text
stringlengths
0
1.05M
meta
dict
__author__ = 'Bohdan Mushkevych' import time from collections import OrderedDict from datetime import datetime from flow.flow_constants import STEP_NAME_START, STEP_NAME_FINISH from flow.core.execution_context import ContextDriven, get_flow_logger, valid_context from flow.core.step_executor import StepExecutor from flow.core.flow_graph_node import FlowGraphNode from flow.db.dao.flow_dao import FlowDao from flow.db.dao.step_dao import StepDao from flow.db.model.step import Step from synergy.system.log_recording_handler import LogRecordingHandler from flow.db.model.flow import Flow, STATE_EMBRYO, STATE_INVALID, STATE_PROCESSED, STATE_IN_PROGRESS class GraphError(Exception): pass class FlowGraph(ContextDriven): """ Graph of interconnected Nodes, each representing an execution step """ def __init__(self, flow_name): super(FlowGraph, self).__init__() self.flow_name = flow_name # format: {step_name:String -> node:FlowGraphNode} self._dict = OrderedDict() self.flow_dao = None self.log_recording_handler = None # list of step names, yielded for processing self.yielded = list() def __getitem__(self, key): return self._dict[key] def __len__(self): return len(self._dict) def __iter__(self): return self def __next__(self): return self.next() def next(self): """ heart of the Flow: traverses the graph and returns next available FlowGraphNode.name for processing in case all nodes are blocked - blocks by sleeping in case all nodes have been yielded for processing - throws StopIteration exception in case any node has failed - throw StopIteration exception """ def _next_iteration(): if len(self.yielded) == len(self): # all of the nodes have been yielded for processing raise StopIteration() for name in self._dict: if self.is_step_failed(name): # one of the steps has failed # thus, marking all flow as failed raise StopIteration() if not self.is_step_unblocked(name) or name in self.yielded: continue self.yielded.append(name) return name return None next_step_name = _next_iteration() while next_step_name is None: # at this point, there are Steps that are blocked, and we must wait for them to become available time.sleep(5) # 5 seconds next_step_name = self.next() return next_step_name def __eq__(self, other): return self._dict == other._dict def __contains__(self, item): return item in self._dict def enlist(self, step_exec, dependent_on_names): assert isinstance(step_exec, StepExecutor) return self.append(step_exec.step_name, dependent_on_names, step_exec.main_actionset.actions, step_exec.pre_actionset.actions, step_exec.post_actionset.actions, step_exec.skip) def append(self, name, dependent_on_names, main_action, pre_actions=None, post_actions=None, skip=False): """ method appends a new Node to the Graph, validates the input for non-existent references :return self to allow chained *append* """ assert isinstance(dependent_on_names, list), \ 'dependent_on_names must be either a list of string or an empty list' assert name not in [STEP_NAME_START, STEP_NAME_FINISH], \ 'step names [{0}, {1}] are reserved.'.format(STEP_NAME_START, STEP_NAME_FINISH) def _find_non_existent(names): non_existent = list() for name in names: if name in self: continue non_existent.append(name) return non_existent if _find_non_existent(dependent_on_names): raise GraphError('Step {0} from Flow {1} is dependent on a non-existent Step {2}' .format(name, self.flow_name, dependent_on_names)) node = FlowGraphNode(name, StepExecutor(step_name=name, main_action=main_action, pre_actions=pre_actions, post_actions=post_actions, skip=skip)) # link newly inserted node with the dependent_on nodes for dependent_on_name in dependent_on_names: self[dependent_on_name]._next.append(node) node._prev.append(self[dependent_on_name]) self._dict[name] = node # return *self* to allow chained *append* return self def all_dependant_steps(self, step_name): """ :param step_name: name of the step to inspect :return: list of all step names, that are dependent on current step """ dependent_on = list() for child_node in self[step_name]._next: dependent_on.append(child_node.step_name) dependent_on.extend(self.all_dependant_steps(child_node.step_name)) return dependent_on def is_step_unblocked(self, step_name): """ :param step_name: name of the step to inspect :return: True if the step has no pending dependencies and is ready for processing; False otherwise """ is_unblocked = True for prev_node in self[step_name]._prev: if prev_node.step_executor and not prev_node.step_executor.is_complete: is_unblocked = False return is_unblocked def is_step_failed(self, step_name): """ :param step_name: name of the step to inspect :return: True if the step has failed (either in STATE_INVALID or STATE_CANCELED); False otherwise """ node = self[step_name] return node.step_entry and node.step_entry.is_failed def set_context(self, context, **kwargs): super(FlowGraph, self).set_context(context, **kwargs) self.flow_dao = FlowDao(self.logger) try: # fetch existing Flow from the DB db_key = [self.flow_name, self.context.timeperiod] flow_entry = self.flow_dao.get_one(db_key) except LookupError: # no flow record for given key was present in the database flow_entry = Flow() flow_entry.flow_name = self.flow_name flow_entry.timeperiod = self.context.timeperiod flow_entry.created_at = datetime.utcnow() flow_entry.state = STATE_EMBRYO self.flow_dao.update(flow_entry) self.context.flow_entry = flow_entry def get_logger(self): return get_flow_logger(self.flow_name, self.settings) @valid_context def clear_steps(self): """ method purges all steps related to given flow from the DB """ assert self.context.flow_entry is not None step_dao = StepDao(self.logger) step_dao.remove_by_flow_id(self.context.flow_entry.db_id) @valid_context def load_steps(self): """ method: 1. loads all steps 2. filters out successful and updates GraphNodes and self.yielded list accordingly 3. removes failed steps from the DB """ assert self.context.flow_entry is not None step_dao = StepDao(self.logger) steps = step_dao.get_all_by_flow_id(self.context.flow_entry.db_id) for s in steps: assert isinstance(s, Step) if s.is_processed: self[s.step_name].step_entry = s self.yielded.append(s.step_name) else: step_dao.remove(s.key) @valid_context def mark_start(self): """ performs flow start-up, such as db and context updates """ self.context.flow_entry.started_at = datetime.utcnow() self.context.flow_entry.state = STATE_IN_PROGRESS self.flow_dao.update(self.context.flow_entry) # enable log recording into DB self.log_recording_handler = LogRecordingHandler(self.get_logger(), self.context.flow_entry.db_id) self.log_recording_handler.attach() @valid_context def _mark_finish(self, state): self.context.flow_entry.finished_at = datetime.utcnow() self.context.flow_entry.state = state self.flow_dao.update(self.context.flow_entry) if self.log_recording_handler: self.log_recording_handler.detach() def mark_failure(self): """ perform flow post-failure activities, such as db update """ self._mark_finish(STATE_INVALID) def mark_success(self): """ perform activities in case of the flow successful completion """ self._mark_finish(STATE_PROCESSED)
{ "repo_name": "mushkevych/synergy_flow", "path": "flow/core/flow_graph.py", "copies": "1", "size": "8952", "license": "bsd-3-clause", "hash": 7261558684651905000, "line_mean": 37.0936170213, "line_max": 111, "alpha_frac": 0.6079088472, "autogenerated": false, "ratio": 4.083941605839416, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.5191850453039416, "avg_score": null, "num_lines": null }
__author__ = 'Bohdan Mushkevych' import time from flow.core.abstract_action import AbstractAction class SleepAction(AbstractAction): def __init__(self, seconds): super(SleepAction, self).__init__('Sleep Action') self.seconds = seconds def run(self, execution_cluster): time.sleep(self.seconds) class ShellCommandAction(AbstractAction): def __init__(self, shell_command): super(ShellCommandAction, self).__init__('Shell Command Action') self.shell_command = shell_command def run(self, execution_cluster): execution_cluster.run_shell_command(self.shell_command) class IdentityAction(AbstractAction): """ this class is intended to be used by Unit Tests """ def __init__(self): super(IdentityAction, self).__init__('Identity Action') def run(self, execution_cluster): self.logger.info('identity action: *do* completed') class FailureAction(AbstractAction): """ this class is intended to be used by Unit Tests """ def __init__(self): super(FailureAction, self).__init__('Failure Action') def run(self, execution_cluster): raise UserWarning('failure action: raising exception') class PigAction(AbstractAction): """ executes a pig script on the given cluster """ def __init__(self, uri_script, **kwargs): super(PigAction, self).__init__('Pig Action', kwargs) self.uri_script = uri_script def run(self, execution_cluster): is_successful = execution_cluster.run_pig_step( uri_script=self.uri_script, start_timeperiod=self.start_timeperiod, end_timeperiod=self.end_timeperiod, timeperiod=self.timeperiod, **self.kwargs) if not is_successful: raise UserWarning('Pig Action failed on {0}'.format(self.uri_script)) class SparkAction(AbstractAction): """ executes a spark script on the given cluster """ def __init__(self, uri_script, language, **kwargs): super(SparkAction, self).__init__('Spark Action', kwargs) self.uri_script = uri_script self.language = language def run(self, execution_cluster): is_successful = execution_cluster.run_spark_step( uri_script=self.uri_script, language=self.language, **self.kwargs) if not is_successful: raise UserWarning('Spark Action failed on {0}'.format(self.uri_script))
{ "repo_name": "mushkevych/synergy_flow", "path": "flow/core/simple_actions.py", "copies": "1", "size": "2455", "license": "bsd-3-clause", "hash": 1915457286382317300, "line_mean": 32.6301369863, "line_max": 83, "alpha_frac": 0.6476578411, "autogenerated": false, "ratio": 4.078073089700997, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 1, "avg_score": 0.0003301353952874167, "num_lines": 73 }
__author__ = 'Bohdan Mushkevych' import time import datetime import unittest from db.model.raw_data import RawData class TestRawData(unittest.TestCase): def setUp(self): self.obj = RawData() def tearDown(self): del self.obj def test_key(self): domain_name = 'test_name' timestamp = time.time() session_id = 'session_xxx_yyy' self.obj.key = (domain_name, timestamp, session_id) assert self.obj.key[0] == domain_name assert self.obj.key[1] == datetime.datetime.fromtimestamp(timestamp) assert self.obj.key[2] == session_id def test_session_id(self): value = 'value_1234567890' self.obj.session_id = value assert self.obj.session_id == value def test_os(self): value = 'Windows MS PS 7.0.0.0.1.1.2' self.obj.os = value assert self.obj.os == value def test_browser(self): br_type = 'FireFox' version = '3.4.5.6.7.8.9' self.obj.browser = br_type + version assert self.obj.browser == br_type + version def test_ip(self): value = '100.100.200.200' self.obj.ip = value assert self.obj.ip == value def test_screen_res(self): value_x = 1080 value_y = 980 self.obj.screen_res = (value_x, value_y) assert self.obj.screen_x == value_x assert self.obj.screen_y == value_y def test_language(self): value = 'ca-uk' self.obj.language = value assert self.obj.language == value def test_country(self): value = 'ca' self.obj.country = value assert self.obj.country == value if __name__ == '__main__': unittest.main()
{ "repo_name": "eggsandbeer/scheduler", "path": "tests/test_raw_data.py", "copies": "1", "size": "1719", "license": "bsd-3-clause", "hash": -7735843768557255000, "line_mean": 25.4461538462, "line_max": 76, "alpha_frac": 0.5828970332, "autogenerated": false, "ratio": 3.403960396039604, "config_test": true, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.44868574292396035, "avg_score": null, "num_lines": null }
__author__ = 'Bohdan Mushkevych' import time import googleapiclient.discovery from flow.core.abstract_cluster import AbstractCluster, ClusterError from flow.core.gcp_filesystem import GcpFilesystem from flow.core.gcp_credentials import gcp_credentials # `https://cloud.google.com/dataproc/docs/reference/rest/v1/projects.regions.clusters#ClusterStatus`_ CLUSTER_STATE_UNKNOWN = 'UNKNOWN' CLUSTER_STATE_CREATING = 'CREATING' CLUSTER_STATE_RUNNING = 'RUNNING' CLUSTER_STATE_ERROR = 'ERROR' CLUSTER_STATE_DELETING = 'DELETING' CLUSTER_STATE_UPDATING = 'UPDATING' OPERATION_STATE_PENDING = 'PENDING' OPERATION_STATE_SETUP_DONE = 'SETUP_DONE' # `https://cloud.google.com/dataproc/docs/concepts/jobs/life-of-a-job`_ JOB_STATE_PENDING = 'PENDING' JOB_STATE_RUNNING = 'RUNNING' JOB_STATE_QUEUED = 'QUEUED' JOB_STATE_DONE = 'DONE' JOB_STATE_ERROR = 'ERROR' class GcpCluster(AbstractCluster): """ implementation of the Google Cloud Platform Dataproc API """ def __init__(self, name, context, **kwargs): super(GcpCluster, self).__init__(name, context, kwargs=kwargs) self._filesystem = GcpFilesystem(self.logger, context, **kwargs) service_account_file_uri = self.context.settings.get('gcp_service_account_file') credentials = gcp_credentials(service_account_file_uri) self.dataproc = googleapiclient.discovery.build('dataproc', 'v1', credentials=credentials) self.cluster_details = None self.project_id = context.settings['gcp_project_id'] self.cluster_name = context.settings['gcp_cluster_name'] self.cluster_region = context.settings['gcp_cluster_region'] self.cluster_zone = context.settings['gcp_cluster_zone'] @property def filesystem(self): return self._filesystem def _run_step(self, job_details): if not self.cluster_details: raise ClusterError('EMR Cluster {0} is not launched'.format(self.cluster_name)) result = self.dataproc.projects().regions().jobs().submit( projectId=self.project_id, region=self.cluster_region, body=job_details).execute() job_id = result['reference']['jobId'] self.logger.info('Submitted job ID {0}. Waiting for completion'.format(job_id)) return self._poll_step(job_id) def _poll_step(self, job_id): details = 'NA' state = JOB_STATE_PENDING while state in [OPERATION_STATE_SETUP_DONE, JOB_STATE_PENDING, JOB_STATE_RUNNING, JOB_STATE_QUEUED]: result = self.dataproc.projects().regions().jobs().get( projectId=self.project_id, region=self.cluster_region, jobId=job_id).execute() state = result['status']['state'] if 'details' in result['status']: details = result['status']['details'] if state == JOB_STATE_ERROR: raise ClusterError('Gcp Job {0} failed: {1}'.format(job_id, details)) elif state == JOB_STATE_DONE: self.logger.info('Gcp Job {0} has completed.') else: self.logger.warning('Unknown state {0} during Gcp Job {1} execution'.format(state, job_id)) return state def run_pig_step(self, uri_script, libs=None, **kwargs): # `https://cloud.google.com/dataproc/docs/reference/rest/v1beta2/PigJob`_ job_details = { 'projectId': self.project_id, 'job': { 'placement': { 'clusterName': self.cluster_name }, 'pigJob': { 'queryFileUri': 'gs://{}/{}'.format(self.context.settings['gcp_code_bucket'], uri_script) } } } if kwargs: job_details['job']['pigJob']['scriptVariables'] = '{}'.format(kwargs) if libs: gs_libs = ['gs://{}/{}'.format(self.context.settings['gcp_code_bucket'], x) for x in libs] job_details['job']['pigJob']['jarFileUris'] = '{}'.format(gs_libs) return self._run_step(job_details) def run_spark_step(self, uri_script, language, libs=None, **kwargs): # `https://cloud.google.com/dataproc/docs/reference/rest/v1beta2/PySparkJob`_ job_details = { 'projectId': self.project_id, 'job': { 'placement': { 'clusterName': self.cluster_name }, 'pysparkJob': { 'mainPythonFileUri': 'gs://{}/{}'.format(self.context.settings['gcp_code_bucket'], uri_script) } } } if libs: gs_libs = ['gs://{}/{}'.format(self.context.settings['gcp_code_bucket'], x) for x in libs] job_details['job']['pysparkJob']['pythonFileUris'] = '{}'.format(gs_libs) return self._run_step(job_details) def run_hadoop_step(self, uri_script, **kwargs): # `https://cloud.google.com/dataproc/docs/reference/rest/v1beta2/HadoopJob`_ raise NotImplementedError('Implement run_hadoop_step for the Gcp cluster') def run_shell_command(self, uri_script, **kwargs): raise NotImplementedError('TODO: implement shell command') def _launch(self): zone_uri = \ 'https://www.googleapis.com/compute/v1/projects/{}/zones/{}'.format(self.project_id, self.cluster_zone) cluster_data = { 'projectId': self.project_id, 'clusterName': self.cluster_name, 'config': { 'gceClusterConfig': { 'zoneUri': zone_uri }, 'masterConfig': { 'numInstances': 1, 'machineTypeUri': 'n1-standard-1' }, 'workerConfig': { 'numInstances': 2, 'machineTypeUri': 'n1-standard-1' } } } result = self.dataproc.projects().regions().clusters().create( projectId=self.project_id, region=self.cluster_region, body=cluster_data).execute() if result['metadata']['status']['state'] in [CLUSTER_STATE_CREATING, CLUSTER_STATE_RUNNING, CLUSTER_STATE_UPDATING, OPERATION_STATE_PENDING]: self.logger.info('Launch request successful') else: self.logger.warning('Cluster {0} entered unknown state {1}'. format(self.cluster_name, result['metadata']['status']['state'])) def _get_cluster(self): try: result = self.dataproc.projects().regions().clusters().get( projectId=self.project_id, region=self.cluster_region, clusterName=self.cluster_name).execute() return result except: return None def _wait_for_cluster(self): cluster = self._get_cluster() while cluster: if cluster['status']['state'] == CLUSTER_STATE_ERROR: raise ClusterError('Cluster {0} creation error: {1}'. format(self.cluster_name, cluster['status']['details'])) if cluster['status']['state'] == CLUSTER_STATE_RUNNING: self.logger.info('Cluster {0} is running'.format(self.cluster_name)) break else: time.sleep(5) cluster = self._get_cluster() return cluster def launch(self): self.logger.info('Launching Gcp Cluster: {0} {{'.format(self.cluster_name)) if not self._get_cluster(): self._launch() self.cluster_details = self._wait_for_cluster() self.logger.info('}') def terminate(self): self.logger.info('Terminating Gcp Cluster {') result = self.dataproc.projects().regions().clusters().delete( projectId=self.project_id, region=self.cluster_region, clusterName=self.cluster_name).execute() if result['metadata']['status']['state'] in [CLUSTER_STATE_DELETING, CLUSTER_STATE_UNKNOWN, OPERATION_STATE_PENDING]: self.cluster_details = None self.logger.info('Termination request successful') else: self.logger.warning('Cluster {0} entered unknown state {1}'. format(self.cluster_name, result['metadata']['status']['state'])) self.logger.info('}')
{ "repo_name": "mushkevych/synergy_flow", "path": "flow/core/gcp_cluster.py", "copies": "1", "size": "8523", "license": "bsd-3-clause", "hash": -7292146590968090000, "line_mean": 39.3933649289, "line_max": 115, "alpha_frac": 0.5750322656, "autogenerated": false, "ratio": 4.029787234042553, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.5104819499642553, "avg_score": null, "num_lines": null }
__author__ = 'Bohdan Mushkevych' import time import os import psutil from synergy.system.repeat_timer import RepeatTimer from synergy.conf import settings class FootprintCalculator(object): def __init__(self): self.pid = os.getpid() def group(self, number): """ method formats number and inserts thousands separators """ s = str(number) groups = [] while s and s[-1].isdigit(): groups.append(s[-3:]) s = s[:-3] return s + '\''.join(reversed(groups)) @property def document(self): ps = psutil.Process(self.pid) return {'memory_rss': self.group(ps.get_memory_info()[0]), 'memory_vms': self.group(ps.get_memory_info()[1]), 'cpu_utilization': '%02d' % ps.get_cpu_percent(), 'mem_virtual_free': self.group(psutil.virtual_memory().free), 'mem_swap_free': self.group(psutil.swap_memory().free)} def get_snapshot(self): resp = 'Footprint: RSS={memory_rss} VMS={memory_vms} CPU={cpu_utilization}; ' \ 'Available: PHYS={mem_virtual_free} VIRT={mem_swap_free}'.format(**self.document) return resp class Tracker(object): def __init__(self, name): self.name = name self.per_24h = 0 self.per_tick = 0 def increment(self, delta=1): self.per_24h += delta self.per_tick += delta def reset_tick(self): self.per_tick = 0 def reset_24h(self): self.per_24h = 0 class TrackerPair(object): def __init__(self, name, success='Success', failure='Failure'): self.name = name self.success = Tracker(success) self.failure = Tracker(failure) def increment_success(self, delta=1): self.success.increment(delta) def increment_failure(self, delta=1): self.failure.increment(delta) def reset_tick(self): self.success.reset_tick() self.failure.reset_tick() def reset_24h(self): self.success.reset_24h() self.failure.reset_24h() def to_string(self, tick_interval_seconds, show_header=True): header = self.name + ' : ' + self.success.name + '/' + self.failure.name + '.' if show_header else '' return header + 'In last {0:d} seconds: {1:d}/{2:d}. In last 24 hours: {3:d}/{4:d}'.format( tick_interval_seconds, self.success.per_tick, self.failure.per_tick, self.success.per_24h, self.failure.per_24h) class TickerThread(object): SECONDS_IN_24_HOURS = 86400 TICKS_BETWEEN_FOOTPRINTS = 10 def __init__(self, logger): self.logger = logger self.trackers = dict() self.interval = settings.settings['perf_ticker_interval'] self.mark_24_hours = time.time() self.mark_footprint = time.time() self.footprint = FootprintCalculator() self.timer = RepeatTimer(self.interval, self._run_tick_thread) def add_tracker(self, tracker): self.trackers[tracker.name] = tracker def get_tracker(self, name): return self.trackers[name] def start(self): self.timer.start() def cancel(self): self.timer.cancel() def is_alive(self): return self.timer.is_alive() def _print_footprint(self): if time.time() - self.mark_footprint > self.TICKS_BETWEEN_FOOTPRINTS * self.interval: self.logger.info(self.footprint.get_snapshot()) self.mark_footprint = time.time() def _run_tick_thread(self): self._print_footprint() current_time = time.time() do_24h_reset = current_time - self.mark_24_hours > self.SECONDS_IN_24_HOURS if do_24h_reset: self.mark_24_hours = current_time tracker_outputs = [] for tracker_name, tracker in self.trackers.items(): tracker_outputs.append(tracker.to_string(self.interval)) tracker.reset_tick() if do_24h_reset: tracker.reset_24h() self.logger.info('\n'.join(tracker_outputs)) class SimpleTracker(TickerThread): TRACKER_PERFORMANCE = 'Performance' def __init__(self, logger): super(SimpleTracker, self).__init__(logger) self.add_tracker(TrackerPair(self.TRACKER_PERFORMANCE)) @property def tracker(self): return self.get_tracker(self.TRACKER_PERFORMANCE) class SessionPerformanceTracker(TickerThread): TRACKER_INSERT = 'Insert' TRACKER_UPDATE = 'Update' def __init__(self, logger): super(SessionPerformanceTracker, self).__init__(logger) self.add_tracker(TrackerPair(self.TRACKER_INSERT)) self.add_tracker(TrackerPair(self.TRACKER_UPDATE)) @property def insert(self): return self.get_tracker(self.TRACKER_INSERT) @property def update(self): return self.get_tracker(self.TRACKER_UPDATE) class UowAwareTracker(SimpleTracker): STATE_IDLE = 'state_idle' STATE_PROCESSING = 'state_processing' def __init__(self, logger): super(UowAwareTracker, self).__init__(logger) self.state = self.STATE_IDLE self.per_job = 0 self.uow = None self.state_triggered_at = time.time() def _run_tick_thread(self): super(UowAwareTracker, self)._run_tick_thread() if self.state == self.STATE_PROCESSING: msg = 'State: {0} for {1} sec; {2} in this uow;'.\ format(self.state, time.time() - self.state_triggered_at, self.per_job) else: msg = 'State: {0} for {1} sec;'.format(self.state, time.time() - self.state_triggered_at) self.logger.info(msg) def increment(self): self.tracker.increment_success() self.per_job += 1 def start_uow(self, uow): self.state = self.STATE_PROCESSING self.uow = uow self.state_triggered_at = time.time() def finish_uow(self): self.logger.info('Success: unit_of_work {0} in timeperiod {1}; processed {2} entries in {3} seconds'. format(self.uow.db_id, self.uow.timeperiod, self.per_job, time.time() - self.state_triggered_at)) self.cancel_uow() def cancel_uow(self): self.state = self.STATE_IDLE self.uow = None self.state_triggered_at = time.time() self.per_job = 0
{ "repo_name": "eggsandbeer/scheduler", "path": "synergy/system/performance_tracker.py", "copies": "1", "size": "6404", "license": "bsd-3-clause", "hash": -1617929295930537700, "line_mean": 29.7884615385, "line_max": 109, "alpha_frac": 0.5993129294, "autogenerated": false, "ratio": 3.526431718061674, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.4625744647461674, "avg_score": null, "num_lines": null }
__author__ = 'Bohdan Mushkevych' import time import os import psutil from system.repeat_timer import RepeatTimer from settings import settings class FootprintCalculator(object): def __init__(self): self.pid = os.getpid() @property def document(self): ps = psutil.Process(self.pid) # '{:,}'.format(number) returns a string with coma as a thousand-separator return {'memory_rss': '{:,}'.format(ps.memory_info()[0]), 'memory_vms': '{:,}'.format(ps.memory_info()[1]), 'cpu_utilization': '{0:02.0f}'.format(ps.cpu_percent()), 'mem_virtual_free': '{:,}'.format(psutil.virtual_memory().free), 'mem_swap_free': '{:,}'.format(psutil.swap_memory().free)} def get_snapshot(self): resp = 'Footprint: RSS={memory_rss} VMS={memory_vms} CPU={cpu_utilization}; ' \ 'Available: PHYS={mem_virtual_free} VIRT={mem_swap_free}'.format(**self.document) return resp class Tracker(object): def __init__(self, name): self.name = name self.per_24h = 0 self.per_tick = 0 def increment(self, delta=1): self.per_24h += delta self.per_tick += delta def reset_tick(self): self.per_tick = 0 def reset_24h(self): self.per_24h = 0 class TrackerPair(object): def __init__(self, name, success='Success', failure='Failure'): self.name = name self.success = Tracker(success) self.failure = Tracker(failure) def increment_success(self, delta=1): self.success.increment(delta) def increment_failure(self, delta=1): self.failure.increment(delta) def reset_tick(self): self.success.reset_tick() self.failure.reset_tick() def reset_24h(self): self.success.reset_24h() self.failure.reset_24h() def to_string(self, tick_interval_seconds, show_header=True): header = self.name + ' : ' + self.success.name + '/' + self.failure.name + '.' if show_header else '' return header + 'In last {0:d} seconds: {1:d}/{2:d}. In last 24 hours: {3:d}/{4:d}'.format( tick_interval_seconds, self.success.per_tick, self.failure.per_tick, self.success.per_24h, self.failure.per_24h) class TickerThread(object): SECONDS_IN_24_HOURS = 86400 TICKS_BETWEEN_FOOTPRINTS = 10 def __init__(self, logger): self.logger = logger self.trackers = dict() self.interval = settings['perf_ticker_interval'] self.mark_24_hours = time.time() self.mark_footprint = time.time() self.footprint = FootprintCalculator() self.timer = RepeatTimer(self.interval, self._run_tick_thread, daemonic=True) def add_tracker(self, tracker): self.trackers[tracker.name] = tracker def get_tracker(self, name): return self.trackers[name] def start(self): self.timer.start() def cancel(self): self.timer.cancel() def is_alive(self): return self.timer.is_alive() def _print_footprint(self): if time.time() - self.mark_footprint > self.TICKS_BETWEEN_FOOTPRINTS * self.interval: self.logger.info(self.footprint.get_snapshot()) self.mark_footprint = time.time() def _run_tick_thread(self): self._print_footprint() current_time = time.time() do_24h_reset = current_time - self.mark_24_hours > self.SECONDS_IN_24_HOURS if do_24h_reset: self.mark_24_hours = current_time tracker_outputs = [] for tracker_name, tracker in self.trackers.items(): tracker_outputs.append(tracker.to_string(self.interval)) tracker.reset_tick() if do_24h_reset: tracker.reset_24h() self.logger.info('\n'.join(tracker_outputs)) class SimpleTracker(TickerThread): TRACKER_PERFORMANCE = 'Performance' def __init__(self, logger): super(SimpleTracker, self).__init__(logger) self.add_tracker(TrackerPair(self.TRACKER_PERFORMANCE)) @property def tracker(self): return self.get_tracker(self.TRACKER_PERFORMANCE)
{ "repo_name": "mushkevych/launch.py", "path": "system/performance_tracker.py", "copies": "1", "size": "4223", "license": "bsd-3-clause", "hash": -8386667933597576000, "line_mean": 29.381294964, "line_max": 109, "alpha_frac": 0.6017049491, "autogenerated": false, "ratio": 3.5133111480865225, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.9611443123720971, "avg_score": 0.0007145946931103414, "num_lines": 139 }
__author__ = 'Bohdan Mushkevych' import time import unittest from datetime import datetime from system import repeat_timer class TestRepeatTimer(unittest.TestCase): INTERVAL = 3 def make_method_yes(self, initial_multiplication=1): # the only way to implement nonlocal closure variables in Python 2.X cycle = {'index': initial_multiplication} def method_yes(start_datetime, seconds): delta = datetime.utcnow() - start_datetime assert delta.seconds == cycle['index'] * seconds cycle['index'] += 1 return method_yes def method_no(self, start_datetime, seconds): raise AssertionError('Assertion failed as NO was executed with parameters {0} {1}'. format(str(start_datetime), seconds)) def method_checkpoint(self, start_datetime, seconds): print('Entering method checkpoint with parameters {0} {1}'.format(str(start_datetime), seconds)) delta = datetime.utcnow() - start_datetime if delta.seconds != seconds: raise AssertionError('Assertion failed by {0} {1}'.format(str(delta), seconds)) def test_normal_workflow(self): self.obj = repeat_timer.RepeatTimer(TestRepeatTimer.INTERVAL, self.method_checkpoint, args=[datetime.utcnow(), TestRepeatTimer.INTERVAL]) self.obj.start() time.sleep(TestRepeatTimer.INTERVAL) self.obj.cancel() assert True def test_cancellation(self): self.obj = repeat_timer.RepeatTimer(TestRepeatTimer.INTERVAL, self.method_no, args=[datetime.utcnow(), 0]) self.obj.start() self.obj.cancel() time.sleep(TestRepeatTimer.INTERVAL) assert True def test_trigger(self): self.obj = repeat_timer.RepeatTimer(TestRepeatTimer.INTERVAL, self.make_method_yes(), args=[datetime.utcnow(), 0]) self.obj.start() self.obj.trigger() self.obj.cancel() time.sleep(TestRepeatTimer.INTERVAL) assert True def test_trigger_with_continuation(self): self.obj = repeat_timer.RepeatTimer(TestRepeatTimer.INTERVAL - 1, self.make_method_yes(initial_multiplication=0), args=[datetime.utcnow(), TestRepeatTimer.INTERVAL - 1]) self.obj.start() self.obj.trigger() time.sleep(TestRepeatTimer.INTERVAL) self.obj.cancel() assert True if __name__ == '__main__': unittest.main()
{ "repo_name": "mushkevych/launch.py", "path": "tests/test_repeat_timer.py", "copies": "1", "size": "2777", "license": "bsd-3-clause", "hash": 7291716159054760000, "line_mean": 37.0410958904, "line_max": 104, "alpha_frac": 0.5729204177, "autogenerated": false, "ratio": 4.60530679933665, "config_test": true, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.567822721703665, "avg_score": null, "num_lines": null }
__author__ = 'Bohdan Mushkevych' import time from psutil import TimeoutExpired from synergy.db.model import unit_of_work from synergy.workers.abstract_uow_aware_worker import AbstractUowAwareWorker RETURN_CODE_CANCEL_UOW = 987654321 class AbstractCliWorker(AbstractUowAwareWorker): """ Module contains common logic for Command Line Callers. It executes shell command and updates unit_of_work base on command's return code """ def __init__(self, process_name): super(AbstractCliWorker, self).__init__(process_name) self.cli_process = None def __del__(self): super(AbstractCliWorker, self).__del__() def _start_process(self, start_timeperiod, end_timeperiod, arguments): raise NotImplementedError('method _start_process must be implemented by %s' % self.__class__.__name__) def _poll_process(self): """ between death of a process and its actual termination lies poorly documented requirement - <purging process' io pipes and reading exit status>. this can be done either by os.wait() or process.wait() :return tuple (boolean: alive, int: return_code) """ try: self.logger.warn(self.cli_process.stderr.read()) self.logger.info(self.cli_process.stdout.read()) return_code = self.cli_process.wait(timeout=0.01) if return_code is None: # process is already terminated self.logger.info('Process %s is terminated' % self.process_name) else: # process is terminated; possibly by OS self.logger.info('Process %s got terminated. Cleaning up' % self.process_name) self.cli_process = None return False, return_code except TimeoutExpired: # process is alive and OK return True, None except Exception: self.logger.error('Exception on polling: %s' % self.process_name, exc_info=True) return False, 999 def _process_uow(self, uow): self._start_process(uow.start_timeperiod, uow.end_timeperiod, uow.arguments) code = None alive = True while alive: alive, code = self._poll_process() time.sleep(0.1) self.logger.info('Command Line Command return code is %r' % code) if code == 0: return 0, unit_of_work.STATE_PROCESSED elif code == RETURN_CODE_CANCEL_UOW: return 0, unit_of_work.STATE_CANCELED else: raise UserWarning('Command Line Command return code is not 0 but %r' % code)
{ "repo_name": "eggsandbeer/scheduler", "path": "workers/abstract_cli_worker.py", "copies": "1", "size": "2617", "license": "bsd-3-clause", "hash": 2670435129854330000, "line_mean": 39.890625, "line_max": 110, "alpha_frac": 0.6289644631, "autogenerated": false, "ratio": 4.057364341085271, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.5186328804185271, "avg_score": null, "num_lines": null }
__author__ = 'Bohdan Mushkevych' import time import boto3 from flow.core.abstract_cluster import AbstractCluster, ClusterError from flow.core.s3_filesystem import S3Filesystem # `http://boto3.readthedocs.io/en/latest/reference/services/emr.html#EMR.Client.describe_cluster`_ CLUSTER_STATE_TERMINATED_WITH_ERRORS = 'TERMINATED_WITH_ERRORS' CLUSTER_STATE_TERMINATED = 'TERMINATED' CLUSTER_STATE_TERMINATING = 'TERMINATING' CLUSTER_STATE_WAITING = 'WAITING' CLUSTER_STATE_RUNNING = 'RUNNING' CLUSTER_STATE_BOOTSTRAPPING = 'BOOTSTRAPPING' CLUSTER_STATE_STARTING = 'STARTING' # `http://boto3.readthedocs.io/en/latest/reference/services/emr.html#EMR.Client.describe_step`_ STEP_STATE_PENDING = 'PENDING' STEP_STATE_CANCEL_PENDING = 'CANCEL_PENDING' STEP_STATE_RUNNING = 'RUNNING' STEP_STATE_COMPLETED = 'COMPLETED' STEP_STATE_CANCELLED = 'CANCELLED' STEP_STATE_FAILED = 'FAILED' STEP_STATE_INTERRUPTED = 'INTERRUPTED' class EmrCluster(AbstractCluster): """ implementation of the abstract API for the case of AWS EMR """ def __init__(self, name, context, **kwargs): super(EmrCluster, self).__init__(name, context, **kwargs) self._filesystem = S3Filesystem(self.logger, context, **kwargs) self.jobflow_id = None # it is both ClusterId and the JobflowId self.client_b3 = boto3.client(service_name='emr', region_name=context.settings['aws_cluster_region'], aws_access_key_id=context.settings['aws_access_key_id'], aws_secret_access_key=context.settings['aws_secret_access_key']) @property def filesystem(self): return self._filesystem def _poll_step(self, step_id): """ method polls the state for given step_id and awaits its completion """ def _current_state(): step = self.client_b3.describe_step(ClusterId=self.jobflow_id, StepId=step_id) return step['Step']['Status']['State'] state = _current_state() while state in [STEP_STATE_PENDING, STEP_STATE_RUNNING]: # Job flow step is being spawned. Idle and recheck the status. time.sleep(20.0) state = _current_state() if state in [STEP_STATE_CANCELLED, STEP_STATE_INTERRUPTED, STEP_STATE_CANCEL_PENDING, STEP_STATE_FAILED]: raise ClusterError('EMR Step {0} failed'.format(step_id)) elif state == STEP_STATE_COMPLETED: self.logger.info('EMR Step {0} has completed'.format(step_id)) else: self.logger.warning('Unknown state {0} during EMR Step {1} execution'.format(state, step_id)) return state def run_pig_step(self, uri_script, **kwargs): """ method starts a Pig step on a cluster and monitors its execution :raise EmrLauncherError: in case the cluster is not launched :return: step state or None if the step failed """ # `https://docs.aws.amazon.com/emr/latest/ReleaseGuide/emr-commandrunner.html`_ # `http://boto3.readthedocs.io/en/latest/reference/services/emr.html#EMR.Client.add_job_flow_steps`_ if not self.jobflow_id: raise ClusterError('EMR Cluster {0} is not launched'.format(self.name)) self.logger.info('Pig Script Step {') try: step = { 'Name': 'SynergyPigStep', 'ActionOnFailure': 'CONTINUE', 'HadoopJarStep': { 'Jar': 'command-runner.jar', 'Args': ['pig-script', '--run-pig-script', '--args', '-f', uri_script] } } if kwargs: properties = [{'Key': '{}'.format(k), 'Value': '{}'.format(v)} for k, v in kwargs.items()] step['HadoopJarStep']['Properties'] = properties step_args = [] for k, v in kwargs.items(): step_args.append('-p') step_args.append('{0}={1}'.format(k, v)) step['HadoopJarStep']['Args'].extend(step_args) step_response = self.client_b3.add_job_flow_steps(JobFlowId=self.jobflow_id, Steps=[step]) step_ids = step_response['StepIds'] assert len(step_ids) == 1 return self._poll_step(step_ids[0]) except ClusterError as e: self.logger.error('Pig Script Step Error: {0}'.format(e), exc_info=True) return None except Exception as e: self.logger.error('Pig Script Step Unexpected Exception: {0}'.format(e), exc_info=True) return None finally: self.logger.info('}') def run_spark_step(self, uri_script, language, **kwargs): # `https://github.com/dev-86/aws-cli/blob/29756ea294aebc7c854b3d9a2b1a56df28637e11/tests/unit/customizations/emr/test_create_cluster_release_label.py`_ # `https://docs.aws.amazon.com/emr/latest/ReleaseGuide/emr-commandrunner.html`_ # `http://boto3.readthedocs.io/en/latest/reference/services/emr.html#EMR.Client.add_job_flow_steps`_ if not self.jobflow_id: raise ClusterError('EMR Cluster {0} is not launched'.format(self.name)) self.logger.info('Spark Step {') try: step = { 'Name': 'SynergyPysparkStep', 'ActionOnFailure': 'CONTINUE', 'HadoopJarStep': { 'Jar': 'command-runner.jar', 'Args': ['spark-submit', '--deploy-mode', 'cluster', uri_script] } } if kwargs: properties = [{'Key': '{}'.format(k), 'Value': '{}'.format(v)} for k, v in kwargs.items()] step['HadoopJarStep']['Properties'] = properties step_response = self.client_b3.add_job_flow_steps(JobFlowId=self.jobflow_id, Steps=[step]) step_ids = step_response['StepIds'] assert len(step_ids) == 1 return self._poll_step(step_ids[0]) except ClusterError as e: self.logger.error('Spark Step Error: {0}'.format(e), exc_info=True) return None except Exception as e: self.logger.error('Spark Step Unexpected Exception: {0}'.format(e), exc_info=True) return None finally: self.logger.info('}') def run_hadoop_step(self, uri_script, **kwargs): # `https://github.com/dev-86/aws-cli/blob/29756ea294aebc7c854b3d9a2b1a56df28637e11/tests/unit/customizations/emr/test_create_cluster_release_label.py`_ pass def run_shell_command(self, uri_script, **kwargs): # `https://github.com/dev-86/aws-cli/blob/29756ea294aebc7c854b3d9a2b1a56df28637e11/tests/unit/customizations/emr/test_create_cluster_release_label.py`_ pass def _launch(self): """ method launches the cluster and returns when the cluster is fully operational and ready to accept business steps :see: `http://boto3.readthedocs.io/en/latest/reference/services/emr.html#EMR.Client.add_job_flow_steps`_ """ self.logger.info('Launching EMR Cluster {0} {{'.format(self.name)) try: response = self.client_b3.run_job_flow( Name=self.context.settings['aws_cluster_name'], ReleaseLabel='emr-5.12.0', Instances={ 'MasterInstanceType': 'm3.xlarge', 'SlaveInstanceType': 'm3.xlarge', 'InstanceCount': 3, 'KeepJobFlowAliveWhenNoSteps': True, 'TerminationProtected': True, 'Ec2KeyName': self.context.settings.get('aws_key_name', ''), }, BootstrapActions=[ { 'Name': 'Maximize Spark Default Config', 'ScriptBootstrapAction': { 'Path': 's3://support.elasticmapreduce/spark/maximize-spark-default-config', } }, ], Applications=[ { 'Name': 'Spark', }, { 'Name': 'Pig', }, ], VisibleToAllUsers=True, JobFlowRole='EMR_EC2_DefaultRole', ServiceRole='EMR_DefaultRole' ) self.logger.info('EMR Cluster Initialization Request Successful.') return response['JobFlowId'] except: self.logger.error('EMR Cluster failed to launch', exc_info=True) raise ClusterError('EMR Cluster {0} launch failed'.format(self.name)) finally: self.logger.info('}') def _get_cluster(self): try: clusters = self.client_b3.list_clusters(ClusterStates=['STARTING', 'BOOTSTRAPPING', 'RUNNING', 'WAITING']) for cluster in clusters['Clusters']: if cluster['Name'] != self.context.settings['aws_cluster_name']: continue return cluster['Id'] return None except: return None def _wait_for_cluster(self, cluster_id): """ method polls the state for the cluster and awaits until it is ready to start processing """ def _current_state(): cluster = self.client_b3.describe_cluster(ClusterId=cluster_id) return cluster['Cluster']['Status']['State'] state = _current_state() while state in [CLUSTER_STATE_STARTING, CLUSTER_STATE_BOOTSTRAPPING, CLUSTER_STATE_RUNNING]: # Cluster is being spawned. Idle and recheck the status. time.sleep(20.0) state = _current_state() if state in [CLUSTER_STATE_TERMINATING, CLUSTER_STATE_TERMINATED, CLUSTER_STATE_TERMINATED_WITH_ERRORS]: raise ClusterError('EMR Cluster {0} launch failed'.format(self.name)) elif state == CLUSTER_STATE_WAITING: # state WAITING marks readiness to process business steps cluster = self.client_b3.describe_cluster(ClusterId=cluster_id) master_dns = cluster['Cluster']['MasterPublicDnsName'] self.logger.info('EMR Cluster Launched Successfully. Master DNS node is {0}'.format(master_dns)) else: self.logger.warning('Unknown state {0} during EMR Cluster launch'.format(state)) return state def launch(self): self.logger.info('Launching EMR Cluster: {0} {{'.format(self.context.settings['aws_cluster_name'])) if self.jobflow_id \ and self._wait_for_cluster(self.jobflow_id) in [CLUSTER_STATE_STARTING, CLUSTER_STATE_BOOTSTRAPPING, CLUSTER_STATE_RUNNING]: raise ClusterError('EMR Cluster {0} has already been launched with id {1}. Use it or dispose it.' .format(self.name, self.jobflow_id)) cluster_id = self._get_cluster() if cluster_id: self.logger.info('Reusing existing EMR Cluster: {0} {{'.format(cluster_id)) else: cluster_id = self._launch() self._wait_for_cluster(cluster_id) self.jobflow_id = cluster_id self.logger.info('}') def terminate(self): """ method terminates the cluster """ if not self.jobflow_id: self.logger.info('No EMR Cluster to stop') return self.logger.info('Terminating EMR Cluster {') try: self.logger.info('Initiating termination procedure...') # Disable cluster termination protection self.client_b3.set_termination_protection(JobFlowIds=[self.jobflow_id], TerminationProtected=False) self.client_b3.terminate_job_flows(JobFlowIds=[self.jobflow_id]) self.jobflow_id = None self.logger.info('Termination request successful') except Exception as e: self.logger.error('Unexpected Exception: {0}'.format(e), exc_info=True) finally: self.logger.info('}')
{ "repo_name": "mushkevych/synergy_flow", "path": "flow/core/emr_cluster.py", "copies": "1", "size": "12175", "license": "bsd-3-clause", "hash": -5344821238485574000, "line_mean": 42.6379928315, "line_max": 159, "alpha_frac": 0.58275154, "autogenerated": false, "ratio": 3.879859783301466, "config_test": true, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.9953278177422135, "avg_score": 0.0018666291758662444, "num_lines": 279 }
__author__ = 'Bohdan Mushkevych' import unittest from collections import OrderedDict from synergy.system import time_helper from synergy.system.timeperiod_dict import TimeperiodDict from synergy.system.time_qualifier import * class TestTimeperiodDict(unittest.TestCase): def test_identity_translation(self): fixture = { QUALIFIER_HOURLY: {'2010123123': '2010123123', '2010123110': '2010123110', '2010123100': '2010123100'}, QUALIFIER_DAILY: {'2010123100': '2010123100', '2010120100': '2010120100'}, QUALIFIER_MONTHLY: {'2010120000': '2010120000', '2010010000': '2010010000'}, QUALIFIER_YEARLY: {'2010000000': '2010000000', '2011000000': '2011000000'}, } for qualifier, f in fixture.items(): d = TimeperiodDict(qualifier, 1) for key, value in f.items(): self.assertEqual(d._translate_timeperiod(key), value, msg='failing combination: q={0} fixture={1}:{2} actual={3}'. format(qualifier, key, value, d._translate_timeperiod(key))) def test_grouping_translation(self): fixture = { QUALIFIER_HOURLY: {'2010123123': '2010123123', '2010123122': '2010123123', '2010123110': '2010123110', '2010123111': '2010123115', '2010123101': '2010123105', '2010123100': '2010123105'}, QUALIFIER_DAILY: {'2010123100': '2010123100', '2010120100': '2010120500', '2010120600': '2010121000', '2010123000': '2010123000', '2010122000': '2010122000'}, QUALIFIER_MONTHLY: {'2010120000': '2010120000', '2010010000': '2010050000', '2010100000': '2010100000', '2010110000': '2010120000'}, } for qualifier, f in fixture.items(): d = TimeperiodDict(qualifier, 5) for key, value in f.items(): self.assertEqual(d._translate_timeperiod(key), value, msg='failing combination: q={0} fixture={1}/{2} actual={3}'. format(qualifier, key, value, d._translate_timeperiod(key))) fixture = { QUALIFIER_YEARLY: {'2010000000': '2010000000', '2011000000': '2011000000'} } for qualifier, f in fixture.items(): try: _ = TimeperiodDict(qualifier, 5) self.assertTrue(False, 'YEARLY should allow only identity grouping (i.e. grouping=1)') except AssertionError: self.assertTrue(True) def test_hourly_translation(self): test_dict = TimeperiodDict(QUALIFIER_HOURLY, 3) fixture = OrderedDict() fixture[(0, 4)] = '2010120303' fixture[(4, 7)] = '2010120306' fixture[(7, 10)] = '2010120309' fixture[(10, 13)] = '2010120312' fixture[(13, 16)] = '2010120315' fixture[(16, 19)] = '2010120318' fixture[(19, 22)] = '2010120321' fixture[(22, 24)] = '2010120323' timeperiod = '2010120300' for boundaries, value in fixture.items(): lower_boundary, upper_boundary = boundaries for i in range(lower_boundary, upper_boundary): actual_value = test_dict._translate_timeperiod(timeperiod) self.assertEqual(actual_value, value, msg='failing combination: timeperiod={0} i={1} actual/expected={2}/{3}'. format(timeperiod, i, actual_value, value)) timeperiod = time_helper.increment_timeperiod(QUALIFIER_HOURLY, timeperiod) def test_daily_translation(self): test_dict = TimeperiodDict(QUALIFIER_DAILY, 3) fixture = OrderedDict() fixture[(1, 4)] = '2010120300' fixture[(4, 7)] = '2010120600' fixture[(7, 10)] = '2010120900' fixture[(10, 13)] = '2010121200' fixture[(13, 16)] = '2010121500' fixture[(16, 19)] = '2010121800' fixture[(19, 22)] = '2010122100' fixture[(22, 25)] = '2010122400' fixture[(25, 28)] = '2010122700' fixture[(28, 31)] = '2010123000' fixture[(31, 32)] = '2010123100' timeperiod = '2010120100' for boundaries, value in fixture.items(): lower_boundary, upper_boundary = boundaries for i in range(lower_boundary, upper_boundary): actual_value = test_dict._translate_timeperiod(timeperiod) self.assertEqual(actual_value, value, msg='failing combination: timeperiod={0} i={1} actual/expected={2}/{3}'. format(timeperiod, i, actual_value, value)) timeperiod = time_helper.increment_timeperiod(QUALIFIER_DAILY, timeperiod) def test_container_methods(self): test_dict = TimeperiodDict(QUALIFIER_HOURLY, 3) timeperiod = '2010123100' for i in range(0, 24): # format {grouped_timeperiod: highest_loop_index} test_dict[timeperiod] = i timeperiod = time_helper.increment_timeperiod(QUALIFIER_HOURLY, timeperiod) fixture = OrderedDict() fixture[(0, 4)] = 3 fixture[(4, 7)] = 6 fixture[(7, 10)] = 9 fixture[(10, 13)] = 12 fixture[(13, 16)] = 15 fixture[(16, 19)] = 18 fixture[(19, 22)] = 21 fixture[(22, 24)] = 23 timeperiod = '2010123100' for boundaries, value in fixture.items(): lower_boundary, upper_boundary = boundaries for i in range(lower_boundary, upper_boundary): self.assertEqual(test_dict[timeperiod], value, msg='failing combination: timeperiod={0} i={1} actual/expected={2}/{3}'. format(timeperiod, i, test_dict[timeperiod], value)) # get method self.assertIsNotNone(test_dict.get(timeperiod), ) timeperiod = time_helper.increment_timeperiod(QUALIFIER_HOURLY, timeperiod) # test __len__ method self.assertEqual(len(test_dict), 8) # test __iter__ method counter = 0 for _ in test_dict: counter += 1 self.assertEqual(counter, 8) if __name__ == '__main__': unittest.main()
{ "repo_name": "mushkevych/scheduler", "path": "tests/test_timeperiod_dict.py", "copies": "1", "size": "6819", "license": "bsd-3-clause", "hash": 3351614010348240400, "line_mean": 42.4331210191, "line_max": 105, "alpha_frac": 0.5264701569, "autogenerated": false, "ratio": 4.1202416918429, "config_test": true, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.51467118487429, "avg_score": null, "num_lines": null }
__author__ = 'Bohdan Mushkevych' import unittest from datetime import datetime, timedelta from synergy.system.event_clock import EventClock, EventTime, parse_time_trigger_string, format_time_trigger_string from synergy.system.repeat_timer import RepeatTimer class TestEventClock(unittest.TestCase): def test_utc_now(self): utc_now = datetime.utcnow() self.obj = EventTime.utc_now() print(str(self.obj)) assert self.obj.day_of_week == str(utc_now.weekday()) \ and self.obj.time_of_day.hour == utc_now.hour \ and self.obj.time_of_day.minute == utc_now.minute \ and self.obj.time_of_day.second == 0 \ and self.obj.time_of_day.microsecond == 0 other_obj = EventTime.utc_now() self.assertEqual(other_obj, self.obj) def test_eq(self): params = [EventTime(x) for x in ['17:00', '4-15:45', '*-09:00', '8:01']] expected = [EventTime(x) for x in ['*-17:00', '2-17:00', '4-15:45', '*-09:00', '*-9:00', '*-08:01']] not_expected = [EventTime(x) for x in ['*-17:15', '1-15:45', '*-9:01', '*-18:01']] for event in expected: self.assertIn(event, params) for event in not_expected: self.assertNotIn(event, params) def test_parser(self): fixture = {'every 300': (300, RepeatTimer), 'every 500': (500, RepeatTimer), 'every 1': (1, RepeatTimer), 'at *-17:00, 4-15:45,*-09:00 ': (['*-17:00', '4-15:45', '*-09:00'], EventClock), 'at 5-18:00 ,4-18:05 ,1-9:01 ': (['5-18:00', '4-18:05', '1-9:01'], EventClock), 'at *-08:01': (['*-08:01'], EventClock), 'at 8:30': (['8:30'], EventClock)} for line, expected_output in fixture.items(): processed_tuple = parse_time_trigger_string(line) self.assertEqual(processed_tuple, expected_output) def test_formatter(self): fixture = {RepeatTimer(300, None): 'every 300', RepeatTimer(500, None): 'every 500', RepeatTimer(1, None): 'every 1', EventClock(['*-17:00', '4-15:45', '*-09:00'], None): 'at *-17:00,4-15:45,*-09:00', EventClock(['5-18:00', '4-18:05', '1-9:01'], None): 'at 5-18:00,4-18:05,1-09:01', EventClock(['*-08:01'], None): 'at *-08:01', EventClock(['8:30'], None): 'at *-08:30'} for handler, expected_output in fixture.items(): processed_tuple = format_time_trigger_string(handler) self.assertEqual(processed_tuple, expected_output) def test_next_run_in(self): # 2014-05-01 is Thu. In Python it is weekday=3 fixed_utc_now = \ datetime(year=2014, month=05, day=01, hour=13, minute=00, second=00, microsecond=00, tzinfo=None) fixture = {EventClock(['*-17:00', '4-15:45', '*-09:00'], None): timedelta(days=0, hours=4, minutes=0, seconds=0, microseconds=0, milliseconds=0), EventClock(['5-18:00', '4-18:05', '1-9:01'], None): timedelta(days=1, hours=5, minutes=5, seconds=0, microseconds=0, milliseconds=0), EventClock(['*-08:01'], None): timedelta(days=0, hours=19, minutes=1, seconds=0, microseconds=0, milliseconds=0), EventClock(['8:30'], None): timedelta(days=0, hours=19, minutes=30, seconds=0, microseconds=0, milliseconds=0)} for handler, expected_output in fixture.items(): handler.is_alive = lambda: True processed_output = handler.next_run_in(utc_now=fixed_utc_now) self.assertEqual(processed_output, expected_output) if __name__ == '__main__': unittest.main()
{ "repo_name": "eggsandbeer/scheduler", "path": "tests/test_event_clock.py", "copies": "1", "size": "3847", "license": "bsd-3-clause", "hash": -4417862393069892000, "line_mean": 46.4938271605, "line_max": 115, "alpha_frac": 0.5489992202, "autogenerated": false, "ratio": 3.3249783923941227, "config_test": true, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.9365509854096049, "avg_score": 0.0016935516996147385, "num_lines": 81 }
__author__ = 'Bohdan Mushkevych' import unittest from db.model.single_session import SingleSession class TestSingleSession(unittest.TestCase): def setUp(self): self.obj = SingleSession() def tearDown(self): del self.obj def test_key(self): domain_name = 'test_name' timeperiod = '20110101161633' session_id = 'session_xxx_yyy' self.obj.key = (domain_name, timeperiod, session_id) temp = self.obj.key assert temp[0] == domain_name assert temp[1] == timeperiod assert temp[2] == session_id def test_session_id(self): value = 'value_1234567890' self.obj.session_id = value assert self.obj.session_id == value def test_os(self): value = 'Windows MS PS 7.0.0.0.1.1.2' self.obj.user_profile.os = value assert self.obj.user_profile.os == value def test_browser(self): value = 'FF 3.4.5.6.7.8.9' self.obj.user_profile.browser = value assert self.obj.user_profile.browser == value def test_ip(self): value = '100.100.200.200' self.obj.user_profile.ip = value assert self.obj.user_profile.ip == value def test_screen_res(self): value_x = 1080 value_y = 980 self.obj.user_profile.screen_res = (value_x, value_y) assert self.obj.user_profile.screen_x == value_x assert self.obj.user_profile.screen_y == value_y def test_language(self): value = 'ca-uk' self.obj.user_profile.language = value assert self.obj.user_profile.language == value def test_country(self): value = 'ca' self.obj.user_profile.country = value assert self.obj.user_profile.country == value def test_total_duration(self): value = 123 self.obj.browsing_history.total_duration = value assert self.obj.browsing_history.total_duration == value def test_number_of_entries(self): value = 12 self.obj.browsing_history.number_of_entries = value assert self.obj.browsing_history.number_of_entries == value if __name__ == '__main__': unittest.main()
{ "repo_name": "eggsandbeer/scheduler", "path": "tests/test_single_session.py", "copies": "1", "size": "2176", "license": "bsd-3-clause", "hash": 3482754946242596000, "line_mean": 28.8082191781, "line_max": 67, "alpha_frac": 0.6125919118, "autogenerated": false, "ratio": 3.476038338658147, "config_test": true, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.45886302504581467, "avg_score": null, "num_lines": null }
__author__ = 'Bohdan Mushkevych' import unittest from settings import enable_test_mode enable_test_mode() from constants import PROCESS_SITE_DAILY from db.model.raw_data import DOMAIN_NAME, TIMEPERIOD from tests import hourly_fixtures, daily_fixtures from tests.test_abstract_worker import AbstractWorkerUnitTest from workers.site_daily_aggregator import SiteDailyAggregator class SiteDailyAggregatorUnitTest(AbstractWorkerUnitTest): def virtual_set_up(self): super(SiteDailyAggregatorUnitTest, self).constructor(baseclass=SiteDailyAggregator, process_name=PROCESS_SITE_DAILY, output_prefix='EXPECTED_SITE_DAILY', output_module=daily_fixtures, generate_output=False, compare_results=True) hourly_fixtures.clean_site_entries() return hourly_fixtures.generated_site_entries() def virtual_tear_down(self): hourly_fixtures.clean_site_entries() def _get_key(self, obj): return obj[DOMAIN_NAME], obj[TIMEPERIOD] def test_aggregation(self): super(SiteDailyAggregatorUnitTest, self).perform_aggregation() if __name__ == '__main__': unittest.main()
{ "repo_name": "eggsandbeer/scheduler", "path": "tests/test_site_daily_aggregator.py", "copies": "1", "size": "1423", "license": "bsd-3-clause", "hash": -6099458677106691000, "line_mean": 37.4594594595, "line_max": 97, "alpha_frac": 0.5952213633, "autogenerated": false, "ratio": 4.635179153094462, "config_test": true, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.5730400516394463, "avg_score": null, "num_lines": null }
__author__ = 'Bohdan Mushkevych' import unittest from settings import enable_test_mode enable_test_mode() from db.model.raw_data import DOMAIN_NAME, TIMEPERIOD from constants import PROCESS_SITE_YEARLY from tests import monthly_fixtures from tests import yearly_fixtures from tests.test_abstract_worker import AbstractWorkerUnitTest from workers.site_yearly_aggregator import SiteYearlyAggregator class SiteYearlyAggregatorUnitTest(AbstractWorkerUnitTest): def virtual_set_up(self): super(SiteYearlyAggregatorUnitTest, self).constructor(baseclass=SiteYearlyAggregator, process_name=PROCESS_SITE_YEARLY, output_prefix='EXPECTED_SITE_YEARLY', output_module=yearly_fixtures, generate_output=False, compare_results=True) monthly_fixtures.clean_site_entries() return monthly_fixtures.generated_site_entries() def virtual_tear_down(self): monthly_fixtures.clean_site_entries() def _get_key(self, obj): return obj[DOMAIN_NAME], obj[TIMEPERIOD] def test_aggregation(self): super(SiteYearlyAggregatorUnitTest, self).perform_aggregation() if __name__ == '__main__': unittest.main()
{ "repo_name": "eggsandbeer/scheduler", "path": "tests/test_site_yearly_aggregator.py", "copies": "1", "size": "1460", "license": "bsd-3-clause", "hash": -4187416878064004600, "line_mean": 37.4210526316, "line_max": 99, "alpha_frac": 0.6006849315, "autogenerated": false, "ratio": 4.740259740259741, "config_test": true, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.584094467175974, "avg_score": null, "num_lines": null }
__author__ = 'Bohdan Mushkevych' import unittest from settings import enable_test_mode enable_test_mode() from db.model.site_statistics import DOMAIN_NAME, TIMEPERIOD from constants import PROCESS_SITE_HOURLY from tests import hourly_fixtures from tests.test_abstract_worker import AbstractWorkerUnitTest from workers.site_hourly_aggregator import SiteHourlyAggregator class SiteHourlyAggregatorUnitTest(AbstractWorkerUnitTest): def virtual_set_up(self): super(SiteHourlyAggregatorUnitTest, self).constructor(baseclass=SiteHourlyAggregator, process_name=PROCESS_SITE_HOURLY, output_prefix='EXPECTED_SITE_HOURLY', output_module=hourly_fixtures, generate_output=False, compare_results=True) hourly_fixtures.clean_session_entries() return hourly_fixtures.generated_session_entries() def virtual_tear_down(self): hourly_fixtures.clean_session_entries() def _get_key(self, obj): return obj[DOMAIN_NAME], obj[TIMEPERIOD] def test_aggregation(self): super(SiteHourlyAggregatorUnitTest, self).perform_aggregation() if __name__ == '__main__': unittest.main()
{ "repo_name": "mushkevych/scheduler", "path": "tests/test_site_hourly_aggregator.py", "copies": "1", "size": "1437", "license": "bsd-3-clause", "hash": -199694802389473440, "line_mean": 38.9166666667, "line_max": 99, "alpha_frac": 0.5984690327, "autogenerated": false, "ratio": 4.758278145695364, "config_test": true, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.5856747178395364, "avg_score": null, "num_lines": null }
__author__ = 'Bohdan Mushkevych' import unittest from odm import document, fields class EmbeddedCollections(document.BaseDocument): field_list = fields.ListField() field_dict = fields.DictField() field_id = fields.ObjectIdField(name='_id', null=True) class TestDocument(unittest.TestCase): def setUp(self): self.maxDiff = None self.model = EmbeddedCollections() def tearDown(self): del self.model def test_getter_setter(self): test_dict = dict() for i in range(1, 100): self.model.field_dict[i] = i * 100 test_dict[i] = i * 100 for i in range(1, 100): self.model.field_list.append(i) self.assertListEqual(self.model.field_list, list(range(1, 100))) self.assertDictEqual(self.model.field_dict, test_dict) def test_jsonification(self): test_dict = dict() for i in range(1, 100): self.model.field_dict[i] = i * 100 test_dict[i] = i * 100 for i in range(1, 100): self.model.field_list.append(i) json_data = self.model.to_json() self.assertIsInstance(json_data, dict) m2 = EmbeddedCollections.from_json(json_data) self.assertListEqual(m2.field_list, list(range(1, 100))) self.assertDictEqual(m2.field_dict, test_dict) def test_nullable_jsonification(self): class FieldContainer(document.BaseDocument): field_list = fields.ListField(null=True) field_dict = fields.DictField(null=True) model = FieldContainer() json_data = model.to_json() self.assertIsInstance(json_data, dict) self.assertIsNone(model.field_list) self.assertIsNone(model.field_dict) m2 = FieldContainer.from_json(json_data) self.assertIsNone(m2.field_list) self.assertIsNone(m2.field_dict) if __name__ == '__main__': unittest.main()
{ "repo_name": "mushkevych/synergy_odm", "path": "tests/test_collection_fields.py", "copies": "1", "size": "1944", "license": "bsd-3-clause", "hash": 4793093026999238000, "line_mean": 28.0149253731, "line_max": 72, "alpha_frac": 0.6193415638, "autogenerated": false, "ratio": 3.5801104972375692, "config_test": true, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.4699452061037569, "avg_score": null, "num_lines": null }
__author__ = 'Bohdan Mushkevych' import unittest from synergy.conf import settings from flow.core.ephemeral_cluster import EphemeralCluster from flow.core.execution_context import ExecutionContext from flow.core.step_executor import StepExecutor, ACTIONSET_COMPLETE, ACTIONSET_FAILED, ACTIONSET_PENDING from flow.core.simple_actions import FailureAction, IdentityAction TEST_PRESET_TIMEPERIOD = '2016060107' TEST_START_TIMEPERIOD = '2016060107' TEST_END_TIMEPERIOD = '2016060108' class StepExecutorTest(unittest.TestCase): def setUp(self): flow_name = 'ut_flow_name' self.context = ExecutionContext(flow_name, TEST_PRESET_TIMEPERIOD, TEST_START_TIMEPERIOD, TEST_END_TIMEPERIOD, settings.settings) self.ephemeral_cluster = EphemeralCluster('unit test cluster', self.context) def tearDown(self): pass def test_simple_step(self): """ method tests happy-flow for the execution flow """ sa_identity = IdentityAction() step_exec = StepExecutor(step_name='a step', main_action=sa_identity, pre_actions=[sa_identity], post_actions=[sa_identity]) step_exec.set_context(self.context) self.assertFalse(step_exec.is_complete) self.assertEqual(step_exec.pre_actionset.state, ACTIONSET_PENDING) self.assertEqual(step_exec.main_actionset.state, ACTIONSET_PENDING) self.assertEqual(step_exec.post_actionset.state, ACTIONSET_PENDING) step_exec.do(self.ephemeral_cluster) self.assertTrue(step_exec.is_complete) self.assertEqual(step_exec.pre_actionset.state, ACTIONSET_COMPLETE) self.assertEqual(step_exec.main_actionset.state, ACTIONSET_COMPLETE) self.assertEqual(step_exec.post_actionset.state, ACTIONSET_COMPLETE) def test_failing_step(self): """ method tests execution step, where one of the phases is failing """ sa_identity = IdentityAction() sa_failure = FailureAction() step_exec = StepExecutor(step_name='a step', main_action=sa_failure, pre_actions=[sa_identity], post_actions=[sa_identity]) step_exec.set_context(self.context) self.assertFalse(step_exec.is_complete) step_exec.do(self.ephemeral_cluster) self.assertFalse(step_exec.is_complete) self.assertEqual(step_exec.pre_actionset.state, ACTIONSET_COMPLETE) self.assertEqual(step_exec.main_actionset.state, ACTIONSET_FAILED) self.assertEqual(step_exec.post_actionset.state, ACTIONSET_PENDING) if __name__ == '__main__': unittest.main()
{ "repo_name": "mushkevych/synergy_flow", "path": "tests/test_step_executor.py", "copies": "1", "size": "2778", "license": "bsd-3-clause", "hash": 4109005751178824700, "line_mean": 41.7384615385, "line_max": 118, "alpha_frac": 0.658387329, "autogenerated": false, "ratio": 3.918194640338505, "config_test": true, "has_no_keywords": false, "few_assignments": false, "quality_score": 1, "avg_score": 0.0004554158383237184, "num_lines": 65 }
__author__ = 'Bohdan Mushkevych' import unittest from synergy.system.time_qualifier import * from context import PROCESS_SITE_HOURLY, PROCESS_SITE_DAILY, PROCESS_SITE_MONTHLY, PROCESS_SITE_YEARLY, \ PROCESS_BASH_DRIVER from synergy.scheduler.process_hierarchy import ProcessHierarchy class TestProcessHierarchy(unittest.TestCase): def _perform_assertions(self, hierarchy, process_name_desc, time_qualifier_desc, top_process_name, bottom_process_name): index = 0 for hierarchy_key in hierarchy: process_name = process_name_desc[index] index += 1 self.assertEqual(hierarchy[hierarchy_key].process_entry.process_name, process_name) self.assertEqual(hierarchy.top_process.process_name, top_process_name) self.assertEqual(hierarchy.bottom_process.process_name, bottom_process_name) for process_name in process_name_desc: self.assertIn(process_name, hierarchy) for qualifier in time_qualifier_desc: self.assertTrue(hierarchy.has_qualifier(qualifier)) def test_four_level(self): hierarchy = ProcessHierarchy(PROCESS_SITE_HOURLY, PROCESS_SITE_YEARLY, PROCESS_SITE_MONTHLY, PROCESS_SITE_DAILY) process_name_desc = [PROCESS_SITE_YEARLY, PROCESS_SITE_MONTHLY, PROCESS_SITE_DAILY, PROCESS_SITE_HOURLY] time_qualifier_desc = [QUALIFIER_YEARLY, QUALIFIER_MONTHLY, QUALIFIER_DAILY, QUALIFIER_HOURLY] self._perform_assertions(hierarchy, process_name_desc, time_qualifier_desc, PROCESS_SITE_YEARLY, PROCESS_SITE_HOURLY) def test_three_level(self): hierarchy = ProcessHierarchy(PROCESS_SITE_HOURLY, PROCESS_SITE_MONTHLY, PROCESS_SITE_DAILY) process_name_desc = [PROCESS_SITE_MONTHLY, PROCESS_SITE_DAILY, PROCESS_SITE_HOURLY] time_qualifier_desc = [QUALIFIER_MONTHLY, QUALIFIER_DAILY, QUALIFIER_HOURLY] self._perform_assertions(hierarchy, process_name_desc, time_qualifier_desc, PROCESS_SITE_MONTHLY, PROCESS_SITE_HOURLY) def test_two_level(self): hierarchy = ProcessHierarchy(PROCESS_SITE_HOURLY, PROCESS_SITE_DAILY) process_name_desc = [PROCESS_SITE_DAILY, PROCESS_SITE_HOURLY] time_qualifier_desc = [QUALIFIER_DAILY, QUALIFIER_HOURLY] self._perform_assertions(hierarchy, process_name_desc, time_qualifier_desc, PROCESS_SITE_DAILY, PROCESS_SITE_HOURLY) def test_one_level(self): hierarchy = ProcessHierarchy(PROCESS_SITE_DAILY) process_name_desc = [PROCESS_SITE_DAILY] time_qualifier_desc = [QUALIFIER_DAILY] self._perform_assertions(hierarchy, process_name_desc, time_qualifier_desc, PROCESS_SITE_DAILY, PROCESS_SITE_DAILY) def test_mix(self): hierarchy = ProcessHierarchy(PROCESS_SITE_HOURLY, PROCESS_SITE_YEARLY) process_name_desc = [PROCESS_SITE_YEARLY, PROCESS_SITE_HOURLY] time_qualifier_desc = [QUALIFIER_YEARLY, QUALIFIER_HOURLY] self._perform_assertions(hierarchy, process_name_desc, time_qualifier_desc, PROCESS_SITE_YEARLY, PROCESS_SITE_HOURLY) def test_invalid_process_name(self): try: ProcessHierarchy(PROCESS_BASH_DRIVER, PROCESS_SITE_HOURLY) self.assertTrue(False, 'AttributeError should have been thrown for improper hierarchical process') except AttributeError: self.assertTrue(True, 'AttributeError was expected and caught') if __name__ == '__main__': unittest.main()
{ "repo_name": "eggsandbeer/scheduler", "path": "tests/test_process_hierarchy.py", "copies": "1", "size": "3643", "license": "bsd-3-clause", "hash": -4439504434706716700, "line_mean": 42.8915662651, "line_max": 120, "alpha_frac": 0.6771891298, "autogenerated": false, "ratio": 3.5541463414634147, "config_test": true, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.9721011984002921, "avg_score": 0.0020646974520988574, "num_lines": 83 }
__author__ = 'Bohdan Mushkevych' import unittest try: import mock except ImportError: from unittest import mock from settings import enable_test_mode enable_test_mode() from constants import PROCESS_SITE_HOURLY from synergy.db.dao.job_dao import JobDao from synergy.db.dao.unit_of_work_dao import UnitOfWorkDao from synergy.db.model import job, unit_of_work from synergy.db.manager.ds_manager import BaseManager from synergy.system.system_logger import get_logger from synergy.scheduler.timetable import Timetable from synergy.scheduler.state_machine_continuous import StateMachineContinuous from tests.state_machine_testing_utils import * from tests.base_fixtures import create_unit_of_work from tests.ut_context import PROCESS_UNIT_TEST class ContinuousSMUnitTest(unittest.TestCase): def setUp(self): self.logger = get_logger(PROCESS_UNIT_TEST) self.time_table_mocked = mock.create_autospec(Timetable) self.job_dao_mocked = mock.create_autospec(JobDao) self.uow_dao_mocked = mock.create_autospec(UnitOfWorkDao) self.ds_mocked = mock.create_autospec(BaseManager) self.sm_real = StateMachineContinuous(self.logger, self.time_table_mocked) self.sm_real.uow_dao = self.uow_dao_mocked self.sm_real.job_dao = self.job_dao_mocked self.sm_real.ds = self.ds_mocked self.sm_real.update_job = mock.Mock(side_effect=self.sm_real.update_job) self.sm_real._process_state_final_run = mock.Mock(side_effect=self.sm_real._process_state_final_run) self.sm_real._process_state_in_progress = mock.Mock(side_effect=self.sm_real._process_state_in_progress) def tearDown(self): pass def test_compute_next_job_state(self): """ method validated logic behind selection of the next Job state """ self.sm_real.insert_and_publish_uow = then_return_uow # use-case 1: make sure it is STATE_IN_PROGRESS for current timeperiod and non-finalizable job job_record = get_job_record(job.STATE_EMBRYO, TEST_ACTUAL_TIMEPERIOD, PROCESS_SITE_HOURLY) self.time_table_mocked.is_job_record_finalizable = mock.MagicMock(return_value=False) self.assertEqual(self.sm_real._compute_next_job_state(job_record), job.STATE_IN_PROGRESS) # use-case 2: make sure it is STATE_IN_PROGRESS for past timeperiod and non-finalizable job job_record = get_job_record(job.STATE_EMBRYO, TEST_PAST_TIMEPERIOD, PROCESS_SITE_HOURLY) self.time_table_mocked.is_job_record_finalizable = mock.MagicMock(return_value=False) self.assertEqual(self.sm_real._compute_next_job_state(job_record), job.STATE_IN_PROGRESS) # use-case 3: make sure it is STATE_IN_PROGRESS for current timeperiod and finalizable job job_record = get_job_record(job.STATE_EMBRYO, TEST_ACTUAL_TIMEPERIOD, PROCESS_SITE_HOURLY) self.time_table_mocked.is_job_record_finalizable = mock.MagicMock(return_value=True) self.assertEqual(self.sm_real._compute_next_job_state(job_record), job.STATE_IN_PROGRESS) # use-case 4: make sure it is STATE_FINAL_RUN for past timeperiod and finalizable job job_record = get_job_record(job.STATE_EMBRYO, TEST_PAST_TIMEPERIOD, PROCESS_SITE_HOURLY) self.time_table_mocked.is_job_record_finalizable = mock.MagicMock(return_value=True) self.assertEqual(self.sm_real._compute_next_job_state(job_record), job.STATE_FINAL_RUN) # use-case 5: make sure the exception is thrown for future timeperiod job_record = get_job_record(job.STATE_EMBRYO, TEST_FUTURE_TIMEPERIOD, PROCESS_SITE_HOURLY) self.time_table_mocked.is_job_record_finalizable = mock.MagicMock(return_value=True) try: self.sm_real._compute_next_job_state(job_record) self.assertTrue(False, 'an exception is expected to be thrown') except ValueError: self.assertTrue(True, 'an exception is expected') def test_state_embryo(self): """ method tests job records in STATE_EMBRYO state""" self.sm_real.insert_and_publish_uow = then_return_uow self.sm_real._compute_next_job_state = mock.MagicMock(return_value=job.STATE_IN_PROGRESS) job_record = get_job_record(job.STATE_EMBRYO, TEST_PRESET_TIMEPERIOD, PROCESS_SITE_HOURLY) self.sm_real.manage_job(job_record) self.sm_real.update_job.assert_called_once_with(mock.ANY, mock.ANY, mock.ANY) def test_duplicatekeyerror_state_embryo(self): """ method tests job records in STATE_EMBRYO state""" self.sm_real._insert_uow = then_raise_uw job_record = get_job_record(job.STATE_EMBRYO, TEST_PRESET_TIMEPERIOD, PROCESS_SITE_HOURLY) try: self.sm_real.manage_job(job_record) self.assertTrue(False, 'UserWarning exception should have been thrown') except UserWarning: self.assertTrue(True) def test_future_timeperiod_state_in_progress(self): """ method tests timetable records in STATE_IN_PROGRESS state""" job_record = get_job_record(job.STATE_IN_PROGRESS, TEST_FUTURE_TIMEPERIOD, PROCESS_SITE_HOURLY) manual_uow = create_unit_of_work(PROCESS_SITE_HOURLY, 0, 1, TEST_ACTUAL_TIMEPERIOD) self.uow_dao_mocked.get_one = mock.MagicMock(return_value=manual_uow) self.time_table_mocked.is_job_record_finalizable = mock.MagicMock(return_value=True) self.sm_real.insert_and_publish_uow = then_raise_uw self.sm_real.manage_job(job_record) self.assertEqual(len(self.sm_real.update_job.call_args_list), 0) def test_preset_timeperiod_state_in_progress(self): """ method tests timetable records in STATE_IN_PROGRESS state""" self.time_table_mocked.is_job_record_finalizable = mock.MagicMock(return_value=True) self.uow_dao_mocked.get_one = mock.MagicMock( side_effect=lambda *_: create_unit_of_work(PROCESS_SITE_HOURLY, 0, 1, TEST_ACTUAL_TIMEPERIOD)) self.sm_real.insert_and_publish_uow = then_return_uow job_record = get_job_record(job.STATE_IN_PROGRESS, TEST_PRESET_TIMEPERIOD, PROCESS_SITE_HOURLY) self.sm_real.manage_job(job_record) self.assertEqual(len(self.sm_real.update_job.call_args_list), 0) self.assertEqual(len(self.sm_real._process_state_final_run.call_args_list), 0) def test_transfer_to_final_state_from_in_progress(self): """ method tests timetable records in STATE_IN_PROGRESS state""" self.time_table_mocked.is_job_record_finalizable = mock.MagicMock(return_value=True) self.uow_dao_mocked.get_one = mock.MagicMock( side_effect=lambda *_: create_unit_of_work( PROCESS_SITE_HOURLY, 1, 1, TEST_ACTUAL_TIMEPERIOD, unit_of_work.STATE_PROCESSED)) self.sm_real.insert_and_publish_uow = then_return_duplicate_uow job_record = get_job_record(job.STATE_IN_PROGRESS, TEST_PRESET_TIMEPERIOD, PROCESS_SITE_HOURLY) self.sm_real.manage_job(job_record) self.assertEqual(len(self.sm_real.update_job.call_args_list), 1) self.assertEqual(len(self.sm_real._process_state_in_progress.call_args_list), 1) self.assertEqual(len(self.sm_real._process_state_final_run.call_args_list), 0) def test_retry_state_in_progress(self): """ method tests timetable records in STATE_IN_PROGRESS state""" self.time_table_mocked.is_job_record_finalizable = mock.MagicMock(return_value=True) self.uow_dao_mocked.get_one = mock.MagicMock( side_effect=lambda *_: create_unit_of_work( PROCESS_SITE_HOURLY, 1, 1, TEST_ACTUAL_TIMEPERIOD, unit_of_work.STATE_PROCESSED)) self.sm_real.insert_and_publish_uow = then_return_uow job_record = get_job_record(job.STATE_IN_PROGRESS, TEST_PRESET_TIMEPERIOD, PROCESS_SITE_HOURLY) self.sm_real.manage_job(job_record) self.assertEqual(len(self.sm_real.update_job.call_args_list), 1) self.assertEqual(len(self.sm_real._process_state_in_progress.call_args_list), 1) self.assertEqual(len(self.sm_real._process_state_final_run.call_args_list), 0) def test_processed_state_final_run(self): """method tests timetable records in STATE_FINAL_RUN state""" self.uow_dao_mocked.get_one = mock.MagicMock( side_effect=lambda *_: create_unit_of_work( PROCESS_SITE_HOURLY, 1, 1, TEST_ACTUAL_TIMEPERIOD, unit_of_work.STATE_PROCESSED)) job_record = get_job_record(job.STATE_FINAL_RUN, TEST_PRESET_TIMEPERIOD, PROCESS_SITE_HOURLY) self.sm_real.manage_job(job_record) self.assertEqual(len(self.sm_real.update_job.call_args_list), 1) self.assertEqual(len(self.time_table_mocked.get_tree.call_args_list), 1) def test_cancelled_state_final_run(self): """method tests timetable records in STATE_FINAL_RUN state""" self.uow_dao_mocked.get_one = mock.MagicMock( side_effect=lambda *_: create_unit_of_work( PROCESS_SITE_HOURLY, 1, 1, TEST_ACTUAL_TIMEPERIOD, unit_of_work.STATE_CANCELED)) job_record = get_job_record(job.STATE_FINAL_RUN, TEST_PRESET_TIMEPERIOD, PROCESS_SITE_HOURLY) self.sm_real.manage_job(job_record) self.assertEqual(len(self.sm_real.update_job.call_args_list), 1) self.assertEqual(len(self.time_table_mocked.get_tree.call_args_list), 1) def test_state_skipped(self): """method tests timetable records in STATE_SKIPPED state""" job_record = get_job_record(job.STATE_SKIPPED, TEST_PRESET_TIMEPERIOD, PROCESS_SITE_HOURLY) self.sm_real.manage_job(job_record) self.assertEqual(len(self.sm_real.update_job.call_args_list), 0) self.assertEqual(len(self.time_table_mocked.get_tree.call_args_list), 0) def test_state_processed(self): """method tests timetable records in STATE_PROCESSED state""" job_record = get_job_record(job.STATE_PROCESSED, TEST_PRESET_TIMEPERIOD, PROCESS_SITE_HOURLY) self.sm_real.manage_job(job_record) self.assertEqual(len(self.sm_real.update_job.call_args_list), 0) self.assertEqual(len(self.time_table_mocked.get_tree.call_args_list), 0) if __name__ == '__main__': unittest.main()
{ "repo_name": "mushkevych/scheduler", "path": "tests/test_state_machine_continuous.py", "copies": "1", "size": "10232", "license": "bsd-3-clause", "hash": -385314419994460350, "line_mean": 50.16, "line_max": 112, "alpha_frac": 0.6968334636, "autogenerated": false, "ratio": 3.227760252365931, "config_test": true, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.9404876326924323, "avg_score": 0.003943477808321677, "num_lines": 200 }
__author__ = 'Bohdan Mushkevych' import unittest try: import mock except ImportError: from unittest import mock from settings import enable_test_mode enable_test_mode() from synergy.db.dao.unit_of_work_dao import UnitOfWorkDao from synergy.db.dao.log_recording_dao import LogRecordingDao from synergy.system.system_logger import get_logger from synergy.system.mq_transmitter import MqTransmitter from synergy.workers.abstract_uow_aware_worker import AbstractUowAwareWorker from tests.base_fixtures import create_and_insert_unit_of_work, TestMessage from context import PROCESS_ALERT_DAILY INFO_LOG_MESSAGES = [f'111222333 INFO log message string {x}' for x in range(10)] WARN_LOG_MESSAGES = [f'444555666 WARNING log message string {x}' for x in range(10)] STD_MESSAGES = [f'777888999 STD OUTPUT message {x}' for x in range(10)] class TheWorker(AbstractUowAwareWorker): def __init__(self, process_name): super(TheWorker, self).__init__(process_name, perform_db_logging=True) self.mq_transmitter = mock.create_autospec(MqTransmitter) def _init_performance_tracker(self, logger): super(TheWorker, self)._init_performance_tracker(logger) self.performance_tracker.cancel() def _init_mq_consumer(self): self.consumer = mock.Mock() class ChattyWorker(TheWorker): def _process_uow(self, uow): for message in INFO_LOG_MESSAGES: self.logger.info(message) for message in WARN_LOG_MESSAGES: self.logger.warning(message) for message in STD_MESSAGES: print(message) class ExceptionWorker(TheWorker): def _process_uow(self, uow): try: raise ValueError('Artificially triggered exception to test Uow Exception Logging') except Exception as e: self.logger.error(f'Exception: {e}', exc_info=True) class LogRecordingHandlerUnitTest(unittest.TestCase): """ Test flow: 1. create a UOW in the database 2. emulate mq message 3. call _mq_callback method 4. validate that all the messages are now found in the uow_log record 5. remove UOW and uow_log record """ def setUp(self): self.process_name = PROCESS_ALERT_DAILY self.logger = get_logger(self.process_name) self.uow_id = create_and_insert_unit_of_work(self.process_name, 'range_start', 'range_end') self.uow_id = str(self.uow_id) self.uow_dao = UnitOfWorkDao(self.logger) self.log_recording_dao = LogRecordingDao(self.logger) def tearDown(self): self.uow_dao.remove(self.uow_id) self.log_recording_dao.remove(self.uow_id) def test_logging(self): self.worker = ChattyWorker(self.process_name) message = TestMessage(process_name=self.process_name, uow_id=self.uow_id) self.worker._mq_callback(message) uow_log = self.log_recording_dao.get_one(self.uow_id) messages = INFO_LOG_MESSAGES + WARN_LOG_MESSAGES # + STD_MESSAGES self.assertLessEqual(len(messages), len(uow_log.log)) for index, message in enumerate(messages): self.assertIn(message, uow_log.log[index]) def test_exception_logging(self): self.worker = ExceptionWorker(self.process_name) message = TestMessage(process_name=self.process_name, uow_id=self.uow_id) self.worker._mq_callback(message) uow_log = self.log_recording_dao.get_one(self.uow_id) messages = ['Exception: Artificially triggered exception to test Uow Exception Logging', 'Method ExceptionWorker._process_uow returned None. Assuming happy flow.', 'at INVALID_TIMEPERIOD: Success/Failure 0/0 entries'] for index, message in enumerate(messages): self.assertIn(message, uow_log.log[index]) if __name__ == '__main__': unittest.main()
{ "repo_name": "mushkevych/scheduler", "path": "tests/test_log_recording_handler.py", "copies": "1", "size": "3875", "license": "bsd-3-clause", "hash": 113173441170446620, "line_mean": 36.2596153846, "line_max": 99, "alpha_frac": 0.6807741935, "autogenerated": false, "ratio": 3.558310376492195, "config_test": true, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.47390845699921946, "avg_score": null, "num_lines": null }
__author__ = 'Bohdan Mushkevych' import unittest try: import mock except ImportError: from unittest import mock from tests import ut_flows ut_flows.register_flows() from synergy.conf import settings from flow.conf import flows from flow.core.flow_graph_node import FlowGraphNode from flow.core.execution_context import ExecutionContext from flow.core.step_executor import StepExecutor, ACTIONSET_COMPLETE from flow.core.ephemeral_cluster import EphemeralCluster TEST_PRESET_TIMEPERIOD = '2016060107' TEST_START_TIMEPERIOD = '2016060107' TEST_END_TIMEPERIOD = '2016060108' class FlowGraphTest(unittest.TestCase): def setUp(self): flow_name = 'ut_flow_name' self.context = ExecutionContext(flow_name, TEST_PRESET_TIMEPERIOD, TEST_START_TIMEPERIOD, TEST_END_TIMEPERIOD, settings.settings) def tearDown(self): pass @mock.patch('flow.core.flow_graph.FlowDao') def test_set_context(self, mock_flow_dao): """ flow_dao is mocked to prevent performing read/write operations on the DB as this UT is about testing the iterator logic """ the_flow = flows.flows[ut_flows.UNIT_TEST_FLOW_SIMPLE] self.assertIsNone(the_flow.context) the_flow.set_context(self.context) self.assertIsNotNone(the_flow.context) @mock.patch('flow.core.flow_graph.FlowDao') @mock.patch('flow.core.flow_graph.StepDao') @mock.patch('flow.core.flow_graph_node.StepDao') @mock.patch('flow.core.flow_graph.LogRecordingHandler') @mock.patch('flow.core.flow_graph_node.LogRecordingHandler') def test_simple_iterator(self, flow_flow_dao, flow_step_dao, step_step_dao, flow_recording_handler, step_recording_handler): """ method tests happy-flow for the iterator """ the_flow = flows.flows[ut_flows.UNIT_TEST_FLOW_SIMPLE] the_flow.set_context(self.context) the_flow.mark_start() steps_order = list() for step_name in the_flow: steps_order.append(step_name) step = the_flow[step_name] assert isinstance(step, FlowGraphNode) step.set_context(self.context) step.mark_start() assert isinstance(step.step_executor, StepExecutor) step.step_executor.pre_actionset.state = ACTIONSET_COMPLETE step.step_executor.main_actionset.state = ACTIONSET_COMPLETE step.step_executor.post_actionset.state = ACTIONSET_COMPLETE step.mark_success() self.assertListEqual(steps_order, ['step_1', 'step_2', 'step_3', 'step_4', 'step_5', 'step_6', 'step_7', 'step_8']) @mock.patch('flow.core.flow_graph.FlowDao') @mock.patch('flow.core.flow_graph.StepDao') @mock.patch('flow.core.flow_graph_node.StepDao') @mock.patch('flow.core.flow_graph.LogRecordingHandler') @mock.patch('flow.core.flow_graph_node.LogRecordingHandler') def test_interrupted_iterator(self, flow_flow_dao, flow_step_dao, step_step_dao, flow_recording_handler, step_recording_handler): """ method tests iterator interrupted by failed step """ the_flow = flows.flows[ut_flows.UNIT_TEST_FLOW_FAILURE] the_flow.set_context(self.context) the_flow.mark_start() ephemeral_cluster = EphemeralCluster('unit test cluster', self.context) steps_order = list() for step_name in the_flow: steps_order.append(step_name) step = the_flow[step_name] assert isinstance(step, FlowGraphNode) step.set_context(self.context) step.run(ephemeral_cluster) self.assertListEqual(steps_order, ['step_1', 'step_2', 'step_3', 'step_4']) def test_all_dependant_steps(self): """ method verifies if iterator interrupted by failed step """ the_flow = flows.flows[ut_flows.UNIT_TEST_FLOW_SIMPLE] self.assertSetEqual(set(the_flow.all_dependant_steps('step_1')), {'step_2', 'step_3', 'step_4', 'step_5', 'step_6', 'step_7', 'step_8'}) self.assertSetEqual(set(the_flow.all_dependant_steps('step_2')), {'step_3', 'step_4', 'step_5', 'step_6', 'step_7', 'step_8'}) self.assertSetEqual(set(the_flow.all_dependant_steps('step_3')), {'step_5'}) self.assertSetEqual(set(the_flow.all_dependant_steps('step_6')), {'step_7', 'step_8'}) if __name__ == '__main__': unittest.main()
{ "repo_name": "mushkevych/synergy_flow", "path": "tests/test_flow_graph.py", "copies": "1", "size": "4570", "license": "bsd-3-clause", "hash": -3215478460911542000, "line_mean": 40.1711711712, "line_max": 118, "alpha_frac": 0.6374179431, "autogenerated": false, "ratio": 3.5703125, "config_test": true, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.969667578535523, "avg_score": 0.002210931548953984, "num_lines": 111 }
