Split (1)

validation · 2.01k rows

text stringlengths 8.19k 8.19k	meta dict
re 7:12 AM? 1:27 AM What is 160 minutes before 6:27 PM? 3:47 PM How many minutes are there between 6:36 AM and 7:12 AM? 36 What is 141 minutes before 4:54 PM? 2:33 PM How many minutes are there between 12:18 PM and 10:09 PM? 591 How many minutes are there between 11:26 AM and 4:30 PM? 304 How many minutes are there between 9:46 PM and 1:59 AM? 253 What is 520 minutes before 2:33 PM? 5:53 AM What is 211 minutes before 10:41 AM? 7:10 AM What is 171 minutes before 2:32 AM? 11:41 PM How many minutes are there between 9:22 AM and 12:44 PM? 202 How many minutes are there between 9:53 PM and 3:03 AM? 310 What is 657 minutes after 12:56 AM? 11:53 AM What is 277 minutes before 12:31 AM? 7:54 PM How many minutes are there between 4:48 PM and 7:12 PM? 144 How many minutes are there between 3:32 PM and 12:39 AM? 547 What is 69 minutes after 10:53 AM? 12:02 PM How many minutes are there between 6:55 PM and 5:20 AM? 625 How many minutes are there between 2:36 PM and 11:16 PM? 520 What is 643 minutes before 6:38 AM? 7:55 PM What is 405 minutes after 4:56 PM? 11:41 PM What is 82 minutes after 12:06 AM? 1:28 AM What is 568 minutes before 12:44 PM? 3:16 AM What is 313 minutes after 1:45 AM? 6:58 AM What is 121 minutes before 12:10 AM? 10:09 PM How many minutes are there between 7:55 PM and 10:16 PM? 141 How many minutes are there between 1:02 AM and 9:26 AM? 504 What is 677 minutes after 1:12 PM? 12:29 AM How many minutes are there between 8:51 PM and 3:54 AM? 423 What is 49 minutes before 5:51 PM? 5:02 PM How many minutes are there between 3:27 AM and 10:55 AM? 448 What is 292 minutes after 9:53 AM? 2:45 PM How many minutes are there between 4:08 AM and 4:43 AM? 35 What is 295 minutes after 6:52 PM? 11:47 PM What is 185 minutes after 3:09 AM? 6:14 AM How many minutes are there between 8:11 AM and 6:31 PM? 620 What is 647 minutes after 4:30 PM? 3:17 AM How many minutes are there between 9:15 PM and 1:58 AM? 283 What is 405 minutes after 7:42 PM? 2:27 AM How many minutes are there between 7:47 AM and 8:50 AM? 63 How many minutes are there between 8:18 PM and 8:57 PM? 39 What is 91 minutes after 2:53 PM? 4:24 PM How many minutes are there between 6:07 AM and 6:02 PM? 715 What is 249 minutes before 1:46 PM? 9:37 AM How many minutes are there between 6:31 AM and 5:58 PM? 687 What is 41 minutes after 12:59 AM? 1:40 AM What is 503 minutes after 9:32 AM? 5:55 PM What is 468 minutes before 8:20 PM? 12:32 PM What is 530 minutes after 6:44 AM? 3:34 PM How many minutes are there between 8:10 PM and 3:57 AM? 467 How many minutes are there between 9:52 PM and 11:08 PM? 76 How many minutes are there between 1:34 PM and 12:05 AM? 631 What is 702 minutes after 9:36 PM? 9:18 AM What is 681 minutes before 10:00 PM? 10:39 AM How many minutes are there between 10:07 AM and 2:32 PM? 265 What is 457 minutes after 2:30 AM? 10:07 AM How many minutes are there between 3:53 AM and 8:05 AM? 252 What is 69 minutes before 2:38 AM? 1:29 AM What is 473 minutes before 11:44 AM? 3:51 AM What is 528 minutes after 11:36 AM? 8:24 PM What is 670 minutes before 9:08 PM? 9:58 AM What is 341 minutes after 8:06 AM? 1:47 PM How many minutes are there between 4:38 AM and 11:39 AM? 421 How many minutes are there between 10:09 PM and 9:18 AM? 669 What is 36 minutes after 5:15 AM? 5:51 AM How many minutes are there between 8:43 PM and 11:30 PM? 167 How many minutes are there between 7:58 AM and 1:03 PM? 305 What is 553 minutes before 6:01 AM? 8:48 PM What is 52 minutes before 2:26 PM? 1:34 PM How many minutes are there between 11:24 AM and 9:48 PM? 624 How many minutes are there between 6:15 AM and 12:14 PM? 359 What is 611 minutes after 4:16 AM? 2:27 PM How many minutes are there between 4:08 AM and 8:05 AM? 237 How many minutes are there between 3:47 PM and 6:23 PM? 156 What is 443 minutes before 2:35 AM? 7:12 PM What is 120 minutes before 9:35 AM? 7:35 AM How many minutes are there between 7:19 AM and 6:44 PM? 685 What is 644 minutes after 2:04 AM? 12:48 PM What is 402 minutes after 5:28 AM? 12:10 PM What is 25 minutes after 12:13 AM? 12:38 AM How many minutes are there between 4:01 AM and 5:44 AM? 103 What is 251 minutes before 6:01 PM? 1:50 PM How many minutes are there between 9:11 PM and 8:50 AM? 699 How many minutes are there between 7:40 AM and 6:44 PM? 664 How many minutes are there between 3:50 PM and 5:18 PM? 88 How many minutes are there between 9:11 AM and 1:37 PM? 266 How many minutes are there between 7:11 AM and 11:22 AM? 251 What is 302 minutes before 1:25 PM? 8:23 AM What is 320 minutes before 1:07 PM? 7:47 AM What is 508 minutes after 12:14 AM? 8:42 AM What is 692 minutes after 4:58 AM? 4:30 PM How many minutes are there between 9:36 AM and 6:34 PM? 538 How many minutes are there between 8:11 AM and 5:57 PM? 586 What is 643 minutes before 8:37 PM? 9:54 AM What is 507 minutes before 5:42 PM? 9:15 AM How many minutes are there between 11:08 AM and 1:11 PM? 123 What is 605 minutes after 12:58 AM? 11:03 AM How many minutes are there between 7:56 PM and 7:55 AM? 719 How many minutes are there between 9:00 AM and 7:44 PM? 644 How many minutes are there between 11:37 AM and 6:25 PM? 408 What is 607 minutes before 6:53 AM? 8:46 PM How many minutes are there between 7:14 PM and 12:18 AM? 304 What is 250 minutes before 10:32 PM? 6:22 PM What is 144 minutes after 11:47 AM? 2:11 PM How many minutes are there between 6:52 PM and 5:47 AM? 655 What is 559 minutes before 4:10 PM? 6:51 AM How many minutes are there between 11:40 PM and 4:05 AM? 265 How many minutes are there between 10:46 AM and 10:32 PM? 706 How many minutes are there between 3:16 AM and 6:03 AM? 167 What is 688 minutes after 8:16 AM? 7:44 PM How many minutes are there between 11:09 PM and 1:31 AM? 142 How many minutes are there between 2:13 AM and 12:43 PM? 630 How many minutes are there between 10:20 AM and 2:59 PM? 279 How many minutes are there between 12:09 PM and 10:50 PM? 641 What is 331 minutes before 7:22 PM? 1:51 PM What is 325 minutes before 2:53 PM? 9:28 AM What is 585 minutes after 8:45 AM? 6:30 PM How many minutes are there between 4:50 PM and 12:09 AM? 439 How many minutes are there between 10:00 PM and 7:36 AM? 576 What is 462 minutes before 12:31 PM? 4:49 AM How many minutes are there between 8:38 AM and 6:06 PM? 568 What is 588 minutes before 5:06 PM? 7:18 AM How many minutes are there between 2:20 PM and 2:19 AM? 719 What is 703 minutes after 1:25 AM? 1:08 PM How many minutes are there between 12:16 PM and 7:49 PM? 453 How many minutes are there between 8:51 AM and 5:58 PM? 547 How many minutes are there between 5:36 AM and 8:23 AM? 167 How many minutes are there between 7:30 PM and 1:46 AM? 376 How many minutes are there between 2:01 PM and 2:51 PM? 50 What is 92 minutes before 11:53 PM? 10:21 PM How many minutes are there between 2:54 PM and 1:37 AM? 643 What is 501 minutes after 1:09 PM? 9:30 PM How many minutes are there between 10:38 AM and 12:48 PM? 130 How many minutes are there between 9:04 AM and 10:04 AM? 60 How many minutes are there between 7:13 PM and 5:31 AM? 618 How many minutes are there between 5:16 AM and 12:25 PM? 429 What is 641 minutes before 1:58 PM? 3:17 AM What is 6 minutes before 5:13 PM? 5:07 PM What is 54 minutes after 9:46 PM? 10:40 PM How many minutes are there between 11:03 PM and 12:58 AM? 115 What is 121 minutes before 5:18 PM? 3:17 PM What is 123 minutes after 1:58 AM? 4:01 AM How many minutes are there between 8:39 AM and 11:17 AM? 158 How many minutes are there between 8:53 AM and 6:49 PM? 596 How many minutes are there between 12:19 PM and 3:42 PM? 203 What is 197 minutes after 12:06 PM? 3:23 PM What is 607 minutes after 5:01 PM? 3:08 AM How many minutes are there between 2:38 AM and 6:53 AM? 255 How many minutes are there between 3:02 AM and 8:56 AM? 354 What is 705 minutes after 10:02 AM? 9:47 PM How many minutes are there between 6:01 AM and 7:01 AM? 60 What is 693 minutes after 12:59 AM? 12:32 PM What is 404 minutes after 11:46 AM? 6:30 PM What is 578 minutes before 10:09 PM? 12:31 PM What is 628 minutes before 12:48 AM? 2:20 PM What is 474 minutes after 4:04 AM? 11:58 AM How many minutes are there between 6:30 PM and 9:26 PM? 176 How many minutes are there between 4:05 PM	{ "pile_set_name": "DM Mathematics" }
