> sys.stderr, \"Error: deleting\", fn\n\n if f == index_fn and islink(fn):\n os.unlink(fn)","def cleanup(self):\n if os.path.exists(self.tgzfile):\n os.remove(self.tgzfile)\n\n if os.path.exists(self.dirname):\n shutil.rmtree(self.dirname)","def clean():\n for root, dirs, files in os.walk('.'):\n for item in dirs:\n if (item[0]!='.'):\n try:\n os.remove(os.path.join(item,'.DS_Store'))\n except:\n pass","def clean():\n for f in [f for f in os.listdir() if f.endswith(\".part\")]:\n os.remove(f)","def clean(session):\n clean_dirs = (\n get_path(\".cache\"),\n get_path(\".coverage\"),\n get_path(\".pytest_cache\"),\n get_path(\"__pycache__\"),\n get_path(\"build\"),\n get_path(\"dist\"),\n get_path(\"docs\", \"__pycache__\"),\n get_path(\"docs\", \"build\"),\n get_path(\"scripts\", \"macos\", \"__pycache__\"),\n get_path(\"src\", \"python\", \"bezier.egg-info\"),\n get_path(\"src\", \"python\", \"bezier\", \"__pycache__\"),\n get_path(\"tests\", \"__pycache__\"),\n get_path(\"tests\", \"functional\", \"__pycache__\"),\n get_path(\"tests\", \"unit\", \"__pycache__\"),\n get_path(\"tests\", \"unit\", \"hazmat\", \"__pycache__\"),\n get_path(\"wheelhouse\"),\n )\n clean_globs = (\n get_path(\".coverage\"),\n get_path(\"*.mod\"),\n get_path(\"*.pyc\"),\n get_path(\"docs\", \"abi\", \"example\"),\n get_path(\"src\", \"python\", \"bezier\", \"*.pyc\"),\n get_path(\"src\", \"python\", \"bezier\", \"*.pyd\"),\n get_path(\"src\", \"python\", \"bezier\", \"*.so\"),\n get_path(\"src\", \"fortran\", \"*.o\"),\n get_path(\"tests\", \"*.pyc\"),\n get_path(\"tests\", \"functional\", \"*.pyc\"),\n get_path(\"tests\", \"unit\", \"*.pyc\"),\n )\n for dir_path in clean_dirs:\n session.run(shutil.rmtree, dir_path, ignore_errors=True)\n for glob_path in clean_globs:\n for filename in glob.glob(glob_path):\n session.run(os.remove, filename)","def clean():\n sudo(\"rm -rf %(admin_webroot)s\" % env)","def clean(ctx):\n ctx.run('rm -rf {dir}'.format(dir=ctx.build_dir.debian_dir))\n ctx.run('rm -rf {dir}'.format(dir=ctx.build_dir.dist_dir))\n ctx.run('rm -rf {dir}'.format(dir=DEBIAN_DPKG_DIR))","def _cleanup(self):\n os.system(\"rm -r %s/*\" %(self._snippet_index_dir))\n os.system(\"rm %s/*\" %(self._para_dir))\n os.system(\"rm %s/*\" %(self._temp_dir))\n os.system(\"rm %s/*\" %(self._snippet_result_dir))","def clean(ctx):\n logger = logging.getLogger(__name__)\n\n root_project_dir = discover_conf_py_directory(ctx.obj[\"root_project_dir\"])\n dirnames = [\"py-api\", \"_build\", \"modules\", \"packages\", \"_doxygen\"]\n dirnames = [\n os.path.join(root_project_dir, dirname) for dirname in dirnames\n ]\n for dirname in dirnames:\n if os.path.isdir(dirname):\n shutil.rmtree(dirname)\n logger.debug(\"Cleaned up %r\", dirname)\n else:\n logger.debug(\"Did not clean up %r (missing)\", dirname)","def clean():\n possible_outputs = (\n '{}.html'.format(CONFIG['FULL_PROJECT_NAME']),\n '{}.epub'.format(CONFIG['FULL_PROJECT_NAME']),\n '{}.pdf'.format(CONFIG['FULL_PROJECT_NAME']),\n '{}.docx'.format(CONFIG['FULL_PROJECT_NAME']),\n '{}.odt'.format(CONFIG['FULL_PROJECT_NAME']),\n )\n\n for filename in possible_outputs:\n if os.path.exists(filename):\n os.remove(filename)\n print(\"Removed {}\".format(filename))","def cleanup(self):\n\n # check if the directory exists\n if not os.path.exists(self.path):\n return\n\n # check if the directory is a directory\n if not os.path.isdir(self.path):\n return\n\n # loop over content of directory and remove it\n for the_file in os.listdir(self.path):\n file_path = os.path.join(self.path, the_file)\n try:\n if os.path.isfile(file_path):\n os.unlink(file_path)\n elif os.path.isdir(file_path):\n shutil.rmtree(file_path)\n except Exception as e:\n pass","def scrub():\n\n\tlocal(\"rm -fr dist build\")\n\tlocal(\"find . -name \\\"*.pyc\\\" -exec rm '{}' ';'\")","def cleanup() -> None:\n\n for fname in glob(os.path.join(tdir, 'alexandria.*')):\n if os.path.splitext(fname)[1] not in {'.c', '.h'}:\n os.unlink(fname)","def clean_directory():\n print(\"INFO: Cleaning old files...\")\n if os.path.exists(os.path.join(os.path.dirname(__file__), 'Scripts')):\n try:\n shutil.rmtree(os.path.join(os.path.dirname(__file__), 'Scripts'))\n except OSError as error:\n print(\"Error: %s - %s.\" % (error.filename, error.strerror))","def cleanup(self):\n\n if self.debug:\n print 'Running cleanup()'\n print 'Starting removing dead links'\n\n for root, dirs, files in os.walk(self.tags_folder):\n if files:\n for f in files:\n try:\n full_path = os.path.join(root, f)\n if not os.path.exists(os.readlink(full_path)):\n os.unlink(full_path)\n if self.debug:\n print 'Removing dead link %s' % full_path\n except OSError:\n pass\n\n if self.debug:\n print 'Starting removing empty directories'\n self._del_empty_dirs(self.tags_folder)","def clearRunDirectory(self):\n for root, dirs, files in os.walk(self.run_dir, topdown=False):\n for name in files:\n if name.lower().endswith(('.cps', '.txt', '.sbml', '.csv')):\n os.remove(os.path.join(root, name))\n for name in dirs:\n if len(os.listdir(os.path.join(root, name)))==0:\n os.rmdir(os.path.join(root, name))","def html():\n builtdocs = path(\"docs\") / options.sphinx.builddir / \"html\"\n destdir = path(PACKAGE) / \"docs\"\n destdir.rmtree()\n builtdocs.move(destdir)","def delete_tempdirs(self):\n\n if self._noWebDir:\n shutil.rmtree(self.webTopDir)","def purge_downloaded_files():\n for fpath in DOWNLOADED_FILEPATHS:\n if os.path.exists(fpath):\n os.remove(fpath)","def _clean_workdir(self):\n\t\ttoremove = [self._get_config_filepath(), self._get_params_filepath(), self._get_conv_filepath(), self._get_psf_filepath()]\n\t\tfor filepath in toremove:\n\t\t\tif os.path.exists(filepath):\t\n\t\t\t\tlogger.debug(\"Removing existing file %s...\" % (filepath))\n\t\t\t\tos.remove(filepath)","def clean_filesystem(files=[]):\n remove_files(files + find_cache_files())","def __del__(self):\n shutil.rmtree(self.epub_dir)","def devclean():\n click.echo(\"start clean your output folder...\")\n rm(OUTPUTDIR, recursive=True)","def deleteIndexFileIfExists(self):\n try:\n os.remove(self.dir+'/index.html')\n except OSError:\n pass","def clear_debug_files(root_path_):\n\n ext_file = [\n \".sdf\",\n \".VC.db\",\n \".idb\",\n \".exp\",\n \".aps\",\n \".pdb\",\n \".obj\",\n \".res\",\n \".log\",\n \".tlog\",\n \".manifest\",\n \".lastbuildstate\",\n \".pch\",\n \".ipch\",\n \".cache\",\n \".ilk\",\n \".ipdb\",\n \".iobj\",\n \".aps\",\n ]\n\n ext_dir = [\n \"ipch\",\n\n ]\n if os.path.exists(root_path_):\n for root, dirs, files in os.walk(root_path_, topdown=True):\n for file in files:\n filename = os.path.join(root, file)\n delete_file(filename, ext_file)\n \n for dir in dirs:\n dir_path = os.path.join(root, dir)\n if dir.lower() in ext_dir:\n print(dir_path);\n shutil.rmtree(dir_path)\n\n for a_dir in ext_dir:\n path = os.path.join(root_path_, a_dir)\n if os.path.exists(path):\n shutil.rmtree(path)","def tearDown(self):\n for fn in self.tempImages:\n os.remove(os.path.join(self.root, fn))\n os.rmdir(self.root)","def clean():\n if os.path.exists('_build'):\n shutil.rmtree('_build')","def cleanUp(self):\n import evoware.fileutil as F\n F.tryRemove(self.f_project, verbose=(self.VERBOSITY>1), tree=1)","def clean():\n folders = ['utils_dfn/temp', 'utils_dfn/img', 'utils_dfn/mask', 'utils_dfn/output']\n for folder in folders:\n for item in os.listdir(folder):\n item_path = os.path.join(folder, item)\n if os.path.isdir(item_path):\n shutil.rmtree(item_path)\n elif os.path.isfile(item_path):\n os.remove(item_path)","def clean(ctx):\n header(clean.__doc__)\n with ctx.cd(ROOT):\n for pattern in CLEAN_PATTERNS:\n info(\"Removing {0}\", pattern)\n ctx.run(\"rm -rf {0}\".format(pattern))","def cleanDataDir(self):\n for strFile in os.listdir(self.strDataDir):\n os.remove(os.path.join(self.strDataDir, strFile))","def _clean_up_optimization():\n for (root, dirs, files) in walk(TEMP_MODULES_DIR_PATH, topdown=False):\n for file in files:\n if file.startswith(\"__temp_\"):\n remove(f\"{root}/{file}\")\n try:\n rmdir(root)\n except OSError:\n G.warn_(f\"Unidentified file found in temporary directory: {root}\")","def removeTmpDirs():\n p = Path(\".\")\n eggDirs = [x for x in p.glob(\"*.egg-info\") if x.is_dir()]\n eggDirs.append(Path(\"build\"))\n\n for d in eggDirs:\n if d.is_dir():\n shutil.rmtree(d)","def _clean(base_dir):\n # remove the snakemake cache\n shutil.rmtree(os.path.join(base_dir, \".snakemake\"), ignore_errors=True)\n\n # remove seq2science caches\n shutil.rmtree(os.path.expanduser(os.path.join(xdg.XDG_CACHE_HOME, \"seq2science\")), ignore_errors=True)\n\n # remove historic seq2science cache location\n shutil.rmtree(os.path.expanduser(f\"~/.config/seq2science/\"), ignore_errors=True)\n\n print(\"All cleaned up!\")","def clear_local_output_directory():\n output_path = '../output/*'\n files = glob.glob(output_path)\n for single_file in files:\n os.remove(single_file)","def clean_retrosheet_files(self):\n # Get zipped and unzipped folder names\n zippedFileFolder = Filepath.get_retrosheet_folder(folder='zipped')\n unzippedFileFolder = Filepath.get_retrosheet_folder(folder='unzipped')\n\n # Clean out all files in both folders\n for folder in (zippedFileFolder, unzippedFileFolder):\n os.chdir(folder)\n for file in os.listdir(os.getcwd()): \n if os.path.isdir(file): \n shutil.rmtree(file)\n else: \n os.remove(file)","def clean_docs(c):\n c.run(f\"rm -fr {DOCS_BUILD_DIR}\")","def tearDown(self):\n # unittest.TestCase.tearDown(self)\n\n root = os.path.join(\".\", \"files\")\n endingList = os.listdir(root)\n rmList = [fn for fn in endingList if fn not in self.startingList]\n\n if self.oldRoot == root:\n for fn in rmList:\n fnFullPath = os.path.join(root, fn)\n if os.path.isdir(fnFullPath):\n os.rmdir(fnFullPath)\n else:\n os.remove(fnFullPath)\n\n os.chdir(self.oldRoot)","def cleancosmeticdir(rootdir):\n for subdir in [t120.t120_ofst_dir,t120.t120_flat_dir,t120.t120_dark_dir]:\n tocleandir = rootdir + t120.t120_ofst_dir\n t120.log.info('tocleandir: '+tocleandir)\n pattern = tocleandir+'master*.fit*'\n tocleanlist = glob.glob(pattern)\n if len(tocleanlist):\n for tocleanfile in tocleanlist:\n t120.log.info('Now removing file: '+tocleanfile)\n os.remove(tocleanfile)\n return","def _remove_files_dirs(self):\n if self.remove_remote_files_dirs:\n self._remove_remote_files_dirs()","def tearDown(self) -> None:\n filtered = [f for f in glob.glob('steps/tests/test_output/*') if not re.match(r'\\.keep', f)]\n for file in filtered:\n try:\n if Path(file).is_dir():\n shutil.rmtree(file)\n else:\n os.remove(file)\n except PermissionError as pe:\n # We don't necessarily care that much\n continue","def clean(self):\n if self.options.format != 'svg':\n for svgfile in self.svgouts.itervalues():\n os.remove(svgfile)\n os.rmdir(self.tmpdir)","def cleanup(destination_subdir):\n sp.check_call(f\"rm {destination_subdir}/*.bam\", shell=True)\n sp.check_call(f\"rm {destination_subdir}/*.sam\", shell=True)\n sp.check_call(f\"rm -rf ./index_files\", shell=True)","def __remove_base_directory__():\n p = subprocess.Popen('rm -rf {}/.wcscanner'.format(context.__BASE_PATH__), shell=True)\n p.wait()","def cleanup_files(self):\n\n self.backup_files()\n self.delete_files()","def clean_target_pages_dir():\n if not os.path.exists(target_pages_dir):\n os.makedirs(target_pages_dir)\n else:\n shutil.rmtree(target_pages_dir)\n os.mkdir(target_pages_dir)","def clean_cwd():\n\n # Generator of the files generated for each runs\n del_files = (file for file in os.listdir() if file.endswith('.vtk')\n or file.endswith('.dat')\n or file.startswith('eeldata')\n or file.endswith('.log'))\n\n for file in del_files:\n try:\n os.remove(file)\n print(\"\\rRemoved {:s} succesfully!\".format(file), end=' '*15)\n except:\n print(\"\\rFailed to remove {:s}\".format(file))\n raise\n\n print('')","def purge(root=os.path.join(\"~\", \".daisykit\", \"assets\")):\n root = os.path.expanduser(root)\n files = os.listdir(root)\n for f in files:\n if f.endswith(\".params\"):\n os.remove(os.path.join(root, f))","def removeEmpties(self,name):\n empties = set()\n projectDir = dirs['installers'].join(name)\n for asDir,sDirs,sFiles in os.walk(projectDir.s):\n if not (sDirs or sFiles): empties.add(GPath(asDir))\n for empty in empties: empty.removedirs()\n projectDir.makedirs() #--In case it just got wiped out.","def clean_up_temp_dir():\n files = glob.glob(f'{CONFIG_DIR}/tmp/*')\n for f in files:\n try:\n os.remove(f)\n except Exception:\n pass","def tearDown(self):\n if self.rootdir and os.path.exists(self.rootdir):\n shutil.rmtree(self.rootdir)","def clear(self, exclude=None):\n exclude = exclude or []\n for root, dirs, files in os.walk(self.config.output_dir):\n for f in files:\n if f not in exclude:\n os.unlink(os.path.join(root, f))\n for d in dirs:\n if d not in exclude:\n shutil.rmtree(os.path.join(root, d))","def __del__(self):\n shutil.rmtree('tmp')\n self.quit_browser()","def clean(self) -> None:\n if self.out_dir.exists():\n shutil.rmtree(self.out_dir)","def remove(self): \n self.doRoot(self.removeDir)\n settings.getChanged('mosh.resourceReplacer.applied').remove(self.file)","def delete_files_for_package(self, package):\n files = self.find_files_for_package(package, absolute_path=True)\n if not files:\n return\n path = os.path.dirname(files[0])\n for file in files:\n if os.path.exists(file):\n log.debug(\"Removing file '%s'\" % (file))\n os.unlink(file)\n if os.path.isdir(path) and os.listdir(path) == []:\n log.debug(\"Remove empty package repository '%s'\" % (path))\n os.rmdir(path)","def clean_output_folder(output_folder):\n for root, dirs, files in os.walk(output_folder):\n for f in files:\n os.unlink(os.path.join(root, f))\n for d in dirs:\n shutil.rmtree(os.path.join(root, d))","def cleanup(self):\n files = self.nlst()\n latest = self.latest_filename\n for filename in files:\n if filename != latest:\n result = self.delete(filename)\n logger.info(f\"Deleted old export from FTP: {result}\")","def remove(args):\n files = []\n for path in args.files:\n if os.path.isdir(path):\n ft = filetree(path)\n files.extend(ft.filelist())\n else:\n files.append(path)\n for path in files:\n relpath = os.path.normpath(os.path.relpath(path, args.base))\n if relpath in args.cache:\n del args.cache[args.cache.index(relpath)]\n if args.delete and os.path.exists(path):\n os.remove(path)\n args.update = True\n return","def clean(self):\n print(\"Cleaning outputs in %s\" % self.args.output)\n files = glob.glob(self.args.output + \"*.pkl\")\n for f in files:\n if os.path.exists(f):\n os.remove(f)","def compress_html():\n if not os.path.exists(PATH_HTML):\n os.makedirs(PATH_HTML)\n os.chdir(PATH_HTML)\n try:\n zip_csv = ZipFile(SITE_NAME + '_' + DATE + '_html.zip', 'a')\n for file in glob.glob(\"*\" + DATE + \"*\" + \"html\"):\n zip_csv.write(file)\n os.remove(file)\n log.info(\"Compressing HTML files\")\n except Exception as e:\n log.error('Error when compressing html')\n log.info(type(e).__name__ + str(e))\n os.chdir(PROJECT_PATH)","def cleanup():\n if len(env.releases) > 3:\n directories = env.releases\n directories.reverse()\n del directories[:3]\n env.directories = ' '.join([ '%(releases_path)s/%(release)s' % { 'releases_path':env.releases_path, 'release':release } for release in directories ])\n run('rm -rf %(directories)s' % env)","def clear(self, cacheDir):","def cleanUp(self):\r\n remove_files(self._db_files_to_remove, error_on_missing=False)","def _delete_data (self, path):\n head, tail = os.path.split(path)\n for subdir, dirs, files in os.walk(head):\n for file in files:\n if tail in file:\n os.remove(os.path.join(subdir, file))","def clean(ctx, so=False, cache=False):\n for name in ctx.shell.files('.', '.coverage*', recursive=False):\n ctx.shell.rm(name)\n for name in ctx.shell.files('bench', '.out.*', recursive=False):\n ctx.shell.rm(name)\n ctx.shell.rm_rf(\n 'docs/coverage',\n 'docs/gcov',\n 'build',\n 'dist',\n 'wheel/dist',\n ctx.doc.userdoc,\n 'docs/_userdoc/_build',\n ctx.doc.website.source,\n ctx.doc.website.target,\n )\n if cache:\n cacheclean(ctx)\n if so:\n soclean(ctx)","def clean_files(self):\n self.filenames.clear()","def tearDown(self):\n rmtree(getcwd(), ignore_errors=True)","def tearDown(self):\n rmtree(getcwd(), ignore_errors=True)","def clean_all_folder():\n LOGGER.warning('removal of old files has been temporarily disabled')\n # paths_to_clean = CFG.remove_files\n # if paths_to_clean: # pylint: disable=using-constant-test\n # for remove_config in paths_to_clean: # pylint: disable=not-an-iterable\n # name = tuple(remove_config.keys())[0]\n # LOGGER.info(f'processing: {name}')\n # remove_config = remove_config[name]\n # if 'folder' not in remove_config.keys():\n # LOGGER.error(f'missing \"folder\" in {name}')\n # return\n # if 'age' not in remove_config.keys():\n # LOGGER.error(f'missing \"age\" in {name}')\n # return\n # if not os.path.exists(remove_config['folder']):\n # LOGGER.error(f'path does not exist: {remove_config[\"folder\"]}')\n # return\n # _remove_old_files_from_folder(**remove_config)\n # else:\n # LOGGER.debug('no folder to clean')","def remover_files():\n directory = os.getcwd()\n for file_name in glob.glob((\"{}/tmp/*\").format(directory)):\n remove(file_name)","def reset():\n local('cd {{ project_name }} && \\\n rm -rf static && rm -rf gzip && rm -rf build')","def cleanup_step(self):\n self.clean_home_subdir()\n\n super(IntelBase, self).cleanup_step()","def remove_dir_content(path):\n for item in os.listdir(path):\n p = os.path.join(path, item)\n if os.path.isdir(p):\n shutil.rmtree(p)\n else:\n os.unlink(p)","def delete_previous_files(schema_name, path_template, path_static):\n list_file_static = listdir(path_static)\n list_file_template = listdir(path_template)\n if schema_name in list_file_static:\n tree_path = path.join(path_static, schema_name)\n rmtree(tree_path, ignore_errors=True)\n html_file_name = \"wrap_\" + schema_name + \".html\"\n if html_file_name in list_file_template:\n html_file_path = path.join(path_template, html_file_name)\n remove(html_file_path)","def clean_local():\n local('rm -fr build')\n local('mkdir -p build')","def cleanup(self):\n\n print \"Cleaning up...\",\n sys.stdout.flush()\n\n builddir = os.path.join(self.build)\n\n comm = 'rm -rf '+builddir\n #+' '+libdir+' '+logdir\n (output, error, retz) = runShellCommand(comm)\n\n print \"done.\""],"string":"[\n \"def clean(ctx):\\n ctx.run(\\\"rm -rf build/html\\\")\",\n \"def cleanup():\\n download_dir = settings.DOWNLOAD_BASE_DIR\\n\\n for base, dirs, files in os.walk(download_dir):\\n for dir in dirs:\\n shutil.rmtree(download_dir + dir)\",\n \"def _cleanup_files(self):\\n\\n for root, dirs, files in os.walk(self.build_directory):\\n dirs_to_delete = [\\n Path(root).joinpath(x) for x in dirs if x == '__pycache__'\\n ]\\n files_to_delete = [\\n Path(root).joinpath(x) for x in files if Path(x).suffix == '.pyc'\\n ]\\n for d in dirs_to_delete:\\n logger.info('Deleting: %s', d)\\n shutil.rmtree(d)\\n for f in files_to_delete:\\n logger.info('Deleting: %s', f)\\n f.unlink()\",\n \"def html_clean(options):\\r\\n remake_directories(options.sphinx.doctrees, options.html.outdir)\\r\\n html(options)\\r\\n return\",\n \"def clean():\\n for dirpath, dirnames, filenames in os.walk('.'):\\n for filename in filenames:\\n if filename.endswith('.pyc') or filename.endswith('.pyo'):\\n full_pathname = os.path.join(dirpath, filename)\\n click.echo('Removing {}'.format(full_pathname))\\n os.remove(full_pathname)\",\n \"def clean(self):\\n if os.path.exists(self.paths['build_dir']):\\n shutil.rmtree(self.paths['build_dir'])\\n if os.path.exists(os.path.join(self.base_dir, 'docs')):\\n shutil.rmtree(os.path.join(self.base_dir, 'docs'))\",\n \"def tearDown(self):\\n for root, dirs, files in os.walk(TEMPDIR, topdown=False):\\n for name in files:\\n os.remove(os.path.join(root, name))\\n for name in dirs:\\n os.rmdir(os.path.join(root, name))\\n os.rmdir(root)\",\n \"def clean():\\n clean_files()\",\n \"def purge_files(self):\\n run_keyword(\\\"Purge Server Configuration\\\")\\n run_keyword(\\\"Purge Cache Manager Configuration\\\")\\n # TODO: Probably the only sane way to do this is to call\\n # a helper script which runs as root.\\n # run_keyword(\\\"Purge Cache\\\")\\n valid = r'/vicep([a-z]|[a-h][a-z]|i[a-v])$'\\n for vicep in glob.glob(\\\"/vicep*\\\"):\\n if re.match(valid, vicep) and os.path.isdir(vicep):\\n run_keyword(\\\"Purge Directory\\\", \\\"%s/AFSIDat\\\" % vicep)\\n run_keyword(\\\"Purge Directory\\\", \\\"%s/Lock\\\" % vicep)\\n for vheader in glob.glob(\\\"%s/V*.vol\\\" % vicep):\\n run_keyword(\\\"Sudo\\\", \\\"rm -f %s\\\" % vheader)\",\n \"def purge_cache():\\n for (dir_path, dir_names, file_names) in os.walk(CACHE, topdown=False):\\n for file_name in file_names:\\n if is_json_file(file_name):\\n path = os.path.join(dir_path, file_name)\\n print(\\\"Removing file “%s”\\\" % path)\\n os.remove(path)\\n for directory in dir_names:\\n path = os.path.join(dir_path, directory)\\n if not os.listdir(path):\\n print(\\\"Removing directory “%s”\\\" % path)\\n os.rmdir(path)\",\n \"def cleanDirecs(rootDir):\\n for root, dirs, files in os.walk(rootDir, topdown=False):\\n \\n if not files:\\n if not dirs:\\n print(\\\"Removing {0}\\\".format(root))\\n os.rmdir(os.path.join(rootDir, root))\",\n \"def clear_data():\\n dir_list = [\\\"generated/*\\\", \\\"pub/static/*\\\", \\\"var/cache/*\\\", \\\"var/page_cache/*\\\", \\\"var/view_preprocessed/*\\\", \\\"var/tmp/*\\\"]\\n\\n for item in dir_list:\\n print(\\\"[ - ] Removing\\\", item, \\\"\\\\n\\\")\\n subprocess.run([\\\"rm\\\", \\\"-rf\\\", item])\",\n \"def cleanup_intermediate_files():\\n\\n dirs = (DIR_PAGE, DIR_SRGB, DIR_VTI, DIR_TIFF, DIR_BACK, DIR_TEXT)\\n map(lambda dir: shutil.rmtree(os.path.join(cwd, dir)) , dirs)\",\n \"def clean_home_subdir(self):\\n\\n self.log.debug(\\\"Cleaning up %s...\\\" % self.home_subdir_local)\\n try:\\n for tree in os.listdir(self.home_subdir_local):\\n self.log.debug(\\\"... removing %s subtree\\\" % tree)\\n path = os.path.join(self.home_subdir_local, tree)\\n if os.path.isfile(path):\\n os.remove(path)\\n else:\\n shutil.rmtree(path)\\n except OSError, err:\\n self.log.error(\\\"Cleaning up intel dir %s failed: %s\\\" % (self.home_subdir_local, err))\",\n \"def _cleanPackageDir(self, *_):\\r\\n for _, path in self._pkgDir:\\r\\n os.rmdir(os.path.join(self._rootfs, path))\\r\\n\\r\\n assert len(self._containers) == 0\",\n \"def clean():\\n print(\\\"\\\\nCleaning the site from {}\\\\n\\\".format(_site_dest))\\n rm(_site_dest)\",\n \"def _clean_bins():\\n rmtree(LIBS_DIR)\\n rmtree(BINS_DIR)\\n rmtree(HEADERS_DIR)\",\n \"def purge():\\n all_hashes = read_all()\\n used_hashes = read_used()\\n\\n for kind, hashes in used_hashes.items():\\n to_remove = all_hashes[kind].difference(hashes)\\n if kind == 'evs':\\n delete_from_directory_by_hashes(EV_DIRECTORY, to_remove)\\n elif kind == 'cache':\\n delete_from_directory_by_hashes(CACHE_DIRECTORY, to_remove)\\n elif kind == 'seeds':\\n delete_from_directory_by_hashes(SEED_DIRECTORY, to_remove)\\n\\n reset_used()\",\n \"def clean_build(c):\\n c.run(\\\"rm -fr build/\\\")\\n c.run(\\\"rm -fr dist/\\\")\\n c.run(\\\"rm -fr xmlstarlet/config.h \\\" \\\"xmlstarlet/Makefile \\\" \\\"xmlstarlet/config.status\\\")\\n c.run(\\\"rm -fr .eggs/\\\")\\n c.run(\\\"find . -name '*.egg-info' -exec rm -fr {} +\\\")\\n c.run(\\\"find . -name '*.egg' -exec rm -f {} +\\\")\",\n \"def clean(self):\\n original_dir = os.getcwd()\\n os.chdir(self.output)\\n\\n # Clear out directory\\n file_list = os.listdir(self.output)\\n\\n for afile in file_list:\\n if not afile.endswith('.gitignore'):\\n path = os.path.join(self.output, afile)\\n if os.path.isdir(path):\\n rmtree(path)\\n else:\\n os.remove(path)\\n os.chdir(original_dir)\",\n \"def clean_build(context):\\n context.run(\\\"rm -fr build/\\\")\\n context.run(\\\"rm -fr dist/\\\")\\n context.run(\\\"rm -fr .eggs/\\\")\\n context.run(\\\"find . -name '*.egg-info' -exec rm -fr {} +\\\")\\n context.run(\\\"find . -name '*.egg' -exec rm -f {} +\\\")\",\n \"def clean(self) -> None:\\n # remove all *.py and *.pyi files in the folder\\n for wc in [\\\"*.py\\\", \\\"*.pyi\\\", \\\"modules.json\\\"]:\\n for f in (self.package_path).rglob(wc):\\n f.unlink()\",\n \"def clean_data():\\n for clean_file in clean_files:\\n file_list = [f for f in os.listdir(\\\".\\\") if f.endswith(clean_file)]\\n for f in file_list:\\n os.remove(f)\",\n \"def clean(allimages, alldirs):\\n\\n for img in allimages:\\n # Delete HTML files\\n htmlfn = join(opts.root, img._dir._path, img._pagefn)\\n if exists(htmlfn):\\n if opts.verbose:\\n print \\\"Deleting\\\", htmlfn\\n try:\\n os.unlink(htmlfn)\\n except:\\n print >> sys.stderr, \\\"Error: deleting\\\", htmlfn\\n\\n # Delete thumbnails\\n if img._thumbfn:\\n thumbfn = join(opts.root, img._thumbfn)\\n if exists(thumbfn):\\n if opts.verbose:\\n print \\\"Deleting\\\", thumbfn\\n try:\\n os.unlink(thumbfn)\\n img._thumbfn = None\\n except:\\n print >> sys.stderr, \\\"Error: deleting\\\", thumbfn\\n\\n for d in alldirs:\\n files = dircache.listdir(join(opts.root, d._path))\\n\\n # Delete HTML files in directories\\n for f in files:\\n fn = join(opts.root, d._path, f)\\n if f in [ dirindex_fn, allindex_fn, allcidx_fn,\\n sortindex_fn, css_fn ] or \\\\\\n f.startswith('trackindex-'):\\n if opts.verbose:\\n print \\\"Deleting\\\", fn\\n try:\\n os.unlink(fn)\\n pass\\n except:\\n print >> sys.stderr, \\\"Error: deleting\\\", fn\\n\\n if f == index_fn and islink(fn):\\n os.unlink(fn)\",\n \"def cleanup(self):\\n if os.path.exists(self.tgzfile):\\n os.remove(self.tgzfile)\\n\\n if os.path.exists(self.dirname):\\n shutil.rmtree(self.dirname)\",\n \"def clean():\\n for root, dirs, files in os.walk('.'):\\n for item in dirs:\\n if (item[0]!='.'):\\n try:\\n os.remove(os.path.join(item,'.DS_Store'))\\n except:\\n pass\",\n \"def clean():\\n for f in [f for f in os.listdir() if f.endswith(\\\".part\\\")]:\\n os.remove(f)\",\n \"def clean(session):\\n clean_dirs = (\\n get_path(\\\".cache\\\"),\\n get_path(\\\".coverage\\\"),\\n get_path(\\\".pytest_cache\\\"),\\n get_path(\\\"__pycache__\\\"),\\n get_path(\\\"build\\\"),\\n get_path(\\\"dist\\\"),\\n get_path(\\\"docs\\\", \\\"__pycache__\\\"),\\n get_path(\\\"docs\\\", \\\"build\\\"),\\n get_path(\\\"scripts\\\", \\\"macos\\\", \\\"__pycache__\\\"),\\n get_path(\\\"src\\\", \\\"python\\\", \\\"bezier.egg-info\\\"),\\n get_path(\\\"src\\\", \\\"python\\\", \\\"bezier\\\", \\\"__pycache__\\\"),\\n get_path(\\\"tests\\\", \\\"__pycache__\\\"),\\n get_path(\\\"tests\\\", \\\"functional\\\", \\\"__pycache__\\\"),\\n get_path(\\\"tests\\\", \\\"unit\\\", \\\"__pycache__\\\"),\\n get_path(\\\"tests\\\", \\\"unit\\\", \\\"hazmat\\\", \\\"__pycache__\\\"),\\n get_path(\\\"wheelhouse\\\"),\\n )\\n clean_globs = (\\n get_path(\\\".coverage\\\"),\\n get_path(\\\"*.mod\\\"),\\n get_path(\\\"*.pyc\\\"),\\n get_path(\\\"docs\\\", \\\"abi\\\", \\\"example\\\"),\\n get_path(\\\"src\\\", \\\"python\\\", \\\"bezier\\\", \\\"*.pyc\\\"),\\n get_path(\\\"src\\\", \\\"python\\\", \\\"bezier\\\", \\\"*.pyd\\\"),\\n get_path(\\\"src\\\", \\\"python\\\", \\\"bezier\\\", \\\"*.so\\\"),\\n get_path(\\\"src\\\", \\\"fortran\\\", \\\"*.o\\\"),\\n get_path(\\\"tests\\\", \\\"*.pyc\\\"),\\n get_path(\\\"tests\\\", \\\"functional\\\", \\\"*.pyc\\\"),\\n get_path(\\\"tests\\\", \\\"unit\\\", \\\"*.pyc\\\"),\\n )\\n for dir_path in clean_dirs:\\n session.run(shutil.rmtree, dir_path, ignore_errors=True)\\n for glob_path in clean_globs:\\n for filename in glob.glob(glob_path):\\n session.run(os.remove, filename)\",\n \"def clean():\\n sudo(\\\"rm -rf %(admin_webroot)s\\\" % env)\",\n \"def clean(ctx):\\n ctx.run('rm -rf {dir}'.format(dir=ctx.build_dir.debian_dir))\\n ctx.run('rm -rf {dir}'.format(dir=ctx.build_dir.dist_dir))\\n ctx.run('rm -rf {dir}'.format(dir=DEBIAN_DPKG_DIR))\",\n \"def _cleanup(self):\\n os.system(\\\"rm -r %s/*\\\" %(self._snippet_index_dir))\\n os.system(\\\"rm %s/*\\\" %(self._para_dir))\\n os.system(\\\"rm %s/*\\\" %(self._temp_dir))\\n os.system(\\\"rm %s/*\\\" %(self._snippet_result_dir))\",\n \"def clean(ctx):\\n logger = logging.getLogger(__name__)\\n\\n root_project_dir = discover_conf_py_directory(ctx.obj[\\\"root_project_dir\\\"])\\n dirnames = [\\\"py-api\\\", \\\"_build\\\", \\\"modules\\\", \\\"packages\\\", \\\"_doxygen\\\"]\\n dirnames = [\\n os.path.join(root_project_dir, dirname) for dirname in dirnames\\n ]\\n for dirname in dirnames:\\n if os.path.isdir(dirname):\\n shutil.rmtree(dirname)\\n logger.debug(\\\"Cleaned up %r\\\", dirname)\\n else:\\n logger.debug(\\\"Did not clean up %r (missing)\\\", dirname)\",\n \"def clean():\\n possible_outputs = (\\n '{}.html'.format(CONFIG['FULL_PROJECT_NAME']),\\n '{}.epub'.format(CONFIG['FULL_PROJECT_NAME']),\\n '{}.pdf'.format(CONFIG['FULL_PROJECT_NAME']),\\n '{}.docx'.format(CONFIG['FULL_PROJECT_NAME']),\\n '{}.odt'.format(CONFIG['FULL_PROJECT_NAME']),\\n )\\n\\n for filename in possible_outputs:\\n if os.path.exists(filename):\\n os.remove(filename)\\n print(\\\"Removed {}\\\".format(filename))\",\n \"def cleanup(self):\\n\\n # check if the directory exists\\n if not os.path.exists(self.path):\\n return\\n\\n # check if the directory is a directory\\n if not os.path.isdir(self.path):\\n return\\n\\n # loop over content of directory and remove it\\n for the_file in os.listdir(self.path):\\n file_path = os.path.join(self.path, the_file)\\n try:\\n if os.path.isfile(file_path):\\n os.unlink(file_path)\\n elif os.path.isdir(file_path):\\n shutil.rmtree(file_path)\\n except Exception as e:\\n pass\",\n \"def scrub():\\n\\n\\tlocal(\\\"rm -fr dist build\\\")\\n\\tlocal(\\\"find . -name \\\\\\\"*.pyc\\\\\\\" -exec rm '{}' ';'\\\")\",\n \"def cleanup() -> None:\\n\\n for fname in glob(os.path.join(tdir, 'alexandria.*')):\\n if os.path.splitext(fname)[1] not in {'.c', '.h'}:\\n os.unlink(fname)\",\n \"def clean_directory():\\n print(\\\"INFO: Cleaning old files...\\\")\\n if os.path.exists(os.path.join(os.path.dirname(__file__), 'Scripts')):\\n try:\\n shutil.rmtree(os.path.join(os.path.dirname(__file__), 'Scripts'))\\n except OSError as error:\\n print(\\\"Error: %s - %s.\\\" % (error.filename, error.strerror))\",\n \"def cleanup(self):\\n\\n if self.debug:\\n print 'Running cleanup()'\\n print 'Starting removing dead links'\\n\\n for root, dirs, files in os.walk(self.tags_folder):\\n if files:\\n for f in files:\\n try:\\n full_path = os.path.join(root, f)\\n if not os.path.exists(os.readlink(full_path)):\\n os.unlink(full_path)\\n if self.debug:\\n print 'Removing dead link %s' % full_path\\n except OSError:\\n pass\\n\\n if self.debug:\\n print 'Starting removing empty directories'\\n self._del_empty_dirs(self.tags_folder)\",\n \"def clearRunDirectory(self):\\n for root, dirs, files in os.walk(self.run_dir, topdown=False):\\n for name in files:\\n if name.lower().endswith(('.cps', '.txt', '.sbml', '.csv')):\\n os.remove(os.path.join(root, name))\\n for name in dirs:\\n if len(os.listdir(os.path.join(root, name)))==0:\\n os.rmdir(os.path.join(root, name))\",\n \"def html():\\n builtdocs = path(\\\"docs\\\") / options.sphinx.builddir / \\\"html\\\"\\n destdir = path(PACKAGE) / \\\"docs\\\"\\n destdir.rmtree()\\n builtdocs.move(destdir)\",\n \"def delete_tempdirs(self):\\n\\n if self._noWebDir:\\n shutil.rmtree(self.webTopDir)\",\n \"def purge_downloaded_files():\\n for fpath in DOWNLOADED_FILEPATHS:\\n if os.path.exists(fpath):\\n os.remove(fpath)\",\n \"def _clean_workdir(self):\\n\\t\\ttoremove = [self._get_config_filepath(), self._get_params_filepath(), self._get_conv_filepath(), self._get_psf_filepath()]\\n\\t\\tfor filepath in toremove:\\n\\t\\t\\tif os.path.exists(filepath):\\t\\n\\t\\t\\t\\tlogger.debug(\\\"Removing existing file %s...\\\" % (filepath))\\n\\t\\t\\t\\tos.remove(filepath)\",\n \"def clean_filesystem(files=[]):\\n remove_files(files + find_cache_files())\",\n \"def __del__(self):\\n shutil.rmtree(self.epub_dir)\",\n \"def devclean():\\n click.echo(\\\"start clean your output folder...\\\")\\n rm(OUTPUTDIR, recursive=True)\",\n \"def deleteIndexFileIfExists(self):\\n try:\\n os.remove(self.dir+'/index.html')\\n except OSError:\\n pass\",\n \"def clear_debug_files(root_path_):\\n\\n ext_file = [\\n \\\".sdf\\\",\\n \\\".VC.db\\\",\\n \\\".idb\\\",\\n \\\".exp\\\",\\n \\\".aps\\\",\\n \\\".pdb\\\",\\n \\\".obj\\\",\\n \\\".res\\\",\\n \\\".log\\\",\\n \\\".tlog\\\",\\n \\\".manifest\\\",\\n \\\".lastbuildstate\\\",\\n \\\".pch\\\",\\n \\\".ipch\\\",\\n \\\".cache\\\",\\n \\\".ilk\\\",\\n \\\".ipdb\\\",\\n \\\".iobj\\\",\\n \\\".aps\\\",\\n ]\\n\\n ext_dir = [\\n \\\"ipch\\\",\\n\\n ]\\n if os.path.exists(root_path_):\\n for root, dirs, files in os.walk(root_path_, topdown=True):\\n for file in files:\\n filename = os.path.join(root, file)\\n delete_file(filename, ext_file)\\n \\n for dir in dirs:\\n dir_path = os.path.join(root, dir)\\n if dir.lower() in ext_dir:\\n print(dir_path);\\n shutil.rmtree(dir_path)\\n\\n for a_dir in ext_dir:\\n path = os.path.join(root_path_, a_dir)\\n if os.path.exists(path):\\n shutil.rmtree(path)\",\n \"def tearDown(self):\\n for fn in self.tempImages:\\n os.remove(os.path.join(self.root, fn))\\n os.rmdir(self.root)\",\n \"def clean():\\n if os.path.exists('_build'):\\n shutil.rmtree('_build')\",\n \"def cleanUp(self):\\n import evoware.fileutil as F\\n F.tryRemove(self.f_project, verbose=(self.VERBOSITY>1), tree=1)\",\n \"def clean():\\n folders = ['utils_dfn/temp', 'utils_dfn/img', 'utils_dfn/mask', 'utils_dfn/output']\\n for folder in folders:\\n for item in os.listdir(folder):\\n item_path = os.path.join(folder, item)\\n if os.path.isdir(item_path):\\n shutil.rmtree(item_path)\\n elif os.path.isfile(item_path):\\n os.remove(item_path)\",\n \"def clean(ctx):\\n header(clean.__doc__)\\n with ctx.cd(ROOT):\\n for pattern in CLEAN_PATTERNS:\\n info(\\\"Removing {0}\\\", pattern)\\n ctx.run(\\\"rm -rf {0}\\\".format(pattern))\",\n \"def cleanDataDir(self):\\n for strFile in os.listdir(self.strDataDir):\\n os.remove(os.path.join(self.strDataDir, strFile))\",\n \"def _clean_up_optimization():\\n for (root, dirs, files) in walk(TEMP_MODULES_DIR_PATH, topdown=False):\\n for file in files:\\n if file.startswith(\\\"__temp_\\\"):\\n remove(f\\\"{root}/{file}\\\")\\n try:\\n rmdir(root)\\n except OSError:\\n G.warn_(f\\\"Unidentified file found in temporary directory: {root}\\\")\",\n \"def removeTmpDirs():\\n p = Path(\\\".\\\")\\n eggDirs = [x for x in p.glob(\\\"*.egg-info\\\") if x.is_dir()]\\n eggDirs.append(Path(\\\"build\\\"))\\n\\n for d in eggDirs:\\n if d.is_dir():\\n shutil.rmtree(d)\",\n \"def _clean(base_dir):\\n # remove the snakemake cache\\n shutil.rmtree(os.path.join(base_dir, \\\".snakemake\\\"), ignore_errors=True)\\n\\n # remove seq2science caches\\n shutil.rmtree(os.path.expanduser(os.path.join(xdg.XDG_CACHE_HOME, \\\"seq2science\\\")), ignore_errors=True)\\n\\n # remove historic seq2science cache location\\n shutil.rmtree(os.path.expanduser(f\\\"~/.config/seq2science/\\\"), ignore_errors=True)\\n\\n print(\\\"All cleaned up!\\\")\",\n \"def clear_local_output_directory():\\n output_path = '../output/*'\\n files = glob.glob(output_path)\\n for single_file in files:\\n os.remove(single_file)\",\n \"def clean_retrosheet_files(self):\\n # Get zipped and unzipped folder names\\n zippedFileFolder = Filepath.get_retrosheet_folder(folder='zipped')\\n unzippedFileFolder = Filepath.get_retrosheet_folder(folder='unzipped')\\n\\n # Clean out all files in both folders\\n for folder in (zippedFileFolder, unzippedFileFolder):\\n os.chdir(folder)\\n for file in os.listdir(os.getcwd()): \\n if os.path.isdir(file): \\n shutil.rmtree(file)\\n else: \\n os.remove(file)\",\n \"def clean_docs(c):\\n c.run(f\\\"rm -fr {DOCS_BUILD_DIR}\\\")\",\n \"def tearDown(self):\\n # unittest.TestCase.tearDown(self)\\n\\n root = os.path.join(\\\".\\\", \\\"files\\\")\\n endingList = os.listdir(root)\\n rmList = [fn for fn in endingList if fn not in self.startingList]\\n\\n if self.oldRoot == root:\\n for fn in rmList:\\n fnFullPath = os.path.join(root, fn)\\n if os.path.isdir(fnFullPath):\\n os.rmdir(fnFullPath)\\n else:\\n os.remove(fnFullPath)\\n\\n os.chdir(self.oldRoot)\",\n \"def cleancosmeticdir(rootdir):\\n for subdir in [t120.t120_ofst_dir,t120.t120_flat_dir,t120.t120_dark_dir]:\\n tocleandir = rootdir + t120.t120_ofst_dir\\n t120.log.info('tocleandir: '+tocleandir)\\n pattern = tocleandir+'master*.fit*'\\n tocleanlist = glob.glob(pattern)\\n if len(tocleanlist):\\n for tocleanfile in tocleanlist:\\n t120.log.info('Now removing file: '+tocleanfile)\\n os.remove(tocleanfile)\\n return\",\n \"def _remove_files_dirs(self):\\n if self.remove_remote_files_dirs:\\n self._remove_remote_files_dirs()\",\n \"def tearDown(self) -> None:\\n filtered = [f for f in glob.glob('steps/tests/test_output/*') if not re.match(r'\\\\.keep', f)]\\n for file in filtered:\\n try:\\n if Path(file).is_dir():\\n shutil.rmtree(file)\\n else:\\n os.remove(file)\\n except PermissionError as pe:\\n # We don't necessarily care that much\\n continue\",\n \"def clean(self):\\n if self.options.format != 'svg':\\n for svgfile in self.svgouts.itervalues():\\n os.remove(svgfile)\\n os.rmdir(self.tmpdir)\",\n \"def cleanup(destination_subdir):\\n sp.check_call(f\\\"rm {destination_subdir}/*.bam\\\", shell=True)\\n sp.check_call(f\\\"rm {destination_subdir}/*.sam\\\", shell=True)\\n sp.check_call(f\\\"rm -rf ./index_files\\\", shell=True)\",\n \"def __remove_base_directory__():\\n p = subprocess.Popen('rm -rf {}/.wcscanner'.format(context.__BASE_PATH__), shell=True)\\n p.wait()\",\n \"def cleanup_files(self):\\n\\n self.backup_files()\\n self.delete_files()\",\n \"def clean_target_pages_dir():\\n if not os.path.exists(target_pages_dir):\\n os.makedirs(target_pages_dir)\\n else:\\n shutil.rmtree(target_pages_dir)\\n os.mkdir(target_pages_dir)\",\n \"def clean_cwd():\\n\\n # Generator of the files generated for each runs\\n del_files = (file for file in os.listdir() if file.endswith('.vtk')\\n or file.endswith('.dat')\\n or file.startswith('eeldata')\\n or file.endswith('.log'))\\n\\n for file in del_files:\\n try:\\n os.remove(file)\\n print(\\\"\\\\rRemoved {:s} succesfully!\\\".format(file), end=' '*15)\\n except:\\n print(\\\"\\\\rFailed to remove {:s}\\\".format(file))\\n raise\\n\\n print('')\",\n \"def purge(root=os.path.join(\\\"~\\\", \\\".daisykit\\\", \\\"assets\\\")):\\n root = os.path.expanduser(root)\\n files = os.listdir(root)\\n for f in files:\\n if f.endswith(\\\".params\\\"):\\n os.remove(os.path.join(root, f))\",\n \"def removeEmpties(self,name):\\n empties = set()\\n projectDir = dirs['installers'].join(name)\\n for asDir,sDirs,sFiles in os.walk(projectDir.s):\\n if not (sDirs or sFiles): empties.add(GPath(asDir))\\n for empty in empties: empty.removedirs()\\n projectDir.makedirs() #--In case it just got wiped out.\",\n \"def clean_up_temp_dir():\\n files = glob.glob(f'{CONFIG_DIR}/tmp/*')\\n for f in files:\\n try:\\n os.remove(f)\\n except Exception:\\n pass\",\n \"def tearDown(self):\\n if self.rootdir and os.path.exists(self.rootdir):\\n shutil.rmtree(self.rootdir)\",\n \"def clear(self, exclude=None):\\n exclude = exclude or []\\n for root, dirs, files in os.walk(self.config.output_dir):\\n for f in files:\\n if f not in exclude:\\n os.unlink(os.path.join(root, f))\\n for d in dirs:\\n if d not in exclude:\\n shutil.rmtree(os.path.join(root, d))\",\n \"def __del__(self):\\n shutil.rmtree('tmp')\\n self.quit_browser()\",\n \"def clean(self) -> None:\\n if self.out_dir.exists():\\n shutil.rmtree(self.out_dir)\",\n \"def remove(self): \\n self.doRoot(self.removeDir)\\n settings.getChanged('mosh.resourceReplacer.applied').remove(self.file)\",\n \"def delete_files_for_package(self, package):\\n files = self.find_files_for_package(package, absolute_path=True)\\n if not files:\\n return\\n path = os.path.dirname(files[0])\\n for file in files:\\n if os.path.exists(file):\\n log.debug(\\\"Removing file '%s'\\\" % (file))\\n os.unlink(file)\\n if os.path.isdir(path) and os.listdir(path) == []:\\n log.debug(\\\"Remove empty package repository '%s'\\\" % (path))\\n os.rmdir(path)\",\n \"def clean_output_folder(output_folder):\\n for root, dirs, files in os.walk(output_folder):\\n for f in files:\\n os.unlink(os.path.join(root, f))\\n for d in dirs:\\n shutil.rmtree(os.path.join(root, d))\",\n \"def cleanup(self):\\n files = self.nlst()\\n latest = self.latest_filename\\n for filename in files:\\n if filename != latest:\\n result = self.delete(filename)\\n logger.info(f\\\"Deleted old export from FTP: {result}\\\")\",\n \"def remove(args):\\n files = []\\n for path in args.files:\\n if os.path.isdir(path):\\n ft = filetree(path)\\n files.extend(ft.filelist())\\n else:\\n files.append(path)\\n for path in files:\\n relpath = os.path.normpath(os.path.relpath(path, args.base))\\n if relpath in args.cache:\\n del args.cache[args.cache.index(relpath)]\\n if args.delete and os.path.exists(path):\\n os.remove(path)\\n args.update = True\\n return\",\n \"def clean(self):\\n print(\\\"Cleaning outputs in %s\\\" % self.args.output)\\n files = glob.glob(self.args.output + \\\"*.pkl\\\")\\n for f in files:\\n if os.path.exists(f):\\n os.remove(f)\",\n \"def compress_html():\\n if not os.path.exists(PATH_HTML):\\n os.makedirs(PATH_HTML)\\n os.chdir(PATH_HTML)\\n try:\\n zip_csv = ZipFile(SITE_NAME + '_' + DATE + '_html.zip', 'a')\\n for file in glob.glob(\\\"*\\\" + DATE + \\\"*\\\" + \\\"html\\\"):\\n zip_csv.write(file)\\n os.remove(file)\\n log.info(\\\"Compressing HTML files\\\")\\n except Exception as e:\\n log.error('Error when compressing html')\\n log.info(type(e).__name__ + str(e))\\n os.chdir(PROJECT_PATH)\",\n \"def cleanup():\\n if len(env.releases) > 3:\\n directories = env.releases\\n directories.reverse()\\n del directories[:3]\\n env.directories = ' '.join([ '%(releases_path)s/%(release)s' % { 'releases_path':env.releases_path, 'release':release } for release in directories ])\\n run('rm -rf %(directories)s' % env)\",\n \"def clear(self, cacheDir):\",\n \"def cleanUp(self):\\r\\n remove_files(self._db_files_to_remove, error_on_missing=False)\",\n \"def _delete_data (self, path):\\n head, tail = os.path.split(path)\\n for subdir, dirs, files in os.walk(head):\\n for file in files:\\n if tail in file:\\n os.remove(os.path.join(subdir, file))\",\n \"def clean(ctx, so=False, cache=False):\\n for name in ctx.shell.files('.', '.coverage*', recursive=False):\\n ctx.shell.rm(name)\\n for name in ctx.shell.files('bench', '.out.*', recursive=False):\\n ctx.shell.rm(name)\\n ctx.shell.rm_rf(\\n 'docs/coverage',\\n 'docs/gcov',\\n 'build',\\n 'dist',\\n 'wheel/dist',\\n ctx.doc.userdoc,\\n 'docs/_userdoc/_build',\\n ctx.doc.website.source,\\n ctx.doc.website.target,\\n )\\n if cache:\\n cacheclean(ctx)\\n if so:\\n soclean(ctx)\",\n \"def clean_files(self):\\n self.filenames.clear()\",\n \"def tearDown(self):\\n rmtree(getcwd(), ignore_errors=True)\",\n \"def tearDown(self):\\n rmtree(getcwd(), ignore_errors=True)\",\n \"def clean_all_folder():\\n LOGGER.warning('removal of old files has been temporarily disabled')\\n # paths_to_clean = CFG.remove_files\\n # if paths_to_clean: # pylint: disable=using-constant-test\\n # for remove_config in paths_to_clean: # pylint: disable=not-an-iterable\\n # name = tuple(remove_config.keys())[0]\\n # LOGGER.info(f'processing: {name}')\\n # remove_config = remove_config[name]\\n # if 'folder' not in remove_config.keys():\\n # LOGGER.error(f'missing \\\"folder\\\" in {name}')\\n # return\\n # if 'age' not in remove_config.keys():\\n # LOGGER.error(f'missing \\\"age\\\" in {name}')\\n # return\\n # if not os.path.exists(remove_config['folder']):\\n # LOGGER.error(f'path does not exist: {remove_config[\\\"folder\\\"]}')\\n # return\\n # _remove_old_files_from_folder(**remove_config)\\n # else:\\n # LOGGER.debug('no folder to clean')\",\n \"def remover_files():\\n directory = os.getcwd()\\n for file_name in glob.glob((\\\"{}/tmp/*\\\").format(directory)):\\n remove(file_name)\",\n \"def reset():\\n local('cd {{ project_name }} && \\\\\\n rm -rf static && rm -rf gzip && rm -rf build')\",\n \"def cleanup_step(self):\\n self.clean_home_subdir()\\n\\n super(IntelBase, self).cleanup_step()\",\n \"def remove_dir_content(path):\\n for item in os.listdir(path):\\n p = os.path.join(path, item)\\n if os.path.isdir(p):\\n shutil.rmtree(p)\\n else:\\n os.unlink(p)\",\n \"def delete_previous_files(schema_name, path_template, path_static):\\n list_file_static = listdir(path_static)\\n list_file_template = listdir(path_template)\\n if schema_name in list_file_static:\\n tree_path = path.join(path_static, schema_name)\\n rmtree(tree_path, ignore_errors=True)\\n html_file_name = \\\"wrap_\\\" + schema_name + \\\".html\\\"\\n if html_file_name in list_file_template:\\n html_file_path = path.join(path_template, html_file_name)\\n remove(html_file_path)\",\n \"def clean_local():\\n local('rm -fr build')\\n local('mkdir -p build')\",\n \"def cleanup(self):\\n\\n print \\\"Cleaning up...\\\",\\n sys.stdout.flush()\\n\\n builddir = os.path.join(self.build)\\n\\n comm = 'rm -rf '+builddir\\n #+' '+libdir+' '+logdir\\n (output, error, retz) = runShellCommand(comm)\\n\\n print \\\"done.\\\"\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.7720015","0.6934762","0.68778396","0.6763646","0.66906065","0.6680769","0.668029","0.66643465","0.66492623","0.6645479","0.6635241","0.6626942","0.6605654","0.65854466","0.654416","0.6536765","0.6526797","0.64898103","0.64494216","0.6443703","0.6431596","0.64281493","0.6421824","0.6420025","0.64162767","0.6400494","0.6388606","0.6372155","0.6369315","0.63596666","0.63587725","0.6351041","0.6349154","0.63455576","0.6341319","0.6336749","0.63364047","0.63309884","0.63142085","0.63126796","0.63040906","0.62925726","0.6287985","0.6283181","0.62622315","0.6255875","0.62524146","0.6244203","0.6240606","0.6233933","0.62319875","0.62312895","0.62232745","0.62017304","0.6197875","0.61842704","0.6179306","0.61736083","0.61705077","0.61704785","0.61690754","0.61639625","0.6163873","0.6163449","0.6159685","0.61484927","0.61365265","0.6125922","0.6111614","0.6108433","0.6107462","0.61020565","0.6096402","0.60726833","0.60707897","0.60657144","0.60604143","0.60491663","0.6045021","0.6043312","0.6034387","0.6021114","0.60198224","0.60039896","0.6000147","0.5998619","0.5995463","0.59888834","0.5985517","0.5984871","0.59810084","0.59810084","0.59805375","0.5977186","0.5975519","0.5974188","0.5971434","0.59689987","0.596187","0.59586084"],"string":"[\n \"0.7720015\",\n \"0.6934762\",\n \"0.68778396\",\n \"0.6763646\",\n \"0.66906065\",\n \"0.6680769\",\n \"0.668029\",\n \"0.66643465\",\n \"0.66492623\",\n \"0.6645479\",\n \"0.6635241\",\n \"0.6626942\",\n \"0.6605654\",\n \"0.65854466\",\n \"0.654416\",\n \"0.6536765\",\n \"0.6526797\",\n \"0.64898103\",\n \"0.64494216\",\n \"0.6443703\",\n \"0.6431596\",\n \"0.64281493\",\n \"0.6421824\",\n \"0.6420025\",\n \"0.64162767\",\n \"0.6400494\",\n \"0.6388606\",\n \"0.6372155\",\n \"0.6369315\",\n \"0.63596666\",\n \"0.63587725\",\n \"0.6351041\",\n \"0.6349154\",\n \"0.63455576\",\n \"0.6341319\",\n \"0.6336749\",\n \"0.63364047\",\n \"0.63309884\",\n \"0.63142085\",\n \"0.63126796\",\n \"0.63040906\",\n \"0.62925726\",\n \"0.6287985\",\n \"0.6283181\",\n \"0.62622315\",\n \"0.6255875\",\n \"0.62524146\",\n \"0.6244203\",\n \"0.6240606\",\n \"0.6233933\",\n \"0.62319875\",\n \"0.62312895\",\n \"0.62232745\",\n \"0.62017304\",\n \"0.6197875\",\n \"0.61842704\",\n \"0.6179306\",\n \"0.61736083\",\n \"0.61705077\",\n \"0.61704785\",\n \"0.61690754\",\n \"0.61639625\",\n \"0.6163873\",\n \"0.6163449\",\n \"0.6159685\",\n \"0.61484927\",\n \"0.61365265\",\n \"0.6125922\",\n \"0.6111614\",\n \"0.6108433\",\n \"0.6107462\",\n \"0.61020565\",\n \"0.6096402\",\n \"0.60726833\",\n \"0.60707897\",\n \"0.60657144\",\n \"0.60604143\",\n \"0.60491663\",\n \"0.6045021\",\n \"0.6043312\",\n \"0.6034387\",\n \"0.6021114\",\n \"0.60198224\",\n \"0.60039896\",\n \"0.6000147\",\n \"0.5998619\",\n \"0.5995463\",\n \"0.59888834\",\n \"0.5985517\",\n \"0.5984871\",\n \"0.59810084\",\n \"0.59810084\",\n \"0.59805375\",\n \"0.5977186\",\n \"0.5975519\",\n \"0.5974188\",\n \"0.5971434\",\n \"0.59689987\",\n \"0.596187\",\n \"0.59586084\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.72082686"},"document_rank":{"kind":"string","value":"1"}}},{"rowIdx":6081,"cells":{"query":{"kind":"string","value":"Purge thumbnail dir from irrelevant thumbnails"},"document":{"kind":"string","value":"def purge_thumbnails(args, thumbdir, posts, diary=False):\n thumblist = list_of_thumbnails(posts, diary)\n thumbs_to_remove = list()\n for fullname in glob.glob(os.path.join(thumbdir, '*.jpg')):\n if os.path.basename(fullname) not in thumblist:\n thumbs_to_remove.append(fullname)\n\n if len(thumbs_to_remove) > args.thumbnails.threshold_thumbs:\n inpt = 'x'\n while inpt not in 'yn':\n inpt = input(f'{len(thumbs_to_remove)} thumbnails to remove. Continue [y|n]? ').lower()\n if inpt == 'n':\n return\n\n for name in thumbs_to_remove:\n print('Removing thumbnail', name)\n os.remove(name)\n info_fullname = os.path.splitext(name)[0] + '.info'\n if os.path.exists(info_fullname):\n os.remove(info_fullname)"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["def clear_thumbnails(self):","def delete_thumbnail(self, thumbnail_name):","def tearDown(self):\n for fn in self.tempImages:\n os.remove(os.path.join(self.root, fn))\n os.rmdir(self.root)","def clear_tmp_folder(self):\r\n for file in os.listdir(self.temp_dir):\r\n if file.endswith('.png') or file.endswith('.jpg'):\r\n path = os.path.join(self.temp_dir, file)\r\n print ('Cleaned up {}'.format(path))\r\n os.remove(path)","def purge():\n all_hashes = read_all()\n used_hashes = read_used()\n\n for kind, hashes in used_hashes.items():\n to_remove = all_hashes[kind].difference(hashes)\n if kind == 'evs':\n delete_from_directory_by_hashes(EV_DIRECTORY, to_remove)\n elif kind == 'cache':\n delete_from_directory_by_hashes(CACHE_DIRECTORY, to_remove)\n elif kind == 'seeds':\n delete_from_directory_by_hashes(SEED_DIRECTORY, to_remove)\n\n reset_used()","def clear_thumbnail(self):\n from anima.ui import utils\n utils.clear_thumbnail(self.thumbnail_graphics_view)","def cleanup():\n cmd='docker rmi --force $(docker images -a -q)'\n bash_command(\"Deleting all images\", cmd)","def clearImageFolder():\n filelist = listImageFolder()\n for f in filelist:\n os.remove('{}/{}'.format(imageFolder, f))","def cleanup(self):\r\n for f in [i for d in self.data.values() for i in d[\"filenames\"]]:\r\n try:\r\n os.unlink(f)\r\n except Exception: pass\r\n self.Destroy()","def _cleanup(self):\n os.system(\"rm -r %s/*\" %(self._snippet_index_dir))\n os.system(\"rm %s/*\" %(self._para_dir))\n os.system(\"rm %s/*\" %(self._temp_dir))\n os.system(\"rm %s/*\" %(self._snippet_result_dir))","def cleanup(self):\n self.qemu.clean_run_files()\n for tmp in glob.glob(self.configfile + \"?*\"):\n os.unlink(tmp)","def space_cleaning():\n for file in os.listdir(\".\"):\n if file.endswith(\".png\"):\n os.remove(file)","def photo_file_cleanup(sender, **kwargs):\n instance = kwargs.get('instance')\n filename = instance.path.url[1:]\n if os.path.exists(filename):\n os.remove(filename)","def clean_up_temp_dir():\n files = glob.glob(f'{CONFIG_DIR}/tmp/*')\n for f in files:\n try:\n os.remove(f)\n except Exception:\n pass","def clearAllPictures(self):\n shutil.rmtree(PNG_OUTPUT_PATH)\n os.makedirs(PNG_OUTPUT_PATH)","def cleanup():\n download_dir = settings.DOWNLOAD_BASE_DIR\n\n for base, dirs, files in os.walk(download_dir):\n for dir in dirs:\n shutil.rmtree(download_dir + dir)","def delete_file(self, instance, sender, **kwargs):\n super(AutoImageField, self).delete_file(instance, sender)\n if getattr(instance, self.attname):\n # Get full path and the base directory that contains the file\n file_name = getattr(instance,self.name).name\n basedir = os.path.dirname(file_name)\n \n # Look for thumbnails created from filters for the current filename\n # and delete the files\n mask = add_to_basename(file_name, '_*')\n [os.remove(os.path.join(basedir, f)) for f in glob.glob(mask)]","def auto_delete_image_and_thumbnail_on_delete(sender, instance, **kwargs):\n if instance.image:\n if os.path.isfile(instance.image.path):\n os.remove(instance.image.path)\n\n if instance.thumbnail:\n if os.path.isfile(instance.thumbnail.path):\n os.remove(instance.thumbnail.path)\n\n return False","def delete_leftovers(self):\n for each_file, artist in self.past_songs_db_data:\n if os.path.isfile(each_file): \n os.remove(each_file)\n print \"Deleted \" + each_file\n\n for each_file in os.listdir(\".\"):\n if each_file.endswith(\".jpg\"):\n os.remove(each_file)","def cleanup_old_backups(self):\n print(\"Cleaning Old Backups for media files\")\n\n file_list = utils.get_backup_file_list(\n self.get_databasename(),\n self.get_servername(),\n 'media.tar.gz',\n self.storage\n )\n\n for backup_date, filename in file_list[0:-dbbackup_settings.CLEANUP_KEEP_MEDIA]:\n if int(backup_date.strftime(\"%d\")) != 1:\n print(\" Deleting: %s\" % filename)\n self.storage.delete_file(filename)","def cleanup_files(self):\n\n self.backup_files()\n self.delete_files()","def clean_temp_storage_dir(self, filenames):\n for fn in filenames:\n try:\n pathlib.Path(pathlib.PurePath(self.temp_storage_dir, fn)).unlink()\n except FileNotFoundError:\n pass","def tearDown(self):\n shutil.rmtree(self.test_pic_folder)","def clean(self):\n if self.image:\n self.glance.images.delete(self.image['id'])\n\n if self.image_file:\n shutil.rmtree(self.download_path)","def cleanup(self):\n if os.path.exists(self.tgzfile):\n os.remove(self.tgzfile)\n\n if os.path.exists(self.dirname):\n shutil.rmtree(self.dirname)","def remove_unactionable_images(data):\n os.makedirs(os.path.join(data, 'removed'), exist_ok=True)\n for product in os.listdir(data):\n if product.startswith('product') is False:\n continue\n path = os.path.join(data, product)\n if os.path.isdir(path) is False:\n continue\n if is_useful(path, 0.5) is False:\n print('\\tRemoving ' + path)\n shutil.copy(os.path.join(path, 'TCI.tiff'),\n os.path.join(data, 'removed', product + '.tiff'))\n shutil.rmtree(path)\n else:\n shutil.copy(os.path.join(path, 'TCI.tiff'),\n os.path.join(data, product + '.tiff'))","def cleanup_intermediate_files():\n\n dirs = (DIR_PAGE, DIR_SRGB, DIR_VTI, DIR_TIFF, DIR_BACK, DIR_TEXT)\n map(lambda dir: shutil.rmtree(os.path.join(cwd, dir)) , dirs)","def clean(allimages, alldirs):\n\n for img in allimages:\n # Delete HTML files\n htmlfn = join(opts.root, img._dir._path, img._pagefn)\n if exists(htmlfn):\n if opts.verbose:\n print \"Deleting\", htmlfn\n try:\n os.unlink(htmlfn)\n except:\n print >> sys.stderr, \"Error: deleting\", htmlfn\n\n # Delete thumbnails\n if img._thumbfn:\n thumbfn = join(opts.root, img._thumbfn)\n if exists(thumbfn):\n if opts.verbose:\n print \"Deleting\", thumbfn\n try:\n os.unlink(thumbfn)\n img._thumbfn = None\n except:\n print >> sys.stderr, \"Error: deleting\", thumbfn\n\n for d in alldirs:\n files = dircache.listdir(join(opts.root, d._path))\n\n # Delete HTML files in directories\n for f in files:\n fn = join(opts.root, d._path, f)\n if f in [ dirindex_fn, allindex_fn, allcidx_fn,\n sortindex_fn, css_fn ] or \\\n f.startswith('trackindex-'):\n if opts.verbose:\n print \"Deleting\", fn\n try:\n os.unlink(fn)\n pass\n except:\n print >> sys.stderr, \"Error: deleting\", fn\n\n if f == index_fn and islink(fn):\n os.unlink(fn)","def clean():\n folders = ['utils_dfn/temp', 'utils_dfn/img', 'utils_dfn/mask', 'utils_dfn/output']\n for folder in folders:\n for item in os.listdir(folder):\n item_path = os.path.join(folder, item)\n if os.path.isdir(item_path):\n shutil.rmtree(item_path)\n elif os.path.isfile(item_path):\n os.remove(item_path)","def clean(self):\n\n for metric in self.metricList:\n listf = glob.glob(\n '{}/*_{}_{}*'.format(self.outDir, metric.name, self.num))\n if len(listf) > 0:\n for val in listf:\n os.system('rm {}'.format(val))","def purge(dir, pattern):\n for p in Path(dir).glob(pattern):\n logging.debug(f\"Deleting - {p}\")\n p.unlink()","def clean_webp_textures():\n for webp in PNG_TEXTURES['output_files']:\n if os.path.isfile(webp):\n os.remove(webp)","def clean(self):\n if self.options.format != 'svg':\n for svgfile in self.svgouts.itervalues():\n os.remove(svgfile)\n os.rmdir(self.tmpdir)","def purge_htmlfiles(args, posts):\n htmlist = list_of_htmlfiles(args, posts)\n html_to_remove = list()\n for fullname in glob.glob(os.path.join(args.root, '*.htm*')):\n if fullname not in htmlist:\n html_to_remove.append(fullname)\n\n if len(html_to_remove) > args.thumbnails.threshold_htmlfiles:\n inpt = 'x'\n while inpt not in 'yn':\n inpt = input(f'{len(html_to_remove)} html files to remove. Continue [y|n]? ').lower()\n if inpt == 'n':\n return\n\n for name in html_to_remove:\n print('Removing html files', name)\n os.remove(name)","def cleanup_file(name: str):\n if os.path.exists(name) and os.path.isfile(name): # h5\n os.remove(name)\n elif os.path.exists(name) and os.path.isdir(name): # tf\n shutil.rmtree(name)","def _cleanup_files(self):\n\n for root, dirs, files in os.walk(self.build_directory):\n dirs_to_delete = [\n Path(root).joinpath(x) for x in dirs if x == '__pycache__'\n ]\n files_to_delete = [\n Path(root).joinpath(x) for x in files if Path(x).suffix == '.pyc'\n ]\n for d in dirs_to_delete:\n logger.info('Deleting: %s', d)\n shutil.rmtree(d)\n for f in files_to_delete:\n logger.info('Deleting: %s', f)\n f.unlink()","def tearDown(self):\n for root, dirs, files in os.walk(TEMPDIR, topdown=False):\n for name in files:\n os.remove(os.path.join(root, name))\n for name in dirs:\n os.rmdir(os.path.join(root, name))\n os.rmdir(root)","def clean():\n clean_files()","def delete_bad_images(bad_image_urls):\n for url in bad_image_urls:\n try:\n os.remove(cfg.PHOTO_DIR + web.get_file_name(url))\n except Exception as e:\n print(\"Error while removing: {0}, E: {1}\".format(url, e))\n\n print(\"# removed image(s): {0}\".format(len(bad_image_urls)))","def delete_AllImgs(self):\n self.listImages.remove_all_imgs()","def clear_figures() -> None:\n \n for filename in os.listdir(FIGURE_DIR):\n filepath = os.path.join(FIGURE_DIR, filename)\n try:\n shutil.rmtree(filepath)\n except OSError:\n os.remove(filepath)","def clearImageCache(self):\n if os.path.exists(\"./cache/\"):\n shutil.rmtree(\"./cache/\")","def delete_test_image(image_field):\n warnings.warn(DeprecationWarning(\n \"delete_test_image() is deprecated in favour of the \"\n \"get_sample_image() context manager.\"), stacklevel=2)\n # ensure all thumbs are deleted\n for filename in glob.glob(\n os.path.join(\n settings.MEDIA_ROOT, 'thumbs', image_field.name.split('/')[-1]\n ) + '*'\n ):\n os.unlink(filename)\n # delete the saved file\n image_field.delete()","def __del__(self):\n\t\tif self.temp_dir:\n\t\t\tself.temp_dir.cleanup()","def _clean_workdir(self):\n\t\ttoremove = [self._get_config_filepath(), self._get_params_filepath(), self._get_conv_filepath(), self._get_psf_filepath()]\n\t\tfor filepath in toremove:\n\t\t\tif os.path.exists(filepath):\t\n\t\t\t\tlogger.debug(\"Removing existing file %s...\" % (filepath))\n\t\t\t\tos.remove(filepath)","def purge_files(self):\n run_keyword(\"Purge Server Configuration\")\n run_keyword(\"Purge Cache Manager Configuration\")\n # TODO: Probably the only sane way to do this is to call\n # a helper script which runs as root.\n # run_keyword(\"Purge Cache\")\n valid = r'/vicep([a-z]|[a-h][a-z]|i[a-v])$'\n for vicep in glob.glob(\"/vicep*\"):\n if re.match(valid, vicep) and os.path.isdir(vicep):\n run_keyword(\"Purge Directory\", \"%s/AFSIDat\" % vicep)\n run_keyword(\"Purge Directory\", \"%s/Lock\" % vicep)\n for vheader in glob.glob(\"%s/V*.vol\" % vicep):\n run_keyword(\"Sudo\", \"rm -f %s\" % vheader)","def clean_chunk_files(dirpath):\n workdir = os.getcwd()\n os.chdir(dirpath)\n for filename in glob.glob(\"[0-9]*_[0-9]*_[0-9]*.hdf5\"):\n os.remove(filename)\n os.chdir(workdir)","def main(directory=\"/images\"):\n dir_path = os.path.dirname(os.path.realpath(__file__))\n parent_dir = os.path.dirname(dir_path)\n threshold = 5000\n start = time.time()\n num_images = 0\n for fn in os.listdir(parent_dir + directory):\n num_images += 1\n full_path = parent_dir + directory + \"/\" + fn\n if os.stat(full_path).st_size < threshold:\n os.remove(full_path)\n print(\"deleted file\", fn)\n print(\"Total files\", num_images)\n curr_time = time.time()\n print(\"Time run so far\", round(curr_time - start, \"\\n\"))\n end = time.time()\n print(\"Time to delete files:\", round(end - start), \"seconds\")\n print(\"Number of images\", num_images)","def teardown():\n os.remove('green-dot.tif')\n os.remove('green-dot.jpg')\n os.remove('green-dot.png')","def _clean_up_temporary_files(dataset_dir):\n filename = _DATA_URL.split('/')[-1]\n filepath = os.path.join(dataset_dir, filename)\n tf.gfile.Remove(filepath)\n\n tmp_dir = os.path.join(dataset_dir, 'cifar-100-python')\n tf.gfile.DeleteRecursively(tmp_dir)","def cleanup(self):\n\t\tfor filename in self.cfg_files:\n\t\t\tif os.path.isfile(filename):\n\t\t\t\tsize = os.stat(filename)[6]\n\t\t\t\tif size == 0:\n\t\t\t\t\tos.remove(filename)\n\n\t\treturn True","def clean_old_data():\n logger.info('Cleaning standalone files on disk...')\n for absolute_path in glob.glob(MEDIA_URL + '*'):\n file_name = os.path.basename(absolute_path)\n try:\n relative_path = os.path.join(AUDIOS_URL, file_name)\n audio = Audio.objects.get(filename=relative_path)\n if audio.get_type() == 'episode':\n try:\n # If there are inactive audios on its being\n for e in audio.podcast.episode_set.exclude(pk=audio.podcast.active_episode.pk):\n if not e.is_active():\n logger.info('Inactive audio found in podcast set. Erasing files.')\n e.delete_files()\n except Exception, e:\n logger.exception(e.message)\n except ObjectDoesNotExist, e:\n logger.info('A file with no audio registered in database')\n if os.path.isfile(relative_path):\n logger.info('Erasing: %s' % relative_path)\n os.remove(relative_path)\n logger.info('... Done.')","def _clean_bins():\n rmtree(LIBS_DIR)\n rmtree(BINS_DIR)\n rmtree(HEADERS_DIR)","def clear_outdated_files():\n for f in os.listdir(MEDIA_ROOT):\n file_path = os.path.join(MEDIA_ROOT, f)\n if os.path.isfile(file_path) and os.stat(file_path).st_mtime < time.time() - STORE_PDF_DAYS * 86400:\n os.remove(file_path)","def purge_downloaded_files():\n for fpath in DOWNLOADED_FILEPATHS:\n if os.path.exists(fpath):\n os.remove(fpath)","def test_cleanup(self):\n imgurl = \"{}spei03.nc\".format(self.processor.base_url)\n httpretty.register_uri(httpretty.GET, imgurl,\n body=get_mock_image())\n self.processor.download(imgurl, 'spei03.tif')\n self.assertNotEqual([], glob.glob(os.path.join(\n self.processor.tmp_dir, self.processor.prefix + '*')))\n self.processor.cleanup()\n self.assertEquals([], glob.glob(os.path.join(\n self.processor.tmp_dir, self.processor.prefix + '*')))","def cleanup(self):\n if self.path and os.path.exists(self.path) and not self.dont_remove:\n rmtree(self.path)\n del self.path\n if self in self.instances:\n self.instances.remove(self)","def clear_obsolete_trash():\n minute_ago = datetime.now() - timedelta(minutes=1)\n Picture.trash.filter(trashed_time__lt=minute_ago).delete()","def cleanup(e):\n for f in e.files:\n try:\n if os.path.isfile(f):\n os.remove(f)\n except OSError:\n continue\n\n return","def teardown():\n for filename in files_to_delete:\n delete_file(filename)","def tearDown(self):\n for d in os.listdir(tmp_dir_path):\n d_path = os.path.join(tmp_dir_path,d)\n try:\n os.remove(d_path)\n except:\n for f in os.listdir(d_path):\n f_path = os.path.join(d_path,f)\n os.remove(f_path)\n os.rmdir(d_path)\n assert os.listdir(tmp_dir_path) == []","def test_thumbnail(self):\n pub = PublicationFactory(thumbnail__filename=\"tester.jpg\")\n self.assertEqual(\n pub.thumbnail.url, f\"/media/reading/publications/{pub.slug}/tester.jpg\"\n )\n self.assertTrue(\n pub.thumbnail.path.endswith, f\"/reading/publications/{pub.slug}/tester.jpg\"\n )\n\n # Tidy up:\n pub.thumbnail.delete()","def cleanup(destination_subdir):\n sp.check_call(f\"rm {destination_subdir}/*.bam\", shell=True)\n sp.check_call(f\"rm {destination_subdir}/*.sam\", shell=True)\n sp.check_call(f\"rm -rf ./index_files\", shell=True)","def clean(self):\n print(\"Cleaning outputs in %s\" % self.args.output)\n files = glob.glob(self.args.output + \"*.pkl\")\n for f in files:\n if os.path.exists(f):\n os.remove(f)","def purge(self):\n pass","def tearDown(self):\n if os.path.exists(settings.MEDIA_ROOT):\n shutil.rmtree(settings.MEDIA_ROOT)","def tearDown(self):\n if os.path.exists(settings.MEDIA_ROOT):\n shutil.rmtree(settings.MEDIA_ROOT)","def cleanup(self):\n files = self.nlst()\n latest = self.latest_filename\n for filename in files:\n if filename != latest:\n result = self.delete(filename)\n logger.info(f\"Deleted old export from FTP: {result}\")","def del_imgs(path):\n files = os.listdir(path)\n for file in files:\n if file.endswith(\".jpg\"):\n os.remove(os.path.join(path, file))","def clean():\n for f in [f for f in os.listdir() if f.endswith(\".part\")]:\n os.remove(f)","def cleanup_intermediate_files(self):\n self.cmd(\"rm -f {local_temp_dir}/*rg_dict* \\\n {local_temp_dir}/*aln* \\\n {local_temp_dir}/snappy*\".\n format(\n local_temp_dir=self.local_temp_dir\n ),\n shell=True)","def clean():\n clean_flatbuffer_binaries()\n clean_webp_textures()","def clean_up_artifacts():\n logger.info(\"Removing artifacts from Sandbox\")\n for item in Analyzer.uploaded:\n # Perform the delete\n response = Samples.delete_sample(ids=item)\n if response[\"status_code\"] > 201:\n # File was not removed, log the failure\n logger.warning(\"Failed to delete %s\", item)\n else:\n logger.debug(\"Deleted %s\", item)\n logger.info(\"Artifact cleanup complete\")","def tearDown(self) -> None:\n filtered = [f for f in glob.glob('steps/tests/test_output/*') if not re.match(r'\\.keep', f)]\n for file in filtered:\n try:\n if Path(file).is_dir():\n shutil.rmtree(file)\n else:\n os.remove(file)\n except PermissionError as pe:\n # We don't necessarily care that much\n continue","def tearDownClass(self):\n if (os.path.exists(MEDIA_ROOT+\"/gitload_test\")):\n shutil.rmtree(MEDIA_ROOT+\"/gitload_test\")","def cleanup(self):\r\n if self.tempDirectory != None:\r\n shutil.rmtree(self.tempDirectory, True)\r\n self.tempDirectory = None","def purge_cache():\n for (dir_path, dir_names, file_names) in os.walk(CACHE, topdown=False):\n for file_name in file_names:\n if is_json_file(file_name):\n path = os.path.join(dir_path, file_name)\n print(\"Removing file “%s”\" % path)\n os.remove(path)\n for directory in dir_names:\n path = os.path.join(dir_path, directory)\n if not os.listdir(path):\n print(\"Removing directory “%s”\" % path)\n os.rmdir(path)","def cleanup():\n if len(env.releases) > 3:\n directories = env.releases\n directories.reverse()\n del directories[:3]\n env.directories = ' '.join([ '%(releases_path)s/%(release)s' % { 'releases_path':env.releases_path, 'release':release } for release in directories ])\n run('rm -rf %(directories)s' % env)","def sorl_delete(**kwargs):\n from sorl.thumbnail import delete\n delete(kwargs['file'])","def purge() -> None:\r\n _purge_func(False)","def __clean(path, pattern = '.tiff'):\n for f in os.listdir(path):\n if re.search(pattern, f):\n os.remove(os.path.join(path, f))\n\n print(\"directory cleaned\")","def remove_thumbnail(inJSON):\n time.sleep(2)\n consoleOutput = exec_console_command(\"rm \" + inJSON + \";\" + constants.getExitStatus)\n\n if \"\\n1\" in consoleOutput:\n raise IOError(\"Thumbnail file doesn't exist to delete. No worries though, it was going to be deleted anyway!\")\n\n return 0","def tearDown(self):\n account_models.User.objects.all().delete()\n photo_models.PhotoFeed.objects.all().delete()\n photo_models.PhotoClassification.objects.filter(name__in=[\"Rural\", \"Abstract\", \"City\"]).delete()\n test_helpers.clear_directory('backend/media/', '*.jpg')","def cleanup_backups():\n try:\n yield\n finally:\n shutil.rmtree(\"tmp/backups\")","def tearDown(self):\n for f in os.listdir('/tmp'):\n if not f.startswith(self.FILE_PREFIX):\n continue\n\n os.remove(os.path.join('/tmp', f))","def cleanup(self):\n\n # check if the directory exists\n if not os.path.exists(self.path):\n return\n\n # check if the directory is a directory\n if not os.path.isdir(self.path):\n return\n\n # loop over content of directory and remove it\n for the_file in os.listdir(self.path):\n file_path = os.path.join(self.path, the_file)\n try:\n if os.path.isfile(file_path):\n os.unlink(file_path)\n elif os.path.isdir(file_path):\n shutil.rmtree(file_path)\n except Exception as e:\n pass","def purge_outdated(self):\n todelete = []\n sql = \"select rowid, path, mtime from pictures\"\n cur = self.con.execute(sql)\n for rowid, path_str, mtime in cur:\n if mtime and op.exists(path_str):\n picture_mtime = os.stat(path_str).st_mtime\n if int(picture_mtime) <= mtime:\n # not outdated\n continue\n todelete.append(rowid)\n if todelete:\n sql = \"delete from pictures where rowid in (%s)\" % ','.join(map(str, todelete))\n self.con.execute(sql)","def cleanUpTemporaryFiles(options):\n os.system(\"rm \"+options.output_directory_per_run+\"/*.abundance\")\n os.system(\"rm \"+options.output_directory_per_run+\"/*.phasing_score\")\n os.system(\"rm \"+options.output_directory_per_run+\"/*regionsOfInterest*\")\n os.system(\"mv \"+options.output_directory_per_run+\"/* \"+options.output_directory_per_run+\"/../\")\n os.system(\"rm -rf \"+options.output_directory_per_run)","def remover_files():\n directory = os.getcwd()\n for file_name in glob.glob((\"{}/tmp/*\").format(directory)):\n remove(file_name)","def _final_cleanup(self):\n # Clean up and remove the temporary gisdbase\n self._cleanup()\n # Remove resource directories\n if \"error\" in self.run_state or \"terminated\" in self.run_state:\n self.storage_interface.remove_resources()","def _clean_up_temporary_files(dataset_dir):\n return","def cleanup(tag, keepimg, builder):\n manager = Manager('cleanup', tag, keepimg=keepimg,\n builder_hostname=builder)\n manager.run()","def clean(self, **kwargs):\n if os.path.exists(self.old_artifact_path):\n shutil.rmtree(self.old_artifact_path)\n log.info(\"Removing old artifact path: %s\" % self.old_artifact_path)","def __del__(self):\n for filename in self.files:\n unlink(filename)","def photo_edit_file_cleanup(sender, **kwargs):\n instance = kwargs.get('instance')\n filename = instance.upload.url[1:]\n if os.path.exists(filename):\n os.remove(filename)","def _purge():\r\n _cache.clear()","def cleanup(folder):\n os.system('rm -rf %s/*' % folder)","def cleanup(self):\n\n if self.debug:\n print 'Running cleanup()'\n print 'Starting removing dead links'\n\n for root, dirs, files in os.walk(self.tags_folder):\n if files:\n for f in files:\n try:\n full_path = os.path.join(root, f)\n if not os.path.exists(os.readlink(full_path)):\n os.unlink(full_path)\n if self.debug:\n print 'Removing dead link %s' % full_path\n except OSError:\n pass\n\n if self.debug:\n print 'Starting removing empty directories'\n self._del_empty_dirs(self.tags_folder)","def cleanup(tempdir):\n try:\n shutil.rmtree(tempdir)\n except OSError:\n pass","def _cleanup_uploads(self):\n logger.debug(\"Performing blob upload cleanup\")\n\n while True:\n # Find all blob uploads older than the threshold (typically a week) and delete them.\n with UseThenDisconnect(app.config):\n stale_upload = model.get_stale_blob_upload(DELETION_DATE_THRESHOLD)\n if stale_upload is None:\n logger.debug(\"No additional stale blob uploads found\")\n return\n\n # Remove the stale upload from storage.\n logger.debug(\"Removing stale blob upload %s\", stale_upload.uuid)\n assert stale_upload.created <= (datetime.utcnow() - DELETION_DATE_THRESHOLD)\n\n try:\n storage.cancel_chunked_upload(\n [stale_upload.location_name], stale_upload.uuid, stale_upload.storage_metadata\n )\n except Exception as ex:\n logger.debug(\n \"Got error when trying to cancel chunked upload %s: %s\",\n stale_upload.uuid,\n ex.message,\n )\n\n # Delete the stale upload's row.\n with UseThenDisconnect(app.config):\n model.delete_blob_upload(stale_upload)\n\n logger.debug(\"Removed stale blob upload %s\", stale_upload.uuid)"],"string":"[\n \"def clear_thumbnails(self):\",\n \"def delete_thumbnail(self, thumbnail_name):\",\n \"def tearDown(self):\\n for fn in self.tempImages:\\n os.remove(os.path.join(self.root, fn))\\n os.rmdir(self.root)\",\n \"def clear_tmp_folder(self):\\r\\n for file in os.listdir(self.temp_dir):\\r\\n if file.endswith('.png') or file.endswith('.jpg'):\\r\\n path = os.path.join(self.temp_dir, file)\\r\\n print ('Cleaned up {}'.format(path))\\r\\n os.remove(path)\",\n \"def purge():\\n all_hashes = read_all()\\n used_hashes = read_used()\\n\\n for kind, hashes in used_hashes.items():\\n to_remove = all_hashes[kind].difference(hashes)\\n if kind == 'evs':\\n delete_from_directory_by_hashes(EV_DIRECTORY, to_remove)\\n elif kind == 'cache':\\n delete_from_directory_by_hashes(CACHE_DIRECTORY, to_remove)\\n elif kind == 'seeds':\\n delete_from_directory_by_hashes(SEED_DIRECTORY, to_remove)\\n\\n reset_used()\",\n \"def clear_thumbnail(self):\\n from anima.ui import utils\\n utils.clear_thumbnail(self.thumbnail_graphics_view)\",\n \"def cleanup():\\n cmd='docker rmi --force $(docker images -a -q)'\\n bash_command(\\\"Deleting all images\\\", cmd)\",\n \"def clearImageFolder():\\n filelist = listImageFolder()\\n for f in filelist:\\n os.remove('{}/{}'.format(imageFolder, f))\",\n \"def cleanup(self):\\r\\n for f in [i for d in self.data.values() for i in d[\\\"filenames\\\"]]:\\r\\n try:\\r\\n os.unlink(f)\\r\\n except Exception: pass\\r\\n self.Destroy()\",\n \"def _cleanup(self):\\n os.system(\\\"rm -r %s/*\\\" %(self._snippet_index_dir))\\n os.system(\\\"rm %s/*\\\" %(self._para_dir))\\n os.system(\\\"rm %s/*\\\" %(self._temp_dir))\\n os.system(\\\"rm %s/*\\\" %(self._snippet_result_dir))\",\n \"def cleanup(self):\\n self.qemu.clean_run_files()\\n for tmp in glob.glob(self.configfile + \\\"?*\\\"):\\n os.unlink(tmp)\",\n \"def space_cleaning():\\n for file in os.listdir(\\\".\\\"):\\n if file.endswith(\\\".png\\\"):\\n os.remove(file)\",\n \"def photo_file_cleanup(sender, **kwargs):\\n instance = kwargs.get('instance')\\n filename = instance.path.url[1:]\\n if os.path.exists(filename):\\n os.remove(filename)\",\n \"def clean_up_temp_dir():\\n files = glob.glob(f'{CONFIG_DIR}/tmp/*')\\n for f in files:\\n try:\\n os.remove(f)\\n except Exception:\\n pass\",\n \"def clearAllPictures(self):\\n shutil.rmtree(PNG_OUTPUT_PATH)\\n os.makedirs(PNG_OUTPUT_PATH)\",\n \"def cleanup():\\n download_dir = settings.DOWNLOAD_BASE_DIR\\n\\n for base, dirs, files in os.walk(download_dir):\\n for dir in dirs:\\n shutil.rmtree(download_dir + dir)\",\n \"def delete_file(self, instance, sender, **kwargs):\\n super(AutoImageField, self).delete_file(instance, sender)\\n if getattr(instance, self.attname):\\n # Get full path and the base directory that contains the file\\n file_name = getattr(instance,self.name).name\\n basedir = os.path.dirname(file_name)\\n \\n # Look for thumbnails created from filters for the current filename\\n # and delete the files\\n mask = add_to_basename(file_name, '_*')\\n [os.remove(os.path.join(basedir, f)) for f in glob.glob(mask)]\",\n \"def auto_delete_image_and_thumbnail_on_delete(sender, instance, **kwargs):\\n if instance.image:\\n if os.path.isfile(instance.image.path):\\n os.remove(instance.image.path)\\n\\n if instance.thumbnail:\\n if os.path.isfile(instance.thumbnail.path):\\n os.remove(instance.thumbnail.path)\\n\\n return False\",\n \"def delete_leftovers(self):\\n for each_file, artist in self.past_songs_db_data:\\n if os.path.isfile(each_file): \\n os.remove(each_file)\\n print \\\"Deleted \\\" + each_file\\n\\n for each_file in os.listdir(\\\".\\\"):\\n if each_file.endswith(\\\".jpg\\\"):\\n os.remove(each_file)\",\n \"def cleanup_old_backups(self):\\n print(\\\"Cleaning Old Backups for media files\\\")\\n\\n file_list = utils.get_backup_file_list(\\n self.get_databasename(),\\n self.get_servername(),\\n 'media.tar.gz',\\n self.storage\\n )\\n\\n for backup_date, filename in file_list[0:-dbbackup_settings.CLEANUP_KEEP_MEDIA]:\\n if int(backup_date.strftime(\\\"%d\\\")) != 1:\\n print(\\\" Deleting: %s\\\" % filename)\\n self.storage.delete_file(filename)\",\n \"def cleanup_files(self):\\n\\n self.backup_files()\\n self.delete_files()\",\n \"def clean_temp_storage_dir(self, filenames):\\n for fn in filenames:\\n try:\\n pathlib.Path(pathlib.PurePath(self.temp_storage_dir, fn)).unlink()\\n except FileNotFoundError:\\n pass\",\n \"def tearDown(self):\\n shutil.rmtree(self.test_pic_folder)\",\n \"def clean(self):\\n if self.image:\\n self.glance.images.delete(self.image['id'])\\n\\n if self.image_file:\\n shutil.rmtree(self.download_path)\",\n \"def cleanup(self):\\n if os.path.exists(self.tgzfile):\\n os.remove(self.tgzfile)\\n\\n if os.path.exists(self.dirname):\\n shutil.rmtree(self.dirname)\",\n \"def remove_unactionable_images(data):\\n os.makedirs(os.path.join(data, 'removed'), exist_ok=True)\\n for product in os.listdir(data):\\n if product.startswith('product') is False:\\n continue\\n path = os.path.join(data, product)\\n if os.path.isdir(path) is False:\\n continue\\n if is_useful(path, 0.5) is False:\\n print('\\\\tRemoving ' + path)\\n shutil.copy(os.path.join(path, 'TCI.tiff'),\\n os.path.join(data, 'removed', product + '.tiff'))\\n shutil.rmtree(path)\\n else:\\n shutil.copy(os.path.join(path, 'TCI.tiff'),\\n os.path.join(data, product + '.tiff'))\",\n \"def cleanup_intermediate_files():\\n\\n dirs = (DIR_PAGE, DIR_SRGB, DIR_VTI, DIR_TIFF, DIR_BACK, DIR_TEXT)\\n map(lambda dir: shutil.rmtree(os.path.join(cwd, dir)) , dirs)\",\n \"def clean(allimages, alldirs):\\n\\n for img in allimages:\\n # Delete HTML files\\n htmlfn = join(opts.root, img._dir._path, img._pagefn)\\n if exists(htmlfn):\\n if opts.verbose:\\n print \\\"Deleting\\\", htmlfn\\n try:\\n os.unlink(htmlfn)\\n except:\\n print >> sys.stderr, \\\"Error: deleting\\\", htmlfn\\n\\n # Delete thumbnails\\n if img._thumbfn:\\n thumbfn = join(opts.root, img._thumbfn)\\n if exists(thumbfn):\\n if opts.verbose:\\n print \\\"Deleting\\\", thumbfn\\n try:\\n os.unlink(thumbfn)\\n img._thumbfn = None\\n except:\\n print >> sys.stderr, \\\"Error: deleting\\\", thumbfn\\n\\n for d in alldirs:\\n files = dircache.listdir(join(opts.root, d._path))\\n\\n # Delete HTML files in directories\\n for f in files:\\n fn = join(opts.root, d._path, f)\\n if f in [ dirindex_fn, allindex_fn, allcidx_fn,\\n sortindex_fn, css_fn ] or \\\\\\n f.startswith('trackindex-'):\\n if opts.verbose:\\n print \\\"Deleting\\\", fn\\n try:\\n os.unlink(fn)\\n pass\\n except:\\n print >> sys.stderr, \\\"Error: deleting\\\", fn\\n\\n if f == index_fn and islink(fn):\\n os.unlink(fn)\",\n \"def clean():\\n folders = ['utils_dfn/temp', 'utils_dfn/img', 'utils_dfn/mask', 'utils_dfn/output']\\n for folder in folders:\\n for item in os.listdir(folder):\\n item_path = os.path.join(folder, item)\\n if os.path.isdir(item_path):\\n shutil.rmtree(item_path)\\n elif os.path.isfile(item_path):\\n os.remove(item_path)\",\n \"def clean(self):\\n\\n for metric in self.metricList:\\n listf = glob.glob(\\n '{}/*_{}_{}*'.format(self.outDir, metric.name, self.num))\\n if len(listf) > 0:\\n for val in listf:\\n os.system('rm {}'.format(val))\",\n \"def purge(dir, pattern):\\n for p in Path(dir).glob(pattern):\\n logging.debug(f\\\"Deleting - {p}\\\")\\n p.unlink()\",\n \"def clean_webp_textures():\\n for webp in PNG_TEXTURES['output_files']:\\n if os.path.isfile(webp):\\n os.remove(webp)\",\n \"def clean(self):\\n if self.options.format != 'svg':\\n for svgfile in self.svgouts.itervalues():\\n os.remove(svgfile)\\n os.rmdir(self.tmpdir)\",\n \"def purge_htmlfiles(args, posts):\\n htmlist = list_of_htmlfiles(args, posts)\\n html_to_remove = list()\\n for fullname in glob.glob(os.path.join(args.root, '*.htm*')):\\n if fullname not in htmlist:\\n html_to_remove.append(fullname)\\n\\n if len(html_to_remove) > args.thumbnails.threshold_htmlfiles:\\n inpt = 'x'\\n while inpt not in 'yn':\\n inpt = input(f'{len(html_to_remove)} html files to remove. Continue [y|n]? ').lower()\\n if inpt == 'n':\\n return\\n\\n for name in html_to_remove:\\n print('Removing html files', name)\\n os.remove(name)\",\n \"def cleanup_file(name: str):\\n if os.path.exists(name) and os.path.isfile(name): # h5\\n os.remove(name)\\n elif os.path.exists(name) and os.path.isdir(name): # tf\\n shutil.rmtree(name)\",\n \"def _cleanup_files(self):\\n\\n for root, dirs, files in os.walk(self.build_directory):\\n dirs_to_delete = [\\n Path(root).joinpath(x) for x in dirs if x == '__pycache__'\\n ]\\n files_to_delete = [\\n Path(root).joinpath(x) for x in files if Path(x).suffix == '.pyc'\\n ]\\n for d in dirs_to_delete:\\n logger.info('Deleting: %s', d)\\n shutil.rmtree(d)\\n for f in files_to_delete:\\n logger.info('Deleting: %s', f)\\n f.unlink()\",\n \"def tearDown(self):\\n for root, dirs, files in os.walk(TEMPDIR, topdown=False):\\n for name in files:\\n os.remove(os.path.join(root, name))\\n for name in dirs:\\n os.rmdir(os.path.join(root, name))\\n os.rmdir(root)\",\n \"def clean():\\n clean_files()\",\n \"def delete_bad_images(bad_image_urls):\\n for url in bad_image_urls:\\n try:\\n os.remove(cfg.PHOTO_DIR + web.get_file_name(url))\\n except Exception as e:\\n print(\\\"Error while removing: {0}, E: {1}\\\".format(url, e))\\n\\n print(\\\"# removed image(s): {0}\\\".format(len(bad_image_urls)))\",\n \"def delete_AllImgs(self):\\n self.listImages.remove_all_imgs()\",\n \"def clear_figures() -> None:\\n \\n for filename in os.listdir(FIGURE_DIR):\\n filepath = os.path.join(FIGURE_DIR, filename)\\n try:\\n shutil.rmtree(filepath)\\n except OSError:\\n os.remove(filepath)\",\n \"def clearImageCache(self):\\n if os.path.exists(\\\"./cache/\\\"):\\n shutil.rmtree(\\\"./cache/\\\")\",\n \"def delete_test_image(image_field):\\n warnings.warn(DeprecationWarning(\\n \\\"delete_test_image() is deprecated in favour of the \\\"\\n \\\"get_sample_image() context manager.\\\"), stacklevel=2)\\n # ensure all thumbs are deleted\\n for filename in glob.glob(\\n os.path.join(\\n settings.MEDIA_ROOT, 'thumbs', image_field.name.split('/')[-1]\\n ) + '*'\\n ):\\n os.unlink(filename)\\n # delete the saved file\\n image_field.delete()\",\n \"def __del__(self):\\n\\t\\tif self.temp_dir:\\n\\t\\t\\tself.temp_dir.cleanup()\",\n \"def _clean_workdir(self):\\n\\t\\ttoremove = [self._get_config_filepath(), self._get_params_filepath(), self._get_conv_filepath(), self._get_psf_filepath()]\\n\\t\\tfor filepath in toremove:\\n\\t\\t\\tif os.path.exists(filepath):\\t\\n\\t\\t\\t\\tlogger.debug(\\\"Removing existing file %s...\\\" % (filepath))\\n\\t\\t\\t\\tos.remove(filepath)\",\n \"def purge_files(self):\\n run_keyword(\\\"Purge Server Configuration\\\")\\n run_keyword(\\\"Purge Cache Manager Configuration\\\")\\n # TODO: Probably the only sane way to do this is to call\\n # a helper script which runs as root.\\n # run_keyword(\\\"Purge Cache\\\")\\n valid = r'/vicep([a-z]|[a-h][a-z]|i[a-v])$'\\n for vicep in glob.glob(\\\"/vicep*\\\"):\\n if re.match(valid, vicep) and os.path.isdir(vicep):\\n run_keyword(\\\"Purge Directory\\\", \\\"%s/AFSIDat\\\" % vicep)\\n run_keyword(\\\"Purge Directory\\\", \\\"%s/Lock\\\" % vicep)\\n for vheader in glob.glob(\\\"%s/V*.vol\\\" % vicep):\\n run_keyword(\\\"Sudo\\\", \\\"rm -f %s\\\" % vheader)\",\n \"def clean_chunk_files(dirpath):\\n workdir = os.getcwd()\\n os.chdir(dirpath)\\n for filename in glob.glob(\\\"[0-9]*_[0-9]*_[0-9]*.hdf5\\\"):\\n os.remove(filename)\\n os.chdir(workdir)\",\n \"def main(directory=\\\"/images\\\"):\\n dir_path = os.path.dirname(os.path.realpath(__file__))\\n parent_dir = os.path.dirname(dir_path)\\n threshold = 5000\\n start = time.time()\\n num_images = 0\\n for fn in os.listdir(parent_dir + directory):\\n num_images += 1\\n full_path = parent_dir + directory + \\\"/\\\" + fn\\n if os.stat(full_path).st_size < threshold:\\n os.remove(full_path)\\n print(\\\"deleted file\\\", fn)\\n print(\\\"Total files\\\", num_images)\\n curr_time = time.time()\\n print(\\\"Time run so far\\\", round(curr_time - start, \\\"\\\\n\\\"))\\n end = time.time()\\n print(\\\"Time to delete files:\\\", round(end - start), \\\"seconds\\\")\\n print(\\\"Number of images\\\", num_images)\",\n \"def teardown():\\n os.remove('green-dot.tif')\\n os.remove('green-dot.jpg')\\n os.remove('green-dot.png')\",\n \"def _clean_up_temporary_files(dataset_dir):\\n filename = _DATA_URL.split('/')[-1]\\n filepath = os.path.join(dataset_dir, filename)\\n tf.gfile.Remove(filepath)\\n\\n tmp_dir = os.path.join(dataset_dir, 'cifar-100-python')\\n tf.gfile.DeleteRecursively(tmp_dir)\",\n \"def cleanup(self):\\n\\t\\tfor filename in self.cfg_files:\\n\\t\\t\\tif os.path.isfile(filename):\\n\\t\\t\\t\\tsize = os.stat(filename)[6]\\n\\t\\t\\t\\tif size == 0:\\n\\t\\t\\t\\t\\tos.remove(filename)\\n\\n\\t\\treturn True\",\n \"def clean_old_data():\\n logger.info('Cleaning standalone files on disk...')\\n for absolute_path in glob.glob(MEDIA_URL + '*'):\\n file_name = os.path.basename(absolute_path)\\n try:\\n relative_path = os.path.join(AUDIOS_URL, file_name)\\n audio = Audio.objects.get(filename=relative_path)\\n if audio.get_type() == 'episode':\\n try:\\n # If there are inactive audios on its being\\n for e in audio.podcast.episode_set.exclude(pk=audio.podcast.active_episode.pk):\\n if not e.is_active():\\n logger.info('Inactive audio found in podcast set. Erasing files.')\\n e.delete_files()\\n except Exception, e:\\n logger.exception(e.message)\\n except ObjectDoesNotExist, e:\\n logger.info('A file with no audio registered in database')\\n if os.path.isfile(relative_path):\\n logger.info('Erasing: %s' % relative_path)\\n os.remove(relative_path)\\n logger.info('... Done.')\",\n \"def _clean_bins():\\n rmtree(LIBS_DIR)\\n rmtree(BINS_DIR)\\n rmtree(HEADERS_DIR)\",\n \"def clear_outdated_files():\\n for f in os.listdir(MEDIA_ROOT):\\n file_path = os.path.join(MEDIA_ROOT, f)\\n if os.path.isfile(file_path) and os.stat(file_path).st_mtime < time.time() - STORE_PDF_DAYS * 86400:\\n os.remove(file_path)\",\n \"def purge_downloaded_files():\\n for fpath in DOWNLOADED_FILEPATHS:\\n if os.path.exists(fpath):\\n os.remove(fpath)\",\n \"def test_cleanup(self):\\n imgurl = \\\"{}spei03.nc\\\".format(self.processor.base_url)\\n httpretty.register_uri(httpretty.GET, imgurl,\\n body=get_mock_image())\\n self.processor.download(imgurl, 'spei03.tif')\\n self.assertNotEqual([], glob.glob(os.path.join(\\n self.processor.tmp_dir, self.processor.prefix + '*')))\\n self.processor.cleanup()\\n self.assertEquals([], glob.glob(os.path.join(\\n self.processor.tmp_dir, self.processor.prefix + '*')))\",\n \"def cleanup(self):\\n if self.path and os.path.exists(self.path) and not self.dont_remove:\\n rmtree(self.path)\\n del self.path\\n if self in self.instances:\\n self.instances.remove(self)\",\n \"def clear_obsolete_trash():\\n minute_ago = datetime.now() - timedelta(minutes=1)\\n Picture.trash.filter(trashed_time__lt=minute_ago).delete()\",\n \"def cleanup(e):\\n for f in e.files:\\n try:\\n if os.path.isfile(f):\\n os.remove(f)\\n except OSError:\\n continue\\n\\n return\",\n \"def teardown():\\n for filename in files_to_delete:\\n delete_file(filename)\",\n \"def tearDown(self):\\n for d in os.listdir(tmp_dir_path):\\n d_path = os.path.join(tmp_dir_path,d)\\n try:\\n os.remove(d_path)\\n except:\\n for f in os.listdir(d_path):\\n f_path = os.path.join(d_path,f)\\n os.remove(f_path)\\n os.rmdir(d_path)\\n assert os.listdir(tmp_dir_path) == []\",\n \"def test_thumbnail(self):\\n pub = PublicationFactory(thumbnail__filename=\\\"tester.jpg\\\")\\n self.assertEqual(\\n pub.thumbnail.url, f\\\"/media/reading/publications/{pub.slug}/tester.jpg\\\"\\n )\\n self.assertTrue(\\n pub.thumbnail.path.endswith, f\\\"/reading/publications/{pub.slug}/tester.jpg\\\"\\n )\\n\\n # Tidy up:\\n pub.thumbnail.delete()\",\n \"def cleanup(destination_subdir):\\n sp.check_call(f\\\"rm {destination_subdir}/*.bam\\\", shell=True)\\n sp.check_call(f\\\"rm {destination_subdir}/*.sam\\\", shell=True)\\n sp.check_call(f\\\"rm -rf ./index_files\\\", shell=True)\",\n \"def clean(self):\\n print(\\\"Cleaning outputs in %s\\\" % self.args.output)\\n files = glob.glob(self.args.output + \\\"*.pkl\\\")\\n for f in files:\\n if os.path.exists(f):\\n os.remove(f)\",\n \"def purge(self):\\n pass\",\n \"def tearDown(self):\\n if os.path.exists(settings.MEDIA_ROOT):\\n shutil.rmtree(settings.MEDIA_ROOT)\",\n \"def tearDown(self):\\n if os.path.exists(settings.MEDIA_ROOT):\\n shutil.rmtree(settings.MEDIA_ROOT)\",\n \"def cleanup(self):\\n files = self.nlst()\\n latest = self.latest_filename\\n for filename in files:\\n if filename != latest:\\n result = self.delete(filename)\\n logger.info(f\\\"Deleted old export from FTP: {result}\\\")\",\n \"def del_imgs(path):\\n files = os.listdir(path)\\n for file in files:\\n if file.endswith(\\\".jpg\\\"):\\n os.remove(os.path.join(path, file))\",\n \"def clean():\\n for f in [f for f in os.listdir() if f.endswith(\\\".part\\\")]:\\n os.remove(f)\",\n \"def cleanup_intermediate_files(self):\\n self.cmd(\\\"rm -f {local_temp_dir}/*rg_dict* \\\\\\n {local_temp_dir}/*aln* \\\\\\n {local_temp_dir}/snappy*\\\".\\n format(\\n local_temp_dir=self.local_temp_dir\\n ),\\n shell=True)\",\n \"def clean():\\n clean_flatbuffer_binaries()\\n clean_webp_textures()\",\n \"def clean_up_artifacts():\\n logger.info(\\\"Removing artifacts from Sandbox\\\")\\n for item in Analyzer.uploaded:\\n # Perform the delete\\n response = Samples.delete_sample(ids=item)\\n if response[\\\"status_code\\\"] > 201:\\n # File was not removed, log the failure\\n logger.warning(\\\"Failed to delete %s\\\", item)\\n else:\\n logger.debug(\\\"Deleted %s\\\", item)\\n logger.info(\\\"Artifact cleanup complete\\\")\",\n \"def tearDown(self) -> None:\\n filtered = [f for f in glob.glob('steps/tests/test_output/*') if not re.match(r'\\\\.keep', f)]\\n for file in filtered:\\n try:\\n if Path(file).is_dir():\\n shutil.rmtree(file)\\n else:\\n os.remove(file)\\n except PermissionError as pe:\\n # We don't necessarily care that much\\n continue\",\n \"def tearDownClass(self):\\n if (os.path.exists(MEDIA_ROOT+\\\"/gitload_test\\\")):\\n shutil.rmtree(MEDIA_ROOT+\\\"/gitload_test\\\")\",\n \"def cleanup(self):\\r\\n if self.tempDirectory != None:\\r\\n shutil.rmtree(self.tempDirectory, True)\\r\\n self.tempDirectory = None\",\n \"def purge_cache():\\n for (dir_path, dir_names, file_names) in os.walk(CACHE, topdown=False):\\n for file_name in file_names:\\n if is_json_file(file_name):\\n path = os.path.join(dir_path, file_name)\\n print(\\\"Removing file “%s”\\\" % path)\\n os.remove(path)\\n for directory in dir_names:\\n path = os.path.join(dir_path, directory)\\n if not os.listdir(path):\\n print(\\\"Removing directory “%s”\\\" % path)\\n os.rmdir(path)\",\n \"def cleanup():\\n if len(env.releases) > 3:\\n directories = env.releases\\n directories.reverse()\\n del directories[:3]\\n env.directories = ' '.join([ '%(releases_path)s/%(release)s' % { 'releases_path':env.releases_path, 'release':release } for release in directories ])\\n run('rm -rf %(directories)s' % env)\",\n \"def sorl_delete(**kwargs):\\n from sorl.thumbnail import delete\\n delete(kwargs['file'])\",\n \"def purge() -> None:\\r\\n _purge_func(False)\",\n \"def __clean(path, pattern = '.tiff'):\\n for f in os.listdir(path):\\n if re.search(pattern, f):\\n os.remove(os.path.join(path, f))\\n\\n print(\\\"directory cleaned\\\")\",\n \"def remove_thumbnail(inJSON):\\n time.sleep(2)\\n consoleOutput = exec_console_command(\\\"rm \\\" + inJSON + \\\";\\\" + constants.getExitStatus)\\n\\n if \\\"\\\\n1\\\" in consoleOutput:\\n raise IOError(\\\"Thumbnail file doesn't exist to delete. No worries though, it was going to be deleted anyway!\\\")\\n\\n return 0\",\n \"def tearDown(self):\\n account_models.User.objects.all().delete()\\n photo_models.PhotoFeed.objects.all().delete()\\n photo_models.PhotoClassification.objects.filter(name__in=[\\\"Rural\\\", \\\"Abstract\\\", \\\"City\\\"]).delete()\\n test_helpers.clear_directory('backend/media/', '*.jpg')\",\n \"def cleanup_backups():\\n try:\\n yield\\n finally:\\n shutil.rmtree(\\\"tmp/backups\\\")\",\n \"def tearDown(self):\\n for f in os.listdir('/tmp'):\\n if not f.startswith(self.FILE_PREFIX):\\n continue\\n\\n os.remove(os.path.join('/tmp', f))\",\n \"def cleanup(self):\\n\\n # check if the directory exists\\n if not os.path.exists(self.path):\\n return\\n\\n # check if the directory is a directory\\n if not os.path.isdir(self.path):\\n return\\n\\n # loop over content of directory and remove it\\n for the_file in os.listdir(self.path):\\n file_path = os.path.join(self.path, the_file)\\n try:\\n if os.path.isfile(file_path):\\n os.unlink(file_path)\\n elif os.path.isdir(file_path):\\n shutil.rmtree(file_path)\\n except Exception as e:\\n pass\",\n \"def purge_outdated(self):\\n todelete = []\\n sql = \\\"select rowid, path, mtime from pictures\\\"\\n cur = self.con.execute(sql)\\n for rowid, path_str, mtime in cur:\\n if mtime and op.exists(path_str):\\n picture_mtime = os.stat(path_str).st_mtime\\n if int(picture_mtime) <= mtime:\\n # not outdated\\n continue\\n todelete.append(rowid)\\n if todelete:\\n sql = \\\"delete from pictures where rowid in (%s)\\\" % ','.join(map(str, todelete))\\n self.con.execute(sql)\",\n \"def cleanUpTemporaryFiles(options):\\n os.system(\\\"rm \\\"+options.output_directory_per_run+\\\"/*.abundance\\\")\\n os.system(\\\"rm \\\"+options.output_directory_per_run+\\\"/*.phasing_score\\\")\\n os.system(\\\"rm \\\"+options.output_directory_per_run+\\\"/*regionsOfInterest*\\\")\\n os.system(\\\"mv \\\"+options.output_directory_per_run+\\\"/* \\\"+options.output_directory_per_run+\\\"/../\\\")\\n os.system(\\\"rm -rf \\\"+options.output_directory_per_run)\",\n \"def remover_files():\\n directory = os.getcwd()\\n for file_name in glob.glob((\\\"{}/tmp/*\\\").format(directory)):\\n remove(file_name)\",\n \"def _final_cleanup(self):\\n # Clean up and remove the temporary gisdbase\\n self._cleanup()\\n # Remove resource directories\\n if \\\"error\\\" in self.run_state or \\\"terminated\\\" in self.run_state:\\n self.storage_interface.remove_resources()\",\n \"def _clean_up_temporary_files(dataset_dir):\\n return\",\n \"def cleanup(tag, keepimg, builder):\\n manager = Manager('cleanup', tag, keepimg=keepimg,\\n builder_hostname=builder)\\n manager.run()\",\n \"def clean(self, **kwargs):\\n if os.path.exists(self.old_artifact_path):\\n shutil.rmtree(self.old_artifact_path)\\n log.info(\\\"Removing old artifact path: %s\\\" % self.old_artifact_path)\",\n \"def __del__(self):\\n for filename in self.files:\\n unlink(filename)\",\n \"def photo_edit_file_cleanup(sender, **kwargs):\\n instance = kwargs.get('instance')\\n filename = instance.upload.url[1:]\\n if os.path.exists(filename):\\n os.remove(filename)\",\n \"def _purge():\\r\\n _cache.clear()\",\n \"def cleanup(folder):\\n os.system('rm -rf %s/*' % folder)\",\n \"def cleanup(self):\\n\\n if self.debug:\\n print 'Running cleanup()'\\n print 'Starting removing dead links'\\n\\n for root, dirs, files in os.walk(self.tags_folder):\\n if files:\\n for f in files:\\n try:\\n full_path = os.path.join(root, f)\\n if not os.path.exists(os.readlink(full_path)):\\n os.unlink(full_path)\\n if self.debug:\\n print 'Removing dead link %s' % full_path\\n except OSError:\\n pass\\n\\n if self.debug:\\n print 'Starting removing empty directories'\\n self._del_empty_dirs(self.tags_folder)\",\n \"def cleanup(tempdir):\\n try:\\n shutil.rmtree(tempdir)\\n except OSError:\\n pass\",\n \"def _cleanup_uploads(self):\\n logger.debug(\\\"Performing blob upload cleanup\\\")\\n\\n while True:\\n # Find all blob uploads older than the threshold (typically a week) and delete them.\\n with UseThenDisconnect(app.config):\\n stale_upload = model.get_stale_blob_upload(DELETION_DATE_THRESHOLD)\\n if stale_upload is None:\\n logger.debug(\\\"No additional stale blob uploads found\\\")\\n return\\n\\n # Remove the stale upload from storage.\\n logger.debug(\\\"Removing stale blob upload %s\\\", stale_upload.uuid)\\n assert stale_upload.created <= (datetime.utcnow() - DELETION_DATE_THRESHOLD)\\n\\n try:\\n storage.cancel_chunked_upload(\\n [stale_upload.location_name], stale_upload.uuid, stale_upload.storage_metadata\\n )\\n except Exception as ex:\\n logger.debug(\\n \\\"Got error when trying to cancel chunked upload %s: %s\\\",\\n stale_upload.uuid,\\n ex.message,\\n )\\n\\n # Delete the stale upload's row.\\n with UseThenDisconnect(app.config):\\n model.delete_blob_upload(stale_upload)\\n\\n logger.debug(\\\"Removed stale blob upload %s\\\", stale_upload.uuid)\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.7496226","0.70975465","0.6904142","0.6789052","0.65433615","0.64652795","0.64232606","0.6410066","0.635366","0.6340497","0.63255644","0.63222384","0.6308864","0.630171","0.6284883","0.6272671","0.6269268","0.62621397","0.62551665","0.6248571","0.6245241","0.6237175","0.6237087","0.6200791","0.61761653","0.6172708","0.6151164","0.6135021","0.61335015","0.6127233","0.6121967","0.60975504","0.60882884","0.6064728","0.606229","0.60616326","0.6060441","0.6056319","0.6048273","0.6043328","0.6034349","0.6028236","0.601911","0.6018856","0.60187143","0.601212","0.60049516","0.60032994","0.59956187","0.5991564","0.5988041","0.5981097","0.5970333","0.59673053","0.5967051","0.5957385","0.5953738","0.5945983","0.59356385","0.5930897","0.5929818","0.59236217","0.59211504","0.59205663","0.59203655","0.59127027","0.59127027","0.59041286","0.5901309","0.59009284","0.59000945","0.58958435","0.58943784","0.5886687","0.58847445","0.58745676","0.58707833","0.5869204","0.58661675","0.58649737","0.58645016","0.58621603","0.5858841","0.58550274","0.5852865","0.58427393","0.5838059","0.5835754","0.5816422","0.5816223","0.58068424","0.58056927","0.58030945","0.57962143","0.5787214","0.57789904","0.5761854","0.5757138","0.5754514","0.57515055"],"string":"[\n \"0.7496226\",\n \"0.70975465\",\n \"0.6904142\",\n \"0.6789052\",\n \"0.65433615\",\n \"0.64652795\",\n \"0.64232606\",\n \"0.6410066\",\n \"0.635366\",\n \"0.6340497\",\n \"0.63255644\",\n \"0.63222384\",\n \"0.6308864\",\n \"0.630171\",\n \"0.6284883\",\n \"0.6272671\",\n \"0.6269268\",\n \"0.62621397\",\n \"0.62551665\",\n \"0.6248571\",\n \"0.6245241\",\n \"0.6237175\",\n \"0.6237087\",\n \"0.6200791\",\n \"0.61761653\",\n \"0.6172708\",\n \"0.6151164\",\n \"0.6135021\",\n \"0.61335015\",\n \"0.6127233\",\n \"0.6121967\",\n \"0.60975504\",\n \"0.60882884\",\n \"0.6064728\",\n \"0.606229\",\n \"0.60616326\",\n \"0.6060441\",\n \"0.6056319\",\n \"0.6048273\",\n \"0.6043328\",\n \"0.6034349\",\n \"0.6028236\",\n \"0.601911\",\n \"0.6018856\",\n \"0.60187143\",\n \"0.601212\",\n \"0.60049516\",\n \"0.60032994\",\n \"0.59956187\",\n \"0.5991564\",\n \"0.5988041\",\n \"0.5981097\",\n \"0.5970333\",\n \"0.59673053\",\n \"0.5967051\",\n \"0.5957385\",\n \"0.5953738\",\n \"0.5945983\",\n \"0.59356385\",\n \"0.5930897\",\n \"0.5929818\",\n \"0.59236217\",\n \"0.59211504\",\n \"0.59205663\",\n \"0.59203655\",\n \"0.59127027\",\n \"0.59127027\",\n \"0.59041286\",\n \"0.5901309\",\n \"0.59009284\",\n \"0.59000945\",\n \"0.58958435\",\n \"0.58943784\",\n \"0.5886687\",\n \"0.58847445\",\n \"0.58745676\",\n \"0.58707833\",\n \"0.5869204\",\n \"0.58661675\",\n \"0.58649737\",\n \"0.58645016\",\n \"0.58621603\",\n \"0.5858841\",\n \"0.58550274\",\n \"0.5852865\",\n \"0.58427393\",\n \"0.5838059\",\n \"0.5835754\",\n \"0.5816422\",\n \"0.5816223\",\n \"0.58068424\",\n \"0.58056927\",\n \"0.58030945\",\n \"0.57962143\",\n \"0.5787214\",\n \"0.57789904\",\n \"0.5761854\",\n \"0.5757138\",\n \"0.5754514\",\n \"0.57515055\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.7741738"},"document_rank":{"kind":"string","value":"0"}}},{"rowIdx":6082,"cells":{"query":{"kind":"string","value":"Return the list of full paths for files in source directory"},"document":{"kind":"string","value":"def list_of_files(sourcedir, recursive):\n result = list()\n if recursive is False:\n listdir = sorted_listdir(os.listdir(sourcedir))\n if '.nomedia' not in listdir:\n for basename in listdir:\n result.append(os.path.join(sourcedir, basename))\n else:\n for root, dirs, files in os.walk(sourcedir):\n if '.nomedia' not in files:\n for basename in sorted_listdir(files):\n result.append(os.path.join(root, basename))\n return result"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["def get_source_files(self):\n return [\n path.as_posix()\n for path in _Path(self.src_dir).rglob(\"*\")\n if not path.is_dir()\n ] + [\n (path / \"CMakeLists.txt\").as_posix()\n for path in _PurePath(self.src_dir).parents\n ]","def collect_project_source_files():\n source_files = glob.glob(PROJECT_SOURCE_FILES_FOLDER + '/**/*.py', recursive=True)\n # Insert root main.py at the beginning.\n source_files.insert(0, os.path.join(PROJECT_ROOT_FOLDER, 'main.py'))\n return list(map(lambda path: posixpath.join(*path.split('\\\\')), source_files))","def relative_to_buildroot(self):\n return [os.path.join(self.rel_path, source) for source in self.source_paths]","def sources_absolute_paths(self):\r\n abs_target_base = os.path.join(get_buildroot(), self.target_base)\r\n for src in self.sources:\r\n yield os.path.join(abs_target_base, src)","def sources_relative_to_buildroot(self):\r\n for src in self.sources:\r\n yield os.path.join(self.target_base, src)","def get_source_files(dir_name):\n return get_files(dir_name, \".h\") + get_files(dir_name, \".cpp\")","def get_source_file_list(dir):\n extensions = ['h', 'c', 'cc', 'cpp', 'm', 'mm']\n extensions = tuple(['.' + x for x in extensions])\n\n files = set()\n for (dirpath, dirnames, filenames) in os.walk(dir):\n files.update([os.path.join(dirpath, name) for name in filenames if\n name.endswith(extensions)])\n\n return [os.path.abspath(file) for file in files]","def source_dirs_files(fspath, fil=None):\r\n dirs = []\r\n files = []\r\n for child in fspath.listdir(fil=fil):\r\n if child.basename.startswith('.'):\r\n continue\r\n if child.check(dir=True):\r\n dirs.append(child)\r\n elif child.check(file=True):\r\n if child.ext in ['.pyc', '.pyo']:\r\n continue\r\n files.append(child)\r\n return sorted(dirs), sorted(files)","def _get_files(self):\n # pylint: disable=unused-variable\n for dirpath, __, filenames in os.walk(self.start_location):\n for file_ in filenames:\n if file_.endswith('.py'):\n yield \"{0}{1}\".format(dirpath, file_)","def get_path_names(directory):\n paths_without_source = set()\n paths = glob.glob(source + \"**/*.*\", recursive=True)\n for p in paths:\n paths_without_source.add(p.replace(directory, \"\", 1))\n\n return paths_without_source","def getSourcePaths(self, makeGlyphs=True, makeKerning=True, makeInfo=True):\n paths = []\n for name in self.sources.keys():\n paths.append(self.sources[name][0].path)\n return paths","def get_paths(pattern):\n if not in_source_tree:\n pattern = '../' + pattern\n\n files = glob.glob(os.path.normpath(os.path.join(top_dir, pattern)))\n return files","def get_library_content(self):\n from glob import glob\n try:\n os.path.isdir(self.source)\n lst = glob(self.source + '/*')\n except TypeError:\n lst = self.source\n dircheck = True\n while dircheck is True:\n dircheck = False\n newlst = []\n for entry in lst:\n if os.path.isdir(entry):\n newlst.extend(glob(entry + '/*'))\n dircheck = True\n else:\n newlst.append(entry)\n lst = newlst\n return lst","def source_paths(self):\n paths = self.config.get('static_dirs')\n if paths:\n return paths\n return [self.config.get('static_dir')]","def FindCheckerFiles(path):\n if not path:\n Logger.fail(\"No source path provided\")\n elif os.path.isfile(path):\n return [ path ]\n elif os.path.isdir(path):\n foundFiles = []\n for root, dirs, files in os.walk(path):\n for file in files:\n extension = os.path.splitext(file)[1]\n if extension in [\".java\", \".smali\"]:\n foundFiles.append(os.path.join(root, file))\n return foundFiles\n else:\n Logger.fail(\"Source path \\\"\" + path + \"\\\" not found\")","def getFiles(searchDir = './', extension = 'source'):\n from glob import glob \n\n return glob(searchDir+'/*.'+extension)","def get_paths(file_path):\n return glob(path.join(file_path, '*'))","def get_file_list(input_dir):\n\tfile_paths = [input_dir +'/' + f for f in listdir(input_dir) if isfile(join(input_dir, f)) ]\n\treturn file_paths","def expand_source_files(filenames, cwd=None):\n out = []\n for f in expand_globpaths(filenames.split(), cwd):\n if path_utils.isdir(f):\n # If we have a directory, collect all the .py files within it....\n out += recursive_glob(path_utils.join(f, \"**\", \"*.py\"))\n elif f.endswith(\".py\"):\n out.append(f)\n elif is_file_script(f, cwd):\n # .....and only process scripts when specfiied by the user.\n out.append(f)\n\n return set(out)","def get_source_files(self):\n files = []\n for pkg in self._po_packages():\n files.append(pkg['template'])\n files.extend((item['po_file'] for item in\n self._po_package_contents(pkg)))\n return files","def get_all_sources(remit):\n if remit == 'panzer' or remit == 'pandoc':\n os.chdir('source-'+remit)\n sourcelist = [name for name in os.listdir(\".\") if os.path.isdir(name)]\n os.chdir('..')\n else:\n # get the maximal list of sources for a diff\n pandoc_list = get_all_sources('pandoc')\n panzer_list = get_all_sources('panzer')\n sourcelist = list(set(pandoc_list+panzer_list))\n sourcelist.sort()\n return sourcelist","def full_path(startPath,files):\n\n files = list_strings(files)\n base = os.path.split(startPath)[0]\n return [ os.path.join(base,f) for f in files ]","def Get_Source(self):\r\n source_directory = filedialog.askdirectory(initialdir = initial_dir, title=\"Select source folder\")\r\n global source\r\n source = source_directory \r\n self.txt_srcPath.delete(0, 'end')\r\n self.txt_srcPath.insert(0, str(source_directory))\r\n file_type = self.txt_fileType.get()\r\n hrs= int(self.txt_fileAge.get())\r\n file_age = datetime.timedelta(hours=hrs)\r\n global filenames_list\r\n filenames_list = []\r\n global files_list\r\n files_list = []\r\n global ft_list\r\n ft_list = []\r\n for f in glob.iglob(os.path.join(source, file_type)):\r\n files_list = [os.path.splitext(f)[0]]\r\n filenames_list.append(f) \r\n return(filenames_list, source, files_list)","def get_all_files(cwd):\n return os.listdir(cwd)","def walkSource(sourcedir):\n for parent, dnames, fnames in os.walk(sourcedir):\n for fname in fnames:\n if fname not in SKIP_FILES:\n filename = os.path.join(parent, fname)\n if filename.endswith('.java') and os.path.isfile(filename):\n with open(filename, 'r') as f:\n lines = f.readlines()\n yield (lines, fname)","def get_source_files(self):\n return zip(*self.distribution.scripts)[0]","def find_dcds(src):\n\n dcd_paths = []\n\n for root, dirs, files in os.walk(src):\n for filename in files:\n if filename.endswith(\".dcd\"):\n dcd_paths.append(os.path.join(root, filename))\n\n return dcd_paths","def find_src_files(kem_dir):\n for dirpath, _, filenames in os.walk(kem_dir):\n for fn in filenames:\n if fn.endswith('.c'):\n if dirpath != kem_dir:\n ndir = dirpath[len(kem_dir) + 1:]\n yield os.path.join(ndir, fn)\n else:\n yield fn","def search(self, src, exclude_pattern = [\"**/*.pyc\"], include_pattern = [\"**/*.py\"]):\n src = os.path.abspath(src)\n \n _target = Path(src)\n _target._flavour.casefold = lambda x : x # basic windows path don't distinguish upper / lower case.\n allfiles = list(_target.glob(\"**/*\"))\n \n exclude = list()\n for _ex in exclude_pattern:\n exclude += _target.glob(_ex) \n \n include = list()\n for _in in include_pattern:\n include += _target.glob(_in) \n \n _target_path = set(allfiles) - set(exclude) | set(include)\n \n _target_dir_path = sorted(list(x for x in _target_path if x.is_dir() is True))\n _target_file_path = sorted(list(x for x in _target_path if x.is_file() is True))\n \n return _target_dir_path, _target_file_path","def Sources():\n return _sources","def get_source_paths():\r\n script_paths = set()\r\n try:\r\n script_paths.update(filter(None, os.environ.get(PYENV).split(os.pathsep)))\r\n script_paths.update(filter(None, os.environ.get(MELENV).split(os.pathsep)))\r\n except AttributeError:\r\n logger.debug('No custom environ variables set.')\r\n\r\n cwd = os.path.dirname(os.path.abspath(__file__))\r\n for each in os.listdir(cwd):\r\n path = os.path.join(cwd, each)\r\n if not os.path.isdir(path) or each.startswith(EXCLUDE_PATTERNS):\r\n continue\r\n script_paths.add(path)\r\n\r\n return script_paths","def listdir(self, name, source, test_data=()):\n assert isinstance(source, config_types.Path)\n self.m.path.assert_absolute(source)\n result = self._run(\n name, ['listdir', source],\n lambda: self.test_api.listdir(test_data),\n self.m.raw_io.output_text())\n ret = [source.join(x) for x in result.stdout.splitlines()]\n result.presentation.logs['listdir'] = map(str, ret)\n return ret","def getFiles(self):\n\t\treturn os.listdir(self.getPath())","def get_dir_files(self, recursive=False):\n logging.info('Enumerating files under the source path (recursive=%s) ...', recursive)\n files = {}\n if not recursive:\n files[self.path_source] = [\n f for f in os.listdir(self.path_source) if os.path.isfile(os.path.join(self.path_source, f))\n ]\n else:\n for current_dir, sub_dirs, dir_files in os.walk(self.path_source):\n files[os.path.join(self.path_source, current_dir)] = [f for f in dir_files]\n\n return files","def file_list(start_dir):\n file_list = []\n for root, dirs, files in os.walk(start_dir):\n for f in files:\n if f[0] != '.':\n file_list.append(f)\n return file_list","def _get_pyfilelist(srcpath, usegitignore=True) -> list:\n gitignorefile = srcpath / Path(\".gitignore\")\n if usegitignore and gitignorefile.exists():\n with gitignorefile.open('r') as f:\n lines = f.read().splitlines()\n gitignore = [\n srcpath / Path(line)\n for line in lines\n if not line.strip().startswith(\"#\")\n and len(line.strip()) > 1\n and Path(line).suffix == \"\"\n ] + [srcpath / Path(\".git\")]\n viablepaths = [\n p for p in srcpath.glob(\"*/\") if p.is_dir() and p not in gitignore\n ]\n filelist = set().union(*[set(p.glob(\"**/*.py\")) for p in viablepaths])\n filelist = filelist.union(*[set(srcpath.glob('*.py'))])\n else:\n filelist = srcpath.glob(\"**/*.py\")\n return [p.relative_to(srcpath) for p in filelist]","def list_files(startpath):\n for root, _, files in os.walk(startpath):\n for f in files:\n yield os.path.join(root, f)","def list_sources(config, base_dir, verbose=False):\n for source in config.sources_under(abspath(base_dir)):\n if verbose:\n print(\"# %s (%s)\" % (source.nicedir, ' '.join(source.info)))\n else:\n print(source.nicedir)","def filePaths(directory_with_files):\n\n # get a list of file names in directory\n list_of_files = os.listdir(directory_with_files) \n\n # join directory path and file name to get full paths to files\n filepaths = [os.path.join(directory_with_files, filename) for filename in list_of_files]\n\n return filepaths","def files(self):\n self._printer('\\tFiles Walk')\n for directory in self.directory:\n for path in os.listdir(directory):\n full_path = os.path.join(directory, path)\n if os.path.isfile(full_path):\n if not path.startswith('.'):\n self.filepaths.append(full_path)\n return self._get_filepaths()","def find_all_files(self):\n look4files = [ f for f in listdir(self.file_location) if isfile(join(self.file_location,f)) ]\n return look4files","def collect_source_hpp_files(self):\n for pattern in self.package_info.source_hpp_patterns:\n for filename in fnmatch.filter(self.source_hpp_files, pattern):\n self.package_info.source_hpp_files.append(os.path.basename(filename))\n self.source_dirs.add(os.path.abspath(os.path.dirname(filename)))\n\n for root, _, filenames in os.walk(self.source_root, followlinks=True):\n for pattern in self.package_info.source_hpp_patterns:\n for filename in fnmatch.filter(filenames, pattern):\n if \"pybindx\" not in filename:\n self.package_info.source_hpp_files.append(os.path.join(root, filename))\n self.package_info.source_hpp_files = [path for path in self.package_info.source_hpp_files\n if self.wrapper_root not in path]","def get_file_paths():\n audio_folder = MY_DIR + '/assets'\n\n audio_addy_list = []\n for file in os.scandir(audio_folder):\n audio_addy_list.append(file.path)\n\n return audio_addy_list","def compile_files(root):\n files = [os.path.join(root, f) for f in os.listdir(root) if not f.startswith(\".\")]\n \n return files","def get_file_list(path: str) -> list:\n\treturn [f for f in listdir(path) if isfile(join(path, f))]","def get_paths(input_folder):\n list_files = []\n conll_folder = glob.glob(input_folder + '/*.json')\n \n for filename in conll_folder:\n list_files.append(filename)\n\n return list_files","def getBaseSrcFile(self) -> List[int]:\n ...","def filepaths(self, langs) -> Generator[str, None, None]:\n for pv in self.projects(langs):\n yield from pv.filepaths()","def findFiles(target, path):\r\n\tfiles = []\r\n\tlyst = os.listdir(path)\r\n\tfor element in lyst:\r\n\t\tif os.path.isfile(element):\r\n\t\t\tif target in element:\r\n\t\t\t\tfiles.append(path + os.sep + element)\r\n\t\telse:\r\n\t\t\tos.chdir(element)\r\n\t\t\tfiles.extend(findFiles(target, os.getcwd()))\r\n\t\t\tos.chdir(\"..\")\r\n\treturn files","def get_files_paths(self):\n return self.__files_paths","def _get_target_files(self) -> List[Path]:\n repo = get_git_repo()\n submodules = repo.submodules # type: ignore\n submodule_paths = [\n self._fname_to_path(repo, submodule.path) for submodule in submodules\n ]\n\n # resolve given paths relative to current working directory\n paths = [p.resolve() for p in self._paths]\n if self._base_commit is not None:\n paths = [\n a\n for a in (self._status.added + self._status.modified)\n # diff_path is a subpath of some element of input_paths\n if any((a == path or path in a.parents) for path in paths)\n ]\n changed_count = len(paths)\n click.echo(f\"| looking at {unit_len(paths, 'changed path')}\", err=True)\n paths = [\n path\n for path in paths\n if all(\n submodule_path not in path.parents\n for submodule_path in submodule_paths\n )\n ]\n if len(paths) != changed_count:\n click.echo(\n f\"| skipping files in {unit_len(submodule_paths, 'submodule')}: \"\n + \", \".join(str(path) for path in submodule_paths),\n err=True,\n )\n\n # Filter out ignore rules, expand directories\n self._ignore_rules_file.seek(0)\n patterns = Parser(self._base_path).parse(self._ignore_rules_file)\n\n file_ignore = FileIgnore(\n base_path=self._base_path, patterns=patterns, target_paths=paths\n )\n\n walked_entries = list(file_ignore.entries())\n click.echo(\n f\"| found {unit_len(walked_entries, 'file')} in the paths to be scanned\",\n err=True,\n )\n filtered: List[Path] = []\n for elem in walked_entries:\n if elem.survives:\n filtered.append(elem.path)\n\n skipped_count = len(walked_entries) - len(filtered)\n if skipped_count:\n click.echo(\n f\"| skipping {unit_len(range(skipped_count), 'file')} based on path ignore rules\",\n err=True,\n )\n\n relative_paths = [path.relative_to(self._base_path) for path in filtered]\n\n return relative_paths","def get_image_path(raw_input_dir: str) -> list:\n result = []\n for root, dirs, files in os.walk(raw_input_dir):\n for file in files:\n result.append(os.path.join(root, file))\n return result","def files_in( d ):\n return [ join(d,f) for f in os.listdir(d) if isfile(join(d,f)) ]","def filepaths(self):\n pass","def get_sources(config, base_dir, exclude_submodules=False):\n for i, source in enumerate(config.sources_under(abspath(base_dir))):\n if i != 0:\n print\n log.info(\"# source %s (%s)\", source.nicedir,\n ' '.join(source.info))\n source.get(exclude_submodules)","def get_files(self) -> list:\n files = []\n for file in os.listdir(self.root):\n if file.endswith(f\".{self.suffix}\"):\n files.append(os.path.join(self.root, file))\n return files","def getContentFiles():\n contentFiles = []\n for contentDir, subDirs, filenames in os.walk(sourceDir, followlinks=True):\n if shouldIgnore(contentDir):\n subDirs[:] = []\n continue\n for filename in filenames:\n if not shouldIgnore(filename):\n cf = ContentFile(os.path.join(contentDir, filename))\n log(`cf.path`)\n contentFiles.append(cf)\n return contentFiles","def _get_file_paths(self, ignored_exts: Optional[Set[str]]) -> List[str]:\n dir_path = os.path.join(self._target_dir, '**')\n all_paths = glob.glob(dir_path, recursive=True)\n if ignored_exts is None:\n return [p for p in all_paths if os.path.isfile(p)]\n file_paths = [p for p in all_paths if self._extr_ext(p) not in ignored_exts]\n return [p for p in file_paths if os.path.isfile(p)]","def discover(self):\n ids = []\n for f in os.listdir(self.dirname):\n if self.file_prefix in f:\n ids.append(self.inv_filename(f))\n return sorted(ids)","def files_in_dir(path):\n return os.listdir(path)","def pdbfile_list():\n import glob, os\n os.chdir(\"../Data\")\n file_list = []\n for file in glob.glob(\"*.pdb\"):\n file_list.append(file)\n return file_list","def glob_paths(self, name, source, pattern, test_data=()):\n assert isinstance(source, config_types.Path)\n result = self._run(\n name, ['glob', source, pattern],\n lambda: self.test_api.glob_paths(test_data),\n self.m.raw_io.output_text())\n ret = [source.join(*x.split(self.m.path.sep))\n for x in result.stdout.splitlines()]\n result.presentation.logs[\"glob\"] = map(str, ret)\n return ret","def get_c_files(path):\n clist = []\n for file in os.listdir(path):\n if file.endswith(\".cc\") or file.endswith(\".c\"):\n clist.append(\"%s/%s\" % (path, file))\n return clist","def get_all_fullpaths(self):\n files = []\n for mf in self.manifests:\n files.extend(self.manifests[mf].get_fullpaths())\n return files","def get_my_files():\n return [file for file in os.listdir(os.getcwd()) if os.path.isfile(file)]","def _get_paths():\n paths = [\n '/'\n ]\n return paths","def _find_files(root_dir, should_include):\n paths = [] # Return value.\n\n is_module = lambda path: path.endswith(\".py\")\n\n # os.walk() is new in Python 2.3\n # http://docs.python.org/library/os.html#os.walk\n for dir_path, dir_names, file_names in os.walk(root_dir):\n new_paths = [os.path.join(dir_path, file_name) for file_name in file_names]\n new_paths = filter(is_module, new_paths)\n new_paths = filter(should_include, new_paths)\n paths.extend(new_paths)\n\n return paths","def find_data_files_distutils(self, package, src_dir):\n from glob import glob\n import os\n from distutils.util import convert_path\n\n globs = (self.package_data.get('', [])\n + self.package_data.get(package, []))\n files = []\n for pattern in globs:\n # Each pattern has to be converted to a platform-specific path\n filelist = glob(os.path.join(src_dir, convert_path(pattern)))\n # Files that match more than one pattern are only added once\n files.extend([fn for fn in filelist if fn not in files\n and (os.path.isfile(fn) or os.path.islink(fn))])\n return files","def list_of_files(path):\r\n files_list=[]\r\n path = os.path.abspath(path)\r\n\r\n #if the path is a file name, returns a list of a single file name\r\n if os.path.isfile(path):\r\n files_list.append(path)\r\n #if the path is a directory name, returns a list of all the file names anded with .asm\r\n else:\r\n for file in os.listdir(path):\r\n if file.endswith(\".asm\"):\r\n files_list.append(os.path.join(path, file))\r\n return files_list","def files_in_dir(root_dir):\n file_set = set()\n\n for dir_, _, files in os.walk(root_dir):\n for file_name in files:\n rel_dir = os.path.relpath(dir_, root_dir)\n rel_file = os.path.join(rel_dir, file_name)\n file_set.add(rel_file)\n\n return [Path(PureWindowsPath(f)) for f in file_set]","def _get_files_list(self):\n ts_filepaths = []\n conn_filepaths = []\n ts_filepaths_from_dir = sorted(os.listdir(self.ts_dir))\n conn_filepaths_from_dir = sorted(os.listdir(self.conn_dir))\n for sub_id in self.ids:\n for ts_file in ts_filepaths_from_dir:\n if sub_id in ts_file:\n ts_filepaths += [os.path.join(self.ts_dir, ts_file)]\n ts_filepaths_from_dir.remove(ts_file)\n break\n for conn_file in conn_filepaths_from_dir:\n if sub_id in conn_file:\n conn_filepaths += [os.path.join(self.conn_dir, conn_file)]\n conn_filepaths_from_dir.remove(conn_file)\n break\n\n return ts_filepaths, conn_filepaths","def __get_sources__(self):\n\n # Let's go to the Apt temporal dir.\n os.chdir(self.conf['AptTmp'])\n\n # Define a global Source file, all the *_Sources files are going to be in this file.\n global_sources_file = open(self.conf['CodeName'] + '_Sources', 'w')\n\n\t\t# The main/debian-installer is in main, so remove it.\n\t\tcomponents = self.conf['Components']\n\t\tif 'main/debian-installer' in components:\n\t\t\tcomponents.remove('main/debian-installer')\n\n # For every component defined...\n for component in components:\n # Download the Packages.gz file\n file = self.__get_packages_file__(self.conf[\"Mirror\"], \\\n \"%s_%s_Sources\" % (self.conf['CodeName'], component), \\\n component, \"source\" + \"/Sources.gz\")\n\n # \"cat\" it into the global_packages_file\n for line in file:\n print >>global_sources_file, line,\n file.close()\n\n\t\tglobal_sources_file.close()\n\t\treturn open(self.conf['CodeName'] + '_Sources', 'r')","def GetAllFilepaths(root_directory):\n path_list = []\n for dirpath, _, filenames in os.walk(root_directory):\n for filename in filenames:\n path_list.append(os.path.abspath(os.path.join(dirpath, filename)))\n return path_list","def get_directories():\n # get current working dir\n directory = os.getcwd()\n # list of dir to look in repo for files\n directories = [\n directory,\n os.path.expanduser(os.path.join(directory, 'src')),\n os.path.expanduser(os.path.join(directory, 'tests'))\n ]\n return directories","def get_file_list(start):\n valid_files = []\n for root, dirs, files in os.walk(start):\n for name in files:\n if name[-5:] == \".conf\":\n valid_files.append(os.path.join(root,name))\n return valid_files","def files(self) -> Generator[Path, None, None]:\n return Path(self.package).resolve(strict=True).glob(self.glob)","def get_target_files(self, src_dir, src_pattern):\n return File().get_target_files(src_dir, src_pattern)","def fullpathlist(path):\n try:\n return [os.path.join(path, filename) for filename in os.listdir(path)]\n except OSError:\n return []","def files(self):\r\n files = []\r\n for path in self.paths:\r\n if os.path.isdir(path):\r\n files.extend(glob.glob(os.path.join(path, f'*{self.ext}')))\r\n else:\r\n files.extend(glob.glob(path))\r\n return list(set(self.get_pattern(fname) for fname in files))","def find_files(self, destination):\n for root, dirs, files in os.walk(destination):\n for f in files:\n if (f.endswith('.scss') or f.endswith('.sass')) and not f.startswith('_'):\n yield os.path.join(root, f)","def list_filenames(self):\n l = []\n for path, dirs, files in os.walk(self.archive_path):\n for file in files:\n l.append(os.path.relpath(os.path.join(path,file),self.archive_path))\n l.sort()\n return l","def pdbfile_list():\n \n import glob, os\n os.chdir(\"../Data\")\n file_list = []\n for file in glob.glob(\"*.pdb\"):\n file_list.append(file)\n return file_list","def get_files(self) -> tp.Iterable[str]:\n return os.listdir(self.path)","def _get_sources_and_includes(dirs_list):\n sources = []\n includes = []\n for directory in dirs_list:\n source_dir = join(os.path.dirname(os.path.realpath(__file__)),\n directory, 'src')\n for source in os.listdir(source_dir):\n sources.append(join(source_dir, source))\n includes.append(join(directory, 'include'))\n return sources, includes","def get_req_file_list_pvd(source_pvd):\n flist = []\n flist.append(source_pvd)\n\n src_dir = os.path.dirname(source_pvd)\n source_tree = ET.parse(source_pvd)\n elems = source_tree.findall('.//DataSet')\n for e in elems:\n subfile = e.get('file')\n sub_fullpath = os.path.join(src_dir, subfile)\n sub_full_dir = os.path.dirname(sub_fullpath)\n flist.append(sub_fullpath)\n sub_tree = ET.parse(sub_fullpath)\n subelems = sub_tree.findall('.//Piece')\n for e2 in subelems:\n leaf = e2.get('Source')\n leaf_path = os.path.join(sub_full_dir, leaf)\n flist.append(leaf_path)\n return flist","def GetSrc():\n return os.path.abspath(os.path.join(_THIS_DIR, os.pardir, os.pardir,\n os.pardir))","def source_list(self):\n return self._source_list","def source_list(self):\n return self._source_list","def local_paths(self) -> List[Path]:\n return self._local_paths","def orig_filepath_list(filename_list, src_path):\n orig_filepaths = list([])\n i = 0\n for filename in filename_list:\n orig_filepaths.append(src_path + filename_list[i])\n i += 1\n return orig_filepaths","def BuildOldFilesList(self, source_file_name):\n default_source = os.path.join(self._tool_dir, source_file_name)\n if os.path.exists(default_source):\n file_list = open(default_source).readlines()\n else:\n print 'WARNING: No default %s list found at %s' % (source_file_name,\n default_source)\n file_list = []\n file_list = [f.strip() for f in file_list]\n file_list.extend(self.GetExtraFiles(self.options.extra_archive_paths,\n source_file_name))\n file_list = archive_utils.ExpandWildcards(self._build_dir, file_list)\n return file_list","def get_replay_source_helper_paths(self):\n\n if self.replay_source is None:\n return None\n\n paths = []\n classes = self.get_helpers_classes()\n\n base_path = self.base_folder_path + \"/data/replay_images/\" + self.replay_source + \"/\"\n for hc in classes:\n current_paths = []\n for c in hc:\n path = base_path + str(c).zfill(2) + \".tfrecord\"\n current_paths.append(path)\n paths.append(current_paths)\n return paths","def path_generator(initial_root):\n for root, dirs, files in os.walk(initial_root):\n paths = [os.path.join(root, name) for name in files]\n return paths","def get_replay_source_no_helper_paths(self):\n paths = []\n classes = self.get_replay_classes_no_helper()\n base_path = self.base_folder_path + \"/data/replay_images/\" + self.replay_source + \"/\"\n\n \n for c in classes:\n full_path = base_path + str(c).zfill(2) + \".tfrecord\"\n paths.append(full_path)\n \n return paths","def sources(self):\n return self._sources.keys()","def expand_files(self, recursive=True, include_buildfile=True):\r\n\r\n files = []\r\n\r\n def _expand(target):\r\n files.extend([os.path.abspath(os.path.join(target.target_base, s))\r\n for s in (target.sources or [])])\r\n if include_buildfile:\r\n files.append(target.address.buildfile.full_path)\r\n if recursive:\r\n for dep in target.dependencies:\r\n if isinstance(dep, TargetWithSources):\r\n _expand(dep)\r\n elif hasattr(dep, 'address'):\r\n # Don't know what it is, but we'll include the BUILD file to be paranoid\r\n files.append(dep.address.buildfile.full_path)\r\n\r\n _expand(self)\r\n return files","def _get_code_files(self):\n for dirpath, dirnames, filenames in os.walk(self.CodesDirectory):\n for f in filenames:\n rel_name = path.join(dirpath, f)\n if f.endswith('.py'):\n yield (rel_name, 'Python')\n elif f.endswith('.pyx'):\n yield (rel_name, 'PyRex')\n elif f.endswith('.c'):\n yield (rel_name, 'C')\n else:\n pass","def buildListOfFiles(searchGlob):\n return [fpath for fpath in glob2.iglob(searchGlob) if os.path.isfile(fpath)]","def FindSources(env, dest, source, suffixes=None):\n for source_entry in env.Flatten(source):\n if type(source_entry) == str:\n # Search for matches for each source entry\n source_nodes = env.Glob(source_entry)\n else:\n # Source entry is already a file or directory node; no need to glob it\n source_nodes = [source_entry]\n for s in source_nodes:\n if str(s.__class__) == 'SCons.Node.FS.Dir':\n # Recursively search subdir. Since glob('*') doesn't match dot files,\n # also glob('.*').\n FindSources(env, dest, [s.abspath + '/*', s.abspath + '/.*'],\n suffixes)\n elif suffixes and s.suffix in suffixes:\n dest.add(s)","def _deleted_sources(self):\r\n # We compute the list lazily.\r\n if self._lazy_deleted_sources is None:\r\n with self.context.new_workunit('find-deleted-sources'):\r\n if os.path.exists(self._analysis_file):\r\n products = self._analysis_parser.parse_products_from_path(self._analysis_file)\r\n buildroot = get_buildroot()\r\n old_sources = products.keys() # Absolute paths.\r\n self._lazy_deleted_sources = [os.path.relpath(src, buildroot) for src in old_sources\r\n if not os.path.exists(src)]\r\n else:\r\n self._lazy_deleted_sources = []\r\n return self._lazy_deleted_sources"],"string":"[\n \"def get_source_files(self):\\n return [\\n path.as_posix()\\n for path in _Path(self.src_dir).rglob(\\\"*\\\")\\n if not path.is_dir()\\n ] + [\\n (path / \\\"CMakeLists.txt\\\").as_posix()\\n for path in _PurePath(self.src_dir).parents\\n ]\",\n \"def collect_project_source_files():\\n source_files = glob.glob(PROJECT_SOURCE_FILES_FOLDER + '/**/*.py', recursive=True)\\n # Insert root main.py at the beginning.\\n source_files.insert(0, os.path.join(PROJECT_ROOT_FOLDER, 'main.py'))\\n return list(map(lambda path: posixpath.join(*path.split('\\\\\\\\')), source_files))\",\n \"def relative_to_buildroot(self):\\n return [os.path.join(self.rel_path, source) for source in self.source_paths]\",\n \"def sources_absolute_paths(self):\\r\\n abs_target_base = os.path.join(get_buildroot(), self.target_base)\\r\\n for src in self.sources:\\r\\n yield os.path.join(abs_target_base, src)\",\n \"def sources_relative_to_buildroot(self):\\r\\n for src in self.sources:\\r\\n yield os.path.join(self.target_base, src)\",\n \"def get_source_files(dir_name):\\n return get_files(dir_name, \\\".h\\\") + get_files(dir_name, \\\".cpp\\\")\",\n \"def get_source_file_list(dir):\\n extensions = ['h', 'c', 'cc', 'cpp', 'm', 'mm']\\n extensions = tuple(['.' + x for x in extensions])\\n\\n files = set()\\n for (dirpath, dirnames, filenames) in os.walk(dir):\\n files.update([os.path.join(dirpath, name) for name in filenames if\\n name.endswith(extensions)])\\n\\n return [os.path.abspath(file) for file in files]\",\n \"def source_dirs_files(fspath, fil=None):\\r\\n dirs = []\\r\\n files = []\\r\\n for child in fspath.listdir(fil=fil):\\r\\n if child.basename.startswith('.'):\\r\\n continue\\r\\n if child.check(dir=True):\\r\\n dirs.append(child)\\r\\n elif child.check(file=True):\\r\\n if child.ext in ['.pyc', '.pyo']:\\r\\n continue\\r\\n files.append(child)\\r\\n return sorted(dirs), sorted(files)\",\n \"def _get_files(self):\\n # pylint: disable=unused-variable\\n for dirpath, __, filenames in os.walk(self.start_location):\\n for file_ in filenames:\\n if file_.endswith('.py'):\\n yield \\\"{0}{1}\\\".format(dirpath, file_)\",\n \"def get_path_names(directory):\\n paths_without_source = set()\\n paths = glob.glob(source + \\\"**/*.*\\\", recursive=True)\\n for p in paths:\\n paths_without_source.add(p.replace(directory, \\\"\\\", 1))\\n\\n return paths_without_source\",\n \"def getSourcePaths(self, makeGlyphs=True, makeKerning=True, makeInfo=True):\\n paths = []\\n for name in self.sources.keys():\\n paths.append(self.sources[name][0].path)\\n return paths\",\n \"def get_paths(pattern):\\n if not in_source_tree:\\n pattern = '../' + pattern\\n\\n files = glob.glob(os.path.normpath(os.path.join(top_dir, pattern)))\\n return files\",\n \"def get_library_content(self):\\n from glob import glob\\n try:\\n os.path.isdir(self.source)\\n lst = glob(self.source + '/*')\\n except TypeError:\\n lst = self.source\\n dircheck = True\\n while dircheck is True:\\n dircheck = False\\n newlst = []\\n for entry in lst:\\n if os.path.isdir(entry):\\n newlst.extend(glob(entry + '/*'))\\n dircheck = True\\n else:\\n newlst.append(entry)\\n lst = newlst\\n return lst\",\n \"def source_paths(self):\\n paths = self.config.get('static_dirs')\\n if paths:\\n return paths\\n return [self.config.get('static_dir')]\",\n \"def FindCheckerFiles(path):\\n if not path:\\n Logger.fail(\\\"No source path provided\\\")\\n elif os.path.isfile(path):\\n return [ path ]\\n elif os.path.isdir(path):\\n foundFiles = []\\n for root, dirs, files in os.walk(path):\\n for file in files:\\n extension = os.path.splitext(file)[1]\\n if extension in [\\\".java\\\", \\\".smali\\\"]:\\n foundFiles.append(os.path.join(root, file))\\n return foundFiles\\n else:\\n Logger.fail(\\\"Source path \\\\\\\"\\\" + path + \\\"\\\\\\\" not found\\\")\",\n \"def getFiles(searchDir = './', extension = 'source'):\\n from glob import glob \\n\\n return glob(searchDir+'/*.'+extension)\",\n \"def get_paths(file_path):\\n return glob(path.join(file_path, '*'))\",\n \"def get_file_list(input_dir):\\n\\tfile_paths = [input_dir +'/' + f for f in listdir(input_dir) if isfile(join(input_dir, f)) ]\\n\\treturn file_paths\",\n \"def expand_source_files(filenames, cwd=None):\\n out = []\\n for f in expand_globpaths(filenames.split(), cwd):\\n if path_utils.isdir(f):\\n # If we have a directory, collect all the .py files within it....\\n out += recursive_glob(path_utils.join(f, \\\"**\\\", \\\"*.py\\\"))\\n elif f.endswith(\\\".py\\\"):\\n out.append(f)\\n elif is_file_script(f, cwd):\\n # .....and only process scripts when specfiied by the user.\\n out.append(f)\\n\\n return set(out)\",\n \"def get_source_files(self):\\n files = []\\n for pkg in self._po_packages():\\n files.append(pkg['template'])\\n files.extend((item['po_file'] for item in\\n self._po_package_contents(pkg)))\\n return files\",\n \"def get_all_sources(remit):\\n if remit == 'panzer' or remit == 'pandoc':\\n os.chdir('source-'+remit)\\n sourcelist = [name for name in os.listdir(\\\".\\\") if os.path.isdir(name)]\\n os.chdir('..')\\n else:\\n # get the maximal list of sources for a diff\\n pandoc_list = get_all_sources('pandoc')\\n panzer_list = get_all_sources('panzer')\\n sourcelist = list(set(pandoc_list+panzer_list))\\n sourcelist.sort()\\n return sourcelist\",\n \"def full_path(startPath,files):\\n\\n files = list_strings(files)\\n base = os.path.split(startPath)[0]\\n return [ os.path.join(base,f) for f in files ]\",\n \"def Get_Source(self):\\r\\n source_directory = filedialog.askdirectory(initialdir = initial_dir, title=\\\"Select source folder\\\")\\r\\n global source\\r\\n source = source_directory \\r\\n self.txt_srcPath.delete(0, 'end')\\r\\n self.txt_srcPath.insert(0, str(source_directory))\\r\\n file_type = self.txt_fileType.get()\\r\\n hrs= int(self.txt_fileAge.get())\\r\\n file_age = datetime.timedelta(hours=hrs)\\r\\n global filenames_list\\r\\n filenames_list = []\\r\\n global files_list\\r\\n files_list = []\\r\\n global ft_list\\r\\n ft_list = []\\r\\n for f in glob.iglob(os.path.join(source, file_type)):\\r\\n files_list = [os.path.splitext(f)[0]]\\r\\n filenames_list.append(f) \\r\\n return(filenames_list, source, files_list)\",\n \"def get_all_files(cwd):\\n return os.listdir(cwd)\",\n \"def walkSource(sourcedir):\\n for parent, dnames, fnames in os.walk(sourcedir):\\n for fname in fnames:\\n if fname not in SKIP_FILES:\\n filename = os.path.join(parent, fname)\\n if filename.endswith('.java') and os.path.isfile(filename):\\n with open(filename, 'r') as f:\\n lines = f.readlines()\\n yield (lines, fname)\",\n \"def get_source_files(self):\\n return zip(*self.distribution.scripts)[0]\",\n \"def find_dcds(src):\\n\\n dcd_paths = []\\n\\n for root, dirs, files in os.walk(src):\\n for filename in files:\\n if filename.endswith(\\\".dcd\\\"):\\n dcd_paths.append(os.path.join(root, filename))\\n\\n return dcd_paths\",\n \"def find_src_files(kem_dir):\\n for dirpath, _, filenames in os.walk(kem_dir):\\n for fn in filenames:\\n if fn.endswith('.c'):\\n if dirpath != kem_dir:\\n ndir = dirpath[len(kem_dir) + 1:]\\n yield os.path.join(ndir, fn)\\n else:\\n yield fn\",\n \"def search(self, src, exclude_pattern = [\\\"**/*.pyc\\\"], include_pattern = [\\\"**/*.py\\\"]):\\n src = os.path.abspath(src)\\n \\n _target = Path(src)\\n _target._flavour.casefold = lambda x : x # basic windows path don't distinguish upper / lower case.\\n allfiles = list(_target.glob(\\\"**/*\\\"))\\n \\n exclude = list()\\n for _ex in exclude_pattern:\\n exclude += _target.glob(_ex) \\n \\n include = list()\\n for _in in include_pattern:\\n include += _target.glob(_in) \\n \\n _target_path = set(allfiles) - set(exclude) | set(include)\\n \\n _target_dir_path = sorted(list(x for x in _target_path if x.is_dir() is True))\\n _target_file_path = sorted(list(x for x in _target_path if x.is_file() is True))\\n \\n return _target_dir_path, _target_file_path\",\n \"def Sources():\\n return _sources\",\n \"def get_source_paths():\\r\\n script_paths = set()\\r\\n try:\\r\\n script_paths.update(filter(None, os.environ.get(PYENV).split(os.pathsep)))\\r\\n script_paths.update(filter(None, os.environ.get(MELENV).split(os.pathsep)))\\r\\n except AttributeError:\\r\\n logger.debug('No custom environ variables set.')\\r\\n\\r\\n cwd = os.path.dirname(os.path.abspath(__file__))\\r\\n for each in os.listdir(cwd):\\r\\n path = os.path.join(cwd, each)\\r\\n if not os.path.isdir(path) or each.startswith(EXCLUDE_PATTERNS):\\r\\n continue\\r\\n script_paths.add(path)\\r\\n\\r\\n return script_paths\",\n \"def listdir(self, name, source, test_data=()):\\n assert isinstance(source, config_types.Path)\\n self.m.path.assert_absolute(source)\\n result = self._run(\\n name, ['listdir', source],\\n lambda: self.test_api.listdir(test_data),\\n self.m.raw_io.output_text())\\n ret = [source.join(x) for x in result.stdout.splitlines()]\\n result.presentation.logs['listdir'] = map(str, ret)\\n return ret\",\n \"def getFiles(self):\\n\\t\\treturn os.listdir(self.getPath())\",\n \"def get_dir_files(self, recursive=False):\\n logging.info('Enumerating files under the source path (recursive=%s) ...', recursive)\\n files = {}\\n if not recursive:\\n files[self.path_source] = [\\n f for f in os.listdir(self.path_source) if os.path.isfile(os.path.join(self.path_source, f))\\n ]\\n else:\\n for current_dir, sub_dirs, dir_files in os.walk(self.path_source):\\n files[os.path.join(self.path_source, current_dir)] = [f for f in dir_files]\\n\\n return files\",\n \"def file_list(start_dir):\\n file_list = []\\n for root, dirs, files in os.walk(start_dir):\\n for f in files:\\n if f[0] != '.':\\n file_list.append(f)\\n return file_list\",\n \"def _get_pyfilelist(srcpath, usegitignore=True) -> list:\\n gitignorefile = srcpath / Path(\\\".gitignore\\\")\\n if usegitignore and gitignorefile.exists():\\n with gitignorefile.open('r') as f:\\n lines = f.read().splitlines()\\n gitignore = [\\n srcpath / Path(line)\\n for line in lines\\n if not line.strip().startswith(\\\"#\\\")\\n and len(line.strip()) > 1\\n and Path(line).suffix == \\\"\\\"\\n ] + [srcpath / Path(\\\".git\\\")]\\n viablepaths = [\\n p for p in srcpath.glob(\\\"*/\\\") if p.is_dir() and p not in gitignore\\n ]\\n filelist = set().union(*[set(p.glob(\\\"**/*.py\\\")) for p in viablepaths])\\n filelist = filelist.union(*[set(srcpath.glob('*.py'))])\\n else:\\n filelist = srcpath.glob(\\\"**/*.py\\\")\\n return [p.relative_to(srcpath) for p in filelist]\",\n \"def list_files(startpath):\\n for root, _, files in os.walk(startpath):\\n for f in files:\\n yield os.path.join(root, f)\",\n \"def list_sources(config, base_dir, verbose=False):\\n for source in config.sources_under(abspath(base_dir)):\\n if verbose:\\n print(\\\"# %s (%s)\\\" % (source.nicedir, ' '.join(source.info)))\\n else:\\n print(source.nicedir)\",\n \"def filePaths(directory_with_files):\\n\\n # get a list of file names in directory\\n list_of_files = os.listdir(directory_with_files) \\n\\n # join directory path and file name to get full paths to files\\n filepaths = [os.path.join(directory_with_files, filename) for filename in list_of_files]\\n\\n return filepaths\",\n \"def files(self):\\n self._printer('\\\\tFiles Walk')\\n for directory in self.directory:\\n for path in os.listdir(directory):\\n full_path = os.path.join(directory, path)\\n if os.path.isfile(full_path):\\n if not path.startswith('.'):\\n self.filepaths.append(full_path)\\n return self._get_filepaths()\",\n \"def find_all_files(self):\\n look4files = [ f for f in listdir(self.file_location) if isfile(join(self.file_location,f)) ]\\n return look4files\",\n \"def collect_source_hpp_files(self):\\n for pattern in self.package_info.source_hpp_patterns:\\n for filename in fnmatch.filter(self.source_hpp_files, pattern):\\n self.package_info.source_hpp_files.append(os.path.basename(filename))\\n self.source_dirs.add(os.path.abspath(os.path.dirname(filename)))\\n\\n for root, _, filenames in os.walk(self.source_root, followlinks=True):\\n for pattern in self.package_info.source_hpp_patterns:\\n for filename in fnmatch.filter(filenames, pattern):\\n if \\\"pybindx\\\" not in filename:\\n self.package_info.source_hpp_files.append(os.path.join(root, filename))\\n self.package_info.source_hpp_files = [path for path in self.package_info.source_hpp_files\\n if self.wrapper_root not in path]\",\n \"def get_file_paths():\\n audio_folder = MY_DIR + '/assets'\\n\\n audio_addy_list = []\\n for file in os.scandir(audio_folder):\\n audio_addy_list.append(file.path)\\n\\n return audio_addy_list\",\n \"def compile_files(root):\\n files = [os.path.join(root, f) for f in os.listdir(root) if not f.startswith(\\\".\\\")]\\n \\n return files\",\n \"def get_file_list(path: str) -> list:\\n\\treturn [f for f in listdir(path) if isfile(join(path, f))]\",\n \"def get_paths(input_folder):\\n list_files = []\\n conll_folder = glob.glob(input_folder + '/*.json')\\n \\n for filename in conll_folder:\\n list_files.append(filename)\\n\\n return list_files\",\n \"def getBaseSrcFile(self) -> List[int]:\\n ...\",\n \"def filepaths(self, langs) -> Generator[str, None, None]:\\n for pv in self.projects(langs):\\n yield from pv.filepaths()\",\n \"def findFiles(target, path):\\r\\n\\tfiles = []\\r\\n\\tlyst = os.listdir(path)\\r\\n\\tfor element in lyst:\\r\\n\\t\\tif os.path.isfile(element):\\r\\n\\t\\t\\tif target in element:\\r\\n\\t\\t\\t\\tfiles.append(path + os.sep + element)\\r\\n\\t\\telse:\\r\\n\\t\\t\\tos.chdir(element)\\r\\n\\t\\t\\tfiles.extend(findFiles(target, os.getcwd()))\\r\\n\\t\\t\\tos.chdir(\\\"..\\\")\\r\\n\\treturn files\",\n \"def get_files_paths(self):\\n return self.__files_paths\",\n \"def _get_target_files(self) -> List[Path]:\\n repo = get_git_repo()\\n submodules = repo.submodules # type: ignore\\n submodule_paths = [\\n self._fname_to_path(repo, submodule.path) for submodule in submodules\\n ]\\n\\n # resolve given paths relative to current working directory\\n paths = [p.resolve() for p in self._paths]\\n if self._base_commit is not None:\\n paths = [\\n a\\n for a in (self._status.added + self._status.modified)\\n # diff_path is a subpath of some element of input_paths\\n if any((a == path or path in a.parents) for path in paths)\\n ]\\n changed_count = len(paths)\\n click.echo(f\\\"| looking at {unit_len(paths, 'changed path')}\\\", err=True)\\n paths = [\\n path\\n for path in paths\\n if all(\\n submodule_path not in path.parents\\n for submodule_path in submodule_paths\\n )\\n ]\\n if len(paths) != changed_count:\\n click.echo(\\n f\\\"| skipping files in {unit_len(submodule_paths, 'submodule')}: \\\"\\n + \\\", \\\".join(str(path) for path in submodule_paths),\\n err=True,\\n )\\n\\n # Filter out ignore rules, expand directories\\n self._ignore_rules_file.seek(0)\\n patterns = Parser(self._base_path).parse(self._ignore_rules_file)\\n\\n file_ignore = FileIgnore(\\n base_path=self._base_path, patterns=patterns, target_paths=paths\\n )\\n\\n walked_entries = list(file_ignore.entries())\\n click.echo(\\n f\\\"| found {unit_len(walked_entries, 'file')} in the paths to be scanned\\\",\\n err=True,\\n )\\n filtered: List[Path] = []\\n for elem in walked_entries:\\n if elem.survives:\\n filtered.append(elem.path)\\n\\n skipped_count = len(walked_entries) - len(filtered)\\n if skipped_count:\\n click.echo(\\n f\\\"| skipping {unit_len(range(skipped_count), 'file')} based on path ignore rules\\\",\\n err=True,\\n )\\n\\n relative_paths = [path.relative_to(self._base_path) for path in filtered]\\n\\n return relative_paths\",\n \"def get_image_path(raw_input_dir: str) -> list:\\n result = []\\n for root, dirs, files in os.walk(raw_input_dir):\\n for file in files:\\n result.append(os.path.join(root, file))\\n return result\",\n \"def files_in( d ):\\n return [ join(d,f) for f in os.listdir(d) if isfile(join(d,f)) ]\",\n \"def filepaths(self):\\n pass\",\n \"def get_sources(config, base_dir, exclude_submodules=False):\\n for i, source in enumerate(config.sources_under(abspath(base_dir))):\\n if i != 0:\\n print\\n log.info(\\\"# source %s (%s)\\\", source.nicedir,\\n ' '.join(source.info))\\n source.get(exclude_submodules)\",\n \"def get_files(self) -> list:\\n files = []\\n for file in os.listdir(self.root):\\n if file.endswith(f\\\".{self.suffix}\\\"):\\n files.append(os.path.join(self.root, file))\\n return files\",\n \"def getContentFiles():\\n contentFiles = []\\n for contentDir, subDirs, filenames in os.walk(sourceDir, followlinks=True):\\n if shouldIgnore(contentDir):\\n subDirs[:] = []\\n continue\\n for filename in filenames:\\n if not shouldIgnore(filename):\\n cf = ContentFile(os.path.join(contentDir, filename))\\n log(`cf.path`)\\n contentFiles.append(cf)\\n return contentFiles\",\n \"def _get_file_paths(self, ignored_exts: Optional[Set[str]]) -> List[str]:\\n dir_path = os.path.join(self._target_dir, '**')\\n all_paths = glob.glob(dir_path, recursive=True)\\n if ignored_exts is None:\\n return [p for p in all_paths if os.path.isfile(p)]\\n file_paths = [p for p in all_paths if self._extr_ext(p) not in ignored_exts]\\n return [p for p in file_paths if os.path.isfile(p)]\",\n \"def discover(self):\\n ids = []\\n for f in os.listdir(self.dirname):\\n if self.file_prefix in f:\\n ids.append(self.inv_filename(f))\\n return sorted(ids)\",\n \"def files_in_dir(path):\\n return os.listdir(path)\",\n \"def pdbfile_list():\\n import glob, os\\n os.chdir(\\\"../Data\\\")\\n file_list = []\\n for file in glob.glob(\\\"*.pdb\\\"):\\n file_list.append(file)\\n return file_list\",\n \"def glob_paths(self, name, source, pattern, test_data=()):\\n assert isinstance(source, config_types.Path)\\n result = self._run(\\n name, ['glob', source, pattern],\\n lambda: self.test_api.glob_paths(test_data),\\n self.m.raw_io.output_text())\\n ret = [source.join(*x.split(self.m.path.sep))\\n for x in result.stdout.splitlines()]\\n result.presentation.logs[\\\"glob\\\"] = map(str, ret)\\n return ret\",\n \"def get_c_files(path):\\n clist = []\\n for file in os.listdir(path):\\n if file.endswith(\\\".cc\\\") or file.endswith(\\\".c\\\"):\\n clist.append(\\\"%s/%s\\\" % (path, file))\\n return clist\",\n \"def get_all_fullpaths(self):\\n files = []\\n for mf in self.manifests:\\n files.extend(self.manifests[mf].get_fullpaths())\\n return files\",\n \"def get_my_files():\\n return [file for file in os.listdir(os.getcwd()) if os.path.isfile(file)]\",\n \"def _get_paths():\\n paths = [\\n '/'\\n ]\\n return paths\",\n \"def _find_files(root_dir, should_include):\\n paths = [] # Return value.\\n\\n is_module = lambda path: path.endswith(\\\".py\\\")\\n\\n # os.walk() is new in Python 2.3\\n # http://docs.python.org/library/os.html#os.walk\\n for dir_path, dir_names, file_names in os.walk(root_dir):\\n new_paths = [os.path.join(dir_path, file_name) for file_name in file_names]\\n new_paths = filter(is_module, new_paths)\\n new_paths = filter(should_include, new_paths)\\n paths.extend(new_paths)\\n\\n return paths\",\n \"def find_data_files_distutils(self, package, src_dir):\\n from glob import glob\\n import os\\n from distutils.util import convert_path\\n\\n globs = (self.package_data.get('', [])\\n + self.package_data.get(package, []))\\n files = []\\n for pattern in globs:\\n # Each pattern has to be converted to a platform-specific path\\n filelist = glob(os.path.join(src_dir, convert_path(pattern)))\\n # Files that match more than one pattern are only added once\\n files.extend([fn for fn in filelist if fn not in files\\n and (os.path.isfile(fn) or os.path.islink(fn))])\\n return files\",\n \"def list_of_files(path):\\r\\n files_list=[]\\r\\n path = os.path.abspath(path)\\r\\n\\r\\n #if the path is a file name, returns a list of a single file name\\r\\n if os.path.isfile(path):\\r\\n files_list.append(path)\\r\\n #if the path is a directory name, returns a list of all the file names anded with .asm\\r\\n else:\\r\\n for file in os.listdir(path):\\r\\n if file.endswith(\\\".asm\\\"):\\r\\n files_list.append(os.path.join(path, file))\\r\\n return files_list\",\n \"def files_in_dir(root_dir):\\n file_set = set()\\n\\n for dir_, _, files in os.walk(root_dir):\\n for file_name in files:\\n rel_dir = os.path.relpath(dir_, root_dir)\\n rel_file = os.path.join(rel_dir, file_name)\\n file_set.add(rel_file)\\n\\n return [Path(PureWindowsPath(f)) for f in file_set]\",\n \"def _get_files_list(self):\\n ts_filepaths = []\\n conn_filepaths = []\\n ts_filepaths_from_dir = sorted(os.listdir(self.ts_dir))\\n conn_filepaths_from_dir = sorted(os.listdir(self.conn_dir))\\n for sub_id in self.ids:\\n for ts_file in ts_filepaths_from_dir:\\n if sub_id in ts_file:\\n ts_filepaths += [os.path.join(self.ts_dir, ts_file)]\\n ts_filepaths_from_dir.remove(ts_file)\\n break\\n for conn_file in conn_filepaths_from_dir:\\n if sub_id in conn_file:\\n conn_filepaths += [os.path.join(self.conn_dir, conn_file)]\\n conn_filepaths_from_dir.remove(conn_file)\\n break\\n\\n return ts_filepaths, conn_filepaths\",\n \"def __get_sources__(self):\\n\\n # Let's go to the Apt temporal dir.\\n os.chdir(self.conf['AptTmp'])\\n\\n # Define a global Source file, all the *_Sources files are going to be in this file.\\n global_sources_file = open(self.conf['CodeName'] + '_Sources', 'w')\\n\\n\\t\\t# The main/debian-installer is in main, so remove it.\\n\\t\\tcomponents = self.conf['Components']\\n\\t\\tif 'main/debian-installer' in components:\\n\\t\\t\\tcomponents.remove('main/debian-installer')\\n\\n # For every component defined...\\n for component in components:\\n # Download the Packages.gz file\\n file = self.__get_packages_file__(self.conf[\\\"Mirror\\\"], \\\\\\n \\\"%s_%s_Sources\\\" % (self.conf['CodeName'], component), \\\\\\n component, \\\"source\\\" + \\\"/Sources.gz\\\")\\n\\n # \\\"cat\\\" it into the global_packages_file\\n for line in file:\\n print >>global_sources_file, line,\\n file.close()\\n\\n\\t\\tglobal_sources_file.close()\\n\\t\\treturn open(self.conf['CodeName'] + '_Sources', 'r')\",\n \"def GetAllFilepaths(root_directory):\\n path_list = []\\n for dirpath, _, filenames in os.walk(root_directory):\\n for filename in filenames:\\n path_list.append(os.path.abspath(os.path.join(dirpath, filename)))\\n return path_list\",\n \"def get_directories():\\n # get current working dir\\n directory = os.getcwd()\\n # list of dir to look in repo for files\\n directories = [\\n directory,\\n os.path.expanduser(os.path.join(directory, 'src')),\\n os.path.expanduser(os.path.join(directory, 'tests'))\\n ]\\n return directories\",\n \"def get_file_list(start):\\n valid_files = []\\n for root, dirs, files in os.walk(start):\\n for name in files:\\n if name[-5:] == \\\".conf\\\":\\n valid_files.append(os.path.join(root,name))\\n return valid_files\",\n \"def files(self) -> Generator[Path, None, None]:\\n return Path(self.package).resolve(strict=True).glob(self.glob)\",\n \"def get_target_files(self, src_dir, src_pattern):\\n return File().get_target_files(src_dir, src_pattern)\",\n \"def fullpathlist(path):\\n try:\\n return [os.path.join(path, filename) for filename in os.listdir(path)]\\n except OSError:\\n return []\",\n \"def files(self):\\r\\n files = []\\r\\n for path in self.paths:\\r\\n if os.path.isdir(path):\\r\\n files.extend(glob.glob(os.path.join(path, f'*{self.ext}')))\\r\\n else:\\r\\n files.extend(glob.glob(path))\\r\\n return list(set(self.get_pattern(fname) for fname in files))\",\n \"def find_files(self, destination):\\n for root, dirs, files in os.walk(destination):\\n for f in files:\\n if (f.endswith('.scss') or f.endswith('.sass')) and not f.startswith('_'):\\n yield os.path.join(root, f)\",\n \"def list_filenames(self):\\n l = []\\n for path, dirs, files in os.walk(self.archive_path):\\n for file in files:\\n l.append(os.path.relpath(os.path.join(path,file),self.archive_path))\\n l.sort()\\n return l\",\n \"def pdbfile_list():\\n \\n import glob, os\\n os.chdir(\\\"../Data\\\")\\n file_list = []\\n for file in glob.glob(\\\"*.pdb\\\"):\\n file_list.append(file)\\n return file_list\",\n \"def get_files(self) -> tp.Iterable[str]:\\n return os.listdir(self.path)\",\n \"def _get_sources_and_includes(dirs_list):\\n sources = []\\n includes = []\\n for directory in dirs_list:\\n source_dir = join(os.path.dirname(os.path.realpath(__file__)),\\n directory, 'src')\\n for source in os.listdir(source_dir):\\n sources.append(join(source_dir, source))\\n includes.append(join(directory, 'include'))\\n return sources, includes\",\n \"def get_req_file_list_pvd(source_pvd):\\n flist = []\\n flist.append(source_pvd)\\n\\n src_dir = os.path.dirname(source_pvd)\\n source_tree = ET.parse(source_pvd)\\n elems = source_tree.findall('.//DataSet')\\n for e in elems:\\n subfile = e.get('file')\\n sub_fullpath = os.path.join(src_dir, subfile)\\n sub_full_dir = os.path.dirname(sub_fullpath)\\n flist.append(sub_fullpath)\\n sub_tree = ET.parse(sub_fullpath)\\n subelems = sub_tree.findall('.//Piece')\\n for e2 in subelems:\\n leaf = e2.get('Source')\\n leaf_path = os.path.join(sub_full_dir, leaf)\\n flist.append(leaf_path)\\n return flist\",\n \"def GetSrc():\\n return os.path.abspath(os.path.join(_THIS_DIR, os.pardir, os.pardir,\\n os.pardir))\",\n \"def source_list(self):\\n return self._source_list\",\n \"def source_list(self):\\n return self._source_list\",\n \"def local_paths(self) -> List[Path]:\\n return self._local_paths\",\n \"def orig_filepath_list(filename_list, src_path):\\n orig_filepaths = list([])\\n i = 0\\n for filename in filename_list:\\n orig_filepaths.append(src_path + filename_list[i])\\n i += 1\\n return orig_filepaths\",\n \"def BuildOldFilesList(self, source_file_name):\\n default_source = os.path.join(self._tool_dir, source_file_name)\\n if os.path.exists(default_source):\\n file_list = open(default_source).readlines()\\n else:\\n print 'WARNING: No default %s list found at %s' % (source_file_name,\\n default_source)\\n file_list = []\\n file_list = [f.strip() for f in file_list]\\n file_list.extend(self.GetExtraFiles(self.options.extra_archive_paths,\\n source_file_name))\\n file_list = archive_utils.ExpandWildcards(self._build_dir, file_list)\\n return file_list\",\n \"def get_replay_source_helper_paths(self):\\n\\n if self.replay_source is None:\\n return None\\n\\n paths = []\\n classes = self.get_helpers_classes()\\n\\n base_path = self.base_folder_path + \\\"/data/replay_images/\\\" + self.replay_source + \\\"/\\\"\\n for hc in classes:\\n current_paths = []\\n for c in hc:\\n path = base_path + str(c).zfill(2) + \\\".tfrecord\\\"\\n current_paths.append(path)\\n paths.append(current_paths)\\n return paths\",\n \"def path_generator(initial_root):\\n for root, dirs, files in os.walk(initial_root):\\n paths = [os.path.join(root, name) for name in files]\\n return paths\",\n \"def get_replay_source_no_helper_paths(self):\\n paths = []\\n classes = self.get_replay_classes_no_helper()\\n base_path = self.base_folder_path + \\\"/data/replay_images/\\\" + self.replay_source + \\\"/\\\"\\n\\n \\n for c in classes:\\n full_path = base_path + str(c).zfill(2) + \\\".tfrecord\\\"\\n paths.append(full_path)\\n \\n return paths\",\n \"def sources(self):\\n return self._sources.keys()\",\n \"def expand_files(self, recursive=True, include_buildfile=True):\\r\\n\\r\\n files = []\\r\\n\\r\\n def _expand(target):\\r\\n files.extend([os.path.abspath(os.path.join(target.target_base, s))\\r\\n for s in (target.sources or [])])\\r\\n if include_buildfile:\\r\\n files.append(target.address.buildfile.full_path)\\r\\n if recursive:\\r\\n for dep in target.dependencies:\\r\\n if isinstance(dep, TargetWithSources):\\r\\n _expand(dep)\\r\\n elif hasattr(dep, 'address'):\\r\\n # Don't know what it is, but we'll include the BUILD file to be paranoid\\r\\n files.append(dep.address.buildfile.full_path)\\r\\n\\r\\n _expand(self)\\r\\n return files\",\n \"def _get_code_files(self):\\n for dirpath, dirnames, filenames in os.walk(self.CodesDirectory):\\n for f in filenames:\\n rel_name = path.join(dirpath, f)\\n if f.endswith('.py'):\\n yield (rel_name, 'Python')\\n elif f.endswith('.pyx'):\\n yield (rel_name, 'PyRex')\\n elif f.endswith('.c'):\\n yield (rel_name, 'C')\\n else:\\n pass\",\n \"def buildListOfFiles(searchGlob):\\n return [fpath for fpath in glob2.iglob(searchGlob) if os.path.isfile(fpath)]\",\n \"def FindSources(env, dest, source, suffixes=None):\\n for source_entry in env.Flatten(source):\\n if type(source_entry) == str:\\n # Search for matches for each source entry\\n source_nodes = env.Glob(source_entry)\\n else:\\n # Source entry is already a file or directory node; no need to glob it\\n source_nodes = [source_entry]\\n for s in source_nodes:\\n if str(s.__class__) == 'SCons.Node.FS.Dir':\\n # Recursively search subdir. Since glob('*') doesn't match dot files,\\n # also glob('.*').\\n FindSources(env, dest, [s.abspath + '/*', s.abspath + '/.*'],\\n suffixes)\\n elif suffixes and s.suffix in suffixes:\\n dest.add(s)\",\n \"def _deleted_sources(self):\\r\\n # We compute the list lazily.\\r\\n if self._lazy_deleted_sources is None:\\r\\n with self.context.new_workunit('find-deleted-sources'):\\r\\n if os.path.exists(self._analysis_file):\\r\\n products = self._analysis_parser.parse_products_from_path(self._analysis_file)\\r\\n buildroot = get_buildroot()\\r\\n old_sources = products.keys() # Absolute paths.\\r\\n self._lazy_deleted_sources = [os.path.relpath(src, buildroot) for src in old_sources\\r\\n if not os.path.exists(src)]\\r\\n else:\\r\\n self._lazy_deleted_sources = []\\r\\n return self._lazy_deleted_sources\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.8271542","0.77901995","0.75900644","0.73890495","0.7383353","0.7309688","0.7303101","0.7151451","0.7086724","0.70593715","0.7048522","0.704018","0.6996113","0.69825387","0.69230485","0.68788785","0.6873243","0.6849214","0.6813808","0.68076485","0.67865753","0.67446584","0.67353475","0.67315847","0.672391","0.6723616","0.67073435","0.66992784","0.6699192","0.66971093","0.6687404","0.6641875","0.66319954","0.6610068","0.6607285","0.65586054","0.65551114","0.65456426","0.65455806","0.65364087","0.6526681","0.6524498","0.6515302","0.6507937","0.6500629","0.64796484","0.6460579","0.6449892","0.64361084","0.64217216","0.64203876","0.6419934","0.64143556","0.6400525","0.6393577","0.6379879","0.6363405","0.6350611","0.63483965","0.6330859","0.63256955","0.6315554","0.6292819","0.6286555","0.62861","0.6281244","0.6279932","0.6274722","0.62700504","0.626975","0.6269229","0.6265977","0.626078","0.6259138","0.6256535","0.62465227","0.62461704","0.6240754","0.6239586","0.62348086","0.6231159","0.62250596","0.6219199","0.61955065","0.6193373","0.6181007","0.61806357","0.61806357","0.61693233","0.61684054","0.6168327","0.6165969","0.6165242","0.616347","0.61632043","0.61546636","0.61521316","0.61488765","0.6146249","0.61431843"],"string":"[\n \"0.8271542\",\n \"0.77901995\",\n \"0.75900644\",\n \"0.73890495\",\n \"0.7383353\",\n \"0.7309688\",\n \"0.7303101\",\n \"0.7151451\",\n \"0.7086724\",\n \"0.70593715\",\n \"0.7048522\",\n \"0.704018\",\n \"0.6996113\",\n \"0.69825387\",\n \"0.69230485\",\n \"0.68788785\",\n \"0.6873243\",\n \"0.6849214\",\n \"0.6813808\",\n \"0.68076485\",\n \"0.67865753\",\n \"0.67446584\",\n \"0.67353475\",\n \"0.67315847\",\n \"0.672391\",\n \"0.6723616\",\n \"0.67073435\",\n \"0.66992784\",\n \"0.6699192\",\n \"0.66971093\",\n \"0.6687404\",\n \"0.6641875\",\n \"0.66319954\",\n \"0.6610068\",\n \"0.6607285\",\n \"0.65586054\",\n \"0.65551114\",\n \"0.65456426\",\n \"0.65455806\",\n \"0.65364087\",\n \"0.6526681\",\n \"0.6524498\",\n \"0.6515302\",\n \"0.6507937\",\n \"0.6500629\",\n \"0.64796484\",\n \"0.6460579\",\n \"0.6449892\",\n \"0.64361084\",\n \"0.64217216\",\n \"0.64203876\",\n \"0.6419934\",\n \"0.64143556\",\n \"0.6400525\",\n \"0.6393577\",\n \"0.6379879\",\n \"0.6363405\",\n \"0.6350611\",\n \"0.63483965\",\n \"0.6330859\",\n \"0.63256955\",\n \"0.6315554\",\n \"0.6292819\",\n \"0.6286555\",\n \"0.62861\",\n \"0.6281244\",\n \"0.6279932\",\n \"0.6274722\",\n \"0.62700504\",\n \"0.626975\",\n \"0.6269229\",\n \"0.6265977\",\n \"0.626078\",\n \"0.6259138\",\n \"0.6256535\",\n \"0.62465227\",\n \"0.62461704\",\n \"0.6240754\",\n \"0.6239586\",\n \"0.62348086\",\n \"0.6231159\",\n \"0.62250596\",\n \"0.6219199\",\n \"0.61955065\",\n \"0.6193373\",\n \"0.6181007\",\n \"0.61806357\",\n \"0.61806357\",\n \"0.61693233\",\n \"0.61684054\",\n \"0.6168327\",\n \"0.6165969\",\n \"0.6165242\",\n \"0.616347\",\n \"0.61632043\",\n \"0.61546636\",\n \"0.61521316\",\n \"0.61488765\",\n \"0.6146249\",\n \"0.61431843\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.6541307"},"document_rank":{"kind":"string","value":"39"}}},{"rowIdx":6083,"cells":{"query":{"kind":"string","value":"Return the list of full paths for pictures and movies in source directory"},"document":{"kind":"string","value":"def list_of_medias(args, sourcedir, recursive):\n files = list_of_files(sourcedir, recursive)\n return [_ for _ in files if is_media_within_dates(_, args.dates)]"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["def __return_movie_file_list(self, movie_path):\n movie_dir = movie_path.rsplit(\"/\",1)[0]\n movie_file_list =[]\n movie_extentionds = self.__movie_file_extensions(self.__file_extentions)\n for x in os.listdir(movie_dir):\n if x.rsplit(\".\",1)[-1]in movie_extentionds:\n movie_file_list.append(movie_dir+\"/\"+x)\t\t\n\t#USUNAC URL Z NAPISY24\n return movie_file_list","def get_replay_source_helper_paths(self):\n\n if self.replay_source is None:\n return None\n\n paths = []\n classes = self.get_helpers_classes()\n\n base_path = self.base_folder_path + \"/data/replay_images/\" + self.replay_source + \"/\"\n for hc in classes:\n current_paths = []\n for c in hc:\n path = base_path + str(c).zfill(2) + \".tfrecord\"\n current_paths.append(path)\n paths.append(current_paths)\n return paths","def get_replay_source_no_helper_paths(self):\n paths = []\n classes = self.get_replay_classes_no_helper()\n base_path = self.base_folder_path + \"/data/replay_images/\" + self.replay_source + \"/\"\n\n \n for c in classes:\n full_path = base_path + str(c).zfill(2) + \".tfrecord\"\n paths.append(full_path)\n \n return paths","def readPlayerImageFiles(self):\n currentPath = os.path.dirname(os.path.abspath(__file__))\n listOfFileNames=[]\n for i in os.listdir(currentPath):\n if re.match(\"player\\_\\d+\",i): #i.endswith(\".gif\")\n listOfFileNames.append(currentPath+'/'+i)\n return listOfFileNames","def get_all_paths(why = 'train'):\r\n if why == 'train':\r\n parent_folder = train_parent_folder\r\n if why == 'test':\r\n parent_folder = test_test_folder\r\n sub_folders = glob.glob(parent_folder) # Directories of all languages\r\n image_paths = [glob.glob(sub_folder + '\\*') for sub_folder in sub_folders] # Directories of all characters\r\n image_paths = sum(image_paths, []) # Flatten out the 2D list to a 1D list \r\n return image_paths","def get_image_path(raw_input_dir: str) -> list:\n result = []\n for root, dirs, files in os.walk(raw_input_dir):\n for file in files:\n result.append(os.path.join(root, file))\n return result","def get_all_image_paths(self):\n image_paths, image_labels = [], []\n for directory_name, subdirectory_list, file_list in os.walk(self.root_directory):\n for file_name in file_list:\n if file_name.endswith(('.jpg',)):\n image_paths.append(os.path.join(directory_name, file_name))\n # Translates labels to 0-26 as recommended in the exercise description\n image_labels.append(ord(directory_name[-1]) - 97)\n return image_paths, image_labels","def find_photos(source_path, common_extensions=('JPG', 'CR2', 'ORF', 'ARW', 'TIFF', 'DNG'), ignore=[]):\n # combinedignored = re.compile('|'.join('(?:{0})'.format(x) for x in ignore))\n # use endswith , ignore must be a tuple then\n # if ignore and dirpath.endswith(ignore):\n # for duplication, at the end cll the same funciton\n\n source_files = list()\n\n for (dirpath, dirnames, filenames) in os.walk(source_path):\n for f in filenames:\n if f.upper().endswith(common_extensions):\n # source_files.append(os.path.join(dirpath, f))\n parent = os.path.basename(os.path.normpath(dirpath))\n source_files.append({'dir':dirpath,\n 'filename':f,\n 'parent_folder':parent})\n\n return source_files","def get_file_paths():\n audio_folder = MY_DIR + '/assets'\n\n audio_addy_list = []\n for file in os.scandir(audio_folder):\n audio_addy_list.append(file.path)\n\n return audio_addy_list","def get_movies(path):\n movies_list = []\n \n \n for f in os.listdir(path):\n \n full_file_path = join(path,f)\n if isdir(full_file_path):\n \n movies_list.extend( get_movies(full_file_path) )\n \n elif isfile(full_file_path) and full_file_path[-3:] in util.extension:\n m = Movie(f, full_file_path)\n movies_list.append(m)\n \n return movies_list","def getSourcePaths(self, makeGlyphs=True, makeKerning=True, makeInfo=True):\n paths = []\n for name in self.sources.keys():\n paths.append(self.sources[name][0].path)\n return paths","def list_of_medias_ext(args, sourcedir):\n result = list()\n listdir = sorted_listdir(os.listdir(sourcedir))\n if '.nomedia' not in listdir:\n for basename in listdir:\n fullname = os.path.join(sourcedir, basename)\n if os.path.isdir(fullname) and basename != '$RECYCLE.BIN' and contains_media(args, fullname):\n result.append(fullname)\n else:\n if is_media_within_dates(fullname, args.dates):\n result.append(fullname)\n return result","def get_img_files(images, db):\n img_dir = db.source\n if img_dir == None:\n raise ValueError('Cannot locate file without a base path. This method looks for it at \\\n db.source, which is not set. This should be set by the loader during DB construction!')\n img_dir = path.join(img_dir, 'img') \n locs = db.get_img_locs(images)\n titles = db.get_location_titles()\n returnval = []\n for image in images:\n loc = locs[image]\n if loc is None:\n raise ValueError('The image %s could not be found' % image)\n returnval.append(path.join(img_dir, titles[loc], str(image) + '.jpg'))\n return returnval","def getFilePaths():\n \n image_dir = r'/hpc/wfok007/mpi_heart/Training Set'\n mask_paths = []\n image_paths = []\n for root, dirs, files in os.walk(image_dir, topdown=False):\n for name in files:\n if name == 'laendo.nrrd':\n mask_paths.append(os.path.join(root, name))\n elif name == 'lgemri.nrrd':\n image_paths.append(os.path.join(root, name))\n else:\n print ('%s is unknown' %name)\n return mask_paths, image_paths","def list_of_files(sourcedir, recursive):\n result = list()\n if recursive is False:\n listdir = sorted_listdir(os.listdir(sourcedir))\n if '.nomedia' not in listdir:\n for basename in listdir:\n result.append(os.path.join(sourcedir, basename))\n else:\n for root, dirs, files in os.walk(sourcedir):\n if '.nomedia' not in files:\n for basename in sorted_listdir(files):\n result.append(os.path.join(root, basename))\n return result","def get_paths_list_from_folder(folder):\n names = os.listdir(folder)\n relative_paths = [os.path.join(folder, image_name) for image_name in names]\n return relative_paths","def voicesPathsCollector(source_dir, gender_ids):\r\n # The list containing the IDs of the speakers which are the folder names\r\n person_ids_list = gender_ids\r\n\r\n # An empty list which it will contains voices paths which are in the section folders\r\n voices_paths_list = []\r\n\r\n # Iterating over a person speaker ids\r\n for person_id_idx in range(len(person_ids_list)):\r\n # Speaker path containing the chapter's directories\r\n speaker_path = Path.cwd().joinpath(source_dir, person_ids_list[person_id_idx])\r\n # The list containing the IDs of the sections by the current speaker which are the folder names\r\n sections_ids_list = os.listdir(speaker_path)\r\n\r\n # Iterating over a sections ids by the current speaker\r\n for sec_id_idx in range(len(sections_ids_list)):\r\n # Section path containing files\r\n section_path = Path.cwd().joinpath(speaker_path,sections_ids_list[sec_id_idx])\r\n # Iterating over files which are existing in section's folders\r\n for file in os.listdir(section_path):\r\n # Choose files with .flac extension\r\n if file.endswith(\".flac\"):\r\n\r\n voice_path = Path.cwd().joinpath(section_path, file)\r\n voices_paths_list.append(voice_path)\r\n\r\n return voices_paths_list","def get_image_list(path: str) -> list:\n\n return list(os.path.join(path, f)\n for f in os.listdir(path)\n if f.endswith('.jpg'))","def get_datapaths(input_dir):\n image_paths = []\n assert os.path.isdir(input_dir), f\"{input_dir} is not existed\"\n\n for root, _, names in os.walk(input_dir):\n for name in names:\n path = os.path.join(root, name)\n image_paths.append(path)\n return image_paths","def getImages(path):\n files = list()\n\n for f in listdir(path):\n file = join(path, f)\n if isfile(file):\n files.append(getImage(file))\n\n return files","def udimPaths(self):\n\t\ttry:\n\t\t\treturn [ textureFile( self.dirPath + a ) for a in os.listdir( self.dirPath ) if self.name + '.' in a ]\n\t\texcept:\n\t\t\treturn []","def get_images_paths(path: str) -> List[str]:\n\n image_paths = []\n\n for folder in os.listdir(path):\n for file in os.listdir(os.path.join(f\"{path}/{folder}\", \"images\")):\n image_paths.append(f\"{path}/{folder}/images/{file}\")\n\n return image_paths","def get_imlist(path):\n\treturn [os.path.join( path, f) for f in os.listdir(path) if f.endswith('.jpg')]","def get_library_content(self):\n from glob import glob\n try:\n os.path.isdir(self.source)\n lst = glob(self.source + '/*')\n except TypeError:\n lst = self.source\n dircheck = True\n while dircheck is True:\n dircheck = False\n newlst = []\n for entry in lst:\n if os.path.isdir(entry):\n newlst.extend(glob(entry + '/*'))\n dircheck = True\n else:\n newlst.append(entry)\n lst = newlst\n return lst","def return_images(directory):\r\n allfiles = os.listdir(directory)\r\n image_list = [im for im in allfiles if '.jpg' in str(im)]\r\n image_list = [directory + im for im in image_list]\r\n return image_list","def get_source_files(self):\n return [\n path.as_posix()\n for path in _Path(self.src_dir).rglob(\"*\")\n if not path.is_dir()\n ] + [\n (path / \"CMakeLists.txt\").as_posix()\n for path in _PurePath(self.src_dir).parents\n ]","def source_paths(self):\n paths = self.config.get('static_dirs')\n if paths:\n return paths\n return [self.config.get('static_dir')]","def Get_Source(self):\r\n source_directory = filedialog.askdirectory(initialdir = initial_dir, title=\"Select source folder\")\r\n global source\r\n source = source_directory \r\n self.txt_srcPath.delete(0, 'end')\r\n self.txt_srcPath.insert(0, str(source_directory))\r\n file_type = self.txt_fileType.get()\r\n hrs= int(self.txt_fileAge.get())\r\n file_age = datetime.timedelta(hours=hrs)\r\n global filenames_list\r\n filenames_list = []\r\n global files_list\r\n files_list = []\r\n global ft_list\r\n ft_list = []\r\n for f in glob.iglob(os.path.join(source, file_type)):\r\n files_list = [os.path.splitext(f)[0]]\r\n filenames_list.append(f) \r\n return(filenames_list, source, files_list)","def darkfiles(cam):\n return fullpathlist(darkpath(cam))","def get_imlist(path):\n return [os.path.join(path, f) for f in os.listdir(path) if f.endswith('.jpg')]","def get_image_list(source_dir):\n\n dir_list = os.path.os.listdir(source_dir)\n# print(dir_list)\n image_list = []\n os.chdir(source_dir)\n for file in dir_list:\n print(\"Inspecting.... : {}\".format(file))\n\n try:\n if Image.open(file).format:\n image_list.append(file)\n print(\"{} : is an image\".format(file))\n except Exception as e:\n print(\"{} : failed the imageness test.i \\n {}\".format(file, e))\n continue\n\n# print(image_list)\n return image_list","def get_filepaths(extract_dir):\n\n index = []\n labels = []\n _extract_dir = os.path.join(extract_dir, 'UCF-101')\n for folder in os.listdir(_extract_dir):\n labels.append(folder)\n folderpath = os.path.join(_extract_dir, folder)\n\n if not os.path.isdir(folderpath):\n continue\n\n for filename in os.listdir(folderpath):\n if 'avi' not in filename:\n continue\n\n if filename[0] == '.':\n continue\n\n filepath = os.path.join(folderpath, filename)\n\n if os.path.exists(filepath):\n index.append(filepath)\n else:\n print(filepath)\n return index, labels","def getVideosPath(self):\r\n videoTypes = [\r\n ('MP4 files', '*.mp4'),\r\n ('3GP files', '*.3gp'),\r\n ('WMV files', '*.wmv'),\r\n ('FLV files', '*.flv'),\r\n ('AVI files', '*.avi'),\r\n ]\r\n global filenames\r\n filenames = askopenfilenames(title=\"Select video files\", multiple=True, )","def get_files():\n\n img_dir = '../ADE20K_2016_07_26/full_data/images/validation/'\n sem_dir = '../ADE20K_2016_07_26/full_data/annotations/validation/'\n ins_dir = '../ADE20K_2016_07_26/full_data/annotations_instance/validation/'\n\n img_files = os.listdir(img_dir)\n sem_files = os.listdir(sem_dir)\n ins_files = os.listdir(ins_dir)\n \n img_files = [ os.path.join(img_dir,item) for item in img_files ]\n sem_files = [ os.path.join(sem_dir,item) for item in sem_files ]\n ins_files = [ os.path.join(ins_dir,item) for item in ins_files ]\n \n img_files.sort()\n sem_files.sort()\n ins_files.sort()\n \n return img_files, sem_files, ins_files","def demo_paths(self):\n base_path = os.path.join(self.module.__path__[0], 'demo')\n paths = []\n if os.path.isdir(base_path):\n for item in os.listdir(base_path):\n # TODO: support examples which is not auto-loaded\n if not os.path.isdir(os.path.join(base_path, 'examples')):\n paths.append(os.path.join(base_path, item))\n return paths","def _locate_images(self):\r\n extensions = '|'.join(self.valid_extensions)\r\n extension_re = re.compile('.+\\.(%s)$' % extensions, re.IGNORECASE)\r\n files = sorted(os.listdir(self.path))\r\n\r\n images = []\r\n for root, dirs, files in os.walk(self.path, followlinks=self.config['follow_links']):\r\n for filename in sorted(files):\r\n if not filename.startswith('.') and extension_re.match(filename):\r\n images.append(Image(path=os.path.join(root, filename), config=self.config))\r\n if not self.config['recursive']:\r\n break\r\n\r\n if not images:\r\n raise SourceImagesNotFoundError(self.path)\r\n\r\n images = sorted(images, reverse=self.config['algorithm_ordering'][0] != '-')\r\n\r\n return images","def get_all_sources(remit):\n if remit == 'panzer' or remit == 'pandoc':\n os.chdir('source-'+remit)\n sourcelist = [name for name in os.listdir(\".\") if os.path.isdir(name)]\n os.chdir('..')\n else:\n # get the maximal list of sources for a diff\n pandoc_list = get_all_sources('pandoc')\n panzer_list = get_all_sources('panzer')\n sourcelist = list(set(pandoc_list+panzer_list))\n sourcelist.sort()\n return sourcelist","def collect_train_paths(self):\n\n image_paths = []\n annotation_paths = []\n\n n_images = 10000\n for i in range(1, n_images + 1):\n added = False\n for extension in ['jpg', 'png']:\n image_path = os.path.join(self.folder,\n f'ImagesPart{(i - 1) // 5000 + 1}',\n f'tr_img_{i:05}.{extension}')\n if os.path.exists(image_path):\n image_paths.append(image_path)\n added = True\n break\n if added:\n annotation_paths.append(\n os.path.join(self.folder, 'train_gt_t13', f'tr_img_{i:05}.txt')\n )\n else:\n print(f'Could not find: {image_path[:-3]}*')\n\n return image_paths, annotation_paths","def get_image_path(source_path):\n\n split = source_path.split('\\\\')\n # get filename\n filename = split[-1].lstrip()\n # get folder name\n folder = split[-3]\n # get full data path\n current_path = folder + '/IMG/' + filename\n return current_path","def get_feature_paths(start_dir, extensions = ['dcm']):\n if start_dir is None:\n start_dir = os.getcwd()\n img_paths = []\n for roots,dirs,files in os.walk(start_dir):\n for name in files:\n for e in extensions:\n if name.endswith('.' + e):\n img_paths.append(roots + '/' + name)\n img_paths.sort()\n return img_paths","def get_filepaths(self):\n image_filepaths = set()\n for one_dir in self.dirs:\n for root, dirnames, filenames in os.walk(one_dir):\n for filename in filenames:\n if re.search(r\"\\.(jpg|jpeg|png|bmp|tiff)$\", filename):\n image_filepaths.add(os.path.join(root, filename))\n image_filepaths = sorted(list(image_filepaths))\n return image_filepaths","def images_path(self):\n return os.path.join(self.extracted_path, \"images\")","def get_subdirs(src_dir):\n img_dirs = sorted(next(os.walk(src_dir))[1])\n subdirs = [src_dir + img_dir for img_dir in img_dirs]\n return subdirs","def get_lst_images(file_path):\n return [i for i in os.listdir(file_path) if i != '.DS_Store']","def listdir(self, name, source, test_data=()):\n assert isinstance(source, config_types.Path)\n self.m.path.assert_absolute(source)\n result = self._run(\n name, ['listdir', source],\n lambda: self.test_api.listdir(test_data),\n self.m.raw_io.output_text())\n ret = [source.join(x) for x in result.stdout.splitlines()]\n result.presentation.logs['listdir'] = map(str, ret)\n return ret","def source_list(self):\n return [g[\"name\"] for g in self._galleries]","def collect_train_paths(self):\n\n image_paths = []\n annotation_paths = []\n n_images = 7200\n for i in tqdm(range(1, n_images + 1)):\n added = False\n for extension in ['jpg', 'png']:\n image_path = os.path.join(self.folder,\n f'ch8_training_images_{(i - 1) // 1000 + 1}',\n f'img_{i}.{extension}')\n if os.path.exists(image_path):\n image_paths.append(image_path)\n added = True\n break\n if added:\n annotation_paths.append(\n os.path.join(self.folder, 'ch8_training_localization_transcription_gt_v2',\n f'gt_img_{i}.txt')\n )\n else:\n logging.warning(f'Could not find: {image_path[:-3]}*')\n return image_paths, annotation_paths","def sources_absolute_paths(self):\r\n abs_target_base = os.path.join(get_buildroot(), self.target_base)\r\n for src in self.sources:\r\n yield os.path.join(abs_target_base, src)","def all_image_paths(self):\n self.labels = [i for i in (self.get_immediate_subdirectories(self.root_dir))\n if not i.startswith('.')]\n\n for root, subFolders, files in os.walk(self.root_dir):\n files = [i for i in files if not i.startswith('.')]\n files = files[:self.img_num] # hard coded - will not read in\n for i in files:\n self.all_files.append(os.path.abspath(root) + '/'.join(subFolders) + '/' + i)","def filepaths(self):\n pass","def full_path(startPath,files):\n\n files = list_strings(files)\n base = os.path.split(startPath)[0]\n return [ os.path.join(base,f) for f in files ]","def relative_to_buildroot(self):\n return [os.path.join(self.rel_path, source) for source in self.source_paths]","def find_candidate_images(images_path):\n images = []\n for root, dirs, files in os.walk(images_path):\n for name in files:\n file_path = os.path.abspath(os.path.join(root, name))\n if (os.path.splitext(name)[1]).lower() in [\".jpg\", \".png\", \".jpeg\"]:\n images.append(file_path)\n return images","def CollectImageFilenames(self):\n # Match all image extensions but not the filenmae of the of beamer pdf\n regex_img = re.compile(\n r'^(?!{}).*\\.(jpg|png|pdf)'.format(self._filename.replace('.tex', '')))\n # regex_img = re.compile(r'^(?!test)'.format(self._filename.replace('.tex', '')))\n files = [f for f in os.listdir(os.getcwd())\n if regex_img.search(f)]\n return files","def prep_files(app):\n smali_paths = []\n start = time.time()\n \n for root, dirs, files in os.walk(app, topdown=False):\n for name in files:\n if name[-6:] == \".smali\":\n smali_paths.append(str(os.path.join(root, name)))\n \n return smali_paths","def flatfiles(cam):\n return fullpathlist(flatpath(cam))","def get_path_names(directory):\n paths_without_source = set()\n paths = glob.glob(source + \"**/*.*\", recursive=True)\n for p in paths:\n paths_without_source.add(p.replace(directory, \"\", 1))\n\n return paths_without_source","def get_image_paths(self):\n return self.image_paths","def get_image_paths(self):\n return self.image_paths","def get_dir_and_file_list(path):\r\n dList = os.listdir(path)\r\n dirList = []\r\n fileList = []\r\n\r\n for item in dList:\r\n \r\n if os.path.isdir(os.path.join(path, item)):\r\n dirList.append(item)\r\n elif os.path.isfile(os.path.join(path, item)):\r\n if any(image_type in item.lower() for image_type in image_types):\r\n preview = image_preview(os.path.join(path, item))\r\n fileList.append((item, preview))\r\n else:\r\n fileList.append((item, None))\r\n\r\n return dirList, fileList","def _get_file_paths(self):\n return [os.path.join(self.path, self.mode, 'waveforms', file_name + '.npy') for file_name in self.file_names]","def collect_project_source_files():\n source_files = glob.glob(PROJECT_SOURCE_FILES_FOLDER + '/**/*.py', recursive=True)\n # Insert root main.py at the beginning.\n source_files.insert(0, os.path.join(PROJECT_ROOT_FOLDER, 'main.py'))\n return list(map(lambda path: posixpath.join(*path.split('\\\\')), source_files))","def findpaths(path):\n print('[INFO] Searching for .png images in ', path)\n frame_paths = []\n frame_to_path_dict = {}\n path_to_frame_dict = {}\n for root, dirs, files in os.walk(path, topdown=False):\n for name in files:\n if name.find('.png') != -1:\n frame_path = os.path.join(root, name)\n # NOTE: may want to change to deal with generic file names\n match = re.search(r'(?P<video_id>\\d+)_(?P<frame_id>\\d+).png', name)\n # video_id = int(match.group('video_id'))\n frame_id = int(match.group('frame_id'))\n frame_paths.append(frame_path)\n frame_to_path_dict[frame_id] = frame_path\n path_to_frame_dict[frame_path] = frame_id\n frame_paths_sorted = sorted(frame_paths, key=lambda x: int(path_to_frame_dict[x]))\n print('[INFO] %i frames located ' % (len(frame_paths)))\n return frame_paths_sorted, frame_to_path_dict, path_to_frame_dict","def scandir(path_):\n return os.listdir","def get_paths(input_folder):\n list_files = []\n conll_folder = glob.glob(input_folder + '/*.json')\n \n for filename in conll_folder:\n list_files.append(filename)\n\n return list_files","def list_sources(config, base_dir, verbose=False):\n for source in config.sources_under(abspath(base_dir)):\n if verbose:\n print(\"# %s (%s)\" % (source.nicedir, ' '.join(source.info)))\n else:\n print(source.nicedir)","def get_lists_in_dir(dir_path):\n image_list = []\n\n for filename in glob.glob(dir_path + '/*.jpg'):\n image_list.append(filename)\n return image_list","def list_dir(self, path):","def load_video_paths(dir):\n VIDEO_EXTENSIONS = ['.mov', '.MOV', '.mp4']\n video_paths = []\n\n # traverse directory to obtain only paths to videos\n for dir_name, _, paths in sorted(os.walk(os.path.expanduser(dir))):\n for path in paths:\n if any(path.endswith(extensions) for extensions in VIDEO_EXTENSIONS):\n video_paths.append(os.path.expanduser(dir_name + '/' + path))\n\n return video_paths","def parse_dir_imgs(root_pth):\n def visit(imgpths, pth, names):\n # Appends detected image filenames to a list.\n imgpths.extend([os.path.join(pth, name) for name in names\n if os.path.splitext(name)[1].lower() in img_exts])\n # Walk down directory tree and get the image file paths\n imgpaths = []\n for dp, foo, names in os.walk(root_pth):\n visit(imgpaths, dp, names)\n # Make lowercased list of imagefilenames\n imgnames = [os.path.split(pth)[1].lower() for pth in imgpaths]\n return imgnames, imgpaths","def collect_image_files():\n negs = [] # Non image files found\n for filename in os.listdir('.'):\n if filename.lower().endswith('.jpg') or filename.lower().\\\n endswith('.jpeg'):\n jpg_files.append(filename)\n elif filename.lower().endswith('.gif'):\n gif_files.append(filename)\n elif filename.lower().endswith('.png'):\n png_files.append(filename)\n else:\n negs.append(filename)\n return negs","def get_file_list() -> List[str]:\n filenames = []\n os.makedirs(\"sequence\", exist_ok=True)\n for file in glob.glob(\"sequence/*.smp\"):\n filenames.append(file.replace(\"sequence/\", \"\"))\n return filenames","def _get_paths():\n paths = [\n '/'\n ]\n return paths","def Sources():\n return _sources","def GetSongFilenames():\n\n\t## Loop through each directory\n\tsong_files = []\n\tfor root, dirs, fnames in os.walk(\"_data\\\\fma_small\\\\\"):\n\t\t\n\t\t## Skip the first level\n\t\tif root == \"_data\\\\fma_small\\\\\":\n\t\t\tcontinue\n\n\t\t## Otherwise collect the files, appending\n\t\t## the root path.\n\t\tsong_files += [root+\"\\\\\"+f for f in fnames]\n\n\treturn song_files","def get_images(fish):\n fish_dir = TRAIN_DIR+'{}'.format(fish)\n images = [fish+'/'+im for im in os.listdir(fish_dir)]\n return images","def movie_path_list_fixture(tmpdir_factory):\n path_list = []\n\n parent_tmpdir = tmpdir_factory.mktemp(\"movies_for_test\")\n rng = np.random.default_rng(172312)\n this_dir = tempfile.mkdtemp(dir=parent_tmpdir)\n this_path = tempfile.mkstemp(dir=this_dir, suffix=\".h5\")[1]\n with h5py.File(this_path, \"w\") as out_file:\n out_file.create_dataset(\"data\", data=rng.random((12, 512, 512)))\n\n path_list.append(this_path)\n\n this_dir = tempfile.mkdtemp(dir=parent_tmpdir)\n this_dir = pathlib.Path(this_dir) / \"processed\"\n this_dir.mkdir()\n this_path = this_dir / \"concat_31Hz_0.h5\"\n with h5py.File(this_path, \"w\") as out_file:\n out_file.create_dataset(\"data\", data=rng.random((12, 512, 512)))\n path_list.append(str(this_path.resolve().absolute()))\n\n this_dir = tempfile.mkdtemp(dir=parent_tmpdir)\n this_dir = pathlib.Path(this_dir) / \"processed\"\n this_dir.mkdir()\n this_path = this_dir / \"motion_corrected_video.h5\"\n with h5py.File(this_path, \"w\") as out_file:\n out_file.create_dataset(\"data\", data=rng.random((12, 512, 512)))\n path_list.append(str(this_path.resolve().absolute()))\n\n yield path_list\n\n for this_path in path_list:\n this_path = pathlib.Path(this_path)\n if this_path.is_file():\n this_path.unlink()","def get_all_images_from_filesystem():\r\n\r\n logging.debug('get_all_images_from_filesystem()')\r\n\r\n dir_path = os.path.join(os.environ['TEMP'],'WarietyWallpaperImages')\r\n all_full_image_paths = []\r\n for my_file in os.listdir(dir_path):\r\n if os.path.isfile(os.path.join(dir_path, my_file)):\r\n all_full_image_paths.append(os.path.join(dir_path, my_file))\r\n return all_full_image_paths","def getFiles(self):\n\t\treturn os.listdir(self.getPath())","def files_in( d ):\n return [ join(d,f) for f in os.listdir(d) if isfile(join(d,f)) ]","def search_images(\n current_dir: str,\n exts={\"jpg\", \"png\", \"jpeg\", \"gif\"}\n) -> typing.Iterable[typing.Tuple[str, str]]:\n for root, _, files in os.walk(current_dir):\n for file_name in files:\n ext = file_name.rsplit('.', 1)[-1].lower()\n if ext in exts:\n yield os.path.join(root, file_name), file_name","def _fetch_all_images(self, path) -> List[str]:\n files_all = []\n\n for ext in self.exts:\n files_all.extend(glob.glob(join(path, ext)))\n\n return files_all","def get_custom_imgs(custom_image_path):\n img_paths = []\n for path, dir, filenames in os.walk(custom_image_path):\n for filename in filenames:\n img_paths.append(os.path.join(path, filename))\n break\n return img_paths","def get_paths(self):\n return (self.world_fpath, self.subj_fpath, self.peds_fpath)","def load_paths(dir):\n IMG_EXTENSIONS = ['.jpg', '.JPG', '.jpeg', '.JPEG',\n '.png', '.PNG', '.bmp', '.BMP']\n image_paths = []\n\n # traverse directory to obtain only paths to images\n for dir_name, _, paths in sorted(os.walk(os.path.expanduser(dir))):\n for path in paths:\n if any(path.endswith(extensions) for extensions in IMG_EXTENSIONS):\n image_paths.append(os.path.expanduser(dir_name + '/' + path))\n\n return image_paths","def getMediaFiles(path):\n fileList = getMediaFileList(path)\n # dirList = getDirectoryList(path)\n\n # results = map(getMediaFiles, dirList)\n\n # for result in results:\n # fileList = fileList + result\n\n return fileList","def get_images_path(file_path):\n assert os.path.isfile(file_path)\n\n images_path = []\n image_dir = os.path.dirname(file_path)\n\n with open(file_path, 'r') as f:\n for line in f:\n line = line.strip()\n origin_path, annot_path = line.split(\" \")\n origin_path = os.path.join(image_dir, origin_path)\n annot_path = os.path.join(image_dir, annot_path)\n images_path.append([origin_path, annot_path])\n\n return images_path","def fullpathlist(path):\n try:\n return [os.path.join(path, filename) for filename in os.listdir(path)]\n except OSError:\n return []","def listImageFolder():\n #Note: Ignores files ending in ~ which is a backup/lock file\n return [f for f in os.listdir(imageFolder) if f[-1] is not '~']","def filePaths(directory_with_files):\n\n # get a list of file names in directory\n list_of_files = os.listdir(directory_with_files) \n\n # join directory path and file name to get full paths to files\n filepaths = [os.path.join(directory_with_files, filename) for filename in list_of_files]\n\n return filepaths","def findFiles(target, path):\r\n\tfiles = []\r\n\tlyst = os.listdir(path)\r\n\tfor element in lyst:\r\n\t\tif os.path.isfile(element):\r\n\t\t\tif target in element:\r\n\t\t\t\tfiles.append(path + os.sep + element)\r\n\t\telse:\r\n\t\t\tos.chdir(element)\r\n\t\t\tfiles.extend(findFiles(target, os.getcwd()))\r\n\t\t\tos.chdir(\"..\")\r\n\treturn files","def fetch_path_from_dirs(list_of_search_dirs, key):\n outputs = []\n for d in list_of_search_dirs:\n this_search_path = os.path.join(d, \"*\" + key + \"*\")\n outputs.extend(glob.glob(this_search_path))\n return outputs","def read_paths(path):\n images = [[] for _ in range(2)]\n for dirname, dirnames, _ in os.walk(path):\n for subdirname in dirnames:\n filepath = os.path.join(dirname, subdirname)\n for filename in os.listdir(filepath):\n try:\n imgpath = str(os.path.join(filepath, filename))\n images[0].append(imgpath)\n limit = re.findall('[0-9]+', filename)\n images[1].append(limit[0])\n except IOError as err:\n print(\"I/O error\")\n except:\n print(\"I/O error 2\")\n raise\n return images","def source_dirs_files(fspath, fil=None):\r\n dirs = []\r\n files = []\r\n for child in fspath.listdir(fil=fil):\r\n if child.basename.startswith('.'):\r\n continue\r\n if child.check(dir=True):\r\n dirs.append(child)\r\n elif child.check(file=True):\r\n if child.ext in ['.pyc', '.pyo']:\r\n continue\r\n files.append(child)\r\n return sorted(dirs), sorted(files)","def list_filenames(self):\n l = []\n for path, dirs, files in os.walk(self.archive_path):\n for file in files:\n l.append(os.path.relpath(os.path.join(path,file),self.archive_path))\n l.sort()\n return l","def _path_files(self):\n\n if not os.path.exists(self.path):\n return None\n\n directory_content = os.listdir(self.path)\n files = []\n\n while len(directory_content) != 0:\n\n if not directory_content[0].startswith(self.path):\n directory_obj = os.path.join(self.path, directory_content[0])\n else:\n directory_obj = directory_content[0]\n\n if os.path.isfile(directory_obj):\n files.append(directory_obj)\n elif os.path.exists(directory_obj):\n temp_directory_content = os.listdir(directory_obj)\n for obj in temp_directory_content:\n directory_content.append(os.path.join(directory_obj, obj))\n directory_content.pop(0)\n\n return files","def get_paths(input_folder: str) -> list[str]:\n\n return [f for f in os.listdir(input_folder) if f[-4:] == '.txt' and f[:3] != 'top']","def list_selfplay_dirs(base_dir):\n\n model_dirs = [os.path.join(base_dir, x)\n for x in tf.io.gfile.listdir(base_dir)]\n return sorted(model_dirs, reverse=True)","def _get_images(image_path):\n logger.debug(\"Getting images: '%s'\", image_path)\n if not os.path.isdir(image_path):\n logger.debug(\"Folder does not exist\")\n return None\n files = [os.path.join(image_path, f)\n for f in os.listdir(image_path) if f.lower().endswith((\".png\", \".jpg\"))]\n logger.debug(\"Image files: %s\", files)\n return files","def getImages(self,Project=\"\"):\n #images = [\"image1.jpg\",\"image2.jpg\",\"image3.jpg\"]\n \n os.chdir(self.dataDir)\n images = glob.glob(\"*.png\")\n \n return images","def get_directories():\n # get current working dir\n directory = os.getcwd()\n # list of dir to look in repo for files\n directories = [\n directory,\n os.path.expanduser(os.path.join(directory, 'src')),\n os.path.expanduser(os.path.join(directory, 'tests'))\n ]\n return directories"],"string":"[\n \"def __return_movie_file_list(self, movie_path):\\n movie_dir = movie_path.rsplit(\\\"/\\\",1)[0]\\n movie_file_list =[]\\n movie_extentionds = self.__movie_file_extensions(self.__file_extentions)\\n for x in os.listdir(movie_dir):\\n if x.rsplit(\\\".\\\",1)[-1]in movie_extentionds:\\n movie_file_list.append(movie_dir+\\\"/\\\"+x)\\t\\t\\n\\t#USUNAC URL Z NAPISY24\\n return movie_file_list\",\n \"def get_replay_source_helper_paths(self):\\n\\n if self.replay_source is None:\\n return None\\n\\n paths = []\\n classes = self.get_helpers_classes()\\n\\n base_path = self.base_folder_path + \\\"/data/replay_images/\\\" + self.replay_source + \\\"/\\\"\\n for hc in classes:\\n current_paths = []\\n for c in hc:\\n path = base_path + str(c).zfill(2) + \\\".tfrecord\\\"\\n current_paths.append(path)\\n paths.append(current_paths)\\n return paths\",\n \"def get_replay_source_no_helper_paths(self):\\n paths = []\\n classes = self.get_replay_classes_no_helper()\\n base_path = self.base_folder_path + \\\"/data/replay_images/\\\" + self.replay_source + \\\"/\\\"\\n\\n \\n for c in classes:\\n full_path = base_path + str(c).zfill(2) + \\\".tfrecord\\\"\\n paths.append(full_path)\\n \\n return paths\",\n \"def readPlayerImageFiles(self):\\n currentPath = os.path.dirname(os.path.abspath(__file__))\\n listOfFileNames=[]\\n for i in os.listdir(currentPath):\\n if re.match(\\\"player\\\\_\\\\d+\\\",i): #i.endswith(\\\".gif\\\")\\n listOfFileNames.append(currentPath+'/'+i)\\n return listOfFileNames\",\n \"def get_all_paths(why = 'train'):\\r\\n if why == 'train':\\r\\n parent_folder = train_parent_folder\\r\\n if why == 'test':\\r\\n parent_folder = test_test_folder\\r\\n sub_folders = glob.glob(parent_folder) # Directories of all languages\\r\\n image_paths = [glob.glob(sub_folder + '\\\\*') for sub_folder in sub_folders] # Directories of all characters\\r\\n image_paths = sum(image_paths, []) # Flatten out the 2D list to a 1D list \\r\\n return image_paths\",\n \"def get_image_path(raw_input_dir: str) -> list:\\n result = []\\n for root, dirs, files in os.walk(raw_input_dir):\\n for file in files:\\n result.append(os.path.join(root, file))\\n return result\",\n \"def get_all_image_paths(self):\\n image_paths, image_labels = [], []\\n for directory_name, subdirectory_list, file_list in os.walk(self.root_directory):\\n for file_name in file_list:\\n if file_name.endswith(('.jpg',)):\\n image_paths.append(os.path.join(directory_name, file_name))\\n # Translates labels to 0-26 as recommended in the exercise description\\n image_labels.append(ord(directory_name[-1]) - 97)\\n return image_paths, image_labels\",\n \"def find_photos(source_path, common_extensions=('JPG', 'CR2', 'ORF', 'ARW', 'TIFF', 'DNG'), ignore=[]):\\n # combinedignored = re.compile('|'.join('(?:{0})'.format(x) for x in ignore))\\n # use endswith , ignore must be a tuple then\\n # if ignore and dirpath.endswith(ignore):\\n # for duplication, at the end cll the same funciton\\n\\n source_files = list()\\n\\n for (dirpath, dirnames, filenames) in os.walk(source_path):\\n for f in filenames:\\n if f.upper().endswith(common_extensions):\\n # source_files.append(os.path.join(dirpath, f))\\n parent = os.path.basename(os.path.normpath(dirpath))\\n source_files.append({'dir':dirpath,\\n 'filename':f,\\n 'parent_folder':parent})\\n\\n return source_files\",\n \"def get_file_paths():\\n audio_folder = MY_DIR + '/assets'\\n\\n audio_addy_list = []\\n for file in os.scandir(audio_folder):\\n audio_addy_list.append(file.path)\\n\\n return audio_addy_list\",\n \"def get_movies(path):\\n movies_list = []\\n \\n \\n for f in os.listdir(path):\\n \\n full_file_path = join(path,f)\\n if isdir(full_file_path):\\n \\n movies_list.extend( get_movies(full_file_path) )\\n \\n elif isfile(full_file_path) and full_file_path[-3:] in util.extension:\\n m = Movie(f, full_file_path)\\n movies_list.append(m)\\n \\n return movies_list\",\n \"def getSourcePaths(self, makeGlyphs=True, makeKerning=True, makeInfo=True):\\n paths = []\\n for name in self.sources.keys():\\n paths.append(self.sources[name][0].path)\\n return paths\",\n \"def list_of_medias_ext(args, sourcedir):\\n result = list()\\n listdir = sorted_listdir(os.listdir(sourcedir))\\n if '.nomedia' not in listdir:\\n for basename in listdir:\\n fullname = os.path.join(sourcedir, basename)\\n if os.path.isdir(fullname) and basename != '$RECYCLE.BIN' and contains_media(args, fullname):\\n result.append(fullname)\\n else:\\n if is_media_within_dates(fullname, args.dates):\\n result.append(fullname)\\n return result\",\n \"def get_img_files(images, db):\\n img_dir = db.source\\n if img_dir == None:\\n raise ValueError('Cannot locate file without a base path. This method looks for it at \\\\\\n db.source, which is not set. This should be set by the loader during DB construction!')\\n img_dir = path.join(img_dir, 'img') \\n locs = db.get_img_locs(images)\\n titles = db.get_location_titles()\\n returnval = []\\n for image in images:\\n loc = locs[image]\\n if loc is None:\\n raise ValueError('The image %s could not be found' % image)\\n returnval.append(path.join(img_dir, titles[loc], str(image) + '.jpg'))\\n return returnval\",\n \"def getFilePaths():\\n \\n image_dir = r'/hpc/wfok007/mpi_heart/Training Set'\\n mask_paths = []\\n image_paths = []\\n for root, dirs, files in os.walk(image_dir, topdown=False):\\n for name in files:\\n if name == 'laendo.nrrd':\\n mask_paths.append(os.path.join(root, name))\\n elif name == 'lgemri.nrrd':\\n image_paths.append(os.path.join(root, name))\\n else:\\n print ('%s is unknown' %name)\\n return mask_paths, image_paths\",\n \"def list_of_files(sourcedir, recursive):\\n result = list()\\n if recursive is False:\\n listdir = sorted_listdir(os.listdir(sourcedir))\\n if '.nomedia' not in listdir:\\n for basename in listdir:\\n result.append(os.path.join(sourcedir, basename))\\n else:\\n for root, dirs, files in os.walk(sourcedir):\\n if '.nomedia' not in files:\\n for basename in sorted_listdir(files):\\n result.append(os.path.join(root, basename))\\n return result\",\n \"def get_paths_list_from_folder(folder):\\n names = os.listdir(folder)\\n relative_paths = [os.path.join(folder, image_name) for image_name in names]\\n return relative_paths\",\n \"def voicesPathsCollector(source_dir, gender_ids):\\r\\n # The list containing the IDs of the speakers which are the folder names\\r\\n person_ids_list = gender_ids\\r\\n\\r\\n # An empty list which it will contains voices paths which are in the section folders\\r\\n voices_paths_list = []\\r\\n\\r\\n # Iterating over a person speaker ids\\r\\n for person_id_idx in range(len(person_ids_list)):\\r\\n # Speaker path containing the chapter's directories\\r\\n speaker_path = Path.cwd().joinpath(source_dir, person_ids_list[person_id_idx])\\r\\n # The list containing the IDs of the sections by the current speaker which are the folder names\\r\\n sections_ids_list = os.listdir(speaker_path)\\r\\n\\r\\n # Iterating over a sections ids by the current speaker\\r\\n for sec_id_idx in range(len(sections_ids_list)):\\r\\n # Section path containing files\\r\\n section_path = Path.cwd().joinpath(speaker_path,sections_ids_list[sec_id_idx])\\r\\n # Iterating over files which are existing in section's folders\\r\\n for file in os.listdir(section_path):\\r\\n # Choose files with .flac extension\\r\\n if file.endswith(\\\".flac\\\"):\\r\\n\\r\\n voice_path = Path.cwd().joinpath(section_path, file)\\r\\n voices_paths_list.append(voice_path)\\r\\n\\r\\n return voices_paths_list\",\n \"def get_image_list(path: str) -> list:\\n\\n return list(os.path.join(path, f)\\n for f in os.listdir(path)\\n if f.endswith('.jpg'))\",\n \"def get_datapaths(input_dir):\\n image_paths = []\\n assert os.path.isdir(input_dir), f\\\"{input_dir} is not existed\\\"\\n\\n for root, _, names in os.walk(input_dir):\\n for name in names:\\n path = os.path.join(root, name)\\n image_paths.append(path)\\n return image_paths\",\n \"def getImages(path):\\n files = list()\\n\\n for f in listdir(path):\\n file = join(path, f)\\n if isfile(file):\\n files.append(getImage(file))\\n\\n return files\",\n \"def udimPaths(self):\\n\\t\\ttry:\\n\\t\\t\\treturn [ textureFile( self.dirPath + a ) for a in os.listdir( self.dirPath ) if self.name + '.' in a ]\\n\\t\\texcept:\\n\\t\\t\\treturn []\",\n \"def get_images_paths(path: str) -> List[str]:\\n\\n image_paths = []\\n\\n for folder in os.listdir(path):\\n for file in os.listdir(os.path.join(f\\\"{path}/{folder}\\\", \\\"images\\\")):\\n image_paths.append(f\\\"{path}/{folder}/images/{file}\\\")\\n\\n return image_paths\",\n \"def get_imlist(path):\\n\\treturn [os.path.join( path, f) for f in os.listdir(path) if f.endswith('.jpg')]\",\n \"def get_library_content(self):\\n from glob import glob\\n try:\\n os.path.isdir(self.source)\\n lst = glob(self.source + '/*')\\n except TypeError:\\n lst = self.source\\n dircheck = True\\n while dircheck is True:\\n dircheck = False\\n newlst = []\\n for entry in lst:\\n if os.path.isdir(entry):\\n newlst.extend(glob(entry + '/*'))\\n dircheck = True\\n else:\\n newlst.append(entry)\\n lst = newlst\\n return lst\",\n \"def return_images(directory):\\r\\n allfiles = os.listdir(directory)\\r\\n image_list = [im for im in allfiles if '.jpg' in str(im)]\\r\\n image_list = [directory + im for im in image_list]\\r\\n return image_list\",\n \"def get_source_files(self):\\n return [\\n path.as_posix()\\n for path in _Path(self.src_dir).rglob(\\\"*\\\")\\n if not path.is_dir()\\n ] + [\\n (path / \\\"CMakeLists.txt\\\").as_posix()\\n for path in _PurePath(self.src_dir).parents\\n ]\",\n \"def source_paths(self):\\n paths = self.config.get('static_dirs')\\n if paths:\\n return paths\\n return [self.config.get('static_dir')]\",\n \"def Get_Source(self):\\r\\n source_directory = filedialog.askdirectory(initialdir = initial_dir, title=\\\"Select source folder\\\")\\r\\n global source\\r\\n source = source_directory \\r\\n self.txt_srcPath.delete(0, 'end')\\r\\n self.txt_srcPath.insert(0, str(source_directory))\\r\\n file_type = self.txt_fileType.get()\\r\\n hrs= int(self.txt_fileAge.get())\\r\\n file_age = datetime.timedelta(hours=hrs)\\r\\n global filenames_list\\r\\n filenames_list = []\\r\\n global files_list\\r\\n files_list = []\\r\\n global ft_list\\r\\n ft_list = []\\r\\n for f in glob.iglob(os.path.join(source, file_type)):\\r\\n files_list = [os.path.splitext(f)[0]]\\r\\n filenames_list.append(f) \\r\\n return(filenames_list, source, files_list)\",\n \"def darkfiles(cam):\\n return fullpathlist(darkpath(cam))\",\n \"def get_imlist(path):\\n return [os.path.join(path, f) for f in os.listdir(path) if f.endswith('.jpg')]\",\n \"def get_image_list(source_dir):\\n\\n dir_list = os.path.os.listdir(source_dir)\\n# print(dir_list)\\n image_list = []\\n os.chdir(source_dir)\\n for file in dir_list:\\n print(\\\"Inspecting.... : {}\\\".format(file))\\n\\n try:\\n if Image.open(file).format:\\n image_list.append(file)\\n print(\\\"{} : is an image\\\".format(file))\\n except Exception as e:\\n print(\\\"{} : failed the imageness test.i \\\\n {}\\\".format(file, e))\\n continue\\n\\n# print(image_list)\\n return image_list\",\n \"def get_filepaths(extract_dir):\\n\\n index = []\\n labels = []\\n _extract_dir = os.path.join(extract_dir, 'UCF-101')\\n for folder in os.listdir(_extract_dir):\\n labels.append(folder)\\n folderpath = os.path.join(_extract_dir, folder)\\n\\n if not os.path.isdir(folderpath):\\n continue\\n\\n for filename in os.listdir(folderpath):\\n if 'avi' not in filename:\\n continue\\n\\n if filename[0] == '.':\\n continue\\n\\n filepath = os.path.join(folderpath, filename)\\n\\n if os.path.exists(filepath):\\n index.append(filepath)\\n else:\\n print(filepath)\\n return index, labels\",\n \"def getVideosPath(self):\\r\\n videoTypes = [\\r\\n ('MP4 files', '*.mp4'),\\r\\n ('3GP files', '*.3gp'),\\r\\n ('WMV files', '*.wmv'),\\r\\n ('FLV files', '*.flv'),\\r\\n ('AVI files', '*.avi'),\\r\\n ]\\r\\n global filenames\\r\\n filenames = askopenfilenames(title=\\\"Select video files\\\", multiple=True, )\",\n \"def get_files():\\n\\n img_dir = '../ADE20K_2016_07_26/full_data/images/validation/'\\n sem_dir = '../ADE20K_2016_07_26/full_data/annotations/validation/'\\n ins_dir = '../ADE20K_2016_07_26/full_data/annotations_instance/validation/'\\n\\n img_files = os.listdir(img_dir)\\n sem_files = os.listdir(sem_dir)\\n ins_files = os.listdir(ins_dir)\\n \\n img_files = [ os.path.join(img_dir,item) for item in img_files ]\\n sem_files = [ os.path.join(sem_dir,item) for item in sem_files ]\\n ins_files = [ os.path.join(ins_dir,item) for item in ins_files ]\\n \\n img_files.sort()\\n sem_files.sort()\\n ins_files.sort()\\n \\n return img_files, sem_files, ins_files\",\n \"def demo_paths(self):\\n base_path = os.path.join(self.module.__path__[0], 'demo')\\n paths = []\\n if os.path.isdir(base_path):\\n for item in os.listdir(base_path):\\n # TODO: support examples which is not auto-loaded\\n if not os.path.isdir(os.path.join(base_path, 'examples')):\\n paths.append(os.path.join(base_path, item))\\n return paths\",\n \"def _locate_images(self):\\r\\n extensions = '|'.join(self.valid_extensions)\\r\\n extension_re = re.compile('.+\\\\.(%s)$' % extensions, re.IGNORECASE)\\r\\n files = sorted(os.listdir(self.path))\\r\\n\\r\\n images = []\\r\\n for root, dirs, files in os.walk(self.path, followlinks=self.config['follow_links']):\\r\\n for filename in sorted(files):\\r\\n if not filename.startswith('.') and extension_re.match(filename):\\r\\n images.append(Image(path=os.path.join(root, filename), config=self.config))\\r\\n if not self.config['recursive']:\\r\\n break\\r\\n\\r\\n if not images:\\r\\n raise SourceImagesNotFoundError(self.path)\\r\\n\\r\\n images = sorted(images, reverse=self.config['algorithm_ordering'][0] != '-')\\r\\n\\r\\n return images\",\n \"def get_all_sources(remit):\\n if remit == 'panzer' or remit == 'pandoc':\\n os.chdir('source-'+remit)\\n sourcelist = [name for name in os.listdir(\\\".\\\") if os.path.isdir(name)]\\n os.chdir('..')\\n else:\\n # get the maximal list of sources for a diff\\n pandoc_list = get_all_sources('pandoc')\\n panzer_list = get_all_sources('panzer')\\n sourcelist = list(set(pandoc_list+panzer_list))\\n sourcelist.sort()\\n return sourcelist\",\n \"def collect_train_paths(self):\\n\\n image_paths = []\\n annotation_paths = []\\n\\n n_images = 10000\\n for i in range(1, n_images + 1):\\n added = False\\n for extension in ['jpg', 'png']:\\n image_path = os.path.join(self.folder,\\n f'ImagesPart{(i - 1) // 5000 + 1}',\\n f'tr_img_{i:05}.{extension}')\\n if os.path.exists(image_path):\\n image_paths.append(image_path)\\n added = True\\n break\\n if added:\\n annotation_paths.append(\\n os.path.join(self.folder, 'train_gt_t13', f'tr_img_{i:05}.txt')\\n )\\n else:\\n print(f'Could not find: {image_path[:-3]}*')\\n\\n return image_paths, annotation_paths\",\n \"def get_image_path(source_path):\\n\\n split = source_path.split('\\\\\\\\')\\n # get filename\\n filename = split[-1].lstrip()\\n # get folder name\\n folder = split[-3]\\n # get full data path\\n current_path = folder + '/IMG/' + filename\\n return current_path\",\n \"def get_feature_paths(start_dir, extensions = ['dcm']):\\n if start_dir is None:\\n start_dir = os.getcwd()\\n img_paths = []\\n for roots,dirs,files in os.walk(start_dir):\\n for name in files:\\n for e in extensions:\\n if name.endswith('.' + e):\\n img_paths.append(roots + '/' + name)\\n img_paths.sort()\\n return img_paths\",\n \"def get_filepaths(self):\\n image_filepaths = set()\\n for one_dir in self.dirs:\\n for root, dirnames, filenames in os.walk(one_dir):\\n for filename in filenames:\\n if re.search(r\\\"\\\\.(jpg|jpeg|png|bmp|tiff)$\\\", filename):\\n image_filepaths.add(os.path.join(root, filename))\\n image_filepaths = sorted(list(image_filepaths))\\n return image_filepaths\",\n \"def images_path(self):\\n return os.path.join(self.extracted_path, \\\"images\\\")\",\n \"def get_subdirs(src_dir):\\n img_dirs = sorted(next(os.walk(src_dir))[1])\\n subdirs = [src_dir + img_dir for img_dir in img_dirs]\\n return subdirs\",\n \"def get_lst_images(file_path):\\n return [i for i in os.listdir(file_path) if i != '.DS_Store']\",\n \"def listdir(self, name, source, test_data=()):\\n assert isinstance(source, config_types.Path)\\n self.m.path.assert_absolute(source)\\n result = self._run(\\n name, ['listdir', source],\\n lambda: self.test_api.listdir(test_data),\\n self.m.raw_io.output_text())\\n ret = [source.join(x) for x in result.stdout.splitlines()]\\n result.presentation.logs['listdir'] = map(str, ret)\\n return ret\",\n \"def source_list(self):\\n return [g[\\\"name\\\"] for g in self._galleries]\",\n \"def collect_train_paths(self):\\n\\n image_paths = []\\n annotation_paths = []\\n n_images = 7200\\n for i in tqdm(range(1, n_images + 1)):\\n added = False\\n for extension in ['jpg', 'png']:\\n image_path = os.path.join(self.folder,\\n f'ch8_training_images_{(i - 1) // 1000 + 1}',\\n f'img_{i}.{extension}')\\n if os.path.exists(image_path):\\n image_paths.append(image_path)\\n added = True\\n break\\n if added:\\n annotation_paths.append(\\n os.path.join(self.folder, 'ch8_training_localization_transcription_gt_v2',\\n f'gt_img_{i}.txt')\\n )\\n else:\\n logging.warning(f'Could not find: {image_path[:-3]}*')\\n return image_paths, annotation_paths\",\n \"def sources_absolute_paths(self):\\r\\n abs_target_base = os.path.join(get_buildroot(), self.target_base)\\r\\n for src in self.sources:\\r\\n yield os.path.join(abs_target_base, src)\",\n \"def all_image_paths(self):\\n self.labels = [i for i in (self.get_immediate_subdirectories(self.root_dir))\\n if not i.startswith('.')]\\n\\n for root, subFolders, files in os.walk(self.root_dir):\\n files = [i for i in files if not i.startswith('.')]\\n files = files[:self.img_num] # hard coded - will not read in\\n for i in files:\\n self.all_files.append(os.path.abspath(root) + '/'.join(subFolders) + '/' + i)\",\n \"def filepaths(self):\\n pass\",\n \"def full_path(startPath,files):\\n\\n files = list_strings(files)\\n base = os.path.split(startPath)[0]\\n return [ os.path.join(base,f) for f in files ]\",\n \"def relative_to_buildroot(self):\\n return [os.path.join(self.rel_path, source) for source in self.source_paths]\",\n \"def find_candidate_images(images_path):\\n images = []\\n for root, dirs, files in os.walk(images_path):\\n for name in files:\\n file_path = os.path.abspath(os.path.join(root, name))\\n if (os.path.splitext(name)[1]).lower() in [\\\".jpg\\\", \\\".png\\\", \\\".jpeg\\\"]:\\n images.append(file_path)\\n return images\",\n \"def CollectImageFilenames(self):\\n # Match all image extensions but not the filenmae of the of beamer pdf\\n regex_img = re.compile(\\n r'^(?!{}).*\\\\.(jpg|png|pdf)'.format(self._filename.replace('.tex', '')))\\n # regex_img = re.compile(r'^(?!test)'.format(self._filename.replace('.tex', '')))\\n files = [f for f in os.listdir(os.getcwd())\\n if regex_img.search(f)]\\n return files\",\n \"def prep_files(app):\\n smali_paths = []\\n start = time.time()\\n \\n for root, dirs, files in os.walk(app, topdown=False):\\n for name in files:\\n if name[-6:] == \\\".smali\\\":\\n smali_paths.append(str(os.path.join(root, name)))\\n \\n return smali_paths\",\n \"def flatfiles(cam):\\n return fullpathlist(flatpath(cam))\",\n \"def get_path_names(directory):\\n paths_without_source = set()\\n paths = glob.glob(source + \\\"**/*.*\\\", recursive=True)\\n for p in paths:\\n paths_without_source.add(p.replace(directory, \\\"\\\", 1))\\n\\n return paths_without_source\",\n \"def get_image_paths(self):\\n return self.image_paths\",\n \"def get_image_paths(self):\\n return self.image_paths\",\n \"def get_dir_and_file_list(path):\\r\\n dList = os.listdir(path)\\r\\n dirList = []\\r\\n fileList = []\\r\\n\\r\\n for item in dList:\\r\\n \\r\\n if os.path.isdir(os.path.join(path, item)):\\r\\n dirList.append(item)\\r\\n elif os.path.isfile(os.path.join(path, item)):\\r\\n if any(image_type in item.lower() for image_type in image_types):\\r\\n preview = image_preview(os.path.join(path, item))\\r\\n fileList.append((item, preview))\\r\\n else:\\r\\n fileList.append((item, None))\\r\\n\\r\\n return dirList, fileList\",\n \"def _get_file_paths(self):\\n return [os.path.join(self.path, self.mode, 'waveforms', file_name + '.npy') for file_name in self.file_names]\",\n \"def collect_project_source_files():\\n source_files = glob.glob(PROJECT_SOURCE_FILES_FOLDER + '/**/*.py', recursive=True)\\n # Insert root main.py at the beginning.\\n source_files.insert(0, os.path.join(PROJECT_ROOT_FOLDER, 'main.py'))\\n return list(map(lambda path: posixpath.join(*path.split('\\\\\\\\')), source_files))\",\n \"def findpaths(path):\\n print('[INFO] Searching for .png images in ', path)\\n frame_paths = []\\n frame_to_path_dict = {}\\n path_to_frame_dict = {}\\n for root, dirs, files in os.walk(path, topdown=False):\\n for name in files:\\n if name.find('.png') != -1:\\n frame_path = os.path.join(root, name)\\n # NOTE: may want to change to deal with generic file names\\n match = re.search(r'(?P<video_id>\\\\d+)_(?P<frame_id>\\\\d+).png', name)\\n # video_id = int(match.group('video_id'))\\n frame_id = int(match.group('frame_id'))\\n frame_paths.append(frame_path)\\n frame_to_path_dict[frame_id] = frame_path\\n path_to_frame_dict[frame_path] = frame_id\\n frame_paths_sorted = sorted(frame_paths, key=lambda x: int(path_to_frame_dict[x]))\\n print('[INFO] %i frames located ' % (len(frame_paths)))\\n return frame_paths_sorted, frame_to_path_dict, path_to_frame_dict\",\n \"def scandir(path_):\\n return os.listdir\",\n \"def get_paths(input_folder):\\n list_files = []\\n conll_folder = glob.glob(input_folder + '/*.json')\\n \\n for filename in conll_folder:\\n list_files.append(filename)\\n\\n return list_files\",\n \"def list_sources(config, base_dir, verbose=False):\\n for source in config.sources_under(abspath(base_dir)):\\n if verbose:\\n print(\\\"# %s (%s)\\\" % (source.nicedir, ' '.join(source.info)))\\n else:\\n print(source.nicedir)\",\n \"def get_lists_in_dir(dir_path):\\n image_list = []\\n\\n for filename in glob.glob(dir_path + '/*.jpg'):\\n image_list.append(filename)\\n return image_list\",\n \"def list_dir(self, path):\",\n \"def load_video_paths(dir):\\n VIDEO_EXTENSIONS = ['.mov', '.MOV', '.mp4']\\n video_paths = []\\n\\n # traverse directory to obtain only paths to videos\\n for dir_name, _, paths in sorted(os.walk(os.path.expanduser(dir))):\\n for path in paths:\\n if any(path.endswith(extensions) for extensions in VIDEO_EXTENSIONS):\\n video_paths.append(os.path.expanduser(dir_name + '/' + path))\\n\\n return video_paths\",\n \"def parse_dir_imgs(root_pth):\\n def visit(imgpths, pth, names):\\n # Appends detected image filenames to a list.\\n imgpths.extend([os.path.join(pth, name) for name in names\\n if os.path.splitext(name)[1].lower() in img_exts])\\n # Walk down directory tree and get the image file paths\\n imgpaths = []\\n for dp, foo, names in os.walk(root_pth):\\n visit(imgpaths, dp, names)\\n # Make lowercased list of imagefilenames\\n imgnames = [os.path.split(pth)[1].lower() for pth in imgpaths]\\n return imgnames, imgpaths\",\n \"def collect_image_files():\\n negs = [] # Non image files found\\n for filename in os.listdir('.'):\\n if filename.lower().endswith('.jpg') or filename.lower().\\\\\\n endswith('.jpeg'):\\n jpg_files.append(filename)\\n elif filename.lower().endswith('.gif'):\\n gif_files.append(filename)\\n elif filename.lower().endswith('.png'):\\n png_files.append(filename)\\n else:\\n negs.append(filename)\\n return negs\",\n \"def get_file_list() -> List[str]:\\n filenames = []\\n os.makedirs(\\\"sequence\\\", exist_ok=True)\\n for file in glob.glob(\\\"sequence/*.smp\\\"):\\n filenames.append(file.replace(\\\"sequence/\\\", \\\"\\\"))\\n return filenames\",\n \"def _get_paths():\\n paths = [\\n '/'\\n ]\\n return paths\",\n \"def Sources():\\n return _sources\",\n \"def GetSongFilenames():\\n\\n\\t## Loop through each directory\\n\\tsong_files = []\\n\\tfor root, dirs, fnames in os.walk(\\\"_data\\\\\\\\fma_small\\\\\\\\\\\"):\\n\\t\\t\\n\\t\\t## Skip the first level\\n\\t\\tif root == \\\"_data\\\\\\\\fma_small\\\\\\\\\\\":\\n\\t\\t\\tcontinue\\n\\n\\t\\t## Otherwise collect the files, appending\\n\\t\\t## the root path.\\n\\t\\tsong_files += [root+\\\"\\\\\\\\\\\"+f for f in fnames]\\n\\n\\treturn song_files\",\n \"def get_images(fish):\\n fish_dir = TRAIN_DIR+'{}'.format(fish)\\n images = [fish+'/'+im for im in os.listdir(fish_dir)]\\n return images\",\n \"def movie_path_list_fixture(tmpdir_factory):\\n path_list = []\\n\\n parent_tmpdir = tmpdir_factory.mktemp(\\\"movies_for_test\\\")\\n rng = np.random.default_rng(172312)\\n this_dir = tempfile.mkdtemp(dir=parent_tmpdir)\\n this_path = tempfile.mkstemp(dir=this_dir, suffix=\\\".h5\\\")[1]\\n with h5py.File(this_path, \\\"w\\\") as out_file:\\n out_file.create_dataset(\\\"data\\\", data=rng.random((12, 512, 512)))\\n\\n path_list.append(this_path)\\n\\n this_dir = tempfile.mkdtemp(dir=parent_tmpdir)\\n this_dir = pathlib.Path(this_dir) / \\\"processed\\\"\\n this_dir.mkdir()\\n this_path = this_dir / \\\"concat_31Hz_0.h5\\\"\\n with h5py.File(this_path, \\\"w\\\") as out_file:\\n out_file.create_dataset(\\\"data\\\", data=rng.random((12, 512, 512)))\\n path_list.append(str(this_path.resolve().absolute()))\\n\\n this_dir = tempfile.mkdtemp(dir=parent_tmpdir)\\n this_dir = pathlib.Path(this_dir) / \\\"processed\\\"\\n this_dir.mkdir()\\n this_path = this_dir / \\\"motion_corrected_video.h5\\\"\\n with h5py.File(this_path, \\\"w\\\") as out_file:\\n out_file.create_dataset(\\\"data\\\", data=rng.random((12, 512, 512)))\\n path_list.append(str(this_path.resolve().absolute()))\\n\\n yield path_list\\n\\n for this_path in path_list:\\n this_path = pathlib.Path(this_path)\\n if this_path.is_file():\\n this_path.unlink()\",\n \"def get_all_images_from_filesystem():\\r\\n\\r\\n logging.debug('get_all_images_from_filesystem()')\\r\\n\\r\\n dir_path = os.path.join(os.environ['TEMP'],'WarietyWallpaperImages')\\r\\n all_full_image_paths = []\\r\\n for my_file in os.listdir(dir_path):\\r\\n if os.path.isfile(os.path.join(dir_path, my_file)):\\r\\n all_full_image_paths.append(os.path.join(dir_path, my_file))\\r\\n return all_full_image_paths\",\n \"def getFiles(self):\\n\\t\\treturn os.listdir(self.getPath())\",\n \"def files_in( d ):\\n return [ join(d,f) for f in os.listdir(d) if isfile(join(d,f)) ]\",\n \"def search_images(\\n current_dir: str,\\n exts={\\\"jpg\\\", \\\"png\\\", \\\"jpeg\\\", \\\"gif\\\"}\\n) -> typing.Iterable[typing.Tuple[str, str]]:\\n for root, _, files in os.walk(current_dir):\\n for file_name in files:\\n ext = file_name.rsplit('.', 1)[-1].lower()\\n if ext in exts:\\n yield os.path.join(root, file_name), file_name\",\n \"def _fetch_all_images(self, path) -> List[str]:\\n files_all = []\\n\\n for ext in self.exts:\\n files_all.extend(glob.glob(join(path, ext)))\\n\\n return files_all\",\n \"def get_custom_imgs(custom_image_path):\\n img_paths = []\\n for path, dir, filenames in os.walk(custom_image_path):\\n for filename in filenames:\\n img_paths.append(os.path.join(path, filename))\\n break\\n return img_paths\",\n \"def get_paths(self):\\n return (self.world_fpath, self.subj_fpath, self.peds_fpath)\",\n \"def load_paths(dir):\\n IMG_EXTENSIONS = ['.jpg', '.JPG', '.jpeg', '.JPEG',\\n '.png', '.PNG', '.bmp', '.BMP']\\n image_paths = []\\n\\n # traverse directory to obtain only paths to images\\n for dir_name, _, paths in sorted(os.walk(os.path.expanduser(dir))):\\n for path in paths:\\n if any(path.endswith(extensions) for extensions in IMG_EXTENSIONS):\\n image_paths.append(os.path.expanduser(dir_name + '/' + path))\\n\\n return image_paths\",\n \"def getMediaFiles(path):\\n fileList = getMediaFileList(path)\\n # dirList = getDirectoryList(path)\\n\\n # results = map(getMediaFiles, dirList)\\n\\n # for result in results:\\n # fileList = fileList + result\\n\\n return fileList\",\n \"def get_images_path(file_path):\\n assert os.path.isfile(file_path)\\n\\n images_path = []\\n image_dir = os.path.dirname(file_path)\\n\\n with open(file_path, 'r') as f:\\n for line in f:\\n line = line.strip()\\n origin_path, annot_path = line.split(\\\" \\\")\\n origin_path = os.path.join(image_dir, origin_path)\\n annot_path = os.path.join(image_dir, annot_path)\\n images_path.append([origin_path, annot_path])\\n\\n return images_path\",\n \"def fullpathlist(path):\\n try:\\n return [os.path.join(path, filename) for filename in os.listdir(path)]\\n except OSError:\\n return []\",\n \"def listImageFolder():\\n #Note: Ignores files ending in ~ which is a backup/lock file\\n return [f for f in os.listdir(imageFolder) if f[-1] is not '~']\",\n \"def filePaths(directory_with_files):\\n\\n # get a list of file names in directory\\n list_of_files = os.listdir(directory_with_files) \\n\\n # join directory path and file name to get full paths to files\\n filepaths = [os.path.join(directory_with_files, filename) for filename in list_of_files]\\n\\n return filepaths\",\n \"def findFiles(target, path):\\r\\n\\tfiles = []\\r\\n\\tlyst = os.listdir(path)\\r\\n\\tfor element in lyst:\\r\\n\\t\\tif os.path.isfile(element):\\r\\n\\t\\t\\tif target in element:\\r\\n\\t\\t\\t\\tfiles.append(path + os.sep + element)\\r\\n\\t\\telse:\\r\\n\\t\\t\\tos.chdir(element)\\r\\n\\t\\t\\tfiles.extend(findFiles(target, os.getcwd()))\\r\\n\\t\\t\\tos.chdir(\\\"..\\\")\\r\\n\\treturn files\",\n \"def fetch_path_from_dirs(list_of_search_dirs, key):\\n outputs = []\\n for d in list_of_search_dirs:\\n this_search_path = os.path.join(d, \\\"*\\\" + key + \\\"*\\\")\\n outputs.extend(glob.glob(this_search_path))\\n return outputs\",\n \"def read_paths(path):\\n images = [[] for _ in range(2)]\\n for dirname, dirnames, _ in os.walk(path):\\n for subdirname in dirnames:\\n filepath = os.path.join(dirname, subdirname)\\n for filename in os.listdir(filepath):\\n try:\\n imgpath = str(os.path.join(filepath, filename))\\n images[0].append(imgpath)\\n limit = re.findall('[0-9]+', filename)\\n images[1].append(limit[0])\\n except IOError as err:\\n print(\\\"I/O error\\\")\\n except:\\n print(\\\"I/O error 2\\\")\\n raise\\n return images\",\n \"def source_dirs_files(fspath, fil=None):\\r\\n dirs = []\\r\\n files = []\\r\\n for child in fspath.listdir(fil=fil):\\r\\n if child.basename.startswith('.'):\\r\\n continue\\r\\n if child.check(dir=True):\\r\\n dirs.append(child)\\r\\n elif child.check(file=True):\\r\\n if child.ext in ['.pyc', '.pyo']:\\r\\n continue\\r\\n files.append(child)\\r\\n return sorted(dirs), sorted(files)\",\n \"def list_filenames(self):\\n l = []\\n for path, dirs, files in os.walk(self.archive_path):\\n for file in files:\\n l.append(os.path.relpath(os.path.join(path,file),self.archive_path))\\n l.sort()\\n return l\",\n \"def _path_files(self):\\n\\n if not os.path.exists(self.path):\\n return None\\n\\n directory_content = os.listdir(self.path)\\n files = []\\n\\n while len(directory_content) != 0:\\n\\n if not directory_content[0].startswith(self.path):\\n directory_obj = os.path.join(self.path, directory_content[0])\\n else:\\n directory_obj = directory_content[0]\\n\\n if os.path.isfile(directory_obj):\\n files.append(directory_obj)\\n elif os.path.exists(directory_obj):\\n temp_directory_content = os.listdir(directory_obj)\\n for obj in temp_directory_content:\\n directory_content.append(os.path.join(directory_obj, obj))\\n directory_content.pop(0)\\n\\n return files\",\n \"def get_paths(input_folder: str) -> list[str]:\\n\\n return [f for f in os.listdir(input_folder) if f[-4:] == '.txt' and f[:3] != 'top']\",\n \"def list_selfplay_dirs(base_dir):\\n\\n model_dirs = [os.path.join(base_dir, x)\\n for x in tf.io.gfile.listdir(base_dir)]\\n return sorted(model_dirs, reverse=True)\",\n \"def _get_images(image_path):\\n logger.debug(\\\"Getting images: '%s'\\\", image_path)\\n if not os.path.isdir(image_path):\\n logger.debug(\\\"Folder does not exist\\\")\\n return None\\n files = [os.path.join(image_path, f)\\n for f in os.listdir(image_path) if f.lower().endswith((\\\".png\\\", \\\".jpg\\\"))]\\n logger.debug(\\\"Image files: %s\\\", files)\\n return files\",\n \"def getImages(self,Project=\\\"\\\"):\\n #images = [\\\"image1.jpg\\\",\\\"image2.jpg\\\",\\\"image3.jpg\\\"]\\n \\n os.chdir(self.dataDir)\\n images = glob.glob(\\\"*.png\\\")\\n \\n return images\",\n \"def get_directories():\\n # get current working dir\\n directory = os.getcwd()\\n # list of dir to look in repo for files\\n directories = [\\n directory,\\n os.path.expanduser(os.path.join(directory, 'src')),\\n os.path.expanduser(os.path.join(directory, 'tests'))\\n ]\\n return directories\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.6780654","0.664078","0.66328037","0.6586579","0.6527416","0.6516118","0.6454078","0.6445807","0.6427995","0.64033985","0.6284854","0.6242137","0.62136245","0.62066734","0.61857104","0.61600107","0.61456895","0.6120278","0.61164725","0.6079566","0.607903","0.60765576","0.6073444","0.607042","0.606977","0.6066481","0.6065801","0.6054336","0.60413295","0.6034053","0.602889","0.60250366","0.60149413","0.59982824","0.59940577","0.5989405","0.59889436","0.5983747","0.5979806","0.59707624","0.5966403","0.596542","0.59614986","0.59587055","0.5949511","0.59439516","0.5937938","0.5921194","0.58973396","0.5896181","0.589426","0.5888969","0.587682","0.58664894","0.5864955","0.58626944","0.58616513","0.58607423","0.58607423","0.58590317","0.58499676","0.5844197","0.5838828","0.58318096","0.58122194","0.5809824","0.5807692","0.579219","0.5786775","0.5778203","0.5773751","0.57713616","0.57712257","0.57620466","0.57568944","0.575689","0.57562786","0.57545584","0.5733904","0.5720712","0.5720115","0.5717183","0.5706487","0.5706117","0.5703502","0.5702218","0.57015634","0.56944364","0.5692686","0.5687115","0.5684107","0.56818515","0.567799","0.5671184","0.56708336","0.56700397","0.5668775","0.56685567","0.5664542","0.5658183","0.5656091"],"string":"[\n \"0.6780654\",\n \"0.664078\",\n \"0.66328037\",\n \"0.6586579\",\n \"0.6527416\",\n \"0.6516118\",\n \"0.6454078\",\n \"0.6445807\",\n \"0.6427995\",\n \"0.64033985\",\n \"0.6284854\",\n \"0.6242137\",\n \"0.62136245\",\n \"0.62066734\",\n \"0.61857104\",\n \"0.61600107\",\n \"0.61456895\",\n \"0.6120278\",\n \"0.61164725\",\n \"0.6079566\",\n \"0.607903\",\n \"0.60765576\",\n \"0.6073444\",\n \"0.607042\",\n \"0.606977\",\n \"0.6066481\",\n \"0.6065801\",\n \"0.6054336\",\n \"0.60413295\",\n \"0.6034053\",\n \"0.602889\",\n \"0.60250366\",\n \"0.60149413\",\n \"0.59982824\",\n \"0.59940577\",\n \"0.5989405\",\n \"0.59889436\",\n \"0.5983747\",\n \"0.5979806\",\n \"0.59707624\",\n \"0.5966403\",\n \"0.596542\",\n \"0.59614986\",\n \"0.59587055\",\n \"0.5949511\",\n \"0.59439516\",\n \"0.5937938\",\n \"0.5921194\",\n \"0.58973396\",\n \"0.5896181\",\n \"0.589426\",\n \"0.5888969\",\n \"0.587682\",\n \"0.58664894\",\n \"0.5864955\",\n \"0.58626944\",\n \"0.58616513\",\n \"0.58607423\",\n \"0.58607423\",\n \"0.58590317\",\n \"0.58499676\",\n \"0.5844197\",\n \"0.5838828\",\n \"0.58318096\",\n \"0.58122194\",\n \"0.5809824\",\n \"0.5807692\",\n \"0.579219\",\n \"0.5786775\",\n \"0.5778203\",\n \"0.5773751\",\n \"0.57713616\",\n \"0.57712257\",\n \"0.57620466\",\n \"0.57568944\",\n \"0.575689\",\n \"0.57562786\",\n \"0.57545584\",\n \"0.5733904\",\n \"0.5720712\",\n \"0.5720115\",\n \"0.5717183\",\n \"0.5706487\",\n \"0.5706117\",\n \"0.5703502\",\n \"0.5702218\",\n \"0.57015634\",\n \"0.56944364\",\n \"0.5692686\",\n \"0.5687115\",\n \"0.5684107\",\n \"0.56818515\",\n \"0.567799\",\n \"0.5671184\",\n \"0.56708336\",\n \"0.56700397\",\n \"0.5668775\",\n \"0.56685567\",\n \"0.5664542\",\n \"0.5658183\",\n \"0.5656091\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.0"},"document_rank":{"kind":"string","value":"-1"}}},{"rowIdx":6084,"cells":{"query":{"kind":"string","value":"Return the list of full paths for pictures and movies in source directory plus subdirectories containing media"},"document":{"kind":"string","value":"def list_of_medias_ext(args, sourcedir):\n result = list()\n listdir = sorted_listdir(os.listdir(sourcedir))\n if '.nomedia' not in listdir:\n for basename in listdir:\n fullname = os.path.join(sourcedir, basename)\n if os.path.isdir(fullname) and basename != '$RECYCLE.BIN' and contains_media(args, fullname):\n result.append(fullname)\n else:\n if is_media_within_dates(fullname, args.dates):\n result.append(fullname)\n return result"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["def list_of_files(sourcedir, recursive):\n result = list()\n if recursive is False:\n listdir = sorted_listdir(os.listdir(sourcedir))\n if '.nomedia' not in listdir:\n for basename in listdir:\n result.append(os.path.join(sourcedir, basename))\n else:\n for root, dirs, files in os.walk(sourcedir):\n if '.nomedia' not in files:\n for basename in sorted_listdir(files):\n result.append(os.path.join(root, basename))\n return result","def __return_movie_file_list(self, movie_path):\n movie_dir = movie_path.rsplit(\"/\",1)[0]\n movie_file_list =[]\n movie_extentionds = self.__movie_file_extensions(self.__file_extentions)\n for x in os.listdir(movie_dir):\n if x.rsplit(\".\",1)[-1]in movie_extentionds:\n movie_file_list.append(movie_dir+\"/\"+x)\t\t\n\t#USUNAC URL Z NAPISY24\n return movie_file_list","def get_file_paths():\n audio_folder = MY_DIR + '/assets'\n\n audio_addy_list = []\n for file in os.scandir(audio_folder):\n audio_addy_list.append(file.path)\n\n return audio_addy_list","def getMediaFiles(path):\n fileList = getMediaFileList(path)\n # dirList = getDirectoryList(path)\n\n # results = map(getMediaFiles, dirList)\n\n # for result in results:\n # fileList = fileList + result\n\n return fileList","def get_subdirs(src_dir):\n img_dirs = sorted(next(os.walk(src_dir))[1])\n subdirs = [src_dir + img_dir for img_dir in img_dirs]\n return subdirs","def find_photos(source_path, common_extensions=('JPG', 'CR2', 'ORF', 'ARW', 'TIFF', 'DNG'), ignore=[]):\n # combinedignored = re.compile('|'.join('(?:{0})'.format(x) for x in ignore))\n # use endswith , ignore must be a tuple then\n # if ignore and dirpath.endswith(ignore):\n # for duplication, at the end cll the same funciton\n\n source_files = list()\n\n for (dirpath, dirnames, filenames) in os.walk(source_path):\n for f in filenames:\n if f.upper().endswith(common_extensions):\n # source_files.append(os.path.join(dirpath, f))\n parent = os.path.basename(os.path.normpath(dirpath))\n source_files.append({'dir':dirpath,\n 'filename':f,\n 'parent_folder':parent})\n\n return source_files","def get_movies(path):\n movies_list = []\n \n \n for f in os.listdir(path):\n \n full_file_path = join(path,f)\n if isdir(full_file_path):\n \n movies_list.extend( get_movies(full_file_path) )\n \n elif isfile(full_file_path) and full_file_path[-3:] in util.extension:\n m = Movie(f, full_file_path)\n movies_list.append(m)\n \n return movies_list","def get_all_paths(why = 'train'):\r\n if why == 'train':\r\n parent_folder = train_parent_folder\r\n if why == 'test':\r\n parent_folder = test_test_folder\r\n sub_folders = glob.glob(parent_folder) # Directories of all languages\r\n image_paths = [glob.glob(sub_folder + '\\*') for sub_folder in sub_folders] # Directories of all characters\r\n image_paths = sum(image_paths, []) # Flatten out the 2D list to a 1D list \r\n return image_paths","def get_replay_source_helper_paths(self):\n\n if self.replay_source is None:\n return None\n\n paths = []\n classes = self.get_helpers_classes()\n\n base_path = self.base_folder_path + \"/data/replay_images/\" + self.replay_source + \"/\"\n for hc in classes:\n current_paths = []\n for c in hc:\n path = base_path + str(c).zfill(2) + \".tfrecord\"\n current_paths.append(path)\n paths.append(current_paths)\n return paths","def get_image_path(raw_input_dir: str) -> list:\n result = []\n for root, dirs, files in os.walk(raw_input_dir):\n for file in files:\n result.append(os.path.join(root, file))\n return result","def voicesPathsCollector(source_dir, gender_ids):\r\n # The list containing the IDs of the speakers which are the folder names\r\n person_ids_list = gender_ids\r\n\r\n # An empty list which it will contains voices paths which are in the section folders\r\n voices_paths_list = []\r\n\r\n # Iterating over a person speaker ids\r\n for person_id_idx in range(len(person_ids_list)):\r\n # Speaker path containing the chapter's directories\r\n speaker_path = Path.cwd().joinpath(source_dir, person_ids_list[person_id_idx])\r\n # The list containing the IDs of the sections by the current speaker which are the folder names\r\n sections_ids_list = os.listdir(speaker_path)\r\n\r\n # Iterating over a sections ids by the current speaker\r\n for sec_id_idx in range(len(sections_ids_list)):\r\n # Section path containing files\r\n section_path = Path.cwd().joinpath(speaker_path,sections_ids_list[sec_id_idx])\r\n # Iterating over files which are existing in section's folders\r\n for file in os.listdir(section_path):\r\n # Choose files with .flac extension\r\n if file.endswith(\".flac\"):\r\n\r\n voice_path = Path.cwd().joinpath(section_path, file)\r\n voices_paths_list.append(voice_path)\r\n\r\n return voices_paths_list","def get_replay_source_no_helper_paths(self):\n paths = []\n classes = self.get_replay_classes_no_helper()\n base_path = self.base_folder_path + \"/data/replay_images/\" + self.replay_source + \"/\"\n\n \n for c in classes:\n full_path = base_path + str(c).zfill(2) + \".tfrecord\"\n paths.append(full_path)\n \n return paths","def readPlayerImageFiles(self):\n currentPath = os.path.dirname(os.path.abspath(__file__))\n listOfFileNames=[]\n for i in os.listdir(currentPath):\n if re.match(\"player\\_\\d+\",i): #i.endswith(\".gif\")\n listOfFileNames.append(currentPath+'/'+i)\n return listOfFileNames","def get_library_content(self):\n from glob import glob\n try:\n os.path.isdir(self.source)\n lst = glob(self.source + '/*')\n except TypeError:\n lst = self.source\n dircheck = True\n while dircheck is True:\n dircheck = False\n newlst = []\n for entry in lst:\n if os.path.isdir(entry):\n newlst.extend(glob(entry + '/*'))\n dircheck = True\n else:\n newlst.append(entry)\n lst = newlst\n return lst","def get_all_image_paths(self):\n image_paths, image_labels = [], []\n for directory_name, subdirectory_list, file_list in os.walk(self.root_directory):\n for file_name in file_list:\n if file_name.endswith(('.jpg',)):\n image_paths.append(os.path.join(directory_name, file_name))\n # Translates labels to 0-26 as recommended in the exercise description\n image_labels.append(ord(directory_name[-1]) - 97)\n return image_paths, image_labels","def source_paths(self):\n paths = self.config.get('static_dirs')\n if paths:\n return paths\n return [self.config.get('static_dir')]","def get_paths_list_from_folder(folder):\n names = os.listdir(folder)\n relative_paths = [os.path.join(folder, image_name) for image_name in names]\n return relative_paths","def create_directory_list(root_dir: str):\n if not os.path.exists(root_dir):\n raise FileNotFoundError(\"Directory {} does not exist\".format(root_dir))\n\n # List all directories associated to different videos.\n recording_path_list = [os.path.join(root_dir, f) for f in os.listdir(root_dir)]\n\n input_data_path = []\n for g in recording_path_list:\n # Append the different directories associated to different video frame intervals.\n input_data_path.extend([os.path.join(g, f) for f in os.listdir(g)])\n\n return input_data_path","def get_dir_files(self, recursive=False):\n logging.info('Enumerating files under the source path (recursive=%s) ...', recursive)\n files = {}\n if not recursive:\n files[self.path_source] = [\n f for f in os.listdir(self.path_source) if os.path.isfile(os.path.join(self.path_source, f))\n ]\n else:\n for current_dir, sub_dirs, dir_files in os.walk(self.path_source):\n files[os.path.join(self.path_source, current_dir)] = [f for f in dir_files]\n\n return files","def GetSongFilenames():\n\n\t## Loop through each directory\n\tsong_files = []\n\tfor root, dirs, fnames in os.walk(\"_data\\\\fma_small\\\\\"):\n\t\t\n\t\t## Skip the first level\n\t\tif root == \"_data\\\\fma_small\\\\\":\n\t\t\tcontinue\n\n\t\t## Otherwise collect the files, appending\n\t\t## the root path.\n\t\tsong_files += [root+\"\\\\\"+f for f in fnames]\n\n\treturn song_files","def get_images_paths(path: str) -> List[str]:\n\n image_paths = []\n\n for folder in os.listdir(path):\n for file in os.listdir(os.path.join(f\"{path}/{folder}\", \"images\")):\n image_paths.append(f\"{path}/{folder}/images/{file}\")\n\n return image_paths","def get_dir_and_file_list(path):\r\n dList = os.listdir(path)\r\n dirList = []\r\n fileList = []\r\n\r\n for item in dList:\r\n \r\n if os.path.isdir(os.path.join(path, item)):\r\n dirList.append(item)\r\n elif os.path.isfile(os.path.join(path, item)):\r\n if any(image_type in item.lower() for image_type in image_types):\r\n preview = image_preview(os.path.join(path, item))\r\n fileList.append((item, preview))\r\n else:\r\n fileList.append((item, None))\r\n\r\n return dirList, fileList","def load_video_paths(dir):\n VIDEO_EXTENSIONS = ['.mov', '.MOV', '.mp4']\n video_paths = []\n\n # traverse directory to obtain only paths to videos\n for dir_name, _, paths in sorted(os.walk(os.path.expanduser(dir))):\n for path in paths:\n if any(path.endswith(extensions) for extensions in VIDEO_EXTENSIONS):\n video_paths.append(os.path.expanduser(dir_name + '/' + path))\n\n return video_paths","def get_datapaths(input_dir):\n image_paths = []\n assert os.path.isdir(input_dir), f\"{input_dir} is not existed\"\n\n for root, _, names in os.walk(input_dir):\n for name in names:\n path = os.path.join(root, name)\n image_paths.append(path)\n return image_paths","def get_source_files(self):\n return [\n path.as_posix()\n for path in _Path(self.src_dir).rglob(\"*\")\n if not path.is_dir()\n ] + [\n (path / \"CMakeLists.txt\").as_posix()\n for path in _PurePath(self.src_dir).parents\n ]","def listdir(self, name, source, test_data=()):\n assert isinstance(source, config_types.Path)\n self.m.path.assert_absolute(source)\n result = self._run(\n name, ['listdir', source],\n lambda: self.test_api.listdir(test_data),\n self.m.raw_io.output_text())\n ret = [source.join(x) for x in result.stdout.splitlines()]\n result.presentation.logs['listdir'] = map(str, ret)\n return ret","def get_skins_and_extensions(base_dir):\n ext_paths = []\n for subdir in ['extensions', 'skins']:\n for name in os.listdir(os.path.join(base_dir, subdir)):\n if os.path.isdir(os.path.join(base_dir, subdir, name)):\n ext_paths.append(os.path.join(subdir, name))\n return ext_paths","def files_in( d ):\n return [ join(d,f) for f in os.listdir(d) if isfile(join(d,f)) ]","def get_content_directories() -> List[str]:\n result:list[str] = []\n for current_path in os.listdir(\"content\"):\n if os.path.isdir(os.path.join(\"content\", current_path)):\n result.append(os.path.join(\"content\", current_path))\n return result","def get_filepaths(extract_dir):\n\n index = []\n labels = []\n _extract_dir = os.path.join(extract_dir, 'UCF-101')\n for folder in os.listdir(_extract_dir):\n labels.append(folder)\n folderpath = os.path.join(_extract_dir, folder)\n\n if not os.path.isdir(folderpath):\n continue\n\n for filename in os.listdir(folderpath):\n if 'avi' not in filename:\n continue\n\n if filename[0] == '.':\n continue\n\n filepath = os.path.join(folderpath, filename)\n\n if os.path.exists(filepath):\n index.append(filepath)\n else:\n print(filepath)\n return index, labels","def fetch_path_from_dirs(list_of_search_dirs, key):\n outputs = []\n for d in list_of_search_dirs:\n this_search_path = os.path.join(d, \"*\" + key + \"*\")\n outputs.extend(glob.glob(this_search_path))\n return outputs","def udimPaths(self):\n\t\ttry:\n\t\t\treturn [ textureFile( self.dirPath + a ) for a in os.listdir( self.dirPath ) if self.name + '.' in a ]\n\t\texcept:\n\t\t\treturn []","def getImages(path):\n files = list()\n\n for f in listdir(path):\n file = join(path, f)\n if isfile(file):\n files.append(getImage(file))\n\n return files","def get_directories():\n # get current working dir\n directory = os.getcwd()\n # list of dir to look in repo for files\n directories = [\n directory,\n os.path.expanduser(os.path.join(directory, 'src')),\n os.path.expanduser(os.path.join(directory, 'tests'))\n ]\n return directories","def findFiles(target, path):\r\n\tfiles = []\r\n\tlyst = os.listdir(path)\r\n\tfor element in lyst:\r\n\t\tif os.path.isfile(element):\r\n\t\t\tif target in element:\r\n\t\t\t\tfiles.append(path + os.sep + element)\r\n\t\telse:\r\n\t\t\tos.chdir(element)\r\n\t\t\tfiles.extend(findFiles(target, os.getcwd()))\r\n\t\t\tos.chdir(\"..\")\r\n\treturn files","def walk_dir(path):\r\n\tassets = []\r\n\r\n\tfor file in os.listdir(path):\r\n\t\tif os.path.isdir(path + \"/\" + file):\r\n\t\t\tif not file.startswith(\".\"):\r\n\t\t\t\t# Ignore . dirs (e.g .svn)\r\n\t\t\t\tassets.extend(walk_dir(path + \"/\" + file))\r\n\t\telif file.endswith('.blend'):\r\n\t\t\tassets.append(path + \"/\" + file)\r\n\r\n\treturn assets","def all_image_paths(self):\n self.labels = [i for i in (self.get_immediate_subdirectories(self.root_dir))\n if not i.startswith('.')]\n\n for root, subFolders, files in os.walk(self.root_dir):\n files = [i for i in files if not i.startswith('.')]\n files = files[:self.img_num] # hard coded - will not read in\n for i in files:\n self.all_files.append(os.path.abspath(root) + '/'.join(subFolders) + '/' + i)","def list_selfplay_dirs(base_dir):\n\n model_dirs = [os.path.join(base_dir, x)\n for x in tf.io.gfile.listdir(base_dir)]\n return sorted(model_dirs, reverse=True)","def get_all_videos_in_directory(directory: str):\n\n all_files_and_folders = os.listdir(directory)\n\n only_videos = []\n for file in all_files_and_folders:\n if is_video(file):\n only_videos.append(file)\n ...\n\n return only_videos","def collect_project_source_files():\n source_files = glob.glob(PROJECT_SOURCE_FILES_FOLDER + '/**/*.py', recursive=True)\n # Insert root main.py at the beginning.\n source_files.insert(0, os.path.join(PROJECT_ROOT_FOLDER, 'main.py'))\n return list(map(lambda path: posixpath.join(*path.split('\\\\')), source_files))","def getFiles(searchDir = './', extension = 'source'):\n from glob import glob \n\n return glob(searchDir+'/*.'+extension)","def _get_files(self, path):\n result = []\n for f in os.listdir(path):\n if os.path.isdir(os.path.join(path, f)):\n result += self._get_files(os.path.join(path, f))\n else:\n result.append(os.path.join(path, f))\n return result","def _path_files(self):\n\n if not os.path.exists(self.path):\n return None\n\n directory_content = os.listdir(self.path)\n files = []\n\n while len(directory_content) != 0:\n\n if not directory_content[0].startswith(self.path):\n directory_obj = os.path.join(self.path, directory_content[0])\n else:\n directory_obj = directory_content[0]\n\n if os.path.isfile(directory_obj):\n files.append(directory_obj)\n elif os.path.exists(directory_obj):\n temp_directory_content = os.listdir(directory_obj)\n for obj in temp_directory_content:\n directory_content.append(os.path.join(directory_obj, obj))\n directory_content.pop(0)\n\n return files","def getfiles(path): \n global picture_list\n try:\n # dir_list has all files and directories in path\n # any directory is WITHOUT ending '/'\n dir_list = os.listdir(path)\n except:\n # path may not be a directory or permission error\n print \"ERROR: in getfiles, picture_list:\", picture_list\n picture_list = None\n return\n \n for line in dir_list:\n file = path + \"/\" + line\n if os.path.isdir(file):\n getfiles( file) # dig into subdirectory\n elif isPicture(file):\n picture_list.append(file)\n else: \n # neither picture file nor directory; ignore \n pass\n return","def relative_to_buildroot(self):\n return [os.path.join(self.rel_path, source) for source in self.source_paths]","def get_filepaths(self):\n image_filepaths = set()\n for one_dir in self.dirs:\n for root, dirnames, filenames in os.walk(one_dir):\n for filename in filenames:\n if re.search(r\"\\.(jpg|jpeg|png|bmp|tiff)$\", filename):\n image_filepaths.add(os.path.join(root, filename))\n image_filepaths = sorted(list(image_filepaths))\n return image_filepaths","def getImmediateSubdirectories(dir):","def list_files_and_dirs(self, path=\"/\"):\n dirs = self.list_dirs(path)\n files = self.list_files(path)\n return dirs + files","def generate_paths(dirname, recursive=False):\n if recursive:\n gen = itertools.chain.from_iterable(\n map(lambda x: map(partial(os.path.join, x[0]), x[2]),\n os.walk(dirname)))\n else:\n gen = filter(os.path.isfile,\n map(partial(os.path.join, dirname), os.listdir(dirname)))\n return filter(lambda s: re.match('.