__author__ = 'Bohdan Mushkevych' try: from http.client import NO_CONTENT except ImportError: from httplib import NO_CONTENT import json from werkzeug.wrappers import Response from synergy.mx.utils import render_template, expose from flow.mx.flow_action_handler import FlowActionHandler, RUN_MODE_RUN_ONE, RUN_MODE_RUN_FROM # for future use @expose('/flow/step/details/') def details_flow_step(request, **values): details = FlowActionHandler(request, **values) return Response(response=json.dumps(details.step_details), mimetype='application/json') # for future use @expose('/flow/flow/details/') def details_flow(request, **values): details = FlowActionHandler(request, **values) return Response(response=json.dumps(details.flow_details), mimetype='application/json') @expose('/flow/run/mode/') def set_run_mode(request, **values): handler = FlowActionHandler(request, **values) handler.set_run_mode() return Response(status=NO_CONTENT) @expose('/flow/run/one_step/') def run_one_step(request, **values): handler = FlowActionHandler(request, **values) return Response(response=json.dumps(handler.perform_freerun_action(RUN_MODE_RUN_ONE)), mimetype='application/json') @expose('/flow/run/from_step/') def run_from_step(request, **values): handler = FlowActionHandler(request, **values) return Response(response=json.dumps(handler.perform_freerun_action(RUN_MODE_RUN_FROM)), mimetype='application/json') @expose('/flow/step/log/') def get_step_log(request, **values): handler = FlowActionHandler(request, **values) return Response(response=json.dumps(handler.get_step_log()), mimetype='application/json') @expose('/flow/flow/log/') def get_flow_log(request, **values): handler = FlowActionHandler(request, **values) return Response(response=json.dumps(handler.get_flow_log()), mimetype='application/json') @expose('/flow/viewer/') def flow_viewer(request, **values): handler = FlowActionHandler(request, **values) return render_template('flow_viewer.html', flow_details=handler.flow_details, process_name=handler.process_name, active_run_mode=handler.active_run_mode, freerun_uows=handler.freerun_uow_records)
{ "repo_name": "mushkevych/synergy_flow", "path": "flow/mx/views.py", "copies": "1", "size": "2351", "license": "bsd-3-clause", "hash": 6102536044288337000, "line_mean": 33.0724637681, "line_max": 94, "alpha_frac": 0.6924712888, "autogenerated": false, "ratio": 3.6677067082683306, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.9854714184157074, "avg_score": 0.0010927625822512962, "num_lines": 69 }
__author__ = 'Bohdan Mushkevych' try: import mock except ImportError: from unittest import mock from settings import enable_test_mode enable_test_mode() import types import unittest import process_starter from six import class_types, PY2, PY3 def main_function(*args): return args class OldClass: def starter_method(self, *args): return args class NewClass(object): def starter_method(self, *args): return args class TestProcessStarter(unittest.TestCase): def test_type_old_class(self): t, m, starter = process_starter.get_class('tests.test_process_starter.OldClass') self.assertIn(t, class_types) self.assertIsInstance(m, class_types) self.assertIsNone(starter) def test_type_new_class(self): t, m, starter = process_starter.get_class('tests.test_process_starter.NewClass') self.assertIn(t, class_types) self.assertIsInstance(m, class_types) self.assertIsNone(starter) def test_type_function(self): t, m, starter = process_starter.get_class('tests.test_process_starter.main_function') self.assertEqual(t, types.FunctionType) self.assertIsInstance(m, types.FunctionType) self.assertIsNone(starter) def test_old_class_method(self): t, m, starter = process_starter.get_class('tests.test_process_starter.OldClass.starter_method') self.assertIn(t, class_types) self.assertIsInstance(m, class_types) self.assertEqual(starter, 'starter_method') def test_not_class(self): t, m, starter = process_starter.get_class('tests.test_process_starter.main_function') self.assertEqual(t, types.FunctionType) self.assertIsInstance(m, types.FunctionType) self.assertNotIsInstance(m, class_types) self.assertIsNone(starter) def test_starter_method(self): t, m, starter = process_starter.get_class('tests.test_process_starter.NewClass.starter_method') self.assertIn(t, class_types) self.assertIsInstance(m, class_types) self.assertEqual(starter, 'starter_method') self.assertIsInstance(getattr(m(), starter), types.MethodType) if PY2: self.assertIsInstance(getattr(m, starter), types.MethodType) if PY3: self.assertIsInstance(getattr(m, starter), types.FunctionType) def test_python_types(self): class _C(object): def m(self): pass self.assertEqual(type(_C), type) self.assertIsInstance(getattr(_C(), 'm'), types.MethodType) self.assertEqual(type(_C().m), types.MethodType) if PY2: self.assertIsInstance(getattr(_C, 'm'), types.MethodType) self.assertEqual(type(_C.m), types.MethodType) if PY3: self.assertIsInstance(getattr(_C, 'm'), types.FunctionType) self.assertEqual(type(_C.m), types.FunctionType) @mock.patch('workers.abstract_worker.SimpleTracker') def test_starting_method(self, mock_tracker): """ performance_tracker must be mocked otherwise they will instantiate threads and prevent Unit Tests from finishing """ from tests.ut_process_context import PROCESS_CLASS_EXAMPLE process_starter.start_by_process_name(PROCESS_CLASS_EXAMPLE, None) def test_starting_function(self): from tests.ut_process_context import PROCESS_SCRIPT_EXAMPLE process_starter.start_by_process_name(PROCESS_SCRIPT_EXAMPLE, 'parameters') if __name__ == '__main__': unittest.main()
{ "repo_name": "mushkevych/launch.py", "path": "tests/test_process_starter.py", "copies": "1", "size": "3591", "license": "bsd-3-clause", "hash": -8991277941250797000, "line_mean": 32.25, "line_max": 103, "alpha_frac": 0.6649958229, "autogenerated": false, "ratio": 3.756276150627615, "config_test": true, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.9908119141848962, "avg_score": 0.002630566335730536, "num_lines": 108 }
__author__ = 'Bohdan' import time class AminisLastErrorHolder: def __init__(self): self.errorText = "" self.__hasError = False def clearError(self): self.errorText = "" self.__hasError = False def setError(self, errorText): self.errorText = errorText self.__hasError = True @property def hasError(self): return self.__hasError def timeDelta(timeBegin): end = time.time() secs = end - timeBegin msecs = (end - timeBegin) * 1000.0 return secs*1000 + msecs def splitAndFilter(value, separator): items = str(value).split(separator) ret = [] for item in items: item = str(item).strip() if len(item) == 0: continue ret += [item] return ret def isFloat(value): try: float(value) return True except ValueError: return False def strToFloat(value): value = str(value).strip() if len(value) == 0: return None value = value.replace(",", ".") try: return float(value) except ValueError: return None
{ "repo_name": "dayitv89/sim-module", "path": "lib/sim900/amsharedmini.py", "copies": "2", "size": "1135", "license": "mit", "hash": -8608614065198607000, "line_mean": 17.9333333333, "line_max": 40, "alpha_frac": 0.5612334802, "autogenerated": false, "ratio": 3.770764119601329, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 1, "avg_score": 0.008416083395933008, "num_lines": 60 }
__author__ = 'Bojan Delic <bojan@delic.in.rs>' __date__ = 'Aug 21, 2013' __copyright__ = 'Copyright (c) 2013 Bojan Delic' import weakref from functools import partial from Queue import Queue from threading import Lock from collections import defaultdict import wpf from System import TimeSpan from System.Windows.Input import ICommand from System import EventArgs from System.Windows.Threading import DispatcherTimer from System.ComponentModel import INotifyPropertyChanged, PropertyChangedEventArgs from System.Collections.ObjectModel import ObservableCollection class MvvmError(Exception): pass class WeakCallable(object): ''' Weak reference to bound methods. Because bound method is created at the moment when it is accessed every time, it will be garbage collected very soon, even if object it is bound to is not garbage collected. This class holds weak references to methods `im_self` and `im_func` that will not be garbage collected until `self` of the method is alive. ''' def __init__(self, func, on_collect=None): ''' Both `on_func_collect` and `on_self_collect` should accept single parameter that will be instance of :class:`.WeakCallable` that died. :param callable func: Methods to create weak reference for. :param callable on_collect: Callable that will be called when function is garbage collected. ''' self._ext_on_collect = on_collect if hasattr(func, 'im_func'): # if this is method self._func = weakref.ref(func.im_func) self._obj = weakref.ref(func.im_self, self._on_collect) else: self._func = weakref.ref(func, self._on_collect) self._obj = None def __call__(self, *args, **kwargs): if self._obj is not None: cl = self._func() obj = self._obj() if cl is not None and obj is not None: return cl(obj, *args, **kwargs) else: raise weakref.ReferenceError('Object no longer available') else: cl = self._func() if cl is not None: return cl(*args, **kwargs) else: raise weakref.ReferenceError('Function no longer available') def _on_collect(self, ref): if self._ext_on_collect is not None: self._ext_on_collect(self) class _Messenger(object): ''' Thread-safe messenger that ensures that all message handlers are executed in main dispatcher thread. This class should be used as singleton. It is not enforced, but recomanded way of getting instance is by using :meth:`_Messenger.instance` class method. ''' _instance = None @classmethod def instance(cls, interval=5): ''' Returns existing instance of messenger. If one does not exist it will be created and returned. :param int interval: Number of miliseconds that represents interval when messages will be processed. Note that this parameter will be used only the first time when instance is requested, every other time it will be ignored because existing instance of :class:`._Messenger` is returned. ''' if not cls._instance: cls._instance = _Messenger(interval) return cls._instance def __init__(self, interval=5): ''' :param int interval: Number of milliseconds that represents interval when messages will be processed. ''' self._subscribers = defaultdict(list) self._messages = Queue() self._lock = Lock() self._timer = DispatcherTimer() self._timer.Interval = TimeSpan.FromMilliseconds(5) self._timer.Tick += self._execute self._timer.Start() def send(self, message, *args, **kwargs): ''' Sends provided message to all listeners. Message is only added to queue and will be processed on next tick. :param Message message: Message to send. ''' self._messages.put((message, args, kwargs), False) def subscribe(self, message, handler): ''' Adds hander for specified message. :param str message: Name of message to subscribe to. :param callable handler: Handler for this message type. Handler must receive single parameter and that parameter will be instance of sent message. ''' with self._lock: ref = WeakCallable(handler, self._on_collect) self._subscribers[message].append(ref) # TODO: Unsubscribing with WeakCallable does not work def unsubscribe(self, message, handler): ''' Removes handler from message listeners. :param str message: Name of message to unsubscribe handler from. :param callable handler: Callable that should be removed as handler for `message`. ''' with self._lock: self._subscribers[message].remove(WeakCallable(handler)) def _execute(self, sender, event_args): ''' Event handler for timer that processes all queued messages. ''' with self._lock: while not self._messages.empty(): msg, args, kwargs = self._messages.get(False) for subscriber in self._subscribers[msg]: try: subscriber(*args, **kwargs) except weakref.ReferenceError: # Reference to handler is lost and it is OK to silence it pass def _on_collect(self, ref): with self._lock: for msg in self._subscribers: if ref in self._subscribers[msg]: self._subscribers[msg].remove(ref) class Signal(object): '''Signal object for messaging. Can be used to connect directly to an object without specifying the message name. It works similarly to Qt Signals and Slots. ''' def __init__(self, name=None): ''' :param str name: Name of signal, for easier debuging. If not provided name of property to which signal is assigned to will be used if signal is creates in :class:`.ViewModel` class. ''' self._messanger = _Messenger.instance() def connect(self, handler): ''' Connects handler to this signal. ''' self._messanger.subscribe(self, handler) def disconnect(self, handler): ''' Disconnects handler from this singal. ''' self._messanger.unsubscribe(self, handler) def emit(self, *args, **kwargs): ''' Emits this signal. As result, all handlers will be invoked. ''' self._messanger.send(self, *args, **kwargs) def __str__(self): return 'signal {name}'.format(name=self.name) class notifiable(property): ''' Decorator that replaces @property decorator by adding raising property changed event when setter is invoked. Example of usage:: class MyViewModel(ViewModel): @notifiable def foo(self): return self._foo @foo.setter def foo(self, value): self._foo = value For simple properties without getter and setter function and with automatic event raising :class:`.Notifiable` can be used. Idea and initial code for this is taken from http://gui-at.blogspot.com/2009/11/inotifypropertychanged-in-ironpython.html ''' def __init__(self, getter): def newgetter(slf): try: return getter(slf) except AttributeError: return None super(notifiable, self).__init__(newgetter) def setter(self, setter): def newsetter(slf, newvalue): oldvalue = self.fget(slf) if oldvalue != newvalue: setter(slf, newvalue) slf.RaisePropertyChanged(setter.__name__) return property(fget=self.fget, fset=newsetter, fdel=self.fdel, doc=self.__doc__) _OCO = ObservableCollection[object] class List(_OCO): ''' ObservableCollection that can be used as ordinary python :class:`list`. ''' append = _OCO.Add count = _OCO.Count index = _OCO.IndexOf insert = _OCO.Insert remove = _OCO.Remove def extend(self, seq): for item in seq: return self.Add(item) def pop(self, index=None): if index: return self.RemoveAt(index) else: return self.RemoveAt(self.Count - 1) def __getitem__(self, y): return list(self)[y] class Notifiable(object): ''' Descriptor class that raises `PropertyChanged` event when new value is set. For this to work, this descriptor can only be used in classes that implements interface `INotifyPropertyChanged` Class is designed to work with subclasses of :class:`ViewModel` because this class implements `INotofyPropertyChanged` and adds metaclass that discovers names of variables for raising events. Example of usage:: class MyViewModel(ViewModel): my_property = NotifProperty() ''' def __init__(self, initial=None, name=None): ''' :param initial: Initial value of this property. :param name: Name of this property. If not provided and if this is used with :class:`.ViewModel`, name will be set automatically to name of property. ''' self.name = name self.initial = initial def __get__(self, obj, objtype=None): if obj is None: return self return getattr(obj, '__notifiable_%s' % self.name, self.initial) def __set__(self, obj, value): current = getattr(obj, '__notifiable_%s' % self.name, self.initial) if current != value: setattr(obj, '__notifiable_%s' % self.name, value) obj.RaisePropertyChanged(self.name) def __delete__(self, obj): if hasattr(obj, '__notifiable_%s' % self.name): delattr(obj, '__notifiable_%s' % self.name) class ViewModelMeta(type): ''' MetaClass that examines fields of new class and populates names of :class:`.NotifProperty` fields to names of variables. ''' def __new__(cls, name, bases, dct): super_new = super(ViewModelMeta, cls).__new__ for name, val in dct.items(): if isinstance(val, (Notifiable, Signal)): if not hasattr(val, 'name') or not val.name: val.name = name return super_new(cls, name, bases, dct) class ViewModel(object, INotifyPropertyChanged): ''' Base ViewModel class that all view-model classes should inherit from. ''' __metaclass__ = ViewModelMeta def __init__(self): self.property_chaged_handlers = [] self.messenger = _Messenger.instance() def RaisePropertyChanged(self, property_name): ''' Raises event that property value has changed for provided property name. :param str property_name: Name of property whose value has changed. ''' args = PropertyChangedEventArgs(property_name) for handler in self.property_chaged_handlers: handler(self, args) def add_PropertyChanged(self, handler): self.property_chaged_handlers.append(handler) def remove_PropertyChanged(self, handler): self.property_chaged_handlers.Remove(handler) class Command(ICommand): ''' Implementation of WPF command. ''' def __init__(self, execute, can_execute=None): self.execute = execute self.can_execute = can_execute self._can_execute_changed_handlers = [] def Execute(self, parameter): ''' Executes handler for this command. ''' self.execute() def add_CanExecuteChanged(self, handler): ''' Adds new listener to CanExecuteChanged event. ''' self._can_execute_changed_handlers.append(handler) def remove_CanExecuteChanged(self, handler): ''' Removes listener for CanExecuteChanged event. ''' self._can_execute_changed_handlers.remove(handler) def RaiseCanExecuteChanged(self): ''' Raises CanExecuteChanged event. ''' for handler in self._can_execute_changed_handlers: handler(self, EventArgs.Empty) def CanExecute(self, parameter): ''' Returns `True` if command can be executed, `False` otherwise. ''' if self.can_execute: return self.can_execute() return True class command(object): ''' Decorator to that turns method to command handler. Example of usage:: class MyClass(ViewModel): @command def command_handler(self): # do something pass @command_handler.can_execute def command_can_execute(self): # return True if command can execute, False otherwise return True ''' def __init__(self, handler, can_execute=None): ''' :param callable handler: Method that will be called when command executed. :param callable can_execute: Method that will be called when GUI needs information if command can be executed. If not provided, default implementation always returns `True`. ''' self._handler = handler self._can_execute = can_execute self._command = None def __get__(self, obj, objtype): if not self._handler: raise AttributeError('Unable to get field') if not self._command: self._command = Command(partial(self._handler, obj), partial(self._can_execute, obj) if self._can_execute else None) return self._command def can_execute(self, can_execute): ''' Decorator that adds function that determines if command can be executed. Decorated function should return `True` if command can be executed and false if it can not. ''' self._can_execute = can_execute
{ "repo_name": "delicb/mvvm", "path": "mvvm.py", "copies": "1", "size": "14540", "license": "bsd-2-clause", "hash": -8600873770774272000, "line_mean": 31.0264317181, "line_max": 99, "alpha_frac": 0.5988308116, "autogenerated": false, "ratio": 4.475223145583256, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.5574053957183256, "avg_score": null, "num_lines": null }
__author__ = 'Bojan Delic <bojan@delic.in.rs>' __date__ = 'Aug 23, 2013' __copyright__ = 'Copyright (c) 2013 Bojan Delic' import os import wpf from mvvm import ViewModel, Notifiable, command, notifiable, List from System.Windows import Application, Window class Person(ViewModel): name = Notifiable() age = Notifiable() def __init__(self, name, age): super(Person, self).__init__() self.name = name self.age = age # Every user ViewModel should inherit from ViewModel class MyViewModel(ViewModel): # creation of properties whose setters automatically # invokes PropertyChanged event. Initial value is optional. text1 = Notifiable('initial value') text2 = Notifiable() elements = Notifiable(List([Person('John', 23), Person('Phil', 33)])) @notifiable def text3(self): return 'Initial value for text3' # using decorator to turn method to subclass of ICommand interface @command def ClickCommand(self): self.text2 = 'This will show up after click' for person in self.elements[1:]: person.name = 'Bob' self.elements.append(Person('Sam', 12)) # Just creating window and adding DataContext, nothing special here class MyWindow(Window): def __init__(self): wpf.LoadComponent(self, os.path.join(os.path.dirname(__file__), 'example1.xaml')) self.DataContext = MyViewModel() if __name__ == '__main__': Application().Run(MyWindow())
{ "repo_name": "delicb/mvvm", "path": "examples/example1.py", "copies": "1", "size": "1488", "license": "bsd-2-clause", "hash": -7874532449419773000, "line_mean": 29.3673469388, "line_max": 89, "alpha_frac": 0.6552419355, "autogenerated": false, "ratio": 3.7293233082706765, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.48845652437706766, "avg_score": null, "num_lines": null }
__author__ = 'Bojan Delic <bojan@delic.in.rs>' __date__ = 'Aug 30, 2013' __copyright__ = 'Copyright (c) 2013 Bojan Delic' import os import wpf import time from threading import Thread from mvvm import ViewModel, Notifiable, command, notifiable, List from System.Windows import Application, Window class MyViewModel(ViewModel): text1 = Notifiable('always showing') text2 = Notifiable() def __init__(self): super(MyViewModel, self).__init__() # subscribe to message with id 'messageId' self.messenger.subscribe('messageId', self.on_message) # message handler - will be executed in GUI thread def on_message(self, content): self.text2 = content # Just creating window and adding DataContext, nothing special here class MyWindow(Window): def __init__(self): wpf.LoadComponent(self, os.path.join(os.path.dirname(__file__), 'message_example.xaml')) self.DataContext = MyViewModel() # thread that wats for 3 seconds and then sends message with content def threaded_function(messenger): time.sleep(3) messenger.send('messageId', 'This will show up in GUI') t = Thread(target=threaded_function, args=(self.DataContext.messenger,)) t.start() if __name__ == '__main__': Application().Run(MyWindow())
{ "repo_name": "delicb/mvvm", "path": "examples/message_example.py", "copies": "1", "size": "1342", "license": "bsd-2-clause", "hash": -5928662593609892000, "line_mean": 31.7317073171, "line_max": 96, "alpha_frac": 0.6602086438, "autogenerated": false, "ratio": 3.7486033519553073, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.9828677440550998, "avg_score": 0.01602691104086188, "num_lines": 41 }
__author__ = 'Bojan Delic <bojan@delic.in.rs>' __date__ = 'Sep 1, 2013' __copyright__ = 'Copyright (c) 2013 Bojan Delic' import os import wpf from mvvm import ViewModel, Signal, Notifiable, command from System.Windows import Window, Application class MyViewModel(ViewModel): text1 = Notifiable('always showing') text2 = Notifiable() # Creating signal by creating instance of class signal = Signal() def __init__(self): super(MyViewModel, self).__init__() # Subscribe to signal. This will probably be in different view model # in real application self.signal.connect(self.on_signal) # signal handler - it will be all parameters provided in `emit` method # of signal def on_signal(self, content): self.text2 = content @command def send_signal(self): # on some event - emit signal with provided parameters self.signal.emit('from signal') class MyWindow(Window): def __init__(self): wpf.LoadComponent(self, os.path.join(os.path.dirname(__file__), 'signals_example.xaml')) self.DataContext = MyViewModel() if __name__ == '__main__': Application().Run(MyWindow())
{ "repo_name": "delicb/mvvm", "path": "examples/signals_example.py", "copies": "1", "size": "1197", "license": "bsd-2-clause", "hash": 8433934176326417000, "line_mean": 27.5, "line_max": 96, "alpha_frac": 0.649122807, "autogenerated": false, "ratio": 3.7523510971786833, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.4901473904178683, "avg_score": null, "num_lines": null }
__author__ = "Bojan Delic <bojan@delic.in.rs>" __mail__ = "bojan@delic.in.rs" try: from PyQt4 import QtGui, QtCore except ImportError: from PySide import QtGui, QtCore from main_window import Ui_MainWindow class MainWindow(QtGui.QMainWindow): def __init__(self, *args, **kwargs): super(MainWindow, self).__init__(*args, **kwargs) self.ui = Ui_MainWindow() self.ui.setupUi(self) #self.setFixedSize(self.width(), self.height()) statusbar = self.statusBar() self.label = QtGui.QLabel('300') statusbar.addPermanentWidget(self.label) slider = QtGui.QSlider(QtCore.Qt.Horizontal, statusbar) slider.setMinimum(50) slider.setMaximum(1000) slider.setValue(300) statusbar.addPermanentWidget(slider) slider.valueChanged.connect(self.ui.board.update_timer) slider.valueChanged.connect(self.update_label) self.statusBar().showMessage("Ovo je Game of Life") self.from_survive = QtGui.QSpinBox(self.ui.toolBar) self.from_survive.setMaximum(6) self.from_survive.setMinimum(1) self.from_survive.setValue(2) self.ui.toolBar.addSeparator() self.ui.toolBar.addWidget(QtGui.QLabel('From survive: ')) self.ui.toolBar.addWidget(self.from_survive) self.to_survive = QtGui.QSpinBox(self.ui.toolBar) self.to_survive.setMaximum(7) self.to_survive.setMinimum(2) self.to_survive.setValue(3) self.ui.toolBar.addSeparator() self.ui.toolBar.addWidget(QtGui.QLabel('To survive: ')) self.ui.toolBar.addWidget(self.to_survive) self.come_to_life = QtGui.QSpinBox(self.ui.toolBar) self.come_to_life.setMaximum(7) self.come_to_life.setMinimum(2) self.come_to_life.setValue(3) self.ui.toolBar.addSeparator() self.ui.toolBar.addWidget(QtGui.QLabel('Come to life: ')) self.ui.toolBar.addWidget(self.come_to_life) self.from_survive.valueChanged.connect(self.ui.board.scene.matrix.set_from_survive) self.to_survive.valueChanged.connect(self.ui.board.scene.matrix.set_to_survive) self.come_to_life.valueChanged.connect(self.ui.board.scene.matrix.set_come_to_life) self.ui.board.scene.matrix.changed.connect(self.update_statusbar) self.ui.board.scene.matrix.reseted.connect(self.update_statusbar) def update_statusbar(self): self.ui.statusBar.showMessage('Live cells: %d' % len(self.ui.board.scene.matrix.get_live_cells())) def update_label(self, value): self.label.setText(str(value)) @QtCore.Slot() def on_actionSave_triggered(self): file_name = QtGui.QFileDialog.getSaveFileName(self) f = open(file_name, 'w') f.write(self.ui.board.scene.matrix.to_string()) @QtCore.Slot() def on_actionOpen_triggered(self): from gol import GOLMatrix f = QtGui.QFileDialog.getOpenFileName(self) self.ui.board.scene.set_matrix(GOLMatrix.from_string(open(f, 'r').read())) self.ui.board.scene.matrix.reseted.emit() if __name__ == '__main__': import sys app = QtGui.QApplication(sys.argv) main = MainWindow() main.show() sys.exit(app.exec_())
{ "repo_name": "delicb/GameOfLife", "path": "gol/main.py", "copies": "1", "size": "3293", "license": "mit", "hash": 6385673163610931000, "line_mean": 35.1868131868, "line_max": 91, "alpha_frac": 0.6532037656, "autogenerated": false, "ratio": 3.2668650793650795, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.9413947483655887, "avg_score": 0.0012242722618386766, "num_lines": 91 }
__author__ = "Bojan Delic <bojan@delic.in.rs>" __mail__ = "bojan@delic.in.rs" try: from PyQt4 import QtGui, QtCore from PyQt4.QtCore import Qt except ImportError: from PySide import QtGui, QtCore from PySide.QtCore import Qt class GOLMatrix(QtCore.QObject): # TODO: How to merge these two signals into one signal with parameter # overload (something like clicked() and clicked(bool)) changed = QtCore.Signal(dict) reseted = QtCore.Signal() def __init__(self): super(GOLMatrix, self).__init__() self.from_survive = 2 self.to_survive = 3 self.come_to_life = 3 self.cur_population = set() self.next_population = set() @QtCore.Slot(int) def set_from_survive(self, from_survive): self.from_survive = from_survive @QtCore.Slot(int) def set_to_survive(self, to_survive): self.to_survive = to_survive @QtCore.Slot(int) def set_come_to_life(self, come_to_life): self.come_to_life = come_to_life def is_alive(self, x, y): ''' Returns `True` if cell (x, y) is alive, `False` otherwise.''' return (x, y) in self.cur_population def set_alive(self, x, y): ''' Marks cell (x, y) as alive.''' if not self.is_alive(x, y): self.cur_population.add((x, y)) self.changed.emit({(x, y): True}) def set_dead(self, x, y): ''' Kills cell (x, y) ''' if self.is_alive(x, y): self.cur_population.remove((x, y)) self.changed.emit({(x, y): False}) def get_neighbours(self, x, y): ''' Returns all neighbors of cell (x, y).''' return ((x-1, y-1), (x, y-1), (x+1, y-1), (x+1, y), (x+1, y+1), (x, y+1), (x-1, y+1), (x-1, y)) def get_live_cells(self): ''' Returns all alive cells.''' return self.cur_population def count_live_neighbours(self, x, y): ''' Returns number of alive neighbors of cell (x, y). ''' return sum(map(lambda coord: self.is_alive(coord[0], coord[1]), self.get_neighbours(x, y))) def get_next_state(self, x, y): ''' Returns state of cell (x, y) for next iteration. Return `True` if cell should be alive, `False` otherwise.''' live_neighbours = self.count_live_neighbours(x, y) return ((self.is_alive(x, y) and self.from_survive <= live_neighbours <= self.to_survive) or (not self.is_alive(x, y) and live_neighbours == self.come_to_life)) def reset(self): self.cur_population = set() self.reseted.emit() def shrink_world(self): ''' Kills all cells that are not visible on canvas. Current implementation kill all cells that are not in (-3, -3, 53, 83), but this should be done in respect to visible area on screen. ''' def should_survive(cell): return cell[0] > -3 and cell[0] < 83 and cell[1] > -3 and cell[1] < 53 self.cur_population = set(filter(should_survive, self.cur_population)) def next_iteration(self): ''' Calculates state of next generation.. ''' # TODO: This should be optimized. For only a few hundred alive cells # show down ins visible. self.next_population = set() checked = set() # no need to check cell that are already checked # for every live cell check if its state should be changed or state # of its neighbors for live in self.get_live_cells(): for neighbour in self.get_neighbours(*live): if neighbour in checked: continue if not neighbour in self.next_population and self.get_next_state(*neighbour): self.next_population.add(neighbour) checked.add(neighbour) self.cur_population, self.next_population = self.next_population, self.cur_population self.shrink_world() self.reseted.emit() def to_string(self): # TODO: Remember `from_survive`, `to_survive` and `come_to_life` import pprint return pprint.pformat(self.get_live_cells()) @classmethod def from_string(cls, s): m = GOLMatrix() m.cur_population = eval(s) return m class Cell(QtGui.QGraphicsItem): def __init__(self, *args, **kwargs): self.size = kwargs.pop('size') super(Cell, self).__init__(*args, **kwargs) def boundingRect(self): return QtCore.QRectF(0, 0, self.size, self.size) def shape(self): path = QtGui.QPainterPath() path.addRect(self.boundingRect()) return path def paint(self, painter, options, widget): painter.setBrush(Qt.black) # TODO: Better way to determine offset? painter.drawEllipse(3, 3, self.size - 6, self.size - 6) class Board(QtGui.QGraphicsScene): def __init__(self, *args, **kwargs): self.border_width = kwargs.pop('border_width') self.square_size = kwargs.pop('square_size') super(Board, self).__init__(*args, **kwargs) self.set_matrix(GOLMatrix()) def set_matrix(self, matrix): self.matrix = matrix self.matrix.reseted.connect(self.redo_all) self.matrix.changed.connect(self.redo_part) @QtCore.Slot(dict) def redo_part(self, part): for (x, y), value in part.items(): if value: self.add_cell(x, y) else: self.remove_cell(x, y) @QtCore.Slot() def redo_all(self): ''' Redraws scene. ''' self.clear() for x, y in self.matrix.get_live_cells(): self.add_cell(x, y) def next_iteration(self): ''' Requests form matrix to calculate next iteration.''' self.matrix.next_iteration() def reset(self): ''' Resets state (kills all cells)''' self.matrix.reset() def get_postion(self, x, y): ''' Returns position of cell (x, y) in scene coordinate system.''' return QtCore.QPointF(x*self.square_size+self.border_width, y*self.square_size+self.border_width) def add_cell(self, x, y): ''' Adds cell to (x, y) coordinates.''' item = Cell(size=self.square_size) item.setPos(self.get_postion(x, y)) self.addItem(item) def remove_cell(self, x, y): ''' Removes cell from (x, y) coordinates.''' self.removeItem(self.itemAt(self.get_postion(x, y))) class BoardView(QtGui.QGraphicsView): def __init__(self, *args, **kwargs): super(BoardView, self).__init__(*args, **kwargs) self.setCacheMode(self.CacheBackground) #self.setViewportUpdateMode(self.BoundingRectViewportUpdate) self.setRenderHint(QtGui.QPainter.Antialiasing) # TODO: Take this from settings self.square_size = 20 self.border_width = 5 # Start from top left corner self.setAlignment(Qt.AlignLeft | Qt.AlignTop) # No need for scroll bar self.setVerticalScrollBarPolicy(Qt.ScrollBarAlwaysOff) self.setHorizontalScrollBarPolicy(Qt.ScrollBarAlwaysOff) self.scene = Board(self, square_size=self.square_size, border_width=self.border_width) self.setScene(self.scene) self.timer = QtCore.QTimer(self) self.timer.setInterval(300) self.timer.timeout.connect(self.scene.next_iteration) def mousePressEvent(self, event): pos = self.mapToScene(event.pos()) item = self.scene.itemAt(pos) x = int((pos.x() - self.border_width) / self.square_size) y = int((pos.y() - self.border_width) / self.square_size) if item: self.scene.matrix.set_dead(x, y) else: self.scene.matrix.set_alive(x, y) super(BoardView, self).mousePressEvent(event) def drawBackground(self, painter, rect): ''' Background drawing. ''' painter.setPen(Qt.DotLine) # vertical lines for i in xrange(int(rect.left() + self.border_width), int(rect.right() - self.border_width), self.square_size): painter.drawLine(i, rect.bottom() + self.border_width, i, rect.top() - self.border_width) # horizontal lines for i in xrange(int(rect.top() + self.border_width), int(rect.bottom() - self.border_width), self.square_size): painter.drawLine(rect.left() + self.border_width, i, rect.right() - self.border_width, i) painter.setPen(QtGui.QPen(Qt.black, self.border_width, Qt.SolidLine, Qt.RoundCap, Qt.RoundJoin)) border = QtCore.QRectF(rect.left() + self.border_width, rect.top() + self.border_width, rect.width() - 2*self.border_width, rect.height() - 2*self.border_width) painter.drawRect(border) def resizeEvent(self, event): # Fixes start of coordinate system to top-left corner of view self.setSceneRect(QtCore.QRectF(0, 0, self.width(), self.height())) super(BoardView, self).resizeEvent(event) def update_timer(self, value): self.timer.setInterval(value) def start(self): self.timer.start() def stop(self): self.timer.stop() def reset(self): self.stop() self.scene.reset()
{ "repo_name": "delicb/GameOfLife", "path": "gol/gol.py", "copies": "1", "size": "9519", "license": "mit", "hash": -2777308220168581600, "line_mean": 34.1254612546, "line_max": 100, "alpha_frac": 0.5812585356, "autogenerated": false, "ratio": 3.547894148341409, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.4629152683941409, "avg_score": null, "num_lines": null }
__author__ = 'Bojan Delic <bojan@delic.in.rs>' __date__ = '02 January 2013' __copyright__ = 'Copyright (c) 2013 Bojan Delic' from samovar.commander import BaseCommand from ._parsing import HgStyle, HgLexer, PARSERS class Command(BaseCommand): '''Performs hg diff command on repositories. Note that using --rev or --change options does not make sense without --repo option, because every repository has different changesets. But these options can be useful if used with tag that are present in every repository. ''' option_list = BaseCommand.option_list + ( ('r, rev', {'action': 'store', 'dest': 'revision', 'help': 'Revision.'}), ('c, change', {'action': 'store', 'help': 'Change made by revision.'}), ('a, text', {'action': 'store_true', 'help': 'Treat all files as text.'}), ('g, git', {'action': 'store_true', 'help': 'Use git extended diff format.'}), ('p, show-function', {'action': 'store_true', 'help': 'Show which function each change is in.'}), ('reverse', {'action': 'store_true', 'help': 'Produce diff that undoes the changes.'}), ('w, ignore-all-space', {'action': 'store_true', 'help': 'Ignore white space when comparing lines'}), ('b, ignore-space-change', {'action': 'store_true', 'help': 'Ignore changes in amount of white space.'}), ('B, ignore-blank-lines', {'action': 'store_true', 'help': 'Ignore changes whose lines are all blank.'}), ('stat', {'action': 'store_true', 'help': 'Output diffstat-style summary of changes.'}), ('U, unified', { 'action' : 'store', 'type' : int, 'dest' : 'unified', 'default' : -1, 'help' : 'Number of lines of context to show.' }), ) Style = HgStyle Lexer = HgLexer LexerConfig = { 'parse' : True, 'parser' : PARSERS['diff'], 'indent' : 0, } def handle(self, *args, **kwargs): for repo in self.config.repositories: status, output, error = repo.diff(**kwargs) self.ui.report(repo, status, {'output': output, 'error': error})
{ "repo_name": "alefnula/samovar", "path": "src/samovar/commands/scm/diff.py", "copies": "1", "size": "2318", "license": "bsd-3-clause", "hash": -388216031497156700, "line_mean": 46.2916666667, "line_max": 114, "alpha_frac": 0.5405522002, "autogenerated": false, "ratio": 3.889261744966443, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.9882306142343241, "avg_score": 0.009501560564640408, "num_lines": 48 }
__author__ = 'Bojan Delic <bojan@delic.in.rs>' __date__ = '02 January 2013' __copyright__ = 'Copyright (c) 2013 Bojan Delic' try: import urlparse except ImportError: import urllib.parse as urlparse from samovar.commander import BaseCommand from tea.utils.crypto import encrypt class Command(BaseCommand): ''' Manages repository credentials. Usage: credentials set credentials list ''' def handle(self, *args, **kwargs): if len(args) == 1 and args[0] == 'set': url = self.ui.ask('Url: ') parsed = urlparse.urlparse(url) url = parsed.netloc if parsed.netloc else parsed.path username = self.ui.ask('Username: ') password = encrypt(self.ui.ask('Password: ', True)) data = { 'url': url, 'username': username, 'password': password, } current_creds = self.config.get(self.id, None) if current_creds: for i, cred in enumerate(current_creds): if cred['url'] == url: self.config.delete('%s.%s' % (self.id, i)) else: self.config.set(self.id, []) self.config.insert(self.id, data) elif len(args) == 1 and args[0] == 'list': for cred in self.config.get(self.id, []): self.ui.info('%s -> %s' % (cred['url'], cred['username'])) else: self.print_usage()
{ "repo_name": "alefnula/samovar", "path": "src/samovar/commands/repo/credentials.py", "copies": "1", "size": "1588", "license": "bsd-3-clause", "hash": -3281368595331230000, "line_mean": 29.137254902, "line_max": 74, "alpha_frac": 0.4981108312, "autogenerated": false, "ratio": 4.082262210796915, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 1, "avg_score": 0.001916683826193256, "num_lines": 51 }
import collections import sys from astropy.coordinates import SkyCoord from astropy import units as u from processing_components.calibration.operations import apply_gaintable, create_gaintable_from_blockvisibility, qa_gaintable from processing_components.visibility.base import create_visibility, copy_visibility from data_models.memory_data_models import ReceptorFrame from processing_components.image.deconvolution import deconvolve_cube, restore_cube from processing_components.imaging.base import create_image_from_visibility, predict_2d, invert_2d from processing_components.imaging.base import advise_wide_field from processing_components.simulation.testing_support import create_test_image, create_low_test_image_from_gleam, simulate_gaintable from processing_components.simulation.configurations import create_named_configuration from data_models.polarisation import PolarisationFrame from processing_components.visibility.base import create_blockvisibility from workflows.serial.imaging.imaging_serial import invert_list_serial_workflow, predict_list_serial_workflow from processing_components.image.operations import qa_image from processing_components.visibility.coalesce import convert_visibility_to_blockvisibility, convert_blockvisibility_to_visibility from processing_components.calibration.calibration import solve_gaintable from workflows.serial.pipelines.pipeline_serial import ical_list_serial_workflow from data_models.data_model_helpers import export_image_to_hdf5 from src.arlwrap_support import * import logging import os results_dir = './results' os.makedirs(results_dir, exist_ok=True) log = logging.getLogger() log.setLevel(logging.INFO) log.addHandler(logging.StreamHandler(sys.stdout)) arl_error = 0 def handle_error(*args): global arl_error if(args[0] != ""): arl_error = -1 print(args[0],"\n",args[1],"\n",args[2]) ff.cdef(""" typedef struct { size_t nvis; int npol; void *data; char *phasecentre; } ARLVis; """) ff.cdef(""" typedef struct { size_t nrows; void *data; } ARLGt; """) ff.cdef(""" typedef struct { char *confname; double pc_ra; double pc_dec; double *times; int ntimes; double *freqs; int nfreqs; double *channel_bandwidth; int nchanwidth; int nbases; int nant; int npol; int nrec; double rmax; char *polframe; } ARLConf; """) ff.cdef(""" typedef struct { int vis_slices; int npixel; double cellsize; double guard_band_image; double delA; int wprojection_planes; } ARLadvice ; """) #@ff.callback("void (*)(const ARLVis *, ARLVis *, bool)") #def arl_copy_visibility_ffi(visin, visout, zero): # """ # Wrap of arl.visibility.base.copy_visibility # """ # # Extra comments becasue this is an example. # # # # Convert the input visibilities into the ARL structure # nvisin=cARLVis(visin) # # # Call the ARL function # tvis=copy_visibility(nvisin, zero=zero) # # # Copy the result into the output buffer # visout.npol=visin.npol # visout.nvis=visin.nvis # nvisout=cARLVis(visout) # numpy.copyto(nvisout, tvis) # # #arl_copy_visibility=collections.namedtuple("FFIX", "address") #arl_copy_visibility.address=int(ff.cast("size_t", arl_copy_visibility_ffi)) @ff.callback("int (*)()") def arl_handle_error_ffi(): global arl_error return arl_error arl_handle_error=collections.namedtuple("FFIX", "address") arl_handle_error.address=int(ff.cast("size_t", arl_handle_error_ffi)) @ff.callback("void (*)(ARLConf *, const ARLVis *, ARLVis *, int)", onerror=handle_error) def arl_copy_visibility_ffi(lowconfig, vis_in, vis_out, zero_in): # Convert the input blockvisibilities into the ARL structure if zero_in == 0: zero = True else: zero = False # Create configuration object lowcore_name = str(ff.string(lowconfig.confname), 'utf-8') lowcore = create_named_configuration(lowcore_name, rmax=lowconfig.rmax) # Re-create input blockvisibility object times = numpy.frombuffer(ff.buffer(lowconfig.times, 8*lowconfig.ntimes), dtype='f8', count=lowconfig.ntimes) frequency = numpy.frombuffer(ff.buffer(lowconfig.freqs, 8*lowconfig.nfreqs), dtype='f8', count=lowconfig.nfreqs) channel_bandwidth = numpy.frombuffer(ff.buffer(lowconfig.channel_bandwidth, 8*lowconfig.nchanwidth), dtype='f8', count=lowconfig.nchanwidth) c_visin = cARLVis(vis_in) py_visin = helper_create_blockvisibility_object(c_visin, frequency, channel_bandwidth, lowcore) py_visin.phasecentre = load_phasecentre(vis_in.phasecentre) py_visin.configuration = lowcore polframe = str(ff.string(lowconfig.polframe), 'utf-8') py_visin.polarisation_frame = PolarisationFrame(polframe) # Call the ARL function py_visout=copy_visibility(py_visin, zero=zero) # Copy the result into the output buffer vis_out.npol=vis_in.npol vis_out.nvis=vis_in.nvis py_vis_out = cARLVis(vis_out) numpy.copyto(py_vis_out, py_visout.data) store_phasecentre(vis_out.phasecentre, py_visin.phasecentre) arl_copy_visibility=collections.namedtuple("FFIX", "address") arl_copy_visibility.address=int(ff.cast("size_t", arl_copy_visibility_ffi)) @ff.callback("void (*)(ARLConf *, const ARLVis *, ARLVis *, int)", onerror=handle_error) def arl_copy_blockvisibility_ffi(lowconfig, blockvis_in, blockvis_out, zero_in): # Convert the input blockvisibilities into the ARL structure if zero_in == 0: zero = True else: zero = False # Create configuration object lowcore_name = str(ff.string(lowconfig.confname), 'utf-8') lowcore = create_named_configuration(lowcore_name, rmax=lowconfig.rmax) # Re-create input blockvisibility object times = numpy.frombuffer(ff.buffer(lowconfig.times, 8*lowconfig.ntimes), dtype='f8', count=lowconfig.ntimes) frequency = numpy.frombuffer(ff.buffer(lowconfig.freqs, 8*lowconfig.nfreqs), dtype='f8', count=lowconfig.nfreqs) channel_bandwidth = numpy.frombuffer(ff.buffer(lowconfig.channel_bandwidth, 8*lowconfig.nchanwidth), dtype='f8', count=lowconfig.nchanwidth) c_blockvisin = cARLBlockVis(blockvis_in, lowconfig.nant, lowconfig.nfreqs) py_blockvisin = helper_create_blockvisibility_object(c_blockvisin, frequency, channel_bandwidth, lowcore) py_blockvisin.phasecentre = load_phasecentre(blockvis_in.phasecentre) py_blockvisin.configuration = lowcore polframe = str(ff.string(lowconfig.polframe), 'utf-8') py_blockvisin.polarisation_frame = PolarisationFrame(polframe) # Call the ARL function py_blockvisout=copy_visibility(py_blockvisin, zero=zero) # Copy the result into the output buffer blockvis_out.npol=blockvis_in.npol blockvis_out.nvis=blockvis_in.nvis py_blockvis_out = cARLBlockVis(blockvis_out, lowconfig.nant, lowconfig.nfreqs) numpy.copyto(py_blockvis_out, py_blockvisout.data) store_phasecentre(blockvis_out.phasecentre, py_blockvisin.phasecentre) arl_copy_blockvisibility=collections.namedtuple("FFIX", "address") arl_copy_blockvisibility.address=int(ff.cast("size_t", arl_copy_blockvisibility_ffi)) @ff.callback("void (*)(ARLConf *, ARLVis *)", onerror=handle_error) def arl_set_visibility_data_to_zero_ffi(lowconfig, vis_in): lowcore_name = str(ff.string(lowconfig.confname), 'utf-8') lowcore = create_named_configuration(lowcore_name, rmax=lowconfig.rmax) times = numpy.frombuffer(ff.buffer(lowconfig.times, 8*lowconfig.ntimes), dtype='f8', count=lowconfig.ntimes) frequency = numpy.frombuffer(ff.buffer(lowconfig.freqs, 8*lowconfig.nfreqs), dtype='f8', count=lowconfig.nfreqs) channel_bandwidth = numpy.frombuffer(ff.buffer(lowconfig.channel_bandwidth, 8*lowconfig.nchanwidth), dtype='f8', count=lowconfig.nchanwidth) c_visin = cARLVis(vis_in) py_visin = helper_create_visibility_object(c_visin) py_visin.phasecentre = load_phasecentre(vis_in.phasecentre) py_visin.configuration = lowcore polframe = str(ff.string(lowconfig.polframe), 'utf-8') py_visin.polarisation_frame = PolarisationFrame(polframe) py_visin.data['vis'][...] = 0.0 arl_set_visibility_data_to_zero=collections.namedtuple("FFIX", "address") arl_set_visibility_data_to_zero.address=int(ff.cast("size_t", arl_set_visibility_data_to_zero_ffi)) @ff.callback("void (*)(ARLConf *, const ARLVis *, const ARLVis *, ARLVis *, int)", onerror=handle_error) def arl_manipulate_visibility_data_ffi(lowconfig, vis1_in, vis2_in, vis_out, operation): lowcore_name = str(ff.string(lowconfig.confname), 'utf-8') lowcore = create_named_configuration(lowcore_name, rmax=lowconfig.rmax) times = numpy.frombuffer(ff.buffer(lowconfig.times, 8*lowconfig.ntimes), dtype='f8', count=lowconfig.ntimes) frequency = numpy.frombuffer(ff.buffer(lowconfig.freqs, 8*lowconfig.nfreqs), dtype='f8', count=lowconfig.nfreqs) channel_bandwidth = numpy.frombuffer(ff.buffer(lowconfig.channel_bandwidth, 8*lowconfig.nchanwidth), dtype='f8', count=lowconfig.nchanwidth) c_vis1in = cARLVis(vis1_in) py_vis1in = helper_create_visibility_object(c_vis1in) py_vis1in.phasecentre = load_phasecentre(vis1_in.phasecentre) py_vis1in.configuration = lowcore polframe = str(ff.string(lowconfig.polframe), 'utf-8') py_vis1in.polarisation_frame = PolarisationFrame(polframe) c_vis2in = cARLVis(vis2_in) py_vis2in = helper_create_visibility_object(c_vis2in) py_vis2in.phasecentre = load_phasecentre(vis2_in.phasecentre) py_vis2in.configuration = lowcore polframe = str(ff.string(lowconfig.polframe), 'utf-8') py_vis2in.polarisation_frame = PolarisationFrame(polframe) c_visout = cARLVis(vis_out) py_visout = helper_create_visibility_object(c_visout) py_visout.phasecentre = load_phasecentre(vis_out.phasecentre) py_visout.configuration = lowcore polframe = str(ff.string(lowconfig.polframe), 'utf-8') py_visout.polarisation_frame = PolarisationFrame(polframe) print("arl_manipulate_visibility_data opcode: ", operation) if operation == 0: # Add print("arl_manipulate_visibility_data: adding") py_visout.data['vis'] = py_vis1in.data['vis'] + py_vis2in.data['vis'] elif operation == 1: # Subtract print("arl_manipulate_visibility_data: subtracting") py_visout.data['vis'] = py_vis1in.data['vis'] - py_vis2in.data['vis'] elif operation == 2: # Multiply print("arl_manipulate_visibility_data: multiplying") py_visout.data['vis'] = py_vis1in.data['vis'] * py_vis2in.data['vis'] elif operation == 3: # Divide print("arl_manipulate_visibility_data: dividing") py_visout.data['vis'] = py_vis1in.data['vis'] / py_vis2in.data['vis'] else: py_visout.data['vis'][...] = 0.0 print("arl_manipulate_visibility_data np.sum(vis.data): ", numpy.sum(py_visout.data['vis']), numpy.sum(py_vis1in.data['vis']), numpy.sum(py_vis2in.data['vis'])) arl_manipulate_visibility_data=collections.namedtuple("FFIX", "address") arl_manipulate_visibility_data.address=int(ff.cast("size_t", arl_manipulate_visibility_data_ffi)) ff.cdef(""" typedef struct { size_t size; int data_shape[4]; void *data; char *wcs; char *polarisation_frame; } Image; """) @ff.callback("void (*)(Image*, Image*)") def arl_add_to_model_ffi(model, res): c_model = cImage(model) c_res = cImage(res) c_model.data += c_res.data arl_add_to_model=collections.namedtuple("FFIX", "address") arl_add_to_model.address=int(ff.cast("size_t", arl_add_to_model_ffi)) @ff.callback("void (*)(ARLConf *, ARLVis *)", onerror=handle_error) def arl_create_visibility_ffi(lowconfig, c_res_vis): lowcore_name = str(ff.string(lowconfig.confname), 'utf-8') # Temp fix for ffi_demo if lowconfig.rmax < 1.0e-5 : lowcore = create_named_configuration(lowcore_name) else: lowcore = create_named_configuration(lowcore_name, rmax=lowconfig.rmax) times = numpy.frombuffer(ff.buffer(lowconfig.times, 8*lowconfig.ntimes), dtype='f8', count=lowconfig.ntimes) frequency = numpy.frombuffer(ff.buffer(lowconfig.freqs, 8*lowconfig.nfreqs), dtype='f8', count=lowconfig.nfreqs) channel_bandwidth = numpy.frombuffer(ff.buffer(lowconfig.channel_bandwidth, 8*lowconfig.nchanwidth), dtype='f8', count=lowconfig.nchanwidth) print(lowcore_name) print("Times: ", times) print("Freqs: ", frequency) print("BW : ", channel_bandwidth) print("PCentre: ", lowconfig.pc_ra, lowconfig.pc_dec) phasecentre = SkyCoord(ra=lowconfig.pc_ra * u.deg, dec=lowconfig.pc_dec*u.deg, frame='icrs', equinox='J2000') polframe = str(ff.string(lowconfig.polframe), 'utf-8') vt = create_visibility(lowcore, times, frequency, channel_bandwidth=channel_bandwidth, weight=1.0, phasecentre=phasecentre, polarisation_frame=PolarisationFrame(polframe)) py_res_vis = cARLVis(c_res_vis) numpy.copyto(py_res_vis, vt.data) store_phasecentre(c_res_vis.phasecentre, phasecentre) arl_create_visibility=collections.namedtuple("FFIX", "address") arl_create_visibility.address=int(ff.cast("size_t", arl_create_visibility_ffi)) @ff.callback("void (*)(ARLConf *, ARLVis *)", onerror=handle_error) def arl_create_blockvisibility_ffi(lowconfig, c_res_vis): lowcore_name = str(ff.string(lowconfig.confname), 'utf-8') print(lowconfig.rmax) lowcore = create_named_configuration(lowcore_name, rmax=lowconfig.rmax) times = numpy.frombuffer(ff.buffer(lowconfig.times, 8*lowconfig.ntimes), dtype='f8', count=lowconfig.ntimes) frequency = numpy.frombuffer(ff.buffer(lowconfig.freqs, 8*lowconfig.nfreqs), dtype='f8', count=lowconfig.nfreqs) channel_bandwidth = numpy.frombuffer(ff.buffer(lowconfig.channel_bandwidth, 8*lowconfig.nchanwidth), dtype='f8', count=lowconfig.nchanwidth) print(lowcore_name) print("Times: ", times) print("Freqs: ", frequency) print("BW : ", channel_bandwidth) print("PCentre: ", lowconfig.pc_ra, lowconfig.pc_dec) phasecentre = SkyCoord(ra=lowconfig.pc_ra * u.deg, dec=lowconfig.pc_dec*u.deg, frame='icrs', equinox='J2000') polframe = str(ff.string(lowconfig.polframe), 'utf-8') print("Polarisation frame: ", polframe) vt = create_blockvisibility(lowcore, times, frequency=frequency, channel_bandwidth=channel_bandwidth, weight=1.0, phasecentre=phasecentre, polarisation_frame=PolarisationFrame(polframe)) py_res_vis = cARLBlockVis(c_res_vis, lowconfig.nant, lowconfig.nfreqs) numpy.copyto(py_res_vis, vt.data) store_phasecentre(c_res_vis.phasecentre, phasecentre) receptor_frame = ReceptorFrame(vt.polarisation_frame.type) lowconfig.nrec = receptor_frame.nrec arl_create_blockvisibility=collections.namedtuple("FFIX", "address") arl_create_blockvisibility.address=int(ff.cast("size_t", arl_create_blockvisibility_ffi)) @ff.callback("void (*)(ARLConf *, const ARLVis *, const ARLVis *, long long int *, ARLVis *)", onerror=handle_error) def arl_convert_visibility_to_blockvisibility_ffi(lowconfig, vis_in, blockvis_in, cindex_in, blockvis_out): lowcore_name = str(ff.string(lowconfig.confname), 'utf-8') lowcore = create_named_configuration(lowcore_name, rmax=lowconfig.rmax) times = numpy.frombuffer(ff.buffer(lowconfig.times, 8*lowconfig.ntimes), dtype='f8', count=lowconfig.ntimes) frequency = numpy.frombuffer(ff.buffer(lowconfig.freqs, 8*lowconfig.nfreqs), dtype='f8', count=lowconfig.nfreqs) channel_bandwidth = numpy.frombuffer(ff.buffer(lowconfig.channel_bandwidth, 8*lowconfig.nchanwidth), dtype='f8', count=lowconfig.nchanwidth) cindex_size = lowconfig.nant*lowconfig.nant*lowconfig.nfreqs*lowconfig.ntimes py_cindex = numpy.frombuffer(ff.buffer(cindex_in, 8*cindex_size), dtype='int', count=cindex_size) c_visin = cARLVis(vis_in) py_visin = helper_create_visibility_object(c_visin) py_visin.phasecentre = load_phasecentre(vis_in.phasecentre) py_visin.configuration = lowcore py_visin.cindex = py_cindex polframe = str(ff.string(lowconfig.polframe), 'utf-8') py_visin.polarisation_frame = PolarisationFrame(polframe) c_blockvisin = cARLBlockVis(blockvis_in, lowconfig.nant, lowconfig.nfreqs) py_blockvisin = helper_create_blockvisibility_object(c_blockvisin, frequency, channel_bandwidth, lowcore) py_blockvisin.phasecentre = load_phasecentre(blockvis_in.phasecentre) py_blockvisin.configuration = lowcore py_blockvisin.polarisation_frame = PolarisationFrame(polframe) py_visin.blockvis = py_blockvisin py_blockvisout = convert_visibility_to_blockvisibility(py_visin) print("convert_visibility_to_blockvisibility np.sum(block_vis.data): ", numpy.sum(py_blockvisout.data['vis'])) py_blockvis_out = cARLBlockVis(blockvis_out, lowconfig.nant, lowconfig.nfreqs) numpy.copyto(py_blockvis_out, py_blockvisout.data) store_phasecentre(blockvis_out.phasecentre, py_blockvisin.phasecentre) arl_convert_visibility_to_blockvisibility=collections.namedtuple("FFIX", "address") arl_convert_visibility_to_blockvisibility.address=int(ff.cast("size_t", arl_convert_visibility_to_blockvisibility_ffi)) @ff.callback("void (*)(ARLConf *, const ARLVis *, ARLVis *, long long int *, ARLVis *)", onerror=handle_error) def arl_convert_blockvisibility_to_visibility_ffi(lowconfig, blockvis_in, vis_out, cindex_out, blockvis_out): # Create configuration object lowcore_name = str(ff.string(lowconfig.confname), 'utf-8') lowcore = create_named_configuration(lowcore_name, rmax=lowconfig.rmax) # Link cindex memory objects cindex_size = lowconfig.nant*lowconfig.nant*lowconfig.nfreqs*lowconfig.ntimes py_cindex = numpy.frombuffer(ff.buffer(cindex_out, 8*cindex_size), dtype='int', count=cindex_size) # Re-create input blockvisibility object times = numpy.frombuffer(ff.buffer(lowconfig.times, 8*lowconfig.ntimes), dtype='f8', count=lowconfig.ntimes) frequency = numpy.frombuffer(ff.buffer(lowconfig.freqs, 8*lowconfig.nfreqs), dtype='f8', count=lowconfig.nfreqs) channel_bandwidth = numpy.frombuffer(ff.buffer(lowconfig.channel_bandwidth, 8*lowconfig.nchanwidth), dtype='f8', count=lowconfig.nchanwidth) c_blockvisin = cARLBlockVis(blockvis_in, lowconfig.nant, lowconfig.nfreqs) py_blockvisin = helper_create_blockvisibility_object(c_blockvisin, frequency, channel_bandwidth, lowcore) py_blockvisin.phasecentre = load_phasecentre(blockvis_in.phasecentre) py_blockvisin.configuration = lowcore polframe = str(ff.string(lowconfig.polframe), 'utf-8') py_blockvisin.polarisation_frame = PolarisationFrame(polframe) # Call arl.coalesce::convert_blockvisibility_to_visibility() vis = convert_blockvisibility_to_visibility(py_blockvisin) # Copy vis.data to C visibility vis_out.data py_vis = cARLVis(vis_out) numpy.copyto(py_vis, vis.data) store_phasecentre(vis_out.phasecentre, py_blockvisin.phasecentre) # Copy vis.blockvis.data to C blockvisibility blockvis_out.data py_blockvis_out = cARLBlockVis(blockvis_out, lowconfig.nant, lowconfig.nfreqs) numpy.copyto(py_blockvis_out, vis.blockvis.data) # Copy vis.cindex to cindex_out numpy.copyto(py_cindex, vis.cindex) print("convert_blockvisibility_to_visibility np.sum(vis.data): ", numpy.sum(vis.data['vis'])) arl_convert_blockvisibility_to_visibility=collections.namedtuple("FFIX", "address") arl_convert_blockvisibility_to_visibility.address=int(ff.cast("size_t", arl_convert_blockvisibility_to_visibility_ffi)) @ff.callback("void (*)(ARLConf *, const ARLVis *, ARLGt *)", onerror=handle_error) def arl_create_gaintable_from_blockvisibility_ffi(lowconfig, blockvis_in, gt_out): lowcore_name = str(ff.string(lowconfig.confname), 'utf-8') lowcore = create_named_configuration(lowcore_name, rmax=lowconfig.rmax) times = numpy.frombuffer(ff.buffer(lowconfig.times, 8*lowconfig.ntimes), dtype='f8', count=lowconfig.ntimes) frequency = numpy.frombuffer(ff.buffer(lowconfig.freqs, 8*lowconfig.nfreqs), dtype='f8', count=lowconfig.nfreqs) channel_bandwidth = numpy.frombuffer(ff.buffer(lowconfig.channel_bandwidth, 8*lowconfig.nchanwidth), dtype='f8', count=lowconfig.nchanwidth) c_blockvisin = cARLBlockVis(blockvis_in, lowconfig.nant, lowconfig.nfreqs) py_blockvisin = helper_create_blockvisibility_object(c_blockvisin, frequency, channel_bandwidth, lowcore) py_blockvisin.phasecentre = load_phasecentre(blockvis_in.phasecentre) py_blockvisin.configuration = lowcore polframe = str(ff.string(lowconfig.polframe), 'utf-8') py_blockvisin.polarisation_frame = PolarisationFrame(polframe) py_gt = create_gaintable_from_blockvisibility(py_blockvisin) # print("create_gaintable_from_blockvisibility np.sum(gt.data): ", numpy.sum(py_gt.data['gain'])) # print(py_gt.data['gain'].shape, py_gt.data['weight'].shape, py_gt.data['residual'].shape, py_gt.data['time'].shape) # print(py_gt.data.size, py_gt.data.itemsize) # print(py_gt.frequency.size) # print("create_gaintable_from_blockvisibility: ", py_gt.receptor_frame.nrec) # receptor_frame = ReceptorFrame(py_blockvisin.polarisation_frame.type) # pframe1 = PolarisationFrame(polframe) # recframe1 = ReceptorFrame(pframe1.type) # print(receptor_frame.nrec, recframe1.nrec, lowcore.receptor_frame.nrec) c_gt_out = cARLGt(gt_out, lowconfig.nant, lowconfig.nfreqs, lowconfig.nrec) numpy.copyto(c_gt_out, py_gt.data) arl_create_gaintable_from_blockvisibility=collections.namedtuple("FFIX", "address") arl_create_gaintable_from_blockvisibility.address=int(ff.cast("size_t", arl_create_gaintable_from_blockvisibility_ffi)) @ff.callback("void (*)(ARLConf *, ARLGt *)", onerror=handle_error) def arl_simulate_gaintable_ffi(lowconfig, gt): lowcore_name = str(ff.string(lowconfig.confname), 'utf-8') lowcore = create_named_configuration(lowcore_name, rmax=lowconfig.rmax) times = numpy.frombuffer(ff.buffer(lowconfig.times, 8*lowconfig.ntimes), dtype='f8', count=lowconfig.ntimes) frequency = numpy.frombuffer(ff.buffer(lowconfig.freqs, 8*lowconfig.nfreqs), dtype='f8', count=lowconfig.nfreqs) polframe = str(ff.string(lowconfig.polframe), 'utf-8') polarisation_frame = PolarisationFrame(polframe) receptor_frame = ReceptorFrame(polarisation_frame.type) # print(lowconfig.polframe, lowconfig.nrec, receptor_frame.nrec) c_gt = cARLGt(gt, lowconfig.nant, lowconfig.nfreqs, lowconfig.nrec) py_gt = helper_create_gaintable_object(c_gt, frequency, receptor_frame) py_gt.receptor_frame = receptor_frame # print() # print(py_gt.__dict__) # print("simulate_gaintable 1 nrec: ", py_gt.receptor_frame.nrec) # print(py_gt.data['gain'].shape, py_gt.data['weight'].shape, py_gt.data['residual'].shape, py_gt.data['time'].shape) py_gt = simulate_gaintable(py_gt, phase_error = 1.0) # py_gt = simulate_gaintable(py_gt, phase_error = 0.0) # print("simulate_gaintable np.sum(gt.data): ", numpy.sum(py_gt.data['gain'])) # print("simulate_gaintable 2 nrec: ", py_gt.receptor_frame.nrec) # print(py_gt.data['gain'].shape, py_gt.data['weight'].shape, py_gt.data['residual'].shape, py_gt.data['time'].shape) numpy.copyto(c_gt, py_gt.data) arl_simulate_gaintable=collections.namedtuple("FFIX", "address") arl_simulate_gaintable.address=int(ff.cast("size_t", arl_simulate_gaintable_ffi)) @ff.callback("void (*)(ARLConf *, const ARLVis *, ARLGt *, ARLVis *, int )", onerror=handle_error) def arl_apply_gaintable_ffi(lowconfig, blockvis_in, gt, blockvis_out, inverse_in): if inverse_in == 0: inverse = True else: inverse = False lowcore_name = str(ff.string(lowconfig.confname), 'utf-8') lowcore = create_named_configuration(lowcore_name, rmax=lowconfig.rmax) times = numpy.frombuffer(ff.buffer(lowconfig.times, 8*lowconfig.ntimes), dtype='f8', count=lowconfig.ntimes) frequency = numpy.frombuffer(ff.buffer(lowconfig.freqs, 8*lowconfig.nfreqs), dtype='f8', count=lowconfig.nfreqs) channel_bandwidth = numpy.frombuffer(ff.buffer(lowconfig.channel_bandwidth, 8*lowconfig.nchanwidth), dtype='f8', count=lowconfig.nchanwidth) # Re-creating the input BlockVisibility object c_blockvisin = cARLBlockVis(blockvis_in, lowconfig.nant, lowconfig.nfreqs) py_blockvisin = helper_create_blockvisibility_object(c_blockvisin, frequency, channel_bandwidth, lowcore) py_blockvisin.phasecentre = load_phasecentre(blockvis_in.phasecentre) py_blockvisin.configuration = lowcore polframe = str(ff.string(lowconfig.polframe), 'utf-8') py_blockvisin.polarisation_frame = PolarisationFrame(polframe) # Re-creating GainTable object receptor_frame = ReceptorFrame(py_blockvisin.polarisation_frame.type) c_gt = cARLGt(gt, lowconfig.nant, lowconfig.nfreqs, lowconfig.nrec) py_gt = helper_create_gaintable_object(c_gt, frequency, receptor_frame) py_gt.receptor_frame = receptor_frame # Calling apply_gaintable() function py_blockvisout = apply_gaintable(py_blockvisin, py_gt, inverse=inverse) # print("apply_gaintable np.sum(blockvis.data): ", numpy.sum(py_blockvisout.data['vis'])) # Copy resulting data from py_blockvisout into c_blockvisout py_blockvis_out = cARLBlockVis(blockvis_out, lowconfig.nant, lowconfig.nfreqs) numpy.copyto(py_blockvis_out, py_blockvisout.data) store_phasecentre(blockvis_out.phasecentre, py_blockvisin.phasecentre) arl_apply_gaintable=collections.namedtuple("FFIX", "address") arl_apply_gaintable.address=int(ff.cast("size_t", arl_apply_gaintable_ffi)) @ff.callback("void (*)(ARLConf *, ARLVis *, ARLGt *, int )", onerror=handle_error) def arl_apply_gaintable_ical_ffi(lowconfig, blockvis_in, gt, inverse_in): if inverse_in == 0: inverse = True else: inverse = False lowcore_name = str(ff.string(lowconfig.confname), 'utf-8') lowcore = create_named_configuration(lowcore_name, rmax=lowconfig.rmax) times = numpy.frombuffer(ff.buffer(lowconfig.times, 8*lowconfig.ntimes), dtype='f8', count=lowconfig.ntimes) frequency = numpy.frombuffer(ff.buffer(lowconfig.freqs, 8*lowconfig.nfreqs), dtype='f8', count=lowconfig.nfreqs) channel_bandwidth = numpy.frombuffer(ff.buffer(lowconfig.channel_bandwidth, 8*lowconfig.nchanwidth), dtype='f8', count=lowconfig.nchanwidth) # Re-creating the input BlockVisibility object c_blockvisin = cARLBlockVis(blockvis_in, lowconfig.nant, lowconfig.nfreqs) py_blockvisin = helper_create_blockvisibility_object(c_blockvisin, frequency, channel_bandwidth, lowcore) py_blockvisin.phasecentre = load_phasecentre(blockvis_in.phasecentre) py_blockvisin.configuration = lowcore polframe = str(ff.string(lowconfig.polframe), 'utf-8') py_blockvisin.polarisation_frame = PolarisationFrame(polframe) # Re-creating GainTable object receptor_frame = ReceptorFrame(py_blockvisin.polarisation_frame.type) c_gt = cARLGt(gt, lowconfig.nant, lowconfig.nfreqs, lowconfig.nrec) py_gt = helper_create_gaintable_object(c_gt, frequency, receptor_frame) py_gt.receptor_frame = receptor_frame # Calling apply_gaintable() function py_blockvisout = apply_gaintable(py_blockvisin, py_gt, inverse=inverse) # print("apply_gaintable np.sum(blockvis.data): ", numpy.sum(py_blockvisout.data['vis'])) # Copy resulting data from py_blockvisout back to c_blockvisin numpy.copyto(c_blockvisin, py_blockvisout.data) arl_apply_gaintable_ical=collections.namedtuple("FFIX", "address") arl_apply_gaintable_ical.address=int(ff.cast("size_t", arl_apply_gaintable_ical_ffi)) @ff.callback("void (*)(ARLConf *, const ARLVis *, const ARLVis *, ARLGt *, int )", onerror=handle_error) def arl_solve_gaintable_ical_ffi(lowconfig, blockvis_in, blockvis_pred, gt, vis_slices): lowcore_name = str(ff.string(lowconfig.confname), 'utf-8') lowcore = create_named_configuration(lowcore_name, rmax=lowconfig.rmax) times = numpy.frombuffer(ff.buffer(lowconfig.times, 8*lowconfig.ntimes), dtype='f8', count=lowconfig.ntimes) frequency = numpy.frombuffer(ff.buffer(lowconfig.freqs, 8*lowconfig.nfreqs), dtype='f8', count=lowconfig.nfreqs) channel_bandwidth = numpy.frombuffer(ff.buffer(lowconfig.channel_bandwidth, 8*lowconfig.nchanwidth), dtype='f8', count=lowconfig.nchanwidth) # Re-creating the input BlockVisibility object c_blockvisin = cARLBlockVis(blockvis_in, lowconfig.nant, lowconfig.nfreqs) py_blockvisin = helper_create_blockvisibility_object(c_blockvisin, frequency, channel_bandwidth, lowcore) py_blockvisin.phasecentre = load_phasecentre(blockvis_in.phasecentre) py_blockvisin.configuration = lowcore polframe = str(ff.string(lowconfig.polframe), 'utf-8') py_blockvisin.polarisation_frame = PolarisationFrame(polframe) # Re-creating the input BlockVisibility_pred object c_blockvispred = cARLBlockVis(blockvis_pred, lowconfig.nant, lowconfig.nfreqs) py_blockvispred = helper_create_blockvisibility_object(c_blockvispred, frequency, channel_bandwidth, lowcore) py_blockvispred.phasecentre = load_phasecentre(blockvis_pred.phasecentre) py_blockvispred.configuration = lowcore polframe = str(ff.string(lowconfig.polframe), 'utf-8') py_blockvispred.polarisation_frame = PolarisationFrame(polframe) # Re-creating GainTable object receptor_frame = ReceptorFrame(py_blockvisin.polarisation_frame.type) c_gt = cARLGt(gt, lowconfig.nant, lowconfig.nfreqs, lowconfig.nrec) py_gt = helper_create_gaintable_object(c_gt, frequency, receptor_frame) py_gt.receptor_frame = receptor_frame # Calling apply_gaintable() function gt_out = solve_gaintable(py_blockvisin, py_blockvispred, vis_slices=vis_slices, timeslice='auto', algorithm='hogbom', niter=1000, fractional_threshold=0.1, threshold=0.1, nmajor=5, gain=0.1, first_selfcal=1, global_solution=False) log.info(qa_gaintable(gt_out, context='Gaintable for selfcal cycle')) numpy.copyto(c_gt, gt_out.data) # print("apply_gaintable np.sum(blockvis.data): ", numpy.sum(py_blockvisout.data['vis'])) arl_solve_gaintable_ical=collections.namedtuple("FFIX", "address") arl_solve_gaintable_ical.address=int(ff.cast("size_t", arl_solve_gaintable_ical_ffi)) @ff.callback("void (*)(ARLConf *, ARLVis *, ARLadvice *)", onerror=handle_error) def arl_advise_wide_field_ffi(lowconfig, vis_in, adv): lowcore_name = str(ff.string(lowconfig.confname), 'utf-8') lowcore = create_named_configuration(lowcore_name, rmax=lowconfig.rmax) c_visin = cARLBlockVis(vis_in, lowconfig.nant, lowconfig.nfreqs) frequency = numpy.frombuffer(ff.buffer(lowconfig.freqs, 8*lowconfig.nfreqs), dtype='f8', count=lowconfig.nfreqs) channel_bandwidth = numpy.frombuffer(ff.buffer(lowconfig.channel_bandwidth, 8*lowconfig.nchanwidth), dtype='f8', count=lowconfig.nchanwidth) py_visin = helper_create_blockvisibility_object(c_visin, frequency, channel_bandwidth, lowcore) py_visin.phasecentre = load_phasecentre(vis_in.phasecentre) polframe = str(ff.string(lowconfig.polframe), 'utf-8') py_visin.polarisation_frame = PolarisationFrame(polframe) print("Index :", py_visin.data['index']) advice=advise_wide_field(py_visin, guard_band_image=adv.guard_band_image, delA=adv.delA, wprojection_planes=adv.wprojection_planes) print(advice['vis_slices'], advice['npixels2'], advice['cellsize']) adv.cellsize = advice['cellsize'] adv.vis_slices = advice['vis_slices'] adv.npixel = advice['npixels2'] arl_advise_wide_field=collections.namedtuple("FFIX", "address") arl_advise_wide_field.address=int(ff.cast("size_t", arl_advise_wide_field_ffi)) ff.cdef(""" typedef struct {int nant, nbases;} ant_t; """) # Get the number of baselines for the given configuration # WARING!!! rmax is missing ! -ToDo @ff.callback("void (*) (char*, ant_t *)", onerror=handle_error) def helper_get_nbases_ffi(config_name, nbases_in): tconfig_name = str(ff.string(config_name), 'utf-8') lowcore = create_named_configuration(tconfig_name) nbases_in.nant = len(lowcore.xyz) nbases_in.nbases = int(len(lowcore.xyz)*(len(lowcore.xyz)-1)/2) print(tconfig_name,nbases_in.nant, nbases_in.nbases ) helper_get_nbases=collections.namedtuple("FFIX", "address") helper_get_nbases.address=int(ff.cast("size_t", helper_get_nbases_ffi)) # Get the number of baselines for the given configuration # WARING!!! rmax is missing ! -ToDo @ff.callback("void (*) (char*, double, ant_t *)") def helper_get_nbases_rmax_ffi(config_name, rmax, nbases_in): tconfig_name = str(ff.string(config_name), 'utf-8') lowcore = create_named_configuration(tconfig_name, rmax=rmax) nbases_in.nant = len(lowcore.xyz) nbases_in.nbases = int(len(lowcore.xyz)*(len(lowcore.xyz)-1)/2) print(tconfig_name,nbases_in.nant, nbases_in.nbases ) helper_get_nbases_rmax=collections.namedtuple("FFIX", "address") helper_get_nbases_rmax.address=int(ff.cast("size_t", helper_get_nbases_rmax_ffi)) @ff.callback("void (*)(ARLConf *, double, int, int *)", onerror=handle_error) def helper_get_image_shape_multifreq_ffi(lowconfig, cellsize, npixel, c_shape): frequency = numpy.frombuffer(ff.buffer(lowconfig.freqs, 8*lowconfig.nfreqs), dtype='f8', count=lowconfig.nfreqs) channel_bandwidth = numpy.frombuffer(ff.buffer(lowconfig.channel_bandwidth, 8*lowconfig.nchanwidth), dtype='f8', count=lowconfig.nchanwidth) print("About to start create_low_test_image_from_gleam with flux_limit = 10. to get a shape of the image") res = create_low_test_image_from_gleam(npixel=npixel, frequency=frequency, channel_bandwidth=channel_bandwidth, cellsize=cellsize, flux_limit = 10.) # phasecentre=phasecentre, applybeam=True) # res = create_test_image(frequency=frequency, cellsize=cellsize, npixel = npixel) shape = list(res.data.shape) # TODO fix ugly numpy.copyto(numpy.frombuffer(ff.buffer(c_shape,4*4),dtype='i4',count=4), shape) helper_get_image_shape_multifreq=collections.namedtuple("FFIX", "address") helper_get_image_shape_multifreq.address=int(ff.cast("size_t", helper_get_image_shape_multifreq_ffi)) # TODO temporary until better solution found @ff.callback("void (*)(const double *, double, int *)", onerror=handle_error) def helper_get_image_shape_ffi(freq, cellsize, c_shape): res = create_test_image(freq, cellsize) shape = list(res.data.shape) # TODO fix ugly numpy.copyto(numpy.frombuffer(ff.buffer(c_shape,4*4),dtype='i4',count=4), shape) helper_get_image_shape=collections.namedtuple("FFIX", "address") helper_get_image_shape.address=int(ff.cast("size_t", helper_get_image_shape_ffi)) # TODO properly implement this routine - shouldn't be within create_test_image #@ff.callback("void (*)(const ARLVis *, Image *)") #def helper_set_image_params_ffi(vis, image): # phasecentre = load_phasecentre(vis.phasecentre) # # py_image = cImage(image) # # py_image.wcs.wcs.crval[0] = phasecentre.ra.deg # py_image.wcs.wcs.crval[1] = phasecentre.dec.deg # py_image.wcs.wcs.crpix[0] = float(nx // 2) # py_image.wcs.wcs.crpix[1] = float(ny // 2) # #helper_set_image_params=collections.namedtuple("FFIX", "address") #helper_set_image_params.address=int(ff.cast("size_t", helper_set_image_params_ffi)) @ff.callback("void (*)(const double *, double, char*, Image *)", onerror=handle_error) def arl_create_test_image_ffi(frequency, cellsize, c_phasecentre, out_img): py_outimg = cImage(out_img, new=True) res = create_test_image(frequency, cellsize) phasecentre = load_phasecentre(c_phasecentre) nchan, npol, ny, nx = res.data.shape # res.wcs.wcs.crval[0] = phasecentre.ra.deg # res.wcs.wcs.crval[1] = phasecentre.dec.deg # res.wcs.wcs.crpix[0] = float(nx // 2) # res.wcs.wcs.crpix[1] = float(ny // 2) store_image_in_c(py_outimg, res) arl_create_test_image=collections.namedtuple("FFIX", "address") arl_create_test_image.address=int(ff.cast("size_t", arl_create_test_image_ffi)) @ff.callback("void (*)(ARLConf *, double, int, char*, Image *)", onerror=handle_error) def arl_create_low_test_image_from_gleam_ffi(lowconfig, cellsize, npixel, c_phasecentre, out_img): py_outimg = cImage(out_img, new=True) frequency = numpy.frombuffer(ff.buffer(lowconfig.freqs, 8*lowconfig.nfreqs), dtype='f8', count=lowconfig.nfreqs) channel_bandwidth = numpy.frombuffer(ff.buffer(lowconfig.channel_bandwidth, 8*lowconfig.nchanwidth), dtype='f8', count=lowconfig.nchanwidth) phasecentre = load_phasecentre(c_phasecentre) print("About to start create_low_test_image_from_gleam") res = create_low_test_image_from_gleam(npixel=npixel, frequency=frequency, channel_bandwidth=channel_bandwidth, cellsize=cellsize, flux_limit = 1.0, phasecentre=phasecentre, applybeam=True) export_image_to_hdf5(res, '%s/gleam_model_res.hdf'%(results_dir)) nchan, npol, ny, nx = res.data.shape # res.wcs.wcs.crval[0] = phasecentre.ra.deg # res.wcs.wcs.crval[1] = phasecentre.dec.deg # res.wcs.wcs.crpix[0] = float(nx // 2) # res.wcs.wcs.crpix[1] = float(ny // 2) export_image_to_hdf5(res, '%s/gleam_model_res1.hdf'%(results_dir)) store_image_in_c(py_outimg, res) arl_create_low_test_image_from_gleam=collections.namedtuple("FFIX", "address") arl_create_low_test_image_from_gleam.address=int(ff.cast("size_t", arl_create_low_test_image_from_gleam_ffi)) @ff.callback("void (*)(const ARLVis *, const Image *, ARLVis *)", onerror=handle_error) def arl_predict_2d_ffi(vis_in, img, vis_out): c_visin = cARLVis(vis_in) py_visin = helper_create_visibility_object(c_visin) c_img = cImage(img) py_visin.phasecentre = load_phasecentre(vis_in.phasecentre) res = predict_2d(py_visin, c_img) vis_out.nvis = vis_in.nvis vis_out.npol = vis_in.npol c_visout = cARLVis(vis_out) numpy.copyto(c_visout, res.data) store_phasecentre(vis_out.phasecentre, res.phasecentre) #arl_copy_visibility(py_visin, c_visout, False) arl_predict_2d=collections.namedtuple("FFIX", "address") arl_predict_2d.address=int(ff.cast("size_t", arl_predict_2d_ffi)) @ff.callback("void (*)(ARLConf *, const ARLVis *, const Image *, ARLVis *, ARLVis *, long long int *)", onerror=handle_error) def arl_predict_function_ffi(lowconfig, vis_in, img, vis_out, blockvis_out, cindex_out): lowcore_name = str(ff.string(lowconfig.confname), 'utf-8') lowcore = create_named_configuration(lowcore_name, rmax=lowconfig.rmax) cindex_size = lowconfig.nant*lowconfig.nant*lowconfig.nfreqs*lowconfig.ntimes py_cindex = numpy.frombuffer(ff.buffer(cindex_out, 8*cindex_size), dtype='int', count=cindex_size) c_visin = cARLBlockVis(vis_in, lowconfig.nant, lowconfig.nfreqs) frequency = numpy.frombuffer(ff.buffer(lowconfig.freqs, 8*lowconfig.nfreqs), dtype='f8', count=lowconfig.nfreqs) channel_bandwidth = numpy.frombuffer(ff.buffer(lowconfig.channel_bandwidth, 8*lowconfig.nchanwidth), dtype='f8', count=lowconfig.nchanwidth) py_visin = helper_create_blockvisibility_object(c_visin, frequency, channel_bandwidth, lowcore) c_img = cImage(img) py_visin.phasecentre = load_phasecentre(vis_in.phasecentre) polframe = str(ff.string(lowconfig.polframe), 'utf-8') py_visin.polarisation_frame = PolarisationFrame(polframe) # print("--------------------> predict_list_serial_workflow Phasecentre : ", py_visin.phasecentre.ra.deg, py_visin.phasecentre.dec.deg) res = predict_list_serial_workflow(py_visin, c_img, vis_slices=51, context='wstack') # print("--------------------> predict_list_serial_workflow sizeof(py_visin.data), sizeof(res.data)", sys.getsizeof(py_visin.data[:]), sys.getsizeof(res.data[:])) # print("--------------------> predict_list_serial_workflow cindex", type(res.cindex), type(res.cindex[0]), len(res.cindex)) # print("--------------------> predict_list_serial_workflow sys.getsizeof(res.cindex)", sys.getsizeof(res.cindex)) # print("--------------------> predict_list_serial_workflow np.sum(predicted_vis.data): ", numpy.sum(res.data['vis'])) # print("--------------------> predict_list_serial_workflow predicted_vis.data: ", res.data) # print("--------------------> predict_list_serial_workflow py_visin.data): ", py_visin.data) # print("predict_list_serial_workflow np.sum(predicted_vis.data): ", numpy.sum(res.data['vis'])) vis_out.npol = vis_in.npol c_visout = cARLVis(vis_out) numpy.copyto(c_visout, res.data) store_phasecentre(vis_out.phasecentre, res.phasecentre) numpy.copyto(py_cindex, res.cindex) py_blockvis_out = cARLBlockVis(blockvis_out, lowconfig.nant, lowconfig.nfreqs) numpy.copyto(py_blockvis_out, res.blockvis.data) store_phasecentre(blockvis_out.phasecentre, res.phasecentre) arl_predict_function=collections.namedtuple("FFIX", "address") arl_predict_function.address=int(ff.cast("size_t", arl_predict_function_ffi)) @ff.callback("void (*)(ARLConf *, ARLVis *, const Image *)", onerror=handle_error) def arl_predict_function_blockvis_ffi(lowconfig, vis_in, img): lowcore_name = str(ff.string(lowconfig.confname), 'utf-8') lowcore = create_named_configuration(lowcore_name, rmax=lowconfig.rmax) c_visin = cARLBlockVis(vis_in, lowconfig.nant, lowconfig.nfreqs) frequency = numpy.frombuffer(ff.buffer(lowconfig.freqs, 8*lowconfig.nfreqs), dtype='f8', count=lowconfig.nfreqs) channel_bandwidth = numpy.frombuffer(ff.buffer(lowconfig.channel_bandwidth, 8*lowconfig.nchanwidth), dtype='f8', count=lowconfig.nchanwidth) py_visin = helper_create_blockvisibility_object(c_visin, frequency, channel_bandwidth, lowcore) c_img = cImage(img) py_visin.phasecentre = load_phasecentre(vis_in.phasecentre) log.info(qa_image(c_img, context='arl_predict_function')) # export_image_to_fits(c_img, '%s/imaging-blockvis_model_in_predicted_function.fits'%(results_dir)) # export_blockvisibility_to_hdf5(py_visin, '%s/py_visin.hdf'%(results_dir)) # export_image_to_hdf5(c_img, '%s/gleam_model_c_img.hdf'%(results_dir)) py_blockvis = predict_list_serial_workflow(py_visin, c_img, vis_slices=51, context='wstack') # export_blockvisibility_to_hdf5(py_blockvis, '%s/py_blockvis.hdf'%(results_dir)) # print(qa_visibility(py_blockvis, context='arl_predict_function_blockvis py_blockvis')) # print("arl_predict_function_blockvis :", py_visin, py_blockvis) numpy.copyto(c_visin, py_blockvis.data) # store_phasecentre(vis_out.phasecentre, res.phasecentre) # print("arl_predict_function_blockvis np.sum(py_blockvis.data): ", numpy.sum(py_blockvis.data['vis'])) # print("arl_predict_function_blockvis nchan npol nants ", py_blockvis.nchan, py_blockvis.npol, py_blockvis.nants) # print("arl_predict_function_blockvis sum(uvw) ", numpy.sum(py_blockvis.uvw)) # print("arl_predict_function_blockvis sum(vis) ", numpy.sum(py_blockvis.vis)) # print("arl_predict_function_blockvis sum(weight) ", numpy.sum(py_blockvis.weight)) # print("arl_predict_function_blockvis time", py_blockvis.time, numpy.sum(py_blockvis.time)) # print("arl_predict_function_blockvis integration_time", py_blockvis.integration_time, numpy.sum(py_blockvis.integration_time)) # print("arl_predict_function_blockvis nvis, size", py_blockvis.nvis, py_blockvis.size()) arl_predict_function_blockvis=collections.namedtuple("FFIX", "address") arl_predict_function_blockvis.address=int(ff.cast("size_t", arl_predict_function_blockvis_ffi)) @ff.callback("void (*)(ARLConf *, ARLVis *, const Image *, ARLVis *, long long int *, int)", onerror=handle_error) def arl_predict_function_ical_ffi(lowconfig, vis_inout, img, blockvis_inout, cindex_inout, vis_slices): lowcore_name = str(ff.string(lowconfig.confname), 'utf-8') lowcore = create_named_configuration(lowcore_name, rmax=lowconfig.rmax) cindex_size = lowconfig.nant*lowconfig.nant*lowconfig.nfreqs*lowconfig.ntimes py_cindex = numpy.frombuffer(ff.buffer(cindex_inout, 8*cindex_size), dtype='int', count=cindex_size) c_visinout = cARLVis(vis_inout) frequency = numpy.frombuffer(ff.buffer(lowconfig.freqs, 8*lowconfig.nfreqs), dtype='f8', count=lowconfig.nfreqs) channel_bandwidth = numpy.frombuffer(ff.buffer(lowconfig.channel_bandwidth, 8*lowconfig.nchanwidth), dtype='f8', count=lowconfig.nchanwidth) py_visinout = helper_create_visibility_object(c_visinout) py_visinout.configuration = lowcore py_visinout.phasecentre = load_phasecentre(vis_inout.phasecentre) polframe = str(ff.string(lowconfig.polframe), 'utf-8') py_visinout.polarisation_frame = PolarisationFrame(polframe) py_blockvis_inout = cARLBlockVis(blockvis_inout, lowconfig.nant, lowconfig.nfreqs) py_blockvisinout = helper_create_blockvisibility_object(py_blockvis_inout, frequency, channel_bandwidth, lowcore) py_visinout.blockvis = py_blockvisinout py_visinout.cindex = py_cindex c_img = cImage(img) res = predict_list_serial_workflow(py_visinout, c_img, vis_slices=vis_slices, context='wstack', timeslice='auto', algorithm='hogbom', niter=1000, fractional_threshold=0.1, threshold=0.1, nmajor=5, gain=0.1, first_selfcal=1, global_solution=False) # print("####################> arl_predict_function_ical: ", type(res)) numpy.copyto(c_visinout, res.data) store_phasecentre(vis_inout.phasecentre, res.phasecentre) numpy.copyto(py_cindex, res.cindex) numpy.copyto(py_blockvis_inout, res.blockvis.data) store_phasecentre(blockvis_inout.phasecentre, res.phasecentre) # print("predict_function_ical np.sum(res.data): ", numpy.sum(res.data['vis'])) # print("predict_function_ical np.sum(res.blockvis.data): ", numpy.sum(res.blockvis.data['vis'])) arl_predict_function_ical=collections.namedtuple("FFIX", "address") arl_predict_function_ical.address=int(ff.cast("size_t", arl_predict_function_ical_ffi)) @ff.callback("void (*)(ARLConf *, const ARLVis *, Image *, int, Image *)", onerror=handle_error) def arl_invert_function_ffi(lowconfig, vis_in, img, vis_slices, img_dirty): # Creating configuration lowcore_name = str(ff.string(lowconfig.confname), 'utf-8') lowcore = create_named_configuration(lowcore_name, rmax=lowconfig.rmax) # Re-creating Visibility object times = numpy.frombuffer(ff.buffer(lowconfig.times, 8*lowconfig.ntimes), dtype='f8', count=lowconfig.ntimes) frequency = numpy.frombuffer(ff.buffer(lowconfig.freqs, 8*lowconfig.nfreqs), dtype='f8', count=lowconfig.nfreqs) channel_bandwidth = numpy.frombuffer(ff.buffer(lowconfig.channel_bandwidth, 8*lowconfig.nchanwidth), dtype='f8', count=lowconfig.nchanwidth) c_visin = cARLVis(vis_in) py_visin = helper_create_visibility_object(c_visin) py_visin.phasecentre = load_phasecentre(vis_in.phasecentre) py_visin.configuration = lowcore polframe = str(ff.string(lowconfig.polframe), 'utf-8') py_visin.polarisation_frame = PolarisationFrame(polframe) # Re-creating images py_img = cImage(img) py_img_dirty = cImage(img_dirty, new=True) # Calling invert_finction() # export_blockvisibility_to_hdf5(py_visin, '%s/py_visin_invert_function.hdf'%(results_dir)) # export_image_to_hdf5(py_img, '%s/model_invert_function.hdf'%(results_dir)) # print("arl_invert_function vis_slices: ", vis_slices) dirty, sumwt = invert_list_serial_workflow(py_visin, py_img, vis_slices=vis_slices, dopsf=False, context='wstack') nchan, npol, ny, nx = dirty.data.shape # dirty.wcs.wcs.crval[0] = py_visin.phasecentre.ra.deg # dirty.wcs.wcs.crval[1] = py_visin.phasecentre.dec.deg # dirty.wcs.wcs.crpix[0] = float(nx // 2) # dirty.wcs.wcs.crpix[1] = float(ny // 2) # Copy Python dirty image into C image store_image_in_c(py_img_dirty, dirty) arl_invert_function=collections.namedtuple("FFIX", "address") arl_invert_function.address=int(ff.cast("size_t", arl_invert_function_ffi)) @ff.callback("void (*)(ARLConf *, const ARLVis *, Image *, int, Image *)", onerror=handle_error) def arl_invert_function_blockvis_ffi(lowconfig, vis_in, img, vis_slices, img_dirty): # Creating configuration lowcore_name = str(ff.string(lowconfig.confname), 'utf-8') lowcore = create_named_configuration(lowcore_name, rmax=lowconfig.rmax) # Re-creating Visibility object times = numpy.frombuffer(ff.buffer(lowconfig.times, 8*lowconfig.ntimes), dtype='f8', count=lowconfig.ntimes) frequency = numpy.frombuffer(ff.buffer(lowconfig.freqs, 8*lowconfig.nfreqs), dtype='f8', count=lowconfig.nfreqs) channel_bandwidth = numpy.frombuffer(ff.buffer(lowconfig.channel_bandwidth, 8*lowconfig.nchanwidth), dtype='f8', count=lowconfig.nchanwidth) c_visin = cARLBlockVis(vis_in, lowconfig.nant, lowconfig.nfreqs) py_visin = helper_create_blockvisibility_object(c_visin, frequency, channel_bandwidth, lowcore) py_visin.phasecentre = load_phasecentre(vis_in.phasecentre) py_visin.configuration = lowcore polframe = str(ff.string(lowconfig.polframe), 'utf-8') py_visin.polarisation_frame = PolarisationFrame(polframe) # Re-creating images py_img = cImage(img) py_img_dirty = cImage(img_dirty, new=True) # Calling invert_finction() # export_blockvisibility_to_hdf5(py_visin, '%s/py_visin_invert_function.hdf'%(results_dir)) # export_image_to_hdf5(py_img, '%s/model_invert_function.hdf'%(results_dir)) # print("arl_invert_function vis_slices: ", vis_slices) dirty, sumwt = invert_list_serial_workflow(py_visin, py_img, vis_slices=vis_slices, dopsf=False, context='wstack') nchan, npol, ny, nx = dirty.data.shape # dirty.wcs.wcs.crval[0] = py_visin.phasecentre.ra.deg # dirty.wcs.wcs.crval[1] = py_visin.phasecentre.dec.deg # dirty.wcs.wcs.crpix[0] = float(nx // 2) # dirty.wcs.wcs.crpix[1] = float(ny // 2) # Copy Python dirty image into C image store_image_in_c(py_img_dirty, dirty) arl_invert_function_blockvis=collections.namedtuple("FFIX", "address") arl_invert_function_blockvis.address=int(ff.cast("size_t", arl_invert_function_blockvis_ffi)) @ff.callback("void (*)(ARLConf *, const ARLVis *, Image *, int, Image *)", onerror=handle_error) def arl_invert_function_ical_ffi(lowconfig, vis_in, img, vis_slices, img_dirty): # Creating configuration lowcore_name = str(ff.string(lowconfig.confname), 'utf-8') lowcore = create_named_configuration(lowcore_name, rmax=lowconfig.rmax) # Re-creating Visibility object times = numpy.frombuffer(ff.buffer(lowconfig.times, 8*lowconfig.ntimes), dtype='f8', count=lowconfig.ntimes) frequency = numpy.frombuffer(ff.buffer(lowconfig.freqs, 8*lowconfig.nfreqs), dtype='f8', count=lowconfig.nfreqs) channel_bandwidth = numpy.frombuffer(ff.buffer(lowconfig.channel_bandwidth, 8*lowconfig.nchanwidth), dtype='f8', count=lowconfig.nchanwidth) c_visin = cARLVis(vis_in) py_visin = helper_create_visibility_object(c_visin) py_visin.phasecentre = load_phasecentre(vis_in.phasecentre) py_visin.configuration = lowcore polframe = str(ff.string(lowconfig.polframe), 'utf-8') py_visin.polarisation_frame = PolarisationFrame(polframe) # Re-creating images py_img = cImage(img) py_img_dirty = cImage(img_dirty, new=True) # Calling invert_finction() dirty, sumwt = invert_list_serial_workflow(py_visin, py_img, vis_slices=vis_slices, context='wstack', timeslice='auto', algorithm='hogbom', niter=1000, fractional_threshold=0.1, threshold=0.1, nmajor=5, gain=0.1, first_selfcal=1, global_solution=False) nchan, npol, ny, nx = dirty.data.shape # dirty.wcs.wcs.crval[0] = py_visin.phasecentre.ra.deg # dirty.wcs.wcs.crval[1] = py_visin.phasecentre.dec.deg # dirty.wcs.wcs.crpix[0] = float(nx // 2) # dirty.wcs.wcs.crpix[1] = float(ny // 2) # Copy Python dirty image into C image store_image_in_c(py_img_dirty, dirty) log.info("Maximum in residual image is %.6f" % (numpy.max(numpy.abs(dirty.data)))) arl_invert_function_ical=collections.namedtuple("FFIX", "address") arl_invert_function_ical.address=int(ff.cast("size_t", arl_invert_function_ical_ffi)) @ff.callback("void (*)(ARLConf *, const ARLVis *, Image *, int, Image *)", onerror=handle_error) def arl_invert_function_psf_ffi(lowconfig, vis_in, img, vis_slices, img_psf): # Creating configuration lowcore_name = str(ff.string(lowconfig.confname), 'utf-8') lowcore = create_named_configuration(lowcore_name, rmax=lowconfig.rmax) # Re-creating Visibility object times = numpy.frombuffer(ff.buffer(lowconfig.times, 8*lowconfig.ntimes), dtype='f8', count=lowconfig.ntimes) frequency = numpy.frombuffer(ff.buffer(lowconfig.freqs, 8*lowconfig.nfreqs), dtype='f8', count=lowconfig.nfreqs) channel_bandwidth = numpy.frombuffer(ff.buffer(lowconfig.channel_bandwidth, 8*lowconfig.nchanwidth), dtype='f8', count=lowconfig.nchanwidth) c_visin = cARLVis(vis_in) py_visin = helper_create_visibility_object(c_visin) py_visin.phasecentre = load_phasecentre(vis_in.phasecentre) py_visin.configuration = lowcore polframe = str(ff.string(lowconfig.polframe), 'utf-8') py_visin.polarisation_frame = PolarisationFrame(polframe) # Re-creating images py_img = cImage(img) py_img_psf = cImage(img_psf, new=True) # Calling invert_finction() psf, sumwt = invert_list_serial_workflow(py_visin, py_img, vis_slices=vis_slices, dopsf=True, context='wstack', timeslice='auto', algorithm='hogbom', niter=1000, fractional_threshold=0.1, threshold=0.1, nmajor=5, gain=0.1, first_selfcal=1, global_solution=False) nchan, npol, ny, nx = psf.data.shape # psf.wcs.wcs.crval[0] = py_visin.phasecentre.ra.deg # psf.wcs.wcs.crval[1] = py_visin.phasecentre.dec.deg # psf.wcs.wcs.crpix[0] = float(nx // 2) # psf.wcs.wcs.crpix[1] = float(ny // 2) # Copy Python dirty image into C image store_image_in_c(py_img_psf, psf) arl_invert_function_psf=collections.namedtuple("FFIX", "address") arl_invert_function_psf.address=int(ff.cast("size_t", arl_invert_function_psf_ffi)) @ff.callback("void (*)(ARLConf *, const ARLVis *, Image *, int, Image *, Image *, Image *)", onerror=handle_error) def arl_ical_ffi(lowconfig, blockvis_in, img_model, vis_slices, img_deconvolved, img_residual, img_restored): # Creating configuration lowcore_name = str(ff.string(lowconfig.confname), 'utf-8') lowcore = create_named_configuration(lowcore_name, rmax=lowconfig.rmax) # Re-creating BlockVisibility object times = numpy.frombuffer(ff.buffer(lowconfig.times, 8*lowconfig.ntimes), dtype='f8', count=lowconfig.ntimes) frequency = numpy.frombuffer(ff.buffer(lowconfig.freqs, 8*lowconfig.nfreqs), dtype='f8', count=lowconfig.nfreqs) channel_bandwidth = numpy.frombuffer(ff.buffer(lowconfig.channel_bandwidth, 8*lowconfig.nchanwidth), dtype='f8', count=lowconfig.nchanwidth) c_blockvisin = cARLBlockVis(blockvis_in, lowconfig.nant, lowconfig.nfreqs) py_blockvisin = helper_create_blockvisibility_object(c_blockvisin, frequency, channel_bandwidth, lowcore) py_blockvisin.phasecentre = load_phasecentre(blockvis_in.phasecentre) polframe = str(ff.string(lowconfig.polframe), 'utf-8') py_blockvisin.polarisation_frame = PolarisationFrame(polframe) # Re-creating images py_model = cImage(img_model) py_img_deconvolved = cImage(img_deconvolved, new=True) py_img_residual = cImage(img_residual, new=True) py_img_restored = cImage(img_restored, new=True) # Callinc ical_list_serial_workflow() deconvolved, residual, restored = ical_list_serial_workflow(block_vis=py_blockvisin, model=py_model, vis_slices=vis_slices, timeslice='auto', algorithm='hogbom', niter=1000, fractional_threshold=0.1, threshold=0.1, context='wstack', nmajor=5, gain=0.1, first_selfcal=1, global_solution=False) # Preparing deconvolved nchan, npol, ny, nx = deconvolved.data.shape # deconvolved.wcs.wcs.crval[0] = py_blockvisin.phasecentre.ra.deg # deconvolved.wcs.wcs.crval[1] = py_blockvisin.phasecentre.dec.deg # deconvolved.wcs.wcs.crpix[0] = float(nx // 2) # deconvolved.wcs.wcs.crpix[1] = float(ny // 2) store_image_in_c(py_img_deconvolved, deconvolved) # Preparing residual nchan, npol, ny, nx = residual.data.shape # residual.wcs.wcs.crval[0] = py_blockvisin.phasecentre.ra.deg # residual.wcs.wcs.crval[1] = py_blockvisin.phasecentre.dec.deg # residual.wcs.wcs.crpix[0] = float(nx // 2) # residual.wcs.wcs.crpix[1] = float(ny // 2) store_image_in_c(py_img_residual, residual) # Preparing restored nchan, npol, ny, nx = restored.data.shape # restored.wcs.wcs.crval[0] = py_blockvisin.phasecentre.ra.deg # restored.wcs.wcs.crval[1] = py_blockvisin.phasecentre.dec.deg # restored.wcs.wcs.crpix[0] = float(nx // 2) # restored.wcs.wcs.crpix[1] = float(ny // 2) store_image_in_c(py_img_restored, restored) arl_ical=collections.namedtuple("FFIX", "address") arl_ical.address=int(ff.cast("size_t", arl_ical_ffi)) @ff.callback("void (*)(const ARLVis *, const Image *, bool dopsf, Image *, double *)") def arl_invert_2d_ffi(invis, in_image, dopsf, out_image, sumwt): py_visin = helper_create_visibility_object(cARLVis(invis)) c_in_img = cImage(in_image) c_out_img = cImage(out_image, new=True) py_visin.phasecentre = load_phasecentre(invis.phasecentre) if dopsf: out, sumwt = invert_2d(py_visin, c_in_img, dopsf=True) else: out, sumwt = invert_2d(py_visin, c_in_img) store_image_in_c_2(c_out_img, out) arl_invert_2d=collections.namedtuple("FFIX", "address") arl_invert_2d.address=int(ff.cast("size_t", arl_invert_2d_ffi)) @ff.callback("void (*)(const ARLVis *, Image *)", onerror=handle_error) def arl_create_image_from_visibility_ffi(vis_in, img_in): c_vis = cARLVis(vis_in) c_img = cImage(img_in, new=True) # We need a proper Visibility object - not this, and not a cARLVis # This is temporary - just so we have some data to pass to # the create_... routine tvis = helper_create_visibility_object(c_vis) tvis.phasecentre = load_phasecentre(vis_in.phasecentre) # Default args for now image = create_image_from_visibility(tvis, cellsize=0.001, npixel=256) #numpy.copyto(c_img.data, image.data) # Pickle WCS and polframe, until better way is found to handle these data # structures #store_image_pickles(c_img, image) store_image_in_c(c_img, image) arl_create_image_from_visibility=collections.namedtuple("FFIX", "address") arl_create_image_from_visibility.address=int(ff.cast("size_t", arl_create_image_from_visibility_ffi)) @ff.callback("void (*)(ARLConf *, const ARLVis *, double, int, char*, Image *)", onerror=handle_error) def arl_create_image_from_blockvisibility_ffi(lowconfig, blockvis_in, cellsize, npixel, c_phasecentre, img_out): # Creating configuration lowcore_name = str(ff.string(lowconfig.confname), 'utf-8') lowcore = create_named_configuration(lowcore_name, rmax=lowconfig.rmax) # Re-creating BlockVisibility object c_blockvisin = cARLBlockVis(blockvis_in, lowconfig.nant, lowconfig.nfreqs) frequency = numpy.frombuffer(ff.buffer(lowconfig.freqs, 8*lowconfig.nfreqs), dtype='f8', count=lowconfig.nfreqs) channel_bandwidth = numpy.frombuffer(ff.buffer(lowconfig.channel_bandwidth, 8*lowconfig.nchanwidth), dtype='f8', count=lowconfig.nchanwidth) py_blockvisin = helper_create_blockvisibility_object(c_blockvisin, frequency, channel_bandwidth, lowcore) # py_blockvisin.phasecentre = load_phasecentre(blockvis_in.phasecentre) # Copying phasecentre and other metadata phasecentre = load_phasecentre(c_phasecentre) py_blockvisin.phasecentre = phasecentre polframe = str(ff.string(lowconfig.polframe), 'utf-8') py_blockvisin.polarisation_frame = PolarisationFrame(polframe) phasecentre1 = SkyCoord(ra=lowconfig.pc_ra * u.deg, dec=lowconfig.pc_dec*u.deg, frame='icrs', equinox='J2000') # Re-creating Image object py_outimg = cImage(img_out, new=True) # Construct a model from py_blockvisin res = create_image_from_visibility(py_blockvisin, npixel=npixel, frequency=[numpy.average(frequency)], nchan=1, channel_bandwidth=[numpy.sum(channel_bandwidth)], cellsize=cellsize, phasecentre=phasecentre1) #numpy.copyto(c_img.data, image.data) # Pickle WCS and polframe, until better way is found to handle these data # structures #store_image_pickles(c_img, image) nchan, npol, ny, nx = res.data.shape # res.wcs.wcs.crval[0] = phasecentre1.ra.deg # res.wcs.wcs.crval[1] = phasecentre1.dec.deg # res.wcs.wcs.crpix[0] = float(nx // 2) # res.wcs.wcs.crpix[1] = float(ny // 2) store_image_in_c(py_outimg, res) arl_create_image_from_blockvisibility=collections.namedtuple("FFIX", "address") arl_create_image_from_blockvisibility.address=int(ff.cast("size_t", arl_create_image_from_blockvisibility_ffi)) @ff.callback("void (*)(Image *, Image *, Image *, Image *)", onerror=handle_error) def arl_deconvolve_cube_ffi(dirty, psf, restored, residual): c_dirty = cImage(dirty) c_psf = cImage(psf) c_residual = cImage(residual, new=True) c_restored = cImage(restored, new=True) py_restored, py_residual = deconvolve_cube(c_dirty, c_psf, niter=1000,threshold=0.001, fracthresh=0.01, window_shape='quarter', gain=0.7, scales=[0,3,10,30]) store_image_in_c(c_restored,py_restored) store_image_in_c(c_residual,py_residual) arl_deconvolve_cube=collections.namedtuple("FFIX", "address") arl_deconvolve_cube.address=int(ff.cast("size_t", arl_deconvolve_cube_ffi)) @ff.callback("void (*)(Image *, Image *, Image *, Image *)", onerror=handle_error) def arl_deconvolve_cube_ical_ffi(dirty, psf, restored, residual): c_dirty = cImage(dirty) c_psf = cImage(psf) c_residual = cImage(residual, new=True) c_restored = cImage(restored, new=True) py_restored, py_residual = deconvolve_cube(c_dirty, c_psf, timeslice='auto', algorithm='hogbom', niter=1000, fractional_threshold=0.1, threshold=0.1, nmajor=5, gain=0.1, first_selfcal=1, global_solution=False) store_image_in_c(c_restored,py_restored) store_image_in_c(c_residual,py_residual) arl_deconvolve_cube_ical=collections.namedtuple("FFIX", "address") arl_deconvolve_cube_ical.address=int(ff.cast("size_t", arl_deconvolve_cube_ical_ffi)) @ff.callback("void (*)(Image *, Image *, Image*, Image*)", onerror=handle_error) def arl_restore_cube_ffi(model, psf, residual, restored): # Cast C Image structs to Python objects c_model = cImage(model) c_psf = cImage(psf) if residual: c_residual = cImage(residual) else: c_residual = None c_restored = cImage(restored, new=True) # Calculate py_restored = restore_cube(c_model, c_psf, c_residual) # Copy Python result to C result struct store_image_in_c(c_restored,py_restored) arl_restore_cube=collections.namedtuple("FFIX", "address") arl_restore_cube.address=int(ff.cast("size_t", arl_restore_cube_ffi)) @ff.callback("void (*)(Image *, Image *, Image*, Image*)", onerror=handle_error) def arl_restore_cube_ical_ffi(model, psf, residual, restored): # Cast C Image structs to Python objects c_model = cImage(model) c_psf = cImage(psf) if residual: c_residual = cImage(residual) else: c_residual = None c_restored = cImage(restored, new=True) # Calculate py_restored = restore_cube(c_model, c_psf, c_residual, timeslice='auto', algorithm='hogbom', niter=1000, fractional_threshold=0.1, threshold=0.1, nmajor=5, gain=0.1, first_selfcal=1, global_solution=False) # Copy Python result to C result struct store_image_in_c(c_restored,py_restored) arl_restore_cube_ical=collections.namedtuple("FFIX", "address") arl_restore_cube_ical.address=int(ff.cast("size_t", arl_restore_cube_ical_ffi))