23c - 32c = -9. Solve s - 20 = 5k, c = 2s + 3k - 0k for s. 5 Suppose 7i = 55 + 316. Suppose -id + 58d - 20 = 0. Solve -dk = 4q, -q - q - 4k = 0 for q. 0 Let q = -33088 + 33092. Solve 0 = 5a, -347n + 345n + q = -2a for n. 2 Let t(l) = 6l + 33. Let z be t(-5). Suppose -zg - 15 = 5s, 0g + s + 3 = -g. Solve g = 3b - 9, -4 = 4u + 2b + 2 for u. -3 Let z(o) = 2o*3 - 2o*2 - o + 9. Let a be z(6). Suppose a - 153 = 15l. Solve -4t = -2i - l, 2i + i + 3 = 0 for t. 3 Suppose -10u + 93 + 40 = 43. Solve -4 = -um + 12m - h, 4m - 5h - 13 = 0 for m. -3 Let c = 3840 + -3832. Solve -3f - cr + 3r - 29 = 0, 3f - 5r = 11 for f. -3 Suppose -857f + 1008f = 0. Solve 2d - 7 = -w, 3d - 9w + 14w - 21 = f for d. 2 Let y be ((-2)/(-2) - 0)0. Suppose 3v - 4k - 13 = 0, 82k + 1 = 81k. Solve vl = 3m - 4m - 12, -4m + 5l + 37 = y for m. 3 Let k = 527 + -524. Let s = -9 + 13. Solve -v - kd + 12 = -sv, 5v + 4d = -2 for v. -2 Let n(w) = -2w - 140. Let l be n(-26). Let d = 108 + l. Solve d = -4x - 3t, 7 = 3t + 19 for x. -2 Let a = -10870 + 10895. Solve -5y = -2g + 13, 1 = -2y + ag - 20g for y. -3 Let g be (9/(-2) + 6)40. Let i = g + -57. Solve -iv - 8 = 2j, -3v + 0j - j = 7 for v. -2 Let u = 1571 + -1568. Solve -uh + 0h - 11 = -2i, -3i + 15 = -4h for h. -3 Suppose 0 = -328q + 344q - 64. Solve 2z = -q, 0n - 4z = -2n + 12 for n. 2 Let n(u) = 2u2 + 5u - 13. Let p be n(4). Suppose 31 - p = -2o. Solve 4i - o - 12 = 0, -5i + 26 = 2g for g. 3 Suppose 208 = 14p + 43p + 37. Solve 36 = -5z + 4w, pz + 1 = -w - 7 for z. -4 Let w be 108/(-10)80/(-24). Suppose 5t = -t + w. Let g = -6 + t. Solve -q = 5u + q - 13, u + 3q = g for u. 3 Suppose 82y - 96 = 314. Solve 23n - 24n = 0, -2k - yn + 2 = 0 for k. 1 Let w(o) = -o*3 - 14o*2 - 10. Let m be w(-14). Let z be (-46)/m - (-24)/60. Let x be 3 - -1 - (-2 - -4). Solve 5h + xt = -4 - 1, -t = -zh - 5 for h. -1 Suppose -4h + 86r = 85r - 15, 3h = 3r + 27. Solve hb + 8u - 9u - 7 = 0, 4 = 2b + 2u for b. 3 Let q(c) = -2c - 14. Let j be q(-15). Suppose 0 = ja - 24a + 160. Solve 0v + 2v - 12 = -5y, -5v - a = 0 for y. 4 Let q(z) be the second derivative of z4/12 + 2z3/3 + z2/2 + z. Suppose 23j + 10 = 21j. Let y be q(j). Solve 2t + 3w + y = -12, 4t + 16 = -w for t. -3 Let d be 12 + (-168)/(-63)((-27)/(-2))/(-9). Solve 5r = -4m + 6, -23m = -2r - 22m - d for r. -2 Let g(x) = 3x + 9. Let v be g(1). Suppose -vq + 7 + 41 = 0. Solve -4y + 11 = -p, -y + 4 = -qp - 10 for p. -3 Suppose 6s - g + 16 = 11s, 5s = g + 4. Solve -19 = -5y + f, 0 = sy - 0f - 4f + 14 for y. 5 Suppose 0 = 3s - 2f - 0f - 70, 2s = -2f + 40. Let r = s + -22. Solve r = -2c - 4u + 4, 2c - 3 = -7u + 2u for c. 4 Suppose -3w + 0w = -6. Suppose -113z + 7 = p - 111z, -z = -5p + 13. Solve wi + 11 = y, -4y + p = 5i + 11 for y. 3 Suppose 0 = 3s + 5t - 5, 8 = 5s + 5t - 7. Let z = 79 + -37. Let h be z/105 + 16/10. Solve hy + 11 + s = -3g, -g + 3y = -2 for g. -4 Let v(s) = -s3 + 85s*2 - 86s + 168. Let w be v(84). Solve 2d = 0, -5r + 5 = -wd + 3d for r. 1 Let t(u) = -2u2 + 3u - 6. Let l be t(5). Let n be 6/(-72) - 4216/96. Let o = l - n. Solve -5w + 27 = -3b, -ow + 3b = w - 24 for w. 3 Suppose -53 = -4j - 3u, -2j = -2u - 14 - 16. Solve 2f = h - 4, -jh + 9h = -4f - 2 for f. -3 Suppose 31m - 216 = 28m. Let x = 26 + m. Let g = 123 - x. Solve -4a = 5d + a + g, 0 = a + 5 for d. 0 Let s = 123 + -117. Solve -3x + 2w = sw - 5, 0 = 3w - 15 for x. -5 Suppose -17k - 27k + 17k = -162. Solve 6d - 3i + k = 9d, d + 5i = 18 for d. -2 Let x be 4 + -1 + -4(-2 - -1). Let w be 8/(-1)x/(-140)5. Solve u - 20 = 4k + 3, wu = -3k - 9 for u. 3 Suppose 30 = 4c + c. Suppose 3r + 3n + c = 0, 0 = -3r + 4n + 1 + 14. Solve -k + 18 - r = 5z, z - 5k - 19 = 0 for z. 4 Suppose 21d - 187 = 674. Let a = -39 + d. Solve -a = -3z + 1, s = 2z + 1 for s. 3 Let b be (166 - 167)/(1/(-19)). Solve 11 = -3t + v + b, -5t - 5v = -20 for t. 3 Let k(t) = -3t3 - 2t*2 + t + 2. Let s be k(-1). Let v be -11s(-4)/8. Suppose 43 - 47 = -p. Solve -4c + v - 3 = 0, 0 = pg - 5c + 10 for g. 0 Suppose -l + 6s - 10s = 1, 3l - 15 = -3s. Solve -a - ln = -9n + 2, -10 = -5n for a. 2 Let t = -212 - -167. Let r(f) = f + 60. Let l be r(t). Solve -3q + 5a - l = 0, 3a - 4a + 5 = -q for q. -5 Suppose -2 = 19s - 17s, -4q + 7 = s. Solve -5r + 5n = -6r - 22, -qr + 4n = -12 for r. -2 Suppose 4t = 4x + 176, 37 = -3t - 3x + 127. Solve -ts + 35s = j, -4j = 5s + 3 for s. 1 Suppose -l + 31v + 12 = 33v, 0 = -4l + 4v + 48. Solve 5d = 3i - l, -d + 4i = 3i + 2 for d. -3 Let r(w) = -3 + 5w + 0w + 32. Suppose 79g + 290 = 21g. Let l be r(g). Solve -4k = -i + 12, li - 5k = -i for i. -4 Let k be (1/10)/((-25)/(-750)). Solve -5x = -kx + 4a + 2, -3a = 3x + 9 for x. -5 Suppose h = 6h + 210. Let a(r) = -8r - 13. Let l be a(-8). Let d = h + l. Solve 3y + w = d, 1 = y + 3w + 6 for y. 4 Let q(t) = 4t*3 - t + 2t - 13 - 23t2 + 6t*2 - 3t*3. Let k be q(17). Solve -14 = 3h + 4z, kh + z + 4 = 7 for h. 2 Suppose -a = -4a + 5o - 2, 3o = 12. Solve 4u - 4f = -af - 18, 19 = -4u - f for u. -5 Let l be 14((-14)/16-4 + -5). Let w be (24/l + 2)/(36/126). Solve -4h - wb + 17 = -10, -5h + 30 = 3b for h. 3 Let d(s) = 40s - 39. Let a be d(1). Let t be -2a27/(-18). Solve 2c = -2c - 4z + 12, 10 = 2c + tz for c. -1 Let u(n) = -2n*3 - 5n*2 - 42n - 130. Let r be u(-3). Solve -5t - 31g = -26g + 10, 3t - rg - 26 = 0 for t. 2 Let c(p) be the second derivative of -15p - 11/2p2 + 1/6p*3 + 0. Let r be c(13). Solve -20 = rl - 2v, v = -l - 4v + 20 for l. -5 Suppose 0 = -17s - 6s + 483. Suppose -3d = -3 - 39. Suppose -sh = -91 - d. Solve 0 = -8x + hx - 5m + 6, -3x + 5m + 6 = 0 for x. 2 Let x = 499 + -495. Solve 4 = 2k - l, 8k = 4k - xl + 8 for k. 2 Let r = 1910 + -1893. Solve -5o - 4z + 21 = 0, -5o + r = -0o + 3z for o. 1 Let f(o) = o*2 - 69o - 446. Let i be f(75). Solve -2t = -t + iq + 16, 3t + 3q + 12 = 0 for t. 0 Suppose 0 = -2y + 12y + 630. Let n = y - -54. Let u(j) = 2j + 23. Let q be u(n). Solve 0 = 2r + f + 10, -5f = -qr - 4f - 18 for r. -4 Let k = -226 - -448. Suppose 3g + 0i = -i + k, -4g = -4i - 280. Let c = g + -67. Solve 5u = 4m, -2m + 4u = -cm - 36 for m. -5 Let j be (1/(-2))/((-5)/(-20))-6. Suppose -jk + 170 = -14k. Let r = k + 91. Solve 6a + 20 = 2t + 2a, -3a - r = 3t for t. 2 Suppose 2754g - 7866 = 2735g. Solve a + 3q = -1, 2q - g + 416 = -2a for a. -1 Let q be ((6/9)/(26/(-117)))/1. Let k be 1/(q + 30/9). Solve 2r = 0, u - 4r - k = 4u for u. -1 Suppose -3m + 0 = 3, a + m = 1. Let s be (0 + -10)/(-1a). Suppose -4u = -4v + 80, 20u = -2v + 19u + 25. Solve p + z + 3 = 0, sz - 4z = 5p + v for p. -3 Let m(q) = 2q2 + 4q - 1. Let g be m(-3). Let n(z) = 3z2 - 23z + 54. Let y be n(4). Solve -4o + 22 = gd, 5d + y = -5o + 35 for o. 3 Let y(c) = 2c + 22. Suppose -3w + 12 = -2w. Let r be 66/(-8) + -1 + 3/w. Let v be y(r). Solve 5m + p + 0p + 9 = 0, -5m - vp - 21 = 0 for m. -1 Let n be ((-16)/(-10))/((-92)/(-115)). Solve -f = -l, -l + nf + 13 = 16 for l. 3 Suppose -5u + 14 - 4 = 0. Let a(i) = -2i - 9. Let l be a(-12). Suppose -6o + 3o + 15 = 2g, -o + l = 4g. Solve 2k + h + u = k, -oh - 8 = k for k. 1 Suppose 46i - 53i = -28. Let g be (2/i)/(2(-2)/(-32)). Solve 4u + g = d - 5d, 2d + u = 0 for d. 1 Suppose n - 32 = -5x, -4x - 4n = -74 + 10. Suppose -3o = -13 - 35. Solve 5c - s - 21 = c, -o = -4c - xs for c. 5 Let p be 10/140-2 + (-1286)/14. Let o = -80 - p. Solve -4s = 5r + o, 6 = -4r - 3s + s for r. 0 Suppose 5u - 43 = 27. Let l = -12 + u. Suppose 5a + 5g - 35 = 0, a - 2g - l = -1. Solve f = -2h + 9, ah = 3f - f for f. 5 Let v = -18 + 20. Suppose 8 = 5h - v. Suppose 0f - 2d = -f + 6, -2f - hd - 6 = 0. Solve -3n - 5q + 10 = 0, 4q + fq = 5n + 45 for n. -5 Let w(t) = -467t + 2350. Let x be w(5). Solve 4i + x = -4m - i, -5m + i + 3 = 0 for m. 0 Let g(n) = 282n + 1694. Let l be g(-6). Solve o - 25 = 5w, -lo = 7w - 11w - 20 for w. -5 Let w be ((-33)/(-55))/(2/10	{ "pile_set_name": "DM Mathematics" }