+\\.midi?$', s, re.I), gen)","def return_images(directory):\r\n allfiles = os.listdir(directory)\r\n image_list = [im for im in allfiles if '.jpg' in str(im)]\r\n image_list = [directory + im for im in image_list]\r\n return image_list","def list_of_medias(args, sourcedir, recursive):\n files = list_of_files(sourcedir, recursive)\n return [_ for _ in files if is_media_within_dates(_, args.dates)]","def list_directory(path):\n files = []\n for f in listdir(path):\n if isfile(join(path, f)) and f.endswith('.mp3'):\n files.append(f)\n return files","def get_subdirectories(self, physical_path):\n result = []\n for p in os.listdir(physical_path):\n if not os.path.isdir(os.path.join(physical_path, p)):\n continue\n result.append(os.path.join(physical_path, p))\n\n return result","def list_dir(self, path):","def flatfiles(cam):\n return fullpathlist(flatpath(cam))","def get_media_directory():\n\treturn _paths[_MEDIA_DIRECTORY_KEY]","def getAllDirs(self):\n\n dirs = [ self ]\n for d in self._subdirs:\n if d.hasImages():\n dirs += d.getAllDirs()\n return dirs","def get_image_list(path: str) -> list:\n\n return list(os.path.join(path, f)\n for f in os.listdir(path)\n if f.endswith('.jpg'))","def getMediaFileList(path):\n\n fileTypes = (\"jpg\", \"mov\", \"mp4\")\n fileList = []\n for base_dir, dirs, files in os.walk(path):\n fileList.extend([os.path.join(base_dir, f) for f in files if f.split(\".\")[1].lower() in fileTypes])\n\n # for the new canon camera, ther are some .Trash and trashinfo files, want to ignore them\n fileList = [file for file in fileList if \"trash\" not in file and \"Trash\" not in file]\n return fileList","def get_filepaths(directory):\n file_paths = [] # List which will store all of the full filepaths.\n\n # Walk the tree.\n\n for root, directories, files in os.walk(directory):\n\n for filename in files:\n if filename.endswith('.wav'):\n # Join the two strings in order to form the full filepath.\n filepath = os.path.join(root, filename)\n file_paths.append(filepath) # Add it to the list.\n # pdb.set_trace()\n file_paths.sort()\n return file_paths","def _get_file_paths(self):\n return [os.path.join(self.path, self.mode, 'waveforms', file_name + '.npy') for file_name in self.file_names]","def source_dirs_files(fspath, fil=None):\r\n dirs = []\r\n files = []\r\n for child in fspath.listdir(fil=fil):\r\n if child.basename.startswith('.'):\r\n continue\r\n if child.check(dir=True):\r\n dirs.append(child)\r\n elif child.check(file=True):\r\n if child.ext in ['.pyc', '.pyo']:\r\n continue\r\n files.append(child)\r\n return sorted(dirs), sorted(files)","def get_paths(input_folder):\n list_files = []\n conll_folder = glob.glob(input_folder + '/*.json')\n \n for filename in conll_folder:\n list_files.append(filename)\n\n return list_files","def get_lists_in_dir(dir_path):\n image_list = []\n\n for filename in glob.glob(dir_path + '/*.jpg'):\n image_list.append(filename)\n return image_list","def get_file_list(input_dir):\n\tfile_paths = [input_dir +'/' + f for f in listdir(input_dir) if isfile(join(input_dir, f)) ]\n\treturn file_paths","def search_images(\n current_dir: str,\n exts={\"jpg\", \"png\", \"jpeg\", \"gif\"}\n) -> typing.Iterable[typing.Tuple[str, str]]:\n for root, _, files in os.walk(current_dir):\n for file_name in files:\n ext = file_name.rsplit('.', 1)[-1].lower()\n if ext in exts:\n yield os.path.join(root, file_name), file_name","def get_dirs(source_dir):\n all_dirs = set()\n it = os.walk(source_dir)\n it.next()\n dirs = list(it)\n for d in dirs:\n if len(d[1])==0:\n all_dirs.add(d[0])\n return all_dirs","def sources_absolute_paths(self):\r\n abs_target_base = os.path.join(get_buildroot(), self.target_base)\r\n for src in self.sources:\r\n yield os.path.join(abs_target_base, src)","def getFilePaths():\n \n image_dir = r'/hpc/wfok007/mpi_heart/Training Set'\n mask_paths = []\n image_paths = []\n for root, dirs, files in os.walk(image_dir, topdown=False):\n for name in files:\n if name == 'laendo.nrrd':\n mask_paths.append(os.path.join(root, name))\n elif name == 'lgemri.nrrd':\n image_paths.append(os.path.join(root, name))\n else:\n print ('%s is unknown' %name)\n return mask_paths, image_paths","def segment_paths(root):\n directories = []\n history = history_path(root)\n for d in os.listdir(history):\n path = os.path.join(history, d)\n if os.path.isdir(path):\n directories.append(path)\n return sorted(directories)","def get_path_names(directory):\n paths_without_source = set()\n paths = glob.glob(source + \"**/*.*\", recursive=True)\n for p in paths:\n paths_without_source.add(p.replace(directory, \"\", 1))\n\n return paths_without_source","def list_sources(config, base_dir, verbose=False):\n for source in config.sources_under(abspath(base_dir)):\n if verbose:\n print(\"# %s (%s)\" % (source.nicedir, ' '.join(source.info)))\n else:\n print(source.nicedir)","def demo_paths(self):\n base_path = os.path.join(self.module.__path__[0], 'demo')\n paths = []\n if os.path.isdir(base_path):\n for item in os.listdir(base_path):\n # TODO: support examples which is not auto-loaded\n if not os.path.isdir(os.path.join(base_path, 'examples')):\n paths.append(os.path.join(base_path, item))\n return paths","def parse_dir_imgs(root_pth):\n def visit(imgpths, pth, names):\n # Appends detected image filenames to a list.\n imgpths.extend([os.path.join(pth, name) for name in names\n if os.path.splitext(name)[1].lower() in img_exts])\n # Walk down directory tree and get the image file paths\n imgpaths = []\n for dp, foo, names in os.walk(root_pth):\n visit(imgpaths, dp, names)\n # Make lowercased list of imagefilenames\n imgnames = [os.path.split(pth)[1].lower() for pth in imgpaths]\n return imgnames, imgpaths","def recursive_glob(rootdir=\".\", suffix=\"\"):\n image_paths = []\n for looproot, _, filenames in os.walk(rootdir):\n for filename in filenames:\n if filename.endswith(suffix):\n image_paths.append(os.path.join(looproot, filename))\n return image_paths","def recursive_glob(rootdir=\".\", suffix=\"\"):\n image_paths = []\n for looproot, _, filenames in os.walk(rootdir):\n for filename in filenames:\n if filename.endswith(suffix):\n image_paths.append(os.path.join(looproot, filename))\n return image_paths","def get_feature_paths(start_dir, extensions = ['dcm']):\n if start_dir is None:\n start_dir = os.getcwd()\n img_paths = []\n for roots,dirs,files in os.walk(start_dir):\n for name in files:\n for e in extensions:\n if name.endswith('.' + e):\n img_paths.append(roots + '/' + name)\n img_paths.sort()\n return img_paths","def scandir(path_):\n return os.listdir","def extract_embeddings_recursive_from_dir(self, dir_from: PathLike, dir_to: PathLike) -> PathLike:\n pass","def get_img_files(images, db):\n img_dir = db.source\n if img_dir == None:\n raise ValueError('Cannot locate file without a base path. This method looks for it at \\\n db.source, which is not set. This should be set by the loader during DB construction!')\n img_dir = path.join(img_dir, 'img') \n locs = db.get_img_locs(images)\n titles = db.get_location_titles()\n returnval = []\n for image in images:\n loc = locs[image]\n if loc is None:\n raise ValueError('The image %s could not be found' % image)\n returnval.append(path.join(img_dir, titles[loc], str(image) + '.jpg'))\n return returnval","def collect_files(path, audio_files):\n\n for entry in os.scandir(path):\n if entry.is_dir():\n collect_files(entry.path, audio_files)\n if entry.is_file() and (entry.path.endswith(\".flac\") or entry.path.endswith(\".wav\")):\n audio_files.append(entry.path)","def get_imlist(path):\n return [os.path.join(path, f) for f in os.listdir(path) if f.endswith('.jpg')]","def getSourcePaths(self, makeGlyphs=True, makeKerning=True, makeInfo=True):\n paths = []\n for name in self.sources.keys():\n paths.append(self.sources[name][0].path)\n return paths","def filePaths(directory_with_files):\n\n # get a list of file names in directory\n list_of_files = os.listdir(directory_with_files) \n\n # join directory path and file name to get full paths to files\n filepaths = [os.path.join(directory_with_files, filename) for filename in list_of_files]\n\n return filepaths","def getContentFiles():\n contentFiles = []\n for contentDir, subDirs, filenames in os.walk(sourceDir, followlinks=True):\n if shouldIgnore(contentDir):\n subDirs[:] = []\n continue\n for filename in filenames:\n if not shouldIgnore(filename):\n cf = ContentFile(os.path.join(contentDir, filename))\n log(`cf.path`)\n contentFiles.append(cf)\n return contentFiles","def get_imlist(path):\n\treturn [os.path.join( path, f) for f in os.listdir(path) if f.endswith('.jpg')]","def get_filepaths(directory):\n file_paths = [] # List which will store all of the full filepaths.\n\n # Walk the tree.\n for root, directories, files in os.walk(directory):\n root = os.path.normpath(root)\n directories.sort()\n files.sort()\n for filename in files:\n # Join the two strings in order to form the full filepath.\n if not root.startswith('_') and not root.startswith('.') and filename.endswith(\".md\"):\n filepath = os.path.normpath(os.path.join(root, filename))\n file_paths.append(filepath) # Add it to the list.\n\n return file_paths # Self-explanatory.","def files(self):\n self._printer('\\tFiles Walk')\n for directory in self.directory:\n for path in os.listdir(directory):\n full_path = os.path.join(directory, path)\n if os.path.isfile(full_path):\n if not path.startswith('.'):\n self.filepaths.append(full_path)\n return self._get_filepaths()","def filepaths(self, langs) -> Generator[str, None, None]:\n for pv in self.projects(langs):\n yield from pv.filepaths()","def getVideosPath(self):\r\n videoTypes = [\r\n ('MP4 files', '*.mp4'),\r\n ('3GP files', '*.3gp'),\r\n ('WMV files', '*.wmv'),\r\n ('FLV files', '*.flv'),\r\n ('AVI files', '*.avi'),\r\n ]\r\n global filenames\r\n filenames = askopenfilenames(title=\"Select video files\", multiple=True, )","def extract_from_dir(self, data_dir):\n data_paths = []\n for(dirpath, dirnames, filenames) in os.walk(data_dir):\n for file in filenames:\n # Make sure that we don't get garbage files\n file_type = file.split('.')\n if len(file_type) == 1 or (file_type[1] not in ['wav', 'txt']):\n continue\n\n data_paths.append(os.path.join(dirpath, file))\n\n return data_paths","def volume_paths(path):\n files = (os.path.join(path, f) for f in sorted(os.listdir(path)))\n return [f for f in files if os.path.isdir(f) or f.endswith('.zip')]","def get_all_sources(remit):\n if remit == 'panzer' or remit == 'pandoc':\n os.chdir('source-'+remit)\n sourcelist = [name for name in os.listdir(\".\") if os.path.isdir(name)]\n os.chdir('..')\n else:\n # get the maximal list of sources for a diff\n pandoc_list = get_all_sources('pandoc')\n panzer_list = get_all_sources('panzer')\n sourcelist = list(set(pandoc_list+panzer_list))\n sourcelist.sort()\n return sourcelist","def list_files_in_directory(self):\n lesson_file_dict = dict()\n lesson_file_dict[\"files\"] = []\n\n directory_list = listdir(self.sub_dir)\n for directory in directory_list:\n if isfile(join(self.sub_dir, directory)):\n lesson_file_dict[\"files\"].append(directory)\n\n return lesson_file_dict","def files_to_upload(source_directory: str) -> list:\n upload_file_names = []\n\n print(source_directory)\n for dirName, subdirList, fileList in os.walk(source_directory):\n for filename in fileList:\n file_path = os.path.join(dirName, filename)\n s3key = os.path.join(os.path.basename(dirName) + '/' + filename)\n upload_file_names.append((file_path, s3key))\n return upload_file_names","def darkfiles(cam):\n return fullpathlist(darkpath(cam))","def _subdirectories(self):\n for o in os.listdir(self.directory):\n if os.path.isdir(os.path.join(self.directory, o)):\n yield os.path.join(self.directory, o)","def dirs(self, dirs=['.']):\n return [Path(d) for d in dirs]","def find_media_files(dirs, exclude_dirs=None):\n def condition(file_):\n return file_.isreg() and file_.check_regex(MEDIA_EXTENSIONS_REGEX)\n\n def precondition(file_):\n for dir_ in exclude_dirs:\n if dir_ in file_.path:\n return False\n return True\n\n if exclude_dirs is None:\n exclude_dirs = []\n result = []\n for dir_ in dirs:\n for file_ in pd.find.find(dir_, condition, precondition):\n m = re.match(TV_SHOW_REGEX, file_.path)\n if not m:\n print \"Skipped %s\" % file_.path\n continue\n tv_show, season, episode = m.groups()\n tv_show = tv_show.replace('.', ' ')\n result.append((tv_show, int(season), int(episode), file_.path))\n\n return result","def load_paths(dir):\n IMG_EXTENSIONS = ['.jpg', '.JPG', '.jpeg', '.JPEG',\n '.png', '.PNG', '.bmp', '.BMP']\n image_paths = []\n\n # traverse directory to obtain only paths to images\n for dir_name, _, paths in sorted(os.walk(os.path.expanduser(dir))):\n for path in paths:\n if any(path.endswith(extensions) for extensions in IMG_EXTENSIONS):\n image_paths.append(os.path.expanduser(dir_name + '/' + path))\n\n return image_paths"],"string":"[\n \"def list_of_files(sourcedir, recursive):\\n result = list()\\n if recursive is False:\\n listdir = sorted_listdir(os.listdir(sourcedir))\\n if '.nomedia' not in listdir:\\n for basename in listdir:\\n result.append(os.path.join(sourcedir, basename))\\n else:\\n for root, dirs, files in os.walk(sourcedir):\\n if '.nomedia' not in files:\\n for basename in sorted_listdir(files):\\n result.append(os.path.join(root, basename))\\n return result\",\n \"def __return_movie_file_list(self, movie_path):\\n movie_dir = movie_path.rsplit(\\\"/\\\",1)[0]\\n movie_file_list =[]\\n movie_extentionds = self.__movie_file_extensions(self.__file_extentions)\\n for x in os.listdir(movie_dir):\\n if x.rsplit(\\\".\\\",1)[-1]in movie_extentionds:\\n movie_file_list.append(movie_dir+\\\"/\\\"+x)\\t\\t\\n\\t#USUNAC URL Z NAPISY24\\n return movie_file_list\",\n \"def get_file_paths():\\n audio_folder = MY_DIR + '/assets'\\n\\n audio_addy_list = []\\n for file in os.scandir(audio_folder):\\n audio_addy_list.append(file.path)\\n\\n return audio_addy_list\",\n \"def getMediaFiles(path):\\n fileList = getMediaFileList(path)\\n # dirList = getDirectoryList(path)\\n\\n # results = map(getMediaFiles, dirList)\\n\\n # for result in results:\\n # fileList = fileList + result\\n\\n return fileList\",\n \"def get_subdirs(src_dir):\\n img_dirs = sorted(next(os.walk(src_dir))[1])\\n subdirs = [src_dir + img_dir for img_dir in img_dirs]\\n return subdirs\",\n \"def find_photos(source_path, common_extensions=('JPG', 'CR2', 'ORF', 'ARW', 'TIFF', 'DNG'), ignore=[]):\\n # combinedignored = re.compile('|'.join('(?:{0})'.format(x) for x in ignore))\\n # use endswith , ignore must be a tuple then\\n # if ignore and dirpath.endswith(ignore):\\n # for duplication, at the end cll the same funciton\\n\\n source_files = list()\\n\\n for (dirpath, dirnames, filenames) in os.walk(source_path):\\n for f in filenames:\\n if f.upper().endswith(common_extensions):\\n # source_files.append(os.path.join(dirpath, f))\\n parent = os.path.basename(os.path.normpath(dirpath))\\n source_files.append({'dir':dirpath,\\n 'filename':f,\\n 'parent_folder':parent})\\n\\n return source_files\",\n \"def get_movies(path):\\n movies_list = []\\n \\n \\n for f in os.listdir(path):\\n \\n full_file_path = join(path,f)\\n if isdir(full_file_path):\\n \\n movies_list.extend( get_movies(full_file_path) )\\n \\n elif isfile(full_file_path) and full_file_path[-3:] in util.extension:\\n m = Movie(f, full_file_path)\\n movies_list.append(m)\\n \\n return movies_list\",\n \"def get_all_paths(why = 'train'):\\r\\n if why == 'train':\\r\\n parent_folder = train_parent_folder\\r\\n if why == 'test':\\r\\n parent_folder = test_test_folder\\r\\n sub_folders = glob.glob(parent_folder) # Directories of all languages\\r\\n image_paths = [glob.glob(sub_folder + '\\\\*') for sub_folder in sub_folders] # Directories of all characters\\r\\n image_paths = sum(image_paths, []) # Flatten out the 2D list to a 1D list \\r\\n return image_paths\",\n \"def get_replay_source_helper_paths(self):\\n\\n if self.replay_source is None:\\n return None\\n\\n paths = []\\n classes = self.get_helpers_classes()\\n\\n base_path = self.base_folder_path + \\\"/data/replay_images/\\\" + self.replay_source + \\\"/\\\"\\n for hc in classes:\\n current_paths = []\\n for c in hc:\\n path = base_path + str(c).zfill(2) + \\\".tfrecord\\\"\\n current_paths.append(path)\\n paths.append(current_paths)\\n return paths\",\n \"def get_image_path(raw_input_dir: str) -> list:\\n result = []\\n for root, dirs, files in os.walk(raw_input_dir):\\n for file in files:\\n result.append(os.path.join(root, file))\\n return result\",\n \"def voicesPathsCollector(source_dir, gender_ids):\\r\\n # The list containing the IDs of the speakers which are the folder names\\r\\n person_ids_list = gender_ids\\r\\n\\r\\n # An empty list which it will contains voices paths which are in the section folders\\r\\n voices_paths_list = []\\r\\n\\r\\n # Iterating over a person speaker ids\\r\\n for person_id_idx in range(len(person_ids_list)):\\r\\n # Speaker path containing the chapter's directories\\r\\n speaker_path = Path.cwd().joinpath(source_dir, person_ids_list[person_id_idx])\\r\\n # The list containing the IDs of the sections by the current speaker which are the folder names\\r\\n sections_ids_list = os.listdir(speaker_path)\\r\\n\\r\\n # Iterating over a sections ids by the current speaker\\r\\n for sec_id_idx in range(len(sections_ids_list)):\\r\\n # Section path containing files\\r\\n section_path = Path.cwd().joinpath(speaker_path,sections_ids_list[sec_id_idx])\\r\\n # Iterating over files which are existing in section's folders\\r\\n for file in os.listdir(section_path):\\r\\n # Choose files with .flac extension\\r\\n if file.endswith(\\\".flac\\\"):\\r\\n\\r\\n voice_path = Path.cwd().joinpath(section_path, file)\\r\\n voices_paths_list.append(voice_path)\\r\\n\\r\\n return voices_paths_list\",\n \"def get_replay_source_no_helper_paths(self):\\n paths = []\\n classes = self.get_replay_classes_no_helper()\\n base_path = self.base_folder_path + \\\"/data/replay_images/\\\" + self.replay_source + \\\"/\\\"\\n\\n \\n for c in classes:\\n full_path = base_path + str(c).zfill(2) + \\\".tfrecord\\\"\\n paths.append(full_path)\\n \\n return paths\",\n \"def readPlayerImageFiles(self):\\n currentPath = os.path.dirname(os.path.abspath(__file__))\\n listOfFileNames=[]\\n for i in os.listdir(currentPath):\\n if re.match(\\\"player\\\\_\\\\d+\\\",i): #i.endswith(\\\".gif\\\")\\n listOfFileNames.append(currentPath+'/'+i)\\n return listOfFileNames\",\n \"def get_library_content(self):\\n from glob import glob\\n try:\\n os.path.isdir(self.source)\\n lst = glob(self.source + '/*')\\n except TypeError:\\n lst = self.source\\n dircheck = True\\n while dircheck is True:\\n dircheck = False\\n newlst = []\\n for entry in lst:\\n if os.path.isdir(entry):\\n newlst.extend(glob(entry + '/*'))\\n dircheck = True\\n else:\\n newlst.append(entry)\\n lst = newlst\\n return lst\",\n \"def get_all_image_paths(self):\\n image_paths, image_labels = [], []\\n for directory_name, subdirectory_list, file_list in os.walk(self.root_directory):\\n for file_name in file_list:\\n if file_name.endswith(('.jpg',)):\\n image_paths.append(os.path.join(directory_name, file_name))\\n # Translates labels to 0-26 as recommended in the exercise description\\n image_labels.append(ord(directory_name[-1]) - 97)\\n return image_paths, image_labels\",\n \"def source_paths(self):\\n paths = self.config.get('static_dirs')\\n if paths:\\n return paths\\n return [self.config.get('static_dir')]\",\n \"def get_paths_list_from_folder(folder):\\n names = os.listdir(folder)\\n relative_paths = [os.path.join(folder, image_name) for image_name in names]\\n return relative_paths\",\n \"def create_directory_list(root_dir: str):\\n if not os.path.exists(root_dir):\\n raise FileNotFoundError(\\\"Directory {} does not exist\\\".format(root_dir))\\n\\n # List all directories associated to different videos.\\n recording_path_list = [os.path.join(root_dir, f) for f in os.listdir(root_dir)]\\n\\n input_data_path = []\\n for g in recording_path_list:\\n # Append the different directories associated to different video frame intervals.\\n input_data_path.extend([os.path.join(g, f) for f in os.listdir(g)])\\n\\n return input_data_path\",\n \"def get_dir_files(self, recursive=False):\\n logging.info('Enumerating files under the source path (recursive=%s) ...', recursive)\\n files = {}\\n if not recursive:\\n files[self.path_source] = [\\n f for f in os.listdir(self.path_source) if os.path.isfile(os.path.join(self.path_source, f))\\n ]\\n else:\\n for current_dir, sub_dirs, dir_files in os.walk(self.path_source):\\n files[os.path.join(self.path_source, current_dir)] = [f for f in dir_files]\\n\\n return files\",\n \"def GetSongFilenames():\\n\\n\\t## Loop through each directory\\n\\tsong_files = []\\n\\tfor root, dirs, fnames in os.walk(\\\"_data\\\\\\\\fma_small\\\\\\\\\\\"):\\n\\t\\t\\n\\t\\t## Skip the first level\\n\\t\\tif root == \\\"_data\\\\\\\\fma_small\\\\\\\\\\\":\\n\\t\\t\\tcontinue\\n\\n\\t\\t## Otherwise collect the files, appending\\n\\t\\t## the root path.\\n\\t\\tsong_files += [root+\\\"\\\\\\\\\\\"+f for f in fnames]\\n\\n\\treturn song_files\",\n \"def get_images_paths(path: str) -> List[str]:\\n\\n image_paths = []\\n\\n for folder in os.listdir(path):\\n for file in os.listdir(os.path.join(f\\\"{path}/{folder}\\\", \\\"images\\\")):\\n image_paths.append(f\\\"{path}/{folder}/images/{file}\\\")\\n\\n return image_paths\",\n \"def get_dir_and_file_list(path):\\r\\n dList = os.listdir(path)\\r\\n dirList = []\\r\\n fileList = []\\r\\n\\r\\n for item in dList:\\r\\n \\r\\n if os.path.isdir(os.path.join(path, item)):\\r\\n dirList.append(item)\\r\\n elif os.path.isfile(os.path.join(path, item)):\\r\\n if any(image_type in item.lower() for image_type in image_types):\\r\\n preview = image_preview(os.path.join(path, item))\\r\\n fileList.append((item, preview))\\r\\n else:\\r\\n fileList.append((item, None))\\r\\n\\r\\n return dirList, fileList\",\n \"def load_video_paths(dir):\\n VIDEO_EXTENSIONS = ['.mov', '.MOV', '.mp4']\\n video_paths = []\\n\\n # traverse directory to obtain only paths to videos\\n for dir_name, _, paths in sorted(os.walk(os.path.expanduser(dir))):\\n for path in paths:\\n if any(path.endswith(extensions) for extensions in VIDEO_EXTENSIONS):\\n video_paths.append(os.path.expanduser(dir_name + '/' + path))\\n\\n return video_paths\",\n \"def get_datapaths(input_dir):\\n image_paths = []\\n assert os.path.isdir(input_dir), f\\\"{input_dir} is not existed\\\"\\n\\n for root, _, names in os.walk(input_dir):\\n for name in names:\\n path = os.path.join(root, name)\\n image_paths.append(path)\\n return image_paths\",\n \"def get_source_files(self):\\n return [\\n path.as_posix()\\n for path in _Path(self.src_dir).rglob(\\\"*\\\")\\n if not path.is_dir()\\n ] + [\\n (path / \\\"CMakeLists.txt\\\").as_posix()\\n for path in _PurePath(self.src_dir).parents\\n ]\",\n \"def listdir(self, name, source, test_data=()):\\n assert isinstance(source, config_types.Path)\\n self.m.path.assert_absolute(source)\\n result = self._run(\\n name, ['listdir', source],\\n lambda: self.test_api.listdir(test_data),\\n self.m.raw_io.output_text())\\n ret = [source.join(x) for x in result.stdout.splitlines()]\\n result.presentation.logs['listdir'] = map(str, ret)\\n return ret\",\n \"def get_skins_and_extensions(base_dir):\\n ext_paths = []\\n for subdir in ['extensions', 'skins']:\\n for name in os.listdir(os.path.join(base_dir, subdir)):\\n if os.path.isdir(os.path.join(base_dir, subdir, name)):\\n ext_paths.append(os.path.join(subdir, name))\\n return ext_paths\",\n \"def files_in( d ):\\n return [ join(d,f) for f in os.listdir(d) if isfile(join(d,f)) ]\",\n \"def get_content_directories() -> List[str]:\\n result:list[str] = []\\n for current_path in os.listdir(\\\"content\\\"):\\n if os.path.isdir(os.path.join(\\\"content\\\", current_path)):\\n result.append(os.path.join(\\\"content\\\", current_path))\\n return result\",\n \"def get_filepaths(extract_dir):\\n\\n index = []\\n labels = []\\n _extract_dir = os.path.join(extract_dir, 'UCF-101')\\n for folder in os.listdir(_extract_dir):\\n labels.append(folder)\\n folderpath = os.path.join(_extract_dir, folder)\\n\\n if not os.path.isdir(folderpath):\\n continue\\n\\n for filename in os.listdir(folderpath):\\n if 'avi' not in filename:\\n continue\\n\\n if filename[0] == '.':\\n continue\\n\\n filepath = os.path.join(folderpath, filename)\\n\\n if os.path.exists(filepath):\\n index.append(filepath)\\n else:\\n print(filepath)\\n return index, labels\",\n \"def fetch_path_from_dirs(list_of_search_dirs, key):\\n outputs = []\\n for d in list_of_search_dirs:\\n this_search_path = os.path.join(d, \\\"*\\\" + key + \\\"*\\\")\\n outputs.extend(glob.glob(this_search_path))\\n return outputs\",\n \"def udimPaths(self):\\n\\t\\ttry:\\n\\t\\t\\treturn [ textureFile( self.dirPath + a ) for a in os.listdir( self.dirPath ) if self.name + '.' in a ]\\n\\t\\texcept:\\n\\t\\t\\treturn []\",\n \"def getImages(path):\\n files = list()\\n\\n for f in listdir(path):\\n file = join(path, f)\\n if isfile(file):\\n files.append(getImage(file))\\n\\n return files\",\n \"def get_directories():\\n # get current working dir\\n directory = os.getcwd()\\n # list of dir to look in repo for files\\n directories = [\\n directory,\\n os.path.expanduser(os.path.join(directory, 'src')),\\n os.path.expanduser(os.path.join(directory, 'tests'))\\n ]\\n return directories\",\n \"def findFiles(target, path):\\r\\n\\tfiles = []\\r\\n\\tlyst = os.listdir(path)\\r\\n\\tfor element in lyst:\\r\\n\\t\\tif os.path.isfile(element):\\r\\n\\t\\t\\tif target in element:\\r\\n\\t\\t\\t\\tfiles.append(path + os.sep + element)\\r\\n\\t\\telse:\\r\\n\\t\\t\\tos.chdir(element)\\r\\n\\t\\t\\tfiles.extend(findFiles(target, os.getcwd()))\\r\\n\\t\\t\\tos.chdir(\\\"..\\\")\\r\\n\\treturn files\",\n \"def walk_dir(path):\\r\\n\\tassets = []\\r\\n\\r\\n\\tfor file in os.listdir(path):\\r\\n\\t\\tif os.path.isdir(path + \\\"/\\\" + file):\\r\\n\\t\\t\\tif not file.startswith(\\\".\\\"):\\r\\n\\t\\t\\t\\t# Ignore . dirs (e.g .svn)\\r\\n\\t\\t\\t\\tassets.extend(walk_dir(path + \\\"/\\\" + file))\\r\\n\\t\\telif file.endswith('.blend'):\\r\\n\\t\\t\\tassets.append(path + \\\"/\\\" + file)\\r\\n\\r\\n\\treturn assets\",\n \"def all_image_paths(self):\\n self.labels = [i for i in (self.get_immediate_subdirectories(self.root_dir))\\n if not i.startswith('.')]\\n\\n for root, subFolders, files in os.walk(self.root_dir):\\n files = [i for i in files if not i.startswith('.')]\\n files = files[:self.img_num] # hard coded - will not read in\\n for i in files:\\n self.all_files.append(os.path.abspath(root) + '/'.join(subFolders) + '/' + i)\",\n \"def list_selfplay_dirs(base_dir):\\n\\n model_dirs = [os.path.join(base_dir, x)\\n for x in tf.io.gfile.listdir(base_dir)]\\n return sorted(model_dirs, reverse=True)\",\n \"def get_all_videos_in_directory(directory: str):\\n\\n all_files_and_folders = os.listdir(directory)\\n\\n only_videos = []\\n for file in all_files_and_folders:\\n if is_video(file):\\n only_videos.append(file)\\n ...\\n\\n return only_videos\",\n \"def collect_project_source_files():\\n source_files = glob.glob(PROJECT_SOURCE_FILES_FOLDER + '/**/*.py', recursive=True)\\n # Insert root main.py at the beginning.\\n source_files.insert(0, os.path.join(PROJECT_ROOT_FOLDER, 'main.py'))\\n return list(map(lambda path: posixpath.join(*path.split('\\\\\\\\')), source_files))\",\n \"def getFiles(searchDir = './', extension = 'source'):\\n from glob import glob \\n\\n return glob(searchDir+'/*.'+extension)\",\n \"def _get_files(self, path):\\n result = []\\n for f in os.listdir(path):\\n if os.path.isdir(os.path.join(path, f)):\\n result += self._get_files(os.path.join(path, f))\\n else:\\n result.append(os.path.join(path, f))\\n return result\",\n \"def _path_files(self):\\n\\n if not os.path.exists(self.path):\\n return None\\n\\n directory_content = os.listdir(self.path)\\n files = []\\n\\n while len(directory_content) != 0:\\n\\n if not directory_content[0].startswith(self.path):\\n directory_obj = os.path.join(self.path, directory_content[0])\\n else:\\n directory_obj = directory_content[0]\\n\\n if os.path.isfile(directory_obj):\\n files.append(directory_obj)\\n elif os.path.exists(directory_obj):\\n temp_directory_content = os.listdir(directory_obj)\\n for obj in temp_directory_content:\\n directory_content.append(os.path.join(directory_obj, obj))\\n directory_content.pop(0)\\n\\n return files\",\n \"def getfiles(path): \\n global picture_list\\n try:\\n # dir_list has all files and directories in path\\n # any directory is WITHOUT ending '/'\\n dir_list = os.listdir(path)\\n except:\\n # path may not be a directory or permission error\\n print \\\"ERROR: in getfiles, picture_list:\\\", picture_list\\n picture_list = None\\n return\\n \\n for line in dir_list:\\n file = path + \\\"/\\\" + line\\n if os.path.isdir(file):\\n getfiles( file) # dig into subdirectory\\n elif isPicture(file):\\n picture_list.append(file)\\n else: \\n # neither picture file nor directory; ignore \\n pass\\n return\",\n \"def relative_to_buildroot(self):\\n return [os.path.join(self.rel_path, source) for source in self.source_paths]\",\n \"def get_filepaths(self):\\n image_filepaths = set()\\n for one_dir in self.dirs:\\n for root, dirnames, filenames in os.walk(one_dir):\\n for filename in filenames:\\n if re.search(r\\\"\\\\.(jpg|jpeg|png|bmp|tiff)$\\\", filename):\\n image_filepaths.add(os.path.join(root, filename))\\n image_filepaths = sorted(list(image_filepaths))\\n return image_filepaths\",\n \"def getImmediateSubdirectories(dir):\",\n \"def list_files_and_dirs(self, path=\\\"/\\\"):\\n dirs = self.list_dirs(path)\\n files = self.list_files(path)\\n return dirs + files\",\n \"def generate_paths(dirname, recursive=False):\\n if recursive:\\n gen = itertools.chain.from_iterable(\\n map(lambda x: map(partial(os.path.join, x[0]), x[2]),\\n os.walk(dirname)))\\n else:\\n gen = filter(os.path.isfile,\\n map(partial(os.path.join, dirname), os.listdir(dirname)))\\n return filter(lambda s: re.match('.+\\\\.midi?$', s, re.I), gen)\",\n \"def return_images(directory):\\r\\n allfiles = os.listdir(directory)\\r\\n image_list = [im for im in allfiles if '.jpg' in str(im)]\\r\\n image_list = [directory + im for im in image_list]\\r\\n return image_list\",\n \"def list_of_medias(args, sourcedir, recursive):\\n files = list_of_files(sourcedir, recursive)\\n return [_ for _ in files if is_media_within_dates(_, args.dates)]\",\n \"def list_directory(path):\\n files = []\\n for f in listdir(path):\\n if isfile(join(path, f)) and f.endswith('.mp3'):\\n files.append(f)\\n return files\",\n \"def get_subdirectories(self, physical_path):\\n result = []\\n for p in os.listdir(physical_path):\\n if not os.path.isdir(os.path.join(physical_path, p)):\\n continue\\n result.append(os.path.join(physical_path, p))\\n\\n return result\",\n \"def list_dir(self, path):\",\n \"def flatfiles(cam):\\n return fullpathlist(flatpath(cam))\",\n \"def get_media_directory():\\n\\treturn _paths[_MEDIA_DIRECTORY_KEY]\",\n \"def getAllDirs(self):\\n\\n dirs = [ self ]\\n for d in self._subdirs:\\n if d.hasImages():\\n dirs += d.getAllDirs()\\n return dirs\",\n \"def get_image_list(path: str) -> list:\\n\\n return list(os.path.join(path, f)\\n for f in os.listdir(path)\\n if f.endswith('.jpg'))\",\n \"def getMediaFileList(path):\\n\\n fileTypes = (\\\"jpg\\\", \\\"mov\\\", \\\"mp4\\\")\\n fileList = []\\n for base_dir, dirs, files in os.walk(path):\\n fileList.extend([os.path.join(base_dir, f) for f in files if f.split(\\\".\\\")[1].lower() in fileTypes])\\n\\n # for the new canon camera, ther are some .Trash and trashinfo files, want to ignore them\\n fileList = [file for file in fileList if \\\"trash\\\" not in file and \\\"Trash\\\" not in file]\\n return fileList\",\n \"def get_filepaths(directory):\\n file_paths = [] # List which will store all of the full filepaths.\\n\\n # Walk the tree.\\n\\n for root, directories, files in os.walk(directory):\\n\\n for filename in files:\\n if filename.endswith('.wav'):\\n # Join the two strings in order to form the full filepath.\\n filepath = os.path.join(root, filename)\\n file_paths.append(filepath) # Add it to the list.\\n # pdb.set_trace()\\n file_paths.sort()\\n return file_paths\",\n \"def _get_file_paths(self):\\n return [os.path.join(self.path, self.mode, 'waveforms', file_name + '.npy') for file_name in self.file_names]\",\n \"def source_dirs_files(fspath, fil=None):\\r\\n dirs = []\\r\\n files = []\\r\\n for child in fspath.listdir(fil=fil):\\r\\n if child.basename.startswith('.'):\\r\\n continue\\r\\n if child.check(dir=True):\\r\\n dirs.append(child)\\r\\n elif child.check(file=True):\\r\\n if child.ext in ['.pyc', '.pyo']:\\r\\n continue\\r\\n files.append(child)\\r\\n return sorted(dirs), sorted(files)\",\n \"def get_paths(input_folder):\\n list_files = []\\n conll_folder = glob.glob(input_folder + '/*.json')\\n \\n for filename in conll_folder:\\n list_files.append(filename)\\n\\n return list_files\",\n \"def get_lists_in_dir(dir_path):\\n image_list = []\\n\\n for filename in glob.glob(dir_path + '/*.jpg'):\\n image_list.append(filename)\\n return image_list\",\n \"def get_file_list(input_dir):\\n\\tfile_paths = [input_dir +'/' + f for f in listdir(input_dir) if isfile(join(input_dir, f)) ]\\n\\treturn file_paths\",\n \"def search_images(\\n current_dir: str,\\n exts={\\\"jpg\\\", \\\"png\\\", \\\"jpeg\\\", \\\"gif\\\"}\\n) -> typing.Iterable[typing.Tuple[str, str]]:\\n for root, _, files in os.walk(current_dir):\\n for file_name in files:\\n ext = file_name.rsplit('.', 1)[-1].lower()\\n if ext in exts:\\n yield os.path.join(root, file_name), file_name\",\n \"def get_dirs(source_dir):\\n all_dirs = set()\\n it = os.walk(source_dir)\\n it.next()\\n dirs = list(it)\\n for d in dirs:\\n if len(d[1])==0:\\n all_dirs.add(d[0])\\n return all_dirs\",\n \"def sources_absolute_paths(self):\\r\\n abs_target_base = os.path.join(get_buildroot(), self.target_base)\\r\\n for src in self.sources:\\r\\n yield os.path.join(abs_target_base, src)\",\n \"def getFilePaths():\\n \\n image_dir = r'/hpc/wfok007/mpi_heart/Training Set'\\n mask_paths = []\\n image_paths = []\\n for root, dirs, files in os.walk(image_dir, topdown=False):\\n for name in files:\\n if name == 'laendo.nrrd':\\n mask_paths.append(os.path.join(root, name))\\n elif name == 'lgemri.nrrd':\\n image_paths.append(os.path.join(root, name))\\n else:\\n print ('%s is unknown' %name)\\n return mask_paths, image_paths\",\n \"def segment_paths(root):\\n directories = []\\n history = history_path(root)\\n for d in os.listdir(history):\\n path = os.path.join(history, d)\\n if os.path.isdir(path):\\n directories.append(path)\\n return sorted(directories)\",\n \"def get_path_names(directory):\\n paths_without_source = set()\\n paths = glob.glob(source + \\\"**/*.*\\\", recursive=True)\\n for p in paths:\\n paths_without_source.add(p.replace(directory, \\\"\\\", 1))\\n\\n return paths_without_source\",\n \"def list_sources(config, base_dir, verbose=False):\\n for source in config.sources_under(abspath(base_dir)):\\n if verbose:\\n print(\\\"# %s (%s)\\\" % (source.nicedir, ' '.join(source.info)))\\n else:\\n print(source.nicedir)\",\n \"def demo_paths(self):\\n base_path = os.path.join(self.module.__path__[0], 'demo')\\n paths = []\\n if os.path.isdir(base_path):\\n for item in os.listdir(base_path):\\n # TODO: support examples which is not auto-loaded\\n if not os.path.isdir(os.path.join(base_path, 'examples')):\\n paths.append(os.path.join(base_path, item))\\n return paths\",\n \"def parse_dir_imgs(root_pth):\\n def visit(imgpths, pth, names):\\n # Appends detected image filenames to a list.\\n imgpths.extend([os.path.join(pth, name) for name in names\\n if os.path.splitext(name)[1].lower() in img_exts])\\n # Walk down directory tree and get the image file paths\\n imgpaths = []\\n for dp, foo, names in os.walk(root_pth):\\n visit(imgpaths, dp, names)\\n # Make lowercased list of imagefilenames\\n imgnames = [os.path.split(pth)[1].lower() for pth in imgpaths]\\n return imgnames, imgpaths\",\n \"def recursive_glob(rootdir=\\\".\\\", suffix=\\\"\\\"):\\n image_paths = []\\n for looproot, _, filenames in os.walk(rootdir):\\n for filename in filenames:\\n if filename.endswith(suffix):\\n image_paths.append(os.path.join(looproot, filename))\\n return image_paths\",\n \"def recursive_glob(rootdir=\\\".\\\", suffix=\\\"\\\"):\\n image_paths = []\\n for looproot, _, filenames in os.walk(rootdir):\\n for filename in filenames:\\n if filename.endswith(suffix):\\n image_paths.append(os.path.join(looproot, filename))\\n return image_paths\",\n \"def get_feature_paths(start_dir, extensions = ['dcm']):\\n if start_dir is None:\\n start_dir = os.getcwd()\\n img_paths = []\\n for roots,dirs,files in os.walk(start_dir):\\n for name in files:\\n for e in extensions:\\n if name.endswith('.' + e):\\n img_paths.append(roots + '/' + name)\\n img_paths.sort()\\n return img_paths\",\n \"def scandir(path_):\\n return os.listdir\",\n \"def extract_embeddings_recursive_from_dir(self, dir_from: PathLike, dir_to: PathLike) -> PathLike:\\n pass\",\n \"def get_img_files(images, db):\\n img_dir = db.source\\n if img_dir == None:\\n raise ValueError('Cannot locate file without a base path. This method looks for it at \\\\\\n db.source, which is not set. This should be set by the loader during DB construction!')\\n img_dir = path.join(img_dir, 'img') \\n locs = db.get_img_locs(images)\\n titles = db.get_location_titles()\\n returnval = []\\n for image in images:\\n loc = locs[image]\\n if loc is None:\\n raise ValueError('The image %s could not be found' % image)\\n returnval.append(path.join(img_dir, titles[loc], str(image) + '.jpg'))\\n return returnval\",\n \"def collect_files(path, audio_files):\\n\\n for entry in os.scandir(path):\\n if entry.is_dir():\\n collect_files(entry.path, audio_files)\\n if entry.is_file() and (entry.path.endswith(\\\".flac\\\") or entry.path.endswith(\\\".wav\\\")):\\n audio_files.append(entry.path)\",\n \"def get_imlist(path):\\n return [os.path.join(path, f) for f in os.listdir(path) if f.endswith('.jpg')]\",\n \"def getSourcePaths(self, makeGlyphs=True, makeKerning=True, makeInfo=True):\\n paths = []\\n for name in self.sources.keys():\\n paths.append(self.sources[name][0].path)\\n return paths\",\n \"def filePaths(directory_with_files):\\n\\n # get a list of file names in directory\\n list_of_files = os.listdir(directory_with_files) \\n\\n # join directory path and file name to get full paths to files\\n filepaths = [os.path.join(directory_with_files, filename) for filename in list_of_files]\\n\\n return filepaths\",\n \"def getContentFiles():\\n contentFiles = []\\n for contentDir, subDirs, filenames in os.walk(sourceDir, followlinks=True):\\n if shouldIgnore(contentDir):\\n subDirs[:] = []\\n continue\\n for filename in filenames:\\n if not shouldIgnore(filename):\\n cf = ContentFile(os.path.join(contentDir, filename))\\n log(`cf.path`)\\n contentFiles.append(cf)\\n return contentFiles\",\n \"def get_imlist(path):\\n\\treturn [os.path.join( path, f) for f in os.listdir(path) if f.endswith('.jpg')]\",\n \"def get_filepaths(directory):\\n file_paths = [] # List which will store all of the full filepaths.\\n\\n # Walk the tree.\\n for root, directories, files in os.walk(directory):\\n root = os.path.normpath(root)\\n directories.sort()\\n files.sort()\\n for filename in files:\\n # Join the two strings in order to form the full filepath.\\n if not root.startswith('_') and not root.startswith('.') and filename.endswith(\\\".md\\\"):\\n filepath = os.path.normpath(os.path.join(root, filename))\\n file_paths.append(filepath) # Add it to the list.\\n\\n return file_paths # Self-explanatory.\",\n \"def files(self):\\n self._printer('\\\\tFiles Walk')\\n for directory in self.directory:\\n for path in os.listdir(directory):\\n full_path = os.path.join(directory, path)\\n if os.path.isfile(full_path):\\n if not path.startswith('.'):\\n self.filepaths.append(full_path)\\n return self._get_filepaths()\",\n \"def filepaths(self, langs) -> Generator[str, None, None]:\\n for pv in self.projects(langs):\\n yield from pv.filepaths()\",\n \"def getVideosPath(self):\\r\\n videoTypes = [\\r\\n ('MP4 files', '*.mp4'),\\r\\n ('3GP files', '*.3gp'),\\r\\n ('WMV files', '*.wmv'),\\r\\n ('FLV files', '*.flv'),\\r\\n ('AVI files', '*.avi'),\\r\\n ]\\r\\n global filenames\\r\\n filenames = askopenfilenames(title=\\\"Select video files\\\", multiple=True, )\",\n \"def extract_from_dir(self, data_dir):\\n data_paths = []\\n for(dirpath, dirnames, filenames) in os.walk(data_dir):\\n for file in filenames:\\n # Make sure that we don't get garbage files\\n file_type = file.split('.')\\n if len(file_type) == 1 or (file_type[1] not in ['wav', 'txt']):\\n continue\\n\\n data_paths.append(os.path.join(dirpath, file))\\n\\n return data_paths\",\n \"def volume_paths(path):\\n files = (os.path.join(path, f) for f in sorted(os.listdir(path)))\\n return [f for f in files if os.path.isdir(f) or f.endswith('.zip')]\",\n \"def get_all_sources(remit):\\n if remit == 'panzer' or remit == 'pandoc':\\n os.chdir('source-'+remit)\\n sourcelist = [name for name in os.listdir(\\\".\\\") if os.path.isdir(name)]\\n os.chdir('..')\\n else:\\n # get the maximal list of sources for a diff\\n pandoc_list = get_all_sources('pandoc')\\n panzer_list = get_all_sources('panzer')\\n sourcelist = list(set(pandoc_list+panzer_list))\\n sourcelist.sort()\\n return sourcelist\",\n \"def list_files_in_directory(self):\\n lesson_file_dict = dict()\\n lesson_file_dict[\\\"files\\\"] = []\\n\\n directory_list = listdir(self.sub_dir)\\n for directory in directory_list:\\n if isfile(join(self.sub_dir, directory)):\\n lesson_file_dict[\\\"files\\\"].append(directory)\\n\\n return lesson_file_dict\",\n \"def files_to_upload(source_directory: str) -> list:\\n upload_file_names = []\\n\\n print(source_directory)\\n for dirName, subdirList, fileList in os.walk(source_directory):\\n for filename in fileList:\\n file_path = os.path.join(dirName, filename)\\n s3key = os.path.join(os.path.basename(dirName) + '/' + filename)\\n upload_file_names.append((file_path, s3key))\\n return upload_file_names\",\n \"def darkfiles(cam):\\n return fullpathlist(darkpath(cam))\",\n \"def _subdirectories(self):\\n for o in os.listdir(self.directory):\\n if os.path.isdir(os.path.join(self.directory, o)):\\n yield os.path.join(self.directory, o)\",\n \"def dirs(self, dirs=['.']):\\n return [Path(d) for d in dirs]\",\n \"def find_media_files(dirs, exclude_dirs=None):\\n def condition(file_):\\n return file_.isreg() and file_.check_regex(MEDIA_EXTENSIONS_REGEX)\\n\\n def precondition(file_):\\n for dir_ in exclude_dirs:\\n if dir_ in file_.path:\\n return False\\n return True\\n\\n if exclude_dirs is None:\\n exclude_dirs = []\\n result = []\\n for dir_ in dirs:\\n for file_ in pd.find.find(dir_, condition, precondition):\\n m = re.match(TV_SHOW_REGEX, file_.path)\\n if not m:\\n print \\\"Skipped %s\\\" % file_.path\\n continue\\n tv_show, season, episode = m.groups()\\n tv_show = tv_show.replace('.', ' ')\\n result.append((tv_show, int(season), int(episode), file_.path))\\n\\n return result\",\n \"def load_paths(dir):\\n IMG_EXTENSIONS = ['.jpg', '.JPG', '.jpeg', '.JPEG',\\n '.png', '.PNG', '.bmp', '.BMP']\\n image_paths = []\\n\\n # traverse directory to obtain only paths to images\\n for dir_name, _, paths in sorted(os.walk(os.path.expanduser(dir))):\\n for path in paths:\\n if any(path.endswith(extensions) for extensions in IMG_EXTENSIONS):\\n image_paths.append(os.path.expanduser(dir_name + '/' + path))\\n\\n return image_paths\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.6816371","0.6584394","0.65694135","0.6454687","0.64294946","0.63914907","0.63858587","0.6369066","0.6280144","0.62456554","0.6161519","0.6160253","0.61361057","0.61112374","0.60726917","0.60657465","0.6015738","0.60046023","0.59833866","0.5970308","0.5962931","0.5946842","0.5943449","0.5941118","0.59369385","0.5896389","0.58943665","0.58893466","0.5880047","0.5864546","0.58619297","0.5841441","0.58404475","0.5835982","0.582826","0.5820611","0.58126026","0.5809517","0.5809223","0.5802272","0.5800264","0.5798355","0.5785188","0.5779069","0.577144","0.5770997","0.5766476","0.5761326","0.57604194","0.575914","0.5757382","0.57541484","0.5743288","0.5736625","0.5735156","0.5727884","0.57136625","0.57130337","0.5698063","0.56936485","0.5692937","0.56926304","0.56895196","0.5687305","0.5680656","0.5674805","0.56727535","0.5670253","0.5670004","0.5668927","0.5668828","0.5668534","0.5667364","0.5663523","0.5655338","0.5655338","0.5654776","0.5650429","0.5641517","0.56352395","0.56346416","0.56321883","0.562954","0.56246877","0.56141394","0.56131536","0.56053716","0.5602999","0.5601989","0.55894595","0.55880797","0.558112","0.55761385","0.55746007","0.55714226","0.5562068","0.55565566","0.55519444","0.5551157","0.55498815"],"string":"[\n \"0.6816371\",\n \"0.6584394\",\n \"0.65694135\",\n \"0.6454687\",\n \"0.64294946\",\n \"0.63914907\",\n \"0.63858587\",\n \"0.6369066\",\n \"0.6280144\",\n \"0.62456554\",\n \"0.6161519\",\n \"0.6160253\",\n \"0.61361057\",\n \"0.61112374\",\n \"0.60726917\",\n \"0.60657465\",\n \"0.6015738\",\n \"0.60046023\",\n \"0.59833866\",\n \"0.5970308\",\n \"0.5962931\",\n \"0.5946842\",\n \"0.5943449\",\n \"0.5941118\",\n \"0.59369385\",\n \"0.5896389\",\n \"0.58943665\",\n \"0.58893466\",\n \"0.5880047\",\n \"0.5864546\",\n \"0.58619297\",\n \"0.5841441\",\n \"0.58404475\",\n \"0.5835982\",\n \"0.582826\",\n \"0.5820611\",\n \"0.58126026\",\n \"0.5809517\",\n \"0.5809223\",\n \"0.5802272\",\n \"0.5800264\",\n \"0.5798355\",\n \"0.5785188\",\n \"0.5779069\",\n \"0.577144\",\n \"0.5770997\",\n \"0.5766476\",\n \"0.5761326\",\n \"0.57604194\",\n \"0.575914\",\n \"0.5757382\",\n \"0.57541484\",\n \"0.5743288\",\n \"0.5736625\",\n \"0.5735156\",\n \"0.5727884\",\n \"0.57136625\",\n \"0.57130337\",\n \"0.5698063\",\n \"0.56936485\",\n \"0.5692937\",\n \"0.56926304\",\n \"0.56895196\",\n \"0.5687305\",\n \"0.5680656\",\n \"0.5674805\",\n \"0.56727535\",\n \"0.5670253\",\n \"0.5670004\",\n \"0.5668927\",\n \"0.5668828\",\n \"0.5668534\",\n \"0.5667364\",\n \"0.5663523\",\n \"0.5655338\",\n \"0.5655338\",\n \"0.5654776\",\n \"0.5650429\",\n \"0.5641517\",\n \"0.56352395\",\n \"0.56346416\",\n \"0.56321883\",\n \"0.562954\",\n \"0.56246877\",\n \"0.56141394\",\n \"0.56131536\",\n \"0.56053716\",\n \"0.5602999\",\n \"0.5601989\",\n \"0.55894595\",\n \"0.55880797\",\n \"0.558112\",\n \"0.55761385\",\n \"0.55746007\",\n \"0.55714226\",\n \"0.5562068\",\n \"0.55565566\",\n \"0.55519444\",\n \"0.5551157\",\n \"0.55498815\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.6835324"},"document_rank":{"kind":"string","value":"0"}}},{"rowIdx":6085,"cells":{"query":{"kind":"string","value":"/Gilles/Dev/journal/tests/subdir/deeper2/deepest/OCT_20000112_000004.jpg > deeper2_deepest_OCT_20000112_000004.jpg /Gilles/Dev/journal/tests/subdir/deeper2/deepest > deeper2_deepest"},"document":{"kind":"string","value":"def relative_name(media_fullname, sourcedir):\n x = os.path.relpath(media_fullname, sourcedir)\n x = x.replace('\\\\', '_').replace('/', '_').replace('#', '_')\n return x"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["def create_train(train_img_path):\n\n f = open(\"train.txt\", \"w+\")\n for subdirs, dirs, files in os.walk(train_img_path):\n for filename in files:\n if filename.endswith(\".jpg\"):\n train_image_path = os.path.join(train_img_path, filename)\n print(train_image_path)\n f.write(train_image_path + \"\\n\")\n f.close()","def save_step_2(imgs, match_list, output_path=\"./output/step2\"):\n # ... your code here ...\n for i in range(len(imgs)):\n name1,tail1 = str.split(filenames[match_list[i][0]],\".\")\n name2,tail2 = str.split(filenames[match_list[i][2]],\".\")\n cv2.imwrite(output_path+\"/\"+name1+\"_\"+str(match_list[i][1])+\"_\"+name2+\"_\"+str(match_list[i][3])+\"_\"+str(match_list[i][4])+\".jpg\", imgs[i])","def prep(path,date,image):\n \n # run bash code with 'Popen'\n P = Popen('cp '+path+date+'/final/'+image+' ./', shell=True)\n P.wait()\n P = Popen('mv '+image+' '+image+'.fz', shell=True)\n P.wait()\n P = Popen('funpack *.fz', shell=True)\n P.wait()\n P = Popen('rm -rf *.fz', shell=True)\n P.wait()","def appendpics(pathofimg, w_sub, h_sub, step):\n num = 0\n dirlist = []\n images = [] # images in each folder\n for root, dirs, fileswer in os.walk(pathofimg):\n if len(dirs)!= 0:\n for dir in dirs:\n dirlist.append(dir)\n for rooert, dirwerwes, files in os.walk(pathofimg+'/'+dir):\n for file in files:\n if(file.endswith('.png')):\n images.append(Image.open(pathofimg+'/'+dir+'/'+file))\n if(len(images)==81):\n break\n target = montage(images, w_sub, h_sub, step)\n target.save(pathofimg +'/'+ dir + '.png', quality=100)\n else:\n dir = 'Generated'\n for file in fileswer:\n if (file.endswith('.png')):\n images.append(Image.open(pathofimg +'/'+ file))\n target1 = montage(images, w_sub, h_sub, step)\n savepath = pathofimg +'/'+ 'generated'\n os.makedirs(savepath)\n target1.save(savepath +'/'+ dir + '.png', quality=100)","def create_val(val_img_path):\n\n f = open(\"val.txt\", \"w+\")\n for subdirs, dirs, files in os.walk(val_img_path):\n for filename in files:\n if filename.endswith(\".jpg\"):\n val_image_path = os.path.join(val_img_path, filename)\n print(val_image_path)\n f.write(val_image_path + \"\\n\")\n f.close()","def seperate_dog_cat(src, dst):\n imgs = [f for f in os.listdir(src) if os.path.isfile(os.path.join(src, f)) and not f.startswith('.')]\n \n dst_dog = os.path.join(dst, 'dog')\n dst_cat = os.path.join(dst, 'cat')\n if not os.path.exists(dst_dog):\n os.makedirs(dst_dog)\n if not os.path.exists(dst_cat):\n os.makedirs(dst_cat)\n \n for img in imgs:\n if 'dog' in img:\n move(os.path.join(src, img), dst_dog)\n if 'cat' in img:\n move(os.path.join(src, img), dst_cat)\n print('seperate done')","def preprocess_images(file_path, new_file_path):\n if not os.path.isdir(new_file_path):\n os.mkdir(new_file_path)\n i = 0\n for dir in listdir(file_path):\n j = 0\n for image_path in listdir(file_path + '/' + dir):\n image = open_image(image_path)\n cv2.imwrite(file_path + '/' + image_path + '/' str(i) + '/' +str(i) + '.jpg', image)\n j += 1\n i += 1","def prepare_output_dir(out_dir, test_dir):\r\n\r\n if not out_dir.exists():\r\n out_dir.mkdir()\r\n\r\n # get the necessary file names\r\n file_names = get_file_names(test_dir, args.distance, print_file_names=False)\r\n\r\n # copy the images in the firstIms into the output folder\r\n for name in file_names[1][0]:\r\n file_path = Path(test_dir / name)\r\n copy_to = Path(out_dir / name)\r\n shutil.copy(file_path, copy_to)\r\n\r\n # the firstIms list does not contain the last image,\r\n # so we need to also copy the last image of the secIms into the output folder\r\n last_im = file_names[1][1][-1]\r\n shutil.copy(Path(test_dir/last_im), Path(out_dir/last_im))\r\n\r\n return file_names","def save_step_1(imgs, output_path='./output/step1'):\n # ... your code here ...\n i=0\n for each in imgs:\n i+=1\n cv2.imwrite(output_path+\"/output\"+str(i)+\".jpg\", each)","def imgWrite(img, path):\n dirMake(os.path.dirname(path))\n sitk.WriteImage(img, path)\n\n # Reformat files to be compatible with CIS Software\n #ext = os.path.splitext(path)[1].lower()\n #if ext == \".vtk\": vtkReformat(path, path)","def save_step_3(img_pairs, match_list, output_path=\"./output/step3\"):\n # ... your code here ...\n for i in range(len(img_pairs)):\n name1,tail1 = str.split(filenames[match_list[i][0]],\".\")\n name2,tail2 = str.split(filenames[match_list[i][1]],\".\")\n cv2.imwrite(output_path+\"/\"+name1+\"_\"+name2+\".jpg\", img_pairs[i][0])\n cv2.imwrite(output_path+\"/\"+name2+\"_\"+name1+\".jpg\", img_pairs[i][1])","def write(img, path):\n create_directories_for_file_name(path)\n writer = sitk.ImageFileWriter()\n writer.Execute(img, path, True)","def write_image_to_file_incrementally(image):\r\n i = 0\r\n while os.path.exists(\"sample%s.jpeg\" % i):\r\n i += 1\r\n with open(\"sample%s.jpeg\" % i, \"wb\") as f:\r\n f.write(image)","def createAllImageFiles(poly, name) :\n \n for i in range(len(poly.getPaths())):\n fileName = name + \"_\" + str(i) + \".dot\"\n imgName = name + \"_\" + str(i) + \".jpg\"\n \n Command = \"neato -Tjpeg \" + fileName + \" -o \" + imgName\n run(Command, shell=True)","def create_full(dirpath, imgname):\n with open(join(dirpath, imgname), 'r+b') as f:\n with Image.open(f) as image:\n fullpicpath = join(outdir, fullpicdir, imgname)\n print(\"saving full pic to\", fullpicpath)\n image.save(fullpicpath, quality=75, optimize=True)","def save_step_4(imgs, output_path=\"./output/step4\"):\n # ... your code here ...\n cv2.imwrite(output_path+\"/output.jpg\", imgs)","def copy_database(path_images, path_labels, path_final_images):\n\n try:\n labels = sorted(os.listdir(path_labels))\n except FileNotFoudError:\n print(\"No such file or directory \", path_labels)\n\n try:\n images = sorted(os.listdir(path_images)) #+ \"RetinaNet_I04590/\"))\n except FileNotFoudError:\n print(\"No such file or directory \", path_images)\n\n \"\"\"if not os.path.exists(path_final_images + \"I04590/\"):\n os.mkdir(path_final_images + \"I04590/\")\n\n if not os.path.exists(path_final_images + \"I045135/\"):\n os.mkdir(path_final_images + \"I045135/\")\n\n if not os.path.exists(path_final_images + \"I090135/\"):\n os.mkdir(path_final_images + \"I090135/\")\n\n if not os.path.exists(path_final_images + \"I4590135/\"):\n os.mkdir(path_final_images + \"I4590135/\")\n\n if not os.path.exists(path_final_images + \"Params/\"):\n os.mkdir(path_final_images + \"Params/\")\n\n if not os.path.exists(path_final_images + \"Pauli2/\"):\n os.mkdir(path_final_images + \"Pauli2/\")\n\n if not os.path.exists(path_final_images + \"Pauli3/\"):\n os.mkdir(path_final_images + \"Pauli3/\")\n\n if not os.path.exists(path_final_images + \"Stokes/\"):\n os.mkdir(path_final_images + \"Stokes/\")\n\n if not os.path.exists(path_final_images + \"Rachel/\"):\n os.mkdir(path_final_images + \"Rachel/\")\n\n if not os.path.exists(path_final_images + \"Rachel2/\"):\n os.mkdir(path_final_images + \"Rachel2/\")\"\"\"\n\n for k in range(len(images)):\n if str(k) + \".xml\" in labels:\n copyfile(path_images + \"/\" + images[k],\n path_final_images + \"/\" + images[k])\n \"\"\"copyfile(path_images + \"RetinaNet_I04590/\" + str(k) + \".png\",\n path_final_images + \"I04590/\" + str(k) + \".png\")\n copyfile(path_images + \"RetinaNet_I045135/\" + str(k) + \".png\",\n path_final_images + \"I045135/\" + str(k) + \".png\")\n copyfile(path_images + \"RetinaNet_I090135/\" + str(k) + \".png\",\n path_final_images + \"I090135/\" + str(k) + \".png\")\n copyfile(path_images + \"RetinaNet_I4590135/\" + str(k) + \".png\",\n path_final_images + \"I4590135/\" + str(k) + \".png\")\n copyfile(path_images + \"RetinaNet_Params/\" + str(k) + \".png\",\n path_final_images + \"Params/\" + str(k) + \".png\")\n copyfile(path_images + \"RetinaNet_Pauli2/\" + str(k) + \".png\",\n path_final_images + \"Pauli2/\" + str(k) + \".png\")\n copyfile(path_images + \"RetinaNet_Pauli3/\" + str(k) + \".png\",\n path_final_images + \"Pauli3/\" + str(k) + \".png\")\n copyfile(path_images + \"RetinaNet_Stokes/\" + str(k) + \".png\",\n path_final_images + \"Stokes/\" + str(k) + \".png\")\n copyfile(path_images + \"RetinaNet_Rachel/\" + str(k) + \".png\",\n path_final_images + \"Rachel/\" + str(k) + \".png\")\n copyfile(path_images + \"RetinaNet_Rachel2/\" + str(k) + \".png\",\n path_final_images + \"Rachel2/\" + str(k) + \".png\")\n copyfile(path_labels + str(k) + \".xml\",\n path_final_labels + str(k) + \".xml\")\"\"\"\n print(k)","def _crop_write_image(self, inroot, images, outroot):\n for image in images:\n inimage_path = osp.join(inroot, image)\n cvimg = cv2.imread(inimage_path)\n cvimg = cvimg[60:-30, 25:-25]\n h, w, _ = cvimg.shape\n assert h == w == 128\n outimage_path = osp.join(outroot, image)\n cv2.imwrite(outimage_path, cvimg)\n print(outimage_path)","def update_destination_file_name (file_name):\n\tglobal COUNTER \n\tCOUNTER += 1\n\tsplitted = file_name.split('/')\n\treturn file_name[:len(file_name)-len(splitted[-1])] + 'Image%05d' % COUNTER +'_'+splitted[-1]","def jarvis(input_path, output_path): \n\n if not os.path.exists(f'{output_path}'):\n os.makedirs(f'{output_path}')\n\n file_list = [filename for filename in os.listdir(f'{input_path}') if '.tif' in filename]\n\n for filename in file_list:\n pathname = os.path.join(input_path, filename)\n new_name = f\"{output_path}{filename.replace('.lif - ', '_').replace('_5x-', '_')}\"\n copyfile(pathname, new_name)\n logger.info(f'{new_name}')","def create_intermediate_files():\n\n dirs = (DIR_PAGE, DIR_SRGB, DIR_VTI, DIR_TIFF,\n DIR_BACK, DIR_TEXT, DIR_FINAL)\n \n for dir in dirs:\n try:\n os.mkdir(os.path.join(cwd, dir))\n except OSError, e:\n print 'directory (', dir, ') already exists'","def group_image(directory, image, group):\r\n\tif os.path.exists(directory + \"\\\\\" + group):\r\n\t\tpass\r\n\telse:\r\n\t\ttry:\r\n\t\t\tos.mkdir(directory + '\\\\' + group)\r\n\t\t\tprint(\"Successfully created directory\", group)\r\n\t\texcept OSError:\r\n\t\t\tprint(\"Creation of directory failed.\")\r\n\ttry:\r\n\t\tshutil.copy(str(directory + '\\\\' + image), str(directory + \"\\\\\" + group + \"\\\\\" + image))\r\n\texcept OSError as OSe:\r\n\t\tprint(OSe)","def move_images_and_list(path, final_path):\n #Lists all created folders\n directories = os.listdir(path)\n #Array that stores the path to each image\n lists = []\n #This variable will be used to give a unique name to each image\n tot_images = 0\n #Creates the path where will be stored all files\n if not os.path.exists(final_path):\n os.mkdir(final_path)\n #Iterates over each folder\n for ph in directories:\n #Iterates over each line of the generated file images.lst\n for img in open(os.path.join(path, ph, \"images.lst\")).readlines():\n \"\"\"Images are stored with a name, how many objects have and\n where it is, like this '01_0252_0067_0139_0222.jpg 1 252 67 139 222'\n so these five lines under changes the first part before '_', because\n in some cases, the command opencv_createsamples creates a same name\n to different positive images, this ensures a different name to each\n image\"\"\"\n split_space = img.split()\n split_underscore = split_space[0].split(\"_\")\n split_underscore[0] = str(tot_images)\n join_underscore = \"_\".join(split_underscore)\n join_space = \" \".join([join_underscore, *split_space[1:]])\n #Appends the new image's name to the list\n lists.append(join_space)\n #Moves each image in the folder to the final path, with a new name\n move(os.path.join(path, ph, split_space[0]),\n os.path.join(final_path, join_space.split()[0]))\n tot_images += 1\n #Writes a file withe the name of all images in the folder\n with open(os.path.join(final_path, \"images.lst\"), \"w+\") as f:\n for i in lists:\n f.write(\"\".join([i, '\\n']))\n #Removes the temporary path\n rmtree(os.path.abspath(path))\n #Name of the created file\n return \"images.lst\"","def make_diff(file_before, file_after, file_output_name):\n if os.path.exists(file_output_name):\n shutil.rmtree(file_output_name)\n os.mkdir(file_output_name)\n psd_diff = diff(file_before, file_after)\n diff_content = {}\n for attr in [\"header\", \"layer\"]:\n diff_content[attr] = getattr(psd_diff, attr)\n with open(os.path.join(file_output_name, \"diff.json\"), \"w\") as diff_file:\n json.dump(diff_content, diff_file, indent=4)\n saved_files = []\n for layer_id in psd_diff.layer.keys():\n if len(psd_diff.layer_image[layer_id]) > 1:\n output_image = os.path.join(file_output_name, layer_id)\n psd_diff.layer_image[layer_id][\"before\"].save(output_image + \".before.png\")\n psd_diff.layer_image[layer_id][\"after\"].save(output_image + \".after.png\")\n diff_image_before = Image.new(\"RGBA\", psd_diff.layer_image[layer_id][\"before\"].size)\n diff_image_before_data = diff_image_before.load()\n diff_image_after = Image.new(\"RGBA\", psd_diff.layer_image[layer_id][\"after\"].size)\n diff_image_after_data = diff_image_after.load()\n width, height = diff_image_before.size\n pixel_index = 1\n for y in xrange(height):\n for x in xrange(width):\n if str(pixel_index) in diff_content[\"layer\"][layer_id][\"pixel\"]:\n diff_image_before_data[x, y] = tuple(diff_content[\"layer\"][layer_id][\"pixel\"][str(pixel_index)][\"before\"])\n diff_image_after_data[x, y] = tuple(diff_content[\"layer\"][layer_id][\"pixel\"][str(pixel_index)][\"after\"])\n else:\n diff_image_before_data[x, y] = (0, 0, 0, 0)\n diff_image_after_data[x, y] = (0, 0, 0, 0)\n pixel_index += 1\n diff_image_before.save(output_image + \".before.diff.png\", \"PNG\")\n diff_image_after.save(output_image + \".after.diff.png\", \"PNG\")\n saved_files.append(output_image + \".before.png\")\n saved_files.append(output_image + \".before.diff.png\")\n saved_files.append(output_image + \".after.diff.png\")\n saved_files.append(output_image + \".after.png\")\n saved_files.append(file_output_name + \"/diff.json\")\n return saved_files","def handle_image(name):\n from_path = args.from_dir + name\n to_path = args.to_dir + name\n\n if width != args.width:\n subprocess.call('jpegtran -rotate 90 -grayscale ' + from_path + ' > ' \\\n + to_path, shell=True)\n else:\n subprocess.call('jpegtran -grayscale ' + from_path + ' > ' + to_path,\\\n shell=True)","def set_image_out_path(self, image_path):\n i = image_path.rfind('/')\n self.image_out_path = image_path[:i+1] + \"out/\" + image_path[i+1:]","def output_diff_local_files(gold_session, image_name):\n given_file = gold_session.GetGivenImageLink(image_name)\n closest_file = gold_session.GetClosestImageLink(image_name)\n diff_file = gold_session.GetDiffImageLink(image_name)\n failure_message = 'Unable to retrieve link'\n logging.error('Generated image: %s', given_file or failure_message)\n logging.error('Closest image: %s', closest_file or failure_message)\n logging.error('Diff image: %s', diff_file or failure_message)","def merge_folders():\r\n from shutil import copyfile\r\n # Merge all folders into main folder\r\n grp_img_dir = os.listdir('Group_Test_Images')\r\n \r\n for grp_img_folder in grp_img_dir:\r\n image_folders = os.listdir('Group_Test_Images'+'/'+grp_img_folder)\r\n \r\n for img_label in image_folders:\r\n new_directory = 'Group_Test_Images'+'/'+img_label\r\n \r\n try:\r\n os.makedirs(new_directory)\r\n except FileExistsError:\r\n # directory already exists\r\n pass\r\n \r\n file_names = os.listdir('Group_Test_Images'+'/'+grp_img_folder+'/'+img_label)\r\n \r\n for file in file_names:\r\n copyfile('Group_Test_Images'+'/'+grp_img_folder+'/'+img_label+'/'+file, new_directory+'/'+file)","def create_output_directory_for_resized_images():\n\n try:\n if not os.path.isdir(RESIZED_NEGATIVE_PATH):\n return os.makedirs(RESIZED_NEGATIVE_PATH)\n elif not os.path.isdir(RESIZED_POSITIVE_PATH):\n return os.makedirs(RESIZED_POSITIVE_PATH)\n except OSError as e:\n print('Error --> {}'.format(e))","def moveFiles(rootDir):\n\n homedir = os.environ['HOME']\n albumDirec = 'AlbumCoverImages'\n #Check if a directory exists\n if not os.path.isdir(os.path.join(homedir, 'Pictures', albumDirec)):\n print('AlbumCoverImages not found, trying to make...')\n os.makedirs(os.path.join(homedir, 'Pictures', albumDirec))\n \n for root, dirs, files in os.walk(rootDir, topdown=False):\n #print('testtest')\n for name in files:\n \n\n #Find image files, and move them to albumCoverImages\n #For some bullshit reason or statments won't work here, have to\n # parse this out to elif statements, ughhhh...\n \n if '.jpg' in name:\n os.rename(os.path.join(root, name), os.path.join(homedir, 'Pictures', albumDirec, name))\n print('{0} moved to {1}!'.format(name, os.path.join(homedir, 'Pictures', albumDirec)))\n \n elif '.png' in name:\n os.rename(os.path.join(root, name), os.path.join(homedir, 'Pictures', albumDirec, name))\n print('{0} moved to {1}!'.format(name, os.path.join(homedir, 'Pictures', albumDirec, name)))\n \n elif '.gif' in name:\n os.rename(os.path.join(root, name), os.path.join(homedir, 'Pictures', albumDirec, name))\n print('{0} moved to {1}!'.format(name, os.path.join(homedir, 'Pictures', albumDirec, name)))\n \n elif '.pdf' in name:\n os.rename(os.path.join(root, name), os.path.join(homedir, 'Pictures', albumDirec, name))\n print('{0} moved to {1}!'.format(name, os.path.join(homedir, 'Pictures', albumDirec, name)))\n\n else:\n try:\n #Use tinytag to get file metadata\n tag = TinyTag.get(os.path.join(root, name))\n artistName = tag.artist\n albumName = tag.album\n \n #TODO: Need to add more conditions\n if isinstance(artistName, str):\n artistName = artistName.replace('/', '_')\n\n elif isinstance(albumName, str):\n albumName.replace('/', '_')\n \n\n #Check if the artists directory exists, if not make it\n try:\n if not os.path.isdir(os.path.join(rootDir, artistName)):\n os.makedirs(os.path.join(rootDir, artistName))\n print('{0} directory made!'.format(artistName))\n \n except ValueError:\n print('ValueError with {0}'.format(root+'/'+name))\n continue\n\n except TypeError:\n print('TypeError with {0}'.format(root+'/'+name))\n continue\n\n #Check if the songs album exists, if not make it\n try:\n if not os.path.isdir(os.path.join(rootDir, artistName, albumName)):\n os.makedirs(os.path.join(rootDir, artistName, albumName))\n print('{0} directory made!'.format(albumName))\n \n except TypeError:\n print('TypeError with {0}! Look at album directory making.'.format(root+'/'+name))\n continue\n\n #TODO: Check if album is in artist direc, if not, move it\n\n #Check if song is in album, if not move it \n try:\n if os.path.isfile(os.path.join(rootDir, artistName, albumName, name)) == False:\n os.rename(os.path.join(root, name), os.path.join(rootDir, artistName, albumName, name))\n print('{0} moved to {1}!'.format(name, albumName))\n \n except TypeError:\n print('TypeError with file {0}! Look at line song moving'.format(root+'/'+name))\n continue\n \n #TODO: Check if this part works\n except LookupError:\n if (\".jpg\") or (\".png\") or (\".7z\") or (\"README\") or (\".zip\") in name:\n continue\n \n else:\n print('No reader support for {0}'.format(name))\n continue","def test_warp():\n image_path = \"./data/test/nifti/unit_test/moving_image.nii.gz\"\n ddf_path = \"./data/test/nifti/unit_test/ddf.nii.gz\"\n\n # custom output path with correct suffix\n out_path = \"logs/test_warp/out.nii.gz\"\n warp(image_path=image_path, ddf_path=ddf_path, out_path=out_path)\n assert os.path.isfile(out_path)\n shutil.rmtree(os.path.dirname(out_path))\n\n # custom output path without correct suffix\n out_path = \"logs/test_warp/out.h5\"\n warp(image_path=image_path, ddf_path=ddf_path, out_path=out_path)\n out_path = \"logs/test_warp/warped.nii.gz\"\n assert os.path.isfile(out_path)\n shutil.rmtree(os.path.dirname(out_path))\n\n # custom output path without correct suffix\n out_path = \"logs/test_warp/\"\n warp(image_path=image_path, ddf_path=ddf_path, out_path=out_path)\n out_path = \"logs/test_warp/warped.nii.gz\"\n assert os.path.isfile(out_path)\n shutil.rmtree(os.path.dirname(out_path))\n\n # custom output path without correct suffix\n out_path = \"logs/test_warp\"\n warp(image_path=image_path, ddf_path=ddf_path, out_path=out_path)\n out_path = \"logs/warped.nii.gz\"\n assert os.path.isfile(out_path)\n shutil.rmtree(os.path.dirname(out_path))\n\n # custom output path\n out_path = \"warped.nii.gz\"\n warp(image_path=image_path, ddf_path=ddf_path, out_path=\"\")\n assert os.path.isfile(out_path)\n os.remove(out_path)","async def save_url_images(images):\n for source, image in images:\n name = source.split('/')[-1]\n async with aiofiles.open(f'{OUTPUT_FOLDER}/{name}', 'wb') as f:\n await f.write(image)","def make_image_dir(to_path, filenames):\n image_dir = os.path.join(to_path, \"image_2\")\n os.makedirs(image_dir)\n for f in filenames:\n image_file = os.path.join(image_dir, f + \".png\")\n os.system(\"cp sample.png {}\".format(image_file))","def output_files(filepath):\n\n infile = open(filepath, 'r')\n lines = infile.readlines()\n\n rel_path = './'\n rel_path += lines[6][lines[6].find(':')+1:].strip()\n rel_path += lines[7][lines[7].find(':')+1:].strip()\n\n filename_I1 = lines[9][lines[9].find(':')+1:].strip()\n filename_I2 = lines[10][lines[10].find(':')+1:].strip()\n filename_IW = lines[12][lines[12].find(':')+1:].strip()\n filename_WE = lines[13][lines[13].find(':')+1:].strip()\n filename_CFLx = lines[15][lines[15].find(':')+1:].strip()\n filename_CFLv = lines[16][lines[16].find(':')+1:].strip()\n filename_S = lines[18][lines[18].find(':')+1:].strip()\n\n filepath_I1 = rel_path + filename_I1\n filepath_I2 = rel_path + filename_I2\n filepath_IW = rel_path + filename_IW\n filepath_WE = rel_path + filename_WE\n # filepath_CFLx = rel_path + filename_CFLx\n # filepath_CFLv = rel_path + filename_CFLv\n filepath_S = rel_path + filename_S\n\n outfile_I1 = open(filepath_I1, 'w')\n outfile_I2 = open(filepath_I2, 'w')\n outfile_IW = open(filepath_IW, 'w')\n outfile_WE = open(filepath_WE, 'w')\n # outfile_CFLx = open(filepath_CFLx, 'w')\n # outfile_CFLv = open(filepath_CFLv, 'w')\n outfile_S = open(filepath_S, 'w')\n\n outfiles = dict(I1 = outfile_I1,\n I2 = outfile_I2,\n IW = outfile_IW,\n WE = outfile_WE,\n # CFLx = outfile_CFLx,\n # CFLv = outfile_CFLv,\n S = outfile_S)\n\n return outfiles","def output_files(filepath):\n\n infile = open(filepath, 'r')\n lines = infile.readlines()\n\n rel_path = './'\n rel_path += lines[6][lines[6].find(':')+1:].strip()\n rel_path += lines[7][lines[7].find(':')+1:].strip()\n\n filename_I1 = lines[9][lines[9].find(':')+1:].strip()\n filename_I2 = lines[10][lines[10].find(':')+1:].strip()\n filename_IW = lines[12][lines[12].find(':')+1:].strip()\n filename_WE = lines[13][lines[13].find(':')+1:].strip()\n filename_CFLx = lines[15][lines[15].find(':')+1:].strip()\n filename_CFLv = lines[16][lines[16].find(':')+1:].strip()\n filename_S = lines[18][lines[18].find(':')+1:].strip()\n\n filepath_I1 = rel_path + filename_I1\n filepath_I2 = rel_path + filename_I2\n filepath_IW = rel_path + filename_IW\n filepath_WE = rel_path + filename_WE\n # filepath_CFLx = rel_path + filename_CFLx\n # filepath_CFLv = rel_path + filename_CFLv\n filepath_S = rel_path + filename_S\n\n outfile_I1 = open(filepath_I1, 'w')\n outfile_I2 = open(filepath_I2, 'w')\n outfile_IW = open(filepath_IW, 'w')\n outfile_WE = open(filepath_WE, 'w')\n # outfile_CFLx = open(filepath_CFLx, 'w')\n # outfile_CFLv = open(filepath_CFLv, 'w')\n outfile_S = open(filepath_S, 'w')\n\n outfiles = dict(I1 = outfile_I1,\n I2 = outfile_I2,\n IW = outfile_IW,\n WE = outfile_WE,\n # CFLx = outfile_CFLx,\n # CFLv = outfile_CFLv,\n S = outfile_S)\n\n return outfiles","def writeList(image, file, path):\n homepath = os.getcwd()\n\n os.chdir(path)\n\n image = image.rstrip('.fits')\n\n if os.path.exists(file):\n filelist = open(file, 'r').readlines()\n if image+'\\n' in filelist or not filelist:\n f = open(file, 'w')\n f.write(image+'\\n')\n else:\n f = open(file, 'a')\n f.write(image+'\\n')\n else:\n f = open(file, 'a')\n f.write(image+'\\n')\n f.close()\n os.chdir(homepath)\n\n return","def _temp_analyze_files(tmpdir):\n img_dir = tmpdir.mkdir(\"img\")\n orig_img = img_dir.join(\"orig.img\")\n orig_hdr = img_dir.join(\"orig.hdr\")\n orig_img.open(\"w\")\n orig_hdr.open(\"w\")\n return orig_img.strpath, orig_hdr.strpath","def crop_and_save(gray, faces):\r\n count = 0\r\n for (x, y, w, h) in faces:\r\n name = int(time.time())\r\n name = str(name)\r\n while os.path.isfile(\"temp/\" + name + \".png\"):\r\n count += 1\r\n name = name + \"+\" + str(count)\r\n cv2.imwrite(os.path.join(\"temp/\" + name + \".png\"), gray[y:y + h, x:x + w])","def imageSaveOutput(image,name,number):\n FileName = name +\" \"+number\n mpimg.imsave(\"test_images_output\"+'//'+FileName,image)\n return 0;","def save_unique_image():\r\n global folder_name\r\n filelist = [file for file in os.listdir('temp') if file.endswith('.png')]\r\n\r\n if filelist:\r\n for image_path in filelist:\r\n found = 0\r\n img_to_del = Image.open(\"temp/\" + image_path)\r\n if not get_immediate_subdirectories():\r\n found = 1\r\n os.makedirs('detected_faces/1/')\r\n img_to_del.save('detected_faces/1/'+ image_path)\r\n os.remove(os.path.join(temp_path, image_path))\r\n folder_name = 1\r\n else:\r\n for folder in get_immediate_subdirectories():\r\n folder_filelist = [file for file in os.listdir(\"detected_faces/\" + folder) if\r\n file.endswith('.png')]\r\n count = len(folder_filelist)\r\n file = folder_filelist[0]\r\n img_to_compare = Image.open(\"detected_faces/\" + folder + \"/\" + file)\r\n if img_to_del.size > img_to_compare.size:\r\n temp_image_resized = img_to_del.resize(img_to_compare.size, Image.ANTIALIAS)\r\n index = get_ssim(temp_image_resized, img_to_compare)\r\n elif img_to_del.size < img_to_compare.size:\r\n img_to_compare = img_to_compare.resize(img_to_del.size, Image.ANTIALIAS)\r\n index = get_ssim(img_to_del, img_to_compare)\r\n else:\r\n index = get_ssim(img_to_del, img_to_compare)\r\n if index > min_ssim_index_val:\r\n found = 1\r\n if count < 5:\r\n img_to_del.save(pathname + \"/\" + folder + \"/\" + image_path)\r\n print image_path\r\n if os.path.isfile(os.path.join(temp_path, image_path)):\r\n os.remove(os.path.join(temp_path, image_path))\r\n if found == 0:\r\n folder_name += 1\r\n os.makedirs('detected_faces/' + str(folder_name))\r\n img_to_del.save(pathname + \"/\" + str(folder_name) + \"/\" + image_path)\r\n if os.path.isfile(os.path.join(temp_path, image_path)):\r\n os.remove(os.path.join(temp_path, image_path))","def determine_output_ending():\n file_found = False\n idx = 1\n while not file_found:\n if not os.path.isfile(LOG_DIR + \"/output%04d.png\" % (idx)):\n return \"%04d\" % (idx)\n idx += 1","def write_output_data_to_disk(\n output_data_dict,\n output_directory=\"./\",\n output_file_suffix=\".nii.gz\",\n overwrite_existing_files=False,\n):\n if output_data_dict is None:\n return\n\n filename_fields = [i for i in output_data_dict.keys() if i != \"parent_sorting_data\"]\n parent_sorting_data = output_data_dict[\"parent_sorting_data\"]\n\n files_written = {}\n\n \"\"\"\n Write the the converted images to disk\n\n ! CONSIDER\n We could simply write as we go?\n Pro: save memory, important if processing very large files\n Con: Reading as we go allows proper indexing\n\n \"\"\"\n\n for field in filename_fields:\n logger.info(\" Writing files for field: %s\", field)\n p = pathlib.Path(output_directory) / parent_sorting_data / field\n p.mkdir(parents=True, exist_ok=True)\n files_written[field] = []\n\n for field_filename_base, field_list in output_data_dict[field].items():\n # Check if there is a list of images with matching names\n # This will depend on the name format chosen\n # If there is a list, we append an index as we write to disk\n\n if isinstance(field_list, (tuple, list)):\n # Flatten\n field_list_flat = list(flatten(field_list))\n\n # Iterate\n for suffix, file_to_write in enumerate(field_list_flat):\n field_filename = field_filename_base + f\"_{suffix}\"\n\n # Some cleaning\n while \"__\" in field_filename:\n field_filename = field_filename.replace(\"__\", \"_\")\n\n while field_filename[-1] == \"_\":\n field_filename = field_filename[:-1]\n\n # Save image!\n output_name = (\n pathlib.Path(output_directory)\n / parent_sorting_data\n / field\n / (field_filename + output_file_suffix)\n )\n files_written[field].append(output_name)\n\n if output_name.is_file():\n logger.warning(\" File exists: %s\", output_name)\n\n if overwrite_existing_files:\n logger.warning(\" You have selected to overwrite existing files.\")\n\n else:\n logger.info(\n \" You have selected to NOT overwrite existing files. Continuing.\"\n )\n continue\n\n sitk.WriteImage(file_to_write, output_name.as_posix())\n\n else:\n field_filename = field_filename_base\n file_to_write = field_list\n\n # Some cleaning\n while \"__\" in field_filename:\n field_filename = field_filename.replace(\"__\", \"_\")\n\n while field_filename[-1] == \"_\":\n field_filename = field_filename[:-1]\n\n # Save image!\n \"\"\"\n ! TO DO\n Use pathlib, and perform some checks so we don\"t overwrite anything!\n \"\"\"\n output_name = (\n pathlib.Path(output_directory)\n / parent_sorting_data\n / field\n / (field_filename + output_file_suffix)\n )\n files_written[field].append(output_name)\n\n if output_name.is_file():\n logger.warning(\" File exists: %s\", output_name)\n\n if overwrite_existing_files:\n logger.warning(\" You have selected to overwrite existing files.\")\n\n else:\n logger.info(\n \" You have selected to NOT overwrite existing files. Continuing.\"\n )\n continue\n\n sitk.WriteImage(file_to_write, output_name.as_posix())\n\n return files_written","def collect_and_rename() -> None:\n image_source_folder = 'image_dir'\n label_source_folder = 'annotation_dir'\n image_target_folder = 'images'\n label_target_folder = 'labels'\n for i, (subdir, _, files) in enumerate(os.walk(image_source_folder), -1):\n # it walks the parent folder first, not a file\n if i == -1: \n continue\n subdir_name = subdir.split('\\\\')[1]\n for file_name in files:\n with open(f'{image_source_folder}/{subdir_name}/{file_name}') as image_file, \\\n open(f'{label_source_folder}/{subdir_name}/{file_name}'.split('.')[0] + '.txt') as label_file:\n shutil.copy2(image_file.name, f'{image_target_folder}/{\"%06d\" % i}.jpg')\n shutil.copy2(label_file.name, f'{label_target_folder}/{\"%06d\" % i}.txt')\n print(f'Processed {i} images')","def quicksavefile(directory, text, format=\".out\"):\n print(text)\n print(directory)\n directory = directory.split(\".\")\n del directory[-1]\n directory.append(format)\n s = \"\".join(directory)\n file = open(s, \"w\")\n file.write(text)\n file.close()","def enumerate_filename(path):\n for (dirpath_0, dirname_list, _) in os.walk(path):\n for dirname in tqdm(dirname_list):\n if dirname[0] != '.':\n dirpath_1 = dirpath_0 + '/' + dirname + '/'\n for (dirpath_2, __, filename_list) in os.walk(dirpath_1):\n for filename in filename_list:\n if filename[0] != '.':\n old_file = dirpath_2 + filename\n new_file = dirpath_2 + str(filename_list.index(filename)) + '.jpg'\n if os.path.exists(new_file):\n print ('File %s already exist' % new_file)\n continue\n else:\n try:\n os.rename(old_file, new_file)\n except:\n print('Couldn\\'t rename %s' % old_file)\n continue","def main(vis_dirs, outdir):\n assert len(vis_dirs) == 4\n\n if not os.path.exists(outdir):\n os.mkdir(outdir)\n\n for i, filename in enumerate(tqdm(os.listdir(vis_dirs[-1]))):\n # if i % 100 == 0:\n # print(i)\n\n files = [os.path.join(vis_dir, filename) for vis_dir in vis_dirs]\n outimg = os.path.join(outdir, filename)\n merge_four_images(files, outimg)\n\n print (\"Finished! Result dir is %s\" % outdir)","def produce_reversed_images(source_dir, save_dir):\n if os.path.exists(source_dir) is False:\n os.makedirs(source_dir)\n if os.path.exists(save_dir) is False:\n os.makedirs(save_dir)\n\n reversed_images_index = 0\n source_img = find_images(source_dir)\n print(\"Reversing the source images...\")\n for s in source_img:\n img, label = read_image_with_label(source_dir, s)\n for d in range(3): # 3 kinds of reversing\n reversed_images_index += 1\n img_new, label_new = reverse_image(img, label, d)\n img_name = str(reversed_images_index) + \"_\" + str(label_new[0]) + \"_\" + str(label_new[1]) + \"_.png\"\n img_new.save(os.path.join(save_dir, img_name))\n if reversed_images_index % 100 == 0:\n print(\"%d images already be produced\" % reversed_images_index)\n print(\"Reverse images reversed: %d\" % reversed_images_index)","def process_images():\n create_dirs()\n for root, dirs, files in os.walk(IN):\n for name in files:\n if name[0] == '.':\n continue\n process_image(name)","def image_splitter(foreground, filename, outfolder_random, outfolder_art, the_class):\n imarray = numpy.random.rand(256, 256, 3) * 255\n background = Image.fromarray(imarray.astype('uint8')).convert('RGBA')\n background2 = Art().redraw()\n foreground = foreground.convert(\"RGBA\")\n datas = foreground.getdata()\n\n new_data = []\n for item in datas:\n if item[0] < 10 and item[1] < 10 and item[2] < 10:\n new_data.append((0, 0, 0, 0))\n else:\n new_data.append(item)\n\n foreground.putdata(new_data)\n\n if not os.path.isdir(outfolder_random + \"/\" + the_class):\n os.makedirs(outfolder_random + \"/\" + the_class)\n if not os.path.isdir(outfolder_art + \"/\" + the_class):\n os.makedirs(outfolder_art + \"/\" + the_class)\n\n background.paste(foreground, (0, 0), foreground)\n new_name = filename[:-17]\n background.save(outfolder_random + \"/\" + the_class + \"/\" + new_name + \"jpg\", \"JPEG\")\n\n background2.paste(foreground, (0, 0), foreground)\n background2.save(outfolder_art + \"/\" + the_class + \"/\" + new_name + 'jpg', \"JPEG\")","def __save_to_dir(self, imagelist, prefix, PATH):\n for pair in imagelist:\n directory = os.path.join(PATH, pair[1])\n if not os.path.exists(directory):\n os.mkdir(directory)\n filename = prefix + pair[2]\n pair[0].save(os.path.join(directory, filename))\n print(\"Saved \" + os.path.join(directory, filename))","def create_and_write_output(predictions_path,output_path,inpDir):\n \n filenames= sorted(os.listdir(predictions_path)) \n for filename in filenames:\n \n # read the 3 channel output image from the neural network\n image=cv2.imread(os.path.join(predictions_path,filename))\n \n # create binary image output using the create_binary function\n out_image=create_binary(image) \n \n # read and store the metadata from the input image\n with BioReader(os.path.join(inpDir,filename)) as br:\n metadata = br.metadata\n\n # Write the binary output consisting of the metadata using bfio.\n output_image_5channel=np.zeros((out_image.shape[0],out_image.shape[1],1,1,1),dtype=np.uint8)\n output_image_5channel[:,:,0,0,0]=out_image \n\n with BioWriter(os.path.join(output_path,filename), metadata=metadata) as bw:\n bw.dtype = output_image_5channel.dtype\n bw.write(output_image_5channel)","def jarvis(input_path, output_path): \n \n if not os.path.exists(f'{output_path}'):\n os.makedirs(f'{output_path}')\n\n folder_list = [sample for sample in os.listdir(input_path) if os.path.isdir(f'{input_path}{sample}')]\n\n for folder in folder_list:\n\n file_list = [filename for filename in os.listdir(f'{input_path}{folder}/') if '.tif' in filename]\n mutant = '_'.join(folder.split(' '))\n\n for x, filename in enumerate(file_list):\n pathname = os.path.join(input_path, folder, filename)\n new_name = f'{output_path}{mutant}_{x}.tif'\n copyfile(pathname, new_name)\n # array_stack = skimage.io.imread(f'{pathname}').transpose(1, 2, 0)\n logger.info(f'{new_name}')","def get_normal_image(image_path):\n resized_images = slice_and_resize(image_path)\n\n normal_full_img = join_images_horizontally(resized_images)\n\n folder = \"static/images/panorama\"\n\n name = next(tempfile._get_candidate_names())\n normal_path = \"%s/%s_resized.png\" % (folder, name)\n normal_full_img.save(normal_path)\n\n return normal_path","def appendTrailer(inputImagePath, trailer, outputPath):\n\n with open(inputImagePath, \"rb\") as f:\n inputContent = f.read()\n\n with open(outputPath, \"wb\") as f:\n f.write(inputContent)\n f.write(trailer)","def create_temp_files(containers):\n for name in containers:\n run_cmd(f\"rm -rf /tmp/{name}.img\", True)\n for name in containers:\n run_cmd(f\"truncate -s 1G /tmp/{name}.img\", True)","def split(directory='', name=''):\n d = directory\n r_path = build_path(d, path.splitext(name)[0] + '_r.png')\n g_path = build_path(d, path.splitext(name)[0] + '_g.png')\n b_path = build_path(d, path.splitext(name)[0] + '_b.png')\n a_path = build_path(d, path.splitext(name)[0] + '_a.png')\n Image.open(build_path(d, name)).convert('RGBA').getchannel(0).save(r_path)\n Image.open(build_path(d, name)).convert('RGBA').getchannel(1).save(g_path)\n Image.open(build_path(d, name)).convert('RGBA').getchannel(2).save(b_path)\n Image.open(build_path(d, name)).convert('RGBA').getchannel(3).save(a_path)","def _handle_old_style_images(staging_path):\n file_num = 0\n for filename in ('snap.vhd', 'image.vhd', 'base.vhd'):\n path = os.path.join(staging_path, filename)\n if os.path.exists(path):\n _rename(path, os.path.join(staging_path, \"%d.vhd\" % file_num))\n file_num += 1","def download_images(src_dir, dest_dir):\n # +++your code here+++\n if not os.path.exists(dest_dir):\n os.mkdir(dest_dir)\n res=utility(src_dir)\n k=0\n f=file(dest_dir+\"/\"+\"index.html\", 'w')\n f.write(\"<html><body>\")\n for i in res:\n local_name='image'+str(k)\n print \"downloading image%d\" %(k)\n urllib.urlretrieve(i, os.path.join(dest_dir, local_name))\n f.write(\"<img src=\"+'\"'+os.path.join(dest_dir, local_name)+'\"'+\">\")\n k+=1\n f.write(\"</body></html>\")\n f.close()\n cmd=\"xdg-open\"+\" \"+'\"'+dest_dir+\"/\"+\"index.html\"+'\"'\n (status, output)=commands.getstatusoutput(cmd)\n sys.exit(1)","def write_tmp_blob(dir, name, sha):\n cmd = ['git', 'cat-file', '-p', sha ]\n abs_path = os.path.join(dir, os.path.basename(name))\n popen = subprocess.Popen(cmd, stdout=subprocess.PIPE)\n output = popen.communicate()[0]\n f = file(abs_path, 'w')\n f.write(output)\n f.close()\n return abs_path","def copy_images_to_new(lab_img, from_dir, to_dir):\n \n for img in lab_img:\n if not os.path.exists(join(todir, img)):\n shutil.copyfile(join(fromdir, img), join(todir, img)) \n print(\"Done\")","def TextureFiles():\n import shutil\n\n # first convert the .psd files to .png\n\n FbmDir = glo.outputFolder + '.fbm'\n\n for d1, d2, filenames in os.walk(FbmDir):\n for filename in filenames:\n \"\"\"filename: vitrin_diffuse.psd\n \"\"\"\n # print \"TextureFiles():\", filename\n if filename[-4:].upper() == '.PSD':\n #print \" -- FbmDir:\" , FbmDir\n #print \" -- in the if clause with filename:\" , filename\n #print \" -- glo.outputFolder\" , glo.outputFolder\n # FbmDir = '../fbx/simplelifeembedmedia.fbm'\n # filename = 'shelves_light.PSD'\n PsdToPngConverter(FbmDir, filename)\n\n # Move only the .png file to the ../png/ directory\n filename = filename[:-4] + '.png'\n src = os.path.join(FbmDir, filename)\n elif filename[0] != '.':\n src = os.path.join(FbmDir, filename)\n pass\n\n shutil.copy(src, glo.outputFolder)\n print os.path.join(glo.outputFolder, filename), \"\\n\"\n sys.stdout.flush()\n # for d1, d2, files in os.walk(glo.outputFolder):\n # if not filename in files:\n # #print \"moving: \", files, filename, not filename in files\n # shutil.copy(src, glo.outputFolder)\n # print os.path.join(glo.outputFolder, filename), \"\\n\"\n # else:\n # print \"%s/%s already exists. File not moved\" % (glo.outputFolder,filename)","def photo2web_process_hattenbach():\n\n os.chdir('/Volumes/SSD External/Hattenbach_v2')\n \n dir_base = os.getcwd()\n \n dir_p2w = '/Users/throop/photos/Trips/'\n \n dirs = sorted(glob.glob(os.path.join(dir_base, '*')))\n \n quality_out = '60'\n size_out = '2000x2000'\n \n for i,dir in enumerate(dirs):\n if os.path.isdir(dir):\n os.chdir(dir)\n dir_originals = os.path.join(dir, 'originals')\n dir_originals_fullres = os.path.join(dir, 'originals_fullres')\n\n# For HH files, copy the 'actual' originals into a 'fullres' folder, for safekeeping\n\n if not os.path.isdir(dir_originals_fullres):\n os.rename(dir_originals, dir_originals_fullres)\n os.mkdir(dir_originals)\n \n files = glob.glob(os.path.join(dir_originals_fullres, '*'))\n\n# Get a list of all the images\n\n# For each image, make a low-res, low-quality image. This is just because the scanned files\n# are huge and high-quality, and not useful for online. They are much larger than necessary. \n# So we use 'convert' to shrink them in size and quality, and put the output into 'originals' directory \n# for photo2web.\n\n for file in files:\n file_short = os.path.basename(file)\n file_in = os.path.join(dir_originals_fullres,file_short)\n file_out = os.path.join(dir_originals,file_short)\n if not os.path.isfile(file_out):\n cmd = (f'convert -resize {size_out} -quality {quality_out}' +\n f' {file_in}' +\n f' {file_out}')\n print(f'{cmd}')\n \n subprocess.run(['convert', '-resize', size_out, '-quality', quality_out,\n file_in,\n file_out])\n\n# Now, finally, go thru and do photo2web on all of them.\n \n print(f'\\nProcessing directory {i}/{len(dirs)} {dir}\\n')\n subprocess.run(['cp', '-r', os.path.join(dir_p2w, 'header.txt'), '.'])\n subprocess.run(['cp', '-r', os.path.join(dir_p2w, 'photos.css'), '.'])\n if not os.path.exists('captions.txt'):\n subprocess.run(['captions_photo2web']) \n subprocess.run(['photo2web_old'])\n subprocess.run(['photo2web'])","def save(images, output):\n for image, frame in images:\n image.save(output(frame))","def compress_image(filename,k):","def convert_for_submission(source_dir, target_dir):\r\n files = subfiles(source_dir, suffix=\".nii.gz\", join=False)\r\n maybe_mkdir_p(target_dir)\r\n for f in files:\r\n img = sitk.ReadImage(join(source_dir, f))\r\n out_file = join(target_dir, f[:-7] + \".nii\")\r\n sitk.WriteImage(img, out_file)","def gen_text (path_img):\n \n try:\n image_files = []\n os.chdir(path_img)\n for filename in os.listdir(os.getcwd()):\n if filename.endswith(\".JPG\"):\n image_files.append(path_img + filename)\n with open(\"images.txt\", \"w\") as outfile:\n for image in image_files:\n outfile.write(image)\n outfile.write(\"\\n\")\n outfile.close()\n \n except KeyboardInterrupt:\n print('Interrupted')\n try:\n os.system.exit(0)\n except SystemExit:\n os._exit(0)","def tiff_split(path_tiff_source, path_tiff_out):\n path_out_low = path_tiff_out + '\\\\' + 'low8bits'\n path_out_hig = path_tiff_out + '\\\\' + 'high8bits'\n path_out_list=[path_out_hig,path_out_low]\n makdir(path_out_low)\n makdir(path_out_hig)\n for file in glob.glob(path_tiff_source + '\\\\' + '*.tiff'):\n tif = TIFF.open(file, 'r')\n img = tif.read_image()\n img_low_8bits = img % 256\n img_hig_8bits = img / 256\n img_low_8bits = img_low_8bits.astype(np.uint8)\n img_hig_8bits = img_hig_8bits.astype(np.uint8)\n img_name = os.path.basename(file)\n tif_split_low = TIFF.open(path_out_low + '\\\\' + img_name, 'w')\n tif_split_low.write_image(img_low_8bits)\n tif_split_hig = TIFF.open(path_out_hig + '\\\\' + img_name, 'w')\n tif_split_hig.write_image(img_hig_8bits)\n return path_out_list","def append_component_images(pldm_fw_up_pkg, image_files):\n for image in image_files:\n with open(image, \"rb\") as file:\n for line in file:\n pldm_fw_up_pkg.write(line)","def process_directory(working_directory, cc_size, output_directory):\n print \"\\nProcessing directory {0}\".format(working_directory)\n \n for dirpath, dirnames, filenames in os.walk(working_directory):\n for f in filenames:\n if f.split('.')[-1] == 'tif':\n img = load_image(os.path.join(dirpath, f))\n onebitimage = img.to_onebit()\n onebitimage.despeckle(int(cc_size))\n output_path = os.path.join(output_directory, f)\n # print onebitimage\n # print (os.path.join(dirpath, f.split('.')[0]+ '_NEW.' + f.split('.')[-1]))\n # onebitimage.save_tiff(os.path.join(dirpath, f.split('.')[0]+ '_NEW.' + f.split('.')[-1]))\n\n onebitimage.save_tiff(output_path)\n print output_path\n else:\n pass","def copy_mosaic(mosaic_dir='K:/IID_SaltonSea/Tasks/Soil mapping/PhotoDocumentation/Original/',\r\n output_dir='K:/IID_SaltonSea/Tasks/Soil mapping/PhotoDocumentation/Processing/',\r\n file_pattern='IID201905*jpg', replace=False): \r\n \r\n if not os.path.exists(mosaic_dir):\r\n sys.exit('input folder does not exist')\r\n \r\n mosaics = []\r\n for root, dirnames, filenames in os.walk(mosaic_dir):\r\n for filename in fnmatch.filter(filenames, file_pattern):\r\n mosaics.append(os.path.join(root, filename))\r\n \r\n c = 0\r\n s = 0\r\n r = 0\r\n for m in mosaics:\r\n f = output_dir + os.path.basename(m)\r\n if not os.path.exists(f):\r\n copyfile(m, f)\r\n print('copied: %s' % f)\r\n c+=1\r\n elif replace:\r\n copyfile(m, f)\r\n print('replaced: %s' % f)\r\n r+=1\r\n else:\r\n print('skipped: %s' % f)\r\n s+=1\r\n \r\n print('copied total of %i files' % c)\r\n print('replaced total of %i files' % r)\r\n print('skipped total of %i files' % s)","def divide_fasta_like_file(input_file, output_dir, ext=''):\n with open(input_file, 'r') as file:\n body = ''\n p_id = ''\n for line in file:\n if line[0] == '>':\n if len(p_id) > 0:\n with open(output_dir + p_id.replace(':', '_') + '.' + ext, \"w\") as out_file:\n out_file.write('>' + p_id.replace(':', '_') + '\\n' + body + '\\n')\n body = ''\n p_id = line.strip()[1:]\n else:\n body += line.strip()\n with open(output_dir + p_id.replace(':', '_') + '.' + ext, \"w\") as out_file:\n out_file.write('>' + p_id.replace(':', '_') + '\\n' + body + '\\n')","def pepsi(directory=None):\r\n \r\n if directory == None:\r\n directory = os.getcwd() # Use working directory if unspecified\r\n \r\n # Create a new directory 'modified'\r\n new_directory = os.path.join(directory, 'modified')\r\n try:\r\n os.mkdir(new_directory)\r\n except OSError:\r\n pass # if the directory already exists, proceed \r\n \r\n #load all the images\r\n image_list, file_list = get_images(directory) \r\n\r\n #go through the images and save modified versions\r\n red = PIL.Image.open(os.path.join(directory, 'red.png'))\r\n blue = PIL.Image.open(os.path.join(directory, 'blue.png'))\r\n template =PIL.Image.open(os.path.join(directory, 'template.png'))\r\n topp = PIL.Image.open(os.path.join(directory, '1.jpeg'))\r\n bottomm = PIL.Image.open(os.path.join(directory, '2.jpg'))\r\n \r\n # Round the corners with radius = 30% of short side\r\n\r\n top = redlogo(topp,red,template)\r\n bottom = bluelogo(bottomm,blue,template)\r\n new_image = template\r\n new_image.paste(bottom,(0,0), mask=bottom)\r\n new_image.paste(top,(0,0), mask=top)\r\n #save the altered image, suing PNG to retain transparency\r\n new_image_filename = os.path.join(new_directory, 'final' + '.png')\r\n new_image.save(new_image_filename) #9b: ","def create_noobj_folder(\n folder: PathLike, \n img_ext: str = \".jpg\",\n):\n folder = Path(folder).expanduser().resolve()\n images = glob(folder, img_ext)\n \n for image in images:\n filename = image.name\n _folder = image.parent.name\n path = folder / (image.stem + \".xml\")\n img_w, img_h = get_image_size(image)\n\n tree = ET.Element(\"annotation\")\n\n et_folder = ET.SubElement(tree, \"folder\")\n et_folder.text = _folder\n\n et_filename = ET.SubElement(tree, \"filename\")\n et_filename.text = filename\n\n et_path = ET.SubElement(tree, \"path\")\n et_path.text = str(path)\n\n et_img_size = ET.SubElement(tree, \"size\")\n ET.SubElement(et_img_size, \"width\").text = str(img_w)\n ET.SubElement(et_img_size, \"height\").text = str(img_h)\n ET.SubElement(et_img_size, \"depth\").text = \"3\"\n\n content = ET.tostring(tree, encoding=\"unicode\", pretty_print=True)\n try: \n path.write_text(content)\n except KeyboardInterrupt:\n path.write_text(content)\n exit()","def add_image(self, f_name,file,new_id):\r\n folder=tempfile.mktemp()\r\n os.mkdir(folder)\r\n datei=open(folder+'/'+f_name,'w+')\r\n datei.write(file.read())\r\n datei.close()\r\n val='' \r\n liste_ext=liste_val\r\n if(self.toolbox.hasProperty('eigene_formate')):\r\n self_val=self.toolbox.getProperty('eigene_formate').split(',')\r\n liste_ext=[]\r\n for x in self_val:\r\n liste_ext.append('_'+x+'.jpeg')\r\n for extension in liste_ext:\r\n #cmd='/usr/bin/convert '+folder+'/'+f_name+' -resize '+extension[1:-4]+'x'+extension[1:-4]+' '+folder+'/'+new_id+extension\r\n cmd='/usr/bin/convert '+folder+'/'+f_name+' -resize '+extension[1:-4]+' '+folder+'/'+new_id+extension\r\n order=os.popen(cmd).read()\r\n kurz_name='_'+str(f_name.split('.')[0])\r\n kurz_name=kurz_name.replace(' ','_')\r\n val=val+self.manage_addImage(id=new_id+kurz_name+extension,file=open(folder+'/'+new_id+extension),title=f_name, precondition='', content_type='',REQUEST=None)+' ' \r\n os.remove(folder+'/'+new_id+extension)\r\n os.remove(folder+'/'+f_name)\r\n os.rmdir(folder)\r\n txt=\"Datei Hochgeladen!<br>\"\r\n #my_root=self.toolbox\r\n #txt+=my_root.id+\"<br>\"\r\n #if(my_root.hasProperty('eigene_formate')):\r\n # txt+=my_root.getProperty('eigene_formate')+\"<br>\"\r\n return txt","def ren_mosaic(mosaic_dir='K:/IID_SaltonSea/Tasks/Soil mapping/PhotoDocumentation/Original/', \r\n file_pattern='*stitch.jpg'): \r\n \r\n \r\n if not os.path.exists(mosaic_dir):\r\n sys.exit('input folder does not exist')\r\n \r\n mosaics = []\r\n for root, dirnames, filenames in os.walk(mosaic_dir):\r\n for filename in fnmatch.filter(filenames, file_pattern):\r\n mosaics.append(os.path.join(root, filename).replace('\\\\','/'))\r\n \r\n s = 0\r\n r = 0\r\n for m in mosaics:\r\n dir_name = os.path.dirname(m).split('/')[-1]\r\n new_name = os.path.dirname(m) + '/' + dir_name + '.jpg'\r\n if os.path.exists(new_name):\r\n print('skipping: %s' % m)\r\n s+=1\r\n else:\r\n os.rename(m, new_name)\r\n print('renamed: %s' % new_name)\r\n r+=1\r\n \r\n print('renamed total of %i files' % r)\r\n print('skipped total of %i files' % s)","def move_files(probs):\r\n path = '../brain_tiny_dataset_class/png/'\r\n for _, _, files in os.walk(path):\r\n for file in files:\r\n # Reads the ID\r\n id = file[3:-4]\r\n try:\r\n # Reads dictionary of probabilities\r\n result = probs[id]\r\n # Moves pictures in 2 folders\r\n if result['epidural'] > 0 or result['intraparenchymal'] > 0 \\\r\n or result['intraventricular'] > 0 or result['subarachnoid'] > 0 \\\r\n or result['subdural'] > 0:\r\n shutil.move(path + file, '../brain_tiny_dataset_class/hemorrhage/' + file)\r\n else:\r\n shutil.move(path + file, '../brain_tiny_dataset_class/healthy/' + file)\r\n except KeyError:\r\n continue","def JPGtoPNGConverter(source, dest):\n files = os.listdir(f\"./{source}\")\n if not os.path.exists(f\"./{dest}\"):os.makedirs(f\"./{dest}\")\n\n for file in files:\n if os.path.splitext(file)[-1] == \".jpg\":\n img = Image.open(f\"./{source}/{file}\")\n clean_text = os.path.splitext(file)[0]\n img.save(f\"./{dest}/{clean_text}.png\",\"png\")\n else:\n print(f\"Your filename: {file} is not in .JPG format !!\")\n return \"All files converted successfully :) \"","def write_camera_pose_to_file(camera_pose_abs_dict: dict, pose_dir_path: str) -> None:\n image_dst = path.join(pose_dir_path, 'images.txt')\n with open(image_dst, 'w+') as file:\n file.write('# Image list with two lines of data per image:\\n')\n file.write('# IMAGE_ID, QW, QX, QY, QZ, TX, TY, TZ, CAMERA_ID, NAME\\n')\n file.write('# POINTS2D[] as (X, Y, POINT3D_ID)\\n')\n file.write(f'# Number of images: {len(camera_pose_abs_dict.keys())}\\n')\n\n # write each camera pose to file\n for image in camera_pose_abs_dict.keys():\n image_pose_data = []\n t_vector = camera_pose_abs_dict[image][1]\n qx, qy, qz, qw = rotation_matrix_to_quaternion(camera_pose_abs_dict[image][0])\n\n image_pose_data.append(str(image))\n # image_pose_data.append(f'{qw} {qx} {qy} {qz}')\n image_pose_data.append(f'{qz} {qy} {qx} {qw}')\n image_pose_data.append(' '.join(map(str, t_vector)))\n image_pose_data.append('1')\n image_pose_data.append(f'image{image}.jpg')\n\n file.write(' '.join(image_pose_data) + '\\n\\n')","def tempWrite(img):\n\tfilename = \"{}.png\".format(os.getpid())\n\tcv2.imwrite(filename, img)\n\treturn filename","def remove_extra_images(path_to_images: str, number_of_images: int) -> None:\n last_image = 'image' + str(number_of_images) + '.jpg'\n while last_image in listdir(path_to_images):\n last_image_path = path.join(path_to_images, last_image)\n remove(last_image_path)\n print(f\"remove {last_image}\")\n number_of_images += 1\n last_image = 'image' + str(number_of_images) + '.jpg'","def recad_dir(pattern, vmin, vmax, shape, discard_vol=False,\n only_new=True):\n file_list = glob(pattern)\n file_list.sort()\n for file_name in file_list:\n h5_name = os.path.splitext(file_name)[0] + '.h5'\n print file_name\n if only_new:\n if os.path.exists(h5_name):\n print \"already exists\"\n continue\n recad_to_h5_chunk(file_name, vmin, vmax, shape)\n if discard_vol and os.path.exists(h5_name):\n os.remove(file_name)\n os.remove(file_name + '.info')\n os.remove(file_name + '.xml')","def do_2003(in_dir, out_dir):\n\n dir_items = setup_outdir_and_get_input(in_dir, out_dir)\n for idx, item in enumerate(dir_items):\n full_path = in_dir + os.path.sep + item\n print(f\"{item} -> {idx}\")\n create_dirs_and_write_files(full_path, idx, in_dir, item, out_dir)","def order_test_set(path_to_images, path_to_csv, path_to_save_test):\n\n try:\n with open(path_to_csv, 'r') as csvfile:\n reader = csv.reader(csvfile, delimiter = ',')\n\n for i, row in enumerate(reader):\n if i == 0: # continue the first line beacuse of the header line\n continue\n\n img_name = row[-1].replace('Test/', '')\n label = row[-2]\n\n path_to_folder = os.path.join(path_to_save_test, label)\n\n if not os.path.isdir(path_to_folder): # if the dir. not exist\n os.makedirs(path_to_folder) # create the directory\n\n img_full_path = os.path.join(path_to_images, img_name)\n\n print(\"Copying \", img_full_path, \" to \", path_to_folder)\n shutil.copy(img_full_path, path_to_folder)\n\n except:\n print(\"[INFO]: Error reading csv file.\")","def stitch_images(self):\n stitched_folder_name = self.parent_folder + 'stitched'\n print(\"Stitching images in:\")\n print(self.folder_list)\n print(\"Storing in: \" + str(stitched_folder_name))\n\n try:\n print(\"Making dir \" + str(stitched_folder_name) + \" for stitching\")\n os.mkdir(stitched_folder_name)\n except OSError:\n print(\"Folder exists, have you already done this stitching??\")\n return\n\n photo_list = self.get_photo_list(self.parent_folder + '/' + self.folder_list[0])\n # get photo sizes\n print(self.parent_folder + '/' + self.folder_list[0] + '/' + photo_list[0])\n size_photo = cv2.imread(self.parent_folder + '/' + self.folder_list[0] +\n '/' + photo_list[0], cv2.IMREAD_ANYDEPTH)\n photo_height, photo_width = np.shape(size_photo)\n stitched_height = photo_height * 2\n stitched_width = photo_width * 4\n\n for photo in photo_list:\n stitched_photo = np.full((stitched_height, stitched_width), 0)\n\n for i, folder in enumerate(self.folder_list):\n print(i)\n print(folder)\n print(self.parent_folder + folder + '/' + photo)\n\n stitched_photo[(int((float(i) / 4.0)) * photo_height):(int(((float(i) / 4.0) + 1)) * photo_height),\n (int(i % 4) * photo_width):((int((i % 4) + 1)) * photo_width)] \\\n = cv2.imread(self.parent_folder + '/' + folder + '/' + photo, cv2.IMREAD_ANYDEPTH)\n\n stitched_photo = stitched_photo.astype(np.uint16)\n cv2.imwrite(stitched_folder_name + '/' + photo, stitched_photo, [cv2.IMWRITE_PNG_COMPRESSION, 0])\n\n return stitched_folder_name","def test_save_image(self):\n\n from m3_save_images.m3_save_images import save_images\n folder_destination_name = \"unittest-sorted-images\"\n path_source = \"../img\"\n image_name = [\"00ff00.png\", \"aqua.png\", \"black.jpg\", \"yellow.png\", \"red2.jpg\", \"green.jpg\"]\n image_color = [\"Lime\", \"Aqua\", \"Black\", \"Yellow\", \"Red\", \"Green\"]\n # new empty folder is needed for testing save_image() function\n if os.path.isdir(folder_destination_name):\n shutil.rmtree(folder_destination_name)\n os.mkdir(folder_destination_name)\n # creating folders\n for i in range(0, 4):\n save_images(folder_destination_name, path_source, image_name[i], image_color[i])\n self.assertEqual(''.join(os.listdir(os.path.join(folder_destination_name, image_color[i]))), image_name[i])\n save_images(folder_destination_name, path_source, image_name[i], image_color[5])\n self.assertNotEqual(''.join(os.listdir(os.path.join(folder_destination_name, image_color[i]))), image_name[5])","def exporting_cropped_images (fpath_tiff):\n src = rasterio.open(fpath_tiff, 'r')\n outfolder_irregular = '/train/irregular'\n outfolder_healthy = '/train/healthy'\n outfolder_concrete = '/train/concrete'\n outfolder_incomplete = '/train/incomplete'\n outfolder_other = '/train/other'\n outfolder = '/train/batch'\n #os.makedirs (outfolder, exist_ok = True)","def copy_photos(source='.', dest='.'):\n if isdir(source): # if this is a directory,\n for child in listdir(source):\n # compose full path to child\n child = join(source, child)\n if isdir(child):\n copy_photos(child, dest)\n else:\n if guess_type(child)[0] is not None \\\n and (guess_type(child)[0].split('/')[0] == 'image'):\n new = rename(child)\n create_tree(new, dest)","def change_imagens(current_folder, destination_folder, name=\"crosswalk\", qtd=0, dim=(128, 64)):\n\n img_path = [os.path.join(current_folder, file) for file in os.listdir(current_folder)]\n qtd_img = 1\n\n for img in img_path:\n img_name = os.path.split(img)[1].split(\"/\")[0]\n extension = os.path.split(img_name)[1].split(\".\")[0]\n\n new_name = name\n saved_name = new_name + \"_\" + str(qtd_img + qtd)\n print(img_name + \" -> \" + saved_name + \".jpg\")\n\n try:\n saved_folder = destination + \"/\"\n\n # carrega a imagem\n img = Image.open(current_folder + \"/\" + img_name)\n # converte a imagem (PIL) para numpy array\n imgNp = np.array(img,'uint8')\n # redimensionar a imagem\n imgNp = cv2.resize(imgNp, dim)\n\n # Cria a pasta positivas_final e salva as imagens\n pathlib.Path(saved_folder).mkdir(parents=True, exist_ok=True)\n cv2.imwrite(saved_folder + saved_name + \".jpg\", imgNp)\n\n qtd_img += 1\n\n except ValueError:\n print('.')","def makeOutDirs(od):\n if args.format.lower() == 'kitti':\n id = \"%s/images\" % od\n ld = \"%s/labels\" % od\n elif args.format.lower() == 'darknet':\n id = \"%s/images\" % od\n ld = \"%s/annotations\" % od\n else:\n print \"Invalid output format %s!\" % args.format\n usage()\n ensureDir(id)\n ensureDir(ld)\n return id, ld","def split_data(src, dst, ratio=0.2):\n dirs = [f for f in os.listdir(src) if os.path.isdir(os.path.join(src, f)) and not f.startswith('.')]\n for d in dirs:\n src_subdir = os.path.join(src, d)\n dst_subdir = os.path.join(dst, d)\n if not os.path.exists(dst_subdir):\n os.makedirs(dst_subdir)\n imgs = [f for f in os.listdir(src_subdir) if os.path.isfile(os.path.join(src_subdir, f)) and not f.startswith('.')]\n for img in imgs:\n if np.random.uniform() <= ratio:\n move(os.path.join(src_subdir, img), dst_subdir)\n print('split done')","def test_build_export_path_image(clpipe_fmriprep_dir: Path):\n\n # Build the fMRIPrep input image path\n image_name = \"sub-0_task-rest_space-MNI152NLin2009cAsym_desc-preproc_bold.nii.gz\"\n fmriprep_dir = clpipe_fmriprep_dir / \"data_fmriprep\" / \"fmriprep\"\n image_path = fmriprep_dir / \"sub-0\" / \"func\" / image_name\n\n # Build the output path\n subject_out_dir = clpipe_fmriprep_dir / \"data_postproc2\" / \"sub-0\"\n\n # Build full export path\n export_path = build_export_path(image_path, \"0\", fmriprep_dir, subject_out_dir)\n\n assert str(export_path) == str(\n subject_out_dir\n / \"func\"\n / \"sub-0_task-rest_space-MNI152NLin2009cAsym_desc-postproc_bold.nii.gz\"\n )","def cat_files(files, output):\n for file in files:\n with open(file, 'r') as fd:\n shutil.copyfileobj(fd, output)","def cat_files(files, output):\n for file in files:\n with open(file, 'r') as fd:\n shutil.copyfileobj(fd, output)","def extract_write_to_file(self, num_extracted, write_dir, sub_h, sub_w, margin=10):\n\n file_seed = len(os.listdir(write_dir))\n\n for i in range(num_extracted):\n file_num = str(file_seed + i)\n write_path = os.path.join(write_dir, file_num + \".\" + 'jpg')\n\n print('extracting {}/{} images of dimension {}x{}'.format(i, num_extracted, sub_h, sub_w))\n print('writting to location: {}'.format(write_path))\n\n self.extract_single(sub_h, sub_w, write_path)","def save_images(images, save_dir, image_type):\n for image in images:\n raw_img = urllib2.urlopen(image).read()\n count = len([i for i in os.listdir(save_dir) if image_type in i]) + 1\n f = open(save_dir + '/' + image_type + '_' + str(count), 'wb')\n f.write(raw_img)\n f.close()","def path_to_name(img):\n\n return os.path.dirname(img) + '_' + os.path.basename(img)","def convert_all(input: str, out: str):\n dateien = listdir(input)\n for datei in dateien:\n out_datei = datei.replace(\" \", \"_\") # Leertasten durch Unterstriche ersetzen\n convert_image(input + datei, out + out_datei)","def write_img_to_fs(name, data):\n with open(name, \"wb\") as fout:\n fout.write(data)","def normalize_path(img_file):\n\n img_file = img_file.split('/')[-1]\n img_file = 'data/IMG/'+img_file.split('\\\\')[-1]\n return img_file","def crop_and_save_images(source_directory, target_directory):\n haar_cascade = cv.CascadeClassifier('haar_face.xml')\n os.chdir(target_directory)\n file_names = os.listdir(source_directory)\n number_of_images = len(file_names)\n total_number_of_digits = math.floor(math.log10(number_of_images)) + 1\n i = 1\n for filename in file_names:\n image = os.path.join(source_directory, filename)\n print(image)\n cropped_image = crop_face_image(image, haar_cascade)\n try:\n if cropped_image.any() is None:\n print('No face detected, skipping image')\n continue\n except AttributeError:\n print('No face detected, skipping image')\n continue\n current_number_of_digits = math.floor(math.log10(i)) + 1\n number_of_zeros = total_number_of_digits - current_number_of_digits\n print(f'Cropping: {filename}, saving to folder {target_directory}')\n newFilename = 'IMG_' + '0'*number_of_zeros + f'{i}.jpg'\n cv.imwrite(newFilename, cropped_image)\n i += 1","def saveImgs(img, filename=None):\n\tif filename is None:\n\t\tdate = time.strftime(\"%Y%m%d\")\n\t\tfilename = \"T\" + str(date)\n\t\tjpg = \".jpg\"\n\t\tcount = 0\n\t\tfor item in img:\n\t\t\tname = filename + str(count) + jpg\n\t\t\tcv2.imwrite(name, item)\n\t\t\tcount += 1\n\telse:\n\t\tfor i in range(0, len(img)):\n\t\t\tcv2.imwrite(filename[i], img[i])"],"string":"[\n \"def create_train(train_img_path):\\n\\n f = open(\\\"train.txt\\\", \\\"w+\\\")\\n for subdirs, dirs, files in os.walk(train_img_path):\\n for filename in files:\\n if filename.endswith(\\\".jpg\\\"):\\n train_image_path = os.path.join(train_img_path, filename)\\n print(train_image_path)\\n f.write(train_image_path + \\\"\\\\n\\\")\\n f.close()\",\n \"def save_step_2(imgs, match_list, output_path=\\\"./output/step2\\\"):\\n # ... your code here ...\\n for i in range(len(imgs)):\\n name1,tail1 = str.split(filenames[match_list[i][0]],\\\".\\\")\\n name2,tail2 = str.split(filenames[match_list[i][2]],\\\".\\\")\\n cv2.imwrite(output_path+\\\"/\\\"+name1+\\\"_\\\"+str(match_list[i][1])+\\\"_\\\"+name2+\\\"_\\\"+str(match_list[i][3])+\\\"_\\\"+str(match_list[i][4])+\\\".jpg\\\", imgs[i])\",\n \"def prep(path,date,image):\\n \\n # run bash code with 'Popen'\\n P = Popen('cp '+path+date+'/final/'+image+' ./', shell=True)\\n P.wait()\\n P = Popen('mv '+image+' '+image+'.fz', shell=True)\\n P.wait()\\n P = Popen('funpack *.fz', shell=True)\\n P.wait()\\n P = Popen('rm -rf *.fz', shell=True)\\n P.wait()\",\n \"def appendpics(pathofimg, w_sub, h_sub, step):\\n num = 0\\n dirlist = []\\n images = [] # images in each folder\\n for root, dirs, fileswer in os.walk(pathofimg):\\n if len(dirs)!= 0:\\n for dir in dirs:\\n dirlist.append(dir)\\n for rooert, dirwerwes, files in os.walk(pathofimg+'/'+dir):\\n for file in files:\\n if(file.endswith('.png')):\\n images.append(Image.open(pathofimg+'/'+dir+'/'+file))\\n if(len(images)==81):\\n break\\n target = montage(images, w_sub, h_sub, step)\\n target.save(pathofimg +'/'+ dir + '.png', quality=100)\\n else:\\n dir = 'Generated'\\n for file in fileswer:\\n if (file.endswith('.png')):\\n images.append(Image.open(pathofimg +'/'+ file))\\n target1 = montage(images, w_sub, h_sub, step)\\n savepath = pathofimg +'/'+ 'generated'\\n os.makedirs(savepath)\\n target1.save(savepath +'/'+ dir + '.png', quality=100)\",\n \"def create_val(val_img_path):\\n\\n f = open(\\\"val.txt\\\", \\\"w+\\\")\\n for subdirs, dirs, files in os.walk(val_img_path):\\n for filename in files:\\n if filename.endswith(\\\".jpg\\\"):\\n val_image_path = os.path.join(val_img_path, filename)\\n print(val_image_path)\\n f.write(val_image_path + \\\"\\\\n\\\")\\n f.close()\",\n \"def seperate_dog_cat(src, dst):\\n imgs = [f for f in os.listdir(src) if os.path.isfile(os.path.join(src, f)) and not f.startswith('.')]\\n \\n dst_dog = os.path.join(dst, 'dog')\\n dst_cat = os.path.join(dst, 'cat')\\n if not os.path.exists(dst_dog):\\n os.makedirs(dst_dog)\\n if not os.path.exists(dst_cat):\\n os.makedirs(dst_cat)\\n \\n for img in imgs:\\n if 'dog' in img:\\n move(os.path.join(src, img), dst_dog)\\n if 'cat' in img:\\n move(os.path.join(src, img), dst_cat)\\n print('seperate done')\",\n \"def preprocess_images(file_path, new_file_path):\\n if not os.path.isdir(new_file_path):\\n os.mkdir(new_file_path)\\n i = 0\\n for dir in listdir(file_path):\\n j = 0\\n for image_path in listdir(file_path + '/' + dir):\\n image = open_image(image_path)\\n cv2.imwrite(file_path + '/' + image_path + '/' str(i) + '/' +str(i) + '.jpg', image)\\n j += 1\\n i += 1\",\n \"def prepare_output_dir(out_dir, test_dir):\\r\\n\\r\\n if not out_dir.exists():\\r\\n out_dir.mkdir()\\r\\n\\r\\n # get the necessary file names\\r\\n file_names = get_file_names(test_dir, args.distance, print_file_names=False)\\r\\n\\r\\n # copy the images in the firstIms into the output folder\\r\\n for name in file_names[1][0]:\\r\\n file_path = Path(test_dir / name)\\r\\n copy_to = Path(out_dir / name)\\r\\n shutil.copy(file_path, copy_to)\\r\\n\\r\\n # the firstIms list does not contain the last image,\\r\\n # so we need to also copy the last image of the secIms into the output folder\\r\\n last_im = file_names[1][1][-1]\\r\\n shutil.copy(Path(test_dir/last_im), Path(out_dir/last_im))\\r\\n\\r\\n return file_names\",\n \"def save_step_1(imgs, output_path='./output/step1'):\\n # ... your code here ...\\n i=0\\n for each in imgs:\\n i+=1\\n cv2.imwrite(output_path+\\\"/output\\\"+str(i)+\\\".jpg\\\", each)\",\n \"def imgWrite(img, path):\\n dirMake(os.path.dirname(path))\\n sitk.WriteImage(img, path)\\n\\n # Reformat files to be compatible with CIS Software\\n #ext = os.path.splitext(path)[1].lower()\\n #if ext == \\\".vtk\\\": vtkReformat(path, path)\",\n \"def save_step_3(img_pairs, match_list, output_path=\\\"./output/step3\\\"):\\n # ... your code here ...\\n for i in range(len(img_pairs)):\\n name1,tail1 = str.split(filenames[match_list[i][0]],\\\".\\\")\\n name2,tail2 = str.split(filenames[match_list[i][1]],\\\".\\\")\\n cv2.imwrite(output_path+\\\"/\\\"+name1+\\\"_\\\"+name2+\\\".jpg\\\", img_pairs[i][0])\\n cv2.imwrite(output_path+\\\"/\\\"+name2+\\\"_\\\"+name1+\\\".jpg\\\", img_pairs[i][1])\",\n \"def write(img, path):\\n create_directories_for_file_name(path)\\n writer = sitk.ImageFileWriter()\\n writer.Execute(img, path, True)\",\n \"def write_image_to_file_incrementally(image):\\r\\n i = 0\\r\\n while os.path.exists(\\\"sample%s.jpeg\\\" % i):\\r\\n i += 1\\r\\n with open(\\\"sample%s.jpeg\\\" % i, \\\"wb\\\") as f:\\r\\n f.write(image)\",\n \"def createAllImageFiles(poly, name) :\\n \\n for i in range(len(poly.getPaths())):\\n fileName = name + \\\"_\\\" + str(i) + \\\".dot\\\"\\n imgName = name + \\\"_\\\" + str(i) + \\\".jpg\\\"\\n \\n Command = \\\"neato -Tjpeg \\\" + fileName + \\\" -o \\\" + imgName\\n run(Command, shell=True)\",\n \"def create_full(dirpath, imgname):\\n with open(join(dirpath, imgname), 'r+b') as f:\\n with Image.open(f) as image:\\n fullpicpath = join(outdir, fullpicdir, imgname)\\n print(\\\"saving full pic to\\\", fullpicpath)\\n image.save(fullpicpath, quality=75, optimize=True)\",\n \"def save_step_4(imgs, output_path=\\\"./output/step4\\\"):\\n # ... your code here ...\\n cv2.imwrite(output_path+\\\"/output.jpg\\\", imgs)\",\n \"def copy_database(path_images, path_labels, path_final_images):\\n\\n try:\\n labels = sorted(os.listdir(path_labels))\\n except FileNotFoudError:\\n print(\\\"No such file or directory \\\", path_labels)\\n\\n try:\\n images = sorted(os.listdir(path_images)) #+ \\\"RetinaNet_I04590/\\\"))\\n except FileNotFoudError:\\n print(\\\"No such file or directory \\\", path_images)\\n\\n \\\"\\\"\\\"if not os.path.exists(path_final_images + \\\"I04590/\\\"):\\n os.mkdir(path_final_images + \\\"I04590/\\\")\\n\\n if not os.path.exists(path_final_images + \\\"I045135/\\\"):\\n os.mkdir(path_final_images + \\\"I045135/\\\")\\n\\n if not os.path.exists(path_final_images + \\\"I090135/\\\"):\\n os.mkdir(path_final_images + \\\"I090135/\\\")\\n\\n if not os.path.exists(path_final_images + \\\"I4590135/\\\"):\\n os.mkdir(path_final_images + \\\"I4590135/\\\")\\n\\n if not os.path.exists(path_final_images + \\\"Params/\\\"):\\n os.mkdir(path_final_images + \\\"Params/\\\")\\n\\n if not os.path.exists(path_final_images + \\\"Pauli2/\\\"):\\n os.mkdir(path_final_images + \\\"Pauli2/\\\")\\n\\n if not os.path.exists(path_final_images + \\\"Pauli3/\\\"):\\n os.mkdir(path_final_images + \\\"Pauli3/\\\")\\n\\n if not os.path.exists(path_final_images + \\\"Stokes/\\\"):\\n os.mkdir(path_final_images + \\\"Stokes/\\\")\\n\\n if not os.path.exists(path_final_images + \\\"Rachel/\\\"):\\n os.mkdir(path_final_images + \\\"Rachel/\\\")\\n\\n if not os.path.exists(path_final_images + \\\"Rachel2/\\\"):\\n os.mkdir(path_final_images + \\\"Rachel2/\\\")\\\"\\\"\\\"\\n\\n for k in range(len(images)):\\n if str(k) + \\\".xml\\\" in labels:\\n copyfile(path_images + \\\"/\\\" + images[k],\\n path_final_images + \\\"/\\\" + images[k])\\n \\\"\\\"\\\"copyfile(path_images + \\\"RetinaNet_I04590/\\\" + str(k) + \\\".png\\\",\\n path_final_images + \\\"I04590/\\\" + str(k) + \\\".png\\\")\\n copyfile(path_images + \\\"RetinaNet_I045135/\\\" + str(k) + \\\".png\\\",\\n path_final_images + \\\"I045135/\\\" + str(k) + \\\".png\\\")\\n copyfile(path_images + \\\"RetinaNet_I090135/\\\" + str(k) + \\\".png\\\",\\n path_final_images + \\\"I090135/\\\" + str(k) + \\\".png\\\")\\n copyfile(path_images + \\\"RetinaNet_I4590135/\\\" + str(k) + \\\".png\\\",\\n path_final_images + \\\"I4590135/\\\" + str(k) + \\\".png\\\")\\n copyfile(path_images + \\\"RetinaNet_Params/\\\" + str(k) + \\\".png\\\",\\n path_final_images + \\\"Params/\\\" + str(k) + \\\".png\\\")\\n copyfile(path_images + \\\"RetinaNet_Pauli2/\\\" + str(k) + \\\".png\\\",\\n path_final_images + \\\"Pauli2/\\\" + str(k) + \\\".png\\\")\\n copyfile(path_images + \\\"RetinaNet_Pauli3/\\\" + str(k) + \\\".png\\\",\\n path_final_images + \\\"Pauli3/\\\" + str(k) + \\\".png\\\")\\n copyfile(path_images + \\\"RetinaNet_Stokes/\\\" + str(k) + \\\".png\\\",\\n path_final_images + \\\"Stokes/\\\" + str(k) + \\\".png\\\")\\n copyfile(path_images + \\\"RetinaNet_Rachel/\\\" + str(k) + \\\".png\\\",\\n path_final_images + \\\"Rachel/\\\" + str(k) + \\\".png\\\")\\n copyfile(path_images + \\\"RetinaNet_Rachel2/\\\" + str(k) + \\\".png\\\",\\n path_final_images + \\\"Rachel2/\\\" + str(k) + \\\".png\\\")\\n copyfile(path_labels + str(k) + \\\".xml\\\",\\n path_final_labels + str(k) + \\\".xml\\\")\\\"\\\"\\\"\\n print(k)\",\n \"def _crop_write_image(self, inroot, images, outroot):\\n for image in images:\\n inimage_path = osp.join(inroot, image)\\n cvimg = cv2.imread(inimage_path)\\n cvimg = cvimg[60:-30, 25:-25]\\n h, w, _ = cvimg.shape\\n assert h == w == 128\\n outimage_path = osp.join(outroot, image)\\n cv2.imwrite(outimage_path, cvimg)\\n print(outimage_path)\",\n \"def update_destination_file_name (file_name):\\n\\tglobal COUNTER \\n\\tCOUNTER += 1\\n\\tsplitted = file_name.split('/')\\n\\treturn file_name[:len(file_name)-len(splitted[-1])] + 'Image%05d' % COUNTER +'_'+splitted[-1]\",\n \"def jarvis(input_path, output_path): \\n\\n if not os.path.exists(f'{output_path}'):\\n os.makedirs(f'{output_path}')\\n\\n file_list = [filename for filename in os.listdir(f'{input_path}') if '.tif' in filename]\\n\\n for filename in file_list:\\n pathname = os.path.join(input_path, filename)\\n new_name = f\\\"{output_path}{filename.replace('.lif - ', '_').replace('_5x-', '_')}\\\"\\n copyfile(pathname, new_name)\\n logger.info(f'{new_name}')\",\n \"def create_intermediate_files():\\n\\n dirs = (DIR_PAGE, DIR_SRGB, DIR_VTI, DIR_TIFF,\\n DIR_BACK, DIR_TEXT, DIR_FINAL)\\n \\n for dir in dirs:\\n try:\\n os.mkdir(os.path.join(cwd, dir))\\n except OSError, e:\\n print 'directory (', dir, ') already exists'\",\n \"def group_image(directory, image, group):\\r\\n\\tif os.path.exists(directory + \\\"\\\\\\\\\\\" + group):\\r\\n\\t\\tpass\\r\\n\\telse:\\r\\n\\t\\ttry:\\r\\n\\t\\t\\tos.mkdir(directory + '\\\\\\\\' + group)\\r\\n\\t\\t\\tprint(\\\"Successfully created directory\\\", group)\\r\\n\\t\\texcept OSError:\\r\\n\\t\\t\\tprint(\\\"Creation of directory failed.\\\")\\r\\n\\ttry:\\r\\n\\t\\tshutil.copy(str(directory + '\\\\\\\\' + image), str(directory + \\\"\\\\\\\\\\\" + group + \\\"\\\\\\\\\\\" + image))\\r\\n\\texcept OSError as OSe:\\r\\n\\t\\tprint(OSe)\",\n \"def move_images_and_list(path, final_path):\\n #Lists all created folders\\n directories = os.listdir(path)\\n #Array that stores the path to each image\\n lists = []\\n #This variable will be used to give a unique name to each image\\n tot_images = 0\\n #Creates the path where will be stored all files\\n if not os.path.exists(final_path):\\n os.mkdir(final_path)\\n #Iterates over each folder\\n for ph in directories:\\n #Iterates over each line of the generated file images.lst\\n for img in open(os.path.join(path, ph, \\\"images.lst\\\")).readlines():\\n \\\"\\\"\\\"Images are stored with a name, how many objects have and\\n where it is, like this '01_0252_0067_0139_0222.jpg 1 252 67 139 222'\\n so these five lines under changes the first part before '_', because\\n in some cases, the command opencv_createsamples creates a same name\\n to different positive images, this ensures a different name to each\\n image\\\"\\\"\\\"\\n split_space = img.split()\\n split_underscore = split_space[0].split(\\\"_\\\")\\n split_underscore[0] = str(tot_images)\\n join_underscore = \\\"_\\\".join(split_underscore)\\n join_space = \\\" \\\".join([join_underscore, *split_space[1:]])\\n #Appends the new image's name to the list\\n lists.append(join_space)\\n #Moves each image in the folder to the final path, with a new name\\n move(os.path.join(path, ph, split_space[0]),\\n os.path.join(final_path, join_space.split()[0]))\\n tot_images += 1\\n #Writes a file withe the name of all images in the folder\\n with open(os.path.join(final_path, \\\"images.lst\\\"), \\\"w+\\\") as f:\\n for i in lists:\\n f.write(\\\"\\\".join([i, '\\\\n']))\\n #Removes the temporary path\\n rmtree(os.path.abspath(path))\\n #Name of the created file\\n return \\\"images.lst\\\"\",\n \"def make_diff(file_before, file_after, file_output_name):\\n if os.path.exists(file_output_name):\\n shutil.rmtree(file_output_name)\\n os.mkdir(file_output_name)\\n psd_diff = diff(file_before, file_after)\\n diff_content = {}\\n for attr in [\\\"header\\\", \\\"layer\\\"]:\\n diff_content[attr] = getattr(psd_diff, attr)\\n with open(os.path.join(file_output_name, \\\"diff.json\\\"), \\\"w\\\") as diff_file:\\n json.dump(diff_content, diff_file, indent=4)\\n saved_files = []\\n for layer_id in psd_diff.layer.keys():\\n if len(psd_diff.layer_image[layer_id]) > 1:\\n output_image = os.path.join(file_output_name, layer_id)\\n psd_diff.layer_image[layer_id][\\\"before\\\"].save(output_image + \\\".before.png\\\")\\n psd_diff.layer_image[layer_id][\\\"after\\\"].save(output_image + \\\".after.png\\\")\\n diff_image_before = Image.new(\\\"RGBA\\\", psd_diff.layer_image[layer_id][\\\"before\\\"].size)\\n diff_image_before_data = diff_image_before.load()\\n diff_image_after = Image.new(\\\"RGBA\\\", psd_diff.layer_image[layer_id][\\\"after\\\"].size)\\n diff_image_after_data = diff_image_after.load()\\n width, height = diff_image_before.size\\n pixel_index = 1\\n for y in xrange(height):\\n for x in xrange(width):\\n if str(pixel_index) in diff_content[\\\"layer\\\"][layer_id][\\\"pixel\\\"]:\\n diff_image_before_data[x, y] = tuple(diff_content[\\\"layer\\\"][layer_id][\\\"pixel\\\"][str(pixel_index)][\\\"before\\\"])\\n diff_image_after_data[x, y] = tuple(diff_content[\\\"layer\\\"][layer_id][\\\"pixel\\\"][str(pixel_index)][\\\"after\\\"])\\n else:\\n diff_image_before_data[x, y] = (0, 0, 0, 0)\\n diff_image_after_data[x, y] = (0, 0, 0, 0)\\n pixel_index += 1\\n diff_image_before.save(output_image + \\\".before.diff.png\\\", \\\"PNG\\\")\\n diff_image_after.save(output_image + \\\".after.diff.png\\\", \\\"PNG\\\")\\n saved_files.append(output_image + \\\".before.png\\\")\\n saved_files.append(output_image + \\\".before.diff.png\\\")\\n saved_files.append(output_image + \\\".after.diff.png\\\")\\n saved_files.append(output_image + \\\".after.png\\\")\\n saved_files.append(file_output_name + \\\"/diff.json\\\")\\n return saved_files\",\n \"def handle_image(name):\\n from_path = args.from_dir + name\\n to_path = args.to_dir + name\\n\\n if width != args.width:\\n subprocess.call('jpegtran -rotate 90 -grayscale ' + from_path + ' > ' \\\\\\n + to_path, shell=True)\\n else:\\n subprocess.call('jpegtran -grayscale ' + from_path + ' > ' + to_path,\\\\\\n shell=True)\",\n \"def set_image_out_path(self, image_path):\\n i = image_path.rfind('/')\\n self.image_out_path = image_path[:i+1] + \\\"out/\\\" + image_path[i+1:]\",\n \"def output_diff_local_files(gold_session, image_name):\\n given_file = gold_session.GetGivenImageLink(image_name)\\n closest_file = gold_session.GetClosestImageLink(image_name)\\n diff_file = gold_session.GetDiffImageLink(image_name)\\n failure_message = 'Unable to retrieve link'\\n logging.error('Generated image: %s', given_file or failure_message)\\n logging.error('Closest image: %s', closest_file or failure_message)\\n logging.error('Diff image: %s', diff_file or failure_message)\",\n \"def merge_folders():\\r\\n from shutil import copyfile\\r\\n # Merge all folders into main folder\\r\\n grp_img_dir = os.listdir('Group_Test_Images')\\r\\n \\r\\n for grp_img_folder in grp_img_dir:\\r\\n image_folders = os.listdir('Group_Test_Images'+'/'+grp_img_folder)\\r\\n \\r\\n for img_label in image_folders:\\r\\n new_directory = 'Group_Test_Images'+'/'+img_label\\r\\n \\r\\n try:\\r\\n os.makedirs(new_directory)\\r\\n except FileExistsError:\\r\\n # directory already exists\\r\\n pass\\r\\n \\r\\n file_names = os.listdir('Group_Test_Images'+'/'+grp_img_folder+'/'+img_label)\\r\\n \\r\\n for file in file_names:\\r\\n copyfile('Group_Test_Images'+'/'+grp_img_folder+'/'+img_label+'/'+file, new_directory+'/'+file)\",\n \"def create_output_directory_for_resized_images():\\n\\n try:\\n if not os.path.isdir(RESIZED_NEGATIVE_PATH):\\n return os.makedirs(RESIZED_NEGATIVE_PATH)\\n elif not os.path.isdir(RESIZED_POSITIVE_PATH):\\n return os.makedirs(RESIZED_POSITIVE_PATH)\\n except OSError as e:\\n print('Error --> {}'.format(e))\",\n \"def moveFiles(rootDir):\\n\\n homedir = os.environ['HOME']\\n albumDirec = 'AlbumCoverImages'\\n #Check if a directory exists\\n if not os.path.isdir(os.path.join(homedir, 'Pictures', albumDirec)):\\n print('AlbumCoverImages not found, trying to make...')\\n os.makedirs(os.path.join(homedir, 'Pictures', albumDirec))\\n \\n for root, dirs, files in os.walk(rootDir, topdown=False):\\n #print('testtest')\\n for name in files:\\n \\n\\n #Find image files, and move them to albumCoverImages\\n #For some bullshit reason or statments won't work here, have to\\n # parse this out to elif statements, ughhhh...\\n \\n if '.jpg' in name:\\n os.rename(os.path.join(root, name), os.path.join(homedir, 'Pictures', albumDirec, name))\\n print('{0} moved to {1}!'.format(name, os.path.join(homedir, 'Pictures', albumDirec)))\\n \\n elif '.png' in name:\\n os.rename(os.path.join(root, name), os.path.join(homedir, 'Pictures', albumDirec, name))\\n print('{0} moved to {1}!'.format(name, os.path.join(homedir, 'Pictures', albumDirec, name)))\\n \\n elif '.gif' in name:\\n os.rename(os.path.join(root, name), os.path.join(homedir, 'Pictures', albumDirec, name))\\n print('{0} moved to {1}!'.format(name, os.path.join(homedir, 'Pictures', albumDirec, name)))\\n \\n elif '.pdf' in name:\\n os.rename(os.path.join(root, name), os.path.join(homedir, 'Pictures', albumDirec, name))\\n print('{0} moved to {1}!'.format(name, os.path.join(homedir, 'Pictures', albumDirec, name)))\\n\\n else:\\n try:\\n #Use tinytag to get file metadata\\n tag = TinyTag.get(os.path.join(root, name))\\n artistName = tag.artist\\n albumName = tag.album\\n \\n #TODO: Need to add more conditions\\n if isinstance(artistName, str):\\n artistName = artistName.replace('/', '_')\\n\\n elif isinstance(albumName, str):\\n albumName.replace('/', '_')\\n \\n\\n #Check if the artists directory exists, if not make it\\n try:\\n if not os.path.isdir(os.path.join(rootDir, artistName)):\\n os.makedirs(os.path.join(rootDir, artistName))\\n print('{0} directory made!'.format(artistName))\\n \\n except ValueError:\\n print('ValueError with {0}'.format(root+'/'+name))\\n continue\\n\\n except TypeError:\\n print('TypeError with {0}'.format(root+'/'+name))\\n continue\\n\\n #Check if the songs album exists, if not make it\\n try:\\n if not os.path.isdir(os.path.join(rootDir, artistName, albumName)):\\n os.makedirs(os.path.join(rootDir, artistName, albumName))\\n print('{0} directory made!'.format(albumName))\\n \\n except TypeError:\\n print('TypeError with {0}! Look at album directory making.'.format(root+'/'+name))\\n continue\\n\\n #TODO: Check if album is in artist direc, if not, move it\\n\\n #Check if song is in album, if not move it \\n try:\\n if os.path.isfile(os.path.join(rootDir, artistName, albumName, name)) == False:\\n os.rename(os.path.join(root, name), os.path.join(rootDir, artistName, albumName, name))\\n print('{0} moved to {1}!'.format(name, albumName))\\n \\n except TypeError:\\n print('TypeError with file {0}! Look at line song moving'.format(root+'/'+name))\\n continue\\n \\n #TODO: Check if this part works\\n except LookupError:\\n if (\\\".jpg\\\") or (\\\".png\\\") or (\\\".7z\\\") or (\\\"README\\\") or (\\\".zip\\\") in name:\\n continue\\n \\n else:\\n print('No reader support for {0}'.format(name))\\n continue\",\n \"def test_warp():\\n image_path = \\\"./data/test/nifti/unit_test/moving_image.nii.gz\\\"\\n ddf_path = \\\"./data/test/nifti/unit_test/ddf.nii.gz\\\"\\n\\n # custom output path with correct suffix\\n out_path = \\\"logs/test_warp/out.nii.gz\\\"\\n warp(image_path=image_path, ddf_path=ddf_path, out_path=out_path)\\n assert os.path.isfile(out_path)\\n shutil.rmtree(os.path.dirname(out_path))\\n\\n # custom output path without correct suffix\\n out_path = \\\"logs/test_warp/out.h5\\\"\\n warp(image_path=image_path, ddf_path=ddf_path, out_path=out_path)\\n out_path = \\\"logs/test_warp/warped.nii.gz\\\"\\n assert os.path.isfile(out_path)\\n shutil.rmtree(os.path.dirname(out_path))\\n\\n # custom output path without correct suffix\\n out_path = \\\"logs/test_warp/\\\"\\n warp(image_path=image_path, ddf_path=ddf_path, out_path=out_path)\\n out_path = \\\"logs/test_warp/warped.nii.gz\\\"\\n assert os.path.isfile(out_path)\\n shutil.rmtree(os.path.dirname(out_path))\\n\\n # custom output path without correct suffix\\n out_path = \\\"logs/test_warp\\\"\\n warp(image_path=image_path, ddf_path=ddf_path, out_path=out_path)\\n out_path = \\\"logs/warped.nii.gz\\\"\\n assert os.path.isfile(out_path)\\n shutil.rmtree(os.path.dirname(out_path))\\n\\n # custom output path\\n out_path = \\\"warped.nii.gz\\\"\\n warp(image_path=image_path, ddf_path=ddf_path, out_path=\\\"\\\")\\n assert os.path.isfile(out_path)\\n os.remove(out_path)\",\n \"async def save_url_images(images):\\n for source, image in images:\\n name = source.split('/')[-1]\\n async with aiofiles.open(f'{OUTPUT_FOLDER}/{name}', 'wb') as f:\\n await f.write(image)\",\n \"def make_image_dir(to_path, filenames):\\n image_dir = os.path.join(to_path, \\\"image_2\\\")\\n os.makedirs(image_dir)\\n for f in filenames:\\n image_file = os.path.join(image_dir, f + \\\".png\\\")\\n os.system(\\\"cp sample.png {}\\\".format(image_file))\",\n \"def output_files(filepath):\\n\\n infile = open(filepath, 'r')\\n lines = infile.readlines()\\n\\n rel_path = './'\\n rel_path += lines[6][lines[6].find(':')+1:].strip()\\n rel_path += lines[7][lines[7].find(':')+1:].strip()\\n\\n filename_I1 = lines[9][lines[9].find(':')+1:].strip()\\n filename_I2 = lines[10][lines[10].find(':')+1:].strip()\\n filename_IW = lines[12][lines[12].find(':')+1:].strip()\\n filename_WE = lines[13][lines[13].find(':')+1:].strip()\\n filename_CFLx = lines[15][lines[15].find(':')+1:].strip()\\n filename_CFLv = lines[16][lines[16].find(':')+1:].strip()\\n filename_S = lines[18][lines[18].find(':')+1:].strip()\\n\\n filepath_I1 = rel_path + filename_I1\\n filepath_I2 = rel_path + filename_I2\\n filepath_IW = rel_path + filename_IW\\n filepath_WE = rel_path + filename_WE\\n # filepath_CFLx = rel_path + filename_CFLx\\n # filepath_CFLv = rel_path + filename_CFLv\\n filepath_S = rel_path + filename_S\\n\\n outfile_I1 = open(filepath_I1, 'w')\\n outfile_I2 = open(filepath_I2, 'w')\\n outfile_IW = open(filepath_IW, 'w')\\n outfile_WE = open(filepath_WE, 'w')\\n # outfile_CFLx = open(filepath_CFLx, 'w')\\n # outfile_CFLv = open(filepath_CFLv, 'w')\\n outfile_S = open(filepath_S, 'w')\\n\\n outfiles = dict(I1 = outfile_I1,\\n I2 = outfile_I2,\\n IW = outfile_IW,\\n WE = outfile_WE,\\n # CFLx = outfile_CFLx,\\n # CFLv = outfile_CFLv,\\n S = outfile_S)\\n\\n return outfiles\",\n \"def output_files(filepath):\\n\\n infile = open(filepath, 'r')\\n lines = infile.readlines()\\n\\n rel_path = './'\\n rel_path += lines[6][lines[6].find(':')+1:].strip()\\n rel_path += lines[7][lines[7].find(':')+1:].strip()\\n\\n filename_I1 = lines[9][lines[9].find(':')+1:].strip()\\n filename_I2 = lines[10][lines[10].find(':')+1:].strip()\\n filename_IW = lines[12][lines[12].find(':')+1:].strip()\\n filename_WE = lines[13][lines[13].find(':')+1:].strip()\\n filename_CFLx = lines[15][lines[15].find(':')+1:].strip()\\n filename_CFLv = lines[16][lines[16].find(':')+1:].strip()\\n filename_S = lines[18][lines[18].find(':')+1:].strip()\\n\\n filepath_I1 = rel_path + filename_I1\\n filepath_I2 = rel_path + filename_I2\\n filepath_IW = rel_path + filename_IW\\n filepath_WE = rel_path + filename_WE\\n # filepath_CFLx = rel_path + filename_CFLx\\n # filepath_CFLv = rel_path + filename_CFLv\\n filepath_S = rel_path + filename_S\\n\\n outfile_I1 = open(filepath_I1, 'w')\\n outfile_I2 = open(filepath_I2, 'w')\\n outfile_IW = open(filepath_IW, 'w')\\n outfile_WE = open(filepath_WE, 'w')\\n # outfile_CFLx = open(filepath_CFLx, 'w')\\n # outfile_CFLv = open(filepath_CFLv, 'w')\\n outfile_S = open(filepath_S, 'w')\\n\\n outfiles = dict(I1 = outfile_I1,\\n I2 = outfile_I2,\\n IW = outfile_IW,\\n WE = outfile_WE,\\n # CFLx = outfile_CFLx,\\n # CFLv = outfile_CFLv,\\n S = outfile_S)\\n\\n return outfiles\",\n \"def writeList(image, file, path):\\n homepath = os.getcwd()\\n\\n os.chdir(path)\\n\\n image = image.rstrip('.fits')\\n\\n if os.path.exists(file):\\n filelist = open(file, 'r').readlines()\\n if image+'\\\\n' in filelist or not filelist:\\n f = open(file, 'w')\\n f.write(image+'\\\\n')\\n else:\\n f = open(file, 'a')\\n f.write(image+'\\\\n')\\n else:\\n f = open(file, 'a')\\n f.write(image+'\\\\n')\\n f.close()\\n os.chdir(homepath)\\n\\n return\",\n \"def _temp_analyze_files(tmpdir):\\n img_dir = tmpdir.mkdir(\\\"img\\\")\\n orig_img = img_dir.join(\\\"orig.img\\\")\\n orig_hdr = img_dir.join(\\\"orig.hdr\\\")\\n orig_img.open(\\\"w\\\")\\n orig_hdr.open(\\\"w\\\")\\n return orig_img.strpath, orig_hdr.strpath\",\n \"def crop_and_save(gray, faces):\\r\\n count = 0\\r\\n for (x, y, w, h) in faces:\\r\\n name = int(time.time())\\r\\n name = str(name)\\r\\n while os.path.isfile(\\\"temp/\\\" + name + \\\".png\\\"):\\r\\n count += 1\\r\\n name = name + \\\"+\\\" + str(count)\\r\\n cv2.imwrite(os.path.join(\\\"temp/\\\" + name + \\\".png\\\"), gray[y:y + h, x:x + w])\",\n \"def imageSaveOutput(image,name,number):\\n FileName = name +\\\" \\\"+number\\n mpimg.imsave(\\\"test_images_output\\\"+'//'+FileName,image)\\n return 0;\",\n \"def save_unique_image():\\r\\n global folder_name\\r\\n filelist = [file for file in os.listdir('temp') if file.endswith('.png')]\\r\\n\\r\\n if filelist:\\r\\n for image_path in filelist:\\r\\n found = 0\\r\\n img_to_del = Image.open(\\\"temp/\\\" + image_path)\\r\\n if not get_immediate_subdirectories():\\r\\n found = 1\\r\\n os.makedirs('detected_faces/1/')\\r\\n img_to_del.save('detected_faces/1/'+ image_path)\\r\\n os.remove(os.path.join(temp_path, image_path))\\r\\n folder_name = 1\\r\\n else:\\r\\n for folder in get_immediate_subdirectories():\\r\\n folder_filelist = [file for file in os.listdir(\\\"detected_faces/\\\" + folder) if\\r\\n file.endswith('.png')]\\r\\n count = len(folder_filelist)\\r\\n file = folder_filelist[0]\\r\\n img_to_compare = Image.open(\\\"detected_faces/\\\" + folder + \\\"/\\\" + file)\\r\\n if img_to_del.size > img_to_compare.size:\\r\\n temp_image_resized = img_to_del.resize(img_to_compare.size, Image.ANTIALIAS)\\r\\n index = get_ssim(temp_image_resized, img_to_compare)\\r\\n elif img_to_del.size < img_to_compare.size:\\r\\n img_to_compare = img_to_compare.resize(img_to_del.size, Image.ANTIALIAS)\\r\\n index = get_ssim(img_to_del, img_to_compare)\\r\\n else:\\r\\n index = get_ssim(img_to_del, img_to_compare)\\r\\n if index > min_ssim_index_val:\\r\\n found = 1\\r\\n if count < 5:\\r\\n img_to_del.save(pathname + \\\"/\\\" + folder + \\\"/\\\" + image_path)\\r\\n print image_path\\r\\n if os.path.isfile(os.path.join(temp_path, image_path)):\\r\\n os.remove(os.path.join(temp_path, image_path))\\r\\n if found == 0:\\r\\n folder_name += 1\\r\\n os.makedirs('detected_faces/' + str(folder_name))\\r\\n img_to_del.save(pathname + \\\"/\\\" + str(folder_name) + \\\"/\\\" + image_path)\\r\\n if os.path.isfile(os.path.join(temp_path, image_path)):\\r\\n os.remove(os.path.join(temp_path, image_path))\",\n \"def determine_output_ending():\\n file_found = False\\n idx = 1\\n while not file_found:\\n if not os.path.isfile(LOG_DIR + \\\"/output%04d.png\\\" % (idx)):\\n return \\\"%04d\\\" % (idx)\\n idx += 1\",\n \"def write_output_data_to_disk(\\n output_data_dict,\\n output_directory=\\\"./\\\",\\n output_file_suffix=\\\".nii.gz\\\",\\n overwrite_existing_files=False,\\n):\\n if output_data_dict is None:\\n return\\n\\n filename_fields = [i for i in output_data_dict.keys() if i != \\\"parent_sorting_data\\\"]\\n parent_sorting_data = output_data_dict[\\\"parent_sorting_data\\\"]\\n\\n files_written = {}\\n\\n \\\"\\\"\\\"\\n Write the the converted images to disk\\n\\n ! CONSIDER\\n We could simply write as we go?\\n Pro: save memory, important if processing very large files\\n Con: Reading as we go allows proper indexing\\n\\n \\\"\\\"\\\"\\n\\n for field in filename_fields:\\n logger.info(\\\" Writing files for field: %s\\\", field)\\n p = pathlib.Path(output_directory) / parent_sorting_data / field\\n p.mkdir(parents=True, exist_ok=True)\\n files_written[field] = []\\n\\n for field_filename_base, field_list in output_data_dict[field].items():\\n # Check if there is a list of images with matching names\\n # This will depend on the name format chosen\\n # If there is a list, we append an index as we write to disk\\n\\n if isinstance(field_list, (tuple, list)):\\n # Flatten\\n field_list_flat = list(flatten(field_list))\\n\\n # Iterate\\n for suffix, file_to_write in enumerate(field_list_flat):\\n field_filename = field_filename_base + f\\\"_{suffix}\\\"\\n\\n # Some cleaning\\n while \\\"__\\\" in field_filename:\\n field_filename = field_filename.replace(\\\"__\\\", \\\"_\\\")\\n\\n while field_filename[-1] == \\\"_\\\":\\n field_filename = field_filename[:-1]\\n\\n # Save image!\\n output_name = (\\n pathlib.Path(output_directory)\\n / parent_sorting_data\\n / field\\n / (field_filename + output_file_suffix)\\n )\\n files_written[field].append(output_name)\\n\\n if output_name.is_file():\\n logger.warning(\\\" File exists: %s\\\", output_name)\\n\\n if overwrite_existing_files:\\n logger.warning(\\\" You have selected to overwrite existing files.\\\")\\n\\n else:\\n logger.info(\\n \\\" You have selected to NOT overwrite existing files. Continuing.\\\"\\n )\\n continue\\n\\n sitk.WriteImage(file_to_write, output_name.as_posix())\\n\\n else:\\n field_filename = field_filename_base\\n file_to_write = field_list\\n\\n # Some cleaning\\n while \\\"__\\\" in field_filename:\\n field_filename = field_filename.replace(\\\"__\\\", \\\"_\\\")\\n\\n while field_filename[-1] == \\\"_\\\":\\n field_filename = field_filename[:-1]\\n\\n # Save image!\\n \\\"\\\"\\\"\\n ! TO DO\\n Use pathlib, and perform some checks so we don\\\"t overwrite anything!\\n \\\"\\\"\\\"\\n output_name = (\\n pathlib.Path(output_directory)\\n / parent_sorting_data\\n / field\\n / (field_filename + output_file_suffix)\\n )\\n files_written[field].append(output_name)\\n\\n if output_name.is_file():\\n logger.warning(\\\" File exists: %s\\\", output_name)\\n\\n if overwrite_existing_files:\\n logger.warning(\\\" You have selected to overwrite existing files.\\\")\\n\\n else:\\n logger.info(\\n \\\" You have selected to NOT overwrite existing files. Continuing.\\\"\\n )\\n continue\\n\\n sitk.WriteImage(file_to_write, output_name.as_posix())\\n\\n return files_written\",\n \"def collect_and_rename() -> None:\\n image_source_folder = 'image_dir'\\n label_source_folder = 'annotation_dir'\\n image_target_folder = 'images'\\n label_target_folder = 'labels'\\n for i, (subdir, _, files) in enumerate(os.walk(image_source_folder), -1):\\n # it walks the parent folder first, not a file\\n if i == -1: \\n continue\\n subdir_name = subdir.split('\\\\\\\\')[1]\\n for file_name in files:\\n with open(f'{image_source_folder}/{subdir_name}/{file_name}') as image_file, \\\\\\n open(f'{label_source_folder}/{subdir_name}/{file_name}'.split('.')[0] + '.txt') as label_file:\\n shutil.copy2(image_file.name, f'{image_target_folder}/{\\\"%06d\\\" % i}.jpg')\\n shutil.copy2(label_file.name, f'{label_target_folder}/{\\\"%06d\\\" % i}.txt')\\n print(f'Processed {i} images')\",\n \"def quicksavefile(directory, text, format=\\\".out\\\"):\\n print(text)\\n print(directory)\\n directory = directory.split(\\\".\\\")\\n del directory[-1]\\n directory.append(format)\\n s = \\\"\\\".join(directory)\\n file = open(s, \\\"w\\\")\\n file.write(text)\\n file.close()\",\n \"def enumerate_filename(path):\\n for (dirpath_0, dirname_list, _) in os.walk(path):\\n for dirname in tqdm(dirname_list):\\n if dirname[0] != '.':\\n dirpath_1 = dirpath_0 + '/' + dirname + '/'\\n for (dirpath_2, __, filename_list) in os.walk(dirpath_1):\\n for filename in filename_list:\\n if filename[0] != '.':\\n old_file = dirpath_2 + filename\\n new_file = dirpath_2 + str(filename_list.index(filename)) + '.jpg'\\n if os.path.exists(new_file):\\n print ('File %s already exist' % new_file)\\n continue\\n else:\\n try:\\n os.rename(old_file, new_file)\\n except:\\n print('Couldn\\\\'t rename %s' % old_file)\\n continue\",\n \"def main(vis_dirs, outdir):\\n assert len(vis_dirs) == 4\\n\\n if not os.path.exists(outdir):\\n os.mkdir(outdir)\\n\\n for i, filename in enumerate(tqdm(os.listdir(vis_dirs[-1]))):\\n # if i % 100 == 0:\\n # print(i)\\n\\n files = [os.path.join(vis_dir, filename) for vis_dir in vis_dirs]\\n outimg = os.path.join(outdir, filename)\\n merge_four_images(files, outimg)\\n\\n print (\\\"Finished! Result dir is %s\\\" % outdir)\",\n \"def produce_reversed_images(source_dir, save_dir):\\n if os.path.exists(source_dir) is False:\\n os.makedirs(source_dir)\\n if os.path.exists(save_dir) is False:\\n os.makedirs(save_dir)\\n\\n reversed_images_index = 0\\n source_img = find_images(source_dir)\\n print(\\\"Reversing the source images...\\\")\\n for s in source_img:\\n img, label = read_image_with_label(source_dir, s)\\n for d in range(3): # 3 kinds of reversing\\n reversed_images_index += 1\\n img_new, label_new = reverse_image(img, label, d)\\n img_name = str(reversed_images_index) + \\\"_\\\" + str(label_new[0]) + \\\"_\\\" + str(label_new[1]) + \\\"_.png\\\"\\n img_new.save(os.path.join(save_dir, img_name))\\n if reversed_images_index % 100 == 0:\\n print(\\\"%d images already be produced\\\" % reversed_images_index)\\n print(\\\"Reverse images reversed: %d\\\" % reversed_images_index)\",\n \"def process_images():\\n create_dirs()\\n for root, dirs, files in os.walk(IN):\\n for name in files:\\n if name[0] == '.':\\n continue\\n process_image(name)\",\n \"def image_splitter(foreground, filename, outfolder_random, outfolder_art, the_class):\\n imarray = numpy.random.rand(256, 256, 3) * 255\\n background = Image.fromarray(imarray.astype('uint8')).convert('RGBA')\\n background2 = Art().redraw()\\n foreground = foreground.convert(\\\"RGBA\\\")\\n datas = foreground.getdata()\\n\\n new_data = []\\n for item in datas:\\n if item[0] < 10 and item[1] < 10 and item[2] < 10:\\n new_data.append((0, 0, 0, 0))\\n else:\\n new_data.append(item)\\n\\n foreground.putdata(new_data)\\n\\n if not os.path.isdir(outfolder_random + \\\"/\\\" + the_class):\\n os.makedirs(outfolder_random + \\\"/\\\" + the_class)\\n if not os.path.isdir(outfolder_art + \\\"/\\\" + the_class):\\n os.makedirs(outfolder_art + \\\"/\\\" + the_class)\\n\\n background.paste(foreground, (0, 0), foreground)\\n new_name = filename[:-17]\\n background.save(outfolder_random + \\\"/\\\" + the_class + \\\"/\\\" + new_name + \\\"jpg\\\", \\\"JPEG\\\")\\n\\n background2.paste(foreground, (0, 0), foreground)\\n background2.save(outfolder_art + \\\"/\\\" + the_class + \\\"/\\\" + new_name + 'jpg', \\\"JPEG\\\")\",\n \"def __save_to_dir(self, imagelist, prefix, PATH):\\n for pair in imagelist:\\n directory = os.path.join(PATH, pair[1])\\n if not os.path.exists(directory):\\n os.mkdir(directory)\\n filename = prefix + pair[2]\\n pair[0].save(os.path.join(directory, filename))\\n print(\\\"Saved \\\" + os.path.join(directory, filename))\",\n \"def create_and_write_output(predictions_path,output_path,inpDir):\\n \\n filenames= sorted(os.listdir(predictions_path)) \\n for filename in filenames:\\n \\n # read the 3 channel output image from the neural network\\n image=cv2.imread(os.path.join(predictions_path,filename))\\n \\n # create binary image output using the create_binary function\\n out_image=create_binary(image) \\n \\n # read and store the metadata from the input image\\n with BioReader(os.path.join(inpDir,filename)) as br:\\n metadata = br.metadata\\n\\n # Write the binary output consisting of the metadata using bfio.\\n output_image_5channel=np.zeros((out_image.shape[0],out_image.shape[1],1,1,1),dtype=np.uint8)\\n output_image_5channel[:,:,0,0,0]=out_image \\n\\n with BioWriter(os.path.join(output_path,filename), metadata=metadata) as bw:\\n bw.dtype = output_image_5channel.dtype\\n bw.write(output_image_5channel)\",\n \"def jarvis(input_path, output_path): \\n \\n if not os.path.exists(f'{output_path}'):\\n os.makedirs(f'{output_path}')\\n\\n folder_list = [sample for sample in os.listdir(input_path) if os.path.isdir(f'{input_path}{sample}')]\\n\\n for folder in folder_list:\\n\\n file_list = [filename for filename in os.listdir(f'{input_path}{folder}/') if '.tif' in filename]\\n mutant = '_'.join(folder.split(' '))\\n\\n for x, filename in enumerate(file_list):\\n pathname = os.path.join(input_path, folder, filename)\\n new_name = f'{output_path}{mutant}_{x}.tif'\\n copyfile(pathname, new_name)\\n # array_stack = skimage.io.imread(f'{pathname}').transpose(1, 2, 0)\\n logger.info(f'{new_name}')\",\n \"def get_normal_image(image_path):\\n resized_images = slice_and_resize(image_path)\\n\\n normal_full_img = join_images_horizontally(resized_images)\\n\\n folder = \\\"static/images/panorama\\\"\\n\\n name = next(tempfile._get_candidate_names())\\n normal_path = \\\"%s/%s_resized.png\\\" % (folder, name)\\n normal_full_img.save(normal_path)\\n\\n return normal_path\",\n \"def appendTrailer(inputImagePath, trailer, outputPath):\\n\\n with open(inputImagePath, \\\"rb\\\") as f:\\n inputContent = f.read()\\n\\n with open(outputPath, \\\"wb\\\") as f:\\n f.write(inputContent)\\n f.write(trailer)\",\n \"def create_temp_files(containers):\\n for name in containers:\\n run_cmd(f\\\"rm -rf /tmp/{name}.img\\\", True)\\n for name in containers:\\n run_cmd(f\\\"truncate -s 1G /tmp/{name}.img\\\", True)\",\n \"def split(directory='', name=''):\\n d = directory\\n r_path = build_path(d, path.splitext(name)[0] + '_r.png')\\n g_path = build_path(d, path.splitext(name)[0] + '_g.png')\\n b_path = build_path(d, path.splitext(name)[0] + '_b.png')\\n a_path = build_path(d, path.splitext(name)[0] + '_a.png')\\n Image.open(build_path(d, name)).convert('RGBA').getchannel(0).save(r_path)\\n Image.open(build_path(d, name)).convert('RGBA').getchannel(1).save(g_path)\\n Image.open(build_path(d, name)).convert('RGBA').getchannel(2).save(b_path)\\n Image.open(build_path(d, name)).convert('RGBA').getchannel(3).save(a_path)\",\n \"def _handle_old_style_images(staging_path):\\n file_num = 0\\n for filename in ('snap.vhd', 'image.vhd', 'base.vhd'):\\n path = os.path.join(staging_path, filename)\\n if os.path.exists(path):\\n _rename(path, os.path.join(staging_path, \\\"%d.vhd\\\" % file_num))\\n file_num += 1\",\n \"def download_images(src_dir, dest_dir):\\n # +++your code here+++\\n if not os.path.exists(dest_dir):\\n os.mkdir(dest_dir)\\n res=utility(src_dir)\\n k=0\\n f=file(dest_dir+\\\"/\\\"+\\\"index.html\\\", 'w')\\n f.write(\\\"<html><body>\\\")\\n for i in res:\\n local_name='image'+str(k)\\n print \\\"downloading image%d\\\" %(k)\\n urllib.urlretrieve(i, os.path.join(dest_dir, local_name))\\n f.write(\\\"<img src=\\\"+'\\\"'+os.path.join(dest_dir, local_name)+'\\\"'+\\\">\\\")\\n k+=1\\n f.write(\\\"</body></html>\\\")\\n f.close()\\n cmd=\\\"xdg-open\\\"+\\\" \\\"+'\\\"'+dest_dir+\\\"/\\\"+\\\"index.html\\\"+'\\\"'\\n (status, output)=commands.getstatusoutput(cmd)\\n sys.exit(1)\",\n \"def write_tmp_blob(dir, name, sha):\\n cmd = ['git', 'cat-file', '-p', sha ]\\n abs_path = os.path.join(dir, os.path.basename(name))\\n popen = subprocess.Popen(cmd, stdout=subprocess.PIPE)\\n output = popen.communicate()[0]\\n f = file(abs_path, 'w')\\n f.write(output)\\n f.close()\\n return abs_path\",\n \"def copy_images_to_new(lab_img, from_dir, to_dir):\\n \\n for img in lab_img:\\n if not os.path.exists(join(todir, img)):\\n shutil.copyfile(join(fromdir, img), join(todir, img)) \\n print(\\\"Done\\\")\",\n \"def TextureFiles():\\n import shutil\\n\\n # first convert the .psd files to .png\\n\\n FbmDir = glo.outputFolder + '.fbm'\\n\\n for d1, d2, filenames in os.walk(FbmDir):\\n for filename in filenames:\\n \\\"\\\"\\\"filename: vitrin_diffuse.psd\\n \\\"\\\"\\\"\\n # print \\\"TextureFiles():\\\", filename\\n if filename[-4:].upper() == '.PSD':\\n #print \\\" -- FbmDir:\\\" , FbmDir\\n #print \\\" -- in the if clause with filename:\\\" , filename\\n #print \\\" -- glo.outputFolder\\\" , glo.outputFolder\\n # FbmDir = '../fbx/simplelifeembedmedia.fbm'\\n # filename = 'shelves_light.PSD'\\n PsdToPngConverter(FbmDir, filename)\\n\\n # Move only the .png file to the ../png/ directory\\n filename = filename[:-4] + '.png'\\n src = os.path.join(FbmDir, filename)\\n elif filename[0] != '.':\\n src = os.path.join(FbmDir, filename)\\n pass\\n\\n shutil.copy(src, glo.outputFolder)\\n print os.path.join(glo.outputFolder, filename), \\\"\\\\n\\\"\\n sys.stdout.flush()\\n # for d1, d2, files in os.walk(glo.outputFolder):\\n # if not filename in files:\\n # #print \\\"moving: \\\", files, filename, not filename in files\\n # shutil.copy(src, glo.outputFolder)\\n # print os.path.join(glo.outputFolder, filename), \\\"\\\\n\\\"\\n # else:\\n # print \\\"%s/%s already exists. File not moved\\\" % (glo.outputFolder,filename)\",\n \"def photo2web_process_hattenbach():\\n\\n os.chdir('/Volumes/SSD External/Hattenbach_v2')\\n \\n dir_base = os.getcwd()\\n \\n dir_p2w = '/Users/throop/photos/Trips/'\\n \\n dirs = sorted(glob.glob(os.path.join(dir_base, '*')))\\n \\n quality_out = '60'\\n size_out = '2000x2000'\\n \\n for i,dir in enumerate(dirs):\\n if os.path.isdir(dir):\\n os.chdir(dir)\\n dir_originals = os.path.join(dir, 'originals')\\n dir_originals_fullres = os.path.join(dir, 'originals_fullres')\\n\\n# For HH files, copy the 'actual' originals into a 'fullres' folder, for safekeeping\\n\\n if not os.path.isdir(dir_originals_fullres):\\n os.rename(dir_originals, dir_originals_fullres)\\n os.mkdir(dir_originals)\\n \\n files = glob.glob(os.path.join(dir_originals_fullres, '*'))\\n\\n# Get a list of all the images\\n\\n# For each image, make a low-res, low-quality image. This is just because the scanned files\\n# are huge and high-quality, and not useful for online. They are much larger than necessary. \\n# So we use 'convert' to shrink them in size and quality, and put the output into 'originals' directory \\n# for photo2web.\\n\\n for file in files:\\n file_short = os.path.basename(file)\\n file_in = os.path.join(dir_originals_fullres,file_short)\\n file_out = os.path.join(dir_originals,file_short)\\n if not os.path.isfile(file_out):\\n cmd = (f'convert -resize {size_out} -quality {quality_out}' +\\n f' {file_in}' +\\n f' {file_out}')\\n print(f'{cmd}')\\n \\n subprocess.run(['convert', '-resize', size_out, '-quality', quality_out,\\n file_in,\\n file_out])\\n\\n# Now, finally, go thru and do photo2web on all of them.\\n \\n print(f'\\\\nProcessing directory {i}/{len(dirs)} {dir}\\\\n')\\n subprocess.run(['cp', '-r', os.path.join(dir_p2w, 'header.txt'), '.'])\\n subprocess.run(['cp', '-r', os.path.join(dir_p2w, 'photos.css'), '.'])\\n if not os.path.exists('captions.txt'):\\n subprocess.run(['captions_photo2web']) \\n subprocess.run(['photo2web_old'])\\n subprocess.run(['photo2web'])\",\n \"def save(images, output):\\n for image, frame in images:\\n image.save(output(frame))\",\n \"def compress_image(filename,k):\",\n \"def convert_for_submission(source_dir, target_dir):\\r\\n files = subfiles(source_dir, suffix=\\\".nii.gz\\\", join=False)\\r\\n maybe_mkdir_p(target_dir)\\r\\n for f in files:\\r\\n img = sitk.ReadImage(join(source_dir, f))\\r\\n out_file = join(target_dir, f[:-7] + \\\".nii\\\")\\r\\n sitk.WriteImage(img, out_file)\",\n \"def gen_text (path_img):\\n \\n try:\\n image_files = []\\n os.chdir(path_img)\\n for filename in os.listdir(os.getcwd()):\\n if filename.endswith(\\\".JPG\\\"):\\n image_files.append(path_img + filename)\\n with open(\\\"images.txt\\\", \\\"w\\\") as outfile:\\n for image in image_files:\\n outfile.write(image)\\n outfile.write(\\\"\\\\n\\\")\\n outfile.close()\\n \\n except KeyboardInterrupt:\\n print('Interrupted')\\n try:\\n os.system.exit(0)\\n except SystemExit:\\n os._exit(0)\",\n \"def tiff_split(path_tiff_source, path_tiff_out):\\n path_out_low = path_tiff_out + '\\\\\\\\' + 'low8bits'\\n path_out_hig = path_tiff_out + '\\\\\\\\' + 'high8bits'\\n path_out_list=[path_out_hig,path_out_low]\\n makdir(path_out_low)\\n makdir(path_out_hig)\\n for file in glob.glob(path_tiff_source + '\\\\\\\\' + '*.tiff'):\\n tif = TIFF.open(file, 'r')\\n img = tif.read_image()\\n img_low_8bits = img % 256\\n img_hig_8bits = img / 256\\n img_low_8bits = img_low_8bits.astype(np.uint8)\\n img_hig_8bits = img_hig_8bits.astype(np.uint8)\\n img_name = os.path.basename(file)\\n tif_split_low = TIFF.open(path_out_low + '\\\\\\\\' + img_name, 'w')\\n tif_split_low.write_image(img_low_8bits)\\n tif_split_hig = TIFF.open(path_out_hig + '\\\\\\\\' + img_name, 'w')\\n tif_split_hig.write_image(img_hig_8bits)\\n return path_out_list\",\n \"def append_component_images(pldm_fw_up_pkg, image_files):\\n for image in image_files:\\n with open(image, \\\"rb\\\") as file:\\n for line in file:\\n pldm_fw_up_pkg.write(line)\",\n \"def process_directory(working_directory, cc_size, output_directory):\\n print \\\"\\\\nProcessing directory {0}\\\".format(working_directory)\\n \\n for dirpath, dirnames, filenames in os.walk(working_directory):\\n for f in filenames:\\n if f.split('.')[-1] == 'tif':\\n img = load_image(os.path.join(dirpath, f))\\n onebitimage = img.to_onebit()\\n onebitimage.despeckle(int(cc_size))\\n output_path = os.path.join(output_directory, f)\\n # print onebitimage\\n # print (os.path.join(dirpath, f.split('.')[0]+ '_NEW.' + f.split('.')[-1]))\\n # onebitimage.save_tiff(os.path.join(dirpath, f.split('.')[0]+ '_NEW.' + f.split('.')[-1]))\\n\\n onebitimage.save_tiff(output_path)\\n print output_path\\n else:\\n pass\",\n \"def copy_mosaic(mosaic_dir='K:/IID_SaltonSea/Tasks/Soil mapping/PhotoDocumentation/Original/',\\r\\n output_dir='K:/IID_SaltonSea/Tasks/Soil mapping/PhotoDocumentation/Processing/',\\r\\n file_pattern='IID201905*jpg', replace=False): \\r\\n \\r\\n if not os.path.exists(mosaic_dir):\\r\\n sys.exit('input folder does not exist')\\r\\n \\r\\n mosaics = []\\r\\n for root, dirnames, filenames in os.walk(mosaic_dir):\\r\\n for filename in fnmatch.filter(filenames, file_pattern):\\r\\n mosaics.append(os.path.join(root, filename))\\r\\n \\r\\n c = 0\\r\\n s = 0\\r\\n r = 0\\r\\n for m in mosaics:\\r\\n f = output_dir + os.path.basename(m)\\r\\n if not os.path.exists(f):\\r\\n copyfile(m, f)\\r\\n print('copied: %s' % f)\\r\\n c+=1\\r\\n elif replace:\\r\\n copyfile(m, f)\\r\\n print('replaced: %s' % f)\\r\\n r+=1\\r\\n else:\\r\\n print('skipped: %s' % f)\\r\\n s+=1\\r\\n \\r\\n print('copied total of %i files' % c)\\r\\n print('replaced total of %i files' % r)\\r\\n print('skipped total of %i files' % s)\",\n \"def divide_fasta_like_file(input_file, output_dir, ext=''):\\n with open(input_file, 'r') as file:\\n body = ''\\n p_id = ''\\n for line in file:\\n if line[0] == '>':\\n if len(p_id) > 0:\\n with open(output_dir + p_id.replace(':', '_') + '.' + ext, \\\"w\\\") as out_file:\\n out_file.write('>' + p_id.replace(':', '_') + '\\\\n' + body + '\\\\n')\\n body = ''\\n p_id = line.strip()[1:]\\n else:\\n body += line.strip()\\n with open(output_dir + p_id.replace(':', '_') + '.' + ext, \\\"w\\\") as out_file:\\n out_file.write('>' + p_id.replace(':', '_') + '\\\\n' + body + '\\\\n')\",\n \"def pepsi(directory=None):\\r\\n \\r\\n if directory == None:\\r\\n directory = os.getcwd() # Use working directory if unspecified\\r\\n \\r\\n # Create a new directory 'modified'\\r\\n new_directory = os.path.join(directory, 'modified')\\r\\n try:\\r\\n os.mkdir(new_directory)\\r\\n except OSError:\\r\\n pass # if the directory already exists, proceed \\r\\n \\r\\n #load all the images\\r\\n image_list, file_list = get_images(directory) \\r\\n\\r\\n #go through the images and save modified versions\\r\\n red = PIL.Image.open(os.path.join(directory, 'red.png'))\\r\\n blue = PIL.Image.open(os.path.join(directory, 'blue.png'))\\r\\n template =PIL.Image.open(os.path.join(directory, 'template.png'))\\r\\n topp = PIL.Image.open(os.path.join(directory, '1.jpeg'))\\r\\n bottomm = PIL.Image.open(os.path.join(directory, '2.jpg'))\\r\\n \\r\\n # Round the corners with radius = 30% of short side\\r\\n\\r\\n top = redlogo(topp,red,template)\\r\\n bottom = bluelogo(bottomm,blue,template)\\r\\n new_image = template\\r\\n new_image.paste(bottom,(0,0), mask=bottom)\\r\\n new_image.paste(top,(0,0), mask=top)\\r\\n #save the altered image, suing PNG to retain transparency\\r\\n new_image_filename = os.path.join(new_directory, 'final' + '.png')\\r\\n new_image.save(new_image_filename) #9b: \",\n \"def create_noobj_folder(\\n folder: PathLike, \\n img_ext: str = \\\".jpg\\\",\\n):\\n folder = Path(folder).expanduser().resolve()\\n images = glob(folder, img_ext)\\n \\n for image in images:\\n filename = image.name\\n _folder = image.parent.name\\n path = folder / (image.stem + \\\".xml\\\")\\n img_w, img_h = get_image_size(image)\\n\\n tree = ET.Element(\\\"annotation\\\")\\n\\n et_folder = ET.SubElement(tree, \\\"folder\\\")\\n et_folder.text = _folder\\n\\n et_filename = ET.SubElement(tree, \\\"filename\\\")\\n et_filename.text = filename\\n\\n et_path = ET.SubElement(tree, \\\"path\\\")\\n et_path.text = str(path)\\n\\n et_img_size = ET.SubElement(tree, \\\"size\\\")\\n ET.SubElement(et_img_size, \\\"width\\\").text = str(img_w)\\n ET.SubElement(et_img_size, \\\"height\\\").text = str(img_h)\\n ET.SubElement(et_img_size, \\\"depth\\\").text = \\\"3\\\"\\n\\n content = ET.tostring(tree, encoding=\\\"unicode\\\", pretty_print=True)\\n try: \\n path.write_text(content)\\n except KeyboardInterrupt:\\n path.write_text(content)\\n exit()\",\n \"def add_image(self, f_name,file,new_id):\\r\\n folder=tempfile.mktemp()\\r\\n os.mkdir(folder)\\r\\n datei=open(folder+'/'+f_name,'w+')\\r\\n datei.write(file.read())\\r\\n datei.close()\\r\\n val='' \\r\\n liste_ext=liste_val\\r\\n if(self.toolbox.hasProperty('eigene_formate')):\\r\\n self_val=self.toolbox.getProperty('eigene_formate').split(',')\\r\\n liste_ext=[]\\r\\n for x in self_val:\\r\\n liste_ext.append('_'+x+'.jpeg')\\r\\n for extension in liste_ext:\\r\\n #cmd='/usr/bin/convert '+folder+'/'+f_name+' -resize '+extension[1:-4]+'x'+extension[1:-4]+' '+folder+'/'+new_id+extension\\r\\n cmd='/usr/bin/convert '+folder+'/'+f_name+' -resize '+extension[1:-4]+' '+folder+'/'+new_id+extension\\r\\n order=os.popen(cmd).read()\\r\\n kurz_name='_'+str(f_name.split('.')[0])\\r\\n kurz_name=kurz_name.replace(' ','_')\\r\\n val=val+self.manage_addImage(id=new_id+kurz_name+extension,file=open(folder+'/'+new_id+extension),title=f_name, precondition='', content_type='',REQUEST=None)+' ' \\r\\n os.remove(folder+'/'+new_id+extension)\\r\\n os.remove(folder+'/'+f_name)\\r\\n os.rmdir(folder)\\r\\n txt=\\\"Datei Hochgeladen!<br>\\\"\\r\\n #my_root=self.toolbox\\r\\n #txt+=my_root.id+\\\"<br>\\\"\\r\\n #if(my_root.hasProperty('eigene_formate')):\\r\\n # txt+=my_root.getProperty('eigene_formate')+\\\"<br>\\\"\\r\\n return txt\",\n \"def ren_mosaic(mosaic_dir='K:/IID_SaltonSea/Tasks/Soil mapping/PhotoDocumentation/Original/', \\r\\n file_pattern='*stitch.jpg'): \\r\\n \\r\\n \\r\\n if not os.path.exists(mosaic_dir):\\r\\n sys.exit('input folder does not exist')\\r\\n \\r\\n mosaics = []\\r\\n for root, dirnames, filenames in os.walk(mosaic_dir):\\r\\n for filename in fnmatch.filter(filenames, file_pattern):\\r\\n mosaics.append(os.path.join(root, filename).replace('\\\\\\\\','/'))\\r\\n \\r\\n s = 0\\r\\n r = 0\\r\\n for m in mosaics:\\r\\n dir_name = os.path.dirname(m).split('/')[-1]\\r\\n new_name = os.path.dirname(m) + '/' + dir_name + '.jpg'\\r\\n if os.path.exists(new_name):\\r\\n print('skipping: %s' % m)\\r\\n s+=1\\r\\n else:\\r\\n os.rename(m, new_name)\\r\\n print('renamed: %s' % new_name)\\r\\n r+=1\\r\\n \\r\\n print('renamed total of %i files' % r)\\r\\n print('skipped total of %i files' % s)\",\n \"def move_files(probs):\\r\\n path = '../brain_tiny_dataset_class/png/'\\r\\n for _, _, files in os.walk(path):\\r\\n for file in files:\\r\\n # Reads the ID\\r\\n id = file[3:-4]\\r\\n try:\\r\\n # Reads dictionary of probabilities\\r\\n result = probs[id]\\r\\n # Moves pictures in 2 folders\\r\\n if result['epidural'] > 0 or result['intraparenchymal'] > 0 \\\\\\r\\n or result['intraventricular'] > 0 or result['subarachnoid'] > 0 \\\\\\r\\n or result['subdural'] > 0:\\r\\n shutil.move(path + file, '../brain_tiny_dataset_class/hemorrhage/' + file)\\r\\n else:\\r\\n shutil.move(path + file, '../brain_tiny_dataset_class/healthy/' + file)\\r\\n except KeyError:\\r\\n continue\",\n \"def JPGtoPNGConverter(source, dest):\\n files = os.listdir(f\\\"./{source}\\\")\\n if not os.path.exists(f\\\"./{dest}\\\"):os.makedirs(f\\\"./{dest}\\\")\\n\\n for file in files:\\n if os.path.splitext(file)[-1] == \\\".jpg\\\":\\n img = Image.open(f\\\"./{source}/{file}\\\")\\n clean_text = os.path.splitext(file)[0]\\n img.save(f\\\"./{dest}/{clean_text}.png\\\",\\\"png\\\")\\n else:\\n print(f\\\"Your filename: {file} is not in .JPG format !!\\\")\\n return \\\"All files converted successfully :) \\\"\",\n \"def write_camera_pose_to_file(camera_pose_abs_dict: dict, pose_dir_path: str) -> None:\\n image_dst = path.join(pose_dir_path, 'images.txt')\\n with open(image_dst, 'w+') as file:\\n file.write('# Image list with two lines of data per image:\\\\n')\\n file.write('# IMAGE_ID, QW, QX, QY, QZ, TX, TY, TZ, CAMERA_ID, NAME\\\\n')\\n file.write('# POINTS2D[] as (X, Y, POINT3D_ID)\\\\n')\\n file.write(f'# Number of images: {len(camera_pose_abs_dict.keys())}\\\\n')\\n\\n # write each camera pose to file\\n for image in camera_pose_abs_dict.keys():\\n image_pose_data = []\\n t_vector = camera_pose_abs_dict[image][1]\\n qx, qy, qz, qw = rotation_matrix_to_quaternion(camera_pose_abs_dict[image][0])\\n\\n image_pose_data.append(str(image))\\n # image_pose_data.append(f'{qw} {qx} {qy} {qz}')\\n image_pose_data.append(f'{qz} {qy} {qx} {qw}')\\n image_pose_data.append(' '.join(map(str, t_vector)))\\n image_pose_data.append('1')\\n image_pose_data.append(f'image{image}.jpg')\\n\\n file.write(' '.join(image_pose_data) + '\\\\n\\\\n')\",\n \"def tempWrite(img):\\n\\tfilename = \\\"{}.png\\\".format(os.getpid())\\n\\tcv2.imwrite(filename, img)\\n\\treturn filename\",\n \"def remove_extra_images(path_to_images: str, number_of_images: int) -> None:\\n last_image = 'image' + str(number_of_images) + '.jpg'\\n while last_image in listdir(path_to_images):\\n last_image_path = path.join(path_to_images, last_image)\\n remove(last_image_path)\\n print(f\\\"remove {last_image}\\\")\\n number_of_images += 1\\n last_image = 'image' + str(number_of_images) + '.jpg'\",\n \"def recad_dir(pattern, vmin, vmax, shape, discard_vol=False,\\n only_new=True):\\n file_list = glob(pattern)\\n file_list.sort()\\n for file_name in file_list:\\n h5_name = os.path.splitext(file_name)[0] + '.h5'\\n print file_name\\n if only_new:\\n if os.path.exists(h5_name):\\n print \\\"already exists\\\"\\n continue\\n recad_to_h5_chunk(file_name, vmin, vmax, shape)\\n if discard_vol and os.path.exists(h5_name):\\n os.remove(file_name)\\n os.remove(file_name + '.info')\\n os.remove(file_name + '.xml')\",\n \"def do_2003(in_dir, out_dir):\\n\\n dir_items = setup_outdir_and_get_input(in_dir, out_dir)\\n for idx, item in enumerate(dir_items):\\n full_path = in_dir + os.path.sep + item\\n print(f\\\"{item} -> {idx}\\\")\\n create_dirs_and_write_files(full_path, idx, in_dir, item, out_dir)\",\n \"def order_test_set(path_to_images, path_to_csv, path_to_save_test):\\n\\n try:\\n with open(path_to_csv, 'r') as csvfile:\\n reader = csv.reader(csvfile, delimiter = ',')\\n\\n for i, row in enumerate(reader):\\n if i == 0: # continue the first line beacuse of the header line\\n continue\\n\\n img_name = row[-1].replace('Test/', '')\\n label = row[-2]\\n\\n path_to_folder = os.path.join(path_to_save_test, label)\\n\\n if not os.path.isdir(path_to_folder): # if the dir. not exist\\n os.makedirs(path_to_folder) # create the directory\\n\\n img_full_path = os.path.join(path_to_images, img_name)\\n\\n print(\\\"Copying \\\", img_full_path, \\\" to \\\", path_to_folder)\\n shutil.copy(img_full_path, path_to_folder)\\n\\n except:\\n print(\\\"[INFO]: Error reading csv file.\\\")\",\n \"def stitch_images(self):\\n stitched_folder_name = self.parent_folder + 'stitched'\\n print(\\\"Stitching images in:\\\")\\n print(self.folder_list)\\n print(\\\"Storing in: \\\" + str(stitched_folder_name))\\n\\n try:\\n print(\\\"Making dir \\\" + str(stitched_folder_name) + \\\" for stitching\\\")\\n os.mkdir(stitched_folder_name)\\n except OSError:\\n print(\\\"Folder exists, have you already done this stitching??\\\")\\n return\\n\\n photo_list = self.get_photo_list(self.parent_folder + '/' + self.folder_list[0])\\n # get photo sizes\\n print(self.parent_folder + '/' + self.folder_list[0] + '/' + photo_list[0])\\n size_photo = cv2.imread(self.parent_folder + '/' + self.folder_list[0] +\\n '/' + photo_list[0], cv2.IMREAD_ANYDEPTH)\\n photo_height, photo_width = np.shape(size_photo)\\n stitched_height = photo_height * 2\\n stitched_width = photo_width * 4\\n\\n for photo in photo_list:\\n stitched_photo = np.full((stitched_height, stitched_width), 0)\\n\\n for i, folder in enumerate(self.folder_list):\\n print(i)\\n print(folder)\\n print(self.parent_folder + folder + '/' + photo)\\n\\n stitched_photo[(int((float(i) / 4.0)) * photo_height):(int(((float(i) / 4.0) + 1)) * photo_height),\\n (int(i % 4) * photo_width):((int((i % 4) + 1)) * photo_width)] \\\\\\n = cv2.imread(self.parent_folder + '/' + folder + '/' + photo, cv2.IMREAD_ANYDEPTH)\\n\\n stitched_photo = stitched_photo.astype(np.uint16)\\n cv2.imwrite(stitched_folder_name + '/' + photo, stitched_photo, [cv2.IMWRITE_PNG_COMPRESSION, 0])\\n\\n return stitched_folder_name\",\n \"def test_save_image(self):\\n\\n from m3_save_images.m3_save_images import save_images\\n folder_destination_name = \\\"unittest-sorted-images\\\"\\n path_source = \\\"../img\\\"\\n image_name = [\\\"00ff00.png\\\", \\\"aqua.png\\\", \\\"black.jpg\\\", \\\"yellow.png\\\", \\\"red2.jpg\\\", \\\"green.jpg\\\"]\\n image_color = [\\\"Lime\\\", \\\"Aqua\\\", \\\"Black\\\", \\\"Yellow\\\", \\\"Red\\\", \\\"Green\\\"]\\n # new empty folder is needed for testing save_image() function\\n if os.path.isdir(folder_destination_name):\\n shutil.rmtree(folder_destination_name)\\n os.mkdir(folder_destination_name)\\n # creating folders\\n for i in range(0, 4):\\n save_images(folder_destination_name, path_source, image_name[i], image_color[i])\\n self.assertEqual(''.join(os.listdir(os.path.join(folder_destination_name, image_color[i]))), image_name[i])\\n save_images(folder_destination_name, path_source, image_name[i], image_color[5])\\n self.assertNotEqual(''.join(os.listdir(os.path.join(folder_destination_name, image_color[i]))), image_name[5])\",\n \"def exporting_cropped_images (fpath_tiff):\\n src = rasterio.open(fpath_tiff, 'r')\\n outfolder_irregular = '/train/irregular'\\n outfolder_healthy = '/train/healthy'\\n outfolder_concrete = '/train/concrete'\\n outfolder_incomplete = '/train/incomplete'\\n outfolder_other = '/train/other'\\n outfolder = '/train/batch'\\n #os.makedirs (outfolder, exist_ok = True)\",\n \"def copy_photos(source='.', dest='.'):\\n if isdir(source): # if this is a directory,\\n for child in listdir(source):\\n # compose full path to child\\n child = join(source, child)\\n if isdir(child):\\n copy_photos(child, dest)\\n else:\\n if guess_type(child)[0] is not None \\\\\\n and (guess_type(child)[0].split('/')[0] == 'image'):\\n new = rename(child)\\n create_tree(new, dest)\",\n \"def change_imagens(current_folder, destination_folder, name=\\\"crosswalk\\\", qtd=0, dim=(128, 64)):\\n\\n img_path = [os.path.join(current_folder, file) for file in os.listdir(current_folder)]\\n qtd_img = 1\\n\\n for img in img_path:\\n img_name = os.path.split(img)[1].split(\\\"/\\\")[0]\\n extension = os.path.split(img_name)[1].split(\\\".\\\")[0]\\n\\n new_name = name\\n saved_name = new_name + \\\"_\\\" + str(qtd_img + qtd)\\n print(img_name + \\\" -> \\\" + saved_name + \\\".jpg\\\")\\n\\n try:\\n saved_folder = destination + \\\"/\\\"\\n\\n # carrega a imagem\\n img = Image.open(current_folder + \\\"/\\\" + img_name)\\n # converte a imagem (PIL) para numpy array\\n imgNp = np.array(img,'uint8')\\n # redimensionar a imagem\\n imgNp = cv2.resize(imgNp, dim)\\n\\n # Cria a pasta positivas_final e salva as imagens\\n pathlib.Path(saved_folder).mkdir(parents=True, exist_ok=True)\\n cv2.imwrite(saved_folder + saved_name + \\\".jpg\\\", imgNp)\\n\\n qtd_img += 1\\n\\n except ValueError:\\n print('.')\",\n \"def makeOutDirs(od):\\n if args.format.lower() == 'kitti':\\n id = \\\"%s/images\\\" % od\\n ld = \\\"%s/labels\\\" % od\\n elif args.format.lower() == 'darknet':\\n id = \\\"%s/images\\\" % od\\n ld = \\\"%s/annotations\\\" % od\\n else:\\n print \\\"Invalid output format %s!\\\" % args.format\\n usage()\\n ensureDir(id)\\n ensureDir(ld)\\n return id, ld\",\n \"def split_data(src, dst, ratio=0.2):\\n dirs = [f for f in os.listdir(src) if os.path.isdir(os.path.join(src, f)) and not f.startswith('.')]\\n for d in dirs:\\n src_subdir = os.path.join(src, d)\\n dst_subdir = os.path.join(dst, d)\\n if not os.path.exists(dst_subdir):\\n os.makedirs(dst_subdir)\\n imgs = [f for f in os.listdir(src_subdir) if os.path.isfile(os.path.join(src_subdir, f)) and not f.startswith('.')]\\n for img in imgs:\\n if np.random.uniform() <= ratio:\\n move(os.path.join(src_subdir, img), dst_subdir)\\n print('split done')\",\n \"def test_build_export_path_image(clpipe_fmriprep_dir: Path):\\n\\n # Build the fMRIPrep input image path\\n image_name = \\\"sub-0_task-rest_space-MNI152NLin2009cAsym_desc-preproc_bold.nii.gz\\\"\\n fmriprep_dir = clpipe_fmriprep_dir / \\\"data_fmriprep\\\" / \\\"fmriprep\\\"\\n image_path = fmriprep_dir / \\\"sub-0\\\" / \\\"func\\\" / image_name\\n\\n # Build the output path\\n subject_out_dir = clpipe_fmriprep_dir / \\\"data_postproc2\\\" / \\\"sub-0\\\"\\n\\n # Build full export path\\n export_path = build_export_path(image_path, \\\"0\\\", fmriprep_dir, subject_out_dir)\\n\\n assert str(export_path) == str(\\n subject_out_dir\\n / \\\"func\\\"\\n / \\\"sub-0_task-rest_space-MNI152NLin2009cAsym_desc-postproc_bold.nii.gz\\\"\\n )\",\n \"def cat_files(files, output):\\n for file in files:\\n with open(file, 'r') as fd:\\n shutil.copyfileobj(fd, output)\",\n \"def cat_files(files, output):\\n for file in files:\\n with open(file, 'r') as fd:\\n shutil.copyfileobj(fd, output)\",\n \"def extract_write_to_file(self, num_extracted, write_dir, sub_h, sub_w, margin=10):\\n\\n file_seed = len(os.listdir(write_dir))\\n\\n for i in range(num_extracted):\\n file_num = str(file_seed + i)\\n write_path = os.path.join(write_dir, file_num + \\\".\\\" + 'jpg')\\n\\n print('extracting {}/{} images of dimension {}x{}'.format(i, num_extracted, sub_h, sub_w))\\n print('writting to location: {}'.format(write_path))\\n\\n self.extract_single(sub_h, sub_w, write_path)\",\n \"def save_images(images, save_dir, image_type):\\n for image in images:\\n raw_img = urllib2.urlopen(image).read()\\n count = len([i for i in os.listdir(save_dir) if image_type in i]) + 1\\n f = open(save_dir + '/' + image_type + '_' + str(count), 'wb')\\n f.write(raw_img)\\n f.close()\",\n \"def path_to_name(img):\\n\\n return os.path.dirname(img) + '_' + os.path.basename(img)\",\n \"def convert_all(input: str, out: str):\\n dateien = listdir(input)\\n for datei in dateien:\\n out_datei = datei.replace(\\\" \\\", \\\"_\\\") # Leertasten durch Unterstriche ersetzen\\n convert_image(input + datei, out + out_datei)\",\n \"def write_img_to_fs(name, data):\\n with open(name, \\\"wb\\\") as fout:\\n fout.write(data)\",\n \"def normalize_path(img_file):\\n\\n img_file = img_file.split('/')[-1]\\n img_file = 'data/IMG/'+img_file.split('\\\\\\\\')[-1]\\n return img_file\",\n \"def crop_and_save_images(source_directory, target_directory):\\n haar_cascade = cv.CascadeClassifier('haar_face.xml')\\n os.chdir(target_directory)\\n file_names = os.listdir(source_directory)\\n number_of_images = len(file_names)\\n total_number_of_digits = math.floor(math.log10(number_of_images)) + 1\\n i = 1\\n for filename in file_names:\\n image = os.path.join(source_directory, filename)\\n print(image)\\n cropped_image = crop_face_image(image, haar_cascade)\\n try:\\n if cropped_image.any() is None:\\n print('No face detected, skipping image')\\n continue\\n except AttributeError:\\n print('No face detected, skipping image')\\n continue\\n current_number_of_digits = math.floor(math.log10(i)) + 1\\n number_of_zeros = total_number_of_digits - current_number_of_digits\\n print(f'Cropping: {filename}, saving to folder {target_directory}')\\n newFilename = 'IMG_' + '0'*number_of_zeros + f'{i}.jpg'\\n cv.imwrite(newFilename, cropped_image)\\n i += 1\",\n \"def saveImgs(img, filename=None):\\n\\tif filename is None:\\n\\t\\tdate = time.strftime(\\\"%Y%m%d\\\")\\n\\t\\tfilename = \\\"T\\\" + str(date)\\n\\t\\tjpg = \\\".jpg\\\"\\n\\t\\tcount = 0\\n\\t\\tfor item in img:\\n\\t\\t\\tname = filename + str(count) + jpg\\n\\t\\t\\tcv2.imwrite(name, item)\\n\\t\\t\\tcount += 1\\n\\telse:\\n\\t\\tfor i in range(0, len(img)):\\n\\t\\t\\tcv2.imwrite(filename[i], img[i])\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.6020291","0.58817405","0.5803224","0.57723814","0.57670635","0.57295036","0.5712866","0.56850314","0.56731784","0.5619671","0.55809706","0.5572275","0.5563066","0.55071867","0.55031073","0.538915","0.5343728","0.5336606","0.5318499","0.53176695","0.5316611","0.53027153","0.5299702","0.5276676","0.5275632","0.5243651","0.52414584","0.5191616","0.51908463","0.5183552","0.51718485","0.5171376","0.51673186","0.5166163","0.5166163","0.5164798","0.5159895","0.51577723","0.51466894","0.51191026","0.5105412","0.51012903","0.5097146","0.5097039","0.5095463","0.5087037","0.5083879","0.5081339","0.5076056","0.5074391","0.5053108","0.50462604","0.50447124","0.50446165","0.5043029","0.5039403","0.50290424","0.5024794","0.50211895","0.5019482","0.5016269","0.5014021","0.50109106","0.50098157","0.50001466","0.49981922","0.49936116","0.49918625","0.49913254","0.4987713","0.49828133","0.49737862","0.4973755","0.4972991","0.49690774","0.4958239","0.49553755","0.49470916","0.49444833","0.49444512","0.49387145","0.4938554","0.49325183","0.49312603","0.49308988","0.4929141","0.49257082","0.49140707","0.4906089","0.48970327","0.4894203","0.48938707","0.48938707","0.48928517","0.4882542","0.4881907","0.48768255","0.48760873","0.48702335","0.4868665","0.4865804"],"string":"[\n \"0.6020291\",\n \"0.58817405\",\n \"0.5803224\",\n \"0.57723814\",\n \"0.57670635\",\n \"0.57295036\",\n \"0.5712866\",\n \"0.56850314\",\n \"0.56731784\",\n \"0.5619671\",\n \"0.55809706\",\n \"0.5572275\",\n \"0.5563066\",\n \"0.55071867\",\n \"0.55031073\",\n \"0.538915\",\n \"0.5343728\",\n \"0.5336606\",\n \"0.5318499\",\n \"0.53176695\",\n \"0.5316611\",\n \"0.53027153\",\n \"0.5299702\",\n \"0.5276676\",\n \"0.5275632\",\n \"0.5243651\",\n \"0.52414584\",\n \"0.5191616\",\n \"0.51908463\",\n \"0.5183552\",\n \"0.51718485\",\n \"0.5171376\",\n \"0.51673186\",\n \"0.5166163\",\n \"0.5166163\",\n \"0.5164798\",\n \"0.5159895\",\n \"0.51577723\",\n \"0.51466894\",\n \"0.51191026\",\n \"0.5105412\",\n \"0.51012903\",\n \"0.5097146\",\n \"0.5097039\",\n \"0.5095463\",\n \"0.5087037\",\n \"0.5083879\",\n \"0.5081339\",\n \"0.5076056\",\n \"0.5074391\",\n \"0.5053108\",\n \"0.50462604\",\n \"0.50447124\",\n \"0.50446165\",\n \"0.5043029\",\n \"0.5039403\",\n \"0.50290424\",\n \"0.5024794\",\n \"0.50211895\",\n \"0.5019482\",\n \"0.5016269\",\n \"0.5014021\",\n \"0.50109106\",\n \"0.50098157\",\n \"0.50001466\",\n \"0.49981922\",\n \"0.49936116\",\n \"0.49918625\",\n \"0.49913254\",\n \"0.4987713\",\n \"0.49828133\",\n \"0.49737862\",\n \"0.4973755\",\n \"0.4972991\",\n \"0.49690774\",\n \"0.4958239\",\n \"0.49553755\",\n \"0.49470916\",\n \"0.49444833\",\n \"0.49444512\",\n \"0.49387145\",\n \"0.4938554\",\n \"0.49325183\",\n \"0.49312603\",\n \"0.49308988\",\n \"0.4929141\",\n \"0.49257082\",\n \"0.49140707\",\n \"0.4906089\",\n \"0.48970327\",\n \"0.4894203\",\n \"0.48938707\",\n \"0.48938707\",\n \"0.48928517\",\n \"0.4882542\",\n \"0.4881907\",\n \"0.48768255\",\n \"0.48760873\",\n \"0.48702335\",\n \"0.4868665\",\n \"0.4865804\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.0"},"document_rank":{"kind":"string","value":"-1"}}},{"rowIdx":6086,"cells":{"query":{"kind":"string","value":"return True if images read on file are identical, False otherwise"},"document":{"kind":"string","value":"def compare_image_buffers(imgbuf1, imgbuf2):\n with io.BytesIO(imgbuf1) as imgio1, io.BytesIO(imgbuf2) as imgio2:\n img1 = Image.open(imgio1)\n img2 = Image.open(imgio2)\n diff = ImageChops.difference(img1, img2)\n return not diff.getbbox()"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["def __compareImage(self, file1, file2):\n # arg=self.__validateString(str_arg)\n # file1, file2=arg.split(' ', 1)\n try:\n img1 = Image.open(file1)\n img2 = Image.open(file2)\n if img1.size != img2.size:\n return False\n by1 = img1.tobytes()\n by2 = img2.tobytes()\n # format r,g,b,255,r,g,b,255, 3 bytes = 1 point, 255=separator, total 4 bytes\n l = len(by1) / 4\n # total points and same points\n tp = 0\n sp = 0\n for j in range(l):\n i = j * 4\n tp += 1\n if by1[i] == by2[i] and by1[i + 1] == by2[i + 1] and by1[i + 2] == by2[i + 2]:\n sp += 1\n # max to 2% diff allowed\n if tp * 0.98 > sp:\n return False\n else:\n return True\n except Exception, e:\n printLog(self.threadName + \"Exception in __compareImage: %s\" % e.message, logging.ERROR)\n traceback.print_exc()\n return False\n finally:\n img1 = None\n img2 = None","def image_comparison(self):\n for result in self.cards:\n if result.image_status:\n return True\n return False","def are_files_equal(file1, file2):\n input_file_1 = open(file1, \"r\")\n input_file_2 = open(file2, \"r\")\n\n file1 = input_file_1.read()\n file2 = input_file_2.read()\n print(type(file1), file1, type(file2), file2)\n\n result =False\n if file1 == file1:\n result = True\n\n input_file_1.close()\n input_file_2.close()\n return result","def images_are_present(file_info):\n currentdir = os.path.join(WORKDIR, file_info['folder'])\n if not os.path.exists(currentdir):\n return False\n count = len([x for x in os.listdir(currentdir) if x.endswith('.png')])\n if count != file_info['size']:\n print([x for x in os.listdir(currentdir) if x.endswith('.png')])\n print('Count does not match')\n print(count)\n print(file_info['size'])\n return False\n return True","def is_new_based_on_imgs(soup):\n\n \n \n prev_hashes = get_prev_img_hashes()\n temp_hashes = get_temp_img_hashes(soup)\n\n if len(temp_hashes.difference(prev_hashes))>0:\n print(\"new, based on images\")\n return True\n else:\n return False","def compare_images(img1_path, img2_path):\n img1 = Image.open(img1_path)\n img2 = Image.open(img2_path)\n try:\n diff = ImageChops.difference(img1, img2)\n except ValueError:\n return False\n return diff.getbbox() is None","def file_present(self,imagefile=None):\n import hashlib\n if self.filesize()==0:\n return False # empty files are never present\n if imagefile==None:\n imagefile=self.imagefile # use this one\n for hashname in ['md5','sha1']:\n oldhash = self.tag(hashname)\n if oldhash:\n newhash = hashlib.new(hashname,self.contents(imagefile=imagefile)).hexdigest()\n return oldhash==newhash\n raise ValueError,\"Cannot process file \"+self.filename()+\": no hash in \"+str(self)","def _check_consistency_between_imaging_extractors(self):\n return True","def equal(self, file1, file2):\n\n if file1.size != file2.size:\n return False\n\n # Compare stat\n if self.use_stat and not self._equal_stat(file1, file2):\n return False\n\n # Compare times\n if self.use_times and not self._equal_times(file1, file2):\n return False\n\n # Compare attributes\n if self.use_attributes and not self._equal_attributes(file1, file2):\n return False\n\n # TODO: Optionally diff hashes\n\n return True","def check_images():\n\n print(f'Looking for duplicate images...')\n\n for image in images_in_directory:\n duplicate = check_image_for_duplicates(image)\n\n if (duplicate):\n print(f'Found {duplicate} to be a duplicate image of: {image}')\n remove_image(duplicate)\n pass","def check_image_for_duplicates(original_image):\n\n original_image_hash = get_average_hash(original_image)\n\n print(f'Checking for duplicate images for {original_image}')\n\n for potential_duplicate_image in images_in_directory:\n potential_duplicate_image_hash = get_average_hash(\n potential_duplicate_image)\n\n if ((original_image != potential_duplicate_image) & compare_image_hashes(original_image_hash, potential_duplicate_image_hash)):\n return potential_duplicate_image\n\n pass","def check_duplicate(fp1, fp2):\n try:\n subprocess.check_output(['diff', fp1, fp2])\n return True\n except subprocess.CalledProcessError:\n return False","def check_md5(file1, file2):\r\n with open(file1, \"rb\") as f1:\r\n h1 = hashlib.md5(f1.read()).digest()\r\n with open(file2, \"rb\") as f2:\r\n h2 = hashlib.md5(f2.read()).digest()\r\n return h1 == h2","def _compare_file(path1, path2):\n\n try:\n return _open_file(path1) == _open_file(path2)\n except OSError:\n return False","def assert_image_equal(path1, path2):\n test_im = np.asarray(Image.open(path1))\n ref_im = np.asarray(Image.open(path2))\n npt.assert_array_equal(test_im, ref_im)","def are_compatible_imgs(one_img, another_img):\n return have_same_shapes(one_img, another_img)","def images_exist(self):\n pass","def compare(file1, file2):\n\tfrom os.path import exists\n\tresult = False\n\t\n\tfile1 = adaptPath(file1)\n\tfile2 = adaptPath(file2)\n\t\n\t# If two files existing\n\tif exists(file1) and exists(file2):\n\t\t# If the date and size equal\n\t\tif getFileSize(file1) == getFileSize(file2):\n\t\t\ttry:\n\t\t\t\t# Read the content of first file\n\t\t\t\tcontent1 = open(file1, \"rb\").read()\n\t\t\t\ttry:\n\t\t\t\t\t# Read the content of second file\n\t\t\t\t\tcontent2 = open(file2, \"rb\").read()\n\t\t\t\t\t# If content differs\n\t\t\t\t\tif content1 == content2:\n\t\t\t\t\t\tresult = True\n\t\t\t\texcept IOError:\n\t\t\t\t\tpass\n\t\t\texcept IOError:\n\t\t\t\tpass\n\treturn result","def compare_files(fp1, fp2):\n\n line1 = fp1.readline()\n line2 = fp2.readline()\n\n while line1 and line2:\n if line1.startswith('#') and line2.startswith('#'):\n pass\n elif not line1 == line2:\n return False\n \n line1 = fp1.readline()\n line2 = fp2.readline()\n\n if line1 or line2:\n return False\n\n return True","def test_image_rw(self):\n from ..image import Image\n from ..io.image import read_image, write_image\n shape = (5,5)\n pix = np.random.uniform(size=shape)\n ivar = np.random.uniform(size=shape)\n mask = np.random.randint(0, 3, size=shape)\n img1 = Image(pix, ivar, mask, readnoise=1.0, camera='b0')\n write_image(self.testfile, img1)\n img2 = read_image(self.testfile)\n\n #- Check output datatypes\n self.assertEqual(img2.pix.dtype, np.float64)\n self.assertEqual(img2.ivar.dtype, np.float64)\n self.assertEqual(img2.mask.dtype, np.uint32)\n\n #- Rounding from keeping np.float32 on disk means they aren't equal\n self.assertFalse(np.all(img1.pix == img2.pix))\n self.assertFalse(np.all(img1.ivar == img2.ivar))\n\n #- But they should be close, and identical after float64->float32\n self.assertTrue(np.allclose(img1.pix, img2.pix))\n self.assertTrue(np.all(img1.pix.astype(np.float32) == img2.pix))\n self.assertTrue(np.allclose(img1.ivar, img2.ivar))\n self.assertTrue(np.all(img1.ivar.astype(np.float32) == img2.ivar))\n\n #- masks should agree\n self.assertTrue(np.all(img1.mask == img2.mask))\n self.assertEqual(img1.readnoise, img2.readnoise)\n self.assertEqual(img1.camera, img2.camera)\n self.assertEqual(img2.mask.dtype, np.uint32)\n\n #- should work with various kinds of metadata header input\n meta = dict(BLAT='foo', BAR='quat', BIZ=1.0)\n img1 = Image(pix, ivar, mask, readnoise=1.0, camera='b0', meta=meta)\n write_image(self.testfile, img1)\n img2 = read_image(self.testfile)\n for key in meta:\n self.assertEqual(meta[key], img2.meta[key], 'meta[{}] not propagated'.format(key))\n\n #- img2 has meta as a FITS header instead of a dictionary;\n #- confirm that works too\n write_image(self.testfile, img2)\n img3 = read_image(self.testfile)\n for key in meta:\n self.assertEqual(meta[key], img3.meta[key], 'meta[{}] not propagated'.format(key))","def is_RGB(self,img_path):\n image=Image.open(img_path)\n image=np.asarray(image)\n if(len(image.shape)<3):\n return False\n return True","def has_images(self):\n return len(self.images) > 0","def samefile(path1, path2):\n try:\n return os.path.samefile(path1, path2)\n except OSError as err:\n if err.errno == 2: # ENOENT\n return False\n else:\n raise","def check_duplicates(files):\n # If we don't have two files, it's kind of meaningless. True or False\n # would be fine.\n if len(files) < 2:\n return True\n file1 = files[0]\n # Compare every file to the first file. If they're all the same, they're\n # all duplicates. If any one of them isn't, they're not all duplicates\n # so return False.\n for f in files[1:]:\n if not no_diff(file1, f):\n return False\n return True","def compare_group_images(directory, show_imgs=True, similarity=\"high\", compression=100):\n # list where the found duplicate/similar images are stored\n duplicates = []\n lower_res = []\n\n imgs_matrix = create_imgs_matrix(directory, compression)\n\n # search for similar images\n if similarity == \"low\":\n ref = 13000\n # search for 1:1 duplicate images\n else:\n ref = 21000\n\n main_img = 0\n compared_img = 1\n nrows, ncols = compression, compression\n srow_A = 0\n erow_A = compression\n srow_B = erow_A\n erow_B = srow_B + compression\n\n while erow_B <= imgs_matrix.shape[0]:\n while compared_img < (len(image_files)):\n # select two images from imgs_matrix\n imgA = imgs_matrix[srow_A: erow_A, # rows\n 0: ncols] # columns\n imgB = imgs_matrix[srow_B: erow_B, # rows\n 0: ncols] # columns\n # compare the images\n rotations = 0\n while image_files[main_img] not in duplicates and rotations <= 3:\n if rotations != 0:\n imgB = rotate_img(imgB)\n err = mse(imgA, imgB)\n print ( \"err:\", err)\n if err <= ref:\n if show_imgs == True:\n show_file_info(compared_img, main_img)\n add_to_list(image_files[main_img], duplicates)\n check_img_quality(directory, image_files[main_img], image_files[compared_img], lower_res)\n rotations += 1\n srow_B += compression\n erow_B += compression\n compared_img += 1\n\n srow_A += compression\n erow_A += compression\n srow_B = erow_A\n erow_B = srow_B + compression\n main_img += 1\n compared_img = main_img + 1\n\n msg = \"\\n***\\n DONE: found \" + str(len(duplicates)) + \" duplicate image pairs in \" + str(\n len(image_files)) + \" total images.\\n The following files have lower resolution:\"\n print(msg)\n return set(lower_res)","def verify(image_path):\n try:\n with Image.open(image_path) as img:\n img.verify()\n return True\n except Exception as e:\n log.warn('Path [{}] does not point to an image: [{}]'.format(image_path, e))\n return False","def check_if_original(article):\n num_img = len(article.find_all(\"img\"))\n return num_img < 2","def compare_contents(lhs, rhs):\n for filename in (lhs, rhs):\n if not os.path.exists(filename):\n return False\n\n with open(lhs, \"r\") as lhs_file, open(rhs, \"r\") as rhs_file:\n return lhs_file.read() == rhs_file.read()","def load_from_images(self):\n logging.debug(\"load_from_images called\")\n return True","def check_duplicate_image_name(image_paths):\n image_names = [os.path.basename(os.path.splitext(p)[0]) for p in image_paths]\n\n num_images = len(image_names)\n\n num_unique = len(set(image_names))\n\n if num_images != num_unique:\n raise ValueError('Found %d duplicate images.' % (num_images - num_unique))\n\n logging.info('Found no duplicates in %d images.', num_images)","def verifyShiftFile(self):\n if self['refimage'] and fu.findFile(self['refimage']):\n return True\n else: return False","def verifyFile(source, destination):\n\tsourceHash = hashlib.sha256(open(source, 'rb').read()).digest()\n\tdestinationHash = hashlib.sha256(open(destination, 'rb').read()).digest()\n\n\tif sourceHash == destinationHash:\n\t\treturn (True, str(sourceHash))\n\n\treturn False","def img_compare(file1, file2):\n # read image\n img1 = Image.open(file1)\n img2 = Image.open(file2)\n\n # resize \n size = 128, 128\n img1_res = img_resize(img1, size)\n img2_res = img_resize(img2, size)\n\n img1_res.save(\"img_1.thumbnail\", \"JPEG\")\n img2_res.save(\"img_2.thumbnail\", \"JPEG\")\n\n # convert to gray scale\n img1_grayscale = img1_res.convert('LA')\n img1_grayscale.save(\"img_1_grayscale.png\")\n\n img2_grayscale = img2_res.convert('LA')\n img2_grayscale.save(\"img_2_grayscale.png\")\n\n # normalise\n img1_norm = normalize(np.array(img1_grayscale.getdata()).astype(float))\n img2_norm = normalize(np.array(img2_grayscale.getdata()).astype(float))\n\n try:\n # compare two images\n diff = img1_norm - img2_norm\n m_norm = sum(abs(diff)) # Manhattan norm\n z_norm = norm(diff.ravel(), 0) # Zero norm\n\n # print(\"Manhattan norm:\", m_norm, \"/ per pixel:\", m_norm/img1_norm.size)\n # print(\"Zero norm:\", z_norm, \"/ per pixel:\", z_norm*1.0/img1_norm.size)\n\n return m_norm/img1_norm.size, float(z_norm) / img1_norm.size\n except:\n return 100, 100","def equal_file_sum(file1_paht, file2_paht):\n md5_sum1 = generate_sum(file1_path)\n md5_sum2 = generate_sum(file2_path)\n return (md5_sum1 == md5_sum2)","def _is_tracked(filename, metadata):\n current_local_sha = local_metadata.get(filename, None)\n current_remote_sha = metadata.get(filename, None)\n return current_local_sha is not None \\\n and current_remote_sha is not None \\\n and current_local_sha == current_remote_sha","def check_type(filename):\n try:\n im = Image.read(filename)\n except SanperaError:\n return False\n else:\n return im.original_format in [b'JPEG', b'PNG', b'GIF']","def is_new_red_camera():\r\n ids = range(15)\r\n for id in ids:\r\n name = 'red{:04d}.fits'.format(id)\r\n if os.path.exists(name):\r\n hdr = pyfits.getheader(name)\r\n if hdr['NAXIS1'] == 4141 or hdr['NAXIS1'] == 4114:\r\n return True\r\n elif hdr['NAXIS1'] == 1024 or hdr['NAXIS1'] == 1124:\r\n return False\r\n else:\r\n raise ValueError('Unexpected image size')\r\n else:\r\n continue\r\n\r\n # raise ValueError('Could not locate red side files')\r\n print 'Could not locate red side files--defaulting to new camera'\r\n return True","def is_newccd(filename):\n fh = fits.open(filename)\n out = False\n if len(fh) == 4:\n out = True\n\n fh.close()\n return out","def _fileinfo_has_changed(self, metadata_filename, new_fileinfo):\n \n # If there is no fileinfo currently stored for 'metadata_filename',\n # try to load the file, calculate the fileinfo, and store it.\n if metadata_filename not in self.fileinfo:\n self._update_fileinfo(metadata_filename)\n\n # Return true if there is no fileinfo for 'metadata_filename'.\n # 'metadata_filename' is not in the 'self.fileinfo' store\n # and it doesn't exist in the 'current' metadata location.\n if self.fileinfo.get(metadata_filename) is None:\n return True\n\n current_fileinfo = self.fileinfo[metadata_filename]\n\n if current_fileinfo['length'] != new_fileinfo['length']:\n return True\n\n # Now compare hashes. Note that the reason we can't just do a simple\n # equality check on the fileinfo dicts is that we want to support the\n # case where the hash algorithms listed in the metadata have changed\n # without having that result in considering all files as needing to be\n # updated, or not all hash algorithms listed can be calculated on the\n # specific client.\n for algorithm, hash_value in new_fileinfo['hashes'].items():\n # We're only looking for a single match. This isn't a security\n # check, we just want to prevent unnecessary downloads.\n if hash_value == current_fileinfo['hashes'][algorithm]:\n return False\n\n return True","def hasImages(self):\n return len(self.getImages()) > 0","def hasImages(self):\n return len(self.getImages()) > 0","def _compare_files(self, first_file, second_file):\n\n self.log.info('-' * 80)\n self.log.info('Compare files')\n\n code, out = cmd_exec(['cmp', str(first_file), str(second_file)], shell=False, log=self.log)\n if code:\n self.log.warning('md5 checksum IS NOT SAME with ffmpeg sw decode')\n self.log.warning(out)\n return False\n\n self.log.info('md5 checksum IS SAME with ffmpeg sw decode')\n return True","def is_jpegxl_recompressed_jpeg_file(filename):\n try:\n with open(filename, 'rb') as h:\n header = h.read(len(JPEGXL_RECOMPRESSED_JPEG_HEADER))\n # Cf. https://arxiv.org/pdf/1908.03565.pdf, section 9.1,\n # on recompressed-JPEG header.\n return header == JPEGXL_RECOMPRESSED_JPEG_HEADER\n except: # pylint:disable=bare-except\n # If anything failed, this means that we cannot establish that the file\n # has the expected header, so we return False.\n return False","def cmp(f1, f2):\n with open(f1) as f1, open(f2) as f2:\n return f1.read() == f2.read()","def test_duplicate_images_error(self):\n with self.assertRaises(AssertionError):\n disk.merge_datasets(self.input_datasets, self.output_dataset)\n\n # Original dataset shouldn't be modified.\n self.assertEqual(0, len(self.output_dataset.metadata()))","def equals(self, image: 'BaseImage') -> bool:\n assert isinstance(image, BaseImage)\n im1 = pygame.image.tostring(self._surface, 'RGBA')\n im2 = pygame.image.tostring(image._surface, 'RGBA')\n return im1 == im2","def number_of_images_valid():\r\n if number_of_images_a_valid() and number_of_images_b_valid():\r\n return True\r\n else:\r\n return False","def check_image(df, fname_col, img_dir):\n\n\tfor filename in df[fname_col].values[0:4]:\n\n\t\tif not os.path.isfile(img_dir+filename):\n\t\t\tlogger.error(\"path {} does not exit\".format(img_dir+filename))\n\t\t\tsuccess = False\n\t\telse:\n\t\t\ttry:\n\t\t\t\timg = mpimg.imread(img_dir + filename)\n\t\t\t\tsuccess = True\n\t\t\texcept OSError:\n\t\t\t\tsuccess = False\n\t\t\t\tlogger.error(\"image is {} corrupted/missing\".\n\t\t\t\t\t\t\t\t\t\t\t\t\tformat(filename))\n\t\t\t\t\n\treturn success","def check_files(self):\n for f in self.filenames:\n img = cv2.imread(f, int(self.color))\n if img is None:\n os.remove(f)","def same_file(wavecar1, wavecar2, wavecar3):\n same = False\n if (filecmp.cmp(wavecar1, wavecar2, shallow=False)):\n print(\"Serious problem:: {} and {} are the same\".format(wavecar1, wavecar2))\n same = True\n if (filecmp.cmp(wavecar1, wavecar3, shallow=False)):\n print(\"Serious problem:: {} and {} are the same\".format(wavecar1, wavecar3))\n same = True\n if (filecmp.cmp(wavecar2, wavecar3, shallow=False)):\n print(\"Serious problem:: {} and {} are the same\".format(wavecar2, wavecar3))\n same = True\n\n if same:\n print(\"It seems that you are using same files to do finite difference, exit\")\n print(\"\\tComment the 'same_file' checker if you know what you are doing\")\n raise SystemExit","def _compare_jpg_decode_with_pil(test_case, images, print_debug_info=False):\n of_decoded_images = _of_image_decode(images)\n pil_images = [Image.open(image) for image in images]\n # convert image to BGR\n pil_decoded_images = [np.array(image)[:, :, ::-1] for image in pil_images]\n\n for of_decoded_image, pil_decoded_image in zip(\n of_decoded_images, pil_decoded_images\n ):\n of_decoded_image = of_decoded_image.squeeze()\n test_case.assertTrue(len(of_decoded_image.shape) == 3)\n test_case.assertTrue(len(pil_decoded_image.shape) == 3)\n\n diff = of_decoded_image - pil_decoded_image\n diff_index = np.where(diff != 0)\n diff_abs_values = diff[diff_index]\n\n if print_debug_info:\n print(\"of_decoded_image:\\n\", of_decoded_image, of_decoded_image.shape)\n print(\"pil_decoded_image:\\n\", pil_decoded_image, pil_decoded_image.shape)\n print(\"diff_index:\\n\", diff_index)\n print(\"diff_abs_values:\\n\", diff_abs_values)\n print(\n \"of_decoded_image diff:\\n\",\n of_decoded_image[diff_index[0], diff_index[1]],\n )\n print(\n \"pil_decoded_image diff:\\n\",\n pil_decoded_image[diff_index[0], diff_index[1]],\n )\n\n # only green channel has difference of 1\n test_case.assertTrue(np.all(diff_index[-1] == 1))\n test_case.assertTrue(np.all(diff_abs_values == 1))","def check_md5sum(file1: str, file2: str) -> bool:\n return get_md5_hash(file1) == get_md5_hash(file2)","def checkImageDimensions(self, filenames):\n\t\ts = None\n\t\thashStr = filenames[:]\n\t\thashStr.sort()\n\t\thashStr = str(hashStr)\n\t\t# check to see if there's already a result of the check for these filenames in the cache\n\t\tif hashStr in self.dimensionCheck:\n\t\t\tLogging.info(\"Using cached result for dimensions check: %s\"%(str(self.dimensionCheck[hashStr])))\n\t\t\treturn self.dimensionCheck[hashStr]\n\t\t\t\n\t\tfor file in filenames:\n\t\t\tif file not in self.imageDims:\n\t\t\t\tprint \"Trying to open\",type(file)\n\t\t\t\ttry:\n\t\t\t\t\tself.ext = file.split(\".\")[-1].upper()\n\t\t\t\t\tif self.ext == \"TIF\":\n\t\t\t\t\t\tself.ext = \"TIFF\"\n\t\t\t\t\tif self.ext == \"JPG\":\n\t\t\t\t\t\tself.ext = \"JPEG\"\n\n\t\t\t\t\tif self.ext == \"VTI\":\n\t\t\t\t\t\treader = vtk.vtkXMLImageReader()\n\t\t\t\t\telse:\n\t\t\t\t\t\treader = eval(\"vtk.vtk%sReader()\"%self.ext)\n\t\t\t\t\treader.SetFileName(file)\n\t\t\t\t\treader.UpdateInformation()\n\t\t\t\texcept IOError, ex:\n\t\t\t\t\ttraceback.print_exc()\n\t\t\t\t\traise Logging.GUIError(\"Cannot open image file\", \"Cannot open image file %s\" % file)\n\n\t\t\t\textent = reader.GetDataExtent()\n\t\t\t\tfSize = (extent[1],extent[3])\n\t\t\t\tself.imageDims[file] = fSize\n\t\t\telse:\n\t\t\t\tfSize = self.imageDims[file]\n\t\t\tif s and fSize != s:\n\t\t\t\tx0, y0 = s\n\t\t\t\tx1, y1 = fSize\n\t\t\t\tself.dimensionCheck[hashStr] = False\n\t\t\t\treturn 0\n\t\t\ts = fSize \n\t\t\tfn = file\n\t\tself.dimensionCheck[hashStr] = True\n\t\treturn 1","def check_files(self):\n print('checking files')\n for f in self.filenames:\n img = cv2.imread(f, int(self.color))\n if img is None:\n os.remove(f)","def is_different(image1, image2):\n gray1 = cv2.cvtColor(image1, cv2.COLOR_RGB2GRAY)\n gray2 = cv2.cvtColor(image2, cv2.COLOR_RGB2GRAY)\n\n (score, diff) = compare_ssim(gray1, gray2, full=True)\n diff = (diff * 255).astype(\"uint8\")\n\n thresh = cv2.threshold(diff, 0, 255,\n cv2.THRESH_BINARY_INV | cv2.THRESH_OTSU)[1]\n cnts = cv2.findContours(thresh, cv2.RETR_EXTERNAL,\n cv2.CHAIN_APPROX_SIMPLE)\n cnts = cnts[0] if imutils.is_cv2() else cnts[1]\n\n return bool(cnts)","def consistent(self):\n return self.incore_digest == self.ondisk_digest","def compare(actor, frame):\n urlretrieve(actor, 'actor.jpg')\n\n with open(\"frame_image.jpg\", 'wb') as frame_image:\n frame_image.write(base64.b64decode(frame[23:]))\n\n actor_encoding = face_encodings(load_image_file('actor.jpg'))[0]\n frame_encoding = face_encodings(load_image_file('frame_image.jpg'))\n\n os.remove('actor.jpg')\n os.remove('frame_image.jpg')\n for encoding in frame_encoding:\n if compare_faces([actor_encoding], encoding):\n return True\n return False","def test_read(self):\n for line in TESTIMAGES.split('\\n'):\n vals = line.strip().split()\n name = vals[0]\n logger.debug(\"Testing file %s\" % name)\n dim1, dim2 = [int(x) for x in vals[1:3]]\n mini, maxi, mean, stddev = [float(x) for x in vals[3:]]\n obj = raxisimage()\n obj.read(os.path.join(os.path.dirname(self.mar), name))\n\n self.assertAlmostEqual(mini, obj.getmin(), 2, \"getmin [%s,%s]\" % (mini, obj.getmin()))\n self.assertAlmostEqual(maxi, obj.getmax(), 2, \"getmax [%s,%s]\" % (maxi, obj.getmax()))\n self.assertAlmostEqual(mean, obj.getmean(), 2, \"getmean [%s,%s]\" % (mean, obj.getmean()))\n self.assertAlmostEqual(stddev, obj.getstddev(), 2, \"getstddev [%s,%s]\" % (stddev, obj.getstddev()))\n self.assertEqual(dim1, obj.dim1, \"dim1\")\n self.assertEqual(dim2, obj.dim2, \"dim2\")\n self.assertNotEqual(obj.dim1, obj.dim2, \"dim2!=dim1\")","def check_fileName(session) -> 'bool':\n c = get_client()\n cursor = c.find({},{\"size\":1, \"_id\":0})\n print(session)\n for document in cursor:\n print(document)\n if hmac.compare_digest(session, document[\"size\"]):\n return True\n print(\"size \", document[\"size\"])\n return False","def hasImg(img_name):\n try:\n Image.objects.raw({\"_id\": img_name}).first()\n return True\n except pymodm_errors.DoesNotExist:\n return False","def assert_data_correct(self) -> bool:\n if not self.training_folder.exists():\n return False\n # 27: number of characters\n # 27*2: 27 original font characters and 27 folders with morphed version\n if len(list(self.training_folder.iterdir())) not in [27, 27 * 2]:\n return False\n # assert that each character folder has the expected number of images inside\n # expected number is repetitions + original, or just original if no morphing\n # took place\n for directory in self.training_folder.iterdir():\n img_count = len(list(directory.iterdir()))\n if img_count != self.repetitions + 1 and img_count != 1:\n return False\n return True","def check_files(self):\n print('checking files')\n for f in tqdm(self.filenames):\n img = cv2.imread(f, int(self.color))\n if img is None:\n os.remove(f)","def hasImage(self):\n if self.getImage():\n return True\n return False","def _check_images_and_labels(self, image_dir, label_dir):\n return len(os.listdir(image_dir))==len(os.listdir(label_dir))","def test_is_image(self):\n os.chdir(\"testimages/\")\n self.assertTrue(fileactions.is_image(\"arch_001.jpg\"))\n self.assertFalse(fileactions.is_image(\"not_an_image.jpg\"))","def check(self, grain=50):\n opengles.glReadPixels(0, 0, self.ix, self.iy,\n GL_RGB, GL_UNSIGNED_BYTE,\n ctypes.byref(self.img))\n r0 = self.img[0:3]\n step = 3 * int(self.ix * self.iy / 50)\n for i in xrange(0, len(self.img)-3, step):\n if self.img[i:(i+3)] != r0:\n return True\n\n return False","def file_should_be_processed(self, filepath):\n try:\n image.load(filepath)\n return True\n except:\n return False","def assert_data_fragments_correct(self) -> bool:\n read_path = Path(os.environ[\"DATA_PATH\"]) / \"fragments\"\n if not read_path.exists():\n return False\n bin_images = [img for img in read_path.iterdir() if \"binarized\" in img.name]\n if len(bin_images) == 0:\n return False\n return True","def __compare_files(self, filename1, filename2):\n self.assertTrue(os.path.isfile(filename1))\n self.assertTrue(os.path.isfile(filename2))\n self.assertEqual(os.path.getsize(filename1), os.path.getsize(filename2))\n with open(filename1, \"rb\") as f1:\n with open(filename2, \"rb\") as f2:\n n_blocks = int(self.args.size) // self.max_block_size\n for i in range(n_blocks):\n self.assertEqual(f1.read(self.max_block_size), \\\n f2.read(self.max_block_size))\n remaining = int(self.args.size) % self.max_block_size\n if remaining > 0:\n self.assertEqual(f1.read(remaining), \\\n f2.read(remaining))","def _check_flip(origin_imgs, result_imgs):\n h, w, c = origin_imgs.shape\n for i in range(h):\n for j in range(w):\n for k in range(c):\n if result_imgs[i, j, k] != origin_imgs[i, w - 1 - j, k]:\n return False\n return True","def isopen(self):\n return _image.image_isopen(self)","def test_sanity_ati1():\n\n with Image.open(TEST_FILE_ATI1) as im:\n im.load()\n\n assert im.format == \"DDS\"\n assert im.mode == \"L\"\n assert im.size == (64, 64)\n\n assert_image_equal_tofile(im, TEST_FILE_ATI1.replace(\".dds\", \".png\"))","def __is_image_id( self, image_id ):\n images_ids = self.__get_multi_images_ids()\n for id in images_ids:\n if image_id == id:\n return True\n return False","def check_overwrite(self, filename, workspace):\n if not self.overwrite.value and os.path.isfile(filename):\n try:\n return (\n workspace.interaction_request(\n self, workspace.measurements.image_set_number, filename\n )\n == \"Yes\"\n )\n except workspace.NoInteractionException:\n raise ValueError(\n 'SaveImages: trying to overwrite %s in headless mode, but Overwrite files is set to \"No\"'\n % (filename)\n )\n return True","def assert_img_equal(request):\n\n testname = request.node.name\n filename = Path(request.module.__file__)\n test_dir = filename.parent / filename.stem\n test_dir.mkdir(exist_ok=True)\n\n def _img_equal(img, index=0):\n expected_file = test_dir / f\"{testname}_{index}.png\"\n actual_file = test_dir / f\"{testname}_{index}_actual.png\"\n if img.ndim == 2:\n cv2.imwrite(str(actual_file), img)\n else:\n img_bgr = img.copy()\n img_bgr[..., :3] = img_bgr[..., :3][..., ::-1]\n cv2.imwrite(str(actual_file), img_bgr) # img is RGB, imwrite expects BGR\n\n if not expected_file.exists():\n raise AssertionError(\n f\"{expected_file} does not exist! Check newly produced img with a command like:\\n\\n feh {actual_file}\\n\\n\"\n )\n\n try:\n pytest.helpers.assert_img_equal(expected_file, img)\n except Exception as e:\n raise AssertionError(f\"{expected_file} differs from {actual_file}\") from e\n\n return _img_equal","def is_image(mine=None, file=None):\n if file:\n mine = get_file_mine(file)\n print(mine)\n if mine:\n return mine.find('image') != -1\n\n return False","def compare_image_hashes(image_hash, potential_duplicate_hash):\n\n return image_hash - potential_duplicate_hash < image_hash_comparison_cutoff","def __lt__(self, img):\r\n ordering = self.config['algorithm_ordering']\r\n ordering = ordering[1:] if ordering.startswith('-') else ordering\r\n\r\n if ordering == \"filename\":\r\n return sorted([self.filename, img.filename])[0] == img.filename\r\n if ordering == 'width':\r\n return self.absolute_width <= img.absolute_width\r\n elif ordering == 'height':\r\n return self.absolute_height <= img.absolute_height\r\n elif ordering == 'area':\r\n return self.absolute_width * self.absolute_height <= img.absolute_width * img.absolute_height\r\n else:\r\n return max(self.absolute_width, self.absolute_height) <= max(img.absolute_width, img.absolute_height)","def test_on_skimage_png(self):\n from_skimage = diffread(TEST_PNG)\n\n self.assertTupleEqual(from_skimage.shape, (256, 256))\n self.assertTrue(np.allclose(from_skimage, np.ones_like(from_skimage)))","def rgb(self) -> bool:\n return self.image_shape[2] == 3","def md5check(fname, md5fname):\n\tmd5fh = open(md5fname, \"r\")\n\treturn (md5sum(fname) == md5fh.readline())","def verify_media(self):\n self.check_dataset_duplicate_ids(self.media)","def test_check_wrong_image(self):\n result = analyzer.check_image_color(\"tests/test_files/non_exists.jpg\")\n self.assertEqual(result, \"Image not found\")","def identify_duplicates(file1, outname, RA=\"RA\", DEC=\"DEC\", dist=1):\n command = (\n f'stilts tmatch1 matcher=sky values=\"{RA} {DEC}\" params={dist} '\n + f\"action=identify in={file1} out={outname}\"\n )\n try:\n subprocess.check_output(command, shell=True, executable=\"/bin/zsh\")\n return True\n except:\n shutil.copyfile(file1, outname)\n return False","def is_valid_image(image):\n if image not in AVAILABLE_IMAGES.keys():\n return False\n\n return True","def check_duplicates(self, file_path):\n\t\tif not file_path:\n\t\t\treturn file_path\n\t\tif not self.settings.get('deduplicate_files', True):\n\t\t\t# Deduplication disabled.\n\t\t\treturn file_path\n\t\twas_new, existing_path = hashjar.add_hash(file_path) # Check if the file exists already.\n\t\tif not was_new:\n\t\t\tprint(\"\\tFile already exists! Resolving...\")\n\t\t\t# Quick and dirty comparison, assumes larger filesize means better quality.\n\t\t\tif os.path.isfile(file_path) and os.path.isfile(existing_path):\n\t\t\t\tif os.path.getsize(file_path) > os.path.getsize(existing_path):\n\t\t\t\t\tprint('\\t\\tNew file was better quality. Removing old file.')\n\t\t\t\t\tos.remove(existing_path)\n\t\t\t\t\tfor ele in self.loader.get_elements_for_file(existing_path):\n\t\t\t\t\t\tele.remap_file(existing_path, file_path)\n\t\t\t\t\treturn file_path\n\t\t\t\telse:\n\t\t\t\t\tprint(\"\\tOld file was better quality, removing newer file.\")\n\t\t\t\t\tos.remove(file_path)\n\t\t\t\t\treturn existing_path\n\t\treturn file_path","def check(self, grain=50):\r\n opengles.glDisable(GL_SCISSOR_TEST)\r\n self.s_flg = False\r\n opengles.glReadPixels(0, self.y0, self.ix, 1,\r\n GL_RGB, GL_UNSIGNED_BYTE,\r\n ctypes.byref(self.img))\r\n r0 = self.img[0:3]\r\n for i in xrange(0, self.img_sz, self.step):\r\n if self.img[i:(i+3)] != r0:\r\n return True\r\n\r\n return False","def mapsMatch(m1,m2):\n same = True\n f1 = file(m1,'r').readlines()\n f2 = file(m2,'r').readlines()\n for i, row in enumerate(f1):\n row = row.strip().split()\n row2 = f2[i].strip().split()\n if row[0] <> row2[0]:\n\t same = False\n break\n return same","def coherent(self):\n return self.uris.size == self.sockets.size","def is_equal(image_a, image_b, tolerance=0.0):\n return image_diff_percent(image_a, image_b) <= tolerance","def _assets_are_stale(self, sourcedirectory, cachedirectory):\n comparison = filecmp.dircmp(sourcedirectory, cachedirectory, [], [])\n if comparison.left_only or comparison.right_only:\n # We have files in one directory and not the other\n return True\n if comparison.diff_files:\n # Some of the files have changed\n return True\n\n return False","def md5_match(file_path, reference_md5):\n\n with open(file_path, \"rb\") as f:\n\n data = f.read()\n\n file_md5 = md5(data).hexdigest()\n\n return file_md5 == reference_md5","def compare(self, checksum):\n real_checksum = checksum\n if len(checksum) > self.hasher_size:\n real_checksum = checksum[0:self.hasher_size]\n afile = checksum[self.hasher_size:len(checksum)]\n self.path = os.path.join(self.path, afile)\n self.compute()\n return self.real_checksum == real_checksum","def read_file(filename):\n\tprint(\"Beginning file read...\")\n\tmy_image = cv2.imread(filename)\n\treturn computer_hash(my_image)","def __eq__(self, other):\n if not isinstance(other, ImageInfo):\n return False\n\n return self.__dict__ == other.__dict__","def check_sub_image(self, ndvi_filename, input_path):\n rgb_filename = re.sub(\"BWNDVI\",\"RGB\",ndvi_filename)\n rgb_img = Image.open(self.get_file(os.path.join(input_path, rgb_filename),\n self.input_location_type))\n img_ok = check_image_ok(rgb_img, 0.05)\n return img_ok","def check_already_extracted(video_parts):\n filename_no_ext, _ = video_parts\n return bool(os.path.exists(os.path.join(output_dir,\n filename_no_ext + '-0030.jpg')))","def check_consistency(trained_model, filename):\n # First, check that the model supports consistency checking (has _source_hash).\n if not hasattr(trained_model, '_source_hash'):\n return True # No check was done (so we assume it's all fine).\n trained_source_hash = trained_model._source_hash\n with open(filename, 'r') as ff:\n code = ff.read()\n m = hashlib.sha256()\n m.update(code.encode())\n true_source_hash = m.hexdigest()\n return trained_source_hash == true_source_hash","def test_consitency_manual(self):\n name = os.path.basename(self.cbf_filename)\n obj = fabio.open(self.cbf_filename)\n new = fabio.cbfimage.cbfimage(data=obj.data, header=obj.header)\n new.write(os.path.join(self.tempdir, name))\n other = fabio.open(os.path.join(self.tempdir, name))\n self.assertEqual(abs(obj.data - other.data).max(), 0, \"data are the same\")\n for key in obj.header:\n if key in[ \"filename\", \"X-Binary-Size-Padding\"]:\n continue\n self.assertTrue(key in other.header, \"Key %s is in header\" % key)\n self.assertEqual(obj.header[key], other.header[key], \"value are the same for key %s [%s|%s]\" % (key, obj.header[key], other.header[key]))","def reversible(self) -> bool:\n xy_row = np.column_stack(\n (\n np.linspace(\n -self.imgsz[0] / (2 * self.f[0]),\n self.imgsz[0] / (2 * self.f[0]),\n int(self.imgsz[0]),\n ),\n np.zeros(int(self.imgsz[0])),\n )\n )\n dxy = self._distort(xy_row)\n continuous_row = np.all(dxy[1:, 0] >= dxy[:-1, 0])\n xy_col = np.column_stack(\n (\n np.zeros(int(self.imgsz[1])),\n np.linspace(\n -self.imgsz[1] / (2 * self.f[1]),\n self.imgsz[1] / (2 * self.f[1]),\n int(self.imgsz[1]),\n ),\n )\n )\n dxy = self._distort(xy_col)\n continuous_col = np.all(dxy[1:, 1] >= dxy[:-1, 1])\n return continuous_row and continuous_col"],"string":"[\n \"def __compareImage(self, file1, file2):\\n # arg=self.__validateString(str_arg)\\n # file1, file2=arg.split(' ', 1)\\n try:\\n img1 = Image.open(file1)\\n img2 = Image.open(file2)\\n if img1.size != img2.size:\\n return False\\n by1 = img1.tobytes()\\n by2 = img2.tobytes()\\n # format r,g,b,255,r,g,b,255, 3 bytes = 1 point, 255=separator, total 4 bytes\\n l = len(by1) / 4\\n # total points and same points\\n tp = 0\\n sp = 0\\n for j in range(l):\\n i = j * 4\\n tp += 1\\n if by1[i] == by2[i] and by1[i + 1] == by2[i + 1] and by1[i + 2] == by2[i + 2]:\\n sp += 1\\n # max to 2% diff allowed\\n if tp * 0.98 > sp:\\n return False\\n else:\\n return True\\n except Exception, e:\\n printLog(self.threadName + \\\"Exception in __compareImage: %s\\\" % e.message, logging.ERROR)\\n traceback.print_exc()\\n return False\\n finally:\\n img1 = None\\n img2 = None\",\n \"def image_comparison(self):\\n for result in self.cards:\\n if result.image_status:\\n return True\\n return False\",\n \"def are_files_equal(file1, file2):\\n input_file_1 = open(file1, \\\"r\\\")\\n input_file_2 = open(file2, \\\"r\\\")\\n\\n file1 = input_file_1.read()\\n file2 = input_file_2.read()\\n print(type(file1), file1, type(file2), file2)\\n\\n result =False\\n if file1 == file1:\\n result = True\\n\\n input_file_1.close()\\n input_file_2.close()\\n return result\",\n \"def images_are_present(file_info):\\n currentdir = os.path.join(WORKDIR, file_info['folder'])\\n if not os.path.exists(currentdir):\\n return False\\n count = len([x for x in os.listdir(currentdir) if x.endswith('.png')])\\n if count != file_info['size']:\\n print([x for x in os.listdir(currentdir) if x.endswith('.png')])\\n print('Count does not match')\\n print(count)\\n print(file_info['size'])\\n return False\\n return True\",\n \"def is_new_based_on_imgs(soup):\\n\\n \\n \\n prev_hashes = get_prev_img_hashes()\\n temp_hashes = get_temp_img_hashes(soup)\\n\\n if len(temp_hashes.difference(prev_hashes))>0:\\n print(\\\"new, based on images\\\")\\n return True\\n else:\\n return False\",\n \"def compare_images(img1_path, img2_path):\\n img1 = Image.open(img1_path)\\n img2 = Image.open(img2_path)\\n try:\\n diff = ImageChops.difference(img1, img2)\\n except ValueError:\\n return False\\n return diff.getbbox() is None\",\n \"def file_present(self,imagefile=None):\\n import hashlib\\n if self.filesize()==0:\\n return False # empty files are never present\\n if imagefile==None:\\n imagefile=self.imagefile # use this one\\n for hashname in ['md5','sha1']:\\n oldhash = self.tag(hashname)\\n if oldhash:\\n newhash = hashlib.new(hashname,self.contents(imagefile=imagefile)).hexdigest()\\n return oldhash==newhash\\n raise ValueError,\\\"Cannot process file \\\"+self.filename()+\\\": no hash in \\\"+str(self)\",\n \"def _check_consistency_between_imaging_extractors(self):\\n return True\",\n \"def equal(self, file1, file2):\\n\\n if file1.size != file2.size:\\n return False\\n\\n # Compare stat\\n if self.use_stat and not self._equal_stat(file1, file2):\\n return False\\n\\n # Compare times\\n if self.use_times and not self._equal_times(file1, file2):\\n return False\\n\\n # Compare attributes\\n if self.use_attributes and not self._equal_attributes(file1, file2):\\n return False\\n\\n # TODO: Optionally diff hashes\\n\\n return True\",\n \"def check_images():\\n\\n print(f'Looking for duplicate images...')\\n\\n for image in images_in_directory:\\n duplicate = check_image_for_duplicates(image)\\n\\n if (duplicate):\\n print(f'Found {duplicate} to be a duplicate image of: {image}')\\n remove_image(duplicate)\\n pass\",\n \"def check_image_for_duplicates(original_image):\\n\\n original_image_hash = get_average_hash(original_image)\\n\\n print(f'Checking for duplicate images for {original_image}')\\n\\n for potential_duplicate_image in images_in_directory:\\n potential_duplicate_image_hash = get_average_hash(\\n potential_duplicate_image)\\n\\n if ((original_image != potential_duplicate_image) & compare_image_hashes(original_image_hash, potential_duplicate_image_hash)):\\n return potential_duplicate_image\\n\\n pass\",\n \"def check_duplicate(fp1, fp2):\\n try:\\n subprocess.check_output(['diff', fp1, fp2])\\n return True\\n except subprocess.CalledProcessError:\\n return False\",\n \"def check_md5(file1, file2):\\r\\n with open(file1, \\\"rb\\\") as f1:\\r\\n h1 = hashlib.md5(f1.read()).digest()\\r\\n with open(file2, \\\"rb\\\") as f2:\\r\\n h2 = hashlib.md5(f2.read()).digest()\\r\\n return h1 == h2\",\n \"def _compare_file(path1, path2):\\n\\n try:\\n return _open_file(path1) == _open_file(path2)\\n except OSError:\\n return False\",\n \"def assert_image_equal(path1, path2):\\n test_im = np.asarray(Image.open(path1))\\n ref_im = np.asarray(Image.open(path2))\\n npt.assert_array_equal(test_im, ref_im)\",\n \"def are_compatible_imgs(one_img, another_img):\\n return have_same_shapes(one_img, another_img)\",\n \"def images_exist(self):\\n pass\",\n \"def compare(file1, file2):\\n\\tfrom os.path import exists\\n\\tresult = False\\n\\t\\n\\tfile1 = adaptPath(file1)\\n\\tfile2 = adaptPath(file2)\\n\\t\\n\\t# If two files existing\\n\\tif exists(file1) and exists(file2):\\n\\t\\t# If the date and size equal\\n\\t\\tif getFileSize(file1) == getFileSize(file2):\\n\\t\\t\\ttry:\\n\\t\\t\\t\\t# Read the content of first file\\n\\t\\t\\t\\tcontent1 = open(file1, \\\"rb\\\").read()\\n\\t\\t\\t\\ttry:\\n\\t\\t\\t\\t\\t# Read the content of second file\\n\\t\\t\\t\\t\\tcontent2 = open(file2, \\\"rb\\\").read()\\n\\t\\t\\t\\t\\t# If content differs\\n\\t\\t\\t\\t\\tif content1 == content2:\\n\\t\\t\\t\\t\\t\\tresult = True\\n\\t\\t\\t\\texcept IOError:\\n\\t\\t\\t\\t\\tpass\\n\\t\\t\\texcept IOError:\\n\\t\\t\\t\\tpass\\n\\treturn result\",\n \"def compare_files(fp1, fp2):\\n\\n line1 = fp1.readline()\\n line2 = fp2.readline()\\n\\n while line1 and line2:\\n if line1.startswith('#') and line2.startswith('#'):\\n pass\\n elif not line1 == line2:\\n return False\\n \\n line1 = fp1.readline()\\n line2 = fp2.readline()\\n\\n if line1 or line2:\\n return False\\n\\n return True\",\n \"def test_image_rw(self):\\n from ..image import Image\\n from ..io.image import read_image, write_image\\n shape = (5,5)\\n pix = np.random.uniform(size=shape)\\n ivar = np.random.uniform(size=shape)\\n mask = np.random.randint(0, 3, size=shape)\\n img1 = Image(pix, ivar, mask, readnoise=1.0, camera='b0')\\n write_image(self.testfile, img1)\\n img2 = read_image(self.testfile)\\n\\n #- Check output datatypes\\n self.assertEqual(img2.pix.dtype, np.float64)\\n self.assertEqual(img2.ivar.dtype, np.float64)\\n self.assertEqual(img2.mask.dtype, np.uint32)\\n\\n #- Rounding from keeping np.float32 on disk means they aren't equal\\n self.assertFalse(np.all(img1.pix == img2.pix))\\n self.assertFalse(np.all(img1.ivar == img2.ivar))\\n\\n #- But they should be close, and identical after float64->float32\\n self.assertTrue(np.allclose(img1.pix, img2.pix))\\n self.assertTrue(np.all(img1.pix.astype(np.float32) == img2.pix))\\n self.assertTrue(np.allclose(img1.ivar, img2.ivar))\\n self.assertTrue(np.all(img1.ivar.astype(np.float32) == img2.ivar))\\n\\n #- masks should agree\\n self.assertTrue(np.all(img1.mask == img2.mask))\\n self.assertEqual(img1.readnoise, img2.readnoise)\\n self.assertEqual(img1.camera, img2.camera)\\n self.assertEqual(img2.mask.dtype, np.uint32)\\n\\n #- should work with various kinds of metadata header input\\n meta = dict(BLAT='foo', BAR='quat', BIZ=1.0)\\n img1 = Image(pix, ivar, mask, readnoise=1.0, camera='b0', meta=meta)\\n write_image(self.testfile, img1)\\n img2 = read_image(self.testfile)\\n for key in meta:\\n self.assertEqual(meta[key], img2.meta[key], 'meta[{}] not propagated'.format(key))\\n\\n #- img2 has meta as a FITS header instead of a dictionary;\\n #- confirm that works too\\n write_image(self.testfile, img2)\\n img3 = read_image(self.testfile)\\n for key in meta:\\n self.assertEqual(meta[key], img3.meta[key], 'meta[{}] not propagated'.format(key))\",\n \"def is_RGB(self,img_path):\\n image=Image.open(img_path)\\n image=np.asarray(image)\\n if(len(image.shape)<3):\\n return False\\n return True\",\n \"def has_images(self):\\n return len(self.images) > 0\",\n \"def samefile(path1, path2):\\n try:\\n return os.path.samefile(path1, path2)\\n except OSError as err:\\n if err.errno == 2: # ENOENT\\n return False\\n else:\\n raise\",\n \"def check_duplicates(files):\\n # If we don't have two files, it's kind of meaningless. True or False\\n # would be fine.\\n if len(files) < 2:\\n return True\\n file1 = files[0]\\n # Compare every file to the first file. If they're all the same, they're\\n # all duplicates. If any one of them isn't, they're not all duplicates\\n # so return False.\\n for f in files[1:]:\\n if not no_diff(file1, f):\\n return False\\n return True\",\n \"def compare_group_images(directory, show_imgs=True, similarity=\\\"high\\\", compression=100):\\n # list where the found duplicate/similar images are stored\\n duplicates = []\\n lower_res = []\\n\\n imgs_matrix = create_imgs_matrix(directory, compression)\\n\\n # search for similar images\\n if similarity == \\\"low\\\":\\n ref = 13000\\n # search for 1:1 duplicate images\\n else:\\n ref = 21000\\n\\n main_img = 0\\n compared_img = 1\\n nrows, ncols = compression, compression\\n srow_A = 0\\n erow_A = compression\\n srow_B = erow_A\\n erow_B = srow_B + compression\\n\\n while erow_B <= imgs_matrix.shape[0]:\\n while compared_img < (len(image_files)):\\n # select two images from imgs_matrix\\n imgA = imgs_matrix[srow_A: erow_A, # rows\\n 0: ncols] # columns\\n imgB = imgs_matrix[srow_B: erow_B, # rows\\n 0: ncols] # columns\\n # compare the images\\n rotations = 0\\n while image_files[main_img] not in duplicates and rotations <= 3:\\n if rotations != 0:\\n imgB = rotate_img(imgB)\\n err = mse(imgA, imgB)\\n print ( \\\"err:\\\", err)\\n if err <= ref:\\n if show_imgs == True:\\n show_file_info(compared_img, main_img)\\n add_to_list(image_files[main_img], duplicates)\\n check_img_quality(directory, image_files[main_img], image_files[compared_img], lower_res)\\n rotations += 1\\n srow_B += compression\\n erow_B += compression\\n compared_img += 1\\n\\n srow_A += compression\\n erow_A += compression\\n srow_B = erow_A\\n erow_B = srow_B + compression\\n main_img += 1\\n compared_img = main_img + 1\\n\\n msg = \\\"\\\\n***\\\\n DONE: found \\\" + str(len(duplicates)) + \\\" duplicate image pairs in \\\" + str(\\n len(image_files)) + \\\" total images.\\\\n The following files have lower resolution:\\\"\\n print(msg)\\n return set(lower_res)\",\n \"def verify(image_path):\\n try:\\n with Image.open(image_path) as img:\\n img.verify()\\n return True\\n except Exception as e:\\n log.warn('Path [{}] does not point to an image: [{}]'.format(image_path, e))\\n return False\",\n \"def check_if_original(article):\\n num_img = len(article.find_all(\\\"img\\\"))\\n return num_img < 2\",\n \"def compare_contents(lhs, rhs):\\n for filename in (lhs, rhs):\\n if not os.path.exists(filename):\\n return False\\n\\n with open(lhs, \\\"r\\\") as lhs_file, open(rhs, \\\"r\\\") as rhs_file:\\n return lhs_file.read() == rhs_file.read()\",\n \"def load_from_images(self):\\n logging.debug(\\\"load_from_images called\\\")\\n return True\",\n \"def check_duplicate_image_name(image_paths):\\n image_names = [os.path.basename(os.path.splitext(p)[0]) for p in image_paths]\\n\\n num_images = len(image_names)\\n\\n num_unique = len(set(image_names))\\n\\n if num_images != num_unique:\\n raise ValueError('Found %d duplicate images.' % (num_images - num_unique))\\n\\n logging.info('Found no duplicates in %d images.', num_images)\",\n \"def verifyShiftFile(self):\\n if self['refimage'] and fu.findFile(self['refimage']):\\n return True\\n else: return False\",\n \"def verifyFile(source, destination):\\n\\tsourceHash = hashlib.sha256(open(source, 'rb').read()).digest()\\n\\tdestinationHash = hashlib.sha256(open(destination, 'rb').read()).digest()\\n\\n\\tif sourceHash == destinationHash:\\n\\t\\treturn (True, str(sourceHash))\\n\\n\\treturn False\",\n \"def img_compare(file1, file2):\\n # read image\\n img1 = Image.open(file1)\\n img2 = Image.open(file2)\\n\\n # resize \\n size = 128, 128\\n img1_res = img_resize(img1, size)\\n img2_res = img_resize(img2, size)\\n\\n img1_res.save(\\\"img_1.thumbnail\\\", \\\"JPEG\\\")\\n img2_res.save(\\\"img_2.thumbnail\\\", \\\"JPEG\\\")\\n\\n # convert to gray scale\\n img1_grayscale = img1_res.convert('LA')\\n img1_grayscale.save(\\\"img_1_grayscale.png\\\")\\n\\n img2_grayscale = img2_res.convert('LA')\\n img2_grayscale.save(\\\"img_2_grayscale.png\\\")\\n\\n # normalise\\n img1_norm = normalize(np.array(img1_grayscale.getdata()).astype(float))\\n img2_norm = normalize(np.array(img2_grayscale.getdata()).astype(float))\\n\\n try:\\n # compare two images\\n diff = img1_norm - img2_norm\\n m_norm = sum(abs(diff)) # Manhattan norm\\n z_norm = norm(diff.ravel(), 0) # Zero norm\\n\\n # print(\\\"Manhattan norm:\\\", m_norm, \\\"/ per pixel:\\\", m_norm/img1_norm.size)\\n # print(\\\"Zero norm:\\\", z_norm, \\\"/ per pixel:\\\", z_norm*1.0/img1_norm.size)\\n\\n return m_norm/img1_norm.size, float(z_norm) / img1_norm.size\\n except:\\n return 100, 100\",\n \"def equal_file_sum(file1_paht, file2_paht):\\n md5_sum1 = generate_sum(file1_path)\\n md5_sum2 = generate_sum(file2_path)\\n return (md5_sum1 == md5_sum2)\",\n \"def _is_tracked(filename, metadata):\\n current_local_sha = local_metadata.get(filename, None)\\n current_remote_sha = metadata.get(filename, None)\\n return current_local_sha is not None \\\\\\n and current_remote_sha is not None \\\\\\n and current_local_sha == current_remote_sha\",\n \"def check_type(filename):\\n try:\\n im = Image.read(filename)\\n except SanperaError:\\n return False\\n else:\\n return im.original_format in [b'JPEG', b'PNG', b'GIF']\",\n \"def is_new_red_camera():\\r\\n ids = range(15)\\r\\n for id in ids:\\r\\n name = 'red{:04d}.fits'.format(id)\\r\\n if os.path.exists(name):\\r\\n hdr = pyfits.getheader(name)\\r\\n if hdr['NAXIS1'] == 4141 or hdr['NAXIS1'] == 4114:\\r\\n return True\\r\\n elif hdr['NAXIS1'] == 1024 or hdr['NAXIS1'] == 1124:\\r\\n return False\\r\\n else:\\r\\n raise ValueError('Unexpected image size')\\r\\n else:\\r\\n continue\\r\\n\\r\\n # raise ValueError('Could not locate red side files')\\r\\n print 'Could not locate red side files--defaulting to new camera'\\r\\n return True\",\n \"def is_newccd(filename):\\n fh = fits.open(filename)\\n out = False\\n if len(fh) == 4:\\n out = True\\n\\n fh.close()\\n return out\",\n \"def _fileinfo_has_changed(self, metadata_filename, new_fileinfo):\\n \\n # If there is no fileinfo currently stored for 'metadata_filename',\\n # try to load the file, calculate the fileinfo, and store it.\\n if metadata_filename not in self.fileinfo:\\n self._update_fileinfo(metadata_filename)\\n\\n # Return true if there is no fileinfo for 'metadata_filename'.\\n # 'metadata_filename' is not in the 'self.fileinfo' store\\n # and it doesn't exist in the 'current' metadata location.\\n if self.fileinfo.get(metadata_filename) is None:\\n return True\\n\\n current_fileinfo = self.fileinfo[metadata_filename]\\n\\n if current_fileinfo['length'] != new_fileinfo['length']:\\n return True\\n\\n # Now compare hashes. Note that the reason we can't just do a simple\\n # equality check on the fileinfo dicts is that we want to support the\\n # case where the hash algorithms listed in the metadata have changed\\n # without having that result in considering all files as needing to be\\n # updated, or not all hash algorithms listed can be calculated on the\\n # specific client.\\n for algorithm, hash_value in new_fileinfo['hashes'].items():\\n # We're only looking for a single match. This isn't a security\\n # check, we just want to prevent unnecessary downloads.\\n if hash_value == current_fileinfo['hashes'][algorithm]:\\n return False\\n\\n return True\",\n \"def hasImages(self):\\n return len(self.getImages()) > 0\",\n \"def hasImages(self):\\n return len(self.getImages()) > 0\",\n \"def _compare_files(self, first_file, second_file):\\n\\n self.log.info('-' * 80)\\n self.log.info('Compare files')\\n\\n code, out = cmd_exec(['cmp', str(first_file), str(second_file)], shell=False, log=self.log)\\n if code:\\n self.log.warning('md5 checksum IS NOT SAME with ffmpeg sw decode')\\n self.log.warning(out)\\n return False\\n\\n self.log.info('md5 checksum IS SAME with ffmpeg sw decode')\\n return True\",\n \"def is_jpegxl_recompressed_jpeg_file(filename):\\n try:\\n with open(filename, 'rb') as h:\\n header = h.read(len(JPEGXL_RECOMPRESSED_JPEG_HEADER))\\n # Cf. https://arxiv.org/pdf/1908.03565.pdf, section 9.1,\\n # on recompressed-JPEG header.\\n return header == JPEGXL_RECOMPRESSED_JPEG_HEADER\\n except: # pylint:disable=bare-except\\n # If anything failed, this means that we cannot establish that the file\\n # has the expected header, so we return False.\\n return False\",\n \"def cmp(f1, f2):\\n with open(f1) as f1, open(f2) as f2:\\n return f1.read() == f2.read()\",\n \"def test_duplicate_images_error(self):\\n with self.assertRaises(AssertionError):\\n disk.merge_datasets(self.input_datasets, self.output_dataset)\\n\\n # Original dataset shouldn't be modified.\\n self.assertEqual(0, len(self.output_dataset.metadata()))\",\n \"def equals(self, image: 'BaseImage') -> bool:\\n assert isinstance(image, BaseImage)\\n im1 = pygame.image.tostring(self._surface, 'RGBA')\\n im2 = pygame.image.tostring(image._surface, 'RGBA')\\n return im1 == im2\",\n \"def number_of_images_valid():\\r\\n if number_of_images_a_valid() and number_of_images_b_valid():\\r\\n return True\\r\\n else:\\r\\n return False\",\n \"def check_image(df, fname_col, img_dir):\\n\\n\\tfor filename in df[fname_col].values[0:4]:\\n\\n\\t\\tif not os.path.isfile(img_dir+filename):\\n\\t\\t\\tlogger.error(\\\"path {} does not exit\\\".format(img_dir+filename))\\n\\t\\t\\tsuccess = False\\n\\t\\telse:\\n\\t\\t\\ttry:\\n\\t\\t\\t\\timg = mpimg.imread(img_dir + filename)\\n\\t\\t\\t\\tsuccess = True\\n\\t\\t\\texcept OSError:\\n\\t\\t\\t\\tsuccess = False\\n\\t\\t\\t\\tlogger.error(\\\"image is {} corrupted/missing\\\".\\n\\t\\t\\t\\t\\t\\t\\t\\t\\t\\t\\t\\t\\tformat(filename))\\n\\t\\t\\t\\t\\n\\treturn success\",\n \"def check_files(self):\\n for f in self.filenames:\\n img = cv2.imread(f, int(self.color))\\n if img is None:\\n os.remove(f)\",\n \"def same_file(wavecar1, wavecar2, wavecar3):\\n same = False\\n if (filecmp.cmp(wavecar1, wavecar2, shallow=False)):\\n print(\\\"Serious problem:: {} and {} are the same\\\".format(wavecar1, wavecar2))\\n same = True\\n if (filecmp.cmp(wavecar1, wavecar3, shallow=False)):\\n print(\\\"Serious problem:: {} and {} are the same\\\".format(wavecar1, wavecar3))\\n same = True\\n if (filecmp.cmp(wavecar2, wavecar3, shallow=False)):\\n print(\\\"Serious problem:: {} and {} are the same\\\".format(wavecar2, wavecar3))\\n same = True\\n\\n if same:\\n print(\\\"It seems that you are using same files to do finite difference, exit\\\")\\n print(\\\"\\\\tComment the 'same_file' checker if you know what you are doing\\\")\\n raise SystemExit\",\n \"def _compare_jpg_decode_with_pil(test_case, images, print_debug_info=False):\\n of_decoded_images = _of_image_decode(images)\\n pil_images = [Image.open(image) for image in images]\\n # convert image to BGR\\n pil_decoded_images = [np.array(image)[:, :, ::-1] for image in pil_images]\\n\\n for of_decoded_image, pil_decoded_image in zip(\\n of_decoded_images, pil_decoded_images\\n ):\\n of_decoded_image = of_decoded_image.squeeze()\\n test_case.assertTrue(len(of_decoded_image.shape) == 3)\\n test_case.assertTrue(len(pil_decoded_image.shape) == 3)\\n\\n diff = of_decoded_image - pil_decoded_image\\n diff_index = np.where(diff != 0)\\n diff_abs_values = diff[diff_index]\\n\\n if print_debug_info:\\n print(\\\"of_decoded_image:\\\\n\\\", of_decoded_image, of_decoded_image.shape)\\n print(\\\"pil_decoded_image:\\\\n\\\", pil_decoded_image, pil_decoded_image.shape)\\n print(\\\"diff_index:\\\\n\\\", diff_index)\\n print(\\\"diff_abs_values:\\\\n\\\", diff_abs_values)\\n print(\\n \\\"of_decoded_image diff:\\\\n\\\",\\n of_decoded_image[diff_index[0], diff_index[1]],\\n )\\n print(\\n \\\"pil_decoded_image diff:\\\\n\\\",\\n pil_decoded_image[diff_index[0], diff_index[1]],\\n )\\n\\n # only green channel has difference of 1\\n test_case.assertTrue(np.all(diff_index[-1] == 1))\\n test_case.assertTrue(np.all(diff_abs_values == 1))\",\n \"def check_md5sum(file1: str, file2: str) -> bool:\\n return get_md5_hash(file1) == get_md5_hash(file2)\",\n \"def checkImageDimensions(self, filenames):\\n\\t\\ts = None\\n\\t\\thashStr = filenames[:]\\n\\t\\thashStr.sort()\\n\\t\\thashStr = str(hashStr)\\n\\t\\t# check to see if there's already a result of the check for these filenames in the cache\\n\\t\\tif hashStr in self.dimensionCheck:\\n\\t\\t\\tLogging.info(\\\"Using cached result for dimensions check: %s\\\"%(str(self.dimensionCheck[hashStr])))\\n\\t\\t\\treturn self.dimensionCheck[hashStr]\\n\\t\\t\\t\\n\\t\\tfor file in filenames:\\n\\t\\t\\tif file not in self.imageDims:\\n\\t\\t\\t\\tprint \\\"Trying to open\\\",type(file)\\n\\t\\t\\t\\ttry:\\n\\t\\t\\t\\t\\tself.ext = file.split(\\\".\\\")[-1].upper()\\n\\t\\t\\t\\t\\tif self.ext == \\\"TIF\\\":\\n\\t\\t\\t\\t\\t\\tself.ext = \\\"TIFF\\\"\\n\\t\\t\\t\\t\\tif self.ext == \\\"JPG\\\":\\n\\t\\t\\t\\t\\t\\tself.ext = \\\"JPEG\\\"\\n\\n\\t\\t\\t\\t\\tif self.ext == \\\"VTI\\\":\\n\\t\\t\\t\\t\\t\\treader = vtk.vtkXMLImageReader()\\n\\t\\t\\t\\t\\telse:\\n\\t\\t\\t\\t\\t\\treader = eval(\\\"vtk.vtk%sReader()\\\"%self.ext)\\n\\t\\t\\t\\t\\treader.SetFileName(file)\\n\\t\\t\\t\\t\\treader.UpdateInformation()\\n\\t\\t\\t\\texcept IOError, ex:\\n\\t\\t\\t\\t\\ttraceback.print_exc()\\n\\t\\t\\t\\t\\traise Logging.GUIError(\\\"Cannot open image file\\\", \\\"Cannot open image file %s\\\" % file)\\n\\n\\t\\t\\t\\textent = reader.GetDataExtent()\\n\\t\\t\\t\\tfSize = (extent[1],extent[3])\\n\\t\\t\\t\\tself.imageDims[file] = fSize\\n\\t\\t\\telse:\\n\\t\\t\\t\\tfSize = self.imageDims[file]\\n\\t\\t\\tif s and fSize != s:\\n\\t\\t\\t\\tx0, y0 = s\\n\\t\\t\\t\\tx1, y1 = fSize\\n\\t\\t\\t\\tself.dimensionCheck[hashStr] = False\\n\\t\\t\\t\\treturn 0\\n\\t\\t\\ts = fSize \\n\\t\\t\\tfn = file\\n\\t\\tself.dimensionCheck[hashStr] = True\\n\\t\\treturn 1\",\n \"def check_files(self):\\n print('checking files')\\n for f in self.filenames:\\n img = cv2.imread(f, int(self.color))\\n if img is None:\\n os.remove(f)\",\n \"def is_different(image1, image2):\\n gray1 = cv2.cvtColor(image1, cv2.COLOR_RGB2GRAY)\\n gray2 = cv2.cvtColor(image2, cv2.COLOR_RGB2GRAY)\\n\\n (score, diff) = compare_ssim(gray1, gray2, full=True)\\n diff = (diff * 255).astype(\\\"uint8\\\")\\n\\n thresh = cv2.threshold(diff, 0, 255,\\n cv2.THRESH_BINARY_INV | cv2.THRESH_OTSU)[1]\\n cnts = cv2.findContours(thresh, cv2.RETR_EXTERNAL,\\n cv2.CHAIN_APPROX_SIMPLE)\\n cnts = cnts[0] if imutils.is_cv2() else cnts[1]\\n\\n return bool(cnts)\",\n \"def consistent(self):\\n return self.incore_digest == self.ondisk_digest\",\n \"def compare(actor, frame):\\n urlretrieve(actor, 'actor.jpg')\\n\\n with open(\\\"frame_image.jpg\\\", 'wb') as frame_image:\\n frame_image.write(base64.b64decode(frame[23:]))\\n\\n actor_encoding = face_encodings(load_image_file('actor.jpg'))[0]\\n frame_encoding = face_encodings(load_image_file('frame_image.jpg'))\\n\\n os.remove('actor.jpg')\\n os.remove('frame_image.jpg')\\n for encoding in frame_encoding:\\n if compare_faces([actor_encoding], encoding):\\n return True\\n return False\",\n \"def test_read(self):\\n for line in TESTIMAGES.split('\\\\n'):\\n vals = line.strip().split()\\n name = vals[0]\\n logger.debug(\\\"Testing file %s\\\" % name)\\n dim1, dim2 = [int(x) for x in vals[1:3]]\\n mini, maxi, mean, stddev = [float(x) for x in vals[3:]]\\n obj = raxisimage()\\n obj.read(os.path.join(os.path.dirname(self.mar), name))\\n\\n self.assertAlmostEqual(mini, obj.getmin(), 2, \\\"getmin [%s,%s]\\\" % (mini, obj.getmin()))\\n self.assertAlmostEqual(maxi, obj.getmax(), 2, \\\"getmax [%s,%s]\\\" % (maxi, obj.getmax()))\\n self.assertAlmostEqual(mean, obj.getmean(), 2, \\\"getmean [%s,%s]\\\" % (mean, obj.getmean()))\\n self.assertAlmostEqual(stddev, obj.getstddev(), 2, \\\"getstddev [%s,%s]\\\" % (stddev, obj.getstddev()))\\n self.assertEqual(dim1, obj.dim1, \\\"dim1\\\")\\n self.assertEqual(dim2, obj.dim2, \\\"dim2\\\")\\n self.assertNotEqual(obj.dim1, obj.dim2, \\\"dim2!=dim1\\\")\",\n \"def check_fileName(session) -> 'bool':\\n c = get_client()\\n cursor = c.find({},{\\\"size\\\":1, \\\"_id\\\":0})\\n print(session)\\n for document in cursor:\\n print(document)\\n if hmac.compare_digest(session, document[\\\"size\\\"]):\\n return True\\n print(\\\"size \\\", document[\\\"size\\\"])\\n return False\",\n \"def hasImg(img_name):\\n try:\\n Image.objects.raw({\\\"_id\\\": img_name}).first()\\n return True\\n except pymodm_errors.DoesNotExist:\\n return False\",\n \"def assert_data_correct(self) -> bool:\\n if not self.training_folder.exists():\\n return False\\n # 27: number of characters\\n # 27*2: 27 original font characters and 27 folders with morphed version\\n if len(list(self.training_folder.iterdir())) not in [27, 27 * 2]:\\n return False\\n # assert that each character folder has the expected number of images inside\\n # expected number is repetitions + original, or just original if no morphing\\n # took place\\n for directory in self.training_folder.iterdir():\\n img_count = len(list(directory.iterdir()))\\n if img_count != self.repetitions + 1 and img_count != 1:\\n return False\\n return True\",\n \"def check_files(self):\\n print('checking files')\\n for f in tqdm(self.filenames):\\n img = cv2.imread(f, int(self.color))\\n if img is None:\\n os.remove(f)\",\n \"def hasImage(self):\\n if self.getImage():\\n return True\\n return False\",\n \"def _check_images_and_labels(self, image_dir, label_dir):\\n return len(os.listdir(image_dir))==len(os.listdir(label_dir))\",\n \"def test_is_image(self):\\n os.chdir(\\\"testimages/\\\")\\n self.assertTrue(fileactions.is_image(\\\"arch_001.jpg\\\"))\\n self.assertFalse(fileactions.is_image(\\\"not_an_image.jpg\\\"))\",\n \"def check(self, grain=50):\\n opengles.glReadPixels(0, 0, self.ix, self.iy,\\n GL_RGB, GL_UNSIGNED_BYTE,\\n ctypes.byref(self.img))\\n r0 = self.img[0:3]\\n step = 3 * int(self.ix * self.iy / 50)\\n for i in xrange(0, len(self.img)-3, step):\\n if self.img[i:(i+3)] != r0:\\n return True\\n\\n return False\",\n \"def file_should_be_processed(self, filepath):\\n try:\\n image.load(filepath)\\n return True\\n except:\\n return False\",\n \"def assert_data_fragments_correct(self) -> bool:\\n read_path = Path(os.environ[\\\"DATA_PATH\\\"]) / \\\"fragments\\\"\\n if not read_path.exists():\\n return False\\n bin_images = [img for img in read_path.iterdir() if \\\"binarized\\\" in img.name]\\n if len(bin_images) == 0:\\n return False\\n return True\",\n \"def __compare_files(self, filename1, filename2):\\n self.assertTrue(os.path.isfile(filename1))\\n self.assertTrue(os.path.isfile(filename2))\\n self.assertEqual(os.path.getsize(filename1), os.path.getsize(filename2))\\n with open(filename1, \\\"rb\\\") as f1:\\n with open(filename2, \\\"rb\\\") as f2:\\n n_blocks = int(self.args.size) // self.max_block_size\\n for i in range(n_blocks):\\n self.assertEqual(f1.read(self.max_block_size), \\\\\\n f2.read(self.max_block_size))\\n remaining = int(self.args.size) % self.max_block_size\\n if remaining > 0:\\n self.assertEqual(f1.read(remaining), \\\\\\n f2.read(remaining))\",\n \"def _check_flip(origin_imgs, result_imgs):\\n h, w, c = origin_imgs.shape\\n for i in range(h):\\n for j in range(w):\\n for k in range(c):\\n if result_imgs[i, j, k] != origin_imgs[i, w - 1 - j, k]:\\n return False\\n return True\",\n \"def isopen(self):\\n return _image.image_isopen(self)\",\n \"def test_sanity_ati1():\\n\\n with Image.open(TEST_FILE_ATI1) as im:\\n im.load()\\n\\n assert im.format == \\\"DDS\\\"\\n assert im.mode == \\\"L\\\"\\n assert im.size == (64, 64)\\n\\n assert_image_equal_tofile(im, TEST_FILE_ATI1.replace(\\\".dds\\\", \\\".png\\\"))\",\n \"def __is_image_id( self, image_id ):\\n images_ids = self.__get_multi_images_ids()\\n for id in images_ids:\\n if image_id == id:\\n return True\\n return False\",\n \"def check_overwrite(self, filename, workspace):\\n if not self.overwrite.value and os.path.isfile(filename):\\n try:\\n return (\\n workspace.interaction_request(\\n self, workspace.measurements.image_set_number, filename\\n )\\n == \\\"Yes\\\"\\n )\\n except workspace.NoInteractionException:\\n raise ValueError(\\n 'SaveImages: trying to overwrite %s in headless mode, but Overwrite files is set to \\\"No\\\"'\\n % (filename)\\n )\\n return True\",\n \"def assert_img_equal(request):\\n\\n testname = request.node.name\\n filename = Path(request.module.