{ "repo_name": "SKA-ScienceDataProcessor/algorithm-reference-library", "path": "deprecated_code/ffiwrappers/src/arlwrap.py", "copies": "1", "size": "64539", "license": "apache-2.0", "hash": 5170159498931707000, "line_mean": 46.9131403118, "line_max": 165, "alpha_frac": 0.7161251336, "autogenerated": false, "ratio": 2.9315920962979787, "config_test": true, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.9106009326528568, "avg_score": 0.008341580673882151, "num_lines": 1347 }
import cffi import numpy from data_models.memory_data_models import Image, Visibility, BlockVisibility, GainTable import pickle ff = cffi.FFI() def ARLDataVisSize(nvis, npol): return (80+32*int(npol))*int(nvis) def cARLVis(visin): """ Convert a const ARLVis * into the ARL Visiblity structure """ npol=visin.npol nvis=visin.nvis #print (ARLDataVisSize(nvis, npol)) desc = [('index', 'i8'), ('uvw', 'f8', (3,)), ('time', 'f8'), ('frequency', 'f8'), ('channel_bandwidth', 'f8'), ('integration_time', 'f8'), ('antenna1', 'i8'), ('antenna2', 'i8'), ('vis', 'c16', (npol,)), ('weight', 'f8', (npol,)), ('imaging_weight', 'f8', (npol,))] r=numpy.frombuffer(ff.buffer(visin.data, ARLDataVisSize(nvis, npol)), dtype=desc, count=nvis) return r def ARLBlockDataVisSize(ntimes, nants, nchan, npol): return (24+24*int(nants*nants) + 24*int(nants*nants)*int(nchan)*int(npol))*int(ntimes) def cARLBlockVis(visin, nants, nchan): """ Convert a const ARLVis * into the ARL BlockVisiblity structure """ npol=visin.npol ntimes=visin.nvis #print (ARLDataVisSize(nvis, npol)) desc = [('index', 'i8'), ('uvw', 'f8', (nants, nants, 3)), ('time', 'f8'), ('integration_time', 'f8'), ('vis', 'c16', (nants, nants, nchan, npol)), ('weight', 'f8', (nants, nants, nchan, npol))] r=numpy.frombuffer(ff.buffer(visin.data, ARLBlockDataVisSize(ntimes, nants, nchan, npol)), dtype=desc, count=ntimes) return r def ARLDataGTSize(ntimes, nants, nchan, nrec): return (8 + 8*nchan*nrec*nrec + 3*8*nants*nchan*nrec*nrec + 8)*ntimes def cARLGt(gtin, nants, nchan, nrec): """ Convert a const ARLGt * into the ARL GainTable structure """ ntimes=gtin.nrows desc = [('gain', 'c16', (nants, nchan, nrec, nrec)), ('weight', 'f8', (nants, nchan, nrec, nrec)), ('residual', 'f8', (nchan, nrec, nrec)), ('time', 'f8'), ('interval', 'f8')] r=numpy.frombuffer(ff.buffer(gtin.data, ARLDataGTSize(ntimes, nants, nchan, nrec)), dtype=desc, count=ntimes) return r def store_pickle(c_dest, py_src, raw_c_ptr=False): src_pickle = pickle.dumps(py_src) src_buf = numpy.frombuffer(src_pickle, dtype='b', count=len(src_pickle)) # Create ndarray if necessary if (raw_c_ptr): c_dest = numpy.frombuffer(ff.buffer(c_dest, len(src_pickle)), dtype='b', count=len(src_pickle)) numpy.copyto(c_dest, src_buf) def load_pickle(c_ptr, size): return pickle.loads(numpy.frombuffer(ff.buffer(c_ptr, size), dtype='b', count=size)) def store_image_pickles(c_img, py_img): store_pickle(c_img.wcs, py_img.wcs) store_pickle(c_img.polarisation_frame, py_img.polarisation_frame) # Turns ARLVis struct into Visibility object def helper_create_visibility_object(c_vis): # This may be incorrect # especially the data field... tvis= Visibility( data=c_vis, frequency=c_vis['frequency'], channel_bandwidth=c_vis['channel_bandwidth'], integration_time=c_vis['integration_time'], antenna1=c_vis['antenna1'], antenna2=c_vis['antenna2'], weight=c_vis['weight'], imaging_weight=c_vis['imaging_weight'], uvw=c_vis['uvw'], time=c_vis['time'] ) return tvis # Turns ARLVis struct into BlockVisibility object def helper_create_blockvisibility_object(c_vis, freqs, chan_b, config): # This may be incorrect # especially the data field... tvis= BlockVisibility( data=c_vis, frequency = freqs, channel_bandwidth = chan_b, configuration = config, integration_time=c_vis['integration_time'], weight=c_vis['weight'], uvw=c_vis['uvw'], time=c_vis['time'] ) return tvis # Turns ARLGt struct into GainTable object def helper_create_gaintable_object(c_gt, freqs, recframe): tgt= GainTable( data=None, frequency = freqs, gain=c_gt['gain'], weight=c_gt['weight'], residual=c_gt['residual'], time=c_gt['time'], interval=c_gt['interval'], receptor_frame=recframe ) # print(tgt.__dict__) return tgt def cImage(image_in, new=False): "Convert an Image* into ARL Image structure" new_image = Image() size = image_in.size data_shape = tuple(image_in.data_shape) new_image.data = numpy.frombuffer(ff.buffer(image_in.data,size*8), dtype='f8', count=size) # frombuffer only does 1D arrays.. new_image.data = new_image.data.reshape(data_shape) # New images don't have pickles yet if new: new_image.wcs = numpy.frombuffer(ff.buffer(image_in.wcs, 2996), dtype='b', count=2996) new_image.polarisation_frame = numpy.frombuffer(ff.buffer( image_in.polarisation_frame, 117), dtype='b', count=117) else: new_image.wcs = pickle.loads(ff.buffer(image_in.wcs, 2996)) new_image.polarisation_frame = pickle.loads(ff.buffer(image_in.polarisation_frame,117)) return new_image # Write cImage data into C structs def store_image_in_c(img_to, img_from): numpy.copyto(img_to.data, img_from.data) store_image_pickles(img_to, img_from) # Phasecentres are too Pythonic to handle right now, so we pickle them def store_phasecentre(c_phasecentre, phasecentre): store_pickle(c_phasecentre, phasecentre, raw_c_ptr=True) def load_phasecentre(c_phasecentre): return load_pickle(c_phasecentre, 4999) def store_image_in_c_2(img_to, img_from): numpy.copyto(img_to.data, img_from.data) store_image_pickles(img_to, img_from)
{ "repo_name": "SKA-ScienceDataProcessor/algorithm-reference-library", "path": "deprecated_code/ffiwrappers/src/arlwrap_support.py", "copies": "1", "size": "6364", "license": "apache-2.0", "hash": -703055979540557400, "line_mean": 30.3497536946, "line_max": 95, "alpha_frac": 0.5691389063, "autogenerated": false, "ratio": 3.197989949748744, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.9188585879665159, "avg_score": 0.015708595276717214, "num_lines": 203 }
__author__ = 'boris' from scipy.stats.mstats import winsorize import scipy.stats as stats import matplotlib matplotlib.use('Agg') import matplotlib.pyplot as plt from collections import defaultdict import numpy import math import mod_lib import mod_utils import operator import os import uniform_colormaps from statsmodels.nonparametric.smoothers_lowess import lowess from matplotlib import rc plt.rcParams['pdf.fonttype'] = 42 #leaves most text as actual text in PDFs, not outlines #plt.rcParams["font.family"] = "sans-serif" rc('font',**{'family':'sans-serif','sans-serif':['Bitstream Vera Sans']}) #rc('text', usetex=True) def plot_mutated_nts_pie(libraries, out_prefix, subtract_background=False, subtract_control=False, exclude_constitutive=False): #Makes an array of pie charts, 1 per library if subtract_background: #if subtracting background, need to only look at those which have a defined control libraries = [library for library in libraries if (library.lib_settings.sample_name in library.experiment_settings.get_property('experimentals')) or (library.lib_settings.sample_name in library.experiment_settings.get_property('with_mod_controls'))] elif subtract_control: #if subtracting background, need to only look at those which have a defined control libraries = [library for library in libraries if library.lib_settings.sample_name in library.experiment_settings.get_property('experimentals')] num_subplots = len(libraries) num_plots_wide = math.ceil(math.sqrt(num_subplots)) num_plots_high = num_plots_wide fig = plt.figure(figsize=(4*num_plots_wide, 4*num_plots_high)) fig.subplots_adjust(wspace=0.4, hspace=0.4) plot_index =1 for library in libraries: plot = fig.add_subplot(num_plots_high, num_plots_wide, plot_index) mutated_nts_count = library.count_mutation_rates_by_nucleotide(subtract_background=subtract_background, subtract_control=subtract_control, exclude_constitutive=exclude_constitutive) labels = sorted(mutated_nts_count.keys()) sizes = numpy.array([mutated_nts_count[nt] for nt in labels]) total = float(sum(sizes)) sizes = sizes/total merged_labels = ['%s %.3f' % (labels[i], sizes[i]) for i in range(len(sizes))] plot.pie(sizes, labels = merged_labels, colors = mod_utils.rainbow) plot.set_title(library.lib_settings.sample_name) plot_index += 1 if subtract_background: plt.suptitle('background-subtracted mutation rate fractions') if subtract_control: plt.suptitle('control-subtracted mutation rate fractions') else: plt.suptitle('mutation rate fractions') plt.savefig(out_prefix + '.pdf', transparent='True', format='pdf') plt.clf() def plot_rt_stop_pie(libraries, out_prefix, subtract_background=False, subtract_control=False, exclude_constitutive=False): #Makes an array of pie charts, 1 per library if subtract_background: #if subtracting background, need to only look at those which have a defined control libraries = [library for library in libraries if (library.lib_settings.sample_name in library.experiment_settings.get_property('experimentals')) or (library.lib_settings.sample_name in library.experiment_settings.get_property('with_mod_controls'))] num_subplots = len(libraries) num_plots_wide = math.ceil(math.sqrt(num_subplots)) num_plots_high = num_plots_wide fig = plt.figure(figsize=(4*num_plots_wide, 4*num_plots_high)) fig.subplots_adjust(wspace=0.4, hspace=0.4) plot_index =1 for library in libraries: plot = fig.add_subplot(num_plots_high, num_plots_wide, plot_index) rt_stop_count = library.count_rt_stop_rpm_by_nucleotide(subtract_background=subtract_background, subtract_control=subtract_control, exclude_constitutive=exclude_constitutive) labels = sorted(rt_stop_count.keys()) sizes = numpy.array([rt_stop_count[nt] for nt in labels]) total = float(sum(sizes)) sizes = sizes/total merged_labels = ['%s %.3f' % (labels[i], sizes[i]) for i in range(len(sizes))] plot.pie(sizes, labels = merged_labels, colors = mod_utils.rainbow) plot.set_title(library.lib_settings.sample_name) plot_index += 1 if subtract_background: plt.suptitle('background-subtracted fraction of RT stops') else: plt.suptitle('fraction of RT stops') plt.savefig(out_prefix + '.pdf', transparent='True', format='pdf') plt.clf() def plot_mutation_breakdown_pie(libraries, out_prefix, exclude_constitutive=False): #Makes an array of pie charts, 4 pers library, with types of mutations for each nt num_subplots = len(libraries)*4 num_plots_wide = 4 num_plots_high = len(libraries) fig = plt.figure(figsize=(16, 4*num_plots_high)) fig.subplots_adjust(wspace=0.4, hspace=0.4) plot_index =1 for library in libraries: mutated_nts_count = library.count_mutation_types_by_nucleotide(exclude_constitutive=exclude_constitutive) for nt in 'ATCG': plot = fig.add_subplot(num_plots_high, num_plots_wide, plot_index) sorted_muts = sorted(mutated_nts_count[nt].items(), key=operator.itemgetter(1), reverse=True) labels = [pair[0] for pair in sorted_muts[:4]] others = [pair[0] for pair in sorted_muts[4:]] sizes = [mutated_nts_count[nt][mut_type] for mut_type in labels] labels.append('other') other_sum = sum([mutated_nts_count[nt][mut_type] for mut_type in others]) sizes.append(other_sum) sizes = numpy.array(sizes) total = float(sum(sizes)) sizes = sizes/total merged_labels = ['%s %.3f' % (labels[i], sizes[i]) for i in range(len(sizes))] plot.pie(sizes, labels = merged_labels, colors = mod_utils.rainbow) plot.set_title(library.lib_settings.sample_name) plot_index += 1 plt.suptitle('mutation rate type fractions') plt.savefig(out_prefix + '.pdf', transparent='True', format='pdf') plt.clf() def plot_mutation_rate_cdfs(libraries, out_prefix, nucleotides_to_count='ATCG', exclude_constitutive=False): #Makes 2 CDF plots. One of all libraries, showing the coverage-normalized mutation rates # and one showing background-subtracted mutation rates fig = plt.figure(figsize=(16, 16)) plots = [] plot = fig.add_subplot(221) plots.append(plot) colormap = plt.get_cmap('nipy_spectral') colorindex = 0 for library in libraries: all_mutation_rates = [val for val in library.list_mutation_rates(subtract_background=False, subtract_control=False, nucleotides_to_count=nucleotides_to_count, exclude_constitutive=exclude_constitutive)] plot.hist(all_mutation_rates, 10000, normed=1, cumulative=True, histtype='step', color=colormap(colorindex/float(len(libraries))), label=library.lib_settings.sample_name, lw=2) colorindex += 1 plot.set_xlabel("mutation rate") plot.set_title('raw mutation rates') lg=plt.legend(loc=4,prop={'size':6}, labelspacing=0.2) lg.draw_frame(False) plot.set_xlim(-0.001, 0.02) plot = fig.add_subplot(222) plots.append(plot) colorindex = 0 libraries_to_plot = [library for library in libraries if library.lib_settings.sample_name in library.experiment_settings.get_property('experimentals')] for library in libraries_to_plot: all_mutation_rates = [val for val in library.list_mutation_rates(subtract_background=True, subtract_control=False, nucleotides_to_count=nucleotides_to_count, exclude_constitutive=exclude_constitutive)] plot.hist(all_mutation_rates, 10000, normed=1, cumulative=True, histtype='step', color=colormap(colorindex/float(len(libraries))), label=library.lib_settings.sample_name, lw=2) colorindex += 1 plot.set_xlabel("background-subtracted mutation rate") plot.set_title('normalized mutation rates') lg=plt.legend(loc=4,prop={'size':6}, labelspacing=0.2) lg.draw_frame(False) plot.set_xlim(-0.001, 0.02) plot = fig.add_subplot(223) plots.append(plot) colormap = plt.get_cmap('nipy_spectral') colorindex = 0 for library in libraries: all_mutation_rates = [math.log(val, 10) for val in library.list_mutation_rates(subtract_background=False, subtract_control=False, nucleotides_to_count=nucleotides_to_count, exclude_constitutive=exclude_constitutive) if val>0] plot.hist(all_mutation_rates, 10000, normed=1, cumulative=True, histtype='step', color=colormap(colorindex/float(len(libraries))), label=library.lib_settings.sample_name, lw=2) colorindex += 1 plot.set_xlabel("log10 mutation rate") plot.set_title('raw mutation rates') lg=plt.legend(loc=2,prop={'size':6}, labelspacing=0.2) lg.draw_frame(False) plot.set_xlim(-5, -1) plot = fig.add_subplot(224) plots.append(plot) colorindex = 0 libraries_to_plot = [library for library in libraries if library.lib_settings.sample_name in library.experiment_settings.get_property('experimentals')] for library in libraries_to_plot: all_mutation_rates = [math.log(val, 10) for val in library.list_mutation_rates(subtract_background=True, subtract_control=False, nucleotides_to_count=nucleotides_to_count, exclude_constitutive=exclude_constitutive) if val>0] plot.hist(all_mutation_rates, 10000, normed=1, cumulative=True, histtype='step', color=colormap(colorindex/float(len(libraries))), label=library.lib_settings.sample_name, lw=2) colorindex += 1 plot.set_xlabel("background-subtracted log10 mutation rate") plot.set_title('normalized mutation rates') lg=plt.legend(loc=2,prop={'size':6}, labelspacing=0.2) lg.draw_frame(False) plot.set_xlim(-5, -1) for plot in plots: plot.set_ylabel("cumulative fraction of %s nucleotides" % (nucleotides_to_count)) plot.set_ylim(0, 1) plt.tight_layout() plt.savefig(out_prefix + '.pdf', transparent='True', format='pdf') plt.clf() def plot_rt_stop_cdfs(libraries, out_prefix, nucleotides_to_count='ATCG', exclude_constitutive=False): #Makes 2 CDF plots. One of all libraries, showing the coverage-normalized mutation rates # and one showing background-subtracted mutation rates fig = plt.figure(figsize=(16, 16)) plots = [] plot = fig.add_subplot(221) plots.append(plot) colormap = plt.get_cmap('nipy_spectral') colorindex = 0 for library in libraries: all_mutation_rates = [val for val in library.list_rt_stop_rpms(subtract_background=False, subtract_control=False, nucleotides_to_count=nucleotides_to_count, exclude_constitutive=exclude_constitutive)] plot.hist(all_mutation_rates, 10000, normed=1, cumulative=True, histtype='step', color=colormap(colorindex/float(len(libraries))), label=library.lib_settings.sample_name, lw=2) colorindex += 1 plot.set_xlabel("RT stop RPMs") #plot.set_title('raw mutation rates') lg=plt.legend(loc=4,prop={'size':6}, labelspacing=0.2) lg.draw_frame(False) plot.set_xlim(0, 10000) plot = fig.add_subplot(222) plots.append(plot) colorindex = 0 libraries_to_plot = [library for library in libraries if library.lib_settings.sample_name in library.experiment_settings.get_property('experimentals')] for library in libraries_to_plot: all_mutation_rates = [val for val in library.list_rt_stop_rpms(subtract_background=True, subtract_control=False, nucleotides_to_count=nucleotides_to_count, exclude_constitutive=exclude_constitutive)] plot.hist(all_mutation_rates, 10000, normed=1, cumulative=True, histtype='step', color=colormap(colorindex/float(len(libraries))), label=library.lib_settings.sample_name, lw=2) colorindex += 1 plot.set_xlabel("background-subtracted RT-stop RPMs") #plot.set_title('normalized mutation rates') lg=plt.legend(loc=4,prop={'size':6}, labelspacing=0.2) lg.draw_frame(False) plot.set_xlim(0, 10000) plot = fig.add_subplot(223) plots.append(plot) colormap = plt.get_cmap('nipy_spectral') colorindex = 0 for library in libraries: all_mutation_rates = [math.log(val, 10) for val in library.list_rt_stop_rpms(subtract_background=False, subtract_control=False, nucleotides_to_count=nucleotides_to_count, exclude_constitutive=exclude_constitutive) if val>0] plot.hist(all_mutation_rates, 10000, normed=1, cumulative=True, histtype='step', color=colormap(colorindex/float(len(libraries))), label=library.lib_settings.sample_name, lw=2) colorindex += 1 plot.set_xlabel("log10 RT stop RPMs") #plot.set_title('raw mutation rates') lg=plt.legend(loc=2,prop={'size':6}, labelspacing=0.2) lg.draw_frame(False) plot.set_xlim(0, 5) plot = fig.add_subplot(224) plots.append(plot) colorindex = 0 libraries_to_plot = [library for library in libraries if library.lib_settings.sample_name in library.experiment_settings.get_property('experimentals')] for library in libraries_to_plot: all_mutation_rates = [math.log(val, 10) for val in library.list_rt_stop_rpms(subtract_background=True, subtract_control=False, nucleotides_to_count=nucleotides_to_count, exclude_constitutive=exclude_constitutive) if val>0] plot.hist(all_mutation_rates, 10000, normed=1, cumulative=True, histtype='step', color=colormap(colorindex/float(len(libraries))), label=library.lib_settings.sample_name, lw=2) colorindex += 1 plot.set_xlabel("background-subtracted log10 RT stop RPMs") #plot.set_title('normalized mutation rates') lg=plt.legend(loc=2,prop={'size':6}, labelspacing=0.2) lg.draw_frame(False) plot.set_xlim(0, 5) for plot in plots: plot.set_ylabel("cumulative fraction of %s nucleotides" % (nucleotides_to_count)) plot.set_ylim(0, 1) plt.tight_layout() plt.savefig(out_prefix + '.pdf', transparent='True', format='pdf') plt.clf() def plot_mutation_rate_violins(libraries, out_prefix, nucleotides_to_count='ATCG', exclude_constitutive=False): #Makes violin plots of raw mutation rates data = [] labels = [] for library in libraries: labels.append(library.lib_settings.sample_name) data.append([math.log10(val) for val in library.list_mutation_rates(subtract_background=False, subtract_control=False, nucleotides_to_count=nucleotides_to_count, exclude_constitutive=exclude_constitutive) if val>0]) colormap = uniform_colormaps.viridis fig = plt.figure(figsize=(5,8)) ax1 = fig.add_subplot(111) # Hide the grid behind plot objects ax1.yaxis.grid(True, linestyle='-', which='major', color='lightgrey', alpha=0.5) ax1.set_axisbelow(True) #ax1.set_xlabel(ylabel) plt.subplots_adjust(left=0.1, right=0.95, top=0.9, bottom=0.25) pos = range(1,len(libraries)+1) # starts at 1 to play nice with boxplot dist = max(pos)-min(pos) w = min(0.15*max(dist,1.0),0.5) for library,p in zip(libraries,pos): d = [math.log10(val) for val in library.list_mutation_rates(subtract_background=False, subtract_control=False, nucleotides_to_count=nucleotides_to_count, exclude_constitutive=exclude_constitutive) if val>0] k = stats.gaussian_kde(d) #calculates the kernel density m = k.dataset.min() #lower bound of violin M = k.dataset.max() #upper bound of violin x = numpy.arange(m,M,(M-m)/100.) # support for violin v = k.evaluate(x) #violin profile (density curve) v = v/v.max()*w #scaling the violin to the available space plt.fill_betweenx(x,p,v+p,facecolor=colormap((p-1)/float(len(libraries))),alpha=0.3) plt.fill_betweenx(x,p,-v+p,facecolor=colormap((p-1)/float(len(libraries))),alpha=0.3) if True: bplot = plt.boxplot(data,notch=1) plt.setp(bplot['boxes'], color='black') plt.setp(bplot['whiskers'], color='black') plt.setp(bplot['fliers'], color='red', marker='.') per50s = [] i = 1 for datum in data: #per50s.append(stats.scoreatpercentile(datum, 50)) t = stats.scoreatpercentile(datum, 50) per50s.append(t) #ax1.annotate(str(round(t,3)), xy=(i+0.1, t), xycoords='data', arrowprops=None, fontsize='small', color='black') i+= 1 #ax1.set_xticks([0.0, 0.5, 1.0, 1.5]) #ax1.set_yscale('log') ax1.set_ylabel('log10 mutation rate') ax1.set_ylim(-5, 0) xtickNames = plt.setp(ax1, xticklabels=labels) plt.setp(xtickNames, rotation=90, fontsize=6) plt.savefig(out_prefix+'.pdf', transparent='True', format='pdf') plt.clf() def plot_rt_stop_violins(libraries, out_prefix, nucleotides_to_count='ATCG', exclude_constitutive=False): #Makes violin plots of raw mutation rates data = [] labels = [] for library in libraries: labels.append(library.lib_settings.sample_name) data.append([math.log10(val+1) for val in library.list_rt_stop_rpms(subtract_background=False, subtract_control=False, nucleotides_to_count=nucleotides_to_count, exclude_constitutive=exclude_constitutive)]) colormap = uniform_colormaps.viridis fig = plt.figure(figsize=(5,8)) ax1 = fig.add_subplot(111) # Hide the grid behind plot objects ax1.yaxis.grid(True, linestyle='-', which='major', color='lightgrey', alpha=0.5) ax1.set_axisbelow(True) #ax1.set_xlabel(ylabel) plt.subplots_adjust(left=0.1, right=0.95, top=0.9, bottom=0.25) pos = range(1,len(libraries)+1) # starts at 1 to play nice with boxplot dist = max(pos)-min(pos) w = min(0.15*max(dist,1.0),0.5) for library,p in zip(libraries,pos): d = [math.log10(val+1) for val in library.list_rt_stop_rpms(subtract_background=False, subtract_control=False, nucleotides_to_count=nucleotides_to_count, exclude_constitutive=exclude_constitutive)] k = stats.gaussian_kde(d) #calculates the kernel density m = k.dataset.min() #lower bound of violin M = k.dataset.max() #upper bound of violin x = numpy.arange(m,M,(M-m)/100.) # support for violin v = k.evaluate(x) #violin profile (density curve) v = v/v.max()*w #scaling the violin to the available space plt.fill_betweenx(x,p,v+p,facecolor=colormap((p-1)/float(len(libraries))),alpha=0.3) plt.fill_betweenx(x,p,-v+p,facecolor=colormap((p-1)/float(len(libraries))),alpha=0.3) if True: bplot = plt.boxplot(data,notch=1) plt.setp(bplot['boxes'], color='black') plt.setp(bplot['whiskers'], color='black') plt.setp(bplot['fliers'], color='red', marker='.') per50s = [] i = 1 for datum in data: #per50s.append(stats.scoreatpercentile(datum, 50)) t = stats.scoreatpercentile(datum, 50) per50s.append(t) #ax1.annotate(str(round(t,3)), xy=(i+0.1, t), xycoords='data', arrowprops=None, fontsize='small', color='black') i+= 1 #ax1.set_xticks([0.0, 0.5, 1.0, 1.5]) #ax1.set_yscale('log') ax1.set_ylabel('log10 RT stop RPM +1') ax1.set_ylim(0, 5) xtickNames = plt.setp(ax1, xticklabels=labels) plt.setp(xtickNames, rotation=90, fontsize=6) plt.savefig(out_prefix+'.pdf', transparent='True', format='pdf') plt.clf() def ma_plots_interactive(libraries, out_prefix, nucleotides_to_count='ATCG', exclude_constitutive=False, max_fold_reduction=0.001, max_fold_increase=100): """ :param libraries: :param out_prefix: :param nucleotides_to_count: :param exclude_constitutive: :return: for each library use bokeh to plot an interactive plot of average magnitude of signal (experimental+control)/2 vs log10 fold change (experimental/control). Protected and de-protected calls will be colored, based on a fold change cutoff and confidence interval. All nucleotides will be labelled on mouseover. """ from bokeh.plotting import figure, output_file, show, save, ColumnDataSource, gridplot from bokeh.models import Range1d from bokeh.models import HoverTool from collections import OrderedDict # output to static HTML file output_file("%s.html" % (out_prefix)) plot_figs=[] for library in libraries: mag, fold_change, annotation = [], [], [] prot_mag, prot_fold_change, prot_annotation = [], [], [] deprot_mag, deprot_fold_change, deprot_annotation = [], [], [] for rRNA_name in library.rRNA_mutation_data: for position in library.rRNA_mutation_data[rRNA_name].nucleotides: nucleotide = library.rRNA_mutation_data[rRNA_name].nucleotides[position] if (exclude_constitutive and nucleotide.exclude_constitutive)or nucleotide.identity not in nucleotides_to_count: continue else: protection_call = nucleotide.determine_protection_status(confidence_interval=library.experiment_settings.get_property('confidence_interval_cutoff'), fold_change_cutoff=library.experiment_settings.get_property('fold_change_cutoff')) control_fold_change = nucleotide.get_control_fold_change_in_mutation_rate() avg_mutation_rate = (nucleotide.mutation_rate+nucleotide.get_control_nucleotide().mutation_rate)/2.0 if control_fold_change == 0: control_fold_change = max_fold_reduction elif control_fold_change == float('inf'): control_fold_change = max_fold_increase if protection_call == 'no_change': mag.append(avg_mutation_rate) fold_change.append(control_fold_change) annotation.append('%s_%s%d' %(rRNA_name,nucleotide.identity,position)) elif protection_call == 'deprotected': deprot_mag.append(avg_mutation_rate) deprot_fold_change.append(control_fold_change) deprot_annotation.append('%s_%s%d' %(rRNA_name,nucleotide.identity,position)) elif protection_call == 'protected': prot_mag.append(avg_mutation_rate) prot_fold_change.append(control_fold_change) prot_annotation.append('%s_%s%d' %(rRNA_name,nucleotide.identity,position)) source = ColumnDataSource(data=dict(x = mag, y = fold_change, label = annotation)) prot_source = ColumnDataSource(data=dict(x = prot_mag, y = prot_fold_change, label = prot_annotation)) deprot_source = ColumnDataSource(data=dict(x = deprot_mag, y = deprot_fold_change, label = deprot_annotation)) TOOLS = "pan,wheel_zoom,reset,save,hover" PlotFig = figure(x_axis_label = "avg signal ([%s] + [%s])/2" % (library.lib_settings.sample_name, library.get_normalizing_lib_with_mod().lib_settings.sample_name), y_axis_label = "fold change [%s]/[%s]" % (library.lib_settings.sample_name, library.get_normalizing_lib_with_mod().lib_settings.sample_name), y_axis_type="log", x_axis_type="log", tools=TOOLS, toolbar_location="right") PlotFig.circle("x", "y", size = 5, source=source, color=mod_utils.bokeh_black) PlotFig.circle("x", "y", size = 5, source=prot_source, color=mod_utils.bokeh_vermillion) PlotFig.circle("x", "y", size = 5, source=deprot_source, color=mod_utils.bokeh_bluishGreen) PlotFig.x_range = Range1d(start=0.00001, end=1) PlotFig.y_range = Range1d(start=.001, end=100) #adjust what information you get when you hover over it Hover = PlotFig.select(dict(type=HoverTool)) Hover.tooltips = OrderedDict([("nuc", "@label")]) plot_figs.append([PlotFig]) p = gridplot(plot_figs) save(p) def ma_plots_interactive_by_count(libraries, out_prefix, nucleotides_to_count='ATCG', exclude_constitutive=False, max_fold_reduction=0.001, max_fold_increase=100, lowess_correct=False): """ :param libraries: :param out_prefix: :param nucleotides_to_count: :param exclude_constitutive: :param max_fold_reduction: :param max_fold_increase: :param lowess_correct: wether to use lowess regression to correct fold_change data :return: for each library use bokeh to plot an interactive plot of average magnitude of signal (experimental+control)/2 vs log10 fold change (experimental/control). Protected and de-protected calls will be colored, based on a fold change cutoff and confidence interval. All nucleotides will be labelled on mouseover. """ from bokeh.plotting import figure, output_file, show, save, ColumnDataSource, gridplot from bokeh.models import Range1d from bokeh.models import HoverTool from collections import OrderedDict # output to static HTML file output_file("%s.html" % (out_prefix)) plot_figs=[] for library in libraries: mag, fold_change, annotation = [], [], [] prot_mag, prot_fold_change, prot_annotation = [], [], [] deprot_mag, deprot_fold_change, deprot_annotation = [], [], [] if lowess_correct: library.lowess_correct_mutation_fold_changes(nucleotides_to_count = nucleotides_to_count, exclude_constitutive=exclude_constitutive, max_fold_reduction=max_fold_reduction, max_fold_increase=max_fold_increase) for rRNA_name in library.rRNA_mutation_data: for position in library.rRNA_mutation_data[rRNA_name].nucleotides: nucleotide = library.rRNA_mutation_data[rRNA_name].nucleotides[position] if (exclude_constitutive and nucleotide.exclude_constitutive)or nucleotide.identity not in nucleotides_to_count: continue else: protection_call = nucleotide.determine_protection_status(confidence_interval=library.experiment_settings.get_property('confidence_interval_cutoff'), fold_change_cutoff=library.experiment_settings.get_property('fold_change_cutoff'), lowess_correct=lowess_correct) if lowess_correct: control_fold_change = nucleotide.lowess_fc else: control_fold_change = nucleotide.get_control_fold_change_in_mutation_rate() avg_mutation_rate = (nucleotide.total_mutation_counts+nucleotide.get_control_nucleotide().total_mutation_counts)/2.0 if control_fold_change == 0: control_fold_change = max_fold_reduction elif control_fold_change == float('inf'): control_fold_change = max_fold_increase if protection_call == 'no_change': mag.append(avg_mutation_rate) fold_change.append(control_fold_change) annotation.append('%s_%s%d' %(rRNA_name,nucleotide.identity,position)) elif protection_call == 'deprotected': deprot_mag.append(avg_mutation_rate) deprot_fold_change.append(control_fold_change) deprot_annotation.append('%s_%s%d' %(rRNA_name,nucleotide.identity,position)) elif protection_call == 'protected': prot_mag.append(avg_mutation_rate) prot_fold_change.append(control_fold_change) prot_annotation.append('%s_%s%d' %(rRNA_name,nucleotide.identity,position)) source = ColumnDataSource(data=dict(x = mag, y = fold_change, label = annotation)) prot_source = ColumnDataSource(data=dict(x = prot_mag, y = prot_fold_change, label = prot_annotation)) deprot_source = ColumnDataSource(data=dict(x = deprot_mag, y = deprot_fold_change, label = deprot_annotation)) fc_log = [math.log(fc, 10) for fc in fold_change] mag_log = [math.log(m, 10) if m>0 else -1. for m in mag] lowess_fc_log = lowess(fc_log, mag_log, return_sorted=False) lowess_fc = 10**lowess_fc_log lowess_fc_sort_by_mag = [x for (y,x) in sorted(zip(mag,lowess_fc), key=lambda pair: pair[0])] lowess_line = ColumnDataSource(data=dict(x = sorted(mag), y = lowess_fc_sort_by_mag)) TOOLS = "pan,wheel_zoom,reset,save,hover" PlotFig = figure(x_axis_label = "average mutation counts", y_axis_label = "fold change [%s]/[%s]" % (library.lib_settings.sample_name, library.get_normalizing_lib_with_mod().lib_settings.sample_name), y_axis_type="log", x_axis_type="log", tools=TOOLS, toolbar_location="right") PlotFig.circle("x", "y", size = 5, source=source, color=mod_utils.bokeh_black) PlotFig.circle("x", "y", size = 5, source=prot_source, color=mod_utils.bokeh_vermillion) PlotFig.circle("x", "y", size = 5, source=deprot_source, color=mod_utils.bokeh_bluishGreen) PlotFig.line("x", "y", source=lowess_line, color='red', line_dash='dashed') PlotFig.x_range = Range1d(start=.1, end=100000) PlotFig.y_range = Range1d(start=.001, end=100) #adjust what information you get when you hover over it Hover = PlotFig.select(dict(type=HoverTool)) Hover.tooltips = OrderedDict([("nuc", "@label")]) plot_figs.append([PlotFig]) p = gridplot(plot_figs) save(p) def ma_plots(libraries, out_prefix, nucleotides_to_count='ATCG', exclude_constitutive=False, max_fold_reduction=0.001, max_fold_increase=100): """ :param libraries: :param out_prefix: :param nucleotides_to_count: :param exclude_constitutive: :return: for each library use bokeh to plot an interactive plot of magnitude of signal (experimental+control)/2 vs log10 fold change (experimental/control). Protected and de-protected calls will be colored, based on a fold change cutoff and confidence interval. All nucleotides will be labelled on mouseover. """ output_file = "%s.pdf" % (out_prefix) plot_figs=[] num_subplots = len(libraries) num_plots_wide = math.ceil(math.sqrt(num_subplots)) num_plots_high = num_plots_wide fig = plt.figure(figsize=(4*num_plots_wide, 4*num_plots_high)) fig.subplots_adjust(wspace=0.4, hspace=0.4) plot_index =1 for library in libraries: plot = fig.add_subplot(num_plots_high, num_plots_wide, plot_index) mag, fold_change, annotation = [], [], [] prot_mag, prot_fold_change, prot_annotation = [], [], [] deprot_mag, deprot_fold_change, deprot_annotation = [], [], [] for rRNA_name in library.rRNA_mutation_data: for position in library.rRNA_mutation_data[rRNA_name].nucleotides: nucleotide = library.rRNA_mutation_data[rRNA_name].nucleotides[position] if (exclude_constitutive and nucleotide.exclude_constitutive)or nucleotide.identity not in nucleotides_to_count: continue else: protection_call = nucleotide.determine_protection_status(confidence_interval=library.experiment_settings.get_property('confidence_interval_cutoff'), fold_change_cutoff=library.experiment_settings.get_property('fold_change_cutoff')) control_fold_change = nucleotide.get_control_fold_change_in_mutation_rate() avg_mutation_rate = (nucleotide.mutation_rate+nucleotide.get_control_nucleotide().mutation_rate)/2.0 if control_fold_change == 0: control_fold_change = max_fold_reduction elif control_fold_change == float('inf'): control_fold_change = max_fold_increase if protection_call == 'no_change': mag.append(avg_mutation_rate) fold_change.append(control_fold_change) annotation.append('%s_%s%d' %(rRNA_name,nucleotide.identity,position)) elif protection_call == 'deprotected': deprot_mag.append(avg_mutation_rate) deprot_fold_change.append(control_fold_change) deprot_annotation.append('%s_%s%d' %(rRNA_name,nucleotide.identity,position)) elif protection_call == 'protected': prot_mag.append(avg_mutation_rate) prot_fold_change.append(control_fold_change) prot_annotation.append('%s_%s%d' %(rRNA_name,nucleotide.identity,position)) plot.set_xlabel("([%s] + [%s])/2" % (library.lib_settings.sample_name, library.get_normalizing_lib_with_mod().lib_settings.sample_name), fontsize = 8) plot.set_ylabel("[%s]/[%s]" % (library.lib_settings.sample_name, library.get_normalizing_lib_with_mod().lib_settings.sample_name), fontsize = 8) plot.set_yscale('log') plot.set_xscale('log') plot.scatter(mag, fold_change, color=mod_utils.black, s=3) plot.scatter(prot_mag, prot_fold_change, color=mod_utils.vermillion, s=5) plot.scatter(deprot_mag, deprot_fold_change, color=mod_utils.bluishGreen, s=5) plot.set_xlim(0.00001,1) plot.set_ylim(1/15.,15) plot_figs.append(plot) plot_index+=1 plt.savefig(output_file, transparent='True', format='pdf') def mutation_rate_scatter(libraries, out_prefix, nucleotides_to_count='ATCG', exclude_constitutive=False): """ :param libraries: :param out_prefix: :param nucleotides_to_count: :param exclude_constitutive: :return: for each library use bokeh to plot an interactive plot of magnitude of signal (experimental+control)/2 vs log10 fold change (experimental/control). Protected and de-protected calls will be colored, based on a fold change cutoff and confidence interval. All nucleotides will be labelled on mouseover. """ output_file = "%s.pdf" % (out_prefix) plot_figs=[] num_subplots = len(libraries) num_plots_wide = math.ceil(math.sqrt(num_subplots)) num_plots_high = num_plots_wide fig = plt.figure(figsize=(4*num_plots_wide, 4*num_plots_high)) fig.subplots_adjust(wspace=0.4, hspace=0.4) plot_index =1 for library in libraries: plot = fig.add_subplot(num_plots_high, num_plots_wide, plot_index) x, y, annotation = [], [], [] for rRNA_name in library.rRNA_mutation_data: for position in library.rRNA_mutation_data[rRNA_name].nucleotides: nucleotide = library.rRNA_mutation_data[rRNA_name].nucleotides[position] if (exclude_constitutive and nucleotide.exclude_constitutive)or nucleotide.identity not in nucleotides_to_count: continue else: x.append(nucleotide.mutation_rate) y.append(nucleotide.get_control_nucleotide().mutation_rate) plot.set_xlabel("%s misincorporation fraction" % (library.lib_settings.sample_name), fontsize = 8) plot.set_ylabel("%s misincorporation fraction" % (library.get_normalizing_lib_with_mod().lib_settings.sample_name), fontsize = 8) plot.set_yscale('log') plot.set_xscale('log') x=numpy.array(x) y=numpy.array(y) plot.scatter(x, y, color=mod_utils.black, s=3) logx=numpy.log10(x) logy=numpy.log10(y) logx, logy = mod_utils.filter_x_y_pairs(logx, logy) r, p = stats.pearsonr(logx, logy) plot.annotate("r^2 = {:.2f}".format(r**2), xy=(.1, .9), xycoords=plot.transAxes) plot.set_xlim(0.00001,1) plot.set_ylim(0.00001,1) plot_figs.append(plot) plot_index+=1 plt.savefig(output_file, transparent='True', format='pdf') def scatter_interactive(libraries, out_prefix, nucleotides_to_count='ATCG', exclude_constitutive=False, max_fold_reduction=0.001, max_fold_increase=100): """ :param libraries: :param out_prefix: :param nucleotides_to_count: :param exclude_constitutive: :return: for each library use bokeh to plot an interactive plot of average magnitude of signal (experimental+control)/2 vs log10 fold change (experimental/control). Protected and de-protected calls will be colored, based on a fold change cutoff and confidence interval. All nucleotides will be labelled on mouseover. """ from bokeh.plotting import figure, output_file, show, save, ColumnDataSource, gridplot from bokeh.models import Range1d from bokeh.models import HoverTool from collections import OrderedDict # output to static HTML file output_file("%s.html" % (out_prefix)) plot_figs=[] for library in libraries: x, y, annotation = [], [], [] prot_x, prot_y, prot_annotation = [], [], [] deprot_x, deprot_y, deprot_annotation = [], [], [] for rRNA_name in library.rRNA_mutation_data: for position in library.rRNA_mutation_data[rRNA_name].nucleotides: nucleotide = library.rRNA_mutation_data[rRNA_name].nucleotides[position] if (exclude_constitutive and nucleotide.exclude_constitutive)or nucleotide.identity not in nucleotides_to_count: continue else: protection_call = nucleotide.determine_protection_status(confidence_interval=library.experiment_settings.get_property('confidence_interval_cutoff'), fold_change_cutoff=library.experiment_settings.get_property('fold_change_cutoff')) control_fold_change = nucleotide.get_control_fold_change_in_mutation_rate() avg_mutation_rate = (nucleotide.mutation_rate+nucleotide.get_control_nucleotide().mutation_rate)/2.0 if control_fold_change == 0: control_fold_change = max_fold_reduction elif control_fold_change == float('inf'): control_fold_change = max_fold_increase if protection_call == 'no_change': x.append(nucleotide.get_control_nucleotide().mutation_rate) y.append(nucleotide.mutation_rate) annotation.append('%s_%s%d' %(rRNA_name,nucleotide.identity,position)) elif protection_call == 'deprotected': deprot_x.append(nucleotide.get_control_nucleotide().mutation_rate) deprot_y.append(nucleotide.mutation_rate) deprot_annotation.append('%s_%s%d' %(rRNA_name,nucleotide.identity,position)) elif protection_call == 'protected': prot_x.append(nucleotide.get_control_nucleotide().mutation_rate) prot_y.append(nucleotide.mutation_rate) prot_annotation.append('%s_%s%d' %(rRNA_name,nucleotide.identity,position)) source = ColumnDataSource(data=dict(x = x, y = y, label = annotation)) prot_source = ColumnDataSource(data=dict(x = prot_x, y = prot_y, label = prot_annotation)) deprot_source = ColumnDataSource(data=dict(x = deprot_x, y = deprot_y, label = deprot_annotation)) TOOLS = "pan,wheel_zoom,reset,save,hover" PlotFig = figure(x_axis_label = "%s misincorporation fraction" % (library.get_normalizing_lib_with_mod().lib_settings.sample_name), y_axis_label = "%s misincorporation fraction" % (library.lib_settings.sample_name), y_axis_type="log", x_axis_type="log", tools=TOOLS, toolbar_location="right") PlotFig.circle("x", "y", size = 5, source=source, color=mod_utils.bokeh_black) PlotFig.circle("x", "y", size = 5, source=prot_source, color=mod_utils.bokeh_vermillion) PlotFig.circle("x", "y", size = 5, source=deprot_source, color=mod_utils.bokeh_bluishGreen) PlotFig.x_range = Range1d(start=0.00001, end=1) PlotFig.y_range = Range1d(start=0.00001, end=1) #adjust what information you get when you hover over it Hover = PlotFig.select(dict(type=HoverTool)) Hover.tooltips = OrderedDict([("nuc", "@label")]) plot_figs.append([PlotFig]) p = gridplot(plot_figs) save(p) def ma_plots_by_count(libraries, out_prefix, nucleotides_to_count='ATCG', exclude_constitutive=False, max_fold_reduction=0.001, max_fold_increase=100, lowess_correct=False): """ :param libraries: :param out_prefix: :param nucleotides_to_count: :param exclude_constitutive: :return: for each library use bokeh to plot an interactive plot of magnitude of signal (experimental+control)/2 vs log10 fold change (experimental/control). Protected and de-protected calls will be colored, based on a fold change cutoff and confidence interval. All nucleotides will be labelled on mouseover. """ output_file = "%s.pdf" % (out_prefix) plot_figs=[] num_subplots = len(libraries) num_plots_wide = math.ceil(math.sqrt(num_subplots)) num_plots_high = num_plots_wide fig = plt.figure(figsize=(4*num_plots_wide, 4*num_plots_high)) fig.subplots_adjust(wspace=0.4, hspace=0.4) plot_index =1 for library in libraries: if lowess_correct: library.lowess_correct_mutation_fold_changes(nucleotides_to_count = nucleotides_to_count, exclude_constitutive=exclude_constitutive, max_fold_reduction=max_fold_reduction, max_fold_increase=max_fold_increase) plot = fig.add_subplot(num_plots_high, num_plots_wide, plot_index) mag, fold_change, annotation = [], [], [] prot_mag, prot_fold_change, prot_annotation = [], [], [] deprot_mag, deprot_fold_change, deprot_annotation = [], [], [] for rRNA_name in library.rRNA_mutation_data: for position in library.rRNA_mutation_data[rRNA_name].nucleotides: nucleotide = library.rRNA_mutation_data[rRNA_name].nucleotides[position] if (exclude_constitutive and nucleotide.exclude_constitutive)or nucleotide.identity not in nucleotides_to_count: continue else: protection_call = nucleotide.determine_protection_status(confidence_interval=library.experiment_settings.get_property('confidence_interval_cutoff'), fold_change_cutoff=library.experiment_settings.get_property('fold_change_cutoff'), lowess_correct=lowess_correct) if lowess_correct: control_fold_change = nucleotide.lowess_fc else: control_fold_change = nucleotide.get_control_fold_change_in_mutation_rate() avg_mutation_counts = (nucleotide.total_mutation_counts+nucleotide.get_control_nucleotide().total_mutation_counts)/2.0 if control_fold_change == 0: control_fold_change = max_fold_reduction elif control_fold_change == float('inf'): control_fold_change = max_fold_increase if protection_call == 'no_change': mag.append(avg_mutation_counts) fold_change.append(control_fold_change) annotation.append('%s_%s%d' %(rRNA_name,nucleotide.identity,position)) elif protection_call == 'deprotected': deprot_mag.append(avg_mutation_counts) deprot_fold_change.append(control_fold_change) deprot_annotation.append('%s_%s%d' %(rRNA_name,nucleotide.identity,position)) elif protection_call == 'protected': prot_mag.append(avg_mutation_counts) prot_fold_change.append(control_fold_change) prot_annotation.append('%s_%s%d' %(rRNA_name,nucleotide.identity,position)) fc_log = [math.log(fc, 10) for fc in fold_change] mag_log = [math.log(m, 10) if m>0 else -1. for m in mag] lowess_fc_log = lowess(fc_log, mag_log, return_sorted=False) lowess_fc = 10**lowess_fc_log lowess_fc_sort_by_mag = [x for (y,x) in sorted(zip(mag,lowess_fc), key=lambda pair: pair[0])] plot.set_xlabel("average # mutations", fontsize = 8) plot.set_ylabel("[%s]/[%s]" % (library.lib_settings.sample_name, library.get_normalizing_lib_with_mod().lib_settings.sample_name), fontsize = 8) plot.set_yscale('log') plot.set_xscale('log') plot.scatter(mag, fold_change, color=mod_utils.black, s=3) plot.scatter(prot_mag, prot_fold_change, color=mod_utils.vermillion, s=5) plot.scatter(deprot_mag, deprot_fold_change, color=mod_utils.bluishGreen, s=5) plot.plot(sorted(mag), lowess_fc_sort_by_mag, linestyle='dashed', color='red') plot.set_xlim(1,1000000) plot.set_ylim(1/15.,15) plot_figs.append(plot) plot_index+=1 plt.savefig(output_file, transparent='True', format='pdf') def highlight_structure(libraries, out_prefix, nucleotides_to_count='ATCG', exclude_constitutive=False): """ :param libraries: :param out_prefix: :param nucleotides_to_count: :param exclude_constitutive: :return: for each library use bokeh to plot an interactive plot of magnitude of signal (experimental+control)/2 vs log10 fold change (experimental/control). Protected and de-protected calls will be colored, based on a fold change cutoff and confidence interval. All nucleotides will be labelled on mouseover. """ for library in libraries: protected_nucleotides = library.get_changed_nucleotides('protected', confidence_interval=library.experiment_settings.get_property('confidence_interval_cutoff'), fold_change_cutoff=library.experiment_settings.get_property('fold_change_cutoff')) num_protected = 0 for rRNA in protected_nucleotides: num_protected += len(protected_nucleotides[rRNA]) deprotected_nucleotides = library.get_changed_nucleotides('deprotected', confidence_interval=library.experiment_settings.get_property('confidence_interval_cutoff'), fold_change_cutoff=library.experiment_settings.get_property('fold_change_cutoff')) num_deprotected = 0 for rRNA in deprotected_nucleotides: num_deprotected += len(deprotected_nucleotides[rRNA]) if num_protected>0 or num_deprotected>0: output_file = open(os.path.join(out_prefix, "%s.txt" % (library.lib_settings.sample_name)), 'w') reference_pymol_script_file = open(library.experiment_settings.get_property('pymol_base_script'), 'rU') for line in reference_pymol_script_file: if line.startswith('#<insert nucleotide highlighting here>'): if num_protected>0: rRNA_selections = [] for rRNA in protected_nucleotides: if len(protected_nucleotides[rRNA])>0: rRNA_selections.append('%s and resi %s' % (rRNA, '+'.join([str(nucleotide.position) for nucleotide in protected_nucleotides[rRNA]]))) outline = 'create protected_nucleotides, %s\n' % (' or '.join(rRNA_selections)) output_file.write(outline) if num_deprotected>0: rRNA_selections = [] for rRNA in deprotected_nucleotides: if len(deprotected_nucleotides[rRNA])>0: rRNA_selections.append('%s and resi %s' % (rRNA, '+'.join([str(nucleotide.position) for nucleotide in deprotected_nucleotides[rRNA]]))) outline = 'create deprotected_nucleotides, %s\n' % (' or '.join(rRNA_selections)) output_file.write(outline) elif line.startswith('#<color groups here>'): if num_protected>0: output_file.write('color vermillion, protected_nucleotides\n') if num_deprotected>0: output_file.write('color bluish_green, deprotected_nucleotides\n') elif line.startswith('#<show spheres for changing nucleotides here>'): if num_protected>0: output_file.write('show spheres, protected_nucleotides\n') if num_deprotected>0: output_file.write('deprotected_nucleotides\n') else: output_file.write(line) reference_pymol_script_file.close() output_file.close() def color_by_change(libraries, out_prefix, nucleotides_to_count='ATCG', exclude_constitutive=False, subtract_background=False): for library in libraries: log_fold_changes = {} maxval = 0.0 minval = 0.0 for rRNA_name in library.rRNA_mutation_data: log_fold_changes[rRNA_name] = {} for nucleotide in library.rRNA_mutation_data[rRNA_name].nucleotides: if library.rRNA_mutation_data[rRNA_name].nucleotides[nucleotide].identity in nucleotides_to_count and \ library.rRNA_mutation_data[rRNA_name].nucleotides[nucleotide].\ get_control_fold_change_in_mutation_rate(subtract_background=subtract_background) not in [0.0, float('inf'), float('-inf')]: if exclude_constitutive and library.rRNA_mutation_data[rRNA_name].nucleotides[nucleotide].exclude_constitutive: continue else: log_fold_changes[rRNA_name][nucleotide] = math.log(library.rRNA_mutation_data[rRNA_name].nucleotides[nucleotide].get_control_fold_change_in_mutation_rate(subtract_background=subtract_background), 10) maxval = max(maxval, log_fold_changes[rRNA_name][nucleotide]) minval = min(minval, log_fold_changes[rRNA_name][nucleotide]) else: continue absmax = max(abs(maxval), abs(minval)) output_file = open(os.path.join(out_prefix, "%s.txt" % (library.lib_settings.sample_name)), 'w') reference_pymol_script_file = open(library.experiment_settings.get_property('pymol_base_script_colorchange'), 'rU') for line in reference_pymol_script_file: if line.startswith('#<insert b-factors>'): output_file.write('python\n') output_file.write('cmd.alter(\'all\', \'b=0.0\')\n') for rRNA_name in log_fold_changes: for nucleotide in log_fold_changes[rRNA_name]: output_file.write('cmd.alter(\''+rRNA_name+' and resi '+str(nucleotide)+'\', \'b=float("'+str(log_fold_changes[rRNA_name][nucleotide])+'")\')\n') output_file.write('python end\n') elif line.startswith('#<insert spectrum>'): output_file.write('spectrum b, bluish_green white vermillion, minimum='+str(-absmax)+', maximum='+str(absmax)+'\n') output_file.write('ramp_new scale, S.c.25S__rRNA, ['+str(-absmax)+',0,'+str(absmax)+'], [bluish_green, white, vermillion]') else: output_file.write(line) reference_pymol_script_file.close() output_file.close() def generate_roc_curves(tp_tn_annotations, genome_fasta, outprefix, libraries, rRNA, nucs_to_count): def winsorize_norm_chromosome_data(mut_density, chromosome, genome_dict, nucs_to_count, to_winsorize = False, low = 0, high = 0.95): """ :param read_5p_ends: :param chromosome: :param strand: :param genome_dict: :param nucs_to_count: :param low: :param high: :return: an array (now zero-indexed from 1-indexed) of densities for the given chromosome on the given strand, winsorized, and only for the given nucleotides """ max_position = max(mut_density[chromosome].nucleotides.keys()) density_array =numpy.array([0.0] * max_position) for position in mut_density[chromosome].nucleotides.keys(): if genome_dict[chromosome][position-1] in nucs_to_count: density_array[position-1] = mut_density[chromosome].nucleotides[position].mutation_rate if to_winsorize: winsorize(density_array, limits = (low, 1-high), inplace = True) normed_array = density_array/float(max(density_array)) return normed_array def get_tp_tn(tp_tn_file): TP = set() TN = set() f = open(tp_tn_file) for line in f: ll= line.strip('\n').split('\t') if ll[2] == 'TP': TP.add(int(ll[0])) if ll[2] =='TN': TN.add(int(ll[0])) f.close() return TP, TN def call_positives(density_array, chromosome, genome_dict, nucs_to_count, cutoff): """ :param density_array: :return:a set of called positive positions I've reverted these to 1-indexed to match the TP and TN calls from the structures """ positives = set() for i in range(len(density_array)): if genome_dict[chromosome][i] in nucs_to_count: if density_array[i] >= cutoff: positives.add(i+1)#adding 1 not necessary for RT stops, since the modified nucleotide is the one 1 upstream of the RT stop!!! return positives def plot_ROC_curves(roc_curves, title, out_prefix): fig = plt.figure(figsize=(8,8)) plot = fig.add_subplot(111)#first a pie chart of mutated nts colormap = plt.get_cmap('nipy_spectral') color_index = 0 for name in sorted(roc_curves.keys()): x, y = roc_curves[name] area_under_curve = numpy.trapz(numpy.array(y[::-1])/100., x=numpy.array(x[::-1])/100.) plot.plot(x, y, lw =2, label = '%s %.3f' % (name, area_under_curve), color = colormap(color_index/float(len(roc_curves)))) color_index +=1 plot.plot(numpy.arange(0,100,0.1), numpy.arange(0,100,0.1), lw =1, ls = 'dashed', color = mod_utils.black, label = 'y=x') plot.set_xlabel('False positive rate (%) (100-specificity)') plot.set_ylabel('True positive rate (%) (sensitivity)') plot.set_title(title) lg=plt.legend(loc=4,prop={'size':10}, labelspacing=0.2) lg.draw_frame(False) plt.savefig(out_prefix + '.pdf', transparent='True', format='pdf') plt.clf() sample_names = [library.lib_settings.sample_name for library in libraries] mutation_densities = [library.rRNA_mutation_data for library in libraries] genome_dict = genome_fasta normed_density_arrays = [winsorize_norm_chromosome_data(mutation_density, rRNA, genome_dict, nucs_to_count) for mutation_density in mutation_densities] real_tp, real_tn = get_tp_tn(tp_tn_annotations) roc_curves = {} for sample_name in sample_names: roc_curves[sample_name] = [[],[]]#x and y value arrays for each stepsize = 0.0001 for cutoff in numpy.arange(0,1.+5*stepsize, stepsize): for i in range(len(sample_names)): called_p = call_positives(normed_density_arrays[i], rRNA, genome_dict, nucs_to_count, cutoff) num_tp_called = len(called_p.intersection(real_tp))#how many true positives called at this cutoff num_fp_called = len(called_p.intersection(real_tn))#how many fp positives called at this cutoff roc_curves[sample_names[i]][1].append(100.*num_tp_called/float(len(real_tp)))#TP rate on y axis roc_curves[sample_names[i]][0].append(100.*num_fp_called/float(len(real_tn)))#FP rate on x axis plot_ROC_curves(roc_curves, rRNA, outprefix) def parse_functional_groups(groups_file, delimiter='\t'): return_dict = defaultdict(list) f = open(groups_file, 'rU') lines = f.readlines() headers = lines[0].strip('\n').split(delimiter) for line in lines[1:]: ll= line.strip('\n').split(delimiter) for i in range(len(ll)): if not ll[i].strip() =='': return_dict[headers[i]].append(ll[i]) f.close() return return_dict def plot_functional_group_changes(libraries, out_prefix, groups_file, nucleotides_to_count='ATCG', exclude_constitutive=False, max_fold_reduction=0.001, max_fold_increase=100): """ :param libraries: :param out_prefix: :param nucleotides_to_count: :param exclude_constitutive: :return: for each library make a plot of log10 fold change (experimental/control) between different functional groups. both as a CDF and as a violin plot """ functional_groups = parse_functional_groups(groups_file) group_names = sorted(functional_groups.keys()) for library in libraries: cdf_file = "%s_%s_CDF.pdf" % (out_prefix, library.lib_settings.sample_name) num_plots_wide = 1 num_plots_high = 1 fig = plt.figure(figsize=(4*num_plots_wide, 4*num_plots_high)) plot_index =1 plot = fig.add_subplot(num_plots_high, num_plots_wide, plot_index) colorindex = 0 all_fold_changes = library.list_mutation_fold_changes(nucleotides_to_count=nucleotides_to_count, exclude_constitutive=exclude_constitutive) hist, bin_edges = numpy.histogram(all_fold_changes, bins=10000) cum_hist = numpy.cumsum(hist) cum_hist = cum_hist/float(max(cum_hist)) plot.plot(bin_edges[:-1], cum_hist, color=mod_utils.colors[0], label='all %d (K-S P)' % (len(all_fold_changes)), lw=2) for group_name in group_names: colorindex+=1 group_fold_changes = [nucleotide.get_control_fold_change_in_mutation_rate() for nucleotide in library.get_nucleotides_from_list(functional_groups[group_name], nucleotides_to_count=nucleotides_to_count, exclude_constitutive=exclude_constitutive) if nucleotide.get_control_fold_change_in_mutation_rate() not in [float('inf'), 0]] d, p = stats.ks_2samp(all_fold_changes, group_fold_changes) hist, bin_edges = numpy.histogram(group_fold_changes, bins=10000) cum_hist = numpy.cumsum(hist) cum_hist = cum_hist/float(max(cum_hist)) plot.plot(bin_edges[:-1], cum_hist, color=mod_utils.colors[colorindex],label='%s %d (%f)' % (group_name, len(group_fold_changes), p), lw=2) lg=plt.legend(loc=2,prop={'size':6}, labelspacing=0.2) lg.draw_frame(False) plot.set_ylabel("cumulative nucleotide fraction", fontsize = 8) plot.set_xlabel("[%s]/[%s]" % (library.lib_settings.sample_name, library.get_normalizing_lib_with_mod().lib_settings.sample_name), fontsize = 8) plot.set_xscale('log') plot.set_xlim(.1,10) plot.set_ylim(0, 1) plt.savefig(cdf_file, transparent='True', format='pdf')
{ "repo_name": "borisz264/mod_seq", "path": "mod_plotting.py", "copies": "1", "size": "62033", "license": "mit", "hash": 5215933679536626000, "line_mean": 55.3945454545, "line_max": 223, "alpha_frac": 0.6142698241, "autogenerated": false, "ratio": 3.548595618099651, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.9618462924261684, "avg_score": 0.008880503587593352, "num_lines": 1100 }
__author__ = 'boris' """ Based on the Rouskin DMS-seq paper: True Positives: Bases that are unpaired in the secondary structure, and the reactive atom has a solvent accessible surface area (to a 3A radius sphere) of greater than 2A squared. True Negatives: are Watson-crick paired (A-U or C-G) in the secondary structure model """ import mod_utils import sys from unused_scripts.rna import rna class rRNA: def __init__(self, bpseq_filename): self.nucleotides = {} self.parse_bpseq(bpseq_filename) def parse_bpseq(self, bpseq_filename): """ :param bpseq_filename: :return: a dictionary mapping position """ f = open(bpseq_filename, 'rU') lines = f.readlines() for line in lines[4:]: nt_num, nt_ident, paired_to = line.rstrip().split(' ') self.nucleotides[int(nt_num)] = nucleotide(self, nt_num, nt_ident, paired_to) f.close() def parse_rouskin_accessibility(self, filenames): for filename in filenames: f = open(filename, 'rU') for line in f: ll = line.rstrip().split('\t') self.nucleotides[int(ll[0])].sasa = float(ll[1]) f.close() def parse_zinshteyn_accessibility(self, filename): f = open(filename) for line in f: ll = line.rstrip().split('\t') assert rna(ll[1]) == self.nucleotides[int(ll[0])].identity self.nucleotides[int(ll[0])].sasa = float(ll[2]) f.close() def write_to_file(self, sasa_cutoff, nucs_to_test, output_prefix): f = open('%s_%.1f_%s.txt' % (output_prefix, sasa_cutoff, nucs_to_test), 'w') for nt_pos in self.nucleotides: nuc = self.nucleotides[nt_pos] assert nt_pos == nuc.position assert not (nuc.is_true_positive(sasa_cutoff) and nuc.is_true_negative()) if nuc.identity in nucs_to_test: if nuc.is_true_positive(sasa_cutoff): result_string = 'TP' elif nuc.is_true_negative(): result_string = 'TN' else: result_string = 'X' else: result_string = 'X' f.write('%d\t%s\t%s\n' % (nuc.position, nuc.identity, result_string)) class nucleotide: def __init__(self, rRNA, position, identity, paired_to): self.rRNA = rRNA self.identity = identity self.position = int(position) self.paired_to = int(paired_to) self.sasa = None #solvent accessible surface ares def is_WC_paired(self): if not self.paired_to == 0: if mod_utils.revComp(self.identity, isRNA = True) == self.rRNA.nucleotides[self.paired_to].identity: #if this nucleotide is the WC complement of the one it's paired to, return True return True return False def is_true_positive(self, sasa_cutoff): if (not self.is_WC_paired()) and (not self.sasa == None) and self.sasa > sasa_cutoff: return True else: return False def is_true_negative(self): if self.is_WC_paired(): return True else: return False def main(): bpseq_filename, outprefix = sys.argv[1:3] #rouskin_sasa_files = sys.argv[3:] zin_sasa_file = sys.argv[3] rRNA_data = rRNA(bpseq_filename) #rRNA_data.parse_rouskin_accessibility(rouskin_sasa_files) rRNA_data.parse_zinshteyn_accessibility(zin_sasa_file) rRNA_data.write_to_file(2.0, 'AC', outprefix) if __name__ == '__main__': main()
{ "repo_name": "borisz264/mod_seq", "path": "structure_ROC_curves/compute_true_positives_negative.py", "copies": "1", "size": "3646", "license": "mit", "hash": -5654917576875624000, "line_mean": 33.4056603774, "line_max": 118, "alpha_frac": 0.5781678552, "autogenerated": false, "ratio": 3.269955156950673, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.4348123012150673, "avg_score": null, "num_lines": null }
__author__ = 'boris' """ inputs: outfolder - where to put all the results control_file_name - a pickled dict of [strand][chromosome][position] = background-subtracted mutations/coverage output from normalize_to_control_make_wig.py - this is already a comparison of modifier to no modifier. experimental_file_names - any number of files, of same format as control file, to be compared to the control. outputs: for each file, a WIG file with the max rescaled to 1 ?add pseudocounts? for each experimental file, a WIG of the log2 ratio of experimental/control for each experimental file, a WIG of the log2 ratio of experimental/control, which were rescaled before comparison. for each experimental file, a pickled dictionary of the log2 ratio, in the same format as above for each experimental file, a pickled dictionary of the log2 ratio, previously rescaled as above """ import sys import mod_utils import os import gzip from scipy.stats.mstats import winsorize import matplotlib.pyplot as plt from collections import defaultdict import numpy import math plt.rcParams['pdf.fonttype'] = 42 #leaves most text as actual text in PDFs, not outlines def write_wig(mutation_dict, sample_name, output_prefix): """ :param mutation_dict: a pickled dict of [strand][chromosome][position] = mutations/coverage :param output_prefix: :return: """ score_table = open(output_prefix+'_scores.txt', 'w') plusWig = gzip.open(output_prefix+'_plus.wig.gz', 'w') #minusWig = gzip.open(output_prefix+'_minus.wig.gz', 'w') plusWig.write('track type=wiggle_0 name=%s\n' % (sample_name+'_plus')) #minusWig.write('track type=wiggle_0 name=%s\n' % (sample_name+'_minus')) allChrs=set(mutation_dict['+'].keys()).union(set(mutation_dict['-'].keys())) for chr in allChrs: #minPos = min([min(weightedReads['+'][chr].keys()), min(weightedReads['-'][chr].keys())]) #maxPos = max([max(weightedReads['+'][chr].keys()), max(weightedReads['-'][chr].keys())]) plusWig.write('variableStep chrom=%s\n' % (chr)) #minusWig.write('variableStep chrom=%s\n' % (chr)) if chr in mutation_dict['+']: for i in sorted(mutation_dict['+'][chr].keys()): plusWig.write('%d\t%f\n' % (i, mutation_dict['+'][chr][i])) score_table.write('%s_%d\t%f\n' % (chr, i, mutation_dict['+'][chr][i])) #if chr in mutation_dict['-']: #for i in sorted(mutation_dict['-'][chr].keys()): #minusWig.write('%d\t%f\n' % (i, mutation_dict['-'][chr][i]/mutation_dict)) plusWig.close() score_table.close() #minusWig.close() def normalize_dict_to_max(mutation_dict, winsorize_data = False, winsorization_limits = (0, 0.95)): all_values = [] normed_dict = {} for strand in mutation_dict: normed_dict[strand] = {} for chromosome in mutation_dict[strand]: normed_dict[strand][chromosome] = {} #print mutation_dict[strand][chromosome].values() all_values += mutation_dict[strand][chromosome].values() #print all_values if winsorize_data: winsorize(all_values, limits = (winsorization_limits[0], 1-winsorization_limits[1]), inplace = True) max_value = float(max(all_values)) for strand in mutation_dict: for chromosome in mutation_dict[strand]: for position in mutation_dict[strand][chromosome]: val = mutation_dict[strand][chromosome][position] if val < min(all_values): val = min(all_values) if val > max(all_values): val = max(all_values) normed_dict[strand][chromosome][position] = val/max_value return normed_dict def plot_weighted_nts_pie(background_subtracted, fasta_genome, title, out_prefix): genome = mod_utils.convertFastaToDict(fasta_genome) fig = plt.figure(figsize=(8,8)) plot = fig.add_subplot(111)#a pie chart of mutated nts weighted by background-subtracted counts labels = "ATCG" nt_counts = defaultdict(float) for strand in background_subtracted: for chromosome in background_subtracted[strand]: for position in background_subtracted[strand][chromosome]: nt = genome[chromosome][position-1] nt_counts[nt] += background_subtracted[strand][chromosome][position] sizes = numpy.array([nt_counts[nt] for nt in labels]) total = float(sum(sizes)) sizes = sizes/total merged_labels = ['%s %.3f' % (labels[i], sizes[i]) for i in range(len(sizes))] plot.pie(sizes, labels = merged_labels, colors = mod_utils.rainbow) plot.set_title(title) plt.savefig(out_prefix + '.pdf', transparent='True', format='pdf') plt.clf() def compare_to_control(experiment_dict, control_dict): """ :param experiment_dict: :param normalization_dict: :return: subtracted_dict - normalization value subtracted from experimental at every position """ ratio_dict = {} for strand in experiment_dict: ratio_dict[strand] = {} for chromosome in experiment_dict[strand]: ratio_dict[strand][chromosome] = {} for position in experiment_dict[strand][chromosome]: try: #dividing by zero will cause issues here ratio_dict[strand][chromosome][position] = math.log(float(experiment_dict[strand][chromosome][position])/float(control_dict[strand][chromosome][position]), 2) except: pass return ratio_dict def normed_mutation_rate_histogram(normalized_mutations, dataset_names, output_prefix, title = '', xlim= (0,1), min = 0, max = 1, step = 0.01): fig = plt.figure(figsize=(16,16)) plot = fig.add_subplot(111) bins = numpy.arange(xlim[0],xlim[1],step) bins = numpy.append(bins, max+step) bins = numpy.append([min-step], bins) for i in range(len(dataset_names)): mutation_densities = [] for strand in normalized_mutations[i]: for chromosome in normalized_mutations[i][strand]: mutation_densities = mutation_densities + [val for val in normalized_mutations[i][strand][chromosome].values()] counts, edges = numpy.histogram(mutation_densities, bins = bins) #plot.hist(mutation_densities, color = mod_utils.colors [i], bins = bins, label=dataset_names[i]) counts = [0]+list(counts)+[0] edges = [0]+list(edges)+[edges[-1]] plot.fill(edges[:-1], numpy.array(counts), alpha = 0.3, color = mod_utils.colors[i], lw=0) plot.plot(edges[:-1], numpy.array(counts), color = mod_utils.colors[i], label=dataset_names[i], lw=2) plot.set_xlim(xlim[0]-step,xlim[1]+step) #plot.set_xticks(numpy.arange(0,10)+0.5) #plot.set_xticklabels(numpy.arange(0,10)) plot.set_xlabel('mutations/coverage') plot.set_ylabel("# positions") plot.set_title(title) lg=plt.legend(loc=2,prop={'size':10}, labelspacing=0.2) lg.draw_frame(False) #plot.set_yscale('log') #plot.set_title(title) plt.savefig(output_prefix + '_mut_density.pdf', transparent='True', format='pdf') plt.clf() def main(): outfolder, genome_fasta, normalization_file_name = sys.argv[1:4] experimental_file_names = sys.argv[4:] control_dict = mod_utils.unPickle(normalization_file_name) rescaled_control_dict = normalize_dict_to_max(control_dict) norm_name = '.'.join(os.path.basename(normalization_file_name).split('.')[:-1]) experimental_dict_names = ['.'.join(os.path.basename(file_name).split('.')[:-1]) for file_name in experimental_file_names] experimental_dicts = [mod_utils.unPickle(file_name) for file_name in experimental_file_names] rescaled_experimental_dicts = [normalize_dict_to_max(exp_dict) for exp_dict in experimental_dicts] print experimental_dict_names, norm_name normed_mutation_rate_histogram(rescaled_experimental_dicts, experimental_dict_names, os.path.join(outfolder, '%s_rescaled_mutation_rate_histogram' % norm_name), title='mutation rate, rescaled to max', xlim = (0, 0.1), min = 0, max =1, step = 0.001) comparisons = [] rescaled_comparisons = [] write_wig(control_dict, norm_name, os.path.join(outfolder, norm_name)) for i in range(len(experimental_dict_names)): write_wig(rescaled_experimental_dicts[i], experimental_dict_names[i], os.path.join(outfolder, experimental_dict_names[i])) comparison_log2_ratios = compare_to_control(experimental_dicts[i], control_dict) rescaled_comparison_log2_ratios = compare_to_control(rescaled_experimental_dicts[i], rescaled_control_dict) comparisons.append(comparison_log2_ratios) rescaled_comparisons.append(rescaled_comparison_log2_ratios) mod_utils.makePickle(comparison_log2_ratios, os.path.join(outfolder, experimental_dict_names[i]+'_comparison_log2.pkl')) #mod_utils.makePickle(rescaled_comparison_log2_ratios, os.path.join(outfolder, experimental_dict_names[i]+'_rescaled_comparison_log2.pkl')) write_wig(comparison_log2_ratios, experimental_dict_names[i]+'_comparison_log2', os.path.join(outfolder, experimental_dict_names[i]+'_comparison_log2')) #write_wig(rescaled_comparison_log2_ratios, experimental_dict_names[i]+'_rescaled)comparison_log2', os.path.join(outfolder, experimental_dict_names[i]+'_rescaled_comparison_log2')) #try: # plot_weighted_nts_pie(background_subtracted, genome_fasta, '%s backround-subtracted fractions' % experimental_dict_names[i], os.path.join(outfolder, experimental_dict_names[i]+'_sub_pie')) #except: # pass #print comparisons #print rescaled_comparisons normed_mutation_rate_histogram(comparisons, experimental_dict_names, os.path.join(outfolder, '%s_comparison_histogram' % norm_name), title='log2 experiment/control', xlim = (-10, 10), min = -100, max =100, step = 0.1) #normed_mutation_rate_histogram(rescaled_comparisons, experimental_dict_names, os.path.join(outfolder, '%s_rescaled_comparison_histogram' % norm_name), title='log2 rescaled experiment/control', xlim = (-10, 10), min = -100, max =100, step = 0.1) main()
{ "repo_name": "borisz264/mod_seq", "path": "unused_scripts/compare_samples.py", "copies": "1", "size": "10227", "license": "mit", "hash": 992569476420671600, "line_mean": 52.5497382199, "line_max": 252, "alpha_frac": 0.6650044001, "autogenerated": false, "ratio": 3.4055944055944054, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.9516956705651354, "avg_score": 0.01072842000861036, "num_lines": 191 }
__author__ = 'boris' """ inputs: outfolder - where to put all the results normalization_file_name - a pickled dict of [strand][chromosome][position] = mutations/coverage output from count_reads_and_mismatches.py - this is from a sample where no modifying reagent was added. experimental_file_names - any number of files, of same format as normalization file, to be normalized by the normalization file outputs: for each file, a WIG file of the mutation rate, normalized by the coverage within the same sample for each experimental file, a WIG of the coverage-normalized mutation rate, normalized again by the control (by simple subtraction). Minimum is set to zero. for each experimental file, a pickled dictionary of the coverage-normalized mutation rate, normalized again by the control, in the same format as above """ import sys import mod_utils import os import gzip from scipy.stats.mstats import winsorize import matplotlib.pyplot as plt from collections import defaultdict import numpy plt.rcParams['pdf.fonttype'] = 42 #leaves most text as actual text in PDFs, not outlines def write_wig(mutation_dict, sample_name, output_prefix): """ :param mutation_dict: a pickled dict of [strand][chromosome][position] = mutations/coverage :param output_prefix: :return: """ plusWig = gzip.open(output_prefix+'_plus.wig.gz', 'w') #minusWig = gzip.open(output_prefix+'_minus.wig.gz', 'w') plusWig.write('track type=wiggle_0 name=%s\n' % (sample_name+'_plus')) #minusWig.write('track type=wiggle_0 name=%s\n' % (sample_name+'_minus')) allChrs=set(mutation_dict['+'].keys()).union(set(mutation_dict['-'].keys())) for chr in allChrs: #minPos = min([min(weightedReads['+'][chr].keys()), min(weightedReads['-'][chr].keys())]) #maxPos = max([max(weightedReads['+'][chr].keys()), max(weightedReads['-'][chr].keys())]) plusWig.write('variableStep chrom=%s\n' % (chr)) #minusWig.write('variableStep chrom=%s\n' % (chr)) if chr in mutation_dict['+']: for i in sorted(mutation_dict['+'][chr].keys()): plusWig.write('%d\t%f\n' % (i, mutation_dict['+'][chr][i])) #if chr in mutation_dict['-']: #for i in sorted(mutation_dict['-'][chr].keys()): #minusWig.write('%d\t%f\n' % (i, mutation_dict['-'][chr][i]/mutation_dict)) plusWig.close() #minusWig.close() def normalize_dict_to_max(mutation_dict, winsorize_data = False, winsorization_limits = (0, 0.95)): all_values = [] normed_dict = {} for strand in mutation_dict: normed_dict[strand] = {} for chromosome in mutation_dict[strand]: normed_dict[strand][chromosome] = {} #print mutation_dict[strand][chromosome].values() all_values += mutation_dict[strand][chromosome].values() #print all_values if winsorize_data: winsorize(all_values, limits = (winsorization_limits[0], 1-winsorization_limits[1]), inplace = True) max_value = float(max(all_values)) for strand in mutation_dict: for chromosome in mutation_dict[strand]: for position in mutation_dict[strand][chromosome]: val = mutation_dict[strand][chromosome][position] if val < min(all_values): val = min(all_values) if val > max(all_values): val = max(all_values) normed_dict[strand][chromosome][position] = val/max_value return normed_dict def plot_weighted_nts_pie(background_subtracted, fasta_genome, title, out_prefix): genome = mod_utils.convertFastaToDict(fasta_genome) fig = plt.figure(figsize=(8,8)) plot = fig.add_subplot(111)#a pie chart of mutated nts weighted by background-subtracted counts labels = "ATCG" nt_counts = defaultdict(float) for strand in background_subtracted: for chromosome in background_subtracted[strand]: for position in background_subtracted[strand][chromosome]: nt = genome[chromosome][position-1] nt_counts[nt] += background_subtracted[strand][chromosome][position] sizes = numpy.array([nt_counts[nt] for nt in labels]) total = float(sum(sizes)) sizes = sizes/total merged_labels = ['%s %.3f' % (labels[i], sizes[i]) for i in range(len(sizes))] plot.pie(sizes, labels = merged_labels, colors = mod_utils.rainbow) plot.set_title(title) plt.savefig(out_prefix + '.pdf', transparent='True', format='pdf') plt.clf() def subtract_background(experiment_dict, normalization_dict): """ :param experiment_dict: :param normalization_dict: :return: subtracted_dict - normalization value subtracted from experimental at every position """ subtracted_dict = {} for strand in experiment_dict: subtracted_dict[strand] = {} for chromosome in experiment_dict[strand]: subtracted_dict[strand][chromosome] = {} for position in experiment_dict[strand][chromosome]: if position in experiment_dict[strand][chromosome] and position in normalization_dict[strand][chromosome]: subtracted_dict[strand][chromosome][position] = max(experiment_dict[strand][chromosome][position]-normalization_dict[strand][chromosome][position], 0) return subtracted_dict def normed_mutation_rate_histogram(normalized_mutations, dataset_names, output_prefix, title = ''): fig = plt.figure(figsize=(16,16)) plot = fig.add_subplot(111) step = 0.0001 max = 0.01 bins = numpy.arange(0,max,step) bins = numpy.append(bins, 1+step) for i in range(len(dataset_names)): mutation_densities = [] for strand in normalized_mutations[i]: for chromosome in normalized_mutations[i][strand]: mutation_densities = mutation_densities + [val for val in normalized_mutations[i][strand][chromosome].values() if val > 0] counts, edges = numpy.histogram(mutation_densities, bins = bins) #plot.hist(mutation_densities, color = mod_utils.colors [i], bins = bins, label=dataset_names[i]) counts = [0]+list(counts)+[0] edges = [0]+list(edges)+[edges[-1]] plot.fill(edges[:-1], numpy.array(counts), alpha = 0.3, color = mod_utils.colors[i], lw=0) plot.plot(edges[:-1], numpy.array(counts), color = mod_utils.colors[i], label=dataset_names[i], lw=2) plot.set_xlim(0,max+step) #plot.set_xticks(numpy.arange(0,10)+0.5) #plot.set_xticklabels(numpy.arange(0,10)) plot.set_xlabel('mutations/coverage') plot.set_ylabel("# positions") plot.set_title(title) lg=plt.legend(loc=2,prop={'size':10}, labelspacing=0.2) lg.draw_frame(False) #plot.set_yscale('log') #plot.set_title(title) plt.savefig(output_prefix + '_mut_density.pdf', transparent='True', format='pdf') plt.clf() def main(): outfolder, genome_fasta, normalization_file_name = sys.argv[1:4] experimental_file_names = sys.argv[4:] mod_utils.make_dir(outfolder) normalization_dict = mod_utils.unPickle(normalization_file_name) norm_name = '.'.join(os.path.basename(normalization_file_name).split('.')[:-2]) experimental_dict_names = ['.'.join(os.path.basename(file_name).split('.')[:-2]) for file_name in experimental_file_names] experimental_dicts = [mod_utils.unPickle(file_name) for file_name in experimental_file_names] normed_mutation_rate_histogram(experimental_dicts, experimental_dict_names, os.path.join(outfolder, 'mutation_rate_histogram'), title='nonzero positions') background_subtracted_sets = [] write_wig(normalization_dict, norm_name, os.path.join(outfolder, norm_name)) for i in range(len(experimental_dict_names)): write_wig(experimental_dicts[i], experimental_dict_names[i], os.path.join(outfolder, experimental_dict_names[i])) background_subtracted = subtract_background(experimental_dicts[i], normalization_dict) background_subtracted_sets.append(background_subtracted) mod_utils.makePickle(background_subtracted, os.path.join(outfolder, experimental_dict_names[i]+'_subtracted.pkl')) write_wig(background_subtracted, experimental_dict_names[i]+'_subtracted', os.path.join(outfolder, experimental_dict_names[i]+'_subtracted')) try: plot_weighted_nts_pie(background_subtracted, genome_fasta, '%s backround-subtracted fractions' % experimental_dict_names[i], os.path.join(outfolder, experimental_dict_names[i]+'_sub_pie')) except: pass normed_mutation_rate_histogram(background_subtracted_sets, experimental_dict_names, os.path.join(outfolder, 'back_subtracted_mutation_rate_histogram'), title = 'nonzero positions, background subtracted') main()
{ "repo_name": "borisz264/mod_seq", "path": "unused_scripts/normalize_to_control_make_wig.py", "copies": "1", "size": "8799", "license": "mit", "hash": 2589449244232951000, "line_mean": 51.0710059172, "line_max": 207, "alpha_frac": 0.6693942493, "autogenerated": false, "ratio": 3.528067361668003, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.9646193503362148, "avg_score": 0.01025362152117078, "num_lines": 169 }