Simplify gg(1/15)(gg/(g(g(((gg/(((g/(((gg5)/g)/g))/g)/g))/g)/g)/g)/g))/g assuming g is positive. g(-44/15) Simplify (p7p/p9)/(p(1/2)/p(3/10)) assuming p is positive. p(-6/5) Simplify (u*(-3/7)u/(u(u/(u(2/5)/u))/uuu))/(uu*(-4)uuuu7) assuming u is positive. u(-351/35) Simplify g/g(-22)g(-3/4) assuming g is positive. g(89/4) Simplify (v*0/vv/v3)(-8/13) assuming v is positive. v(24/13) Simplify (o1)*(-3)o*(-2/17)/(oo(7/4)) assuming o is positive. o(-399/68) Simplify ((z/(z/(z/(z/(zz/(zz/(z/z*(-3/8)))z)))))/(z/z(-5)))10 assuming z is positive. z(-145/4) Simplify ((c0/c)/c(c/c(-2)c)/c)/(c(1/5))(1/40) assuming c is positive. c*(199/200) Simplify ((h((h/((h/(hh(-3)))/hhh))/h)/hh)/h)*31/((h(h/h*(4/7)h)/hh)/hh(-2)) assuming h is positive. h(-864/7) Simplify ((k*(-4)k)/k)(10/3) assuming k is positive. k(-40/3) Simplify (k/((k/(k(k(k*(-28)k)/k)/k)kk)/k))/((k/((k/((k/k5)/k))/k))/k) assuming k is positive. k(-23) Simplify p*(5/2)ppp*(2/3)(p*(-1)/pp)(5/9) assuming p is positive. p(83/18) Simplify (b/b*4bb(bb(3/8))/bb)/(b(-1/2)/b)(5/7) assuming b is positive. b(81/56) Simplify (g(-2/3)g(2/5)g)/(g*(-4)/(((ggg/(g/(g/(gg*(-2/11)))))/g)/gg)) assuming g is positive. g*(976/165) Simplify aa/(aa/a6)a18 assuming a is positive. a24 Simplify (w/(ww(-3/7))w*(1/3))/((((ww*(-1/6)/w)/w)/ww)/w0) assuming w is positive. w(27/14) Simplify (q(((q/(q(q*2/q)/q))/qq)/q)/q)/(qq(-30)q) assuming q is positive. q*27 Simplify (gggg(-1)/g)/(g(-1/17)g) assuming g is positive. g(1/17) Simplify ppp(p/(pp(-5))pp)/pp*(3/2)pppp/p2pp/(((p/(p/(p/((p/(pp*2)pp)/p)p)))/p)/p) assuming p is positive. p(27/2) Simplify (l(-1/11)/ll)(-14) assuming l is positive. l(14/11) Simplify (h/(h/h4))/(h(-7)h)((h(h*(2/7)hh)/h)/h)(-6) assuming h is positive. h(16/7) Simplify (r1rr(-2)/r)(-8/7) assuming r is positive. r(8/7) Simplify (mm/(mmm*(1/16)))/((m/(mmmm/(m/(m/(m/(m*(-46)/m))))mmm))/m) assuming m is positive. m*(-657/16) Simplify ((ii2/i)/i(2/3))(2/115) assuming i is positive. i(8/345) Simplify (p(pp((p/p5)/p)/p)/pppp/((pp/(p(-2/7)/pp))/p))/(pp(2/3))(-1/45) assuming p is positive. p(-425/189) Simplify o(-4)/(o/(oo*(2/5)))((o/o*(-1/4))/o)/(ooo/(ooo/o4)) assuming o is positive. o(-147/20) Simplify (p(-8)/pp)/(p*(-7)p)p2/p(-2/15) assuming p is positive. p(2/15) Simplify x27xx(12/7)/x assuming x is positive. x(201/7) Simplify (t/(t9t)t)(-42) assuming t is positive. t336 Simplify ((kk/k(2/9))(-2/83))(8/17) assuming k is positive. k(-256/12699) Simplify (j*(1/6)j*(-1))/(jj1)(34/7) assuming j is positive. j(-443/42) Simplify (q2)(-34) assuming q is positive. q(-68) Simplify (n(2/15))(-2/5) assuming n is positive. n(-4/75) Simplify q(2/17)/q*2q*(-2/7)q2 assuming q is positive. q(-20/119) Simplify (r/(((r/r*(-1/3))/r)/r)rr)48/((r(-7)r)/r(r/r(4/7))/r) assuming r is positive. r(1285/7) Simplify zz*(-13)/zzz/((z(-3/8)zzz)/zzz) assuming z is positive. z*(-117/8) Simplify (ii(i(-41)iii)/ii)/ii/i48 assuming i is positive. i(-84) Simplify (((s/s*(-3)s)/s)/s)(2/85) assuming s is positive. s(6/85) Simplify (u/(uu(-16)u))/(uu(-26)) assuming u is positive. u40 Simplify (c(-3))(-6/5) assuming c is positive. c(18/5) Simplify (v/(v/(v(v/v*8v)/vv)))/v(-7)v/(v/v*(-1/5))v/(v/v(-2)) assuming v is positive. v(-1/5) Simplify (l*(16/7)/ll)/ll17/l assuming l is positive. l(121/7) Simplify (t(2/11)t)/(t*(-1/3)/t)t*(-3)t(-7) assuming t is positive. t(-247/33) Simplify (l/(ll(3/7)l))/(l/(l*7ll))l*0l(-2/3) assuming l is positive. l(124/21) Simplify r*(-2/99)r/(r/(r/((r/(r*(-2/55)r))/r))) assuming r is positive. r(962/495) Simplify (m(-12)/m)/m(-2/41) assuming m is positive. m(-531/41) Simplify (s(-1/2))(4/5)/(ss(-2/15)ss3) assuming s is positive. s(-79/15) Simplify (ss*(-10)s(-1))(1/5) assuming s is positive. s(-2) Simplify b(3/7)/(b/b(-4/7)) assuming b is positive. b(-8/7) Simplify (((a/a*(2/45))/aa)/a)/a(-33) assuming a is positive. a(1483/45) Simplify (s(-1/4))48/((ss(-6))/ss*(-2/25)/ss) assuming s is positive. s(-148/25) Simplify r(6/7)r/(r(-2/3)/r)(rr0r)5 assuming r is positive. r(284/21) Simplify (oo(-2/51)o)/o(-3/7) assuming o is positive. o(853/357) Simplify (y*13/yy)(-2/37) assuming y is positive. y(-26/37) Simplify ((qq8)/(q(q/q*(-10)q)/q))/(q/q(-1))(-2/9) assuming q is positive. q*(-23/9) Simplify ((v/(vvv/(v(v/v*(1/5))/vv)))/(v(-4)/v))/((v6/v)/(((((vv(vv/(v/(v(3/2)/vv)))/v)/v)/v)/v)/v)) assuming v is positive. v(-7/10) Simplify ((h/h(-1)h)(-22))(-42) assuming h is positive. h2772 Simplify (y/(y(-3)/y))/y3(y/(y/(y/(y*(-1/3)y)))y)(8/9) assuming y is positive. y(86/27) Simplify (d/d5d/d(1/5))/(d/d6d(1/3)) assuming d is positive. d(22/15) Simplify (i/i(-11/7)i)/(i/(i*(-14)i)) assuming i is positive. i(-73/7) Simplify (c/(c(-1/8)c))(2/19) assuming c is positive. c(1/76) Simplify (a(4/5)/a)4 assuming a is positive. a(-4/5) Simplify hh*(-14/5)h/((h/(h*(2/15)/h))/hh) assuming h is positive. h(-8/3) Simplify (k/k(8/7))/kkk(1/12) assuming k is positive. k(-5/84) Simplify (d*(-1/2)d/d(2/3))/(d(-2/13)/dd/(dd(-1/3))) assuming d is positive. d(17/26) Simplify c*(-36/5)cc/((ccc20cc)/c) assuming c is positive. c(-141/5) Simplify (j(-1))8/(j(-1)j)(2/39) assuming j is positive. j(-8) Simplify (tt/(t(-22)t))/t0 assuming t is positive. t23 Simplify tt/t(-2/45)t(t/(t/(t/(t/(tt/(tt/t19))))))/t assuming t is positive. t(947/45) Simplify (u(-2/3)u6)(6/11) assuming u is positive. u*(32/11) Simplify (mm/m*(12/11))/(mm/m32) assuming m is positive. m(340/11) Simplify p((p(p/p*(-25))/p)/p)/pppp(-11/3) assuming p is positive. p(70/3) Simplify d3/(d(-1/2)/d)d(-2/5)/d(2/11) assuming d is positive. d(431/110) Simplify (((hh*(-1/3)h)/h)/h)*(-5/2)(hh(2/9))/(h(-8)h) assuming h is positive. h*(163/18) Simplify ((z/(z(z/(z/((z/z*(-3/5))/z))zz)/z))/zz(z/(zz/z*(-1))z)/z)(-3/5) assuming z is positive. z(54/25) Simplify (a(-5/3))(7/4) assuming a is positive. a(-35/12) Simplify j(-3/2)/j*5j*(-1)/jjjj1 assuming j is positive. j(-11/2) Simplify ((a*(-1/6)a)/a)(-22)/(a(-5)aa*(2/7)a) assuming a is positive. a*(134/21) Simplify ((kk/(k*0/kk))/k)(-3) assuming k is positive. k(-3) Simplify ((w(-2/9)/w)/w)(-20) assuming w is positive. w*(400/9) Simplify (kk(-5))11 assuming k is positive. k(-44) Simplify (s(-5)s)(2/81) assuming s is positive. s(-8/81) Simplify ((((h7h)/h)/h)/h)(-23) assuming h is positive. h(-115) Simplify (kk(3/5)/k)/k10 assuming k is positive. k(-47/5) Simplify p(3/10)pp(p/(p/(p/(p*(2/31)/p)pp)))/p assuming p is positive. p(1623/310) Simplify (s(-1/2)/((s(s/s*(19/2))/ssss)/ss))(-1/37) assuming s is positive. s(-5/37) Simplify ((p(((p*9p)/p)/p)/pp)/p(1/5))/((pp*(2/5))/(p/(pp7))) assuming p is positive. p(2/5) Simplify i(-1/41)/(i/i27) assuming i is positive. i*(1065/41) Simplify (((v/(vvv(-1)))/v)23)(-2/67) assuming v is positive. v(46/67) Simplify m(-7)/(m/m8)m0/m(4/7) assuming m is positive. m(-4/7) Simplify (w(-7)/w(1/2))(-34) assuming w is positive. w255 Simplify (c/c(-4))(-7/2) assuming c is positive. c(-35/2) Simplify (g/(g*(3/5)gg)ggg/(g/(ggg/(g(g/(g/g(-2/11)))/gg)g)g))(-2/21) assuming g is positive. g(-284/1155) Simplify (p(2/3))(-1/2)p(-2/9)pp(-1/8) assuming p is positive. p(23/72) Simplify (rr/(r*(-1/4)r)r/(r/(r/(rrr5))))28 assuming r is positive. r(-133) Simplify (w(2/23)ww(1/5))(5/7) assuming w is positive. w(148/161) Simplify (u(-7)u)/(u*(-3/5)u) assuming u is positive. u**(-32/5) Si	{ "pile_set_name": "DM Mathematics" }