__file__)\\n test_dir = filename.parent / filename.stem\\n test_dir.mkdir(exist_ok=True)\\n\\n def _img_equal(img, index=0):\\n expected_file = test_dir / f\\\"{testname}_{index}.png\\\"\\n actual_file = test_dir / f\\\"{testname}_{index}_actual.png\\\"\\n if img.ndim == 2:\\n cv2.imwrite(str(actual_file), img)\\n else:\\n img_bgr = img.copy()\\n img_bgr[..., :3] = img_bgr[..., :3][..., ::-1]\\n cv2.imwrite(str(actual_file), img_bgr) # img is RGB, imwrite expects BGR\\n\\n if not expected_file.exists():\\n raise AssertionError(\\n f\\\"{expected_file} does not exist! Check newly produced img with a command like:\\\\n\\\\n feh {actual_file}\\\\n\\\\n\\\"\\n )\\n\\n try:\\n pytest.helpers.assert_img_equal(expected_file, img)\\n except Exception as e:\\n raise AssertionError(f\\\"{expected_file} differs from {actual_file}\\\") from e\\n\\n return _img_equal\",\n \"def is_image(mine=None, file=None):\\n if file:\\n mine = get_file_mine(file)\\n print(mine)\\n if mine:\\n return mine.find('image') != -1\\n\\n return False\",\n \"def compare_image_hashes(image_hash, potential_duplicate_hash):\\n\\n return image_hash - potential_duplicate_hash < image_hash_comparison_cutoff\",\n \"def __lt__(self, img):\\r\\n ordering = self.config['algorithm_ordering']\\r\\n ordering = ordering[1:] if ordering.startswith('-') else ordering\\r\\n\\r\\n if ordering == \\\"filename\\\":\\r\\n return sorted([self.filename, img.filename])[0] == img.filename\\r\\n if ordering == 'width':\\r\\n return self.absolute_width <= img.absolute_width\\r\\n elif ordering == 'height':\\r\\n return self.absolute_height <= img.absolute_height\\r\\n elif ordering == 'area':\\r\\n return self.absolute_width * self.absolute_height <= img.absolute_width * img.absolute_height\\r\\n else:\\r\\n return max(self.absolute_width, self.absolute_height) <= max(img.absolute_width, img.absolute_height)\",\n \"def test_on_skimage_png(self):\\n from_skimage = diffread(TEST_PNG)\\n\\n self.assertTupleEqual(from_skimage.shape, (256, 256))\\n self.assertTrue(np.allclose(from_skimage, np.ones_like(from_skimage)))\",\n \"def rgb(self) -> bool:\\n return self.image_shape[2] == 3\",\n \"def md5check(fname, md5fname):\\n\\tmd5fh = open(md5fname, \\\"r\\\")\\n\\treturn (md5sum(fname) == md5fh.readline())\",\n \"def verify_media(self):\\n self.check_dataset_duplicate_ids(self.media)\",\n \"def test_check_wrong_image(self):\\n result = analyzer.check_image_color(\\\"tests/test_files/non_exists.jpg\\\")\\n self.assertEqual(result, \\\"Image not found\\\")\",\n \"def identify_duplicates(file1, outname, RA=\\\"RA\\\", DEC=\\\"DEC\\\", dist=1):\\n command = (\\n f'stilts tmatch1 matcher=sky values=\\\"{RA} {DEC}\\\" params={dist} '\\n + f\\\"action=identify in={file1} out={outname}\\\"\\n )\\n try:\\n subprocess.check_output(command, shell=True, executable=\\\"/bin/zsh\\\")\\n return True\\n except:\\n shutil.copyfile(file1, outname)\\n return False\",\n \"def is_valid_image(image):\\n if image not in AVAILABLE_IMAGES.keys():\\n return False\\n\\n return True\",\n \"def check_duplicates(self, file_path):\\n\\t\\tif not file_path:\\n\\t\\t\\treturn file_path\\n\\t\\tif not self.settings.get('deduplicate_files', True):\\n\\t\\t\\t# Deduplication disabled.\\n\\t\\t\\treturn file_path\\n\\t\\twas_new, existing_path = hashjar.add_hash(file_path) # Check if the file exists already.\\n\\t\\tif not was_new:\\n\\t\\t\\tprint(\\\"\\\\tFile already exists! Resolving...\\\")\\n\\t\\t\\t# Quick and dirty comparison, assumes larger filesize means better quality.\\n\\t\\t\\tif os.path.isfile(file_path) and os.path.isfile(existing_path):\\n\\t\\t\\t\\tif os.path.getsize(file_path) > os.path.getsize(existing_path):\\n\\t\\t\\t\\t\\tprint('\\\\t\\\\tNew file was better quality. Removing old file.')\\n\\t\\t\\t\\t\\tos.remove(existing_path)\\n\\t\\t\\t\\t\\tfor ele in self.loader.get_elements_for_file(existing_path):\\n\\t\\t\\t\\t\\t\\tele.remap_file(existing_path, file_path)\\n\\t\\t\\t\\t\\treturn file_path\\n\\t\\t\\t\\telse:\\n\\t\\t\\t\\t\\tprint(\\\"\\\\tOld file was better quality, removing newer file.\\\")\\n\\t\\t\\t\\t\\tos.remove(file_path)\\n\\t\\t\\t\\t\\treturn existing_path\\n\\t\\treturn file_path\",\n \"def check(self, grain=50):\\r\\n opengles.glDisable(GL_SCISSOR_TEST)\\r\\n self.s_flg = False\\r\\n opengles.glReadPixels(0, self.y0, self.ix, 1,\\r\\n GL_RGB, GL_UNSIGNED_BYTE,\\r\\n ctypes.byref(self.img))\\r\\n r0 = self.img[0:3]\\r\\n for i in xrange(0, self.img_sz, self.step):\\r\\n if self.img[i:(i+3)] != r0:\\r\\n return True\\r\\n\\r\\n return False\",\n \"def mapsMatch(m1,m2):\\n same = True\\n f1 = file(m1,'r').readlines()\\n f2 = file(m2,'r').readlines()\\n for i, row in enumerate(f1):\\n row = row.strip().split()\\n row2 = f2[i].strip().split()\\n if row[0] <> row2[0]:\\n\\t same = False\\n break\\n return same\",\n \"def coherent(self):\\n return self.uris.size == self.sockets.size\",\n \"def is_equal(image_a, image_b, tolerance=0.0):\\n return image_diff_percent(image_a, image_b) <= tolerance\",\n \"def _assets_are_stale(self, sourcedirectory, cachedirectory):\\n comparison = filecmp.dircmp(sourcedirectory, cachedirectory, [], [])\\n if comparison.left_only or comparison.right_only:\\n # We have files in one directory and not the other\\n return True\\n if comparison.diff_files:\\n # Some of the files have changed\\n return True\\n\\n return False\",\n \"def md5_match(file_path, reference_md5):\\n\\n with open(file_path, \\\"rb\\\") as f:\\n\\n data = f.read()\\n\\n file_md5 = md5(data).hexdigest()\\n\\n return file_md5 == reference_md5\",\n \"def compare(self, checksum):\\n real_checksum = checksum\\n if len(checksum) > self.hasher_size:\\n real_checksum = checksum[0:self.hasher_size]\\n afile = checksum[self.hasher_size:len(checksum)]\\n self.path = os.path.join(self.path, afile)\\n self.compute()\\n return self.real_checksum == real_checksum\",\n \"def read_file(filename):\\n\\tprint(\\\"Beginning file read...\\\")\\n\\tmy_image = cv2.imread(filename)\\n\\treturn computer_hash(my_image)\",\n \"def __eq__(self, other):\\n if not isinstance(other, ImageInfo):\\n return False\\n\\n return self.__dict__ == other.__dict__\",\n \"def check_sub_image(self, ndvi_filename, input_path):\\n rgb_filename = re.sub(\\\"BWNDVI\\\",\\\"RGB\\\",ndvi_filename)\\n rgb_img = Image.open(self.get_file(os.path.join(input_path, rgb_filename),\\n self.input_location_type))\\n img_ok = check_image_ok(rgb_img, 0.05)\\n return img_ok\",\n \"def check_already_extracted(video_parts):\\n filename_no_ext, _ = video_parts\\n return bool(os.path.exists(os.path.join(output_dir,\\n filename_no_ext + '-0030.jpg')))\",\n \"def check_consistency(trained_model, filename):\\n # First, check that the model supports consistency checking (has _source_hash).\\n if not hasattr(trained_model, '_source_hash'):\\n return True # No check was done (so we assume it's all fine).\\n trained_source_hash = trained_model._source_hash\\n with open(filename, 'r') as ff:\\n code = ff.read()\\n m = hashlib.sha256()\\n m.update(code.encode())\\n true_source_hash = m.hexdigest()\\n return trained_source_hash == true_source_hash\",\n \"def test_consitency_manual(self):\\n name = os.path.basename(self.cbf_filename)\\n obj = fabio.open(self.cbf_filename)\\n new = fabio.cbfimage.cbfimage(data=obj.data, header=obj.header)\\n new.write(os.path.join(self.tempdir, name))\\n other = fabio.open(os.path.join(self.tempdir, name))\\n self.assertEqual(abs(obj.data - other.data).max(), 0, \\\"data are the same\\\")\\n for key in obj.header:\\n if key in[ \\\"filename\\\", \\\"X-Binary-Size-Padding\\\"]:\\n continue\\n self.assertTrue(key in other.header, \\\"Key %s is in header\\\" % key)\\n self.assertEqual(obj.header[key], other.header[key], \\\"value are the same for key %s [%s|%s]\\\" % (key, obj.header[key], other.header[key]))\",\n \"def reversible(self) -> bool:\\n xy_row = np.column_stack(\\n (\\n np.linspace(\\n -self.imgsz[0] / (2 * self.f[0]),\\n self.imgsz[0] / (2 * self.f[0]),\\n int(self.imgsz[0]),\\n ),\\n np.zeros(int(self.imgsz[0])),\\n )\\n )\\n dxy = self._distort(xy_row)\\n continuous_row = np.all(dxy[1:, 0] >= dxy[:-1, 0])\\n xy_col = np.column_stack(\\n (\\n np.zeros(int(self.imgsz[1])),\\n np.linspace(\\n -self.imgsz[1] / (2 * self.f[1]),\\n self.imgsz[1] / (2 * self.f[1]),\\n int(self.imgsz[1]),\\n ),\\n )\\n )\\n dxy = self._distort(xy_col)\\n continuous_col = np.all(dxy[1:, 1] >= dxy[:-1, 1])\\n return continuous_row and continuous_col\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.73973125","0.6985823","0.68735695","0.6753808","0.6718825","0.67187357","0.67060715","0.66544104","0.64797544","0.6415226","0.6404903","0.6333785","0.629946","0.62671864","0.6233922","0.6232194","0.61956316","0.6156336","0.60619223","0.6051723","0.60221314","0.60185254","0.60083586","0.5999905","0.5990362","0.5974603","0.593965","0.59360605","0.5934657","0.59307516","0.5928271","0.59277403","0.58991015","0.589421","0.58894527","0.58879703","0.58847433","0.58817774","0.58618927","0.58563024","0.58563024","0.58527267","0.5827585","0.58193266","0.5805843","0.58049315","0.58034694","0.5799385","0.5793126","0.57897717","0.5769511","0.5766681","0.5762456","0.57545316","0.57513934","0.5749852","0.5748375","0.57408124","0.573175","0.57211345","0.5720841","0.57205623","0.57183206","0.5718258","0.57088095","0.57006985","0.569202","0.5686787","0.5683639","0.5683189","0.56773704","0.56708705","0.5668705","0.56630564","0.5654363","0.5645765","0.5645644","0.56443185","0.5638958","0.5631421","0.56313866","0.56264657","0.5625926","0.56181985","0.56152946","0.5606123","0.5602853","0.5599952","0.559895","0.5590131","0.55857444","0.5585567","0.5576262","0.5564011","0.5560918","0.5556057","0.55540776","0.5550908","0.55478317","0.55316335"],"string":"[\n \"0.73973125\",\n \"0.6985823\",\n \"0.68735695\",\n \"0.6753808\",\n \"0.6718825\",\n \"0.67187357\",\n \"0.67060715\",\n \"0.66544104\",\n \"0.64797544\",\n \"0.6415226\",\n \"0.6404903\",\n \"0.6333785\",\n \"0.629946\",\n \"0.62671864\",\n \"0.6233922\",\n \"0.6232194\",\n \"0.61956316\",\n \"0.6156336\",\n \"0.60619223\",\n \"0.6051723\",\n \"0.60221314\",\n \"0.60185254\",\n \"0.60083586\",\n \"0.5999905\",\n \"0.5990362\",\n \"0.5974603\",\n \"0.593965\",\n \"0.59360605\",\n \"0.5934657\",\n \"0.59307516\",\n \"0.5928271\",\n \"0.59277403\",\n \"0.58991015\",\n \"0.589421\",\n \"0.58894527\",\n \"0.58879703\",\n \"0.58847433\",\n \"0.58817774\",\n \"0.58618927\",\n \"0.58563024\",\n \"0.58563024\",\n \"0.58527267\",\n \"0.5827585\",\n \"0.58193266\",\n \"0.5805843\",\n \"0.58049315\",\n \"0.58034694\",\n \"0.5799385\",\n \"0.5793126\",\n \"0.57897717\",\n \"0.5769511\",\n \"0.5766681\",\n \"0.5762456\",\n \"0.57545316\",\n \"0.57513934\",\n \"0.5749852\",\n \"0.5748375\",\n \"0.57408124\",\n \"0.573175\",\n \"0.57211345\",\n \"0.5720841\",\n \"0.57205623\",\n \"0.57183206\",\n \"0.5718258\",\n \"0.57088095\",\n \"0.57006985\",\n \"0.569202\",\n \"0.5686787\",\n \"0.5683639\",\n \"0.5683189\",\n \"0.56773704\",\n \"0.56708705\",\n \"0.5668705\",\n \"0.56630564\",\n \"0.5654363\",\n \"0.5645765\",\n \"0.5645644\",\n \"0.56443185\",\n \"0.5638958\",\n \"0.5631421\",\n \"0.56313866\",\n \"0.56264657\",\n \"0.5625926\",\n \"0.56181985\",\n \"0.56152946\",\n \"0.5606123\",\n \"0.5602853\",\n \"0.5599952\",\n \"0.559895\",\n \"0.5590131\",\n \"0.55857444\",\n \"0.5585567\",\n \"0.5576262\",\n \"0.5564011\",\n \"0.5560918\",\n \"0.5556057\",\n \"0.55540776\",\n \"0.5550908\",\n \"0.55478317\",\n \"0.55316335\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.57149756"},"document_rank":{"kind":"string","value":"64"}}},{"rowIdx":6087,"cells":{"query":{"kind":"string","value":"Compose html with blogger image urls"},"document":{"kind":"string","value":"def compose_blogger_html(args, title, posts, imgdata, online_videos):\n for post in posts:\n for media in post.medias:\n if type(media) is PostImage:\n if media.uri not in imgdata:\n print('Image missing: ', media.uri)\n else:\n img_url, resized_url = imgdata[media.uri]\n media.uri = img_url\n media.resized_url = resized_url\n elif type(media) is PostVideo:\n if not online_videos:\n print('Video missing: ', media.uri)\n else:\n media.iframe = online_videos[0]\n del online_videos[0]\n else:\n assert False\n\n return print_html(args, posts, title, '', target='blogger')"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["def replfunc(self, match):\n url = match.group(1)\n imgformat = url.split('.')[-1]\n if url.startswith('http'):\n data = urlopen(url).read()\n elif url.startswith('data'):\n img = '<img src=\"' + url + '\" ' + match.group(2) + ' />'\n return img\n else:\n with open(url, 'rb') as f:\n data = f.read()\n\n self.log.info(\"embedding url: %s, format: %s\" % (url, imgformat))\n b64_data = base64.b64encode(data).decode(\"utf-8\")\n if imgformat == \"svg\":\n img = '<img src=\"data:image/svg+xml;base64,' + \\\n b64_data + '\" ' + match.group(2) + '/>'\n elif imgformat == \"pdf\":\n img = '<img src=\"data:application/pdf;base64,' + \\\n b64_data + '\" ' + match.group(2) + '/>'\n else:\n img = '<img src=\"data:image/' + imgformat + \\\n ';base64,' + b64_data + '\" ' + match.group(2) + ' />'\n return img","def image_preview(self):\r\n h = '<img src=\"%s\" alt=\"Campaign badge\"/>' % self.image.url\r\n return mark_safe(h)","def image(self, link, title, alt):\n if not link.startswith(('http://', 'https://')):\n source_dir = os.path.dirname(self.source_path)\n link = os.path.abspath(os.path.join(source_dir, link))\n return '<img src=\"%s\" title=\"%s\" alt=\"%s\" />' % (link, title, alt)","def create_HTML_a_img(link_url, image_url):\n img = '<img src=\"' + image_url + '\">'\n linked_image = create_HTML_a(link_url, img)\n return linked_image","def website_create_body(website_info):\r\n body = \"\"\r\n body += H2 + website_info.title + END_H2\r\n body += '\\n' + P + website_info.content + END_P\r\n for image in website_info.images:\r\n if isinstance(image, str):\r\n body += '<img src=\"' + image + CLASS_CENTER\r\n elif isinstance(image, Image):\r\n body += '<img src=\"' + image.name + '\" width=\"' + image.size + CLASS_CENTER\r\n else:\r\n pass\r\n return body","def url(self):\n\t\treturn self.base_url+\"{}/{}/{}.jpg\".format(self.template,self._escape(self.top_text),self._escape(self.bottom_text))+(\"?\"+\"&\".join([\"{}={}\".format(k,quote(self.kwargs[k])) for k in self.kwargs]) if self.kwargs else \"\")","def embed_images(self):\n for img in self.book.xpath(\"//img[ not(starts-with(@src, 'data:')) and @src!= '']\"):\n img_src = img.attrib[\"src\"]\n img_raw = self.get_remote_content(img_src)\n if img_raw != None:\n img_64 = base64.b64encode(img_raw)\n file_info = os.path.splitext(img_src)\n ext = file_info[1].replace(\".\", \"\")\n ext = re.sub(\"\\?.*$\", \"\" , ext)\n \n if ext == \"svg\":\n svg = html.fromstring(img_raw.decode(\"utf-8\"))\n img.clear()\n img.tag = \"svg\"\n img[:] = [svg]\n else:\n img.set(\"src\", \"data:image/{};base64,{}\".format(ext, img_64.decode(\"utf-8\")))","def prepare_for_blogger(args):\n title, posts = parse_markdown(os.path.join(args.root, 'index.md'))\n online_images, online_videos = online_images_url(args)\n\n if args.check_images and check_images(args, posts, online_images) is False:\n pass\n\n html = compose_blogger_html(args, title, posts, online_images, online_videos)\n\n if args.full is False:\n html = re.search('<body>(.*)?</body>', html, flags=re.DOTALL).group(1)\n html = re.sub('<script>.*?</script>', '', html, flags=re.DOTALL)\n html = STYLE.replace('%%', '%') + html\n\n if args.dest:\n with open(args.dest, 'wt', encoding='utf-8') as f:\n f.write(html)\n else:\n clipboard.copy(html)","def create_html(pic_info,sum_pic,upload_path,yun_link=('1','2')):\n save_file=pic_info+'.txt'\n content=\"\"\"\n <p>\n <img src=\"%s%s\" style=\"\" title=\"%s\"/>\n </p>\n <p>\n <img src=\"%s%s\" style=\"\" title=\"%s\"/>\n </p>\n <p>\n <img src=\"%s%s\" style=\"\" title=\"%s\"/>\n </p>\n <p>\n <img src=\"%s%s\" style=\"\" title=\"%s\"/>\n </p>\n <p>\n <span style=\"color: #FF0000; font-size: 24px;\">link: \n </span>\n <a href=\"%s\" target=\"_blank\" \n style=\"font-size: 24px; text-decoration: underline;\">\n <span style=\"font-size: 24px;\">%s\n </span>\n </a> \n <span style=\"font-size: 24px;\">\n <span style=\"color: #FF0000; font-size: 24px;\">code:\n </span>\n %s\n </span>\n </p>\\n\\n\\n\\n\\n\\n\\n\\n\\n\n \"\"\"%(upload_path,sum_pic[0],sum_pic[0],upload_path,sum_pic[1],sum_pic[1],\n upload_path,sum_pic[2],sum_pic[2],upload_path,sum_pic[3],sum_pic[3],\n yun_link[0],yun_link[0],yun_link[1])\n with open(save_file, 'w') as f:\n f.write(content)\n f.close()","def correct_img_links(body_main_content, schema_name, list_name_image):\n for name_image in list_name_image:\n body_main_content = body_main_content.replace(\n \"src=\\\"\" + name_image + \"\\\"\",\n \"src=\\\"{% static \\\"schema_viewer/oxygen/\" + schema_name + \"/\" + name_image + \"\\\" %}\\\"\"\n )\n return body_main_content","def banner_wrapper(banner_url):\n # so simple\n return '{url}<img src=\"{url}\" alt=\"{alt}\">'.format(\n url=banner_url,\n alt='Banner'\n )","def image(self, src, title, text):\n src = escape_link(src)\n text = escape(text, quote=True)\n if title:\n title = escape(title, quote=True)\n html = '<img src=\"%s\" alt=\"%s\" title=\"%s\"' % (src, text, title)\n else:\n html = '<img src=\"%s\" alt=\"%s\"' % (src, text)\n if self.options.get('use_xhtml'):\n return '%s />' % html\n return '%s>' % html","def image_preview(self):\r\n h = '<img src=\"%s\" alt=\"%s\"/>' % (self.image_resized_url, self.title)\r\n return mark_safe(h)","def getNewsIconURL(newsBrain):","def embed_images(self, html):\n if not self.SUPPORT_EMBED_IMAGES:\n raise RuntimeError('%r does not support embed_images' % type(self))\n\n return self.RE_IMG.sub(self._embed_image, html)","def get_image(result):\n article_id = result['id']\n id_ = article_id[14:]\n href = article_id[:14]\n\n #FIXME: not working\n image_url = \"http://www.jpress.nli.org.il/Olive/APA/NLI_heb/get/GetImage.ashx?kind=block&href=%s&id=%s&ext=.png\" %(href, id_)\n \n return image_url","def get_image_url():","def thumbnail_generator():\n website_url = json.loads(request.data.decode())['url']\n try:\n webpage, message = url_preview.send_request(website_url)\n if webpage is not None:\n #Construct the soup object\n soup_object = url_preview.get_soup_object(webpage)\n #Get the title of the artcile\n title = url_preview.get_title(soup_object)\n #Get the website of the article\n website_name = url_preview.get_url(soup_object).rsplit(\".\", 1)[0]\n if website_name is None:\n website_name = website_url.split(\"//\", 1)[1].split(\"/\", 1)[0].rsplit(\".\", 1)[0]\n\n #Get the description of the article\n description = url_preview.get_description(soup_object)\n\n #Get the published date and time of the article\n date_time = url_preview.get_date_time(website_url)\n\n #Get the link to the preview image\n image_url = url_preview.get_preview_image(soup_object)['content']\n\n #Get the link to the favicon\n favicon_url = url_preview. get_favicon(soup_object)\n\n return render_template(\n \"success.html\",\n urlx=website_url,\n title=title,\n site_name=website_name,\n description=description,\n date_time=date_time,\n preview_image=image_url,\n favicon=favicon_url\n )\n except Exception as exp:\n return render_template('error.html', msg=str(exp))","def get_images(self,soup,Images):\n \n img=soup.find_all('a',href=re.compile(\"/photo.php?fbid=\"))\n img1=soup.find_all('a',href=re.compile(\"/photo\"))\n m=' '\n if img !=[]:\n img_href='https://www.facebook.com'+img[0]['href']\n m+=img_href+'\\n'\n \n elif img1 !=[]:\n img_href='https://www.facebook.com'+img1[0]['href']\n m+=img_href+'\\n'\n \n else:\n img=soup.find_all('a',href=re.compile(\"pcb\"))\n if img !=[]:\n for i in img:\n img_href='https://www.facebook.com'+i['href']\n m+=img_href+'\\n' \n \n \n else:\n img=soup.find_all('a',href=re.compile(\"photos\"))\n if img !=[]:\n for i in img:\n img_href='https://www.facebook.com'+i['href']\n m+=img_href+'\\n'\n \n Images.append(m)\n \n return Images","def hook_image_tag(self, parser, space, name):\n link = name\n caption = name\n params = {}\n\n # Parse the inner syntax, e.g. [[Image:src|option=val|caption]]\n separator = name.find('|')\n items = []\n if separator != -1:\n items = link.split('|')\n link = items[0]\n # If the last item contains '=', it's not a caption\n if items[-1].find('=') == -1:\n caption = items[-1]\n items = items[1:-1]\n else:\n caption = link\n items = items[1:]\n\n # parse the relevant items\n params = self._buildImageParams(items)\n img_path = self._getImagePath(link)\n\n template = jingo.env.get_template('wikiparser/hook_image.html')\n r_kwargs = {'img_path': img_path, 'caption': caption, 'params': params}\n return template.render(**r_kwargs)","def format_post_background(post: dict) -> str:\n parsed = urllib.parse.urlparse(post['url'])\n logger.debug(f\"Sending post: {post['name']}\")\n if 'i.redd.it' in post['url']:\n return f\"\"\"\n <div id=\"{post['name']}\" class=\"col-sm-3 col-lg-3 col-xxl-3\">\n <img class=\"\" style=\"width: 100%;\" src=\"{post['url']}\">\n </div>\n \"\"\"\n elif 'v.redd.it' in post['url']:\n if post['media'] is not None:\n return \"\"\n return f\"\"\"\n <div id=\"{post['name']}\" class=\"col-sm-3 col-lg-3 col-xxl-3\">\n <video style=\"width: 100%;\" data-dashjs-player autoplay src=\"{post['media']['reddit_video']['dash_url']}\" controls></video>\n </div>\n \"\"\"\n else:\n logger.error(f\"Error no media for v.redd.it link: {post['url']}\")\n return \"\"\n elif 'imgur' in post['url'] and ('gif' in post['url'] or 'mp4' in post['url']):\n return \"\"\n imgur_id = parsed.path.split('.')[0].split('/')[-1]\n return f\"\"\"\n <div id=\"{post['name']}\" class=\"col-sm-3 col-lg-3 col-xxl-3\">\n <video controls poster=\"//i.imgur.com/{imgur_id}.jpg\" preload=\"auto\" autoplay=\"autoplay\" muted=\"muted\" loop=\"loop\" webkit-playsinline=\"\" style=\"width: 100%; height: 100%;\">\n <source src=\"//i.imgur.com/{imgur_id}.mp4\" type=\"video/mp4\">\n </video>\n </div>\n \"\"\"\n elif 'imgur' in post['url']:\n imgur_id = parsed.path.split('.')[0].split('/')[-1]\n return f\"\"\"\n <div id=\"{post['name']}\" class=\"col-sm-3 col-lg-3 col-xxl-3\">\n <img class=\"\" style=\"width: 100%;\" src=\"//i.imgur.com/{imgur_id}.jpg\">\n </div>\n \"\"\"\n elif 'redgif' in post['url']:\n return \"\"\n redgifs_id = parsed.path.split('.')[0].split('/')[-1]\n return f\"\"\"\n <div id=\"{post['name']}\" class=\"col-sm-3 col-lg-3 col-xxl-3\">\n <div style='position:relative; padding-bottom:88.67%;'>\n <iframe src='https://redgifs.com/ifr/{redgifs_id}' frameborder='0' scrolling='no' width='100%' height='100%' style='position:absolute;top:0;left:0;' allowfullscreen></iframe>\n </div>\n </div>\n \"\"\"\n elif 'gfycat' in post['url']:\n return \"\"\n else:\n thumbnail = post.get('thumbnail', '/favicon.ico')\n thumbnail = thumbnail if thumbnail != '' else '/favicon.ico'\n return f\"\"\"\n <div id=\"{post['name']}\" class=\"col-sm-3 col-lg-3 col-xxl-3\">\n <a href=\"{post['url']}\"><img class=\"\" style=\"width: 100%;\" src=\"{thumbnail}\">\n </div>\n \"\"\"\n return \"\"","def img(self, obj):\n return mark_safe(\n f\"<img src='/{obj.image.url}' width='{obj.image.width}' height='{obj.image.height}' />\"\n )","def show_me():\n # Scumbag thumbnail code\n try:\n from PIL import Image\n except ImportError:\n pass\n else:\n filename = os.path.join(app.static_folder, 'img', 'badumtss.png')\n image = Image.open(filename)\n\n return render_template('show_me.html')","async def img(ctx, message):\n \"\"\":param: ctx\"\"\"\n \"\"\":param: message\"\"\"\n \"\"\"return image url\"\"\"\n link_list = []\n\n url = \"http://imgur.com/search?q=\" + message\n response = urlopen(url)\n html = response.read()\n soup = BeautifulSoup(html, \"lxml\")\n for a in soup.find_all('a', href=True):\n if((a['href'][0:9]) == \"/gallery/\"):\n link_list.append(\"https://imgur.com/\" + a['href'])\n if(len(link_list) >=1):\n random_num = random.randint(0, len(link_list) - 1)\n await bot.say(link_list[random_num])\n else:\n await bot.say(\"there is no contente for \"+message)","def get_content(self):\n\n self.content = self.book.get_template('cover')\n\n tree = parse_string(super(EpubCoverHtml, self).get_content())\n tree_root = tree.getroot()\n\n images = tree_root.xpath('//xhtml:img', namespaces={'xhtml': NAMESPACES['XHTML']})\n\n images[0].set('src', self.image_name)\n images[0].set('alt', self.title)\n\n tree_str = etree.tostring(tree, pretty_print=True, encoding='utf-8', xml_declaration=True)\n\n return tree_str","def parse_template(data, template):\n img_html = \"\"\"<div class=\"thumb-wrap\"><div class=\"thumb-holder\"></div><a href=\"{{URL}}\" target=\"_top\"><div class=\"thumb-img\" style=\"background-image:url('{{IMG}}');\"></div></a></div>\"\"\"\n template = template.replace('{{URL}}', data['link'].replace('http:','https:'))\n template = template.replace('{{URLX}}', data['link'])\n template = template.replace('{{TITLE}}', data['title'])\n #template = template.replace('{{BLURB}}', data['summary'])\n img_html = img_html.replace('{{URL}}', data['link'].replace('http:','https:'))\n if hasattr(data, 'tags') and len(data['tags']) > 0:\n template = template.replace('{{SECTION}}', data['tags'][0]['term'])\n else:\n template = template.replace('<h2><a href=\"{{URL}}\" target=\"_top\">{{SECTION}}</a></h2>', '')\n if hasattr(data, 'media_content') and len(data['media_content']) > 0:\n template = template.replace('{{IMG}}', '%s?w=150' % data['media_content'][0]['url'].replace('http:','https:'))\n else:\n template = template.replace(img_html, '')\n\n return template","def index():\n\n return \"\"\"\n <div>\n <h1> Image Captioning REST API </h1>\n <h3> The following API end points are valid </h3>\n <ul>\n <h4> Inception V3 </h4>\n <li> <code>/inception/v3/ping </code> - <br/>\n <b> Description : </b> checks availability of the service. returns \"pong\" with status 200 when it is available\n </li>\n <li> <code>/inception/v3/caption/image</code> - <br/>\n <table>\n <tr><th align=\"left\"> Description </th><td> This is a service that can caption images</td></tr>\n <tr><th align=\"left\"> How to supply Image Content </th></tr>\n <tr><th align=\"left\"> With HTTP GET : </th> <td>\n Include a query parameter <code>url </code> which is an http url of JPEG image <br/>\n Example: <code> curl \"localhost:8764/inception/v3/caption/image?url=http://xyz.com/example.jpg\"</code>\n </td></tr>\n <tr><th align=\"left\"> With HTTP POST :</th><td>\n POST JPEG image content as binary data in request body. <br/>\n Example: <code> curl -X POST \"localhost:8764/inception/v3/caption/image\" --data-binary @example.jpg </code>\n </td></tr>\n </table>\n </li>\n <ul>\n </div>\n \"\"\"","def get_thumbnail_url():","def get_image_link():\n image_links = set()\n supplemented_keyword = urllib.parse.quote(\n supplemented_keywords[random.randint(0,\n len(supplemented_keywords) - 1)],\n safe='')\n main_keyword = urllib.parse.quote(\n main_keywords[random.randint(0,\n len(main_keywords) - 1)], safe='')\n\n # print('the theme of cats: ' + supplemented_keyword)\n\n search_query = (main_keyword + ' ' + supplemented_keyword).replace(\n ' ', '%20')\n url = 'https://www.google.com/search?q=' + \\\n search_query + '&source=lnms&tbm=isch'\n image_links = image_links.union(parse_page(url))\n\n image_link = list(image_links)[random.randint(0, len(image_links) - 1)]\n # print('link:' + image_link)\n\n while 'https://' not in image_link or r'\\\\u' in image_link or '.jpg' not in image_link:\n image_link = list(image_links)[random.randint(0, len(image_links) - 1)]\n # print('link:' + image_link)\n\n return image_link","def prettyformat(self):\n \n import re\n\n html = self.get_htmlsrc()\n if type(html) == type([]):\n html = html[0]\n if type(html) != type(\"\"):\n try:\n html = str(html)\n except:\n html = html.__str__()\n \n tmp = BeautifulSoup(html)\n base = self.target_baseurl()\n# aitems = tmp.findAll(\"a\",href=re.compile(\"^\\/\"))\n aitems = tmp.findAll(\"a\",href=re.compile(\"^[^hH]\"))\n for i in aitems:\n u = i['href']\n if u[0] != '/':\n i['href'] = base + '/' + u\n else: \n i['href'] = base + u\n# imgitems = tmp.findAll(\"img\",src=re.compile(\"^\\/\"))\n imgitems = tmp.findAll(\"img\",src=re.compile(\"^[^hH]\"))\n for j in imgitems:\n v = j['src']\n if v[0] != '/':\n j['src'] = base + '/' + v\n else: \n j['src'] = base + v\n return tmp","def wiki_image(pagetext):\n images = [i for i in pagetext.images if i not in EXCLUDED_IMAGES]\n if len(images) > 0:\n return images[0]\n else:\n return ''","def parse_content(self, node):\n\n if node is None:\n return ''\n\n for image_node in node.find_all('img'):\n source = image_node.get('src')\n image_node['src'] = self.get_link(source)\n\n return str(node)","def _handle_img_tag(self, attrs):\n alt = \"\"\n image_format = \"\"\n image_id = 0\n for key, value in attrs:\n if key == \"alt\":\n alt = value\n if key == \"class\":\n image_format = value.split()[1].replace(\"-\", \"\")\n if key == \"src\":\n filename, _, extension = value.split(\"/\")[-1].split(\".\")\n image_id = ImageModel.objects.get(file__endswith=f\"{filename}.{extension}\").id\n return f\"<embed alt='{alt}' embedtype='image' format='{image_format}' id='{image_id}'/>\"","def bb_forum(hit):\n try:\n forum_slug = hit.group(1)\n f = Forum.objects.get(slug=forum_slug)\n return '<a href=\"%s\"><img src=\"%snewspaper.png\" alt=\"forum\" border=\"0\" /> %s</a>' % (f.get_absolute_url(), settings.MEDIA_URL, f)\n except:\n return \"[forum]%s[/forum]\" % (forum_slug)","def image_capture_demo():\n return render_template('image_capture_demo.html')","def avatar_preview(self):\r\n h = '<img src=\"%s\" alt=\"%s\"/>' % (self.image_avatar_url, self.title)\r\n return mark_safe(h)","def l10n_img(ctx, url):\n return static(l10n_img_file_name(ctx, url))","def get_html(self):\r\n context = {\r\n 'display_name': self.display_name_with_default,\r\n 'instructions_html': self.instructions,\r\n 'annotation_storage': self.annotation_storage_url,\r\n 'token': retrieve_token(self.user, self.annotation_token_secret),\r\n 'tag': self.instructor_tags,\r\n 'openseadragonjson': self.openseadragonjson,\r\n }\r\n\r\n return self.system.render_template('imageannotation.html', context)","def preview_tag(self, pid):\n data = self.api.get_product_odata(pid)\n url = data['quicklook_url']\n user = os.environ['HUB_USER']\n password = os.environ['HUB_PASS']\n r = requests.get(url, auth=HTTPBasicAuth(user, password))\n c = r.content\n c64 = base64.b64encode(c)\n tag_template = '<img width=\"150\" height=\"150\" src=\"data:image/jpg;base64, {}\">'\n return tag_template.format(c64.decode('utf-8'))","def test_lazy_images(self):\n sample = load_sample('wired.sample.html')\n doc = Document('http://www.wired.com/design/2014/01/will-influential-ui-design-minority-report/', sample)\n article = doc.get_clean_article()\n self.assertIn('<img src=\"http://www.wired.com/images_blogs/design/2014/01/her-joaquin-phoenix-41-660x371.jpg\"', article)","def image(self, text):\n pattern = re.compile(r\"\"\"\n (?:[\\[{])? # pre\n \\! # opening !\n (\\<|\\=|\\>)? # optional alignment atts\n (%s) # optional style,class atts\n (?:\\. )? # optional dot-space\n ([^\\s(!]+) # presume this is the src\n \\s? # optional space\n (?:\\(([^\\)]+)\\))? # optional title\n \\! # closing\n (?::(\\S+))? # optional href\n (?:[\\]}]|(?=\\s|$)) # lookahead: space or end of string\n \"\"\" % self.c, re.U | re.X)\n return pattern.sub(self.fImage, text)","def add_image_to_html(self, image_path):\r\n file_object = open(self.file_name, 'a+')\r\n html_content = f'<div><img src={image_path} width=\"500\" height=\"300\"></div>'\r\n file_object.write(html_content)","def process_image_url(value, field):\n if field.width:\n if not value:\n return u\"无\"\n return mark_safe(\"\"\"\n <a href=\"{0}\" target=\"_blank\"><img src=\"{0}\" width=\"{1}\" a>\n \"\"\".format(absolute_media_path(value), field.width))\n # only show url address.\n elif value:\n shorten_value = ''\n if len(value) > 20:\n shorten_value = value[0:12] + \"...\"\n return mark_safe(\"\"\"\n <a href=\"{0}\" target=\"_blank\" title=\"{0}\" >{1}</a>\n \"\"\".format(absolute_media_path(value), shorten_value if shorten_value else value))\n else:\n return \"\"","def getimgs():","def make_page(keyword, html):\n output = []\n addline = output.append\n\n addline('<!DOCTYPE HTML PUBLIC \"-//W3C//DTD HTML 4.01//EN\" \"http://www.w3.org/TR/html4/strict.dtd\">')\n addline('<html>')\n addline('<head>')\n addline('<title>Tweets for #%s</title>' % (keyword))\n addline('<style type=\"text/css\">')\n addline('div.tweet_container { float: right; width: 400px; font-size: 0.8em; border: 2px solid darkblue; padding: 8px; height: 80%; overflow-y: scroll; }')\n addline('div.tweet_container h3 { margin: 0; padding: 0; text-align: center; color: darkblue; margin-bottom: 6px; padding-bottom: 6px; border-bottom: 2px solid darkblue; }')\n addline('div.tweet { clear: both; }')\n addline('div.tweetphoto { float:left; width: auto; margin: 0; padding: 0; }')\n addline('div.tweetphoto img { border: none; width: 48px; height: 48px; display: block; margin: 0; margin-bottom: 24px; margin-right: 8px; padding: 0; }')\n addline('div.tweetphoto a > img { border: 1px solid black; }')\n addline('</style>')\n addline('</head>')\n addline('<body>')\n\n addline(html)\n\n addline('</div>')\n addline('</body>')\n addline('</html>')\n return '\\n'.join(output)","def process_images(text):\n # if text != None:\n if text is not None:\n soup = BeautifulSoup(str(text), 'html.parser')\n img = soup.img\n try:\n image = img['title']\n return image\n except (TypeError, KeyError):\n # print(img)\n pass","def background_image(self, **kwargs):\n try:\n asset = self.app.module_map.uploader.get(self.barcamp.background_image)\n except AssetNotFound:\n asset = None\n if not asset:\n return u\"\"\n v = asset.variants['full']\n url = self.app.url_for(\"asset\", asset_id = v._id)\n amap = html_params(**kwargs)\n return \"\"\"<img src=\"%s\" width=\"%s\" height=\"%s\" %s>\"\"\" %(\n url,\n v.metadata['width'],\n v.metadata['height'],\n amap)","def get_image_url(article):\n get_image = article.find_all(\"img\")[0]\n return get_image.get(\"src\").replace(\"../../\", \"http://books.toscrape.com/\")","async def images(self, ctx, *, query: str=None):\n # Handle empty query\n if query is None:\n return await ctx.error('Please provide a query!')\n\n # Using these specific headers and \"lnms\" as source, will provide divs with \"rg_meta\" classes,\n # The modern image search page being JS rendered, data in these divs are jsons with raw image URLs\n # Old image search pages, only have thumbnails and a direct link to websites\n params = {'q': quote_plus(query), 'source': 'lmns', 'tbm': 'isch'}\n async with self.aiohttp_session.get(self.url, params=params, headers=self.image_headers) as r:\n html = await r.text()\n\n # Healthy\n soup = BeautifulSoup(html, 'lxml')\n\n # Go over 4 items, json.loads the item text, and grab \"ou\" probably stands for \"original url\"\n images = []\n for i, item in enumerate(soup.select('div.rg_meta')[:4]):\n js = json.loads(item.text)\n images.append((f\"{i+1}. {js['st']} - {js['s']}\", js[\"ou\"]))\n newl = '\\n'\n await ctx.message.edit(content=f\"```py\\n{newl.join([x[0] for x in images])}\"\n f\"\\n# Choose the appropriate number or type 0 to leave\\n```\")\n\n def check(m):\n return m.author == ctx.author and m.content.isdigit() and m.channel == ctx.channel\n message = await self.bot.wait_for('message', check=check)\n if message.content == \"0\":\n await message.delete()\n return await ctx.message.delete()\n choice = int(message.content) - 1\n await message.delete()\n await ctx.message.edit(content=images[choice][1])","def get_image_qm(html_src, todir):\n #print url\n\n img_url, title = img_details(html_src)\n \n r = requests.get(img_url)\n with open(todir+title+'.jpg','wb') as f:\n f.write(r.content)","def make_content(museum, image_url, image_name, image_artist, filename):\n message = \"From the \" + museum\n # if image_name is not None:\n # message += \" with title \" + image_name\n if image_artist is not None:\n message += \" by \" + image_artist\n\n r = requests.get(image_url)\n if r.status_code == 200:\n with open(filename, mode=\"wb\") as image:\n for chunk in r:\n image.write(chunk)\n else:\n return None\n return (message)","def html_to_text_img(url):\n if url is '' or url is None:\n return None\n try:\n html = urlopen(url)\n except HTTPError as e:\n print(e)\n return None\n except URLError as e:\n print(e)\n return None\n\n try:\n soup = BeautifulSoup(html.read(), \"html.parser\")\n except AttributeError as e:\n print(e)\n return None\n\n title = soup.find(\"h1\").get_text()\n text = ''\n ps = soup.find(\"div\", {\"class\": \"article gtm-click\"}).find_all('p')\n for p in ps:\n text += ''.join(p.get_text())\n imgs = soup.select(\"div.article__image img\")\n img_url = imgs[0]['data-src']\n\n return title, text, img_url","def get_images(self, article: BeautifulSoup):\n images = []\n content = article.select_one(self.parsing_template.content)\n\n if content:\n body_images = content.select(self.parsing_template.image_element)\n else:\n body_images = None\n\n if body_images:\n for element in body_images:\n\n img = element.find('img')\n if not img:\n continue\n url = img.get(self.parsing_template.image_attribute) # TODO format url correctly\n\n try:\n text = self.get_text(element, self.parsing_template.image_text)\n except IndexError:\n text = ''\n\n try:\n photographer = self.get_text(element, self.parsing_template.image_photographer)\n except IndexError:\n photographer = ''\n\n # Image text and photographer is not separated.\n # Tries to separate out the photographer\n if self.parsing_template.photographer_delimiter:\n if text and not photographer:\n text, photographer = self.parse_photographer(text, text)\n if photographer:\n text, photographer = self.parse_photographer(text, photographer)\n\n if url:\n if photographer:\n # Removes unwanted text in the photographer\n for replace in self.parsing_template.photograph_ignore_text:\n photographer = photographer.replace(replace, '')\n photographer = photographer.replace('/', ',')\n\n if len(text) > 255:\n text = text[:254]\n\n # Separate each photograph\n photographers = []\n for photograph in photographer.split(','):\n photographer_name_split = list(filter(lambda x: x or x != ' ', photograph.split(' ')))\n if photographer_name_split:\n if len(photographer_name_split) == 1:\n lastName = photographer_name_split[0].strip(' ').strip('.')\n firstName = ''\n else:\n firstName = photographer_name_split[0].strip(' ')\n lastName = photographer_name_split[1].strip(' ').strip('.')\n photographers.append(Photographer(firstName=firstName, lastName=lastName))\n\n images.append((ArticleImage(url=url, text=text), photographers))\n\n return images","def logosmall(self):\n try:\n asset = self.app.module_map.uploader.get(self.barcamp.logo)\n except AssetNotFound:\n asset = None\n if not asset:\n return u\"\"\n v = asset.variants['medium_user']\n url = self.app.url_for(\"asset\", asset_id = v._id)\n return \"\"\"<a href=\"%s\"><img src=\"%s\" width=\"%s\" height=\"%s\"></a>\"\"\" %(\n self.handler.url_for(\"barcamps.index\", slug = self.barcamp.slug),\n url,\n v.metadata['width'],\n v.metadata['height'])","def insert_image(self, image64: str, class_txt: str, height: int, width: int) -> str:\n if (height is None) & (width is None):\n image = \"\"\"<div class=\"text-center\">\n <img class=\"resize\" src=\"data:image/png;base64, \"\"\" + image64 + \"\"\"\"/>\\n\n </div>\"\"\"\n else:\n image = \"\"\"<div>\n <img class=\"\"\" + class_txt + \"\"\" src=\"data:image/png;base64, \"\"\" + image64 + \"\"\"\"\" height=\"\"\" + str(\n height) + \"\"\" width=\"\"\" + str(\n width) + \"\"\"/>\\n\n </div>\n \"\"\"\n\n self.html_doc = self.html_doc + image\n return self.html_doc","def extract_images_url(url, source):\n if source == \"mangaseeonline\":\n r = s.post(\n \"http://playwright:5000/scrape\",\n json={\n \"url\": url.replace(\"-page-1\", \"\"), \"wait\": 1}\n )\n tree = html.fromstring(r.text)\n return tree.xpath('//*[@id=\"TopPage\"]/descendant::img/@src')\n if source == \"nettruyen\":\n r = s.get(\n settings.SPLASH_URL, params={\n \"url\": url.replace(\"-page-1\", \"\"), \"wait\": 1}\n )\n tree = html.fromstring(r.text)\n return tree.xpath('//*[@class=\"reading-detail box_doc\"]/div/img/@src')\n if source == \"doctruyen3q\":\n r = s.get(\n settings.SPLASH_URL, params={\"url\": url, \"wait\": 1}\n )\n tree = html.fromstring(r.text)\n return tree.xpath('//*[contains(@id, \"page_\")]/img/@src')\n if source == \"truyenkinhdien\":\n r = s.get(\n settings.SPLASH_URL.replace(\"render.html\", \"execute\"),\n params={\"url\": url, \"lua_source\": lua_script, \"wait\": 1},\n )\n tree = html.fromstring(r.json()[\"html\"])\n return tree.xpath(\n '//*[@class=\"sgdg-gallery\"]/a[not(contains(@style,\"display:none\"))]/img/@src'\n )","def mk_image_tag(self, uri: str) -> str:\n\n data_uri, width, height = self.webserver.get_image(f'{uri}&features=unstable')\n return f'<img src=\"{data_uri}\" width=\"{width}\" height=\"{height}\"/>'","def get_album_art_url(html):\n\treturn re.findall('img src=\"(.*?)\" width=\"500\"', html)[0]","def injectImage(self, img_info, open_url):\n injected_img = None\n\n if img_info.size/1024 < 256:\n encoded = base64.b64encode(open_url.read())\n injected_img = ('<img src=\"data:image/jpeg;charset=utf-8;base64,' +\n str(encoded) +\n '\" %s />' % self.getModifiers(img_info))\n else:\n image = Image.open(StringIO.StringIO(open_url.read()))\n image.thumbnail((self.cfg().chatimg.max_width, self.cfg().chatimg.max_height), Image.ANTIALIAS)\n trans = StringIO.StringIO()\n image.save(trans, format=\"JPEG\")\n encoded = base64.b64encode(trans.getvalue())\n injected_img = ('<img src=\"data:image/jpeg;charset=utf-8;base64,' +\n str(encoded) +\n '\" />')\n\n return injected_img","def add_three_images(document_text, image_link_template, image_folder, images, width):\n for idx in range(3):\n document_text += \"\\n\"\n image_info = r'<td>{0}</td>'.format(image_link_template.format(\n os.path.join(image_folder, images[idx]), width))\n document_text = add_document_text(document_text, image_info)\n return document_text","def add_to_html(self, news: dict) -> str:\n\n add_to_html_file = \"\"\n add_to_html_file += f\"<h2>Title: {news['Title']}</h2>\\n\"\n add_to_html_file += f\"<a href={news['Link']}>Link to news</a><br>\\n\"\n add_to_html_file += f\"<p>PubDate: {news['PubDate']}</p>\\n\"\n add_to_html_file += f\"<p>Source: {news['Source']}</p>\\n\"\n full_path_to_image = f\"{self.full_path_to_image_cache}{os.sep}{news['ImageCacheName']}\"\n add_to_html_file += f\"<img height='120' src='{full_path_to_image}' alt='No image'>\\n<br>\\n<br>\\n\"\n\n return add_to_html_file","def build_md_once(self, index, tid):\n url = self.joint_url(tid)\n title_json = proxy_req(url, 1)\n if not title_json:\n if can_retry(url, index):\n self.build_md_once(index, tid)\n return\n content = BeautifulSoup(\n title_json['content'], 'html.parser').find_all('div')\n text = []\n img_href = []\n img_id = 1\n ttid = 1\n img_title = self.find_title(index).split('/')[1][:-3]\n for word in content:\n temp_text = ''\n if word.span and len(word.span.text) and not word.span.text[0].isdigit:\n temp_text = '## ' + word.span.text\n ttid = 1\n if word.img:\n temp_text = ' + '.jpg)'\n img_href.append(word.img['src'].replace('https', 'http'))\n img_id += 1\n\n if not len(temp_text):\n temp_text = word.text\n if len(temp_text) and temp_text[0].isdigit():\n temp_text = str(ttid) + '. **' + \\\n ' '.join(temp_text.split('\\xa0')[1:]).strip() + '**'\n ttid += 1\n if len(temp_text) and temp_text[0:2] == '//':\n temp_text = str(ttid) + '. **' + \\\n ' '.join(temp_text.split('\\xa0')[2:]).strip() + '**'\n ttid += 1\n if len(temp_text) and (temp_text[0] == '￥' or temp_text[0] == '€'):\n temp_text = '<a>' + temp_text + '</a>'\n text.append(temp_text)\n with codecs.open(data_dir + self.find_title(index), 'w', encoding='utf-8') as f:\n f.write('\\n'.join(text))\n self.img_map[index] = img_href\n print(index, len(img_href))","def get_image_url(img):\n # element['data-src'] and element.get('data-src') doesn't work\n for k, v in img.items():\n if k == 'data-src':\n # https://t.nhentai.net/galleries/<gallerycode>/<page#>t.<extension>\n # https://i.nhentai.net/galleries/<gallerycode>/<page#>.<extension>\n return v[:8] + 'i' + v[9:32] + v[32:].replace('t.', '.', 1)","def gallery():\n return render('base.html')","def _repr_html_(self):\n import io\n import base64\n from PIL import Image\n\n library_name = \"vedo.assembly.Assembly\"\n help_url = \"https://vedo.embl.es/docs/vedo/assembly.html\"\n\n arr = self.thumbnail(zoom=1.1, elevation=-60)\n\n im = Image.fromarray(arr)\n buffered = io.BytesIO()\n im.save(buffered, format=\"PNG\", quality=100)\n encoded = base64.b64encode(buffered.getvalue()).decode(\"utf-8\")\n url = \"data:image/png;base64,\" + encoded\n image = f\"<img src='{url}'></img>\"\n\n # statisitics\n bounds = \"<br/>\".join(\n [\n vedo.utils.precision(min_x, 4) + \" ... \" + vedo.utils.precision(max_x, 4)\n for min_x, max_x in zip(self.bounds()[::2], self.bounds()[1::2])\n ]\n )\n\n help_text = \"\"\n if self.name:\n help_text += f\"<b> {self.name}:   </b>\"\n help_text += '<b><a href=\"' + help_url + '\" target=\"_blank\">' + library_name + \"</a></b>\"\n if self.filename:\n dots = \"\"\n if len(self.filename) > 30:\n dots = \"...\"\n help_text += f\"<br/><code><i>({dots}{self.filename[-30:]})</i></code>\"\n\n allt = [\n \"<table>\",\n \"<tr>\",\n \"<td>\",\n image,\n \"</td>\",\n \"<td style='text-align: center; vertical-align: center;'><br/>\",\n help_text,\n \"<table>\",\n \"<tr><td><b> nr. of objects </b></td><td>\"\n + str(self.GetNumberOfPaths())\n + \"</td></tr>\",\n \"<tr><td><b> position </b></td><td>\" + str(self.GetPosition()) + \"</td></tr>\",\n \"<tr><td><b> diagonal size </b></td><td>\"\n + vedo.utils.precision(self.diagonal_size(), 5)\n + \"</td></tr>\",\n \"<tr><td><b> bounds </b> <br/> (x/y/z) </td><td>\" + str(bounds) + \"</td></tr>\",\n \"</table>\",\n \"</table>\",\n ]\n return \"\\n\".join(allt)","def _formatBody(self, body_contents):\n body_contents = str(body_contents)\n\n # Replace github image tag  with plain url\n p = re.compile('!\\[.*?\\]\\((.*?)\\)')\n body_contents = p.sub('\\g<1>', body_contents)\n\n # Replace github image tag <img> with plain url\n p = re.compile('<img.*src=\"(.*?)\".*>')\n body_contents = p.sub('\\g<1>', body_contents)\n\n # Replace ``` with [code] tag\n p = re.compile('```(.*?)(```|$)', re.DOTALL)\n body_contents = p.sub('[code]\\g<1>[/code]', body_contents)\n\n return self._cutBody(body_contents)","def get_content(html_soup):\n text_above_image = html_soup.findAll('div', attrs = {\"class\" : \"rs-content abstract\"})\n if len(text_above_image) > 1:\n text_above_image = text_above_image[1].get_text()\n else:\n text_above_image = '' \n text_below_image = html_soup.find('div', attrs = {\"class\" : \"body\"}).get_text()\n content = text_above_image + text_below_image\n \n return content","def get_images(self, page_number):","def add_to_fb2(self, news: dict) -> str:\n\n add_to_fb2_file = \"\"\n add_to_fb2_file += f\" <p>Title: {news['Title']}</p>\\n\"\n add_to_fb2_file += f\" <p><a l:href='{news['Link']}'> 'Link to news' </a></p>\\n\"\n add_to_fb2_file += f\" <p>PubDate: {news['PubDate']}</p>\\n\"\n add_to_fb2_file += f\" <p>Source: {news['Source']}</p>\\n\"\n\n if news['ImageCacheName']:\n add_to_fb2_file += f\" <p><image l:href='#{news['ImageCacheName']}'/></p>\\n\"\n with open(f\"{self.full_path_to_image_cache}{os.sep}{news['ImageCacheName']}\", \"rb\") as img_file:\n b64_string = base64.b64encode(img_file.read())\n self.binaries += f\"<binary id='{news['ImageCacheName']}' \" \\\n f\"content-type='image/jpeg'>{b64_string.decode('utf-8')}</binary>\\n\"\n\n add_to_fb2_file += f\" <empty-line/>\\n\"\n\n return add_to_fb2_file","def return_image(val, model_id, message_name, field_name, mime, sind):\n column_data_source = curdoc().get_model_by_name(sind)\n index = column_data_source.tags[0]\n url = \"http://{0}/image/\".format(_host) + \"---\".join([model_id, message_name, field_name, mime, sind, str(index)])\n return url","def generate_file_link_html_from_url(self, s3_public_url, file_name):\r\n image_link = \"\"\"\r\n <a href=\"{0}\" target=\"_blank\">{1}</a>\r\n \"\"\".format(s3_public_url, file_name)\r\n return image_link","def render_social_media_metadata(self):\n sm_metadata_html = SM_METADATA_TEMPLATE.format(\n self.view.permalink,\n self.view.img_urls[1],\n self.view.img_urls[0],)\n return sm_metadata_html","def create_base_image(self, builder, template, parameters):","async def getImageURLS(self, tags, fuzzy=False, singlePage=False):\n if fuzzy:\n tags = tags.split(\" \")\n for tag in tags:\n tag = tag + \"~\"\n temp = \" \"\n tags = temp.join(tags)\n print(tags)\n num = await self.totalImages(tags)\n if num != 0:\n PID = 0\n imgList = []\n XML = None\n t = True\n tempURL = self.urlGen(tags=tags, PID=PID)\n while t:\n with async_timeout.timeout(10):\n async with self.session.get(url=tempURL) as XML:\n XML = await XML.read()\n XML = ET.XML(XML)\n XML = self.ParseXML(XML)\n if XML is None:\n return None\n if len(imgList) >= int(XML['posts']['@count']): # \"if we're out of images to process\"\n t = False # \"end the loop\"\n else:\n for data in XML['posts']['post']:\n imgList.append(str(data['@file_url']))\n if singlePage:\n return imgList\n PID += 1\n return imgList\n else:\n return None","def embed_image_html(image, type):\n if type == 'dehaze':\n image_pil = Image.fromarray((image).astype('uint8'))\n elif type == 'style_transfer':\n image_pil = Image.fromarray((image).astype('uint8'))\n else:\n image_pil = Image.fromarray((255 * image).astype('uint8'))\n if sys.version_info.major == 2:\n string_buf=StringIO.StringIO()\n image_pil.save(string_buf, format='png')\n data = string_buf.getvalue().encode('base64').replace('\\n', '')\n else:\n _buf = BytesIO()\n image_pil.save(_buf, format='png')\n _buf.seek(0)\n b64_buf = base64.b64encode(_buf.getvalue())\n string_buf = StringIO(b64_buf.decode('utf-8', errors='replace'))\n data =string_buf.getvalue().replace('\\n', '')\n\n return 'data:image/png;base64,' + data","def url_for(**options):\n\n url_parts = get_url_parts(**options)\n image_hash = hashlib.md5(b(options[\"image_url\"])).hexdigest()\n url_parts.append(image_hash)\n\n return \"/\".join(url_parts)","def crawling_images_url(self, data_dict, output_choice, commentors = False, tagged = True):\n\n content = []\n usernamelist = []\n\n for key in data_dict:\n data = self.json_url(data_dict[key]['url'])\n tempdict = data['entry_data']['PostPage'][0]['graphql']['shortcode_media']\n \n if commentors:\n for comment in tempdict['edge_media_to_comment']['edges']:\n newuser = comment['node']['owner']['username']\n if newuser not in usernamelist and newuser != self.username:\n usernamelist.append(newuser)\n data1 = self.rootuser_info(self.userpage_scraper(newuser))\n if output_choice[0]:\n print(data1)\n elif output_choice[1]:\n content.append(data1)\n\n if tagged:\n for tag in tempdict['edge_media_to_tagged_user']['edges']:\n newuser = tag['node']['user']['username']\n if newuser not in usernamelist and newuser != self.username:\n usernamelist.append(newuser)\n data1 = self.rootuser_info(self.userpage_scraper(newuser))\n if output_choice[0]:\n print(data1)\n elif output_choice[1]:\n content.append(data1)\n\n if output_choice[1]:\n self.pretty_print({'content': content}, False)","def html_factory(article, html_file):\n with html_file:\n tags.h1(article.title)\n tags.p(tags.b('Title: '), article.title)\n tags.p(tags.b('Link: ', tags.a(tags.b(article.link), href=article.link, )))\n tags.p(tags.b('Date: '), article.date.strftime(\"%a, %d %B, %Y\"))\n tags.p(tags.b('Source: '), article.source)\n tags.p(tags.b('Description: '), article.description)\n if article.image != '---':\n tags.p(tags.img(style=\"width:360px\", src=article.image))\n else:\n tags.p(tags.b('Sorry, no images for this article'))\n return html_file","async def _misc_IMGplumbob(self, ctx):\r\n await self.bot.say('{}, http://i.imgur.com/q8xJsJQ.gif'.format(ctx.message.author.mention))","def breadcrumb_subscriber( event ):\n img = '<img src=\"'+event.request.static_url(\"leirirekkari:static/img/icons/breadcrumb_home.png\") + '\" />'\n event.request.bread = [{'url':'/', 'text':img}]","def html_img_tags(self):\n return self.findall_markdown_cells(r'<img[^>]*>')","def PLACEHOLDER(width=100, height=100, HTTP=\"\", seperator='/'):\n return f\"{HTTP}://{CDN_IMG.PLACEHOLDER_SERVICE}/{width}{seperator}{height}\"","def ShowHTML(pTitle, href):\n\n oc = ObjectContainer(title2=pTitle)\n\n href = href if href else ''\n html = HTML.ElementFromURL(BASE_URL + href)\n\n if '/pornstars-click/' in href:\n href = '/profiles/' + href.rsplit('/', 1)[1]\n url = BASE_URL + href\n\n xvideosBest = \"thumb-block \"\n if (len(html.xpath('//div[@class=\"thumbBlock\"]')) > 0):\n xvideosBest = \"thumbBlock\"\n\n if (len(html.xpath('//title//text()')) > 0):\n if 'Pornstar page' in html.xpath('//title//text()')[0]:\n url = url + '/pornstar_videos/0/0'\n html = HTML.ElementFromURL(url)\n elif 'Channel page' in html.xpath('//title//text()')[0]:\n url = url + '/uploads/0/0'\n html = HTML.ElementFromURL(url)\n\n for video in html.xpath('//div[@class=\"%s\"]' %xvideosBest):\n try:\n if '/profiles/' not in url and '/pornstars-click' not in url:\n if (len(video.xpath('./div/div/a//@href')) == 0):\n oc.add(VideoClipObject(\n url=BASE_URL + video.xpath('./p/a//@href')[0],\n title=video.xpath('./p/a//text()')[0],\n thumb=THUMB_REG.search(video.xpath('./div/div/script//text()')[0]).group(1)\n ))\n else:\n vhref = video.xpath('./p/a//@href')[0]\n vtitle = video.xpath('./p/a//text()')[0]\n oc.add(DirectoryObject(\n key=Callback(ShowHTML, href=vhref, pTitle=vtitle),\n title=vtitle, thumb=THUMB_REG.search(video.xpath('./div/div/a/script//text()')[0]).group(1)\n ))\n else:\n oc.add(VideoClipObject(\n url=BASE_URL + video.xpath('./div/p/a//@href')[0],\n title=video.xpath('./div/p/a//text()')[0],\n thumb=video.xpath('./div/div/a/img//@src')[0]\n ))\n except:\n Log.Warn('nothing')\n\n # setup nextURL\n try:\n nextURL = None\n if html.xpath('//li/a[@data-page][text()=\"Next\"]'):\n next_page = int(html.xpath('//li/a[text()=\"Next\"]/@data-page')[0])\n nextURL = '/{}/{}'.format(url.split('/', 3)[3].rsplit('/', 1)[0], next_page)\n elif html.xpath('//li/a[@class=\"no-page\"][text()=\"Next\"]'):\n nextURL = html.xpath('//li/a[@class=\"no-page\"][text()=\"Next\"]/@href')[0]\n elif html.xpath('//div[contains(@class,\"pagination\")]//a[@class=\"active\"]/../following-sibling::li/a/@href'):\n nextURL = html.xpath(\"//div[contains(@class,'pagination')]/ul/li/a[@class='active']/../following-sibling::li/a/@href\")[0]\n\n if nextURL:\n next_page_num = nextURL.split('=')[-1] if '&' in nextURL else nextURL.split('/')[-1]\n next_page_num = next_page_num if next_page_num else nextURL.split('/')[-2]\n #Log(u\"next page number = '{}'\".format(next_page_num))\n oc.add(NextPageObject(\n key=Callback(ShowHTML, href=nextURL, pTitle='Page ' + next_page_num),\n title=\"More ...\"))\n except:\n Log.Exception(\"Cannot find next page\")\n # it will loop through and return the values for all items in the page\n return oc","def _get_image_url_in_content(self, content):\n begin_token = 'src=\"'\n begin = content.find(begin_token)\n if begin == -1:\n return None\n\n # Acrescentamos o tamanho do 'begin_token' no 'begin'\n begin += len(begin_token)\n end = content.find('\"', begin)\n url = content[begin:end]\n return url.split('?')[0]","async def bImage(self, ctx, query, num=1):\r\n\r\n webpage = \"http://www.bing.com/images/search?q=\" + query.replace(\" \", \"+\") + \"&view=detailv2&adlt=off&selectedIndex=0\"\r\n\r\n html_content = urllib.request.urlopen(webpage)\r\n str_html = html_content.read().decode(\"utf-8\")\r\n match = re.findall(r'src=\"http://?([^\\'\" >]+)', str_html)\r\n if match:\r\n try:\r\n await ctx.send(\"http://\" + match[num-1])\r\n except (Exception):\r\n await ctx.send(\"```No \" + str(num) + \"th Result```\")\r\n else:\r\n await ctx.send(\"```No Image Found```\")","def embed_image_html(imgBGR, target_width=TARGET_WIDTH, target_height=TARGET_HEIGHT):\n import cv2\n from PIL import Image\n if target_width is not None:\n imgBGR = _resize(imgBGR, t_width=target_width)\n elif target_width is not None:\n imgBGR = _resize(imgBGR, t_height=target_height)\n imgRGB = cv2.cvtColor(imgBGR, cv2.COLOR_BGR2RGB)\n pil_img = Image.fromarray(imgRGB)\n string_buf = StringIO()\n pil_img.save(string_buf, format='jpeg')\n data = string_buf.getvalue().encode('base64').replace('\\n', '')\n return 'data:image/jpeg;base64,' + data","def user_images_url(self, datadict):\n\n dict1 = datadict['entry_data']['ProfilePage'][0]['graphql']['user']['edge_owner_to_timeline_media']\n no_of_posts = dict1['count']\n\n posts = dict1['edges']\n\n posts_info = {}\n for count, post in enumerate(posts):\n tempdict = {}\n\n tempdict['url'] = \"https://www.instagram.com/p/\" + post['node']['shortcode']\n tempdict['is_video'] = post['node']['is_video']\n tempdict['caption'] = post['node']['edge_media_to_caption']['edges'][0]['node']\n\n\n posts_info[count] = tempdict\n\n return (posts_info)","def _format_image(image, tags):\n text = \", \".join(md.pre(tag) for tag in tags)\n dest = _to_dockerfile_url(image)\n return md.item(md.link(text, dest))","def images(name):\n return static_file(name, root=os.path.join(BASEDIR, \"images\"))","def get_image_link(self):\n table = self.soup.find('table')\n image_tag = table.find('img')\n image_name = self.soup.find_all(\"b\")[1].text\n return image_tag['src'], image_name\n\n # image = td.find_all('img')\n # print(image)\n # if image is not None:\n # return urljoin(self.base_url, image['src'])","def img_alt_src(html_source):\n # =============================================================================\n # Beautiful soup\n # =============================================================================\n \n bs = BeautifulSoup(html_source, 'html.parser')\n \n #Getting all Alt text from HTML \n alt_txt = [] \n img_url = []\n for img in bs.find_all('img', alt=True):\n try:\n print(img['alt'])\n print(img['src'])\n a = img['alt']\n s = img['src']\n alt_txt.append(a)\n img_url.append(s)\n except:\n print('pass')\n \n \n cleaning(alt_txt, img_url)","def getBody(HTMLstring, png_list):\n\n # Next, we generate all the rows but the last one...\n while len(png_list) > 4:\n HTMLstring += '<div class=\"row\">'\n for i in range(4):\n HTMLstring += ('''<div class=\"col-xs-3 imgbox\">\n <img class=\"img-responsive\" src=\"''' \n + png_list[i] + '''\" /><h5 class=\"center\">''' + png_list[i]\n + \"</h5></div>\")\n HTMLstring += \"</div>\"\n png_list = png_list[4:]\n \n # We obtain the last row by popping what remains.\n HTMLstring += '<div class=\"row\">'\n while len(png_list) > 0:\n png_file = png_list.pop(0)\n HTMLstring +=('''<div class=\"col-xs-3 imgbox\">\n <img class=\"img-responsive\" src=\"''' \n + png_file + '''\" /><h5 class=\"center\">''' + png_file\n + \"</h5></div>\")\n HTMLstring += \"</div>\"\n return HTMLstring","def image(name, value, width=\"\", height=\"\", alt=None):\n if alt is None:\n alt = name\n log.debug(u\"image %s\" % value)\n html = u\"<img id=\\\"%s\\\" \" % name\n html += u'alt=\"%s\" ' % alt\n if width:\n html += u\"width=\\\"%s\\\" \" % width\n if height:\n html += u\"height=\\\"%s\\\" \" % height\n html += u\"src=\\\"%s\\\" \" % value\n html += u\"/>\\n\"\n return html","def brief_json(self, absolutize_url):\n template = {}\n template.update({\n \"id\": self.image_id,\n \"links\": self.links_json(absolutize_url),\n \"name\": self.name\n })\n return template","def __urlImageGenerator(cls, link):\n\n try:\n a = Article(url=link)\n a.download()\n a.parse()\n a.fetch_images()\n\n for img in a.imgs:\n yield img\n except Exception:\n pass","def content(self, datas):\n subject = \"TCC - MLaaS Topzero D+\"\n\n body = f\"\"\"\n <h1>TCC MLaaS</h1>\n <p>Realizamos o treinamento da base de dados que nos foi enviada. Abaixo você pode ver nossa o resultado dos treinos realizados.</p>\n \"\"\"\n\n for data in datas:\n if data is not None:\n for key, info in data['images'].items():\n body += f\"\"\"{info[0]}\"\"\"\n if info[1] is not None:\n body += f\"\"\"<br><img src=\"cid:{info[1]}\" alt=\"{key}\" height=\"300\" width=\"300\"><br>\"\"\"\n\n body += f\"\"\"\n </br>\n Atenciosamente\n <h4><b>IESB</b></h4>\n <h5>created by <b>Allan Kleitson Teotonio</b></h5>\n <h5>Science Computer. 2019</h5>\n \"\"\"\n\n return subject, body","def tag_and_embed_image_urls(self, image_urls, model=None):\n return self._multi_imageurl_op(image_urls, ['tag','embed'], model=model)","def img_render(kve, lopt_str, sopt_str, gopt_str, popt_str, glopt_str, img_path):\n i_before = ''\n i_layer = ''\n i_after = ''\n i_label_str_html = ''\n if 'img' in kve:\n img_paths = [x.strip() for x in kve['img'].split(':')]\n for opt_str in glopt_str, popt_str, gopt_str, sopt_str, lopt_str:\n if 'autoilabel' in opt_str:\n i_label_str = os.path.splitext(os.path.basename(img_paths[0]))[0]\n i_label_str_html = ' <div class=\"label bottom\">' \\\n + i_label_str + '</div>'\n if 'ilabel' in kve:\n i_label_str = kve['ilabel']\n i_label_str_html = ' <div class=\"label bottom\">' \\\n + i_label_str + '</div>'\n img_tag_str = ''\n for idx, path in enumerate(img_paths):\n img_tag_str = img_tag_str + '<img src=\"' + img_path + img_paths[idx] + '\"/>'\n for opt_str in [glopt_str, popt_str, gopt_str, sopt_str, lopt_str]:\n if 'ibefore' in opt_str:\n i_before = ' <div class=\"layout ' + lopt_str \\\n + '\"><div class=\"img\">' + img_tag_str + '</div>' \\\n + i_label_str_html + '</div>'\n if 'iafter' in opt_str:\n i_after = ' <div class=\"layout ' + lopt_str \\\n + '\"><div class=\"img\">' + img_tag_str + '</div>' \\\n + i_label_str_html + '</div>'\n if not (i_before or i_after):\n i_layer = ' <div class=\"img\">' + img_tag_str + '</div>'\n return i_before, i_layer, i_after\n return '', '', ''","def _collect_img_links(self):\n raise NotImplementedError","def get_image_comic_url(session, response):\n soup = bs(response.text, 'lxml')\n for div in soup.find_all('div', class_=\"img-comic-container\"):\n for a in div.find_all('a', class_=\"img-comic-link\"):\n for img in a.find_all('img', src=True):\n return \"https:\" + img['src']"],"string":"[\n \"def replfunc(self, match):\\n url = match.group(1)\\n imgformat = url.split('.')[-1]\\n if url.startswith('http'):\\n data = urlopen(url).read()\\n elif url.startswith('data'):\\n img = '<img src=\\\"' + url + '\\\" ' + match.group(2) + ' />'\\n return img\\n else:\\n with open(url, 'rb') as f:\\n data = f.read()\\n\\n self.log.info(\\\"embedding url: %s, format: %s\\\" % (url, imgformat))\\n b64_data = base64.b64encode(data).decode(\\\"utf-8\\\")\\n if imgformat == \\\"svg\\\":\\n img = '<img src=\\\"data:image/svg+xml;base64,' + \\\\\\n b64_data + '\\\" ' + match.group(2) + '/>'\\n elif imgformat == \\\"pdf\\\":\\n img = '<img src=\\\"data:application/pdf;base64,' + \\\\\\n b64_data + '\\\" ' + match.group(2) + '/>'\\n else:\\n img = '<img src=\\\"data:image/' + imgformat + \\\\\\n ';base64,' + b64_data + '\\\" ' + match.group(2) + ' />'\\n return img\",\n \"def image_preview(self):\\r\\n h = '<img src=\\\"%s\\\" alt=\\\"Campaign badge\\\"/>' % self.image.url\\r\\n return mark_safe(h)\",\n \"def image(self, link, title, alt):\\n if not link.startswith(('http://', 'https://')):\\n source_dir = os.path.dirname(self.source_path)\\n link = os.path.abspath(os.path.join(source_dir, link))\\n return '<img src=\\\"%s\\\" title=\\\"%s\\\" alt=\\\"%s\\\" />' % (link, title, alt)\",\n \"def create_HTML_a_img(link_url, image_url):\\n img = '<img src=\\\"' + image_url + '\\\">'\\n linked_image = create_HTML_a(link_url, img)\\n return linked_image\",\n \"def website_create_body(website_info):\\r\\n body = \\\"\\\"\\r\\n body += H2 + website_info.title + END_H2\\r\\n body += '\\\\n' + P + website_info.content + END_P\\r\\n for image in website_info.images:\\r\\n if isinstance(image, str):\\r\\n body += '<img src=\\\"' + image + CLASS_CENTER\\r\\n elif isinstance(image, Image):\\r\\n body += '<img src=\\\"' + image.name + '\\\" width=\\\"' + image.size + CLASS_CENTER\\r\\n else:\\r\\n pass\\r\\n return body\",\n \"def url(self):\\n\\t\\treturn self.base_url+\\\"{}/{}/{}.jpg\\\".format(self.template,self._escape(self.top_text),self._escape(self.bottom_text))+(\\\"?\\\"+\\\"&\\\".join([\\\"{}={}\\\".format(k,quote(self.kwargs[k])) for k in self.kwargs]) if self.kwargs else \\\"\\\")\",\n \"def embed_images(self):\\n for img in self.book.xpath(\\\"//img[ not(starts-with(@src, 'data:')) and @src!= '']\\\"):\\n img_src = img.attrib[\\\"src\\\"]\\n img_raw = self.get_remote_content(img_src)\\n if img_raw != None:\\n img_64 = base64.b64encode(img_raw)\\n file_info = os.path.splitext(img_src)\\n ext = file_info[1].replace(\\\".\\\", \\\"\\\")\\n ext = re.sub(\\\"\\\\?.*$\\\", \\\"\\\" , ext)\\n \\n if ext == \\\"svg\\\":\\n svg = html.fromstring(img_raw.decode(\\\"utf-8\\\"))\\n img.clear()\\n img.tag = \\\"svg\\\"\\n img[:] = [svg]\\n else:\\n img.set(\\\"src\\\", \\\"data:image/{};base64,{}\\\".format(ext, img_64.decode(\\\"utf-8\\\")))\",\n \"def prepare_for_blogger(args):\\n title, posts = parse_markdown(os.path.join(args.root, 'index.md'))\\n online_images, online_videos = online_images_url(args)\\n\\n if args.check_images and check_images(args, posts, online_images) is False:\\n pass\\n\\n html = compose_blogger_html(args, title, posts, online_images, online_videos)\\n\\n if args.full is False:\\n html = re.search('<body>(.*)?</body>', html, flags=re.DOTALL).group(1)\\n html = re.sub('<script>.*?</script>', '', html, flags=re.DOTALL)\\n html = STYLE.replace('%%', '%') + html\\n\\n if args.dest:\\n with open(args.dest, 'wt', encoding='utf-8') as f:\\n f.write(html)\\n else:\\n clipboard.copy(html)\",\n \"def create_html(pic_info,sum_pic,upload_path,yun_link=('1','2')):\\n save_file=pic_info+'.txt'\\n content=\\\"\\\"\\\"\\n <p>\\n <img src=\\\"%s%s\\\" style=\\\"\\\" title=\\\"%s\\\"/>\\n </p>\\n <p>\\n <img src=\\\"%s%s\\\" style=\\\"\\\" title=\\\"%s\\\"/>\\n </p>\\n <p>\\n <img src=\\\"%s%s\\\" style=\\\"\\\" title=\\\"%s\\\"/>\\n </p>\\n <p>\\n <img src=\\\"%s%s\\\" style=\\\"\\\" title=\\\"%s\\\"/>\\n </p>\\n <p>\\n <span style=\\\"color: #FF0000; font-size: 24px;\\\">link: \\n </span>\\n <a href=\\\"%s\\\" target=\\\"_blank\\\" \\n style=\\\"font-size: 24px; text-decoration: underline;\\\">\\n <span style=\\\"font-size: 24px;\\\">%s\\n </span>\\n </a> \\n <span style=\\\"font-size: 24px;\\\">\\n <span style=\\\"color: #FF0000; font-size: 24px;\\\">code:\\n </span>\\n %s\\n </span>\\n </p>\\\\n\\\\n\\\\n\\\\n\\\\n\\\\n\\\\n\\\\n\\\\n\\n \\\"\\\"\\\"%(upload_path,sum_pic[0],sum_pic[0],upload_path,sum_pic[1],sum_pic[1],\\n upload_path,sum_pic[2],sum_pic[2],upload_path,sum_pic[3],sum_pic[3],\\n yun_link[0],yun_link[0],yun_link[1])\\n with open(save_file, 'w') as f:\\n f.write(content)\\n f.close()\",\n \"def correct_img_links(body_main_content, schema_name, list_name_image):\\n for name_image in list_name_image:\\n body_main_content = body_main_content.replace(\\n \\\"src=\\\\\\\"\\\" + name_image + \\\"\\\\\\\"\\\",\\n \\\"src=\\\\\\\"{% static \\\\\\\"schema_viewer/oxygen/\\\" + schema_name + \\\"/\\\" + name_image + \\\"\\\\\\\" %}\\\\\\\"\\\"\\n )\\n return body_main_content\",\n \"def banner_wrapper(banner_url):\\n # so simple\\n return '{url}<img src=\\\"{url}\\\" alt=\\\"{alt}\\\">'.format(\\n url=banner_url,\\n alt='Banner'\\n )\",\n \"def image(self, src, title, text):\\n src = escape_link(src)\\n text = escape(text, quote=True)\\n if title:\\n title = escape(title, quote=True)\\n html = '<img src=\\\"%s\\\" alt=\\\"%s\\\" title=\\\"%s\\\"' % (src, text, title)\\n else:\\n html = '<img src=\\\"%s\\\" alt=\\\"%s\\\"' % (src, text)\\n if self.options.get('use_xhtml'):\\n return '%s />' % html\\n return '%s>' % html\",\n \"def image_preview(self):\\r\\n h = '<img src=\\\"%s\\\" alt=\\\"%s\\\"/>' % (self.image_resized_url, self.title)\\r\\n return mark_safe(h)\",\n \"def getNewsIconURL(newsBrain):\",\n \"def embed_images(self, html):\\n if not self.SUPPORT_EMBED_IMAGES:\\n raise RuntimeError('%r does not support embed_images' % type(self))\\n\\n return self.RE_IMG.sub(self._embed_image, html)\",\n \"def get_image(result):\\n article_id = result['id']\\n id_ = article_id[14:]\\n href = article_id[:14]\\n\\n #FIXME: not working\\n image_url = \\\"http://www.jpress.nli.org.il/Olive/APA/NLI_heb/get/GetImage.ashx?kind=block&href=%s&id=%s&ext=.png\\\" %(href, id_)\\n \\n return image_url\",\n \"def get_image_url():\",\n \"def thumbnail_generator():\\n website_url = json.loads(request.data.decode())['url']\\n try:\\n webpage, message = url_preview.send_request(website_url)\\n if webpage is not None:\\n #Construct the soup object\\n soup_object = url_preview.get_soup_object(webpage)\\n #Get the title of the artcile\\n title = url_preview.get_title(soup_object)\\n #Get the website of the article\\n website_name = url_preview.get_url(soup_object).rsplit(\\\".\\\", 1)[0]\\n if website_name is None:\\n website_name = website_url.split(\\\"//\\\", 1)[1].split(\\\"/\\\", 1)[0].rsplit(\\\".\\\", 1)[0]\\n\\n #Get the description of the article\\n description = url_preview.get_description(soup_object)\\n\\n #Get the published date and time of the article\\n date_time = url_preview.get_date_time(website_url)\\n\\n #Get the link to the preview image\\n image_url = url_preview.get_preview_image(soup_object)['content']\\n\\n #Get the link to the favicon\\n favicon_url = url_preview. get_favicon(soup_object)\\n\\n return render_template(\\n \\\"success.html\\\",\\n urlx=website_url,\\n title=title,\\n site_name=website_name,\\n description=description,\\n date_time=date_time,\\n preview_image=image_url,\\n favicon=favicon_url\\n )\\n except Exception as exp:\\n return render_template('error.html', msg=str(exp))\",\n \"def get_images(self,soup,Images):\\n \\n img=soup.find_all('a',href=re.compile(\\\"/photo.php?fbid=\\\"))\\n img1=soup.find_all('a',href=re.compile(\\\"/photo\\\"))\\n m=' '\\n if img !=[]:\\n img_href='https://www.facebook.com'+img[0]['href']\\n m+=img_href+'\\\\n'\\n \\n elif img1 !=[]:\\n img_href='https://www.facebook.com'+img1[0]['href']\\n m+=img_href+'\\\\n'\\n \\n else:\\n img=soup.find_all('a',href=re.compile(\\\"pcb\\\"))\\n if img !=[]:\\n for i in img:\\n img_href='https://www.facebook.com'+i['href']\\n m+=img_href+'\\\\n' \\n \\n \\n else:\\n img=soup.find_all('a',href=re.compile(\\\"photos\\\"))\\n if img !=[]:\\n for i in img:\\n img_href='https://www.facebook.com'+i['href']\\n m+=img_href+'\\\\n'\\n \\n Images.append(m)\\n \\n return Images\",\n \"def hook_image_tag(self, parser, space, name):\\n link = name\\n caption = name\\n params = {}\\n\\n # Parse the inner syntax, e.g. [[Image:src|option=val|caption]]\\n separator = name.find('|')\\n items = []\\n if separator != -1:\\n items = link.split('|')\\n link = items[0]\\n # If the last item contains '=', it's not a caption\\n if items[-1].find('=') == -1:\\n caption = items[-1]\\n items = items[1:-1]\\n else:\\n caption = link\\n items = items[1:]\\n\\n # parse the relevant items\\n params = self._buildImageParams(items)\\n img_path = self._getImagePath(link)\\n\\n template = jingo.env.get_template('wikiparser/hook_image.html')\\n r_kwargs = {'img_path': img_path, 'caption': caption, 'params': params}\\n return template.render(**r_kwargs)\",\n \"def format_post_background(post: dict) -> str:\\n parsed = urllib.parse.urlparse(post['url'])\\n logger.debug(f\\\"Sending post: {post['name']}\\\")\\n if 'i.redd.it' in post['url']:\\n return f\\\"\\\"\\\"\\n <div id=\\\"{post['name']}\\\" class=\\\"col-sm-3 col-lg-3 col-xxl-3\\\">\\n <img class=\\\"\\\" style=\\\"width: 100%;\\\" src=\\\"{post['url']}\\\">\\n </div>\\n \\\"\\\"\\\"\\n elif 'v.redd.it' in post['url']:\\n if post['media'] is not None:\\n return \\\"\\\"\\n return f\\\"\\\"\\\"\\n <div id=\\\"{post['name']}\\\" class=\\\"col-sm-3 col-lg-3 col-xxl-3\\\">\\n <video style=\\\"width: 100%;\\\" data-dashjs-player autoplay src=\\\"{post['media']['reddit_video']['dash_url']}\\\" controls></video>\\n </div>\\n \\\"\\\"\\\"\\n else:\\n logger.error(f\\\"Error no media for v.redd.it link: {post['url']}\\\")\\n return \\\"\\\"\\n elif 'imgur' in post['url'] and ('gif' in post['url'] or 'mp4' in post['url']):\\n return \\\"\\\"\\n imgur_id = parsed.path.split('.')[0].split('/')[-1]\\n return f\\\"\\\"\\\"\\n <div id=\\\"{post['name']}\\\" class=\\\"col-sm-3 col-lg-3 col-xxl-3\\\">\\n <video controls poster=\\\"//i.imgur.com/{imgur_id}.jpg\\\" preload=\\\"auto\\\" autoplay=\\\"autoplay\\\" muted=\\\"muted\\\" loop=\\\"loop\\\" webkit-playsinline=\\\"\\\" style=\\\"width: 100%; height: 100%;\\\">\\n <source src=\\\"//i.imgur.com/{imgur_id}.mp4\\\" type=\\\"video/mp4\\\">\\n </video>\\n </div>\\n \\\"\\\"\\\"\\n elif 'imgur' in post['url']:\\n imgur_id = parsed.path.split('.')[0].split('/')[-1]\\n return f\\\"\\\"\\\"\\n <div id=\\\"{post['name']}\\\" class=\\\"col-sm-3 col-lg-3 col-xxl-3\\\">\\n <img class=\\\"\\\" style=\\\"width: 100%;\\\" src=\\\"//i.imgur.com/{imgur_id}.jpg\\\">\\n </div>\\n \\\"\\\"\\\"\\n elif 'redgif' in post['url']:\\n return \\\"\\\"\\n redgifs_id = parsed.path.split('.')[0].split('/')[-1]\\n return f\\\"\\\"\\\"\\n <div id=\\\"{post['name']}\\\" class=\\\"col-sm-3 col-lg-3 col-xxl-3\\\">\\n <div style='position:relative; padding-bottom:88.67%;'>\\n <iframe src='https://redgifs.com/ifr/{redgifs_id}' frameborder='0' scrolling='no' width='100%' height='100%' style='position:absolute;top:0;left:0;' allowfullscreen></iframe>\\n </div>\\n </div>\\n \\\"\\\"\\\"\\n elif 'gfycat' in post['url']:\\n return \\\"\\\"\\n else:\\n thumbnail = post.get('thumbnail', '/favicon.ico')\\n thumbnail = thumbnail if thumbnail != '' else '/favicon.ico'\\n return f\\\"\\\"\\\"\\n <div id=\\\"{post['name']}\\\" class=\\\"col-sm-3 col-lg-3 col-xxl-3\\\">\\n <a href=\\\"{post['url']}\\\"><img class=\\\"\\\" style=\\\"width: 100%;\\\" src=\\\"{thumbnail}\\\">\\n </div>\\n \\\"\\\"\\\"\\n return \\\"\\\"\",\n \"def img(self, obj):\\n return mark_safe(\\n f\\\"<img src='/{obj.image.url}' width='{obj.image.width}' height='{obj.image.height}' />\\\"\\n )\",\n \"def show_me():\\n # Scumbag thumbnail code\\n try:\\n from PIL import Image\\n except ImportError:\\n pass\\n else:\\n filename = os.path.join(app.static_folder, 'img', 'badumtss.png')\\n image = Image.open(filename)\\n\\n return render_template('show_me.html')\",\n \"async def img(ctx, message):\\n \\\"\\\"\\\":param: ctx\\\"\\\"\\\"\\n \\\"\\\"\\\":param: message\\\"\\\"\\\"\\n \\\"\\\"\\\"return image url\\\"\\\"\\\"\\n link_list = []\\n\\n url = \\\"http://imgur.com/search?q=\\\" + message\\n response = urlopen(url)\\n html = response.read()\\n soup = BeautifulSoup(html, \\\"lxml\\\")\\n for a in soup.find_all('a', href=True):\\n if((a['href'][0:9]) == \\\"/gallery/\\\"):\\n link_list.append(\\\"https://imgur.com/\\\" + a['href'])\\n if(len(link_list) >=1):\\n random_num = random.randint(0, len(link_list) - 1)\\n await bot.say(link_list[random_num])\\n else:\\n await bot.say(\\\"there is no contente for \\\"+message)\",\n \"def get_content(self):\\n\\n self.content = self.book.get_template('cover')\\n\\n tree = parse_string(super(EpubCoverHtml, self).get_content())\\n tree_root = tree.getroot()\\n\\n images = tree_root.xpath('//xhtml:img', namespaces={'xhtml': NAMESPACES['XHTML']})\\n\\n images[0].set('src', self.image_name)\\n images[0].set('alt', self.title)\\n\\n tree_str = etree.tostring(tree, pretty_print=True, encoding='utf-8', xml_declaration=True)\\n\\n return tree_str\",\n \"def parse_template(data, template):\\n img_html = \\\"\\\"\\\"<div class=\\\"thumb-wrap\\\"><div class=\\\"thumb-holder\\\"></div><a href=\\\"{{URL}}\\\" target=\\\"_top\\\"><div class=\\\"thumb-img\\\" style=\\\"background-image:url('{{IMG}}');\\\"></div></a></div>\\\"\\\"\\\"\\n template = template.replace('{{URL}}', data['link'].replace('http:','https:'))\\n template = template.replace('{{URLX}}', data['link'])\\n template = template.replace('{{TITLE}}', data['title'])\\n #template = template.replace('{{BLURB}}', data['summary'])\\n img_html = img_html.replace('{{URL}}', data['link'].replace('http:','https:'))\\n if hasattr(data, 'tags') and len(data['tags']) > 0:\\n template = template.replace('{{SECTION}}', data['tags'][0]['term'])\\n else:\\n template = template.replace('<h2><a href=\\\"{{URL}}\\\" target=\\\"_top\\\">{{SECTION}}</a></h2>', '')\\n if hasattr(data, 'media_content') and len(data['media_content']) > 0:\\n template = template.replace('{{IMG}}', '%s?w=150' % data['media_content'][0]['url'].replace('http:','https:'))\\n else:\\n template = template.replace(img_html, '')\\n\\n return template\",\n \"def index():\\n\\n return \\\"\\\"\\\"\\n <div>\\n <h1> Image Captioning REST API </h1>\\n <h3> The following API end points are valid </h3>\\n <ul>\\n <h4> Inception V3 </h4>\\n <li> <code>/inception/v3/ping </code> - <br/>\\n <b> Description : </b> checks availability of the service. returns \\\"pong\\\" with status 200 when it is available\\n </li>\\n <li> <code>/inception/v3/caption/image</code> - <br/>\\n <table>\\n <tr><th align=\\\"left\\\"> Description </th><td> This is a service that can caption images</td></tr>\\n <tr><th align=\\\"left\\\"> How to supply Image Content </th></tr>\\n <tr><th align=\\\"left\\\"> With HTTP GET : </th> <td>\\n Include a query parameter <code>url </code> which is an http url of JPEG image <br/>\\n Example: <code> curl \\\"localhost:8764/inception/v3/caption/image?url=http://xyz.com/example.jpg\\\"</code>\\n </td></tr>\\n <tr><th align=\\\"left\\\"> With HTTP POST :</th><td>\\n POST JPEG image content as binary data in request body. <br/>\\n Example: <code> curl -X POST \\\"localhost:8764/inception/v3/caption/image\\\" --data-binary @example.jpg </code>\\n </td></tr>\\n </table>\\n </li>\\n <ul>\\n </div>\\n \\\"\\\"\\\"\",\n \"def get_thumbnail_url():\",\n \"def get_image_link():\\n image_links = set()\\n supplemented_keyword = urllib.parse.quote(\\n supplemented_keywords[random.randint(0,\\n len(supplemented_keywords) - 1)],\\n safe='')\\n main_keyword = urllib.parse.quote(\\n main_keywords[random.randint(0,\\n len(main_keywords) - 1)], safe='')\\n\\n # print('the theme of cats: ' + supplemented_keyword)\\n\\n search_query = (main_keyword + ' ' + supplemented_keyword).replace(\\n ' ', '%20')\\n url = 'https://www.google.com/search?q=' + \\\\\\n search_query + '&source=lnms&tbm=isch'\\n image_links = image_links.union(parse_page(url))\\n\\n image_link = list(image_links)[random.randint(0, len(image_links) - 1)]\\n # print('link:' + image_link)\\n\\n while 'https://' not in image_link or r'\\\\\\\\u' in image_link or '.jpg' not in image_link:\\n image_link = list(image_links)[random.randint(0, len(image_links) - 1)]\\n # print('link:' + image_link)\\n\\n return image_link\",\n \"def prettyformat(self):\\n \\n import re\\n\\n html = self.get_htmlsrc()\\n if type(html) == type([]):\\n html = html[0]\\n if type(html) != type(\\\"\\\"):\\n try:\\n html = str(html)\\n except:\\n html = html.__str__()\\n \\n tmp = BeautifulSoup(html)\\n base = self.target_baseurl()\\n# aitems = tmp.findAll(\\\"a\\\",href=re.compile(\\\"^\\\\/\\\"))\\n aitems = tmp.findAll(\\\"a\\\",href=re.compile(\\\"^[^hH]\\\"))\\n for i in aitems:\\n u = i['href']\\n if u[0] != '/':\\n i['href'] = base + '/' + u\\n else: \\n i['href'] = base + u\\n# imgitems = tmp.findAll(\\\"img\\\",src=re.compile(\\\"^\\\\/\\\"))\\n imgitems = tmp.findAll(\\\"img\\\",src=re.compile(\\\"^[^hH]\\\"))\\n for j in imgitems:\\n v = j['src']\\n if v[0] != '/':\\n j['src'] = base + '/' + v\\n else: \\n j['src'] = base + v\\n return tmp\",\n \"def wiki_image(pagetext):\\n images = [i for i in pagetext.images if i not in EXCLUDED_IMAGES]\\n if len(images) > 0:\\n return images[0]\\n else:\\n return ''\",\n \"def parse_content(self, node):\\n\\n if node is None:\\n return ''\\n\\n for image_node in node.find_all('img'):\\n source = image_node.get('src')\\n image_node['src'] = self.get_link(source)\\n\\n return str(node)\",\n \"def _handle_img_tag(self, attrs):\\n alt = \\\"\\\"\\n image_format = \\\"\\\"\\n image_id = 0\\n for key, value in attrs:\\n if key == \\\"alt\\\":\\n alt = value\\n if key == \\\"class\\\":\\n image_format = value.split()[1].replace(\\\"-\\\", \\\"\\\")\\n if key == \\\"src\\\":\\n filename, _, extension = value.split(\\\"/\\\")[-1].split(\\\".\\\")\\n image_id = ImageModel.objects.get(file__endswith=f\\\"{filename}.{extension}\\\").id\\n return f\\\"<embed alt='{alt}' embedtype='image' format='{image_format}' id='{image_id}'/>\\\"\",\n \"def bb_forum(hit):\\n try:\\n forum_slug = hit.group(1)\\n f = Forum.objects.get(slug=forum_slug)\\n return '<a href=\\\"%s\\\"><img src=\\\"%snewspaper.png\\\" alt=\\\"forum\\\" border=\\\"0\\\" /> %s</a>' % (f.get_absolute_url(), settings.MEDIA_URL, f)\\n except:\\n return \\\"[forum]%s[/forum]\\\" % (forum_slug)\",\n \"def image_capture_demo():\\n return render_template('image_capture_demo.html')\",\n \"def avatar_preview(self):\\r\\n h = '<img src=\\\"%s\\\" alt=\\\"%s\\\"/>' % (self.image_avatar_url, self.title)\\r\\n return mark_safe(h)\",\n \"def l10n_img(ctx, url):\\n return static(l10n_img_file_name(ctx, url))\",\n \"def get_html(self):\\r\\n context = {\\r\\n 'display_name': self.display_name_with_default,\\r\\n 'instructions_html': self.instructions,\\r\\n 'annotation_storage': self.annotation_storage_url,\\r\\n 'token': retrieve_token(self.user, self.annotation_token_secret),\\r\\n 'tag': self.instructor_tags,\\r\\n 'openseadragonjson': self.openseadragonjson,\\r\\n }\\r\\n\\r\\n return self.system.render_template('imageannotation.html', context)\",\n \"def preview_tag(self, pid):\\n data = self.api.get_product_odata(pid)\\n url = data['quicklook_url']\\n user = os.environ['HUB_USER']\\n password = os.environ['HUB_PASS']\\n r = requests.get(url, auth=HTTPBasicAuth(user, password))\\n c = r.content\\n c64 = base64.b64encode(c)\\n tag_template = '<img width=\\\"150\\\" height=\\\"150\\\" src=\\\"data:image/jpg;base64, {}\\\">'\\n return tag_template.format(c64.decode('utf-8'))\",\n \"def test_lazy_images(self):\\n sample = load_sample('wired.sample.html')\\n doc = Document('http://www.wired.com/design/2014/01/will-influential-ui-design-minority-report/', sample)\\n article = doc.get_clean_article()\\n self.assertIn('<img src=\\\"http://www.wired.com/images_blogs/design/2014/01/her-joaquin-phoenix-41-660x371.jpg\\\"', article)\",\n \"def image(self, text):\\n pattern = re.compile(r\\\"\\\"\\\"\\n (?:[\\\\[{])? # pre\\n \\\\! # opening !\\n (\\\\<|\\\\=|\\\\>)? # optional alignment atts\\n (%s) # optional style,class atts\\n (?:\\\\. )? # optional dot-space\\n ([^\\\\s(!]+) # presume this is the src\\n \\\\s? # optional space\\n (?:\\\\(([^\\\\)]+)\\\\))? # optional title\\n \\\\! # closing\\n (?::(\\\\S+))? # optional href\\n (?:[\\\\]}]|(?=\\\\s|$)) # lookahead: space or end of string\\n \\\"\\\"\\\" % self.c, re.U | re.X)\\n return pattern.sub(self.fImage, text)\",\n \"def add_image_to_html(self, image_path):\\r\\n file_object = open(self.file_name, 'a+')\\r\\n html_content = f'<div><img src={image_path} width=\\\"500\\\" height=\\\"300\\\"></div>'\\r\\n file_object.write(html_content)\",\n \"def process_image_url(value, field):\\n if field.width:\\n if not value:\\n return u\\\"无\\\"\\n return mark_safe(\\\"\\\"\\\"\\n <a href=\\\"{0}\\\" target=\\\"_blank\\\"><img src=\\\"{0}\\\" width=\\\"{1}\\\" a>\\n \\\"\\\"\\\".format(absolute_media_path(value), field.width))\\n # only show url address.\\n elif value:\\n shorten_value = ''\\n if len(value) > 20:\\n shorten_value = value[0:12] + \\\"...\\\"\\n return mark_safe(\\\"\\\"\\\"\\n <a href=\\\"{0}\\\" target=\\\"_blank\\\" title=\\\"{0}\\\" >{1}</a>\\n \\\"\\\"\\\".format(absolute_media_path(value), shorten_value if shorten_value else value))\\n else:\\n return \\\"\\\"\",\n \"def getimgs():\",\n \"def make_page(keyword, html):\\n output = []\\n addline = output.append\\n\\n addline('<!DOCTYPE HTML PUBLIC \\\"-//W3C//DTD HTML 4.01//EN\\\" \\\"http://www.w3.org/TR/html4/strict.dtd\\\">')\\n addline('<html>')\\n addline('<head>')\\n addline('<title>Tweets for #%s</title>' % (keyword))\\n addline('<style type=\\\"text/css\\\">')\\n addline('div.tweet_container { float: right; width: 400px; font-size: 0.8em; border: 2px solid darkblue; padding: 8px; height: 80%; overflow-y: scroll; }')\\n addline('div.tweet_container h3 { margin: 0; padding: 0; text-align: center; color: darkblue; margin-bottom: 6px; padding-bottom: 6px; border-bottom: 2px solid darkblue; }')\\n addline('div.tweet { clear: both; }')\\n addline('div.tweetphoto { float:left; width: auto; margin: 0; padding: 0; }')\\n addline('div.tweetphoto img { border: none; width: 48px; height: 48px; display: block; margin: 0; margin-bottom: 24px; margin-right: 8px; padding: 0; }')\\n addline('div.tweetphoto a > img { border: 1px solid black; }')\\n addline('</style>')\\n addline('</head>')\\n addline('<body>')\\n\\n addline(html)\\n\\n addline('</div>')\\n addline('</body>')\\n addline('</html>')\\n return '\\\\n'.join(output)\",\n \"def process_images(text):\\n # if text != None:\\n if text is not None:\\n soup = BeautifulSoup(str(text), 'html.parser')\\n img = soup.img\\n try:\\n image = img['title']\\n return image\\n except (TypeError, KeyError):\\n # print(img)\\n pass\",\n \"def background_image(self, **kwargs):\\n try:\\n asset = self.app.module_map.uploader.get(self.barcamp.background_image)\\n except AssetNotFound:\\n asset = None\\n if not asset:\\n return u\\\"\\\"\\n v = asset.variants['full']\\n url = self.app.url_for(\\\"asset\\\", asset_id = v._id)\\n amap = html_params(**kwargs)\\n return \\\"\\\"\\\"<img src=\\\"%s\\\" width=\\\"%s\\\" height=\\\"%s\\\" %s>\\\"\\\"\\\" %(\\n url,\\n v.metadata['width'],\\n v.metadata['height'],\\n amap)\",\n \"def get_image_url(article):\\n get_image = article.find_all(\\\"img\\\")[0]\\n return get_image.get(\\\"src\\\").replace(\\\"../../\\\", \\\"http://books.toscrape.com/\\\")\",\n \"async def images(self, ctx, *, query: str=None):\\n # Handle empty query\\n if query is None:\\n return await ctx.error('Please provide a query!')\\n\\n # Using these specific headers and \\\"lnms\\\" as source, will provide divs with \\\"rg_meta\\\" classes,\\n # The modern image search page being JS rendered, data in these divs are jsons with raw image URLs\\n # Old image search pages, only have thumbnails and a direct link to websites\\n params = {'q': quote_plus(query), 'source': 'lmns', 'tbm': 'isch'}\\n async with self.aiohttp_session.get(self.url, params=params, headers=self.image_headers) as r:\\n html = await r.text()\\n\\n # Healthy\\n soup = BeautifulSoup(html, 'lxml')\\n\\n # Go over 4 items, json.loads the item text, and grab \\\"ou\\\" probably stands for \\\"original url\\\"\\n images = []\\n for i, item in enumerate(soup.select('div.rg_meta')[:4]):\\n js = json.loads(item.text)\\n images.append((f\\\"{i+1}. {js['st']} - {js['s']}\\\", js[\\\"ou\\\"]))\\n newl = '\\\\n'\\n await ctx.message.edit(content=f\\\"```py\\\\n{newl.join([x[0] for x in images])}\\\"\\n f\\\"\\\\n# Choose the appropriate number or type 0 to leave\\\\n```\\\")\\n\\n def check(m):\\n return m.author == ctx.author and m.content.isdigit() and m.channel == ctx.channel\\n message = await self.bot.wait_for('message', check=check)\\n if message.content == \\\"0\\\":\\n await message.delete()\\n return await ctx.message.delete()\\n choice = int(message.content) - 1\\n await message.delete()\\n await ctx.message.edit(content=images[choice][1])\",\n \"def get_image_qm(html_src, todir):\\n #print url\\n\\n img_url, title = img_details(html_src)\\n \\n r = requests.get(img_url)\\n with open(todir+title+'.jpg','wb') as f:\\n f.write(r.content)\",\n \"def make_content(museum, image_url, image_name, image_artist, filename):\\n message = \\\"From the \\\" + museum\\n # if image_name is not None:\\n # message += \\\" with title \\\" + image_name\\n if image_artist is not None:\\n message += \\\" by \\\" + image_artist\\n\\n r = requests.get(image_url)\\n if r.status_code == 200:\\n with open(filename, mode=\\\"wb\\\") as image:\\n for chunk in r:\\n image.write(chunk)\\n else:\\n return None\\n return (message)\",\n \"def html_to_text_img(url):\\n if url is '' or url is None:\\n return None\\n try:\\n html = urlopen(url)\\n except HTTPError as e:\\n print(e)\\n return None\\n except URLError as e:\\n print(e)\\n return None\\n\\n try:\\n soup = BeautifulSoup(html.read(), \\\"html.parser\\\")\\n except AttributeError as e:\\n print(e)\\n return None\\n\\n title = soup.find(\\\"h1\\\").get_text()\\n text = ''\\n ps = soup.find(\\\"div\\\", {\\\"class\\\": \\\"article gtm-click\\\"}).find_all('p')\\n for p in ps:\\n text += ''.join(p.get_text())\\n imgs = soup.select(\\\"div.article__image img\\\")\\n img_url = imgs[0]['data-src']\\n\\n return title, text, img_url\",\n \"def get_images(self, article: BeautifulSoup):\\n images = []\\n content = article.select_one(self.parsing_template.content)\\n\\n if content:\\n body_images = content.select(self.parsing_template.image_element)\\n else:\\n body_images = None\\n\\n if body_images:\\n for element in body_images:\\n\\n img = element.find('img')\\n if not img:\\n continue\\n url = img.get(self.parsing_template.image_attribute) # TODO format url correctly\\n\\n try:\\n text = self.get_text(element, self.parsing_template.image_text)\\n except IndexError:\\n text = ''\\n\\n try:\\n photographer = self.get_text(element, self.parsing_template.image_photographer)\\n except IndexError:\\n photographer = ''\\n\\n # Image text and photographer is not separated.\\n # Tries to separate out the photographer\\n if self.parsing_template.photographer_delimiter:\\n if text and not photographer:\\n text, photographer = self.parse_photographer(text, text)\\n if photographer:\\n text, photographer = self.parse_photographer(text, photographer)\\n\\n if url:\\n if photographer:\\n # Removes unwanted text in the photographer\\n for replace in self.parsing_template.photograph_ignore_text:\\n photographer = photographer.replace(replace, '')\\n photographer = photographer.replace('/', ',')\\n\\n if len(text) > 255:\\n text = text[:254]\\n\\n # Separate each photograph\\n photographers = []\\n for photograph in photographer.split(','):\\n photographer_name_split = list(filter(lambda x: x or x != ' ', photograph.split(' ')))\\n if photographer_name_split:\\n if len(photographer_name_split) == 1:\\n lastName = photographer_name_split[0].strip(' ').strip('.')\\n firstName = ''\\n else:\\n firstName = photographer_name_split[0].strip(' ')\\n lastName = photographer_name_split[1].strip(' ').strip('.')\\n photographers.append(Photographer(firstName=firstName, lastName=lastName))\\n\\n images.append((ArticleImage(url=url, text=text), photographers))\\n\\n return images\",\n \"def logosmall(self):\\n try:\\n asset = self.app.module_map.uploader.get(self.barcamp.logo)\\n except AssetNotFound:\\n asset = None\\n if not asset:\\n return u\\\"\\\"\\n v = asset.variants['medium_user']\\n url = self.app.url_for(\\\"asset\\\", asset_id = v._id)\\n return \\\"\\\"\\\"<a href=\\\"%s\\\"><img src=\\\"%s\\\" width=\\\"%s\\\" height=\\\"%s\\\"></a>\\\"\\\"\\\" %(\\n self.handler.url_for(\\\"barcamps.index\\\", slug = self.barcamp.slug),\\n url,\\n v.metadata['width'],\\n v.metadata['height'])\",\n \"def insert_image(self, image64: str, class_txt: str, height: int, width: int) -> str:\\n if (height is None) & (width is None):\\n image = \\\"\\\"\\\"<div class=\\\"text-center\\\">\\n <img class=\\\"resize\\\" src=\\\"data:image/png;base64, \\\"\\\"\\\" + image64 + \\\"\\\"\\\"\\\"/>\\\\n\\n </div>\\\"\\\"\\\"\\n else:\\n image = \\\"\\\"\\\"<div>\\n <img class=\\\"\\\"\\\" + class_txt + \\\"\\\"\\\" src=\\\"data:image/png;base64, \\\"\\\"\\\" + image64 + \\\"\\\"\\\"\\\"\\\" height=\\\"\\\"\\\" + str(\\n height) + \\\"\\\"\\\" width=\\\"\\\"\\\" + str(\\n width) + \\\"\\\"\\\"/>\\\\n\\n </div>\\n \\\"\\\"\\\"\\n\\n self.html_doc = self.html_doc + image\\n return self.html_doc\",\n \"def extract_images_url(url, source):\\n if source == \\\"mangaseeonline\\\":\\n r = s.post(\\n \\\"http://playwright:5000/scrape\\\",\\n json={\\n \\\"url\\\": url.replace(\\\"-page-1\\\", \\\"\\\"), \\\"wait\\\": 1}\\n )\\n tree = html.fromstring(r.text)\\n return tree.xpath('//*[@id=\\\"TopPage\\\"]/descendant::img/@src')\\n if source == \\\"nettruyen\\\":\\n r = s.get(\\n settings.SPLASH_URL, params={\\n \\\"url\\\": url.replace(\\\"-page-1\\\", \\\"\\\"), \\\"wait\\\": 1}\\n )\\n tree = html.fromstring(r.text)\\n return tree.xpath('//*[@class=\\\"reading-detail box_doc\\\"]/div/img/@src')\\n if source == \\\"doctruyen3q\\\":\\n r = s.get(\\n settings.SPLASH_URL, params={\\\"url\\\": url, \\\"wait\\\": 1}\\n )\\n tree = html.fromstring(r.text)\\n return tree.xpath('//*[contains(@id, \\\"page_\\\")]/img/@src')\\n if source == \\\"truyenkinhdien\\\":\\n r = s.get(\\n settings.SPLASH_URL.replace(\\\"render.html\\\", \\\"execute\\\"),\\n params={\\\"url\\\": url, \\\"lua_source\\\": lua_script, \\\"wait\\\": 1},\\n )\\n tree = html.fromstring(r.json()[\\\"html\\\"])\\n return tree.xpath(\\n '//*[@class=\\\"sgdg-gallery\\\"]/a[not(contains(@style,\\\"display:none\\\"))]/img/@src'\\n )\",\n \"def mk_image_tag(self, uri: str) -> str:\\n\\n data_uri, width, height = self.webserver.get_image(f'{uri}&features=unstable')\\n return f'<img src=\\\"{data_uri}\\\" width=\\\"{width}\\\" height=\\\"{height}\\\"/>'\",\n \"def get_album_art_url(html):\\n\\treturn re.findall('img src=\\\"(.*?)\\\" width=\\\"500\\\"', html)[0]\",\n \"def injectImage(self, img_info, open_url):\\n injected_img = None\\n\\n if img_info.size/1024 < 256:\\n encoded = base64.b64encode(open_url.read())\\n injected_img = ('<img src=\\\"data:image/jpeg;charset=utf-8;base64,' +\\n str(encoded) +\\n '\\\" %s />' % self.getModifiers(img_info))\\n else:\\n image = Image.open(StringIO.StringIO(open_url.read()))\\n image.thumbnail((self.cfg().chatimg.max_width, self.cfg().chatimg.max_height), Image.ANTIALIAS)\\n trans = StringIO.StringIO()\\n image.save(trans, format=\\\"JPEG\\\")\\n encoded = base64.b64encode(trans.getvalue())\\n injected_img = ('<img src=\\\"data:image/jpeg;charset=utf-8;base64,' +\\n str(encoded) +\\n '\\\" />')\\n\\n return injected_img\",\n \"def add_three_images(document_text, image_link_template, image_folder, images, width):\\n for idx in range(3):\\n document_text += \\\"\\\\n\\\"\\n image_info = r'<td>{0}</td>'.format(image_link_template.format(\\n os.path.join(image_folder, images[idx]), width))\\n document_text = add_document_text(document_text, image_info)\\n return document_text\",\n \"def add_to_html(self, news: dict) -> str:\\n\\n add_to_html_file = \\\"\\\"\\n add_to_html_file += f\\\"<h2>Title: {news['Title']}</h2>\\\\n\\\"\\n add_to_html_file += f\\\"<a href={news['Link']}>Link to news</a><br>\\\\n\\\"\\n add_to_html_file += f\\\"<p>PubDate: {news['PubDate']}</p>\\\\n\\\"\\n add_to_html_file += f\\\"<p>Source: {news['Source']}</p>\\\\n\\\"\\n full_path_to_image = f\\\"{self.full_path_to_image_cache}{os.sep}{news['ImageCacheName']}\\\"\\n add_to_html_file += f\\\"<img height='120' src='{full_path_to_image}' alt='No image'>\\\\n<br>\\\\n<br>\\\\n\\\"\\n\\n return add_to_html_file\",\n \"def build_md_once(self, index, tid):\\n url = self.joint_url(tid)\\n title_json = proxy_req(url, 1)\\n if not title_json:\\n if can_retry(url, index):\\n self.build_md_once(index, tid)\\n return\\n content = BeautifulSoup(\\n title_json['content'], 'html.parser').find_all('div')\\n text = []\\n img_href = []\\n img_id = 1\\n ttid = 1\\n img_title = self.find_title(index).split('/')[1][:-3]\\n for word in content:\\n temp_text = ''\\n if word.span and len(word.span.text) and not word.span.text[0].isdigit:\\n temp_text = '## ' + word.span.text\\n ttid = 1\\n if word.img:\\n temp_text = ' + '.jpg)'\\n img_href.append(word.img['src'].replace('https', 'http'))\\n img_id += 1\\n\\n if not len(temp_text):\\n temp_text = word.text\\n if len(temp_text) and temp_text[0].isdigit():\\n temp_text = str(ttid) + '. **' + \\\\\\n ' '.join(temp_text.split('\\\\xa0')[1:]).strip() + '**'\\n ttid += 1\\n if len(temp_text) and temp_text[0:2] == '//':\\n temp_text = str(ttid) + '. **' + \\\\\\n ' '.join(temp_text.split('\\\\xa0')[2:]).strip() + '**'\\n ttid += 1\\n if len(temp_text) and (temp_text[0] == '￥' or temp_text[0] == '€'):\\n temp_text = '<a>' + temp_text + '</a>'\\n text.append(temp_text)\\n with codecs.open(data_dir + self.find_title(index), 'w', encoding='utf-8') as f:\\n f.write('\\\\n'.join(text))\\n self.img_map[index] = img_href\\n print(index, len(img_href))\",\n \"def get_image_url(img):\\n # element['data-src'] and element.get('data-src') doesn't work\\n for k, v in img.items():\\n if k == 'data-src':\\n # https://t.nhentai.net/galleries/<gallerycode>/<page#>t.<extension>\\n # https://i.nhentai.net/galleries/<gallerycode>/<page#>.<extension>\\n return v[:8] + 'i' + v[9:32] + v[32:].replace('t.', '.', 1)\",\n \"def gallery():\\n return render('base.html')\",\n \"def _repr_html_(self):\\n import io\\n import base64\\n from PIL import Image\\n\\n library_name = \\\"vedo.assembly.Assembly\\\"\\n help_url = \\\"https://vedo.embl.es/docs/vedo/assembly.html\\\"\\n\\n arr = self.thumbnail(zoom=1.1, elevation=-60)\\n\\n im = Image.fromarray(arr)\\n buffered = io.BytesIO()\\n im.save(buffered, format=\\\"PNG\\\", quality=100)\\n encoded = base64.b64encode(buffered.getvalue()).decode(\\\"utf-8\\\")\\n url = \\\"data:image/png;base64,\\\" + encoded\\n image = f\\\"<img src='{url}'></img>\\\"\\n\\n # statisitics\\n bounds = \\\"<br/>\\\".join(\\n [\\n vedo.utils.precision(min_x, 4) + \\\" ... \\\" + vedo.utils.precision(max_x, 4)\\n for min_x, max_x in zip(self.bounds()[::2], self.bounds()[1::2])\\n ]\\n )\\n\\n help_text = \\\"\\\"\\n if self.name:\\n help_text += f\\\"<b> {self.name}:   </b>\\\"\\n help_text += '<b><a href=\\\"' + help_url + '\\\" target=\\\"_blank\\\">' + library_name + \\\"</a></b>\\\"\\n if self.filename:\\n dots = \\\"\\\"\\n if len(self.filename) > 30:\\n dots = \\\"...\\\"\\n help_text += f\\\"<br/><code><i>({dots}{self.filename[-30:]})</i></code>\\\"\\n\\n allt = [\\n \\\"<table>\\\",\\n \\\"<tr>\\\",\\n \\\"<td>\\\",\\n image,\\n \\\"</td>\\\",\\n \\\"<td style='text-align: center; vertical-align: center;'><br/>\\\",\\n help_text,\\n \\\"<table>\\\",\\n \\\"<tr><td><b> nr. of objects </b></td><td>\\\"\\n + str(self.GetNumberOfPaths())\\n + \\\"</td></tr>\\\",\\n \\\"<tr><td><b> position </b></td><td>\\\" + str(self.GetPosition()) + \\\"</td></tr>\\\",\\n \\\"<tr><td><b> diagonal size </b></td><td>\\\"\\n + vedo.utils.precision(self.diagonal_size(), 5)\\n + \\\"</td></tr>\\\",\\n \\\"<tr><td><b> bounds </b> <br/> (x/y/z) </td><td>\\\" + str(bounds) + \\\"</td></tr>\\\",\\n \\\"</table>\\\",\\n \\\"</table>\\\",\\n ]\\n return \\\"\\\\n\\\".join(allt)\",\n \"def _formatBody(self, body_contents):\\n body_contents = str(body_contents)\\n\\n # Replace github image tag  with plain url\\n p = re.compile('!\\\\[.*?\\\\]\\\\((.*?)\\\\)')\\n body_contents = p.sub('\\\\g<1>', body_contents)\\n\\n # Replace github image tag <img> with plain url\\n p = re.compile('<img.*src=\\\"(.*?)\\\".*>')\\n body_contents = p.sub('\\\\g<1>', body_contents)\\n\\n # Replace ``` with [code] tag\\n p = re.compile('```(.*?)(```|$)', re.DOTALL)\\n body_contents = p.sub('[code]\\\\g<1>[/code]', body_contents)\\n\\n return self._cutBody(body_contents)\",\n \"def get_content(html_soup):\\n text_above_image = html_soup.findAll('div', attrs = {\\\"class\\\" : \\\"rs-content abstract\\\"})\\n if len(text_above_image) > 1:\\n text_above_image = text_above_image[1].get_text()\\n else:\\n text_above_image = '' \\n text_below_image = html_soup.find('div', attrs = {\\\"class\\\" : \\\"body\\\"}).get_text()\\n content = text_above_image + text_below_image\\n \\n return content\",\n \"def get_images(self, page_number):\",\n \"def add_to_fb2(self, news: dict) -> str:\\n\\n add_to_fb2_file = \\\"\\\"\\n add_to_fb2_file += f\\\" <p>Title: {news['Title']}</p>\\\\n\\\"\\n add_to_fb2_file += f\\\" <p><a l:href='{news['Link']}'> 'Link to news' </a></p>\\\\n\\\"\\n add_to_fb2_file += f\\\" <p>PubDate: {news['PubDate']}</p>\\\\n\\\"\\n add_to_fb2_file += f\\\" <p>Source: {news['Source']}</p>\\\\n\\\"\\n\\n if news['ImageCacheName']:\\n add_to_fb2_file += f\\\" <p><image l:href='#{news['ImageCacheName']}'/></p>\\\\n\\\"\\n with open(f\\\"{self.full_path_to_image_cache}{os.sep}{news['ImageCacheName']}\\\", \\\"rb\\\") as img_file:\\n b64_string = base64.b64encode(img_file.read())\\n self.binaries += f\\\"<binary id='{news['ImageCacheName']}' \\\" \\\\\\n f\\\"content-type='image/jpeg'>{b64_string.decode('utf-8')}</binary>\\\\n\\\"\\n\\n add_to_fb2_file += f\\\" <empty-line/>\\\\n\\\"\\n\\n return add_to_fb2_file\",\n \"def return_image(val, model_id, message_name, field_name, mime, sind):\\n column_data_source = curdoc().get_model_by_name(sind)\\n index = column_data_source.tags[0]\\n url = \\\"http://{0}/image/\\\".format(_host) + \\\"---\\\".join([model_id, message_name, field_name, mime, sind, str(index)])\\n return url\",\n \"def generate_file_link_html_from_url(self, s3_public_url, file_name):\\r\\n image_link = \\\"\\\"\\\"\\r\\n <a href=\\\"{0}\\\" target=\\\"_blank\\\">{1}</a>\\r\\n \\\"\\\"\\\".format(s3_public_url, file_name)\\r\\n return image_link\",\n \"def render_social_media_metadata(self):\\n sm_metadata_html = SM_METADATA_TEMPLATE.format(\\n self.view.permalink,\\n self.view.img_urls[1],\\n self.view.img_urls[0],)\\n return sm_metadata_html\",\n \"def create_base_image(self, builder, template, parameters):\",\n \"async def getImageURLS(self, tags, fuzzy=False, singlePage=False):\\n if fuzzy:\\n tags = tags.split(\\\" \\\")\\n for tag in tags:\\n tag = tag + \\\"~\\\"\\n temp = \\\" \\\"\\n tags = temp.join(tags)\\n print(tags)\\n num = await self.totalImages(tags)\\n if num != 0:\\n PID = 0\\n imgList = []\\n XML = None\\n t = True\\n tempURL = self.urlGen(tags=tags, PID=PID)\\n while t:\\n with async_timeout.timeout(10):\\n async with self.session.get(url=tempURL) as XML:\\n XML = await XML.read()\\n XML = ET.XML(XML)\\n XML = self.ParseXML(XML)\\n if XML is None:\\n return None\\n if len(imgList) >= int(XML['posts']['@count']): # \\\"if we're out of images to process\\\"\\n t = False # \\\"end the loop\\\"\\n else:\\n for data in XML['posts']['post']:\\n imgList.append(str(data['@file_url']))\\n if singlePage:\\n return imgList\\n PID += 1\\n return imgList\\n else:\\n return None\",\n \"def embed_image_html(image, type):\\n if type == 'dehaze':\\n image_pil = Image.fromarray((image).astype('uint8'))\\n elif type == 'style_transfer':\\n image_pil = Image.fromarray((image).astype('uint8'))\\n else:\\n image_pil = Image.fromarray((255 * image).astype('uint8'))\\n if sys.version_info.major == 2:\\n string_buf=StringIO.StringIO()\\n image_pil.save(string_buf, format='png')\\n data = string_buf.getvalue().encode('base64').replace('\\\\n', '')\\n else:\\n _buf = BytesIO()\\n image_pil.save(_buf, format='png')\\n _buf.seek(0)\\n b64_buf = base64.b64encode(_buf.getvalue())\\n string_buf = StringIO(b64_buf.decode('utf-8', errors='replace'))\\n data =string_buf.getvalue().replace('\\\\n', '')\\n\\n return 'data:image/png;base64,' + data\",\n \"def url_for(**options):\\n\\n url_parts = get_url_parts(**options)\\n image_hash = hashlib.md5(b(options[\\\"image_url\\\"])).hexdigest()\\n url_parts.append(image_hash)\\n\\n return \\\"/\\\".join(url_parts)\",\n \"def crawling_images_url(self, data_dict, output_choice, commentors = False, tagged = True):\\n\\n content = []\\n usernamelist = []\\n\\n for key in data_dict:\\n data = self.json_url(data_dict[key]['url'])\\n tempdict = data['entry_data']['PostPage'][0]['graphql']['shortcode_media']\\n \\n if commentors:\\n for comment in tempdict['edge_media_to_comment']['edges']:\\n newuser = comment['node']['owner']['username']\\n if newuser not in usernamelist and newuser != self.username:\\n usernamelist.append(newuser)\\n data1 = self.rootuser_info(self.userpage_scraper(newuser))\\n if output_choice[0]:\\n print(data1)\\n elif output_choice[1]:\\n content.append(data1)\\n\\n if tagged:\\n for tag in tempdict['edge_media_to_tagged_user']['edges']:\\n newuser = tag['node']['user']['username']\\n if newuser not in usernamelist and newuser != self.username:\\n usernamelist.append(newuser)\\n data1 = self.rootuser_info(self.userpage_scraper(newuser))\\n if output_choice[0]:\\n print(data1)\\n elif output_choice[1]:\\n content.append(data1)\\n\\n if output_choice[1]:\\n self.pretty_print({'content': content}, False)\",\n \"def html_factory(article, html_file):\\n with html_file:\\n tags.h1(article.title)\\n tags.p(tags.b('Title: '), article.title)\\n tags.p(tags.b('Link: ', tags.a(tags.b(article.link), href=article.link, )))\\n tags.p(tags.b('Date: '), article.date.strftime(\\\"%a, %d %B, %Y\\\"))\\n tags.p(tags.b('Source: '), article.source)\\n tags.p(tags.b('Description: '), article.description)\\n if article.image != '---':\\n tags.p(tags.img(style=\\\"width:360px\\\", src=article.image))\\n else:\\n tags.p(tags.b('Sorry, no images for this article'))\\n return html_file\",\n \"async def _misc_IMGplumbob(self, ctx):\\r\\n await self.bot.say('{}, http://i.imgur.com/q8xJsJQ.gif'.format(ctx.message.author.mention))\",\n \"def breadcrumb_subscriber( event ):\\n img = '<img src=\\\"'+event.request.static_url(\\\"leirirekkari:static/img/icons/breadcrumb_home.png\\\") + '\\\" />'\\n event.request.bread = [{'url':'/', 'text':img}]\",\n \"def html_img_tags(self):\\n return self.findall_markdown_cells(r'<img[^>]*>')\",\n \"def PLACEHOLDER(width=100, height=100, HTTP=\\\"\\\", seperator='/'):\\n return f\\\"{HTTP}://{CDN_IMG.PLACEHOLDER_SERVICE}/{width}{seperator}{height}\\\"\",\n \"def ShowHTML(pTitle, href):\\n\\n oc = ObjectContainer(title2=pTitle)\\n\\n href = href if href else ''\\n html = HTML.ElementFromURL(BASE_URL + href)\\n\\n if '/pornstars-click/' in href:\\n href = '/profiles/' + href.rsplit('/', 1)[1]\\n url = BASE_URL + href\\n\\n xvideosBest = \\\"thumb-block \\\"\\n if (len(html.xpath('//div[@class=\\\"thumbBlock\\\"]')) > 0):\\n xvideosBest = \\\"thumbBlock\\\"\\n\\n if (len(html.xpath('//title//text()')) > 0):\\n if 'Pornstar page' in html.xpath('//title//text()')[0]:\\n url = url + '/pornstar_videos/0/0'\\n html = HTML.ElementFromURL(url)\\n elif 'Channel page' in html.xpath('//title//text()')[0]:\\n url = url + '/uploads/0/0'\\n html = HTML.ElementFromURL(url)\\n\\n for video in html.xpath('//div[@class=\\\"%s\\\"]' %xvideosBest):\\n try:\\n if '/profiles/' not in url and '/pornstars-click' not in url:\\n if (len(video.xpath('./div/div/a//@href')) == 0):\\n oc.add(VideoClipObject(\\n url=BASE_URL + video.xpath('./p/a//@href')[0],\\n title=video.xpath('./p/a//text()')[0],\\n thumb=THUMB_REG.search(video.xpath('./div/div/script//text()')[0]).group(1)\\n ))\\n else:\\n vhref = video.xpath('./p/a//@href')[0]\\n vtitle = video.xpath('./p/a//text()')[0]\\n oc.add(DirectoryObject(\\n key=Callback(ShowHTML, href=vhref, pTitle=vtitle),\\n title=vtitle, thumb=THUMB_REG.search(video.xpath('./div/div/a/script//text()')[0]).group(1)\\n ))\\n else:\\n oc.add(VideoClipObject(\\n url=BASE_URL + video.xpath('./div/p/a//@href')[0],\\n title=video.xpath('./div/p/a//text()')[0],\\n thumb=video.xpath('./div/div/a/img//@src')[0]\\n ))\\n except:\\n Log.Warn('nothing')\\n\\n # setup nextURL\\n try:\\n nextURL = None\\n if html.xpath('//li/a[@data-page][text()=\\\"Next\\\"]'):\\n next_page = int(html.xpath('//li/a[text()=\\\"Next\\\"]/@data-page')[0])\\n nextURL = '/{}/{}'.format(url.split('/', 3)[3].rsplit('/', 1)[0], next_page)\\n elif html.xpath('//li/a[@class=\\\"no-page\\\"][text()=\\\"Next\\\"]'):\\n nextURL = html.xpath('//li/a[@class=\\\"no-page\\\"][text()=\\\"Next\\\"]/@href')[0]\\n elif html.xpath('//div[contains(@class,\\\"pagination\\\")]//a[@class=\\\"active\\\"]/../following-sibling::li/a/@href'):\\n nextURL = html.xpath(\\\"//div[contains(@class,'pagination')]/ul/li/a[@class='active']/../following-sibling::li/a/@href\\\")[0]\\n\\n if nextURL:\\n next_page_num = nextURL.split('=')[-1] if '&' in nextURL else nextURL.split('/')[-1]\\n next_page_num = next_page_num if next_page_num else nextURL.split('/')[-2]\\n #Log(u\\\"next page number = '{}'\\\".format(next_page_num))\\n oc.add(NextPageObject(\\n key=Callback(ShowHTML, href=nextURL, pTitle='Page ' + next_page_num),\\n title=\\\"More ...\\\"))\\n except:\\n Log.Exception(\\\"Cannot find next page\\\")\\n # it will loop through and return the values for all items in the page\\n return oc\",\n \"def _get_image_url_in_content(self, content):\\n begin_token = 'src=\\\"'\\n begin = content.find(begin_token)\\n if begin == -1:\\n return None\\n\\n # Acrescentamos o tamanho do 'begin_token' no 'begin'\\n begin += len(begin_token)\\n end = content.find('\\\"', begin)\\n url = content[begin:end]\\n return url.split('?')[0]\",\n \"async def bImage(self, ctx, query, num=1):\\r\\n\\r\\n webpage = \\\"http://www.bing.com/images/search?q=\\\" + query.replace(\\\" \\\", \\\"+\\\") + \\\"&view=detailv2&adlt=off&selectedIndex=0\\\"\\r\\n\\r\\n html_content = urllib.request.urlopen(webpage)\\r\\n str_html = html_content.read().decode(\\\"utf-8\\\")\\r\\n match = re.findall(r'src=\\\"http://?([^\\\\'\\\" >]+)', str_html)\\r\\n if match:\\r\\n try:\\r\\n await ctx.send(\\\"http://\\\" + match[num-1])\\r\\n except (Exception):\\r\\n await ctx.send(\\\"```No \\\" + str(num) + \\\"th Result```\\\")\\r\\n else:\\r\\n await ctx.send(\\\"```No Image Found```\\\")\",\n \"def embed_image_html(imgBGR, target_width=TARGET_WIDTH, target_height=TARGET_HEIGHT):\\n import cv2\\n from PIL import Image\\n if target_width is not None:\\n imgBGR = _resize(imgBGR, t_width=target_width)\\n elif target_width is not None:\\n imgBGR = _resize(imgBGR, t_height=target_height)\\n imgRGB = cv2.cvtColor(imgBGR, cv2.COLOR_BGR2RGB)\\n pil_img = Image.fromarray(imgRGB)\\n string_buf = StringIO()\\n pil_img.save(string_buf, format='jpeg')\\n data = string_buf.getvalue().encode('base64').replace('\\\\n', '')\\n return 'data:image/jpeg;base64,' + data\",\n \"def user_images_url(self, datadict):\\n\\n dict1 = datadict['entry_data']['ProfilePage'][0]['graphql']['user']['edge_owner_to_timeline_media']\\n no_of_posts = dict1['count']\\n\\n posts = dict1['edges']\\n\\n posts_info = {}\\n for count, post in enumerate(posts):\\n tempdict = {}\\n\\n tempdict['url'] = \\\"https://www.instagram.com/p/\\\" + post['node']['shortcode']\\n tempdict['is_video'] = post['node']['is_video']\\n tempdict['caption'] = post['node']['edge_media_to_caption']['edges'][0]['node']\\n\\n\\n posts_info[count] = tempdict\\n\\n return (posts_info)\",\n \"def _format_image(image, tags):\\n text = \\\", \\\".join(md.pre(tag) for tag in tags)\\n dest = _to_dockerfile_url(image)\\n return md.item(md.link(text, dest))\",\n \"def images(name):\\n return static_file(name, root=os.path.join(BASEDIR, \\\"images\\\"))\",\n \"def get_image_link(self):\\n table = self.soup.find('table')\\n image_tag = table.find('img')\\n image_name = self.soup.find_all(\\\"b\\\")[1].text\\n return image_tag['src'], image_name\\n\\n # image = td.find_all('img')\\n # print(image)\\n # if image is not None:\\n # return urljoin(self.base_url, image['src'])\",\n \"def img_alt_src(html_source):\\n # =============================================================================\\n # Beautiful soup\\n # =============================================================================\\n \\n bs = BeautifulSoup(html_source, 'html.parser')\\n \\n #Getting all Alt text from HTML \\n alt_txt = [] \\n img_url = []\\n for img in bs.find_all('img', alt=True):\\n try:\\n print(img['alt'])\\n print(img['src'])\\n a = img['alt']\\n s = img['src']\\n alt_txt.append(a)\\n img_url.append(s)\\n except:\\n print('pass')\\n \\n \\n cleaning(alt_txt, img_url)\",\n \"def getBody(HTMLstring, png_list):\\n\\n # Next, we generate all the rows but the last one...\\n while len(png_list) > 4:\\n HTMLstring += '<div class=\\\"row\\\">'\\n for i in range(4):\\n HTMLstring += ('''<div class=\\\"col-xs-3 imgbox\\\">\\n <img class=\\\"img-responsive\\\" src=\\\"''' \\n + png_list[i] + '''\\\" /><h5 class=\\\"center\\\">''' + png_list[i]\\n + \\\"</h5></div>\\\")\\n HTMLstring += \\\"</div>\\\"\\n png_list = png_list[4:]\\n \\n # We obtain the last row by popping what remains.\\n HTMLstring += '<div class=\\\"row\\\">'\\n while len(png_list) > 0:\\n png_file = png_list.pop(0)\\n HTMLstring +=('''<div class=\\\"col-xs-3 imgbox\\\">\\n <img class=\\\"img-responsive\\\" src=\\\"''' \\n + png_file + '''\\\" /><h5 class=\\\"center\\\">''' + png_file\\n + \\\"</h5></div>\\\")\\n HTMLstring += \\\"</div>\\\"\\n return HTMLstring\",\n \"def image(name, value, width=\\\"\\\", height=\\\"\\\", alt=None):\\n if alt is None:\\n alt = name\\n log.debug(u\\\"image %s\\\" % value)\\n html = u\\\"<img id=\\\\\\\"%s\\\\\\\" \\\" % name\\n html += u'alt=\\\"%s\\\" ' % alt\\n if width:\\n html += u\\\"width=\\\\\\\"%s\\\\\\\" \\\" % width\\n if height:\\n html += u\\\"height=\\\\\\\"%s\\\\\\\" \\\" % height\\n html += u\\\"src=\\\\\\\"%s\\\\\\\" \\\" % value\\n html += u\\\"/>\\\\n\\\"\\n return html\",\n \"def brief_json(self, absolutize_url):\\n template = {}\\n template.update({\\n \\\"id\\\": self.image_id,\\n \\\"links\\\": self.links_json(absolutize_url),\\n \\\"name\\\": self.name\\n })\\n return template\",\n \"def __urlImageGenerator(cls, link):\\n\\n try:\\n a = Article(url=link)\\n a.download()\\n a.parse()\\n a.fetch_images()\\n\\n for img in a.imgs:\\n yield img\\n except Exception:\\n pass\",\n \"def content(self, datas):\\n subject = \\\"TCC - MLaaS Topzero D+\\\"\\n\\n body = f\\\"\\\"\\\"\\n <h1>TCC MLaaS</h1>\\n <p>Realizamos o treinamento da base de dados que nos foi enviada. Abaixo você pode ver nossa o resultado dos treinos realizados.</p>\\n \\\"\\\"\\\"\\n\\n for data in datas:\\n if data is not None:\\n for key, info in data['images'].items():\\n body += f\\\"\\\"\\\"{info[0]}\\\"\\\"\\\"\\n if info[1] is not None:\\n body += f\\\"\\\"\\\"<br><img src=\\\"cid:{info[1]}\\\" alt=\\\"{key}\\\" height=\\\"300\\\" width=\\\"300\\\"><br>\\\"\\\"\\\"\\n\\n body += f\\\"\\\"\\\"\\n </br>\\n Atenciosamente\\n <h4><b>IESB</b></h4>\\n <h5>created by <b>Allan Kleitson Teotonio</b></h5>\\n <h5>Science Computer. 2019</h5>\\n \\\"\\\"\\\"\\n\\n return subject, body\",\n \"def tag_and_embed_image_urls(self, image_urls, model=None):\\n return self._multi_imageurl_op(image_urls, ['tag','embed'], model=model)\",\n \"def img_render(kve, lopt_str, sopt_str, gopt_str, popt_str, glopt_str, img_path):\\n i_before = ''\\n i_layer = ''\\n i_after = ''\\n i_label_str_html = ''\\n if 'img' in kve:\\n img_paths = [x.strip() for x in kve['img'].split(':')]\\n for opt_str in glopt_str, popt_str, gopt_str, sopt_str, lopt_str:\\n if 'autoilabel' in opt_str:\\n i_label_str = os.path.splitext(os.path.basename(img_paths[0]))[0]\\n i_label_str_html = ' <div class=\\\"label bottom\\\">' \\\\\\n + i_label_str + '</div>'\\n if 'ilabel' in kve:\\n i_label_str = kve['ilabel']\\n i_label_str_html = ' <div class=\\\"label bottom\\\">' \\\\\\n + i_label_str + '</div>'\\n img_tag_str = ''\\n for idx, path in enumerate(img_paths):\\n img_tag_str = img_tag_str + '<img src=\\\"' + img_path + img_paths[idx] + '\\\"/>'\\n for opt_str in [glopt_str, popt_str, gopt_str, sopt_str, lopt_str]:\\n if 'ibefore' in opt_str:\\n i_before = ' <div class=\\\"layout ' + lopt_str \\\\\\n + '\\\"><div class=\\\"img\\\">' + img_tag_str + '</div>' \\\\\\n + i_label_str_html + '</div>'\\n if 'iafter' in opt_str:\\n i_after = ' <div class=\\\"layout ' + lopt_str \\\\\\n + '\\\"><div class=\\\"img\\\">' + img_tag_str + '</div>' \\\\\\n + i_label_str_html + '</div>'\\n if not (i_before or i_after):\\n i_layer = ' <div class=\\\"img\\\">' + img_tag_str + '</div>'\\n return i_before, i_layer, i_after\\n return '', '', ''\",\n \"def _collect_img_links(self):\\n raise NotImplementedError\",\n \"def get_image_comic_url(session, response):\\n soup = bs(response.text, 'lxml')\\n for div in soup.find_all('div', class_=\\\"img-comic-container\\\"):\\n for a in div.find_all('a', class_=\\\"img-comic-link\\\"):\\n for img in a.find_all('img', src=True):\\n return \\\"https:\\\" + img['src']\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.65580297","0.6551254","0.65510756","0.6550227","0.6437125","0.6404325","0.6345454","0.63356936","0.6310244","0.6258961","0.6221798","0.6157185","0.6137797","0.60765594","0.606654","0.6046435","0.60122216","0.6008134","0.60027015","0.60017127","0.5978731","0.5950172","0.5888022","0.5865719","0.5858332","0.58505434","0.5821355","0.58195585","0.5818279","0.58034253","0.57795256","0.57734686","0.5757102","0.57512516","0.57496184","0.5741821","0.5740479","0.57259667","0.5722323","0.57159287","0.56949216","0.5694811","0.56867915","0.56866217","0.5680487","0.566889","0.5655942","0.5643483","0.5624365","0.5622925","0.5616132","0.5605249","0.56015253","0.5599998","0.5590731","0.5572891","0.5561459","0.5551721","0.55492884","0.55375","0.5528547","0.5526228","0.552043","0.5512654","0.55079013","0.55065924","0.5494266","0.5493481","0.5486345","0.54846513","0.5483397","0.5479986","0.5475414","0.54719317","0.5465602","0.54590756","0.5446466","0.5443482","0.5434954","0.5432839","0.54313785","0.5427405","0.54251987","0.54187685","0.54135305","0.54127693","0.54092354","0.5400677","0.5400417","0.53947973","0.5386845","0.5385445","0.5382407","0.5380116","0.53783494","0.53768843","0.5373979","0.53649503","0.5360862","0.53580785"],"string":"[\n \"0.65580297\",\n \"0.6551254\",\n \"0.65510756\",\n \"0.6550227\",\n \"0.6437125\",\n \"0.6404325\",\n \"0.6345454\",\n \"0.63356936\",\n \"0.6310244\",\n \"0.6258961\",\n \"0.6221798\",\n \"0.6157185\",\n \"0.6137797\",\n \"0.60765594\",\n \"0.606654\",\n \"0.6046435\",\n \"0.60122216\",\n \"0.6008134\",\n \"0.60027015\",\n \"0.60017127\",\n \"0.5978731\",\n \"0.5950172\",\n \"0.5888022\",\n \"0.5865719\",\n \"0.5858332\",\n \"0.58505434\",\n \"0.5821355\",\n \"0.58195585\",\n \"0.5818279\",\n \"0.58034253\",\n \"0.57795256\",\n \"0.57734686\",\n \"0.5757102\",\n \"0.57512516\",\n \"0.57496184\",\n \"0.5741821\",\n \"0.5740479\",\n \"0.57259667\",\n \"0.5722323\",\n \"0.57159287\",\n \"0.56949216\",\n \"0.5694811\",\n \"0.56867915\",\n \"0.56866217\",\n \"0.5680487\",\n \"0.566889\",\n \"0.5655942\",\n \"0.5643483\",\n \"0.5624365\",\n \"0.5622925\",\n \"0.5616132\",\n \"0.5605249\",\n \"0.56015253\",\n \"0.5599998\",\n \"0.5590731\",\n \"0.5572891\",\n \"0.5561459\",\n \"0.5551721\",\n \"0.55492884\",\n \"0.55375\",\n \"0.5528547\",\n \"0.5526228\",\n \"0.552043\",\n \"0.5512654\",\n \"0.55079013\",\n \"0.55065924\",\n \"0.5494266\",\n \"0.5493481\",\n \"0.5486345\",\n \"0.54846513\",\n \"0.5483397\",\n \"0.5479986\",\n \"0.5475414\",\n \"0.54719317\",\n \"0.5465602\",\n \"0.54590756\",\n \"0.5446466\",\n \"0.5443482\",\n \"0.5434954\",\n \"0.5432839\",\n \"0.54313785\",\n \"0.5427405\",\n \"0.54251987\",\n \"0.54187685\",\n \"0.54135305\",\n \"0.54127693\",\n \"0.54092354\",\n \"0.5400677\",\n \"0.5400417\",\n \"0.53947973\",\n \"0.5386845\",\n \"0.5385445\",\n \"0.5382407\",\n \"0.5380116\",\n \"0.53783494\",\n \"0.53768843\",\n \"0.5373979\",\n \"0.53649503\",\n \"0.5360862\",\n \"0.53580785\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.74483454"},"document_rank":{"kind":"string","value":"0"}}},{"rowIdx":6088,"cells":{"query":{"kind":"string","value":"Export blogger html to clipboard. If full, export complete html, otherwise export html extract ready to paste into blogger edit mode."},"document":{"kind":"string","value":"def prepare_for_blogger(args):\n title, posts = parse_markdown(os.path.join(args.root, 'index.md'))\n online_images, online_videos = online_images_url(args)\n\n if args.check_images and check_images(args, posts, online_images) is False:\n pass\n\n html = compose_blogger_html(args, title, posts, online_images, online_videos)\n\n if args.full is False:\n html = re.search('<body>(.*)?</body>', html, flags=re.DOTALL).group(1)\n html = re.sub('<script>.*?</script>', '', html, flags=re.DOTALL)\n html = STYLE.replace('%%', '%') + html\n\n if args.dest:\n with open(args.dest, 'wt', encoding='utf-8') as f:\n f.write(html)\n else:\n clipboard.copy(html)"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["def make_backup(filename, html):\n\n with open(filename, 'wb') as f:\n f.write(html)","def write_to_paste_buffer(txt):\n pyperclip.copy(txt)","def clipboard(self, text = None):\n if text == None:\n response = self._fetch_json('/api/clipboard')\n return response['content']\n else:\n postdata = codecs.encode(json.dumps({ 'content': text }), 'utf-8')\n self._urlopen('/api/clipboard', postdata).read()","def _get_paste_page_content(self, url):\n paste_raw_url = self._get_post_url(url)\n paste_content = self._make_request(paste_raw_url, to_json=False)\n return paste_content.text","def publish_html(self, readyhtml):\n with open(self.outfile,'w') as f_out:\n f_out.writelines(readyhtml)","def copy(to_end=False):\n # Find a way to generalize this for different systems\n if to_end:\n with open('/Users/john/Terminal Saved Output', 'r') as f:\n output = f.read().replace('bpython', 'Python')\n code = output.split('\\nPython')[-1]\n else:\n code = pyperclip.paste()\n pyperclip.copy(parse_code(code))\n return None","def save_clipboard(dist):\n tmpimg = ImageGrab.grabclipboard()\n if tmpimg:\n tmpimg.save(dist, 'PNG', compress_level=9)\n return dist\n return ''","def do_copy_button( self, event ):\n #rint( \" do_copy_button -- this is all \")\n data = self.msg_text.get( 1.0, Tk.END )\n pyperclip.copy( data )","def run_paste(self, expanded, unexpanded) :\n\t\tif expanded :\n\t\t\treturn self.errormessage(\"Doesn't need any argument\")\n\t\tif not self.HasPerms(self.__context, 'View management screens') :\n\t\t\treturn -1\n\t\tif not hasattr(self, '_clipboard') :\n\t\t\treturn self.errormessage(\"Clipboard is empty\")\n\t\ttry :\n\t\t\tself.__context.manage_pasteObjects(cb_copy_data = self._clipboard)\n\t\t\tself.htmlmessage(\"Clipboard's content pasted into %s\" % self.getcwd())\n\t\texcept CopyError :\n\t\t\treturn self.errormessage(\"Impossible to paste clipboard's content into %s\" % self.getcwd())","def scrape_paste(self,paste_id):\n parameter = {'i': paste_id}\n r = requests.get('https://scrape.pastebin.com/api_scrape_item.php',params=parameter)\n return r.text","def exportHtmlFile(self):\n\n fileName = QtGui.QFileDialog.getSaveFileName(None,\"Save html file\", os.getenv('HOME'))\n if fileName:\n fileName += \".html\"\n #print ((\"Exporting: to \" + fileName))\n filedata = \"<html>\\n<head>\\n<title>\" + self.settings['projectName'] + \"</title>\\n</head>\\n<body>\\n\"\n #filedata += str(self.htmlResults.encode('utf-8'))\n modData = \"\"\n for c in self.htmlResults:\n if ord(c) < 128:\n modData += c\n else:\n modData += \"&#\" + str(ord(c)) + \";\"\n filedata += modData\n filedata += \"</body>\\n</html>\"\n f = open(fileName, 'w')\n f.write(filedata)\n f.close()\n self.log += \"Search Results exported to \" + fileName + \"\\n\"\n QtGui.QMessageBox.information(None, \"Html file Export\", str(fileName) + \" exported\")","def wonder():\n copy()\n get_soup()\n get_text()\n change_write_text()\n Check_status_time_stamp()","def clip_copy(num):\n if g.browse_mode == \"ytpl\":\n\n p = g.ytpls[int(num) - 1]\n link = \"https://youtube.com/playlist?list=%s\" % p['link']\n\n elif g.browse_mode == \"normal\":\n item = (g.model.songs[int(num) - 1])\n link = \"https://youtube.com/watch?v=%s\" % item.ytid\n\n else:\n g.message = \"clipboard copy not valid in this mode\"\n g.content = generate_songlist_display()\n return\n\n if has_pyperclip:\n\n try:\n pyperclip.copy(link)\n g.message = c.y + link + c.w + \" copied\"\n g.content = generate_songlist_display()\n\n except Exception as e:\n xprint(link)\n xprint(\"Error - couldn't copy to clipboard.\")\n xprint(e.__doc__)\n xprint(\"\")\n input(\"Press Enter to continue.\")\n g.content = generate_songlist_display()\n\n else:\n g.message = \"pyperclip module must be installed for clipboard support\\n\"\n g.message += \"see https://pypi.python.org/pypi/pyperclip/\"\n g.content = generate_songlist_display()","def clip(save, edit, browser, overwrite):\n html = clipboard.get_clipboard_html()\n if html is None:\n click.echo('No html in the clipboard')\n return\n\n if save is None:\n content = html2md.html_to_markdown(html).strip()\n click.echo(content)\n return\n\n if not save.endswith('.md'):\n click.echo('Note must have extension \".md\"')\n return\n\n note = Note(save)\n if os.path.exists(note.path.abs) and not overwrite:\n click.echo('Note already exists at \"{}\" (specify `--overwrite` to overwrite)'.format(note.path.abs))\n return\n\n html = parsers.rewrite_external_images(html, note)\n content = html2md.html_to_markdown(html).strip()\n note.write(content)\n\n if browser:\n click.launch('http://localhost:{0}/{1}'.format(conf.PORT, note.path.rel))\n\n if edit:\n click.edit(filename=note.path.abs)","def direct_save():\n c = ClipboardMemo()\n c.save()","def copy_to_clipboard(input):\n #\n # Define Tk Window and Prevent from Showing\n #\n root = tk.Tk()\n root.withdraw()\n #\n # Clear Clipboard and Append Text\n #\n root.clipboard_clear()\n root.clipboard_append(input)","def exportBookmarksHtml(self, filePath=''):\n if not filePath:\n filePath = self.getFileName(_('TreeLine - Export HTML Bookmarks'),\n 'html')\n if not filePath:\n return False\n QtGui.QApplication.setOverrideCursor(QtCore.Qt.WaitCursor)\n if ExportDialog.exportWhat == ExportDialog.entireTree:\n self.selectedNodes = [self.rootNode]\n addBranches = ExportDialog.exportWhat != ExportDialog.selectNode\n title = _bookmarkTitle\n if len(self.selectedNodes) == 1 and addBranches:\n title = self.selectedNodes[0].title()\n self.selectedNodes = self.selectedNodes[0].childList\n lines = ['<!DOCTYPE NETSCAPE-Bookmark-file-1>',\n '<meta http-equiv=\"Content-Type\" content=\"text/html; '\n 'charset=utf-8\">', '<title>{0}</title>'.format(title),\n '<h1>{0}</h1>'.format(title)]\n for node in self.selectedNodes:\n lines.extend(node.exportHtmlBookmarks(addBranches))\n with open(filePath, 'w', encoding='utf-8') as f:\n f.writelines([(line + '\\n') for line in lines])\n return True","def copyToClipboard(copy_str):\n\tcopier = Tk()\n\t# keep the window from showing\n\tcopier.withdraw()\n\tcopier.clipboard_clear()\n\t# text saved to clipboard\n\tcopier.clipboard_append(copy_str)\n\tcopier.destroy()","def from_clipboard(self):\n for url in QApplication.clipboard().mimeData().urls():\n src = url.path()\n dst = os.path.join(self.current_location(), os.path.basename(src))\n try:\n if os.path.islink(src) or os.path.isfile(src):\n copyfile(src, dst, overwrite=False)\n elif os.path.isdir(src):\n copytree(src, dst, overwrite=False)\n except:\n QMessageBox.critical(self, 'Error copying file/dir', traceback.format_exc())","def _on_articles_copy_link(self, evt=None):\n \n # get selected articles\n articles = self._articles_view.GetSelectedArticles()\n if not articles:\n return\n \n # format links\n text = \"\"\n for article in articles:\n if article.doi:\n text += \"http://dx.doi.org/%s\\n\" % article.doi\n \n # make text object for data\n obj = wx.TextDataObject()\n obj.SetText(text.strip())\n \n # paste to clipboard\n if wx.TheClipboard.Open():\n wx.TheClipboard.SetData(obj)\n wx.TheClipboard.Close()","async def paste(text: str) -> str:\n\n async with aiohttp.ClientSession() as aioclient:\n post = await aioclient.post(\"https://hastebin.com/documents\", data=text)\n if post.status == 200:\n response = await post.text()\n return f\"https://hastebin.com/{response[8:-2]}\"\n\n # Fallback bin\n post = await aioclient.post(\"https://bin.drlazor.be\", data={\"val\": text})\n if post.status == 200:\n return post.url","def convert_html():\n return","def exportHtmlSingle(self, filePath=''):\n if not filePath:\n filePath = self.getFileName(_('TreeLine - Export HTML'), 'html')\n if not filePath:\n return False\n QtGui.QApplication.setOverrideCursor(QtCore.Qt.WaitCursor)\n if ExportDialog.exportWhat == ExportDialog.entireTree:\n self.selectedNodes = [self.rootNode]\n outputGroup = treeoutput.OutputGroup(self.selectedNodes,\n ExportDialog.includeRoot,\n ExportDialog.exportWhat !=\n ExportDialog.selectNode,\n ExportDialog.openOnly, True)\n outputGroup.addBlanksBetween()\n outputGroup.addIndents()\n outputGroup.addSiblingPrefixes()\n outGroups = outputGroup.splitColumns(ExportDialog.numColumns)\n htmlTitle = os.path.splitext(os.path.basename(filePath))[0]\n indent = globalref.genOptions.getValue('IndentOffset')\n lines = ['<!DOCTYPE html PUBLIC \"-//W3C//DTD HTML 4.01 '\n 'Transitional//EN\">', '<html>', '<head>',\n '<meta http-equiv=\"Content-Type\" content=\"text/html; '\n 'charset=utf-8\">', '<title>{0}</title>'.format(htmlTitle),\n '<style type=\"text/css\"><!--',\n 'div {{margin-left: {0}em}}'.format(indent),\n 'td {padding: 10px}', 'tr {vertical-align: top}',\n '--></style>', '</head>', '<body>']\n if ExportDialog.addHeader:\n headerText = (globalref.mainControl.activeControl.printData.\n formatHeaderFooter(True))\n if headerText:\n lines.append(headerText)\n lines.extend(['<table>', '<tr><td>'])\n lines.extend(outGroups[0].getLines())\n for group in outGroups[1:]:\n lines.append('</td><td>')\n lines.extend(group.getLines())\n lines.extend(['</td></tr>', '</table>'])\n if ExportDialog.addHeader:\n footerText = (globalref.mainControl.activeControl.printData.\n formatHeaderFooter(False))\n if footerText:\n lines.append(footerText)\n lines.extend(['</body>', '</html>'])\n with open(filePath, 'w', encoding='utf-8') as f:\n f.writelines([(line + '\\n') for line in lines])\n return True","def write_html(self, filename):\n # todo: allow writing in split mode\n html = self.to_html()\n open(filename, 'wt').write(html)\n print('Exported app to %r' % filename)","def print_contents(browser, dest='~/.browser.html'):\n import os\n open(os.path.expanduser(dest), 'w').write(browser.contents)","def _get_pastes_page_content(self):\n url = self._get_post_list_url()\n content = self._make_request(url, to_json=False)\n return content.text","def save(self, filename):\n outfile = open(filename, \"w\")\n outfile.write(self.html.encode('utf8'))\n outfile.close()","def paste(self, text):\n if self.file is None:\n return self.paste_to_stdout(text)\n return self.paste_to_file(text)","def __editPaste(self):\n if QApplication.focusWidget() == e5App().getObject(\"Shell\"):\n e5App().getObject(\"Shell\").paste()\n else:\n self.activeWindow().paste()","def write(self,out):\n with open( out, \"wb\") as fi:\n fi.write(html.tostring(self.book))","def __copyToClipboard(self):\n itm = self.findList.selectedItems()[0]\n if itm.parent():\n fn = itm.parent().text(0)\n else:\n fn = itm.text(0)\n \n cb = QApplication.clipboard()\n cb.setText(fn)","async def pob(self, ctx):\n if str(ctx.guild.id) in ctx.bot.server_config.conf and ctx.bot.server_config.conf[str(ctx.guild.id)]['disable_pastebin']:\n return\n paste_keys = pastebin.fetch_paste_key(ctx.message.content)\n if not paste_keys: return\n xml = None\n paste_key = paste_keys[0]\n try:\n xml = await self.bot.loop.run_in_executor(None, pastebin.get_as_xml, paste_key)\n except:\n return\n if not xml: return\n stats = await self.bot.loop.run_in_executor(None, cache_pob_xml, xml, self.client)\n await self.make_responsive_embed(stats, ctx)","def save_raw_html(r):\n raw_insert = {\"raw_html\": r}\n raw_html.insert_one(raw_insert)\n return None","def outputHtml(s):\n htmlFile.write(s + \"\\n\")","def offline_copy(_export_path):\n global export_path\n export_path = _export_path\n \n # First, monkey patch the original config\n main.NBCONFIG.protectect_dirs = []\n main.NBCONFIG.protected_users = {}\n main.NBCONFIG.edit_users = {}\n \n # Now monkey patch NBweb\n main.REQUIRELOGIN = False\n\n pages = []\n\n # Copy and work all source files \n for dirpath,dirnames,filenames in os.walk(NBCONFIG.source):\n for dirname in dirnames[:]: # Iterate a copy since we will delete in place\n if any(dirname.startswith(i) for i in ['.']):\n dirnames.remove(dirname) # So we do not parse it later\n continue\n if dirname == '_scratch':\n dirnames.remove(dirname) # So we do not parse it later\n continue\n \n # Names\n src_systemname = os.path.join(dirpath,dirname)\n rootname = os.path.relpath(src_systemname,NBCONFIG.source) # No leading / though\n dest_systemname = os.path.join(export_path,rootname)\n \n mkdir(rootname,isfile=False) # Will make the dir no matter what\n \n # Index\n dest = os.path.join(export_path,rootname, 'index.html')\n \n # Exclusions.\n if main.exclusion_check(utils.join('/',rootname +'/')):\n with open(dest,'w',encoding='utf8') as FF:\n FF.write('')\n continue\n \n try:\n html = main.main_route('/' + rootname + '/')\n except HTTPError:\n # Likely some additional resource in _NBweb\n try:\n os.rmdir(dest_systemname) # Should be empty\n except OSError:\n pass\n os.symlink(src_systemname,dest_systemname)\n continue\n \n \n html = process_page(html,dest)\n with open(dest,'w',encoding='utf8') as FF:\n FF.write(html)\n \n # _all\n dest = os.path.join(export_path,'_all',rootname, 'index.html')\n mkdir(dest,isfile=True,isfull=True)\n \n html = main.allpage('/'+ rootname +'/')\n html = process_page(html,dest)\n with open(dest,'w',encoding='utf8') as FF:\n FF.write(html)\n \n \n # Loop each file\n for filename in filenames:\n if os.path.splitext(filename)[0] == 'index':\n continue # Already made above\n \n # Names\n src_systemname = os.path.join(dirpath,filename)\n rootname = os.path.relpath(src_systemname,NBCONFIG.source) # No leading / though\n dest_systemname = os.path.join(export_path,rootname)\n \n mkdir(rootname,isfile=True) # Will make the dir no matter what\n try:\n os.symlink(src_systemname,dest_systemname) \n except OSError:\n os.remove(dest_systemname)\n os.symlink(src_systemname,dest_systemname)\n \n rootbasename,ext = os.path.splitext(rootname)\n if ext in NBCONFIG.extensions:\n dest = os.path.join(export_path,rootbasename + '.html')\n try:\n html = main.main_route(rootbasename + '.html')\n except:\n print('Issue with: {}'.format(rootname))\n \n html = process_page(html,dest)\n \n with open(dest,'w',encoding='utf8') as FF:\n FF.write(html)\n pages.append(rootbasename)\n\n ## Index pages\n # Home page w/o blog\n dest_systemname = os.path.join(export_path,'')\n dest = os.path.join(export_path,'index.html')\n \n html0 = main.main_route('/',map_view=True)\n \n html = process_page(html0,dest)\n with open(dest,'w',encoding='utf8') as FF:\n FF.write(html)\n\n # Also write the sitemap\n dest = os.path.join(export_path,'_sitemap/index.html')\n mkdir('/_sitemap',isfile=False)\n html = process_page(html0,dest)\n with open(dest,'w',encoding='utf8') as FF:\n FF.write(html)\n \n # _all\n dest = os.path.join(export_path,'_all','index.html')\n \n html = main.allpage('/')\n html = process_page(html,dest)\n with open(dest,'w',encoding='utf8') as FF:\n FF.write(html)\n \n ## Blog Pages\n if len(NBCONFIG.blog_dirs) > 0:\n blog_num = 0\n while True:\n dest = os.path.join(export_path,'_blog',unicode(blog_num),'index.html')\n \n try:\n html = main.main_route('/',map_view=False,blog_num=blog_num)\n except HTTPError:\n break # At the last one\n \n mkdir(dest,isfile=True,isfull=True) \n \n html = process_page(html,dest)\n with open(dest,'w',encoding='utf8') as FF:\n FF.write(html)\n blog_num += 1\n # Make the home page. \n dest = os.path.join(export_path,'index.html')\n html = main.main_route('/',map_view=False,blog_num=0)\n html = process_page(html,dest)\n with open(dest,'w',encoding='utf8') as FF:\n FF.write(html)\n \n ## Special Pages\n make_random_forward(pages)\n \n # Tags\n dest = os.path.join(export_path,'_tags/index.html')\n mkdir(dest,isfile=True,isfull=True) \n html = main.return_tags()\n html = process_page(html,dest)\n with open(dest,'w',encoding='utf8') as FF:\n FF.write(html)\n \n # ToDos\n dest = os.path.join(export_path,'_todo/index.html')\n mkdir(dest,isfile=True,isfull=True) \n html = main.return_todo()\n html = process_page(html,dest)\n with open(dest,'w',encoding='utf8') as FF:\n FF.write(html)\n \n txt = main.return_todo_txt()\n dest = os.path.join(export_path,'_todo/todo.txt')\n with open(dest,'w',encoding='utf8') as FF:\n FF.write(txt)\n \n # Galleries\n cpsym( utils.join(NBCONFIG.scratch_path,'_galleries'),utils.join(export_path,'_galleries'))\n \n ## Clean up\n for F in [utils.join(export_path,'_NBweb',a) for a in ['NBCONFIG.py','NBCONFIG.pyc','template.html']]:\n try:\n os.remove(F)\n except:\n pass\n \n # Make sure there are never any directory listings\n for dirpath,dirnames,filenames in os.walk(export_path):\n if 'index.html' not in filenames:\n with open(utils.join(dirpath,'index.html'),'w',encoding='utf8') as F:\n F.write('')","def compose_blogger_html(args, title, posts, imgdata, online_videos):\n for post in posts:\n for media in post.medias:\n if type(media) is PostImage:\n if media.uri not in imgdata:\n print('Image missing: ', media.uri)\n else:\n img_url, resized_url = imgdata[media.uri]\n media.uri = img_url\n media.resized_url = resized_url\n elif type(media) is PostVideo:\n if not online_videos:\n print('Video missing: ', media.uri)\n else:\n media.iframe = online_videos[0]\n del online_videos[0]\n else:\n assert False\n\n return print_html(args, posts, title, '', target='blogger')","def copy_to_clipboard(self, txt):\r\n cmd = 'echo \"' + txt.strip() + '\"|clip'\r\n return subprocess.check_call(cmd, shell=True)","def output_html(self, path):\n if path is None:\n return\n import os\n fout = codecs.open(os.path.abspath(path), 'w', encoding='utf-8')\n fout.write('<html><body><table>')\n for data in self.datas:\n fout.write('<tr><td>%s</td><td>%s</td><td>%s</td></tr>' % (data['url'], data['title'], data['summary']))\n self.datas.remove(data)\n fout.write('</table></body></html>')\n fout.close()","def copy_raw_bibtex(self, entry_idx=None):\n if entry_idx is None:\n entry_idx = self.selector.get_selection()\n else:\n entry_idx = self.selector.select_by_index(entry_idx)\n if not entry_idx:\n self.visual.error(\"Need a selection to show raw bibtex of\")\n return\n\n entries = self.get_current_entries()\n entries_string = Writer.entries_to_bibtex_string(entries)\n clipboard.copy(entries_string)\n self.visual.message(f\"Copied raw bibtex content of {len(entries)} entries.\")","def htmlDocContentDumpOutput(self, buf, encoding):\n if buf is None: buf__o = None\n else: buf__o = buf._o\n libxml2mod.htmlDocContentDumpOutput(buf__o, self._o, encoding)","def _on_articles_copy_summary(self, evt=None):\n \n # get selected articles\n articles = self._articles_view.GetSelectedArticles()\n if not articles:\n return\n \n # format citations\n text = \"\"\n for article in articles:\n text += article.format(\"[TI]\\n[AU]\\n[CI]\\n[DOIX]\\n\\n[AB]\\n\\n\")\n \n # make text object for data\n obj = wx.TextDataObject()\n obj.SetText(text.strip())\n \n # paste to clipboard\n if wx.TheClipboard.Open():\n wx.TheClipboard.SetData(obj)\n wx.TheClipboard.Close()","def copy_link(self):\n try:\n Clipboard.copy(self.url)\n except:\n self.ids.link.text=self.link_message","def clipboard_copy(text):\n result = subprocess.run(\n # \"primary\" because \"clipboard\" doesn't seem to work for all apps\n # you must paste with middle click\n [\"xclip\", \"-selection\", \"primary\", \"-l\", \"1\"],\n input=bytes(text, encoding=\"utf-8\")\n )\n if result.returncode == 0:\n pass\n else:\n print(\"Error copying\")","def extract(url, output):\n click.echo(\"Start progress..\")\n news = url.context\n e = Extractor(news)\n click.echo(\"Extract information..\")\n try:\n news_text = e.get_news()\n except ExtractException as exception:\n # we aren't showing traceback to user, just echoing error message\n return click.echo(\"Page parsing error: %s\" % exception.args[0])\n\n with open(output, \"w\", encoding=\"utf-8\") as out_file:\n # print(news_text, file=out_file, flush=True)\n with click.progressbar(news_text, length=len(news_text.encode()),\n label=\"Writing to file\") as bar:\n for item in bar:\n print(item, end='', file=out_file, flush=True)\n\n click.echo(\"Finished!\")","def test_copy_details(self):\n self.new_details.save_details()\n twitter = Details('Dennis', 'Facebook', 'Kiplangat', 'kiplangat18')\n twitter.save_details()\n find_details = None\n for details in Details.user_details_list:\n find_details = Details.find_by_site_name(details.site_name)\n return pyperclip.copy(find_details.password)\n\n Details.copy_details(self.new_details.site_name)\n self.assertEqual('kiplangat18', pyperclip.paste())\n print(pyperclip.paste())","def copy_as_curl(self):\n curl_headers = ''\n for header, value in self.headers:\n curl_headers += \"-H '{}: {}' \".format(header, value)\n curl_data = ''\n if self.operation in ('POST', 'PUT'):\n curl_data = \"--data '{}' \".format(self.data)\n curl_cmd = \"curl '{}' {} {}--compressed\".format(self.url.url(), curl_headers, curl_data)\n QApplication.clipboard().setText(curl_cmd)","def copy_to_clipboard(show_string, copy_string):\n copy_command = \"echo %s | pbcopy\" % (copy_string)\n print \"%s | bash='/bin/bash' param1='-c' param2='%s' terminal=false\" \\\n % (show_string, copy_command)","def copy_link(self):\n try:\n Clipboard.copy(self.url)\n except(AttributeError):\n self.ids.label.text = self.error_msg","def htmlDocContentDumpFormatOutput(self, buf, encoding, format):\n if buf is None: buf__o = None\n else: buf__o = buf._o\n libxml2mod.htmlDocContentDumpFormatOutput(buf__o, self._o, encoding, format)","def export(self, package):\n self.style = package.style\n self.copyFiles(package)\n self.html = self.renderHeader(package.name)\n self.html += u\"<body>\\n\"\n self.html += u\"<div id=\\\"content\\\">\\n\"\n self.html += u\"<div id=\\\"header\\\">\\n\"\n self.html += escape(package.title)\n self.html += u\"</div>\\n\"\n self.html += u\"<div id=\\\"main\\\">\\n\"\n self.renderNode(package.root)\n self.html += u\"</div>\\n\"\n self.html += u\"</div>\\n\"\n self.html += u\"</body></html>\\n\"\n self.save(self.outputDir/\"index.html\")","def process_page(html,dest):\n html0 = html[:]\n to_root = os.path.relpath(export_path,dest)\n to_root = to_root[1:]# Change '../' or '..' to '.' or './'\n \n # Fix links to directories first since that is easier to find\n html,N1 = re_dirlinks.subn(r'\\1=\"/\\2/index.html\"',html)\n \n # all pages links\n html,N2 = re_all.subn(r'\\1=\"/_all/\\2/index.html\"',html)\n \n # Add index.html for any other internal links. NOTE: by preprocessing\n # all internal links from the main content will already end in .html so this\n # is just special pages.\n for match in re_intlinks.finditer(html):\n dest = match.groups()[-1]\n ext = os.path.splitext(dest)[-1]\n if ext == '':\n old = r'{}=\"/{}\"'.format(*match.groups())\n new = r'{}=\"/{}\"'.format(match.groups()[0], os.path.join(match.groups()[1],'index.html') )\n html = html.replace(old,new)\n \n # Now make all links to the root\n html,N3 = re_intlinks.subn(r'\\1=\"{}/\\2\"'.format(to_root),html)\n \n # Remove the search stuff\n out = []\n ff = False\n for line in html.split('\\n'):\n if not ff and '<!-- search -->' not in line:\n out.append(line)\n continue\n \n if '<!-- search -->' in line:\n ff = True\n \n if ff and '<!-- /search -->' in line:\n ff = False\n\n html = '\\n'.join(out)\n return html","def dump_html(self):\n l_html = self.m_driver.find_element_by_xpath('//html').get_attribute('outerHTML')\n with open(datetime.datetime.now().strftime('%Y%m%d_%H%M%S.html'), 'w') as f:\n f.write(l_html)","def toClipboard(self):\n buf = io.BytesIO()\n self.fig.savefig(buf, dpi=300, facecolor='w', format='png',\n transparent=True)\n QtGui.QApplication.clipboard().setImage(\n QtGui.QImage.fromData(buf.getvalue()))\n buf.close()","def clipboard(self, data):\n p = subprocess.Popen([\"xclip\", \"-selection\", \"clipboard\"], stdin=subprocess.PIPE)\n p.stdin.write(data.encode())\n p.stdin.close()","def save(self):\n html_file = '{}/{}.html'.format(self.web_dir, self.title)\n f = open(html_file, 'wt')\n f.write(self.doc.render())\n f.close()","def contentRaw(request):\n paste = Paste.get(request.matchdict['idContent'])\n # TODO type/mime\n return paste.content","def copy(self):\r\n ret=' '\r\n if self.REQUEST.SESSION.has_key('my_path'):\r\n\t zpath=self.REQUEST.SESSION['my_path'].replace('toolbox_root','').strip('/')\r\n\t #ret=zpath\r\n\t if self.REQUEST.SESSION.has_key('copy_bild'):\r\n\t\t cp_bild=self.REQUEST.SESSION['copy_bild'].split('/')[-1].strip('/')\r\n\t\t cp_path=str('/').join(self.REQUEST.SESSION['copy_bild'].split('/')[0:-1])\r\n\t\t #ret+=' '+cp_path+' '+cp_bild\r\n\t\t if cp_path!=zpath:\r\n\t\t \tn_id=search_id(self,self.restrictedTraverse(zpath).objectValues('Image'))\r\n\t\t \t#ret+=' '+n_id\r\n\t\t\tfor x in liste_val:\r\n\t\t\t\ttry:\r\n\t\t\t\t\tfor obj in self.restrictedTraverse(cp_path).objectValues('Image'):\r\n\t\t\t\t\t if str(obj.getId())[0:6]==cp_bild:\r\n\t\t\t\t\t\tmy_clip=self.restrictedTraverse(cp_path).manage_copyObjects([obj.getId()])\r\n\t\t\t\t\t\tcopied=self.restrictedTraverse(zpath).manage_pasteObjects(my_clip)\r\n\t\t\t\t\t\t#ret+=' new id : '+str(copied[0]['new_id'])\r\n\t\t\t\t\t\t#if str(copied[0]['new_id']).split('_')[0]!=n_id:\r\n\t\t\t\t\t\t#\tself.restrictedTraverse(zpath).manage_renameObjects([str(copied[0]['new_id'])],[str(n_id+x)])\r\n\t\t\t\t\t\t\t#ret +=' False '\r\n\t\t\t\t\t\t#ret+='<br>\\n'\r\n\t\t\t\texcept:\r\n\t\t\t\t\tret+=''\r\n else:\r\n\t ret=' '\r\n return ' '","def _pasteFile(self) -> None:\n if not self._fileClipboard:\n return\n cut = self._fileClipboard.pop()\n filenames = [x.name for x in self._fileClipboard]\n destPaths = [self._currPath.joinpath(x) for x in filenames]\n try:\n duplicates = []\n for src, dest in zip(self._fileClipboard, destPaths):\n if src == dest:\n raise shutil.SameFileError\n if dest in self._currPath.glob('*'):\n duplicates.append(dest)\n if duplicates:\n if self._overwriteFileMsgBox(duplicates) == QMessageBox.Cancel:\n self._fileClipboard.clear()\n self._pasteFileAction.setEnabled(False)\n return\n for src, dest in zip(self._fileClipboard, destPaths):\n if cut and src.is_file():\n shutil.move(str(src), str(dest))\n elif src.is_dir():\n dir_util.copy_tree(str(src), str(dest))\n if cut:\n shutil.rmtree(src)\n elif src.is_file():\n shutil.copy(str(src), str(dest))\n elif not src.exists():\n raise FileNotFoundError\n self._statusBar.showMessage('File pasted!', 3000)\n self._fileClipboard.clear()\n self._pasteFileAction.setEnabled(False)\n except shutil.SameFileError:\n self._statusBar.showMessage('You cannot overwrite the same file!', 3000)\n self._fileClipboard.clear()\n except PermissionError:\n self._statusBar.showMessage('No permission to copy the file!', 3000)\n self._fileClipboard.clear()\n except FileNotFoundError:\n self._statusBar.showMessage('Cannot find the source file!', 3000)\n self._fileClipboard.clear()\n finally:\n self._listDirectories()","def get_paste_buffer():\n pb_str = pyperclip.paste()\n\n # If value returned from the clipboard is unicode and this is Python 2, convert to a \"normal\" Python 2 string first\n if six.PY2 and not isinstance(pb_str, str):\n import unicodedata\n pb_str = unicodedata.normalize('NFKD', pb_str).encode('ascii', 'ignore')\n\n return pb_str","def set_clipboard(content, *args, **kwargs):\n G.DEVICE.set_clipboard(content, *args, **kwargs)","def htmlDocContentDumpOutput(self, cur, encoding):\n if cur is None: cur__o = None\n else: cur__o = cur._o\n libxml2mod.htmlDocContentDumpOutput(self._o, cur__o, encoding)","def save(self, *args, **kwargs):\n if not self.slug:\n self.slug = '%02x' % random.getrandbits(256)\n\n lexer = get_lexer_by_name(self.language)\n options = self.title and {'title': self.title} or {}\n formatter = HtmlFormatter(style=self.style, linenos='table',\n full=True, **options)\n self.highlighted = highlight(self.code, lexer, formatter)\n super(Paste, self).save(*args, **kwargs)","def copy(self, event):\n selection = self.get_selection()\n if not selection:\n return []\n start_row, start_col, end_row, end_col = selection\n data = u''\n rows = range(start_row, end_row + 1)\n for row in rows:\n columns = range(start_col, end_col + 1)\n for idx, column in enumerate(columns, 1):\n if idx == len(columns):\n # if we are at the last cell of the row, add new line instead\n data += self.GetCellValue(row, column) + \"\\n\"\n else:\n data += self.GetCellValue(row, column) + \"\\t\"\n text_data_object = wx.TextDataObject()\n text_data_object.SetText(data)\n if wx.TheClipboard.Open():\n wx.TheClipboard.SetData(text_data_object)\n wx.TheClipboard.Close()\n else:\n wx.MessageBox(\"Can't open the clipboard\", \"Warning\")","def saveHtml(path: str, filename: str, html: str) -> None:\n filepath = os.path.join(path, filename)\n with open(filepath, \"w\") as fileHandle:\n fileHandle.write(html)\n return filepath","def saveToFile(html):\n #print(\"Saving to file.\")\n html += \"\\n\"\n #open necessary files to save\n logFile = open(\"postLog_{0}_{1}.txt\".format(os.path.splitext(path)[0], dateTimeNow), \"a\")\n logFile.write(html)\n logFile.close()\n #print(\"Check Point.\")","def paste(cmd=paste_cmd, stdout=PIPE):\n return Popen(cmd, stdout=stdout).communicate()[0].decode('utf-8')","def save_page_as(browser, file_name):\n\n with open(file_name, \"w\") as fout:\n fout.write(browser.find_element_by_tag_name(\"pre\").text)","def write_paste_log(url):\n with open('checked_pastes.txt', 'a') as paste_file:\n paste_file.writelines(url+\"\\n\")","def process_webpage(self, target, output_file, url, embed, selenium):\n\t\t# Build the output file's name\n\t\tself._build_output_file(output_file)\n\t\t# Open the output file and clone the webpage\n\t\twith open(self.output_file_name, \"w\") as output:\n\t\t\tself.collect_source(target, output, url, embed, selenium)","def download_html_command():\n # 1. Get input scan id from Demisto\n scanid = demisto.args().get('scanid')\n # 2. Get the forensic webpage HTML from SlashNext API\n response = download_html(scanid=scanid)\n if response.get('errorNo') != 0:\n return\n # 3. Parse and format the response\n html_base64 = response.get('htmlData').get('htmlBase64')\n html_data = base64.b64decode(html_base64)\n\n html_file = fileResult('slashnext_{}.html'.format(scanid), html_data, entryTypes['file'])\n\n demisto.results({\n 'Type': entryTypes['file'],\n 'ContentsFormat': formats['text'],\n 'Contents': 'Forensics: Webpage HTML for URL Scan ID = {}'.format(scanid),\n 'File': html_file.get('File'),\n 'FileID': html_file.get('FileID')\n })","def save_current_nb_as_html(info=False):\n assert in_ipynb()\n\n full_path = get_notebook_name()\n path, filename = os.path.split(full_path)\n\n wd_save = os.getcwd()\n os.chdir(path)\n cmd = 'jupyter nbconvert --to html \"{}\"'.format(filename)\n os.system(cmd)\n os.chdir(wd_save)\n\n if info:\n print(\"target dir: \", path)\n print(\"cmd: \", cmd)\n print(\"working dir: \", wd_save)","def cli(ctx, resource, blog, relative_path, verbose):\n ctx.verbose = verbose\n validate_blog_and_settings(ctx, blog, relative_path)\n export_path = resolve_export_path(ctx, relative_path)\n\n resource_map = {\n \"design_assets\": copy_design_assets,\n \"blog_template\": copy_blog_template,\n \"blog_index\": copy_blog_index,\n \"blog_config\": copy_blog_config,\n \"blog_layout\": copy_blog_layout,\n }\n\n transfer = resource_map.get(resource)\n if not transfer:\n ctx.log(\"No such resource. See blogger export --help\")\n ctx.log(\"ERROR: INVALID RESOURCE NAME\")\n raise SystemExit()\n\n ctx.vlog(\"Using function\", transfer)\n transfer(ctx, export_path)","def test_export_html(self):\r\n resp = self.client.get_html(self.url)\r\n self.assertEquals(resp.status_code, 200)\r\n self.assertContains(resp, \"Export My Course Content\")","def htmlDocDump(self, f):\n ret = libxml2mod.htmlDocDump(f, self._o)\n return ret","def dump(self, path, mode='standalone'):\n if mode == 'standalone':\n with open(path+\"/export_grid_standalone\"+str(self._id)+\".html\", 'w+') as f:\n f.write(self.export_html(build=True))\n elif mode == 'all':\n widget_export = self.export_html(build=False)\n with open(path+\"/export_scripts.html\", \"w+\") as f:\n f.write(widget_export['script_tags'])\n with open(path+\"/export_html_state.html\", \"w+\") as f:\n f.write(widget_export['html_state'])\n with open(path+\"/export_state_\"+str(self._id)+\".json\", \"w+\") as f:\n f.write(json.dumps(widget_export['manager_state']))\n with open(path+\"/export_grid_\"+str(self._id)+\".html\", \"w+\") as f:\n f.write(widget_export['grid_div'])","def _on_articles_copy_citation(self, evt=None):\n \n # get selected articles\n articles = self._articles_view.GetSelectedArticles()\n if not articles:\n return\n \n # format citations\n text = \"\"\n for article in articles:\n text += article.format(\"[TI]\\n[AU]\\n[CI]\\n[DOIX]\\n\\n\")\n \n # make text object for data\n obj = wx.TextDataObject()\n obj.SetText(text.strip())\n \n # paste to clipboard\n if wx.TheClipboard.Open():\n wx.TheClipboard.SetData(obj)\n wx.TheClipboard.Close()","def print_html(html):\n display(HTML(html))","def assemble(self, page):\n html = self.include(page)\n html = HTMLBeautifier.beautify(html, 4)\n path = osp.join(self.dst, page)\n with open(path, \"wt\") as fp:\n fp.write(html)","def save_trail_html(title, url):\n r = requests.get(url).text\n raw_insert = {'trail': title,\n \"raw_html\": r}\n trail_page_raw_html.insert_one(raw_insert)\n return None","def set_code(path, doc):\n if path is None:\n pasteboard.set(doc)\n else:\n with open(path, 'w', encoding='UTF-8') as html_file:\n html_file.write(str(doc))","def edit_html():\n # save the new html_raw\n entry = request.form.get(\"entry\")\n entry_dict[entry]['html_raw'] = request.form.get(\"raw\")\n entry_dict[entry]['html'] = raw_to_html(entry, entry_dict[entry]['html_raw'])\n # save into pkl file\n with open(entry_dict_path, 'wb') as pkl_file:\n cPickle.dump(entry_dict, pkl_file)\n # update the website\n return jsonify(True)","def __editCopy(self):\n if QApplication.focusWidget() == e5App().getObject(\"Shell\"):\n e5App().getObject(\"Shell\").copy()\n else:\n self.activeWindow().copy()","def ReferencePhase2Clipboard (self, event) :\n\t\tif wx.TheClipboard.Open() :\n\t\t\ttxt_data = str( self.GetReferencePhase()[0] )[1:-1]\n\t\t\twx.TheClipboard.SetData(wx.TextDataObject(txt_data)) \n\t\t\twx.TheClipboard.Close()\n\t\telse :\n\t\t\twx.MessageBox(\"Unable to open the clipboard\", \"Error\")","def ShowHTML(self, url):\n import sys, os, urllib\n if urllib.splittype(url)[0] is None: # just a file spec\n if hasattr(sys, \"frozen\"):\n fname = os.path.join(os.path.dirname(sys.argv[0]),\n \"..\", \"docs\", \"sb_server\", url)\n if not os.path.isfile(fname):\n fname = os.path.join(os.path.dirname(sys.argv[0]), url)\n else:\n fname = os.path.join(os.path.dirname(__file__), \"docs\", url)\n fname = os.path.abspath(fname)\n if not os.path.isfile(fname):\n self.ShowMessage(\"Can't find \"+url)\n return\n url = fname\n SetWaitCursor(1)\n os.startfile(url)\n SetWaitCursor(0)","def save_html(self, file_name=None, raw_html=True):\n if raw_html:\n with open(file_name or self.url_obj.file_path, 'wb') as fh:\n fh.write(self.raw_html)\n else:\n self.lxml.getroottree().write(file_name or self.url_obj.file_path, method=\"html\")","def htmlDocContentDumpFormatOutput(self, cur, encoding, format):\n if cur is None: cur__o = None\n else: cur__o = cur._o\n libxml2mod.htmlDocContentDumpFormatOutput(self._o, cur__o, encoding, format)","def create_full_batter_html(url):\n # raw_batter_list = scrape_razzball_batters(url)\n raw_batter_list = fantasy_pro_players(url)\n return create_full_batter(raw_batter_list)","def copy_text(self):\n self.window.clipboard_clear()\n if self.tab_control.index(\"current\") == 0:\n try:\n self.text = self.textbox.get(\"sel.first\", \"sel.last\")\n except tk.TclError:\n self.text = self.textbox.get(\"1.0\", tk.END)\n self.window.clipboard_append(self.text)\n elif self.tab_control.index(\"current\") == 1:\n self.window.clipboard_append(self.words)","def paste_text(text, language=\"text\", paste_expire=8640, paste_user=\"paste.py\",\n return_link=True):\n # costruct url\n data = {\"paste_data\": text,\n \"paste_lang\": language,\n \"api_submit\": \"true\",\n \"mode\": \"json\",\n \"paste_user\": paste_user,\n \"paste_expire\": paste_expire\n }\n try:\n with contextlib.closing(urllib2.urlopen(PASTE_BASE_URL, urllib.urlencode(data))) as query:\n id = json.loads(query.read(), object_hook=Struct).result.id\n return PASTE_BASE_URL + id if return_link else id\n except urllib2.HTTPError as e:\n print(\"Error uploading file:\")\n print(e.reason)","def _copy_to_clipboard_ctrl(self):\n res = \"\"\n clipboard = QtWidgets.QApplication.clipboard()\n proxies = self._get_table()\n for proxy in proxies:\n res += str(proxy) + \"\\n\"\n clipboard.clear(mode=clipboard.Clipboard)\n clipboard.setText(res, mode=clipboard.Clipboard)","def saveCopyCurrentEditor(self):\n aw = self.activeWindow()\n self.saveCopyEditorEd(aw)","def write_html(self):\n html_exporter = HTMLExporter(template_file=os.path.join(config[\"templates_dir\"], \"notebook.tpl\"))\n for nb in self.notebooks:\n (body, resources) = html_exporter.from_notebook_node(nb.content)\n body = re.sub('{github_user_name}', config[\"github_user_name\"], body)\n body = re.sub('{github_repo_name}', config[\"github_repo_name\"], body)\n html_path = os.path.join(self.dst_dir, os.path.splitext(nb.filename)[0] + \".html\")\n print(f\"- writing {html_path}\")\n with open(html_path, 'w') as f:\n f.write(body)","def remove_html( html):\n return html2txt(html)","def _save_book_detail(self, book_dict, book_nmb):\n content = self._get_book_content(book_dict['book_page_href'])\n with open(f'{PATH_TO_DATA}/{book_nmb}.html', 'w') as file:\n file.write(content)","def export_notebook():\n #system(\"jupyter nbconvert --to HTML \\\"Look At Enron data set.ipynb\\\"\")\n system(\"jupyter nbconvert --to HTML --output=Look+At+Enron+data+set.html \\\"Look At Enron data set.ipynb\\\"\")\n return","def get_help_content(burl):\n\n box_content = ''+\\\n '<div class=\"box-top\">' +\\\n ' <div class=\"row\">'+\\\n ' <div class=\"col-lg-12 col-md-12 col-sm-12 col-xs-12\">'+\\\n ' <div class=\"box-part rounded sa-center-content\" style=\"'+\\\n theme_return_this('', 'border-style:solid; border-width:thin; border-color:#343a40;') +'\">'+\\\n get_help_tabs(burl) +\\\n ' </div>'+\\\n ' </div>'+\\\n ' </div>'+\\\n '</div>'\n return box_content","def read_from_clipboard():\n\n return pyperclip.paste()","def paste(*_, **settings):\n\n hook_exceptions()\n return app","def _CreateClipboardImage( self ):\n bmap = None\n\n fd, name = tempfile.mkstemp( '.png' )\n try:\n os.close( fd )\n if self.CreatePrintImage( name ):\n bmap = wx.Image( name, wx.BITMAP_TYPE_PNG ).ConvertToBitmap()\n finally:\n os.remove( name )\n\n return bmap","def __html__(self) -> str:\n components = [\n self.attributee_html,\n self.linked_title if self.title else 'untitled document',\n self.date.string if self.date else '',\n self.descriptive_phrase,\n f'archived in {self.collection}' if self.collection else '',\n ]\n return self.components_to_html(components)"],"string":"[\n \"def make_backup(filename, html):\\n\\n with open(filename, 'wb') as f:\\n f.write(html)\",\n \"def write_to_paste_buffer(txt):\\n pyperclip.copy(txt)\",\n \"def clipboard(self, text = None):\\n if text == None:\\n response = self._fetch_json('/api/clipboard')\\n return response['content']\\n else:\\n postdata = codecs.encode(json.dumps({ 'content': text }), 'utf-8')\\n self._urlopen('/api/clipboard', postdata).read()\",\n \"def _get_paste_page_content(self, url):\\n paste_raw_url = self._get_post_url(url)\\n paste_content = self._make_request(paste_raw_url, to_json=False)\\n return paste_content.text\",\n \"def publish_html(self, readyhtml):\\n with open(self.outfile,'w') as f_out:\\n f_out.writelines(readyhtml)\",\n \"def copy(to_end=False):\\n # Find a way to generalize this for different systems\\n if to_end:\\n with open('/Users/john/Terminal Saved Output', 'r') as f:\\n output = f.read().replace('bpython', 'Python')\\n code = output.split('\\\\nPython')[-1]\\n else:\\n code = pyperclip.paste()\\n pyperclip.copy(parse_code(code))\\n return None\",\n \"def save_clipboard(dist):\\n tmpimg = ImageGrab.grabclipboard()\\n if tmpimg:\\n tmpimg.save(dist, 'PNG', compress_level=9)\\n return dist\\n return ''\",\n \"def do_copy_button( self, event ):\\n #rint( \\\" do_copy_button -- this is all \\\")\\n data = self.msg_text.get( 1.0, Tk.END )\\n pyperclip.copy( data )\",\n \"def run_paste(self, expanded, unexpanded) :\\n\\t\\tif expanded :\\n\\t\\t\\treturn self.errormessage(\\\"Doesn't need any argument\\\")\\n\\t\\tif not self.HasPerms(self.__context, 'View management screens') :\\n\\t\\t\\treturn -1\\n\\t\\tif not hasattr(self, '_clipboard') :\\n\\t\\t\\treturn self.errormessage(\\\"Clipboard is empty\\\")\\n\\t\\ttry :\\n\\t\\t\\tself.__context.manage_pasteObjects(cb_copy_data = self._clipboard)\\n\\t\\t\\tself.htmlmessage(\\\"Clipboard's content pasted into %s\\\" % self.getcwd())\\n\\t\\texcept CopyError :\\n\\t\\t\\treturn self.errormessage(\\\"Impossible to paste clipboard's content into %s\\\" % self.getcwd())\",\n \"def scrape_paste(self,paste_id):\\n parameter = {'i': paste_id}\\n r = requests.get('https://scrape.pastebin.com/api_scrape_item.php',params=parameter)\\n return r.text\",\n \"def exportHtmlFile(self):\\n\\n fileName = QtGui.QFileDialog.getSaveFileName(None,\\\"Save html file\\\", os.getenv('HOME'))\\n if fileName:\\n fileName += \\\".html\\\"\\n #print ((\\\"Exporting: to \\\" + fileName))\\n filedata = \\\"<html>\\\\n<head>\\\\n<title>\\\" + self.settings['projectName'] + \\\"</title>\\\\n</head>\\\\n<body>\\\\n\\\"\\n #filedata += str(self.htmlResults.encode('utf-8'))\\n modData = \\\"\\\"\\n for c in self.htmlResults:\\n if ord(c) < 128:\\n modData += c\\n else:\\n modData += \\\"&#\\\" + str(ord(c)) + \\\";\\\"\\n filedata += modData\\n filedata += \\\"</body>\\\\n</html>\\\"\\n f = open(fileName, 'w')\\n f.write(filedata)\\n f.close()\\n self.log += \\\"Search Results exported to \\\" + fileName + \\\"\\\\n\\\"\\n QtGui.QMessageBox.information(None, \\\"Html file Export\\\", str(fileName) + \\\" exported\\\")\",\n \"def wonder():\\n copy()\\n get_soup()\\n get_text()\\n change_write_text()\\n Check_status_time_stamp()\",\n \"def clip_copy(num):\\n if g.browse_mode == \\\"ytpl\\\":\\n\\n p = g.ytpls[int(num) - 1]\\n link = \\\"https://youtube.com/playlist?list=%s\\\" % p['link']\\n\\n elif g.browse_mode == \\\"normal\\\":\\n item = (g.model.songs[int(num) - 1])\\n link = \\\"https://youtube.com/watch?v=%s\\\" % item.ytid\\n\\n else:\\n g.message = \\\"clipboard copy not valid in this mode\\\"\\n g.content = generate_songlist_display()\\n return\\n\\n if has_pyperclip:\\n\\n try:\\n pyperclip.copy(link)\\n g.message = c.y + link + c.w + \\\" copied\\\"\\n g.content = generate_songlist_display()\\n\\n except Exception as e:\\n xprint(link)\\n xprint(\\\"Error - couldn't copy to clipboard.\\\")\\n xprint(e.__doc__)\\n xprint(\\\"\\\")\\n input(\\\"Press Enter to continue.\\\")\\n g.content = generate_songlist_display()\\n\\n else:\\n g.message = \\\"pyperclip module must be installed for clipboard support\\\\n\\\"\\n g.message += \\\"see https://pypi.python.org/pypi/pyperclip/\\\"\\n g.content = generate_songlist_display()\",\n \"def clip(save, edit, browser, overwrite):\\n html = clipboard.get_clipboard_html()\\n if html is None:\\n click.echo('No html in the clipboard')\\n return\\n\\n if save is None:\\n content = html2md.html_to_markdown(html).strip()\\n click.echo(content)\\n return\\n\\n if not save.endswith('.md'):\\n click.echo('Note must have extension \\\".md\\\"')\\n return\\n\\n note = Note(save)\\n if os.path.exists(note.path.abs) and not overwrite:\\n click.echo('Note already exists at \\\"{}\\\" (specify `--overwrite` to overwrite)'.format(note.path.abs))\\n return\\n\\n html = parsers.rewrite_external_images(html, note)\\n content = html2md.html_to_markdown(html).strip()\\n note.write(content)\\n\\n if browser:\\n click.launch('http://localhost:{0}/{1}'.format(conf.PORT, note.path.rel))\\n\\n if edit:\\n click.edit(filename=note.path.abs)\",\n \"def direct_save():\\n c = ClipboardMemo()\\n c.save()\",\n \"def copy_to_clipboard(input):\\n #\\n # Define Tk Window and Prevent from Showing\\n #\\n root = tk.Tk()\\n root.withdraw()\\n #\\n # Clear Clipboard and Append Text\\n #\\n root.clipboard_clear()\\n root.clipboard_append(input)\",\n \"def exportBookmarksHtml(self, filePath=''):\\n if not filePath:\\n filePath = self.getFileName(_('TreeLine - Export HTML Bookmarks'),\\n 'html')\\n if not filePath:\\n return False\\n QtGui.QApplication.setOverrideCursor(QtCore.Qt.WaitCursor)\\n if ExportDialog.exportWhat == ExportDialog.entireTree:\\n self.selectedNodes = [self.rootNode]\\n addBranches = ExportDialog.exportWhat != ExportDialog.selectNode\\n title = _bookmarkTitle\\n if len(self.selectedNodes) == 1 and addBranches:\\n title = self.selectedNodes[0].title()\\n self.selectedNodes = self.selectedNodes[0].childList\\n lines = ['<!DOCTYPE NETSCAPE-Bookmark-file-1>',\\n '<meta http-equiv=\\\"Content-Type\\\" content=\\\"text/html; '\\n 'charset=utf-8\\\">', '<title>{0}</title>'.format(title),\\n '<h1>{0}</h1>'.format(title)]\\n for node in self.selectedNodes:\\n lines.extend(node.exportHtmlBookmarks(addBranches))\\n with open(filePath, 'w', encoding='utf-8') as f:\\n f.writelines([(line + '\\\\n') for line in lines])\\n return True\",\n \"def copyToClipboard(copy_str):\\n\\tcopier = Tk()\\n\\t# keep the window from showing\\n\\tcopier.withdraw()\\n\\tcopier.clipboard_clear()\\n\\t# text saved to clipboard\\n\\tcopier.clipboard_append(copy_str)\\n\\tcopier.destroy()\",\n \"def from_clipboard(self):\\n for url in QApplication.clipboard().mimeData().urls():\\n src = url.path()\\n dst = os.path.join(self.current_location(), os.path.basename(src))\\n try:\\n if os.path.islink(src) or os.path.isfile(src):\\n copyfile(src, dst, overwrite=False)\\n elif os.path.isdir(src):\\n copytree(src, dst, overwrite=False)\\n except:\\n QMessageBox.critical(self, 'Error copying file/dir', traceback.format_exc())\",\n \"def _on_articles_copy_link(self, evt=None):\\n \\n # get selected articles\\n articles = self._articles_view.GetSelectedArticles()\\n if not articles:\\n return\\n \\n # format links\\n text = \\\"\\\"\\n for article in articles:\\n if article.doi:\\n text += \\\"http://dx.doi.org/%s\\\\n\\\" % article.doi\\n \\n # make text object for data\\n obj = wx.TextDataObject()\\n obj.SetText(text.strip())\\n \\n # paste to clipboard\\n if wx.TheClipboard.Open():\\n wx.TheClipboard.SetData(obj)\\n wx.TheClipboard.Close()\",\n \"async def paste(text: str) -> str:\\n\\n async with aiohttp.ClientSession() as aioclient:\\n post = await aioclient.post(\\\"https://hastebin.com/documents\\\", data=text)\\n if post.status == 200:\\n response = await post.text()\\n return f\\\"https://hastebin.com/{response[8:-2]}\\\"\\n\\n # Fallback bin\\n post = await aioclient.post(\\\"https://bin.drlazor.be\\\", data={\\\"val\\\": text})\\n if post.status == 200:\\n return post.url\",\n \"def convert_html():\\n return\",\n \"def exportHtmlSingle(self, filePath=''):\\n if not filePath:\\n filePath = self.getFileName(_('TreeLine - Export HTML'), 'html')\\n if not filePath:\\n return False\\n QtGui.QApplication.setOverrideCursor(QtCore.Qt.WaitCursor)\\n if ExportDialog.exportWhat == ExportDialog.entireTree:\\n self.selectedNodes = [self.rootNode]\\n outputGroup = treeoutput.OutputGroup(self.selectedNodes,\\n ExportDialog.includeRoot,\\n ExportDialog.exportWhat !=\\n ExportDialog.selectNode,\\n ExportDialog.openOnly, True)\\n outputGroup.addBlanksBetween()\\n outputGroup.addIndents()\\n outputGroup.addSiblingPrefixes()\\n outGroups = outputGroup.splitColumns(ExportDialog.numColumns)\\n htmlTitle = os.path.splitext(os.path.basename(filePath))[0]\\n indent = globalref.genOptions.getValue('IndentOffset')\\n lines = ['<!DOCTYPE html PUBLIC \\\"-//W3C//DTD HTML 4.01 '\\n 'Transitional//EN\\\">', '<html>', '<head>',\\n '<meta http-equiv=\\\"Content-Type\\\" content=\\\"text/html; '\\n 'charset=utf-8\\\">', '<title>{0}</title>'.format(htmlTitle),\\n '<style type=\\\"text/css\\\"><!--',\\n 'div {{margin-left: {0}em}}'.format(indent),\\n 'td {padding: 10px}', 'tr {vertical-align: top}',\\n '--></style>', '</head>', '<body>']\\n if ExportDialog.addHeader:\\n headerText = (globalref.mainControl.activeControl.printData.\\n formatHeaderFooter(True))\\n if headerText:\\n lines.append(headerText)\\n lines.extend(['<table>', '<tr><td>'])\\n lines.extend(outGroups[0].getLines())\\n for group in outGroups[1:]:\\n lines.append('</td><td>')\\n lines.extend(group.getLines())\\n lines.extend(['</td></tr>', '</table>'])\\n if ExportDialog.addHeader:\\n footerText = (globalref.mainControl.activeControl.printData.\\n formatHeaderFooter(False))\\n if footerText:\\n lines.append(footerText)\\n lines.extend(['</body>', '</html>'])\\n with open(filePath, 'w', encoding='utf-8') as f:\\n f.writelines([(line + '\\\\n') for line in lines])\\n return True\",\n \"def write_html(self, filename):\\n # todo: allow writing in split mode\\n html = self.to_html()\\n open(filename, 'wt').write(html)\\n print('Exported app to %r' % filename)\",\n \"def print_contents(browser, dest='~/.browser.html'):\\n import os\\n open(os.path.expanduser(dest), 'w').write(browser.contents)\",\n \"def _get_pastes_page_content(self):\\n url = self._get_post_list_url()\\n content = self._make_request(url, to_json=False)\\n return content.text\",\n \"def save(self, filename):\\n outfile = open(filename, \\\"w\\\")\\n outfile.write(self.html.encode('utf8'))\\n outfile.close()\",\n \"def paste(self, text):\\n if self.file is None:\\n return self.paste_to_stdout(text)\\n return self.paste_to_file(text)\",\n \"def __editPaste(self):\\n if QApplication.focusWidget() == e5App().getObject(\\\"Shell\\\"):\\n e5App().getObject(\\\"Shell\\\").paste()\\n else:\\n self.activeWindow().paste()\",\n \"def write(self,out):\\n with open( out, \\\"wb\\\") as fi:\\n fi.write(html.tostring(self.book))\",\n \"def __copyToClipboard(self):\\n itm = self.findList.selectedItems()[0]\\n if itm.parent():\\n fn = itm.parent().text(0)\\n else:\\n fn = itm.text(0)\\n \\n cb = QApplication.clipboard()\\n cb.setText(fn)\",\n \"async def pob(self, ctx):\\n if str(ctx.guild.id) in ctx.bot.server_config.conf and ctx.bot.server_config.conf[str(ctx.guild.id)]['disable_pastebin']:\\n return\\n paste_keys = pastebin.fetch_paste_key(ctx.message.content)\\n if not paste_keys: return\\n xml = None\\n paste_key = paste_keys[0]\\n try:\\n xml = await self.bot.loop.run_in_executor(None, pastebin.get_as_xml, paste_key)\\n except:\\n return\\n if not xml: return\\n stats = await self.bot.loop.run_in_executor(None, cache_pob_xml, xml, self.client)\\n await self.make_responsive_embed(stats, ctx)\",\n \"def save_raw_html(r):\\n raw_insert = {\\\"raw_html\\\": r}\\n raw_html.insert_one(raw_insert)\\n return None\",\n \"def outputHtml(s):\\n htmlFile.write(s + \\\"\\\\n\\\")\",\n \"def offline_copy(_export_path):\\n global export_path\\n export_path = _export_path\\n \\n # First, monkey patch the original config\\n main.NBCONFIG.protectect_dirs = []\\n main.NBCONFIG.protected_users = {}\\n main.NBCONFIG.edit_users = {}\\n \\n # Now monkey patch NBweb\\n main.REQUIRELOGIN = False\\n\\n pages = []\\n\\n # Copy and work all source files \\n for dirpath,dirnames,filenames in os.walk(NBCONFIG.source):\\n for dirname in dirnames[:]: # Iterate a copy since we will delete in place\\n if any(dirname.startswith(i) for i in ['.']):\\n dirnames.remove(dirname) # So we do not parse it later\\n continue\\n if dirname == '_scratch':\\n dirnames.remove(dirname) # So we do not parse it later\\n continue\\n \\n # Names\\n src_systemname = os.path.join(dirpath,dirname)\\n rootname = os.path.relpath(src_systemname,NBCONFIG.source) # No leading / though\\n dest_systemname = os.path.join(export_path,rootname)\\n \\n mkdir(rootname,isfile=False) # Will make the dir no matter what\\n \\n # Index\\n dest = os.path.join(export_path,rootname, 'index.html')\\n \\n # Exclusions.\\n if main.exclusion_check(utils.join('/',rootname +'/')):\\n with open(dest,'w',encoding='utf8') as FF:\\n FF.write('')\\n continue\\n \\n try:\\n html = main.main_route('/' + rootname + '/')\\n except HTTPError:\\n # Likely some additional resource in _NBweb\\n try:\\n os.rmdir(dest_systemname) # Should be empty\\n except OSError:\\n pass\\n os.symlink(src_systemname,dest_systemname)\\n continue\\n \\n \\n html = process_page(html,dest)\\n with open(dest,'w',encoding='utf8') as FF:\\n FF.write(html)\\n \\n # _all\\n dest = os.path.join(export_path,'_all',rootname, 'index.html')\\n mkdir(dest,isfile=True,isfull=True)\\n \\n html = main.allpage('/'+ rootname +'/')\\n html = process_page(html,dest)\\n with open(dest,'w',encoding='utf8') as FF:\\n FF.write(html)\\n \\n \\n # Loop each file\\n for filename in filenames:\\n if os.path.splitext(filename)[0] == 'index':\\n continue # Already made above\\n \\n # Names\\n src_systemname = os.path.join(dirpath,filename)\\n rootname = os.path.relpath(src_systemname,NBCONFIG.source) # No leading / though\\n dest_systemname = os.path.join(export_path,rootname)\\n \\n mkdir(rootname,isfile=True) # Will make the dir no matter what\\n try:\\n os.symlink(src_systemname,dest_systemname) \\n except OSError:\\n os.remove(dest_systemname)\\n os.symlink(src_systemname,dest_systemname)\\n \\n rootbasename,ext = os.path.splitext(rootname)\\n if ext in NBCONFIG.extensions:\\n dest = os.path.join(export_path,rootbasename + '.html')\\n try:\\n html = main.main_route(rootbasename + '.html')\\n except:\\n print('Issue with: {}'.format(rootname))\\n \\n html = process_page(html,dest)\\n \\n with open(dest,'w',encoding='utf8') as FF:\\n FF.write(html)\\n pages.append(rootbasename)\\n\\n ## Index pages\\n # Home page w/o blog\\n dest_systemname = os.path.join(export_path,'')\\n dest = os.path.join(export_path,'index.html')\\n \\n html0 = main.main_route('/',map_view=True)\\n \\n html = process_page(html0,dest)\\n with open(dest,'w',encoding='utf8') as FF:\\n FF.write(html)\\n\\n # Also write the sitemap\\n dest = os.path.join(export_path,'_sitemap/index.html')\\n mkdir('/_sitemap',isfile=False)\\n html = process_page(html0,dest)\\n with open(dest,'w',encoding='utf8') as FF:\\n FF.write(html)\\n \\n # _all\\n dest = os.path.join(export_path,'_all','index.html')\\n \\n html = main.allpage('/')\\n html = process_page(html,dest)\\n with open(dest,'w',encoding='utf8') as FF:\\n FF.write(html)\\n \\n ## Blog Pages\\n if len(NBCONFIG.blog_dirs) > 0:\\n blog_num = 0\\n while True:\\n dest = os.path.join(export_path,'_blog',unicode(blog_num),'index.html')\\n \\n try:\\n html = main.main_route('/',map_view=False,blog_num=blog_num)\\n except HTTPError:\\n break # At the last one\\n \\n mkdir(dest,isfile=True,isfull=True) \\n \\n html = process_page(html,dest)\\n with open(dest,'w',encoding='utf8') as FF:\\n FF.write(html)\\n blog_num += 1\\n # Make the home page. \\n dest = os.path.join(export_path,'index.html')\\n html = main.main_route('/',map_view=False,blog_num=0)\\n html = process_page(html,dest)\\n with open(dest,'w',encoding='utf8') as FF:\\n FF.write(html)\\n \\n ## Special Pages\\n make_random_forward(pages)\\n \\n # Tags\\n dest = os.path.join(export_path,'_tags/index.html')\\n mkdir(dest,isfile=True,isfull=True) \\n html = main.return_tags()\\n html = process_page(html,dest)\\n with open(dest,'w',encoding='utf8') as FF:\\n FF.write(html)\\n \\n # ToDos\\n dest = os.path.join(export_path,'_todo/index.html')\\n mkdir(dest,isfile=True,isfull=True) \\n html = main.return_todo()\\n html = process_page(html,dest)\\n with open(dest,'w',encoding='utf8') as FF:\\n FF.write(html)\\n \\n txt = main.return_todo_txt()\\n dest = os.path.join(export_path,'_todo/todo.txt')\\n with open(dest,'w',encoding='utf8') as FF:\\n FF.write(txt)\\n \\n # Galleries\\n cpsym( utils.join(NBCONFIG.scratch_path,'_galleries'),utils.join(export_path,'_galleries'))\\n \\n ## Clean up\\n for F in [utils.join(export_path,'_NBweb',a) for a in ['NBCONFIG.py','NBCONFIG.pyc','template.html']]:\\n try:\\n os.remove(F)\\n except:\\n pass\\n \\n # Make sure there are never any directory listings\\n for dirpath,dirnames,filenames in os.walk(export_path):\\n if 'index.html' not in filenames:\\n with open(utils.join(dirpath,'index.html'),'w',encoding='utf8') as F:\\n F.write('')\",\n \"def compose_blogger_html(args, title, posts, imgdata, online_videos):\\n for post in posts:\\n for media in post.medias:\\n if type(media) is PostImage:\\n if media.uri not in imgdata:\\n print('Image missing: ', media.uri)\\n else:\\n img_url, resized_url = imgdata[media.uri]\\n media.uri = img_url\\n media.resized_url = resized_url\\n elif type(media) is PostVideo:\\n if not online_videos:\\n print('Video missing: ', media.uri)\\n else:\\n media.iframe = online_videos[0]\\n del online_videos[0]\\n else:\\n assert False\\n\\n return print_html(args, posts, title, '', target='blogger')\",\n \"def copy_to_clipboard(self, txt):\\r\\n cmd = 'echo \\\"' + txt.strip() + '\\\"|clip'\\r\\n return subprocess.check_call(cmd, shell=True)\",\n \"def output_html(self, path):\\n if path is None:\\n return\\n import os\\n fout = codecs.open(os.path.abspath(path), 'w', encoding='utf-8')\\n fout.write('<html><body><table>')\\n for data in self.datas:\\n fout.write('<tr><td>%s</td><td>%s</td><td>%s</td></tr>' % (data['url'], data['title'], data['summary']))\\n self.datas.remove(data)\\n fout.write('</table></body></html>')\\n fout.close()\",\n \"def copy_raw_bibtex(self, entry_idx=None):\\n if entry_idx is None:\\n entry_idx = self.selector.get_selection()\\n else:\\n entry_idx = self.selector.select_by_index(entry_idx)\\n if not entry_idx:\\n self.visual.error(\\\"Need a selection to show raw bibtex of\\\")\\n return\\n\\n entries = self.get_current_entries()\\n entries_string = Writer.entries_to_bibtex_string(entries)\\n clipboard.copy(entries_string)\\n self.visual.message(f\\\"Copied raw bibtex content of {len(entries)} entries.\\\")\",\n \"def htmlDocContentDumpOutput(self, buf, encoding):\\n if buf is None: buf__o = None\\n else: buf__o = buf._o\\n libxml2mod.htmlDocContentDumpOutput(buf__o, self._o, encoding)\",\n \"def _on_articles_copy_summary(self, evt=None):\\n \\n # get selected articles\\n articles = self._articles_view.GetSelectedArticles()\\n if not articles:\\n return\\n \\n # format citations\\n text = \\\"\\\"\\n for article in articles:\\n text += article.format(\\\"[TI]\\\\n[AU]\\\\n[CI]\\\\n[DOIX]\\\\n\\\\n[AB]\\\\n\\\\n\\\")\\n \\n # make text object for data\\n obj = wx.TextDataObject()\\n obj.SetText(text.strip())\\n \\n # paste to clipboard\\n if wx.TheClipboard.Open():\\n wx.TheClipboard.SetData(obj)\\n wx.TheClipboard.Close()\",\n \"def copy_link(self):\\n try:\\n Clipboard.copy(self.url)\\n except:\\n self.ids.link.text=self.link_message\",\n \"def clipboard_copy(text):\\n result = subprocess.run(\\n # \\\"primary\\\" because \\\"clipboard\\\" doesn't seem to work for all apps\\n # you must paste with middle click\\n [\\\"xclip\\\", \\\"-selection\\\", \\\"primary\\\", \\\"-l\\\", \\\"1\\\"],\\n input=bytes(text, encoding=\\\"utf-8\\\")\\n )\\n if result.returncode == 0:\\n pass\\n else:\\n print(\\\"Error copying\\\")\",\n \"def extract(url, output):\\n click.echo(\\\"Start progress..\\\")\\n news = url.context\\n e = Extractor(news)\\n click.echo(\\\"Extract information..\\\")\\n try:\\n news_text = e.get_news()\\n except ExtractException as exception:\\n # we aren't showing traceback to user, just echoing error message\\n return click.echo(\\\"Page parsing error: %s\\\" % exception.args[0])\\n\\n with open(output, \\\"w\\\", encoding=\\\"utf-8\\\") as out_file:\\n # print(news_text, file=out_file, flush=True)\\n with click.progressbar(news_text, length=len(news_text.encode()),\\n label=\\\"Writing to file\\\") as bar:\\n for item in bar:\\n print(item, end='', file=out_file, flush=True)\\n\\n click.echo(\\\"Finished!\\\")\",\n \"def test_copy_details(self):\\n self.new_details.save_details()\\n twitter = Details('Dennis', 'Facebook', 'Kiplangat', 'kiplangat18')\\n twitter.save_details()\\n find_details = None\\n for details in Details.user_details_list:\\n find_details = Details.find_by_site_name(details.site_name)\\n return pyperclip.copy(find_details.password)\\n\\n Details.copy_details(self.new_details.site_name)\\n self.assertEqual('kiplangat18', pyperclip.paste())\\n print(pyperclip.paste())\",\n \"def copy_as_curl(self):\\n curl_headers = ''\\n for header, value in self.headers:\\n curl_headers += \\\"-H '{}: {}' \\\".format(header, value)\\n curl_data = ''\\n if self.operation in ('POST', 'PUT'):\\n curl_data = \\\"--data '{}' \\\".format(self.data)\\n curl_cmd = \\\"curl '{}' {} {}--compressed\\\".format(self.url.url(), curl_headers, curl_data)\\n QApplication.clipboard().setText(curl_cmd)\",\n \"def copy_to_clipboard(show_string, copy_string):\\n copy_command = \\\"echo %s | pbcopy\\\" % (copy_string)\\n print \\\"%s | bash='/bin/bash' param1='-c' param2='%s' terminal=false\\\" \\\\\\n % (show_string, copy_command)\",\n \"def copy_link(self):\\n try:\\n Clipboard.copy(self.url)\\n except(AttributeError):\\n self.ids.label.text = self.error_msg\",\n \"def htmlDocContentDumpFormatOutput(self, buf, encoding, format):\\n if buf is None: buf__o = None\\n else: buf__o = buf._o\\n libxml2mod.htmlDocContentDumpFormatOutput(buf__o, self._o, encoding, format)\",\n \"def export(self, package):\\n self.style = package.style\\n self.copyFiles(package)\\n self.html = self.renderHeader(package.name)\\n self.html += u\\\"<body>\\\\n\\\"\\n self.html += u\\\"<div id=\\\\\\\"content\\\\\\\">\\\\n\\\"\\n self.html += u\\\"<div id=\\\\\\\"header\\\\\\\">\\\\n\\\"\\n self.html += escape(package.title)\\n self.html += u\\\"</div>\\\\n\\\"\\n self.html += u\\\"<div id=\\\\\\\"main\\\\\\\">\\\\n\\\"\\n self.renderNode(package.root)\\n self.html += u\\\"</div>\\\\n\\\"\\n self.html += u\\\"</div>\\\\n\\\"\\n self.html += u\\\"</body></html>\\\\n\\\"\\n self.save(self.outputDir/\\\"index.html\\\")\",\n \"def process_page(html,dest):\\n html0 = html[:]\\n to_root = os.path.relpath(export_path,dest)\\n to_root = to_root[1:]# Change '../' or '..' to '.' or './'\\n \\n # Fix links to directories first since that is easier to find\\n html,N1 = re_dirlinks.subn(r'\\\\1=\\\"/\\\\2/index.html\\\"',html)\\n \\n # all pages links\\n html,N2 = re_all.subn(r'\\\\1=\\\"/_all/\\\\2/index.html\\\"',html)\\n \\n # Add index.html for any other internal links. NOTE: by preprocessing\\n # all internal links from the main content will already end in .html so this\\n # is just special pages.\\n for match in re_intlinks.finditer(html):\\n dest = match.groups()[-1]\\n ext = os.path.splitext(dest)[-1]\\n if ext == '':\\n old = r'{}=\\\"/{}\\\"'.format(*match.groups())\\n new = r'{}=\\\"/{}\\\"'.format(match.groups()[0], os.path.join(match.groups()[1],'index.html') )\\n html = html.replace(old,new)\\n \\n # Now make all links to the root\\n html,N3 = re_intlinks.subn(r'\\\\1=\\\"{}/\\\\2\\\"'.format(to_root),html)\\n \\n # Remove the search stuff\\n out = []\\n ff = False\\n for line in html.split('\\\\n'):\\n if not ff and '<!-- search -->' not in line:\\n out.append(line)\\n continue\\n \\n if '<!-- search -->' in line:\\n ff = True\\n \\n if ff and '<!-- /search -->' in line:\\n ff = False\\n\\n html = '\\\\n'.join(out)\\n return html\",\n \"def dump_html(self):\\n l_html = self.m_driver.find_element_by_xpath('//html').get_attribute('outerHTML')\\n with open(datetime.datetime.now().strftime('%Y%m%d_%H%M%S.html'), 'w') as f:\\n f.write(l_html)\",\n \"def toClipboard(self):\\n buf = io.BytesIO()\\n self.fig.savefig(buf, dpi=300, facecolor='w', format='png',\\n transparent=True)\\n QtGui.QApplication.clipboard().setImage(\\n QtGui.QImage.fromData(buf.getvalue()))\\n buf.close()\",\n \"def clipboard(self, data):\\n p = subprocess.Popen([\\\"xclip\\\", \\\"-selection\\\", \\\"clipboard\\\"], stdin=subprocess.PIPE)\\n p.stdin.write(data.encode())\\n p.stdin.close()\",\n \"def save(self):\\n html_file = '{}/{}.html'.format(self.web_dir, self.title)\\n f = open(html_file, 'wt')\\n f.write(self.doc.render())\\n f.close()\",\n \"def contentRaw(request):\\n paste = Paste.get(request.matchdict['idContent'])\\n # TODO type/mime\\n return paste.content\",\n \"def copy(self):\\r\\n ret=' '\\r\\n if self.REQUEST.SESSION.has_key('my_path'):\\r\\n\\t zpath=self.REQUEST.SESSION['my_path'].replace('toolbox_root','').strip('/')\\r\\n\\t #ret=zpath\\r\\n\\t if self.REQUEST.SESSION.has_key('copy_bild'):\\r\\n\\t\\t cp_bild=self.REQUEST.SESSION['copy_bild'].split('/')[-1].strip('/')\\r\\n\\t\\t cp_path=str('/').join(self.REQUEST.SESSION['copy_bild'].split('/')[0:-1])\\r\\n\\t\\t #ret+=' '+cp_path+' '+cp_bild\\r\\n\\t\\t if cp_path!=zpath:\\r\\n\\t\\t \\tn_id=search_id(self,self.restrictedTraverse(zpath).objectValues('Image'))\\r\\n\\t\\t \\t#ret+=' '+n_id\\r\\n\\t\\t\\tfor x in liste_val:\\r\\n\\t\\t\\t\\ttry:\\r\\n\\t\\t\\t\\t\\tfor obj in self.restrictedTraverse(cp_path).objectValues('Image'):\\r\\n\\t\\t\\t\\t\\t if str(obj.getId())[0:6]==cp_bild:\\r\\n\\t\\t\\t\\t\\t\\tmy_clip=self.restrictedTraverse(cp_path).manage_copyObjects([obj.getId()])\\r\\n\\t\\t\\t\\t\\t\\tcopied=self.restrictedTraverse(zpath).manage_pasteObjects(my_clip)\\r\\n\\t\\t\\t\\t\\t\\t#ret+=' new id : '+str(copied[0]['new_id'])\\r\\n\\t\\t\\t\\t\\t\\t#if str(copied[0]['new_id']).split('_')[0]!=n_id:\\r\\n\\t\\t\\t\\t\\t\\t#\\tself.restrictedTraverse(zpath).manage_renameObjects([str(copied[0]['new_id'])],[str(n_id+x)])\\r\\n\\t\\t\\t\\t\\t\\t\\t#ret +=' False '\\r\\n\\t\\t\\t\\t\\t\\t#ret+='<br>\\\\n'\\r\\n\\t\\t\\t\\texcept:\\r\\n\\t\\t\\t\\t\\tret+=''\\r\\n else:\\r\\n\\t ret=' '\\r\\n return ' '\",\n \"def _pasteFile(self) -> None:\\n if not self._fileClipboard:\\n return\\n cut = self._fileClipboard.pop()\\n filenames = [x.name for x in self._fileClipboard]\\n destPaths = [self._currPath.joinpath(x) for x in filenames]\\n try:\\n duplicates = []\\n for src, dest in zip(self._fileClipboard, destPaths):\\n if src == dest:\\n raise shutil.SameFileError\\n if dest in self._currPath.glob('*'):\\n duplicates.append(dest)\\n if duplicates:\\n if self._overwriteFileMsgBox(duplicates) == QMessageBox.Cancel:\\n self._fileClipboard.clear()\\n self._pasteFileAction.setEnabled(False)\\n return\\n for src, dest in zip(self._fileClipboard, destPaths):\\n if cut and src.is_file():\\n shutil.move(str(src), str(dest))\\n elif src.is_dir():\\n dir_util.copy_tree(str(src), str(dest))\\n if cut:\\n shutil.rmtree(src)\\n elif src.is_file():\\n shutil.copy(str(src), str(dest))\\n elif not src.exists():\\n raise FileNotFoundError\\n self._statusBar.showMessage('File pasted!', 3000)\\n self._fileClipboard.clear()\\n self._pasteFileAction.setEnabled(False)\\n except shutil.SameFileError:\\n self._statusBar.showMessage('You cannot overwrite the same file!', 3000)\\n self._fileClipboard.clear()\\n except PermissionError:\\n self._statusBar.showMessage('No permission to copy the file!', 3000)\\n self._fileClipboard.clear()\\n except FileNotFoundError:\\n self._statusBar.showMessage('Cannot find the source file!', 3000)\\n self._fileClipboard.clear()\\n finally:\\n self._listDirectories()\",\n \"def get_paste_buffer():\\n pb_str = pyperclip.paste()\\n\\n # If value returned from the clipboard is unicode and this is Python 2, convert to a \\\"normal\\\" Python 2 string first\\n if six.PY2 and not isinstance(pb_str, str):\\n import unicodedata\\n pb_str = unicodedata.normalize('NFKD', pb_str).encode('ascii', 'ignore')\\n\\n return pb_str\",\n \"def set_clipboard(content, *args, **kwargs):\\n G.DEVICE.set_clipboard(content, *args, **kwargs)\",\n \"def htmlDocContentDumpOutput(self, cur, encoding):\\n if cur is None: cur__o = None\\n else: cur__o = cur._o\\n libxml2mod.htmlDocContentDumpOutput(self._o, cur__o, encoding)\",\n \"def save(self, *args, **kwargs):\\n if not self.slug:\\n self.slug = '%02x' % random.getrandbits(256)\\n\\n lexer = get_lexer_by_name(self.language)\\n options = self.title and {'title': self.title} or {}\\n formatter = HtmlFormatter(style=self.style, linenos='table',\\n full=True, **options)\\n self.highlighted = highlight(self.code, lexer, formatter)\\n super(Paste, self).save(*args, **kwargs)\",\n \"def copy(self, event):\\n selection = self.get_selection()\\n if not selection:\\n return []\\n start_row, start_col, end_row, end_col = selection\\n data = u''\\n rows = range(start_row, end_row + 1)\\n for row in rows:\\n columns = range(start_col, end_col + 1)\\n for idx, column in enumerate(columns, 1):\\n if idx == len(columns):\\n # if we are at the last cell of the row, add new line instead\\n data += self.GetCellValue(row, column) + \\\"\\\\n\\\"\\n else:\\n data += self.GetCellValue(row, column) + \\\"\\\\t\\\"\\n text_data_object = wx.TextDataObject()\\n text_data_object.SetText(data)\\n if wx.TheClipboard.Open():\\n wx.TheClipboard.SetData(text_data_object)\\n wx.TheClipboard.Close()\\n else:\\n wx.MessageBox(\\\"Can't open the clipboard\\\", \\\"Warning\\\")\",\n \"def saveHtml(path: str, filename: str, html: str) -> None:\\n filepath = os.path.join(path, filename)\\n with open(filepath, \\\"w\\\") as fileHandle:\\n fileHandle.write(html)\\n return filepath\",\n \"def saveToFile(html):\\n #print(\\\"Saving to file.\\\")\\n html += \\\"\\\\n\\\"\\n #open necessary files to save\\n logFile = open(\\\"postLog_{0}_{1}.txt\\\".format(os.path.splitext(path)[0], dateTimeNow), \\\"a\\\")\\n logFile.write(html)\\n logFile.close()\\n #print(\\\"Check Point.\\\")\",\n \"def paste(cmd=paste_cmd, stdout=PIPE):\\n return Popen(cmd, stdout=stdout).communicate()[0].decode('utf-8')\",\n \"def save_page_as(browser, file_name):\\n\\n with open(file_name, \\\"w\\\") as fout:\\n fout.write(browser.find_element_by_tag_name(\\\"pre\\\").text)\",\n \"def write_paste_log(url):\\n with open('checked_pastes.txt', 'a') as paste_file:\\n paste_file.writelines(url+\\\"\\\\n\\\")\",\n \"def process_webpage(self, target, output_file, url, embed, selenium):\\n\\t\\t# Build the output file's name\\n\\t\\tself._build_output_file(output_file)\\n\\t\\t# Open the output file and clone the webpage\\n\\t\\twith open(self.output_file_name, \\\"w\\\") as output:\\n\\t\\t\\tself.collect_source(target, output, url, embed, selenium)\",\n \"def download_html_command():\\n # 1. Get input scan id from Demisto\\n scanid = demisto.args().get('scanid')\\n # 2. Get the forensic webpage HTML from SlashNext API\\n response = download_html(scanid=scanid)\\n if response.get('errorNo') != 0:\\n return\\n # 3. Parse and format the response\\n html_base64 = response.get('htmlData').get('htmlBase64')\\n html_data = base64.b64decode(html_base64)\\n\\n html_file = fileResult('slashnext_{}.html'.format(scanid), html_data, entryTypes['file'])\\n\\n demisto.results({\\n 'Type': entryTypes['file'],\\n 'ContentsFormat': formats['text'],\\n 'Contents': 'Forensics: Webpage HTML for URL Scan ID = {}'.format(scanid),\\n 'File': html_file.get('File'),\\n 'FileID': html_file.get('FileID')\\n })\",\n \"def save_current_nb_as_html(info=False):\\n assert in_ipynb()\\n\\n full_path = get_notebook_name()\\n path, filename = os.path.split(full_path)\\n\\n wd_save = os.getcwd()\\n os.chdir(path)\\n cmd = 'jupyter nbconvert --to html \\\"{}\\\"'.format(filename)\\n os.system(cmd)\\n os.chdir(wd_save)\\n\\n if info:\\n print(\\\"target dir: \\\", path)\\n print(\\\"cmd: \\\", cmd)\\n print(\\\"working dir: \\\", wd_save)\",\n \"def cli(ctx, resource, blog, relative_path, verbose):\\n ctx.verbose = verbose\\n validate_blog_and_settings(ctx, blog, relative_path)\\n export_path = resolve_export_path(ctx, relative_path)\\n\\n resource_map = {\\n \\\"design_assets\\\": copy_design_assets,\\n \\\"blog_template\\\": copy_blog_template,\\n \\\"blog_index\\\": copy_blog_index,\\n \\\"blog_config\\\": copy_blog_config,\\n \\\"blog_layout\\\": copy_blog_layout,\\n }\\n\\n transfer = resource_map.get(resource)\\n if not transfer:\\n ctx.log(\\\"No such resource. See blogger export --help\\\")\\n ctx.log(\\\"ERROR: INVALID RESOURCE NAME\\\")\\n raise SystemExit()\\n\\n ctx.vlog(\\\"Using function\\\", transfer)\\n transfer(ctx, export_path)\",\n \"def test_export_html(self):\\r\\n resp = self.client.get_html(self.url)\\r\\n self.assertEquals(resp.status_code, 200)\\r\\n self.assertContains(resp, \\\"Export My Course Content\\\")\",\n \"def htmlDocDump(self, f):\\n ret = libxml2mod.htmlDocDump(f, self._o)\\n return ret\",\n \"def dump(self, path, mode='standalone'):\\n if mode == 'standalone':\\n with open(path+\\\"/export_grid_standalone\\\"+str(self._id)+\\\".html\\\", 'w+') as f:\\n f.write(self.export_html(build=True))\\n elif mode == 'all':\\n widget_export = self.export_html(build=False)\\n with open(path+\\\"/export_scripts.html\\\", \\\"w+\\\") as f:\\n f.write(widget_export['script_tags'])\\n with open(path+\\\"/export_html_state.html\\\", \\\"w+\\\") as f:\\n f.write(widget_export['html_state'])\\n with open(path+\\\"/export_state_\\\"+str(self._id)+\\\".json\\\", \\\"w+\\\") as f:\\n f.write(json.dumps(widget_export['manager_state']))\\n with open(path+\\\"/export_grid_\\\"+str(self._id)+\\\".html\\\", \\\"w+\\\") as f:\\n f.write(widget_export['grid_div'])\",\n \"def _on_articles_copy_citation(self, evt=None):\\n \\n # get selected articles\\n articles = self._articles_view.GetSelectedArticles()\\n if not articles:\\n return\\n \\n # format citations\\n text = \\\"\\\"\\n for article in articles:\\n text += article.format(\\\"[TI]\\\\n[AU]\\\\n[CI]\\\\n[DOIX]\\\\n\\\\n\\\")\\n \\n # make text object for data\\n obj = wx.TextDataObject()\\n obj.SetText(text.strip())\\n \\n # paste to clipboard\\n if wx.TheClipboard.Open():\\n wx.TheClipboard.SetData(obj)\\n wx.TheClipboard.Close()\",\n \"def print_html(html):\\n display(HTML(html))\",\n \"def assemble(self, page):\\n html = self.include(page)\\n html = HTMLBeautifier.beautify(html, 4)\\n path = osp.join(self.dst, page)\\n with open(path, \\\"wt\\\") as fp:\\n fp.write(html)\",\n \"def save_trail_html(title, url):\\n r = requests.get(url).text\\n raw_insert = {'trail': title,\\n \\\"raw_html\\\": r}\\n trail_page_raw_html.insert_one(raw_insert)\\n return None\",\n \"def set_code(path, doc):\\n if path is None:\\n pasteboard.set(doc)\\n else:\\n with open(path, 'w', encoding='UTF-8') as html_file:\\n html_file.write(str(doc))\",\n \"def edit_html():\\n # save the new html_raw\\n entry = request.form.get(\\\"entry\\\")\\n entry_dict[entry]['html_raw'] = request.form.get(\\\"raw\\\")\\n entry_dict[entry]['html'] = raw_to_html(entry, entry_dict[entry]['html_raw'])\\n # save into pkl file\\n with open(entry_dict_path, 'wb') as pkl_file:\\n cPickle.dump(entry_dict, pkl_file)\\n # update the website\\n return jsonify(True)\",\n \"def __editCopy(self):\\n if QApplication.focusWidget() == e5App().getObject(\\\"Shell\\\"):\\n e5App().getObject(\\\"Shell\\\").copy()\\n else:\\n self.activeWindow().copy()\",\n \"def ReferencePhase2Clipboard (self, event) :\\n\\t\\tif wx.TheClipboard.Open() :\\n\\t\\t\\ttxt_data = str( self.GetReferencePhase()[0] )[1:-1]\\n\\t\\t\\twx.TheClipboard.SetData(wx.TextDataObject(txt_data)) \\n\\t\\t\\twx.TheClipboard.Close()\\n\\t\\telse :\\n\\t\\t\\twx.MessageBox(\\\"Unable to open the clipboard\\\", \\\"Error\\\")\",\n \"def ShowHTML(self, url):\\n import sys, os, urllib\\n if urllib.splittype(url)[0] is None: # just a file spec\\n if hasattr(sys, \\\"frozen\\\"):\\n fname = os.path.join(os.path.dirname(sys.argv[0]),\\n \\\"..\\\", \\\"docs\\\", \\\"sb_server\\\", url)\\n if not os.path.isfile(fname):\\n fname = os.path.join(os.path.dirname(sys.argv[0]), url)\\n else:\\n fname = os.path.join(os.path.dirname(__file__), \\\"docs\\\", url)\\n fname = os.path.abspath(fname)\\n if not os.path.isfile(fname):\\n self.ShowMessage(\\\"Can't find \\\"+url)\\n return\\n url = fname\\n SetWaitCursor(1)\\n os.startfile(url)\\n SetWaitCursor(0)\",\n \"def save_html(self, file_name=None, raw_html=True):\\n if raw_html:\\n with open(file_name or self.url_obj.file_path, 'wb') as fh:\\n fh.write(self.raw_html)\\n else:\\n self.lxml.getroottree().write(file_name or self.url_obj.file_path, method=\\\"html\\\")\",\n \"def htmlDocContentDumpFormatOutput(self, cur, encoding, format):\\n if cur is None: cur__o = None\\n else: cur__o = cur._o\\n libxml2mod.htmlDocContentDumpFormatOutput(self._o, cur__o, encoding, format)\",\n \"def create_full_batter_html(url):\\n # raw_batter_list = scrape_razzball_batters(url)\\n raw_batter_list = fantasy_pro_players(url)\\n return create_full_batter(raw_batter_list)\",\n \"def copy_text(self):\\n self.window.clipboard_clear()\\n if self.tab_control.index(\\\"current\\\") == 0:\\n try:\\n self.text = self.textbox.get(\\\"sel.first\\\", \\\"sel.last\\\")\\n except tk.TclError:\\n self.text = self.textbox.get(\\\"1.0\\\", tk.END)\\n self.window.clipboard_append(self.text)\\n elif self.tab_control.index(\\\"current\\\") == 1:\\n self.window.clipboard_append(self.words)\",\n \"def paste_text(text, language=\\\"text\\\", paste_expire=8640, paste_user=\\\"paste.py\\\",\\n return_link=True):\\n # costruct url\\n data = {\\\"paste_data\\\": text,\\n \\\"paste_lang\\\": language,\\n \\\"api_submit\\\": \\\"true\\\",\\n \\\"mode\\\": \\\"json\\\",\\n \\\"paste_user\\\": paste_user,\\n \\\"paste_expire\\\": paste_expire\\n }\\n try:\\n with contextlib.closing(urllib2.urlopen(PASTE_BASE_URL, urllib.urlencode(data))) as query:\\n id = json.loads(query.read(), object_hook=Struct).result.id\\n return PASTE_BASE_URL + id if return_link else id\\n except urllib2.HTTPError as e:\\n print(\\\"Error uploading file:\\\")\\n print(e.reason)\",\n \"def _copy_to_clipboard_ctrl(self):\\n res = \\\"\\\"\\n clipboard = QtWidgets.QApplication.clipboard()\\n proxies = self._get_table()\\n for proxy in proxies:\\n res += str(proxy) + \\\"\\\\n\\\"\\n clipboard.clear(mode=clipboard.Clipboard)\\n clipboard.setText(res, mode=clipboard.Clipboard)\",\n \"def saveCopyCurrentEditor(self):\\n aw = self.activeWindow()\\n self.saveCopyEditorEd(aw)\",\n \"def write_html(self):\\n html_exporter = HTMLExporter(template_file=os.path.join(config[\\\"templates_dir\\\"], \\\"notebook.tpl\\\"))\\n for nb in self.notebooks:\\n (body, resources) = html_exporter.from_notebook_node(nb.content)\\n body = re.sub('{github_user_name}', config[\\\"github_user_name\\\"], body)\\n body = re.sub('{github_repo_name}', config[\\\"github_repo_name\\\"], body)\\n html_path = os.path.join(self.dst_dir, os.path.splitext(nb.filename)[0] + \\\".html\\\")\\n print(f\\\"- writing {html_path}\\\")\\n with open(html_path, 'w') as f:\\n f.write(body)\",\n \"def remove_html( html):\\n return html2txt(html)\",\n \"def _save_book_detail(self, book_dict, book_nmb):\\n content = self._get_book_content(book_dict['book_page_href'])\\n with open(f'{PATH_TO_DATA}/{book_nmb}.html', 'w') as file:\\n file.write(content)\",\n \"def export_notebook():\\n #system(\\\"jupyter nbconvert --to HTML \\\\\\\"Look At Enron data set.ipynb\\\\\\\"\\\")\\n system(\\\"jupyter nbconvert --to HTML --output=Look+At+Enron+data+set.html \\\\\\\"Look At Enron data set.ipynb\\\\\\\"\\\")\\n return\",\n \"def get_help_content(burl):\\n\\n box_content = ''+\\\\\\n '<div class=\\\"box-top\\\">' +\\\\\\n ' <div class=\\\"row\\\">'+\\\\\\n ' <div class=\\\"col-lg-12 col-md-12 col-sm-12 col-xs-12\\\">'+\\\\\\n ' <div class=\\\"box-part rounded sa-center-content\\\" style=\\\"'+\\\\\\n theme_return_this('', 'border-style:solid; border-width:thin; border-color:#343a40;') +'\\\">'+\\\\\\n get_help_tabs(burl) +\\\\\\n ' </div>'+\\\\\\n ' </div>'+\\\\\\n ' </div>'+\\\\\\n '</div>'\\n return box_content\",\n \"def read_from_clipboard():\\n\\n return pyperclip.paste()\",\n \"def paste(*_, **settings):\\n\\n hook_exceptions()\\n return app\",\n \"def _CreateClipboardImage( self ):\\n bmap = None\\n\\n fd, name = tempfile.mkstemp( '.png' )\\n try:\\n os.close( fd )\\n if self.CreatePrintImage( name ):\\n bmap = wx.Image( name, wx.BITMAP_TYPE_PNG ).ConvertToBitmap()\\n finally:\\n os.remove( name )\\n\\n return bmap\",\n \"def __html__(self) -> str:\\n components = [\\n self.attributee_html,\\n self.linked_title if self.title else 'untitled document',\\n self.date.string if self.date else '',\\n self.descriptive_phrase,\\n f'archived in {self.collection}' if self.collection else '',\\n ]\\n return self.components_to_html(components)\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.5765858","0.56113607","0.55505186","0.55185163","0.54795206","0.5450024","0.5427715","0.54080874","0.5321129","0.5313652","0.52682567","0.52502394","0.52400166","0.5201354","0.5193638","0.51862955","0.51706195","0.51384276","0.5110709","0.51039314","0.50777346","0.50516135","0.5049289","0.5045748","0.50399256","0.5038537","0.50320333","0.50315464","0.50192195","0.5017713","0.5015303","0.49910522","0.49899396","0.4975696","0.49301708","0.49295437","0.49287626","0.49238238","0.48951623","0.48802155","0.4878112","0.48772863","0.48728707","0.4862285","0.48567897","0.4851482","0.48510426","0.4845891","0.4826378","0.48261222","0.48069593","0.47996047","0.47963637","0.47725597","0.47696292","0.4719436","0.47084716","0.4704344","0.46999788","0.4699498","0.4697988","0.46959165","0.46952295","0.46871516","0.46869463","0.46794647","0.46754578","0.46743247","0.46629965","0.46565866","0.4654243","0.46472007","0.46321294","0.46137992","0.46097672","0.46054712","0.4605299","0.45858222","0.45816666","0.45787","0.45783478","0.4575048","0.45635816","0.45632213","0.45549494","0.4554627","0.4552195","0.45467612","0.45423475","0.45394534","0.4531241","0.45263818","0.4525857","0.45255804","0.45190412","0.45119485","0.4510758","0.45053062","0.44992852","0.44991896"],"string":"[\n \"0.5765858\",\n \"0.56113607\",\n \"0.55505186\",\n \"0.55185163\",\n \"0.54795206\",\n \"0.5450024\",\n \"0.5427715\",\n \"0.54080874\",\n \"0.5321129\",\n \"0.5313652\",\n \"0.52682567\",\n \"0.52502394\",\n \"0.52400166\",\n \"0.5201354\",\n \"0.5193638\",\n \"0.51862955\",\n \"0.51706195\",\n \"0.51384276\",\n \"0.5110709\",\n \"0.51039314\",\n \"0.50777346\",\n \"0.50516135\",\n \"0.5049289\",\n \"0.5045748\",\n \"0.50399256\",\n \"0.5038537\",\n \"0.50320333\",\n \"0.50315464\",\n \"0.50192195\",\n \"0.5017713\",\n \"0.5015303\",\n \"0.49910522\",\n \"0.49899396\",\n \"0.4975696\",\n \"0.49301708\",\n \"0.49295437\",\n \"0.49287626\",\n \"0.49238238\",\n \"0.48951623\",\n \"0.48802155\",\n \"0.4878112\",\n \"0.48772863\",\n \"0.48728707\",\n \"0.4862285\",\n \"0.48567897\",\n \"0.4851482\",\n \"0.48510426\",\n \"0.4845891\",\n \"0.4826378\",\n \"0.48261222\",\n \"0.48069593\",\n \"0.47996047\",\n \"0.47963637\",\n \"0.47725597\",\n \"0.47696292\",\n \"0.4719436\",\n \"0.47084716\",\n \"0.4704344\",\n \"0.46999788\",\n \"0.4699498\",\n \"0.4697988\",\n \"0.46959165\",\n \"0.46952295\",\n \"0.46871516\",\n \"0.46869463\",\n \"0.46794647\",\n \"0.46754578\",\n \"0.46743247\",\n \"0.46629965\",\n \"0.46565866\",\n \"0.4654243\",\n \"0.46472007\",\n \"0.46321294\",\n \"0.46137992\",\n \"0.46097672\",\n \"0.46054712\",\n \"0.4605299\",\n \"0.45858222\",\n \"0.45816666\",\n \"0.45787\",\n \"0.45783478\",\n \"0.4575048\",\n \"0.45635816\",\n \"0.45632213\",\n \"0.45549494\",\n \"0.4554627\",\n \"0.4552195\",\n \"0.45467612\",\n \"0.45423475\",\n \"0.45394534\",\n \"0.4531241\",\n \"0.45263818\",\n \"0.4525857\",\n \"0.45255804\",\n \"0.45190412\",\n \"0.45119485\",\n \"0.4510758\",\n \"0.45053062\",\n \"0.44992852\",\n \"0.44991896\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.6119939"},"document_rank":{"kind":"string","value":"0"}}},{"rowIdx":6089,"cells":{"query":{"kind":"string","value":"For testing identity between a diary file and the fle obtained after reading and printing it. See testing."},"document":{"kind":"string","value":"def idempotence(args):\n title, posts = parse_markdown(os.path.join(args.root, 'index.md'))\n print_markdown(posts, title, os.path.join(args.dest, 'index.md'))"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["def _test_example_eda_adf():\n main([\"pnictogen/repo/split.ADF.in\", \"data/water-dimer.xyz\"])\n assert_equals(\n open(\"data/water-dimer_eda.in\").read(),\n \"\"\"TITLE data/water-dimer.xyz eda\n\nCHARGE 0 0\n\nNumber of atoms\n 6\n\nATOMS Cartesian\nO 0.12908 -0.26336 0.64798 f=f1\nH 0.89795 0.28805 0.85518 f=f1\nH 0.10833 -0.20468 -0.33302 f=f1\nO 0.31020 0.07569 -2.07524 f=f2\nH -0.26065 0.64232 -2.62218 f=f2\nH 0.64083 -0.57862 -2.71449 f=f2\nEnd\n\nFragments\n f1 data/water-dimer_f1.t21\n f2 data/water-dimer_f2.t21\nEnd\n\nBasis\nEnd\n\nGeometry\nEnd\n\n\"\"\",\n )\n assert_equals(\n open(\"data/water-dimer_f1.in\").read(),\n \"\"\"TITLE data/water-dimer.xyz f1\n\nCHARGE 0 0\n\nNumber of atoms\n 3\n\nATOMS Cartesian\nO 0.12908 -0.26336 0.64798\nH 0.89795 0.28805 0.85518\nH 0.10833 -0.20468 -0.33302\nEnd\n\nBasis\nEnd\n\nGeometry\nEnd\n\n\"\"\",\n )\n assert_equals(\n open(\"data/water-dimer_f2.in\").read(),\n \"\"\"TITLE data/water-dimer.xyz f2\n\nCHARGE 0 0\n\nNumber of atoms\n 3\n\nATOMS Cartesian\nO 0.31020 0.07569 -2.07524\nH -0.26065 0.64232 -2.62218\nH 0.64083 -0.57862 -2.71449\nEnd\n\nBasis\nEnd\n\nGeometry\nEnd\n\n\"\"\",\n )","def identify_file(self, file):","def test_is_delicious_file(self):\r\n good_file = self._get_del_file()\r\n\r\n self.assertTrue(\r\n DelImporter.can_handle(good_file),\r\n \"DelImporter should handle this file\")\r\n\r\n good_file.close()","def test_Telegramfd (self):\n\t\t# This file is delivered openned while this test.\n\t\ttestfilepath = os.path.join (self.hotfolder, \"fileinuse.txt\")\n\t\tf = open(testfilepath,\"a\") #opens file with name of \"test.txt\"\n\t\tf.write(\"This file is now opened and i'm writting on it \\n\")\n\n\n\t\tknown_values = set ([\n\t\t\t('TESTS/Test3/Telegram Desktop/Printer output.pdf', '.file'),\n\t\t\t('TESTS/Test3/Telegram Desktop/This is a Zero avi file.avi', '.file'),\n\t\t\t('TESTS/Test3/Telegram Desktop/File not in use.CBR', '.file'),\n\t\t\t('TESTS/Test3/Telegram Desktop/This is a dummy rar file.rar', '.rar'),\n\t\t\t])\n\n\t\tEntries = MD.Telegramfd (self.hotfolder)\n\t\tself.assertEqual (known_values, set(Entries))\n\n\t\tf.close ()","def test_is_delicious_file(self):\r\n good_file = self._get_del_file()\r\n self.assertTrue(\r\n DelXMLImporter.can_handle(good_file),\r\n \"DelXMLImporter should handle this file\")\r\n good_file.close()","def test_get_infile(self):\r\n pass # not practically testable, but obvious file I/O\r","def test_fileinuse (self):\t\t\n\t\t# open a file:\n\t\ttestfilepath = os.path.join (self.testfolder, \"fileinuse.txt\")\n\t\tf = open(testfilepath,\"a\") #opens file with name of \"test.txt\"\n\t\tf.write(\"This file is now opened and i'm writting on it \\n\")\n\t\tself.assertEqual (MD.fileinuse(testfilepath), True) # Checks a file that it is beign written.\n\t\tself.assertEqual (MD.folderinuse(self.testfolder), True) # Checks if any file inside the folder is beign used.\n\t\tf.close()\n\t\tself.assertEqual (MD.fileinuse(testfilepath), False) # Cheks a file that it is closed.\n\t\tself.assertEqual (MD.folderinuse(self.testfolder), False)","def test_file_shizz(topic_path):\n\tL = [[1,2,3],[4,5,6]]\n\tprint(open(topic_path+'/D/'+str(L[1][0])+'.txt'))","def test_print_drug_info(self):\n\n pwd = self.get_script_path()\n fout1 = self.test_output_file\n fout2 = pwd+'/../insight_testsuite/tests/my_test/output/test_output_file_2.txt'\n print_drug_info(self.test_sorted_tuple, self.test_dict, self.test_num_unique_name, self.test_total_cost_each_drug, fout2, 2)\n self.assertTrue(filecmp.cmp(fout1, fout2))","def test_DL_import_equals_export(self):\n filepath = '2.txt'\n original_dl = flow_processing_input.DetectorsLocation(2021)\n original_dl.detectors_location_dict = createDLDataset(10).dataset\n original_dl.export_to_file(filepath)\n new_dl = flow_processing_input.DetectorsLocation(2021, filepath)\n os.remove(filepath)\n # Check if new_dl contains the same attributes as the original_dl\n self.assertTrue(new_dl == original_dl)\n # Check if new_dl is not equal to a different DL of same size\n random_dl = flow_processing_input.DetectorsLocation(2021)\n random_dl.detectors_location_dict = createDLDataset(10).dataset\n self.assertFalse(new_dl == random_dl)","def test_fid(self):\n g = h5g.create(self.fid, '/foobar')\n x = h5i.get_file_id(g)\n self.assertIsInstance(x, h5f.FileID)\n self.assertEqual(x, self.fid)\n self.assertEqual(h5i.get_ref(x), 1)","def test_DL_import_from_constructor(self):\n filepath = '7.txt'\n original_dl = flow_processing_input.DetectorsLocation(2021)\n original_dl.detectors_location_dict = createDLDataset(10).dataset\n original_dl.export_to_file(filepath)\n new_dl = flow_processing_input.DetectorsLocation(2021, filepath)\n os.remove(filepath)\n # Check if new_dl contains the same attributes as the original_dl\n self.assertTrue(new_dl == original_dl)","def test_fobj():\n Level3File(get_test_data('nids/Level3_FFC_N0Q_20140407_1805.nids'))","def test_read_file_from_disk(self):\r\n actual_data = read_file_from_disk(self.test_file1)\r\n self.assertEqual(self.test_file1_data, actual_data)","def test_is_not_delicious_file(self):\r\n bad_file = StringIO.StringIO()\r\n bad_file.write('failing tests please')\r\n bad_file.seek(0)\r\n\r\n self.assertTrue(\r\n not DelImporter.can_handle(bad_file),\r\n \"DelImporter cannot handle this file\")\r\n\r\n bad_file.close()","def test_get_db_list_from_file(): # ***Incomplete test\n ##########################\n # Arrange.\n infp = \"infp\"\n\n ##########################\n # Act.\n #x = get_db_list_from_file(infp)\n\n ##########################\n # Assert.\n assert True == True # ***Temporary.","def _test(self, file_name):\n data = bob.io.base.load(file_name)\n assert (_data == data).all()","def test_read_from_file():\n reading_file = d.read_code_from_file()\n assert type(reading_file) == list\n assert len(reading_file) == 7\n assert \"\\n\" not in d.read_code_from_file()","def testOneShow(self):\n\t\t# for line in self.file:\n\t\t# \tprint line\n\t\tline = self.file.readline()\n\t\tinfo = scrapeFilename( line )\n\t\tassert info['show'] == \"Chuck\"","def test_file_reader(self):\r\n a = list(file_reader(\"student_majors.txt\", 3, sep='|', header=True))\r\n\r\n b = [('123', 'Jin He', 'Computer Science'), ('234', 'Nanda Koka', 'Software Engineering'), \\\r\n ('345', 'Benji Cai', 'Software Engineering')]\r\n self.assertEqual(a, b)\r\n \r\n c = [(\"CWID\", \"Name\", \"Major\"), ('123', 'Jin He', 'Computer Science'), ('234', 'Nanda Koka', 'Software Engineering'), \\\r\n ('345', 'Benji Cai', 'Software Engineering')]\r\n self.assertNotEqual(a,c)","def test_printdiff(self):\n\n # Testing different string input options\n assert printdiff(self.data('arange.fits'),\n self.data('blank.fits')) is None\n assert printdiff(self.data('arange.fits'),\n self.data('blank.fits'), ext=0) is None\n assert printdiff(self.data('o4sp040b0_raw.fits'),\n self.data('o4sp040b0_raw.fits'),\n extname='sci') is None\n\n # This may seem weird, but check printdiff to see, need to test\n # incorrect second file\n with pytest.raises(IOError):\n printdiff('o4sp040b0_raw.fits', 'fakefile.fits', extname='sci')\n\n # Test HDU object inputs\n with fits.open(self.data('stddata.fits'), mode='readonly') as in1:\n with fits.open(self.data('checksum.fits'), mode='readonly') as in2:\n\n assert printdiff(in1[0], in2[0]) is None\n\n with pytest.raises(ValueError):\n printdiff(in1[0], in2[0], ext=0)\n\n assert printdiff(in1, in2) is None\n\n with pytest.raises(NotImplementedError):\n printdiff(in1, in2, 0)","def test_printdiff(self):\n\n # Testing different string input options\n assert printdiff(self.data(\"arange.fits\"), self.data(\"blank.fits\")) is None\n assert (\n printdiff(self.data(\"arange.fits\"), self.data(\"blank.fits\"), ext=0) is None\n )\n assert (\n printdiff(\n self.data(\"o4sp040b0_raw.fits\"),\n self.data(\"o4sp040b0_raw.fits\"),\n extname=\"sci\",\n )\n is None\n )\n\n # This may seem weird, but check printdiff to see, need to test\n # incorrect second file\n with pytest.raises(OSError):\n printdiff(\"o4sp040b0_raw.fits\", \"fakefile.fits\", extname=\"sci\")\n\n # Test HDU object inputs\n with fits.open(self.data(\"stddata.fits\"), mode=\"readonly\") as in1:\n with fits.open(self.data(\"checksum.fits\"), mode=\"readonly\") as in2:\n assert printdiff(in1[0], in2[0]) is None\n\n with pytest.raises(ValueError):\n printdiff(in1[0], in2[0], ext=0)\n\n assert printdiff(in1, in2) is None\n\n with pytest.raises(NotImplementedError):\n printdiff(in1, in2, 0)","def test_real_file(self):\n log.info('===== START TEST BYTE LOSS =====')\n\n # Recovered\n file_path = os.path.join(RESOURCE_PATH, '11079364_SNA_SNA.txt')\n\n stream_handle = open(file_path, MODE_ASCII_READ)\n\n self.create_parser(stream_handle, telem_flag=False)\n\n particles = self.parser.get_records(182)\n\n log.debug(\"*** test_real_file Num particles %s\", len(particles))\n\n # check all the values against expected results.\n self.assert_particles(particles, '11079364_SNA_SNA_recov.yml', RESOURCE_PATH)\n self.assertEquals(self.exception_callback_value, [])\n stream_handle.close()\n\n # Telemetered\n file_path = os.path.join(RESOURCE_PATH, '11079419_SNA_SNA.txt')\n\n stream_handle = open(file_path, MODE_ASCII_READ)\n\n self.create_parser(stream_handle)\n\n particles = self.parser.get_records(172)\n\n log.debug(\"*** test_real_file Num particles %s\", len(particles))\n\n # check all the values against expected results.\n self.assert_particles(particles, '11079419_SNA_SNA_telem.yml', RESOURCE_PATH)\n stream_handle.close()\n\n log.info('===== END TEST REAL FILE =====')","def testReadDataFile(self):\n try:\n blockNameList = []\n myReader = ParseCifSimple(self.__pathPdbxDataFile, False, 0, 255, \"?\", self.__logFileName)\n blockNameList = myReader.GetBlockNames(blockNameList)\n #\n for blockName in blockNameList:\n block = myReader.GetBlock(blockName)\n tableNameList = []\n tableNameList = block.GetTableNames(tableNameList)\n for tableName in tableNameList:\n table = block.GetTable(tableName)\n columnNameList = table.GetColumnNames()\n logger.debug(\"Table %s colunms %r\", tableName, columnNameList)\n numRows = table.GetNumRows()\n rowList = []\n for iRow in range(0, numRows):\n row = table.GetRow(iRow)\n rowList.append(row)\n logger.debug(\"table %s row length %d\", tableName, len(rowList))\n except Exception as e:\n logger.exception(\"Failing with %s\", str(e))\n self.fail()","def test_handle_info_reading():\n bids_root = _TempDir()\n\n # read in USA dataset, so it should find 50 Hz\n raw = _read_raw_fif(raw_fname)\n\n # write copy of raw with line freq of 60\n # bids basename and fname\n bids_path = BIDSPath(subject='01', session='01',\n task='audiovisual', run='01',\n root=bids_root)\n suffix = \"meg\"\n bids_fname = bids_path.copy().update(suffix=suffix,\n extension='.fif')\n write_raw_bids(raw, bids_path, overwrite=True)\n\n # find sidecar JSON fname\n bids_fname.update(datatype=suffix)\n sidecar_fname = _find_matching_sidecar(bids_fname, suffix=suffix,\n extension='.json')\n\n # assert that we get the same line frequency set\n raw = read_raw_bids(bids_path=bids_path)\n assert raw.info['line_freq'] == 60\n\n # 2. if line frequency is not set in raw file, then ValueError\n raw.info['line_freq'] = None\n with pytest.raises(ValueError, match=\"PowerLineFrequency .* required\"):\n write_raw_bids(raw, bids_path, overwrite=True)\n\n # make a copy of the sidecar in \"derivatives/\"\n # to check that we make sure we always get the right sidecar\n # in addition, it should not break the sidecar reading\n # in `read_raw_bids`\n deriv_dir = op.join(bids_root, \"derivatives\")\n sidecar_copy = op.join(deriv_dir, op.basename(sidecar_fname))\n os.mkdir(deriv_dir)\n with open(sidecar_fname, \"r\", encoding='utf-8') as fin:\n sidecar_json = json.load(fin)\n sidecar_json[\"PowerLineFrequency\"] = 45\n _write_json(sidecar_copy, sidecar_json)\n raw = read_raw_bids(bids_path=bids_path)\n assert raw.info['line_freq'] == 60\n\n # 3. assert that we get an error when sidecar json doesn't match\n _update_sidecar(sidecar_fname, \"PowerLineFrequency\", 55)\n with pytest.raises(ValueError, match=\"Line frequency in sidecar json\"):\n raw = read_raw_bids(bids_path=bids_path)\n assert raw.info['line_freq'] == 55","def test_DL_import_wrong_file_unserialized(self):\n filepath = '6.txt'\n wrong_file = open(filepath, 'x')\n wrong_file.write(\"This is not a serialized detector flow data\")\n wrong_file.close()\n # Check if exception was raised for wrong serialization\n with self.assertRaises(Exception):\n flow_processing_input.DetectorsLocation(9999, filepath)\n os.remove(filepath)","def test_file_access():\n file = gff.GFFFile()\n entry_scaffold = (\"ab\", \"cd\", 1, 2, None, None, None, {\"Id\":\"foo\"})\n entry = (\"a\",) + entry_scaffold\n file.append(*entry)\n assert file[0] == entry\n file.append(*((\"b\",) + entry_scaffold))\n file.insert(1, *((\"c\",) + entry_scaffold))\n file[1] = (\"d\",) + entry_scaffold\n file.insert(3, *((\"e\",) + entry_scaffold))\n del file[2]\n assert [seqid for seqid, _, _, _, _, _, _, _, _ in file] \\\n == [\"a\", \"d\", \"e\", ]","def test_is_not_delicious_file(self):\r\n bad_file = StringIO.StringIO()\r\n bad_file.write('failing tests please')\r\n bad_file.seek(0)\r\n\r\n self.assertTrue(\r\n not DelXMLImporter.can_handle(bad_file),\r\n \"DelXMLImporter cannot handle this file\")\r\n\r\n bad_file.close()","def test_the_main_with_simple_yet_proper_file(self):\r\n assert the_main_function('test_proper_file.csv') == (['\\ufeffid', 'link'], [['1', 'abc.com'], ['2', 'gef.com']])","def idfreader1(fname, iddfile, theidf, conv=True, commdct=None, block=None):\n versiontuple = iddversiontuple(iddfile)\n # import pdb; pdb.set_trace()\n block, data, commdct, idd_index = readidf.readdatacommdct1(\n fname, iddfile=iddfile, commdct=commdct, block=block\n )\n if conv:\n convertallfields(data, commdct, block)\n # fill gaps in idd\n ddtt, dtls = data.dt, data.dtls\n if versiontuple < (8,):\n skiplist = [\"TABLE:MULTIVARIABLELOOKUP\"]\n else:\n skiplist = None\n nofirstfields = iddgaps.missingkeys_standard(commdct, dtls, skiplist=skiplist)\n iddgaps.missingkeys_nonstandard(block, commdct, dtls, nofirstfields)\n # bunchdt = makebunches(data, commdct)\n bunchdt = makebunches_alter(data, commdct, theidf, block)\n return bunchdt, block, data, commdct, idd_index, versiontuple","def test():\n from pylada.dftcrystal.functional import Functional\n from pylada.dftcrystal import Crystal\n from pylada.dftcrystal.parse import parse\n parsed = parse(string)\n structure = Crystal()\n structure.read_input(parsed['rutile']['CRYSTAL'])\n a = Functional()\n a.read_input(parsed)\n assert a.scfdir \n assert a.maxcycle == 300\n assert a.exchsize == 6937578\n # need structure otherwise parse can't find beginning of input.\n otherstring = a.print_input(structure=structure)\n otherparsed = parse(otherstring)\n b = Functional()\n b.read_input(otherparsed)\n assert otherstring == b.print_input(structure=structure)","def test_reader(self):\n default_list_file = GAMEBASE + \"/Lists/char-LIST.tex\"\n output = name_pdfs.read_names_file(default_list_file)\n self.assertIsInstance(output, dict)\n self.assertGreater(len(output), 0)\n # Check that the function returns a dict ✓\n # Of greater than length 0 ✓\n fname = \"\"\n for example in self.bad_filenames:\n with self.subTest(fname=example):\n with self.assertRaises(OSError):\n name_pdfs.read_names_file(fname)","def test_file_reader(self) -> None:\n result = [['123', 'Jin He', 'Computer Science'],\n ['234', 'Nanda Koka', 'Software Engineering'],\n ['345', 'Benji Cai', 'Software Engineering']]\n # file have header\n self.assertTrue(\n list(file_reader('C:/Users/Nidhi/Desktop/SEM3/810/HW08/student_majors.txt', 3, '|', True)) == result)\n # file without header\n self.assertFalse(\n list(file_reader('C:/Users/Nidhi/Desktop/SEM3/810/HW08/student_majors.txt', 3, '|')) == result)\n # More than 3 datafield\n with self.assertRaises(ValueError):\n list(file_reader(\n 'C:/Users/Nidhi/Desktop/SEM3/810/HW08/student_majors.txt', 4, '|', True))\n # file not found\n with self.assertRaises(FileNotFoundError):\n list(file_reader('abc.txt', 3, '|', True))","def test_open_ped_duplicate_person(self):\n \n self.temp.write('A B 0 0 1 1\\n')\n self.temp.write('A B 0 0 1 1\\n')\n self.temp.flush()\n \n with self.assertRaises(ValueError):\n open_ped(self.temp.name)","def _read_file(self):\n\n with open(self.file_name, 'rb') as f:\n new_test = struct.unpack('<l', f.read(8)[4:])[0]\n f.close()\n\n with open(self.file_name, 'rb') as f:\n old_test = struct.unpack('<h', f.read(6)[4:])[0]\n f.close()\n\n with open(self.file_name, 'rb') as f:\n other_test = struct.unpack('<l', f.read(20)[16:])[0]\n f.close()\n\n open_file = open(self.file_name, 'rb')\n\n if (other_test==202):\n raw = open_file.read(1236)[11:]\n self.model = '202'\n elif ((not new_test==102) and old_test==102):\n raw = open_file.read(1133)\n self.model = '102old'\n elif (new_test==102 and old_test==102):\n raw = open_file.read(1224)\n self.model = '102new'\n\n self.header = DpHeader(raw, self.model)\n\n self.data = DpData(open_file, \n self.model, \n self.header.interferogram_size, \n self.header.number_of_coadds, \n 2048*self.header.zero_fill,\n self.header.laser_wavelength_microns, \n self.header.dispersion_constant_xm,\n self.header.dispersion_constant_xb)\n\n open_file.close()","def test_identify_contents_1(self):\n Path(self.base_dir, \"new_dir\").mkdir()\n Path(self.base_dir, \"file1.txt\").touch()\n Path(self.base_dir, \".DS_Store\").touch()\n list_of_items = basic.identify_contents(self.base_dir, kind=\"file\")\n exp_num_items = 2\n self.assertEqual(len(list_of_items), exp_num_items)","def test_basic():\n f = Level3File(get_test_data('nids/Level3_FFC_N0Q_20140407_1805.nids', as_file_obj=False))\n assert f.metadata['prod_time'].replace(second=0) == datetime(2014, 4, 7, 18, 5)\n assert f.metadata['vol_time'].replace(second=0) == datetime(2014, 4, 7, 18, 5)\n assert f.metadata['msg_time'].replace(second=0) == datetime(2014, 4, 7, 18, 6)\n assert f.filename == get_test_data('nids/Level3_FFC_N0Q_20140407_1805.nids',\n as_file_obj=False)\n\n # At this point, really just want to make sure that __str__ is able to run and produce\n # something not empty, the format is still up for grabs.\n assert str(f)","def test_file(self):\n a = False\n if \"show()\" in open('attempt.py').read():\n a = True\n self.assertEquals(a,True)","def test_nonfile(self):\n self.assertEqual(None,readfiles.read_file(\"tests.txt))","def test_get_query_list_from_file(): # ***Incomplete test\n ##########################\n # Arrange.\n infp = \"infp\"\n\n ##########################\n # Act.\n #x = get_query_list_from_file(infp)\n\n ##########################\n # Assert.\n assert True == True # ***Temporary.","def test_read_identity(self):\n pass","def test_factory_gives_delicious(self):\r\n loc = os.path.dirname(__file__)\r\n del_file = os.path.join(loc, 'delicious.html')\r\n\r\n with open(del_file) as del_io:\r\n imp = Importer(del_io, username=u\"admin\")\r\n\r\n self.assertTrue(\r\n isinstance(imp, DelImporter),\r\n \"Instance should be a delimporter instance\")","def test_open_ped(self):\n \n self.temp.write('A B 0 0 1 1\\n')\n self.temp.flush()\n families = open_ped(self.temp.name)\n \n fam = Family('A')\n fam.add_person(Person('A', 'B', '0', '0', '1', '1'))\n \n self.assertEqual(families[0].nodes, fam.nodes)","def test_read_file():\n filename = 'sample'\n assert read_file(filename) == 'hello!\\n'","def diet_retrieve(file_name):\n with open(file_name, \"r\") as f:\n content = f.read()\n return print(content)","def test_call_infernal_test1_file_output(self):\r\n # do not collect results; check output files instead\r\n actual = self.infernal_test1_aligner(\r\n self.infernal_test1_input_fp, result_path=self.result_fp,\r\n log_path=self.log_fp)\r\n\r\n self.assertTrue(actual is None,\r\n \"Result should be None when result path provided.\")\r\n\r\n expected_aln = self.infernal_test1_expected_aln\r\n with open(self.result_fp) as result_f:\r\n actual_aln = Alignment.from_fasta_records(parse_fasta(\r\n result_f), DNA)\r\n self.assertEqual(actual_aln, expected_aln)","def load_patient_data():\n data_file = open(\"test_data.txt\", \"r\")\n still_finding_patients = True\n my_patients = []\n while still_finding_patients is True:\n name_line = next(data_file)\n if name_line != \"END\":\n name_line = name_line.split()\n fname = name_line[0]\n lname = name_line[1]\n age = next(data_file).strip()\n gender = next(data_file).strip().casefold()\n tsh_data = next(data_file)\n tsh_data = tsh_data.strip().split(\",\")\n tsh_data.remove(\"TSH\")\n new_patient = create_patient(fname, lname, age, gender, tsh_data)\n my_patients.append(new_patient)\n else:\n still_finding_patients = False\n data_file.close()\n return my_patients","def test_artemis_reader():\n _test_raw_reader(\n read_raw_artemis123,\n input_fname=short_hpi_1kz_fname,\n pos_fname=dig_fname,\n verbose=\"error\",\n )","def test_readfile(self):\n fname = os.path.join(self.datadir, 'monol_testA_E3-50_rebin4_gti') + \\\n HEN_FILE_EXTENSION\n command = \"{0}\".format(fname)\n\n hen.io.main(command.split())","def test_reader(file_dir,\n word2id_dict,\n label2id_dict,\n word_replace_dict,\n filename_feature=\"\"):\n word_dict_len = max(map(int, word2id_dict.values())) + 1\n label_dict_len = max(map(int, label2id_dict.values())) + 1\n\n def reader():\n \"\"\"\n the data generator\n \"\"\"\n index = 0\n for root, dirs, files in os.walk(file_dir):\n for filename in files:\n if not filename.startswith(filename_feature):\n continue\n for line in io.open(\n os.path.join(root, filename), 'r', encoding='utf8'):\n index += 1\n bad_line = False\n line = line.strip(\"\\n\")\n if len(line) == 0:\n continue\n seg_tag = line.rfind(\"\\t\")\n if seg_tag == -1:\n seg_tag = len(line)\n word_part = line[0:seg_tag]\n label_part = line[seg_tag + 1:]\n word_idx = []\n words = word_part\n for word in words:\n if ord(word) < 0x20:\n word = ' '\n if word in word_replace_dict:\n word = word_replace_dict[word]\n if word in word2id_dict:\n word_idx.append(int(word2id_dict[word]))\n else:\n word_idx.append(int(word2id_dict[\"OOV\"]))\n yield word_idx, words\n\n return reader","def test_checkForOldParents(self):\n f = open(\"Output.txt\", \"a+\")\n fam: Dict = {'F23':\n {'fam': 'F23', 'MARR': '14 FEB 1980', 'HUSB': 'I01', 'WIFE': 'I07',\n 'CHIL': ['I19', 'I26', 'I30']},\n 'F16': {'fam': 'F16', 'MARR': '12 DEC 2007'}}\n fam2: Dict = {'F23': {'fam': 'F23', 'MARR': '14 FEB 1980', 'HUSB': 'I01', 'WIFE': 'I07', 'CHIL': ['I19']}}\n\n ind1: Dict = {'I01': {'id': 'I01', 'name': 'Joe /Smith/', 'BIRT': '15 JUL 1900', 'sex': 'M', 'family': 'F23',\n 'DEAT': '31 DEC 2013'},\n 'I07': {'id': 'I07', 'name': 'Jennifer /Smith/', 'BIRT': '23 SEP 1902', 'sex': 'F',\n 'family': 'F23',\n 'DEAT': '31 DEC 2013'},\n 'I19': {'id': 'I19', 'name': 'Dick /Smith/', 'BIRT': '13 FEB 1999', 'sex': 'M', 'family': 'F23',\n 'DEAT': '31 DEC 2013'}}\n\n ind2: Dict = {'I01': {'id': 'I01', 'name': 'Joe /Smith/', 'BIRT': '15 JUL 1960', 'sex': 'M', 'family': 'F23',\n 'DEAT': '31 DEC 2013'},\n 'I07': {'id': 'I07', 'name': 'Jennifer /Smith/', 'BIRT': '23 SEP 1960', 'sex': 'F',\n 'family': 'F23'},\n 'I19': {'id': 'I19', 'name': 'Dick /Smith/', 'BIRT': '13 FEB 1981', 'sex': 'M', 'family': 'F23'},\n 'I26': {'id': 'I26', 'name': 'Jane /Smith/', 'BIRT': '13 FEB 1981', 'sex': 'F', 'family': 'F23'},\n 'I30': {'id': 'I30', 'name': 'Mary /Test/', 'BIRT': '13 FEB 1981', 'sex': 'F', 'family': 'F23'},\n 'I32': {'id': 'I32', 'name': 'Nick /Tary/', 'BIRT': '13 FEB 1981', 'sex': 'M', 'family': 'F23'},\n 'I44': {'id': 'I44', 'name': 'Cersi /Lanister/', 'BIRT': '13 FEB 1981', 'sex': 'F',\n 'family': 'F23'}}\n\n self.assertTrue(us.checkForOldParents(fam, ind2, f))\n self.assertFalse(us.checkForOldParents(fam2, ind1, f))","def test_read_delete(self):\n\n expected = \"Hello, World! This has been written by Fun Ilrys.\"\n File(\"hi\").write(expected)\n actual = File(\"hi\").read()\n\n self.assertEqual(expected, actual)\n\n expected = False\n File(\"hi\").delete()\n actual = PyFunceble.path.isfile(\"hi\")\n\n self.assertEqual(expected, actual)","def test_identify_contents_2(self):\n Path(self.base_dir, \"new_dir\").mkdir()\n Path(self.base_dir, \"file1.txt\").touch()\n Path(self.base_dir, \".DS_Store\").touch()\n ignore_set = set([\".DS_Store\"])\n list_of_items = basic.identify_contents(self.base_dir, kind=\"file\",\n ignore_set=ignore_set)\n exp_num_items = 1\n self.assertEqual(len(list_of_items), exp_num_items)","def idfreader(fname, iddfile, conv=True):\n data, commdct, idd_index = readidf.readdatacommdct(fname, iddfile=iddfile)\n if conv:\n convertallfields(data, commdct)\n # fill gaps in idd\n ddtt, dtls = data.dt, data.dtls\n # skiplist = [\"TABLE:MULTIVARIABLELOOKUP\"]\n nofirstfields = iddgaps.missingkeys_standard(\n commdct, dtls, skiplist=[\"TABLE:MULTIVARIABLELOOKUP\"]\n )\n iddgaps.missingkeys_nonstandard(None, commdct, dtls, nofirstfields)\n bunchdt = makebunches(data, commdct)\n return bunchdt, data, commdct, idd_index","def test_call_requires_read_1_file(self):\r\n p = RtaxTaxonAssigner({\r\n 'reference_sequences_fp': self.reference_seqs_fp,\r\n 'id_to_taxonomy_fp': self.id_to_taxonomy_fp})\r\n\r\n # no read_1_seqs_fp passed results in AssertionError\r\n self.assertRaises(AssertionError, p, self.input_seqs_fp)","def test_GFD_import_equals_export(self):\n filepath = '2.txt'\n original_gfd = flow_processing_input.GroundFlowData()\n original_gfd.detector_flow_data = createGFDDataset(10).dataset\n original_gfd.export_to_file(filepath)\n new_gfd = flow_processing_input.GroundFlowData(filepath)\n os.remove(filepath)\n # Check if new_gfd contains the same attributes as the original_gfd\n self.assertTrue(new_gfd == original_gfd)\n # Check if new_gfd is not equal to a different gfd of same size\n random_gfd = flow_processing_input.GroundFlowData()\n random_gfd.detector_flow_data = createGFDDataset(10).dataset\n self.assertFalse(new_gfd == random_gfd)","def test_doubled_file():\n with contextlib.closing(get_test_data('Level2_KFTG_20150430_1419.ar2v')) as infile:\n data = infile.read()\n fobj = BytesIO(data + data)\n f = Level2File(fobj)\n assert len(f.sweeps) == 12","def test_DL_import_wrong_file_serialized(self):\n filepath = '5.txt'\n with open(filepath, 'wb') as file:\n pickle.dump([\"This is a wrong dataset\"], file)\n # Check if exception was raised for wrong data type\n with self.assertRaises(Exception):\n flow_processing_input.DetectorsLocation(9999, filepath)\n os.remove(filepath)","def main():\n print \"=\" * 78\n print \"%s %s\" % (__prog_name__, __version__)\n debug, input_file_names = check_cli()\n if not input_file_names:\n _error(\"No input file name found!\\n\\n%s\" % __help__)\n for input_file_name in input_file_names:\n print \"* Reading\", input_file_name\n file_base_name = os.path.splitext(os.path.basename(input_file_name))[0]\n file_dir_name = os.path.dirname(input_file_name)\n sections = {}\n tex_map = {}\n with open(input_file_name, 'rU') as in_fd:\n sections = get_sections(in_fd.read())\n\n if debug:\n write_dump_file(file_dir_name, file_base_name, \"sec\",\n {\"sections\": sections})\n\n if not sections:\n _error(\"Nothing could be read from '%s'.\\nIs this an Oolite .dat file?\" \\\n % input_file_name)\n\n # Magically call the 'check' functions\n for name in sections.keys():\n f_name = \"check_%s\" % name.lower()\n if f_name in globals().keys():\n if not globals()[f_name](sections):\n _error(\"Number of entries in '%s' section is different as declared!\" % name)\n\n def get_data(name, sections=sections):\n \"\"\"Returns the 'data' object from the 'name' one found in the\n 'sections' one.\n :sections: dictionary: Object returned by 'get_sections'.\n :name: string: The name of the section to get the 'data'.\n Returns a list of 'lines'.\n \"\"\"\n return sections.get(name, {}).get(\"data\", [])\n\n oti_file_name = build_file_path(file_dir_name, file_base_name, \"oti\")\n tex_map = parse_names(get_data(\"NAMES\"), oti_file_name)\n\n tex_refs, tex_lines_out = parse_textures(get_data(\"TEXTURES\"))\n\n if debug:\n write_dump_file(file_dir_name, file_base_name, \"tex\",\n {\"tex_refs\": tex_refs,\n \"tex_lines_out\": tex_lines_out})\n\n # Update the tex_map object if textures indexes and names are both\n # used in 'TEXTURES'.\n if sorted(tex_map.keys()) != sorted(tex_refs.get(\"named\").keys()):\n tex_map = update_tex_map(tex_map,\n set(tex_refs[\"named\"].keys()).difference(tex_map.keys()))\n\n if debug:\n write_dump_file(file_dir_name, file_base_name, \"txm\",\n {\"tex_map\": tex_map})\n\n n_verts, vertex_lines_out = parse_vertex(get_data(\"VERTEX\"))\n\n if debug:\n write_dump_file(file_dir_name, file_base_name, \"ver\",\n {\"n_verts\": n_verts,\n \"vertex_lines_out\": vertex_lines_out})\n\n n_normals, normals_lines_out = parse_normals(get_data(\"NORMALS\"))\n\n if debug:\n write_dump_file(file_dir_name, file_base_name, \"nor\",\n {\"n_normals\": n_normals,\n \"normals_lines_out\": normals_lines_out})\n\n n_faces, faces_groups = parse_faces(get_data(\"FACES\"), tex_refs,\n normals_lines_out)\n\n if debug:\n write_dump_file(file_dir_name, file_base_name, \"fac\",\n {\"n_faces\": n_faces,\n \"faces_groups\": faces_groups})\n\n output_file_name = build_file_path(file_dir_name,\n file_base_name, 'obj')\n material_file_name = build_file_path(file_dir_name,\n file_base_name, 'mtl')\n mtl_lib_file = os.path.basename(material_file_name)\n\n write_obj(output_file_name, file_base_name, mtl_lib_file,\n tex_lines_out, tex_map, n_verts, vertex_lines_out,\n n_normals, normals_lines_out, n_faces, faces_groups)\n\n write_mtl(material_file_name, tex_map)\n\n _exit(\"* Done\")","def test_file_analyzer(self):\r\n file_analyzer = FileAnalyzer(\"C:\\\\Users\\\\Himan\\\\Desktop\\\\Semester 2\\\\SSW 810\\\\HW\\\\Assignment 8\")\r\n self.assertEqual(file_analyzer.files_summary, {'HW08_Himanshu.py': {'class': 1, 'function': 5, 'line': 100, 'char': 4472}, \\\r\n 'HW08_Test_Himanshu.py': {'class': 1, 'function': 3, 'line': 38, 'char': 1861}})\r\n self.assertNotEqual(file_analyzer.files_summary, {'HW08_Himanshu.py': {'class': 0, 'function': 5, 'line': 46, 'char': 1931}})\r\n\r\n self.assertNotEqual(file_analyzer.files_summary, {'HW08_Himanshu.py': {'class': 1, 'function': 5, 'line': 100}}) # testing less fields\r\n\r\n with self.assertRaises(FileNotFoundError): # raises exception error\r\n FileAnalyzer(\"C:\\\\Users\\\\Himan\\\\Desktop\\\\Semester 2\\\\SSW 810\\\\HW\\\\Assignment 10\").files_summary","def test_hdf5_reader_dos(data_regression):\n from masci_tools.io.parsers.hdf5 import HDF5Reader\n from masci_tools.io.parsers.hdf5.recipes import FleurDOS\n\n TEST_BANDDOS_FILE = os.path.join(HDFTEST_DIR, 'banddos_dos.hdf')\n\n with open(TEST_BANDDOS_FILE, 'rb') as file:\n with HDF5Reader(file) as reader:\n data, attrs = reader.read(recipe=FleurDOS)\n\n data_regression.check({'datasets': convert_to_pystd(data), 'attributes': convert_to_pystd(attrs)})","def test_main(data, tmp_path):\n\n main(data, tmp_path)\n\n FILES = (\n \"gd32f888x(0-1)xx-pinctrl.h\",\n \"gd32f888x(2-3)xx-pinctrl.h\",\n \"gd32f888y(0-1)xx-pinctrl.h\",\n \"gd32f999x(0-1)xx-pinctrl.h\",\n \"gd32f999x(2-3)xx-pinctrl.h\",\n \"gd32f999y(0-1)xx-pinctrl.h\",\n )\n\n for file in FILES:\n ref_file = data / file\n gen_file = tmp_path / file\n\n assert gen_file.exists()\n\n with open(ref_file) as ref, open(gen_file) as gen:\n assert ref.read() == gen.read()","def test_GFD_import_from_constructor(self):\n filepath = '7.txt'\n original_gfd = flow_processing_input.GroundFlowData()\n original_gfd.detector_flow_data = createGFDDataset(10).dataset\n original_gfd.export_to_file(filepath)\n new_gfd = flow_processing_input.GroundFlowData(filepath)\n os.remove(filepath)\n # Check if new_gfd contains the same attributes as the original_gfd\n self.assertTrue(new_gfd == original_gfd)","def test_identify_contents_7(self):\n Path(self.base_dir, \"new_dir1\").mkdir()\n Path(self.base_dir, \"new_dir2\").mkdir()\n Path(self.base_dir, \"file1.txt\").touch()\n Path(self.base_dir, \".DS_Store\").touch()\n list_of_items = basic.identify_contents(self.base_dir, kind=\"invalid\")\n self.assertIsNone(list_of_items)","def test_whole_file(self):\n import soundfile\n import numpy as np\n\n data_file_path = \"sample-data/flacformats.d2\"\n expected_format = \"FLAC\"\n expected_subtype = \"PCM_24\"\n\n # Read the file using standard file I/O\n sf1 = soundfile.SoundFile(data_file_path)\n self.assertEqual(sf1.format, expected_format)\n self.assertEqual(sf1.subtype, expected_subtype)\n data1 = sf1.read()\n\n # Read the file using HTTP\n with open(data_file_path, \"rb\") as f:\n file_content = {\"/foo.dat\": f.read()}\n with DummyHTTPServer(file_content) as server:\n url = server.url(\"/foo.dat\")\n file2 = wfdb.io._url.openurl(url, \"rb\")\n sf2 = soundfile.SoundFile(file2)\n self.assertEqual(sf2.format, expected_format)\n self.assertEqual(sf2.subtype, expected_subtype)\n data2 = sf2.read()\n\n # Check that results are equal\n np.testing.assert_array_equal(data1, data2)","def testGetFile(self):\n try:\n remoteLocator = self.__pathPdbxDictionaryFile\n fn = self.__fileU.getFileName(remoteLocator)\n # _, fn = os.path.split(remoteLocator)\n lPath = os.path.join(self.__workPath, fn)\n ok = self.__fileU.get(remoteLocator, lPath)\n self.assertTrue(ok)\n ok = self.__fileU.exists(lPath)\n self.assertTrue(ok)\n ok = self.__fileU.isLocal(lPath)\n self.assertTrue(ok)\n tPath = self.__fileU.getFilePath(lPath)\n self.assertEqual(lPath, tPath)\n ok = self.__fileU.remove(lPath)\n self.assertTrue(ok)\n dPath = os.path.join(self.__workPath, \"tdir\")\n ok = self.__fileU.mkdir(dPath)\n self.assertTrue(ok)\n ok = self.__fileU.remove(dPath)\n self.assertTrue(ok)\n ok = self.__fileU.remove(\";lakdjf\")\n self.assertTrue(ok)\n\n except Exception as e:\n logger.exception(\"Failing with %s\", str(e))\n self.fail()","def sniff( self, filename ):\n handle = open(filename)\n line = handle.readline()\n handle.close()\n first = line.split()\n\n # 0 -> ID animal\n #read fixed effect\n i=1\n while (first[i].isalnum() and i<len(first)):\n i=i+1\n\n if ( i >= len(first) ):\n return False\n\n #read cov\n while ((i+1)<len(first) and not first[i+1].isalnum() ):\n i=i+1\n\n if ( i+1 >= len(first) ):\n return False\n\n #read trait\n while ((i+1)<len(first) and (i+2)<len(first) and not first[i].isalnum() and first[i+1].isalnum() and first[i+2].isalnum()):\n i=i+3\n\n if ( i != len(first) ):\n return False\n\n return True","def test_read_file_to_list():\n new_file = \"Hello,World\"\n data = race.read_file_to_list()\n assert type(data) == list\n for x in data:\n assert type(x) == dict\n assert len(data) == 33\n with pytest.raises(FileNotFoundError):\n Race(new_file).read_file_to_list()","def test_open_ped_mismatch(self):\n \n self.temp.write('A B 0 0 1 1\\n')\n self.temp.flush()\n families = open_ped(self.temp.name)\n \n fam = Family('A')\n fam.add_person(Person('A', 'B', '0', '0', '1', '1'))\n fam.add_person(Person('A', 'C', '0', '0', '1', '1'))\n \n self.assertNotEqual(families[0].nodes, fam.nodes)","def test_read():\n f = open('test', mode='r')\n line = f.read()\n f.close()","def test_two_files():\n\n out_file = ''.join(\n random.choices(string.ascii_uppercase + string.digits, k=5))\n try:\n if os.path.isfile(out_file):\n os.remove(out_file)\n\n rv, out = getstatusoutput(f'{prg} -f {tair} {amigo} -o {out_file}')\n assert rv == 0\n assert re.search('1: tair_heat.txt', out)\n assert re.search('2: amigo_heat.txt', out)\n assert re.search(\n f'Wrote 20 gene IDs from 2 files to file \"{out_file}\"', out)\n assert os.path.isfile(out_file)\n exp_two = '\\n'.join(\n sorted(\"\"\"\n AT5G12020 AT3G06400 AT2G33590 AT1G54050 AT5G67030 AT4G14690 AT1G16030 AT5G03720 AT3G10800 \n AT5G12140 AT1G64280 AT3G24500 AT3G09440 AT3G04120 AT4G19630 AT1G16540 AT2G22360 AT1G13930 \n AT5G41340 AT3G24520\n \"\"\".split()))\n assert open(out_file).read().strip() == exp_two.strip()\n\n finally:\n if os.path.isfile(out_file):\n os.remove(out_file)","def test_GFD_import_wrong_file_unserialized(self):\n filepath = '6.txt'\n wrong_file = open(filepath, 'x')\n wrong_file.write(\"This is not a serialized detector flow data\")\n wrong_file.close()\n # Check if exception was raised for wrong serialization\n with self.assertRaises(Exception):\n flow_processing_input.GroundFlowData(filepath)\n os.remove(filepath)","def test_get_file_accessors(self):\n pass","def test_get_file_object(self):\n pass","def test_fileobj_not_closed(self):\n\n f = open(self.data('test0.fits'), 'rb')\n data = fits.getdata(f)\n assert not f.closed\n\n f.seek(0)\n header = fits.getheader(f)\n assert not f.closed","def read(self):\n if self.getiddname() is None:\n errortxt = (\n \"IDD file needed to read the idf file. \"\n \"Set it using IDF.setiddname(iddfile)\"\n )\n raise IDDNotSetError(errortxt)\n readout = idfreader1(\n self.idfname, self.iddname, self, commdct=self.idd_info, block=self.block\n )\n (self.idfobjects, block, self.model, idd_info, idd_index, idd_version) = readout\n self.setidd(idd_info, idd_index, block, idd_version)","def test_nids_supplemental(fname, truth):\n f = Level3File(get_test_data(fname))\n assert f.metadata['delta_time'] == truth[0]\n assert f.metadata['supplemental_scan'] == truth[1]","def test_sanity_ati1():\n\n with Image.open(TEST_FILE_ATI1) as im:\n im.load()\n\n assert im.format == \"DDS\"\n assert im.mode == \"L\"\n assert im.size == (64, 64)\n\n assert_image_equal_tofile(im, TEST_FILE_ATI1.replace(\".dds\", \".png\"))","def F(f):\n return datafile(f, __name__)","def test_file_has_details(self):\n file_content = bytes(\n \"\"\"\n 1001 | Eggs | 12\\n\n 1002 | Bread | 1\\n\n 1003 | Butter | 1\\n\n 1004 | Milk | 1\\n\n 1005 | Corn | 2\n \"\"\", encoding='UTF-8'\n )\n\n test_file = SimpleUploadedFile(\n \"sample.txt\", file_content, content_type=\"text/txt\")\n \n new_file = File.objects.create(\n file=test_file,\n rows=5,\n items='Eggs, Bread, Butter, Milk, Corn'\n )\n\n file_details = File.objects.get(id=new_file.id)\n self.assertEqual(file_details.file.name, new_file.file.name)\n self.assertEqual(file_details.rows, new_file.rows)\n self.assertEqual(file_details.items, new_file.items)","def test_open_ped_header(self):\n \n self.temp.write('family_id person_id dad mom sex phenotype\\n')\n self.temp.write('A B 0 0 1 1\\n')\n self.temp.flush()\n families = open_ped(self.temp.name)\n \n fam = Family('A')\n fam.add_person(Person('A', 'B', '0', '0', '1', '1'))\n \n self.assertEqual(families[0].nodes, fam.nodes)","def OpenDosi(filename=None):\n\tglobal dosi, spacing_dosi, dim_x_dosi, dim_y_dosi, dim_z_dosi, dosi_open, isodose_show, origin_dosi, filename_dosi\n\tdosi_swapY,dosi_swapZ = False, False\n\n\ttypes = [('All files', '*.dcm *.mhd'), ('DCM files', '*.dcm'), ('MHD files', '*.mhd')]\n\n\tif(filename==None):\tfile_path = tkFileDialog.askopenfilename(initialdir = dir_ini, filetypes = types)\n\telse:\tfile_path = filename\n\n\tfilename_dosi = file_path\n\n\tprint('Opening RD file ...')\n\n\t### .dcm file ###\n\tif(file_path.endswith('.dcm')):\n\t\tds = pydicom.read_file(file_path)\n\t\tds.file_meta.TransferSyntaxUID = pydicom.uid.ImplicitVRLittleEndian \n\t\tscaling_dosi = float(ds.DoseGridScaling)\n\t\tdosi = scaling_dosi*ds.pixel_array\n\t\tsp = ds.PixelSpacing\n\t\tspacing_dosi = [ float(ds.GridFrameOffsetVector[1] - ds.GridFrameOffsetVector[0]), float(sp[1]),float(sp[0])]\n\t\torigin_dosi = ds.ImagePositionPatient\n\t\torigin_dosi = [float(origin_dosi[2]),float(origin_dosi[1]),float(origin_dosi[0])]\n\t\tdosi_swapZ =(ds.ImageOrientationPatient[0:3] == [1, 0, 0])\n dosi_swapY =(ds.ImageOrientationPatient[3:6] == [0, 1, 0])\n\n\t\t#if ds.SeriesDescription=='PatientLETScorer [MeV/mm/(g/cm3)]':\tSetIntensityRange(dosi,0,15)\n\n\t### .mhd file ###\n\tif(file_path.endswith('.mhd')):\t\n \t\titkimage = sitk.ReadImage(file_path) \t\t\t\t# Reads the image using SimpleITK\n \t\tdosi = sitk.GetArrayFromImage(itkimage)\n\t\tspacing_dosi = np.array(list(reversed(itkimage.GetSpacing()))) \t# Read the spacing along each dimension\n\t\torigin_dosi = np.array(list(reversed((itkimage.GetOrigin()))))\t\t# Read the origin\n\t\ttext_file = open(file_path, \"r\")\n\t\ttmp = text_file.readlines()\n\t\tdosi_swap = (tmp[8][-4:-1] == 'RAI')\n\n\tif(len(np.shape(volume))==3):\tdim_x_dosi, dim_y_dosi, dim_z_dosi = np.shape(dosi)[0], np.shape(dosi)[1], np.shape(dosi)[2]\n\n\tif(len(np.shape(volume))==2):\tdim_x_dosi, dim_y_dosi, dim_z_dosi = np.shape(dosi)[0], np.shape(dosi)[1], 1\n\n\t#print 'dosi type', dosi.dtype\n\t\n\t# Dealing with image orientation\n\tif(dosi_swapY == True):\n\t\tdosi = np.flip(dosi,1) # flip volume\n\t\torigin_dosi[1] = origin_dosi[1] + dim_y_dosi*spacing_dosi[1]\t\t\n\tif(dosi_swapZ == True):\n\t\tdosi = np.flip(dosi,2) # flip volume\n\t\torigin_dosi[2] = origin_dosi[2] + dim_z_dosi*spacing_dosi[2]\n\tif(dosi_swapY == True)and(dosi_swapZ == True):\n\t\tspacing_dosi[1], spacing_dosi[2] = spacing_dosi[2], spacing_dosi[1]\n\n print ' dosi_swapY, dosi_swapZ :', dosi_swapY, dosi_swapZ\n\n\tdosi_open = True\n\tisodose_show = True\n\tcheck1.select()\n\tUpdate_all()\n\n\tprint(' file successfully opened!')","def test_read(self):\n self.assertArrayEqual(self.dset['a'], self.data['a'])","def test_open_file(self):\n\t\tposition, potential = schrodinger.open_file('potential_energy.dat')\n\t\tself.assertEqual(position, [0.0, 1.57079, 3.14159, 4.71238, 6.28318, 7.85398, 9.42477])\n\t\tself.assertEqual(potential, [0.0, 6.0, 0.0, -6.0, 0.0, 6.0, 0.0])","def readOutputfile(filename, verbose=False):\n\n # -----------------------------------------------------------------------------\n # Defining the classes for data structure\n T_Simulation = namedtuple('Simulation', ['step'])\n T_Step = namedtuple('Step', ['element', 'node'])\n\n T_Displacement = namedtuple('Displacement', ['ux', 'uy'])\n\n T_Element = namedtuple('Element', ['gp', 'avstrain', 'avstress', 'eqstrain'])\n T_GP = namedtuple('GP', ['stress', 'strain'])\n T_Stresses = namedtuple('Stresses', ['xx', 'yy', 'zz', 'yz', 'zx', 'xy'])\n T_Strains = namedtuple('Strains', ['xx', 'yy', 'zz', 'yz', 'zx', 'xy'])\n # -----------------------------------------------------------------------------\n\n nSteps = 0 # Simulation step counter\n\n SimData = T_Simulation(list())\n\n with open(filename) as f:\n line = f.readline() # Read in the first line of the input file\n while True: # Loop over all lines of the input file\n # Read the nodes displacements\n #line = f.readline()\n #print(line)\n if line == 'DofManager output:\\n': # String starts a list of nodes displacement information\n nSteps += 1 # The above string starts a new simulation step\n line = f.readline() # Cancel ---------- seperator\n line = f.readline()\n Nodes = list() # Initialize/clear list of nodes\n\n while line != '\\n' and line != 'Element output:\\n': # Strings that finish the list\n #\t\t\t\tnNode = int(line.strip().split()[1]) # Node id\n line = f.readline()\n dim1 = float(line.strip().split()[3]) # Displacement dim1\n line = f.readline()\n dim2 = float(line.strip().split()[3]) # Displacement dim2\n Nodes.append(\n T_Displacement(dim1, dim2)) # Append displacements of the current node to the node list\n line = f.readline()\n\n\n if verbose:\n print('Step {}: Dofs completed.