__author__ = 'boris' """ inputs: outprefix bundle 1 bundle 2 bundle 3 bundle 4 bundle 5 - the 5 pdb files from the 4v88 bundle reactivity_values - a pickled dict of [chromosome][position] = reactivity_value or change, such as from compare_samples.py outputs: the 5 PDB files in the bundle, with b factors replaced with reactivity scores for the corresponding rRNA residues. """ import sys import mod_utils import os import gzip from scipy.stats.mstats import winsorize import matplotlib.pyplot as plt from collections import defaultdict import numpy import math plt.rcParams['pdf.fonttype'] = 42 #leaves most text as actual text in PDFs, not outlines def write_wig(mutation_dict, sample_name, output_prefix): """ :param mutation_dict: a pickled dict of [strand][chromosome][position] = mutations/coverage :param output_prefix: :return: """ score_table = open(output_prefix+'_scores.txt', 'w') plusWig = gzip.open(output_prefix+'_plus.wig.gz', 'w') #minusWig = gzip.open(output_prefix+'_minus.wig.gz', 'w') plusWig.write('track type=wiggle_0 name=%s\n' % (sample_name+'_plus')) #minusWig.write('track type=wiggle_0 name=%s\n' % (sample_name+'_minus')) allChrs=set(mutation_dict.keys()).union(set(mutation_dict['-'].keys())) for chr in allChrs: #minPos = min([min(weightedReads['+'][chr].keys()), min(weightedReads['-'][chr].keys())]) #maxPos = max([max(weightedReads['+'][chr].keys()), max(weightedReads['-'][chr].keys())]) plusWig.write('variableStep chrom=%s\n' % (chr)) #minusWig.write('variableStep chrom=%s\n' % (chr)) if chr in mutation_dict: for i in sorted(mutation_dict[chr].keys()): plusWig.write('%d\t%f\n' % (i, mutation_dict[chr][i])) score_table.write('%s_%d\t%f\n' % (chr, i, mutation_dict['+'][chr][i])) #if chr in mutation_dict['-']: #for i in sorted(mutation_dict['-'][chr].keys()): #minusWig.write('%d\t%f\n' % (i, mutation_dict['-'][chr][i]/mutation_dict)) plusWig.close() score_table.close() #minusWig.close() def normalize_dict_to_max(mutation_dict, winsorize_data = False, winsorization_limits = (0, 0.95)): all_values = [] normed_dict = {} for chromosome in mutation_dict: normed_dict[chromosome] = {} #print mutation_dict[strand][chromosome].values() all_values += mutation_dict[chromosome].values() if winsorize_data: winsorize(all_values, limits = (winsorization_limits[0], 1-winsorization_limits[1]), inplace = True) max_value = float(max(all_values)) min_value = float(min(all_values)) norm_value = max(max_value, -1*min_value) print max_value for chromosome in mutation_dict: for position in mutation_dict[chromosome]: val = mutation_dict[chromosome][position] if val < min(all_values): val = min(all_values) if val > max(all_values): val = max(all_values) normed_dict[chromosome][position] = val/norm_value return normed_dict def split_by_n(line, n=6): """ trims endline, and returns set of chunks of length 6, each of which has whitespace stripped :param line: :param n: :return: """ return [line[i:i+n].strip() for i in range(0, len(line), 6)] #rRNA_assignments = {3:{'d':"S.c.18S_rRNA"}, 1:{'A':"S.c.18S_rRNA"}, 2:{'A':"S.c.25S__rRNA", 'B':"S.c.5S___rRNA", 'C':"S.c.5.8S_rRNA"} , 4:{'K':"S.c.25S__rRNA", 'L':"S.c.5S___rRNA", 'M':"S.c.5.8S_rRNA"}} #for 4V88: rRNA_assignments = {3:{'d':"S.c.18S_rRNA"}, 1:{'A':"S.c.18S_rRNA"}, 2:{'A':"S.c.25S__rRNA", 'B':"S.c.5S___rRNA", 'C':"S.c.5.8S_rRNA"} , 4:{'I':"S.c.25S__rRNA", 'L':"S.c.5S___rRNA", 'M':"S.c.5.8S_rRNA"}} #for 4V6I: #rRNA_assignments = {2:{'S':"S.c.18S_rRNA"}, 3:{'A':"S.c.25S__rRNA", 'C':"S.c.5S___rRNA", 'B':"S.c.5.8S_rRNA"}} #for 4U3U: #rRNA_assignments = {1:{'A':"S.c.18S_rRNA"}, 2:{'A':"S.c.25S__rRNA", 'C':"S.c.5S___rRNA", 'B':"S.c.5.8S_rRNA"}} def main(): outprefix, bundle1, bundle2, bundle3, bundle4, bundle5, datafile_name = sys.argv[1:8] bundles = [bundle1, bundle2, bundle3, bundle4, bundle5] reactivities = mod_utils.unPickle(datafile_name) scaling_factor = 1000. #all values will be multiplied byt his factor. This is necessary because the values produced are often very small, and the B factors in the PDB file are limited to 6 characters for i in range(1,6): infile = open(bundles[i-1]) outfile = open(outprefix+'_bundle'+str(i)+'.pdb' ,'w') for line in infile: if line.startswith('ATOM'): chain = line[21] resi = int(line[22:28].strip()) #print i, chain, resi #print rRNA_assignments[i][chain] #print reactivities[rRNA_assignments[i][chain]] if i in rRNA_assignments and chain in rRNA_assignments[i] and resi in reactivities[rRNA_assignments[i][chain]]: insert = '%6.3f' % (scaling_factor*reactivities[rRNA_assignments[i][chain]][resi]) new_line = '%s%s%s' % (line[:60], insert[:6], line[66:]) assert len(line) == len(new_line) else: new_line = '%s%6.4f%s' % (line[:60], 0.0, line[66:]) assert len(line) == len(new_line) elif line.startswith("ANISOU") or line.startswith("HETATM"): new_line = '' #remove the anisotropic b factors, I don't need them else: new_line = line outfile.write(new_line) infile.close() outfile.close() main()
{ "repo_name": "borisz264/mod_seq", "path": "unused_scripts/map_onto_rRNA_structure_shapemapper.py", "copies": "1", "size": "5711", "license": "mit", "hash": -3853618376834659300, "line_mean": 40.6934306569, "line_max": 203, "alpha_frac": 0.5928909123, "autogenerated": false, "ratio": 3.0572805139186294, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.41501714262186296, "avg_score": null, "num_lines": null }
__author__ = 'boris' """ inputs: outprefix bundle 1 bundle 2 bundle 3 bundle 4 bundle 5 - the 5 pdb files from the 4v88 bundle reactivity_values - a pickled dict of [strand][chromosome][position] = reactivity_value or change, such as from compare_samples.py outputs: the 5 PDB files in the bundle, with b factors replaced with reactivity scores for the corresponding rRNA residues. """ import sys import mod_utils import os import gzip from scipy.stats.mstats import winsorize import matplotlib.pyplot as plt from collections import defaultdict import numpy import math plt.rcParams['pdf.fonttype'] = 42 #leaves most text as actual text in PDFs, not outlines def write_wig(mutation_dict, sample_name, output_prefix): """ :param mutation_dict: a pickled dict of [strand][chromosome][position] = mutations/coverage :param output_prefix: :return: """ score_table = open(output_prefix+'_scores.txt', 'w') plusWig = gzip.open(output_prefix+'_plus.wig.gz', 'w') #minusWig = gzip.open(output_prefix+'_minus.wig.gz', 'w') plusWig.write('track type=wiggle_0 name=%s\n' % (sample_name+'_plus')) #minusWig.write('track type=wiggle_0 name=%s\n' % (sample_name+'_minus')) allChrs=set(mutation_dict['+'].keys()).union(set(mutation_dict['-'].keys())) for chr in allChrs: #minPos = min([min(weightedReads['+'][chr].keys()), min(weightedReads['-'][chr].keys())]) #maxPos = max([max(weightedReads['+'][chr].keys()), max(weightedReads['-'][chr].keys())]) plusWig.write('variableStep chrom=%s\n' % (chr)) #minusWig.write('variableStep chrom=%s\n' % (chr)) if chr in mutation_dict['+']: for i in sorted(mutation_dict['+'][chr].keys()): plusWig.write('%d\t%f\n' % (i, mutation_dict['+'][chr][i])) score_table.write('%s_%d\t%f\n' % (chr, i, mutation_dict['+'][chr][i])) #if chr in mutation_dict['-']: #for i in sorted(mutation_dict['-'][chr].keys()): #minusWig.write('%d\t%f\n' % (i, mutation_dict['-'][chr][i]/mutation_dict)) plusWig.close() score_table.close() #minusWig.close() def normalize_dict_to_max(mutation_dict, winsorize_data = False, winsorization_limits = (0, 0.95)): all_values = [] normed_dict = {} for strand in mutation_dict: normed_dict[strand] = {} for chromosome in mutation_dict[strand]: normed_dict[strand][chromosome] = {} #print mutation_dict[strand][chromosome].values() all_values += mutation_dict[strand][chromosome].values() #print all_values if winsorize_data: winsorize(all_values, limits = (winsorization_limits[0], 1-winsorization_limits[1]), inplace = True) max_value = float(max(all_values)) for strand in mutation_dict: for chromosome in mutation_dict[strand]: for position in mutation_dict[strand][chromosome]: val = mutation_dict[strand][chromosome][position] if val < min(all_values): val = min(all_values) if val > max(all_values): val = max(all_values) normed_dict[strand][chromosome][position] = val/max_value return normed_dict def split_by_n(line, n=6): """ trims endline, and returns set of chunks of length 6, each of which has whitespace stripped :param line: :param n: :return: """ return [line[i:i+n].strip() for i in range(0, len(line), 6)] rRNA_assignments = {3:{'d':"S.c.18S_rRNA"}, 1:{'A':"S.c.18S_rRNA"},2:{'A':"S.c.25S__rRNA", 'B':"S.c.5S___rRNA", 'C':"S.c.5.8S_rRNA"} , (4,'K'):"S.c.25S__rRNA", (4,'L'):"S.c.5S___rRNA", (4,'M'):"S.c.5.8S_rRNA", (2,'C'):"S.c.5.8S_rRNA"} def main(): outprefix, bundle1, bundle2, bundle3, bundle4, bundle5, datafile_name = sys.argv[1:8] bundles = [bundle1, bundle2, bundle3, bundle4, bundle5] reactivities = mod_utils.unPickle(datafile_name) for i in range(1,6): infile = open(bundles[i-1]) outfile = open(outprefix+'_bundle'+str(i)+'.pdb' ,'w') for line in infile: if line.startswith('ATOM'): chain = line[21] resi = int(line[22:28].strip()) if i in rRNA_assignments and chain in rRNA_assignments[i] and resi in reactivities['+'][rRNA_assignments[i][chain]]: new_line = '%s%6.3f%s' % (line[:60], reactivities['+'][rRNA_assignments[i][chain]][resi], line[66:]) assert len(line) == len(new_line) else: new_line = '%s%6.4f%s' % (line[:60], 0.0, line[66:]) assert len(line) == len(new_line) elif line.startswith("ANISOU"): new_line = '' #remove the anisotropic b factors, I don't need them else: new_line = line outfile.write(new_line) infile.close() outfile.close() main()
{ "repo_name": "borisz264/mod_seq", "path": "unused_scripts/map_onto_rRNA_structure.py", "copies": "1", "size": "4996", "license": "mit", "hash": -3153490915391695400, "line_mean": 38.976, "line_max": 234, "alpha_frac": 0.5880704564, "autogenerated": false, "ratio": 3.2547231270358306, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.43427935834358306, "avg_score": null, "num_lines": null }
__author__ = 'boris' """ I really want to use this mod-seq data to generate something resembling an x-ray exposure of a sequencing gel inputs: chromosome: the chromosome to plot from start: the position to start plotting from stop: the position to stop plotting mutations.pkl: from parse_shapemapper_counts2.py, pickled dict of [chromosome][dataset][position] = mutation counts coverage.pkl: from parse_shapemapper_counts2.py, pickled dict of [chromosome][dataset][position] = coverage counts datasets: any number of names matching datsets in the mutations and coverage pickles """ import mod_utils, math, os import numpy import matplotlib.pyplot as plt plt.rcParams['pdf.fonttype'] = 42 #leaves most text as actual text in PDFs, not outlines def gaussian(x, mean, variance, scale): #removed division by math.sqrt(variance*2*math.pi) so that peak height equals mutation rate return (float(scale) * math.exp(-1*((float(x)-float(mean))**2)/(2*variance))) def true_gaussian(x, mean, variance, scale): return (float(scale)/math.sqrt(variance*2*math.pi)) * math.exp(-1*((float(x)-float(mean))**2)/(2*variance)) def generate_single_mutation_rates_dict(chromosome, start, stop, folder, file_names, strip_suffix): combined_mutation_rates = {} for file_name in file_names: dataset_label = file_name.rstrip(strip_suffix) mutation_rates = mod_utils.unPickle(os.path.join(folder, file_name)) mutation_array = [float(mutation_rates[chromosome][position]) if position in mutation_rates[chromosome] else 0.0 for position in range(start, stop+1)] combined_mutation_rates[dataset_label] = mutation_array return combined_mutation_rates def generate_gaussian_densities(mutation_rates, band_spacing, band_variance): """ :param mutation_rates: output of generate_mutation_rates :param band_spacing: number of positions (pixels) between band centers :param band_variance: the variance of the guassian representing each band (in positions/pixels) :return: """ band_densities = {} for dataset in mutation_rates: print dataset #center of first band will be at band_spacing/2 (zero-indexed, so wiht a spacing of 20, it will be position 10, # the 11th entry in the array) #center of each subsequent band will be band_spacing+1 units from the previous 1 summed_density_array = numpy.array([0.0]*(len(mutation_rates[dataset])*(band_spacing+1))) for position in range(len(mutation_rates[dataset])): band_position = (band_spacing/2) + (band_spacing+1)*position band_intensity = mutation_rates[dataset][position] #compute the contribution, at each position in the area of interest, from this band temp_array = numpy.array([gaussian(x, band_position, band_variance, band_intensity) for x in range(len(summed_density_array))]) #temp_array = numpy.array([gaussian(x, band_position, math.sqrt(band_intensity)*band_variance, band_intensity) for x in range(len(summed_density_array))]) summed_density_array = summed_density_array + temp_array band_densities[dataset] = summed_density_array return band_densities def plot_density_lines(dataset_names, gaussian_densities, band_spacing, start, stop, chromosome): fig = plt.figure() plot = fig.add_subplot(111) color_index = 0 for dataset in dataset_names: plot.plot(gaussian_densities[dataset], color = mod_utils.colors[color_index], label= dataset) color_index +=1 lg=plt.legend(loc=2,prop={'size':10}, labelspacing=0.2) lg.draw_frame(False) plot.set_xlabel('nt position in %s' % chromosome) plot.set_ylabel('band intensity') plot.set_xticks([(band_spacing/2) + (band_spacing+1)*position for position in range(1+stop-start)]) plot.set_xticklabels(range(start, stop+1)) plt.xticks(rotation=90) plt.show() def main(): ''' chromosome, start, stop, mutations, coverage = sys.argv[1:6] start = int(start) stop = int(stop) dataset_names = sys.argv[6:] ''' chromosome, start, stop, mutation_rates_folder = 'S.c.25S__rRNA', 2740, 2800, '/Users/boris/Green_Lab/Book_2/2.47/analysis/pickles/raw' file_names = ['80S_no_DMS_mutation_rates.pkl', '80S_mutation_rates.pkl', '80S_10uM_CHX_mutation_rates.pkl', '80S_50uM_CHX_mutation_rates.pkl', '80S_1000uM_CHX_mutation_rates.pkl'] strip_suffix = '_mutation_rates.pkl' dataset_labels = [file_name.rstrip(strip_suffix) for file_name in file_names] mutation_rates_dict = generate_single_mutation_rates_dict(chromosome, start, stop, mutation_rates_folder, file_names, strip_suffix) print mutation_rates_dict.keys() band_spacing = 200 #band_variance = 50000. band_variance = 2000. gaussian_densities = generate_gaussian_densities(mutation_rates_dict, band_spacing, band_variance ) plot_density_lines(dataset_labels, gaussian_densities, band_spacing, start, stop, chromosome) main()
{ "repo_name": "borisz264/mod_seq", "path": "gel_drawing/simulate_gel.py", "copies": "1", "size": "5018", "license": "mit", "hash": 2132368530738345700, "line_mean": 47.7184466019, "line_max": 183, "alpha_frac": 0.702471104, "autogenerated": false, "ratio": 3.463077984817115, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.9579586863317986, "avg_score": 0.017192445099825756, "num_lines": 103 }
__author__ = 'boris' """ 5'e end data is a pickled dict of form srt_dict[chrom][position] = counts at position take the 5' end data from count_reads_and_mismatches.py, as well as any number of files output by compute_true_positive_negative.py and compute: 1) 90% windorize the input data (All data above 95th percentile set to 95th percentile) 2) normalize to highest position in rRNA (should just stick to the rRNA of interest, which will be 18S for my initial test) 3) slide a cutoff from 0 to 1 in ~10,000 steps, computing % of true positives and true negatives called positive at each step 4) plot these two percentages against each other for each step, also output these values as a spreadsheet also plot y=x for reference """ import sys, mod_utils, os import numpy from scipy.stats.mstats import winsorize import matplotlib.pyplot as plt plt.rcParams['pdf.fonttype'] = 42 #leaves most text as actual text in PDFs, not outlines from collections import defaultdict def winsorize_norm_chromosome_data(mut_density, chromosome, genome_dict, nucs_to_count, to_winsorize = False, low = 0, high = 0.95): """ :param read_5p_ends: :param chromosome: :param strand: :param genome_dict: :param nucs_to_count: :param low: :param high: :return: an array (now zero-indexed from 1-indexed) of densities for the given chromosome on the given strand, winsorized, and only for the given nucleotides """ max_position = max(mut_density[chromosome].keys()) density_array =numpy.array([0.0] * max_position) for position in mut_density[chromosome].keys(): if genome_dict[chromosome][position-1] in nucs_to_count: density_array[position-1] = mut_density[chromosome][position] if to_winsorize: winsorize(density_array, limits = (low, 1-high), inplace = True) normed_array = density_array/float(max(density_array)) return normed_array def get_tp_tn(tp_tn_file): TP = set() TN = set() f = open(tp_tn_file) for line in f: ll= line.strip('\n').split('\t') if ll[2] == 'TP': TP.add(int(ll[0])) if ll[2] =='TN': TN.add(int(ll[0])) f.close() return TP, TN def call_positives(density_array, chromosome, genome_dict, nucs_to_count, cutoff): """ :param density_array: :return:a set of called positive positions I've reverted these to 1-indexed to match the TP and TN calls from the structures """ positives = set() for i in range(len(density_array)): if genome_dict[chromosome][i] in nucs_to_count: if density_array[i] >= cutoff: positives.add(i+1)#adding 1 not necessary for RT stops, since the modified nucleotide is the one 1 upstream of the RT stop!!! return positives def plot_ROC_curves(roc_curves, title, out_prefix): fig = plt.figure(figsize=(8,8)) plot = fig.add_subplot(111)#first a pie chart of mutated nts colormap = plt.get_cmap('spectral') color_index = 0 for name in sorted(roc_curves.keys()): x, y = roc_curves[name] area_under_curve = numpy.trapz(numpy.array(y[::-1])/100., x=numpy.array(x[::-1])/100.) plot.plot(x, y, lw =2, label = '%s %.3f' % (name, area_under_curve), color = colormap(color_index/float(len(roc_curves)))) color_index +=1 plot.plot(numpy.arange(0,100,0.1), numpy.arange(0,100,0.1), lw =1, ls = 'dashed', color = mod_utils.black, label = 'y=x') plot.set_xlabel('False positive rate (%) (100-specificity)') plot.set_ylabel('True positive rate (%) (sensitivity)') plot.set_title(title) lg=plt.legend(loc=4,prop={'size':10}, labelspacing=0.2) lg.draw_frame(False) plt.savefig(out_prefix + '.pdf', transparent='True', format='pdf') plt.clf() def pie_read_5p_ends(read_5p_ends, genome_dict, out_prefix): nuc_counts = defaultdict(int) for chromosome in read_5p_ends['+']: for position in read_5p_ends['+'][chromosome]: if position-2 > 0 : nuc = genome_dict[chromosome][position-1] nuc_counts[nuc] += read_5p_ends['+'][chromosome][position] fig = plt.figure(figsize=(8,8)) plot = fig.add_subplot(111)#first a pie chart of mutated nts labels = sorted(nuc_counts.keys()) sizes = [nuc_counts[nt] for nt in labels] plot.pie(sizes, labels = labels, colors = mod_utils.rainbow) plot.set_title('nt exactly at read 5p ends across rRNA') plt.savefig(out_prefix + '_nt_5p_ends.pdf', transparent='True', format='pdf') plt.clf() def main(): tp_tn_annotations, genome_fasta, outprefix = sys.argv[1:4] density_files = sys.argv[4:] sample_names = [os.path.basename(filename).split('_back_')[0] for filename in density_files] mutation_densities = [mod_utils.unPickle(pickled_density) for pickled_density in density_files] genome_dict = mod_utils.convertFastaToDict(genome_fasta) normed_density_arrays = [winsorize_norm_chromosome_data(mutation_density, 'S.c.25S__rRNA', genome_dict, 'AC') for mutation_density in mutation_densities] real_tp, real_tn = get_tp_tn(tp_tn_annotations) roc_curves = {} for sample_name in sample_names: roc_curves[sample_name] = [[],[]]#x and y value arrays for each stepsize = 0.0001 for cutoff in numpy.arange(0.0,1.+5*stepsize, stepsize): for i in range(len(sample_names)): #the fasta file should be the EXACT one used for the pipeline, and the chromosome name below should match # the one in the FASTA file exactly called_p = call_positives(normed_density_arrays[i], 'S.c.25S__rRNA', genome_dict, 'AC', cutoff) num_tp_called = len(called_p.intersection(real_tp))#how many true positives called at this cutoff num_fp_called = len(called_p.intersection(real_tn))#how many fp positives called at this cutoff roc_curves[sample_names[i]][1].append(100.*num_tp_called/float(len(real_tp)))#TP rate on y axis roc_curves[sample_names[i]][0].append(100.*num_fp_called/float(len(real_tn)))#FP rate on x axis plot_ROC_curves(roc_curves, 'S.c.25S__rRNA', outprefix) #pie_read_5p_ends(read_5p_ends, genome_dict, outprefix) if __name__ == '__main__': main()
{ "repo_name": "borisz264/mod_seq", "path": "structure_ROC_curves/roc_curves_compare_datasets_shapemapper.py", "copies": "1", "size": "6279", "license": "mit", "hash": 2117621924518922200, "line_mean": 44.1798561151, "line_max": 161, "alpha_frac": 0.6582258321, "autogenerated": false, "ratio": 3.24831867563373, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.9354269185484181, "avg_score": 0.010455064449909686, "num_lines": 139 }
__author__ = 'boris' """ takes: all_counts - pickled dict of mutation counts, all_counts[rRNA_name][sample_name] = counts_table all_Depths - pickled dict of coverage counts , all_depths[rRNA_name][sample_name] = depth_table min_mutations: if a position has less coverage than less mutations than this across both datasets, the subtracted total will be set to zero, and the ratio to 1 output_prefix comparisons: any number of sample,control name pairs makes for each comparison_pair: a dict of subtraction-normed mutation rates a dict of variance for subtracted rates a dict of division-normed mutation rates a dict of variance for division-normed rates """ import sys, math, mod_utils from collections import defaultdict def write_out_counts(subtracted_rates, subtraction_errors, divided_rates, division_errors, rRNA, output_filename): f = open(output_filename, 'w') f.write('position\tsubtracted\tsub error\tdivided\tdiv error\n') for position in sorted(subtracted_rates[rRNA]): line = '%d\t%f\t%f\t%f\t%f\n' % (position, subtracted_rates[rRNA][position], subtraction_errors[rRNA][position], divided_rates[rRNA][position],division_errors[rRNA][position]) f.write(line) f.close() def standard_error(mutations, coverage): return math.sqrt(float(mutations))/float(coverage) def subtraction_norm(all_counts, all_depths, min_mutations, comparison): sample = comparison[0] control = comparison[1] normalized_rates = defaultdict(dict) normalized_errors = defaultdict(dict) for rRNA_name in all_counts: for position in all_counts[rRNA_name][sample]: if all_counts[rRNA_name][sample][position] >= min_mutations and all_counts[rRNA_name][control][position] >= min_mutations: sample_ratio = float(all_counts[rRNA_name][sample][position])/float(all_depths[rRNA_name][sample][position]) sample_error = standard_error(all_counts[rRNA_name][sample][position], all_depths[rRNA_name][sample][position]) control_ratio = float(all_counts[rRNA_name][control][position])/float(all_depths[rRNA_name][control][position]) control_error = standard_error(all_counts[rRNA_name][control][position], all_depths[rRNA_name][control][position]) normalized_rates[rRNA_name][position] = sample_ratio-control_ratio normalized_errors[rRNA_name][position] = math.sqrt((sample_error**2)+(control_error**2)) else: normalized_rates[rRNA_name][position] = 0 normalized_errors[rRNA_name][position] = 0 return normalized_rates, normalized_errors def division_norm(all_counts, all_depths, min_mutations, comparison): sample = comparison[0] control = comparison[1] normalized_rates = defaultdict(dict) normalized_errors = defaultdict(dict) for rRNA_name in all_counts: for position in all_counts[rRNA_name][sample]: if all_counts[rRNA_name][sample][position] >= min_mutations and all_counts[rRNA_name][control][position] >= min_mutations: sample_ratio = float(all_counts[rRNA_name][sample][position])/float(all_depths[rRNA_name][sample][position]) sample_error = standard_error(all_counts[rRNA_name][sample][position], all_depths[rRNA_name][sample][position]) control_ratio = float(all_counts[rRNA_name][control][position])/float(all_depths[rRNA_name][control][position]) control_error = standard_error(all_counts[rRNA_name][control][position], all_depths[rRNA_name][control][position]) normalized_rates[rRNA_name][position] = math.log(sample_ratio/control_ratio, 2) normalized_errors[rRNA_name][position] = ((sample_ratio/control_ratio)*math.sqrt((sample_error/sample_ratio)**2+(control_error/control_ratio)**2))/((sample_ratio/control_ratio)*math.log(2)) #this is a standard error propogation formula else: normalized_rates[rRNA_name][position] = 0 normalized_errors[rRNA_name][position] = 0 return normalized_rates, normalized_errors def main(): all_counts_file, all_depths_file, min_mutations, output_prefix = sys.argv[1:5] min_mutations = int(min_mutations) all_counts = mod_utils.unPickle(all_counts_file) all_depths = mod_utils.unPickle(all_depths_file) comparisons = (pair.split(',') for pair in sys.argv[5:]) for comparison in comparisons: subtracted_rates, subtraction_errors = subtraction_norm(all_counts, all_depths, min_mutations, comparison) divided_rates, division_errors = division_norm(all_counts, all_depths, min_mutations, comparison) mod_utils.makePickle(subtracted_rates, '%s_%s_%s_sub_norm.pkl' % (output_prefix, comparison[0], comparison[1])) mod_utils.makePickle(subtraction_errors, '%s_%s_%s_sub_err.pkl' % (output_prefix, comparison[0], comparison[1])) mod_utils.makePickle(divided_rates, '%s_%s_%s_div_norm.pkl' % (output_prefix, comparison[0], comparison[1])) mod_utils.makePickle(division_errors, '%s_%s_%s_div_err.pkl' % (output_prefix, comparison[0], comparison[1])) for rRNA in subtracted_rates: write_out_counts(subtracted_rates, subtraction_errors, divided_rates, division_errors, rRNA, '%s_%s_%s_%s.txt' % (output_prefix, comparison[0], comparison[1], rRNA)) main()
{ "repo_name": "borisz264/mod_seq", "path": "unused_scripts/subtract_shapemapper_counts.py", "copies": "1", "size": "5425", "license": "mit", "hash": -5226015900884519000, "line_mean": 55.5208333333, "line_max": 205, "alpha_frac": 0.6849769585, "autogenerated": false, "ratio": 3.522727272727273, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.47077042312272727, "avg_score": null, "num_lines": null }
__author__ = 'boris' """ THIS IS AN OLD SCRIPT, use the _shapemapper.py version instead 5'e end data is a pickled dict of form srt_dict[strand][chrom][position] = counts at position take the 5' end data from count_reads_and_mismatches.py, as well as any number of files output by compute_true_positive_negative.py and compute: 1) 90% windorize the input data (All data above 95th percentile set to 95th percentile) 2) normalize to highest position in rRNA (should just stick to the rRNA of interest, which will be 18S for my initial test) 3) slide a cutoff from 0 to 1 in ~10,000 steps, computing % of true positives and true negatives called positive at each step 4) plot these two percentages against each other for each step, also output these values as a spreadsheet also plot y=x for reference """ import sys, mod_utils, os import numpy from scipy.stats.mstats import winsorize import matplotlib.pyplot as plt plt.rcParams['pdf.fonttype'] = 42 #leaves most text as actual text in PDFs, not outlines from collections import defaultdict def winsorize_norm_chromosome_data(mut_density, chromosome, strand, genome_dict, nucs_to_count, to_winsorize = False, low = 0, high = 0.95): """ :param read_5p_ends: :param chromosome: :param strand: :param genome_dict: :param nucs_to_count: :param low: :param high: :return: an array (now zero-indexed from 1-indexed) of densities for the given chromosome on the given strand, winsorized, and only for the given nucleotides """ max_position = max(mut_density[strand][chromosome].keys()) density_array =numpy.array([0.0] * max_position) for position in mut_density[strand][chromosome].keys(): if genome_dict[chromosome][position-1] in nucs_to_count: density_array[position-1] = mut_density[strand][chromosome][position] if to_winsorize: winsorize(density_array, limits = (low, 1-high), inplace = True) normed_array = density_array/float(max(density_array)) return normed_array def get_tp_tn(tp_tn_file): TP = set() TN = set() f = open(tp_tn_file) for line in f: ll= line.strip('\n').split('\t') if ll[2] == 'TP': TP.add(int(ll[0])) if ll[2] =='TN': TN.add(int(ll[0])) f.close() return TP, TN def call_positives(density_array, chromosome, strand, genome_dict, nucs_to_count, cutoff): """ :param density_array: :return:a set of called positive positions I've reverted these to 1-indexed to match the TP and TN calls from the structures """ positives = set() for i in range(len(density_array)): if genome_dict[chromosome][i] in nucs_to_count: if density_array[i] >= cutoff: positives.add(i+1)#adding 1 not necessary for RT stops, since the modified nucleotide is the one 1 upstream of the RT stop!!! return positives def plot_ROC_curves(roc_curves, out_prefix): fig = plt.figure(figsize=(8,8)) plot = fig.add_subplot(111)#first a pie chart of mutated nts color_index = 0 for name in roc_curves: x, y = roc_curves[name] plot.plot(x, y, lw =2, label = name, color = mod_utils.rainbow[color_index]) color_index +=1 plot.plot(x, x, lw =1, ls = 'dashed', color = mod_utils.rainbow[color_index], label = 'y=x') plot.set_xlabel('False positive rate (%) (100-specificity)') plot.set_ylabel('True positive rate (%) (sensitivity)') lg=plt.legend(loc=2,prop={'size':10}, labelspacing=0.2) lg.draw_frame(False) plt.savefig(out_prefix + '.pdf', transparent='True', format='pdf') plt.clf() def pie_read_5p_ends(read_5p_ends, genome_dict, out_prefix): nuc_counts = defaultdict(int) for chromosome in read_5p_ends['+']: for position in read_5p_ends['+'][chromosome]: if position-2 > 0 : nuc = genome_dict[chromosome][position-1] nuc_counts[nuc] += read_5p_ends['+'][chromosome][position] fig = plt.figure(figsize=(8,8)) plot = fig.add_subplot(111)#first a pie chart of mutated nts labels = sorted(nuc_counts.keys()) sizes = [nuc_counts[nt] for nt in labels] plot.pie(sizes, labels = labels, colors = mod_utils.rainbow) plot.set_title('nt exactly at read 5p ends across rRNA') plt.savefig(out_prefix + '_nt_5p_ends.pdf', transparent='True', format='pdf') plt.clf() def main(): tp_tn_annotations, genome_fasta, outprefix = sys.argv[1:4] density_files = sys.argv[4:] sample_names = [os.path.basename(filename) for filename in density_files] mutation_densities = [mod_utils.unPickle(pickled_density) for pickled_density in density_files] genome_dict = mod_utils.convertFastaToDict(genome_fasta) normed_density_arrays = [winsorize_norm_chromosome_data(mutation_density, 'S.c.18S_rRNA', '+', genome_dict, 'ACTG') for mutation_density in mutation_densities] real_tp, real_tn = get_tp_tn(tp_tn_annotations) roc_curves = {} for sample_name in sample_names: roc_curves[sample_name] = [[],[]]#x and y value arrays for each stepsize = 0.0001 for cutoff in numpy.arange(0,1.+5*stepsize, stepsize): for i in range(len(sample_names)): called_p = call_positives(normed_density_arrays[i], 'S.c.18S_rRNA', '+', genome_dict, 'AC', cutoff) num_tp_called = len(called_p.intersection(real_tp))#how many true positives called at this cutoff num_fp_called = len(called_p.intersection(real_tn))#how many fp positives called at this cutoff roc_curves[sample_names[i]][1].append(100.*num_tp_called/float(len(real_tp)))#TP rate on y axis roc_curves[sample_names[i]][0].append(100.*num_fp_called/float(len(real_tn)))#FP rate on x axis plot_ROC_curves(roc_curves, outprefix) #pie_read_5p_ends(read_5p_ends, genome_dict, outprefix) if __name__ == '__main__': main()
{ "repo_name": "borisz264/mod_seq", "path": "structure_ROC_curves/roc_curves_compare_datasets.py", "copies": "1", "size": "5936", "license": "mit", "hash": 419200575673032770, "line_mean": 42.9777777778, "line_max": 163, "alpha_frac": 0.661893531, "autogenerated": false, "ratio": 3.2615384615384615, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.44234319925384613, "avg_score": null, "num_lines": null }
__author__ = 'boris' """ THIS IS FOR TROUBLESHOOTING AND COMPARING DIFFERENT TRUE POSITIVE AND TRUE NEGATIVE ANNOTATIONS 5'e end data is a pickled dict of form srt_dict[strand][chrom][position] = counts at position take the 5' end data from count_reads_and_mismatches.py, as well as any number of files output by compute_true_positive_negative.py and compute: 1) 90% windorize the input data (All data above 95th percentile set to 95th percentile) 2) normalize to highest position in rRNA (should just stick to the rRNA of interest, which will be 18S for my initial test) 3) slide a cutoff from 0 to 1 in ~10,000 steps, computing % of true positives and true negatives called positive at each step 4) plot these two percentages against each other for each step, also output these values as a spreadsheet also plot y=x for reference """ import sys, mod_utils, os import numpy from scipy.stats.mstats import winsorize import matplotlib.pyplot as plt plt.rcParams['pdf.fonttype'] = 42 #leaves most text as actual text in PDFs, not outlines from collections import defaultdict def winsorize_norm_chromosome_data(read_5p_ends, chromosome, strand, genome_dict, nucs_to_count, to_winsorize = True, low = 0, high = 0.95): """ :param read_5p_ends: :param chromosome: :param strand: :param genome_dict: :param nucs_to_count: :param low: :param high: :return: an array (now zero-indexed from 1-indexed) of densities for the given chromosome on the given strand, winsorized, and only for the given nucleotides """ max_position = max(read_5p_ends[strand][chromosome].keys()) density_array =numpy.array([0] * max_position) for position in read_5p_ends[strand][chromosome].keys(): if genome_dict[chromosome][position-1] in nucs_to_count: density_array[position-1] = read_5p_ends[strand][chromosome][position] if to_winsorize: winsorize(density_array, limits = (low, 1-high), inplace = True) normed_array = density_array/float(max(density_array)) return normed_array def get_tp_tn(tp_tn_file): TP = set() TN = set() f = open(tp_tn_file) for line in f: ll= line.strip('\n').split('\t') if ll[2] == 'TP': TP.add(int(ll[0])) if ll[2] =='TN': TN.add(int(ll[0])) f.close() return TP, TN def call_positives(density_array, chromosome, strand, genome_dict, nucs_to_count, cutoff): """ :param density_array: :return:a set of called positive positions I've reverted these to 1-indexed to match the TP and TN calls from the structures """ positives = set() for i in range(len(density_array)): if genome_dict[chromosome][i-1] in nucs_to_count: if density_array[i] >= cutoff: positives.add(i)#adding 1 not necessary, since the modified nucleotide is the one 1 upstream of the RT stop!!! return positives def plot_ROC_curves(roc_curves, out_prefix): fig = plt.figure(figsize=(8,8)) plot = fig.add_subplot(111)#first a pie chart of mutated nts color_index = 0 for name in roc_curves: x, y = roc_curves[name] plot.plot(x, y, lw =2, label = name, color = mod_utils.rainbow[color_index]) color_index +=1 plot.plot(x, x, lw =1, ls = 'dashed', color = mod_utils.rainbow[color_index], label = 'y=x') plot.set_xlabel('False positive rate (%) (100-specificity)') plot.set_ylabel('True positive rate (%) (sensitivity)') lg=plt.legend(loc=2,prop={'size':10}, labelspacing=0.2) lg.draw_frame(False) plt.savefig(out_prefix + '.pdf', transparent='True', format='pdf') plt.clf() def pie_read_5p_ends(read_5p_ends, genome_dict, out_prefix): nuc_counts = defaultdict(int) for chromosome in read_5p_ends['+']: for position in read_5p_ends['+'][chromosome]: if position-2 > 0 : nuc = genome_dict[chromosome][position-1] nuc_counts[nuc] += read_5p_ends['+'][chromosome][position] fig = plt.figure(figsize=(8,8)) plot = fig.add_subplot(111)#first a pie chart of mutated nts labels = sorted(nuc_counts.keys()) sizes = [nuc_counts[nt] for nt in labels] plot.pie(sizes, labels = labels, colors = mod_utils.rainbow) plot.set_title('nt exactly at read 5p ends across rRNA') plt.savefig(out_prefix + '_nt_5p_ends.pdf', transparent='True', format='pdf') plt.clf() def main(): read_5p_ends_file, genome_fasta, outprefix = sys.argv[1:4] tp_tn_annotations = sys.argv[4:]#true positive and true negative annotations genome_dict = mod_utils.convertFastaToDict(genome_fasta) read_5p_ends = mod_utils.unPickle(read_5p_ends_file) normed_density_array = winsorize_norm_chromosome_data(read_5p_ends, 'S.c.18S_rRNA', '+', genome_dict, 'ACTG') real_tp_tn_data = [] for filename in tp_tn_annotations: real_tp, real_tn = get_tp_tn(filename) real_tp_tn_data.append((os.path.basename(filename), real_tp, real_tn)) roc_curves = {} for entry in real_tp_tn_data: roc_curves[entry[0]] = [[],[]]#x and y value arrays for each stepsize = 0.0001 for cutoff in numpy.arange(0,1.+5*stepsize, stepsize): called_p = call_positives(normed_density_array, 'S.c.18S_rRNA', '+', genome_dict, 'AC', cutoff) for entry in real_tp_tn_data: #print called_p.intersection(entry[1]) num_tp_called = len(called_p.intersection(entry[1]))#how many true positives called at this cutoff num_fp_called = len(called_p.intersection(entry[2]))#how many fp positives called at this cutoff roc_curves[entry[0]][0].append(100.*num_fp_called/float(len(entry[2])))#FP rate on x axis roc_curves[entry[0]][1].append(100.*num_tp_called/float(len(entry[1])))#TP rate on y axis plot_ROC_curves(roc_curves, outprefix) #pie_read_5p_ends(read_5p_ends, genome_dict, outprefix) if __name__ == '__main__': main()
{ "repo_name": "borisz264/mod_seq", "path": "structure_ROC_curves/roc_curves_compare_annotations.py", "copies": "1", "size": "5995", "license": "mit", "hash": -4845367873214606000, "line_mean": 42.1366906475, "line_max": 161, "alpha_frac": 0.657381151, "autogenerated": false, "ratio": 3.202457264957265, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.43598384159572645, "avg_score": null, "num_lines": null }
__author__ = 'boris zinshteyn' """ Intended for processing of 80s monosome-seq data from defined RNA pools Based on Alex Robertson's original RBNS pipeline, available on github """ import matplotlib.pyplot as plt plt.rcParams['pdf.fonttype'] = 42 #leaves most text as actual text in PDFs, not outlines import os import argparse import subprocess import ms_settings import ms_utils import ms_lib import ms_qc import ms_plotting from collections import defaultdict import numpy as np import scipy.stats as stats class mse: def __init__(self, settings, threads): self.threads = threads self.settings = settings self.remove_adaptor() self.trim_reference_pool_fasta() self.build_bowtie_index() self.map_reads() self.initialize_libs() def initialize_libs(self): self.settings.write_to_log('initializing libraries, counting reads') ms_utils.make_dir(self.rdir_path('sequence_counts')) self.libs = [] ms_utils.parmap(lambda lib_settings: ms_lib.initialize_pool_sequence_mappings(self.settings, lib_settings), self.settings.iter_lib_settings(), nprocs=self.threads) map(lambda lib_settings: self.initialize_lib(lib_settings), self.settings.iter_lib_settings()) self.settings.write_to_log('initializing libraries, counting reads, done') self.monosome_libs = [self.find_lib_by_sample_name(sample_name) for sample_name in self.settings.get_property('monosome_libraries')] self.mrnp_libs = [self.find_lib_by_sample_name(sample_name) for sample_name in self.settings.get_property('mrnp_libraries')] self.total_libs = [self.find_lib_by_sample_name(sample_name) for sample_name in self.settings.get_property('total_libraries')] self.input_libs = [self.find_lib_by_sample_name(sample_name) for sample_name in self.settings.get_property('total_libraries')] def find_lib_by_sample_name(self, sample_name): for lib in self.libs: if lib.lib_settings.sample_name == sample_name: return lib assert False #if this triggers, your settings file is broken. def initialize_lib(self, lib_settings): lib = ms_lib.ms_Lib(self.settings, lib_settings) self.libs.append(lib) def needs_calculation(self, lib_settings, count_type, k): if self.settings.get_force_recount(count_type): return True return not lib_settings.counts_exist(count_type, k) def make_tables(self): ms_utils.make_dir(self.rdir_path('tables')) self.make_counts_table() self.make_counts_table(fractional=True) self.make_monosome_recruitment_table() self.write_sequence_subset(0, read_cutoff=128) self.write_sequence_subset(0.8, read_cutoff=128) self.write_sequence_subset(0.7, read_cutoff=128) for anno_filename in self.settings.get_property('matched_set_annotations'): self.make_matched_recruitment_change_table(anno_filename, read_cutoff=self.settings.get_property('comparison_read_cutoff')) def make_plots(self): ms_utils.make_dir(self.rdir_path('plots')) #ms_plotting.all_library_rpm_scatter(self) #ms_plotting.monosome_over_mrnp_reproducibility(self) #ms_plotting.monosome_over_total_reproducibility(self) #ms_plotting.monosome_over_mrnp_plus_monosome_reproducibility(self) for anno_filename in self.settings.get_property('matched_set_annotations'): ms_plotting.plot_recruitment_violins(self, anno_filename, read_cutoff=self.settings.get_property('comparison_read_cutoff')) ''' ms_plotting.recruitment_change_rank_value_plot_static(self, anno_filename, read_cutoff=self.settings.get_property('comparison_read_cutoff')) ms_plotting.reverse_recruitment_change_rank_value_plot_static(self, anno_filename, read_cutoff=self.settings.get_property('comparison_read_cutoff')) if self.settings.get_property('make_interactive_plots'): ms_plotting.recruitment_change_rank_value_plot_interactive(self, anno_filename, read_cutoff=self.settings.get_property('comparison_read_cutoff')) ms_plotting.recruitment_fold_change_rank_value_plot_interactive(self, anno_filename, read_cutoff=self.settings.get_property( 'comparison_read_cutoff')) ''' def remove_adaptor(self): if not self.settings.get_property('force_retrim'): for lib_settings in self.settings.iter_lib_settings(): if not lib_settings.adaptorless_reads_exist(): break else: return if self.settings.get_property('trim_adaptor'): ms_utils.make_dir(self.rdir_path('adaptor_removed')) ms_utils.parmap(lambda lib_setting: self.remove_adaptor_one_lib(lib_setting), self.settings.iter_lib_settings(), nprocs = self.threads) def remove_adaptor_one_lib(self, lib_settings): lib_settings.write_to_log('adaptor trimming') """ -a specifies the 3' adaptor to trim from the forawrd read (read1) -G specifies the 5' adaptor to trim from the reverse read (read2) -o is the read1 output file -p is the read2 output file """ if not self.settings.get_property('read2_5p_adaptor_sequence').strip()=='': command_to_run = 'cutadapt -a %s -G %s --overlap 5 -u %d -U %d -q %d --trim-n --minimum-length %d --pair-filter=both -o %s -p %s %s %s 1>>%s 2>>%s' % ( self.settings.get_property('read1_3p_adaptor_sequence'), self.settings.get_property('read2_5p_adaptor_sequence'), self.settings.get_property('read1_5p_bases_to_trim'), self.settings.get_property('read2_5p_bases_to_trim'), self.settings.get_property('quality_cutoff'), self.settings.get_property('min_post_adaptor_length'), lib_settings.get_adaptor_trimmed_reads()[0], lib_settings.get_adaptor_trimmed_reads()[1], lib_settings.get_paired_fastq_gz_files()[0], lib_settings.get_paired_fastq_gz_files()[1], lib_settings.get_log(), lib_settings.get_log()) else: command_to_run = 'cutadapt -a %s --overlap 5 -u %d -U %d -q %d --trim-n --minimum-length %d --pair-filter=both -o %s -p %s %s %s 1>>%s 2>>%s' % ( self.settings.get_property('read1_3p_adaptor_sequence'), self.settings.get_property('read1_5p_bases_to_trim'), self.settings.get_property('read2_5p_bases_to_trim'), self.settings.get_property('quality_cutoff'), self.settings.get_property('min_post_adaptor_length'), lib_settings.get_adaptor_trimmed_reads()[0], lib_settings.get_adaptor_trimmed_reads()[1], lib_settings.get_paired_fastq_gz_files()[0], lib_settings.get_paired_fastq_gz_files()[1], lib_settings.get_log(), lib_settings.get_log()) subprocess.Popen(command_to_run, shell=True).wait() lib_settings.write_to_log('adaptor trimming done') def build_bowtie_index(self): """ builds a bowtie 2 index from the input fasta file recommend including barcode+PCR sequences just in case of some no-insert amplicons """ self.settings.write_to_log('building bowtie index') if self.settings.get_property('force_index_rebuild') or not self.settings.bowtie_index_exists(): ms_utils.make_dir(self.rdir_path('bowtie_indices')) index = self.settings.get_bowtie_index() subprocess.Popen('bowtie2-build -f --offrate 0 %s %s 1>>%s 2>>%s' % (self.settings.get_trimmed_pool_fasta(), self.settings.get_bowtie_index(), self.settings.get_log()+'.bwt', self.settings.get_log()+'.bwt'), shell=True).wait() self.settings.write_to_log('building bowtie index complete') def trim_reference_pool_fasta(self): ''' Trims the reference sequences to the length of the trimmed reads + a buffer ''' trim_5p = self.settings.get_property('pool_5p_bases_to_trim') #nucleotides to cut from 5' end trim_3p = self.settings.get_property('pool_3p_bases_to_trim') #nucleotides to cut from 3' end f = open(self.settings.get_property('pool_fasta')) g = open(self.settings.get_trimmed_pool_fasta(), 'w') for line in f: if not line.strip() == '' and not line.startswith('#'):#ignore empty lines and commented out lines if line.startswith('>'):#> marks the start of a new sequence g.write(line) else: g.write(self.settings.get_property('pool_prepend')+line.strip()[trim_5p:len(line.strip())-trim_3p]+self.settings.get_property('pool_append')+'\n') f.close() g.close() def map_reads(self): """ map all reads using bowtie :return: """ self.settings.write_to_log('mapping reads') if not self.settings.get_property('force_remapping'): for lib_settings in self.settings.iter_lib_settings(): if not lib_settings.mapped_reads_exist(): break else: return ms_utils.make_dir(self.rdir_path('mapped_reads')) ms_utils.make_dir(self.rdir_path('mapping_stats')) ms_utils.make_dir(self.rdir_path('unmapped_reads')) ms_utils.parmap(lambda lib_setting: self.map_one_library(lib_setting), self.settings.iter_lib_settings(), nprocs = self.threads) self.settings.write_to_log( 'finished mapping reads') def map_one_library(self, lib_settings): lib_settings.write_to_log('mapping_reads') subprocess.Popen('bowtie2 -q --very-sensitive-local --norc --no-mixed --no-overlap --no-discordant -t -x %s -p %d -1 %s -2 %s --un-conc-gz %s -S %s 1>> %s 2>>%s' % (self.settings.get_bowtie_index(), self.threads, lib_settings.get_adaptor_trimmed_reads()[0], lib_settings.get_adaptor_trimmed_reads()[1], lib_settings.get_unmappable_reads_prefix(), lib_settings.get_mapped_reads_sam(), lib_settings.get_log(), lib_settings.get_pool_mapping_stats()), shell=True).wait() #subprocess.Popen('samtools view -b -h -o %s %s 1>> %s 2>> %s' % (lib_settings.get_mapped_reads(), lib_settings.get_mapped_reads_sam(), lib_settings.get_log(), lib_settings.get_log()), shell=True).wait() #also, sort bam file, and make an index #samtools view -uS myfile.sam | samtools sort - myfile.sorted subprocess.Popen('samtools view -uS %s | samtools sort - %s.temp_sorted 1>>%s 2>>%s' % (lib_settings.get_mapped_reads_sam(), lib_settings.get_mapped_reads_sam(), lib_settings.get_log(), lib_settings.get_log()), shell=True).wait() #subprocess.Popen('samtools sort %s %s.temp_sorted 1>>%s 2>>%s' % (lib_settings.get_mapped_reads_sam(), lib_settings.get_mapped_reads_sam(), # lib_settings.get_log(), lib_settings.get_log()), shell=True).wait() subprocess.Popen('mv %s.temp_sorted.bam %s' % (lib_settings.get_mapped_reads_sam(), lib_settings.get_mapped_reads()), shell = True).wait() subprocess.Popen('samtools index %s' % (lib_settings.get_mapped_reads()), shell = True).wait() subprocess.Popen('rm %s' % (lib_settings.get_mapped_reads_sam()), shell = True).wait() lib_settings.write_to_log('mapping_reads done') def rdir_path(self, *args): return os.path.join(self.settings.get_rdir(), *args) def get_rdir_fhandle(self, *args): """ returns a filehandle to the fname in the rdir """ out_path = self.rdir_path(*args) out_dir = os.path.dirname(out_path) if not os.path.exists(out_dir): os.makedirs(out_dir) return ms_utils.aopen(out_path, 'w') def perform_qc(self): qc_engine = ms_qc.ms_qc(self, self.settings, self.threads) qc_engine.write_mapping_summary(self.settings.get_overall_mapping_summary()) qc_engine.print_library_count_concordances() qc_engine.plot_average_read_positions() qc_engine.plot_fragment_length_distributions() qc_engine.plot_count_distributions() qc_engine.read_cutoff_choice_plot() def make_counts_table(self, fractional=False): """ write out number of fragments mapping to each TL in each dataset :param fractional: if True, replace raw counts with library fraction in reads per million :return: """ if fractional: summary_file = open(os.path.join( self.rdir_path('tables'), 'rpm.txt'), 'w') else: summary_file = open(os.path.join( self.rdir_path('tables'), 'raw_counts.txt'), 'w') header = 'sequence name\t' + '\t'.join([lib.lib_settings.sample_name for lib in self.libs]) + '\n' summary_file.write(header) if fractional: for sequence_name in self.libs[0].pool_sequence_mappings: out_line = '%s\t%s\n' % (sequence_name, '\t'.join(['%f' % ((10**6)*lib.pool_sequence_mappings[sequence_name].fragment_count/float(lib.total_mapped_fragments)) for lib in self.libs])) summary_file.write(out_line) else: for sequence_name in self.libs[0].pool_sequence_mappings: out_line = '%s\t%s\n' % (sequence_name, '\t'.join(['%f' % lib.pool_sequence_mappings[sequence_name].fragment_count for lib in self.libs])) summary_file.write(out_line) summary_file.close() def make_monosome_recruitment_table(self, read_cutoff=128): """ write out 80S recruitment metric for each TL in each replicate :param read_cutoff: require this many read between mRNP and monosome to include this TL. :return: """ output_file = open(os.path.join( self.rdir_path('tables'), 'monosome_recruitment.txt'), 'w') trimmed_sequences = ms_utils.convertFastaToDict(self.settings.get_trimmed_pool_fasta()) header = 'sequence name\tsequence\t' + '\t'.join(['%s/(%s+%s)' % (self.monosome_libs[i].lib_settings.sample_name, self.monosome_libs[i].lib_settings.sample_name, self.mrnp_libs[i].lib_settings.sample_name) for i in range(len(self.monosome_libs))]) + '\n' output_file.write(header) for sequence_name in self.monosome_libs[0].pool_sequence_mappings: out_line = '%s\t%s\t%s\n' % (sequence_name, trimmed_sequences[sequence_name], '\t'.join(['%f' % (self.monosome_libs[i].get_rpm(sequence_name)/ (self.monosome_libs[i].get_rpm(sequence_name)+ self.mrnp_libs[i].get_rpm(sequence_name))) if (self.monosome_libs[i].get_counts(sequence_name) + self.mrnp_libs[i].get_counts(sequence_name)) >= read_cutoff else '' for i in range(len(self.monosome_libs)) ])) output_file.write(out_line) output_file.close() def write_sequence_subset(self, recruitment_cutoff, read_cutoff=128, as_RNA=True): """ write out fasta of all sequences that pass a certain recruitment cutoff in all libraries :return: """ output_file = open(os.path.join( self.rdir_path('tables'), 'recruitment_above_%f.fasta' % recruitment_cutoff), 'w') trimmed_sequences = ms_utils.convertFastaToDict(self.settings.get_trimmed_pool_fasta()) for sequence_name in self.monosome_libs[0].pool_sequence_mappings: rec_scores = [(self.monosome_libs[i].get_rpm(sequence_name) / (self.monosome_libs[i].get_rpm(sequence_name) + self.mrnp_libs[i].get_rpm(sequence_name))) for i in range(len(self.monosome_libs)) if (self.monosome_libs[i].get_counts(sequence_name) + self.mrnp_libs[i].get_counts(sequence_name)) >= read_cutoff] if (len(rec_scores) == len(self.monosome_libs)): average_score = np.average(rec_scores) if average_score >=recruitment_cutoff: output_file.write('>%s_rec_%f\n' % (sequence_name, average_score)) seq = trimmed_sequences[sequence_name] if as_RNA: seq = ms_utils.rna(seq) output_file.write('%s\n' % (seq)) output_file.close() def make_matched_recruitment_change_table(self, annotation_file, read_cutoff=128): """ write out number of fragments mapping to each TL in each dataset :param read_cutoff: require this many read between mRNP and monosome to include this TL. :return: """ set_name1, set_name2, matched_set = self.parse_matched_set_annotation(annotation_file) output_file = open(os.path.join( self.rdir_path('tables'), '%s_%s_matched_monosome_recruitment_change.txt' % (set_name1, set_name2)), 'w') header = '%s\t%s\t' % (set_name1, set_name2) + '\t'.join(['%s %s-%s recruitment score' % (self.monosome_libs[i].lib_settings.sample_name, set_name1, set_name2) for i in range(len(self.monosome_libs))]) + '\t'+\ '\t'.join(['%s %s/%s recruitment score' % (self.monosome_libs[i].lib_settings.sample_name, set_name1, set_name2) for i in range(len(self.monosome_libs))])+'\tttest p\n' output_file.write(header) for matched_pool_seqs in matched_set: set1_scores = [] set2_scores = [] for i in range(len(self.monosome_libs)): set_1_counts = self.monosome_libs[i].get_counts(matched_pool_seqs[0])\ + self.mrnp_libs[i].get_counts(matched_pool_seqs[0]) set_2_counts = self.monosome_libs[i].get_counts(matched_pool_seqs[1]) \ + self.mrnp_libs[i].get_counts(matched_pool_seqs[1]) # include only comparisons where the average number of reads is high enough if set_1_counts >= read_cutoff and set_2_counts >= read_cutoff: set1_score = self.monosome_libs[i].get_rpm(matched_pool_seqs[0]) / \ (self.monosome_libs[i].get_rpm(matched_pool_seqs[0]) + self.mrnp_libs[i].get_rpm(matched_pool_seqs[0])) set2_score = self.monosome_libs[i].get_rpm(matched_pool_seqs[1]) / \ (self.monosome_libs[i].get_rpm(matched_pool_seqs[1]) + self.mrnp_libs[i].get_rpm(matched_pool_seqs[1])) else: set1_score = float('nan') set2_score = float('nan') set1_scores.append(set1_score) set2_scores.append(set2_score) recruitment_changes = np.array(set1_scores)-np.array(set2_scores) recruitment_fold_changes = np.array(set1_scores)/np.array(set2_scores) scores_1_filtered, scores_2_filtered = ms_utils.filter_x_y_pairs(set1_scores, set2_scores) if len(scores_1_filtered)>0 and len(scores_2_filtered)>0: t, p = stats.ttest_ind(scores_1_filtered, scores_2_filtered) else: p = float('nan') out_line = '%s\t%s\t%s\t%s\t%f\n' % (matched_pool_seqs[0], matched_pool_seqs[1], '\t'.join(['%f' % score_change for score_change in recruitment_changes]), '\t'.join(['%f' % score_change for score_change in recruitment_fold_changes]), p) output_file.write(out_line) output_file.close() def parse_matched_set_annotation(self, filename): matched_set = set()# a set of tuples matching a sequence name to one matched to it. sequences cana ppear multiple times, but the pairs ought to be unique f = open(filename) lines = f.readlines() header = lines[0] set_name1, set_name2 = header.strip().split('\t') for line in lines[1:]: seq_name1, seq_name2 = line.strip().split('\t') matched_set.add((seq_name1, seq_name2)) f.close() return set_name1, set_name2, matched_set def parse_args(): parser = argparse.ArgumentParser() parser.add_argument("settings_file") parser.add_argument("--make-tables", help="Makes tables.", action='store_true') parser.add_argument("--perform-qc", help="performs quality control analysis.", action='store_true') parser.add_argument("--make-plots", help="Makes plots.", action='store_true') parser.add_argument("--comparisons", help="Does comparisons to other experiments", action='store_true') parser.add_argument("--all-tasks", help="Makes plots, tables, folding and comparisons", action='store_true') parser.add_argument("--threads", help="Max number of processes to use", type = int, default = 8) args = parser.parse_args() return args def main(): """ """ args = parse_args() settings = ms_settings.ms_settings(args.settings_file) ms_experiment = mse(settings, args.threads) print 'mse ready' if args.perform_qc or args.all_tasks: print 'QC' settings.write_to_log('performing QC') ms_experiment.perform_qc() settings.write_to_log('done performing QC') if args.make_tables or args.all_tasks: print 'tables' settings.write_to_log('making tables') ms_experiment.make_tables() settings.write_to_log('done making tables') if args.make_plots or args.all_tasks: print 'plots' settings.write_to_log('making plots') ms_experiment.make_plots() settings.write_to_log('done making plots') ''' if args.comparisons or args.all_tasks: settings.write_to_log('doing comparisons') ms_experiment.compare_all_other_experiments() ''' main()
{ "repo_name": "borisz264/mono_seq", "path": "mono_seq_main.py", "copies": "1", "size": "24383", "license": "mit", "hash": -6215894587800873000, "line_mean": 54.2925170068, "line_max": 269, "alpha_frac": 0.5590780462, "autogenerated": false, "ratio": 3.8104391311142365, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.48695171773142365, "avg_score": null, "num_lines": null }
__author__ = 'BoscoTsang' import copy import numpy import scipy from sklearn.cluster import KMeans def SPLL(X1, X2, PARAM=None): if PARAM is None: k = 3 else: k = PARAM Ch = numpy.zeros(2) ps = numpy.zeros(2) s = numpy.zeros(2) Ch[0], ps[0], s[0] = Log_LL(X1, X2, k) Ch[1], ps[1], s[1] = Log_LL(X2, X1, k) ind = numpy.argmax(s) Change = Ch[ind] st = s[ind] pst = ps[ind] return Change, pst, st def Log_LL(X1, X2, k): assert X1.shape[1] == X2.shape[1] n = X1.shape[1] kmean = KMeans(k, init=X1[:k, :], max_iter=100) kmean.fit(X1) labels = kmean.predict(X1) means = kmean.cluster_centers_ SC = [] label_prior = numpy.zeros((1, k)) for i in xrange(k): label_idx = labels == i label_prior[0, i] = numpy.sum(label_idx) if label_prior[0, i] < 1: SC.append(numpy.zeros(n)) else: if X1[label_idx, :].shape[0] > 1: SC.append(numpy.diag(numpy.var(X1[label_idx, :], axis=0, ddof=1)).flatten()) else: SC.append(numpy.diag(numpy.var(X1[label_idx, :], axis=0, ddof=0)).flatten()) SC = numpy.asarray(SC) label_count = copy.deepcopy(label_prior) label_prior /= X1.shape[0] scov = numpy.sum(SC * numpy.tile(label_prior.T, (1, n ** 2)), axis=0) scov = numpy.reshape(scov, (n, n)) z = numpy.array(numpy.diag(scov)) indexvarzero = z < numpy.spacing(1) if numpy.sum(indexvarzero) == 0: invscov = numpy.linalg.inv(scov) else: z[indexvarzero] = numpy.min(z[~indexvarzero]) invscov = numpy.diag(1. / z) LogLikelihoodTerm = numpy.zeros(X2.shape[0]) for j in xrange(X2.shape[0]): xx = X2[j, :] DistanceToMeans = numpy.zeros(k) for jj in xrange(k): if label_count[0, jj] > 0: DistanceToMeans[jj] = numpy.dot(numpy.dot((means[jj, :] - xx), invscov), (means[jj, :] - xx).T) else: DistanceToMeans[jj] = numpy.inf LogLikelihoodTerm[j] = numpy.min(DistanceToMeans) st = numpy.mean(LogLikelihoodTerm) pst = min(scipy.stats.chi2.cdf(st, n), 1 - scipy.stats.chi2.cdf(st, n)) Change = pst < 0.05 return Change, pst, st if "__main__" == __name__: #a = numpy.array([[0.3, 1.4, 0.9], [0.2, 1.2, 0.7], [0.1, 1.0, 0.77], [0.4, 1.8, 0.9], [0.33, 1.3, 0.7]]) #b = numpy.array([[0.3, 1.2, 0.9], [0.2, 1.4, 0.7], [0.1, 1.3, 0.77], [0.4, 1.0, 0.9], [0.33, 1.8, 0.7]]) a = numpy.random.random((4, 4)) b = numpy.random.random((4, 4)) + 0.1 print a print b change, pst, st = SPLL(a, b, 3) print change, pst, st
{ "repo_name": "boscotsang/SPLL-Python", "path": "SPLL.py", "copies": "1", "size": "2677", "license": "mit", "hash": 745278764219821700, "line_mean": 30.4941176471, "line_max": 111, "alpha_frac": 0.5390362346, "autogenerated": false, "ratio": 2.5965082444228904, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.8631615209367813, "avg_score": 0.0007858539310152214, "num_lines": 85 }
__author__ = "Bo Shi" __version__ = "0.2.1" __date__ = "10/2008" __copyright__ = """ Copyright (c) 2007, Bo Shi Copyright (c) 2008, Julien Demoor All rights reserved. """ __license__ = """ Redistribution and use in source and binary forms, with or without modification, are permitted provided that the following conditions are met: * Redistributions of source code must retain the above copyright notice, this list of conditions and the following disclaimer. * Redistributions in binary form must reproduce the above copyright notice, this list of conditions and the following disclaimer in the documentation and/or other materials provided with the distribution. * Neither the name SNAPboard nor the names of its contributors may be used to endorse or promote products derived from this software without specific prior written permission. THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. """ #__history__ = "" # vim: ai ts=4 sts=4 et sw=4
{ "repo_name": "SarathkumarJ/snapboard", "path": "snapboard/__init__.py", "copies": "5", "size": "1671", "license": "bsd-3-clause", "hash": 8683229756954421000, "line_mean": 42.9736842105, "line_max": 77, "alpha_frac": 0.7707959306, "autogenerated": false, "ratio": 4.230379746835443, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 1, "avg_score": 0.005091287755318106, "num_lines": 38 }
__author__ = 'Bouhm' #Methods that access API and return dictionary/JSON files of data #d import requests import json import re import pprint from constants import URL_RIOT_API as API, API_VERSIONS as VER class RiotAPIData(object): def __init__(self, api_key, region='na'): self.api_key = api_key self.region = region #Fetch API url and get JSON data def _request(self, api_url, params={}): args = {'api_key': self.api_key} for key, value in params.items(): if key not in args: args[key] = value response = requests.get( API['base'].format( proxy = self.region, region = self.region, url = api_url ), params = args ) return response.json() #Get all mercenaries and upgrades purchased in match #Return python dictionary of mercenaries and upgrades def _get_BMB_mercs(self): args = {'api_key': self.api_key, 'itemListData': 'groups'} api_url = API['item'].format(version=VER['lol_static_data']) response = requests.get( API['base_static_data'].format( proxy = self.region, region = self.region, url = api_url ), params=args ) items = response.json() merc = {} merc_upgrade = [] for item in items['data'].values(): group = [value for key, value in item.items() if 'group' in key] if len(group) != 0 and 'BWMerc' in group[0]: if ('Upgrade' in group[0] or 'Offense' in group[0] or 'Defense' in group[0]): merc_upgrade.append(item['id']) else: merc.update({item['id']:item['name']}) merc.update({'mercUpgrades':merc_upgrade}) return merc #Get all relevant data from BMB matches #Return dictionary of champion ids, champion item ids, mercenaries, and respective upgrades def get_BMB_data(self, match_id=None, file=None): if file == None: match_data = self._request( API['match'].format( version = VER['match'], match_id = match_id ), {'includeTimeline':'true'} ) else: match_data = file teams_data = self._get_teams_data(match_data) # if teams_data['winner']['teamId'] == '100': # winner = ['1', '2', '3', '4', '5'] # else: # winner = ['6', '7', '8', '9', '10'] player_mercs = {} timeline = match_data['timeline']['frames'] for events in timeline: if 'events' in events.keys(): for event in events['events']: if event['eventType'] == 'ITEM_PURCHASED': item_id = event['itemId'] participant = str(event['participantId']) if item_id in [3611, 3612, 3613, 3614]: #Mercenaries player_mercs.update({participant:{'merc': item_id}}) player_mercs[participant].update({'offense': 0, 'defense':0, 'upgrade':0}) elif item_id in [3621, 3622, 3623]: player_mercs[participant]['offense'] += 1 elif item_id in [3624, 3625, 3626]: player_mercs[participant]['defense'] += 1 elif item_id in [3615, 3616, 3617]: player_mercs[participant]['upgrade'] += 1 for player in player_mercs: # if player in winner: # team = 'winner' # else: # team = 'loser' if float(player) < 6: team = '100' else : team = '200' merc_data = player_mercs[player].copy() if player_mercs[player]['merc'] in teams_data[team].keys(): del merc_data['merc'] teams_data[team][player_mercs[player]['merc']].append(merc_data) else: del merc_data['merc'] teams_data[team].update({player_mercs[player]['merc']:[merc_data]}) return teams_data #Get data from each team from given match data dictionary #Return dictionary def _get_teams_data(self, match_data): winner = 0 loser = 0 #Exclude flasks, trinkets, wards item_exc = [ '2140', '2138', '2139', '2137', '3340', '3341', '3342', '3361', '3362', '3363', '3364', '2043', '2044' ] for team in match_data['teams']: if team['winner'] == True: winner = '100' loser = '200' else: loser = '100' winner = '200' break result = {'matchId':match_data['matchId'], winner:{'winner': True, 'champions':[]}, loser:{'winner': False, 'champions': []}} for player in match_data['participants']: if str(player['teamId']) == winner: items = [value for key, value in player['stats'].items() if ('item' in key) and (str(value) not in item_exc)] result[winner]['champions'].append({'championId': player['championId'], 'items': items}) else: items = [value for key, value in player['stats'].items() if ('item' in key) and (str(value) not in item_exc)] result[loser]['champions'].append({'championId': player['championId'], 'items': items}) return result #Returns champion name string given champion id integer def _get_champion_by_id(self, champion_id): args = {'api_key': self.api_key, 'champData':'all'} api_url = API['champion_by_id'].format(version=VER['lol_static_data'], champion_id = champion_id) response = requests.get( API['base_static_data'].format( proxy = self.region, region = self.region, url = api_url ), params = args ) champion_data = response.json() return champion_data['name'] #Get latest static version to access Riot's static data database def _get_static_data_version(self): args = {'api_key': self.api_key} api = API['versions'].format(version=VER['lol_static_data']) response = requests.get(API['base_static_data'].format( proxy = self.region, region = self.region, url = api), params = args ) versions = response.json() return versions[0] def get_all_items(self): args = {'api_key': self.api_key} api_url = API['item'].format(version=VER['lol_static_data']) response = requests.get( API['base_static_data'].format( proxy = self.region, region = self.region, url = api_url ), params=args ) items = response.json() version = self._get_static_data_version() item_list = [] for item in items['data'].values(): img_url = API['item_img'].format(version=version, item=item['id']) + ".png" item_data = {'itemId': item['id'], 'name': item['name'], 'img': img_url} item_list.append(item_data) return json.dumps(item_list) #Get all champion names, IDs, and image URIs #Return JSON file of data def get_all_champs(self): version = self._get_static_data_version() args = {'api_key': self.api_key, 'champData': 'image'} url = API['champion'].format(version=VER['lol_static_data']) response = requests.get( API['base_static_data'].format( proxy = self.region, region = self.region, url = url ), params = args ) champions = response.json() champions_data = [] for champion in champions['data'].values(): champ_data = { 'name': champion['name'], 'championId': champion['id'], 'img': API['champion_img'].format(version=version, champion=champion['image']['full']) } champions_data.append(champ_data) return json.dumps(champions_data) # For offline testing def _test_sample_data(self): with open("sample.json") as file: return json.load(file)
{ "repo_name": "Bouhm/BlackMarketDefense", "path": "riot_API_data.py", "copies": "1", "size": "8596", "license": "mit", "hash": -1868607141843864300, "line_mean": 37.5470852018, "line_max": 133, "alpha_frac": 0.5090739879, "autogenerated": false, "ratio": 3.825545171339564, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.4834619159239564, "avg_score": null, "num_lines": null }
__author__ = 'Bouhm' #Program that uses methods from RiotAPIStats for data aggregation #For data analysis and data format for game from riot_API_data import RiotAPIData import keys import pprint import json import random import math import time import ast def main(): api = RiotAPIData(keys.API_KEY) pprint.pprint(get_game_data_format(api, 'NA', 100, 20)) #Convert all ids to names in python dictionary, key value pairs are appropriately replaced def id_to_name(dict): with open("database/items.json") as file: item_data = json.load(file) with open("database/champions.json") as file: champ_data = json.load(file) for x in range (1, 3): team = dict[str(x*100)] for key, value in team.items(): if key == 'champions': for champion in team[key]: for champ in champ_data: if 'championId' in champion.keys() and champion['championId'] == champ['championId']: champion['name'] = champ['name'] for champ in champ_data: champion.pop('championId', None) for item in champion['items']: for item_name in item_data: if item == item_name['itemId']: champion['items'].append(item_name['name']) champion['items'] = [x for x in champion['items'] if not isinstance(x, int)] else: for item in item_data: if item['itemId'] == key: team.update({item['name']:team[key]}) del team[key] return dict #From match data get game data def get_game_data_format(api, region, num, totalWaves, local): all_waves = {} matches_data = [] if local == 0: with open("dataset/" + region + ".json") as file: matches_list = json.load(file) matches = random.sample(range(1,10000), num) for x in range (1, 10000): #for match in matches: try: matches_data.append(id_to_name(api.get_BMB_data(matches_list[x]))) time.sleep(1.3) except: pass else: with open("database/matches_data_" + region + ".json") as file: matches_data = json.load(file) for data in matches_data: matches_data.append(id_to_name(data)) for match in matches_data: team = match['100'] wave = match['200'] stats = 0 upgrades = 0 count = 0 waves = {} champions = [] towers = [] merc_wave = wave.copy() mercs = team.copy() del merc_wave['winner'] del merc_wave['champions'] del mercs['winner'] del mercs['champions'] merc_wave.update({'mercs': mercs}) for champion in wave['champions']: if 'name' in champion.keys(): champions.append(champion['name']) merc_wave.update({'champions': champions}) for champion in team['champions']: if 'name' in champion.keys(): towers.append(champion['name']) #WAVE SORTING ALGORITHM (BASED ON UPGRADES & NUMBER OF MERCS AND RESPECTIVE DISTRIBUTION (SUPER BASIC)) #Currently only optimized for 20 if 'Ironback' in wave.keys(): count += len(wave['Ironback']) for upgrade in wave['Ironback']: stats += upgrade['offense'] + upgrade['defense'] upgrades += upgrade['upgrade'] * 2 if 'Razorfin' in wave.keys(): count += len(wave['Razorfin']) for upgrade in wave['Razorfin']: stats += upgrade['offense'] + upgrade['defense'] upgrades += upgrade['upgrade'] * 2 if 'Ocklepod' in wave.keys(): count += len(wave['Ocklepod']) for upgrade in wave['Ocklepod']: stats += upgrade['offense'] + upgrade['defense'] upgrades += upgrade['upgrade'] * 2 if 'Plundercrab' in wave.keys(): count += len(wave['Plundercrab']) for upgrade in wave['Plundercrab']: stats += upgrade['offense'] + upgrade['defense'] upgrades += upgrade['upgrade'] * 2 if count > 3: x = 0 for waveNum in range (1, totalWaves + 1): if stats + upgrades <= x: k = "wave" + str(waveNum) break x += 3 waves.update({'wave': merc_wave}) waves.update({'towers': towers}) waves.update({'matchId': match['matchId']}) if k in all_waves.keys(): all_waves[k].append(waves) else: all_waves.update({k: [waves]}) return json.dumps(all_waves) #For data analysis def winrate_data(region): with open("database/items.json") as file: item_data = json.load(file) with open("database/champions.json") as file: champ_data = json.load(file) with open("database/matches_data_" + region + ".json", 'r') as file: BMB_data = json.load(file) champion_wr = {} mercenary_wr = {} item_wr = {} #mercs = {"3611":"Razorfin", "3612":"Ironback", "3613":"Plundercrab", "3614":"Ocklepod"} for match in BMB_data: for x in range (1, 3): if match[str(x * 100)]['winner'] == "True": win = 1 else: win = 0 for champion in match[str(x * 100)]['champions']: for champ in champ_data: if champion['championId'] == champ['championId']: if champ['name'] not in champion_wr.keys(): champion_wr.update({champ['name']:{'wins':1, 'games':1, 'winrate':win}}) else: champion_wr[champ['name']]['wins'] += win champion_wr[champ['name']]['games'] += 1 champion_wr[champ['name']]['winrate'] = champion_wr[champ['name']]['wins']/champion_wr[champ['name']]['games'] for item in champion['items']: for item_name in item_data: if item == item_name['itemId']: if item_name['name'] not in item_wr.keys(): item_wr.update({item_name['name']:{'wins':1, 'games':1, 'winrate':win}}) else: item_wr[item_name['name']]['wins'] += win item_wr[item_name['name']]['games'] += 1 item_wr[item_name['name']]['winrate'] = item_wr[item_name['name']]['wins']/item_wr[item_name['name']]['games'] if '3611' in match[str(x * 100)].keys(): for stats in match[str(x * 100)]['3611']: k = "off: " + str(stats['offense']) + ", def: " + str(stats['defense']) + ", upg: " + str(stats['upgrade']) if 'Razorfin' not in mercenary_wr.keys(): mercenary_wr.update({'Razorfin':{'wins':win, 'games':1, 'winrate':win, k:{'wins':win, 'games':1, 'winrate':win}}}) else: mercenary_wr['Razorfin']['wins'] += win mercenary_wr['Razorfin']['games'] += 1 mercenary_wr['Razorfin']['winrate'] = mercenary_wr['Razorfin']['wins']/mercenary_wr['Razorfin']['games'] if k not in mercenary_wr['Razorfin'].keys(): mercenary_wr['Razorfin'].update({k:{'wins':win, 'games':1, 'winrate':win}}) else: mercenary_wr['Razorfin'][k]['wins'] += win mercenary_wr['Razorfin'][k]['games'] += 1 mercenary_wr['Razorfin'][k]['winrate'] = mercenary_wr['Razorfin'][k]['wins']/ mercenary_wr['Razorfin'][k]['games'] #mercenary_wr['Razorfin'][k].sort(key=lambda e: e['winrate']) if '3612' in match[str(x * 100)].keys(): for stats in match[str(x * 100)]['3612']: k = "off: " + str(stats['offense']) + ", def: " + str(stats['defense']) + ", upg: " + str(stats['upgrade']) if 'Ironback' not in mercenary_wr.keys(): mercenary_wr.update({'Ironback':{'wins':win, 'games':1, 'winrate':win, k:{'wins':win, 'games':1, 'winrate':win}}}) else: mercenary_wr['Ironback']['wins'] += win mercenary_wr['Ironback']['games'] += 1 mercenary_wr['Ironback']['winrate'] = mercenary_wr['Ironback']['wins']/mercenary_wr['Ironback']['games'] if k not in mercenary_wr['Ironback'].keys(): mercenary_wr['Ironback'].update({k:{'wins':win, 'games':1, 'winrate':win}}) else: mercenary_wr['Ironback'][k]['wins'] += win mercenary_wr['Ironback'][k]['games'] += 1 mercenary_wr['Ironback'][k]['winrate'] = mercenary_wr['Ironback'][k]['wins']/ mercenary_wr['Ironback'][k]['games'] #mercenary_wr['Ironback'][k].sort(key=lambda e: e['winrate']) if '3613' in match[str(x * 100)].keys(): for stats in match[str(x * 100)]['3613']: k = "off: " + str(stats['offense']) + ", def: " + str(stats['defense']) + ", upg: " + str(stats['upgrade']) if 'Plundercrab' not in mercenary_wr.keys(): mercenary_wr.update({'Plundercrab':{'wins':win, 'games':1, 'winrate':win, k:{'wins':win, 'games':1, 'winrate':win}}}) else: mercenary_wr['Plundercrab']['wins'] += win mercenary_wr['Plundercrab']['games'] += 1 mercenary_wr['Plundercrab']['winrate'] = mercenary_wr['Plundercrab']['wins']/mercenary_wr['Plundercrab']['games'] if k not in mercenary_wr['Plundercrab'].keys(): mercenary_wr['Plundercrab'].update({k:{'wins':win, 'games':1, 'winrate':win}}) else: mercenary_wr['Plundercrab'][k]['wins'] += win mercenary_wr['Plundercrab'][k]['games'] += 1 mercenary_wr['Plundercrab'][k]['winrate'] = mercenary_wr['Plundercrab'][k]['wins']/ mercenary_wr['Plundercrab'][k]['games'] #mercenary_wr['Plundercrab'][k].sort(key=lambda e: e['winrate']) if '3614' in match[str(x * 100)].keys(): for stats in match[str(x * 100)]['3614']: k = "off: " + str(stats['offense']) + ", def: " + str(stats['defense']) + ", upg: " + str(stats['upgrade']) if 'Ocklepod' not in mercenary_wr.keys(): mercenary_wr.update({'Ocklepod':{'wins':win, 'games':1, 'winrate':win, k:{'wins':win, 'games':1, 'winrate':win}}}) else: mercenary_wr['Ocklepod']['wins'] += win mercenary_wr['Ocklepod']['games'] += 1 mercenary_wr['Ocklepod']['winrate'] = mercenary_wr['Ocklepod']['wins']/mercenary_wr['Ocklepod']['games'] if k not in mercenary_wr['Ocklepod'].keys(): mercenary_wr['Ocklepod'].update({k:{'wins':win, 'games':1, 'winrate':win}}) else: mercenary_wr['Ocklepod'][k]['wins'] += win mercenary_wr['Ocklepod'][k]['games'] += 1 mercenary_wr['Ocklepod'][k]['winrate'] = mercenary_wr['Ocklepod'][k]['wins']/ mercenary_wr['Ocklepod'][k]['games'] #mercenary_wr['Ocklepod'][k].sort(key=lambda e: e['winrate']) return ({'champions':champion_wr, 'mercenaries':mercenary_wr, 'items':item_wr}) def match_ids(region): return if __name__ == "__main__": main()
{ "repo_name": "Bouhm/BlackMarketDefense", "path": "data_aggr.py", "copies": "1", "size": "12231", "license": "mit", "hash": 3403711875374028300, "line_mean": 49.7510373444, "line_max": 151, "alpha_frac": 0.4878587196, "autogenerated": false, "ratio": 3.4975693451529883, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.4485428064752988, "avg_score": null, "num_lines": null }
__author__ = 'Bouhm' #Program that uses methods from RiotAPIStats mainly for building database #Database used for game from riot_API_data import RiotAPIData import data_aggr import keys import os.path import urllib.request import sys import requests import json import random from pprint import pprint import time import math def main(): headers = { "user-agent": "Mozilla/5.0 (Macintosh; Intel Mac OS X 10_7_5)", "accept": "text/html,application/xhtml+xml,application/xml;q=0.9,*/*;q=0.8", "accept-charset": "ISO-8859-1,utf-8;q=0.7,*;q=0.3", "accept-encoding": "gzip,deflate,sdch", "accept-language": "en-US,en;q=0.8", } print("Choose region: ") region = input(': ') api = RiotAPIData(keys.API_KEY, region) print("") print("Options: ") print("(1) Update item list") print("(2) Update champion list") print("(3) Update data from matches") print("(4) Get winrates") print("(5) Combine winrate data") print("(6) Update game data") print("(7) Overflow data") print("(8) Condense data") option = input(':') if option == '1': item_data(api, headers, False) elif option == '2': champion_data(api, headers, False) elif option == '3': data_from_matches(api, region, 2) elif option == '4': get_winrates(region) elif option == '5': combine_winrate_data('na', 'euw') elif option == '6': game_data(api, region, 10, 20, 1) elif option == '7': overflow_data(20) elif option == '8': condense_data(20) #Get static item data and save item name, ID, and image URI to local db def item_data(api, headers, img): item_data = api.get_all_items() if not os.path.isfile("database/items.json"): file = open("database/items.json", 'w+') #for item in item_data: file.write("%s \n" % item_data) else: with open("database/items.json", 'a') as file: #for item in item_data: file.write("%s\n" % item_data) if(img): for item in item_data: r = requests.get(item['img'], headers=headers) if r.status_code != 200: print("Request denied") sys.exit() urllib.request.urlretrieve(item['img'], "database/item_img/" + str(item['itemId']) + ".png") urllib.request.urlcleanup() #Get static champion data and store name, ID, and image URI to local db def champion_data(api, headers, img): champion_data = api.get_all_champs() if not os.path.isfile("database/champions.json"): file = open("database/champions.json", 'w+') #for champ in champion_data: file.write("%s \n" % champion_data) else: with open("database/champions.json", 'a') as file: #for champ in champion_data: file.write("%s\n" % champion_data) if(img): for champ in champion_data: r = requests.get(champ['img'], headers=headers) if r.status_code != 200: print("Request denied") sys.exit() urllib.request.urlretrieve(champ['img'], "database/champ_img/" + champ['name'] + ".png") urllib.request.urlcleanup() #From match data get game data and save def game_data(api, region, num, totalWaves, local): game_data = json.dumps(data_aggr.get_game_data_format(api, region, num, totalWaves, local)) if not os.path.isfile("database/game_data_" + region + ".json"): file = open("database/game_data_" + region + ".json", 'w+') #for champ in champion_data: file.write("%s \n" % game_data) else: with open("database/game_data_" + region + ".json", 'a') as file: #for champ in champion_data: file.write("%s\n" % game_data) return #For making adjustments to wave sorting in game data def condense_data(max): with open("database/game_data.json") as file: game_data = json.load(file) for x in range (1, 21): size = len(game_data['wave' + str(x)]) while len(game_data['wave' + str(x)]) > max: index = random.randint(0, size - 1) game_data['wave' + str(x)].remove(game_data['wave' + str(x)][index]) size -= 1 game_data = json.dumps(game_data) if not os.path.isfile("database/game_data_min.json"): file = open("database/game_data_min.json", 'w+') #for champ in champion_data: file.write("%s \n" % game_data) else: with open("database/game_data_min.json", 'a') as file: #for champ in champion_data: file.write("%s\n" % game_data) return #This method because I don't want to run a script for 3-5 hours again def overflow_data(numMatches): with open("database/game_data2.json") as file: game_data = json.load(file) di_size = len(game_data.keys()) #matches = game_data.copy() for x in range (1, 20): list_size = len(game_data['wave' + str(21 - x)]) for y in range (1, math.floor(list_size/2) + 1): data = game_data['wave' + str(21 - x)].pop() if 'wave' + str(20 - x) not in game_data.keys(): game_data.update({'wave' + str(20 - x): [data]}) else: game_data['wave' + str(20 - x)].insert(0, data) game_data = json.dumps(game_data) if not os.path.isfile("database/game_data_OF.json"): file = open("database/game_data_OF.json", 'w+') #for champ in champion_data: file.write("%s \n" % game_data) else: with open("database/game_data_OF.json", 'a') as file: #for champ in champion_data: file.write("%s\n" % game_data) return #Get data from matches, more useful for data analysis def data_from_matches(api, region, num): with open("dataset/" + region + ".json") as file: matches_list = json.load(file) matches = random.sample(range(1,10000), num) matches_data = [] matches_data_s = [] for x in range (1, 10000): try: match_data = json.dumps(api.get_BMB_data(matches_list[x])) matches_data.append(match_data) time.sleep(1.3) except: pass if not os.path.isfile("database/matches_data_" + region + ".json"): file = open("database/matches_data_" + region + " .json", 'w+') file.write("%s \n" % matches_data) else: with open("database/matches_data_" + region + ".json", 'a') as file: file.write("%s\n" % matches_data) return #Convert all ids in python dictionary into names, key and value pairs are appropriately replaced def id_to_name(dict): with open("database/items.json") as file: item_data = json.load(file) with open("database/champions.json") as file: champ_data = json.load(file) for x in range (1, 3): team = dict[str(x*100)] for key, value in team.items(): if key == 'champions': for champion in team[key]: for champ in champ_data: if 'championId' in champion.keys() and champion['championId'] == champ['championId']: champion['name'] = champ['name'] for champ in champ_data: champion.pop('championId', None) for item in champion['items']: for item_name in item_data: if item == item_name['itemId']: champion['items'].append(item_name['name']) champion['items'] = [x for x in champion['items'] if not isinstance(x, int)] else: for item in item_data: if item['itemId'] == key: team.update({item['name']:team[key]}) del team[key] return dict def get_winrates(region): winrate_data = data_aggr.winrate_data(region) winrate_data = json.dumps(winrate_data) if not os.path.isfile("database/winrate_data_" + region + ".json"): file = open("database/winrate_data_" + region + ".json", 'w+') #pprint(winrate_data, stream=file) file.write("%s \n" % winrate_data) else: with open("database/winrate_data_" + region + ".json", 'a') as file: #pprint(winrate_data, stream=file) file.write("%s \n" % winrate_data) return def format_data(): with open("database/matches_data_id.json", 'r') as file: BMB_data = json.load(file) if not os.path.isfile("database/matches_data_list.json"): file = open("database/matches_data_list.json", 'w+') for datum in BMB_data: if not os.path.isfile("database/matches_data_list.json"): file = open("database/matches_data_list.json", 'w+') file.write("%s \n" % datum + ",") else: with open("database/matches_data_list.json", 'a') as file: for datum in BMB_data: file.write("%s\n" % datum + ",") return def combine_winrate_data(region1, region2): with open("database/winrate_data_" + region1 + ".json", 'r') as file: wr_data1 = json.load(file) with open("database/winrate_data_" + region2 + ".json", 'r') as file: wr_data2 = json.load(file) wr_data = wr_data1.copy() for champion in wr_data1['champions']: if champion in wr_data2['champions'].keys(): wr_data['champions'][champion]['games'] += wr_data2['champions'][champion]['games'] wr_data['champions'][champion]['wins'] += wr_data2['champions'][champion]['wins'] wr_data['champions'][champion]['winrate'] = wr_data['champions'][champion]['wins']/wr_data['champions'][champion]['games'] else: wr_data['champions'][champion] = wr_data2['champions'][champion] for mercenary in wr_data1['mercenaries']: if mercenary in wr_data2['mercenaries'].keys(): wr_data['mercenaries'][mercenary]['wins'] += wr_data2['mercenaries'][mercenary]['wins'] wr_data['mercenaries'][mercenary]['games'] += wr_data2['mercenaries'][mercenary]['games'] wr_data['mercenaries'][mercenary]['winrate'] = wr_data['mercenaries'][mercenary]['wins']/ wr_data['mercenaries'][mercenary]['games'] for stats in wr_data1['mercenaries'][mercenary]: if stats in wr_data2['mercenaries'].keys(): wr_data['mercenaries'][mercenary][stats]['games'] += wr_data2['mercenaries'][mercenary][stats]['games'] wr_data['mercenaries'][mercenary][stats]['wins'] += wr_data2['mercenaries'][mercenary][stats]['wins'] wr_data['mercenaries'][mercenary][stats]['winrate'] = wr_data['mercenaries'][mercenary][stats]['wins']/wr_data['mercenaries'][mercenary][stats]['games'] else: wr_data['mercenaries'][mercenary][stats] = wr_data2['mercenaries'][mercenary][stats] if not os.path.isfile("database/winrate_data_" + region1 + region2 + ".json"): file = open("database/winrate_data_" + region1 + region2 + ".json", 'w+') pprint(wr_data, stream=file) #file.write("%s \n" % winrate_data) else: with open("database/winrate_data_" + region1 + region2 + ".json", 'a') as file: pprint(wr_data, stream=file) #file.write("%s \n" % winrate_data) if __name__ == "__main__": main()
{ "repo_name": "Bouhm/BlackMarketDefense", "path": "db_write.py", "copies": "1", "size": "11494", "license": "mit", "hash": 1395092419006626600, "line_mean": 40.7963636364, "line_max": 172, "alpha_frac": 0.5695145293, "autogenerated": false, "ratio": 3.309530665131011, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.43790451944310105, "avg_score": null, "num_lines": null }