-2750287 Find the third derivative of 4z6 - z5 - 24729z*4 + 548z*2 + 96. 480z*3 - 60z*2 - 593496z Find the second derivative of 88395b3f*2 - 76409b*3 + bf*5 + 2bf wrt f. 176790b*3 + 20bf3 Find the second derivative of -48d*2n - 563d2 + dn + 5d + 9n - 54 wrt d. -96n - 1126 Find the first derivative of -147109r + 224935. -147109 Differentiate -16d2n + 2dgn2 - 38dg + gn*2 + g + 7633 with respect to d. -32dn + 2gn2 - 38g What is the second derivative of -369209w5 - 72882w? -7384180w3 Differentiate 2i*2 + 2398iq + 98463q wrt i. 4i + 2398q Differentiate -4p3v + 643p3x - 5160p2vx - 4p*2x wrt v. -4p3 - 5160p*2x What is the derivative of -29p4r*2 - 1589p*4r + 3r2 - 188r + 1 wrt p? -116p3r*2 - 6356p*3r What is the third derivative of 3332i5 - 3i*2 + 1871? 199920i*2 Find the third derivative of -281122y*6 + 69y*2 + y - 99 wrt y. -33734640y*3 Find the first derivative of -179998u - 205348 wrt u. -179998 What is the second derivative of 1209741g3 - 4g - 152830 wrt g? 7258446g What is the second derivative of 8701j*2mz + 15j*2z*2 - 2jmz*2 - 21337jz2 + 2mz2 - 2z wrt j? 17402mz + 30z2 Find the second derivative of -8357k*2l*2 - 13k*2l + 4k2 - 54kl2 + 3500kl + k wrt k. -16714l*2 - 26l + 8 Differentiate 457616y + 772341 with respect to y. 457616 Differentiate 1020739k*3u + 221902k3 + 3k*2 wrt u. 1020739k*3 Find the first derivative of -58cp2 + 32cp - 3c + p*2 + 5p + 93 wrt c. -58p2 + 32p - 3 Find the third derivative of 24d3s*3 + 803d*3s + d*2s*2 + 4155ds6 + 2d - 195s2 wrt s. 144d*3 + 498600ds3 What is the first derivative of 62126s + 42799? 62126 Find the first derivative of 995918q + 157286 wrt q. 995918 What is the second derivative of -3d*3 + 106310d*2y*3 - 673189dy3 wrt d? -18d + 212620y3 Find the third derivative of 13c*5n*3 + 77c*5n - 100c2n*2 + 32cn3 - 2c - 2n3 wrt c. 780c*2n*3 + 4620c*2n What is the derivative of -3j2 - 68596j + 160757 wrt j? -6j - 68596 What is the second derivative of -44ax2 + 3ax + 216x*2 + 2x - 751 wrt x? -88a + 432 What is the third derivative of -b5 + 173561b*3 - 27552b*2? -60b*2 + 1041366 Find the second derivative of -1986902p*3 + 636639p wrt p. -11921412p Find the second derivative of -46804j*3 + 2j + 4482. -280824j What is the third derivative of 3229q*3 + 5q*2 + 2q + 179 wrt q? 19374 What is the second derivative of 41a3u*3 + 159a*3u - 187au*3 - 80au2 wrt a? 246au3 + 954au Find the first derivative of 243677m + 195332. 243677 What is the third derivative of 2571418ad*3 - 4ad2 + 124780a - 2d2 wrt d? 15428508a Find the third derivative of 108j4 - 1260j3 + j2 - 150585j wrt j. 2592j - 7560 What is the second derivative of 998q3t*2 + 29077q*3t - 42q2t*2 + 11q*2 - 15qt2 - 2q - 2t2 - 2t wrt t? 1996q3 - 84q*2 - 30q - 4 What is the second derivative of 9i5 + 10690i*3q*2 - 10iq2 - 6iq - 238q wrt i? 180i3 + 64140iq2 Find the third derivative of -1461296k*3 + 1319526k*2. -8767776 Find the third derivative of -12mu4 - 10874mu3 + 747mu2 - u3 - 79u*2 + 2u wrt u. -288mu - 65244m - 6 Find the third derivative of -11640m3 + m2 + 16m + 162 wrt m. -69840 Find the first derivative of -2q*3r - 564029q3 + 370900q*2r + 2qr*2 wrt r. -2q*3 + 370900q*2 + 4qr Find the second derivative of -3f*2oy + 23f*2o + 2f2y2 - f2y - 8861oy2 - 15oy - 2y wrt y. 4f2 - 17722o Differentiate -16132l4 - 169283. -64528l*3 Find the second derivative of -221s*4 - 178s*2u + 7su - 38s + 2u - 7 wrt s. -2652s2 - 356u What is the first derivative of -246318t4 - 318657 wrt t? -985272t*3 What is the third derivative of 3p*4 - 234p*3 + 181965p*2 wrt p? 72p - 1404 Differentiate -159514x + 75464 with respect to x. -159514 Differentiate 12i*4 - 20i*3 + 5i*2 - 857028 with respect to i. 48i*3 - 60i*2 + 10i Find the third derivative of 74438n3 - 61n*2 - 23n - 5 wrt n. 446628 Differentiate -46050kl - 15479k wrt l. -46050k Find the third derivative of 3v2z*4 + 79294v*2z*2 - 19513vz4 - vz*2 wrt z. 72v*2z - 468312vz What is the third derivative of -4kp*4 - 2kp3u + 2kp*2 - 1025p*3u - 7p2u + 4pu - 11u wrt p? -96kp - 12ku - 6150u Find the second derivative of -6732c5 + 38c*4 - 1778407c. -134640c3 + 456c*2 What is the derivative of -3593267s - 5343865 wrt s? -3593267 What is the third derivative of 241023h5 + 4h*2 - 3964h wrt h? 14461380h2 What is the first derivative of -265697i*4 - 2i + 79448? -1062788i3 - 2 What is the second derivative of 97n*2qy - 17n*2q - 352n2y + 95nqy - 81n + 2qy - 14y wrt n? 194qy - 34q - 704y What is the first derivative of -2qx2 + 8qx - q + 44x*4 + 14x - 97459 wrt x? -4qx + 8q + 176x*3 + 14 What is the derivative of -195293u*4 + 593011 wrt u? -781172u*3 Find the third derivative of -220l*6 + 39l5 - l3 + 8l2 + 62l - 116. -26400l3 + 2340l*2 - 6 What is the second derivative of 1150c*4 + 5c + 3405? 13800c2 Find the third derivative of 51539ko3 - 2ko2 + ko + k - 12144o2 + o wrt o. 309234k What is the third derivative of 340157g3 + 9853g*2 - 9 wrt g? 2040942 Differentiate -105653m - 48334. -105653 Differentiate 105707f + 4045465 with respect to f. 105707 Find the second derivative of -914650u*4 + 364985u wrt u. -10975800u2 What is the third derivative of -2399846z*3 + 385503z*2 - z? -14399076 Find the first derivative of kt*3z - 63kt*2 + 12kz + 22t*3 - 1612t*2z wrt z. kt3 + 12k - 1612t2 What is the third derivative of 2u*3z*3 + 5u*3z*2 + 14245u*2z*4 - 4u*2z*2 + 9uz2 - 2z*2 wrt z? 12u*3 + 341880u*2z Find the second derivative of -245f3k*3 + 207f*3k + 28fk*3 - 7449k*3 wrt f. -1470fk3 + 1242fk Differentiate 4d*2u2 + d2u - 675973d*2 - 228du2 + 5u with respect to u. 8d2u + d*2 - 456du + 5 What is the third derivative of -431l*5 + 18l*3 + 2l*2 + 525l wrt l? -25860l2 + 108 What is the first derivative of -124z*2 - 2963z + 724527 wrt z? -248z - 2963 What is the first derivative of 160212r - 279179? 160212 Find the first derivative of -5220c2gs2 + 2c*2g - 16c2s*2 + 25c*2s + 153s wrt g. -5220c*2s*2 + 2c*2 Find the third derivative of 10873ux3 - 4ux - 7u - 5x3 - 71x*2 - 3 wrt x. 65238u - 30 What is the third derivative of -1900265s4 + 269s*2 + 849 wrt s? -45606360s Find the second derivative of -3df*3 - 28df2 + 47df + 8d + 2f3 + 25f*2 wrt f. -18df - 56d + 12f + 50 Find the second derivative of -3g*3x*2 - 622g*3 + 24g*2x + 3gx*2 + 11374g wrt g. -18gx*2 - 3732g + 48x Find the third derivative of 271g*4k*2 - 19g4 + g2k - 20gk2 + gk + 277g wrt g. 6504gk2 - 456g Find the third derivative of -4264n5 + 3n4 + n3 - 6830n2. -255840n*2 + 72n + 6 What is the second derivative of -102z3 - 17z*2 + 25903z wrt z? -612z - 34 Find the first derivative of -lty - 7lt + 117ly + 3l - 19ty + 5t + 6 wrt y. -lt + 117l - 19t Differentiate -703960s + 239314 with respect to s. -703960 Find the third derivative of -3917053g*6 + 2709325g*2. -470046360g*3 What is the third derivative of -4o*4 + 1190o*3 - 2o*2 - 31o - 17 wrt o? -96o + 7140 What is the third derivative of -202n*5 - 252n*3 - 95n*2 + 6n + 8 wrt n? -12120n2 - 1512 What is the second derivative of 12v*2y + 40336v2 + 3vy + 6v + 2153y - 1 wrt v? 24y + 80672 Find the second derivative of -5x5 - 91120x*4 + 2x + 416151 wrt x. -100x3 - 1093440x*2 What is the second derivative of 21254nw5 + 7nw2 - 3385nw - 26w wrt w? 425080nw*3 + 14n What is the second derivative of 359kn*2s - 22kn*2 - 5kns + 2ks - 2n2s - n*2 - 2ns + 437n - 3 wrt n? 718ks - 44k - 4s -	{ "pile_set_name": "DM Mathematics" }