\\n'.format(nSteps))\n print('---------------------------------\\n')\n\n # Read the stresses an strains at Gauss points\n elif line == 'Element output:\\n': # String starts a list elements, GPs, strains and stresses\n line = f.readline() # Cancel ---------- seperator\n line = f.readline()\n Elements = list() # Initialize/clear list of elements\n\n while line != '\\n' and line != '\\tR E A C T I O N S O U T P U T:\\n': # Strings that finish the list\n #\t\t\t\t\tnElement = line.strip().split()[2] # Element id\n line = f.readline()\n GPs = T_Element(list(), 0, 0, 0) # List of Gauss points\n\n while line != '\\n' and line.strip().split()[0] == 'GP': # String that starts a new GP\n #\t\t\t\t\t\tnGP = int(line.strip().split()[1].split('.')[1]) # GP id\n tmp = [float(i) for i in line.strip().split()[4:10]] # Read the strains\n strain = T_Strains(tmp[0], tmp[1], tmp[2], tmp[3], tmp[4], tmp[5])\n line = f.readline()\n tmp = [float(i) for i in line.strip().split()[1:7]] # Read the stresses\n stress = T_Stresses(tmp[0], tmp[1], tmp[2], tmp[3], tmp[4], tmp[5])\n GPs.gp.append(\n T_GP(stress, strain)) # Append stresses and strains of the current GP to the GP list\n line = f.readline()\n\n\n Elements.append(GPs) # Append GP list of the current element to the element list\n\n if verbose:\n print('Step {}: GPs completed.\\n'.format(nSteps))\n print('---------------------------------\\n')\n\n SimData.step.append(T_Step(Elements, Nodes)) # Append element and node list of the current step to the step list\n #print('the file input ends')\n #print(nSteps)\n # only needed with a while loop\n # Jump over the lines until we reach the next time step (Caught by if-clause)\n try:\n line = f.readline() # Will generate an error if files end is reached\n if line == \"\":\n raise EOFError\n except:\n if verbose: print(\"End of file reached.\\n\")\n break # Break the 'while True' loop\n\n # -----------------------------------------------------------------------------\n\n\n print('averaging the stress')\n # Averaging of strains and stress of GPs of each element\n for istep in range(len(SimData.step)):\n\n for ielement in range(len(SimData.step[istep].element)):\n print(len)\n # Initialization before each element\n stresses = np.array([0., 0., 0., 0., 0., 0.])\n strains = np.array([0., 0., 0., 0., 0., 0.])\n\n for igp in range(len(SimData.step[istep].element[ielement])):\n print(igp)\n # Add up all data of all GPs\n #stresses[:] += SimData.step[istep].element[ielement].gp[igp].stress[:]\n strains[:] += SimData.step[istep].element[ielement].gp[igp].strain[:]\n\n # Divide GP sum by number of GPs\n stresses /= len(SimData.step[istep].element[ielement])\n strains /= len(SimData.step[istep].element[ielement])\n # Replace the field (initialized with 0) with new information\n SimData.step[istep].element[ielement] = SimData.step[istep].element[ielement]._replace(\n avstress=T_Stresses(stresses[0], stresses[1], stresses[2], stresses[3], stresses[4], stresses[5]))\n SimData.step[istep].element[ielement] = SimData.step[istep].element[ielement]._replace(\n avstrain=T_Strains(strains[0], strains[1], strains[2], strains[3], strains[4], strains[5]))\n print('Analysis finished')\n return SimData","def test_ordinary(self):\n date = datetime(2016, 11, 12)\n seq = 36\n name = star_barcode.barcode_filename(date, seq)\n self.assertEqual(\n name,\n 'Barcode_2016-W45-6_36.pdf'\n )","def test_pert_file(self):\n path, case = os.path.split(self.ieee14)\n\n # --- with pert file ---\n ss = andes.run('ieee14.raw', pert='pert.py',\n input_path=path, no_output=True, default_config=True,\n )\n ss.TDS.init()\n self.assertIsNotNone(ss.TDS.callpert)\n\n # --- without pert file ---\n ss = andes.run('ieee14.raw',\n input_path=path, no_output=True, default_config=True,\n )\n ss.TDS.init()\n self.assertIsNone(ss.TDS.callpert)","def test_conversion_lowlevel(path):\n gff_file = gff.GFFFile.read(join(data_dir(\"sequence\"), path))\n ref_entries = [entry for entry in gff_file]\n\n gff_file = gff.GFFFile()\n for entry in ref_entries:\n gff_file.append(*entry)\n temp = TemporaryFile(\"w+\")\n gff_file.write(temp)\n\n temp.seek(0)\n gff_file = gff.GFFFile.read(temp)\n temp.close()\n test_entries = [field for field in gff_file]\n assert test_entries == ref_entries","def test_fileobj_not_closed(self):\n\n f = open(self.data(\"test0.fits\"), \"rb\")\n _ = fits.getdata(f)\n assert not f.closed\n\n f.seek(0)\n _ = fits.getheader(f)\n assert not f.closed\n\n f.close() # Close it now","def open_read_write(file_to_open=PROBLEM_FILE):\n\n with open(file_to_open, 'r') as working_file:\n # turns the opened file into a list using a list comprehension\n working_file = [sentence.strip() for sentence in working_file.readlines()]\n\n # iterates through the enumerated file displaying a tuple\n # of (index, string)\n for sentence in enumerate(working_file): #iterates through the file\n if sentence[0] % 2: #Checks to see if the index is divisible by 2\n print(sentence[1]) #prints the string","def test_derivs(self):\n cr = CaseReader(self.filename)\n last_case = cr.get_case(-1)\n self.assertIsNone(last_case.derivs,\n \"Case erroneously contains derivs.\")","def testFileInRead(self, mockPath):\n mockPath.return_value = 'bananaphone.ccc'\n self.node = cdl_convert.ColorCollection(input_file='mybestfile.ccc')\n\n mockPath.assert_called_once_with('mybestfile.ccc')\n\n self.assertEqual(\n 'bananaphone.ccc',\n self.node.file_in\n )","def test_irr_read(irregular_written_data):\n\n fp, written = irregular_written_data\n with openEDF(fp) as reader:\n arr = reader.read(0)\n #imprecision due to 2-byte conversion so tolerance set to 1 unit\n assert np.allclose(written, arr, equal_nan=True, atol=1)","def assertState(self, files):\n\n for path, expected in files.iteritems():\n fullpath = os.path.join(self._dir, path)\n self.assertFile(fullpath, path)\n with open(fullpath, 'r') as file:\n actual = file.read() \n self.assertEqual(actual, expected)","def test_make_fna(self):\r\n fna_fp = os.path.join(self.sff_dir, 'test.fna')\r\n fna_gz_fp = os.path.join(self.gz_sff_dir, 'test_gz.fna')\r\n make_fna(self.sff_fp, fna_fp)\r\n make_fna(self.sff_gz_fp, fna_gz_fp)\r\n self.assertEqual(open(fna_fp).read(), fna_txt)\r\n self.assertEqual(open(fna_gz_fp).read(), fna_txt)","def read_and_test_file_content(self): # pragma: no cover\n\n # We print the CLI header.\n PyFunceble.CLICore.print_header()\n\n with open(self.file, \"r\", encoding=\"utf-8\") as file:\n # We open the file we have to test.\n\n for line in self._get_list_to_of_subjects_to_test_from_file(file):\n # We loop through the file decoded file\n # content.\n\n # We test the line.\n self._test_line(line)\n\n for index, line in self.mining.list_of_mined():\n # We loop through the list of mined domains\n # (if the mining subystem is activated.)\n\n # We test the line.\n self._test_line(line)\n # and remove the currently tested line\n # from the mining database.\n self.mining.remove(index, line)\n\n for subject in self.get_complements():\n # We loop through the list of complements.\n\n # We test the complement.\n self._test_line(subject)\n\n # We inform all subsystem that we are not testing for complements anymore.\n self.complements_test_started = False\n\n # We update the counters\n self.autocontinue.update_counters()\n # We clean the autocontinue subsystem, we finished\n # the test.\n self.autocontinue.clean()\n # We process the autosaving if necessary.\n self.autosave.process(test_completed=True)\n # We close the database connection\n if self.sqlite_db.authorized:\n self.sqlite_db.connection.close()\n if self.mysql_db.authorized:\n self.mysql_db.get_connection().close()","def test_fileOperations(self): \n from DIRAC import gConfig\n testSE = 'testSE'\n #rssClient = ResourceStatusClient()\n #result = rssClient.getStorageElementsList( 'Read' )\n #result = gConfig.getSections( '/Resources/StorageElements' )\n #if result['OK'] and result['Value']:\n # testSE = result['Value'][0]\n #if result['Ok']:\n # testSE = result['Value'][ 0 ] \n \n result = self.fc.addFile( { testFile: { 'PFN': 'testfile', \n 'SE': testSE , \n 'Size':0, \n 'GUID':0, \n 'Checksum':'0' } } )\n self.assert_( result['OK'] )\n if gConfig.getValue( '/Resources/StorageElements/%s/AccessProtocol.1/Host' % testSE, '' ):\n result = self.fc.getReplicas( testFile )\n self.assert_( result['OK'] )\n self.assert_( testFile in result['Value']['Successful'] )","def test_process_file():\r\n\r\n ## Once you have process_file \"working\", uncomment the 5 lines starting with\r\n ## file1 = \"\"\r\n ## Set kdiffexe to the path to kdiff3.exe on your computer\r\n ## Set file1 and file2 to the original and fixed eversion of the files\r\n ## This should provide a nice visual comparison of the file with and\r\n ## without the fix. In general, this is not a good practice for testing.\r\n ## That is, launching an external applicaiton to show the results.\r\n ##\r\n # file1 = \"\"\r\n # file2 = \"\"\r\n # kdiffexe = '\"C:\\Program Files\\KDiff3\\kdiff3.exe\"'\r\n # cmd = r'{} {} {}'.format(kdiffexe, file1, file2)\r\n # os.system(cmd)\r\n fh.process_file()","def test_read_input_file(self):\n\n test_max_digit = 2\n tuple1 = self.test_raw_tuple\n tuple2, max_digit = read_input_file(self.test_drug_info_file)\n self.assertEqual(tuple1, tuple2)\n self.assertAlmostEqual(max_digit,test_max_digit)","def test_can_create_fa_dfl(\n pages: conftest.UserPages, sample_upload_file: types.FilePayload\n) -> None:\n\n with pages.imp_page() as imp_page:\n dfl_id = fa_dfl_create(imp_page, sample_upload_file)\n\n with pages.ilb_page() as ilb_page:\n fa_dfl_manage_and_complete_case(ilb_page, dfl_id)","def test_file_field():"],"string":"[\n \"def _test_example_eda_adf():\\n main([\\\"pnictogen/repo/split.ADF.in\\\", \\\"data/water-dimer.xyz\\\"])\\n assert_equals(\\n open(\\\"data/water-dimer_eda.in\\\").read(),\\n \\\"\\\"\\\"TITLE data/water-dimer.xyz eda\\n\\nCHARGE 0 0\\n\\nNumber of atoms\\n 6\\n\\nATOMS Cartesian\\nO 0.12908 -0.26336 0.64798 f=f1\\nH 0.89795 0.28805 0.85518 f=f1\\nH 0.10833 -0.20468 -0.33302 f=f1\\nO 0.31020 0.07569 -2.07524 f=f2\\nH -0.26065 0.64232 -2.62218 f=f2\\nH 0.64083 -0.57862 -2.71449 f=f2\\nEnd\\n\\nFragments\\n f1 data/water-dimer_f1.t21\\n f2 data/water-dimer_f2.t21\\nEnd\\n\\nBasis\\nEnd\\n\\nGeometry\\nEnd\\n\\n\\\"\\\"\\\",\\n )\\n assert_equals(\\n open(\\\"data/water-dimer_f1.in\\\").read(),\\n \\\"\\\"\\\"TITLE data/water-dimer.xyz f1\\n\\nCHARGE 0 0\\n\\nNumber of atoms\\n 3\\n\\nATOMS Cartesian\\nO 0.12908 -0.26336 0.64798\\nH 0.89795 0.28805 0.85518\\nH 0.10833 -0.20468 -0.33302\\nEnd\\n\\nBasis\\nEnd\\n\\nGeometry\\nEnd\\n\\n\\\"\\\"\\\",\\n )\\n assert_equals(\\n open(\\\"data/water-dimer_f2.in\\\").read(),\\n \\\"\\\"\\\"TITLE data/water-dimer.xyz f2\\n\\nCHARGE 0 0\\n\\nNumber of atoms\\n 3\\n\\nATOMS Cartesian\\nO 0.31020 0.07569 -2.07524\\nH -0.26065 0.64232 -2.62218\\nH 0.64083 -0.57862 -2.71449\\nEnd\\n\\nBasis\\nEnd\\n\\nGeometry\\nEnd\\n\\n\\\"\\\"\\\",\\n )\",\n \"def identify_file(self, file):\",\n \"def test_is_delicious_file(self):\\r\\n good_file = self._get_del_file()\\r\\n\\r\\n self.assertTrue(\\r\\n DelImporter.can_handle(good_file),\\r\\n \\\"DelImporter should handle this file\\\")\\r\\n\\r\\n good_file.close()\",\n \"def test_Telegramfd (self):\\n\\t\\t# This file is delivered openned while this test.\\n\\t\\ttestfilepath = os.path.join (self.hotfolder, \\\"fileinuse.txt\\\")\\n\\t\\tf = open(testfilepath,\\\"a\\\") #opens file with name of \\\"test.txt\\\"\\n\\t\\tf.write(\\\"This file is now opened and i'm writting on it \\\\n\\\")\\n\\n\\n\\t\\tknown_values = set ([\\n\\t\\t\\t('TESTS/Test3/Telegram Desktop/Printer output.pdf', '.file'),\\n\\t\\t\\t('TESTS/Test3/Telegram Desktop/This is a Zero avi file.avi', '.file'),\\n\\t\\t\\t('TESTS/Test3/Telegram Desktop/File not in use.CBR', '.file'),\\n\\t\\t\\t('TESTS/Test3/Telegram Desktop/This is a dummy rar file.rar', '.rar'),\\n\\t\\t\\t])\\n\\n\\t\\tEntries = MD.Telegramfd (self.hotfolder)\\n\\t\\tself.assertEqual (known_values, set(Entries))\\n\\n\\t\\tf.close ()\",\n \"def test_is_delicious_file(self):\\r\\n good_file = self._get_del_file()\\r\\n self.assertTrue(\\r\\n DelXMLImporter.can_handle(good_file),\\r\\n \\\"DelXMLImporter should handle this file\\\")\\r\\n good_file.close()\",\n \"def test_get_infile(self):\\r\\n pass # not practically testable, but obvious file I/O\\r\",\n \"def test_fileinuse (self):\\t\\t\\n\\t\\t# open a file:\\n\\t\\ttestfilepath = os.path.join (self.testfolder, \\\"fileinuse.txt\\\")\\n\\t\\tf = open(testfilepath,\\\"a\\\") #opens file with name of \\\"test.txt\\\"\\n\\t\\tf.write(\\\"This file is now opened and i'm writting on it \\\\n\\\")\\n\\t\\tself.assertEqual (MD.fileinuse(testfilepath), True) # Checks a file that it is beign written.\\n\\t\\tself.assertEqual (MD.folderinuse(self.testfolder), True) # Checks if any file inside the folder is beign used.\\n\\t\\tf.close()\\n\\t\\tself.assertEqual (MD.fileinuse(testfilepath), False) # Cheks a file that it is closed.\\n\\t\\tself.assertEqual (MD.folderinuse(self.testfolder), False)\",\n \"def test_file_shizz(topic_path):\\n\\tL = [[1,2,3],[4,5,6]]\\n\\tprint(open(topic_path+'/D/'+str(L[1][0])+'.txt'))\",\n \"def test_print_drug_info(self):\\n\\n pwd = self.get_script_path()\\n fout1 = self.test_output_file\\n fout2 = pwd+'/../insight_testsuite/tests/my_test/output/test_output_file_2.txt'\\n print_drug_info(self.test_sorted_tuple, self.test_dict, self.test_num_unique_name, self.test_total_cost_each_drug, fout2, 2)\\n self.assertTrue(filecmp.cmp(fout1, fout2))\",\n \"def test_DL_import_equals_export(self):\\n filepath = '2.txt'\\n original_dl = flow_processing_input.DetectorsLocation(2021)\\n original_dl.detectors_location_dict = createDLDataset(10).dataset\\n original_dl.export_to_file(filepath)\\n new_dl = flow_processing_input.DetectorsLocation(2021, filepath)\\n os.remove(filepath)\\n # Check if new_dl contains the same attributes as the original_dl\\n self.assertTrue(new_dl == original_dl)\\n # Check if new_dl is not equal to a different DL of same size\\n random_dl = flow_processing_input.DetectorsLocation(2021)\\n random_dl.detectors_location_dict = createDLDataset(10).dataset\\n self.assertFalse(new_dl == random_dl)\",\n \"def test_fid(self):\\n g = h5g.create(self.fid, '/foobar')\\n x = h5i.get_file_id(g)\\n self.assertIsInstance(x, h5f.FileID)\\n self.assertEqual(x, self.fid)\\n self.assertEqual(h5i.get_ref(x), 1)\",\n \"def test_DL_import_from_constructor(self):\\n filepath = '7.txt'\\n original_dl = flow_processing_input.DetectorsLocation(2021)\\n original_dl.detectors_location_dict = createDLDataset(10).dataset\\n original_dl.export_to_file(filepath)\\n new_dl = flow_processing_input.DetectorsLocation(2021, filepath)\\n os.remove(filepath)\\n # Check if new_dl contains the same attributes as the original_dl\\n self.assertTrue(new_dl == original_dl)\",\n \"def test_fobj():\\n Level3File(get_test_data('nids/Level3_FFC_N0Q_20140407_1805.nids'))\",\n \"def test_read_file_from_disk(self):\\r\\n actual_data = read_file_from_disk(self.test_file1)\\r\\n self.assertEqual(self.test_file1_data, actual_data)\",\n \"def test_is_not_delicious_file(self):\\r\\n bad_file = StringIO.StringIO()\\r\\n bad_file.write('failing tests please')\\r\\n bad_file.seek(0)\\r\\n\\r\\n self.assertTrue(\\r\\n not DelImporter.can_handle(bad_file),\\r\\n \\\"DelImporter cannot handle this file\\\")\\r\\n\\r\\n bad_file.close()\",\n \"def test_get_db_list_from_file(): # ***Incomplete test\\n ##########################\\n # Arrange.\\n infp = \\\"infp\\\"\\n\\n ##########################\\n # Act.\\n #x = get_db_list_from_file(infp)\\n\\n ##########################\\n # Assert.\\n assert True == True # ***Temporary.\",\n \"def _test(self, file_name):\\n data = bob.io.base.load(file_name)\\n assert (_data == data).all()\",\n \"def test_read_from_file():\\n reading_file = d.read_code_from_file()\\n assert type(reading_file) == list\\n assert len(reading_file) == 7\\n assert \\\"\\\\n\\\" not in d.read_code_from_file()\",\n \"def testOneShow(self):\\n\\t\\t# for line in self.file:\\n\\t\\t# \\tprint line\\n\\t\\tline = self.file.readline()\\n\\t\\tinfo = scrapeFilename( line )\\n\\t\\tassert info['show'] == \\\"Chuck\\\"\",\n \"def test_file_reader(self):\\r\\n a = list(file_reader(\\\"student_majors.txt\\\", 3, sep='|', header=True))\\r\\n\\r\\n b = [('123', 'Jin He', 'Computer Science'), ('234', 'Nanda Koka', 'Software Engineering'), \\\\\\r\\n ('345', 'Benji Cai', 'Software Engineering')]\\r\\n self.assertEqual(a, b)\\r\\n \\r\\n c = [(\\\"CWID\\\", \\\"Name\\\", \\\"Major\\\"), ('123', 'Jin He', 'Computer Science'), ('234', 'Nanda Koka', 'Software Engineering'), \\\\\\r\\n ('345', 'Benji Cai', 'Software Engineering')]\\r\\n self.assertNotEqual(a,c)\",\n \"def test_printdiff(self):\\n\\n # Testing different string input options\\n assert printdiff(self.data('arange.fits'),\\n self.data('blank.fits')) is None\\n assert printdiff(self.data('arange.fits'),\\n self.data('blank.fits'), ext=0) is None\\n assert printdiff(self.data('o4sp040b0_raw.fits'),\\n self.data('o4sp040b0_raw.fits'),\\n extname='sci') is None\\n\\n # This may seem weird, but check printdiff to see, need to test\\n # incorrect second file\\n with pytest.raises(IOError):\\n printdiff('o4sp040b0_raw.fits', 'fakefile.fits', extname='sci')\\n\\n # Test HDU object inputs\\n with fits.open(self.data('stddata.fits'), mode='readonly') as in1:\\n with fits.open(self.data('checksum.fits'), mode='readonly') as in2:\\n\\n assert printdiff(in1[0], in2[0]) is None\\n\\n with pytest.raises(ValueError):\\n printdiff(in1[0], in2[0], ext=0)\\n\\n assert printdiff(in1, in2) is None\\n\\n with pytest.raises(NotImplementedError):\\n printdiff(in1, in2, 0)\",\n \"def test_printdiff(self):\\n\\n # Testing different string input options\\n assert printdiff(self.data(\\\"arange.fits\\\"), self.data(\\\"blank.fits\\\")) is None\\n assert (\\n printdiff(self.data(\\\"arange.fits\\\"), self.data(\\\"blank.fits\\\"), ext=0) is None\\n )\\n assert (\\n printdiff(\\n self.data(\\\"o4sp040b0_raw.fits\\\"),\\n self.data(\\\"o4sp040b0_raw.fits\\\"),\\n extname=\\\"sci\\\",\\n )\\n is None\\n )\\n\\n # This may seem weird, but check printdiff to see, need to test\\n # incorrect second file\\n with pytest.raises(OSError):\\n printdiff(\\\"o4sp040b0_raw.fits\\\", \\\"fakefile.fits\\\", extname=\\\"sci\\\")\\n\\n # Test HDU object inputs\\n with fits.open(self.data(\\\"stddata.fits\\\"), mode=\\\"readonly\\\") as in1:\\n with fits.open(self.data(\\\"checksum.fits\\\"), mode=\\\"readonly\\\") as in2:\\n assert printdiff(in1[0], in2[0]) is None\\n\\n with pytest.raises(ValueError):\\n printdiff(in1[0], in2[0], ext=0)\\n\\n assert printdiff(in1, in2) is None\\n\\n with pytest.raises(NotImplementedError):\\n printdiff(in1, in2, 0)\",\n \"def test_real_file(self):\\n log.info('===== START TEST BYTE LOSS =====')\\n\\n # Recovered\\n file_path = os.path.join(RESOURCE_PATH, '11079364_SNA_SNA.txt')\\n\\n stream_handle = open(file_path, MODE_ASCII_READ)\\n\\n self.create_parser(stream_handle, telem_flag=False)\\n\\n particles = self.parser.get_records(182)\\n\\n log.debug(\\\"*** test_real_file Num particles %s\\\", len(particles))\\n\\n # check all the values against expected results.\\n self.assert_particles(particles, '11079364_SNA_SNA_recov.yml', RESOURCE_PATH)\\n self.assertEquals(self.exception_callback_value, [])\\n stream_handle.close()\\n\\n # Telemetered\\n file_path = os.path.join(RESOURCE_PATH, '11079419_SNA_SNA.txt')\\n\\n stream_handle = open(file_path, MODE_ASCII_READ)\\n\\n self.create_parser(stream_handle)\\n\\n particles = self.parser.get_records(172)\\n\\n log.debug(\\\"*** test_real_file Num particles %s\\\", len(particles))\\n\\n # check all the values against expected results.\\n self.assert_particles(particles, '11079419_SNA_SNA_telem.yml', RESOURCE_PATH)\\n stream_handle.close()\\n\\n log.info('===== END TEST REAL FILE =====')\",\n \"def testReadDataFile(self):\\n try:\\n blockNameList = []\\n myReader = ParseCifSimple(self.__pathPdbxDataFile, False, 0, 255, \\\"?\\\", self.__logFileName)\\n blockNameList = myReader.GetBlockNames(blockNameList)\\n #\\n for blockName in blockNameList:\\n block = myReader.GetBlock(blockName)\\n tableNameList = []\\n tableNameList = block.GetTableNames(tableNameList)\\n for tableName in tableNameList:\\n table = block.GetTable(tableName)\\n columnNameList = table.GetColumnNames()\\n logger.debug(\\\"Table %s colunms %r\\\", tableName, columnNameList)\\n numRows = table.GetNumRows()\\n rowList = []\\n for iRow in range(0, numRows):\\n row = table.GetRow(iRow)\\n rowList.append(row)\\n logger.debug(\\\"table %s row length %d\\\", tableName, len(rowList))\\n except Exception as e:\\n logger.exception(\\\"Failing with %s\\\", str(e))\\n self.fail()\",\n \"def test_handle_info_reading():\\n bids_root = _TempDir()\\n\\n # read in USA dataset, so it should find 50 Hz\\n raw = _read_raw_fif(raw_fname)\\n\\n # write copy of raw with line freq of 60\\n # bids basename and fname\\n bids_path = BIDSPath(subject='01', session='01',\\n task='audiovisual', run='01',\\n root=bids_root)\\n suffix = \\\"meg\\\"\\n bids_fname = bids_path.copy().update(suffix=suffix,\\n extension='.fif')\\n write_raw_bids(raw, bids_path, overwrite=True)\\n\\n # find sidecar JSON fname\\n bids_fname.update(datatype=suffix)\\n sidecar_fname = _find_matching_sidecar(bids_fname, suffix=suffix,\\n extension='.json')\\n\\n # assert that we get the same line frequency set\\n raw = read_raw_bids(bids_path=bids_path)\\n assert raw.info['line_freq'] == 60\\n\\n # 2. if line frequency is not set in raw file, then ValueError\\n raw.info['line_freq'] = None\\n with pytest.raises(ValueError, match=\\\"PowerLineFrequency .* required\\\"):\\n write_raw_bids(raw, bids_path, overwrite=True)\\n\\n # make a copy of the sidecar in \\\"derivatives/\\\"\\n # to check that we make sure we always get the right sidecar\\n # in addition, it should not break the sidecar reading\\n # in `read_raw_bids`\\n deriv_dir = op.join(bids_root, \\\"derivatives\\\")\\n sidecar_copy = op.join(deriv_dir, op.basename(sidecar_fname))\\n os.mkdir(deriv_dir)\\n with open(sidecar_fname, \\\"r\\\", encoding='utf-8') as fin:\\n sidecar_json = json.load(fin)\\n sidecar_json[\\\"PowerLineFrequency\\\"] = 45\\n _write_json(sidecar_copy, sidecar_json)\\n raw = read_raw_bids(bids_path=bids_path)\\n assert raw.info['line_freq'] == 60\\n\\n # 3. assert that we get an error when sidecar json doesn't match\\n _update_sidecar(sidecar_fname, \\\"PowerLineFrequency\\\", 55)\\n with pytest.raises(ValueError, match=\\\"Line frequency in sidecar json\\\"):\\n raw = read_raw_bids(bids_path=bids_path)\\n assert raw.info['line_freq'] == 55\",\n \"def test_DL_import_wrong_file_unserialized(self):\\n filepath = '6.txt'\\n wrong_file = open(filepath, 'x')\\n wrong_file.write(\\\"This is not a serialized detector flow data\\\")\\n wrong_file.close()\\n # Check if exception was raised for wrong serialization\\n with self.assertRaises(Exception):\\n flow_processing_input.DetectorsLocation(9999, filepath)\\n os.remove(filepath)\",\n \"def test_file_access():\\n file = gff.GFFFile()\\n entry_scaffold = (\\\"ab\\\", \\\"cd\\\", 1, 2, None, None, None, {\\\"Id\\\":\\\"foo\\\"})\\n entry = (\\\"a\\\",) + entry_scaffold\\n file.append(*entry)\\n assert file[0] == entry\\n file.append(*((\\\"b\\\",) + entry_scaffold))\\n file.insert(1, *((\\\"c\\\",) + entry_scaffold))\\n file[1] = (\\\"d\\\",) + entry_scaffold\\n file.insert(3, *((\\\"e\\\",) + entry_scaffold))\\n del file[2]\\n assert [seqid for seqid, _, _, _, _, _, _, _, _ in file] \\\\\\n == [\\\"a\\\", \\\"d\\\", \\\"e\\\", ]\",\n \"def test_is_not_delicious_file(self):\\r\\n bad_file = StringIO.StringIO()\\r\\n bad_file.write('failing tests please')\\r\\n bad_file.seek(0)\\r\\n\\r\\n self.assertTrue(\\r\\n not DelXMLImporter.can_handle(bad_file),\\r\\n \\\"DelXMLImporter cannot handle this file\\\")\\r\\n\\r\\n bad_file.close()\",\n \"def test_the_main_with_simple_yet_proper_file(self):\\r\\n assert the_main_function('test_proper_file.csv') == (['\\\\ufeffid', 'link'], [['1', 'abc.com'], ['2', 'gef.com']])\",\n \"def idfreader1(fname, iddfile, theidf, conv=True, commdct=None, block=None):\\n versiontuple = iddversiontuple(iddfile)\\n # import pdb; pdb.set_trace()\\n block, data, commdct, idd_index = readidf.readdatacommdct1(\\n fname, iddfile=iddfile, commdct=commdct, block=block\\n )\\n if conv:\\n convertallfields(data, commdct, block)\\n # fill gaps in idd\\n ddtt, dtls = data.dt, data.dtls\\n if versiontuple < (8,):\\n skiplist = [\\\"TABLE:MULTIVARIABLELOOKUP\\\"]\\n else:\\n skiplist = None\\n nofirstfields = iddgaps.missingkeys_standard(commdct, dtls, skiplist=skiplist)\\n iddgaps.missingkeys_nonstandard(block, commdct, dtls, nofirstfields)\\n # bunchdt = makebunches(data, commdct)\\n bunchdt = makebunches_alter(data, commdct, theidf, block)\\n return bunchdt, block, data, commdct, idd_index, versiontuple\",\n \"def test():\\n from pylada.dftcrystal.functional import Functional\\n from pylada.dftcrystal import Crystal\\n from pylada.dftcrystal.parse import parse\\n parsed = parse(string)\\n structure = Crystal()\\n structure.read_input(parsed['rutile']['CRYSTAL'])\\n a = Functional()\\n a.read_input(parsed)\\n assert a.scfdir \\n assert a.maxcycle == 300\\n assert a.exchsize == 6937578\\n # need structure otherwise parse can't find beginning of input.\\n otherstring = a.print_input(structure=structure)\\n otherparsed = parse(otherstring)\\n b = Functional()\\n b.read_input(otherparsed)\\n assert otherstring == b.print_input(structure=structure)\",\n \"def test_reader(self):\\n default_list_file = GAMEBASE + \\\"/Lists/char-LIST.tex\\\"\\n output = name_pdfs.read_names_file(default_list_file)\\n self.assertIsInstance(output, dict)\\n self.assertGreater(len(output), 0)\\n # Check that the function returns a dict ✓\\n # Of greater than length 0 ✓\\n fname = \\\"\\\"\\n for example in self.bad_filenames:\\n with self.subTest(fname=example):\\n with self.assertRaises(OSError):\\n name_pdfs.read_names_file(fname)\",\n \"def test_file_reader(self) -> None:\\n result = [['123', 'Jin He', 'Computer Science'],\\n ['234', 'Nanda Koka', 'Software Engineering'],\\n ['345', 'Benji Cai', 'Software Engineering']]\\n # file have header\\n self.assertTrue(\\n list(file_reader('C:/Users/Nidhi/Desktop/SEM3/810/HW08/student_majors.txt', 3, '|', True)) == result)\\n # file without header\\n self.assertFalse(\\n list(file_reader('C:/Users/Nidhi/Desktop/SEM3/810/HW08/student_majors.txt', 3, '|')) == result)\\n # More than 3 datafield\\n with self.assertRaises(ValueError):\\n list(file_reader(\\n 'C:/Users/Nidhi/Desktop/SEM3/810/HW08/student_majors.txt', 4, '|', True))\\n # file not found\\n with self.assertRaises(FileNotFoundError):\\n list(file_reader('abc.txt', 3, '|', True))\",\n \"def test_open_ped_duplicate_person(self):\\n \\n self.temp.write('A B 0 0 1 1\\\\n')\\n self.temp.write('A B 0 0 1 1\\\\n')\\n self.temp.flush()\\n \\n with self.assertRaises(ValueError):\\n open_ped(self.temp.name)\",\n \"def _read_file(self):\\n\\n with open(self.file_name, 'rb') as f:\\n new_test = struct.unpack('<l', f.read(8)[4:])[0]\\n f.close()\\n\\n with open(self.file_name, 'rb') as f:\\n old_test = struct.unpack('<h', f.read(6)[4:])[0]\\n f.close()\\n\\n with open(self.file_name, 'rb') as f:\\n other_test = struct.unpack('<l', f.read(20)[16:])[0]\\n f.close()\\n\\n open_file = open(self.file_name, 'rb')\\n\\n if (other_test==202):\\n raw = open_file.read(1236)[11:]\\n self.model = '202'\\n elif ((not new_test==102) and old_test==102):\\n raw = open_file.read(1133)\\n self.model = '102old'\\n elif (new_test==102 and old_test==102):\\n raw = open_file.read(1224)\\n self.model = '102new'\\n\\n self.header = DpHeader(raw, self.model)\\n\\n self.data = DpData(open_file, \\n self.model, \\n self.header.interferogram_size, \\n self.header.number_of_coadds, \\n 2048*self.header.zero_fill,\\n self.header.laser_wavelength_microns, \\n self.header.dispersion_constant_xm,\\n self.header.dispersion_constant_xb)\\n\\n open_file.close()\",\n \"def test_identify_contents_1(self):\\n Path(self.base_dir, \\\"new_dir\\\").mkdir()\\n Path(self.base_dir, \\\"file1.txt\\\").touch()\\n Path(self.base_dir, \\\".DS_Store\\\").touch()\\n list_of_items = basic.identify_contents(self.base_dir, kind=\\\"file\\\")\\n exp_num_items = 2\\n self.assertEqual(len(list_of_items), exp_num_items)\",\n \"def test_basic():\\n f = Level3File(get_test_data('nids/Level3_FFC_N0Q_20140407_1805.nids', as_file_obj=False))\\n assert f.metadata['prod_time'].replace(second=0) == datetime(2014, 4, 7, 18, 5)\\n assert f.metadata['vol_time'].replace(second=0) == datetime(2014, 4, 7, 18, 5)\\n assert f.metadata['msg_time'].replace(second=0) == datetime(2014, 4, 7, 18, 6)\\n assert f.filename == get_test_data('nids/Level3_FFC_N0Q_20140407_1805.nids',\\n as_file_obj=False)\\n\\n # At this point, really just want to make sure that __str__ is able to run and produce\\n # something not empty, the format is still up for grabs.\\n assert str(f)\",\n \"def test_file(self):\\n a = False\\n if \\\"show()\\\" in open('attempt.py').read():\\n a = True\\n self.assertEquals(a,True)\",\n \"def test_nonfile(self):\\n self.assertEqual(None,readfiles.read_file(\\\"tests.txt))\",\n \"def test_get_query_list_from_file(): # ***Incomplete test\\n ##########################\\n # Arrange.\\n infp = \\\"infp\\\"\\n\\n ##########################\\n # Act.\\n #x = get_query_list_from_file(infp)\\n\\n ##########################\\n # Assert.\\n assert True == True # ***Temporary.\",\n \"def test_read_identity(self):\\n pass\",\n \"def test_factory_gives_delicious(self):\\r\\n loc = os.path.dirname(__file__)\\r\\n del_file = os.path.join(loc, 'delicious.html')\\r\\n\\r\\n with open(del_file) as del_io:\\r\\n imp = Importer(del_io, username=u\\\"admin\\\")\\r\\n\\r\\n self.assertTrue(\\r\\n isinstance(imp, DelImporter),\\r\\n \\\"Instance should be a delimporter instance\\\")\",\n \"def test_open_ped(self):\\n \\n self.temp.write('A B 0 0 1 1\\\\n')\\n self.temp.flush()\\n families = open_ped(self.temp.name)\\n \\n fam = Family('A')\\n fam.add_person(Person('A', 'B', '0', '0', '1', '1'))\\n \\n self.assertEqual(families[0].nodes, fam.nodes)\",\n \"def test_read_file():\\n filename = 'sample'\\n assert read_file(filename) == 'hello!\\\\n'\",\n \"def diet_retrieve(file_name):\\n with open(file_name, \\\"r\\\") as f:\\n content = f.read()\\n return print(content)\",\n \"def test_call_infernal_test1_file_output(self):\\r\\n # do not collect results; check output files instead\\r\\n actual = self.infernal_test1_aligner(\\r\\n self.infernal_test1_input_fp, result_path=self.result_fp,\\r\\n log_path=self.log_fp)\\r\\n\\r\\n self.assertTrue(actual is None,\\r\\n \\\"Result should be None when result path provided.\\\")\\r\\n\\r\\n expected_aln = self.infernal_test1_expected_aln\\r\\n with open(self.result_fp) as result_f:\\r\\n actual_aln = Alignment.from_fasta_records(parse_fasta(\\r\\n result_f), DNA)\\r\\n self.assertEqual(actual_aln, expected_aln)\",\n \"def load_patient_data():\\n data_file = open(\\\"test_data.txt\\\", \\\"r\\\")\\n still_finding_patients = True\\n my_patients = []\\n while still_finding_patients is True:\\n name_line = next(data_file)\\n if name_line != \\\"END\\\":\\n name_line = name_line.split()\\n fname = name_line[0]\\n lname = name_line[1]\\n age = next(data_file).strip()\\n gender = next(data_file).strip().casefold()\\n tsh_data = next(data_file)\\n tsh_data = tsh_data.strip().split(\\\",\\\")\\n tsh_data.remove(\\\"TSH\\\")\\n new_patient = create_patient(fname, lname, age, gender, tsh_data)\\n my_patients.append(new_patient)\\n else:\\n still_finding_patients = False\\n data_file.close()\\n return my_patients\",\n \"def test_artemis_reader():\\n _test_raw_reader(\\n read_raw_artemis123,\\n input_fname=short_hpi_1kz_fname,\\n pos_fname=dig_fname,\\n verbose=\\\"error\\\",\\n )\",\n \"def test_readfile(self):\\n fname = os.path.join(self.datadir, 'monol_testA_E3-50_rebin4_gti') + \\\\\\n HEN_FILE_EXTENSION\\n command = \\\"{0}\\\".format(fname)\\n\\n hen.io.main(command.split())\",\n \"def test_reader(file_dir,\\n word2id_dict,\\n label2id_dict,\\n word_replace_dict,\\n filename_feature=\\\"\\\"):\\n word_dict_len = max(map(int, word2id_dict.values())) + 1\\n label_dict_len = max(map(int, label2id_dict.values())) + 1\\n\\n def reader():\\n \\\"\\\"\\\"\\n the data generator\\n \\\"\\\"\\\"\\n index = 0\\n for root, dirs, files in os.walk(file_dir):\\n for filename in files:\\n if not filename.startswith(filename_feature):\\n continue\\n for line in io.open(\\n os.path.join(root, filename), 'r', encoding='utf8'):\\n index += 1\\n bad_line = False\\n line = line.strip(\\\"\\\\n\\\")\\n if len(line) == 0:\\n continue\\n seg_tag = line.rfind(\\\"\\\\t\\\")\\n if seg_tag == -1:\\n seg_tag = len(line)\\n word_part = line[0:seg_tag]\\n label_part = line[seg_tag + 1:]\\n word_idx = []\\n words = word_part\\n for word in words:\\n if ord(word) < 0x20:\\n word = ' '\\n if word in word_replace_dict:\\n word = word_replace_dict[word]\\n if word in word2id_dict:\\n word_idx.append(int(word2id_dict[word]))\\n else:\\n word_idx.append(int(word2id_dict[\\\"OOV\\\"]))\\n yield word_idx, words\\n\\n return reader\",\n \"def test_checkForOldParents(self):\\n f = open(\\\"Output.txt\\\", \\\"a+\\\")\\n fam: Dict = {'F23':\\n {'fam': 'F23', 'MARR': '14 FEB 1980', 'HUSB': 'I01', 'WIFE': 'I07',\\n 'CHIL': ['I19', 'I26', 'I30']},\\n 'F16': {'fam': 'F16', 'MARR': '12 DEC 2007'}}\\n fam2: Dict = {'F23': {'fam': 'F23', 'MARR': '14 FEB 1980', 'HUSB': 'I01', 'WIFE': 'I07', 'CHIL': ['I19']}}\\n\\n ind1: Dict = {'I01': {'id': 'I01', 'name': 'Joe /Smith/', 'BIRT': '15 JUL 1900', 'sex': 'M', 'family': 'F23',\\n 'DEAT': '31 DEC 2013'},\\n 'I07': {'id': 'I07', 'name': 'Jennifer /Smith/', 'BIRT': '23 SEP 1902', 'sex': 'F',\\n 'family': 'F23',\\n 'DEAT': '31 DEC 2013'},\\n 'I19': {'id': 'I19', 'name': 'Dick /Smith/', 'BIRT': '13 FEB 1999', 'sex': 'M', 'family': 'F23',\\n 'DEAT': '31 DEC 2013'}}\\n\\n ind2: Dict = {'I01': {'id': 'I01', 'name': 'Joe /Smith/', 'BIRT': '15 JUL 1960', 'sex': 'M', 'family': 'F23',\\n 'DEAT': '31 DEC 2013'},\\n 'I07': {'id': 'I07', 'name': 'Jennifer /Smith/', 'BIRT': '23 SEP 1960', 'sex': 'F',\\n 'family': 'F23'},\\n 'I19': {'id': 'I19', 'name': 'Dick /Smith/', 'BIRT': '13 FEB 1981', 'sex': 'M', 'family': 'F23'},\\n 'I26': {'id': 'I26', 'name': 'Jane /Smith/', 'BIRT': '13 FEB 1981', 'sex': 'F', 'family': 'F23'},\\n 'I30': {'id': 'I30', 'name': 'Mary /Test/', 'BIRT': '13 FEB 1981', 'sex': 'F', 'family': 'F23'},\\n 'I32': {'id': 'I32', 'name': 'Nick /Tary/', 'BIRT': '13 FEB 1981', 'sex': 'M', 'family': 'F23'},\\n 'I44': {'id': 'I44', 'name': 'Cersi /Lanister/', 'BIRT': '13 FEB 1981', 'sex': 'F',\\n 'family': 'F23'}}\\n\\n self.assertTrue(us.checkForOldParents(fam, ind2, f))\\n self.assertFalse(us.checkForOldParents(fam2, ind1, f))\",\n \"def test_read_delete(self):\\n\\n expected = \\\"Hello, World! This has been written by Fun Ilrys.\\\"\\n File(\\\"hi\\\").write(expected)\\n actual = File(\\\"hi\\\").read()\\n\\n self.assertEqual(expected, actual)\\n\\n expected = False\\n File(\\\"hi\\\").delete()\\n actual = PyFunceble.path.isfile(\\\"hi\\\")\\n\\n self.assertEqual(expected, actual)\",\n \"def test_identify_contents_2(self):\\n Path(self.base_dir, \\\"new_dir\\\").mkdir()\\n Path(self.base_dir, \\\"file1.txt\\\").touch()\\n Path(self.base_dir, \\\".DS_Store\\\").touch()\\n ignore_set = set([\\\".DS_Store\\\"])\\n list_of_items = basic.identify_contents(self.base_dir, kind=\\\"file\\\",\\n ignore_set=ignore_set)\\n exp_num_items = 1\\n self.assertEqual(len(list_of_items), exp_num_items)\",\n \"def idfreader(fname, iddfile, conv=True):\\n data, commdct, idd_index = readidf.readdatacommdct(fname, iddfile=iddfile)\\n if conv:\\n convertallfields(data, commdct)\\n # fill gaps in idd\\n ddtt, dtls = data.dt, data.dtls\\n # skiplist = [\\\"TABLE:MULTIVARIABLELOOKUP\\\"]\\n nofirstfields = iddgaps.missingkeys_standard(\\n commdct, dtls, skiplist=[\\\"TABLE:MULTIVARIABLELOOKUP\\\"]\\n )\\n iddgaps.missingkeys_nonstandard(None, commdct, dtls, nofirstfields)\\n bunchdt = makebunches(data, commdct)\\n return bunchdt, data, commdct, idd_index\",\n \"def test_call_requires_read_1_file(self):\\r\\n p = RtaxTaxonAssigner({\\r\\n 'reference_sequences_fp': self.reference_seqs_fp,\\r\\n 'id_to_taxonomy_fp': self.id_to_taxonomy_fp})\\r\\n\\r\\n # no read_1_seqs_fp passed results in AssertionError\\r\\n self.assertRaises(AssertionError, p, self.input_seqs_fp)\",\n \"def test_GFD_import_equals_export(self):\\n filepath = '2.txt'\\n original_gfd = flow_processing_input.GroundFlowData()\\n original_gfd.detector_flow_data = createGFDDataset(10).dataset\\n original_gfd.export_to_file(filepath)\\n new_gfd = flow_processing_input.GroundFlowData(filepath)\\n os.remove(filepath)\\n # Check if new_gfd contains the same attributes as the original_gfd\\n self.assertTrue(new_gfd == original_gfd)\\n # Check if new_gfd is not equal to a different gfd of same size\\n random_gfd = flow_processing_input.GroundFlowData()\\n random_gfd.detector_flow_data = createGFDDataset(10).dataset\\n self.assertFalse(new_gfd == random_gfd)\",\n \"def test_doubled_file():\\n with contextlib.closing(get_test_data('Level2_KFTG_20150430_1419.ar2v')) as infile:\\n data = infile.read()\\n fobj = BytesIO(data + data)\\n f = Level2File(fobj)\\n assert len(f.sweeps) == 12\",\n \"def test_DL_import_wrong_file_serialized(self):\\n filepath = '5.txt'\\n with open(filepath, 'wb') as file:\\n pickle.dump([\\\"This is a wrong dataset\\\"], file)\\n # Check if exception was raised for wrong data type\\n with self.assertRaises(Exception):\\n flow_processing_input.DetectorsLocation(9999, filepath)\\n os.remove(filepath)\",\n \"def main():\\n print \\\"=\\\" * 78\\n print \\\"%s %s\\\" % (__prog_name__, __version__)\\n debug, input_file_names = check_cli()\\n if not input_file_names:\\n _error(\\\"No input file name found!\\\\n\\\\n%s\\\" % __help__)\\n for input_file_name in input_file_names:\\n print \\\"* Reading\\\", input_file_name\\n file_base_name = os.path.splitext(os.path.basename(input_file_name))[0]\\n file_dir_name = os.path.dirname(input_file_name)\\n sections = {}\\n tex_map = {}\\n with open(input_file_name, 'rU') as in_fd:\\n sections = get_sections(in_fd.read())\\n\\n if debug:\\n write_dump_file(file_dir_name, file_base_name, \\\"sec\\\",\\n {\\\"sections\\\": sections})\\n\\n if not sections:\\n _error(\\\"Nothing could be read from '%s'.\\\\nIs this an Oolite .dat file?\\\" \\\\\\n % input_file_name)\\n\\n # Magically call the 'check' functions\\n for name in sections.keys():\\n f_name = \\\"check_%s\\\" % name.lower()\\n if f_name in globals().keys():\\n if not globals()[f_name](sections):\\n _error(\\\"Number of entries in '%s' section is different as declared!\\\" % name)\\n\\n def get_data(name, sections=sections):\\n \\\"\\\"\\\"Returns the 'data' object from the 'name' one found in the\\n 'sections' one.\\n :sections: dictionary: Object returned by 'get_sections'.\\n :name: string: The name of the section to get the 'data'.\\n Returns a list of 'lines'.\\n \\\"\\\"\\\"\\n return sections.get(name, {}).get(\\\"data\\\", [])\\n\\n oti_file_name = build_file_path(file_dir_name, file_base_name, \\\"oti\\\")\\n tex_map = parse_names(get_data(\\\"NAMES\\\"), oti_file_name)\\n\\n tex_refs, tex_lines_out = parse_textures(get_data(\\\"TEXTURES\\\"))\\n\\n if debug:\\n write_dump_file(file_dir_name, file_base_name, \\\"tex\\\",\\n {\\\"tex_refs\\\": tex_refs,\\n \\\"tex_lines_out\\\": tex_lines_out})\\n\\n # Update the tex_map object if textures indexes and names are both\\n # used in 'TEXTURES'.\\n if sorted(tex_map.keys()) != sorted(tex_refs.get(\\\"named\\\").keys()):\\n tex_map = update_tex_map(tex_map,\\n set(tex_refs[\\\"named\\\"].keys()).difference(tex_map.keys()))\\n\\n if debug:\\n write_dump_file(file_dir_name, file_base_name, \\\"txm\\\",\\n {\\\"tex_map\\\": tex_map})\\n\\n n_verts, vertex_lines_out = parse_vertex(get_data(\\\"VERTEX\\\"))\\n\\n if debug:\\n write_dump_file(file_dir_name, file_base_name, \\\"ver\\\",\\n {\\\"n_verts\\\": n_verts,\\n \\\"vertex_lines_out\\\": vertex_lines_out})\\n\\n n_normals, normals_lines_out = parse_normals(get_data(\\\"NORMALS\\\"))\\n\\n if debug:\\n write_dump_file(file_dir_name, file_base_name, \\\"nor\\\",\\n {\\\"n_normals\\\": n_normals,\\n \\\"normals_lines_out\\\": normals_lines_out})\\n\\n n_faces, faces_groups = parse_faces(get_data(\\\"FACES\\\"), tex_refs,\\n normals_lines_out)\\n\\n if debug:\\n write_dump_file(file_dir_name, file_base_name, \\\"fac\\\",\\n {\\\"n_faces\\\": n_faces,\\n \\\"faces_groups\\\": faces_groups})\\n\\n output_file_name = build_file_path(file_dir_name,\\n file_base_name, 'obj')\\n material_file_name = build_file_path(file_dir_name,\\n file_base_name, 'mtl')\\n mtl_lib_file = os.path.basename(material_file_name)\\n\\n write_obj(output_file_name, file_base_name, mtl_lib_file,\\n tex_lines_out, tex_map, n_verts, vertex_lines_out,\\n n_normals, normals_lines_out, n_faces, faces_groups)\\n\\n write_mtl(material_file_name, tex_map)\\n\\n _exit(\\\"* Done\\\")\",\n \"def test_file_analyzer(self):\\r\\n file_analyzer = FileAnalyzer(\\\"C:\\\\\\\\Users\\\\\\\\Himan\\\\\\\\Desktop\\\\\\\\Semester 2\\\\\\\\SSW 810\\\\\\\\HW\\\\\\\\Assignment 8\\\")\\r\\n self.assertEqual(file_analyzer.files_summary, {'HW08_Himanshu.py': {'class': 1, 'function': 5, 'line': 100, 'char': 4472}, \\\\\\r\\n 'HW08_Test_Himanshu.py': {'class': 1, 'function': 3, 'line': 38, 'char': 1861}})\\r\\n self.assertNotEqual(file_analyzer.files_summary, {'HW08_Himanshu.py': {'class': 0, 'function': 5, 'line': 46, 'char': 1931}})\\r\\n\\r\\n self.assertNotEqual(file_analyzer.files_summary, {'HW08_Himanshu.py': {'class': 1, 'function': 5, 'line': 100}}) # testing less fields\\r\\n\\r\\n with self.assertRaises(FileNotFoundError): # raises exception error\\r\\n FileAnalyzer(\\\"C:\\\\\\\\Users\\\\\\\\Himan\\\\\\\\Desktop\\\\\\\\Semester 2\\\\\\\\SSW 810\\\\\\\\HW\\\\\\\\Assignment 10\\\").files_summary\",\n \"def test_hdf5_reader_dos(data_regression):\\n from masci_tools.io.parsers.hdf5 import HDF5Reader\\n from masci_tools.io.parsers.hdf5.recipes import FleurDOS\\n\\n TEST_BANDDOS_FILE = os.path.join(HDFTEST_DIR, 'banddos_dos.hdf')\\n\\n with open(TEST_BANDDOS_FILE, 'rb') as file:\\n with HDF5Reader(file) as reader:\\n data, attrs = reader.read(recipe=FleurDOS)\\n\\n data_regression.check({'datasets': convert_to_pystd(data), 'attributes': convert_to_pystd(attrs)})\",\n \"def test_main(data, tmp_path):\\n\\n main(data, tmp_path)\\n\\n FILES = (\\n \\\"gd32f888x(0-1)xx-pinctrl.h\\\",\\n \\\"gd32f888x(2-3)xx-pinctrl.h\\\",\\n \\\"gd32f888y(0-1)xx-pinctrl.h\\\",\\n \\\"gd32f999x(0-1)xx-pinctrl.h\\\",\\n \\\"gd32f999x(2-3)xx-pinctrl.h\\\",\\n \\\"gd32f999y(0-1)xx-pinctrl.h\\\",\\n )\\n\\n for file in FILES:\\n ref_file = data / file\\n gen_file = tmp_path / file\\n\\n assert gen_file.exists()\\n\\n with open(ref_file) as ref, open(gen_file) as gen:\\n assert ref.read() == gen.read()\",\n \"def test_GFD_import_from_constructor(self):\\n filepath = '7.txt'\\n original_gfd = flow_processing_input.GroundFlowData()\\n original_gfd.detector_flow_data = createGFDDataset(10).dataset\\n original_gfd.export_to_file(filepath)\\n new_gfd = flow_processing_input.GroundFlowData(filepath)\\n os.remove(filepath)\\n # Check if new_gfd contains the same attributes as the original_gfd\\n self.assertTrue(new_gfd == original_gfd)\",\n \"def test_identify_contents_7(self):\\n Path(self.base_dir, \\\"new_dir1\\\").mkdir()\\n Path(self.base_dir, \\\"new_dir2\\\").mkdir()\\n Path(self.base_dir, \\\"file1.txt\\\").touch()\\n Path(self.base_dir, \\\".DS_Store\\\").touch()\\n list_of_items = basic.identify_contents(self.base_dir, kind=\\\"invalid\\\")\\n self.assertIsNone(list_of_items)\",\n \"def test_whole_file(self):\\n import soundfile\\n import numpy as np\\n\\n data_file_path = \\\"sample-data/flacformats.d2\\\"\\n expected_format = \\\"FLAC\\\"\\n expected_subtype = \\\"PCM_24\\\"\\n\\n # Read the file using standard file I/O\\n sf1 = soundfile.SoundFile(data_file_path)\\n self.assertEqual(sf1.format, expected_format)\\n self.assertEqual(sf1.subtype, expected_subtype)\\n data1 = sf1.read()\\n\\n # Read the file using HTTP\\n with open(data_file_path, \\\"rb\\\") as f:\\n file_content = {\\\"/foo.dat\\\": f.read()}\\n with DummyHTTPServer(file_content) as server:\\n url = server.url(\\\"/foo.dat\\\")\\n file2 = wfdb.io._url.openurl(url, \\\"rb\\\")\\n sf2 = soundfile.SoundFile(file2)\\n self.assertEqual(sf2.format, expected_format)\\n self.assertEqual(sf2.subtype, expected_subtype)\\n data2 = sf2.read()\\n\\n # Check that results are equal\\n np.testing.assert_array_equal(data1, data2)\",\n \"def testGetFile(self):\\n try:\\n remoteLocator = self.__pathPdbxDictionaryFile\\n fn = self.__fileU.getFileName(remoteLocator)\\n # _, fn = os.path.split(remoteLocator)\\n lPath = os.path.join(self.__workPath, fn)\\n ok = self.__fileU.get(remoteLocator, lPath)\\n self.assertTrue(ok)\\n ok = self.__fileU.exists(lPath)\\n self.assertTrue(ok)\\n ok = self.__fileU.isLocal(lPath)\\n self.assertTrue(ok)\\n tPath = self.__fileU.getFilePath(lPath)\\n self.assertEqual(lPath, tPath)\\n ok = self.__fileU.remove(lPath)\\n self.assertTrue(ok)\\n dPath = os.path.join(self.__workPath, \\\"tdir\\\")\\n ok = self.__fileU.mkdir(dPath)\\n self.assertTrue(ok)\\n ok = self.__fileU.remove(dPath)\\n self.assertTrue(ok)\\n ok = self.__fileU.remove(\\\";lakdjf\\\")\\n self.assertTrue(ok)\\n\\n except Exception as e:\\n logger.exception(\\\"Failing with %s\\\", str(e))\\n self.fail()\",\n \"def sniff( self, filename ):\\n handle = open(filename)\\n line = handle.readline()\\n handle.close()\\n first = line.split()\\n\\n # 0 -> ID animal\\n #read fixed effect\\n i=1\\n while (first[i].isalnum() and i<len(first)):\\n i=i+1\\n\\n if ( i >= len(first) ):\\n return False\\n\\n #read cov\\n while ((i+1)<len(first) and not first[i+1].isalnum() ):\\n i=i+1\\n\\n if ( i+1 >= len(first) ):\\n return False\\n\\n #read trait\\n while ((i+1)<len(first) and (i+2)<len(first) and not first[i].isalnum() and first[i+1].isalnum() and first[i+2].isalnum()):\\n i=i+3\\n\\n if ( i != len(first) ):\\n return False\\n\\n return True\",\n \"def test_read_file_to_list():\\n new_file = \\\"Hello,World\\\"\\n data = race.read_file_to_list()\\n assert type(data) == list\\n for x in data:\\n assert type(x) == dict\\n assert len(data) == 33\\n with pytest.raises(FileNotFoundError):\\n Race(new_file).read_file_to_list()\",\n \"def test_open_ped_mismatch(self):\\n \\n self.temp.write('A B 0 0 1 1\\\\n')\\n self.temp.flush()\\n families = open_ped(self.temp.name)\\n \\n fam = Family('A')\\n fam.add_person(Person('A', 'B', '0', '0', '1', '1'))\\n fam.add_person(Person('A', 'C', '0', '0', '1', '1'))\\n \\n self.assertNotEqual(families[0].nodes, fam.nodes)\",\n \"def test_read():\\n f = open('test', mode='r')\\n line = f.read()\\n f.close()\",\n \"def test_two_files():\\n\\n out_file = ''.join(\\n random.choices(string.ascii_uppercase + string.digits, k=5))\\n try:\\n if os.path.isfile(out_file):\\n os.remove(out_file)\\n\\n rv, out = getstatusoutput(f'{prg} -f {tair} {amigo} -o {out_file}')\\n assert rv == 0\\n assert re.search('1: tair_heat.txt', out)\\n assert re.search('2: amigo_heat.txt', out)\\n assert re.search(\\n f'Wrote 20 gene IDs from 2 files to file \\\"{out_file}\\\"', out)\\n assert os.path.isfile(out_file)\\n exp_two = '\\\\n'.join(\\n sorted(\\\"\\\"\\\"\\n AT5G12020 AT3G06400 AT2G33590 AT1G54050 AT5G67030 AT4G14690 AT1G16030 AT5G03720 AT3G10800 \\n AT5G12140 AT1G64280 AT3G24500 AT3G09440 AT3G04120 AT4G19630 AT1G16540 AT2G22360 AT1G13930 \\n AT5G41340 AT3G24520\\n \\\"\\\"\\\".split()))\\n assert open(out_file).read().strip() == exp_two.strip()\\n\\n finally:\\n if os.path.isfile(out_file):\\n os.remove(out_file)\",\n \"def test_GFD_import_wrong_file_unserialized(self):\\n filepath = '6.txt'\\n wrong_file = open(filepath, 'x')\\n wrong_file.write(\\\"This is not a serialized detector flow data\\\")\\n wrong_file.close()\\n # Check if exception was raised for wrong serialization\\n with self.assertRaises(Exception):\\n flow_processing_input.GroundFlowData(filepath)\\n os.remove(filepath)\",\n \"def test_get_file_accessors(self):\\n pass\",\n \"def test_get_file_object(self):\\n pass\",\n \"def test_fileobj_not_closed(self):\\n\\n f = open(self.data('test0.fits'), 'rb')\\n data = fits.getdata(f)\\n assert not f.closed\\n\\n f.seek(0)\\n header = fits.getheader(f)\\n assert not f.closed\",\n \"def read(self):\\n if self.getiddname() is None:\\n errortxt = (\\n \\\"IDD file needed to read the idf file. \\\"\\n \\\"Set it using IDF.setiddname(iddfile)\\\"\\n )\\n raise IDDNotSetError(errortxt)\\n readout = idfreader1(\\n self.idfname, self.iddname, self, commdct=self.idd_info, block=self.block\\n )\\n (self.idfobjects, block, self.model, idd_info, idd_index, idd_version) = readout\\n self.setidd(idd_info, idd_index, block, idd_version)\",\n \"def test_nids_supplemental(fname, truth):\\n f = Level3File(get_test_data(fname))\\n assert f.metadata['delta_time'] == truth[0]\\n assert f.metadata['supplemental_scan'] == truth[1]\",\n \"def test_sanity_ati1():\\n\\n with Image.open(TEST_FILE_ATI1) as im:\\n im.load()\\n\\n assert im.format == \\\"DDS\\\"\\n assert im.mode == \\\"L\\\"\\n assert im.size == (64, 64)\\n\\n assert_image_equal_tofile(im, TEST_FILE_ATI1.replace(\\\".dds\\\", \\\".png\\\"))\",\n \"def F(f):\\n return datafile(f, __name__)\",\n \"def test_file_has_details(self):\\n file_content = bytes(\\n \\\"\\\"\\\"\\n 1001 | Eggs | 12\\\\n\\n 1002 | Bread | 1\\\\n\\n 1003 | Butter | 1\\\\n\\n 1004 | Milk | 1\\\\n\\n 1005 | Corn | 2\\n \\\"\\\"\\\", encoding='UTF-8'\\n )\\n\\n test_file = SimpleUploadedFile(\\n \\\"sample.txt\\\", file_content, content_type=\\\"text/txt\\\")\\n \\n new_file = File.objects.create(\\n file=test_file,\\n rows=5,\\n items='Eggs, Bread, Butter, Milk, Corn'\\n )\\n\\n file_details = File.objects.get(id=new_file.id)\\n self.assertEqual(file_details.file.name, new_file.file.name)\\n self.assertEqual(file_details.rows, new_file.rows)\\n self.assertEqual(file_details.items, new_file.items)\",\n \"def test_open_ped_header(self):\\n \\n self.temp.write('family_id person_id dad mom sex phenotype\\\\n')\\n self.temp.write('A B 0 0 1 1\\\\n')\\n self.temp.flush()\\n families = open_ped(self.temp.name)\\n \\n fam = Family('A')\\n fam.add_person(Person('A', 'B', '0', '0', '1', '1'))\\n \\n self.assertEqual(families[0].nodes, fam.nodes)\",\n \"def OpenDosi(filename=None):\\n\\tglobal dosi, spacing_dosi, dim_x_dosi, dim_y_dosi, dim_z_dosi, dosi_open, isodose_show, origin_dosi, filename_dosi\\n\\tdosi_swapY,dosi_swapZ = False, False\\n\\n\\ttypes = [('All files', '*.dcm *.mhd'), ('DCM files', '*.dcm'), ('MHD files', '*.mhd')]\\n\\n\\tif(filename==None):\\tfile_path = tkFileDialog.askopenfilename(initialdir = dir_ini, filetypes = types)\\n\\telse:\\tfile_path = filename\\n\\n\\tfilename_dosi = file_path\\n\\n\\tprint('Opening RD file ...')\\n\\n\\t### .dcm file ###\\n\\tif(file_path.endswith('.dcm')):\\n\\t\\tds = pydicom.read_file(file_path)\\n\\t\\tds.file_meta.TransferSyntaxUID = pydicom.uid.ImplicitVRLittleEndian \\n\\t\\tscaling_dosi = float(ds.DoseGridScaling)\\n\\t\\tdosi = scaling_dosi*ds.pixel_array\\n\\t\\tsp = ds.PixelSpacing\\n\\t\\tspacing_dosi = [ float(ds.GridFrameOffsetVector[1] - ds.GridFrameOffsetVector[0]), float(sp[1]),float(sp[0])]\\n\\t\\torigin_dosi = ds.ImagePositionPatient\\n\\t\\torigin_dosi = [float(origin_dosi[2]),float(origin_dosi[1]),float(origin_dosi[0])]\\n\\t\\tdosi_swapZ =(ds.ImageOrientationPatient[0:3] == [1, 0, 0])\\n dosi_swapY =(ds.ImageOrientationPatient[3:6] == [0, 1, 0])\\n\\n\\t\\t#if ds.SeriesDescription=='PatientLETScorer [MeV/mm/(g/cm3)]':\\tSetIntensityRange(dosi,0,15)\\n\\n\\t### .mhd file ###\\n\\tif(file_path.endswith('.mhd')):\\t\\n \\t\\titkimage = sitk.ReadImage(file_path) \\t\\t\\t\\t# Reads the image using SimpleITK\\n \\t\\tdosi = sitk.GetArrayFromImage(itkimage)\\n\\t\\tspacing_dosi = np.array(list(reversed(itkimage.GetSpacing()))) \\t# Read the spacing along each dimension\\n\\t\\torigin_dosi = np.array(list(reversed((itkimage.GetOrigin()))))\\t\\t# Read the origin\\n\\t\\ttext_file = open(file_path, \\\"r\\\")\\n\\t\\ttmp = text_file.readlines()\\n\\t\\tdosi_swap = (tmp[8][-4:-1] == 'RAI')\\n\\n\\tif(len(np.shape(volume))==3):\\tdim_x_dosi, dim_y_dosi, dim_z_dosi = np.shape(dosi)[0], np.shape(dosi)[1], np.shape(dosi)[2]\\n\\n\\tif(len(np.shape(volume))==2):\\tdim_x_dosi, dim_y_dosi, dim_z_dosi = np.shape(dosi)[0], np.shape(dosi)[1], 1\\n\\n\\t#print 'dosi type', dosi.dtype\\n\\t\\n\\t# Dealing with image orientation\\n\\tif(dosi_swapY == True):\\n\\t\\tdosi = np.flip(dosi,1) # flip volume\\n\\t\\torigin_dosi[1] = origin_dosi[1] + dim_y_dosi*spacing_dosi[1]\\t\\t\\n\\tif(dosi_swapZ == True):\\n\\t\\tdosi = np.flip(dosi,2) # flip volume\\n\\t\\torigin_dosi[2] = origin_dosi[2] + dim_z_dosi*spacing_dosi[2]\\n\\tif(dosi_swapY == True)and(dosi_swapZ == True):\\n\\t\\tspacing_dosi[1], spacing_dosi[2] = spacing_dosi[2], spacing_dosi[1]\\n\\n print ' dosi_swapY, dosi_swapZ :', dosi_swapY, dosi_swapZ\\n\\n\\tdosi_open = True\\n\\tisodose_show = True\\n\\tcheck1.select()\\n\\tUpdate_all()\\n\\n\\tprint(' file successfully opened!')\",\n \"def test_read(self):\\n self.assertArrayEqual(self.dset['a'], self.data['a'])\",\n \"def test_open_file(self):\\n\\t\\tposition, potential = schrodinger.open_file('potential_energy.dat')\\n\\t\\tself.assertEqual(position, [0.0, 1.57079, 3.14159, 4.71238, 6.28318, 7.85398, 9.42477])\\n\\t\\tself.assertEqual(potential, [0.0, 6.0, 0.0, -6.0, 0.0, 6.0, 0.0])\",\n \"def readOutputfile(filename, verbose=False):\\n\\n # -----------------------------------------------------------------------------\\n # Defining the classes for data structure\\n T_Simulation = namedtuple('Simulation', ['step'])\\n T_Step = namedtuple('Step', ['element', 'node'])\\n\\n T_Displacement = namedtuple('Displacement', ['ux', 'uy'])\\n\\n T_Element = namedtuple('Element', ['gp', 'avstrain', 'avstress', 'eqstrain'])\\n T_GP = namedtuple('GP', ['stress', 'strain'])\\n T_Stresses = namedtuple('Stresses', ['xx', 'yy', 'zz', 'yz', 'zx', 'xy'])\\n T_Strains = namedtuple('Strains', ['xx', 'yy', 'zz', 'yz', 'zx', 'xy'])\\n # -----------------------------------------------------------------------------\\n\\n nSteps = 0 # Simulation step counter\\n\\n SimData = T_Simulation(list())\\n\\n with open(filename) as f:\\n line = f.readline() # Read in the first line of the input file\\n while True: # Loop over all lines of the input file\\n # Read the nodes displacements\\n #line = f.readline()\\n #print(line)\\n if line == 'DofManager output:\\\\n': # String starts a list of nodes displacement information\\n nSteps += 1 # The above string starts a new simulation step\\n line = f.readline() # Cancel ---------- seperator\\n line = f.readline()\\n Nodes = list() # Initialize/clear list of nodes\\n\\n while line != '\\\\n' and line != 'Element output:\\\\n': # Strings that finish the list\\n #\\t\\t\\t\\tnNode = int(line.strip().split()[1]) # Node id\\n line = f.readline()\\n dim1 = float(line.strip().split()[3]) # Displacement dim1\\n line = f.readline()\\n dim2 = float(line.strip().split()[3]) # Displacement dim2\\n Nodes.append(\\n T_Displacement(dim1, dim2)) # Append displacements of the current node to the node list\\n line = f.readline()\\n\\n\\n if verbose:\\n print('Step {}: Dofs completed.\\\\n'.format(nSteps))\\n print('---------------------------------\\\\n')\\n\\n # Read the stresses an strains at Gauss points\\n elif line == 'Element output:\\\\n': # String starts a list elements, GPs, strains and stresses\\n line = f.readline() # Cancel ---------- seperator\\n line = f.readline()\\n Elements = list() # Initialize/clear list of elements\\n\\n while line != '\\\\n' and line != '\\\\tR E A C T I O N S O U T P U T:\\\\n': # Strings that finish the list\\n #\\t\\t\\t\\t\\tnElement = line.strip().split()[2] # Element id\\n line = f.readline()\\n GPs = T_Element(list(), 0, 0, 0) # List of Gauss points\\n\\n while line != '\\\\n' and line.strip().split()[0] == 'GP': # String that starts a new GP\\n #\\t\\t\\t\\t\\t\\tnGP = int(line.strip().split()[1].split('.')[1]) # GP id\\n tmp = [float(i) for i in line.strip().split()[4:10]] # Read the strains\\n strain = T_Strains(tmp[0], tmp[1], tmp[2], tmp[3], tmp[4], tmp[5])\\n line = f.readline()\\n tmp = [float(i) for i in line.strip().split()[1:7]] # Read the stresses\\n stress = T_Stresses(tmp[0], tmp[1], tmp[2], tmp[3], tmp[4], tmp[5])\\n GPs.gp.append(\\n T_GP(stress, strain)) # Append stresses and strains of the current GP to the GP list\\n line = f.readline()\\n\\n\\n Elements.append(GPs) # Append GP list of the current element to the element list\\n\\n if verbose:\\n print('Step {}: GPs completed.\\\\n'.format(nSteps))\\n print('---------------------------------\\\\n')\\n\\n SimData.step.append(T_Step(Elements, Nodes)) # Append element and node list of the current step to the step list\\n #print('the file input ends')\\n #print(nSteps)\\n # only needed with a while loop\\n # Jump over the lines until we reach the next time step (Caught by if-clause)\\n try:\\n line = f.readline() # Will generate an error if files end is reached\\n if line == \\\"\\\":\\n raise EOFError\\n except:\\n if verbose: print(\\\"End of file reached.\\\\n\\\")\\n break # Break the 'while True' loop\\n\\n # -----------------------------------------------------------------------------\\n\\n\\n print('averaging the stress')\\n # Averaging of strains and stress of GPs of each element\\n for istep in range(len(SimData.step)):\\n\\n for ielement in range(len(SimData.step[istep].element)):\\n print(len)\\n # Initialization before each element\\n stresses = np.array([0., 0., 0., 0., 0., 0.])\\n strains = np.array([0., 0., 0., 0., 0., 0.])\\n\\n for igp in range(len(SimData.step[istep].element[ielement])):\\n print(igp)\\n # Add up all data of all GPs\\n #stresses[:] += SimData.step[istep].element[ielement].gp[igp].stress[:]\\n strains[:] += SimData.step[istep].element[ielement].gp[igp].strain[:]\\n\\n # Divide GP sum by number of GPs\\n stresses /= len(SimData.step[istep].element[ielement])\\n strains /= len(SimData.step[istep].element[ielement])\\n # Replace the field (initialized with 0) with new information\\n SimData.step[istep].element[ielement] = SimData.step[istep].element[ielement]._replace(\\n avstress=T_Stresses(stresses[0], stresses[1], stresses[2], stresses[3], stresses[4], stresses[5]))\\n SimData.step[istep].element[ielement] = SimData.step[istep].element[ielement]._replace(\\n avstrain=T_Strains(strains[0], strains[1], strains[2], strains[3], strains[4], strains[5]))\\n print('Analysis finished')\\n return SimData\",\n \"def test_ordinary(self):\\n date = datetime(2016, 11, 12)\\n seq = 36\\n name = star_barcode.barcode_filename(date, seq)\\n self.assertEqual(\\n name,\\n 'Barcode_2016-W45-6_36.pdf'\\n )\",\n \"def test_pert_file(self):\\n path, case = os.path.split(self.ieee14)\\n\\n # --- with pert file ---\\n ss = andes.run('ieee14.raw', pert='pert.py',\\n input_path=path, no_output=True, default_config=True,\\n )\\n ss.TDS.init()\\n self.assertIsNotNone(ss.TDS.callpert)\\n\\n # --- without pert file ---\\n ss = andes.run('ieee14.raw',\\n input_path=path, no_output=True, default_config=True,\\n )\\n ss.TDS.init()\\n self.assertIsNone(ss.TDS.callpert)\",\n \"def test_conversion_lowlevel(path):\\n gff_file = gff.GFFFile.read(join(data_dir(\\\"sequence\\\"), path))\\n ref_entries = [entry for entry in gff_file]\\n\\n gff_file = gff.GFFFile()\\n for entry in ref_entries:\\n gff_file.append(*entry)\\n temp = TemporaryFile(\\\"w+\\\")\\n gff_file.write(temp)\\n\\n temp.seek(0)\\n gff_file = gff.GFFFile.read(temp)\\n temp.close()\\n test_entries = [field for field in gff_file]\\n assert test_entries == ref_entries\",\n \"def test_fileobj_not_closed(self):\\n\\n f = open(self.data(\\\"test0.fits\\\"), \\\"rb\\\")\\n _ = fits.getdata(f)\\n assert not f.closed\\n\\n f.seek(0)\\n _ = fits.getheader(f)\\n assert not f.closed\\n\\n f.close() # Close it now\",\n \"def open_read_write(file_to_open=PROBLEM_FILE):\\n\\n with open(file_to_open, 'r') as working_file:\\n # turns the opened file into a list using a list comprehension\\n working_file = [sentence.strip() for sentence in working_file.readlines()]\\n\\n # iterates through the enumerated file displaying a tuple\\n # of (index, string)\\n for sentence in enumerate(working_file): #iterates through the file\\n if sentence[0] % 2: #Checks to see if the index is divisible by 2\\n print(sentence[1]) #prints the string\",\n \"def test_derivs(self):\\n cr = CaseReader(self.filename)\\n last_case = cr.get_case(-1)\\n self.assertIsNone(last_case.derivs,\\n \\\"Case erroneously contains derivs.\\\")\",\n \"def testFileInRead(self, mockPath):\\n mockPath.return_value = 'bananaphone.ccc'\\n self.node = cdl_convert.ColorCollection(input_file='mybestfile.ccc')\\n\\n mockPath.assert_called_once_with('mybestfile.ccc')\\n\\n self.assertEqual(\\n 'bananaphone.ccc',\\n self.node.file_in\\n )\",\n \"def test_irr_read(irregular_written_data):\\n\\n fp, written = irregular_written_data\\n with openEDF(fp) as reader:\\n arr = reader.read(0)\\n #imprecision due to 2-byte conversion so tolerance set to 1 unit\\n assert np.allclose(written, arr, equal_nan=True, atol=1)\",\n \"def assertState(self, files):\\n\\n for path, expected in files.iteritems():\\n fullpath = os.path.join(self._dir, path)\\n self.assertFile(fullpath, path)\\n with open(fullpath, 'r') as file:\\n actual = file.read() \\n self.assertEqual(actual, expected)\",\n \"def test_make_fna(self):\\r\\n fna_fp = os.path.join(self.sff_dir, 'test.fna')\\r\\n fna_gz_fp = os.path.join(self.gz_sff_dir, 'test_gz.fna')\\r\\n make_fna(self.sff_fp, fna_fp)\\r\\n make_fna(self.sff_gz_fp, fna_gz_fp)\\r\\n self.assertEqual(open(fna_fp).read(), fna_txt)\\r\\n self.assertEqual(open(fna_gz_fp).read(), fna_txt)\",\n \"def read_and_test_file_content(self): # pragma: no cover\\n\\n # We print the CLI header.\\n PyFunceble.CLICore.print_header()\\n\\n with open(self.file, \\\"r\\\", encoding=\\\"utf-8\\\") as file:\\n # We open the file we have to test.\\n\\n for line in self._get_list_to_of_subjects_to_test_from_file(file):\\n # We loop through the file decoded file\\n # content.\\n\\n # We test the line.\\n self._test_line(line)\\n\\n for index, line in self.mining.list_of_mined():\\n # We loop through the list of mined domains\\n # (if the mining subystem is activated.)\\n\\n # We test the line.\\n self._test_line(line)\\n # and remove the currently tested line\\n # from the mining database.\\n self.mining.remove(index, line)\\n\\n for subject in self.get_complements():\\n # We loop through the list of complements.\\n\\n # We test the complement.\\n self._test_line(subject)\\n\\n # We inform all subsystem that we are not testing for complements anymore.\\n self.complements_test_started = False\\n\\n # We update the counters\\n self.autocontinue.update_counters()\\n # We clean the autocontinue subsystem, we finished\\n # the test.\\n self.autocontinue.clean()\\n # We process the autosaving if necessary.\\n self.autosave.process(test_completed=True)\\n # We close the database connection\\n if self.sqlite_db.authorized:\\n self.sqlite_db.connection.close()\\n if self.mysql_db.authorized:\\n self.mysql_db.get_connection().close()\",\n \"def test_fileOperations(self): \\n from DIRAC import gConfig\\n testSE = 'testSE'\\n #rssClient = ResourceStatusClient()\\n #result = rssClient.getStorageElementsList( 'Read' )\\n #result = gConfig.getSections( '/Resources/StorageElements' )\\n #if result['OK'] and result['Value']:\\n # testSE = result['Value'][0]\\n #if result['Ok']:\\n # testSE = result['Value'][ 0 ] \\n \\n result = self.fc.addFile( { testFile: { 'PFN': 'testfile', \\n 'SE': testSE , \\n 'Size':0, \\n 'GUID':0, \\n 'Checksum':'0' } } )\\n self.assert_( result['OK'] )\\n if gConfig.getValue( '/Resources/StorageElements/%s/AccessProtocol.1/Host' % testSE, '' ):\\n result = self.fc.getReplicas( testFile )\\n self.assert_( result['OK'] )\\n self.assert_( testFile in result['Value']['Successful'] )\",\n \"def test_process_file():\\r\\n\\r\\n ## Once you have process_file \\\"working\\\", uncomment the 5 lines starting with\\r\\n ## file1 = \\\"\\\"\\r\\n ## Set kdiffexe to the path to kdiff3.exe on your computer\\r\\n ## Set file1 and file2 to the original and fixed eversion of the files\\r\\n ## This should provide a nice visual comparison of the file with and\\r\\n ## without the fix. In general, this is not a good practice for testing.\\r\\n ## That is, launching an external applicaiton to show the results.\\r\\n ##\\r\\n # file1 = \\\"\\\"\\r\\n # file2 = \\\"\\\"\\r\\n # kdiffexe = '\\\"C:\\\\Program Files\\\\KDiff3\\\\kdiff3.exe\\\"'\\r\\n # cmd = r'{} {} {}'.format(kdiffexe, file1, file2)\\r\\n # os.system(cmd)\\r\\n fh.process_file()\",\n \"def test_read_input_file(self):\\n\\n test_max_digit = 2\\n tuple1 = self.test_raw_tuple\\n tuple2, max_digit = read_input_file(self.test_drug_info_file)\\n self.assertEqual(tuple1, tuple2)\\n self.assertAlmostEqual(max_digit,test_max_digit)\",\n \"def test_can_create_fa_dfl(\\n pages: conftest.UserPages, sample_upload_file: types.FilePayload\\n) -> None:\\n\\n with pages.imp_page() as imp_page:\\n dfl_id = fa_dfl_create(imp_page, sample_upload_file)\\n\\n with pages.ilb_page() as ilb_page:\\n fa_dfl_manage_and_complete_case(ilb_page, dfl_id)\",\n \"def test_file_field():\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.59925705","0.59771883","0.59220266","0.5896933","0.58921814","0.58638084","0.57837987","0.5661089","0.56471264","0.56424177","0.5633926","0.56308526","0.5623441","0.5612273","0.56118274","0.56060433","0.5597619","0.55867624","0.557899","0.5573398","0.55718875","0.55690295","0.55538565","0.5505405","0.5502898","0.5486591","0.5483567","0.54779994","0.5457131","0.5438945","0.54351866","0.542571","0.5408695","0.5378154","0.5374414","0.5358395","0.53453785","0.5344981","0.5336678","0.53346276","0.53280574","0.53259873","0.5317975","0.5317791","0.5310719","0.530913","0.53090686","0.53002834","0.5290266","0.527335","0.52580833","0.52563727","0.52484953","0.5241584","0.5239888","0.52375776","0.523584","0.5234615","0.5233701","0.523055","0.5227521","0.52264696","0.522613","0.52220225","0.5212241","0.5208084","0.52074236","0.52032375","0.5198244","0.519398","0.5193812","0.5192464","0.5180411","0.5176407","0.5174323","0.5172295","0.5172052","0.5171112","0.5168009","0.51648694","0.5158724","0.51578146","0.5153783","0.51517904","0.51502866","0.51492435","0.5147022","0.51268697","0.5114887","0.5114586","0.51124454","0.51059085","0.51056796","0.51006377","0.50991464","0.5094975","0.50931984","0.5092014","0.5088746","0.5086057","0.50845885"],"string":"[\n \"0.59925705\",\n \"0.59771883\",\n \"0.59220266\",\n \"0.5896933\",\n \"0.58921814\",\n \"0.58638084\",\n \"0.57837987\",\n \"0.5661089\",\n \"0.56471264\",\n \"0.56424177\",\n \"0.5633926\",\n \"0.56308526\",\n \"0.5623441\",\n \"0.5612273\",\n \"0.56118274\",\n \"0.56060433\",\n \"0.5597619\",\n \"0.55867624\",\n \"0.557899\",\n \"0.5573398\",\n \"0.55718875\",\n \"0.55690295\",\n \"0.55538565\",\n \"0.5505405\",\n \"0.5502898\",\n \"0.5486591\",\n \"0.5483567\",\n \"0.54779994\",\n \"0.5457131\",\n \"0.5438945\",\n \"0.54351866\",\n \"0.542571\",\n \"0.5408695\",\n \"0.5378154\",\n \"0.5374414\",\n \"0.5358395\",\n \"0.53453785\",\n \"0.5344981\",\n \"0.5336678\",\n \"0.53346276\",\n \"0.53280574\",\n \"0.53259873\",\n \"0.5317975\",\n \"0.5317791\",\n \"0.5310719\",\n \"0.530913\",\n \"0.53090686\",\n \"0.53002834\",\n \"0.5290266\",\n \"0.527335\",\n \"0.52580833\",\n \"0.52563727\",\n \"0.52484953\",\n \"0.5241584\",\n \"0.5239888\",\n \"0.52375776\",\n \"0.523584\",\n \"0.5234615\",\n \"0.5233701\",\n \"0.523055\",\n \"0.5227521\",\n \"0.52264696\",\n \"0.522613\",\n \"0.52220225\",\n \"0.5212241\",\n \"0.5208084\",\n \"0.52074236\",\n \"0.52032375\",\n \"0.5198244\",\n \"0.519398\",\n \"0.5193812\",\n \"0.5192464\",\n \"0.5180411\",\n \"0.5176407\",\n \"0.5174323\",\n \"0.5172295\",\n \"0.5172052\",\n \"0.5171112\",\n \"0.5168009\",\n \"0.51648694\",\n \"0.5158724\",\n \"0.51578146\",\n \"0.5153783\",\n \"0.51517904\",\n \"0.51502866\",\n \"0.51492435\",\n \"0.5147022\",\n \"0.51268697\",\n \"0.5114887\",\n \"0.5114586\",\n \"0.51124454\",\n \"0.51059085\",\n \"0.51056796\",\n \"0.51006377\",\n \"0.50991464\",\n \"0.5094975\",\n \"0.50931984\",\n \"0.5092014\",\n \"0.5088746\",\n \"0.5086057\",\n \"0.50845885\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.0"},"document_rank":{"kind":"string","value":"-1"}}},{"rowIdx":6090,"cells":{"query":{"kind":"string","value":"Made before reading config file (config file located in args.root). Check and normalize root path."},"document":{"kind":"string","value":"def setup_part1(args):\n args.rootarg = args.root\n rootext = os.path.splitext(args.rootarg)[1]\n if rootext == '':\n pass\n else:\n args.root = os.path.dirname(args.root)\n\n if args.root:\n args.root = os.path.abspath(args.root)\n if not os.path.isdir(args.root):\n if args.gallery:\n os.mkdir(args.root)\n else:\n error('Directory not found', args.root)"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["def get_config_file(self):\n\n conf_file = self.args.file\n if conf_file is not None:\n if os.path.isfile(conf_file):\n config_file = open(conf_file, \"r\")\n self.main_file = yaml.load(config_file, Loader=yaml.FullLoader)\n elif os.path.isfile(\n os.path.join(get_path(\"DEFAULT\", \"config_file_path\"), conf_file)\n ):\n fpath = get_path(\"DEFAULT\", \"config_file_path\")\n config_file = open(os.path.join(fpath, conf_file), \"r\")\n self.main_file = yaml.load(config_file, Loader=yaml.FullLoader)\n else:\n self.logger.error(\n colorama.Fore.RED\n + \"ERROR!! Config file '%s' is not present \" % conf_file,\n extra=self.log_detail,\n )\n sys.exit(1)\n else:\n if self.args.hostname and self.args.testfiles:\n temp_dict = {\n \"hosts\": [{\"device\": \"\", \"username\": \"\", \"passwd\": \"\"}],\n \"tests\": [],\n }\n temp_dict[\"hosts\"][0][\"device\"] = self.args.hostname\n temp_dict[\"hosts\"][0][\"username\"] = self.args.login\n temp_dict[\"hosts\"][0][\"passwd\"] = self.args.passwd\n for tfile in self.args.testfiles:\n temp_dict[\"tests\"].append(tfile)\n self.main_file = temp_dict\n\n if (\n self.main_file.__contains__(\"sqlite\")\n and self.main_file[\"sqlite\"]\n and self.main_file[\"sqlite\"][0]\n ):\n self.chk_database(\n self.main_file,\n self.args.pre_snapfile,\n self.args.post_snapfile,\n self.args.check,\n self.args.snap,\n )\n else:\n # if --check option is given for sqlite, then snap file name is not compulsory\n # else exit the function saying arguments not correct\n if self.args.check is True and (\n self.args.pre_snapfile is None or self.args.post_snapfile is None\n ):\n self.logger.error(\n colorama.Fore.RED\n + \"Arguments not given correctly, Please refer help message\",\n extra=self.log_detail,\n )\n self.parser.print_help()\n sys.exit(1)","def pre_config_root_read(self, resource_id):\n pass","def test_load_config_safe(self):\n self.__test_load_config_safe(\".scuba.yml\")","def readConfigFile( self, fileName ):\n try:\n self.analysisBox.readConfig( fileName )\n path, name = os.path.split( fileName )\n self.rsrc.lastFolder = path\n self.console.info( 'Read full config file %s\\n' % fileName )\n except IOError, ValueError:\n self.console.error( 'Error reading full config file %s\\n' % fileName )","def set_rootdir(configdict, config_file):\n if 'rootdir' not in configdict or not configdict['rootdir']:\n configdict['rootdir'] = os.path.dirname(config_file)","def validate_paths(self):\n # When we're started with a *.qemuboot.conf arg assume that image\n # artefacts are relative to that file, rather than in whatever\n # directory DEPLOY_DIR_IMAGE in the conf file points to.\n if self.qbconfload:\n imgdir = os.path.realpath(os.path.dirname(self.qemuboot))\n if imgdir != os.path.realpath(self.get('DEPLOY_DIR_IMAGE')):\n logger.info('Setting DEPLOY_DIR_IMAGE to folder containing %s (%s)' % (self.qemuboot, imgdir))\n self.set('DEPLOY_DIR_IMAGE', imgdir)\n\n # If the STAGING_*_NATIVE directories from the config file don't exist\n # and we're in a sourced OE build directory try to extract the paths\n # from `bitbake -e`\n havenative = os.path.exists(self.get('STAGING_DIR_NATIVE')) and \\\n os.path.exists(self.get('STAGING_BINDIR_NATIVE'))\n\n if not havenative:\n if not self.bitbake_e:\n self.load_bitbake_env()\n\n if self.bitbake_e:\n native_vars = ['STAGING_DIR_NATIVE']\n for nv in native_vars:\n s = re.search('^%s=\"(.*)\"' % nv, self.bitbake_e, re.M)\n if s and s.group(1) != self.get(nv):\n logger.info('Overriding conf file setting of %s to %s from Bitbake environment' % (nv, s.group(1)))\n self.set(nv, s.group(1))\n else:\n # when we're invoked from a running bitbake instance we won't\n # be able to call `bitbake -e`, then try:\n # - get OE_TMPDIR from environment and guess paths based on it\n # - get OECORE_NATIVE_SYSROOT from environment (for sdk)\n tmpdir = self.get('OE_TMPDIR')\n oecore_native_sysroot = self.get('OECORE_NATIVE_SYSROOT')\n if tmpdir:\n logger.info('Setting STAGING_DIR_NATIVE and STAGING_BINDIR_NATIVE relative to OE_TMPDIR (%s)' % tmpdir)\n hostos, _, _, _, machine = os.uname()\n buildsys = '%s-%s' % (machine, hostos.lower())\n staging_dir_native = '%s/sysroots/%s' % (tmpdir, buildsys)\n self.set('STAGING_DIR_NATIVE', staging_dir_native)\n elif oecore_native_sysroot:\n logger.info('Setting STAGING_DIR_NATIVE to OECORE_NATIVE_SYSROOT (%s)' % oecore_native_sysroot)\n self.set('STAGING_DIR_NATIVE', oecore_native_sysroot)\n if self.get('STAGING_DIR_NATIVE'):\n # we have to assume that STAGING_BINDIR_NATIVE is at usr/bin\n staging_bindir_native = '%s/usr/bin' % self.get('STAGING_DIR_NATIVE')\n logger.info('Setting STAGING_BINDIR_NATIVE to %s' % staging_bindir_native)\n self.set('STAGING_BINDIR_NATIVE', '%s/usr/bin' % self.get('STAGING_DIR_NATIVE'))","def __read_config(self):\n with open(self.config_file, 'r') as data_file:\n dict = json.load(data_file)\n self.ibooks_doc_root = dict[\"ibooks_doc_root\"]\n self.library_folder = dict[\"library_folder\"]\n self.annotation_folder = dict[\"annotation_folder\"]\n self.tmp_dir = dict[\"tmp_dir\"]","def init_config():\n config_file = create_config_file.CreateConfigFile()\n config_file.check_if_config_file_exists()","def use_config_file(self):\n self.config_file = self.find_config_file()\n if self.config_file:\n self.apply_config_file(self.config_file)","def init():\n for config_filename in _config_utils.CONFIG_FILENAMES:\n if os.path.isfile(config_filename):\n config_filepath = os.path.abspath(config_filename)\n click.echo(\"found existing config file {}\".format(config_filepath))\n return\n\n config_filepath = _config_utils.create_empty_config_file('.')\n click.echo(\"initialized empty config file {}\".format(config_filepath))","def initialize_paths(self):\n for path in self.config[\"paths\"]:\n self.force_path_to_exist(self.config[\"paths\"][path])","def _check_config(self):","def load_config_file(self, suppress_errors=True):\n self.log.debug(\"Searching %s for config files\", self.config_file_paths)\n base_config = 'jupyter_config'\n try:\n super(JupyterApp, self).load_config_file(\n base_config,\n path=self.config_file_paths,\n )\n except ConfigFileNotFound:\n # ignore errors loading parent\n self.log.debug(\"Config file %s not found\", base_config)\n pass\n\n if self.config_file:\n path, config_file_name = os.path.split(self.config_file)\n else:\n path = self.config_file_paths\n config_file_name = self.config_file_name\n\n if not config_file_name or (config_file_name == base_config):\n return\n\n try:\n super(JupyterApp, self).load_config_file(\n config_file_name,\n path=path\n )\n except ConfigFileNotFound:\n self.log.debug(\"Config file not found, skipping: %s\", config_file_name)\n except Exception:\n # Reraise errors for testing purposes, or if set in\n # self.raise_config_file_errors\n if (not suppress_errors) or self.raise_config_file_errors:\n raise\n self.log.warning(\"Error loading config file: %s\" %\n config_file_name, exc_info=True)","def get_cluster_config_path(root_dir, console_args):\n\n if os.path.isabs(console_args.cluster_config_path):\n return console_args.cluster_config_path\n return os.path.join(root_dir, console_args.cluster_config_path)","def init():\n file_name = 'config.json'\n home_directory_path = str(Path.home())\n config_file_directory = home_directory_path+\"/.config/files/\"\n full_path = config_file_directory + file_name\n\n if os.path.isfile(full_path) and os.access(full_path, os.R_OK): # Readable Config file exists and is valid\n try:\n with open(full_path) as file:\n json_file = json.load(file)\n load_json_and_arguments(json_file)\n\n except ValueError as exception:\n raise ValueError(\"Invalid JSON configuration file\")\n\n elif not os.path.isfile(full_path): # Config file doesn't exist yet, create it\n\n if not os.path.exists(config_file_directory): # Make the directory if that doesn't exist as well\n os.makedirs(config_file_directory)\n\n get_account_info(full_path)\n\n else:\n raise IOError(\"Config file: \" + full_path + \" not accessible\")","def _init_variables(self, config_root):\n if not config_root and 'EXCONF_CONFIG_ROOT' in os.environ:\n config_root = os.environ['EXCONF_CONFIG_ROOT']\n if not config_root and EXCONF_CONFIG_FILE_NAME in os.listdir('.'):\n config_root = '.'\n if not config_root:\n raise ValueError(\"Exconf configuration root not defined. Give -c option, or define \"\n \"environment variable EXCONF_CONFIG_ROOT.\")\n if not EXCONF_CONFIG_FILE_NAME in os.listdir(config_root):\n raise ValueError(\"No {} file found from configuration root: {}\"\n .format(EXCONF_CONFIG_FILE_NAME, config_root))\n config_root = os.path.abspath(config_root)\n exconf_config_file_path = os.path.join(config_root, EXCONF_CONFIG_FILE_NAME)\n LOG.debug(\"Reading Exconf configuration from: {}\", exconf_config_file_path)\n self.config_vars = read_yaml(exconf_config_file_path)\n self.config_vars[EXCONF_VAR_CONFIG_ROOT] = config_root\n self.resolved_vars = None","def do_root(self, line):\n self.root_directory = line\n if self.source_file:\n self.source_file = self.root_directory + \"/\" + self.source_file\n print(f\"Root directory to read & write files is: {line}\")","def __init__(self):\n\n self.root_path = os.path.dirname(os.path.abspath(__file__))[:-5]\n self.config_path = os.path.join(self.root_path, \"files\\\\CONFIG.txt\")\n self.metrics_path = os.path.join(self.root_path, \"files\\\\metrics.txt\")\n\n self.setup_metrics_file()\n\n if self.check_configuration() is False:\n self.setup_configuration_file()","def config(filename, root_path):\n cnf = _config('/etc/%s' % filename)\n if cnf is False:\n filename = os.path.join(root_path, filename)\n cnf = _config(filename)\n return cnf","def _loadconfig(self):\n\n # Get the Topology, from the topology layout file\n topo = {}\n with open(self._autoconfig_filename, \"r\") as stream:\n try:\n topo = yaml.load(stream)\n if \"metadata\" in topo:\n self._metadata = topo[\"metadata\"]\n except yaml.YAMLError as exc:\n raise RuntimeError(\n \"Couldn't read the Auto config file {}.\".format(\n self._autoconfig_filename, exc\n )\n )\n\n systemfile = self._rootdir + self._metadata[\"system_config_file\"]\n if self._clean is False and os.path.isfile(systemfile):\n with open(systemfile, \"r\") as sysstream:\n try:\n systopo = yaml.load(sysstream)\n if \"nodes\" in systopo:\n self._nodes = systopo[\"nodes\"]\n except yaml.YAMLError as sysexc:\n raise RuntimeError(\n \"Couldn't read the System config file {}.\".format(\n systemfile, sysexc\n )\n )\n else:\n # Get the nodes from Auto Config\n if \"nodes\" in topo:\n self._nodes = topo[\"nodes\"]\n\n # Set the root directory in all the nodes\n for i in self._nodes.items():\n node = i[1]\n node[\"rootdir\"] = self._rootdir","def modify_base_buildroot(self):\n if \"'%s '\" % self.buildroot_pkgs != pipes.quote(str(self.buildroot_pkgs)+' '):\n # just different test if it contains only alphanumeric characters allowed in packages name\n raise BuilderError(\"Do not try this kind of attack on me\")\n self.root_conn.module_name = \"lineinfile\"\n self.root_conn.module_args = \"\"\"dest=/etc/mock/%s.cfg line=\"config_opts['chroot_setup_cmd'] = 'install @buildsys-build %s'\" regexp=\"^.*chroot_setup_cmd.*$\" \"\"\" % (self.chroot, self.buildroot_pkgs)\n self.mockremote.callback.log('putting %s into minimal buildroot of %s' % (self.buildroot_pkgs, self.chroot))\n results = self.root_conn.run()\n\n is_err, err_results = check_for_ans_error(results, self.hostname, success_codes=[0],\n return_on_error=['stdout', 'stderr'])\n if is_err:\n self.mockremote.callback.log(\"Error: %s\" % err_results)\n myresults = get_ans_results(results, self.hostname)\n self.mockremote.callback.log(\"%s\" % myresults)","def load_config(self, cfg: ConfigParser):\n log.debug('loading configuration file')\n section = cfg['DEFAULT']\n # use host-specific configuration, if any\n if self.hostname in cfg:\n section = cfg[self.hostname]\n self.path = os.path.abspath(os.path.expanduser(section['repo_dir']))\n self.gpg_key_id = section['gpg_key_id']\n self.ignored_files = section['ignored_files'].split(',')\n self.ignored_files.append('.gitkeep')","def check_config_file():\n # Locate and init config.\n default_config = \"config.json\"\n if len(sys.argv) == 2:\n # config from command line\n app_config = config_reader(sys.argv[1])\n else:\n # config should be in default\n app_config = config_reader(default_config)\n # fin\n if not app_config:\n print(\"Exiting due to invalid config file.\")\n return False\n # fin\n return app_config","def _check(self, config: Dict):\n if 'path' not in config:\n raise FileNotFoundError(\"File not found.\")","def test_no_recognized_root(self):\n result = self.runner.invoke(\n cli,\n [*CLI_LOG_OPTION, \"config\", \"set\", \"wrong_root.agent_name\", \"value\"],\n standalone_mode=False,\n )\n assert result.exit_code == 1\n assert (\n result.exception.message\n == \"The root of the dotted path must be one of: {}\".format(\n ALLOWED_PATH_ROOTS\n )\n )","def load_config(self):\n pass","def __check_config(self):\n if not os.path.exists(self.__config_path):\n return False\n else:\n return True","def setup_config_folder(self):\n\n config_dir = self.config_folder\n \n logging.info(\"using config folder: %s\" % (config_dir))\n if not os.path.isdir(config_dir):\n os.mkdir(config_dir)\n\n try:\n f = open(config_dir + self.wordlist_file,'r')\n except IOError:\n f = open(config_dir + self.wordlist_file,'a+')\n f.close()\n\n try:\n f = open(config_dir + self.score_file,'r')\n except IOError:\n f = open(config_dir + self.score_file,'a+')\n f.close()","def read_config(self, config_filename):","def load_settings_from_file(self, cfg_file):\n \n #\n #\n # TODO\n # Missing settings should not cause exceptions\n #\n #\n #\n\n if not os.path.exists(cfg_file): \n raise Exception('Provided config file [%s] does not exist or cannot be read.' % cfg_file)\n\n import ConfigParser\n config = ConfigParser.ConfigParser()\n config.read(cfg_file)\n \n \n self.reference_root = config.get('Paths','reference-root')\n \n self.scratch_root = os.getcwd()\n try:\n self.scratch_root = config.get('Paths','scratch-root')\n except ConfigParser.NoOptionError:\n self.logger.info('Scratch-root setting is missing. Using current directory: %s' % self.scratch_root)\n\n\n if (self.run_folder != None):\n self.run_id = os.path.basename(self.run_folder)\n else:\n raise Exception('Set runfolder with PipelineConfig.set_runfolder() before loading settings')\n \n \n #\n # TODO\n # needs to be updated on update of settings\n #\n self.runs_scratch_dir = os.path.join(self.scratch_root, self.run_id) if self.run_folder != None else self.scratch_root\n self.logger.info('Run\\'s scratch directory: %s' % self.runs_scratch_dir)\n \n # optional results and fastq archive dirs \n self.results_archive = None\n try:\n self.results_archive = config.get('Paths','results-archive')\n except ConfigParser.NoOptionError:\n self.logger.info('No results-archive provided. Results will not be archived outside of the run\\'s scratch directory.')\n \n self.fastq_archive = None\n try:\n self.fastq_archive = config.get('Paths','fastq-archive')\n except ConfigParser.NoOptionError:\n self.logger.info('No fastq-archive provided. Fastq files will not be archived outside of the run\\'s scratch directory.')\n \n \n # optional /tmp dir\n self.tmp_dir = '/tmp'\n try:\n self.tmp_dir = config.get('Paths','tmp-dir')\n except ConfigParser.NoOptionError:\n self.logger.info('No tmp-dir provided. /tmp will be used.')\n \n \n \n \n # reference files\n self.reference = os.path.join(self.reference_root, config.get('Resources','reference-genome'))\n self.capture = os.path.join(self.reference_root, config.get('Resources','capture-regions-bed'))\n self.capture_qualimap = os.path.join(self.reference_root, config.get('Resources','capture-regions-bed-for-qualimap'))\n self.capture_plus = os.path.join(self.reference_root, config.get('Resources', 'capture-plus-regions-bed'))\n self.gene_coordinates = os.path.join(self.reference_root, config.get('Resources', 'gene-coordinates'))\n \n self.adapters = os.path.join(self.reference_root, config.get('Resources', 'adapters-fasta'))\n \n # tools\n self.bcl2fastq = config.get('Tools','bcl2fastq')\n self.trimmomatic = config.get('Tools','trimmomatic') \n self.bwa = config.get('Tools','bwa')\n self.samtools = config.get('Tools','samtools')\n self.picard = config.get('Tools','picard')\n self.gatk = config.get('Tools','gatk')\n self.freebayes = config.get('Tools','freebayes')\n self.bcftools = config.get('Tools','bcftools')\n self.qualimap = config.get('Tools','qualimap')\n \tself.fastqc\t = config.get('Tools','fastqc')\n\n\n # annovar settings\n self.convert_to_annovar = os.path.join(config.get('Annovar','annovar_home'), \n config.get('Annovar','convert_to_annovar'))\n self.annovar_annotate = os.path.join(config.get('Annovar','annovar_home'),\n config.get('Annovar','annovar_annotate'))\n self.table_annovar = os.path.join(config.get('Annovar','annovar_home'), \n config.get('Annovar','table_annovar'))\n self.annovar_human_db = os.path.join(config.get('Annovar','annovar_home'),\n config.get('Annovar','annovar_human_db'))\n self.annovar_1000genomes_eur = config.get('Annovar','annovar_1000genomes_eur')\n self.annovar_1000genomes_eur_maf_cutoff = config.get('Annovar','annovar_1000genomes_eur_maf_cutoff')\n self.annovar_inhouse_dbs = config.get('Annovar','annovar_inhouse_dbs')\n self.omim_gene_phenotype_map_file = config.get('Annovar','omim_gene_phenotype_map_file')","def init_config(self):\n with open(self.config_file, 'r') as fh:\n self.config = json.load(fh, object_pairs_hook=OrderedDict)\n logger.info('Config loaded: %s' % os.path.abspath(self.config_file))","def init_config(self):\n with open(self.config_file, 'r') as fh:\n self.config = json.load(fh, object_pairs_hook=OrderedDict)\n logger.info('Config loaded: %s' % os.path.abspath(self.config_file))","def parse_config(self):\n # TODO: parse config file\n pass","def __init__(self, config):\n\n self.root = config.root\n self.pidfile = config.pidfile\n self.log_conf = config.logging","def test_config_overwrites():\n basepath = os.path.abspath(os.path.join(os.path.dirname(__file__), \"..\", '..'))\n temppath = '/tmp/'\n\n conf = core.Config(datapath=temppath)\n\n assert conf.basepath.lower() == basepath.lower()\n assert conf.datapath.lower() == temppath.lower()","def test_config(self):\n if self.config.get('base_url')[-1] is '/':\n raise exceptions.ScidashClientWrongConfigException('Remove last '\n 'slash '\n 'from base_url')","def cli(ctx, root):\n try:\n ctx.obj = create_initial_context(root)\n except SettingsBroken as e:\n click.echo(\n 'Failed to read the settings file: %s' % str(e),\n err=True\n )\n exit(1)","def __init__(self, rootdir, filename, clean=False):\n self._autoconfig_filename = rootdir + filename\n self._rootdir = rootdir\n self._metadata = {}\n self._nodes = {}\n self._vpp_devices_node = {}\n self._hugepage_config = \"\"\n self._clean = clean\n self._loadconfig()\n self._sockfilename = \"\"","def __init__(self, file_root):\n self.root = file_root","def __init__(self, cfg_path):\n\t\tself.cfg_path = cfg_path\n\t\tself.cfg_root = self.load_cfg(self.cfg_path)","def __post_init__(self, *args, **kwargs) -> None:\n super().__post_init__(*args, **kwargs)\n\n self._path = Path(source_file).resolve()\n\n super().__init__(length, length)\n\n if not self._path.exists():\n raise ConfigFileError(\n f\"The source file {self.path} does not exist...\")","def __init__(self):\n\n self.path = os.path.dirname(os.path.realpath(__file__)) + '/config.ini'\n self.config = configparser.ConfigParser()\n self.config.read(self.path)","def read( self, filename ):\n conf_file = cfg.ConfigFile(filename)\n self.root_node = conf_file.root_node","def sanitize_config(config):\n\tif not 'dbfile' in config.keys():\n\t\tconfig['dbfile'] = DEFAULTCONFIG['dbfile']\n\tfor path in ['dbfile']:\n\t\tconfig[path]=os.path.expanduser(config[path])\n\treturn config","def parse_args(self, argv):\n super(UpdaterDaemon, self).parse_args(argv)\n\n self.stdout = self.options.log_file\n self.stderr = self.options.error_log\n\n config = self.options.config\n if config is None:\n config = os.path.join(os.path.dirname(__file__), 'config.py')\n config = os.path.normpath(os.path.abspath(config))\n configdir, configfile = os.path.split(config)\n configfile, ext = os.path.splitext(configfile)\n if configdir not in sys.path:\n sys.path.insert(0, configdir)\n self.config = __import__(configfile)","def setUp(self):\n super(LaunchConfigPersonalityTest, self).setUp()\n self.path = '/root/test.txt'","def _set_config():\n\n\tdebug_msg = \"load default config yaml file\"\n\tlogger.debug(debug_msg)\n\n\tconfig_file_parser(paths.CONFIG_FILE, override_options=True)","def _load_config(self, args: argparse.Namespace):\n #\n # Load a config, filename may or may-not be provided...\n #\n try:\n self._config = TortugaScriptConfig.load(args.config)\n\n except ConfigException as ex:\n print(str(ex))\n sys.exit(0)\n\n #\n # Override the config with any provided argument values\n #\n if args.url:\n self._config.url = args.url\n if args.username:\n self._config.username = args.username\n if args.password:\n self._config.password = args.password\n if args.token:\n self._config.token = args.token\n self._config.verify = args.verify","def _find_config_root(self) -> str:\n location = [\"apache2.conf\", \"httpd.conf\", \"conf/httpd.conf\"]\n for name in location:\n if os.path.isfile(os.path.join(self.root, name)):\n return os.path.join(self.root, name)\n raise errors.NoInstallationError(\"Could not find configuration root\")","def __init__(self, config_file):\n \n self.log = logging.getLogger(__name__)\n\n self.parser = ConfigParser.ConfigParser()\n if os.path.exists(config_file) and os.path.isfile(config_file):\n self.parser.read(config_file)\n self.log.debug(\"opened configuration '%s'\" % config_file)\n else:\n raise ConfigError(\"Config file missing\", \"File '%s' doesn't exist.\" % (config_file))\n\n self.config_file = config_file\n self.check_config()","def test_no_recognized_root(self):\n result = self.runner.invoke(\n cli,\n [*CLI_LOG_OPTION, \"config\", \"get\", \"wrong_root.agent_name\"],\n standalone_mode=False,\n )\n assert result.exit_code == 1\n assert (\n result.exception.message\n == \"The root of the dotted path must be one of: {}\".format(\n ALLOWED_PATH_ROOTS\n )\n )","def checkRequiredConfigs(self):\n containmentFolder = self.getAbsContainmentFolder()\n rootFileName = self.app.config.exhale_args[\"rootFileName\"]\n rootFileTitle = self.app.config.exhale_args[\"rootFileTitle\"]\n doxygenStripFromPath = self.app.config.exhale_args[\"doxygenStripFromPath\"]\n\n # validate that the containmentFolder was created\n assert os.path.isdir(containmentFolder)\n # validate that {containmentFolder}/{rootFileName} was created\n assert os.path.isfile(os.path.join(containmentFolder, rootFileName))\n # validate that the title was included\n with open(os.path.join(containmentFolder, rootFileName), \"r\") as root:\n root_contents = root.read()\n root_heading = \"{0}\\n{1}\".format(\n rootFileTitle,\n exhale.utils.heading_mark(rootFileTitle, exhale.configs.SECTION_HEADING_CHAR)\n )\n assert root_heading in root_contents\n\n # TODO: validate doxygenStripFromPath\n if doxygenStripFromPath: # this is only here to avoid a flake8 fail on a todo\n pass","def test_read_namespaced_build_config(self):\n pass","def __setup_config_file_abspath():\n if \"APPDATA\" in os.environ:\n basedir = os.environ[\"APPDATA\"]\n elif \"HOME\" in os.environ:\n basedir = os.environ[\"HOME\"]\n else:\n raise AssertionError(\"APPDATA or HOME env vars must be defined \"\n \"to store config file\")\n abs_dir_path = os.path.join(\n basedir, TestManager.APPDATA_SUBDIRECTORY_NAME)\n os.makedirs(abs_dir_path, exist_ok=True, mode=0o660)\n return os.path.join(abs_dir_path, ConfigManager.CONFIG_FILE_NAME)","def test_create_config_roots(self):\n with self.override_role():\n self._create_config_root()","def __init__(self, filename, dirname='~'):\n self.config = configparser.ConfigParser()\n\n expanded_dirname = os.path.expanduser(dirname)\n self.configuration_filename = os.path.join(expanded_dirname, filename)\n if os.path.isfile(self.configuration_filename):\n self.config.read(self.configuration_filename)","def test_default_config_file_paths(\n config,\n):\n assert \"~/.config/yessssms.conf\" in CONFIG_FILE_PATHS\n assert \"/etc/yessssms.conf\" in CONFIG_FILE_PATHS","def setup_config(self):\n\n try:\n with open('config.json') as f:\n config = json.load(f)\n except FileNotFoundError as e:\n log.debug('{}[*]{} {}'.format(DFbase.LOG_ERROR_COLOR,\n DFbase.LOG_INFO_COLOR, e))\n print('{}[*]{} {}'.format(DFbase.LOG_ERROR_COLOR, \n DFbase.LOG_INFO_COLOR, \n 'Please copy config.json.example to confing.json'))\n return False\n except Exception as e:\n log.debug('{}[*]{} {}'.format(DFbase.LOG_ERROR_COLOR, \n DFbase.LOG_INFO_COLOR, e))\n return False\n\n self.artifacts_path = config['ARTIFACTS']['BASE_PATH'].format(self.container_id)\n self.executable_path = config['ARTIFACTS']['EXECUTABLE_PATH']\n self.executable_path = self.executable_path.replace('BASE_PATH', self.artifacts_path)\n self.diff_files_path = config['ARTIFACTS']['DIFF_FILES_PATH']\n self.diff_files_path = self.diff_files_path.replace('BASE_PATH', self.artifacts_path)\n self.log_journald = (True if config['ARTIFACTS']['LOG_JOURNALD_SERVICE'] == \"TRUE\" else False)\n\n for x_path in [self.artifacts_path, self.executable_path, self.diff_files_path]:\n if not os.path.exists(x_path):\n try:\n os.makedirs(x_path, mode=0o700)\n except Exception as e:\n log.debug('{}[*]{} {}'.format(DFbase.LOG_ERROR_COLOR,\n DFbase.LOG_INFO_COLOR, e))\n print('{}[*]{} {}:{}'.format(DFbase.LOG_ERROR_COLOR,\n DFbase.LOG_INFO_COLOR,\n 'Failed when creating directory', x_path))\n return False\n\n return True","def init_config(self):\n # self.config.read(self.cnfgfile)\n if not self.config.has_section(VERSION_SECTION):\n self.config.add_section(VERSION_SECTION)","def pre_config_root_create(self, resource_dict):\n pass","def setup():\n\tglobal config_parser, config_file\n\tglobal prefix\n\n\tif os.path.islink(sys.argv[0]):\n\t\tlink = os.readlink(sys.argv[0])\n\n\t\tif not os.path.isabs(link):\n\t\t\tlink = os.path.join(os.path.dirname(sys.argv[0]), link)\n\n\t\tprefix = os.path.dirname(os.path.abspath(link))\n\telse:\n\t\tprefix = os.path.dirname(os.path.abspath(sys.argv[0]))\n\n\tconfig_parser = ConfigParser.ConfigParser()\n\tset_defaults()\n\n\tconfig_file = os.path.join (xdg_config_home, \"sushi\", \"nigiri\")\n\n\tif not check_config_file(config_file):\n\t\tprint \"Config file creation failed. Aborting.\"\n\t\treturn\n\n\tread_config_file()","def AutomagicalSettings(self):\n # Try to find gclient or repo root first.\n if not self.options.no_search:\n self.toplevel_root = gclient_utils.FindGclientRoot(self.checkout_root)\n if self.toplevel_root:\n logging.info('Found .gclient at %s' % self.toplevel_root)\n else:\n self.toplevel_root = gclient_utils.FindFileUpwards(\n os.path.join('..', '.repo'), self.checkout_root)\n if self.toplevel_root:\n logging.info('Found .repo dir at %s'\n % os.path.dirname(self.toplevel_root))\n\n # Parse TRYSERVER_* settings from codereview.settings before falling back\n # on setting self.options.root manually further down. Otherwise\n # TRYSERVER_ROOT would never be used in codereview.settings.\n self._GclStyleSettings()\n\n if self.toplevel_root and not self.options.root:\n assert os.path.abspath(self.toplevel_root) == self.toplevel_root\n self.options.root = gclient_utils.PathDifference(self.toplevel_root,\n self.checkout_root)\n else:\n self._GclStyleSettings()","def onLoadConfig(self, inifile):\n cp = ConfigParser(self.defaults)\n cp.readfp(inifile)\n depth = self.getDepth(cp)\n self.baseurl = urljoin(self.inipath, depth)\n # create child loaders for any other l10n.ini files to be included\n try:\n for title, path in cp.items('includes'):\n # skip default items\n if title in self.defaults:\n continue\n # add child config parser\n self.addChild(title, path, cp)\n except NoSectionError:\n pass\n # try to load the \"dirs\" defined in the \"compare\" section\n try:\n self.dirs.extend(cp.get('compare', 'dirs').split())\n except (NoOptionError, NoSectionError):\n pass\n # try getting a top level compare dir, as used for fennec\n try:\n self.tld = cp.get('compare', 'tld')\n # remove tld from comparison dirs\n if self.tld in self.dirs:\n self.dirs.remove(self.tld)\n except (NoOptionError, NoSectionError):\n self.tld = None\n # try to set \"all_path\" and \"all_url\"\n try:\n self.all_path = cp.get('general', 'all')\n self.all_url = urljoin(self.baseurl, self.all_path)\n except (NoOptionError, NoSectionError):\n self.all_path = None\n self.all_url = None\n return cp","def setup_local_config(self, file_path):\n try:\n shutil.copy(file_path, os.path.join(self.rundir, const.LOCAL_CONFIG_FILE))\n except OSError as e:\n raise ContainerError(\"Local config file provided errored out: {}\".format(e))","def _build_config_file_path(cls, filename):\n if os.path.exists(filename):\n return filename\n res = os.path.join(os.path.dirname(__file__), '..', 'config', filename)\n if not os.path.exists(res):\n raise ValueError(\"requested config file %s does not exist!\" % filename)\n return res","def __init__(self, appname):\n self.exepath = '%s' % (os.path.dirname(os.path.realpath(__file__)))\n self.cnfgfile = '%s/versions.cfg' % self.exepath\n self.static_path = '%s/app/static' % self.exepath\n self.config = ConfigParser.RawConfigParser()","def read_config_file(self, path):\n config = configparser.ConfigParser(allow_no_value=True, delimiters=('='))\n config.optionxform = str\n\n if path:\n path_conf = os.path.abspath(path)\n Output.print_information(\"Reading configuration file \" + path_conf, True)\n if not os.path.isfile(path_conf):\n raise InvalidConfigException(\"The specified config file doesn't exist.\")\n config.read(path_conf)\n\n else:\n home_directory = os.path.expanduser(\"~\")\n cwd_conf = os.path.abspath(os.path.join(os.getcwd(), \"cryptodetector.conf\"))\n home_conf = os.path.abspath(os.path.join(home_directory, \"cryptodetector.conf\"))\n\n # Does config file exist in current working directory?\n if os.path.isfile(cwd_conf):\n Output.print_information(\"Reading configuration file \" + cwd_conf, True)\n self.options[\"config_file\"] = cwd_conf\n config.read(cwd_conf)\n\n # Does config file exist in home folder ?\n elif os.path.isfile(home_conf):\n Output.print_information(\"Reading configuration file \" + home_conf, True)\n self.options[\"config_file\"] = home_conf\n config.read(home_conf)\n\n else:\n Output.print_information(\"Didn't find any configuration file. Expect all \" \\\n + \"parameters from the command line.\", True)\n return\n\n for section in [\"settings\", \"methods\"]:\n if section not in config.sections():\n raise InvalidConfigException(\"Invalid configuration file. [\" \\\n + section + \"] section \" + \"is required.\")\n\n for option in self.options:\n\n if isinstance(self.options[option], list):\n option_value = Options.read_array_option(config, option)\n\n elif isinstance(self.options[option], bool):\n option_value = Options.read_boolean_option(config, \"settings\", option)\n\n else:\n option_value = Options.read_string_option(config, \"settings\", option)\n\n if option_value != None:\n self.options[option] = option_value\n\n for option in [\"methods\", \"packages\"]:\n if config.has_section(option):\n self.options[option] = [item for item, _ in config.items(option)]\n\n if self.options[\"output_existing\"] not in [\"rename\", \"overwrite\", \"skip\"]:\n raise InvalidConfigException(\"Invalid config file. In section [settings] \" \\\n + \"output_existing had invalid value '\" + self.options[\"output_existing\"] \\\n + \"'. Its value must be one of three choices: \" \\\n + \"'rename', 'overwrite', and 'skip'.\")\n\n if not self.options[\"methods\"]:\n raise InvalidConfigException(\"Invalid configuration file. There should be one \" \\\n + \"or more items under the [methods] section.\")\n\n methods = self.options[\"methods\"]\n Options.validate_methods(methods)\n\n for method in methods:\n method_class = Options.available_methods()[method]\n\n if not hasattr(method_class, \"options\"):\n continue\n\n for option in method_class.options:\n if isinstance(method_class.options[option], list):\n option_value = Options.read_array_option(config, \"method:\" \\\n + method + \":\" + option)\n\n elif isinstance(method_class.options[option], bool):\n option_value = Options.read_boolean_option(config, \"method:\" + method, option)\n\n else:\n option_value = Options.read_string_option(config, \"method:\" + method, option)\n\n if option_value != None:\n method_class.options[option] = option_value\n self.options[method + \"_\" + option] = option_value","def get_base_config(self):\n\t\tshutit_global.shutit_global_object.yield_to_draw()\n\t\tcp = self.config_parser\n\t\t# TODO: what happens if a command-line arg was already set?\n\t\t# BEGIN Read from config files\n\t\t# build - details relating to the build\n\t\tself.build['privileged'] = cp.getboolean('build', 'privileged')\n\t\tself.build['base_image'] = cp.get('build', 'base_image')\n\t\tself.build['dotest'] = cp.get('build', 'dotest')\n\t\tself.build['net'] = cp.get('build', 'net')\n\t\t# Take a command-line arg if given, else default.\n\t\tif self.build['conn_module'] is None:\n\t\t\tself.build['conn_module'] = cp.get('build', 'conn_module')\n\t\t# target - the target of the build, ie the container\n\t\tself.target['hostname'] = cp.get('target', 'hostname')\n\t\tself.target['ports'] = cp.get('target', 'ports')\n\t\tself.target['volumes'] = cp.get('target', 'volumes')\n\t\tself.target['volumes_from'] = cp.get('target', 'volumes_from')\n\t\tself.target['name'] = cp.get('target', 'name')\n\t\tself.target['rm'] = cp.getboolean('target', 'rm')\n\t\t# host - the host on which the shutit script is run\n\t\tself.host['add_shutit_to_path'] = cp.getboolean('host', 'add_shutit_to_path')\n\t\tself.host['docker_executable'] = cp.get('host', 'docker_executable')\n\t\tself.host['dns'] = cp.get('host', 'dns')\n\t\tself.host['password'] = cp.get('host', 'password')\n\t\tif isinstance(self.host['password'],str):\n\t\t\tshutit_global.shutit_global_object.secret_words_set.add(self.host['password'])\n\t\tself.logfile = cp.get('host', 'logfile')\n\t\tself.host['shutit_module_path'] = cp.get('host', 'shutit_module_path').split(':')\n\n\t\t# repository - information relating to docker repository/registry\n\t\tself.repository['name'] = cp.get('repository', 'name')\n\t\tself.repository['server'] = cp.get('repository', 'server')\n\t\tself.repository['push'] = cp.getboolean('repository', 'push')\n\t\tself.repository['tag'] = cp.getboolean('repository', 'tag')\n\t\tself.repository['export'] = cp.getboolean('repository', 'export')\n\t\tself.repository['save'] = cp.getboolean('repository', 'save')\n\t\tself.repository['suffix_date'] = cp.getboolean('repository', 'suffix_date')\n\t\tself.repository['suffix_format'] = cp.get('repository', 'suffix_format')\n\t\tself.repository['user'] = cp.get('repository', 'user')\n\t\tself.repository['password'] = cp.get('repository', 'password')\n\t\tif isinstance(self.repository['password'],str):\n\t\t\tshutit_global.shutit_global_object.secret_words_set.add(self.repository['password'])\n\t\tself.repository['email'] = cp.get('repository', 'email')\n\t\tself.repository['tag_name'] = cp.get('repository', 'tag_name')\n\t\t# END Read from config files\n\n\t\t# BEGIN tidy configs up\n\t\tif self.target['docker_image'] == '':\n\t\t\tself.target['docker_image'] = self.build['base_image']\n\t\t# END tidy configs up\n\n\t\t# FAILS begins\n\t\t# rm is incompatible with repository actions\n\t\tif self.target['rm'] and (self.repository['tag'] or self.repository['push'] or self.repository['save'] or self.repository['export']): # pragma: no cover\n\t\t\tshutit_global.shutit_global_object.shutit_print(\"Can't have [target]/rm and [repository]/(push/save/export) set to true\")\n\t\t\tshutit_global.shutit_global_object.handle_exit(exit_code=1)\n\t\tif self.target['hostname'] != '' and self.build['net'] != '' and self.build['net'] != 'bridge': # pragma: no cover\n\t\t\tshutit_global.shutit_global_object.shutit_print('\\n\\ntarget/hostname or build/net configs must be blank\\n\\n')\n\t\t\tshutit_global.shutit_global_object.handle_exit(exit_code=1)\n\t\t# FAILS ends","def _validate_config(self):\n pass","def init_config():\n try:\n initConfig()\n click.echo(\"Submarine CLI Config initialized\")\n except AttributeError as err:\n click.echo(err)","def __init__(self, config_file='/etc/sfa/ldap_config.py'):\n\n try:\n execfile(config_file, self.__dict__)\n\n self.config_file = config_file\n # path to configuration data\n self.config_path = os.path.dirname(config_file)\n except IOError:\n raise IOError, \"Could not find or load the configuration file: %s\" \\\n % config_file","def test_config_from_file(self):\n parser = Parser()\n args = parser.parser.parse_args(['-c'])\n if args.config:\n config = Config()\n config.config_file = \"./config\"\n config.config = test_config\n config.config_from_file()\n self.assertTrue(config.config)\n os.remove(config.config_file)","def _loadConfig(self):\n self._packRoot = getattr(sys, \"_MEIPASS\", path.abspath(path.dirname(__file__)))\n rootDir = path.abspath(path.join(self._packRoot, path.pardir))\n logger.debug(\"MOTools root dir is: %s\" % rootDir)\n\n metConf = path.join(rootDir, \"met_config\", \"met_config.json\")\n mainConf = path.join(rootDir, \"main_config.json\")\n userConf = path.join(rootDir, \"user_config.json\")\n\n self._confData = {\n \"MET\": {\"path\": metConf, \"config\": {}, \"loaded\": False},\n \"MAIN\": {\"path\": mainConf, \"config\": {}, \"loaded\": False},\n \"USER\": {\"path\": userConf, \"config\": {}, \"loaded\": False},\n }\n\n for confGroup in self._confData:\n confFile = self._confData[confGroup][\"path\"]\n logger.debug(\"Loading %s config file\" % confGroup)\n if path.isfile(confFile):\n jsonData = {}\n try:\n with open(confFile, mode=\"r\") as inFile:\n jsonData = json.loads(inFile.read())\n if \"config\" in jsonData:\n self._confData[confGroup][\"config\"] = jsonData[\"config\"]\n self._confData[confGroup][\"loaded\"] = True\n except Exception as e:\n logger.error(\"Failed to parse config JSON data.\")\n logger.error(str(e))\n return False\n else:\n logger.debug(\"No file: %s\" % confFile)\n\n # if not self._confData[\"MAIN\"][\"loaded\"]:\n # logger.error(\"Failed to load minimum configuration file main_config.json.\")\n # raise RuntimeError\n\n return","def __init__(self):\n super().__init__()\n\n etc_conf_names = ('app.conf', 'app.local.conf')\n conf_paths = [os.path.join(APP_DIR, 'etc', c) for c in etc_conf_names]\n\n user_config_path = os.path.join(\n os.path.expanduser('~'),\n '.config',\n 'url_manager.conf'\n )\n conf_paths.append(user_config_path)\n\n self.read(conf_paths)\n self.set('DEFAULT', 'app_dir', APP_DIR)","def init_config():\n cf = ConfigParser.ConfigParser()\n try :\n cf.read(CONFIG_FILE)\n except os.errno:\n Log.e(TAG, \"Open configuration file error!\")\n return False\n try :\n SW_CONFIG['7zpath'] = cf.get(\"dir_config\", \"7zpath\")\n SW_CONFIG['sharefolder'] = cf.get(\"dir_config\", \"sharefolder\")\n SW_CONFIG['distpath'] = cf.get(\"dir_config\", \"distpath\")\n SW_CONFIG['sw_version'] = cf.get(\"sw_config\", \"version\")\n SW_CONFIG['startup'] = cf.get(\"sw_config\", \"startup\")\n except ConfigParser.Error:\n Log.e(DEBUG_TAG, \"Config file parse error!\")\n clean()\n return False\n try :\n RUN_CONFIG['backup'] = (cf.get(\"run_config\", \"backup\") == \"True\")\n RUN_CONFIG['pop'] = (cf.get(\"run_config\", \"pop\") == \"True\")\n except ConfigParser.Error:\n Log.e(TAG, \"no run config in config file!\")\n RUN_CONFIG['backup'] = False\n RUN_CONFIG['pop'] = False\n try :\n for option in cf.options(\"hook_config\"): \n HOOK_CONFIG[option] = cf.get(\"hook_config\", option)\n except ConfigParser.Error:\n Log.e(TAG, \"No hook config in config file!\")\n if not os.path.exists(SW_CONFIG['sharefolder']):\n try:\n os.makedirs(SW_CONFIG['sharefolder'])\n except os.error:\n print \"Can't create the local folder:\" + SW_CONFIG['distpath'] + \", Please set another one\"\n clean()\n exit()\n if not os.path.exists(SW_CONFIG['distpath']):\n try:\n os.makedirs(SW_CONFIG['distpath'])\n except os.error:\n print \"Can't create the share folder:\" + SW_CONFIG['sharefolder'] + \" temp directory!\"\n clean()\n os.system(\"pause\")\n exit()\n return True","def init_config(self):\n pass","def _load_config():\n\tcfg = configparser.ConfigParser()\n\tcfg.read(os.path.join(get_current_directory(), 'citi.config'))\n\treturn cfg","def __init__(self, config_path, normalize=False):\n self.config = {}\n _config_dict = {}\n self._config_path = Utils.expand_path(config_path)\n self.update = None\n self.normalize = normalize","def set_root(self):\n config_dir = os.path.expanduser(\"~/.local/shs\")\n config_file = os.path.join(config_dir, \"shs_gui.cfg\")\n # check the file and create one if it's not there\n if not os.path.isfile(config_file):\n os.makedirs(config_dir)\n open(config_file, 'w').close()\n config = ConfigParser.ConfigParser()\n config.read(config_file)\n # if config exists and has needed option\n if config.has_option(\"general\", \"root_dir\"):\n return config.get(\"general\", \"root_dir\")\n # make config\n if not config.has_section(\"general\"):\n config.add_section(\"general\")\n dlg = wx.DirDialog(self, \"Select root directory\")\n if dlg.ShowModal() == wx.ID_OK:\n root_dir = dlg.GetPath()\n config.set(\"general\", \"root_dir\", root_dir)\n else:\n sys.exit(1)\n with open(config_file, 'w') as f:\n config.write(f)\n return root_dir","def test_load(yaml_config_file):\n config = Config()\n config.load(PATH_FILE_CONFIG)\n assert config.backup_root_directory == yaml_config_file.backup\n assert config.docker_compose_wordpress_project_directory == yaml_config_file.docker_compose_wordpress_project","def __init__(self, path_to_config_file):\n self.file_path = path_to_config_file","def test_load_configuration_loads_main_file():\n config.load_configuration(main_configuration_path)\n assert config.get('test.nested.path.value') == 'test value'","def test_find_config_cur_dir(self, in_tmp_path):\n with open(\".scuba.yml\", \"w\") as f:\n f.write(\"image: bosybux\\n\")\n\n path, rel, _ = scuba.config.find_config()\n assert_paths_equal(path, in_tmp_path)\n assert_paths_equal(rel, \"\")","def initialize(self):\n \n if not readconf.check_file_config(self.config):\n return False\n\n # access fields from the .ini file as named properties in self.config, e.g.\n # an .ini field named host is accessed as self.config['host']\n\n self.pointer=utils.read_file_ptr(self.config)\n \n return True","def __init__(self):\n self.filename = pathlib.Path(__file__).parent.absolute().__str__() + '/../../data/config.ini'\n self.data = ConfigParser()\n self.data.read(self.filename)","def setup_config(self, args=None):\n self.config_parse(args=args)","def test_find_config_parent_dir(self, in_tmp_path):\n with open(\".scuba.yml\", \"w\") as f:\n f.write(\"image: bosybux\\n\")\n\n os.mkdir(\"subdir\")\n os.chdir(\"subdir\")\n\n # Verify our current working dir\n assert_paths_equal(os.getcwd(), in_tmp_path.joinpath(\"subdir\"))\n\n path, rel, _ = scuba.config.find_config()\n assert_paths_equal(path, in_tmp_path)\n assert_paths_equal(rel, \"subdir\")","def __init__(self, rootPath=None):\n self.rootPath = rootPath or '.'","def config():\n global base_dir, log_path\n\n # Set paths\n base_dir = os.path.dirname(os.path.realpath(__file__))\n cfg.path = base_dir + '/config.json'\n log_path = base_dir + '/log.log'\n\n # Start logging\n logging.basicConfig(filename=log_path, format='%(asctime)-16s | %(levelname)-5s | %(message)s', level=logging.DEBUG)\n sys.excepthook = _excepthook\n\n # Load configuration\n cfg.load()\n logging.info('Loaded configuration')\n\n # Print configuration and check if is complete\n cfg.print()\n if not cfg.check:\n logging.info('Exiting...')\n sys.exit(1)","def config_file_setup(logger, cf_label, cf_from_cli=None):\n presta_config_dir = os.path.join(user_config_dir(__appname__))\n config_file_from_home = os.path.join(presta_config_dir, cf_label)\n\n if not path_exists(config_file_from_home, logger, force=False):\n logger.info('Creating config path {}'.format(presta_config_dir))\n ensure_dir(presta_config_dir)\n config_file_path = '/'.join(['config', cf_label])\n config_file_from_package = resource_filename(__appname__,\n config_file_path)\n copyfile(config_file_from_package, config_file_from_home)\n\n config_file_paths = []\n if cf_from_cli and path_exists(cf_from_cli, logger, force=False):\n config_file_paths.append(WeightedPath(cf_from_cli, 0))\n if path_exists(config_file_from_home, logger, force=False):\n config_file_paths.append(WeightedPath(config_file_from_home, 1))\n\n logger.debug(\"config file paths: {}\".format(config_file_paths))\n\n config_file_path = sorted(config_file_paths)[0].path\n logger.info('Reading configuration from {}'.format(config_file_path))\n return config_file_path","def check_arg_path(self, p):\n if p.endswith('.qemuboot.conf'):\n self.qemuboot = p\n self.qbconfload = True\n elif re.search('\\.bin$', p) or re.search('bzImage', p) or \\\n re.search('zImage', p) or re.search('vmlinux', p) or \\\n re.search('fitImage', p) or re.search('uImage', p):\n self.kernel = p\n elif os.path.exists(p) and (not os.path.isdir(p)) and '-image-' in os.path.basename(p):\n self.rootfs = p\n # Check filename against self.fstypes can hanlde <file>.cpio.gz,\n # otherwise, its type would be \"gz\", which is incorrect.\n fst = \"\"\n for t in self.fstypes:\n if p.endswith(t):\n fst = t\n break\n if not fst:\n m = re.search('.*\\.(.*)$', self.rootfs)\n if m:\n fst = m.group(1)\n if fst:\n self.check_arg_fstype(fst)\n qb = re.sub('\\.' + fst + \"$\", '', self.rootfs)\n qb = '%s%s' % (re.sub('\\.rootfs$', '', qb), '.qemuboot.conf')\n if os.path.exists(qb):\n self.qemuboot = qb\n self.qbconfload = True\n else:\n logger.warn(\"%s doesn't exist\" % qb)\n else:\n raise Exception(\"Can't find FSTYPE from: %s\" % p)\n\n elif os.path.isdir(p) or re.search(':', p) and re.search('/', p):\n if self.is_deploy_dir_image(p):\n logger.info('DEPLOY_DIR_IMAGE: %s' % p)\n self.set(\"DEPLOY_DIR_IMAGE\", p)\n else:\n logger.info(\"Assuming %s is an nfs rootfs\" % p)\n self.check_arg_nfs(p)\n elif os.path.basename(p).startswith('ovmf'):\n self.ovmf_bios.append(p)\n else:\n raise Exception(\"Unknown path arg %s\" % p)","def setUp(self):\n self._wiki = None\n self._app = None\n self.rootdir = mkdtemp()\n self.create_file(u'config.py', self.config_content)","def get_hosts(self):\n self.logger.debug(colorama.Fore.BLUE +\n \"jsnapy.cfg file location used : %s\" %\n get_config_location(), extra=self.log_detail)\n self.logger.debug(colorama.Fore.BLUE +\n \"Configuration file location used : %s\" %\n get_path('DEFAULT', 'config_file_path'), extra=self.log_detail)\n \n if self.args.pre_snapfile is not None:\n output_file = self.args.pre_snapfile\n elif self.args.snapcheck is True and self.args.pre_snapfile is None:\n output_file = \"snap_temp\"\n self.snap_del = True\n else:\n output_file = \"\"\n conf_file = self.args.file\n check = self.args.check\n snap = self.args.snap\n if conf_file is not None:\n if os.path.isfile(conf_file):\n config_file = open(conf_file, 'r')\n self.main_file = yaml.load(config_file)\n elif os.path.isfile(os.path.join(get_path('DEFAULT', 'config_file_path'), conf_file)):\n fpath = get_path('DEFAULT', 'config_file_path')\n config_file = open(os.path.join(fpath, conf_file), 'r')\n self.main_file = yaml.load(config_file)\n else:\n self.logger.error(\n colorama.Fore.RED +\n \"ERROR!! Config file '%s' is not present \" %\n conf_file, extra=self.log_detail)\n sys.exit(1)\n else:\n if self.args.hostname and self.args.testfiles:\n temp_dict = {'hosts':[{'device':'', 'username':'', 'passwd':''}], 'tests':[]}\n temp_dict['hosts'][0]['device'] = self.args.hostname\n temp_dict['hosts'][0]['username'] = self.args.login\n temp_dict['hosts'][0]['passwd'] = self.args.passwd\n for tfile in self.args.testfiles:\n temp_dict['tests'].append(tfile)\n self.main_file = temp_dict\n\n\n #### if --check option is given for sqlite, then snap file name is not compulsory ####\n #### else exit the function saying arguments not correct ####\n if self.main_file.__contains__(\n 'sqlite') and self.main_file['sqlite'] and self.main_file['sqlite'][0]:\n self.chk_database(\n self.main_file,\n self.args.pre_snapfile,\n self.args.post_snapfile,\n check,\n snap)\n else:\n if (self.args.check is True and (\n self.args.file is None or self.args.pre_snapfile is None or self.args.post_snapfile is None)):\n self.logger.error(colorama.Fore.RED +\n \"Arguments not given correctly, Please refer help message\",\n extra=self.log_detail)\n self.parser.print_help()\n sys.exit(1)\n self.login(output_file)","def _real_paths(config):\n for key in ('--config', '--ffmpeg-bin', '--log', '--music-source', '--working-dir'):\n if not config[key]:\n continue\n config[key] = os.path.realpath(os.path.expanduser(config[key]))","def pre_process_information(self):\n self.logger.debug(\n colorama.Fore.BLUE\n + \"jsnapy.cfg file location used : %s\" % get_config_location(),\n extra=self.log_detail,\n )\n self.logger.debug(\n colorama.Fore.BLUE\n + \"Configuration file location used : %s\"\n % get_path(\"DEFAULT\", \"config_file_path\"),\n extra=self.log_detail,\n )","def __init__(self, root_path):\r\n self.root_path = root_path\r\n if not os.path.exists(root_path):\r\n os.makedirs(root_path)","def readConfigFile(self):\n self.config_obj = ConfigParser.ConfigParser()\n self.config_obj.readfp(open(self.configfile))\n\n # Set the log file\n if (not self.args_obj.log_file and self.config_obj.has_option('DEFAULT','logfile')):\n self.logfile = self.config_obj.get('DEFAULT', 'logfile')\n\n # Set the baud rate\n if (not self.args_obj.baud_rate and self.config_obj.has_option('DEFAULT','baud')):\n self.baudrate = self.config_obj.get('DEFAULT', 'baud')\n\n # Set the device port \n if (not self.args_obj.device and self.config_obj.has_option('DEFAULT','device')):\n self.device = self.config_obj.get('DEFAULT', 'device')\n\n # Set the connection timeout\n if (not self.args_obj.timeout and self.config_obj.has_option('DEFAULT','timeout')):\n self.timeout = self.config_obj.get('DEFAULT','timeout')\n\n if DEBUG:\n print('(DEBUG) Config Options:')\n self.pp.pprint(self.config_obj.sections())","def __init__(self, config_path=None):\n config_path = config_path or CONF.api_paste_config\n if os.path.exists(config_path):\n self.config_path = config_path\n else:\n self.config_path = CONF.find_file(config_path)","def _prep_test(self):\n if not os.path.isfile(self.confpath):\n LOGGER.error(\"Conf file not valid: %s\", self.confpath)\n if not os.path.isfile(self.testlist):\n LOGGER.error(\"testlist file not valid: %s\", self.testlist)","def test_ignore_non_configs_from_current_dir(tmp_path: pathlib.Path) -> None:\n\n cli.startup(tmp_path)\n\n junk_config = tmp_path / \"myconfig.psd\"\n junk_config.touch()\n conf = tmp_path / \"watmyconfig.json\"\n conf.touch()\n configs_found = in_dir(tmp_path)\n assert len(configs_found) == 1","def _init_config(self, configPath=None):\n # TODO: The SafeConfigParser class has been renamed to ConfigParser in Python 3.2.\n # This alias will be removed in future versions.\n # We still use SafeConfigParser for backwards compatibility with Python 2.\n self.config = SafeConfigParser()\n # Make option names case sensitive\n self.config.optionxform = str\n\n if configPath and os.path.isdir(configPath):\n configDir = configPath\n else:\n configDir = os.path.join(os.path.dirname(os.path.realpath(__file__)), 'conf')\n\n # List filenames in configDir alphabetically\n _, _, configFiles = next(os.walk(configDir))\n configFiles = sorted(configFiles, key=str.lower)\n\n # Read configuration pipeline\n for f in configFiles:\n with open(os.path.join(configDir, f)) as configFile:\n self.config.readfp(configFile)\n self._store_config_pass()\n\n if configPath and os.path.isfile(configPath):\n self.config.read(configPath)\n self._store_config_pass()\n\n appSection = 'application'\n self.appName = self._get_option_value(appSection, 'appName')\n self.appResource = self._get_option_value(appSection, 'appResource')\n self.appArgs = []\n appArgs = self._get_option_value(appSection, 'appArgs')\n if appArgs:\n self.appArgs = appArgs.split(' ')\n self.mainClass = self._get_option_value(appSection, 'mainClass')"],"string":"[\n \"def get_config_file(self):\\n\\n conf_file = self.args.file\\n if conf_file is not None:\\n if os.path.isfile(conf_file):\\n config_file = open(conf_file, \\\"r\\\")\\n self.main_file = yaml.load(config_file, Loader=yaml.FullLoader)\\n elif os.path.isfile(\\n os.path.join(get_path(\\\"DEFAULT\\\", \\\"config_file_path\\\"), conf_file)\\n ):\\n fpath = get_path(\\\"DEFAULT\\\", \\\"config_file_path\\\")\\n config_file = open(os.path.join(fpath, conf_file), \\\"r\\\")\\n self.main_file = yaml.load(config_file, Loader=yaml.FullLoader)\\n else:\\n self.logger.error(\\n colorama.Fore.RED\\n + \\\"ERROR!! Config file '%s' is not present \\\" % conf_file,\\n extra=self.log_detail,\\n )\\n sys.exit(1)\\n else:\\n if self.args.hostname and self.args.testfiles:\\n temp_dict = {\\n \\\"hosts\\\": [{\\\"device\\\": \\\"\\\", \\\"username\\\": \\\"\\\", \\\"passwd\\\": \\\"\\\"}],\\n \\\"tests\\\": [],\\n }\\n temp_dict[\\\"hosts\\\"][0][\\\"device\\\"] = self.args.hostname\\n temp_dict[\\\"hosts\\\"][0][\\\"username\\\"] = self.args.login\\n temp_dict[\\\"hosts\\\"][0][\\\"passwd\\\"] = self.args.passwd\\n for tfile in self.args.testfiles:\\n temp_dict[\\\"tests\\\"].append(tfile)\\n self.main_file = temp_dict\\n\\n if (\\n self.main_file.__contains__(\\\"sqlite\\\")\\n and self.main_file[\\\"sqlite\\\"]\\n and self.main_file[\\\"sqlite\\\"][0]\\n ):\\n self.chk_database(\\n self.main_file,\\n self.args.pre_snapfile,\\n self.args.post_snapfile,\\n self.args.check,\\n self.args.snap,\\n )\\n else:\\n # if --check option is given for sqlite, then snap file name is not compulsory\\n # else exit the function saying arguments not correct\\n if self.args.check is True and (\\n self.args.pre_snapfile is None or self.args.post_snapfile is None\\n ):\\n self.logger.error(\\n colorama.Fore.RED\\n + \\\"Arguments not given correctly, Please refer help message\\\",\\n extra=self.log_detail,\\n )\\n self.parser.print_help()\\n sys.exit(1)\",\n \"def pre_config_root_read(self, resource_id):\\n pass\",\n \"def test_load_config_safe(self):\\n self.__test_load_config_safe(\\\".scuba.yml\\\")\",\n \"def readConfigFile( self, fileName ):\\n try:\\n self.analysisBox.readConfig( fileName )\\n path, name = os.path.split( fileName )\\n self.rsrc.lastFolder = path\\n self.console.info( 'Read full config file %s\\\\n' % fileName )\\n except IOError, ValueError:\\n self.console.error( 'Error reading full config file %s\\\\n' % fileName )\",\n \"def set_rootdir(configdict, config_file):\\n if 'rootdir' not in configdict or not configdict['rootdir']:\\n configdict['rootdir'] = os.path.dirname(config_file)\",\n \"def validate_paths(self):\\n # When we're started with a *.qemuboot.conf arg assume that image\\n # artefacts are relative to that file, rather than in whatever\\n # directory DEPLOY_DIR_IMAGE in the conf file points to.\\n if self.qbconfload:\\n imgdir = os.path.realpath(os.path.dirname(self.qemuboot))\\n if imgdir != os.path.realpath(self.get('DEPLOY_DIR_IMAGE')):\\n logger.info('Setting DEPLOY_DIR_IMAGE to folder containing %s (%s)' % (self.qemuboot, imgdir))\\n self.set('DEPLOY_DIR_IMAGE', imgdir)\\n\\n # If the STAGING_*_NATIVE directories from the config file don't exist\\n # and we're in a sourced OE build directory try to extract the paths\\n # from `bitbake -e`\\n havenative = os.path.exists(self.get('STAGING_DIR_NATIVE')) and \\\\\\n os.path.exists(self.get('STAGING_BINDIR_NATIVE'))\\n\\n if not havenative:\\n if not self.bitbake_e:\\n self.load_bitbake_env()\\n\\n if self.bitbake_e:\\n native_vars = ['STAGING_DIR_NATIVE']\\n for nv in native_vars:\\n s = re.search('^%s=\\\"(.*)\\\"' % nv, self.bitbake_e, re.M)\\n if s and s.group(1) != self.get(nv):\\n logger.info('Overriding conf file setting of %s to %s from Bitbake environment' % (nv, s.group(1)))\\n self.set(nv, s.group(1))\\n else:\\n # when we're invoked from a running bitbake instance we won't\\n # be able to call `bitbake -e`, then try:\\n # - get OE_TMPDIR from environment and guess paths based on it\\n # - get OECORE_NATIVE_SYSROOT from environment (for sdk)\\n tmpdir = self.get('OE_TMPDIR')\\n oecore_native_sysroot = self.get('OECORE_NATIVE_SYSROOT')\\n if tmpdir:\\n logger.info('Setting STAGING_DIR_NATIVE and STAGING_BINDIR_NATIVE relative to OE_TMPDIR (%s)' % tmpdir)\\n hostos, _, _, _, machine = os.uname()\\n buildsys = '%s-%s' % (machine, hostos.lower())\\n staging_dir_native = '%s/sysroots/%s' % (tmpdir, buildsys)\\n self.set('STAGING_DIR_NATIVE', staging_dir_native)\\n elif oecore_native_sysroot:\\n logger.info('Setting STAGING_DIR_NATIVE to OECORE_NATIVE_SYSROOT (%s)' % oecore_native_sysroot)\\n self.set('STAGING_DIR_NATIVE', oecore_native_sysroot)\\n if self.get('STAGING_DIR_NATIVE'):\\n # we have to assume that STAGING_BINDIR_NATIVE is at usr/bin\\n staging_bindir_native = '%s/usr/bin' % self.get('STAGING_DIR_NATIVE')\\n logger.info('Setting STAGING_BINDIR_NATIVE to %s' % staging_bindir_native)\\n self.set('STAGING_BINDIR_NATIVE', '%s/usr/bin' % self.get('STAGING_DIR_NATIVE'))\",\n \"def __read_config(self):\\n with open(self.config_file, 'r') as data_file:\\n dict = json.load(data_file)\\n self.ibooks_doc_root = dict[\\\"ibooks_doc_root\\\"]\\n self.library_folder = dict[\\\"library_folder\\\"]\\n self.annotation_folder = dict[\\\"annotation_folder\\\"]\\n self.tmp_dir = dict[\\\"tmp_dir\\\"]\",\n \"def init_config():\\n config_file = create_config_file.CreateConfigFile()\\n config_file.check_if_config_file_exists()\",\n \"def use_config_file(self):\\n self.config_file = self.find_config_file()\\n if self.config_file:\\n self.apply_config_file(self.config_file)\",\n \"def init():\\n for config_filename in _config_utils.CONFIG_FILENAMES:\\n if os.path.isfile(config_filename):\\n config_filepath = os.path.abspath(config_filename)\\n click.echo(\\\"found existing config file {}\\\".format(config_filepath))\\n return\\n\\n config_filepath = _config_utils.create_empty_config_file('.')\\n click.echo(\\\"initialized empty config file {}\\\".format(config_filepath))\",\n \"def initialize_paths(self):\\n for path in self.config[\\\"paths\\\"]:\\n self.force_path_to_exist(self.config[\\\"paths\\\"][path])\",\n \"def _check_config(self):\",\n \"def load_config_file(self, suppress_errors=True):\\n self.log.debug(\\\"Searching %s for config files\\\", self.config_file_paths)\\n base_config = 'jupyter_config'\\n try:\\n super(JupyterApp, self).load_config_file(\\n base_config,\\n path=self.config_file_paths,\\n )\\n except ConfigFileNotFound:\\n # ignore errors loading parent\\n self.log.debug(\\\"Config file %s not found\\\", base_config)\\n pass\\n\\n if self.config_file:\\n path, config_file_name = os.path.split(self.config_file)\\n else:\\n path = self.config_file_paths\\n config_file_name = self.config_file_name\\n\\n if not config_file_name or (config_file_name == base_config):\\n return\\n\\n try:\\n super(JupyterApp, self).load_config_file(\\n config_file_name,\\n path=path\\n )\\n except ConfigFileNotFound:\\n self.log.debug(\\\"Config file not found, skipping: %s\\\", config_file_name)\\n except Exception:\\n # Reraise errors for testing purposes, or if set in\\n # self.raise_config_file_errors\\n if (not suppress_errors) or self.raise_config_file_errors:\\n raise\\n self.log.warning(\\\"Error loading config file: %s\\\" %\\n config_file_name, exc_info=True)\",\n \"def get_cluster_config_path(root_dir, console_args):\\n\\n if os.path.isabs(console_args.cluster_config_path):\\n return console_args.cluster_config_path\\n return os.path.join(root_dir, console_args.cluster_config_path)\",\n \"def init():\\n file_name = 'config.json'\\n home_directory_path = str(Path.home())\\n config_file_directory = home_directory_path+\\\"/.config/files/\\\"\\n full_path = config_file_directory + file_name\\n\\n if os.path.isfile(full_path) and os.access(full_path, os.R_OK): # Readable Config file exists and is valid\\n try:\\n with open(full_path) as file:\\n json_file = json.load(file)\\n load_json_and_arguments(json_file)\\n\\n except ValueError as exception:\\n raise ValueError(\\\"Invalid JSON configuration file\\\")\\n\\n elif not os.path.isfile(full_path): # Config file doesn't exist yet, create it\\n\\n if not os.path.exists(config_file_directory): # Make the directory if that doesn't exist as well\\n os.makedirs(config_file_directory)\\n\\n get_account_info(full_path)\\n\\n else:\\n raise IOError(\\\"Config file: \\\" + full_path + \\\" not accessible\\\")\",\n \"def _init_variables(self, config_root):\\n if not config_root and 'EXCONF_CONFIG_ROOT' in os.environ:\\n config_root = os.environ['EXCONF_CONFIG_ROOT']\\n if not config_root and EXCONF_CONFIG_FILE_NAME in os.listdir('.'):\\n config_root = '.'\\n if not config_root:\\n raise ValueError(\\\"Exconf configuration root not defined. Give -c option, or define \\\"\\n \\\"environment variable EXCONF_CONFIG_ROOT.\\\")\\n if not EXCONF_CONFIG_FILE_NAME in os.listdir(config_root):\\n raise ValueError(\\\"No {} file found from configuration root: {}\\\"\\n .format(EXCONF_CONFIG_FILE_NAME, config_root))\\n config_root = os.path.abspath(config_root)\\n exconf_config_file_path = os.path.join(config_root, EXCONF_CONFIG_FILE_NAME)\\n LOG.debug(\\\"Reading Exconf configuration from: {}\\\", exconf_config_file_path)\\n self.config_vars = read_yaml(exconf_config_file_path)\\n self.config_vars[EXCONF_VAR_CONFIG_ROOT] = config_root\\n self.resolved_vars = None\",\n \"def do_root(self, line):\\n self.root_directory = line\\n if self.source_file:\\n self.source_file = self.root_directory + \\\"/\\\" + self.source_file\\n print(f\\\"Root directory to read & write files is: {line}\\\")\",\n \"def __init__(self):\\n\\n self.root_path = os.path.dirname(os.path.abspath(__file__))[:-5]\\n self.config_path = os.path.join(self.root_path, \\\"files\\\\\\\\CONFIG.txt\\\")\\n self.metrics_path = os.path.join(self.root_path, \\\"files\\\\\\\\metrics.txt\\\")\\n\\n self.setup_metrics_file()\\n\\n if self.check_configuration() is False:\\n self.setup_configuration_file()\",\n \"def config(filename, root_path):\\n cnf = _config('/etc/%s' % filename)\\n if cnf is False:\\n filename = os.path.join(root_path, filename)\\n cnf = _config(filename)\\n return cnf\",\n \"def _loadconfig(self):\\n\\n # Get the Topology, from the topology layout file\\n topo = {}\\n with open(self._autoconfig_filename, \\\"r\\\") as stream:\\n try:\\n topo = yaml.load(stream)\\n if \\\"metadata\\\" in topo:\\n self._metadata = topo[\\\"metadata\\\"]\\n except yaml.YAMLError as exc:\\n raise RuntimeError(\\n \\\"Couldn't read the Auto config file {}.\\\".format(\\n self._autoconfig_filename, exc\\n )\\n )\\n\\n systemfile = self._rootdir + self._metadata[\\\"system_config_file\\\"]\\n if self._clean is False and os.path.isfile(systemfile):\\n with open(systemfile, \\\"r\\\") as sysstream:\\n try:\\n systopo = yaml.load(sysstream)\\n if \\\"nodes\\\" in systopo:\\n self._nodes = systopo[\\\"nodes\\\"]\\n except yaml.YAMLError as sysexc:\\n raise RuntimeError(\\n \\\"Couldn't read the System config file {}.\\\".format(\\n systemfile, sysexc\\n )\\n )\\n else:\\n # Get the nodes from Auto Config\\n if \\\"nodes\\\" in topo:\\n self._nodes = topo[\\\"nodes\\\"]\\n\\n # Set the root directory in all the nodes\\n for i in self._nodes.items():\\n node = i[1]\\n node[\\\"rootdir\\\"] = self._rootdir\",\n \"def modify_base_buildroot(self):\\n if \\\"'%s '\\\" % self.buildroot_pkgs != pipes.quote(str(self.buildroot_pkgs)+' '):\\n # just different test if it contains only alphanumeric characters allowed in packages name\\n raise BuilderError(\\\"Do not try this kind of attack on me\\\")\\n self.root_conn.module_name = \\\"lineinfile\\\"\\n self.root_conn.module_args = \\\"\\\"\\\"dest=/etc/mock/%s.cfg line=\\\"config_opts['chroot_setup_cmd'] = 'install @buildsys-build %s'\\\" regexp=\\\"^.*chroot_setup_cmd.*$\\\" \\\"\\\"\\\" % (self.chroot, self.buildroot_pkgs)\\n self.mockremote.callback.log('putting %s into minimal buildroot of %s' % (self.buildroot_pkgs, self.chroot))\\n results = self.root_conn.run()\\n\\n is_err, err_results = check_for_ans_error(results, self.hostname, success_codes=[0],\\n return_on_error=['stdout', 'stderr'])\\n if is_err:\\n self.mockremote.callback.log(\\\"Error: %s\\\" % err_results)\\n myresults = get_ans_results(results, self.hostname)\\n self.mockremote.callback.log(\\\"%s\\\" % myresults)\",\n \"def load_config(self, cfg: ConfigParser):\\n log.debug('loading configuration file')\\n section = cfg['DEFAULT']\\n # use host-specific configuration, if any\\n if self.hostname in cfg:\\n section = cfg[self.hostname]\\n self.path = os.path.abspath(os.path.expanduser(section['repo_dir']))\\n self.gpg_key_id = section['gpg_key_id']\\n self.ignored_files = section['ignored_files'].split(',')\\n self.ignored_files.append('.gitkeep')\",\n \"def check_config_file():\\n # Locate and init config.\\n default_config = \\\"config.json\\\"\\n if len(sys.argv) == 2:\\n # config from command line\\n app_config = config_reader(sys.argv[1])\\n else:\\n # config should be in default\\n app_config = config_reader(default_config)\\n # fin\\n if not app_config:\\n print(\\\"Exiting due to invalid config file.\\\")\\n return False\\n # fin\\n return app_config\",\n \"def _check(self, config: Dict):\\n if 'path' not in config:\\n raise FileNotFoundError(\\\"File not found.\\\")\",\n \"def test_no_recognized_root(self):\\n result = self.runner.invoke(\\n cli,\\n [*CLI_LOG_OPTION, \\\"config\\\", \\\"set\\\", \\\"wrong_root.agent_name\\\", \\\"value\\\"],\\n standalone_mode=False,\\n )\\n assert result.exit_code == 1\\n assert (\\n result.exception.message\\n == \\\"The root of the dotted path must be one of: {}\\\".format(\\n ALLOWED_PATH_ROOTS\\n )\\n )\",\n \"def load_config(self):\\n pass\",\n \"def __check_config(self):\\n if not os.path.exists(self.__config_path):\\n return False\\n else:\\n return True\",\n \"def setup_config_folder(self):\\n\\n config_dir = self.config_folder\\n \\n logging.info(\\\"using config folder: %s\\\" % (config_dir))\\n if not os.path.isdir(config_dir):\\n os.mkdir(config_dir)\\n\\n try:\\n f = open(config_dir + self.wordlist_file,'r')\\n except IOError:\\n f = open(config_dir + self.wordlist_file,'a+')\\n f.close()\\n\\n try:\\n f = open(config_dir + self.score_file,'r')\\n except IOError:\\n f = open(config_dir + self.score_file,'a+')\\n f.close()\",\n \"def read_config(self, config_filename):\",\n \"def load_settings_from_file(self, cfg_file):\\n \\n #\\n #\\n # TODO\\n # Missing settings should not cause exceptions\\n #\\n #\\n #\\n\\n if not os.path.exists(cfg_file): \\n raise Exception('Provided config file [%s] does not exist or cannot be read.' % cfg_file)\\n\\n import ConfigParser\\n config = ConfigParser.ConfigParser()\\n config.read(cfg_file)\\n \\n \\n self.reference_root = config.get('Paths','reference-root')\\n \\n self.scratch_root = os.getcwd()\\n try:\\n self.scratch_root = config.get('Paths','scratch-root')\\n except ConfigParser.NoOptionError:\\n self.logger.info('Scratch-root setting is missing. Using current directory: %s' % self.scratch_root)\\n\\n\\n if (self.run_folder != None):\\n self.run_id = os.path.basename(self.run_folder)\\n else:\\n raise Exception('Set runfolder with PipelineConfig.set_runfolder() before loading settings')\\n \\n \\n #\\n # TODO\\n # needs to be updated on update of settings\\n #\\n self.runs_scratch_dir = os.path.join(self.scratch_root, self.run_id) if self.run_folder != None else self.scratch_root\\n self.logger.info('Run\\\\'s scratch directory: %s' % self.runs_scratch_dir)\\n \\n # optional results and fastq archive dirs \\n self.results_archive = None\\n try:\\n self.results_archive = config.get('Paths','results-archive')\\n except ConfigParser.NoOptionError:\\n self.logger.info('No results-archive provided. Results will not be archived outside of the run\\\\'s scratch directory.')\\n \\n self.fastq_archive = None\\n try:\\n self.fastq_archive = config.get('Paths','fastq-archive')\\n except ConfigParser.NoOptionError:\\n self.logger.info('No fastq-archive provided. Fastq files will not be archived outside of the run\\\\'s scratch directory.')\\n \\n \\n # optional /tmp dir\\n self.tmp_dir = '/tmp'\\n try:\\n self.tmp_dir = config.get('Paths','tmp-dir')\\n except ConfigParser.NoOptionError:\\n self.logger.info('No tmp-dir provided. /tmp will be used.')\\n \\n \\n \\n \\n # reference files\\n self.reference = os.path.join(self.reference_root, config.get('Resources','reference-genome'))\\n self.capture = os.path.join(self.reference_root, config.get('Resources','capture-regions-bed'))\\n self.capture_qualimap = os.path.join(self.reference_root, config.get('Resources','capture-regions-bed-for-qualimap'))\\n self.capture_plus = os.path.join(self.reference_root, config.get('Resources', 'capture-plus-regions-bed'))\\n self.gene_coordinates = os.path.join(self.reference_root, config.get('Resources', 'gene-coordinates'))\\n \\n self.adapters = os.path.join(self.reference_root, config.get('Resources', 'adapters-fasta'))\\n \\n # tools\\n self.bcl2fastq = config.get('Tools','bcl2fastq')\\n self.trimmomatic = config.get('Tools','trimmomatic') \\n self.bwa = config.get('Tools','bwa')\\n self.samtools = config.get('Tools','samtools')\\n self.picard = config.get('Tools','picard')\\n self.gatk = config.get('Tools','gatk')\\n self.freebayes = config.get('Tools','freebayes')\\n self.bcftools = config.get('Tools','bcftools')\\n self.qualimap = config.get('Tools','qualimap')\\n \\tself.fastqc\\t = config.get('Tools','fastqc')\\n\\n\\n # annovar settings\\n self.convert_to_annovar = os.path.join(config.get('Annovar','annovar_home'), \\n config.get('Annovar','convert_to_annovar'))\\n self.annovar_annotate = os.path.join(config.get('Annovar','annovar_home'),\\n config.get('Annovar','annovar_annotate'))\\n self.table_annovar = os.path.join(config.get('Annovar','annovar_home'), \\n config.get('Annovar','table_annovar'))\\n self.annovar_human_db = os.path.join(config.get('Annovar','annovar_home'),\\n config.get('Annovar','annovar_human_db'))\\n self.annovar_1000genomes_eur = config.get('Annovar','annovar_1000genomes_eur')\\n self.annovar_1000genomes_eur_maf_cutoff = config.get('Annovar','annovar_1000genomes_eur_maf_cutoff')\\n self.annovar_inhouse_dbs = config.get('Annovar','annovar_inhouse_dbs')\\n self.omim_gene_phenotype_map_file = config.get('Annovar','omim_gene_phenotype_map_file')\",\n \"def init_config(self):\\n with open(self.config_file, 'r') as fh:\\n self.config = json.load(fh, object_pairs_hook=OrderedDict)\\n logger.info('Config loaded: %s' % os.path.abspath(self.config_file))\",\n \"def init_config(self):\\n with open(self.config_file, 'r') as fh:\\n self.config = json.load(fh, object_pairs_hook=OrderedDict)\\n logger.info('Config loaded: %s' % os.path.abspath(self.config_file))\",\n \"def parse_config(self):\\n # TODO: parse config file\\n pass\",\n \"def __init__(self, config):\\n\\n self.root = config.root\\n self.pidfile = config.pidfile\\n self.log_conf = config.logging\",\n \"def test_config_overwrites():\\n basepath = os.path.abspath(os.path.join(os.path.dirname(__file__), \\\"..\\\", '..'))\\n temppath = '/tmp/'\\n\\n conf = core.Config(datapath=temppath)\\n\\n assert conf.basepath.lower() == basepath.lower()\\n assert conf.datapath.lower() == temppath.lower()\",\n \"def test_config(self):\\n if self.config.get('base_url')[-1] is '/':\\n raise exceptions.ScidashClientWrongConfigException('Remove last '\\n 'slash '\\n 'from base_url')\",\n \"def cli(ctx, root):\\n try:\\n ctx.obj = create_initial_context(root)\\n except SettingsBroken as e:\\n click.echo(\\n 'Failed to read the settings file: %s' % str(e),\\n err=True\\n )\\n exit(1)\",\n \"def __init__(self, rootdir, filename, clean=False):\\n self._autoconfig_filename = rootdir + filename\\n self._rootdir = rootdir\\n self._metadata = {}\\n self._nodes = {}\\n self._vpp_devices_node = {}\\n self._hugepage_config = \\\"\\\"\\n self._clean = clean\\n self._loadconfig()\\n self._sockfilename = \\\"\\\"\",\n \"def __init__(self, file_root):\\n self.root = file_root\",\n \"def __init__(self, cfg_path):\\n\\t\\tself.cfg_path = cfg_path\\n\\t\\tself.cfg_root = self.load_cfg(self.cfg_path)\",\n \"def __post_init__(self, *args, **kwargs) -> None:\\n super().__post_init__(*args, **kwargs)\\n\\n self._path = Path(source_file).resolve()\\n\\n super().__init__(length, length)\\n\\n if not self._path.exists():\\n raise ConfigFileError(\\n f\\\"The source file {self.path} does not exist...\\\")\",\n \"def __init__(self):\\n\\n self.path = os.path.dirname(os.path.realpath(__file__)) + '/config.ini'\\n self.config = configparser.ConfigParser()\\n self.config.read(self.path)\",\n \"def read( self, filename ):\\n conf_file = cfg.ConfigFile(filename)\\n self.root_node = conf_file.root_node\",\n \"def sanitize_config(config):\\n\\tif not 'dbfile' in config.keys():\\n\\t\\tconfig['dbfile'] = DEFAULTCONFIG['dbfile']\\n\\tfor path in ['dbfile']:\\n\\t\\tconfig[path]=os.path.expanduser(config[path])\\n\\treturn config\",\n \"def parse_args(self, argv):\\n super(UpdaterDaemon, self).parse_args(argv)\\n\\n self.stdout = self.options.log_file\\n self.stderr = self.options.error_log\\n\\n config = self.options.config\\n if config is None:\\n config = os.path.join(os.path.dirname(__file__), 'config.py')\\n config = os.path.normpath(os.path.abspath(config))\\n configdir, configfile = os.path.split(config)\\n configfile, ext = os.path.splitext(configfile)\\n if configdir not in sys.path:\\n sys.path.insert(0, configdir)\\n self.config = __import__(configfile)\",\n \"def setUp(self):\\n super(LaunchConfigPersonalityTest, self).setUp()\\n self.path = '/root/test.txt'\",\n \"def _set_config():\\n\\n\\tdebug_msg = \\\"load default config yaml file\\\"\\n\\tlogger.debug(debug_msg)\\n\\n\\tconfig_file_parser(paths.CONFIG_FILE, override_options=True)\",\n \"def _load_config(self, args: argparse.Namespace):\\n #\\n # Load a config, filename may or may-not be provided...\\n #\\n try:\\n self._config = TortugaScriptConfig.load(args.config)\\n\\n except ConfigException as ex:\\n print(str(ex))\\n sys.exit(0)\\n\\n #\\n # Override the config with any provided argument values\\n #\\n if args.url:\\n self._config.url = args.url\\n if args.username:\\n self._config.username = args.username\\n if args.password:\\n self._config.password = args.password\\n if args.token:\\n self._config.token = args.token\\n self._config.verify = args.verify\",\n \"def _find_config_root(self) -> str:\\n location = [\\\"apache2.conf\\\", \\\"httpd.conf\\\", \\\"conf/httpd.conf\\\"]\\n for name in location:\\n if os.path.isfile(os.path.join(self.root, name)):\\n return os.path.join(self.root, name)\\n raise errors.NoInstallationError(\\\"Could not find configuration root\\\")\",\n \"def __init__(self, config_file):\\n \\n self.log = logging.getLogger(__name__)\\n\\n self.parser = ConfigParser.ConfigParser()\\n if os.path.exists(config_file) and os.path.isfile(config_file):\\n self.parser.read(config_file)\\n self.log.debug(\\\"opened configuration '%s'\\\" % config_file)\\n else:\\n raise ConfigError(\\\"Config file missing\\\", \\\"File '%s' doesn't exist.\\\" % (config_file))\\n\\n self.config_file = config_file\\n self.check_config()\",\n \"def test_no_recognized_root(self):\\n result = self.runner.invoke(\\n cli,\\n [*CLI_LOG_OPTION, \\\"config\\\", \\\"get\\\", \\\"wrong_root.agent_name\\\"],\\n standalone_mode=False,\\n )\\n assert result.exit_code == 1\\n assert (\\n result.exception.message\\n == \\\"The root of the dotted path must be one of: {}\\\".format(\\n ALLOWED_PATH_ROOTS\\n )\\n )\",\n \"def checkRequiredConfigs(self):\\n containmentFolder = self.getAbsContainmentFolder()\\n rootFileName = self.app.config.exhale_args[\\\"rootFileName\\\"]\\n rootFileTitle = self.app.config.exhale_args[\\\"rootFileTitle\\\"]\\n doxygenStripFromPath = self.app.config.exhale_args[\\\"doxygenStripFromPath\\\"]\\n\\n # validate that the containmentFolder was created\\n assert os.path.isdir(containmentFolder)\\n # validate that {containmentFolder}/{rootFileName} was created\\n assert os.path.isfile(os.path.join(containmentFolder, rootFileName))\\n # validate that the title was included\\n with open(os.path.join(containmentFolder, rootFileName), \\\"r\\\") as root:\\n root_contents = root.read()\\n root_heading = \\\"{0}\\\\n{1}\\\".format(\\n rootFileTitle,\\n exhale.utils.heading_mark(rootFileTitle, exhale.configs.SECTION_HEADING_CHAR)\\n )\\n assert root_heading in root_contents\\n\\n # TODO: validate doxygenStripFromPath\\n if doxygenStripFromPath: # this is only here to avoid a flake8 fail on a todo\\n pass\",\n \"def test_read_namespaced_build_config(self):\\n pass\",\n \"def __setup_config_file_abspath():\\n if \\\"APPDATA\\\" in os.environ:\\n basedir = os.environ[\\\"APPDATA\\\"]\\n elif \\\"HOME\\\" in os.environ:\\n basedir = os.environ[\\\"HOME\\\"]\\n else:\\n raise AssertionError(\\\"APPDATA or HOME env vars must be defined \\\"\\n \\\"to store config file\\\")\\n abs_dir_path = os.path.join(\\n basedir, TestManager.APPDATA_SUBDIRECTORY_NAME)\\n os.makedirs(abs_dir_path, exist_ok=True, mode=0o660)\\n return os.path.join(abs_dir_path, ConfigManager.CONFIG_FILE_NAME)\",\n \"def test_create_config_roots(self):\\n with self.override_role():\\n self._create_config_root()\",\n \"def __init__(self, filename, dirname='~'):\\n self.config = configparser.ConfigParser()\\n\\n expanded_dirname = os.path.expanduser(dirname)\\n self.configuration_filename = os.path.join(expanded_dirname, filename)\\n if os.path.isfile(self.configuration_filename):\\n self.config.read(self.configuration_filename)\",\n \"def test_default_config_file_paths(\\n config,\\n):\\n assert \\\"~/.config/yessssms.conf\\\" in CONFIG_FILE_PATHS\\n assert \\\"/etc/yessssms.conf\\\" in CONFIG_FILE_PATHS\",\n \"def setup_config(self):\\n\\n try:\\n with open('config.json') as f:\\n config = json.load(f)\\n except FileNotFoundError as e:\\n log.debug('{}[*]{} {}'.format(DFbase.LOG_ERROR_COLOR,\\n DFbase.LOG_INFO_COLOR, e))\\n print('{}[*]{} {}'.format(DFbase.LOG_ERROR_COLOR, \\n DFbase.LOG_INFO_COLOR, \\n 'Please copy config.json.example to confing.json'))\\n return False\\n except Exception as e:\\n log.debug('{}[*]{} {}'.format(DFbase.LOG_ERROR_COLOR, \\n DFbase.LOG_INFO_COLOR, e))\\n return False\\n\\n self.artifacts_path = config['ARTIFACTS']['BASE_PATH'].format(self.container_id)\\n self.executable_path = config['ARTIFACTS']['EXECUTABLE_PATH']\\n self.executable_path = self.executable_path.replace('BASE_PATH', self.artifacts_path)\\n self.diff_files_path = config['ARTIFACTS']['DIFF_FILES_PATH']\\n self.diff_files_path = self.diff_files_path.replace('BASE_PATH', self.artifacts_path)\\n self.log_journald = (True if config['ARTIFACTS']['LOG_JOURNALD_SERVICE'] == \\\"TRUE\\\" else False)\\n\\n for x_path in [self.artifacts_path, self.executable_path, self.diff_files_path]:\\n if not os.path.exists(x_path):\\n try:\\n os.makedirs(x_path, mode=0o700)\\n except Exception as e:\\n log.debug('{}[*]{} {}'.format(DFbase.LOG_ERROR_COLOR,\\n DFbase.LOG_INFO_COLOR, e))\\n print('{}[*]{} {}:{}'.format(DFbase.LOG_ERROR_COLOR,\\n DFbase.LOG_INFO_COLOR,\\n 'Failed when creating directory', x_path))\\n return False\\n\\n return True\",\n \"def init_config(self):\\n # self.config.read(self.cnfgfile)\\n if not self.config.has_section(VERSION_SECTION):\\n self.config.add_section(VERSION_SECTION)\",\n \"def pre_config_root_create(self, resource_dict):\\n pass\",\n \"def setup():\\n\\tglobal config_parser, config_file\\n\\tglobal prefix\\n\\n\\tif os.path.islink(sys.argv[0]):\\n\\t\\tlink = os.readlink(sys.argv[0])\\n\\n\\t\\tif not os.path.isabs(link):\\n\\t\\t\\tlink = os.path.join(os.path.dirname(sys.argv[0]), link)\\n\\n\\t\\tprefix = os.path.dirname(os.path.abspath(link))\\n\\telse:\\n\\t\\tprefix = os.path.dirname(os.path.abspath(sys.argv[0]))\\n\\n\\tconfig_parser = ConfigParser.ConfigParser()\\n\\tset_defaults()\\n\\n\\tconfig_file = os.path.join (xdg_config_home, \\\"sushi\\\", \\\"nigiri\\\")\\n\\n\\tif not check_config_file(config_file):\\n\\t\\tprint \\\"Config file creation failed. Aborting.\\\"\\n\\t\\treturn\\n\\n\\tread_config_file()\",\n \"def AutomagicalSettings(self):\\n # Try to find gclient or repo root first.\\n if not self.options.no_search:\\n self.toplevel_root = gclient_utils.FindGclientRoot(self.checkout_root)\\n if self.toplevel_root:\\n logging.info('Found .gclient at %s' % self.toplevel_root)\\n else:\\n self.toplevel_root = gclient_utils.FindFileUpwards(\\n os.path.join('..', '.repo'), self.checkout_root)\\n if self.toplevel_root:\\n logging.info('Found .repo dir at %s'\\n % os.path.dirname(self.toplevel_root))\\n\\n # Parse TRYSERVER_* settings from codereview.settings before falling back\\n # on setting self.options.root manually further down. Otherwise\\n # TRYSERVER_ROOT would never be used in codereview.settings.\\n self._GclStyleSettings()\\n\\n if self.toplevel_root and not self.options.root:\\n assert os.path.abspath(self.toplevel_root) == self.toplevel_root\\n self.options.root = gclient_utils.PathDifference(self.toplevel_root,\\n self.checkout_root)\\n else:\\n self._GclStyleSettings()\",\n \"def onLoadConfig(self, inifile):\\n cp = ConfigParser(self.defaults)\\n cp.readfp(inifile)\\n depth = self.getDepth(cp)\\n self.baseurl = urljoin(self.inipath, depth)\\n # create child loaders for any other l10n.ini files to be included\\n try:\\n for title, path in cp.items('includes'):\\n # skip default items\\n if title in self.defaults:\\n continue\\n # add child config parser\\n self.addChild(title, path, cp)\\n except NoSectionError:\\n pass\\n # try to load the \\\"dirs\\\" defined in the \\\"compare\\\" section\\n try:\\n self.dirs.extend(cp.get('compare', 'dirs').split())\\n except (NoOptionError, NoSectionError):\\n pass\\n # try getting a top level compare dir, as used for fennec\\n try:\\n self.tld = cp.get('compare', 'tld')\\n # remove tld from comparison dirs\\n if self.tld in self.dirs:\\n self.dirs.remove(self.tld)\\n except (NoOptionError, NoSectionError):\\n self.tld = None\\n # try to set \\\"all_path\\\" and \\\"all_url\\\"\\n try:\\n self.all_path = cp.get('general', 'all')\\n self.all_url = urljoin(self.baseurl, self.all_path)\\n except (NoOptionError, NoSectionError):\\n self.all_path = None\\n self.all_url = None\\n return cp\",\n \"def setup_local_config(self, file_path):\\n try:\\n shutil.copy(file_path, os.path.join(self.rundir, const.LOCAL_CONFIG_FILE))\\n except OSError as e:\\n raise ContainerError(\\\"Local config file provided errored out: {}\\\".format(e))\",\n \"def _build_config_file_path(cls, filename):\\n if os.path.exists(filename):\\n return filename\\n res = os.path.join(os.path.dirname(__file__), '..', 'config', filename)\\n if not os.path.exists(res):\\n raise ValueError(\\\"requested config file %s does not exist!\\\" % filename)\\n return res\",\n \"def __init__(self, appname):\\n self.exepath = '%s' % (os.path.dirname(os.path.realpath(__file__)))\\n self.cnfgfile = '%s/versions.cfg' % self.exepath\\n self.static_path = '%s/app/static' % self.exepath\\n self.config = ConfigParser.RawConfigParser()\",\n \"def read_config_file(self, path):\\n config = configparser.ConfigParser(allow_no_value=True, delimiters=('='))\\n config.optionxform = str\\n\\n if path:\\n path_conf = os.path.abspath(path)\\n Output.print_information(\\\"Reading configuration file \\\" + path_conf, True)\\n if not os.path.isfile(path_conf):\\n raise InvalidConfigException(\\\"The specified config file doesn't exist.\\\")\\n config.read(path_conf)\\n\\n else:\\n home_directory = os.path.expanduser(\\\"~\\\")\\n cwd_conf = os.path.abspath(os.path.join(os.getcwd(), \\\"cryptodetector.conf\\\"))\\n home_conf = os.path.abspath(os.path.join(home_directory, \\\"cryptodetector.conf\\\"))\\n\\n # Does config file exist in current working directory?\\n if os.path.isfile(cwd_conf):\\n Output.print_information(\\\"Reading configuration file \\\" + cwd_conf, True)\\n self.options[\\\"config_file\\\"] = cwd_conf\\n config.read(cwd_conf)\\n\\n # Does config file exist in home folder ?\\n elif os.path.isfile(home_conf):\\n Output.print_information(\\\"Reading configuration file \\\" + home_conf, True)\\n self.options[\\\"config_file\\\"] = home_conf\\n config.read(home_conf)\\n\\n else:\\n Output.print_information(\\\"Didn't find any configuration file. Expect all \\\" \\\\\\n + \\\"parameters from the command line.\\\", True)\\n return\\n\\n for section in [\\\"settings\\\", \\\"methods\\\"]:\\n if section not in config.sections():\\n raise InvalidConfigException(\\\"Invalid configuration file. [\\\" \\\\\\n + section + \\\"] section \\\" + \\\"is required.\\\")\\n\\n for option in self.options:\\n\\n if isinstance(self.options[option], list):\\n option_value = Options.read_array_option(config, option)\\n\\n elif isinstance(self.options[option], bool):\\n option_value = Options.read_boolean_option(config, \\\"settings\\\", option)\\n\\n else:\\n option_value = Options.read_string_option(config, \\\"settings\\\", option)\\n\\n if option_value != None:\\n self.options[option] = option_value\\n\\n for option in [\\\"methods\\\", \\\"packages\\\"]:\\n if config.has_section(option):\\n self.options[option] = [item for item, _ in config.items(option)]\\n\\n if self.options[\\\"output_existing\\\"] not in [\\\"rename\\\", \\\"overwrite\\\", \\\"skip\\\"]:\\n raise InvalidConfigException(\\\"Invalid config file. In section [settings] \\\" \\\\\\n + \\\"output_existing had invalid value '\\\" + self.options[\\\"output_existing\\\"] \\\\\\n + \\\"'. Its value must be one of three choices: \\\" \\\\\\n + \\\"'rename', 'overwrite', and 'skip'.\\\")\\n\\n if not self.options[\\\"methods\\\"]:\\n raise InvalidConfigException(\\\"Invalid configuration file. There should be one \\\" \\\\\\n + \\\"or more items under the [methods] section.\\\")\\n\\n methods = self.options[\\\"methods\\\"]\\n Options.validate_methods(methods)\\n\\n for method in methods:\\n method_class = Options.available_methods()[method]\\n\\n if not hasattr(method_class, \\\"options\\\"):\\n continue\\n\\n for option in method_class.options:\\n if isinstance(method_class.options[option], list):\\n option_value = Options.read_array_option(config, \\\"method:\\\" \\\\\\n + method + \\\":\\\" + option)\\n\\n elif isinstance(method_class.options[option], bool):\\n option_value = Options.read_boolean_option(config, \\\"method:\\\" + method, option)\\n\\n else:\\n option_value = Options.read_string_option(config, \\\"method:\\\" + method, option)\\n\\n if option_value != None:\\n method_class.options[option] = option_value\\n self.options[method + \\\"_\\\" + option] = option_value\",\n \"def get_base_config(self):\\n\\t\\tshutit_global.shutit_global_object.yield_to_draw()\\n\\t\\tcp = self.config_parser\\n\\t\\t# TODO: what happens if a command-line arg was already set?\\n\\t\\t# BEGIN Read from config files\\n\\t\\t# build - details relating to the build\\n\\t\\tself.build['privileged'] = cp.getboolean('build', 'privileged')\\n\\t\\tself.build['base_image'] = cp.get('build', 'base_image')\\n\\t\\tself.build['dotest'] = cp.get('build', 'dotest')\\n\\t\\tself.build['net'] = cp.get('build', 'net')\\n\\t\\t# Take a command-line arg if given, else default.\\n\\t\\tif self.build['conn_module'] is None:\\n\\t\\t\\tself.build['conn_module'] = cp.get('build', 'conn_module')\\n\\t\\t# target - the target of the build, ie the container\\n\\t\\tself.target['hostname'] = cp.get('target', 'hostname')\\n\\t\\tself.target['ports'] = cp.get('target', 'ports')\\n\\t\\tself.target['volumes'] = cp.get('target', 'volumes')\\n\\t\\tself.target['volumes_from'] = cp.get('target', 'volumes_from')\\n\\t\\tself.target['name'] = cp.get('target', 'name')\\n\\t\\tself.target['rm'] = cp.getboolean('target', 'rm')\\n\\t\\t# host - the host on which the shutit script is run\\n\\t\\tself.host['add_shutit_to_path'] = cp.getboolean('host', 'add_shutit_to_path')\\n\\t\\tself.host['docker_executable'] = cp.get('host', 'docker_executable')\\n\\t\\tself.host['dns'] = cp.get('host', 'dns')\\n\\t\\tself.host['password'] = cp.get('host', 'password')\\n\\t\\tif isinstance(self.host['password'],str):\\n\\t\\t\\tshutit_global.shutit_global_object.secret_words_set.add(self.host['password'])\\n\\t\\tself.logfile = cp.get('host', 'logfile')\\n\\t\\tself.host['shutit_module_path'] = cp.get('host', 'shutit_module_path').split(':')\\n\\n\\t\\t# repository - information relating to docker repository/registry\\n\\t\\tself.repository['name'] = cp.get('repository', 'name')\\n\\t\\tself.repository['server'] = cp.get('repository', 'server')\\n\\t\\tself.repository['push'] = cp.getboolean('repository', 'push')\\n\\t\\tself.repository['tag'] = cp.getboolean('repository', 'tag')\\n\\t\\tself.repository['export'] = cp.getboolean('repository', 'export')\\n\\t\\tself.repository['save'] = cp.getboolean('repository', 'save')\\n\\t\\tself.repository['suffix_date'] = cp.getboolean('repository', 'suffix_date')\\n\\t\\tself.repository['suffix_format'] = cp.get('repository', 'suffix_format')\\n\\t\\tself.repository['user'] = cp.get('repository', 'user')\\n\\t\\tself.repository['password'] = cp.get('repository', 'password')\\n\\t\\tif isinstance(self.repository['password'],str):\\n\\t\\t\\tshutit_global.shutit_global_object.secret_words_set.add(self.repository['password'])\\n\\t\\tself.repository['email'] = cp.get('repository', 'email')\\n\\t\\tself.repository['tag_name'] = cp.get('repository', 'tag_name')\\n\\t\\t# END Read from config files\\n\\n\\t\\t# BEGIN tidy configs up\\n\\t\\tif self.target['docker_image'] == '':\\n\\t\\t\\tself.target['docker_image'] = self.build['base_image']\\n\\t\\t# END tidy configs up\\n\\n\\t\\t# FAILS begins\\n\\t\\t# rm is incompatible with repository actions\\n\\t\\tif self.target['rm'] and (self.repository['tag'] or self.repository['push'] or self.repository['save'] or self.repository['export']): # pragma: no cover\\n\\t\\t\\tshutit_global.shutit_global_object.shutit_print(\\\"Can't have [target]/rm and [repository]/(push/save/export) set to true\\\")\\n\\t\\t\\tshutit_global.shutit_global_object.handle_exit(exit_code=1)\\n\\t\\tif self.target['hostname'] != '' and self.build['net'] != '' and self.build['net'] != 'bridge': # pragma: no cover\\n\\t\\t\\tshutit_global.shutit_global_object.shutit_print('\\\\n\\\\ntarget/hostname or build/net configs must be blank\\\\n\\\\n')\\n\\t\\t\\tshutit_global.shutit_global_object.handle_exit(exit_code=1)\\n\\t\\t# FAILS ends\",\n \"def _validate_config(self):\\n pass\",\n \"def init_config():\\n try:\\n initConfig()\\n click.echo(\\\"Submarine CLI Config initialized\\\")\\n except AttributeError as err:\\n click.echo(err)\",\n \"def __init__(self, config_file='/etc/sfa/ldap_config.py'):\\n\\n try:\\n execfile(config_file, self.__dict__)\\n\\n self.config_file = config_file\\n # path to configuration data\\n self.config_path = os.path.dirname(config_file)\\n except IOError:\\n raise IOError, \\\"Could not find or load the configuration file: %s\\\" \\\\\\n % config_file\",\n \"def test_config_from_file(self):\\n parser = Parser()\\n args = parser.parser.parse_args(['-c'])\\n if args.config:\\n config = Config()\\n config.config_file = \\\"./config\\\"\\n config.config = test_config\\n config.config_from_file()\\n self.assertTrue(config.config)\\n os.remove(config.config_file)\",\n \"def _loadConfig(self):\\n self._packRoot = getattr(sys, \\\"_MEIPASS\\\", path.abspath(path.dirname(__file__)))\\n rootDir = path.abspath(path.join(self._packRoot, path.pardir))\\n logger.debug(\\\"MOTools root dir is: %s\\\" % rootDir)\\n\\n metConf = path.join(rootDir, \\\"met_config\\\", \\\"met_config.json\\\")\\n mainConf = path.join(rootDir, \\\"main_config.json\\\")\\n userConf = path.join(rootDir, \\\"user_config.json\\\")\\n\\n self._confData = {\\n \\\"MET\\\": {\\\"path\\\": metConf, \\\"config\\\": {}, \\\"loaded\\\": False},\\n \\\"MAIN\\\": {\\\"path\\\": mainConf, \\\"config\\\": {}, \\\"loaded\\\": False},\\n \\\"USER\\\": {\\\"path\\\": userConf, \\\"config\\\": {}, \\\"loaded\\\": False},\\n }\\n\\n for confGroup in self._confData:\\n confFile = self._confData[confGroup][\\\"path\\\"]\\n logger.debug(\\\"Loading %s config file\\\" % confGroup)\\n if path.isfile(confFile):\\n jsonData = {}\\n try:\\n with open(confFile, mode=\\\"r\\\") as inFile:\\n jsonData = json.loads(inFile.read())\\n if \\\"config\\\" in jsonData:\\n self._confData[confGroup][\\\"config\\\"] = jsonData[\\\"config\\\"]\\n self._confData[confGroup][\\\"loaded\\\"] = True\\n except Exception as e:\\n logger.error(\\\"Failed to parse config JSON data.\\\")\\n logger.error(str(e))\\n return False\\n else:\\n logger.debug(\\\"No file: %s\\\" % confFile)\\n\\n # if not self._confData[\\\"MAIN\\\"][\\\"loaded\\\"]:\\n # logger.error(\\\"Failed to load minimum configuration file main_config.json.\\\")\\n # raise RuntimeError\\n\\n return\",\n \"def __init__(self):\\n super().__init__()\\n\\n etc_conf_names = ('app.conf', 'app.local.conf')\\n conf_paths = [os.path.join(APP_DIR, 'etc', c) for c in etc_conf_names]\\n\\n user_config_path = os.path.join(\\n os.path.expanduser('~'),\\n '.config',\\n 'url_manager.conf'\\n )\\n conf_paths.append(user_config_path)\\n\\n self.read(conf_paths)\\n self.set('DEFAULT', 'app_dir', APP_DIR)\",\n \"def init_config():\\n cf = ConfigParser.ConfigParser()\\n try :\\n cf.read(CONFIG_FILE)\\n except os.errno:\\n Log.e(TAG, \\\"Open configuration file error!\\\")\\n return False\\n try :\\n SW_CONFIG['7zpath'] = cf.get(\\\"dir_config\\\", \\\"7zpath\\\")\\n SW_CONFIG['sharefolder'] = cf.get(\\\"dir_config\\\", \\\"sharefolder\\\")\\n SW_CONFIG['distpath'] = cf.get(\\\"dir_config\\\", \\\"distpath\\\")\\n SW_CONFIG['sw_version'] = cf.get(\\\"sw_config\\\", \\\"version\\\")\\n SW_CONFIG['startup'] = cf.get(\\\"sw_config\\\", \\\"startup\\\")\\n except ConfigParser.Error:\\n Log.e(DEBUG_TAG, \\\"Config file parse error!\\\")\\n clean()\\n return False\\n try :\\n RUN_CONFIG['backup'] = (cf.get(\\\"run_config\\\", \\\"backup\\\") == \\\"True\\\")\\n RUN_CONFIG['pop'] = (cf.get(\\\"run_config\\\", \\\"pop\\\") == \\\"True\\\")\\n except ConfigParser.Error:\\n Log.e(TAG, \\\"no run config in config file!\\\")\\n RUN_CONFIG['backup'] = False\\n RUN_CONFIG['pop'] = False\\n try :\\n for option in cf.options(\\\"hook_config\\\"): \\n HOOK_CONFIG[option] = cf.get(\\\"hook_config\\\", option)\\n except ConfigParser.Error:\\n Log.e(TAG, \\\"No hook config in config file!\\\")\\n if not os.path.exists(SW_CONFIG['sharefolder']):\\n try:\\n os.makedirs(SW_CONFIG['sharefolder'])\\n except os.error:\\n print \\\"Can't create the local folder:\\\" + SW_CONFIG['distpath'] + \\\", Please set another one\\\"\\n clean()\\n exit()\\n if not os.path.exists(SW_CONFIG['distpath']):\\n try:\\n os.makedirs(SW_CONFIG['distpath'])\\n except os.error:\\n print \\\"Can't create the share folder:\\\" + SW_CONFIG['sharefolder'] + \\\" temp directory!\\\"\\n clean()\\n os.system(\\\"pause\\\")\\n exit()\\n return True\",\n \"def init_config(self):\\n pass\",\n \"def _load_config():\\n\\tcfg = configparser.ConfigParser()\\n\\tcfg.read(os.path.join(get_current_directory(), 'citi.config'))\\n\\treturn cfg\",\n \"def __init__(self, config_path, normalize=False):\\n self.config = {}\\n _config_dict = {}\\n self._config_path = Utils.expand_path(config_path)\\n self.update = None\\n self.normalize = normalize\",\n \"def set_root(self):\\n config_dir = os.path.expanduser(\\\"~/.local/shs\\\")\\n config_file = os.path.join(config_dir, \\\"shs_gui.cfg\\\")\\n # check the file and create one if it's not there\\n if not os.path.isfile(config_file):\\n os.makedirs(config_dir)\\n open(config_file, 'w').close()\\n config = ConfigParser.ConfigParser()\\n config.read(config_file)\\n # if config exists and has needed option\\n if config.has_option(\\\"general\\\", \\\"root_dir\\\"):\\n return config.get(\\\"general\\\", \\\"root_dir\\\")\\n # make config\\n if not config.has_section(\\\"general\\\"):\\n config.add_section(\\\"general\\\")\\n dlg = wx.DirDialog(self, \\\"Select root directory\\\")\\n if dlg.ShowModal() == wx.ID_OK:\\n root_dir = dlg.GetPath()\\n config.set(\\\"general\\\", \\\"root_dir\\\", root_dir)\\n else:\\n sys.exit(1)\\n with open(config_file, 'w') as f:\\n config.write(f)\\n return root_dir\",\n \"def test_load(yaml_config_file):\\n config = Config()\\n config.load(PATH_FILE_CONFIG)\\n assert config.backup_root_directory == yaml_config_file.backup\\n assert config.docker_compose_wordpress_project_directory == yaml_config_file.docker_compose_wordpress_project\",\n \"def __init__(self, path_to_config_file):\\n self.file_path = path_to_config_file\",\n \"def test_load_configuration_loads_main_file():\\n config.load_configuration(main_configuration_path)\\n assert config.get('test.nested.path.value') == 'test value'\",\n \"def test_find_config_cur_dir(self, in_tmp_path):\\n with open(\\\".scuba.yml\\\", \\\"w\\\") as f:\\n f.write(\\\"image: bosybux\\\\n\\\")\\n\\n path, rel, _ = scuba.config.find_config()\\n assert_paths_equal(path, in_tmp_path)\\n assert_paths_equal(rel, \\\"\\\")\",\n \"def initialize(self):\\n \\n if not readconf.check_file_config(self.config):\\n return False\\n\\n # access fields from the .ini file as named properties in self.config, e.g.\\n # an .ini field named host is accessed as self.config['host']\\n\\n self.pointer=utils.read_file_ptr(self.config)\\n \\n return True\",\n \"def __init__(self):\\n self.filename = pathlib.Path(__file__).parent.absolute().__str__() + '/../../data/config.ini'\\n self.data = ConfigParser()\\n self.data.read(self.filename)\",\n \"def setup_config(self, args=None):\\n self.config_parse(args=args)\",\n \"def test_find_config_parent_dir(self, in_tmp_path):\\n with open(\\\".scuba.yml\\\", \\\"w\\\") as f:\\n f.write(\\\"image: bosybux\\\\n\\\")\\n\\n os.mkdir(\\\"subdir\\\")\\n os.chdir(\\\"subdir\\\")\\n\\n # Verify our current working dir\\n assert_paths_equal(os.getcwd(), in_tmp_path.joinpath(\\\"subdir\\\"))\\n\\n path, rel, _ = scuba.config.find_config()\\n assert_paths_equal(path, in_tmp_path)\\n assert_paths_equal(rel, \\\"subdir\\\")\",\n \"def __init__(self, rootPath=None):\\n self.rootPath = rootPath or '.'\",\n \"def config():\\n global base_dir, log_path\\n\\n # Set paths\\n base_dir = os.path.dirname(os.path.realpath(__file__))\\n cfg.path = base_dir + '/config.json'\\n log_path = base_dir + '/log.log'\\n\\n # Start logging\\n logging.basicConfig(filename=log_path, format='%(asctime)-16s | %(levelname)-5s | %(message)s', level=logging.DEBUG)\\n sys.excepthook = _excepthook\\n\\n # Load configuration\\n cfg.load()\\n logging.info('Loaded configuration')\\n\\n # Print configuration and check if is complete\\n cfg.print()\\n if not cfg.check:\\n logging.info('Exiting...')\\n sys.exit(1)\",\n \"def config_file_setup(logger, cf_label, cf_from_cli=None):\\n presta_config_dir = os.path.join(user_config_dir(__appname__))\\n config_file_from_home = os.path.join(presta_config_dir, cf_label)\\n\\n if not path_exists(config_file_from_home, logger, force=False):\\n logger.info('Creating config path {}'.format(presta_config_dir))\\n ensure_dir(presta_config_dir)\\n config_file_path = '/'.join(['config', cf_label])\\n config_file_from_package = resource_filename(__appname__,\\n config_file_path)\\n copyfile(config_file_from_package, config_file_from_home)\\n\\n config_file_paths = []\\n if cf_from_cli and path_exists(cf_from_cli, logger, force=False):\\n config_file_paths.append(WeightedPath(cf_from_cli, 0))\\n if path_exists(config_file_from_home, logger, force=False):\\n config_file_paths.append(WeightedPath(config_file_from_home, 1))\\n\\n logger.debug(\\\"config file paths: {}\\\".format(config_file_paths))\\n\\n config_file_path = sorted(config_file_paths)[0].path\\n logger.info('Reading configuration from {}'.format(config_file_path))\\n return config_file_path\",\n \"def check_arg_path(self, p):\\n if p.endswith('.qemuboot.conf'):\\n self.qemuboot = p\\n self.qbconfload = True\\n elif re.search('\\\\.bin$', p) or re.search('bzImage', p) or \\\\\\n re.search('zImage', p) or re.search('vmlinux', p) or \\\\\\n re.search('fitImage', p) or re.search('uImage', p):\\n self.kernel = p\\n elif os.path.exists(p) and (not os.path.isdir(p)) and '-image-' in os.path.basename(p):\\n self.rootfs = p\\n # Check filename against self.fstypes can hanlde <file>.cpio.gz,\\n # otherwise, its type would be \\\"gz\\\", which is incorrect.\\n fst = \\\"\\\"\\n for t in self.fstypes:\\n if p.endswith(t):\\n fst = t\\n break\\n if not fst:\\n m = re.search('.*\\\\.(.*)$', self.rootfs)\\n if m:\\n fst = m.group(1)\\n if fst:\\n self.check_arg_fstype(fst)\\n qb = re.sub('\\\\.' + fst + \\\"$\\\", '', self.rootfs)\\n qb = '%s%s' % (re.sub('\\\\.rootfs$', '', qb), '.qemuboot.conf')\\n if os.path.exists(qb):\\n self.qemuboot = qb\\n self.qbconfload = True\\n else:\\n logger.warn(\\\"%s doesn't exist\\\" % qb)\\n else:\\n raise Exception(\\\"Can't find FSTYPE from: %s\\\" % p)\\n\\n elif os.path.isdir(p) or re.search(':', p) and re.search('/', p):\\n if self.is_deploy_dir_image(p):\\n logger.info('DEPLOY_DIR_IMAGE: %s' % p)\\n self.set(\\\"DEPLOY_DIR_IMAGE\\\", p)\\n else:\\n logger.info(\\\"Assuming %s is an nfs rootfs\\\" % p)\\n self.check_arg_nfs(p)\\n elif os.path.basename(p).startswith('ovmf'):\\n self.ovmf_bios.append(p)\\n else:\\n raise Exception(\\\"Unknown path arg %s\\\" % p)\",\n \"def setUp(self):\\n self._wiki = None\\n self._app = None\\n self.rootdir = mkdtemp()\\n self.create_file(u'config.py', self.config_content)\",\n \"def get_hosts(self):\\n self.logger.debug(colorama.Fore.BLUE +\\n \\\"jsnapy.cfg file location used : %s\\\" %\\n get_config_location(), extra=self.log_detail)\\n self.logger.debug(colorama.Fore.BLUE +\\n \\\"Configuration file location used : %s\\\" %\\n get_path('DEFAULT', 'config_file_path'), extra=self.log_detail)\\n \\n if self.args.pre_snapfile is not None:\\n output_file = self.args.pre_snapfile\\n elif self.args.snapcheck is True and self.args.pre_snapfile is None:\\n output_file = \\\"snap_temp\\\"\\n self.snap_del = True\\n else:\\n output_file = \\\"\\\"\\n conf_file = self.args.file\\n check = self.args.check\\n snap = self.args.snap\\n if conf_file is not None:\\n if os.path.isfile(conf_file):\\n config_file = open(conf_file, 'r')\\n self.main_file = yaml.load(config_file)\\n elif os.path.isfile(os.path.join(get_path('DEFAULT', 'config_file_path'), conf_file)):\\n fpath = get_path('DEFAULT', 'config_file_path')\\n config_file = open(os.path.join(fpath, conf_file), 'r')\\n self.main_file = yaml.load(config_file)\\n else:\\n self.logger.error(\\n colorama.Fore.RED +\\n \\\"ERROR!! Config file '%s' is not present \\\" %\\n conf_file, extra=self.log_detail)\\n sys.exit(1)\\n else:\\n if self.args.hostname and self.args.testfiles:\\n temp_dict = {'hosts':[{'device':'', 'username':'', 'passwd':''}], 'tests':[]}\\n temp_dict['hosts'][0]['device'] = self.args.hostname\\n temp_dict['hosts'][0]['username'] = self.args.login\\n temp_dict['hosts'][0]['passwd'] = self.args.passwd\\n for tfile in self.args.testfiles:\\n temp_dict['tests'].append(tfile)\\n self.main_file = temp_dict\\n\\n\\n #### if --check option is given for sqlite, then snap file name is not compulsory ####\\n #### else exit the function saying arguments not correct ####\\n if self.main_file.__contains__(\\n 'sqlite') and self.main_file['sqlite'] and self.main_file['sqlite'][0]:\\n self.chk_database(\\n self.main_file,\\n self.args.pre_snapfile,\\n self.args.post_snapfile,\\n check,\\n snap)\\n else:\\n if (self.args.check is True and (\\n self.args.file is None or self.args.pre_snapfile is None or self.args.post_snapfile is None)):\\n self.logger.error(colorama.Fore.RED +\\n \\\"Arguments not given correctly, Please refer help message\\\",\\n extra=self.log_detail)\\n self.parser.print_help()\\n sys.exit(1)\\n self.login(output_file)\",\n \"def _real_paths(config):\\n for key in ('--config', '--ffmpeg-bin', '--log', '--music-source', '--working-dir'):\\n if not config[key]:\\n continue\\n config[key] = os.path.realpath(os.path.expanduser(config[key]))\",\n \"def pre_process_information(self):\\n self.logger.debug(\\n colorama.Fore.BLUE\\n + \\\"jsnapy.cfg file location used : %s\\\" % get_config_location(),\\n extra=self.log_detail,\\n )\\n self.logger.debug(\\n colorama.Fore.BLUE\\n + \\\"Configuration file location used : %s\\\"\\n % get_path(\\\"DEFAULT\\\", \\\"config_file_path\\\"),\\n extra=self.log_detail,\\n )\",\n \"def __init__(self, root_path):\\r\\n self.root_path = root_path\\r\\n if not os.path.exists(root_path):\\r\\n os.makedirs(root_path)\",\n \"def readConfigFile(self):\\n self.config_obj = ConfigParser.ConfigParser()\\n self.config_obj.readfp(open(self.configfile))\\n\\n # Set the log file\\n if (not self.args_obj.log_file and self.config_obj.has_option('DEFAULT','logfile')):\\n self.logfile = self.config_obj.get('DEFAULT', 'logfile')\\n\\n # Set the baud rate\\n if (not self.args_obj.baud_rate and self.config_obj.has_option('DEFAULT','baud')):\\n self.baudrate = self.config_obj.get('DEFAULT', 'baud')\\n\\n # Set the device port \\n if (not self.args_obj.device and self.config_obj.has_option('DEFAULT','device')):\\n self.device = self.config_obj.get('DEFAULT', 'device')\\n\\n # Set the connection timeout\\n if (not self.args_obj.timeout and self.config_obj.has_option('DEFAULT','timeout')):\\n self.timeout = self.config_obj.get('DEFAULT','timeout')\\n\\n if DEBUG:\\n print('(DEBUG) Config Options:')\\n self.pp.pprint(self.config_obj.sections())\",\n \"def __init__(self, config_path=None):\\n config_path = config_path or CONF.api_paste_config\\n if os.path.exists(config_path):\\n self.config_path = config_path\\n else:\\n self.config_path = CONF.find_file(config_path)\",\n \"def _prep_test(self):\\n if not os.path.isfile(self.confpath):\\n LOGGER.error(\\\"Conf file not valid: %s\\\", self.confpath)\\n if not os.path.isfile(self.testlist):\\n LOGGER.error(\\\"testlist file not valid: %s\\\", self.testlist)\",\n \"def test_ignore_non_configs_from_current_dir(tmp_path: pathlib.Path) -> None:\\n\\n cli.startup(tmp_path)\\n\\n junk_config = tmp_path / \\\"myconfig.psd\\\"\\n junk_config.touch()\\n conf = tmp_path / \\\"watmyconfig.json\\\"\\n conf.touch()\\n configs_found = in_dir(tmp_path)\\n assert len(configs_found) == 1\",\n \"def _init_config(self, configPath=None):\\n # TODO: The SafeConfigParser class has been renamed to ConfigParser in Python 3.2.\\n # This alias will be removed in future versions.\\n # We still use SafeConfigParser for backwards compatibility with Python 2.\\n self.config = SafeConfigParser()\\n # Make option names case sensitive\\n self.config.optionxform = str\\n\\n if configPath and os.path.isdir(configPath):\\n configDir = configPath\\n else:\\n configDir = os.path.join(os.path.dirname(os.path.realpath(__file__)), 'conf')\\n\\n # List filenames in configDir alphabetically\\n _, _, configFiles = next(os.walk(configDir))\\n configFiles = sorted(configFiles, key=str.lower)\\n\\n # Read configuration pipeline\\n for f in configFiles:\\n with open(os.path.join(configDir, f)) as configFile:\\n self.config.readfp(configFile)\\n self._store_config_pass()\\n\\n if configPath and os.path.isfile(configPath):\\n self.config.read(configPath)\\n self._store_config_pass()\\n\\n appSection = 'application'\\n self.appName = self._get_option_value(appSection, 'appName')\\n self.appResource = self._get_option_value(appSection, 'appResource')\\n self.appArgs = []\\n appArgs = self._get_option_value(appSection, 'appArgs')\\n if appArgs:\\n self.appArgs = appArgs.split(' ')\\n self.mainClass = self._get_option_value(appSection, 'mainClass')\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.6453089","0.63893116","0.62628293","0.6203292","0.61769146","0.6169113","0.6103033","0.6092019","0.60891813","0.6075031","0.6063229","0.60553133","0.60498255","0.6032961","0.60153127","0.5980272","0.59365386","0.59269124","0.5921976","0.5921835","0.591809","0.59162027","0.59065837","0.5898748","0.58953357","0.5892111","0.5878654","0.58723736","0.58646935","0.58607477","0.5845702","0.5845702","0.583296","0.5829095","0.5826809","0.5812458","0.58108616","0.58080935","0.57959586","0.5793713","0.577614","0.57749647","0.5773486","0.57538927","0.5753366","0.57519746","0.5750386","0.57502496","0.57470083","0.57412636","0.5732899","0.57307297","0.57282424","0.5722484","0.57167464","0.5702766","0.5702544","0.56848586","0.56840664","0.5680867","0.56789476","0.56776834","0.5673542","0.5672469","0.5671791","0.5669366","0.5666052","0.5650121","0.5649162","0.56490344","0.56476814","0.5646387","0.5641404","0.56412005","0.5640579","0.5634524","0.5625793","0.56227475","0.56121373","0.56093526","0.5607996","0.56072307","0.5605271","0.56050104","0.55888665","0.5587677","0.55847996","0.5583773","0.55809546","0.5573635","0.5564399","0.5560984","0.55600554","0.5559736","0.5557547","0.55558634","0.5555597","0.55537426","0.55531025","0.55476344","0.55436933"],"string":"[\n \"0.6453089\",\n \"0.63893116\",\n \"0.62628293\",\n \"0.6203292\",\n \"0.61769146\",\n \"0.6169113\",\n \"0.6103033\",\n \"0.6092019\",\n \"0.60891813\",\n \"0.6075031\",\n \"0.6063229\",\n \"0.60553133\",\n \"0.60498255\",\n \"0.6032961\",\n \"0.60153127\",\n \"0.5980272\",\n \"0.59365386\",\n \"0.59269124\",\n \"0.5921976\",\n \"0.5921835\",\n \"0.591809\",\n \"0.59162027\",\n \"0.59065837\",\n \"0.5898748\",\n \"0.58953357\",\n \"0.5892111\",\n \"0.5878654\",\n \"0.58723736\",\n \"0.58646935\",\n \"0.58607477\",\n \"0.5845702\",\n \"0.5845702\",\n \"0.583296\",\n \"0.5829095\",\n \"0.5826809\",\n \"0.5812458\",\n \"0.58108616\",\n \"0.58080935\",\n \"0.57959586\",\n \"0.5793713\",\n \"0.577614\",\n \"0.57749647\",\n \"0.5773486\",\n \"0.57538927\",\n \"0.5753366\",\n \"0.57519746\",\n \"0.5750386\",\n \"0.57502496\",\n \"0.57470083\",\n \"0.57412636\",\n \"0.5732899\",\n \"0.57307297\",\n \"0.57282424\",\n \"0.5722484\",\n \"0.57167464\",\n \"0.5702766\",\n \"0.5702544\",\n \"0.56848586\",\n \"0.56840664\",\n \"0.5680867\",\n \"0.56789476\",\n \"0.56776834\",\n \"0.5673542\",\n \"0.5672469\",\n \"0.5671791\",\n \"0.5669366\",\n \"0.5666052\",\n \"0.5650121\",\n \"0.5649162\",\n \"0.56490344\",\n \"0.56476814\",\n \"0.5646387\",\n \"0.5641404\",\n \"0.56412005\",\n \"0.5640579\",\n \"0.5634524\",\n \"0.5625793\",\n \"0.56227475\",\n \"0.56121373\",\n \"0.56093526\",\n \"0.5607996\",\n \"0.56072307\",\n \"0.5605271\",\n \"0.56050104\",\n \"0.55888665\",\n \"0.5587677\",\n \"0.55847996\",\n \"0.5583773\",\n \"0.55809546\",\n \"0.5573635\",\n \"0.5564399\",\n \"0.5560984\",\n \"0.55600554\",\n \"0.5559736\",\n \"0.5557547\",\n \"0.55558634\",\n \"0.5555597\",\n \"0.55537426\",\n \"0.55531025\",\n \"0.55476344\",\n \"0.55436933\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.0"},"document_rank":{"kind":"string","value":"-1"}}},{"rowIdx":6091,"cells":{"query":{"kind":"string","value":"Made after reading config file. Check for ffmpeg in path. Create .thumbnails dir if necessary and create .nomedia in it. Copy photobox file to destination dir. Handle priority between command line and config file."},"document":{"kind":"string","value":"def setup_part2(args):\n if args.update:\n args.sourcedir = args.source.sourcedir\n args.bydir = args.source.bydir\n args.bydate = args.source.bydate\n args.diary = args.source.diary\n args.recursive = args.source.recursive\n args.dates = args.source.dates\n args.github_pages = args.source.github_pages\n elif args.gallery:\n args.source.sourcedir = args.sourcedir\n args.source.bydir = args.bydir\n args.source.bydate = args.bydate\n args.source.diary = args.diary\n args.source.recursive = args.recursive\n args.source.dates = args.dates\n args.source.github_pages = args.github_pages\n update_config(args)\n\n if args.github_pages:\n args.html_suffix = '.html'\n else:\n args.html_suffix = '.htm'\n\n rootext = os.path.splitext(args.rootarg)[1]\n if rootext:\n args.rootname = os.path.basename(args.rootarg)\n else:\n args.rootname = 'index' + args.html_suffix\n\n if args.sourcedir:\n args.sourcedir = os.path.abspath(args.sourcedir)\n if os.path.splitdrive(args.sourcedir)[0]:\n drive, rest = os.path.splitdrive(args.sourcedir)\n args.sourcedir = drive.upper() + rest\n if not os.path.isdir(args.sourcedir):\n error('Directory not found', args.sourcedir)\n else:\n if args.gallery and args.diary is False and args.update is None:\n error('Directory not found', 'Use --sourcedir')\n\n if args.dest:\n args.dest = os.path.abspath(args.dest)\n\n if args.dest is None:\n args.dest = args.root\n\n if args.blogger and args.urlblogger is None:\n error('No blogger url (--url)')\n\n if args.gallery or args.update:\n # check for ffmpeg and ffprobe in path\n for exe in ('ffmpeg', 'ffprobe'):\n try:\n check_output([exe, '-version'])\n except FileNotFoundError:\n error('File not found', exe)\n\n if args.github_pages:\n args.thumbrep = 'thumbnails'\n else:\n args.thumbrep = '.thumbnails'\n\n args.thumbdir = os.path.join(args.dest, args.thumbrep)\n if not os.path.exists(args.thumbdir):\n os.mkdir(args.thumbdir)\n open(os.path.join(args.thumbdir, '.nomedia'), 'a').close()\n\n favicondst = os.path.join(args.dest, 'favicon.ico')\n if not os.path.isfile(favicondst):\n faviconsrc = os.path.join(os.path.dirname(__file__), 'favicon.ico')\n shutil.copyfile(faviconsrc, favicondst)\n\n photoboxdir = os.path.join(args.dest, 'photobox')\n if not os.path.exists(photoboxdir):\n photoboxsrc = os.path.join(os.path.dirname(__file__), 'photobox')\n shutil.copytree(photoboxsrc, photoboxdir)\n\n if args.dates:\n if not(args.gallery or args.create):\n # silently ignored for the moment, otherwise all other commands will\n # launch a wanrning or an error on the default --dates value\n pass\n\n if args.dates == 'source':\n pass\n elif args.dates == 'diary':\n if args.create:\n error('Incorrect date format', args.dates)\n elif re.match(r'\\d+-\\d+', args.dates):\n date1, date2 = args.dates.split('-')\n if validate_date(date1) and validate_date(date2):\n args.dates = date1, date2\n else:\n error('Incorrect date format', args.dates)\n else:\n error('Incorrect date format', args.dates)"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["def take_one_shot(path_to_images, name_image, video_source=\"/dev/video0\"):\n subprocess_cmd(\"ffmpeg -f video4linux2 -s 1280x720 -i {} -frames 1 ./{}/{} -loglevel error -nostats\".format(video_source, path_to_images, name_image))","def makeVideo():\n os.system(\"cd video && ffmpeg -r 10 -i img%05d.jpg -vcodec mpeg4 -y caronthehill_clip.mp4\")","def thumbnail(self, fnameIn, fnameOut):\n cmd = \"convert -define jpeg:size=500x150 \"\n cmd += '\"%s\" ' % os.path.join(self.downloadFolder, fnameIn)\n cmd += \"-auto-orient -thumbnail 250x150 \"\n cmd += '\"%s\" ' % os.path.join(self.thumbnailFolder, fnameOut)\n self.log(\"creating thumbnail ...\")\n self.log(cmd)\n process = subprocess.Popen(cmd, shell=True, stdout=subprocess.PIPE)\n process.wait()","def make_video(pattern, plotdir, moviedir, movienametag):\n images_list = glob('%s/%s'%(plotdir, pattern))\n images_list.sort()\n # save all required files into tmp_moviedir, with simple filenames: %.4d.png\n tmp_moviedir = '%s/tmp_movie_%s'%(plotdir, movienametag)\n os.system('mkdir -p %s'%tmp_moviedir)\n for i in range(len(images_list)):\n fname = images_list[i].split('%s/'%plotdir)[-1].split('.png')[0]\n os.system('cp %s/%s.png %s/%.4d.png'%(plotdir, fname, tmp_moviedir, i))\n\n os.system('avconv -i %s'%tmp_moviedir +'/%04d.png ' \\\n +' -y -c:v libx264 -pix_fmt yuv420p %s/%s.mp4'%(moviedir, movienametag))","def generate_thumbnail():\n import tempfile\n import glob\n from anima.env import mayaEnv\n m_env = mayaEnv.Maya()\n v = m_env.get_current_version()\n\n if not v:\n return\n\n # do not generate a thumbnail from a Repr\n if '@' in v.take_name:\n return\n\n task = v.task\n project = task.project\n # repo = project.repository\n imf = project.image_format\n width = int(imf.width * 0.5)\n height = int(imf.height * 0.5)\n\n temp_output = tempfile.mktemp()\n\n current_frame = pm.currentTime(q=1)\n output_file = pm.playblast(\n fmt='image',\n startTime=current_frame,\n endTime=current_frame,\n sequenceTime=1,\n forceOverwrite=1,\n filename=temp_output,\n clearCache=1,\n showOrnaments=1,\n percent=100,\n wh=(width, height),\n offScreen=1,\n viewer=0,\n compression='PNG',\n quality=70,\n framePadding=0\n )\n pm.currentTime(current_frame)\n\n output_file = output_file.replace('####', '*')\n found_output_file = glob.glob(output_file)\n if found_output_file:\n output_file = found_output_file[0]\n\n from anima.ui import utils\n utils.upload_thumbnail(task, output_file)\n\n return found_output_file","def main(base_dir: str, output_dir: str) -> None:\n base_path = pathlib.Path(base_dir)\n output_path = pathlib.Path(output_dir).expanduser()\n\n stage_copy_images(base_path, output_path)\n stage_extract_videos(base_path, output_path)","def copy_file_to_server():\r\n utils.system_output('mv /home/chronos/user/Downloads/* /usr/local/autotest/results/default/',ignore_status=True)\r\n logging.info(\"Video Copied to Log location\")","def main():\n destination = Path(argv[1])\n source_files = destination.glob(\"**/*.wma\")\n for file in source_files:\n new_name = file.name.rsplit(\".\", maxsplit=1)[0] + \".flac\"\n dest = str(file.parent / new_name)\n cmd = list(map(str, [\"avconv\", \"-i\", file, dest]))\n if platform == \"win32\":\n print(\"Running on windows... on Unix I'd run the following command:\")\n print(cmd)\n else:\n that = Popen(cmd)\n that.wait()","def copyMedia(source, target):\n if not os.path.exists(target):\n print(\"copying source,target:\", source, target)\n shutil.copy2(source, target)","def prep(path,date,image):\n \n # run bash code with 'Popen'\n P = Popen('cp '+path+date+'/final/'+image+' ./', shell=True)\n P.wait()\n P = Popen('mv '+image+' '+image+'.fz', shell=True)\n P.wait()\n P = Popen('funpack *.fz', shell=True)\n P.wait()\n P = Popen('rm -rf *.fz', shell=True)\n P.wait()","def process_video(proc_state):\n entry = proc_state.entry\n workbench = proc_state.workbench\n video_config = mgg.global_config['media_type:mediagoblin.media_types.video']\n\n queued_filepath = entry.queued_media_file\n queued_filename = proc_state.get_queued_filename()\n name_builder = FilenameBuilder(queued_filename)\n\n medium_filepath = create_pub_filepath(\n entry, name_builder.fill('{basename}-640p.webm'))\n\n thumbnail_filepath = create_pub_filepath(\n entry, name_builder.fill('{basename}.thumbnail.jpg'))\n\n # Create a temporary file for the video destination (cleaned up with workbench)\n tmp_dst = NamedTemporaryFile(dir=workbench.dir, delete=False)\n with tmp_dst:\n # Transcode queued file to a VP8/vorbis file that fits in a 640x640 square\n progress_callback = ProgressCallback(entry)\n\n dimensions = (\n mgg.global_config['media:medium']['max_width'],\n mgg.global_config['media:medium']['max_height'])\n\n # Extract metadata and keep a record of it\n metadata = transcoders.VideoTranscoder().discover(queued_filename)\n store_metadata(entry, metadata)\n\n # Figure out whether or not we need to transcode this video or\n # if we can skip it\n if skip_transcode(metadata):\n _log.debug('Skipping transcoding')\n\n dst_dimensions = metadata['videowidth'], metadata['videoheight']\n\n # Push original file to public storage\n _log.debug('Saving original...')\n proc_state.copy_original(queued_filepath[-1])\n\n did_transcode = False\n else:\n transcoder = transcoders.VideoTranscoder()\n\n transcoder.transcode(queued_filename, tmp_dst.name,\n vp8_quality=video_config['vp8_quality'],\n vp8_threads=video_config['vp8_threads'],\n vorbis_quality=video_config['vorbis_quality'],\n progress_callback=progress_callback,\n dimensions=dimensions)\n\n dst_dimensions = transcoder.dst_data.videowidth,\\\n transcoder.dst_data.videoheight\n\n # Push transcoded video to public storage\n _log.debug('Saving medium...')\n mgg.public_store.copy_local_to_storage(tmp_dst.name, medium_filepath)\n _log.debug('Saved medium')\n\n entry.media_files['webm_640'] = medium_filepath\n\n did_transcode = True\n\n # Save the width and height of the transcoded video\n entry.media_data_init(\n width=dst_dimensions[0],\n height=dst_dimensions[1])\n\n # Temporary file for the video thumbnail (cleaned up with workbench)\n tmp_thumb = NamedTemporaryFile(dir=workbench.dir, suffix='.jpg', delete=False)\n\n with tmp_thumb:\n # Create a thumbnail.jpg that fits in a 180x180 square\n transcoders.VideoThumbnailerMarkII(\n queued_filename,\n tmp_thumb.name,\n 180)\n\n # Push the thumbnail to public storage\n _log.debug('Saving thumbnail...')\n mgg.public_store.copy_local_to_storage(tmp_thumb.name, thumbnail_filepath)\n entry.media_files['thumb'] = thumbnail_filepath\n\n # save the original... but only if we did a transcoding\n # (if we skipped transcoding and just kept the original anyway as the main\n # media, then why would we save the original twice?)\n if video_config['keep_original'] and did_transcode:\n # Push original file to public storage\n _log.debug('Saving original...')\n proc_state.copy_original(queued_filepath[-1])\n\n # Remove queued media file from storage and database\n proc_state.delete_queue_file()","def prepare_video(path_to_video: str, number_of_images=87) -> None:\n\n temp_video = path.join(path_to_video, 'temp_outpy.mp4')\n video = path.join(path_to_video, 'outpy.h264')\n\n # create mp4 video for metadata and compute video duration\n subprocess.run(['ffmpeg', '-i', video, '-c', 'copy', temp_video])\n result = subprocess.run([\"ffprobe\", \"-v\", \"error\", \"-show_entries\",\n \"format=duration\", \"-of\",\n \"default=noprint_wrappers=1:nokey=1\", temp_video],\n stdout=subprocess.PIPE,\n stderr=subprocess.STDOUT)\n video_duration = float(result.stdout)\n\n # create images folder\n path_to_images = path.join(path_to_video, 'images')\n if path.exists(path_to_images) and path.isdir(path_to_images):\n shutil.rmtree(path_to_images)\n makedirs(path_to_images)\n\n # split the given video into images\n subprocess.run(['ffmpeg', '-i', temp_video, '-r', str(number_of_images / video_duration), '-f', 'image2',\n path.join(path_to_images, 'image%d.jpg')])\n\n # remove extra files\n remove_extra_images(path_to_images, number_of_images)\n remove(temp_video)","def make_video(input_files, width=0, height=0, frame_rate=24, crf=20, output_path=\"video.mp4\"):\n if isinstance(input_files, list):\n from PIL import Image # pylint: disable=C0415\n\n with Image.open(input_files[0]) as img:\n width, height = img.size\n tmp_dir = \"tmp_ffmpeg_dir\"\n os.mkdir(tmp_dir)\n if width % 2 != 0:\n print(f\"Width ({width}) not divisible by 2\")\n width -= 1\n if height % 2 != 0:\n print(f\"Height ({width}) not divisible by 2\")\n height -= 1\n for i, inp in enumerate(input_files):\n shutil.copy(inp, os.path.join(tmp_dir, f\"{i:06d}.png\"))\n inputs = f\"{tmp_dir}/%06d.png\"\n command = ffmpeg_common_args(frame_rate, inputs, width, height, crf, output_path)\n ret = os.system(command)\n assert ret == 0, \"ffmpeg failed to generate video file.\"\n for i in range(len(input_files)):\n os.remove(os.path.join(tmp_dir, f\"{i:06d}.png\"))\n os.rmdir(tmp_dir)\n elif isinstance(input_files, str):\n assert width != 0 and height != 0\n command = ffmpeg_common_args(frame_rate, input_files, width, height, crf, output_path)\n ret = os.system(command)\n assert ret == 0, \"ffmpeg failed to generate video file.\"\n else:\n assert (\n False\n ), f'input_files should be list (of files) or str (of file template, e.g., \"%04d.png\") instead of {type(input_files)}'","def createThumbnail(self, useCursorPosition=False, dbPath = None, versionInt = None):\n\n return \"\"\n # logger.debug(\"Func: createThumbnail\")\n # projectPath = self.projectDir\n # if useCursorPosition:\n # versionInt = self.currentVersionIndex\n # dbPath = self.currentDatabasePath\n # else:\n # if not dbPath or not versionInt:\n # msg = \"Both dbPath and version must be defined if useCursorPosition=False\"\n # raise Exception ([360, msg])\n #\n # versionStr = \"v%s\" % (str(versionInt).zfill(3))\n # dbDir, shotNameWithExt = os.path.split(dbPath)\n # shotName = os.path.splitext(shotNameWithExt)[0]\n #\n # thumbPath = \"{0}_{1}_thumb.jpg\".format(os.path.join(dbDir, shotName), versionStr)\n # relThumbPath = os.path.relpath(thumbPath, projectPath)\n #\n # # create a thumbnail using playblast\n # thumbDir = os.path.split(thumbPath)[0]\n # if os.path.exists(thumbDir):\n # # frame = pm.currentTime(query=True)\n # frame = cmds.currentTime(query=True)\n # # store = pm.getAttr(\"defaultRenderGlobals.imageFormat\")\n # store = cmds.getAttr(\"defaultRenderGlobals.imageFormat\")\n # # pm.setAttr(\"defaultRenderGlobals.imageFormat\", 8) # This is the value for jpeg\n # cmds.setAttr(\"defaultRenderGlobals.imageFormat\", 8) # This is the value for jpeg\n # # pm.playblast(completeFilename=thumbPath, forceOverwrite=True, format='image', width=221, height=124, showOrnaments=False, frame=[frame], viewer=False, percent=100)\n # cmds.playblast(completeFilename=thumbPath, forceOverwrite=True, format='image', width=221, height=124, showOrnaments=False, frame=[frame], viewer=False, percent=100)\n # # pm.setAttr(\"defaultRenderGlobals.imageFormat\", store) #take it back\n # cmds.setAttr(\"defaultRenderGlobals.imageFormat\", store) #take it back\n # else:\n # # pm.warning(\"something went wrong with thumbnail. Skipping thumbnail\")\n # cmds.warning(\"something went wrong with thumbnail. Skipping thumbnail\")\n # return \"\"\n # # return thumbPath\n # return relThumbPath","def write_thumbnails(self, appstruct):\n slugser = slugify(appstruct[\"serial\"])\n pdf_filename = \"thumbnails/%s/uploaded.pdf\" % slugser\n top_file = \"thumbnails/%s/top.png\" % slugser\n mos_file = \"thumbnails/%s/mosaic.png\" % slugser\n \n thumg = ThumbnailGenerator(pdf_filename)\n self.save_blob(thumg.top_thumbnail(), top_file)\n self.save_blob(thumg.mosaic_thumbnail(), mos_file)","def main():\n # load parameters\n params = load_params()\n # check that both profiles exist (we assume that this means the directories\n # are found on disk)\n if not os.path.exists(params['profile1']):\n emsg = 'profile1={0} does not exist'\n eargs = [params['profile1']]\n raise AperoCopyError(emsg.format(*eargs))\n if not os.path.exists(params['profile2']):\n emsg = 'profile2={0} does not exist'\n eargs = [params['profile2']]\n raise AperoCopyError(emsg.format(*eargs))\n # get a list of files from profile 1 for each block kinds\n files1, paths1 = get_files_profile1(params)\n # get the output files for profile 2 for each block kind\n files2, files3, paths2, paths3 = get_files_profile2(params, files1, paths1)\n # copy files from profile 1 to profile 2 for each block kind\n # must copy files to a temporary path first (copying can be slow)\n copy_files(params, files1, files2, files3)\n # may need to update profile 2 (via git) to match profile 1\n update_git_profile2(params)\n # remove all old files from profile 2 blocks\n success = reset_profile2(params, paths3)\n # rename the directories in profile 2 (this is quicker than copying)\n if success:\n success = rename_directories(params, paths2, paths3)\n # update databases for profile 2\n if success:\n update_databases_profile2(params)\n # return to __main__\n return","def copy_support_files() -> None:\n # root folder files\n filelist = {\"favicon128.png\",\n \"favicon96.png\",\n \"favicon72.png\",\n \"favicon48.png\",\n \"favicon32.png\",\n \"favicon24.png\",\n \"favicon16.png\",\n \"favicon.ico\",\n \"apple-touch-icon.png\",\n \"apple-touch-icon-precomposed.png\",\n \"apple-touch-icon-72x72.png\",\n \"apple-touch-icon-72x72-precomposed.png\",\n \"apple-touch-icon-114x114.png\",\n \"apple-touch-icon-114x114-precomposed.png\",\n \"apple-touch-icon-144x144.png\",\n \"apple-touch-icon-144x144-precomposed.png\",\n \"uca_style.css\"}\n for filename in filelist:\n try:\n shutil.copy2(\"resources/\" + filename, WEBOUT_PATH)\n except FileNotFoundError:\n report_error(\"Missing file: resources/\" + filename)\n # image folder files\n filelist = {\"film.png\",\n \"stylifera75.png\",\n \"DOI_logo.svg\",\n \"size_hist.png\",\n \"size_ind.png\",\n \"size_mean.png\",\n \"size_range.png\",\n \"size_summary.png\",\n \"double_clawed.jpg\"}\n for filename in filelist:\n try:\n shutil.copy2(\"resources/images/\" + filename, WEBOUT_PATH + \"images/\")\n except FileNotFoundError:\n report_error(\"Missing file: resources/images/\" + filename)\n filelist = {\"specific_word_cloud.png\",\n \"binomial_word_cloud.png\"}\n for filename in filelist:\n try:\n shutil.copy2(TMP_PATH + filename, WEBOUT_PATH + \"images/\")\n except FileNotFoundError:\n report_error(\"Missing file: \" + TMP_PATH + filename)\n # font-awesome files\n filelist = {\"fontawesome.min.js\",\n \"brands.min.js\",\n \"regular.min.js\",\n \"solid.min.js\"}\n for filename in filelist:\n try:\n shutil.copy2(\"resources/font-awesome/js/\" + filename, WEBOUT_PATH + \"js/\")\n except FileNotFoundError:\n report_error(\"Missing file: resources/font-awesome/js/\" + TMP_PATH + filename)\n # flag-icon files\n filelist = {\"flag-icons.min.css\"}\n for filename in filelist:\n try:\n shutil.copy2(\"resources/flag-icon-css/css/\" + filename, WEBOUT_PATH + \"images/flag-icon-css/css/\")\n except FileNotFoundError:\n report_error(\"Missing file: images/flag-icon-css/css/\" + TMP_PATH + filename)\n filelist = {\"de.svg\", # Germany\n \"es.svg\", # Spain\n \"ru.svg\", # Russia\n \"fr.svg\", # France\n \"pt.svg\", # Portugal\n \"dk.svg\", # Denmark\n \"nl.svg\", # Netherlands\n \"jp.svg\", # Japan\n \"cn.svg\", # China\n \"us.svg\", # USA\n \"th.svg\", # Thailand\n \"va.svg\", # Vatican\n \"it.svg\", # Italy\n \"kr.svg\", # South Korea\n \"pl.svg\", # Poland\n \"mm.svg\", # Myanamar (Burma)\n \"sa.svg\", # Saudi Arabia (best option for Arabic of those available)\n \"id.svg\", # Indonesia\n \"za.svg\", # South Africa (best option for Afrikaans)\n \"my.svg\", # Malaysia (for Malay)\n \"mg.svg\", # Madagascar (for Malagasy)\n \"ir.svg\", # Iran (for Persian)\n \"vn.svg\"} # Vietnam\n for filename in filelist:\n try:\n shutil.copy2(\"resources/flag-icon-css/flags/4x3/\" + filename, WEBOUT_PATH +\n \"images/flag-icon-css/flags/4x3/\")\n except FileNotFoundError:\n report_error(\"Missing file: images/flag-icon-css/flags/4x3/\" + TMP_PATH + filename)","def post_process_hls(d):\r\n\r\n log('post_process_hls()> start processing', d.name)\r\n\r\n local_video_m3u8_file = os.path.join(d.temp_folder, 'local_video.m3u8')\r\n local_audio_m3u8_file = os.path.join(d.temp_folder, 'local_audio.m3u8')\r\n\r\n cmd = f'\"{config.ffmpeg_actual_path}\" -loglevel error -stats -y -protocol_whitelist \"file,http,https,tcp,tls,crypto\" ' \\\r\n f'-allowed_extensions ALL -i \"{local_video_m3u8_file}\" -c copy \"file:{d.temp_file}\"'\r\n error, output = run_command(cmd, d=d)\r\n\r\n if error:\r\n # retry without \"-c copy\" parameter, takes longer time\r\n cmd = f'\"{config.ffmpeg_actual_path}\" -loglevel error -stats -y -protocol_whitelist \"file,http,https,tcp,tls,crypto\" ' \\\r\n f'-allowed_extensions ALL -i \"{local_video_m3u8_file}\" \"file:{d.temp_file}\"'\r\n error, output = run_command(cmd, d=d)\r\n\r\n if error:\r\n log('post_process_hls()> ffmpeg failed:', output)\r\n return False\r\n\r\n if 'dash' in d.subtype_list:\r\n cmd = f'\"{config.ffmpeg_actual_path}\" -loglevel error -stats -y -protocol_whitelist \"file,http,https,tcp,tls,crypto\" ' \\\r\n f'-allowed_extensions ALL -i \"{local_audio_m3u8_file}\" -c copy \"file:{d.audio_file}\"'\r\n error, output = run_command(cmd, d=d)\r\n\r\n if error:\r\n # retry without \"-c copy\" parameter, takes longer time\r\n cmd = f'\"{config.ffmpeg_actual_path}\" -loglevel error -stats -y -protocol_whitelist \"file,http,https,tcp,tls,crypto\" ' \\\r\n f'-allowed_extensions ALL -i \"{local_audio_m3u8_file}\" \"file:{d.audio_file}\"'\r\n error, output = run_command(cmd, d=d)\r\n\r\n if error:\r\n log('post_process_hls()> ffmpeg failed:', output)\r\n return False\r\n\r\n log('post_process_hls()> done processing', d.name)\r\n\r\n return True","def save_video(foldername, songname, songlen, num_steps, output):\n num_steps_by_len = num_steps / songlen\n p = subprocess.Popen(['ffmpeg', '-f', 'image2', '-r', str(num_steps_by_len), '-i', '%d.png', '-c:v', 'libx264', '-pix_fmt', 'yuv420p', '-vf', 'pad=ceil(iw/2)*2:ceil(ih/2)*2', 'movie.mp4'], cwd=foldername)\n p.wait()\n\n p = subprocess.Popen(['ffmpeg', '-i', 'movie.mp4', '-i', '../audio_files/' + songname + '.mp3', '-map', '0:v', '-map', '1:a', '-c', 'copy', output], cwd=foldername)\n p.wait()","def create_movie(name, folder):\n cmd = [\"ffmpeg\", \"-framerate\", \"1\", \"-i\", folder + \"/pic%04d.png\", \"-c:v\",\n \"libx264\", \"-r\", \"30\", \"-pix_fmt\", \"yuv420p\", name]\n return subprocess.call(cmd)","def _copy_snpeff_config(self):\n\n CONFIG = sequana_data(\"snpEff.config\", \"snpeff\")\n os.makedirs(self.snpeff_datadir, exist_ok=True)\n shutil.copyfile(CONFIG, self.configfile)","def let_camera_update_parameters(path_to_images, name_image, video_source=\"/dev/video0\"):\n subprocess_cmd(\"ffmpeg -f video4linux2 -s 1280x720 -i {} -ss 00:00:02 -frames 1 ./{}/{} -loglevel error -nostats\".format(video_source, path_to_images, name_image))","def _init(args, workflows_dir, config_path):\n for file in [\"samples.tsv\", \"config.yaml\"]:\n src = os.path.join(workflows_dir, args.workflow.replace(\"-\", \"_\"), file)\n dest = os.path.join(os.path.dirname(config_path), file)\n\n copy_file = True\n if os.path.exists(dest) and args.force is False:\n choices = {\"yes\": True, \"y\": True, \"no\": False, \"n\": False}\n\n sys.stdout.write(f\"File: {dest} already exists. Do you want to overwrite it? (yes/no) \")\n while True:\n choice = input().lower()\n if choice in choices:\n copy_file = choices[choice]\n break\n else:\n print(\"Please respond with yes (y) or no (n).\")\n\n if copy_file:\n shutil.copyfile(src, dest)","def get_video_as_images():\n experiments = ['me1.mp4']\n try:\n if (os.path.isdir(\"dump\")):\n shutil.rmtree('dump')\n except OSError:\n print (\"Deletion of the directory failed\")\n exit()\n os.system('mkdir dump')\n for experiment in experiments:\n exp_no_ext = experiment.split('.')[0]\n subdir_cmd = \"dump/{0}\".format(exp_no_ext)\n os.mkdir(subdir_cmd)\n os.system('ffmpeg -i videos/%s dump/%s/%s%%03d.jpg' % (experiment, exp_no_ext, exp_no_ext))\n run_all(exp_no_ext)","def prepare_destination(self):\n self.movie_root_path = self.config.share_movie_root_path % (\n self.share_path, self.title)\n\n if os.path.isdir(self.movie_root_path):\n if self.capacity_reached():\n Logger.log(\n '[!] Capacity reached. Skipping adding movie %s.' % self.title)\n else:\n if not os.path.isdir(self.movie_root_path):\n Logger.log('[+] Adding Movie: %s' % self.title)\n os.mkdir(self.movie_root_path)","def main():\n parser = CustomArgumentParser()\n parser.add_argument(\"-s\", \"--simon-sez\",\n help=\"Really, Simon sez copy the data!\", action=\"store_true\")\n parser.add_argument(\"-r\", \"--src-directory\",\n help=\"Copy metadata from files in this directory.\")\n parser.add_argument(\"-d\", \"--dst-directory\",\n help=\"Copy metadata to matching files in this directory.\")\n parser.add_argument(\"-v\", \"--verbose\", help=\"Log level to DEBUG.\",\n action=\"store_true\")\n args = parser.parse_args()\n\n if args.verbose:\n logging.basicConfig(level=logging.DEBUG)\n else:\n logging.basicConfig(level=logging.INFO)\n\n error = False\n\n # Require these two arguments.\n for arg in [args.src_directory, args.dst_directory]:\n if not arg:\n logger.error(\n \"Required src or dst directory parameter missing.\")\n error = True\n # XXX: Duplicates exit below. Can't check directory if null.\n logger.error(\"Exiting due to errors.\")\n parser.usage_message()\n sys.exit(1)\n\n if (os.path.exists(args.src_directory) and\n os.path.isdir(args.src_directory)):\n src_directory = args.src_directory\n else:\n logger.error(\n \"--src-directory={} does not exist or is not a directory.\".format(\n args.dst_directory))\n error = True\n\n if (os.path.exists(args.dst_directory) and\n os.path.isdir(args.dst_directory)):\n dst_directory = args.dst_directory\n else:\n logger.error(\n \"--dst-directory={} does not exist or is not a directory.\".format(\n args.dst_directory))\n error = True\n\n if error:\n logger.error(\"Exiting due to errors.\")\n parser.usage_message()\n sys.exit(1)\n else:\n process_all_files(src_directory, dst_directory, simon_sez=args.simon_sez)","def make_image_dir(to_path, filenames):\n image_dir = os.path.join(to_path, \"image_2\")\n os.makedirs(image_dir)\n for f in filenames:\n image_file = os.path.join(image_dir, f + \".png\")\n os.system(\"cp sample.png {}\".format(image_file))","def write_upload_files(self, appstruct):\n \n # Create the directory if it does not exist\n final_dir = \"thumbnails/%s\" % slugify(appstruct[\"serial\"])\n if not os.path.exists(final_dir):\n log.info(\"Make directory: %s\", final_dir)\n os.makedirs(final_dir)\n\n final_file = \"%s/uploaded.pdf\" % final_dir\n file_pointer = appstruct[\"pdf_upload\"][\"fp\"]\n self.single_file_write(file_pointer, final_file)","def TextureFiles():\n import shutil\n\n # first convert the .psd files to .png\n\n FbmDir = glo.outputFolder + '.fbm'\n\n for d1, d2, filenames in os.walk(FbmDir):\n for filename in filenames:\n \"\"\"filename: vitrin_diffuse.psd\n \"\"\"\n # print \"TextureFiles():\", filename\n if filename[-4:].upper() == '.PSD':\n #print \" -- FbmDir:\" , FbmDir\n #print \" -- in the if clause with filename:\" , filename\n #print \" -- glo.outputFolder\" , glo.outputFolder\n # FbmDir = '../fbx/simplelifeembedmedia.fbm'\n # filename = 'shelves_light.PSD'\n PsdToPngConverter(FbmDir, filename)\n\n # Move only the .png file to the ../png/ directory\n filename = filename[:-4] + '.png'\n src = os.path.join(FbmDir, filename)\n elif filename[0] != '.':\n src = os.path.join(FbmDir, filename)\n pass\n\n shutil.copy(src, glo.outputFolder)\n print os.path.join(glo.outputFolder, filename), \"\\n\"\n sys.stdout.flush()\n # for d1, d2, files in os.walk(glo.outputFolder):\n # if not filename in files:\n # #print \"moving: \", files, filename, not filename in files\n # shutil.copy(src, glo.outputFolder)\n # print os.path.join(glo.outputFolder, filename), \"\\n\"\n # else:\n # print \"%s/%s already exists. File not moved\" % (glo.outputFolder,filename)","def handle_image(name):\n from_path = args.from_dir + name\n to_path = args.to_dir + name\n\n if width != args.width:\n subprocess.call('jpegtran -rotate 90 -grayscale ' + from_path + ' > ' \\\n + to_path, shell=True)\n else:\n subprocess.call('jpegtran -grayscale ' + from_path + ' > ' + to_path,\\\n shell=True)","def photo2web_process_hattenbach():\n\n os.chdir('/Volumes/SSD External/Hattenbach_v2')\n \n dir_base = os.getcwd()\n \n dir_p2w = '/Users/throop/photos/Trips/'\n \n dirs = sorted(glob.glob(os.path.join(dir_base, '*')))\n \n quality_out = '60'\n size_out = '2000x2000'\n \n for i,dir in enumerate(dirs):\n if os.path.isdir(dir):\n os.chdir(dir)\n dir_originals = os.path.join(dir, 'originals')\n dir_originals_fullres = os.path.join(dir, 'originals_fullres')\n\n# For HH files, copy the 'actual' originals into a 'fullres' folder, for safekeeping\n\n if not os.path.isdir(dir_originals_fullres):\n os.rename(dir_originals, dir_originals_fullres)\n os.mkdir(dir_originals)\n \n files = glob.glob(os.path.join(dir_originals_fullres, '*'))\n\n# Get a list of all the images\n\n# For each image, make a low-res, low-quality image. This is just because the scanned files\n# are huge and high-quality, and not useful for online. They are much larger than necessary. \n# So we use 'convert' to shrink them in size and quality, and put the output into 'originals' directory \n# for photo2web.\n\n for file in files:\n file_short = os.path.basename(file)\n file_in = os.path.join(dir_originals_fullres,file_short)\n file_out = os.path.join(dir_originals,file_short)\n if not os.path.isfile(file_out):\n cmd = (f'convert -resize {size_out} -quality {quality_out}' +\n f' {file_in}' +\n f' {file_out}')\n print(f'{cmd}')\n \n subprocess.run(['convert', '-resize', size_out, '-quality', quality_out,\n file_in,\n file_out])\n\n# Now, finally, go thru and do photo2web on all of them.\n \n print(f'\\nProcessing directory {i}/{len(dirs)} {dir}\\n')\n subprocess.run(['cp', '-r', os.path.join(dir_p2w, 'header.txt'), '.'])\n subprocess.run(['cp', '-r', os.path.join(dir_p2w, 'photos.css'), '.'])\n if not os.path.exists('captions.txt'):\n subprocess.run(['captions_photo2web']) \n subprocess.run(['photo2web_old'])\n subprocess.run(['photo2web'])","def config_copy(ipydir, profile):\n for fpath in profile_files(profile):\n filename = osp.basename(fpath)\n dest_file = osp.join(ipydir, 'profile_' + profile, 'startup',\n filename)\n shutil.copy(fpath, dest_file)\n logger.info(\"Copy files '%s' for profile '%s'.\",\n osp.basename(filename), profile)","def main():\n # Parameters\n opt = get_args()\n\n assert os.path.exists(opt.path_video), \"Video file does not exist\"\n try:\n os.makedirs(opt.path_images)\n except Exception:\n print(\"Folder already exists. Overwriting it\")\n pass\n\n assert opt.size is None or opt.size is not None and len(opt.size) <= 2, \"Make sure the size indicated contains at maximum two numbers [none, max_dimension or width and height]\"\n\n # Get base path\n base_path = os.path.join(opt.path_images, opt.basename)\n\n # Load video from file\n try:\n cap = cv2.VideoCapture(opt.path_video)\n except Exception as e:\n print('Video failed to be loaded:', e)\n sys.exit(0)\n\n # Parse video\n parse_video(cap, base_path, opt.step, opt.size)\n\n # Release capture\n cap.release()\n cv2.destroyAllWindows()\n \n return 0","def main():\n\n # Just grab all files - we'll use try/except to filter\n images = glob.glob(os.path.join(args.input_dir, '*.*'))\n if not os.path.exists(args.output_dir):\n os.makedirs(args.output_dir)\n for img_file in images:\n print(img_file)\n try:\n np_img = plt.imread(img_file)\n print(np_img.shape)\n img_name = img_file.split(os.sep)[-1]\n new_img_file = os.path.join(args.output_dir, img_name)\n pad_image(np_img, new_img_file)\n except Exception as e:\n print('Warning: {}. Skpping file.'.format(e))\n continue","def generate_thumbnail(self, img_path):\n\n thumb_path = self.thumbnail_path(img_path)\n dirpath = os.path.dirname(thumb_path)\n try:\n os.makedirs(dirpath)\n except OSError: # path exists\n pass\n\n cmd = [\n '/usr/local/bin/gm',\n 'convert',\n '-thumbnail', '256x256>',\n '-background', 'transparent',\n '-gravity', 'center',\n '-extent', '256x256',\n img_path, thumb_path\n ]\n\n retcode = subprocess.call(cmd)\n\n if retcode:\n log.error('convert exited with %d : %s', retcode, img_path)\n return False\n\n log.debug('Wrote thumbnail for `%s` to `%s`.', img_path, thumb_path)\n\n return True","def take_door_photo():\n\n # based on lukec's code in VHS.pm\n config = yaml.load(file('/etc/vhs.yaml'))\n short_hash = hashlib.sha256(str(datetime.datetime.now())).hexdigest()[0:6]\n pic_base = config.get('picture_base')\n if pic_base:\n filename = os.path.join(pic_base, '%s.jpeg' % short_hash)\n os.system('streamer -c /dev/video0 -b 16 -o %s >/dev/null 2>&1' % filename)\n short_file = os.path.splitext(filename)[0] + '.jpg'\n os.rename(filename, short_file)\n pic_uri_base = config.get('picture_uri_base') \n if pic_uri_base and os.path.exists(short_file):\n pic_uri = '%s/%s' % (pic_uri_base, os.path.basename(short_file))\n return (pic_uri, short_file)\n\n return None","def main(input):\n path = os.path.abspath(input)\n name = os.path.splitext(os.path.basename(path))[0]\n p = os.path.join(os.getcwd(),name)\n i = 1\n p1 = p\n while os.path.exists(p1):\n p1 = \"{p}-{i}\".format(p=p,i=i)\n i += 1\n p = p1\n os.mkdir(p1)\n os.mkdir(os.path.join(p1,\"media\"))\n with zipfile.ZipFile(path) as zf:\n for file in zf.namelist():\n # Path traversal defense copied from\n # http://hg.python.org/cpython/file/tip/Lib/http/server.py#l789\n words = file.split('/')\n dest = os.path.join(p1, \"media\")\n if words[0] == \"word\" and words[1] == \"media\":\n for word in words[2:]:\n while True:\n drive, word = os.path.splitdrive(word)\n head, word = os.path.split(word)\n if not drive:\n break\n if word in (os.curdir, os.pardir, ''):\n continue\n dest = os.path.join(dest, word)\n click.echo(\"{} -> {}\".format(file, dest))\n of = open(dest, 'wb')\n of.write(zf.read(file))\n of.close()\n\n newdoc = os.path.join(p1, os.path.basename(path))\n lyxfile = os.path.join(p1, name + \".lyx\")\n texfile = os.path.join(p1, name + \".tex\")\n shutil.copyfile(path, newdoc)\n os.system(\"pandoc -s -f docx -t latex -o '{of}' '{i}'\".format(of=texfile, i=newdoc))\n os.system(\"tex2lyx '{i}' '{o}'\".format(i=texfile, o=lyxfile))\n os.remove(texfile)\n os.system(\"convertwmf {dir}\".format(dir=os.path.join(p1, \"media\")))\n click.echo(lyxfile)","def make_video(data,\n xdim, ydim, sample_read_rows, sample_read_cols, image_write_rows, image_write_cols,\n directory, filename, fps = 24.0, start_frame = 1, end_frame = None, timestamp = False, fontsize = 30, ts_pos = (0,0), save_raw = False):\n\n #Command to send via the command prompt which specifies the pipe parameters\n # command = ['ffmpeg',\n # '-y', # (optional) overwrite output file if it exists\n # '-f', 'image2pipe',\n # '-vcodec', 'mjpeg', #'mjpeg',\n # '-r', '1',\n # '-r', str(fps), # frames per second\n # '-i', '-', # The input comes from a pipe\n # '-an', # Tells FFMPEG not to expect any audio\n # '-vcodec', 'mpeg4',\n # '-b:v', '5000k',\n # directory + filename + \"/\"+filename+\".mp4\",\n # '-hide_banner',\n # '-loglevel', 'panic']\n\n # Create directories if they don't exist\n if not os.path.exists(os.path.join(directory, filename, 'frames/')):\n os.makedirs(os.path.join(directory, filename, 'frames/'))\n if save_raw and not os.path.exists(os.path.join(directory, filename, 'frames-raw/')):\n os.makedirs(os.path.join(directory, filename, 'frames-raw/'))\n\n if end_frame == None:\n end_frame = data.FrameCount\n\n cm = colormap.get_cmap('viridis')\n\n for i, frame_offset in enumerate(tqdm.tqdm(range(start_frame, end_frame))):\n frame = FrameRead(data, frame_offset)\n frame_image = np.zeros([ydim, xdim], dtype=np.uint8)\n frame_image[image_write_rows, image_write_cols] = frame.frame_data[sample_read_rows, sample_read_cols]\n\n rgb_im = Image.fromarray(cm(frame_image, bytes=True)).convert('RGB')\n rgb_im.save(os.path.join(directory, filename, 'frames/', f'{i}.jpg'), 'JPEG')\n\n if save_raw:\n Image.fromarray(np.uint8(frame.frame_data), mode='L').save(os.path.join(directory, filename, 'frames-raw/', f'{i}.jpg'), 'JPEG')","def genThumbnail(filename,thumbnailType,config,regen=False):\n # define the sizes of the various thumbnails\n thumbnailTypeDefinitions={\n 's': (75,75), #should be square eventually\n 'q': (150,150), #should be square eventually\n 't': (100,100),\n 'm': (240,240),\n 'n': (320,230),\n 'k': (500,500),\n 'c': (800,800),\n 'b': (1024,1024)}\n size = thumbnailTypeDefinitions[thumbnailType]\n thumbFilename = filename.split('.')[0] + '_' + thumbnailType + '.' + filename.split('.')[1]\n if os.path.isfile(config['LOCALARCHIVEPATH']+'/'+thumbFilename) and regen == False:\n return(thumbFilename)\n else:\n try:\n logger.info('Generating thumbnail: %s' %(config['LOCALARCHIVEPATH']+'/'+thumbFilename))\n img = Image.open(config['LOCALARCHIVEPATH']+'/'+filename)\n icc_profile = img.info.get('icc_profile')\n img.thumbnail(size,Image.ANTIALIAS)\n img.save(config['LOCALARCHIVEPATH']+'/'+thumbFilename, 'JPEG', icc_profile=icc_profile, quality=95)\n return(thumbFilename)\n except IOError as e:\n raise e","def add_media(file, mode, gui_instance=None):\r\n\r\n global option # Using the global variable that specifies user choice (typically \"Yes\" or \"No\" choices)\r\n global config_var # Using the global variable that reads and modifies the configuration file\r\n\r\n basename_file = os.path.basename(file)\r\n\r\n # Checking if the specified file is a valid media file\r\n if basename_file.endswith('.mp3') or basename_file.endswith('.wav'):\r\n assumed_artist = \"\" # This variable will store the artist of the media\r\n\r\n if \"-\" in basename_file:\r\n\r\n \"\"\" \r\n Usually, media files use a '-' character to split the title of the media and the artist.\r\n This algorithm will attempt to automatically 'guess' the title and artist of the media if this\r\n character is present.\r\n \"\"\"\r\n\r\n # If there is a whitespace before the '-' character, we remove it\r\n if basename_file.split(\"-\")[0].endswith(\" \"):\r\n assumed_artist = basename_file.split(\"-\")[0][:-1] # The auto-processed artist name\r\n else:\r\n assumed_artist = basename_file.split(\"-\")[0]\r\n\r\n if file.split(\"-\")[1].startswith(\" \"): # If there is a whitespace after the '-' character, we remove it\r\n assumed_title = basename_file.split(\"-\")[1][1:-4] # The auto-processed media title\r\n else:\r\n assumed_title = basename_file.split(\"-\")[1][:-4]\r\n\r\n else: # If no \"-\" character is present in the title of the file, assuming the title is the name of the file\r\n assumed_title = os.path.splitext(basename_file)[0]\r\n\r\n if config_var['RUN-MODE']['run_mode'] == \"2\": # Debugging mode\r\n print(\"\\nAssumed title: \" + assumed_title)\r\n print(\"Assumed artist: \" + assumed_artist)\r\n\r\n if not mode: # The user is attempting to add media files from another directory\r\n try:\r\n shutil.copy2(file, media_folder) # Copying the source file to the media folder\r\n\r\n except PermissionError: # Application does not have permission to write in the media folder\r\n # Application is running in GUI-mode\r\n if gui_instance is not None:\r\n messagebox.showerror(\"Unable to copy file\", \"Unable to copy file to media folder. Make sure you \"\r\n \"haven't selected a write-protected folder.\")\r\n\r\n # Application is running in CLI or debugging mode\r\n if config_var['RUN-MODE']['run_mode'] == \"1\" or config_var['RUN-MODE']['run_mode'] == \"2\":\r\n print(\"\\nError: Unable to copy file to media folder. Make sure you haven't selected a \"\r\n \"write-protected folder.\")\r\n\r\n return False\r\n\r\n # Updating the database\r\n cursor = connection.cursor()\r\n\r\n # Getting the full path of the file (using an app-level convention for slashes)\r\n full_path = os.path.join(media_folder, os.path.basename(file)).replace(\"\\\\\", \"/\")\r\n\r\n cursor.execute(\"SELECT COUNT(1) FROM media WHERE full_path = \\\"\" + full_path + \"\\\"\")\r\n result = int(str(cursor.fetchone())[1])\r\n\r\n if not result: # The selected file is not present in the database\r\n sql_command = ''' INSERT INTO media(title, artist, album, release_date, tags, full_path)\r\n VALUES (?, ?, ?, ?, ?, ?) '''\r\n\r\n values = (assumed_title, assumed_artist, '', '', '', full_path)\r\n\r\n try: # Attempting to add the media file to the database\r\n cursor.execute(sql_command, values)\r\n\r\n connection.commit()\r\n\r\n except Error: # Database is locked\r\n # Application is running in GUI-mode\r\n if gui_instance is not None:\r\n messagebox.showerror(\"Database is locked\", \"Error when trying to commit changes to database. Make \"\r\n \"sure another application is not using the database.\")\r\n\r\n # Application is running in CLI or debugging mode\r\n if config_var['RUN-MODE']['run_mode'] == \"1\" or config_var['RUN-MODE']['run_mode'] == \"2\":\r\n print(\"\\nError when trying to commit changes to database. Make sure another application is not \"\r\n \"using the database.\")\r\n\r\n return False\r\n\r\n if gui_instance is not None: # The method has been fired by a GUI widget\r\n gui_instance.display_media() # Updating the media list\r\n\r\n else: # The method has been fired by using CLI\r\n cursor.execute(\"SELECT id FROM media WHERE full_path = \\\"\" + full_path + \"\\\"\")\r\n new_id = cursor.fetchone()\r\n\r\n print(\"\\nThe song was added successfully!\\n\\nThe ID of the song is: \" + str(new_id[0]) +\r\n \"\\nDo you want to configure the song metadata now? (Y/N)\")\r\n\r\n option = input() # Getting user response\r\n if option.lower() == \"y\": # The user has responded affirmatively\r\n SongStorageCLI.configure_media(full_path)\r\n\r\n else: # The user has responded negatively\r\n print(\"\\nThe auto-processing tool assumed that the name of the song is \\\"\" + assumed_title + \"\\\" \" +\r\n \"and that the name of the artist is \\\"\" + assumed_artist + \"\\\".\\nYou can always change \" +\r\n \"these values, as well as other metadata information, by using the \\\"Modify_data \" +\r\n str(new_id[0]) + \"\\\" command.\")\r\n return\r\n\r\n else: # The selected file already exists in the database; letting the user know\r\n if gui_instance is not None: # The method has been fired by a GUI widget\r\n messagebox.showinfo(\"Media file already exists\",\r\n \"The selected file already exists in the media folder.\")\r\n\r\n else: # The method has been fired by using CLI\r\n print(\"There is already a song with this name in the media folder!\")\r\n\r\n return False\r\n\r\n if config_var['RUN-MODE']['run_mode'] == \"2\": # Debugging mode\r\n print(\"\\nMedia file has been added successfully.\")\r\n\r\n return True","def copy_database(path_images, path_labels, path_final_images):\n\n try:\n labels = sorted(os.listdir(path_labels))\n except FileNotFoudError:\n print(\"No such file or directory \", path_labels)\n\n try:\n images = sorted(os.listdir(path_images)) #+ \"RetinaNet_I04590/\"))\n except FileNotFoudError:\n print(\"No such file or directory \", path_images)\n\n \"\"\"if not os.path.exists(path_final_images + \"I04590/\"):\n os.mkdir(path_final_images + \"I04590/\")\n\n if not os.path.exists(path_final_images + \"I045135/\"):\n os.mkdir(path_final_images + \"I045135/\")\n\n if not os.path.exists(path_final_images + \"I090135/\"):\n os.mkdir(path_final_images + \"I090135/\")\n\n if not os.path.exists(path_final_images + \"I4590135/\"):\n os.mkdir(path_final_images + \"I4590135/\")\n\n if not os.path.exists(path_final_images + \"Params/\"):\n os.mkdir(path_final_images + \"Params/\")\n\n if not os.path.exists(path_final_images + \"Pauli2/\"):\n os.mkdir(path_final_images + \"Pauli2/\")\n\n if not os.path.exists(path_final_images + \"Pauli3/\"):\n os.mkdir(path_final_images + \"Pauli3/\")\n\n if not os.path.exists(path_final_images + \"Stokes/\"):\n os.mkdir(path_final_images + \"Stokes/\")\n\n if not os.path.exists(path_final_images + \"Rachel/\"):\n os.mkdir(path_final_images + \"Rachel/\")\n\n if not os.path.exists(path_final_images + \"Rachel2/\"):\n os.mkdir(path_final_images + \"Rachel2/\")\"\"\"\n\n for k in range(len(images)):\n if str(k) + \".xml\" in labels:\n copyfile(path_images + \"/\" + images[k],\n path_final_images + \"/\" + images[k])\n \"\"\"copyfile(path_images + \"RetinaNet_I04590/\" + str(k) + \".png\",\n path_final_images + \"I04590/\" + str(k) + \".png\")\n copyfile(path_images + \"RetinaNet_I045135/\" + str(k) + \".png\",\n path_final_images + \"I045135/\" + str(k) + \".png\")\n copyfile(path_images + \"RetinaNet_I090135/\" + str(k) + \".png\",\n path_final_images + \"I090135/\" + str(k) + \".png\")\n copyfile(path_images + \"RetinaNet_I4590135/\" + str(k) + \".png\",\n path_final_images + \"I4590135/\" + str(k) + \".png\")\n copyfile(path_images + \"RetinaNet_Params/\" + str(k) + \".png\",\n path_final_images + \"Params/\" + str(k) + \".png\")\n copyfile(path_images + \"RetinaNet_Pauli2/\" + str(k) + \".png\",\n path_final_images + \"Pauli2/\" + str(k) + \".png\")\n copyfile(path_images + \"RetinaNet_Pauli3/\" + str(k) + \".png\",\n path_final_images + \"Pauli3/\" + str(k) + \".png\")\n copyfile(path_images + \"RetinaNet_Stokes/\" + str(k) + \".png\",\n path_final_images + \"Stokes/\" + str(k) + \".png\")\n copyfile(path_images + \"RetinaNet_Rachel/\" + str(k) + \".png\",\n path_final_images + \"Rachel/\" + str(k) + \".png\")\n copyfile(path_images + \"RetinaNet_Rachel2/\" + str(k) + \".png\",\n path_final_images + \"Rachel2/\" + str(k) + \".png\")\n copyfile(path_labels + str(k) + \".xml\",\n path_final_labels + str(k) + \".xml\")\"\"\"\n print(k)","def main():\n parser = argparse.ArgumentParser()\n parser.add_argument('--visualize', dest='visualize_dir', help=\"Path to directory to load all vizualization info from\")\n parser.add_argument('--overwrite', dest='overwrite', default=False, action='store_true', help=\"Overwrite existing logs parts if found\")\n args = parser.parse_args()\n if not args.visualize_dir:\n print \"Missing required argument, --visualize\"\n exit(-1)\n\n dsrc_log_file = args.visualize_dir + '/dsrc.log'\n radar_log_file = args.visualize_dir + '/radar.log'\n video_file = args.visualize_dir + '/video.mp4'\n log_config = args.visualize_dir + '/config.json'\n\n config = parse_config(log_config)\n\n if 'parts_auto_enabled' in config and config['parts_auto_enabled']:\n cap = cv2.VideoCapture(video_file)\n fps = cap.get(cv2.CAP_PROP_FPS)\n frames = cap.get(cv2.CAP_PROP_FRAME_COUNT)\n duration = float(frames) / fps\n cap.release()\n\n print 'Video duration: %s' % duration\n start = 0\n count = 1\n while start < duration:\n config['parts'].append({\n 'start': start,\n 'end': start + config['parts_auto_interval'],\n 'name': 'auto_part_%s' % count\n })\n count = count + 1\n start = start + config['parts_auto_interval']\n\n print config \n\n for index, part in enumerate(config['parts']):\n part_path = args.visualize_dir + '/' + (part['name'] if 'name' in part else 'part_%s' % (index+1))\n print \"---------------------------------------\"\n print \" Writing log to %s\" % part_path\n print \"---------------------------------------\"\n if not args.overwrite and os.path.exists(part_path):\n print \"Log already exists, skipping...\"\n continue\n\n if not os.path.exists(part_path):\n os.makedirs(part_path)\n\n export_part_video(part, part_path, video_file)\n export_part_log(part, part_path + '/radar.log', radar_log_file, config['video_start'])\n export_part_log(part, part_path + '/dsrc.log', dsrc_log_file, config['video_start'])\n export_part_config(part_path + '/config.json', config)","def deploy_user_media(env=None, haus_vars={} ):\n print green('Deploying user media')\n with cd(\"/var/www\"):\n run('./manage.py sync_media_s3 --prefix=uploads')","def get_thumbnail_path(examfile):\n h = examfile.hash\n thumb = os.path.join(settings.MEDIA_ROOT, \"cache\", h + \".png\")\n if os.path.exists(thumb):\n return thumb\n path = os.path.join(settings.MEDIA_ROOT, examfile.path.path)\n cmd = \"/usr/local/bin/mudraw -o %s -h 800 -w 600 '%s' 1\" % (thumb, path)\n args = shlex.split(cmd.encode(\"utf8\"))\n mudraw = subprocess.Popen(args)\n mudraw.wait()\n return thumb","def web_archive_config():\n\n try:\n auth_check()\n except Exception as e:\n return flask.redirect(str(e))\n\n socket_timeout = flask.request.args.get('ytdl-socket-timeout', '120')\n retries = flask.request.args.get('ytdl-retries', 'infinite')\n output = flask.request.args.get('ytdl-output', '%(uploader_id)s/%(id)s.%(ext)s')\n overwrites = flask.request.args.get('ytdl-overwrites', 'false') == 'true'\n info_json = flask.request.args.get('ytdl-info-json', 'true') == 'true'\n thumbnail = flask.request.args.get('ytdl-thumbnail', 'true') == 'true'\n format = flask.request.args.get('ytdl-format', 'bestvideo[vcodec^=vp]' +\n '+bestaudio[acodec=opus]/bestvideo+bestaudio[acodec=opus]' +\n '/bestvideo+bestaudio/best')\n merge_format = flask.request.args.get('ytdl-merge-format', 'mkv')\n all_subs = flask.request.args.get('ytdl-all-subs', 'true') == 'true'\n sub_format = flask.request.args.get('ytdl-sub-format', 'srt/best')\n convert_subs = flask.request.args.get('ytdl-convert-subs', 'srt')\n\n config = io.BytesIO()\n\n config.write(('--socket-timeout ' + socket_timeout + '\\n').encode('utf-8'))\n config.write(('--retries ' + retries + '\\n').encode('utf-8'))\n config.write(('--output ' + output + '\\n').encode('utf-8'))\n if not overwrites:\n config.write('--no-overwrites\\n'.encode('utf-8'))\n if info_json:\n config.write('--write-info-json\\n'.encode('utf-8'))\n if thumbnail:\n config.write('--write-thumbnail\\n'.encode('utf-8'))\n config.write(('--format ' + format + '\\n').encode('utf-8'))\n config.write(('--merge-output-format ' + merge_format + '\\n').encode('utf-8'))\n if all_subs:\n config.write('--all-subs\\n'.encode('utf-8'))\n config.write(('--sub-format ' + sub_format + '\\n').encode('utf-8'))\n config.write(('--convert-subs ' + convert_subs + '\\n').encode('utf-8'))\n\n config.seek(0)\n\n return flask.Response(config,\n mimetype = 'text/plain',\n headers = { 'Content-Disposition': 'attachment;filename=config.txt' }\n )","def process_video(self, input_path, output_path, debug=False):\n clip = VideoFileClip(input_path)\n if debug:\n test_clip = clip.fl_image(self.process_image_debug)\n else:\n test_clip = clip.fl_image(self.process_image)\n test_clip.write_videofile(output_path)","def copy_image_files(self) -> None:\n if self.images:\n if self.config.epub_fix_images or self.config.epub_max_image_width:\n if not Image:\n logger.warning(__('Pillow not found - copying image files'))\n super().copy_image_files()\n else:\n self.copy_image_files_pil()\n else:\n super().copy_image_files()","def preparation(self):\n # [1] Makes a dir for saving results.\n # if 'Result' dir already exists,\n # a 'temporary' dir will be made.\n\n try:\n os.mkdir(self.dir_for_saving_result)\n except FileExistsError:\n self.viewer.display_message(\"Made a temporary directory.\")\n self.dir_for_saving_result = 'temporary'\n os.mkdir('temporary')\n\n # [2] Copies config file into the same dir as the one where results will be stored\n shutil.copy2(self.config_file_name, self.dir_for_saving_result)","def make_mock_fs(self):\n\t\ttemp = tempfile.mkdtemp(prefix=\"fpltest\")\n\t\ttry:\n\t\t\tconfig = fplsync.Config()\n\t\t\tconfig.playlist_source = os.path.join(temp, \"fb2k_playlists\")\n\t\t\tconfig.source = os.path.join(temp, \"source\")\n\t\t\tconfig.dest = os.path.join(temp, \"dest\")\n\t\t\tconfig.playlist_dest = os.path.join(temp, \"playlists\")\n\t\t\tos.mkdir(config.source)\n\t\t\twith open(os.path.join(config.source, \"a.mp3\"), \"w\") as f:\n\t\t\t\tprint(\"a\" * 1000, file=f, end=\"\")\n\t\t\twith open(os.path.join(config.source, \"b.mp3\"), \"w\") as f:\n\t\t\t\tprint(\"b\" * 1000, file=f, end=\"\")\n\t\t\twith open(os.path.join(config.source, \"c.mp3\"), \"w\") as f:\n\t\t\t\tprint(\"c\" * 1000, file=f, end=\"\")\n\t\t\tos.mkdir(config.dest)\n\t\t\tos.mkdir(config.playlist_source)\n\t\t\tos.mkdir(config.playlist_dest)\n\t\t\tyield config\n\t\tfinally:\n\t\t\tshutil.rmtree(temp)","def prepare_output_dir(out_dir, test_dir):\r\n\r\n if not out_dir.exists():\r\n out_dir.mkdir()\r\n\r\n # get the necessary file names\r\n file_names = get_file_names(test_dir, args.distance, print_file_names=False)\r\n\r\n # copy the images in the firstIms into the output folder\r\n for name in file_names[1][0]:\r\n file_path = Path(test_dir / name)\r\n copy_to = Path(out_dir / name)\r\n shutil.copy(file_path, copy_to)\r\n\r\n # the firstIms list does not contain the last image,\r\n # so we need to also copy the last image of the secIms into the output folder\r\n last_im = file_names[1][1][-1]\r\n shutil.copy(Path(test_dir/last_im), Path(out_dir/last_im))\r\n\r\n return file_names","def setup_part1(args):\n args.rootarg = args.root\n rootext = os.path.splitext(args.rootarg)[1]\n if rootext == '':\n pass\n else:\n args.root = os.path.dirname(args.root)\n\n if args.root:\n args.root = os.path.abspath(args.root)\n if not os.path.isdir(args.root):\n if args.gallery:\n os.mkdir(args.root)\n else:\n error('Directory not found', args.root)","def create_thumb(dirpath, imgname):\n with open(join(dirpath, imgname), 'r+b') as f:\n with Image.open(f) as image:\n thumb = resizeimage.resize_width(image, 50)\n thumbpath = join(outdir, thumbdir, imgname)\n print(\"saving thumbnail to\", thumbpath)\n thumb.save(thumbpath, image.format)","def create_full(dirpath, imgname):\n with open(join(dirpath, imgname), 'r+b') as f:\n with Image.open(f) as image:\n fullpicpath = join(outdir, fullpicdir, imgname)\n print(\"saving full pic to\", fullpicpath)\n image.save(fullpicpath, quality=75, optimize=True)","def convert_topic_dir(full_topic_dir, full_target_dir, photo_topic):\n warnings.simplefilter('error', Image.DecompressionBombWarning)\n topicfiles = [f for f in listdir(full_topic_dir) if isfile(join(full_topic_dir, f))\n and (f.lower().endswith(\".jpg\") or f.lower().endswith(\".jpeg\"))]\n for topicfile in topicfiles:\n fulltopicfile = join(full_topic_dir, topicfile)\n fulltargetfile = join(full_target_dir, topicfile)\n if not exists_and_newer(fulltargetfile, fulltopicfile):\n print(\" Converting\", topicfile, \": \", end='')\n try:\n im = Image.open(fulltopicfile)\n\n if im._getexif() is not None:\n exif = {\n TAGS[k]: v\n for k, v in im._getexif().items()\n if k in TAGS\n }\n else:\n exif = dict()\n\n if 'Orientation' in exif:\n im = apply_image_rotation_by_exif(im, exif['Orientation'])\n\n if 'ImageDescription' in exif:\n photo_description = exif['ImageDescription']\n photo_description = bytes(photo_description, encoding=\"ansi\", errors=\"ignore\").decode(\"utf-8\", errors=\"ignore\") # PIL reads exif data as ansi not utf-8 strings\n if photo_description.rstrip() == '':\n photo_caption = photo_topic\n else:\n if photo_description.endswith('#'):\n photo_caption = photo_topic + \" - \" + photo_description.rstrip('#')\n else:\n photo_caption = photo_description\n else:\n photo_caption = photo_topic\n\n print(photo_caption)\n im.thumbnail(targetSize, Image.ANTIALIAS)\n im = add_caption_to_image(im, photo_caption)\n im.save(fulltargetfile, \"JPEG\")\n except IOError:\n print(\"cannot create target for '%s'\" % fulltopicfile)\n except AttributeError:\n print(\"Attribute error for '%s'\" % fulltopicfile)\n else:\n print(\" Skipping\", topicfile)","def prepare(self, dst, options):\n self.checkExisting(dst)\n self.makedirs(dst.parent())","def process_video(filename, args, cfg, net):\n # Split video into frames\n images = split_video(filename)\n # Set output dir\n output_dir = args.output\n # Add brackets and extension to filename\n output_path = create_video_output_path(output_dir, cfg)\n # Get height and width of 1st image\n height, width, _ = check_img_size(images[0]).shape\n # Create VideoWriter object\n video = cv2.VideoWriter(output_path, \n cv2.VideoWriter_fourcc(*'FMP4'), \n cfg['video']['fps'], \n (width, height))\n for image in images:\n # Process frames\n img_steps = process_image(image, cfg, net)\n # Check for --show-detections flag\n output_img = check_if_adding_bboxes(args, img_steps) \n # Write to video\n video.write(output_img) \n # Release video writer object\n video.release()","def CpSrcDest( IMGFOLDER = '..\\\\Data\\\\',\n EXTENSION = \".jpg\",\n DESTINATION_FOLDER='..\\\\Data\\\\AllBirds\\\\'):\n for i, imag in enumerate(BirdPhotos):\n filename= IMGFOLDER+ imag + EXTENSION\n cpCommand = \"copy \" + filename + \" \" + DESTINATION_FOLDER\n os.system(cpCommand)\n return","def get_destination(metadata: Metadata):\n\n func = f\"{__name__}.get_destination\"\n\n metadata[\"destination\"] = metadata[\"full_clipname\"].replace(\n f\"/{app.capture_folder_name}/\", f\"/{app.destination_folder_name}/\"\n )\n\n if path.exists(metadata[\"destination\"]):\n metadata[\"renamed\"] = \"True\"\n print(f\"file exists:{metadata['destination']}\")\n directory = path.dirname(metadata[\"destination\"])\n filename = path.splitext(path.basename(metadata[\"destination\"]))[0]\n extension = path.splitext(path.basename(metadata[\"destination\"]))[1]\n number = 1\n dest = path.join(directory, f\"{filename}-{number:0>2d}{extension}\")\n metadata[\"destination\"] = dest\n print(f\"Will now test with:{dest}\")\n while path.exists(dest):\n number += 1\n dest = path.join(directory, f\"{filename}-{number:0>2d}{extension}\")\n print(f\"Will now test with:{dest}\")\n\n metadata[\"destination\"] = dest\n\n post_event(\n \"log_info\",\n f\"{func}\",\n f\"The destination is: {metadata['destination']} - was renamed: {metadata['renamed']}\",\n )\n\n return metadata","def configure_devbox():\n\n # Does a devbox folder already exist?\n is_present = os.path.isdir(Settings.devbox_folder)\n\n # If so, alert the user and exit.\n if is_present:\n message1 = \"This folder is already initialized.\"\n message2 = \"To re-initialize, \"\n message2 += \"run '\" + Settings.program + \" destroy' first.\"\n Utilities.log(message1)\n Utilities.log(message2)\n exit(1)\n\n # Create the config folder in the current directory.\n Utilities.create_folder(Settings.devbox_folder)\n\n # Copy config files.\n source_folder = Settings.source_config\n dest_folder = Settings.config_folder\n folder_copied = Utilities.copy_folder(source_folder, dest_folder)\n\n # Report any errors.\n if not folder_copied:\n Utilities.log(\"Could not copy config files.\")\n exit(1)\n\n # Copy the Vagrantfile to the root of the devbox folder.\n source_file = Settings.config_folder + \"/vagrant/Vagrantfile\"\n dest_location = Settings.devbox_folder\n file_copied = Utilities.copy_file(source_file, dest_location)\n\n # Report any errors.\n if not file_copied:\n Utilities.log(\"Could not copy Vagrantfile.\")\n exit(1)","def set(self):\n \n ffmpeg_installed = misc.askquestion(DialogTitle='FFMPEG Check',\n Question='Is FFMPEG installed?')\n \n if ffmpeg_installed:\n ffmpeg_dir = misc.get_dir(DialogTitle='Please select the directory where FFMPEG (binary) is installed:')\n \n if sys.platform=='win32':\n self.ffmpeg = os.path.join(ffmpeg_dir, 'ffmpeg.exe')\n self.ffplay = os.path.join(ffmpeg_dir, 'ffplay.exe')\n else:\n self.ffmpeg = os.path.join(ffmpeg_dir, 'ffmpeg')\n self.ffplay = os.path.join(ffmpeg_dir, 'ffplay')\n \n if not os.path.exists(self.ffmpeg):\n print('Sorry, {0} does not exist!'.format(self.ffmpeg))\n return\n \n if not os.path.exists(self.ffplay):\n print('Sorry, {0} does not exist!'.format(self.ffplay))\n return\n \n else:\n self.ffmpeg = None\n self.ffplay = None\n \n # Save them to the default config file\n info = {'ffmpeg':self.ffmpeg, 'ffplay': self.ffplay}\n try:\n with open(self.config_file, 'w') as outFile:\n json.dump(info, outFile)\n print('Config information written to {0}'.format(os.path.abspath(self.config_file)))\n except PermissionError as e:\n curDir = os.path.abspath(os.curdir)\n print('Current directory: {0}'.format(curDir))\n print('Error: {0}'.format(e))\n \n return","def create_output_directory_for_resized_images():\n\n try:\n if not os.path.isdir(RESIZED_NEGATIVE_PATH):\n return os.makedirs(RESIZED_NEGATIVE_PATH)\n elif not os.path.isdir(RESIZED_POSITIVE_PATH):\n return os.makedirs(RESIZED_POSITIVE_PATH)\n except OSError as e:\n print('Error --> {}'.format(e))","def task():\n if os.path.isdir(orig):\n for fP in [ fP for fP in glob.glob(os.path.join(orig, '*-*/*')) if \\\n os.path.isdir(fP) ]:\n if not os.path.exists(dest + fP[len(orig):]):\n os.makedirs(dest + fP[len(orig):])\n for fP in [ fP for fP in glob.glob(os.path.join(orig, '*-*/*/%s.log' %fmt.get_date())) if \\\n os.path.isfile(fP) ]:\n convert(fP, dest + fP[len(orig):])","def init_image_info():\n if not os.path.exists(UPLOAD_FOLDER):\n os.makedirs(UPLOAD_FOLDER)","def preprocess(config_path, save_dir):\r\n \r\n cfg = mmcv.Config.fromfile(config_path)\r\n cfg.merge_from_dict({\r\n 'model.test_cfg.mode': 'slide', \r\n 'model.test_cfg.crop_size': (512, 512), \r\n 'model.test_cfg.stride': (384, 384)\r\n })\r\n\r\n # build the dataloader\r\n dataset = build_dataset(cfg.data.test)\r\n data_loader = build_dataloader(\r\n dataset,\r\n samples_per_gpu=1,\r\n workers_per_gpu=cfg.data.workers_per_gpu,\r\n dist=False,\r\n shuffle=False)\r\n\r\n # slide window and crop image\r\n cnt = 0\r\n for data in tqdm.tqdm(data_loader, desc=\"Processing\"):\r\n img = data['img'][0]\r\n img_meta = data['img_metas'][0].data[0]\r\n cnt += slide_crop(img, img_meta, cfg.model, save_dir)\r\n print(f'Preprocess finished, {cnt} binary files generated.')","def raw(self, out, config, size, **filters):\r\n with vm2vm.raw.RawImage(out, \"w\") as img:\r\n img.mkfs(size)\r\n with vm2vm.raw.Mountpoint(img.name) as mnt:\r\n self.copy(dest=mnt, config=config, **filters)","def make(config):\n # Create child folders\n for func in (create_basic_structure,\n copy_resources,\n copy_databases,\n copy_libraries,\n copy_security,\n copy_app_actions,\n copy_pages,\n create_application_info_file,\n replace_all_guids):\n\n INFO(\"\")\n INFO(\"+\"*70)\n INFO(\"\")\n func(config)","def generate_video_from_frames(path_to_frames, title):\r\n mean_height = 0\r\n mean_width = 0\r\n num_of_images = load_one_setting(settings_filename, 'MAX_CYCLES')\r\n os.chdir(path_to_frames)\r\n '''Loading all frames'''\r\n for file in os.listdir('.'):\r\n if file.endswith(\".jpg\") or file.endswith(\".jpeg\") or file.endswith(\"png\") or file.endswith(\"JPEG\"):\r\n im = Image.open(file)\r\n width, height = im.size\r\n mean_width += width\r\n mean_height += height\r\n\r\n mean_width = int(mean_width / num_of_images)\r\n mean_height = int(mean_height / num_of_images)\r\n\r\n for file in os.listdir('.'):\r\n if file.endswith(\".jpg\") or file.endswith(\".jpeg\") or file.endswith(\"png\") or file.endswith(\"JPEG\"):\r\n im = Image.open(file)\r\n imResize = im.resize((mean_width, mean_height), Image.ANTIALIAS)\r\n imResize.save(file, 'JPEG', quality=95)\r\n release_video(title)\r\n os.chdir(r'../..')","def main(argv):\n args = parse_command_line(argv)\n return convert_chunks_to_jpeg(args.raw_chunks_dir,\n jpeg_quality=args.jpeg_quality,\n slicing_plane=args.slicing_plane) or 0","def create_links(list_of_paths, dest_dir, print_cfg_ipol=False):\n ms = False\n for i, f in enumerate(list_of_paths):\n\n if isinstance(f, tuple): # we have the ms image\n # tif ms\n ms = True\n symlink_p(f[1], os.path.join(dest_dir, 'im_ms_%02d.tif' % (i+1)))\n\n # preview ms\n tmp = copy_file_matching_pathname('PREVIEW_*.JPG', os.path.dirname(f[1]), dest_dir)\n if tmp:\n symlink_p(tmp, os.path.join(dest_dir, 'prv_%02d.jpg' % (i+1)))\n # enhance contrast\n # os.system(\"/home/carlo/code/s2p/bin/qauto %s %s\" % (tmp, tmp)\n else:\n print('MS PREVIEW not found for %s' % f[1], file=sys.stderr)\n f = f[0] # the path to ms preview is not needed anymore\n\n # pan preview (if no ms preview)\n if not os.path.isfile(os.path.join(dest_dir, 'prv_%02d.jpg' % (i+1))):\n tmp = copy_file_matching_pathname('PREVIEW_*.JPG', os.path.dirname(f), dest_dir)\n if tmp:\n symlink_p(tmp, os.path.join(dest_dir, 'prv_%02d.jpg' % (i+1)))\n # os.system(\"/home/carlo/code/s2p/bin/qauto %s %s\" % (tmp, tmp))\n else:\n print('PAN PREVIEW not found for %s' % f, file=sys.stderr)\n\n # dim\n tmp = copy_file_matching_pathname('DIM_*.XML', os.path.dirname(f), dest_dir)\n if tmp:\n symlink_p(tmp, os.path.join(dest_dir, 'dim_%02d.xml' % (i+1)))\n\n # rpc\n tmp = copy_file_matching_pathname('RPC_*.XML', os.path.dirname(f), dest_dir)\n if tmp:\n symlink_p(tmp, os.path.join(dest_dir, 'rpc_%02d.xml' % (i+1)))\n\n # tif panchro\n symlink_p(f, os.path.join(dest_dir, 'im_panchro_%02d.tif' % (i+1)))\n\n # dzi 8 bits\n dzi8_found = False\n dzi8 = '%s_8BITS.dzi' % f[:-8] # remove extension '.JP2.TIF' (8 chars)\n files8 = '%s_8BITS_files' % f[:-8]\n if os.path.isfile(dzi8) and os.path.isdir(files8):\n symlink_p(dzi8, os.path.join(dest_dir, 'im_panchro_8BITS_%02d.dzi' % (i+1)))\n symlink_p(files8, os.path.join(dest_dir, 'im_panchro_8BITS_%02d_files' % (i+1)))\n dzi8_found = True\n\n # dzi 16 bits\n dzi16_found = False\n dzi16 = '%s_16BITS.dzi' % f[:-8] # remove extension '.JP2.TIF' (8 chars)\n files16 = '%s_16BITS_files' % f[:-8]\n if os.path.isfile(dzi16) and os.path.isdir(files16):\n symlink_p(dzi16, os.path.join(dest_dir, 'im_panchro_16BITS_%02d.dzi' % (i+1)))\n symlink_p(files16, os.path.join(dest_dir, 'im_panchro_16BITS_%02d_files' % (i+1)))\n dzi16_found = True\n\n # print warning if neither 8bit nor 16bit dzi was found\n if (not dzi8_found) and (not dzi16_found):\n print('WARNING: no dzi file found for img %s' % f, file=sys.stderr)\n\n if print_cfg_ipol:\n print_cfg.main(dest_dir, len(list_of_paths), ms)","def generate_clips(input_dir, output_dir, duration=20, ext='.mkv'):\n \n i = [0,0,0,0]\n \n output_dirs = [os.path.join(output_dir, 'goals'),\n os.path.join(output_dir, 'bg'),\n os.path.join(output_dir, 'cards'),\n os.path.join(output_dir, 'subs')]\n\n for dir in output_dirs:\n if not os.path.exists(dir):\n os.mkdir(dir)\n print('Made directory ' + dir)\n \n \n for path in input_dir:\n print(path)\n \n with open(os.path.join(path, 'Labels.json')) as f:\n file = json.load(f)\n labels = parseLabels(file)\n \n # for each item in label, crop a specified length and save to output_dir\n for timestamp, label in labels:\n half = timestamp[0]\n time = timestamp[1]\n vid_name = os.path.join(path, half + ext)\n\n if time - 5 > 0:\n\n if label == 'soccer-ball':\n # collect an instance of a goal\n clip_video(vid_name, time - 5, duration, i[0], output_dirs[0])\n i[0] += 1\n\n # collect an instance of a non-goal, if it does not overlap with another event\n if event_overlap(labels, half, time - 45, duration) == False and time - 45 > 0:\n clip_video(vid_name, time - 45, duration, i[1], output_dirs[1])\n i[1] += 1\n\n elif 'card' in label:\n # collect an instance of a carding event\n clip_video(vid_name, time - 4, duration, i[2], output_dirs[2])\n i[2] += 1\n\n if event_overlap(labels, half, time - 45, duration) == False and time - 45 > 0:\n clip_video(vid_name, time - 45, duration, i[1], output_dirs[1])\n i[1] += 1\n\n\n elif 'substitution' in label:\n # collect an instance of a carding event\n clip_video(vid_name, time - 4, duration, i[3], output_dirs[3])\n i[3] += 1\n\n if event_overlap(labels, half, time - 45, duration) == False and time - 45 > 0:\n clip_video(vid_name, time - 45, duration, i[1], output_dirs[1])\n i[1] += 1\n\n print('Saved clip from ' + path)","def _prepare(self):\n logging.info('-> copy configuration...')