__author__ = 'bouska' from datetime import datetime, timedelta from StringIO import StringIO class Event(object): def __init__(self): self.summary = "" self.organizer = "" self.location = "" self.description = "" self.start = None self.duration = None class Calendar(object): def __init__(self): self.name = "" self.description = "" self.version = "2.0" self.provider = "https://bitbucket.org/odebeir/geholimport" self.start_date = datetime.today() self.events = [] def add_event(self, event): self.events.append(event) def as_string(self): def write_line(out, line): out.write(line+'\n') out = StringIO() def dirty_fix(duration): def total_seconds(td): return (td.microseconds + (td.seconds + td.days * 24 * 3600) * 10**6) / 10**6 seconds = total_seconds(duration) hours = seconds / 60 / 60 minutes = seconds / 60 % 60 return "%02i:%02i" % (hours, minutes) for event in self.events: write_line(out, "REM %s AT %s DURATION %s MSG %s (%s)" % (str(event.start.strftime("%b %d %Y")), str(event.start.strftime("%H:%M")), str(dirty_fix(event.duration)), str(event.summary.encode("Utf-8")), str(event.location))) ical_string = out.getvalue() out.close() return ical_string def convert_geholcalendar_to_remind(gehol_calendar, first_monday): date_init = datetime.strptime(first_monday,'%d/%m/%Y') cal = Calendar() cal.description = gehol_calendar.description cal.name = gehol_calendar.name cal.start_date = date_init for event in gehol_calendar.events: remind_event = Event() for (i, event_week) in enumerate(event.weeks): delta = timedelta(days=(event_week-1)*7 + event.day) start = date_init+delta + timedelta(hours = event.start_time.hour, minutes = event.start_time.minute) duration = timedelta(hours = event.stop_time.hour, minutes = event.stop_time.minute) - timedelta(hours = event.start_time.hour, minutes = event.start_time.minute) remind_event = Event() remind_event.summary = event.summary remind_event.location = event.location #remind_event.description = event.description #remind_event.organizer = event.organizer remind_event.start = start remind_event.duration = duration cal.add_event(remind_event) return cal
{ "repo_name": "Psycojoker/geholparser", "path": "src/gehol/converters/remindwriter.py", "copies": "1", "size": "2796", "license": "mit", "hash": -686036909865581600, "line_mean": 30.4157303371, "line_max": 146, "alpha_frac": 0.5500715308, "autogenerated": false, "ratio": 3.971590909090909, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.5021662439890909, "avg_score": null, "num_lines": null }
__author__ = 'bperozzi' import graph_tool.all as gt import seaborn as sns def find_color(value, maxv, minv, palette): # XXX need to get min in there percentage = (value - minv) / (maxv - minv) idx = int(percentage * len(palette)) idx = min(len(palette) - 1, idx) #print value, idx #print palette[idx] return list(palette[idx]) + [1.0] def draw_graph_heatmap(graph, value_map, output, directed=False, palette=sns.cubehelix_palette(10, start=.5, rot=-.75), position=None): # for normalize values = value_map.values() maxv = max(values) minv = min(values) if len(values) != len(graph): # some graph nodes missing from map. # make them 0 minv = min(minv, 0) gt_graph = gt.Graph(directed=directed) node_map = {node: gt_graph.add_vertex() for node in graph} if not directed: seen_edges = set() for node, edges in graph.iteritems(): i = node_map[node] for e in edges: j = node_map[e] if directed: gt_graph.add_edge(i, j) else: if (j, i) not in seen_edges: gt_graph.add_edge(i, j) seen_edges.add((i, j)) node_intensity = gt_graph.new_vertex_property("vector<float>") node_label = gt_graph.new_vertex_property("string") for id, value in value_map.iteritems(): node = node_map[id] node_intensity[node] = find_color(value, maxv, minv, palette) node_label[node] = id for id in graph: if id not in value_map: node = node_map[id] node_intensity[node] = find_color(0, maxv, minv, palette) node_label[node] = id if position is None: position = gt.sfdp_layout(gt_graph) gt.graph_draw(gt_graph, pos=position, vertex_text=node_label, vertex_fill_color=node_intensity, output=output) return position def draw_graph(graph, value_map=None, output=None, show_ids=False, directed=False, position=None): gt_graph = gt.Graph(directed=directed) node_map = {node: gt_graph.add_vertex() for node in graph} if not directed: seen_edges = set() for node, edges in graph.iteritems(): i = node_map[node] for e in edges: j = node_map[e] if directed: gt_graph.add_edge(i, j) else: if (j, i) not in seen_edges: gt_graph.add_edge(i, j) seen_edges.add((i, j)) if position is None: position = gt.sfdp_layout(gt_graph) node_label = gt_graph.new_vertex_property("string") if value_map is not None: for id, value in value_map.iteritems(): node = node_map[id] node_label[node] = id for id in graph: if id not in value_map: node = node_map[id] node_label[node] = id elif show_ids: for id in graph: node = node_map[id] node_label[node] = id if show_ids: gt.graph_draw(gt_graph, pos=position, vertex_text=node_label, output=output) else: gt.graph_draw(gt_graph, pos=position, output=output) return position
{ "repo_name": "phanein/magic-graph", "path": "src/magicgraph/visualization.py", "copies": "1", "size": "3005", "license": "bsd-3-clause", "hash": 4217968771521474000, "line_mean": 23.048, "line_max": 135, "alpha_frac": 0.6093178037, "autogenerated": false, "ratio": 3.159831756046267, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.9180030076497447, "avg_score": 0.017823896649763773, "num_lines": 125 }
__author__ = 'bptripp' # CNN with support and object depth maps as input. import numpy as np from os.path import join import scipy import cPickle from keras.models import Sequential from keras.layers.convolutional import Convolution2D, MaxPooling2D from keras.layers.core import Dense, Dropout, Activation, Flatten from keras.optimizers import Adam, RMSprop from data import load_all_params im_width = 80 model = Sequential() model.add(Convolution2D(32, 9, 9, input_shape=(2,im_width,im_width), init='glorot_normal', border_mode='same')) model.add(Activation('relu')) model.add(MaxPooling2D(pool_size=(2,2))) model.add(Convolution2D(32, 3, 3, init='glorot_normal', border_mode='same')) model.add(Activation('relu')) #model.add(MaxPooling2D(pool_size=(2,2))) model.add(Convolution2D(32, 3, 3, init='glorot_normal', border_mode='same')) model.add(Activation('relu')) model.add(Dropout(.25)) model.add(Flatten()) model.add(Dense(512)) model.add(Activation('relu')) #model.add(Dropout(.25)) model.add(Dense(512)) model.add(Activation('relu')) #model.add(Dropout(.25)) model.add(Dense(64)) model.add(Activation('relu')) #model.add(Dropout(.25)) model.add(Dense(1)) model.add(Activation('sigmoid')) #from keras.models import model_from_json #model = model_from_json(open('v-model-architecture.json').read()) #model.load_weights('v-model-weights.h5') rmsp = RMSprop(lr=0.001, rho=0.9, epsilon=1e-06) adam = Adam(lr=0.00001, beta_1=0.9, beta_2=0.999, epsilon=1e-08) model.compile(loss='binary_crossentropy', optimizer=adam) objects, gripper_pos, gripper_orient, labels = load_all_params('../../grasp-conv/data/output_data.csv') seq_nums = np.arange(len(objects)) % 1000 #exactly 1000 per object in above file (dated March 18) labels = np.array(labels)[:,np.newaxis] n = len(objects) validation_indices = np.random.randint(0, n, 500) #TODO: generalize across objects s = set(validation_indices) train_indices = [x for x in range(n) if x not in s] #train_indices = train_indices[:1000] def get_input(object, seq_num): image_file = object[:-4] + '-' + str(seq_num) + '.png' X = [] image_dir = '../../grasp-conv/data/obj_depths/' image = scipy.misc.imread(join(image_dir, image_file)) rescaled_distance = image / 255.0 X.append(1.0 - rescaled_distance) image_dir = '../../grasp-conv/data/support_depths/' image = scipy.misc.imread(join(image_dir, image_file)) rescaled_distance = image / 255.0 X.append(1.0 - rescaled_distance) return np.array(X) Y_valid = labels[validation_indices,:] X_valid = [] for ind in validation_indices: X_valid.append(get_input(objects[ind], seq_nums[ind])) X_valid = np.array(X_valid) def generate_XY(): while 1: ind = train_indices[np.random.randint(len(train_indices))] Y = np.zeros((1,1)) Y[0,0] = labels[ind,0] X = get_input(objects[ind], seq_nums[ind]) X = X[np.newaxis,:,:,:] #print('ind ' + str(ind) + ' Y ' + str(Y)) yield (X, Y) h = model.fit_generator(generate_XY(), samples_per_epoch=500, nb_epoch=1500, validation_data=(X_valid, Y_valid)) f = file('v-history.pkl', 'wb') cPickle.dump(h.history, f) f.close() json_string = model.to_json() open('v-model-architecture.json', 'w').write(json_string) model.save_weights('v-model-weights.h5', overwrite=True)
{ "repo_name": "bptripp/grasp-convnet", "path": "py/vrep_model.py", "copies": "1", "size": "3319", "license": "mit", "hash": -8229903321220664000, "line_mean": 30.6095238095, "line_max": 111, "alpha_frac": 0.6869539018, "autogenerated": false, "ratio": 2.841609589041096, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.8947663598792206, "avg_score": 0.01617997840977817, "num_lines": 105 }
__author__ = 'bptripp' # Convolutional network for grasp success prediction import numpy as np from keras.models import Sequential from keras.layers.convolutional import Convolution2D, MaxPooling2D from keras.layers.core import Dense, Dropout, Activation, Flatten from keras.optimizers import Adam import cPickle from tuning import disp_tuning from depthmap import get_distance def get_bowls(): shapes = [ '24_bowl-16-Feb-2016-10-12-27', '24_bowl-17-Feb-2016-22-00-34', '24_bowl-24-Feb-2016-17-38-53', '24_bowl-26-Feb-2016-08-35-29', '24_bowl-27-Feb-2016-23-52-43', '24_bowl-29-Feb-2016-15-01-53'] distances = [] box_distances = [] labels = [] for shape in shapes: f = file('../data/depths/' + shape + '.pkl', 'rb') d, bd, l = cPickle.load(f) f.close() dist = get_distance(d, .2, 1.0) box_dist = get_distance(bd, .2, 1.0) distances.extend(dist.tolist()) box_distances.extend(box_dist.tolist()) labels.extend(l.tolist()) return np.array(distances), np.array(box_distances), np.array(labels) def make_datasets(distances, box_distances, labels): # try more like disparity with zero background distances = 1 - distances box_distances = 1 - box_distances indices = np.arange(len(labels)) validation_flags = indices % 10 == 9 training_flags = ~validation_flags n_train = len(labels[training_flags]) n_validation = len(labels[validation_flags]) X_train = np.zeros((n_train,2,distances.shape[1],distances.shape[2])) X_valid = np.zeros((n_validation,2,distances.shape[1],distances.shape[2])) X_train[:,0,:,:] = distances[training_flags,:,:] X_train[:,1,:,:] = box_distances[training_flags,:,:] X_valid[:,0,:,:] = distances[validation_flags,:,:] X_valid[:,1,:,:] = box_distances[validation_flags,:,:] Y_train = labels[training_flags] Y_valid = labels[validation_flags] return X_train, Y_train, X_valid, Y_valid distances, box_distances, labels = get_bowls() X_train, Y_train, X_valid, Y_valid = make_datasets(distances, box_distances, labels) print(X_train.shape) print(Y_train.shape) print(X_valid.shape) print(Y_valid.shape) imsize = (X_train.shape[2],X_train.shape[3]) model = Sequential() model.add(Convolution2D(32, 10, 10, input_shape=(2,imsize[0],imsize[1]), init='glorot_normal', border_mode='same')) model.add(Activation('relu')) model.add(MaxPooling2D(pool_size=(2,2))) # model.add(Dropout(.5)) model.add(Convolution2D(32, 5, 5, init='glorot_normal', border_mode='same')) model.add(Activation('relu')) model.add(MaxPooling2D(pool_size=(2,2))) # model.add(Dropout(.5)) model.add(Convolution2D(32, 5, 5, init='glorot_normal', border_mode='same')) model.add(Activation('relu')) # model.add(Dropout(.5)) model.add(Flatten()) model.add(Dense(256)) model.add(Activation('relu')) model.add(Dropout(.5)) model.add(Dense(1)) model.add(Activation('sigmoid')) adam = Adam(lr=0.0001, beta_1=0.9, beta_2=0.999, epsilon=1e-08) model.compile(loss='mean_squared_error', optimizer=adam) from cninit import init_model init_model(model, X_train, Y_train) h = model.fit(X_train, Y_train, batch_size=32, nb_epoch=200, show_accuracy=True, validation_data=(X_valid, Y_valid)) Y_predict = model.predict(X_valid) print(Y_predict - Y_valid) model.save_weights('model_weights.h5') model.to_json('model.json')
{ "repo_name": "bptripp/grasp-convnet", "path": "py/model.py", "copies": "1", "size": "3409", "license": "mit", "hash": -7864330088695125000, "line_mean": 31.1603773585, "line_max": 116, "alpha_frac": 0.6726312702, "autogenerated": false, "ratio": 2.9362618432385874, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.41088931134385875, "avg_score": null, "num_lines": null }
__author__ = 'bptripp' from cnn_stimuli import get_image_file_list import cPickle as pickle import time import numpy as np import matplotlib.pyplot as plt from alexnet import preprocess, load_net, load_vgg def excess_kurtosis(columns): m = np.mean(columns, axis=0) sd = np.std(columns, axis=0) result = np.zeros(columns.shape[1]) for i in range(columns.shape[1]): column = columns[:,i] d = column - m[i] result[i] = np.sum(d**4) / columns.shape[0] / sd[i]**4 - 3 return result # Copying these two functions from Salman's repo, # ObjectSelectivity/sparseness.py and ObjectSelectivity/kurtosis_selectivity_profile.py def calculate_kurtosis(rates_per_object): """ Given an array of firing rates of the neuron to objects, return the sparseness metric Kurtosis (actually excess kurtosis) of the neuron as defined in: [1] Lehky, S. R., Kiani, R., Esteky, H., & Tanaka, K. (2011). Statistics of visual responses in primate inferotemporal cortex to object stimuli. Journal of Neurophysiology, 106(3), 1097-117. Kurtosis = (sum (Ri - Rmean)**4 / (n*sigma**4)) - 3 :param rates_per_object: array of firing rates of the neuron to multiple objects. :return: kurtosis sparseness. This is defined outside the class as it is used by other selectivity profiles. """ n = np.float(rates_per_object.shape[0]) rates_mean = np.mean(rates_per_object) rates_sigma = np.std(rates_per_object) kurtosis = np.sum((rates_per_object - rates_mean)**4) / (n * rates_sigma**4) - 3 # kurtosis2= np.sum((rates_per_object - rates_mean)**4) / n \ # / (np.sum((rates_per_object - rates_mean)**2) / n)** 2 - 3 return kurtosis def activity_fraction(rates_per_object): R = rates_per_object n = len(rates_per_object) return n/(n-1) * ( 1 - np.sum(R/n)**2 / np.sum(R**2/n) ) # num = 1 - (np.sum(R)/n)**2 / np.sum(R**2)/n # den = 1 - 1/n # return num / den def plot_selectivity_and_sparseness(r_mat, font_size=10): # plt.figure(figsize=) # fig = plt.figure() # print(fig.get_size_inches()) # f, ax_arr = plt.subplots(2, 1, sharex=True, figsize=(3.5,5)) f, ax_arr = plt.subplots(2, 1, sharex=False, figsize=(3,5)) # Single Neuron selectivities n_neurons = r_mat.shape[0] n_objs = r_mat.shape[1] selectivities = np.zeros(n_neurons) sparsenesses = np.zeros(n_objs) for n_idx in np.arange(n_neurons): rates = r_mat[n_idx, :] selectivities[n_idx] = calculate_kurtosis(rates) for o_idx in np.arange(n_objs): rates = r_mat[:, o_idx] sparsenesses[o_idx] = calculate_kurtosis(rates) print(np.mean(selectivities)) print(np.mean(sparsenesses)) print('min selectivity: ' + str(np.min(selectivities))) print('max selectivity: ' + str(np.max(selectivities))) # Plot selectivities ------------------------------------------------ ax_arr[0].hist(np.clip(selectivities, -10, 25), bins=np.arange(-5, 850, step=1), color='red') ax_arr[0].set_ylabel('frequency', fontsize=font_size) ax_arr[0].set_xlabel('kurtosis', fontsize=font_size) ax_arr[0].tick_params(axis='x', labelsize=font_size) ax_arr[0].tick_params(axis='y', labelsize=font_size) # ax_arr[0].set_xlim([0.1, 850]) ax_arr[0].annotate('mean=%0.2f' % np.mean(selectivities), xy=(0.55, 0.98), xycoords='axes fraction', fontsize=font_size, horizontalalignment='left', verticalalignment='top') ax_arr[0].annotate('med.=%0.2f' % np.median(selectivities), xy=(0.55, 0.88), xycoords='axes fraction', fontsize=font_size, horizontalalignment='left', verticalalignment='top') ax_arr[0].annotate('n=%d' % len(selectivities), xy=(0.55, 0.78), xycoords='axes fraction', fontsize=font_size, horizontalalignment='left', verticalalignment='top') ax_arr[0].annotate('single-neuron', xy=(0.01, 0.98), xycoords='axes fraction', fontsize=font_size, horizontalalignment='left', verticalalignment='top') # ax_arr[0].set_ylim([0, 40]) # ax_arr[0].set_xlim([0, 200]) # ax_arr[0].set_ylim([0, 130]) # ax_arr[0].set_xscale('log') # Plot sparsenesses ------------------------------------------------ ax_arr[1].hist(np.clip(sparsenesses, -10, 60), bins=np.arange(-5, 850, step=3)) ax_arr[1].set_ylabel('frequency', fontsize=font_size) ax_arr[1].set_xlabel('kurtosis', fontsize=font_size) ax_arr[1].tick_params(axis='x', labelsize=font_size) ax_arr[1].tick_params(axis='y', labelsize=font_size) ax_arr[1].annotate('mean=%0.2f' % np.mean(sparsenesses), xy=(0.55, 0.98), xycoords='axes fraction', fontsize=font_size, horizontalalignment='left', verticalalignment='top') ax_arr[1].annotate('med.=%0.2f' % np.median(sparsenesses), xy=(0.55, 0.88), xycoords='axes fraction', fontsize=font_size, horizontalalignment='left', verticalalignment='top') ax_arr[1].annotate('n=%d' % len(sparsenesses), xy=(0.55, 0.78), xycoords='axes fraction', fontsize=font_size, horizontalalignment='left', verticalalignment='top') ax_arr[1].annotate('population', xy=(0.01, 0.98), xycoords='axes fraction', fontsize=font_size, horizontalalignment='left', verticalalignment='top') ax_arr[0].set_xlim([-2, 26]) ax_arr[1].set_xlim([-2, 62]) # ax_arr[1].set_ylim([0, 300]) plt.tight_layout() # ax_arr[1].set_xscale('log') if False: with open('face-preference-alexnet-0.pkl', 'rb') as file: alexnet0 = pickle.load(file) with open('face-preference-alexnet-1.pkl', 'rb') as file: alexnet1 = pickle.load(file) with open('face-preference-alexnet-2.pkl', 'rb') as file: alexnet2 = pickle.load(file) with open('face-preference-vgg-0.pkl', 'rb') as file: vgg0 = pickle.load(file) with open('face-preference-vgg-1.pkl', 'rb') as file: vgg1 = pickle.load(file) with open('face-preference-vgg-2.pkl', 'rb') as file: vgg2 = pickle.load(file) edges = np.linspace(-5, 5, 21) plt.figure(figsize=(8,4.5)) plt.subplot(2,3,1) plt.hist(alexnet2, edges) plt.ylabel('AlexNet Unit Count', fontsize=16) plt.title('output-2', fontsize=16) plt.subplot(2,3,2) plt.hist(alexnet1, edges) plt.title('output-1', fontsize=16) plt.subplot(2,3,3) plt.hist(alexnet0, edges) plt.title('output', fontsize=16) plt.subplot(2,3,4) plt.hist(vgg2, edges, color='g') plt.ylabel('VGG Unit Count', fontsize=16) plt.subplot(2,3,5) plt.hist(vgg1, edges, color='g') plt.xlabel('Preference for Face Images', fontsize=16) plt.subplot(2,3,6) plt.hist(vgg0, edges, color='g') plt.tight_layout(pad=0.05) plt.savefig('../figures/selectivity-faces.eps') plt.show() if False: use_vgg = True remove_level = 2 if use_vgg: model = load_vgg(weights_path='../weights/vgg16_weights.h5', remove_level=remove_level) else: model = load_net(weights_path='../weights/alexnet_weights.h5', remove_level=remove_level) image_files = get_image_file_list('./images/lehky-processed/', 'png', with_path=True) im = preprocess(image_files, use_vgg=use_vgg) print(image_files) mainly_faces = [197] mainly_faces.extend(range(170, 178)) mainly_faces.extend(range(181, 196)) mainly_faces.extend(range(203, 214)) mainly_faces.extend(range(216, 224)) faces_major = [141, 142, 165, 169, 179, 196, 214, 215, 271] faces_major.extend(range(144, 147)) faces_major.extend(range(157, 159)) faces_present = [131, 143, 178, 180, 198, 230, 233, 234, 305, 306, 316, 372, 470] faces_present.extend(range(134, 141)) faces_present.extend(range(147, 150)) faces_present.extend(range(155, 157)) faces_present.extend(range(161, 165)) faces_present.extend(range(365, 369)) faces_present.extend(faces_major) faces_present.extend(mainly_faces) faces_ind = [] for i in range(len(image_files)): for j in range(len(mainly_faces)): if str(mainly_faces[j]) + '.' in image_files[i]: faces_ind.append(i) no_faces_ind = [] for i in range(len(image_files)): has_face = False for j in range(len(faces_present)): if str(faces_present[j]) + '.' in image_files[i]: has_face = True if not has_face: no_faces_ind.append(i) # print(faces_ind) # print(no_faces_ind) start_time = time.time() out = model.predict(im) print(out.shape) f = out[faces_ind,:] nf = out[no_faces_ind,:] print(f.shape) print(nf.shape) face_preference = np.mean(f, axis=0) - np.mean(nf, axis=0) vf = np.var(f, axis=0) + 1e-3 # small constant in case zero variance due to lack of response vnf = np.var(nf, axis=0) + 1e-3 d_prime = face_preference / np.sqrt((vf + vnf)/2) network_name = 'vgg' if use_vgg else 'alexnet' with open('face-preference-' + network_name + '-' + str(remove_level) + '.pkl', 'wb') as file: pickle.dump(d_prime, file) print(d_prime) plt.hist(d_prime) plt.show() if True: use_vgg = False remove_level = 1 if use_vgg: model = load_vgg(weights_path='../weights/vgg16_weights.h5', remove_level=remove_level) else: model = load_net(weights_path='../weights/alexnet_weights.h5', remove_level=remove_level) # model = load_net(weights_path='../weights/alexnet_weights.h5') image_files = get_image_file_list('./images/lehky-processed/', 'png', with_path=True) im = preprocess(image_files, use_vgg=use_vgg) start_time = time.time() out = model.predict(im) print('prediction time: ' + str(time.time() - start_time)) # with open('lehky.pkl', 'wb') as file: # pickle.dump(out, file) # with open('lehky.pkl', 'rb') as file: # out = pickle.load(file) n = 674 # use first n or n with greatest responses if False: rect = np.maximum(0, out[:,:n]) else: maxima = np.max(out, axis=0) ind = np.zeros(n, dtype=int) c = 0 i = 0 while c < n: if maxima[i] > 2: ind[c] = i c = c + 1 i = i + 1 # ind = (-maxima).argsort()[:n] rect = np.maximum(0, out[:,ind]) selectivity = excess_kurtosis(rect) sparseness = excess_kurtosis(rect.T) print(np.mean(selectivity)) print(np.mean(sparseness)) print(np.max(selectivity)) print(np.max(sparseness)) plot_selectivity_and_sparseness(rect.T, 11) network_name = 'vgg' if use_vgg else 'alexnet' plt.savefig('../figures/selectivity-' + network_name + '-' + str(remove_level) + '-talk.eps') plt.show() if False: plt.figure(figsize=(4,3.8)) plt.scatter(3.5, 12.51, c='k', marker='x', s=40, label='IT') # from Lehky et al. Fig 4A and 4B selectivity_alexnet = [10.53, 28.59, 31.44] sparseness_alexnet = [4.04, 8.85, 6.61] selectivity_vgg = [26.79, 14.44, 34.65] sparseness_vgg = [6.59, 3.40, 3.54] plt.scatter([10.53, 28.59, 31.44], [4.04, 8.85, 6.61], c='b', marker='o', s=30, label='Alexnet') plt.scatter([26.79, 14.44, 34.65], [6.59, 3.40, 3.54], c='g', marker='s', s=45, label='VGG-16') plt.plot([0, 40], [0, 40], 'k') plt.xlim([0,38]) plt.ylim([0,38]) gap = 0.4 plt.text(3.5+gap, 9.61+gap+.05, 'IT') plt.text(selectivity_alexnet[0]+gap, sparseness_alexnet[0]+gap, 'out') plt.text(selectivity_alexnet[1]+gap, sparseness_alexnet[1]+gap, 'out-1') plt.text(selectivity_alexnet[2]+gap, sparseness_alexnet[2]+gap, 'out-2') plt.text(selectivity_vgg[0]+gap, sparseness_vgg[0]+gap, 'out') plt.text(selectivity_vgg[1]+gap, sparseness_vgg[1]+gap, 'out-1') plt.text(selectivity_vgg[2]+gap, sparseness_vgg[2]+gap, 'out-2') plt.xlabel('Selectivity') plt.ylabel('Sparseness') plt.tight_layout() plt.savefig('../figures/cnn-selectivity.eps') plt.show() if False: r_mat = rect.T n_neurons = r_mat.shape[0] activity_fractions = np.zeros(n_neurons) for n_idx in np.arange(n_neurons): rates = r_mat[n_idx, :] activity_fractions[n_idx] = activity_fraction(rates) print(activity_fractions) plt.plot(activity_fractions) plt.show() rate = np.mean(rect,0) # with open('activity-fraction.pkl', 'wb') as file: # pickle.dump((ind, activity_fractions), file) # bins = np.linspace(0, 1000, 501) # plt.figure() # plt.subplot(2,1,1) # plt.hist(selectivity, bins) # # plt.xlim([0, 100]) # # plt.ylim([0, 100]) # plt.subplot(2,1,2) # plt.hist(sparseness, bins) # # plt.xlim([0, 100]) # # plt.ylim([0, 100]) # plt.show() # # note: there is a NaN due to single kurtosis much less than gaussian # print(np.corrcoef(np.mean(rect,0), np.log(selectivity+1))) # plt.figure() # plt.scatter(np.mean(rect,0), np.log(selectivity+1)) # plt.gca().set_xscale('log') # plt.gca().set_yscale('log') # plt.show() # # rate = np.mean(rect,0) # with open('rate-vs-selectivity.pkl', 'wb') as file: # pickle.dump((ind, rate, selectivity), file)
{ "repo_name": "bptripp/it-cnn", "path": "tuning/selectivity.py", "copies": "1", "size": "13980", "license": "mit", "hash": 7703437769836973000, "line_mean": 32.3651551313, "line_max": 100, "alpha_frac": 0.5779685265, "autogenerated": false, "ratio": 3.051735428945645, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.9111438104428167, "avg_score": 0.0036531702034956226, "num_lines": 419 }
__author__ = 'bptripp' from os import listdir, makedirs from os.path import join, isfile, basename, exists import numpy as np from scipy import misc import string import matplotlib import matplotlib.pyplot as plt def get_image_file_list(source_path, extension, with_path=False): if with_path: result = [join(source_path, f) for f in listdir(source_path) if isfile(join(source_path, f)) and f.endswith(extension)] else: result = [f for f in listdir(source_path) if isfile(join(source_path, f)) and f.endswith(extension)] return result def alpha(i): if i >= 26**2 or i < 0: raise Exception('Can only handle indices from 0 to 675') first = i/26 second = np.mod(i, 26) return string.ascii_uppercase[first] + string.ascii_uppercase[second] def process_lehky_files(source_path, dest_path): """ Reads raw files from Lehky et al. (2011) supplementary material and converts them to a good form for AlexNet. Strips the border and embeds in larger gray image. :param source_path: Where original images are :param dest_path: Where processed images go :return: """ border = 2 full_shape = [256,256,3] background = 127 files = get_image_file_list(source_path, 'ppm') if not exists(dest_path): makedirs(dest_path) for file in files: image = misc.imread(join(source_path, file)) cropped = clean_lehky_image(image, border, background) # cropped = image[border:(image.shape[0]-border),border:(image.shape[1]-border),:] # cropped = np.maximum(255-cropped, 1) #without this there are various artefacts, don't know why # # for i in range(cropped.shape[0]): # for j in range(cropped.shape[1]): # distance = np.linalg.norm(cropped[i,j,0] - [background,background,background]) # if distance < 15: # cropped[i,j,:] = background full = np.zeros(full_shape) full[:] = 127 corner = [full_shape[i]/2 - 1 - cropped.shape[i]/2 for i in range(2)] full[corner[0]:corner[0]+cropped.shape[0],corner[1]:corner[1]+cropped.shape[1],:] = cropped # plt.imshow(cropped) # plt.imshow(full) # plt.show() misc.imsave(join(dest_path, file[:-4]+'.png'), full) def clean_lehky_image(image, border, background): cropped = image[border:(image.shape[0]-border),border:(image.shape[1]-border),:] cropped = np.maximum(255-cropped, 1) #without this there are various artefacts, don't know why cropped = 255 - cropped for i in range(cropped.shape[0]): for j in range(cropped.shape[1]): distance = np.linalg.norm(cropped[i,j,0] - [background,background,background]) if distance < 15: cropped[i,j,:] = background return cropped def make_orientations(source_image_file, orientations, dest_path): if not exists(dest_path): makedirs(dest_path) source_name = basename(source_image_file)[:-4] source_image = misc.imread(source_image_file) scale = 100. / np.max(source_image.shape) source_image = misc.imresize(source_image, scale) full_dim = 256 ccr_dim = int(2*np.ceil(full_dim/2*2**.5)) # cover corners when rotated # ccr_shape = [ccr_dim,ccr_dim] background_colour = source_image[0,0,:] big_image = np.tile(background_colour, [ccr_dim,ccr_dim,1]) corner = [ccr_dim/2-source_image.shape[0]/2, ccr_dim/2-source_image.shape[1]/2] ss = source_image.shape big_image[corner[0]:corner[0]+ss[0],corner[1]:corner[1]+ss[1],:] = source_image # plt.imshow(background) # plt.show() # bg = np.round(np.mean(source_image[0:3,0:3,:])) # print(bg) # print(source_image[0:3,0:3,:]) # buffered = np. for orientation in orientations: rotated = misc.imrotate(big_image, orientation, interp='bilinear') crop = (ccr_dim - full_dim)/2 cropped = rotated[crop:-crop,crop:-crop,:] # plt.imshow(cropped) # plt.show() misc.imsave(join(dest_path, source_name + alpha(int(orientation)) + '.png'), cropped) def add_borders(source_path, dest_path, scale=.2, dim=256, extension='png'): if not exists(dest_path): makedirs(dest_path) files = get_image_file_list(source_path, extension) for file in files: image = misc.imread(join(source_path, file), mode='RGB') image = misc.imresize(image, scale) full = np.zeros((dim,dim,3), dtype=image.dtype) full[:] = 255 corner = [dim/2 - 1 - image.shape[i]/2 for i in range(2)] full[corner[0]:corner[0]+image.shape[0],corner[1]:corner[1]+image.shape[1],:] = image # plt.figure() # plt.subplot(2,1,1) # plt.imshow(image) # plt.subplot(2,1,2) # plt.imshow(full) # plt.show() misc.imsave(join(dest_path, file), full) def make_sizes(source_image_file, scales, dest_path): if not exists(dest_path): makedirs(dest_path) # print(source_image_file) source_name = basename(source_image_file)[:-4] source_image = misc.imread(source_image_file) background_colour = source_image[0,0,:] dim = 256 for i in range(len(scales)): result = np.tile(background_colour, [dim,dim,1]) scaled = misc.imresize(source_image, scales[i]) if scaled.shape[0] > dim: trim = int((scaled.shape[0]-dim+1)/2) scaled = scaled[trim:-trim,:,:] if scaled.shape[1] > dim: trim = int((scaled.shape[1]-dim+1)/2) scaled = scaled[:,trim:-trim,:] # print(scales[i]) # print(scaled.shape) c = int(np.floor((dim-scaled.shape[0])/2)), int(np.floor((dim-scaled.shape[1])/2)) #corner result[c[0]:c[0]+scaled.shape[0],c[1]:c[1]+scaled.shape[1]] = scaled misc.imsave(join(dest_path, source_name + alpha(i) + '.png'), result) # plt.imshow(result) # plt.show() def make_positions(source_image_file, scale, offsets, dest_path): if not exists(dest_path): makedirs(dest_path) source_name = basename(source_image_file)[:-4] source = misc.imread(source_image_file) source = misc.imresize(source, scale) background_colour = source[0,0,:] dim = 256 for i in range(len(offsets)): result = np.tile(background_colour, [dim,dim,1]) top = (dim-source.shape[0])/2 bottom = top+source.shape[0] left = (dim-source.shape[1])/2+offsets[i] right = left + source.shape[1] section = source[:,np.maximum(0,-left):-1-np.maximum(0,right-dim),:] result[top:bottom,np.maximum(0,left):np.minimum(dim-1,right-1),:] = section misc.imsave(join(dest_path, source_name + alpha(i) + '.png'), result) # plt.imshow(result) # plt.show() def make_positions_schwartz(source_image_file, offset, dest_path, scale=1): if not exists(dest_path): makedirs(dest_path) source_name = basename(source_image_file)[:-4] source = misc.imread(source_image_file) source = misc.imresize(source, scale) background_colour = source[0,0,:] dim = 256 hor_offsets = [-offset, offset, 0, 0, 0] ver_offsets = [0, 0, -offset, offset, 0] for i in range(len(hor_offsets)): result = np.tile(background_colour, [dim,dim,1]) top = (dim-source.shape[0])/2+ver_offsets[i] bottom = top+source.shape[0] left = (dim-source.shape[1])/2+hor_offsets[i] right = left + source.shape[1] section = source[:,np.maximum(0,-left):-1-np.maximum(0,right-dim),:] result[top:bottom,np.maximum(0,left):np.minimum(dim-1,right-1),:] = section misc.imsave(join(dest_path, source_name + alpha(i) + '.png'), result) # plt.imshow(result) # plt.show() def make_occlusions(dest_path, shape_colour=[255,255,255], motion=False): def make_background(): return 1 + 254*np.tile(np.random.randint(0, 2, [256,256,1]), [1,1,3]) # can't see how to extract pixels from image on mac, so drawing lines manually def draw_line(image, p1, p2, width): left = int(max(0, min(p1[1]-width, p2[1]-width))) right = int(min(image.shape[1]-1, max(p1[1]+width, p2[1]+width))) top = int(max(0, min(p1[0]-width, p2[0]-width))) bottom = int(min(image.shape[1]-1, max(p1[0]+width, p2[0]+width))) a = p1[0]-p2[0] b = p2[1]-p1[1] c = -a*p1[1] - b*p1[0] for i in range(top, bottom): for j in range(left, right): if p1[0] == p2[0]: #horizontal d = abs(i-p1[0]) elif p1[1] == p2[1]: #vertical d = abs(j-p1[1]) else: d = abs(a*j + b*i + c) / (a**2 + b**2)**.5 val = 255 if d < width: # image[i,j,:] = 255 image[i,j,:] = shape_colour elif d - width < 1: image[i,j,:] = (d-width)*image[i,j,:] + (1-d+width)*np.array(shape_colour, dtype=int) #[val,val,val] def draw_contour(image, x, y, width): for i in range(len(x)-1): draw_line(image, (x[i],y[i]), (x[i+1],y[i+1]), width) def occlude(image, p): block_dim = 8 original_image = image.copy() for i in range(image.shape[0]/block_dim): for j in range(image.shape[1]/block_dim): if np.random.rand() < p: if not motion: image[block_dim*i:block_dim*(i+1), block_dim*j:block_dim*(j+1), :] = 255 else: # simulate motion of ~1.5 degrees diagonally by moving down and right 20 pixels # simulate transience of occlusion at each point with transparency opacity = .05 for k in range(20): top = block_dim*i+k bottom = min(block_dim*(i+1)+k,image.shape[0]) left = block_dim*j+k right = min(block_dim*(j+1)+k, image.shape[1]) change = opacity * (255 - original_image[top:bottom, left:right, :]) image[top:bottom, left:right, :] = image[top:bottom, left:right, :] + change # image[top:bottom, left:right, :] \ # = (1-opacity) * image[top:bottom, left:right, :] \ # + opacity * 255 def save_occlusions(name, x, y, line_width): d = join(dest_path, name) if not exists(d): makedirs(d) # x, y: lists of coordinates of shape outline to plot percent_occlusion = [0, 20, 50, 90, 100] for p in percent_occlusion: for rep in range(10): image = make_background() draw_contour(image, x, y, line_width) occlude(image, p/100.) # the 99 is a hack to make the files load in the expected order (not alphabetically) misc.imsave(join(dest_path, name, name + str(np.minimum(p,99)) + '-' + str(rep) + '.png'), 255-image) # plt.imshow(image) # plt.show() angle = np.linspace(0, 2*np.pi) save_occlusions('circle', 128+30*np.cos(angle), 128+30*np.sin(angle), 2) angle = np.linspace(0, 2*np.pi, 13) radii = [30-15*np.mod(i,2) for i in range(len(angle))] save_occlusions('star', 128+radii*np.cos(angle), 128+radii*np.sin(angle), 2) a,b = 108,148 save_occlusions('square', [a,b,b,a,a], [a,a,b,b,a], 2) save_occlusions('triangle', 128+np.array([18,18,-18,18]), 128+np.array([-18,18,0,-18]), 2) save_occlusions('strange', 128+np.array([20,20,10,10,-20,-20,-10,-10,0,0,10,10,20]), 128+np.array([-30,20,20,10,10,0,0,-20,-20,0,0,-30,-30]), 2) save_occlusions('arrow', 128-1.25*np.array([30, 10, 10, -25, -25, 10, 10, 30]), 128+1.25*np.array([0, 18, 10, 10, -10, -10, -18, 0]), 2) save_occlusions('h', 128-1.25*np.array([20, -20, -20, -5, -5, -20, -20, 20, 20, 5, 5, 20, 20]), 128-1.25*np.array([-15, -15, -5, -5, 5, 5, 15, 15, 5, 5, -5, -5, -15]), 2) angle = np.linspace(0, 2*np.pi, 9)+np.pi/8 save_occlusions('stop', 128+38*np.cos(angle), 128+38*np.sin(angle), 2) # circle_image = make_background() # angle = np.linspace(0, 2*np.pi) # draw_contour(circle_image, 128+20*np.cos(angle), 128+20*np.sin(angle), 3) def make_clutters(source_path, dest_path): if not exists(dest_path): makedirs(dest_path) makedirs(join(dest_path+'/top')) makedirs(join(dest_path+'/bottom')) makedirs(join(dest_path+'/pair')) full_shape = [256,256,3] background_colour = 127 files = get_image_file_list(source_path, 'ppm') images = [] for file in files: image = misc.imread(join(source_path, file)) images.append(clean_lehky_image(image, 2, background_colour)) tops = images[:4] bottoms = images[4:] corner_top_image = [66,99] #top left corner of top image corner_bottom_image = [132,99] # top left corner of bottom image def get_background(): background = np.zeros(full_shape) background[:] = background_colour return background def add_image(background, image, corner): background[corner[0]:corner[0]+image.shape[0], corner[1]:corner[1]+image.shape[1] ,:] = image for i in range(len(tops)): full = get_background() add_image(full, tops[i], corner_top_image) misc.imsave(join(dest_path+'/top', 'top' + str(i) + '.png'), full) for i in range(len(bottoms)): full = get_background() add_image(full, bottoms[i], corner_bottom_image) misc.imsave(join(dest_path+'/bottom', 'bottom' + str(i) + '.png'), full) # all pairs for i in range(len(tops)): for j in range(len(bottoms)): full = get_background() add_image(full, tops[i], corner_top_image) add_image(full, bottoms[j], corner_bottom_image) misc.imsave(join(dest_path+'/pair', 'pair' + str(i) + '-' + str(j) + '.png'), full) # full = np.zeros(full_shape) # full[:] = 127 # # full[corner_top_image[0]:corner_top_image[0]+images[i].shape[0],corner_top_image[1]:corner_top_image[1]+images[i].shape[1],:] = images[i] # full[corner_bottom_image[0]:corner_bottom_image[0]+images[j].shape[0],corner_bottom_image[1]:corner_bottom_image[1]+images[j].shape[1],:] = images[j] # # plt.imshow(full) # plt.show() def make_3d(source_dir, dest_dir): # crop and resize images appropriately target_shape = [256,256,3] source_files = get_image_file_list(source_dir, 'jpg') for source_file in source_files: im = misc.imread(join(source_dir, source_file)) excess = im.shape[1] - im.shape[0] cropped = im[:,excess/2:-excess/2] resized = misc.imresize(cropped, target_shape) # print(im.shape) # print(cropped.shape) # print(resized.shape) misc.imsave(join(dest_dir, source_file), resized) # source = misc.imread(source_image_file) if __name__ == '__main__': # add_borders('./source-images/simplification/from', './images/simplification/from') # add_borders('./source-images/simplification/to', './images/simplification/to') add_borders('./source-images/simplification/other', './images/simplification/other', scale=.85) # # print(get_image_file_list('./source-images/lehky', 'ppm')) # # print('Cleaning Lehky et al. images ...') # process_lehky_files('./source-images/lehky', # './images/lehky-processed') # # print('Making orientation stimuli ... ') # make_orientations('./source-images/banana.png', # np.linspace(0, 360, 91), # './images/banana-rotations') # # make_orientations('./source-images/shoe.png', # np.linspace(0, 360, 91), # './images/shoe-rotations') # # make_orientations('./source-images/corolla.png', # np.linspace(0, 360, 91), # './images/corolla-rotations') # # make_orientations('./source-images/swiss_knife.jpg', # np.linspace(0, 360, 91), # './images/swiss-knife-rotations') # # make_orientations('./source-images/staple.png', # np.linspace(0, 360, 91), # './images/staple-rotations') # # print('Making clutter stimuli ... ') # make_clutters('./source-images/clutter', # './images/clutter') # # print('Making occlusion stimuli ... ') # make_occlusions('./images/occlusions-black') # make_occlusions('./images/occlusions-red', shape_colour=[0,255,255]) # Note in Kovacs et al, the shape was typically presented for 500ms, the occlusion # pattern moved at 3deg/s, and shapes covered an area of about 10deg^2, so the # occlusion pattern moved about half the shape height (diagonally down) # make_occlusions('./images/occlusions-moving', motion=True) # # print('Making size tuning stimuli ... ') # # schwartz_scales = [13**.5/28**.5, 1., 50**.5/28**.5] # schwartz_scales = .5*np.array([13**.5/28**.5, 1., 50**.5/28**.5]) # make_sizes('./source-images/schwartz/f1.png', # schwartz_scales, # './images/scales/f1') # make_sizes('./source-images/schwartz/f2.png', # schwartz_scales, # './images/scales/f2') # make_sizes('./source-images/schwartz/f3.png', # schwartz_scales, # './images/scales/f3') # make_sizes('./source-images/schwartz/f4.png', # schwartz_scales, # './images/scales/f4') # make_sizes('./source-images/schwartz/f5.png', # schwartz_scales, # './images/scales/f5') # make_sizes('./source-images/schwartz/f6.png', # schwartz_scales, # './images/scales/f6') # # scales = np.logspace(np.log10(.05), np.log10(1.2), 45) # make_sizes('./source-images/corolla.png', # scales, # './images/scales/corolla') # # make_sizes('./source-images/shoe.png', # scales, # './images/scales/shoe') # # make_sizes('./source-images/banana.png', # scales, # './images/scales/banana') # # print('Making position tuning stimuli ... ') # offsets = np.linspace(-75, 75, 150/5+1, dtype=int) # make_positions('./source-images/shoe.png', .4, # offsets, # './images/positions/shoe') # # make_positions('./source-images/banana.png', .4, # offsets, # './images/positions/banana') # # make_positions('./source-images/corolla.png', .4, # offsets, # './images/positions/corolla') # # make_positions('./source-images/staple.png', .4, # offsets, # './images/positions/staple') # # From Schwartz et al., 5 degrees up, down, left right with stimulus 28**.5=5.3 degrees wide # our stimuli ~2/3 * 56 pixels = 37, so we want shifts of 35 pixels # Our new stimuli ~150pixels wide and we'll scale by .5, so say 71-pixel shift # schwartz_offset = 35 # schwartz_scale = .4 # schwartz_offset = schwartz_offset = (5/5.3)*(schwartz_scale*150) # make_positions_schwartz('./source-images/schwartz/f1.png', # schwartz_offset, # './images/positions/f1', scale=schwartz_scale) # make_positions_schwartz('./source-images/schwartz/f2.png', # schwartz_offset, # './images/positions/f2', scale=schwartz_scale) # make_positions_schwartz('./source-images/schwartz/f3.png', # schwartz_offset, # './images/positions/f3', scale=schwartz_scale) # make_positions_schwartz('./source-images/schwartz/f4.png', # schwartz_offset, # './images/positions/f4', scale=schwartz_scale) # make_positions_schwartz('./source-images/schwartz/f5.png', # schwartz_offset, # './images/positions/f5', scale=schwartz_scale) # make_positions_schwartz('./source-images/schwartz/f6.png', # schwartz_offset, # './images/positions/f6', scale=schwartz_scale) # make_3d('/Users/bptripp/code/salman-IT/salman/images/scooter', # '/Users/bptripp/code/salman-IT/salman/images/scooter-cropped') # make_3d('/Users/bptripp/code/salman-IT/salman/images/staple', # '/Users/bptripp/code/salman-IT/salman/images/staple-cropped') # make_3d('/Users/bptripp/code/salman-IT/salman/images/head', # '/Users/bptripp/code/salman-IT/salman/images/head-cropped')
{ "repo_name": "bptripp/it-cnn", "path": "tuning/cnn_stimuli.py", "copies": "1", "size": "21255", "license": "mit", "hash": -6568319712443032000, "line_mean": 38.9530075188, "line_max": 174, "alpha_frac": 0.5637261821, "autogenerated": false, "ratio": 3.1704952267303104, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.42342214088303104, "avg_score": null, "num_lines": null }
__author__ = 'bptripp' from os import listdir from os.path import isfile, join import cPickle import numpy as np import scipy from keras.models import Sequential from keras.layers.core import Dense, Flatten, Dropout, Activation from keras.layers.convolutional import Convolution2D, MaxPooling2D from keras.optimizers import Adam from keras.models import model_from_json from keras.regularizers import activity_l2 num_outputs = 250 def merge_data(rel_dir): image_filenames = [] neuron_metrics = [] for f in listdir(rel_dir): rel_filename = join(rel_dir, f) if isfile(rel_filename) and f.endswith('.pkl') and not f == 'neuron-points.pkl': object_name = f[:-11] print('Processing ' + object_name) with open(rel_filename) as rel_file: target_indices, target_points, object_eye_points, object_eye_angles, neuron_metrics_for_object = cPickle.load(rel_file) s = neuron_metrics_for_object.shape for i in range(s[0]): #loop through target points for j in range(s[1]): #loop through eye perspectives image_filename = object_name + '-' + str(i) + '-' + str(j) + '.png' image_filenames.append(image_filename) neuron_metrics.append(neuron_metrics_for_object[i,j,:]) with open('perspective-data.pkl', 'wb') as f: cPickle.dump((image_filenames, np.array(neuron_metrics)), f) def get_model(): model = Sequential() model.add(Convolution2D(64, 7, 7, input_shape=(1,80,80), init='glorot_normal', border_mode='same', activity_regularizer=activity_l2(0.000001))) model.add(Activation('relu')) model.add(Convolution2D(64, 3, 3, init='glorot_normal', border_mode='same', activity_regularizer=activity_l2(0.000001))) model.add(Activation('relu')) # model.add(Dropout(.5)) model.add(Convolution2D(64, 3, 3, init='glorot_normal', border_mode='same', activity_regularizer=activity_l2(0.000001))) model.add(Activation('relu')) model.add(MaxPooling2D((2,2))) # model.add(Dropout(.5)) model.add(Flatten()) model.add(Dense(256, activity_regularizer=activity_l2(0.000001))) model.add(Activation('relu')) model.add(Dropout(.5)) model.add(Dense(1024, activity_regularizer=activity_l2(0.000001))) model.add(Activation('relu')) model.add(Dropout(.5)) model.add(Dense(num_outputs)) adam = Adam(lr=0.000001, beta_1=0.9, beta_2=0.999, epsilon=1e-08) model.compile(loss='mse', optimizer=adam) return model def load_model(weights_file='p-model-weights.h5'): model = model_from_json(open('p-model-architecture-big-reg.json').read()) model.load_weights(weights_file) adam = Adam(lr=0.000001, beta_1=0.9, beta_2=0.999, epsilon=1e-08) model.compile(loss='mse', optimizer=adam) return model def load_data(data_file): with open(data_file, 'rb') as f: image_filenames, neuron_metrics = cPickle.load(f) return image_filenames, neuron_metrics[:,:num_outputs] def check_data(): image_filenames, neuron_metrics = load_data('perspective-data-small.pkl') print(len(image_filenames)) print(neuron_metrics.shape) print(image_filenames[0]) print(neuron_metrics[0]) print(np.min(neuron_metrics)) print(np.max(neuron_metrics)) print(np.mean(neuron_metrics)) print(np.std(neuron_metrics)) def get_input(image_dir, image_file): image = scipy.misc.imread(join(image_dir, image_file)) return np.array(image / 255.0) def get_XY(image_dir, image_filenames, neuron_metrics, indices): X = [] Y = [] for ind in indices: X.append(get_input(image_dir, image_filenames[ind])[np.newaxis,:]) Y.append(neuron_metrics[ind]) return np.array(X), np.array(Y) def train_model(model, data_file, image_dir, train_indices, valid_indices): image_filenames, neuron_metrics = load_data(data_file) print(len(image_filenames)) X_valid, Y_valid = get_XY(image_dir, image_filenames, neuron_metrics, valid_indices) def generate_XY(): while 1: batch_X = [] batch_Y = [] for i in range(32): ind = train_indices[np.random.randint(len(train_indices))] X = get_input(image_dir, image_filenames[ind]) Y = neuron_metrics[ind] batch_X.append(X[np.newaxis,:]) batch_Y.append(Y) yield (np.array(batch_X), np.array(batch_Y)) for i in range(10,13): h = model.fit_generator(generate_XY(), samples_per_epoch=8192, nb_epoch=100, validation_data=(X_valid, Y_valid)) with file('p-history-big-reg-' + str(i) + '.pkl', 'wb') as f: cPickle.dump(h.history, f) json_string = model.to_json() open('p-model-architecture-big-reg.json', 'w').write(json_string) model.save_weights('p-model-weights-big-reg-' + str(i) + '.h5', overwrite=True) def predict(model, image_dir, data_file, indices): image_filenames, neuron_metrics = load_data(data_file) X, Y = get_XY(image_dir, image_filenames, neuron_metrics, indices) return Y, model.predict(X, batch_size=32, verbose=0) if __name__ == '__main__': # merge_data('/Volumes/TrainingData/grasp-conv/data/relative-small/') # check_data() valid_indices = np.arange(0, 50000, 100) s = set(valid_indices) train_indices = [x for x in range(70000) if x not in s] #model = get_model() model = load_model(weights_file='p-model-weights-big-reg-9.h5') train_model(model, 'perspective-data-big.pkl', '../../grasp-conv/data/eye-perspectives', train_indices, valid_indices) #model = load_model(weights_file='p-model-weights-big-9.h5') #targets, predictions = predict(model, # '../../grasp-conv/data/eye-perspectives', # 'perspective-data-big.pkl', # valid_indices) #with open('perspective-predictions-big-9.pkl', 'wb') as f: # cPickle.dump((targets, predictions), f)
{ "repo_name": "bptripp/grasp-convnet", "path": "py/perspective_model.py", "copies": "1", "size": "6118", "license": "mit", "hash": -4846606596169325000, "line_mean": 34.5697674419, "line_max": 147, "alpha_frac": 0.6312520432, "autogenerated": false, "ratio": 3.292787944025834, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.4424039987225834, "avg_score": null, "num_lines": null }
__author__ = 'bptripp' from os import listdir from os.path import isfile, join import time import numpy as np import matplotlib.pyplot as plt import cPickle from PIL import Image from scipy.optimize import bisect from quaternion import angle_between_quaterions, to_quaternion def get_random_points(n, radius, surface=False): point_directions = np.random.randn(3, n) norms = np.sum(point_directions**2, axis=0)**.5 points = radius * point_directions / norms if not surface: # points = points * np.random.rand(n)**(1./3.) palm = .035 #TODO: whoops, this is in metres, not fraction of radius points = points * (palm + (1-palm)*np.random.rand(n)) return points def get_random_angles(n, std=np.pi/8.): """ :param n: Number of angles needed :return: Random angles in restricted ranges, meant as deviations in perspective around looking staight at something. """ angles = std*np.random.randn(3, n) angles[2,:] = 2*np.pi*np.random.rand(1, n) return angles def get_rotation_matrix(point, angle): """ :param point: Location of camera :param angle: Not what you expect: this is a list of angles relative to looking at (0,0,0), about world-z (azimuth), camera-y (elevation), and camera-z (roll). Random samples are produced by get_random_angles(). :return: just what you expect """ z = -point #location of (0,0,0) relative to point alpha = np.arctan(z[1]/z[0]) if z[0] < 0: alpha = alpha + np.pi if alpha < 0: alpha = alpha + 2.*np.pi alpha = alpha + angle[0] # rotate by alpha about z Rz = np.array([[np.cos(alpha), -np.sin(alpha), 0], [np.sin(alpha), np.cos(alpha), 0], [0, 0, 1]]) # find elevation in new coordinates beta = -np.arctan(np.sqrt(z[0]**2+z[1]**2)/z[2]) if z[2] < 0: beta = beta + np.pi if beta < 0: beta = beta + 2.*np.pi beta = beta + angle[1] # rotate by beta about y Ry = np.array([[np.cos(beta), 0, -np.sin(beta)], [0, 1, 0], [np.sin(beta), 0, np.cos(beta)]]) gamma = angle[2] Rz2 = np.array([[np.cos(-gamma), -np.sin(-gamma), 0], [np.sin(-gamma), np.cos(-gamma), 0], [0, 0, 1]]) return np.dot(Rz, np.dot(Ry, Rz2)) def check_rotation_matrix(scatter=False): from mpl_toolkits.mplot3d import axes3d, Axes3D n = 6 points = get_random_points(n, 2) angles = get_random_angles(n) # point = np.array([1,1e-6,1e-6]) # point = np.array([1e-6,1,1e-6]) fig = plt.figure() ax = fig.add_subplot(1,1,1,projection='3d') for i in range(points.shape[1]): point = points[:,i] angle = angles[:,i] if not scatter: angle[0] = 0 angle[1] = 0 R = get_rotation_matrix(point, angle) ax.scatter(0, 0, 0, color='b') ax.scatter(point[0], point[1], point[2], color='r') x = np.dot(R, np.array([1,0,0])) y = np.dot(R, np.array([0,1,0])) z = np.dot(R, np.array([0,0,1])) ax.plot([point[0],point[0]+x[0]], [point[1],point[1]+x[1]], [point[2],point[2]+x[2]], color='r') ax.plot([point[0],point[0]+y[0]], [point[1],point[1]+y[1]], [point[2],point[2]+y[2]], color='g') ax.plot([point[0],point[0]+z[0]], [point[1],point[1]+z[1]], [point[2],point[2]+z[2]], color='b') plt.xlabel('x') plt.ylabel('y') plt.ylabel('z') if not scatter: plt.title('blue axes should point AT blue dot (zero)') else: plt.title('blue axes should point NEAR blue dot (zero)') plt.show() def check_depth_from_random_perspective(): from depthmap import loadOBJ, Display filename = '../data/obj_files/24_bowl-02-Mar-2016-07-03-29.obj' verts, faces = loadOBJ(filename) # put vertical centre at zero verts = np.array(verts) minz = np.min(verts, axis=0)[2] maxz = np.max(verts, axis=0)[2] verts[:,2] = verts[:,2] - (minz+maxz)/2 n = 6 points = get_random_points(n, .25) angles = get_random_angles(n) point = points[:,0] angle = angles[:,0] rot = get_rotation_matrix(point, angle) im_width = 80 d = Display(imsize=(im_width,im_width)) d.set_camera_position(point, rot, .5) d.set_mesh(verts, faces) depth = d.read_depth() d.close() X = np.arange(0, im_width) Y = np.arange(0, im_width) X, Y = np.meshgrid(X, Y) from mpl_toolkits.mplot3d import axes3d, Axes3D fig = plt.figure() ax = fig.add_subplot(1,1,1,projection='3d') ax.plot_wireframe(X, Y, depth) ax.set_xlabel('x') plt.show() def find_vertical(point): """ Find new angle[2] so that camera-up points up. In terms of rotation matrix, R[2,0] should be 0 (x-axis horizontal) and R[2,1] should be positive (pointing up rather than down). """ def f(gamma): return get_rotation_matrix(point, np.array([0, 0, gamma]))[2][0] gamma = bisect(f, 0, np.pi) # if get_rotation_matrix(point, np.array([0, 0, gamma]))[2][1] < 0: if get_rotation_matrix(point, np.array([0, 0, gamma]))[2][1] > 0: gamma = gamma + np.pi return gamma def check_find_vertical(): n = 3 points = get_random_points(n, .35, surface=True) for i in range(n): point = points[:,i] gamma = find_vertical(point) rot = get_rotation_matrix(point, np.array([0, 0, gamma])) print(rot) # if np.abs(rot[2,0] > 1e-6) or rot[2,1] < 0: if np.abs(rot[2,0] > 1e-6) or rot[2,1] > 0: print('error with gamma: ' + str(gamma) + ' should be 0: ' + str(rot[2,0]) + ' should be +ve: ' + str(rot[2,1])) def plot_random_samples(): n = 1000 points = get_random_points(n, .25) angles = get_random_angles(n) from mpl_toolkits.mplot3d import axes3d, Axes3D fig = plt.figure(figsize=(10,5)) ax = fig.add_subplot(1,2,1,projection='3d') ax.scatter(points[0,:], points[1,:], points[2,:]) ax = fig.add_subplot(1,2,2,projection='3d') ax.scatter(angles[0,:], angles[1,:], angles[2,:]) plt.show() def get_perspectives(obj_filename, points, angles, im_width=80, near_clip=.25, far_clip=0.8, fov=45, camera_offset=.45, target_point=None): from depthmap import loadOBJ, Display, get_distance verts, faces = loadOBJ(obj_filename) # put vertical centre at zero verts = np.array(verts) min_bounding_box = np.min(verts, axis=0) max_bounding_box = np.max(verts, axis=0) # set bounding box centre to 0,0,0 verts[:,0] = verts[:,0] - (min_bounding_box[0]+max_bounding_box[0])/2. verts[:,1] = verts[:,1] - (min_bounding_box[1]+max_bounding_box[1])/2. verts[:,2] = verts[:,2] - (min_bounding_box[2]+max_bounding_box[2])/2. if target_point is not None: verts[:,0] = verts[:,0] - target_point[0] verts[:,1] = verts[:,1] - target_point[1] verts[:,2] = verts[:,2] - target_point[2] d = Display(imsize=(im_width,im_width)) d.set_perspective(fov=fov, near_clip=near_clip, far_clip=far_clip) perspectives = np.zeros((points.shape[1],im_width,im_width), dtype='float32') for i in range(points.shape[1]): point = points[:,i] angle = angles[:,i] rot = get_rotation_matrix(point, angle) d.set_camera_position(point, rot, camera_offset) d.set_mesh(verts, faces) depth = d.read_depth() distance = get_distance(depth, near_clip, far_clip) perspectives[i,:,:] = distance d.close() return perspectives def process_directory(obj_dir, data_dir, n): from os import listdir from os.path import isfile, join import time for f in listdir(obj_dir): obj_filename = join(obj_dir, f) if isfile(obj_filename) and f.endswith('.obj'): data_filename = join(data_dir, f[:-4] + '.pkl') if isfile(data_filename): print('Skipping ' + f) else: print('Processing ' + f) start_time = time.time() points = get_random_points(n, .15) angles = get_random_angles(n, std=0) print(angles) perspectives = get_perspectives(obj_filename, points, angles) f = open(data_filename, 'wb') cPickle.dump((points, angles, perspectives), f) f.close() print(' ' + str(time.time()-start_time) + 's') def process_eye_directory(obj_dir, data_dir, n): #TODO: save image files here to allow random ordering during training from os import listdir from os.path import isfile, join import time for f in listdir(obj_dir): obj_filename = join(obj_dir, f) if isfile(obj_filename) and f.endswith('.obj'): data_filename = join(data_dir, f[:-4] + '.pkl') if isfile(data_filename): print('Skipping ' + f) else: print('Processing ' + f) start_time = time.time() points = get_random_points(n, .35, surface=True) #.75m with offset angles = np.zeros_like(points) # Set camera-up to vertical via third angle (angle needed is always # 3pi/4, but we'll find it numerically in case other parts of code # change while we're not looking). for i in range(n): angles[2,i] = find_vertical(points[:,i]) perspectives = get_perspectives(obj_filename, points, angles, near_clip=.4, fov=30) f = open(data_filename, 'wb') cPickle.dump((points, angles, perspectives), f) f.close() print(' ' + str(time.time()-start_time) + 's') def check_maps(data_dir): """ Checks pkl files in given directory to see if any of the depth maps they contain are empty. """ from os import listdir from os.path import isfile, join for f in listdir(data_dir): data_filename = join(data_dir, f) if isfile(data_filename) and f.endswith('.pkl'): print('Checking ' + f) f = open(data_filename, 'rb') (points, angles, perspectives) = cPickle.load(f) f.close() for i in range(perspectives.shape[0]): sd = np.std(perspectives[i,:,:].flatten()) if sd < 1e-3: print(' map ' + str(i) + ' is empty') def calculate_metrics(perspectives, im_width=80, fov=45.0, camera_offset=.45): """ :param perspectives: numpy array of depth images of object from gripper perspective """ asymmetry_scale = 13.0 #TODO: calculate from camera params (13 pixels is ~5cm with default params) from heuristic import finger_path_template, calculate_grip_metrics finger_path = finger_path_template(fov*np.pi/180., im_width, camera_offset) collision_template = np.zeros_like(finger_path) collision_template[finger_path > 0] = camera_offset + 0.033 # print(np.max(collision_template)) # print(np.max(finger_path)) # plt.imshow(collision_template) # plt.show() metrics = [] collisions = [] for perspective in perspectives: intersections, qualities = calculate_grip_metrics(perspective, finger_path) q1 = qualities[0] q2 = qualities[1] q3 = qualities[2] if intersections[0] is None or intersections[2] is None: a1 = 1 else: a1 = ((intersections[0]-intersections[2])/asymmetry_scale)**2 if intersections[1] is None or intersections[2] is None: a2 = 1 else: a2 = ((intersections[1]-intersections[2])/asymmetry_scale)**2 m = np.minimum((q1+q2)/1.5, q3) / (1 + (q1*a1+q2*a2) / (q1+q2+1e-6)) collision = np.max(collision_template - perspective) > 0 collisions.append(collision) # if collision: # m = 0 metrics.append(m) # plt.subplot(1,2,1) # plt.imshow(perspective) # plt.subplot(1,2,2) # plt.imshow(np.maximum(0, finger_path-perspective)) # print(collision) # print((a1,a2)) # print(intersections) # print(qualities) # print('metric: ' + str(m)) # plt.show() # print((intersections, qualities)) return metrics, collisions def get_quaternion_distance(points, angles): """ Get new representation of camera/gripper configurations as rotation quaternions and distances from origin, rather than 3D points and rotations about axis pointing to origin. """ # print(points) # print(angles) quaternions = [] distances = [] for point, angle in zip(points.T, angles.T): distances.append(np.linalg.norm(point)) quaternions.append(to_quaternion(get_rotation_matrix(point, angle))) return np.array(quaternions), np.array(distances) def smooth_metrics(quaternions, distances, metrics): from interpolate import interpolate smoothed = [] for i in range(len(metrics)): # print(i) interpolated = interpolate(quaternions[i], distances[i], quaternions, distances, metrics, sigma_d=.02, sigma_a=(16*np.pi/180)) smoothed.append(interpolated) # print(interpolated - metrics[one]) return smoothed def load_target_points(filename): objects = [] indices = [] points = [] for line in open(filename, "r"): vals = line.translate(None, '"\n').split(',') assert len(vals) == 5 objects.append(vals[0]) indices.append(int(vals[1])) points.append([float(vals[2]), float(vals[3]), float(vals[4])]) return objects, indices, points def get_target_points_for_object(objects, indices, points, object): indices_for_object = [] points_for_object = [] for o, i, p in zip(objects, indices, points): if o == object: indices_for_object.append(i) points_for_object.append(p) return np.array(indices_for_object), np.array(points_for_object) def check_target_points(): objects, indices, points = load_target_points('../../grasp-conv/data/obj-points.csv') print(objects) print(indices) print(points) indices, points = get_target_points_for_object(objects, indices, points, '28_Spatula_final-11-Nov-2015-14-22-01.obj') print(indices) print(points) def check_metrics(): # points, angles, metrics, collisions = calculate_metrics('../../grasp-conv/data/perspectives/28_Spatula_final-11-Nov-2015-14-22-01.pkl') # with open('spatula-perspectives.pkl', 'wb') as f: # cPickle.dump((points, angles, metrics, collisions), f) with open('spatula-perspectives.pkl', 'rb') as f: (points, angles, metrics, collisions) = cPickle.load(f) metrics = np.array(metrics) smoothed = smooth_metrics(points, angles, metrics) with open('spatula-perspectives-smoothed.pkl', 'wb') as f: cPickle.dump((points, angles, metrics, collisions, smoothed), f) plt.hist(metrics, bins=50) plt.show() def make_grip_perspective_depths(obj_dir, data_dir, target_points_file, n=1000): objects, indices, points = load_target_points(target_points_file) for f in listdir(obj_dir): obj_filename = join(obj_dir, f) if isfile(obj_filename) and f.endswith('.obj'): data_filename = join(data_dir, f[:-4] + '.pkl') if isfile(data_filename): print('Skipping ' + f) else: print('Processing ' + f) target_indices, target_points = get_target_points_for_object(objects, indices, points, f) start_time = time.time() #TODO: is there any reason to make points & angles these the same or different across targets? gripper_points = get_random_points(n, .15) gripper_angles = get_random_angles(n, std=0) perspectives = [] for target_point in target_points: print(' ' + str(target_point)) p = get_perspectives(obj_filename, gripper_points, gripper_angles, target_point=target_point) perspectives.append(p) f = open(data_filename, 'wb') cPickle.dump((gripper_points, gripper_angles, target_indices, target_points, perspectives), f) f.close() print(' ' + str(time.time()-start_time) + 's') def make_metrics(perspective_dir, metric_dir): """ We'll store in separate pkl files per object to allow incremental processing, even through results won't take much memory. """ for f in listdir(perspective_dir): perspective_filename = join(perspective_dir, f) if isfile(perspective_filename) and f.endswith('.pkl'): metric_filename = join(metric_dir, f[:-4] + '-metrics.pkl') if isfile(metric_filename): print('Skipping ' + f) else: print('Processing ' + f) start_time = time.time() with open(perspective_filename) as perspective_file: gripper_points, gripper_angles, target_indices, target_points, perspectives = cPickle.load(perspective_file) print('unpickle: ' + str(time.time() - start_time)) quaternions, distances = get_quaternion_distance(gripper_points, gripper_angles) collisions = [] free_smoothed = [] coll_smoothed = [] for p in perspectives: # one per target point fm, c = calculate_metrics(p) fm = np.array(fm) c = np.array(c) fs = smooth_metrics(quaternions, distances, fm) cm = fm * (1-c) cs = smooth_metrics(quaternions, distances, cm) collisions.append(c) free_smoothed.append(fs) coll_smoothed.append(cs) f = open(metric_filename, 'wb') cPickle.dump((gripper_points, gripper_angles, target_indices, target_points, collisions, free_smoothed, coll_smoothed), f) f.close() def make_eye_perspective_depths(obj_dir, data_dir, target_points_file, n=20): all_objects, all_target_indices, all_target_points = load_target_points(target_points_file) camera_offset=.45 near_clip=.6 far_clip=1.0 eye_points = [] eye_angles = [] objects = [] target_indices = [] target_points = [] for f in listdir(obj_dir): obj_filename = join(obj_dir, f) if isfile(obj_filename) and f.endswith('.obj'): #and int(f[0]) >= 0: #TODO: set f[0] range here print('Processing ' + f) ti, tp= get_target_points_for_object(all_objects, all_target_indices, all_target_points, f) objects.append(f) target_indices.append(ti) target_points.append(tp) start_time = time.time() points = get_random_points(n, .35, surface=True) #.8m with offset # points = np.array([[ 0.00001], [0.35], [0.00001]]) # TODO: bug with x=0 and with z=0 print(points) angles = np.zeros_like(points) eye_points.append(points) eye_angles.append(angles) # Set camera-up to vertical via third angle (angle needed is always # 3pi/4, but we'll find it numerically in case other parts of code # change while we're not looking). for i in range(n): angles[2,i] = find_vertical(points[:,i]) perspectives = [] for target_index, target_point in zip(ti, tp): print(' ' + str(target_point)) perspectives = get_perspectives(obj_filename, points, angles, near_clip=near_clip, far_clip=far_clip, camera_offset=camera_offset, fov=30, target_point=target_point) for i in range(len(perspectives)): distance = perspectives[i] rescaled_distance = np.maximum(0, (distance-camera_offset)/(far_clip-camera_offset)) imfile = data_dir + f[:-4] + '-' + str(target_index) + '-' + str(i) + '.png' Image.fromarray((255.0*rescaled_distance).astype('uint8')).save(imfile) print(' ' + str(time.time()-start_time) + 's') data_filename = join(data_dir, 'eye-perspectives-murata.pkl') f = open(data_filename, 'wb') cPickle.dump((objects, target_indices, target_points, eye_points, eye_angles), f) f.close() def merge_eye_perspectives(data_dir): # make_eye_perspective_depths mysteriously does not run all the way through, so I've # done it in two parts which are merged here: files = ['eye-perspectives1.pkl', 'eye-perspectives2.pkl'] objects = [] target_indices = [] target_points = [] eye_points = [] eye_angles = [] for file in files: with open(join(data_dir, file), 'rb') as f: o, ti, tp, ep, ea = cPickle.load(f) objects.extend(o) target_indices.extend(ti) target_points.extend(tp) eye_points.extend(ep) eye_angles.extend(ea) with open(join(data_dir, 'eye-perspectives.pkl'),'wb') as f: cPickle.dump((objects, target_indices, target_points, eye_points, eye_angles), f) def export_neuron_perspectives(): import csv with open('../data/neuron-points.pkl', 'rb') as f: neuron_points, neuron_angles = cPickle.load(f) with open('neuron-perspectives.csv', 'wb') as csvfile: writer = csv.writer(csvfile, delimiter=',') for point, angle in zip(neuron_points.T, neuron_angles.T): R = get_rotation_matrix(point, angle) row = list(point) row.extend(R.flatten()) writer.writerow(row) def export_eye_perspectives(eye_perspectives_file): import csv with open(eye_perspectives_file) as f: objects, target_indices, target_points, eye_points, eye_angles = cPickle.load(f) with open('eye-perspectives.csv', 'wb') as csvfile: writer = csv.writer(csvfile, delimiter=',') for object, ep, ea, tp in zip(objects, eye_points, eye_angles, target_points): print('Processing ' + object) for target_point in tp: for eye_point, eye_angle in zip(ep.T, ea.T): eye_R = get_rotation_matrix(eye_point, eye_angle) # row = [object] row = [] row.extend(target_point) row.extend(eye_point) row.extend(eye_R.flatten()) writer.writerow(row) def make_relative_metrics(eye_perspectives_file, metrics_dir, result_dir, n=500, neuron_points=None, neuron_angles=None): from quaternion import difference_between_quaternions from interpolate import interpolate # each of these points/angles will correspond to an output neuron ... if neuron_points is None or neuron_angles is None: neuron_points = get_random_points(n, .15) neuron_angles = get_random_angles(n, std=0) with open(join(result_dir, 'neuron-points.pkl'), 'wb') as f: cPickle.dump((neuron_points, neuron_angles), f) neuron_quaternions, neuron_distances = get_quaternion_distance(neuron_points, neuron_angles) with open(eye_perspectives_file) as f: objects, target_indices, target_points, eye_points, eye_angles = cPickle.load(f) for object, object_eye_points, object_eye_angles in zip(objects, eye_points, eye_angles): print('Processing ' + object) start_time = time.time() eye_quaternions, eye_distances = get_quaternion_distance(object_eye_points, object_eye_angles) metrics_file = join(metrics_dir, object[:-4] + '-metrics.pkl') with open(metrics_file) as f: gripper_points, gripper_angles, target_indices, target_points, collisions, free_smoothed, coll_smoothed = cPickle.load(f) gripper_quaternions, gripper_distances = get_quaternion_distance(gripper_points, gripper_angles) # note that for each object, gripper configs are the same relative to each target point #TODO: do we want coll_smoothed instead / as well? metrics = free_smoothed # interpolate relative to each eye point neuron_metrics_for_object = [] for target_index, target_metrics in zip(target_indices, metrics): print(' target ' + str(target_index)) neuron_metrics_for_target = [] for eye_quaternion in eye_quaternions: rel_quaternions = [] for gripper_quaternion in gripper_quaternions: rel_quaternions.append(difference_between_quaternions(eye_quaternion, gripper_quaternion)) rel_quaternions = np.array(rel_quaternions) #interpolate ... neuron_metrics = [] for neuron_quaternion, neuron_distance in zip(neuron_quaternions, neuron_distances): interpolated = interpolate(neuron_quaternion, neuron_distance, rel_quaternions, gripper_distances, target_metrics, sigma_d=.02, sigma_a=(16*np.pi/180)) neuron_metrics.append(interpolated) neuron_metrics_for_target.append(neuron_metrics) neuron_metrics_for_object.append(neuron_metrics_for_target) neuron_metrics_for_object = np.array(neuron_metrics_for_object) result_file = join(result_dir, object[:-4] + '-neuron.pkl') with open(result_file, 'wb') as f: cPickle.dump((target_indices, target_points, object_eye_points, object_eye_angles, neuron_metrics_for_object), f) print(' ' + str(time.time() - start_time) + 's') def make_XY(): eye_image_files = [] metrics = [] return eye_image_files, metrics if __name__ == '__main__': # check_rotation_matrix(scatter=True) # check_depth_from_random_perspective() # plot_random_samples() # check_find_vertical() # check_target_points() # check_metrics() # make_grip_perspective_depths('../../grasp-conv/data/obj_tmp/', # '../../grasp-conv/data/perspectives/', # '../../grasp-conv/data/obj-points.csv') # make_grip_perspective_depths('../../grasp-conv/data/obj_files/', # '/Volumes/TrainingData/grasp-conv/data/perspectives/', # '../../grasp-conv/data/obj-points.csv') # make_eye_perspective_depths('../../grasp-conv/data/obj_tmp/', # '../../grasp-conv/data/eye-tmp/', # '../../grasp-conv/data/obj-points.csv') make_eye_perspective_depths('../../grasp-conv/data/obj_files_murata/', '../../grasp-conv/data/eye-perspectives-murata/', '../../grasp-conv/data/obj-points-murata.csv', n=1) # make_eye_perspective_depths('../../grasp-conv/data/obj_files/', # '/Volumes/TrainingData/grasp-conv/data/eye-perspectives/', # '../../grasp-conv/data/obj-points.csv') # merge_eye_perspectives('/Volumes/TrainingData/grasp-conv/data/eye-perspectives/') # with open('/Volumes/TrainingData/grasp-conv/data/eye-perspectives/eye-perspectives.pkl','rb') as f: # objects, target_indices, target_points, eye_points, eye_angles = cPickle.load(f) # print(objects) # print(target_indices) # print(target_points) # print(eye_angles) # make_relative_metrics('/Volumes/TrainingData/grasp-conv/data/eye-perspectives/eye-perspectives.pkl', # '/Volumes/TrainingData/grasp-conv/data/metrics/', # '/Volumes/TrainingData/grasp-conv/data/relative/') # export_neuron_perspectives() # export_eye_perspectives('/Volumes/TrainingData/grasp-conv/data/eye-perspectives/eye-perspectives.pkl') # import scipy # image = scipy.misc.imread('../../grasp-conv/data/eye-tmp/1_Coffeecup_final-03-Mar-2016-18-50-40-0-7.png') # plt.imshow(image) # plt.show() # with open('../../grasp-conv/data/eye-tmp/eye-perspectives.pkl') as f: # objects, target_indices, target_points, eye_points, eye_angles = cPickle.load(f) # print(objects) # print(target_indices) # print(target_points) # print(np.array(eye_points)) # print(np.array(eye_angles)) # with open('spatula-perspectives.pkl', 'rb') as f: # gripper_points, gripper_angles, target_indices, target_points, perspectives = cPickle.load(f) # make_metrics('../../grasp-conv/data/perspectives/', '../../grasp-conv/data/metrics/') # make_relative_metrics('../../grasp-conv/data/eye-tmp/eye-perspectives.pkl', # '../../grasp-conv/data/metrics/', # '../../grasp-conv/data/relative/') # checking files look OK ... # with open('../../grasp-conv/data/relative/neuron-points.pkl', 'rb') as f: # neuron_points, neuron_angles = cPickle.load(f) # print(neuron_angles.shape) # with open('../../grasp-conv/data/relative/1_Coffeecup_final-03-Mar-2016-18-50-40-neuron.pkl', 'rb') as f: # target_indices, target_points, object_eye_points, object_eye_angles, neuron_metrics_for_object = cPickle.load(f) # print(neuron_metrics_for_object.shape) # print(np.min(neuron_metrics_for_object)) # print(np.max(neuron_metrics_for_object)) # print(np.std(neuron_metrics_for_object)) # make_metrics('/Volumes/TrainingData/grasp-conv/data/perspectives/', # '/Volumes/TrainingData/grasp-conv/data/metrics/') # process_eye_directory('../../grasp-conv/data/obj_tmp/', '../../grasp-conv/data/eye-perspectives-tmp/', 100) # process_directory('../data/obj_files/', '../data/perspectives/', 10) # process_directory('../../grasp-conv/data/obj_tmp/', '../../grasp-conv/data/perspectives/', 5000) # check_maps('../../grasp-conv/data/perspectives/')
{ "repo_name": "bptripp/grasp-convnet", "path": "py/perspective.py", "copies": "1", "size": "30382", "license": "mit", "hash": -3662520170638863000, "line_mean": 37.3127364439, "line_max": 141, "alpha_frac": 0.5873543546, "autogenerated": false, "ratio": 3.4060538116591927, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.9469955772366101, "avg_score": 0.004690478778618361, "num_lines": 793 }
__author__ = 'bptripp' from os.path import join import cPickle import matplotlib.pyplot as plt import scipy.misc import numpy as np from perspective import get_rotation_matrix, get_random_points def plot_correct_point_scatter(): n_points = 200 with open('../data/neuron-points.pkl', 'rb') as f: neuron_points, neuron_angles = cPickle.load(f) with open('perspective-data-small.pkl', 'rb') as f: image_files, metrics = cPickle.load(f) # print(metrics.shape) index = 600 points = neuron_points[:,:n_points] offsets = np.zeros_like(points) for i in range(n_points): r = get_rotation_matrix(neuron_points[:,i], neuron_angles[:,i]) offsets[:,i] = points[:,i] + np.dot(r, np.array([0,.005,0])) from mpl_toolkits.mplot3d import axes3d, Axes3D fig = plt.figure(figsize=(20,10)) ax = fig.add_subplot(1,2,1,projection='3d') ax.scatter(points[0,:], points[1,:], points[2,:], c=metrics[index,:n_points], cmap='autumn', depthshade=False) ax.scatter(offsets[0,:], offsets[1,:], offsets[2,:], c=metrics[index,:n_points], cmap='autumn', depthshade=False, s=10) plt.subplot(1,2,2) image = scipy.misc.imread(join('../../grasp-conv/data/eye-perspectives', image_files[index])) plt.imshow(image) plt.title(image_files[index]) plt.show() # print(neuron_points[:,:n_points]) def plot_predictions(): # with open('perspective-predictions-better.pkl') as f: with open('perspective-predictions-ray.pkl') as f: targets, predictions = cPickle.load(f) targets = targets.astype(float) plt.figure(figsize=(9,6)) for i in range(25): plt.subplot(5,5,i) plt.scatter(targets[:,i], predictions[:,i], s=1) cc = np.corrcoef(targets[:,i], predictions[:,i]) print(cc[0,1]) c = np.corrcoef(targets[:,i], predictions[:,i])[0,1] plt.gca().axes.xaxis.set_ticks([]) plt.gca().axes.yaxis.set_ticks([]) print(c) plt.tight_layout() plt.show() def plot_points_with_correlations(): with open('perspective-predictions-big-0.pkl') as f: targets, predictions = cPickle.load(f) n_points = targets.shape[1] r = [] for i in range(n_points): r.append(np.corrcoef(targets[:,i], predictions[:,i])[0,1]) with open('perspective-predictions-big-9.pkl') as f: # with open('perspective-predictions-ray.pkl') as f: targets, predictions = cPickle.load(f) # targets = targets.astype(float) r_better = [] for i in range(n_points): r_better.append(np.corrcoef(targets[:,i], predictions[:,i])[0,1]) with open('../data/neuron-points.pkl', 'rb') as f: neuron_points, neuron_angles = cPickle.load(f) # from mpl_toolkits.mplot3d import axes3d, Axes3D # fig = plt.figure() # ax = fig.add_subplot(1,1,1,projection='3d') # ax.scatter(neuron_points[0,:n_points], neuron_points[1,:n_points], neuron_points[2,:n_points], # c=r, cmap='autumn', depthshade=False, s=40) # plt.show() angles_from_vertical = [] for i in range(n_points): # hor = np.sqrt(neuron_points[0,i]**2 + neuron_points[1,i]**2) # ver = neuron_points[2,i] # angles_from_vertical.append(np.arctan(hor / ver)) norm = np.linalg.norm(neuron_points[:,i]) angles_from_vertical.append(np.arccos(neuron_points[2,i] / norm)) fig = plt.figure() plt.scatter(angles_from_vertical, r, s=30, facecolors='none', edgecolors='r') plt.scatter(angles_from_vertical, r_better, color='r', s=30) plt.xlim([0,np.pi]) plt.ylim([0,1]) plt.tick_params(axis='both', labelsize=18) plt.xlabel('angle between eye and hand (rad)', fontsize=18) plt.ylabel('target-prediction correlation', fontsize=18) plt.show() def katsuyama_depths(): K = [[-0.1500, -0.1500], [-0.1960, -0.0812], [-0.2121, 0], [-0.1960, 0.0812], [-0.1500, 0.1500], [-0.0812, 0.1960], [0.0000, 0.2121], [0.0812, 0.1960], [0.1500, 0.1500], [-0.2500, -0.2500], [-0.3266, -0.1353], [-0.3536, 0], [-0.3266, 0.1353], [-0.2500, 0.2500], [-0.1353, 0.3266], [0, 0.3536], [0.1353, 0.3266], [0.2500, 0.2500], [0, 0]] K = np.array(K) # Original numbers for x and y in cm, whereas we want m. This requires multiplying # by 10000, but such shapes are much sharper than objects, so we drop by 10x print(K) K = 1000. * K depths = [] for i in range(K.shape[0]): depths.append(katsuyama_depth(K[i,0], K[i,1])) return np.array(depths) def katsuyama_depth(K1, K2, c=.8, im_width=80, fov=30, near_clip=.6, far_clip=1): # note their display was about 36 degrees rads_per_pixel = (fov*np.pi/180.) / im_width hor_angles = np.arange(-im_width/2+.5, im_width/2+.5, 1) * rads_per_pixel ver_angles = hor_angles ta = np.tan(hor_angles)**2 tb = np.tan(ver_angles)**2 # solve quadratic equation ... b = -1 depth = np.zeros((len(ver_angles),len(hor_angles))) for i in range(len(ver_angles)): for j in range(len(hor_angles)): a = .5 * (K1*tb[i] + K2*ta[j]) if np.abs(a) < 1e-6: depth[i,j] = c elif b**2 - 4*a*c < 0: depth[i,j] = far_clip else: # we want the closer hit depth[i,j] = (-b - np.sqrt(b**2 - 4*a*c)) / (2*a) depth = np.minimum(far_clip, np.maximum(near_clip, depth)) return depth def get_truncated_model(structure_file, weights_file, n_layers): from keras.models import model_from_json from keras.optimizers import Adam from keras.models import Sequential model = model_from_json(open(structure_file).read()) model.load_weights(weights_file) print(str(len(model.layers)) + ' layers') truncated = Sequential() for i in range(n_layers): truncated.add(model.layers[i]) adam = Adam(lr=0.000001, beta_1=0.9, beta_2=0.999, epsilon=1e-08) truncated.compile(loss='mse', optimizer=adam) return truncated def save_katsutama_responses(structure_file, weights_file, n_layers): model = get_truncated_model(structure_file, weights_file, n_layers) x = katsuyama_depths()[:,np.newaxis,:,:] responses = model.predict_on_batch(x) print(responses.shape) with open('katsuyama-' + str(n_layers) + '.pkl', 'wb') as f: cPickle.dump(responses, f) def save_murata_respones(structure_file, weights_file, n_layers): from perspective_model import get_input model = get_truncated_model(structure_file, weights_file, n_layers) X = [] image_dir = '../../grasp-conv/data/eye-perspectives-murata/good' X.append(get_input(image_dir, 'Cube 10 X 10 X 10-0-0.png')) X.append(get_input(image_dir, 'Cylinder 45 X 5-0-0.png')) X.append(get_input(image_dir, 'Ring - 15-0-0.png')) X.append(get_input(image_dir, 'Sphere - 10-0-0.png')) X = np.array(X) X = X[:,np.newaxis,:,:] responses = model.predict_on_batch(X) with open('murata-' + str(n_layers) + '.pkl', 'wb') as f: cPickle.dump(responses, f) def plot_katsuyama_responses(n_layers): with open('../data/katsuyama-' + str(n_layers) + '.pkl') as f: data = cPickle.load(f) if len(data.shape) == 4: data = data[:,:,40,40] print(data.shape) data = data - data[18,:] #18 is the flat background data = data / np.max(np.abs(data), axis=0) # dead units will be nan, not plotted # plt.plot(np.max(data, axis=0)) # plt.imshow(data) # plt.hist(data) plt.plot(range(19), data) plt.show() def plot_murata_responses(n_layers): with open('murata-' + str(n_layers) + '.pkl') as f: data = cPickle.load(f) if len(data.shape) == 4: data = data[:,:,40,40] print(data.shape) # data = data - data[18,:] #18 is the flat background data = data / np.max(np.abs(data), axis=0) # dead units will be nan, not plotted # plt.plot(np.max(data, axis=0)) # plt.imshow(data) # plt.hist(data) plt.plot(data) plt.show() def sketch_perspectives(n_plot=100, offset_radius=0.): np.random.seed(1) sketch_points = np.array( [[0., 0., 0., 0., 0., 0.], [-.05, -.05, -.03, .03, .05, .05], [.05, .03, 0, 0, .03, .05]] ) with open('../../grasp-conv/data/relative/neuron-points.pkl', 'rb') as f: neuron_points, neuron_angles = cPickle.load(f) offsets = get_random_points(n_plot, offset_radius, surface=False) from mpl_toolkits.mplot3d import axes3d, Axes3D fig = plt.figure() ax = fig.add_subplot(1,1,1,projection='3d') for point, angle, offset in zip(neuron_points.T[:n_plot], neuron_angles.T[:n_plot], offsets.T): r = get_rotation_matrix(point, angle) r = np.eye(3) sp = np.dot(r, sketch_points) + point[:,np.newaxis] + offset[:,np.newaxis] ax.plot(sp[0], sp[1], sp[2], 'k') plt.axis('off') plt.savefig('perspective-sketch.pdf') plt.show() if __name__ == '__main__': # plot_correct_point_scatter() # plot_predictions() # plot_points_with_correlations() # depth = katsuyama_depth(200, -1.5, .8) # depths = katsuyama_depths() # for i in range(depths.shape[0]): # plt.imshow(depths[i,:,:]) # print(depths[i,0,:]) # plt.show() # layers = [2,4,6,9,12] # for l in layers: # print('running ' + str(l) + ' layers') # # save_katsutama_responses('p-model-architecture-big.json', 'p-model-weights-big-9.h5', l) # save_murata_respones('p-model-architecture-big.json', 'p-model-weights-big-9.h5', l) # plot_katsuyama_responses(12) plot_murata_responses(4) # sketch_perspectives(n_plot=300, offset_radius=.15) # sketch_perspectives(n_plot=1, offset_radius=.0)
{ "repo_name": "bptripp/grasp-convnet", "path": "py/perspective_analysis.py", "copies": "1", "size": "9936", "license": "mit", "hash": -8287427461598452000, "line_mean": 30.8461538462, "line_max": 100, "alpha_frac": 0.5932971014, "autogenerated": false, "ratio": 2.913782991202346, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.8967109348254264, "avg_score": 0.007994148869616347, "num_lines": 312 }