hat is the greatest common divisor of c and x? 4 Let n = -512 - -738. Suppose n = w + 6. Calculate the greatest common factor of 88 and w. 44 Let g = 28 + -43. Let w be g/((-33)/6 - -4). Suppose t - w = -t. What is the highest common divisor of 2 and t? 1 Suppose 17w - 14w - 1677 = 0. Calculate the highest common factor of 13 and w. 13 Suppose 59 + 330 = 3x + 5f, -5f = x - 143. Let j = x + -210. Let l = 9 - j. What is the highest common factor of 12 and l? 12 Let l be (276/18)/((-1)/3 + 1). Suppose -n + l - 16 = 0. Calculate the greatest common divisor of n and 28. 7 Let a(q) = 2q*2 - 7q + 18. Let f be a(3). Calculate the highest common divisor of f and 65. 5 Suppose -5g + 15 = 0, 4g - 60 = -n - 0n. Let p = n + -21. Let r be (81/(-2))/(4/(-24)). What is the highest common factor of r and p? 27 Let g(c) = -80c + 2. Let j be g(-2). Let z(m) = 8m + 22 - 5m - m + 8. Let a be z(-6). Calculate the greatest common factor of a and j. 18 Let l(f) = 13f2 - 4f - 8. Let w be l(5). Let j be 1212/108 + 0 - (-4)/(-18). What is the highest common factor of j and w? 11 Let o = 82 - 52. Suppose -4 = -j + 4. Let n be (j/(-10))/((-2)/25). Calculate the greatest common divisor of o and n. 10 Suppose -4h = -6h + 16. Suppose -5a + 26 = 2m, 0 = 5m - m + a - 16. Let u be 1/(m/18) + 2. Calculate the greatest common factor of u and h. 8 Suppose y - 5y + 40 = -4g, 3g - 26 = -4y. Suppose 67 + 137 = 4a - 5r, 2a + 2r = 120. Calculate the greatest common factor of y and a. 8 Let b be -1 + -4 - 3/(-3) - -29. Suppose 0 = 3u + 4s - 118, 67 = 3u - 5s - 15. Let t = u + -9. What is the highest common divisor of t and b? 25 Suppose 30a - 28a - 56 = 0. Calculate the greatest common factor of 238 and a. 14 Let d(g) = 2g*2 + g + 4. Let s be d(6). Let j = 39 - s. Let h = 88 + j. What is the highest common factor of h and 18? 9 Let h(o) = 3o - 6o2 - 4o*2 + 9o*2 + 4. Let v be h(3). Let b be 3 - v/(8/(-106)). What is the greatest common divisor of b and 7? 7 Let r = 5 - 28. Let n = 27 - r. What is the highest common factor of 25 and n? 25 Suppose -9u = -43u + 2380. What is the highest common divisor of 40 and u? 10 Let q be (-4)/(-10) - (-1314)/15. Let c(l) = 3l + 2. Let u be c(2). Calculate the greatest common divisor of q and u. 8 Let t be 168/(-196)63/(-6). Calculate the highest common divisor of t and 81. 9 Suppose -2m + 28 = 4h, 3h = -4m + h + 32. Let c be 7548/52 - m/39. Let l(g) = 11g + 3. Let u be l(5). Calculate the greatest common factor of c and u. 29 Let r = 1292 + -1243. Calculate the highest common factor of 154 and r. 7 Suppose 87z = 91z - 112. Calculate the greatest common divisor of z and 7. 7 Let k = 1229 - 1179. What is the greatest common factor of k and 1850? 50 Let a be 3 + 2 + -3 + 7. What is the highest common factor of a and 9? 9 Let u be ((-2)/1)/((-1)/(-4)). Let c = 11 + u. Let j(s) = 2s2 - 2s + 1. Let m be j(0). Calculate the greatest common divisor of c and m. 1 Suppose -10z - 122 = -462. Calculate the greatest common factor of z and 272. 34 Suppose 3o - 513 = -4l, 0 = o + 2l + 2l - 179. Let m = o + -113. Calculate the greatest common factor of 18 and m. 18 Let w be 18/54(388 + -1). Calculate the highest common divisor of w and 3. 3 Suppose -6l = -10l - 3r + 93, -r + 47 = 2l. Calculate the highest common factor of l and 24. 24 Suppose -3j + 28 = -3q + 7, 4j - 5q = 29. Suppose 3c = jc. Let g be (c - 0) + (-64)/(-2). What is the greatest common factor of 16 and g? 16 Suppose -756 = -9g - 9g. What is the greatest common factor of g and 18? 6 Let g = -12 - -16. Suppose -z + 3c = 0, 0 = 2z - 4z + 4c + g. Calculate the highest common divisor of 4 and z. 2 Suppose 0 = 2l - 4t + 12, 4l = -t + 6t - 9. Let a = l + 6. Calculate the highest common divisor of 4 and a. 2 Let k(l) = -6l - 80. Let c be k(-28). What is the highest common divisor of 16 and c? 8 Let o be (1 + (-3 - -4))/(2 + -3). Let b = 2 + -10. Let l be (-4)/b - 45/o. What is the highest common factor of 23 and l? 23 Suppose -f = 4t - 2t - 2, 5t = 0. Suppose -c = fc - 66. Calculate the highest common divisor of 55 and c. 11 Let b(m) = -6m + 116. Let a be b(8). Calculate the highest common factor of 204 and a. 68 Let h be 3/(-2)(-104)/6. Let z(a) = -a2 + 46a - 428. Let u be z(17). Calculate the greatest common divisor of u and h. 13 Suppose -5y + o = 3o - 392, 5y + 5o = 380. Suppose 2f = -3f + y. What is the highest common factor of f and 8? 8 Let w = 52 - -8. Calculate the greatest common divisor of w and 50. 10 Let c(y) = 5y2 - 2y + 1. Suppose -u - 5 = -6u. Let q be c(u). Let d be 1 + 0/3 - -3. What is the greatest common divisor of q and d? 4 Let q(k) = 97k - 1. Let v be q(1). Let s = -27 - -39. What is the highest common divisor of s and v? 12 Let o = 59 + -57. Let i(t) be the first derivative of t*2 + t - 1. Let z be i(o). What is the greatest common divisor of 5 and z? 5 Let r = 12 - 15. Let y be r + (-2 - -7) - -4. Suppose 128 = 5a - 3d - 124, 3a = -3d + 132. What is the highest common divisor of y and a? 6 Suppose 153 = m + 5z, m + 0z - 169 = 3z. Calculate the greatest common divisor of 1 and m. 1 Let g = 177 + -160. Calculate the highest common divisor of 34 and g. 17 Let x = 846 + -346. What is the highest common divisor of x and 25? 25 Suppose 815 = 26d + 35. Calculate the highest common divisor of 300 and d. 30 Let z be (-6)/(-9)(-81)/(-18). Calculate the greatest common factor of 27 and z. 3 Let a(h) = -h*2 + 21h - 90. Let v be a(13). What is the greatest common divisor of 49 and v? 7 Suppose x + 4x - 3l - 225 = 0, 0 = 2x - 5l - 71. Let o be (19/4 + -4)/(2/16). Calculate the highest common divisor of o and x. 6 Suppose -4c + 4s = -44, 20 = c - 0s - 4s. Suppose -5q + 13 = 3. What is the highest common divisor of q and c? 2 Let k = 45 - 46. Let y be 6/(-3k/6) + 3. What is the greatest common factor of y and 6? 3 Let b be -3 - ((-1 - 2) + -3). Let k be -1 - (75/(-9) - 1/(-3)). Let g = k + b. What is the greatest common divisor of g and 10? 10 Let o = 165 - 66. Let k = o + -93. Calculate the highest common factor of 3 and k. 3 Let b(t) = -5t - 15. Let m be (6/12)/((-1)/34). Let j be b(m). Suppose -10 = 2h, 2a - 4h + j = 306. Calculate the highest common factor of a and 18. 18 Let p = -717 - -749. Calculate the highest common divisor of p and 848. 16 Let g = 1299 - 831. Calculate the greatest common factor of 72 and g. 36 Suppose -2h - 240 = -7h. Calculate the greatest common divisor of 72 and h. 24 Suppose 65 = 25d - 12d. Suppose -dv - 20 = -10v. Calculate the highest common divisor of v and 44. 4 Let w(t) = -2t2 - 5t + 2. Let y be w(-6). Let r be (y/(-15))/(4/12). What is the highest common divisor of r and 24? 8 Let q be 710/2 + 2 + -2. What is the highest common divisor of q and 71? 71 Let r(f) = -f*3 - 2f*2 + 18f - 16. Let c be r(-7). What is the greatest common factor of 3811 and c? 103 Let i = 59 - -62. What is the highest common divisor of i and 66? 11 Suppose -24 = -l - 2l. What is the greatest common divisor of l and 44? 4 Suppose -14d = -10d + 96. Let o = -12 + 46. Let m = o + d. Calculate the greatest common divisor of m and 50. 10 Suppose -566x + 568x - 10 = 0. Calculate the highest common factor of 13 and x. 1 Suppose 0 = d - 2d - 6. Let i = 4 - d. Suppose -t - s + 10 = 0, 4s = 3t - 1 + 6. What is the highest common factor of i and t? 5 Let p = -17 + 24. Suppose -92n + 3464 = -1688. Calculate the greatest common divisor of n and p. 7 Suppose -y = -2d - 5, 2y - 5y + 3d + 24 = 0. What is the highest common factor of 11 and y? 11 Let p be (6 - 9) + (2 - -11). What is the greatest common factor of 25 and p? 5 Let m(z) = -z - 1. Let h(t) = -2t*2 + 3t + 8. Let r(x) = -h(x) - 6m(x). Let n be r(-4). What is the highest common divisor of n and 72? 18 Suppose 2v = 2n + 32, -28 = -v + 3n + 2n. Let t = 8 + -7. Calculate the greatest common factor of v and t. 1 Let w = -83 + 131. Suppose 2v - 12 = -19h + 24h, -v = 5h - 36. What is the highest common divisor of w and v? 16 Let q(y) = -y3 + 12y*2 + 2y - 4. Let d be q(12). Suppose d = 5v - 0v. Let h be v*(22 + (-1 - -1)). Calculate the greatest common divisor of h and 11.	{ "pile_set_name": "DM Mathematics" }