\n path_cofig = self.params['path_config_bUnwarpJ']\n shutil.copy(path_cofig, os.path.join(self.params['path_exp'],\n os.path.basename(path_cofig)))\n if 'path_config_IJ_SIFT' in self.params:\n path_cofig = self.params['path_config_IJ_SIFT']\n shutil.copy(path_cofig, os.path.join(self.params['path_exp'],\n os.path.basename(path_cofig)))\n if 'path_config_IJ_MOPS' in self.params:\n path_cofig = self.params['path_config_IJ_MOPS']\n shutil.copy(path_cofig, os.path.join(self.params['path_exp'],\n os.path.basename(path_cofig)))","def thumbnail_path(instance, filename):\n\n username = instance.user.username\n mainpath = os.path.join(\"infocomp\",username,\"thumbnails\",filename)\n return mainpath","def __main__() :\n try :\n poly = Polyhedre(sys.argv[1])\n \n name = sys.argv[2]\n \n createAllFiles(poly, name)\n\n createAllImageFiles(poly, name)\n \n except FileNotFoundError :\n print(\"Use an existing file\")","def mix_audio_and_video(self):\n\t\tself._logger.info('Starting ffmpeg...')\n\t\tsp.run('ffmpeg -v 0 -i {0} -i {1} -c:v copy '\n\t\t '-c:a aac -strict experimental {2}'\n\t\t .format(self.TEMP_FOLDER + self._video_manager.output_file_name,\n\t\t self.TEMP_FOLDER + self._audio_manager.output_file_name,\n\t\t self.SAVE_FOLDER + self._video_manager.output_file_name))\n\t\tself._logger.info('Save done. Output file: {}'\n\t\t .format(self._video_manager.output_file_name))\n\t\tself._logger.info('Cleaning the temp folder...')\n\t\tfor file in glob.glob(self.TEMP_FOLDER + '*'):\n\t\t\tos.remove(file)","def take_snapshot(self, path, file_name):\n pipelie_state = self.player.get_state(1)\n p_state = pipelie_state.state\n if p_state not in (Gst.State.PLAYING, Gst.State.PAUSED):\n print(\"Stream is not ready\")\n else:\n try:\n sink = self.player.get_by_name('sink')\n sample = GstBase.BaseSink.get_last_sample(sink)\n image_buffer = Gst.Sample.get_buffer(sample)\n buffer_map = Gst.Buffer.map(image_buffer, Gst.MapFlags.READ)\n image_binary_data = bytearray(buffer_map.info.data)\n utils.store_image(image_binary_data, path, file_name + \".jpeg\")\n except:\n print(\"Capturing image failed.\")","def main(raw_dir,save_dir,ext,target_size):\r\n try:\r\n msg = \"--target-size must be a tuple of 2 integers\"\r\n assert isinstance(target_size, tuple) and len(target_size) == 2, msg\r\n fnames = glob.glob(os.path.join(raw_dir, \"*.{}\".format(ext)))\r\n os.makedirs(save_dir, exist_ok=True)\r\n print(\"{} files to resize from directory `{}` to target size:{}\".format(len(fnames), raw_dir, target_size))\r\n for i, fname in enumerate(fnames):\r\n print(\".\", end=\"\", flush=True)\r\n img = cv2.imread(fname)\r\n img_small = cv2.resize(img, target_size)\r\n new_fname = \"{}.{}\".format(str(i), ext)\r\n small_fname = os.path.join(save_dir, new_fname)\r\n cv2.imwrite(small_fname, img_small)\r\n print(\"\\nDone resizing {} files.\\nSaved to directory: `{}`\".format(len(fnames), save_dir))\r\n except Exception as ex:\r\n print('Exception:',ex)","def main():\n global MASK\n start_time = time()\n parser = initArgparse()\n args = parser.parse_args()\n dirtree = args.directorytree\n filetree = args.filetree\n meta = args.metadata\n newmeta = args.newmetadata\n sfv = args.sfv\n yes = args.yes\n MASK = args.exclude\n\n for i in args.DIRECTORY:\n if Path(i).exists() is True:\n basepath = Path(i)\n else:\n raise NotADirectoryError(f\"{i} does not exist\")\n default = False\n if dirtree == sfv == filetree == meta == newmeta is False:\n default = True\n if dirtree is True or default is True:\n dirtree_file = f\"{basepath.name}_directory_tree.txt\"\n checkFileExists(basepath, dirtree_file, yes)\n createDirectoryTree(basepath, dirtree_file)\n if sfv is True or default is True:\n sfv_file = f\"{basepath.name}.sfv\"\n checkFileExists(basepath, sfv_file, yes)\n createSfv(basepath, sfv_file)\n if filetree is True or default is True:\n csvtree_file = f\"{basepath.name}_file_tree.csv\"\n jsontree_file = f\"{basepath.name}_file_tree.json\"\n checkFileExists(basepath, jsontree_file, yes)\n checkFileExists(basepath, csvtree_file, yes)\n createFileTree(basepath, jsontree_file, csvtree_file)\n if meta is True or default is True:\n metadata_file = f\"{basepath.name}_metadata.json\"\n checkFileExists(basepath, metadata_file, yes)\n createMetadata(basepath, metadata_file)\n if newmeta is True:\n createNewMetadata(basepath)\n filesCache.cache_clear()\n getFileInfo.cache_clear()\n killTika()\n\n stop_time = time()\n print(f\"Finished in {round(stop_time-start_time, 2)} seconds\")","def _queue_photos(self):\n global filtering_queue\n global number_of_pictures\n\n number_of_pictures = 0\n\n for root, dirs, files in walk(curdir):\n for file in files:\n if dirs == \"thumb\" or dirs == \"filtered\":\n pass\n else:\n file_path = join(root, file)\n filtering_data = [file_path, curdir]\n filtering_queue.put(filtering_data)\n number_of_pictures += 1\n print(\"Queued:\", file_path)\n\n try:\n mkdir(join(curdir, \"thumb\"))\n except FileExistsError:\n pass\n try:\n mkdir(join(curdir, \"thumb\", \"Alexander\"))\n except FileExistsError:\n pass\n try:\n mkdir(join(curdir, \"thumb\", \"Bjarke\"))\n except FileExistsError:\n pass\n try:\n mkdir(join(curdir, \"thumb\", \"Gabrielle\"))\n except FileExistsError:\n pass\n try:\n mkdir(join(curdir, \"thumb\", \"Monica\"))\n except FileExistsError:\n pass\n try:\n mkdir(join(curdir, \"thumb\", \"Wenche\"))\n except FileExistsError:\n pass\n try:\n mkdir(join(curdir, \"filtered\"))\n except FileExistsError:\n pass","def extract_frames_from_directory(count, source, destination):\n all_videos = os.listdir(source)\n print(all_videos)\n\n for video in all_videos:\n video_file = source + video # Retrieve a video from the OverHeadPress\n cap = cv2.VideoCapture(video_file) # capturing the video from the given path\n dim = (224, 224)\n\n while cap.isOpened():\n frame_id = cap.get(1) # current frame number\n ret, frame = cap.read()\n if not ret:\n break\n\n # We are capturing at 28 frames per second. \n # If we want to capture every 0.2 seconds we will take every 5 frames\n if frame_id % 8 == 0:\n filename =\"frame%d.jpg\" % count\n count+=1\n resized = cv2.resize(frame, dim)\n cv2.imwrite(destination + filename, resized)\n\n cap.release()\n print (\"Finished processing: \" + video + \". Ended at video: \" + str(count))","def moveFiles(rootDir):\n\n homedir = os.environ['HOME']\n albumDirec = 'AlbumCoverImages'\n #Check if a directory exists\n if not os.path.isdir(os.path.join(homedir, 'Pictures', albumDirec)):\n print('AlbumCoverImages not found, trying to make...')\n os.makedirs(os.path.join(homedir, 'Pictures', albumDirec))\n \n for root, dirs, files in os.walk(rootDir, topdown=False):\n #print('testtest')\n for name in files:\n \n\n #Find image files, and move them to albumCoverImages\n #For some bullshit reason or statments won't work here, have to\n # parse this out to elif statements, ughhhh...\n \n if '.jpg' in name:\n os.rename(os.path.join(root, name), os.path.join(homedir, 'Pictures', albumDirec, name))\n print('{0} moved to {1}!'.format(name, os.path.join(homedir, 'Pictures', albumDirec)))\n \n elif '.png' in name:\n os.rename(os.path.join(root, name), os.path.join(homedir, 'Pictures', albumDirec, name))\n print('{0} moved to {1}!'.format(name, os.path.join(homedir, 'Pictures', albumDirec, name)))\n \n elif '.gif' in name:\n os.rename(os.path.join(root, name), os.path.join(homedir, 'Pictures', albumDirec, name))\n print('{0} moved to {1}!'.format(name, os.path.join(homedir, 'Pictures', albumDirec, name)))\n \n elif '.pdf' in name:\n os.rename(os.path.join(root, name), os.path.join(homedir, 'Pictures', albumDirec, name))\n print('{0} moved to {1}!'.format(name, os.path.join(homedir, 'Pictures', albumDirec, name)))\n\n else:\n try:\n #Use tinytag to get file metadata\n tag = TinyTag.get(os.path.join(root, name))\n artistName = tag.artist\n albumName = tag.album\n \n #TODO: Need to add more conditions\n if isinstance(artistName, str):\n artistName = artistName.replace('/', '_')\n\n elif isinstance(albumName, str):\n albumName.replace('/', '_')\n \n\n #Check if the artists directory exists, if not make it\n try:\n if not os.path.isdir(os.path.join(rootDir, artistName)):\n os.makedirs(os.path.join(rootDir, artistName))\n print('{0} directory made!'.format(artistName))\n \n except ValueError:\n print('ValueError with {0}'.format(root+'/'+name))\n continue\n\n except TypeError:\n print('TypeError with {0}'.format(root+'/'+name))\n continue\n\n #Check if the songs album exists, if not make it\n try:\n if not os.path.isdir(os.path.join(rootDir, artistName, albumName)):\n os.makedirs(os.path.join(rootDir, artistName, albumName))\n print('{0} directory made!'.format(albumName))\n \n except TypeError:\n print('TypeError with {0}! Look at album directory making.'.format(root+'/'+name))\n continue\n\n #TODO: Check if album is in artist direc, if not, move it\n\n #Check if song is in album, if not move it \n try:\n if os.path.isfile(os.path.join(rootDir, artistName, albumName, name)) == False:\n os.rename(os.path.join(root, name), os.path.join(rootDir, artistName, albumName, name))\n print('{0} moved to {1}!'.format(name, albumName))\n \n except TypeError:\n print('TypeError with file {0}! Look at line song moving'.format(root+'/'+name))\n continue\n \n #TODO: Check if this part works\n except LookupError:\n if (\".jpg\") or (\".png\") or (\".7z\") or (\"README\") or (\".zip\") in name:\n continue\n \n else:\n print('No reader support for {0}'.format(name))\n continue","def main_convert():\n\n verbose = True\n\n # Build parser.\n parser = argparse.ArgumentParser()\n\n parser.add_argument('fname_pattern', action='store', help='File name pattern')\n parser.add_argument('-R', '--recursive', action='store_true', default=True,\n help='Search several subdirectories')\n\n # Run parser, extract arguments.\n args = parser.parse_args()\n\n # List of files.\n pattern = os.path.normpath(unicode(args.fname_pattern))\n\n if os.path.isdir(pattern):\n pattern = os.path.join(pattern, '*')\n fname_list = glob.glob(pattern)\n\n pattern = os.path.join(pattern, '*')\n fname_list.extend(glob.glob(pattern))\n\n pattern = os.path.join(pattern, '*')\n fname_list.extend(glob.glob(pattern))\n\n pattern = os.path.join(pattern, '*')\n fname_list.extend(glob.glob(pattern))\n\n else:\n fname_list = glob.glob(pattern)\n\n to_be_removed = []\n for f in fname_list:\n if os.path.isdir(f):\n to_be_removed.append(f)\n\n for f in to_be_removed:\n fname_list.remove(f)\n\n # Do the work.\n num_files = len(fname_list)\n for k, f_src in enumerate(fname_list):\n f_src = os.path.abspath(f_src)\n\n b_src, e = os.path.splitext(f_src)\n\n folder = os.path.basename(os.path.dirname(f_src))\n if (e == '.mp3' or e == '.wma' or e == '.wav' or e == '.aiff') and b_src != 'tmp' and folder != '.audio_convert':\n\n if verbose:\n try:\n print('%3d/%d: [%s -> .m4a] %s' % (k, num_files, e, os.path.basename(b_src)))\n except Exception as e:\n val = repr(f_src)\n raise Exception('Problem processing file: %s' % val)\n\n # Temporary working copy.\n path_work = os.path.dirname(f_src)\n f_tmp_src = os.path.join(path_work, 'tmp' + e)\n shutil.copy(f_src, f_tmp_src)\n\n # Transcode file format.\n f_tmp_dst = convert(f_tmp_src, verbose=verbose)\n\n # Finish.\n b_tmp_dst, e_dst = os.path.splitext(f_tmp_dst)\n\n f_dst = b_src + e_dst\n if os.path.isfile(f_dst):\n os.remove(f_dst)\n os.rename(f_tmp_dst, f_dst)\n\n if os.path.isfile(f_tmp_src):\n os.remove(f_tmp_src)\n\n if os.path.isfile(f_dst):\n move_processed_file(f_src)\n\n # Done.","def main(args):\n\n for dir in args.dirs:\n # prepdir = mdssprep.Directory(dir,exclude=['file_*3*','file_2??'],include=['file_*5*'],maxarchivesize=mdssprep.one_meg*200.,minsize=mdssprep.one_meg*100.)\n prepdir = mdssprep.Directory(dir)\n prepdir.archive(dryrun=False)","def _copy_otto_files(self):\n\n # Copy files used by the container\n # Substitute name of the container in the configuration file.\n lxcdefaults = os.path.join(utils.get_base_dir(), \"lxc.defaults\")\n with open(os.path.join(lxcdefaults, \"config\"), 'r') as fin:\n with open(os.path.join(self.containerpath, \"config\"), 'w') as fout:\n for line in fin:\n lineout = line\n if \"${NAME}\" in line:\n lineout = line.replace(\"${NAME}\", self.name)\n elif \"${ARCH}\" in line:\n lineout = line.replace(\"${ARCH}\", self.arch)\n fout.write(lineout)\n\n dri_exists = os.path.exists(\"/dev/dri\")\n vga_device = utils.find_vga_device()\n with open(os.path.join(lxcdefaults, \"fstab\"), 'r') as fin:\n with open(os.path.join(self.containerpath, \"fstab\"), 'w') as fout:\n for line in fin:\n if line.startswith(\"/dev/dri\") and not dri_exists:\n lineout = \"# /dev/dri not found, entry disabled (\"\\\n \"do you use nvidia or fglrx graphics \"\\\n \"drivers?)\\n\"\n lineout += \"#\" + line\n else:\n lineout = line\n fout.write(lineout)\n\n src = os.path.join(lxcdefaults, \"scripts\")\n dst = os.path.join(self.containerpath, \"tools\", \"scripts\")\n with ignored(OSError):\n shutil.rmtree(dst)\n shutil.copytree(src, dst)\n utils.set_executable(os.path.join(dst, \"pre-start.sh\"))\n utils.set_executable(os.path.join(dst, \"pre-mount.sh\"))\n utils.set_executable(os.path.join(dst, \"post-stop.sh\"))\n\n src = os.path.join(lxcdefaults, \"guest\")\n dst = os.path.join(self.containerpath, \"tools\", \"guest\")\n with ignored(OSError):\n shutil.rmtree(dst)\n shutil.copytree(src, dst)\n\n # Some graphics need a proprietary driver\n # driver -> packages to install\n drivers = {\n \"fglrx\": \"fglrx\",\n \"fglrx_pci\": \"fglrx\",\n \"nvidia\": \"nvidia-current\"\n }\n if vga_device is not None and \"Driver\" in vga_device:\n if vga_device[\"Driver\"] in drivers:\n logging.info(\"Installing additional drivers for graphics \"\n \"card {}\".format(vga_device[\"Device\"]))\n # l-h-g must be installed to compile additional modules\n pkgs = \"linux-headers-generic {}\\n\".format(\n drivers[vga_device[\"Driver\"]])\n # TODO: this shouldn't be in the guest directory\n pkgsdir = os.path.join(self.containerpath, \"tools\", \"guest\", \"var\", \"local\", \"otto\", \"config\")\n if not os.path.exists(pkgsdir):\n os.makedirs(pkgsdir)\n with open(os.path.join(pkgsdir, \"00drivers.pkgs\"), 'w') as fpkgs:\n logging.debug(\"Custom drivers written to {}\".format(\n os.path.join(pkgsdir, \"00drivers.pkgs\")))\n fpkgs.write(pkgs)","def move_files():\r\n if \"defaultdirectory\" in data:\r\n print(\"\\n*** Default video source directory:\", data[\"defaultdirectory\"])\r\n srcdir = input(\"Enter '1' to use default video source directory\\n\"\r\n \"Otherwise, please enter the full path where your videos are located.\\n\"\r\n \"Example: C:\\\\user\\\\downloads\\\\ \\n\").strip()\r\n if srcdir.startswith('1'):\r\n srcdir = data[\"defaultdirectory\"]\r\n else:\r\n srcdir = input(\"Please enter the full path where your videos are located.\\n\"\r\n \"Example: C:\\\\user\\\\downloads\\\\ \\n\").strip()\r\n while not os.path.isdir(srcdir):\r\n srcdir = input(\"\\n*** Invalid directory. Please enter the full path where your \"\r\n \"videos are located.\\n Example: C:\\\\user\\\\downloads\\\\ \\n\").strip()\r\n data[\"defaultdirectory\"] = srcdir\r\n save_json()\r\n print()\r\n for filename in os.listdir(srcdir):\r\n # Only look for folders/files in the format \"S##E##\". Example: \"X-Files S01E02\"\r\n if re.search('[sS]\\\\d{2}[eE]\\\\d{2}', filename):\r\n found = False\r\n filepath = os.path.join(srcdir, filename)\r\n name = filename.lower()\r\n for key in data:\r\n keywords = key.split()\r\n if all(word in name for word in keywords):\r\n found = True\r\n try:\r\n shutil.move(filepath, data[key])\r\n except Exception as e:\r\n print(\"*** Error with {}\".format(filename))\r\n print(\"The file might be open in another program\")\r\n print(repr(e))\r\n else:\r\n print(\"*** Moved:\", (filename[:41] + \"...\") if len(filename) > 44 else filename)\r\n break\r\n if not found:\r\n # Prints the shows that matched the episode formatting, but were not\r\n # configured to be processed\r\n print(\"* Not processed:\", (filename[:35] + '...') if len(filename) > 38 else filename)","def cp_dir_or_files(self):\n if self.recursive:\n if self.cmdtype == 'upload' and not self.srcpath.endswith(os.path.sep):\n basename = os.path.basename(self.srcpath)\n self.destpath = join_obs_path(self.destpath, basename)\n elif self.cmdtype == 'download' and not self.srcpath.endswith('/'):\n bucket, key = split_bucket_key(self.srcpath)\n basename = key.split('/')[-1]\n if basename:\n self.destpath = os.path.join(self.destpath, basename)\n elif not self.srcpath.endswith('/'):\n bucket, key = split_bucket_key(self.srcpath)\n basename = key.split('/')[-1]\n if basename:\n self.destpath = join_obs_path(self.destpath, basename)","def main():\n parser = argparse.ArgumentParser()\n parser.add_argument('--dryrun', '-n', action='store_true',\n help=('check TileDB/SSH files differences only, '\n 'does not perform any copy'))\n parser.add_argument('--debug', '-d', action='store_true',\n help=('prints debug messages'))\n parser.add_argument('--tdmq-url', action='store', type=str, required=True,\n dest='tdmq_url',\n help=('tdmq server and path of the form'))\n parser.add_argument('--tdmq-auth-token', action='store', type=str, required=True,\n dest='tdmq_auth_token',\n help=('tdmq server authorization token'))\n parser.add_argument('--ssh-url', action='store', type=str, required=True,\n dest='ssh_url',\n help=(\n 'ssh server and path of the form: '\n '<USER>@<NAME_NODE>:<PORT>/PATH'))\n parser.add_argument('--ssh-key', action='store', type=str, required=True,\n dest='ssh_key',\n help=('key for ssh server authentication'))\n parser.add_argument('--desc-file', action='store', type=str, required=True,\n dest='source_desc_file',\n help=('source descrption file'))\n\n # Only one of --hours and --sync can be provided on command line\n sync_group = parser.add_mutually_exclusive_group()\n sync_group.add_argument('--hours', action='store',\n dest='hours', default=24, type=int,\n help=('uploads only the radar images '\n 'more recent than the given number of hours'))\n sync_group.add_argument('--sync', '-s', action='store_true',\n dest='sync',\n help=('upload all the missing radar images'))\n\n args = parser.parse_args()\n\n # If the debug flag is set, print all messages\n if args.debug:\n logging.basicConfig(\n level=logging.DEBUG,\n format='[%(levelname)s] %(message)s')\n else:\n logging.basicConfig(\n level=logging.INFO,\n format='[%(levelname)s] %(message)s')\n\n logging.getLogger(\"paramiko\").setLevel(logging.WARNING)\n\n (_ssh_username, _ssh_hostname, _ssh_port,\n _ssh_root) = check_ssh_url(args.ssh_url)\n if _ssh_hostname is None:\n logging.error(\n 'Wrong, incomplete or absent SSH path: \\'%s\\'', args.ssh_url)\n sys.exit(1)\n\n if os.path.isfile(args.ssh_key) == False:\n logging.error(\n 'SSH key file not found: \\'%s\\'', args.ssh_key)\n sys.exit(1)\n\n if os.path.isfile(args.source_desc_file) == False:\n logging.error(\n 'Source description file not found: \\'%s\\'', args.source_desc_file)\n sys.exit(1)\n\n _source_desc = load_description(args.source_desc_file)\n\n ssh_client = SSHClient(\n username=_ssh_username,\n hostname=_ssh_hostname,\n port=_ssh_port,\n key_file=args.ssh_key,\n root_dir=_ssh_root\n )\n\n _folder_list = ssh_client.list_folder()\n\n def _name_filter(file_name):\n # Is a radar image file\n if re.match(r'cag01est2400\\d{4}-\\d{2}-\\d{2}_\\d{2}:\\d{2}:\\d{2}.png', file_name):\n return True\n else:\n return False\n\n # Filter out not image files\n _image_list = list(filter(_name_filter, _folder_list))\n\n # Instantiates a TDMQ client, retrieves the source if exists or registers a\n # new one\n tdmq_client = Client(args.tdmq_url, args.tdmq_auth_token)\n sources = tdmq_client.find_sources({'id': _source_desc['id']})\n if len(sources) > 0:\n assert len(sources) == 1\n source = sources[0]\n logging.info(f\"Using source {source.tdmq_id} for {source.id}.\")\n else:\n source = tdmq_client.register_source(_source_desc)\n logging.info(f\"Created source {source.tdmq_id} for {source.id}.\")\n\n try:\n ts = source.timeseries()\n times = ts.time\n last_image_time = max(sorted(times))\n _last_slot = max(ts.tiledb_indices)\n except Exception as ex: # FIXME too general\n times = []\n last_image_time = datetime.datetime(1970, 1, 1, 0, 0, 0)\n _last_slot = 0\n\n # Builds the list of file to download\n if args.sync:\n _images_to_ingest = ingest_missings(_image_list, times)\n else:\n start_time = (\n datetime.datetime.now() - datetime.timedelta(hours=args.hours)\n ).replace( minute=0, second=0, microsecond=0)\n\n logging.info(f\"Requested images from {start_time} (last local image is {last_image_time}).\")\n if start_time > last_image_time:\n last_image_time = start_time\n\n _images_to_ingest = ingest_latests(last_image_time, _image_list)\n\n logging.info(\n f\"Remote files: {len(_folder_list)}, remote images: \"\n f\"{len(_image_list)}, images to sync: {len(_images_to_ingest)}.\")\n\n for _image in _images_to_ingest:\n _timestamp = datetime.datetime.strptime(\n _image, 'cag01est2400%Y-%m-%d_%H:%M:%S.png')\n _last_slot = _last_slot + 1\n\n if args.dryrun:\n logging.debug(f\"[DRY-RUN] Ingesting data at time {_timestamp}, slot {_last_slot}.\")\n else:\n logging.debug(f\"Ingesting data at time {_timestamp}, slot {_last_slot}.\")\n _data = fetch_radar_data(ssh_client, _image)\n source.ingest(_timestamp, _data, _last_slot)\n logging.info(f\"Done ingesting.\")","def get_train_video(opt, frame_path, Total_frames):\n clip = []\n i = 0\n loop = 0\n\n # choosing a random frame\n if Total_frames <= opt.sample_duration: \n loop = 1\n start_frame = 0\n else:\n start_frame = np.random.randint(0, Total_frames - opt.sample_duration)\n \n if opt.modality == 'RGB': \n while len(clip) < opt.sample_duration:\n try:\n im = Image.open(os.path.join(frame_path, '%05d.jpg'%(start_frame+i+1)))\n clip.append(im.copy())\n im.close()\n except:\n print('ERROR no such image {}'.format(os.path.join(frame_path, '%05d.jpg'%(i+1))))\n i += 1\n \n if loop==1 and i == Total_frames:\n i = 0\n\n elif opt.modality == 'Flow': \n while len(clip) < 2*opt.sample_duration:\n try:\n im_x = Image.open(os.path.join(frame_path, 'TVL1jpg_x_%05d.jpg'%(start_frame+i+1)))\n im_y = Image.open(os.path.join(frame_path, 'TVL1jpg_y_%05d.jpg'%(start_frame+i+1)))\n clip.append(im_x.copy())\n clip.append(im_y.copy())\n im_x.close()\n im_y.close()\n except:\n pass\n i += 1\n \n if loop==1 and i == Total_frames:\n i = 0\n \n elif opt.modality == 'RGB_Flow':\n while len(clip) < 3*opt.sample_duration:\n try:\n im = Image.open(os.path.join(frame_path, '%05d.jpg'%(start_frame+i+1)))\n im_x = Image.open(os.path.join(frame_path, 'TVL1jpg_x_%05d.jpg'%(start_frame+i+1)))\n im_y = Image.open(os.path.join(frame_path, 'TVL1jpg_y_%05d.jpg'%(start_frame+i+1)))\n clip.append(im.copy())\n clip.append(im_x.copy())\n clip.append(im_y.copy())\n im.close()\n im_x.close()\n im_y.close()\n except:\n pass\n i += 1\n \n if loop==1 and i == Total_frames:\n i = 0\n return clip","def texlive_install():\n orDir = os.getcwd()\n system = platform.system()\n if system == 'Windows':\n print('A Windows system has been detected.')\n default_dir = '/texlive/'\n elif system == 'Linux':\n print('A Linux system has been detected.')\n default_dir = '/usr/share/texlive'\n else:\n print(\"System '{}' is not known. Aborting.\".format(system))\n raise SystemExit()\n\n print('Looking for configuration file...')\n # If available, the default root path is used\n if os.path.isdir(default_dir):\n os.chdir(default_dir)\n else:\n os.chdir('/')\n # Then we look for the config file\n for root, dirs, files in os.walk(os.getcwd()):\n if 'texmf.cnf' in files:\n filePath = os.path.join(root,'texmf.cnf')\n print('Configuration file found at {}'.format(filePath))\n break\n if filePath is None:\n print('Warning: no configuration file has been found. Continuing with default settings...')\n filePath = default_dir\n\n # And now for the actual local texmf folder, which is created if not already there\n os.chdir(os.path.join(root,'..'))\n texmf_dir = os.path.join(os.getcwd(),'texmf-local')\n f_chdir(texmf_dir)\n new_dir = 'tex'\n f_chdir(new_dir)\n new_dir = 'latex'\n f_chdir(new_dir)\n\n # template files are copied\n new_dir = 'imta'\n f_chdir(new_dir)\n templatePath = os.getcwd()\n copy_source_files(orDir,templatePath)\n\n \n output = subprocess.check_output(\"tlmgr conf auxtrees add {}\".format(texmf_dir), \n shell=True).decode('utf-8')\n \n print('Configuration file updated')\n # original directory is restored\n f_chdir(orDir)","def copy_facemap_roi(procfile, videofile, outputfile=None):\n videodata = np.load(procfile, allow_pickle=True).item() \n videodata['filenames'] = [[videofile]]\n if outputfile is None:\n outputfile = os.path.splitext(videofile)[0]+'_proc.npy'\n if os.path.isfile(outputfile):\n print(f'File {outputfile} exists. It will not be overwritten.')\n return None\n np.save(outputfile, videodata)\n return outputfile","def process_videos(chapter_info):\n\n print(\"Processing chapter_info:\", chapter_info)\n\n # getting creation time of the first chapter\n # TODO update when adding multiple directory proccessing\n os.chdir(DIR_VIDEO_FILES)\n print(\"1st chapter\", chapter_info[1][0])\n chap1_time = time.strftime(\n r\"%Y-%m-%d_%H-%M\", time.localtime(os.path.getctime(chapter_info[1][0])))\n print(\"1st chapter creation\", chap1_time)\n\n # output_file = f\"M_GH00{chapter_info[0]}_{chap1_time}.MP4\"\n output_file = f\"{chap1_time}_GH00{chapter_info[0]}_MRG.MP4\"\n if os.path.isfile(output_file):\n print(f\"Chapter already processed, found file: {output_file}\")\n return\n\n # preparing text file containing file list for merging (for ffmpeg)\n video_list_file = chapter_info[0] + \"_merge.txt\"\n with open(video_list_file, \"w\") as f:\n for video_chapter in chapter_info[1]:\n f.write(f\"file {video_chapter}\\n\")\n\n command = f\"{FFMPEG_EXE} -f concat -i {video_list_file} -c copy {DIR_OUTPUT}{output_file}\"\n print(\"command =\", command)\n # p = subprocess.run(\"dir\", shell=True, capture_output=True)\n # p = subprocess.run(\"dir\", shell=True, stdout=subprocess.PIPE, text=True)\n p = subprocess.run(command, stdout=subprocess.PIPE, text=True)\n print(\"returncode =\", p.returncode)\n # print(\"stdout =\", p.stdout)\n os.remove(video_list_file) # remove file list after merging\n # rename original chapters after processing\n for video_chapter in chapter_info[1]:\n os.rename(video_chapter, f\"OK_{video_chapter}\")","def main():\n parser = argparse.ArgumentParser(description=\"Tracks adult fish\")\n # add options for argument parser\n parser.add_argument(\"in_path\",\n help=\"Path to the video directory.\")\n parser.add_argument(\"out_path\",\n help=\"Directory for results. Should be empty.\")\n parser.add_argument(\"-x\", \"--keep_temp\", action=\"store_true\",\n help=\"Keep temporary folder after execution.\")\n parser.add_argument(\"--visual\", action=\"store_true\",\n help=\"shows a visual representation of the tracking progress.\")\n\n # parse arguments from command line\n args = parser.parse_args()\n # get all file names and directories ready\n out_dir, temp_dir, video_bases, videos = housekeeping(args)\n borders = []\n for i in range(len(videos)):\n v = videos[i]\n get_borders(borders, temp_dir, v)\n\n for i in range(len(videos)):\n vbn = video_bases[i]\n v = videos[i]\n scaled_video = \"scaled_\" + vbn + \".avi\"\n ffmpeg = Ffmpeg(v, os.path.join(temp_dir, scaled_video))\n ffmpeg.f = \"avi\"\n ffmpeg.vcodec = \"libx264rgb\"\n ffmpeg.width = 480\n ffmpeg.run()\n\n for i in range(len(videos)):\n vbn = video_bases[i]\n pts = tracker(args, temp_dir, vbn)\n border = borders[i]\n tracks_lower, tracks_upper = split_tracks(border, pts)\n analysis = Analysis(tracks_lower, tracks_upper, px_size=0.06)\n analysis.analyze(os.path.join(out_dir, 'stats.txt'), vbn, vel=True)\n\n if not args.keep_temp:\n shutil.rmtree(temp_dir)","def fileCopyToMorph():\r\n print(str(self.copyFilePath))\r\n print(str(self.morphPath))\r\n \"\"\"copyPath = self.createDir + self.name + \"-\" + self.method\r\n print(str(copyPath))\r\n \r\n os.system(copyPath)\"\"\"\r\n os.system(self.copyFilePath)\r\n print(\"Burada sorun yok\")","def seperate_dog_cat(src, dst):\n imgs = [f for f in os.listdir(src) if os.path.isfile(os.path.join(src, f)) and not f.startswith('.')]\n \n dst_dog = os.path.join(dst, 'dog')\n dst_cat = os.path.join(dst, 'cat')\n if not os.path.exists(dst_dog):\n os.makedirs(dst_dog)\n if not os.path.exists(dst_cat):\n os.makedirs(dst_cat)\n \n for img in imgs:\n if 'dog' in img:\n move(os.path.join(src, img), dst_dog)\n if 'cat' in img:\n move(os.path.join(src, img), dst_cat)\n print('seperate done')","def form_sample_folder(self, input_folder, target_folder, sample_name):\n print(f'processing {sample_name} folder.')\n # first make a subfolder to contain the images - e.g. 'target_folder/sample_name'\n sample_dir = join(target_folder, sample_name)\n if not os.path.exists(sample_dir):\n mkdir(sample_dir)\n # resize and move the mask images - e.g. 'target_folder/sample_name/imgs_necrosis.png'\n img_file_nec = join(input_folder, 'Necrosis',\n 'Tissue Slides.'+sample_name+'.png')\n img_res = self.process_img(img_file_nec, self.rescale_ratio)\n img_nec = img_res.copy()\n cv2.imwrite(join(sample_dir, 'necrosis.png'), img_res)\n\n img_file_perf = join(input_folder, 'Perfusion',\n 'Tissue Slides.'+sample_name+'.png')\n img_res = self.process_img(img_file_perf, self.rescale_ratio)\n cv2.imwrite(join(sample_dir, 'perfusion.png'), img_res)\n\n # resize and move the maker HE and EF5 images\n files = listdir(input_folder)\n img_files = [x for x in files if x.split(\n '.')[-1] in ('tif', 'jpg', 'png')]\n for img_file in img_files:\n if (sample_name+'_' in img_file) or (sample_name+'-' in img_file):\n if ('HE-G' in img_file) or ('HE-green' in img_file) or ('HEgreen' in img_file):\n img_res = self.process_img(\n join(input_folder, img_file), self.rescale_ratio)\n if not os.path.exists(join(sample_dir, 'HE-green.png')):\n cv2.imwrite(join(sample_dir, 'HE-green.png'), img_res)\n else:\n warnings.warn(\n f\"file already exists, while processing {img_file}\")\n elif ('HE-R' in img_file) or ('HE-red' in img_file) or ('HEred' in img_file):\n img_res = self.process_img(\n join(input_folder, img_file), self.rescale_ratio)\n if not os.path.exists(join(sample_dir, 'HE-red.png')):\n cv2.imwrite(join(sample_dir, 'HE-red.png'), img_res)\n else:\n warnings.warn(\n f\"file already exists, while processing {img_file}\")\n elif ('HE-B' in img_file) or ('HE-blue' in img_file) or ('HE-blue' in img_file):\n img_res = self.process_img(\n join(input_folder, img_file), self.rescale_ratio)\n if not os.path.exists(join(sample_dir, 'HE-blue.png')):\n cv2.imwrite(join(sample_dir, 'HE-blue.png'), img_res)\n else:\n warnings.warn(\n f\"file already exists, while processing {img_file}\")\n elif 'EF5' in img_file:\n img_res = self.process_img(\n join(input_folder, img_file), self.rescale_ratio)\n img_ef5 = img_res.copy()\n if not os.path.exists(join(sample_dir, 'EF5.png')):\n cv2.imwrite(join(sample_dir, 'EF5.png'), img_res)\n else:\n warnings.warn(\n f\"file already exists, while processing {img_file}\")\n\n masked_ef5 = (img_ef5 * (img_nec <= 0)).astype(img_ef5.dtype)\n cv2.imwrite(join(sample_dir, 'EF5_masked.png'), masked_ef5)\n assert len(listdir(sample_dir)) == 7\n return","def gen_thumb(video_path, thumb_path):\n if os.path.isfile(thumb_path):\n os.remove(thumb_path)\n\n global THUMB_SIZE\n cmd = ['ffmpeg', '-itsoffset', '-5', '-i', video_path, '-vframes', '1', '-f', 'apng', '-s', THUMB_SIZE, thumb_path]\n p = Popen(cmd, stdin=PIPE, stdout=PIPE, stderr=PIPE)\n output = p.communicate()[1]\n\n duration = search_duration_from_text(output)\n if not duration:\n tlog = get_logger(current_thread().name)\n tlog.error(\"Failed to find duration for {0}\".format(video_path))\n duration = 0\n\n return p.returncode == 0, duration","def upload():\n run('mkdir -p /srv/images/'+env.project_name+'/')\n rsync_project(\n env.project_dir, './',\n exclude=(\n '.git', '.gitignore', '__pycache__', '*.pyc', '.DS_Store', 'environment.yml',\n 'fabfile.py', 'Makefile', '.idea', 'bower_components', 'node_modules',\n '.env.example', 'README.md', 'var'\n ), delete=True)","def setup_rawpath(job, raw_path):\n\n logging.info(f\"Destination is {raw_path}\")\n if not os.path.exists(raw_path):\n try:\n os.makedirs(raw_path)\n except OSError:\n err = f\"Couldn't create the base file path: {raw_path}. Probably a permissions error\"\n logging.error(err)\n else:\n logging.info(f\"{raw_path} exists. Adding timestamp.\")\n raw_path = os.path.join(str(job.config.RAW_PATH), f\"{job.title}_{job.stage}\")\n logging.info(f\"raw_path is {raw_path}\")\n try:\n os.makedirs(raw_path)\n except OSError:\n err = f\"Couldn't create the base file path: {raw_path}. Probably a permissions error\"\n raise OSError(err) from OSError\n return raw_path","def processVideo(inputRootFolder='/home/pi/Logging/UnprocessedVideo',\n outputFolder='/home/pi/Logging/Unsent',\n cam_framerate=10,\n delay=15):\n logging.info('Processing videos')\n sleep(delay) # hardcoded sleep function to ensure that the video has finished saving\n # Create directories if necessary\n try:\n os.makedirs(inputRootFolder)\n except OSError as e:\n if e.errno != errno.EEXIST:\n raise # This was not a \"directory exists\" error\n try:\n os.makedirs(outputFolder)\n except OSError as e:\n if e.errno != errno.EEXIST:\n raise # This was not a \"directory exists\" error\n # Get the list of subdirectories\n f = []\n for (dirpath, dirnames, filenames) in os.walk(inputRootFolder):\n f.extend(dirnames)\n # Go through each subdirectory\n for folder in f:\n folderName = os.path.join(inputRootFolder,folder)\n videoListName = '%s/videoList.txt' % folderName #file that will contain list of videos\n videoList = io.open(videoListName, 'w')\n for fileName in sorted(os.listdir(folderName)): #add each video in the folder to the file\n if (fileName.startswith('Video')):\n videoString = (\"file '%s/%s'\\n\" % (folderName, fileName))\n videoList.write(videoString)\n videoList.close()\n outputFile = '%s/%s.mp4' % (outputFolder, folder)\n #concatenate the videos\n subprocess.call(['ffmpeg', '-y', '-f', 'concat', '-safe', '0', '-i',\n videoListName, '-c', 'copy', outputFile], shell=False)\n shutil.rmtree(folderName, ignore_errors=True) #delete the folder\n logging.info('Processed videos')","def _videoclipupload(request, hash_key):\n # get video\n video_queryset = Video.objects.all().select_related('owner')\n video = get_object_or_404(video_queryset, hash_key=hash_key)\n \n if request.method == 'POST':\n \n # create a form instance and populate it with data from the request\n form = UploadClipForm(request.POST, request.FILES)\n \n # check whether it's valid\n if form.is_valid():\n # process the data in form.cleaned_data as required\n number = form.cleaned_data['formatted_number'].as_e164\n name = form.cleaned_data['name']\n clip = form.cleaned_data['clip']\n \n # get location of script\n script_dir = os.path.dirname(os.path.abspath(__file__))\n script_path = os.path.join(script_dir, \"process.sh\")\n \n # get locations of input and output files\n input_video = clip.temporary_file_path()\n output_video = NamedTemporaryFile(suffix='.mp4')\n output_image = NamedTemporaryFile(suffix='.jpg')\n output_duration = NamedTemporaryFile()\n \n # get the ffmpeg path\n # on production we had to install the 64 bit static ffmpeg build\n ffmpeg_path = ''\n if not settings.DEBUG:\n ffmpeg_path = '/home/nceruchalu/bin/'\n \n # Generate the output files\n subprocess.check_call(\n [script_path, input_video, output_video.name, \n output_image.name, output_duration.name, ffmpeg_path])\n \n # Get clip duration from the results\n clip_duration = map(float, output_duration)[0]\n \n # if we've come this far then all is well, and we can go ahead\n # and create this clip\n user = User.objects.get_user_by_number(number)\n if not user.is_active and name:\n user.full_name = name\n user.save()\n \n # first add user as a video user, because nobody should\n # add to a clip without being a video user\n VideoUsers.objects.add_users_to_video(video, user)\n \n # Try creating the clip with a thumbnail, if that fails try\n # without the thumbnail\n Clip.objects.create(owner=user,\n video=video,\n mp4=File(output_video),\n photo=ImageFile(output_image),\n duration=clip_duration)\n \n # close and delete the tempoary files\n output_video.close()\n output_image.close()\n output_duration.close()\n \n # redirect to the video details URL but add a querystring param\n # indicating that the video should start from the last clip\n video_url = reverse('web-video-detail',kwargs={'hash_key':hash_key})\n redirect_url = \"{video_url}?latest=1\".format(video_url=video_url)\n \n return HttpResponseRedirect(redirect_url)\n \n else:\n # if a GET (or any other method) we'll create a blank form\n form = UploadClipForm()\n \n return render_to_response('video/upload.html',\n {'video':video,\n 'form':form},\n context_instance=RequestContext(request))","def ffmpeg_subclip_video_file(filename, t1, t2):\n subprocess.call(['ffmpeg', '-i', filename, '-ss', str(t1), '-to', str(t2), '-c', 'copy', '-y', filename.split('.')[0] + '_subclip.mp4'])\n return"],"string":"[\n \"def take_one_shot(path_to_images, name_image, video_source=\\\"/dev/video0\\\"):\\n subprocess_cmd(\\\"ffmpeg -f video4linux2 -s 1280x720 -i {} -frames 1 ./{}/{} -loglevel error -nostats\\\".format(video_source, path_to_images, name_image))\",\n \"def makeVideo():\\n os.system(\\\"cd video && ffmpeg -r 10 -i img%05d.jpg -vcodec mpeg4 -y caronthehill_clip.mp4\\\")\",\n \"def thumbnail(self, fnameIn, fnameOut):\\n cmd = \\\"convert -define jpeg:size=500x150 \\\"\\n cmd += '\\\"%s\\\" ' % os.path.join(self.downloadFolder, fnameIn)\\n cmd += \\\"-auto-orient -thumbnail 250x150 \\\"\\n cmd += '\\\"%s\\\" ' % os.path.join(self.thumbnailFolder, fnameOut)\\n self.log(\\\"creating thumbnail ...\\\")\\n self.log(cmd)\\n process = subprocess.Popen(cmd, shell=True, stdout=subprocess.PIPE)\\n process.wait()\",\n \"def make_video(pattern, plotdir, moviedir, movienametag):\\n images_list = glob('%s/%s'%(plotdir, pattern))\\n images_list.sort()\\n # save all required files into tmp_moviedir, with simple filenames: %.4d.png\\n tmp_moviedir = '%s/tmp_movie_%s'%(plotdir, movienametag)\\n os.system('mkdir -p %s'%tmp_moviedir)\\n for i in range(len(images_list)):\\n fname = images_list[i].split('%s/'%plotdir)[-1].split('.png')[0]\\n os.system('cp %s/%s.png %s/%.4d.png'%(plotdir, fname, tmp_moviedir, i))\\n\\n os.system('avconv -i %s'%tmp_moviedir +'/%04d.png ' \\\\\\n +' -y -c:v libx264 -pix_fmt yuv420p %s/%s.mp4'%(moviedir, movienametag))\",\n \"def generate_thumbnail():\\n import tempfile\\n import glob\\n from anima.env import mayaEnv\\n m_env = mayaEnv.Maya()\\n v = m_env.get_current_version()\\n\\n if not v:\\n return\\n\\n # do not generate a thumbnail from a Repr\\n if '@' in v.take_name:\\n return\\n\\n task = v.task\\n project = task.project\\n # repo = project.repository\\n imf = project.image_format\\n width = int(imf.width * 0.5)\\n height = int(imf.height * 0.5)\\n\\n temp_output = tempfile.mktemp()\\n\\n current_frame = pm.currentTime(q=1)\\n output_file = pm.playblast(\\n fmt='image',\\n startTime=current_frame,\\n endTime=current_frame,\\n sequenceTime=1,\\n forceOverwrite=1,\\n filename=temp_output,\\n clearCache=1,\\n showOrnaments=1,\\n percent=100,\\n wh=(width, height),\\n offScreen=1,\\n viewer=0,\\n compression='PNG',\\n quality=70,\\n framePadding=0\\n )\\n pm.currentTime(current_frame)\\n\\n output_file = output_file.replace('####', '*')\\n found_output_file = glob.glob(output_file)\\n if found_output_file:\\n output_file = found_output_file[0]\\n\\n from anima.ui import utils\\n utils.upload_thumbnail(task, output_file)\\n\\n return found_output_file\",\n \"def main(base_dir: str, output_dir: str) -> None:\\n base_path = pathlib.Path(base_dir)\\n output_path = pathlib.Path(output_dir).expanduser()\\n\\n stage_copy_images(base_path, output_path)\\n stage_extract_videos(base_path, output_path)\",\n \"def copy_file_to_server():\\r\\n utils.system_output('mv /home/chronos/user/Downloads/* /usr/local/autotest/results/default/',ignore_status=True)\\r\\n logging.info(\\\"Video Copied to Log location\\\")\",\n \"def main():\\n destination = Path(argv[1])\\n source_files = destination.glob(\\\"**/*.wma\\\")\\n for file in source_files:\\n new_name = file.name.rsplit(\\\".\\\", maxsplit=1)[0] + \\\".flac\\\"\\n dest = str(file.parent / new_name)\\n cmd = list(map(str, [\\\"avconv\\\", \\\"-i\\\", file, dest]))\\n if platform == \\\"win32\\\":\\n print(\\\"Running on windows... on Unix I'd run the following command:\\\")\\n print(cmd)\\n else:\\n that = Popen(cmd)\\n that.wait()\",\n \"def copyMedia(source, target):\\n if not os.path.exists(target):\\n print(\\\"copying source,target:\\\", source, target)\\n shutil.copy2(source, target)\",\n \"def prep(path,date,image):\\n \\n # run bash code with 'Popen'\\n P = Popen('cp '+path+date+'/final/'+image+' ./', shell=True)\\n P.wait()\\n P = Popen('mv '+image+' '+image+'.fz', shell=True)\\n P.wait()\\n P = Popen('funpack *.fz', shell=True)\\n P.wait()\\n P = Popen('rm -rf *.fz', shell=True)\\n P.wait()\",\n \"def process_video(proc_state):\\n entry = proc_state.entry\\n workbench = proc_state.workbench\\n video_config = mgg.global_config['media_type:mediagoblin.media_types.video']\\n\\n queued_filepath = entry.queued_media_file\\n queued_filename = proc_state.get_queued_filename()\\n name_builder = FilenameBuilder(queued_filename)\\n\\n medium_filepath = create_pub_filepath(\\n entry, name_builder.fill('{basename}-640p.webm'))\\n\\n thumbnail_filepath = create_pub_filepath(\\n entry, name_builder.fill('{basename}.thumbnail.jpg'))\\n\\n # Create a temporary file for the video destination (cleaned up with workbench)\\n tmp_dst = NamedTemporaryFile(dir=workbench.dir, delete=False)\\n with tmp_dst:\\n # Transcode queued file to a VP8/vorbis file that fits in a 640x640 square\\n progress_callback = ProgressCallback(entry)\\n\\n dimensions = (\\n mgg.global_config['media:medium']['max_width'],\\n mgg.global_config['media:medium']['max_height'])\\n\\n # Extract metadata and keep a record of it\\n metadata = transcoders.VideoTranscoder().discover(queued_filename)\\n store_metadata(entry, metadata)\\n\\n # Figure out whether or not we need to transcode this video or\\n # if we can skip it\\n if skip_transcode(metadata):\\n _log.debug('Skipping transcoding')\\n\\n dst_dimensions = metadata['videowidth'], metadata['videoheight']\\n\\n # Push original file to public storage\\n _log.debug('Saving original...')\\n proc_state.copy_original(queued_filepath[-1])\\n\\n did_transcode = False\\n else:\\n transcoder = transcoders.VideoTranscoder()\\n\\n transcoder.transcode(queued_filename, tmp_dst.name,\\n vp8_quality=video_config['vp8_quality'],\\n vp8_threads=video_config['vp8_threads'],\\n vorbis_quality=video_config['vorbis_quality'],\\n progress_callback=progress_callback,\\n dimensions=dimensions)\\n\\n dst_dimensions = transcoder.dst_data.videowidth,\\\\\\n transcoder.dst_data.videoheight\\n\\n # Push transcoded video to public storage\\n _log.debug('Saving medium...')\\n mgg.public_store.copy_local_to_storage(tmp_dst.name, medium_filepath)\\n _log.debug('Saved medium')\\n\\n entry.media_files['webm_640'] = medium_filepath\\n\\n did_transcode = True\\n\\n # Save the width and height of the transcoded video\\n entry.media_data_init(\\n width=dst_dimensions[0],\\n height=dst_dimensions[1])\\n\\n # Temporary file for the video thumbnail (cleaned up with workbench)\\n tmp_thumb = NamedTemporaryFile(dir=workbench.dir, suffix='.jpg', delete=False)\\n\\n with tmp_thumb:\\n # Create a thumbnail.jpg that fits in a 180x180 square\\n transcoders.VideoThumbnailerMarkII(\\n queued_filename,\\n tmp_thumb.name,\\n 180)\\n\\n # Push the thumbnail to public storage\\n _log.debug('Saving thumbnail...')\\n mgg.public_store.copy_local_to_storage(tmp_thumb.name, thumbnail_filepath)\\n entry.media_files['thumb'] = thumbnail_filepath\\n\\n # save the original... but only if we did a transcoding\\n # (if we skipped transcoding and just kept the original anyway as the main\\n # media, then why would we save the original twice?)\\n if video_config['keep_original'] and did_transcode:\\n # Push original file to public storage\\n _log.debug('Saving original...')\\n proc_state.copy_original(queued_filepath[-1])\\n\\n # Remove queued media file from storage and database\\n proc_state.delete_queue_file()\",\n \"def prepare_video(path_to_video: str, number_of_images=87) -> None:\\n\\n temp_video = path.join(path_to_video, 'temp_outpy.mp4')\\n video = path.join(path_to_video, 'outpy.h264')\\n\\n # create mp4 video for metadata and compute video duration\\n subprocess.run(['ffmpeg', '-i', video, '-c', 'copy', temp_video])\\n result = subprocess.run([\\\"ffprobe\\\", \\\"-v\\\", \\\"error\\\", \\\"-show_entries\\\",\\n \\\"format=duration\\\", \\\"-of\\\",\\n \\\"default=noprint_wrappers=1:nokey=1\\\", temp_video],\\n stdout=subprocess.PIPE,\\n stderr=subprocess.STDOUT)\\n video_duration = float(result.stdout)\\n\\n # create images folder\\n path_to_images = path.join(path_to_video, 'images')\\n if path.exists(path_to_images) and path.isdir(path_to_images):\\n shutil.rmtree(path_to_images)\\n makedirs(path_to_images)\\n\\n # split the given video into images\\n subprocess.run(['ffmpeg', '-i', temp_video, '-r', str(number_of_images / video_duration), '-f', 'image2',\\n path.join(path_to_images, 'image%d.jpg')])\\n\\n # remove extra files\\n remove_extra_images(path_to_images, number_of_images)\\n remove(temp_video)\",\n \"def make_video(input_files, width=0, height=0, frame_rate=24, crf=20, output_path=\\\"video.mp4\\\"):\\n if isinstance(input_files, list):\\n from PIL import Image # pylint: disable=C0415\\n\\n with Image.open(input_files[0]) as img:\\n width, height = img.size\\n tmp_dir = \\\"tmp_ffmpeg_dir\\\"\\n os.mkdir(tmp_dir)\\n if width % 2 != 0:\\n print(f\\\"Width ({width}) not divisible by 2\\\")\\n width -= 1\\n if height % 2 != 0:\\n print(f\\\"Height ({width}) not divisible by 2\\\")\\n height -= 1\\n for i, inp in enumerate(input_files):\\n shutil.copy(inp, os.path.join(tmp_dir, f\\\"{i:06d}.png\\\"))\\n inputs = f\\\"{tmp_dir}/%06d.png\\\"\\n command = ffmpeg_common_args(frame_rate, inputs, width, height, crf, output_path)\\n ret = os.system(command)\\n assert ret == 0, \\\"ffmpeg failed to generate video file.\\\"\\n for i in range(len(input_files)):\\n os.remove(os.path.join(tmp_dir, f\\\"{i:06d}.png\\\"))\\n os.rmdir(tmp_dir)\\n elif isinstance(input_files, str):\\n assert width != 0 and height != 0\\n command = ffmpeg_common_args(frame_rate, input_files, width, height, crf, output_path)\\n ret = os.system(command)\\n assert ret == 0, \\\"ffmpeg failed to generate video file.\\\"\\n else:\\n assert (\\n False\\n ), f'input_files should be list (of files) or str (of file template, e.g., \\\"%04d.png\\\") instead of {type(input_files)}'\",\n \"def createThumbnail(self, useCursorPosition=False, dbPath = None, versionInt = None):\\n\\n return \\\"\\\"\\n # logger.debug(\\\"Func: createThumbnail\\\")\\n # projectPath = self.projectDir\\n # if useCursorPosition:\\n # versionInt = self.currentVersionIndex\\n # dbPath = self.currentDatabasePath\\n # else:\\n # if not dbPath or not versionInt:\\n # msg = \\\"Both dbPath and version must be defined if useCursorPosition=False\\\"\\n # raise Exception ([360, msg])\\n #\\n # versionStr = \\\"v%s\\\" % (str(versionInt).zfill(3))\\n # dbDir, shotNameWithExt = os.path.split(dbPath)\\n # shotName = os.path.splitext(shotNameWithExt)[0]\\n #\\n # thumbPath = \\\"{0}_{1}_thumb.jpg\\\".format(os.path.join(dbDir, shotName), versionStr)\\n # relThumbPath = os.path.relpath(thumbPath, projectPath)\\n #\\n # # create a thumbnail using playblast\\n # thumbDir = os.path.split(thumbPath)[0]\\n # if os.path.exists(thumbDir):\\n # # frame = pm.currentTime(query=True)\\n # frame = cmds.currentTime(query=True)\\n # # store = pm.getAttr(\\\"defaultRenderGlobals.imageFormat\\\")\\n # store = cmds.getAttr(\\\"defaultRenderGlobals.imageFormat\\\")\\n # # pm.setAttr(\\\"defaultRenderGlobals.imageFormat\\\", 8) # This is the value for jpeg\\n # cmds.setAttr(\\\"defaultRenderGlobals.imageFormat\\\", 8) # This is the value for jpeg\\n # # pm.playblast(completeFilename=thumbPath, forceOverwrite=True, format='image', width=221, height=124, showOrnaments=False, frame=[frame], viewer=False, percent=100)\\n # cmds.playblast(completeFilename=thumbPath, forceOverwrite=True, format='image', width=221, height=124, showOrnaments=False, frame=[frame], viewer=False, percent=100)\\n # # pm.setAttr(\\\"defaultRenderGlobals.imageFormat\\\", store) #take it back\\n # cmds.setAttr(\\\"defaultRenderGlobals.imageFormat\\\", store) #take it back\\n # else:\\n # # pm.warning(\\\"something went wrong with thumbnail. Skipping thumbnail\\\")\\n # cmds.warning(\\\"something went wrong with thumbnail. Skipping thumbnail\\\")\\n # return \\\"\\\"\\n # # return thumbPath\\n # return relThumbPath\",\n \"def write_thumbnails(self, appstruct):\\n slugser = slugify(appstruct[\\\"serial\\\"])\\n pdf_filename = \\\"thumbnails/%s/uploaded.pdf\\\" % slugser\\n top_file = \\\"thumbnails/%s/top.png\\\" % slugser\\n mos_file = \\\"thumbnails/%s/mosaic.png\\\" % slugser\\n \\n thumg = ThumbnailGenerator(pdf_filename)\\n self.save_blob(thumg.top_thumbnail(), top_file)\\n self.save_blob(thumg.mosaic_thumbnail(), mos_file)\",\n \"def main():\\n # load parameters\\n params = load_params()\\n # check that both profiles exist (we assume that this means the directories\\n # are found on disk)\\n if not os.path.exists(params['profile1']):\\n emsg = 'profile1={0} does not exist'\\n eargs = [params['profile1']]\\n raise AperoCopyError(emsg.format(*eargs))\\n if not os.path.exists(params['profile2']):\\n emsg = 'profile2={0} does not exist'\\n eargs = [params['profile2']]\\n raise AperoCopyError(emsg.format(*eargs))\\n # get a list of files from profile 1 for each block kinds\\n files1, paths1 = get_files_profile1(params)\\n # get the output files for profile 2 for each block kind\\n files2, files3, paths2, paths3 = get_files_profile2(params, files1, paths1)\\n # copy files from profile 1 to profile 2 for each block kind\\n # must copy files to a temporary path first (copying can be slow)\\n copy_files(params, files1, files2, files3)\\n # may need to update profile 2 (via git) to match profile 1\\n update_git_profile2(params)\\n # remove all old files from profile 2 blocks\\n success = reset_profile2(params, paths3)\\n # rename the directories in profile 2 (this is quicker than copying)\\n if success:\\n success = rename_directories(params, paths2, paths3)\\n # update databases for profile 2\\n if success:\\n update_databases_profile2(params)\\n # return to __main__\\n return\",\n \"def copy_support_files() -> None:\\n # root folder files\\n filelist = {\\\"favicon128.png\\\",\\n \\\"favicon96.png\\\",\\n \\\"favicon72.png\\\",\\n \\\"favicon48.png\\\",\\n \\\"favicon32.png\\\",\\n \\\"favicon24.png\\\",\\n \\\"favicon16.png\\\",\\n \\\"favicon.ico\\\",\\n \\\"apple-touch-icon.png\\\",\\n \\\"apple-touch-icon-precomposed.png\\\",\\n \\\"apple-touch-icon-72x72.png\\\",\\n \\\"apple-touch-icon-72x72-precomposed.png\\\",\\n \\\"apple-touch-icon-114x114.png\\\",\\n \\\"apple-touch-icon-114x114-precomposed.png\\\",\\n \\\"apple-touch-icon-144x144.png\\\",\\n \\\"apple-touch-icon-144x144-precomposed.png\\\",\\n \\\"uca_style.css\\\"}\\n for filename in filelist:\\n try:\\n shutil.copy2(\\\"resources/\\\" + filename, WEBOUT_PATH)\\n except FileNotFoundError:\\n report_error(\\\"Missing file: resources/\\\" + filename)\\n # image folder files\\n filelist = {\\\"film.png\\\",\\n \\\"stylifera75.png\\\",\\n \\\"DOI_logo.svg\\\",\\n \\\"size_hist.png\\\",\\n \\\"size_ind.png\\\",\\n \\\"size_mean.png\\\",\\n \\\"size_range.png\\\",\\n \\\"size_summary.png\\\",\\n \\\"double_clawed.jpg\\\"}\\n for filename in filelist:\\n try:\\n shutil.copy2(\\\"resources/images/\\\" + filename, WEBOUT_PATH + \\\"images/\\\")\\n except FileNotFoundError:\\n report_error(\\\"Missing file: resources/images/\\\" + filename)\\n filelist = {\\\"specific_word_cloud.png\\\",\\n \\\"binomial_word_cloud.png\\\"}\\n for filename in filelist:\\n try:\\n shutil.copy2(TMP_PATH + filename, WEBOUT_PATH + \\\"images/\\\")\\n except FileNotFoundError:\\n report_error(\\\"Missing file: \\\" + TMP_PATH + filename)\\n # font-awesome files\\n filelist = {\\\"fontawesome.min.js\\\",\\n \\\"brands.min.js\\\",\\n \\\"regular.min.js\\\",\\n \\\"solid.min.js\\\"}\\n for filename in filelist:\\n try:\\n shutil.copy2(\\\"resources/font-awesome/js/\\\" + filename, WEBOUT_PATH + \\\"js/\\\")\\n except FileNotFoundError:\\n report_error(\\\"Missing file: resources/font-awesome/js/\\\" + TMP_PATH + filename)\\n # flag-icon files\\n filelist = {\\\"flag-icons.min.css\\\"}\\n for filename in filelist:\\n try:\\n shutil.copy2(\\\"resources/flag-icon-css/css/\\\" + filename, WEBOUT_PATH + \\\"images/flag-icon-css/css/\\\")\\n except FileNotFoundError:\\n report_error(\\\"Missing file: images/flag-icon-css/css/\\\" + TMP_PATH + filename)\\n filelist = {\\\"de.svg\\\", # Germany\\n \\\"es.svg\\\", # Spain\\n \\\"ru.svg\\\", # Russia\\n \\\"fr.svg\\\", # France\\n \\\"pt.svg\\\", # Portugal\\n \\\"dk.svg\\\", # Denmark\\n \\\"nl.svg\\\", # Netherlands\\n \\\"jp.svg\\\", # Japan\\n \\\"cn.svg\\\", # China\\n \\\"us.svg\\\", # USA\\n \\\"th.svg\\\", # Thailand\\n \\\"va.svg\\\", # Vatican\\n \\\"it.svg\\\", # Italy\\n \\\"kr.svg\\\", # South Korea\\n \\\"pl.svg\\\", # Poland\\n \\\"mm.svg\\\", # Myanamar (Burma)\\n \\\"sa.svg\\\", # Saudi Arabia (best option for Arabic of those available)\\n \\\"id.svg\\\", # Indonesia\\n \\\"za.svg\\\", # South Africa (best option for Afrikaans)\\n \\\"my.svg\\\", # Malaysia (for Malay)\\n \\\"mg.svg\\\", # Madagascar (for Malagasy)\\n \\\"ir.svg\\\", # Iran (for Persian)\\n \\\"vn.svg\\\"} # Vietnam\\n for filename in filelist:\\n try:\\n shutil.copy2(\\\"resources/flag-icon-css/flags/4x3/\\\" + filename, WEBOUT_PATH +\\n \\\"images/flag-icon-css/flags/4x3/\\\")\\n except FileNotFoundError:\\n report_error(\\\"Missing file: images/flag-icon-css/flags/4x3/\\\" + TMP_PATH + filename)\",\n \"def post_process_hls(d):\\r\\n\\r\\n log('post_process_hls()> start processing', d.name)\\r\\n\\r\\n local_video_m3u8_file = os.path.join(d.temp_folder, 'local_video.m3u8')\\r\\n local_audio_m3u8_file = os.path.join(d.temp_folder, 'local_audio.m3u8')\\r\\n\\r\\n cmd = f'\\\"{config.ffmpeg_actual_path}\\\" -loglevel error -stats -y -protocol_whitelist \\\"file,http,https,tcp,tls,crypto\\\" ' \\\\\\r\\n f'-allowed_extensions ALL -i \\\"{local_video_m3u8_file}\\\" -c copy \\\"file:{d.temp_file}\\\"'\\r\\n error, output = run_command(cmd, d=d)\\r\\n\\r\\n if error:\\r\\n # retry without \\\"-c copy\\\" parameter, takes longer time\\r\\n cmd = f'\\\"{config.ffmpeg_actual_path}\\\" -loglevel error -stats -y -protocol_whitelist \\\"file,http,https,tcp,tls,crypto\\\" ' \\\\\\r\\n f'-allowed_extensions ALL -i \\\"{local_video_m3u8_file}\\\" \\\"file:{d.temp_file}\\\"'\\r\\n error, output = run_command(cmd, d=d)\\r\\n\\r\\n if error:\\r\\n log('post_process_hls()> ffmpeg failed:', output)\\r\\n return False\\r\\n\\r\\n if 'dash' in d.subtype_list:\\r\\n cmd = f'\\\"{config.ffmpeg_actual_path}\\\" -loglevel error -stats -y -protocol_whitelist \\\"file,http,https,tcp,tls,crypto\\\" ' \\\\\\r\\n f'-allowed_extensions ALL -i \\\"{local_audio_m3u8_file}\\\" -c copy \\\"file:{d.audio_file}\\\"'\\r\\n error, output = run_command(cmd, d=d)\\r\\n\\r\\n if error:\\r\\n # retry without \\\"-c copy\\\" parameter, takes longer time\\r\\n cmd = f'\\\"{config.ffmpeg_actual_path}\\\" -loglevel error -stats -y -protocol_whitelist \\\"file,http,https,tcp,tls,crypto\\\" ' \\\\\\r\\n f'-allowed_extensions ALL -i \\\"{local_audio_m3u8_file}\\\" \\\"file:{d.audio_file}\\\"'\\r\\n error, output = run_command(cmd, d=d)\\r\\n\\r\\n if error:\\r\\n log('post_process_hls()> ffmpeg failed:', output)\\r\\n return False\\r\\n\\r\\n log('post_process_hls()> done processing', d.name)\\r\\n\\r\\n return True\",\n \"def save_video(foldername, songname, songlen, num_steps, output):\\n num_steps_by_len = num_steps / songlen\\n p = subprocess.Popen(['ffmpeg', '-f', 'image2', '-r', str(num_steps_by_len), '-i', '%d.png', '-c:v', 'libx264', '-pix_fmt', 'yuv420p', '-vf', 'pad=ceil(iw/2)*2:ceil(ih/2)*2', 'movie.mp4'], cwd=foldername)\\n p.wait()\\n\\n p = subprocess.Popen(['ffmpeg', '-i', 'movie.mp4', '-i', '../audio_files/' + songname + '.mp3', '-map', '0:v', '-map', '1:a', '-c', 'copy', output], cwd=foldername)\\n p.wait()\",\n \"def create_movie(name, folder):\\n cmd = [\\\"ffmpeg\\\", \\\"-framerate\\\", \\\"1\\\", \\\"-i\\\", folder + \\\"/pic%04d.png\\\", \\\"-c:v\\\",\\n \\\"libx264\\\", \\\"-r\\\", \\\"30\\\", \\\"-pix_fmt\\\", \\\"yuv420p\\\", name]\\n return subprocess.call(cmd)\",\n \"def _copy_snpeff_config(self):\\n\\n CONFIG = sequana_data(\\\"snpEff.config\\\", \\\"snpeff\\\")\\n os.makedirs(self.snpeff_datadir, exist_ok=True)\\n shutil.copyfile(CONFIG, self.configfile)\",\n \"def let_camera_update_parameters(path_to_images, name_image, video_source=\\\"/dev/video0\\\"):\\n subprocess_cmd(\\\"ffmpeg -f video4linux2 -s 1280x720 -i {} -ss 00:00:02 -frames 1 ./{}/{} -loglevel error -nostats\\\".format(video_source, path_to_images, name_image))\",\n \"def _init(args, workflows_dir, config_path):\\n for file in [\\\"samples.tsv\\\", \\\"config.yaml\\\"]:\\n src = os.path.join(workflows_dir, args.workflow.replace(\\\"-\\\", \\\"_\\\"), file)\\n dest = os.path.join(os.path.dirname(config_path), file)\\n\\n copy_file = True\\n if os.path.exists(dest) and args.force is False:\\n choices = {\\\"yes\\\": True, \\\"y\\\": True, \\\"no\\\": False, \\\"n\\\": False}\\n\\n sys.stdout.write(f\\\"File: {dest} already exists. Do you want to overwrite it? (yes/no) \\\")\\n while True:\\n choice = input().lower()\\n if choice in choices:\\n copy_file = choices[choice]\\n break\\n else:\\n print(\\\"Please respond with yes (y) or no (n).\\\")\\n\\n if copy_file:\\n shutil.copyfile(src, dest)\",\n \"def get_video_as_images():\\n experiments = ['me1.mp4']\\n try:\\n if (os.path.isdir(\\\"dump\\\")):\\n shutil.rmtree('dump')\\n except OSError:\\n print (\\\"Deletion of the directory failed\\\")\\n exit()\\n os.system('mkdir dump')\\n for experiment in experiments:\\n exp_no_ext = experiment.split('.')[0]\\n subdir_cmd = \\\"dump/{0}\\\".format(exp_no_ext)\\n os.mkdir(subdir_cmd)\\n os.system('ffmpeg -i videos/%s dump/%s/%s%%03d.jpg' % (experiment, exp_no_ext, exp_no_ext))\\n run_all(exp_no_ext)\",\n \"def prepare_destination(self):\\n self.movie_root_path = self.config.share_movie_root_path % (\\n self.share_path, self.title)\\n\\n if os.path.isdir(self.movie_root_path):\\n if self.capacity_reached():\\n Logger.log(\\n '[!] Capacity reached. Skipping adding movie %s.' % self.title)\\n else:\\n if not os.path.isdir(self.movie_root_path):\\n Logger.log('[+] Adding Movie: %s' % self.title)\\n os.mkdir(self.movie_root_path)\",\n \"def main():\\n parser = CustomArgumentParser()\\n parser.add_argument(\\\"-s\\\", \\\"--simon-sez\\\",\\n help=\\\"Really, Simon sez copy the data!\\\", action=\\\"store_true\\\")\\n parser.add_argument(\\\"-r\\\", \\\"--src-directory\\\",\\n help=\\\"Copy metadata from files in this directory.\\\")\\n parser.add_argument(\\\"-d\\\", \\\"--dst-directory\\\",\\n help=\\\"Copy metadata to matching files in this directory.\\\")\\n parser.add_argument(\\\"-v\\\", \\\"--verbose\\\", help=\\\"Log level to DEBUG.\\\",\\n action=\\\"store_true\\\")\\n args = parser.parse_args()\\n\\n if args.verbose:\\n logging.basicConfig(level=logging.DEBUG)\\n else:\\n logging.basicConfig(level=logging.INFO)\\n\\n error = False\\n\\n # Require these two arguments.\\n for arg in [args.src_directory, args.dst_directory]:\\n if not arg:\\n logger.error(\\n \\\"Required src or dst directory parameter missing.\\\")\\n error = True\\n # XXX: Duplicates exit below. Can't check directory if null.\\n logger.error(\\\"Exiting due to errors.\\\")\\n parser.usage_message()\\n sys.exit(1)\\n\\n if (os.path.exists(args.src_directory) and\\n os.path.isdir(args.src_directory)):\\n src_directory = args.src_directory\\n else:\\n logger.error(\\n \\\"--src-directory={} does not exist or is not a directory.\\\".format(\\n args.dst_directory))\\n error = True\\n\\n if (os.path.exists(args.dst_directory) and\\n os.path.isdir(args.dst_directory)):\\n dst_directory = args.dst_directory\\n else:\\n logger.error(\\n \\\"--dst-directory={} does not exist or is not a directory.\\\".format(\\n args.dst_directory))\\n error = True\\n\\n if error:\\n logger.error(\\\"Exiting due to errors.\\\")\\n parser.usage_message()\\n sys.exit(1)\\n else:\\n process_all_files(src_directory, dst_directory, simon_sez=args.simon_sez)\",\n \"def make_image_dir(to_path, filenames):\\n image_dir = os.path.join(to_path, \\\"image_2\\\")\\n os.makedirs(image_dir)\\n for f in filenames:\\n image_file = os.path.join(image_dir, f + \\\".png\\\")\\n os.system(\\\"cp sample.png {}\\\".format(image_file))\",\n \"def write_upload_files(self, appstruct):\\n \\n # Create the directory if it does not exist\\n final_dir = \\\"thumbnails/%s\\\" % slugify(appstruct[\\\"serial\\\"])\\n if not os.path.exists(final_dir):\\n log.info(\\\"Make directory: %s\\\", final_dir)\\n os.makedirs(final_dir)\\n\\n final_file = \\\"%s/uploaded.pdf\\\" % final_dir\\n file_pointer = appstruct[\\\"pdf_upload\\\"][\\\"fp\\\"]\\n self.single_file_write(file_pointer, final_file)\",\n \"def TextureFiles():\\n import shutil\\n\\n # first convert the .psd files to .png\\n\\n FbmDir = glo.outputFolder + '.fbm'\\n\\n for d1, d2, filenames in os.walk(FbmDir):\\n for filename in filenames:\\n \\\"\\\"\\\"filename: vitrin_diffuse.psd\\n \\\"\\\"\\\"\\n # print \\\"TextureFiles():\\\", filename\\n if filename[-4:].upper() == '.PSD':\\n #print \\\" -- FbmDir:\\\" , FbmDir\\n #print \\\" -- in the if clause with filename:\\\" , filename\\n #print \\\" -- glo.outputFolder\\\" , glo.outputFolder\\n # FbmDir = '../fbx/simplelifeembedmedia.fbm'\\n # filename = 'shelves_light.PSD'\\n PsdToPngConverter(FbmDir, filename)\\n\\n # Move only the .png file to the ../png/ directory\\n filename = filename[:-4] + '.png'\\n src = os.path.join(FbmDir, filename)\\n elif filename[0] != '.':\\n src = os.path.join(FbmDir, filename)\\n pass\\n\\n shutil.copy(src, glo.outputFolder)\\n print os.path.join(glo.outputFolder, filename), \\\"\\\\n\\\"\\n sys.stdout.flush()\\n # for d1, d2, files in os.walk(glo.outputFolder):\\n # if not filename in files:\\n # #print \\\"moving: \\\", files, filename, not filename in files\\n # shutil.copy(src, glo.outputFolder)\\n # print os.path.join(glo.outputFolder, filename), \\\"\\\\n\\\"\\n # else:\\n # print \\\"%s/%s already exists. File not moved\\\" % (glo.outputFolder,filename)\",\n \"def handle_image(name):\\n from_path = args.from_dir + name\\n to_path = args.to_dir + name\\n\\n if width != args.width:\\n subprocess.call('jpegtran -rotate 90 -grayscale ' + from_path + ' > ' \\\\\\n + to_path, shell=True)\\n else:\\n subprocess.call('jpegtran -grayscale ' + from_path + ' > ' + to_path,\\\\\\n shell=True)\",\n \"def photo2web_process_hattenbach():\\n\\n os.chdir('/Volumes/SSD External/Hattenbach_v2')\\n \\n dir_base = os.getcwd()\\n \\n dir_p2w = '/Users/throop/photos/Trips/'\\n \\n dirs = sorted(glob.glob(os.path.join(dir_base, '*')))\\n \\n quality_out = '60'\\n size_out = '2000x2000'\\n \\n for i,dir in enumerate(dirs):\\n if os.path.isdir(dir):\\n os.chdir(dir)\\n dir_originals = os.path.join(dir, 'originals')\\n dir_originals_fullres = os.path.join(dir, 'originals_fullres')\\n\\n# For HH files, copy the 'actual' originals into a 'fullres' folder, for safekeeping\\n\\n if not os.path.isdir(dir_originals_fullres):\\n os.rename(dir_originals, dir_originals_fullres)\\n os.mkdir(dir_originals)\\n \\n files = glob.glob(os.path.join(dir_originals_fullres, '*'))\\n\\n# Get a list of all the images\\n\\n# For each image, make a low-res, low-quality image. This is just because the scanned files\\n# are huge and high-quality, and not useful for online. They are much larger than necessary. \\n# So we use 'convert' to shrink them in size and quality, and put the output into 'originals' directory \\n# for photo2web.\\n\\n for file in files:\\n file_short = os.path.basename(file)\\n file_in = os.path.join(dir_originals_fullres,file_short)\\n file_out = os.path.join(dir_originals,file_short)\\n if not os.path.isfile(file_out):\\n cmd = (f'convert -resize {size_out} -quality {quality_out}' +\\n f' {file_in}' +\\n f' {file_out}')\\n print(f'{cmd}')\\n \\n subprocess.run(['convert', '-resize', size_out, '-quality', quality_out,\\n file_in,\\n file_out])\\n\\n# Now, finally, go thru and do photo2web on all of them.\\n \\n print(f'\\\\nProcessing directory {i}/{len(dirs)} {dir}\\\\n')\\n subprocess.run(['cp', '-r', os.path.join(dir_p2w, 'header.txt'), '.'])\\n subprocess.run(['cp', '-r', os.path.join(dir_p2w, 'photos.css'), '.'])\\n if not os.path.exists('captions.txt'):\\n subprocess.run(['captions_photo2web']) \\n subprocess.run(['photo2web_old'])\\n subprocess.run(['photo2web'])\",\n \"def config_copy(ipydir, profile):\\n for fpath in profile_files(profile):\\n filename = osp.basename(fpath)\\n dest_file = osp.join(ipydir, 'profile_' + profile, 'startup',\\n filename)\\n shutil.copy(fpath, dest_file)\\n logger.info(\\\"Copy files '%s' for profile '%s'.\\\",\\n osp.basename(filename), profile)\",\n \"def main():\\n # Parameters\\n opt = get_args()\\n\\n assert os.path.exists(opt.path_video), \\\"Video file does not exist\\\"\\n try:\\n os.makedirs(opt.path_images)\\n except Exception:\\n print(\\\"Folder already exists. Overwriting it\\\")\\n pass\\n\\n assert opt.size is None or opt.size is not None and len(opt.size) <= 2, \\\"Make sure the size indicated contains at maximum two numbers [none, max_dimension or width and height]\\\"\\n\\n # Get base path\\n base_path = os.path.join(opt.path_images, opt.basename)\\n\\n # Load video from file\\n try:\\n cap = cv2.VideoCapture(opt.path_video)\\n except Exception as e:\\n print('Video failed to be loaded:', e)\\n sys.exit(0)\\n\\n # Parse video\\n parse_video(cap, base_path, opt.step, opt.size)\\n\\n # Release capture\\n cap.release()\\n cv2.destroyAllWindows()\\n \\n return 0\",\n \"def main():\\n\\n # Just grab all files - we'll use try/except to filter\\n images = glob.glob(os.path.join(args.input_dir, '*.*'))\\n if not os.path.exists(args.output_dir):\\n os.makedirs(args.output_dir)\\n for img_file in images:\\n print(img_file)\\n try:\\n np_img = plt.imread(img_file)\\n print(np_img.shape)\\n img_name = img_file.split(os.sep)[-1]\\n new_img_file = os.path.join(args.output_dir, img_name)\\n pad_image(np_img, new_img_file)\\n except Exception as e:\\n print('Warning: {}. Skpping file.'.format(e))\\n continue\",\n \"def generate_thumbnail(self, img_path):\\n\\n thumb_path = self.thumbnail_path(img_path)\\n dirpath = os.path.dirname(thumb_path)\\n try:\\n os.makedirs(dirpath)\\n except OSError: # path exists\\n pass\\n\\n cmd = [\\n '/usr/local/bin/gm',\\n 'convert',\\n '-thumbnail', '256x256>',\\n '-background', 'transparent',\\n '-gravity', 'center',\\n '-extent', '256x256',\\n img_path, thumb_path\\n ]\\n\\n retcode = subprocess.call(cmd)\\n\\n if retcode:\\n log.error('convert exited with %d : %s', retcode, img_path)\\n return False\\n\\n log.debug('Wrote thumbnail for `%s` to `%s`.', img_path, thumb_path)\\n\\n return True\",\n \"def take_door_photo():\\n\\n # based on lukec's code in VHS.pm\\n config = yaml.load(file('/etc/vhs.yaml'))\\n short_hash = hashlib.sha256(str(datetime.datetime.now())).hexdigest()[0:6]\\n pic_base = config.get('picture_base')\\n if pic_base:\\n filename = os.path.join(pic_base, '%s.jpeg' % short_hash)\\n os.system('streamer -c /dev/video0 -b 16 -o %s >/dev/null 2>&1' % filename)\\n short_file = os.path.splitext(filename)[0] + '.jpg'\\n os.rename(filename, short_file)\\n pic_uri_base = config.get('picture_uri_base') \\n if pic_uri_base and os.path.exists(short_file):\\n pic_uri = '%s/%s' % (pic_uri_base, os.path.basename(short_file))\\n return (pic_uri, short_file)\\n\\n return None\",\n \"def main(input):\\n path = os.path.abspath(input)\\n name = os.path.splitext(os.path.basename(path))[0]\\n p = os.path.join(os.getcwd(),name)\\n i = 1\\n p1 = p\\n while os.path.exists(p1):\\n p1 = \\\"{p}-{i}\\\".format(p=p,i=i)\\n i += 1\\n p = p1\\n os.mkdir(p1)\\n os.mkdir(os.path.join(p1,\\\"media\\\"))\\n with zipfile.ZipFile(path) as zf:\\n for file in zf.namelist():\\n # Path traversal defense copied from\\n # http://hg.python.org/cpython/file/tip/Lib/http/server.py#l789\\n words = file.split('/')\\n dest = os.path.join(p1, \\\"media\\\")\\n if words[0] == \\\"word\\\" and words[1] == \\\"media\\\":\\n for word in words[2:]:\\n while True:\\n drive, word = os.path.splitdrive(word)\\n head, word = os.path.split(word)\\n if not drive:\\n break\\n if word in (os.curdir, os.pardir, ''):\\n continue\\n dest = os.path.join(dest, word)\\n click.echo(\\\"{} -> {}\\\".format(file, dest))\\n of = open(dest, 'wb')\\n of.write(zf.read(file))\\n of.close()\\n\\n newdoc = os.path.join(p1, os.path.basename(path))\\n lyxfile = os.path.join(p1, name + \\\".lyx\\\")\\n texfile = os.path.join(p1, name + \\\".tex\\\")\\n shutil.copyfile(path, newdoc)\\n os.system(\\\"pandoc -s -f docx -t latex -o '{of}' '{i}'\\\".format(of=texfile, i=newdoc))\\n os.system(\\\"tex2lyx '{i}' '{o}'\\\".format(i=texfile, o=lyxfile))\\n os.remove(texfile)\\n os.system(\\\"convertwmf {dir}\\\".format(dir=os.path.join(p1, \\\"media\\\")))\\n click.echo(lyxfile)\",\n \"def make_video(data,\\n xdim, ydim, sample_read_rows, sample_read_cols, image_write_rows, image_write_cols,\\n directory, filename, fps = 24.0, start_frame = 1, end_frame = None, timestamp = False, fontsize = 30, ts_pos = (0,0), save_raw = False):\\n\\n #Command to send via the command prompt which specifies the pipe parameters\\n # command = ['ffmpeg',\\n # '-y', # (optional) overwrite output file if it exists\\n # '-f', 'image2pipe',\\n # '-vcodec', 'mjpeg', #'mjpeg',\\n # '-r', '1',\\n # '-r', str(fps), # frames per second\\n # '-i', '-', # The input comes from a pipe\\n # '-an', # Tells FFMPEG not to expect any audio\\n # '-vcodec', 'mpeg4',\\n # '-b:v', '5000k',\\n # directory + filename + \\\"/\\\"+filename+\\\".mp4\\\",\\n # '-hide_banner',\\n # '-loglevel', 'panic']\\n\\n # Create directories if they don't exist\\n if not os.path.exists(os.path.join(directory, filename, 'frames/')):\\n os.makedirs(os.path.join(directory, filename, 'frames/'))\\n if save_raw and not os.path.exists(os.path.join(directory, filename, 'frames-raw/')):\\n os.makedirs(os.path.join(directory, filename, 'frames-raw/'))\\n\\n if end_frame == None:\\n end_frame = data.FrameCount\\n\\n cm = colormap.get_cmap('viridis')\\n\\n for i, frame_offset in enumerate(tqdm.tqdm(range(start_frame, end_frame))):\\n frame = FrameRead(data, frame_offset)\\n frame_image = np.zeros([ydim, xdim], dtype=np.uint8)\\n frame_image[image_write_rows, image_write_cols] = frame.frame_data[sample_read_rows, sample_read_cols]\\n\\n rgb_im = Image.fromarray(cm(frame_image, bytes=True)).convert('RGB')\\n rgb_im.save(os.path.join(directory, filename, 'frames/', f'{i}.jpg'), 'JPEG')\\n\\n if save_raw:\\n Image.fromarray(np.uint8(frame.frame_data), mode='L').save(os.path.join(directory, filename, 'frames-raw/', f'{i}.jpg'), 'JPEG')\",\n \"def genThumbnail(filename,thumbnailType,config,regen=False):\\n # define the sizes of the various thumbnails\\n thumbnailTypeDefinitions={\\n 's': (75,75), #should be square eventually\\n 'q': (150,150), #should be square eventually\\n 't': (100,100),\\n 'm': (240,240),\\n 'n': (320,230),\\n 'k': (500,500),\\n 'c': (800,800),\\n 'b': (1024,1024)}\\n size = thumbnailTypeDefinitions[thumbnailType]\\n thumbFilename = filename.split('.')[0] + '_' + thumbnailType + '.' + filename.split('.')[1]\\n if os.path.isfile(config['LOCALARCHIVEPATH']+'/'+thumbFilename) and regen == False:\\n return(thumbFilename)\\n else:\\n try:\\n logger.info('Generating thumbnail: %s' %(config['LOCALARCHIVEPATH']+'/'+thumbFilename))\\n img = Image.open(config['LOCALARCHIVEPATH']+'/'+filename)\\n icc_profile = img.info.get('icc_profile')\\n img.thumbnail(size,Image.ANTIALIAS)\\n img.save(config['LOCALARCHIVEPATH']+'/'+thumbFilename, 'JPEG', icc_profile=icc_profile, quality=95)\\n return(thumbFilename)\\n except IOError as e:\\n raise e\",\n \"def add_media(file, mode, gui_instance=None):\\r\\n\\r\\n global option # Using the global variable that specifies user choice (typically \\\"Yes\\\" or \\\"No\\\" choices)\\r\\n global config_var # Using the global variable that reads and modifies the configuration file\\r\\n\\r\\n basename_file = os.path.basename(file)\\r\\n\\r\\n # Checking if the specified file is a valid media file\\r\\n if basename_file.endswith('.mp3') or basename_file.endswith('.wav'):\\r\\n assumed_artist = \\\"\\\" # This variable will store the artist of the media\\r\\n\\r\\n if \\\"-\\\" in basename_file:\\r\\n\\r\\n \\\"\\\"\\\" \\r\\n Usually, media files use a '-' character to split the title of the media and the artist.\\r\\n This algorithm will attempt to automatically 'guess' the title and artist of the media if this\\r\\n character is present.\\r\\n \\\"\\\"\\\"\\r\\n\\r\\n # If there is a whitespace before the '-' character, we remove it\\r\\n if basename_file.split(\\\"-\\\")[0].endswith(\\\" \\\"):\\r\\n assumed_artist = basename_file.split(\\\"-\\\")[0][:-1] # The auto-processed artist name\\r\\n else:\\r\\n assumed_artist = basename_file.split(\\\"-\\\")[0]\\r\\n\\r\\n if file.split(\\\"-\\\")[1].startswith(\\\" \\\"): # If there is a whitespace after the '-' character, we remove it\\r\\n assumed_title = basename_file.split(\\\"-\\\")[1][1:-4] # The auto-processed media title\\r\\n else:\\r\\n assumed_title = basename_file.split(\\\"-\\\")[1][:-4]\\r\\n\\r\\n else: # If no \\\"-\\\" character is present in the title of the file, assuming the title is the name of the file\\r\\n assumed_title = os.path.splitext(basename_file)[0]\\r\\n\\r\\n if config_var['RUN-MODE']['run_mode'] == \\\"2\\\": # Debugging mode\\r\\n print(\\\"\\\\nAssumed title: \\\" + assumed_title)\\r\\n print(\\\"Assumed artist: \\\" + assumed_artist)\\r\\n\\r\\n if not mode: # The user is attempting to add media files from another directory\\r\\n try:\\r\\n shutil.copy2(file, media_folder) # Copying the source file to the media folder\\r\\n\\r\\n except PermissionError: # Application does not have permission to write in the media folder\\r\\n # Application is running in GUI-mode\\r\\n if gui_instance is not None:\\r\\n messagebox.showerror(\\\"Unable to copy file\\\", \\\"Unable to copy file to media folder. Make sure you \\\"\\r\\n \\\"haven't selected a write-protected folder.\\\")\\r\\n\\r\\n # Application is running in CLI or debugging mode\\r\\n if config_var['RUN-MODE']['run_mode'] == \\\"1\\\" or config_var['RUN-MODE']['run_mode'] == \\\"2\\\":\\r\\n print(\\\"\\\\nError: Unable to copy file to media folder. Make sure you haven't selected a \\\"\\r\\n \\\"write-protected folder.\\\")\\r\\n\\r\\n return False\\r\\n\\r\\n # Updating the database\\r\\n cursor = connection.cursor()\\r\\n\\r\\n # Getting the full path of the file (using an app-level convention for slashes)\\r\\n full_path = os.path.join(media_folder, os.path.basename(file)).replace(\\\"\\\\\\\\\\\", \\\"/\\\")\\r\\n\\r\\n cursor.execute(\\\"SELECT COUNT(1) FROM media WHERE full_path = \\\\\\\"\\\" + full_path + \\\"\\\\\\\"\\\")\\r\\n result = int(str(cursor.fetchone())[1])\\r\\n\\r\\n if not result: # The selected file is not present in the database\\r\\n sql_command = ''' INSERT INTO media(title, artist, album, release_date, tags, full_path)\\r\\n VALUES (?, ?, ?, ?, ?, ?) '''\\r\\n\\r\\n values = (assumed_title, assumed_artist, '', '', '', full_path)\\r\\n\\r\\n try: # Attempting to add the media file to the database\\r\\n cursor.execute(sql_command, values)\\r\\n\\r\\n connection.commit()\\r\\n\\r\\n except Error: # Database is locked\\r\\n # Application is running in GUI-mode\\r\\n if gui_instance is not None:\\r\\n messagebox.showerror(\\\"Database is locked\\\", \\\"Error when trying to commit changes to database. Make \\\"\\r\\n \\\"sure another application is not using the database.\\\")\\r\\n\\r\\n # Application is running in CLI or debugging mode\\r\\n if config_var['RUN-MODE']['run_mode'] == \\\"1\\\" or config_var['RUN-MODE']['run_mode'] == \\\"2\\\":\\r\\n print(\\\"\\\\nError when trying to commit changes to database. Make sure another application is not \\\"\\r\\n \\\"using the database.\\\")\\r\\n\\r\\n return False\\r\\n\\r\\n if gui_instance is not None: # The method has been fired by a GUI widget\\r\\n gui_instance.display_media() # Updating the media list\\r\\n\\r\\n else: # The method has been fired by using CLI\\r\\n cursor.execute(\\\"SELECT id FROM media WHERE full_path = \\\\\\\"\\\" + full_path + \\\"\\\\\\\"\\\")\\r\\n new_id = cursor.fetchone()\\r\\n\\r\\n print(\\\"\\\\nThe song was added successfully!\\\\n\\\\nThe ID of the song is: \\\" + str(new_id[0]) +\\r\\n \\\"\\\\nDo you want to configure the song metadata now? (Y/N)\\\")\\r\\n\\r\\n option = input() # Getting user response\\r\\n if option.lower() == \\\"y\\\": # The user has responded affirmatively\\r\\n SongStorageCLI.configure_media(full_path)\\r\\n\\r\\n else: # The user has responded negatively\\r\\n print(\\\"\\\\nThe auto-processing tool assumed that the name of the song is \\\\\\\"\\\" + assumed_title + \\\"\\\\\\\" \\\" +\\r\\n \\\"and that the name of the artist is \\\\\\\"\\\" + assumed_artist + \\\"\\\\\\\".\\\\nYou can always change \\\" +\\r\\n \\\"these values, as well as other metadata information, by using the \\\\\\\"Modify_data \\\" +\\r\\n str(new_id[0]) + \\\"\\\\\\\" command.\\\")\\r\\n return\\r\\n\\r\\n else: # The selected file already exists in the database; letting the user know\\r\\n if gui_instance is not None: # The method has been fired by a GUI widget\\r\\n messagebox.showinfo(\\\"Media file already exists\\\",\\r\\n \\\"The selected file already exists in the media folder.\\\")\\r\\n\\r\\n else: # The method has been fired by using CLI\\r\\n print(\\\"There is already a song with this name in the media folder!\\\")\\r\\n\\r\\n return False\\r\\n\\r\\n if config_var['RUN-MODE']['run_mode'] == \\\"2\\\": # Debugging mode\\r\\n print(\\\"\\\\nMedia file has been added successfully.\\\")\\r\\n\\r\\n return True\",\n \"def copy_database(path_images, path_labels, path_final_images):\\n\\n try:\\n labels = sorted(os.listdir(path_labels))\\n except FileNotFoudError:\\n print(\\\"No such file or directory \\\", path_labels)\\n\\n try:\\n images = sorted(os.listdir(path_images)) #+ \\\"RetinaNet_I04590/\\\"))\\n except FileNotFoudError:\\n print(\\\"No such file or directory \\\", path_images)\\n\\n \\\"\\\"\\\"if not os.path.exists(path_final_images + \\\"I04590/\\\"):\\n os.mkdir(path_final_images + \\\"I04590/\\\")\\n\\n if not os.path.exists(path_final_images + \\\"I045135/\\\"):\\n os.mkdir(path_final_images + \\\"I045135/\\\")\\n\\n if not os.path.exists(path_final_images + \\\"I090135/\\\"):\\n os.mkdir(path_final_images + \\\"I090135/\\\")\\n\\n if not os.path.exists(path_final_images + \\\"I4590135/\\\"):\\n os.mkdir(path_final_images + \\\"I4590135/\\\")\\n\\n if not os.path.exists(path_final_images + \\\"Params/\\\"):\\n os.mkdir(path_final_images + \\\"Params/\\\")\\n\\n if not os.path.exists(path_final_images + \\\"Pauli2/\\\"):\\n os.mkdir(path_final_images + \\\"Pauli2/\\\")\\n\\n if not os.path.exists(path_final_images + \\\"Pauli3/\\\"):\\n os.mkdir(path_final_images + \\\"Pauli3/\\\")\\n\\n if not os.path.exists(path_final_images + \\\"Stokes/\\\"):\\n os.mkdir(path_final_images + \\\"Stokes/\\\")\\n\\n if not os.path.exists(path_final_images + \\\"Rachel/\\\"):\\n os.mkdir(path_final_images + \\\"Rachel/\\\")\\n\\n if not os.path.exists(path_final_images + \\\"Rachel2/\\\"):\\n os.mkdir(path_final_images + \\\"Rachel2/\\\")\\\"\\\"\\\"\\n\\n for k in range(len(images)):\\n if str(k) + \\\".xml\\\" in labels:\\n copyfile(path_images + \\\"/\\\" + images[k],\\n path_final_images + \\\"/\\\" + images[k])\\n \\\"\\\"\\\"copyfile(path_images + \\\"RetinaNet_I04590/\\\" + str(k) + \\\".png\\\",\\n path_final_images + \\\"I04590/\\\" + str(k) + \\\".png\\\")\\n copyfile(path_images + \\\"RetinaNet_I045135/\\\" + str(k) + \\\".png\\\",\\n path_final_images + \\\"I045135/\\\" + str(k) + \\\".png\\\")\\n copyfile(path_images + \\\"RetinaNet_I090135/\\\" + str(k) + \\\".png\\\",\\n path_final_images + \\\"I090135/\\\" + str(k) + \\\".png\\\")\\n copyfile(path_images + \\\"RetinaNet_I4590135/\\\" + str(k) + \\\".png\\\",\\n path_final_images + \\\"I4590135/\\\" + str(k) + \\\".png\\\")\\n copyfile(path_images + \\\"RetinaNet_Params/\\\" + str(k) + \\\".png\\\",\\n path_final_images + \\\"Params/\\\" + str(k) + \\\".png\\\")\\n copyfile(path_images + \\\"RetinaNet_Pauli2/\\\" + str(k) + \\\".png\\\",\\n path_final_images + \\\"Pauli2/\\\" + str(k) + \\\".png\\\")\\n copyfile(path_images + \\\"RetinaNet_Pauli3/\\\" + str(k) + \\\".png\\\",\\n path_final_images + \\\"Pauli3/\\\" + str(k) + \\\".png\\\")\\n copyfile(path_images + \\\"RetinaNet_Stokes/\\\" + str(k) + \\\".png\\\",\\n path_final_images + \\\"Stokes/\\\" + str(k) + \\\".png\\\")\\n copyfile(path_images + \\\"RetinaNet_Rachel/\\\" + str(k) + \\\".png\\\",\\n path_final_images + \\\"Rachel/\\\" + str(k) + \\\".png\\\")\\n copyfile(path_images + \\\"RetinaNet_Rachel2/\\\" + str(k) + \\\".png\\\",\\n path_final_images + \\\"Rachel2/\\\" + str(k) + \\\".png\\\")\\n copyfile(path_labels + str(k) + \\\".xml\\\",\\n path_final_labels + str(k) + \\\".xml\\\")\\\"\\\"\\\"\\n print(k)\",\n \"def main():\\n parser = argparse.ArgumentParser()\\n parser.add_argument('--visualize', dest='visualize_dir', help=\\\"Path to directory to load all vizualization info from\\\")\\n parser.add_argument('--overwrite', dest='overwrite', default=False, action='store_true', help=\\\"Overwrite existing logs parts if found\\\")\\n args = parser.parse_args()\\n if not args.visualize_dir:\\n print \\\"Missing required argument, --visualize\\\"\\n exit(-1)\\n\\n dsrc_log_file = args.visualize_dir + '/dsrc.log'\\n radar_log_file = args.visualize_dir + '/radar.log'\\n video_file = args.visualize_dir + '/video.mp4'\\n log_config = args.visualize_dir + '/config.json'\\n\\n config = parse_config(log_config)\\n\\n if 'parts_auto_enabled' in config and config['parts_auto_enabled']:\\n cap = cv2.VideoCapture(video_file)\\n fps = cap.get(cv2.CAP_PROP_FPS)\\n frames = cap.get(cv2.CAP_PROP_FRAME_COUNT)\\n duration = float(frames) / fps\\n cap.release()\\n\\n print 'Video duration: %s' % duration\\n start = 0\\n count = 1\\n while start < duration:\\n config['parts'].append({\\n 'start': start,\\n 'end': start + config['parts_auto_interval'],\\n 'name': 'auto_part_%s' % count\\n })\\n count = count + 1\\n start = start + config['parts_auto_interval']\\n\\n print config \\n\\n for index, part in enumerate(config['parts']):\\n part_path = args.visualize_dir + '/' + (part['name'] if 'name' in part else 'part_%s' % (index+1))\\n print \\\"---------------------------------------\\\"\\n print \\\" Writing log to %s\\\" % part_path\\n print \\\"---------------------------------------\\\"\\n if not args.overwrite and os.path.exists(part_path):\\n print \\\"Log already exists, skipping...\\\"\\n continue\\n\\n if not os.path.exists(part_path):\\n os.makedirs(part_path)\\n\\n export_part_video(part, part_path, video_file)\\n export_part_log(part, part_path + '/radar.log', radar_log_file, config['video_start'])\\n export_part_log(part, part_path + '/dsrc.log', dsrc_log_file, config['video_start'])\\n export_part_config(part_path + '/config.json', config)\",\n \"def deploy_user_media(env=None, haus_vars={} ):\\n print green('Deploying user media')\\n with cd(\\\"/var/www\\\"):\\n run('./manage.py sync_media_s3 --prefix=uploads')\",\n \"def get_thumbnail_path(examfile):\\n h = examfile.hash\\n thumb = os.path.join(settings.MEDIA_ROOT, \\\"cache\\\", h + \\\".png\\\")\\n if os.path.exists(thumb):\\n return thumb\\n path = os.path.join(settings.MEDIA_ROOT, examfile.path.path)\\n cmd = \\\"/usr/local/bin/mudraw -o %s -h 800 -w 600 '%s' 1\\\" % (thumb, path)\\n args = shlex.split(cmd.encode(\\\"utf8\\\"))\\n mudraw = subprocess.Popen(args)\\n mudraw.wait()\\n return thumb\",\n \"def web_archive_config():\\n\\n try:\\n auth_check()\\n except Exception as e:\\n return flask.redirect(str(e))\\n\\n socket_timeout = flask.request.args.get('ytdl-socket-timeout', '120')\\n retries = flask.request.args.get('ytdl-retries', 'infinite')\\n output = flask.request.args.get('ytdl-output', '%(uploader_id)s/%(id)s.%(ext)s')\\n overwrites = flask.request.args.get('ytdl-overwrites', 'false') == 'true'\\n info_json = flask.request.args.get('ytdl-info-json', 'true') == 'true'\\n thumbnail = flask.request.args.get('ytdl-thumbnail', 'true') == 'true'\\n format = flask.request.args.get('ytdl-format', 'bestvideo[vcodec^=vp]' +\\n '+bestaudio[acodec=opus]/bestvideo+bestaudio[acodec=opus]' +\\n '/bestvideo+bestaudio/best')\\n merge_format = flask.request.args.get('ytdl-merge-format', 'mkv')\\n all_subs = flask.request.args.get('ytdl-all-subs', 'true') == 'true'\\n sub_format = flask.request.args.get('ytdl-sub-format', 'srt/best')\\n convert_subs = flask.request.args.get('ytdl-convert-subs', 'srt')\\n\\n config = io.BytesIO()\\n\\n config.write(('--socket-timeout ' + socket_timeout + '\\\\n').encode('utf-8'))\\n config.write(('--retries ' + retries + '\\\\n').encode('utf-8'))\\n config.write(('--output ' + output + '\\\\n').encode('utf-8'))\\n if not overwrites:\\n config.write('--no-overwrites\\\\n'.encode('utf-8'))\\n if info_json:\\n config.write('--write-info-json\\\\n'.encode('utf-8'))\\n if thumbnail:\\n config.write('--write-thumbnail\\\\n'.encode('utf-8'))\\n config.write(('--format ' + format + '\\\\n').encode('utf-8'))\\n config.write(('--merge-output-format ' + merge_format + '\\\\n').encode('utf-8'))\\n if all_subs:\\n config.write('--all-subs\\\\n'.encode('utf-8'))\\n config.write(('--sub-format ' + sub_format + '\\\\n').encode('utf-8'))\\n config.write(('--convert-subs ' + convert_subs + '\\\\n').encode('utf-8'))\\n\\n config.seek(0)\\n\\n return flask.Response(config,\\n mimetype = 'text/plain',\\n headers = { 'Content-Disposition': 'attachment;filename=config.txt' }\\n )\",\n \"def process_video(self, input_path, output_path, debug=False):\\n clip = VideoFileClip(input_path)\\n if debug:\\n test_clip = clip.fl_image(self.process_image_debug)\\n else:\\n test_clip = clip.fl_image(self.process_image)\\n test_clip.write_videofile(output_path)\",\n \"def copy_image_files(self) -> None:\\n if self.images:\\n if self.config.epub_fix_images or self.config.epub_max_image_width:\\n if not Image:\\n logger.warning(__('Pillow not found - copying image files'))\\n super().copy_image_files()\\n else:\\n self.copy_image_files_pil()\\n else:\\n super().copy_image_files()\",\n \"def preparation(self):\\n # [1] Makes a dir for saving results.\\n # if 'Result' dir already exists,\\n # a 'temporary' dir will be made.\\n\\n try:\\n os.mkdir(self.dir_for_saving_result)\\n except FileExistsError:\\n self.viewer.display_message(\\\"Made a temporary directory.\\\")\\n self.dir_for_saving_result = 'temporary'\\n os.mkdir('temporary')\\n\\n # [2] Copies config file into the same dir as the one where results will be stored\\n shutil.copy2(self.config_file_name, self.dir_for_saving_result)\",\n \"def make_mock_fs(self):\\n\\t\\ttemp = tempfile.mkdtemp(prefix=\\\"fpltest\\\")\\n\\t\\ttry:\\n\\t\\t\\tconfig = fplsync.Config()\\n\\t\\t\\tconfig.playlist_source = os.path.join(temp, \\\"fb2k_playlists\\\")\\n\\t\\t\\tconfig.source = os.path.join(temp, \\\"source\\\")\\n\\t\\t\\tconfig.dest = os.path.join(temp, \\\"dest\\\")\\n\\t\\t\\tconfig.playlist_dest = os.path.join(temp, \\\"playlists\\\")\\n\\t\\t\\tos.mkdir(config.source)\\n\\t\\t\\twith open(os.path.join(config.source, \\\"a.mp3\\\"), \\\"w\\\") as f:\\n\\t\\t\\t\\tprint(\\\"a\\\" * 1000, file=f, end=\\\"\\\")\\n\\t\\t\\twith open(os.path.join(config.source, \\\"b.mp3\\\"), \\\"w\\\") as f:\\n\\t\\t\\t\\tprint(\\\"b\\\" * 1000, file=f, end=\\\"\\\")\\n\\t\\t\\twith open(os.path.join(config.source, \\\"c.mp3\\\"), \\\"w\\\") as f:\\n\\t\\t\\t\\tprint(\\\"c\\\" * 1000, file=f, end=\\\"\\\")\\n\\t\\t\\tos.mkdir(config.dest)\\n\\t\\t\\tos.mkdir(config.playlist_source)\\n\\t\\t\\tos.mkdir(config.playlist_dest)\\n\\t\\t\\tyield config\\n\\t\\tfinally:\\n\\t\\t\\tshutil.rmtree(temp)\",\n \"def prepare_output_dir(out_dir, test_dir):\\r\\n\\r\\n if not out_dir.exists():\\r\\n out_dir.mkdir()\\r\\n\\r\\n # get the necessary file names\\r\\n file_names = get_file_names(test_dir, args.distance, print_file_names=False)\\r\\n\\r\\n # copy the images in the firstIms into the output folder\\r\\n for name in file_names[1][0]:\\r\\n file_path = Path(test_dir / name)\\r\\n copy_to = Path(out_dir / name)\\r\\n shutil.copy(file_path, copy_to)\\r\\n\\r\\n # the firstIms list does not contain the last image,\\r\\n # so we need to also copy the last image of the secIms into the output folder\\r\\n last_im = file_names[1][1][-1]\\r\\n shutil.copy(Path(test_dir/last_im), Path(out_dir/last_im))\\r\\n\\r\\n return file_names\",\n \"def setup_part1(args):\\n args.rootarg = args.root\\n rootext = os.path.splitext(args.rootarg)[1]\\n if rootext == '':\\n pass\\n else:\\n args.root = os.path.dirname(args.root)\\n\\n if args.root:\\n args.root = os.path.abspath(args.root)\\n if not os.path.isdir(args.root):\\n if args.gallery:\\n os.mkdir(args.root)\\n else:\\n error('Directory not found', args.root)\",\n \"def create_thumb(dirpath, imgname):\\n with open(join(dirpath, imgname), 'r+b') as f:\\n with Image.open(f) as image:\\n thumb = resizeimage.resize_width(image, 50)\\n thumbpath = join(outdir, thumbdir, imgname)\\n print(\\\"saving thumbnail to\\\", thumbpath)\\n thumb.save(thumbpath, image.format)\",\n \"def create_full(dirpath, imgname):\\n with open(join(dirpath, imgname), 'r+b') as f:\\n with Image.open(f) as image:\\n fullpicpath = join(outdir, fullpicdir, imgname)\\n print(\\\"saving full pic to\\\", fullpicpath)\\n image.save(fullpicpath, quality=75, optimize=True)\",\n \"def convert_topic_dir(full_topic_dir, full_target_dir, photo_topic):\\n warnings.simplefilter('error', Image.DecompressionBombWarning)\\n topicfiles = [f for f in listdir(full_topic_dir) if isfile(join(full_topic_dir, f))\\n and (f.lower().endswith(\\\".jpg\\\") or f.lower().endswith(\\\".jpeg\\\"))]\\n for topicfile in topicfiles:\\n fulltopicfile = join(full_topic_dir, topicfile)\\n fulltargetfile = join(full_target_dir, topicfile)\\n if not exists_and_newer(fulltargetfile, fulltopicfile):\\n print(\\\" Converting\\\", topicfile, \\\": \\\", end='')\\n try:\\n im = Image.open(fulltopicfile)\\n\\n if im._getexif() is not None:\\n exif = {\\n TAGS[k]: v\\n for k, v in im._getexif().items()\\n if k in TAGS\\n }\\n else:\\n exif = dict()\\n\\n if 'Orientation' in exif:\\n im = apply_image_rotation_by_exif(im, exif['Orientation'])\\n\\n if 'ImageDescription' in exif:\\n photo_description = exif['ImageDescription']\\n photo_description = bytes(photo_description, encoding=\\\"ansi\\\", errors=\\\"ignore\\\").decode(\\\"utf-8\\\", errors=\\\"ignore\\\") # PIL reads exif data as ansi not utf-8 strings\\n if photo_description.rstrip() == '':\\n photo_caption = photo_topic\\n else:\\n if photo_description.endswith('#'):\\n photo_caption = photo_topic + \\\" - \\\" + photo_description.rstrip('#')\\n else:\\n photo_caption = photo_description\\n else:\\n photo_caption = photo_topic\\n\\n print(photo_caption)\\n im.thumbnail(targetSize, Image.ANTIALIAS)\\n im = add_caption_to_image(im, photo_caption)\\n im.save(fulltargetfile, \\\"JPEG\\\")\\n except IOError:\\n print(\\\"cannot create target for '%s'\\\" % fulltopicfile)\\n except AttributeError:\\n print(\\\"Attribute error for '%s'\\\" % fulltopicfile)\\n else:\\n print(\\\" Skipping\\\", topicfile)\",\n \"def prepare(self, dst, options):\\n self.checkExisting(dst)\\n self.makedirs(dst.parent())\",\n \"def process_video(filename, args, cfg, net):\\n # Split video into frames\\n images = split_video(filename)\\n # Set output dir\\n output_dir = args.output\\n # Add brackets and extension to filename\\n output_path = create_video_output_path(output_dir, cfg)\\n # Get height and width of 1st image\\n height, width, _ = check_img_size(images[0]).shape\\n # Create VideoWriter object\\n video = cv2.VideoWriter(output_path, \\n cv2.VideoWriter_fourcc(*'FMP4'), \\n cfg['video']['fps'], \\n (width, height))\\n for image in images:\\n # Process frames\\n img_steps = process_image(image, cfg, net)\\n # Check for --show-detections flag\\n output_img = check_if_adding_bboxes(args, img_steps) \\n # Write to video\\n video.write(output_img) \\n # Release video writer object\\n video.release()\",\n \"def CpSrcDest( IMGFOLDER = '..\\\\\\\\Data\\\\\\\\',\\n EXTENSION = \\\".jpg\\\",\\n DESTINATION_FOLDER='..\\\\\\\\Data\\\\\\\\AllBirds\\\\\\\\'):\\n for i, imag in enumerate(BirdPhotos):\\n filename= IMGFOLDER+ imag + EXTENSION\\n cpCommand = \\\"copy \\\" + filename + \\\" \\\" + DESTINATION_FOLDER\\n os.system(cpCommand)\\n return\",\n \"def get_destination(metadata: Metadata):\\n\\n func = f\\\"{__name__}.get_destination\\\"\\n\\n metadata[\\\"destination\\\"] = metadata[\\\"full_clipname\\\"].replace(\\n f\\\"/{app.capture_folder_name}/\\\", f\\\"/{app.destination_folder_name}/\\\"\\n )\\n\\n if path.exists(metadata[\\\"destination\\\"]):\\n metadata[\\\"renamed\\\"] = \\\"True\\\"\\n print(f\\\"file exists:{metadata['destination']}\\\")\\n directory = path.dirname(metadata[\\\"destination\\\"])\\n filename = path.splitext(path.basename(metadata[\\\"destination\\\"]))[0]\\n extension = path.splitext(path.basename(metadata[\\\"destination\\\"]))[1]\\n number = 1\\n dest = path.join(directory, f\\\"{filename}-{number:0>2d}{extension}\\\")\\n metadata[\\\"destination\\\"] = dest\\n print(f\\\"Will now test with:{dest}\\\")\\n while path.exists(dest):\\n number += 1\\n dest = path.join(directory, f\\\"{filename}-{number:0>2d}{extension}\\\")\\n print(f\\\"Will now test with:{dest}\\\")\\n\\n metadata[\\\"destination\\\"] = dest\\n\\n post_event(\\n \\\"log_info\\\",\\n f\\\"{func}\\\",\\n f\\\"The destination is: {metadata['destination']} - was renamed: {metadata['renamed']}\\\",\\n )\\n\\n return metadata\",\n \"def configure_devbox():\\n\\n # Does a devbox folder already exist?\\n is_present = os.path.isdir(Settings.devbox_folder)\\n\\n # If so, alert the user and exit.\\n if is_present:\\n message1 = \\\"This folder is already initialized.\\\"\\n message2 = \\\"To re-initialize, \\\"\\n message2 += \\\"run '\\\" + Settings.program + \\\" destroy' first.\\\"\\n Utilities.log(message1)\\n Utilities.log(message2)\\n exit(1)\\n\\n # Create the config folder in the current directory.\\n Utilities.create_folder(Settings.devbox_folder)\\n\\n # Copy config files.\\n source_folder = Settings.source_config\\n dest_folder = Settings.config_folder\\n folder_copied = Utilities.copy_folder(source_folder, dest_folder)\\n\\n # Report any errors.\\n if not folder_copied:\\n Utilities.log(\\\"Could not copy config files.\\\")\\n exit(1)\\n\\n # Copy the Vagrantfile to the root of the devbox folder.\\n source_file = Settings.config_folder + \\\"/vagrant/Vagrantfile\\\"\\n dest_location = Settings.devbox_folder\\n file_copied = Utilities.copy_file(source_file, dest_location)\\n\\n # Report any errors.\\n if not file_copied:\\n Utilities.log(\\\"Could not copy Vagrantfile.\\\")\\n exit(1)\",\n \"def set(self):\\n \\n ffmpeg_installed = misc.askquestion(DialogTitle='FFMPEG Check',\\n Question='Is FFMPEG installed?')\\n \\n if ffmpeg_installed:\\n ffmpeg_dir = misc.get_dir(DialogTitle='Please select the directory where FFMPEG (binary) is installed:')\\n \\n if sys.platform=='win32':\\n self.ffmpeg = os.path.join(ffmpeg_dir, 'ffmpeg.exe')\\n self.ffplay = os.path.join(ffmpeg_dir, 'ffplay.exe')\\n else:\\n self.ffmpeg = os.path.join(ffmpeg_dir, 'ffmpeg')\\n self.ffplay = os.path.join(ffmpeg_dir, 'ffplay')\\n \\n if not os.path.exists(self.ffmpeg):\\n print('Sorry, {0} does not exist!'.format(self.ffmpeg))\\n return\\n \\n if not os.path.exists(self.ffplay):\\n print('Sorry, {0} does not exist!'.format(self.ffplay))\\n return\\n \\n else:\\n self.ffmpeg = None\\n self.ffplay = None\\n \\n # Save them to the default config file\\n info = {'ffmpeg':self.ffmpeg, 'ffplay': self.ffplay}\\n try:\\n with open(self.config_file, 'w') as outFile:\\n json.dump(info, outFile)\\n print('Config information written to {0}'.format(os.path.abspath(self.config_file)))\\n except PermissionError as e:\\n curDir = os.path.abspath(os.curdir)\\n print('Current directory: {0}'.format(curDir))\\n print('Error: {0}'.format(e))\\n \\n return\",\n \"def create_output_directory_for_resized_images():\\n\\n try:\\n if not os.path.isdir(RESIZED_NEGATIVE_PATH):\\n return os.makedirs(RESIZED_NEGATIVE_PATH)\\n elif not os.path.isdir(RESIZED_POSITIVE_PATH):\\n return os.makedirs(RESIZED_POSITIVE_PATH)\\n except OSError as e:\\n print('Error --> {}'.format(e))\",\n \"def task():\\n if os.path.isdir(orig):\\n for fP in [ fP for fP in glob.glob(os.path.join(orig, '*-*/*')) if \\\\\\n os.path.isdir(fP) ]:\\n if not os.path.exists(dest + fP[len(orig):]):\\n os.makedirs(dest + fP[len(orig):])\\n for fP in [ fP for fP in glob.glob(os.path.join(orig, '*-*/*/%s.log' %fmt.get_date())) if \\\\\\n os.path.isfile(fP) ]:\\n convert(fP, dest + fP[len(orig):])\",\n \"def init_image_info():\\n if not os.path.exists(UPLOAD_FOLDER):\\n os.makedirs(UPLOAD_FOLDER)\",\n \"def preprocess(config_path, save_dir):\\r\\n \\r\\n cfg = mmcv.Config.fromfile(config_path)\\r\\n cfg.merge_from_dict({\\r\\n 'model.test_cfg.mode': 'slide', \\r\\n 'model.test_cfg.crop_size': (512, 512), \\r\\n 'model.test_cfg.stride': (384, 384)\\r\\n })\\r\\n\\r\\n # build the dataloader\\r\\n dataset = build_dataset(cfg.data.test)\\r\\n data_loader = build_dataloader(\\r\\n dataset,\\r\\n samples_per_gpu=1,\\r\\n workers_per_gpu=cfg.data.workers_per_gpu,\\r\\n dist=False,\\r\\n shuffle=False)\\r\\n\\r\\n # slide window and crop image\\r\\n cnt = 0\\r\\n for data in tqdm.tqdm(data_loader, desc=\\\"Processing\\\"):\\r\\n img = data['img'][0]\\r\\n img_meta = data['img_metas'][0].data[0]\\r\\n cnt += slide_crop(img, img_meta, cfg.model, save_dir)\\r\\n print(f'Preprocess finished, {cnt} binary files generated.')\",\n \"def raw(self, out, config, size, **filters):\\r\\n with vm2vm.raw.RawImage(out, \\\"w\\\") as img:\\r\\n img.mkfs(size)\\r\\n with vm2vm.raw.Mountpoint(img.name) as mnt:\\r\\n self.copy(dest=mnt, config=config, **filters)\",\n \"def make(config):\\n # Create child folders\\n for func in (create_basic_structure,\\n copy_resources,\\n copy_databases,\\n copy_libraries,\\n copy_security,\\n copy_app_actions,\\n copy_pages,\\n create_application_info_file,\\n replace_all_guids):\\n\\n INFO(\\\"\\\")\\n INFO(\\\"+\\\"*70)\\n INFO(\\\"\\\")\\n func(config)\",\n \"def generate_video_from_frames(path_to_frames, title):\\r\\n mean_height = 0\\r\\n mean_width = 0\\r\\n num_of_images = load_one_setting(settings_filename, 'MAX_CYCLES')\\r\\n os.chdir(path_to_frames)\\r\\n '''Loading all frames'''\\r\\n for file in os.listdir('.'):\\r\\n if file.endswith(\\\".jpg\\\") or file.endswith(\\\".jpeg\\\") or file.endswith(\\\"png\\\") or file.endswith(\\\"JPEG\\\"):\\r\\n im = Image.open(file)\\r\\n width, height = im.size\\r\\n mean_width += width\\r\\n mean_height += height\\r\\n\\r\\n mean_width = int(mean_width / num_of_images)\\r\\n mean_height = int(mean_height / num_of_images)\\r\\n\\r\\n for file in os.listdir('.'):\\r\\n if file.endswith(\\\".jpg\\\") or file.endswith(\\\".jpeg\\\") or file.endswith(\\\"png\\\") or file.endswith(\\\"JPEG\\\"):\\r\\n im = Image.open(file)\\r\\n imResize = im.resize((mean_width, mean_height), Image.ANTIALIAS)\\r\\n imResize.save(file, 'JPEG', quality=95)\\r\\n release_video(title)\\r\\n os.chdir(r'../..')\",\n \"def main(argv):\\n args = parse_command_line(argv)\\n return convert_chunks_to_jpeg(args.raw_chunks_dir,\\n jpeg_quality=args.jpeg_quality,\\n slicing_plane=args.slicing_plane) or 0\",\n \"def create_links(list_of_paths, dest_dir, print_cfg_ipol=False):\\n ms = False\\n for i, f in enumerate(list_of_paths):\\n\\n if isinstance(f, tuple): # we have the ms image\\n # tif ms\\n ms = True\\n symlink_p(f[1], os.path.join(dest_dir, 'im_ms_%02d.tif' % (i+1)))\\n\\n # preview ms\\n tmp = copy_file_matching_pathname('PREVIEW_*.JPG', os.path.dirname(f[1]), dest_dir)\\n if tmp:\\n symlink_p(tmp, os.path.join(dest_dir, 'prv_%02d.jpg' % (i+1)))\\n # enhance contrast\\n # os.system(\\\"/home/carlo/code/s2p/bin/qauto %s %s\\\" % (tmp, tmp)\\n else:\\n print('MS PREVIEW not found for %s' % f[1], file=sys.stderr)\\n f = f[0] # the path to ms preview is not needed anymore\\n\\n # pan preview (if no ms preview)\\n if not os.path.isfile(os.path.join(dest_dir, 'prv_%02d.jpg' % (i+1))):\\n tmp = copy_file_matching_pathname('PREVIEW_*.JPG', os.path.dirname(f), dest_dir)\\n if tmp:\\n symlink_p(tmp, os.path.join(dest_dir, 'prv_%02d.jpg' % (i+1)))\\n # os.system(\\\"/home/carlo/code/s2p/bin/qauto %s %s\\\" % (tmp, tmp))\\n else:\\n print('PAN PREVIEW not found for %s' % f, file=sys.stderr)\\n\\n # dim\\n tmp = copy_file_matching_pathname('DIM_*.XML', os.path.dirname(f), dest_dir)\\n if tmp:\\n symlink_p(tmp, os.path.join(dest_dir, 'dim_%02d.xml' % (i+1)))\\n\\n # rpc\\n tmp = copy_file_matching_pathname('RPC_*.XML', os.path.dirname(f), dest_dir)\\n if tmp:\\n symlink_p(tmp, os.path.join(dest_dir, 'rpc_%02d.xml' % (i+1)))\\n\\n # tif panchro\\n symlink_p(f, os.path.join(dest_dir, 'im_panchro_%02d.tif' % (i+1)))\\n\\n # dzi 8 bits\\n dzi8_found = False\\n dzi8 = '%s_8BITS.dzi' % f[:-8] # remove extension '.JP2.TIF' (8 chars)\\n files8 = '%s_8BITS_files' % f[:-8]\\n if os.path.isfile(dzi8) and os.path.isdir(files8):\\n symlink_p(dzi8, os.path.join(dest_dir, 'im_panchro_8BITS_%02d.dzi' % (i+1)))\\n symlink_p(files8, os.path.join(dest_dir, 'im_panchro_8BITS_%02d_files' % (i+1)))\\n dzi8_found = True\\n\\n # dzi 16 bits\\n dzi16_found = False\\n dzi16 = '%s_16BITS.dzi' % f[:-8] # remove extension '.JP2.TIF' (8 chars)\\n files16 = '%s_16BITS_files' % f[:-8]\\n if os.path.isfile(dzi16) and os.path.isdir(files16):\\n symlink_p(dzi16, os.path.join(dest_dir, 'im_panchro_16BITS_%02d.dzi' % (i+1)))\\n symlink_p(files16, os.path.join(dest_dir, 'im_panchro_16BITS_%02d_files' % (i+1)))\\n dzi16_found = True\\n\\n # print warning if neither 8bit nor 16bit dzi was found\\n if (not dzi8_found) and (not dzi16_found):\\n print('WARNING: no dzi file found for img %s' % f, file=sys.stderr)\\n\\n if print_cfg_ipol:\\n print_cfg.main(dest_dir, len(list_of_paths), ms)\",\n \"def generate_clips(input_dir, output_dir, duration=20, ext='.mkv'):\\n \\n i = [0,0,0,0]\\n \\n output_dirs = [os.path.join(output_dir, 'goals'),\\n os.path.join(output_dir, 'bg'),\\n os.path.join(output_dir, 'cards'),\\n os.path.join(output_dir, 'subs')]\\n\\n for dir in output_dirs:\\n if not os.path.exists(dir):\\n os.mkdir(dir)\\n print('Made directory ' + dir)\\n \\n \\n for path in input_dir:\\n print(path)\\n \\n with open(os.path.join(path, 'Labels.json')) as f:\\n file = json.load(f)\\n labels = parseLabels(file)\\n \\n # for each item in label, crop a specified length and save to output_dir\\n for timestamp, label in labels:\\n half = timestamp[0]\\n time = timestamp[1]\\n vid_name = os.path.join(path, half + ext)\\n\\n if time - 5 > 0:\\n\\n if label == 'soccer-ball':\\n # collect an instance of a goal\\n clip_video(vid_name, time - 5, duration, i[0], output_dirs[0])\\n i[0] += 1\\n\\n # collect an instance of a non-goal, if it does not overlap with another event\\n if event_overlap(labels, half, time - 45, duration) == False and time - 45 > 0:\\n clip_video(vid_name, time - 45, duration, i[1], output_dirs[1])\\n i[1] += 1\\n\\n elif 'card' in label:\\n # collect an instance of a carding event\\n clip_video(vid_name, time - 4, duration, i[2], output_dirs[2])\\n i[2] += 1\\n\\n if event_overlap(labels, half, time - 45, duration) == False and time - 45 > 0:\\n clip_video(vid_name, time - 45, duration, i[1], output_dirs[1])\\n i[1] += 1\\n\\n\\n elif 'substitution' in label:\\n # collect an instance of a carding event\\n clip_video(vid_name, time - 4, duration, i[3], output_dirs[3])\\n i[3] += 1\\n\\n if event_overlap(labels, half, time - 45, duration) == False and time - 45 > 0:\\n clip_video(vid_name, time - 45, duration, i[1], output_dirs[1])\\n i[1] += 1\\n\\n print('Saved clip from ' + path)\",\n \"def _prepare(self):\\n logging.info('-> copy configuration...')\\n path_cofig = self.params['path_config_bUnwarpJ']\\n shutil.copy(path_cofig, os.path.join(self.params['path_exp'],\\n os.path.basename(path_cofig)))\\n if 'path_config_IJ_SIFT' in self.params:\\n path_cofig = self.params['path_config_IJ_SIFT']\\n shutil.copy(path_cofig, os.path.join(self.params['path_exp'],\\n os.path.basename(path_cofig)))\\n if 'path_config_IJ_MOPS' in self.params:\\n path_cofig = self.params['path_config_IJ_MOPS']\\n shutil.copy(path_cofig, os.path.join(self.params['path_exp'],\\n os.path.basename(path_cofig)))\",\n \"def thumbnail_path(instance, filename):\\n\\n username = instance.user.username\\n mainpath = os.path.join(\\\"infocomp\\\",username,\\\"thumbnails\\\",filename)\\n return mainpath\",\n \"def __main__() :\\n try :\\n poly = Polyhedre(sys.argv[1])\\n \\n name = sys.argv[2]\\n \\n createAllFiles(poly, name)\\n\\n createAllImageFiles(poly, name)\\n \\n except FileNotFoundError :\\n print(\\\"Use an existing file\\\")\",\n \"def mix_audio_and_video(self):\\n\\t\\tself._logger.info('Starting ffmpeg...')\\n\\t\\tsp.run('ffmpeg -v 0 -i {0} -i {1} -c:v copy '\\n\\t\\t '-c:a aac -strict experimental {2}'\\n\\t\\t .format(self.TEMP_FOLDER + self._video_manager.output_file_name,\\n\\t\\t self.TEMP_FOLDER + self._audio_manager.output_file_name,\\n\\t\\t self.SAVE_FOLDER + self._video_manager.output_file_name))\\n\\t\\tself._logger.info('Save done. Output file: {}'\\n\\t\\t .format(self._video_manager.output_file_name))\\n\\t\\tself._logger.info('Cleaning the temp folder...')\\n\\t\\tfor file in glob.glob(self.TEMP_FOLDER + '*'):\\n\\t\\t\\tos.remove(file)\",\n \"def take_snapshot(self, path, file_name):\\n pipelie_state = self.player.get_state(1)\\n p_state = pipelie_state.state\\n if p_state not in (Gst.State.PLAYING, Gst.State.PAUSED):\\n print(\\\"Stream is not ready\\\")\\n else:\\n try:\\n sink = self.player.get_by_name('sink')\\n sample = GstBase.BaseSink.get_last_sample(sink)\\n image_buffer = Gst.Sample.get_buffer(sample)\\n buffer_map = Gst.Buffer.map(image_buffer, Gst.MapFlags.READ)\\n image_binary_data = bytearray(buffer_map.info.data)\\n utils.store_image(image_binary_data, path, file_name + \\\".jpeg\\\")\\n except:\\n print(\\\"Capturing image failed.\\\")\",\n \"def main(raw_dir,save_dir,ext,target_size):\\r\\n try:\\r\\n msg = \\\"--target-size must be a tuple of 2 integers\\\"\\r\\n assert isinstance(target_size, tuple) and len(target_size) == 2, msg\\r\\n fnames = glob.glob(os.path.join(raw_dir, \\\"*.{}\\\".format(ext)))\\r\\n os.makedirs(save_dir, exist_ok=True)\\r\\n print(\\\"{} files to resize from directory `{}` to target size:{}\\\".format(len(fnames), raw_dir, target_size))\\r\\n for i, fname in enumerate(fnames):\\r\\n print(\\\".\\\", end=\\\"\\\", flush=True)\\r\\n img = cv2.imread(fname)\\r\\n img_small = cv2.resize(img, target_size)\\r\\n new_fname = \\\"{}.{}\\\".format(str(i), ext)\\r\\n small_fname = os.path.join(save_dir, new_fname)\\r\\n cv2.imwrite(small_fname, img_small)\\r\\n print(\\\"\\\\nDone resizing {} files.\\\\nSaved to directory: `{}`\\\".format(len(fnames), save_dir))\\r\\n except Exception as ex:\\r\\n print('Exception:',ex)\",\n \"def main():\\n global MASK\\n start_time = time()\\n parser = initArgparse()\\n args = parser.parse_args()\\n dirtree = args.directorytree\\n filetree = args.filetree\\n meta = args.metadata\\n newmeta = args.newmetadata\\n sfv = args.sfv\\n yes = args.yes\\n MASK = args.exclude\\n\\n for i in args.DIRECTORY:\\n if Path(i).exists() is True:\\n basepath = Path(i)\\n else:\\n raise NotADirectoryError(f\\\"{i} does not exist\\\")\\n default = False\\n if dirtree == sfv == filetree == meta == newmeta is False:\\n default = True\\n if dirtree is True or default is True:\\n dirtree_file = f\\\"{basepath.name}_directory_tree.txt\\\"\\n checkFileExists(basepath, dirtree_file, yes)\\n createDirectoryTree(basepath, dirtree_file)\\n if sfv is True or default is True:\\n sfv_file = f\\\"{basepath.name}.sfv\\\"\\n checkFileExists(basepath, sfv_file, yes)\\n createSfv(basepath, sfv_file)\\n if filetree is True or default is True:\\n csvtree_file = f\\\"{basepath.name}_file_tree.csv\\\"\\n jsontree_file = f\\\"{basepath.name}_file_tree.json\\\"\\n checkFileExists(basepath, jsontree_file, yes)\\n checkFileExists(basepath, csvtree_file, yes)\\n createFileTree(basepath, jsontree_file, csvtree_file)\\n if meta is True or default is True:\\n metadata_file = f\\\"{basepath.name}_metadata.json\\\"\\n checkFileExists(basepath, metadata_file, yes)\\n createMetadata(basepath, metadata_file)\\n if newmeta is True:\\n createNewMetadata(basepath)\\n filesCache.cache_clear()\\n getFileInfo.cache_clear()\\n killTika()\\n\\n stop_time = time()\\n print(f\\\"Finished in {round(stop_time-start_time, 2)} seconds\\\")\",\n \"def _queue_photos(self):\\n global filtering_queue\\n global number_of_pictures\\n\\n number_of_pictures = 0\\n\\n for root, dirs, files in walk(curdir):\\n for file in files:\\n if dirs == \\\"thumb\\\" or dirs == \\\"filtered\\\":\\n pass\\n else:\\n file_path = join(root, file)\\n filtering_data = [file_path, curdir]\\n filtering_queue.put(filtering_data)\\n number_of_pictures += 1\\n print(\\\"Queued:\\\", file_path)\\n\\n try:\\n mkdir(join(curdir, \\\"thumb\\\"))\\n except FileExistsError:\\n pass\\n try:\\n mkdir(join(curdir, \\\"thumb\\\", \\\"Alexander\\\"))\\n except FileExistsError:\\n pass\\n try:\\n mkdir(join(curdir, \\\"thumb\\\", \\\"Bjarke\\\"))\\n except FileExistsError:\\n pass\\n try:\\n mkdir(join(curdir, \\\"thumb\\\", \\\"Gabrielle\\\"))\\n except FileExistsError:\\n pass\\n try:\\n mkdir(join(curdir, \\\"thumb\\\", \\\"Monica\\\"))\\n except FileExistsError:\\n pass\\n try:\\n mkdir(join(curdir, \\\"thumb\\\", \\\"Wenche\\\"))\\n except FileExistsError:\\n pass\\n try:\\n mkdir(join(curdir, \\\"filtered\\\"))\\n except FileExistsError:\\n pass\",\n \"def extract_frames_from_directory(count, source, destination):\\n all_videos = os.listdir(source)\\n print(all_videos)\\n\\n for video in all_videos:\\n video_file = source + video # Retrieve a video from the OverHeadPress\\n cap = cv2.VideoCapture(video_file) # capturing the video from the given path\\n dim = (224, 224)\\n\\n while cap.isOpened():\\n frame_id = cap.get(1) # current frame number\\n ret, frame = cap.read()\\n if not ret:\\n break\\n\\n # We are capturing at 28 frames per second. \\n # If we want to capture every 0.2 seconds we will take every 5 frames\\n if frame_id % 8 == 0:\\n filename =\\\"frame%d.jpg\\\" % count\\n count+=1\\n resized = cv2.resize(frame, dim)\\n cv2.imwrite(destination + filename, resized)\\n\\n cap.release()\\n print (\\\"Finished processing: \\\" + video + \\\". Ended at video: \\\" + str(count))\",\n \"def moveFiles(rootDir):\\n\\n homedir = os.environ['HOME']\\n albumDirec = 'AlbumCoverImages'\\n #Check if a directory exists\\n if not os.path.isdir(os.path.join(homedir, 'Pictures', albumDirec)):\\n print('AlbumCoverImages not found, trying to make...')\\n os.makedirs(os.path.join(homedir, 'Pictures', albumDirec))\\n \\n for root, dirs, files in os.walk(rootDir, topdown=False):\\n #print('testtest')\\n for name in files:\\n \\n\\n #Find image files, and move them to albumCoverImages\\n #For some bullshit reason or statments won't work here, have to\\n # parse this out to elif statements, ughhhh...\\n \\n if '.jpg' in name:\\n os.rename(os.path.join(root, name), os.path.join(homedir, 'Pictures', albumDirec, name))\\n print('{0} moved to {1}!'.format(name, os.path.join(homedir, 'Pictures', albumDirec)))\\n \\n elif '.png' in name:\\n os.rename(os.path.join(root, name), os.path.join(homedir, 'Pictures', albumDirec, name))\\n print('{0} moved to {1}!'.format(name, os.path.join(homedir, 'Pictures', albumDirec, name)))\\n \\n elif '.gif' in name:\\n os.rename(os.path.join(root, name), os.path.join(homedir, 'Pictures', albumDirec, name))\\n print('{0} moved to {1}!'.format(name, os.path.join(homedir, 'Pictures', albumDirec, name)))\\n \\n elif '.pdf' in name:\\n os.rename(os.path.join(root, name), os.path.join(homedir, 'Pictures', albumDirec, name))\\n print('{0} moved to {1}!'.format(name, os.path.join(homedir, 'Pictures', albumDirec, name)))\\n\\n else:\\n try:\\n #Use tinytag to get file metadata\\n tag = TinyTag.get(os.path.join(root, name))\\n artistName = tag.artist\\n albumName = tag.album\\n \\n #TODO: Need to add more conditions\\n if isinstance(artistName, str):\\n artistName = artistName.replace('/', '_')\\n\\n elif isinstance(albumName, str):\\n albumName.replace('/', '_')\\n \\n\\n #Check if the artists directory exists, if not make it\\n try:\\n if not os.path.isdir(os.path.join(rootDir, artistName)):\\n os.makedirs(os.path.join(rootDir, artistName))\\n print('{0} directory made!'.format(artistName))\\n \\n except ValueError:\\n print('ValueError with {0}'.format(root+'/'+name))\\n continue\\n\\n except TypeError:\\n print('TypeError with {0}'.format(root+'/'+name))\\n continue\\n\\n #Check if the songs album exists, if not make it\\n try:\\n if not os.path.isdir(os.path.join(rootDir, artistName, albumName)):\\n os.makedirs(os.path.join(rootDir, artistName, albumName))\\n print('{0} directory made!'.format(albumName))\\n \\n except TypeError:\\n print('TypeError with {0}! Look at album directory making.'.format(root+'/'+name))\\n continue\\n\\n #TODO: Check if album is in artist direc, if not, move it\\n\\n #Check if song is in album, if not move it \\n try:\\n if os.path.isfile(os.path.join(rootDir, artistName, albumName, name)) == False:\\n os.rename(os.path.join(root, name), os.path.join(rootDir, artistName, albumName, name))\\n print('{0} moved to {1}!'.format(name, albumName))\\n \\n except TypeError:\\n print('TypeError with file {0}! Look at line song moving'.format(root+'/'+name))\\n continue\\n \\n #TODO: Check if this part works\\n except LookupError:\\n if (\\\".jpg\\\") or (\\\".png\\\") or (\\\".7z\\\") or (\\\"README\\\") or (\\\".zip\\\") in name:\\n continue\\n \\n else:\\n print('No reader support for {0}'.format(name))\\n continue\",\n \"def main_convert():\\n\\n verbose = True\\n\\n # Build parser.\\n parser = argparse.ArgumentParser()\\n\\n parser.add_argument('fname_pattern', action='store', help='File name pattern')\\n parser.add_argument('-R', '--recursive', action='store_true', default=True,\\n help='Search several subdirectories')\\n\\n # Run parser, extract arguments.\\n args = parser.parse_args()\\n\\n # List of files.\\n pattern = os.path.normpath(unicode(args.fname_pattern))\\n\\n if os.path.isdir(pattern):\\n pattern = os.path.join(pattern, '*')\\n fname_list = glob.glob(pattern)\\n\\n pattern = os.path.join(pattern, '*')\\n fname_list.extend(glob.glob(pattern))\\n\\n pattern = os.path.join(pattern, '*')\\n fname_list.extend(glob.glob(pattern))\\n\\n pattern = os.path.join(pattern, '*')\\n fname_list.extend(glob.glob(pattern))\\n\\n else:\\n fname_list = glob.glob(pattern)\\n\\n to_be_removed = []\\n for f in fname_list:\\n if os.path.isdir(f):\\n to_be_removed.append(f)\\n\\n for f in to_be_removed:\\n fname_list.remove(f)\\n\\n # Do the work.\\n num_files = len(fname_list)\\n for k, f_src in enumerate(fname_list):\\n f_src = os.path.abspath(f_src)\\n\\n b_src, e = os.path.splitext(f_src)\\n\\n folder = os.path.basename(os.path.dirname(f_src))\\n if (e == '.mp3' or e == '.wma' or e == '.wav' or e == '.aiff') and b_src != 'tmp' and folder != '.audio_convert':\\n\\n if verbose:\\n try:\\n print('%3d/%d: [%s -> .m4a] %s' % (k, num_files, e, os.path.basename(b_src)))\\n except Exception as e:\\n val = repr(f_src)\\n raise Exception('Problem processing file: %s' % val)\\n\\n # Temporary working copy.\\n path_work = os.path.dirname(f_src)\\n f_tmp_src = os.path.join(path_work, 'tmp' + e)\\n shutil.copy(f_src, f_tmp_src)\\n\\n # Transcode file format.\\n f_tmp_dst = convert(f_tmp_src, verbose=verbose)\\n\\n # Finish.\\n b_tmp_dst, e_dst = os.path.splitext(f_tmp_dst)\\n\\n f_dst = b_src + e_dst\\n if os.path.isfile(f_dst):\\n os.remove(f_dst)\\n os.rename(f_tmp_dst, f_dst)\\n\\n if os.path.isfile(f_tmp_src):\\n os.remove(f_tmp_src)\\n\\n if os.path.isfile(f_dst):\\n move_processed_file(f_src)\\n\\n # Done.\",\n \"def main(args):\\n\\n for dir in args.dirs:\\n # prepdir = mdssprep.Directory(dir,exclude=['file_*3*','file_2??'],include=['file_*5*'],maxarchivesize=mdssprep.one_meg*200.,minsize=mdssprep.one_meg*100.)\\n prepdir = mdssprep.Directory(dir)\\n prepdir.archive(dryrun=False)\",\n \"def _copy_otto_files(self):\\n\\n # Copy files used by the container\\n # Substitute name of the container in the configuration file.\\n lxcdefaults = os.path.join(utils.get_base_dir(), \\\"lxc.defaults\\\")\\n with open(os.path.join(lxcdefaults, \\\"config\\\"), 'r') as fin:\\n with open(os.path.join(self.containerpath, \\\"config\\\"), 'w') as fout:\\n for line in fin:\\n lineout = line\\n if \\\"${NAME}\\\" in line:\\n lineout = line.replace(\\\"${NAME}\\\", self.name)\\n elif \\\"${ARCH}\\\" in line:\\n lineout = line.replace(\\\"${ARCH}\\\", self.arch)\\n fout.write(lineout)\\n\\n dri_exists = os.path.exists(\\\"/dev/dri\\\")\\n vga_device = utils.find_vga_device()\\n with open(os.path.join(lxcdefaults, \\\"fstab\\\"), 'r') as fin:\\n with open(os.path.join(self.containerpath, \\\"fstab\\\"), 'w') as fout:\\n for line in fin:\\n if line.startswith(\\\"/dev/dri\\\") and not dri_exists:\\n lineout = \\\"# /dev/dri not found, entry disabled (\\\"\\\\\\n \\\"do you use nvidia or fglrx graphics \\\"\\\\\\n \\\"drivers?)\\\\n\\\"\\n lineout += \\\"#\\\" + line\\n else:\\n lineout = line\\n fout.write(lineout)\\n\\n src = os.path.join(lxcdefaults, \\\"scripts\\\")\\n dst = os.path.join(self.containerpath, \\\"tools\\\", \\\"scripts\\\")\\n with ignored(OSError):\\n shutil.rmtree(dst)\\n shutil.copytree(src, dst)\\n utils.set_executable(os.path.join(dst, \\\"pre-start.sh\\\"))\\n utils.set_executable(os.path.join(dst, \\\"pre-mount.sh\\\"))\\n utils.set_executable(os.path.join(dst, \\\"post-stop.sh\\\"))\\n\\n src = os.path.join(lxcdefaults, \\\"guest\\\")\\n dst = os.path.join(self.containerpath, \\\"tools\\\", \\\"guest\\\")\\n with ignored(OSError):\\n shutil.rmtree(dst)\\n shutil.copytree(src, dst)\\n\\n # Some graphics need a proprietary driver\\n # driver -> packages to install\\n drivers = {\\n \\\"fglrx\\\": \\\"fglrx\\\",\\n \\\"fglrx_pci\\\": \\\"fglrx\\\",\\n \\\"nvidia\\\": \\\"nvidia-current\\\"\\n }\\n if vga_device is not None and \\\"Driver\\\" in vga_device:\\n if vga_device[\\\"Driver\\\"] in drivers:\\n logging.info(\\\"Installing additional drivers for graphics \\\"\\n \\\"card {}\\\".format(vga_device[\\\"Device\\\"]))\\n # l-h-g must be installed to compile additional modules\\n pkgs = \\\"linux-headers-generic {}\\\\n\\\".format(\\n drivers[vga_device[\\\"Driver\\\"]])\\n # TODO: this shouldn't be in the guest directory\\n pkgsdir = os.path.join(self.containerpath, \\\"tools\\\", \\\"guest\\\", \\\"var\\\", \\\"local\\\", \\\"otto\\\", \\\"config\\\")\\n if not os.path.exists(pkgsdir):\\n os.makedirs(pkgsdir)\\n with open(os.path.join(pkgsdir, \\\"00drivers.pkgs\\\"), 'w') as fpkgs:\\n logging.debug(\\\"Custom drivers written to {}\\\".format(\\n os.path.join(pkgsdir, \\\"00drivers.pkgs\\\")))\\n fpkgs.write(pkgs)\",\n \"def move_files():\\r\\n if \\\"defaultdirectory\\\" in data:\\r\\n print(\\\"\\\\n*** Default video source directory:\\\", data[\\\"defaultdirectory\\\"])\\r\\n srcdir = input(\\\"Enter '1' to use default video source directory\\\\n\\\"\\r\\n \\\"Otherwise, please enter the full path where your videos are located.\\\\n\\\"\\r\\n \\\"Example: C:\\\\\\\\user\\\\\\\\downloads\\\\\\\\ \\\\n\\\").strip()\\r\\n if srcdir.startswith('1'):\\r\\n srcdir = data[\\\"defaultdirectory\\\"]\\r\\n else:\\r\\n srcdir = input(\\\"Please enter the full path where your videos are located.\\\\n\\\"\\r\\n \\\"Example: C:\\\\\\\\user\\\\\\\\downloads\\\\\\\\ \\\\n\\\").strip()\\r\\n while not os.path.isdir(srcdir):\\r\\n srcdir = input(\\\"\\\\n*** Invalid directory. Please enter the full path where your \\\"\\r\\n \\\"videos are located.\\\\n Example: C:\\\\\\\\user\\\\\\\\downloads\\\\\\\\ \\\\n\\\").strip()\\r\\n data[\\\"defaultdirectory\\\"] = srcdir\\r\\n save_json()\\r\\n print()\\r\\n for filename in os.listdir(srcdir):\\r\\n # Only look for folders/files in the format \\\"S##E##\\\". Example: \\\"X-Files S01E02\\\"\\r\\n if re.search('[sS]\\\\\\\\d{2}[eE]\\\\\\\\d{2}', filename):\\r\\n found = False\\r\\n filepath = os.path.join(srcdir, filename)\\r\\n name = filename.lower()\\r\\n for key in data:\\r\\n keywords = key.split()\\r\\n if all(word in name for word in keywords):\\r\\n found = True\\r\\n try:\\r\\n shutil.move(filepath, data[key])\\r\\n except Exception as e:\\r\\n print(\\\"*** Error with {}\\\".format(filename))\\r\\n print(\\\"The file might be open in another program\\\")\\r\\n print(repr(e))\\r\\n else:\\r\\n print(\\\"*** Moved:\\\", (filename[:41] + \\\"...\\\") if len(filename) > 44 else filename)\\r\\n break\\r\\n if not found:\\r\\n # Prints the shows that matched the episode formatting, but were not\\r\\n # configured to be processed\\r\\n print(\\\"* Not processed:\\\", (filename[:35] + '...') if len(filename) > 38 else filename)\",\n \"def cp_dir_or_files(self):\\n if self.recursive:\\n if self.cmdtype == 'upload' and not self.srcpath.endswith(os.path.sep):\\n basename = os.path.basename(self.srcpath)\\n self.destpath = join_obs_path(self.destpath, basename)\\n elif self.cmdtype == 'download' and not self.srcpath.endswith('/'):\\n bucket, key = split_bucket_key(self.srcpath)\\n basename = key.split('/')[-1]\\n if basename:\\n self.destpath = os.path.join(self.destpath, basename)\\n elif not self.srcpath.endswith('/'):\\n bucket, key = split_bucket_key(self.srcpath)\\n basename = key.split('/')[-1]\\n if basename:\\n self.destpath = join_obs_path(self.destpath, basename)\",\n \"def main():\\n parser = argparse.ArgumentParser()\\n parser.add_argument('--dryrun', '-n', action='store_true',\\n help=('check TileDB/SSH files differences only, '\\n 'does not perform any copy'))\\n parser.add_argument('--debug', '-d', action='store_true',\\n help=('prints debug messages'))\\n parser.add_argument('--tdmq-url', action='store', type=str, required=True,\\n dest='tdmq_url',\\n help=('tdmq server and path of the form'))\\n parser.add_argument('--tdmq-auth-token', action='store', type=str, required=True,\\n dest='tdmq_auth_token',\\n help=('tdmq server authorization token'))\\n parser.add_argument('--ssh-url', action='store', type=str, required=True,\\n dest='ssh_url',\\n help=(\\n 'ssh server and path of the form: '\\n '<USER>@<NAME_NODE>:<PORT>/PATH'))\\n parser.add_argument('--ssh-key', action='store', type=str, required=True,\\n dest='ssh_key',\\n help=('key for ssh server authentication'))\\n parser.add_argument('--desc-file', action='store', type=str, required=True,\\n dest='source_desc_file',\\n help=('source descrption file'))\\n\\n # Only one of --hours and --sync can be provided on command line\\n sync_group = parser.add_mutually_exclusive_group()\\n sync_group.add_argument('--hours', action='store',\\n dest='hours', default=24, type=int,\\n help=('uploads only the radar images '\\n 'more recent than the given number of hours'))\\n sync_group.add_argument('--sync', '-s', action='store_true',\\n dest='sync',\\n help=('upload all the missing radar images'))\\n\\n args = parser.parse_args()\\n\\n # If the debug flag is set, print all messages\\n if args.debug:\\n logging.basicConfig(\\n level=logging.DEBUG,\\n format='[%(levelname)s] %(message)s')\\n else:\\n logging.basicConfig(\\n level=logging.INFO,\\n format='[%(levelname)s] %(message)s')\\n\\n logging.getLogger(\\\"paramiko\\\").setLevel(logging.WARNING)\\n\\n (_ssh_username, _ssh_hostname, _ssh_port,\\n _ssh_root) = check_ssh_url(args.ssh_url)\\n if _ssh_hostname is None:\\n logging.error(\\n 'Wrong, incomplete or absent SSH path: \\\\'%s\\\\'', args.ssh_url)\\n sys.exit(1)\\n\\n if os.path.isfile(args.ssh_key) == False:\\n logging.error(\\n 'SSH key file not found: \\\\'%s\\\\'', args.ssh_key)\\n sys.exit(1)\\n\\n if os.path.isfile(args.source_desc_file) == False:\\n logging.error(\\n 'Source description file not found: \\\\'%s\\\\'', args.source_desc_file)\\n sys.exit(1)\\n\\n _source_desc = load_description(args.source_desc_file)\\n\\n ssh_client = SSHClient(\\n username=_ssh_username,\\n hostname=_ssh_hostname,\\n port=_ssh_port,\\n key_file=args.ssh_key,\\n root_dir=_ssh_root\\n )\\n\\n _folder_list = ssh_client.list_folder()\\n\\n def _name_filter(file_name):\\n # Is a radar image file\\n if re.match(r'cag01est2400\\\\d{4}-\\\\d{2}-\\\\d{2}_\\\\d{2}:\\\\d{2}:\\\\d{2}.png', file_name):\\n return True\\n else:\\n return False\\n\\n # Filter out not image files\\n _image_list = list(filter(_name_filter, _folder_list))\\n\\n # Instantiates a TDMQ client, retrieves the source if exists or registers a\\n # new one\\n tdmq_client = Client(args.tdmq_url, args.tdmq_auth_token)\\n sources = tdmq_client.find_sources({'id': _source_desc['id']})\\n if len(sources) > 0:\\n assert len(sources) == 1\\n source = sources[0]\\n logging.info(f\\\"Using source {source.tdmq_id} for {source.id}.\\\")\\n else:\\n source = tdmq_client.register_source(_source_desc)\\n logging.info(f\\\"Created source {source.tdmq_id} for {source.id}.\\\")\\n\\n try:\\n ts = source.timeseries()\\n times = ts.time\\n last_image_time = max(sorted(times))\\n _last_slot = max(ts.tiledb_indices)\\n except Exception as ex: # FIXME too general\\n times = []\\n last_image_time = datetime.datetime(1970, 1, 1, 0, 0, 0)\\n _last_slot = 0\\n\\n # Builds the list of file to download\\n if args.sync:\\n _images_to_ingest = ingest_missings(_image_list, times)\\n else:\\n start_time = (\\n datetime.datetime.now() - datetime.timedelta(hours=args.hours)\\n ).replace( minute=0, second=0, microsecond=0)\\n\\n logging.info(f\\\"Requested images from {start_time} (last local image is {last_image_time}).\\\")\\n if start_time > last_image_time:\\n last_image_time = start_time\\n\\n _images_to_ingest = ingest_latests(last_image_time, _image_list)\\n\\n logging.info(\\n f\\\"Remote files: {len(_folder_list)}, remote images: \\\"\\n f\\\"{len(_image_list)}, images to sync: {len(_images_to_ingest)}.\\\")\\n\\n for _image in _images_to_ingest:\\n _timestamp = datetime.datetime.strptime(\\n _image, 'cag01est2400%Y-%m-%d_%H:%M:%S.png')\\n _last_slot = _last_slot + 1\\n\\n if args.dryrun:\\n logging.debug(f\\\"[DRY-RUN] Ingesting data at time {_timestamp}, slot {_last_slot}.\\\")\\n else:\\n logging.debug(f\\\"Ingesting data at time {_timestamp}, slot {_last_slot}.\\\")\\n _data = fetch_radar_data(ssh_client, _image)\\n source.ingest(_timestamp, _data, _last_slot)\\n logging.info(f\\\"Done ingesting.\\\")\",\n \"def get_train_video(opt, frame_path, Total_frames):\\n clip = []\\n i = 0\\n loop = 0\\n\\n # choosing a random frame\\n if Total_frames <= opt.sample_duration: \\n loop = 1\\n start_frame = 0\\n else:\\n start_frame = np.random.randint(0, Total_frames - opt.sample_duration)\\n \\n if opt.modality == 'RGB': \\n while len(clip) < opt.sample_duration:\\n try:\\n im = Image.open(os.path.join(frame_path, '%05d.jpg'%(start_frame+i+1)))\\n clip.append(im.copy())\\n im.close()\\n except:\\n print('ERROR no such image {}'.format(os.path.join(frame_path, '%05d.jpg'%(i+1))))\\n i += 1\\n \\n if loop==1 and i == Total_frames:\\n i = 0\\n\\n elif opt.modality == 'Flow': \\n while len(clip) < 2*opt.sample_duration:\\n try:\\n im_x = Image.open(os.path.join(frame_path, 'TVL1jpg_x_%05d.jpg'%(start_frame+i+1)))\\n im_y = Image.open(os.path.join(frame_path, 'TVL1jpg_y_%05d.jpg'%(start_frame+i+1)))\\n clip.append(im_x.copy())\\n clip.append(im_y.copy())\\n im_x.close()\\n im_y.close()\\n except:\\n pass\\n i += 1\\n \\n if loop==1 and i == Total_frames:\\n i = 0\\n \\n elif opt.modality == 'RGB_Flow':\\n while len(clip) < 3*opt.sample_duration:\\n try:\\n im = Image.open(os.path.join(frame_path, '%05d.jpg'%(start_frame+i+1)))\\n im_x = Image.open(os.path.join(frame_path, 'TVL1jpg_x_%05d.jpg'%(start_frame+i+1)))\\n im_y = Image.open(os.path.join(frame_path, 'TVL1jpg_y_%05d.jpg'%(start_frame+i+1)))\\n clip.append(im.copy())\\n clip.append(im_x.copy())\\n clip.append(im_y.copy())\\n im.close()\\n im_x.close()\\n im_y.close()\\n except:\\n pass\\n i += 1\\n \\n if loop==1 and i == Total_frames:\\n i = 0\\n return clip\",\n \"def texlive_install():\\n orDir = os.getcwd()\\n system = platform.system()\\n if system == 'Windows':\\n print('A Windows system has been detected.')\\n default_dir = '/texlive/'\\n elif system == 'Linux':\\n print('A Linux system has been detected.')\\n default_dir = '/usr/share/texlive'\\n else:\\n print(\\\"System '{}' is not known. Aborting.\\\".format(system))\\n raise SystemExit()\\n\\n print('Looking for configuration file...')\\n # If available, the default root path is used\\n if os.path.isdir(default_dir):\\n os.chdir(default_dir)\\n else:\\n os.chdir('/')\\n # Then we look for the config file\\n for root, dirs, files in os.walk(os.getcwd()):\\n if 'texmf.cnf' in files:\\n filePath = os.path.join(root,'texmf.cnf')\\n print('Configuration file found at {}'.format(filePath))\\n break\\n if filePath is None:\\n print('Warning: no configuration file has been found. Continuing with default settings...')\\n filePath = default_dir\\n\\n # And now for the actual local texmf folder, which is created if not already there\\n os.chdir(os.path.join(root,'..'))\\n texmf_dir = os.path.join(os.getcwd(),'texmf-local')\\n f_chdir(texmf_dir)\\n new_dir = 'tex'\\n f_chdir(new_dir)\\n new_dir = 'latex'\\n f_chdir(new_dir)\\n\\n # template files are copied\\n new_dir = 'imta'\\n f_chdir(new_dir)\\n templatePath = os.getcwd()\\n copy_source_files(orDir,templatePath)\\n\\n \\n output = subprocess.check_output(\\\"tlmgr conf auxtrees add {}\\\".format(texmf_dir), \\n shell=True).decode('utf-8')\\n \\n print('Configuration file updated')\\n # original directory is restored\\n f_chdir(orDir)\",\n \"def copy_facemap_roi(procfile, videofile, outputfile=None):\\n videodata = np.load(procfile, allow_pickle=True).item() \\n videodata['filenames'] = [[videofile]]\\n if outputfile is None:\\n outputfile = os.path.splitext(videofile)[0]+'_proc.npy'\\n if os.path.isfile(outputfile):\\n print(f'File {outputfile} exists. It will not be overwritten.')\\n return None\\n np.save(outputfile, videodata)\\n return outputfile\",\n \"def process_videos(chapter_info):\\n\\n print(\\\"Processing chapter_info:\\\", chapter_info)\\n\\n # getting creation time of the first chapter\\n # TODO update when adding multiple directory proccessing\\n os.chdir(DIR_VIDEO_FILES)\\n print(\\\"1st chapter\\\", chapter_info[1][0])\\n chap1_time = time.strftime(\\n r\\\"%Y-%m-%d_%H-%M\\\", time.localtime(os.path.getctime(chapter_info[1][0])))\\n print(\\\"1st chapter creation\\\", chap1_time)\\n\\n # output_file = f\\\"M_GH00{chapter_info[0]}_{chap1_time}.MP4\\\"\\n output_file = f\\\"{chap1_time}_GH00{chapter_info[0]}_MRG.MP4\\\"\\n if os.path.isfile(output_file):\\n print(f\\\"Chapter already processed, found file: {output_file}\\\")\\n return\\n\\n # preparing text file containing file list for merging (for ffmpeg)\\n video_list_file = chapter_info[0] + \\\"_merge.txt\\\"\\n with open(video_list_file, \\\"w\\\") as f:\\n for video_chapter in chapter_info[1]:\\n f.write(f\\\"file {video_chapter}\\\\n\\\")\\n\\n command = f\\\"{FFMPEG_EXE} -f concat -i {video_list_file} -c copy {DIR_OUTPUT}{output_file}\\\"\\n print(\\\"command =\\\", command)\\n # p = subprocess.run(\\\"dir\\\", shell=True, capture_output=True)\\n # p = subprocess.run(\\\"dir\\\", shell=True, stdout=subprocess.PIPE, text=True)\\n p = subprocess.run(command, stdout=subprocess.PIPE, text=True)\\n print(\\\"returncode =\\\", p.returncode)\\n # print(\\\"stdout =\\\", p.stdout)\\n os.remove(video_list_file) # remove file list after merging\\n # rename original chapters after processing\\n for video_chapter in chapter_info[1]:\\n os.rename(video_chapter, f\\\"OK_{video_chapter}\\\")\",\n \"def main():\\n parser = argparse.ArgumentParser(description=\\\"Tracks adult fish\\\")\\n # add options for argument parser\\n parser.add_argument(\\\"in_path\\\",\\n help=\\\"Path to the video directory.\\\")\\n parser.add_argument(\\\"out_path\\\",\\n help=\\\"Directory for results. Should be empty.\\\")\\n parser.add_argument(\\\"-x\\\", \\\"--keep_temp\\\", action=\\\"store_true\\\",\\n help=\\\"Keep temporary folder after execution.\\\")\\n parser.add_argument(\\\"--visual\\\", action=\\\"store_true\\\",\\n help=\\\"shows a visual representation of the tracking progress.\\\")\\n\\n # parse arguments from command line\\n args = parser.parse_args()\\n # get all file names and directories ready\\n out_dir, temp_dir, video_bases, videos = housekeeping(args)\\n borders = []\\n for i in range(len(videos)):\\n v = videos[i]\\n get_borders(borders, temp_dir, v)\\n\\n for i in range(len(videos)):\\n vbn = video_bases[i]\\n v = videos[i]\\n scaled_video = \\\"scaled_\\\" + vbn + \\\".avi\\\"\\n ffmpeg = Ffmpeg(v, os.path.join(temp_dir, scaled_video))\\n ffmpeg.f = \\\"avi\\\"\\n ffmpeg.vcodec = \\\"libx264rgb\\\"\\n ffmpeg.width = 480\\n ffmpeg.run()\\n\\n for i in range(len(videos)):\\n vbn = video_bases[i]\\n pts = tracker(args, temp_dir, vbn)\\n border = borders[i]\\n tracks_lower, tracks_upper = split_tracks(border, pts)\\n analysis = Analysis(tracks_lower, tracks_upper, px_size=0.06)\\n analysis.analyze(os.path.join(out_dir, 'stats.txt'), vbn, vel=True)\\n\\n if not args.keep_temp:\\n shutil.rmtree(temp_dir)\",\n \"def fileCopyToMorph():\\r\\n print(str(self.copyFilePath))\\r\\n print(str(self.morphPath))\\r\\n \\\"\\\"\\\"copyPath = self.createDir + self.name + \\\"-\\\" + self.method\\r\\n print(str(copyPath))\\r\\n \\r\\n os.system(copyPath)\\\"\\\"\\\"\\r\\n os.system(self.copyFilePath)\\r\\n print(\\\"Burada sorun yok\\\")\",\n \"def seperate_dog_cat(src, dst):\\n imgs = [f for f in os.listdir(src) if os.path.isfile(os.path.join(src, f)) and not f.startswith('.')]\\n \\n dst_dog = os.path.join(dst, 'dog')\\n dst_cat = os.path.join(dst, 'cat')\\n if not os.path.exists(dst_dog):\\n os.makedirs(dst_dog)\\n if not os.path.exists(dst_cat):\\n os.makedirs(dst_cat)\\n \\n for img in imgs:\\n if 'dog' in img:\\n move(os.path.join(src, img), dst_dog)\\n if 'cat' in img:\\n move(os.path.join(src, img), dst_cat)\\n print('seperate done')\",\n \"def form_sample_folder(self, input_folder, target_folder, sample_name):\\n print(f'processing {sample_name} folder.')\\n # first make a subfolder to contain the images - e.g. 'target_folder/sample_name'\\n sample_dir = join(target_folder, sample_name)\\n if not os.path.exists(sample_dir):\\n mkdir(sample_dir)\\n # resize and move the mask images - e.g. 'target_folder/sample_name/imgs_necrosis.png'\\n img_file_nec = join(input_folder, 'Necrosis',\\n 'Tissue Slides.'+sample_name+'.png')\\n img_res = self.process_img(img_file_nec, self.rescale_ratio)\\n img_nec = img_res.copy()\\n cv2.imwrite(join(sample_dir, 'necrosis.png'), img_res)\\n\\n img_file_perf = join(input_folder, 'Perfusion',\\n 'Tissue Slides.'+sample_name+'.png')\\n img_res = self.process_img(img_file_perf, self.rescale_ratio)\\n cv2.imwrite(join(sample_dir, 'perfusion.png'), img_res)\\n\\n # resize and move the maker HE and EF5 images\\n files = listdir(input_folder)\\n img_files = [x for x in files if x.split(\\n '.')[-1] in ('tif', 'jpg', 'png')]\\n for img_file in img_files:\\n if (sample_name+'_' in img_file) or (sample_name+'-' in img_file):\\n if ('HE-G' in img_file) or ('HE-green' in img_file) or ('HEgreen' in img_file):\\n img_res = self.process_img(\\n join(input_folder, img_file), self.rescale_ratio)\\n if not os.path.exists(join(sample_dir, 'HE-green.png')):\\n cv2.imwrite(join(sample_dir, 'HE-green.png'), img_res)\\n else:\\n warnings.warn(\\n f\\\"file already exists, while processing {img_file}\\\")\\n elif ('HE-R' in img_file) or ('HE-red' in img_file) or ('HEred' in img_file):\\n img_res = self.process_img(\\n join(input_folder, img_file), self.rescale_ratio)\\n if not os.path.exists(join(sample_dir, 'HE-red.png')):\\n cv2.imwrite(join(sample_dir, 'HE-red.png'), img_res)\\n else:\\n warnings.warn(\\n f\\\"file already exists, while processing {img_file}\\\")\\n elif ('HE-B' in img_file) or ('HE-blue' in img_file) or ('HE-blue' in img_file):\\n img_res = self.process_img(\\n join(input_folder, img_file), self.rescale_ratio)\\n if not os.path.exists(join(sample_dir, 'HE-blue.png')):\\n cv2.imwrite(join(sample_dir, 'HE-blue.png'), img_res)\\n else:\\n warnings.warn(\\n f\\\"file already exists, while processing {img_file}\\\")\\n elif 'EF5' in img_file:\\n img_res = self.process_img(\\n join(input_folder, img_file), self.rescale_ratio)\\n img_ef5 = img_res.copy()\\n if not os.path.exists(join(sample_dir, 'EF5.png')):\\n cv2.imwrite(join(sample_dir, 'EF5.png'), img_res)\\n else:\\n warnings.warn(\\n f\\\"file already exists, while processing {img_file}\\\")\\n\\n masked_ef5 = (img_ef5 * (img_nec <= 0)).astype(img_ef5.dtype)\\n cv2.imwrite(join(sample_dir, 'EF5_masked.png'), masked_ef5)\\n assert len(listdir(sample_dir)) == 7\\n return\",\n \"def gen_thumb(video_path, thumb_path):\\n if os.path.isfile(thumb_path):\\n os.remove(thumb_path)\\n\\n global THUMB_SIZE\\n cmd = ['ffmpeg', '-itsoffset', '-5', '-i', video_path, '-vframes', '1', '-f', 'apng', '-s', THUMB_SIZE, thumb_path]\\n p = Popen(cmd, stdin=PIPE, stdout=PIPE, stderr=PIPE)\\n output = p.communicate()[1]\\n\\n duration = search_duration_from_text(output)\\n if not duration:\\n tlog = get_logger(current_thread().name)\\n tlog.error(\\\"Failed to find duration for {0}\\\".format(video_path))\\n duration = 0\\n\\n return p.returncode == 0, duration\",\n \"def upload():\\n run('mkdir -p /srv/images/'+env.project_name+'/')\\n rsync_project(\\n env.project_dir, './',\\n exclude=(\\n '.git', '.gitignore', '__pycache__', '*.pyc', '.DS_Store', 'environment.yml',\\n 'fabfile.py', 'Makefile', '.idea', 'bower_components', 'node_modules',\\n '.env.example', 'README.md', 'var'\\n ), delete=True)\",\n \"def setup_rawpath(job, raw_path):\\n\\n logging.info(f\\\"Destination is {raw_path}\\\")\\n if not os.path.exists(raw_path):\\n try:\\n os.makedirs(raw_path)\\n except OSError:\\n err = f\\\"Couldn't create the base file path: {raw_path}. Probably a permissions error\\\"\\n logging.error(err)\\n else:\\n logging.info(f\\\"{raw_path} exists. Adding timestamp.\\\")\\n raw_path = os.path.join(str(job.config.RAW_PATH), f\\\"{job.title}_{job.stage}\\\")\\n logging.info(f\\\"raw_path is {raw_path}\\\")\\n try:\\n os.makedirs(raw_path)\\n except OSError:\\n err = f\\\"Couldn't create the base file path: {raw_path}. Probably a permissions error\\\"\\n raise OSError(err) from OSError\\n return raw_path\",\n \"def processVideo(inputRootFolder='/home/pi/Logging/UnprocessedVideo',\\n outputFolder='/home/pi/Logging/Unsent',\\n cam_framerate=10,\\n delay=15):\\n logging.info('Processing videos')\\n sleep(delay) # hardcoded sleep function to ensure that the video has finished saving\\n # Create directories if necessary\\n try:\\n os.makedirs(inputRootFolder)\\n except OSError as e:\\n if e.errno != errno.EEXIST:\\n raise # This was not a \\\"directory exists\\\" error\\n try:\\n os.makedirs(outputFolder)\\n except OSError as e:\\n if e.errno != errno.EEXIST:\\n raise # This was not a \\\"directory exists\\\" error\\n # Get the list of subdirectories\\n f = []\\n for (dirpath, dirnames, filenames) in os.walk(inputRootFolder):\\n f.extend(dirnames)\\n # Go through each subdirectory\\n for folder in f:\\n folderName = os.path.join(inputRootFolder,folder)\\n videoListName = '%s/videoList.txt' % folderName #file that will contain list of videos\\n videoList = io.open(videoListName, 'w')\\n for fileName in sorted(os.listdir(folderName)): #add each video in the folder to the file\\n if (fileName.startswith('Video')):\\n videoString = (\\\"file '%s/%s'\\\\n\\\" % (folderName, fileName))\\n videoList.write(videoString)\\n videoList.close()\\n outputFile = '%s/%s.mp4' % (outputFolder, folder)\\n #concatenate the videos\\n subprocess.call(['ffmpeg', '-y', '-f', 'concat', '-safe', '0', '-i',\\n videoListName, '-c', 'copy', outputFile], shell=False)\\n shutil.rmtree(folderName, ignore_errors=True) #delete the folder\\n logging.info('Processed videos')\",\n \"def _videoclipupload(request, hash_key):\\n # get video\\n video_queryset = Video.objects.all().select_related('owner')\\n video = get_object_or_404(video_queryset, hash_key=hash_key)\\n \\n if request.method == 'POST':\\n \\n # create a form instance and populate it with data from the request\\n form = UploadClipForm(request.POST, request.FILES)\\n \\n # check whether it's valid\\n if form.is_valid():\\n # process the data in form.cleaned_data as required\\n number = form.cleaned_data['formatted_number'].as_e164\\n name = form.cleaned_data['name']\\n clip = form.cleaned_data['clip']\\n \\n # get location of script\\n script_dir = os.path.dirname(os.path.abspath(__file__))\\n script_path = os.path.join(script_dir, \\\"process.sh\\\")\\n \\n # get locations of input and output files\\n input_video = clip.temporary_file_path()\\n output_video = NamedTemporaryFile(suffix='.mp4')\\n output_image = NamedTemporaryFile(suffix='.jpg')\\n output_duration = NamedTemporaryFile()\\n \\n # get the ffmpeg path\\n # on production we had to install the 64 bit static ffmpeg build\\n ffmpeg_path = ''\\n if not settings.DEBUG:\\n ffmpeg_path = '/home/nceruchalu/bin/'\\n \\n # Generate the output files\\n subprocess.check_call(\\n [script_path, input_video, output_video.name, \\n output_image.name, output_duration.name, ffmpeg_path])\\n \\n # Get clip duration from the results\\n clip_duration = map(float, output_duration)[0]\\n \\n # if we've come this far then all is well, and we can go ahead\\n # and create this clip\\n user = User.objects.get_user_by_number(number)\\n if not user.is_active and name:\\n user.full_name = name\\n user.save()\\n \\n # first add user as a video user, because nobody should\\n # add to a clip without being a video user\\n VideoUsers.objects.add_users_to_video(video, user)\\n \\n # Try creating the clip with a thumbnail, if that fails try\\n # without the thumbnail\\n Clip.objects.create(owner=user,\\n video=video,\\n mp4=File(output_video),\\n photo=ImageFile(output_image),\\n duration=clip_duration)\\n \\n # close and delete the tempoary files\\n output_video.close()\\n output_image.close()\\n output_duration.close()\\n \\n # redirect to the video details URL but add a querystring param\\n # indicating that the video should start from the last clip\\n video_url = reverse('web-video-detail',kwargs={'hash_key':hash_key})\\n redirect_url = \\\"{video_url}?latest=1\\\".format(video_url=video_url)\\n \\n return HttpResponseRedirect(redirect_url)\\n \\n else:\\n # if a GET (or any other method) we'll create a blank form\\n form = UploadClipForm()\\n \\n return render_to_response('video/upload.html',\\n {'video':video,\\n 'form':form},\\n context_instance=RequestContext(request))\",\n \"def ffmpeg_subclip_video_file(filename, t1, t2):\\n subprocess.call(['ffmpeg', '-i', filename, '-ss', str(t1), '-to', str(t2), '-c', 'copy', '-y', filename.split('.')[0] + '_subclip.mp4'])\\n return\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.5893241","0.57616824","0.5529838","0.55258685","0.55187756","0.55067265","0.5499056","0.54705536","0.5458571","0.5449385","0.54415053","0.53093326","0.5306078","0.53042513","0.5287746","0.5274733","0.5265946","0.5246467","0.52405924","0.5228054","0.5227246","0.5223553","0.5209518","0.519676","0.51964355","0.5181166","0.51608443","0.51529205","0.5132727","0.5124742","0.5107104","0.50845337","0.5082515","0.5072183","0.5070495","0.50600946","0.50590765","0.50343186","0.50277627","0.50061774","0.4998831","0.4998305","0.49927324","0.49895415","0.49807692","0.4974426","0.49729759","0.49677858","0.49517065","0.49508423","0.49467623","0.49452364","0.49408785","0.4939306","0.49368545","0.4921772","0.49135807","0.4910351","0.4909662","0.49039823","0.49015692","0.48944283","0.4883725","0.4881896","0.48783296","0.48766387","0.4868423","0.48574197","0.4846574","0.4846177","0.48435035","0.48393098","0.48357633","0.48330018","0.483269","0.48303634","0.48266","0.4822527","0.48196164","0.48173836","0.48142824","0.4808503","0.48064017","0.48062852","0.48038638","0.47889832","0.4785968","0.47830164","0.47810307","0.47772652","0.4774487","0.47733688","0.47721803","0.47697154","0.47684667","0.47670767","0.47661275","0.47639725","0.4760354","0.4756789"],"string":"[\n \"0.5893241\",\n \"0.57616824\",\n \"0.5529838\",\n \"0.55258685\",\n \"0.55187756\",\n \"0.55067265\",\n \"0.5499056\",\n \"0.54705536\",\n \"0.5458571\",\n \"0.5449385\",\n \"0.54415053\",\n \"0.53093326\",\n \"0.5306078\",\n \"0.53042513\",\n \"0.5287746\",\n \"0.5274733\",\n \"0.5265946\",\n \"0.5246467\",\n \"0.52405924\",\n \"0.5228054\",\n \"0.5227246\",\n \"0.5223553\",\n \"0.5209518\",\n \"0.519676\",\n \"0.51964355\",\n \"0.5181166\",\n \"0.51608443\",\n \"0.51529205\",\n \"0.5132727\",\n \"0.5124742\",\n \"0.5107104\",\n \"0.50845337\",\n \"0.5082515\",\n \"0.5072183\",\n \"0.5070495\",\n \"0.50600946\",\n \"0.50590765\",\n \"0.50343186\",\n \"0.50277627\",\n \"0.50061774\",\n \"0.4998831\",\n \"0.4998305\",\n \"0.49927324\",\n \"0.49895415\",\n \"0.49807692\",\n \"0.4974426\",\n \"0.49729759\",\n \"0.49677858\",\n \"0.49517065\",\n \"0.49508423\",\n \"0.49467623\",\n \"0.49452364\",\n \"0.49408785\",\n \"0.4939306\",\n \"0.49368545\",\n \"0.4921772\",\n \"0.49135807\",\n \"0.4910351\",\n \"0.4909662\",\n \"0.49039823\",\n \"0.49015692\",\n \"0.48944283\",\n \"0.4883725\",\n \"0.4881896\",\n \"0.48783296\",\n \"0.48766387\",\n \"0.4868423\",\n \"0.48574197\",\n \"0.4846574\",\n \"0.4846177\",\n \"0.48435035\",\n \"0.48393098\",\n \"0.48357633\",\n \"0.48330018\",\n \"0.483269\",\n \"0.48303634\",\n \"0.48266\",\n \"0.4822527\",\n \"0.48196164\",\n \"0.48173836\",\n \"0.48142824\",\n \"0.4808503\",\n \"0.48064017\",\n \"0.48062852\",\n \"0.48038638\",\n \"0.47889832\",\n \"0.4785968\",\n \"0.47830164\",\n \"0.47810307\",\n \"0.47772652\",\n \"0.4774487\",\n \"0.47733688\",\n \"0.47721803\",\n \"0.47697154\",\n \"0.47684667\",\n \"0.47670767\",\n \"0.47661275\",\n \"0.47639725\",\n \"0.4760354\",\n \"0.4756789\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.57895535"},"document_rank":{"kind":"string","value":"1"}}},{"rowIdx":6092,"cells":{"query":{"kind":"string","value":"Read command line argument runtype Throws error if the choice is not correct"},"document":{"kind":"string","value":"def parseArg():\n try:\n parser = argparse.ArgumentParser(\n description='This is the Scheduler export utility')\n parser.add_argument('--weekofmonth', action='store', dest='weekofmonth',\n required=True, help='select the week of month[1-5]', type = int, choices=[1,2,3,4,5])\n parser.add_argument('--dayofweek', action='store', dest='dayofweek', help='select day of week [1-7]', type=int, choices=[1,2,3,4,5,6,7])\n args = parser.parse_args()\n global WEEK\n global DAY\n WEEK = args.weekofmonth\n DAY = args.dayofweek\n log.info(\"1;EME;RUNNING;000;Scheduler.py;;;;;STARTING \" + os.path.basename(__file__))\n schedule(WEEK, DAY)\n except Exception as e:\n log.exception(\"1;EME;FAILURE;700;STARTUP ERROR \" + str(e), exc_info=False)\n sys.exit(0)"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["def readArgs():\n args = sys.argv\n if len(args) != 3:\n print(\"ERROR - Wrong number of arguments! \\n\")\n print(\"Usage: plotGantt.py TYPE path/to/result/file.gantt \\n where TYPE is : MTS / SCH\")\n exit(5)\n if args[1] != \"MTS\" and args[1] != \"SCH\":\n print(\"ERROR - Wrong type specified! : \" + args[1])\n print(\"Usage: plotGantt.py TYPE path/to/result/file.gantt \\n where TYPE is : MTS / SCH\")\n return args","def cmd_type(args):","def read_cmd_args():\n\n if len(sys.argv) != 9:\n print(\"[ERR] Invalid number of command line arguments!\")\n usage()\n sys.exit(1)\n\n # FCST_SYR\n try:\n fcst_syr = int(sys.argv[1])\n except ValueError:\n print(f\"[ERR] Invalid argument for FCST_SYR! Received {(sys.argv[1])}\")\n usage()\n sys.exit(1)\n if fcst_syr < 0:\n print(f\"[ERR] Invalid argument for FCST_SYR! Received {(sys.argv[1])}\")\n usage()\n sys.exit(1)\n\n # FCST_EYR\n try:\n fcst_eyr = int(sys.argv[2])\n except ValueError:\n print(f\"[ERR] Invalid argument for FCST_EYR! Received {(sys.argv[2])}\")\n usage()\n sys.exit(1)\n if fcst_eyr < 0:\n print(f\"[ERR] Invalid argument for FCST_EYR! Received {(sys.argv[2])}\")\n usage()\n sys.exit(1)\n\n # MONTH_ABBR\n month_abbr = str(sys.argv[3])\n\n # MONTH_NUM\n try:\n month_num = int(sys.argv[4])\n except ValueError:\n print(f\"[ERR] Invalid argument for MONTH_NUM! Received {(sys.argv[4])}\")\n usage()\n sys.exit(1)\n if month_num < 1:\n print(f\"[ERR] Invalid argument for MONTH_NUM! Received {(sys.argv[4])}\")\n usage()\n sys.exit(1)\n if month_num > 12:\n print(f\"[ERR] Invalid argument for MONTH_NUM! Received {(sys.argv[4])}\")\n usage()\n sys.exit(1)\n\n # FCST_TYPE\n fcst_type = str(sys.argv[5])\n\n # LEAD_MONTHS\n try:\n lead_months = int(sys.argv[6])\n except ValueError:\n print(f\"[ERR] Invalid argument for LEAD_MONTHS! Received {(sys.argv[6])}\")\n usage()\n sys.exit(1)\n if lead_months < 0:\n print(f\"[ERR] Invalid argument for LEAD_MONTHS! Received {(sys.argv[6])}\")\n usage()\n sys.exit(1)\n\n # ENS_NUM\n try:\n ens_num = int(sys.argv[7])\n except ValueError:\n print(f\"[ERR] Invalid argument for ENS_NUM! Received {(sys.argv[7])}\")\n usage()\n sys.exit(1)\n if ens_num < 0:\n print(f\"[ERR] Invalid argument for ENS_NUM! Received {(sys.argv[7])}\")\n usage()\n sys.exit(1)\n\n # CONFIG_FILE\n config_file = sys.argv[8]\n if not os.path.exists(config_file):\n print(f\"[ERR] {config_file} does not exist!\")\n sys.exit(1)\n\n return fcst_syr, fcst_eyr, month_abbr, month_num, fcst_type, lead_months, \\\n \tens_num, config_file","def readCommandLine(self, **kwargs):\n try:\n condition = kwargs[\"fname\"].split(':')[0]\n except Exception,e:\n rospy.logerr(\"%s\"%str(e))\n self.mm.neglect()\n return\n\n # experimentation parameters\n answer = raw_input('Change %s: %s to: ' % (condition,self.exp_predicates[condition]))\n self.exp_predicates[condition] = answer\n self.mm.loadMenu(\"teachMenu\")","def test_type_arg(self, parse_input):\n with pytest.warns(SyntaxWarning, match=\"Only keyword options of the form\"):\n parse_input(\"name testname\\nversion 1.0\\ntarget example (6)\\ntype example (42)\")","def parse_command_line():\r\n\r\n parser = argparse.ArgumentParser(description='User args')\r\n parser.add_argument(\"--action\", choices=['train', 'predict', 'demo', 'test'], required=True, help=\"Choose action.\")\r\n parser.add_argument(\"--model\", choices=['vgg', 'unet', 'fpn'], required=True, help=\"Choose model.\")\r\n parser.add_argument(\"--dataset\", choices=['full', 'small'], required=True, help=\"Choose dataset.\")\r\n\r\n return parser.parse_args()","def read_user_input(self):\n\n self.commandline = raw_input(\"Enter the string you want to parse\\n\")","def _read_cmd_args():\n\n # Check if argument count is correct.\n if len(sys.argv) != 5:\n print(\"[ERR] Invalid number of command line arguments!\")\n _usage()\n sys.exit(1)\n\n # Get path to config file\n configfile = sys.argv[1]\n if not os.path.exists(configfile):\n print(f\"[ERR] Config file {configfile} does not exist!\")\n sys.exit(1)\n\n # Get top directory of LIS data\n topdatadir = sys.argv[2]\n if not os.path.exists(topdatadir):\n print(f\"[ERR] LIS data directory {topdatadir} does not exist!\")\n sys.exit(1)\n\n # Get valid year and month\n yyyymm = sys.argv[3]\n if len(yyyymm) != 6:\n print(\"[ERR] Invalid length of YYYYMM, must be 6 characters!\")\n sys.exit(1)\n year = int(yyyymm[0:4])\n month = int(yyyymm[4:6])\n try:\n startdate = datetime.datetime(year, month, day=1)\n except ValueError:\n print(\"[ERR] Invalid YYYYMM passed to script!\")\n sys.exit(1)\n\n # Get model forcing ID\n model_forcing = sys.argv[4]\n\n return configfile, topdatadir, startdate, model_forcing","def test_arg_type(args, arg, arg_type):\n try:\n arg_type(args[arg])\n except Exception:\n raise GaiaException('Required argument {} must be of type {}'\n .format(arg, arg_type))","def _read_cmd_args():\n\n # Check if argument count is correct.\n if len(sys.argv) != 4:\n print(\"[ERR] Invalid number of command line arguments!\")\n print(len(sys.argv))\n print(sys.argv[:])\n _usage()\n sys.exit(1)\n\n # Check if lis.config template exists.\n lis_config_template = sys.argv[1]\n if not os.path.exists(lis_config_template):\n print(f\"[ERR] {lis_config_template} does not exist!\")\n sys.exit(1)\n\n # Check if directory for restart files exists. Actual restart file\n # shall be checked later.\n restart_dir = sys.argv[2]\n if not os.path.exists(restart_dir):\n print(f\"[ERR] Directory {restart_dir} does not exist!\")\n sys.exit(1)\n\n # Get start date of new LIS run.\n yyyymmdd = sys.argv[3]\n if len(yyyymmdd) != 8:\n print(\"[ERR] Invalid length for YYYYMMDD, must be 8 characters!\")\n sys.exit(1)\n year = int(yyyymmdd[0:4])\n month = int(yyyymmdd[4:6])\n day = int(yyyymmdd[6:8])\n try:\n startdate = datetime.date(year, month, day)\n except ValueError:\n print(\"[ERR] Invalid YYYYMMDD passed to script!\")\n sys.exit(1)\n\n return lis_config_template, restart_dir, startdate","def parse_args(args):\n assert os.path.isfile(args.data_path), \"The specified data file does not exist.\"\n assert os.path.isfile(args.model_path), \"The specified model file does not exist.\"\n\n if args.read_batches is not False:\n if args.read_batches.lower() in (\"y\", \"yes\", \"1\", \"\", \"true\", \"t\"):\n args.read_batches = True\n else:\n args.read_batches = False","def parse_and_validate_cmd_line():\n if len(sys.argv) != 4:\n print USAGE_STR.format(sys.argv[0])\n sys.exit()\n # attempt to parse the parameters tell the user and exit if we can't\n num_segments = parse_and_validate_num_segs(sys.argv[1])\n # try to parse numThreads\n num_threads = parse_and_validate_num_threads(sys.argv[2])\n # try to parse and test the data directory\n data_dir = parse_and_validate_data_dir(sys.argv[3])\n return num_segments, num_threads, data_dir","def main(argv,required_arg,required_arg_type,optional_arg):\n \n # add optional_arguments to the parser\n for option in optional_arg:\n parse_option_dictionary[option]()\n \n # parse the command line\n passed_optional_arg, passed_required_arg = parser.parse_args(argv)\n \n required_arg_values = grabRequiredArgs(passed_required_arg,required_arg,\n required_arg_type)\n\n return required_arg_values, passed_optional_arg","def validate_args(self, in_args, cmd_call):\n valid_1, valid_2 = None, None\n\n if len(in_args) > 0 and type(in_args) is not list:\n args = in_args.split()\n valid_1 = args[0]\n elif type(in_args) is list and len(in_args) > 0:\n args = in_args\n valid_1 = args[0]\n else:\n args = []\n\n if cmd_call in ['default']:\n # Default : Returns a valid cui type for an input cui\n # checks to see if there is more than 2 arguments\n # if so, arg[0] may be a valid code\n # arg[1] may be a valid code type\n # if not ask the user what type of code type arg[0] is\n # valid_1 = valid cui type\n # valid_2 = None\n while True:\n if len(args) >= 2 and len(args) <= 3:\n input_type = args[1].upper()\n else:\n input_type = input(\"What type of id is '{0}'? [LOCAL/RXCUI/NDC/SNOMED]\".format(args[0])).upper()\n\n # Confirm it's a valid code type\n valid_type = self.validate_id_type(input_type)\n # Valid type is a boolean of True\n if isinstance(valid_type, str) or valid_type is None:\n return None\n elif valid_type:\n break\n elif not valid_type:\n print('Invalid Option, Please Try Again')\n continue\n valid_1 = input_type\n\n elif cmd_call in self.cmd_config_default:\n # valid_1 : Valid Cui , valid_2 : Valid Cui Type\n valid_2, _ = self.validate_args(args, 'default')\n valid_1 = args[0]\n\n elif cmd_call == 'code_lookup':\n # args[0] : Initial CUI, args[1] : Initial CUI Type, args[2] : Target CUI Type\n # valid_1 : valid cui, valid_2 : list valid source and target\n _dict_opts = util.OPTIONS_CUI_TYPES.copy()\n _avail = list(set(smores.get_dict_sources()) & set(_dict_opts))\n if len(_avail) == 0 and len(args) < 2:\n print('There are no available starting cui types that can be crosswalked.\\n'\n 'Please load a file containing valid cui types: {0}'.format(_dict_opts))\n return False, None\n\n if len(args) >= 2:\n if len(args) == 3:\n # provided cui, cui source, and target\n valid_2, _ = self.validate_args(args, 'default')\n source, target = args[1].upper(), args[2].upper()\n else:\n source, target = args[0].upper(), args[1].upper()\n valid_1 = simple_input(\"Is {0} the correct starting source? \".format(source), ['YES', 'NO', 'exit'])\n if valid_1 == 'exit':\n return False, None\n # TODO need path for valid_2\n else:\n valid_1 = simple_input(\"Which code set do you want to start with?\", _avail)\n if valid_1 != 'exit':\n _dict_opts.remove(valid_1) # Don't lookup what we've already got\n valid_2 = simple_input(\"Which code set do you want to get results for?\", _dict_opts)\n if valid_2 == 'exit':\n return False, None\n else:\n return False, None\n\n elif cmd_call == 'errors':\n _current_err = list(self.errors.keys())\n if len(args) > 1:\n smores_error('#Cx001.7', console_p=True)\n return\n elif len(args) == 1 and args[0].lower() in _current_err:\n valid_1 = args[0]\n elif len(args) == 1:\n print('There are currently no errors logged for that command.')\n return\n else:\n valid_1 = simple_input(\"Please choose a command from the list to see errors: \", _current_err)\n\n elif cmd_call in ['csv', 'remap', 'fhir', 'json']:\n # Format: [File] [Output]\n if not self.inputs['loaded']:\n print(\"No Files Loaded!\\nYou Must load a file containing local medications first\")\n else:\n _file_opts = list(self.inputs['files'].keys()) + ['All']\n _dict_opts = list(smores.get_dict_sources(True)) #+ ['All']\n _file_or_dict = None\n\n if cmd_call in ['csv', 'json']:\n if len(args) == 0:\n _file_or_dict = simple_input(\"Do you want results for a File or a constructed Dictionary?\",\n ['File', 'Dictionary', 'exit'], True)\n elif args[0] not in _file_opts and args[0] not in _dict_opts:\n print('That option was not recognized as a valid source.')\n _file_or_dict = simple_input(\"Do you want results for a File or a constructed Dictionary?\",\n ['File', 'Dictionary', 'exit'], True)\n else:\n valid_1 = args[0]\n\n if _file_or_dict.upper() == 'FILE':\n valid_1 = 'FILE|' + simple_input(\"Please choose a loaded file\", _file_opts, True)\n\n elif _file_or_dict.upper() == 'DICTIONARY':\n valid_1 = 'DICT|' + simple_input(\"Please choose a code dictionary to output\", _dict_opts, True)\n elif _file_or_dict.upper() == 'EXIT':\n return None, None\n\n else:\n valid_1 = simple_input(\"Please choose a loaded file\", _file_opts, True)\n\n if cmd_call in ['csv', 'json', 'fhir']:\n if len(args) == 2 and len(args[1]) > 0:\n valid_2 = args[1]\n else:\n valid_2= input(\"Please provide an output file name:\").strip()\n\n if len(valid_2) > 0:\n if \".\" in valid_2:\n valid_2, ext = valid_2.split(\".\")\n else:\n valid_2 = ''\n print('Empty file name provided, using default.')\n else:\n valid_2 = args[0]\n\n elif cmd_call == 'file':\n re_use = False\n if self.inputs['loaded'] and len(in_args) == 0:\n print(\"The following file(s) have already been loaded: \\n\" + str(self.inputs['files']))\n _load_more = simple_input(\"Would you like to load an additional file?\", ['Y', 'N', 'exit'])\n if _load_more == 'Y':\n pass\n elif _load_more == 'N':\n _re_use = simple_input(\"Would you like to re-use a loaded file?\", ['Y', 'N', 'exit'])\n if _re_use == 'Y':\n re_use = True\n else:\n return False, None\n else:\n return False, None\n\n if in_args is not None and len(in_args) > 0:\n valid_1 = in_args\n else:\n valid_1 = input(\"Please enter the name of the file to load: \") if not re_use else simple_input(\n 'Select the file to be used: ', list(self.inputs['files'].keys()), index=True)\n\n while True:\n if valid_1 in self.inputs['files']:\n if not re_use:\n print(\"It looks like you've already loaded that file. Please try a different file.\")\n valid_1, valid_2 = input(\"Please enter the name of the file to load: \")\n else:\n break\n elif len(valid_1) == 0:\n smores_error('#Cx001.7', logger=smoresLog)\n valid_1, valid_2 = input(\"Please enter the name of the file to load: \")\n else:\n break\n\n if not resolve_target_path(valid_1):\n valid_1, valid_2 = self.validate_args('', 'file')\n\n elif '.smr' in valid_1:\n if len(self.inputs['files']) > 0:\n print(\n 'It looks like you are trying to load a session, this will replace the current session and '\n 'all previous work.')\n _save = simple_input('Do you want to save the current session first?', ['Y', 'N', 'EXIT'])\n if _save == 'Y':\n smores.save_session(self.__version__)\n elif _save == 'EXIT':\n return False, None\n valid_2 = 'session'\n else:\n valid_2 = 'file'\n\n smoresLog.debug('Args: {0}, Validated as: {1}'.format(valid_1, valid_2))\n return valid_1, valid_2","def processCmdLineArgs(expectedTypes, usage):\n\targs = []\n\tnumComLineArgs = len(sys.argv)\n\tnumExpected = len(expectedTypes)\n\tif (numComLineArgs - 1 == len(expectedTypes)):\n\t\ttry:\n\t\t\tfor i in range(0, numExpected):\n\t\t\t\tif (expectedTypes[i] == typeInt):\n\t\t\t\t\targs.append(int(sys.argv[i+1]))\n\t\t\t\telif (expectedTypes[i] == typeFloat):\n\t\t\t\t\targs.append(float(sys.argv[i+1]))\n\t\t\t\telif (expectedTypes[i] == typeString):\n\t\t\t\t\targs.append(sys.argv[i+1])\n\t\texcept ValueError:\n\t\t\tprint (\"expected number of command line arguments found but there is type mis match\")\n\t\t\tsys.exit(1)\n\telse:\n\t\tprint (\"expected number of command line arguments not found\")\n\t\tprint (usage)\n\t\tsys.exit(1)\n\treturn args","def test_type_kwarg(self, parse_input):\n bb = parse_input(\"name testname\\nversion 1.0\\ntarget example (6)\\ntype example (copies=1000)\")\n assert bb.programtype[\"options\"] == {\"copies\": 1000}","def test_atleast_two_arguments_needed_one():\n cli_result = subprocess.run(\n ['kaiba', 'config.js'],\n capture_output=True,\n )\n assert b'the following arguments are required: input' in cli_result.stderr\n assert cli_result.returncode == 2","def test_parser_init_with_valid_project_type(parser):\n parser.parse_args(['--init', 'java'])","def main():\n\targuments_sent = sys.argv\n\tif len(arguments_sent) > 1:\n\t\tfile_path = arguments_sent[1]\n\t\tprocess_based_on_type(file_path)","def get_type_check(self, arg, option):\n pass","def main():\r\n args = sys.argv\r\n print 'Script:', args[0]\r\n args.pop(0)\r\n for i, argument in enumerate(sys.argv):\r\n print 'Argument {}: {}'.format(i, argument)\r\n print 'Type: {}'.format(type(argument))","def test_from_command_line():\n config_file = t_path(\n Path('steps') / 'jwst_generic_pars-makeliststep_0001.asdf'\n )\n args = [config_file]\n step = Step.from_cmdline(args)\n assert isinstance(step, MakeListStep)\n assert step.par1 == 42.0\n assert step.par2 == 'Yes, a string'\n\n results = step.run()\n assert results == DEFAULT_RESULT","def test_from_command_line_override():\n config_file = t_path(\n Path('steps') / 'jwst_generic_pars-makeliststep_0001.asdf'\n )\n args = [config_file, '--par1=0.']\n step = Step.from_cmdline(args)\n assert isinstance(step, MakeListStep)\n assert step.par1 == 0.\n assert step.par2 == 'Yes, a string'\n\n results = step.run()\n assert results == [0., DEFAULT_PAR2, False]","def read_command( argv ):\n from optparse import OptionParser\n usageStr = \"\"\"\n USAGE: python tortoise.py <options>\n EXAMPLES: python tortoise.py --agent ReflexBrain\n OR python tortoise.py -a ReflexBrain\n - run tortoise with the reflex agent\n \"\"\"\n parser = OptionParser(usageStr)\n \n parser.add_option('-a', '--agent', dest = 'agent',\n help = default('The agent to use'),\n metavar = 'TYPE', default = 'ReflexBrain')\n parser.add_option('-w', '--width', dest = 'width',\n help = default('World width'), default = 15)\n parser.add_option('-s', '--speed', dest = 'speed',\n help = default('Speed'), default = 40)\n parser.add_option('-r', '--random-seed', dest = 'random_seed',\n help = default('Random'), default = -1)\n \n options, otherjunk = parser.parse_args(argv)\n\n if len(otherjunk) != 0:\n raise Exception('Command line input not understood: ' + str(otherjunk))\n args = dict()\n \n # Choose a Tortoise solver\n try:\n module = __import__('agents')\n if options.agent in dir(module):\n agent = getattr(module, options.agent)\n args['agent'] = agent()\n else:\n raise Exception('Unknown agent: ' + options.agent)\n except ImportError:\n raise Exception('No file agents.py')\n \n args['width'] = int(options.width)\n args['speed'] = int(options.speed)\n args['random_seed'] = int(options.random_seed)\n return args","def read(self, sys):\n\n # if no options are set, print help\n if len(sys.argv) == 1:\n sys.argv.append('-h')\n\n # make sure parameter file is processed first\n # so that all options on the command line\n # have precedence\n if any(['@' in xx[0] for xx in sys.argv]):\n paridx = [xx[0] for xx in sys.argv].index('@')\n parfile = sys.argv.pop(paridx)\n sys.argv.insert(1, parfile)\n\n opt = self.parser.parse_args()\n\n # transform some parameters to proper types\n try:\n if 1 != opt.beamscaling:\n opt.beamscaling = [float(xx)\n for xx\n in opt.beamscaling.split(',')]\n\n if opt.feed:\n opt.feed = self.parse_range(opt.feed)\n\n if opt.pol:\n opt.pol = self.parse_range(opt.pol)\n\n if opt.window:\n opt.window = self.parse_range(opt.window)\n\n if opt.mapscans:\n opt.mapscans = self.parse_range(opt.mapscans)\n\n if opt.refscans:\n opt.refscans = self.parse_range(opt.refscans)\n\n except ValueError:\n print('ERROR: there is a malformed parameter option')\n print(' please check your command line settings and try again.')\n sys.exit()\n\n opt.units = opt.units.lower()\n\n return opt","def validate_argtype(arg, argtype):\r\n if not isinstance(arg, argtype):\r\n raise HelperException('{0} argument must be of type {1}'.format(\r\n arg, argtype))\r\n return arg","def read_cmd(self):\n\n parser = ArgumentParser(formatter_class=ArgumentDefaultsHelpFormatter)\n req_opts = parser.add_argument_group(\"Required Options\")\n req_opts.add_argument(\"--instance_dir\", required=True,\n help=\"directory with instances (not recursive\")\n \n opt_opts = parser.add_argument_group(\"Optional Options\")\n \n opt_opts.add_argument(\"--fn_suffix\", default=\".*\",\n help=\"suffix of instance file names\")\n opt_opts.add_argument(\"--cutoff\", default=10, type=int,\n help=\"running time cutoff [sec]\")\n opt_opts.add_argument(\"--memlimit\", default=2048, type=int,\n help=\"memory limit\")\n opt_opts.add_argument(\"--ac_budget\", default=360,\n help=\"configuration budget [sec]\")\n opt_opts.add_argument(\"--run_obj\", default=\"runtime\",\n choices=[\"runtime\", \"quality\"],\n help=\"run objective\")\n opt_opts.add_argument(\"--par-factor\", default=10,\n help=\"Factor by which to penalize unsolved instances. Usage may differ based on TAE used.\")\n\n opt_opts.add_argument(\"--binary\", default=\"clingo\",\n help=\"target binary\")\n opt_opts.add_argument(\"--pcs_file\", default=\"pcs/all_params.pcs\",\n help=\"parameter configuration file\")\n opt_opts.add_argument(\"--runsolver\", default=\"binaries/runsolver\",\n help=\"runsolver binary\")\n opt_opts.add_argument(\"--tae_class\", default=None,\n help=\"TAE class to individualize clingo calls -- has to inherit from smac.tae.execute_ta_run_aclib.ExecuteTARunAClib\")\n\n\n opt_opts.add_argument(\"--seed\", default=12345, type=int,\n help=\"random seed\")\n opt_opts.add_argument(\"--verbose_level\", default=logging.INFO,\n choices=[\"INFO\", \"DEBUG\"],\n help=\"random seed\")\n opt_opts.add_argument(\"--tae_args\", default=\"{}\",\n help=\"Miscellaneous options for the TAE\")\n \n\n args_, misc = parser.parse_known_args()\n self._check_args(args_)\n args_.tae_args=json.loads(args_.tae_args)\n\n # remove leading '-' in option names\n misc = dict((k.lstrip(\"-\"), v.strip(\"'\"))\n for k, v in zip(misc[::2], misc[1::2]))\n\n misc[\"instances\"] = self._find_files(dir_=args_.instance_dir, suffix_=args_.fn_suffix)\n misc[\"wallclock_limit\"] = args_.ac_budget\n misc[\"cutoff_time\"] = args_.cutoff\n misc[\"paramfile\"] = args_.pcs_file\n misc[\"algo\"] = \"\"\n misc[\"run_obj\"] = args_.run_obj\n\n return args_, misc","def errFunc(runType):\n logger.error('Execution type not recognized! {}'.format(runType))\n raise InvalidExecutionType('{} is not a valid command'.format(runType))","def _validate_edit_command(args):\n res = _check_entry_name(args)\n if res != 0:\n return res\n\n # If no new type is specified on the command line then leave validation of\n # property arguments to _process_edit_command() when a type of the existing\n # entry is determined.\n if args.type is None:\n return 0\n\n return _check_property_arguments(args, args.type)","def getopt():\n raise NotImplementedError()","def getTRSLanguage():\n try:\n return sys.argv[1]\n except IndexError as error:\n print(\"No language argument\\n\")\n sys.exit()","def check_argv():\n parser = argparse.ArgumentParser(description=__doc__.strip().split(\"\\n\")[0], add_help=False)\n parser.add_argument(\"segment_fn\", type=str, help=\"pickled segmentation file\")\n if len(sys.argv) == 1:\n parser.print_help()\n sys.exit(1)\n return parser.parse_args()","def parse_argument(argument_option):\n index = sys.argv.index(argument_option)\n try:\n argument = sys.argv[index+1]\n except IndexError:\n print('ERROR: Invalid argument!')\n print(__doc__)\n print(unittest.main.__doc__)\n else:\n sys.argv.pop(index)\n sys.argv.pop(index)\n return argument","def check_args():\n schema = Schema({\n 'FOLDREC': Use(open, error='FOLDREC file should be readable'),\n 'CLUSTAL': Use(open, error='CLUSTAL file should be readable'),\n 'CCMPRED': Use(open, error='CCMPRED file should be readable'),\n '--metafold': Use(open, error='METAFOLD_FILE should be readable'),\n '--nb_pdb': And(Use(int), lambda n: 1 <= n <= 405,\n error='--nb_pdb=NUM should be integer 1 <= N <= 405'),\n '--dssp': Use(open, error='dssp/mkdssp should be readable'),\n '--dope': Use(open, error='dope file should be readable'),\n '--benchmark': Use(open, error='BENCHMARK_FILE should be readable'),\n '--cpu': And(Use(int), lambda n: 0 <= n <= cpu_count(),\n error='--cpus=NUM should be integer 1 <= N <= ' + str(cpu_count())),\n # The output PATH is created (if not exists) at the end of the program\n # so we skip the check.\n object: object})\n try:\n schema.validate(ARGUMENTS)\n except SchemaError as err:\n exit(err)","def run(self, line):\r\n if os.name == 'nt':\r\n if not ctypes.windll.shell32.IsUserAnAdmin() != 0:\r\n self.app.typepath.adminpriv = False\r\n elif not os.getuid() == 0:\r\n self.app.typepath.adminpriv = False\r\n\r\n nargv = []\r\n curr = []\r\n argfound = False\r\n\r\n if \"--version\" in line or \"-V\" in line:\r\n sys.stdout.write(\"\"\"%(progname)s %(version)s\\n\"\"\" % \\\r\n {'progname': versioning.__longname__, 'version': \\\r\n versioning.__version__})\r\n sys.stdout.flush()\r\n sys.exit(self.retcode)\r\n\r\n else:\r\n for argument in enumerate(line):\r\n if not argfound and not argument[1].startswith('-'):\r\n nargv = line[argument[0]:]\r\n break\r\n else:\r\n argfound = False\r\n\r\n if argument[1] == \"-c\":\r\n argfound = True\r\n\r\n curr.append(argument[1])\r\n\r\n (self.opts, _) = self.parser.parse_args(curr)\r\n\r\n try:\r\n Encryption.encode_credentials('test')\r\n self.app.set_encode_funct(Encryption.encode_credentials)\r\n self.app.set_decode_funct(Encryption.decode_credentials)\r\n self.encoding = True\r\n except redfish.hpilo.risblobstore2.ChifDllMissingError:\r\n self.encoding = False\r\n\r\n if self.opts.config is not None and len(self.opts.config) > 0:\r\n if not os.path.isfile(self.opts.config):\r\n self.retcode = ReturnCodes.CONFIGURATION_FILE_ERROR\r\n sys.exit(self.retcode)\r\n\r\n self.app.config_file = self.opts.config\r\n\r\n self.app.config_from_file(self.app.config_file)\r\n if self.opts.logdir and self.opts.debug:\r\n logdir = self.opts.logdir\r\n else:\r\n logdir = self.app.config.get_logdir()\r\n\r\n if logdir and self.opts.debug:\r\n try:\r\n os.makedirs(logdir)\r\n except OSError as ex:\r\n if ex.errno == errno.EEXIST:\r\n pass\r\n else:\r\n raise\r\n\r\n if self.opts.debug:\r\n logfile = os.path.join(logdir, versioning.__shortname__+'.log')\r\n\r\n # Create a file logger since we got a logdir\r\n lfile = logging.FileHandler(filename=logfile)\r\n formatter = logging.Formatter(\"%(asctime)s %(levelname)s\\t: \" \\\r\n \"%(message)s\")\r\n\r\n lfile.setFormatter(formatter)\r\n lfile.setLevel(logging.DEBUG)\r\n LOGGER.addHandler(lfile)\r\n self.app.LOGGER = LOGGER\r\n\r\n cachedir = None\r\n if self.opts.nocache:\r\n self.app.config.set_cache(False)\r\n else:\r\n self.app.config.set_cachedir(os.path.join(self.opts.config_dir, \\\r\n 'cache'))\r\n cachedir = self.app.config.get_cachedir()\r\n\r\n if cachedir:\r\n try:\r\n os.makedirs(cachedir)\r\n except OSError as ex:\r\n if ex.errno == errno.EEXIST:\r\n pass\r\n else:\r\n raise\r\n\r\n if (\"login\" in line or any(x.startswith(\"--url\") for x in line) or not line)\\\r\n and not (any(x.startswith((\"-h\", \"--h\")) for x in nargv) or \"help\" in line):\r\n self.app.logout()\r\n else:\r\n self.app.restore()\r\n self.opts.is_redfish = self.app.updatedefinesflag(redfishflag=\\\r\n self.opts.is_redfish)\r\n\r\n if nargv:\r\n try:\r\n self.retcode = self._run_command(self.opts, nargv)\r\n if self.app.config.get_cache():\r\n if (\"logout\" not in line) and (\"--logout\" not in line):\r\n self.app.save()\r\n else:\r\n self.app.logout()\r\n except Exception as excp:\r\n self.handle_exceptions(excp)\r\n\r\n return self.retcode\r\n else:\r\n self.cmdloop(self.opts)\r\n\r\n if self.app.config.get_cache():\r\n self.app.save()\r\n else:\r\n self.app.logout()","def test_parser_init_with_invalid_project_type(parser):\n with pytest.raises(SystemExit):\n parser.parse_args(['--init', 'error'])","def validate_command_line_input(args):\n valid = False\n if 0 < len(args) <= 4:\n valid = True\n for arg in args:\n if int(arg) > 4:\n valid = False\n break\n else:\n pass\n if valid:\n CRUDStarter.load_operations(args)\n pass\n else:\n CRUDStarter.logger.info(\"Argument maximum acceptable value is 4\")\n else:\n CRUDStarter.logger.info(\"at least One at most Four argument(s) required\")","def check_input_options(args):\n\n # Make sure the input file is trimmed for use later on in the program.\n args.input_file = args.input_file.strip()\n\n # Make sure the output_type string(s) is(are) trimmed and lowercase.\n args.output_type = [x.strip().lower() for x in args.output_type]\n\n # The DPI value must be greater than zero...\n if args.dpi_val <= 0.:\n raise ValueError(\"DPI value must be > 0.\")","def check_input_options(args):\n\n # Make sure the input file is trimmed for use later on in the program.\n args.input_file = args.input_file.strip()\n\n # Make sure the output_type string(s) is(are) trimmed and lowercase.\n args.output_type = [x.strip().lower() for x in args.output_type]\n\n # The DPI value must be greater than zero...\n if args.dpi_val <= 0.:\n raise ValueError(\"DPI value must be > 0.\")","def main(args):\n cli = CLI()\n # Check arguments\n cli.parse_arguments(args)","def readCommand( argv ): ## argv belongs to the 'sys'-library and can be called through sys.argv. The function reads the console's comand line argument and passes it to a variable like so: args = sys.argv[1:]\n from optparse import OptionParser ## Option Parser is a powerful library for passing command line options (an advanced args) if you like. It allows you to add options by defining attributes. \n usageStr = \"\"\" \n USAGE: python pacman.py <options> \n EXAMPLES: (1) python pacman.py\n - starts an interactive game\n (2) python pacman.py --layout smallClassic --zoom 2\n OR python pacman.py -l smallClassic -z 2\n - starts an interactive game on a smaller board, zoomed in\n \"\"\" \n parser = OptionParser(usageStr) ## This creates the Option Parser instance. It also passes the usageStr which functions as a little help-text for the user.\n\n ### In this section all the option strings are defined. Typically each option has one short option string and one long option string. For example the parser.add_option('-n'... has '-n' as short and '--numGames' as the long option string. Both have the same effect. The option argument will be the same and be saved as the variabme 'numGames'. \n parser.add_option('-n', '--numGames', dest='numGames', type='int', \n help=default('the number of GAMES to play'), metavar='GAMES', default=1) ## the syntax for the options is (based on the example in this line) --n 3. This means that the value '3' would be assigned to the variable numGames.\n parser.add_option('-l', '--layout', dest='layout',\n help=default('the LAYOUT_FILE from which to load the map layout'), #The instance -> 'options.layout' defines the layout_file from which to load the map layout; DEFAULT = medium_classic\n metavar='LAYOUT_FILE', default='mediumClassic')\n parser.add_option('-p', '--pacman', dest='pacman',\n help=default('the agent TYPE in the pacmanAgents module to use'), #The instance -> 'options.pacman' defines which of the agent TYPE in the pacmanAgents moduleto use.\n metavar='TYPE', default='KeyboardAgent')\n parser.add_option('-t', '--textGraphics', action='store_true', dest='textGraphics',\n help='Display output as text only', default=False)\n parser.add_option('-q', '--quietTextGraphics', action='store_true', dest='quietGraphics',\n help='Generate minimal output and no graphics', default=False)\n parser.add_option('-g', '--ghosts', dest='ghost',\n help=default('the ghost agent TYPE in the ghostAgents module to use'),\n metavar = 'TYPE', default='RandomGhost')\n parser.add_option('-k', '--numghosts', type='int', dest='numGhosts',\n help=default('The maximum number of ghosts to use'), default=4)\n parser.add_option('-z', '--zoom', type='float', dest='zoom',\n help=default('Zoom the size of the graphics window'), default=1.0)\n parser.add_option('-f', '--fixRandomSeed', action='store_true', dest='fixRandomSeed',\n help='Fixes the random seed to always play the same game', default=False)\n parser.add_option('-r', '--recordActions', action='store_true', dest='record',\n help='Writes game histories to a file (named by the time they were played)', default=False)\n parser.add_option('--replay', dest='gameToReplay',\n help='A recorded game file (pickle) to replay', default=None)\n parser.add_option('-a','--agentArgs',dest='agentArgs',\n help='Comma separated values sent to agent. e.g. \"opt1=val1,opt2,opt3=val3\"')\n parser.add_option('-x', '--numTraining', dest='numTraining', type='int',\n help=default('How many episodes are training (suppresses output)'), default=0)\n parser.add_option('--frameTime', dest='frameTime', type='float',\n help=default('Time to delay between frames; <0 means keyboard'), default=0.1)\n parser.add_option('-c', '--catchExceptions', action='store_true', dest='catchExceptions',\n help='Turns on exception handling and timeouts during games', default=False)\n parser.add_option('--timeout', dest='timeout', type='int',\n help=default('Maximum length of time an agent can spend computing in a single game'), default=30)\n\n #ONCE ALL THE OPTIONS HAVE BEEN DEFINED, optparse is instructed to parse the programm's command line.\n ##> The parser.parse_args() returns two values:\n ### (A) OPTIONS: An object containing values for all of your options e.g.:e.g. if --file takes a single string argument, then options.file will be the filename supplied by the user, or None if the user did not supply that option\n ### (B) ARGS: The list of positional arguments leftover after parsing options (we call this here otherjunk)\n options, otherjunk = parser.parse_args(argv) ## if the user happens to accidentally enter a command other than the specified arguments specified by parser.add_option it is passed to otherjunk\n if len(otherjunk) != 0: ## if there actually ends up to be a value in the otherjunk the program raises an Exception.\n raise Exception('Command line input not understood: ' + str(otherjunk))\n args = dict() # ARGS IS THE VARIABLE THAT IS BEING RETURNED BY THE readCommand function.\n\n # Fix the random seed\n if options.fixRandomSeed: random.seed('cs188') # 'random.seed' is part of the random class. The random.seed([x]) command initialises a standard random number. Optional argument x can be any hashable object. \n\n # Choose a layout\n args['layout'] = layout.getLayout( options.layout ) # REF_LAYOUT111: layout.py --> This function returns the layout object that was created by the layout class via the getlayout function. This contains the height, width, walls, food, captules and agent positions etc.\n if args['layout'] == None: raise Exception(\"The layout \" + options.layout + \" cannot be found\")\n\n # Choose a Pacman agent\n noKeyboard = options.gameToReplay == None and (options.textGraphics or options.quietGraphics) ## noKeyboard is set to TRUE if the user chooses the --replay and text- or silent graphics option.\n ##print noKeyboard\n pacmanType = loadAgent(options.pacman, noKeyboard) ## [see REFERENCE_001]: the loadAgent function takes the pacman argument the user passed into the command line as the option--pacman option identifies the appropriate agent (which may be the programmed agent or whost agent). \n agentOpts = parseAgentArgs(options.agentArgs) ##Passes the option.agentArgs which was captured by the user's console input into the agentOps variable. agentArgs is: \"Comma separated values sent to agent. e.g. \"opt1=val1,opt2,opt3=val3. The ParseAgentArgs function converts the option - value pairings into a dictionary formatted opts[opt1] = val1. \n if options.numTraining > 0: ##numTraining was captured by the user's console input and designates how many games are training games which means that the output remains surpressed.\n args['numTraining'] = options.numTraining ## This takes the user's input as the -x or --numTraining and passes it to the args dictionary with the numTraining key as the args['numTraining'] variable.\n if 'numTraining' not in agentOpts: agentOpts['numTraining'] = options.numTraining ## This integrates the variable entered into as training rounds in the agentOpts variable.\n pacman = pacmanType(**agentOpts) ## REFERENCE002 ##Instantiate Pacman with agentOpts. ## The variable pacmanType contains a reference to agent module loaded by the load Agent function. This function does not cause the module to be instanciated. This happens when here ## See[REFERENCE_001]: ## The * and ** will 'soak up' any remaining values not otherwise accounted for. In this case these options are basically the agent options the user can input.\n ## agentOpts contains the opts dictionary = {opt1:val1, opt2:val2, opt3:val3}; it also contains the numTraining variable as the ['numTraining'] key. As such it has the following structure. {opt1:val1,opt2:val2,opt3:val3, numTraining:int}.\n args['pacman'] = pacman ## This passes the instanciated object to the agent dictionary containing the pacman key.\n\n # Don't display training games\n if 'numTrain' in agentOpts: ## Checks whether the user has determined a certain number of training games. If they did, the number is passed on as an int to the options.numQuiet and option.numIgnore variables.\n options.numQuiet = int(agentOpts['numTrain']) \n options.numIgnore = int(agentOpts['numTrain'])\n\n # Choose a ghost agent\n ghostType = loadAgent(options.ghost, noKeyboard) ## The options.ghost variable contains the user's ghost type preference as specified in the console.The user can choose between -g RandomGhost which is A ghost that chooses a legal action uniformly at random OR DirectionalGhost, a ghost that prefers to rush Pacman, or flee when scared.\n args['ghosts'] = [ghostType( i+1 ) for i in range( options.numGhosts )] #instanciates as many ghost agents as the player requested by entering the desired number as -k', '--numghosts'in the console.\n\n # Choose a display format ##contains whether the game output is displayed as minimal output and no graphics (-q) text only (-t) or via graphicsDiplay (standard)\n if options.quietGraphics: \n import textDisplay\n args['display'] = textDisplay.NullGraphics()\n elif options.textGraphics:\n import textDisplay\n textDisplay.SLEEP_TIME = options.frameTime\n args['display'] = textDisplay.PacmanGraphics()\n else:\n import graphicsDisplay ## This refers to the module that is responsible for the graphical representation of the game.\n args['display'] = graphicsDisplay.PacmanGraphics(options.zoom, frameTime = options.frameTime) ## This line instanciates the PacmanGraphics class from the graphicsDisplay module and passes the reference to the args['display'] dictionary.\n args['numGames'] = options.numGames \n args['record'] = options.record\n args['catchExceptions'] = options.catchExceptions\n args['timeout'] = options.timeout\n\n # Special case: recorded games don't use the runGames method or args structure\n if options.gameToReplay != None:\n print 'Replaying recorded game %s.' % options.gameToReplay \n import cPickle\n f = open(options.gameToReplay)\n try: recorded = cPickle.load(f)\n finally: f.close()\n recorded['display'] = args['display']\n replayGame(**recorded)\n sys.exit(0)\n\n return args #returns the args-dictionary which contains:\n ##args['pacman'] which contains a dictionary of dictionaries of the agent that was loaded into args['numtraining'] = {agentOpts[opt1]: val1 ; agentOpts[opt2]:val2; agentOpts[opt3]:val3}\n ##args['layout'] - this function returns the layout object that was created by the layout class via the getlayout function.\n ##args['numTraining'] which contains which designates how many games are training games which means that the output remains surpressed\n ##args['ghosts'] - contains the instanciated ghost agents in line with the number the user specified\n ##args['display'] - contains whether the game output is displayed as minimal output and no graphics (-q) text only (-t) or via graphicsDiplay (standard)\n ##args['numGames'] - the number of GAMES to play\n ##args['record'] - Writes game histories to a file (named by the time they were played)\n ##args['catchExceptions'] = options.catchExceptions - Turns on exception handling and timeouts during games\n ##args['timeout'] = options.timeout -Maximum length of time an agent can spend computing in a single game","def configure_commandline(cmdline_arguments: argparse.Namespace) -> Optional[Text]:","def main():\n\tn = len(sys.argv)\n\tif n == 1:\n\t main_menu()\n\telif n > 3:\n\t print(\"Invalid number of args\")\n\telse:\n\t features = {\n\t \"add\": add,\n\t \"help\": main_menu,\n\t \"ls\": getTasks,\n\t \"done\": markOff,\n\t \"report\": getReport,\n\t \"del\": deleteTask}\n\t choosedFeature = features.get(sys.argv[1],\"Invalid Argument\")\n\t if choosedFeature == \"Invalid Argument\":\n\t \tprint(choosedFeature)\n\t else:\n\t \tchoosedFeature()","def parse_arguments(args):","def test_invalid_arguments(self):\n # More than two arguments should report an error.\n exit_code, output = run_cli('a', 'b', 'c')\n assert exit_code != 0\n assert \"Error\" in output\n # Invalid `ionice' values should report an error.\n exit_code, output = run_cli('--ionice=foo')\n assert exit_code != 0\n assert \"Error\" in output","def main():\n opt = parse_opts()\n run(opt)","def main():\n opt = parse_opts()\n run(opt)","def check_input(args):\n\n # Defaults\n option = ''\n fh = sys.stdin # file handle\n\n if not len(args):\n # Reading from pipe with default option\n if sys.stdin.isatty():\n sys.stderr.write(__doc__)\n sys.exit(1)\n\n elif len(args) == 1:\n # One of two options: option & Pipe OR file & default option\n if args[0].startswith('-'):\n option = args[0][1:]\n if sys.stdin.isatty(): # ensure the PDB data is streamed in\n emsg = 'ERROR!! No data to process!\\n'\n sys.stderr.write(emsg)\n sys.stderr.write(__doc__)\n sys.exit(1)\n\n else:\n if not os.path.isfile(args[0]):\n emsg = 'ERROR!! File not found or not readable: \\'{}\\'\\n'\n sys.stderr.write(emsg.format(args[0]))\n sys.stderr.write(__doc__)\n sys.exit(1)\n\n fh = open(args[0], 'r')\n\n elif len(args) == 2:\n # Two options: option & File\n if not args[0].startswith('-'):\n emsg = 'ERROR! First argument is not an option: \\'{}\\'\\n'\n sys.stderr.write(emsg.format(args[0]))\n sys.stderr.write(__doc__)\n sys.exit(1)\n\n if not os.path.isfile(args[1]):\n emsg = 'ERROR!! File not found or not readable: \\'{}\\'\\n'\n sys.stderr.write(emsg.format(args[1]))\n sys.stderr.write(__doc__)\n sys.exit(1)\n\n option = args[0][1:]\n fh = open(args[1], 'r')\n\n else: # Whatever ...\n sys.stderr.write(__doc__)\n sys.exit(1)\n\n # Validate option\n if len(option) > 1:\n emsg = 'ERROR!! Alternate location identifiers must be single '\n emsg += 'characters: \\'{}\\''\n sys.stderr.write(emsg.format(option))\n sys.exit(1)\n\n return (option, fh)","def get_file_read_arg(self):\n\ttry:\n\t arg = sys.argv[1]\n\t file_read = str(arg)\n\texcept IndexError:\n\t print \"Please provide the name of the file that you wish to receive.\"\n\t sys.exit(\"Example usage:\\n\\nclient.py myfile.txt receivedfile.txt 127.0.0.1 6060 0.0\") \n\tif (len(file_read) > 100):\n\t print \"Name of file must be equal to or less than 100 characters.\"\n\t sys.exit(\"Example usage:\\n\\nclient.py myfile.txt receivedfile.txt 127.0.0.1 6060 0.0\")\n\telse:\n\t return file_read","def get_command_line_args(argv):\n # Initialize the arguments to their default values \n\n args = {'startdate': '20200101',\n 'enddate': '20200102',\n 'outfile': 'test.nc',\n 'dt': 5,\n 'real': True,\n 'south': False,\n 'tcv': False,\n 'substorm': False,\n 'ions': False,\n 'move': False,\n 'cusp': False}\n\n arg_type = {'startdate': str,\n 'enddate': str,\n 'outfile': str,\n 'dt': float,\n 'real': bool,\n 'south': bool,\n 'tcv': bool,\n 'substorm': bool,\n 'ions': bool,\n 'move': bool,\n 'cusp': bool}\n \n # If there is input, set default help to False\n args['help'] = False if len(argv) > 0 else True\n \n # Cycle through all arguments except the first, saving input\n for arg in argv:\n # Treat the file list and formatting seperately\n if arg.find('-') == 0:\n # This is not a filename, remove the dash to get the key\n split_arg = arg.split('=')\n akey = split_arg[0][1:]\n # Get the argument value as the desired type\n if akey not in arg_type.keys():\n raise ValueError(''.join(['unknown command line input, ',\n arg, ', try -help for details']))\n\n if len(split_arg) == 1:\n if arg_type[akey] == bool:\n arg_val = True\n else:\n raise ValueError('expected equality after flag {:}'.format(\n akey))\n else:\n if arg_type[akey] == int:\n arg_val = int(split_arg[1])\n elif arg_type[akey] == float:\n arg_val = float(split_arg[1])\n elif arg_type[akey] == str:\n arg_val = split_arg[1]\n else:\n # This is boolean input\n arg_val = bool_string(split_arg[1])\n\n args[akey] = arg_val\n \n return args","def validate_arguments(self,args):\n\t\tif args.org == None:\n\t\t\tprint('Please specify Organization name. Exiting.')\n\t\t\tsys.exit(0)\n\t\tif args.repo == None:\n\t\t\tprint('Please specify Repositories name. Exiting.')\n\t\t\tsys.exit(0)\n\t\tif args.event_type == None:\n\t\t\tprint('Please specify type of the event. Exiting.')\n\t\t\tsys.exit(0)","def get_op():\n if len(sys.argv) < 2:\n print(\"Error! You must enter either '-e' or '-d' as the first argument.\")\n return -1\n return sys.argv[1]","def test_args(self):\n parser = argparse.ArgumentParser(\n prog=\"sysbottle\", description=\"sysbottle is parsed\"\n )\n subparsers = parser.add_subparsers()\n sysbottle.build(subparsers)\n args = parser.parse_args(\n [\n \"sysbottle\",\n \"abc.txt\",\n \"-c\",\n \"90\",\n \"-q\",\n \"1\",\n \"-d\",\n \"sda\",\n \"-i\",\n \"5\",\n \"-t\",\n \"3\",\n ]\n )\n self.assertTrue(hasattr(args, \"file\"))\n self.assertTrue(hasattr(args, \"cpu\"))\n self.assertTrue(hasattr(args, \"diskQ\"))\n self.assertTrue(hasattr(args, \"disks\"))\n self.assertTrue(hasattr(args, \"iowait\"))\n self.assertTrue(hasattr(args, \"throughput\"))","def test_robo():\n print(\n \"Choose the option of input:\\n\"\n \"1. Enter the command string\\n\"\n \"2. Select from input file\"\n )\n option = input(\"Enter 1 or 2 to select the input method:\")\n # Wait till the right option is chosen.\n while not (option == \"1\" or option == \"2\"):\n print(\"Invalid option, please enter valid option\")\n option = input(\"Enter 1 or 2 to select the input method:\")\n\n if option == \"1\":\n command = input(\"Enter the command as string:\")\n # To format the cli command to proper string.\n command = command[1:-1]\n robo = calculate_distance.Robot()\n robo.main(command)\n\n elif option == \"2\":\n file = open(os.path.dirname(__file__) + \"/input.yml\")\n parsed_input_file = yaml.load(file, Loader=yaml.FullLoader)\n command_list = parsed_input_file.get(\"input_list\")\n # To iterate through the list of commands given.\n for item in command_list:\n robo = calculate_distance.Robot()\n robo.main(item)","def get_mode():\n\tprint(\"Please choose the file type that you want to normalize ('band'/'phband'/'dos'): \", end='')\n\twhile True:\n\t\tmode = input()\n\t\tif mode == \"b\" or mode == \"band\" : return \"band\"\n\t\telif mode == \"pb\" or mode == \"phband\": return \"phband\"\n\t\telif mode == \"d\" or mode == \"dos\" : return \"dos\"\n\t\telif mode == \"phd\" or mode == \"phdos\" :\n\t\t\tprint(\"phdos-files don't need to be normalized; if you wanna change the unit, plz try other programs.\"); exit(1)\n\t\telse: print(\"Plz enter 'band'/'b', 'phband'/'pb', or 'dos'/'d': \", end=\"\")","def main(args):","def main(args):","def read_type():\n\twhile True:\n\t\t_type = input(\"Introduceti tipul: \")\n\t\tif (is_in_list(_type, VALID_TYPES)):\n\t\t\treturn (_type)\n\t\telse:\n\t\t\tprint(\"Tipul este invalid.\")","def test_filename_required():\n with pytest.raises(SystemExit):\n cli.parse_args(['-f'])","def ReadArguments():\n\n args = ParseArguments()\n\n logging.info('Command line arguments...')\n for arg in vars(args):\n logging.info(str(arg) + ': ' + str(getattr(args, arg)))\n logging.info('')\n\n IsTest(args)\n ProcessCacheSize(args)\n ProcessLineSize(args)\n ProcessMulti(args)\n ProcessMemPattern(args)\n ProcessMemFile(args)","def parameters_are_valid():\n # The only accepted number of command line arguments is 3: they are\n # aggregator.py, the filename, and the topic\n if len(sys.argv) != 3:\n # Issue error message if invalid number of command line arguments\n print(\"Error: invalid number of arguments\")\n print(\"Usage: aggregator.py filename topic\")\n return False\n else:\n return True","def test_exit_on_wrong_type(self):\n with self.assertRaises(SystemExit):\n pyint = Interpreter()\n pyint.run(file=WRONG_TYPE)","def handleCmdLine(self):\n description = \"Nagios monitoring script to check for open ports\\n\"\n usage = (\"%prog <options>\\n\")\n parser = OptionParser(usage=usage, description=description)\n\n parser.add_option(\"-c\", \"--config\",\n type=\"string\",\n help=\"path to open ports configuration file\")\n parser.add_option(\"-l\", \"--list\",\n type=\"string\",\n help=\"supply list of allowed ports seperated by comma.\")\n\n (self.options, args) = parser.parse_args()","def get_input_file():\n if len(sys.argv) < 3:\n return -1\n return sys.argv[2]","def main():\n try:\n string = sys.argv[1]\n substring = sys.argv[2]\n\n except IndexError:\n string = None\n substring = None\n\n try:\n sys.argv[3]\n\n except IndexError:\n pass\n\n else:\n print(\" More than expected Number of Arguments\")\n string = None\n substring = None\n\n RabinKarp(string, substring)","def parseArg(self, c):\n\n\t\tif rocks.app.Application.parseArg(self,c):\n\t\t\treturn 1\n\t\telif c[0] in ('-h', '--help'):\n\t\t\tself.help()\n\t\telif c[0] in ('-x', '--xml'):\n\t\t\tself.xmlname = c[1]\n\t\telse:\n\t\t\treturn 0\n\t\treturn 1","def parse_cmdline():\n\tparser = ArgumentParser(prog=\"FastP_QC.py\", description=\"\"\"Script collects stats from fastp jsons.\"\"\")\n\tparser.add_argument(\"-r1\", \"--r1_stats\", dest=\"r1_stats\", action=\"store\", required=True, help=\"Text file with r1 stats, from q30.py script.\")\n\tparser.add_argument(\"-r2\", \"--r2_stats\", dest=\"r2_stats\", action=\"store\", required=True, help=\"Text file with r2 stats, from q30.py script.\")\n\tparser.add_argument(\"-n\", \"--name\", dest=\"name\", action=\"store\", required=True, help=\"Sample name\")\n\targs = parser.parse_args()\n\treturn args","def command_line_arguments():\n\n try:\n parser = argparse.ArgumentParser(description='Log Handler/Cleaner/Copier for Idemia DocAuth')\n\n # Add required arguments.\n parser.add_argument('action', choices=['clean', 'download'], type=str, help='clean or download')\n\n # Parse the arguments\n args = parser.parse_args()\n\n return args\n\n except Exception as err:\n print(err)\n return","def check_args(lst):\n # Must have at least as first argument the zone file to turn to yaml\n if len(lst) < 3 or not os.path.isfile(lst[1]):\n print \"This script needs at least a valid zone file path as argument\"\n print \"Its usage is\", sys.argv[0], \" zonefile_path domain_name\"\n print \"zonefile_path being the path to the zone file and domain_name the domain name\"\n sys.exit(\"Insufficient Number of Arguments\")","def handle_cmdline():\n\n cmdline = ArgumentParser(init_args=['address', 'arch', 'file'],\n address_required=True, address_default=None,\n file_required=True,\n file_help='Flash or memory image to inspect',\n formatter_class=RawDescriptionHelpFormatter,\n usage=_USAGE, description=_DESCRIPTION, epilog=_EPILOG)\n\n cmdline.add_argument('--longhelp',\n choices=['Y', 'N'],\n default=None,\n help=_LONGHELP_TEXT)\n\n cmdline.add_argument('--autocomplete',\n choices=['Y', 'N'],\n default=None,\n help=_AUTOCOMPLETE_TEXT)\n\n cmdline.add_argument('--threshold',\n type=int,\n default=5,\n help='Minimum table size to report. Default: 5')\n\n cmdline.add_argument('--subcmds',\n action='store_true',\n default=False,\n help='Include sub-command tables in displayed results')\n\n cmdline.add_argument('--details',\n action='store_true',\n default=False,\n help='Display more detailed output')\n\n args = cmdline.parse_args()\n\n if args.longhelp is not None:\n args.longhelp = args.longhelp == 'Y'\n\n if args.autocomplete is not None:\n args.autocomplete = args.autocomplete == 'Y'\n\n return args","def get_port_arg(self):\n\ttry:\n\t arg = sys.argv[4]\n\t port = int(arg) \n\texcept ValueError:\n\t print \"Port must be a number only.\"\n\t sys.exit(\"Example usage:\\n\\nclient.py myfile.txt receivedfile.txt 127.0.0.1 6060 0.0\")\t \n\texcept IndexError:\n\t print \"Port number must be provided.\"\n\t sys.exit(\"Example usage:\\n\\nclient.py myfile.txt receivedfile.txt 127.0.0.1 6060 0.0\")\t \n\tif any([port < 1024, port > 60000]):\n\t print \"Port must be between 1024 and 60000\"\n\t sys.exit(\"Example usage:\\n\\nclient.py myfile.txt receivedfile.txt 127.0.0.1 6060 0.0\")\t \n\telse:\n\t return port","def process_check_input_argument():\n\n try:\n input_argv = sys.argv[1]\n if input_argv == \"0\":\n stand_alone_flag = 0\n else:\n stand_alone_flag = 0\n except IndexError:\n stand_alone_flag = 1\n\n return stand_alone_flag","def getArg(flag):\n try:\n a = sys.argv[sys.argv.index(flag) + 1]\n except:\n return \"\"\n else:\n return a","def parse_command_line_arguments(command_line_arguments):\n # First determine if a we're loading from a file\n filename = False\n if \"--file\" in command_line_arguments:\n index = command_line_arguments.index(\"--file\")+1\n filename = command_line_arguments[index]\n if output.tracking_suffix in filename:\n # Assumes simulation in progress. So, if final_sweep ==\n # current_sweep, the simulation will load and then\n # immediately end.\n return get_progress_file_info(filename)\n if not (output.output_suffix in filename):\n raise ValueError(\"Can only load from *.boundaryprg2p1 or \"\n +\"*.boundary2p1 files!\")\n # If filename is of type *.boundary2p1, we assume its okay and\n # load from it. None of the other command line arguments\n # change.\n\n if \"--select\" in command_line_arguments:\n index = command_line_arguments.index(\"--select\")+1\n if command_line_arguments[index] == \"std\":\n algorithm = monte_carlo.select_for_curvature\n elif command_line_arguments[index] == \"area\":\n algorithm = monte_carlo.select_for_area\n else:\n algorithm = default_algorithm\n else:\n algorithm = default_algorithm \n\n if \"--target-area\" in command_line_arguments:\n index = command_line_arguments.index(\"--target-area\")+1\n target_area = int(eval(command_line_arguments[index]))\n else:\n target_area = int(eval(command_line_arguments[0]))\n\n if \"--target-std\" in command_line_arguments:\n index = command_line_arguments.index(\"--target-std\")+1\n target_std = float(eval(command_line_arguments[index]))\n else:\n target_std = default_target_std\n\n if \"--area-damping\" in command_line_arguments:\n index = command_line_arguments.index(\"--area-damping\")+1\n area_damping_strength = float(eval(command_line_arguments[index]))\n else:\n area_damping_strength = default_area_damping\n if not 0 <= area_damping_strength <= 1:\n raise ValueError(\"Damping must be between 0 and 1.\")\n\n if \"--std-damping\" in command_line_arguments:\n index = command_line_arguments.index(\"--std-damping\")+1\n std_damping_strength = float(eval(command_line_arguments[index]))\n else:\n std_damping_strength = default_std_damping\n if not 0 <= area_damping_strength <= 1:\n raise ValueError(\"Damping must be between 0 and 1.\")\n\n if \"--initial\" in command_line_arguments:\n index = command_line_arguments.index(\"--initial\")+1\n initial_sweep = int(eval(command_line_arguments[index]))\n else:\n initial_sweep = default_initial_sweep\n\n if \"--final\" in command_line_arguments:\n index = command_line_arguments.index(\"--final\")+1\n final_sweep = int(eval(command_line_arguments[index]))\n else:\n final_sweep = default_final_sweep\n\n if \"--save\" in command_line_arguments:\n index = command_line_arguments.index(\"--save\")+1\n save_every_n_sweeps = int(eval(command_line_arguments[index]))\n else:\n save_every_n_sweeps = default_save_every_n_sweeps\n if save_every_n_sweeps < 1:\n raise ValueError(\"You must save at least every 1 sweeps!\")\n\n if \"--v5\" in command_line_arguments:\n index = command_line_arguments.index(\"--v5\")+1\n v5damping = int(eval(command_line_arguments[index]))\n else:\n v5damping = target_area/10\n\n if \"--v6\" in command_line_arguments:\n index = command_line_arguments.index(\"--v6\")+1\n v6damping = int(eval(command_line_arguments[index]))\n else:\n v6damping = target_area/10\n \n if \"--many\" in command_line_arguments:\n if \"--one\" in command_line_arguments or \"--exact\" in command_line_arguments:\n raise ValueError(\"Contradictory input!\")\n if \"--micro\" in command_line_arguments:\n gather_data_function = output.save_many_microscopically_optimal\n else:\n gather_data_function = output.gather_data_to_n_files\n elif \"--one\" in command_line_arguments:\n if \"--many\" in command_line_arguments or \"--exact\" in command_line_arguments:\n raise ValueError(\"Condtradictory input!\")\n if \"--micro\" in command_line_arguments:\n gather_data_function = output.stop_at_microscopically_optimal\n else:\n gather_data_function = output.gather_data_to_1_file\n elif \"--exact\" in command_line_arguments:\n if \"--many\" in command_line_arguments or \"--one\" in command_line_arguments:\n raise ValueError(\"Contradictory input!\")\n gather_data_function = output.generate_n_exact_spheres\n index = command_line_arguments.index(\"--exact\")+1\n # In this case, v5damping is fitness_damping, as defined\n # in generate_n_exact_spheres\n v5damping = int(eval(command_line_arguments[index]))\n else:\n if \"--micro\" in command_line_arguments:\n gather_data_function = output.stop_at_microscopically_optimal\n else:\n gather_data_function = output.gather_data_to_1_file\n\n # return a class with all the info we need\n params = parameters(filename, target_area, area_damping_strength,\n target_std, std_damping_strength,\n initial_sweep, final_sweep,\n save_every_n_sweeps,\n v5damping, v6damping,\n algorithm,\n gather_data_function)\n return params","def validate_args(args):\n if len(args) != 4:\n print(\"ERROR: incorrect length of args.\")\n cli_help_msg()\n sys.exit()\n\n #first argument: check it is a read directory\n if args[1].lower().strip() == 'docid' or args[1].lower().strip() == 'docno':\n print(\"ERROR: incorrect key. Please pass 'docid' or 'docno'\")\n sys.exit()","def main(args=None):","def main(args=None):","def parse_command_line():\n parser = argparse.ArgumentParser()\n\n # All reference encoders\n parser.add_argument(\"--step\", dest=\"step\", default=\"10\", type=int, help=\"step size\")\n parser.add_argument(\"--repeats\", dest=\"repeats\", type=int, default=1, help=\"repeats\")\n\n parser.add_argument(dest=\"image\", default=None,\n help=\"select the test image to run\")\n\n args = parser.parse_args()\n return args","def read_opts(self):\n\n # process any optlist_ options\n self.valid_opts.check_special_opts(sys.argv)\n\n # ------------------------------------------------------------\n # terminal arguments, first\n\n # cannot have len(argv) <= 1 here, but be consistent with other progs\n if len(sys.argv) <= 1 or '-help' in sys.argv:\n print g_help_string\n return 0\n\n if '-hist' in sys.argv:\n print g_history\n return 0\n\n if '-ver' in sys.argv:\n print g_version\n return 0\n\n if '-show_valid_opts' in sys.argv:\n self.valid_opts.show('', 1)\n return 0\n\n # ------------------------------------------------------------\n # read all user options\n\n self.user_opts = self.OL.read_options(sys.argv, self.valid_opts)\n if not self.user_opts: return 1 # error condition\n\n return None # normal completion","def getArgs():\r\n parser = argparse.ArgumentParser(\r\n description = \"\"\"This program uses the validation data and a given model to do brain segmentation that will be sent to FeTs challenge to get evaluated \"\"\")\r\n parser.add_argument(\"-d\", type = str, help = \"d is the path to validation dataset, e.g: C:/Documents/MICCAI_FeTS2021_TrainingData/\")\r\n parser.add_argument(\"-m\", type = str, help = \"m is the path for the model to load, e.g: C:/Documents/MICCAI_FeTS2021_TrainingData/cpt/cpt_0_1\")\r\n parser.add_argument(\"-o\", type = str, help = \"o is the output path, e.g: C:/Documents/inferences\")\r\n # Get your arguments\r\n return parser.parse_args()","def runmain(args):\n\n #case: no extra args, so return help\n if len(args) == 0:\n print USAGE\n return\n\n toolname = args[1]\n if toolname == 'help':\n print USAGE\n return\n\n elif toolname == 'splitdata':\n splitdata(args)\n return\n \n elif toolname == 'aboutdata':\n aboutdata(args)\n return\n\n elif toolname == 'test':\n testffx(args)\n return\n \n else:\n print \"There is no toolname of '%s'.\" % toolname\n print USAGE\n return","def _cli_validate(self, settings, remaining_argv):\n return None","def grabRequiredArgs(passed_required_arg,required_arg,required_arg_type):\n \n # Check for correct number of arguments\n if len(passed_required_arg) - 1 < len(required_arg):\n print \"Missing arguments(s)\"\n print \"Try --help for options.\"\n sys.exit(1)\n \n # Pull command line values and place in dictionary with correct argument\n # identifier\n required_arg_values = {}\n for i in range(0,len(required_arg)):\n required_arg_values.update([(required_arg[i],passed_required_arg[i+1])])\n \n # Do a few sanity checks on required arguments (using required_arg_type)\n for index, arg in enumerate(required_arg):\n # Check for input file existance\n if required_arg_type[index] == 'inpfile':\n try:\n open(required_arg_values[arg],'r')\n except IOError:\n print \"File '\" + required_arg_values[arg] + \"' not readable!\"\n sys.exit(2)\n \n # Prompt before overwriting output files\n if required_arg_type[index] == 'outfile':\n try:\n open(required_arg_values[arg],'r')\n except IOError:\n continue\n decision = raw_input(\"Warning! File '\" + required_arg_values[arg] \\\n + \"' already exists! overwrite (y/n)? \")\n if decision[0] == 'Y' or decision[1] == 'y':\n os.remove(required_arg_values[arg])\n else:\n sys.exit()\n \n # Check for directory existance\n if required_arg_type[index] == 'outdir':\n try:\n os.listdir(required_arg_values[arg])\n except OSError:\n decision = raw_input(\"Directory '\" + required_arg_values[arg] + \\\n \"' does not exist. Create it (y/n)? \")\n if decision[0] == 'Y' or decision[0] == 'y':\n os.mkdir(required_arg_values[arg])\n else:\n sys.exit()\n \n # If there are any more arguments on the command line, report them and\n # ignore them.\n if len(passed_required_arg) - 1 > len(required_arg):\n print \"Trailing arguments (not evaluated):\"\n for trailer in passed_required_arg[len(required_arg):]:\n print trailer\n \n return required_arg_values","def check_input_args(in_arg, phase=\"train\"):\n\n if phase==\"train\": \n # Check that flowers directory exists \n if not path.isdir(in_arg.data_dir):\n print(\"For data loading: can't find directory '{}' starting from '{}'. Please check the paths and run again!\" . format(in_arg.data_dir, os.getcwd()))\n sys.exit(0)\n \n # Check that checkpoints directory exists\n if not path.isdir(in_arg.save_dir):\n print(\"For checkpoints saving: can't find directory '{}' starting from '{}'. Please check the paths and run again!\" . format(in_arg.save_dir, os.getcwd()))\n sys.exit(0) \n \n else:\n # phase == predict\n # Check that the flower name exists. Example: \"/data/flowers/test/25/image_06583.jpg\"\n if not path.isfile(in_arg.image_file):\n print(\"Image file: can't find file '{}' starting from '{}'. Please check the path, filename and run again!\" . format(in_arg.image_file, os.getcwd()))\n sys.exit(0) \n \n if not path.isfile(in_arg.checkpoint):\n print(\"Checkpoint file: can't find file '{}' starting from '{}'. Please check the path, filename and run again!\" . format(in_arg.checkpoint, os.getcwd()))\n sys.exit(0)\n \n if in_arg.category_names and not path.isfile(in_arg.category_names):\n print(\"Category names file: can't find file '{}' starting from '{}'. Please check the path, filename and run again!\" . format(in_arg.category_names, os.getcwd()))\n sys.exit(0) \n \n # All cases\n\n # Check that the architecture is supported\n if in_arg.arch not in ['alexnet', 'resnet18', 'vgg19_bn']:\n print(\"Architecture can only be: alexnet, resnet18 or vgg19_bn. Please check the architecture and run again!\")\n sys.exit(0) \n \n # Check that a valid value has been set for gpu\n if in_arg.gpu != 0 and in_arg.gpu != 1:\n print(\"GPU can only be set to 0 (disable) or 1 (enable)! Please check the value and run again!\")\n sys.exit(0)","def checkCommandArgs():\n try:\n int(sys.argv[1]) #sin\n int(sys.argv[2]) #sout\n int(sys.argv[3]) #csin\n except (ValueError, IndexError) as e:\n print (\"One or more port numbers are not ints or were not entered\")\n sys.exit()\n \n for i in range(3):\n if int(sys.argv[i+1]) > PORT_RANGE_UPPER or int(sys.argv[i+1]) < PORT_RANGE_LOWER:\n print(\"One or more port number out of range\")\n sys.exit()\n \n if not os.path.isfile(sys.argv[4]):\n print(\"file does not exist\")\n sys.exit()\n \n return int(sys.argv[1]), int(sys.argv[2]), int(sys.argv[3]), sys.argv[4]","def test_type_name(self, parse_input):\n bb = parse_input(\"name testname\\nversion 1.0\\ntype type\")\n assert bb.programtype[\"name\"] == \"type\"","def run(self):\n if len(sys.argv[1:]) == 0:\n arg_parse.print_help()\n arg_parse.exit()\n\n try:\n if args.unix:\n self.from_unix_sec()\n print (\"Unix Seconds: \" + self.in_unix_sec + \" UTC\")\n elif args.umil:\n self.from_unix_milli()\n print (\"Unix Milliseconds: \" + self.in_unix_milli + \" UTC\")\n elif args.wh:\n self.from_win_64_hex()\n print (\"Windows 64 bit Hex BE: \" + self.in_windows_hex_64 + \" UTC\")\n elif args.whle:\n self.from_win_64_hexle()\n print (\"Windows 64 bit Hex LE: \" + self.in_windows_hex_le + \" UTC\")\n elif args.goog:\n self.from_chrome()\n print (\"Google Chrome Time: \" + self.in_chrome + \" UTC\")\n elif args.active:\n self.from_ad()\n print (\"Active Directory Timestamp: \" + self.in_ad + \" UTC\")\n elif args.uhbe:\n self.from_unix_hex_32be()\n print (\"Unix Hex 32 bit BE: \" + self.in_unix_hex_32 + \" UTC\")\n elif args.uhle:\n self.from_unix_hex_32le()\n print (\"Unix Hex 32 bit LE: \" + self.in_unix_hex_32le + \" UTC\")\n elif args.cookie:\n self.from_cookie()\n print (\"Windows Cookie Date: \" + self.in_cookie + \" UTC\")\n elif args.oleb:\n self.from_ole_be()\n print (\"Windows OLE 64 bit double BE: \" + self.in_ole_be + \" UTC\")\n elif args.olel:\n self.from_ole_le()\n print (\"Windows OLE 64 bit double LE: \" + self.in_ole_le + \" UTC\")\n elif args.mac:\n self.from_mac()\n print (\"Mac Absolute Time: \" + self.in_mac + \" UTC\")\n elif args.hfsdec:\n self.from_hfs_dec()\n print (\"Mac OS/HFS+ Decimal Date: \" + self.in_hfs_dec + \" UTC\")\n elif args.hfsbe:\n self.from_hfs_be()\n print (\"HFS/HFS+ 32 bit Hex BE: \" + self.in_hfs_be + \" HFS Local / HFS+ UTC\")\n elif args.hfsle:\n self.from_hfs_le()\n print (\"HFS/HFS+ 32 big Hex LE: \" + self.in_hfs_le + \" HFS Local / HFS+ UTC\")\n elif args.msdos:\n self.from_msdos()\n print (\"MS-DOS 32 bit Hex Value: \" + self.in_msdos + \" Local\")\n elif args.fat:\n self.from_fat()\n print (\"FAT Date + Time: \" + self.in_fat + \" Local\")\n elif args.sys:\n self.from_systime()\n print (\"Microsoft 128 bit SYSTEMTIME: \" + self.in_systemtime + \" UTC\")\n elif args.ft:\n self.from_filetime()\n print (\"Microsoft FILETIME/LDAP time: \" + self.in_filetime + \" UTC\")\n elif args.pr:\n self.from_prtime()\n print (\"Mozilla PRTime: \" + self.in_prtime + \" UTC\")\n elif args.auto:\n self.from_ole_auto()\n print (\"OLE Automation Date: \" + self.in_ole_auto + \" UTC\")\n elif args.ios:\n self.from_ios_time()\n print (\"iOS 11 Date: \" + self.in_iostime)\n elif args.sym:\n self.from_sym_time()\n print (\"Symantec AV Timestamp: \" + self.in_symtime)\n elif args.gps:\n self.from_gps_time()\n print (\"GPS Timestamp: \" + self.in_gpstime)\n elif args.timestamp:\n self.to_timestamps()\n elif args.guess:\n self.from_all()\n except Exception as e:\n logging.error(str(type(e)) + \",\" + str(e))","def parse_arguments():\n parser = argparse.ArgumentParser(description=\"Parse library type information.\")\n parser.add_argument(\"input_file\", help=\"Salmon library type information file.\")\n return parser.parse_args()","def getopts():\n parser = argparse.ArgumentParser()\n parser.add_argument(\"-i\", \"--input\", type=argparse.FileType('r'),\n required=True, help=\"input file (.csv)\")\n return parser.parse_args()","def test_invalidargs(clickrunner):\n for args in maincli.invalid_args:\n result = clickrunner.invoke(maincli.entrypoint, args)\n assert result.exit_code == 2\n assert \"no such option\" in result.output","def parse_command_line_arguments(argv):\n print(\"reading command line arguments in...\")\n\n parser = argparse.ArgumentParser(description='Description of your program')\n parser.add_argument('-i', '--input', help='Location of input csv file', required=True)\n parser.add_argument('-p', '--predicting', help='The column name containing the category to predict', required=True)\n parser.add_argument('-s', '--scoring', help='The scoring type to be used with model evaluation', required=False)\n parser.add_argument('-c', '--scale', help='List of column names to scale values for', nargs='+', required=False)\n args = parser.parse_args()\n\n return args.input, args.predicting, args.scoring, args.scale","def test_cli_unknown(run):\n\n out, err, mocked_input = run(\n dork.cli.main, '-?', input_side_effect=['tester', '.rq'])\n assert 'Greetings' in out\n assert err == \"\"\n assert mocked_input.call_count == 2","def conf_load_run_specification(fin):\n err_msg = \"Unknown specification. Excpected RUN:'name'.\"\n spec = fin.readline().strip().split(':')\n if len(spec) != 2 or spec[0] != 'RUN':\n raise EnvironmentError(err_msg)\n name = spec[1].strip()\n if len(name) == 0:\n raise EnvironmentError(\"Excpected non empty name for RUN(RUN:'name').\")\n return name","def _get_input_from_argv():\n payload_index = sys.argv.index('--') + 1\n params = sys.argv[payload_index:]\n if not params:\n raise ValueError(\n \"A JSON payload was expected after the -- delimiter, but none \"\n \"was found.\")\n return ' '.join(params)","def handle_cmdline_args():\n\n parser = argparse.ArgumentParser(\n description='Generate synthetic data from a specification in a json '\n 'file using the \"synth-method\" described in the json file. ')\n\n parser.add_argument(\n '-i', dest='infile', required=True,\n help='The input json file. Must contain a \"synth-method\" property')\n\n parser.add_argument(\n '-o', dest='outfile_prefix', required=True, help='The prefix of the output paths (data json and csv), relative to the QUIPP-pipeline root directory')\n\n args = parser.parse_args()\n return args","def readCommand( argv ):\n from optparse import OptionParser\n usageStr = \"\"\"\n USAGE: python wumpus.py <options>\n EXAMPLES: python wumpus.py --agent DummyAgent\n OR python wumpus.py -a DummyAgent\n - run wumpus with the dummy agent\n \"\"\"\n parser = OptionParser(usageStr)\n \n parser.add_option('-a', '--agent', dest = 'agent',\n help = default('the agent to use'),\n metavar = 'TYPE', default = 'DummyAgent')\n parser.add_option('-w', '--width', dest ='width',\n help = default('World width'), default = 4)\n parser.add_option('-s', '--speed', dest ='speed',\n help = default('Speed'), default = 70)\n parser.add_option('-t', '--timeout', dest='timeout',\n help = default('Maximum search time (for debugging purpose)'), default = 2000)\n parser.add_option('-g', '--debugging', dest = 'debugging',\n help = 'For debuging purpose, set the random seed which generates the same world with the same seed', default = -1)\n \n options, otherjunk = parser.parse_args(argv)\n\n if len(otherjunk) != 0:\n raise Exception('Command line input not understood: ' + str(otherjunk))\n args = dict()\n \n # Choose a Wumpus solver\n try:\n module = __import__('agent')\n if options.agent in dir(module):\n agent = getattr(module, options.agent)\n args['agent'] = agent()\n else:\n raise Exception('Unknown agent: ' + options.agent)\n except ImportError:\n raise Exception('No file agent.py')\n \n args['width'] = int(options.width) + 2 # Add the borders.\n args['speed'] = int(options.speed)\n args['timeout'] = int(options.timeout)\n args['debugging'] = options.debugging\n\n return args","def parse_args(self):\n #-----------------------------------------------------------------------\n #This code is based on code from the KR Toolkit by Christian Muise\n #URL: http://code.google.com/p/krtoolkit/\n try:\n argv, opts, flags = sys.argv[1:], {}, []\n while argv:\n if argv[0][0:2] == '--':\n flags.append(argv[0])\n argv = argv[1:]\n elif argv[0][0] == '-':\n opts[argv[0]] = argv[1]\n argv = argv[2:]\n else:\n raise InputException(\"Badly constructed arg: \" +argv[0])\n except IndexError:\n raise InputException(\"Badly constructed arg: \" + argv[0])\n #-----------------------------------------------------------------------\n for flag in flags:\n if flag in self.program_flags:\n vars(self)[self.program_flags[flag].var_name] = True\n if self.program_flags[flag].function:\n self.program_flags[flag].function(self)\n else:\n raise InputException(\"Invalid flag: \" + flag)\n \n if not self.quiet:\n min_width = max(len('Flags:'),\n max(map(lambda x : len(x.description),\n self.program_args.itervalues()))) + 1\n if len(flags) == 0:\n print \"{:<{}} {}\".format('Flags:', min_width,'<None>')\n else:\n print \"{:<{}} {}\".format('Flags:', min_width,\n ', '.join(filter(lambda f : f in flags,\n self.program_flags)))\n \n for arg in opts:\n if arg not in self.program_args:\n raise InputException(\"Invalid arg: \" + arg)\n \n for arg in self.program_arg_order:\n arg_def = self.program_args[arg]\n if arg not in opts:\n if arg_def.needed:\n raise InputException(\"Error needed arg is missing: \" + arg)\n vars(self)[arg_def.var_name] = arg_def.default_value\n else:\n if arg_def.validator == None:\n vars(self)[arg_def.var_name] = opts[arg]\n else:\n vars(self)[arg_def.var_name] = arg_def.validator(opts[arg],\n arg_def.validator_args)\n if not self.quiet:\n print \"{:<{}} {}\".format(arg_def.description + ':', min_width,\n vars(self)[arg_def.var_name])","def parsare_argumente():\n for arg in sys.argv:\n if arg == \"-h\":\n display_usage()\n\n in_dir=\"input\"\n out_dir=\"output\"\n n=3\n timeout=10\n for arg in sys.argv[1:]:\n check = arg.split(\"=\")\n if len(check) < 2:\n print(\"invalid\")\n exit()\n if check[0] == \"if\":\n in_dir = ''.join(check[1:])\n elif check[0] == \"of\":\n out_dir = ''.join(check[1:])\n elif check[0] == 'n':\n try:\n n = int(''.join(check[1:]))\n except ValueError:\n print(\"nr invalid\")\n display_usage()\n elif check[0] == 't':\n try:\n timeout = int(''.join(check[1:]))\n except ValueError:\n print(\"nr invalid\")\n display_usage()\n\n return [in_dir, out_dir, n, timeout]","def readCommand( argv ):\n from optparse import OptionParser\n usageStr = \"\"\"\n USAGE: python wumpus.py <options>\n EXAMPLES: (1) python wumpus.py\n - starts simple manual Hunt The Wumpus game\n (2) python wumpus.py -k OR python wumpus.py --kb\n - starts simple manual Hunt The Wumpus game with\n knowledge base and interactive queries possible\n \"\"\"\n parser = OptionParser(usageStr)\n\n parser.add_option('-k', '--kb', action='store_true', dest='kb', default=False,\n help=default(\"Instantiate a queriable knowledge base\"))\n parser.add_option('-y', '--hybrid', action='store_true', dest='hybrid', default=False,\n help=default(\"Run hybrid wumpus agent\" \\\n + \" (takes precedence over -k option)\"))\n parser.add_option('-l', '--layout', dest='layout', default=None,\n help=default(\"Load layout file\"))\n\n parser.add_option('-t', '--test', action='store_true', dest='test_minisat',\n default=False,\n help=default(\"Test connection to command-line MiniSat\"))\n\n options, otherjunk = parser.parse_args(argv)\n \n if len(otherjunk) != 0:\n raise Exception(\"Command line input not understood: \" + str(otherjunk))\n\n return options","def parse_args():\n\n product_help = ('The type of output products to process. Can be '\n '\"individual\", \"composite\", or \"both\".')\n\n parser = argparse.ArgumentParser()\n parser.add_argument('product_type', action='store', type=str, help=product_help)\n args = parser.parse_args()\n\n # Make sure the argument is a valid option\n valid_options = ['individual', 'composite', 'both']\n explanation = '{} is not a valid option. Please choose \"individual\", \"composite\", or \"both\".'.format(args.product_type)\n assert args.product_type in valid_options, explanation\n\n return args","def parseInputLine(self, line):\r\n if line is not None and line is not '':\r\n func = getattr(self, 'cmd_' + line.split()[0].upper(), None)\r\n if func is not None:\r\n func(line.split()[1:])\r\n else:\r\n self.terminal.write('No such command')\r\n self.showPrompt()"],"string":"[\n \"def readArgs():\\n args = sys.argv\\n if len(args) != 3:\\n print(\\\"ERROR - Wrong number of arguments! \\\\n\\\")\\n print(\\\"Usage: plotGantt.py TYPE path/to/result/file.gantt \\\\n where TYPE is : MTS / SCH\\\")\\n exit(5)\\n if args[1] != \\\"MTS\\\" and args[1] != \\\"SCH\\\":\\n print(\\\"ERROR - Wrong type specified! : \\\" + args[1])\\n print(\\\"Usage: plotGantt.py TYPE path/to/result/file.gantt \\\\n where TYPE is : MTS / SCH\\\")\\n return args\",\n \"def cmd_type(args):\",\n \"def read_cmd_args():\\n\\n if len(sys.argv) != 9:\\n print(\\\"[ERR] Invalid number of command line arguments!\\\")\\n usage()\\n sys.exit(1)\\n\\n # FCST_SYR\\n try:\\n fcst_syr = int(sys.argv[1])\\n except ValueError:\\n print(f\\\"[ERR] Invalid argument for FCST_SYR! Received {(sys.argv[1])}\\\")\\n usage()\\n sys.exit(1)\\n if fcst_syr < 0:\\n print(f\\\"[ERR] Invalid argument for FCST_SYR! Received {(sys.argv[1])}\\\")\\n usage()\\n sys.exit(1)\\n\\n # FCST_EYR\\n try:\\n fcst_eyr = int(sys.argv[2])\\n except ValueError:\\n print(f\\\"[ERR] Invalid argument for FCST_EYR! Received {(sys.argv[2])}\\\")\\n usage()\\n sys.exit(1)\\n if fcst_eyr < 0:\\n print(f\\\"[ERR] Invalid argument for FCST_EYR! Received {(sys.argv[2])}\\\")\\n usage()\\n sys.exit(1)\\n\\n # MONTH_ABBR\\n month_abbr = str(sys.argv[3])\\n\\n # MONTH_NUM\\n try:\\n month_num = int(sys.argv[4])\\n except ValueError:\\n print(f\\\"[ERR] Invalid argument for MONTH_NUM! Received {(sys.argv[4])}\\\")\\n usage()\\n sys.exit(1)\\n if month_num < 1:\\n print(f\\\"[ERR] Invalid argument for MONTH_NUM! Received {(sys.argv[4])}\\\")\\n usage()\\n sys.exit(1)\\n if month_num > 12:\\n print(f\\\"[ERR] Invalid argument for MONTH_NUM! Received {(sys.argv[4])}\\\")\\n usage()\\n sys.exit(1)\\n\\n # FCST_TYPE\\n fcst_type = str(sys.argv[5])\\n\\n # LEAD_MONTHS\\n try:\\n lead_months = int(sys.argv[6])\\n except ValueError:\\n print(f\\\"[ERR] Invalid argument for LEAD_MONTHS! Received {(sys.argv[6])}\\\")\\n usage()\\n sys.exit(1)\\n if lead_months < 0:\\n print(f\\\"[ERR] Invalid argument for LEAD_MONTHS! Received {(sys.argv[6])}\\\")\\n usage()\\n sys.exit(1)\\n\\n # ENS_NUM\\n try:\\n ens_num = int(sys.argv[7])\\n except ValueError:\\n print(f\\\"[ERR] Invalid argument for ENS_NUM! Received {(sys.argv[7])}\\\")\\n usage()\\n sys.exit(1)\\n if ens_num < 0:\\n print(f\\\"[ERR] Invalid argument for ENS_NUM! Received {(sys.argv[7])}\\\")\\n usage()\\n sys.exit(1)\\n\\n # CONFIG_FILE\\n config_file = sys.argv[8]\\n if not os.path.exists(config_file):\\n print(f\\\"[ERR] {config_file} does not exist!\\\")\\n sys.exit(1)\\n\\n return fcst_syr, fcst_eyr, month_abbr, month_num, fcst_type, lead_months, \\\\\\n \\tens_num, config_file\",\n \"def readCommandLine(self, **kwargs):\\n try:\\n condition = kwargs[\\\"fname\\\"].split(':')[0]\\n except Exception,e:\\n rospy.logerr(\\\"%s\\\"%str(e))\\n self.mm.neglect()\\n return\\n\\n # experimentation parameters\\n answer = raw_input('Change %s: %s to: ' % (condition,self.exp_predicates[condition]))\\n self.exp_predicates[condition] = answer\\n self.mm.loadMenu(\\\"teachMenu\\\")\",\n \"def test_type_arg(self, parse_input):\\n with pytest.warns(SyntaxWarning, match=\\\"Only keyword options of the form\\\"):\\n parse_input(\\\"name testname\\\\nversion 1.0\\\\ntarget example (6)\\\\ntype example (42)\\\")\",\n \"def parse_command_line():\\r\\n\\r\\n parser = argparse.ArgumentParser(description='User args')\\r\\n parser.add_argument(\\\"--action\\\", choices=['train', 'predict', 'demo', 'test'], required=True, help=\\\"Choose action.\\\")\\r\\n parser.add_argument(\\\"--model\\\", choices=['vgg', 'unet', 'fpn'], required=True, help=\\\"Choose model.\\\")\\r\\n parser.add_argument(\\\"--dataset\\\", choices=['full', 'small'], required=True, help=\\\"Choose dataset.\\\")\\r\\n\\r\\n return parser.parse_args()\",\n \"def read_user_input(self):\\n\\n self.commandline = raw_input(\\\"Enter the string you want to parse\\\\n\\\")\",\n \"def _read_cmd_args():\\n\\n # Check if argument count is correct.\\n if len(sys.argv) != 5:\\n print(\\\"[ERR] Invalid number of command line arguments!\\\")\\n _usage()\\n sys.exit(1)\\n\\n # Get path to config file\\n configfile = sys.argv[1]\\n if not os.path.exists(configfile):\\n print(f\\\"[ERR] Config file {configfile} does not exist!\\\")\\n sys.exit(1)\\n\\n # Get top directory of LIS data\\n topdatadir = sys.argv[2]\\n if not os.path.exists(topdatadir):\\n print(f\\\"[ERR] LIS data directory {topdatadir} does not exist!\\\")\\n sys.exit(1)\\n\\n # Get valid year and month\\n yyyymm = sys.argv[3]\\n if len(yyyymm) != 6:\\n print(\\\"[ERR] Invalid length of YYYYMM, must be 6 characters!\\\")\\n sys.exit(1)\\n year = int(yyyymm[0:4])\\n month = int(yyyymm[4:6])\\n try:\\n startdate = datetime.datetime(year, month, day=1)\\n except ValueError:\\n print(\\\"[ERR] Invalid YYYYMM passed to script!\\\")\\n sys.exit(1)\\n\\n # Get model forcing ID\\n model_forcing = sys.argv[4]\\n\\n return configfile, topdatadir, startdate, model_forcing\",\n \"def test_arg_type(args, arg, arg_type):\\n try:\\n arg_type(args[arg])\\n except Exception:\\n raise GaiaException('Required argument {} must be of type {}'\\n .format(arg, arg_type))\",\n \"def _read_cmd_args():\\n\\n # Check if argument count is correct.\\n if len(sys.argv) != 4:\\n print(\\\"[ERR] Invalid number of command line arguments!\\\")\\n print(len(sys.argv))\\n print(sys.argv[:])\\n _usage()\\n sys.exit(1)\\n\\n # Check if lis.config template exists.\\n lis_config_template = sys.argv[1]\\n if not os.path.exists(lis_config_template):\\n print(f\\\"[ERR] {lis_config_template} does not exist!\\\")\\n sys.exit(1)\\n\\n # Check if directory for restart files exists. Actual restart file\\n # shall be checked later.\\n restart_dir = sys.argv[2]\\n if not os.path.exists(restart_dir):\\n print(f\\\"[ERR] Directory {restart_dir} does not exist!\\\")\\n sys.exit(1)\\n\\n # Get start date of new LIS run.\\n yyyymmdd = sys.argv[3]\\n if len(yyyymmdd) != 8:\\n print(\\\"[ERR] Invalid length for YYYYMMDD, must be 8 characters!\\\")\\n sys.exit(1)\\n year = int(yyyymmdd[0:4])\\n month = int(yyyymmdd[4:6])\\n day = int(yyyymmdd[6:8])\\n try:\\n startdate = datetime.date(year, month, day)\\n except ValueError:\\n print(\\\"[ERR] Invalid YYYYMMDD passed to script!\\\")\\n sys.exit(1)\\n\\n return lis_config_template, restart_dir, startdate\",\n \"def parse_args(args):\\n assert os.path.isfile(args.data_path), \\\"The specified data file does not exist.\\\"\\n assert os.path.isfile(args.model_path), \\\"The specified model file does not exist.\\\"\\n\\n if args.read_batches is not False:\\n if args.read_batches.lower() in (\\\"y\\\", \\\"yes\\\", \\\"1\\\", \\\"\\\", \\\"true\\\", \\\"t\\\"):\\n args.read_batches = True\\n else:\\n args.read_batches = False\",\n \"def parse_and_validate_cmd_line():\\n if len(sys.argv) != 4:\\n print USAGE_STR.format(sys.argv[0])\\n sys.exit()\\n # attempt to parse the parameters tell the user and exit if we can't\\n num_segments = parse_and_validate_num_segs(sys.argv[1])\\n # try to parse numThreads\\n num_threads = parse_and_validate_num_threads(sys.argv[2])\\n # try to parse and test the data directory\\n data_dir = parse_and_validate_data_dir(sys.argv[3])\\n return num_segments, num_threads, data_dir\",\n \"def main(argv,required_arg,required_arg_type,optional_arg):\\n \\n # add optional_arguments to the parser\\n for option in optional_arg:\\n parse_option_dictionary[option]()\\n \\n # parse the command line\\n passed_optional_arg, passed_required_arg = parser.parse_args(argv)\\n \\n required_arg_values = grabRequiredArgs(passed_required_arg,required_arg,\\n required_arg_type)\\n\\n return required_arg_values, passed_optional_arg\",\n \"def validate_args(self, in_args, cmd_call):\\n valid_1, valid_2 = None, None\\n\\n if len(in_args) > 0 and type(in_args) is not list:\\n args = in_args.split()\\n valid_1 = args[0]\\n elif type(in_args) is list and len(in_args) > 0:\\n args = in_args\\n valid_1 = args[0]\\n else:\\n args = []\\n\\n if cmd_call in ['default']:\\n # Default : Returns a valid cui type for an input cui\\n # checks to see if there is more than 2 arguments\\n # if so, arg[0] may be a valid code\\n # arg[1] may be a valid code type\\n # if not ask the user what type of code type arg[0] is\\n # valid_1 = valid cui type\\n # valid_2 = None\\n while True:\\n if len(args) >= 2 and len(args) <= 3:\\n input_type = args[1].upper()\\n else:\\n input_type = input(\\\"What type of id is '{0}'? [LOCAL/RXCUI/NDC/SNOMED]\\\".format(args[0])).upper()\\n\\n # Confirm it's a valid code type\\n valid_type = self.validate_id_type(input_type)\\n # Valid type is a boolean of True\\n if isinstance(valid_type, str) or valid_type is None:\\n return None\\n elif valid_type:\\n break\\n elif not valid_type:\\n print('Invalid Option, Please Try Again')\\n continue\\n valid_1 = input_type\\n\\n elif cmd_call in self.cmd_config_default:\\n # valid_1 : Valid Cui , valid_2 : Valid Cui Type\\n valid_2, _ = self.validate_args(args, 'default')\\n valid_1 = args[0]\\n\\n elif cmd_call == 'code_lookup':\\n # args[0] : Initial CUI, args[1] : Initial CUI Type, args[2] : Target CUI Type\\n # valid_1 : valid cui, valid_2 : list valid source and target\\n _dict_opts = util.OPTIONS_CUI_TYPES.copy()\\n _avail = list(set(smores.get_dict_sources()) & set(_dict_opts))\\n if len(_avail) == 0 and len(args) < 2:\\n print('There are no available starting cui types that can be crosswalked.\\\\n'\\n 'Please load a file containing valid cui types: {0}'.format(_dict_opts))\\n return False, None\\n\\n if len(args) >= 2:\\n if len(args) == 3:\\n # provided cui, cui source, and target\\n valid_2, _ = self.validate_args(args, 'default')\\n source, target = args[1].upper(), args[2].upper()\\n else:\\n source, target = args[0].upper(), args[1].upper()\\n valid_1 = simple_input(\\\"Is {0} the correct starting source? \\\".format(source), ['YES', 'NO', 'exit'])\\n if valid_1 == 'exit':\\n return False, None\\n # TODO need path for valid_2\\n else:\\n valid_1 = simple_input(\\\"Which code set do you want to start with?\\\", _avail)\\n if valid_1 != 'exit':\\n _dict_opts.remove(valid_1) # Don't lookup what we've already got\\n valid_2 = simple_input(\\\"Which code set do you want to get results for?\\\", _dict_opts)\\n if valid_2 == 'exit':\\n return False, None\\n else:\\n return False, None\\n\\n elif cmd_call == 'errors':\\n _current_err = list(self.errors.keys())\\n if len(args) > 1:\\n smores_error('#Cx001.7', console_p=True)\\n return\\n elif len(args) == 1 and args[0].lower() in _current_err:\\n valid_1 = args[0]\\n elif len(args) == 1:\\n print('There are currently no errors logged for that command.')\\n return\\n else:\\n valid_1 = simple_input(\\\"Please choose a command from the list to see errors: \\\", _current_err)\\n\\n elif cmd_call in ['csv', 'remap', 'fhir', 'json']:\\n # Format: [File] [Output]\\n if not self.inputs['loaded']:\\n print(\\\"No Files Loaded!\\\\nYou Must load a file containing local medications first\\\")\\n else:\\n _file_opts = list(self.inputs['files'].keys()) + ['All']\\n _dict_opts = list(smores.get_dict_sources(True)) #+ ['All']\\n _file_or_dict = None\\n\\n if cmd_call in ['csv', 'json']:\\n if len(args) == 0:\\n _file_or_dict = simple_input(\\\"Do you want results for a File or a constructed Dictionary?\\\",\\n ['File', 'Dictionary', 'exit'], True)\\n elif args[0] not in _file_opts and args[0] not in _dict_opts:\\n print('That option was not recognized as a valid source.')\\n _file_or_dict = simple_input(\\\"Do you want results for a File or a constructed Dictionary?\\\",\\n ['File', 'Dictionary', 'exit'], True)\\n else:\\n valid_1 = args[0]\\n\\n if _file_or_dict.upper() == 'FILE':\\n valid_1 = 'FILE|' + simple_input(\\\"Please choose a loaded file\\\", _file_opts, True)\\n\\n elif _file_or_dict.upper() == 'DICTIONARY':\\n valid_1 = 'DICT|' + simple_input(\\\"Please choose a code dictionary to output\\\", _dict_opts, True)\\n elif _file_or_dict.upper() == 'EXIT':\\n return None, None\\n\\n else:\\n valid_1 = simple_input(\\\"Please choose a loaded file\\\", _file_opts, True)\\n\\n if cmd_call in ['csv', 'json', 'fhir']:\\n if len(args) == 2 and len(args[1]) > 0:\\n valid_2 = args[1]\\n else:\\n valid_2= input(\\\"Please provide an output file name:\\\").strip()\\n\\n if len(valid_2) > 0:\\n if \\\".\\\" in valid_2:\\n valid_2, ext = valid_2.split(\\\".\\\")\\n else:\\n valid_2 = ''\\n print('Empty file name provided, using default.')\\n else:\\n valid_2 = args[0]\\n\\n elif cmd_call == 'file':\\n re_use = False\\n if self.inputs['loaded'] and len(in_args) == 0:\\n print(\\\"The following file(s) have already been loaded: \\\\n\\\" + str(self.inputs['files']))\\n _load_more = simple_input(\\\"Would you like to load an additional file?\\\", ['Y', 'N', 'exit'])\\n if _load_more == 'Y':\\n pass\\n elif _load_more == 'N':\\n _re_use = simple_input(\\\"Would you like to re-use a loaded file?\\\", ['Y', 'N', 'exit'])\\n if _re_use == 'Y':\\n re_use = True\\n else:\\n return False, None\\n else:\\n return False, None\\n\\n if in_args is not None and len(in_args) > 0:\\n valid_1 = in_args\\n else:\\n valid_1 = input(\\\"Please enter the name of the file to load: \\\") if not re_use else simple_input(\\n 'Select the file to be used: ', list(self.inputs['files'].keys()), index=True)\\n\\n while True:\\n if valid_1 in self.inputs['files']:\\n if not re_use:\\n print(\\\"It looks like you've already loaded that file. Please try a different file.\\\")\\n valid_1, valid_2 = input(\\\"Please enter the name of the file to load: \\\")\\n else:\\n break\\n elif len(valid_1) == 0:\\n smores_error('#Cx001.7', logger=smoresLog)\\n valid_1, valid_2 = input(\\\"Please enter the name of the file to load: \\\")\\n else:\\n break\\n\\n if not resolve_target_path(valid_1):\\n valid_1, valid_2 = self.validate_args('', 'file')\\n\\n elif '.smr' in valid_1:\\n if len(self.inputs['files']) > 0:\\n print(\\n 'It looks like you are trying to load a session, this will replace the current session and '\\n 'all previous work.')\\n _save = simple_input('Do you want to save the current session first?', ['Y', 'N', 'EXIT'])\\n if _save == 'Y':\\n smores.save_session(self.__version__)\\n elif _save == 'EXIT':\\n return False, None\\n valid_2 = 'session'\\n else:\\n valid_2 = 'file'\\n\\n smoresLog.debug('Args: {0}, Validated as: {1}'.format(valid_1, valid_2))\\n return valid_1, valid_2\",\n \"def processCmdLineArgs(expectedTypes, usage):\\n\\targs = []\\n\\tnumComLineArgs = len(sys.argv)\\n\\tnumExpected = len(expectedTypes)\\n\\tif (numComLineArgs - 1 == len(expectedTypes)):\\n\\t\\ttry:\\n\\t\\t\\tfor i in range(0, numExpected):\\n\\t\\t\\t\\tif (expectedTypes[i] == typeInt):\\n\\t\\t\\t\\t\\targs.append(int(sys.argv[i+1]))\\n\\t\\t\\t\\telif (expectedTypes[i] == typeFloat):\\n\\t\\t\\t\\t\\targs.append(float(sys.argv[i+1]))\\n\\t\\t\\t\\telif (expectedTypes[i] == typeString):\\n\\t\\t\\t\\t\\targs.append(sys.argv[i+1])\\n\\t\\texcept ValueError:\\n\\t\\t\\tprint (\\\"expected number of command line arguments found but there is type mis match\\\")\\n\\t\\t\\tsys.exit(1)\\n\\telse:\\n\\t\\tprint (\\\"expected number of command line arguments not found\\\")\\n\\t\\tprint (usage)\\n\\t\\tsys.exit(1)\\n\\treturn args\",\n \"def test_type_kwarg(self, parse_input):\\n bb = parse_input(\\\"name testname\\\\nversion 1.0\\\\ntarget example (6)\\\\ntype example (copies=1000)\\\")\\n assert bb.programtype[\\\"options\\\"] == {\\\"copies\\\": 1000}\",\n \"def test_atleast_two_arguments_needed_one():\\n cli_result = subprocess.run(\\n ['kaiba', 'config.js'],\\n capture_output=True,\\n )\\n assert b'the following arguments are required: input' in cli_result.stderr\\n assert cli_result.returncode == 2\",\n \"def test_parser_init_with_valid_project_type(parser):\\n parser.parse_args(['--init', 'java'])\",\n \"def main():\\n\\targuments_sent = sys.argv\\n\\tif len(arguments_sent) > 1:\\n\\t\\tfile_path = arguments_sent[1]\\n\\t\\tprocess_based_on_type(file_path)\",\n \"def get_type_check(self, arg, option):\\n pass\",\n \"def main():\\r\\n args = sys.argv\\r\\n print 'Script:', args[0]\\r\\n args.pop(0)\\r\\n for i, argument in enumerate(sys.argv):\\r\\n print 'Argument {}: {}'.format(i, argument)\\r\\n print 'Type: {}'.format(type(argument))\",\n \"def test_from_command_line():\\n config_file = t_path(\\n Path('steps') / 'jwst_generic_pars-makeliststep_0001.asdf'\\n )\\n args = [config_file]\\n step = Step.from_cmdline(args)\\n assert isinstance(step, MakeListStep)\\n assert step.par1 == 42.0\\n assert step.par2 == 'Yes, a string'\\n\\n results = step.run()\\n assert results == DEFAULT_RESULT\",\n \"def test_from_command_line_override():\\n config_file = t_path(\\n Path('steps') / 'jwst_generic_pars-makeliststep_0001.asdf'\\n )\\n args = [config_file, '--par1=0.']\\n step = Step.from_cmdline(args)\\n assert isinstance(step, MakeListStep)\\n assert step.par1 == 0.