__author__ = 'bptripp' from os.path import join import matplotlib.pyplot as plt import cPickle import numpy as np import scipy from data import load_all_params # objects, gripper_pos, gripper_orient, labels = load_all_params('../../grasp-conv/data/output_data.csv') # f = file('../data/metrics-objects.pkl', 'rb') # oi, oq, of = cPickle.load(f) # intersections, qualities, files # f.close() # f = file('../data/metrics-support.pkl', 'rb') # si, sq, sf = cPickle.load(f) # f.close() def count_cases(correlates, labels): correlates = correlates.astype(int) cases = np.zeros((np.max(correlates)+1,2), dtype=int) for c, l in zip(correlates, labels): cases[c,l] += 1 return cases def get_collisions(oi, si): oi = np.array(oi) si = np.array(si) # collision if any si < oi and si is not None oi = np.where(oi == np.array(None), 900, oi) si = np.where(si == np.array(None), 1000, si) return np.sum(si < oi, axis=1) > 0 def check_objects_centred(): """ The hand is supposed to be aimed at a point on the object, so central pixel(s) should be on object, otherwise probably a bug (e.g. something wrong with how mesh imported into V-REP). """ image_dir = '../../grasp-conv/data/obj_depths/' im_width = 80 camera_offset=.45 near_clip=.25 far_clip=.8 from os import listdir from os.path import isfile, join from heuristic import finger_path_template import scipy finger_path = finger_path_template(45.*np.pi/180., im_width, camera_offset) bad = [] background_threshold = 254 for f in listdir(image_dir): image_filename = join(image_dir, f) if isfile(image_filename) and f.endswith('.png'): image = scipy.misc.imread(image_filename) if np.min(image[39:41,39:41]) >= background_threshold: bad.append(f) print(f) print(len(bad)) def regions_at_intersections(distance, intersections, axis=0, directions=[-1,-1,1], length=5, spans=[[32,38],[42,48],[37,43]]): """ :param distance: 2D distance map :param intersections: pixel coords of finger-surface intersections """ regions = [] for i in range(len(intersections)): direction = directions[i] span = spans[i] if axis==0: d = distance else: d = distance.T if direction < 0: d = d[::-1,:] if intersections[i] is None: region = np.zeros((length,span[1]-span[0])) else: region = d[intersections[i]:intersections[i]+length,span[0]:span[1]] regions.append(region) return regions #TODO: watch for outliers due to numerical sensitivity at sharp edges def surface_slope(distance_map, threshold): """ Fits a plane to given points, ignoring values greater than a threshold distance (meant to be the background). """ x = np.arange(0, distance_map.shape[1]) y = np.arange(0, distance_map.shape[0]) X, Y = np.meshgrid(x, y) features = np.vstack((X.ravel(), Y.ravel(), np.ones_like(Y).ravel())).T distances = distance_map.ravel() include = distances <= threshold if np.isnan(np.std(distances[include])): return [0,0,np.mean(distances[include])] else: x, residuals, rank, s = np.linalg.lstsq(features[include,:], distances[include]) return x def check_region_example(): camera_offset=.45 far_clip=.8 import scipy image = scipy.misc.imread('../../grasp-conv/data/obj_depths/1_Coffeecup_final-03-Mar-2016-18-50-40-1.png') rescaled_distance = image / 255.0 distance = rescaled_distance*(far_clip-camera_offset)+camera_offset intersections = [38,36,21] regions = regions_at_intersections(distance, intersections) print(np.array(regions)) for region in regions: print(surface_slope(region, far_clip-.005)) plt.imshow(distance) plt.show() #TODO: test def angle_from_vertical(gripper_orient): from depthmap import rot_matrix R = rot_matrix(gripper_orient[0], gripper_orient[1], gripper_orient[2]) camera_vector = np.dot(R, np.array([0,0,1])) return np.arccos(-camera_vector[2]) def object_area(distance, threshold): return(np.sum(distance < threshold) / float(distance.size)) def object_centre(distance, threshold): object = distance < threshold x = np.arange(0, distance.shape[1]) y = np.arange(0, distance.shape[0]) X, Y = np.meshgrid(x, y) return np.mean(X[object]), np.mean(Y[object]) def check_correlates(): data_file = '../../grasp-conv/data/output_data.csv' objects, gripper_pos, gripper_orient, labels, power_pinch = load_all_params(data_file, return_power_pinch=True) seq_nums = np.arange(len(objects)) % 1000 camera_offset=.45 far_clip=.8 threshold = far_clip - .005 for i in range(5): image_filename = join('../../grasp-conv/data/obj_depths', objects[i][:-4] + '-' + str(seq_nums[i]) + '.png') image = scipy.misc.imread(image_filename) rescaled_distance = image / 255.0 distance = rescaled_distance*(far_clip-camera_offset)+camera_offset print('angle: ' + str(angle_from_vertical(gripper_orient[i]))) print('area: ' + str(object_area(distance, threshold))) print('centre: ' + str(object_centre(distance, threshold))) plt.imshow(distance) plt.show() def get_correlates(): """ Create a CSV file with a bunch of measures that may be correlates of grasp success. """ from heuristic import finger_path_template, calculate_grip_metrics data_file = '../../grasp-conv/data/output_data.csv' objects, gripper_pos, gripper_orient, labels, power_pinch = load_all_params(data_file, return_power_pinch=True) seq_nums = np.arange(len(objects)) % 1000 labels = np.array(labels) power_pinch = np.array(power_pinch) camera_offset=.45 far_clip=.8 fov = 45.*np.pi/180. im_width=80 finger_path = finger_path_template(fov, im_width, camera_offset) background_threshold = far_clip - .005 result = [] for i in range(len(labels)): data = [labels[i], power_pinch[i]] image_filename = join('../../grasp-conv/data/obj_depths', objects[i][:-4] + '-' + str(seq_nums[i]) + '.png') distance_image = scipy.misc.imread(image_filename) rescaled_distance = distance_image / 255.0 distance = rescaled_distance*(far_clip-camera_offset)+camera_offset intersections, qualities = calculate_grip_metrics(distance, finger_path) regions = regions_at_intersections(distance, intersections) for region in regions: slope = surface_slope(region, background_threshold) data.extend(slope[:2]) image_filename = join('../../grasp-conv/data/obj_overlap', objects[i][:-4] + '-' + str(seq_nums[i]) + '-overlap.png') overlap_image = scipy.misc.imread(image_filename) regions = regions_at_intersections(overlap_image, intersections, length=3) for region in regions: data.append(np.sum(region > 0) / float(region.size)) data.append(angle_from_vertical(gripper_orient[i])) data.append(object_area(distance, background_threshold)) data.extend(object_centre(distance, background_threshold)) # intersections and quality metrics intersections = np.where(intersections == np.array(None), im_width, intersections).astype(float) data.extend(intersections) data.extend(qualities) # symmetry rel_int = intersections / (im_width/2.) data.append((rel_int[0]-rel_int[2])**2) data.append((rel_int[1]-rel_int[2])**2) # intersections with support box image_filename = join('../../grasp-conv/data/support_depths', objects[i][:-4] + '-' + str(seq_nums[i]) + '.png') distance_image = scipy.misc.imread(image_filename) rescaled_distance = distance_image / 255.0 distance = rescaled_distance*(far_clip-camera_offset)+camera_offset support_intersections, support_qualities = calculate_grip_metrics(distance, finger_path) support_intersections = np.where(support_intersections == np.array(None), im_width, support_intersections).astype(float) data.extend(support_intersections) result.append(data) # fig = plt.figure(figsize=(5,10)) # fig.add_subplot(2,1,1) # plt.hist(power_pinch[labels<.5], range=(0, .20), bins=100) # fig.add_subplot(2,1,2) # plt.hist(power_pinch[labels>.5], range=(0, .20), bins=100) # plt.show() return np.array(result) if __name__ == '__main__': # check_objects_centred() # save_correlates() # weights = surface_slope(np.random.rand(4,6)) # print(weights) # check_region_example() #TODO: slopes and fractions of regions within finger path # import scipy # from os.path import join # image_dir = '../../grasp-conv/data/obj_overlap/' # image_file = '1_Coffeecup_final-03-Mar-2016-18-50-40-1-overlap.png' # image = scipy.misc.imread(join(image_dir, image_file)) # # intersections = [38,36,21] # regions = regions_at_intersections(image, intersections, length=3) # regions = np.array(regions) # for region in regions: # print(region) # print(np.sum(region > 0) / float(region.size)) # # plt.imshow(image) # plt.show() # check_correlates() correlates = get_correlates() import csv with open('correlates.csv', 'wb') as csvfile: cw = csv.writer(csvfile, delimiter=',') for c in correlates: cw.writerow(c)
{ "repo_name": "bptripp/grasp-convnet", "path": "py/analysis.py", "copies": "1", "size": "9741", "license": "mit", "hash": -4711622697899618000, "line_mean": 31.6879194631, "line_max": 128, "alpha_frac": 0.6271430038, "autogenerated": false, "ratio": 3.318909710391823, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.44460527141918227, "avg_score": null, "num_lines": null }
__author__ = 'bptripp' from os.path import join import numpy as np import matplotlib matplotlib.rcParams['xtick.labelsize'] = 14 matplotlib.rcParams['ytick.labelsize'] = 14 import matplotlib.pyplot as plt from cnn_stimuli import get_image_file_list from alexnet import preprocess, load_net, load_vgg # load IT neuron data from Kovacs figure 8 ... kovacs = np.zeros((8,4)) NO = np.loadtxt(open('../data/NO.csv', 'rb'), delimiter=',') kovacs[:,0] = NO[:,1] MV20 = np.loadtxt(open('../data/MV20.csv', 'rb'), delimiter=',') kovacs[:,1] = MV20[:,1] MV50 = np.loadtxt(open('../data/MV50.csv', 'rb'), delimiter=',') kovacs[:,2] = MV50[:,1] MV90 = np.loadtxt(open('../data/MV90.csv', 'rb'), delimiter=',') kovacs[:,3] = MV90[:,1] def average_over_reps(responses, reps): n_occ = responses.shape[0]/reps averages = np.zeros((n_occ, responses.shape[1])) for i in range(n_occ): averages[i,:] = np.mean(responses[i*reps:(i+1)*reps,:], axis=0) return averages def plot(data, plot_colour): assert data.shape[1] == 4 plt.figure(figsize=(3.5,3.5)) # max = data[0,0] shape_index = range(1,data.shape[0]+1) plt.plot(shape_index, data[:,0], plot_colour+'d-', label='NO') plt.plot(shape_index, data[:,1], plot_colour+'o--', label='20%') plt.plot(shape_index, data[:,2], plot_colour+'^-.', label='50%') plt.plot(shape_index, data[:,3], plot_colour+'s:', label='90%') plt.legend(loc='upper right', shadow=False, frameon=False) plt.xlabel('Shape rank', fontsize=16) plt.ylabel('Mean Response', fontsize=16) plt.tight_layout() def get_mean_responses(use_vgg, remove_level): if use_vgg: model = load_vgg(weights_path='../weights/vgg16_weights.h5', remove_level=remove_level) else: model = load_net(weights_path='../weights/alexnet_weights.h5', remove_level=remove_level) reps = 10 out = [] shapes = ['circle', 'square', 'star', 'triangle', 'strange', 'h', 'arrow', 'stop'] for shape in shapes: image_files = get_image_file_list(join(base_directory, shape), 'png', with_path=True) im = preprocess(image_files, use_vgg=use_vgg) out.append(average_over_reps(model.predict(im), reps)) out = np.array(out) print(out.shape) unoccluded_responses = out[:,0,:] print(unoccluded_responses.shape) var = np.var(unoccluded_responses, axis=0) n = 500 ind = (-var).argsort()[:n] # ind = range(n) most_selective = out[:,:,ind] most_sorted = np.zeros_like(most_selective) for i in range(n): order = np.argsort(most_selective[:,0,i])[::-1] most_sorted[:,:,i] = most_selective[order,:,i] # out: shape, occlusion, neuron means = np.mean(most_sorted, axis=2) return means[:,:4]-means[:,4,None] use_vgg = True if use_vgg: plot_colour = 'g' else: plot_colour = 'b' # occlusion_type = 'black' # occlusion_type = 'red' occlusion_type = 'moving' base_directory = './images/occlusions-' + occlusion_type # # plot figure like Kovacs ... # remove_level = 1 # means = get_mean_responses(use_vgg, remove_level) # plot(means, plot_colour) # if use_vgg: # plt.savefig('../figures/occlusions-' + occlusion_type + '-vgg-' + str(remove_level) + '.eps') # else: # plt.savefig('../figures/occlusions-' + occlusion_type + '-alexnet-' + str(remove_level) + '.eps') # plt.show() # # replot Kovacs data ... # plot(kovacs, 'k') # plt.savefig('../figures/occlusions-kovacs.eps') # plt.show() # plot functions of occlusion level ... visibility = [100, 80, 50, 10] plt.figure(figsize=(3.5,3.5)) kovacs_relative = kovacs[0,:] - kovacs[-1,:] plt.plot(visibility, kovacs_relative/kovacs_relative[0], 'k', label='IT') remove_levels = [0, 1, 2] labels = ['last layer', '2nd last', '3rd last'] line_formats = ['-', '--', '-.'] for i in range(3): means = get_mean_responses(use_vgg, remove_levels[i]) relative = means[0,:] - means[-1,:] plt.plot(visibility, relative/relative[0], plot_colour+line_formats[i], label=labels[i]) plt.legend(loc='upper left', shadow=False, frameon=False) plt.xlabel('Percent Visible', fontsize=16) plt.ylabel('Mean Normalized Response', fontsize=16) plt.xticks([20, 40, 60, 80, 100]) plt.ylim([-.1, 1.1]) plt.tight_layout() network_name = 'vgg' if use_vgg else 'alexnet' plt.savefig('../figures/occlusions-sigmoid-' + occlusion_type + '-' + network_name + '.eps') plt.show()
{ "repo_name": "bptripp/it-cnn", "path": "tuning/occlusion.py", "copies": "1", "size": "4383", "license": "mit", "hash": 8586947636810286000, "line_mean": 32.4580152672, "line_max": 103, "alpha_frac": 0.6354095368, "autogenerated": false, "ratio": 2.851659076122316, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.3987068612922316, "avg_score": null, "num_lines": null }
__author__ = 'bptripp' import argparse import logging from os import listdir, rename from os.path import isfile, join, isdir, basename, split import cPickle as pickle import numpy as np import matplotlib.pyplot as plt import time from alexnet import preprocess, load_net from auction import auction """ TODO: - DONE load minibatch images - DONE run network to get existing tuning - DONE generate orientation tuning samples - DONE choose Bertsekas integer resolution - DONE dicard all but ~200 output units - DONE normalize and use Bertsekas to pair up with empirical model - DONE scale empirical responses and make labels - DONE generator - LATER optionally resample orientation tuning curves each minibatch to reduce sampling bias (although there are many samples) - LATER recharacterize all tuning - DONE load existing network & strip last layer - DONE code to generate and save minibatch list - DONE organize files better to reduce looping to find orientations """ def make_ideal_tuning_curves(angles, n): # from Salman's paper curves = np.zeros((len(angles), n)) prefs = 360.*np.random.rand(n) i = 0 widths = np.zeros(n) while i < n: width = 30. + 15. * np.random.randn() if width > 1: widths[i] = width i = i + 1 for i in range(n): da = angles - prefs[i] da[da > 180] = da[da > 180] - 360 da[da < -180] = da[da < -180] + 360 curves[:,i] = np.exp(-(da)**2 / 2 / widths[i]**2) # plt.plot(angles, curves) # plt.title('Empirical') # plt.ylim([0,1]) # plt.show() return curves def find_stimuli(image_path, extension): stimuli = set() for d in listdir(image_path): if isdir(join(image_path, d)): for f in listdir(join(image_path, d)): if isfile(join(image_path, d, f)) and f.endswith(extension): parts = f.split('-') stim_name = parts[0] + '-' + parts[1] stimuli.add(join(image_path, d, stim_name)) return list(stimuli) def get_images(stimulus, extension): return preprocess(get_image_paths(stimulus, extension)) def get_image_paths(stimulus, extension): directory, partial_name = split(stimulus) return [join(directory, f) for f in listdir(directory) if f.startswith(partial_name + '-') and f.endswith(extension)] def get_similarities(actual_curves, ideal_curves): actual_normalized = normalize_curves(actual_curves) ideal_normalized = normalize_curves(ideal_curves) return np.dot(actual_normalized.T, ideal_normalized) def normalize_curves(tuning_curves): #one tuning curve per column nm = np.linalg.norm(tuning_curves, axis=0, ord=2) + 1e-6 return tuning_curves / nm[None,:] def get_XY(model, stimulus, baseline_mean): images = get_images(stimulus, extension) actual_curves = model.predict(images) logging.info(stimulus) n = 200 ideal_curves = make_ideal_tuning_curves(angles, n) assignments = get_assignments(actual_curves[:,:n], ideal_curves) #similarities = get_similarities(actual_curves[:,:n], ideal_curves) #A = ((1+similarities)*50).astype(int) #assignments, prices = auction(A) logging.debug('ideal curves shape: ' + str(ideal_curves.shape)) #logging.debug('similarities shape: ' + str(similarities.shape)) logging.debug('assignments shape: ' + str(assignments.shape)) target_curves = get_targets(actual_curves, ideal_curves, assignments, baseline_mean) logging.debug('images shape: ' + str(images.shape)) logging.debug('target curves shape: ' + str(target_curves.shape)) return images, target_curves def get_cost(model, stimulus, baseline_mean): images = get_images(stimulus, extension) actual_curves = model.predict(images) n = 200 ideal_curves = make_ideal_tuning_curves(angles, n) assignments = get_assignments(actual_curves[:,:n], ideal_curves) target_curves = get_targets(actual_curves, ideal_curves, assignments, baseline_mean) return np.mean((actual_curves - target_curves)**2) def get_assignments(actual_curves, ideal_curves): similarities = get_similarities(actual_curves, ideal_curves) A = ((1+similarities)*50).astype(int) assignments, prices = auction(A) return assignments def get_targets(actual_curves, ideal_curves, assignments, baseline_mean): n = ideal_curves.shape[1] target_curves = actual_curves.copy() for i in range(n): target_curves[:,i] = ideal_curves[:,int(assignments[i])] scale_factor = np.abs(np.mean(actual_curves[:,i]) / np.mean(target_curves[:,i])) target_curves[:,i] = target_curves[:,i] * scale_factor if baseline_mean is not None: #maintain the mean so targets don't sneak down to zero target_mean = np.mean(target_curves[:,:n]) if target_mean > 0: target_curves[:,:n] = target_curves[:,:n] * baseline_mean / target_mean return target_curves def fix_file_names(image_path): for file_name in listdir(image_path): if isdir(join(image_path, file_name)): new_name = file_name.replace('-', '_') if not new_name == file_name: print('renaming ' + join(image_path, file_name) + ' to ' + join(image_path, new_name)) rename(join(image_path, file_name), join(image_path, new_name)) for image_file_name in listdir(join(image_path, new_name)): image_new_name = image_file_name.replace(file_name, new_name) print('renaming ' + join(image_path, new_name, image_file_name) + ' to ' + join(image_path, new_name, image_new_name)) rename(join(image_path, new_name, image_file_name), join(image_path, new_name, image_new_name)) if __name__ == '__main__': logging.basicConfig(filename='orientation.log', level=logging.DEBUG) parser = argparse.ArgumentParser() parser.add_argument('train_image_path', help='path to stimulus images for training') parser.add_argument('valid_image_path', help='path to stimulus images for validation') train_image_path = parser.parse_args().train_image_path valid_image_path = parser.parse_args().valid_image_path fix_file_names(valid_image_path) fix_file_names(train_image_path) extension = '.png' train_stimuli = find_stimuli(train_image_path, extension) valid_stimuli = find_stimuli(valid_image_path, extension) print(len(listdir(train_image_path))) print(len(listdir(valid_image_path))) print('Processing ' + str(len(train_stimuli)) + ' training inputs from ' + train_image_path) print('Processing ' + str(len(valid_stimuli)) + ' validation inputs from ' + valid_image_path) # for fn in listdir(train_image_path): # if isdir(join(train_image_path, fn)): # l = len(listdir(join(train_image_path, fn))) # print(str(l) + ' in ' + fn) angles = range(0, 361, 10) model = load_net() # plt.figure(figsize=(8,8)) # # for i in range(8): # for j in range(8): # ind = 8*i+j # plt.subplot(8,8,ind+1) # plt.plot(actual_curves[:,ind]) # # plt.plot(ideal_curves[:,assignments[ind]]) # plt.plot(target_curves[:,ind]) # # plt.show() # find baseline mean rate with some random stimuli baseline_means = [] baseline_inds = np.random.randint(len(valid_stimuli), size=10) for ind in baseline_inds: print('baseline from ' + valid_stimuli[ind]) images = get_images(valid_stimuli[ind], extension) baseline_means.append(np.mean(model.predict(images))) baseline_mean = np.mean(baseline_means) def generate_training(): while 1: ind = np.random.randint(0, len(train_stimuli)) X, Y = get_XY(model, train_stimuli[ind], baseline_mean) yield X, Y def generate_validation(): while 1: ind = np.random.randint(0, len(valid_stimuli)) X, Y = get_XY(model, valid_stimuli[ind], None) yield X, Y val_cost = [] for i in range(50): h = model.fit_generator(generate_training(), samples_per_epoch=len(train_stimuli)*len(angles), nb_epoch=1) #validation_data=generate_validation(), nb_val_samples=len(valid_stimuli)*len(angles)) val_cost_i = [] for vs in valid_stimuli: val_cost_i.append(get_cost(model, vs, baseline_mean)) val_cost.append(np.mean(val_cost_i)) print('validation cost: ' + str(np.mean(val_cost_i))) with open('orientation_history.pkl', 'wb') as f: pickle.dump(val_cost, f) model.save_weights('orientation_weights' + str(i) + '.h5', overwrite=True) #f = open('orientation_history.pkl', 'wb') #pickle.dump(h.history, f) #f.close()
{ "repo_name": "bptripp/it-cnn", "path": "orientation.py", "copies": "1", "size": "8926", "license": "mit", "hash": -6839530519317261000, "line_mean": 34.2806324111, "line_max": 126, "alpha_frac": 0.6342146538, "autogenerated": false, "ratio": 3.452998065764023, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.9549400756721746, "avg_score": 0.00756239256845513, "num_lines": 253 }
__author__ = 'bptripp' import argparse import numpy as np import cPickle as pickle import matplotlib.pyplot as plt from alexnet import preprocess, load_net from orientation import find_stimuli, get_images parser = argparse.ArgumentParser() parser.add_argument('action', help='either save (evaluate and save tuning curves) or plot (plot examples)') parser.add_argument('valid_image_path', help='path to stimulus images for validation') valid_image_path = parser.parse_args().valid_image_path action = parser.parse_args().action curves_file = 'orientation_curves.pkl' n = 200 if action == 'save': model = load_net() model.load_weights('orientation_weights.h5') extension = '.png' valid_stimuli = find_stimuli(valid_image_path, extension) curves = [] for stimulus in valid_stimuli: print(stimulus) images = get_images(stimulus, extension) curves.append(model.predict(images)[:,:n]) curves = np.array(curves, dtype=np.float16) print(curves.shape) f = open(curves_file, 'wb') pickle.dump((valid_stimuli, curves), f) f.close() if action == 'plot': f = open(curves_file, 'rb') valid_stimuli, curves = pickle.load(f) f.close() plt.figure(figsize=(12,12)) for i in range(8): for j in range(8): ind = 8*i+j plt.subplot(8,8,ind+1) plt.plot(curves[0,:,ind]) plt.show()
{ "repo_name": "bptripp/it-cnn", "path": "orientation_analysis.py", "copies": "1", "size": "1404", "license": "mit", "hash": -7949491637300808000, "line_mean": 26.5294117647, "line_max": 107, "alpha_frac": 0.6602564103, "autogenerated": false, "ratio": 3.334916864608076, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.44951732749080764, "avg_score": null, "num_lines": null }
__author__ = 'bptripp' import cPickle as pickle from scipy.optimize import curve_fit import numpy as np import matplotlib matplotlib.rcParams['xtick.labelsize'] = 16 matplotlib.rcParams['ytick.labelsize'] = 16 import matplotlib.pyplot as plt from cnn_stimuli import get_image_file_list from alexnet import preprocess, load_net, load_vgg from orientation import smooth offsets = np.linspace(-75, 75, 150/5+1, dtype=int) def get_centre_of_mass(y): """ Centre of mass of a tuning function as in Op De Beeck et al. (2000), including only points >50% of peak. """ ind = y > .5*np.max(y) masked = np.zeros(y.shape) masked[ind] = y[ind] return np.sum(offsets*masked) / np.sum(masked) def get_width(y): """ Width of a tuning function as in Op De Beeck et al. (2000); distance between where it falls to 50% of peak on each side. """ max_ind = np.argmax(y) below_threshold = y < .5*np.max(y) # print(below_threshold) # low_and_left = np.logical_and(range(len(y)) < max_ind, below_threshold) # low_and_right = np.logical_and(range(len(y)) > max_ind, below_threshold) # # if max(low_and_left): # low_ind = np.max(np.where(low_and_left)) # else: # low_ind = 0 # # if max(low_and_right): # high_ind = np.min(np.where(low_and_right)) # else: # high_ind = len(y)-1 for i in range(max_ind, -1, -1): if below_threshold[i]: break if i == 0: low_ind = i else: low_ind = i + 1 for i in range(max_ind, len(y)): if below_threshold[i]: break if i == len(y) - 1: high_ind = i else: high_ind = i - 1 # print(y) # print('threshold: ' + str(.5*np.max(y))) # print(max_ind) # print(low_ind) # print(high_ind) # print('*******') # return offsets[high_ind] - offsets[low_ind] if False: # plot selectivity vs. position tolerance model = load_net() image_files = get_image_file_list('./images/positions/banana', 'png', with_path=True) im = preprocess(image_files) out = model.predict(im) with open('activity-fraction.pkl', 'rb') as file: (ind, selectivity) = pickle.load(file) # n = 674 n = len(ind) print(n) object_responses = out[:,ind] plt.plot(offsets, object_responses) plt.show() # maxima = np.max(out, axis=0) # ind = (-maxima).argsort()[:n] # smoothed = smooth(object_responses, ind) def get_sd(x, y): x = np.array(x, dtype=float) mean = sum(x*y)/n sigma = (sum(y*(x-mean)**2)/n)**.5 return sigma widths = np.zeros(n) good_selectivity = [] good_widths = [] for i in range(n): widths[i] = get_sd(offsets, object_responses[:,i]) if np.mean(object_responses[:,i]) > .001: good_selectivity.append(selectivity[i]) good_widths.append(widths[i]) # if widths[i] < 1: # print(object_responses[:,i]) with open('selectivity-vs-pos-tolerance.pkl', 'wb') as file: pickle.dump((good_selectivity, good_widths), file) print(np.corrcoef(good_selectivity, good_widths)) plt.scatter(good_selectivity, good_widths) plt.show() if True: # alexnet 0: mean width: 146.208333333 std centres: 3.49089969478 # alexnet 1: mean width: 138.875 std centres: 5.96841285709 # alexnet 2: mean width: 112.583333333 std centres: 23.4025005388 # vgg 0: mean width: 150.0 std centres: 1.12932654355 # vgg 1: mean width: 150.0 std centres: 1.422815326 # vgg 2: mean width: 141.916666667 std centres: 11.2126510706 data = np.loadtxt(open("../data/op-de-beeck-6.csv","rb"),delimiter=",") x = data[:,0] it_std_rf_centre = np.std(x) it_mean_rf_size = 10.3 # from Op De Beeck # # strongest 30 responses ... # alexnet_std_rf_centre = np.array([23.4025005388, 5.96841285709, 3.49089969478]) # alexnet_mean_rf_size = np.array([112.583333333, 138.875, 146.208333333]) # vgg_std_rf_centre = np.array([11.2126510706, 1.422815326, 1.12932654355]) # vgg_mean_rf_size = np.array([141.916666667, 150.0, 150.0]) # first 30 strong responses ... alexnet_std_rf_centre = np.array([30.2666393886, 14.4771892017, 5.46262378919]) alexnet_mean_rf_size = np.array([62.5833333333, 108.625, 140.333333333]) vgg_std_rf_centre = np.array([22.2973512678, 3.0048651618, 2.26856624582]) vgg_mean_rf_size = np.array([97.5, 147.916666667, 149.625]) layers = [-2, -1, 0] plt.figure(figsize=(5,3.5)) plt.plot(layers, alexnet_std_rf_centre / alexnet_mean_rf_size, 'o-') plt.plot(layers, vgg_std_rf_centre / vgg_mean_rf_size, 's-') plt.plot(layers, it_std_rf_centre/it_mean_rf_size*np.array([1, 1, 1]), 'k--') plt.xlabel('Distance from output (layers)', fontsize=16) plt.ylabel('STD of centers / mean width', fontsize=16) plt.xticks([-2,-1,0]) plt.tight_layout() plt.savefig('../figures/position-variability.eps') plt.show() if False: # plot tuning curve examples remove_level = 0 # model = load_net(weights_path='../weights/alexnet_weights.h5', remove_level=remove_level) # use_vgg = False model = load_vgg(weights_path='../weights/vgg16_weights.h5', remove_level=remove_level) use_vgg = True out = [] image_files = get_image_file_list('./images/positions/staple', 'png', with_path=True) im = preprocess(image_files, use_vgg=use_vgg) out.append(model.predict(im)) image_files = get_image_file_list('./images/positions/shoe', 'png', with_path=True) im = preprocess(image_files, use_vgg=use_vgg) out.append(model.predict(im)) image_files = get_image_file_list('./images/positions/corolla', 'png', with_path=True) im = preprocess(image_files, use_vgg=use_vgg) out.append(model.predict(im)) image_files = get_image_file_list('./images/positions/banana', 'png', with_path=True) im = preprocess(image_files, use_vgg=use_vgg) out.append(model.predict(im)) out = np.array(out) # print(out.shape) # plot example tuning curves n = 30 labels = ('staple', 'shoe', 'car', 'banana') plt.figure(figsize=(6,6)) centres = [] widths = [] for i in range(4): object_responses = np.squeeze(out[i,:,:]) # print(object_responses.shape) maxima = np.max(object_responses, axis=0) # ind = (-maxima).argsort()[:n] print('using first large n') ind = [] j = 0 while len(ind) < n: if maxima[j] > 2: ind.append(j) j = j + 1 smoothed = smooth(object_responses, ind) for j in range(smoothed.shape[1]): centres.append(get_centre_of_mass(smoothed[:,j])) widths.append(get_width(smoothed[:,j])) # plt.plot(offsets, object_responses[:,ind]) plt.subplot(2,2,i+1) if i >= 2: plt.xlabel('Offset (pixels)', fontsize=16) if i == 0 | i == 3: plt.ylabel('Response', fontsize=16) plt.title(labels[i], fontsize=16) plt.plot(offsets, smoothed) plt.xticks([-75,-25,25,75]) plt.tight_layout() print(centres) print(widths) print('mean width: ' + str(np.mean(widths)) + ' std centres: ' + str(np.std(centres))) net = 'vgg16' if use_vgg else 'alexnet' plt.savefig('../figures/position-tuning-' + net + '-' + str(remove_level) + '.eps') plt.show() def correlations(out): cc = np.corrcoef(out.T) result = [] for i in range(cc.shape[0]): for j in range(i+1,cc.shape[1]): result.append(cc[i][j]) return result def invariant(out): return np.mean(correlations(out)) > .5 def clear_preference(out): # one size is clearly preferred in that it elicits a stronger response for each shape max_ind = np.argmax(out, axis=1) votes = np.zeros((5)) for m in max_ind: votes[m] = votes[m] + 1 return np.max(votes) >= 5 # return np.max(np.abs(np.diff(max_ind))) == 0 if False: # plot Schwartz et al. (1983) example U = np.loadtxt(open('../data/U.csv', 'rb'), delimiter=',') L = np.loadtxt(open('../data/L.csv', 'rb'), delimiter=',') C = np.loadtxt(open('../data/C.csv', 'rb'), delimiter=',') I = np.loadtxt(open('../data/I.csv', 'rb'), delimiter=',') F = np.loadtxt(open('../data/F.csv', 'rb'), delimiter=',') o = np.zeros((6,5)) o[:,0] = U[:,1] o[:,1] = L[:,1] o[:,2] = C[:,1] o[:,3] = I[:,1] o[:,4] = F[:,1] plt.figure(figsize=(4,3.5)) plt.plot(range(1,7), o) plt.tight_layout() plt.xlabel('Stimulus #', fontsize=18) plt.ylabel('Response (spikes/s)', fontsize=18) plt.tight_layout() plt.savefig('../figures/position-schwartz-example.eps') plt.show() print('Schwartz correlation ' + str(np.mean(correlations(o)))) if False: # plot mean correlations and fraction with clear preference layers = [-2, -1, 0] plt.figure(figsize=(4,3.5)) alexnet_correlations = [0.350468586188, 0.603050738337, 0.813774571373] vgg_correlations = [0.578857429221, 0.8000155323, 0.928289856194] schwartz_correlation = 0.791299618127 plt.plot(layers, alexnet_correlations) plt.plot(layers, vgg_correlations) plt.plot(layers, schwartz_correlation*np.array([1, 1, 1]), 'k--') plt.xlabel('Distance from output (layers)', fontsize=16) plt.ylabel('Mean correlation', fontsize=16) plt.xticks([-2,-1,0]) plt.ylim([0, 1]) plt.tight_layout() plt.savefig('../figures/position-correlations.eps') plt.show() plt.figure(figsize=(4,3.5)) alexnet_fractions = [0.21875, 0.125, 0.046875] vgg_fractions = [0.078125, 0.109375, 0.0] plt.plot(layers, alexnet_fractions) plt.plot(layers, vgg_fractions) plt.xlabel('Distance from output (layers)', fontsize=16) plt.ylabel('Fraction with preference', fontsize=16) plt.xticks([-2,-1,0]) plt.ylim([0, 1]) plt.tight_layout() plt.savefig('../figures/position-preferences.eps') plt.show() if False: use_vgg = True remove_level = 0 if use_vgg: model = load_vgg(weights_path='../weights/vgg16_weights.h5', remove_level=remove_level) else: model = load_net(weights_path='../weights/alexnet_weights.h5', remove_level=remove_level) out = [] stimuli = ['f1', 'f2', 'f3', 'f4', 'f5', 'f6'] for stimulus in stimuli: image_files = get_image_file_list('./images/positions/'+stimulus, 'png', with_path=True) im = preprocess(image_files, use_vgg=use_vgg) out.append(model.predict(im)) out = np.array(out) print(out.shape) # plot invariance with Schwartz stimuli i = 0 c = 0 n_invariant = 0 n_clear = 0 mean_correlations = [] while c < 64: plt.subplot(8,8,c+1) o = out[:,:,i] if np.max(o) > 1: plt.plot(o) yl = plt.gca().get_ylim() if invariant(o): n_invariant = n_invariant + 1 plt.text(4.3, yl[0] + (yl[1]-yl[0])*.8, 'c', fontsize=14) if clear_preference(o): n_clear = n_clear + 1 plt.text(.1, yl[0] + (yl[1]-yl[0])*.8, 'p', fontsize=14) mean_correlations.append(np.mean(correlations(o))) plt.xticks([]) plt.yticks([]) c = c + 1 i = i + 1 print(mean_correlations) print('fraction with preference ' + str(float(n_clear)/64.)) print('mean correlation ' + str(np.nanmean(mean_correlations))) plt.tight_layout() network_name = 'vgg' if use_vgg else 'alexnet' plt.savefig('../figures/position-invariance-schwartz-' + network_name + '-' + str(remove_level) + '.eps') plt.show()
{ "repo_name": "bptripp/it-cnn", "path": "tuning/position.py", "copies": "1", "size": "11797", "license": "mit", "hash": -8436449798592760000, "line_mean": 30.1266490765, "line_max": 109, "alpha_frac": 0.5937950326, "autogenerated": false, "ratio": 2.9745335350479074, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.40683285676479075, "avg_score": null, "num_lines": null }
__author__ = 'bptripp' import cPickle import csv import numpy as np import matplotlib.pyplot as plt from mpl_toolkits.mplot3d import axes3d, Axes3D from data import get_prob_label, get_points from depthmap import rot_matrix, loadOBJ def export_overlap_results(): with open('o-predict.pkl', 'rb') as f: outputs, targets = cPickle.load(f) print(outputs.shape) print(targets.shape) with open('o-predict.csv', 'wb') as f: writer = csv.writer(f, delimiter=',') for output, target in zip(outputs, targets): writer.writerow([output[0], target[0]]) def plot_success_prob(): shape = '24_bowl-02-Mar-2016-07-03-29' param_filename = '../data/params/' + shape + '.csv' points, labels = get_points(param_filename) # z = np.linspace(-4 * np.pi, 4 * np.pi, 300) # x = np.cos(z) # y = np.sin(z) # z = [1, 2] # x = [1, 2] # y = [1, 2] # # fig = plt.figure() # ax = fig.gca(projection='3d') # ax.plot(x, y, z, # color = 'Blue', # colour of the curve # linewidth = 3, # thickness of the line # ) fig = plt.figure() ax = Axes3D(fig) red = np.array([1.0,0.0,0.0]) green = np.array([0.0,1.0,0.0]) obj_filename = '../data/obj_files/' + shape + '.obj' verts, faces = loadOBJ(obj_filename) verts = np.array(verts) minz = np.min(verts, axis=0)[2] verts[:,2] = verts[:,2] + 0.2 - minz show_flags = np.random.rand(verts.shape[0]) < .25 ax.scatter(verts[show_flags,0], verts[show_flags,1], verts[show_flags,2], c='b') for i in range(1000): point = points[i] prob, confidence = get_prob_label(points, labels, point, sigma_p=1.5*.001, sigma_a=1.5*(4*np.pi/180)) goodness = prob * np.minimum(1, .5 + .15*confidence) rm = rot_matrix(point[3], point[4], point[5]) pos = point[:3] front = pos + np.dot(rm,[0,0,.15]) left = pos - np.dot(rm,[0.0,0.005,0]) right = pos + np.dot(rm,[0.0,0.01,0]) # if goodness > .85: if prob > .9: ax.plot([pos[0],front[0]], [pos[1],front[1]], [pos[2],front[2]], color=(prob*green + (1-prob)*red), linewidth=confidence) ax.plot([left[0],right[0]], [left[1],right[1]], [left[2],right[2]], color=(prob*green + (1-prob)*red), linewidth=confidence) plt.show() if __name__ == '__main__': # plot_success_prob() export_overlap_results()
{ "repo_name": "bptripp/grasp-convnet", "path": "py/plots.py", "copies": "1", "size": "2538", "license": "mit", "hash": -2312333928488435700, "line_mean": 30.725, "line_max": 109, "alpha_frac": 0.5413711584, "autogenerated": false, "ratio": 2.9205983889528193, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.8926573113653251, "avg_score": 0.007079286739913615, "num_lines": 80 }
__author__ = 'bptripp' import csv import time import numpy as np import matplotlib.pyplot as plt from cnn_stimuli import get_image_file_list from alexnet import preprocess, load_net, load_vgg from scipy.signal import fftconvolve def mean_corr(out): cc = np.corrcoef(out.T) n = cc.shape[0] print('n: ' + str(n)) print(out.shape) cc_list = [] for i in range(n): for j in range(i+1,n): cc_list.append(cc[i,j]) print(cc_list) mean_cc = np.mean(cc_list) print('mean corr: ' + str(mean_cc)) def smooth(out, ind, n=5): l = out.shape[0] wrapped = np.zeros((out.shape[0]*3, len(ind))) wrapped[0:l,:] = out[:,ind] wrapped[l:2*l,:] = out[:,ind] wrapped[2*l:3*l,:] = out[:,ind] filter = 1./n*np.ones(n) # print('filter: ' + str(filter)) for i in range(wrapped.shape[1]): wrapped[:,i] = fftconvolve(wrapped[:,i], filter, 'same') return wrapped[l:2*l,:] def plot_curves(out, n, kernel_len=5, angles=None, normalize=False): print('plotting') if angles is None: angles = np.linspace(0, 360, 91) maxima = np.max(out, axis=0) # n = 10 # ind = (-maxima).argsort()[:n] # print('using first n') # ind = range(n) print('using first large n') ind = [] i = 0 while len(ind) < n: if maxima[i] > 2: ind.append(i) i = i + 1 print(ind) smoothed = smooth(out, ind, n=kernel_len) # if smooth: # smoothed = smooth(out, ind) # else: # smoothed = out[:,ind] mean_corr(smoothed) # print(len(angles)) # print(smoothed.shape) if normalize: smoothed = smoothed / np.max(smoothed, axis=0) plt.plot(angles, smoothed) plt.xlim([np.min(angles), np.max(angles)]) def freiwald_depths(out): """ From Freiwald & Tsao (2010) Science, supplementary material, page 6 ... Head orientation tuning depth was computed using the mean response to frontal faces (Rfrontal), and the mean response to full profile faces in the preferred direction (Rprofile) as follows: Tuning Depth = (Rfrontal - Rprofile) / (Rfrontal + Rprofile) """ assert(out.shape[0] == 25) frontal = np.maximum(0, out[0,:]) profile = np.maximum(0, np.maximum(out[6,:], out[19,:])) m = np.max(out, axis=0) frontal = frontal[m >= 1] profile = profile[m >= 1] return (frontal - profile) / (frontal + profile + 1e-3) def plot_freiwald_histograms(): fractions = [] fractions.append(np.loadtxt(open("../data/freiwald-4h-am.csv","rb"),delimiter=",")) fractions.append(np.loadtxt(open("../data/freiwald-4h-al.csv","rb"),delimiter=",")) fractions.append(np.loadtxt(open("../data/freiwald-4h-mlmf.csv","rb"),delimiter=",")) plt.figure(figsize=(3,2*3)) for i in range(3): plt.subplot(3,1,i+1) f = fractions[i] hist_edges = np.linspace(-1, 1, len(f)+1) # hist_edges = hist_edges[:-1] print(f.shape) print(hist_edges.shape) plt.bar(hist_edges[:-1]+.02, f, width=hist_edges[1]-hist_edges[0]-.04, color=[.5,.5,.5]) plt.xlim([-1, 1]) plt.ylim([0, .55]) plt.ylabel('Fraction of cells') plt.xlabel('Head orientation tuning depth') plt.tight_layout() plt.savefig('../figures/orientation-freiwald.eps') plt.show() def plot_logothetis_and_freiwald_tuning_data(): plt.figure(figsize=(9,2.5)) plt.subplot(1,3,1) plot_csv_tuning_curve('../data/logothetis-a.csv') plot_csv_tuning_curve('../data/logothetis-b.csv') plot_csv_tuning_curve('../data/logothetis-c.csv') plot_csv_tuning_curve('../data/logothetis-d.csv') plot_csv_tuning_curve('../data/logothetis-e.csv') plt.ylabel('Response') plt.xlabel('Angle (degrees)') plt.xlim([-180, 180]) plt.xticks([-180, -60, 60, 180]) plt.subplot(1,3,3) plot_csv_tuning_curve('../data/freiwald-1.csv') plot_csv_tuning_curve('../data/freiwald-2.csv') plot_csv_tuning_curve('../data/freiwald-3.csv') plot_csv_tuning_curve('../data/freiwald-4.csv') plt.xlabel('Angle (degrees)') plt.xlim([-180, 180]) plt.xticks([-180, -60, 60, 180]) plt.tight_layout() plt.savefig('../figures/tuning-data.eps') plt.show() def plot_csv_tuning_curve(filename): data = np.loadtxt(open(filename, 'rb'), delimiter=',') ind = np.argsort(data[:,0]) plt.plot(data[ind,0], data[ind,1]) if __name__ == '__main__': # model = load_vgg(weights_path='../weights/vgg16_weights.h5', remove_level=2) # use_vgg = True # model = load_net(weights_path='../weights/alexnet_weights.h5', remove_level=1) # use_vgg = False # # plt.figure(figsize=(6,6)) # # image_files = get_image_file_list('./images/swiss-knife-rotations/', 'png', with_path=True) # image_files = get_image_file_list('./images/staple-rotations/', 'png', with_path=True) # im = preprocess(image_files, use_vgg=use_vgg) # out = model.predict(im) # # plt.subplot(2,2,1) # plt.subplot2grid((5,2), (0,0), rowspan=2) # plot_curves(out, 10) # # plt.ylim([0,12]) # plt.ylabel('Response') # image_files = get_image_file_list('./images/shoe-rotations/', 'png', with_path=True) # im = preprocess(image_files, use_vgg=use_vgg) # out = model.predict(im) # # plt.subplot(2,2,2) # plt.subplot2grid((5,2), (0,1), rowspan=2) # plot_curves(out, 10) # # plt.ylim([0,12]) # image_files = get_image_file_list('./images/corolla-rotations/', 'png', with_path=True) # im = preprocess(image_files, use_vgg=use_vgg) # out = model.predict(im) # # plt.subplot(2,2,3) # plt.subplot2grid((5,2), (3,0), rowspan=2) # plot_curves(out, 10) # # plt.ylim([0,12]) # plt.xlabel('Angle (degrees)') # plt.ylabel('Response') # image_files = get_image_file_list('./images/banana-rotations/', 'png', with_path=True) # im = preprocess(image_files, use_vgg=use_vgg) # out = model.predict(im) # # plt.subplot(2,2,4) # plt.subplot2grid((5,2), (3,1), rowspan=2) # plot_curves(out, 10) # # plt.ylim([0,12]) # plt.xlabel('Angle (degrees)') # plt.tight_layout() # plt.savefig('../figures/orientation.eps') # plt.show() plot_freiwald_histograms() # # plot_logothetis_and_freiwald_tuning_data() # remove_levels = [0,1,2] # use_vgg = False # # # remove_levels = [0,1,2] # # use_vgg = False # # plt.figure(figsize=(9,2*len(remove_levels))) # # hist_edges = np.linspace(-1, 1, 10) # freiwalds = [] # # for i in range(len(remove_levels)): # if use_vgg: # model = load_vgg(weights_path='../weights/vgg16_weights.h5', remove_level=remove_levels[i]) # else: # model = load_net(weights_path='../weights/alexnet_weights.h5', remove_level=remove_levels[i]) # # plt.subplot(len(remove_levels),3,(3*i)+1) # image_files = get_image_file_list('./source-images/staple/', 'jpg', with_path=True) # im = preprocess(image_files, use_vgg=use_vgg) # out = model.predict(im) # # angles = np.array(range(0,361,10)) # wrap_indices = range(18, 36) + range(19) # plot_curves(out[wrap_indices,:], 10, kernel_len=3, angles=range(-180,181,10)) # plt.xticks([-180, -60, 60, 180]) # plt.ylabel('Response') # # plt.title('Staple') # if i == len(remove_levels)-1: # plt.xlabel('Angle (degrees)') # # # plt.subplot(len(remove_levels),3,(3*i)+2) # image_files = get_image_file_list('./source-images/scooter/', 'jpg', with_path=True) # im = preprocess(image_files, use_vgg=use_vgg) # out = model.predict(im) # wrap_indices = range(12,24) + range(13) # plot_curves(out[wrap_indices,:], 10, kernel_len=3, angles=range(-180,181,15)) # plt.xticks([-180, -60, 60, 180]) # # plt.title('Scooter') # if i == len(remove_levels)-1: # plt.xlabel('Angle (degrees)') # # plt.subplot(len(remove_levels),3,(3*i)+3) # image_files = get_image_file_list('./source-images/head/', 'jpg', with_path=True) # im = preprocess(image_files, use_vgg=use_vgg) # out = model.predict(im) # wrap_indices = range(12,24) + range(13) # plot_curves(out[wrap_indices,:], 10, kernel_len=3, angles=range(-180,181,15)) # plt.xticks([-180, -60, 60, 180]) # # plt.title('Head') # if i == len(remove_levels)-1: # plt.xlabel('Angle (degrees)') # # fd = freiwald_depths(out) # h, e = np.histogram(fd, hist_edges) # h = h.astype(float) # h = h / np.sum(h) # freiwalds.append(h) # # plt.tight_layout() # plt.savefig('../figures/orientation3d.eps') # plt.show() # # plt.figure(figsize=(3,2*len(remove_levels))) # for i in range(len(remove_levels)): # plt.subplot(len(remove_levels),1,i+1) # plt.bar(hist_edges[:-1]+.02, freiwalds[i], width=.2-.04, color=[.5,.5,.5]) # plt.xlim([-1, 1]) # plt.ylim([0, .55]) # plt.ylabel('Fraction of units') # # plt.xlabel('Head orientation tuning depth') # plt.tight_layout() # plt.savefig('../figures/orientation-freiwald-net.eps') # plt.show() # plt.figure(figsize=(7,3)) # n = 15 # kernel_len = 3 # angles = range(0,361,10) # image_files = get_image_file_list('./source-images/staple/', 'jpg', with_path=True) # im = preprocess(image_files) # out = model.predict(im) # plt.subplot(1,2,1) # plot_curves(out, n, kernel_len=kernel_len, angles=angles, normalize=True) # plt.ylabel('Response') # plt.ylim([0,1]) # plt.title('CNN') # # fake = np.zeros((out.shape[0], n)) # np.random.seed(1) # prefs = 360.*np.random.rand(n) # i = 0 # widths = np.zeros(n) # while i < n: # width = 30. + 15. * np.random.randn() # if width > 1: # widths[i] = width # i = i + 1 # print(widths) # # for i in range(n): # fake[:,i] = np.exp(-(angles-prefs[i])**2 / 2 / widths[i]**2) # # # plt.subplot(1,2,2) # plot_curves(fake, n, kernel_len=kernel_len, angles=angles, normalize=True) # plt.title('Empirical') # plt.ylim([0,1]) # # plt.tight_layout() # plt.savefig('../figures/orientation-salman.eps') # plt.show()
{ "repo_name": "bptripp/it-cnn", "path": "tuning/orientation.py", "copies": "1", "size": "10458", "license": "mit", "hash": -499343919266384960, "line_mean": 31.3777089783, "line_max": 107, "alpha_frac": 0.5720022949, "autogenerated": false, "ratio": 2.853478854024557, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.8906378837938125, "avg_score": 0.0038204621972864256, "num_lines": 323 }
__author__ = 'bptripp' import numpy as np from os.path import join import scipy import cPickle from keras.optimizers import Adam from data import load_all_params from keras.models import model_from_json def get_input(object, seq_num): image_file = object[:-4] + '-' + str(seq_num) + '-overlap.png' X = [] image_dir = '../../grasp-conv/data/obj_overlap/' image = scipy.misc.imread(join(image_dir, image_file)) X.append(image[:,32:48] / 255.0) image_dir = '../../grasp-conv/data/support_overlap/' image = scipy.misc.imread(join(image_dir, image_file)) X.append(image[:,32:48] / 255.0) return np.array(X) f = open('o-valid-ind.pkl') validation_indices = cPickle.load(f) f.close() model = model_from_json(open('o-model-architecture.json').read()) model.load_weights('o-model-weights.h5') adam = Adam(lr=0.0001, beta_1=0.9, beta_2=0.999, epsilon=1e-08) model.compile(loss='binary_crossentropy', optimizer=adam) objects, gripper_pos, gripper_orient, labels = load_all_params('../../grasp-conv/data/output_data.csv') seq_nums = np.arange(len(objects)) % 1000 #exactly 1000 per object in above file (dated March 18) labels = np.array(labels)[:,np.newaxis] Y_valid = labels[validation_indices,:] X_valid = [] for ind in validation_indices: X_valid.append(get_input(objects[ind], seq_nums[ind])) X_valid = np.array(X_valid) predictions = model.predict(X_valid, batch_size=32, verbose=0) print(predictions) f = open('o-predict.pkl', 'wb') cPickle.dump((predictions, Y_valid), f) f.close()
{ "repo_name": "bptripp/grasp-convnet", "path": "py/overlap_check.py", "copies": "1", "size": "1534", "license": "mit", "hash": -1824734868123990300, "line_mean": 27.4074074074, "line_max": 103, "alpha_frac": 0.6870925684, "autogenerated": false, "ratio": 2.8407407407407406, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.8921821947176998, "avg_score": 0.021202272392748585, "num_lines": 54 }
__author__ = 'bptripp' import numpy as np from scipy.optimize import curve_fit import matplotlib.pyplot as plt from sklearn.cluster import KMeans from sklearn.discriminant_analysis import LinearDiscriminantAnalysis from keras.models import Sequential from keras.layers.core import Dense, Activation, Flatten from keras.layers.convolutional import Convolution2D, MaxPooling2D """ Initialization of CNNs via clustering of inputs and convex optimization of outputs. """ def sigmoid(x, centre, gain): y = 1 / (1 + np.exp(-gain*(x-centre))) return y def gaussian(x, mu, sigma): return np.exp(-np.power(x - mu, 2.) / (2 * np.power(sigma, 2.))) def get_sigmoid_params(false_samples, true_samples, do_plot=False): """ Find gain and bias for sigmoid function that approximates probability of class memberships. Probability based on Bayes' rule & gaussian model of samples from each class. """ false_mu = np.mean(false_samples) false_sigma = np.std(false_samples) true_mu = np.mean(true_samples) true_sigma = np.std(true_samples) lowest = np.minimum(np.min(false_samples), np.min(true_samples)) highest = np.maximum(np.max(false_samples), np.max(true_samples)) a = np.arange(lowest, highest, (highest-lowest)/25) p_x_false = gaussian(a, false_mu, false_sigma) p_x_true = gaussian(a, true_mu, true_sigma) p_x = p_x_true + p_x_false p_true = p_x_true / p_x popt, _ = curve_fit(sigmoid, a, p_true) centre, gain = popt[0], popt[1] if do_plot: plt.hist(false_samples, a) plt.hist(true_samples, a) plt.plot(a, 100*sigmoid(a, centre, gain)) plt.plot(a, 100*p_true) plt.title('centre: ' + str(centre) + ' gain: ' + str(gain)) plt.show() return centre, gain def check_sigmoid(): n = 1000 false_samples = 1 + .3*np.random.randn(n) true_samples = -1 + 1*np.random.randn(n) centre, gain = get_sigmoid_params(false_samples, true_samples, do_plot=True) def get_convolutional_prototypes(samples, shape, patches_per_sample=5): assert len(samples.shape) == 4 assert len(shape) == 4 wiggle = (samples.shape[2]-shape[2], samples.shape[3]-shape[3]) patches = [] for sample in samples: for i in range(patches_per_sample): corner = (np.random.randint(0, wiggle[0]), np.random.randint(0, wiggle[1])) patches.append(sample[:,corner[0]:corner[0]+shape[2],corner[1]:corner[1]+shape[3]]) patches = np.array(patches) flat = np.reshape(patches, (patches.shape[0], -1)) km = KMeans(shape[0]) km.fit(flat) kernels = km.cluster_centers_ # normalize product of centre and corresponding kernel for i in range(kernels.shape[0]): kernels[i,:] = kernels[i,:] / np.linalg.norm(kernels[i,:]) return np.reshape(kernels, shape) def get_dense_prototypes(samples, n): km = KMeans(n) km.fit(samples) return km.cluster_centers_ def check_get_prototypes(): samples = np.random.rand(1000, 2, 28, 28) prototypes = get_convolutional_prototypes(samples, (20,2,5,5)) print(prototypes.shape) samples = np.random.rand(900, 2592) prototypes = get_dense_prototypes(samples, 64) print(prototypes.shape) def get_discriminant(samples, labels): lda = LinearDiscriminantAnalysis(solver='eigen', shrinkage='auto') lda.fit(samples, labels) return lda.coef_[0] def check_discriminant(): n = 1000 labels = np.random.rand(n) < 0.5 samples = np.zeros((n,2)) for i in range(len(labels)): if labels[i] > 0.5: samples[i,:] = np.array([0,1]) + 1*np.random.randn(1,2) else: samples[i,:] = np.array([-2,-1]) + .5*np.random.randn(1,2) coeff = get_discriminant(samples, labels) plt.figure(figsize=(10,5)) plt.subplot(1,2,1) plt.scatter(samples[labels>.5,0], samples[labels>.5,1], color='g') plt.scatter(samples[labels<.5,0], samples[labels<.5,1], color='r') plt.plot([-coeff[0], coeff[0]], [-coeff[1], coeff[1]], color='k') plt.subplot(1,2,2) get_sigmoid_params(np.dot(samples[labels<.5], coeff), np.dot(samples[labels>.5], coeff), do_plot=True) plt.show() def init_model(model, X_train, Y_train): if not (isinstance(model.layers[-1], Activation) \ and model.layers[-1].activation.__name__ == 'sigmoid'\ and isinstance(model.layers[-2], Dense)): raise Exception('This does not look like an LDA-compatible network, which is all we support') for i in range(len(model.layers)-2): if isinstance(model.layers[i], Convolution2D): inputs = get_inputs(model, X_train, i) w, b = model.layers[i].get_weights() w = get_convolutional_prototypes(inputs, w.shape) b = .1 * np.ones_like(b) model.layers[i].set_weights([w,b]) if isinstance(model.layers[i], Dense): inputs = get_inputs(model, X_train, i) w, b = model.layers[i].get_weights() w = get_dense_prototypes(inputs, w.shape[1]).T b = .1 * np.ones_like(b) model.layers[i].set_weights([w,b]) inputs = get_inputs(model, X_train, len(model.layers)-3) coeff = get_discriminant(inputs, Y_train) centre, gain = get_sigmoid_params(np.dot(inputs[Y_train<.5], coeff), np.dot(inputs[Y_train>.5], coeff)) w = coeff*gain w = w[:,np.newaxis] b = np.array([-centre]) model.layers[-2].set_weights([w,b]) sigmoid_inputs = get_inputs(model, X_train, len(model.layers)-1) plt.figure() plt.subplot(2,1,1) bins = np.arange(np.min(Y_train), np.max(Y_train)) plt.hist(sigmoid_inputs[Y_train<.5]) plt.subplot(2,1,2) plt.hist(sigmoid_inputs[Y_train>.5]) plt.show() def get_inputs(model, X_train, layer): if layer == 0: return X_train else: partial_model = Sequential(layers=model.layers[:layer]) partial_model.compile('sgd', 'mse') return partial_model.predict(X_train) if __name__ == '__main__': # check_sigmoid() # check_get_prototypes() # check_discriminant() import cPickle f = file('../data/bowl-test.pkl', 'rb') # f = file('../data/depths/24_bowl-29-Feb-2016-15-01-53.pkl', 'rb') d, bd, l = cPickle.load(f) f.close() d = d - np.mean(d.flatten()) d = d / np.std(d.flatten()) # n = 900 n = 90 X_train = np.zeros((n,1,80,80)) X_train[:,0,:,:] = d[:n,:,:] Y_train = l[:n] model = Sequential() model.add(Convolution2D(64,9,9,input_shape=(1,80,80))) model.add(Activation('relu')) model.add(MaxPooling2D()) # model.add(Convolution2D(64,3,3)) # model.add(Activation('relu')) # model.add(MaxPooling2D()) model.add(Flatten()) model.add(Dense(64)) model.add(Activation('relu')) model.add(Dense(1)) model.add(Activation('sigmoid')) init_model(model, X_train, Y_train) # from visualize import plot_kernels # plot_kernels(model.layers[0].get_weights()[0])
{ "repo_name": "bptripp/grasp-convnet", "path": "py/cninit.py", "copies": "1", "size": "7083", "license": "mit", "hash": 9001662641487659000, "line_mean": 30.9054054054, "line_max": 101, "alpha_frac": 0.6162642948, "autogenerated": false, "ratio": 3.0822454308093996, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.41985097256093995, "avg_score": null, "num_lines": null }
__author__ = 'bptripp' import numpy as np from scipy.optimize import newton from scipy.signal import convolve2d import matplotlib.pyplot as plt # Barrett hand dimensions from http://www.barrett.com/images/HandDime4.gif # Fingers don't extend fully, max 40deg from straight. First segment .07m; second .058m # I have estimated the hand origin in MeshLab from a mesh exported from V-REP def finger_path_template(fov, im_width, camera_offset, finger_width=.025): """ :param fov: camera field of view (radians!!!) :param im_width: pixels :param camera_offset: distance of camera behind hand :return: distance image of the intersection volume of Barrett hand """ # pixels = range(im_width/2) pixels = range(-im_width/4, im_width/2) # cross centre rads_per_pixel = fov / im_width; angles = rads_per_pixel * (np.array(pixels).astype(float) + 0.5) single_finger_xyz = (0.,.0396,.0302) double_finger_xyz = (0.025,.0604,.0302) single_depths = [] #lone finger double_depths = [] #pair of fingers on other side for angle in angles: single_depths.append(finger_depth(angle, camera_offset, finger_yz=single_finger_xyz[1:])) double_depths.append(finger_depth(angle, camera_offset, finger_yz=double_finger_xyz[1:])) template = np.zeros((im_width,im_width)) for i in range(len(pixels)): if single_depths[i] > 0: finger_half_width_rad = np.arctan(finger_width/2./single_depths[i]) finger_half_width_pixels = finger_half_width_rad / rads_per_pixel min_finger = int(np.floor(im_width/2-finger_half_width_pixels+.5)) max_finger = int(np.ceil(im_width/2+finger_half_width_pixels+.5)) template[im_width/2-1-pixels[i],min_finger:max_finger] = single_depths[i] #TODO: clean up offset if double_depths[i] > 0: finger_x_pixels = np.arctan(double_finger_xyz[0]/double_depths[i]) / rads_per_pixel # x offset of paired fingers min_finger = int(np.floor(im_width/2+finger_x_pixels-finger_half_width_pixels+.5)) max_finger = int(np.ceil(im_width/2+finger_x_pixels+finger_half_width_pixels+.5)) template[im_width/2+pixels[i],min_finger:max_finger] = double_depths[i] min_finger = int(np.floor(im_width/2-finger_x_pixels-finger_half_width_pixels+.5)) max_finger = int(np.ceil(im_width/2-finger_x_pixels+finger_half_width_pixels+.5)) template[im_width/2+pixels[i],min_finger:max_finger] = double_depths[i] return template def finger_depth(camera_angle, camera_offset, finger_length=.12, finger_yz=(.05,0.013), finger_ext=.31): # finger_ext: angle from finger CoR to tip at max extension y0 = finger_yz[0] z0 = finger_yz[1] l = finger_length max_angle = np.arctan((y0+l*np.cos(finger_ext))/(z0+camera_offset+l*np.sin(finger_ext))) # this seems like a reasonable place to stop min_angle = np.arctan((y0+l*np.cos(0.75*np.pi))/(z0+camera_offset+l*np.sin(0.75*np.pi))) result = 0 # if camera_angle > -1e-6 and camera_angle < max_angle: if camera_angle > min_angle and camera_angle < max_angle: # find corresponding finger angle f = lambda b: (y0+l*np.sin(b))/(z0+camera_offset+l*np.cos(b)) - np.tan(camera_angle) b = newton(f, np.pi/4.) z = z0 + camera_offset + l*np.cos(b) y = y0 + l*np.sin(b) result = np.sqrt(y**2+z**2) return result def calculate_metric_map(depth_map, finger_path, direction, saturation_distance=.02, box_size=3): """ An intermediate step in calculation of grip metrics. It isn't necessary to calculate this result separately except that decomposing calculation of metrics in this way may simplify deep network training. The same metrics could be calculated from various related maps. This one is chosen because it has fairly local features that should be easy for a network to approximate. """ finger_width = np.round(np.mean(np.sum(finger_path > 0, axis=0))) overlap = np.maximum(0, finger_path - depth_map) overlap = np.minimum(saturation_distance, overlap) overlap = overlap[::direction,:] running_max = np.zeros_like(overlap) for i in range(overlap.shape[0]): start = np.maximum(0,i) finish = np.minimum(overlap.shape[0],i+1) running_max[i,:] = np.max(overlap[start:finish,:], axis=0) window = np.ones((box_size,finger_width)) window = window / np.sum(window*saturation_distance) # normalize so that max convolution result is 1 result = convolve2d(running_max, window, mode='same') return result[::direction,:] def calculate_grip_metrics(depth_map, finger_path, saturation_distance=.02, box_size=3): overlap = np.maximum(0, finger_path - depth_map) # find first overlap from outside to centre in three regions s = depth_map.shape regions = [[s[0],s[0]/2,0,s[1]/2], [s[0],s[0]/2,s[1]/2,s[1]], [0,s[0]/2,s[1]/4,3*s[1]/4]] close_directions = [-1,-1,1] intersections = [] qualities = [] for region, direction in zip(regions, close_directions): region_overlap = overlap[region[0]:region[1]:direction,region[2]:region[3]] #running max to avoid penalizing grasping outside of concave shape ... # region_overlap = np.maximum.accumulate(region_overlap, axis=1) region_overlap = np.maximum.accumulate(region_overlap, axis=0) # p = np.sum(region_overlap, axis=0) p = np.sum(region_overlap, axis=1) # print(p) if True in (p>0).tolist(): intersection = (p>0).tolist().index(True) else: intersection = None intersections.append(intersection) region_finger = finger_path[region[0]:region[1]:direction,region[2]:region[3]] region_finger = saturation_distance * np.array(region_finger > 0).astype(float) region_overlap = np.minimum(region_overlap, saturation_distance) if intersection is None: quality = 0 else: # sub_region_overlap = region_overlap[:,intersection:intersection+box_size] # sub_region_finger = region_finger[:,intersection:intersection+box_size] sub_region_overlap = region_overlap[intersection:intersection+box_size,:] sub_region_finger = region_finger[intersection:intersection+box_size,:] quality = np.sum(sub_region_overlap.flatten()) / np.sum(sub_region_finger.flatten()) # plt.imshow(sub_region_finger) # plt.show() qualities.append(quality) # print(intersections) # print(qualities) # # from mpl_toolkits.mplot3d import axes3d, Axes3D # X = np.arange(0, len(depth_map)) # Y = np.arange(0, len(depth_map)) # X, Y = np.meshgrid(X, Y) # fig = plt.figure() # ax = fig.add_subplot(1,1,1,projection='3d') # ax.plot_wireframe(X, Y, overlap) # plt.show() return intersections, qualities def check_overlap_range(image_dir='../../grasp-conv/data/obj_depths', im_width=80, camera_offset=.45, far_clip=.8): from data import load_all_params import scipy objects, gripper_pos, gripper_orient, labels = load_all_params('../../grasp-conv/data/output_data.csv') seq_nums = np.arange(len(objects)) % 1000 from os import listdir from os.path import isfile, join from heuristic import finger_path_template finger_path = finger_path_template(45.*np.pi/180., im_width, camera_offset) max_overlaps = [] for object, seq_num in zip(objects, seq_nums): filename = join(image_dir, object[:-4] + '-' + str(seq_num) + '.png') image = scipy.misc.imread(filename) rescaled_distance = image / 255.0 distance = rescaled_distance*(far_clip-camera_offset)+camera_offset max_overlaps.append(np.max(finger_path - distance)) return max_overlaps, labels if __name__ == '__main__': camera_offset=.45 near_clip=.25 far_clip=.8 fov = 45.*np.pi/180. im_width=80 template = finger_path_template(fov, im_width, camera_offset) plt.imshow(template) plt.show() # import scipy # image = scipy.misc.imread('../../grasp-conv/data/obj_depths/1_Coffeecup_final-03-Mar-2016-18-50-40-1.png') # rescaled_distance = image / 255.0 # distance = rescaled_distance*(far_clip-camera_offset)+camera_offset # # finger_path = finger_path_template(45.*np.pi/180., 80, camera_offset) # import time # start_time = time.time() # for i in range(100): # mm = calculate_metric_map(distance, finger_path, 1) # print('elapsed: ' + str(time.time() - start_time)) # # print(np.min(mm)) # print(np.max(mm)) # # intersections, qualities = calculate_grip_metrics(distance, finger_path) # print(intersections) # # from visualize import plot_mesh # plot_mesh(finger_path) # from data import load_all_params # objects, gripper_pos, gripper_orient, labels = load_all_params('../../grasp-conv/data/output_data.csv') # # plot max overlaps (sanity check) ... # max_overlaps, labels = check_overlap_range() # max_overlaps = np.array(max_overlaps) # labels = np.array(labels) # # import cPickle # f = open('overlaps.pkl', 'wb') # cPickle.dump((max_overlaps, labels), f) # f.close() # # plt.plot(max_overlaps) # plt.show()
{ "repo_name": "bptripp/grasp-convnet", "path": "py/heuristic.py", "copies": "1", "size": "9413", "license": "mit", "hash": -6188186780872422000, "line_mean": 38.2208333333, "line_max": 124, "alpha_frac": 0.6434717943, "autogenerated": false, "ratio": 3.1460561497326203, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.9256767204989063, "avg_score": 0.0065521478087116536, "num_lines": 240 }
__author__ = 'bptripp' import numpy as np import cPickle from keras.models import Sequential from keras.layers.convolutional import Convolution2D, MaxPooling2D from keras.layers.core import Dense, Dropout, Activation, Flatten from keras.optimizers import Adam im_width = 80 model = Sequential() model.add(Convolution2D(32, 9, 9, input_shape=(1,im_width,im_width), init='glorot_normal', border_mode='same')) model.add(Activation('relu')) model.add(MaxPooling2D(pool_size=(2,2))) model.add(Convolution2D(32, 3, 3, init='glorot_normal', border_mode='same')) model.add(Activation('relu')) model.add(MaxPooling2D(pool_size=(2,2))) model.add(Convolution2D(32, 3, 3, init='glorot_normal', border_mode='same')) model.add(Activation('relu')) model.add(Flatten()) model.add(Dense(256)) model.add(Activation('relu')) model.add(Dropout(.5)) model.add(Dense(1)) model.add(Activation('sigmoid')) adam = Adam(lr=0.0001, beta_1=0.9, beta_2=0.999, epsilon=1e-08) # model.compile(loss='mean_squared_error', optimizer=adam) model.compile(loss='binary_crossentropy', optimizer=adam) f = file('../data/metrics-support.pkl', 'rb') intersections, qualities, files = cPickle.load(f) f.close() #TODO: len(train_indices) + len(validation_indices) sometimes at random is slightly > len(files) n = len(files) validation_indices = np.random.randint(0, n, 500) s = set(validation_indices) train_indices = [x for x in range(n) if x not in s] intersections = np.array(intersections) collisions = np.where(intersections == np.array(None), 0, intersections) collisions = np.minimum(np.max(collisions, axis=1), 1) print(collisions.shape) from os.path import join import scipy def get_input(image_file): image_dir = '../../grasp-conv/data/support_depths/' image = scipy.misc.imread(join(image_dir, image_file)) rescaled_distance = image / 255.0 return 1.0 - rescaled_distance # I think this is a good closeup disparity-like representation Y_valid = collisions[validation_indices] X_valid = [] for ind in validation_indices: X_valid.append(get_input(files[ind])) X_valid = np.array(X_valid) X_valid = X_valid[:,np.newaxis,:,:] def generate_XY(): while 1: ind = train_indices[np.random.randint(len(train_indices))] Y = np.zeros((1,1)) Y[0] = collisions[ind] X = get_input(files[ind]) X = X[np.newaxis,np.newaxis,:,:] yield (X, Y) h = model.fit_generator(generate_XY(), samples_per_epoch=500, nb_epoch=500, validation_data=(X_valid, Y_valid)) f = file('collision-history.pkl', 'wb') cPickle.dump(h, f) f.close()
{ "repo_name": "bptripp/grasp-convnet", "path": "py/collision_model.py", "copies": "1", "size": "2567", "license": "mit", "hash": -644877019632732200, "line_mean": 31.4936708861, "line_max": 111, "alpha_frac": 0.7051032333, "autogenerated": false, "ratio": 2.913734392735528, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.9016633545075702, "avg_score": 0.020440816191965208, "num_lines": 79 }
__author__ = 'bptripp' import numpy as np import matplotlib matplotlib.rcParams['xtick.labelsize'] = 14 matplotlib.rcParams['ytick.labelsize'] = 14 import matplotlib.pyplot as plt from cnn_stimuli import get_image_file_list from alexnet import load_vgg, load_net, preprocess # remove_level = 2 # use_vgg = False # # if use_vgg: # model = load_vgg(weights_path='../weights/vgg16_weights.h5', remove_level=remove_level) # else: # model = load_net(weights_path='../weights/alexnet_weights.h5', remove_level=remove_level) # # # from_dir = './images/simplification/from/' # from_image_files = get_image_file_list(from_dir, 'png', with_path=True) # from_out = model.predict(preprocess(from_image_files, use_vgg=use_vgg)) # # to_dir = './images/simplification/to/' # to_image_files = get_image_file_list(to_dir, 'png', with_path=True) # to_out = model.predict(preprocess(to_image_files, use_vgg=use_vgg)) # # other_dir = './images/simplification/other/' # other_image_files = get_image_file_list(other_dir, 'png', with_path=True) # other_out = model.predict(preprocess(other_image_files, use_vgg=use_vgg)) # # #TODO: get null distribution by shuffling froms instead of using tos # # # baseline = np.min(np.concatenate((from_out, to_out), axis=0), axis=0) # baseline = np.min(from_out, axis=0) # from_out = from_out - baseline # to_out = to_out - baseline # # n = 50 # n_shapes = from_out.shape[0] # # ratios = [] # # nulls = [] # plt.figure(figsize=(6,6)) # edges = np.linspace(0, 2.0, 11) # labels = ['plant', 'hind leg', 'cube', 'person', 'ball', 'haystack', 'pom-pom', 'apple', 'hand', 'skewer', 'bread', 'cat'] # position = 1 # ratio_fractions_over_one = np.zeros(n_shapes) # null_fractions_over_one = np.zeros(n_shapes) # # unit_maxima = np.max(np.concatenate((from_out, other_out), axis=0), axis=0) # tolerance = np.mean(unit_maxima) * .05 # print(tolerance) # # for i in range(n_shapes): # # find units that respond most strongly to this shape, among "from" and "other" groups # this_shape_preferred = np.logical_and(from_out[i,:] >= unit_maxima-tolerance, from_out[i,:] > 1) # # print(sum(this_shape_preferred)) # ind = np.where(this_shape_preferred) # # print(ind) # # # from_out[i,:] # # # response = from_out[i,:] # # ind = (-from_out[i,:]).argsort()[:n] # ratios = to_out[i,ind] / from_out[i,ind] # nulls = [] # for j in range(1,n_shapes): # nulls.append(to_out[np.mod(i+j, n_shapes),ind] / from_out[i,ind]) # nulls = np.array(nulls) # # #extra fussing to make order of panels like Tanaka # plt.subplot(4,3,position) # position = position + 3 # if position > 12: # position = position - 11 # # # print(ratios.flatten()) # ratio_counts, e = np.histogram(ratios.flatten(), edges) # ratio_fractions = ratio_counts.astype(float) / np.sum(ratio_counts) # null_counts, e = np.histogram(nulls.flatten(), edges) # null_fractions = null_counts.astype(float) / np.sum(null_counts) # # plt.bar(edges[:-1], ratio_fractions, width=.2, color=[0,0,1]) # plt.bar(edges[:-1], -null_fractions, width=.2, color=[0.7,0.7,0.7]) # plt.xlim((0,2)) # plt.ylim((-.8,.8)) # plt.xticks([0,1,2]) # plt.yticks([-.8,-.4,0,.4,.8]) # plt.title(labels[i]) # # if len(ratios.flatten()) == 0: # ratio_fractions_over_one[i] = np.nan # null_fractions_over_one[i] = np.nan # else: # ratio_fractions_over_one[i] = float(np.sum(ratios.flatten() > 1)) / len(ratios.flatten()) # null_fractions_over_one[i] = float(np.sum(nulls.flatten() > 1)) / len(nulls.flatten()) # # plt.tight_layout() # # print('>1 ' + str(np.nanmean(ratio_fractions_over_one)) + ' ' + str(np.nanmean(null_fractions_over_one))) # # if use_vgg: # plt.savefig('../figures/simplification-vgg-' + str(remove_level) + '.eps') # else: # plt.savefig('../figures/simplification-alexnet-' + str(remove_level) + '.eps') # # plt.show() # plot fractions over one (from repeated runs) remove_level = np.array([0,1,2]) #values from all above threshold ... vgg_ratio_over_one = [0.117499415481, 0.0418854340439, 0.0531346631493] vgg_null_over_one = [0.0523417204617, 0.0151203682413, 0.0246139848455] alexnet_ratio_over_one = [0.149668638138, 0.07128067702, .0675081863766] alexnet_null_over_one = [0.0663521248382, 0.0251136422064, 0.0279159685923] #values from top 50 ... # vgg_ratio_over_one = [0.146666666667, 0.123333333333, 0.115] # vgg_null_over_one = [0.0984848484848, 0.0943939393939, 0.0916666666667] # alexnet_ratio_over_one = [0.166666666667, 0.116666666667, 0.106666666667] # alexnet_null_over_one = [0.0763636363636, 0.050303030303, 0.0604545454545] plt.figure(figsize=(6,2)) plt.subplot(1,2,1) plt.plot(-remove_level, vgg_ratio_over_one, color='b') plt.plot(-remove_level, vgg_null_over_one, color='k') plt.ylim([0,.2]) plt.title('VGG-16') plt.subplot(1,2,2) plt.plot(-remove_level, alexnet_ratio_over_one, color='b') plt.plot(-remove_level, alexnet_null_over_one, color='k') plt.ylim([0,.2]) plt.title('Alexnet') # plt.xlabel('Distance from output (layers)') plt.tight_layout() plt.savefig('../figures/simplification-over-one.eps') plt.show()
{ "repo_name": "bptripp/it-cnn", "path": "tuning/simplification.py", "copies": "1", "size": "5168", "license": "mit", "hash": 8056749729226095000, "line_mean": 36.4492753623, "line_max": 124, "alpha_frac": 0.6557662539, "autogenerated": false, "ratio": 2.5647642679900744, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.3720530521890074, "avg_score": null, "num_lines": null }
__author__ = 'bptripp' import numpy as np import matplotlib.pyplot as plt import cPickle from quaternion import angle_between_quaterions # def interpolate(point, angle, points, angles, values, sigma_p=.01, sigma_a=(4*np.pi/180)): # """ # Gaussian kernel smoothing. # """ # # q = to_quaternion(get_rotation_matrix(point, angle)) # # print(angle) # # weights = np.zeros(len(values)) # # foo = np.zeros(len(values)) # # bar = np.zeros(len(values)) # for i in range(len(values)): # # q_i = to_quaternion(get_rotation_matrix(points[:,i], angles[:,i])) # # # print(q_i) # # # angle = angle_between_quaterions(q, q_i) # # print(angle) # # position_distance = np.linalg.norm(point - points[:,i]) # angle_distance = angle[2] - angles[2,i]; # # # weights[i] = np.exp( -(angle**2/2/sigma_a**2) ) # weights[i] = np.exp( -(angle_distance**2/2/sigma_a**2 + position_distance**2/2/sigma_p**2) ) # # weights[i] = np.exp( -(angle**2/2/sigma_a**2 + distance**2/2/sigma_p**2) ) # # foo[i] = np.exp( -(angle**2/2/sigma_a**2) ) # # bar[i] = np.exp( -(distance**2/2/sigma_p**2) ) # # # print(weights) # # print(np.sum(weights)) # # print(np.sum(foo)) # # print(np.sum(bar)) # return np.sum(weights * np.array(values)) / np.sum(weights) def interpolate(quaternion, distance, quaternions, distances, values, sigma_a=(4*np.pi/180), sigma_d=.01): """ Gaussian kernel smoothing. """ weights = np.zeros(len(values)) angle_threshold = np.cos(1.25*sigma_a) # I think this corresponds to twice this angle between quaternions distance_threshold = 2.5*sigma_d # attempt fast estimate (only considering within-threshold points) ... c = 0 for i in range(len(values)): distance_difference = np.abs(distance - distances[i]) if distance_difference < distance_threshold and np.dot(quaternion, quaternions[i]) > angle_threshold: c += 1 angle_difference = np.abs(angle_between_quaterions(quaternion, quaternions[i])) weights[i] = np.exp( -(angle_difference**2/2/sigma_a**2 + distance_difference**2/2/sigma_d**2) ) # slow estimate if not enough matches ... # print(c) if c <= 3: # print('slow estimate ' + str(c)) for i in range(len(values)): distance_difference = np.abs(distance - distances[i]) angle_difference = np.abs(angle_between_quaterions(quaternion, quaternions[i])) weights[i] = np.exp( -(angle_difference**2/2/sigma_a**2 + distance_difference**2/2/sigma_d**2) ) # print(weights) # print(values) return np.sum(weights * np.array(values)) / np.sum(weights) def check_interpolate(): from perspective import get_quaternion_distance point = np.array([1e-6,.1,.1]) angle = np.array([0,0,.9]) points = np.array([[1e-6,.1,.1], [1e-6,.12,.1]]).T angles = np.array([[0,0,1], [0,0,1]]).T values = np.array([0,1]) quaternion, distance = get_quaternion_distance(point[:,np.newaxis], angle[:,np.newaxis]) quaternions, distances = get_quaternion_distance(points, angles) # print(quaternion) # print(distance) # print(quaternions) # print(distances) # estimate = interpolate(point, angle, points, angles, values, sigma_p=.01, sigma_a=(4*np.pi/180)) estimate = interpolate(quaternion[0], distance[0], quaternions, distances, values, sigma_d=.01, sigma_a=(4*np.pi/180)) print(estimate) def test_interpolation_accuracy(points, angles, metrics, n_examples): """ Compare interpolated vs. actual metrics by leaving random examples out of interpolation set and estimating them. """ from perspective import get_quaternion_distance quaternions, distances = get_quaternion_distance(points, angles) actuals = [] interpolateds = [] for i in range(n_examples): print(i) one = np.random.randint(0, len(metrics)) others = range(one) others.extend(range(one+1, len(metrics))) others = np.array(others) actuals.append(metrics[one]) interpolated = interpolate(quaternions[one,:], distances[one], quaternions[others,:], distances[others], metrics[others], sigma_d=.01, sigma_a=(8*np.pi/180)) interpolateds.append(interpolated) # print(interpolated - metrics[one]) # print(np.corrcoef(actuals, interpolateds)) return actuals, interpolateds def plot_interp_error_vs_density(): with open('spatula-perspectives-smoothed.pkl', 'rb') as f: (points, angles, metrics, collisions, smoothed) = cPickle.load(f) metrics = np.array(metrics) smoothed = np.array(smoothed) numbers = [250, 500, 1000, 2000, 4000] metric_errors = [] smoothed_errors = [] for n in numbers: actuals, interpolateds = test_interpolation_accuracy(points[:,:n], angles[:,:n], metrics[:n], 500) metric_errors.append(np.mean( (np.array(actuals)-np.array(interpolateds))**2 )**.5) actuals, interpolateds = test_interpolation_accuracy(points[:,:n], angles[:,:n], smoothed[:n], 500) smoothed_errors.append(np.mean( (np.array(actuals)-np.array(interpolateds))**2 )**.5) plt.plot(numbers, smoothed_errors) plt.plot(numbers, metric_errors) plt.show() if __name__ == '__main__': # check_interpolate() plot_interp_error_vs_density()
{ "repo_name": "bptripp/grasp-convnet", "path": "py/interpolate.py", "copies": "1", "size": "5452", "license": "mit", "hash": -7175818093723811000, "line_mean": 36.0884353741, "line_max": 129, "alpha_frac": 0.6214233309, "autogenerated": false, "ratio": 3.1845794392523366, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.9283599713418187, "avg_score": 0.004480611346829962, "num_lines": 147 }
__author__ = 'bptripp' import numpy as np def to_quaternion(rotation_matrix): # from Siciliano & Khatib pg. 12 and quaternion.m by Tincknell r = rotation_matrix # e0 = .5 * np.sqrt(1 + r[0][0] + r[1][1] + r[2][2]) e0 = .5 * np.sqrt(np.maximum(0, r[0][0] + r[1][1] + r[2][2] + 1)) if e0 == 0: e1 = np.sqrt(np.maximum(0, -0.5 * (r[1][1] + r[2][2]))) * np.sign(-r[1][2]) e2 = np.sqrt(np.maximum(0, -0.5 * (r[0][0] + r[2][2]))) * np.sign(-r[0][2]) e3 = np.sqrt(np.maximum(0, -0.5 * (r[0][0] + r[1][1]))) * np.sign(-r[0][1]) else: e1 = (r[2][1] - r[1][2]) / (4*e0) e2 = (r[0][2] - r[2][0]) / (4*e0) e3 = (r[1][0] - r[0][1]) / (4*e0) return np.array([e0,e1,e2,e3]) """ This is from quaternion.m by Mark Tincknell function eout = RotMat2e( R ) % function eout = RotMat2e( R ) % One Rotation Matrix -> one quaternion eout = zeros(4,1); if ~all( all( R == 0 )) eout(1) = 0.5 * sqrt( max( 0, R(1,1) + R(2,2) + R(3,3) + 1 )); if eout(1) == 0 eout(2) = sqrt( max( 0, -0.5 *( R(2,2) + R(3,3) ))) * sgn( -R(2,3) ); eout(3) = sqrt( max( 0, -0.5 *( R(1,1) + R(3,3) ))) * sgn( -R(1,3) ); eout(4) = sqrt( max( 0, -0.5 *( R(1,1) + R(2,2) ))) * sgn( -R(1,2) ); else eout(2) = 0.25 *( R(3,2) - R(2,3) )/ eout(1); eout(3) = 0.25 *( R(1,3) - R(3,1) )/ eout(1); eout(4) = 0.25 *( R(2,1) - R(1,2) )/ eout(1); end end end % RotMat2e """ def from_quaternion(e): # from http://www.euclideanspace.com/maths/geometry/rotations/conversions/quaternionToMatrix/ rm = [[1-2*e[2]**2-2*e[3]**2, 2*e[1]*e[2]-2*e[3]*e[0], 2*e[1]*e[3]+2*e[2]*e[0]], [2*e[1]*e[2]+2*e[3]*e[0], 1-2*e[1]**2-2*e[3]**2, 2*e[2]*e[3]-2*e[1]*e[0]], [2*e[1]*e[3]-2*e[2]*e[0], 2*e[2]*e[3]+2*e[1]*e[0], 1-2*e[1]**2-2*e[2]**2]] return np.array(rm) def quaterion_product(e1, e2): # from https://en.wikipedia.org/wiki/Quaternion result = [ e1[0]*e2[0] - e1[1]*e2[1] - e1[2]*e2[2] - e1[3]*e2[3], e1[0]*e2[1] + e1[1]*e2[0] + e1[2]*e2[3] - e1[3]*e2[2], e1[0]*e2[2] - e1[1]*e2[3] + e1[2]*e2[0] + e1[3]*e2[1], e1[0]*e2[3] + e1[1]*e2[2] - e1[2]*e2[1] + e1[3]*e2[0] ] return np.array(result) def quaternion_conj(e): return np.array([e[0], -e[1], -e[2], -e[3]]) def angle_between_quaterions(e1, e2): # from http://math.stackexchange.com/questions/90081/quaternion-distance # return np.arccos(2*(e1[0]*e2[0]+e1[1]*e2[1]+e1[2]*e2[2]+e1[3]*e2[3])-1) # from http://math.stackexchange.com/questions/167827/compute-angle-between-quaternions-in-matlab z = quaterion_product(e1, quaternion_conj(e2)) # print(z[0]) return 2*np.arccos(np.clip(z[0], -1, 1)) def difference_between_quaternions(e1, e2): """ TODO: look this up when internet is back online :param e1: From here :param e2: To here :return: Quaternion of rotation """ # print(e1) # print(e2) guess = quaterion_product(quaternion_conj(e1), e2) # print(guess) r1 = from_quaternion(e1) r2 = from_quaternion(e2) guess2 = to_quaternion(np.dot(np.linalg.inv(r1), r2)) # print(guess2) p = np.array([0, .2, -.4, 1.1]) # print(quaterion_product(guess, quaterion_product(p, quaternion_conj(guess)))) # print(quaterion_product(guess2, quaterion_product(p, quaternion_conj(guess2)))) return guess2 def equal(e1, e2, tol=1e-6): # TODO: account for double cover equal = True for i in range(4): if e1[i]-e2[i] > tol: equal = False return equal def check_quaternion(): r = np.array([[0.86230895, 0.20974727, -0.46090059], [ 0.50269225, -0.4642552, 0.72922398], [-0.06102276, -0.86050752, -0.50576974]]) error = r - from_quaternion(to_quaternion(r)) assert np.std(error.flatten()) < 1e-6 def check_difference(): # r1 = np.array([[0.86230895, 0.20974727, -0.46090059], # [ 0.50269225, -0.4642552, 0.72922398], # [-0.06102276, -0.86050752, -0.50576974]]) r1 = np.array([[0.31578947, -0.9486833, -0.01664357], [-0.94736842, -0.31622777, 0.0499307], [-0.05263158, 0., -0.998614]]) r2 = np.array([[1, 0, 0], [0, np.cos(np.pi), -np.sin(np.pi)], [0, np.sin(np.pi), np.cos(np.pi)]]) # print(r2) difference_between_quaternions(to_quaternion(r1), to_quaternion(r2)) r3 = np.array([[1, 0, 0], [0, np.cos(np.pi/2), -np.sin(np.pi/2)], [0, np.sin(np.pi/2), np.cos(np.pi/2)]]) d = difference_between_quaternions(to_quaternion(r3), to_quaternion(r2)) # print(d) # print(to_quaternion(r3)) assert equal(d, to_quaternion(r3)) if __name__ == '__main__': # check_quaternion() check_difference() # r1 = np.array([[0.86230895, 0.20974727, -0.46090059], # [ 0.50269225, -0.4642552, 0.72922398], # [-0.06102276, -0.86050752, -0.50576974]]) # r2 = np.array([[1, 0, 0], [0, np.cos(np.pi), -np.sin(np.pi)], [0, np.sin(np.pi), np.cos(np.pi)]]) # # a = .5*np.pi # r3 = np.array([[1, 0, 0], [0, np.cos(a), -np.sin(a)], [0, np.sin(a), np.cos(a)]]) # e1 = to_quaternion(r1) # e2 = to_quaternion(r2) # e3 = to_quaternion(r3) # # print(e1) # # print(e2) # # print(np.linalg.norm(e1)) # # print(np.dot(e2,e3))
{ "repo_name": "bptripp/grasp-convnet", "path": "py/quaternion.py", "copies": "1", "size": "5300", "license": "mit", "hash": 8663867377050157000, "line_mean": 33.1935483871, "line_max": 109, "alpha_frac": 0.5320754717, "autogenerated": false, "ratio": 2.1527213647441106, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.31847968364441104, "avg_score": null, "num_lines": null }