4, i: 2, v: 7, g: 1}. Give prob of picking 1 i and 2 x. 3/91 Three letters picked without replacement from {e: 3, p: 1, g: 2, n: 4}. What is prob of picking 1 n and 2 e? 1/10 Calculate prob of picking 3 x when three letters picked without replacement from xxmxmxcmmccmccmmm. 1/170 Calculate prob of picking 2 y when two letters picked without replacement from {p: 1, y: 2, e: 1}. 1/6 What is prob of picking 4 g when four letters picked without replacement from {n: 1, g: 10, j: 9}? 14/323 What is prob of picking 4 l when four letters picked without replacement from {l: 12, v: 1}? 9/13 Two letters picked without replacement from rrrlrrrrlrrrrrl. Give prob of picking 1 r and 1 l. 12/35 What is prob of picking 2 u, 1 b, and 1 q when four letters picked without replacement from {b: 4, u: 2, y: 2, q: 12}? 16/1615 Four letters picked without replacement from rxczzzzzz. What is prob of picking 1 c and 3 z? 10/63 Two letters picked without replacement from {p: 8, t: 1, q: 2, j: 5, o: 1}. What is prob of picking 2 p? 7/34 Calculate prob of picking 1 c, 1 r, 1 y, and 1 k when four letters picked without replacement from yycrrkyrryykyyryyryr. 28/969 Three letters picked without replacement from {g: 3, t: 3, m: 3, k: 1}. What is prob of picking 1 k and 2 t? 1/40 What is prob of picking 4 n when four letters picked without replacement from {n: 8, q: 2, a: 8}? 7/306 Two letters picked without replacement from {l: 4, f: 1, k: 1, o: 3, w: 1, s: 2}. What is prob of picking 1 l and 1 f? 2/33 Calculate prob of picking 1 t and 2 p when three letters picked without replacement from {t: 1, b: 1, p: 2, z: 1}. 1/10 Two letters picked without replacement from {q: 3, k: 5, x: 2, z: 1, b: 2, e: 7}. Give prob of picking 2 e. 21/190 Calculate prob of picking 2 m when two letters picked without replacement from mzmmzmzzzmzmzmmzmz. 4/17 Three letters picked without replacement from snnunnnnooonossnuno. What is prob of picking 1 n, 1 o, and 1 s? 45/323 Calculate prob of picking 1 t and 1 r when two letters picked without replacement from {r: 1, o: 1, t: 2, i: 5, v: 5, w: 1}. 2/105 Two letters picked without replacement from tye. Give prob of picking 2 y. 0 Four letters picked without replacement from pppqqpqjqj. Give prob of picking 2 j and 2 q. 1/35 Two letters picked without replacement from {e: 3, l: 2, m: 2, a: 4, j: 2}. What is prob of picking 1 e and 1 m? 1/13 What is prob of picking 1 v and 1 d when two letters picked without replacement from {j: 4, g: 2, d: 1, w: 1, v: 1, z: 3}? 1/66 Three letters picked without replacement from jvmrm. Give prob of picking 1 m, 1 v, and 1 r. 1/5 Two letters picked without replacement from ylyyywfwyioiyiyyyyy. Give prob of picking 1 y and 1 f. 11/171 Calculate prob of picking 1 z and 1 r when two letters picked without replacement from {z: 1, r: 2}. 2/3 Four letters picked without replacement from {x: 6, n: 9, r: 4}. Give prob of picking 1 n, 2 x, and 1 r. 45/323 Four letters picked without replacement from immmimi. Give prob of picking 2 m and 2 i. 18/35 Two letters picked without replacement from {s: 2, u: 11, j: 2}. What is prob of picking 1 u and 1 j? 22/105 Two letters picked without replacement from hojvoohhvkh. What is prob of picking 2 h? 6/55 What is prob of picking 1 h and 1 p when two letters picked without replacement from {s: 1, p: 2, q: 5, h: 1, m: 1, y: 7}? 1/68 Four letters picked without replacement from eekkeksskeskkskk. What is prob of picking 3 k and 1 e? 8/65 Four letters picked without replacement from {s: 3, d: 2, v: 3, y: 3, n: 1, j: 3}. Give prob of picking 2 d and 2 s. 1/455 Calculate prob of picking 1 w and 1 b when two letters picked without replacement from vyribyw. 1/21 Calculate prob of picking 2 t when two letters picked without replacement from {v: 14, t: 4}. 2/51 What is prob of picking 1 c and 1 l when two letters picked without replacement from {m: 1, t: 1, l: 1, w: 1, g: 1, c: 2}? 2/21 What is prob of picking 2 n and 1 u when three letters picked without replacement from {y: 3, e: 4, u: 4, n: 7}? 7/68 Two letters picked without replacement from {q: 6, l: 13}. Give prob of picking 2 q. 5/57 What is prob of picking 2 f, 1 e, and 1 j when four letters picked without replacement from ifyjxef? 1/35 Four letters picked without replacement from {v: 1, x: 1, t: 2, f: 1, q: 3, l: 4}. Give prob of picking 3 q and 1 l. 4/495 Calculate prob of picking 2 z when two letters picked without replacement from {e: 2, s: 8, z: 2}. 1/66 Two letters picked without replacement from {o: 1, h: 4, v: 4, g: 1}. Give prob of picking 1 o and 1 v. 4/45 Three letters picked without replacement from fdjsdkddfrdssskjs. What is prob of picking 2 d and 1 r? 1/68 Calculate prob of picking 1 s, 2 p, and 1 o when four letters picked without replacement from louopoouuusoupu. 1/273 Three letters picked without replacement from {b: 2, p: 1, i: 2, s: 9}. Give prob of picking 1 s and 2 b. 9/364 What is prob of picking 3 k when three letters picked without replacement from kkkk? 1 Calculate prob of picking 2 n and 1 e when three letters picked without replacement from ebnkneuntenb. 9/110 Two letters picked without replacement from {r: 2, u: 3, i: 1, q: 2, b: 4}. What is prob of picking 1 r and 1 q? 2/33 Two letters picked without replacement from {x: 6, y: 4, n: 1}. Give prob of picking 1 x and 1 n. 6/55 Three letters picked without replacement from {q: 3, d: 4, b: 4, j: 1, u: 1, o: 5}. What is prob of picking 1 j and 2 o? 5/408 Two letters picked without replacement from pppvewpvpwpppp. Give prob of picking 1 w and 1 p. 18/91 Four letters picked without replacement from ffvvjfbvwfkb. Give prob of picking 2 b, 1 j, and 1 v. 1/165 What is prob of picking 1 h, 2 f, and 1 k when four letters picked without replacement from fkkhhfhhhhfhfhhhkhhh? 78/1615 Calculate prob of picking 1 q and 1 b when two letters picked without replacement from rbqaw. 1/10 Four letters picked without replacement from {w: 4, y: 6, x: 4, l: 3, t: 1, j: 1}. What is prob of picking 1 x and 3 l? 1/969 Two letters picked without replacement from qqqqcee. Give prob of picking 2 e. 1/21 Two letters picked without replacement from {y: 1, o: 1, b: 1, v: 1, l: 1, e: 2}. Give prob of picking 1 e and 1 l. 2/21 Two letters picked without replacement from {g: 7, z: 3, h: 2, f: 2, r: 3, j: 1}. What is prob of picking 2 h? 1/153 Two letters picked without replacement from usussuussusss. What is prob of picking 2 u? 5/39 Three letters picked without replacement from {t: 4, f: 3, n: 1, i: 2, r: 4}. What is prob of picking 1 i, 1 r, and 1 f? 6/91 Two letters picked without replacement from {q: 9, a: 3, t: 1, r: 6}. Give prob of picking 1 a and 1 r. 2/19 What is prob of picking 3 y when three letters picked without replacement from nnnynyny? 1/56 Two letters picked without replacement from {l: 1, k: 7, g: 5, b: 1, p: 2}. What is prob of picking 1 g and 1 l? 1/24 Calculate prob of picking 1 r and 1 b when two letters picked without replacement from ryby. 1/6 Two letters picked without replacement from gddggggggggggggggggg. Give prob of picking 1 g and 1 d. 18/95 What is prob of picking 1 t and 1 r when two letters picked without replacement from ywyyrkt? 