\\n assert step.par2 == 'Yes, a string'\\n\\n results = step.run()\\n assert results == [0., DEFAULT_PAR2, False]\",\n \"def read_command( argv ):\\n from optparse import OptionParser\\n usageStr = \\\"\\\"\\\"\\n USAGE: python tortoise.py <options>\\n EXAMPLES: python tortoise.py --agent ReflexBrain\\n OR python tortoise.py -a ReflexBrain\\n - run tortoise with the reflex agent\\n \\\"\\\"\\\"\\n parser = OptionParser(usageStr)\\n \\n parser.add_option('-a', '--agent', dest = 'agent',\\n help = default('The agent to use'),\\n metavar = 'TYPE', default = 'ReflexBrain')\\n parser.add_option('-w', '--width', dest = 'width',\\n help = default('World width'), default = 15)\\n parser.add_option('-s', '--speed', dest = 'speed',\\n help = default('Speed'), default = 40)\\n parser.add_option('-r', '--random-seed', dest = 'random_seed',\\n help = default('Random'), default = -1)\\n \\n options, otherjunk = parser.parse_args(argv)\\n\\n if len(otherjunk) != 0:\\n raise Exception('Command line input not understood: ' + str(otherjunk))\\n args = dict()\\n \\n # Choose a Tortoise solver\\n try:\\n module = __import__('agents')\\n if options.agent in dir(module):\\n agent = getattr(module, options.agent)\\n args['agent'] = agent()\\n else:\\n raise Exception('Unknown agent: ' + options.agent)\\n except ImportError:\\n raise Exception('No file agents.py')\\n \\n args['width'] = int(options.width)\\n args['speed'] = int(options.speed)\\n args['random_seed'] = int(options.random_seed)\\n return args\",\n \"def read(self, sys):\\n\\n # if no options are set, print help\\n if len(sys.argv) == 1:\\n sys.argv.append('-h')\\n\\n # make sure parameter file is processed first\\n # so that all options on the command line\\n # have precedence\\n if any(['@' in xx[0] for xx in sys.argv]):\\n paridx = [xx[0] for xx in sys.argv].index('@')\\n parfile = sys.argv.pop(paridx)\\n sys.argv.insert(1, parfile)\\n\\n opt = self.parser.parse_args()\\n\\n # transform some parameters to proper types\\n try:\\n if 1 != opt.beamscaling:\\n opt.beamscaling = [float(xx)\\n for xx\\n in opt.beamscaling.split(',')]\\n\\n if opt.feed:\\n opt.feed = self.parse_range(opt.feed)\\n\\n if opt.pol:\\n opt.pol = self.parse_range(opt.pol)\\n\\n if opt.window:\\n opt.window = self.parse_range(opt.window)\\n\\n if opt.mapscans:\\n opt.mapscans = self.parse_range(opt.mapscans)\\n\\n if opt.refscans:\\n opt.refscans = self.parse_range(opt.refscans)\\n\\n except ValueError:\\n print('ERROR: there is a malformed parameter option')\\n print(' please check your command line settings and try again.')\\n sys.exit()\\n\\n opt.units = opt.units.lower()\\n\\n return opt\",\n \"def validate_argtype(arg, argtype):\\r\\n if not isinstance(arg, argtype):\\r\\n raise HelperException('{0} argument must be of type {1}'.format(\\r\\n arg, argtype))\\r\\n return arg\",\n \"def read_cmd(self):\\n\\n parser = ArgumentParser(formatter_class=ArgumentDefaultsHelpFormatter)\\n req_opts = parser.add_argument_group(\\\"Required Options\\\")\\n req_opts.add_argument(\\\"--instance_dir\\\", required=True,\\n help=\\\"directory with instances (not recursive\\\")\\n \\n opt_opts = parser.add_argument_group(\\\"Optional Options\\\")\\n \\n opt_opts.add_argument(\\\"--fn_suffix\\\", default=\\\".*\\\",\\n help=\\\"suffix of instance file names\\\")\\n opt_opts.add_argument(\\\"--cutoff\\\", default=10, type=int,\\n help=\\\"running time cutoff [sec]\\\")\\n opt_opts.add_argument(\\\"--memlimit\\\", default=2048, type=int,\\n help=\\\"memory limit\\\")\\n opt_opts.add_argument(\\\"--ac_budget\\\", default=360,\\n help=\\\"configuration budget [sec]\\\")\\n opt_opts.add_argument(\\\"--run_obj\\\", default=\\\"runtime\\\",\\n choices=[\\\"runtime\\\", \\\"quality\\\"],\\n help=\\\"run objective\\\")\\n opt_opts.add_argument(\\\"--par-factor\\\", default=10,\\n help=\\\"Factor by which to penalize unsolved instances. Usage may differ based on TAE used.\\\")\\n\\n opt_opts.add_argument(\\\"--binary\\\", default=\\\"clingo\\\",\\n help=\\\"target binary\\\")\\n opt_opts.add_argument(\\\"--pcs_file\\\", default=\\\"pcs/all_params.pcs\\\",\\n help=\\\"parameter configuration file\\\")\\n opt_opts.add_argument(\\\"--runsolver\\\", default=\\\"binaries/runsolver\\\",\\n help=\\\"runsolver binary\\\")\\n opt_opts.add_argument(\\\"--tae_class\\\", default=None,\\n help=\\\"TAE class to individualize clingo calls -- has to inherit from smac.tae.execute_ta_run_aclib.ExecuteTARunAClib\\\")\\n\\n\\n opt_opts.add_argument(\\\"--seed\\\", default=12345, type=int,\\n help=\\\"random seed\\\")\\n opt_opts.add_argument(\\\"--verbose_level\\\", default=logging.INFO,\\n choices=[\\\"INFO\\\", \\\"DEBUG\\\"],\\n help=\\\"random seed\\\")\\n opt_opts.add_argument(\\\"--tae_args\\\", default=\\\"{}\\\",\\n help=\\\"Miscellaneous options for the TAE\\\")\\n \\n\\n args_, misc = parser.parse_known_args()\\n self._check_args(args_)\\n args_.tae_args=json.loads(args_.tae_args)\\n\\n # remove leading '-' in option names\\n misc = dict((k.lstrip(\\\"-\\\"), v.strip(\\\"'\\\"))\\n for k, v in zip(misc[::2], misc[1::2]))\\n\\n misc[\\\"instances\\\"] = self._find_files(dir_=args_.instance_dir, suffix_=args_.fn_suffix)\\n misc[\\\"wallclock_limit\\\"] = args_.ac_budget\\n misc[\\\"cutoff_time\\\"] = args_.cutoff\\n misc[\\\"paramfile\\\"] = args_.pcs_file\\n misc[\\\"algo\\\"] = \\\"\\\"\\n misc[\\\"run_obj\\\"] = args_.run_obj\\n\\n return args_, misc\",\n \"def errFunc(runType):\\n logger.error('Execution type not recognized! {}'.format(runType))\\n raise InvalidExecutionType('{} is not a valid command'.format(runType))\",\n \"def _validate_edit_command(args):\\n res = _check_entry_name(args)\\n if res != 0:\\n return res\\n\\n # If no new type is specified on the command line then leave validation of\\n # property arguments to _process_edit_command() when a type of the existing\\n # entry is determined.\\n if args.type is None:\\n return 0\\n\\n return _check_property_arguments(args, args.type)\",\n \"def getopt():\\n raise NotImplementedError()\",\n \"def getTRSLanguage():\\n try:\\n return sys.argv[1]\\n except IndexError as error:\\n print(\\\"No language argument\\\\n\\\")\\n sys.exit()\",\n \"def check_argv():\\n parser = argparse.ArgumentParser(description=__doc__.strip().split(\\\"\\\\n\\\")[0], add_help=False)\\n parser.add_argument(\\\"segment_fn\\\", type=str, help=\\\"pickled segmentation file\\\")\\n if len(sys.argv) == 1:\\n parser.print_help()\\n sys.exit(1)\\n return parser.parse_args()\",\n \"def parse_argument(argument_option):\\n index = sys.argv.index(argument_option)\\n try:\\n argument = sys.argv[index+1]\\n except IndexError:\\n print('ERROR: Invalid argument!')\\n print(__doc__)\\n print(unittest.main.__doc__)\\n else:\\n sys.argv.pop(index)\\n sys.argv.pop(index)\\n return argument\",\n \"def check_args():\\n schema = Schema({\\n 'FOLDREC': Use(open, error='FOLDREC file should be readable'),\\n 'CLUSTAL': Use(open, error='CLUSTAL file should be readable'),\\n 'CCMPRED': Use(open, error='CCMPRED file should be readable'),\\n '--metafold': Use(open, error='METAFOLD_FILE should be readable'),\\n '--nb_pdb': And(Use(int), lambda n: 1 <= n <= 405,\\n error='--nb_pdb=NUM should be integer 1 <= N <= 405'),\\n '--dssp': Use(open, error='dssp/mkdssp should be readable'),\\n '--dope': Use(open, error='dope file should be readable'),\\n '--benchmark': Use(open, error='BENCHMARK_FILE should be readable'),\\n '--cpu': And(Use(int), lambda n: 0 <= n <= cpu_count(),\\n error='--cpus=NUM should be integer 1 <= N <= ' + str(cpu_count())),\\n # The output PATH is created (if not exists) at the end of the program\\n # so we skip the check.\\n object: object})\\n try:\\n schema.validate(ARGUMENTS)\\n except SchemaError as err:\\n exit(err)\",\n \"def run(self, line):\\r\\n if os.name == 'nt':\\r\\n if not ctypes.windll.shell32.IsUserAnAdmin() != 0:\\r\\n self.app.typepath.adminpriv = False\\r\\n elif not os.getuid() == 0:\\r\\n self.app.typepath.adminpriv = False\\r\\n\\r\\n nargv = []\\r\\n curr = []\\r\\n argfound = False\\r\\n\\r\\n if \\\"--version\\\" in line or \\\"-V\\\" in line:\\r\\n sys.stdout.write(\\\"\\\"\\\"%(progname)s %(version)s\\\\n\\\"\\\"\\\" % \\\\\\r\\n {'progname': versioning.__longname__, 'version': \\\\\\r\\n versioning.__version__})\\r\\n sys.stdout.flush()\\r\\n sys.exit(self.retcode)\\r\\n\\r\\n else:\\r\\n for argument in enumerate(line):\\r\\n if not argfound and not argument[1].startswith('-'):\\r\\n nargv = line[argument[0]:]\\r\\n break\\r\\n else:\\r\\n argfound = False\\r\\n\\r\\n if argument[1] == \\\"-c\\\":\\r\\n argfound = True\\r\\n\\r\\n curr.append(argument[1])\\r\\n\\r\\n (self.opts, _) = self.parser.parse_args(curr)\\r\\n\\r\\n try:\\r\\n Encryption.encode_credentials('test')\\r\\n self.app.set_encode_funct(Encryption.encode_credentials)\\r\\n self.app.set_decode_funct(Encryption.decode_credentials)\\r\\n self.encoding = True\\r\\n except redfish.hpilo.risblobstore2.ChifDllMissingError:\\r\\n self.encoding = False\\r\\n\\r\\n if self.opts.config is not None and len(self.opts.config) > 0:\\r\\n if not os.path.isfile(self.opts.config):\\r\\n self.retcode = ReturnCodes.CONFIGURATION_FILE_ERROR\\r\\n sys.exit(self.retcode)\\r\\n\\r\\n self.app.config_file = self.opts.config\\r\\n\\r\\n self.app.config_from_file(self.app.config_file)\\r\\n if self.opts.logdir and self.opts.debug:\\r\\n logdir = self.opts.logdir\\r\\n else:\\r\\n logdir = self.app.config.get_logdir()\\r\\n\\r\\n if logdir and self.opts.debug:\\r\\n try:\\r\\n os.makedirs(logdir)\\r\\n except OSError as ex:\\r\\n if ex.errno == errno.EEXIST:\\r\\n pass\\r\\n else:\\r\\n raise\\r\\n\\r\\n if self.opts.debug:\\r\\n logfile = os.path.join(logdir, versioning.__shortname__+'.log')\\r\\n\\r\\n # Create a file logger since we got a logdir\\r\\n lfile = logging.FileHandler(filename=logfile)\\r\\n formatter = logging.Formatter(\\\"%(asctime)s %(levelname)s\\\\t: \\\" \\\\\\r\\n \\\"%(message)s\\\")\\r\\n\\r\\n lfile.setFormatter(formatter)\\r\\n lfile.setLevel(logging.DEBUG)\\r\\n LOGGER.addHandler(lfile)\\r\\n self.app.LOGGER = LOGGER\\r\\n\\r\\n cachedir = None\\r\\n if self.opts.nocache:\\r\\n self.app.config.set_cache(False)\\r\\n else:\\r\\n self.app.config.set_cachedir(os.path.join(self.opts.config_dir, \\\\\\r\\n 'cache'))\\r\\n cachedir = self.app.config.get_cachedir()\\r\\n\\r\\n if cachedir:\\r\\n try:\\r\\n os.makedirs(cachedir)\\r\\n except OSError as ex:\\r\\n if ex.errno == errno.EEXIST:\\r\\n pass\\r\\n else:\\r\\n raise\\r\\n\\r\\n if (\\\"login\\\" in line or any(x.startswith(\\\"--url\\\") for x in line) or not line)\\\\\\r\\n and not (any(x.startswith((\\\"-h\\\", \\\"--h\\\")) for x in nargv) or \\\"help\\\" in line):\\r\\n self.app.logout()\\r\\n else:\\r\\n self.app.restore()\\r\\n self.opts.is_redfish = self.app.updatedefinesflag(redfishflag=\\\\\\r\\n self.opts.is_redfish)\\r\\n\\r\\n if nargv:\\r\\n try:\\r\\n self.retcode = self._run_command(self.opts, nargv)\\r\\n if self.app.config.get_cache():\\r\\n if (\\\"logout\\\" not in line) and (\\\"--logout\\\" not in line):\\r\\n self.app.save()\\r\\n else:\\r\\n self.app.logout()\\r\\n except Exception as excp:\\r\\n self.handle_exceptions(excp)\\r\\n\\r\\n return self.retcode\\r\\n else:\\r\\n self.cmdloop(self.opts)\\r\\n\\r\\n if self.app.config.get_cache():\\r\\n self.app.save()\\r\\n else:\\r\\n self.app.logout()\",\n \"def test_parser_init_with_invalid_project_type(parser):\\n with pytest.raises(SystemExit):\\n parser.parse_args(['--init', 'error'])\",\n \"def validate_command_line_input(args):\\n valid = False\\n if 0 < len(args) <= 4:\\n valid = True\\n for arg in args:\\n if int(arg) > 4:\\n valid = False\\n break\\n else:\\n pass\\n if valid:\\n CRUDStarter.load_operations(args)\\n pass\\n else:\\n CRUDStarter.logger.info(\\\"Argument maximum acceptable value is 4\\\")\\n else:\\n CRUDStarter.logger.info(\\\"at least One at most Four argument(s) required\\\")\",\n \"def check_input_options(args):\\n\\n # Make sure the input file is trimmed for use later on in the program.\\n args.input_file = args.input_file.strip()\\n\\n # Make sure the output_type string(s) is(are) trimmed and lowercase.\\n args.output_type = [x.strip().lower() for x in args.output_type]\\n\\n # The DPI value must be greater than zero...\\n if args.dpi_val <= 0.:\\n raise ValueError(\\\"DPI value must be > 0.\\\")\",\n \"def check_input_options(args):\\n\\n # Make sure the input file is trimmed for use later on in the program.\\n args.input_file = args.input_file.strip()\\n\\n # Make sure the output_type string(s) is(are) trimmed and lowercase.\\n args.output_type = [x.strip().lower() for x in args.output_type]\\n\\n # The DPI value must be greater than zero...\\n if args.dpi_val <= 0.:\\n raise ValueError(\\\"DPI value must be > 0.\\\")\",\n \"def main(args):\\n cli = CLI()\\n # Check arguments\\n cli.parse_arguments(args)\",\n \"def readCommand( argv ): ## argv belongs to the 'sys'-library and can be called through sys.argv. The function reads the console's comand line argument and passes it to a variable like so: args = sys.argv[1:]\\n from optparse import OptionParser ## Option Parser is a powerful library for passing command line options (an advanced args) if you like. It allows you to add options by defining attributes. \\n usageStr = \\\"\\\"\\\" \\n USAGE: python pacman.py <options> \\n EXAMPLES: (1) python pacman.py\\n - starts an interactive game\\n (2) python pacman.py --layout smallClassic --zoom 2\\n OR python pacman.py -l smallClassic -z 2\\n - starts an interactive game on a smaller board, zoomed in\\n \\\"\\\"\\\" \\n parser = OptionParser(usageStr) ## This creates the Option Parser instance. It also passes the usageStr which functions as a little help-text for the user.\\n\\n ### In this section all the option strings are defined. Typically each option has one short option string and one long option string. For example the parser.add_option('-n'... has '-n' as short and '--numGames' as the long option string. Both have the same effect. The option argument will be the same and be saved as the variabme 'numGames'. \\n parser.add_option('-n', '--numGames', dest='numGames', type='int', \\n help=default('the number of GAMES to play'), metavar='GAMES', default=1) ## the syntax for the options is (based on the example in this line) --n 3. This means that the value '3' would be assigned to the variable numGames.\\n parser.add_option('-l', '--layout', dest='layout',\\n help=default('the LAYOUT_FILE from which to load the map layout'), #The instance -> 'options.layout' defines the layout_file from which to load the map layout; DEFAULT = medium_classic\\n metavar='LAYOUT_FILE', default='mediumClassic')\\n parser.add_option('-p', '--pacman', dest='pacman',\\n help=default('the agent TYPE in the pacmanAgents module to use'), #The instance -> 'options.pacman' defines which of the agent TYPE in the pacmanAgents moduleto use.\\n metavar='TYPE', default='KeyboardAgent')\\n parser.add_option('-t', '--textGraphics', action='store_true', dest='textGraphics',\\n help='Display output as text only', default=False)\\n parser.add_option('-q', '--quietTextGraphics', action='store_true', dest='quietGraphics',\\n help='Generate minimal output and no graphics', default=False)\\n parser.add_option('-g', '--ghosts', dest='ghost',\\n help=default('the ghost agent TYPE in the ghostAgents module to use'),\\n metavar = 'TYPE', default='RandomGhost')\\n parser.add_option('-k', '--numghosts', type='int', dest='numGhosts',\\n help=default('The maximum number of ghosts to use'), default=4)\\n parser.add_option('-z', '--zoom', type='float', dest='zoom',\\n help=default('Zoom the size of the graphics window'), default=1.0)\\n parser.add_option('-f', '--fixRandomSeed', action='store_true', dest='fixRandomSeed',\\n help='Fixes the random seed to always play the same game', default=False)\\n parser.add_option('-r', '--recordActions', action='store_true', dest='record',\\n help='Writes game histories to a file (named by the time they were played)', default=False)\\n parser.add_option('--replay', dest='gameToReplay',\\n help='A recorded game file (pickle) to replay', default=None)\\n parser.add_option('-a','--agentArgs',dest='agentArgs',\\n help='Comma separated values sent to agent. e.g. \\\"opt1=val1,opt2,opt3=val3\\\"')\\n parser.add_option('-x', '--numTraining', dest='numTraining', type='int',\\n help=default('How many episodes are training (suppresses output)'), default=0)\\n parser.add_option('--frameTime', dest='frameTime', type='float',\\n help=default('Time to delay between frames; <0 means keyboard'), default=0.1)\\n parser.add_option('-c', '--catchExceptions', action='store_true', dest='catchExceptions',\\n help='Turns on exception handling and timeouts during games', default=False)\\n parser.add_option('--timeout', dest='timeout', type='int',\\n help=default('Maximum length of time an agent can spend computing in a single game'), default=30)\\n\\n #ONCE ALL THE OPTIONS HAVE BEEN DEFINED, optparse is instructed to parse the programm's command line.\\n ##> The parser.parse_args() returns two values:\\n ### (A) OPTIONS: An object containing values for all of your options e.g.:e.g. if --file takes a single string argument, then options.file will be the filename supplied by the user, or None if the user did not supply that option\\n ### (B) ARGS: The list of positional arguments leftover after parsing options (we call this here otherjunk)\\n options, otherjunk = parser.parse_args(argv) ## if the user happens to accidentally enter a command other than the specified arguments specified by parser.add_option it is passed to otherjunk\\n if len(otherjunk) != 0: ## if there actually ends up to be a value in the otherjunk the program raises an Exception.\\n raise Exception('Command line input not understood: ' + str(otherjunk))\\n args = dict() # ARGS IS THE VARIABLE THAT IS BEING RETURNED BY THE readCommand function.\\n\\n # Fix the random seed\\n if options.fixRandomSeed: random.seed('cs188') # 'random.seed' is part of the random class. The random.seed([x]) command initialises a standard random number. Optional argument x can be any hashable object. \\n\\n # Choose a layout\\n args['layout'] = layout.getLayout( options.layout ) # REF_LAYOUT111: layout.py --> This function returns the layout object that was created by the layout class via the getlayout function. This contains the height, width, walls, food, captules and agent positions etc.\\n if args['layout'] == None: raise Exception(\\\"The layout \\\" + options.layout + \\\" cannot be found\\\")\\n\\n # Choose a Pacman agent\\n noKeyboard = options.gameToReplay == None and (options.textGraphics or options.quietGraphics) ## noKeyboard is set to TRUE if the user chooses the --replay and text- or silent graphics option.\\n ##print noKeyboard\\n pacmanType = loadAgent(options.pacman, noKeyboard) ## [see REFERENCE_001]: the loadAgent function takes the pacman argument the user passed into the command line as the option--pacman option identifies the appropriate agent (which may be the programmed agent or whost agent). \\n agentOpts = parseAgentArgs(options.agentArgs) ##Passes the option.agentArgs which was captured by the user's console input into the agentOps variable. agentArgs is: \\\"Comma separated values sent to agent. e.g. \\\"opt1=val1,opt2,opt3=val3. The ParseAgentArgs function converts the option - value pairings into a dictionary formatted opts[opt1] = val1. \\n if options.numTraining > 0: ##numTraining was captured by the user's console input and designates how many games are training games which means that the output remains surpressed.\\n args['numTraining'] = options.numTraining ## This takes the user's input as the -x or --numTraining and passes it to the args dictionary with the numTraining key as the args['numTraining'] variable.\\n if 'numTraining' not in agentOpts: agentOpts['numTraining'] = options.numTraining ## This integrates the variable entered into as training rounds in the agentOpts variable.\\n pacman = pacmanType(**agentOpts) ## REFERENCE002 ##Instantiate Pacman with agentOpts. ## The variable pacmanType contains a reference to agent module loaded by the load Agent function. This function does not cause the module to be instanciated. This happens when here ## See[REFERENCE_001]: ## The * and ** will 'soak up' any remaining values not otherwise accounted for. In this case these options are basically the agent options the user can input.\\n ## agentOpts contains the opts dictionary = {opt1:val1, opt2:val2, opt3:val3}; it also contains the numTraining variable as the ['numTraining'] key. As such it has the following structure. {opt1:val1,opt2:val2,opt3:val3, numTraining:int}.\\n args['pacman'] = pacman ## This passes the instanciated object to the agent dictionary containing the pacman key.\\n\\n # Don't display training games\\n if 'numTrain' in agentOpts: ## Checks whether the user has determined a certain number of training games. If they did, the number is passed on as an int to the options.numQuiet and option.numIgnore variables.\\n options.numQuiet = int(agentOpts['numTrain']) \\n options.numIgnore = int(agentOpts['numTrain'])\\n\\n # Choose a ghost agent\\n ghostType = loadAgent(options.ghost, noKeyboard) ## The options.ghost variable contains the user's ghost type preference as specified in the console.The user can choose between -g RandomGhost which is A ghost that chooses a legal action uniformly at random OR DirectionalGhost, a ghost that prefers to rush Pacman, or flee when scared.\\n args['ghosts'] = [ghostType( i+1 ) for i in range( options.numGhosts )] #instanciates as many ghost agents as the player requested by entering the desired number as -k', '--numghosts'in the console.\\n\\n # Choose a display format ##contains whether the game output is displayed as minimal output and no graphics (-q) text only (-t) or via graphicsDiplay (standard)\\n if options.quietGraphics: \\n import textDisplay\\n args['display'] = textDisplay.NullGraphics()\\n elif options.textGraphics:\\n import textDisplay\\n textDisplay.SLEEP_TIME = options.frameTime\\n args['display'] = textDisplay.PacmanGraphics()\\n else:\\n import graphicsDisplay ## This refers to the module that is responsible for the graphical representation of the game.\\n args['display'] = graphicsDisplay.PacmanGraphics(options.zoom, frameTime = options.frameTime) ## This line instanciates the PacmanGraphics class from the graphicsDisplay module and passes the reference to the args['display'] dictionary.\\n args['numGames'] = options.numGames \\n args['record'] = options.record\\n args['catchExceptions'] = options.catchExceptions\\n args['timeout'] = options.timeout\\n\\n # Special case: recorded games don't use the runGames method or args structure\\n if options.gameToReplay != None:\\n print 'Replaying recorded game %s.' % options.gameToReplay \\n import cPickle\\n f = open(options.gameToReplay)\\n try: recorded = cPickle.load(f)\\n finally: f.close()\\n recorded['display'] = args['display']\\n replayGame(**recorded)\\n sys.exit(0)\\n\\n return args #returns the args-dictionary which contains:\\n ##args['pacman'] which contains a dictionary of dictionaries of the agent that was loaded into args['numtraining'] = {agentOpts[opt1]: val1 ; agentOpts[opt2]:val2; agentOpts[opt3]:val3}\\n ##args['layout'] - this function returns the layout object that was created by the layout class via the getlayout function.\\n ##args['numTraining'] which contains which designates how many games are training games which means that the output remains surpressed\\n ##args['ghosts'] - contains the instanciated ghost agents in line with the number the user specified\\n ##args['display'] - contains whether the game output is displayed as minimal output and no graphics (-q) text only (-t) or via graphicsDiplay (standard)\\n ##args['numGames'] - the number of GAMES to play\\n ##args['record'] - Writes game histories to a file (named by the time they were played)\\n ##args['catchExceptions'] = options.catchExceptions - Turns on exception handling and timeouts during games\\n ##args['timeout'] = options.timeout -Maximum length of time an agent can spend computing in a single game\",\n \"def configure_commandline(cmdline_arguments: argparse.Namespace) -> Optional[Text]:\",\n \"def main():\\n\\tn = len(sys.argv)\\n\\tif n == 1:\\n\\t main_menu()\\n\\telif n > 3:\\n\\t print(\\\"Invalid number of args\\\")\\n\\telse:\\n\\t features = {\\n\\t \\\"add\\\": add,\\n\\t \\\"help\\\": main_menu,\\n\\t \\\"ls\\\": getTasks,\\n\\t \\\"done\\\": markOff,\\n\\t \\\"report\\\": getReport,\\n\\t \\\"del\\\": deleteTask}\\n\\t choosedFeature = features.get(sys.argv[1],\\\"Invalid Argument\\\")\\n\\t if choosedFeature == \\\"Invalid Argument\\\":\\n\\t \\tprint(choosedFeature)\\n\\t else:\\n\\t \\tchoosedFeature()\",\n \"def parse_arguments(args):\",\n \"def test_invalid_arguments(self):\\n # More than two arguments should report an error.\\n exit_code, output = run_cli('a', 'b', 'c')\\n assert exit_code != 0\\n assert \\\"Error\\\" in output\\n # Invalid `ionice' values should report an error.\\n exit_code, output = run_cli('--ionice=foo')\\n assert exit_code != 0\\n assert \\\"Error\\\" in output\",\n \"def main():\\n opt = parse_opts()\\n run(opt)\",\n \"def main():\\n opt = parse_opts()\\n run(opt)\",\n \"def check_input(args):\\n\\n # Defaults\\n option = ''\\n fh = sys.stdin # file handle\\n\\n if not len(args):\\n # Reading from pipe with default option\\n if sys.stdin.isatty():\\n sys.stderr.write(__doc__)\\n sys.exit(1)\\n\\n elif len(args) == 1:\\n # One of two options: option & Pipe OR file & default option\\n if args[0].startswith('-'):\\n option = args[0][1:]\\n if sys.stdin.isatty(): # ensure the PDB data is streamed in\\n emsg = 'ERROR!! No data to process!\\\\n'\\n sys.stderr.write(emsg)\\n sys.stderr.write(__doc__)\\n sys.exit(1)\\n\\n else:\\n if not os.path.isfile(args[0]):\\n emsg = 'ERROR!! File not found or not readable: \\\\'{}\\\\'\\\\n'\\n sys.stderr.write(emsg.format(args[0]))\\n sys.stderr.write(__doc__)\\n sys.exit(1)\\n\\n fh = open(args[0], 'r')\\n\\n elif len(args) == 2:\\n # Two options: option & File\\n if not args[0].startswith('-'):\\n emsg = 'ERROR! First argument is not an option: \\\\'{}\\\\'\\\\n'\\n sys.stderr.write(emsg.format(args[0]))\\n sys.stderr.write(__doc__)\\n sys.exit(1)\\n\\n if not os.path.isfile(args[1]):\\n emsg = 'ERROR!! File not found or not readable: \\\\'{}\\\\'\\\\n'\\n sys.stderr.write(emsg.format(args[1]))\\n sys.stderr.write(__doc__)\\n sys.exit(1)\\n\\n option = args[0][1:]\\n fh = open(args[1], 'r')\\n\\n else: # Whatever ...\\n sys.stderr.write(__doc__)\\n sys.exit(1)\\n\\n # Validate option\\n if len(option) > 1:\\n emsg = 'ERROR!! Alternate location identifiers must be single '\\n emsg += 'characters: \\\\'{}\\\\''\\n sys.stderr.write(emsg.format(option))\\n sys.exit(1)\\n\\n return (option, fh)\",\n \"def get_file_read_arg(self):\\n\\ttry:\\n\\t arg = sys.argv[1]\\n\\t file_read = str(arg)\\n\\texcept IndexError:\\n\\t print \\\"Please provide the name of the file that you wish to receive.\\\"\\n\\t sys.exit(\\\"Example usage:\\\\n\\\\nclient.py myfile.txt receivedfile.txt 127.0.0.1 6060 0.0\\\") \\n\\tif (len(file_read) > 100):\\n\\t print \\\"Name of file must be equal to or less than 100 characters.\\\"\\n\\t sys.exit(\\\"Example usage:\\\\n\\\\nclient.py myfile.txt receivedfile.txt 127.0.0.1 6060 0.0\\\")\\n\\telse:\\n\\t return file_read\",\n \"def get_command_line_args(argv):\\n # Initialize the arguments to their default values \\n\\n args = {'startdate': '20200101',\\n 'enddate': '20200102',\\n 'outfile': 'test.nc',\\n 'dt': 5,\\n 'real': True,\\n 'south': False,\\n 'tcv': False,\\n 'substorm': False,\\n 'ions': False,\\n 'move': False,\\n 'cusp': False}\\n\\n arg_type = {'startdate': str,\\n 'enddate': str,\\n 'outfile': str,\\n 'dt': float,\\n 'real': bool,\\n 'south': bool,\\n 'tcv': bool,\\n 'substorm': bool,\\n 'ions': bool,\\n 'move': bool,\\n 'cusp': bool}\\n \\n # If there is input, set default help to False\\n args['help'] = False if len(argv) > 0 else True\\n \\n # Cycle through all arguments except the first, saving input\\n for arg in argv:\\n # Treat the file list and formatting seperately\\n if arg.find('-') == 0:\\n # This is not a filename, remove the dash to get the key\\n split_arg = arg.split('=')\\n akey = split_arg[0][1:]\\n # Get the argument value as the desired type\\n if akey not in arg_type.keys():\\n raise ValueError(''.join(['unknown command line input, ',\\n arg, ', try -help for details']))\\n\\n if len(split_arg) == 1:\\n if arg_type[akey] == bool:\\n arg_val = True\\n else:\\n raise ValueError('expected equality after flag {:}'.format(\\n akey))\\n else:\\n if arg_type[akey] == int:\\n arg_val = int(split_arg[1])\\n elif arg_type[akey] == float:\\n arg_val = float(split_arg[1])\\n elif arg_type[akey] == str:\\n arg_val = split_arg[1]\\n else:\\n # This is boolean input\\n arg_val = bool_string(split_arg[1])\\n\\n args[akey] = arg_val\\n \\n return args\",\n \"def validate_arguments(self,args):\\n\\t\\tif args.org == None:\\n\\t\\t\\tprint('Please specify Organization name. Exiting.')\\n\\t\\t\\tsys.exit(0)\\n\\t\\tif args.repo == None:\\n\\t\\t\\tprint('Please specify Repositories name. Exiting.')\\n\\t\\t\\tsys.exit(0)\\n\\t\\tif args.event_type == None:\\n\\t\\t\\tprint('Please specify type of the event. Exiting.')\\n\\t\\t\\tsys.exit(0)\",\n \"def get_op():\\n if len(sys.argv) < 2:\\n print(\\\"Error! You must enter either '-e' or '-d' as the first argument.\\\")\\n return -1\\n return sys.argv[1]\",\n \"def test_args(self):\\n parser = argparse.ArgumentParser(\\n prog=\\\"sysbottle\\\", description=\\\"sysbottle is parsed\\\"\\n )\\n subparsers = parser.add_subparsers()\\n sysbottle.build(subparsers)\\n args = parser.parse_args(\\n [\\n \\\"sysbottle\\\",\\n \\\"abc.txt\\\",\\n \\\"-c\\\",\\n \\\"90\\\",\\n \\\"-q\\\",\\n \\\"1\\\",\\n \\\"-d\\\",\\n \\\"sda\\\",\\n \\\"-i\\\",\\n \\\"5\\\",\\n \\\"-t\\\",\\n \\\"3\\\",\\n ]\\n )\\n self.assertTrue(hasattr(args, \\\"file\\\"))\\n self.assertTrue(hasattr(args, \\\"cpu\\\"))\\n self.assertTrue(hasattr(args, \\\"diskQ\\\"))\\n self.assertTrue(hasattr(args, \\\"disks\\\"))\\n self.assertTrue(hasattr(args, \\\"iowait\\\"))\\n self.assertTrue(hasattr(args, \\\"throughput\\\"))\",\n \"def test_robo():\\n print(\\n \\\"Choose the option of input:\\\\n\\\"\\n \\\"1. Enter the command string\\\\n\\\"\\n \\\"2. Select from input file\\\"\\n )\\n option = input(\\\"Enter 1 or 2 to select the input method:\\\")\\n # Wait till the right option is chosen.\\n while not (option == \\\"1\\\" or option == \\\"2\\\"):\\n print(\\\"Invalid option, please enter valid option\\\")\\n option = input(\\\"Enter 1 or 2 to select the input method:\\\")\\n\\n if option == \\\"1\\\":\\n command = input(\\\"Enter the command as string:\\\")\\n # To format the cli command to proper string.\\n command = command[1:-1]\\n robo = calculate_distance.Robot()\\n robo.main(command)\\n\\n elif option == \\\"2\\\":\\n file = open(os.path.dirname(__file__) + \\\"/input.yml\\\")\\n parsed_input_file = yaml.load(file, Loader=yaml.FullLoader)\\n command_list = parsed_input_file.get(\\\"input_list\\\")\\n # To iterate through the list of commands given.\\n for item in command_list:\\n robo = calculate_distance.Robot()\\n robo.main(item)\",\n \"def get_mode():\\n\\tprint(\\\"Please choose the file type that you want to normalize ('band'/'phband'/'dos'): \\\", end='')\\n\\twhile True:\\n\\t\\tmode = input()\\n\\t\\tif mode == \\\"b\\\" or mode == \\\"band\\\" : return \\\"band\\\"\\n\\t\\telif mode == \\\"pb\\\" or mode == \\\"phband\\\": return \\\"phband\\\"\\n\\t\\telif mode == \\\"d\\\" or mode == \\\"dos\\\" : return \\\"dos\\\"\\n\\t\\telif mode == \\\"phd\\\" or mode == \\\"phdos\\\" :\\n\\t\\t\\tprint(\\\"phdos-files don't need to be normalized; if you wanna change the unit, plz try other programs.\\\"); exit(1)\\n\\t\\telse: print(\\\"Plz enter 'band'/'b', 'phband'/'pb', or 'dos'/'d': \\\", end=\\\"\\\")\",\n \"def main(args):\",\n \"def main(args):\",\n \"def read_type():\\n\\twhile True:\\n\\t\\t_type = input(\\\"Introduceti tipul: \\\")\\n\\t\\tif (is_in_list(_type, VALID_TYPES)):\\n\\t\\t\\treturn (_type)\\n\\t\\telse:\\n\\t\\t\\tprint(\\\"Tipul este invalid.\\\")\",\n \"def test_filename_required():\\n with pytest.raises(SystemExit):\\n cli.parse_args(['-f'])\",\n \"def ReadArguments():\\n\\n args = ParseArguments()\\n\\n logging.info('Command line arguments...')\\n for arg in vars(args):\\n logging.info(str(arg) + ': ' + str(getattr(args, arg)))\\n logging.info('')\\n\\n IsTest(args)\\n ProcessCacheSize(args)\\n ProcessLineSize(args)\\n ProcessMulti(args)\\n ProcessMemPattern(args)\\n ProcessMemFile(args)\",\n \"def parameters_are_valid():\\n # The only accepted number of command line arguments is 3: they are\\n # aggregator.py, the filename, and the topic\\n if len(sys.argv) != 3:\\n # Issue error message if invalid number of command line arguments\\n print(\\\"Error: invalid number of arguments\\\")\\n print(\\\"Usage: aggregator.py filename topic\\\")\\n return False\\n else:\\n return True\",\n \"def test_exit_on_wrong_type(self):\\n with self.assertRaises(SystemExit):\\n pyint = Interpreter()\\n pyint.run(file=WRONG_TYPE)\",\n \"def handleCmdLine(self):\\n description = \\\"Nagios monitoring script to check for open ports\\\\n\\\"\\n usage = (\\\"%prog <options>\\\\n\\\")\\n parser = OptionParser(usage=usage, description=description)\\n\\n parser.add_option(\\\"-c\\\", \\\"--config\\\",\\n type=\\\"string\\\",\\n help=\\\"path to open ports configuration file\\\")\\n parser.add_option(\\\"-l\\\", \\\"--list\\\",\\n type=\\\"string\\\",\\n help=\\\"supply list of allowed ports seperated by comma.\\\")\\n\\n (self.options, args) = parser.parse_args()\",\n \"def get_input_file():\\n if len(sys.argv) < 3:\\n return -1\\n return sys.argv[2]\",\n \"def main():\\n try:\\n string = sys.argv[1]\\n substring = sys.argv[2]\\n\\n except IndexError:\\n string = None\\n substring = None\\n\\n try:\\n sys.argv[3]\\n\\n except IndexError:\\n pass\\n\\n else:\\n print(\\\" More than expected Number of Arguments\\\")\\n string = None\\n substring = None\\n\\n RabinKarp(string, substring)\",\n \"def parseArg(self, c):\\n\\n\\t\\tif rocks.app.Application.parseArg(self,c):\\n\\t\\t\\treturn 1\\n\\t\\telif c[0] in ('-h', '--help'):\\n\\t\\t\\tself.help()\\n\\t\\telif c[0] in ('-x', '--xml'):\\n\\t\\t\\tself.xmlname = c[1]\\n\\t\\telse:\\n\\t\\t\\treturn 0\\n\\t\\treturn 1\",\n \"def parse_cmdline():\\n\\tparser = ArgumentParser(prog=\\\"FastP_QC.py\\\", description=\\\"\\\"\\\"Script collects stats from fastp jsons.\\\"\\\"\\\")\\n\\tparser.add_argument(\\\"-r1\\\", \\\"--r1_stats\\\", dest=\\\"r1_stats\\\", action=\\\"store\\\", required=True, help=\\\"Text file with r1 stats, from q30.py script.\\\")\\n\\tparser.add_argument(\\\"-r2\\\", \\\"--r2_stats\\\", dest=\\\"r2_stats\\\", action=\\\"store\\\", required=True, help=\\\"Text file with r2 stats, from q30.py script.\\\")\\n\\tparser.add_argument(\\\"-n\\\", \\\"--name\\\", dest=\\\"name\\\", action=\\\"store\\\", required=True, help=\\\"Sample name\\\")\\n\\targs = parser.parse_args()\\n\\treturn args\",\n \"def command_line_arguments():\\n\\n try:\\n parser = argparse.ArgumentParser(description='Log Handler/Cleaner/Copier for Idemia DocAuth')\\n\\n # Add required arguments.\\n parser.add_argument('action', choices=['clean', 'download'], type=str, help='clean or download')\\n\\n # Parse the arguments\\n args = parser.parse_args()\\n\\n return args\\n\\n except Exception as err:\\n print(err)\\n return\",\n \"def check_args(lst):\\n # Must have at least as first argument the zone file to turn to yaml\\n if len(lst) < 3 or not os.path.isfile(lst[1]):\\n print \\\"This script needs at least a valid zone file path as argument\\\"\\n print \\\"Its usage is\\\", sys.argv[0], \\\" zonefile_path domain_name\\\"\\n print \\\"zonefile_path being the path to the zone file and domain_name the domain name\\\"\\n sys.exit(\\\"Insufficient Number of Arguments\\\")\",\n \"def handle_cmdline():\\n\\n cmdline = ArgumentParser(init_args=['address', 'arch', 'file'],\\n address_required=True, address_default=None,\\n file_required=True,\\n file_help='Flash or memory image to inspect',\\n formatter_class=RawDescriptionHelpFormatter,\\n usage=_USAGE, description=_DESCRIPTION, epilog=_EPILOG)\\n\\n cmdline.add_argument('--longhelp',\\n choices=['Y', 'N'],\\n default=None,\\n help=_LONGHELP_TEXT)\\n\\n cmdline.add_argument('--autocomplete',\\n choices=['Y', 'N'],\\n default=None,\\n help=_AUTOCOMPLETE_TEXT)\\n\\n cmdline.add_argument('--threshold',\\n type=int,\\n default=5,\\n help='Minimum table size to report. Default: 5')\\n\\n cmdline.add_argument('--subcmds',\\n action='store_true',\\n default=False,\\n help='Include sub-command tables in displayed results')\\n\\n cmdline.add_argument('--details',\\n action='store_true',\\n default=False,\\n help='Display more detailed output')\\n\\n args = cmdline.parse_args()\\n\\n if args.longhelp is not None:\\n args.longhelp = args.longhelp == 'Y'\\n\\n if args.autocomplete is not None:\\n args.autocomplete = args.autocomplete == 'Y'\\n\\n return args\",\n \"def get_port_arg(self):\\n\\ttry:\\n\\t arg = sys.argv[4]\\n\\t port = int(arg) \\n\\texcept ValueError:\\n\\t print \\\"Port must be a number only.\\\"\\n\\t sys.exit(\\\"Example usage:\\\\n\\\\nclient.py myfile.txt receivedfile.txt 127.0.0.1 6060 0.0\\\")\\t \\n\\texcept IndexError:\\n\\t print \\\"Port number must be provided.\\\"\\n\\t sys.exit(\\\"Example usage:\\\\n\\\\nclient.py myfile.txt receivedfile.txt 127.0.0.1 6060 0.0\\\")\\t \\n\\tif any([port < 1024, port > 60000]):\\n\\t print \\\"Port must be between 1024 and 60000\\\"\\n\\t sys.exit(\\\"Example usage:\\\\n\\\\nclient.py myfile.txt receivedfile.txt 127.0.0.1 6060 0.0\\\")\\t \\n\\telse:\\n\\t return port\",\n \"def process_check_input_argument():\\n\\n try:\\n input_argv = sys.argv[1]\\n if input_argv == \\\"0\\\":\\n stand_alone_flag = 0\\n else:\\n stand_alone_flag = 0\\n except IndexError:\\n stand_alone_flag = 1\\n\\n return stand_alone_flag\",\n \"def getArg(flag):\\n try:\\n a = sys.argv[sys.argv.index(flag) + 1]\\n except:\\n return \\\"\\\"\\n else:\\n return a\",\n \"def parse_command_line_arguments(command_line_arguments):\\n # First determine if a we're loading from a file\\n filename = False\\n if \\\"--file\\\" in command_line_arguments:\\n index = command_line_arguments.index(\\\"--file\\\")+1\\n filename = command_line_arguments[index]\\n if output.tracking_suffix in filename:\\n # Assumes simulation in progress. So, if final_sweep ==\\n # current_sweep, the simulation will load and then\\n # immediately end.\\n return get_progress_file_info(filename)\\n if not (output.output_suffix in filename):\\n raise ValueError(\\\"Can only load from *.boundaryprg2p1 or \\\"\\n +\\\"*.boundary2p1 files!\\\")\\n # If filename is of type *.boundary2p1, we assume its okay and\\n # load from it. None of the other command line arguments\\n # change.\\n\\n if \\\"--select\\\" in command_line_arguments:\\n index = command_line_arguments.index(\\\"--select\\\")+1\\n if command_line_arguments[index] == \\\"std\\\":\\n algorithm = monte_carlo.select_for_curvature\\n elif command_line_arguments[index] == \\\"area\\\":\\n algorithm = monte_carlo.select_for_area\\n else:\\n algorithm = default_algorithm\\n else:\\n algorithm = default_algorithm \\n\\n if \\\"--target-area\\\" in command_line_arguments:\\n index = command_line_arguments.index(\\\"--target-area\\\")+1\\n target_area = int(eval(command_line_arguments[index]))\\n else:\\n target_area = int(eval(command_line_arguments[0]))\\n\\n if \\\"--target-std\\\" in command_line_arguments:\\n index = command_line_arguments.index(\\\"--target-std\\\")+1\\n target_std = float(eval(command_line_arguments[index]))\\n else:\\n target_std = default_target_std\\n\\n if \\\"--area-damping\\\" in command_line_arguments:\\n index = command_line_arguments.index(\\\"--area-damping\\\")+1\\n area_damping_strength = float(eval(command_line_arguments[index]))\\n else:\\n area_damping_strength = default_area_damping\\n if not 0 <= area_damping_strength <= 1:\\n raise ValueError(\\\"Damping must be between 0 and 1.\\\")\\n\\n if \\\"--std-damping\\\" in command_line_arguments:\\n index = command_line_arguments.index(\\\"--std-damping\\\")+1\\n std_damping_strength = float(eval(command_line_arguments[index]))\\n else:\\n std_damping_strength = default_std_damping\\n if not 0 <= area_damping_strength <= 1:\\n raise ValueError(\\\"Damping must be between 0 and 1.\\\")\\n\\n if \\\"--initial\\\" in command_line_arguments:\\n index = command_line_arguments.index(\\\"--initial\\\")+1\\n initial_sweep = int(eval(command_line_arguments[index]))\\n else:\\n initial_sweep = default_initial_sweep\\n\\n if \\\"--final\\\" in command_line_arguments:\\n index = command_line_arguments.index(\\\"--final\\\")+1\\n final_sweep = int(eval(command_line_arguments[index]))\\n else:\\n final_sweep = default_final_sweep\\n\\n if \\\"--save\\\" in command_line_arguments:\\n index = command_line_arguments.index(\\\"--save\\\")+1\\n save_every_n_sweeps = int(eval(command_line_arguments[index]))\\n else:\\n save_every_n_sweeps = default_save_every_n_sweeps\\n if save_every_n_sweeps < 1:\\n raise ValueError(\\\"You must save at least every 1 sweeps!\\\")\\n\\n if \\\"--v5\\\" in command_line_arguments:\\n index = command_line_arguments.index(\\\"--v5\\\")+1\\n v5damping = int(eval(command_line_arguments[index]))\\n else:\\n v5damping = target_area/10\\n\\n if \\\"--v6\\\" in command_line_arguments:\\n index = command_line_arguments.index(\\\"--v6\\\")+1\\n v6damping = int(eval(command_line_arguments[index]))\\n else:\\n v6damping = target_area/10\\n \\n if \\\"--many\\\" in command_line_arguments:\\n if \\\"--one\\\" in command_line_arguments or \\\"--exact\\\" in command_line_arguments:\\n raise ValueError(\\\"Contradictory input!\\\")\\n if \\\"--micro\\\" in command_line_arguments:\\n gather_data_function = output.save_many_microscopically_optimal\\n else:\\n gather_data_function = output.gather_data_to_n_files\\n elif \\\"--one\\\" in command_line_arguments:\\n if \\\"--many\\\" in command_line_arguments or \\\"--exact\\\" in command_line_arguments:\\n raise ValueError(\\\"Condtradictory input!\\\")\\n if \\\"--micro\\\" in command_line_arguments:\\n gather_data_function = output.stop_at_microscopically_optimal\\n else:\\n gather_data_function = output.gather_data_to_1_file\\n elif \\\"--exact\\\" in command_line_arguments:\\n if \\\"--many\\\" in command_line_arguments or \\\"--one\\\" in command_line_arguments:\\n raise ValueError(\\\"Contradictory input!\\\")\\n gather_data_function = output.generate_n_exact_spheres\\n index = command_line_arguments.index(\\\"--exact\\\")+1\\n # In this case, v5damping is fitness_damping, as defined\\n # in generate_n_exact_spheres\\n v5damping = int(eval(command_line_arguments[index]))\\n else:\\n if \\\"--micro\\\" in command_line_arguments:\\n gather_data_function = output.stop_at_microscopically_optimal\\n else:\\n gather_data_function = output.gather_data_to_1_file\\n\\n # return a class with all the info we need\\n params = parameters(filename, target_area, area_damping_strength,\\n target_std, std_damping_strength,\\n initial_sweep, final_sweep,\\n save_every_n_sweeps,\\n v5damping, v6damping,\\n algorithm,\\n gather_data_function)\\n return params\",\n \"def validate_args(args):\\n if len(args) != 4:\\n print(\\\"ERROR: incorrect length of args.\\\")\\n cli_help_msg()\\n sys.exit()\\n\\n #first argument: check it is a read directory\\n if args[1].lower().strip() == 'docid' or args[1].lower().strip() == 'docno':\\n print(\\\"ERROR: incorrect key. Please pass 'docid' or 'docno'\\\")\\n sys.exit()\",\n \"def main(args=None):\",\n \"def main(args=None):\",\n \"def parse_command_line():\\n parser = argparse.ArgumentParser()\\n\\n # All reference encoders\\n parser.add_argument(\\\"--step\\\", dest=\\\"step\\\", default=\\\"10\\\", type=int, help=\\\"step size\\\")\\n parser.add_argument(\\\"--repeats\\\", dest=\\\"repeats\\\", type=int, default=1, help=\\\"repeats\\\")\\n\\n parser.add_argument(dest=\\\"image\\\", default=None,\\n help=\\\"select the test image to run\\\")\\n\\n args = parser.parse_args()\\n return args\",\n \"def read_opts(self):\\n\\n # process any optlist_ options\\n self.valid_opts.check_special_opts(sys.argv)\\n\\n # ------------------------------------------------------------\\n # terminal arguments, first\\n\\n # cannot have len(argv) <= 1 here, but be consistent with other progs\\n if len(sys.argv) <= 1 or '-help' in sys.argv:\\n print g_help_string\\n return 0\\n\\n if '-hist' in sys.argv:\\n print g_history\\n return 0\\n\\n if '-ver' in sys.argv:\\n print g_version\\n return 0\\n\\n if '-show_valid_opts' in sys.argv:\\n self.valid_opts.show('', 1)\\n return 0\\n\\n # ------------------------------------------------------------\\n # read all user options\\n\\n self.user_opts = self.OL.read_options(sys.argv, self.valid_opts)\\n if not self.user_opts: return 1 # error condition\\n\\n return None # normal completion\",\n \"def getArgs():\\r\\n parser = argparse.ArgumentParser(\\r\\n description = \\\"\\\"\\\"This program uses the validation data and a given model to do brain segmentation that will be sent to FeTs challenge to get evaluated \\\"\\\"\\\")\\r\\n parser.add_argument(\\\"-d\\\", type = str, help = \\\"d is the path to validation dataset, e.g: C:/Documents/MICCAI_FeTS2021_TrainingData/\\\")\\r\\n parser.add_argument(\\\"-m\\\", type = str, help = \\\"m is the path for the model to load, e.g: C:/Documents/MICCAI_FeTS2021_TrainingData/cpt/cpt_0_1\\\")\\r\\n parser.add_argument(\\\"-o\\\", type = str, help = \\\"o is the output path, e.g: C:/Documents/inferences\\\")\\r\\n # Get your arguments\\r\\n return parser.parse_args()\",\n \"def runmain(args):\\n\\n #case: no extra args, so return help\\n if len(args) == 0:\\n print USAGE\\n return\\n\\n toolname = args[1]\\n if toolname == 'help':\\n print USAGE\\n return\\n\\n elif toolname == 'splitdata':\\n splitdata(args)\\n return\\n \\n elif toolname == 'aboutdata':\\n aboutdata(args)\\n return\\n\\n elif toolname == 'test':\\n testffx(args)\\n return\\n \\n else:\\n print \\\"There is no toolname of '%s'.\\\" % toolname\\n print USAGE\\n return\",\n \"def _cli_validate(self, settings, remaining_argv):\\n return None\",\n \"def grabRequiredArgs(passed_required_arg,required_arg,required_arg_type):\\n \\n # Check for correct number of arguments\\n if len(passed_required_arg) - 1 < len(required_arg):\\n print \\\"Missing arguments(s)\\\"\\n print \\\"Try --help for options.\\\"\\n sys.exit(1)\\n \\n # Pull command line values and place in dictionary with correct argument\\n # identifier\\n required_arg_values = {}\\n for i in range(0,len(required_arg)):\\n required_arg_values.update([(required_arg[i],passed_required_arg[i+1])])\\n \\n # Do a few sanity checks on required arguments (using required_arg_type)\\n for index, arg in enumerate(required_arg):\\n # Check for input file existance\\n if required_arg_type[index] == 'inpfile':\\n try:\\n open(required_arg_values[arg],'r')\\n except IOError:\\n print \\\"File '\\\" + required_arg_values[arg] + \\\"' not readable!\\\"\\n sys.exit(2)\\n \\n # Prompt before overwriting output files\\n if required_arg_type[index] == 'outfile':\\n try:\\n open(required_arg_values[arg],'r')\\n except IOError:\\n continue\\n decision = raw_input(\\\"Warning! File '\\\" + required_arg_values[arg] \\\\\\n + \\\"' already exists! overwrite (y/n)? \\\")\\n if decision[0] == 'Y' or decision[1] == 'y':\\n os.remove(required_arg_values[arg])\\n else:\\n sys.exit()\\n \\n # Check for directory existance\\n if required_arg_type[index] == 'outdir':\\n try:\\n os.listdir(required_arg_values[arg])\\n except OSError:\\n decision = raw_input(\\\"Directory '\\\" + required_arg_values[arg] + \\\\\\n \\\"' does not exist. Create it (y/n)? \\\")\\n if decision[0] == 'Y' or decision[0] == 'y':\\n os.mkdir(required_arg_values[arg])\\n else:\\n sys.exit()\\n \\n # If there are any more arguments on the command line, report them and\\n # ignore them.\\n if len(passed_required_arg) - 1 > len(required_arg):\\n print \\\"Trailing arguments (not evaluated):\\\"\\n for trailer in passed_required_arg[len(required_arg):]:\\n print trailer\\n \\n return required_arg_values\",\n \"def check_input_args(in_arg, phase=\\\"train\\\"):\\n\\n if phase==\\\"train\\\": \\n # Check that flowers directory exists \\n if not path.isdir(in_arg.data_dir):\\n print(\\\"For data loading: can't find directory '{}' starting from '{}'. Please check the paths and run again!\\\" . format(in_arg.data_dir, os.getcwd()))\\n sys.exit(0)\\n \\n # Check that checkpoints directory exists\\n if not path.isdir(in_arg.save_dir):\\n print(\\\"For checkpoints saving: can't find directory '{}' starting from '{}'. Please check the paths and run again!\\\" . format(in_arg.save_dir, os.getcwd()))\\n sys.exit(0) \\n \\n else:\\n # phase == predict\\n # Check that the flower name exists. Example: \\\"/data/flowers/test/25/image_06583.jpg\\\"\\n if not path.isfile(in_arg.image_file):\\n print(\\\"Image file: can't find file '{}' starting from '{}'. Please check the path, filename and run again!\\\" . format(in_arg.image_file, os.getcwd()))\\n sys.exit(0) \\n \\n if not path.isfile(in_arg.checkpoint):\\n print(\\\"Checkpoint file: can't find file '{}' starting from '{}'. Please check the path, filename and run again!\\\" . format(in_arg.checkpoint, os.getcwd()))\\n sys.exit(0)\\n \\n if in_arg.category_names and not path.isfile(in_arg.category_names):\\n print(\\\"Category names file: can't find file '{}' starting from '{}'. Please check the path, filename and run again!\\\" . format(in_arg.category_names, os.getcwd()))\\n sys.exit(0) \\n \\n # All cases\\n\\n # Check that the architecture is supported\\n if in_arg.arch not in ['alexnet', 'resnet18', 'vgg19_bn']:\\n print(\\\"Architecture can only be: alexnet, resnet18 or vgg19_bn. Please check the architecture and run again!\\\")\\n sys.exit(0) \\n \\n # Check that a valid value has been set for gpu\\n if in_arg.gpu != 0 and in_arg.gpu != 1:\\n print(\\\"GPU can only be set to 0 (disable) or 1 (enable)! Please check the value and run again!\\\")\\n sys.exit(0)\",\n \"def checkCommandArgs():\\n try:\\n int(sys.argv[1]) #sin\\n int(sys.argv[2]) #sout\\n int(sys.argv[3]) #csin\\n except (ValueError, IndexError) as e:\\n print (\\\"One or more port numbers are not ints or were not entered\\\")\\n sys.exit()\\n \\n for i in range(3):\\n if int(sys.argv[i+1]) > PORT_RANGE_UPPER or int(sys.argv[i+1]) < PORT_RANGE_LOWER:\\n print(\\\"One or more port number out of range\\\")\\n sys.exit()\\n \\n if not os.path.isfile(sys.argv[4]):\\n print(\\\"file does not exist\\\")\\n sys.exit()\\n \\n return int(sys.argv[1]), int(sys.argv[2]), int(sys.argv[3]), sys.argv[4]\",\n \"def test_type_name(self, parse_input):\\n bb = parse_input(\\\"name testname\\\\nversion 1.0\\\\ntype type\\\")\\n assert bb.programtype[\\\"name\\\"] == \\\"type\\\"\",\n \"def run(self):\\n if len(sys.argv[1:]) == 0:\\n arg_parse.print_help()\\n arg_parse.exit()\\n\\n try:\\n if args.unix:\\n self.from_unix_sec()\\n print (\\\"Unix Seconds: \\\" + self.in_unix_sec + \\\" UTC\\\")\\n elif args.umil:\\n self.from_unix_milli()\\n print (\\\"Unix Milliseconds: \\\" + self.in_unix_milli + \\\" UTC\\\")\\n elif args.wh:\\n self.from_win_64_hex()\\n print (\\\"Windows 64 bit Hex BE: \\\" + self.in_windows_hex_64 + \\\" UTC\\\")\\n elif args.whle:\\n self.from_win_64_hexle()\\n print (\\\"Windows 64 bit Hex LE: \\\" + self.in_windows_hex_le + \\\" UTC\\\")\\n elif args.goog:\\n self.from_chrome()\\n print (\\\"Google Chrome Time: \\\" + self.in_chrome + \\\" UTC\\\")\\n elif args.active:\\n self.from_ad()\\n print (\\\"Active Directory Timestamp: \\\" + self.in_ad + \\\" UTC\\\")\\n elif args.uhbe:\\n self.from_unix_hex_32be()\\n print (\\\"Unix Hex 32 bit BE: \\\" + self.in_unix_hex_32 + \\\" UTC\\\")\\n elif args.uhle:\\n self.from_unix_hex_32le()\\n print (\\\"Unix Hex 32 bit LE: \\\" + self.in_unix_hex_32le + \\\" UTC\\\")\\n elif args.cookie:\\n self.from_cookie()\\n print (\\\"Windows Cookie Date: \\\" + self.in_cookie + \\\" UTC\\\")\\n elif args.oleb:\\n self.from_ole_be()\\n print (\\\"Windows OLE 64 bit double BE: \\\" + self.in_ole_be + \\\" UTC\\\")\\n elif args.olel:\\n self.from_ole_le()\\n print (\\\"Windows OLE 64 bit double LE: \\\" + self.in_ole_le + \\\" UTC\\\")\\n elif args.mac:\\n self.from_mac()\\n print (\\\"Mac Absolute Time: \\\" + self.in_mac + \\\" UTC\\\")\\n elif args.hfsdec:\\n self.from_hfs_dec()\\n print (\\\"Mac OS/HFS+ Decimal Date: \\\" + self.in_hfs_dec + \\\" UTC\\\")\\n elif args.hfsbe:\\n self.from_hfs_be()\\n print (\\\"HFS/HFS+ 32 bit Hex BE: \\\" + self.in_hfs_be + \\\" HFS Local / HFS+ UTC\\\")\\n elif args.hfsle:\\n self.from_hfs_le()\\n print (\\\"HFS/HFS+ 32 big Hex LE: \\\" + self.in_hfs_le + \\\" HFS Local / HFS+ UTC\\\")\\n elif args.msdos:\\n self.from_msdos()\\n print (\\\"MS-DOS 32 bit Hex Value: \\\" + self.in_msdos + \\\" Local\\\")\\n elif args.fat:\\n self.from_fat()\\n print (\\\"FAT Date + Time: \\\" + self.in_fat + \\\" Local\\\")\\n elif args.sys:\\n self.from_systime()\\n print (\\\"Microsoft 128 bit SYSTEMTIME: \\\" + self.in_systemtime + \\\" UTC\\\")\\n elif args.ft:\\n self.from_filetime()\\n print (\\\"Microsoft FILETIME/LDAP time: \\\" + self.in_filetime + \\\" UTC\\\")\\n elif args.pr:\\n self.from_prtime()\\n print (\\\"Mozilla PRTime: \\\" + self.in_prtime + \\\" UTC\\\")\\n elif args.auto:\\n self.from_ole_auto()\\n print (\\\"OLE Automation Date: \\\" + self.in_ole_auto + \\\" UTC\\\")\\n elif args.ios:\\n self.from_ios_time()\\n print (\\\"iOS 11 Date: \\\" + self.in_iostime)\\n elif args.sym:\\n self.from_sym_time()\\n print (\\\"Symantec AV Timestamp: \\\" + self.in_symtime)\\n elif args.gps:\\n self.from_gps_time()\\n print (\\\"GPS Timestamp: \\\" + self.in_gpstime)\\n elif args.timestamp:\\n self.to_timestamps()\\n elif args.guess:\\n self.from_all()\\n except Exception as e:\\n logging.error(str(type(e)) + \\\",\\\" + str(e))\",\n \"def parse_arguments():\\n parser = argparse.ArgumentParser(description=\\\"Parse library type information.\\\")\\n parser.add_argument(\\\"input_file\\\", help=\\\"Salmon library type information file.\\\")\\n return parser.parse_args()\",\n \"def getopts():\\n parser = argparse.ArgumentParser()\\n parser.add_argument(\\\"-i\\\", \\\"--input\\\", type=argparse.FileType('r'),\\n required=True, help=\\\"input file (.csv)\\\")\\n return parser.parse_args()\",\n \"def test_invalidargs(clickrunner):\\n for args in maincli.invalid_args:\\n result = clickrunner.invoke(maincli.entrypoint, args)\\n assert result.exit_code == 2\\n assert \\\"no such option\\\" in result.output\",\n \"def parse_command_line_arguments(argv):\\n print(\\\"reading command line arguments in...\\\")\\n\\n parser = argparse.ArgumentParser(description='Description of your program')\\n parser.add_argument('-i', '--input', help='Location of input csv file', required=True)\\n parser.add_argument('-p', '--predicting', help='The column name containing the category to predict', required=True)\\n parser.add_argument('-s', '--scoring', help='The scoring type to be used with model evaluation', required=False)\\n parser.add_argument('-c', '--scale', help='List of column names to scale values for', nargs='+', required=False)\\n args = parser.parse_args()\\n\\n return args.input, args.predicting, args.scoring, args.scale\",\n \"def test_cli_unknown(run):\\n\\n out, err, mocked_input = run(\\n dork.cli.main, '-?', input_side_effect=['tester', '.rq'])\\n assert 'Greetings' in out\\n assert err == \\\"\\\"\\n assert mocked_input.call_count == 2\",\n \"def conf_load_run_specification(fin):\\n err_msg = \\\"Unknown specification. Excpected RUN:'name'.\\\"\\n spec = fin.readline().strip().split(':')\\n if len(spec) != 2 or spec[0] != 'RUN':\\n raise EnvironmentError(err_msg)\\n name = spec[1].strip()\\n if len(name) == 0:\\n raise EnvironmentError(\\\"Excpected non empty name for RUN(RUN:'name').\\\")\\n return name\",\n \"def _get_input_from_argv():\\n payload_index = sys.argv.index('--') + 1\\n params = sys.argv[payload_index:]\\n if not params:\\n raise ValueError(\\n \\\"A JSON payload was expected after the -- delimiter, but none \\\"\\n \\\"was found.\\\")\\n return ' '.join(params)\",\n \"def handle_cmdline_args():\\n\\n parser = argparse.ArgumentParser(\\n description='Generate synthetic data from a specification in a json '\\n 'file using the \\\"synth-method\\\" described in the json file. ')\\n\\n parser.add_argument(\\n '-i', dest='infile', required=True,\\n help='The input json file. Must contain a \\\"synth-method\\\" property')\\n\\n parser.add_argument(\\n '-o', dest='outfile_prefix', required=True, help='The prefix of the output paths (data json and csv), relative to the QUIPP-pipeline root directory')\\n\\n args = parser.parse_args()\\n return args\",\n \"def readCommand( argv ):\\n from optparse import OptionParser\\n usageStr = \\\"\\\"\\\"\\n USAGE: python wumpus.py <options>\\n EXAMPLES: python wumpus.py --agent DummyAgent\\n OR python wumpus.py -a DummyAgent\\n - run wumpus with the dummy agent\\n \\\"\\\"\\\"\\n parser = OptionParser(usageStr)\\n \\n parser.add_option('-a', '--agent', dest = 'agent',\\n help = default('the agent to use'),\\n metavar = 'TYPE', default = 'DummyAgent')\\n parser.add_option('-w', '--width', dest ='width',\\n help = default('World width'), default = 4)\\n parser.add_option('-s', '--speed', dest ='speed',\\n help = default('Speed'), default = 70)\\n parser.add_option('-t', '--timeout', dest='timeout',\\n help = default('Maximum search time (for debugging purpose)'), default = 2000)\\n parser.add_option('-g', '--debugging', dest = 'debugging',\\n help = 'For debuging purpose, set the random seed which generates the same world with the same seed', default = -1)\\n \\n options, otherjunk = parser.parse_args(argv)\\n\\n if len(otherjunk) != 0:\\n raise Exception('Command line input not understood: ' + str(otherjunk))\\n args = dict()\\n \\n # Choose a Wumpus solver\\n try:\\n module = __import__('agent')\\n if options.agent in dir(module):\\n agent = getattr(module, options.agent)\\n args['agent'] = agent()\\n else:\\n raise Exception('Unknown agent: ' + options.agent)\\n except ImportError:\\n raise Exception('No file agent.py')\\n \\n args['width'] = int(options.width) + 2 # Add the borders.\\n args['speed'] = int(options.speed)\\n args['timeout'] = int(options.timeout)\\n args['debugging'] = options.debugging\\n\\n return args\",\n \"def parse_args(self):\\n #-----------------------------------------------------------------------\\n #This code is based on code from the KR Toolkit by Christian Muise\\n #URL: http://code.google.com/p/krtoolkit/\\n try:\\n argv, opts, flags = sys.argv[1:], {}, []\\n while argv:\\n if argv[0][0:2] == '--':\\n flags.append(argv[0])\\n argv = argv[1:]\\n elif argv[0][0] == '-':\\n opts[argv[0]] = argv[1]\\n argv = argv[2:]\\n else:\\n raise InputException(\\\"Badly constructed arg: \\\" +argv[0])\\n except IndexError:\\n raise InputException(\\\"Badly constructed arg: \\\" + argv[0])\\n #-----------------------------------------------------------------------\\n for flag in flags:\\n if flag in self.program_flags:\\n vars(self)[self.program_flags[flag].var_name] = True\\n if self.program_flags[flag].function:\\n self.program_flags[flag].function(self)\\n else:\\n raise InputException(\\\"Invalid flag: \\\" + flag)\\n \\n if not self.quiet:\\n min_width = max(len('Flags:'),\\n max(map(lambda x : len(x.description),\\n self.program_args.itervalues()))) + 1\\n if len(flags) == 0:\\n print \\\"{:<{}} {}\\\".format('Flags:', min_width,'<None>')\\n else:\\n print \\\"{:<{}} {}\\\".format('Flags:', min_width,\\n ', '.join(filter(lambda f : f in flags,\\n self.program_flags)))\\n \\n for arg in opts:\\n if arg not in self.program_args:\\n raise InputException(\\\"Invalid arg: \\\" + arg)\\n \\n for arg in self.program_arg_order:\\n arg_def = self.program_args[arg]\\n if arg not in opts:\\n if arg_def.needed:\\n raise InputException(\\\"Error needed arg is missing: \\\" + arg)\\n vars(self)[arg_def.var_name] = arg_def.default_value\\n else:\\n if arg_def.validator == None:\\n vars(self)[arg_def.var_name] = opts[arg]\\n else:\\n vars(self)[arg_def.var_name] = arg_def.validator(opts[arg],\\n arg_def.validator_args)\\n if not self.quiet:\\n print \\\"{:<{}} {}\\\".format(arg_def.description + ':', min_width,\\n vars(self)[arg_def.var_name])\",\n \"def parsare_argumente():\\n for arg in sys.argv:\\n if arg == \\\"-h\\\":\\n display_usage()\\n\\n in_dir=\\\"input\\\"\\n out_dir=\\\"output\\\"\\n n=3\\n timeout=10\\n for arg in sys.argv[1:]:\\n check = arg.split(\\\"=\\\")\\n if len(check) < 2:\\n print(\\\"invalid\\\")\\n exit()\\n if check[0] == \\\"if\\\":\\n in_dir = ''.join(check[1:])\\n elif check[0] == \\\"of\\\":\\n out_dir = ''.join(check[1:])\\n elif check[0] == 'n':\\n try:\\n n = int(''.join(check[1:]))\\n except ValueError:\\n print(\\\"nr invalid\\\")\\n display_usage()\\n elif check[0] == 't':\\n try:\\n timeout = int(''.join(check[1:]))\\n except ValueError:\\n print(\\\"nr invalid\\\")\\n display_usage()\\n\\n return [in_dir, out_dir, n, timeout]\",\n \"def readCommand( argv ):\\n from optparse import OptionParser\\n usageStr = \\\"\\\"\\\"\\n USAGE: python wumpus.py <options>\\n EXAMPLES: (1) python wumpus.py\\n - starts simple manual Hunt The Wumpus game\\n (2) python wumpus.py -k OR python wumpus.py --kb\\n - starts simple manual Hunt The Wumpus game with\\n knowledge base and interactive queries possible\\n \\\"\\\"\\\"\\n parser = OptionParser(usageStr)\\n\\n parser.add_option('-k', '--kb', action='store_true', dest='kb', default=False,\\n help=default(\\\"Instantiate a queriable knowledge base\\\"))\\n parser.add_option('-y', '--hybrid', action='store_true', dest='hybrid', default=False,\\n help=default(\\\"Run hybrid wumpus agent\\\" \\\\\\n + \\\" (takes precedence over -k option)\\\"))\\n parser.add_option('-l', '--layout', dest='layout', default=None,\\n help=default(\\\"Load layout file\\\"))\\n\\n parser.add_option('-t', '--test', action='store_true', dest='test_minisat',\\n default=False,\\n help=default(\\\"Test connection to command-line MiniSat\\\"))\\n\\n options, otherjunk = parser.parse_args(argv)\\n \\n if len(otherjunk) != 0:\\n raise Exception(\\\"Command line input not understood: \\\" + str(otherjunk))\\n\\n return options\",\n \"def parse_args():\\n\\n product_help = ('The type of output products to process. Can be '\\n '\\\"individual\\\", \\\"composite\\\", or \\\"both\\\".')\\n\\n parser = argparse.ArgumentParser()\\n parser.add_argument('product_type', action='store', type=str, help=product_help)\\n args = parser.parse_args()\\n\\n # Make sure the argument is a valid option\\n valid_options = ['individual', 'composite', 'both']\\n explanation = '{} is not a valid option. Please choose \\\"individual\\\", \\\"composite\\\", or \\\"both\\\".'.format(args.product_type)\\n assert args.product_type in valid_options, explanation\\n\\n return args\",\n \"def parseInputLine(self, line):\\r\\n if line is not None and line is not '':\\r\\n func = getattr(self, 'cmd_' + line.split()[0].upper(), None)\\r\\n if func is not None:\\r\\n func(line.split()[1:])\\r\\n else:\\r\\n self.terminal.write('No such command')\\r\\n self.showPrompt()\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.7166374","0.67722404","0.6072575","0.60625833","0.60188425","0.5963004","0.593148","0.5922895","0.59138274","0.5889174","0.5888878","0.58836305","0.5879857","0.58746564","0.5859843","0.5856361","0.5829581","0.58261716","0.58230263","0.5807125","0.5805372","0.5757864","0.5718999","0.5717036","0.569504","0.5692562","0.56755054","0.56663656","0.56654745","0.56611365","0.564919","0.56489664","0.562811","0.56153977","0.5614497","0.5598462","0.55952525","0.5591032","0.5591032","0.5576977","0.55755657","0.5569013","0.55526257","0.5551375","0.5546564","0.5546538","0.5546538","0.55330896","0.5532514","0.5530876","0.5529703","0.5528288","0.5522718","0.5515282","0.5514953","0.55053383","0.55053383","0.5505108","0.55030286","0.5498748","0.54936844","0.5472797","0.5464812","0.5447572","0.5442971","0.5433334","0.54303557","0.54277474","0.5422482","0.5421113","0.54182786","0.54171807","0.54166865","0.54120076","0.54084784","0.54037094","0.54037094","0.54013616","0.5400634","0.5399884","0.53986686","0.5396497","0.5395713","0.53903335","0.53850603","0.538482","0.5380289","0.5379048","0.5378603","0.5376076","0.53661335","0.53645283","0.536348","0.5359537","0.534749","0.5341946","0.533852","0.53220135","0.5314182","0.53109","0.5309988"],"string":"[\n \"0.7166374\",\n \"0.67722404\",\n \"0.6072575\",\n \"0.60625833\",\n \"0.60188425\",\n \"0.5963004\",\n \"0.593148\",\n \"0.5922895\",\n \"0.59138274\",\n \"0.5889174\",\n \"0.5888878\",\n \"0.58836305\",\n \"0.5879857\",\n \"0.58746564\",\n \"0.5859843\",\n \"0.5856361\",\n \"0.5829581\",\n \"0.58261716\",\n \"0.58230263\",\n \"0.5807125\",\n \"0.5805372\",\n \"0.5757864\",\n \"0.5718999\",\n \"0.5717036\",\n \"0.569504\",\n \"0.5692562\",\n \"0.56755054\",\n \"0.56663656\",\n \"0.56654745\",\n \"0.56611365\",\n \"0.564919\",\n \"0.56489664\",\n \"0.562811\",\n \"0.56153977\",\n \"0.5614497\",\n \"0.5598462\",\n \"0.55952525\",\n \"0.5591032\",\n \"0.5591032\",\n \"0.5576977\",\n \"0.55755657\",\n \"0.5569013\",\n \"0.55526257\",\n \"0.5551375\",\n \"0.5546564\",\n \"0.5546538\",\n \"0.5546538\",\n \"0.55330896\",\n \"0.5532514\",\n \"0.5530876\",\n \"0.5529703\",\n \"0.5528288\",\n \"0.5522718\",\n \"0.5515282\",\n \"0.5514953\",\n \"0.55053383\",\n \"0.55053383\",\n \"0.5505108\",\n \"0.55030286\",\n \"0.5498748\",\n \"0.54936844\",\n \"0.5472797\",\n \"0.5464812\",\n \"0.5447572\",\n \"0.5442971\",\n \"0.5433334\",\n \"0.54303557\",\n \"0.54277474\",\n \"0.5422482\",\n \"0.5421113\",\n \"0.54182786\",\n \"0.54171807\",\n \"0.54166865\",\n \"0.54120076\",\n \"0.54084784\",\n \"0.54037094\",\n \"0.54037094\",\n \"0.54013616\",\n \"0.5400634\",\n \"0.5399884\",\n \"0.53986686\",\n \"0.5396497\",\n \"0.5395713\",\n \"0.53903335\",\n \"0.53850603\",\n \"0.538482\",\n \"0.5380289\",\n \"0.5379048\",\n \"0.5378603\",\n \"0.5376076\",\n \"0.53661335\",\n \"0.53645283\",\n \"0.536348\",\n \"0.5359537\",\n \"0.534749\",\n \"0.5341946\",\n \"0.533852\",\n \"0.53220135\",\n \"0.5314182\",\n \"0.53109\",\n \"0.5309988\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.0"},"document_rank":{"kind":"string","value":"-1"}}},{"rowIdx":6093,"cells":{"query":{"kind":"string","value":"Returns the week of the month for the specified date."},"document":{"kind":"string","value":"def week_of_month(dt):\n try:\n first_day = dt.replace(day=1)\n dom = dt.day\n if first_day.weekday() == 6:\n adjusted_dom = dom + day_of_week(dt) - 1\n else:\n adjusted_dom = dom + day_of_week(dt)\n return int(ceil(adjusted_dom/7.0))\n except Exception as e:\n log.exception(\"1;EME;FAILURE;700; FUNCTION ERROR \" + str(e), exc_info=False)\n sys.exit(0)"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["def get_week_from_date(date) -> int:\n month, year = date.month, date.year\n if month < 4:\n year -= 1\n ld = _labor_day(year)\n wk1_wed = ld + timedelta(days=2)\n days_since = (date - wk1_wed).days\n weeks_since = days_since / 7.\n week = math.floor(weeks_since) + 1\n return int(week)","def get_week(date):\n\n # TODO: the API seems broken. It returns week, year not year, week as documentef\n # why not use date.isocalendar() from the stdlib?\n\n date = date_trunc('week', date)\n\n first_monday = date_trunc('week', date_trunc('year', date))\n if first_monday.year < date.year:\n first_monday += datetime.timedelta(weeks=1)\n diff = date_trunc('day', date) - first_monday\n week = 1 + (diff.days / 7)\n return week, first_monday.year","def week_of_month(dt):\n\n first_day = dt.replace(day=1)\n\n dom = dt.day\n adjusted_dom = dom + first_day.weekday()\n\n return int(ceil(adjusted_dom/7.0))","def GetWeekNum(self, date):\n (y, m, d) = date.split('-')\n return (dt.date(int(y), int(m), int(d)) - self.START_DATE).days / 7","def date_to_week(y, m, d):\r\n return datetime.datetime(y, m, d).strftime(r'%YW%W')","def weeks_of_the_month(self) -> Optional[pulumi.Input[Sequence[pulumi.Input[Union[str, 'WeekNumber']]]]]:\n return pulumi.get(self, \"weeks_of_the_month\")","def date_to_day_of_week(date):\n return date.weekday()","def current_week_number(date=datetime.datetime.now()):\n return int(date.strftime(\"%W\"))","def weeks_of_the_month(self) -> Optional[Sequence[str]]:\n return pulumi.get(self, \"weeks_of_the_month\")","def date_day_of_week(date):\n day_of_week = date.strftime('%A')\n return day_of_week","def get_weekday_number(date):\n return date.strftime('%w')","def ISOWEEKNUM(date):\n return _make_datetime(date).isocalendar()[1]","def get_next_monday(date):\n return date + datetime.timedelta(days=-date.weekday(), weeks=1)","def get_weeks_for_month(month=None):\n if not month:\n month = dt.now().month\n return Week.objects.filter(date__month=month).order_by('number')","def WEEKDAY(date, return_type=1):\n if return_type not in _weekday_type_map:\n raise ValueError(\"Invalid return type %s\" % (return_type,))\n (first, index) = _weekday_type_map[return_type]\n return (_make_datetime(date).weekday() - first) % 7 + index","def ISOWEEKNUM(\n date: func_xltypes.XlDateTime\n) -> func_xltypes.XlNumber:\n\n datetime_date = utils.number_to_datetime(int(date))\n isoweeknum = datetime_date.isocalendar()[1]\n return isoweeknum","def day_of_week(date: datetime) -> str:\n weekday = date.weekday()\n return calendar.day_name[weekday]","def get_week_date():\n return timezone.now()+timezone.timedelta(days=6)","def dateweek(line, date):\r\n\tindex = datetime.weekday(date)\r\n\tdateweek = '%s%s%s' % (date.day, cn2en.DATE_WEEK, cn2en.WEEKDAYS[index])\r\n\t\r\n\treturn dateweek == line","def day_of_week(day, month, year):\n bias = (14 - month) // 12\n m_year = year - bias\n mth = month + 12 * bias - 2\n return (day + m_year + m_year // 4 - m_year // 100 + m_year // 400 + (31 * mth) // 12) % 7","def get_week_from_datestr(datestr: str) -> int:\n return date.fromisoformat(datestr).isocalendar()[1]","def current_week() -> int:\n now = datetime.now()\n return get_week_from_date(now)","def WEEKNUM(date, return_type=1):\n if return_type == 21:\n return ISOWEEKNUM(date)\n if return_type not in _weekday_type_map:\n raise ValueError(\"Invalid return type %s\" % (return_type,))\n (first, index) = _weekday_type_map[return_type]\n date = _make_datetime(date)\n jan1 = datetime.datetime(date.year, 1, 1)\n week1_start = jan1 - datetime.timedelta(days=(jan1.weekday() - first) % 7)\n return (date - week1_start).days // 7 + 1","def date_to_dow(y, m, d):\r\n # Python uses Monday week start, so wrap around\r\n w = calendar.weekday(y, m, d) + 1\r\n if w == 7:\r\n w = 0\r\n return w","def find_date(startdate, weekday, weeknumber):\n import datetime\n # The +1 makes this match up with linux times (day 1 = Monday)\n daysahead = weekday - (startdate.weekday() + 1)\n if daysahead < 0:\n # Target day already happened this week\n daysahead += 7\n # Add 7 days for each Week Of Month we want - but 'This' week is week 1\n daysahead += 7 * (weeknumber - 1)\n return startdate + datetime.timedelta(daysahead)","def date_month(date):\n return date.month","def date_week_of_year(date, *, sunday_is_first_day_of_week: bool = False):\n if sunday_is_first_day_of_week:\n return date.strftime(\"%U\")\n else:\n return date.strftime(\"%V\")","def MONTH(date):\n return _make_datetime(date).month","def week_start_on_monday(weekday):\n return (weekday - 1 + 6) % 7 + 1","def day_of_week():\n return calendar.day_name[datetime.date.today().weekday()]","def date_day_of_month(date):\n return date.day","def week(self):\n J = self.JulianDay()\n d4 = (J + 31741 - (J % 7)) % 146097 % 36524 % 1461\n L = d4 // 1460\n d1 = ((d4 - L) % 365) + L\n return d1 // 7 + 1","def date_day(date):\n return date_day_of_month(date)","def wkday_on_first(yr, mon): # returns day of week of first of month of the given year (1/1/2016)\r\n TotalDays = 0\r\n for x in range(1754, yr):\r\n YearNum = yeardays(x)\r\n TotalDays += YearNum\r\n for x in range(1, mon):\r\n MonNum = monthdays(yr, x)\r\n TotalDays += MonNum\r\n WhatDayNum = TotalDays % 7\r\n WhatDay = [\"Tues\", \"Wedn\", \"Thu\", \"Fri\", \"Sat\", \"Mon\"]\r\n return WhatDay[WhatDayNum]","def week_range(date):\n # isocalendar calculates the year, week of the year, and day of the week.\n # dow is Mon = 1, Sat = 6, Sun = 7\n year, week, dow = date.isocalendar()\n\n # Find the first day of the week.\n if dow == 7:\n # Since we want to start with Sunday, let's test for that condition.\n start_date = date\n else:\n # Otherwise, subtract `dow` number days to get the first day\n start_date = date - timedelta(dow)\n\n return start_date, start_date + timedelta(6)","def dayofweek(day, month, year, formatresult=True):\n if formatresult is False:\n return calendar.weekday(year, month, day) + 1\n days = {\n 0: 'Monday',\n 1: \"Tuesday\",\n 2: \"Wednesday\",\n 3: \"Thursday\",\n 4: \"Friday\",\n 5: \"Saturday\",\n 6: \"Sunday\"\n }\n return days[calendar.weekday(year, month, day)]","def DayOfWeek(year, month, day):\n num = year * 365\n num = num + year // 4 + 1\n num = num - (year // 100 + 1)\n num = num + year // 400 + 1\n if month < 3 and LeapYear(year):\n num = num - 1\n return (num + MONTH_OFFSETS[month - 1] + day + 4) % 7 + 1","def Day_of_week(day, month, year):\r\n if year % 4 == 0 and (year % 400 == 0 or year % 100 != 0):\r\n doomsday = [11, 29, 21, 4, 9, 6, 11, 8, 5, 10, 7, 12]\r\n else:\r\n doomsday = [10, 28, 21, 4, 9, 6, 11, 8, 5, 10, 7, 12]\r\n exact_day = ((day - doomsday[month-1]) + Dooms_day(year)) % 7\r\n character_day = [\"Sunday\", \"Monday\", \"Tuesday\", \"Wednesday\", \"Thursday\", \r\n \"Friday\", \"Saturday\"]\r\n return character_day[exact_day]","def get_week_start(x: Optional[Date] = None) -> Date:\n asof = x or get_today()\n return asof - TimeDelta(days=(asof.isoweekday() - 1) % 7)","def the_week_url():\n return '/timeline/%d/%02d/%d/' % \\\n (datetime.now().year, datetime.now().month, timekit.monthweek(datetime.now()))","def get_week():\n now = dt.now().date()\n return Week.objects.filter(date__lte=now).order_by('-date').first()","def day_of_the_week(arg):","def date_with_day_of_week_appended(mydate): \n import datetime\n month, day, year = (int(x) for x in mydate.split('/')) \n shortened_year = abs(year) % 100 \n day_of_week = datetime.date(year, month, day).strftime(\"%A\")\n return \"%s/%s/%s %s\" % (month,day,shortened_year, day_of_week)","def weekly():","def week(start_day=\"monday\"):\r\n today = datetime.datetime.combine(datetime.date.today(), datetime.datetime.min.time())\r\n weekday = today.weekday()\r\n week = list(calendar.Calendar(getattr(calendar, start_day.upper())).iterweekdays())\r\n pos = week.index(weekday)\r\n week_stamp = (to_stamp(today - datetime.timedelta(days=pos - i)) for i, d in enumerate(week))\r\n return collections.OrderedDict(((calendar.day_name[a], (b, b + DAY)) for a, b in zip(week, week_stamp)))","def week(self):\n if self._week.lower() == 'wild card':\n return WILD_CARD\n if self._week.lower() == 'division':\n return DIVISION\n if self._week.lower() == 'conf. champ.':\n return CONF_CHAMPIONSHIP\n if self._week.lower() == 'superbowl':\n return SUPER_BOWL\n return self._week","def weekday(self):\n\n return func.extract('dow', self.start_date) + 1","def monday_last_week():\n today = datetime.date.today()\n last_week = today - datetime.timedelta(days=7)\n return last_week - datetime.timedelta(days=(last_week.isoweekday() - 1))","def day_of_week(self):\n # 1 Jan 0001 was Monday according to the proleptic Gregorian calendar.\n # So, 1 Jan 0001 has ordinal 1, and the weekday is 0.\n return (self._ordinals - 1) % 7","def weekday(self):\n if self.month is not None and self.day is not None:\n return self.todate().weekday()\n else:\n return None","def _get_date_in_words(number_date):\n month_list = ['Jan ', 'Feb ', 'Mar ', 'Apr ', 'May ', 'Jun ', 'Jul ', 'Aug ', 'Sep ', 'Oct ', 'Nov ', 'Dec ']\n month = int(number_date[5:7]) - 1\n day = str(int(number_date[-2:]))\n return month_list[month] + day","def get_today_week_number(self):\n\n today = date.today()\n iso_result = today.isocalendar()\n return iso_result[1]","def weekdayname(self, date):\n weekday = weekdayname_msgid(date.dow())\n return translate(weekday, domain='plonelocales',\n context=self.request, default=weekday)","def first_monday_of_week(year, week):\n weekyear = \"{} {} 1\".format(year, week)\n return time.asctime(time.strptime(weekyear, \"%Y %U %w\"))","def _set_date_weekly(self):\n dt_weekday = dt.now()\n try:\n dt_weekday = self._get_datetime_or_error()\n except ValueError:\n self._dt_string = \"\"\n raise InvalidDateError(detail={\n \"message\": \"Invalid Date Provided\",\n \"period\": self.period.value,\n \"date\": self._given_date\n })\n week_start = dt_weekday - timedelta(days=dt_weekday.weekday())\n self.date['year'] = week_start.year\n self.date['month'] = week_start.month\n self.date['day'] = week_start.day","def get_current_week(self):\n result = self._method_call(\"CurrentWeek\")\n return int(result)","def day_of_week(self) -> pulumi.Input[Union[str, 'WeekDay']]:\n return pulumi.get(self, \"day_of_week\")","def day_of_week(self) -> pulumi.Input[Union[str, 'WeekDay']]:\n return pulumi.get(self, \"day_of_week\")","def day_of_week(self) -> str:\n return pulumi.get(self, \"day_of_week\")","def day_of_week(self) -> str:\n return pulumi.get(self, \"day_of_week\")","def week_of_month(self, week_of_month):\n allowed_values = [\"first\", \"second\", \"third\", \"fourth\", \"last\"] # noqa: E501\n if week_of_month not in allowed_values:\n raise ValueError(\n \"Invalid value for `week_of_month` ({0}), must be one of {1}\" # noqa: E501\n .format(week_of_month, allowed_values)\n )\n\n self._week_of_month = week_of_month","def day_of_week(self):\n day_of_week_names = ['Monday', 'Tuesday', 'Wednesday', 'Thursday',\n 'Friday', 'Saturday', 'Sunday']\n diff = self.diff(Date(1, 1, 1970)) + 3\n while diff < 0:\n diff += 7\n print(day_of_week_names[diff % 7])","def get_week(time_index):\n return np.array(time_index.week).reshape(-1,1)","def forecast_weekly():\n forecast = get_forecast()\n daily = forecast.daily()\n return daily.summary","def get_current_week_range(self, currdate):\n dow_start = datetime.datetime.strftime(currdate, '%w')\n if dow_start == '0':\n week_start = currdate\n else:\n week_start = self.get_previous_byday('Sunday', currdate)\n\n week_end = week_start + datetime.timedelta(days=6)\n return (week_start, week_end)","def getCurrentWeek(self):\n return self.wcount % 48","def main():\n print(day_of_week(datetime.now()))\n print(day_of_week(datetime(2019, 7, 4)))\n print(day_of_week(datetime(2013, 12, 25)))\n print(day_of_week(datetime(2000, 1, 1)))","def day_of_month():\n return datetime.date.today().day","def dow(self):\n comparator = Date(11, 12, 2014) # known to be a 'Wednesday'\n DOW = ['Wednesday', 'Thursday', 'Friday', 'Saturday', 'Sunday', 'Monday', 'Tuesday']\n diff = self.diff(comparator)\n return DOW[diff % 7]","def set_week_day(self, wday):\r\n\t\twdays = ['Domingo', 'Lunes', 'Martes', 'Miercoles',\r\n\t\t\t\t 'Jueves', 'Viernes', 'Sabado']\r\n\t\tfor i in range(7):\r\n\t\t\tif wday == i: \r\n\t\t\t\treturn wdays[i]","def meetup_day(year, month, day_of_week, day_occurrence):\n \n cal = calendar.monthcalendar(year, month)\n day_of_week_index = days_of_week[day_of_week]\n \n not_teenth = day_occurrence != 'teenth'\n day_is_in_first_week = cal[0][day_of_week_index] != 0\n \n if not_teenth and day_is_in_first_week:\n week_index = week_indices[day_occurrence]\n \n elif not_teenth and not day_is_in_first_week:\n week_index = week_indices[day_occurrence] + 1\n \n else:\n for i in range(len(cal)):\n if cal[i][day_of_week_index] >= 10:\n week_index = i\n break\n\n date = cal[week_index][day_of_week_index]\n return datetime.date(year, month, date)","def meetup_day(year, month, dow, wom):\n first_dow = monthrange(year, month)[0]\n days_in_month = monthrange(year, month)[1]\n possible_dates = []\n print str(year) + str(month) + dow + wom\n\n \"\"\"Build dictionary of possible dates based on dow\"\"\"\n for day in range(1, days_in_month+1):\n if datetime.date(year, month, day).strftime(\"%A\") == dow:\n print day\n possible_dates.extend([day])\n\n \"\"\"Perform logic on wom constraint\"\"\"\n if wom == \"teenth\":\n for day in possible_dates:\n if day > 12 and day < 20:\n return datetime.date(year, month, day)\n elif wom == \"last\":\n return datetime.date(year, month, possible_dates[-1])\n else:\n return datetime.date(year, month, possible_dates[ int(wom[:1]) - 1 ])","def dates_of_the_week():\n date_list = list()\n now = datetime.datetime.now()\n monday = now - datetime.timedelta(days=now.weekday(), hours=now.hour, minutes=now.minute, seconds=now.second,\n microseconds=now.microsecond)\n date_list.append(monday)\n for each in range(1, 6):\n monday = monday + datetime.timedelta(days=1)\n date_list.append(monday)\n date_list.append((monday + datetime.timedelta(days=1, hours=23, minutes=59, seconds=59)))\n return date_list","def week(self) -> Index:\n warnings.warn(\n \"`week` is deprecated in 3.5.0 and will be removed in 4.0.0.\",\n FutureWarning,\n )\n return Index(self.to_series().dt.week)","def weekNumber(self): # real signature unknown; restored from __doc__\r\n pass","def _compute_week_index(self, column_index):\n latest_week = self.end_date.isocalendar()[1]\n column_date = self.start_date + timedelta(column_index)\n week = column_date.isocalendar()[1]\n week_index = latest_week - week\n return week_index","def GetWeekDay(self):\n if self.day is None:\n if self.week:\n return (\n self.century,\n self.year //\n 10,\n self.year %\n 10,\n self.week,\n None)\n elif self.month is None:\n if self.year is None:\n return (self.century, None, None, None, None)\n else:\n return (\n self.century,\n self.year //\n 10,\n self.year %\n 10,\n None,\n None)\n else:\n raise DateTimeError(\"can't get week day with month precision\")\n else:\n century, year, ordinalDay = self.GetOrdinalDay()\n year += century * 100\n if LeapYear(year):\n yearLength = 366\n else:\n yearLength = 365\n weekday = DayOfWeek(year, self.month, self.day)\n thursday = ordinalDay + 4 - weekday\n if thursday < 1:\n # Thursday this week was actually last year, and so we are\n # part of the last calendar week of last year too.\n # may return year==0\n year -= 1\n week = WeekCount(year)\n elif thursday > yearLength:\n # Thursday this week is actually next year, and so we are\n # part of the first calendar week of next year too.\n # may return century=100\n year += 1\n week = 1\n else:\n # We are part of this year, but which week?\t Jan 4th is always\n # part of the first week of the year, so we calculate the ordinal\n # value of the Monay that began that week\n yearBase = 5 - DayOfWeek(year, 1, 4)\n week = (ordinalDay - yearBase) // 7 + 1\n return year // 100, (year % 100) // 10, (year % 10), week, weekday","def find_day_of_week(year, month, day_of_week, offset=0, use_datetime=False):\n iter = Calendar().itermonthdates(year, month)\n n = 0\n\n for value in iter:\n if month != value.month:\n continue\n\n if day_of_week == weekday(value.year, value.month, value.day):\n if n == offset:\n return convert_date_to_datetime(value) if use_datetime else value\n else:\n n += 1\n\n return None","def day_of_week(self) -> str:\n return self.elements[4]","def get_next_week(self, startdate):\n dow_today = int(datetime.datetime.strftime(startdate, '%w'))\n days_until_sunday = 7 - ((dow_today + 7) % 7)\n #days_until_sunday = 7 - (dow_today + 1)\n sunday = startdate + datetime.timedelta(days=days_until_sunday)\n following_saturday = sunday + datetime.timedelta(days=6)\n next_week = (sunday, following_saturday)\n return next_week","def workweeks(yr):\n\n # TODO: MOVE all of this crap into a intelDateTime.py module. Does not belong here. JSS\n\n nyd = datetime.date(yr, 1, 1).weekday() # Determine the day of the week on which the 1st of January fell this year.\n if nyd == 5: return 53 # If the 1st of January fell on a Saturday, the year has 53 weeks.\n if nyd == 4 and isleapyear(yr): return 53 # Same deal if the 1st of January fell on a Friday in a leap year.\n return 52 # All other years have 52 work weeks.","def WEEKDAY(\n serial_number: func_xltypes.XlNumber,\n return_type: func_xltypes.XlNumber = None\n) -> func_xltypes.XlNumber:\n\n date = utils.number_to_datetime(int(serial_number))\n\n if return_type is None:\n # Numbers 1 (Sunday) through 7 (Saturday)\n weekDays = (2, 3, 4, 5, 6, 7, 1)\n return weekDays[date.weekday()]\n\n elif int(return_type) == 1:\n # Numbers 1 (Sunday) through 7 (Saturday)\n weekDays = (2, 3, 4, 5, 6, 7, 1)\n return weekDays[date.weekday()]\n\n # weekday() is 0 based, starting on a Monday\n elif int(return_type) == 2:\n # Numbers 1 (Monday) through 7 (Sunday)\n weekDays = (1, 2, 3, 4, 5, 6, 7)\n return weekDays[date.weekday()]\n\n elif int(return_type) == 3:\n # Numbers 0 (Monday) through 6 (Sunday)\n weekDays = (0, 1, 2, 3, 4, 5, 6)\n return weekDays[date.weekday()]\n\n elif int(return_type) == 11:\n # Numbers 1 (Monday) through 7 (Sunday)\n weekDays = (1, 2, 3, 4, 5, 6, 7)\n return weekDays[date.weekday()]\n\n elif int(return_type) == 12:\n # Numbers 1 (Tuesday) through 7 (Monday)\n weekDays = (7, 1, 2, 3, 4, 5, 6)\n return weekDays[date.weekday()]\n\n elif int(return_type) == 13:\n # Numbers 1 (Wednesday) through 7 (Tuesday)\n weekDays = (6, 7, 1, 2, 3, 4, 5)\n return weekDays[date.weekday()]\n\n elif int(return_type) == 14:\n # Numbers 1 (Thursday) through 7 (Wednesday)\n weekDays = (5, 6, 7, 1, 2, 3, 4)\n return weekDays[date.weekday()]\n\n elif int(return_type) == 15:\n # Numbers 1 (Friday) through 7 (Thursday)\n weekDays = (4, 5, 6, 7, 1, 2, 3)\n return weekDays[date.weekday()]\n\n elif int(return_type) == 16:\n # Numbers 1 (Saturday) through 7 (Friday)\n weekDays = (3, 4, 5, 6, 7, 1, 2)\n return weekDays[date.weekday()]\n\n elif int(return_type) == 17:\n # Numbers 1 (Sunday) through 7 (Saturday)\n weekDays = (2, 3, 4, 5, 6, 7, 1)\n return weekDays[date.weekday()]\n\n else:\n raise xlerrors.NumExcelError(\n f\"return_type needs to be omitted or one of 1, 2, 3, 11, 12, 13,\\\n 14, 15, 16 or 17. You supplied {return_type}\")","def _get_next_monday(self):\n today = datetime.date.today()\n weekday_int = today.weekday()\n if weekday_int == 0:\n return today\n next_mon = today + timedelta(7 - weekday_int)\n return next_mon","def GetFirstSundayOfMonth(year, month):\n weeks = calendar.Calendar().monthdays2calendar(year, month)\n # Return the first day in the first week that is a Sunday.\n return [date_day[0] for date_day in weeks[0] if date_day[1] == 6][0]","def get_weekday():\n result = datetime.today().weekday() + 1\n return result","def _DayNumToWeekdayNum(daynum):\n return (daynum + _WEEKDAY_BASE) % NUM_WEEKDAYS","def get_weekday(self):\n originDate = Date(1900, 1, 1)\n return WEEKDAYS[originDate.days_since(self) % 7]","def get_week_of_year(date, padded_or_unpadded, start_Sunday_or_Monday):\n if start_Sunday_or_Monday == constants.str_Sunday:\n week_of_year = date.strftime('%U')\n elif start_Sunday_or_Monday == constants.str_Monday:\n week_of_year = date.strftime('%W')\n else:\n err_msg = str_possible_values('start_Sunday_or_Monday', [\n constants.str_Sunday, constants.str_Monday])\n raise ValueError(err_msg)\n\n if padded_or_unpadded == constants.str_padded:\n return week_of_year\n elif padded_or_unpadded == constants.str_unpadded:\n return str(int(week_of_year))\n else:\n err_msg = str_possible_values('padded_or_unpadded', [\n constants.str_padded, constants.str_unpadded])\n raise ValueError(err_msg)","def get_the_weekday(self,date):\n date_convert = date.split('-')\n week_days = (\"Monday\", \"Tuesday\", \"Wednesday\", \"Thursday\", \"Friday\", \"Saturday\", \"Sunday\")\n date_list = [int(i) for i in date_convert]\n day = datetime.date(date_list[0], date_list[1], date_list[2])\n # convert weekday into digit (eg Mon -> 0,)\n num_day = day.weekday()\n day_as_string = week_days[num_day]\n return day_as_string","def get_weekdays(date: str) -> list:\n parsed_date = parser.parse(date)\n day_of_week = parsed_date.weekday()\n first_day_of_week = parsed_date - datetime.timedelta(days=day_of_week)\n\n return holiday.create_date_range(first_day_of_week, 7)","def test_monday(self):\n date = datetime.date(1981, 5, 4)\n self.assertEqual(date.isoweekday(), 1)\n start_date, end_date = get_weekspan(date)\n self.assertEqual(start_date.isoweekday(), 1)\n self.assertEqual(end_date.isoweekday(), 7)\n self.assertTrue(start_date.toordinal() <= date.toordinal() <= end_date.toordinal())","def formatWeek(self, themonth, theweek, num_weeks):\n s = ''.join(self.formatDay(themonth, d, num_weeks) for d in theweek)\n return '<tr>%s</tr>' % s","def get_date_in_two_weeks():\n today = datetime.datetime.today()\n date_in_two_weeks = today + datetime.timedelta(days=14)\n return date_in_two_weeks.date()","def current_week(self):\n\n if not self.iso_equal() and self.time_stamp.weekday() == 6:\n return self.time_stamp_iso[1] + 2\n if not self.iso_equal() or self.time_stamp.weekday() == 6:\n return self.time_stamp_iso[1] + 1 \n return self.time_stamp_iso[1]","def check_weekday_of_date(self, date):\n return date.isoweekday() % 7","def get_day_of_week_string(date_string):\n\n # Split on / string, and feed to a datetime object, to use weekday function\n date_strings = date_string.split(\"/\")\n update_date = datetime.datetime(int(date_strings[2]), int(date_strings[1]), int(date_strings[0]))\n weekDays = (\"Mon\", \"Tue\", \"Wed\", \"Thur\", \"Fri\", \"Sat\", \"Sun\")\n day_of_week = str(weekDays[update_date.weekday()])\n return day_of_week","def test_weeks(self):\n d = datetime(2014, 1, 29)\n eq_(week_start(d), datetime(2014, 1, 27, 0, 0, 0))\n eq_(week_end(d), datetime(2014, 2, 2, 23, 59, 59))","def get_current_day_week_number(week_delta=0):\n return (datetime.today() + timedelta(weeks=week_delta)).isocalendar()[1]","def dow(values, feature, parent): \r\n input_date = values[0]\r\n \r\n # Return dayOfWeek() % 7 so that values range from 0 (sun) to 6 (sat)\r\n # to match Postgresql behaviour\r\n if type(input_date) == QDateTime:\r\n return input_date.date().dayOfWeek() % 7\r\n elif type(input_date) == QDate:\r\n return input_date.dayOfWeek() % 7\r\n elif type(input_date) in (str, unicode): \r\n # Convert string to qdate\r\n input_qdate = QDate.fromString(input_date, 'yyyy-MM-dd')\r\n if input_qdate.isValid():\r\n return input_qdate.dayOfWeek() % 7 \r\n else:\r\n return None","def dow(values, feature, parent): \r\n input_date = values[0]\r\n \r\n # Return dayOfWeek() % 7 so that values range from 0 (sun) to 6 (sat)\r\n # to match Postgresql behaviour\r\n if type(input_date) == QDateTime:\r\n return input_date.date().dayOfWeek() % 7\r\n elif type(input_date) == QDate:\r\n return input_date.dayOfWeek() % 7\r\n elif type(input_date) in (str, unicode): \r\n # Convert string to qdate\r\n input_qdate = QDate.fromString(input_date, 'yyyy-MM-dd')\r\n if input_qdate.isValid():\r\n return input_qdate.dayOfWeek() % 7 \r\n else:\r\n return None"],"string":"[\n \"def get_week_from_date(date) -> int:\\n month, year = date.month, date.year\\n if month < 4:\\n year -= 1\\n ld = _labor_day(year)\\n wk1_wed = ld + timedelta(days=2)\\n days_since = (date - wk1_wed).days\\n weeks_since = days_since / 7.\\n week = math.floor(weeks_since) + 1\\n return int(week)\",\n \"def get_week(date):\\n\\n # TODO: the API seems broken. It returns week, year not year, week as documentef\\n # why not use date.isocalendar() from the stdlib?\\n\\n date = date_trunc('week', date)\\n\\n first_monday = date_trunc('week', date_trunc('year', date))\\n if first_monday.year < date.year:\\n first_monday += datetime.timedelta(weeks=1)\\n diff = date_trunc('day', date) - first_monday\\n week = 1 + (diff.days / 7)\\n return week, first_monday.year\",\n \"def week_of_month(dt):\\n\\n first_day = dt.replace(day=1)\\n\\n dom = dt.day\\n adjusted_dom = dom + first_day.weekday()\\n\\n return int(ceil(adjusted_dom/7.0))\",\n \"def GetWeekNum(self, date):\\n (y, m, d) = date.split('-')\\n return (dt.date(int(y), int(m), int(d)) - self.START_DATE).days / 7\",\n \"def date_to_week(y, m, d):\\r\\n return datetime.datetime(y, m, d).strftime(r'%YW%W')\",\n \"def weeks_of_the_month(self) -> Optional[pulumi.Input[Sequence[pulumi.Input[Union[str, 'WeekNumber']]]]]:\\n return pulumi.get(self, \\\"weeks_of_the_month\\\")\",\n \"def date_to_day_of_week(date):\\n return date.weekday()\",\n \"def current_week_number(date=datetime.datetime.now()):\\n return int(date.strftime(\\\"%W\\\"))\",\n \"def weeks_of_the_month(self) -> Optional[Sequence[str]]:\\n return pulumi.get(self, \\\"weeks_of_the_month\\\")\",\n \"def date_day_of_week(date):\\n day_of_week = date.strftime('%A')\\n return day_of_week\",\n \"def get_weekday_number(date):\\n return date.strftime('%w')\",\n \"def ISOWEEKNUM(date):\\n return _make_datetime(date).isocalendar()[1]\",\n \"def get_next_monday(date):\\n return date + datetime.timedelta(days=-date.weekday(), weeks=1)\",\n \"def get_weeks_for_month(month=None):\\n if not month:\\n month = dt.now().month\\n return Week.objects.filter(date__month=month).order_by('number')\",\n \"def WEEKDAY(date, return_type=1):\\n if return_type not in _weekday_type_map:\\n raise ValueError(\\\"Invalid return type %s\\\" % (return_type,))\\n (first, index) = _weekday_type_map[return_type]\\n return (_make_datetime(date).weekday() - first) % 7 + index\",\n \"def ISOWEEKNUM(\\n date: func_xltypes.XlDateTime\\n) -> func_xltypes.XlNumber:\\n\\n datetime_date = utils.number_to_datetime(int(date))\\n isoweeknum = datetime_date.isocalendar()[1]\\n return isoweeknum\",\n \"def day_of_week(date: datetime) -> str:\\n weekday = date.weekday()\\n return calendar.day_name[weekday]\",\n \"def get_week_date():\\n return timezone.now()+timezone.timedelta(days=6)\",\n \"def dateweek(line, date):\\r\\n\\tindex = datetime.weekday(date)\\r\\n\\tdateweek = '%s%s%s' % (date.day, cn2en.DATE_WEEK, cn2en.WEEKDAYS[index])\\r\\n\\t\\r\\n\\treturn dateweek == line\",\n \"def day_of_week(day, month, year):\\n bias = (14 - month) // 12\\n m_year = year - bias\\n mth = month + 12 * bias - 2\\n return (day + m_year + m_year // 4 - m_year // 100 + m_year // 400 + (31 * mth) // 12) % 7\",\n \"def get_week_from_datestr(datestr: str) -> int:\\n return date.fromisoformat(datestr).isocalendar()[1]\",\n \"def current_week() -> int:\\n now = datetime.now()\\n return get_week_from_date(now)\",\n \"def WEEKNUM(date, return_type=1):\\n if return_type == 21:\\n return ISOWEEKNUM(date)\\n if return_type not in _weekday_type_map:\\n raise ValueError(\\\"Invalid return type %s\\\" % (return_type,))\\n (first, index) = _weekday_type_map[return_type]\\n date = _make_datetime(date)\\n jan1 = datetime.datetime(date.year, 1, 1)\\n week1_start = jan1 - datetime.timedelta(days=(jan1.weekday() - first) % 7)\\n return (date - week1_start).days // 7 + 1\",\n \"def date_to_dow(y, m, d):\\r\\n # Python uses Monday week start, so wrap around\\r\\n w = calendar.weekday(y, m, d) + 1\\r\\n if w == 7:\\r\\n w = 0\\r\\n return w\",\n \"def find_date(startdate, weekday, weeknumber):\\n import datetime\\n # The +1 makes this match up with linux times (day 1 = Monday)\\n daysahead = weekday - (startdate.weekday() + 1)\\n if daysahead < 0:\\n # Target day already happened this week\\n daysahead += 7\\n # Add 7 days for each Week Of Month we want - but 'This' week is week 1\\n daysahead += 7 * (weeknumber - 1)\\n return startdate + datetime.timedelta(daysahead)\",\n \"def date_month(date):\\n return date.month\",\n \"def date_week_of_year(date, *, sunday_is_first_day_of_week: bool = False):\\n if sunday_is_first_day_of_week:\\n return date.strftime(\\\"%U\\\")\\n else:\\n return date.strftime(\\\"%V\\\")\",\n \"def MONTH(date):\\n return _make_datetime(date).month\",\n \"def week_start_on_monday(weekday):\\n return (weekday - 1 + 6) % 7 + 1\",\n \"def day_of_week():\\n return calendar.day_name[datetime.date.today().weekday()]\",\n \"def date_day_of_month(date):\\n return date.day\",\n \"def week(self):\\n J = self.JulianDay()\\n d4 = (J + 31741 - (J % 7)) % 146097 % 36524 % 1461\\n L = d4 // 1460\\n d1 = ((d4 - L) % 365) + L\\n return d1 // 7 + 1\",\n \"def date_day(date):\\n return date_day_of_month(date)\",\n \"def wkday_on_first(yr, mon): # returns day of week of first of month of the given year (1/1/2016)\\r\\n TotalDays = 0\\r\\n for x in range(1754, yr):\\r\\n YearNum = yeardays(x)\\r\\n TotalDays += YearNum\\r\\n for x in range(1, mon):\\r\\n MonNum = monthdays(yr, x)\\r\\n TotalDays += MonNum\\r\\n WhatDayNum = TotalDays % 7\\r\\n WhatDay = [\\\"Tues\\\", \\\"Wedn\\\", \\\"Thu\\\", \\\"Fri\\\", \\\"Sat\\\", \\\"Mon\\\"]\\r\\n return WhatDay[WhatDayNum]\",\n \"def week_range(date):\\n # isocalendar calculates the year, week of the year, and day of the week.\\n # dow is Mon = 1, Sat = 6, Sun = 7\\n year, week, dow = date.isocalendar()\\n\\n # Find the first day of the week.\\n if dow == 7:\\n # Since we want to start with Sunday, let's test for that condition.\\n start_date = date\\n else:\\n # Otherwise, subtract `dow` number days to get the first day\\n start_date = date - timedelta(dow)\\n\\n return start_date, start_date + timedelta(6)\",\n \"def dayofweek(day, month, year, formatresult=True):\\n if formatresult is False:\\n return calendar.weekday(year, month, day) + 1\\n days = {\\n 0: 'Monday',\\n 1: \\\"Tuesday\\\",\\n 2: \\\"Wednesday\\\",\\n 3: \\\"Thursday\\\",\\n 4: \\\"Friday\\\",\\n 5: \\\"Saturday\\\",\\n 6: \\\"Sunday\\\"\\n }\\n return days[calendar.weekday(year, month, day)]\",\n \"def DayOfWeek(year, month, day):\\n num = year * 365\\n num = num + year // 4 + 1\\n num = num - (year // 100 + 1)\\n num = num + year // 400 + 1\\n if month < 3 and LeapYear(year):\\n num = num - 1\\n return (num + MONTH_OFFSETS[month - 1] + day + 4) % 7 + 1\",\n \"def Day_of_week(day, month, year):\\r\\n if year % 4 == 0 and (year % 400 == 0 or year % 100 != 0):\\r\\n doomsday = [11, 29, 21, 4, 9, 6, 11, 8, 5, 10, 7, 12]\\r\\n else:\\r\\n doomsday = [10, 28, 21, 4, 9, 6, 11, 8, 5, 10, 7, 12]\\r\\n exact_day = ((day - doomsday[month-1]) + Dooms_day(year)) % 7\\r\\n character_day = [\\\"Sunday\\\", \\\"Monday\\\", \\\"Tuesday\\\", \\\"Wednesday\\\", \\\"Thursday\\\", \\r\\n \\\"Friday\\\", \\\"Saturday\\\"]\\r\\n return character_day[exact_day]\",\n \"def get_week_start(x: Optional[Date] = None) -> Date:\\n asof = x or get_today()\\n return asof - TimeDelta(days=(asof.isoweekday() - 1) % 7)\",\n \"def the_week_url():\\n return '/timeline/%d/%02d/%d/' % \\\\\\n (datetime.now().year, datetime.now().month, timekit.monthweek(datetime.now()))\",\n \"def get_week():\\n now = dt.now().date()\\n return Week.objects.filter(date__lte=now).order_by('-date').first()\",\n \"def day_of_the_week(arg):\",\n \"def date_with_day_of_week_appended(mydate): \\n import datetime\\n month, day, year = (int(x) for x in mydate.split('/')) \\n shortened_year = abs(year) % 100 \\n day_of_week = datetime.date(year, month, day).strftime(\\\"%A\\\")\\n return \\\"%s/%s/%s %s\\\" % (month,day,shortened_year, day_of_week)\",\n \"def weekly():\",\n \"def week(start_day=\\\"monday\\\"):\\r\\n today = datetime.datetime.combine(datetime.date.today(), datetime.datetime.min.time())\\r\\n weekday = today.weekday()\\r\\n week = list(calendar.Calendar(getattr(calendar, start_day.upper())).iterweekdays())\\r\\n pos = week.index(weekday)\\r\\n week_stamp = (to_stamp(today - datetime.timedelta(days=pos - i)) for i, d in enumerate(week))\\r\\n return collections.OrderedDict(((calendar.day_name[a], (b, b + DAY)) for a, b in zip(week, week_stamp)))\",\n \"def week(self):\\n if self._week.lower() == 'wild card':\\n return WILD_CARD\\n if self._week.lower() == 'division':\\n return DIVISION\\n if self._week.lower() == 'conf. champ.':\\n return CONF_CHAMPIONSHIP\\n if self._week.lower() == 'superbowl':\\n return SUPER_BOWL\\n return self._week\",\n \"def weekday(self):\\n\\n return func.extract('dow', self.start_date) + 1\",\n \"def monday_last_week():\\n today = datetime.date.today()\\n last_week = today - datetime.timedelta(days=7)\\n return last_week - datetime.timedelta(days=(last_week.isoweekday() - 1))\",\n \"def day_of_week(self):\\n # 1 Jan 0001 was Monday according to the proleptic Gregorian calendar.\\n # So, 1 Jan 0001 has ordinal 1, and the weekday is 0.\\n return (self._ordinals - 1) % 7\",\n \"def weekday(self):\\n if self.month is not None and self.day is not None:\\n return self.todate().weekday()\\n else:\\n return None\",\n \"def _get_date_in_words(number_date):\\n month_list = ['Jan ', 'Feb ', 'Mar ', 'Apr ', 'May ', 'Jun ', 'Jul ', 'Aug ', 'Sep ', 'Oct ', 'Nov ', 'Dec ']\\n month = int(number_date[5:7]) - 1\\n day = str(int(number_date[-2:]))\\n return month_list[month] + day\",\n \"def get_today_week_number(self):\\n\\n today = date.today()\\n iso_result = today.isocalendar()\\n return iso_result[1]\",\n \"def weekdayname(self, date):\\n weekday = weekdayname_msgid(date.dow())\\n return translate(weekday, domain='plonelocales',\\n context=self.request, default=weekday)\",\n \"def first_monday_of_week(year, week):\\n weekyear = \\\"{} {} 1\\\".format(year, week)\\n return time.asctime(time.strptime(weekyear, \\\"%Y %U %w\\\"))\",\n \"def _set_date_weekly(self):\\n dt_weekday = dt.now()\\n try:\\n dt_weekday = self._get_datetime_or_error()\\n except ValueError:\\n self._dt_string = \\\"\\\"\\n raise InvalidDateError(detail={\\n \\\"message\\\": \\\"Invalid Date Provided\\\",\\n \\\"period\\\": self.period.value,\\n \\\"date\\\": self._given_date\\n })\\n week_start = dt_weekday - timedelta(days=dt_weekday.weekday())\\n self.date['year'] = week_start.year\\n self.date['month'] = week_start.month\\n self.date['day'] = week_start.day\",\n \"def get_current_week(self):\\n result = self._method_call(\\\"CurrentWeek\\\")\\n return int(result)\",\n \"def day_of_week(self) -> pulumi.Input[Union[str, 'WeekDay']]:\\n return pulumi.get(self, \\\"day_of_week\\\")\",\n \"def day_of_week(self) -> pulumi.Input[Union[str, 'WeekDay']]:\\n return pulumi.get(self, \\\"day_of_week\\\")\",\n \"def day_of_week(self) -> str:\\n return pulumi.get(self, \\\"day_of_week\\\")\",\n \"def day_of_week(self) -> str:\\n return pulumi.get(self, \\\"day_of_week\\\")\",\n \"def week_of_month(self, week_of_month):\\n allowed_values = [\\\"first\\\", \\\"second\\\", \\\"third\\\", \\\"fourth\\\", \\\"last\\\"] # noqa: E501\\n if week_of_month not in allowed_values:\\n raise ValueError(\\n \\\"Invalid value for `week_of_month` ({0}), must be one of {1}\\\" # noqa: E501\\n .format(week_of_month, allowed_values)\\n )\\n\\n self._week_of_month = week_of_month\",\n \"def day_of_week(self):\\n day_of_week_names = ['Monday', 'Tuesday', 'Wednesday', 'Thursday',\\n 'Friday', 'Saturday', 'Sunday']\\n diff = self.diff(Date(1, 1, 1970)) + 3\\n while diff < 0:\\n diff += 7\\n print(day_of_week_names[diff % 7])\",\n \"def get_week(time_index):\\n return np.array(time_index.week).reshape(-1,1)\",\n \"def forecast_weekly():\\n forecast = get_forecast()\\n daily = forecast.daily()\\n return daily.summary\",\n \"def get_current_week_range(self, currdate):\\n dow_start = datetime.datetime.strftime(currdate, '%w')\\n if dow_start == '0':\\n week_start = currdate\\n else:\\n week_start = self.get_previous_byday('Sunday', currdate)\\n\\n week_end = week_start + datetime.timedelta(days=6)\\n return (week_start, week_end)\",\n \"def getCurrentWeek(self):\\n return self.wcount % 48\",\n \"def main():\\n print(day_of_week(datetime.now()))\\n print(day_of_week(datetime(2019, 7, 4)))\\n print(day_of_week(datetime(2013, 12, 25)))\\n print(day_of_week(datetime(2000, 1, 1)))\",\n \"def day_of_month():\\n return datetime.date.today().day\",\n \"def dow(self):\\n comparator = Date(11, 12, 2014) # known to be a 'Wednesday'\\n DOW = ['Wednesday', 'Thursday', 'Friday', 'Saturday', 'Sunday', 'Monday', 'Tuesday']\\n diff = self.diff(comparator)\\n return DOW[diff % 7]\",\n \"def set_week_day(self, wday):\\r\\n\\t\\twdays = ['Domingo', 'Lunes', 'Martes', 'Miercoles',\\r\\n\\t\\t\\t\\t 'Jueves', 'Viernes', 'Sabado']\\r\\n\\t\\tfor i in range(7):\\r\\n\\t\\t\\tif wday == i: \\r\\n\\t\\t\\t\\treturn wdays[i]\",\n \"def meetup_day(year, month, day_of_week, day_occurrence):\\n \\n cal = calendar.monthcalendar(year, month)\\n day_of_week_index = days_of_week[day_of_week]\\n \\n not_teenth = day_occurrence != 'teenth'\\n day_is_in_first_week = cal[0][day_of_week_index] != 0\\n \\n if not_teenth and day_is_in_first_week:\\n week_index = week_indices[day_occurrence]\\n \\n elif not_teenth and not day_is_in_first_week:\\n week_index = week_indices[day_occurrence] + 1\\n \\n else:\\n for i in range(len(cal)):\\n if cal[i][day_of_week_index] >= 10:\\n week_index = i\\n break\\n\\n date = cal[week_index][day_of_week_index]\\n return datetime.date(year, month, date)\",\n \"def meetup_day(year, month, dow, wom):\\n first_dow = monthrange(year, month)[0]\\n days_in_month = monthrange(year, month)[1]\\n possible_dates = []\\n print str(year) + str(month) + dow + wom\\n\\n \\\"\\\"\\\"Build dictionary of possible dates based on dow\\\"\\\"\\\"\\n for day in range(1, days_in_month+1):\\n if datetime.date(year, month, day).strftime(\\\"%A\\\") == dow:\\n print day\\n possible_dates.extend([day])\\n\\n \\\"\\\"\\\"Perform logic on wom constraint\\\"\\\"\\\"\\n if wom == \\\"teenth\\\":\\n for day in possible_dates:\\n if day > 12 and day < 20:\\n return datetime.date(year, month, day)\\n elif wom == \\\"last\\\":\\n return datetime.date(year, month, possible_dates[-1])\\n else:\\n return datetime.date(year, month, possible_dates[ int(wom[:1]) - 1 ])\",\n \"def dates_of_the_week():\\n date_list = list()\\n now = datetime.datetime.now()\\n monday = now - datetime.timedelta(days=now.weekday(), hours=now.hour, minutes=now.minute, seconds=now.second,\\n microseconds=now.microsecond)\\n date_list.append(monday)\\n for each in range(1, 6):\\n monday = monday + datetime.timedelta(days=1)\\n date_list.append(monday)\\n date_list.append((monday + datetime.timedelta(days=1, hours=23, minutes=59, seconds=59)))\\n return date_list\",\n \"def week(self) -> Index:\\n warnings.warn(\\n \\\"`week` is deprecated in 3.5.0 and will be removed in 4.0.0.\\\",\\n FutureWarning,\\n )\\n return Index(self.to_series().dt.week)\",\n \"def weekNumber(self): # real signature unknown; restored from __doc__\\r\\n pass\",\n \"def _compute_week_index(self, column_index):\\n latest_week = self.end_date.isocalendar()[1]\\n column_date = self.start_date + timedelta(column_index)\\n week = column_date.isocalendar()[1]\\n week_index = latest_week - week\\n return week_index\",\n \"def GetWeekDay(self):\\n if self.day is None:\\n if self.week:\\n return (\\n self.century,\\n self.year //\\n 10,\\n self.year %\\n 10,\\n self.week,\\n None)\\n elif self.month is None:\\n if self.year is None:\\n return (self.century, None, None, None, None)\\n else:\\n return (\\n self.century,\\n self.year //\\n 10,\\n self.year %\\n 10,\\n None,\\n None)\\n else:\\n raise DateTimeError(\\\"can't get week day with month precision\\\")\\n else:\\n century, year, ordinalDay = self.GetOrdinalDay()\\n year += century * 100\\n if LeapYear(year):\\n yearLength = 366\\n else:\\n yearLength = 365\\n weekday = DayOfWeek(year, self.month, self.day)\\n thursday = ordinalDay + 4 - weekday\\n if thursday < 1:\\n # Thursday this week was actually last year, and so we are\\n # part of the last calendar week of last year too.\\n # may return year==0\\n year -= 1\\n week = WeekCount(year)\\n elif thursday > yearLength:\\n # Thursday this week is actually next year, and so we are\\n # part of the first calendar week of next year too.\\n # may return century=100\\n year += 1\\n week = 1\\n else:\\n # We are part of this year, but which week?\\t Jan 4th is always\\n # part of the first week of the year, so we calculate the ordinal\\n # value of the Monay that began that week\\n yearBase = 5 - DayOfWeek(year, 1, 4)\\n week = (ordinalDay - yearBase) // 7 + 1\\n return year // 100, (year % 100) // 10, (year % 10), week, weekday\",\n \"def find_day_of_week(year, month, day_of_week, offset=0, use_datetime=False):\\n iter = Calendar().itermonthdates(year, month)\\n n = 0\\n\\n for value in iter:\\n if month != value.month:\\n continue\\n\\n if day_of_week == weekday(value.year, value.month, value.day):\\n if n == offset:\\n return convert_date_to_datetime(value) if use_datetime else value\\n else:\\n n += 1\\n\\n return None\",\n \"def day_of_week(self) -> str:\\n return self.elements[4]\",\n \"def get_next_week(self, startdate):\\n dow_today = int(datetime.datetime.strftime(startdate, '%w'))\\n days_until_sunday = 7 - ((dow_today + 7) % 7)\\n #days_until_sunday = 7 - (dow_today + 1)\\n sunday = startdate + datetime.timedelta(days=days_until_sunday)\\n following_saturday = sunday + datetime.timedelta(days=6)\\n next_week = (sunday, following_saturday)\\n return next_week\",\n \"def workweeks(yr):\\n\\n # TODO: MOVE all of this crap into a intelDateTime.py module. Does not belong here. JSS\\n\\n nyd = datetime.date(yr, 1, 1).weekday() # Determine the day of the week on which the 1st of January fell this year.\\n if nyd == 5: return 53 # If the 1st of January fell on a Saturday, the year has 53 weeks.\\n if nyd == 4 and isleapyear(yr): return 53 # Same deal if the 1st of January fell on a Friday in a leap year.\\n return 52 # All other years have 52 work weeks.\",\n \"def WEEKDAY(\\n serial_number: func_xltypes.XlNumber,\\n return_type: func_xltypes.XlNumber = None\\n) -> func_xltypes.XlNumber:\\n\\n date = utils.number_to_datetime(int(serial_number))\\n\\n if return_type is None:\\n # Numbers 1 (Sunday) through 7 (Saturday)\\n weekDays = (2, 3, 4, 5, 6, 7, 1)\\n return weekDays[date.weekday()]\\n\\n elif int(return_type) == 1:\\n # Numbers 1 (Sunday) through 7 (Saturday)\\n weekDays = (2, 3, 4, 5, 6, 7, 1)\\n return weekDays[date.weekday()]\\n\\n # weekday() is 0 based, starting on a Monday\\n elif int(return_type) == 2:\\n # Numbers 1 (Monday) through 7 (Sunday)\\n weekDays = (1, 2, 3, 4, 5, 6, 7)\\n return weekDays[date.weekday()]\\n\\n elif int(return_type) == 3:\\n # Numbers 0 (Monday) through 6 (Sunday)\\n weekDays = (0, 1, 2, 3, 4, 5, 6)\\n return weekDays[date.weekday()]\\n\\n elif int(return_type) == 11:\\n # Numbers 1 (Monday) through 7 (Sunday)\\n weekDays = (1, 2, 3, 4, 5, 6, 7)\\n return weekDays[date.weekday()]\\n\\n elif int(return_type) == 12:\\n # Numbers 1 (Tuesday) through 7 (Monday)\\n weekDays = (7, 1, 2, 3, 4, 5, 6)\\n return weekDays[date.weekday()]\\n\\n elif int(return_type) == 13:\\n # Numbers 1 (Wednesday) through 7 (Tuesday)\\n weekDays = (6, 7, 1, 2, 3, 4, 5)\\n return weekDays[date.weekday()]\\n\\n elif int(return_type) == 14:\\n # Numbers 1 (Thursday) through 7 (Wednesday)\\n weekDays = (5, 6, 7, 1, 2, 3, 4)\\n return weekDays[date.weekday()]\\n\\n elif int(return_type) == 15:\\n # Numbers 1 (Friday) through 7 (Thursday)\\n weekDays = (4, 5, 6, 7, 1, 2, 3)\\n return weekDays[date.weekday()]\\n\\n elif int(return_type) == 16:\\n # Numbers 1 (Saturday) through 7 (Friday)\\n weekDays = (3, 4, 5, 6, 7, 1, 2)\\n return weekDays[date.weekday()]\\n\\n elif int(return_type) == 17:\\n # Numbers 1 (Sunday) through 7 (Saturday)\\n weekDays = (2, 3, 4, 5, 6, 7, 1)\\n return weekDays[date.weekday()]\\n\\n else:\\n raise xlerrors.NumExcelError(\\n f\\\"return_type needs to be omitted or one of 1, 2, 3, 11, 12, 13,\\\\\\n 14, 15, 16 or 17. You supplied {return_type}\\\")\",\n \"def _get_next_monday(self):\\n today = datetime.date.today()\\n weekday_int = today.weekday()\\n if weekday_int == 0:\\n return today\\n next_mon = today + timedelta(7 - weekday_int)\\n return next_mon\",\n \"def GetFirstSundayOfMonth(year, month):\\n weeks = calendar.Calendar().monthdays2calendar(year, month)\\n # Return the first day in the first week that is a Sunday.\\n return [date_day[0] for date_day in weeks[0] if date_day[1] == 6][0]\",\n \"def get_weekday():\\n result = datetime.today().weekday() + 1\\n return result\",\n \"def _DayNumToWeekdayNum(daynum):\\n return (daynum + _WEEKDAY_BASE) % NUM_WEEKDAYS\",\n \"def get_weekday(self):\\n originDate = Date(1900, 1, 1)\\n return WEEKDAYS[originDate.days_since(self) % 7]\",\n \"def get_week_of_year(date, padded_or_unpadded, start_Sunday_or_Monday):\\n if start_Sunday_or_Monday == constants.str_Sunday:\\n week_of_year = date.strftime('%U')\\n elif start_Sunday_or_Monday == constants.str_Monday:\\n week_of_year = date.strftime('%W')\\n else:\\n err_msg = str_possible_values('start_Sunday_or_Monday', [\\n constants.str_Sunday, constants.str_Monday])\\n raise ValueError(err_msg)\\n\\n if padded_or_unpadded == constants.str_padded:\\n return week_of_year\\n elif padded_or_unpadded == constants.str_unpadded:\\n return str(int(week_of_year))\\n else:\\n err_msg = str_possible_values('padded_or_unpadded', [\\n constants.str_padded, constants.str_unpadded])\\n raise ValueError(err_msg)\",\n \"def get_the_weekday(self,date):\\n date_convert = date.split('-')\\n week_days = (\\\"Monday\\\", \\\"Tuesday\\\", \\\"Wednesday\\\", \\\"Thursday\\\", \\\"Friday\\\", \\\"Saturday\\\", \\\"Sunday\\\")\\n date_list = [int(i) for i in date_convert]\\n day = datetime.date(date_list[0], date_list[1], date_list[2])\\n # convert weekday into digit (eg Mon -> 0,)\\n num_day = day.weekday()\\n day_as_string = week_days[num_day]\\n return day_as_string\",\n \"def get_weekdays(date: str) -> list:\\n parsed_date = parser.parse(date)\\n day_of_week = parsed_date.weekday()\\n first_day_of_week = parsed_date - datetime.timedelta(days=day_of_week)\\n\\n return holiday.create_date_range(first_day_of_week, 7)\",\n \"def test_monday(self):\\n date = datetime.date(1981, 5, 4)\\n self.assertEqual(date.isoweekday(), 1)\\n start_date, end_date = get_weekspan(date)\\n self.assertEqual(start_date.isoweekday(), 1)\\n self.assertEqual(end_date.isoweekday(), 7)\\n self.assertTrue(start_date.toordinal() <= date.toordinal() <= end_date.toordinal())\",\n \"def formatWeek(self, themonth, theweek, num_weeks):\\n s = ''.join(self.formatDay(themonth, d, num_weeks) for d in theweek)\\n return '<tr>%s</tr>' % s\",\n \"def get_date_in_two_weeks():\\n today = datetime.datetime.today()\\n date_in_two_weeks = today + datetime.timedelta(days=14)\\n return date_in_two_weeks.date()\",\n \"def current_week(self):\\n\\n if not self.iso_equal() and self.time_stamp.weekday() == 6:\\n return self.time_stamp_iso[1] + 2\\n if not self.iso_equal() or self.time_stamp.weekday() == 6:\\n return self.time_stamp_iso[1] + 1 \\n return self.time_stamp_iso[1]\",\n \"def check_weekday_of_date(self, date):\\n return date.isoweekday() % 7\",\n \"def get_day_of_week_string(date_string):\\n\\n # Split on / string, and feed to a datetime object, to use weekday function\\n date_strings = date_string.split(\\\"/\\\")\\n update_date = datetime.datetime(int(date_strings[2]), int(date_strings[1]), int(date_strings[0]))\\n weekDays = (\\\"Mon\\\", \\\"Tue\\\", \\\"Wed\\\", \\\"Thur\\\", \\\"Fri\\\", \\\"Sat\\\", \\\"Sun\\\")\\n day_of_week = str(weekDays[update_date.weekday()])\\n return day_of_week\",\n \"def test_weeks(self):\\n d = datetime(2014, 1, 29)\\n eq_(week_start(d), datetime(2014, 1, 27, 0, 0, 0))\\n eq_(week_end(d), datetime(2014, 2, 2, 23, 59, 59))\",\n \"def get_current_day_week_number(week_delta=0):\\n return (datetime.today() + timedelta(weeks=week_delta)).isocalendar()[1]\",\n \"def dow(values, feature, parent): \\r\\n input_date = values[0]\\r\\n \\r\\n # Return dayOfWeek() % 7 so that values range from 0 (sun) to 6 (sat)\\r\\n # to match Postgresql behaviour\\r\\n if type(input_date) == QDateTime:\\r\\n return input_date.date().dayOfWeek() % 7\\r\\n elif type(input_date) == QDate:\\r\\n return input_date.dayOfWeek() % 7\\r\\n elif type(input_date) in (str, unicode): \\r\\n # Convert string to qdate\\r\\n input_qdate = QDate.fromString(input_date, 'yyyy-MM-dd')\\r\\n if input_qdate.isValid():\\r\\n return input_qdate.dayOfWeek() % 7 \\r\\n else:\\r\\n return None\",\n \"def dow(values, feature, parent): \\r\\n input_date = values[0]\\r\\n \\r\\n # Return dayOfWeek() % 7 so that values range from 0 (sun) to 6 (sat)\\r\\n # to match Postgresql behaviour\\r\\n if type(input_date) == QDateTime:\\r\\n return input_date.date().dayOfWeek() % 7\\r\\n elif type(input_date) == QDate:\\r\\n return input_date.dayOfWeek() % 7\\r\\n elif type(input_date) in (str, unicode): \\r\\n # Convert string to qdate\\r\\n input_qdate = QDate.fromString(input_date, 'yyyy-MM-dd')\\r\\n if input_qdate.isValid():\\r\\n return input_qdate.dayOfWeek() % 7 \\r\\n else:\\r\\n return None\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.7487706","0.7056256","0.70537466","0.70099276","0.70012397","0.6820069","0.6787127","0.66652584","0.6636667","0.651747","0.6508568","0.644575","0.6422966","0.64131665","0.6229527","0.6217697","0.62044543","0.61213183","0.60555804","0.6036671","0.6029071","0.60265785","0.60136586","0.6007771","0.5957888","0.59162563","0.58802545","0.587622","0.58497775","0.5796988","0.57785064","0.5767196","0.57330704","0.57207453","0.56769633","0.56669176","0.56077415","0.5603615","0.5584805","0.55747443","0.5565038","0.55476975","0.5521967","0.54931575","0.5490721","0.5360772","0.53543615","0.53540415","0.5352934","0.5348617","0.5329983","0.5329249","0.53237426","0.53219616","0.532178","0.5314833","0.531229","0.531229","0.5303133","0.5303133","0.529916","0.52952474","0.5294984","0.5290728","0.52878475","0.5241577","0.5216507","0.52069634","0.5205545","0.51964587","0.51932096","0.5188195","0.5178408","0.51759404","0.517013","0.51687855","0.51474416","0.5144719","0.51258004","0.5124162","0.5122752","0.51202756","0.509934","0.50988144","0.5092133","0.50859004","0.50788414","0.507361","0.50704086","0.5067984","0.50455415","0.5017548","0.50129634","0.50049096","0.50008965","0.49954584","0.49748206","0.49518907","0.4944139","0.4944139"],"string":"[\n \"0.7487706\",\n \"0.7056256\",\n \"0.70537466\",\n \"0.70099276\",\n \"0.70012397\",\n \"0.6820069\",\n \"0.6787127\",\n \"0.66652584\",\n \"0.6636667\",\n \"0.651747\",\n \"0.6508568\",\n \"0.644575\",\n \"0.6422966\",\n \"0.64131665\",\n \"0.6229527\",\n \"0.6217697\",\n \"0.62044543\",\n \"0.61213183\",\n \"0.60555804\",\n \"0.6036671\",\n \"0.6029071\",\n \"0.60265785\",\n \"0.60136586\",\n \"0.6007771\",\n \"0.5957888\",\n \"0.59162563\",\n \"0.58802545\",\n \"0.587622\",\n \"0.58497775\",\n \"0.5796988\",\n \"0.57785064\",\n \"0.5767196\",\n \"0.57330704\",\n \"0.57207453\",\n \"0.56769633\",\n \"0.56669176\",\n \"0.56077415\",\n \"0.5603615\",\n \"0.5584805\",\n \"0.55747443\",\n \"0.5565038\",\n \"0.55476975\",\n \"0.5521967\",\n \"0.54931575\",\n \"0.5490721\",\n \"0.5360772\",\n \"0.53543615\",\n \"0.53540415\",\n \"0.5352934\",\n \"0.5348617\",\n \"0.5329983\",\n \"0.5329249\",\n \"0.53237426\",\n \"0.53219616\",\n \"0.532178\",\n \"0.5314833\",\n \"0.531229\",\n \"0.531229\",\n \"0.5303133\",\n \"0.5303133\",\n \"0.529916\",\n \"0.52952474\",\n \"0.5294984\",\n \"0.5290728\",\n \"0.52878475\",\n \"0.5241577\",\n \"0.5216507\",\n \"0.52069634\",\n \"0.5205545\",\n \"0.51964587\",\n \"0.51932096\",\n \"0.5188195\",\n \"0.5178408\",\n \"0.51759404\",\n \"0.517013\",\n \"0.51687855\",\n \"0.51474416\",\n \"0.5144719\",\n \"0.51258004\",\n \"0.5124162\",\n \"0.5122752\",\n \"0.51202756\",\n \"0.509934\",\n \"0.50988144\",\n \"0.5092133\",\n \"0.50859004\",\n \"0.50788414\",\n \"0.507361\",\n \"0.50704086\",\n \"0.5067984\",\n \"0.50455415\",\n \"0.5017548\",\n \"0.50129634\",\n \"0.50049096\",\n \"0.50008965\",\n \"0.49954584\",\n \"0.49748206\",\n \"0.49518907\",\n \"0.4944139\",\n \"0.4944139\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.65848774"},"document_rank":{"kind":"string","value":"9"}}},{"rowIdx":6094,"cells":{"query":{"kind":"string","value":"Returns customized day of week as first day Default first day of week is Monday mday used to set firstweek of day"},"document":{"kind":"string","value":"def day_of_week(dt):\n cday = dt\n mday = 2\n uday = cday.isocalendar()[2] + mday\n try:\n if uday > 7:\n CURRDAY = uday - 7\n log.debug(\"1;EME;RUNNING;000;Scheduler.py;Setting customized day of week>7 : \", CURRDAY)\n else:\n CURRDAY = uday\n log.debug(\"1;EME;RUNNING;000;Scheduler.py;Setting customized day of week : \", CURRDAY)\n return CURRDAY\n except Exception as e:\n log.exception(\"1;EME;FAILURE;700;SCHEDULE ERROR \" + str(e), exc_info=False)\n sys.exit(0)"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["def first_day_of_week(self):\n return self.__first_day_of_week","def locale_first_weekday():\n\tfirst_weekday = 6 #by default settle on monday\n\n\ttry:\n\t\tprocess = os.popen(\"locale first_weekday week-1stday\")\n\t\tweek_offset, week_start = process.read().split('\\n')[:2]\n\t\tprocess.close()\n\t\tweek_start = datetime.date(*time.strptime(week_start, \"%Y%m%d\")[:3])\n\t\tweek_offset = datetime.timedelta(int(week_offset) - 1)\n\t\tbeginning = week_start + week_offset\n\t\tfirst_weekday = int(beginning.strftime(\"%w\"))\n\texcept:\n\t\tprint \"WARNING - Failed to get first weekday from locale\"\n\n\treturn first_weekday","def _FirstSunday(self, dtz): # pylint: disable-msg=C0103,R0201\n return dtz + datetime.timedelta(days=(6-dtz.weekday()))","def first_week_day(self) -> int:\n return self._data['week_data']['first_day']","def day_of_week_for_start_day(self):\n import calendar\n\n day = self.idfobjects[\"RUNPERIOD\"][0][\"Day_of_Week_for_Start_Day\"]\n\n if day.lower() == \"sunday\":\n return calendar.SUNDAY\n elif day.lower() == \"monday\":\n return calendar.MONDAY\n elif day.lower() == \"tuesday\":\n return calendar.TUESDAY\n elif day.lower() == \"wednesday\":\n return calendar.WEDNESDAY\n elif day.lower() == \"thursday\":\n return calendar.THURSDAY\n elif day.lower() == \"friday\":\n return calendar.FRIDAY\n elif day.lower() == \"saturday\":\n return calendar.SATURDAY\n else:\n return 0","def day_of_week():\n return calendar.day_name[datetime.date.today().weekday()]","def wkday_on_first(yr, mon): # returns day of week of first of month of the given year (1/1/2016)\r\n TotalDays = 0\r\n for x in range(1754, yr):\r\n YearNum = yeardays(x)\r\n TotalDays += YearNum\r\n for x in range(1, mon):\r\n MonNum = monthdays(yr, x)\r\n TotalDays += MonNum\r\n WhatDayNum = TotalDays % 7\r\n WhatDay = [\"Tues\", \"Wedn\", \"Thu\", \"Fri\", \"Sat\", \"Mon\"]\r\n return WhatDay[WhatDayNum]","def week_start_on_monday(weekday):\n return (weekday - 1 + 6) % 7 + 1","def set_week_day(self, wday):\r\n\t\twdays = ['Domingo', 'Lunes', 'Martes', 'Miercoles',\r\n\t\t\t\t 'Jueves', 'Viernes', 'Sabado']\r\n\t\tfor i in range(7):\r\n\t\t\tif wday == i: \r\n\t\t\t\treturn wdays[i]","def get_day_of_week() -> str:\n return datetime.now(pytz.timezone('US/Eastern')).strftime(\"%a\").lower()","def day_of_week(self) -> str:\n return self.elements[4]","def get_weekday():\n result = datetime.today().weekday() + 1\n return result","def day_of_week(self):\n day_of_week_names = ['Monday', 'Tuesday', 'Wednesday', 'Thursday',\n 'Friday', 'Saturday', 'Sunday']\n diff = self.diff(Date(1, 1, 1970)) + 3\n while diff < 0:\n diff += 7\n print(day_of_week_names[diff % 7])","def day_of_week(self) -> str:\n return pulumi.get(self, \"day_of_week\")","def day_of_week(self) -> str:\n return pulumi.get(self, \"day_of_week\")","def get_day_today() -> str:\n day = datetime.now().strftime(\"%w\")\n if day == '0': # Sunday\n return '6'\n elif day == '6': # Saturday\n return '5'\n elif day == '1': # Monday\n return '0'\n elif day == '2': # Tuesday\n return '1'\n elif day == '3': # Wednesday\n return '2'\n elif day == '4': # Thursday\n return '3'\n elif day == '5': # Friday\n return '4'","def day_of_week(self):\n # 1 Jan 0001 was Monday according to the proleptic Gregorian calendar.\n # So, 1 Jan 0001 has ordinal 1, and the weekday is 0.\n return (self._ordinals - 1) % 7","def weekday(self):\n return (self.toordinal() + 6) % 7","def day_of_week(self) -> pulumi.Input[Union[str, 'WeekDay']]:\n return pulumi.get(self, \"day_of_week\")","def day_of_week(self) -> pulumi.Input[Union[str, 'WeekDay']]:\n return pulumi.get(self, \"day_of_week\")","def _get_next_monday(self):\n today = datetime.date.today()\n weekday_int = today.weekday()\n if weekday_int == 0:\n return today\n next_mon = today + timedelta(7 - weekday_int)\n return next_mon","def weekday(day):\n return (day % 7) - 1","def weekday(self):\n return 0","def weekday(self):\n return 0","def day_of_the_week(arg):","def day_of_week(date: datetime) -> str:\n weekday = date.weekday()\n return calendar.day_name[weekday]","def first_monday_of_week(year, week):\n weekyear = \"{} {} 1\".format(year, week)\n return time.asctime(time.strptime(weekyear, \"%Y %U %w\"))","def get_first_day_of_the_week(self):\n if SubscriptionProduct.objects.filter(\n subscription=self, product__weekday=1\n ).exists():\n return 1\n elif SubscriptionProduct.objects.filter(\n subscription=self, product__weekday=2\n ).exists():\n return 2\n elif SubscriptionProduct.objects.filter(\n subscription=self, product__weekday=3\n ).exists():\n return 3\n elif SubscriptionProduct.objects.filter(\n subscription=self, product__weekday=4\n ).exists():\n return 4\n elif SubscriptionProduct.objects.filter(\n subscription=self, product__weekday=5\n ).exists():\n return 5\n else:\n return 6","def date_day_of_week(date):\n day_of_week = date.strftime('%A')\n return day_of_week","def get_week_start(x: Optional[Date] = None) -> Date:\n asof = x or get_today()\n return asof - TimeDelta(days=(asof.isoweekday() - 1) % 7)","def get_weekday(self):\n originDate = Date(1900, 1, 1)\n return WEEKDAYS[originDate.days_since(self) % 7]","def get_weekday(self):\n weekdays = dict(PRODUCT_WEEKDAYS)\n return weekdays.get(self.weekday, \"N/A\")","def get_next_monday(date):\n return date + datetime.timedelta(days=-date.weekday(), weeks=1)","def day(self) -> Optional[pulumi.Input[Union[str, 'WeekDay']]]:\n return pulumi.get(self, \"day\")","def next_sunday(day):\n if day.weekday() == 6: # sunday\n return day + timedelta(days=7)\n else:\n return day + timedelta(days=(6 - day.weekday()))","def weekday(self):\n if self.month is not None and self.day is not None:\n return self.todate().weekday()\n else:\n return None","def dow_1(self):\n return self._dayoffset + 1","def next_seven_day(self):\n today = datetime.date.today()\n week_next = today + datetime.timedelta(days=7)\n return week_next.strftime('%Y-%m-%d')","def weekday(self):\n\n return func.extract('dow', self.start_date) + 1","def weekday(self) -> int:\n return WD_EN.index(self.time.day.lower())","def first_month_day():\r\n return datetime.now().replace(day=1).strftime('%d-%m-%Y')","def weekdayname(self, date):\n weekday = weekdayname_msgid(date.dow())\n return translate(weekday, domain='plonelocales',\n context=self.request, default=weekday)","def start_day_of_weekend(self):\n return self._start_day_of_weekend","def day_name(self):\n ref = Date(11, 11, 2019)\n day_names = ['Monday', 'Tuesday', 'Wednesday', \n 'Thursday', 'Friday', 'Saturday', 'Sunday']\n days = self.days_between(ref)\n self_day = day_names[days%7]\n return self_day","def day_name(x):\r\n if x==0:\r\n return \"Sunday\"\r\n elif x==1:\r\n return \"Monday\"\r\n elif x==2:\r\n return \"Tuesday\"\r\n elif x==3:\r\n return \"Wednesday\"\r\n elif x==4:\r\n return \"Thursday\"\r\n elif x==5:\r\n return \"Friday\"\r\n elif x==6:\r\n return \"Saturday\"","def main():\n print(day_of_week(datetime.now()))\n print(day_of_week(datetime(2019, 7, 4)))\n print(day_of_week(datetime(2013, 12, 25)))\n print(day_of_week(datetime(2000, 1, 1)))","def get_week_date():\n return timezone.now()+timezone.timedelta(days=6)","def date_week_of_year(date, *, sunday_is_first_day_of_week: bool = False):\n if sunday_is_first_day_of_week:\n return date.strftime(\"%U\")\n else:\n return date.strftime(\"%V\")","def first_day_of_month():\n first_object = datetime.utcnow()\n first_string = first_object.strftime('%m/01/%Y')\n return first_string","def get_the_weekday(self,date):\n date_convert = date.split('-')\n week_days = (\"Monday\", \"Tuesday\", \"Wednesday\", \"Thursday\", \"Friday\", \"Saturday\", \"Sunday\")\n date_list = [int(i) for i in date_convert]\n day = datetime.date(date_list[0], date_list[1], date_list[2])\n # convert weekday into digit (eg Mon -> 0,)\n num_day = day.weekday()\n day_as_string = week_days[num_day]\n return day_as_string","def Day_of_week(day, month, year):\r\n if year % 4 == 0 and (year % 400 == 0 or year % 100 != 0):\r\n doomsday = [11, 29, 21, 4, 9, 6, 11, 8, 5, 10, 7, 12]\r\n else:\r\n doomsday = [10, 28, 21, 4, 9, 6, 11, 8, 5, 10, 7, 12]\r\n exact_day = ((day - doomsday[month-1]) + Dooms_day(year)) % 7\r\n character_day = [\"Sunday\", \"Monday\", \"Tuesday\", \"Wednesday\", \"Thursday\", \r\n \"Friday\", \"Saturday\"]\r\n return character_day[exact_day]","def get_next_weekend():\n d = datetime.date.today()\n # day 5 for saturday\n t = datetime.timedelta((7 + 5 - d.weekday()) % 7)\n return (d + t).strftime('%d-%m-%Y')","def weekday(self, dt):\n days = {\n 0: self.MONDAY,\n 1: self.TUESDAY,\n 2: self.WEDNESDAY,\n 3: self.THURSDAY,\n 4: self.FRIDAY,\n 5: self.SATURDAY,\n 6: self.SUNDAY\n }\n return days.get(dt.weekday())","def dow(self):\n comparator = Date(11, 12, 2014) # known to be a 'Wednesday'\n DOW = ['Wednesday', 'Thursday', 'Friday', 'Saturday', 'Sunday', 'Monday', 'Tuesday']\n diff = self.diff(comparator)\n return DOW[diff % 7]","def isoweekday(self):\n # 1-Jan-0001 is a Monday\n return self.toordinal() % 7 or 7","def date_to_dow(y, m, d):\r\n # Python uses Monday week start, so wrap around\r\n w = calendar.weekday(y, m, d) + 1\r\n if w == 7:\r\n w = 0\r\n return w","def distributeWeekday(self, jan1):\n self.firstday = jan1\n for day in self.daylist:\n if jan1%7 == 6 or jan1%7 == 0:\n day.weekday = 'weekend'\n jan1 = jan1 + 1","def date_to_day_of_week(date):\n return date.weekday()","def get_weekday_number(date):\n return date.strftime('%w')","def GetFirstSundayOfMonth(year, month):\n weeks = calendar.Calendar().monthdays2calendar(year, month)\n # Return the first day in the first week that is a Sunday.\n return [date_day[0] for date_day in weeks[0] if date_day[1] == 6][0]","def next_weekday(weekday, d=datetime.datetime.now()):\n if weekday.lower() not in day_values:\n return None\n days_ahead = day_values[weekday.lower()] - d.weekday()\n if days_ahead <= 0: # Target day already happened this week\n days_ahead += 7\n return d + datetime.timedelta(days_ahead)","def assign_numeric_day(x):\n\n if x == 'Sunday':\n return 0\n elif x == 'Monday':\n return 1\n elif x == 'Tuesday':\n return 2\n elif x == 'Wednesday':\n return 3\n elif x == 'Thursday':\n return 4\n elif x == 'Friday':\n return 5\n elif x == 'Saturday':\n return 6","def get_weekday():\n try:\n day = config.getint(\"threadbot\", \"debug_day\")\n except ConfigParser.NoOptionError:\n d = datetime.date.today()\n day = d.weekday()\n sort_by_new = False\n\n # 0 / Monday / Feedback thread\n # 1 / Tuesday / How do I make this sound thread\n # 2 / Wednesday / There are no stupid questions thread\n # 3 / Thursday / Marketplace thread\n dayname = \"waffles\"\n if day == 0:\n dayname = \"monday\"\n sort_by_new = True\n elif day == 1:\n dayname = \"tuesday\"\n sort_by_new = True\n elif day == 2:\n dayname = \"wednesday\"\n sort_by_new = True\n elif day == 3:\n dayname = \"thursday\"\n sort_by_new = False\n else:\n sys.exit(1) # woo inelegance\n\n return dayname, sort_by_new","def meetup_day(year, month, day_of_week, day_occurrence):\n \n cal = calendar.monthcalendar(year, month)\n day_of_week_index = days_of_week[day_of_week]\n \n not_teenth = day_occurrence != 'teenth'\n day_is_in_first_week = cal[0][day_of_week_index] != 0\n \n if not_teenth and day_is_in_first_week:\n week_index = week_indices[day_occurrence]\n \n elif not_teenth and not day_is_in_first_week:\n week_index = week_indices[day_occurrence] + 1\n \n else:\n for i in range(len(cal)):\n if cal[i][day_of_week_index] >= 10:\n week_index = i\n break\n\n date = cal[week_index][day_of_week_index]\n return datetime.date(year, month, date)","def day_of_week(day, month, year):\n bias = (14 - month) // 12\n m_year = year - bias\n mth = month + 12 * bias - 2\n return (day + m_year + m_year // 4 - m_year // 100 + m_year // 400 + (31 * mth) // 12) % 7","def next_day_of_week(current, day_of_week):\n\n while current.weekday() != day_of_week:\n current += timedelta(1)\n return current","def getDay(self):\n return _libsbml.Date_getDay(self)","def _get_earliest_monday(self):\n try:\n earliest_request_date = self.org_admin.get_hours_requested().\\\n order_by('usertimelog__datetime_start').first().\\\n usertimelog.datetime_start\n except:\n earliest_request_date = self.org_admin.get_hours_approved().\\\n order_by('usertimelog__datetime_start').first().\\\n usertimelog.datetime_start\n\n earliest_monday = earliest_request_date - timedelta(\n days=(earliest_request_date.weekday()))\n earliest_monday = earliest_monday.replace(hour=00, minute=00, second=00)\n\n return earliest_monday","def weekday_name(day_of_week):\n\n weekday_names = [\n 'Sunday', \n 'Monday', \n 'Tuesday', \n 'Wednesday', \n 'Thursday', \n 'Friday', \n 'Saturday']\n \n if day_of_week < 1 or day_of_week > 7:\n return 'None! Sowwy.'\n\n if day_of_week == 1:\n print(weekday_names[0])\n if day_of_week == 2:\n print(weekday_names[1])\n if day_of_week == 3:\n print(weekday_names[2])\n if day_of_week == 4:\n print(weekday_names[3])\n if day_of_week == 5:\n print(weekday_names[4])\n if day_of_week == 6:\n print(weekday_names[5]) \n if day_of_week == 7:\n print(weekday_names[6])","def get_next_weekday(date, weekday):\n return date + dt.timedelta(days=(weekday - date.weekday() + 7) % 7)","def get_trip_day_weekday(self):\n\n days = {\"Lundi\":'1', \"Mardi\":'2', \"Mercredi\":'3', \"Jeudi\":'4', \"Vendredi\":'5', \"Samedi\":'6', \"Dimanche\":'7'}\n\n return int(days[dict(self.TRIP_DAY_SELECTIONS)[self.trip_day]])","def __str__(self):\n return self.day_of_week","def format_weekday(time):\n return time.strftime(\"%A\").lower()","def week(start_day=\"monday\"):\r\n today = datetime.datetime.combine(datetime.date.today(), datetime.datetime.min.time())\r\n weekday = today.weekday()\r\n week = list(calendar.Calendar(getattr(calendar, start_day.upper())).iterweekdays())\r\n pos = week.index(weekday)\r\n week_stamp = (to_stamp(today - datetime.timedelta(days=pos - i)) for i, d in enumerate(week))\r\n return collections.OrderedDict(((calendar.day_name[a], (b, b + DAY)) for a, b in zip(week, week_stamp)))","def WEEKDAY(\n serial_number: func_xltypes.XlNumber,\n return_type: func_xltypes.XlNumber = None\n) -> func_xltypes.XlNumber:\n\n date = utils.number_to_datetime(int(serial_number))\n\n if return_type is None:\n # Numbers 1 (Sunday) through 7 (Saturday)\n weekDays = (2, 3, 4, 5, 6, 7, 1)\n return weekDays[date.weekday()]\n\n elif int(return_type) == 1:\n # Numbers 1 (Sunday) through 7 (Saturday)\n weekDays = (2, 3, 4, 5, 6, 7, 1)\n return weekDays[date.weekday()]\n\n # weekday() is 0 based, starting on a Monday\n elif int(return_type) == 2:\n # Numbers 1 (Monday) through 7 (Sunday)\n weekDays = (1, 2, 3, 4, 5, 6, 7)\n return weekDays[date.weekday()]\n\n elif int(return_type) == 3:\n # Numbers 0 (Monday) through 6 (Sunday)\n weekDays = (0, 1, 2, 3, 4, 5, 6)\n return weekDays[date.weekday()]\n\n elif int(return_type) == 11:\n # Numbers 1 (Monday) through 7 (Sunday)\n weekDays = (1, 2, 3, 4, 5, 6, 7)\n return weekDays[date.weekday()]\n\n elif int(return_type) == 12:\n # Numbers 1 (Tuesday) through 7 (Monday)\n weekDays = (7, 1, 2, 3, 4, 5, 6)\n return weekDays[date.weekday()]\n\n elif int(return_type) == 13:\n # Numbers 1 (Wednesday) through 7 (Tuesday)\n weekDays = (6, 7, 1, 2, 3, 4, 5)\n return weekDays[date.weekday()]\n\n elif int(return_type) == 14:\n # Numbers 1 (Thursday) through 7 (Wednesday)\n weekDays = (5, 6, 7, 1, 2, 3, 4)\n return weekDays[date.weekday()]\n\n elif int(return_type) == 15:\n # Numbers 1 (Friday) through 7 (Thursday)\n weekDays = (4, 5, 6, 7, 1, 2, 3)\n return weekDays[date.weekday()]\n\n elif int(return_type) == 16:\n # Numbers 1 (Saturday) through 7 (Friday)\n weekDays = (3, 4, 5, 6, 7, 1, 2)\n return weekDays[date.weekday()]\n\n elif int(return_type) == 17:\n # Numbers 1 (Sunday) through 7 (Saturday)\n weekDays = (2, 3, 4, 5, 6, 7, 1)\n return weekDays[date.weekday()]\n\n else:\n raise xlerrors.NumExcelError(\n f\"return_type needs to be omitted or one of 1, 2, 3, 11, 12, 13,\\\n 14, 15, 16 or 17. You supplied {return_type}\")","def week(self):\n J = self.JulianDay()\n d4 = (J + 31741 - (J % 7)) % 146097 % 36524 % 1461\n L = d4 // 1460\n d1 = ((d4 - L) % 365) + L\n return d1 // 7 + 1","def dayname(self):\n return self.strftime(\"%A\")","def get_this_week_label(self):\n return gettext_lazy('This week')","def get_today_week_number(self):\n\n today = date.today()\n iso_result = today.isocalendar()\n return iso_result[1]","def WEEKDAY(date, return_type=1):\n if return_type not in _weekday_type_map:\n raise ValueError(\"Invalid return type %s\" % (return_type,))\n (first, index) = _weekday_type_map[return_type]\n return (_make_datetime(date).weekday() - first) % 7 + index","def find_date(startdate, weekday, weeknumber):\n import datetime\n # The +1 makes this match up with linux times (day 1 = Monday)\n daysahead = weekday - (startdate.weekday() + 1)\n if daysahead < 0:\n # Target day already happened this week\n daysahead += 7\n # Add 7 days for each Week Of Month we want - but 'This' week is week 1\n daysahead += 7 * (weeknumber - 1)\n return startdate + datetime.timedelta(daysahead)","def week(self):\n if self._week.lower() == 'wild card':\n return WILD_CARD\n if self._week.lower() == 'division':\n return DIVISION\n if self._week.lower() == 'conf. champ.':\n return CONF_CHAMPIONSHIP\n if self._week.lower() == 'superbowl':\n return SUPER_BOWL\n return self._week","def weekly():","def next_weekday(date, weekday):\n delta = weekday - date.weekday()\n if delta < 0:\n delta += 7\n return date + timedelta(days=int(delta))","def formatWeekDay(self, day):\n return '<th class=\"day\">%s</th>' % day_abbr[day]","def format_dow(value):\n if value:\n return [\n 'Sunday',\n 'Monday',\n 'Tuesday',\n 'Wednesday',\n 'Thursday',\n 'Friday',\n 'Saturday',\n ][value]\n else:\n return 'N/A'","def day_num(x):\r\n if x==\"Sunday\":\r\n return 0\r\n elif x==\"Monday\":\r\n return 1\r\n elif x==\"Tuesday\":\r\n return 2\r\n elif x==\"Wednesday\":\r\n return 3\r\n elif x==\"Thursday\":\r\n return 4\r\n elif x==\"Friday\":\r\n return 5\r\n elif x==\"Saturday\":\r\n return 6","def dayofweek(self) -> Index:\n warnings.warn(\n \"`dayofweek` will return int32 index instead of int 64 index in 4.0.0.\",\n FutureWarning,\n )\n return Index(self.to_series().dt.dayofweek)","def dayofweek(day, month, year, formatresult=True):\n if formatresult is False:\n return calendar.weekday(year, month, day) + 1\n days = {\n 0: 'Monday',\n 1: \"Tuesday\",\n 2: \"Wednesday\",\n 3: \"Thursday\",\n 4: \"Friday\",\n 5: \"Saturday\",\n 6: \"Sunday\"\n }\n return days[calendar.weekday(year, month, day)]","def weekday(self, *args, **kwargs): # real signature unknown\r\n pass","def first_day_of_month(date):\n return date.replace(day=1)","def first_day_of_month(date):\n return date.replace(day=1)","def date_form(day):\r\n new_day = \"\"\r\n if day == \"Monday\":\r\n new_day = \"Poniedziałek\"\r\n elif day == \"Tuesday\":\r\n new_day = \"Wtorek\"\r\n elif day == \"Wednesday\":\r\n new_day = \"Środa\"\r\n elif day == \"Thursday\":\r\n new_day = \"Czwartek\"\r\n elif day == \"Friday\":\r\n new_day = \"Piątek\"\r\n elif day == \"Saturday\":\r\n new_day = \"Sobota\"\r\n elif day == \"Sunday\":\r\n new_day = \"Niedziela\"\r\n return new_day","def week_init():\n week = input('Week to check: MM/DD/YYYY\\n')\n week = dtt.datetime.strptime(week,'%m/%d/%Y') #turns input to a datetime\n beforeday = input('Check days before date (Press enter to use today): MM/DD/YYYY\\n') or dtt.date.today()\n if (beforeday != dtt.date.today()):\n beforeday = dtt.datetime.strptime(beforeday,'%m/%d/%Y')\n return week, beforeday","def day_07_b() -> int:\n return 0","def getOneDay(self,day_number=0):\n return self.event_time_sequence[day_number]","def DayOfWeek(year, month, day):\n num = year * 365\n num = num + year // 4 + 1\n num = num - (year // 100 + 1)\n num = num + year // 400 + 1\n if month < 3 and LeapYear(year):\n num = num - 1\n return (num + MONTH_OFFSETS[month - 1] + day + 4) % 7 + 1","def get_current_day_week_number(week_delta=0):\n return (datetime.today() + timedelta(weeks=week_delta)).isocalendar()[1]","def day_07_a() -> int:\n return 0","def days_of_the_week(self) -> Optional[pulumi.Input[Sequence[pulumi.Input[Union[str, 'DayOfWeek']]]]]:\n return pulumi.get(self, \"days_of_the_week\")"],"string":"[\n \"def first_day_of_week(self):\\n return self.__first_day_of_week\",\n \"def locale_first_weekday():\\n\\tfirst_weekday = 6 #by default settle on monday\\n\\n\\ttry:\\n\\t\\tprocess = os.popen(\\\"locale first_weekday week-1stday\\\")\\n\\t\\tweek_offset, week_start = process.read().split('\\\\n')[:2]\\n\\t\\tprocess.close()\\n\\t\\tweek_start = datetime.date(*time.strptime(week_start, \\\"%Y%m%d\\\")[:3])\\n\\t\\tweek_offset = datetime.timedelta(int(week_offset) - 1)\\n\\t\\tbeginning = week_start + week_offset\\n\\t\\tfirst_weekday = int(beginning.strftime(\\\"%w\\\"))\\n\\texcept:\\n\\t\\tprint \\\"WARNING - Failed to get first weekday from locale\\\"\\n\\n\\treturn first_weekday\",\n \"def _FirstSunday(self, dtz): # pylint: disable-msg=C0103,R0201\\n return dtz + datetime.timedelta(days=(6-dtz.weekday()))\",\n \"def first_week_day(self) -> int:\\n return self._data['week_data']['first_day']\",\n \"def day_of_week_for_start_day(self):\\n import calendar\\n\\n day = self.idfobjects[\\\"RUNPERIOD\\\"][0][\\\"Day_of_Week_for_Start_Day\\\"]\\n\\n if day.lower() == \\\"sunday\\\":\\n return calendar.SUNDAY\\n elif day.lower() == \\\"monday\\\":\\n return calendar.MONDAY\\n elif day.lower() == \\\"tuesday\\\":\\n return calendar.TUESDAY\\n elif day.lower() == \\\"wednesday\\\":\\n return calendar.WEDNESDAY\\n elif day.lower() == \\\"thursday\\\":\\n return calendar.THURSDAY\\n elif day.lower() == \\\"friday\\\":\\n return calendar.FRIDAY\\n elif day.lower() == \\\"saturday\\\":\\n return calendar.SATURDAY\\n else:\\n return 0\",\n \"def day_of_week():\\n return calendar.day_name[datetime.date.today().weekday()]\",\n \"def wkday_on_first(yr, mon): # returns day of week of first of month of the given year (1/1/2016)\\r\\n TotalDays = 0\\r\\n for x in range(1754, yr):\\r\\n YearNum = yeardays(x)\\r\\n TotalDays += YearNum\\r\\n for x in range(1, mon):\\r\\n MonNum = monthdays(yr, x)\\r\\n TotalDays += MonNum\\r\\n WhatDayNum = TotalDays % 7\\r\\n WhatDay = [\\\"Tues\\\", \\\"Wedn\\\", \\\"Thu\\\", \\\"Fri\\\", \\\"Sat\\\", \\\"Mon\\\"]\\r\\n return WhatDay[WhatDayNum]\",\n \"def week_start_on_monday(weekday):\\n return (weekday - 1 + 6) % 7 + 1\",\n \"def set_week_day(self, wday):\\r\\n\\t\\twdays = ['Domingo', 'Lunes', 'Martes', 'Miercoles',\\r\\n\\t\\t\\t\\t 'Jueves', 'Viernes', 'Sabado']\\r\\n\\t\\tfor i in range(7):\\r\\n\\t\\t\\tif wday == i: \\r\\n\\t\\t\\t\\treturn wdays[i]\",\n \"def get_day_of_week() -> str:\\n return datetime.now(pytz.timezone('US/Eastern')).strftime(\\\"%a\\\").lower()\",\n \"def day_of_week(self) -> str:\\n return self.elements[4]\",\n \"def get_weekday():\\n result = datetime.today().weekday() + 1\\n return result\",\n \"def day_of_week(self):\\n day_of_week_names = ['Monday', 'Tuesday', 'Wednesday', 'Thursday',\\n 'Friday', 'Saturday', 'Sunday']\\n diff = self.diff(Date(1, 1, 1970)) + 3\\n while diff < 0:\\n diff += 7\\n print(day_of_week_names[diff % 7])\",\n \"def day_of_week(self) -> str:\\n return pulumi.get(self, \\\"day_of_week\\\")\",\n \"def day_of_week(self) -> str:\\n return pulumi.get(self, \\\"day_of_week\\\")\",\n \"def get_day_today() -> str:\\n day = datetime.now().strftime(\\\"%w\\\")\\n if day == '0': # Sunday\\n return '6'\\n elif day == '6': # Saturday\\n return '5'\\n elif day == '1': # Monday\\n return '0'\\n elif day == '2': # Tuesday\\n return '1'\\n elif day == '3': # Wednesday\\n return '2'\\n elif day == '4': # Thursday\\n return '3'\\n elif day == '5': # Friday\\n return '4'\",\n \"def day_of_week(self):\\n # 1 Jan 0001 was Monday according to the proleptic Gregorian calendar.\\n # So, 1 Jan 0001 has ordinal 1, and the weekday is 0.\\n return (self._ordinals - 1) % 7\",\n \"def weekday(self):\\n return (self.toordinal() + 6) % 7\",\n \"def day_of_week(self) -> pulumi.Input[Union[str, 'WeekDay']]:\\n return pulumi.get(self, \\\"day_of_week\\\")\",\n \"def day_of_week(self) -> pulumi.Input[Union[str, 'WeekDay']]:\\n return pulumi.get(self, \\\"day_of_week\\\")\",\n \"def _get_next_monday(self):\\n today = datetime.date.today()\\n weekday_int = today.weekday()\\n if weekday_int == 0:\\n return today\\n next_mon = today + timedelta(7 - weekday_int)\\n return next_mon\",\n \"def weekday(day):\\n return (day % 7) - 1\",\n \"def weekday(self):\\n return 0\",\n \"def weekday(self):\\n return 0\",\n \"def day_of_the_week(arg):\",\n \"def day_of_week(date: datetime) -> str:\\n weekday = date.weekday()\\n return calendar.day_name[weekday]\",\n \"def first_monday_of_week(year, week):\\n weekyear = \\\"{} {} 1\\\".format(year, week)\\n return time.asctime(time.strptime(weekyear, \\\"%Y %U %w\\\"))\",\n \"def get_first_day_of_the_week(self):\\n if SubscriptionProduct.objects.filter(\\n subscription=self, product__weekday=1\\n ).exists():\\n return 1\\n elif SubscriptionProduct.objects.filter(\\n subscription=self, product__weekday=2\\n ).exists():\\n return 2\\n elif SubscriptionProduct.objects.filter(\\n subscription=self, product__weekday=3\\n ).exists():\\n return 3\\n elif SubscriptionProduct.objects.filter(\\n subscription=self, product__weekday=4\\n ).exists():\\n return 4\\n elif SubscriptionProduct.objects.filter(\\n subscription=self, product__weekday=5\\n ).exists():\\n return 5\\n else:\\n return 6\",\n \"def date_day_of_week(date):\\n day_of_week = date.strftime('%A')\\n return day_of_week\",\n \"def get_week_start(x: Optional[Date] = None) -> Date:\\n asof = x or get_today()\\n return asof - TimeDelta(days=(asof.isoweekday() - 1) % 7)\",\n \"def get_weekday(self):\\n originDate = Date(1900, 1, 1)\\n return WEEKDAYS[originDate.days_since(self) % 7]\",\n \"def get_weekday(self):\\n weekdays = dict(PRODUCT_WEEKDAYS)\\n return weekdays.get(self.weekday, \\\"N/A\\\")\",\n \"def get_next_monday(date):\\n return date + datetime.timedelta(days=-date.weekday(), weeks=1)\",\n \"def day(self) -> Optional[pulumi.Input[Union[str, 'WeekDay']]]:\\n return pulumi.get(self, \\\"day\\\")\",\n \"def next_sunday(day):\\n if day.weekday() == 6: # sunday\\n return day + timedelta(days=7)\\n else:\\n return day + timedelta(days=(6 - day.weekday()))\",\n \"def weekday(self):\\n if self.month is not None and self.day is not None:\\n return self.todate().weekday()\\n else:\\n return None\",\n \"def dow_1(self):\\n return self._dayoffset + 1\",\n \"def next_seven_day(self):\\n today = datetime.date.today()\\n week_next = today + datetime.timedelta(days=7)\\n return week_next.strftime('%Y-%m-%d')\",\n \"def weekday(self):\\n\\n return func.extract('dow', self.start_date) + 1\",\n \"def weekday(self) -> int:\\n return WD_EN.index(self.time.day.lower())\",\n \"def first_month_day():\\r\\n return datetime.now().replace(day=1).strftime('%d-%m-%Y')\",\n \"def weekdayname(self, date):\\n weekday = weekdayname_msgid(date.dow())\\n return translate(weekday, domain='plonelocales',\\n context=self.request, default=weekday)\",\n \"def start_day_of_weekend(self):\\n return self._start_day_of_weekend\",\n \"def day_name(self):\\n ref = Date(11, 11, 2019)\\n day_names = ['Monday', 'Tuesday', 'Wednesday', \\n 'Thursday', 'Friday', 'Saturday', 'Sunday']\\n days = self.days_between(ref)\\n self_day = day_names[days%7]\\n return self_day\",\n \"def day_name(x):\\r\\n if x==0:\\r\\n return \\\"Sunday\\\"\\r\\n elif x==1:\\r\\n return \\\"Monday\\\"\\r\\n elif x==2:\\r\\n return \\\"Tuesday\\\"\\r\\n elif x==3:\\r\\n return \\\"Wednesday\\\"\\r\\n elif x==4:\\r\\n return \\\"Thursday\\\"\\r\\n elif x==5:\\r\\n return \\\"Friday\\\"\\r\\n elif x==6:\\r\\n return \\\"Saturday\\\"\",\n \"def main():\\n print(day_of_week(datetime.now()))\\n print(day_of_week(datetime(2019, 7, 4)))\\n print(day_of_week(datetime(2013, 12, 25)))\\n print(day_of_week(datetime(2000, 1, 1)))\",\n \"def get_week_date():\\n return timezone.now()+timezone.timedelta(days=6)\",\n \"def date_week_of_year(date, *, sunday_is_first_day_of_week: bool = False):\\n if sunday_is_first_day_of_week:\\n return date.strftime(\\\"%U\\\")\\n else:\\n return date.strftime(\\\"%V\\\")\",\n \"def first_day_of_month():\\n first_object = datetime.utcnow()\\n first_string = first_object.strftime('%m/01/%Y')\\n return first_string\",\n \"def get_the_weekday(self,date):\\n date_convert = date.split('-')\\n week_days = (\\\"Monday\\\", \\\"Tuesday\\\", \\\"Wednesday\\\", \\\"Thursday\\\", \\\"Friday\\\", \\\"Saturday\\\", \\\"Sunday\\\")\\n date_list = [int(i) for i in date_convert]\\n day = datetime.date(date_list[0], date_list[1], date_list[2])\\n # convert weekday into digit (eg Mon -> 0,)\\n num_day = day.weekday()\\n day_as_string = week_days[num_day]\\n return day_as_string\",\n \"def Day_of_week(day, month, year):\\r\\n if year % 4 == 0 and (year % 400 == 0 or year % 100 != 0):\\r\\n doomsday = [11, 29, 21, 4, 9, 6, 11, 8, 5, 10, 7, 12]\\r\\n else:\\r\\n doomsday = [10, 28, 21, 4, 9, 6, 11, 8, 5, 10, 7, 12]\\r\\n exact_day = ((day - doomsday[month-1]) + Dooms_day(year)) % 7\\r\\n character_day = [\\\"Sunday\\\", \\\"Monday\\\", \\\"Tuesday\\\", \\\"Wednesday\\\", \\\"Thursday\\\", \\r\\n \\\"Friday\\\", \\\"Saturday\\\"]\\r\\n return character_day[exact_day]\",\n \"def get_next_weekend():\\n d = datetime.date.today()\\n # day 5 for saturday\\n t = datetime.timedelta((7 + 5 - d.weekday()) % 7)\\n return (d + t).strftime('%d-%m-%Y')\",\n \"def weekday(self, dt):\\n days = {\\n 0: self.MONDAY,\\n 1: self.TUESDAY,\\n 2: self.WEDNESDAY,\\n 3: self.THURSDAY,\\n 4: self.FRIDAY,\\n 5: self.SATURDAY,\\n 6: self.SUNDAY\\n }\\n return days.get(dt.weekday())\",\n \"def dow(self):\\n comparator = Date(11, 12, 2014) # known to be a 'Wednesday'\\n DOW = ['Wednesday', 'Thursday', 'Friday', 'Saturday', 'Sunday', 'Monday', 'Tuesday']\\n diff = self.diff(comparator)\\n return DOW[diff % 7]\",\n \"def isoweekday(self):\\n # 1-Jan-0001 is a Monday\\n return self.toordinal() % 7 or 7\",\n \"def date_to_dow(y, m, d):\\r\\n # Python uses Monday week start, so wrap around\\r\\n w = calendar.weekday(y, m, d) + 1\\r\\n if w == 7:\\r\\n w = 0\\r\\n return w\",\n \"def distributeWeekday(self, jan1):\\n self.firstday = jan1\\n for day in self.daylist:\\n if jan1%7 == 6 or jan1%7 == 0:\\n day.weekday = 'weekend'\\n jan1 = jan1 + 1\",\n \"def date_to_day_of_week(date):\\n return date.weekday()\",\n \"def get_weekday_number(date):\\n return date.strftime('%w')\",\n \"def GetFirstSundayOfMonth(year, month):\\n weeks = calendar.Calendar().monthdays2calendar(year, month)\\n # Return the first day in the first week that is a Sunday.\\n return [date_day[0] for date_day in weeks[0] if date_day[1] == 6][0]\",\n \"def next_weekday(weekday, d=datetime.datetime.now()):\\n if weekday.lower() not in day_values:\\n return None\\n days_ahead = day_values[weekday.lower()] - d.weekday()\\n if days_ahead <= 0: # Target day already happened this week\\n days_ahead += 7\\n return d + datetime.timedelta(days_ahead)\",\n \"def assign_numeric_day(x):\\n\\n if x == 'Sunday':\\n return 0\\n elif x == 'Monday':\\n return 1\\n elif x == 'Tuesday':\\n return 2\\n elif x == 'Wednesday':\\n return 3\\n elif x == 'Thursday':\\n return 4\\n elif x == 'Friday':\\n return 5\\n elif x == 'Saturday':\\n return 6\",\n \"def get_weekday():\\n try:\\n day = config.getint(\\\"threadbot\\\", \\\"debug_day\\\")\\n except ConfigParser.NoOptionError:\\n d = datetime.date.today()\\n day = d.weekday()\\n sort_by_new = False\\n\\n # 0 / Monday / Feedback thread\\n # 1 / Tuesday / How do I make this sound thread\\n # 2 / Wednesday / There are no stupid questions thread\\n # 3 / Thursday / Marketplace thread\\n dayname = \\\"waffles\\\"\\n if day == 0:\\n dayname = \\\"monday\\\"\\n sort_by_new = True\\n elif day == 1:\\n dayname = \\\"tuesday\\\"\\n sort_by_new = True\\n elif day == 2:\\n dayname = \\\"wednesday\\\"\\n sort_by_new = True\\n elif day == 3:\\n dayname = \\\"thursday\\\"\\n sort_by_new = False\\n else:\\n sys.exit(1) # woo inelegance\\n\\n return dayname, sort_by_new\",\n \"def meetup_day(year, month, day_of_week, day_occurrence):\\n \\n cal = calendar.monthcalendar(year, month)\\n day_of_week_index = days_of_week[day_of_week]\\n \\n not_teenth = day_occurrence != 'teenth'\\n day_is_in_first_week = cal[0][day_of_week_index] != 0\\n \\n if not_teenth and day_is_in_first_week:\\n week_index = week_indices[day_occurrence]\\n \\n elif not_teenth and not day_is_in_first_week:\\n week_index = week_indices[day_occurrence] + 1\\n \\n else:\\n for i in range(len(cal)):\\n if cal[i][day_of_week_index] >= 10:\\n week_index = i\\n break\\n\\n date = cal[week_index][day_of_week_index]\\n return datetime.date(year, month, date)\",\n \"def day_of_week(day, month, year):\\n bias = (14 - month) // 12\\n m_year = year - bias\\n mth = month + 12 * bias - 2\\n return (day + m_year + m_year // 4 - m_year // 100 + m_year // 400 + (31 * mth) // 12) % 7\",\n \"def next_day_of_week(current, day_of_week):\\n\\n while current.weekday() != day_of_week:\\n current += timedelta(1)\\n return current\",\n \"def getDay(self):\\n return _libsbml.Date_getDay(self)\",\n \"def _get_earliest_monday(self):\\n try:\\n earliest_request_date = self.org_admin.get_hours_requested().\\\\\\n order_by('usertimelog__datetime_start').first().\\\\\\n usertimelog.datetime_start\\n except:\\n earliest_request_date = self.org_admin.get_hours_approved().\\\\\\n order_by('usertimelog__datetime_start').first().\\\\\\n usertimelog.datetime_start\\n\\n earliest_monday = earliest_request_date - timedelta(\\n days=(earliest_request_date.weekday()))\\n earliest_monday = earliest_monday.replace(hour=00, minute=00, second=00)\\n\\n return earliest_monday\",\n \"def weekday_name(day_of_week):\\n\\n weekday_names = [\\n 'Sunday', \\n 'Monday', \\n 'Tuesday', \\n 'Wednesday', \\n 'Thursday', \\n 'Friday', \\n 'Saturday']\\n \\n if day_of_week < 1 or day_of_week > 7:\\n return 'None! Sowwy.'\\n\\n if day_of_week == 1:\\n print(weekday_names[0])\\n if day_of_week == 2:\\n print(weekday_names[1])\\n if day_of_week == 3:\\n print(weekday_names[2])\\n if day_of_week == 4:\\n print(weekday_names[3])\\n if day_of_week == 5:\\n print(weekday_names[4])\\n if day_of_week == 6:\\n print(weekday_names[5]) \\n if day_of_week == 7:\\n print(weekday_names[6])\",\n \"def get_next_weekday(date, weekday):\\n return date + dt.timedelta(days=(weekday - date.weekday() + 7) % 7)\",\n \"def get_trip_day_weekday(self):\\n\\n days = {\\\"Lundi\\\":'1', \\\"Mardi\\\":'2', \\\"Mercredi\\\":'3', \\\"Jeudi\\\":'4', \\\"Vendredi\\\":'5', \\\"Samedi\\\":'6', \\\"Dimanche\\\":'7'}\\n\\n return int(days[dict(self.TRIP_DAY_SELECTIONS)[self.trip_day]])\",\n \"def __str__(self):\\n return self.day_of_week\",\n \"def format_weekday(time):\\n return time.strftime(\\\"%A\\\").lower()\",\n \"def week(start_day=\\\"monday\\\"):\\r\\n today = datetime.datetime.combine(datetime.date.today(), datetime.datetime.min.time())\\r\\n weekday = today.weekday()\\r\\n week = list(calendar.Calendar(getattr(calendar, start_day.upper())).iterweekdays())\\r\\n pos = week.index(weekday)\\r\\n week_stamp = (to_stamp(today - datetime.timedelta(days=pos - i)) for i, d in enumerate(week))\\r\\n return collections.OrderedDict(((calendar.day_name[a], (b, b + DAY)) for a, b in zip(week, week_stamp)))\",\n \"def WEEKDAY(\\n serial_number: func_xltypes.XlNumber,\\n return_type: func_xltypes.XlNumber = None\\n) -> func_xltypes.XlNumber:\\n\\n date = utils.number_to_datetime(int(serial_number))\\n\\n if return_type is None:\\n # Numbers 1 (Sunday) through 7 (Saturday)\\n weekDays = (2, 3, 4, 5, 6, 7, 1)\\n return weekDays[date.weekday()]\\n\\n elif int(return_type) == 1:\\n # Numbers 1 (Sunday) through 7 (Saturday)\\n weekDays = (2, 3, 4, 5, 6, 7, 1)\\n return weekDays[date.weekday()]\\n\\n # weekday() is 0 based, starting on a Monday\\n elif int(return_type) == 2:\\n # Numbers 1 (Monday) through 7 (Sunday)\\n weekDays = (1, 2, 3, 4, 5, 6, 7)\\n return weekDays[date.weekday()]\\n\\n elif int(return_type) == 3:\\n # Numbers 0 (Monday) through 6 (Sunday)\\n weekDays = (0, 1, 2, 3, 4, 5, 6)\\n return weekDays[date.weekday()]\\n\\n elif int(return_type) == 11:\\n # Numbers 1 (Monday) through 7 (Sunday)\\n weekDays = (1, 2, 3, 4, 5, 6, 7)\\n return weekDays[date.weekday()]\\n\\n elif int(return_type) == 12:\\n # Numbers 1 (Tuesday) through 7 (Monday)\\n weekDays = (7, 1, 2, 3, 4, 5, 6)\\n return weekDays[date.weekday()]\\n\\n elif int(return_type) == 13:\\n # Numbers 1 (Wednesday) through 7 (Tuesday)\\n weekDays = (6, 7, 1, 2, 3, 4, 5)\\n return weekDays[date.weekday()]\\n\\n elif int(return_type) == 14:\\n # Numbers 1 (Thursday) through 7 (Wednesday)\\n weekDays = (5, 6, 7, 1, 2, 3, 4)\\n return weekDays[date.weekday()]\\n\\n elif int(return_type) == 15:\\n # Numbers 1 (Friday) through 7 (Thursday)\\n weekDays = (4, 5, 6, 7, 1, 2, 3)\\n return weekDays[date.weekday()]\\n\\n elif int(return_type) == 16:\\n # Numbers 1 (Saturday) through 7 (Friday)\\n weekDays = (3, 4, 5, 6, 7, 1, 2)\\n return weekDays[date.weekday()]\\n\\n elif int(return_type) == 17:\\n # Numbers 1 (Sunday) through 7 (Saturday)\\n weekDays = (2, 3, 4, 5, 6, 7, 1)\\n return weekDays[date.weekday()]\\n\\n else:\\n raise xlerrors.NumExcelError(\\n f\\\"return_type needs to be omitted or one of 1, 2, 3, 11, 12, 13,\\\\\\n 14, 15, 16 or 17. You supplied {return_type}\\\")\",\n \"def week(self):\\n J = self.JulianDay()\\n d4 = (J + 31741 - (J % 7)) % 146097 % 36524 % 1461\\n L = d4 // 1460\\n d1 = ((d4 - L) % 365) + L\\n return d1 // 7 + 1\",\n \"def dayname(self):\\n return self.strftime(\\\"%A\\\")\",\n \"def get_this_week_label(self):\\n return gettext_lazy('This week')\",\n \"def get_today_week_number(self):\\n\\n today = date.today()\\n iso_result = today.isocalendar()\\n return iso_result[1]\",\n \"def WEEKDAY(date, return_type=1):\\n if return_type not in _weekday_type_map:\\n raise ValueError(\\\"Invalid return type %s\\\" % (return_type,))\\n (first, index) = _weekday_type_map[return_type]\\n return (_make_datetime(date).weekday() - first) % 7 + index\",\n \"def find_date(startdate, weekday, weeknumber):\\n import datetime\\n # The +1 makes this match up with linux times (day 1 = Monday)\\n daysahead = weekday - (startdate.weekday() + 1)\\n if daysahead < 0:\\n # Target day already happened this week\\n daysahead += 7\\n # Add 7 days for each Week Of Month we want - but 'This' week is week 1\\n daysahead += 7 * (weeknumber - 1)\\n return startdate + datetime.timedelta(daysahead)\",\n \"def week(self):\\n if self._week.lower() == 'wild card':\\n return WILD_CARD\\n if self._week.lower() == 'division':\\n return DIVISION\\n if self._week.lower() == 'conf. champ.':\\n return CONF_CHAMPIONSHIP\\n if self._week.lower() == 'superbowl':\\n return SUPER_BOWL\\n return self._week\",\n \"def weekly():\",\n \"def next_weekday(date, weekday):\\n delta = weekday - date.weekday()\\n if delta < 0:\\n delta += 7\\n return date + timedelta(days=int(delta))\",\n \"def formatWeekDay(self, day):\\n return '<th class=\\\"day\\\">%s</th>' % day_abbr[day]\",\n \"def format_dow(value):\\n if value:\\n return [\\n 'Sunday',\\n 'Monday',\\n 'Tuesday',\\n 'Wednesday',\\n 'Thursday',\\n 'Friday',\\n 'Saturday',\\n ][value]\\n else:\\n return 'N/A'\",\n \"def day_num(x):\\r\\n if x==\\\"Sunday\\\":\\r\\n return 0\\r\\n elif x==\\\"Monday\\\":\\r\\n return 1\\r\\n elif x==\\\"Tuesday\\\":\\r\\n return 2\\r\\n elif x==\\\"Wednesday\\\":\\r\\n return 3\\r\\n elif x==\\\"Thursday\\\":\\r\\n return 4\\r\\n elif x==\\\"Friday\\\":\\r\\n return 5\\r\\n elif x==\\\"Saturday\\\":\\r\\n return 6\",\n \"def dayofweek(self) -> Index:\\n warnings.warn(\\n \\\"`dayofweek` will return int32 index instead of int 64 index in 4.0.0.\\\",\\n FutureWarning,\\n )\\n return Index(self.to_series().dt.dayofweek)\",\n \"def dayofweek(day, month, year, formatresult=True):\\n if formatresult is False:\\n return calendar.weekday(year, month, day) + 1\\n days = {\\n 0: 'Monday',\\n 1: \\\"Tuesday\\\",\\n 2: \\\"Wednesday\\\",\\n 3: \\\"Thursday\\\",\\n 4: \\\"Friday\\\",\\n 5: \\\"Saturday\\\",\\n 6: \\\"Sunday\\\"\\n }\\n return days[calendar.weekday(year, month, day)]\",\n \"def weekday(self, *args, **kwargs): # real signature unknown\\r\\n pass\",\n \"def first_day_of_month(date):\\n return date.replace(day=1)\",\n \"def first_day_of_month(date):\\n return date.replace(day=1)\",\n \"def date_form(day):\\r\\n new_day = \\\"\\\"\\r\\n if day == \\\"Monday\\\":\\r\\n new_day = \\\"Poniedziałek\\\"\\r\\n elif day == \\\"Tuesday\\\":\\r\\n new_day = \\\"Wtorek\\\"\\r\\n elif day == \\\"Wednesday\\\":\\r\\n new_day = \\\"Środa\\\"\\r\\n elif day == \\\"Thursday\\\":\\r\\n new_day = \\\"Czwartek\\\"\\r\\n elif day == \\\"Friday\\\":\\r\\n new_day = \\\"Piątek\\\"\\r\\n elif day == \\\"Saturday\\\":\\r\\n new_day = \\\"Sobota\\\"\\r\\n elif day == \\\"Sunday\\\":\\r\\n new_day = \\\"Niedziela\\\"\\r\\n return new_day\",\n \"def week_init():\\n week = input('Week to check: MM/DD/YYYY\\\\n')\\n week = dtt.datetime.strptime(week,'%m/%d/%Y') #turns input to a datetime\\n beforeday = input('Check days before date (Press enter to use today): MM/DD/YYYY\\\\n') or dtt.date.today()\\n if (beforeday != dtt.date.today()):\\n beforeday = dtt.datetime.strptime(beforeday,'%m/%d/%Y')\\n return week, beforeday\",\n \"def day_07_b() -> int:\\n return 0\",\n \"def getOneDay(self,day_number=0):\\n return self.event_time_sequence[day_number]\",\n \"def DayOfWeek(year, month, day):\\n num = year * 365\\n num = num + year // 4 + 1\\n num = num - (year // 100 + 1)\\n num = num + year // 400 + 1\\n if month < 3 and LeapYear(year):\\n num = num - 1\\n return (num + MONTH_OFFSETS[month - 1] + day + 4) % 7 + 1\",\n \"def get_current_day_week_number(week_delta=0):\\n return (datetime.today() + timedelta(weeks=week_delta)).isocalendar()[1]\",\n \"def day_07_a() -> int:\\n return 0\",\n \"def days_of_the_week(self) -> Optional[pulumi.Input[Sequence[pulumi.Input[Union[str, 'DayOfWeek']]]]]:\\n return pulumi.get(self, \\\"days_of_the_week\\\")\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.7771828","0.7742936","0.7577031","0.75041586","0.74610543","0.74022716","0.74017537","0.7226098","0.715162","0.71447414","0.7032424","0.69580626","0.68952614","0.6892024","0.6892024","0.6819581","0.6817187","0.6786361","0.67820686","0.67820686","0.67739815","0.6772486","0.6748926","0.6748926","0.6729732","0.67196107","0.6719052","0.6707428","0.669348","0.6691228","0.6655274","0.66373277","0.6631656","0.6577313","0.65757084","0.6570707","0.65643585","0.6551987","0.65515757","0.65436834","0.6510603","0.6483161","0.6477809","0.64646626","0.6453292","0.6426419","0.63563794","0.63525856","0.63353413","0.63317156","0.63024795","0.63016605","0.62984246","0.6288423","0.6285493","0.6273741","0.62495583","0.6221345","0.62168336","0.6209232","0.6201185","0.61978763","0.6197852","0.6195678","0.61954254","0.61921555","0.61831224","0.6169908","0.6139091","0.6132008","0.61015975","0.6074397","0.60736555","0.60684794","0.60671055","0.604498","0.6007471","0.5978471","0.595789","0.5954382","0.5939457","0.5935921","0.5928186","0.5927785","0.59254557","0.59235096","0.5922619","0.59103566","0.58998567","0.58700246","0.5854158","0.5854158","0.58516204","0.5850265","0.58484024","0.58455324","0.5842351","0.58400804","0.5831603","0.581228"],"string":"[\n \"0.7771828\",\n \"0.7742936\",\n \"0.7577031\",\n \"0.75041586\",\n \"0.74610543\",\n \"0.74022716\",\n \"0.74017537\",\n \"0.7226098\",\n \"0.715162\",\n \"0.71447414\",\n \"0.7032424\",\n \"0.69580626\",\n \"0.68952614\",\n \"0.6892024\",\n \"0.6892024\",\n \"0.6819581\",\n \"0.6817187\",\n \"0.6786361\",\n \"0.67820686\",\n \"0.67820686\",\n \"0.67739815\",\n \"0.6772486\",\n \"0.6748926\",\n \"0.6748926\",\n \"0.6729732\",\n \"0.67196107\",\n \"0.6719052\",\n \"0.6707428\",\n \"0.669348\",\n \"0.6691228\",\n \"0.6655274\",\n \"0.66373277\",\n \"0.6631656\",\n \"0.6577313\",\n \"0.65757084\",\n \"0.6570707\",\n \"0.65643585\",\n \"0.6551987\",\n \"0.65515757\",\n \"0.65436834\",\n \"0.6510603\",\n \"0.6483161\",\n \"0.6477809\",\n \"0.64646626\",\n \"0.6453292\",\n \"0.6426419\",\n \"0.63563794\",\n \"0.63525856\",\n \"0.63353413\",\n \"0.63317156\",\n \"0.63024795\",\n \"0.63016605\",\n \"0.62984246\",\n \"0.6288423\",\n \"0.6285493\",\n \"0.6273741\",\n \"0.62495583\",\n \"0.6221345\",\n \"0.62168336\",\n \"0.6209232\",\n \"0.6201185\",\n \"0.61978763\",\n \"0.6197852\",\n \"0.6195678\",\n \"0.61954254\",\n \"0.61921555\",\n \"0.61831224\",\n \"0.6169908\",\n \"0.6139091\",\n \"0.6132008\",\n \"0.61015975\",\n \"0.6074397\",\n \"0.60736555\",\n \"0.60684794\",\n \"0.60671055\",\n \"0.604498\",\n \"0.6007471\",\n \"0.5978471\",\n \"0.595789\",\n \"0.5954382\",\n \"0.5939457\",\n \"0.5935921\",\n \"0.5928186\",\n \"0.5927785\",\n \"0.59254557\",\n \"0.59235096\",\n \"0.5922619\",\n \"0.59103566\",\n \"0.58998567\",\n \"0.58700246\",\n \"0.5854158\",\n \"0.5854158\",\n \"0.58516204\",\n \"0.5850265\",\n \"0.58484024\",\n \"0.58455324\",\n \"0.5842351\",\n \"0.58400804\",\n \"0.5831603\",\n \"0.581228\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.6687542"},"document_rank":{"kind":"string","value":"30"}}},{"rowIdx":6095,"cells":{"query":{"kind":"string","value":"Returns the q'th percentile of the distribution given in the argument 'data'. Uses the 'precision' parameter to control the noise level."},"document":{"kind":"string","value":"def Quantile(data, q, precision=1.0):\n N, bins = np.histogram(data, bins=precision*np.sqrt(len(data)))\n norm_cumul = 1.0*N.cumsum() / len(data)\n\n for i in range(0, len(norm_cumul)):\n if norm_cumul[i] > q:\n return bins[i]"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["def Quartiles(data):\n q = np.percentile(data, [25, 50, 75])\n\n return q[0], q[1], q[2]","def test__quantile(self):\r\n # regular cases\r\n sample_data = array(range(25, 42))\r\n assert_almost_equal(_quantile(sample_data, 0.5), median(sample_data))\r\n\r\n # sorted data is assumed for this function\r\n sample_data = sorted(\r\n array([0.17483293, 0.99891939, 0.81377467, 0.8137437,\r\n 0.51990174, 0.35521497, 0.98751461]))\r\n assert_almost_equal(_quantile(sample_data, 0.10), 0.283062154)","def prctile(data, p_vals=[0, 25, 50, 75, 100], sorted_=False):\r\n ps = [p_vals] if np.isscalar(p_vals) else p_vals\r\n\r\n if not sorted_:\r\n data = sorted(data)\r\n n = len(data)\r\n d = []\r\n for p in ps:\r\n fi = p * n / 100 - 0.5\r\n if fi <= 0: # maybe extrapolate?\r\n d.append(data[0])\r\n elif fi >= n - 1:\r\n d.append(data[-1])\r\n else:\r\n i = int(fi)\r\n d.append((i+1 - fi) * data[i] + (fi - i) * data[i+1])\r\n return d[0] if np.isscalar(p_vals) else d","def get_percentile(self, q):\n return None","def get_percentile(self, q):\n return None","def quantile(x, p):\n sorted_x = sorted(x)\n # round p_index to base int\n p_index = int(p * len(x))\n return sorted_x[p_index]","def calcrange_quartile(data, log=False):\n if not isinstance(data, numpy.ndarray):\n data = numpy.array(data)\n if log:\n data = data[data > 0.]\n\n if len(data) == 0:\n if log: return 0.1, 1.\n else: return 0., 1.\n\n data = numpy.sort(data)\n q1 = data[int(math.floor(0.25*len(data)))]\n q3 = data[int(math.floor(0.75*len(data)))]\n if log:\n return q1 / (q3 - q1), q3 * (q3 - q1)\n else:\n return q1 - (q3 - q1), q3 + (q3 - q1)","def quantile(x,p):\n p_index = int(p*len(x))\n return sorted(x)[p_index]","def quantile(x, p):\n p_index = int(p * len(x))\n return sorted(x)[p_index]","def quantile(x, p):\n p_index = int(p * len(x))\n return sorted(x)[p_index]","def quantile(x, p):\n p_index = int(p * len(x))\n return sorted(x)[p_index]","def IQR(data):\n return percentile(data, 75) - percentile(data, 25)","def quantile(xs: List[float], p: float) -> float:\n p_index = int(p * len(xs))\n return sorted(xs)[p_index]","def default_quantile():\n return np.logspace(-5, 0, 100)","def get_percentile(self, q):\n return self.sum_stat_sample_ratio.get_percentile(q)","def percentile(t: torch.tensor, q: float):\n # Note that ``kthvalue()`` works one-based, i.e. the first sorted value\n # indeed corresponds to k=1, not k=0! Use float(q) instead of q directly,\n # so that ``round()`` returns an integer, even if q is a np.float32.\n k = 1 + round(.01 * float(q) * (t.numel() - 1))\n result = t.view(-1).kthvalue(k).values.item()\n return result","def get_percentile(self, q):\n return self.sum_stat_sample_delta.get_percentile(q)","def percentile(field, q):\n # https://gist.github.com/spezold/42a451682422beb42bc43ad0c0967a30\n # Note that ``kthvalue()`` works one-based, i.e. the first sorted value\n # indeed corresponds to k=1, not k=0! Use float(q) instead of q directly,\n # so that ``round()`` returns an integer, even if q is a np.float32.\n k = 1 + round(.01 * float(q) * (field.shape[1] - 1))\n result = field.kthvalue(k, dim=1).values\n return result","def _quantile(data, quantile):\r\n index = quantile * (len(data) - 1)\r\n bottom_index = int(floor(index))\r\n top_index = int(ceil(index))\r\n\r\n difference = index - bottom_index\r\n output = (1 - difference) * \\\r\n data[bottom_index] + difference * data[top_index]\r\n\r\n return output","def get_percentile(self, q):\n raise NotImplementedError(\"This is an abstract method and needs to be implemented in derived classes.\")","def test_profiled_quantiles(self):\n\n # this data has 4 bins, range of 3\n # with equal bin size, each bin has the width of 0.75\n\n data = [\"1.0\", \"2.0\", \"3.0\", \"4.0\"]\n df = pd.Series(data)\n profiler = FloatColumn(df.name)\n profiler.update(df)\n profile = profiler.profile\n\n est_quartiles = profile['quantiles']\n est_Q1 = est_quartiles[249]\n est_Q2 = est_quartiles[499]\n est_Q3 = est_quartiles[749]\n\n data_to_num = [float(item) for item in data]\n exact_Q1 = np.percentile(data_to_num, 25)\n exact_Q2 = np.percentile(data_to_num, 50)\n exact_Q3 = np.percentile(data_to_num, 75)\n\n self.assertEqual(est_Q1, exact_Q1)\n self.assertEqual(est_Q2, exact_Q2)\n self.assertEqual(est_Q3, exact_Q3)","def get_quartile_data(cls, data: tuple or list) -> tuple:\n cls._data_validation(data)\n # Sort the data\n sorted_data = sorted(list(data))\n # Get q2, which is the median\n q2 = cls.get_median(data)\n first_half_data = list()\n second_half_data = list()\n # add to first half until median, then add to second half\n for i in range(len(sorted_data)):\n # if less than q2, first half\n if sorted_data[i] < q2:\n first_half_data.append(sorted_data[i])\n # if greather than q2, second half, skips q2\n elif sorted_data[i] > q2:\n second_half_data.append(sorted_data[i])\n # use median method on halves to get quartiles\n q1 = cls.get_median(first_half_data)\n q3 = cls.get_median(second_half_data)\n iqr = q3-q1\n return q1, q2, q3, iqr","def test_valid_calculation_of_quantile(alpha: Any) -> None:\n n = 30\n check_alpha_and_n_samples(alpha, n)","def test_quantile(self):\r\n\r\n # suffle the data to be sure, it is getting sorted\r\n sample_data = array(range(1, 11))\r\n shuffle(sample_data)\r\n\r\n # regular cases\r\n expected_output = [1.9, 2.8, 3.25, 5.5, 7.75, 7.93]\r\n list_of_quantiles = [0.1, 0.2, 0.25, 0.5, 0.75, 0.77]\r\n output = quantile(sample_data, list_of_quantiles)\r\n assert_almost_equal(expected_output, output)\r\n\r\n sample_data = array([42, 32, 24, 57, 15, 34, 83, 24, 60, 67, 55, 17,\r\n 83, 17, 80, 65, 14, 34, 39, 53])\r\n list_of_quantiles = [0.5]\r\n output = quantile(sample_data, list_of_quantiles)\r\n assert_almost_equal(output, median(sample_data))\r\n\r\n # quantiles must be between [0, 1]\r\n with self.assertRaises(AssertionError):\r\n output = quantile(sample_data, [0.1, 0.2, -0.1, 2, 0.3, 0.5])\r\n\r\n # quantiles must be a list or a numpy array\r\n with self.assertRaises(AssertionError):\r\n output = quantile(sample_data, 1)\r\n\r\n # the data must be a list or a numpy array\r\n with self.assertRaises(AssertionError):\r\n output = quantile(1, [0])","def _percentile(self, data, percent):\n if not data:\n return None\n k = (len(data) - 1) * percent\n f = math.floor(k)\n c = math.ceil(k)\n if f == c:\n return data[int(k)]\n d0 = data[int(f)] * (c - k)\n d1 = data[int(c)] * (k - f)\n return d0 + d1","def quantile(a, prob):\n a=numpy.asanyarray(a)\n a=a[numpy.logical_not(numpy.isnan(a))].ravel()\n n=a.size\n\n if prob>=1-.5/n:\n return a.max()\n elif prob<=.5/n:\n return a.min()\n\n # find the two bounds we're interpreting between:\n # that is, find i such that (i+.5) / n <= prob <= (i+1.5)/n\n t=n*prob-.5\n i=int(t)\n\n # partial sort so that the ith element is at position i, with bigger ones\n # to the right and smaller to the left\n a.sort()\n\n if i==t: # did we luck out and get an integer index?\n return a[i]\n else:\n # we'll linearly interpolate between this and the next index\n smaller=a[i]\n larger=a[i+1:].min()\n if numpy.isinf(smaller):\n return smaller # avoid inf - inf\n return smaller+(larger-smaller)*(t-i)","def get_quartile_data(cls, data: tuple or list) -> tuple:\n cls._data_validation(data)\n from math import floor\n # Sort the data\n n = cls.get_n(data)\n if n == 0:\n # Empty dataset, returns zeroes\n return 0, 0, 0, 0\n sorted_data = sorted(list(data))\n n_is_odd = True if n % 2 == 1 else False\n\n # Get middle index\n odd_middle_index = floor(n / 2)\n even_upper_index = floor(n / 2)\n even_lower_index = floor(n / 2) - 1\n\n # Get q2, which is the median\n q2 = cls.get_median(data)\n first_half_data = list()\n second_half_data = list()\n\n # add to first half until median, then add to second half\n if n_is_odd:\n for i in range(n):\n if i < odd_middle_index:\n first_half_data.append(sorted_data[i])\n # note how if index = middle_index, skips\n elif i > odd_middle_index:\n second_half_data.append(sorted_data[i])\n else:\n for i in range(n):\n if i <= even_lower_index:\n first_half_data.append(sorted_data[i])\n # note how if index = middle_index, skips\n else:\n second_half_data.append(sorted_data[i])\n # use median method on halves to get quartiles\n q1 = cls.get_median(first_half_data)\n q3 = cls.get_median(second_half_data)\n iqr = q3 - q1\n return q1, q2, q3, iqr","def quartiles(x, percentile):\n length = len(x)\n\n if percentile == 25:\n center = length // 4\n elif percentile == 75:\n center = length // 2 + length // 4\n\n x.sort()\n\n if length % 2 == 0:\n return (x[center - 1] + x[center]) / 2\n else:\n return x[center]","def get_percentile(before, level):\n snr = np.array(before.getColumnByName('snr')[:])\n return np.percentile(snr, level)","def quantile_func(q):\n def f(x):\n return np.quantile(x, q)\n\n return f","def percentile_filter(data, feats):\n\n # Determines the fraction of nonzero values in the data.\n sparsity_frac = feats['nonzeros'] / (feats['nrows'] * feats['ncols'])\n\n # NOTE: Added convenience term derived from experience.\n thresh = np.percentile(data.ravel(), q=100 * (1 - (sparsity_frac + 0.1)))\n\n # Replace p-values below threshold with zero.\n data[(data > 0) & (data < thresh)] = 0\n\n return data","def torch_percentile(t, q):\n # Note that ``kthvalue()`` works one-based, i.e. the first sorted value\n # indeed corresponds to k=1, not k=0! Use float(q) instead of q directly,\n # so that ``round()`` returns an integer, even if q is a np.float32.\n k = 1 + round(.01 * float(q) * (t.numel() - 1))\n result = t.view(-1).kthvalue(k).values.item()\n return result","def percentile(p):\n assert 1.0 > p >= 0.0\n\n def __p1(ls):\n k = math.floor(len(ls) * p)\n assert k >= 0\n assert k < len(ls)\n\n start = 0\n end = len(ls) - 1\n\n while start <= end:\n pivot_index = start\n pivot_val = ls[pivot_index]\n\n for i in range(pivot_index + 1, end + 1):\n if ls[i] >= pivot_val:\n continue\n else:\n ls[pivot_index] = ls[i]\n pivot_index += 1\n ls[i] = ls[pivot_index]\n\n ls[pivot_index] = pivot_val\n if pivot_index == k:\n return pivot_val\n elif pivot_index > k:\n end = pivot_index - 1\n else:\n start = pivot_index + 1\n\n return ls[start]\n\n return __p1","def median(data, weights):\n return quantile(data, weights, 0.5)","def test_lots_of_percentiles(self):\n data = np.array(\n [\n [[14.4, -46, 10.2], [-73.0, -46, -89.2], [-89.2, -93.25, -94.6]],\n [[19.2, 8.25, 10.6], [-19, 8.25, -67.6], [-67.6, -79.75, -83.8]],\n [[24.0, 8.75, 11.0], [8.33333, 8.75, -46.0], [-46.0, -66.25, -73.0]],\n [[28.8, 9.25, 11.4], [9.0, 9.25, -24.4], [-24.4, -52.75, -62.2]],\n [[33.6, 9.75, 11.8], [9.666667, 9.75, -2.8], [-2.8, -39.25, -51.4]],\n [\n [38.4, 10.333333, 16.8],\n [10.333333, 10.2, 8.5],\n [8.333333, -25.75, -40.6],\n ],\n [[43.2, 11.0, 26.4], [11.0, 10.6, 9.5], [9.0, -12.25, -29.8]],\n [\n [48.0, 11.666667, 36.0],\n [11.666667, 11.0, 10.5],\n [9.666667, 1.25, -19.0],\n ],\n [[52.8, 24, 45.6], [24, 11.4, 11.5], [10.5, 8.5, -8.2]],\n [[57.6, 48, 55.2], [48, 11.8, 36.0], [11.5, 9.5, 2.6]],\n ],\n dtype=np.float32,\n )\n\n percentiles = np.arange(5, 100, 10)\n result = Plugin()._probabilities_to_percentiles(self.cube, percentiles)\n self.assertArrayAlmostEqual(result.data, data, decimal=5)","def calc_stats(data):\n x = np.asarray(data, np.float)\n vals_min = np.min(x)\n vals_max = np.max(x)\n q2 = np.percentile(x, 50, interpolation='linear')\n q1 = np.percentile(x, 25, interpolation='lower')\n q3 = np.percentile(x, 75, interpolation='higher')\n iqr = q3 - q1\n whisker_dist = 1.5 * iqr\n\n # in order to prevent drawing whiskers outside the interval\n # of data one defines the whisker positions as:\n d1 = np.min(x[x >= (q1 - whisker_dist)])\n d2 = np.max(x[x <= (q3 + whisker_dist)])\n return {\n 'min': vals_min,\n 'max': vals_max,\n 'q1': q1,\n 'q2': q2,\n 'q3': q3,\n 'd1': d1,\n 'd2': d2\n }","def p(n):\n def p_(x):\n return np.percentile(x, n)\n\n p_.__name__ = \"p_%s\" % n\n return p_","def quantile(agg, k=4, name='quantile'):\n\n w = 100.0 / k\n p = np.arange(w, 100 + w, w)\n\n if p[-1] > 100.0:\n p[-1] = 100.0\n\n q = np.array([stats.scoreatpercentile(agg.data, pct) for pct in p])\n q = np.unique(q)\n k_q = len(q)\n\n if k_q < k:\n print(\"Quantile Warning: Not enough unique values for k classes (using {} bins)\".format(k_q))\n\n return DataArray(_bin(agg.data, q, np.arange(k_q)),\n name=name,\n dims=agg.dims,\n coords=agg.coords,\n attrs=agg.attrs)","def dp_quantile(data, alpha, candidates=None, lower=None, upper=None, mechanism=\"Automatic\", privacy_usage=None, interpolation=\"midpoint\", **kwargs):\n return Component(\n \"DPQuantile\",\n arguments={\n 'data': Component.of(data),\n 'candidates': Component.of(candidates),\n 'lower': Component.of(lower),\n 'upper': Component.of(upper)\n },\n options={\n 'alpha': alpha,\n 'mechanism': mechanism,\n 'privacy_usage': serialize_privacy_usage(privacy_usage),\n 'interpolation': interpolation\n },\n constraints=kwargs)","def _get_percentile_cutoff(data, cutoff=None, percentile=None, required=False):\n if percentile is not None:\n if cutoff is not None:\n raise ValueError(\n \"Only one of `cutoff` and `percentile` should be given.\"\n \"Got cutoff={}, percentile={}\".format(cutoff, percentile)\n )\n if not isinstance(percentile, numbers.Number):\n return [_get_percentile_cutoff(data, percentile=p) for p in percentile]\n if percentile < 1:\n warnings.warn(\n \"`percentile` expects values between 0 and 100.\"\n \"Got {}. Did you mean {}?\".format(percentile, percentile * 100),\n UserWarning,\n )\n cutoff = np.percentile(np.array(data).reshape(-1), percentile)\n elif cutoff is None and required:\n raise ValueError(\"One of either `cutoff` or `percentile` must be given.\")\n return cutoff","def kernel_quantile_heuristic(X, q=0.5):\n pairwise_sq_dists = pdist(X, 'sqeuclidean')\n quantile_heuristic_s2 = np.quantile(pairwise_sq_dists, q=q)\n return quantile_heuristic_s2","def test_check_data_specifying_percentiles(self):\n expected_data = np.array(\n [self.percentile_25, self.percentile_50, self.percentile_75]\n )\n result = Plugin().process(self.cube, percentiles=[25, 50, 75])\n self.assertArrayAlmostEqual(result.data, expected_data, decimal=5)","def transfo_quantile(xx):\n\n # nn = np.zeros(len(xx))\n # oo = np.argsort(xx)\n # nn[oo] = np.arange(len(xx)) / len(xx) + 1 / (2 * len(xx))\n # return nn\n\n return rankdata(xx) / len(xx) - 1 / (2 * len(xx))","def test_check_data_specifying_no_of_percentiles(self):\n expected_data = np.array(\n [self.percentile_25, self.percentile_50, self.percentile_75]\n )\n result = Plugin().process(self.cube, no_of_percentiles=3)\n self.assertArrayAlmostEqual(result.data, expected_data, decimal=5)","def test_check_data_specifying_single_percentile(self):\n expected_data = np.array(self.percentile_25)\n result = Plugin().process(self.cube, percentiles=[25])\n self.assertArrayAlmostEqual(result.data, expected_data, decimal=5)","def matlab_percentile(in_data, percentiles):\n data = np.sort(in_data)\n p_rank = 100.0 * (np.arange(data.size) + 0.5) / data.size\n perc = np.interp(percentiles, p_rank, data, left=data[0], right=data[-1])\n return perc","def kempton_taylor_q(counts, lower_quantile=.25, upper_quantile=.75):\n n = len(counts)\n lower = int(ceil(n*lower_quantile))\n upper = int(n*upper_quantile)\n sorted = counts.copy()\n sorted.sort()\n return (upper-lower)/log(sorted[upper]/sorted[lower])","def normalizeprctile(expdat,percent=80):\n\tparams=locals()\n\n\t# select the bacteria to use - don't want to include very low freq. bacteria\n\tnewexp=hs.filterminreads(expdat,1*len(expdat.samples))\n\n\tpercvals=np.percentile(newexp.data,percent,axis=0)\n#\tplt.figure()\n#\tplt.plot(percvals)\n\tpercvals=percvals/np.mean(percvals)\n\tnewexp=hs.copyexp(expdat)\n\tfor idx,samp in enumerate(expdat.samples):\n\t\tnewexp.data[:,idx]=newexp.data[:,idx]*percvals[idx]\n\tnewexp.filters.append(\"normalize percentile %f\" % percent)\n\ths.addcommand(newexp,\"normalizeprctile\",params=params,replaceparams={'expdat':expdat})\n\n\treturn newexp","def trimean(data):\n p_25, p_50, p_75 = percentile(data, [25, 50, 75], axis=0)\n\n return (p_25 + 2 * p_50 + p_75) / 4","def get_percentile(data_list, score, kind='weak'):\n n = len(data_list)\n\n if kind == 'strict':\n return len([i for i in data_list if i < score]) / float(n) * 100\n elif kind == 'weak':\n return len([i for i in data_list if i <= score]) / float(n) * 100\n elif kind == 'mean':\n return (len([i for i in data_list if i < score]) + len([i for i in data_list if i <= score])) * 50 / float(n)\n else:\n raise ValueError(\"The kind kwarg must be 'strict', 'weak' or 'mean'. You can also opt to leave it out and rely on the default method.\")","def quantileValues(data, device):\n r = pd.DataFrame([])\n if isinstance(data, pd.DataFrame) or isinstance(data, pd.Series):\n minValue = data.min()\n maxValue = data.max()\n q1 = data.quantile(0.25)\n # q2 = tmp['deltaSeconds'].quantile(0.5)\n q3 = data.quantile(0.75)\n QR = q3 - q1\n upper = 1.5 * QR + q3\n lower = q1 - 1.5 * QR\n\n elif isinstance(data, np.ndarray):\n minValue = data.min()\n maxValue = data.max()\n q1 = np.percentile(data, 25)\n # q2 = np.percentile(data, 50)\n q3 = np.percentile(data, 75)\n QR = q3 - q1\n upper = 1.5 * QR + q3\n lower = q1 - 1.5 * QR\n r = (r.append(pd.DataFrame({'mac': device.mac, 'minValue': minValue,\n 'maxValue': maxValue, 'lower': lower,\n 'upper': upper, 'q1': q1, 'q3': q3},\n index=[0]), ignore_index=True))\n return r","def percentile(scores, student_score):\n scores = np.array(sorted(scores))\n num_scores = len(scores)\n return round(sum(scores <= student_score) / float(num_scores) * 100, 2)","def percentile(data, statfxn, niter=10000, alpha=0.05):\n\n index = _make_boot_index(data.shape[0], niter)\n boot_stats = statfxn(data[index], axis=-1)\n\n # compute the `alpha/2` and `1-alpha/2` percentiles of `boot_stats`\n CI = numpy.percentile(boot_stats, [alpha * 50, 100 - (alpha * 50)], axis=0)\n\n return CI","def PrivateQuantile(Z, q, eps, xmin, xmax):\n\n N = len(Z)\n m = np.floor((N - 1) * q + 1.5)\n Z[Z < xmin] = xmin\n Z[Z > xmax] = xmax\n Z_dict = {i: Z[i - 1] for i in range(1, len(Z) + 1)}\n Z_dict[0] = np.min(Z) # see Du et al, I found Smith confusing\n Z_dict[len(Z) + 1] = np.max(Z) # see Du et al, I found Smith confusing\n\n ps = []\n prob_sum = 0\n\n for i in range(len(Z) + 1):\n # p_i = (Z_dict[i+1] - Z_dict[i]) * np.exp(eps * Utility(m, i)) #du\n p_i = (Z_dict[i + 1] - Z_dict[i]) * np.exp(-eps * np.abs(i - q * k)) # smith\n prob_sum += p_i\n ps.append(p_i)\n\n prob_vec = [p_i / prob_sum for p_i in ps]\n j = np.random.choice(a=list(range(len(Z) + 1)), size=1, p=prob_vec)[0]\n out = np.random.uniform(low=Z_dict[j], high=Z_dict[j + 1], size=1)\n\n return (out)","def quantile(image, q, nonzero=True):\n img_arr = image.numpy()\n if isinstance(q, (list,tuple)):\n q = [qq*100. if qq <= 1. else qq for qq in q]\n if nonzero:\n img_arr = img_arr[img_arr>0]\n vals = [np.percentile(img_arr, qq) for qq in q]\n return tuple(vals)\n elif isinstance(q, (float,int)):\n if q <= 1.:\n q = q*100.\n if nonzero:\n img_arr = img_arr[img_arr>0]\n return np.percentile(img_arr[img_arr>0], q)\n else:\n raise ValueError('q argument must be list/tuple or float/int')","def test_percentile_kurtosis():\n f = np.asarray([\n [0.99, 1.0, 0.5, 0.52],\n [0.69, 0.6, 0.61, 1.0]])\n R = common_metrics.percentile_kurtosis(f, maximise=True)\n expected = np.asarray(\n [1.06382979, 5.0])\n assert np.allclose(R, expected)","def percentile(data, percentiles, weights=None):\n # check if actually weighted percentiles is needed\n if weights is None:\n return np.percentile(data, list(percentiles))\n if np.equal(weights, 1.).all():\n return np.percentile(data, list(percentiles))\n\n # make sure percentiles are fractions between 0 and 1\n if not np.greater_equal(percentiles, 0.0).all():\n raise ValueError(\"Percentiles less than 0\")\n if not np.less_equal(percentiles, 100.0).all():\n raise ValueError(\"Percentiles greater than 100\")\n\n # Make sure data is in correct shape\n shape = np.shape(data)\n n = len(data)\n if (len(shape) != 1):\n raise ValueError(\"wrong data shape, expecting 1d\")\n\n if len(weights) != n:\n print(n, len(weights))\n raise ValueError(\"weights must be the same shape as data\")\n if not np.greater_equal(weights, 0.0).all():\n raise ValueError(\"Not all weights are non-negative.\")\n\n _data = np.asarray(data, dtype=float)\n\n if hasattr(percentiles, '__iter__'):\n _p = np.asarray(percentiles, dtype=float) * 0.01\n else:\n _p = np.asarray([percentiles * 0.01], dtype=float)\n\n _wt = np.asarray(weights, dtype=float)\n\n len_p = len(_p)\n sd = np.empty(n, dtype=float)\n sw = np.empty(n, dtype=float)\n aw = np.empty(n, dtype=float)\n o = np.empty(len_p, dtype=float)\n\n i = np.argsort(_data)\n np.take(_data, i, axis=0, out=sd)\n np.take(_wt, i, axis=0, out=sw)\n np.add.accumulate(sw, out=aw)\n\n if not aw[-1] > 0:\n raise ValueError(\"Nonpositive weight sum\")\n\n w = (aw - 0.5 * sw) / aw[-1]\n\n spots = np.searchsorted(w, _p)\n for (pk, s, p) in zip(range(len_p), spots, _p):\n if s == 0:\n o[pk] = sd[0]\n elif s == n:\n o[pk] = sd[n - 1]\n else:\n f1 = (w[s] - p) / (w[s] - w[s - 1])\n f2 = (p - w[s - 1]) / (w[s] - w[s - 1])\n o[pk] = sd[s - 1] * f1 + sd[s] * f2\n return o","def quartile(db: pd.DataFrame, col: str) -> pd.DataFrame:\n _, bins = pd.qcut(x=db[col],\n q=[0.25, 0.75], # [0.0, 0.25, 0.5, 0.75, 1.0],\n retbins=True, duplicates='drop')\n q1 = bins[0] # lower (first) quartile\n q3 = bins[1] # upper (third) quartile\n iqr = q3 - q1 # InterQuartile Range\n lower_fence = (q1 - 1.5 * iqr)\n upper_fence = (q3 + 1.5 * iqr)\n db.loc[db[col] < lower_fence, col] = q1\n db.loc[db[col] > upper_fence, col] = q3\n return db","def quantiles(self, q: int):\n return self.dist.quantiles(q)","def quantile(self, q: float) -> np.array:\n assert 0 <= q <= 1\n return np.array(\n list(\n chain.from_iterable(\n model.predict(self.featurized_data, q)\n for model in self.models\n )\n )\n )","def quantile(df):\r\n\r\n\tdf_quantile_dict = dict()\r\n\r\n\tfor i, col in enumerate(df.columns):\r\n\t\tdf_quantile_dict[col] = [df[col].quantile(0.25), df[col].quantile(0.5), df[col].quantile(0.75)]\r\n\r\n\tdf_quantile = pd.DataFrame(df_quantile_dict, index=['Quantile (25%)', 'Quantile (50%)', 'Quantile (75%)'])\r\n\tpd.set_option('precision', 2) # set output display precision in 2 decimal places\r\n\r\n\treturn df_quantile","def percentile(N, percent):\n N.sort()\n if not N:\n return None\n k = (len(N) - 1) * percent\n f = math.floor(k)\n c = math.ceil(k)\n if f == c:\n return N[int(k)]\n d0 = N[int(f)] * (c - k)\n d1 = N[int(c)] * (k - f)\n return d0 + d1","def compute_percentile(value, cutoffs):\n\tif value < cutoffs[0]:\n\t\treturn 0.0\n\n\tfor i, cutoff in enumerate(cutoffs):\n\t\tif value < cutoff:\n\t\t\treturn math.floor(100 * (float(i)/(len(cutoffs))))\n\t\t\tbreak\n\treturn 100.0","def calc_q1(data: list) -> float:\n py = copy.copy(data)\n py.sort()\n return py[round(len(py) / 4)]","def quantile(self, hypercube):\n raise NotImplementedError()","def quantile_corner(x, q, weights=None):\n if weights is None:\n return np.percentile(x, [100. * qi for qi in q])\n else:\n idx = np.argsort(x)\n xsorted = x[idx]\n cdf = np.add.accumulate(weights[idx])\n cdf /= cdf[-1]\n return np.interp(q, cdf, xsorted).tolist()","def quantile(self, q, *, axis=0, **kwargs) -> \"Dataset\":\n return self._quantile(q, axis=axis, func=np.quantile, **kwargs)","def test_check_data_not_specifying_percentiles(self):\n expected_data = np.array(\n [self.percentile_25, self.percentile_50, self.percentile_75]\n )\n result = Plugin().process(self.cube)\n self.assertArrayAlmostEqual(result.data, expected_data, decimal=5)","def quantile(data, weights, quantile_limit):\n data = np.asarray(data)\n # TO DO: Allow to specify the axis\n if data.ndim == 0:\n raise TypeError(\"data must have at least one dimension\")\n\n elif data.ndim == 1:\n return quantile_1d(data, weights, quantile_limit)\n\n # elif data.ndim > 1:\n shape = data.shape\n imr = data.reshape((np.prod(shape[:-1]), shape[-1]))\n result = np.apply_along_axis(quantile_1d, -1, imr, weights, quantile_limit)\n return result.reshape(shape[:-1])","def quantile_1d(data, weights, quantile_limit):\n data = np.asarray(data)\n weights = np.asarray(weights)\n if data.ndim != 1:\n raise TypeError(\"data must be a one dimensional array\")\n\n if data.shape != weights.shape:\n raise TypeError(\"the length of data and weights must be the same\")\n\n if not 0.0 <= quantile_limit <= 1.0:\n raise ValueError(\"quantile must have a value between 0.0 and 1.0\")\n\n # Sort the data\n ind_sorted = np.argsort(data)\n sorted_data = data[ind_sorted]\n notnan = ~np.isnan(sorted_data)\n if np.count_nonzero(notnan) == 0:\n return np.nan\n\n sorted_weights = np.nan_to_num(weights[ind_sorted][notnan])\n\n # Compute the auxiliary arrays\n cuml_weights = np.cumsum(sorted_weights)\n\n # TO DO: Check that the weights do not sum zero\n prob_normalized = (cuml_weights - 0.5 * sorted_weights) / np.sum(sorted_weights)\n\n # Get the value of the weighted median\n return np.interp(quantile_limit, prob_normalized, sorted_data[notnan])","def test_lots_of_probability_thresholds(self):\n data = np.array(\n [\n [[2.9, 2.9, 2.9], [2.9, 2.9, 2.9], [2.9, 2.9, 2.9]],\n [[14.5, 14.5, 14.5], [14.5, 14.5, 14.5], [14.5, 14.5, 14.5]],\n [\n [26.099998, 26.099998, 26.099998],\n [26.099998, 26.099998, 26.099998],\n [26.099998, 26.099998, 26.099998],\n ],\n ],\n dtype=np.float32,\n )\n\n input_probs = np.tile(np.linspace(1, 0, 30), (3, 3, 1)).T\n cube = set_up_probability_cube(\n input_probs.astype(np.float32),\n np.arange(30).astype(np.float32),\n threshold_units=\"degC\",\n )\n\n result = Plugin()._probabilities_to_percentiles(cube, self.percentiles)\n\n self.assertArrayAlmostEqual(result.data, data)","def quintile(self, ratio):\n\t\tif ratio<=float(1)/float(5):\n\t\t\treturn 1\n\t\telif ratio <= float(2)/float(5):\n\t\t\treturn 2\n\t\telif ratio <= float(3)/float(5):\n\t\t\treturn 3\n\t\telif ratio <= float(4)/float(5):\n\t\t\treturn 4\n\t\telse:\n\t\t\treturn 5","def percentile(N, percent):\n if not N:\n return None\n k = (len(N)-1) * percent\n f = math.floor(k)\n c = math.ceil(k)\n if f == c:\n return N[int(k)]\n d0 = N[int(f)] * (c-k)\n d1 = N[int(c)] * (k-f)\n return d0+d1","def createQuantile(data, column_name, cut_of_point):\r\n data[data[column_name] > data[column_name].quantile(cut_of_point)] = 0\r\n return data","def calc_percentile(self, p):\n bounds = self.range_bins\n r = []\n v = []\n for b in bounds:\n d = self._get_data_distance(0., b)\n if len(d) < 1:\n continue\n r.append(b)\n v.append(np.percentile(d, p * 100.)) # percentile value\n\n r = np.asarray(r)\n np.asarray(v)\n\n o = {'r': np.asarray(r), 'value': np.asarray(v)}\n if 'percentiles' not in self.statistic.keys():\n self.statistic.update({'percentiles': {}})\n\n self.statistic['percentiles'].update({p: o})","def axis_distribution_ratio(data, cutoff, upper_or_lower=\"upper\"):\n\n count = 0\n if upper_or_lower == \"upper\":\n for a in data:\n if a > cutoff:\n count += 1\n\n elif upper_or_lower == \"lower\":\n for a in data:\n if a < cutoff:\n count += 1\n\n ratio = count/len(data)\n\n return ratio","def quantile(data, quantiles):\r\n\r\n assert isinstance(data, list) or isinstance(data, ndarray), \"Data must be either\" +\\\r\n \" a Python list or a NumPy 1-D array\"\r\n assert isinstance(quantiles, list) or isinstance(quantiles, ndarray), \"Quantiles\" +\\\r\n \" must be either a Python list or a NumPy 1-D array\"\r\n assert all(map(lambda x: x >= 0 and x <= 1, quantiles)), \"All the elements \" +\\\r\n \"in the quantiles list must be greater than 0 and lower than one\"\r\n\r\n # unless the user wanted, do not modify the data\r\n data = deepcopy(data)\r\n\r\n if not isinstance(data, ndarray):\r\n data = array(data)\r\n data.sort()\r\n\r\n output = []\r\n # if needed different quantile methods could be used\r\n for one_quantile in quantiles:\r\n output.append(_quantile(data, one_quantile))\r\n\r\n return output","def _getPercentile(points, n, interpolate=False):\n sortedPoints = sorted([ p for p in points if p is not None])\n if len(sortedPoints) == 0:\n return None\n fractionalRank = (n/100.0) * (len(sortedPoints) + 1)\n rank = int(fractionalRank)\n rankFraction = fractionalRank - rank\n\n if not interpolate:\n rank += int(math.ceil(rankFraction))\n\n if rank == 0:\n percentile = sortedPoints[0]\n elif rank - 1 == len(sortedPoints):\n percentile = sortedPoints[-1]\n else:\n percentile = sortedPoints[rank - 1] # Adjust for 0-index\n\n if interpolate:\n if rank != len(sortedPoints): # if a next value exists\n nextValue = sortedPoints[rank]\n percentile = percentile + rankFraction * (nextValue - percentile)\n\n return percentile","def compute_quantile(risk, T_max: int, scenario_numbers, quantile):\r\n\r\n print(\"\\tComputing Quantile...\")\r\n # Init quantile\r\n q = np.zeros(T_max)\r\n for t in range(T_max):\r\n risk[t].sort()\r\n q[t] = risk[t][int(np.ceil(scenario_numbers[t] * quantile)) - 1]\r\n print(\"\\tDone\")\r\n\r\n return q","def get_percentile(obs, bootstrap):\n if np.isnan(obs):\n return np.nan\n else:\n return np.searchsorted(np.sort(bootstrap), obs) / len(bootstrap)","def test_simple_check_data_above(self):\n expected = np.array([8.15384615, 9.38461538, 11.6])\n expected = expected[:, np.newaxis, np.newaxis]\n\n data = np.array([0.95, 0.3, 0.05])\n data = data[:, np.newaxis, np.newaxis]\n\n cube = set_up_probability_cube(\n data.astype(np.float32), ECC_TEMPERATURE_THRESHOLDS, threshold_units=\"degC\"\n )\n\n result = Plugin()._probabilities_to_percentiles(cube, self.percentiles)\n self.assertArrayAlmostEqual(result.data, expected)","def get_IQR(lst):\n return (float(np.percentile(lst, 75)) - float(np.percentile(lst, 25)))","def calc_iqr(sig):\n # iqr = subtract(*percentile(sig, [75, 25]))\n return np.percentile(sig, 75) - np.percentile(sig, 25)","def ferdosi(data_points):\n (N, _) = data_points.shape\n twentieth = np.percentile(data_points, 20, axis=0)\n eightieth = np.percentile(data_points, 80, axis=0)\n sigmas = (eightieth - twentieth) / math.log(N)\n return np.min(sigmas)","def threshold_func(distribution: List[float], alpha: List[float], **kwargs) -> float:\n threshold = np.quantile(distribution, q=alpha, interpolation=\"lower\", **kwargs)\n return threshold","def perc(data,percentile):\n clip_value = np.percentile(data,percentile)\n data = clip(data,clip_value)\n return data","def nrmse_ipercentile(self, q1=25, q2=75) -> float:\n\n q1 = np.percentile(self.true, q1)\n q3 = np.percentile(self.true, q2)\n iqr = q3 - q1\n\n return float(self.rmse() / iqr)","def iqr(self, arr):\n a = np.asarray(arr)\n self.q1 = stats.scoreatpercentile(a, 25)\n self.q2 = stats.scoreatpercentile(a, 50)\n self.q3 = stats.scoreatpercentile(a, 75)","def basic_stats(data):\n if isinstance(data, pd.DataFrame):\n return data.describe(percentiles=[0.5]).T.drop(['50%'], axis=1)\n else:\n return data.to_frame().describe(percentiles=[0.5]).T.drop(['50%'], axis=1)","def get_percentile_from_freq(\n freq: pd.Series,\n p: float = 0.5,\n ascending: bool = False,\n include_boundary: Union[bool, None] = None,\n) -> pd.Series:\n freq = freq.sort_values(ascending=ascending)\n cutoff_idx = (freq.cumsum() >= p * freq.sum()).idxmax()\n\n if include_boundary is None:\n if ascending:\n # If your looking at the smallest, if there is a large\n # jump in count, you will get way too much of the data\n # so probably *dont*\n include_boundary = False\n else:\n # If you're looking at the topx largest, you probably want\n # to *include* the count just larger than the sum (because)\n # this is probably a large proportion of the total count\n include_boundary = True\n if include_boundary:\n return freq.loc[:cutoff_idx]\n return freq.loc[:cutoff_idx].iloc[:-1]","def test_create_quantile(self):\n quantile = pmp.utils.create_quantile(0.5, 4.0)\n self.assertIsInstance(quantile, pmp.Quantile)","def percentile(data, qval, labels=None, index=None):\n data = np.asanyarray(data)\n\n def single_group(vals):\n return np.percentile(vals, qval)\n\n if labels is None:\n return single_group(data)\n\n # ensure input and labels match sizes\n data, labels = np.broadcast_arrays(data, labels)\n\n if index is None:\n mask = labels > 0\n return single_group(data[mask])\n\n if np.isscalar(index):\n mask = labels == index\n return single_group(data[mask])\n\n # remap labels to unique integers if necessary, or if the largest\n # label is larger than the number of values.\n if (\n not _safely_castable_to_int(labels.dtype)\n or labels.min() < 0\n or labels.max() > labels.size\n ):\n # remap labels, and indexes\n unique_labels, labels = np.unique(labels, return_inverse=True)\n idxs = np.searchsorted(unique_labels, index)\n\n # make all of idxs valid\n idxs[idxs >= unique_labels.size] = 0\n found = unique_labels[idxs] == index\n else:\n # labels are an integer type, and there aren't too many.\n idxs = np.asanyarray(index, int).copy()\n found = (idxs >= 0) & (idxs <= labels.max())\n\n idxs[~found] = labels.max() + 1\n\n # reorder data and labels, first by labels, then by data\n order = np.lexsort((data.ravel(), labels.ravel()))\n data = data.ravel()[order]\n labels = labels.ravel()[order]\n\n locs = np.arange(len(labels))\n lo = np.zeros(labels.max() + 2, int)\n lo[labels[::-1]] = locs[::-1]\n hi = np.zeros(labels.max() + 2, int)\n hi[labels] = locs\n lo = lo[idxs]\n hi = hi[idxs]\n # lo is an index to the lowest value in input for each label,\n # hi is an index to the largest value.\n\n # here starts the part that really diverts from scipy's median finder; the\n # linear interpolation method used corresponds to the default behaviour of\n # np.percentile().\n size = hi - lo + 1 # size of the group\n frac = (size - 1) * (qval / 100) # fractional index relative to lo\n hi = lo - np.int64(-frac // 1) # ceiled absolute index to data\n lo = lo + np.int64(frac // 1) # floored absolute index to data\n part = frac % 1 # fractional part of index\n return (data[lo] + part * (data[hi] - data[lo])).tolist()","def quantile(data, alpha, candidates=None, interpolation=\"midpoint\", **kwargs):\n return Component(\n \"Quantile\",\n arguments={\n 'data': Component.of(data),\n 'candidates': Component.of(candidates)\n },\n options={\n 'alpha': alpha,\n 'interpolation': interpolation\n },\n constraints=kwargs)","def calculate_cornish_fisher_percentile(alpha, mu, sigma, skew, kurt):\n\n z = stats.norm.ppf(alpha)\n he2 = np.polynomial.hermite_e.hermeval(z, [0.0, 0.0, 1.0])\n he3 = np.polynomial.hermite_e.hermeval(z, [0.0, 0.0, 0.0, 1.0])\n he13 = np.polynomial.hermite_e.hermeval(z, [0.0, -1.0, 0.0, -2.0])\n\n w = (z +\n he2 * skew / 6 +\n he3 * kurt / 24 +\n he13 * (skew ** 2) / 36)\n\n return mu + sigma * w","def quantile(self, axis: str = 'rows', q: float = 0.5) -> 'DataFrame':\n if not utils.is_number(q):\n raise TypeError('`q` must be a number between 0 and 1')\n if q < 0 or q > 1:\n raise ValueError('`q` must be between 0 and 1')\n return self._stat_funcs('quantile', axis, q=q)","def percentile(self, p=None):\n if p is None:\n raise ValueError(\"Please supply p\")\n\n if type(p) not in [int, float]:\n raise TypeError(\"p is a \" + str(type(p)) + \", not int or float\")\n\n if (p < 0) or (p > 100):\n raise ValueError(\"p: \" + str(p) + \" is not between 0 and 100!\")\n\n self.run()\n\n new_files = []\n new_commands = []\n for ff in self:\n target = temp_file(\"nc\")\n\n cdo_command = (\n \"cdo -timpctl,\"\n + str(p)\n + \" \"\n + ff\n + \" -timmin \"\n + ff\n + \" -timmax \"\n + ff\n + \" \"\n + target\n )\n\n cdo_command = tidy_command(cdo_command)\n target = run_cdo(cdo_command, target)\n new_files.append(target)\n new_commands.append(cdo_command)\n\n self.history += new_commands\n self._hold_history = copy.deepcopy(self.history)\n\n self.current = new_files\n\n cleanup()","def quantiles(x, qlist=[2.5, 25, 50, 75, 97.5]):\n # Make a copy of trace\n x = x.copy()\n\n # For multivariate node\n if x.ndim > 1:\n # Transpose first, then sort, then transpose back\n sx = np.transpose(np.sort(np.transpose(x)))\n else:\n # Sort univariate node\n sx = np.sort(x)\n\n try:\n # Generate specified quantiles\n quants = [sx[int(len(sx) * q / 100.0)] for q in qlist]\n\n return dict(zip(qlist, quants))\n\n except IndexError:\n print(\"Too few elements for quantile calculation\")","def performance_quantiles(data, performance_measure):\n quantiles = pd.qcut(x=data[performance_measure], q=4, labels=['q1', 'q2', 'q3', 'q4'])\n bins = quantiles.to_frame(name=performance_measure + '_quantiles')\n data_quantiles = pd.merge(data, bins, right_index=True, left_index=True)\n data_quantiles.dropna(inplace=True)\n data_quantiles.sort_values(performance_measure + '_quantiles', inplace=True)\n return data_quantiles","def printProbability(p):\n if p > .0000001:\n return \"%9.6f%%\" % (p * 100)\n else:\n return \"%9.3e\" % (p)","def quantile(series: Sequence, quantile: Union[None, float] = None):\n if quantile is None:\n try:\n last, series = series[-1], series[:-1]\n return np.mean(series < last)\n except IndexError:\n return np.nan\n assert 0 <= quantile <= 1, \"quantile must be within [0, 1]\"\n return np.nanpercentile(series, quantile * 100)"],"string":"[\n \"def Quartiles(data):\\n q = np.percentile(data, [25, 50, 75])\\n\\n return q[0], q[1], q[2]\",\n \"def test__quantile(self):\\r\\n # regular cases\\r\\n sample_data = array(range(25, 42))\\r\\n assert_almost_equal(_quantile(sample_data, 0.5), median(sample_data))\\r\\n\\r\\n # sorted data is assumed for this function\\r\\n sample_data = sorted(\\r\\n array([0.17483293, 0.99891939, 0.81377467, 0.8137437,\\r\\n 0.51990174, 0.35521497, 0.98751461]))\\r\\n assert_almost_equal(_quantile(sample_data, 0.10), 0.283062154)\",\n \"def prctile(data, p_vals=[0, 25, 50, 75, 100], sorted_=False):\\r\\n ps = [p_vals] if np.isscalar(p_vals) else p_vals\\r\\n\\r\\n if not sorted_:\\r\\n data = sorted(data)\\r\\n n = len(data)\\r\\n d = []\\r\\n for p in ps:\\r\\n fi = p * n / 100 - 0.5\\r\\n if fi <= 0: # maybe extrapolate?\\r\\n d.append(data[0])\\r\\n elif fi >= n - 1:\\r\\n d.append(data[-1])\\r\\n else:\\r\\n i = int(fi)\\r\\n d.append((i+1 - fi) * data[i] + (fi - i) * data[i+1])\\r\\n return d[0] if np.isscalar(p_vals) else d\",\n \"def get_percentile(self, q):\\n return None\",\n \"def get_percentile(self, q):\\n return None\",\n \"def quantile(x, p):\\n sorted_x = sorted(x)\\n # round p_index to base int\\n p_index = int(p * len(x))\\n return sorted_x[p_index]\",\n \"def calcrange_quartile(data, log=False):\\n if not isinstance(data, numpy.ndarray):\\n data = numpy.array(data)\\n if log:\\n data = data[data > 0.]\\n\\n if len(data) == 0:\\n if log: return 0.1, 1.\\n else: return 0., 1.\\n\\n data = numpy.sort(data)\\n q1 = data[int(math.floor(0.25*len(data)))]\\n q3 = data[int(math.floor(0.75*len(data)))]\\n if log:\\n return q1 / (q3 - q1), q3 * (q3 - q1)\\n else:\\n return q1 - (q3 - q1), q3 + (q3 - q1)\",\n \"def quantile(x,p):\\n p_index = int(p*len(x))\\n return sorted(x)[p_index]\",\n \"def quantile(x, p):\\n p_index = int(p * len(x))\\n return sorted(x)[p_index]\",\n \"def quantile(x, p):\\n p_index = int(p * len(x))\\n return sorted(x)[p_index]\",\n \"def quantile(x, p):\\n p_index = int(p * len(x))\\n return sorted(x)[p_index]\",\n \"def IQR(data):\\n return percentile(data, 75) - percentile(data, 25)\",\n \"def quantile(xs: List[float], p: float) -> float:\\n p_index = int(p * len(xs))\\n return sorted(xs)[p_index]\",\n \"def default_quantile():\\n return np.logspace(-5, 0, 100)\",\n \"def get_percentile(self, q):\\n return self.sum_stat_sample_ratio.get_percentile(q)\",\n \"def percentile(t: torch.tensor, q: float):\\n # Note that ``kthvalue()`` works one-based, i.e. the first sorted value\\n # indeed corresponds to k=1, not k=0! Use float(q) instead of q directly,\\n # so that ``round()`` returns an integer, even if q is a np.float32.\\n k = 1 + round(.01 * float(q) * (t.numel() - 1))\\n result = t.view(-1).kthvalue(k).values.item()\\n return result\",\n \"def get_percentile(self, q):\\n return self.sum_stat_sample_delta.get_percentile(q)\",\n \"def percentile(field, q):\\n # https://gist.github.com/spezold/42a451682422beb42bc43ad0c0967a30\\n # Note that ``kthvalue()`` works one-based, i.e. the first sorted value\\n # indeed corresponds to k=1, not k=0! Use float(q) instead of q directly,\\n # so that ``round()`` returns an integer, even if q is a np.float32.\\n k = 1 + round(.01 * float(q) * (field.shape[1] - 1))\\n result = field.kthvalue(k, dim=1).values\\n return result\",\n \"def _quantile(data, quantile):\\r\\n index = quantile * (len(data) - 1)\\r\\n bottom_index = int(floor(index))\\r\\n top_index = int(ceil(index))\\r\\n\\r\\n difference = index - bottom_index\\r\\n output = (1 - difference) * \\\\\\r\\n data[bottom_index] + difference * data[top_index]\\r\\n\\r\\n return output\",\n \"def get_percentile(self, q):\\n raise NotImplementedError(\\\"This is an abstract method and needs to be implemented in derived classes.\\\")\",\n \"def test_profiled_quantiles(self):\\n\\n # this data has 4 bins, range of 3\\n # with equal bin size, each bin has the width of 0.75\\n\\n data = [\\\"1.0\\\", \\\"2.0\\\", \\\"3.0\\\", \\\"4.0\\\"]\\n df = pd.Series(data)\\n profiler = FloatColumn(df.name)\\n profiler.update(df)\\n profile = profiler.profile\\n\\n est_quartiles = profile['quantiles']\\n est_Q1 = est_quartiles[249]\\n est_Q2 = est_quartiles[499]\\n est_Q3 = est_quartiles[749]\\n\\n data_to_num = [float(item) for item in data]\\n exact_Q1 = np.percentile(data_to_num, 25)\\n exact_Q2 = np.percentile(data_to_num, 50)\\n exact_Q3 = np.percentile(data_to_num, 75)\\n\\n self.assertEqual(est_Q1, exact_Q1)\\n self.assertEqual(est_Q2, exact_Q2)\\n self.assertEqual(est_Q3, exact_Q3)\",\n \"def get_quartile_data(cls, data: tuple or list) -> tuple:\\n cls._data_validation(data)\\n # Sort the data\\n sorted_data = sorted(list(data))\\n # Get q2, which is the median\\n q2 = cls.get_median(data)\\n first_half_data = list()\\n second_half_data = list()\\n # add to first half until median, then add to second half\\n for i in range(len(sorted_data)):\\n # if less than q2, first half\\n if sorted_data[i] < q2:\\n first_half_data.append(sorted_data[i])\\n # if greather than q2, second half, skips q2\\n elif sorted_data[i] > q2:\\n second_half_data.append(sorted_data[i])\\n # use median method on halves to get quartiles\\n q1 = cls.get_median(first_half_data)\\n q3 = cls.get_median(second_half_data)\\n iqr = q3-q1\\n return q1, q2, q3, iqr\",\n \"def test_valid_calculation_of_quantile(alpha: Any) -> None:\\n n = 30\\n check_alpha_and_n_samples(alpha, n)\",\n \"def test_quantile(self):\\r\\n\\r\\n # suffle the data to be sure, it is getting sorted\\r\\n sample_data = array(range(1, 11))\\r\\n shuffle(sample_data)\\r\\n\\r\\n # regular cases\\r\\n expected_output = [1.9, 2.8, 3.25, 5.5, 7.75, 7.93]\\r\\n list_of_quantiles = [0.1, 0.2, 0.25, 0.5, 0.75, 0.77]\\r\\n output = quantile(sample_data, list_of_quantiles)\\r\\n assert_almost_equal(expected_output, output)\\r\\n\\r\\n sample_data = array([42, 32, 24, 57, 15, 34, 83, 24, 60, 67, 55, 17,\\r\\n 83, 17, 80, 65, 14, 34, 39, 53])\\r\\n list_of_quantiles = [0.5]\\r\\n output = quantile(sample_data, list_of_quantiles)\\r\\n assert_almost_equal(output, median(sample_data))\\r\\n\\r\\n # quantiles must be between [0, 1]\\r\\n with self.assertRaises(AssertionError):\\r\\n output = quantile(sample_data, [0.1, 0.2, -0.1, 2, 0.3, 0.5])\\r\\n\\r\\n # quantiles must be a list or a numpy array\\r\\n with self.assertRaises(AssertionError):\\r\\n output = quantile(sample_data, 1)\\r\\n\\r\\n # the data must be a list or a numpy array\\r\\n with self.assertRaises(AssertionError):\\r\\n output = quantile(1, [0])\",\n \"def _percentile(self, data, percent):\\n if not data:\\n return None\\n k = (len(data) - 1) * percent\\n f = math.floor(k)\\n c = math.ceil(k)\\n if f == c:\\n return data[int(k)]\\n d0 = data[int(f)] * (c - k)\\n d1 = data[int(c)] * (k - f)\\n return d0 + d1\",\n \"def quantile(a, prob):\\n a=numpy.asanyarray(a)\\n a=a[numpy.logical_not(numpy.isnan(a))].ravel()\\n n=a.size\\n\\n if prob>=1-.5/n:\\n return a.max()\\n elif prob<=.5/n:\\n return a.min()\\n\\n # find the two bounds we're interpreting between:\\n # that is, find i such that (i+.5) / n <= prob <= (i+1.5)/n\\n t=n*prob-.5\\n i=int(t)\\n\\n # partial sort so that the ith element is at position i, with bigger ones\\n # to the right and smaller to the left\\n a.sort()\\n\\n if i==t: # did we luck out and get an integer index?\\n return a[i]\\n else:\\n # we'll linearly interpolate between this and the next index\\n smaller=a[i]\\n larger=a[i+1:].min()\\n if numpy.isinf(smaller):\\n return smaller # avoid inf - inf\\n return smaller+(larger-smaller)*(t-i)\",\n \"def get_quartile_data(cls, data: tuple or list) -> tuple:\\n cls._data_validation(data)\\n from math import floor\\n # Sort the data\\n n = cls.get_n(data)\\n if n == 0:\\n # Empty dataset, returns zeroes\\n return 0, 0, 0, 0\\n sorted_data = sorted(list(data))\\n n_is_odd = True if n % 2 == 1 else False\\n\\n # Get middle index\\n odd_middle_index = floor(n / 2)\\n even_upper_index = floor(n / 2)\\n even_lower_index = floor(n / 2) - 1\\n\\n # Get q2, which is the median\\n q2 = cls.get_median(data)\\n first_half_data = list()\\n second_half_data = list()\\n\\n # add to first half until median, then add to second half\\n if n_is_odd:\\n for i in range(n):\\n if i < odd_middle_index:\\n first_half_data.append(sorted_data[i])\\n # note how if index = middle_index, skips\\n elif i > odd_middle_index:\\n second_half_data.append(sorted_data[i])\\n else:\\n for i in range(n):\\n if i <= even_lower_index:\\n first_half_data.append(sorted_data[i])\\n # note how if index = middle_index, skips\\n else:\\n second_half_data.append(sorted_data[i])\\n # use median method on halves to get quartiles\\n q1 = cls.get_median(first_half_data)\\n q3 = cls.get_median(second_half_data)\\n iqr = q3 - q1\\n return q1, q2, q3, iqr\",\n \"def quartiles(x, percentile):\\n length = len(x)\\n\\n if percentile == 25:\\n center = length // 4\\n elif percentile == 75:\\n center = length // 2 + length // 4\\n\\n x.sort()\\n\\n if length % 2 == 0:\\n return (x[center - 1] + x[center]) / 2\\n else:\\n return x[center]\",\n \"def get_percentile(before, level):\\n snr = np.array(before.getColumnByName('snr')[:])\\n return np.percentile(snr, level)\",\n \"def quantile_func(q):\\n def f(x):\\n return np.quantile(x, q)\\n\\n return f\",\n \"def percentile_filter(data, feats):\\n\\n # Determines the fraction of nonzero values in the data.\\n sparsity_frac = feats['nonzeros'] / (feats['nrows'] * feats['ncols'])\\n\\n # NOTE: Added convenience term derived from experience.\\n thresh = np.percentile(data.ravel(), q=100 * (1 - (sparsity_frac + 0.1)))\\n\\n # Replace p-values below threshold with zero.\\n data[(data > 0) & (data < thresh)] = 0\\n\\n return data\",\n \"def torch_percentile(t, q):\\n # Note that ``kthvalue()`` works one-based, i.e. the first sorted value\\n # indeed corresponds to k=1, not k=0! Use float(q) instead of q directly,\\n # so that ``round()`` returns an integer, even if q is a np.float32.\\n k = 1 + round(.01 * float(q) * (t.numel() - 1))\\n result = t.view(-1).kthvalue(k).values.item()\\n return result\",\n \"def percentile(p):\\n assert 1.0 > p >= 0.0\\n\\n def __p1(ls):\\n k = math.floor(len(ls) * p)\\n assert k >= 0\\n assert k < len(ls)\\n\\n start = 0\\n end = len(ls) - 1\\n\\n while start <= end:\\n pivot_index = start\\n pivot_val = ls[pivot_index]\\n\\n for i in range(pivot_index + 1, end + 1):\\n if ls[i] >= pivot_val:\\n continue\\n else:\\n ls[pivot_index] = ls[i]\\n pivot_index += 1\\n ls[i] = ls[pivot_index]\\n\\n ls[pivot_index] = pivot_val\\n if pivot_index == k:\\n return pivot_val\\n elif pivot_index > k:\\n end = pivot_index - 1\\n else:\\n start = pivot_index + 1\\n\\n return ls[start]\\n\\n return __p1\",\n \"def median(data, weights):\\n return quantile(data, weights, 0.5)\",\n \"def test_lots_of_percentiles(self):\\n data = np.array(\\n [\\n [[14.4, -46, 10.2], [-73.0, -46, -89.2], [-89.2, -93.25, -94.6]],\\n [[19.2, 8.25, 10.6], [-19, 8.25, -67.6], [-67.6, -79.75, -83.8]],\\n [[24.0, 8.75, 11.0], [8.33333, 8.75, -46.0], [-46.0, -66.25, -73.0]],\\n [[28.8, 9.25, 11.4], [9.0, 9.25, -24.4], [-24.4, -52.75, -62.2]],\\n [[33.6, 9.75, 11.8], [9.666667, 9.75, -2.8], [-2.8, -39.25, -51.4]],\\n [\\n [38.4, 10.333333, 16.8],\\n [10.333333, 10.2, 8.5],\\n [8.333333, -25.75, -40.6],\\n ],\\n [[43.2, 11.0, 26.4], [11.0, 10.6, 9.5], [9.0, -12.25, -29.8]],\\n [\\n [48.0, 11.666667, 36.0],\\n [11.666667, 11.0, 10.5],\\n [9.666667, 1.25, -19.0],\\n ],\\n [[52.8, 24, 45.6], [24, 11.4, 11.5], [10.5, 8.5, -8.2]],\\n [[57.6, 48, 55.2], [48, 11.8, 36.0], [11.5, 9.5, 2.6]],\\n ],\\n dtype=np.float32,\\n )\\n\\n percentiles = np.arange(5, 100, 10)\\n result = Plugin()._probabilities_to_percentiles(self.cube, percentiles)\\n self.assertArrayAlmostEqual(result.data, data, decimal=5)\",\n \"def calc_stats(data):\\n x = np.asarray(data, np.float)\\n vals_min = np.min(x)\\n vals_max = np.max(x)\\n q2 = np.percentile(x, 50, interpolation='linear')\\n q1 = np.percentile(x, 25, interpolation='lower')\\n q3 = np.percentile(x, 75, interpolation='higher')\\n iqr = q3 - q1\\n whisker_dist = 1.5 * iqr\\n\\n # in order to prevent drawing whiskers outside the interval\\n # of data one defines the whisker positions as:\\n d1 = np.min(x[x >= (q1 - whisker_dist)])\\n d2 = np.max(x[x <= (q3 + whisker_dist)])\\n return {\\n 'min': vals_min,\\n 'max': vals_max,\\n 'q1': q1,\\n 'q2': q2,\\n 'q3': q3,\\n 'd1': d1,\\n 'd2': d2\\n }\",\n \"def p(n):\\n def p_(x):\\n return np.percentile(x, n)\\n\\n p_.__name__ = \\\"p_%s\\\" % n\\n return p_\",\n \"def quantile(agg, k=4, name='quantile'):\\n\\n w = 100.0 / k\\n p = np.arange(w, 100 + w, w)\\n\\n if p[-1] > 100.0:\\n p[-1] = 100.0\\n\\n q = np.array([stats.scoreatpercentile(agg.data, pct) for pct in p])\\n q = np.unique(q)\\n k_q = len(q)\\n\\n if k_q < k:\\n print(\\\"Quantile Warning: Not enough unique values for k classes (using {} bins)\\\".format(k_q))\\n\\n return DataArray(_bin(agg.data, q, np.arange(k_q)),\\n name=name,\\n dims=agg.dims,\\n coords=agg.coords,\\n attrs=agg.attrs)\",\n \"def dp_quantile(data, alpha, candidates=None, lower=None, upper=None, mechanism=\\\"Automatic\\\", privacy_usage=None, interpolation=\\\"midpoint\\\", **kwargs):\\n return Component(\\n \\\"DPQuantile\\\",\\n arguments={\\n 'data': Component.of(data),\\n 'candidates': Component.of(candidates),\\n 'lower': Component.of(lower),\\n 'upper': Component.of(upper)\\n },\\n options={\\n 'alpha': alpha,\\n 'mechanism': mechanism,\\n 'privacy_usage': serialize_privacy_usage(privacy_usage),\\n 'interpolation': interpolation\\n },\\n constraints=kwargs)\",\n \"def _get_percentile_cutoff(data, cutoff=None, percentile=None, required=False):\\n if percentile is not None:\\n if cutoff is not None:\\n raise ValueError(\\n \\\"Only one of `cutoff` and `percentile` should be given.\\\"\\n \\\"Got cutoff={}, percentile={}\\\".format(cutoff, percentile)\\n )\\n if not isinstance(percentile, numbers.Number):\\n return [_get_percentile_cutoff(data, percentile=p) for p in percentile]\\n if percentile < 1:\\n warnings.warn(\\n \\\"`percentile` expects values between 0 and 100.\\\"\\n \\\"Got {}. Did you mean {}?\\\".format(percentile, percentile * 100),\\n UserWarning,\\n )\\n cutoff = np.percentile(np.array(data).reshape(-1), percentile)\\n elif cutoff is None and required:\\n raise ValueError(\\\"One of either `cutoff` or `percentile` must be given.\\\")\\n return cutoff\",\n \"def kernel_quantile_heuristic(X, q=0.5):\\n pairwise_sq_dists = pdist(X, 'sqeuclidean')\\n quantile_heuristic_s2 = np.quantile(pairwise_sq_dists, q=q)\\n return quantile_heuristic_s2\",\n \"def test_check_data_specifying_percentiles(self):\\n expected_data = np.array(\\n [self.percentile_25, self.percentile_50, self.percentile_75]\\n )\\n result = Plugin().process(self.cube, percentiles=[25, 50, 75])\\n self.assertArrayAlmostEqual(result.data, expected_data, decimal=5)\",\n \"def transfo_quantile(xx):\\n\\n # nn = np.zeros(len(xx))\\n # oo = np.argsort(xx)\\n # nn[oo] = np.arange(len(xx)) / len(xx) + 1 / (2 * len(xx))\\n # return nn\\n\\n return rankdata(xx) / len(xx) - 1 / (2 * len(xx))\",\n \"def test_check_data_specifying_no_of_percentiles(self):\\n expected_data = np.array(\\n [self.percentile_25, self.percentile_50, self.percentile_75]\\n )\\n result = Plugin().process(self.cube, no_of_percentiles=3)\\n self.assertArrayAlmostEqual(result.data, expected_data, decimal=5)\",\n \"def test_check_data_specifying_single_percentile(self):\\n expected_data = np.array(self.percentile_25)\\n result = Plugin().process(self.cube, percentiles=[25])\\n self.assertArrayAlmostEqual(result.data, expected_data, decimal=5)\",\n \"def matlab_percentile(in_data, percentiles):\\n data = np.sort(in_data)\\n p_rank = 100.0 * (np.arange(data.size) + 0.5) / data.size\\n perc = np.interp(percentiles, p_rank, data, left=data[0], right=data[-1])\\n return perc\",\n \"def kempton_taylor_q(counts, lower_quantile=.25, upper_quantile=.75):\\n n = len(counts)\\n lower = int(ceil(n*lower_quantile))\\n upper = int(n*upper_quantile)\\n sorted = counts.copy()\\n sorted.sort()\\n return (upper-lower)/log(sorted[upper]/sorted[lower])\",\n \"def normalizeprctile(expdat,percent=80):\\n\\tparams=locals()\\n\\n\\t# select the bacteria to use - don't want to include very low freq. bacteria\\n\\tnewexp=hs.filterminreads(expdat,1*len(expdat.samples))\\n\\n\\tpercvals=np.percentile(newexp.data,percent,axis=0)\\n#\\tplt.figure()\\n#\\tplt.plot(percvals)\\n\\tpercvals=percvals/np.mean(percvals)\\n\\tnewexp=hs.copyexp(expdat)\\n\\tfor idx,samp in enumerate(expdat.samples):\\n\\t\\tnewexp.data[:,idx]=newexp.data[:,idx]*percvals[idx]\\n\\tnewexp.filters.append(\\\"normalize percentile %f\\\" % percent)\\n\\ths.addcommand(newexp,\\\"normalizeprctile\\\",params=params,replaceparams={'expdat':expdat})\\n\\n\\treturn newexp\",\n \"def trimean(data):\\n p_25, p_50, p_75 = percentile(data, [25, 50, 75], axis=0)\\n\\n return (p_25 + 2 * p_50 + p_75) / 4\",\n \"def get_percentile(data_list, score, kind='weak'):\\n n = len(data_list)\\n\\n if kind == 'strict':\\n return len([i for i in data_list if i < score]) / float(n) * 100\\n elif kind == 'weak':\\n return len([i for i in data_list if i <= score]) / float(n) * 100\\n elif kind == 'mean':\\n return (len([i for i in data_list if i < score]) + len([i for i in data_list if i <= score])) * 50 / float(n)\\n else:\\n raise ValueError(\\\"The kind kwarg must be 'strict', 'weak' or 'mean'. You can also opt to leave it out and rely on the default method.\\\")\",\n \"def quantileValues(data, device):\\n r = pd.DataFrame([])\\n if isinstance(data, pd.DataFrame) or isinstance(data, pd.Series):\\n minValue = data.min()\\n maxValue = data.max()\\n q1 = data.quantile(0.25)\\n # q2 = tmp['deltaSeconds'].quantile(0.5)\\n q3 = data.quantile(0.75)\\n QR = q3 - q1\\n upper = 1.5 * QR + q3\\n lower = q1 - 1.5 * QR\\n\\n elif isinstance(data, np.ndarray):\\n minValue = data.min()\\n maxValue = data.max()\\n q1 = np.percentile(data, 25)\\n # q2 = np.percentile(data, 50)\\n q3 = np.percentile(data, 75)\\n QR = q3 - q1\\n upper = 1.5 * QR + q3\\n lower = q1 - 1.5 * QR\\n r = (r.append(pd.DataFrame({'mac': device.mac, 'minValue': minValue,\\n 'maxValue': maxValue, 'lower': lower,\\n 'upper': upper, 'q1': q1, 'q3': q3},\\n index=[0]), ignore_index=True))\\n return r\",\n \"def percentile(scores, student_score):\\n scores = np.array(sorted(scores))\\n num_scores = len(scores)\\n return round(sum(scores <= student_score) / float(num_scores) * 100, 2)\",\n \"def percentile(data, statfxn, niter=10000, alpha=0.05):\\n\\n index = _make_boot_index(data.shape[0], niter)\\n boot_stats = statfxn(data[index], axis=-1)\\n\\n # compute the `alpha/2` and `1-alpha/2` percentiles of `boot_stats`\\n CI = numpy.percentile(boot_stats, [alpha * 50, 100 - (alpha * 50)], axis=0)\\n\\n return CI\",\n \"def PrivateQuantile(Z, q, eps, xmin, xmax):\\n\\n N = len(Z)\\n m = np.floor((N - 1) * q + 1.5)\\n Z[Z < xmin] = xmin\\n Z[Z > xmax] = xmax\\n Z_dict = {i: Z[i - 1] for i in range(1, len(Z) + 1)}\\n Z_dict[0] = np.min(Z) # see Du et al, I found Smith confusing\\n Z_dict[len(Z) + 1] = np.max(Z) # see Du et al, I found Smith confusing\\n\\n ps = []\\n prob_sum = 0\\n\\n for i in range(len(Z) + 1):\\n # p_i = (Z_dict[i+1] - Z_dict[i]) * np.exp(eps * Utility(m, i)) #du\\n p_i = (Z_dict[i + 1] - Z_dict[i]) * np.exp(-eps * np.abs(i - q * k)) # smith\\n prob_sum += p_i\\n ps.append(p_i)\\n\\n prob_vec = [p_i / prob_sum for p_i in ps]\\n j = np.random.choice(a=list(range(len(Z) + 1)), size=1, p=prob_vec)[0]\\n out = np.random.uniform(low=Z_dict[j], high=Z_dict[j + 1], size=1)\\n\\n return (out)\",\n \"def quantile(image, q, nonzero=True):\\n img_arr = image.numpy()\\n if isinstance(q, (list,tuple)):\\n q = [qq*100. if qq <= 1. else qq for qq in q]\\n if nonzero:\\n img_arr = img_arr[img_arr>0]\\n vals = [np.percentile(img_arr, qq) for qq in q]\\n return tuple(vals)\\n elif isinstance(q, (float,int)):\\n if q <= 1.:\\n q = q*100.\\n if nonzero:\\n img_arr = img_arr[img_arr>0]\\n return np.percentile(img_arr[img_arr>0], q)\\n else:\\n raise ValueError('q argument must be list/tuple or float/int')\",\n \"def test_percentile_kurtosis():\\n f = np.asarray([\\n [0.99, 1.0, 0.5, 0.52],\\n [0.69, 0.6, 0.61, 1.0]])\\n R = common_metrics.percentile_kurtosis(f, maximise=True)\\n expected = np.asarray(\\n [1.06382979, 5.0])\\n assert np.allclose(R, expected)\",\n \"def percentile(data, percentiles, weights=None):\\n # check if actually weighted percentiles is needed\\n if weights is None:\\n return np.percentile(data, list(percentiles))\\n if np.equal(weights, 1.).all():\\n return np.percentile(data, list(percentiles))\\n\\n # make sure percentiles are fractions between 0 and 1\\n if not np.greater_equal(percentiles, 0.0).all():\\n raise ValueError(\\\"Percentiles less than 0\\\")\\n if not np.less_equal(percentiles, 100.0).all():\\n raise ValueError(\\\"Percentiles greater than 100\\\")\\n\\n # Make sure data is in correct shape\\n shape = np.shape(data)\\n n = len(data)\\n if (len(shape) != 1):\\n raise ValueError(\\\"wrong data shape, expecting 1d\\\")\\n\\n if len(weights) != n:\\n print(n, len(weights))\\n raise ValueError(\\\"weights must be the same shape as data\\\")\\n if not np.greater_equal(weights, 0.0).all():\\n raise ValueError(\\\"Not all weights are non-negative.\\\")\\n\\n _data = np.asarray(data, dtype=float)\\n\\n if hasattr(percentiles, '__iter__'):\\n _p = np.asarray(percentiles, dtype=float) * 0.01\\n else:\\n _p = np.asarray([percentiles * 0.01], dtype=float)\\n\\n _wt = np.asarray(weights, dtype=float)\\n\\n len_p = len(_p)\\n sd = np.empty(n, dtype=float)\\n sw = np.empty(n, dtype=float)\\n aw = np.empty(n, dtype=float)\\n o = np.empty(len_p, dtype=float)\\n\\n i = np.argsort(_data)\\n np.take(_data, i, axis=0, out=sd)\\n np.take(_wt, i, axis=0, out=sw)\\n np.add.accumulate(sw, out=aw)\\n\\n if not aw[-1] > 0:\\n raise ValueError(\\\"Nonpositive weight sum\\\")\\n\\n w = (aw - 0.5 * sw) / aw[-1]\\n\\n spots = np.searchsorted(w, _p)\\n for (pk, s, p) in zip(range(len_p), spots, _p):\\n if s == 0:\\n o[pk] = sd[0]\\n elif s == n:\\n o[pk] = sd[n - 1]\\n else:\\n f1 = (w[s] - p) / (w[s] - w[s - 1])\\n f2 = (p - w[s - 1]) / (w[s] - w[s - 1])\\n o[pk] = sd[s - 1] * f1 + sd[s] * f2\\n return o\",\n \"def quartile(db: pd.DataFrame, col: str) -> pd.DataFrame:\\n _, bins = pd.qcut(x=db[col],\\n q=[0.25, 0.75], # [0.0, 0.25, 0.5, 0.75, 1.0],\\n retbins=True, duplicates='drop')\\n q1 = bins[0] # lower (first) quartile\\n q3 = bins[1] # upper (third) quartile\\n iqr = q3 - q1 # InterQuartile Range\\n lower_fence = (q1 - 1.5 * iqr)\\n upper_fence = (q3 + 1.5 * iqr)\\n db.loc[db[col] < lower_fence, col] = q1\\n db.loc[db[col] > upper_fence, col] = q3\\n return db\",\n \"def quantiles(self, q: int):\\n return self.dist.quantiles(q)\",\n \"def quantile(self, q: float) -> np.array:\\n assert 0 <= q <= 1\\n return np.array(\\n list(\\n chain.from_iterable(\\n model.predict(self.featurized_data, q)\\n for model in self.models\\n )\\n )\\n )\",\n \"def quantile(df):\\r\\n\\r\\n\\tdf_quantile_dict = dict()\\r\\n\\r\\n\\tfor i, col in enumerate(df.columns):\\r\\n\\t\\tdf_quantile_dict[col] = [df[col].quantile(0.25), df[col].quantile(0.5), df[col].quantile(0.75)]\\r\\n\\r\\n\\tdf_quantile = pd.DataFrame(df_quantile_dict, index=['Quantile (25%)', 'Quantile (50%)', 'Quantile (75%)'])\\r\\n\\tpd.set_option('precision', 2) # set output display precision in 2 decimal places\\r\\n\\r\\n\\treturn df_quantile\",\n \"def percentile(N, percent):\\n N.sort()\\n if not N:\\n return None\\n k = (len(N) - 1) * percent\\n f = math.floor(k)\\n c = math.ceil(k)\\n if f == c:\\n return N[int(k)]\\n d0 = N[int(f)] * (c - k)\\n d1 = N[int(c)] * (k - f)\\n return d0 + d1\",\n \"def compute_percentile(value, cutoffs):\\n\\tif value < cutoffs[0]:\\n\\t\\treturn 0.0\\n\\n\\tfor i, cutoff in enumerate(cutoffs):\\n\\t\\tif value < cutoff:\\n\\t\\t\\treturn math.floor(100 * (float(i)/(len(cutoffs))))\\n\\t\\t\\tbreak\\n\\treturn 100.0\",\n \"def calc_q1(data: list) -> float:\\n py = copy.copy(data)\\n py.sort()\\n return py[round(len(py) / 4)]\",\n \"def quantile(self, hypercube):\\n raise NotImplementedError()\",\n \"def quantile_corner(x, q, weights=None):\\n if weights is None:\\n return np.percentile(x, [100. * qi for qi in q])\\n else:\\n idx = np.argsort(x)\\n xsorted = x[idx]\\n cdf = np.add.accumulate(weights[idx])\\n cdf /= cdf[-1]\\n return np.interp(q, cdf, xsorted).tolist()\",\n \"def quantile(self, q, *, axis=0, **kwargs) -> \\\"Dataset\\\":\\n return self._quantile(q, axis=axis, func=np.quantile, **kwargs)\",\n \"def test_check_data_not_specifying_percentiles(self):\\n expected_data = np.array(\\n [self.percentile_25, self.percentile_50, self.percentile_75]\\n )\\n result = Plugin().process(self.cube)\\n self.assertArrayAlmostEqual(result.data, expected_data, decimal=5)\",\n \"def quantile(data, weights, quantile_limit):\\n data = np.asarray(data)\\n # TO DO: Allow to specify the axis\\n if data.ndim == 0:\\n raise TypeError(\\\"data must have at least one dimension\\\")\\n\\n elif data.ndim == 1:\\n return quantile_1d(data, weights, quantile_limit)\\n\\n # elif data.ndim > 1:\\n shape = data.shape\\n imr = data.reshape((np.prod(shape[:-1]), shape[-1]))\\n result = np.apply_along_axis(quantile_1d, -1, imr, weights, quantile_limit)\\n return result.reshape(shape[:-1])\",\n \"def quantile_1d(data, weights, quantile_limit):\\n data = np.asarray(data)\\n weights = np.asarray(weights)\\n if data.ndim != 1:\\n raise TypeError(\\\"data must be a one dimensional array\\\")\\n\\n if data.shape != weights.shape:\\n raise TypeError(\\\"the length of data and weights must be the same\\\")\\n\\n if not 0.0 <= quantile_limit <= 1.0:\\n raise ValueError(\\\"quantile must have a value between 0.0 and 1.0\\\")\\n\\n # Sort the data\\n ind_sorted = np.argsort(data)\\n sorted_data = data[ind_sorted]\\n notnan = ~np.isnan(sorted_data)\\n if np.count_nonzero(notnan) == 0:\\n return np.nan\\n\\n sorted_weights = np.nan_to_num(weights[ind_sorted][notnan])\\n\\n # Compute the auxiliary arrays\\n cuml_weights = np.cumsum(sorted_weights)\\n\\n # TO DO: Check that the weights do not sum zero\\n prob_normalized = (cuml_weights - 0.5 * sorted_weights) / np.sum(sorted_weights)\\n\\n # Get the value of the weighted median\\n return np.interp(quantile_limit, prob_normalized, sorted_data[notnan])\",\n \"def test_lots_of_probability_thresholds(self):\\n data = np.array(\\n [\\n [[2.9, 2.9, 2.9], [2.9, 2.9, 2.9], [2.9, 2.9, 2.9]],\\n [[14.5, 14.5, 14.5], [14.5, 14.5, 14.5], [14.5, 14.5, 14.5]],\\n [\\n [26.099998, 26.099998, 26.099998],\\n [26.099998, 26.099998, 26.099998],\\n [26.099998, 26.099998, 26.099998],\\n ],\\n ],\\n dtype=np.float32,\\n )\\n\\n input_probs = np.tile(np.linspace(1, 0, 30), (3, 3, 1)).T\\n cube = set_up_probability_cube(\\n input_probs.astype(np.float32),\\n np.arange(30).astype(np.float32),\\n threshold_units=\\\"degC\\\",\\n )\\n\\n result = Plugin()._probabilities_to_percentiles(cube, self.percentiles)\\n\\n self.assertArrayAlmostEqual(result.data, data)\",\n \"def quintile(self, ratio):\\n\\t\\tif ratio<=float(1)/float(5):\\n\\t\\t\\treturn 1\\n\\t\\telif ratio <= float(2)/float(5):\\n\\t\\t\\treturn 2\\n\\t\\telif ratio <= float(3)/float(5):\\n\\t\\t\\treturn 3\\n\\t\\telif ratio <= float(4)/float(5):\\n\\t\\t\\treturn 4\\n\\t\\telse:\\n\\t\\t\\treturn 5\",\n \"def percentile(N, percent):\\n if not N:\\n return None\\n k = (len(N)-1) * percent\\n f = math.floor(k)\\n c = math.ceil(k)\\n if f == c:\\n return N[int(k)]\\n d0 = N[int(f)] * (c-k)\\n d1 = N[int(c)] * (k-f)\\n return d0+d1\",\n \"def createQuantile(data, column_name, cut_of_point):\\r\\n data[data[column_name] > data[column_name].quantile(cut_of_point)] = 0\\r\\n return data\",\n \"def calc_percentile(self, p):\\n bounds = self.range_bins\\n r = []\\n v = []\\n for b in bounds:\\n d = self._get_data_distance(0., b)\\n if len(d) < 1:\\n continue\\n r.append(b)\\n v.append(np.percentile(d, p * 100.)) # percentile value\\n\\n r = np.asarray(r)\\n np.asarray(v)\\n\\n o = {'r': np.asarray(r), 'value': np.asarray(v)}\\n if 'percentiles' not in self.statistic.keys():\\n self.statistic.update({'percentiles': {}})\\n\\n self.statistic['percentiles'].update({p: o})\",\n \"def axis_distribution_ratio(data, cutoff, upper_or_lower=\\\"upper\\\"):\\n\\n count = 0\\n if upper_or_lower == \\\"upper\\\":\\n for a in data:\\n if a > cutoff:\\n count += 1\\n\\n elif upper_or_lower == \\\"lower\\\":\\n for a in data:\\n if a < cutoff:\\n count += 1\\n\\n ratio = count/len(data)\\n\\n return ratio\",\n \"def quantile(data, quantiles):\\r\\n\\r\\n assert isinstance(data, list) or isinstance(data, ndarray), \\\"Data must be either\\\" +\\\\\\r\\n \\\" a Python list or a NumPy 1-D array\\\"\\r\\n assert isinstance(quantiles, list) or isinstance(quantiles, ndarray), \\\"Quantiles\\\" +\\\\\\r\\n \\\" must be either a Python list or a NumPy 1-D array\\\"\\r\\n assert all(map(lambda x: x >= 0 and x <= 1, quantiles)), \\\"All the elements \\\" +\\\\\\r\\n \\\"in the quantiles list must be greater than 0 and lower than one\\\"\\r\\n\\r\\n # unless the user wanted, do not modify the data\\r\\n data = deepcopy(data)\\r\\n\\r\\n if not isinstance(data, ndarray):\\r\\n data = array(data)\\r\\n data.sort()\\r\\n\\r\\n output = []\\r\\n # if needed different quantile methods could be used\\r\\n for one_quantile in quantiles:\\r\\n output.append(_quantile(data, one_quantile))\\r\\n\\r\\n return output\",\n \"def _getPercentile(points, n, interpolate=False):\\n sortedPoints = sorted([ p for p in points if p is not None])\\n if len(sortedPoints) == 0:\\n return None\\n fractionalRank = (n/100.0) * (len(sortedPoints) + 1)\\n rank = int(fractionalRank)\\n rankFraction = fractionalRank - rank\\n\\n if not interpolate:\\n rank += int(math.ceil(rankFraction))\\n\\n if rank == 0:\\n percentile = sortedPoints[0]\\n elif rank - 1 == len(sortedPoints):\\n percentile = sortedPoints[-1]\\n else:\\n percentile = sortedPoints[rank - 1] # Adjust for 0-index\\n\\n if interpolate:\\n if rank != len(sortedPoints): # if a next value exists\\n nextValue = sortedPoints[rank]\\n percentile = percentile + rankFraction * (nextValue - percentile)\\n\\n return percentile\",\n \"def compute_quantile(risk, T_max: int, scenario_numbers, quantile):\\r\\n\\r\\n print(\\\"\\\\tComputing Quantile...\\\")\\r\\n # Init quantile\\r\\n q = np.zeros(T_max)\\r\\n for t in range(T_max):\\r\\n risk[t].sort()\\r\\n q[t] = risk[t][int(np.ceil(scenario_numbers[t] * quantile)) - 1]\\r\\n print(\\\"\\\\tDone\\\")\\r\\n\\r\\n return q\",\n \"def get_percentile(obs, bootstrap):\\n if np.isnan(obs):\\n return np.nan\\n else:\\n return np.searchsorted(np.sort(bootstrap), obs) / len(bootstrap)\",\n \"def test_simple_check_data_above(self):\\n expected = np.array([8.15384615, 9.38461538, 11.6])\\n expected = expected[:, np.newaxis, np.newaxis]\\n\\n data = np.array([0.95, 0.3, 0.05])\\n data = data[:, np.newaxis, np.newaxis]\\n\\n cube = set_up_probability_cube(\\n data.astype(np.float32), ECC_TEMPERATURE_THRESHOLDS, threshold_units=\\\"degC\\\"\\n )\\n\\n result = Plugin()._probabilities_to_percentiles(cube, self.percentiles)\\n self.assertArrayAlmostEqual(result.data, expected)\",\n \"def get_IQR(lst):\\n return (float(np.percentile(lst, 75)) - float(np.percentile(lst, 25)))\",\n \"def calc_iqr(sig):\\n # iqr = subtract(*percentile(sig, [75, 25]))\\n return np.percentile(sig, 75) - np.percentile(sig, 25)\",\n \"def ferdosi(data_points):\\n (N, _) = data_points.shape\\n twentieth = np.percentile(data_points, 20, axis=0)\\n eightieth = np.percentile(data_points, 80, axis=0)\\n sigmas = (eightieth - twentieth) / math.log(N)\\n return np.min(sigmas)\",\n \"def threshold_func(distribution: List[float], alpha: List[float], **kwargs) -> float:\\n threshold = np.quantile(distribution, q=alpha, interpolation=\\\"lower\\\", **kwargs)\\n return threshold\",\n \"def perc(data,percentile):\\n clip_value = np.percentile(data,percentile)\\n data = clip(data,clip_value)\\n return data\",\n \"def nrmse_ipercentile(self, q1=25, q2=75) -> float:\\n\\n q1 = np.percentile(self.true, q1)\\n q3 = np.percentile(self.true, q2)\\n iqr = q3 - q1\\n\\n return float(self.rmse() / iqr)\",\n \"def iqr(self, arr):\\n a = np.asarray(arr)\\n self.q1 = stats.scoreatpercentile(a, 25)\\n self.q2 = stats.scoreatpercentile(a, 50)\\n self.q3 = stats.scoreatpercentile(a, 75)\",\n \"def basic_stats(data):\\n if isinstance(data, pd.DataFrame):\\n return data.describe(percentiles=[0.5]).T.drop(['50%'], axis=1)\\n else:\\n return data.to_frame().describe(percentiles=[0.5]).T.drop(['50%'], axis=1)\",\n \"def get_percentile_from_freq(\\n freq: pd.Series,\\n p: float = 0.5,\\n ascending: bool = False,\\n include_boundary: Union[bool, None] = None,\\n) -> pd.Series:\\n freq = freq.sort_values(ascending=ascending)\\n cutoff_idx = (freq.cumsum() >= p * freq.sum()).idxmax()\\n\\n if include_boundary is None:\\n if ascending:\\n # If your looking at the smallest, if there is a large\\n # jump in count, you will get way too much of the data\\n # so probably *dont*\\n include_boundary = False\\n else:\\n # If you're looking at the topx largest, you probably want\\n # to *include* the count just larger than the sum (because)\\n # this is probably a large proportion of the total count\\n include_boundary = True\\n if include_boundary:\\n return freq.loc[:cutoff_idx]\\n return freq.loc[:cutoff_idx].iloc[:-1]\",\n \"def test_create_quantile(self):\\n quantile = pmp.utils.create_quantile(0.5, 4.0)\\n self.assertIsInstance(quantile, pmp.Quantile)\",\n \"def percentile(data, qval, labels=None, index=None):\\n data = np.asanyarray(data)\\n\\n def single_group(vals):\\n return np.percentile(vals, qval)\\n\\n if labels is None:\\n return single_group(data)\\n\\n # ensure input and labels match sizes\\n data, labels = np.broadcast_arrays(data, labels)\\n\\n if index is None:\\n mask = labels > 0\\n return single_group(data[mask])\\n\\n if np.isscalar(index):\\n mask = labels == index\\n return single_group(data[mask])\\n\\n # remap labels to unique integers if necessary, or if the largest\\n # label is larger than the number of values.\\n if (\\n not _safely_castable_to_int(labels.dtype)\\n or labels.min() < 0\\n or labels.max() > labels.size\\n ):\\n # remap labels, and indexes\\n unique_labels, labels = np.unique(labels, return_inverse=True)\\n idxs = np.searchsorted(unique_labels, index)\\n\\n # make all of idxs valid\\n idxs[idxs >= unique_labels.size] = 0\\n found = unique_labels[idxs] == index\\n else:\\n # labels are an integer type, and there aren't too many.\\n idxs = np.asanyarray(index, int).copy()\\n found = (idxs >= 0) & (idxs <= labels.max())\\n\\n idxs[~found] = labels.max() + 1\\n\\n # reorder data and labels, first by labels, then by data\\n order = np.lexsort((data.ravel(), labels.ravel()))\\n data = data.ravel()[order]\\n labels = labels.ravel()[order]\\n\\n locs = np.arange(len(labels))\\n lo = np.zeros(labels.max() + 2, int)\\n lo[labels[::-1]] = locs[::-1]\\n hi = np.zeros(labels.max() + 2, int)\\n hi[labels] = locs\\n lo = lo[idxs]\\n hi = hi[idxs]\\n # lo is an index to the lowest value in input for each label,\\n # hi is an index to the largest value.\\n\\n # here starts the part that really diverts from scipy's median finder; the\\n # linear interpolation method used corresponds to the default behaviour of\\n # np.percentile().\\n size = hi - lo + 1 # size of the group\\n frac = (size - 1) * (qval / 100) # fractional index relative to lo\\n hi = lo - np.int64(-frac // 1) # ceiled absolute index to data\\n lo = lo + np.int64(frac // 1) # floored absolute index to data\\n part = frac % 1 # fractional part of index\\n return (data[lo] + part * (data[hi] - data[lo])).tolist()\",\n \"def quantile(data, alpha, candidates=None, interpolation=\\\"midpoint\\\", **kwargs):\\n return Component(\\n \\\"Quantile\\\",\\n arguments={\\n 'data': Component.of(data),\\n 'candidates': Component.of(candidates)\\n },\\n options={\\n 'alpha': alpha,\\n 'interpolation': interpolation\\n },\\n constraints=kwargs)\",\n \"def calculate_cornish_fisher_percentile(alpha, mu, sigma, skew, kurt):\\n\\n z = stats.norm.ppf(alpha)\\n he2 = np.polynomial.hermite_e.hermeval(z, [0.0, 0.0, 1.0])\\n he3 = np.polynomial.hermite_e.hermeval(z, [0.0, 0.0, 0.0, 1.0])\\n he13 = np.polynomial.hermite_e.hermeval(z, [0.0, -1.0, 0.0, -2.0])\\n\\n w = (z +\\n he2 * skew / 6 +\\n he3 * kurt / 24 +\\n he13 * (skew ** 2) / 36)\\n\\n return mu + sigma * w\",\n \"def quantile(self, axis: str = 'rows', q: float = 0.5) -> 'DataFrame':\\n if not utils.is_number(q):\\n raise TypeError('`q` must be a number between 0 and 1')\\n if q < 0 or q > 1:\\n raise ValueError('`q` must be between 0 and 1')\\n return self._stat_funcs('quantile', axis, q=q)\",\n \"def percentile(self, p=None):\\n if p is None:\\n raise ValueError(\\\"Please supply p\\\")\\n\\n if type(p) not in [int, float]:\\n raise TypeError(\\\"p is a \\\" + str(type(p)) + \\\", not int or float\\\")\\n\\n if (p < 0) or (p > 100):\\n raise ValueError(\\\"p: \\\" + str(p) + \\\" is not between 0 and 100!\\\")\\n\\n self.run()\\n\\n new_files = []\\n new_commands = []\\n for ff in self:\\n target = temp_file(\\\"nc\\\")\\n\\n cdo_command = (\\n \\\"cdo -timpctl,\\\"\\n + str(p)\\n + \\\" \\\"\\n + ff\\n + \\\" -timmin \\\"\\n + ff\\n + \\\" -timmax \\\"\\n + ff\\n + \\\" \\\"\\n + target\\n )\\n\\n cdo_command = tidy_command(cdo_command)\\n target = run_cdo(cdo_command, target)\\n new_files.append(target)\\n new_commands.append(cdo_command)\\n\\n self.history += new_commands\\n self._hold_history = copy.deepcopy(self.history)\\n\\n self.current = new_files\\n\\n cleanup()\",\n \"def quantiles(x, qlist=[2.5, 25, 50, 75, 97.5]):\\n # Make a copy of trace\\n x = x.copy()\\n\\n # For multivariate node\\n if x.ndim > 1:\\n # Transpose first, then sort, then transpose back\\n sx = np.transpose(np.sort(np.transpose(x)))\\n else:\\n # Sort univariate node\\n sx = np.sort(x)\\n\\n try:\\n # Generate specified quantiles\\n quants = [sx[int(len(sx) * q / 100.0)] for q in qlist]\\n\\n return dict(zip(qlist, quants))\\n\\n except IndexError:\\n print(\\\"Too few elements for quantile calculation\\\")\",\n \"def performance_quantiles(data, performance_measure):\\n quantiles = pd.qcut(x=data[performance_measure], q=4, labels=['q1', 'q2', 'q3', 'q4'])\\n bins = quantiles.to_frame(name=performance_measure + '_quantiles')\\n data_quantiles = pd.merge(data, bins, right_index=True, left_index=True)\\n data_quantiles.dropna(inplace=True)\\n data_quantiles.sort_values(performance_measure + '_quantiles', inplace=True)\\n return data_quantiles\",\n \"def printProbability(p):\\n if p > .0000001:\\n return \\\"%9.6f%%\\\" % (p * 100)\\n else:\\n return \\\"%9.3e\\\" % (p)\",\n \"def quantile(series: Sequence, quantile: Union[None, float] = None):\\n if quantile is None:\\n try:\\n last, series = series[-1], series[:-1]\\n return np.mean(series < last)\\n except IndexError:\\n return np.nan\\n assert 0 <= quantile <= 1, \\\"quantile must be within [0, 1]\\\"\\n return np.nanpercentile(series, quantile * 100)\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.72270185","0.7012418","0.6803648","0.67029893","0.67029893","0.669614","0.6685391","0.65556973","0.65500534","0.65500534","0.65500534","0.64803755","0.64564687","0.64286137","0.64046985","0.6381233","0.6363074","0.636056","0.6354891","0.63055617","0.6262271","0.62104005","0.61781657","0.61349875","0.61099523","0.60976803","0.6073696","0.6039872","0.5991325","0.598613","0.59652305","0.59274745","0.5917163","0.5900064","0.58929324","0.5889406","0.5865979","0.5853466","0.5847741","0.5846151","0.583102","0.5823016","0.5818445","0.5810179","0.5804896","0.5794636","0.57916933","0.5786017","0.5782249","0.5769046","0.5763376","0.5760332","0.57261485","0.5719482","0.57137287","0.5702018","0.5699559","0.5690979","0.5666378","0.56658685","0.56628805","0.56587875","0.5655953","0.56516045","0.56288034","0.55750257","0.55749226","0.5543568","0.55390424","0.5536854","0.5533037","0.5526286","0.55258083","0.55214494","0.55123323","0.5504404","0.55030763","0.54941225","0.54913145","0.54886734","0.54862607","0.5483289","0.5471594","0.5470774","0.546778","0.54423887","0.5440931","0.5429077","0.5422745","0.54194427","0.5417265","0.5412508","0.54115266","0.54070294","0.54031116","0.53886133","0.53788406","0.53779006","0.53677","0.5367047"],"string":"[\n \"0.72270185\",\n \"0.7012418\",\n \"0.6803648\",\n \"0.67029893\",\n \"0.67029893\",\n \"0.669614\",\n \"0.6685391\",\n \"0.65556973\",\n \"0.65500534\",\n \"0.65500534\",\n \"0.65500534\",\n \"0.64803755\",\n \"0.64564687\",\n \"0.64286137\",\n \"0.64046985\",\n \"0.6381233\",\n \"0.6363074\",\n \"0.636056\",\n \"0.6354891\",\n \"0.63055617\",\n \"0.6262271\",\n \"0.62104005\",\n \"0.61781657\",\n \"0.61349875\",\n \"0.61099523\",\n \"0.60976803\",\n \"0.6073696\",\n \"0.6039872\",\n \"0.5991325\",\n \"0.598613\",\n \"0.59652305\",\n \"0.59274745\",\n \"0.5917163\",\n \"0.5900064\",\n \"0.58929324\",\n \"0.5889406\",\n \"0.5865979\",\n \"0.5853466\",\n \"0.5847741\",\n \"0.5846151\",\n \"0.583102\",\n \"0.5823016\",\n \"0.5818445\",\n \"0.5810179\",\n \"0.5804896\",\n \"0.5794636\",\n \"0.57916933\",\n \"0.5786017\",\n \"0.5782249\",\n \"0.5769046\",\n \"0.5763376\",\n \"0.5760332\",\n \"0.57261485\",\n \"0.5719482\",\n \"0.57137287\",\n \"0.5702018\",\n \"0.5699559\",\n \"0.5690979\",\n \"0.5666378\",\n \"0.56658685\",\n \"0.56628805\",\n \"0.56587875\",\n \"0.5655953\",\n \"0.56516045\",\n \"0.56288034\",\n \"0.55750257\",\n \"0.55749226\",\n \"0.5543568\",\n \"0.55390424\",\n \"0.5536854\",\n \"0.5533037\",\n \"0.5526286\",\n \"0.55258083\",\n \"0.55214494\",\n \"0.55123323\",\n \"0.5504404\",\n \"0.55030763\",\n \"0.54941225\",\n \"0.54913145\",\n \"0.54886734\",\n \"0.54862607\",\n \"0.5483289\",\n \"0.5471594\",\n \"0.5470774\",\n \"0.546778\",\n \"0.54423887\",\n \"0.5440931\",\n \"0.5429077\",\n \"0.5422745\",\n \"0.54194427\",\n \"0.5417265\",\n \"0.5412508\",\n \"0.54115266\",\n \"0.54070294\",\n \"0.54031116\",\n \"0.53886133\",\n \"0.53788406\",\n \"0.53779006\",\n \"0.53677\",\n \"0.5367047\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.7864236"},"document_rank":{"kind":"string","value":"0"}}},{"rowIdx":6096,"cells":{"query":{"kind":"string","value":"Downloads a YouTube video by its unique id."