__author__ = 'bptripp' import os import csv import numpy as np from itertools import islice from depthmap import * from PIL import Image import scipy import scipy.misc from depthmap import loadOBJ, Display from heuristic import calculate_metric_map import cPickle import matplotlib.pyplot as plt # class GraspDataSource(object): # # def __init__(self, csv_file_name, obj_directory_name, range=None, imsize=(50,50)): # self.obj_directory_name = obj_directory_name # self.imsize = imsize # # self.objfiles = [] # self.orientations = [] # self.positions = [] # self.success = [] # # with open(csv_file_name, 'rb') as csvfile: # r = csv.reader(csvfile, delimiter=',') # for row in islice(r, 1, None): # self.objfiles.append(obj_directory_name + os.path.sep + row[0]) # self.orientations.append([float(row[1]), float(row[2]), float(row[3])]) # self.positions.append([float(row[4]), float(row[5]), float(row[6])]) # self.success.append(float(row[8])) # # if range is not None: # self.objfiles = self.objfiles[range[0]:range[1]] # self.orientations = self.orientations[range[0]:range[1]] # self.positions = self.positions[range[0]:range[1]] # self.success = self.success[range[0]:range[1]] # # self.display = Display(imsize=imsize) # # # def get_XY(self, n): # ind = np.random.randint(0, len(self.objfiles), n) # X = np.zeros((n, 1, self.imsize[0], self.imsize[1])) # Y = np.zeros(n) # for i in range(n): # # print(self.objfiles[ind[i]]) # verts, faces = loadOBJ(self.objfiles[ind[i]]) # new_verts = move_vertices(self.positions[ind[i]], self.orientations[ind[i]], verts) # self.display.set_mesh(new_verts, faces) # X[i,0,:,:] = self.display.read_depth() # Y[i] = self.success[ind[i]] # return np.array(X), np.array(Y) # class AshleyDataSource(object): # def __init__(self): # self.X = np.zeros((1000,1,28,28)) # for i in range(1000): # # filename = '25_mug-02-Feb-2016-12-40-43.obj131001' # filename = '../data/imgs/25_mug-02-Feb-2016-12-40-43.obj13' + str(1001+i) + '.png' # im = Image.open(filename) # self.X[i,0,:,:] = np.array(im.getdata()).reshape((28,28)) # # for line in open('../data/labels.csv', "r"): # vals = line.split(',') # self.Y = map(int, vals) # # # normalize input # self.X = (self.X - np.mean(self.X.flatten())) / np.std(self.X.flatten()) # def make_depth_from_gripper(obj_filename, param_filename, bottom=0.2): # """ # Make depth images from perspective of gripper. # """ # verts, faces = loadOBJ(obj_filename) # verts = np.array(verts) # min_bounding_box = np.min(verts, axis=0) # max_bounding_box = np.max(verts, axis=0) # # # set bounding box horizontal centre to 0,0 # verts[:,0] = verts[:,0] - (min_bounding_box[0]+max_bounding_box[0])/2. # verts[:,1] = verts[:,1] - (min_bounding_box[1]+max_bounding_box[1])/2. # # set bottom of bounding box to "bottom" # verts[:,2] = verts[:,2] + bottom - min_bounding_box[2] # # d = Display(imsize=(80,80)) # # labels = [] # depths = [] # c = 0 # for line in open(param_filename, "r"): # # print(c) # # if c == 100: # # break # c = c + 1 # # vals = line.split(',') # gripper_pos = [float(vals[0]), float(vals[1]), float(vals[2])] # gripper_orient = [float(vals[3]), float(vals[4]), float(vals[5])] # rot = rot_matrix(gripper_orient[0], gripper_orient[1], gripper_orient[2]) # labels.append(int(vals[6])) # # d.set_camera_position(gripper_pos, rot, .4) # d.set_mesh(verts, faces) #this mut go after set_camera_position # depth = d.read_depth() # depths.append(depth) # # d.close() # return np.array(depths), np.array(labels) def load_all_params(param_filename, return_power_pinch=False): """ Example line from file: "104_toaster_final-18-Dec-2015-13-56-59.obj",2.99894,0.034299705,0.4714164,0.09123467,0.0384472,0.5518384,0.0880979987086634,0.0 """ bad = [ # Ashley says these are bad after looking through V-REP images ... '24_bowl-24-Feb-2016-17-38-53', '24_bowl-26-Feb-2016-08-35-29', '24_bowl-27-Feb-2016-23-52-43', '24_bowl-29-Feb-2016-15-01-53', '25_mug-11-Feb-2016-02-25-25', '28_Spatula_final-10-Mar-2016-18-31-08', '42_wineglass_final-01-Nov-2015-19-25-18', # These somehow have two objects in V-REP images ... '24_bowl-02-Mar-2016-07-03-29', '24_bowl-03-Mar-2016-22-54-50', '24_bowl-05-Mar-2016-13-53-41', '24_bowl-07-Mar-2016-05-06-04', # These ones may fall over a bit at simulation start (first has off depth maps, others don't) ... '55_hairdryer_final-18-Nov-2015-13-57-47', '55_hairdryer_final-15-Dec-2015-12-18-19', '55_hairdryer_final-09-Dec-2015-09-54-47', '55_hairdryer_final-19-Nov-2015-09-56-56', '55_hairdryer_final-21-Nov-2015-05-16-08', # These frequently do not have object at centre of depth map (various reasons possible) ... '33_pan_final-11-Mar-2016-17-41-49', '53_watertap_final-04-Dec-2015-01-28-24', '53_watertap_final-06-Dec-2015-04-20-45', '53_watertap_final-15-Nov-2015-05-08-46', '53_watertap_final-17-Nov-2015-00-26-39', '53_watertap_final-17-Nov-2015-15-57-57', '53_watertap_final-19-Jan-2016-04-32-52', '56_headphones_final-11-Nov-2015-14-14-02', '64_tongs_final-02-Dec-2015-12-22-36', '68_toy_final-05-Dec-2015-03-00-07', '68_toy_final-13-Nov-2015-10-50-34', '68_toy_final-18-Dec-2015-12-36-41', '68_toy_final-22-Nov-2015-08-51-12', '76_mirror_final-06-Dec-2015-03-46-18', '77_napkinholder_final-28-Nov-2015-13-06-17', '79_toy_dog_final-03-Dec-2015-08-15-04', '79_toy_dog_final-20-Jan-2016-06-55-00', '92_shell_final-26-Feb-2016-17-48-04', '94_weight_final-27-Feb-2016-15-40-40', '94_weight_final-29-Feb-2016-17-59-42', '95_boots_final-01-Mar-2016-16-02-15', '95_boots_final-01-Mar-2016-16-07-50', '95_boots_final-02-Mar-2016-13-46-24', '95_boots_final-02-Mar-2016-13-56-54', '95_boots_final-15-Nov-2015-06-30-07', '95_boots_final-20-Nov-2015-09-23-39', '95_boots_final-21-Nov-2015-04-00-35', '95_boots_final-23-Dec-2015-15-28-51', '95_boots_final-28-Feb-2016-18-58-13', '95_boots_final-28-Feb-2016-18-58-15', '98_faucet_final-28-Feb-2016-18-32-04', '98_faucet_final-28-Feb-2016-18-58-23', '98_faucet_final-28-Feb-2016-18-58-25' ] objects = [] gripper_pos = [] gripper_orient = [] labels = [] power_pinch = [] skip_count = 0 for line in open(param_filename, "r"): vals = line.translate(None, '"\n').split(',') if (vals[0] == 'objfilename'): pass elif vals[0][:-4] in bad: skip_count += 1 else: objects.append(vals[0]) gripper_orient.append([float(vals[1]), float(vals[2]), float(vals[3])]) gripper_pos.append([float(vals[4]), float(vals[5]), float(vals[6])]) labels.append(int(float(vals[8]))) power_pinch.append(float(vals[7])) print('Skipped ' + str(skip_count) + '; returning ' + str(len(objects))) if return_power_pinch: return objects, gripper_pos, gripper_orient, labels, power_pinch else: return objects, gripper_pos, gripper_orient, labels def make_depth_images(obj_name, pos, rot, obj_dir, image_dir, bottom=0.2, imsize=(80,80), camera_offset=.45, near_clip=.25, far_clip=.8, support=False): """ Saves depth images from perspective of gripper as image files. Default camera parameters make an exaggerated representation of region in front of hand. :param obj_name: Name corresponding to .obj file (without path or extension) :param pos: Positions of perspectives from which to make depth images :param rot: Rotation matrices of perspectives :param obj_dir: Directory where .obj files can be found :param image_dir: Directory in which to store images """ obj_filename = obj_dir + obj_name + '.obj' if support: verts, faces = loadOBJ('../data/support-box.obj') else: verts, faces = loadOBJ(obj_filename) verts = np.array(verts) # minz = np.min(verts, axis=0)[2] # verts[:,2] = verts[:,2] + bottom - minz min_bounding_box = np.min(verts, axis=0) max_bounding_box = np.max(verts, axis=0) # set bounding box horizontal centre to 0,0 verts[:,0] = verts[:,0] - (min_bounding_box[0]+max_bounding_box[0])/2. verts[:,1] = verts[:,1] - (min_bounding_box[1]+max_bounding_box[1])/2. # set bottom of bounding box to "bottom" verts[:,2] = verts[:,2] + bottom - min_bounding_box[2] d = Display(imsize=imsize) d.set_perspective(fov=45, near_clip=near_clip, far_clip=far_clip) for i in range(len(pos)): d.set_camera_position(pos[i], rot[i], camera_offset) d.set_mesh(verts, faces) #this must go after set_camera_position depth = d.read_depth() distance = get_distance(depth, near_clip, far_clip) rescaled_distance = np.maximum(0, (distance-camera_offset)/(far_clip-camera_offset)) imfile = image_dir + obj_name + '-' + str(i) + '.png' Image.fromarray((255.0*rescaled_distance).astype('uint8')).save(imfile) # scipy.misc.toimage(depth, cmin=0.0, cmax=1.0).save(imfile) d.close() def make_random_depths(obj_filename, param_filename, n, im_size=(40,40)): """ Creates a dataset of depth maps and corresponding success probabilities at random interpolated gripper configurations. """ verts, faces = loadOBJ(obj_filename) verts = np.array(verts) minz = np.min(verts, axis=0)[2] verts[:,2] = verts[:,2] + 0.2 - minz points, labels = get_points(param_filename) d = Display(imsize=im_size) probs = [] depths = [] for i in range(n): point = get_interpolated_point(points) estimate, confidence = get_prob_label(points, labels, point, sigma_p=2*.001, sigma_a=2*(4*np.pi/180)) probs.append(estimate) gripper_pos = point[:3] gripper_orient = point[3:] d.set_camera_position(gripper_pos, gripper_orient, .3) d.set_mesh(verts, faces) #this must go after set_camera_position depth = d.read_depth() depths.append(depth) d.close() return np.array(depths), np.array(probs) def get_interpolated_point(points): """ Creates a random point that is interpolated between a pair of nearby points. """ p1 = np.random.randint(0, len(points)) p2 = get_closest_index(points, p1, prob_include=.5) mix_weight = np.random.rand() result = points[p1]*mix_weight + points[p2]*(1-mix_weight) return result def get_closest_index(points, index, prob_include=1): min_distance = 1000 closest_index = [] for i in range(len(points)): distance = np.linalg.norm(points[i] - points[index]) if distance < min_distance and i != index and np.random.rand() < prob_include: min_distance = distance closest_index = i return closest_index def get_points(param_filename): points = [] labels = [] for line in open(param_filename, "r"): vals = line.split(',') points.append([float(vals[0]), float(vals[1]), float(vals[2]), float(vals[3]), float(vals[4]), float(vals[5])]) labels.append(int(vals[6])) return np.array(points), labels def get_prob_label(points, labels, point, sigma_p=.01, sigma_a=(4*np.pi/180)): """ Gaussian kernel smoothing of success/failure to estimate success probability. """ sigma_p_inv = sigma_p**-1 sigma_a_inv = sigma_a**-1 sigma_inv = np.diag([sigma_p_inv, sigma_p_inv, sigma_p_inv, sigma_a_inv, sigma_a_inv, sigma_a_inv]) differences = points - point weights = np.zeros(len(labels)) for i in range(len(labels)): weights[i] = np.exp( -(1./2) * np.dot(differences[i,:], np.dot(sigma_inv, differences[i,:])) ) estimate = np.sum(weights * np.array(labels).astype(float)) / np.sum(weights) confidence = np.sum(weights) # print(confidence) return estimate, confidence # def make_random_bowl_depths(): # shapes = ['24_bowl-02-Mar-2016-07-03-29', # '24_bowl-03-Mar-2016-22-54-50', # '24_bowl-05-Mar-2016-13-53-41', # '24_bowl-07-Mar-2016-05-06-04', # '24_bowl-16-Feb-2016-10-12-27', # '24_bowl-17-Feb-2016-22-00-34', # '24_bowl-24-Feb-2016-17-38-53', # '24_bowl-26-Feb-2016-08-35-29', # '24_bowl-27-Feb-2016-23-52-43', # '24_bowl-29-Feb-2016-15-01-53'] # # # shapes = ['24_bowl-02-Mar-2016-07-03-29'] # # n = 10000 # for shape in shapes: # depths, labels = make_random_depths('../data/obj_files/' + shape + '.obj', # '../data/params/' + shape + '.csv', # n, im_size=(40,40)) # # f = file('../data/' + shape + '-random.pkl', 'wb') # cPickle.dump((depths, labels), f) # f.close() # def check_random_bowl_depths(): # # # shapes = ['24_bowl-02-Mar-2016-07-03-29', # # '24_bowl-03-Mar-2016-22-54-50', # # '24_bowl-05-Mar-2016-13-53-41', # # '24_bowl-07-Mar-2016-05-06-04', # # '24_bowl-16-Feb-2016-10-12-27', # # '24_bowl-17-Feb-2016-22-00-34', # # '24_bowl-24-Feb-2016-17-38-53', # # '24_bowl-26-Feb-2016-08-35-29', # # '24_bowl-27-Feb-2016-23-52-43', # # '24_bowl-29-Feb-2016-15-01-53'] # # shapes = ['24_bowl-02-Mar-2016-07-03-29'] # # f = file('../data/' + shapes[0] + '-random.pkl', 'rb') # (depths, labels) = cPickle.load(f) # f.close() # # print(labels) # # import matplotlib.pyplot as plt # from mpl_toolkits.mplot3d import axes3d, Axes3D # # depths = depths.astype(float) # depths[depths > np.max(depths.flatten()) - 1] = np.NaN # # X = np.arange(0, depths.shape[1]) # Y = np.arange(0, depths.shape[2]) # X, Y = np.meshgrid(X, Y) # fig = plt.figure(figsize=(12,6)) # ax1 = fig.add_subplot(1, 2, 1, projection='3d') # plt.xlabel('x') # ax2 = fig.add_subplot(1, 2, 2, projection='3d') # plt.xlabel('x') # # ax = Axes3D(fig) # # for i in range(depths.shape[0]): # s = 5 #pixel stride # for i in range(n): # if labels[i] > .5: # color = 'g' # ax = ax1 # ax.plot_wireframe(X[::s,::s], Y[::s,::s], depths[i,::s,::s], color=color) # else: # color = 'r' # ax = ax2 # if np.random.rand(1) < .5: # ax.plot_wireframe(X[::s,::s], Y[::s,::s], depths[i,::s,::s], color=color) # # plt.title(str(i) + ': ' + str(labels[i])) # plt.show() def plot_box_corners(): verts, faces = loadOBJ('../data/support-box.obj') verts = np.array(verts) print(verts.shape) import matplotlib.pyplot as plt from mpl_toolkits.mplot3d import axes3d, Axes3D fig = plt.figure() ax = fig.add_subplot(1, 2, 1, projection='3d') ax.scatter(verts[:,0], verts[:,1], verts[:,2]) plt.show() # def save_bowl_and_box_depths(): # shapes = [ # '24_bowl-16-Feb-2016-10-12-27', # '24_bowl-17-Feb-2016-22-00-34', # '24_bowl-24-Feb-2016-17-38-53', # '24_bowl-26-Feb-2016-08-35-29', # '24_bowl-27-Feb-2016-23-52-43', # '24_bowl-29-Feb-2016-15-01-53'] # # import time # for shape in shapes: # print('Processing ' + shape) # start_time = time.time() # depths, labels = make_depth_from_gripper('../data/obj_files/' + shape + '.obj', # '../data/params/' + shape + '.csv', # bottom=0.2) # box_depths, _ = make_depth_from_gripper('../data/support-box.obj', # '../data/params/' + shape + '.csv', # bottom=0) # f = file('../data/depths/' + shape + '.pkl', 'wb') # cPickle.dump((depths, box_depths, labels), f) # f.close() # print(' ' + str(time.time() - start_time) + 's') def check_bowl_and_box_variance(): f = file('../data/depths/' + '24_bowl-16-Feb-2016-10-12-27' + '.pkl', 'rb') depths, box_depths, labels = cPickle.load(f) f.close() # print(labels) # print(depths.shape) # print(box_depths.shape) obj_sd = [] box_sd = [] for i in range(len(labels)): obj_sd.append(np.std(depths[i,:,:].flatten())) box_sd.append(np.std(box_depths[i,:,:].flatten())) import matplotlib.pyplot as plt plt.plot(obj_sd) plt.plot(box_sd) plt.show() def plot_bowl_and_box_distance_example(): f = file('../data/depths/' + '24_bowl-16-Feb-2016-10-12-27' + '.pkl', 'rb') depths, box_depths, labels = cPickle.load(f) f.close() from depthmap import get_distance distances = get_distance(depths, .2, 1.0) box_distances = get_distance(box_depths, .2, 1.0) distances[distances > .99] = None box_distances[box_distances > .99] = None from mpl_toolkits.mplot3d import axes3d, Axes3D X = np.arange(0, depths.shape[1]) Y = np.arange(0, depths.shape[2]) X, Y = np.meshgrid(X, Y) fig = plt.figure() ax = fig.add_subplot(1, 1, 1, projection='3d') ax.plot_wireframe(X, Y, distances[205,:,:], color='b') ax.plot_wireframe(X, Y, box_distances[205,:,:], color='r') plt.show() def load_depth_image(directory, object, index): imfile = directory + object + str(index) + '.png' image = scipy.ndimage.imread(imfile, flatten=True) def get_pos_rot(objects, gripper_pos, gripper_orient, obj): """ Get positions and rotation matrices for a given object, from a parameter list for all objects. """ pos = [] rot = [] for i in range(len(objects)): if objects[i] == obj: pos.append(gripper_pos[i]) rot.append(rot_matrix(gripper_orient[i][0], gripper_orient[i][1], gripper_orient[i][2])) return np.array(pos), np.array(rot) def process_directory(obj_dir, image_dir, support=False): from os import listdir from os.path import isfile, join import time objects, gripper_pos, gripper_orient, labels = load_all_params('../../grasp-conv/data/output_data.csv') bottom = 0 if support else 0.2 for f in listdir(obj_dir): obj_filename = join(obj_dir, f) if isfile(obj_filename) and f.endswith('.obj'): print('Processing ' + f) start_time = time.time() pos, rot = get_pos_rot(objects, gripper_pos, gripper_orient, f) make_depth_images(f[:-4], pos, rot, obj_dir, image_dir, bottom=bottom, support=support) print(' ' + str(time.time()-start_time) + 's') def calculate_grasp_metrics_for_directory(image_dir, im_width=80, camera_offset=.45, near_clip=.25, far_clip=.8): from os import listdir from os.path import isfile, join import time from heuristic import finger_path_template from heuristic import calculate_grip_metrics template = finger_path_template(45.*np.pi/180., im_width, camera_offset) all_intersections = [] all_qualities = [] all_files = [] for f in listdir(image_dir): image_filename = join(image_dir, f) if isfile(image_filename) and f.endswith('.png'): # print('Processing ' + image_filename) image = scipy.misc.imread(image_filename) rescaled_distance = image / 255.0 distance = rescaled_distance*(far_clip-camera_offset)+camera_offset # from mpl_toolkits.mplot3d import axes3d, Axes3D # X = np.arange(0, im_width) # Y = np.arange(0, im_width) # X, Y = np.meshgrid(X, Y) # fig = plt.figure() # distance[distance > camera_offset + .3] = None # template[template < camera_offset] = None # ax = fig.add_subplot(1,1,1,projection='3d') # ax.plot_wireframe(X, Y, distance) # ax.plot_wireframe(X, Y, template, color='r') # ax.set_xlabel('x') # plt.show() intersections, qualities = calculate_grip_metrics(distance, template) # print(intersections) # print(qualities) all_intersections.append(intersections) all_qualities.append(qualities) all_files.append(f) return all_intersections, all_qualities, all_files def calculate_grasp_metric_maps_for_directory(image_dir, dest_dir, im_width=80, camera_offset=.45, near_clip=.25, far_clip=.8): from os import listdir from os.path import isfile, join from heuristic import finger_path_template finger_path = finger_path_template(45.*np.pi/180., im_width, camera_offset) for f in listdir(image_dir): image_filename = join(image_dir, f) if isfile(image_filename) and f.endswith('.png'): print('Processing ' + image_filename) image = scipy.misc.imread(image_filename) rescaled_distance = image / 255.0 distance = rescaled_distance*(far_clip-camera_offset)+camera_offset mm = calculate_metric_map(distance, finger_path, 1) imfile = dest_dir + f[:-4] + '-map' + '.png' Image.fromarray((255.0*mm).astype('uint8')).save(imfile) def calculate_overlap_for_directory(image_dir, dest_dir, im_width=80, camera_offset=.45, far_clip=.8): from os import listdir from os.path import isfile, join from heuristic import finger_path_template finger_path = finger_path_template(45.*np.pi/180., im_width, camera_offset) c = 0 for f in listdir(image_dir): image_filename = join(image_dir, f) if isfile(image_filename) and f.endswith('.png'): if c % 1000 == 0: print('Processing ' + image_filename) c += 1 image = scipy.misc.imread(image_filename) rescaled_distance = image / 255.0 distance = rescaled_distance*(far_clip-camera_offset)+camera_offset overlap = np.maximum(0, finger_path - distance) imfile = dest_dir + f[:-4] + '-overlap' + '.png' # we divide by 15.4cm because it's the max overlap due to gripper geometry Image.fromarray((255.0/.154*overlap).astype('uint8')).save(imfile) def compress_images(directory, extension, name='zip'): """ We need this to transfer data to server. """ from os import listdir from os.path import isfile, join from zipfile import ZipFile n_per_zip = 50000 # with ZipFile('zip-all.zip', 'w') as zf: # for f in listdir(directory): # image_filename = join(directory, f) # if isfile(image_filename) and f.endswith(extension): # zf.write(image_filename) zip_index = 0 file_index = 0 for f in listdir(directory): image_filename = join(directory, f) if isfile(image_filename) and f.endswith(extension): if file_index == 0: zf = ZipFile(name + str(zip_index) + '.zip', 'w') zf.write(image_filename) file_index += 1 if file_index == n_per_zip: print('writing file ' + str(zip_index)) file_index = 0 zf.close() zip_index += 1 zf.close() if __name__ == '__main__': # save_bowl_and_box_depths() # plot_bowl_and_box_distance_example() # compress_images('../../grasp-conv/data/support_depths/', '.png') # compress_images('../../grasp-conv/data/obj_depths/', '.png') # compress_images('../../grasp-conv/data/obj_mm/', '.png') # compress_images('../../grasp-conv/data/support_overlap/', '.png', name='support-overlap') # compress_images('../../grasp-conv/data/obj_overlap/', '.png', name='obj-overlap') compress_images('/Volumes/TrainingData/grasp-conv/data/eye-perspectives', '.png', name='eye-perspectives') # calculate_grasp_metric_maps_for_directory('../../grasp-conv/data/obj_depths/', '../../grasp-conv/data/obj_mm/') # image = scipy.misc.imread('../../grasp-conv/data/obj_mm/104_toaster_final-18-Dec-2015-13-56-59-0-map.png') # mm = image / 255.0 # print(np.min(mm)) # print(np.max(mm)) # objects, gripper_pos, gripper_orient, labels = load_all_params('../../grasp-conv/data/output_data.csv') # obj_dir = '../../grasp-conv/data/obj_files/' # process_directory(obj_dir, '../../grasp-conv/data/obj_depths/') # # process_directory(obj_dir, '../../grasp-conv/data/support_depths/', support=True) # # # intersections, qualities, files = calculate_grasp_metrics_for_directory('../../grasp-conv/data/support_depths/') # intersections, qualities, files = calculate_grasp_metrics_for_directory('../../grasp-conv/data/obj_depths/') # f = file('../data/metrics-objects.pkl', 'wb') # cPickle.dump((intersections, qualities, files), f) # f.close() # calculate_overlap_for_directory('../../grasp-conv/data/obj_depths/', '../../grasp-conv/data/obj_overlap/') # calculate_overlap_for_directory('../../grasp-conv/data/support_depths/', '../../grasp-conv/data/support_overlap/') # f = file('metrics.pkl', 'rb') # intersections, qualities = cPickle.load(f) # f.close() # print(intersections) # print(qualities) # from mpl_toolkits.mplot3d import axes3d, Axes3D # X = np.arange(0, 80) # Y = np.arange(0, 80) # X, Y = np.meshgrid(X, Y) # fig = plt.figure() # ax = fig.add_subplot(1,1,1,projection='3d') # ax.plot_wireframe(X, Y, foo) # ax.set_xlabel('x') # plt.show()
{ "repo_name": "bptripp/grasp-convnet", "path": "py/data.py", "copies": "1", "size": "26522", "license": "mit", "hash": 8336879002755659000, "line_mean": 36.4076163611, "line_max": 132, "alpha_frac": 0.5748058216, "autogenerated": false, "ratio": 2.9613666815542654, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.9028794386960786, "avg_score": 0.0014756232386961279, "num_lines": 709 }
__author__ = 'bptripp' import time import numpy as np import matplotlib matplotlib.rcParams['xtick.labelsize'] = 18 matplotlib.rcParams['ytick.labelsize'] = 18 import matplotlib.pyplot as plt from cnn_stimuli import get_image_file_list from alexnet import preprocess, load_net, load_vgg scales = np.logspace(np.log10(.05), np.log10(1.2), 45) #copied from cnn_stimuli (bad idea!) model = load_net(weights_path='../weights/alexnet_weights.h5') use_vgg = False # model = load_vgg(weights_path='../weights/vgg16_weights.h5') # use_vgg=True # if use_vgg: # model = load_vgg(weights_path='../weights/vgg16_weights.h5', remove_level=remove_levels[i]) # else: # model = load_net(weights_path='../weights/alexnet_weights.h5', remove_level=remove_levels[i]) def correlations(out): cc = np.corrcoef(out.T) result = [] for i in range(cc.shape[0]): for j in range(i+1,cc.shape[1]): result.append(cc[i][j]) return result def invariant(out): #dims: object, size # return np.mean([cc[0,1], cc[0,2], cc[1,2]]) > .7 # return np.mean([cc[0,1], cc[0,2], cc[1,2]]) > .5 return np.mean(correlations(out)) > .75 def clear_preference(out): # one size is clearly preferred in that it elicits a stronger response for each shape max_ind = np.argmax(out, axis=1) # print(max_ind) return np.max(np.abs(np.diff(max_ind))) == 0 def bandwidth(scales, responses): peak_ind = np.argmax(responses) peak = responses[peak_ind] top = peak_ind for i in range(peak_ind, len(responses)): if responses[i] > peak/2: top = i else: break bottom = peak_ind for i in range(peak_ind, -1, -1): if responses[i] > peak/2: bottom = i else: break result = np.log2(scales[top] / scales[bottom]) # print('bandwidth') # print(peak_ind) # print(bottom) # print(top) # print(result) return result if False: # plot Schwartz et al. (1983) example deg13 = np.loadtxt(open('../data/deg13.csv', 'rb'), delimiter=',') deg28 = np.loadtxt(open('../data/deg28.csv', 'rb'), delimiter=',') deg50 = np.loadtxt(open('../data/deg50.csv', 'rb'), delimiter=',') o = np.zeros((6,3)) o[:,0] = deg13[:,1] o[:,1] = deg28[:,1] o[:,2] = deg50[:,1] plt.figure(figsize=(4,3.5)) plt.plot(range(1,7), o) plt.tight_layout() plt.xlabel('Stimulus #', fontsize=18) plt.ylabel('Response (spikes/s)', fontsize=18) plt.tight_layout() plt.savefig('../figures/size-schwartz-example.eps') plt.show() # plt.semilogx([2, 4, 8, 16, 32, 64], o) print('Schwartz correlation ' + str(np.mean(correlations(o)))) if False: # plot mean correlations and fraction with clear preference layers = [-2, -1, 0] plt.figure(figsize=(4,3.5)) alexnet_correlations = [0.495586845637, 0.530755560076, 0.721706983642] vgg_correlations = [0.444102093071, 0.524417339524, 0.613046758844] schwartz_correlation = 0.958892832321 plt.plot(layers, alexnet_correlations) plt.plot(layers, vgg_correlations) plt.plot(layers, schwartz_correlation*np.array([1, 1, 1]), 'k--') plt.xlabel('Distance from output (layers)', fontsize=16) plt.ylabel('Mean correlation', fontsize=16) plt.xticks([-2,-1,0]) plt.ylim([0, 1]) plt.tight_layout() plt.savefig('../figures/size-correlations.eps') plt.show() plt.figure(figsize=(4,3.5)) alexnet_fractions = [0.03125, 0.046875, 0.03125] vgg_fractions = [0.0625, 0.046875, 0.015625] plt.plot(layers, alexnet_fractions) plt.plot(layers, vgg_fractions) plt.xlabel('Distance from output (layers)', fontsize=16) plt.ylabel('Fraction with preference', fontsize=16) plt.xticks([-2,-1,0]) plt.ylim([0, 1]) plt.tight_layout() plt.savefig('../figures/size-preferences.eps') plt.show() if True: use_vgg = True remove_level = 0 if use_vgg: model = load_vgg(weights_path='../weights/vgg16_weights.h5', remove_level=remove_level) else: model = load_net(weights_path='../weights/alexnet_weights.h5', remove_level=remove_level) out = [] stimuli = ['f1', 'f2', 'f3', 'f4', 'f5', 'f6'] for stimulus in stimuli: image_files = get_image_file_list('./images/scales/' + stimulus, 'png', with_path=True) im = preprocess(image_files, use_vgg=use_vgg) out.append(model.predict(im)) out = np.array(out) print(out.shape) # plot invariance with Schwartz stimuli i = 0 c = 0 n_invariant = 0 n_clear = 0 mean_correlations = [] while c < 64: plt.subplot(8,8,c+1) o = out[:,:,i] # if np.max(o) > .1: if np.max(o) > 1: plt.plot(o) yl = plt.gca().get_ylim() if invariant(o): n_invariant = n_invariant + 1 plt.text(4.3, yl[0] + (yl[1]-yl[0])*.8, 'c', fontsize=14) if clear_preference(o): n_clear = n_clear + 1 plt.text(.1, yl[0] + (yl[1]-yl[0])*.8, 'p', fontsize=14) mean_correlations.append(np.mean(correlations(o))) plt.xticks([]) plt.yticks([]) c = c + 1 i = i + 1 print(mean_correlations) print('fraction with preference ' + str(float(n_clear)/64.)) print('mean correlation ' + str(np.nanmean(mean_correlations))) plt.tight_layout() net = 'vgg16' if use_vgg else 'alexnet' plt.savefig('../figures/size-invariance-' + net + '-' + str(remove_level) + '.eps') plt.show() if False: #plot invariance with naturalistic stimuli size_ind = (25,30,34) # roughly matched with Schwartz et al. (see cnn_stimuli) i = 0 c = 0 n_invariant = 0 # for i in range(9): while c < 64: plt.subplot(8,8,c+1) o = out[:,size_ind,i] if np.max(o) > .1: plt.plot(o) # print(out[:,size_ind,i]) # print(invariant(o)) if invariant(o): n_invariant = n_invariant + 1 plt.text(1.8, np.max(o)*.7, '*', fontsize=16) plt.xticks([]) plt.yticks([]) # plt.title(str(i) + ' ' + str(invariant(o))) c = c + 1 i = i + 1 print(n_invariant) plt.tight_layout() plt.savefig('../figures/size-invariance.eps') plt.show() if False: # plot example tuning curves # image_files = get_image_file_list('./images/scales/banana', 'png', with_path=True) # image_files = get_image_file_list('./images/scales/shoe', 'png', with_path=True) image_files = get_image_file_list('./images/scales/corolla', 'png', with_path=True) im = preprocess(image_files, use_vgg=use_vgg) object_responses = model.predict(im) # object_responses = np.squeeze(out[0,:,:]) maxima = np.max(object_responses, axis=0) n = 50 ind = (-maxima).argsort()[:n] plt.plot(scales, object_responses[:,ind]) prefs = np.zeros(n) for i in range(n): bandwidth(scales, object_responses[:,ind[i]]) prefs[i] = scales[np.argmax(object_responses[:,ind[i]])] plt.show() plt.hist(prefs) plt.show() def get_max_indices(object_responses, n=500): maxima = np.max(object_responses, axis=0) return (-maxima).argsort()[:n] def get_bandwidth(object_responses, ind): n = len(ind) bandwidths = np.zeros(n) prefs = np.zeros(n) for i in range(n): size_tuning_curve = object_responses[:,ind[i]] bandwidths[i] = bandwidth(scales, size_tuning_curve) prefs[i] = scales[np.argmax(size_tuning_curve)] return bandwidths, prefs if False: data = np.loadtxt(open('../data/ito.csv', 'rb'), delimiter=',') bandwidths = np.squeeze(data[:,1]) bandwidths[bandwidths>3.95] = 4.01 #these are on the line print(bandwidths) fs = 18 hist_edges = [x * .5 for x in range(13)] plt.figure(figsize=(3,3)) plt.hist(bandwidths[bandwidths<4], hist_edges) plt.hist(bandwidths[bandwidths>=4], hist_edges, color=[1,0,0]) plt.xlabel('Size BW (Octaves)', fontsize=fs) plt.ylabel('Frequency', fontsize=fs) plt.tight_layout() plt.savefig('../figures/bandwidth-ito.eps') plt.show() if False: # plot histograms of bandwidth and preferred size out = [] image_files = get_image_file_list('./images/scales/banana', 'png', with_path=True) im = preprocess(image_files, use_vgg=use_vgg) out.append(model.predict(im)) image_files = get_image_file_list('./images/scales/shoe', 'png', with_path=True) im = preprocess(image_files, use_vgg=use_vgg) out.append(model.predict(im)) image_files = get_image_file_list('./images/scales/corolla', 'png', with_path=True) im = preprocess(image_files, use_vgg=use_vgg) out.append(model.predict(im)) out = np.array(out) fs = 18 hist_edges = [x * .5 for x in range(13)] plt.figure(figsize=(3,3)) n = 200 bandwidths = np.zeros((3*n)) for i in range(3): # plt.subplot(1,3,i+1) object_responses = np.squeeze(out[i,:,:]) ind = get_max_indices(object_responses, n=200) bandwidths[n*i:n*(i+1)], prefs = get_bandwidth(object_responses, ind) plt.hist(bandwidths, hist_edges) plt.xlabel('Size BW (Octaves)', fontsize=fs) plt.ylabel('Frequency', fontsize=fs) plt.tight_layout() if use_vgg: plt.savefig('../figures/bandwidth-vgg16.eps') else: plt.savefig('../figures/bandwidth-alexnet.eps') plt.show() # print('preferences mean: ' + str(np.mean(prefs))) # print('preferences min: ' + str(np.min(prefs))) # print('preferences max: ' + str(np.max(prefs))) # print('bandwidth mean: ' + str(np.mean(bandwidths))) # print('bandwidth max: ' + str(np.max(bandwidths))) # plt.figure(figsize=(10,3)) # plt.subplot(1,2,1) # plt.hist(prefs, 8) # plt.xlabel('Preferred Scale', fontsize=fs) # plt.ylabel('Frequency', fontsize=fs) # plt.subplot(1,2,2) # plt.hist(bandwidths, 10) # plt.xlabel('Size BW (Octaves)', fontsize=fs) # plt.ylabel('Frequency', fontsize=fs) # plt.tight_layout() # plt.savefig('../figures/bandwidth.eps') # plt.show()
{ "repo_name": "bptripp/it-cnn", "path": "tuning/size.py", "copies": "1", "size": "10236", "license": "mit", "hash": -2986005213834400300, "line_mean": 30.4953846154, "line_max": 99, "alpha_frac": 0.5980851895, "autogenerated": false, "ratio": 3.023929098966027, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.41220142884660266, "avg_score": null, "num_lines": null }
__author__ = 'bptripp' # Just like perspective_model, but with ray-based metrics instead of depth map-based metrics as targets. from os import listdir from os.path import isfile, join import cPickle import numpy as np import scipy from keras.models import Sequential from keras.layers.core import Dense, Flatten, Dropout, Activation from keras.layers.convolutional import Convolution2D, MaxPooling2D from keras.optimizers import Adam from keras.models import model_from_json from keras.regularizers import activity_l2 num_outputs = 25 def get_model(): model = Sequential() model.add(Convolution2D(64, 7, 7, input_shape=(1,80,80), init='glorot_normal', border_mode='same', activity_regularizer=activity_l2(0.0000001))) model.add(Activation('relu')) model.add(Convolution2D(64, 3, 3, init='glorot_normal', border_mode='same', activity_regularizer=activity_l2(0.0000001))) model.add(Activation('relu')) model.add(Convolution2D(64, 3, 3, init='glorot_normal', border_mode='same', activity_regularizer=activity_l2(0.0000001))) model.add(Activation('relu')) model.add(MaxPooling2D((2,2))) model.add(Flatten()) model.add(Dense(256, activity_regularizer=activity_l2(0.0000001))) model.add(Activation('relu')) model.add(Dropout(.5)) model.add(Dense(1024, activity_regularizer=activity_l2(0.0000001))) model.add(Activation('relu')) model.add(Dropout(.5)) model.add(Dense(num_outputs)) adam = Adam(lr=0.000001, beta_1=0.9, beta_2=0.999, epsilon=1e-08) model.compile(loss='mse', optimizer=adam) return model def load_model(weights_file='p2-model-weights.h5'): model = model_from_json(open('p2-model-architecture-25-reg.json').read()) model.load_weights(weights_file) adam = Adam(lr=0.000001, beta_1=0.9, beta_2=0.999, epsilon=1e-08) model.compile(loss='mse', optimizer=adam) return model def load_data(): import csv objects = [] with open('../data/eye-perspectives-objects.csv') as f: reader = csv.reader(f, delimiter=',') for row in reader: objects.append(row[0]) image_filenames = [] for i in range(len(objects)): case = i % 200 target = case / 20 eye = case % 20 fn = objects[i][:-4] + '-' + str(target) + '-' + str(eye) + '.png' image_filenames.append(fn) neuron_metrics = [] with open('../data/ray-metrics.csv') as f: reader = csv.reader(f, delimiter=',') for row in reader: neuron_metrics.append(row) neuron_metrics = np.array(neuron_metrics) return image_filenames, neuron_metrics[:,:num_outputs] def get_input(image_dir, image_file): image = scipy.misc.imread(join(image_dir, image_file)) return np.array(image / 255.0) def get_XY(image_dir, image_filenames, neuron_metrics, indices): X = [] Y = [] for ind in indices: X.append(get_input(image_dir, image_filenames[ind])[np.newaxis,:]) Y.append(neuron_metrics[ind]) return np.array(X), np.array(Y) def train_model(model, image_dir, train_indices, valid_indices): image_filenames, neuron_metrics = load_data() print(len(image_filenames)) X_valid, Y_valid = get_XY(image_dir, image_filenames, neuron_metrics, valid_indices) def generate_XY(): while 1: batch_X = [] batch_Y = [] for i in range(32): ind = train_indices[np.random.randint(len(train_indices))] X = get_input(image_dir, image_filenames[ind]) Y = neuron_metrics[ind] batch_X.append(X[np.newaxis,:]) batch_Y.append(Y) yield (np.array(batch_X), np.array(batch_Y)) for i in range(11,16): h = model.fit_generator(generate_XY(), samples_per_epoch=8192, nb_epoch=100, validation_data=(X_valid, Y_valid)) with file('p2-history-25-reg-' + str(i) + '.pkl', 'wb') as f: cPickle.dump(h.history, f) json_string = model.to_json() open('p2-model-architecture-25-reg.json', 'w').write(json_string) model.save_weights('p2-model-weights-25-reg-' + str(i) + '.h5', overwrite=True) def predict(model, image_dir, indices): image_filenames, neuron_metrics = load_data() X, Y = get_XY(image_dir, image_filenames, neuron_metrics, indices) return Y, model.predict(X, batch_size=32, verbose=0) if __name__ == '__main__': # image_filenames, neuron_metrics = load_data() valid_indices = np.arange(0, 50000, 100) s = set(valid_indices) train_indices = [x for x in range(70000) if x not in s] #model = get_model() model = load_model(weights_file='p2-model-weights-25-reg-10.h5') train_model(model, '../../grasp-conv/data/eye-perspectives', train_indices, valid_indices) #model = load_model(weights_file='p2-model-weights-big-reg-12.h5') #targets, predictions = predict(model, # '../../grasp-conv/data/eye-perspectives', # valid_indices) #with open('perspective-predictions-big-reg-12.pkl', 'wb') as f: # cPickle.dump((targets, predictions), f)
{ "repo_name": "bptripp/grasp-convnet", "path": "py/perspective_model2.py", "copies": "1", "size": "5197", "license": "mit", "hash": -7916265495153750000, "line_mean": 33.1907894737, "line_max": 148, "alpha_frac": 0.6313257649, "autogenerated": false, "ratio": 3.268553459119497, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.4399879224019497, "avg_score": null, "num_lines": null }
__author__ = 'bptripp' """ Bertsekas' Auction Algorithm. This is a nearly line-by-line port of the Matlab implementation by Florian Bernard: http://www.mathworks.com/matlabcentral/fileexchange/48448-fast-linear-assignment-problem-using-auction-algorithm And this is a nice introduction to the algorithm: Bertsekas, D. P. (1990). The Auction Algorithm for Assignment and Other Network Flow Problems: A Tutorial. Interfaces, 20(4) Bernard's Matlab code is distributed under the BSD License, as follows: Copyright (c) 2014, Florian Bernard All rights reserved. Redistribution and use in source and binary forms, with or without modification, are permitted provided that the following conditions are met: * Redistributions of source code must retain the above copyright notice, this list of conditions and the following disclaimer. * Redistributions in binary form must reproduce the above copyright notice, this list of conditions and the following disclaimer in the documentation and/or other materials provided with the distribution THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. This code is also distributed under the BSD License, Copyright (2015) Bryan Tripp. Note that Bertsekas's Fortran code is also online: http://www.mit.edu/~dimitrib/auction.txt """ import time import numpy as np def auction(A, epsilon=None, epsilonDecreaseFactor=None): """ Parameters ---------- :param A: :param epsilon: :param epsilonDecreaseFactor: Returns ------- :return assignments: best assignment per row of A :return prices: """ N = A.shape[0] prices = np.ones(N) A = A * N+1 # heuristic for setting epsilon if epsilon is None: # epsilon = np.max(np.abs(A[:])) / 25.0 #this sometimes make us skip the loop epsilon = np.maximum(1, np.max(np.abs(A[:])) / 15.0) if epsilonDecreaseFactor is None: epsilonDecreaseFactor = 0.2 while epsilon >= 1: # The outer loop performs epsilon-scaling in order to speed up execution # time. In particular, an updated prices array is computed in each # round, which speeds up further rounds with lower values of epsilon. assignments = np.empty(N) assignments[:] = np.NAN while np.any(np.isnan(assignments)): # Forward-Auction Algorithm -- Bidding Phase # find unassigned indices unassignedIdx, = np.nonzero(np.isnan(assignments)) nUnassigned = len(unassignedIdx) # find best and second best objects AijMinusPj = A[unassignedIdx, :] - prices viIdx = np.argmax(AijMinusPj, axis=1) for i in range(nUnassigned): AijMinusPj[i][viIdx[i]] = -np.Inf # print(AijMinusPj) wi = np.max(AijMinusPj, axis=1) # compute bids bids = np.empty(nUnassigned) bids[:] = np.NAN for i in range(nUnassigned): bids[i] = A[unassignedIdx[i], viIdx[i]] - wi[i] + epsilon # Assignment Phase objectsThatHaveBeenBiddedFor = np.unique(viIdx) for uniqueObjIdx in range(len(objectsThatHaveBeenBiddedFor)): currObject = objectsThatHaveBeenBiddedFor[uniqueObjIdx] personssWhoGaveBidsForJ = np.nonzero(viIdx==currObject) b = bids[personssWhoGaveBidsForJ] idx = np.argmax(b) prices[currObject] = b[idx] personWithHighestBid = unassignedIdx[personssWhoGaveBidsForJ[0][idx]] # remove previous assignment and store new assignment (person with highest bid) assignments[assignments==currObject] = np.NaN assignments[personWithHighestBid] = currObject # print(assignments) epsilon = epsilon * epsilonDecreaseFactor # refine epsilon return assignments, prices if __name__ == '__main__': A = np.array([[5, 9, 2], [10, 3, 2], [8, 7, 4]]) print(A) start_time = time.time() assignments, prices = auction(A) print(assignments) print('auction time: ' + str(time.time() - start_time))
{ "repo_name": "bptripp/it-cnn", "path": "auction.py", "copies": "1", "size": "4988", "license": "mit", "hash": 1182420263333599700, "line_mean": 36.223880597, "line_max": 116, "alpha_frac": 0.6595829992, "autogenerated": false, "ratio": 3.996794871794872, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 1, "avg_score": 0.0014786096196599246, "num_lines": 134 }
__author__ = 'bptripp' """ The input to this network isn't depth maps, but rather a group of hand-engineered features. """ import csv import numpy as np from os.path import join import scipy import cPickle from keras.models import Sequential from keras.layers.core import Dense, Dropout, Activation from keras.optimizers import Adam from data import load_all_params model = Sequential() model.add(Dense(256, input_shape=[25])) model.add(Activation('relu')) model.add(Dropout(.25)) model.add(Dense(256)) model.add(Activation('relu')) model.add(Dropout(.25)) model.add(Dense(1)) model.add(Activation('sigmoid')) adam = Adam(lr=0.0001, beta_1=0.9, beta_2=0.999, epsilon=1e-08) model.compile(loss='binary_crossentropy', optimizer=adam) labels = [] features = [] with open('correlates.csv', 'rb') as csvfile: r = csv.reader(csvfile, delimiter=',') for row in r: labels.append(row[0]) features.append(row[1:]) labels = np.array(labels).astype(float) features = np.array(features).astype(float) # normalize features ... for i in range(features.shape[1]): features[:,i] = features[:,i] - np.mean(features[:,i]) features[:,i] = features[:,i] / np.std(features[:,i]) n = len(labels) validation_indices = np.random.randint(0, n, 500) s = set(validation_indices) train_indices = [x for x in range(n) if x not in s] Y_valid = labels[validation_indices,np.newaxis] X_valid = features[validation_indices,:] Y_train = labels[train_indices,np.newaxis] X_train = features[train_indices,:] # print(Y_valid.shape) # print(X_valid.shape) # print(Y_train.shape) # print(X_train.shape) h = model.fit(X_train, Y_train, nb_epoch=500, validation_data=(X_valid, Y_valid))
{ "repo_name": "bptripp/grasp-convnet", "path": "py/correlates_model.py", "copies": "1", "size": "1688", "license": "mit", "hash": 6371515681995578000, "line_mean": 26.6721311475, "line_max": 91, "alpha_frac": 0.7049763033, "autogenerated": false, "ratio": 2.9770723104056436, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.9163860625861889, "avg_score": 0.0036375975687508604, "num_lines": 61 }
__author__ = 'bptripp' """ The input to this network isn't depth maps, but rather depth of overlap between object / support and gripper finger trajectory. """ import numpy as np from os.path import join import scipy import cPickle from keras.models import Sequential from keras.layers.convolutional import Convolution2D, MaxPooling2D from keras.layers.core import Dense, Dropout, Activation, Flatten from keras.optimizers import Adam from data import load_all_params model = Sequential() model.add(Convolution2D(64, 7, 7, input_shape=(2,80,16), init='glorot_normal', border_mode='same')) model.add(Activation('relu')) model.add(Convolution2D(64, 3, 3, init='glorot_normal', border_mode='same')) model.add(Activation('relu')) model.add(Dropout(.5)) model.add(Convolution2D(64, 3, 3, init='glorot_normal', border_mode='same')) model.add(Activation('relu')) model.add(Dropout(.5)) model.add(Flatten()) model.add(Dense(1024)) model.add(Activation('relu')) model.add(Dropout(.5)) model.add(Dense(512)) model.add(Activation('relu')) model.add(Dropout(.5)) model.add(Dense(1)) model.add(Activation('sigmoid')) adam = Adam(lr=0.0001, beta_1=0.9, beta_2=0.999, epsilon=1e-08) model.compile(loss='binary_crossentropy', optimizer=adam) objects, gripper_pos, gripper_orient, labels = load_all_params('../../grasp-conv/data/output_data.csv') seq_nums = np.arange(len(objects)) % 1000 #exactly 1000 per object in above file (dated March 18) labels = np.array(labels)[:,np.newaxis] n = len(objects) validation_indices = np.random.randint(0, n, 5000) #TODO: generalize across objects s = set(validation_indices) train_indices = [x for x in range(n) if x not in s] f = file('o-valid-ind.pkl', 'wb') cPickle.dump(validation_indices, f) f.close() def get_input(object, seq_num): image_file = object[:-4] + '-' + str(seq_num) + '-overlap.png' X = [] image_dir = '../../grasp-conv/data/obj_overlap/' image = scipy.misc.imread(join(image_dir, image_file)) X.append(image[:,32:48] / 255.0) image_dir = '../../grasp-conv/data/support_overlap/' image = scipy.misc.imread(join(image_dir, image_file)) X.append(image[:,32:48] / 255.0) return np.array(X) Y_valid = labels[validation_indices,:] X_valid = [] for ind in validation_indices: X_valid.append(get_input(objects[ind], seq_nums[ind])) X_valid = np.array(X_valid) def generate_XY(): while 1: batch_X = [] batch_Y = [] for i in range(32): ind = train_indices[np.random.randint(len(train_indices))] Y = np.zeros((1)) Y[0] = labels[ind,0] X = get_input(objects[ind], seq_nums[ind]) #X = X[np.newaxis,:,:,:] batch_X.append(X) batch_Y.append(Y) yield (np.array(batch_X), np.array(batch_Y)) # X = get_input(objects[0], 0) # import matplotlib.pyplot as plt # fig = plt.figure(figsize=(10,5)) # ax = plt.subplot(1,2,1) # plt.imshow(X[0,:,:]) # ax = plt.subplot(1,2,2) # plt.imshow(X[1,:,:]) # plt.show() h = model.fit_generator(generate_XY(), samples_per_epoch=32768, nb_epoch=250, validation_data=(X_valid, Y_valid)) f = file('o-history.pkl', 'wb') cPickle.dump(h.history, f) f.close() json_string = model.to_json() open('o-model-architecture.json', 'w').write(json_string) model.save_weights('o-model-weights.h5', overwrite=True)
{ "repo_name": "bptripp/grasp-convnet", "path": "py/overlap_model.py", "copies": "1", "size": "3344", "license": "mit", "hash": 1837334114612783000, "line_mean": 28.8571428571, "line_max": 103, "alpha_frac": 0.6662679426, "autogenerated": false, "ratio": 2.8902333621434746, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.8996346266073552, "avg_score": 0.012031007733984416, "num_lines": 112 }
__author__ = 'bptripp' # Testing responses of pre-trained AlexNet for comparison with IT from keras.optimizers import SGD from keras.layers import Flatten import keras import numpy as np from convnetskeras.convnets import preprocess_image_batch, convnet def load_net(remove_last_layer=True, weights_path='weights/alexnet_weights.h5', units_to_keep=None, remove_level=1): sgd = SGD(lr=0.00001, decay=1e-6, momentum=0.9, nesterov=True) model = convnet('alexnet', weights_path=weights_path, heatmap=False) if remove_last_layer: pop(model) #activation if remove_level > 0: pop(model) #dense pop(model) #dropout if remove_level > 1: pop(model) #dense pop(model) #dropout # https://github.com/fchollet/keras/issues/2640 # although it looks like this is done correctly already model.layers[-1].outbound_nodes = [] model.outputs = [model.layers[-1].output] # this code is from Container.__init__ model.internal_output_shapes = [x._keras_shape for x in model.outputs] # for layer in model.layers: # print(layer) model.compile(optimizer=sgd, loss='mse') return model def load_vgg(remove_last_layer=True, weights_path='weights/vgg16_weights.h5', units_to_keep=None, remove_level=1): sgd = SGD(lr=0.00001, decay=1e-6, momentum=0.9, nesterov=True) model = convnet('vgg_16', weights_path=weights_path, heatmap=False) if remove_last_layer: pop(model) #activation if remove_level > 0: pop(model) #dense pop(model) #dropout if remove_level > 1: pop(model) #dense pop(model) #dropout if remove_level > 2: pop(model) #dense pop(model) #flatten model.add(Flatten(name='flatten')) if remove_level > 3: pop(model) #flatten added above pop(model) #maxpool pop(model) #conv pop(model) #zeropad pop(model) #conv pop(model) #zeropad pop(model) #conv pop(model) #zeropad model.add(Flatten(name='flatten')) if remove_level > 4: pop(model) #flatten added above pop(model) #maxpool pop(model) #conv pop(model) #zeropad pop(model) #conv pop(model) #zeropad pop(model) #conv pop(model) #zeropad model.add(Flatten(name='flatten')) # https://github.com/fchollet/keras/issues/2640 # although it looks like this is done correctly already model.layers[-1].outbound_nodes = [] model.outputs = [model.layers[-1].output] # this code is from Container.__init__ model.internal_output_shapes = [x._keras_shape for x in model.outputs] # for layer in model.layers: # print(layer) model.compile(optimizer=sgd, loss='mse') return model # adapted from https://github.com/fchollet/keras/issues/2371 def pop(model): '''Removes a layer instance on top of the layer stack. ''' if not model.outputs: raise Exception('Sequential model cannot be popped: model is empty.') else: model.layers.pop() if not model.layers: model.outputs = [] model.inbound_nodes = [] model.outbound_nodes = [] else: model.layers[-1].outbound_nodes = [] model.outputs = [model.layers[-1].output] model.built = False def preprocess(image_files, use_vgg=False): """ :param image_files: :return: array of image data with default params """ if use_vgg: return preprocess_image_batch(image_files, img_size=(256,256), crop_size=(224,224), color_mode="bgr") else: return preprocess_image_batch(image_files, img_size=(256,256), crop_size=(227,227), color_mode="rgb") # foo = np.moveaxis(foo, 1, 3) # print(foo.shape) if __name__ == '__main__': load_net(weights_path='./weights/alexnet_weights.h5', units_to_keep=100)
{ "repo_name": "bptripp/it-cnn", "path": "alexnet.py", "copies": "1", "size": "4129", "license": "mit", "hash": 5789811955364366000, "line_mean": 29.3602941176, "line_max": 116, "alpha_frac": 0.5957859046, "autogenerated": false, "ratio": 3.606113537117904, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.9630880579810598, "avg_score": 0.014203772381461288, "num_lines": 136 }
__author__ = 'brad' import pyaudio import wave import cStringIO class SoundStream(): def __init__(self, pya, address): if address is not None: self.file = wave.open(str(address), 'rb') self.pya = pya self.stream = None self.address = address self.chunk = 1024 self.channels = 2 self.complete = False def callback(self, in_data, frame_count, time_info, status): data = '' data = self.file.readframes(frame_count) if data == '': data = chr(0)*self.file.getnchannels()*self.file.getsampwidth()*frame_count if len(data) < self.file.getnchannels()*self.file.getsampwidth()*frame_count: length = self.file.getnchannels()*self.file.getsampwidth()*frame_count - len(data) data += chr(0) * length return data, pyaudio.paContinue def play(self, sound_file=None): if sound_file is not None: self.address = sound_file if self.stream is not None: self.stream.close() if self.address is not None: self.file = wave.open(str(self.address), 'rb') self.stream = self.pya.open(format=self.pya.get_format_from_width(self.file.getsampwidth()), channels=self.file.getnchannels(), rate=self.file.getframerate(), output=True, stream_callback=self.callback) def stop(self): self.stream.stop_stream() self.stream.close() def update(self): if self.stream is not None: if not self.stream.is_active(): self.stream.close() self.play() def destroy(self): self.stream.stop_stream() self.stream.close() class Sound(): def __init__(self, pya): self.file = None self.pya = pya self.stream = None self.chunk = 1024 self.channels = 2 self.complete = False def callback(self, in_data, frame_count, time_info, status): data = '' if not self.complete: data = self.file.readframes(frame_count) final_pos = self.file.data.tell() if data == '': data = self.file.silence*frame_count if len(data) < self.file.channels*self.file.width*frame_count: length = self.file.channels*self.file.width*frame_count - len(data) data += chr(0) * length if self.complete: self.complete = False return data, pyaudio.paComplete if final_pos == 0: self.complete = True return data, pyaudio.paContinue def play(self, sound_file): if self.stream is not None: self.stream.close() self.file = sound_file self.stream = self.pya.open(format=self.pya.get_format_from_width(sound_file.width), channels=sound_file.channels, rate=sound_file.framerate, output=True, stream_callback=self.callback) def stop(self): self.stream.stop_stream() self.stream.close() def destroy(self): self.stream.stop_stream() self.stream.close() class WaveFile(): def __init__(self, address): self.file = wave.open(address, 'rb') self.width = self.file.getsampwidth() self.channels = self.file.getnchannels() self.framerate = self.file.getframerate() self.silence = chr(0)*self.width*self.channels self.data = cStringIO.StringIO(self.file.readframes(self.file.getnframes())) self.file.close() self.complete = False def readframes(self, frame_count): data = self.data.read(frame_count*self.channels*self.width) if self.complete: self.data.seek(0) self.complete = False if self.data.tell() == len(self.data.getvalue()): self.complete = True return data
{ "repo_name": "branderson/PyZelda", "path": "src/engine/backend/sound.py", "copies": "1", "size": "4132", "license": "mit", "hash": 1642200993317907200, "line_mean": 33.4333333333, "line_max": 104, "alpha_frac": 0.5493707648, "autogenerated": false, "ratio": 3.980732177263969, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.5030102942063969, "avg_score": null, "num_lines": null }
__author__ = 'brad' import pygame import pyaudio import backend from ctypes import * from contextlib import contextmanager ERROR_HANDLER_FUNC = CFUNCTYPE(None, c_char_p, c_int, c_char_p, c_int, c_char_p) def py_error_handler(filename, line, function, err, fmt): pass c_error_handler = ERROR_HANDLER_FUNC(py_error_handler) @contextmanager def noalsaerr(): asound = cdll.LoadLibrary('libasound.so.2') asound.snd_lib_error_set_handler(c_error_handler) yield asound.snd_lib_error_set_handler(None) class ResourceManager(object): def __init__(self, force_pygame=True, force_pyaudio=True, muted=False): pygame.font.init() # pygame.mixer.init() self.sprites = {} self.music = {} self.sounds = {} self.fonts = {} self.force_pygame = force_pygame self.force_pyaudio = force_pyaudio self.muted = muted self.current_key = None with noalsaerr(): self.pya = pyaudio.PyAudio() self.sound_channels = 4 self.current_sounds = [backend.Sound(self.pya) for x in xrange(self.sound_channels)] self.sound_queue_index = 0 def add_image(self, key, image): self.sprites[key] = image def add_image_list(self, key, images): self.sprites[key] = images def add_image_file(self, key, filename): try: self.sprites[key] = pygame.image.load(filename).convert_alpha() return True except: return False def remove_image(self, key): del self.sprites[key] def add_image_file_list(self, key, filenames): self.sprites[key] = [] for filename in filenames: try: self.sprites[key].append(pygame.image.load(filename).convert_alpha()) except: pass def add_spritesheet_image(self, key, spritesheet, rectangle, colorkey=None): self.sprites[key] = spritesheet.image_at(rectangle, colorkey) def add_spritesheet_image_list(self, key, spritesheet, rectangle_list, colorkey=None): self.sprites[key] = spritesheet.images_at(rectangle_list, colorkey) def add_spritesheet_strip(self, key, spritesheet, rect, image_count, colorkey=None): self.sprites[key] = spritesheet.load_strip(rect, image_count, colorkey) def add_spritesheet_strip_offsets(self, key, spritesheet, topleft, image_count, per_line, image_size, hor_offset, ver_offset, colorkey=None): self.sprites[key] = spritesheet.load_strip_offsets(topleft, image_count, per_line, image_size, hor_offset, ver_offset, colorkey) def get_images(self, key): return self.sprites[key] def add_font(self, key, filename, size): self.fonts[key] = pygame.font.Font(filename, size) def remove_font(self, key): del self.fonts[key] def add_music(self, key, filename): # if pyglet.media.have_avbin and not self.force_pygame: # self.music[key] = pyglet.media.load(filename) if self.force_pyaudio: self.music[key] = backend.SoundStream(self.pya, filename) else: self.music[key] = filename def remove_music(self, key): del self.music[key] def play_music(self, key, start=0): if not self.muted: # if pyglet.media.have_avbin and not self.force_pygame: # self.music[key].play() if self.force_pyaudio: if self.current_key is not None: self.music[self.current_key].stop() self.music[key].play() self.current_key = key else: pygame.mixer.music.load(self.music[key]) pygame.mixer.music.play(-1) # pygame.mixer.music.set_pos(start) # if pyglet.media.have_avbin and not self.force_pygame: # self.music[key].play() def add_sound(self, key, filename): # if pyglet.media.have_avbin and not self.force_pygame: # self.sounds[key] = pyglet.media.load(filename, streaming=False) if self.force_pyaudio: self.sounds[key] = backend.WaveFile(filename) else: self.sounds[key] = pygame.mixer.Sound(filename) # pass def remove_sound(self, key): del self.sounds[key] def play_sound(self, key): if not self.muted: if self.force_pyaudio: self.current_sounds[self.sound_queue_index].play(self.sounds[key]) self.sound_queue_index += 1 if self.sound_queue_index > self.sound_channels - 1: self.sound_queue_index = 0 else: self.sounds[key].play() # self.current_sounds.append(self.sounds[key]) def update_sound(self): if self.current_key is not None: if self.force_pyaudio: if self.current_key is not None: self.music[self.current_key].update()
{ "repo_name": "branderson/PyZelda", "path": "src/engine/resourceman.py", "copies": "1", "size": "5061", "license": "mit", "hash": -4913173962195845000, "line_mean": 34.6478873239, "line_max": 117, "alpha_frac": 0.5947441217, "autogenerated": false, "ratio": 3.5970149253731343, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.9679828480996076, "avg_score": 0.002386113215411864, "num_lines": 142 }
__author__ = 'brad' import pygame import random class ObjectState(object): def __init__(self): pass def update(self, game_object, game_scene): pass class GameObject(pygame.sprite.Sprite, object): def __init__(self, image=None, layer=0, masks=None, collision_rect=None, angle=0, position=(0, 0), handle_collisions=False, object_type=None, properties=None, visible=True, persistent=False, tile_id=None, animate=False, animation_speed=15, current_frame=0, sync=False, solid=False, hitbox=None, call_special_update=False): pygame.sprite.Sprite.__init__(self) self.images = {} self.images['image'] = {} self.images['image'][0] = [] if image is None: self.images['image'][0].append(pygame.Surface((0, 0))) else: try: len(image) self.images['image'][0] = image except TypeError: self.images['image'][0] = [image] self.flipped_hor = False self.flipped_ver = False self.tinted = None self.inverted = False self.visible = visible self.current_animation = 'image' self.animate = animate self.animation_frame = current_frame self.animation_speed = animation_speed # How many frames to wait between frames self.animation_counter = 0 self.sync = sync self.frame_ready = False self.current_image = self.images['image'] self.current_key = 'image' if collision_rect is None: self.collision_rect = self.images['image'][0][0].get_rect() else: self.collision_rect = collision_rect if hitbox is None: self.hitbox = self.collision_rect else: self.hitbox = hitbox self.rect = self.images['image'][0][0].get_rect() self._rect_offset = (0, 0) self.rect_offset = (0, 0) # self.rect_scaled = self.rect.copy() # self.rect_draw = self.images['image'].get_rect() self.layer = layer self.masks = [] # self.images['image'] = self.image self.angle = angle self.scene_position = None self.position = position self.states = {} self._state = None self.handle_collisions = handle_collisions self.object_type = object_type self.persistent = persistent self.updated = True self.updated_sprite = False self.solid = solid self.remove = False self.call_special_update = call_special_update if properties is None: self.properties = {} else: self.properties = properties for object_property in properties.keys(): if object_property == "solid": # if properties[property] == "True": self.solid = True self.handle_collisions = True if object_property == "handle_collisions": self.handle_collisions = True if object_property == "object_type": self.object_type = properties[object_property] if object_property == "collision_rect": crect_list = map(int, self.properties[object_property].split(',')) self.collision_rect = pygame.Rect(crect_list) if object_property == "hitbox": crect_list = map(int, self.properties[object_property].split(',')) self.hitbox = pygame.Rect(crect_list) self.tile_id = tile_id # self.rotate(0) if masks is not None: for mask in masks: self.add_mask(mask) def get_global_rect(self): return pygame.Rect(self.rect[0] + self.position[0], self.rect[1] + self.position[1], self.rect[2], self.rect[3]) def get_global_collision_rect(self): return pygame.Rect(self.collision_rect[0] + self.position[0], self.collision_rect[1] + self.position[1], self.collision_rect[2], self.collision_rect[3]) def get_global_hitbox(self): return pygame.Rect(self.hitbox[0] + self.position[0], self.hitbox[1] + self.position[1], self.hitbox[2], self.hitbox[3]) def add_mask(self, mask): self.masks.append(mask) def remove_mask(self, mask): if self.masks.count(mask) != 0: while self.masks.remove(mask): pass def add_image(self, key, surface): self.images[key] = {} self.images[key][0] = [] self.images[key][0].append(surface) def set_image(self, key): self.updated = True self.updated_sprite = True # self.image = self.images[key] self.current_image = self.images[key] self.current_key = key self.animation_frame = 0 self.rect = self.images[self.current_key][self.animation_frame][0].get_rect() # self.rect = self.current_image[0][0].get_rect() # self.rotate(0) def remove_image(self, key): if key in self.images: del self.images[key] def add_animation(self, key, image_list): self.images[key] = {} self.images[key][0] = image_list def set_animation_frame(self, frame): self.updated = True self.updated_sprite = True # self.image = self.images[key][frame] self.animation_frame = frame # self.current_image = self.images[key][frame] # self.rotate(0) def set_animation(self, key, starting_frame=0): self.updated = True self.updated_sprite = True # self.image = self.images[key][starting_frame] self.animation_frame = starting_frame self.current_animation = key # self.current_image = self.images[key][starting_frame] self.current_key = key # self.rotate(0) def next_frame(self, direction=1): self.updated = True self.updated_sprite = True if direction == -1: self.animation_frame -= 1 if self.animation_frame < 0: # self.animation_frame = self.images[self.current_animation].__len__()-1 self.animation_frame = len(self.images[self.current_animation][0])-1 else: self.animation_frame += 1 if self.animation_frame > len(self.images[self.current_animation][0])-1: self.animation_frame = 0 if self.animation_frame < len(self.images[self.current_animation][0]): # self.image = self.images[self.current_animation][self.animation_frame] # self.current_image = self.images[self.current_animation][self.animation_frame] # self.rotate(0) return True else: return False def move(self, coordinate): self.updated = True if coordinate is not None: self.position = coordinate return True else: return False def increment(self, increment): return self.move((self.position[0] + increment[0], self.position[1] + increment[1])) def destroy(self): del self return True def width(self): return self.rect.width def height(self): return self.rect.height def draw(self, surface, (x, y), invert=False, tint=(0, 0, 0), colorkey=None): # , x_scale, y_scale, x, y): # TODO: May need to change image to current_image. Also go through and make sure using right image consistently key = (surface.x_scale, surface.y_scale) try: if (invert and not self.inverted) or (not invert and self.inverted): for image in self.images.keys(): for size in self.images[image].keys(): for frame in xrange(0, len(self.images[image][size])): self.images[image][size][frame] = self.invert_colors(self.images[image][size][frame], colorkey=colorkey) self.inverted = not self.inverted # TODO: Make this non destructive # if tint is not None and self.tinted != tint: # for image in self.images.keys(): # for size in self.images[image].keys(): # for frame in xrange(0, len(self.images[image][size])): # self.images[image][size][frame] = self.tint(self.images[image][size][frame], tint) surface.blit(self.tint(self.images[self.current_key][key][self.animation_frame], tint=tint, colorkey=colorkey), (x, y, self.images[self.current_key][key][self.animation_frame].get_width(), self.images[self.current_key][key][self.animation_frame].get_height())) # surface.blit(self.images[self.current_key][key][self.animation_frame], # (x, y, self.images[self.current_key][key][self.animation_frame].get_width(), # self.images[self.current_key][key][self.animation_frame].get_height())) # if tint != (0, 0, 0, 0): # tint_surface = pygame.Surface(self.images[self.current_key][key][self.animation_frame].get_size()) # tint_surface.fill(tint) # surface.blit(tint_surface, (x, y)) except IndexError: print(str(self.animation_frame) + " " + str(len(self.images[self.current_key][key]))) self.updated = False self.updated_sprite = False def scale_to_view(self, scaling): # self.updated = True # print("Scaling") for image_list in self.images.keys(): self.images[image_list][scaling] = [] for image in xrange(0, len(self.images[image_list][0])): self.images[image_list][scaling].append(pygame.transform.scale(self.images[image_list][0][image], (int(self.images[image_list][0][image].get_width()*scaling[0]), int(self.images[image_list][0][image].get_height()*scaling[1])))) # self.images[image_list][0][image][scaling] = pygame.transform.scale(self.images[image_list][image], # (int(self.images[image_list][image].get_width()*scaling[0]), # int(self.images[image_list][image].get_height()*scaling[1]))) def rotate(self, angle): self.angle += angle rect = self.rect flipped_image = pygame.transform.flip(self.current_image, self.flipped_hor, self.flipped_ver) # flipped_image = self.image self.image = pygame.transform.rotate(flipped_image, self.angle) # self.image = pygame.transform.flip(self.image, self.flipped_hor, self.flipped_ver) rect.center = self.image.get_rect().center self.rect = rect # Rotates about center, clipping to original width and height # Don't use this, doesn't work def rotate_clip(self, angle): """rotate an image while keeping its center and size""" self.angle += angle rect = self.rect self.image = pygame.transform.rotate(self.current_image, self.angle) rect.center = self.image.get_rect().center self.image = self.image.subsurface(rect).copy() def flip(self, flip_hor, flip_ver): if flip_hor: self.flipped_hor = not self.flipped_hor if flip_ver: self.flipped_ver = not self.flipped_ver self.rotate(0) @staticmethod def tint(input_surface, tint, colorkey=None): if tint == (0, 0, 0) or tint == (0, 0, 0, 0): return input_surface else: surface = input_surface.copy() tint_surface = pygame.Surface((surface.get_width(), surface.get_height())) tint_surface.fill(tint) surface.blit(tint_surface, (0, 0)) # else: # surface = input_surface.copy() # surface.lock() # for x in range(0, surface.get_width()): # for y in range(0, surface.get_height()): # pixel = surface.get_at((x, y)) # if pixel != colorkey: # new_r = pixel.r + tint[0] # if new_r > 255: # new_r = 255 # elif new_r < 0: # new_r = 0 # new_g = pixel.g + tint[1] # if new_g > 255: # new_g = 255 # elif new_g < 0: # new_g = 0 # new_b = pixel.b + tint[2] # if new_b > 255: # new_b = 255 # elif new_b < 0: # new_b = 0 # new_a = pixel.a # if len(tint) == 4: # new_a = pixel.a + tint[3] # if new_a > 255: # new_a = 255 # elif new_a < 0: # new_a = 0 # surface.set_at((x, y), (new_r, new_g, new_b, new_a)) # surface.unlock() return surface @staticmethod def invert_colors(input_surface, colorkey=(0, 0, 0)): surface = input_surface.copy() surface.lock() for x in range(0, surface.get_width()): for y in range(0, surface.get_height()): pixel = surface.get_at((x, y)) if pixel != colorkey: new_r = 255 - pixel.r new_g = 255 - pixel.g new_b = 255 - pixel.b a = pixel.a surface.set_at((x, y), (new_r, new_g, new_b, a)) surface.unlock() return surface @staticmethod def bloom(input_surface, colorkey=(0, 0, 0)): surface = input_surface.copy() surface.lock() for x in range(0, surface.get_width()): for y in range(0, surface.get_height()): pixel = surface.get_at((x, y)) if pixel != colorkey: new_r = 2*pixel.r new_g = 2*pixel.g new_b = 2*pixel.b if new_r > 255: new_r = 255 if new_g > 255: new_g = 255 if new_b > 255: new_b = 255 a = pixel.a surface.set_at((x, y), (new_r, new_g, new_b, a)) surface.unlock() return surface @staticmethod def gauss(input_surface, colorkey): surface = input_surface.copy() surface.lock() for x in range(0, surface.get_width()): for y in range(0, surface.get_height()): pixel = surface.get_at((x, y)) if pixel != colorkey: arg1 = 30 arg2 = 150 # new_r = pixel.r + random.randrange(-pixel.r, 255 - pixel.r, 1) # new_g = pixel.g + random.randrange(-pixel.g, 255 - pixel.g, 1) # new_b = pixel.b + random.randrange(-pixel.b, 255 - pixel.b, 1) new_r = pixel.r + random.gauss(arg1, arg2) new_g = pixel.g + random.gauss(arg1, arg2) new_b = pixel.b + random.gauss(arg1, arg2) if new_r > 255: new_r = 255 elif new_r < 0: new_r = 0 if new_g > 255: new_g = 255 elif new_g < 0: new_g = 0 if new_b > 255: new_b = 255 elif new_b < 0: new_b = 0 a = pixel.a surface.set_at((x, y), (new_r, new_g, new_b, a)) surface.unlock() return surface def update(self, can_update=True, rewind=False, direction=1): if self._state is not None: # self._state.update(self) pass if self.animation_speed > 0: if not rewind: self.animation_counter += 1 if self.animation_counter >= self.animation_speed: self.frame_ready = True if self.frame_ready and can_update: if not rewind: self.next_frame(direction) self.animation_counter = 0 if self.frame_ready: self.animation_counter = 0 self.frame_ready = False return True else: return False
{ "repo_name": "branderson/PyZelda", "path": "src/engine/gameobject.py", "copies": "1", "size": "17043", "license": "mit", "hash": -1847703564882521000, "line_mean": 41.1856435644, "line_max": 145, "alpha_frac": 0.5088892801, "autogenerated": false, "ratio": 3.9323950161513612, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.4941284296251361, "avg_score": null, "num_lines": null }
__author__ = 'brad' import backend class CoordinateSurface(backend.Surface): def __init__(self, rect, coordinate_size): # This part should be cleaned up """The CoordinateSurface is essentially a pygame Surface with a builtin secondary coordinate system, which operates irrespectively of the screen coordinates. It holds pointers to game objects and can manipulate those objects. :rtype : CoordinateSurface """ try: backend.Surface.__init__(self, (rect.width, rect.height), flags=3) except: backend.Surface.__init__(self, (rect[0], rect[1]), flags=3) self.coordinate_array = {} self.layers = [] self.x_scale = 1. self.y_scale = 1. self.active = True self.coordinate_width = coordinate_size[0] self.coordinate_height = coordinate_size[1] self.x_scale = self.get_width()/float(self.coordinate_width) self.y_scale = self.get_height()/float(self.coordinate_height) def insert_object(self, game_object, coordinate): # TODO: Make return false if object not added. if coordinate[0] > self.coordinate_width or coordinate[1] > self.coordinate_height: return False if coordinate in self.coordinate_array: self.coordinate_array[coordinate].append(game_object) else: self.coordinate_array[coordinate] = [game_object] if game_object.layer not in self.layers: self.layers.append(game_object.layer) self.layers.sort() return True def insert_object_centered(self, game_object, coordinate): # game_object.scale(self.x_scale, self.y_scale) adjusted_x = coordinate[0] - game_object.rect.centerx adjusted_y = coordinate[1] - game_object.rect.centery return self.insert_object(game_object, (adjusted_x, adjusted_y)) def remove_object(self, game_object): # TODO: Extend to remove all at position remove_layer = True for key in self.coordinate_array.keys(): for ob in self.coordinate_array[key]: if ob.layer == game_object.layer: remove_layer = False if remove_layer: self.layers.remove(game_object.layer) for key in self.coordinate_array.keys(): if self.coordinate_array[key].count(game_object) > 0: self.coordinate_array[key].remove(game_object) if self.coordinate_array[key].__len__() == 0: del self.coordinate_array[key] try: game_object.delete() except: pass return True return False def clear(self): for key in self.coordinate_array.keys(): del self.coordinate_array[key] self.coordinate_array = {} self.layers = [] def check_collision(self, coordinate): if coordinate in self.coordinate_array: return True else: return False # Returns a list of game objects at position def check_collision_objects(self, coordinate): if coordinate in self.coordinate_array: return self.coordinate_array[coordinate] else: return None def move_object(self, game_object, coordinate): position = self.check_position(game_object) # We're gonna need to refactor so that each coordinate is a list of objects if position is not None: if coordinate in self.coordinate_array: self.coordinate_array[coordinate].append(game_object) else: self.coordinate_array[coordinate] = [game_object] self.coordinate_array[position].remove(game_object) if len(self.coordinate_array[position]) == 0: del self.coordinate_array[position] return True else: return False def increment_object(self, game_object, increment): return self.move_object(game_object, (self.check_position(game_object)[0] + increment[0], self.check_position(game_object)[1] + increment[1])) def check_position(self, game_object): for key in self.coordinate_array.keys(): if self.coordinate_array[key].count(game_object) > 0: return key return None # Convert screen coordinates to game coordinates def convert_to_surface_coordinates(self, coordinate): if coordinate[0] > self.get_width() or coordinate[1] > self.get_height(): print("Cannot enter values greater than size of surface") return game_x_coordinate = (float(self.coordinate_width)/float(self.get_width()))*coordinate[0] game_y_coordinate = (float(self.coordinate_height)/float(self.get_height()))*coordinate[1] return game_x_coordinate, game_y_coordinate # Convert game coordinates to screen coordinates def convert_to_screen_coordinates(self, coordinate): if coordinate[0] > self.coordinate_width or coordinate[1] > self.coordinate_height: print("Cannot enter values greater than coordinate size of surface") return screen_x_coordinate = (float(self.get_width())/float(self.coordinate_width))*coordinate[0] screen_y_coordinate = (float(self.get_height())/float(self.coordinate_height))*coordinate[1] # print(str(screen_x_coordinate) + " " + str(screen_y_coordinate)) return screen_x_coordinate, screen_y_coordinate def update(self, fill=None, masks=None, invert=False, tint=(0, 0, 0), colorkey=None): if self.active: # if fill is None: # self.fill((0, 0, 0, 0)) # else: # self.fill(fill) objects = 0 drawn_objects = 0 for layer in self.layers: for key in self.coordinate_array.keys(): for game_object in self.coordinate_array[key]: if game_object.layer == layer and game_object.visible: if masks is None: if game_object.updated: self.draw_object(game_object, invert=invert, tint=tint, colorkey=colorkey) drawn_objects += 1 objects += 1 else: draw_game_object = False for mask in masks: if game_object.masks.count(mask) != 0: draw_game_object = True if draw_game_object and game_object.updated: self.draw_object(game_object, invert=invert, tint=tint, colorkey=colorkey) drawn_objects += 1 objects += 1 # print(str(objects) + " tiles and objects in the room, " + str(drawn_objects) + " drawn to screen") # Unusably slow. Don't use except for stills. def tint(self, (r, g, b, a)): # TODO: Draw colored surface over surface instead. self.lock() for x in range(0, self.get_width() - 1): for y in range(0, self.get_height() - 1): new_r = self.get_at((x, y)).r + r if new_r > 255: new_r = 255 elif new_r < 0: new_r = 0 new_g = self.get_at((x, y)).g + g if new_g > 255: new_g = 255 elif new_g < 0: new_g = 0 new_b = self.get_at((x, y)).b + b if new_b > 255: new_b = 255 elif new_b < 0: new_b = 0 new_a = self.get_at((x, y)).a + a if new_a > 255: new_a = 255 elif new_a < 0: new_a = 0 self.set_at((x, y), (new_r, new_g, new_b, new_a)) self.unlock() def invert_colors(self): self.lock() for x in range(0, self.get_width() - 1): for y in range(0, self.get_height() - 1): new_r = 255 - self.get_at((x, y)).r new_g = 255 - self.get_at((x, y)).g new_b = 255 - self.get_at((x, y)).b a = self.get_at((x, y)).a self.set_at((x, y), (new_r, new_g, new_b, a)) self.unlock() def update_screen_coordinates(self, new_size): backend.Surface.__init__(self, new_size, flags=1) self.x_scale = float(self.get_width())/float(self.coordinate_width) self.y_scale = float(self.get_height())/float(self.coordinate_height) def update_objects(self): pass # Deprecated def draw_object(self, game_object, invert=False, tint=(0, 0, 0), colorkey=(0, 0, 0)): x = self.convert_to_screen_coordinates(self.check_position(game_object))[0] y = self.convert_to_screen_coordinates(self.check_position(game_object))[1] if not (self.x_scale, self.y_scale) in game_object.current_image.keys(): game_object.scale_to_view((self.x_scale, self.y_scale)) game_object.draw(self, (x, y), invert=invert, tint=tint, colorkey=colorkey) def draw(self): return self # return pygame.transform.scale(self, (int(self.get_width()*self.x_scale), int(self.get_height()*self.y_scale)))
{ "repo_name": "branderson/PyZelda", "path": "src/engine/coordsurface.py", "copies": "1", "size": "9618", "license": "mit", "hash": 6534510860761072000, "line_mean": 42.9178082192, "line_max": 120, "alpha_frac": 0.5498024537, "autogenerated": false, "ratio": 4.032704402515724, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.5082506856215724, "avg_score": null, "num_lines": null }
__author__ = 'brad' import math import pygame class Scene(object): def __init__(self, scene_size, update_all=False, handle_all_collisions=False): self.coordinate_array = {} self.collision_array = {} self.views = {} self.view_rects = {} self.view_draw_positions = {} self.view_update_values = {} self.active = True self.scene_width = scene_size[0] self.scene_height = scene_size[1] self.update_all = update_all self.handle_all_collisions = handle_all_collisions def insert_view(self, surface, key, view_scene_position, view_draw_position=None, fill=None, masks=None, view_size=None): if view_size is None: view_size = (surface.coordinate_width, surface.coordinate_height) self.views[key] = surface self.view_rects[key] = pygame.Rect(view_scene_position, view_size) if view_draw_position is None: self.view_draw_positions[key] = (0, 0) else: self.view_draw_positions[key] = view_draw_position self.view_update_values[key] = (fill, masks) def remove_view(self, key): if key in self.views: del self.views[key] del self.view_rects[key] del self.view_draw_positions[key] del self.view_update_values[key] def pan_view(self, key, increment): self.view_rects[key].x += increment[0] self.view_rects[key].y += increment[1] def move_view(self, key, coordinate): self.view_rects[key].topleft = coordinate def center_view_on_object(self, key, game_object): current_view = self.view_rects[key] self.view_rects[key] = pygame.Rect((self.check_position(game_object)[0] - current_view.width/2 + game_object.rect.width/2, self.check_position(game_object)[1] - current_view.height/2 + game_object.rect.height/2), (current_view.width, current_view.height)) def update_touching_objects(self, game_object): position = game_object.scene_position if isinstance(position[0], float) or isinstance(position[1], float): for other_object in self.list_objects(): other_frame_rect = other_object.images[other_object.current_key][0][other_object.animation_frame].get_rect() moved_object_rect = pygame.Rect((math.ceil(position[0]) + game_object._rect_offset[0], math.ceil(position[1]) + game_object._rect_offset[1]), (game_object.rect.width, game_object.rect.height)) other_object_rect = pygame.Rect((math.ceil(other_object.scene_position[0]) + other_object._rect_offset[0], math.ceil(other_object.scene_position[1]) + other_object._rect_offset[1]), (other_frame_rect.width, other_frame_rect.height)) if other_object_rect.colliderect(moved_object_rect): other_object.updated = True for other_object in self.list_objects(): try: other_frame_rect = other_object.images[other_object.current_key][0][other_object.animation_frame].get_rect() except IndexError: print(other_object.object_type + " " + other_object.current_key + " " + str(other_object.animation_frame)) moved_object_rect = pygame.Rect((math.floor(position[0]) + game_object._rect_offset[0], math.floor(position[1]) + game_object._rect_offset[1]), (game_object.rect.width, game_object.rect.height)) other_object_rect = pygame.Rect((math.floor(other_object.scene_position[0]) + other_object._rect_offset[0], math.floor(other_object.scene_position[1]) + other_object._rect_offset[1]), (other_frame_rect.width, other_frame_rect.height)) if other_object_rect.colliderect(moved_object_rect): other_object.updated = True def insert_object(self, game_object, coordinate): game_object.updated = True if coordinate[0] > self.scene_width or coordinate[1] > self.scene_height: return False if coordinate in self.coordinate_array: self.coordinate_array[coordinate].append(game_object) else: self.coordinate_array[coordinate] = [game_object] game_object.scene_position = coordinate game_object.position = coordinate # self.update_touching_objects(game_object) self.update_collisions() return True def insert_object_centered(self, game_object, coordinate): adjusted_x = coordinate[0] - game_object.rect.centerx adjusted_y = coordinate[1] - game_object.rect.centery self.insert_object(game_object, (adjusted_x, adjusted_y)) def remove_object(self, game_object): self.update_touching_objects(game_object) self.coordinate_array[game_object.scene_position].remove(game_object) del game_object def list_objects(self): object_list = [] for coordinate in self.coordinate_array.keys(): for game_object in self.coordinate_array[coordinate]: object_list.append(game_object) return object_list def clear(self, key=0): # TODO: Make default value clear all views, also switch to view.clear() for coordinate in self.coordinate_array.keys(): del self.coordinate_array[coordinate] for game_object in self.list_objects(): if self.views[key].checkPosition(game_object) is not None: self.views[key].remove_object(game_object) self.update_collisions() def check_collision(self, coordinate, game_object=None): """Checks if any object at position, or if game_object at position""" self.update_collisions() if game_object is None: for rect in self.collision_array.viewitems(): if rect.collidepoint(coordinate): return True else: return False else: if game_object in self.collision_array: if self.collision_array[game_object].collidepoint(coordinate): return True return False def check_collision_objects(self, coordinate): """Returns a list of game objects at position""" self.update_collisions() object_list = [] for game_object in self.collision_array: if self.collision_array[game_object].collidepoint(coordinate): object_list.append(game_object) return object_list def check_collision_rect_objects(self, rect): """Returns a list of game objects that collide with rect""" self.update_collisions() object_list = [] for game_object in self.collision_array: if self.collision_array[game_object].colliderect(rect): object_list.append(game_object) return object_list def check_object_collision_objects(self, game_object): """Returns a list of game objects that collide with object""" self.update_collisions() object_list = [] for test_object in self.collision_array: if self.collision_array[game_object].colliderect(self.collision_array[test_object]) and test_object != game_object: object_list.append(test_object) return object_list def check_object_collision(self, game_object1, game_object2): """Checks whether two objects collide""" # TODO: Add exception if KeyError self.update_collisions() if self.collision_array[game_object1].colliderect(self.collision_array[game_object2]): return True else: return False def check_contain_object(self, game_object1, game_object2): """Checks whether game_object1 totally contains game_object2""" self.update_collisions() if not self.collision_array[game_object1].collidepoint(self.collision_array[game_object2].topleft): return False if not self.collision_array[game_object1].collidepoint(self.collision_array[game_object2].topright): return False if not self.collision_array[game_object1].collidepoint(self.collision_array[game_object2].bottomleft): return False if not self.collision_array[game_object1].collidepoint(self.collision_array[game_object2].bottomright): return False else: return True @staticmethod def move_object(game_object, coordinate): return game_object.move(coordinate) @staticmethod def increment_object(game_object, increment): return game_object.increment(increment) @staticmethod def increment_object_radial(self, game_object, increment): x_increment = math.cos(math.radians(game_object.angle))*increment y_increment = math.sin(math.radians(game_object.angle))*increment return game_object.increment((x_increment, y_increment)) @staticmethod def check_position(game_object): # for key in self.coordinate_array.keys(): # if self.coordinate_array[key].count(game_object) > 0: # return key return game_object.position # return None def update(self, key=0, fill=None, masks=None, invert=False, tint=(0, 0, 0), colorkey=None): # TODO: Make default key update all views self.views[key].clear() update_collisions = False remove_keys = [] self.update_coordinates() for coordinate in self.coordinate_array.keys(): if not self.coordinate_array[coordinate]: remove_keys.append(coordinate) for coordinate in remove_keys: self.coordinate_array.pop(coordinate) for game_object in self.list_objects(): if game_object.updated_sprite: update_collisions = True if update_collisions: self.update_collisions() for game_object in self.list_objects(): add_object = False object_rect = pygame.Rect((game_object.position[0] + game_object._rect_offset[0], game_object.position[1] + game_object._rect_offset[1]), (game_object.rect.width, game_object.rect.height)) if self.view_rects[key].colliderect(object_rect) and game_object.visible: if masks is None: add_object = True else: for mask in masks: if game_object.masks.count(mask) != 0: add_object = True if add_object and self.views[key].active: if game_object.updated: self.update_touching_objects(game_object) if self.update_all: game_object.updated = True self.views[key].insert_object(game_object, (game_object.position[0] + game_object._rect_offset[0] - self.view_rects[key].x, game_object.position[1] + game_object._rect_offset[1] - self.view_rects[key].y)) self.views[key].update(fill, masks, invert=invert, tint=tint, colorkey=colorkey) def update_coordinates(self): for game_object in self.list_objects(): if game_object.remove: self.remove_object(game_object) del game_object elif game_object.updated: try: frame_rect = game_object.images[game_object.current_key][0][game_object.animation_frame].get_rect() except IndexError: print(game_object.object_type + " " + game_object.current_key + " " + str(game_object.animation_frame)) if game_object.scene_position != game_object.position or game_object.rect != frame_rect: position = game_object.scene_position self.update_touching_objects(game_object) if position is not None: if game_object.position in self.coordinate_array: self.coordinate_array[game_object.position].append(game_object) else: self.coordinate_array[game_object.position] = [game_object] if len(self.coordinate_array[position]) == 0: del self.coordinate_array[position] self.coordinate_array[position].remove(game_object) game_object.scene_position = game_object.position game_object.rect = pygame.Rect((0, 0), (game_object.images[game_object.current_key][0] [game_object.animation_frame].get_width(), game_object.images[game_object.current_key][0] [game_object.animation_frame].get_height())) game_object._rect_offset = game_object.rect_offset def update_collisions(self): self.update_coordinates() self.collision_array = {} # objects = [] for game_object in self.list_objects(): # objects.append(game_object) if game_object.handle_collisions or self.handle_all_collisions: # and game_object.updated: collide_rect = pygame.Rect((game_object.scene_position[0]+game_object.collision_rect.x, game_object.scene_position[1]+game_object.collision_rect.y), (game_object.collision_rect.width, game_object.collision_rect.height)) self.collision_array[game_object] = collide_rect # remove_objects = [] # for game_object in self.collision_array.keys(): # in_objects = False # for test_object in objects: # if game_object == test_object: # in_objects = True # if not in_objects: # remove_objects.append(game_object) # for game_object in remove_objects: # self.collision_array.pop(game_object) def update_screen_coordinates(self, key, new_size): self.views[key].update_screen_coordinates(new_size) def update_objects(self): for view in self.views: view.update_objects()
{ "repo_name": "branderson/PyZelda", "path": "src/engine/scene.py", "copies": "1", "size": "15417", "license": "mit", "hash": -1677391333928915700, "line_mean": 48.4166666667, "line_max": 127, "alpha_frac": 0.5618473114, "autogenerated": false, "ratio": 4.236603462489695, "config_test": true, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.5298450773889696, "avg_score": null, "num_lines": null }