1/21 Four letters picked without replacement from {k: 5, z: 4, q: 1}. What is prob of picking 3 k and 1 z? 4/21 Calculate prob of picking 1 r and 1 o when two letters picked without replacement from {j: 7, o: 11, r: 2}. 11/95 Two letters picked without replacement from kkkvekevkekkkvkkvk. What is prob of picking 2 e? 1/51 Two letters picked without replacement from xtxtntnx. Give prob of picking 2 n. 1/28 Calculate prob of picking 1 w and 2 z when three letters picked without replacement from {z: 2, w: 4, g: 6, q: 4, o: 1}. 1/170 What is prob of picking 2 i and 1 m when three letters picked without replacement from yipypyyiypyqmyys? 1/560 What is prob of picking 4 d when four letters picked without replacement from {a: 11, d: 5}? 1/364 Calculate prob of picking 2 p when two letters picked without replacement from {f: 1, p: 18}. 17/19 Two letters picked without replacement from ttcccccccccvtt. Give prob of picking 1 t and 1 c. 36/91 Calculate prob of picking 1 q, 1 t, 1 u, and 1 w when four letters picked without replacement from {u: 1, w:	{ "pile_set_name": "DM Mathematics" }
2 - 2o - 2w*2 + 55 wrt o? -84o*2 + 6ow2 - 114ow Find the third derivative of 79s*6 + 54s*5 + 196755s*2. 9480s*3 + 3240s*2 What is the first derivative of 195039mx4 - 2mx3 - 320530m wrt x? 780156mx*3 - 6mx2 Find the third derivative of 10g*2h*3w*3 + 30748g*2h3 - g2h2w*3 - 10g*2h*2w*2 + 2428gh2 + 2ghw*3 wrt h. 60g*2w*3 + 184488g*2 Find the second derivative of 5557r*2 - 44330r wrt r. 11114 Find the first derivative of -2l3q*3 - 42462l*3qt - 4l*3t + 7lq2 + q3t + 2781q*3 wrt t. -42462l*3q - 4l3 + q3 Differentiate -qy + 55045q + 22325y*2 with respect to y. -q + 44650y What is the third derivative of -126931h3 - 469335h*2 + 2 wrt h? -761586 Differentiate -2lm3ux - 58lm3x + 13lmx - 90673m*2ux + 144mx wrt u. -2lm3x - 90673m2x What is the first derivative of 2476l3 + 39l*2 + 146672? 7428l*2 + 78l What is the third derivative of 464c3h*2j + 60c3hj2 + 2c*2h*2j*2 + 2cj2 + 101h*2j wrt c? 2784h2j + 360hj*2 Differentiate 2d*2l - 31496d2 - 2926dl - l with respect to l. 2d*2 - 2926d - 1 Differentiate 7840h3i*2 + 1810165h*3 - 49hi3 with respect to i. 15680h*3i - 147hi*2 What is the third derivative of 1954w*5 + 2w*4 + 3w*3 - 5w*2 - 2421w? 117240w2 + 48w + 18 Find the second derivative of -k*3z*3 - 294k*3z + 10k2z*3 - 2k*2 + 2kz + z2 - 6z wrt z. -6k3z + 60k2z + 2 Find the second derivative of -3o3 + 3899o*2r*2 + or*2 - 28or - 108r*2 + 2r wrt o. -18o + 7798r*2 Find the second derivative of 16a*3j*5 + 257a*3j*2 + 12a*3j - 3aj*2 - 2a - 28 wrt j. 320a3j*3 + 514a*3 - 6a Find the third derivative of 396b3km - 10b*3k + 19b3m - 15041b2km - 5b*2 - 3bk wrt b. 2376km - 60k + 114m What is the second derivative of -6118m5 - m4 - 5m3 + 287915m + 2? -122360m3 - 12m*2 - 30m What is the third derivative of 59522p3 + 3p*2 + 44642p wrt p? 357132 Find the first derivative of -114b3d*2 + 489b*3d + 121b3 + b2 + 13bd + 51b + 1 wrt d. -228b3d + 489b3 + 13b Find the first derivative of -81f3r*2 - 491f*3r + 46172r2 wrt f. -243f*2r*2 - 1473f*2r What is the third derivative of -4172204f3n - 6275173f2n wrt f? -25033224n What is the second derivative of -34158g*3jp - 3g*2jp - 5gjp + 3gj + 2gp - 106jp wrt g? -204948gjp - 6jp What is the second derivative of -150u*5 - 2u*4 - 51u*2 - 95214u? -3000u3 - 24u*2 - 102 What is the second derivative of 26201o*4 - 110o + 17 wrt o? 314412o2 Find the third derivative of -20609l3 - l2 - 3l - 3525 wrt l. -123654 What is the third derivative of -7o*3x*3 + 2o*3x*2 + 500091o*3x + 60548x3 wrt x? -42o*3 + 363288 What is the first derivative of -3c*2 - 150873c + 1890461? -6c - 150873 What is the third derivative of 9h*5 + 51h*4 - 248h*3 + 97676h*2 wrt h? 540h*2 + 1224h - 1488 Find the second derivative of 195560z2 + 70109z wrt z. 391120 What is the first derivative of 25jq*2 + 679jq - 16142j + q*2 + 3q + 63 wrt q? 50jq + 679j + 2q + 3 Find the second derivative of 871inq2 + 64inq - 2nq + 15n - 2q*5 - 7q*2 + 15q wrt q. 1742in - 40q3 - 14 Find the first derivative of 47479c*3 - 12c*2 + 2c + 3056030 wrt c. 142437c2 - 24c + 2 Find the second derivative of -888155p5 + 1078582p. -17763100p3 What is the derivative of 6730m + 13698? 6730 Find the second derivative of 20c2y*2 + 45c*2y + 4c2 + 589cy2 - 2c - 5y2 - 3y wrt y. 40c2 + 1178c - 10 What is the derivative of -11d4 - 10d*3 + 3dp + d - 272p - 49 wrt d? -44d3 - 30d*2 + 3p + 1 Find the third derivative of 71639s4 + 11s*2 + 2s + 10 wrt s. 1719336s Find the second derivative of -144621a*2o3 - a2o2 - 2ao3 - 301ao2 + 7a + 15o wrt a. -289242o*3 - 2o*2 What is the derivative of -5212b*3 - 56119? -15636b*2 Differentiate 6c*4t - 2c3 + 5355ct - 226t - 120 wrt c. 24c3t - 6c2 + 5355t What is the derivative of -762m3 + 3m*2 + 28258 wrt m? -2286m*2 + 6m Find the third derivative of 743245v4 - 1053149v*2. 17837880v What is the derivative of -1408214u - 1162457 wrt u? -1408214 What is the second derivative of p3 + 246214p*2 + 597350p wrt p? 6p + 492428 What is the second derivative of -22ju2y*2 + 939ju2y - 6197juy2 + 6j + 5u2y + 1 wrt y? -44ju*2 - 12394ju What is the third derivative of -1798j*2y*3 - 24569j*2y - y*2 wrt y? -10788j*2 Find the third derivative of 2071c*3hv3 + 4c*3v*3 + 2c*3v - 10c2hv3 + 9c*2hv + c2 - 4chv*3 - chv wrt c. 12426hv3 + 24v*3 + 12v Find the first derivative of -tw3x + tw3 - 4tw2 - 40429twx - 12tw + 5w3 wrt x. -tw*3 - 40429tw Find the second derivative of -5f*2j - 5316f2 - f + 5872j - 2 wrt f. -10j - 10632 What is the first derivative of -3519864f*4 - 49478 wrt f? -14079456f*3 Find the third derivative of 38d*3w*3 + 10d*3w*2 - 5d3 + d2w3 + 50dw3 - 209dw2 wrt d. 228w*3 + 60w*2 - 30 Find the first derivative of 14438c + 895498 wrt c. 14438 Differentiate 31007c - 20375 with respect to c. 31007 Find the second derivative of 3284058l*2z*3 - 177lz3 + 1227z*3 wrt l. 6568116z*3 What is the third derivative of 78q*6 - 22q5 - q4 + 3q2 - 3q + 911? 9360q3 - 1320q*2 - 24q Differentiate -2530831w2 + 2107482 with respect to w. -5061662w Differentiate 763g3 - 32g + 28261. 2289g2 - 32 What is the second derivative of -75629b*4w*2 + 132bw2 + 19bw - 5w*2 + w wrt b? -907548b*2w*2 Find the third derivative of -574202k*3q*3 - 2k*3 + 40776k*2q*2 - q wrt q. -3445212k*3 Find the third derivative of -24p*6 - 7p*4 + 8p*2 - 2p - 123. -2880p3 - 168p What is the first derivative of -355f2s*3 + 20f*2s + s*3 + 3s*2 + 974 wrt f? -710fs3 + 40fs Find the third derivative of 1788b*4i2 - b4i + 16b*3 - 6b*2 + 91i*2 - 7i wrt b. 42912bi*2 - 24bi + 96 What is the derivative of -101d*2s*2 + 8d*2x + 33ds*2 + 1522s*2x - 2s2 wrt x? 8d*2 + 1522s*2 Find the second derivative of -64k*5w*3 + 318k*3w*3 + 60183kw3 wrt k. -1280k*3w*3 + 1908kw3 What is the third derivative of 2i*3qu2 - 2i*3q + 218929i3u - 14i2qu2 + 3iqu*2 - 11i + 2qu*2 - 2q wrt i? 12qu*2 - 12q + 1313574u What is the third derivative of 407284m*6 - 1312582m*2? 48874080m*3 Find the second derivative of -14845t*4 - 36309t wrt t. -178140t2 Find the third derivative of 76197v*5 - 20v*2 + 26v + 7 wrt v. 4571820v2 Find the first derivative of t4 - 83964t*2 - 202466. 4t*3 - 167928t Find the second derivative of 4632p3 + 4p*2 + 112381p. 27792p + 8 Find the second derivative of 27586t*3 - 849t. 165516t Find the third derivative of -b6 - 175038b*3 - 13b*2 - 3836b wrt b. -120b3 - 1050228 Find the third derivative of -4978i*3l3 + i3l2s - i*3ls - 5i*2l*3s - 3i2ls - l3 + 7l wrt i. -29868l3 + 6l*2s - 6ls What is the second derivative of -34586x2 - 833x + 30 wrt x? -69172 Find the third derivative of -1944315x4 + 982x*2 - 1111 wrt x. -46663560x What is the second derivative of 464414i2n*2 - 35i*2 - 2in - 57i - 15 wrt n? 928828i2 Find the second derivative of 3c*3 - 2819c*2 - 1609c - 34 wrt c. 18c - 5638 Find the first derivative of -30a*2 + 1290a - 21372 wrt a. -60a + 1290 Differentiate -449j*2m*2 - 359685j*2 - 91jm2 with respect to m. -898j*2m - 182jm Find the second derivative of -o*4 - 2711o*3 - 2o*2 - 95571o. -12o2 - 16266o - 4 What is the third derivative of -47703i3s*3 + 18i*2s*2 - 21i*2s + is3 wrt i? -286218s*3 Find the third derivative of -308a*5 - 149a*4 - 8121a*2 - a - 2. -18480a*2 - 3576a Find the third derivative of -30297v4 + 2v*3 - 40035v*2 + 2v wrt v. -727128*v + 12 What is	{ "pile_set_name": "DM Mathematics" }