},"document":{"kind":"string","value":"def youtube_download_by_id(id, title=None, output_dir='.', merge=True, info_only=False):\n \n raw_video_info = get_content('http://www.youtube.com/get_video_info?video_id=%s' % id)\n video_info = parse.parse_qs(raw_video_info)\n \n if video_info['status'] == ['ok'] and ('use_cipher_signature' not in video_info or video_info['use_cipher_signature'] == ['False']):\n title = parse.unquote_plus(video_info['title'][0])\n stream_list = parse.parse_qs(raw_video_info)['url_encoded_fmt_stream_map'][0].split(',')\n \n else:\n # Parse video page when video_info is not usable.\n video_page = get_content('http://www.youtube.com/watch?v=%s' % id)\n ytplayer_config = json.loads(match1(video_page, r'ytplayer.config\\s*=\\s*([^\\n]+);'))\n \n title = ytplayer_config['args']['title']\n stream_list = ytplayer_config['args']['url_encoded_fmt_stream_map'].split(',')\n \n streams = {\n parse.parse_qs(stream)['itag'][0] : parse.parse_qs(stream)\n for stream in stream_list\n }\n \n for codec in yt_codecs:\n itag = str(codec['itag'])\n if itag in streams:\n download_stream = streams[itag]\n break\n \n url = download_stream['url'][0]\n if 'sig' in download_stream:\n sig = download_stream['sig'][0]\n else:\n sig = decrypt_signature(download_stream['s'][0])\n url = '%s&signature=%s' % (url, sig)\n \n type, ext, size = url_info(url)\n \n print_info(site_info, title, type, size)\n if not info_only:\n download_urls([url], title, ext, size, output_dir, merge = merge)"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["def download(idd, path):\n print(f'[{script}]: Downloading YT video \"{idd}\"...') if verbosity >= 1 else None\n\n try:\n yt = pytube.YouTube(\"https://www.youtube.com/watch?v=\" + idd)\n stream = yt.streams.filter(progressive=True).first()\n stream.download(path, filename=idd)\n except Exception:\n print(f'[{script}]: Failed download of YT video \"{idd}\".')\n return None\n\n data = {\n \"idd\": idd,\n \"abr\": stream.abr,\n \"acodec\": stream.audio_codec,\n \"bitrate\": stream.bitrate,\n \"codecs\": stream.codecs,\n \"fps\": stream.fps,\n \"mime\": stream.mime_type,\n \"res\": stream.resolution,\n \"vcodec\": stream.video_codec,\n \"size\": stream._filesize,\n \"frames\": stream.fps * yt.length,\n }\n\n file_path = path + \"/\" + data[\"idd\"] + \".mp4\"\n print(\n f'[{script}]: Download successful. Saved to \"{file_path}\".'\n ) if verbosity >= 2 else None\n return data","def get_video(self, video_id):\n uri = 'videos/' + video_id\n return self.make_request(uri)","def download_video(self, url):\n yt = YouTube(url)\n yt_filtered = yt.streams.filter(progressive=True, file_extension=\"mp4\")\n yt_resolutions = yt_filtered.order_by(\"resolution\")\n\n # Downloads the first video that fits the description\n video = yt_resolutions.desc().first()\n video.download()\n\n # Returns the filename\n return video.default_filename","def get_youtube_video_url(video_id):\n url = \"https://www.youtube.com/watch?v=\" + video_id\n return url","def download_from_youtube():\n linkinput = input(\"Enter the url you want to download: \")\n youtube_object = Youtube(linkinput)\n youtube_object.youtube()","def get_video_by_id():\n sample_id = demisto.getArg('id')\n r = req('GET', SUB_API + 'samples/' + sample_id + '/video.webm')\n ec = {'ThreatGrid.Sample.Id': sample_id}\n demisto.results([\n {\n 'Type': entryTypes['note'],\n 'EntryContext': ec,\n 'HumanReadable': '### ThreatGrid Sample Run Video File -\\n'\n + 'Your sample run video file download request has been completed successfully for '\n + sample_id,\n 'Contents': ec,\n 'ContentsFormat': formats['json']\n },\n fileResult(sample_id + '.webm', r.content)\n ])","def get_yt_video(yt_url):\n\n ydl_opts = {\n 'format': 'bestaudio/best',\n 'postprocessors': [{\n 'key': 'FFmpegExtractAudio',\n 'preferredcodec': 'mp3',\n 'preferredquality': '192',\n }],\n 'outtmpl': '%(id)s.%(ext)s'\n }\n ydl = youtube_dl.YoutubeDL(ydl_opts)\n\n with ydl:\n result = ydl.extract_info(\n #'http://www.youtube.com/watch?v=BaW_jenozKc',\n yt_url,\n download=True # We just want to extract the info\n )\n\n if 'entries' in result:\n # Can be a playlist or a list of videos\n video = result['entries'][0]\n else:\n # Just a video\n video = result\n\n return video","def play_youtube(self, media_id):\n pass","def movieid_first_video_url(self, movie_id):\n YOUTUBE_URL = \"https://www.youtube.com/watch?v=\"\n VIDEOS_URL = \"https://api.themoviedb.org/3/movie/%s/videos\"\n url_with_movieid = VIDEOS_URL % (movie_id)\n parm_dict = {\"api_key\": self.api_key, \"language\": self.language}\n url = url_with_movieid + \"?\" + urlencode(parm_dict, doseq=True)\n # print url\n\n response = requests.get(url)\n json_dict = json.loads(response.text)\n response.close()\n\n youtube_video_key = json_dict['results'][0]['key']\n return YOUTUBE_URL + youtube_video_key","async def get_video(videoid):\n\theaders = {\n\t\t'Client-ID': config['twitch_clientid'],\n\t\t'Authorization': f\"Bearer {get_token()}\",\n\t}\n\tdata = await common.http.request_coro(\"https://api.twitch.tv/helix/videos\", {\"id\": videoid.lstrip('v')}, headers=headers)\n\treturn json.loads(data)[\"data\"][0]","def url(yt_id: str) -> str:\n return \"https://www.youtube.com/watch?v={}\".format(yt_id)","def youtube_download(url, output_dir='.', merge=True, info_only=False):\n \n id = match1(url, r'youtu.be/([^/]+)') or parse_query_param(url, 'v')\n assert id\n \n youtube_download_by_id(id, title=None, output_dir=output_dir, merge=merge, info_only=info_only)","def get_video(lesson_id, video_id):\n url = '{0}?cat={1}&video={2}'.format(BASE_URL, lesson_id, video_id)\n page = requests.get(url, verify=False)\n soup = BeautifulSoup(page.content)\n return soup.find('iframe')['src'].split('/')[-1]","def play_youtube(self, media_id):\n raise NotImplementedError()","def fetch_youtube_url(search_term, dev_key=None):\r\n in_cache, video_id = check_if_in_cache(search_term)\r\n if in_cache:\r\n return YOUTUBE_VIDEO_URL + video_id\r\n if not dev_key:\r\n YOUTUBE_SEARCH_BASE = \"https://www.youtube.com/results?search_query=\"\r\n try:\r\n response = requests.get(YOUTUBE_SEARCH_BASE + search_term).content\r\n html_response = html.fromstring(response)\r\n video = html_response.xpath(\"//a[contains(@class, 'yt-uix-tile-link')]/@href\")\r\n video_id = re.search(\"((\\?v=)[a-zA-Z0-9_-]{4,15})\", video[0]).group(0)[3:]\r\n log.debug(f\"Found video id {video_id} for search term {search_term}\")\r\n _ = save_to_cache(search_term=search_term, video_id=video_id)\r\n return YOUTUBE_VIDEO_URL + video_id\r\n except AttributeError as e:\r\n log.warning(f\"Could not find scrape details for {search_term}\")\r\n capture_exception(e)\r\n return None\r\n except IndexError as e:\r\n log.warning(f\"Could not perform scrape search for {search_term}, got a different HTML\")\r\n capture_exception(e)\r\n return None\r\n else:\r\n youtube = build(YOUTUBE_API_SERVICE_NAME, YOUTUBE_API_VERSION,\r\n developerKey=dev_key,\r\n cache_discovery=False)\r\n try:\r\n in_cache, video_id = check_if_in_cache(search_term)\r\n\r\n if not in_cache:\r\n search_response = youtube.search().list(q=search_term,\r\n part='id, snippet').execute()\r\n for v in search_response['items']:\r\n if v['id']['kind'] == VIDEO:\r\n video_id = v['id']['videoId']\r\n log.debug(f\"Adding Video id {video_id}\")\r\n _ = save_to_cache(search_term=search_term, video_id=video_id) \r\n return YOUTUBE_VIDEO_URL + video_id\r\n except HttpError as err:\r\n err_details = loads(err.content.decode('utf-8')).get('error').get('errors')\r\n secho(\"Couldn't complete search due to following errors: \", fg='red')\r\n for e in err_details:\r\n error_reason = e.get('reason')\r\n error_domain = e.get('domain')\r\n error_message = e.get('message')\r\n\r\n if error_reason == 'quotaExceeded' or error_reason == 'dailyLimitExceeded':\r\n secho(f\"\\tYou're over daily allowed quota. Unfortunately, YouTube restricts API keys to a max of 10,000 requests per day which translates to a maximum of 100 searches.\", fg='red')\r\n secho(f\"\\tThe quota will be reset at midnight Pacific Time (PT).\" ,fg='red')\r\n secho(f\"\\tYou can request for Quota increase from https://console.developers.google.com/apis/api/youtube.googleapis.com/quotas.\", fg='red')\r\n else:\r\n secho(f\"\\t Search failed due to {error_domain}:{error_reason}, message: {error_message}\")\r\n return None","def test_task_video_download(url_to_video: str, empty_video_resource: VideoResource):\n download_video(url_to_video, empty_video_resource.id)\n empty_video_resource.refresh_from_db()\n video_instance = empty_video_resource.videos.filter(primary=True).first()\n\n assert empty_video_resource.videos.all()\n assert video_instance.extension == 'mp4'\n assert video_instance.primary\n for item in video_instance.video.open():\n assert item","async def youtube(self, ctx, *args):\n if not args:\n await ctx.send(\"usage: `>youtube [search string]`\")\n return\n search_string = \" \".join(args)\n search_string = urllib.parse.urlencode({'search_query': search_string})\n response = requests.get('http://www.youtube.com/results?' + search_string + \"&hl=en_US&app=desktop\")\n if response.status_code == 200:\n search_results = re.findall('href=\\\\\"\\\\/watch\\\\?v=(.{11})', response.content.decode())\n try:\n first_result_url = 'http://www.youtube.com/watch?v=' + search_results[0]\n except IndexError:\n with open('downloads/yt_dump.txt', 'w') as f:\n f.write(response.content.decode())\n #print(response.is_redirect)\n return await ctx.send(\"Found nothing!\")\n await ctx.send(first_result_url)\n self.logger.info(misolog.format_log(ctx, f\"{first_result_url}\"))\n else:\n await ctx.send(\"Error: status code \" + str(response.status_code))\n self.logger.info(misolog.format_log(ctx, f\"error{response.status_code}\"))","async def get_youtube_video(self, ctx, *, query):\n\n if not query:\n return await ctx.send(\"Go on, search something.\")\n\n # Executor for sync function\n video_list = await self.bot.loop.run_in_executor(None, YouTube.sync_get_youtube_video, query)\n\n if not video_list:\n return await ctx.say(f\"Sorry, couldn't find anything for `{query}`\")\n\n # Return top hit\n await ctx.send(f'{video_list[0][\"video_url\"]}')","async def download_video(v_url):\n reply = await v_url.get_reply_message()\n if v_url.pattern_match.group(2) != \"\":\n url = v_url.pattern_match.group(2)\n elif reply is not None:\n url = reply.message\n url = re.findall(r\"\\bhttps?://.*\\.\\S+\", reply.message)[0]\n else:\n return\n type = (\n v_url.pattern_match.group(1).lower()\n if v_url.pattern_match.group(1) is not None\n else \"a\"\n )\n await v_url.edit(\"`Preparing to download...`\")\n out_folder = Config.TMP_DOWNLOAD_DIRECTORY + \"youtubedl/\"\n Config.TMP_DOWNLOAD_DIRECTORY + \"/thumb_image.jpg\"\n if not os.path.isdir(out_folder):\n os.makedirs(out_folder)\n if type == \"a\":\n opts = {\n \"format\": \"bestaudio\",\n \"addmetadata\": True,\n \"noplaylist\": False,\n \"key\": \"FFmpegMetadata\",\n \"writethumbnail\": True,\n \"embedthumbnail\": True,\n \"prefer_ffmpeg\": True,\n \"geo_bypass\": True,\n \"nocheckcertificate\": True,\n \"postprocessors\": [\n {\n \"key\": \"FFmpegExtractAudio\",\n \"preferredcodec\": \"mp3\",\n \"preferredquality\": \"320\",\n }\n ],\n \"outtmpl\": out_folder + \"%(title)s.%(ext)s\",\n \"quiet\": True,\n \"logtostderr\": False,\n }\n video = False\n song = True\n\n elif type == \"v\":\n opts = {\n \"format\": \"best\",\n \"addmetadata\": True,\n \"noplaylist\": False,\n \"getthumbnail\": True,\n \"embedthumbnail\": True,\n \"xattrs\": True,\n \"writethumbnail\": True,\n \"key\": \"FFmpegMetadata\",\n \"prefer_ffmpeg\": True,\n \"geo_bypass\": True,\n \"nocheckcertificate\": True,\n \"postprocessors\": [\n {\"key\": \"FFmpegVideoConvertor\", \"preferedformat\": \"mp4\"},\n ],\n \"outtmpl\": out_folder + \"%(title)s.%(ext)s\",\n \"logtostderr\": False,\n \"quiet\": True,\n }\n song = False\n video = True\n\n try:\n await v_url.edit(\"`Fetching playlist data, please wait..`\")\n with YoutubeDL(opts) as ytdl:\n ytdl.extract_info(url)\n # print(ytdl_data['thumbnail'])\n filename = sorted(get_lst_of_files(out_folder, []))\n except DownloadError as DE:\n await v_url.edit(f\"`{str(DE)}`\")\n return\n except ContentTooShortError:\n await v_url.edit(\"`The download content was too short.`\")\n return\n except GeoRestrictedError:\n await v_url.edit(\n \"`Video is not available from your geographic location due to geographic restrictions imposed by a website.`\"\n )\n return\n except MaxDownloadsReached:\n await v_url.edit(\"`Max-downloads limit has been reached.`\")\n return\n except PostProcessingError:\n await v_url.edit(\"`There was an error during post processing.`\")\n return\n except UnavailableVideoError:\n await v_url.edit(\"`Media is not available in the requested format.`\")\n return\n except XAttrMetadataError as XAME:\n await v_url.edit(f\"`{XAME.code}: {XAME.msg}\\n{XAME.reason}`\")\n return\n except ExtractorError:\n await v_url.edit(\"`There was an error during info extraction.`\")\n return\n except Exception as e:\n await v_url.edit(f\"{str(type(e)): {str(e)}}\")\n return\n c_time = time.time()\n await v_url.edit(\"`YouTube Playlist Downloading Processing Now.\\nPlease Wait!`\")\n if song:\n for single_file in filename:\n if os.path.exists(single_file):\n caption_rts = os.path.basename(single_file)\n force_document = True\n supports_streaming = False\n document_attributes = []\n if single_file.endswith((\".mp4\", \".mp3\", \".flac\", \".webm\")):\n metadata = extractMetadata(createParser(single_file))\n duration = 0\n width = 0\n height = 180\n if metadata.has(\"duration\"):\n duration = metadata.get(\"duration\").seconds\n document_attributes = [\n DocumentAttributeVideo(\n duration=duration,\n w=width,\n h=height,\n round_message=False,\n supports_streaming=True,\n )\n ]\n try:\n ytdl_data_name_audio = os.path.basename(single_file)\n thumb = (\n out_folder\n + ytdl_data_name_audio[: (len(ytdl_data_name_audio) - 4)]\n + \".jpg\"\n )\n print(ytdl_data_name_audio)\n file_path = single_file\n song_size = file_size(file_path)\n await v_url.client.send_file(\n v_url.chat_id,\n single_file,\n caption=f\"`{ytdl_data_name_audio}`\"\n + \"\\n\"\n + f\"Size👉 {song_size}\",\n force_document=force_document,\n supports_streaming=supports_streaming,\n allow_cache=False,\n thumb=thumb,\n reply_to=v_url.message.id,\n attributes=document_attributes,\n progress_callback=lambda d, t: asyncio.get_event_loop().create_task(\n progress(\n d,\n t,\n v_url,\n c_time,\n \"Uploading..\",\n f\"{ytdl_data_name_audio}\",\n )\n ),\n )\n # os.remove(thumb)\n except Exception as e:\n await v_url.client.send_message(\n v_url.chat_id,\n \"{} caused `{}`\".format(caption_rts, str(e)),\n )\n continue\n os.remove(single_file)\n await asyncio.sleep(DELETE_TIMEOUT)\n # await v_url.delete()\n shutil.rmtree(out_folder)\n if video:\n for single_file in filename:\n if os.path.exists(single_file):\n caption_rts = os.path.basename(single_file)\n force_document = False\n supports_streaming = True\n document_attributes = []\n if single_file.endswith((\".mp4\", \".mp3\", \".flac\", \".webm\")):\n metadata = extractMetadata(createParser(single_file))\n duration = 0\n width = 0\n height = 0\n if metadata.has(\"duration\"):\n duration = metadata.get(\"duration\").seconds\n document_attributes = [\n DocumentAttributeVideo(\n duration=duration,\n w=width,\n h=height,\n round_message=False,\n supports_streaming=True,\n )\n ]\n # print(ytdl_data)\n # for file in os.listdir(\"./DOWNLOADS/youtubedl/\"):\n # if file.endswith(\".jpg\"):\n # thumb = \"./DOWNLOADS/youtubedl/\" + file\n # print(os.path.join(\"./DOWNLOADS/youtubedl/\", file))\n # image_link = ytdl_data['thumbnail']\n # downloaded_image = wget.download(image_link,out_folder)\n # thumb = ytdl_data_name_video + \".jpg\"\n file_path = single_file\n video_size = file_size(file_path)\n try:\n ytdl_data_name_video = os.path.basename(single_file)\n thumb = (\n out_folder\n + ytdl_data_name_video[: (len(ytdl_data_name_video) - 4)]\n + \".jpg\"\n )\n await v_url.client.send_file(\n v_url.chat_id,\n single_file,\n caption=f\"`{ytdl_data_name_video}`\"\n + \"\\n\"\n + f\"Size👉 {video_size}\",\n force_document=force_document,\n supports_streaming=supports_streaming,\n thumb=thumb,\n allow_cache=False,\n reply_to=v_url.message.id,\n attributes=document_attributes,\n progress_callback=lambda d, t: asyncio.get_event_loop().create_task(\n progress(\n d,\n t,\n v_url,\n c_time,\n \"Uploading..\",\n f\"{ytdl_data_name_video}\",\n )\n ),\n )\n # os.remove(thumb)\n except Exception as e:\n await v_url.client.send_message(\n v_url.chat_id,\n \"{} caused `{}`\".format(caption_rts, str(e)),\n )\n continue\n os.remove(single_file)\n await asyncio.sleep(DELETE_TIMEOUT)\n # await v_url.delete()\n shutil.rmtree(out_folder)","def get_video(self, video_id):\n return self._videos.get(video_id, None)","async def retrieveJS(self, videoId=None):\n session = await self.getSession\n resp = await session.get(\"https://www.youtube.com/iframe_api\")\n # if resp.status == 200 and","def download_video(self, file_path, video_url, video_creation_time):\r\n logger.debug(\"Downloading video created at \" + _format_timestamp_iso(self.tz, video_creation_time) + \" from \"\r\n + video_url + \" to \" + file_path)\r\n failed = False\r\n try:\r\n self._download_with_api(file_path, video_url)\r\n except Exception as e:\r\n logger.debug(\"Video download failed using TikTokApi: \" + str(e))\r\n failed = True\r\n if not os.path.isfile(file_path):\r\n failed = True\r\n logger.debug(\"No file was created by TikTokApi at \" + file_path)\r\n elif os.stat(file_path).st_size < 1024:\r\n failed = True\r\n try:\r\n os.remove(file_path)\r\n logger.debug(\"Deleted malformed TikTokApi download at \" + file_path)\r\n except Exception as ee:\r\n logger.error(\"Unable to delete malformed TikTokApi download at \" + str(ee))\r\n if failed:\r\n sleep_time = random.uniform(self.sleep_min, self.sleep_max)\r\n logger.info(\"Sleeping for: \" + str(sleep_time) + \" seconds\")\r\n sleep(sleep_time)\r\n try:\r\n logger.debug(\"Falling back to YouTube-dl\")\r\n self.fallback_counter += 1\r\n self._download_with_ytdl(file_path, video_url)\r\n if not os.path.isfile(file_path):\r\n raise AssertionError(\"No file was created by YouTube-dl at \" + file_path)\r\n elif os.stat(file_path).st_size < 1024:\r\n try:\r\n os.remove(file_path)\r\n logger.debug(\"Deleted malformed YouTube-dl download at \" + file_path)\r\n except Exception as ee:\r\n raise AssertionError(\"Malformed file was created at \" + file_path +\r\n \" and could not be removed: \" + str(ee))\r\n raise AssertionError(\"Malformed file was created at \" + file_path + \" and was removed\")\r\n failed = False\r\n except youtube_dl.utils.DownloadError as ee:\r\n logger.error(\"YouTube-dl DownloadError: \" + str(ee))\r\n self.ytdl_downloaderror_counter += 1\r\n failed = True\r\n except Exception as ee:\r\n logger.error(\"Video download failed with YouTube-dl: \" + str(ee))\r\n self.other_error_counter += 1\r\n failed = True\r\n if not failed:\r\n try:\r\n os.utime(file_path, (video_creation_time, video_creation_time))\r\n except Exception as e:\r\n logger.debug(\"Unable to set utime of \" + str(video_creation_time) + \" on file \" + file_path +\r\n \", Error: \" + str(e))\r\n return True\r\n return False","def do_downloads(filename1=\"og\", filename2=\"lyrical\", video_id=DEFALT_VIDEO_ID):\n original_video_url = youtube_id_to_url(video_id)\n download_from_url(original_video_url, filename1)\n lyrics_video_url = get_lyrics_url(original_video_url)\n download_from_url(lyrics_video_url, filename2)\n\n return filename1, filename2","def download(video_identifier,\n output_filename,\n num_attempts=5,\n url_base='https://www.youtube.com/watch?v='):\n # Defensive argument checking.\n assert isinstance(video_identifier, str), 'video_identifier must be string'\n assert isinstance(output_filename, str), 'output_filename must be string'\n assert len(video_identifier) == 11, 'video_identifier must have length 11'\n\n status = False\n\n if not os.path.exists(output_filename):\n command = [\n 'youtube-dl', '--quiet', '--no-warnings', '--no-check-certificate',\n '-f', 'mp4', '-o',\n '\"%s\"' % output_filename,\n '\"%s\"' % (url_base + video_identifier)\n ]\n command = ' '.join(command)\n print(command)\n attempts = 0\n while True:\n try:\n subprocess.check_output(\n command, shell=True, stderr=subprocess.STDOUT)\n except subprocess.CalledProcessError:\n attempts += 1\n if attempts == num_attempts:\n return status, 'Fail'\n else:\n break\n # Check if the video was successfully saved.\n status = os.path.exists(output_filename)\n return status, 'Downloaded'","def download_wrapper(youtube_id, output_dir):\n # we do this to align with names in annotations\n output_filename = os.path.join(output_dir, youtube_id + '.mp4')\n if os.path.exists(output_filename):\n status = tuple([youtube_id, True, 'Exists'])\n return status\n\n downloaded, log = download(youtube_id, output_filename)\n status = tuple([youtube_id, downloaded, log])\n return status","def google_youtube_details(vidid):\n\tif not API_KEY:\n\t\traise ConfigException(\"Require API_KEY for googleapi. Reload after setting.\")\n\t# TODO: make module option for safesearch\n\td = {\"id\" : quote(vidid.encode(\"utf-8\")), \"part\" : \"contentDetails,id,snippet,statistics,status\", \"key\" : API_KEY}\n\t\n\tf = urlopen(YOUTUBE_INFO_URL % (urlencode(d)))\n\tytdata = load(f)\n\tif f.getcode() == 200:\n\t\tif \"items\" in ytdata:\n\t\t\tresults = ytdata[\"items\"]\n\t\t\tif len(results) == 0:\n\t\t\t\treturn None\n\t\t\treturn results[0]\n\telse:\n\t\traise RuntimeError(\"Error (%s): %s\" % (f.getcode(), ytdata.replace(\"\\n\", \" \")))","def download_videos(download_limit=6):\n videos = []\n for fname in os.listdir('yt_api_data'):\n videos += load_video_data(fname)\n vids_downloaded = 0\n excluded_vids = get_excluded_videos()\n for video_id, title in videos:\n if download_limit != 'all' and vids_downloaded == download_limit:\n break\n title = title.replace(' ', '_')\n mkv_path = \"videos/\" + title + \".mkv\"\n mp4_path = \"videos/\" + title + \".mp4\"\n download_fpath = \"videos/\" + title\n if not check_excluded_list(excluded_vids, title) and not os.path.isfile(mkv_path) and not os.path.isfile(mp4_path):\n print(colored(str(vids_downloaded + 1) + \": \", \"yellow\") + colored(video_id + \" downloading: \" + download_fpath, \"green\"))\n command_prefix = \"youtube-dl -o \" + download_fpath\n if video_id[0] == '-': \n os.system(command_prefix + \" -- \" + video_id)\n else:\n os.system(command_prefix + \" \" + video_id)\n vids_downloaded += 1\n else:\n print(colored(\"skipping download: \" + title + \"with youtube_id: \" + video_id, \"yellow\"))","def download_vid(vid_link, quality_num=None):\r\n if quality_num is not None:\r\n # if quality_num provided\r\n try:\r\n os.system(\"youtube-dl -f \"+str(quality_num)+\" \\'\"+str(vid_link)+\"\\'\")\r\n except Exception:\r\n print(Exception)\r\n else:\r\n # by default the best quality is downloaded\r\n try:\r\n os.system(\"youtube-dl \"+str(vid_link))\r\n except Exception:\r\n print(Exception)","def youtube_id_to_url(yt_video_id):\n return 'https://www.youtube.com/watch?v=' + yt_video_id","def download(target_url):\n program_location = sys.executable\n program_name = \"youtube-dl.exe\"\n # Define arguments. see this url for help\n # https://github.com/rg3/youtube-dl\n ignore_errors = \"-i\"\n safe_filenames = \"--restrict-filenames\"\n output_arg = \"-o\"\n output_template = \"download\\%(uploader)s\\%(playlist)s\\%(title)s-%(id)s.%(ext)s\"\n command = [program_name, ignore_errors, safe_filenames, output_arg, output_template, target_url]\n result = subprocess.call(command)\n print \"Command result: \", result","def download(self, url=None):\n if url is None:\n if self.results is None:\n raise ValueError(\"Please specify a valid url.\")\n else:\n url = self.results[0]\n try:\n meta = pafy.new(url)\n except Exception:\n raise IOError(\"Video not available for download.\")\n\n vid = meta.getbest()\n path = vid.download()\n self.videos.append(path)\n return path","def make_video_url(movie_id, api_key):\n\n MOVIE_URL = \"https://api.themoviedb.org/3/movie/\"\n LANG = \"&language=en-US\"\n # Find the youtube key for video trailer\n connection = requests.get(MOVIE_URL + str(movie_id) +\n \"/videos?api_key=\" + api_key + LANG)\n videos_json = json.loads(connection.text)\n connection.close()\n\n if connection.status_code != 200:\n # constant in case issue is found with connection....\n return VIDEO_URL + '5PSNL1qE6VY'\n else:\n if len(videos_json['results']) == 0:\n # constant in case no video is found for given movie....\n return VIDEO_URL + '5PSNL1qE6VY'\n else:\n # If all well we get aa video url for all movie\n # based on discovery or discovery by year\n return VIDEO_URL + videos_json['results'][0]['key']","def download(video, save_dir, vid):\n if not os.path.exists(save_dir):\n os.makedirs(save_dir)\n print(\"--> downloading {}\".format(video.title))\n\n best = video.getbest(preftype=\"mp4\")\n filename = best.download(\n filepath=os.path.join(save_dir,\n \"{}.{}\".format(vid, best.extension)))\n print(\"--> saved to {}\".format(filename))\n\n return os.path.join(save_dir, \"{}.{}\".format(vid, best.extension))","def download_vid(item):\n vid_name, vid_id = item\n vid = Video(vid_name, vid_id, resolution='224p')\n vid.download()","async def youtube(self, ctx, *, query):\n url = f\"https://www.googleapis.com/youtube/v3/search?part=snippet&q={query}&type=video&maxResults=1&key={google_api_key}\"\n response = requests.get(url)\n try:\n await ctx.send(\n f\"https://www.youtube.com/watch?v={response.json()['items'][0]['id']['videoId']}\"\n )\n except IndexError:\n await ctx.send(\"**No results for given query found.**\")","def get_yt_video_id(url):\n\n from urlparse import urlparse, parse_qs\n\n if url.startswith(('youtu', 'www')):\n url = 'http://' + url\n\n query = urlparse(url)\n\n if 'youtube' in query.hostname:\n if query.path == '/watch':\n return parse_qs(query.query)['v'][0]\n elif query.path.startswith(('/embed/', '/v/')):\n return query.path.split('/')[2]\n elif 'youtu.be' in query.hostname:\n return query.path[1:]\n else:\n raise ValueError","async def download_video(event):\n url = event.pattern_match.group(1)\n rmsg = await event.get_reply_message()\n if not url and rmsg:\n myString = rmsg.text\n url = re.search(\"(?P<url>https?://[^\\s]+)\", myString).group(\"url\")\n if not url:\n return await edit_or_reply(event, \"What I am Supposed to find? Give link\")\n codevent = await edit_or_reply(event, \"`Preparing to download...`\")\n reply_to_id = await reply_id(event)\n ytdl_data = await ytdl_down(codevent, video_opts, url)\n if ytdl_down is None:\n return\n f = pathlib.Path(f\"{ytdl_data['title']}.mp4\".replace(\"|\", \"_\"))\n codthumb = pathlib.Path(f\"{ytdl_data['title']}.jpg\".replace(\"|\", \"_\"))\n if not os.path.exists(codthumb):\n codthumb = pathlib.Path(f\"{ytdl_data['title']}.webp\".replace(\"|\", \"_\"))\n if not os.path.exists(codthumb):\n codthumb = None\n await codevent.edit(\n f\"`Preparing to upload video:`\\\n \\n**{ytdl_data['title']}**\\\n \\nby *{ytdl_data['uploader']}*\"\n )\n ul = io.open(f, \"rb\")\n c_time = time.time()\n attributes, mime_type = await fix_attributes(f, ytdl_data, supports_streaming=True)\n uploaded = await event.client.fast_upload_file(\n file=ul,\n progress_callback=lambda d, t: asyncio.get_event_loop().create_task(\n progress(d, t, codevent, c_time, \"upload\", file_name=f)\n ),\n )\n ul.close()\n media = types.InputMediaUploadedDocument(\n file=uploaded,\n mime_type=mime_type,\n attributes=attributes,\n thumb=await event.client.upload_file(codthumb) if codthumb else None,\n )\n await event.client.send_file(\n event.chat_id,\n file=media,\n reply_to=reply_to_id,\n caption=ytdl_data[\"title\"],\n )\n os.remove(f)\n if codthumb:\n os.remove(codthumb)\n await event.delete()","def test_get_video_id_from_url(self):\n self.assertEqual(get_video_id_from_url('https://www.youtube.com/embed/DqGwxR_0d1M'),\n 'DqGwxR_0d1M')\n self.assertEqual(get_video_id_from_url('https://youtu.be/DqGwxR_0d1M'), 'DqGwxR_0d1M')\n self.assertEqual(\n get_video_id_from_url('https://www.youtube.com/watch?v=DqGwxR_0d1M&feature=youtu.be'),\n 'DqGwxR_0d1M')\n self.assertEqual(get_video_id_from_url('https://www.youtube.com/watch?v=DqGwxR_0d1M'),\n 'DqGwxR_0d1M')","def __init__(self, url, params=None):\n super(YoutubeVideo, self).__init__(url, params)\n self.video_id = self.get_video_id()","def youtube_cmd(ctx, cmd, arg):\n\t\turl = \"http://gdata.youtube.com/feeds/api/videos?q=%s&max-results=3&v=2\" % urllib.parse.quote(arg)\n\t\tr = urllib.request.urlopen(url)\n\t\tr = dom.parse(r)\n\t\t\t\n\t\tresults = int(r.getElementsByTagName(\"openSearch:totalResults\")[0].firstChild.data)\n\n\t\tif results > 0:\n\t\t\tres = min(results, 3)\n\t\t\tctx.reply(\"Results 1-%d out of %s\" % (res, prettyNumber(results)), \"YouTube\")\n\t\telse:\n\t\t\tctx.reply(\"No results found for %s\" % arg, \"YouTube\")\n\n\t\tfor i in r.getElementsByTagName(\"entry\"):\n\t\t\tvid = i.getElementsByTagName(\"id\")[0].firstChild.data\n\t\t\tvid = vid.split(\":\")[-1]\n\n\t\t\tdisplayMeta(ctx, i, vid)","def query_youtube(movie_title):\n #convert movie_title to “percent-encoded” string, then open search\n query_string = urllib.urlencode({\"search_query\" : movie_title + \" trailer\"})\n html_content = urllib.urlopen(\"http://www.youtube.com/results?\" +\n query_string)\n #use regular expressions to find all 11 character videos IDs\n query_results = re.findall(r'href=\\\"\\/watch\\?v=(.{11})',\n html_content.read())\n return \"http://www.youtube.com/watch?v=\" + query_results[0]","def download_audio_from_youtube(youtube_link: str):\r\n with st.spinner(\"Extracting audio from Youtube...\"):\r\n try:\r\n a = pytube.YouTube(youtube_link).streams.first().download('files/','video_for_audio') # Download video from youtube\r\n b = ffmpg.ffmpeg_extract_audio('files/video_for_audio.mp4','files/audio.mp3') # extract sound and save as mp3\r\n os.remove('files/video_for_audio.mp4') # remove unecessary video\r\n # Release the process from the downloaded files\r\n del a, b\r\n st.success(\"Sound was extracted successfully from the youtube video!\")\r\n except:\r\n st.error(\"Unexpected error has occured, please try again!\")","def youtube_dl_latest(args=None):\n args = parse_youtube_dl_arguments(args=args)\n download_videos(channels_file=args.channels_file, hierarchy=args.hierarchy)","def _get_trailer_url(self, movie_id):\n payload = {\n 'api_key': self.api_key,\n 'language': self.language\n }\n\n youtube_base_url = 'https://www.youtube.com/watch?v='\n url = self.BASE_URL + str(movie_id) + '/videos'\n resp = requests.get(url, params=payload)\n\n if resp.status_code == requests.codes.ok:\n video_results = resp.json()['results']\n for video in video_results:\n if video['type'] == u'Trailer':\n return youtube_base_url + video['key']\n\n print 'Couldnt find a trailer for the movie, returning placeholder'\n print 'video trailer.'\n return 'https://www.youtube.com/watch?v=FnCdOQsX5kc'\n else:\n # Throws an error if the movie_id is not illegible\n resp.raise_for_status()","def get_yt_link_by_id(video_id):\n info = InnerTube().player(video_id)\n det = info.get(\"videoDetails\", None)\n title = det.get(\"title\", None) if det else None\n streaming_data = info.get(\"streamingData\", None)\n fmts = streaming_data.get(\"formats\", None) if streaming_data else None\n\n if fmts:\n links = {Quality[i[\"itag\"]]: i[\"url\"] for i in fmts if i.get(\"itag\", -1) in Quality and \"url\" in i}\n\n if links and title:\n return links, title.replace(\"+\", \" \")\n\n cause = None\n status = info.get(\"playabilityStatus\", None)\n if status:\n cause = f\"[{status.get('status', '')}] {status.get('reason', '')}\"\n\n log(f\"{__class__.__name__}: Getting link to video with id '{video_id}' filed! Cause: {cause}\")\n\n return None, cause","async def download(self, ctx, *, song):\n try:\n with youtube_dl.YoutubeDL(ytdl_download_format_options) as ydl:\n if \"https://www.youtube.com/\" in song:\n download = ydl.extract_info(song, True)\n else:\n infosearched = ydl.extract_info(\n \"ytsearch:\"+song, False)\n download = ydl.extract_info(\n infosearched['entries'][0]['webpage_url'], True)\n filename = ydl.prepare_filename(download)\n embed = discord.Embed(\n title=\"Your download is ready\", description=\"Please wait a moment while the file is beeing uploaded\")\n await ctx.send(embed=embed, delete_after=30)\n await ctx.send(file=discord.File(filename))\n os.remove(filename)\n except (youtube_dl.utils.ExtractorError, youtube_dl.utils.DownloadError):\n embed = discord.Embed(title=\"Song couldn't be downloaded\", description=(\"Song:\"+song))\n await ctx.send(embed=embed)","async def youtube(self, ctx, *, query):\r\n\r\n utub = 'https://youtube.com/results?search_query='\r\n url = utub + query.replace(\" \", \"+\")\r\n r = requests.get(url).text\r\n num1 = r.find('{\"videoRenderer')\r\n num2 = r.find('{\"videoRenderer', num1+1)\r\n # print (num1)\r\n # print (num2)\r\n videoRenderer = (json.loads(r[num1:num2-1])[\"videoRenderer\"])\r\n vid = (videoRenderer[\"videoId\"])\r\n page = (\"https://youtube.com/watch?v=\" + vid)\r\n await ctx.send(page)","def get_video_data(id, fetch_all_videos=True):\n youtube_data = _youtube_feed('videos', id)['entry']\n return Playlist(None, 1, [_get_video_data(youtube_data)], None)","def compose_embed_youtube(video_id = None):\n assert(video_id != None)\n return \"http://www.youtube.com/embed/{0}?enablejsapi=1&wmode=opaque\".format(\n video_id\n )","def download_video_data(self):\n\n def scrape_url(url):\n \"\"\"Scrape the video list, youtube_dl does all the heavy lifting\"\"\"\n ydl_opts = {\n \"ignoreerrors\": True, # Skip private and unavaliable videos\n }\n\n ydl = youtube_dl.YoutubeDL(ydl_opts)\n\n with ydl:\n result_ydl = ydl.extract_info(\n url,\n download=False # No download needed, only the info\n )\n\n logger.debug('Url scraped {}', url)\n if 'entries' in result_ydl:\n # It's a playlist or a list of videos\n return result_ydl['entries']\n # Just a video\n return [result_ydl]\n\n youtube_list = sum((scrape_url(url) for url in self.youtube_lists), [])\n for youtube_video_data in youtube_list:\n if youtube_video_data: # Valid video\n self.youtube_videos.append(\n Video.from_youtube(\n video_data=youtube_video_data, event=self))\n else:\n logger.warning('Null youtube video')","def downloadvideo(filename):\n url = \"http://openings.moe/video/\" + filename\n f = getfile(url)\n safeprint(Colors.PURPLE + url + Colors.END + \":\\nSaving to --> \" + Colors.YELLOW + filename + Colors.END)\n with open(os.path.basename(url), \"wb\") as local_file:\n try:\n local_file.write(f.read())\n except IOError as e:\n safeprint(\"An error occurred while saving the file, try again. \" + str(e))","def tekstowo_youtube_url(source):\n reg = re.compile(r\"var videoID = \\\"(.*)\\\";\")\n try:\n video_id = reg.search(source).group(1)\n except Exception:\n raise Exception(ERROR_STR + '[crawler] cannot find videoID')\n if not video_id:\n raise Exception(ERROR_STR + '[crawler] empty videoID')\n\n return \"https://www.youtube.com/watch?v=\" + video_id","def youtubefetch(url,outputp=''):\n\toutputpath = os.path.expanduser(outputp)\n\tif (os.path.exists(outputpath) & os.path.isdir(outputpath)) != True:\n\t\toutputpath = '/tmp/'\n\t\n\t(_,_,urlproper) = url.partition(\"?\")\n\t(urlproper,_,_) = urlproper.partition(\"&\")\n\turlproper = \"http://proxy.cs.tcd.ie:8080/www.youtube.com/watch?\" + urlproper\n\tpage = urllib2.urlopen(url).readlines()\n\tfilteredpage = [ elem for elem in page if elem.find(\"fullscreenUrl\") != -1 ]\n\tif (len(filteredpage) == 0):\n\t\treturn 'failed'\n\t\t\n\tfilteredpage = filteredpage[0]\n\t(_, p1, partialurl) = filteredpage.partition(\"video_id=\")\n\t(partialurl , _, name) = partialurl.rpartition(\"&title=\")\n\t(name,_,_) = name.partition(\"'\")\n\tvideourl = \"http://www.youtube.com/get_video.php?\" + p1 + partialurl\n\tvideo = urllib2.urlopen(videourl).read()\n\t#print videourl\n\t#print name\n\toutputfile = open((outputpath+name+\".flv\"),'wb')\n\toutputfile.write(video)\n\toutputfile.flush()\n\toutputfile.close()\n\treturn outputpath+name+\".flv\"","async def video(ctx, message):\n \"\"\":param: ctx\"\"\"\n \"\"\":param: message\"\"\"\n \"\"\"return video url\"\"\"\n link_list = []\n print ('Searching YouTube for: %s' % message)\n url = \"https://www.youtube.com/results?search_query=\" + message\n response = urlopen(url)\n html = response.read()\n soup = BeautifulSoup(html, \"lxml\")\n for vid in soup.findAll(attrs={'class': 'yt-uix-tile-link'}):\n link_list.append('https://www.youtube.com' + vid['href'])\n if(len(link_list) >=1):\n random_num = random.randint(0, len(link_list) - 1)\n await bot.say(link_list[random_num])\n else:\n await bot.say(\"there is no contente for \"+message)","def download(dltype, num):\n # This function needs refactoring!\n # pylint: disable=R0912\n # pylint: disable=R0914\n if g.browse_mode == \"ytpl\" and dltype in (\"da\", \"dv\"):\n plid = g.ytpls[int(num) - 1][\"link\"]\n down_plist(dltype, plid)\n return\n\n elif g.browse_mode == \"ytpl\":\n g.message = \"Use da or dv to specify audio / video playlist download\"\n g.message = c.y + g.message + c.w\n g.content = generate_songlist_display()\n return\n\n elif g.browse_mode != \"normal\":\n g.message = \"Download must refer to a specific video item\"\n g.message = c.y + g.message + c.w\n g.content = generate_songlist_display()\n return\n\n writestatus(\"Fetching video info...\")\n song = (g.model.songs[int(num) - 1])\n best = dltype.startswith(\"dv\") or dltype.startswith(\"da\")\n\n if not best:\n\n try:\n # user prompt for download stream\n url, ext, url_au, ext_au = prompt_dl(song)\n\n except KeyboardInterrupt:\n g.message = c.r + \"Download aborted!\" + c.w\n g.content = generate_songlist_display()\n return\n\n if not url or ext_au == \"abort\":\n # abort on invalid stream selection\n g.content = generate_songlist_display()\n g.message = \"%sNo download selected / invalid input%s\" % (c.y, c.w)\n return\n\n else:\n # download user selected stream(s)\n filename = _make_fname(song, ext)\n args = (song, filename, url)\n\n if url_au and ext_au:\n # downloading video and audio stream for muxing\n audio = False\n filename_au = _make_fname(song, ext_au)\n args_au = (song, filename_au, url_au)\n\n else:\n audio = ext in (\"m4a\", \"ogg\")\n\n kwargs = dict(audio=audio)\n\n elif best:\n # set updownload without prompt\n url_au = None\n av = \"audio\" if dltype.startswith(\"da\") else \"video\"\n audio = av == \"audio\"\n filename = _make_fname(song, None, av=av)\n args = (song, filename)\n kwargs = dict(url=None, audio=audio)\n\n try:\n # perform download(s)\n dl_filenames = [args[1]]\n f = _download(*args, **kwargs)\n if f:\n g.message = \"Saved to \" + c.g + f + c.w\n\n if url_au:\n dl_filenames += [args_au[1]]\n _download(*args_au, allow_transcode=False, **kwargs)\n\n except KeyboardInterrupt:\n g.message = c.r + \"Download halted!\" + c.w\n\n try:\n for downloaded in dl_filenames:\n os.remove(downloaded)\n\n except IOError:\n pass\n\n if url_au:\n # multiplex\n mux_cmd = \"APP -i VIDEO -i AUDIO -c copy OUTPUT\".split()\n mux_cmd = \"%s -i %s -i %s -c copy %s\"\n mux_cmd = [g.muxapp, \"-i\", args[1], \"-i\", args_au[1], \"-c\",\n \"copy\", args[1][:-3] + \"mp4\"]\n\n try:\n subprocess.call(mux_cmd)\n g.message = \"Saved to :\" + c.g + mux_cmd[7] + c.w\n os.remove(args[1])\n os.remove(args_au[1])\n\n except KeyboardInterrupt:\n g.message = \"Audio/Video multiplex aborted!\"\n\n g.content = generate_songlist_display()","def get_yt_link(self, video_id, url=None, skip_errors=False):\n if self._settings.enable_yt_dl and url:\n if not self._yt_dl:\n self._yt_dl = YouTubeDL.get_instance(self._settings, self._callback)\n if not self._yt_dl:\n raise YouTubeException(\"yt-dlp initialization error.\")\n return self._yt_dl.get_yt_link(url, skip_errors)\n\n return self.get_yt_link_by_id(video_id)","def download_video(video_stream):\n global file_size\n file_size = size_in_mb(video_stream.filesize)\n home_dir = os.environ['HOME']\n path = f'{home_dir}/Downloads/Video'\n print('-'*60)\n print(f'Filename:\\t{video_stream.title}')\n print(f'Location:\\t{path}')\n print(f'Size:\\t\\t{file_size} MB\\n')\n\n filename = video_stream.title + '_video.mp4'\n filename = filename.replace('/', ' ')\n filename = filename.replace('\\\\', ' ')\n\n if os.path.exists(os.path.join(path, filename)):\n print(\"The file has been already downloaded.\")\n sys.exit()\n \n video_stream.download(path, filename)","def get_video_id(self):\n if self.video_id:\n return self.video_id\n \n if not self.original_url:\n return ''\n \n p = urlparse.urlparse(self.youtube_fix_url(self.original_url))\n if p.path == '/watch':\n # Url of type http://www.youtube.com/watch?v=KRaeHxwZvms&feature=g-u-u&context=G2b00124FUAAAAAAAAAA\n #logger.debug('is a watch')\n params = cgi.parse_qs(p.query)\n if 'v' in params:\n return params['v'][0]\n elif p.fragment.startswith('/watch?v='):\n # sample. http://m.youtube.com/#/watch?v=ZXkW1-HdRC8\n params = cgi.parse_qs(p.fragment)\n if '/watch?v' in params:\n return params['/watch?v'][0]\n elif p.path.startswith('/v/') or p.path.startswith('/embed/'):\n path = p.path.split('/')\n return path[-1]\n elif p.netloc == 'youtu.be':\n return p.path[1:]\n elif re.match('(.{1}/){3}([\\w+-_^/]+)', p.fragment):\n parts = p.fragment.split('/')\n return parts[-1]\n return ''","def download_video_url(\n video_url: str,\n pipeline: PipelineContext,\n destination=\"%(title)s.%(ext)s\",\n progress=ProgressMonitor.NULL,\n):\n\n config = pipeline.config\n logger = logging.getLogger(__name__)\n logger.info(\"Starting video download from URL: %s\", video_url)\n\n # Setup progress-tracking\n progress.scale(total_work=1.0)\n progress_tracker = YDLProgressTracker(show_progress_bar=True)\n\n # Resolve destination path template\n output_template = complete_template(config.sources.root, destination)\n logger.info(\"Output template: %s\", output_template)\n\n ydl_opts = {\n \"format\": \"mp4\",\n \"logger\": YDLLogger(logger),\n \"progress_hooks\": [progress_tracker.hook],\n \"outtmpl\": output_template,\n }\n\n with youtube_dl.YoutubeDL(ydl_opts) as ydl:\n # Determine destination file name\n video_info = ydl.extract_info(video_url, download=False)\n file_name = ydl.prepare_filename(video_info)\n logger.info(\"Downloading file: %s\", file_name)\n\n # Download file\n with progress_tracker.track(progress):\n ydl.download([video_url])\n\n progress.complete()\n return file_name","def video_download_chain_task(uuid):\n chain = signature(\n 'wts_worker.worker.video_download',\n kwargs={'uuid': uuid},\n )\n chain |= signature(\n 'wts_worker.worker.video_register_title',\n kwargs={'uuid': uuid},\n )\n return chain.apply_async()","def get_video_info(self, id, **kwargs):\n kwargs['id'] = id\n return self.get('info/video.json', **kwargs)","def sync_get_youtube_video(query):\n return yt.get_video_info(query, num_results=1)","def download_video(video_url, output_path, output_name=\"\", default_type=\"mp4\", verbose=False):\n try:\n if \".\" not in output_name:\n output_name = f\"{output_name}.{default_type}\"\n output_path = os.path.join(output_path, output_name)\n api_response = core.get_request_with_retries(video_url)\n core_utils.print_if_verbose('Processing...', verbose)\n f = open(output_path, 'wb')\n for chunk in api_response.iter_content(chunk_size=255):\n # filter out keep-alive new chunks\n if chunk:\n f.write(chunk)\n core_utils.print_if_verbose(f'The video has been exported here: {output_path}', verbose)\n f.close()\n except Exception as exception_msg:\n print(f\"The video could not be downloaded due to the following error: {exception_msg}\")\n return","def vid_player(video_url, id=None, width='100%', height='auto'):\n return {'video_url': video_url, 'width': width, 'height': height, 'id': id }","def get(idd):\n print(f'[{script}]: Collecting data for \"{idd}\"...') if verbosity >= 1 else None\n\n youtube = build(\"youtube\", \"v3\", developerKey=API_KEY)\n request = youtube.videos().list(\n part=\"snippet, contentDetails, statistics\",\n chart=None,\n hl=None,\n id=idd,\n locale=None,\n maxHeight=None,\n maxResults=None,\n maxWidth=None,\n myRating=None,\n onBehalfOfContentOwner=None,\n pageToken=None,\n regionCode=None,\n videoCategoryId=None,\n )\n response = request.execute()\n response = response[\"items\"][0]\n\n data = {\n \"title\": response[\"snippet\"][\"title\"],\n \"idd\": idd,\n \"thumbnail\": response[\"snippet\"][\"thumbnails\"][\"default\"][\"url\"],\n \"author\": response[\"snippet\"][\"channelTitle\"],\n \"published\": datetime.strptime(\n response[\"snippet\"][\"publishedAt\"], \"%Y-%m-%dT%H:%M:%S%z\"\n ),\n \"description\": response[\"snippet\"][\"description\"],\n \"duration\": isodate.parse_duration(\n response[\"contentDetails\"][\"duration\"]\n ).total_seconds(),\n \"views\": response[\"statistics\"][\"viewCount\"],\n }\n\n try:\n data[\"rating\"] = int(response[\"statistics\"][\"likeCount\"]) / (\n int(response[\"statistics\"][\"likeCount\"])\n + int(response[\"statistics\"][\"dislikeCount\"])\n )\n except KeyError:\n print(\n f'[{script}]: WARNING: \"{idd}\" does not have ratings enabled.'\n ) if verbosity >= 2 else None\n data[\"rating\"] = -1\n\n try:\n data[\"comment_count\"] = response[\"statistics\"][\"commentCount\"]\n except KeyError:\n print(\n f'[{script}]: WARNING: \"{idd}\" does not have comments enabled.'\n ) if verbosity >= 2 else None\n data[\"comment_count\"] = -1\n\n print(f\"[{script}]: Got video data.\") if verbosity >= 2 else None\n return data","def download_file(id, output=DATA_DIR, quiet=False):\n url = f\"https://drive.google.com/uc?id={id}\"\n gdown.download(url, output=output, quiet=quiet)","def download_ostrich_video(download_to_path):\n urlretrieve(REMOTE_OSTRICH_VID_PATH, download_to_path)","def __ext_embed_id(self, youtube_url):\n youtube_id_match = re.search(r'(?<=v=)[^&#]+', youtube_url)\n youtube_id_match = youtube_id_match or re.search(\n r'(?<=be/)[^&#]+', youtube_url)\n trailer_youtube_id = (youtube_id_match.group(0) if youtube_id_match\n else None)\n return trailer_youtube_id","def download(track_id, ext):\n\n if ext != 'mp3':\n return Response('', status=404)\n\n track = models.Track.query.get(track_id)\n if track is None:\n abort(404)\n\n track_file = open(track.get_path(), 'r')\n filename_header = (\n 'Content-Disposition', 'attachment; filename=\"%s.mp3\"' % track.title\n )\n\n return Response(response=track_file.read(), mimetype='audio/mpeg',\n headers=[filename_header])","def web_archive_insert_video(id):\n\n db = get_db()\n user_id = flask.session['user']['id']\n\n video_id = id\n video = yt_get_video(video_id)\n channel_id = video['snippet']['channelId']\n\n archive = None\n for playlist in db_get_archives():\n if playlist['contentDetails']['itemCount'] < 5000:\n archive = playlist\n break\n\n if archive is None:\n archive = yt_create_playlist()\n\n if yt_insert_to_playlist(video_id, archive['id']):\n if channel_id not in db[user_id]:\n db[user_id][channel_id] = {\n 'played': {}, 'archived': {}\n }\n db[user_id][channel_id]['archived'][video_id] = archive['id']\n update_db(db)","def download_by_link(link: str, videoid: str) -> [str, str]:\n\t# set youtube_dl arguments \n\tydl_opts = {\n\t\t'quiet': False, # don't write in output\n\t\t'no_warnings': True, # write warnings in output\n\t\t'format': \"bestaudio/best\", # download best audio quality\n\t\t'format': 'mp4', # setup format webm\n\t\t'outtmpl': '%(name)s' + str(videoid) + '.%(ext)s', # setup output name \n\t\t'postprocessor': [{ # dk how this need work, but if this not setup audio didn't download\n\t\t\t'key': \"FFmpegExtractAudioPP\",\n\t\t\t'preferredquality': \"512\",\n\t\t }],\n\t}\n\t# start download audio\n\twith youtube_dl.YoutubeDL(ydl_opts) as ydl:\n\t\tdata = ydl.extract_info(link) # exctrat info about audio\n\tfake_name = \"NA\" + str(videoid)\n\t# TODO: think about this query \n\t# refactoring title \n\ttitle = data.pop('title')\n\ttitle = re.sub(r'[^\\w]', ' ', title)\n\ttitle = translate(title)\n\ttitle = title.replace(' ', '_')\n\treturn fake_name, title","def video_detail(request, video_id):\n\n video = get_object_or_404(Video, id=video_id)\n\n context = {\"video\": video}\n\n return render(request, 'video_detail.html', context)","def download(df_shorter,folderName):\n os.mkdir(str(folderName))\n path = os.getcwd()+'\\\\'+str(folderName)+'\\\\'\n #add column with video link generated from IDs\n df_shorter['urls'] = df_shorter['id'].apply(lambda x: generateLinkFromId(x))\n vid_dl = []\n i = 1\n for url in df_shorter['urls']:\n if url != False:\n name = str(i)+'.mp4'\n vid_dl.append(wget.download(url,path+name))#retrun the path of the saved video\n i = i+1\n return vid_dl","def generateLinkFromId(videoId):\n page = requests.get('https://www.tiktok.com/embed/v2/'+videoId+'?lang=en')\n tree = html.fromstring(page.content)\n buyers = tree.xpath('//*[@id=\"main\"]/div/div/div[1]/div/div/div/div[2]/div[1]/video/@src')\n if len(buyers) > 0:\n return buyers[0]\n else:\n return False","def _render_no_tracking(self, video_id):\n you_tube_url = (\n 'https://www.youtube.com/embed/%s'\n '?feature=player_embedded&rel=0') % video_id\n iframe = cElementTree.XML(\"\"\"\n<div class=\"gcb-video-container\">\n <iframe class=\"youtube-player\" title=\"YouTube Video Player\"\n type=\"text/html\" frameborder=\"0\" allowfullscreen=\"allowfullscreen\">\n </iframe>\n</div>\"\"\")\n iframe[0].set('src', you_tube_url)\n return iframe","def google_youtube_check(id):\n\tif not API_KEY:\n\t\traise ConfigException(\"Require API_KEY for googleapi. Reload after setting.\")\n\td = {\"id\" : quote(id.encode(\"utf-8\")), \"part\" : \"id,status\", \"key\" : API_KEY}\n\t\n\tf = urlopen(YOUTUBE_INFO_URL % (urlencode(d)))\n\tytdata = load(f)\n\tif not ytdata.get(\"items\"): # if there are no items for the ID search, return False\n\t\treturn False\n\treturn True","def play_video(self):\n\n self.wait.until(self.visible((By.ID, \"video-title\")))\n self.driver.find_element_by_xpath(\"//button[@class='ytp-large-play-button ytp-button']\").click()","def download_file_from_google_drive(file_id, dest_path, verbose=False):\n\n destination_directory = dirname(dest_path)\n if len(destination_directory) > 0 and not exists(destination_directory):\n makedirs(destination_directory)\n\n session = requests.Session()\n\n if verbose:\n print('Downloading file with Google ID {} into {}... '.format(file_id, dest_path), end='')\n stdout.flush()\n\n response = session.get(Constant.DOWNLOAD_URL, params={'id': file_id}, stream=True)\n\n token = get_confirm_token(response)\n if token:\n params = {'id': file_id, 'confirm': token}\n response = session.get(Constant.DOWNLOAD_URL, params=params, stream=True)\n\n save_response_content(response, dest_path)\n if verbose:\n print('Download completed.')","def select(self, video_id):\n\n query = \"\"\"\n SELECT id, uri, filename, description\n FROM videos\n WHERE id = ?\n \"\"\"\n\n result = Model.execute(query, (video_id,))\n\n return result.fetchone()","def get_video_id(url):\n\n if not url:\n return \"\"\n\n # If URL is embedded\n if \"embed\" in url:\n return url.split(\"/\")[-1]\n\n parse_result = urlparse(url)\n query = parse_qs(parse_result.query)\n return query[\"v\"][0]","def playlist_videos(playlist_id):\r\n url = PLAYLIST_ITEMS_URL.format(API_KEY, playlist_id)\r\n response = util.web.http_get(url=url, json=True, referer='https://tinychat.com')\r\n\r\n if response['json'] is not None:\r\n video_list = []\r\n # next_page_token = response['json']['nextPageToken']\r\n try:\r\n if 'items' in response['json']:\r\n for item in response['json']['items']:\r\n video_id = item['snippet']['resourceId']['videoId']\r\n details = video_details(video_id)\r\n if details is not None:\r\n info = {\r\n 'type': 'youTube',\r\n 'video_id': video_id,\r\n 'video_title': details['video_title'],\r\n 'video_time': details['video_time']\r\n }\r\n video_list.append(info)\r\n return video_list\r\n except KeyError as ke:\r\n log.error(ke, exc_info=True)\r\n return None","def upload_youtube(msg):\n url = \"https://www.youtube.com/watch?v=%s\" % msg['yt_videoid']\n fname = \"%s/download_file/%s.mp4\" % (TOP_LEVEL_DIR, randint(1, 1000000000))\n cmd = \"/home/hadn/py4code/bin/youtube-dl -o %s %s\" % (fname, url)\n cmd = shlex.split(cmd)\n up = Popen(cmd, stdout=PIPE)\n temp = up.communicate()\n\n cmd_upload = \"/home/hadn/py4code/bin/python %s/flask_app/crawler/upload_youtube.py --file %s --title '%s'\" % (\n TOP_LEVEL_DIR, fname, msg['title'])\n cmd_upload = shlex.split(cmd_upload)\n up_youtube = Popen(cmd_upload, stdout=PIPE)\n temp_upload = up_youtube.communicate()\n\n print(temp_upload)\n return msg","def download_subtitles(video_ids):\n print(f\"[downloading subs] {video_ids}\")\n ydl_opts = {\n 'skip_download': True,\n 'writeautomaticsub': True,\n 'outtmpl': 'subtitles/%(id)s',\n 'subtitleslangs': ['en']\n }\n for video_id in video_ids:\n filename = f\"subtitles/{video_id}.en.vtt\"\n # Don't download if these subtitles are already downloaded\n # or if we know there are no subtitles on the video\n if video_id in cached_no_subtitles:\n continue\n if not os.path.isfile(filename):\n print(f\"[downloading subtitle] {video_id}\")\n with youtube_dl.YoutubeDL(ydl_opts) as ydl:\n # assume downloaded subtitle is correct\n ydl.download([video_id])\n # Delay to be nice to the server\n time.sleep(2)\n try:\n with open(filename) as f:\n yield video_id, f.read()\n except IOError:\n with open(CACHED_NO_SUBTITLES_FILE, \"a\") as f:\n f.write(video_id + '\\n')\n cached_no_subtitles.add(video_id)\n yield video_id, None","def get_embed_youtube(link = None):\n assert(link != None)\n assert(link != \"\")\n log.debug( \"preparsed link: \" + link)\n video_id = \"\"\n try:\n # break the link\n choppedLink = link.split(\"/\")\n if choppedLink[2].find(\"youtu.be\") >= 0:\n # Parse short link getting only last piece\n video_id = get_id_shortlink(choppedLink)\n elif choppedLink[3].find(\"attribution_link\") >= 0 :\n # Its an attribution link, a bit special\n video_id = get_id_attribution(choppedLink)\n else:\n # This should be a regular link\n video_id = get_id_regular_link(choppedLink)\n\n # and finally compose the embed link\n flink = compose_embed_youtube(video_id)\n log.debug( \"compound link: \" + flink)\n except Exception as e:\n log.error(\"Something weird happened when ending getting embed youtube\")\n log.exception(e)\n raise NotImplementedError( \"We are still working on links like \" + link)\n\n return flink","def get_videos_in_playlist(self):\n\n self.ydl = youtube_dl.YoutubeDL()\n # uses the youtube_dl as a context manager\n with self.ydl:\n self.result = self.ydl.extract_info(\n self.url, extra_info={'listformats': True}, download=False)\n for video in (self. result['entries']):\n video_id = video['id']\n self. url = f'https://www.youtube.com/watch?v={video_id}'\n self. show_formats()","def download_flickr_video(url, save_root, force_overwrite):\n\n # (Try to) open the URL\n response = urlopen(url)\n # Extract the file extension from the resolved URL\n m = re.match(r'(.*)\\?s=.*', response.url)\n _, ext = os.path.splitext(m.group(1))\n # Build the path to save the video to\n video_meta = parse.parse(VIDEO_URL_FORMAT, url)\n user_id = video_meta['user_id']\n video_id = video_meta['video_id']\n save_path = os.path.join(save_root, f'{user_id}-{video_id}{ext}')\n # Save the video\n if os.path.isfile(save_path) and not force_overwrite:\n raise FileExistsError(f'File already exists at {save_path}')\n else:\n with open(save_path, 'wb') as f:\n shutil.copyfileobj(response, f)\n\n return save_path","def get_youtube_handler():\n options = {}\n home = os.path.expanduser(\"~\")\n default_credentials = os.path.join(home, \".youtube-upload-credentials.json\")\n #client_secrets = options.client_secrets or os.path.join(home, \".client_secrets.json\")\n #credentials = options.credentials_file or default_credentials\n client_secrets = os.path.join(home, \".client_secrets.json\")\n credentials = default_credentials \n debug(\"Using client secrets: {0}\".format(client_secrets))\n debug(\"Using credentials file: {0}\".format(credentials))\n #get_code_callback = (auth.browser.get_code\n #if options.auth_browser else auth.console.get_code)\n get_code_callback = auth.browser.get_code\n return auth.get_resource(client_secrets, credentials,\n get_code_callback=get_code_callback)","def __construct_url_from_id(_video_id):\n return f\"{core.get_base_url(api_base=False)}/videos/{_video_id}\"","def download(self, language, filename, filetype):\n if language not in self.languages.keys():\n print \"Theres's no subtitle in this language\"\n sys.exit()\n url = \"http://www.youtube.com/api/timedtext?v={0}&lang={1}\".format(self.video_id, language)\n self.subtitle = urllib2.urlopen(url)\n if filetype == \"srt\":\n self.writeSRTFile(filename)\n else:\n self.writeXMLFile(filename)","def fetch_pyvideo_pk(self):\n url = 'http://pyvideo.org/search?models=videos.video&q={0}'.format(self.full_name.replace(\" \", \"+\"))\n soup = BeautifulSoup(requests.get(url).content).findAll(\"a\")\n if soup:\n for link in soup:\n if link.string == self.full_name:\n self.pyvideo_pk = link.get('href').split('/')[2]\n self.save()\n return self.pyvideo_pk\n self.pyvideo_pk = None\n self.save()\n return None","def add_video_to_playlist(youtube, args, privacy=\"public\"):\n video_id = args['video_id']\n playlist_id = args['playlist_id']\n \n print(video_id)\n #print(type(args))\n \n if playlist_id:\n return add_video_to_existing_playlist(youtube, playlist_id, video_id)\n else:\n lib.debug(\"Error adding video to playlist\")","async def video_url(cls, url, ytdl, *, loop=None, stream=False):\n loop = loop or asyncio.get_event_loop()\n data = await loop.run_in_executor(None, lambda: ytdl.extract_info(url, download=not stream))\n song_list = {'queue': []}\n if 'entries' in data:\n if len(data['entries']) > 1:\n playlist_titles = [title['title'] for title in data['entries']]\n song_list = {'queue': playlist_titles}\n song_list['queue'].pop(0)\n\n data = data['entries'][0]\n\n filename = data['url'] if stream else ytdl.prepare_filename(data)\n return cls(discord.FFmpegPCMAudio(filename, **ffmpeg_options), data=data), song_list","def fetch_trailer(self, movie_id):\n movie = tmdbsimple.Movies(movie_id)\n request = movie.videos()\n trailer = movie.results[0]['key']\n\n return trailer","def video_details(video_id, check=True):\r\n url = VIDEO_DETAILS_URL.format(API_KEY, video_id)\r\n response = util.web.http_get(url=url, json=True, referer='https://tinychat.com')\r\n\r\n if response['json'] is not None:\r\n try:\r\n if 'items' in response['json']:\r\n if len(response['json']['items']) is not 0:\r\n contentdetails = response['json']['items'][0]['contentDetails']\r\n if check:\r\n if 'regionRestriction' in contentdetails:\r\n if 'blocked' in contentdetails['regionRestriction']:\r\n blocked = contentdetails['regionRestriction']['blocked']\r\n if [i for e in ALLOWED_COUNTRIES for i in blocked if e in i]:\r\n log.info('%s is blocked in: %s' %\r\n (video_id, blocked))\r\n return None\r\n if 'allowed' in contentdetails['regionRestriction']:\r\n allowed = contentdetails['regionRestriction']['allowed']\r\n if [i for e in ALLOWED_COUNTRIES for i in allowed if e not in i]:\r\n log.info('%s is allowed in: %s' %\r\n (video_id, allowed))\r\n return None\r\n video_time = util.string_util.convert_to_millisecond(contentdetails['duration'])\r\n video_title = response['json']['items'][0]['snippet']['title'].encode('ascii', 'ignore')\r\n\r\n return {\r\n 'type': 'youTube',\r\n 'video_id': video_id,\r\n 'video_time': video_time,\r\n 'video_title': video_title\r\n }\r\n return None\r\n except KeyError as ke:\r\n log.error(ke, exc_info=True)\r\n return None","def download_videos(blink, save_dir=\"/media\"):\n blink.download_videos(save_dir, since=get_date())","def download(self, download_id):\r\n return downloads.Downloads(self, download_id)","def request_id(self):\n select_id = input(\"\\n>>> \")\n select_dict = [format for format in self.result['formats']\n if format['format_id'] == select_id][0]\n filesize = size(select_dict['filesize']\n ) if select_dict['filesize'] else 0\n # url = select_dict['url']\n print(f\"Downloading {self.result['title']}, size={filesize}\")\n self.title = self.result['title']\n for item in [\"(\", \")\", \" \", \",\", \".\", \"'\"]:\n self.title = self.title.replace(item, '_')\n self.title = self.title.replace('__', '_')\n self.download_video(select_id)","def get_video_id(self, obj):\n return obj.video.id","def get_video_id(self):\n \n if self.video_id:\n return self.video_id\n \n if not self.original_url:\n return ''\n \n #logger.debug('DAILYMOTION VIDEO FOUND %s' % url)\n \n p = urlparse.urlparse(self.original_url)\n path = p.path\n if path.endswith('/'):\n path = path[:-1]\n path_list = path[1:].split('/')\n \n if len(path_list) == 3 and (p.path.startswith('/embed/video/') or p.path.startswith('/swf/video/')):\n # http://www.dailymotion.com/embed/video/xmp7zw\n return re.sub('_.+', '', path_list[2])\n elif len(path_list) == 2 and (p.path.startswith('/video/') or p.path.startswith('/swf/')):\n # http://www.dailymotion.com/video/xmp7zw_whatever\n # http://www.dailymotion.com/swf/xmp7zw\n return re.sub('_.+', '', path_list[1])\n \n return ''","def play_trailer(self):\n webbrowser.open(self.youtube_trailer_url)"],"string":"[\n \"def download(idd, path):\\n print(f'[{script}]: Downloading YT video \\\"{idd}\\\"...') if verbosity >= 1 else None\\n\\n try:\\n yt = pytube.YouTube(\\\"https://www.youtube.com/watch?v=\\\" + idd)\\n stream = yt.streams.filter(progressive=True).first()\\n stream.download(path, filename=idd)\\n except Exception:\\n print(f'[{script}]: Failed download of YT video \\\"{idd}\\\".')\\n return None\\n\\n data = {\\n \\\"idd\\\": idd,\\n \\\"abr\\\": stream.abr,\\n \\\"acodec\\\": stream.audio_codec,\\n \\\"bitrate\\\": stream.bitrate,\\n \\\"codecs\\\": stream.codecs,\\n \\\"fps\\\": stream.fps,\\n \\\"mime\\\": stream.mime_type,\\n \\\"res\\\": stream.resolution,\\n \\\"vcodec\\\": stream.video_codec,\\n \\\"size\\\": stream._filesize,\\n \\\"frames\\\": stream.fps * yt.length,\\n }\\n\\n file_path = path + \\\"/\\\" + data[\\\"idd\\\"] + \\\".mp4\\\"\\n print(\\n f'[{script}]: Download successful. Saved to \\\"{file_path}\\\".'\\n ) if verbosity >= 2 else None\\n return data\",\n \"def get_video(self, video_id):\\n uri = 'videos/' + video_id\\n return self.make_request(uri)\",\n \"def download_video(self, url):\\n yt = YouTube(url)\\n yt_filtered = yt.streams.filter(progressive=True, file_extension=\\\"mp4\\\")\\n yt_resolutions = yt_filtered.order_by(\\\"resolution\\\")\\n\\n # Downloads the first video that fits the description\\n video = yt_resolutions.desc().first()\\n video.download()\\n\\n # Returns the filename\\n return video.default_filename\",\n \"def get_youtube_video_url(video_id):\\n url = \\\"https://www.youtube.com/watch?v=\\\" + video_id\\n return url\",\n \"def download_from_youtube():\\n linkinput = input(\\\"Enter the url you want to download: \\\")\\n youtube_object = Youtube(linkinput)\\n youtube_object.youtube()\",\n \"def get_video_by_id():\\n sample_id = demisto.getArg('id')\\n r = req('GET', SUB_API + 'samples/' + sample_id + '/video.webm')\\n ec = {'ThreatGrid.Sample.Id': sample_id}\\n demisto.results([\\n {\\n 'Type': entryTypes['note'],\\n 'EntryContext': ec,\\n 'HumanReadable': '### ThreatGrid Sample Run Video File -\\\\n'\\n + 'Your sample run video file download request has been completed successfully for '\\n + sample_id,\\n 'Contents': ec,\\n 'ContentsFormat': formats['json']\\n },\\n fileResult(sample_id + '.webm', r.content)\\n ])\",\n \"def get_yt_video(yt_url):\\n\\n ydl_opts = {\\n 'format': 'bestaudio/best',\\n 'postprocessors': [{\\n 'key': 'FFmpegExtractAudio',\\n 'preferredcodec': 'mp3',\\n 'preferredquality': '192',\\n }],\\n 'outtmpl': '%(id)s.%(ext)s'\\n }\\n ydl = youtube_dl.YoutubeDL(ydl_opts)\\n\\n with ydl:\\n result = ydl.extract_info(\\n #'http://www.youtube.com/watch?v=BaW_jenozKc',\\n yt_url,\\n download=True # We just want to extract the info\\n )\\n\\n if 'entries' in result:\\n # Can be a playlist or a list of videos\\n video = result['entries'][0]\\n else:\\n # Just a video\\n video = result\\n\\n return video\",\n \"def play_youtube(self, media_id):\\n pass\",\n \"def movieid_first_video_url(self, movie_id):\\n YOUTUBE_URL = \\\"https://www.youtube.com/watch?v=\\\"\\n VIDEOS_URL = \\\"https://api.themoviedb.org/3/movie/%s/videos\\\"\\n url_with_movieid = VIDEOS_URL % (movie_id)\\n parm_dict = {\\\"api_key\\\": self.api_key, \\\"language\\\": self.language}\\n url = url_with_movieid + \\\"?\\\" + urlencode(parm_dict, doseq=True)\\n # print url\\n\\n response = requests.get(url)\\n json_dict = json.loads(response.text)\\n response.close()\\n\\n youtube_video_key = json_dict['results'][0]['key']\\n return YOUTUBE_URL + youtube_video_key\",\n \"async def get_video(videoid):\\n\\theaders = {\\n\\t\\t'Client-ID': config['twitch_clientid'],\\n\\t\\t'Authorization': f\\\"Bearer {get_token()}\\\",\\n\\t}\\n\\tdata = await common.http.request_coro(\\\"https://api.twitch.tv/helix/videos\\\", {\\\"id\\\": videoid.lstrip('v')}, headers=headers)\\n\\treturn json.loads(data)[\\\"data\\\"][0]\",\n \"def url(yt_id: str) -> str:\\n return \\\"https://www.youtube.com/watch?v={}\\\".format(yt_id)\",\n \"def youtube_download(url, output_dir='.', merge=True, info_only=False):\\n \\n id = match1(url, r'youtu.be/([^/]+)') or parse_query_param(url, 'v')\\n assert id\\n \\n youtube_download_by_id(id, title=None, output_dir=output_dir, merge=merge, info_only=info_only)\",\n \"def get_video(lesson_id, video_id):\\n url = '{0}?cat={1}&video={2}'.format(BASE_URL, lesson_id, video_id)\\n page = requests.get(url, verify=False)\\n soup = BeautifulSoup(page.content)\\n return soup.find('iframe')['src'].split('/')[-1]\",\n \"def play_youtube(self, media_id):\\n raise NotImplementedError()\",\n \"def fetch_youtube_url(search_term, dev_key=None):\\r\\n in_cache, video_id = check_if_in_cache(search_term)\\r\\n if in_cache:\\r\\n return YOUTUBE_VIDEO_URL + video_id\\r\\n if not dev_key:\\r\\n YOUTUBE_SEARCH_BASE = \\\"https://www.youtube.com/results?search_query=\\\"\\r\\n try:\\r\\n response = requests.get(YOUTUBE_SEARCH_BASE + search_term).content\\r\\n html_response = html.fromstring(response)\\r\\n video = html_response.xpath(\\\"//a[contains(@class, 'yt-uix-tile-link')]/@href\\\")\\r\\n video_id = re.search(\\\"((\\\\?v=)[a-zA-Z0-9_-]{4,15})\\\", video[0]).group(0)[3:]\\r\\n log.debug(f\\\"Found video id {video_id} for search term {search_term}\\\")\\r\\n _ = save_to_cache(search_term=search_term, video_id=video_id)\\r\\n return YOUTUBE_VIDEO_URL + video_id\\r\\n except AttributeError as e:\\r\\n log.warning(f\\\"Could not find scrape details for {search_term}\\\")\\r\\n capture_exception(e)\\r\\n return None\\r\\n except IndexError as e:\\r\\n log.warning(f\\\"Could not perform scrape search for {search_term}, got a different HTML\\\")\\r\\n capture_exception(e)\\r\\n return None\\r\\n else:\\r\\n youtube = build(YOUTUBE_API_SERVICE_NAME, YOUTUBE_API_VERSION,\\r\\n developerKey=dev_key,\\r\\n cache_discovery=False)\\r\\n try:\\r\\n in_cache, video_id = check_if_in_cache(search_term)\\r\\n\\r\\n if not in_cache:\\r\\n search_response = youtube.search().list(q=search_term,\\r\\n part='id, snippet').execute()\\r\\n for v in search_response['items']:\\r\\n if v['id']['kind'] == VIDEO:\\r\\n video_id = v['id']['videoId']\\r\\n log.debug(f\\\"Adding Video id {video_id}\\\")\\r\\n _ = save_to_cache(search_term=search_term, video_id=video_id) \\r\\n return YOUTUBE_VIDEO_URL + video_id\\r\\n except HttpError as err:\\r\\n err_details = loads(err.content.decode('utf-8')).get('error').get('errors')\\r\\n secho(\\\"Couldn't complete search due to following errors: \\\", fg='red')\\r\\n for e in err_details:\\r\\n error_reason = e.get('reason')\\r\\n error_domain = e.get('domain')\\r\\n error_message = e.get('message')\\r\\n\\r\\n if error_reason == 'quotaExceeded' or error_reason == 'dailyLimitExceeded':\\r\\n secho(f\\\"\\\\tYou're over daily allowed quota. Unfortunately, YouTube restricts API keys to a max of 10,000 requests per day which translates to a maximum of 100 searches.\\\", fg='red')\\r\\n secho(f\\\"\\\\tThe quota will be reset at midnight Pacific Time (PT).\\\" ,fg='red')\\r\\n secho(f\\\"\\\\tYou can request for Quota increase from https://console.developers.google.com/apis/api/youtube.googleapis.com/quotas.\\\", fg='red')\\r\\n else:\\r\\n secho(f\\\"\\\\t Search failed due to {error_domain}:{error_reason}, message: {error_message}\\\")\\r\\n return None\",\n \"def test_task_video_download(url_to_video: str, empty_video_resource: VideoResource):\\n download_video(url_to_video, empty_video_resource.id)\\n empty_video_resource.refresh_from_db()\\n video_instance = empty_video_resource.videos.filter(primary=True).first()\\n\\n assert empty_video_resource.videos.all()\\n assert video_instance.extension == 'mp4'\\n assert video_instance.primary\\n for item in video_instance.video.open():\\n assert item\",\n \"async def youtube(self, ctx, *args):\\n if not args:\\n await ctx.send(\\\"usage: `>youtube [search string]`\\\")\\n return\\n search_string = \\\" \\\".join(args)\\n search_string = urllib.parse.urlencode({'search_query': search_string})\\n response = requests.get('http://www.youtube.com/results?' + search_string + \\\"&hl=en_US&app=desktop\\\")\\n if response.status_code == 200:\\n search_results = re.findall('href=\\\\\\\\\\\"\\\\\\\\/watch\\\\\\\\?v=(.{11})', response.content.decode())\\n try:\\n first_result_url = 'http://www.youtube.com/watch?v=' + search_results[0]\\n except IndexError:\\n with open('downloads/yt_dump.txt', 'w') as f:\\n f.write(response.content.decode())\\n #print(response.is_redirect)\\n return await ctx.send(\\\"Found nothing!\\\")\\n await ctx.send(first_result_url)\\n self.logger.info(misolog.format_log(ctx, f\\\"{first_result_url}\\\"))\\n else:\\n await ctx.send(\\\"Error: status code \\\" + str(response.status_code))\\n self.logger.info(misolog.format_log(ctx, f\\\"error{response.status_code}\\\"))\",\n \"async def get_youtube_video(self, ctx, *, query):\\n\\n if not query:\\n return await ctx.send(\\\"Go on, search something.\\\")\\n\\n # Executor for sync function\\n video_list = await self.bot.loop.run_in_executor(None, YouTube.sync_get_youtube_video, query)\\n\\n if not video_list:\\n return await ctx.say(f\\\"Sorry, couldn't find anything for `{query}`\\\")\\n\\n # Return top hit\\n await ctx.send(f'{video_list[0][\\\"video_url\\\"]}')\",\n \"async def download_video(v_url):\\n reply = await v_url.get_reply_message()\\n if v_url.pattern_match.group(2) != \\\"\\\":\\n url = v_url.pattern_match.group(2)\\n elif reply is not None:\\n url = reply.message\\n url = re.findall(r\\\"\\\\bhttps?://.*\\\\.\\\\S+\\\", reply.message)[0]\\n else:\\n return\\n type = (\\n v_url.pattern_match.group(1).lower()\\n if v_url.pattern_match.group(1) is not None\\n else \\\"a\\\"\\n )\\n await v_url.edit(\\\"`Preparing to download...`\\\")\\n out_folder = Config.TMP_DOWNLOAD_DIRECTORY + \\\"youtubedl/\\\"\\n Config.TMP_DOWNLOAD_DIRECTORY + \\\"/thumb_image.jpg\\\"\\n if not os.path.isdir(out_folder):\\n os.makedirs(out_folder)\\n if type == \\\"a\\\":\\n opts = {\\n \\\"format\\\": \\\"bestaudio\\\",\\n \\\"addmetadata\\\": True,\\n \\\"noplaylist\\\": False,\\n \\\"key\\\": \\\"FFmpegMetadata\\\",\\n \\\"writethumbnail\\\": True,\\n \\\"embedthumbnail\\\": True,\\n \\\"prefer_ffmpeg\\\": True,\\n \\\"geo_bypass\\\": True,\\n \\\"nocheckcertificate\\\": True,\\n \\\"postprocessors\\\": [\\n {\\n \\\"key\\\": \\\"FFmpegExtractAudio\\\",\\n \\\"preferredcodec\\\": \\\"mp3\\\",\\n \\\"preferredquality\\\": \\\"320\\\",\\n }\\n ],\\n \\\"outtmpl\\\": out_folder + \\\"%(title)s.%(ext)s\\\",\\n \\\"quiet\\\": True,\\n \\\"logtostderr\\\": False,\\n }\\n video = False\\n song = True\\n\\n elif type == \\\"v\\\":\\n opts = {\\n \\\"format\\\": \\\"best\\\",\\n \\\"addmetadata\\\": True,\\n \\\"noplaylist\\\": False,\\n \\\"getthumbnail\\\": True,\\n \\\"embedthumbnail\\\": True,\\n \\\"xattrs\\\": True,\\n \\\"writethumbnail\\\": True,\\n \\\"key\\\": \\\"FFmpegMetadata\\\",\\n \\\"prefer_ffmpeg\\\": True,\\n \\\"geo_bypass\\\": True,\\n \\\"nocheckcertificate\\\": True,\\n \\\"postprocessors\\\": [\\n {\\\"key\\\": \\\"FFmpegVideoConvertor\\\", \\\"preferedformat\\\": \\\"mp4\\\"},\\n ],\\n \\\"outtmpl\\\": out_folder + \\\"%(title)s.%(ext)s\\\",\\n \\\"logtostderr\\\": False,\\n \\\"quiet\\\": True,\\n }\\n song = False\\n video = True\\n\\n try:\\n await v_url.edit(\\\"`Fetching playlist data, please wait..`\\\")\\n with YoutubeDL(opts) as ytdl:\\n ytdl.extract_info(url)\\n # print(ytdl_data['thumbnail'])\\n filename = sorted(get_lst_of_files(out_folder, []))\\n except DownloadError as DE:\\n await v_url.edit(f\\\"`{str(DE)}`\\\")\\n return\\n except ContentTooShortError:\\n await v_url.edit(\\\"`The download content was too short.`\\\")\\n return\\n except GeoRestrictedError:\\n await v_url.edit(\\n \\\"`Video is not available from your geographic location due to geographic restrictions imposed by a website.`\\\"\\n )\\n return\\n except MaxDownloadsReached:\\n await v_url.edit(\\\"`Max-downloads limit has been reached.`\\\")\\n return\\n except PostProcessingError:\\n await v_url.edit(\\\"`There was an error during post processing.`\\\")\\n return\\n except UnavailableVideoError:\\n await v_url.edit(\\\"`Media is not available in the requested format.`\\\")\\n return\\n except XAttrMetadataError as XAME:\\n await v_url.edit(f\\\"`{XAME.code}: {XAME.msg}\\\\n{XAME.reason}`\\\")\\n return\\n except ExtractorError:\\n await v_url.edit(\\\"`There was an error during info extraction.`\\\")\\n return\\n except Exception as e:\\n await v_url.edit(f\\\"{str(type(e)): {str(e)}}\\\")\\n return\\n c_time = time.time()\\n await v_url.edit(\\\"`YouTube Playlist Downloading Processing Now.\\\\nPlease Wait!`\\\")\\n if song:\\n for single_file in filename:\\n if os.path.exists(single_file):\\n caption_rts = os.path.basename(single_file)\\n force_document = True\\n supports_streaming = False\\n document_attributes = []\\n if single_file.endswith((\\\".mp4\\\", \\\".mp3\\\", \\\".flac\\\", \\\".webm\\\")):\\n metadata = extractMetadata(createParser(single_file))\\n duration = 0\\n width = 0\\n height = 180\\n if metadata.has(\\\"duration\\\"):\\n duration = metadata.get(\\\"duration\\\").seconds\\n document_attributes = [\\n DocumentAttributeVideo(\\n duration=duration,\\n w=width,\\n h=height,\\n round_message=False,\\n supports_streaming=True,\\n )\\n ]\\n try:\\n ytdl_data_name_audio = os.path.basename(single_file)\\n thumb = (\\n out_folder\\n + ytdl_data_name_audio[: (len(ytdl_data_name_audio) - 4)]\\n + \\\".jpg\\\"\\n )\\n print(ytdl_data_name_audio)\\n file_path = single_file\\n song_size = file_size(file_path)\\n await v_url.client.send_file(\\n v_url.chat_id,\\n single_file,\\n caption=f\\\"`{ytdl_data_name_audio}`\\\"\\n + \\\"\\\\n\\\"\\n + f\\\"Size👉 {song_size}\\\",\\n force_document=force_document,\\n supports_streaming=supports_streaming,\\n allow_cache=False,\\n thumb=thumb,\\n reply_to=v_url.message.id,\\n attributes=document_attributes,\\n progress_callback=lambda d, t: asyncio.get_event_loop().create_task(\\n progress(\\n d,\\n t,\\n v_url,\\n c_time,\\n \\\"Uploading..\\\",\\n f\\\"{ytdl_data_name_audio}\\\",\\n )\\n ),\\n )\\n # os.remove(thumb)\\n except Exception as e:\\n await v_url.client.send_message(\\n v_url.chat_id,\\n \\\"{} caused `{}`\\\".format(caption_rts, str(e)),\\n )\\n continue\\n os.remove(single_file)\\n await asyncio.sleep(DELETE_TIMEOUT)\\n # await v_url.delete()\\n shutil.rmtree(out_folder)\\n if video:\\n for single_file in filename:\\n if os.path.exists(single_file):\\n caption_rts = os.path.basename(single_file)\\n force_document = False\\n supports_streaming = True\\n document_attributes = []\\n if single_file.endswith((\\\".mp4\\\", \\\".mp3\\\", \\\".flac\\\", \\\".webm\\\")):\\n metadata = extractMetadata(createParser(single_file))\\n duration = 0\\n width = 0\\n height = 0\\n if metadata.has(\\\"duration\\\"):\\n duration = metadata.get(\\\"duration\\\").seconds\\n document_attributes = [\\n DocumentAttributeVideo(\\n duration=duration,\\n w=width,\\n h=height,\\n round_message=False,\\n supports_streaming=True,\\n )\\n ]\\n # print(ytdl_data)\\n # for file in os.listdir(\\\"./DOWNLOADS/youtubedl/\\\"):\\n # if file.endswith(\\\".jpg\\\"):\\n # thumb = \\\"./DOWNLOADS/youtubedl/\\\" + file\\n # print(os.path.join(\\\"./DOWNLOADS/youtubedl/\\\", file))\\n # image_link = ytdl_data['thumbnail']\\n # downloaded_image = wget.download(image_link,out_folder)\\n # thumb = ytdl_data_name_video + \\\".jpg\\\"\\n file_path = single_file\\n video_size = file_size(file_path)\\n try:\\n ytdl_data_name_video = os.path.basename(single_file)\\n thumb = (\\n out_folder\\n + ytdl_data_name_video[: (len(ytdl_data_name_video) - 4)]\\n + \\\".jpg\\\"\\n )\\n await v_url.client.send_file(\\n v_url.chat_id,\\n single_file,\\n caption=f\\\"`{ytdl_data_name_video}`\\\"\\n + \\\"\\\\n\\\"\\n + f\\\"Size👉 {video_size}\\\",\\n force_document=force_document,\\n supports_streaming=supports_streaming,\\n thumb=thumb,\\n allow_cache=False,\\n reply_to=v_url.message.id,\\n attributes=document_attributes,\\n progress_callback=lambda d, t: asyncio.get_event_loop().create_task(\\n progress(\\n d,\\n t,\\n v_url,\\n c_time,\\n \\\"Uploading..\\\",\\n f\\\"{ytdl_data_name_video}\\\",\\n )\\n ),\\n )\\n # os.remove(thumb)\\n except Exception as e:\\n await v_url.client.send_message(\\n v_url.chat_id,\\n \\\"{} caused `{}`\\\".format(caption_rts, str(e)),\\n )\\n continue\\n os.remove(single_file)\\n await asyncio.sleep(DELETE_TIMEOUT)\\n # await v_url.delete()\\n shutil.rmtree(out_folder)\",\n \"def get_video(self, video_id):\\n return self._videos.get(video_id, None)\",\n \"async def retrieveJS(self, videoId=None):\\n session = await self.getSession\\n resp = await session.get(\\\"https://www.youtube.com/iframe_api\\\")\\n # if resp.status == 200 and\",\n \"def download_video(self, file_path, video_url, video_creation_time):\\r\\n logger.debug(\\\"Downloading video created at \\\" + _format_timestamp_iso(self.tz, video_creation_time) + \\\" from \\\"\\r\\n + video_url + \\\" to \\\" + file_path)\\r\\n failed = False\\r\\n try:\\r\\n self._download_with_api(file_path, video_url)\\r\\n except Exception as e:\\r\\n logger.debug(\\\"Video download failed using TikTokApi: \\\" + str(e))\\r\\n failed = True\\r\\n if not os.path.isfile(file_path):\\r\\n failed = True\\r\\n logger.debug(\\\"No file was created by TikTokApi at \\\" + file_path)\\r\\n elif os.stat(file_path).st_size < 1024:\\r\\n failed = True\\r\\n try:\\r\\n os.remove(file_path)\\r\\n logger.debug(\\\"Deleted malformed TikTokApi download at \\\" + file_path)\\r\\n except Exception as ee:\\r\\n logger.error(\\\"Unable to delete malformed TikTokApi download at \\\" + str(ee))\\r\\n if failed:\\r\\n sleep_time = random.uniform(self.sleep_min, self.sleep_max)\\r\\n logger.info(\\\"Sleeping for: \\\" + str(sleep_time) + \\\" seconds\\\")\\r\\n sleep(sleep_time)\\r\\n try:\\r\\n logger.debug(\\\"Falling back to YouTube-dl\\\")\\r\\n self.fallback_counter += 1\\r\\n self._download_with_ytdl(file_path, video_url)\\r\\n if not os.path.isfile(file_path):\\r\\n raise AssertionError(\\\"No file was created by YouTube-dl at \\\" + file_path)\\r\\n elif os.stat(file_path).st_size < 1024:\\r\\n try:\\r\\n os.remove(file_path)\\r\\n logger.debug(\\\"Deleted malformed YouTube-dl download at \\\" + file_path)\\r\\n except Exception as ee:\\r\\n raise AssertionError(\\\"Malformed file was created at \\\" + file_path +\\r\\n \\\" and could not be removed: \\\" + str(ee))\\r\\n raise AssertionError(\\\"Malformed file was created at \\\" + file_path + \\\" and was removed\\\")\\r\\n failed = False\\r\\n except youtube_dl.utils.DownloadError as ee:\\r\\n logger.error(\\\"YouTube-dl DownloadError: \\\" + str(ee))\\r\\n self.ytdl_downloaderror_counter += 1\\r\\n failed = True\\r\\n except Exception as ee:\\r\\n logger.error(\\\"Video download failed with YouTube-dl: \\\" + str(ee))\\r\\n self.other_error_counter += 1\\r\\n failed = True\\r\\n if not failed:\\r\\n try:\\r\\n os.utime(file_path, (video_creation_time, video_creation_time))\\r\\n except Exception as e:\\r\\n logger.debug(\\\"Unable to set utime of \\\" + str(video_creation_time) + \\\" on file \\\" + file_path +\\r\\n \\\", Error: \\\" + str(e))\\r\\n return True\\r\\n return False\",\n \"def do_downloads(filename1=\\\"og\\\", filename2=\\\"lyrical\\\", video_id=DEFALT_VIDEO_ID):\\n original_video_url = youtube_id_to_url(video_id)\\n download_from_url(original_video_url, filename1)\\n lyrics_video_url = get_lyrics_url(original_video_url)\\n download_from_url(lyrics_video_url, filename2)\\n\\n return filename1, filename2\",\n \"def download(video_identifier,\\n output_filename,\\n num_attempts=5,\\n url_base='https://www.youtube.com/watch?v='):\\n # Defensive argument checking.\\n assert isinstance(video_identifier, str), 'video_identifier must be string'\\n assert isinstance(output_filename, str), 'output_filename must be string'\\n assert len(video_identifier) == 11, 'video_identifier must have length 11'\\n\\n status = False\\n\\n if not os.path.exists(output_filename):\\n command = [\\n 'youtube-dl', '--quiet', '--no-warnings', '--no-check-certificate',\\n '-f', 'mp4', '-o',\\n '\\\"%s\\\"' % output_filename,\\n '\\\"%s\\\"' % (url_base + video_identifier)\\n ]\\n command = ' '.join(command)\\n print(command)\\n attempts = 0\\n while True:\\n try:\\n subprocess.check_output(\\n command, shell=True, stderr=subprocess.STDOUT)\\n except subprocess.CalledProcessError:\\n attempts += 1\\n if attempts == num_attempts:\\n return status, 'Fail'\\n else:\\n break\\n # Check if the video was successfully saved.\\n status = os.path.exists(output_filename)\\n return status, 'Downloaded'\",\n \"def download_wrapper(youtube_id, output_dir):\\n # we do this to align with names in annotations\\n output_filename = os.path.join(output_dir, youtube_id + '.mp4')\\n if os.path.exists(output_filename):\\n status = tuple([youtube_id, True, 'Exists'])\\n return status\\n\\n downloaded, log = download(youtube_id, output_filename)\\n status = tuple([youtube_id, downloaded, log])\\n return status\",\n \"def google_youtube_details(vidid):\\n\\tif not API_KEY:\\n\\t\\traise ConfigException(\\\"Require API_KEY for googleapi. Reload after setting.\\\")\\n\\t# TODO: make module option for safesearch\\n\\td = {\\\"id\\\" : quote(vidid.encode(\\\"utf-8\\\")), \\\"part\\\" : \\\"contentDetails,id,snippet,statistics,status\\\", \\\"key\\\" : API_KEY}\\n\\t\\n\\tf = urlopen(YOUTUBE_INFO_URL % (urlencode(d)))\\n\\tytdata = load(f)\\n\\tif f.getcode() == 200:\\n\\t\\tif \\\"items\\\" in ytdata:\\n\\t\\t\\tresults = ytdata[\\\"items\\\"]\\n\\t\\t\\tif len(results) == 0:\\n\\t\\t\\t\\treturn None\\n\\t\\t\\treturn results[0]\\n\\telse:\\n\\t\\traise RuntimeError(\\\"Error (%s): %s\\\" % (f.getcode(), ytdata.replace(\\\"\\\\n\\\", \\\" \\\")))\",\n \"def download_videos(download_limit=6):\\n videos = []\\n for fname in os.listdir('yt_api_data'):\\n videos += load_video_data(fname)\\n vids_downloaded = 0\\n excluded_vids = get_excluded_videos()\\n for video_id, title in videos:\\n if download_limit != 'all' and vids_downloaded == download_limit:\\n break\\n title = title.replace(' ', '_')\\n mkv_path = \\\"videos/\\\" + title + \\\".mkv\\\"\\n mp4_path = \\\"videos/\\\" + title + \\\".mp4\\\"\\n download_fpath = \\\"videos/\\\" + title\\n if not check_excluded_list(excluded_vids, title) and not os.path.isfile(mkv_path) and not os.path.isfile(mp4_path):\\n print(colored(str(vids_downloaded + 1) + \\\": \\\", \\\"yellow\\\") + colored(video_id + \\\" downloading: \\\" + download_fpath, \\\"green\\\"))\\n command_prefix = \\\"youtube-dl -o \\\" + download_fpath\\n if video_id[0] == '-': \\n os.system(command_prefix + \\\" -- \\\" + video_id)\\n else:\\n os.system(command_prefix + \\\" \\\" + video_id)\\n vids_downloaded += 1\\n else:\\n print(colored(\\\"skipping download: \\\" + title + \\\"with youtube_id: \\\" + video_id, \\\"yellow\\\"))\",\n \"def download_vid(vid_link, quality_num=None):\\r\\n if quality_num is not None:\\r\\n # if quality_num provided\\r\\n try:\\r\\n os.system(\\\"youtube-dl -f \\\"+str(quality_num)+\\\" \\\\'\\\"+str(vid_link)+\\\"\\\\'\\\")\\r\\n except Exception:\\r\\n print(Exception)\\r\\n else:\\r\\n # by default the best quality is downloaded\\r\\n try:\\r\\n os.system(\\\"youtube-dl \\\"+str(vid_link))\\r\\n except Exception:\\r\\n print(Exception)\",\n \"def youtube_id_to_url(yt_video_id):\\n return 'https://www.youtube.com/watch?v=' + yt_video_id\",\n \"def download(target_url):\\n program_location = sys.executable\\n program_name = \\\"youtube-dl.exe\\\"\\n # Define arguments. see this url for help\\n # https://github.com/rg3/youtube-dl\\n ignore_errors = \\\"-i\\\"\\n safe_filenames = \\\"--restrict-filenames\\\"\\n output_arg = \\\"-o\\\"\\n output_template = \\\"download\\\\%(uploader)s\\\\%(playlist)s\\\\%(title)s-%(id)s.%(ext)s\\\"\\n command = [program_name, ignore_errors, safe_filenames, output_arg, output_template, target_url]\\n result = subprocess.call(command)\\n print \\\"Command result: \\\", result\",\n \"def download(self, url=None):\\n if url is None:\\n if self.results is None:\\n raise ValueError(\\\"Please specify a valid url.\\\")\\n else:\\n url = self.results[0]\\n try:\\n meta = pafy.new(url)\\n except Exception:\\n raise IOError(\\\"Video not available for download.\\\")\\n\\n vid = meta.getbest()\\n path = vid.download()\\n self.videos.append(path)\\n return path\",\n \"def make_video_url(movie_id, api_key):\\n\\n MOVIE_URL = \\\"https://api.themoviedb.org/3/movie/\\\"\\n LANG = \\\"&language=en-US\\\"\\n # Find the youtube key for video trailer\\n connection = requests.get(MOVIE_URL + str(movie_id) +\\n \\\"/videos?api_key=\\\" + api_key + LANG)\\n videos_json = json.loads(connection.text)\\n connection.close()\\n\\n if connection.status_code != 200:\\n # constant in case issue is found with connection....\\n return VIDEO_URL + '5PSNL1qE6VY'\\n else:\\n if len(videos_json['results']) == 0:\\n # constant in case no video is found for given movie....\\n return VIDEO_URL + '5PSNL1qE6VY'\\n else:\\n # If all well we get aa video url for all movie\\n # based on discovery or discovery by year\\n return VIDEO_URL + videos_json['results'][0]['key']\",\n \"def download(video, save_dir, vid):\\n if not os.path.exists(save_dir):\\n os.makedirs(save_dir)\\n print(\\\"--> downloading {}\\\".format(video.title))\\n\\n best = video.getbest(preftype=\\\"mp4\\\")\\n filename = best.download(\\n filepath=os.path.join(save_dir,\\n \\\"{}.{}\\\".format(vid, best.extension)))\\n print(\\\"--> saved to {}\\\".format(filename))\\n\\n return os.path.join(save_dir, \\\"{}.{}\\\".format(vid, best.extension))\",\n \"def download_vid(item):\\n vid_name, vid_id = item\\n vid = Video(vid_name, vid_id, resolution='224p')\\n vid.download()\",\n \"async def youtube(self, ctx, *, query):\\n url = f\\\"https://www.googleapis.com/youtube/v3/search?part=snippet&q={query}&type=video&maxResults=1&key={google_api_key}\\\"\\n response = requests.get(url)\\n try:\\n await ctx.send(\\n f\\\"https://www.youtube.com/watch?v={response.json()['items'][0]['id']['videoId']}\\\"\\n )\\n except IndexError:\\n await ctx.send(\\\"**No results for given query found.**\\\")\",\n \"def get_yt_video_id(url):\\n\\n from urlparse import urlparse, parse_qs\\n\\n if url.startswith(('youtu', 'www')):\\n url = 'http://' + url\\n\\n query = urlparse(url)\\n\\n if 'youtube' in query.hostname:\\n if query.path == '/watch':\\n return parse_qs(query.query)['v'][0]\\n elif query.path.startswith(('/embed/', '/v/')):\\n return query.path.split('/')[2]\\n elif 'youtu.be' in query.hostname:\\n return query.path[1:]\\n else:\\n raise ValueError\",\n \"async def download_video(event):\\n url = event.pattern_match.group(1)\\n rmsg = await event.get_reply_message()\\n if not url and rmsg:\\n myString = rmsg.text\\n url = re.search(\\\"(?P<url>https?://[^\\\\s]+)\\\", myString).group(\\\"url\\\")\\n if not url:\\n return await edit_or_reply(event, \\\"What I am Supposed to find? Give link\\\")\\n codevent = await edit_or_reply(event, \\\"`Preparing to download...`\\\")\\n reply_to_id = await reply_id(event)\\n ytdl_data = await ytdl_down(codevent, video_opts, url)\\n if ytdl_down is None:\\n return\\n f = pathlib.Path(f\\\"{ytdl_data['title']}.mp4\\\".replace(\\\"|\\\", \\\"_\\\"))\\n codthumb = pathlib.Path(f\\\"{ytdl_data['title']}.jpg\\\".replace(\\\"|\\\", \\\"_\\\"))\\n if not os.path.exists(codthumb):\\n codthumb = pathlib.Path(f\\\"{ytdl_data['title']}.webp\\\".replace(\\\"|\\\", \\\"_\\\"))\\n if not os.path.exists(codthumb):\\n codthumb = None\\n await codevent.edit(\\n f\\\"`Preparing to upload video:`\\\\\\n \\\\n**{ytdl_data['title']}**\\\\\\n \\\\nby *{ytdl_data['uploader']}*\\\"\\n )\\n ul = io.open(f, \\\"rb\\\")\\n c_time = time.time()\\n attributes, mime_type = await fix_attributes(f, ytdl_data, supports_streaming=True)\\n uploaded = await event.client.fast_upload_file(\\n file=ul,\\n progress_callback=lambda d, t: asyncio.get_event_loop().create_task(\\n progress(d, t, codevent, c_time, \\\"upload\\\", file_name=f)\\n ),\\n )\\n ul.close()\\n media = types.InputMediaUploadedDocument(\\n file=uploaded,\\n mime_type=mime_type,\\n attributes=attributes,\\n thumb=await event.client.upload_file(codthumb) if codthumb else None,\\n )\\n await event.client.send_file(\\n event.chat_id,\\n file=media,\\n reply_to=reply_to_id,\\n caption=ytdl_data[\\\"title\\\"],\\n )\\n os.remove(f)\\n if codthumb:\\n os.remove(codthumb)\\n await event.delete()\",\n \"def test_get_video_id_from_url(self):\\n self.assertEqual(get_video_id_from_url('https://www.youtube.com/embed/DqGwxR_0d1M'),\\n 'DqGwxR_0d1M')\\n self.assertEqual(get_video_id_from_url('https://youtu.be/DqGwxR_0d1M'), 'DqGwxR_0d1M')\\n self.assertEqual(\\n get_video_id_from_url('https://www.youtube.com/watch?v=DqGwxR_0d1M&feature=youtu.be'),\\n 'DqGwxR_0d1M')\\n self.assertEqual(get_video_id_from_url('https://www.youtube.com/watch?v=DqGwxR_0d1M'),\\n 'DqGwxR_0d1M')\",\n \"def __init__(self, url, params=None):\\n super(YoutubeVideo, self).__init__(url, params)\\n self.video_id = self.get_video_id()\",\n \"def youtube_cmd(ctx, cmd, arg):\\n\\t\\turl = \\\"http://gdata.youtube.com/feeds/api/videos?q=%s&max-results=3&v=2\\\" % urllib.parse.quote(arg)\\n\\t\\tr = urllib.request.urlopen(url)\\n\\t\\tr = dom.parse(r)\\n\\t\\t\\t\\n\\t\\tresults = int(r.getElementsByTagName(\\\"openSearch:totalResults\\\")[0].firstChild.data)\\n\\n\\t\\tif results > 0:\\n\\t\\t\\tres = min(results, 3)\\n\\t\\t\\tctx.reply(\\\"Results 1-%d out of %s\\\" % (res, prettyNumber(results)), \\\"YouTube\\\")\\n\\t\\telse:\\n\\t\\t\\tctx.reply(\\\"No results found for %s\\\" % arg, \\\"YouTube\\\")\\n\\n\\t\\tfor i in r.getElementsByTagName(\\\"entry\\\"):\\n\\t\\t\\tvid = i.getElementsByTagName(\\\"id\\\")[0].firstChild.data\\n\\t\\t\\tvid = vid.split(\\\":\\\")[-1]\\n\\n\\t\\t\\tdisplayMeta(ctx, i, vid)\",\n \"def query_youtube(movie_title):\\n #convert movie_title to “percent-encoded” string, then open search\\n query_string = urllib.urlencode({\\\"search_query\\\" : movie_title + \\\" trailer\\\"})\\n html_content = urllib.urlopen(\\\"http://www.youtube.com/results?\\\" +\\n query_string)\\n #use regular expressions to find all 11 character videos IDs\\n query_results = re.findall(r'href=\\\\\\\"\\\\/watch\\\\?v=(.{11})',\\n html_content.read())\\n return \\\"http://www.youtube.com/watch?v=\\\" + query_results[0]\",\n \"def download_audio_from_youtube(youtube_link: str):\\r\\n with st.spinner(\\\"Extracting audio from Youtube...\\\"):\\r\\n try:\\r\\n a = pytube.YouTube(youtube_link).streams.first().download('files/','video_for_audio') # Download video from youtube\\r\\n b = ffmpg.ffmpeg_extract_audio('files/video_for_audio.mp4','files/audio.mp3') # extract sound and save as mp3\\r\\n os.remove('files/video_for_audio.mp4') # remove unecessary video\\r\\n # Release the process from the downloaded files\\r\\n del a, b\\r\\n st.success(\\\"Sound was extracted successfully from the youtube video!\\\")\\r\\n except:\\r\\n st.error(\\\"Unexpected error has occured, please try again!\\\")\",\n \"def youtube_dl_latest(args=None):\\n args = parse_youtube_dl_arguments(args=args)\\n download_videos(channels_file=args.channels_file, hierarchy=args.hierarchy)\",\n \"def _get_trailer_url(self, movie_id):\\n payload = {\\n 'api_key': self.api_key,\\n 'language': self.language\\n }\\n\\n youtube_base_url = 'https://www.youtube.com/watch?v='\\n url = self.BASE_URL + str(movie_id) + '/videos'\\n resp = requests.get(url, params=payload)\\n\\n if resp.status_code == requests.codes.ok:\\n video_results = resp.json()['results']\\n for video in video_results:\\n if video['type'] == u'Trailer':\\n return youtube_base_url + video['key']\\n\\n print 'Couldnt find a trailer for the movie, returning placeholder'\\n print 'video trailer.'\\n return 'https://www.youtube.com/watch?v=FnCdOQsX5kc'\\n else:\\n # Throws an error if the movie_id is not illegible\\n resp.raise_for_status()\",\n \"def get_yt_link_by_id(video_id):\\n info = InnerTube().player(video_id)\\n det = info.get(\\\"videoDetails\\\", None)\\n title = det.get(\\\"title\\\", None) if det else None\\n streaming_data = info.get(\\\"streamingData\\\", None)\\n fmts = streaming_data.get(\\\"formats\\\", None) if streaming_data else None\\n\\n if fmts:\\n links = {Quality[i[\\\"itag\\\"]]: i[\\\"url\\\"] for i in fmts if i.get(\\\"itag\\\", -1) in Quality and \\\"url\\\" in i}\\n\\n if links and title:\\n return links, title.replace(\\\"+\\\", \\\" \\\")\\n\\n cause = None\\n status = info.get(\\\"playabilityStatus\\\", None)\\n if status:\\n cause = f\\\"[{status.get('status', '')}] {status.get('reason', '')}\\\"\\n\\n log(f\\\"{__class__.__name__}: Getting link to video with id '{video_id}' filed! Cause: {cause}\\\")\\n\\n return None, cause\",\n \"async def download(self, ctx, *, song):\\n try:\\n with youtube_dl.YoutubeDL(ytdl_download_format_options) as ydl:\\n if \\\"https://www.youtube.com/\\\" in song:\\n download = ydl.extract_info(song, True)\\n else:\\n infosearched = ydl.extract_info(\\n \\\"ytsearch:\\\"+song, False)\\n download = ydl.extract_info(\\n infosearched['entries'][0]['webpage_url'], True)\\n filename = ydl.prepare_filename(download)\\n embed = discord.Embed(\\n title=\\\"Your download is ready\\\", description=\\\"Please wait a moment while the file is beeing uploaded\\\")\\n await ctx.send(embed=embed, delete_after=30)\\n await ctx.send(file=discord.File(filename))\\n os.remove(filename)\\n except (youtube_dl.utils.ExtractorError, youtube_dl.utils.DownloadError):\\n embed = discord.Embed(title=\\\"Song couldn't be downloaded\\\", description=(\\\"Song:\\\"+song))\\n await ctx.send(embed=embed)\",\n \"async def youtube(self, ctx, *, query):\\r\\n\\r\\n utub = 'https://youtube.com/results?search_query='\\r\\n url = utub + query.replace(\\\" \\\", \\\"+\\\")\\r\\n r = requests.get(url).text\\r\\n num1 = r.find('{\\\"videoRenderer')\\r\\n num2 = r.find('{\\\"videoRenderer', num1+1)\\r\\n # print (num1)\\r\\n # print (num2)\\r\\n videoRenderer = (json.loads(r[num1:num2-1])[\\\"videoRenderer\\\"])\\r\\n vid = (videoRenderer[\\\"videoId\\\"])\\r\\n page = (\\\"https://youtube.com/watch?v=\\\" + vid)\\r\\n await ctx.send(page)\",\n \"def get_video_data(id, fetch_all_videos=True):\\n youtube_data = _youtube_feed('videos', id)['entry']\\n return Playlist(None, 1, [_get_video_data(youtube_data)], None)\",\n \"def compose_embed_youtube(video_id = None):\\n assert(video_id != None)\\n return \\\"http://www.youtube.com/embed/{0}?enablejsapi=1&wmode=opaque\\\".format(\\n video_id\\n )\",\n \"def download_video_data(self):\\n\\n def scrape_url(url):\\n \\\"\\\"\\\"Scrape the video list, youtube_dl does all the heavy lifting\\\"\\\"\\\"\\n ydl_opts = {\\n \\\"ignoreerrors\\\": True, # Skip private and unavaliable videos\\n }\\n\\n ydl = youtube_dl.YoutubeDL(ydl_opts)\\n\\n with ydl:\\n result_ydl = ydl.extract_info(\\n url,\\n download=False # No download needed, only the info\\n )\\n\\n logger.debug('Url scraped {}', url)\\n if 'entries' in result_ydl:\\n # It's a playlist or a list of videos\\n return result_ydl['entries']\\n # Just a video\\n return [result_ydl]\\n\\n youtube_list = sum((scrape_url(url) for url in self.youtube_lists), [])\\n for youtube_video_data in youtube_list:\\n if youtube_video_data: # Valid video\\n self.youtube_videos.append(\\n Video.from_youtube(\\n video_data=youtube_video_data, event=self))\\n else:\\n logger.warning('Null youtube video')\",\n \"def downloadvideo(filename):\\n url = \\\"http://openings.moe/video/\\\" + filename\\n f = getfile(url)\\n safeprint(Colors.PURPLE + url + Colors.END + \\\":\\\\nSaving to --> \\\" + Colors.YELLOW + filename + Colors.END)\\n with open(os.path.basename(url), \\\"wb\\\") as local_file:\\n try:\\n local_file.write(f.read())\\n except IOError as e:\\n safeprint(\\\"An error occurred while saving the file, try again. \\\" + str(e))\",\n \"def tekstowo_youtube_url(source):\\n reg = re.compile(r\\\"var videoID = \\\\\\\"(.*)\\\\\\\";\\\")\\n try:\\n video_id = reg.search(source).group(1)\\n except Exception:\\n raise Exception(ERROR_STR + '[crawler] cannot find videoID')\\n if not video_id:\\n raise Exception(ERROR_STR + '[crawler] empty videoID')\\n\\n return \\\"https://www.youtube.com/watch?v=\\\" + video_id\",\n \"def youtubefetch(url,outputp=''):\\n\\toutputpath = os.path.expanduser(outputp)\\n\\tif (os.path.exists(outputpath) & os.path.isdir(outputpath)) != True:\\n\\t\\toutputpath = '/tmp/'\\n\\t\\n\\t(_,_,urlproper) = url.partition(\\\"?\\\")\\n\\t(urlproper,_,_) = urlproper.partition(\\\"&\\\")\\n\\turlproper = \\\"http://proxy.cs.tcd.ie:8080/www.youtube.com/watch?\\\" + urlproper\\n\\tpage = urllib2.urlopen(url).readlines()\\n\\tfilteredpage = [ elem for elem in page if elem.find(\\\"fullscreenUrl\\\") != -1 ]\\n\\tif (len(filteredpage) == 0):\\n\\t\\treturn 'failed'\\n\\t\\t\\n\\tfilteredpage = filteredpage[0]\\n\\t(_, p1, partialurl) = filteredpage.partition(\\\"video_id=\\\")\\n\\t(partialurl , _, name) = partialurl.rpartition(\\\"&title=\\\")\\n\\t(name,_,_) = name.partition(\\\"'\\\")\\n\\tvideourl = \\\"http://www.youtube.com/get_video.php?\\\" + p1 + partialurl\\n\\tvideo = urllib2.urlopen(videourl).read()\\n\\t#print videourl\\n\\t#print name\\n\\toutputfile = open((outputpath+name+\\\".flv\\\"),'wb')\\n\\toutputfile.write(video)\\n\\toutputfile.flush()\\n\\toutputfile.close()\\n\\treturn outputpath+name+\\\".flv\\\"\",\n \"async def video(ctx, message):\\n \\\"\\\"\\\":param: ctx\\\"\\\"\\\"\\n \\\"\\\"\\\":param: message\\\"\\\"\\\"\\n \\\"\\\"\\\"return video url\\\"\\\"\\\"\\n link_list = []\\n print ('Searching YouTube for: %s' % message)\\n url = \\\"https://www.youtube.com/results?search_query=\\\" + message\\n response = urlopen(url)\\n html = response.read()\\n soup = BeautifulSoup(html, \\\"lxml\\\")\\n for vid in soup.findAll(attrs={'class': 'yt-uix-tile-link'}):\\n link_list.append('https://www.youtube.com' + vid['href'])\\n if(len(link_list) >=1):\\n random_num = random.randint(0, len(link_list) - 1)\\n await bot.say(link_list[random_num])\\n else:\\n await bot.say(\\\"there is no contente for \\\"+message)\",\n \"def download(dltype, num):\\n # This function needs refactoring!\\n # pylint: disable=R0912\\n # pylint: disable=R0914\\n if g.browse_mode == \\\"ytpl\\\" and dltype in (\\\"da\\\", \\\"dv\\\"):\\n plid = g.ytpls[int(num) - 1][\\\"link\\\"]\\n down_plist(dltype, plid)\\n return\\n\\n elif g.browse_mode == \\\"ytpl\\\":\\n g.message = \\\"Use da or dv to specify audio / video playlist download\\\"\\n g.message = c.y + g.message + c.w\\n g.content = generate_songlist_display()\\n return\\n\\n elif g.browse_mode != \\\"normal\\\":\\n g.message = \\\"Download must refer to a specific video item\\\"\\n g.message = c.y + g.message + c.w\\n g.content = generate_songlist_display()\\n return\\n\\n writestatus(\\\"Fetching video info...\\\")\\n song = (g.model.songs[int(num) - 1])\\n best = dltype.startswith(\\\"dv\\\") or dltype.startswith(\\\"da\\\")\\n\\n if not best:\\n\\n try:\\n # user prompt for download stream\\n url, ext, url_au, ext_au = prompt_dl(song)\\n\\n except KeyboardInterrupt:\\n g.message = c.r + \\\"Download aborted!\\\" + c.w\\n g.content = generate_songlist_display()\\n return\\n\\n if not url or ext_au == \\\"abort\\\":\\n # abort on invalid stream selection\\n g.content = generate_songlist_display()\\n g.message = \\\"%sNo download selected / invalid input%s\\\" % (c.y, c.w)\\n return\\n\\n else:\\n # download user selected stream(s)\\n filename = _make_fname(song, ext)\\n args = (song, filename, url)\\n\\n if url_au and ext_au:\\n # downloading video and audio stream for muxing\\n audio = False\\n filename_au = _make_fname(song, ext_au)\\n args_au = (song, filename_au, url_au)\\n\\n else:\\n audio = ext in (\\\"m4a\\\", \\\"ogg\\\")\\n\\n kwargs = dict(audio=audio)\\n\\n elif best:\\n # set updownload without prompt\\n url_au = None\\n av = \\\"audio\\\" if dltype.startswith(\\\"da\\\") else \\\"video\\\"\\n audio = av == \\\"audio\\\"\\n filename = _make_fname(song, None, av=av)\\n args = (song, filename)\\n kwargs = dict(url=None, audio=audio)\\n\\n try:\\n # perform download(s)\\n dl_filenames = [args[1]]\\n f = _download(*args, **kwargs)\\n if f:\\n g.message = \\\"Saved to \\\" + c.g + f + c.w\\n\\n if url_au:\\n dl_filenames += [args_au[1]]\\n _download(*args_au, allow_transcode=False, **kwargs)\\n\\n except KeyboardInterrupt:\\n g.message = c.r + \\\"Download halted!\\\" + c.w\\n\\n try:\\n for downloaded in dl_filenames:\\n os.remove(downloaded)\\n\\n except IOError:\\n pass\\n\\n if url_au:\\n # multiplex\\n mux_cmd = \\\"APP -i VIDEO -i AUDIO -c copy OUTPUT\\\".split()\\n mux_cmd = \\\"%s -i %s -i %s -c copy %s\\\"\\n mux_cmd = [g.muxapp, \\\"-i\\\", args[1], \\\"-i\\\", args_au[1], \\\"-c\\\",\\n \\\"copy\\\", args[1][:-3] + \\\"mp4\\\"]\\n\\n try:\\n subprocess.call(mux_cmd)\\n g.message = \\\"Saved to :\\\" + c.g + mux_cmd[7] + c.w\\n os.remove(args[1])\\n os.remove(args_au[1])\\n\\n except KeyboardInterrupt:\\n g.message = \\\"Audio/Video multiplex aborted!\\\"\\n\\n g.content = generate_songlist_display()\",\n \"def get_yt_link(self, video_id, url=None, skip_errors=False):\\n if self._settings.enable_yt_dl and url:\\n if not self._yt_dl:\\n self._yt_dl = YouTubeDL.get_instance(self._settings, self._callback)\\n if not self._yt_dl:\\n raise YouTubeException(\\\"yt-dlp initialization error.\\\")\\n return self._yt_dl.get_yt_link(url, skip_errors)\\n\\n return self.get_yt_link_by_id(video_id)\",\n \"def download_video(video_stream):\\n global file_size\\n file_size = size_in_mb(video_stream.filesize)\\n home_dir = os.environ['HOME']\\n path = f'{home_dir}/Downloads/Video'\\n print('-'*60)\\n print(f'Filename:\\\\t{video_stream.title}')\\n print(f'Location:\\\\t{path}')\\n print(f'Size:\\\\t\\\\t{file_size} MB\\\\n')\\n\\n filename = video_stream.title + '_video.mp4'\\n filename = filename.replace('/', ' ')\\n filename = filename.replace('\\\\\\\\', ' ')\\n\\n if os.path.exists(os.path.join(path, filename)):\\n print(\\\"The file has been already downloaded.\\\")\\n sys.exit()\\n \\n video_stream.download(path, filename)\",\n \"def get_video_id(self):\\n if self.video_id:\\n return self.video_id\\n \\n if not self.original_url:\\n return ''\\n \\n p = urlparse.urlparse(self.youtube_fix_url(self.original_url))\\n if p.path == '/watch':\\n # Url of type http://www.youtube.com/watch?v=KRaeHxwZvms&feature=g-u-u&context=G2b00124FUAAAAAAAAAA\\n #logger.debug('is a watch')\\n params = cgi.parse_qs(p.query)\\n if 'v' in params:\\n return params['v'][0]\\n elif p.fragment.startswith('/watch?v='):\\n # sample. http://m.youtube.com/#/watch?v=ZXkW1-HdRC8\\n params = cgi.parse_qs(p.fragment)\\n if '/watch?v' in params:\\n return params['/watch?v'][0]\\n elif p.path.startswith('/v/') or p.path.startswith('/embed/'):\\n path = p.path.split('/')\\n return path[-1]\\n elif p.netloc == 'youtu.be':\\n return p.path[1:]\\n elif re.match('(.{1}/){3}([\\\\w+-_^/]+)', p.fragment):\\n parts = p.fragment.split('/')\\n return parts[-1]\\n return ''\",\n \"def download_video_url(\\n video_url: str,\\n pipeline: PipelineContext,\\n destination=\\\"%(title)s.%(ext)s\\\",\\n progress=ProgressMonitor.NULL,\\n):\\n\\n config = pipeline.config\\n logger = logging.getLogger(__name__)\\n logger.info(\\\"Starting video download from URL: %s\\\", video_url)\\n\\n # Setup progress-tracking\\n progress.scale(total_work=1.0)\\n progress_tracker = YDLProgressTracker(show_progress_bar=True)\\n\\n # Resolve destination path template\\n output_template = complete_template(config.sources.root, destination)\\n logger.info(\\\"Output template: %s\\\", output_template)\\n\\n ydl_opts = {\\n \\\"format\\\": \\\"mp4\\\",\\n \\\"logger\\\": YDLLogger(logger),\\n \\\"progress_hooks\\\": [progress_tracker.hook],\\n \\\"outtmpl\\\": output_template,\\n }\\n\\n with youtube_dl.YoutubeDL(ydl_opts) as ydl:\\n # Determine destination file name\\n video_info = ydl.extract_info(video_url, download=False)\\n file_name = ydl.prepare_filename(video_info)\\n logger.info(\\\"Downloading file: %s\\\", file_name)\\n\\n # Download file\\n with progress_tracker.track(progress):\\n ydl.download([video_url])\\n\\n progress.complete()\\n return file_name\",\n \"def video_download_chain_task(uuid):\\n chain = signature(\\n 'wts_worker.worker.video_download',\\n kwargs={'uuid': uuid},\\n )\\n chain |= signature(\\n 'wts_worker.worker.video_register_title',\\n kwargs={'uuid': uuid},\\n )\\n return chain.apply_async()\",\n \"def get_video_info(self, id, **kwargs):\\n kwargs['id'] = id\\n return self.get('info/video.json', **kwargs)\",\n \"def sync_get_youtube_video(query):\\n return yt.get_video_info(query, num_results=1)\",\n \"def download_video(video_url, output_path, output_name=\\\"\\\", default_type=\\\"mp4\\\", verbose=False):\\n try:\\n if \\\".\\\" not in output_name:\\n output_name = f\\\"{output_name}.{default_type}\\\"\\n output_path = os.path.join(output_path, output_name)\\n api_response = core.get_request_with_retries(video_url)\\n core_utils.print_if_verbose('Processing...', verbose)\\n f = open(output_path, 'wb')\\n for chunk in api_response.iter_content(chunk_size=255):\\n # filter out keep-alive new chunks\\n if chunk:\\n f.write(chunk)\\n core_utils.print_if_verbose(f'The video has been exported here: {output_path}', verbose)\\n f.close()\\n except Exception as exception_msg:\\n print(f\\\"The video could not be downloaded due to the following error: {exception_msg}\\\")\\n return\",\n \"def vid_player(video_url, id=None, width='100%', height='auto'):\\n return {'video_url': video_url, 'width': width, 'height': height, 'id': id }\",\n \"def get(idd):\\n print(f'[{script}]: Collecting data for \\\"{idd}\\\"...') if verbosity >= 1 else None\\n\\n youtube = build(\\\"youtube\\\", \\\"v3\\\", developerKey=API_KEY)\\n request = youtube.videos().list(\\n part=\\\"snippet, contentDetails, statistics\\\",\\n chart=None,\\n hl=None,\\n id=idd,\\n locale=None,\\n maxHeight=None,\\n maxResults=None,\\n maxWidth=None,\\n myRating=None,\\n onBehalfOfContentOwner=None,\\n pageToken=None,\\n regionCode=None,\\n videoCategoryId=None,\\n )\\n response = request.execute()\\n response = response[\\\"items\\\"][0]\\n\\n data = {\\n \\\"title\\\": response[\\\"snippet\\\"][\\\"title\\\"],\\n \\\"idd\\\": idd,\\n \\\"thumbnail\\\": response[\\\"snippet\\\"][\\\"thumbnails\\\"][\\\"default\\\"][\\\"url\\\"],\\n \\\"author\\\": response[\\\"snippet\\\"][\\\"channelTitle\\\"],\\n \\\"published\\\": datetime.strptime(\\n response[\\\"snippet\\\"][\\\"publishedAt\\\"], \\\"%Y-%m-%dT%H:%M:%S%z\\\"\\n ),\\n \\\"description\\\": response[\\\"snippet\\\"][\\\"description\\\"],\\n \\\"duration\\\": isodate.parse_duration(\\n response[\\\"contentDetails\\\"][\\\"duration\\\"]\\n ).total_seconds(),\\n \\\"views\\\": response[\\\"statistics\\\"][\\\"viewCount\\\"],\\n }\\n\\n try:\\n data[\\\"rating\\\"] = int(response[\\\"statistics\\\"][\\\"likeCount\\\"]) / (\\n int(response[\\\"statistics\\\"][\\\"likeCount\\\"])\\n + int(response[\\\"statistics\\\"][\\\"dislikeCount\\\"])\\n )\\n except KeyError:\\n print(\\n f'[{script}]: WARNING: \\\"{idd}\\\" does not have ratings enabled.'\\n ) if verbosity >= 2 else None\\n data[\\\"rating\\\"] = -1\\n\\n try:\\n data[\\\"comment_count\\\"] = response[\\\"statistics\\\"][\\\"commentCount\\\"]\\n except KeyError:\\n print(\\n f'[{script}]: WARNING: \\\"{idd}\\\" does not have comments enabled.'\\n ) if verbosity >= 2 else None\\n data[\\\"comment_count\\\"] = -1\\n\\n print(f\\\"[{script}]: Got video data.\\\") if verbosity >= 2 else None\\n return data\",\n \"def download_file(id, output=DATA_DIR, quiet=False):\\n url = f\\\"https://drive.google.com/uc?id={id}\\\"\\n gdown.download(url, output=output, quiet=quiet)\",\n \"def download_ostrich_video(download_to_path):\\n urlretrieve(REMOTE_OSTRICH_VID_PATH, download_to_path)\",\n \"def __ext_embed_id(self, youtube_url):\\n youtube_id_match = re.search(r'(?<=v=)[^&#]+', youtube_url)\\n youtube_id_match = youtube_id_match or re.search(\\n r'(?<=be/)[^&#]+', youtube_url)\\n trailer_youtube_id = (youtube_id_match.group(0) if youtube_id_match\\n else None)\\n return trailer_youtube_id\",\n \"def download(track_id, ext):\\n\\n if ext != 'mp3':\\n return Response('', status=404)\\n\\n track = models.Track.query.get(track_id)\\n if track is None:\\n abort(404)\\n\\n track_file = open(track.get_path(), 'r')\\n filename_header = (\\n 'Content-Disposition', 'attachment; filename=\\\"%s.mp3\\\"' % track.title\\n )\\n\\n return Response(response=track_file.read(), mimetype='audio/mpeg',\\n headers=[filename_header])\",\n \"def web_archive_insert_video(id):\\n\\n db = get_db()\\n user_id = flask.session['user']['id']\\n\\n video_id = id\\n video = yt_get_video(video_id)\\n channel_id = video['snippet']['channelId']\\n\\n archive = None\\n for playlist in db_get_archives():\\n if playlist['contentDetails']['itemCount'] < 5000:\\n archive = playlist\\n break\\n\\n if archive is None:\\n archive = yt_create_playlist()\\n\\n if yt_insert_to_playlist(video_id, archive['id']):\\n if channel_id not in db[user_id]:\\n db[user_id][channel_id] = {\\n 'played': {}, 'archived': {}\\n }\\n db[user_id][channel_id]['archived'][video_id] = archive['id']\\n update_db(db)\",\n \"def download_by_link(link: str, videoid: str) -> [str, str]:\\n\\t# set youtube_dl arguments \\n\\tydl_opts = {\\n\\t\\t'quiet': False, # don't write in output\\n\\t\\t'no_warnings': True, # write warnings in output\\n\\t\\t'format': \\\"bestaudio/best\\\", # download best audio quality\\n\\t\\t'format': 'mp4', # setup format webm\\n\\t\\t'outtmpl': '%(name)s' + str(videoid) + '.%(ext)s', # setup output name \\n\\t\\t'postprocessor': [{ # dk how this need work, but if this not setup audio didn't download\\n\\t\\t\\t'key': \\\"FFmpegExtractAudioPP\\\",\\n\\t\\t\\t'preferredquality': \\\"512\\\",\\n\\t\\t }],\\n\\t}\\n\\t# start download audio\\n\\twith youtube_dl.YoutubeDL(ydl_opts) as ydl:\\n\\t\\tdata = ydl.extract_info(link) # exctrat info about audio\\n\\tfake_name = \\\"NA\\\" + str(videoid)\\n\\t# TODO: think about this query \\n\\t# refactoring title \\n\\ttitle = data.pop('title')\\n\\ttitle = re.sub(r'[^\\\\w]', ' ', title)\\n\\ttitle = translate(title)\\n\\ttitle = title.replace(' ', '_')\\n\\treturn fake_name, title\",\n \"def video_detail(request, video_id):\\n\\n video = get_object_or_404(Video, id=video_id)\\n\\n context = {\\\"video\\\": video}\\n\\n return render(request, 'video_detail.html', context)\",\n \"def download(df_shorter,folderName):\\n os.mkdir(str(folderName))\\n path = os.getcwd()+'\\\\\\\\'+str(folderName)+'\\\\\\\\'\\n #add column with video link generated from IDs\\n df_shorter['urls'] = df_shorter['id'].apply(lambda x: generateLinkFromId(x))\\n vid_dl = []\\n i = 1\\n for url in df_shorter['urls']:\\n if url != False:\\n name = str(i)+'.mp4'\\n vid_dl.append(wget.download(url,path+name))#retrun the path of the saved video\\n i = i+1\\n return vid_dl\",\n \"def generateLinkFromId(videoId):\\n page = requests.get('https://www.tiktok.com/embed/v2/'+videoId+'?lang=en')\\n tree = html.fromstring(page.content)\\n buyers = tree.xpath('//*[@id=\\\"main\\\"]/div/div/div[1]/div/div/div/div[2]/div[1]/video/@src')\\n if len(buyers) > 0:\\n return buyers[0]\\n else:\\n return False\",\n \"def _render_no_tracking(self, video_id):\\n you_tube_url = (\\n 'https://www.youtube.com/embed/%s'\\n '?feature=player_embedded&rel=0') % video_id\\n iframe = cElementTree.XML(\\\"\\\"\\\"\\n<div class=\\\"gcb-video-container\\\">\\n <iframe class=\\\"youtube-player\\\" title=\\\"YouTube Video Player\\\"\\n type=\\\"text/html\\\" frameborder=\\\"0\\\" allowfullscreen=\\\"allowfullscreen\\\">\\n </iframe>\\n</div>\\\"\\\"\\\")\\n iframe[0].set('src', you_tube_url)\\n return iframe\",\n \"def google_youtube_check(id):\\n\\tif not API_KEY:\\n\\t\\traise ConfigException(\\\"Require API_KEY for googleapi. Reload after setting.\\\")\\n\\td = {\\\"id\\\" : quote(id.encode(\\\"utf-8\\\")), \\\"part\\\" : \\\"id,status\\\", \\\"key\\\" : API_KEY}\\n\\t\\n\\tf = urlopen(YOUTUBE_INFO_URL % (urlencode(d)))\\n\\tytdata = load(f)\\n\\tif not ytdata.get(\\\"items\\\"): # if there are no items for the ID search, return False\\n\\t\\treturn False\\n\\treturn True\",\n \"def play_video(self):\\n\\n self.wait.until(self.visible((By.ID, \\\"video-title\\\")))\\n self.driver.find_element_by_xpath(\\\"//button[@class='ytp-large-play-button ytp-button']\\\").click()\",\n \"def download_file_from_google_drive(file_id, dest_path, verbose=False):\\n\\n destination_directory = dirname(dest_path)\\n if len(destination_directory) > 0 and not exists(destination_directory):\\n makedirs(destination_directory)\\n\\n session = requests.Session()\\n\\n if verbose:\\n print('Downloading file with Google ID {} into {}... '.format(file_id, dest_path), end='')\\n stdout.flush()\\n\\n response = session.get(Constant.DOWNLOAD_URL, params={'id': file_id}, stream=True)\\n\\n token = get_confirm_token(response)\\n if token:\\n params = {'id': file_id, 'confirm': token}\\n response = session.get(Constant.DOWNLOAD_URL, params=params, stream=True)\\n\\n save_response_content(response, dest_path)\\n if verbose:\\n print('Download completed.')\",\n \"def select(self, video_id):\\n\\n query = \\\"\\\"\\\"\\n SELECT id, uri, filename, description\\n FROM videos\\n WHERE id = ?\\n \\\"\\\"\\\"\\n\\n result = Model.execute(query, (video_id,))\\n\\n return result.fetchone()\",\n \"def get_video_id(url):\\n\\n if not url:\\n return \\\"\\\"\\n\\n # If URL is embedded\\n if \\\"embed\\\" in url:\\n return url.split(\\\"/\\\")[-1]\\n\\n parse_result = urlparse(url)\\n query = parse_qs(parse_result.query)\\n return query[\\\"v\\\"][0]\",\n \"def playlist_videos(playlist_id):\\r\\n url = PLAYLIST_ITEMS_URL.format(API_KEY, playlist_id)\\r\\n response = util.web.http_get(url=url, json=True, referer='https://tinychat.com')\\r\\n\\r\\n if response['json'] is not None:\\r\\n video_list = []\\r\\n # next_page_token = response['json']['nextPageToken']\\r\\n try:\\r\\n if 'items' in response['json']:\\r\\n for item in response['json']['items']:\\r\\n video_id = item['snippet']['resourceId']['videoId']\\r\\n details = video_details(video_id)\\r\\n if details is not None:\\r\\n info = {\\r\\n 'type': 'youTube',\\r\\n 'video_id': video_id,\\r\\n 'video_title': details['video_title'],\\r\\n 'video_time': details['video_time']\\r\\n }\\r\\n video_list.append(info)\\r\\n return video_list\\r\\n except KeyError as ke:\\r\\n log.error(ke, exc_info=True)\\r\\n return None\",\n \"def upload_youtube(msg):\\n url = \\\"https://www.youtube.com/watch?v=%s\\\" % msg['yt_videoid']\\n fname = \\\"%s/download_file/%s.mp4\\\" % (TOP_LEVEL_DIR, randint(1, 1000000000))\\n cmd = \\\"/home/hadn/py4code/bin/youtube-dl -o %s %s\\\" % (fname, url)\\n cmd = shlex.split(cmd)\\n up = Popen(cmd, stdout=PIPE)\\n temp = up.communicate()\\n\\n cmd_upload = \\\"/home/hadn/py4code/bin/python %s/flask_app/crawler/upload_youtube.py --file %s --title '%s'\\\" % (\\n TOP_LEVEL_DIR, fname, msg['title'])\\n cmd_upload = shlex.split(cmd_upload)\\n up_youtube = Popen(cmd_upload, stdout=PIPE)\\n temp_upload = up_youtube.communicate()\\n\\n print(temp_upload)\\n return msg\",\n \"def download_subtitles(video_ids):\\n print(f\\\"[downloading subs] {video_ids}\\\")\\n ydl_opts = {\\n 'skip_download': True,\\n 'writeautomaticsub': True,\\n 'outtmpl': 'subtitles/%(id)s',\\n 'subtitleslangs': ['en']\\n }\\n for video_id in video_ids:\\n filename = f\\\"subtitles/{video_id}.en.vtt\\\"\\n # Don't download if these subtitles are already downloaded\\n # or if we know there are no subtitles on the video\\n if video_id in cached_no_subtitles:\\n continue\\n if not os.path.isfile(filename):\\n print(f\\\"[downloading subtitle] {video_id}\\\")\\n with youtube_dl.YoutubeDL(ydl_opts) as ydl:\\n # assume downloaded subtitle is correct\\n ydl.download([video_id])\\n # Delay to be nice to the server\\n time.sleep(2)\\n try:\\n with open(filename) as f:\\n yield video_id, f.read()\\n except IOError:\\n with open(CACHED_NO_SUBTITLES_FILE, \\\"a\\\") as f:\\n f.write(video_id + '\\\\n')\\n cached_no_subtitles.add(video_id)\\n yield video_id, None\",\n \"def get_embed_youtube(link = None):\\n assert(link != None)\\n assert(link != \\\"\\\")\\n log.debug( \\\"preparsed link: \\\" + link)\\n video_id = \\\"\\\"\\n try:\\n # break the link\\n choppedLink = link.split(\\\"/\\\")\\n if choppedLink[2].find(\\\"youtu.be\\\") >= 0:\\n # Parse short link getting only last piece\\n video_id = get_id_shortlink(choppedLink)\\n elif choppedLink[3].find(\\\"attribution_link\\\") >= 0 :\\n # Its an attribution link, a bit special\\n video_id = get_id_attribution(choppedLink)\\n else:\\n # This should be a regular link\\n video_id = get_id_regular_link(choppedLink)\\n\\n # and finally compose the embed link\\n flink = compose_embed_youtube(video_id)\\n log.debug( \\\"compound link: \\\" + flink)\\n except Exception as e:\\n log.error(\\\"Something weird happened when ending getting embed youtube\\\")\\n log.exception(e)\\n raise NotImplementedError( \\\"We are still working on links like \\\" + link)\\n\\n return flink\",\n \"def get_videos_in_playlist(self):\\n\\n self.ydl = youtube_dl.YoutubeDL()\\n # uses the youtube_dl as a context manager\\n with self.ydl:\\n self.result = self.ydl.extract_info(\\n self.url, extra_info={'listformats': True}, download=False)\\n for video in (self. result['entries']):\\n video_id = video['id']\\n self. url = f'https://www.youtube.com/watch?v={video_id}'\\n self. show_formats()\",\n \"def download_flickr_video(url, save_root, force_overwrite):\\n\\n # (Try to) open the URL\\n response = urlopen(url)\\n # Extract the file extension from the resolved URL\\n m = re.match(r'(.*)\\\\?s=.*', response.url)\\n _, ext = os.path.splitext(m.group(1))\\n # Build the path to save the video to\\n video_meta = parse.parse(VIDEO_URL_FORMAT, url)\\n user_id = video_meta['user_id']\\n video_id = video_meta['video_id']\\n save_path = os.path.join(save_root, f'{user_id}-{video_id}{ext}')\\n # Save the video\\n if os.path.isfile(save_path) and not force_overwrite:\\n raise FileExistsError(f'File already exists at {save_path}')\\n else:\\n with open(save_path, 'wb') as f:\\n shutil.copyfileobj(response, f)\\n\\n return save_path\",\n \"def get_youtube_handler():\\n options = {}\\n home = os.path.expanduser(\\\"~\\\")\\n default_credentials = os.path.join(home, \\\".youtube-upload-credentials.json\\\")\\n #client_secrets = options.client_secrets or os.path.join(home, \\\".client_secrets.json\\\")\\n #credentials = options.credentials_file or default_credentials\\n client_secrets = os.path.join(home, \\\".client_secrets.json\\\")\\n credentials = default_credentials \\n debug(\\\"Using client secrets: {0}\\\".format(client_secrets))\\n debug(\\\"Using credentials file: {0}\\\".format(credentials))\\n #get_code_callback = (auth.browser.get_code\\n #if options.auth_browser else auth.console.get_code)\\n get_code_callback = auth.browser.get_code\\n return auth.get_resource(client_secrets, credentials,\\n get_code_callback=get_code_callback)\",\n \"def __construct_url_from_id(_video_id):\\n return f\\\"{core.get_base_url(api_base=False)}/videos/{_video_id}\\\"\",\n \"def download(self, language, filename, filetype):\\n if language not in self.languages.keys():\\n print \\\"Theres's no subtitle in this language\\\"\\n sys.exit()\\n url = \\\"http://www.youtube.com/api/timedtext?v={0}&lang={1}\\\".format(self.video_id, language)\\n self.subtitle = urllib2.urlopen(url)\\n if filetype == \\\"srt\\\":\\n self.writeSRTFile(filename)\\n else:\\n self.writeXMLFile(filename)\",\n \"def fetch_pyvideo_pk(self):\\n url = 'http://pyvideo.org/search?models=videos.video&q={0}'.format(self.full_name.replace(\\\" \\\", \\\"+\\\"))\\n soup = BeautifulSoup(requests.get(url).content).findAll(\\\"a\\\")\\n if soup:\\n for link in soup:\\n if link.string == self.full_name:\\n self.pyvideo_pk = link.get('href').split('/')[2]\\n self.save()\\n return self.pyvideo_pk\\n self.pyvideo_pk = None\\n self.save()\\n return None\",\n \"def add_video_to_playlist(youtube, args, privacy=\\\"public\\\"):\\n video_id = args['video_id']\\n playlist_id = args['playlist_id']\\n \\n print(video_id)\\n #print(type(args))\\n \\n if playlist_id:\\n return add_video_to_existing_playlist(youtube, playlist_id, video_id)\\n else:\\n lib.debug(\\\"Error adding video to playlist\\\")\",\n \"async def video_url(cls, url, ytdl, *, loop=None, stream=False):\\n loop = loop or asyncio.get_event_loop()\\n data = await loop.run_in_executor(None, lambda: ytdl.extract_info(url, download=not stream))\\n song_list = {'queue': []}\\n if 'entries' in data:\\n if len(data['entries']) > 1:\\n playlist_titles = [title['title'] for title in data['entries']]\\n song_list = {'queue': playlist_titles}\\n song_list['queue'].pop(0)\\n\\n data = data['entries'][0]\\n\\n filename = data['url'] if stream else ytdl.prepare_filename(data)\\n return cls(discord.FFmpegPCMAudio(filename, **ffmpeg_options), data=data), song_list\",\n \"def fetch_trailer(self, movie_id):\\n movie = tmdbsimple.Movies(movie_id)\\n request = movie.videos()\\n trailer = movie.results[0]['key']\\n\\n return trailer\",\n \"def video_details(video_id, check=True):\\r\\n url = VIDEO_DETAILS_URL.format(API_KEY, video_id)\\r\\n response = util.web.http_get(url=url, json=True, referer='https://tinychat.com')\\r\\n\\r\\n if response['json'] is not None:\\r\\n try:\\r\\n if 'items' in response['json']:\\r\\n if len(response['json']['items']) is not 0:\\r\\n contentdetails = response['json']['items'][0]['contentDetails']\\r\\n if check:\\r\\n if 'regionRestriction' in contentdetails:\\r\\n if 'blocked' in contentdetails['regionRestriction']:\\r\\n blocked = contentdetails['regionRestriction']['blocked']\\r\\n if [i for e in ALLOWED_COUNTRIES for i in blocked if e in i]:\\r\\n log.info('%s is blocked in: %s' %\\r\\n (video_id, blocked))\\r\\n return None\\r\\n if 'allowed' in contentdetails['regionRestriction']:\\r\\n allowed = contentdetails['regionRestriction']['allowed']\\r\\n if [i for e in ALLOWED_COUNTRIES for i in allowed if e not in i]:\\r\\n log.info('%s is allowed in: %s' %\\r\\n (video_id, allowed))\\r\\n return None\\r\\n video_time = util.string_util.convert_to_millisecond(contentdetails['duration'])\\r\\n video_title = response['json']['items'][0]['snippet']['title'].encode('ascii', 'ignore')\\r\\n\\r\\n return {\\r\\n 'type': 'youTube',\\r\\n 'video_id': video_id,\\r\\n 'video_time': video_time,\\r\\n 'video_title': video_title\\r\\n }\\r\\n return None\\r\\n except KeyError as ke:\\r\\n log.error(ke, exc_info=True)\\r\\n return None\",\n \"def download_videos(blink, save_dir=\\\"/media\\\"):\\n blink.download_videos(save_dir, since=get_date())\",\n \"def download(self, download_id):\\r\\n return downloads.Downloads(self, download_id)\",\n \"def request_id(self):\\n select_id = input(\\\"\\\\n>>> \\\")\\n select_dict = [format for format in self.result['formats']\\n if format['format_id'] == select_id][0]\\n filesize = size(select_dict['filesize']\\n ) if select_dict['filesize'] else 0\\n # url = select_dict['url']\\n print(f\\\"Downloading {self.result['title']}, size={filesize}\\\")\\n self.title = self.result['title']\\n for item in [\\\"(\\\", \\\")\\\", \\\" \\\", \\\",\\\", \\\".\\\", \\\"'\\\"]:\\n self.title = self.title.replace(item, '_')\\n self.title = self.title.replace('__', '_')\\n self.download_video(select_id)\",\n \"def get_video_id(self, obj):\\n return obj.video.id\",\n \"def get_video_id(self):\\n \\n if self.video_id:\\n return self.video_id\\n \\n if not self.original_url:\\n return ''\\n \\n #logger.debug('DAILYMOTION VIDEO FOUND %s' % url)\\n \\n p = urlparse.urlparse(self.original_url)\\n path = p.path\\n if path.endswith('/'):\\n path = path[:-1]\\n path_list = path[1:].split('/')\\n \\n if len(path_list) == 3 and (p.path.startswith('/embed/video/') or p.path.startswith('/swf/video/')):\\n # http://www.dailymotion.com/embed/video/xmp7zw\\n return re.sub('_.+', '', path_list[2])\\n elif len(path_list) == 2 and (p.path.startswith('/video/') or p.path.startswith('/swf/')):\\n # http://www.dailymotion.com/video/xmp7zw_whatever\\n # http://www.dailymotion.com/swf/xmp7zw\\n return re.sub('_.+', '', path_list[1])\\n \\n return ''\",\n \"def play_trailer(self):\\n webbrowser.open(self.youtube_trailer_url)\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.7745084","0.7303579","0.7203833","0.71133363","0.70373094","0.7022766","0.69767386","0.6973098","0.69691336","0.69578743","0.69145817","0.6872059","0.68037355","0.6796082","0.6795651","0.67516667","0.6571322","0.6560047","0.65302217","0.65141547","0.6513327","0.6511696","0.6491822","0.64788663","0.6476651","0.6446605","0.6435045","0.64282376","0.64242804","0.6374236","0.6368706","0.6368076","0.63553596","0.6344511","0.63122314","0.62956583","0.6284835","0.62543577","0.62126166","0.6195221","0.61944854","0.6191643","0.61824924","0.61666745","0.61501634","0.61476386","0.6135256","0.6134161","0.61200297","0.61105704","0.60876447","0.60781586","0.60530466","0.5987342","0.5985662","0.5981774","0.597452","0.5970539","0.59704703","0.5931067","0.59295976","0.59284186","0.5903014","0.59006155","0.5861927","0.5830635","0.5824812","0.5824054","0.5804496","0.57983035","0.5793523","0.57847166","0.57837677","0.5754795","0.575012","0.57391614","0.572212","0.57114565","0.5706584","0.56954604","0.56878084","0.5687131","0.568461","0.5680392","0.56731844","0.5671808","0.5665233","0.5664644","0.56617934","0.56608164","0.5658029","0.56576025","0.56148094","0.5611423","0.5610124","0.5608605","0.5607025","0.5593614","0.55868816","0.55760217"],"string":"[\n \"0.7745084\",\n \"0.7303579\",\n \"0.7203833\",\n \"0.71133363\",\n \"0.70373094\",\n \"0.7022766\",\n \"0.69767386\",\n \"0.6973098\",\n \"0.69691336\",\n \"0.69578743\",\n \"0.69145817\",\n \"0.6872059\",\n \"0.68037355\",\n \"0.6796082\",\n \"0.6795651\",\n \"0.67516667\",\n \"0.6571322\",\n \"0.6560047\",\n \"0.65302217\",\n \"0.65141547\",\n \"0.6513327\",\n \"0.6511696\",\n \"0.6491822\",\n \"0.64788663\",\n \"0.6476651\",\n \"0.6446605\",\n \"0.6435045\",\n \"0.64282376\",\n \"0.64242804\",\n \"0.6374236\",\n \"0.6368706\",\n \"0.6368076\",\n \"0.63553596\",\n \"0.6344511\",\n \"0.63122314\",\n \"0.62956583\",\n \"0.6284835\",\n \"0.62543577\",\n \"0.62126166\",\n \"0.6195221\",\n \"0.61944854\",\n \"0.6191643\",\n \"0.61824924\",\n \"0.61666745\",\n \"0.61501634\",\n \"0.61476386\",\n \"0.6135256\",\n \"0.6134161\",\n \"0.61200297\",\n \"0.61105704\",\n \"0.60876447\",\n \"0.60781586\",\n \"0.60530466\",\n \"0.5987342\",\n \"0.5985662\",\n \"0.5981774\",\n \"0.597452\",\n \"0.5970539\",\n \"0.59704703\",\n \"0.5931067\",\n \"0.59295976\",\n \"0.59284186\",\n \"0.5903014\",\n \"0.59006155\",\n \"0.5861927\",\n \"0.5830635\",\n \"0.5824812\",\n \"0.5824054\",\n \"0.5804496\",\n \"0.57983035\",\n \"0.5793523\",\n \"0.57847166\",\n \"0.57837677\",\n \"0.5754795\",\n \"0.575012\",\n \"0.57391614\",\n \"0.572212\",\n \"0.57114565\",\n \"0.5706584\",\n \"0.56954604\",\n \"0.56878084\",\n \"0.5687131\",\n \"0.568461\",\n \"0.5680392\",\n \"0.56731844\",\n \"0.5671808\",\n \"0.5665233\",\n \"0.5664644\",\n \"0.56617934\",\n \"0.56608164\",\n \"0.5658029\",\n \"0.56576025\",\n \"0.56148094\",\n \"0.5611423\",\n \"0.5610124\",\n \"0.5608605\",\n \"0.5607025\",\n \"0.5593614\",\n \"0.55868816\",\n \"0.55760217\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.7562303"},"document_rank":{"kind":"string","value":"1"}}},{"rowIdx":6097,"cells":{"query":{"kind":"string","value":"Downloads YouTube videos by URL."},"document":{"kind":"string","value":"def youtube_download(url, output_dir='.', merge=True, info_only=False):\n \n id = match1(url, r'youtu.be/([^/]+)') or parse_query_param(url, 'v')\n assert id\n \n youtube_download_by_id(id, title=None, output_dir=output_dir, merge=merge, info_only=info_only)"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["def download_video(self, url):\n yt = YouTube(url)\n yt_filtered = yt.streams.filter(progressive=True, file_extension=\"mp4\")\n yt_resolutions = yt_filtered.order_by(\"resolution\")\n\n # Downloads the first video that fits the description\n video = yt_resolutions.desc().first()\n video.download()\n\n # Returns the filename\n return video.default_filename","def download_from_youtube():\n linkinput = input(\"Enter the url you want to download: \")\n youtube_object = Youtube(linkinput)\n youtube_object.youtube()","def download_video_data(self):\n\n def scrape_url(url):\n \"\"\"Scrape the video list, youtube_dl does all the heavy lifting\"\"\"\n ydl_opts = {\n \"ignoreerrors\": True, # Skip private and unavaliable videos\n }\n\n ydl = youtube_dl.YoutubeDL(ydl_opts)\n\n with ydl:\n result_ydl = ydl.extract_info(\n url,\n download=False # No download needed, only the info\n )\n\n logger.debug('Url scraped {}', url)\n if 'entries' in result_ydl:\n # It's a playlist or a list of videos\n return result_ydl['entries']\n # Just a video\n return [result_ydl]\n\n youtube_list = sum((scrape_url(url) for url in self.youtube_lists), [])\n for youtube_video_data in youtube_list:\n if youtube_video_data: # Valid video\n self.youtube_videos.append(\n Video.from_youtube(\n video_data=youtube_video_data, event=self))\n else:\n logger.warning('Null youtube video')","def download(self, url=None):\n if url is None:\n if self.results is None:\n raise ValueError(\"Please specify a valid url.\")\n else:\n url = self.results[0]\n try:\n meta = pafy.new(url)\n except Exception:\n raise IOError(\"Video not available for download.\")\n\n vid = meta.getbest()\n path = vid.download()\n self.videos.append(path)\n return path","def download_videos(download_limit=6):\n videos = []\n for fname in os.listdir('yt_api_data'):\n videos += load_video_data(fname)\n vids_downloaded = 0\n excluded_vids = get_excluded_videos()\n for video_id, title in videos:\n if download_limit != 'all' and vids_downloaded == download_limit:\n break\n title = title.replace(' ', '_')\n mkv_path = \"videos/\" + title + \".mkv\"\n mp4_path = \"videos/\" + title + \".mp4\"\n download_fpath = \"videos/\" + title\n if not check_excluded_list(excluded_vids, title) and not os.path.isfile(mkv_path) and not os.path.isfile(mp4_path):\n print(colored(str(vids_downloaded + 1) + \": \", \"yellow\") + colored(video_id + \" downloading: \" + download_fpath, \"green\"))\n command_prefix = \"youtube-dl -o \" + download_fpath\n if video_id[0] == '-': \n os.system(command_prefix + \" -- \" + video_id)\n else:\n os.system(command_prefix + \" \" + video_id)\n vids_downloaded += 1\n else:\n print(colored(\"skipping download: \" + title + \"with youtube_id: \" + video_id, \"yellow\"))","def download(target_url):\n program_location = sys.executable\n program_name = \"youtube-dl.exe\"\n # Define arguments. see this url for help\n # https://github.com/rg3/youtube-dl\n ignore_errors = \"-i\"\n safe_filenames = \"--restrict-filenames\"\n output_arg = \"-o\"\n output_template = \"download\\%(uploader)s\\%(playlist)s\\%(title)s-%(id)s.%(ext)s\"\n command = [program_name, ignore_errors, safe_filenames, output_arg, output_template, target_url]\n result = subprocess.call(command)\n print \"Command result: \", result","def scrape_url(url):\n ydl_opts = {\n \"ignoreerrors\": True, # Skip private and unavaliable videos\n }\n\n ydl = youtube_dl.YoutubeDL(ydl_opts)\n\n with ydl:\n result_ydl = ydl.extract_info(\n url,\n download=False # No download needed, only the info\n )\n\n logger.debug('Url scraped {}', url)\n if 'entries' in result_ydl:\n # It's a playlist or a list of videos\n return result_ydl['entries']\n # Just a video\n return [result_ydl]","def fetch_youtube_url(page_url):\n video_soup = Soup(requests.get(page_url).content)\n for anchor in video_soup('a'):\n if not anchor.has_key('href'):\n continue\n if 'youtube' in anchor['href']:\n return anchor['href']","async def download_video(v_url):\n reply = await v_url.get_reply_message()\n if v_url.pattern_match.group(2) != \"\":\n url = v_url.pattern_match.group(2)\n elif reply is not None:\n url = reply.message\n url = re.findall(r\"\\bhttps?://.*\\.\\S+\", reply.message)[0]\n else:\n return\n type = (\n v_url.pattern_match.group(1).lower()\n if v_url.pattern_match.group(1) is not None\n else \"a\"\n )\n await v_url.edit(\"`Preparing to download...`\")\n out_folder = Config.TMP_DOWNLOAD_DIRECTORY + \"youtubedl/\"\n Config.TMP_DOWNLOAD_DIRECTORY + \"/thumb_image.jpg\"\n if not os.path.isdir(out_folder):\n os.makedirs(out_folder)\n if type == \"a\":\n opts = {\n \"format\": \"bestaudio\",\n \"addmetadata\": True,\n \"noplaylist\": False,\n \"key\": \"FFmpegMetadata\",\n \"writethumbnail\": True,\n \"embedthumbnail\": True,\n \"prefer_ffmpeg\": True,\n \"geo_bypass\": True,\n \"nocheckcertificate\": True,\n \"postprocessors\": [\n {\n \"key\": \"FFmpegExtractAudio\",\n \"preferredcodec\": \"mp3\",\n \"preferredquality\": \"320\",\n }\n ],\n \"outtmpl\": out_folder + \"%(title)s.%(ext)s\",\n \"quiet\": True,\n \"logtostderr\": False,\n }\n video = False\n song = True\n\n elif type == \"v\":\n opts = {\n \"format\": \"best\",\n \"addmetadata\": True,\n \"noplaylist\": False,\n \"getthumbnail\": True,\n \"embedthumbnail\": True,\n \"xattrs\": True,\n \"writethumbnail\": True,\n \"key\": \"FFmpegMetadata\",\n \"prefer_ffmpeg\": True,\n \"geo_bypass\": True,\n \"nocheckcertificate\": True,\n \"postprocessors\": [\n {\"key\": \"FFmpegVideoConvertor\", \"preferedformat\": \"mp4\"},\n ],\n \"outtmpl\": out_folder + \"%(title)s.%(ext)s\",\n \"logtostderr\": False,\n \"quiet\": True,\n }\n song = False\n video = True\n\n try:\n await v_url.edit(\"`Fetching playlist data, please wait..`\")\n with YoutubeDL(opts) as ytdl:\n ytdl.extract_info(url)\n # print(ytdl_data['thumbnail'])\n filename = sorted(get_lst_of_files(out_folder, []))\n except DownloadError as DE:\n await v_url.edit(f\"`{str(DE)}`\")\n return\n except ContentTooShortError:\n await v_url.edit(\"`The download content was too short.`\")\n return\n except GeoRestrictedError:\n await v_url.edit(\n \"`Video is not available from your geographic location due to geographic restrictions imposed by a website.`\"\n )\n return\n except MaxDownloadsReached:\n await v_url.edit(\"`Max-downloads limit has been reached.`\")\n return\n except PostProcessingError:\n await v_url.edit(\"`There was an error during post processing.`\")\n return\n except UnavailableVideoError:\n await v_url.edit(\"`Media is not available in the requested format.`\")\n return\n except XAttrMetadataError as XAME:\n await v_url.edit(f\"`{XAME.code}: {XAME.msg}\\n{XAME.reason}`\")\n return\n except ExtractorError:\n await v_url.edit(\"`There was an error during info extraction.`\")\n return\n except Exception as e:\n await v_url.edit(f\"{str(type(e)): {str(e)}}\")\n return\n c_time = time.time()\n await v_url.edit(\"`YouTube Playlist Downloading Processing Now.\\nPlease Wait!`\")\n if song:\n for single_file in filename:\n if os.path.exists(single_file):\n caption_rts = os.path.basename(single_file)\n force_document = True\n supports_streaming = False\n document_attributes = []\n if single_file.endswith((\".mp4\", \".mp3\", \".flac\", \".webm\")):\n metadata = extractMetadata(createParser(single_file))\n duration = 0\n width = 0\n height = 180\n if metadata.has(\"duration\"):\n duration = metadata.get(\"duration\").seconds\n document_attributes = [\n DocumentAttributeVideo(\n duration=duration,\n w=width,\n h=height,\n round_message=False,\n supports_streaming=True,\n )\n ]\n try:\n ytdl_data_name_audio = os.path.basename(single_file)\n thumb = (\n out_folder\n + ytdl_data_name_audio[: (len(ytdl_data_name_audio) - 4)]\n + \".jpg\"\n )\n print(ytdl_data_name_audio)\n file_path = single_file\n song_size = file_size(file_path)\n await v_url.client.send_file(\n v_url.chat_id,\n single_file,\n caption=f\"`{ytdl_data_name_audio}`\"\n + \"\\n\"\n + f\"Size👉 {song_size}\",\n force_document=force_document,\n supports_streaming=supports_streaming,\n allow_cache=False,\n thumb=thumb,\n reply_to=v_url.message.id,\n attributes=document_attributes,\n progress_callback=lambda d, t: asyncio.get_event_loop().create_task(\n progress(\n d,\n t,\n v_url,\n c_time,\n \"Uploading..\",\n f\"{ytdl_data_name_audio}\",\n )\n ),\n )\n # os.remove(thumb)\n except Exception as e:\n await v_url.client.send_message(\n v_url.chat_id,\n \"{} caused `{}`\".format(caption_rts, str(e)),\n )\n continue\n os.remove(single_file)\n await asyncio.sleep(DELETE_TIMEOUT)\n # await v_url.delete()\n shutil.rmtree(out_folder)\n if video:\n for single_file in filename:\n if os.path.exists(single_file):\n caption_rts = os.path.basename(single_file)\n force_document = False\n supports_streaming = True\n document_attributes = []\n if single_file.endswith((\".mp4\", \".mp3\", \".flac\", \".webm\")):\n metadata = extractMetadata(createParser(single_file))\n duration = 0\n width = 0\n height = 0\n if metadata.has(\"duration\"):\n duration = metadata.get(\"duration\").seconds\n document_attributes = [\n DocumentAttributeVideo(\n duration=duration,\n w=width,\n h=height,\n round_message=False,\n supports_streaming=True,\n )\n ]\n # print(ytdl_data)\n # for file in os.listdir(\"./DOWNLOADS/youtubedl/\"):\n # if file.endswith(\".jpg\"):\n # thumb = \"./DOWNLOADS/youtubedl/\" + file\n # print(os.path.join(\"./DOWNLOADS/youtubedl/\", file))\n # image_link = ytdl_data['thumbnail']\n # downloaded_image = wget.download(image_link,out_folder)\n # thumb = ytdl_data_name_video + \".jpg\"\n file_path = single_file\n video_size = file_size(file_path)\n try:\n ytdl_data_name_video = os.path.basename(single_file)\n thumb = (\n out_folder\n + ytdl_data_name_video[: (len(ytdl_data_name_video) - 4)]\n + \".jpg\"\n )\n await v_url.client.send_file(\n v_url.chat_id,\n single_file,\n caption=f\"`{ytdl_data_name_video}`\"\n + \"\\n\"\n + f\"Size👉 {video_size}\",\n force_document=force_document,\n supports_streaming=supports_streaming,\n thumb=thumb,\n allow_cache=False,\n reply_to=v_url.message.id,\n attributes=document_attributes,\n progress_callback=lambda d, t: asyncio.get_event_loop().create_task(\n progress(\n d,\n t,\n v_url,\n c_time,\n \"Uploading..\",\n f\"{ytdl_data_name_video}\",\n )\n ),\n )\n # os.remove(thumb)\n except Exception as e:\n await v_url.client.send_message(\n v_url.chat_id,\n \"{} caused `{}`\".format(caption_rts, str(e)),\n )\n continue\n os.remove(single_file)\n await asyncio.sleep(DELETE_TIMEOUT)\n # await v_url.delete()\n shutil.rmtree(out_folder)","async def youtube(self, ctx, *args):\n if not args:\n await ctx.send(\"usage: `>youtube [search string]`\")\n return\n search_string = \" \".join(args)\n search_string = urllib.parse.urlencode({'search_query': search_string})\n response = requests.get('http://www.youtube.com/results?' + search_string + \"&hl=en_US&app=desktop\")\n if response.status_code == 200:\n search_results = re.findall('href=\\\\\"\\\\/watch\\\\?v=(.{11})', response.content.decode())\n try:\n first_result_url = 'http://www.youtube.com/watch?v=' + search_results[0]\n except IndexError:\n with open('downloads/yt_dump.txt', 'w') as f:\n f.write(response.content.decode())\n #print(response.is_redirect)\n return await ctx.send(\"Found nothing!\")\n await ctx.send(first_result_url)\n self.logger.info(misolog.format_log(ctx, f\"{first_result_url}\"))\n else:\n await ctx.send(\"Error: status code \" + str(response.status_code))\n self.logger.info(misolog.format_log(ctx, f\"error{response.status_code}\"))","def get_yt_video(yt_url):\n\n ydl_opts = {\n 'format': 'bestaudio/best',\n 'postprocessors': [{\n 'key': 'FFmpegExtractAudio',\n 'preferredcodec': 'mp3',\n 'preferredquality': '192',\n }],\n 'outtmpl': '%(id)s.%(ext)s'\n }\n ydl = youtube_dl.YoutubeDL(ydl_opts)\n\n with ydl:\n result = ydl.extract_info(\n #'http://www.youtube.com/watch?v=BaW_jenozKc',\n yt_url,\n download=True # We just want to extract the info\n )\n\n if 'entries' in result:\n # Can be a playlist or a list of videos\n video = result['entries'][0]\n else:\n # Just a video\n video = result\n\n return video","def download(idd, path):\n print(f'[{script}]: Downloading YT video \"{idd}\"...') if verbosity >= 1 else None\n\n try:\n yt = pytube.YouTube(\"https://www.youtube.com/watch?v=\" + idd)\n stream = yt.streams.filter(progressive=True).first()\n stream.download(path, filename=idd)\n except Exception:\n print(f'[{script}]: Failed download of YT video \"{idd}\".')\n return None\n\n data = {\n \"idd\": idd,\n \"abr\": stream.abr,\n \"acodec\": stream.audio_codec,\n \"bitrate\": stream.bitrate,\n \"codecs\": stream.codecs,\n \"fps\": stream.fps,\n \"mime\": stream.mime_type,\n \"res\": stream.resolution,\n \"vcodec\": stream.video_codec,\n \"size\": stream._filesize,\n \"frames\": stream.fps * yt.length,\n }\n\n file_path = path + \"/\" + data[\"idd\"] + \".mp4\"\n print(\n f'[{script}]: Download successful. Saved to \"{file_path}\".'\n ) if verbosity >= 2 else None\n return data","def youtube_download_by_id(id, title=None, output_dir='.', merge=True, info_only=False):\n \n raw_video_info = get_content('http://www.youtube.com/get_video_info?video_id=%s' % id)\n video_info = parse.parse_qs(raw_video_info)\n \n if video_info['status'] == ['ok'] and ('use_cipher_signature' not in video_info or video_info['use_cipher_signature'] == ['False']):\n title = parse.unquote_plus(video_info['title'][0])\n stream_list = parse.parse_qs(raw_video_info)['url_encoded_fmt_stream_map'][0].split(',')\n \n else:\n # Parse video page when video_info is not usable.\n video_page = get_content('http://www.youtube.com/watch?v=%s' % id)\n ytplayer_config = json.loads(match1(video_page, r'ytplayer.config\\s*=\\s*([^\\n]+);'))\n \n title = ytplayer_config['args']['title']\n stream_list = ytplayer_config['args']['url_encoded_fmt_stream_map'].split(',')\n \n streams = {\n parse.parse_qs(stream)['itag'][0] : parse.parse_qs(stream)\n for stream in stream_list\n }\n \n for codec in yt_codecs:\n itag = str(codec['itag'])\n if itag in streams:\n download_stream = streams[itag]\n break\n \n url = download_stream['url'][0]\n if 'sig' in download_stream:\n sig = download_stream['sig'][0]\n else:\n sig = decrypt_signature(download_stream['s'][0])\n url = '%s&signature=%s' % (url, sig)\n \n type, ext, size = url_info(url)\n \n print_info(site_info, title, type, size)\n if not info_only:\n download_urls([url], title, ext, size, output_dir, merge = merge)","def get_videos_in_playlist(self):\n\n self.ydl = youtube_dl.YoutubeDL()\n # uses the youtube_dl as a context manager\n with self.ydl:\n self.result = self.ydl.extract_info(\n self.url, extra_info={'listformats': True}, download=False)\n for video in (self. result['entries']):\n video_id = video['id']\n self. url = f'https://www.youtube.com/watch?v={video_id}'\n self. show_formats()","def youtube_dl_latest(args=None):\n args = parse_youtube_dl_arguments(args=args)\n download_videos(channels_file=args.channels_file, hierarchy=args.hierarchy)","def download_video(self, file_path, video_url, video_creation_time):\r\n logger.debug(\"Downloading video created at \" + _format_timestamp_iso(self.tz, video_creation_time) + \" from \"\r\n + video_url + \" to \" + file_path)\r\n failed = False\r\n try:\r\n self._download_with_api(file_path, video_url)\r\n except Exception as e:\r\n logger.debug(\"Video download failed using TikTokApi: \" + str(e))\r\n failed = True\r\n if not os.path.isfile(file_path):\r\n failed = True\r\n logger.debug(\"No file was created by TikTokApi at \" + file_path)\r\n elif os.stat(file_path).st_size < 1024:\r\n failed = True\r\n try:\r\n os.remove(file_path)\r\n logger.debug(\"Deleted malformed TikTokApi download at \" + file_path)\r\n except Exception as ee:\r\n logger.error(\"Unable to delete malformed TikTokApi download at \" + str(ee))\r\n if failed:\r\n sleep_time = random.uniform(self.sleep_min, self.sleep_max)\r\n logger.info(\"Sleeping for: \" + str(sleep_time) + \" seconds\")\r\n sleep(sleep_time)\r\n try:\r\n logger.debug(\"Falling back to YouTube-dl\")\r\n self.fallback_counter += 1\r\n self._download_with_ytdl(file_path, video_url)\r\n if not os.path.isfile(file_path):\r\n raise AssertionError(\"No file was created by YouTube-dl at \" + file_path)\r\n elif os.stat(file_path).st_size < 1024:\r\n try:\r\n os.remove(file_path)\r\n logger.debug(\"Deleted malformed YouTube-dl download at \" + file_path)\r\n except Exception as ee:\r\n raise AssertionError(\"Malformed file was created at \" + file_path +\r\n \" and could not be removed: \" + str(ee))\r\n raise AssertionError(\"Malformed file was created at \" + file_path + \" and was removed\")\r\n failed = False\r\n except youtube_dl.utils.DownloadError as ee:\r\n logger.error(\"YouTube-dl DownloadError: \" + str(ee))\r\n self.ytdl_downloaderror_counter += 1\r\n failed = True\r\n except Exception as ee:\r\n logger.error(\"Video download failed with YouTube-dl: \" + str(ee))\r\n self.other_error_counter += 1\r\n failed = True\r\n if not failed:\r\n try:\r\n os.utime(file_path, (video_creation_time, video_creation_time))\r\n except Exception as e:\r\n logger.debug(\"Unable to set utime of \" + str(video_creation_time) + \" on file \" + file_path +\r\n \", Error: \" + str(e))\r\n return True\r\n return False","def download(dltype, num):\n # This function needs refactoring!\n # pylint: disable=R0912\n # pylint: disable=R0914\n if g.browse_mode == \"ytpl\" and dltype in (\"da\", \"dv\"):\n plid = g.ytpls[int(num) - 1][\"link\"]\n down_plist(dltype, plid)\n return\n\n elif g.browse_mode == \"ytpl\":\n g.message = \"Use da or dv to specify audio / video playlist download\"\n g.message = c.y + g.message + c.w\n g.content = generate_songlist_display()\n return\n\n elif g.browse_mode != \"normal\":\n g.message = \"Download must refer to a specific video item\"\n g.message = c.y + g.message + c.w\n g.content = generate_songlist_display()\n return\n\n writestatus(\"Fetching video info...\")\n song = (g.model.songs[int(num) - 1])\n best = dltype.startswith(\"dv\") or dltype.startswith(\"da\")\n\n if not best:\n\n try:\n # user prompt for download stream\n url, ext, url_au, ext_au = prompt_dl(song)\n\n except KeyboardInterrupt:\n g.message = c.r + \"Download aborted!\" + c.w\n g.content = generate_songlist_display()\n return\n\n if not url or ext_au == \"abort\":\n # abort on invalid stream selection\n g.content = generate_songlist_display()\n g.message = \"%sNo download selected / invalid input%s\" % (c.y, c.w)\n return\n\n else:\n # download user selected stream(s)\n filename = _make_fname(song, ext)\n args = (song, filename, url)\n\n if url_au and ext_au:\n # downloading video and audio stream for muxing\n audio = False\n filename_au = _make_fname(song, ext_au)\n args_au = (song, filename_au, url_au)\n\n else:\n audio = ext in (\"m4a\", \"ogg\")\n\n kwargs = dict(audio=audio)\n\n elif best:\n # set updownload without prompt\n url_au = None\n av = \"audio\" if dltype.startswith(\"da\") else \"video\"\n audio = av == \"audio\"\n filename = _make_fname(song, None, av=av)\n args = (song, filename)\n kwargs = dict(url=None, audio=audio)\n\n try:\n # perform download(s)\n dl_filenames = [args[1]]\n f = _download(*args, **kwargs)\n if f:\n g.message = \"Saved to \" + c.g + f + c.w\n\n if url_au:\n dl_filenames += [args_au[1]]\n _download(*args_au, allow_transcode=False, **kwargs)\n\n except KeyboardInterrupt:\n g.message = c.r + \"Download halted!\" + c.w\n\n try:\n for downloaded in dl_filenames:\n os.remove(downloaded)\n\n except IOError:\n pass\n\n if url_au:\n # multiplex\n mux_cmd = \"APP -i VIDEO -i AUDIO -c copy OUTPUT\".split()\n mux_cmd = \"%s -i %s -i %s -c copy %s\"\n mux_cmd = [g.muxapp, \"-i\", args[1], \"-i\", args_au[1], \"-c\",\n \"copy\", args[1][:-3] + \"mp4\"]\n\n try:\n subprocess.call(mux_cmd)\n g.message = \"Saved to :\" + c.g + mux_cmd[7] + c.w\n os.remove(args[1])\n os.remove(args_au[1])\n\n except KeyboardInterrupt:\n g.message = \"Audio/Video multiplex aborted!\"\n\n g.content = generate_songlist_display()","async def video_url(cls, url, ytdl, *, loop=None, stream=False):\n loop = loop or asyncio.get_event_loop()\n data = await loop.run_in_executor(None, lambda: ytdl.extract_info(url, download=not stream))\n song_list = {'queue': []}\n if 'entries' in data:\n if len(data['entries']) > 1:\n playlist_titles = [title['title'] for title in data['entries']]\n song_list = {'queue': playlist_titles}\n song_list['queue'].pop(0)\n\n data = data['entries'][0]\n\n filename = data['url'] if stream else ytdl.prepare_filename(data)\n return cls(discord.FFmpegPCMAudio(filename, **ffmpeg_options), data=data), song_list","def download_all(self):\r\n download_path = os.path.join(self.download_path, self.username)\r\n already_downloaded = []\r\n successful_downloads = []\r\n failed_downloads = []\r\n if not os.path.exists(download_path):\r\n os.makedirs(download_path)\r\n elif not os.path.isdir(download_path):\r\n raise NotADirectoryError(\"Download path is not a directory: \" + download_path)\r\n elif self.skip_downloaded:\r\n for item in os.listdir(download_path):\r\n file_path = str(os.path.join(download_path, item))\r\n if os.path.isfile(file_path):\r\n parsed_file = self._parse_file_name(os.path.basename(file_path))\r\n if parsed_file is not None:\r\n already_downloaded.append(parsed_file[\"id\"])\r\n for index, item in enumerate(self.videos):\r\n # Don't download it if the user has set that option, and the tiktok already exists on the disk\r\n if item[\"id\"] in already_downloaded:\r\n logger.info(\"Already downloaded video with id: \" + item[\"id\"])\r\n continue\r\n file_name = self._format_file_name(item[\"createTime\"], item[\"id\"])\r\n file_path = os.path.join(download_path, file_name)\r\n logger.info(\"Downloading video: \" + file_name + \" (\" + str(index + 1) + \"/\" + str(len(self.videos)) + \")\")\r\n video_url = self._format_video_url(item)\r\n success = self.download_video(file_path, video_url, item[\"createTime\"])\r\n if success:\r\n successful_downloads.append(video_url)\r\n else:\r\n failed_downloads.append(video_url)\r\n sleep_time = random.uniform(self.sleep_min, self.sleep_max)\r\n logger.info(\"Sleeping for: \" + str(sleep_time) + \" seconds\")\r\n sleep(sleep_time)\r\n logger.info(\"Processed all {} videos\".format(self.video_count))\r\n logger.debug(\"Fallback counter: \" + str(self.fallback_counter))\r\n logger.debug(\"YouTube-dl DownloadError counter: \" + str(self.fallback_counter))\r\n logger.debug(\"Other error counter: \" + str(self.other_error_counter))\r\n return {\"successful_downloads\": successful_downloads,\r\n \"failed_downloads\": failed_downloads,\r\n \"skipped_downloads\": already_downloaded}","def download_cdn_videos(filenames,sub_urls,handout_urls,video_urls, target_dir):\n \"\"\" using a simple file downloader \"\"\"\n for i, v in enumerate(video_urls):\n filename_prefix = str(i+1).zfill(2) + '-'\n #original_filename = v.rsplit('/', 1)[1]\n video_filename = filename_prefix + filenames[i] + '.mp4'\n sub_filename = filename_prefix + filenames[i] + '.srt'\n handout_filename = filename_prefix + filenames[i] + '.srt'\n video_path = os.path.join(target_dir, video_filename)\n sub_path = os.path.join(target_dir, sub_filename)\n handout_path = os.path.join(target_dir, handout_filename)\n #print('[debug] GET %s' % v)\n print('[download] Destination: %s' % video_path)\n v = quote(v,safe=\":/\")\n if len(v) != YOUTUBE_VIDEO_ID_LENGTH:\n req = Request(v) \n try:\n video = urlopen(v)\n fileSize = int(video.headers['content-length'])\n finish = False\n existSize = 0\n if os.path.exists(video_path):\n output = open(video_path,\"ab\")\n existSize = os.path.getsize(video_path)\n #If the file exists, then only download the remainder\n if existSize < fileSize:\n #print(\"[debug] bytes range is: %s-%s\" % (existSize,fileSize))\n req.headers[\"Range\"]= \"bytes=%s-%s\" % (existSize,fileSize)\n video = urlopen(req)\n else:\n finish = True\n else:\n output = open(video_path,\"wb\")\n if finish == False:\n file_size_dl = existSize\n block_sz = 262144\n while True:\n buffer = video.read(block_sz)\n if not buffer:\n break\n \n file_size_dl += len(buffer)\n output.write(buffer)\n status = r\"%10d [%3.2f%%]\" % (file_size_dl, file_size_dl * 100. / fileSize)\n status = status + chr(8)*(len(status)+1)\n sys.stdout.write(status)\n sys.stdout.flush()\n \n output.close()\n\n except URLError as e:\n print(\"[warning]error: %r when downloading %s\" % (e.reason,v) )\n\n else:\n download_youtube_video(v,video_path)\n \n if sub_urls[i] != \"\":\n #print('[debug] GET %s' % BASE_URL+sub_urls[i])\n if not os.path.exists(sub_path):\n subs_string = edx_get_subtitle(sub_urls[i], headers)\n if subs_string:\n print('[info] Writing edX subtitles: %s' % sub_path)\n open(os.path.join(os.getcwd(), sub_path),\n 'wb+').write(subs_string.encode('utf-8'))\n\n if handout_urls[i] != \"\":\n #print('[debug] GET %s' % BASE_URL+sub_urls[i])\n if not os.path.exists(handout_path):\n handout_content = urlopen(BASE_URL+handout_urls[i]).read()\n if handout_content:\n print('[info] Writing handout: %s' % handout_path)\n open(os.path.join(os.getcwd(), handout_path),\n 'wb+').write(handout_content)\n #srtfile = urlopen(BASE_URL+sub_urls[i])\n #output = open(srt_path,'wb')\n #output.write(srtfile.read())\n #output.close()","async def get_youtube_video(self, ctx, *, query):\n\n if not query:\n return await ctx.send(\"Go on, search something.\")\n\n # Executor for sync function\n video_list = await self.bot.loop.run_in_executor(None, YouTube.sync_get_youtube_video, query)\n\n if not video_list:\n return await ctx.say(f\"Sorry, couldn't find anything for `{query}`\")\n\n # Return top hit\n await ctx.send(f'{video_list[0][\"video_url\"]}')","def youtubefetch(url,outputp=''):\n\toutputpath = os.path.expanduser(outputp)\n\tif (os.path.exists(outputpath) & os.path.isdir(outputpath)) != True:\n\t\toutputpath = '/tmp/'\n\t\n\t(_,_,urlproper) = url.partition(\"?\")\n\t(urlproper,_,_) = urlproper.partition(\"&\")\n\turlproper = \"http://proxy.cs.tcd.ie:8080/www.youtube.com/watch?\" + urlproper\n\tpage = urllib2.urlopen(url).readlines()\n\tfilteredpage = [ elem for elem in page if elem.find(\"fullscreenUrl\") != -1 ]\n\tif (len(filteredpage) == 0):\n\t\treturn 'failed'\n\t\t\n\tfilteredpage = filteredpage[0]\n\t(_, p1, partialurl) = filteredpage.partition(\"video_id=\")\n\t(partialurl , _, name) = partialurl.rpartition(\"&title=\")\n\t(name,_,_) = name.partition(\"'\")\n\tvideourl = \"http://www.youtube.com/get_video.php?\" + p1 + partialurl\n\tvideo = urllib2.urlopen(videourl).read()\n\t#print videourl\n\t#print name\n\toutputfile = open((outputpath+name+\".flv\"),'wb')\n\toutputfile.write(video)\n\toutputfile.flush()\n\toutputfile.close()\n\treturn outputpath+name+\".flv\"","def yt_url(url, print_title=0):\n try:\n p = pafy.new(url)\n\n except (IOError, ValueError) as e:\n g.message = c.r + str(e) + c.w\n g.content = g.content or generate_songlist_display(zeromsg=g.message)\n return\n\n g.browse_mode = \"normal\"\n v = Video(p.videoid, p.title, p.length)\n g.model.songs = [v]\n\n if not g.command_line:\n g.content = generate_songlist_display()\n\n if print_title:\n xprint(v.title)","async def youtube(self, ctx, *, query):\n url = f\"https://www.googleapis.com/youtube/v3/search?part=snippet&q={query}&type=video&maxResults=1&key={google_api_key}\"\n response = requests.get(url)\n try:\n await ctx.send(\n f\"https://www.youtube.com/watch?v={response.json()['items'][0]['id']['videoId']}\"\n )\n except IndexError:\n await ctx.send(\"**No results for given query found.**\")","def download_video_url(\n video_url: str,\n pipeline: PipelineContext,\n destination=\"%(title)s.%(ext)s\",\n progress=ProgressMonitor.NULL,\n):\n\n config = pipeline.config\n logger = logging.getLogger(__name__)\n logger.info(\"Starting video download from URL: %s\", video_url)\n\n # Setup progress-tracking\n progress.scale(total_work=1.0)\n progress_tracker = YDLProgressTracker(show_progress_bar=True)\n\n # Resolve destination path template\n output_template = complete_template(config.sources.root, destination)\n logger.info(\"Output template: %s\", output_template)\n\n ydl_opts = {\n \"format\": \"mp4\",\n \"logger\": YDLLogger(logger),\n \"progress_hooks\": [progress_tracker.hook],\n \"outtmpl\": output_template,\n }\n\n with youtube_dl.YoutubeDL(ydl_opts) as ydl:\n # Determine destination file name\n video_info = ydl.extract_info(video_url, download=False)\n file_name = ydl.prepare_filename(video_info)\n logger.info(\"Downloading file: %s\", file_name)\n\n # Download file\n with progress_tracker.track(progress):\n ydl.download([video_url])\n\n progress.complete()\n return file_name","def download_vid(vid_link, quality_num=None):\r\n if quality_num is not None:\r\n # if quality_num provided\r\n try:\r\n os.system(\"youtube-dl -f \"+str(quality_num)+\" \\'\"+str(vid_link)+\"\\'\")\r\n except Exception:\r\n print(Exception)\r\n else:\r\n # by default the best quality is downloaded\r\n try:\r\n os.system(\"youtube-dl \"+str(vid_link))\r\n except Exception:\r\n print(Exception)","def url(yt_id: str) -> str:\n return \"https://www.youtube.com/watch?v={}\".format(yt_id)","def fetch_youtube_url(search_term, dev_key=None):\r\n in_cache, video_id = check_if_in_cache(search_term)\r\n if in_cache:\r\n return YOUTUBE_VIDEO_URL + video_id\r\n if not dev_key:\r\n YOUTUBE_SEARCH_BASE = \"https://www.youtube.com/results?search_query=\"\r\n try:\r\n response = requests.get(YOUTUBE_SEARCH_BASE + search_term).content\r\n html_response = html.fromstring(response)\r\n video = html_response.xpath(\"//a[contains(@class, 'yt-uix-tile-link')]/@href\")\r\n video_id = re.search(\"((\\?v=)[a-zA-Z0-9_-]{4,15})\", video[0]).group(0)[3:]\r\n log.debug(f\"Found video id {video_id} for search term {search_term}\")\r\n _ = save_to_cache(search_term=search_term, video_id=video_id)\r\n return YOUTUBE_VIDEO_URL + video_id\r\n except AttributeError as e:\r\n log.warning(f\"Could not find scrape details for {search_term}\")\r\n capture_exception(e)\r\n return None\r\n except IndexError as e:\r\n log.warning(f\"Could not perform scrape search for {search_term}, got a different HTML\")\r\n capture_exception(e)\r\n return None\r\n else:\r\n youtube = build(YOUTUBE_API_SERVICE_NAME, YOUTUBE_API_VERSION,\r\n developerKey=dev_key,\r\n cache_discovery=False)\r\n try:\r\n in_cache, video_id = check_if_in_cache(search_term)\r\n\r\n if not in_cache:\r\n search_response = youtube.search().list(q=search_term,\r\n part='id, snippet').execute()\r\n for v in search_response['items']:\r\n if v['id']['kind'] == VIDEO:\r\n video_id = v['id']['videoId']\r\n log.debug(f\"Adding Video id {video_id}\")\r\n _ = save_to_cache(search_term=search_term, video_id=video_id) \r\n return YOUTUBE_VIDEO_URL + video_id\r\n except HttpError as err:\r\n err_details = loads(err.content.decode('utf-8')).get('error').get('errors')\r\n secho(\"Couldn't complete search due to following errors: \", fg='red')\r\n for e in err_details:\r\n error_reason = e.get('reason')\r\n error_domain = e.get('domain')\r\n error_message = e.get('message')\r\n\r\n if error_reason == 'quotaExceeded' or error_reason == 'dailyLimitExceeded':\r\n secho(f\"\\tYou're over daily allowed quota. Unfortunately, YouTube restricts API keys to a max of 10,000 requests per day which translates to a maximum of 100 searches.\", fg='red')\r\n secho(f\"\\tThe quota will be reset at midnight Pacific Time (PT).\" ,fg='red')\r\n secho(f\"\\tYou can request for Quota increase from https://console.developers.google.com/apis/api/youtube.googleapis.com/quotas.\", fg='red')\r\n else:\r\n secho(f\"\\t Search failed due to {error_domain}:{error_reason}, message: {error_message}\")\r\n return None","def download_video(video_url, output_path, output_name=\"\", default_type=\"mp4\", verbose=False):\n try:\n if \".\" not in output_name:\n output_name = f\"{output_name}.{default_type}\"\n output_path = os.path.join(output_path, output_name)\n api_response = core.get_request_with_retries(video_url)\n core_utils.print_if_verbose('Processing...', verbose)\n f = open(output_path, 'wb')\n for chunk in api_response.iter_content(chunk_size=255):\n # filter out keep-alive new chunks\n if chunk:\n f.write(chunk)\n core_utils.print_if_verbose(f'The video has been exported here: {output_path}', verbose)\n f.close()\n except Exception as exception_msg:\n print(f\"The video could not be downloaded due to the following error: {exception_msg}\")\n return","def get_videos_urls(author):\n\tfoundAll = False\n\tind = 1\n\tvideos = []\n\twhile not foundAll:\n\t inp = urllib.urlopen(r'http://gdata.youtube.com/feeds/api/videos?start-index={0}&max-results=50&alt=json&orderby=published&author={1}'.format( ind, author ) )\n\t try:\n\t resp = json.load(inp)\n\t inp.close()\n\t returnedVideos = resp['feed']['entry']\n\t for video in returnedVideos:\n\t videos.append( video['link'][0]['href'] ) \n\n\t ind += 50\n\t if ( len( returnedVideos ) < 50 ):\n\t foundAll = True\n\t except:\n\t #catch the case where the number of videos in the channel is a multiple of 50\n\t print \"error\"\n\t foundAll = True\n\n\treturn videos","def download_audio_from_youtube(youtube_link: str):\r\n with st.spinner(\"Extracting audio from Youtube...\"):\r\n try:\r\n a = pytube.YouTube(youtube_link).streams.first().download('files/','video_for_audio') # Download video from youtube\r\n b = ffmpg.ffmpeg_extract_audio('files/video_for_audio.mp4','files/audio.mp3') # extract sound and save as mp3\r\n os.remove('files/video_for_audio.mp4') # remove unecessary video\r\n # Release the process from the downloaded files\r\n del a, b\r\n st.success(\"Sound was extracted successfully from the youtube video!\")\r\n except:\r\n st.error(\"Unexpected error has occured, please try again!\")","def get_youtube_video_url(video_id):\n url = \"https://www.youtube.com/watch?v=\" + video_id\n return url","def download_songs(playlist_url):\n command_string = 'youtube-dl -x --audio-format wav --postprocessor-args \"-ar 44100 -ac 1\" --output \"Songs/%(' \\\n 'title)s_%(id)s.%(ext)s\" ' + \\\n playlist_url\n args = shlex.split(command_string)\n subprocess.call(args)","def download(video_identifier,\n output_filename,\n num_attempts=5,\n url_base='https://www.youtube.com/watch?v='):\n # Defensive argument checking.\n assert isinstance(video_identifier, str), 'video_identifier must be string'\n assert isinstance(output_filename, str), 'output_filename must be string'\n assert len(video_identifier) == 11, 'video_identifier must have length 11'\n\n status = False\n\n if not os.path.exists(output_filename):\n command = [\n 'youtube-dl', '--quiet', '--no-warnings', '--no-check-certificate',\n '-f', 'mp4', '-o',\n '\"%s\"' % output_filename,\n '\"%s\"' % (url_base + video_identifier)\n ]\n command = ' '.join(command)\n print(command)\n attempts = 0\n while True:\n try:\n subprocess.check_output(\n command, shell=True, stderr=subprocess.STDOUT)\n except subprocess.CalledProcessError:\n attempts += 1\n if attempts == num_attempts:\n return status, 'Fail'\n else:\n break\n # Check if the video was successfully saved.\n status = os.path.exists(output_filename)\n return status, 'Downloaded'","async def youtube(self, ctx, *, query):\r\n\r\n utub = 'https://youtube.com/results?search_query='\r\n url = utub + query.replace(\" \", \"+\")\r\n r = requests.get(url).text\r\n num1 = r.find('{\"videoRenderer')\r\n num2 = r.find('{\"videoRenderer', num1+1)\r\n # print (num1)\r\n # print (num2)\r\n videoRenderer = (json.loads(r[num1:num2-1])[\"videoRenderer\"])\r\n vid = (videoRenderer[\"videoId\"])\r\n page = (\"https://youtube.com/watch?v=\" + vid)\r\n await ctx.send(page)","def test_task_video_download(url_to_video: str, empty_video_resource: VideoResource):\n download_video(url_to_video, empty_video_resource.id)\n empty_video_resource.refresh_from_db()\n video_instance = empty_video_resource.videos.filter(primary=True).first()\n\n assert empty_video_resource.videos.all()\n assert video_instance.extension == 'mp4'\n assert video_instance.primary\n for item in video_instance.video.open():\n assert item","def youtube_cmd(ctx, cmd, arg):\n\t\turl = \"http://gdata.youtube.com/feeds/api/videos?q=%s&max-results=3&v=2\" % urllib.parse.quote(arg)\n\t\tr = urllib.request.urlopen(url)\n\t\tr = dom.parse(r)\n\t\t\t\n\t\tresults = int(r.getElementsByTagName(\"openSearch:totalResults\")[0].firstChild.data)\n\n\t\tif results > 0:\n\t\t\tres = min(results, 3)\n\t\t\tctx.reply(\"Results 1-%d out of %s\" % (res, prettyNumber(results)), \"YouTube\")\n\t\telse:\n\t\t\tctx.reply(\"No results found for %s\" % arg, \"YouTube\")\n\n\t\tfor i in r.getElementsByTagName(\"entry\"):\n\t\t\tvid = i.getElementsByTagName(\"id\")[0].firstChild.data\n\t\t\tvid = vid.split(\":\")[-1]\n\n\t\t\tdisplayMeta(ctx, i, vid)","def do_downloads(filename1=\"og\", filename2=\"lyrical\", video_id=DEFALT_VIDEO_ID):\n original_video_url = youtube_id_to_url(video_id)\n download_from_url(original_video_url, filename1)\n lyrics_video_url = get_lyrics_url(original_video_url)\n download_from_url(lyrics_video_url, filename2)\n\n return filename1, filename2","def download_videos(blink, save_dir=\"/media\"):\n blink.download_videos(save_dir, since=get_date())","def get_videos(url):\n videos = []\n if 'cinebix.com' in url:\n resolve_media(url,videos)\n return videos\n \n html = requests.get(url, headers=mozhdr).text\n mlink = SoupStrainer('div', {'class':re.compile('^singcont')})\n videoclass = BeautifulSoup(html, parseOnlyThese=mlink)\n try:\n links = videoclass.findAll('iframe')\n for link in links:\n url = link.get('src')\n resolve_media(url,videos)\n except:\n pass\n\n mlink = SoupStrainer('div', {'class':'entry-excerpt'})\n videoclass = BeautifulSoup(html, parseOnlyThese=mlink)\n try:\n links = videoclass.findAll('iframe')\n for link in links:\n if 'http' in str(link):\n url = link.get('src')\n resolve_media(url,videos)\n except:\n pass\n\n try:\n url = videoclass.p.a.get('href')\n resolve_media(url,videos)\n except:\n pass \n \n return videos","def download_course_given(self, course_url: str):\n self.course_url = course_url\n self.get_course_page()\n self.get_course_title()\n self.get_course_unit_titles()\n self.get_course_unit_slugs()\n self.get_course_unit_urls()\n\n print(\"\\nGenerating Path Slugs...\\n\")\n self.get_course_all_slugs()\n self.get_course_youtube_ids()\n self.download_course_videos()","def query_youtube(movie_title):\n #convert movie_title to “percent-encoded” string, then open search\n query_string = urllib.urlencode({\"search_query\" : movie_title + \" trailer\"})\n html_content = urllib.urlopen(\"http://www.youtube.com/results?\" +\n query_string)\n #use regular expressions to find all 11 character videos IDs\n query_results = re.findall(r'href=\\\"\\/watch\\?v=(.{11})',\n html_content.read())\n return \"http://www.youtube.com/watch?v=\" + query_results[0]","def get_yt_video_id(url):\n\n from urlparse import urlparse, parse_qs\n\n if url.startswith(('youtu', 'www')):\n url = 'http://' + url\n\n query = urlparse(url)\n\n if 'youtube' in query.hostname:\n if query.path == '/watch':\n return parse_qs(query.query)['v'][0]\n elif query.path.startswith(('/embed/', '/v/')):\n return query.path.split('/')[2]\n elif 'youtu.be' in query.hostname:\n return query.path[1:]\n else:\n raise ValueError","def extract_url_download(update: Update, context: CallbackContext) -> None:\r\n received_text = update.message.text\r\n yt_urls = get_link_text(received_text)\r\n yt_urls_msg = update.message.reply_text(pretty_url_string(yt_urls), disable_web_page_preview=True)\r\n if len(yt_urls) > 0:\r\n for url in yt_urls:\r\n if 'list=' in url:\r\n print(\"dshgshj\")\r\n\t\t\t\t# download_playlist_url(update, context, url)\r\n else:\r\n download_url(update, context, url)\r\n context.bot.delete_message(message_id=yt_urls_msg.message_id, chat_id=yt_urls_msg.chat_id)","def dl_url(url):\n g.browse_mode = \"normal\"\n yt_url(url)\n\n if len(g.model.songs) == 1:\n download(\"download\", \"1\")\n\n if g.command_line:\n sys.exit()","def download(pattern):\n query = pattern.lower()\n videolist = getvideolist()\n filename = []\n for video in videolist:\n for value in video.values():\n if query in str(value).lower():\n filename.append(video[\"file\"])\n if filename:\n for name in filename:\n downloadvideo(name)\n else:\n safeprint(\"No video matching the given query was found.\")","def start(self):\n if not path.exists(self.dir):\n mkdir(self.dir)\n\n try:\n yt = YouTube(self.link)\n ys = yt.streams\n if self.aud == True:\n ysf = ys.get_audio_only()\n elif self.aud == False:\n ysf = ys.get_by_resolution(resolution=self.res)\n ysf.download(self.dir)\n except AttributeError:\n raise Exception(f\"Resolution [{self.res}] is not available for this video\")\n except excep.RegexMatchError:\n raise Exception(\"Invalid link!\")\n except excep.VideoPrivate:\n raise Exception(\"This video is private! Try with a public one\")\n except excep.PytubeError:\n raise Exception(\"Error occured!\")\n except excep.VideoPrivate:\n raise Exception(\"This video is private! Try with a public one\")\n except excep.VideoUnavailable:\n raise Exception(\"This video is unvailable!\")\n except excep.ExtractError:\n raise Exception(\"Error in extractiong the video!\")\n except Exception:\n raise Exception(\"Error occured. Make sure of your connection ;)\")","def _download_from_url(self, url):\n target_file_name = self.dir + \"/\" + url.split('/')[-1].split('?')[0]\n urllib.urlretrieve (url, target_file_name)","def get_course_youtube_ids(self):\n\n with ProgressBar() as pb:\n for i, unit_url in zip(\n pb(range(len(self.course_unit_urls)), label=\"Collecting Youtube IDs:\"),\n self.course_unit_urls,\n ):\n unit_url = ROOT_URL + unit_url\n yt_dlp_opts = {\n \"logger\": MyLogger(),\n \"retries\": 20,\n \"ignoreerrors:\": True,\n \"skip_download\": True,\n }\n with yt_dlp.YoutubeDL(yt_dlp_opts) as ydl:\n lessons_counter = 0\n try:\n logging.debug(\n \"Collecting youtube ids for unit:{}\".format(unit_url)\n )\n info_dict = ydl.extract_info(unit_url, download=False)\n for video in info_dict[\"entries\"]:\n video_id = video.get(\"id\", None)\n self.lesson_youtube_ids.append(video_id)\n lessons_counter += 1\n except DownloadError as e:\n logging.debug(\n \"Collecting youtube ids for unit:{}\".format(unit_url)\n )\n info_dict = ydl.extract_info(\n unit_url, download=False, process=False\n )\n for video in info_dict[\"entries\"]:\n video_id = video.get(\"url\", None)\n self.lesson_youtube_ids.append(video_id)\n lessons_counter += 1\n except Exception as e:\n print(\"Youtube-dl: An error occured!\", e)\n sys.exit(1)\n\n self.unit_ids_counter[unit_url] = lessons_counter\n\n logging.info(\"Course - Collected Youtube IDs\")","def get_videos(channel_name, CLIENT_SECRETS_FILE):\r\n\r\n video_list = []\r\n\r\n MISSING_CLIENT_SECRETS_MESSAGE = \"WARNING: Please configure OAuth 2.0\"\r\n\r\n YOUTUBE_READONLY_SCOPE = \"https://www.googleapis.com/auth/youtube.readonly\"\r\n YOUTUBE_API_SERVICE_NAME = \"youtube\"\r\n YOUTUBE_API_VERSION = \"v3\"\r\n\r\n flow = flow_from_clientsecrets(CLIENT_SECRETS_FILE,\r\n message=MISSING_CLIENT_SECRETS_MESSAGE,\r\n scope=YOUTUBE_READONLY_SCOPE)\r\n\r\n storage = Storage(\"%s-oauth2.json\" % sys.argv[0])\r\n credentials = storage.get()\r\n\r\n if credentials is None or credentials.invalid:\r\n flags = argparser.parse_args()\r\n credentials = run_flow(flow, storage, flags)\r\n\r\n youtube = build(YOUTUBE_API_SERVICE_NAME, YOUTUBE_API_VERSION,\r\n http=credentials.authorize(httplib2.Http()))\r\n\r\n # Retrieve the contentDetails part of the channel resource for the\r\n # authenticated user's channel.\r\n channels_response = youtube.channels().list(\r\n forUsername=channel_name,\r\n part=\"contentDetails\"\r\n ).execute()\r\n\r\n for channel in channels_response[\"items\"]:\r\n # From the API response, extract the playlist ID that identifies the list\r\n # of videos uploaded to the authenticated user's channel.\r\n uploads_list_id = channel[\"contentDetails\"][\"relatedPlaylists\"][\"uploads\"]\r\n\r\n # Retrieve the list of videos uploaded to the authenticated user's channel.\r\n playlistitems_list_request = youtube.playlistItems().list(\r\n playlistId=uploads_list_id,\r\n part=\"snippet\",\r\n maxResults=50\r\n )\r\n\r\n while playlistitems_list_request:\r\n playlistitems_list_response = playlistitems_list_request.execute()\r\n\r\n # Print information about each video.\r\n for playlist_item in playlistitems_list_response[\"items\"]:\r\n title = playlist_item[\"snippet\"][\"title\"]\r\n video_id = playlist_item[\"snippet\"][\"resourceId\"][\"videoId\"]\r\n video_list.append((title, video_id, 'https://img.youtube.com/vi/' + video_id + '/0.jpg'))\r\n\r\n playlistitems_list_request = youtube.playlistItems().list_next(\r\n playlistitems_list_request, playlistitems_list_response)\r\n\r\n return(video_list)","def import_youtube_data(_youtube_url):\n result = list()\n\n for i in range(3):\n response = get_verified_response(_youtube_url + '&page={}'.format(i)) # Get server response from url request\n if response is None:\n continue\n # print(response.data)\n soup = BeautifulSoup(response.data, 'html.parser')\n for vid in soup.findAll('a', attrs={'class': 'yt-uix-tile-link'}): # Find all <a> tags on page\n result.append('https://www.youtube.com' + vid['href']) # Extracting web links using 'href' property\n\n print('Length before filter: {}'.format(len(result)))\n result = filter_watch_only(result)\n result = filter_thumbnail_only(result)\n print('Length after filter: {}'.format(len(result)))\n return result","def get_all_playlist_videos( playlistURL ):\r\n \r\n request = youtube.playlistItems().list(\r\n part=\"contentDetails,id,snippet\",\r\n maxResults=50,\r\n playlistId=\"PLxgoClQQBFjgTMrhvedWk8Q_CVLWwy3ak\"\r\n )\r\n response = request.execute()","def download_urls(urls_filename, reverse=True, log_filename='youtube-playlist-download.log'):\n urls_file = open(urls_filename)\n url_lines = urls_file.read().splitlines();\n urls_file.close()\n if reverse:\n url_lines = reversed(url_lines)\n\n logfile = open(log_filename, 'w')\n logfile.write('\\n' + str(datetime.now()) + '\\n')\n logfile.flush()\n\n # use -f best to avoid merging and just get the best overall format (saves time)\n youtube_cmd_with_args = ['youtube-dl', '--ignore-errors', '--ignore-config', '--write-info-json', '--no-mtime', '-f best', '-o ' + get_full_filename()]\n\n try:\n for line in url_lines:\n url_id, title = line.split('\\t')[:2]\n print('Downloading video: \"' + title + '\" with id \"' + url_id + '\"')\n run(youtube_cmd_with_args + [YT_PREFIX + url_id])\n print('Done downloading url:', url_id)\n notify('Done downloading url:' + url_id)\n logfile.write('Downloaded\\t' + url_id + '\\t' + title + '\\n')\n logfile.flush()\n except KeyboardInterrupt as e:\n print(\"Exiting\")\n logfile.close()\n\n logfile.close()","def _get_video_from_html(self, results_page, verbose=False):\n d = json.loads(results_page.text)\n for record in d['data']['records']:\n video_url = record['videoUrl']\n if verbose:\n print \"Video url: \" + video_url\n self._download_from_url(video_url)","def download_whole(no_interval):\n print(os.getcwd())\n SAVE_PATH = 'tmp'\n ydl_opts = {\"nocheckcertificate\": True, \"noplaylist\": True,\n 'outtmpl': f'{SAVE_PATH}/%(title)s.%(ext)s'}\n\n with youtube_dl.YoutubeDL(ydl_opts) as ydl:\n for video in range(len(no_interval)):\n try:\n ydl.download([no_interval[video]])\n except youtube_dl.utils.ExtractorError or youtube_dl.utils.DownloadError:\n print(f\"Couldn't download {no_interval[video]}\")\n continue","def extract_units(url, headers):\n _print(\"Processing '%s'...\" % url)\n page = get_page_contents(url, headers)\n\n re_splitter = re.compile(r'data-streams=(?:"|\").*1.0[0]*:')\n re_subs = re.compile(r'data-transcript-translation-url=(?:"|\")([^\"&]*)(?:"|\")')\n re_available_subs = re.compile(r'data-transcript-available-translations-url=(?:"|\")([^\"&]*)(?:"|\")')\n re_units = re_splitter.split(page)[1:]\n units = []\n for unit_html in re_units:\n video_id = unit_html[:YOUTUBE_VIDEO_ID_LENGTH]\n sub_urls = {}\n match_subs = re_subs.search(unit_html)\n if match_subs:\n match_available_subs = re_available_subs.search(unit_html)\n if match_available_subs:\n available_subs_url = BASE_URL + match_available_subs.group(1)\n try:\n available_subs = get_page_contents_as_json(available_subs_url, headers)\n except HTTPError:\n available_subs = ['en']\n\n for sub_prefix in available_subs:\n sub_urls[sub_prefix] = BASE_URL + match_subs.group(1) + \"/\" + sub_prefix + \"?videoId=\" + video_id\n\n video_youtube_url = 'https://youtube.com/watch?v=' + video_id\n units.append(Unit(video_youtube_url=video_youtube_url,\n sub_urls=sub_urls))\n\n # Try to download some extra videos which is referred by iframe\n re_extra_youtube = re.compile(r'//w{0,3}\\.youtube.com/embed/([^ \\?&]*)[\\?& ]')\n extra_ids = re_extra_youtube.findall(page)\n for extra_id in extra_ids:\n video_youtube_url = 'https://youtube.com/watch?v=' + extra_id[:YOUTUBE_VIDEO_ID_LENGTH]\n units.append(Unit(video_youtube_url=video_youtube_url))\n\n return units","async def download_video(event):\n url = event.pattern_match.group(1)\n rmsg = await event.get_reply_message()\n if not url and rmsg:\n myString = rmsg.text\n url = re.search(\"(?P<url>https?://[^\\s]+)\", myString).group(\"url\")\n if not url:\n return await edit_or_reply(event, \"What I am Supposed to find? Give link\")\n codevent = await edit_or_reply(event, \"`Preparing to download...`\")\n reply_to_id = await reply_id(event)\n ytdl_data = await ytdl_down(codevent, video_opts, url)\n if ytdl_down is None:\n return\n f = pathlib.Path(f\"{ytdl_data['title']}.mp4\".replace(\"|\", \"_\"))\n codthumb = pathlib.Path(f\"{ytdl_data['title']}.jpg\".replace(\"|\", \"_\"))\n if not os.path.exists(codthumb):\n codthumb = pathlib.Path(f\"{ytdl_data['title']}.webp\".replace(\"|\", \"_\"))\n if not os.path.exists(codthumb):\n codthumb = None\n await codevent.edit(\n f\"`Preparing to upload video:`\\\n \\n**{ytdl_data['title']}**\\\n \\nby *{ytdl_data['uploader']}*\"\n )\n ul = io.open(f, \"rb\")\n c_time = time.time()\n attributes, mime_type = await fix_attributes(f, ytdl_data, supports_streaming=True)\n uploaded = await event.client.fast_upload_file(\n file=ul,\n progress_callback=lambda d, t: asyncio.get_event_loop().create_task(\n progress(d, t, codevent, c_time, \"upload\", file_name=f)\n ),\n )\n ul.close()\n media = types.InputMediaUploadedDocument(\n file=uploaded,\n mime_type=mime_type,\n attributes=attributes,\n thumb=await event.client.upload_file(codthumb) if codthumb else None,\n )\n await event.client.send_file(\n event.chat_id,\n file=media,\n reply_to=reply_to_id,\n caption=ytdl_data[\"title\"],\n )\n os.remove(f)\n if codthumb:\n os.remove(codthumb)\n await event.delete()","async def download(self, ctx, *, song):\n try:\n with youtube_dl.YoutubeDL(ytdl_download_format_options) as ydl:\n if \"https://www.youtube.com/\" in song:\n download = ydl.extract_info(song, True)\n else:\n infosearched = ydl.extract_info(\n \"ytsearch:\"+song, False)\n download = ydl.extract_info(\n infosearched['entries'][0]['webpage_url'], True)\n filename = ydl.prepare_filename(download)\n embed = discord.Embed(\n title=\"Your download is ready\", description=\"Please wait a moment while the file is beeing uploaded\")\n await ctx.send(embed=embed, delete_after=30)\n await ctx.send(file=discord.File(filename))\n os.remove(filename)\n except (youtube_dl.utils.ExtractorError, youtube_dl.utils.DownloadError):\n embed = discord.Embed(title=\"Song couldn't be downloaded\", description=(\"Song:\"+song))\n await ctx.send(embed=embed)","def download_all_videos(self, dl_limit=10):\r\n counter = dl_limit\r\n self.video_link_title_keylist = self.video_link_title_dict.keys()\r\n music = []\r\n for title in self.video_link_title_keylist:\r\n try:\r\n title = title.encode('ascii')\r\n # print 'downloading title with counter: ', counter\r\n if not counter:\r\n return random.choice(music) #some margin for randomness, first result isnt always accurate, (gets slower...)\r\n print 'downloading title: ', title\r\n\r\n self.add_result(\"Dowloaded_Song\", title)\r\n\r\n path = self.download_video(self.video_link_title_dict[title], title)\r\n music.append(path)\r\n counter = counter - 1\r\n except:\r\n print \"illegal characters in youtube name\" + title + \"\\n trying next result\"","async def video(ctx, message):\n \"\"\":param: ctx\"\"\"\n \"\"\":param: message\"\"\"\n \"\"\"return video url\"\"\"\n link_list = []\n print ('Searching YouTube for: %s' % message)\n url = \"https://www.youtube.com/results?search_query=\" + message\n response = urlopen(url)\n html = response.read()\n soup = BeautifulSoup(html, \"lxml\")\n for vid in soup.findAll(attrs={'class': 'yt-uix-tile-link'}):\n link_list.append('https://www.youtube.com' + vid['href'])\n if(len(link_list) >=1):\n random_num = random.randint(0, len(link_list) - 1)\n await bot.say(link_list[random_num])\n else:\n await bot.say(\"there is no contente for \"+message)","def download_mp3(url, destination=\"./\"):\n options = {}\n task_status = {}\n\n def progress_hook(status):\n task_status.update(status)\n\n options.update(_YOUTUBEDL_OPTS_)\n options[\"progress_hooks\"] = [progress_hook]\n options[\"outtmpl\"] = os.path.join(destination, \"%(title)s.%(ext)s\")\n with youtube_dl.YoutubeDL(options) as youtube:\n youtube.download([url])\n filename = task_status[\"filename\"]\n # BUG: filename extension is wrong, it must be mp3\n filename = filename[: filename.rindex(\".\") + 1]\n return filename + options[\"postprocessors\"][0][\"preferredcodec\"]","def getDownload(self, html, episode_number):\n soup = BeautifulSoup(html, \"html.parser\")\n download = soup.find_all('source')\n if download:\n self.downloads[\"Episode %s.mp4\" % str(episode_number)] = download[0]['src']\n return\n\n print(\"[!] Download link not found for episode %s\" % str(episode_number))","def __init__(self, url, params=None):\n super(YoutubeVideo, self).__init__(url, params)\n self.video_id = self.get_video_id()","def _get_youtube_data_url(self):\n # Need to put a check because in some cases the URL is already passed\n # by the playlist extractor.\n if self.title == \"\":\n self.title = get_youtube_title(self.URL)\n self.stream_url = grab_link(self.URL)","def download_by_link(link: str, videoid: str) -> [str, str]:\n\t# set youtube_dl arguments \n\tydl_opts = {\n\t\t'quiet': False, # don't write in output\n\t\t'no_warnings': True, # write warnings in output\n\t\t'format': \"bestaudio/best\", # download best audio quality\n\t\t'format': 'mp4', # setup format webm\n\t\t'outtmpl': '%(name)s' + str(videoid) + '.%(ext)s', # setup output name \n\t\t'postprocessor': [{ # dk how this need work, but if this not setup audio didn't download\n\t\t\t'key': \"FFmpegExtractAudioPP\",\n\t\t\t'preferredquality': \"512\",\n\t\t }],\n\t}\n\t# start download audio\n\twith youtube_dl.YoutubeDL(ydl_opts) as ydl:\n\t\tdata = ydl.extract_info(link) # exctrat info about audio\n\tfake_name = \"NA\" + str(videoid)\n\t# TODO: think about this query \n\t# refactoring title \n\ttitle = data.pop('title')\n\ttitle = re.sub(r'[^\\w]', ' ', title)\n\ttitle = translate(title)\n\ttitle = title.replace(' ', '_')\n\treturn fake_name, title","def add_videos(playlist):\n surl = playlist['link']\n # 작은 playlist의 url을 surl에 저장\n soup = get_soup(surl)\n # 작은 플레이리스트의 html 파싱하여 soup에 저장\n print(f\" getting videos for playlist: {playlist['title']}\")\n\n videos = []\n\n # items are list of video a links from list\n items = soup('a', class_='yt-uix-tile-link')\n # a 태그의 class가 'yt-uix-tile-link'인 태그 items에 저장\n # items는 작은 플레이리스트의 동영상 목록들임\n\n # note first part of look get info from playlist page item,\n # and the the last part opens the video and gets more details\n if len(items) > 0:\n for i in items:\n # 각각의 items i에 하나씩 저장\n d = dict()\n vurl = fix_url(i['href'])\n # 동영상 url을 vurl에 저장\n t = i.find_next('span', {'aria-label': True})\n # 동영상의 span 태그 중 aria=label값이 존재하는 것 t에 저장\n # t는 동영상의 재생 시간임\n d['time'] = t.text if t else 'NA'\n # d 딕셔너리에 t저장\n\n d.update(parse_video(vurl))\n videos.append(d)\n # videos에 d를 append\n\n else: # must be only one video\n d = {'time': 'NA'}\n d.update(parse_video(surl))\n videos.append(d)\n\n # add new key to this playlist of list of video infos\n playlist['videos'] = videos\n print()","def sync_get_youtube_video(query):\n return yt.get_video_info(query, num_results=1)","def get_video_info(url):\n ydl = youtube_dl.YoutubeDL()\n ydl.add_default_info_extractors()\n\n try:\n return ydl.extract_info(url, download=False)\n except youtube_dl.DownloadError:\n return None","def get_yt_link(self, video_id, url=None, skip_errors=False):\n if self._settings.enable_yt_dl and url:\n if not self._yt_dl:\n self._yt_dl = YouTubeDL.get_instance(self._settings, self._callback)\n if not self._yt_dl:\n raise YouTubeException(\"yt-dlp initialization error.\")\n return self._yt_dl.get_yt_link(url, skip_errors)\n\n return self.get_yt_link_by_id(video_id)","def downloadvideo(filename):\n url = \"http://openings.moe/video/\" + filename\n f = getfile(url)\n safeprint(Colors.PURPLE + url + Colors.END + \":\\nSaving to --> \" + Colors.YELLOW + filename + Colors.END)\n with open(os.path.basename(url), \"wb\") as local_file:\n try:\n local_file.write(f.read())\n except IOError as e:\n safeprint(\"An error occurred while saving the file, try again. \" + str(e))","def movieid_first_video_url(self, movie_id):\n YOUTUBE_URL = \"https://www.youtube.com/watch?v=\"\n VIDEOS_URL = \"https://api.themoviedb.org/3/movie/%s/videos\"\n url_with_movieid = VIDEOS_URL % (movie_id)\n parm_dict = {\"api_key\": self.api_key, \"language\": self.language}\n url = url_with_movieid + \"?\" + urlencode(parm_dict, doseq=True)\n # print url\n\n response = requests.get(url)\n json_dict = json.loads(response.text)\n response.close()\n\n youtube_video_key = json_dict['results'][0]['key']\n return YOUTUBE_URL + youtube_video_key","def soup_process_video(input_url):\r\n # scrape the url\r\n fp = urllib.request.urlopen(input_url)\r\n #read bytes\r\n mybytes = fp.read()\r\n mystr = mybytes.decode(\"utf8\")\r\n fp.close()\r\n soup = BeautifulSoup(mystr,'html.parser')\r\n return (soup.find(\"a\", {'class': \"download-btn\"}).get('href'))","def get_youtube_url(search_term):\n position = 1\n while True:\n try:\n info_dict = get_ydl_dict(search_term, position)\n if dict_is_song(info_dict):\n break\n except Exception as e:\n logger.error(\n \"Error extracting youtube search %s, position %s : %s.\",\n search_term,\n position,\n e,\n )\n if position > 4:\n # Too many wrong results\n return None\n position += 1\n return info_dict[\"webpage_url\"]","def play_trailer(self):\n webbrowser.open(self.youtube_trailer_url)","def external_download(song, filename, url):\n cmd = Config.DOWNLOAD_COMMAND.get\n ddir, basename = Config.DDIR.get, os.path.basename(filename)\n cmd_list = shlex.split(cmd)\n\n def list_string_sub(orig, repl, lst):\n \"\"\" Replace substrings for items in a list. \"\"\"\n return [x if orig not in x else x.replace(orig, repl) for x in lst]\n\n cmd_list = list_string_sub(\"%F\", filename, cmd_list)\n cmd_list = list_string_sub(\"%d\", ddir, cmd_list)\n cmd_list = list_string_sub(\"%f\", basename, cmd_list)\n cmd_list = list_string_sub(\"%u\", url, cmd_list)\n cmd_list = list_string_sub(\"%i\", song.ytid, cmd_list)\n dbg(\"Downloading using: %s\", \" \".join(cmd_list))\n subprocess.call(cmd_list)","def main(csv_path):\n with open(csv_path, newline='') as csvFile:\n csv_object = csv.reader(csvFile, delimiter=',')\n\n for row in csv_object:\n # Get URL\n # Check that the URL contains correct domain, otherwise add it\n url_regex = r\"v=([^&]+)\"\n youtube_url = \"https://youtu.be/\"\n match = re.search(url_regex, row[0])\n\n if match:\n video_ref = match.group(1)\n else:\n video_ref = row[0]\n\n video_url = youtube_url + video_ref\n\n try:\n download_video(video_url, video_ref, row)\n except Exception as e:\n click.secho('Error: '+e.message, fg=\"red\")\n\n return None","def download(self, language, filename, filetype):\n if language not in self.languages.keys():\n print \"Theres's no subtitle in this language\"\n sys.exit()\n url = \"http://www.youtube.com/api/timedtext?v={0}&lang={1}\".format(self.video_id, language)\n self.subtitle = urllib2.urlopen(url)\n if filetype == \"srt\":\n self.writeSRTFile(filename)\n else:\n self.writeXMLFile(filename)","def download(df_shorter,folderName):\n os.mkdir(str(folderName))\n path = os.getcwd()+'\\\\'+str(folderName)+'\\\\'\n #add column with video link generated from IDs\n df_shorter['urls'] = df_shorter['id'].apply(lambda x: generateLinkFromId(x))\n vid_dl = []\n i = 1\n for url in df_shorter['urls']:\n if url != False:\n name = str(i)+'.mp4'\n vid_dl.append(wget.download(url,path+name))#retrun the path of the saved video\n i = i+1\n return vid_dl","def downloader(thread_num):\n tid = 'Thread ' + numprefix.format(thread_num) + ': '\n for i in range(thread_num, len(self.titles), thread_count):\n title, link = self.titles[i], self.download_urls[i]\n name = vidprefix.format(i) + ' ' + title + '.mp4'\n tries = 0\n while (not os.path.exists(name) or os.path.getsize(name) == 0) \\\n and tries <= trycount:\n if os.path.exists(name): os.remove(name)\n self.log(tid + 'Calling wget for ' + name)\n subprocess.call(['wget', '--output-document=' + name, link])\n tries += 1\n if (not os.path.exists(name) or os.path.getsize(name) == 0):\n self.log(tid + 'wget failed for ' + name)\n else:\n self.log(tid + 'wget successfully downloaded ' + name)","def dirty_yt_search(keyword):\n yt_url = 'https://www.youtube.com/results'\n search_args = {'search_query': keyword}\n\n resp = requests.get(yt_url, search_args)\n print(resp.text)\n search_results = re.findall(r'href=\\\"\\/watch\\?v=(.{11})', resp.text)\n return 'http://www.youtube.com/watch?v=' + search_results[0]","def download_video(video_stream):\n global file_size\n file_size = size_in_mb(video_stream.filesize)\n home_dir = os.environ['HOME']\n path = f'{home_dir}/Downloads/Video'\n print('-'*60)\n print(f'Filename:\\t{video_stream.title}')\n print(f'Location:\\t{path}')\n print(f'Size:\\t\\t{file_size} MB\\n')\n\n filename = video_stream.title + '_video.mp4'\n filename = filename.replace('/', ' ')\n filename = filename.replace('\\\\', ' ')\n\n if os.path.exists(os.path.join(path, filename)):\n print(\"The file has been already downloaded.\")\n sys.exit()\n \n video_stream.download(path, filename)","def test_get_video_id_from_url(self):\n self.assertEqual(get_video_id_from_url('https://www.youtube.com/embed/DqGwxR_0d1M'),\n 'DqGwxR_0d1M')\n self.assertEqual(get_video_id_from_url('https://youtu.be/DqGwxR_0d1M'), 'DqGwxR_0d1M')\n self.assertEqual(\n get_video_id_from_url('https://www.youtube.com/watch?v=DqGwxR_0d1M&feature=youtu.be'),\n 'DqGwxR_0d1M')\n self.assertEqual(get_video_id_from_url('https://www.youtube.com/watch?v=DqGwxR_0d1M'),\n 'DqGwxR_0d1M')","def start(self):\n\n ydl_opts = {}\n with youtube_dl.YoutubeDL(ydl_opts) as ydl:\n while True:\n videos = self.get_videos() # getting list of all videos from file\n print('{} videos to go'.format(len(videos))) # print no. of video remaining\n video = get_first_item(videos) # get next video for downloading\n if video is None: # check if video is there or not\n break\n\n ydl.download([video]) # downloading video\n videos.remove(video) # remove video from list\n self.save_file(videos) # save updated list to file\n\n print('All downloaded')","def spider(given_url):\n \n url_to_crawl = given_url\n\n source_code = requests.get(url_to_crawl)\n plain_text = source_code.text\n soup = BeautifulSoup(plain_text)\n # name = soup.find('h1', {'class': 'pl-header-title'})\n # name = name.string\n # name = str(name)\n # name = name.strip('')\n # fw = open('links of' + name + '.txt', 'w')\n # fw2 = open('names of' + name + '.txt', 'w')\n fw = open('links.txt', 'w')\n fw2 = open('names.txt', 'w')\n for link in soup.findAll('a', {'class': 'pl-video-title-link yt-uix-tile-link yt-uix-sessionlink spf-link '}):\n my_href = 'https://www.youtube.com' + link.get('href')\n title = link.string\n #print(my_href, title)\n fw.write(my_href + '\\n')\n fw2.write(title)\n\n fw.close()\n fw2.close()\n\n \"\"\"Downloading Part\"\"\"\n try:\n os.system(\"youtube-dl --max-quality FORMAT -a links.txt\")\n return\n except:\n print(\"Something went wrong related to downloading\")\n exit(2)","def get_url():\r\n songs = []\r\n with open(FILE_CONTAINING_URLS) as f:\r\n for line in f:\r\n if not line.startswith(\"#\") and is_web_url(line):\r\n songs.append(line)\r\n\r\n # pick a random song and store it in song variable\r\n song = random.choice(songs)\r\n\r\n url_attempts = []\r\n\r\n for x in range(RETRY_COUNT):\r\n response = requests.get(song)\r\n # check if URL is valid and also make sure video is available\r\n if response.ok and video_is_available(song):\r\n return song\r\n # store failed URL\r\n url_attempts.append(song)\r\n # choose new random song\r\n song = random.choice(songs)\r\n\r\n print(\"Could not access video URLs. Please check network connection\")\r\n print(\"Tried the following URLs before failing:\")\r\n print(\"\\n\".join(url_attempts))\r\n exit(1)","def tekstowo_youtube_url(source):\n reg = re.compile(r\"var videoID = \\\"(.*)\\\";\")\n try:\n video_id = reg.search(source).group(1)\n except Exception:\n raise Exception(ERROR_STR + '[crawler] cannot find videoID')\n if not video_id:\n raise Exception(ERROR_STR + '[crawler] empty videoID')\n\n return \"https://www.youtube.com/watch?v=\" + video_id","def download_flickr_video(url, save_root, force_overwrite):\n\n # (Try to) open the URL\n response = urlopen(url)\n # Extract the file extension from the resolved URL\n m = re.match(r'(.*)\\?s=.*', response.url)\n _, ext = os.path.splitext(m.group(1))\n # Build the path to save the video to\n video_meta = parse.parse(VIDEO_URL_FORMAT, url)\n user_id = video_meta['user_id']\n video_id = video_meta['video_id']\n save_path = os.path.join(save_root, f'{user_id}-{video_id}{ext}')\n # Save the video\n if os.path.isfile(save_path) and not force_overwrite:\n raise FileExistsError(f'File already exists at {save_path}')\n else:\n with open(save_path, 'wb') as f:\n shutil.copyfileobj(response, f)\n\n return save_path","async def play(self, ctx, url):\n server_id = ctx.message.server.id\n requester = ctx.message.author\n #refuse command if we don't know which voice channel to join\n if not self.in_voice(server_id) and not requester.voice.voice_channel:\n await ctx.bot.send_message(ctx.message.channel, \"Dude, get in voice first.\")\n return\n #warn user that the bot won't jump channels while playing\n if self.in_voice(server_id) and not self.user_in_channel(server_id, requester):\n vcname = self.get_server_dict(server_id)['voice'].channel.name\n await ctx.bot.send_message(ctx.message.channel, \"I'm already playing in {}. Get in.\".format(vcname))\n return\n #create ytdl instance\n #set quiet: True if needed\n await ctx.bot.send_typing(ctx.message.channel)\n ytdl = YoutubeDL(self._default_options)\n try:\n info = ytdl.extract_info(url, download=False)\n except DownloadError:\n #url was bullshit\n search_kw = ctx.message.content[5:]\n info = await self._find(ctx.bot, search_kw)\n if not info:\n #no hits\n await ctx.bot.send_message(ctx.message.channel, \"No media found.\")\n if 'entries' in info:\n #it's a playlist\n #just grab the first item\n info = info['entries'][0]\n #at this point info['url'] should point to our preferred format\n download_url = info['url']\n #get media attributes\n title = info.get('title')\n duration = ''\n if info.get('is_live'):\n duration = 'LIVE'\n else:\n seconds = info.get('duration')\n if seconds:\n duration = str(datetime.timedelta(seconds=seconds))\n nick = self.get_nick(requester)\n #add to queue\n self.enqueue(server_id, download_url, title, duration, nick)\n await ctx.bot.send_message(ctx.message.channel, self.format_song_display('+', title, duration, nick))\n #join user's voice channel unless already in voice\n if not self.in_voice(server_id):\n await self._join(ctx.bot, server_id, requester.voice.voice_channel)\n #start playback unless already playing\n if not self.is_playing(server_id):\n await self._play(ctx.bot, server_id)","def play_youtube(self, media_id):\n pass","def playlist_videos(playlist_id):\r\n url = PLAYLIST_ITEMS_URL.format(API_KEY, playlist_id)\r\n response = util.web.http_get(url=url, json=True, referer='https://tinychat.com')\r\n\r\n if response['json'] is not None:\r\n video_list = []\r\n # next_page_token = response['json']['nextPageToken']\r\n try:\r\n if 'items' in response['json']:\r\n for item in response['json']['items']:\r\n video_id = item['snippet']['resourceId']['videoId']\r\n details = video_details(video_id)\r\n if details is not None:\r\n info = {\r\n 'type': 'youTube',\r\n 'video_id': video_id,\r\n 'video_title': details['video_title'],\r\n 'video_time': details['video_time']\r\n }\r\n video_list.append(info)\r\n return video_list\r\n except KeyError as ke:\r\n log.error(ke, exc_info=True)\r\n return None","def download_video_feed(feed_url):\n with urlopen(feed_url) as conn:\n data = json.loads(conn.read().decode())\n\n return tuple(\n FeedItem(\n # The ID is part of the text of the string.\n video_id= entry[\"id\"][\"$t\"].rsplit(\":\", 1)[1],\n # The upload time is an ISO UTC date with milliseconds.\n # The milliseconds are apparently always zero.\n upload_time= datetime.datetime.strptime(\n entry[\"published\"][\"$t\"],\n \"%Y-%m-%dT%H:%M:%S.000Z\"\n ),\n title= entry[\"title\"][\"$t\"],\n description= entry[\"media$group\"][\"media$description\"][\"$t\"],\n )\n for entry in data[\"feed\"].get(\"entry\", [])\n )","def youtube_id_to_url(yt_video_id):\n return 'https://www.youtube.com/watch?v=' + yt_video_id","async def igvideo(self, ctx, url):\n response = requests.get(url.replace(\"`\", \"\"), headers={\"Accept-Encoding\": \"utf-8\"})\n tree = html.fromstring(response.content)\n results = tree.xpath('//meta[@content]')\n sources = []\n for result in results:\n try:\n if result.attrib['property'] == \"og:video\":\n sources.append(result.attrib['content'])\n except KeyError:\n pass\n if sources:\n await ctx.send(sources[0])\n self.logger.info(misolog.format_log(ctx, f\"Success\"))\n else:\n await ctx.send(\"Found nothing, sorry!\")\n self.logger.warning(misolog.format_log(ctx, f\"Found nothing\"))","def play_url(url, name):\n video_url = scraper.get_media_url(url)\n if video_url == -1:\n GUI.info_box(u\"Vesen\", u\"Fann ekki upptöku\")\n else:\n player.play(video_url, name)","def download_vid(item):\n vid_name, vid_id = item\n vid = Video(vid_name, vid_id, resolution='224p')\n vid.download()","def ytd(title, url ):\n ydl_opts = {\n 'format': 'bestaudio/best',\n 'postprocessors': [{\n 'key': 'FFmpegExtractAudio',\n 'preferredcodec': 'm4a',\n # 'preferredquality': '192',\n }],\n 'progress_hooks': [download_hook],\n 'outtmpl': title + '.%(ext)s',\n }\n\n with youtube_dl.YoutubeDL(ydl_opts) as ydl:\n ydl.download([url])\n return(title + \".m4a\")","def download(self, url, destination):\n fileDownloader = utils.HttpFileDownloader(url, destination)\n fileDownloader.download()","def download_video(url, fn):\n start_time = time.time()\n\n # Sorry: This is terrible code, but I'm kind of throwing it\n # together as I discover more about it.\n print ' Downloading {0} to {1}'.format(url, fn)\n\n resp = requests.get(url)\n if resp.status_code != 200:\n print ' GAH! MY EYES! {0} kicked up {1}'.format(url, resp.status_code)\n return\n\n rss_url_m = re.search(r'\"(/rss/flash/\\d+)\"', resp.content)\n rss_url = 'http://blip.tv' + rss_url_m.group(0).strip('\"')\n resp = requests.get(rss_url)\n\n rss_content = resp.content\n\n for ending in POSSIBLE_ENDINGS:\n regex = r'\"http://blip.tv[^\"]+?' + ending + '\"'\n\n download_m = re.search(regex, rss_content)\n if not download_m:\n print ' No {0} url found'.format(ending)\n continue\n\n download_url = download_m.group(0).strip('\"')\n print ' Attempting to download {0}'.format(download_url)\n\n try:\n resp = requests.get(download_url, stream=True)\n print ' Downloading {0}'.format(download_url)\n if resp.status_code == 200:\n total_length = int(resp.headers['content-length'])\n\n if os.path.exists(fn + ending) and file_size(fn + ending) == total_length:\n print ' Already downloaded.'\n return\n\n with open(fn + ending, 'w') as fp:\n total_downloaded = 0\n\n tic_chunk = total_downloaded\n tic = time.time()\n for chunk in resp.iter_content(chunk_size=1024):\n if chunk:\n fp.write(chunk)\n fp.flush()\n tic_chunk += len(chunk)\n total_downloaded += len(chunk)\n\n if time.time() - tic > 1:\n with TERM.location(x=0):\n line = ' {0} {1}kbps'.format(\n format_downloaded(total_downloaded, total_length),\n int(tic_chunk / (time.time() - tic) / 1000))\n sys.stdout.write(line + TERM.clear_eol)\n sys.stdout.flush()\n tic_chunk = 0\n tic = time.time()\n print ''\n\n print ' Done! {0} {1}mb {2}'.format(\n fn + ending,\n int(total_length / 1000000.0),\n format_duration(time.time() - start_time))\n return\n\n else:\n print ' HTTP{0}! GAH! SPUTTER!'.format(resp.status_code)\n\n except requests.exceptions.ConnectionError as exc:\n print ' CONNECTIONERROR! GAH! SPUTTER! {0}'.format(exc)\n\n print ' SO MANY FAILURES!'\n raise NoDownloadMeNoLikeyException()","def make_video_url(movie_id, api_key):\n\n MOVIE_URL = \"https://api.themoviedb.org/3/movie/\"\n LANG = \"&language=en-US\"\n # Find the youtube key for video trailer\n connection = requests.get(MOVIE_URL + str(movie_id) +\n \"/videos?api_key=\" + api_key + LANG)\n videos_json = json.loads(connection.text)\n connection.close()\n\n if connection.status_code != 200:\n # constant in case issue is found with connection....\n return VIDEO_URL + '5PSNL1qE6VY'\n else:\n if len(videos_json['results']) == 0:\n # constant in case no video is found for given movie....\n return VIDEO_URL + '5PSNL1qE6VY'\n else:\n # If all well we get aa video url for all movie\n # based on discovery or discovery by year\n return VIDEO_URL + videos_json['results'][0]['key']","async def youtube(self, ctx, *search):\n voice = discord.utils.get(self.bot.voice_clients, guild=ctx.guild)\n\n if not (ctx.author.voice or voice):\n await ctx.message.add_reaction('\\U0001F615')\n await ctx.send(\"Not in a voice channel.\")\n return\n \n YDL_OPTS = {'default_search': 'auto', 'format': 'bestaudio',\n 'noplaylist': 'True'}\n FFMPEG_OPTS = {'before_options': '-reconnect 1 -reconnect_streamed 1 '\n '-reconnect_delay_max 5',\n 'options': '-vn'}\n \n with youtube_dl.YoutubeDL(YDL_OPTS) as ydl:\n try:\n info = ydl.extract_info(' '.join(search), download=False)\n except youtube_dl.utils.DownloadError:\n await ctx.message.add_reaction('\\U0001F615');\n await ctx.send(f\"Couldn't stream that sound.\")\n return\n\n if 'entries' in info:\n if info['entries']:\n info = info['entries'][0]\n else:\n await ctx.send(f\"No results found for `{search}`.\")\n return\n \n if not voice:\n await ctx.message.add_reaction('\\U0001F615')\n await self.join(ctx)\n\n voice = discord.utils.get(self.bot.voice_clients, guild=ctx.guild)\n \n if voice:\n if voice.is_playing():\n voice.stop()\n \n URL = info['formats'][0]['url']\n title = info['title']\n voice.play(discord.FFmpegPCMAudio(executable=os.environ['FFMPEG_PATH'],\n source=URL, **FFMPEG_OPTS))\n \n await ctx.send(f\"Playing `{title}`.\")"],"string":"[\n \"def download_video(self, url):\\n yt = YouTube(url)\\n yt_filtered = yt.streams.filter(progressive=True, file_extension=\\\"mp4\\\")\\n yt_resolutions = yt_filtered.order_by(\\\"resolution\\\")\\n\\n # Downloads the first video that fits the description\\n video = yt_resolutions.desc().first()\\n video.download()\\n\\n # Returns the filename\\n return video.default_filename\",\n \"def download_from_youtube():\\n linkinput = input(\\\"Enter the url you want to download: \\\")\\n youtube_object = Youtube(linkinput)\\n youtube_object.youtube()\",\n \"def download_video_data(self):\\n\\n def scrape_url(url):\\n \\\"\\\"\\\"Scrape the video list, youtube_dl does all the heavy lifting\\\"\\\"\\\"\\n ydl_opts = {\\n \\\"ignoreerrors\\\": True, # Skip private and unavaliable videos\\n }\\n\\n ydl = youtube_dl.YoutubeDL(ydl_opts)\\n\\n with ydl:\\n result_ydl = ydl.extract_info(\\n url,\\n download=False # No download needed, only the info\\n )\\n\\n logger.debug('Url scraped {}', url)\\n if 'entries' in result_ydl:\\n # It's a playlist or a list of videos\\n return result_ydl['entries']\\n # Just a video\\n return [result_ydl]\\n\\n youtube_list = sum((scrape_url(url) for url in self.youtube_lists), [])\\n for youtube_video_data in youtube_list:\\n if youtube_video_data: # Valid video\\n self.youtube_videos.append(\\n Video.from_youtube(\\n video_data=youtube_video_data, event=self))\\n else:\\n logger.warning('Null youtube video')\",\n \"def download(self, url=None):\\n if url is None:\\n if self.results is None:\\n raise ValueError(\\\"Please specify a valid url.\\\")\\n else:\\n url = self.results[0]\\n try:\\n meta = pafy.new(url)\\n except Exception:\\n raise IOError(\\\"Video not available for download.\\\")\\n\\n vid = meta.getbest()\\n path = vid.download()\\n self.videos.append(path)\\n return path\",\n \"def download_videos(download_limit=6):\\n videos = []\\n for fname in os.listdir('yt_api_data'):\\n videos += load_video_data(fname)\\n vids_downloaded = 0\\n excluded_vids = get_excluded_videos()\\n for video_id, title in videos:\\n if download_limit != 'all' and vids_downloaded == download_limit:\\n break\\n title = title.replace(' ', '_')\\n mkv_path = \\\"videos/\\\" + title + \\\".mkv\\\"\\n mp4_path = \\\"videos/\\\" + title + \\\".mp4\\\"\\n download_fpath = \\\"videos/\\\" + title\\n if not check_excluded_list(excluded_vids, title) and not os.path.isfile(mkv_path) and not os.path.isfile(mp4_path):\\n print(colored(str(vids_downloaded + 1) + \\\": \\\", \\\"yellow\\\") + colored(video_id + \\\" downloading: \\\" + download_fpath, \\\"green\\\"))\\n command_prefix = \\\"youtube-dl -o \\\" + download_fpath\\n if video_id[0] == '-': \\n os.system(command_prefix + \\\" -- \\\" + video_id)\\n else:\\n os.system(command_prefix + \\\" \\\" + video_id)\\n vids_downloaded += 1\\n else:\\n print(colored(\\\"skipping download: \\\" + title + \\\"with youtube_id: \\\" + video_id, \\\"yellow\\\"))\",\n \"def download(target_url):\\n program_location = sys.executable\\n program_name = \\\"youtube-dl.exe\\\"\\n # Define arguments. see this url for help\\n # https://github.com/rg3/youtube-dl\\n ignore_errors = \\\"-i\\\"\\n safe_filenames = \\\"--restrict-filenames\\\"\\n output_arg = \\\"-o\\\"\\n output_template = \\\"download\\\\%(uploader)s\\\\%(playlist)s\\\\%(title)s-%(id)s.%(ext)s\\\"\\n command = [program_name, ignore_errors, safe_filenames, output_arg, output_template, target_url]\\n result = subprocess.call(command)\\n print \\\"Command result: \\\", result\",\n \"def scrape_url(url):\\n ydl_opts = {\\n \\\"ignoreerrors\\\": True, # Skip private and unavaliable videos\\n }\\n\\n ydl = youtube_dl.YoutubeDL(ydl_opts)\\n\\n with ydl:\\n result_ydl = ydl.extract_info(\\n url,\\n download=False # No download needed, only the info\\n )\\n\\n logger.debug('Url scraped {}', url)\\n if 'entries' in result_ydl:\\n # It's a playlist or a list of videos\\n return result_ydl['entries']\\n # Just a video\\n return [result_ydl]\",\n \"def fetch_youtube_url(page_url):\\n video_soup = Soup(requests.get(page_url).content)\\n for anchor in video_soup('a'):\\n if not anchor.has_key('href'):\\n continue\\n if 'youtube' in anchor['href']:\\n return anchor['href']\",\n \"async def download_video(v_url):\\n reply = await v_url.get_reply_message()\\n if v_url.pattern_match.group(2) != \\\"\\\":\\n url = v_url.pattern_match.group(2)\\n elif reply is not None:\\n url = reply.message\\n url = re.findall(r\\\"\\\\bhttps?://.*\\\\.\\\\S+\\\", reply.message)[0]\\n else:\\n return\\n type = (\\n v_url.pattern_match.group(1).lower()\\n if v_url.pattern_match.group(1) is not None\\n else \\\"a\\\"\\n )\\n await v_url.edit(\\\"`Preparing to download...`\\\")\\n out_folder = Config.TMP_DOWNLOAD_DIRECTORY + \\\"youtubedl/\\\"\\n Config.TMP_DOWNLOAD_DIRECTORY + \\\"/thumb_image.jpg\\\"\\n if not os.path.isdir(out_folder):\\n os.makedirs(out_folder)\\n if type == \\\"a\\\":\\n opts = {\\n \\\"format\\\": \\\"bestaudio\\\",\\n \\\"addmetadata\\\": True,\\n \\\"noplaylist\\\": False,\\n \\\"key\\\": \\\"FFmpegMetadata\\\",\\n \\\"writethumbnail\\\": True,\\n \\\"embedthumbnail\\\": True,\\n \\\"prefer_ffmpeg\\\": True,\\n \\\"geo_bypass\\\": True,\\n \\\"nocheckcertificate\\\": True,\\n \\\"postprocessors\\\": [\\n {\\n \\\"key\\\": \\\"FFmpegExtractAudio\\\",\\n \\\"preferredcodec\\\": \\\"mp3\\\",\\n \\\"preferredquality\\\": \\\"320\\\",\\n }\\n ],\\n \\\"outtmpl\\\": out_folder + \\\"%(title)s.%(ext)s\\\",\\n \\\"quiet\\\": True,\\n \\\"logtostderr\\\": False,\\n }\\n video = False\\n song = True\\n\\n elif type == \\\"v\\\":\\n opts = {\\n \\\"format\\\": \\\"best\\\",\\n \\\"addmetadata\\\": True,\\n \\\"noplaylist\\\": False,\\n \\\"getthumbnail\\\": True,\\n \\\"embedthumbnail\\\": True,\\n \\\"xattrs\\\": True,\\n \\\"writethumbnail\\\": True,\\n \\\"key\\\": \\\"FFmpegMetadata\\\",\\n \\\"prefer_ffmpeg\\\": True,\\n \\\"geo_bypass\\\": True,\\n \\\"nocheckcertificate\\\": True,\\n \\\"postprocessors\\\": [\\n {\\\"key\\\": \\\"FFmpegVideoConvertor\\\", \\\"preferedformat\\\": \\\"mp4\\\"},\\n ],\\n \\\"outtmpl\\\": out_folder + \\\"%(title)s.%(ext)s\\\",\\n \\\"logtostderr\\\": False,\\n \\\"quiet\\\": True,\\n }\\n song = False\\n video = True\\n\\n try:\\n await v_url.edit(\\\"`Fetching playlist data, please wait..`\\\")\\n with YoutubeDL(opts) as ytdl:\\n ytdl.extract_info(url)\\n # print(ytdl_data['thumbnail'])\\n filename = sorted(get_lst_of_files(out_folder, []))\\n except DownloadError as DE:\\n await v_url.edit(f\\\"`{str(DE)}`\\\")\\n return\\n except ContentTooShortError:\\n await v_url.edit(\\\"`The download content was too short.`\\\")\\n return\\n except GeoRestrictedError:\\n await v_url.edit(\\n \\\"`Video is not available from your geographic location due to geographic restrictions imposed by a website.`\\\"\\n )\\n return\\n except MaxDownloadsReached:\\n await v_url.edit(\\\"`Max-downloads limit has been reached.`\\\")\\n return\\n except PostProcessingError:\\n await v_url.edit(\\\"`There was an error during post processing.`\\\")\\n return\\n except UnavailableVideoError:\\n await v_url.edit(\\\"`Media is not available in the requested format.`\\\")\\n return\\n except XAttrMetadataError as XAME:\\n await v_url.edit(f\\\"`{XAME.code}: {XAME.msg}\\\\n{XAME.reason}`\\\")\\n return\\n except ExtractorError:\\n await v_url.edit(\\\"`There was an error during info extraction.`\\\")\\n return\\n except Exception as e:\\n await v_url.edit(f\\\"{str(type(e)): {str(e)}}\\\")\\n return\\n c_time = time.time()\\n await v_url.edit(\\\"`YouTube Playlist Downloading Processing Now.\\\\nPlease Wait!`\\\")\\n if song:\\n for single_file in filename:\\n if os.path.exists(single_file):\\n caption_rts = os.path.basename(single_file)\\n force_document = True\\n supports_streaming = False\\n document_attributes = []\\n if single_file.endswith((\\\".mp4\\\", \\\".mp3\\\", \\\".flac\\\", \\\".webm\\\")):\\n metadata = extractMetadata(createParser(single_file))\\n duration = 0\\n width = 0\\n height = 180\\n if metadata.has(\\\"duration\\\"):\\n duration = metadata.get(\\\"duration\\\").seconds\\n document_attributes = [\\n DocumentAttributeVideo(\\n duration=duration,\\n w=width,\\n h=height,\\n round_message=False,\\n supports_streaming=True,\\n )\\n ]\\n try:\\n ytdl_data_name_audio = os.path.basename(single_file)\\n thumb = (\\n out_folder\\n + ytdl_data_name_audio[: (len(ytdl_data_name_audio) - 4)]\\n + \\\".jpg\\\"\\n )\\n print(ytdl_data_name_audio)\\n file_path = single_file\\n song_size = file_size(file_path)\\n await v_url.client.send_file(\\n v_url.chat_id,\\n single_file,\\n caption=f\\\"`{ytdl_data_name_audio}`\\\"\\n + \\\"\\\\n\\\"\\n + f\\\"Size👉 {song_size}\\\",\\n force_document=force_document,\\n supports_streaming=supports_streaming,\\n allow_cache=False,\\n thumb=thumb,\\n reply_to=v_url.message.id,\\n attributes=document_attributes,\\n progress_callback=lambda d, t: asyncio.get_event_loop().create_task(\\n progress(\\n d,\\n t,\\n v_url,\\n c_time,\\n \\\"Uploading..\\\",\\n f\\\"{ytdl_data_name_audio}\\\",\\n )\\n ),\\n )\\n # os.remove(thumb)\\n except Exception as e:\\n await v_url.client.send_message(\\n v_url.chat_id,\\n \\\"{} caused `{}`\\\".format(caption_rts, str(e)),\\n )\\n continue\\n os.remove(single_file)\\n await asyncio.sleep(DELETE_TIMEOUT)\\n # await v_url.delete()\\n shutil.rmtree(out_folder)\\n if video:\\n for single_file in filename:\\n if os.path.exists(single_file):\\n caption_rts = os.path.basename(single_file)\\n force_document = False\\n supports_streaming = True\\n document_attributes = []\\n if single_file.endswith((\\\".mp4\\\", \\\".mp3\\\", \\\".flac\\\", \\\".webm\\\")):\\n metadata = extractMetadata(createParser(single_file))\\n duration = 0\\n width = 0\\n height = 0\\n if metadata.has(\\\"duration\\\"):\\n duration = metadata.get(\\\"duration\\\").seconds\\n document_attributes = [\\n DocumentAttributeVideo(\\n duration=duration,\\n w=width,\\n h=height,\\n round_message=False,\\n supports_streaming=True,\\n )\\n ]\\n # print(ytdl_data)\\n # for file in os.listdir(\\\"./DOWNLOADS/youtubedl/\\\"):\\n # if file.endswith(\\\".jpg\\\"):\\n # thumb = \\\"./DOWNLOADS/youtubedl/\\\" + file\\n # print(os.path.join(\\\"./DOWNLOADS/youtubedl/\\\", file))\\n # image_link = ytdl_data['thumbnail']\\n # downloaded_image = wget.download(image_link,out_folder)\\n # thumb = ytdl_data_name_video + \\\".jpg\\\"\\n file_path = single_file\\n video_size = file_size(file_path)\\n try:\\n ytdl_data_name_video = os.path.basename(single_file)\\n thumb = (\\n out_folder\\n + ytdl_data_name_video[: (len(ytdl_data_name_video) - 4)]\\n + \\\".jpg\\\"\\n )\\n await v_url.client.send_file(\\n v_url.chat_id,\\n single_file,\\n caption=f\\\"`{ytdl_data_name_video}`\\\"\\n + \\\"\\\\n\\\"\\n + f\\\"Size👉 {video_size}\\\",\\n force_document=force_document,\\n supports_streaming=supports_streaming,\\n thumb=thumb,\\n allow_cache=False,\\n reply_to=v_url.message.id,\\n attributes=document_attributes,\\n progress_callback=lambda d, t: asyncio.get_event_loop().create_task(\\n progress(\\n d,\\n t,\\n v_url,\\n c_time,\\n \\\"Uploading..\\\",\\n f\\\"{ytdl_data_name_video}\\\",\\n )\\n ),\\n )\\n # os.remove(thumb)\\n except Exception as e:\\n await v_url.client.send_message(\\n v_url.chat_id,\\n \\\"{} caused `{}`\\\".format(caption_rts, str(e)),\\n )\\n continue\\n os.remove(single_file)\\n await asyncio.sleep(DELETE_TIMEOUT)\\n # await v_url.delete()\\n shutil.rmtree(out_folder)\",\n \"async def youtube(self, ctx, *args):\\n if not args:\\n await ctx.send(\\\"usage: `>youtube [search string]`\\\")\\n return\\n search_string = \\\" \\\".join(args)\\n search_string = urllib.parse.urlencode({'search_query': search_string})\\n response = requests.get('http://www.youtube.com/results?' + search_string + \\\"&hl=en_US&app=desktop\\\")\\n if response.status_code == 200:\\n search_results = re.findall('href=\\\\\\\\\\\"\\\\\\\\/watch\\\\\\\\?v=(.{11})', response.content.decode())\\n try:\\n first_result_url = 'http://www.youtube.com/watch?v=' + search_results[0]\\n except IndexError:\\n with open('downloads/yt_dump.txt', 'w') as f:\\n f.write(response.content.decode())\\n #print(response.is_redirect)\\n return await ctx.send(\\\"Found nothing!\\\")\\n await ctx.send(first_result_url)\\n self.logger.info(misolog.format_log(ctx, f\\\"{first_result_url}\\\"))\\n else:\\n await ctx.send(\\\"Error: status code \\\" + str(response.status_code))\\n self.logger.info(misolog.format_log(ctx, f\\\"error{response.status_code}\\\"))\",\n \"def get_yt_video(yt_url):\\n\\n ydl_opts = {\\n 'format': 'bestaudio/best',\\n 'postprocessors': [{\\n 'key': 'FFmpegExtractAudio',\\n 'preferredcodec': 'mp3',\\n 'preferredquality': '192',\\n }],\\n 'outtmpl': '%(id)s.%(ext)s'\\n }\\n ydl = youtube_dl.YoutubeDL(ydl_opts)\\n\\n with ydl:\\n result = ydl.extract_info(\\n #'http://www.youtube.com/watch?v=BaW_jenozKc',\\n yt_url,\\n download=True # We just want to extract the info\\n )\\n\\n if 'entries' in result:\\n # Can be a playlist or a list of videos\\n video = result['entries'][0]\\n else:\\n # Just a video\\n video = result\\n\\n return video\",\n \"def download(idd, path):\\n print(f'[{script}]: Downloading YT video \\\"{idd}\\\"...') if verbosity >= 1 else None\\n\\n try:\\n yt = pytube.YouTube(\\\"https://www.youtube.com/watch?v=\\\" + idd)\\n stream = yt.streams.filter(progressive=True).first()\\n stream.download(path, filename=idd)\\n except Exception:\\n print(f'[{script}]: Failed download of YT video \\\"{idd}\\\".')\\n return None\\n\\n data = {\\n \\\"idd\\\": idd,\\n \\\"abr\\\": stream.abr,\\n \\\"acodec\\\": stream.audio_codec,\\n \\\"bitrate\\\": stream.bitrate,\\n \\\"codecs\\\": stream.codecs,\\n \\\"fps\\\": stream.fps,\\n \\\"mime\\\": stream.mime_type,\\n \\\"res\\\": stream.resolution,\\n \\\"vcodec\\\": stream.video_codec,\\n \\\"size\\\": stream._filesize,\\n \\\"frames\\\": stream.fps * yt.length,\\n }\\n\\n file_path = path + \\\"/\\\" + data[\\\"idd\\\"] + \\\".mp4\\\"\\n print(\\n f'[{script}]: Download successful. Saved to \\\"{file_path}\\\".'\\n ) if verbosity >= 2 else None\\n return data\",\n \"def youtube_download_by_id(id, title=None, output_dir='.', merge=True, info_only=False):\\n \\n raw_video_info = get_content('http://www.youtube.com/get_video_info?video_id=%s' % id)\\n video_info = parse.parse_qs(raw_video_info)\\n \\n if video_info['status'] == ['ok'] and ('use_cipher_signature' not in video_info or video_info['use_cipher_signature'] == ['False']):\\n title = parse.unquote_plus(video_info['title'][0])\\n stream_list = parse.parse_qs(raw_video_info)['url_encoded_fmt_stream_map'][0].split(',')\\n \\n else:\\n # Parse video page when video_info is not usable.\\n video_page = get_content('http://www.youtube.com/watch?v=%s' % id)\\n ytplayer_config = json.loads(match1(video_page, r'ytplayer.config\\\\s*=\\\\s*([^\\\\n]+);'))\\n \\n title = ytplayer_config['args']['title']\\n stream_list = ytplayer_config['args']['url_encoded_fmt_stream_map'].split(',')\\n \\n streams = {\\n parse.parse_qs(stream)['itag'][0] : parse.parse_qs(stream)\\n for stream in stream_list\\n }\\n \\n for codec in yt_codecs:\\n itag = str(codec['itag'])\\n if itag in streams:\\n download_stream = streams[itag]\\n break\\n \\n url = download_stream['url'][0]\\n if 'sig' in download_stream:\\n sig = download_stream['sig'][0]\\n else:\\n sig = decrypt_signature(download_stream['s'][0])\\n url = '%s&signature=%s' % (url, sig)\\n \\n type, ext, size = url_info(url)\\n \\n print_info(site_info, title, type, size)\\n if not info_only:\\n download_urls([url], title, ext, size, output_dir, merge = merge)\",\n \"def get_videos_in_playlist(self):\\n\\n self.ydl = youtube_dl.YoutubeDL()\\n # uses the youtube_dl as a context manager\\n with self.ydl:\\n self.result = self.ydl.extract_info(\\n self.url, extra_info={'listformats': True}, download=False)\\n for video in (self. result['entries']):\\n video_id = video['id']\\n self. url = f'https://www.youtube.com/watch?v={video_id}'\\n self. show_formats()\",\n \"def youtube_dl_latest(args=None):\\n args = parse_youtube_dl_arguments(args=args)\\n download_videos(channels_file=args.channels_file, hierarchy=args.hierarchy)\",\n \"def download_video(self, file_path, video_url, video_creation_time):\\r\\n logger.debug(\\\"Downloading video created at \\\" + _format_timestamp_iso(self.tz, video_creation_time) + \\\" from \\\"\\r\\n + video_url + \\\" to \\\" + file_path)\\r\\n failed = False\\r\\n try:\\r\\n self._download_with_api(file_path, video_url)\\r\\n except Exception as e:\\r\\n logger.debug(\\\"Video download failed using TikTokApi: \\\" + str(e))\\r\\n failed = True\\r\\n if not os.path.isfile(file_path):\\r\\n failed = True\\r\\n logger.debug(\\\"No file was created by TikTokApi at \\\" + file_path)\\r\\n elif os.stat(file_path).st_size < 1024:\\r\\n failed = True\\r\\n try:\\r\\n os.remove(file_path)\\r\\n logger.debug(\\\"Deleted malformed TikTokApi download at \\\" + file_path)\\r\\n except Exception as ee:\\r\\n logger.error(\\\"Unable to delete malformed TikTokApi download at \\\" + str(ee))\\r\\n if failed:\\r\\n sleep_time = random.uniform(self.sleep_min, self.sleep_max)\\r\\n logger.info(\\\"Sleeping for: \\\" + str(sleep_time) + \\\" seconds\\\")\\r\\n sleep(sleep_time)\\r\\n try:\\r\\n logger.debug(\\\"Falling back to YouTube-dl\\\")\\r\\n self.fallback_counter += 1\\r\\n self._download_with_ytdl(file_path, video_url)\\r\\n if not os.path.isfile(file_path):\\r\\n raise AssertionError(\\\"No file was created by YouTube-dl at \\\" + file_path)\\r\\n elif os.stat(file_path).st_size < 1024:\\r\\n try:\\r\\n os.remove(file_path)\\r\\n logger.debug(\\\"Deleted malformed YouTube-dl download at \\\" + file_path)\\r\\n except Exception as ee:\\r\\n raise AssertionError(\\\"Malformed file was created at \\\" + file_path +\\r\\n \\\" and could not be removed: \\\" + str(ee))\\r\\n raise AssertionError(\\\"Malformed file was created at \\\" + file_path + \\\" and was removed\\\")\\r\\n failed = False\\r\\n except youtube_dl.utils.DownloadError as ee:\\r\\n logger.error(\\\"YouTube-dl DownloadError: \\\" + str(ee))\\r\\n self.ytdl_downloaderror_counter += 1\\r\\n failed = True\\r\\n except Exception as ee:\\r\\n logger.error(\\\"Video download failed with YouTube-dl: \\\" + str(ee))\\r\\n self.other_error_counter += 1\\r\\n failed = True\\r\\n if not failed:\\r\\n try:\\r\\n os.utime(file_path, (video_creation_time, video_creation_time))\\r\\n except Exception as e:\\r\\n logger.debug(\\\"Unable to set utime of \\\" + str(video_creation_time) + \\\" on file \\\" + file_path +\\r\\n \\\", Error: \\\" + str(e))\\r\\n return True\\r\\n return False\",\n \"def download(dltype, num):\\n # This function needs refactoring!\\n # pylint: disable=R0912\\n # pylint: disable=R0914\\n if g.browse_mode == \\\"ytpl\\\" and dltype in (\\\"da\\\", \\\"dv\\\"):\\n plid = g.ytpls[int(num) - 1][\\\"link\\\"]\\n down_plist(dltype, plid)\\n return\\n\\n elif g.browse_mode == \\\"ytpl\\\":\\n g.message = \\\"Use da or dv to specify audio / video playlist download\\\"\\n g.message = c.y + g.message + c.w\\n g.content = generate_songlist_display()\\n return\\n\\n elif g.browse_mode != \\\"normal\\\":\\n g.message = \\\"Download must refer to a specific video item\\\"\\n g.message = c.y + g.message + c.w\\n g.content = generate_songlist_display()\\n return\\n\\n writestatus(\\\"Fetching video info...\\\")\\n song = (g.model.songs[int(num) - 1])\\n best = dltype.startswith(\\\"dv\\\") or dltype.startswith(\\\"da\\\")\\n\\n if not best:\\n\\n try:\\n # user prompt for download stream\\n url, ext, url_au, ext_au = prompt_dl(song)\\n\\n except KeyboardInterrupt:\\n g.message = c.r + \\\"Download aborted!\\\" + c.w\\n g.content = generate_songlist_display()\\n return\\n\\n if not url or ext_au == \\\"abort\\\":\\n # abort on invalid stream selection\\n g.content = generate_songlist_display()\\n g.message = \\\"%sNo download selected / invalid input%s\\\" % (c.y, c.w)\\n return\\n\\n else:\\n # download user selected stream(s)\\n filename = _make_fname(song, ext)\\n args = (song, filename, url)\\n\\n if url_au and ext_au:\\n # downloading video and audio stream for muxing\\n audio = False\\n filename_au = _make_fname(song, ext_au)\\n args_au = (song, filename_au, url_au)\\n\\n else:\\n audio = ext in (\\\"m4a\\\", \\\"ogg\\\")\\n\\n kwargs = dict(audio=audio)\\n\\n elif best:\\n # set updownload without prompt\\n url_au = None\\n av = \\\"audio\\\" if dltype.startswith(\\\"da\\\") else \\\"video\\\"\\n audio = av == \\\"audio\\\"\\n filename = _make_fname(song, None, av=av)\\n args = (song, filename)\\n kwargs = dict(url=None, audio=audio)\\n\\n try:\\n # perform download(s)\\n dl_filenames = [args[1]]\\n f = _download(*args, **kwargs)\\n if f:\\n g.message = \\\"Saved to \\\" + c.g + f + c.w\\n\\n if url_au:\\n dl_filenames += [args_au[1]]\\n _download(*args_au, allow_transcode=False, **kwargs)\\n\\n except KeyboardInterrupt:\\n g.message = c.r + \\\"Download halted!\\\" + c.w\\n\\n try:\\n for downloaded in dl_filenames:\\n os.remove(downloaded)\\n\\n except IOError:\\n pass\\n\\n if url_au:\\n # multiplex\\n mux_cmd = \\\"APP -i VIDEO -i AUDIO -c copy OUTPUT\\\".split()\\n mux_cmd = \\\"%s -i %s -i %s -c copy %s\\\"\\n mux_cmd = [g.muxapp, \\\"-i\\\", args[1], \\\"-i\\\", args_au[1], \\\"-c\\\",\\n \\\"copy\\\", args[1][:-3] + \\\"mp4\\\"]\\n\\n try:\\n subprocess.call(mux_cmd)\\n g.message = \\\"Saved to :\\\" + c.g + mux_cmd[7] + c.w\\n os.remove(args[1])\\n os.remove(args_au[1])\\n\\n except KeyboardInterrupt:\\n g.message = \\\"Audio/Video multiplex aborted!\\\"\\n\\n g.content = generate_songlist_display()\",\n \"async def video_url(cls, url, ytdl, *, loop=None, stream=False):\\n loop = loop or asyncio.get_event_loop()\\n data = await loop.run_in_executor(None, lambda: ytdl.extract_info(url, download=not stream))\\n song_list = {'queue': []}\\n if 'entries' in data:\\n if len(data['entries']) > 1:\\n playlist_titles = [title['title'] for title in data['entries']]\\n song_list = {'queue': playlist_titles}\\n song_list['queue'].pop(0)\\n\\n data = data['entries'][0]\\n\\n filename = data['url'] if stream else ytdl.prepare_filename(data)\\n return cls(discord.FFmpegPCMAudio(filename, **ffmpeg_options), data=data), song_list\",\n \"def download_all(self):\\r\\n download_path = os.path.join(self.download_path, self.username)\\r\\n already_downloaded = []\\r\\n successful_downloads = []\\r\\n failed_downloads = []\\r\\n if not os.path.exists(download_path):\\r\\n os.makedirs(download_path)\\r\\n elif not os.path.isdir(download_path):\\r\\n raise NotADirectoryError(\\\"Download path is not a directory: \\\" + download_path)\\r\\n elif self.skip_downloaded:\\r\\n for item in os.listdir(download_path):\\r\\n file_path = str(os.path.join(download_path, item))\\r\\n if os.path.isfile(file_path):\\r\\n parsed_file = self._parse_file_name(os.path.basename(file_path))\\r\\n if parsed_file is not None:\\r\\n already_downloaded.append(parsed_file[\\\"id\\\"])\\r\\n for index, item in enumerate(self.videos):\\r\\n # Don't download it if the user has set that option, and the tiktok already exists on the disk\\r\\n if item[\\\"id\\\"] in already_downloaded:\\r\\n logger.info(\\\"Already downloaded video with id: \\\" + item[\\\"id\\\"])\\r\\n continue\\r\\n file_name = self._format_file_name(item[\\\"createTime\\\"], item[\\\"id\\\"])\\r\\n file_path = os.path.join(download_path, file_name)\\r\\n logger.info(\\\"Downloading video: \\\" + file_name + \\\" (\\\" + str(index + 1) + \\\"/\\\" + str(len(self.videos)) + \\\")\\\")\\r\\n video_url = self._format_video_url(item)\\r\\n success = self.download_video(file_path, video_url, item[\\\"createTime\\\"])\\r\\n if success:\\r\\n successful_downloads.append(video_url)\\r\\n else:\\r\\n failed_downloads.append(video_url)\\r\\n sleep_time = random.uniform(self.sleep_min, self.sleep_max)\\r\\n logger.info(\\\"Sleeping for: \\\" + str(sleep_time) + \\\" seconds\\\")\\r\\n sleep(sleep_time)\\r\\n logger.info(\\\"Processed all {} videos\\\".format(self.video_count))\\r\\n logger.debug(\\\"Fallback counter: \\\" + str(self.fallback_counter))\\r\\n logger.debug(\\\"YouTube-dl DownloadError counter: \\\" + str(self.fallback_counter))\\r\\n logger.debug(\\\"Other error counter: \\\" + str(self.other_error_counter))\\r\\n return {\\\"successful_downloads\\\": successful_downloads,\\r\\n \\\"failed_downloads\\\": failed_downloads,\\r\\n \\\"skipped_downloads\\\": already_downloaded}\",\n \"def download_cdn_videos(filenames,sub_urls,handout_urls,video_urls, target_dir):\\n \\\"\\\"\\\" using a simple file downloader \\\"\\\"\\\"\\n for i, v in enumerate(video_urls):\\n filename_prefix = str(i+1).zfill(2) + '-'\\n #original_filename = v.rsplit('/', 1)[1]\\n video_filename = filename_prefix + filenames[i] + '.mp4'\\n sub_filename = filename_prefix + filenames[i] + '.srt'\\n handout_filename = filename_prefix + filenames[i] + '.srt'\\n video_path = os.path.join(target_dir, video_filename)\\n sub_path = os.path.join(target_dir, sub_filename)\\n handout_path = os.path.join(target_dir, handout_filename)\\n #print('[debug] GET %s' % v)\\n print('[download] Destination: %s' % video_path)\\n v = quote(v,safe=\\\":/\\\")\\n if len(v) != YOUTUBE_VIDEO_ID_LENGTH:\\n req = Request(v) \\n try:\\n video = urlopen(v)\\n fileSize = int(video.headers['content-length'])\\n finish = False\\n existSize = 0\\n if os.path.exists(video_path):\\n output = open(video_path,\\\"ab\\\")\\n existSize = os.path.getsize(video_path)\\n #If the file exists, then only download the remainder\\n if existSize < fileSize:\\n #print(\\\"[debug] bytes range is: %s-%s\\\" % (existSize,fileSize))\\n req.headers[\\\"Range\\\"]= \\\"bytes=%s-%s\\\" % (existSize,fileSize)\\n video = urlopen(req)\\n else:\\n finish = True\\n else:\\n output = open(video_path,\\\"wb\\\")\\n if finish == False:\\n file_size_dl = existSize\\n block_sz = 262144\\n while True:\\n buffer = video.read(block_sz)\\n if not buffer:\\n break\\n \\n file_size_dl += len(buffer)\\n output.write(buffer)\\n status = r\\\"%10d [%3.2f%%]\\\" % (file_size_dl, file_size_dl * 100. / fileSize)\\n status = status + chr(8)*(len(status)+1)\\n sys.stdout.write(status)\\n sys.stdout.flush()\\n \\n output.close()\\n\\n except URLError as e:\\n print(\\\"[warning]error: %r when downloading %s\\\" % (e.reason,v) )\\n\\n else:\\n download_youtube_video(v,video_path)\\n \\n if sub_urls[i] != \\\"\\\":\\n #print('[debug] GET %s' % BASE_URL+sub_urls[i])\\n if not os.path.exists(sub_path):\\n subs_string = edx_get_subtitle(sub_urls[i], headers)\\n if subs_string:\\n print('[info] Writing edX subtitles: %s' % sub_path)\\n open(os.path.join(os.getcwd(), sub_path),\\n 'wb+').write(subs_string.encode('utf-8'))\\n\\n if handout_urls[i] != \\\"\\\":\\n #print('[debug] GET %s' % BASE_URL+sub_urls[i])\\n if not os.path.exists(handout_path):\\n handout_content = urlopen(BASE_URL+handout_urls[i]).read()\\n if handout_content:\\n print('[info] Writing handout: %s' % handout_path)\\n open(os.path.join(os.getcwd(), handout_path),\\n 'wb+').write(handout_content)\\n #srtfile = urlopen(BASE_URL+sub_urls[i])\\n #output = open(srt_path,'wb')\\n #output.write(srtfile.read())\\n #output.close()\",\n \"async def get_youtube_video(self, ctx, *, query):\\n\\n if not query:\\n return await ctx.send(\\\"Go on, search something.\\\")\\n\\n # Executor for sync function\\n video_list = await self.bot.loop.run_in_executor(None, YouTube.sync_get_youtube_video, query)\\n\\n if not video_list:\\n return await ctx.say(f\\\"Sorry, couldn't find anything for `{query}`\\\")\\n\\n # Return top hit\\n await ctx.send(f'{video_list[0][\\\"video_url\\\"]}')\",\n \"def youtubefetch(url,outputp=''):\\n\\toutputpath = os.path.expanduser(outputp)\\n\\tif (os.path.exists(outputpath) & os.path.isdir(outputpath)) != True:\\n\\t\\toutputpath = '/tmp/'\\n\\t\\n\\t(_,_,urlproper) = url.partition(\\\"?\\\")\\n\\t(urlproper,_,_) = urlproper.partition(\\\"&\\\")\\n\\turlproper = \\\"http://proxy.cs.tcd.ie:8080/www.youtube.com/watch?\\\" + urlproper\\n\\tpage = urllib2.urlopen(url).readlines()\\n\\tfilteredpage = [ elem for elem in page if elem.find(\\\"fullscreenUrl\\\") != -1 ]\\n\\tif (len(filteredpage) == 0):\\n\\t\\treturn 'failed'\\n\\t\\t\\n\\tfilteredpage = filteredpage[0]\\n\\t(_, p1, partialurl) = filteredpage.partition(\\\"video_id=\\\")\\n\\t(partialurl , _, name) = partialurl.rpartition(\\\"&title=\\\")\\n\\t(name,_,_) = name.partition(\\\"'\\\")\\n\\tvideourl = \\\"http://www.youtube.com/get_video.php?\\\" + p1 + partialurl\\n\\tvideo = urllib2.urlopen(videourl).read()\\n\\t#print videourl\\n\\t#print name\\n\\toutputfile = open((outputpath+name+\\\".flv\\\"),'wb')\\n\\toutputfile.write(video)\\n\\toutputfile.flush()\\n\\toutputfile.close()\\n\\treturn outputpath+name+\\\".flv\\\"\",\n \"def yt_url(url, print_title=0):\\n try:\\n p = pafy.new(url)\\n\\n except (IOError, ValueError) as e:\\n g.message = c.r + str(e) + c.w\\n g.content = g.content or generate_songlist_display(zeromsg=g.message)\\n return\\n\\n g.browse_mode = \\\"normal\\\"\\n v = Video(p.videoid, p.title, p.length)\\n g.model.songs = [v]\\n\\n if not g.command_line:\\n g.content = generate_songlist_display()\\n\\n if print_title:\\n xprint(v.title)\",\n \"async def youtube(self, ctx, *, query):\\n url = f\\\"https://www.googleapis.com/youtube/v3/search?part=snippet&q={query}&type=video&maxResults=1&key={google_api_key}\\\"\\n response = requests.get(url)\\n try:\\n await ctx.send(\\n f\\\"https://www.youtube.com/watch?v={response.json()['items'][0]['id']['videoId']}\\\"\\n )\\n except IndexError:\\n await ctx.send(\\\"**No results for given query found.**\\\")\",\n \"def download_video_url(\\n video_url: str,\\n pipeline: PipelineContext,\\n destination=\\\"%(title)s.%(ext)s\\\",\\n progress=ProgressMonitor.NULL,\\n):\\n\\n config = pipeline.config\\n logger = logging.getLogger(__name__)\\n logger.info(\\\"Starting video download from URL: %s\\\", video_url)\\n\\n # Setup progress-tracking\\n progress.scale(total_work=1.0)\\n progress_tracker = YDLProgressTracker(show_progress_bar=True)\\n\\n # Resolve destination path template\\n output_template = complete_template(config.sources.root, destination)\\n logger.info(\\\"Output template: %s\\\", output_template)\\n\\n ydl_opts = {\\n \\\"format\\\": \\\"mp4\\\",\\n \\\"logger\\\": YDLLogger(logger),\\n \\\"progress_hooks\\\": [progress_tracker.hook],\\n \\\"outtmpl\\\": output_template,\\n }\\n\\n with youtube_dl.YoutubeDL(ydl_opts) as ydl:\\n # Determine destination file name\\n video_info = ydl.extract_info(video_url, download=False)\\n file_name = ydl.prepare_filename(video_info)\\n logger.info(\\\"Downloading file: %s\\\", file_name)\\n\\n # Download file\\n with progress_tracker.track(progress):\\n ydl.download([video_url])\\n\\n progress.complete()\\n return file_name\",\n \"def download_vid(vid_link, quality_num=None):\\r\\n if quality_num is not None:\\r\\n # if quality_num provided\\r\\n try:\\r\\n os.system(\\\"youtube-dl -f \\\"+str(quality_num)+\\\" \\\\'\\\"+str(vid_link)+\\\"\\\\'\\\")\\r\\n except Exception:\\r\\n print(Exception)\\r\\n else:\\r\\n # by default the best quality is downloaded\\r\\n try:\\r\\n os.system(\\\"youtube-dl \\\"+str(vid_link))\\r\\n except Exception:\\r\\n print(Exception)\",\n \"def url(yt_id: str) -> str:\\n return \\\"https://www.youtube.com/watch?v={}\\\".format(yt_id)\",\n \"def fetch_youtube_url(search_term, dev_key=None):\\r\\n in_cache, video_id = check_if_in_cache(search_term)\\r\\n if in_cache:\\r\\n return YOUTUBE_VIDEO_URL + video_id\\r\\n if not dev_key:\\r\\n YOUTUBE_SEARCH_BASE = \\\"https://www.youtube.com/results?search_query=\\\"\\r\\n try:\\r\\n response = requests.get(YOUTUBE_SEARCH_BASE + search_term).content\\r\\n html_response = html.fromstring(response)\\r\\n video = html_response.xpath(\\\"//a[contains(@class, 'yt-uix-tile-link')]/@href\\\")\\r\\n video_id = re.search(\\\"((\\\\?v=)[a-zA-Z0-9_-]{4,15})\\\", video[0]).group(0)[3:]\\r\\n log.debug(f\\\"Found video id {video_id} for search term {search_term}\\\")\\r\\n _ = save_to_cache(search_term=search_term, video_id=video_id)\\r\\n return YOUTUBE_VIDEO_URL + video_id\\r\\n except AttributeError as e:\\r\\n log.warning(f\\\"Could not find scrape details for {search_term}\\\")\\r\\n capture_exception(e)\\r\\n return None\\r\\n except IndexError as e:\\r\\n log.warning(f\\\"Could not perform scrape search for {search_term}, got a different HTML\\\")\\r\\n capture_exception(e)\\r\\n return None\\r\\n else:\\r\\n youtube = build(YOUTUBE_API_SERVICE_NAME, YOUTUBE_API_VERSION,\\r\\n developerKey=dev_key,\\r\\n cache_discovery=False)\\r\\n try:\\r\\n in_cache, video_id = check_if_in_cache(search_term)\\r\\n\\r\\n if not in_cache:\\r\\n search_response = youtube.search().list(q=search_term,\\r\\n part='id, snippet').execute()\\r\\n for v in search_response['items']:\\r\\n if v['id']['kind'] == VIDEO:\\r\\n video_id = v['id']['videoId']\\r\\n log.debug(f\\\"Adding Video id {video_id}\\\")\\r\\n _ = save_to_cache(search_term=search_term, video_id=video_id) \\r\\n return YOUTUBE_VIDEO_URL + video_id\\r\\n except HttpError as err:\\r\\n err_details = loads(err.content.decode('utf-8')).get('error').get('errors')\\r\\n secho(\\\"Couldn't complete search due to following errors: \\\", fg='red')\\r\\n for e in err_details:\\r\\n error_reason = e.get('reason')\\r\\n error_domain = e.get('domain')\\r\\n error_message = e.get('message')\\r\\n\\r\\n if error_reason == 'quotaExceeded' or error_reason == 'dailyLimitExceeded':\\r\\n secho(f\\\"\\\\tYou're over daily allowed quota. Unfortunately, YouTube restricts API keys to a max of 10,000 requests per day which translates to a maximum of 100 searches.\\\", fg='red')\\r\\n secho(f\\\"\\\\tThe quota will be reset at midnight Pacific Time (PT).\\\" ,fg='red')\\r\\n secho(f\\\"\\\\tYou can request for Quota increase from https://console.developers.google.com/apis/api/youtube.googleapis.com/quotas.\\\", fg='red')\\r\\n else:\\r\\n secho(f\\\"\\\\t Search failed due to {error_domain}:{error_reason}, message: {error_message}\\\")\\r\\n return None\",\n \"def download_video(video_url, output_path, output_name=\\\"\\\", default_type=\\\"mp4\\\", verbose=False):\\n try:\\n if \\\".\\\" not in output_name:\\n output_name = f\\\"{output_name}.{default_type}\\\"\\n output_path = os.path.join(output_path, output_name)\\n api_response = core.get_request_with_retries(video_url)\\n core_utils.print_if_verbose('Processing...', verbose)\\n f = open(output_path, 'wb')\\n for chunk in api_response.iter_content(chunk_size=255):\\n # filter out keep-alive new chunks\\n if chunk:\\n f.write(chunk)\\n core_utils.print_if_verbose(f'The video has been exported here: {output_path}', verbose)\\n f.close()\\n except Exception as exception_msg:\\n print(f\\\"The video could not be downloaded due to the following error: {exception_msg}\\\")\\n return\",\n \"def get_videos_urls(author):\\n\\tfoundAll = False\\n\\tind = 1\\n\\tvideos = []\\n\\twhile not foundAll:\\n\\t inp = urllib.urlopen(r'http://gdata.youtube.com/feeds/api/videos?start-index={0}&max-results=50&alt=json&orderby=published&author={1}'.format( ind, author ) )\\n\\t try:\\n\\t resp = json.load(inp)\\n\\t inp.close()\\n\\t returnedVideos = resp['feed']['entry']\\n\\t for video in returnedVideos:\\n\\t videos.append( video['link'][0]['href'] ) \\n\\n\\t ind += 50\\n\\t if ( len( returnedVideos ) < 50 ):\\n\\t foundAll = True\\n\\t except:\\n\\t #catch the case where the number of videos in the channel is a multiple of 50\\n\\t print \\\"error\\\"\\n\\t foundAll = True\\n\\n\\treturn videos\",\n \"def download_audio_from_youtube(youtube_link: str):\\r\\n with st.spinner(\\\"Extracting audio from Youtube...\\\"):\\r\\n try:\\r\\n a = pytube.YouTube(youtube_link).streams.first().download('files/','video_for_audio') # Download video from youtube\\r\\n b = ffmpg.ffmpeg_extract_audio('files/video_for_audio.mp4','files/audio.mp3') # extract sound and save as mp3\\r\\n os.remove('files/video_for_audio.mp4') # remove unecessary video\\r\\n # Release the process from the downloaded files\\r\\n del a, b\\r\\n st.success(\\\"Sound was extracted successfully from the youtube video!\\\")\\r\\n except:\\r\\n st.error(\\\"Unexpected error has occured, please try again!\\\")\",\n \"def get_youtube_video_url(video_id):\\n url = \\\"https://www.youtube.com/watch?v=\\\" + video_id\\n return url\",\n \"def download_songs(playlist_url):\\n command_string = 'youtube-dl -x --audio-format wav --postprocessor-args \\\"-ar 44100 -ac 1\\\" --output \\\"Songs/%(' \\\\\\n 'title)s_%(id)s.%(ext)s\\\" ' + \\\\\\n playlist_url\\n args = shlex.split(command_string)\\n subprocess.call(args)\",\n \"def download(video_identifier,\\n output_filename,\\n num_attempts=5,\\n url_base='https://www.youtube.com/watch?v='):\\n # Defensive argument checking.\\n assert isinstance(video_identifier, str), 'video_identifier must be string'\\n assert isinstance(output_filename, str), 'output_filename must be string'\\n assert len(video_identifier) == 11, 'video_identifier must have length 11'\\n\\n status = False\\n\\n if not os.path.exists(output_filename):\\n command = [\\n 'youtube-dl', '--quiet', '--no-warnings', '--no-check-certificate',\\n '-f', 'mp4', '-o',\\n '\\\"%s\\\"' % output_filename,\\n '\\\"%s\\\"' % (url_base + video_identifier)\\n ]\\n command = ' '.join(command)\\n print(command)\\n attempts = 0\\n while True:\\n try:\\n subprocess.check_output(\\n command, shell=True, stderr=subprocess.STDOUT)\\n except subprocess.CalledProcessError:\\n attempts += 1\\n if attempts == num_attempts:\\n return status, 'Fail'\\n else:\\n break\\n # Check if the video was successfully saved.\\n status = os.path.exists(output_filename)\\n return status, 'Downloaded'\",\n \"async def youtube(self, ctx, *, query):\\r\\n\\r\\n utub = 'https://youtube.com/results?search_query='\\r\\n url = utub + query.replace(\\\" \\\", \\\"+\\\")\\r\\n r = requests.get(url).text\\r\\n num1 = r.find('{\\\"videoRenderer')\\r\\n num2 = r.find('{\\\"videoRenderer', num1+1)\\r\\n # print (num1)\\r\\n # print (num2)\\r\\n videoRenderer = (json.loads(r[num1:num2-1])[\\\"videoRenderer\\\"])\\r\\n vid = (videoRenderer[\\\"videoId\\\"])\\r\\n page = (\\\"https://youtube.com/watch?v=\\\" + vid)\\r\\n await ctx.send(page)\",\n \"def test_task_video_download(url_to_video: str, empty_video_resource: VideoResource):\\n download_video(url_to_video, empty_video_resource.id)\\n empty_video_resource.refresh_from_db()\\n video_instance = empty_video_resource.videos.filter(primary=True).first()\\n\\n assert empty_video_resource.videos.all()\\n assert video_instance.extension == 'mp4'\\n assert video_instance.primary\\n for item in video_instance.video.open():\\n assert item\",\n \"def youtube_cmd(ctx, cmd, arg):\\n\\t\\turl = \\\"http://gdata.youtube.com/feeds/api/videos?q=%s&max-results=3&v=2\\\" % urllib.parse.quote(arg)\\n\\t\\tr = urllib.request.urlopen(url)\\n\\t\\tr = dom.parse(r)\\n\\t\\t\\t\\n\\t\\tresults = int(r.getElementsByTagName(\\\"openSearch:totalResults\\\")[0].firstChild.data)\\n\\n\\t\\tif results > 0:\\n\\t\\t\\tres = min(results, 3)\\n\\t\\t\\tctx.reply(\\\"Results 1-%d out of %s\\\" % (res, prettyNumber(results)), \\\"YouTube\\\")\\n\\t\\telse:\\n\\t\\t\\tctx.reply(\\\"No results found for %s\\\" % arg, \\\"YouTube\\\")\\n\\n\\t\\tfor i in r.getElementsByTagName(\\\"entry\\\"):\\n\\t\\t\\tvid = i.getElementsByTagName(\\\"id\\\")[0].firstChild.data\\n\\t\\t\\tvid = vid.split(\\\":\\\")[-1]\\n\\n\\t\\t\\tdisplayMeta(ctx, i, vid)\",\n \"def do_downloads(filename1=\\\"og\\\", filename2=\\\"lyrical\\\", video_id=DEFALT_VIDEO_ID):\\n original_video_url = youtube_id_to_url(video_id)\\n download_from_url(original_video_url, filename1)\\n lyrics_video_url = get_lyrics_url(original_video_url)\\n download_from_url(lyrics_video_url, filename2)\\n\\n return filename1, filename2\",\n \"def download_videos(blink, save_dir=\\\"/media\\\"):\\n blink.download_videos(save_dir, since=get_date())\",\n \"def get_videos(url):\\n videos = []\\n if 'cinebix.com' in url:\\n resolve_media(url,videos)\\n return videos\\n \\n html = requests.get(url, headers=mozhdr).text\\n mlink = SoupStrainer('div', {'class':re.compile('^singcont')})\\n videoclass = BeautifulSoup(html, parseOnlyThese=mlink)\\n try:\\n links = videoclass.findAll('iframe')\\n for link in links:\\n url = link.get('src')\\n resolve_media(url,videos)\\n except:\\n pass\\n\\n mlink = SoupStrainer('div', {'class':'entry-excerpt'})\\n videoclass = BeautifulSoup(html, parseOnlyThese=mlink)\\n try:\\n links = videoclass.findAll('iframe')\\n for link in links:\\n if 'http' in str(link):\\n url = link.get('src')\\n resolve_media(url,videos)\\n except:\\n pass\\n\\n try:\\n url = videoclass.p.a.get('href')\\n resolve_media(url,videos)\\n except:\\n pass \\n \\n return videos\",\n \"def download_course_given(self, course_url: str):\\n self.course_url = course_url\\n self.get_course_page()\\n self.get_course_title()\\n self.get_course_unit_titles()\\n self.get_course_unit_slugs()\\n self.get_course_unit_urls()\\n\\n print(\\\"\\\\nGenerating Path Slugs...