__author__ = 'brad' import os import src.engine as engine # import src.engine as engine import random RESOURCE_DIR = os.path.join(os.path.dirname(__file__),'../../resources/') + '/' SPRITE_DIR = RESOURCE_DIR + 'sprite/' class AbstractEffect(engine.GameObject): def __init__(self, object_type): self.resource_manager = engine.ResourceManager() self.effect_sheet = engine.Spritesheet(SPRITE_DIR + "Effects.png") engine.GameObject.__init__(self, layer=100, object_type=object_type) self.animation_speed = 15 class AbstractShortGrass(AbstractEffect): def __init__(self, object_type): AbstractEffect.__init__(self, object_type) self.direction = 1 def update(self, can_update=True, rewind=False, direction=1): previous_frame = self.animation_frame engine.GameObject.update(self, direction=self.direction) if self.animation_frame != previous_frame: self.direction = random.choice([1, -1]) class ShortGrass(AbstractShortGrass): def __init__(self): AbstractShortGrass.__init__(self, 'effect_short_grass') self.resource_manager.add_spritesheet_strip_offsets('effect_short_grass', self.effect_sheet, (0, 0), 3, 3, (16, 16), 0, 0, (64, 64, 192)) self.add_animation('image', self.resource_manager.get_images('effect_short_grass')) self.set_animation('image', 0) class ShortForestGrass(AbstractShortGrass): def __init__(self): AbstractShortGrass.__init__(self, 'effect_short_forest_grass') self.resource_manager.add_spritesheet_strip_offsets('effect_short_forest_grass', self.effect_sheet, (0, 16), 3, 3, (16, 16), 0, 0, (64, 64, 192)) self.add_animation('image', self.resource_manager.get_images('effect_short_forest_grass')) self.set_animation('image', 0) class CutGrass(AbstractEffect): def __init__(self): AbstractEffect.__init__(self, 'effect_cut_grass') self.resource_manager.add_spritesheet_strip_offsets('effect_cut_grass', self.effect_sheet, (0, 32), 8, 8, (32, 32), 0, 0, (64, 64, 192)) self.add_animation('image', self.resource_manager.get_images('effect_cut_grass')) self.set_animation('image', 0) self.animation_speed = 2 self.animate = True def update(self, can_update=True, rewind=False, direction=1): if self.animation_frame == 7: self.remove = True else: engine.GameObject.update(self)
{ "repo_name": "branderson/PyZelda", "path": "src/game/effects.py", "copies": "1", "size": "2648", "license": "mit", "hash": -8580490143469607000, "line_mean": 41.0317460317, "line_max": 107, "alpha_frac": 0.6087613293, "autogenerated": false, "ratio": 3.6373626373626373, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.4746123966662637, "avg_score": null, "num_lines": null }
__author__ = 'brad' import os import src.engine as engine from pygame import Rect RESOURCE_DIR = os.path.join(os.path.dirname(__file__),'../../resources/') + '/' SPRITE_DIR = RESOURCE_DIR + 'sprite/' class LinkSword(engine.GameObject): def __init__(self, facing, mode="slash"): self.resource_manager = engine.ResourceManager() link_sheet = engine.Spritesheet(SPRITE_DIR + "Link.png") # Load animations self.resource_manager.add_spritesheet_strip_offsets('link_sword_right', link_sheet, (192, 128), 4, 4, (16, 16), 0, 0, (64, 64, 192)) self.resource_manager.add_spritesheet_strip_offsets('link_sword_up', link_sheet, (128, 128), 4, 4, (16, 16), 0, 0, (64, 64, 192)) self.resource_manager.add_spritesheet_strip_offsets('link_sword_down', link_sheet, (64, 128), 4, 4, (16, 16), 0, 0, (64, 64, 192)) self.resource_manager.add_spritesheet_strip_offsets('link_sword_left', link_sheet, (0, 128), 4, 4, (16, 16), 0, 0, (64, 64, 192)) self.resource_manager.add_spritesheet_strip_offsets('link_sword_spin_clockwise', link_sheet, (0, 144), 8, 8, (16, 16), 0, 0, (64, 64, 192)) self.resource_manager.add_spritesheet_strip_offsets('link_sword_spin_counter', link_sheet, (0, 160), 8, 8, (16, 16), 0, 0, (64, 64, 192)) self.directions = ['link_sword_right', 'link_sword_up', 'link_sword_left', 'link_sword_down'] engine.GameObject.__init__(self, image=self.resource_manager.get_images(self.directions[facing]), layer=25, persistent=True) self.add_animation('link_sword_up', self.resource_manager.get_images('link_sword_up')) self.add_animation('link_sword_down', self.resource_manager.get_images('link_sword_down')) self.add_animation('link_sword_right', self.resource_manager.get_images('link_sword_right')) self.add_animation('link_sword_left', self.resource_manager.get_images('link_sword_left')) self.add_animation('link_sword_spin_clockwise', self.resource_manager.get_images('link_sword_spin_clockwise')) self.add_animation('link_sword_spin_counter', self.resource_manager.get_images('link_sword_spin_counter')) self.set_animation(self.directions[facing], 0) self.animation_speed = 30 self.facing = facing self.handle_collisions = True frame_col = {'up': ((3, 10), (1, 6)), 'ur': ((0, 6), (10, 10)), 'right': ((0, 11), (6, 1)), 'dr': ((0, 0), (10, 10)), 'down': ((11, 0), (1, 6)), 'dl': ((6, 0), (10, 10)), 'left': ((10, 11), (6, 1)), 'ul': ((6, 6), (10, 10)), 'right_upper': ((0, 3), (6, 1))} hit_boxes = {'up': ((2, 4), (6, 12)), 'ur': ((0, 0), (16, 16)), 'right': ((0, 8), (12, 6)), 'dr': ((0, 0), (16, 16)), 'down': ((2, 0), (6, 12)), 'dl': ((0, 0), (16, 16)), 'left': ((4, 8), (12, 6)), 'ul': ((0, 0), (16, 16)), 'right_upper': ((0, 2), (12, 6))} self.collision_rects = {'link_sword_up': [Rect(frame_col['right_upper']), Rect(frame_col['ur']), Rect(frame_col['up'])], 'link_sword_down': [Rect(frame_col['left']), Rect(frame_col['dl']), Rect(frame_col['down'])], 'link_sword_right': [Rect(frame_col['up']), Rect(frame_col['ur']), Rect(frame_col['right'])], 'link_sword_left': [Rect(frame_col['up']), Rect(frame_col['ul']), Rect(frame_col['left'])], 'link_sword_spin_clockwise': [Rect(frame_col['dr']), Rect(frame_col['down']), Rect(frame_col['dl']), Rect(frame_col['left']), Rect(frame_col['ul']), Rect(frame_col['up']), Rect(frame_col['ur']), Rect(frame_col['right'])], 'link_sword_spin_counter': [Rect(frame_col['dl']), Rect(frame_col['down']), Rect(frame_col['dr']), Rect(frame_col['right']), Rect(frame_col['ur']), Rect(frame_col['up']), Rect(frame_col['ul']), Rect(frame_col['left'])]} self.hitbox_rects = {'link_sword_up': [Rect(hit_boxes['right_upper']), Rect(hit_boxes['ur']), Rect(hit_boxes['up'])], 'link_sword_down': [Rect(hit_boxes['left']), Rect(hit_boxes['dl']), Rect(hit_boxes['down'])], 'link_sword_right': [Rect(hit_boxes['up']), Rect(hit_boxes['ur']), Rect(hit_boxes['right'])], 'link_sword_left': [Rect(hit_boxes['up']), Rect(hit_boxes['ul']), Rect(hit_boxes['left'])], 'link_sword_spin_clockwise': [Rect(hit_boxes['dr']), Rect(hit_boxes['down']), Rect(hit_boxes['dl']), Rect(hit_boxes['left']), Rect(hit_boxes['ul']), Rect(hit_boxes['up']), Rect(hit_boxes['ur']), Rect(hit_boxes['right'])], 'link_sword_spin_counter': [Rect(hit_boxes['dl']), Rect(hit_boxes['down']), Rect(hit_boxes['dr']), Rect(hit_boxes['right']), Rect(hit_boxes['ur']), Rect(hit_boxes['up']), Rect(hit_boxes['ul']), Rect(hit_boxes['left'])]} self.call_special_update = True def update_collisions(self): self.collision_rect = self.collision_rects[self.current_key][self.animation_frame] self.hitbox = self.hitbox_rects[self.current_key][self.animation_frame] def special_update(self, game_scene): for game_object in game_scene.list_objects(): if game_object.get_global_hitbox().colliderect(self.get_global_hitbox()): if game_object.object_type == "octorok": game_scene.remove_object(game_object)
{ "repo_name": "branderson/PyZelda", "path": "src/game/linksword.py", "copies": "1", "size": "6473", "license": "mit", "hash": 9037202522360393000, "line_mean": 68.6021505376, "line_max": 147, "alpha_frac": 0.4835470416, "autogenerated": false, "ratio": 3.604120267260579, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.9567951856324808, "avg_score": 0.003943090507154208, "num_lines": 93 }
__author__ = 'brad' import os import src.engine as engine import pygame import effects import random import linksword import specialtiles from pygame.locals import * RESOURCE_DIR = os.path.join(os.path.dirname(__file__),'../../resources/') + '/' SPRITE_DIR = RESOURCE_DIR + 'sprite/' SOUND_DIR = RESOURCE_DIR + 'sound/' class Link(engine.GameObject): def __init__(self, layer=50): self.resource_manager = engine.ResourceManager() link_sheet = engine.Spritesheet(SPRITE_DIR + "Link.png") overworld_sheet = engine.Spritesheet(SPRITE_DIR + "OverworldSheet.png") self.resource_manager.add_spritesheet_strip_offsets('overworld_tiles', overworld_sheet, (1, 1), 600, 24, (16, 16), 1, 1) # Load animations self.resource_manager.add_spritesheet_strip_offsets('link_walk_down', link_sheet, (32, 0), 2, 2, (16, 16), 0, 0, (64, 64, 192)) self.resource_manager.add_spritesheet_strip_offsets('link_walk_up', link_sheet, (64, 0), 2, 2, (16, 16), 0, 0, (64, 64, 192)) self.resource_manager.add_spritesheet_strip_offsets('link_walk_left', link_sheet, (0, 0), 2, 2, (16, 16), 0, 0, (64, 64, 192)) self.resource_manager.add_spritesheet_strip_offsets('link_walk_right', link_sheet, (96, 0), 2, 2, (16, 16), 0, 0, (64, 64, 192)) self.resource_manager.add_spritesheet_strip_offsets('link_push_down', link_sheet, (32, 16), 2, 2, (16, 16), 0, 0, (64, 64, 192)) self.resource_manager.add_spritesheet_strip_offsets('link_push_up', link_sheet, (64, 16), 2, 2, (16, 16), 0, 0, (64, 64, 192)) self.resource_manager.add_spritesheet_strip_offsets('link_push_left', link_sheet, (0, 16), 2, 2, (16, 16), 0, 0, (64, 64, 192)) self.resource_manager.add_spritesheet_strip_offsets('link_push_right', link_sheet, (96, 16), 2, 2, (16, 16), 0, 0, (64, 64, 192)) self.resource_manager.add_spritesheet_strip_offsets('link_shield_walk_down', link_sheet, (32, 32), 2, 2, (16, 16), 0, 0, (64, 64, 192)) self.resource_manager.add_spritesheet_strip_offsets('link_shield_walk_up', link_sheet, (64, 32), 2, 2, (16, 16), 0, 0, (64, 64, 192)) self.resource_manager.add_spritesheet_strip_offsets('link_shield_walk_left', link_sheet, (0, 32), 2, 2, (16, 16), 0, 0, (64, 64, 192)) # These two might be messed up self.resource_manager.add_spritesheet_strip_offsets('link_shield_walk_right', link_sheet, (96, 32), 2, 2, (16, 16), 0, 0, (64, 64, 192)) self.resource_manager.add_spritesheet_strip_offsets('link_use_shield_down', link_sheet, (32, 48), 2, 2, (16, 16), 0, 0, (64, 64, 192)) # Needs to be fixed self.resource_manager.add_spritesheet_strip_offsets('link_use_shield_up', link_sheet, (64, 48), 2, 2, (16, 16), 0, 0, (64, 64, 192)) self.resource_manager.add_spritesheet_strip_offsets('link_use_shield_left', link_sheet, (0, 48), 2, 2, (16, 16), 0, 0, (64, 64, 192)) # Take a look at black spot self.resource_manager.add_spritesheet_strip_offsets('link_use_shield_right', link_sheet, (96, 48), 2, 2, (16, 16), 0, 0, (64, 64, 192)) self.resource_manager.add_spritesheet_strip_offsets('link_hop_down', link_sheet, (0, 64), 3, 3, (16, 16), 0, 0, (64, 64, 192)) self.resource_manager.add_spritesheet_strip_offsets('link_fall', link_sheet, (0, 96), 3, 3, (16, 16), 0, 0, (64, 64, 192)) self.resource_manager.add_spritesheet_strip_offsets('link_sword_down', link_sheet, (32, 112), 2, 2, (16, 16), 0, 0, (64, 64, 192)) self.resource_manager.add_spritesheet_strip_offsets('link_sword_up', link_sheet, (64, 112), 2, 2, (16, 16), 0, 0, (64, 64, 192)) self.resource_manager.add_spritesheet_strip_offsets('link_sword_left', link_sheet, (0, 112), 2, 2, (16, 16), 0, 0, (64, 64, 192)) self.resource_manager.add_spritesheet_strip_offsets('link_sword_right', link_sheet, (96, 112), 2, 2, (16, 16), 0, 0, (64, 64, 192)) engine.GameObject.__init__(self, self.resource_manager.get_images('link_walk_down'), layer, collision_rect=pygame.Rect((3, 4), (10, 11)), handle_collisions=True, object_type="player", persistent=True) # Add animations to Link self.add_animation('link_walk_up', self.resource_manager.get_images('link_walk_up')) self.add_animation('link_walk_down', self.resource_manager.get_images('link_walk_down')) self.add_animation('link_walk_right', self.resource_manager.get_images('link_walk_right')) self.add_animation('link_walk_left', self.resource_manager.get_images('link_walk_left')) self.add_animation('link_push_up', self.resource_manager.get_images('link_push_up')) self.add_animation('link_push_down', self.resource_manager.get_images('link_push_down')) self.add_animation('link_push_left', self.resource_manager.get_images('link_push_left')) self.add_animation('link_push_right', self.resource_manager.get_images('link_push_right')) self.add_animation('link_shield_walk_up', self.resource_manager.get_images('link_shield_walk_up')) self.add_animation('link_shield_walk_down', self.resource_manager.get_images('link_shield_walk_down')) self.add_animation('link_shield_walk_right', self.resource_manager.get_images('link_shield_walk_right')) self.add_animation('link_shield_walk_left', self.resource_manager.get_images('link_shield_walk_left')) self.add_animation('link_use_shield_up', self.resource_manager.get_images('link_use_shield_up')) self.add_animation('link_use_shield_down', self.resource_manager.get_images('link_use_shield_down')) self.add_animation('link_use_shield_left', self.resource_manager.get_images('link_use_shield_left')) self.add_animation('link_use_shield_right', self.resource_manager.get_images('link_use_shield_right')) self.add_animation('link_hop_down', self.resource_manager.get_images('link_hop_down')) self.add_animation('link_fall', self.resource_manager.get_images('link_fall')) self.add_animation('link_sword_up', self.resource_manager.get_images('link_sword_up')) self.add_animation('link_sword_down', self.resource_manager.get_images('link_sword_down')) self.add_animation('link_sword_right', self.resource_manager.get_images('link_sword_right')) self.add_animation('link_sword_left', self.resource_manager.get_images('link_sword_left')) # Group animations self.link_walk = ["link_walk_right", "link_walk_up", "link_walk_left", "link_walk_down"] self.link_push = ["link_push_right", "link_push_up", "link_push_left", "link_push_down"] self.link_shield_walk = ["link_shield_walk_right", "link_shield_walk_up", "link_shield_walk_left", "link_shield_walk_down"] self.link_use_shield = ["link_use_shield_right", "link_use_shield_up", "link_use_shield_left", "link_use_shield_down"] self.link_sword = ["link_sword_right", "link_sword_up", "link_sword_left", "link_sword_down"] # Add sounds to Link self.resource_manager.add_sound('link_hop', SOUND_DIR + 'LA_Link_Jump.wav') self.resource_manager.add_sound('link_land', SOUND_DIR + 'LA_Link_Land.wav') self.resource_manager.add_sound('link_shield', SOUND_DIR + 'LA_Shield.wav') self.resource_manager.add_sound('link_fall', SOUND_DIR + 'LA_Link_Fall.wav') self.resource_manager.add_sound('link_sword_1', SOUND_DIR + 'LA_Sword_Slash1.wav') self.resource_manager.add_sound('link_sword_2', SOUND_DIR + 'LA_Sword_Slash2.wav') self.resource_manager.add_sound('link_sword_3', SOUND_DIR + 'LA_Sword_Slash3.wav') self.resource_manager.add_sound('link_sword_4', SOUND_DIR + 'LA_Sword_Slash4.wav') self.resource_manager.add_sound('link_sword_charge', SOUND_DIR + 'LA_Sword_Charge.wav') self.resource_manager.add_sound('link_sword_spin', SOUND_DIR + 'LA_Sword_Spin.wav') self.resource_manager.add_sound('link_sword_tap', SOUND_DIR + 'LA_Sword_Tap.wav') self.resource_manager.add_sound('grass_cut', SOUND_DIR + 'LA_Bush_Cut.wav') self.sword_slashes = ['link_sword_1', 'link_sword_2', 'link_sword_3', 'link_sword_4'] # Configure Link's properties self.speed = 1.25 # 1.25 self.movement = {0: (self.speed, 0), 1: (0, -self.speed), 2: (-self.speed, 0), 3: (0, self.speed)} self.direction = 3 self.facing = 3 self.big_grass = ["big_grass", "big_forest_grass"] self.short_grass = ["short_grass", "short_forest_grass"] self.effect_short_grass = ["effect_short_grass", "effect_short_forest_grass"] self.in_grass = False self.shield = False self.left = None self.right = None self.controllable = True self.no_clip = False self.direction_held = False self.body_rect = self.rect self.interaction_rect = None # self.collision_rect.copy() self.standard_animation_speed = 15 self.solid = True # Link's States # self.walk = WalkingState() # self.collide = CollidingState() # self.shield = ShieldState() self._state = WalkingState(self) self.state = "WalkingState" def update_interactions(self): if self.facing == 0: self.interaction_rect = pygame.Rect((self.position[0]+self.collision_rect.x+self.collision_rect.width, self.position[1]+self.collision_rect.y), (1, self.collision_rect.height)) elif self.facing == 1: self.interaction_rect = pygame.Rect((self.position[0]+self.collision_rect.x, self.position[1]+self.collision_rect.y-1), (self.collision_rect.width, 1)) elif self.facing == 2: self.interaction_rect = pygame.Rect((self.position[0]+self.collision_rect.x-1, self.position[1]+self.collision_rect.y), (1, self.collision_rect.height)) elif self.facing == 3: self.interaction_rect = pygame.Rect((self.position[0]+self.collision_rect.x, self.position[1]+self.collision_rect.y+self.collision_rect.height), (self.collision_rect.width, 1)) def update_state(self, game_scene): self._state.update(self, game_scene) in_grass = False grass_type = None # Short grass effect for game_object in game_scene.check_object_collision_objects(self): object_type = game_object.object_type if object_type in self.short_grass: in_grass = True grass_type = object_type if in_grass and not self.in_grass: if grass_type == self.short_grass[0]: game_scene.insert_object(effects.ShortGrass(), self.position) elif grass_type == self.short_grass[1]: game_scene.insert_object(effects.ShortForestGrass(), self.position) self.in_grass = True elif not in_grass and self.in_grass: for game_object in game_scene.list_objects(): if game_object.object_type in self.effect_short_grass: game_scene.remove_object(game_object) self.in_grass = False def play_sound(self, key): self.resource_manager.play_sound(key) def set_speed(self, speed): self.speed = speed self.movement = {0: (self.speed, 0), 1: (0, -self.speed), 2: (-self.speed, 0), 3: (0, self.speed)} def handle_input(self, game_scene): if self._state is not None: self._state.handle_input(self, game_scene) self.update_interactions() def handle_event(self, game_scene, event): if self._state is not None: self._state.handle_event(self, game_scene, event) self.update_interactions() class WalkingState(engine.ObjectState): def __init__(self, link): link.state = "WalkingState" engine.ObjectState.__init__(self) # Change animations if not link.shield: link.set_animation(link.link_walk[link.facing], 0) else: link.set_animation(link.link_shield_walk[link.facing], 0) link.controllable = True link.animation_speed = link.standard_animation_speed link.rect_offset = (0, 0) @staticmethod def handle_input(link, game_scene): key = pygame.key.get_pressed() moves = [] moved = False # mouse = pygame.mouse.get_pressed() # if mouse[2]: # link._state = ShieldState(link) # Gather movement directions if not key[K_a] and not key[K_d] and not key[K_w] and not key[K_s] and not key[K_b]: link.set_animation_frame(0) else: if key[K_a] and not key[K_d]: if not key[K_w] and not key[K_s] and link.facing != 2: link.facing = 2 if not link.shield: link.set_animation(link.link_walk[link.facing], 0) else: link.set_animation(link.link_shield_walk[link.facing], 0) link.direction = 2 moves.append(2) moved = True elif key[K_d] and not key[K_a]: if not key[K_w] and not key[K_s] and link.facing != 0: link.facing = 0 if not link.shield: link.set_animation(link.link_walk[link.facing], 0) else: link.set_animation(link.link_shield_walk[link.facing], 0) link.direction = 0 moves.append(0) moved = True if key[K_s] and not key[K_w]: if not key[K_d] and not key[K_a] and link.facing != 3: link.facing = 3 if not link.shield: link.set_animation(link.link_walk[link.facing], 0) else: link.set_animation(link.link_shield_walk[link.facing], 0) link.direction = 3 moves.append(3) moved = True elif key[K_w] and not key[K_s]: if not key[K_d] and not key[K_a] and link.facing != 1: link.facing = 1 if not link.shield: link.set_animation(link.link_walk[link.facing], 0) else: link.set_animation(link.link_shield_walk[link.facing], 0) link.direction = 1 moves.append(1) moved = True # Execute movements if moved: for move_direction in moves: previous_position = link.position link.increment(link.movement[move_direction]) # Deal with collisions if not link.no_clip: collisions = [] # Figure out what link is colliding with for game_object in game_scene.check_object_collision_objects(link): # Regular collisions, stop movement if game_object.solid: collisions.append("solid") if "slow" in game_object.properties: collisions.append("slow") link.set_speed(float(game_object.properties["slow"])) if game_object.object_type == "hole": collisions.append("hole") if game_object.object_type == "jump": collisions.append("jump") # if game_object.object_type == "octorok": # print("Octorok") if "solid" in collisions: link.move(previous_position) link._state = CollidingState(link) elif "jump" in collisions: link._state = HoppingState(link) elif "hole" in collisions: link._state = SlippingState(link) #TODO: Fix this if "slow" not in collisions: link.set_speed(float(1.25)) # Update and move short grass effect if link.in_grass: for game_object in game_scene.list_objects(): if game_object.object_type in link.effect_short_grass: game_object.move(link.position) game_object.update() link.update() @staticmethod def handle_event(link, game_scene, event): if event.type == MOUSEBUTTONDOWN: button = event.button if button == 1: link._state = SwordState(link) if button == 3: if link.shield: link._state = ShieldState(link) def update(self, link, game_scene): return class CollidingState(engine.ObjectState): def __init__(self, link): link.state = "CollidingState" engine.ObjectState.__init__(self) link.set_animation(link.link_push[link.facing], 0) link.controllable = True link.animation_speed = link.standard_animation_speed link.rect_offset = (0, 0) @staticmethod def handle_input(link, game_scene): key = pygame.key.get_pressed() moves = [] moved = False if key[K_a] and not key[K_d]: if not key[K_w] and not key[K_s] and link.facing != 2: link.facing = 2 link.set_animation(link.link_push[link.facing], 0) link.direction = 2 moves.append(2) moved = True elif key[K_d] and not key[K_a]: if not key[K_w] and not key[K_s] and link.facing != 0: link.facing = 0 link.set_animation(link.link_push[link.facing], 0) link.direction = 0 moves.append(0) moved = True if key[K_s] and not key[K_w]: if not key[K_d] and not key[K_a] and link.facing != 3: link.facing = 3 link.set_animation(link.link_push[link.facing], 0) link.direction = 3 moves.append(3) moved = True elif key[K_w] and not key[K_s]: if not key[K_d] and not key[K_a] and link.facing != 1: link.facing = 1 link.set_animation(link.link_push[link.facing], 0) link.direction = 1 moves.append(1) moved = True not_colliding_any = True if moved: for move_direction in moves: not_colliding_direction = True previous_position = link.position link.increment(link.movement[move_direction]) for game_object in game_scene.check_object_collision_objects(link): # Regular collisions, stop movement if game_object.solid and not link.no_clip: not_colliding_direction = False not_colliding_any = False # Stairs if "slow" in game_object.properties: link.set_speed(float(game_object.properties["slow"])) else: link.set_speed(float(1.25)) if not not_colliding_direction: link.move(previous_position) # Update and move short grass effect if link.in_grass: for game_object in game_scene.list_objects(): if game_object.object_type in link.effect_short_grass: game_object.move(link.position) game_object.update() link.update() if not_colliding_any: link._state = WalkingState(link) @staticmethod def handle_event(link, game_scene, event): if event.type == MOUSEBUTTONDOWN: button = event.button if button == 1: link._state = SwordState(link) def update(self, link, game_scene): return class HoppingState(engine.ObjectState): def __init__(self, link): link.state = "HoppingState" engine.ObjectState.__init__(self) link.set_animation("link_hop_down", 0) link.controllable = False link.animation_counter = 0 link.play_sound("link_hop") self.hop_frame = 0 link.animation_speed = 15 link.rect_offset = (0, 0) @staticmethod def handle_input(link, game_scene): return @staticmethod def handle_event(link, game_scene, event): pass def update(self, link, game_scene): moved = False for game_object in game_scene.check_object_collision_objects(link): if game_object.solid or game_object.object_type == "jump": link.increment((0, 1)) moved = True if self.hop_frame < 3: if link.animation_counter >= 7: link.next_frame(1) link.animation_counter = 0 self.hop_frame += 1 else: link.set_animation('link_walk_down', 0) if not moved: link.play_sound('link_land') link._state = WalkingState(link) # TODO: Slipping should not be a state, can be in other states while slipping. Perhaps hole should pull player in. class SlippingState(engine.ObjectState): def __init__(self, link): engine.ObjectState.__init__(self) @staticmethod def handle_input(link, game_scene): return @staticmethod def handle_event(link, game_scene, event): pass def update(self, link, game_scene): return class FallingState(engine.ObjectState): def __init__(self, link): engine.ObjectState.__init__(self) link._state = WalkingState(link) @staticmethod def handle_input(link, game_scene): return @staticmethod def handle_event(link, game_scene, event): pass def update(self, link, game_scene): return class ShieldState(engine.ObjectState): def __init__(self, link): link.state = "ShieldState" engine.ObjectState.__init__(self) link.controllable = False link.set_animation(link.link_use_shield[link.facing], 0) link.play_sound('link_shield') link.animation_speed = link.standard_animation_speed link.rect_offset = (0, 0) @staticmethod def handle_input(link, game_scene): key = pygame.key.get_pressed() moves = [] moved = False mouse = pygame.mouse.get_pressed() # print(str(mouse)) if not mouse[2]: link._state = WalkingState(link) # Gather movement directions if not key[K_a] and not key[K_d] and not key[K_w] and not key[K_s] and not key[K_b]: link.set_animation_frame(0) else: if key[K_a] and not key[K_d]: if not key[K_w] and not key[K_s] and link.facing != 2: link.facing = 2 link.set_animation(link.link_use_shield[link.facing], 0) link.direction = 2 moves.append(2) moved = True elif key[K_d] and not key[K_a]: if not key[K_w] and not key[K_s] and link.facing != 0: link.facing = 0 link.set_animation(link.link_use_shield[link.facing], 0) link.direction = 0 moves.append(0) moved = True if key[K_s] and not key[K_w]: if not key[K_d] and not key[K_a] and link.facing != 3: link.facing = 3 link.set_animation(link.link_use_shield[link.facing], 0) link.direction = 3 moves.append(3) moved = True elif key[K_w] and not key[K_s]: if not key[K_d] and not key[K_a] and link.facing != 1: link.facing = 1 link.set_animation(link.link_use_shield[link.facing], 0) link.direction = 1 moves.append(1) moved = True # Execute movements if moved: for move_direction in moves: previous_position = link.position link.increment(link.movement[move_direction]) # Deal with collisions if not link.no_clip: collisions = [] # Figure out what link is colliding with for game_object in game_scene.check_object_collision_objects(link): # Regular collisions, stop movement if game_object.solid: collisions.append("solid") if "slow" in game_object.properties: collisions.append("slow") link.set_speed(float(game_object.properties["slow"])) if game_object.object_type == "hole": collisions.append("hole") if game_object.object_type == "jump": collisions.append("jump") if "solid" in collisions: link.move(previous_position) # link._state = CollidingState(link) elif "jump" in collisions: link._state = HoppingState(link) elif "hole" in collisions: link._state = SlippingState(link) #TODO: Fix this if "slow" in collisions: link.set_speed(float(1.25)) # Update and move short grass effect if link.in_grass: for game_object in game_scene.list_objects(): if game_object.object_type in link.effect_short_grass: game_object.move(link.position) game_object.update() link.update() @staticmethod def handle_event(link, game_scene, event): if event.type == MOUSEBUTTONDOWN: button = event.button if button == 1: link._state = SwordState(link) def update(self, link, game_scene): return class SwordState(engine.ObjectState): def __init__(self, link): link.state = "SwordState" engine.ObjectState.__init__(self) link.set_animation(link.link_sword[link.facing], 0) link.animation_counter = 0 self.holding = True self.incremented = False self.frame = -2 link.animation_speed = 4 link.rect_offset = (0, 0) # Play random slash sound link.play_sound(link.sword_slashes[random.randrange(0, 4, 1)]) # Make the sword self.sword = linksword.LinkSword(link.facing, mode="slash") self.sword.animation_speed = link.animation_speed / 2 self.inserted = False self.sword_positions = [[(0, -16), (12, -12), (16, 0)], [(16, 0), (12, -12), (0, -16)], [(0, -16), (-12, -12), (-16, 0)], [(-16, 0), (-12, 12), (0, 16)]] self.link_movement = [(2, 0), (0, -2), (-2, 0), (0, 2)] def handle_input(self, link, game_scene): mouse = pygame.mouse.get_pressed() # print(str(mouse)) if not mouse[0]: self.holding = False def handle_event(self, link, game_scene, event): if event.type == MOUSEBUTTONDOWN: button = event.button if button == 1: if self.inserted: game_scene.remove_object(self.sword) if self.incremented: link.increment((-1*self.link_movement[link.facing][0], -1*self.link_movement[link.facing][1])) link._state = SwordState(link) def update(self, link, game_scene): if not self.inserted and self.frame == -1: game_scene.insert_object(self.sword, (link.position[0] + self.sword_positions[link.facing][0][0], link.position[1] + self.sword_positions[link.facing][0][1])) self.sword.handle_collisions = False self.inserted = True self.frame = 0 if self.frame == -2: self.frame = -1 if self.sword.animation_frame < 2 and self.inserted: if self.sword.update(): if self.sword.animation_frame == 1: link.set_animation_frame(1) elif self.sword.animation_frame == 2: link.increment(self.link_movement[link.facing]) self.incremented = True self.sword.move((link.position[0] + self.sword_positions[link.facing][self.frame][0], link.position[1] + self.sword_positions[link.facing][self.frame][1])) if self.sword.animation_frame == 2: self.sword.handle_collisions = True self.sword.update_collisions() if link.update(can_update=False): self.frame += 1 if self.frame == 5: link.increment((-1*self.link_movement[link.facing][0], -1*self.link_movement[link.facing][1])) self.incremented = False if not self.holding: mouse = pygame.mouse.get_pressed() if mouse[2]: link._state = ShieldState(link) else: link._state = WalkingState(link) else: link._state = SwordChargeState(link) game_scene.remove_object(self.sword) link.updated = True # Don't know why these don't update normally here self.sword.updated = True for game_object in game_scene.list_objects(): if game_object.object_type in link.big_grass or game_object.object_type in link.short_grass: if self.sword.handle_collisions: if game_object.get_global_rect().colliderect(self.sword.get_global_collision_rect()): # print(str(self.sword.collision_rect[0]) + ", " + str(self.sword.collision_rect[1]) + ", " + # str(self.sword.collision_rect[2]) + ", " +str(self.sword.collision_rect[3])) position = game_object.position game_scene.remove_object(game_object) game_scene.insert_object(specialtiles.GroundTile(link.resource_manager), position) game_scene.insert_object_centered(effects.CutGrass(), (position[0]-8, position[1]-8)) link.resource_manager.play_sound('grass_cut') class SwordChargeState(engine.ObjectState): def __init__(self, link): link.state = "SwordChargeState" engine.ObjectState.__init__(self) if link.shield: link.set_animation(link.link_shield_walk[link.facing], 0) else: link.set_animation(link.link_walk[link.facing], 0) link.animation_frame = 0 self.holding = True self.charged = False self.spin = False self.frame = 0 link.animation_speed = link.standard_animation_speed self.sword = linksword.LinkSword(link.facing, mode="charge") self.sword.set_animation_frame(2) self.sword_positions = [(12, 0), (0, -12), (-12, 0), (0, 12)] self.inserted = False def handle_input(self, link, game_scene): key = pygame.key.get_pressed() moves = [] moved = False # Gather movement directions if not key[K_a] and not key[K_d] and not key[K_w] and not key[K_s] and not key[K_b]: link.set_animation_frame(0) else: if key[K_a] and not key[K_d]: link.direction = 2 moves.append(2) moved = True elif key[K_d] and not key[K_a]: link.direction = 0 moves.append(0) moved = True if key[K_s] and not key[K_w]: link.direction = 3 moves.append(3) moved = True elif key[K_w] and not key[K_s]: link.direction = 1 moves.append(1) moved = True # Execute movements if moved: stab = False for move_direction in moves: previous_position = link.position link.increment(link.movement[move_direction]) # Deal with collisions if not link.no_clip: collisions = [] # Figure out what link is colliding with for game_object in game_scene.check_object_collision_objects(link): # Regular collisions, stop movement if game_object.solid: collisions.append("solid") if move_direction == link.facing: if game_object.get_global_rect().colliderect(self.sword.get_global_collision_rect()): stab = True if "slow" in game_object.properties: collisions.append("slow") link.set_speed(float(game_object.properties["slow"])) if game_object.object_type == "hole": collisions.append("hole") if game_object.object_type == "jump": collisions.append("jump") if "solid" in collisions: link.move(previous_position) # link._state = CollidingState(link) elif "jump" in collisions: if self.inserted: game_scene.remove_object(self.sword) link._state = HoppingState(link) elif "hole" in collisions: if self.inserted: game_scene.remove_object(self.sword) link._state = SlippingState(link) #TODO: Fix this if "slow" in collisions: link.set_speed(float(1.25)) if stab and len(moves) == 1: if self.inserted: game_scene.remove_object(self.sword) link._state = SwordStabState(link) # Update and move short grass effect if link.in_grass: for game_object in game_scene.list_objects(): if game_object.object_type in link.effect_short_grass: game_object.move(link.position) game_object.update() link.update() def handle_event(self, link, game_scene, event): if event.type == MOUSEBUTTONUP: button = event.button if button == 1: if self.charged: if self.inserted: game_scene.remove_object(self.sword) link._state = SwordSpinState(link) else: if self.inserted: game_scene.remove_object(self.sword) link._state = WalkingState(link) def update(self, link, game_scene): if not self.inserted: game_scene.insert_object(self.sword, (link.position[0] + self.sword_positions[link.facing][0], link.position[1] + self.sword_positions[link.facing][1])) self.inserted = True else: self.sword.move((link.position[0] + self.sword_positions[link.facing][0], link.position[1] + self.sword_positions[link.facing][1])) if self.charged: if self.sword.animation_frame == 2 and self.frame % 3 == 0: self.sword.set_animation_frame(3) elif self.frame % 3 == 0: self.sword.set_animation_frame(2) self.frame += 1 if self.frame == 30: self.charged = True link.play_sound('link_sword_charge') class SwordStabState(engine.ObjectState): def __init__(self, link): link.state = "SwordStabState" engine.ObjectState.__init__(self) link.controllable = False link.animation_frame = 0 link.animation_speed = 4 link.animation_counter = 0 self.frame = 0 self.stabbed = False self.inserted = False link.set_animation(link.link_sword[link.facing], 1) self.sword = linksword.LinkSword(link.facing, mode="stab") self.sword_positions = [(12, 0), (0, -12), (-12, 0), (0, 12)] self.sword.animation_frame = 2 self.sword.update_collisions() # print("Stabbing") @staticmethod def handle_input(link, game_scene): return @staticmethod def handle_event(link, game_scene, event): return def update(self, link, game_scene): if not self.inserted: game_scene.insert_object(self.sword, (link.position[0] + self.sword_positions[link.facing][0], link.position[1] + self.sword_positions[link.facing][1])) self.inserted = True if not self.stabbed: # Figure out what is being stabbed and act accordingly collisions = [] # Figure out what link is colliding with for game_object in game_scene.list_objects(): if game_object.object_type in link.big_grass: if self.sword.handle_collisions: if game_object.get_global_rect().colliderect(self.sword.get_global_collision_rect()): # print(str(self.sword.collision_rect[0]) + ", " + str(self.sword.collision_rect[1]) + ", " + # str(self.sword.collision_rect[2]) + ", " +str(self.sword.collision_rect[3])) position = game_object.position game_scene.remove_object(game_object) game_scene.insert_object(specialtiles.GroundTile(link.resource_manager), position) game_scene.insert_object_centered(effects.CutGrass(), (position[0]-8, position[1]-8)) collisions.append("big_grass") elif game_object.solid: collisions.append("solid") if "big_grass" in collisions: link.resource_manager.play_sound('grass_cut') elif "solid" in collisions: link.play_sound('link_sword_tap') self.stabbed = True if self.frame == 0: if link.update(can_update=False): self.frame = 1 if link.facing == 0: link.increment((2, 0)) self.sword.increment((2, 0)) elif link.facing == 1: link.increment((0, -2)) self.sword.increment((0, -2)) elif link.facing == 2: link.increment((-2, 0)) self.sword.increment((-2, 0)) else: link.increment((0, 2)) self.sword.increment((0, 2)) elif self.frame == 2: if link.update(can_update=False): link.set_animation(link.link_walk[link.facing], 0) if link.facing == 0: link.increment((-2, 0)) self.sword.increment((-2, 0)) elif link.facing == 1: link.increment((0, 2)) self.sword.increment((0, 2)) elif link.facing == 2: link.increment((2, 0)) self.sword.increment((2, 0)) else: link.increment((0, -2)) self.sword.increment((0, -2)) self.frame += 1 else: if link.update(can_update=False): self.frame += 1 if self.frame == 6: if self.inserted: game_scene.remove_object(self.sword) mouse = pygame.mouse.get_pressed() if mouse[0]: link._state = SwordChargeState(link) else: link._state = WalkingState(link) class SwordSpinState(engine.ObjectState): def __init__(self, link): link.state = "SwordSpinState" engine.ObjectState.__init__(self) link.controllable = False link.animation_frame = 0 link.play_sound('link_sword_spin') link.animation_speed = 4 link.animation_counter = 0 self.frame = 0 self.positions = {'up': (0, -16), 'ur': (12, -12), 'right': (16, 0), 'dr': (12, 12), 'down': (0, 16), 'dl': (-12, 12), 'left': (-16, 0), 'ul': (-12, -12)} self.sword = linksword.LinkSword(link.facing, mode="spin") # self.sword.set_animation_frame(2) self.sword_positions = [[self.positions['dr'], self.positions['down'], self.positions['dl'], self.positions['left'], self.positions['ul'], self.positions['up'], self.positions['up'], self.positions['ur'], self.positions['right']], [self.positions['ul'], self.positions['left'], self.positions['dl'], self.positions['down'], self.positions['dr'], self.positions['right'], self.positions['right'], self.positions['ur'], self.positions['up']], [self.positions['dl'], self.positions['down'], self.positions['dr'], self.positions['right'], self.positions['ur'], self.positions['up'], self.positions['up'], self.positions['ul'], self.positions['left']], [self.positions['dr'], self.positions['right'], self.positions['ur'], self.positions['up'], self.positions['ul'], self.positions['left'], self.positions['left'], self.positions['dl'], self.positions['down']]] self.link_sprite_indices = [['link_sword_right', 'link_sword_down', 'link_sword_left', 'link_sword_up', 'link_sword_right'], ['link_sword_up', 'link_sword_left', 'link_sword_down', 'link_sword_right', 'link_sword_up'], ['link_sword_left', 'link_sword_down', 'link_sword_right', 'link_sword_up', 'link_sword_left'], ['link_sword_down', 'link_sword_right', 'link_sword_up', 'link_sword_left', 'link_sword_down']] self.inserted = False link.set_animation(self.link_sprite_indices[link.facing][0], 1) if link.facing == 0: self.sword.set_animation('link_sword_spin_clockwise', 0) elif link.facing == 1: self.sword.set_animation('link_sword_spin_counter', 6) elif link.facing == 2: self.sword.set_animation('link_sword_spin_counter', 0) elif link.facing == 3: self.sword.set_animation('link_sword_spin_counter', 2) self.sword.update_collisions() @staticmethod def handle_input(link, game_scene): return @staticmethod def handle_event(link, game_scene, event): return def update(self, link, game_scene): if not self.inserted: game_scene.insert_object(self.sword, (link.position[0] + self.sword_positions[link.facing][0][0], link.position[1] + self.sword_positions[link.facing][0][1])) self.inserted = True if link.update(can_update=False): if self.frame < 8: self.sword.move((link.position[0] + self.sword_positions[link.facing][self.frame+1][0], link.position[1] + self.sword_positions[link.facing][self.frame+1][1])) if self.frame == 1: link.set_animation(self.link_sprite_indices[link.facing][1], 1) elif self.frame == 2: link.set_animation(self.link_sprite_indices[link.facing][2], 1) elif self.frame == 5: link.set_animation(self.link_sprite_indices[link.facing][3], 1) elif self.frame == 7: link.set_animation(self.link_sprite_indices[link.facing][4], 1) if self.frame != 5: self.sword.next_frame(1) self.sword.update_collisions() else: game_scene.remove_object(self.sword) link._state = WalkingState(link) self.frame += 1 link.updated = True self.sword.updated = True for game_object in game_scene.list_objects(): if game_object.object_type in link.big_grass or game_object.object_type in link.short_grass: if self.sword.handle_collisions: if game_object.get_global_rect().colliderect(self.sword.get_global_collision_rect()): # print(str(self.sword.collision_rect[0]) + ", " + str(self.sword.collision_rect[1]) + ", " + # str(self.sword.collision_rect[2]) + ", " +str(self.sword.collision_rect[3])) position = game_object.position game_scene.remove_object(game_object) game_scene.insert_object(specialtiles.GroundTile(link.resource_manager), position) game_scene.insert_object_centered(effects.CutGrass(), (position[0]-8, position[1]-8))
{ "repo_name": "branderson/PyZelda", "path": "src/game/link.py", "copies": "1", "size": "46634", "license": "mit", "hash": 5435727386401376000, "line_mean": 46.3922764228, "line_max": 174, "alpha_frac": 0.5351245872, "autogenerated": false, "ratio": 3.8018914071416923, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.4837015994341692, "avg_score": null, "num_lines": null }
__author__ = 'brad' import os import src.engine as engine import pygame RESOURCE_DIR = os.path.join(os.path.dirname(__file__),'../../resources/') + '/' FONT_DIR = RESOURCE_DIR + 'font/' class HUD(engine.CoordinateSurface): def __init__(self, screen_size): engine.CoordinateSurface.__init__(self, pygame.Rect((0, 0), (screen_size[0], screen_size[1]/8)), (160, 16)) class TextBox(engine.CoordinateSurface): def __init__(self, text, screen_size, coordinate_size, justify="center"): self.scale = (screen_size[0]/coordinate_size[0], screen_size[1]/(coordinate_size[1]+16)) self.width = 144*self.scale[0] self.height = 40*self.scale[1] # pygame.Surface.__init__(self, screen_size) engine.CoordinateSurface.__init__(self, pygame.Rect((0, 0), (self.width, self.height)), (144, 40)) self.fill((0, 0, 0, 255)) self.resource_manager = engine.ResourceManager() self.resource_manager.add_font('game_text', FONT_DIR + 'zeldadxt.ttf', int(self.scale[1]*12)) self.text = str(text) self.text_speed = 5 self.frame_counter = 0 self.next_letter = False self.justify = justify self.lines = [] self.current_line = 0 self.current_letter = 0 self.waiting = False self.scrolling = False self.scroll_frame = 0 self.finished = False self.rendered_letters = [] self.line_starts = [] self.letter_spacing = 8 * self.scale[0] line = "" for char in self.text: if char != '\\': line += char else: self.lines.append(line) line = "" self.lines.append(line) if self.justify == "center": for line in self.lines: letters = len(line) line_start = self.width/2 - (letters/2)*self.letter_spacing self.line_starts.append(line_start) elif self.justify == "left": for i in xrange (0, len(self.lines)): self.line_starts.append(8*self.scale[0]) # text_surface = self.resource_manager.fonts['game_text'].render(text, False, (255, 255, 139, 255)) # self.blit(text_surface, (8*scale[0], 8*scale[0])) def update_text(self): self.frame_counter += 1 if self.frame_counter >= self.text_speed: self.next_letter = True if not self.finished and not self.waiting and not self.scrolling: if self.next_letter: self.rendered_letters.append(self.resource_manager.fonts['game_text'].render (self.lines[self.current_line][self.current_letter], False, (255, 255, 139, 255))) # self.rendered_letters.append(self.lines[self.current_line][self.current_letter]) self.current_letter += 1 self.draw_letters() if self.current_letter == len(self.lines[self.current_line]): self.current_letter = 0 self.current_line += 1 if self.current_line % 2 == 0: self.waiting = True if self.current_line == len(self.lines): self.finished = True if self.current_line > 1 and not self.waiting: self.scrolling = True self.frame_counter = 0 self.next_letter = False elif not self.finished and self.waiting: pass # TODO: Flash the down arrow if self.scrolling and self.next_letter: self.scroll_up() self.frame_counter = 0 self.next_letter = False def draw_letters(self): # Draw all of the letters up to the current point self.fill((0, 0, 0, 255)) if self.current_line >= 1: line = 0 draw_line = 0 letters = len(self.lines[self.current_line-1]) + self.current_letter letter = 0 for i in xrange(0, letters): try: self.blit(self.rendered_letters[i], (self.line_starts[self.current_line-1+line] + letter*self.letter_spacing, 6*self.scale[0]+16*self.scale[0]*draw_line)) except IndexError: print(str(self.current_line) + " " + str(self.current_line-1+line)) letter += 1 if i == len(self.lines[self.current_line-1]) - 1: draw_line = 1 line += 1 letter = 0 elif self.current_line == 0: for i in xrange(0, self.current_letter): # print(str(self.line_starts[0] + i*self.letter_spacing) + ", " + str(8*self.scale[0])) # print(str(self.line_starts[0])) self.blit(self.rendered_letters[i], (self.line_starts[0] + i*self.letter_spacing, 6*self.scale[0])) def scroll_up(self): # TODO: Scroll text up and delete previous line # Scrolls up in two increments, deleting previous line on first increment if self.scroll_frame == 0: # Deletes line no longer visible length = len(self.lines[self.current_line-2]) for i in xrange(0, length): self.rendered_letters.pop(0) # Scroll up two increments if self.scroll_frame < 6 and self.scroll_frame % 2 == 0: scroll_surface = self.copy() self.fill((0, 0, 0, 255)) self.blit(scroll_surface, (0, -8*self.scale[1])) self.scroll_frame += 1 else: self.waiting = False self.scrolling = False self.scroll_frame = 0
{ "repo_name": "branderson/PyZelda", "path": "src/game/gui.py", "copies": "1", "size": "5763", "license": "mit", "hash": -3086630491856024600, "line_mean": 42.3308270677, "line_max": 148, "alpha_frac": 0.538434843, "autogenerated": false, "ratio": 3.834331337325349, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.4872766180325349, "avg_score": null, "num_lines": null }
__author__ = 'brad' import os import src.engine as engine RESOURCE_DIR = os.path.join(os.path.dirname(__file__),'../../resources/') + '/' SPRITE_DIR = RESOURCE_DIR + 'sprite/' class AbstractTile(engine.GameObject): def __init__(self): self.resource_manager = engine.ResourceManager() self.tile_sheet = engine.Spritesheet(SPRITE_DIR + "OverworldSheet.png") class ShortGrass(AbstractTile): def __init__(self, resource_manager): AbstractTile.__init__(self) engine.GameObject.__init__(self, self.resource_manager.get_images('overworld_tiles')[229], layer=-500, handle_collisions=True, object_type="short_grass") class BigBeachGrass(engine.GameObject): def __init__(self, resource_manager): engine.GameObject.__init__(self, resource_manager.get_images('overworld_tiles')[254], layer=-500, handle_collisions=True, object_type="big_beach_grass") class Hole(engine.GameObject): def __init__(self, resource_manager): engine.GameObject.__init__(self, resource_manager.get_images('overworld_tiles')[232], layer=-500, handle_collisions=True, object_type="big_beach_grass", solid=True) class GroundTile(AbstractTile): def __init__(self, resource_manager): engine.GameObject.__init__(self, resource_manager.get_images('overworld_tiles')[220], layer=-1000, handle_collisions=False)
{ "repo_name": "branderson/PyZelda", "path": "src/game/specialtiles.py", "copies": "1", "size": "1495", "license": "mit", "hash": -5557264308554162000, "line_mean": 38.3421052632, "line_max": 113, "alpha_frac": 0.6314381271, "autogenerated": false, "ratio": 3.7004950495049505, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.48319331766049506, "avg_score": null, "num_lines": null }
__author__ = 'brad' import pygame from resourceman import ResourceManager from spritesheet import Spritesheet from gameobject import GameObject import xml.etree.ElementTree as ET class Map(object): def __init__(self, filename, tile_set): """Takes an XML world file and a tile set and creates a map from it""" # Load the tile set self.resource_manager = ResourceManager() self.object_tiles = {} self.object_properties = {} self.tile_set = Spritesheet(tile_set) # Could eventually allow for multiple tile sets by making a list # TODO: Make spritesheet size independent of class self.resource_manager.add_spritesheet_strip_offsets('tile_set', self.tile_set, (1, 1), 600, 24, (16, 16), 1, 1) # Read the XML file tree = ET.parse(filename) root = tree.getroot() self.width = int(root.get("width")) self.height = int(root.get("height")) self.tile_width = int(root.get("tilewidth")) self.tile_height = int(root.get("tileheight")) # Read in the special tiles self.special_tiles = {} for tileset in root.findall("tileset"): for tile in tileset.findall("tile"): tile_properties = {} for tile_property in tile.find("properties").findall("property"): tile_properties[tile_property.get("name")] = tile_property.get("value") self.special_tiles[int(tile.get("id"))] = tile_properties # Read in the layers self.layers = {} for layer in root.findall("layer"): # print(layer.get("name")) tile_list = [] for tile in layer.find("data").findall("tile"): # print(tile.get("gid")) tile_list.append(int(tile.get("gid"))) self.layers[layer.get("name")] = tile_list # Read in the collision boxes self.object_layers = {} for layer in root.findall("objectgroup"): rect_list = [] rect_index = "" for object_rect in layer.findall("object"): try: current_rect =pygame.Rect(int(object_rect.get("x")), # /self.tile_width, int(object_rect.get("y")), # /self.tile_height, int(object_rect.get("width")), # /self.tile_width, int(object_rect.get("height"))) # /self.tile_height)) rect_list.append(current_rect) rect_index = str(current_rect[0]) + " " + str(current_rect[1]) + " " + str(current_rect[2]) + " " + str(current_rect[3]) except TypeError: print("There was a problem loading object at " + str(int(object_rect.get("x"))/self.tile_width) + ", " + str(int(object_rect.get("y"))/self.tile_height)) current_properties = {} if object_rect.get("type") is not None: current_properties["type"] = object_rect.get("type") if object_rect.find("properties") is not None: for object_property in object_rect.find("properties").findall("property"): current_properties[object_property.get("name")] = object_property.get("value") if "layer" not in current_properties.keys(): current_properties["layer"] = 0 self.object_properties[rect_index] = current_properties self.object_layers[layer.get("name")] = rect_list for layer_property in layer.findall("property"): if layer_property.get("name") == "tile": self.object_tiles[layer.get("name")] = int(layer_property.get("value")) def get_tile_index(self, layer_name, x_tile, y_tile): index = self.width*y_tile+x_tile try: return self.layers[layer_name][index]-1 except IndexError: return 0 def build_world(self, scene, view_rect=None, current_frame=0): # This will be deprecated shortly # print("Starting build") # self.clear_collisions(scene) objects = 0 tiles = 0 if view_rect is None: row = 0 for layer_name in self.layers.keys(): while row < self.height: for tile in xrange(0, self.width): current_tile = self.get_tile_index(layer_name, tile, row) if current_tile != -1: is_special_tile = False for special_tile in self.special_tiles.keys(): if current_tile == special_tile: is_special_tile = True if is_special_tile: scene.insert_object(GameObject(self.resource_manager.get_images('tile_set') [current_tile], -1000, object_type=layer_name, properties=self.special_tiles[current_tile], tile_id=current_tile, sync=True), (16*tile, 16*row)) else: scene.insert_object(GameObject(self.resource_manager.get_images('tile_set') [current_tile], -1000, object_type=layer_name, tile_id=current_tile), (16*tile, 16*row)) # print(str(row) + " " + str(tile)) row += 1 else: tile_rect = (view_rect.x/self.tile_width, view_rect.y/self.tile_height, view_rect.width/self.tile_width, view_rect.height/self.tile_height) # print(str(view_rect[0]) + " " + str(view_rect[1]) + " " + str(view_rect[2]) + " " + str(view_rect[3])) # Build the map tiles for layer_name in self.layers.keys(): row = 0 while row < tile_rect[3]: for tile in xrange(0, tile_rect[2]): current_tile = self.get_tile_index(layer_name, tile_rect[0]+tile, tile_rect[1]+row) if current_tile != -1: is_special_tile = False for special_tile in self.special_tiles.keys(): if current_tile == special_tile: is_special_tile = True if is_special_tile: animated = False frames = 0 # for object_property in self.special_tiles[current_tile].keys(): # if object_property == "animate": # animated = True # frames = int(self.special_tiles[current_tile][object_property]) if "animate" in self.special_tiles[current_tile]: animated = True frames = int(self.special_tiles[current_tile]["animate"]) if animated: images = [] for x in xrange(current_tile, current_tile + frames): images.append(self.resource_manager.get_images('tile_set')[x]) scene.insert_object(GameObject(images, -1000, object_type=layer_name, properties=self.special_tiles[current_tile], tile_id=current_tile, animate=True, current_frame=current_frame, sync=True), (16*(tile_rect[0]+tile), 16*(tile_rect[1]+row))) else: scene.insert_object(GameObject(self.resource_manager.get_images('tile_set') [current_tile], -1000, object_type=layer_name, properties=self.special_tiles[current_tile], tile_id=current_tile), (16*(tile_rect[0]+tile), 16*(tile_rect[1]+row))) else: # Allow it to determine whether objects already exist and just make them visible if they do scene.insert_object(GameObject(self.resource_manager.get_images('tile_set') [current_tile], -1000, object_type=layer_name, tile_id=current_tile), (16*(tile_rect[0]+tile), 16*(tile_rect[1]+row))) tiles += 1 # print(str(row) + " " + str(tile)) row += 1 # Build the object layers for layer_name in self.object_layers.keys(): for object_rect in self.object_layers[layer_name]: if object_rect.colliderect(view_rect): # tile_rect): rect_index = str(object_rect[0]) + " " + str(object_rect[1]) + " " + str(object_rect[2]) + " " + str(object_rect[3]) scene.insert_object(GameObject(collision_rect=pygame.Rect(0, 0, object_rect[2], object_rect[3]), handle_collisions=True, object_type=layer_name, visible=False, properties=self.object_properties[rect_index], layer=self.object_properties[rect_index]["layer"]), (object_rect[0], object_rect[1])) objects += 1 # print("Added " + str(tiles) + " tiles") # print("Added " + str(objects) + " objects") # print("Ending build") def clear_tiles(self, scene, view_rect, kill_all=False): # print("Starting to clear tiles") # handle_all_collisions = scene.handle_all_collisions # scene.handle_all_collisions = True # scene.update_collisions() # scene.handle_all_collisions = handle_all_collisions self.clear_objects(scene, view_rect) objects = 0 for coordinate in scene.coordinate_array.keys(): for game_object in scene.coordinate_array[coordinate]: if game_object.object_type == "Map Tiles": object_rect = pygame.Rect(scene.check_position(game_object), (game_object.rect.width, game_object.rect.height)) # try: # object_rect = scene.collision_array[game_object] # except KeyError: # print("an object failed to clear") if not object_rect.colliderect(view_rect): if kill_all: scene.remove_object(game_object) else: game_object.visible = False objects += 1 # scene.update_collisions() # print("There were " + str(objects) + " tiles") # print("Ending clear tiles") # @staticmethod # def clear_collisions(scene, kill_all=False): # # print("Starting to clear objects") # objects = 0 # for coordinate in scene.coordinate_array.keys(): # for game_object in scene.coordinate_array[coordinate]: # if not game_object.persistent and game_object.object_type == "Regular Collisions": # scene.remove_object(game_object) # objects += 1 # # print("There were " + str(objects) + " objects") # # print("Ending clear objects") @staticmethod def clear_objects(scene, view_rect): for coordinate in scene.coordinate_array.keys(): for game_object in scene.coordinate_array[coordinate]: if not game_object.persistent and game_object.object_type != "Map Tiles": object_rect = pygame.Rect(scene.check_position(game_object), (game_object.rect.width, game_object.rect.height)) if not object_rect.colliderect(view_rect): scene.remove_object(game_object)
{ "repo_name": "branderson/PyZelda", "path": "src/engine/map.py", "copies": "1", "size": "13218", "license": "mit", "hash": -697693512749228700, "line_mean": 56.2251082251, "line_max": 140, "alpha_frac": 0.4665607505, "autogenerated": false, "ratio": 4.680594900849858, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.5647155651349859, "avg_score": null, "num_lines": null }
__author__ = 'brad' import pygame class Spritesheet(object): def __init__(self, filename): try: self.sheet = pygame.image.load(filename).convert() except pygame.error, message: print 'Unable to load spritesheet image:', filename raise SystemExit, message # Load image at location def image_at(self, rectangle, colorkey=None): """Loads image from x, y, x+offset, y+offset""" rect = pygame.Rect(rectangle) image = pygame.Surface(rect.size).convert() image.blit(self.sheet, (0, 0), rect) if colorkey is not None: if colorkey is -1: colorkey = image.get_at((0, 0)) image.set_colorkey(colorkey, pygame.RLEACCEL) return image # Load a list of images def images_at(self, rectangle_list, colorkey=None): return [self.image_at(rectangle, colorkey) for rectangle in rectangle_list] # Load a strip of images def load_strip(self, rect, image_count, colorkey=None): rectangle_list = [(rect[0]+rect[2]*x, rect[1], rect[2], rect[3]) for x in range(image_count)] return self.images_at(rectangle_list, colorkey) # Load a stip of images with offsets def load_strip_offsets(self, topleft, image_count, per_line, image_size, hor_offset=0, ver_offset=0, colorkey=None): rectangle_list = [] lines = int(image_count/per_line) even_lines = True if image_count % per_line != 0: even_lines = False current_topleft = topleft for line in xrange(0, lines): for image in xrange(0, per_line): rectangle_list.append(pygame.Rect(current_topleft, (image_size[0], image_size[1]))) current_topleft = (current_topleft[0] + image_size[0] + hor_offset, current_topleft[1]) current_topleft = (topleft[0], current_topleft[1] + image_size[1] + ver_offset) return self.images_at(rectangle_list, colorkey)
{ "repo_name": "branderson/PyZelda", "path": "src/engine/spritesheet.py", "copies": "1", "size": "2004", "license": "mit", "hash": 4134208237051990500, "line_mean": 40.7708333333, "line_max": 120, "alpha_frac": 0.6097804391, "autogenerated": false, "ratio": 3.5978456014362656, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.4707626040536266, "avg_score": null, "num_lines": null }
__author__ = 'brad' import src.engine as engine import pygame import random class AbstractEnemy(engine.GameObject): def __init__(self): self.resource_manager = engine.ResourceManager() engine.GameObject.__init__(self, layer=0, handle_collisions=True, solid=True, object_type="enemy") class Octorok(AbstractEnemy): def __init__(self, resource_manager): AbstractEnemy.__init__(self) self.resource_manager.add_image_list('octorok_walk_left', [resource_manager.get_images('octorok')[0], resource_manager.get_images('octorok')[1]]) self.resource_manager.add_image_list('octorok_walk_down', [resource_manager.get_images('octorok')[2], resource_manager.get_images('octorok')[3]]) self.resource_manager.add_image_list('octorok_walk_up', [resource_manager.get_images('octorok')[4], resource_manager.get_images('octorok')[5]]) self.resource_manager.add_image_list('octorok_walk_right', [resource_manager.get_images('octorok')[6], resource_manager.get_images('octorok')[7]]) self.resource_manager.add_image('octorok_missile', resource_manager.get_images('octorok')[8]) self.add_animation('octorok_walk_up', self.resource_manager.get_images('octorok_walk_up')) self.add_animation('octorok_walk_down', self.resource_manager.get_images('octorok_walk_down')) self.add_animation('octorok_walk_left', self.resource_manager.get_images('octorok_walk_left')) self.add_animation('octorok_walk_right', self.resource_manager.get_images('octorok_walk_right')) self.animations = ['octorok_walk_right', 'octorok_walk_up', 'octorok_walk_left', 'octorok_walk_down'] self.facing = random.randint(0, 3) self.solid = True self.hitbox = pygame.Rect((0, 0), (16, 16)) self.object_type = "octorok" self._state = WalkingState(self) self.speed = 1.0 self.movement = {0: (self.speed, 0), 1: (0, -self.speed), 2: (-self.speed, 0), 3: (0, self.speed)} self.mouth = [(16, 2), (2, 0), (0, 2), (2, 16)] def turn(self): self.facing = random.randint(0, 3) self.set_animation(self.animations[self.facing], 0) class WalkingState(engine.ObjectState): def __init__(self, octorok): octorok.state = "WalkingState" engine.ObjectState.__init__(self) # Change animations octorok.set_animation(octorok.animations[octorok.facing], 0) octorok.collision_rect = octorok.images[octorok.current_key][0][0].get_rect() self.animation_speed = 15 self.frame = 0 self.shot_counter = 0 self.walking = False self.missile = octorok.resource_manager.get_images('octorok_missile') def update(self, octorok, game_scene): if self.walking: previous_position = octorok.position octorok.increment(octorok.movement[octorok.facing]) on_screen = False for game_object in game_scene.check_object_collision_objects(octorok): if game_object.solid: octorok.position = previous_position self.walking = False if game_object.object_type == "camera": if game_scene.check_contain_object(game_object, octorok): on_screen = True if not on_screen: octorok.position = previous_position self.walking = False if octorok.update(): self.frame += 1 if self.shot_counter < 8: self.shot_counter += 1 if self.frame == 5: self.frame = 0 self.walking = False else: if octorok.update(can_update=False): if self.frame < 2: self.frame += 1 if self.shot_counter < 8: self.shot_counter += 1 else: self.frame = 0 self.walking = True octorok.turn() # if self.shot_counter == 8 and self.walking == False: # missile = Missile(self.missile, octorok.facing) # game_scene.insert_object(missile, (octorok.position[0] + octorok.mouth[octorok.facing][0], # octorok.position[1] + octorok.mouth[octorok.facing][1])) # self.shot_counter = 0 class Missile(engine.GameObject): def __init__(self, missile_sprite, direction): engine.GameObject.__init__(self, missile_sprite, handle_collisions=True) self.speed = 4 self.movement = {0: (self.speed, 0), 1: (0, -self.speed), 2: (-self.speed, 0), 3: (0, self.speed)} self.direction = direction self.call_special_update = True def special_update(self, game_scene): self.increment(self.movement[self.direction]) on_screen = False for game_object in game_scene.check_object_collision_objects(self): if game_object.solid and game_object.object_type != "octorok": self.remove = True game_scene.remove_object(self) if game_object.object_type == "camera": if game_scene.check_contain_object(game_object, self): on_screen = True game_scene.remove_object(self) if not on_screen: self.remove = True
{ "repo_name": "branderson/PyZelda", "path": "src/game/octorok.py", "copies": "1", "size": "5684", "license": "mit", "hash": -3163787031724578000, "line_mean": 46.7647058824, "line_max": 111, "alpha_frac": 0.5626319493, "autogenerated": false, "ratio": 3.6506101477199744, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.970427045636613, "avg_score": 0.001794328130768888, "num_lines": 119 }
__author__ = 'Brad Urani' import matplotlib.pyplot as plt import matplotlib.mlab as mlab import numpy as np import scifipy.histogramhelpers as hh class PlotHelpers(object): def __init__(self): pass def histogram_with_pdf(self, hist): mu = hh.hist_mean(hist) std_dev = hh.hist_std_dev(hist) width_list = self.width_list(hist) plt.bar(hist.keys(), hist.values(), width_list, facecolor='g', alpha=0.75) x = np.linspace(min(hist.keys()), max(hist.keys()), 1000) plt.plot(x, mlab.normpdf(x, mu, std_dev) * np.mean(width_list), linewidth=5, c='r') plt.grid(True) plt.show() return mu, std_dev def double_histogram(self, hist1, hist2): plt.bar(hist1.keys(), hist1.values(), self.width_list(hist1), facecolor='g', alpha=0.5) plt.bar(hist2.keys(), hist2.values(), self.width_list(hist2), facecolor='b', alpha=0.5) plt.grid(True) plt.show() def width_list(self, hist): bins = hist.keys() diffs = [bins[n]-bins[n-1] for n in range(1, len(bins))] diffs.append(np.mean(diffs)) #add one for the last bar return diffs def histogram(self, hist): plt.bar(hist.keys(), hist.values(), self.width_list(hist), facecolor='g', alpha=0.5) plt.grid(True) plt.show()
{ "repo_name": "bradurani/scifipy", "path": "plothelpers.py", "copies": "1", "size": "1335", "license": "unlicense", "hash": 8418426080242399000, "line_mean": 33.2564102564, "line_max": 95, "alpha_frac": 0.6037453184, "autogenerated": false, "ratio": 3.104651162790698, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.4208396481190698, "avg_score": null, "num_lines": null }
import base64 from urllib.parse import urlsplit from pprint import pprint # TODO stop logging accesses from django.http import HttpResponse from rest_framework import authentication from rest_framework import exceptions from .models import LocalCredentials, RemoteCredentials def createBasicAuthToken(username, password): """ This creates an HTTP Basic Auth token from a username and password. """ # Format into the HTTP Basic Auth format tokenString = '{}:{}'.format(username, password) # Encode into bytes for b64, then into b64 bytesString = tokenString.encode('utf-8') return base64.b64encode(bytesString) def parseBasicAuthToken(token): """ This parses an HTTP Basic Auth token and returns a tuple of (username, password). """ # Convert the token into a bytes object so b64 can work with it if isinstance(token, str): token = token.encode('utf-8') # Decode from b64 then bytes parsedBytes = base64.b64decode(token) parsedString = parsedBytes.decode('utf-8') # Split out the username, rejoin the password if it had colons username, *passwordParts = parsedString.split(':') password = ':'.join(passwordParts) return (username, password) def getRemoteCredentials(url): """ Finds a remote host that can be used for the given url. Returns None if it couldn't find. """ hostSplit = urlsplit(url) hostNetloc = hostSplit.netloc for remoteHost in RemoteCredentials.objects.all(): remoteHostSplit = urlsplit(remoteHost.host) remoteHostNetloc = remoteHostSplit.netloc if hostNetloc == remoteHostNetloc: return remoteHost return None class nodeToNodeBasicAuth(authentication.BaseAuthentication): def authenticate(self, request): """ This is an authentication backend for our rest API. It implements HTTP Basic Auth using admin controlled passwords separate from users. """ # TODO stop logging accesses print(request.method, request.path) body = request.body.decode('utf-8') pprint(body) # Didn't provide auth print('HTTP_AUTHORIZATION' in request.META) if 'HTTP_AUTHORIZATION' not in request.META: raise exceptions.AuthenticationFailed() auth = request.META['HTTP_AUTHORIZATION'] print('AUTH', auth) # Tried to auth the wrong way prefix = 'Basic ' if not auth.startswith(prefix): raise exceptions.AuthenticationFailed() # Get username and password token = auth[len(prefix):] username, password = parseBasicAuthToken(token) # TODO stop logging accesses print('AUTHD WITH: {}, {}\n\n'.format(username, password)) # Fail if these credentials don't exist try: creds = LocalCredentials.objects.get(username=username) except LocalCredentials.DoesNotExist: raise exceptions.AuthenticationFailed() # We should probably check their password matches if creds.password != password: raise exceptions.AuthenticationFailed() # These are useful things for auth.. maybe later return (None, None) def authenticate_header(self, request): return 'Basic realm="api"'
{ "repo_name": "CMPUT404W17T06/CMPUT404-project", "path": "rest/authUtils.py", "copies": "1", "size": "3344", "license": "apache-2.0", "hash": 6049982798142617000, "line_mean": 31.4660194175, "line_max": 77, "alpha_frac": 0.6734449761, "autogenerated": false, "ratio": 4.531165311653116, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.5704610287753116, "avg_score": null, "num_lines": null }
import uuid import json from dash.models import Post, Author from .verifyUtils import InvalidField, MissingFields, MalformedId, NotFound, \ MalformedBody def validateData(data, fields): """ Validates data in a dictionary using validation functions. Validation functions should take 3 arguments, the full data (for dependency validation), the data name, and the data. Validation functions return an updated, validated version of their value. Validation functions should raise InvalidField exceptions when they fail to validate their data or DependencyError if a precondition fails. """ for key, validator in fields: if isinstance(validator, tuple): if key in data: try: validateData(data[key], validator) except InvalidField as e: for innerKey in e.data: raise InvalidField(key + '.' + innerKey, e.data[innerKey]) else: raise InvalidField(key, data[key]) elif key in data: data[key] = validator(data, key, data[key]) def requireFields(data, required): """ Ensure that data has required fields. No return on success. Raises MissingFields if fields are missing from data. """ # Make sure we have required fields notFound = [] for key in required: # If it's a tuple we need to recurse if isinstance(key, tuple): # The key wasn't even sent in the data if key[0] not in data: notFound.append(key[0]) # If the data at the key isn't a dict then it's the wrong type # Say we're missing it and leave early elif not isinstance(data[key[0]], dict): notFound.append(key[0]) # If the key is in the data recurse elif key[0] in data: # Recurse. Catch missing fields from below and append their # keys to make the output more useful try: requireFields(data[key[0]], key[1]) except MissingFields as e: for missing in e.data['required']: notFound.append(key[0] + '.' + missing) # It was a flat key and just wasn't found else: notFound.append(key[0]) # It's not a tuple so it should be a key in this data, append to # notFound elif key not in data: notFound.append(key) # If we didn't find required keys return an error if notFound: raise MissingFields(notFound) def pidToUrl(request, pid): """ Change a URL pid to a locally valid post id URL. Returns a url string on success or raises MalformedId. """ try: urlUuid = uuid.UUID(pid) url = 'http://' + request.get_host() + '/posts/' + urlUuid.hex + '/' except ValueError: # Include the bad ID in the response badPath = '/posts/' + pid + '/' raise MalformedId('post', request.build_absolute_uri(badPath)) return url def aidToUrl(request, pid): """ Change a url aid to a locally valid author id URL. Returns a url string on success or raises MalformedId. """ try: urlUuid = uuid.UUID(pid) url = 'http://' + request.get_host() + '/author/' + urlUuid.hex + '/' except ValueError: # Include the bad ID in the response raise MalformedId('author', request.build_absolute_uri(request.path)) return url def getPost(request, pid): """ Get a post by pid in URL. pid = Post id (uuid4, any valid format available from uuid python lib) Returns a post object on success, raises NotFound on failure. """ # Get url or error response url = pidToUrl(request, pid) try: post = Post.objects.get(id=url) # Url was valid but post didn't exist except Post.DoesNotExist: # Include the bad ID in the response badPath = '/posts/' + pid + '/' raise NotFound('post', request.build_absolute_uri(badPath)) return post def getAuthor(request, aid): """ Get an author by aid in URL. aid = Author id (uuid4, any valid format available from uuid python lib) Returns an Author object on success, raises NotFound on failure. """ # Get url or error response url = aidToUrl(request, aid) try: author = Author.objects.get(id=url) # Url was valid but author didn't exist except Author.DoesNotExist: # Include the bad ID in the response raise NotFound('author', request.build_absolute_uri(request.path)) return author def getData(request): """ This tries to return valid JSON data from a request. Raises MalformedBody if POST body wasn't valid JSON. """ try: return json.loads(str(request.body, encoding='utf-8')) except json.decoder.JSONDecodeError: raise MalformedBody(request.body) def getPostData(request): """ Returns post data from POST request. """ data = getData(request) # Ensure required fields are present required = ('author', 'title', 'content', 'contentType', 'visibility') requireFields(data, required) return data def getCommentData(request): """ Returns comment data from POST request. """ data = getData(request) # Ensure required fields are present required = ( 'query', 'post', ('comment', ( ('author', ( 'id', 'host', 'displayName' )), 'comment', 'contentType', 'published', 'id' )) ) requireFields(data, required) return data def getFriendRequestData(request): """ Returns friend request data from POST request. """ data = getData(request) authorRequired = ('id', 'host', 'displayName') required = ( 'query', ('author', authorRequired), ('friend', authorRequired) ) requireFields(data, required) return data def getFriendsListData(request): """ Returns data about a multiple friend query. """ data = getData(request) required = ( 'query', 'author', 'authors' ) requireFields(data, required) return data
{ "repo_name": "CMPUT404W17T06/CMPUT404-project", "path": "rest/dataUtils.py", "copies": "1", "size": "6464", "license": "apache-2.0", "hash": 1300210495638494500, "line_mean": 28.3818181818, "line_max": 79, "alpha_frac": 0.588799505, "autogenerated": false, "ratio": 4.34700739744452, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.543580690244452, "avg_score": null, "num_lines": null }
from django.core.paginator import Paginator, InvalidPage from rest_framework.views import APIView from dash.models import Comment, Author, RemoteCommentAuthor from .serializers import CommentSerializer from .verifyUtils import addCommentValidators, InvalidField, ResourceConflict, \ DependencyError, NotVisible from .dataUtils import validateData, getCommentData, getPost from .httpUtils import JSONResponse class CommentView(APIView): """ This view gets """ def get(self, request, pid): # Try to pull page number out of GET try: pageNum = int(request.GET.get('page', 0)) except ValueError: raise InvalidField('page', request.GET.get('page')) # Paginator one-indexes for some reason... pageNum += 1 # Try to pull size out of GET try: size = int(request.GET.get('size', 50)) except ValueError: raise InvalidField('size', request.GET.get('size')) # Only serve max 100 comments per page if size > 100: size = 100 # Get comments and the count post = getPost(request, pid) comments = Comment.objects.filter(post=post) count = comments.count() # Set up the Paginator pager = Paginator(comments, size) # Get our page try: page = pager.page(pageNum) except InvalidPage: data = {'query': 'comments', 'count': count, 'comments': [], 'size': 0} if pageNum > pager.num_pages: # Last page is num_pages - 1 because zero indexed for external uri = request.build_absolute_uri('?size={}&page={}'\ .format(size, pager.num_pages - 1)) data['last'] = uri elif pageNum < 1: # First page is 0 because zero indexed for external uri = request.build_absolute_uri('?size={}&page={}'\ .format(size, 0)) data['first'] = uri else: # Just reraise the error.. raise return JSONResponse(data) # Start our query response respData = {} respData['query'] = 'comments' respData['count'] = count respData['size'] = size if size < len(page) else len(page) # Now get our data comSer = CommentSerializer(page, many=True) respData['comments'] = comSer.data # Build and our next/previous uris # Next if one-indexed pageNum isn't already the page count if pageNum != pager.num_pages: # Just use page num, we've already incremented and the external # inteface is zero indexed uri = request.build_absolute_uri('?size={}&page={}'\ .format(size, pageNum)) respData['next'] = uri # Previous if one-indexed pageNum isn't the first page if pageNum != 1: # Use pageNum - 2 because we're using one indexed pageNum and the # external interface is zero indexed uri = request.build_absolute_uri('?size={}&page={}'\ .format(size, pageNum - 2)) respData['previous'] = uri return JSONResponse(respData, status=200) def post(self, request, pid): """ This creates comments on posts. """ # Get and validate the sent data data = getCommentData(request) validateData(data, addCommentValidators) # See if a comment exists already try: comment = Comment.objects.get(id=data['comment']['id']) # We WANT it to be not found except Comment.DoesNotExist: pass # No error was raised which means it already exists else: raise ResourceConflict('comment', data['comment']['id']) # Get the post this should be attached to post = getPost(request, pid) # Check if post is SERVERONLY, they can't post comments to a SERVERONLY # post (how did they even SEE it?) if post.visibility == 'SERVERONLY': raise NotVisible('Access denied: post has SERVERONLY visibility') # Ensure that the url they POST'd to was the URL they said they were # posting to if post.id != data['post']: data = {'post.id': post.id, 'query.post': data['post']} raise DependencyError(data) # Pull out comment specific data commentData = data['comment'] # Build comment comment = Comment() comment.author = commentData['author']['id'] comment.post = post comment.comment = commentData['comment'] comment.contentType = commentData['contentType'] comment.published = commentData['published'] comment.id = commentData['id'] comment.save() authorData = commentData['author'] authorId = authorData['id'] # Try to get as a local author try: author = Author.objects.get(id=authorId) # Not a local author, we don't care, just make them remote except Author.DoesNotExist: # Try and get remote author, if we find, then update try: author = RemoteCommentAuthor.objects.get(authorId=authorId) author.displayName = authorData['displayName'] author.host = authorData['host'] author.github = authorData.get('github', '') author.save() # Didn't exist, so make! except RemoteCommentAuthor.DoesNotExist: author = RemoteCommentAuthor() author.authorId = authorId author.displayName = authorData['displayName'] author.host = authorData['host'] author.save() # TODO check if author has visibility,403 if they don't data = { "query": "addComment", "success": True, "message": "Comment Added" } return JSONResponse(data)
{ "repo_name": "CMPUT404W17T06/CMPUT404-project", "path": "rest/commentView.py", "copies": "1", "size": "6383", "license": "apache-2.0", "hash": -7357989257104396000, "line_mean": 35.0621468927, "line_max": 80, "alpha_frac": 0.5489581701, "autogenerated": false, "ratio": 4.707227138643068, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.5756185308743068, "avg_score": null, "num_lines": null }
from django.core.paginator import Paginator, InvalidPage from rest_framework.views import APIView from dash.models import Post from .serializers import PostSerializer from .dataUtils import getAuthor from .httpUtils import JSONResponse class AuthorPostView(APIView): """ This is for viewing all of the posts that a single author has made. """ def get(self, request, aid): # Try to pull page number out of GET try: pageNum = int(request.GET.get('page', 0)) except ValueError: raise InvalidField('page', request.GET.get('page')) # Paginator one-indexes for some reason... pageNum += 1 # Try to pull size out of GET try: size = int(request.GET.get('size', 50)) except ValueError: raise InvalidField('size', request.GET.get('size')) # Only serve max 100 posts per page if size > 100: size = 100 # Get the author author = getAuthor(request, aid) # Get their posts and exclude server only and unlisted posts = Post.objects.filter(author=author) \ .exclude(unlisted=True) \ .exclude(visibility="SERVERONLY") count = posts.count() # Set up the Paginator pager = Paginator(posts, size) # Get our page try: page = pager.page(pageNum) except InvalidPage: data = {'query': 'posts', 'count': count, 'posts': [], 'size': 0} if pageNum > pager.num_pages: # Last page is num_pages - 1 because zero indexed for external uri = request.build_absolute_uri('?size={}&page={}'\ .format(size, pager.num_pages - 1)) data['last'] = uri elif pageNum < 1: # First page is 0 because zero indexed for external uri = request.build_absolute_uri('?size={}&page={}'\ .format(size, 0)) data['first'] = uri else: # Just reraise the error.. raise return JSONResponse(data) # Start our query response respData = {} respData['query'] = 'posts' respData['count'] = count respData['size'] = size if size < len(page) else len(page) # Now get our data postSer = PostSerializer(page, many=True) respData['posts'] = postSer.data # Build and our next/previous uris # Next if one-indexed pageNum isn't already the page count if pageNum != pager.num_pages: # Just use page num, we've already incremented and the external # inteface is zero indexed uri = request.build_absolute_uri('?size={}&page={}'\ .format(size, pageNum)) respData['next'] = uri # Previous if one-indexed pageNum isn't the first page if pageNum != 1: # Use pageNum - 2 because we're using one indexed pageNum and the # external interface is zero indexed uri = request.build_absolute_uri('?size={}&page={}'\ .format(size, pageNum - 2)) respData['previous'] = uri return JSONResponse(respData)
{ "repo_name": "CMPUT404W17T06/CMPUT404-project", "path": "rest/authorPostView.py", "copies": "1", "size": "3559", "license": "apache-2.0", "hash": 2794073843567580000, "line_mean": 34.2376237624, "line_max": 78, "alpha_frac": 0.5206518685, "autogenerated": false, "ratio": 4.658376963350785, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 0.5679028831850785, "avg_score": null, "num_lines": null }
from django.core.paginator import Paginator, InvalidPage from rest_framework.views import APIView from dash.models import Post from .serializers import PostSerializer from .verifyUtils import InvalidField from .httpUtils import JSONResponse class PostsView(APIView): """ This is the get multiple posts view and uses Pagination to display posts. """ def get(self, request): # Try to pull page number out of GET try: pageNum = int(request.GET.get('page', 0)) except ValueError: raise InvalidField('page', request.GET.get('page')) # Paginator one-indexes for some reason... pageNum += 1 # Try to pull size out of GET try: size = int(request.GET.get('size', 50)) except ValueError: raise InvalidField('size', request.GET.get('size')) # Only serve max 100 posts per page if size > 100: size = 100 # Get posts and the count posts = Post.objects.exclude(visibility='SERVERONLY') count = posts.count() # Set up the Paginator pager = Paginator(posts, size) # Get our page try: page = pager.page(pageNum) except InvalidPage: data = {'query': 'posts', 'count': count, 'posts': [], 'size': 0} if pageNum > pager.num_pages: # Last page is num_pages - 1 because zero indexed for external uri = request.build_absolute_uri('?size={}&page={}'\ .format(size, pager.num_pages - 1)) data['last'] = uri elif pageNum < 1: # First page is 0 because zero indexed for external uri = request.build_absolute_uri('?size={}&page={}'\ .format(size, 0)) data['first'] = uri else: # Just reraise the error.. raise return JSONResponse(data) # Start our query response respData = {} respData['query'] = 'posts' respData['count'] = count respData['size'] = size if size < len(page) else len(page) # Now get our data postSer = PostSerializer(page, many=True) respData['posts'] = postSer.data # Build and our next/previous uris # Next if one-indexed pageNum isn't already the page count if pageNum != pager.num_pages: # Just use page num, we've already incremented and the external # inteface is zero indexed uri = request.build_absolute_uri('?size={}&page={}'\ .format(size, pageNum)) respData['next'] = uri # Previous if one-indexed pageNum isn't the first page if pageNum != 1: # Use pageNum - 2 because we're using one indexed pageNum and the # external interface is zero indexed uri = request.build_absolute_uri('?size={}&page={}'\ .format(size, pageNum - 2)) respData['previous'] = uri return JSONResponse(respData, status=200)
{ "repo_name": "CMPUT404W17T06/CMPUT404-project", "path": "rest/multiPostView.py", "copies": "1", "size": "3369", "license": "apache-2.0", "hash": 8388208766356484000, "line_mean": 34.4631578947, "line_max": 78, "alpha_frac": 0.5244879786, "autogenerated": false, "ratio": 4.6341127922971115, "config_test": false, "has_no_keywords": false, "few_assignments": false, "quality_score": 1, "avg_score": 0.0010338555418646952, "num_lines": 95 }