\\\\n\\\")\\n self.get_course_all_slugs()\\n self.get_course_youtube_ids()\\n self.download_course_videos()\",\n \"def query_youtube(movie_title):\\n #convert movie_title to “percent-encoded” string, then open search\\n query_string = urllib.urlencode({\\\"search_query\\\" : movie_title + \\\" trailer\\\"})\\n html_content = urllib.urlopen(\\\"http://www.youtube.com/results?\\\" +\\n query_string)\\n #use regular expressions to find all 11 character videos IDs\\n query_results = re.findall(r'href=\\\\\\\"\\\\/watch\\\\?v=(.{11})',\\n html_content.read())\\n return \\\"http://www.youtube.com/watch?v=\\\" + query_results[0]\",\n \"def get_yt_video_id(url):\\n\\n from urlparse import urlparse, parse_qs\\n\\n if url.startswith(('youtu', 'www')):\\n url = 'http://' + url\\n\\n query = urlparse(url)\\n\\n if 'youtube' in query.hostname:\\n if query.path == '/watch':\\n return parse_qs(query.query)['v'][0]\\n elif query.path.startswith(('/embed/', '/v/')):\\n return query.path.split('/')[2]\\n elif 'youtu.be' in query.hostname:\\n return query.path[1:]\\n else:\\n raise ValueError\",\n \"def extract_url_download(update: Update, context: CallbackContext) -> None:\\r\\n received_text = update.message.text\\r\\n yt_urls = get_link_text(received_text)\\r\\n yt_urls_msg = update.message.reply_text(pretty_url_string(yt_urls), disable_web_page_preview=True)\\r\\n if len(yt_urls) > 0:\\r\\n for url in yt_urls:\\r\\n if 'list=' in url:\\r\\n print(\\\"dshgshj\\\")\\r\\n\\t\\t\\t\\t# download_playlist_url(update, context, url)\\r\\n else:\\r\\n download_url(update, context, url)\\r\\n context.bot.delete_message(message_id=yt_urls_msg.message_id, chat_id=yt_urls_msg.chat_id)\",\n \"def dl_url(url):\\n g.browse_mode = \\\"normal\\\"\\n yt_url(url)\\n\\n if len(g.model.songs) == 1:\\n download(\\\"download\\\", \\\"1\\\")\\n\\n if g.command_line:\\n sys.exit()\",\n \"def download(pattern):\\n query = pattern.lower()\\n videolist = getvideolist()\\n filename = []\\n for video in videolist:\\n for value in video.values():\\n if query in str(value).lower():\\n filename.append(video[\\\"file\\\"])\\n if filename:\\n for name in filename:\\n downloadvideo(name)\\n else:\\n safeprint(\\\"No video matching the given query was found.\\\")\",\n \"def start(self):\\n if not path.exists(self.dir):\\n mkdir(self.dir)\\n\\n try:\\n yt = YouTube(self.link)\\n ys = yt.streams\\n if self.aud == True:\\n ysf = ys.get_audio_only()\\n elif self.aud == False:\\n ysf = ys.get_by_resolution(resolution=self.res)\\n ysf.download(self.dir)\\n except AttributeError:\\n raise Exception(f\\\"Resolution [{self.res}] is not available for this video\\\")\\n except excep.RegexMatchError:\\n raise Exception(\\\"Invalid link!\\\")\\n except excep.VideoPrivate:\\n raise Exception(\\\"This video is private! Try with a public one\\\")\\n except excep.PytubeError:\\n raise Exception(\\\"Error occured!\\\")\\n except excep.VideoPrivate:\\n raise Exception(\\\"This video is private! Try with a public one\\\")\\n except excep.VideoUnavailable:\\n raise Exception(\\\"This video is unvailable!\\\")\\n except excep.ExtractError:\\n raise Exception(\\\"Error in extractiong the video!\\\")\\n except Exception:\\n raise Exception(\\\"Error occured. Make sure of your connection ;)\\\")\",\n \"def _download_from_url(self, url):\\n target_file_name = self.dir + \\\"/\\\" + url.split('/')[-1].split('?')[0]\\n urllib.urlretrieve (url, target_file_name)\",\n \"def get_course_youtube_ids(self):\\n\\n with ProgressBar() as pb:\\n for i, unit_url in zip(\\n pb(range(len(self.course_unit_urls)), label=\\\"Collecting Youtube IDs:\\\"),\\n self.course_unit_urls,\\n ):\\n unit_url = ROOT_URL + unit_url\\n yt_dlp_opts = {\\n \\\"logger\\\": MyLogger(),\\n \\\"retries\\\": 20,\\n \\\"ignoreerrors:\\\": True,\\n \\\"skip_download\\\": True,\\n }\\n with yt_dlp.YoutubeDL(yt_dlp_opts) as ydl:\\n lessons_counter = 0\\n try:\\n logging.debug(\\n \\\"Collecting youtube ids for unit:{}\\\".format(unit_url)\\n )\\n info_dict = ydl.extract_info(unit_url, download=False)\\n for video in info_dict[\\\"entries\\\"]:\\n video_id = video.get(\\\"id\\\", None)\\n self.lesson_youtube_ids.append(video_id)\\n lessons_counter += 1\\n except DownloadError as e:\\n logging.debug(\\n \\\"Collecting youtube ids for unit:{}\\\".format(unit_url)\\n )\\n info_dict = ydl.extract_info(\\n unit_url, download=False, process=False\\n )\\n for video in info_dict[\\\"entries\\\"]:\\n video_id = video.get(\\\"url\\\", None)\\n self.lesson_youtube_ids.append(video_id)\\n lessons_counter += 1\\n except Exception as e:\\n print(\\\"Youtube-dl: An error occured!\\\", e)\\n sys.exit(1)\\n\\n self.unit_ids_counter[unit_url] = lessons_counter\\n\\n logging.info(\\\"Course - Collected Youtube IDs\\\")\",\n \"def get_videos(channel_name, CLIENT_SECRETS_FILE):\\r\\n\\r\\n video_list = []\\r\\n\\r\\n MISSING_CLIENT_SECRETS_MESSAGE = \\\"WARNING: Please configure OAuth 2.0\\\"\\r\\n\\r\\n YOUTUBE_READONLY_SCOPE = \\\"https://www.googleapis.com/auth/youtube.readonly\\\"\\r\\n YOUTUBE_API_SERVICE_NAME = \\\"youtube\\\"\\r\\n YOUTUBE_API_VERSION = \\\"v3\\\"\\r\\n\\r\\n flow = flow_from_clientsecrets(CLIENT_SECRETS_FILE,\\r\\n message=MISSING_CLIENT_SECRETS_MESSAGE,\\r\\n scope=YOUTUBE_READONLY_SCOPE)\\r\\n\\r\\n storage = Storage(\\\"%s-oauth2.json\\\" % sys.argv[0])\\r\\n credentials = storage.get()\\r\\n\\r\\n if credentials is None or credentials.invalid:\\r\\n flags = argparser.parse_args()\\r\\n credentials = run_flow(flow, storage, flags)\\r\\n\\r\\n youtube = build(YOUTUBE_API_SERVICE_NAME, YOUTUBE_API_VERSION,\\r\\n http=credentials.authorize(httplib2.Http()))\\r\\n\\r\\n # Retrieve the contentDetails part of the channel resource for the\\r\\n # authenticated user's channel.\\r\\n channels_response = youtube.channels().list(\\r\\n forUsername=channel_name,\\r\\n part=\\\"contentDetails\\\"\\r\\n ).execute()\\r\\n\\r\\n for channel in channels_response[\\\"items\\\"]:\\r\\n # From the API response, extract the playlist ID that identifies the list\\r\\n # of videos uploaded to the authenticated user's channel.\\r\\n uploads_list_id = channel[\\\"contentDetails\\\"][\\\"relatedPlaylists\\\"][\\\"uploads\\\"]\\r\\n\\r\\n # Retrieve the list of videos uploaded to the authenticated user's channel.\\r\\n playlistitems_list_request = youtube.playlistItems().list(\\r\\n playlistId=uploads_list_id,\\r\\n part=\\\"snippet\\\",\\r\\n maxResults=50\\r\\n )\\r\\n\\r\\n while playlistitems_list_request:\\r\\n playlistitems_list_response = playlistitems_list_request.execute()\\r\\n\\r\\n # Print information about each video.\\r\\n for playlist_item in playlistitems_list_response[\\\"items\\\"]:\\r\\n title = playlist_item[\\\"snippet\\\"][\\\"title\\\"]\\r\\n video_id = playlist_item[\\\"snippet\\\"][\\\"resourceId\\\"][\\\"videoId\\\"]\\r\\n video_list.append((title, video_id, 'https://img.youtube.com/vi/' + video_id + '/0.jpg'))\\r\\n\\r\\n playlistitems_list_request = youtube.playlistItems().list_next(\\r\\n playlistitems_list_request, playlistitems_list_response)\\r\\n\\r\\n return(video_list)\",\n \"def import_youtube_data(_youtube_url):\\n result = list()\\n\\n for i in range(3):\\n response = get_verified_response(_youtube_url + '&page={}'.format(i)) # Get server response from url request\\n if response is None:\\n continue\\n # print(response.data)\\n soup = BeautifulSoup(response.data, 'html.parser')\\n for vid in soup.findAll('a', attrs={'class': 'yt-uix-tile-link'}): # Find all <a> tags on page\\n result.append('https://www.youtube.com' + vid['href']) # Extracting web links using 'href' property\\n\\n print('Length before filter: {}'.format(len(result)))\\n result = filter_watch_only(result)\\n result = filter_thumbnail_only(result)\\n print('Length after filter: {}'.format(len(result)))\\n return result\",\n \"def get_all_playlist_videos( playlistURL ):\\r\\n \\r\\n request = youtube.playlistItems().list(\\r\\n part=\\\"contentDetails,id,snippet\\\",\\r\\n maxResults=50,\\r\\n playlistId=\\\"PLxgoClQQBFjgTMrhvedWk8Q_CVLWwy3ak\\\"\\r\\n )\\r\\n response = request.execute()\",\n \"def download_urls(urls_filename, reverse=True, log_filename='youtube-playlist-download.log'):\\n urls_file = open(urls_filename)\\n url_lines = urls_file.read().splitlines();\\n urls_file.close()\\n if reverse:\\n url_lines = reversed(url_lines)\\n\\n logfile = open(log_filename, 'w')\\n logfile.write('\\\\n' + str(datetime.now()) + '\\\\n')\\n logfile.flush()\\n\\n # use -f best to avoid merging and just get the best overall format (saves time)\\n youtube_cmd_with_args = ['youtube-dl', '--ignore-errors', '--ignore-config', '--write-info-json', '--no-mtime', '-f best', '-o ' + get_full_filename()]\\n\\n try:\\n for line in url_lines:\\n url_id, title = line.split('\\\\t')[:2]\\n print('Downloading video: \\\"' + title + '\\\" with id \\\"' + url_id + '\\\"')\\n run(youtube_cmd_with_args + [YT_PREFIX + url_id])\\n print('Done downloading url:', url_id)\\n notify('Done downloading url:' + url_id)\\n logfile.write('Downloaded\\\\t' + url_id + '\\\\t' + title + '\\\\n')\\n logfile.flush()\\n except KeyboardInterrupt as e:\\n print(\\\"Exiting\\\")\\n logfile.close()\\n\\n logfile.close()\",\n \"def _get_video_from_html(self, results_page, verbose=False):\\n d = json.loads(results_page.text)\\n for record in d['data']['records']:\\n video_url = record['videoUrl']\\n if verbose:\\n print \\\"Video url: \\\" + video_url\\n self._download_from_url(video_url)\",\n \"def download_whole(no_interval):\\n print(os.getcwd())\\n SAVE_PATH = 'tmp'\\n ydl_opts = {\\\"nocheckcertificate\\\": True, \\\"noplaylist\\\": True,\\n 'outtmpl': f'{SAVE_PATH}/%(title)s.%(ext)s'}\\n\\n with youtube_dl.YoutubeDL(ydl_opts) as ydl:\\n for video in range(len(no_interval)):\\n try:\\n ydl.download([no_interval[video]])\\n except youtube_dl.utils.ExtractorError or youtube_dl.utils.DownloadError:\\n print(f\\\"Couldn't download {no_interval[video]}\\\")\\n continue\",\n \"def extract_units(url, headers):\\n _print(\\\"Processing '%s'...\\\" % url)\\n page = get_page_contents(url, headers)\\n\\n re_splitter = re.compile(r'data-streams=(?:"|\\\").*1.0[0]*:')\\n re_subs = re.compile(r'data-transcript-translation-url=(?:"|\\\")([^\\\"&]*)(?:"|\\\")')\\n re_available_subs = re.compile(r'data-transcript-available-translations-url=(?:"|\\\")([^\\\"&]*)(?:"|\\\")')\\n re_units = re_splitter.split(page)[1:]\\n units = []\\n for unit_html in re_units:\\n video_id = unit_html[:YOUTUBE_VIDEO_ID_LENGTH]\\n sub_urls = {}\\n match_subs = re_subs.search(unit_html)\\n if match_subs:\\n match_available_subs = re_available_subs.search(unit_html)\\n if match_available_subs:\\n available_subs_url = BASE_URL + match_available_subs.group(1)\\n try:\\n available_subs = get_page_contents_as_json(available_subs_url, headers)\\n except HTTPError:\\n available_subs = ['en']\\n\\n for sub_prefix in available_subs:\\n sub_urls[sub_prefix] = BASE_URL + match_subs.group(1) + \\\"/\\\" + sub_prefix + \\\"?videoId=\\\" + video_id\\n\\n video_youtube_url = 'https://youtube.com/watch?v=' + video_id\\n units.append(Unit(video_youtube_url=video_youtube_url,\\n sub_urls=sub_urls))\\n\\n # Try to download some extra videos which is referred by iframe\\n re_extra_youtube = re.compile(r'//w{0,3}\\\\.youtube.com/embed/([^ \\\\?&]*)[\\\\?& ]')\\n extra_ids = re_extra_youtube.findall(page)\\n for extra_id in extra_ids:\\n video_youtube_url = 'https://youtube.com/watch?v=' + extra_id[:YOUTUBE_VIDEO_ID_LENGTH]\\n units.append(Unit(video_youtube_url=video_youtube_url))\\n\\n return units\",\n \"async def download_video(event):\\n url = event.pattern_match.group(1)\\n rmsg = await event.get_reply_message()\\n if not url and rmsg:\\n myString = rmsg.text\\n url = re.search(\\\"(?P<url>https?://[^\\\\s]+)\\\", myString).group(\\\"url\\\")\\n if not url:\\n return await edit_or_reply(event, \\\"What I am Supposed to find? Give link\\\")\\n codevent = await edit_or_reply(event, \\\"`Preparing to download...`\\\")\\n reply_to_id = await reply_id(event)\\n ytdl_data = await ytdl_down(codevent, video_opts, url)\\n if ytdl_down is None:\\n return\\n f = pathlib.Path(f\\\"{ytdl_data['title']}.mp4\\\".replace(\\\"|\\\", \\\"_\\\"))\\n codthumb = pathlib.Path(f\\\"{ytdl_data['title']}.jpg\\\".replace(\\\"|\\\", \\\"_\\\"))\\n if not os.path.exists(codthumb):\\n codthumb = pathlib.Path(f\\\"{ytdl_data['title']}.webp\\\".replace(\\\"|\\\", \\\"_\\\"))\\n if not os.path.exists(codthumb):\\n codthumb = None\\n await codevent.edit(\\n f\\\"`Preparing to upload video:`\\\\\\n \\\\n**{ytdl_data['title']}**\\\\\\n \\\\nby *{ytdl_data['uploader']}*\\\"\\n )\\n ul = io.open(f, \\\"rb\\\")\\n c_time = time.time()\\n attributes, mime_type = await fix_attributes(f, ytdl_data, supports_streaming=True)\\n uploaded = await event.client.fast_upload_file(\\n file=ul,\\n progress_callback=lambda d, t: asyncio.get_event_loop().create_task(\\n progress(d, t, codevent, c_time, \\\"upload\\\", file_name=f)\\n ),\\n )\\n ul.close()\\n media = types.InputMediaUploadedDocument(\\n file=uploaded,\\n mime_type=mime_type,\\n attributes=attributes,\\n thumb=await event.client.upload_file(codthumb) if codthumb else None,\\n )\\n await event.client.send_file(\\n event.chat_id,\\n file=media,\\n reply_to=reply_to_id,\\n caption=ytdl_data[\\\"title\\\"],\\n )\\n os.remove(f)\\n if codthumb:\\n os.remove(codthumb)\\n await event.delete()\",\n \"async def download(self, ctx, *, song):\\n try:\\n with youtube_dl.YoutubeDL(ytdl_download_format_options) as ydl:\\n if \\\"https://www.youtube.com/\\\" in song:\\n download = ydl.extract_info(song, True)\\n else:\\n infosearched = ydl.extract_info(\\n \\\"ytsearch:\\\"+song, False)\\n download = ydl.extract_info(\\n infosearched['entries'][0]['webpage_url'], True)\\n filename = ydl.prepare_filename(download)\\n embed = discord.Embed(\\n title=\\\"Your download is ready\\\", description=\\\"Please wait a moment while the file is beeing uploaded\\\")\\n await ctx.send(embed=embed, delete_after=30)\\n await ctx.send(file=discord.File(filename))\\n os.remove(filename)\\n except (youtube_dl.utils.ExtractorError, youtube_dl.utils.DownloadError):\\n embed = discord.Embed(title=\\\"Song couldn't be downloaded\\\", description=(\\\"Song:\\\"+song))\\n await ctx.send(embed=embed)\",\n \"def download_all_videos(self, dl_limit=10):\\r\\n counter = dl_limit\\r\\n self.video_link_title_keylist = self.video_link_title_dict.keys()\\r\\n music = []\\r\\n for title in self.video_link_title_keylist:\\r\\n try:\\r\\n title = title.encode('ascii')\\r\\n # print 'downloading title with counter: ', counter\\r\\n if not counter:\\r\\n return random.choice(music) #some margin for randomness, first result isnt always accurate, (gets slower...)\\r\\n print 'downloading title: ', title\\r\\n\\r\\n self.add_result(\\\"Dowloaded_Song\\\", title)\\r\\n\\r\\n path = self.download_video(self.video_link_title_dict[title], title)\\r\\n music.append(path)\\r\\n counter = counter - 1\\r\\n except:\\r\\n print \\\"illegal characters in youtube name\\\" + title + \\\"\\\\n trying next result\\\"\",\n \"async def video(ctx, message):\\n \\\"\\\"\\\":param: ctx\\\"\\\"\\\"\\n \\\"\\\"\\\":param: message\\\"\\\"\\\"\\n \\\"\\\"\\\"return video url\\\"\\\"\\\"\\n link_list = []\\n print ('Searching YouTube for: %s' % message)\\n url = \\\"https://www.youtube.com/results?search_query=\\\" + message\\n response = urlopen(url)\\n html = response.read()\\n soup = BeautifulSoup(html, \\\"lxml\\\")\\n for vid in soup.findAll(attrs={'class': 'yt-uix-tile-link'}):\\n link_list.append('https://www.youtube.com' + vid['href'])\\n if(len(link_list) >=1):\\n random_num = random.randint(0, len(link_list) - 1)\\n await bot.say(link_list[random_num])\\n else:\\n await bot.say(\\\"there is no contente for \\\"+message)\",\n \"def download_mp3(url, destination=\\\"./\\\"):\\n options = {}\\n task_status = {}\\n\\n def progress_hook(status):\\n task_status.update(status)\\n\\n options.update(_YOUTUBEDL_OPTS_)\\n options[\\\"progress_hooks\\\"] = [progress_hook]\\n options[\\\"outtmpl\\\"] = os.path.join(destination, \\\"%(title)s.%(ext)s\\\")\\n with youtube_dl.YoutubeDL(options) as youtube:\\n youtube.download([url])\\n filename = task_status[\\\"filename\\\"]\\n # BUG: filename extension is wrong, it must be mp3\\n filename = filename[: filename.rindex(\\\".\\\") + 1]\\n return filename + options[\\\"postprocessors\\\"][0][\\\"preferredcodec\\\"]\",\n \"def getDownload(self, html, episode_number):\\n soup = BeautifulSoup(html, \\\"html.parser\\\")\\n download = soup.find_all('source')\\n if download:\\n self.downloads[\\\"Episode %s.mp4\\\" % str(episode_number)] = download[0]['src']\\n return\\n\\n print(\\\"[!] Download link not found for episode %s\\\" % str(episode_number))\",\n \"def __init__(self, url, params=None):\\n super(YoutubeVideo, self).__init__(url, params)\\n self.video_id = self.get_video_id()\",\n \"def _get_youtube_data_url(self):\\n # Need to put a check because in some cases the URL is already passed\\n # by the playlist extractor.\\n if self.title == \\\"\\\":\\n self.title = get_youtube_title(self.URL)\\n self.stream_url = grab_link(self.URL)\",\n \"def download_by_link(link: str, videoid: str) -> [str, str]:\\n\\t# set youtube_dl arguments \\n\\tydl_opts = {\\n\\t\\t'quiet': False, # don't write in output\\n\\t\\t'no_warnings': True, # write warnings in output\\n\\t\\t'format': \\\"bestaudio/best\\\", # download best audio quality\\n\\t\\t'format': 'mp4', # setup format webm\\n\\t\\t'outtmpl': '%(name)s' + str(videoid) + '.%(ext)s', # setup output name \\n\\t\\t'postprocessor': [{ # dk how this need work, but if this not setup audio didn't download\\n\\t\\t\\t'key': \\\"FFmpegExtractAudioPP\\\",\\n\\t\\t\\t'preferredquality': \\\"512\\\",\\n\\t\\t }],\\n\\t}\\n\\t# start download audio\\n\\twith youtube_dl.YoutubeDL(ydl_opts) as ydl:\\n\\t\\tdata = ydl.extract_info(link) # exctrat info about audio\\n\\tfake_name = \\\"NA\\\" + str(videoid)\\n\\t# TODO: think about this query \\n\\t# refactoring title \\n\\ttitle = data.pop('title')\\n\\ttitle = re.sub(r'[^\\\\w]', ' ', title)\\n\\ttitle = translate(title)\\n\\ttitle = title.replace(' ', '_')\\n\\treturn fake_name, title\",\n \"def add_videos(playlist):\\n surl = playlist['link']\\n # 작은 playlist의 url을 surl에 저장\\n soup = get_soup(surl)\\n # 작은 플레이리스트의 html 파싱하여 soup에 저장\\n print(f\\\" getting videos for playlist: {playlist['title']}\\\")\\n\\n videos = []\\n\\n # items are list of video a links from list\\n items = soup('a', class_='yt-uix-tile-link')\\n # a 태그의 class가 'yt-uix-tile-link'인 태그 items에 저장\\n # items는 작은 플레이리스트의 동영상 목록들임\\n\\n # note first part of look get info from playlist page item,\\n # and the the last part opens the video and gets more details\\n if len(items) > 0:\\n for i in items:\\n # 각각의 items i에 하나씩 저장\\n d = dict()\\n vurl = fix_url(i['href'])\\n # 동영상 url을 vurl에 저장\\n t = i.find_next('span', {'aria-label': True})\\n # 동영상의 span 태그 중 aria=label값이 존재하는 것 t에 저장\\n # t는 동영상의 재생 시간임\\n d['time'] = t.text if t else 'NA'\\n # d 딕셔너리에 t저장\\n\\n d.update(parse_video(vurl))\\n videos.append(d)\\n # videos에 d를 append\\n\\n else: # must be only one video\\n d = {'time': 'NA'}\\n d.update(parse_video(surl))\\n videos.append(d)\\n\\n # add new key to this playlist of list of video infos\\n playlist['videos'] = videos\\n print()\",\n \"def sync_get_youtube_video(query):\\n return yt.get_video_info(query, num_results=1)\",\n \"def get_video_info(url):\\n ydl = youtube_dl.YoutubeDL()\\n ydl.add_default_info_extractors()\\n\\n try:\\n return ydl.extract_info(url, download=False)\\n except youtube_dl.DownloadError:\\n return None\",\n \"def get_yt_link(self, video_id, url=None, skip_errors=False):\\n if self._settings.enable_yt_dl and url:\\n if not self._yt_dl:\\n self._yt_dl = YouTubeDL.get_instance(self._settings, self._callback)\\n if not self._yt_dl:\\n raise YouTubeException(\\\"yt-dlp initialization error.\\\")\\n return self._yt_dl.get_yt_link(url, skip_errors)\\n\\n return self.get_yt_link_by_id(video_id)\",\n \"def downloadvideo(filename):\\n url = \\\"http://openings.moe/video/\\\" + filename\\n f = getfile(url)\\n safeprint(Colors.PURPLE + url + Colors.END + \\\":\\\\nSaving to --> \\\" + Colors.YELLOW + filename + Colors.END)\\n with open(os.path.basename(url), \\\"wb\\\") as local_file:\\n try:\\n local_file.write(f.read())\\n except IOError as e:\\n safeprint(\\\"An error occurred while saving the file, try again. \\\" + str(e))\",\n \"def movieid_first_video_url(self, movie_id):\\n YOUTUBE_URL = \\\"https://www.youtube.com/watch?v=\\\"\\n VIDEOS_URL = \\\"https://api.themoviedb.org/3/movie/%s/videos\\\"\\n url_with_movieid = VIDEOS_URL % (movie_id)\\n parm_dict = {\\\"api_key\\\": self.api_key, \\\"language\\\": self.language}\\n url = url_with_movieid + \\\"?\\\" + urlencode(parm_dict, doseq=True)\\n # print url\\n\\n response = requests.get(url)\\n json_dict = json.loads(response.text)\\n response.close()\\n\\n youtube_video_key = json_dict['results'][0]['key']\\n return YOUTUBE_URL + youtube_video_key\",\n \"def soup_process_video(input_url):\\r\\n # scrape the url\\r\\n fp = urllib.request.urlopen(input_url)\\r\\n #read bytes\\r\\n mybytes = fp.read()\\r\\n mystr = mybytes.decode(\\\"utf8\\\")\\r\\n fp.close()\\r\\n soup = BeautifulSoup(mystr,'html.parser')\\r\\n return (soup.find(\\\"a\\\", {'class': \\\"download-btn\\\"}).get('href'))\",\n \"def get_youtube_url(search_term):\\n position = 1\\n while True:\\n try:\\n info_dict = get_ydl_dict(search_term, position)\\n if dict_is_song(info_dict):\\n break\\n except Exception as e:\\n logger.error(\\n \\\"Error extracting youtube search %s, position %s : %s.\\\",\\n search_term,\\n position,\\n e,\\n )\\n if position > 4:\\n # Too many wrong results\\n return None\\n position += 1\\n return info_dict[\\\"webpage_url\\\"]\",\n \"def play_trailer(self):\\n webbrowser.open(self.youtube_trailer_url)\",\n \"def external_download(song, filename, url):\\n cmd = Config.DOWNLOAD_COMMAND.get\\n ddir, basename = Config.DDIR.get, os.path.basename(filename)\\n cmd_list = shlex.split(cmd)\\n\\n def list_string_sub(orig, repl, lst):\\n \\\"\\\"\\\" Replace substrings for items in a list. \\\"\\\"\\\"\\n return [x if orig not in x else x.replace(orig, repl) for x in lst]\\n\\n cmd_list = list_string_sub(\\\"%F\\\", filename, cmd_list)\\n cmd_list = list_string_sub(\\\"%d\\\", ddir, cmd_list)\\n cmd_list = list_string_sub(\\\"%f\\\", basename, cmd_list)\\n cmd_list = list_string_sub(\\\"%u\\\", url, cmd_list)\\n cmd_list = list_string_sub(\\\"%i\\\", song.ytid, cmd_list)\\n dbg(\\\"Downloading using: %s\\\", \\\" \\\".join(cmd_list))\\n subprocess.call(cmd_list)\",\n \"def main(csv_path):\\n with open(csv_path, newline='') as csvFile:\\n csv_object = csv.reader(csvFile, delimiter=',')\\n\\n for row in csv_object:\\n # Get URL\\n # Check that the URL contains correct domain, otherwise add it\\n url_regex = r\\\"v=([^&]+)\\\"\\n youtube_url = \\\"https://youtu.be/\\\"\\n match = re.search(url_regex, row[0])\\n\\n if match:\\n video_ref = match.group(1)\\n else:\\n video_ref = row[0]\\n\\n video_url = youtube_url + video_ref\\n\\n try:\\n download_video(video_url, video_ref, row)\\n except Exception as e:\\n click.secho('Error: '+e.message, fg=\\\"red\\\")\\n\\n return None\",\n \"def download(self, language, filename, filetype):\\n if language not in self.languages.keys():\\n print \\\"Theres's no subtitle in this language\\\"\\n sys.exit()\\n url = \\\"http://www.youtube.com/api/timedtext?v={0}&lang={1}\\\".format(self.video_id, language)\\n self.subtitle = urllib2.urlopen(url)\\n if filetype == \\\"srt\\\":\\n self.writeSRTFile(filename)\\n else:\\n self.writeXMLFile(filename)\",\n \"def download(df_shorter,folderName):\\n os.mkdir(str(folderName))\\n path = os.getcwd()+'\\\\\\\\'+str(folderName)+'\\\\\\\\'\\n #add column with video link generated from IDs\\n df_shorter['urls'] = df_shorter['id'].apply(lambda x: generateLinkFromId(x))\\n vid_dl = []\\n i = 1\\n for url in df_shorter['urls']:\\n if url != False:\\n name = str(i)+'.mp4'\\n vid_dl.append(wget.download(url,path+name))#retrun the path of the saved video\\n i = i+1\\n return vid_dl\",\n \"def downloader(thread_num):\\n tid = 'Thread ' + numprefix.format(thread_num) + ': '\\n for i in range(thread_num, len(self.titles), thread_count):\\n title, link = self.titles[i], self.download_urls[i]\\n name = vidprefix.format(i) + ' ' + title + '.mp4'\\n tries = 0\\n while (not os.path.exists(name) or os.path.getsize(name) == 0) \\\\\\n and tries <= trycount:\\n if os.path.exists(name): os.remove(name)\\n self.log(tid + 'Calling wget for ' + name)\\n subprocess.call(['wget', '--output-document=' + name, link])\\n tries += 1\\n if (not os.path.exists(name) or os.path.getsize(name) == 0):\\n self.log(tid + 'wget failed for ' + name)\\n else:\\n self.log(tid + 'wget successfully downloaded ' + name)\",\n \"def dirty_yt_search(keyword):\\n yt_url = 'https://www.youtube.com/results'\\n search_args = {'search_query': keyword}\\n\\n resp = requests.get(yt_url, search_args)\\n print(resp.text)\\n search_results = re.findall(r'href=\\\\\\\"\\\\/watch\\\\?v=(.{11})', resp.text)\\n return 'http://www.youtube.com/watch?v=' + search_results[0]\",\n \"def download_video(video_stream):\\n global file_size\\n file_size = size_in_mb(video_stream.filesize)\\n home_dir = os.environ['HOME']\\n path = f'{home_dir}/Downloads/Video'\\n print('-'*60)\\n print(f'Filename:\\\\t{video_stream.title}')\\n print(f'Location:\\\\t{path}')\\n print(f'Size:\\\\t\\\\t{file_size} MB\\\\n')\\n\\n filename = video_stream.title + '_video.mp4'\\n filename = filename.replace('/', ' ')\\n filename = filename.replace('\\\\\\\\', ' ')\\n\\n if os.path.exists(os.path.join(path, filename)):\\n print(\\\"The file has been already downloaded.\\\")\\n sys.exit()\\n \\n video_stream.download(path, filename)\",\n \"def test_get_video_id_from_url(self):\\n self.assertEqual(get_video_id_from_url('https://www.youtube.com/embed/DqGwxR_0d1M'),\\n 'DqGwxR_0d1M')\\n self.assertEqual(get_video_id_from_url('https://youtu.be/DqGwxR_0d1M'), 'DqGwxR_0d1M')\\n self.assertEqual(\\n get_video_id_from_url('https://www.youtube.com/watch?v=DqGwxR_0d1M&feature=youtu.be'),\\n 'DqGwxR_0d1M')\\n self.assertEqual(get_video_id_from_url('https://www.youtube.com/watch?v=DqGwxR_0d1M'),\\n 'DqGwxR_0d1M')\",\n \"def start(self):\\n\\n ydl_opts = {}\\n with youtube_dl.YoutubeDL(ydl_opts) as ydl:\\n while True:\\n videos = self.get_videos() # getting list of all videos from file\\n print('{} videos to go'.format(len(videos))) # print no. of video remaining\\n video = get_first_item(videos) # get next video for downloading\\n if video is None: # check if video is there or not\\n break\\n\\n ydl.download([video]) # downloading video\\n videos.remove(video) # remove video from list\\n self.save_file(videos) # save updated list to file\\n\\n print('All downloaded')\",\n \"def spider(given_url):\\n \\n url_to_crawl = given_url\\n\\n source_code = requests.get(url_to_crawl)\\n plain_text = source_code.text\\n soup = BeautifulSoup(plain_text)\\n # name = soup.find('h1', {'class': 'pl-header-title'})\\n # name = name.string\\n # name = str(name)\\n # name = name.strip('')\\n # fw = open('links of' + name + '.txt', 'w')\\n # fw2 = open('names of' + name + '.txt', 'w')\\n fw = open('links.txt', 'w')\\n fw2 = open('names.txt', 'w')\\n for link in soup.findAll('a', {'class': 'pl-video-title-link yt-uix-tile-link yt-uix-sessionlink spf-link '}):\\n my_href = 'https://www.youtube.com' + link.get('href')\\n title = link.string\\n #print(my_href, title)\\n fw.write(my_href + '\\\\n')\\n fw2.write(title)\\n\\n fw.close()\\n fw2.close()\\n\\n \\\"\\\"\\\"Downloading Part\\\"\\\"\\\"\\n try:\\n os.system(\\\"youtube-dl --max-quality FORMAT -a links.txt\\\")\\n return\\n except:\\n print(\\\"Something went wrong related to downloading\\\")\\n exit(2)\",\n \"def get_url():\\r\\n songs = []\\r\\n with open(FILE_CONTAINING_URLS) as f:\\r\\n for line in f:\\r\\n if not line.startswith(\\\"#\\\") and is_web_url(line):\\r\\n songs.append(line)\\r\\n\\r\\n # pick a random song and store it in song variable\\r\\n song = random.choice(songs)\\r\\n\\r\\n url_attempts = []\\r\\n\\r\\n for x in range(RETRY_COUNT):\\r\\n response = requests.get(song)\\r\\n # check if URL is valid and also make sure video is available\\r\\n if response.ok and video_is_available(song):\\r\\n return song\\r\\n # store failed URL\\r\\n url_attempts.append(song)\\r\\n # choose new random song\\r\\n song = random.choice(songs)\\r\\n\\r\\n print(\\\"Could not access video URLs. Please check network connection\\\")\\r\\n print(\\\"Tried the following URLs before failing:\\\")\\r\\n print(\\\"\\\\n\\\".join(url_attempts))\\r\\n exit(1)\",\n \"def tekstowo_youtube_url(source):\\n reg = re.compile(r\\\"var videoID = \\\\\\\"(.*)\\\\\\\";\\\")\\n try:\\n video_id = reg.search(source).group(1)\\n except Exception:\\n raise Exception(ERROR_STR + '[crawler] cannot find videoID')\\n if not video_id:\\n raise Exception(ERROR_STR + '[crawler] empty videoID')\\n\\n return \\\"https://www.youtube.com/watch?v=\\\" + video_id\",\n \"def download_flickr_video(url, save_root, force_overwrite):\\n\\n # (Try to) open the URL\\n response = urlopen(url)\\n # Extract the file extension from the resolved URL\\n m = re.match(r'(.*)\\\\?s=.*', response.url)\\n _, ext = os.path.splitext(m.group(1))\\n # Build the path to save the video to\\n video_meta = parse.parse(VIDEO_URL_FORMAT, url)\\n user_id = video_meta['user_id']\\n video_id = video_meta['video_id']\\n save_path = os.path.join(save_root, f'{user_id}-{video_id}{ext}')\\n # Save the video\\n if os.path.isfile(save_path) and not force_overwrite:\\n raise FileExistsError(f'File already exists at {save_path}')\\n else:\\n with open(save_path, 'wb') as f:\\n shutil.copyfileobj(response, f)\\n\\n return save_path\",\n \"async def play(self, ctx, url):\\n server_id = ctx.message.server.id\\n requester = ctx.message.author\\n #refuse command if we don't know which voice channel to join\\n if not self.in_voice(server_id) and not requester.voice.voice_channel:\\n await ctx.bot.send_message(ctx.message.channel, \\\"Dude, get in voice first.\\\")\\n return\\n #warn user that the bot won't jump channels while playing\\n if self.in_voice(server_id) and not self.user_in_channel(server_id, requester):\\n vcname = self.get_server_dict(server_id)['voice'].channel.name\\n await ctx.bot.send_message(ctx.message.channel, \\\"I'm already playing in {}. Get in.\\\".format(vcname))\\n return\\n #create ytdl instance\\n #set quiet: True if needed\\n await ctx.bot.send_typing(ctx.message.channel)\\n ytdl = YoutubeDL(self._default_options)\\n try:\\n info = ytdl.extract_info(url, download=False)\\n except DownloadError:\\n #url was bullshit\\n search_kw = ctx.message.content[5:]\\n info = await self._find(ctx.bot, search_kw)\\n if not info:\\n #no hits\\n await ctx.bot.send_message(ctx.message.channel, \\\"No media found.\\\")\\n if 'entries' in info:\\n #it's a playlist\\n #just grab the first item\\n info = info['entries'][0]\\n #at this point info['url'] should point to our preferred format\\n download_url = info['url']\\n #get media attributes\\n title = info.get('title')\\n duration = ''\\n if info.get('is_live'):\\n duration = 'LIVE'\\n else:\\n seconds = info.get('duration')\\n if seconds:\\n duration = str(datetime.timedelta(seconds=seconds))\\n nick = self.get_nick(requester)\\n #add to queue\\n self.enqueue(server_id, download_url, title, duration, nick)\\n await ctx.bot.send_message(ctx.message.channel, self.format_song_display('+', title, duration, nick))\\n #join user's voice channel unless already in voice\\n if not self.in_voice(server_id):\\n await self._join(ctx.bot, server_id, requester.voice.voice_channel)\\n #start playback unless already playing\\n if not self.is_playing(server_id):\\n await self._play(ctx.bot, server_id)\",\n \"def play_youtube(self, media_id):\\n pass\",\n \"def playlist_videos(playlist_id):\\r\\n url = PLAYLIST_ITEMS_URL.format(API_KEY, playlist_id)\\r\\n response = util.web.http_get(url=url, json=True, referer='https://tinychat.com')\\r\\n\\r\\n if response['json'] is not None:\\r\\n video_list = []\\r\\n # next_page_token = response['json']['nextPageToken']\\r\\n try:\\r\\n if 'items' in response['json']:\\r\\n for item in response['json']['items']:\\r\\n video_id = item['snippet']['resourceId']['videoId']\\r\\n details = video_details(video_id)\\r\\n if details is not None:\\r\\n info = {\\r\\n 'type': 'youTube',\\r\\n 'video_id': video_id,\\r\\n 'video_title': details['video_title'],\\r\\n 'video_time': details['video_time']\\r\\n }\\r\\n video_list.append(info)\\r\\n return video_list\\r\\n except KeyError as ke:\\r\\n log.error(ke, exc_info=True)\\r\\n return None\",\n \"def download_video_feed(feed_url):\\n with urlopen(feed_url) as conn:\\n data = json.loads(conn.read().decode())\\n\\n return tuple(\\n FeedItem(\\n # The ID is part of the text of the string.\\n video_id= entry[\\\"id\\\"][\\\"$t\\\"].rsplit(\\\":\\\", 1)[1],\\n # The upload time is an ISO UTC date with milliseconds.\\n # The milliseconds are apparently always zero.\\n upload_time= datetime.datetime.strptime(\\n entry[\\\"published\\\"][\\\"$t\\\"],\\n \\\"%Y-%m-%dT%H:%M:%S.000Z\\\"\\n ),\\n title= entry[\\\"title\\\"][\\\"$t\\\"],\\n description= entry[\\\"media$group\\\"][\\\"media$description\\\"][\\\"$t\\\"],\\n )\\n for entry in data[\\\"feed\\\"].get(\\\"entry\\\", [])\\n )\",\n \"def youtube_id_to_url(yt_video_id):\\n return 'https://www.youtube.com/watch?v=' + yt_video_id\",\n \"async def igvideo(self, ctx, url):\\n response = requests.get(url.replace(\\\"`\\\", \\\"\\\"), headers={\\\"Accept-Encoding\\\": \\\"utf-8\\\"})\\n tree = html.fromstring(response.content)\\n results = tree.xpath('//meta[@content]')\\n sources = []\\n for result in results:\\n try:\\n if result.attrib['property'] == \\\"og:video\\\":\\n sources.append(result.attrib['content'])\\n except KeyError:\\n pass\\n if sources:\\n await ctx.send(sources[0])\\n self.logger.info(misolog.format_log(ctx, f\\\"Success\\\"))\\n else:\\n await ctx.send(\\\"Found nothing, sorry!\\\")\\n self.logger.warning(misolog.format_log(ctx, f\\\"Found nothing\\\"))\",\n \"def play_url(url, name):\\n video_url = scraper.get_media_url(url)\\n if video_url == -1:\\n GUI.info_box(u\\\"Vesen\\\", u\\\"Fann ekki upptöku\\\")\\n else:\\n player.play(video_url, name)\",\n \"def download_vid(item):\\n vid_name, vid_id = item\\n vid = Video(vid_name, vid_id, resolution='224p')\\n vid.download()\",\n \"def ytd(title, url ):\\n ydl_opts = {\\n 'format': 'bestaudio/best',\\n 'postprocessors': [{\\n 'key': 'FFmpegExtractAudio',\\n 'preferredcodec': 'm4a',\\n # 'preferredquality': '192',\\n }],\\n 'progress_hooks': [download_hook],\\n 'outtmpl': title + '.%(ext)s',\\n }\\n\\n with youtube_dl.YoutubeDL(ydl_opts) as ydl:\\n ydl.download([url])\\n return(title + \\\".m4a\\\")\",\n \"def download(self, url, destination):\\n fileDownloader = utils.HttpFileDownloader(url, destination)\\n fileDownloader.download()\",\n \"def download_video(url, fn):\\n start_time = time.time()\\n\\n # Sorry: This is terrible code, but I'm kind of throwing it\\n # together as I discover more about it.\\n print ' Downloading {0} to {1}'.format(url, fn)\\n\\n resp = requests.get(url)\\n if resp.status_code != 200:\\n print ' GAH! MY EYES! {0} kicked up {1}'.format(url, resp.status_code)\\n return\\n\\n rss_url_m = re.search(r'\\\"(/rss/flash/\\\\d+)\\\"', resp.content)\\n rss_url = 'http://blip.tv' + rss_url_m.group(0).strip('\\\"')\\n resp = requests.get(rss_url)\\n\\n rss_content = resp.content\\n\\n for ending in POSSIBLE_ENDINGS:\\n regex = r'\\\"http://blip.tv[^\\\"]+?' + ending + '\\\"'\\n\\n download_m = re.search(regex, rss_content)\\n if not download_m:\\n print ' No {0} url found'.format(ending)\\n continue\\n\\n download_url = download_m.group(0).strip('\\\"')\\n print ' Attempting to download {0}'.format(download_url)\\n\\n try:\\n resp = requests.get(download_url, stream=True)\\n print ' Downloading {0}'.format(download_url)\\n if resp.status_code == 200:\\n total_length = int(resp.headers['content-length'])\\n\\n if os.path.exists(fn + ending) and file_size(fn + ending) == total_length:\\n print ' Already downloaded.'\\n return\\n\\n with open(fn + ending, 'w') as fp:\\n total_downloaded = 0\\n\\n tic_chunk = total_downloaded\\n tic = time.time()\\n for chunk in resp.iter_content(chunk_size=1024):\\n if chunk:\\n fp.write(chunk)\\n fp.flush()\\n tic_chunk += len(chunk)\\n total_downloaded += len(chunk)\\n\\n if time.time() - tic > 1:\\n with TERM.location(x=0):\\n line = ' {0} {1}kbps'.format(\\n format_downloaded(total_downloaded, total_length),\\n int(tic_chunk / (time.time() - tic) / 1000))\\n sys.stdout.write(line + TERM.clear_eol)\\n sys.stdout.flush()\\n tic_chunk = 0\\n tic = time.time()\\n print ''\\n\\n print ' Done! {0} {1}mb {2}'.format(\\n fn + ending,\\n int(total_length / 1000000.0),\\n format_duration(time.time() - start_time))\\n return\\n\\n else:\\n print ' HTTP{0}! GAH! SPUTTER!'.format(resp.status_code)\\n\\n except requests.exceptions.ConnectionError as exc:\\n print ' CONNECTIONERROR! GAH! SPUTTER! {0}'.format(exc)\\n\\n print ' SO MANY FAILURES!'\\n raise NoDownloadMeNoLikeyException()\",\n \"def make_video_url(movie_id, api_key):\\n\\n MOVIE_URL = \\\"https://api.themoviedb.org/3/movie/\\\"\\n LANG = \\\"&language=en-US\\\"\\n # Find the youtube key for video trailer\\n connection = requests.get(MOVIE_URL + str(movie_id) +\\n \\\"/videos?api_key=\\\" + api_key + LANG)\\n videos_json = json.loads(connection.text)\\n connection.close()\\n\\n if connection.status_code != 200:\\n # constant in case issue is found with connection....\\n return VIDEO_URL + '5PSNL1qE6VY'\\n else:\\n if len(videos_json['results']) == 0:\\n # constant in case no video is found for given movie....\\n return VIDEO_URL + '5PSNL1qE6VY'\\n else:\\n # If all well we get aa video url for all movie\\n # based on discovery or discovery by year\\n return VIDEO_URL + videos_json['results'][0]['key']\",\n \"async def youtube(self, ctx, *search):\\n voice = discord.utils.get(self.bot.voice_clients, guild=ctx.guild)\\n\\n if not (ctx.author.voice or voice):\\n await ctx.message.add_reaction('\\\\U0001F615')\\n await ctx.send(\\\"Not in a voice channel.\\\")\\n return\\n \\n YDL_OPTS = {'default_search': 'auto', 'format': 'bestaudio',\\n 'noplaylist': 'True'}\\n FFMPEG_OPTS = {'before_options': '-reconnect 1 -reconnect_streamed 1 '\\n '-reconnect_delay_max 5',\\n 'options': '-vn'}\\n \\n with youtube_dl.YoutubeDL(YDL_OPTS) as ydl:\\n try:\\n info = ydl.extract_info(' '.join(search), download=False)\\n except youtube_dl.utils.DownloadError:\\n await ctx.message.add_reaction('\\\\U0001F615');\\n await ctx.send(f\\\"Couldn't stream that sound.\\\")\\n return\\n\\n if 'entries' in info:\\n if info['entries']:\\n info = info['entries'][0]\\n else:\\n await ctx.send(f\\\"No results found for `{search}`.\\\")\\n return\\n \\n if not voice:\\n await ctx.message.add_reaction('\\\\U0001F615')\\n await self.join(ctx)\\n\\n voice = discord.utils.get(self.bot.voice_clients, guild=ctx.guild)\\n \\n if voice:\\n if voice.is_playing():\\n voice.stop()\\n \\n URL = info['formats'][0]['url']\\n title = info['title']\\n voice.play(discord.FFmpegPCMAudio(executable=os.environ['FFMPEG_PATH'],\\n source=URL, **FFMPEG_OPTS))\\n \\n await ctx.send(f\\\"Playing `{title}`.\\\")\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.7559332","0.7511336","0.7269561","0.7109881","0.69188035","0.6849369","0.6837979","0.67307305","0.67147034","0.6699649","0.6661852","0.6603577","0.6570227","0.6545135","0.65282965","0.6528034","0.6490521","0.64205855","0.63792336","0.63700604","0.63433367","0.63277906","0.6298527","0.6272969","0.62356573","0.6211464","0.6199923","0.6186832","0.6168526","0.616394","0.6121756","0.6118238","0.61055785","0.61009365","0.6096731","0.60924286","0.60746604","0.6063348","0.60186833","0.6013931","0.5990241","0.5941902","0.592355","0.59027916","0.58924145","0.5880168","0.5871658","0.58627516","0.58581376","0.58542866","0.5848118","0.58469605","0.58441955","0.5832069","0.5830507","0.58195204","0.5791336","0.5778909","0.5767589","0.5767135","0.574161","0.5732235","0.5707057","0.568659","0.5679438","0.56790936","0.5663001","0.56626743","0.5659062","0.565889","0.5650707","0.5647895","0.5630932","0.560571","0.56024164","0.5601405","0.5600421","0.5596286","0.5582787","0.55795485","0.55716056","0.55692255","0.556901","0.5545642","0.5529973","0.5511336","0.55071557","0.54950684","0.5482425","0.54798764","0.5467569","0.5461113","0.5460923","0.54539615","0.54533607","0.54530257","0.5444963","0.5436253","0.54340583","0.5434017"],"string":"[\n \"0.7559332\",\n \"0.7511336\",\n \"0.7269561\",\n \"0.7109881\",\n \"0.69188035\",\n \"0.6849369\",\n \"0.6837979\",\n \"0.67307305\",\n \"0.67147034\",\n \"0.6699649\",\n \"0.6661852\",\n \"0.6603577\",\n \"0.6570227\",\n \"0.6545135\",\n \"0.65282965\",\n \"0.6528034\",\n \"0.6490521\",\n \"0.64205855\",\n \"0.63792336\",\n \"0.63700604\",\n \"0.63433367\",\n \"0.63277906\",\n \"0.6298527\",\n \"0.6272969\",\n \"0.62356573\",\n \"0.6211464\",\n \"0.6199923\",\n \"0.6186832\",\n \"0.6168526\",\n \"0.616394\",\n \"0.6121756\",\n \"0.6118238\",\n \"0.61055785\",\n \"0.61009365\",\n \"0.6096731\",\n \"0.60924286\",\n \"0.60746604\",\n \"0.6063348\",\n \"0.60186833\",\n \"0.6013931\",\n \"0.5990241\",\n \"0.5941902\",\n \"0.592355\",\n \"0.59027916\",\n \"0.58924145\",\n \"0.5880168\",\n \"0.5871658\",\n \"0.58627516\",\n \"0.58581376\",\n \"0.58542866\",\n \"0.5848118\",\n \"0.58469605\",\n \"0.58441955\",\n \"0.5832069\",\n \"0.5830507\",\n \"0.58195204\",\n \"0.5791336\",\n \"0.5778909\",\n \"0.5767589\",\n \"0.5767135\",\n \"0.574161\",\n \"0.5732235\",\n \"0.5707057\",\n \"0.568659\",\n \"0.5679438\",\n \"0.56790936\",\n \"0.5663001\",\n \"0.56626743\",\n \"0.5659062\",\n \"0.565889\",\n \"0.5650707\",\n \"0.5647895\",\n \"0.5630932\",\n \"0.560571\",\n \"0.56024164\",\n \"0.5601405\",\n \"0.5600421\",\n \"0.5596286\",\n \"0.5582787\",\n \"0.55795485\",\n \"0.55716056\",\n \"0.55692255\",\n \"0.556901\",\n \"0.5545642\",\n \"0.5529973\",\n \"0.5511336\",\n \"0.55071557\",\n \"0.54950684\",\n \"0.5482425\",\n \"0.54798764\",\n \"0.5467569\",\n \"0.5461113\",\n \"0.5460923\",\n \"0.54539615\",\n \"0.54533607\",\n \"0.54530257\",\n \"0.5444963\",\n \"0.5436253\",\n \"0.54340583\",\n \"0.5434017\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.7409529"},"document_rank":{"kind":"string","value":"2"}}},{"rowIdx":6098,"cells":{"query":{"kind":"string","value":"Check that user_data is a dict and that key is in there"},"document":{"kind":"string","value":"def has_user_data(self, key):\n return isinstance(self._user_data, dict) and key in self._user_data"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["def check_for_dict(check):","def is_valid(data):\n return isinstance(data, dict) \\\n and \"u_id\" in data \\\n and \"token\" in data \\\n and isinstance(data[\"u_id\"], int) \\\n and isinstance(data[\"token\"], str)","def can_insert(data):\n return isinstance(data, dict)","def _is_key_value(data):\n if data is None:\n return False\n return all(x in data for x in ['key', 'value'])","def isDict(data):\n\ttry:\n\t\tfrom types import DictType\n\t\tif type(data) == DictType:\n\t\t\treturn True\n\texcept ImportError:\n\t\tif type(data) == type({}):\n\t\t\treturn True\n\treturn False","def verify_rpc_value ( user_dict ):\n for key in user_dict:\n if not isinstance ( user_dict[ key ], str ):\n # Error code 422\n raise ValueError ( 'Value of {0} is not a string'.format ( key ) )","def _is_dict(val):\n\n return isinstance(val, dict)","def sanity_check(cls, data): # no version with ID, since PUT (update) isn't allowed\n data = _dict_sanity_check(data,\n mandatory_keys = [\n (\"user_id\", User.exists),\n (\"customer_id\", Customer.exists)\n ],\n optional_keys = [])\n return data, None","def verifyData(self, expectedDict):\n pass","def _is_dict(item):\n return isinstance(item, dict)","def validate_user_request_dict(request_dict):\n if 'first_name' not in request_dict:\n return False\n if 'last_name' not in request_dict:\n return False\n if 'id' not in request_dict:\n return False\n if 'email' not in request_dict:\n return False\n return True","def check_user_data_in_response(response_data):\n assert response_data[\"id\"] > 0\n assert response_data[\"name\"] == pytest.test_user.name\n assert response_data[\"email\"] == pytest.test_user.email\n assert response_data[\"gender\"] == pytest.test_user.gender\n assert response_data[\"status\"] == pytest.test_user.status","def __is_valid_dict(self, GRFData):\n\n if type(GRFData) is not dict:\n raise ValueError(\"Expected GRFData to be of type '{}', but received type '{}'.\".format(type(dict), type(GRFData)))\n\n for component in self.comp_list:\n if component not in GRFData.keys():\n raise ValueError(\"Component '{}' not found in GRFData.\".format(component))","def is_data_true(data):\n\n if not data:\n return False\n\n if not isinstance(data, dict):\n if not util.get_value_from_health_internal_tuple(data):\n return False\n return True\n\n for _k in data:\n if is_data_true(data[_k]):\n return True\n\n return False","def dict_support_required(self):\n\t\treturn self.typemanager.has_dicts","def test_process_dict_true(self):\n\n self.assertIn('userA@domain', self.temp_set)","def _validate_input_dict(self, input):\n if isinstance(input, dict):\n required = {\"type\", \"value\"}\n not_found = required - set(input.keys())\n if not_found:\n raise SpecificationError(\n \"Required key(s) not found in input dictionary: {}\".format(\n \", \".join(not_found)\n )\n )\n else:\n raise Exception(\"input element has to be a dictionary\")","def valid_user_data(user_data):\n return 'account_ids' in user_data and 'monthly_expenses' in user_data","def is_dict(value):\n return isinstance(value, dict)","def _validate_dict_data(self, expected, actual):\n for k, v in expected.iteritems():\n if k in actual:\n if (isinstance(v, basestring) or\n isinstance(v, bool) or\n isinstance(v, (int, long))):\n if v != actual[k]:\n return \"{}:{}\".format(k, actual[k])\n elif not v(actual[k]):\n return \"{}:{}\".format(k, actual[k])\n else:\n return \"key '{}' does not exist\".format(k)\n return None","def test_dictionary(self):\n self.assertIsInstance(self.test1json, dict)","def dict_type(verifield, required):\n if verifield is None: return True\n if not isinstance(verifield, dict): return False\n all_of = [value or True for value in verifield.values() if isinstance(value, required) or value is None]\n return not verifield or (all(all_of or [False]) and len(all_of) == len(verifield))","def check_data_is_format(data):\n try:\n data_lst = data\n if not isinstance(data, list):\n data_lst = json.loads(data)\n\n for data in data_lst:\n if not isinstance(data, dict):\n raise ValueError(\"data contains not dict\")\n\n for key in data.keys():\n check_type(key)\n except ValueError as e:\n logging.error(\"data format check error %s\" % e)\n return False, None\n except Exception as e:\n logging.error(\"data format check unknown error %s\" % e)\n return False, None\n else:\n return True, data_lst","def is_dict(self) -> bool:\n return True","def _verfify_auth_and_profiles_data (self, data):\n if type(data.get('profiles')) == dict:\n if len(str(data.get('authURL', ''))) > 10 and len(str(data.get('authURL', ''))) < 50:\n return True\n return False","def is_typed_dict(self) -> bool:\n return True","def params_is_valid(data):\n if isinstance(data['title'], str) and isinstance(data['description'], str) and isinstance(data['params'], dict):\n return True\n else:\n return False","def update_response_json(user, data):\n if type(data) == dict and type(user) == str:\n if user in data.keys():\n data = data[user]\n response_json.response[user] = data\n return response_json.response\n return {'update': 'failed',\n 'reason': 'data provided incorrectly formatted. \\\n the data must be json formatted, and <user> must be of type string'}","def check_if_nested(data):\n if isinstance(data, dict):\n for k in data:\n if isinstance(data[k], (list, dict)):\n return True\n elif isinstance(data, list):\n for i in data:\n if isinstance(i, (list, dict)):\n return True\n return False","def verifyDictTypes( template, dictToCheck ):\n for key in dictToCheck:\n if not ( ( isinstance( dictToCheck[ key ], list ) and\n isinstance( template[ key ], list ) ) or\n ( isinstance( dictToCheck[ key ], dict ) and\n isinstance( template[ key ], dict ) ) or\n ( isinstance( dictToCheck[ key ], template[ key ] ) ) ):\n return False\n\n return True","def _is_key_value_array(self, data):\n for d in data:\n if not self._is_key_value(d):\n return False\n return True","def __is_key_in_json(self, key=str, json_dict=json):\n if key in json_dict:\n # noinspection PyUnresolvedReferences\n return json_dict[key]\n else:\n return self.NO_KEY_VALUE_FOR_ENTRY","def validate_dict(data_dict, entity):\r\n fields = []\r\n for key, value in data_dict.items():\r\n if not value:\r\n fields.append(key)\r\n continue\r\n if len(fields) > 0:\r\n return provide_field_value(entity, fields)\r\n elif key == hqAddKey:\r\n status = validate_hqadd(value)\r\n if not status == ok_str:\r\n return status\r\n elif key == logoUrlKey:\r\n status = validate_logourl(value)\r\n if not status == ok_str:\r\n return status\r\n elif key == type_key:\r\n status = validate_officeType(value)\r\n if not status == ok_str:\r\n return status\r\n elif key == name_key:\r\n status = None\r\n if entity == party_key:\r\n status = validate_partyname(value)\r\n elif entity == office_key:\r\n status = validate_officeName(value)\r\n if not status == ok_str:\r\n return status\r\n if fields:\r\n return provide_field_value(entity, fields)\r\n return ok_str","def is_dictionary(obj):\n return type(obj) is dict","def is_dict(obj):\n return type(obj) == type({})","def assertUser(self, user): # camel case to be consistent with unittest\n self.assertIsInstance(user, dict)\n self.assertIn('id', user)\n self.assertIn('nickname', user)","def _validate_dict_entry(self, dict_entry):\r\n try:\r\n # Type-check all of the type-critical items.\r\n if (\r\n type(dict_entry[\"id\"]) == int and\r\n type(dict_entry[\"date\"]) == datetime.date and\r\n type(dict_entry[\"time\"]) == datetime.time and\r\n type(dict_entry[\"datetime\"]) == datetime.datetime and\r\n type(dict_entry[\"duration\"]) == datetime.timedelta):\r\n return True\r\n else:\r\n return False\r\n # end if\r\n except Exception as err:\r\n _z_exc(\"logentry.py/_validate_dict_entry\", err)\r\n # end try\r","def _verify_dict_field(self, _dict, name, types):\n if type(types) != list:\n types = [types]\n if str in types and unicode not in types:\n types.append(unicode)\n if unicode in types and str not in types:\n types.append(str)\n self.assertTrue(name in _dict, msg=\"Missing field '%s'\" % name)\n self.assertTrue(type(_dict[name]) in types,\n msg=\"Erroneous type of the field '%s': \"\n \"found %s, expected any of %s\" % (\n name, str(type(_dict[name])), \",\".join([str(x) for x in types])))","def validate(self, data: Dict):\n for key in self.__dict__.keys():\n if not key.startswith('__') and key != 'id':\n if data[key] == '' or data[key] is None:\n raise ValidationError(\n message=f'{key} should not be \"{data[key]}\"'\n )","def clean_dict(data: dict) -> None:\n if not isinstance(data, dict):\n logger.warning(f\"Not a dictionary: {type(data)}\")\n return\n\n data.pop(\"_id\", None)\n data.pop(\"password\", None)\n\n return","def test_good_data(self):\n self.assertNotEqual(self.request.user.email, self.good_dict['email'])\n self.request.json_body = deepcopy(self.good_dict)\n result = user_id_put_view(self.request)['d']\n self.assertEqual(result, dict_from_row(self.request.user, remove_fields=removals))\n self.assertEqual(self.request.user.email, self.good_dict['email'])","def test_json_representation_of_user(new_user):\n user, user_data = new_user\n user_json = user.json()\n\n acceptable_keys = 'id', 'username', 'created_at', 'is_admin'\n unacceptable_keys = 'salt', 'password', 'hashed_password'\n\n assert_that(user_json).contains_value(user_data.get('username'))\n assert_that(user_json).contains_key(*acceptable_keys)\n assert_that(user_json).does_not_contain_key(*unacceptable_keys)","def match(self, data_instance: Dict[str, Any]) -> bool:","def _check_fields(self, content: JsonDict) -> None:\n self.assertIn(\"id\", content)\n self.assertIn(\"received_ts\", content)\n self.assertIn(\"room_id\", content)\n self.assertIn(\"event_id\", content)\n self.assertIn(\"user_id\", content)\n self.assertIn(\"sender\", content)\n self.assertIn(\"canonical_alias\", content)\n self.assertIn(\"name\", content)\n self.assertIn(\"event_json\", content)\n self.assertIn(\"score\", content)\n self.assertIn(\"reason\", content)\n self.assertIn(\"auth_events\", content[\"event_json\"])\n self.assertIn(\"type\", content[\"event_json\"])\n self.assertIn(\"room_id\", content[\"event_json\"])\n self.assertIn(\"sender\", content[\"event_json\"])\n self.assertIn(\"content\", content[\"event_json\"])","def isJWE_unserialized_single(x):\n if isinstance(x, dict) \\\n and (\"unprotected\" in x or \"protected\" in x) \\\n and (\"ciphertext\" in x):\n try:\n if \"protected\" in x:\n json.loads(x[\"protected\"])\n return True\n except:\n return False\n else:\n return False","def has_value(value):\n return IsDictContainingValue(wrap_matcher(value))","def validate_json(data: dict) -> bool:\n try:\n assert \"data\" in data.keys()\n assert isinstance(data[\"data\"], str)\n assert \"command\" in data.keys()\n assert isinstance(data[\"command\"], str)\n assert \"time\" in data.keys()\n assert isinstance(data[\"time\"], str)\n assert \"origin\" in data.keys()\n assert isinstance(data[\"origin\"], str)\n return True\n except AssertionError:\n return False","def verify_object(self, data):\n rv = self.get(data[self.id_field])\n result = not is_404(rv)\n if result:\n for key, value in data:\n if not in_response(rv, value):\n return False\n return result","def is_data_response(resp: Response, data_field: str = None) -> bool:\n\n return \\\n resp and \\\n is_dict(resp) and \\\n is_success_response(resp) and \\\n resp.get(\"data\") is not None and \\\n (not data_field or data_field in resp.get(\"data\"))","def _import(self, data):\n if isinstance(data, dict):\n if len(data):\n for key in data:\n if data.get(key) is not None:\n if not self.set(key, data.get(key)):\n raise Exception('%s %s icin dogru bir veri degil.' % (data.get(key), key))","def checkOpsimData(self, otherdata=None):\n data2check = self.opsim_data\n if otherdata:\n data2check = otherdata\n if type(data2check) != list:\n if type(data2check) == dict:\n if set(self._opsim_keys).issubset(set(data2check.keys())):\n return True, 'good'\n else:\n return False, 'Data is not complete'\n else:\n return False, 'Data is not a list nor a dictionary'\n else:\n nodict = 0\n baddict = 0\n for data in data2check:\n if type(data) != dict:\n nodict += 1\n else:\n if not set(self._opsim_keys).issubset(set(data.keys())):\n baddict += 1\n if (nodict == 0 and baddict == 0):\n return True, 'good'\n else:\n statement = '{0} non dictionary element(s) and {1} uncomplete\\\n dictionary(ies) in data list'.format(nodict, baddict)\n return (False, statement)","def parse_user_dict(self, line):\n pass","def isJWS_unserialized_single(x):\n if isinstance(x, dict) \\\n and \"payload\" in x and \"signature\" in x \\\n and (\"protected\" in x or \"unprotected\" in x):\n try: \n if \"protected\" in x: \n json.loads(x[\"protected\"])\n return True\n except:\n return False\n else: \n return False","def handle_input(data: dict):","def assertContainsDict(self, dictionary, data):\n for key in dictionary:\n self.assertTrue(key in data, msg=\"Data doesn't have key '{}'\".format(key))\n value = dictionary[key]\n value2 = data[key]\n self.assertEqual(value, value2,\n msg=\"key={}, value={} != target={}\".format(key, value, value2))","def rule_00_config_is_dict(session):\n return isinstance(session[\"config\"], dict)","def test_input_text_returned_in_response_data(self):\n user_name = \"Ron Obvious\"\n user_input = \"Hello!\"\n\n data = self.chatbot.get_response_data(user_name, user_input)\n\n self.assertIn(user_input, data[\"user\"].keys())","def has_dict_keys(self, dict_in_pointer):\n if type(dict_in_pointer)==str:\n dict_in_pointer = [dict_in_pointer]\n if type(dict_in_pointer)==dict:\n dict_in_pointer = dict_in_pointer.keys()\n if type(dict_in_pointer)!=list:\n return None\n start = self.head\n while start:\n if dict_in_pointer==start.getMember():\n return start\n start = start.getLink()\n return None","def missing_data(self, data):\n missing_fields = []\n for key in data:\n if not key in request.json:\n missing_fields.append(key)\n if missing_fields:\n message = 'Missing ' + ', '.join(missing_fields)\n return self.bad_request(message)\n return None","def hasCustomData( self, key ):\n return str(key) in self._customData","def _dict_sanity_check(data, mandatory_keys, optional_keys, obj=None):\n # Both mandatory and optional key lists contain tuples, with key name being the first\n # element in each tuple. The validator is not needed for the mandatory / optional key\n # check, so we can ignore it here.\n missing_keys = [k for k, _ in mandatory_keys if k not in data]\n if missing_keys:\n raise ValueError(f\"missing mandatory key(s): {', '.join(missing_keys)}\")\n\n # Create a lookup of key name to validator function. The lookup will have an entry for all\n # possible keys, so we can also use it to check if we have any invalid keys.\n keys_to_validators = dict(mandatory_keys + optional_keys)\n always_allowed = [\"id\", \"_created\", \"_updated\", \"_links\", \"_embedded\"]\n invalid_keys = [k for k in data\n if k not in keys_to_validators and k not in always_allowed]\n if invalid_keys:\n raise ValueError(f\"invalid key(s) in request body: {', '.join(invalid_keys)}\")\n\n # Now we individually call the validators on all values in the data, producing a useful\n # error message if possible\n res = {}\n for key, value in data.items():\n try:\n res[key] = keys_to_validators[key](value)\n except ValueError as ex:\n raise ValueError(f\"key '{key}': {str(ex)}\")\n\n now_time_string = datetime.datetime.now().isoformat()\n if obj is None:\n res['_created'] = now_time_string\n res['_updated'] = now_time_string\n return res","def test_user_info(user_keys):\n\n pyme_instance = PyMe(206946886)\n response = pyme_instance.display()\n\n assert isinstance(response, dict)\n assert response['id'] == 206946886, \"The ID of the user should be in the response\"\n assert set(user_keys).issubset(response.keys()), \"All keys should be in the response\"","def everything_is_unicode(d: dict) -> bool:\n for k, v in d.items():\n if isinstance(v, dict) and k != \"headers\":\n if not everything_is_unicode(v):\n return False\n elif isinstance(v, list):\n for i in v:\n if isinstance(i, dict) and not everything_is_unicode(i):\n return False\n elif isinstance(i, bytes):\n return False\n elif isinstance(v, bytes):\n return False\n return True","def isdictinstance(obj):\n return isinstance(obj, dict) or isinstance(obj, DotDict)","def test_metadata_fonts_items_dicts(self):\n for x in self.metadata.get('fonts', None):\n self.assertEqual(type(x), type({}), msg=\"type(%s) is not dict\" % x)","def _check_user_entry(user):\n if \"tenant_name\" in user:\n keys = set(user.keys())\n if keys == {\"username\", \"password\", \"tenant_name\",\n \"project_domain_name\", \"user_domain_name\"}:\n if (user[\"user_domain_name\"] == \"\"\n and user[\"project_domain_name\"] == \"\"):\n # it is credentials of keystone v2 and they were created\n # --fromenv\n del user[\"user_domain_name\"]\n del user[\"project_domain_name\"]\n return True\n else:\n # it looks like keystone v3 credentials\n user[\"project_name\"] = user.pop(\"tenant_name\")\n return True","def test_dict(self, dictionary: dict) -> None:\r\n if not isinstance(dictionary, dict):\r\n raise ValueError(f'Expected dictionary, but received {type(dictionary)}')\r\n for key, value in dictionary.items():\r\n conditional_check(key, self.case_check, self.ignored_keys)\r\n if isinstance(value, dict):\r\n self.test_dict(dictionary=value)\r\n elif isinstance(value, list):\r\n self.test_list(items=value)","def validate_transaction_dict(request_dict):\n if 'id' not in request_dict:\n return False\n if 'user_id' not in request_dict:\n return False\n if 'amount' not in request_dict:\n return False\n if 'date' not in request_dict:\n return False\n return True","def test_process_dict_false(self):\n\n self.assertNotIn('userB@domain', self.temp_set)","def validate_dto(cls, data: dict) -> bool:\n\n required_keys = {'signature', 'signer'}\n return (\n cls.validate_dto_required(data, required_keys)\n and cls.validate_dto_all(data, required_keys)\n )","def isdict(val: Any) -> bool:\n return isinstance(val, MutableMapping)","def is_sync_service_data(values):\n if not isinstance(values, dict):\n return False\n\n for acr, users in values.items():\n if not isinstance(acr, (str, unicode)) or not isinstance(users, list):\n return False\n\n return True","def get_if_exist(self, data, key):\n if key in data:\n return data[key]\n return None","def _check_keys(self, dict, filetype):\n self.filetype = filetype\n for key in dict:\n if isinstance(dict[key], scipy.io.matlab.mio5_params.mat_struct):\n dict[key] = self._todict(dict[key], self.filetype)\n return dict","def check_dict(dic, validator, messages):\n check_dict_alg(dic, validator, [], messages, validator, \"NoObject\")","def isJWP_unserialized(x):\n if isinstance(x, dict) \\\n and \"payload\" in x and isinstance(x[\"unprotected\"], dict)\\\n and \"unprotected\" in x and \"signature\" not in x:\n return True\n else:\n return False","def __getitem__(self, key):\n return self._user_data.get(key)","def test_dict(self, testdata: TestData) -> None:\n for data in testdata['observation_type']:\n observation_type = ObservationType.from_dict(data)\n assert data == observation_type.to_dict()","def _check_keys(dict):\n for key in dict.keys():\n if isinstance(dict[key], sio.matlab.mio5_params.mat_struct):\n dict[key] = _todict(dict[key])\n return dict","def check_data(cls, database, data):\n if not data:\n abort(204, 'No data received')\n entity = {}\n try:\n entity = loads(data)\n except:\n print \"erreur chargement json %s\" % (data,)\n abort(404, 'Error on loading data')\n mapper = inspect(database)\n orm_data = {}\n for column in mapper.attrs:\n if isinstance(column, ColumnProperty) and \\\n not column.columns[0].nullable and \\\n not column.columns[0].foreign_keys and \\\n not column.columns[0].primary_key:\n orm_data[column.key] = column.columns[0].nullable\n else:\n pass\n for field in orm_data.iterkeys():\n if entity.has_key(field):\n #del(orm_data[column])\n pass\n else:\n return False\n return entity","def validate(self, data):\n # if data['is_private'] and data['contestants']:\n # raise serializers.ValidationError(\"Can not be private and compete for an award.\")\n return data","def _normalize(empty, user_data):\n if isinstance(user_data, UserData):\n return user_data.to_dict()\n if isinstance(user_data, dict):\n return _dict_to_dict(empty, user_data)\n if isinstance(user_data, (bytes, bytearray)):\n return _bytes_to_dict(empty, user_data)\n if user_data is None:\n return empty\n raise ValueError","def dict_check(*args, func=None):\n func = func or inspect.stack()[2][3]\n for var in args:\n if not isinstance(var, (dict, collections.UserDict, collections.abc.MutableMapping)):\n name = type(var).__name__\n raise DictError(\n 'Function {} expected dict, {} got instead.'.format(func, name))","def is_item_in_the_response(key, value, jsonResponse):\n flag = False\n for item in jsonResponse:\n if type(jsonResponse[item]) == int:\n if item == key and jsonResponse[item] == int(value):\n flag = True\n\n if type(jsonResponse[item]) == str:\n if item == key and jsonResponse[item] == str(value):\n flag = True\n\n if type(jsonResponse[item]) == bool:\n if item == key and jsonResponse[item] == bool(value):\n flag = True\n else:\n #log and error\n pass\n return flag","def _check_data_type(self, key: str, value: Any):\n allowedDataType = from_dot_notation(\n field=\".\".join([*self.parents, key]), obj=self.definition\n ).get(\"allowedDataType\", None)\n if allowedDataType is not None and not isinstance(value, allowedDataType):\n raise Exception(\n f\"Value '{value}' is not of the correct type. The allowed data type is: {allowedDataType.__name__}\"\n )","def test_postive_get_auth_horizon_check_keys(self):\n r = self.res.get('/auth/config/'+utils.partner, headers=utils.headers)\n logging.info(\"Return response is '%s'\" % r)\n # convert string to dictionary\n rd = ast.literal_eval(r)\n logging.info(\"Return response in dictionary format is '%s'\" % rd)\n self.assertEqual(self.res.response.status, 200)\n keys = ['type', 'web_endpoint', 'client_endpoint', 'org_name']\n self.assertTrue(utils.is_same_array(keys, rd.keys()), \"Keys are not correct!\")","def has_dict(self, dict_in_pointer):\n if type(dict_in_pointer)!=dict:\n return None\n start = self.head\n while start:\n if dict_in_pointer==start.getMember():\n return start\n start = start.getLink()\n return None","def check_dictionary(self, dico):\n if dico is not None:\n self.log.info('Check the dictionary')\n test, aff = validate(dico, proto_domain, test_comp = False)\n if test:\n self.log.info(aff)\n else:\n self.log.error(aff)\n sys.exit()","def test_obj_dict(self):\n obj = storage.all()\n self.assertIsInstance(obj, dict)","def test_export_data_none(self) -> None:\n user_data = user_models.ExpUserLastPlaythroughModel.export_data(\n self.NONEXISTENT_USER_ID)\n expected_data: Dict[str, Dict[str, str]] = {}\n self.assertEqual(expected_data, user_data)","def validate(self, data):\n password1 = data.get('password1')\n password2 = data.get('password2')\n\n if password1 is None:\n raise serializers.ValidationError(\"KeyError: password1 does not exist.\")\n\n if password2 is None:\n raise serializers.ValidationError(\"KeyError: password2 does not exist\")\n\n if password1 != password2:\n raise serializers.ValidationError(\"The two password fields didn't match.\")\n return data","def _is_valid_dict(content_type: str) -> bool:\n content_type = content_type.strip()\n\n if not content_type.startswith(\"pt:dict\"):\n return False\n\n if not _has_matched_brackets(content_type):\n return False\n\n if not _has_brackets(content_type):\n return False\n\n sub_types = _get_sub_types_of_compositional_types(content_type)\n if len(sub_types) != 2:\n return False\n\n sub_type_1 = sub_types[0]\n sub_type_2 = sub_types[1]\n return _is_valid_pt(sub_type_1) and _is_valid_pt(sub_type_2)","def _get_user_data(self):\n return {\"key\": self._key}","def get_user_data(self, key, default=None):\n if not isinstance(self._user_data, dict):\n return default\n return self._user_data.get(key)","def has_data(self, *args, **kwargs):\n return False","def test_dict(self, obj: dict) -> None:\r\n properties = read_properties(obj)\r\n for key, value in properties.items():\r\n conditional_check(key, self.case_check, self.ignored_keys)\r\n if read_type(value) == 'object':\r\n logger.debug('dict -> dict')\r\n self.test_dict(obj=value)\r\n elif read_type(value) == 'array':\r\n logger.debug('dict -> list')\r\n self.test_list(array=value)","def validate_data(self, data):\n try:\n event_id = data[\"event\"]\n guests = data[\"guests\"]\n section = data.get(\"section\", None)\n except KeyError:\n return False, \"\", \"\", \"\"\n try:\n event = Event.objects.get(pk=event_id)\n except Event.DoesNotExist:\n return False, \"\", \"\", \"\"\n if not isinstance(guests, list):\n return False, \"\", \"\", \"\"\n if section is not None:\n try:\n event.venue.sections.get(pk=section)\n except Section.DoesNotExist:\n return False, \"\", \"\", \"\"\n return True, event, guests, section","def has(self, key):\n return self.data.get(key, None) is not None","def check_key(request):\n try:\n access_key = request.session.get('access_key_tw', None)\n if not access_key:\n return False\n except KeyError:\n return False\n return True\n\n\t# User info","def check_fields_updated_correctly(old_user_data: user_models.User,\n updated_data_json: Dict[str, Any]) -> bool:\n\n updated_user_object = get_user_data_from_user_model(old_user_data)\n updated_user_data_dict = updated_user_object.dict()\n\n # basically just getting intersetion of keys from two dicts\n keys_to_compare = set(updated_user_data_dict).intersection(\n set(updated_data_json))\n\n try:\n is_password = lambda x: x == \"password\"\n for key in keys_to_compare:\n\n if is_password(key):\n password_str = updated_data_json[key]\n assert updated_user_object.check_password(password_str)\n continue\n\n assert updated_data_json[key] == updated_user_data_dict[key]\n return True\n except AssertionError as assert_error:\n logging.warning(f\"failed at: {assert_error}\")\n return False"],"string":"[\n \"def check_for_dict(check):\",\n \"def is_valid(data):\\n return isinstance(data, dict) \\\\\\n and \\\"u_id\\\" in data \\\\\\n and \\\"token\\\" in data \\\\\\n and isinstance(data[\\\"u_id\\\"], int) \\\\\\n and isinstance(data[\\\"token\\\"], str)\",\n \"def can_insert(data):\\n return isinstance(data, dict)\",\n \"def _is_key_value(data):\\n if data is None:\\n return False\\n return all(x in data for x in ['key', 'value'])\",\n \"def isDict(data):\\n\\ttry:\\n\\t\\tfrom types import DictType\\n\\t\\tif type(data) == DictType:\\n\\t\\t\\treturn True\\n\\texcept ImportError:\\n\\t\\tif type(data) == type({}):\\n\\t\\t\\treturn True\\n\\treturn False\",\n \"def verify_rpc_value ( user_dict ):\\n for key in user_dict:\\n if not isinstance ( user_dict[ key ], str ):\\n # Error code 422\\n raise ValueError ( 'Value of {0} is not a string'.format ( key ) )\",\n \"def _is_dict(val):\\n\\n return isinstance(val, dict)\",\n \"def sanity_check(cls, data): # no version with ID, since PUT (update) isn't allowed\\n data = _dict_sanity_check(data,\\n mandatory_keys = [\\n (\\\"user_id\\\", User.exists),\\n (\\\"customer_id\\\", Customer.exists)\\n ],\\n optional_keys = [])\\n return data, None\",\n \"def verifyData(self, expectedDict):\\n pass\",\n \"def _is_dict(item):\\n return isinstance(item, dict)\",\n \"def validate_user_request_dict(request_dict):\\n if 'first_name' not in request_dict:\\n return False\\n if 'last_name' not in request_dict:\\n return False\\n if 'id' not in request_dict:\\n return False\\n if 'email' not in request_dict:\\n return False\\n return True\",\n \"def check_user_data_in_response(response_data):\\n assert response_data[\\\"id\\\"] > 0\\n assert response_data[\\\"name\\\"] == pytest.test_user.name\\n assert response_data[\\\"email\\\"] == pytest.test_user.email\\n assert response_data[\\\"gender\\\"] == pytest.test_user.gender\\n assert response_data[\\\"status\\\"] == pytest.test_user.status\",\n \"def __is_valid_dict(self, GRFData):\\n\\n if type(GRFData) is not dict:\\n raise ValueError(\\\"Expected GRFData to be of type '{}', but received type '{}'.\\\".format(type(dict), type(GRFData)))\\n\\n for component in self.comp_list:\\n if component not in GRFData.keys():\\n raise ValueError(\\\"Component '{}' not found in GRFData.\\\".format(component))\",\n \"def is_data_true(data):\\n\\n if not data:\\n return False\\n\\n if not isinstance(data, dict):\\n if not util.get_value_from_health_internal_tuple(data):\\n return False\\n return True\\n\\n for _k in data:\\n if is_data_true(data[_k]):\\n return True\\n\\n return False\",\n \"def dict_support_required(self):\\n\\t\\treturn self.typemanager.has_dicts\",\n \"def test_process_dict_true(self):\\n\\n self.assertIn('userA@domain', self.temp_set)\",\n \"def _validate_input_dict(self, input):\\n if isinstance(input, dict):\\n required = {\\\"type\\\", \\\"value\\\"}\\n not_found = required - set(input.keys())\\n if not_found:\\n raise SpecificationError(\\n \\\"Required key(s) not found in input dictionary: {}\\\".format(\\n \\\", \\\".join(not_found)\\n )\\n )\\n else:\\n raise Exception(\\\"input element has to be a dictionary\\\")\",\n \"def valid_user_data(user_data):\\n return 'account_ids' in user_data and 'monthly_expenses' in user_data\",\n \"def is_dict(value):\\n return isinstance(value, dict)\",\n \"def _validate_dict_data(self, expected, actual):\\n for k, v in expected.iteritems():\\n if k in actual:\\n if (isinstance(v, basestring) or\\n isinstance(v, bool) or\\n isinstance(v, (int, long))):\\n if v != actual[k]:\\n return \\\"{}:{}\\\".format(k, actual[k])\\n elif not v(actual[k]):\\n return \\\"{}:{}\\\".format(k, actual[k])\\n else:\\n return \\\"key '{}' does not exist\\\".format(k)\\n return None\",\n \"def test_dictionary(self):\\n self.assertIsInstance(self.test1json, dict)\",\n \"def dict_type(verifield, required):\\n if verifield is None: return True\\n if not isinstance(verifield, dict): return False\\n all_of = [value or True for value in verifield.values() if isinstance(value, required) or value is None]\\n return not verifield or (all(all_of or [False]) and len(all_of) == len(verifield))\",\n \"def check_data_is_format(data):\\n try:\\n data_lst = data\\n if not isinstance(data, list):\\n data_lst = json.loads(data)\\n\\n for data in data_lst:\\n if not isinstance(data, dict):\\n raise ValueError(\\\"data contains not dict\\\")\\n\\n for key in data.keys():\\n check_type(key)\\n except ValueError as e:\\n logging.error(\\\"data format check error %s\\\" % e)\\n return False, None\\n except Exception as e:\\n logging.error(\\\"data format check unknown error %s\\\" % e)\\n return False, None\\n else:\\n return True, data_lst\",\n \"def is_dict(self) -> bool:\\n return True\",\n \"def _verfify_auth_and_profiles_data (self, data):\\n if type(data.get('profiles')) == dict:\\n if len(str(data.get('authURL', ''))) > 10 and len(str(data.get('authURL', ''))) < 50:\\n return True\\n return False\",\n \"def is_typed_dict(self) -> bool:\\n return True\",\n \"def params_is_valid(data):\\n if isinstance(data['title'], str) and isinstance(data['description'], str) and isinstance(data['params'], dict):\\n return True\\n else:\\n return False\",\n \"def update_response_json(user, data):\\n if type(data) == dict and type(user) == str:\\n if user in data.keys():\\n data = data[user]\\n response_json.response[user] = data\\n return response_json.response\\n return {'update': 'failed',\\n 'reason': 'data provided incorrectly formatted. \\\\\\n the data must be json formatted, and <user> must be of type string'}\",\n \"def check_if_nested(data):\\n if isinstance(data, dict):\\n for k in data:\\n if isinstance(data[k], (list, dict)):\\n return True\\n elif isinstance(data, list):\\n for i in data:\\n if isinstance(i, (list, dict)):\\n return True\\n return False\",\n \"def verifyDictTypes( template, dictToCheck ):\\n for key in dictToCheck:\\n if not ( ( isinstance( dictToCheck[ key ], list ) and\\n isinstance( template[ key ], list ) ) or\\n ( isinstance( dictToCheck[ key ], dict ) and\\n isinstance( template[ key ], dict ) ) or\\n ( isinstance( dictToCheck[ key ], template[ key ] ) ) ):\\n return False\\n\\n return True\",\n \"def _is_key_value_array(self, data):\\n for d in data:\\n if not self._is_key_value(d):\\n return False\\n return True\",\n \"def __is_key_in_json(self, key=str, json_dict=json):\\n if key in json_dict:\\n # noinspection PyUnresolvedReferences\\n return json_dict[key]\\n else:\\n return self.NO_KEY_VALUE_FOR_ENTRY\",\n \"def validate_dict(data_dict, entity):\\r\\n fields = []\\r\\n for key, value in data_dict.items():\\r\\n if not value:\\r\\n fields.append(key)\\r\\n continue\\r\\n if len(fields) > 0:\\r\\n return provide_field_value(entity, fields)\\r\\n elif key == hqAddKey:\\r\\n status = validate_hqadd(value)\\r\\n if not status == ok_str:\\r\\n return status\\r\\n elif key == logoUrlKey:\\r\\n status = validate_logourl(value)\\r\\n if not status == ok_str:\\r\\n return status\\r\\n elif key == type_key:\\r\\n status = validate_officeType(value)\\r\\n if not status == ok_str:\\r\\n return status\\r\\n elif key == name_key:\\r\\n status = None\\r\\n if entity == party_key:\\r\\n status = validate_partyname(value)\\r\\n elif entity == office_key:\\r\\n status = validate_officeName(value)\\r\\n if not status == ok_str:\\r\\n return status\\r\\n if fields:\\r\\n return provide_field_value(entity, fields)\\r\\n return ok_str\",\n \"def is_dictionary(obj):\\n return type(obj) is dict\",\n \"def is_dict(obj):\\n return type(obj) == type({})\",\n \"def assertUser(self, user): # camel case to be consistent with unittest\\n self.assertIsInstance(user, dict)\\n self.assertIn('id', user)\\n self.assertIn('nickname', user)\",\n \"def _validate_dict_entry(self, dict_entry):\\r\\n try:\\r\\n # Type-check all of the type-critical items.\\r\\n if (\\r\\n type(dict_entry[\\\"id\\\"]) == int and\\r\\n type(dict_entry[\\\"date\\\"]) == datetime.date and\\r\\n type(dict_entry[\\\"time\\\"]) == datetime.time and\\r\\n type(dict_entry[\\\"datetime\\\"]) == datetime.datetime and\\r\\n type(dict_entry[\\\"duration\\\"]) == datetime.timedelta):\\r\\n return True\\r\\n else:\\r\\n return False\\r\\n # end if\\r\\n except Exception as err:\\r\\n _z_exc(\\\"logentry.py/_validate_dict_entry\\\", err)\\r\\n # end try\\r\",\n \"def _verify_dict_field(self, _dict, name, types):\\n if type(types) != list:\\n types = [types]\\n if str in types and unicode not in types:\\n types.append(unicode)\\n if unicode in types and str not in types:\\n types.append(str)\\n self.assertTrue(name in _dict, msg=\\\"Missing field '%s'\\\" % name)\\n self.assertTrue(type(_dict[name]) in types,\\n msg=\\\"Erroneous type of the field '%s': \\\"\\n \\\"found %s, expected any of %s\\\" % (\\n name, str(type(_dict[name])), \\\",\\\".join([str(x) for x in types])))\",\n \"def validate(self, data: Dict):\\n for key in self.__dict__.keys():\\n if not key.startswith('__') and key != 'id':\\n if data[key] == '' or data[key] is None:\\n raise ValidationError(\\n message=f'{key} should not be \\\"{data[key]}\\\"'\\n )\",\n \"def clean_dict(data: dict) -> None:\\n if not isinstance(data, dict):\\n logger.warning(f\\\"Not a dictionary: {type(data)}\\\")\\n return\\n\\n data.pop(\\\"_id\\\", None)\\n data.pop(\\\"password\\\", None)\\n\\n return\",\n \"def test_good_data(self):\\n self.assertNotEqual(self.request.user.email, self.good_dict['email'])\\n self.request.json_body = deepcopy(self.good_dict)\\n result = user_id_put_view(self.request)['d']\\n self.assertEqual(result, dict_from_row(self.request.user, remove_fields=removals))\\n self.assertEqual(self.request.user.email, self.good_dict['email'])\",\n \"def test_json_representation_of_user(new_user):\\n user, user_data = new_user\\n user_json = user.json()\\n\\n acceptable_keys = 'id', 'username', 'created_at', 'is_admin'\\n unacceptable_keys = 'salt', 'password', 'hashed_password'\\n\\n assert_that(user_json).contains_value(user_data.get('username'))\\n assert_that(user_json).contains_key(*acceptable_keys)\\n assert_that(user_json).does_not_contain_key(*unacceptable_keys)\",\n \"def match(self, data_instance: Dict[str, Any]) -> bool:\",\n \"def _check_fields(self, content: JsonDict) -> None:\\n self.assertIn(\\\"id\\\", content)\\n self.assertIn(\\\"received_ts\\\", content)\\n self.assertIn(\\\"room_id\\\", content)\\n self.assertIn(\\\"event_id\\\", content)\\n self.assertIn(\\\"user_id\\\", content)\\n self.assertIn(\\\"sender\\\", content)\\n self.assertIn(\\\"canonical_alias\\\", content)\\n self.assertIn(\\\"name\\\", content)\\n self.assertIn(\\\"event_json\\\", content)\\n self.assertIn(\\\"score\\\", content)\\n self.assertIn(\\\"reason\\\", content)\\n self.assertIn(\\\"auth_events\\\", content[\\\"event_json\\\"])\\n self.assertIn(\\\"type\\\", content[\\\"event_json\\\"])\\n self.assertIn(\\\"room_id\\\", content[\\\"event_json\\\"])\\n self.assertIn(\\\"sender\\\", content[\\\"event_json\\\"])\\n self.assertIn(\\\"content\\\", content[\\\"event_json\\\"])\",\n \"def isJWE_unserialized_single(x):\\n if isinstance(x, dict) \\\\\\n and (\\\"unprotected\\\" in x or \\\"protected\\\" in x) \\\\\\n and (\\\"ciphertext\\\" in x):\\n try:\\n if \\\"protected\\\" in x:\\n json.loads(x[\\\"protected\\\"])\\n return True\\n except:\\n return False\\n else:\\n return False\",\n \"def has_value(value):\\n return IsDictContainingValue(wrap_matcher(value))\",\n \"def validate_json(data: dict) -> bool:\\n try:\\n assert \\\"data\\\" in data.keys()\\n assert isinstance(data[\\\"data\\\"], str)\\n assert \\\"command\\\" in data.keys()\\n assert isinstance(data[\\\"command\\\"], str)\\n assert \\\"time\\\" in data.keys()\\n assert isinstance(data[\\\"time\\\"], str)\\n assert \\\"origin\\\" in data.keys()\\n assert isinstance(data[\\\"origin\\\"], str)\\n return True\\n except AssertionError:\\n return False\",\n \"def verify_object(self, data):\\n rv = self.get(data[self.id_field])\\n result = not is_404(rv)\\n if result:\\n for key, value in data:\\n if not in_response(rv, value):\\n return False\\n return result\",\n \"def is_data_response(resp: Response, data_field: str = None) -> bool:\\n\\n return \\\\\\n resp and \\\\\\n is_dict(resp) and \\\\\\n is_success_response(resp) and \\\\\\n resp.get(\\\"data\\\") is not None and \\\\\\n (not data_field or data_field in resp.get(\\\"data\\\"))\",\n \"def _import(self, data):\\n if isinstance(data, dict):\\n if len(data):\\n for key in data:\\n if data.get(key) is not None:\\n if not self.set(key, data.get(key)):\\n raise Exception('%s %s icin dogru bir veri degil.' % (data.get(key), key))\",\n \"def checkOpsimData(self, otherdata=None):\\n data2check = self.opsim_data\\n if otherdata:\\n data2check = otherdata\\n if type(data2check) != list:\\n if type(data2check) == dict:\\n if set(self._opsim_keys).issubset(set(data2check.keys())):\\n return True, 'good'\\n else:\\n return False, 'Data is not complete'\\n else:\\n return False, 'Data is not a list nor a dictionary'\\n else:\\n nodict = 0\\n baddict = 0\\n for data in data2check:\\n if type(data) != dict:\\n nodict += 1\\n else:\\n if not set(self._opsim_keys).issubset(set(data.keys())):\\n baddict += 1\\n if (nodict == 0 and baddict == 0):\\n return True, 'good'\\n else:\\n statement = '{0} non dictionary element(s) and {1} uncomplete\\\\\\n dictionary(ies) in data list'.format(nodict, baddict)\\n return (False, statement)\",\n \"def parse_user_dict(self, line):\\n pass\",\n \"def isJWS_unserialized_single(x):\\n if isinstance(x, dict) \\\\\\n and \\\"payload\\\" in x and \\\"signature\\\" in x \\\\\\n and (\\\"protected\\\" in x or \\\"unprotected\\\" in x):\\n try: \\n if \\\"protected\\\" in x: \\n json.loads(x[\\\"protected\\\"])\\n return True\\n except:\\n return False\\n else: \\n return False\",\n \"def handle_input(data: dict):\",\n \"def assertContainsDict(self, dictionary, data):\\n for key in dictionary:\\n self.assertTrue(key in data, msg=\\\"Data doesn't have key '{}'\\\".format(key))\\n value = dictionary[key]\\n value2 = data[key]\\n self.assertEqual(value, value2,\\n msg=\\\"key={}, value={} != target={}\\\".format(key, value, value2))\",\n \"def rule_00_config_is_dict(session):\\n return isinstance(session[\\\"config\\\"], dict)\",\n \"def test_input_text_returned_in_response_data(self):\\n user_name = \\\"Ron Obvious\\\"\\n user_input = \\\"Hello!\\\"\\n\\n data = self.chatbot.get_response_data(user_name, user_input)\\n\\n self.assertIn(user_input, data[\\\"user\\\"].keys())\",\n \"def has_dict_keys(self, dict_in_pointer):\\n if type(dict_in_pointer)==str:\\n dict_in_pointer = [dict_in_pointer]\\n if type(dict_in_pointer)==dict:\\n dict_in_pointer = dict_in_pointer.keys()\\n if type(dict_in_pointer)!=list:\\n return None\\n start = self.head\\n while start:\\n if dict_in_pointer==start.getMember():\\n return start\\n start = start.getLink()\\n return None\",\n \"def missing_data(self, data):\\n missing_fields = []\\n for key in data:\\n if not key in request.json:\\n missing_fields.append(key)\\n if missing_fields:\\n message = 'Missing ' + ', '.join(missing_fields)\\n return self.bad_request(message)\\n return None\",\n \"def hasCustomData( self, key ):\\n return str(key) in self._customData\",\n \"def _dict_sanity_check(data, mandatory_keys, optional_keys, obj=None):\\n # Both mandatory and optional key lists contain tuples, with key name being the first\\n # element in each tuple. The validator is not needed for the mandatory / optional key\\n # check, so we can ignore it here.\\n missing_keys = [k for k, _ in mandatory_keys if k not in data]\\n if missing_keys:\\n raise ValueError(f\\\"missing mandatory key(s): {', '.join(missing_keys)}\\\")\\n\\n # Create a lookup of key name to validator function. The lookup will have an entry for all\\n # possible keys, so we can also use it to check if we have any invalid keys.\\n keys_to_validators = dict(mandatory_keys + optional_keys)\\n always_allowed = [\\\"id\\\", \\\"_created\\\", \\\"_updated\\\", \\\"_links\\\", \\\"_embedded\\\"]\\n invalid_keys = [k for k in data\\n if k not in keys_to_validators and k not in always_allowed]\\n if invalid_keys:\\n raise ValueError(f\\\"invalid key(s) in request body: {', '.join(invalid_keys)}\\\")\\n\\n # Now we individually call the validators on all values in the data, producing a useful\\n # error message if possible\\n res = {}\\n for key, value in data.items():\\n try:\\n res[key] = keys_to_validators[key](value)\\n except ValueError as ex:\\n raise ValueError(f\\\"key '{key}': {str(ex)}\\\")\\n\\n now_time_string = datetime.datetime.now().isoformat()\\n if obj is None:\\n res['_created'] = now_time_string\\n res['_updated'] = now_time_string\\n return res\",\n \"def test_user_info(user_keys):\\n\\n pyme_instance = PyMe(206946886)\\n response = pyme_instance.display()\\n\\n assert isinstance(response, dict)\\n assert response['id'] == 206946886, \\\"The ID of the user should be in the response\\\"\\n assert set(user_keys).issubset(response.keys()), \\\"All keys should be in the response\\\"\",\n \"def everything_is_unicode(d: dict) -> bool:\\n for k, v in d.items():\\n if isinstance(v, dict) and k != \\\"headers\\\":\\n if not everything_is_unicode(v):\\n return False\\n elif isinstance(v, list):\\n for i in v:\\n if isinstance(i, dict) and not everything_is_unicode(i):\\n return False\\n elif isinstance(i, bytes):\\n return False\\n elif isinstance(v, bytes):\\n return False\\n return True\",\n \"def isdictinstance(obj):\\n return isinstance(obj, dict) or isinstance(obj, DotDict)\",\n \"def test_metadata_fonts_items_dicts(self):\\n for x in self.metadata.get('fonts', None):\\n self.assertEqual(type(x), type({}), msg=\\\"type(%s) is not dict\\\" % x)\",\n \"def _check_user_entry(user):\\n if \\\"tenant_name\\\" in user:\\n keys = set(user.keys())\\n if keys == {\\\"username\\\", \\\"password\\\", \\\"tenant_name\\\",\\n \\\"project_domain_name\\\", \\\"user_domain_name\\\"}:\\n if (user[\\\"user_domain_name\\\"] == \\\"\\\"\\n and user[\\\"project_domain_name\\\"] == \\\"\\\"):\\n # it is credentials of keystone v2 and they were created\\n # --fromenv\\n del user[\\\"user_domain_name\\\"]\\n del user[\\\"project_domain_name\\\"]\\n return True\\n else:\\n # it looks like keystone v3 credentials\\n user[\\\"project_name\\\"] = user.pop(\\\"tenant_name\\\")\\n return True\",\n \"def test_dict(self, dictionary: dict) -> None:\\r\\n if not isinstance(dictionary, dict):\\r\\n raise ValueError(f'Expected dictionary, but received {type(dictionary)}')\\r\\n for key, value in dictionary.items():\\r\\n conditional_check(key, self.case_check, self.ignored_keys)\\r\\n if isinstance(value, dict):\\r\\n self.test_dict(dictionary=value)\\r\\n elif isinstance(value, list):\\r\\n self.test_list(items=value)\",\n \"def validate_transaction_dict(request_dict):\\n if 'id' not in request_dict:\\n return False\\n if 'user_id' not in request_dict:\\n return False\\n if 'amount' not in request_dict:\\n return False\\n if 'date' not in request_dict:\\n return False\\n return True\",\n \"def test_process_dict_false(self):\\n\\n self.assertNotIn('userB@domain', self.temp_set)\",\n \"def validate_dto(cls, data: dict) -> bool:\\n\\n required_keys = {'signature', 'signer'}\\n return (\\n cls.validate_dto_required(data, required_keys)\\n and cls.validate_dto_all(data, required_keys)\\n )\",\n \"def isdict(val: Any) -> bool:\\n return isinstance(val, MutableMapping)\",\n \"def is_sync_service_data(values):\\n if not isinstance(values, dict):\\n return False\\n\\n for acr, users in values.items():\\n if not isinstance(acr, (str, unicode)) or not isinstance(users, list):\\n return False\\n\\n return True\",\n \"def get_if_exist(self, data, key):\\n if key in data:\\n return data[key]\\n return None\",\n \"def _check_keys(self, dict, filetype):\\n self.filetype = filetype\\n for key in dict:\\n if isinstance(dict[key], scipy.io.matlab.mio5_params.mat_struct):\\n dict[key] = self._todict(dict[key], self.filetype)\\n return dict\",\n \"def check_dict(dic, validator, messages):\\n check_dict_alg(dic, validator, [], messages, validator, \\\"NoObject\\\")\",\n \"def isJWP_unserialized(x):\\n if isinstance(x, dict) \\\\\\n and \\\"payload\\\" in x and isinstance(x[\\\"unprotected\\\"], dict)\\\\\\n and \\\"unprotected\\\" in x and \\\"signature\\\" not in x:\\n return True\\n else:\\n return False\",\n \"def __getitem__(self, key):\\n return self._user_data.get(key)\",\n \"def test_dict(self, testdata: TestData) -> None:\\n for data in testdata['observation_type']:\\n observation_type = ObservationType.from_dict(data)\\n assert data == observation_type.to_dict()\",\n \"def _check_keys(dict):\\n for key in dict.keys():\\n if isinstance(dict[key], sio.matlab.mio5_params.mat_struct):\\n dict[key] = _todict(dict[key])\\n return dict\",\n \"def check_data(cls, database, data):\\n if not data:\\n abort(204, 'No data received')\\n entity = {}\\n try:\\n entity = loads(data)\\n except:\\n print \\\"erreur chargement json %s\\\" % (data,)\\n abort(404, 'Error on loading data')\\n mapper = inspect(database)\\n orm_data = {}\\n for column in mapper.attrs:\\n if isinstance(column, ColumnProperty) and \\\\\\n not column.columns[0].nullable and \\\\\\n not column.columns[0].foreign_keys and \\\\\\n not column.columns[0].primary_key:\\n orm_data[column.key] = column.columns[0].nullable\\n else:\\n pass\\n for field in orm_data.iterkeys():\\n if entity.has_key(field):\\n #del(orm_data[column])\\n pass\\n else:\\n return False\\n return entity\",\n \"def validate(self, data):\\n # if data['is_private'] and data['contestants']:\\n # raise serializers.ValidationError(\\\"Can not be private and compete for an award.\\\")\\n return data\",\n \"def _normalize(empty, user_data):\\n if isinstance(user_data, UserData):\\n return user_data.to_dict()\\n if isinstance(user_data, dict):\\n return _dict_to_dict(empty, user_data)\\n if isinstance(user_data, (bytes, bytearray)):\\n return _bytes_to_dict(empty, user_data)\\n if user_data is None:\\n return empty\\n raise ValueError\",\n \"def dict_check(*args, func=None):\\n func = func or inspect.stack()[2][3]\\n for var in args:\\n if not isinstance(var, (dict, collections.UserDict, collections.abc.MutableMapping)):\\n name = type(var).__name__\\n raise DictError(\\n 'Function {} expected dict, {} got instead.'.format(func, name))\",\n \"def is_item_in_the_response(key, value, jsonResponse):\\n flag = False\\n for item in jsonResponse:\\n if type(jsonResponse[item]) == int:\\n if item == key and jsonResponse[item] == int(value):\\n flag = True\\n\\n if type(jsonResponse[item]) == str:\\n if item == key and jsonResponse[item] == str(value):\\n flag = True\\n\\n if type(jsonResponse[item]) == bool:\\n if item == key and jsonResponse[item] == bool(value):\\n flag = True\\n else:\\n #log and error\\n pass\\n return flag\",\n \"def _check_data_type(self, key: str, value: Any):\\n allowedDataType = from_dot_notation(\\n field=\\\".\\\".join([*self.parents, key]), obj=self.definition\\n ).get(\\\"allowedDataType\\\", None)\\n if allowedDataType is not None and not isinstance(value, allowedDataType):\\n raise Exception(\\n f\\\"Value '{value}' is not of the correct type. The allowed data type is: {allowedDataType.__name__}\\\"\\n )\",\n \"def test_postive_get_auth_horizon_check_keys(self):\\n r = self.res.get('/auth/config/'+utils.partner, headers=utils.headers)\\n logging.info(\\\"Return response is '%s'\\\" % r)\\n # convert string to dictionary\\n rd = ast.literal_eval(r)\\n logging.info(\\\"Return response in dictionary format is '%s'\\\" % rd)\\n self.assertEqual(self.res.response.status, 200)\\n keys = ['type', 'web_endpoint', 'client_endpoint', 'org_name']\\n self.assertTrue(utils.is_same_array(keys, rd.keys()), \\\"Keys are not correct!\\\")\",\n \"def has_dict(self, dict_in_pointer):\\n if type(dict_in_pointer)!=dict:\\n return None\\n start = self.head\\n while start:\\n if dict_in_pointer==start.getMember():\\n return start\\n start = start.getLink()\\n return None\",\n \"def check_dictionary(self, dico):\\n if dico is not None:\\n self.log.info('Check the dictionary')\\n test, aff = validate(dico, proto_domain, test_comp = False)\\n if test:\\n self.log.info(aff)\\n else:\\n self.log.error(aff)\\n sys.exit()\",\n \"def test_obj_dict(self):\\n obj = storage.all()\\n self.assertIsInstance(obj, dict)\",\n \"def test_export_data_none(self) -> None:\\n user_data = user_models.ExpUserLastPlaythroughModel.export_data(\\n self.NONEXISTENT_USER_ID)\\n expected_data: Dict[str, Dict[str, str]] = {}\\n self.assertEqual(expected_data, user_data)\",\n \"def validate(self, data):\\n password1 = data.get('password1')\\n password2 = data.get('password2')\\n\\n if password1 is None:\\n raise serializers.ValidationError(\\\"KeyError: password1 does not exist.\\\")\\n\\n if password2 is None:\\n raise serializers.ValidationError(\\\"KeyError: password2 does not exist\\\")\\n\\n if password1 != password2:\\n raise serializers.ValidationError(\\\"The two password fields didn't match.\\\")\\n return data\",\n \"def _is_valid_dict(content_type: str) -> bool:\\n content_type = content_type.strip()\\n\\n if not content_type.startswith(\\\"pt:dict\\\"):\\n return False\\n\\n if not _has_matched_brackets(content_type):\\n return False\\n\\n if not _has_brackets(content_type):\\n return False\\n\\n sub_types = _get_sub_types_of_compositional_types(content_type)\\n if len(sub_types) != 2:\\n return False\\n\\n sub_type_1 = sub_types[0]\\n sub_type_2 = sub_types[1]\\n return _is_valid_pt(sub_type_1) and _is_valid_pt(sub_type_2)\",\n \"def _get_user_data(self):\\n return {\\\"key\\\": self._key}\",\n \"def get_user_data(self, key, default=None):\\n if not isinstance(self._user_data, dict):\\n return default\\n return self._user_data.get(key)\",\n \"def has_data(self, *args, **kwargs):\\n return False\",\n \"def test_dict(self, obj: dict) -> None:\\r\\n properties = read_properties(obj)\\r\\n for key, value in properties.items():\\r\\n conditional_check(key, self.case_check, self.ignored_keys)\\r\\n if read_type(value) == 'object':\\r\\n logger.debug('dict -> dict')\\r\\n self.test_dict(obj=value)\\r\\n elif read_type(value) == 'array':\\r\\n logger.debug('dict -> list')\\r\\n self.test_list(array=value)\",\n \"def validate_data(self, data):\\n try:\\n event_id = data[\\\"event\\\"]\\n guests = data[\\\"guests\\\"]\\n section = data.get(\\\"section\\\", None)\\n except KeyError:\\n return False, \\\"\\\", \\\"\\\", \\\"\\\"\\n try:\\n event = Event.objects.get(pk=event_id)\\n except Event.DoesNotExist:\\n return False, \\\"\\\", \\\"\\\", \\\"\\\"\\n if not isinstance(guests, list):\\n return False, \\\"\\\", \\\"\\\", \\\"\\\"\\n if section is not None:\\n try:\\n event.venue.sections.get(pk=section)\\n except Section.DoesNotExist:\\n return False, \\\"\\\", \\\"\\\", \\\"\\\"\\n return True, event, guests, section\",\n \"def has(self, key):\\n return self.data.get(key, None) is not None\",\n \"def check_key(request):\\n try:\\n access_key = request.session.get('access_key_tw', None)\\n if not access_key:\\n return False\\n except KeyError:\\n return False\\n return True\\n\\n\\t# User info\",\n \"def check_fields_updated_correctly(old_user_data: user_models.User,\\n updated_data_json: Dict[str, Any]) -> bool:\\n\\n updated_user_object = get_user_data_from_user_model(old_user_data)\\n updated_user_data_dict = updated_user_object.dict()\\n\\n # basically just getting intersetion of keys from two dicts\\n keys_to_compare = set(updated_user_data_dict).intersection(\\n set(updated_data_json))\\n\\n try:\\n is_password = lambda x: x == \\\"password\\\"\\n for key in keys_to_compare:\\n\\n if is_password(key):\\n password_str = updated_data_json[key]\\n assert updated_user_object.check_password(password_str)\\n continue\\n\\n assert updated_data_json[key] == updated_user_data_dict[key]\\n return True\\n except AssertionError as assert_error:\\n logging.warning(f\\\"failed at: {assert_error}\\\")\\n return False\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.719985","0.7077056","0.6867152","0.6618034","0.6470574","0.63971496","0.63777405","0.63742024","0.63429755","0.63425326","0.62384546","0.6238243","0.61970216","0.6187313","0.6175904","0.61512995","0.6139445","0.6129756","0.610137","0.6098412","0.6043313","0.60295683","0.6013052","0.597079","0.5963954","0.5947398","0.5927177","0.5924112","0.59203804","0.58964926","0.5890138","0.58770454","0.586571","0.58592165","0.58560395","0.5853215","0.584921","0.58411944","0.5820981","0.57644534","0.57629895","0.5761087","0.57549345","0.57439667","0.5742135","0.5731169","0.57243556","0.5707997","0.570401","0.57017344","0.569077","0.568537","0.56817365","0.5668661","0.5666086","0.566288","0.56624734","0.566032","0.56579936","0.56528544","0.56448936","0.5630685","0.562969","0.56278855","0.5621436","0.5618712","0.5608061","0.5603161","0.55998206","0.55945784","0.5574706","0.55725884","0.5555796","0.55363643","0.55334955","0.552803","0.5524321","0.5518366","0.5518122","0.55135566","0.55099106","0.5499479","0.5495527","0.54948694","0.54825133","0.5481502","0.5478038","0.5475902","0.54735476","0.5469913","0.54618895","0.54563254","0.54368514","0.5412439","0.54049957","0.53934026","0.53924656","0.5387306","0.5386386","0.53858083"],"string":"[\n \"0.719985\",\n \"0.7077056\",\n \"0.6867152\",\n \"0.6618034\",\n \"0.6470574\",\n \"0.63971496\",\n \"0.63777405\",\n \"0.63742024\",\n \"0.63429755\",\n \"0.63425326\",\n \"0.62384546\",\n \"0.6238243\",\n \"0.61970216\",\n \"0.6187313\",\n \"0.6175904\",\n \"0.61512995\",\n \"0.6139445\",\n \"0.6129756\",\n \"0.610137\",\n \"0.6098412\",\n \"0.6043313\",\n \"0.60295683\",\n \"0.6013052\",\n \"0.597079\",\n \"0.5963954\",\n \"0.5947398\",\n \"0.5927177\",\n \"0.5924112\",\n \"0.59203804\",\n \"0.58964926\",\n \"0.5890138\",\n \"0.58770454\",\n \"0.586571\",\n \"0.58592165\",\n \"0.58560395\",\n \"0.5853215\",\n \"0.584921\",\n \"0.58411944\",\n \"0.5820981\",\n \"0.57644534\",\n \"0.57629895\",\n \"0.5761087\",\n \"0.57549345\",\n \"0.57439667\",\n \"0.5742135\",\n \"0.5731169\",\n \"0.57243556\",\n \"0.5707997\",\n \"0.570401\",\n \"0.57017344\",\n \"0.569077\",\n \"0.568537\",\n \"0.56817365\",\n \"0.5668661\",\n \"0.5666086\",\n \"0.566288\",\n \"0.56624734\",\n \"0.566032\",\n \"0.56579936\",\n \"0.56528544\",\n \"0.56448936\",\n \"0.5630685\",\n \"0.562969\",\n \"0.56278855\",\n \"0.5621436\",\n \"0.5618712\",\n \"0.5608061\",\n \"0.5603161\",\n \"0.55998206\",\n \"0.55945784\",\n \"0.5574706\",\n \"0.55725884\",\n \"0.5555796\",\n \"0.55363643\",\n \"0.55334955\",\n \"0.552803\",\n \"0.5524321\",\n \"0.5518366\",\n \"0.5518122\",\n \"0.55135566\",\n \"0.55099106\",\n \"0.5499479\",\n \"0.5495527\",\n \"0.54948694\",\n \"0.54825133\",\n \"0.5481502\",\n \"0.5478038\",\n \"0.5475902\",\n \"0.54735476\",\n \"0.5469913\",\n \"0.54618895\",\n \"0.54563254\",\n \"0.54368514\",\n \"0.5412439\",\n \"0.54049957\",\n \"0.53934026\",\n \"0.53924656\",\n \"0.5387306\",\n \"0.5386386\",\n \"0.53858083\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.75419945"},"document_rank":{"kind":"string","value":"0"}}},{"rowIdx":6099,"cells":{"query":{"kind":"string","value":"Return key from user_data if it's a dict"},"document":{"kind":"string","value":"def get_user_data(self, key, default=None):\n if not isinstance(self._user_data, dict):\n return default\n return self._user_data.get(key)"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["def __getitem__(self, key):\n return self._user_data.get(key)","def _get_user_data(self):\n return {\"key\": self._key}","def get(self, key):\n return self._user_data.get(key)","def _get_key(self, object_type, user_key = None):\n\t\tif not user_key and not self.object_type_keys.has_key(object_type):\n\t\t\traise ParserError(\"Unknown key for object type: %s\\n\" % object_type)\n\n\t\t## Use a default key\n\t\tif not user_key:\n\t\t\tuser_key = self.object_type_keys[object_type]\n\n\t\treturn user_key","def get_key_from_data_dict(data: dict, key: str):\n retrieved_key = data.get(key, None)\n if not retrieved_key:\n LOG.info(\n f\"Could not get key {key} from request to the API. Data received: {data}\"\n )\n return retrieved_key","def key_data(self) -> Optional[pulumi.Input[str]]:\n return pulumi.get(self, \"key_data\")","def get_key(self, user):\r\n from delicious_cake.models import ApiKey\r\n\r\n try:\r\n key = ApiKey.objects.get(user=user)\r\n except ApiKey.DoesNotExist:\r\n return False\r\n\r\n return key.key","def get_if_exist(self, data, key):\n if key in data:\n return data[key]\n return None","def __is_key_in_json(self, key=str, json_dict=json):\n if key in json_dict:\n # noinspection PyUnresolvedReferences\n return json_dict[key]\n else:\n return self.NO_KEY_VALUE_FOR_ENTRY","def data_key(self):\n raise NotImplementedError","def datakey(self) -> pulumi.Input[str]:\n return pulumi.get(self, \"datakey\")","def _get_user_id(self, user: Optional[Dict[str, Any]]) -> Optional[str]:\n return user[\"id\"] if user and \"id\" in user else None","def has_user_data(self, key):\n return isinstance(self._user_data, dict) and key in self._user_data","def fetch(self, key: object, default=None):\n return self._user_data.get(key, default)","def get_key(dictionary: dict, *args) -> Union[str, bool, dict]:\n data = reduce(lambda c, k: c.get(k, {}), args, dictionary)\n if data == {}:\n return \"\"\n return data","def key(self):\n if \"key\" in self._prop_dict:\n return self._prop_dict[\"key\"]\n else:\n return None","def __getitem__(self, key):\n return self.data.get(key, '')","def getType(self):\n if self.use_dic:\n data = self.dic.keys()[0]\n act = self.dic[data].keys()[0]\n return self.dic[data][act].keys()[0]\n else:\n return None","def key_data(self) -> pulumi.Input[str]:\n return pulumi.get(self, \"key_data\")","def key_data(self) -> pulumi.Input[str]:\n return pulumi.get(self, \"key_data\")","def user_data(self) -> Optional[pulumi.Input[str]]:\n return pulumi.get(self, \"user_data\")","def user_data(self) -> Optional[pulumi.Input[str]]:\n return pulumi.get(self, \"user_data\")","def extract_backing_type(value: dict) -> str:\n return next(iter(value.keys()))","def get_key(self, item):\r\n return item[0]","def _get_user_id(user_data: dict):\n data = json.dumps(user_data).encode('utf-8')\n hashed_data = hashlib.sha256()\n hashed_data.update(data)\n return hashed_data.hexdigest()","def get_userdata(self, nick, datakey):\n nickkey = irc.strings.lower(nick)\n data = None\n if nickkey in self.users and datakey in self.users[nickkey]:\n data = self.users[nickkey][datakey]\n return data","def meta_value(request_object, dictkey):\n \n try:\n val = request_object.META[dictkey]\n except: # Exception as ex:\n val = ''\n return val","def getUserFromKey(key):\n\t\t#get(Key(key))\n\t\t#return None if no user found","def check_user_type(self): # FIXME Buggy as screen_name can be int\n try:\n int(self.user)\n return {'user_id': self.user}\n except ValueError:\n return {'screen_name': self.user}","def key(self) -> Optional[pulumi.Input[str]]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[pulumi.Input[str]]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[pulumi.Input[str]]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[pulumi.Input[str]]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[pulumi.Input[str]]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[pulumi.Input[str]]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[pulumi.Input[str]]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[pulumi.Input[str]]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[pulumi.Input[str]]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[pulumi.Input[str]]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[pulumi.Input[str]]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[pulumi.Input[str]]:\n return pulumi.get(self, \"key\")","def extract_user_short(data):\n user_pk = data.get(\"id\", data.get(\"pk\"))\n assert user_pk, 'User without pk \"%s\"' % data\n return {\n \"pk\": int(user_pk),\n \"username\": data[\"username\"],\n \"full_name\": data[\"full_name\"],\n \"is_private\": data.get(\"is_private\"),\n \"profile_pic_url\": data[\"profile_pic_url\"],\n \"is_verified\": data.get(\"is_verified\"),\n # \"is_unpublished\": data.get(\"is_unpublished\"),\n }","def getKey(instance):\n return instance['name']","def key(self) -> Optional[str]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[str]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[str]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[str]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[str]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[str]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[str]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[str]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[str]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[str]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[str]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[str]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[str]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[str]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[str]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[str]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[str]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[str]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[str]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[str]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[str]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[str]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[str]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[str]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[str]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[str]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[str]:\n return pulumi.get(self, \"key\")","def key(self) -> Optional[str]:\n return pulumi.get(self, \"key\")","def get_value(self) -> Dict[str, any]:","def __parse_user_id(self, data):\n if 'user_id' in data:\n return data['user_id']\n if 'user' in data:\n return data['user']['id']\n return None","def key(self):\n return self.value()._key","def getRetKey(dictionary):\n retKey = \"\"\n try:\n if dictionary:\n retKey = dictionary.values()[0].keys()[0]\n except TypeError:\n logging.debug(\"type error\")\n\n return retKey","def key(key):\n return key","def user_id(self):\n return json_loads(self.user_json).get('id')","def __getitem__(self, key):\r\n if key == 'name':\r\n return self.name\r\n elif key == 'type':\r\n return self.type\r\n elif key == 'tab_id':\r\n return self.tab_id\r\n else:\r\n raise KeyError('Key {0} not present in tab {1}'.format(key, self.to_json()))","def make_external_key(self, data):\n return data['key']","def key_object_name(self) -> Optional[pulumi.Input[str]]:\n return pulumi.get(self, \"key_object_name\")","def get_key(self, user, api_key):\n return True","def object_key(self) -> str:\n return self._values.get('object_key')","def get_user_info_by_id(self, user_id: int) -> dict:","def check_for_dict(check):","def _access_dict(self, d, key):\n try:\n # try to get access to the value by using the key\n value = d[key]\n return value\n except:\n # fail to access the value from the key\n # namely, the feature does not exist in the \n # feature dictionary of a specific apartment\n return None","def key_type(self) -> global___Type:","def key(self) -> \"str\":\n return self._attrs.get(\"key\")","def _get_key(name, obj):\r\n wanted_key = 'data'\r\n if isinstance(obj, h5py.Group):\r\n for key, val in list(obj.items()):\r\n if key == wanted_key:\r\n if isinstance(obj[key], h5py.Dataset):\r\n key_path = obj.name + \"/\" + key\r\n return key_path","def __getattr__(self, key):\n if key == 'user_data':\n if key in self.data:\n return self.data[key]\n api = ApiClient()\n user_json = api.rest(self.url + '/user_data.json')\n self.user_data = UserData(json.loads(user_json), self.url)\n return self.user_data\n\n return super(Template, self).__getattr__(key)","def has_dict_keys(self, dict_in_pointer):\n if type(dict_in_pointer)==str:\n dict_in_pointer = [dict_in_pointer]\n if type(dict_in_pointer)==dict:\n dict_in_pointer = dict_in_pointer.keys()\n if type(dict_in_pointer)!=list:\n return None\n start = self.head\n while start:\n if dict_in_pointer==start.getMember():\n return start\n start = start.getLink()\n return None","def get_in(self, key=None, default=None):\n if key is None:\n raise KeyError(\"'Dict' attribute key can't be empty\")\n key_list = key.strip().split('.')\n data = self\n size = len(key_list)\n for index, k in enumerate(key_list):\n data = data.get(k)\n if index < size-1 and not isinstance(data, dict):\n return default\n return data","def to_internal_value(self, data):\n try:\n if not isinstance(data, dict) or \"id\" not in data:\n raise TypeError\n return super().to_internal_value(data[\"id\"])\n except (TypeError, ValueError):\n self.fail(\"incorrect_type\", data_type=type(data).__name__)","def __getitem__(self, key):\n if isinstance(key, str):\n phone = EntityDatabase.parse_phone(key)\n if phone:\n return self._phone_id[phone]\n else:\n key = key.lstrip('@').lower()\n return self._entities[self._username_id[key]]\n\n if isinstance(key, int):\n return self._entities[key] # normal IDs are assumed users\n\n if isinstance(key, TLObject):\n sc = type(key).SUBCLASS_OF_ID\n if sc == 0x2d45687:\n # Subclass of \"Peer\"\n return self._entities[utils.get_peer_id(key, add_mark=True)]\n elif sc in {0x2da17977, 0xc5af5d94, 0x6d44b7db}:\n # Subclass of \"User\", \"Chat\" or \"Channel\"\n return key\n\n raise KeyError(key)","def user_display_name(self):\n return self.key.id()","def _convert_dict_key(self, string):\r\n try:\r\n # Don't do any of this if the string is empty or None.\r\n if string is None:\r\n return None\r\n # If the string represents a container, convert it.\r\n elif string[0] in [\"(\", \"[\", \"{\"]:\r\n string = (\r\n str_utils.str_to_container(string))\r\n # Try other type conversions. Any that fail will leave the\r\n # variable untouched.\r\n else:\r\n string = str_utils.str_to_num(string)\r\n string = (\r\n str_utils.str_to_datetime(string))\r\n string = str_utils.str_to_bool(string)\r\n # end if\r\n return string\r\n except Exception as err:\r\n _z_exc(\"logentry.py/convert_dict_key\", err)\r\n # end try\r","def get_metadata(resource, key, default_value):\n if ('object' in resource and 'user_metadata' in resource['object'] and\n key in resource['object']['user_metadata']):\n return resource['object']['user_metadata'][key]\n return default_value","def get_key(self):\n return self._determine_key()","def username(self):\n return json_loads(self.user_json).get('username')","def get(self, key: t.Hashable) -> t.Any:","def get_key(self, role):\n\n for key, role_name in self.assignable_roles[0].items():\n if role_name == role.name:\n return key"],"string":"[\n \"def __getitem__(self, key):\\n return self._user_data.get(key)\",\n \"def _get_user_data(self):\\n return {\\\"key\\\": self._key}\",\n \"def get(self, key):\\n return self._user_data.get(key)\",\n \"def _get_key(self, object_type, user_key = None):\\n\\t\\tif not user_key and not self.object_type_keys.has_key(object_type):\\n\\t\\t\\traise ParserError(\\\"Unknown key for object type: %s\\\\n\\\" % object_type)\\n\\n\\t\\t## Use a default key\\n\\t\\tif not user_key:\\n\\t\\t\\tuser_key = self.object_type_keys[object_type]\\n\\n\\t\\treturn user_key\",\n \"def get_key_from_data_dict(data: dict, key: str):\\n retrieved_key = data.get(key, None)\\n if not retrieved_key:\\n LOG.info(\\n f\\\"Could not get key {key} from request to the API. Data received: {data}\\\"\\n )\\n return retrieved_key\",\n \"def key_data(self) -> Optional[pulumi.Input[str]]:\\n return pulumi.get(self, \\\"key_data\\\")\",\n \"def get_key(self, user):\\r\\n from delicious_cake.models import ApiKey\\r\\n\\r\\n try:\\r\\n key = ApiKey.objects.get(user=user)\\r\\n except ApiKey.DoesNotExist:\\r\\n return False\\r\\n\\r\\n return key.key\",\n \"def get_if_exist(self, data, key):\\n if key in data:\\n return data[key]\\n return None\",\n \"def __is_key_in_json(self, key=str, json_dict=json):\\n if key in json_dict:\\n # noinspection PyUnresolvedReferences\\n return json_dict[key]\\n else:\\n return self.NO_KEY_VALUE_FOR_ENTRY\",\n \"def data_key(self):\\n raise NotImplementedError\",\n \"def datakey(self) -> pulumi.Input[str]:\\n return pulumi.get(self, \\\"datakey\\\")\",\n \"def _get_user_id(self, user: Optional[Dict[str, Any]]) -> Optional[str]:\\n return user[\\\"id\\\"] if user and \\\"id\\\" in user else None\",\n \"def has_user_data(self, key):\\n return isinstance(self._user_data, dict) and key in self._user_data\",\n \"def fetch(self, key: object, default=None):\\n return self._user_data.get(key, default)\",\n \"def get_key(dictionary: dict, *args) -> Union[str, bool, dict]:\\n data = reduce(lambda c, k: c.get(k, {}), args, dictionary)\\n if data == {}:\\n return \\\"\\\"\\n return data\",\n \"def key(self):\\n if \\\"key\\\" in self._prop_dict:\\n return self._prop_dict[\\\"key\\\"]\\n else:\\n return None\",\n \"def __getitem__(self, key):\\n return self.data.get(key, '')\",\n \"def getType(self):\\n if self.use_dic:\\n data = self.dic.keys()[0]\\n act = self.dic[data].keys()[0]\\n return self.dic[data][act].keys()[0]\\n else:\\n return None\",\n \"def key_data(self) -> pulumi.Input[str]:\\n return pulumi.get(self, \\\"key_data\\\")\",\n \"def key_data(self) -> pulumi.Input[str]:\\n return pulumi.get(self, \\\"key_data\\\")\",\n \"def user_data(self) -> Optional[pulumi.Input[str]]:\\n return pulumi.get(self, \\\"user_data\\\")\",\n \"def user_data(self) -> Optional[pulumi.Input[str]]:\\n return pulumi.get(self, \\\"user_data\\\")\",\n \"def extract_backing_type(value: dict) -> str:\\n return next(iter(value.keys()))\",\n \"def get_key(self, item):\\r\\n return item[0]\",\n \"def _get_user_id(user_data: dict):\\n data = json.dumps(user_data).encode('utf-8')\\n hashed_data = hashlib.sha256()\\n hashed_data.update(data)\\n return hashed_data.hexdigest()\",\n \"def get_userdata(self, nick, datakey):\\n nickkey = irc.strings.lower(nick)\\n data = None\\n if nickkey in self.users and datakey in self.users[nickkey]:\\n data = self.users[nickkey][datakey]\\n return data\",\n \"def meta_value(request_object, dictkey):\\n \\n try:\\n val = request_object.META[dictkey]\\n except: # Exception as ex:\\n val = ''\\n return val\",\n \"def getUserFromKey(key):\\n\\t\\t#get(Key(key))\\n\\t\\t#return None if no user found\",\n \"def check_user_type(self): # FIXME Buggy as screen_name can be int\\n try:\\n int(self.user)\\n return {'user_id': self.user}\\n except ValueError:\\n return {'screen_name': self.user}\",\n \"def key(self) -> Optional[pulumi.Input[str]]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[pulumi.Input[str]]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[pulumi.Input[str]]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[pulumi.Input[str]]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[pulumi.Input[str]]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[pulumi.Input[str]]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[pulumi.Input[str]]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[pulumi.Input[str]]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[pulumi.Input[str]]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[pulumi.Input[str]]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[pulumi.Input[str]]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[pulumi.Input[str]]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def extract_user_short(data):\\n user_pk = data.get(\\\"id\\\", data.get(\\\"pk\\\"))\\n assert user_pk, 'User without pk \\\"%s\\\"' % data\\n return {\\n \\\"pk\\\": int(user_pk),\\n \\\"username\\\": data[\\\"username\\\"],\\n \\\"full_name\\\": data[\\\"full_name\\\"],\\n \\\"is_private\\\": data.get(\\\"is_private\\\"),\\n \\\"profile_pic_url\\\": data[\\\"profile_pic_url\\\"],\\n \\\"is_verified\\\": data.get(\\\"is_verified\\\"),\\n # \\\"is_unpublished\\\": data.get(\\\"is_unpublished\\\"),\\n }\",\n \"def getKey(instance):\\n return instance['name']\",\n \"def key(self) -> Optional[str]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[str]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[str]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[str]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[str]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[str]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[str]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[str]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[str]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[str]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[str]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[str]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[str]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[str]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[str]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[str]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[str]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[str]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[str]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[str]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[str]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[str]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[str]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[str]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[str]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[str]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[str]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def key(self) -> Optional[str]:\\n return pulumi.get(self, \\\"key\\\")\",\n \"def get_value(self) -> Dict[str, any]:\",\n \"def __parse_user_id(self, data):\\n if 'user_id' in data:\\n return data['user_id']\\n if 'user' in data:\\n return data['user']['id']\\n return None\",\n \"def key(self):\\n return self.value()._key\",\n \"def getRetKey(dictionary):\\n retKey = \\\"\\\"\\n try:\\n if dictionary:\\n retKey = dictionary.values()[0].keys()[0]\\n except TypeError:\\n logging.debug(\\\"type error\\\")\\n\\n return retKey\",\n \"def key(key):\\n return key\",\n \"def user_id(self):\\n return json_loads(self.user_json).get('id')\",\n \"def __getitem__(self, key):\\r\\n if key == 'name':\\r\\n return self.name\\r\\n elif key == 'type':\\r\\n return self.type\\r\\n elif key == 'tab_id':\\r\\n return self.tab_id\\r\\n else:\\r\\n raise KeyError('Key {0} not present in tab {1}'.format(key, self.to_json()))\",\n \"def make_external_key(self, data):\\n return data['key']\",\n \"def key_object_name(self) -> Optional[pulumi.Input[str]]:\\n return pulumi.get(self, \\\"key_object_name\\\")\",\n \"def get_key(self, user, api_key):\\n return True\",\n \"def object_key(self) -> str:\\n return self._values.get('object_key')\",\n \"def get_user_info_by_id(self, user_id: int) -> dict:\",\n \"def check_for_dict(check):\",\n \"def _access_dict(self, d, key):\\n try:\\n # try to get access to the value by using the key\\n value = d[key]\\n return value\\n except:\\n # fail to access the value from the key\\n # namely, the feature does not exist in the \\n # feature dictionary of a specific apartment\\n return None\",\n \"def key_type(self) -> global___Type:\",\n \"def key(self) -> \\\"str\\\":\\n return self._attrs.get(\\\"key\\\")\",\n \"def _get_key(name, obj):\\r\\n wanted_key = 'data'\\r\\n if isinstance(obj, h5py.Group):\\r\\n for key, val in list(obj.items()):\\r\\n if key == wanted_key:\\r\\n if isinstance(obj[key], h5py.Dataset):\\r\\n key_path = obj.name + \\\"/\\\" + key\\r\\n return key_path\",\n \"def __getattr__(self, key):\\n if key == 'user_data':\\n if key in self.data:\\n return self.data[key]\\n api = ApiClient()\\n user_json = api.rest(self.url + '/user_data.json')\\n self.user_data = UserData(json.loads(user_json), self.url)\\n return self.user_data\\n\\n return super(Template, self).__getattr__(key)\",\n \"def has_dict_keys(self, dict_in_pointer):\\n if type(dict_in_pointer)==str:\\n dict_in_pointer = [dict_in_pointer]\\n if type(dict_in_pointer)==dict:\\n dict_in_pointer = dict_in_pointer.keys()\\n if type(dict_in_pointer)!=list:\\n return None\\n start = self.head\\n while start:\\n if dict_in_pointer==start.getMember():\\n return start\\n start = start.getLink()\\n return None\",\n \"def get_in(self, key=None, default=None):\\n if key is None:\\n raise KeyError(\\\"'Dict' attribute key can't be empty\\\")\\n key_list = key.strip().split('.')\\n data = self\\n size = len(key_list)\\n for index, k in enumerate(key_list):\\n data = data.get(k)\\n if index < size-1 and not isinstance(data, dict):\\n return default\\n return data\",\n \"def to_internal_value(self, data):\\n try:\\n if not isinstance(data, dict) or \\\"id\\\" not in data:\\n raise TypeError\\n return super().to_internal_value(data[\\\"id\\\"])\\n except (TypeError, ValueError):\\n self.fail(\\\"incorrect_type\\\", data_type=type(data).__name__)\",\n \"def __getitem__(self, key):\\n if isinstance(key, str):\\n phone = EntityDatabase.parse_phone(key)\\n if phone:\\n return self._phone_id[phone]\\n else:\\n key = key.lstrip('@').lower()\\n return self._entities[self._username_id[key]]\\n\\n if isinstance(key, int):\\n return self._entities[key] # normal IDs are assumed users\\n\\n if isinstance(key, TLObject):\\n sc = type(key).SUBCLASS_OF_ID\\n if sc == 0x2d45687:\\n # Subclass of \\\"Peer\\\"\\n return self._entities[utils.get_peer_id(key, add_mark=True)]\\n elif sc in {0x2da17977, 0xc5af5d94, 0x6d44b7db}:\\n # Subclass of \\\"User\\\", \\\"Chat\\\" or \\\"Channel\\\"\\n return key\\n\\n raise KeyError(key)\",\n \"def user_display_name(self):\\n return self.key.id()\",\n \"def _convert_dict_key(self, string):\\r\\n try:\\r\\n # Don't do any of this if the string is empty or None.\\r\\n if string is None:\\r\\n return None\\r\\n # If the string represents a container, convert it.\\r\\n elif string[0] in [\\\"(\\\", \\\"[\\\", \\\"{\\\"]:\\r\\n string = (\\r\\n str_utils.str_to_container(string))\\r\\n # Try other type conversions. Any that fail will leave the\\r\\n # variable untouched.\\r\\n else:\\r\\n string = str_utils.str_to_num(string)\\r\\n string = (\\r\\n str_utils.str_to_datetime(string))\\r\\n string = str_utils.str_to_bool(string)\\r\\n # end if\\r\\n return string\\r\\n except Exception as err:\\r\\n _z_exc(\\\"logentry.py/convert_dict_key\\\", err)\\r\\n # end try\\r\",\n \"def get_metadata(resource, key, default_value):\\n if ('object' in resource and 'user_metadata' in resource['object'] and\\n key in resource['object']['user_metadata']):\\n return resource['object']['user_metadata'][key]\\n return default_value\",\n \"def get_key(self):\\n return self._determine_key()\",\n \"def username(self):\\n return json_loads(self.user_json).get('username')\",\n \"def get(self, key: t.Hashable) -> t.Any:\",\n \"def get_key(self, role):\\n\\n for key, role_name in self.assignable_roles[0].items():\\n if role_name == role.name:\\n return key\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.6847286","0.65308297","0.6454429","0.63964266","0.6262093","0.618459","0.61062187","0.60399806","0.59043604","0.5890058","0.5878438","0.5858267","0.5846593","0.58453906","0.5799683","0.57730305","0.57642144","0.57528245","0.5742863","0.5742863","0.5728808","0.5728808","0.5722891","0.5696669","0.5694399","0.5691886","0.56825244","0.5680933","0.56729406","0.567122","0.567122","0.567122","0.567122","0.567122","0.567122","0.567122","0.567122","0.567122","0.567122","0.567122","0.567122","0.56624836","0.56175345","0.56112355","0.56112355","0.56112355","0.56112355","0.56112355","0.56112355","0.56112355","0.56112355","0.56112355","0.56112355","0.56112355","0.56112355","0.56112355","0.56112355","0.56112355","0.56112355","0.56112355","0.56112355","0.56112355","0.56112355","0.56112355","0.56112355","0.56112355","0.56112355","0.56112355","0.56112355","0.56112355","0.56112355","0.5550921","0.55208933","0.5504325","0.54826486","0.5480856","0.5476723","0.540954","0.5397665","0.5390716","0.5384224","0.53750604","0.5365029","0.535012","0.5334877","0.53298384","0.5317377","0.5306698","0.528563","0.5279906","0.52794","0.527539","0.5269111","0.5260414","0.52578866","0.5255594","0.52532315","0.52374935","0.5231247","0.5228284"],"string":"[\n \"0.6847286\",\n \"0.65308297\",\n \"0.6454429\",\n \"0.63964266\",\n \"0.6262093\",\n \"0.618459\",\n \"0.61062187\",\n \"0.60399806\",\n \"0.59043604\",\n \"0.5890058\",\n \"0.5878438\",\n \"0.5858267\",\n \"0.5846593\",\n \"0.58453906\",\n \"0.5799683\",\n \"0.57730305\",\n \"0.57642144\",\n \"0.57528245\",\n \"0.5742863\",\n \"0.5742863\",\n \"0.5728808\",\n \"0.5728808\",\n \"0.5722891\",\n \"0.5696669\",\n \"0.5694399\",\n \"0.5691886\",\n \"0.56825244\",\n \"0.5680933\",\n \"0.56729406\",\n \"0.567122\",\n \"0.567122\",\n \"0.567122\",\n \"0.567122\",\n \"0.567122\",\n \"0.567122\",\n \"0.567122\",\n \"0.567122\",\n \"0.567122\",\n \"0.567122\",\n \"0.567122\",\n \"0.567122\",\n \"0.56624836\",\n \"0.56175345\",\n \"0.56112355\",\n \"0.56112355\",\n \"0.56112355\",\n \"0.56112355\",\n \"0.56112355\",\n \"0.56112355\",\n \"0.56112355\",\n \"0.56112355\",\n \"0.56112355\",\n \"0.56112355\",\n \"0.56112355\",\n \"0.56112355\",\n \"0.56112355\",\n \"0.56112355\",\n \"0.56112355\",\n \"0.56112355\",\n \"0.56112355\",\n \"0.56112355\",\n \"0.56112355\",\n \"0.56112355\",\n \"0.56112355\",\n \"0.56112355\",\n \"0.56112355\",\n \"0.56112355\",\n \"0.56112355\",\n \"0.56112355\",\n \"0.56112355\",\n \"0.56112355\",\n \"0.5550921\",\n \"0.55208933\",\n \"0.5504325\",\n \"0.54826486\",\n \"0.5480856\",\n \"0.5476723\",\n \"0.540954\",\n \"0.5397665\",\n \"0.5390716\",\n \"0.5384224\",\n \"0.53750604\",\n \"0.5365029\",\n \"0.535012\",\n \"0.5334877\",\n \"0.53298384\",\n \"0.5317377\",\n \"0.5306698\",\n \"0.528563\",\n \"0.5279906\",\n \"0.52794\",\n \"0.527539\",\n \"0.5269111\",\n \"0.5260414\",\n \"0.52578866\",\n \"0.5255594\",\n \"0.52532315\",\n \"0.52374935\",\n \"0.5231247\",\n \"0.5228284\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.6621438"},"document_rank":{"kind":"string","value":"1"}}}],"truncated":false,"partial":true},"paginationData":{"pageIndex":60,"numItemsPerPage":100,"numTotalItems":95772,"offset":6000,"length":100}},"jwt":"eyJhbGciOiJFZERTQSJ9.eyJyZWFkIjp0cnVlLCJwZXJtaXNzaW9ucyI6eyJyZXBvLmNvbnRlbnQucmVhZCI6dHJ1ZX0sImlhdCI6MTc3MzkzMzkxMSwic3ViIjoiL2RhdGFzZXRzL25vbWljLWFpL2Nvcm5zdGFjay1weXRob24tdjEiLCJleHAiOjE3NzM5Mzc1MTEsImlzcyI6Imh0dHBzOi8vaHVnZ2luZ2ZhY2UuY28ifQ.siCb5DoEx_AI4_t4z3vZC325meEAT593rWsCkiv0EccSkkrlo9gKMM-ZEks-LLjvG-ZR31G_FOW5mkwdbnigDg","displayUrls":true,"splitSizeSummaries":[{"config":"default","split":"train","numRows":95772,"numBytesParquet":1928375891}]},"discussionsStats":{"closed":1,"open":1,"total":2},"fullWidth":true,"hasGatedAccess":true,"hasFullAccess":true,"isEmbedded":false,"savedQueries":{"community":[],"user":[]}}">
query stringlengths 9 3.4k | document stringlengths 9 87.4k | metadata dict | negatives listlengths 4 101 | negative_scores listlengths 4 101 | document_score stringlengths 3 10 | document_rank stringclasses 102
values |
|---|---|---|---|---|---|---|
Calculate the number of columns and rows required to divide an image into ``n`` parts. Return a tuple of integers in the format (num_columns, num_rows) | def calc_columns_rows(n):
num_columns = int(ceil(sqrt(n)))
num_rows = int(ceil(n / float(num_columns)))
return (num_columns, num_rows) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def compute_rows_columns(num_wells):\n a = math.sqrt(num_wells / 6)\n n_rows = int(round(2 * a))\n n_columns = int(round(3 * a))\n return n_rows, n_columns",
"def compute_nrows_ncolumns(nplots):\n n_rows = int(np.sqrt(nplots)) + (np.sqrt(nplots) != int(np.sqrt(nplots))) * 1\n n_columns = int(np... | [
"0.73097175",
"0.7159921",
"0.6962047",
"0.69273585",
"0.6925103",
"0.6749133",
"0.66736543",
"0.6470178",
"0.64632785",
"0.63872576",
"0.6368298",
"0.62814194",
"0.6258692",
"0.6197939",
"0.61734897",
"0.6155329",
"0.6155302",
"0.61514986",
"0.61438143",
"0.6133328",
"0.6131... | 0.79326427 | 0 |
Calculate combined size of tiles. | def get_combined_size(tiles):
# TODO: Refactor calculating layout to avoid repetition.
columns, rows = calc_columns_rows(len(tiles))
tile_size = tiles[0].image.size
return (tile_size[0] * columns, tile_size[1] * rows) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def tile_size_2d(self):\n return 32.0, 32.0",
"def get_num_tiles(rows, cols, row_tile_size, col_tile_size):\n num_row_tiles = math.ceil(rows / row_tile_size)\n num_col_tiles = math.ceil(cols / col_tile_size)\n return num_row_tiles, num_col_tiles",
"def get_tilesize(self, sampling):\n xsize = {... | [
"0.6917832",
"0.6854386",
"0.66924536",
"0.66773844",
"0.6626963",
"0.6563682",
"0.6505493",
"0.6481431",
"0.64496267",
"0.641139",
"0.63941205",
"0.631634",
"0.6312036",
"0.627973",
"0.62632513",
"0.625943",
"0.6246556",
"0.621888",
"0.6217926",
"0.62107056",
"0.61723995",
... | 0.8319171 | 0 |
``tiles`` Tuple of ``Image`` instances. ``width`` Optional, width of combined image. ``height`` Optional, height of combined image. ``Image`` instance. | def join(tiles, width=0, height=0):
# Don't calculate size if width and height are provided
# this allows an application that knows what the
# combined size should be to construct an image when
# pieces are missing.
if width > 0 and height > 0:
im = Image.new("RGBA", (width, height), None)
else:
im = Image.new("RGBA", get_combined_size(tiles), None)
columns, rows = calc_columns_rows(len(tiles))
for tile in tiles:
try:
im.paste(tile.image, tile.coords)
except IOError:
# do nothing, blank out the image
continue
return im | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def _tile_images(imgs, tile_shape, concatenated_image, margin_color=None):\n x_num, y_num = tile_shape\n one_width = imgs[0].shape[1]\n one_height = imgs[0].shape[0]\n if concatenated_image is None:\n concatenated_image = np.zeros((one_height * y_num, one_width * x_num, 3),\n ... | [
"0.6996957",
"0.6695184",
"0.63886476",
"0.62590015",
"0.6253077",
"0.6211737",
"0.62029433",
"0.60706353",
"0.6000102",
"0.596734",
"0.5926167",
"0.5918759",
"0.5894937",
"0.5867754",
"0.5861465",
"0.5857397",
"0.5848029",
"0.5744577",
"0.5702461",
"0.5656095",
"0.56503665",... | 0.7703681 | 0 |
Basic sanity checks prior to performing a split. | def validate_image(image, number_tiles):
TILE_LIMIT = 99 * 99
try:
number_tiles = int(number_tiles)
except BaseException:
raise ValueError("number_tiles could not be cast to integer.")
if number_tiles > TILE_LIMIT or number_tiles < 2:
raise ValueError(
"Number of tiles must be between 2 and {} (you \
asked for {}).".format(
TILE_LIMIT, number_tiles
)
) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def test_splitSanity(self):\n # Whiteboxing\n self.assertRaises(ValueError, irc.split, \"foo\", -1)\n self.assertRaises(ValueError, irc.split, \"foo\", 0)\n self.assertEqual([], irc.split(\"\", 1))\n self.assertEqual([], irc.split(\"\"))",
"def test_splitValidatesLength(self):\... | [
"0.7558807",
"0.69345814",
"0.6754861",
"0.6698345",
"0.6582555",
"0.6470959",
"0.644443",
"0.6433854",
"0.6428578",
"0.63183737",
"0.63103896",
"0.6191666",
"0.61298126",
"0.60792583",
"0.6011742",
"0.5989836",
"0.5981029",
"0.5925554",
"0.589626",
"0.58922535",
"0.58776075"... | 0.0 | -1 |
Basic checks for columns and rows values | def validate_image_col_row(image, col, row):
SPLIT_LIMIT = 99
try:
col = int(col)
row = int(row)
except BaseException:
raise ValueError("columns and rows values could not be cast to integer.")
if col < 1 or row < 1 or col > SPLIT_LIMIT or row > SPLIT_LIMIT:
raise ValueError(
f"Number of columns and rows must be between 1 and"
f"{SPLIT_LIMIT} (you asked for rows: {row} and col: {col})."
)
if col == 1 and row == 1:
raise ValueError("There is nothing to divide. You asked for the entire image.") | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def getValidRowsCols(self) :\n colns = number_of_good_cols(self.r_sheet)\n rowns = number_of_good_rows(self.r_sheet)\n \n # Check whether the number of good columns and rows are correct\n while self.isEmptyRow(rowns-1, colns) :\n rowns = rowns - 1 \n while self.... | [
"0.6793047",
"0.6788679",
"0.6685578",
"0.66567594",
"0.65624297",
"0.6553434",
"0.6511974",
"0.6502489",
"0.6456458",
"0.6430093",
"0.6386662",
"0.63792455",
"0.63757235",
"0.63635373",
"0.63515013",
"0.6350334",
"0.6341316",
"0.6338641",
"0.63122106",
"0.6300438",
"0.629813... | 0.0 | -1 |
Split an image into a specified number of tiles. | def slice(
filename,
number_tiles=None,
col=None,
row=None,
save=True,
DecompressionBombWarning=True,
):
if DecompressionBombWarning is False:
Image.MAX_IMAGE_PIXELS = None
im = Image.open(filename)
im_w, im_h = im.size
columns = 0
rows = 0
if number_tiles:
validate_image(im, number_tiles)
columns, rows = calc_columns_rows(number_tiles)
else:
validate_image_col_row(im, col, row)
columns = col
rows = row
tile_w, tile_h = int(floor(im_w / columns)), int(floor(im_h / rows))
tiles = []
number = 1
for pos_y in range(0, im_h - rows, tile_h): # -rows for rounding error.
for pos_x in range(0, im_w - columns, tile_w): # as above.
area = (pos_x, pos_y, pos_x + tile_w, pos_y + tile_h)
image = im.crop(area)
position = (int(floor(pos_x / tile_w)) + 1, int(floor(pos_y / tile_h)) + 1)
coords = (pos_x, pos_y)
tile = Tile(image, number, position, coords)
tiles.append(tile)
number += 1
if save:
save_tiles(
tiles, prefix=get_basename(filename), directory=os.path.dirname(filename)
)
return tuple(tiles) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def _split_image_into_tiles(\n self, image: np.ndarray\n ) -> t.Sequence[t.Tuple[t.Tuple[t.Any, ...], np.ndarray]]:\n h, w, c = image.shape\n tile_height = (\n math.ceil(h / (self._n_tiles // 2 - 1))\n if self._n_tiles > 4\n else math.ceil(h / (self._n_tiles... | [
"0.7739236",
"0.76190794",
"0.70275676",
"0.67776227",
"0.6704536",
"0.66682243",
"0.6638104",
"0.6595239",
"0.65494275",
"0.6480226",
"0.646695",
"0.6428937",
"0.6403003",
"0.6392269",
"0.6336873",
"0.62955356",
"0.6278064",
"0.6265527",
"0.6264345",
"0.624642",
"0.614579",
... | 0.64391273 | 11 |
Write image files to disk. Create specified folder(s) if they | def save_tiles(tiles, prefix="", directory=os.getcwd(), format="png"):
for tile in tiles:
tile.save(
filename=tile.generate_filename(
prefix=prefix, directory=directory, format=format
),
format=format,
)
return tuple(tiles) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def write(img, path):\n create_directories_for_file_name(path)\n writer = sitk.ImageFileWriter()\n writer.Execute(img, path, True)",
"def create_directories(train_path, test_path):\n train_path.joinpath(\"images\").mkdir(parents=True)\n test_path.joinpath(\"images\").mkdir(parents=True)",
"def c... | [
"0.71206725",
"0.70679843",
"0.70667833",
"0.69145185",
"0.68923235",
"0.6808798",
"0.680336",
"0.67864877",
"0.6739885",
"0.66490185",
"0.65963286",
"0.65840054",
"0.656958",
"0.65321773",
"0.6529073",
"0.6489769",
"0.647365",
"0.6456709",
"0.642183",
"0.641787",
"0.64059615... | 0.0 | -1 |
Determine column and row position for filename. | def get_image_column_row(filename):
row, column = os.path.splitext(filename)[0][-5:].split("_")
return (int(column) - 1, int(row) - 1) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def get_position(self): # maybe encoded in filepath at some point\n result = (self.iter * self.row_step)% self.row_size, self.iter // (self.row_size * self.row_step)* self.col_step\n self.iter += 1\n return result",
"def ind(self, pos):\n row = int(pos[1:]) - 1\n column = self... | [
"0.6791335",
"0.66289556",
"0.66289556",
"0.66289556",
"0.6522248",
"0.6411789",
"0.63911855",
"0.63667697",
"0.6281292",
"0.62766576",
"0.6266177",
"0.6249092",
"0.6142638",
"0.61390686",
"0.6129921",
"0.60795605",
"0.60582995",
"0.60221326",
"0.6021388",
"0.60078406",
"0.59... | 0.75118536 | 0 |
Open all images in a directory. Return tuple of Tile instances. | def open_images_in(directory):
files = [
filename
for filename in os.listdir(directory)
if "_" in filename and not filename.startswith("joined")
]
tiles = []
if len(files) > 0:
i = 0
for file in files:
pos = get_image_column_row(file)
im = Image.open(os.path.join(directory, file))
position_xy = [0, 0]
count = 0
for a, b in zip(pos, im.size):
position_xy[count] = a * b
count = count + 1
tiles.append(
Tile(
image=im,
position=pos,
number=i + 1,
coords=position_xy,
filename=file,
)
)
i = i + 1
return tiles | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def load_pic_in_directory(directory):\n return [Image.open(os.path.join(directory, img)) for img in os.listdir(directory)]",
"def get_images(directory=None): #import from mask.py\n \n if directory == None:\n directory = os.getcwd() # Use working directory if unspecified\n \n image_list ... | [
"0.67336595",
"0.6599813",
"0.6416653",
"0.63725936",
"0.61642754",
"0.6014441",
"0.5978408",
"0.59570676",
"0.5940081",
"0.5896447",
"0.58877945",
"0.5837525",
"0.5792128",
"0.5787893",
"0.5751572",
"0.57426775",
"0.5739392",
"0.57090163",
"0.57005966",
"0.56994253",
"0.5688... | 0.81790555 | 0 |
If a resource has no title, it's ID should be returned. | def test_str_no_title(media_resource_factory):
resource = media_resource_factory()
assert str(resource) == str(resource.id) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def resourceid(self):",
"def resource_id(self) -> Optional[str]:\n return pulumi.get(self, \"resource_id\")",
"def resource_id(self) -> Optional[pulumi.Input[str]]:\n return pulumi.get(self, \"resource_id\")",
"def resource_id(self) -> Optional[pulumi.Input[str]]:\n return pulumi.get(sel... | [
"0.7058361",
"0.68127316",
"0.6649041",
"0.6649041",
"0.6649041",
"0.6649041",
"0.6649041",
"0.6649041",
"0.6649041",
"0.6649041",
"0.6649041",
"0.66319466",
"0.662835",
"0.65403503",
"0.6520874",
"0.6478558",
"0.643827",
"0.6429088",
"0.6386452",
"0.6386452",
"0.6386452",
... | 0.5996474 | 44 |
If a resource has a title, it should be included in the string representation. | def test_str_with_title(media_resource_factory):
resource = media_resource_factory(title="Test Resource")
assert str(resource) == f"{resource.id} ({resource.title})" | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def resource_link_title(self):\n return self.request.POST.get(\"resource_link_title\", self.resource_link_id)",
"def get_resource_details (self):\n return (f\"[Title:\\\"{self.get_title()}\\\"] [Author:{self.get_author()}] [Publisher:{self.get_publisher()}] [Year:{self.get_year()}]\")",
"def res_... | [
"0.68804574",
"0.6865952",
"0.6629121",
"0.6599802",
"0.6590698",
"0.6551943",
"0.6400065",
"0.6386993",
"0.6346398",
"0.632626",
"0.63220584",
"0.63117653",
"0.6293808",
"0.62767816",
"0.6276447",
"0.62574726",
"0.6230404",
"0.61885935",
"0.6185459",
"0.61847913",
"0.6184791... | 0.7142992 | 0 |
Media resources should be ordered by creation time, ascending. | def test_ordering(media_resource_factory):
m1 = media_resource_factory()
m2 = media_resource_factory()
assert list(models.MediaResource.objects.all()) == [m1, m2] | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def get_sorted_img_list():\n dirPath=settings.BASE_DIR\n imgdir=\"/pttWeb/static/topicmodel\"\n fileID=glob.glob(dirPath+imgdir+\"/*.png\")\n fileID=[i.replace('/home/stream/Documents/minimum_django/pttWeb/static/','') for i in fileID]\n fileID=[Week_Image(i) for i in fileID]\n fileID.sort(key=la... | [
"0.61875653",
"0.60358816",
"0.59814835",
"0.5946629",
"0.5863695",
"0.57058465",
"0.5681557",
"0.5633815",
"0.55823237",
"0.5550474",
"0.5542779",
"0.5542779",
"0.5542779",
"0.5542779",
"0.5485966",
"0.54624945",
"0.544271",
"0.5394488",
"0.5365429",
"0.5348334",
"0.5256054"... | 0.65957546 | 0 |
If a media resource has both an image and YouTube video ID specified then cleaning it should throw an error. | def test_clean_both_image_and_youtube_id(image):
resource = models.MediaResource(image=image, youtube_id="dQw4w9WgXcQ")
with pytest.raises(ValidationError):
resource.clean() | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def test_clean_no_image_or_youtube_id():\n resource = models.MediaResource()\n\n with pytest.raises(ValidationError):\n resource.clean()",
"def test_clean_only_youtube_id():\n resource = models.MediaResource(youtube_id=\"dQw4w9WgXcQ\")\n\n resource.clean()",
"def test_clean_only_image(image)... | [
"0.7774484",
"0.7352817",
"0.6742315",
"0.6415747",
"0.59018755",
"0.5872863",
"0.58247",
"0.57007104",
"0.55338883",
"0.5439113",
"0.54177034",
"0.53636616",
"0.5305156",
"0.53002834",
"0.52959025",
"0.51120865",
"0.51028275",
"0.50996584",
"0.5081952",
"0.5054293",
"0.50387... | 0.78584284 | 0 |
If a media resource does not encapsulate any media, cleaning it should throw an error. | def test_clean_no_image_or_youtube_id():
resource = models.MediaResource()
with pytest.raises(ValidationError):
resource.clean() | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def _handle_removed_media(self):\r\n if self.has_media():\r\n try:\r\n image = str(self.image)\r\n os.remove(image)\r\n except OSError:\r\n raise('Failure trying to remove image from filesystem.')\r\n return True",
"def test_clean_o... | [
"0.69884086",
"0.6832411",
"0.6076411",
"0.5952054",
"0.5877735",
"0.586007",
"0.574167",
"0.5715479",
"0.56592447",
"0.56336623",
"0.5573302",
"0.55011815",
"0.5439052",
"0.54167026",
"0.5395553",
"0.5383151",
"0.53797346",
"0.532659",
"0.52952904",
"0.5293007",
"0.5271096",... | 0.70109206 | 0 |
Cleaning a media resource that only has an image should do nothing. | def test_clean_only_image(image):
resource = models.MediaResource(image=image)
resource.clean() | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def _handle_removed_media(self):\r\n if self.has_media():\r\n try:\r\n image = str(self.image)\r\n os.remove(image)\r\n except OSError:\r\n raise('Failure trying to remove image from filesystem.')\r\n return True",
"def clean_before... | [
"0.698834",
"0.67045337",
"0.6504589",
"0.6436783",
"0.6413871",
"0.637336",
"0.6318583",
"0.61001015",
"0.60031515",
"0.59312874",
"0.59246147",
"0.5909386",
"0.58954066",
"0.5854419",
"0.58376265",
"0.58252335",
"0.5816791",
"0.5799392",
"0.5791953",
"0.5740084",
"0.5719948... | 0.7978231 | 0 |
Cleaning a media resource that only has a YouTube video ID should do nothing. | def test_clean_only_youtube_id():
resource = models.MediaResource(youtube_id="dQw4w9WgXcQ")
resource.clean() | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def test_clean_no_image_or_youtube_id():\n resource = models.MediaResource()\n\n with pytest.raises(ValidationError):\n resource.clean()",
"def test_clean_both_image_and_youtube_id(image):\n resource = models.MediaResource(image=image, youtube_id=\"dQw4w9WgXcQ\")\n\n with pytest.raises(Validat... | [
"0.7022397",
"0.66042817",
"0.61575353",
"0.5879848",
"0.56859034",
"0.56468034",
"0.5629039",
"0.5511188",
"0.5497184",
"0.54881966",
"0.54724157",
"0.5448994",
"0.5418817",
"0.541001",
"0.54045886",
"0.53989905",
"0.5339894",
"0.5189437",
"0.51847184",
"0.51762545",
"0.5173... | 0.8092883 | 0 |
If a media resource has an image, its type property should indicate it's an image. | def test_type_image(image):
resource = models.MediaResource(image=image)
assert resource.type == models.MediaResource.TYPE_IMAGE | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def is_image(content_type):\n return content_type == \"image/jpeg\" or content_type == \"image/png\"",
"def is_image(self):\r\n # we can only get this if we have headers\r\n LOG.debug('content type')\r\n LOG.debug(self.content_type)\r\n if (self.content_type is not None and\r\n ... | [
"0.71367157",
"0.6835922",
"0.6663885",
"0.6654667",
"0.6619548",
"0.648332",
"0.6373138",
"0.6143732",
"0.6071515",
"0.59954345",
"0.5967518",
"0.596137",
"0.59485954",
"0.5918796",
"0.5918796",
"0.5918796",
"0.5918796",
"0.5918796",
"0.5918796",
"0.5918796",
"0.5918796",
... | 0.7742908 | 0 |
If a media resource has a YouTube video ID, its type property should indicate it's a YouTube video. | def test_type_youtube():
resource = models.MediaResource(youtube_id="dQw4w9WgXcQ")
assert resource.type == models.MediaResource.TYPE_YOUTUBE | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def play_youtube(self, media_id):\n pass",
"def isYouTube(self):\n if 'youtube' in self.link.split('.'):\n return True\n return None",
"def play_youtube(self, media_id):\n raise NotImplementedError()",
"def on_play(self, event, type=\"yt\", content=None):\n urls ... | [
"0.6823963",
"0.6766844",
"0.6746436",
"0.6112856",
"0.60233295",
"0.59815586",
"0.5897715",
"0.58677566",
"0.5842102",
"0.58315057",
"0.580741",
"0.580741",
"0.580741",
"0.580741",
"0.58059746",
"0.579559",
"0.579133",
"0.5763148",
"0.57312804",
"0.57054985",
"0.56609565",
... | 0.78130394 | 0 |
A facet dict should produce correct choice labels | def test_choices_from_facets(self):
fake_facets = {
"doctype": {"foo": 1, "bar": 2, "baz": 3},
"has_transcription": {"true": 3, "false": 3},
}
form = DocumentSearchForm()
# call the method to configure choices based on facets
form.set_choices_from_facets(fake_facets)
# test doctype facets (FacetChoiceField)
for choice in form.fields["doctype"].widget.choices:
# choice is index id, label
choice_label = choice[1]
assert isinstance(choice_label, str)
assert "<span>" in choice_label
# test has_transcription facet (BooleanFacetField)
bool_label = form.fields["has_transcription"].label
assert isinstance(bool_label, str)
assert "3</span>" in bool_label | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def populate_from_facets(self, facet_dict):\n # generate the list of choice from the facets\n\n self.choices = (\n (\n val,\n mark_safe(f'<span>{label}</span><span class=\"count\">{count:,}</span>'),\n )\n for val, (label, count) in facet... | [
"0.72828305",
"0.6952813",
"0.6830777",
"0.6303037",
"0.6230736",
"0.60396737",
"0.58811235",
"0.56370056",
"0.56334686",
"0.5489322",
"0.54117686",
"0.53088254",
"0.5206354",
"0.5197836",
"0.5150402",
"0.5128234",
"0.51101923",
"0.50881493",
"0.5084556",
"0.50771785",
"0.506... | 0.69385916 | 2 |
Should add an error if query is empty and sort is relevance | def test_clean(self):
form = DocumentSearchForm()
form.cleaned_data = {"q": "", "sort": "relevance"}
form.clean()
assert len(form.errors) == 1
# Otherwise should not raise an error
form = DocumentSearchForm()
form.cleaned_data = {"q": "test", "sort": "relevance"}
form.clean()
assert len(form.errors) == 0
form = DocumentSearchForm()
form.cleaned_data = {"q": "", "sort": "scholarship_desc"}
form.clean()
assert len(form.errors) == 0 | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def test_sortby_invalid(self):\n qs = {'a': 1, 'w': 4, 'format': 'json', 'sortby': ''}\n response = self.client.get(reverse('search.advanced'), qs)\n eq_(200, response.status_code)",
"def test_scroll_query_sort_safe(self):\n self._validate_scroll_search_params({\"sort\": \"_id\"}, {\"... | [
"0.68004227",
"0.668683",
"0.649039",
"0.6110041",
"0.60085225",
"0.5954969",
"0.5795239",
"0.5701212",
"0.5672946",
"0.5664839",
"0.5664839",
"0.56449044",
"0.5619792",
"0.5586709",
"0.5570209",
"0.55674064",
"0.5558715",
"0.55321485",
"0.5520282",
"0.55074567",
"0.5495927",... | 0.0 | -1 |
Should add an error if rationale is 'other' and rationale notes are empty | def test_clean(self):
doc = Document.objects.create()
form = DocumentMergeForm()
form.cleaned_data = {
"primary_document": doc.id,
"rationale": "other",
"rationale_notes": "",
}
form.clean()
assert len(form.errors) == 1
# should not produce an error if rationale notes provided
form = DocumentSearchForm()
form.cleaned_data = {
"primary_document": doc.id,
"rationale": "other",
"rationale_notes": "test",
}
form.clean()
assert len(form.errors) == 0
# should not produce an error if rational is "duplicate" or "join"
form = DocumentSearchForm()
form.cleaned_data = {
"primary_document": doc.id,
"rationale": "duplicate",
"rationale_notes": "",
}
form.clean()
assert len(form.errors) == 0 | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def test_contentious_prescription_no_rationale(self):\n url = reverse('admin:prescription_prescription_add')\n data = {\n 'name': 'Test',\n 'planned_season': 1,\n 'planned_year': 2013,\n 'region': 1,\n 'district': 1,\n 'location': 'Tes... | [
"0.6536794",
"0.6193883",
"0.59964615",
"0.59149736",
"0.5794971",
"0.57020473",
"0.568294",
"0.5651748",
"0.56196064",
"0.55880433",
"0.556072",
"0.55405277",
"0.5500709",
"0.54977834",
"0.5488182",
"0.5431535",
"0.5406004",
"0.5385384",
"0.5364079",
"0.53436726",
"0.5336585... | 0.5011413 | 64 |
Can this crawler process this URL? | def offer(self, url):
parts = urlparse(url)
return bool(self.KT_RE.match(parts.netloc)) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def can_handle(self, url):\n return self.url_re.match(url)",
"def match_url(self, url):\n pass",
"def can_fetch(self, useragent, url):\n target_url = url\n if self.root_path:\n target_url = re.sub(self.root_path, \"\", target_url)\n return super(Robot, self).can_fe... | [
"0.73433197",
"0.6720704",
"0.66891474",
"0.6490422",
"0.647403",
"0.6457199",
"0.6456133",
"0.6403348",
"0.6397142",
"0.636222",
"0.6355213",
"0.6349857",
"0.6321741",
"0.630184",
"0.62799656",
"0.6256721",
"0.62470055",
"0.6201895",
"0.61920714",
"0.61752903",
"0.6173302",
... | 0.619864 | 18 |
Fetch and return the raw HTML for this url. The return content is a unicode string. | def fetch(self, url):
self.log.info("Fetching URL: " + url)
r = requests.get(url, verify=False)
# raise an HTTPError on badness
r.raise_for_status()
# this decodes r.content using a guessed encoding
return r.text | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def _get_raw_html(self):\n buffer = BytesIO()\n c = pycurl.Curl()\n c.setopt(c.URL, self.url)\n c.setopt(c.WRITEDATA, buffer)\n c.perform()\n c.close()\n return buffer.getvalue()",
"def getHtml(self, url):\n r = requests.get(url)\n html = r.content\n... | [
"0.8074977",
"0.7284636",
"0.7092009",
"0.7025183",
"0.69793874",
"0.69557333",
"0.6916234",
"0.68908453",
"0.68863857",
"0.6852996",
"0.68447953",
"0.68049586",
"0.6689668",
"0.6678838",
"0.6672157",
"0.66424465",
"0.6611915",
"0.6605699",
"0.6543702",
"0.65425205",
"0.65123... | 0.69644094 | 5 |
Extract text and other things from the raw_html for this document. | def extract(self, doc, raw_html):
super(KenyaTodayCrawler, self).extract(doc, raw_html)
soup = BeautifulSoup(raw_html)
# gather title
doc.title = soup.find(attrs={"property":"og:title"})['content']
#gather publish date
date = self.extract_plaintext(soup.select("main.content .entry-meta .entry-time"))
doc.published_at = self.parse_timestamp(date)
nodes = soup.select(".content .entry-content p")
self.log.info(nodes)
if len(nodes) > 1:
doc.summary = self.extract_plaintext(nodes[0:1])
doc.text = "\n\n".join(p.text.strip() for p in nodes[2:])
doc.author = Author.unknown() | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def extract_all_text(self, url, html_doc):\n self.title_text = self.get_title_words(html_doc)\n self.meta_text = self.get_meta_words(html_doc)\n self.url_text = self.get_url_words(url)\n self.heading_text = self.get_heading_words(html_doc)\n self.body_text = self.get_body_words(h... | [
"0.6755422",
"0.6671859",
"0.6553396",
"0.64243054",
"0.6272383",
"0.623531",
"0.623531",
"0.6228035",
"0.61742455",
"0.61664754",
"0.61556983",
"0.6104006",
"0.6092044",
"0.60168433",
"0.59852856",
"0.59402233",
"0.5923603",
"0.59181535",
"0.59116304",
"0.58720744",
"0.58008... | 0.73629075 | 0 |
We override the normal solve() so that we do not have to enter all 343,000 state_targets for this class. | def solve(self, print_steps=False) -> bool:
(state, _cost_to_goal) = self.ida_heuristic()
steps = self.steps(state)
if steps:
for step in steps:
self.parent.rotate(step)
if print_steps:
logger.info(f"{self}: step {step}")
return True
else:
return False | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def solve(self, state, times):",
"def solve(self, current_state: dict) -> dict:",
"def solution(self) -> State:",
"def solve(self):\n pass",
"def solve(self):\n pass",
"def solve(self):\n ...",
"def solve(self):",
"def solve(self):\n \n raise NotImplementedError(\"n... | [
"0.7180512",
"0.6942709",
"0.6700484",
"0.662909",
"0.662909",
"0.6619703",
"0.6546795",
"0.63575697",
"0.6320139",
"0.6305795",
"0.6301925",
"0.6139513",
"0.6138511",
"0.608324",
"0.6081203",
"0.6034735",
"0.6010343",
"0.5882625",
"0.5849981",
"0.57675886",
"0.57673275",
"... | 0.0 | -1 |
Our goal is to get the edges split into high/low groups but we do not care what the final orienation is of the edges. Each edge can either be in its final orientation or not so there are (2^12)/2 or 2048 possible permutations. The /2 is because there cannot be an odd number of edges not in their final orientation. | def eo_edges(self):
logger.info("eo_edges called")
permutations = []
original_state = self.state[:]
original_solution = self.solution[:]
tmp_solution_len = len(self.solution)
# Build a list of the wing strings at each midge
wing_strs = []
for _, square_index, partner_index in midges_recolor_tuples_555:
square_value = self.state[square_index]
partner_value = self.state[partner_index]
wing_str = square_value + partner_value
wing_str = wing_str_map[square_value + partner_value]
wing_strs.append(wing_str)
# build a list of all possible EO permutations...an even number of edges must be high
for num in range(4096):
num = str(bin(num)).lstrip("0b").zfill(12)
if num.count("1") % 2 == 0:
permutations.append(list(map(int, num)))
# Put all 2048 starting states in a file and point ida-via-graph
# at the file so it can solve all of them and apply the one that is the shortest.
lr_center_stage_states = []
eo_outer_orbit_states = []
eo_inner_orbit_states = []
for permutation in permutations:
must_be_uppercase = []
must_be_lowercase = []
self.state = original_state[:]
for wing_str, uppercase in zip(wing_strs, permutation):
if uppercase:
must_be_uppercase.append(wing_str)
else:
must_be_lowercase.append(wing_str)
# logger.info("%s: %s permutation %s" % (self, index, "".join(map(str, permutation))))
self.edges_flip_orientation(must_be_uppercase, must_be_lowercase)
# build lists of the states that we need to find state_indexes for
lr_center_stage_states.append(self.lt_phase3_lr_center_stage.state())
eo_outer_orbit_states.append(self.lt_phase3_eo_outer_orbit.state())
eo_inner_orbit_states.append(self.lt_phase3_eo_inner_orbit.state())
# now we have a huge list of states to lookup, do a binary search on multiple states at once (this is drastically faster
# than binary searching for them individually). state_index_multiple() will return a dict where the state is the key
# and the state_index is the value.
lr_center_stage_eo_inner_orbit_state_indexes = self.lt_phase3_lr_center_stage.state_index_multiple(
lr_center_stage_states
)
eo_outer_orbit_state_indexes = self.lt_phase3_eo_outer_orbit.state_index_multiple(eo_outer_orbit_states)
eo_inner_orbit_state_indexes = self.lt_phase3_eo_inner_orbit.state_index_multiple(eo_inner_orbit_states)
# build a list of tuples of the state indexes
pt_state_indexes = []
for lr_center_stage_eo_inner_orbit_state, eo_outer_orbit_state, eo_inner_orbit_state in zip(
lr_center_stage_states, eo_outer_orbit_states, eo_inner_orbit_states
):
pt_state_indexes.append(
(
lr_center_stage_eo_inner_orbit_state_indexes[lr_center_stage_eo_inner_orbit_state],
eo_outer_orbit_state_indexes[eo_outer_orbit_state],
eo_inner_orbit_state_indexes[eo_inner_orbit_state],
)
)
self.state = original_state[:]
self.solution = original_solution[:]
# When solve_via_c is passed pt_state_indexes (2048 lines of states in this case), it will try all 2048 of them
# to find the state that has the shortest solution.
self.lt_phase3.solve_via_c(pt_states=pt_state_indexes)
self.print_cube_add_comment("edges EOed into high/low groups", tmp_solution_len)
self.post_eo_state = self.state[:]
self.post_eo_solution = self.solution[:]
# re-color the cube so that the edges are oriented correctly so we can
# pair 4-edges then 8-edges. After all edge pairing is done we will uncolor
# the cube and re-apply the solution.
self.edges_flip_orientation(wing_strs, [])
self.highlow_edges_print() | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def subdivide_ngons(faces: Iterable[Sequence[Union[Vector, Vec2]]]) -> Iterable[\n List[Vector]]:\n for face in faces:\n if len(face) < 5:\n yield face\n else:\n mid_pos = sum(face) / len(face)\n for index, vertex in enumerate(face):\n yield face[... | [
"0.5971374",
"0.58695173",
"0.5826751",
"0.5813039",
"0.57311904",
"0.57143676",
"0.5701675",
"0.5663653",
"0.5646929",
"0.56423926",
"0.5626546",
"0.560861",
"0.55968225",
"0.55719924",
"0.55631095",
"0.5513152",
"0.5477863",
"0.5472609",
"0.5460661",
"0.5448054",
"0.5435083... | 0.5720235 | 5 |
phase5 requires a 4edge combo where none of the edges are in the zplane. phase4 will put a 4edge combo into that state. There are 12!/(4!8!) or 495 different 4edge combinations. Try them all and see which one has the lowest phase4 cost. | def find_first_four_edges_to_pair(self):
original_state = self.state[:]
original_solution = self.solution[:]
original_solution_len = len(self.solution)
results = []
for wing_str_index, wing_str_combo in enumerate(itertools.combinations(wing_strs_all, 4)):
wing_str_combo = sorted(wing_str_combo)
self.state = original_state[:]
self.solution = original_solution[:]
self.lt_phase4.wing_strs = wing_str_combo
if self.lt_phase4.solve():
phase4_solution = self.solution[original_solution_len:]
phase4_solution_len = len(phase4_solution)
results.append((phase4_solution_len, wing_str_combo))
logger.debug(
f"{wing_str_index+1}/495 {wing_str_combo} phase-4 solution length is {phase4_solution_len}"
)
else:
logger.debug(f"{wing_str_index+1}/495 {wing_str_combo} phase-4 solution length is >= 4 ")
self.lt_phase4.fh_txt_cache = {}
self.state = original_state[:]
self.solution = original_solution[:]
results.sort()
return results | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def phase_5(self):\n test_board_1 = board(5, 5, [1, 1], [0, 0])\n render = Render_engine('terminal', test_board_1)\n\n render.render_terminal(test_board_1)",
"def cost_function_SO4(params: list):\n cost = 0\n SO4 = SO4_circuit(params[0], params[1], params[2], params[3], params[4], para... | [
"0.56203735",
"0.5353156",
"0.5339077",
"0.53312033",
"0.52918285",
"0.52905166",
"0.5248838",
"0.52097756",
"0.5169619",
"0.51692957",
"0.51207316",
"0.50766826",
"0.5064046",
"0.5053413",
"0.50450885",
"0.50349313",
"0.503351",
"0.49939486",
"0.49711737",
"0.49670827",
"0.4... | 0.58114266 | 0 |
phase1 stages the centers on sides L and R phase2 stages the centers on sides F and B and put the LR centers in one of 495 states that can be solved without L L' R R'...this is prep work for phase 3 TODO this needs more work BLBFRUFRDDFBUULBRLBRRLDLDLFURFLUBUDRRRDDFDFBBLUFRUFFBBFBLLLDBDFBDBLFDUUFRFBLDUDDURFDRBBDFUUFUBFBDLULDLRRUDFDFULLLUUBUDRLURLBBDURFRBULBRFRBRDRRULDFLFLR results in "5x5x5 edge swaps are odd, cannot pair edges" | def group_centers_phase1_and_2(self) -> None:
self.rotate_U_to_U()
self.rotate_F_to_F()
if self.centers_staged():
return
original_state = self.state[:]
original_solution = self.solution[:]
tmp_solution_len = len(self.solution)
# find multiple phase1 solutions
phase1_solutions = self.lt_LR_centers_stage.solutions_via_c(solution_count=100)
pt_state_indexes = []
pt_state_indexes_LR_centers_special = []
phase2_pt_state_indexes_to_phase1_solution = {}
logger.info(f"found {len(phase1_solutions)} phase1 solutions")
# find the phase2 solution for each phase1 solution
for phase1_solution, (pt0_state, pt1_state, pt2_state, pt3_state, pt4_state) in phase1_solutions:
self.state = original_state[:]
self.solution = original_solution[:]
for step in phase1_solution:
self.rotate(step)
# stage the LR centers
phase2_pt_state_indexes = tuple([pt.state_index() for pt in self.lt_FB_centers_stage.prune_tables])
pt_state_indexes.append(phase2_pt_state_indexes)
phase2_pt_state_indexes_to_phase1_solution[phase2_pt_state_indexes] = phase1_solution
# stage the LR centers and put them into one of 495 states solveable with L L' R R'
phase2_pt_state_indexes = tuple(
[pt.state_index() for pt in self.lt_FB_centers_stage_LR_centers_special.prune_tables]
)
pt_state_indexes_LR_centers_special.append(phase2_pt_state_indexes)
phase2_pt_state_indexes_to_phase1_solution[phase2_pt_state_indexes] = phase1_solution
self.state = original_state[:]
self.solution = original_solution[:]
# stage the FB centers
phase2_solutions = self.lt_FB_centers_stage.solutions_via_c(pt_states=pt_state_indexes, solution_count=1)
phase2_solution = phase2_solutions[0][0]
# stage the FB centers and put LR centers into one of 495 states solveable with L L' R R'
phase2_solutions_lr_centers_special = self.lt_FB_centers_stage_LR_centers_special.solutions_via_c(
pt_states=pt_state_indexes_LR_centers_special, solution_count=1
)
phase2_solution_lr_centers_special = phase2_solutions_lr_centers_special[0][0]
# if we can put the LR centers into one of 495 states without adding to the move count, make it so
if len(phase2_solution_lr_centers_special) <= len(phase2_solution):
min_phase2_solution, (
pt0_state,
pt1_state,
pt2_state,
pt3_state,
pt4_state,
) = phase2_solutions_lr_centers_special[0]
min_phase1_solution = phase2_pt_state_indexes_to_phase1_solution[pt0_state, pt1_state, pt2_state]
else:
min_phase2_solution, (pt0_state, pt1_state, pt2_state, pt3_state, pt4_state) = phase2_solutions[0]
min_phase1_solution = phase2_pt_state_indexes_to_phase1_solution[pt0_state, pt1_state]
logger.info(
f"phase2 solution length {len(phase2_solution)}, phase2_lr_centers_special solution length {len(phase2_solution_lr_centers_special)}"
)
for step in min_phase1_solution:
self.rotate(step)
self.print_cube_add_comment("LR centers staged", tmp_solution_len)
tmp_solution_len = len(self.solution)
for step in min_phase2_solution:
self.rotate(step)
self.print_cube_add_comment("UD FB centers staged", tmp_solution_len) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def chain_corrections():\n \n #read the files\n sample_4m=read_sample(map_files('sample_4m'))\n empty_cell_4m=read_sample(map_files('empty_cell_4m'))\n empty_4m=read_sample(map_files('empty_4m'))\n transmission_sample_cell_4m=read_sample(map_files('trans_sample_4m'))\n transmission_empty_cell_... | [
"0.5802384",
"0.5704981",
"0.553651",
"0.55297977",
"0.55000675",
"0.5490818",
"0.53914285",
"0.5377671",
"0.5346241",
"0.53404874",
"0.5332665",
"0.52918446",
"0.52571434",
"0.52550757",
"0.52523685",
"0.5244776",
"0.5243008",
"0.5238628",
"0.5237757",
"0.52282685",
"0.51770... | 0.7835292 | 0 |
Returns value of card. Always returns 11 for Ace. | def get_value(self):
if self.rank == 'A':
return 11
elif self.rank in ['J', 'Q', 'K']:
return 10
else:
return int(self.rank) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def get_card_value(self, card):\n if card >= 10:\n return 10\n if card == 1:\n return 11\n return card",
"def value(self, card):\n return self.valores[self.deck.index(card)]",
"def card_value (card):\r\n value = card[0]\r\n if value in ['Jack','Queen','Ki... | [
"0.8789612",
"0.8161618",
"0.7929443",
"0.7905337",
"0.76787597",
"0.75404507",
"0.7418031",
"0.7387034",
"0.7376184",
"0.7270906",
"0.72434753",
"0.713611",
"0.708218",
"0.7063227",
"0.6924992",
"0.69160146",
"0.68489075",
"0.6820446",
"0.6620286",
"0.657642",
"0.65416074",
... | 0.61869216 | 35 |
Convert a column number into a column letter (3 > 'C') Right shift the column col_idx by 26 to find column letters in reverse order. These numbers are 1based, and can be converted to ASCII ordinals by adding 64. | def _get_column_letter(col_idx):
# these indicies corrospond to A -> ZZZ and include all allowed
# columns
if not 1 <= col_idx <= 18278:
raise ValueError("Invalid column index {0}".format(col_idx))
letters = []
while col_idx > 0:
col_idx, remainder = divmod(col_idx, 26)
# check for exact division and borrow if needed
if remainder == 0:
remainder = 26
col_idx -= 1
letters.append(chr(remainder+64))
return ''.join(reversed(letters)) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def _index_to_column(i, column=''):\n\n # A dictionary of numbers to letters starting at 0, e.g.\n # {0: 'A', 1: 'B' ...}\n num_to_alpha = {k:v for k, v in enumerate(string.ascii_uppercase, 0)}\n # If our index is divisble by 26, we need to get recursive and add\n # additional letters.\n div = i ... | [
"0.7620537",
"0.74437094",
"0.7439917",
"0.7273949",
"0.68757963",
"0.6614841",
"0.65894353",
"0.6583816",
"0.6494394",
"0.64713115",
"0.64713115",
"0.6470613",
"0.6470613",
"0.6470613",
"0.64606607",
"0.6388831",
"0.6317523",
"0.6244326",
"0.61555386",
"0.60580075",
"0.59901... | 0.7847133 | 0 |
Given a head of LinkedList, delete from that linkedList index j and skip index i iterative | def skip_i_delete_j(head, i, j):
if i == 0:
return None
if head is None or j < 0 or i < 0:
return head
current = head
previous = None
while current:
# skip (i - 1) nodes
for _ in range(i - 1):
if current is None:
return head
current = current.next
previous = current
current = current.next
# delete next j nodes
for _ in range(j):
if current is None:
break
next_node = current.next
current = next_node
previous.next = current
return head | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def delete(self, index):\n if index == 0 and self.head is not None:\n self.head = self.head.next\n return\n\n current_index = 0\n current = self.head\n previous = None\n\n while current:\n if current_index == index:\n previous.next = current.next\n\n previous = current\n ... | [
"0.7670848",
"0.7561153",
"0.73862875",
"0.7377517",
"0.73646194",
"0.73238605",
"0.7250336",
"0.72010875",
"0.71746737",
"0.71504664",
"0.713762",
"0.71322805",
"0.7128258",
"0.7071973",
"0.70681566",
"0.7032534",
"0.69234806",
"0.6903745",
"0.6830704",
"0.6819169",
"0.68181... | 0.81535465 | 0 |
Perform a context visibility test. Creates a (fake) image with the specified owner and is_public attributes, then creates a context with the given keyword arguments and expects exp_res as the result of an is_image_visible() call on the context. | def do_visible(self, exp_res, img_owner, img_public, **kwargs):
img = FakeImage(img_owner, img_public)
ctx = context.RequestContext(**kwargs)
self.assertEqual(ctx.is_image_visible(img), exp_res) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def do_sharable(self, exp_res, img_owner, membership=None, **kwargs):\n\n img = FakeImage(img_owner, True)\n ctx = context.RequestContext(**kwargs)\n\n sharable_args = {}\n if membership is not None:\n sharable_args['membership'] = membership\n\n self.assertEqual(ctx.i... | [
"0.55633384",
"0.54331094",
"0.5389461",
"0.5342315",
"0.5338732",
"0.53361624",
"0.5331995",
"0.53111786",
"0.5263905",
"0.519634",
"0.5192311",
"0.5132145",
"0.51142937",
"0.5112023",
"0.50558454",
"0.49886537",
"0.49874082",
"0.49178144",
"0.47592",
"0.4705346",
"0.4691575... | 0.7743895 | 0 |
Perform a context sharability test. Creates a (fake) image with the specified owner and is_public attributes, then creates a context with the given keyword arguments and expects exp_res as the result of an is_image_sharable() call on the context. If membership is not None, its value will be passed in as the 'membership' keyword argument of is_image_sharable(). | def do_sharable(self, exp_res, img_owner, membership=None, **kwargs):
img = FakeImage(img_owner, True)
ctx = context.RequestContext(**kwargs)
sharable_args = {}
if membership is not None:
sharable_args['membership'] = membership
self.assertEqual(ctx.is_image_sharable(img, **sharable_args), exp_res) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def test_auth_sharable_can_share(self):\n self.do_sharable(True, 'pattieblack', FakeMembership(True),\n tenant='froggy')",
"def do_visible(self, exp_res, img_owner, img_public, **kwargs):\n\n img = FakeImage(img_owner, img_public)\n ctx = context.RequestContext(**kwar... | [
"0.54896724",
"0.54389876",
"0.52578163",
"0.5243541",
"0.5127175",
"0.50320935",
"0.49899673",
"0.49097702",
"0.4775629",
"0.47158346",
"0.47047496",
"0.4655331",
"0.4621686",
"0.46000612",
"0.45601118",
"0.45558378",
"0.45160365",
"0.4514471",
"0.45083925",
"0.45038795",
"0... | 0.8215476 | 0 |
Tests that an empty context (with is_admin set to True) can access an image with is_public set to True. | def test_empty_public(self):
self.do_visible(True, None, True, is_admin=True) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def do_visible(self, exp_res, img_owner, img_public, **kwargs):\n\n img = FakeImage(img_owner, img_public)\n ctx = context.RequestContext(**kwargs)\n\n self.assertEqual(ctx.is_image_visible(img), exp_res)",
"def test_aws_service_api_private_images_get(self):\n pass",
"def test_aws_s... | [
"0.6889831",
"0.67943805",
"0.67671615",
"0.6649116",
"0.66382194",
"0.6531554",
"0.64865774",
"0.6406382",
"0.6406382",
"0.62943596",
"0.6245481",
"0.62123114",
"0.6179777",
"0.61140406",
"0.6112191",
"0.6104334",
"0.61026704",
"0.6068213",
"0.605546",
"0.6054745",
"0.599086... | 0.65038705 | 6 |
Tests that an empty context (with is_admin set to True) can access an owned image with is_public set to True. | def test_empty_public_owned(self):
self.do_visible(True, 'pattieblack', True, is_admin=True) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def test_empty_private_owned(self):\n self.do_visible(True, 'pattieblack', False, is_admin=True)",
"def test_auth_public_unowned(self):\n self.do_visible(True, 'pattieblack', True, tenant='froggy')",
"def test_should_render_for_owner_unpublished(self) -> None:\n self.assertTrue(self.action... | [
"0.68287414",
"0.68124455",
"0.6661694",
"0.65978193",
"0.6575297",
"0.6509962",
"0.6473352",
"0.64539516",
"0.6439792",
"0.63888246",
"0.63792306",
"0.6371669",
"0.6366299",
"0.6361131",
"0.63585526",
"0.62366015",
"0.6124907",
"0.6047954",
"0.6000606",
"0.5996451",
"0.59751... | 0.7047812 | 0 |
Tests that an empty context (with is_admin set to True) can access an image with is_public set to False. | def test_empty_private(self):
self.do_visible(True, None, False, is_admin=True) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def do_visible(self, exp_res, img_owner, img_public, **kwargs):\n\n img = FakeImage(img_owner, img_public)\n ctx = context.RequestContext(**kwargs)\n\n self.assertEqual(ctx.is_image_visible(img), exp_res)",
"def test_aws_service_api_private_images_get(self):\n pass",
"def test_aws_s... | [
"0.6836172",
"0.6736128",
"0.67086965",
"0.6513356",
"0.65056294",
"0.6466665",
"0.64133674",
"0.6399818",
"0.6399818",
"0.63390875",
"0.6302523",
"0.6226055",
"0.61997557",
"0.6121848",
"0.6118551",
"0.6102106",
"0.6089454",
"0.6087831",
"0.6057525",
"0.6023837",
"0.5988064"... | 0.6399744 | 9 |
Tests that an empty context (with is_admin set to True) can access an owned image with is_public set to False. | def test_empty_private_owned(self):
self.do_visible(True, 'pattieblack', False, is_admin=True) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def test_empty_public_owned(self):\n self.do_visible(True, 'pattieblack', True, is_admin=True)",
"def test_auth_public_unowned(self):\n self.do_visible(True, 'pattieblack', True, tenant='froggy')",
"def test_should_render_for_owner_unpublished(self) -> None:\n self.assertTrue(self.action.s... | [
"0.70528495",
"0.6893526",
"0.67592186",
"0.6630321",
"0.65318274",
"0.65298545",
"0.6517861",
"0.65116936",
"0.6454932",
"0.6407351",
"0.63348746",
"0.63260263",
"0.63152415",
"0.6308235",
"0.62680256",
"0.62383586",
"0.6053724",
"0.59971654",
"0.5979315",
"0.59685737",
"0.5... | 0.6911272 | 1 |
Tests that an empty context (with is_admin set to True) can not share an image, with or without membership. | def test_empty_shared(self):
self.do_sharable(False, 'pattieblack', None, is_admin=True)
self.do_sharable(False, 'pattieblack', FakeMembership(True),
is_admin=True) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def test_un_logged_in_user_can_not_upload_picture(self):\n tmp_file = generate_image_for_testing()\n response = self.client.post(self.user_passport_url,\n data={'passport': tmp_file})\n\n self.assertEqual(403, response.status_code)",
"def test_auth_sharable... | [
"0.6628714",
"0.65942466",
"0.6389793",
"0.63213843",
"0.6221423",
"0.6164767",
"0.6150678",
"0.6041313",
"0.6000155",
"0.5972449",
"0.597103",
"0.5943589",
"0.59278715",
"0.59188557",
"0.59188557",
"0.5916836",
"0.59154505",
"0.5850877",
"0.58333635",
"0.5827698",
"0.5801319... | 0.60693204 | 7 |
Tests that an anonymous context (with is_admin set to False) can access an image with is_public set to True. | def test_anon_public(self):
self.do_visible(True, None, True) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def do_visible(self, exp_res, img_owner, img_public, **kwargs):\n\n img = FakeImage(img_owner, img_public)\n ctx = context.RequestContext(**kwargs)\n\n self.assertEqual(ctx.is_image_visible(img), exp_res)",
"def test_home_as_anonymous(self):\n response = self.client.get(\"/images/cont... | [
"0.7238873",
"0.6944182",
"0.6944182",
"0.6802116",
"0.6793539",
"0.6687952",
"0.6679281",
"0.667282",
"0.65554184",
"0.65371454",
"0.6498809",
"0.6494417",
"0.6419172",
"0.6416152",
"0.62828475",
"0.6213219",
"0.61874706",
"0.61568916",
"0.6070943",
"0.6064813",
"0.6054403",... | 0.60884994 | 18 |
Tests that an anonymous context (with is_admin set to False) can access an owned image with is_public set to True. | def test_anon_public_owned(self):
self.do_visible(True, 'pattieblack', True) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def test_auth_public_owned(self):\n self.do_visible(True, 'pattieblack', True, tenant='pattieblack')",
"def do_visible(self, exp_res, img_owner, img_public, **kwargs):\n\n img = FakeImage(img_owner, img_public)\n ctx = context.RequestContext(**kwargs)\n\n self.assertEqual(ctx.is_image... | [
"0.7065106",
"0.6996031",
"0.69618833",
"0.6797919",
"0.6793525",
"0.67584467",
"0.6624481",
"0.65740824",
"0.65740824",
"0.6573112",
"0.65594554",
"0.65575325",
"0.6551023",
"0.6535924",
"0.6526421",
"0.64701694",
"0.6450757",
"0.6430041",
"0.63988215",
"0.6285752",
"0.62624... | 0.69320416 | 3 |
Tests that an anonymous context (with is_admin set to False) can access an unowned image with is_public set to False. | def test_anon_private(self):
self.do_visible(True, None, False) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def test_auth_public_unowned(self):\n self.do_visible(True, 'pattieblack', True, tenant='froggy')",
"def test_auth_private_unowned(self):\n self.do_visible(False, 'pattieblack', False, tenant='froggy')",
"def test_home_as_anonymous(self):\n response = self.client.get(\"/images/contents/\")... | [
"0.74188906",
"0.7377053",
"0.7144698",
"0.7144698",
"0.6877964",
"0.67840487",
"0.676745",
"0.67583287",
"0.6704905",
"0.6680704",
"0.66680026",
"0.66457",
"0.663838",
"0.6636891",
"0.6628976",
"0.6577022",
"0.65723354",
"0.6503181",
"0.6480543",
"0.6474261",
"0.64629656",
... | 0.6370962 | 24 |
Tests that an anonymous context (with is_admin set to False) cannot access an owned image with is_public set to False. | def test_anon_private_owned(self):
self.do_visible(False, 'pattieblack', False) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def test_auth_public_unowned(self):\n self.do_visible(True, 'pattieblack', True, tenant='froggy')",
"def test_auth_private_unowned(self):\n self.do_visible(False, 'pattieblack', False, tenant='froggy')",
"def test_get_user_template_as_anonymous_with_access_right_raises_access_control_error(\n ... | [
"0.7152943",
"0.7109335",
"0.70072263",
"0.69585896",
"0.69585896",
"0.68980104",
"0.6817293",
"0.6704428",
"0.66895926",
"0.64946806",
"0.64736044",
"0.64594865",
"0.645942",
"0.644374",
"0.64420414",
"0.6405941",
"0.6374608",
"0.6368752",
"0.6364217",
"0.6354941",
"0.634457... | 0.6603411 | 9 |
Tests that an empty context (with is_admin set to True) can not share an image, with or without membership. | def test_anon_shared(self):
self.do_sharable(False, 'pattieblack', None)
self.do_sharable(False, 'pattieblack', FakeMembership(True)) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def test_un_logged_in_user_can_not_upload_picture(self):\n tmp_file = generate_image_for_testing()\n response = self.client.post(self.user_passport_url,\n data={'passport': tmp_file})\n\n self.assertEqual(403, response.status_code)",
"def test_auth_sharable... | [
"0.6629645",
"0.6598161",
"0.6393106",
"0.6323076",
"0.62207663",
"0.61628443",
"0.61534476",
"0.6073732",
"0.6038234",
"0.6002864",
"0.5974506",
"0.5970309",
"0.5945625",
"0.5925215",
"0.5923474",
"0.5923474",
"0.59200865",
"0.59187025",
"0.5852431",
"0.58361256",
"0.5830204... | 0.54502434 | 86 |
Tests that an authenticated context (with is_admin set to False) can access an image with is_public set to True. | def test_auth_public(self):
self.do_visible(True, None, True, tenant='froggy') | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def do_visible(self, exp_res, img_owner, img_public, **kwargs):\n\n img = FakeImage(img_owner, img_public)\n ctx = context.RequestContext(**kwargs)\n\n self.assertEqual(ctx.is_image_visible(img), exp_res)",
"def test_admin_public(self):\n with self.login(self.user_admin):\n ... | [
"0.7359513",
"0.6947033",
"0.6891199",
"0.6887777",
"0.67541796",
"0.66183466",
"0.65862226",
"0.6581423",
"0.64067996",
"0.6383469",
"0.6383469",
"0.63796556",
"0.6267833",
"0.6206277",
"0.61293125",
"0.612802",
"0.6117827",
"0.61051565",
"0.6098563",
"0.6088459",
"0.6074225... | 0.6749067 | 5 |
Tests that an authenticated context (with is_admin set to False) can access an image (which it does not own) with is_public set to True. | def test_auth_public_unowned(self):
self.do_visible(True, 'pattieblack', True, tenant='froggy') | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def do_visible(self, exp_res, img_owner, img_public, **kwargs):\n\n img = FakeImage(img_owner, img_public)\n ctx = context.RequestContext(**kwargs)\n\n self.assertEqual(ctx.is_image_visible(img), exp_res)",
"def test_aws_service_api_private_images_get(self):\n pass",
"def test_aws_s... | [
"0.7225246",
"0.7020056",
"0.7001125",
"0.6687295",
"0.6627152",
"0.6603058",
"0.6603058",
"0.6587212",
"0.6518558",
"0.6515378",
"0.64673233",
"0.63507557",
"0.63226664",
"0.63195735",
"0.6267392",
"0.6243786",
"0.6220447",
"0.62151307",
"0.6181711",
"0.61252385",
"0.6124277... | 0.6331947 | 12 |
Tests that an authenticated context (with is_admin set to False) can access an image (which it does own) with is_public set to True. | def test_auth_public_owned(self):
self.do_visible(True, 'pattieblack', True, tenant='pattieblack') | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def do_visible(self, exp_res, img_owner, img_public, **kwargs):\n\n img = FakeImage(img_owner, img_public)\n ctx = context.RequestContext(**kwargs)\n\n self.assertEqual(ctx.is_image_visible(img), exp_res)",
"def test_aws_service_api_private_image_get(self):\n pass",
"def test_aws_se... | [
"0.73359025",
"0.69640315",
"0.6943459",
"0.6736147",
"0.6731248",
"0.65971106",
"0.65788954",
"0.6512353",
"0.6501864",
"0.6422808",
"0.63721627",
"0.63721627",
"0.6363177",
"0.6315687",
"0.6243033",
"0.6159482",
"0.6147465",
"0.6144617",
"0.6143973",
"0.6141446",
"0.6107203... | 0.64223385 | 10 |
Tests that an authenticated context (with is_admin set to False) can access an image with is_public set to False. | def test_auth_private(self):
self.do_visible(True, None, False, tenant='froggy') | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def do_visible(self, exp_res, img_owner, img_public, **kwargs):\n\n img = FakeImage(img_owner, img_public)\n ctx = context.RequestContext(**kwargs)\n\n self.assertEqual(ctx.is_image_visible(img), exp_res)",
"def test_aws_service_api_private_image_get(self):\n pass",
"def test_aws_se... | [
"0.7295332",
"0.69605845",
"0.69604754",
"0.67785037",
"0.66477525",
"0.6625932",
"0.65665686",
"0.6512257",
"0.65008277",
"0.65008277",
"0.6442916",
"0.62628233",
"0.62376827",
"0.6148696",
"0.6145751",
"0.6145588",
"0.61448425",
"0.61161464",
"0.6112119",
"0.60931945",
"0.6... | 0.66329974 | 5 |
Tests that an authenticated context (with is_admin set to False) cannot access an image (which it does not own) with is_public set to False. | def test_auth_private_unowned(self):
self.do_visible(False, 'pattieblack', False, tenant='froggy') | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def test_no_images_unauthorized(self):\n res = self.client.get(IMAGE_URL)\n self.assertEqual(res.status_code, status.HTTP_401_UNAUTHORIZED)",
"def test_unauthenticated_resource_allowed(self):\n raise NotImplementedError # FIXME",
"def test_un_logged_in_user_can_not_upload_picture(self):\n... | [
"0.72276163",
"0.69970745",
"0.6978492",
"0.68080735",
"0.6803085",
"0.6803085",
"0.67497104",
"0.6643472",
"0.6630605",
"0.6568257",
"0.65023047",
"0.64936197",
"0.6412895",
"0.6403637",
"0.6389285",
"0.6367777",
"0.6367777",
"0.6348167",
"0.6298395",
"0.6289524",
"0.6269371... | 0.6672808 | 7 |
Tests that an authenticated context (with is_admin set to False) can access an image (which it does own) with is_public set to False. | def test_auth_private_owned(self):
self.do_visible(True, 'pattieblack', False, tenant='pattieblack') | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def do_visible(self, exp_res, img_owner, img_public, **kwargs):\n\n img = FakeImage(img_owner, img_public)\n ctx = context.RequestContext(**kwargs)\n\n self.assertEqual(ctx.is_image_visible(img), exp_res)",
"def test_aws_service_api_private_image_get(self):\n pass",
"def test_aws_se... | [
"0.72539985",
"0.70253825",
"0.7010216",
"0.66228914",
"0.65394044",
"0.652322",
"0.649416",
"0.649245",
"0.649245",
"0.6490199",
"0.6474233",
"0.64500856",
"0.64078796",
"0.6296748",
"0.6282635",
"0.6253098",
"0.6213612",
"0.61675084",
"0.61526585",
"0.60946745",
"0.6082156"... | 0.61762923 | 17 |
Tests that an authenticated context (with is_admin set to False) cannot share an image it neither owns nor is shared with it. | def test_auth_sharable(self):
self.do_sharable(False, 'pattieblack', None, tenant='froggy') | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def test_auth_sharable_cannot_share(self):\n self.do_sharable(False, 'pattieblack', FakeMembership(False),\n tenant='froggy')",
"def cant_share_photo(request, ttl=None,*args, **kwargs):\n\tif ttl:\n\t\ttry:\n\t\t\tttl = int(ttl)\n\t\texcept ValueError:\n\t\t\tttl = None\n\tphoto_id... | [
"0.73269576",
"0.66646326",
"0.662856",
"0.6424367",
"0.6423024",
"0.63863295",
"0.62619466",
"0.6225412",
"0.62130284",
"0.62111557",
"0.62085885",
"0.61964643",
"0.61871755",
"0.60659873",
"0.6040665",
"0.59974575",
"0.59781015",
"0.59628546",
"0.5954561",
"0.59475374",
"0.... | 0.5450656 | 81 |
Tests that an authenticated context (with is_admin set to True) can share an image it neither owns nor is shared with it. | def test_auth_sharable_admin(self):
self.do_sharable(True, 'pattieblack', None, tenant='froggy',
is_admin=True) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def test_auth_sharable_cannot_share(self):\n self.do_sharable(False, 'pattieblack', FakeMembership(False),\n tenant='froggy')",
"def ensure_share(self, context, share, share_server=None):\n pass",
"def ensure_share(self, context, share, share_server=None):\r\n LOG.d... | [
"0.7128801",
"0.6828019",
"0.67746824",
"0.67188835",
"0.6670886",
"0.64948475",
"0.63549715",
"0.63543147",
"0.61875457",
"0.6095076",
"0.6056876",
"0.60101897",
"0.600731",
"0.59870404",
"0.59508693",
"0.5939599",
"0.5927158",
"0.58969176",
"0.58855337",
"0.5838346",
"0.581... | 0.55289805 | 44 |
Tests that an authenticated context (with is_admin set to False) can share an image it owns, even if it is not shared with it. | def test_auth_sharable_owned(self):
self.do_sharable(True, 'pattieblack', None, tenant='pattieblack') | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def canShare(self):\n return False",
"def test_auth_sharable_can_share(self):\n self.do_sharable(True, 'pattieblack', FakeMembership(True),\n tenant='froggy')",
"def do_sharable(self, exp_res, img_owner, membership=None, **kwargs):\n\n img = FakeImage(img_owner, Tru... | [
"0.6706358",
"0.6633116",
"0.6622457",
"0.66168797",
"0.6576476",
"0.6559533",
"0.62385696",
"0.6178727",
"0.6154038",
"0.60761106",
"0.60420334",
"0.59743327",
"0.5963598",
"0.58454823",
"0.5845463",
"0.5824839",
"0.57912004",
"0.5788092",
"0.57464755",
"0.5700856",
"0.56992... | 0.6179839 | 7 |
Tests that an authenticated context (with is_admin set to False) cannot share an image it does not own even if it is shared with it, but with can_share = False. | def test_auth_sharable_cannot_share(self):
self.do_sharable(False, 'pattieblack', FakeMembership(False),
tenant='froggy') | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def ensure_share(self, context, share, share_server=None):\n pass",
"def ensure_share(self, context, share, share_server=None):\r\n LOG.debug(\"Ensure share.\")",
"def cant_share_photo(request, ttl=None,*args, **kwargs):\n\tif ttl:\n\t\ttry:\n\t\t\tttl = int(ttl)\n\t\texcept ValueError:\n\t\t\ttt... | [
"0.6938848",
"0.6857029",
"0.68210304",
"0.67752564",
"0.6616296",
"0.63722545",
"0.6287799",
"0.6185038",
"0.61454177",
"0.6070145",
"0.6063103",
"0.6063056",
"0.59651726",
"0.5954177",
"0.5950448",
"0.58537835",
"0.5789933",
"0.57651097",
"0.5743968",
"0.57354796",
"0.57342... | 0.74366206 | 0 |
Tests that an authenticated context (with is_admin set to False) can share an image it does not own if it is shared with it with can_share = True. | def test_auth_sharable_can_share(self):
self.do_sharable(True, 'pattieblack', FakeMembership(True),
tenant='froggy') | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def ensure_share(self, context, share, share_server=None):\n pass",
"def canShare(self):\n return False",
"def ensure_share(self, context, share, share_server=None):\r\n LOG.debug(\"Ensure share.\")",
"def test_auth_sharable_cannot_share(self):\n self.do_sharable(False, 'pattiebla... | [
"0.7160142",
"0.71592975",
"0.70918334",
"0.70580095",
"0.65058416",
"0.635865",
"0.6244558",
"0.62139976",
"0.6194017",
"0.6169052",
"0.61176854",
"0.6066014",
"0.605547",
"0.59966147",
"0.59790087",
"0.59150696",
"0.58924675",
"0.5879898",
"0.5861287",
"0.57947785",
"0.5792... | 0.6919593 | 4 |
Init args with argparse | def init_args():
parser = argparse.ArgumentParser(description='Create xls for Tom')
parser.add_argument('start', metavar='N', type=int, help='starting '
'number')
parser.add_argument('total_x', metavar='N', type=int,
help='total number of x rows')
parser.add_argument('total_y', metavar='N', type=int,
help='total number of y columns')
parser.add_argument('filename', metavar='NAME', default='test.csv',
type=str, help='file name to write to, should end in '
'csv')
return parser.parse_args() | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def init_args():\n parser = argparse.ArgumentParser(\n description=\"DeltaSherlock Client software.\")\n parser.add_argument('-v', '--version', action='version', version=VERSION)\n parser.add_argument('-c', '--config', action='store', dest='config_file',\n default='./config.i... | [
"0.79507685",
"0.7793449",
"0.77239007",
"0.77109313",
"0.76677924",
"0.7543103",
"0.7493199",
"0.7482822",
"0.7471515",
"0.74647325",
"0.74401",
"0.73976904",
"0.7346049",
"0.732926",
"0.7325903",
"0.73169327",
"0.7307563",
"0.7270258",
"0.72573745",
"0.7214987",
"0.7203224"... | 0.76917267 | 4 |
loads file FILTER, returns filter matrix | def load_filter():
if not os.path.isfile(FILTER):
print('no filter found, creating square grid')
return []
with open(FILTER, 'r') as ff:
reader = csv.reader(ff)
l = list(reader)
ar = numpy.asarray(l)
# ar = numpy.transpose(ar, (0, 1))
# ar = numpy.flip(ar, 1)
# ar = numpy.rot90(ar, k=3, axes=(0, 1))
# ar = numpy.swapaxes(ar, 0, 1)
f = list(map(list, ar))
return f | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def load_filter_file(self, file_path): \n self._pop_all_self()\n self.filter_list = []\n self.file_path = file_path \n \n with codecs.open(self.file_path, 'r', encoding='cp1252') as fid: \n for k, line in enumerate(fid):\n line = line.lstrip('\\n\\r ')\n... | [
"0.66520554",
"0.657589",
"0.65067047",
"0.64896256",
"0.63868827",
"0.6371127",
"0.626495",
"0.5997112",
"0.59562635",
"0.5929189",
"0.59240067",
"0.5835717",
"0.58037555",
"0.5700353",
"0.56678426",
"0.5623952",
"0.5620478",
"0.55956954",
"0.5576885",
"0.55100983",
"0.55041... | 0.7438268 | 0 |
returns boolean, whether xy is occupied in filter matrix | def filtered(filter, xy):
try:
x, y = xy
return bool(filter[x][y])
except IndexError:
return False | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def xy_occupied(xy, board):\n return True if board[xy[0]][xy[1]] else False",
"def occupiedNeighbor(self, xi, yi):\n\n xmax = self.mapData.og.info.width\n ymax = self.mapData.og.info.height\n\n if self.mapData.sampled:\n # Fails on an occupied cell\n assert self.mapD... | [
"0.6924757",
"0.6860181",
"0.6504782",
"0.6499604",
"0.6476733",
"0.6406629",
"0.6393374",
"0.63787687",
"0.6288766",
"0.6284607",
"0.6230571",
"0.62087417",
"0.6196269",
"0.61808234",
"0.6141441",
"0.612595",
"0.61152285",
"0.61060596",
"0.60959953",
"0.60850585",
"0.6084111... | 0.71220756 | 0 |
Do all the grunt work of the snaking values, ordering the filtered blanks, and basically all the heavy lifting | def create_matrix(totals, filter, start=0, odd=False):
i = start
blank = ''
x, y = 0, 0
total_x, total_y = totals
# matrix is represented as
#
# row are down
# t-> 1 7
# 2 9
# 3 10
# 4 11
# 5 12
# 6 13
# Transposed with zip later
matrix = []
while y < total_y:
row = []
blank_pos = []
while x < total_x:
# TODO: Blank all points before starting coords
if bool(i % 2) != odd: # xor operator for two boolean variables
blank_pos.append(x)
elif filtered(filter, (x, y)):
blank_pos.append(x)
x += 1
continue
else:
row.append(i)
x += 1
i += 1
if y % 2: # if odd
row.reverse()
for pos in blank_pos:
row.insert(pos, blank)
matrix.append(row)
y += 1
x = 0
final = list(map(list, zip_longest(*matrix)))
print('final matrix')
for f in final:
print(f)
return final | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def order_filter(self,elements):",
"def sorted_data():\n stock_data = scrape_data()\n filtered_data = list(filter(sort_func, stock_data))\n return filtered_data",
"def sort_by_default(self):\n self.data.sort()",
"def sorting_by_criteria(self, result):\r\n\t\tresult = sorted(result, key=lambda... | [
"0.58309174",
"0.5732334",
"0.55798095",
"0.55124855",
"0.55037796",
"0.548661",
"0.5477536",
"0.5469715",
"0.5449085",
"0.5353315",
"0.5303698",
"0.5301049",
"0.5292167",
"0.5289656",
"0.52799255",
"0.5173217",
"0.51695305",
"0.5167786",
"0.5151389",
"0.51467687",
"0.5128702... | 0.0 | -1 |
Write the matrix to a csv table | def write_out(matrix, filename):
with open(filename, 'w') as csvfile:
writer = csv.writer(csvfile)
for r in matrix:
writer.writerow(r)
print(filename + ' writen!') | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def generate_csv(table, header):\n with open(\"%s.csv\" % header, \"w\") as csvfile:\n for i in range(len(table)):\n for j in range(len(table[i])):\n if j != len(table[i])-1:\n tmp = table[i][j] + \",\"\n else:\n tmp = table[i... | [
"0.75623345",
"0.7330622",
"0.71900606",
"0.71231455",
"0.71107894",
"0.7031687",
"0.7024952",
"0.70113516",
"0.697658",
"0.69399834",
"0.6934993",
"0.69087684",
"0.69058",
"0.6873836",
"0.6852782",
"0.6852024",
"0.6777883",
"0.676096",
"0.6755106",
"0.67167455",
"0.6708375",... | 0.76784086 | 0 |
Name a city and the country it resides in seperated by a comma. | def city_country(city, country):
print(f'"{city.title()}, {country.title()}"\n') | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def city_names(city, country):\n place = f\"{city}, {country}\"\n return place.title()",
"def city_country(city, country):\n city_and_country = city + ', ' + country\n return city_and_country.title()",
"def city_country(city_name, country_name):\n city_country_combo = city_name + ', ' + country_... | [
"0.8305632",
"0.8101193",
"0.80840385",
"0.80514556",
"0.8050137",
"0.7992045",
"0.79826546",
"0.7955863",
"0.79475707",
"0.7865331",
"0.7797506",
"0.77545387",
"0.7729826",
"0.7729826",
"0.7728276",
"0.75599986",
"0.75591683",
"0.72416097",
"0.7220424",
"0.71964306",
"0.7175... | 0.760025 | 15 |
Construct a DCEL from the output of matplotlib.delaunay.delaunay. | def from_delaunay_triangulation(cls, xl, yl, triangles, circumcentres):
def add_containing_face_to_dcel():
containing_face_edges = [edge for edge in dcel.edges if not edge.nxt]
edge = containing_face_edges.pop()
face = Face(outer_component=None, inner_components=[edge])
dcel.faces.append(face)
first_edge = edge
previous_edge = [
e for e in containing_face_edges if e.get_destination() == edge.origin
]
edge.prev = previous_edge[0]
while len(containing_face_edges) > 1:
edge.incident_face = face
next_edge = [
e for e in containing_face_edges if e.origin == edge.get_destination()
]
edge.nxt = next_edge[0]
next_edge[0].prev = edge
edge = next_edge[0]
containing_face_edges.remove(next_edge[0])
edge_2 = containing_face_edges.pop()
edge.incident_face = face
edge_2.incident_face = face
edge_2.prev = edge
edge_2.nxt = first_edge
edge.nxt = edge_2
def add_triangle_edges(circumcentre):
triangles_edges = []
for vertex_idx, origin in enumerate(triangle_vertices):
# Destination of the edge in this triangle that has vertex as origin
destination = triangle_vertices[(vertex_idx + 1) % 3]
edge_1 = HalfEdge(origin)
edge_2 = HalfEdge(destination, twin=edge_1)
edge_1.twin = edge_2
edge_1 = dcel.add_edge(edge_1)
edge_2.twin = edge_1
edge_2 = dcel.add_edge(edge_2)
edge_1.twin = edge_2
triangles_edges.append(edge_1)
triangle_face = Face(triangles_edges[0], circumcentre=list(circumcentre))
dcel.faces.append(triangle_face)
# Set previous and next of the edges
for edge_idx, edge in enumerate(triangles_edges):
edge.nxt = triangles_edges[(edge_idx + 1) % 3]
edge.prev = triangles_edges[(edge_idx + 3 - 1) % 3]
edge.incident_face = triangle_face
triangle_vertices[edge_idx].incident_edge = edge
dcel = cls()
for t_idx, t in enumerate(triangles):
triangle_vertices = [
dcel.add_vertex(Vertex(x))
for x in du.get_triangle_vertices(xl, yl, t)
]
add_triangle_edges(circumcentres[t_idx])
add_containing_face_to_dcel()
return dcel | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def _mesh(self):\n from scipy.spatial import Delaunay\n points = self.cluster.get_positions()\n delaunay = Delaunay(points)\n simplices = self._filter_max_dist_in_element(delaunay.simplices)\n delaunay.simplices = simplices\n return delaunay",
"def __plot_delaunay(self, ... | [
"0.553893",
"0.5346823",
"0.52831537",
"0.50846463",
"0.49604708",
"0.48745608",
"0.48555076",
"0.485055",
"0.4848358",
"0.4832407",
"0.47853115",
"0.47777563",
"0.47689658",
"0.47675616",
"0.47572455",
"0.474961",
"0.4736425",
"0.47201127",
"0.4714435",
"0.47010985",
"0.4685... | 0.5686502 | 0 |
Add an edge to DCEL if it doesn't already exists, otherwise return the existing edge. | def add_edge(self, edge):
try:
edge_idx = self.edges.index(edge)
return self.edges[edge_idx]
except Exception:
self.edges.append(edge)
return edge | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def add_edge(self, edge):\n\n add_egde = True\n for edge_this in self.edges:\n if edge_this == edge:\n add_egde = False\n\n if add_egde:\n self.edges.append(edge)\n\n return self",
"def add_edge(self, edge):\n edge = set(edge)\n (vert... | [
"0.7570172",
"0.7543887",
"0.7385329",
"0.731582",
"0.7228451",
"0.72140056",
"0.7205442",
"0.7191608",
"0.7144214",
"0.712575",
"0.7108078",
"0.7094593",
"0.7083264",
"0.6992474",
"0.6966737",
"0.6870384",
"0.6825222",
"0.6818147",
"0.67740756",
"0.67177004",
"0.6700951",
... | 0.81017184 | 0 |
Add vertex to DCEL if it doesn't already exists, otherwise return the existing vertex. | def add_vertex(self, vertex):
try:
vertex_idx = self.vertices.index(vertex)
# print "{} already in {}".format(vertex, self.vertices)
return self.vertices[vertex_idx]
except Exception:
self.vertices.append(vertex)
# print "adding {} to {}".format(vertex, self.vertices)
return vertex | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def add_vertex(self, vertex):\n if vertex.id not in self.vertices.keys():\n self.vertices[vertex.id] = vertex",
"def _add_vertex(self, x, y):\n v = Vertex2(x, y)\n i = bisect(self.vertices, v)\n \n # if vertex at these coordinates exists just return it\n if le... | [
"0.7698422",
"0.75747514",
"0.7562474",
"0.75239784",
"0.7504211",
"0.7403369",
"0.7356343",
"0.7279313",
"0.71772546",
"0.7124853",
"0.70904213",
"0.7066278",
"0.7066278",
"0.7043618",
"0.70346177",
"0.7016917",
"0.69948727",
"0.6946342",
"0.6899464",
"0.6882716",
"0.6859618... | 0.8166046 | 0 |
Construct a DCEL object. | def __init__(self, vertices=None, edges=None, faces=None):
super(DCEL, self).__init__()
self.vertices = vertices or []
self.edges = edges or []
self.faces = faces or [] | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def build(*args, **kwargs):\n\n\treturn Excel(*args, **kwargs)",
"def __init__(self, name=None, compile_paths=combined_path):\n Hay2011Cell.__init__(self, name=name, compile_paths=compile_paths)",
"def new( self, d, x, y, dx, n='temp.grd', nd=-999.0):\n self.data = d\n self.name = n\n ... | [
"0.5953067",
"0.5625412",
"0.5618868",
"0.5610069",
"0.5567573",
"0.553519",
"0.5409826",
"0.5340056",
"0.5289628",
"0.52513236",
"0.52174574",
"0.52136445",
"0.5164729",
"0.5140498",
"0.5093613",
"0.50666684",
"0.5061276",
"0.50513726",
"0.5045033",
"0.5029647",
"0.50290495"... | 0.5404663 | 7 |
Return all faces where the circumcentre is not infinity. | def get_bounded_faces(self):
return [face for face in self.faces if face.is_bounded()] | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def faces_only(self):\n return self._faces_only",
"def get_filtered_faces(self, faces):\n filtered_faces = []\n for face in faces:\n i, j, k = face\n thresh = 100.0\n if self.get_distance_between_points(i, j) > thresh:\n continue\n e... | [
"0.6049252",
"0.6032412",
"0.5654293",
"0.5523289",
"0.55073357",
"0.5405898",
"0.5375053",
"0.53417516",
"0.52805036",
"0.52619165",
"0.52610266",
"0.5258601",
"0.5257462",
"0.5247194",
"0.5216561",
"0.52134645",
"0.5212665",
"0.5200357",
"0.5186478",
"0.51604086",
"0.515638... | 0.5622148 | 3 |
Add a face to DCEL if it doesn't already exists, otherwise return the existing face. | def add_face(self, face):
try:
face_idx = self.faces.index(face)
return self.faces[face_idx]
except Exception:
self.faces.append(face)
return face | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def add_face(self, face):\n\n if face.uuid is None:\n face.uuid = self._generate_uuid()\n\n if face.uuid in self._faces:\n error_str = \"Trying to add an already existing face with uuid: \"\\\n + str(face.uuid)\n raise KeyError(error_str)\n\n sel... | [
"0.7516604",
"0.62119764",
"0.61790365",
"0.5979341",
"0.5872748",
"0.5751965",
"0.5587595",
"0.539488",
"0.5394591",
"0.5375931",
"0.53083056",
"0.5234154",
"0.52226603",
"0.5124483",
"0.5124483",
"0.5102945",
"0.50553864",
"0.5042418",
"0.5035193",
"0.502191",
"0.5008115",
... | 0.8184843 | 0 |
Return a list of vertices that form the outer boundary of finite faces of the DCEL. | def get_outer_boundary_of_voronoi(self):
edge = [edge for edge in self.edges if not edge.nxt][0]
# next(obj for obj in objs if obj.val==5)
first_vertex = edge.origin
outer_boundary = []
while (not edge.get_destination() == first_vertex):
if(edge.get_destination().is_infinity()):
edge = edge.twin.nxt
else:
outer_boundary.append(edge)
edge = edge.nxt
outer_boundary.append(edge)
return outer_boundary | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def GetInteriorEdgesQuad(self):\n\n if not isinstance(self.all_edges,np.ndarray):\n self.GetEdgesQuad()\n if not isinstance(self.edges,np.ndarray):\n self.GetBoundaryEdgesQuad()\n\n sorted_all_edges = np.sort(self.all_edges,axis=1)\n sorted_boundary_edges = np.sort... | [
"0.6706478",
"0.6694034",
"0.6630309",
"0.6623699",
"0.66021216",
"0.65841985",
"0.6554914",
"0.64516014",
"0.6362444",
"0.63408965",
"0.6277447",
"0.62755173",
"0.61893046",
"0.6162313",
"0.6147987",
"0.6136316",
"0.612656",
"0.611977",
"0.61181563",
"0.610831",
"0.60700697"... | 0.73313373 | 0 |
Return the dual of the current DCEL. | def dual(self):
def set_twins():
for edge_idx in range(0, len(dual_dcel.edges), 2):
dual_dcel.edges[edge_idx].twin = dual_dcel.edges[edge_idx + 1]
dual_dcel.edges[edge_idx + 1].twin = dual_dcel.edges[edge_idx]
def set_next_and_previous():
for face in dual_dcel.faces:
face_edges = [edge for edge in dual_dcel.edges if edge.incident_face == face]
for edge in face_edges:
if(not edge.get_destination().is_infinity()):
edge.nxt = [e for e in face_edges if e.origin == edge.get_destination()][0]
if(not edge.origin.is_infinity()):
edge.prev = [e for e in face_edges if edge.origin == e.get_destination()][0]
dual_dcel = DCEL()
for edge in self.edges:
incident_face = dual_dcel.add_face(Face(circumcentre=edge.twin.origin.as_points()))
origin = dual_dcel.add_vertex(Vertex(coordinates=edge.incident_face.circumcentre))
dual_edge = HalfEdge(
origin=origin,
incident_face=incident_face
)
incident_face.outer_component = dual_edge
origin.incident_edge = dual_edge
dual_dcel.edges.append(dual_edge)
set_twins()
set_next_and_previous()
return dual_dcel | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def dual(self):\n return dual_array(self)",
"def getdualobj(self,whichsol_):\n dualobj_ = ctypes.c_double()\n res = __library__.MSK_XX_getdualobj(self.__nativep,whichsol_,ctypes.byref(dualobj_))\n if res != 0:\n _,msg = self.__getlasterror(res)\n raise Error(rescode(res),msg)\n dualo... | [
"0.68338317",
"0.6423258",
"0.5941094",
"0.5921593",
"0.57853687",
"0.57633495",
"0.5762203",
"0.57469624",
"0.5682356",
"0.5682002",
"0.5639214",
"0.5613858",
"0.55889916",
"0.55681217",
"0.5535743",
"0.5530557",
"0.55077",
"0.54985017",
"0.5457592",
"0.54481125",
"0.5441906... | 0.6778644 | 1 |
Printfriendly representation of the DCEL object. | def __repr__(self):
return (
'<DCEL ('
'vertices:\n {obj.vertices},\n'
'edges:\n {obj.edges},\n'
'faces:\n {obj.faces}>'.format(obj=self)
) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def __repr__(self):\n cls = self.__class__.__name__\n return '%s(%s)' % (cls, repr(self.d))",
"def __str__(self):\n result=\"curv %f d0 %f z0 %f ctheta %f phi %f barcode %d\"%(self.curv,self.d0,self.z0,self.ctheta,self.phi,self.barcode)\n return result",
"def printObj(self):\n ... | [
"0.71572053",
"0.70599174",
"0.70522857",
"0.69488704",
"0.69239604",
"0.6836956",
"0.6819858",
"0.6812137",
"0.6802802",
"0.6789431",
"0.6776764",
"0.6766797",
"0.6753627",
"0.6751448",
"0.6745186",
"0.67189395",
"0.6699513",
"0.6692117",
"0.6681709",
"0.6676318",
"0.6663971... | 0.74030674 | 0 |
Read the VQE convergence data for the mini BMN model from disk | def read_data(
optimizer: str,
p: dict,
):
filename = f"{p['f']}_l{p['l']}_convergence_{optimizer}_{p['v']}_depth{p['d']}_reps{p['n']}_max{p['m']}.{p['s']}"
if not os.path.isfile(filename):
print(f"{filename} does not exist.")
sys.exit()
if p['s'] == 'h5':
df = pd.read_hdf(filename, "vqe")
if p['s'] == 'gz':
df = pd.read_pickle(filename)
return df[df.counts<=p['m']] | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def read_models():\n model_files_cvd = np.sort(glob.glob(\"./grad_results/cvd*N1024_f0003.npy\"))\n model_files_mnist = np.sort(glob.glob(\"./grad_results/mnist*N25000_f02.npy\"))\n\n model_files_cvd = np.array([model_files_cvd[2], model_files_cvd[1], model_files_cvd[0]])\n\n results_cvd = []\n resu... | [
"0.590859",
"0.5844918",
"0.5836278",
"0.57506764",
"0.5689922",
"0.565109",
"0.5614794",
"0.55639184",
"0.55183434",
"0.5517771",
"0.5503399",
"0.5463083",
"0.5459767",
"0.54251224",
"0.5416442",
"0.5392664",
"0.5355077",
"0.53432804",
"0.5338355",
"0.53167695",
"0.53060263"... | 0.0 | -1 |
Read the VQE convergence data for the mini BMN model from disk | def collect_data(
optimizers: list,
p: dict,
):
# concatenate the results from all files
frames = [read_data(o, p) for o in optimizers]
return pd.concat(frames, keys=optimizers, names=["Optimizer"]) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def read_models():\n model_files_cvd = np.sort(glob.glob(\"./grad_results/cvd*N1024_f0003.npy\"))\n model_files_mnist = np.sort(glob.glob(\"./grad_results/mnist*N25000_f02.npy\"))\n\n model_files_cvd = np.array([model_files_cvd[2], model_files_cvd[1], model_files_cvd[0]])\n\n results_cvd = []\n resu... | [
"0.5908623",
"0.58457416",
"0.583959",
"0.5752228",
"0.56917495",
"0.5652151",
"0.56139976",
"0.55662304",
"0.5519502",
"0.5518119",
"0.550503",
"0.54647243",
"0.54624826",
"0.54254407",
"0.5418097",
"0.53947306",
"0.5358178",
"0.53448343",
"0.53399765",
"0.53206843",
"0.5307... | 0.0 | -1 |
Read the VQE convergence data for the mini BMN model from disk | def plot_convergence(
optimizers: list = ["COBYLA", "SLSQP", "L-BFGS-B", "NELDER-MEAD"],
g2N: float = 0.2,
maxit: int = 10000,
varform: list = ["ry"],
depth: int = 3,
nrep: int = 10,
dataprefix: str = "data/miniBMN",
datasuffix: str = "h5",
figprefix: str = "figures/miniBMN",
ht: float = 0.0,
up: int = 1000,
):
# setup parameters
params = dict()
params["l"] = str(g2N).replace(".", "")
params["d"] = depth
params["v"] = "-".join(varform)
params["m"] = maxit
params["n"] = nrep
params["f"] = dataprefix
params["s"] = datasuffix
assert type(optimizers).__name__ == "list"
# collect data
result = collect_data(optimizers, params)
# get best runs
gs = dict()
for r in optimizers:
gs[r] = result.loc[r].groupby("rep").apply(min).energy
gsdf = pd.DataFrame.from_dict(gs, dtype=float)
print(gsdf.describe().T[["min", "max", "mean", "std"]])
# Plot
# select the best runs for each optimizer
fig, ax = plt.subplots()
for o in optimizers:
result.loc[o, gsdf[o].idxmin()].plot(
x="counts", y="energy", xlim=[0, up], label=o, ax=ax
)
ax.axhline(ht, c="k", ls="--", lw="2", label="HT")
ax.set_xlabel("iterations")
ax.set_ylabel("VQE energy")
ax.legend(loc="upper right")
filename = f"{figprefix}_l{params['l']}_convergence_{params['v']}_depth{params['d']}_nr{params['n']}_max{params['m']}_xlim{up}"
plt.savefig(f"{filename}.pdf")
plt.savefig(f"{filename}.png")
plt.savefig(f"{filename}.svg")
plt.close() | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def read_models():\n model_files_cvd = np.sort(glob.glob(\"./grad_results/cvd*N1024_f0003.npy\"))\n model_files_mnist = np.sort(glob.glob(\"./grad_results/mnist*N25000_f02.npy\"))\n\n model_files_cvd = np.array([model_files_cvd[2], model_files_cvd[1], model_files_cvd[0]])\n\n results_cvd = []\n resu... | [
"0.590859",
"0.5844918",
"0.5836278",
"0.57506764",
"0.5689922",
"0.565109",
"0.5614794",
"0.55639184",
"0.55183434",
"0.5517771",
"0.5503399",
"0.5463083",
"0.5459767",
"0.54251224",
"0.5416442",
"0.5392664",
"0.5355077",
"0.53432804",
"0.5338355",
"0.53167695",
"0.53060263"... | 0.0 | -1 |
Store the camera intrinsics. We need this for the calibration matrices from the Tango | def new_camera_intrinsics_callback(self, new_camera_info):
self.camera_intrinsics = new_camera_info
self.k_mat = np.matrix(
np.array(self.camera_intrinsics.K).reshape((3, 3))
)
self.k_inv = self.k_mat.I | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def save_intrinsics(self, save_dir):\n if not osp.isfile(\n osp.join(save_dir, 'intrinsics', 'intrinsics.npy')):\n np.save(osp.join(\n save_dir, 'intrinsics', 'intrinsics'), self.camera_model.K)",
"def load_extrinsics(self):\n return self.um.read_json(\"extr... | [
"0.6322945",
"0.597689",
"0.58319306",
"0.5828599",
"0.57685983",
"0.5751193",
"0.57245207",
"0.5624981",
"0.55312103",
"0.550769",
"0.55075365",
"0.5502988",
"0.54702735",
"0.54578793",
"0.53877527",
"0.5327595",
"0.53023946",
"0.5278144",
"0.5220536",
"0.5179092",
"0.516386... | 0.6199243 | 1 |
Take keypoint motion data from other node and process it | def new_motion_callback(self, new_motion_msg):
# we can't do anything until we have the camera calibration
if self.camera_intrinsics is None:
# TOmaybeDO: use a wait_for_message instead of missing a frame?
return
previous_kp = np.stack(
(new_motion_msg.prev_x, new_motion_msg.prev_y),
axis=1
)
current_kp = np.stack(
(new_motion_msg.cur_x, new_motion_msg.cur_y),
axis=1
)
f_mat = self.calculate_fundamental_matrix(previous_kp, current_kp)
camera_matrix, R_mat, t_mat = self.manually_calculate_pose(f_mat)
error_amount, triangulated = self.triangulation(
previous_kp, current_kp,
self.base_transformation_mat, camera_matrix
)
# print np.linalg.norm(np.array(error_amount))
for p in triangulated:
print p
self.pub_point_cloud.publish(
header=Header(
stamp=rospy.Time.now(), # TODO: use camera image time
frame_id='map'
),
points=[Point32(p[0], p[1], p[2]) for p in triangulated]
)
# get quaternion from rotation matrix
tf_rot = np.identity(4)
tf_rot[0:3, 0:3] = R_mat
quat = tf.transformations.quaternion_from_matrix(tf_rot)
old_quat = self.accumulated_pose.orientation
new_quat = tf.transformations.quaternion_multiply(
[old_quat.x, old_quat.y, old_quat.z, old_quat.w],
quat
)
normalized_new_quat = tf.transformations.quaternion_from_euler(
*tf.transformations.euler_from_quaternion(new_quat)
)
print normalized_new_quat
self.accumulated_pose.orientation = Quaternion(
*normalized_new_quat
)
self.pub_pose.publish(
header=Header(
stamp=rospy.Time.now(), # TODO: use camera image time
frame_id='map'
),
pose=Pose(
Point(
0, 0, 0
),
self.accumulated_pose.orientation
)
) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def PTS(self):",
"def dnd_motion(self, source, event):",
"def motion_model(particle_poses, speed_command, odom_pose, odom_pose_prev, dt):\n \n M = particle_poses.shape[0]\n \n # TODO. For each particle calculate its predicted pose plus some\n # additive error to represent the process noise. Wi... | [
"0.5876557",
"0.5821907",
"0.5732931",
"0.56815475",
"0.56735855",
"0.56616944",
"0.5590481",
"0.5567074",
"0.54753345",
"0.5468342",
"0.54676706",
"0.53700924",
"0.5357709",
"0.5344554",
"0.53419507",
"0.53375906",
"0.5330831",
"0.53234816",
"0.5321119",
"0.5305486",
"0.5304... | 0.5297739 | 21 |
Returns a point cloud | def triangulation(self, kp_a, kp_b, cam_a, cam_b):
reproj_error = []
point_cloud = []
for i in range(len(kp_a)):
# convert to normalized homogeneous coordinates
kp = kp_a[i]
u = np.array([kp[0], kp[1], 1.0])
mat_um = self.k_inv * np.matrix(u).T
u = np.array(mat_um[:, 0])
kp_ = kp_b[i]
u_ = np.array([kp_[0], kp_[1], 1.0])
mat_um_ = self.k_inv * np.matrix(u_).T
u_ = np.array(mat_um_[:, 0])
# now we triangulate!
x = self.linear_ls_triangulation(
u, cam_a, u_, cam_b
)
point_cloud.append(x.flatten())
# calculate reprojection error
# reproject to other img
x_for_camera = np.matrix(
np.append(x, [[1.0]], axis=0)
)
x_pt_img = np.array(self.k_mat * cam_b * x_for_camera).flatten()
x_pt_img_ = np.array([
x_pt_img[0] / x_pt_img[2],
x_pt_img[1] / x_pt_img[2]
])
# check error in matched keypoint
reproj_error.append(
np.linalg.norm(x_pt_img_ - kp_)
)
return reproj_error, point_cloud | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def point_cloud(self):\n\t\tgen = self.loop(point_cloud=True)\n\t\tpoint_cloud = next(gen)\n\t\treturn point_cloud",
"def convertcloud(points):\n pcd = open3d.geometry.PointCloud()\n pcd.points = open3d.utility.Vector3dVector(points)\n return pcd",
"def as_point_cloud(self):\n far = 1000.0 # m... | [
"0.8203496",
"0.77815324",
"0.7489397",
"0.743419",
"0.7415985",
"0.7225747",
"0.708484",
"0.7042392",
"0.6747202",
"0.6592699",
"0.6537746",
"0.65085596",
"0.6495195",
"0.6450036",
"0.64452165",
"0.64442986",
"0.64307445",
"0.6306346",
"0.62692606",
"0.6268943",
"0.6201976",... | 0.0 | -1 |
Python version of Mastering Opencv With Practical Computer Vision Projects' LST implementation on page 144 | def linear_ls_triangulation(self, point_a, cam_a, point_b, cam_b):
# build A matrix
# import pdb; pdb.set_trace()
point_a = point_a.flatten()
point_b = point_b.flatten()
mat_a = np.matrix([
[point_a[0]*cam_a[2, 0]-cam_a[0, 0], point_a[0]*cam_a[2, 1]-cam_a[0, 1], point_a[0]*cam_a[2, 2]-cam_a[0, 2]],
[point_a[1]*cam_a[2, 0]-cam_a[1, 0], point_a[1]*cam_a[2, 1]-cam_a[1, 1], point_a[1]*cam_a[2, 2]-cam_a[1, 2]],
[point_b[0]*cam_b[2, 0]-cam_b[0, 0], point_b[0]*cam_b[2, 1]-cam_b[0, 1], point_b[0]*cam_b[2, 2]-cam_b[0, 2]],
[point_b[1]*cam_b[2, 0]-cam_b[1, 0], point_b[1]*cam_b[2, 1]-cam_b[1, 1], point_b[1]*cam_b[2, 2]-cam_b[1, 2]]
])
# build B vector
mat_b = np.matrix([
[-(point_a[0]*cam_a[2, 3]-cam_a[0, 3])],
[-(point_a[1]*cam_a[2, 3]-cam_a[1, 3])],
[-(point_b[0]*cam_b[2, 3]-cam_b[0, 3])],
[-(point_b[1]*cam_b[2, 3]-cam_b[1, 3])]
])
# solve for X
_, x = cv2.solve(mat_a, mat_b, None, cv2.DECOMP_SVD)
return x | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def test_lk():\n\n # get current directory to work relative to current file path\n curdir = os.path.dirname(__file__)\n\n # Load configuration for system\n yaml_file = os.path.join(curdir, 'config.yaml')\n with open(yaml_file, \"r\") as f:\n config = yaml.load(f)\n\n # extract list of vide... | [
"0.6522741",
"0.6153111",
"0.6147058",
"0.61378473",
"0.61305165",
"0.6099224",
"0.60517925",
"0.60009754",
"0.5988831",
"0.5987549",
"0.59458303",
"0.5937482",
"0.59371877",
"0.59214646",
"0.5915029",
"0.5895097",
"0.5894147",
"0.5874924",
"0.584025",
"0.58343947",
"0.582210... | 0.0 | -1 |
The main run loop | def run(self):
r = rospy.Rate(100)
while not rospy.is_shutdown():
r.sleep() | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def loop(self):\n pass",
"def _run(self):\n while(self._loop):\n pass",
"async def _main(self):\n while True:\n time.sleep(1)",
"def run(self):\n self.cmdloop()",
"def main_loop(self):\n # main loop...don't ever exit\n while True:\n # collect dat... | [
"0.8346334",
"0.8201697",
"0.80821764",
"0.7956556",
"0.7799716",
"0.7637182",
"0.75982195",
"0.75860673",
"0.75406194",
"0.7487311",
"0.7481487",
"0.7428722",
"0.73967844",
"0.7389132",
"0.73753315",
"0.7373896",
"0.7358908",
"0.73579377",
"0.73549044",
"0.73549044",
"0.7353... | 0.0 | -1 |
Add padding for unet of given depth | def _pad(x, depth=4):
divisor = np.power(2, depth)
remainder = x.shape[0] % divisor
# no padding because already of even shape
if remainder == 0:
return x
# add zero rows after 1D feature
elif len(x.shape) == 2:
return np.pad(x, [(0, divisor - remainder), (0, 0)], "constant")
# add zero columns and rows after 2D feature
elif len(x.shape) == 3:
return np.pad(x, [(0, divisor - remainder), (0, divisor - remainder),
(0, 0)], "constant") | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def space_to_depth_fixed_padding(inputs, kernel_size,\n data_format='channels_last', block_size=2):\n pad_total = kernel_size - 1\n pad_beg = (pad_total // 2 + 1) // block_size\n pad_end = (pad_total // 2) // block_size\n return _padding(inputs, (pad_beg, pad_end), data_format)"... | [
"0.66942734",
"0.6406283",
"0.61821586",
"0.6131536",
"0.5901226",
"0.5837195",
"0.57383364",
"0.56973714",
"0.56866306",
"0.56743133",
"0.56252444",
"0.551921",
"0.55042475",
"0.5423706",
"0.5403531",
"0.54034203",
"0.5395218",
"0.53895396",
"0.538164",
"0.5379684",
"0.53743... | 0.69494796 | 0 |
returns a normalized url to path relative from root | def relative_url(path, root):
try:
url = os.path.relpath(path, root)
except:
error('Unable to make a relative url:', url, root)
url = url.replace('\\', '/') if os.sep == '\\' else url
return urllib.parse.quote(url) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def full_url(self, path):\n if path[0] == '/':\n path = path[1:]\n return urljoin(self.absolute_root, path)",
"def getRootURL():",
"def relative_base(base):\n return as_base(base).lstrip('/')",
"def _graceful_relative_url(base_url, url):\n if url == base_url:\n return ''... | [
"0.75811696",
"0.7120959",
"0.7007499",
"0.6957676",
"0.6937742",
"0.6913981",
"0.6850913",
"0.67784756",
"0.6737724",
"0.67350227",
"0.67350227",
"0.6698321",
"0.6689216",
"0.6677582",
"0.6671769",
"0.6658958",
"0.66039646",
"0.6588936",
"0.65848976",
"0.65747464",
"0.656249... | 0.7165835 | 1 |
Generate Post objects from markdown. Date must be present in each post and posts must be ordrered by date. | def parse_markdown(filename):
if not os.path.exists(filename):
error('File not found', filename)
posts = list()
with open(filename, encoding='utf-8') as f:
line = next(f)
if line.startswith('# '):
title = line[2:].strip()
record = []
next(f)
else:
title = None
record = [line]
for line in f:
if not line.startswith('___'):
record.append(line)
else:
posts.append(Post.from_markdown(record))
record = []
# set rank of posts in date
daterank = defaultdict(int)
for post in posts:
daterank[post.date] += 1
post.daterank = daterank[post.date]
# check post order
for post1, post2 in zip(posts[:-1], posts[1:]):
if post1.date > post2.date:
error('Posts are not ordered', f'{post1.date} > {post2.date}')
return title, posts | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def markdown_post(post):\n post['entry'] = markdown(post['entry'].replace(\"\\n\",\" \\n\"), output=\"html5\")\n return post",
"def parse_post_text(formatted_content):\n post = {}\n # Parse Mod comments and remove them from the text.\n potential_comments = re.finditer(\"\\[.+?\\]\", formatted_con... | [
"0.6771389",
"0.62583774",
"0.59715056",
"0.59394884",
"0.59075785",
"0.58579963",
"0.5806396",
"0.58032244",
"0.57632285",
"0.5762416",
"0.575449",
"0.5736609",
"0.5716471",
"0.5630635",
"0.56303996",
"0.55910885",
"0.5574774",
"0.55405563",
"0.5535492",
"0.55039394",
"0.549... | 0.7360025 | 0 |
Purge root dir from irrelevant html files | def purge_htmlfiles(args, posts):
htmlist = list_of_htmlfiles(args, posts)
html_to_remove = list()
for fullname in glob.glob(os.path.join(args.root, '*.htm*')):
if fullname not in htmlist:
html_to_remove.append(fullname)
if len(html_to_remove) > args.thumbnails.threshold_htmlfiles:
inpt = 'x'
while inpt not in 'yn':
inpt = input(f'{len(html_to_remove)} html files to remove. Continue [y|n]? ').lower()
if inpt == 'n':
return
for name in html_to_remove:
print('Removing html files', name)
os.remove(name) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def clean(ctx):\n ctx.run(\"rm -rf build/html\")",
"def cleanup():\n download_dir = settings.DOWNLOAD_BASE_DIR\n\n for base, dirs, files in os.walk(download_dir):\n for dir in dirs:\n shutil.rmtree(download_dir + dir)",
"def _cleanup_files(self):\n\n for root, dirs, files in os.walk(self.bu... | [
"0.7720015",
"0.6934762",
"0.68778396",
"0.6763646",
"0.66906065",
"0.6680769",
"0.668029",
"0.66643465",
"0.66492623",
"0.6645479",
"0.6635241",
"0.6626942",
"0.6605654",
"0.65854466",
"0.654416",
"0.6536765",
"0.6526797",
"0.64898103",
"0.64494216",
"0.6443703",
"0.6431596"... | 0.72082686 | 1 |
Purge thumbnail dir from irrelevant thumbnails | def purge_thumbnails(args, thumbdir, posts, diary=False):
thumblist = list_of_thumbnails(posts, diary)
thumbs_to_remove = list()
for fullname in glob.glob(os.path.join(thumbdir, '*.jpg')):
if os.path.basename(fullname) not in thumblist:
thumbs_to_remove.append(fullname)
if len(thumbs_to_remove) > args.thumbnails.threshold_thumbs:
inpt = 'x'
while inpt not in 'yn':
inpt = input(f'{len(thumbs_to_remove)} thumbnails to remove. Continue [y|n]? ').lower()
if inpt == 'n':
return
for name in thumbs_to_remove:
print('Removing thumbnail', name)
os.remove(name)
info_fullname = os.path.splitext(name)[0] + '.info'
if os.path.exists(info_fullname):
os.remove(info_fullname) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def clear_thumbnails(self):",
"def delete_thumbnail(self, thumbnail_name):",
"def tearDown(self):\n for fn in self.tempImages:\n os.remove(os.path.join(self.root, fn))\n os.rmdir(self.root)",
"def clear_tmp_folder(self):\r\n for file in os.listdir(self.temp_dir):\r\n ... | [
"0.7496226",
"0.70975465",
"0.6904142",
"0.6789052",
"0.65433615",
"0.64652795",
"0.64232606",
"0.6410066",
"0.635366",
"0.6340497",
"0.63255644",
"0.63222384",
"0.6308864",
"0.630171",
"0.6284883",
"0.6272671",
"0.6269268",
"0.62621397",
"0.62551665",
"0.6248571",
"0.6245241... | 0.7741738 | 0 |
Return the list of full paths for files in source directory | def list_of_files(sourcedir, recursive):
result = list()
if recursive is False:
listdir = sorted_listdir(os.listdir(sourcedir))
if '.nomedia' not in listdir:
for basename in listdir:
result.append(os.path.join(sourcedir, basename))
else:
for root, dirs, files in os.walk(sourcedir):
if '.nomedia' not in files:
for basename in sorted_listdir(files):
result.append(os.path.join(root, basename))
return result | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def get_source_files(self):\n return [\n path.as_posix()\n for path in _Path(self.src_dir).rglob(\"*\")\n if not path.is_dir()\n ] + [\n (path / \"CMakeLists.txt\").as_posix()\n for path in _PurePath(self.src_dir).parents\n ]",
"def coll... | [
"0.8271542",
"0.77901995",
"0.75900644",
"0.73890495",
"0.7383353",
"0.7309688",
"0.7303101",
"0.7151451",
"0.7086724",
"0.70593715",
"0.7048522",
"0.704018",
"0.6996113",
"0.69825387",
"0.69230485",
"0.68788785",
"0.6873243",
"0.6849214",
"0.6813808",
"0.68076485",
"0.678657... | 0.6541307 | 39 |
Return the list of full paths for pictures and movies in source directory | def list_of_medias(args, sourcedir, recursive):
files = list_of_files(sourcedir, recursive)
return [_ for _ in files if is_media_within_dates(_, args.dates)] | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def __return_movie_file_list(self, movie_path):\n movie_dir = movie_path.rsplit(\"/\",1)[0]\n movie_file_list =[]\n movie_extentionds = self.__movie_file_extensions(self.__file_extentions)\n for x in os.listdir(movie_dir):\n if x.rsplit(\".\",1)[-1]in movie_extentionds:\n ... | [
"0.6780654",
"0.664078",
"0.66328037",
"0.6586579",
"0.6527416",
"0.6516118",
"0.6454078",
"0.6445807",
"0.6427995",
"0.64033985",
"0.6284854",
"0.6242137",
"0.62136245",
"0.62066734",
"0.61857104",
"0.61600107",
"0.61456895",
"0.6120278",
"0.61164725",
"0.6079566",
"0.607903... | 0.0 | -1 |
Return the list of full paths for pictures and movies in source directory plus subdirectories containing media | def list_of_medias_ext(args, sourcedir):
result = list()
listdir = sorted_listdir(os.listdir(sourcedir))
if '.nomedia' not in listdir:
for basename in listdir:
fullname = os.path.join(sourcedir, basename)
if os.path.isdir(fullname) and basename != '$RECYCLE.BIN' and contains_media(args, fullname):
result.append(fullname)
else:
if is_media_within_dates(fullname, args.dates):
result.append(fullname)
return result | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def list_of_files(sourcedir, recursive):\n result = list()\n if recursive is False:\n listdir = sorted_listdir(os.listdir(sourcedir))\n if '.nomedia' not in listdir:\n for basename in listdir:\n result.append(os.path.join(sourcedir, basename))\n else:\n for r... | [
"0.6816371",
"0.6584394",
"0.65694135",
"0.6454687",
"0.64294946",
"0.63914907",
"0.63858587",
"0.6369066",
"0.6280144",
"0.62456554",
"0.6161519",
"0.6160253",
"0.61361057",
"0.61112374",
"0.60726917",
"0.60657465",
"0.6015738",
"0.60046023",
"0.59833866",
"0.5970308",
"0.59... | 0.6835324 | 0 |
/Gilles/Dev/journal/tests/subdir/deeper2/deepest/OCT_20000112_000004.jpg > deeper2_deepest_OCT_20000112_000004.jpg /Gilles/Dev/journal/tests/subdir/deeper2/deepest > deeper2_deepest | def relative_name(media_fullname, sourcedir):
x = os.path.relpath(media_fullname, sourcedir)
x = x.replace('\\', '_').replace('/', '_').replace('#', '_')
return x | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def create_train(train_img_path):\n\n f = open(\"train.txt\", \"w+\")\n for subdirs, dirs, files in os.walk(train_img_path):\n for filename in files:\n if filename.endswith(\".jpg\"):\n train_image_path = os.path.join(train_img_path, filename)\n print(train_ima... | [
"0.6020291",
"0.58817405",
"0.5803224",
"0.57723814",
"0.57670635",
"0.57295036",
"0.5712866",
"0.56850314",
"0.56731784",
"0.5619671",
"0.55809706",
"0.5572275",
"0.5563066",
"0.55071867",
"0.55031073",
"0.538915",
"0.5343728",
"0.5336606",
"0.5318499",
"0.53176695",
"0.5316... | 0.0 | -1 |
return True if images read on file are identical, False otherwise | def compare_image_buffers(imgbuf1, imgbuf2):
with io.BytesIO(imgbuf1) as imgio1, io.BytesIO(imgbuf2) as imgio2:
img1 = Image.open(imgio1)
img2 = Image.open(imgio2)
diff = ImageChops.difference(img1, img2)
return not diff.getbbox() | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def __compareImage(self, file1, file2):\n # arg=self.__validateString(str_arg)\n # file1, file2=arg.split(' ', 1)\n try:\n img1 = Image.open(file1)\n img2 = Image.open(file2)\n if img1.size != img2.size:\n return False\n by1 = img1.tob... | [
"0.73973125",
"0.6985823",
"0.68735695",
"0.6753808",
"0.6718825",
"0.67187357",
"0.67060715",
"0.66544104",
"0.64797544",
"0.6415226",
"0.6404903",
"0.6333785",
"0.629946",
"0.62671864",
"0.6233922",
"0.6232194",
"0.61956316",
"0.6156336",
"0.60619223",
"0.6051723",
"0.60221... | 0.57149756 | 64 |
Compose html with blogger image urls | def compose_blogger_html(args, title, posts, imgdata, online_videos):
for post in posts:
for media in post.medias:
if type(media) is PostImage:
if media.uri not in imgdata:
print('Image missing: ', media.uri)
else:
img_url, resized_url = imgdata[media.uri]
media.uri = img_url
media.resized_url = resized_url
elif type(media) is PostVideo:
if not online_videos:
print('Video missing: ', media.uri)
else:
media.iframe = online_videos[0]
del online_videos[0]
else:
assert False
return print_html(args, posts, title, '', target='blogger') | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def replfunc(self, match):\n url = match.group(1)\n imgformat = url.split('.')[-1]\n if url.startswith('http'):\n data = urlopen(url).read()\n elif url.startswith('data'):\n img = '<img src=\"' + url + '\" ' + match.group(2) + ' />'\n return img\n ... | [
"0.65580297",
"0.6551254",
"0.65510756",
"0.6550227",
"0.6437125",
"0.6404325",
"0.6345454",
"0.63356936",
"0.6310244",
"0.6258961",
"0.6221798",
"0.6157185",
"0.6137797",
"0.60765594",
"0.606654",
"0.6046435",
"0.60122216",
"0.6008134",
"0.60027015",
"0.60017127",
"0.5978731... | 0.74483454 | 0 |
Export blogger html to clipboard. If full, export complete html, otherwise export html extract ready to paste into blogger edit mode. | def prepare_for_blogger(args):
title, posts = parse_markdown(os.path.join(args.root, 'index.md'))
online_images, online_videos = online_images_url(args)
if args.check_images and check_images(args, posts, online_images) is False:
pass
html = compose_blogger_html(args, title, posts, online_images, online_videos)
if args.full is False:
html = re.search('<body>(.*)?</body>', html, flags=re.DOTALL).group(1)
html = re.sub('<script>.*?</script>', '', html, flags=re.DOTALL)
html = STYLE.replace('%%', '%') + html
if args.dest:
with open(args.dest, 'wt', encoding='utf-8') as f:
f.write(html)
else:
clipboard.copy(html) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def make_backup(filename, html):\n\n with open(filename, 'wb') as f:\n f.write(html)",
"def write_to_paste_buffer(txt):\n pyperclip.copy(txt)",
"def clipboard(self, text = None):\n if text == None:\n response = self._fetch_json('/api/clipboard')\n return response['cont... | [
"0.5765858",
"0.56113607",
"0.55505186",
"0.55185163",
"0.54795206",
"0.5450024",
"0.5427715",
"0.54080874",
"0.5321129",
"0.5313652",
"0.52682567",
"0.52502394",
"0.52400166",
"0.5201354",
"0.5193638",
"0.51862955",
"0.51706195",
"0.51384276",
"0.5110709",
"0.51039314",
"0.5... | 0.6119939 | 0 |
For testing identity between a diary file and the fle obtained after reading and printing it. See testing. | def idempotence(args):
title, posts = parse_markdown(os.path.join(args.root, 'index.md'))
print_markdown(posts, title, os.path.join(args.dest, 'index.md')) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def _test_example_eda_adf():\n main([\"pnictogen/repo/split.ADF.in\", \"data/water-dimer.xyz\"])\n assert_equals(\n open(\"data/water-dimer_eda.in\").read(),\n \"\"\"TITLE data/water-dimer.xyz eda\n\nCHARGE 0 0\n\nNumber of atoms\n 6\n\nATOMS Cartesian\nO 0.12908 -0.26336 ... | [
"0.59925705",
"0.59771883",
"0.59220266",
"0.5896933",
"0.58921814",
"0.58638084",
"0.57837987",
"0.5661089",
"0.56471264",
"0.56424177",
"0.5633926",
"0.56308526",
"0.5623441",
"0.5612273",
"0.56118274",
"0.56060433",
"0.5597619",
"0.55867624",
"0.557899",
"0.5573398",
"0.55... | 0.0 | -1 |
Made before reading config file (config file located in args.root). Check and normalize root path. | def setup_part1(args):
args.rootarg = args.root
rootext = os.path.splitext(args.rootarg)[1]
if rootext == '':
pass
else:
args.root = os.path.dirname(args.root)
if args.root:
args.root = os.path.abspath(args.root)
if not os.path.isdir(args.root):
if args.gallery:
os.mkdir(args.root)
else:
error('Directory not found', args.root) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def get_config_file(self):\n\n conf_file = self.args.file\n if conf_file is not None:\n if os.path.isfile(conf_file):\n config_file = open(conf_file, \"r\")\n self.main_file = yaml.load(config_file, Loader=yaml.FullLoader)\n elif os.path.isfile(\n ... | [
"0.6453089",
"0.63893116",
"0.62628293",
"0.6203292",
"0.61769146",
"0.6169113",
"0.6103033",
"0.6092019",
"0.60891813",
"0.6075031",
"0.6063229",
"0.60553133",
"0.60498255",
"0.6032961",
"0.60153127",
"0.5980272",
"0.59365386",
"0.59269124",
"0.5921976",
"0.5921835",
"0.5918... | 0.0 | -1 |
Made after reading config file. Check for ffmpeg in path. Create .thumbnails dir if necessary and create .nomedia in it. Copy photobox file to destination dir. Handle priority between command line and config file. | def setup_part2(args):
if args.update:
args.sourcedir = args.source.sourcedir
args.bydir = args.source.bydir
args.bydate = args.source.bydate
args.diary = args.source.diary
args.recursive = args.source.recursive
args.dates = args.source.dates
args.github_pages = args.source.github_pages
elif args.gallery:
args.source.sourcedir = args.sourcedir
args.source.bydir = args.bydir
args.source.bydate = args.bydate
args.source.diary = args.diary
args.source.recursive = args.recursive
args.source.dates = args.dates
args.source.github_pages = args.github_pages
update_config(args)
if args.github_pages:
args.html_suffix = '.html'
else:
args.html_suffix = '.htm'
rootext = os.path.splitext(args.rootarg)[1]
if rootext:
args.rootname = os.path.basename(args.rootarg)
else:
args.rootname = 'index' + args.html_suffix
if args.sourcedir:
args.sourcedir = os.path.abspath(args.sourcedir)
if os.path.splitdrive(args.sourcedir)[0]:
drive, rest = os.path.splitdrive(args.sourcedir)
args.sourcedir = drive.upper() + rest
if not os.path.isdir(args.sourcedir):
error('Directory not found', args.sourcedir)
else:
if args.gallery and args.diary is False and args.update is None:
error('Directory not found', 'Use --sourcedir')
if args.dest:
args.dest = os.path.abspath(args.dest)
if args.dest is None:
args.dest = args.root
if args.blogger and args.urlblogger is None:
error('No blogger url (--url)')
if args.gallery or args.update:
# check for ffmpeg and ffprobe in path
for exe in ('ffmpeg', 'ffprobe'):
try:
check_output([exe, '-version'])
except FileNotFoundError:
error('File not found', exe)
if args.github_pages:
args.thumbrep = 'thumbnails'
else:
args.thumbrep = '.thumbnails'
args.thumbdir = os.path.join(args.dest, args.thumbrep)
if not os.path.exists(args.thumbdir):
os.mkdir(args.thumbdir)
open(os.path.join(args.thumbdir, '.nomedia'), 'a').close()
favicondst = os.path.join(args.dest, 'favicon.ico')
if not os.path.isfile(favicondst):
faviconsrc = os.path.join(os.path.dirname(__file__), 'favicon.ico')
shutil.copyfile(faviconsrc, favicondst)
photoboxdir = os.path.join(args.dest, 'photobox')
if not os.path.exists(photoboxdir):
photoboxsrc = os.path.join(os.path.dirname(__file__), 'photobox')
shutil.copytree(photoboxsrc, photoboxdir)
if args.dates:
if not(args.gallery or args.create):
# silently ignored for the moment, otherwise all other commands will
# launch a wanrning or an error on the default --dates value
pass
if args.dates == 'source':
pass
elif args.dates == 'diary':
if args.create:
error('Incorrect date format', args.dates)
elif re.match(r'\d+-\d+', args.dates):
date1, date2 = args.dates.split('-')
if validate_date(date1) and validate_date(date2):
args.dates = date1, date2
else:
error('Incorrect date format', args.dates)
else:
error('Incorrect date format', args.dates) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def take_one_shot(path_to_images, name_image, video_source=\"/dev/video0\"):\n subprocess_cmd(\"ffmpeg -f video4linux2 -s 1280x720 -i {} -frames 1 ./{}/{} -loglevel error -nostats\".format(video_source, path_to_images, name_image))",
"def makeVideo():\n os.system(\"cd video && ffmpeg -r 10 -i img%05d.jpg -... | [
"0.5893241",
"0.57616824",
"0.5529838",
"0.55258685",
"0.55187756",
"0.55067265",
"0.5499056",
"0.54705536",
"0.5458571",
"0.5449385",
"0.54415053",
"0.53093326",
"0.5306078",
"0.53042513",
"0.5287746",
"0.5274733",
"0.5265946",
"0.5246467",
"0.52405924",
"0.5228054",
"0.5227... | 0.57895535 | 1 |
Read command line argument runtype Throws error if the choice is not correct | def parseArg():
try:
parser = argparse.ArgumentParser(
description='This is the Scheduler export utility')
parser.add_argument('--weekofmonth', action='store', dest='weekofmonth',
required=True, help='select the week of month[1-5]', type = int, choices=[1,2,3,4,5])
parser.add_argument('--dayofweek', action='store', dest='dayofweek', help='select day of week [1-7]', type=int, choices=[1,2,3,4,5,6,7])
args = parser.parse_args()
global WEEK
global DAY
WEEK = args.weekofmonth
DAY = args.dayofweek
log.info("1;EME;RUNNING;000;Scheduler.py;;;;;STARTING " + os.path.basename(__file__))
schedule(WEEK, DAY)
except Exception as e:
log.exception("1;EME;FAILURE;700;STARTUP ERROR " + str(e), exc_info=False)
sys.exit(0) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def readArgs():\n args = sys.argv\n if len(args) != 3:\n print(\"ERROR - Wrong number of arguments! \\n\")\n print(\"Usage: plotGantt.py TYPE path/to/result/file.gantt \\n where TYPE is : MTS / SCH\")\n exit(5)\n if args[1] != \"MTS\" and args[1] != \"SCH\":\n print(\"ERROR - W... | [
"0.7166374",
"0.67722404",
"0.6072575",
"0.60625833",
"0.60188425",
"0.5963004",
"0.593148",
"0.5922895",
"0.59138274",
"0.5889174",
"0.5888878",
"0.58836305",
"0.5879857",
"0.58746564",
"0.5859843",
"0.5856361",
"0.5829581",
"0.58261716",
"0.58230263",
"0.5807125",
"0.580537... | 0.0 | -1 |
Returns the week of the month for the specified date. | def week_of_month(dt):
try:
first_day = dt.replace(day=1)
dom = dt.day
if first_day.weekday() == 6:
adjusted_dom = dom + day_of_week(dt) - 1
else:
adjusted_dom = dom + day_of_week(dt)
return int(ceil(adjusted_dom/7.0))
except Exception as e:
log.exception("1;EME;FAILURE;700; FUNCTION ERROR " + str(e), exc_info=False)
sys.exit(0) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def get_week_from_date(date) -> int:\n month, year = date.month, date.year\n if month < 4:\n year -= 1\n ld = _labor_day(year)\n wk1_wed = ld + timedelta(days=2)\n days_since = (date - wk1_wed).days\n weeks_since = days_since / 7.\n week = math.floor(weeks_since) + 1\n return int(wee... | [
"0.7487706",
"0.7056256",
"0.70537466",
"0.70099276",
"0.70012397",
"0.6820069",
"0.6787127",
"0.66652584",
"0.6636667",
"0.651747",
"0.6508568",
"0.644575",
"0.6422966",
"0.64131665",
"0.6229527",
"0.6217697",
"0.62044543",
"0.61213183",
"0.60555804",
"0.6036671",
"0.6029071... | 0.65848774 | 9 |
Returns customized day of week as first day Default first day of week is Monday mday used to set firstweek of day | def day_of_week(dt):
cday = dt
mday = 2
uday = cday.isocalendar()[2] + mday
try:
if uday > 7:
CURRDAY = uday - 7
log.debug("1;EME;RUNNING;000;Scheduler.py;Setting customized day of week>7 : ", CURRDAY)
else:
CURRDAY = uday
log.debug("1;EME;RUNNING;000;Scheduler.py;Setting customized day of week : ", CURRDAY)
return CURRDAY
except Exception as e:
log.exception("1;EME;FAILURE;700;SCHEDULE ERROR " + str(e), exc_info=False)
sys.exit(0) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def first_day_of_week(self):\n return self.__first_day_of_week",
"def locale_first_weekday():\n\tfirst_weekday = 6 #by default settle on monday\n\n\ttry:\n\t\tprocess = os.popen(\"locale first_weekday week-1stday\")\n\t\tweek_offset, week_start = process.read().split('\\n')[:2]\n\t\tprocess.close()\n\t\tw... | [
"0.7771828",
"0.7742936",
"0.7577031",
"0.75041586",
"0.74610543",
"0.74022716",
"0.74017537",
"0.7226098",
"0.715162",
"0.71447414",
"0.7032424",
"0.69580626",
"0.68952614",
"0.6892024",
"0.6892024",
"0.6819581",
"0.6817187",
"0.6786361",
"0.67820686",
"0.67820686",
"0.67739... | 0.6687542 | 30 |
Returns the q'th percentile of the distribution given in the argument 'data'. Uses the 'precision' parameter to control the noise level. | def Quantile(data, q, precision=1.0):
N, bins = np.histogram(data, bins=precision*np.sqrt(len(data)))
norm_cumul = 1.0*N.cumsum() / len(data)
for i in range(0, len(norm_cumul)):
if norm_cumul[i] > q:
return bins[i] | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def Quartiles(data):\n q = np.percentile(data, [25, 50, 75])\n\n return q[0], q[1], q[2]",
"def test__quantile(self):\r\n # regular cases\r\n sample_data = array(range(25, 42))\r\n assert_almost_equal(_quantile(sample_data, 0.5), median(sample_data))\r\n\r\n # sorted data is ass... | [
"0.72270185",
"0.7012418",
"0.6803648",
"0.67029893",
"0.67029893",
"0.669614",
"0.6685391",
"0.65556973",
"0.65500534",
"0.65500534",
"0.65500534",
"0.64803755",
"0.64564687",
"0.64286137",
"0.64046985",
"0.6381233",
"0.6363074",
"0.636056",
"0.6354891",
"0.63055617",
"0.626... | 0.7864236 | 0 |
Downloads a YouTube video by its unique id. | def youtube_download_by_id(id, title=None, output_dir='.', merge=True, info_only=False):
raw_video_info = get_content('http://www.youtube.com/get_video_info?video_id=%s' % id)
video_info = parse.parse_qs(raw_video_info)
if video_info['status'] == ['ok'] and ('use_cipher_signature' not in video_info or video_info['use_cipher_signature'] == ['False']):
title = parse.unquote_plus(video_info['title'][0])
stream_list = parse.parse_qs(raw_video_info)['url_encoded_fmt_stream_map'][0].split(',')
else:
# Parse video page when video_info is not usable.
video_page = get_content('http://www.youtube.com/watch?v=%s' % id)
ytplayer_config = json.loads(match1(video_page, r'ytplayer.config\s*=\s*([^\n]+);'))
title = ytplayer_config['args']['title']
stream_list = ytplayer_config['args']['url_encoded_fmt_stream_map'].split(',')
streams = {
parse.parse_qs(stream)['itag'][0] : parse.parse_qs(stream)
for stream in stream_list
}
for codec in yt_codecs:
itag = str(codec['itag'])
if itag in streams:
download_stream = streams[itag]
break
url = download_stream['url'][0]
if 'sig' in download_stream:
sig = download_stream['sig'][0]
else:
sig = decrypt_signature(download_stream['s'][0])
url = '%s&signature=%s' % (url, sig)
type, ext, size = url_info(url)
print_info(site_info, title, type, size)
if not info_only:
download_urls([url], title, ext, size, output_dir, merge = merge) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def download(idd, path):\n print(f'[{script}]: Downloading YT video \"{idd}\"...') if verbosity >= 1 else None\n\n try:\n yt = pytube.YouTube(\"https://www.youtube.com/watch?v=\" + idd)\n stream = yt.streams.filter(progressive=True).first()\n stream.download(path, filename=idd)\n exce... | [
"0.7745084",
"0.7303579",
"0.7203833",
"0.71133363",
"0.70373094",
"0.7022766",
"0.69767386",
"0.6973098",
"0.69691336",
"0.69578743",
"0.69145817",
"0.6872059",
"0.68037355",
"0.6796082",
"0.6795651",
"0.67516667",
"0.6571322",
"0.6560047",
"0.65302217",
"0.65141547",
"0.651... | 0.7562303 | 1 |
Downloads YouTube videos by URL. | def youtube_download(url, output_dir='.', merge=True, info_only=False):
id = match1(url, r'youtu.be/([^/]+)') or parse_query_param(url, 'v')
assert id
youtube_download_by_id(id, title=None, output_dir=output_dir, merge=merge, info_only=info_only) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def download_video(self, url):\n yt = YouTube(url)\n yt_filtered = yt.streams.filter(progressive=True, file_extension=\"mp4\")\n yt_resolutions = yt_filtered.order_by(\"resolution\")\n\n # Downloads the first video that fits the description\n video = yt_resolutions.desc().first()... | [
"0.7559332",
"0.7511336",
"0.7269561",
"0.7109881",
"0.69188035",
"0.6849369",
"0.6837979",
"0.67307305",
"0.67147034",
"0.6699649",
"0.6661852",
"0.6603577",
"0.6570227",
"0.6545135",
"0.65282965",
"0.6528034",
"0.6490521",
"0.64205855",
"0.63792336",
"0.63700604",
"0.634333... | 0.7409529 | 2 |
Check that user_data is a dict and that key is in there | def has_user_data(self, key):
return isinstance(self._user_data, dict) and key in self._user_data | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def check_for_dict(check):",
"def is_valid(data):\n return isinstance(data, dict) \\\n and \"u_id\" in data \\\n and \"token\" in data \\\n and isinstance(data[\"u_id\"], int) \\\n and isinstance(data[\"token\"], str)",
"def can_insert(data):\n return isinstanc... | [
"0.719985",
"0.7077056",
"0.6867152",
"0.6618034",
"0.6470574",
"0.63971496",
"0.63777405",
"0.63742024",
"0.63429755",
"0.63425326",
"0.62384546",
"0.6238243",
"0.61970216",
"0.6187313",
"0.6175904",
"0.61512995",
"0.6139445",
"0.6129756",
"0.610137",
"0.6098412",
"0.6043313... | 0.75419945 | 0 |
Return key from user_data if it's a dict | def get_user_data(self, key, default=None):
if not isinstance(self._user_data, dict):
return default
return self._user_data.get(key) | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"def __getitem__(self, key):\n return self._user_data.get(key)",
"def _get_user_data(self):\n return {\"key\": self._key}",
"def get(self, key):\n return self._user_data.get(key)",
"def _get_key(self, object_type, user_key = None):\n\t\tif not user_key and not self.object_type_keys.has_ke... | [
"0.6847286",
"0.65308297",
"0.6454429",
"0.63964266",
"0.6262093",
"0.618459",
"0.61062187",
"0.60399806",
"0.59043604",
"0.5890058",
"0.5878438",
"0.5858267",
"0.5846593",
"0.58453906",
"0.5799683",
"0.57730305",
"0.57642144",
"0.57528245",
"0.5742863",
"0.5742863",
"0.57288... | 0.6621438 | 1 |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.