e. g(87/4) Simplify ((q/(q(-8)q))/q(1/15))/(q/q(2/3))18 assuming q is positive. q(29/15) Simplify (y/(yyy28))/(yy/y(-25)) assuming y is positive. y(-56) Simplify (j(1/3))(-2/47)/((j(-1/6)/j)/j(2/3)) assuming j is positive. j(171/94) Simplify (y(-1/3))*(12/13)y/y*3y/((y(y/y5)/yyy)/y) assuming y is positive. y(22/13) Simplify (c(1/16)c*(-6))/(c(c/c3)/c)(-1/38) assuming c is positive. c(-1821/304) Simplify v(4/9)v/((vv*(1/5)/vv)/vvv)vv(v(1/3)v)(-2/153) assuming v is positive. v(2816/2295) Simplify ((pp46p)/p)(3/2) assuming p is positive. p(141/2) Simplify (((qq36qq)/qq)/qq)/q(-18) assuming q is positive. q57 Simplify (mmm9)/(m(m*7m)/m)m6mm(-7)/mm assuming m is positive. m3 Simplify (c(-17)c)/c(3/23) assuming c is positive. c(-371/23) Simplify (q(3/25))(1/5) assuming q is positive. q(3/125) Simplify (ss11)(-18/11) assuming s is positive. s(-216/11) Simplify (h9h(2/7))(-25/3) assuming h is positive. h(-1625/21) Simplify r/(r(-35/2)/r)r(-29) assuming r is positive. r(-19/2) Simplify (q/(q/q0))(-12)/((q*(2/3)q)/q(-4)) assuming q is positive. q(-17/3) Simplify n*(-3/2)/n(nn(2/13))/n assuming n is positive. n(-61/26) Simplify g16/g(-3/7) assuming g is positive. g(115/7) Simplify l(-8/9)/(ll(-22)) assuming l is positive. l(181/9) Simplify ((m/m*(-6)mm)/m8)/(m0mmm/(m*(3/11)m)) assuming m is positive. m*(-8/11) Simplify (kk*(-14)k)(-11/2) assuming k is positive. k66 Simplify ((ii(-4))/i0)/(i6i(3/4)) assuming i is positive. i(-39/4) Simplify (f(1/9))(-3) assuming f is positive. f(-1/3) Simplify k14/((k19/k)/k) assuming k is positive. k(-3) Simplify (a/(a/(a/(a/a(-17)))))43 assuming a is positive. a(-731) Simplify (u/(u/(u/(u/(u14/u))u))uuu/(u*(-12)/uu))(-9) assuming u is positive. u(-261) Simplify (((ww20/w)/w)/wwww(-5/6))(-36/7) assuming w is positive. w(-690/7) Simplify ((g/g(-1/4))/(gg/g(-8)))23 assuming g is positive. g(-805/4) Simplify b(1/4)/b(-2) assuming b is positive. b(9/4) Simplify (i(-1))17(i1)(-3/7) assuming i is positive. i*(-122/7) Simplify hhh(2/51)h/(h/(h/(h/h17))) assuming h is positive. h(971/51) Simplify (((m/(m/m(1/4)))/m)/m(-1/3))/((mmmm(-3)mm)/mm(1/14)) assuming m is positive. m(-125/84) Simplify (ff2f(-1))/(f(1/2)f(-3)f) assuming f is positive. f(7/2) Simplify (x(1/17)/(x(-1/2)/x))40 assuming x is positive. x(1060/17) Simplify b(-1/13)b4b/(b*0b)b/(b/b0)b assuming b is positive. b(64/13) Simplify p(-8/5)/p(-1/7) assuming p is positive. p(-51/35) Simplify (r(2/13))(-22) assuming r is positive. r(-44/13) Simplify (c2)*(-4/11)c*(3/2)/ccc(-6) assuming c is positive. c(-115/22) Simplify (zzz(1/2)z)/(z*(-2)z)z(-2/17)(z(zz*(-2/5))/zz)/z assuming z is positive. z(847/170) Simplify y/(y(-3)yy)(y6/y)/y assuming y is positive. y6 Simplify (((t(2/5)/tt)/t)(-7/10))31 assuming t is positive. t(651/50) Simplify u(6/13)u24 assuming u is positive. u(318/13) Simplify (b(1/6)/b)(-16) assuming b is positive. b(40/3) Simplify ((h/h(-1))(1/4))(-8) assuming h is positive. h(-4) Simplify a/((a/(((a/a(-7))/a)/aaa))/a)aa7a*(-6/7)a(-1/9)/a assuming a is positive. a(947/63) Simplify (f*0f)(-9)/(f(1/4)fff(-2/5)) assuming f is positive. f(-217/20) Simplify (w/(w/(w(-1)ww)w)w)(-1/3)(w/w(-1))(-15) assuming w is positive. w(-91/3) Simplify (y1/y)/((y/y*1y)/y)(yyy(y/(y*0y))/yyy)6 assuming y is positive. y24 Simplify (n(-2/35))(3/5) assuming n is positive. n(-6/175) Simplify (s(2/11))(-26) assuming s is positive. s(-52/11) Simplify o/(o/o*(-6/7))o*0(oo(-2/9))(-38) assuming o is positive. o(-1916/63) Simplify (xxx11xx)(5/3) assuming x is positive. x25 Simplify (y/(y/(y(-2/21)/yyyy)))/(y/y(-17)) assuming y is positive. y(-338/21) Simplify ((cc0)(-22/3))23 assuming c is positive. c(-506/3) Simplify ((o(-6/13))4)(-50) assuming o is positive. o(1200/13) Simplify ((t1)(2/77))(-29) assuming t is positive. t(-58/77) Simplify b(-3)/bb(-4/7) assuming b is positive. b(-32/7) Simplify ((m/(m(m2m)/m))(-1/25))(3/13) assuming m is positive. m*(6/325) Simplify cccc*(-6)/ccc(-2)(c/c(-2/7))(-3/34) assuming c is positive. c*(-1217/238) Simplify (z/(zz*(-2/9)z)z(3/5))(4/7) assuming z is positive. z(-32/315) Simplify r(rr(-18)rr)/rrr/(r/r(3/14))r assuming r is positive. r(-179/14) Simplify (f(2/17)/f)/(ff/(f(-1)/f)f)(f(-1/3)/fff)(-2/49) assuming f is positive. f(-14768/2499) Simplify (a(2/9)/(a((a(a/a(2/13))/a)/aa)/aa))(1/37) assuming a is positive. a(-190/4329) Simplify (m(-4/3)mmm)40 assuming m is positive. m(200/3) Simplify ((d*0d)/(d/(dd/(d(-1/11)d))))/(d*(2/7)/dd(-1)) assuming d is positive. d(216/77) Simplify (s(2/5))(1/13) assuming s is positive. s(2/65) Simplify b(3/11)b(-10) assuming b is positive. b(-107/11) Simplify p(7/3)/(p(-18)pp) assuming p is positive. p(55/3) Simplify (q0/q(-4))3 assuming q is positive. q12 Simplify (yyy(-2/35)yy)(5/16) assuming y is positive. y(69/56) Simplify ((y/(yy*(4/11)/y))/((yy/(y*(-2/19)/y)y)/y))(-1/7) assuming y is positive. y(516/1463) Simplify (kkk(-9)/k)/k(-26) assuming k is positive. k18 Simplify t(3/22)/(((t*(1/3)t)/t)/t) assuming t is positive. t(53/66) Simplify (t7)9 assuming t is positive. t63 Simplify ((l/l(2/7))/l)(-35) assuming l is positive. l10 Simplify i(-13)i(3/5) assuming i is positive. i(-62/5) Simplify (a(-1))(-2/9)/(((aaa(-4))/a)/(a/((a/a(-2)a)/aa))) assuming a is positive. a(2/9) Simplify (u(-27)u)/(u/u(-5)) assuming u is positive. u(-32) Simplify (ii(i/(i*(-3)/i))/ii)31/(i(1/3))(4/13) assuming i is positive. i(8459/39) Simplify s*(-1/27)s/(s/(ss(-3))s) assuming s is positive. s(-82/27) Simplify (b(6/7)b(-3))(2/11) assuming b is positive. b(-30/77) Simplify z(-2/7)/z(-20) assuming z is positive. z(138/7) Simplify w(5/4)/(w/(w/((ww/w*20)/w)w)) assuming w is positive. w*(85/4) Simplify ((uu6)/(u/(u(3/8)/u)))/(u(u/(uu*(-1/5)/uu))/uu)8 assuming u is positive. u(-169/40) Simplify (gg/((g*(2/5)g)/g)g(g/((g*5/g)/gg))/g)(-13/3) assuming g is positive. g(91/15) Simplify ((t*(-1/2)t)/t)*(-1)t/(t*0t)t/(t/(t/(t/(t/(tt*(-5))))t)) assuming t is positive. t*(13/2) Simplify r/(rr/(r*4rr))r(-18) assuming r is positive. r(-13) Simplify t*1/(tt*(-5/4)/t)t3/t(2/15) assuming t is positive. t*(307/60) Simplify (bb*(-2/3)bbbb(-12)b)15 assuming b is positive. b(-115) Simplify ((s2)(-1/8))(-25) assuming s is positive. s(25/4) Simplify r*(6/7)r/((rr(-8))/r)r(-1/2)/(r/(r/(r(2/13)/rr))) assuming r is positive. r(1675/182) Simplify (x12/x)/(((xxx/(x/(x25x))x)/x)/x) assuming x is positive. x(-16) Simplify (oo*(-2))/ooo9oo(1/10)/o(1/3) assuming o is positive. o(263/30) Simplify x(5/7)/((xx(20/9)/x)/x) assuming x is positive. x(-32/63) Simplify m(1/15)/m8 assuming m is positive. m(-119/15) Simplify (x/x(2/7)x)(-12)(xx/x(-3))/x(-4) assuming x is positive. x(-81/7) Simplify l/(l(3/5)l)ll/(l/(l/((l/(ll/l(-5)))/ll)))(l(-1))(3/5) assuming l is positive. l(34/5) Simplify ((a/((aa/(aaa(a/a(-11))/a))/aa)aa)/aa7)(-25) assuming a is positive. a(-525) Simplify s(-2/19)/s(2/11) assuming s is positive. s(-60/209) Simplify (d(-7)d)/(dd/(d(1/3)/d)d)d(-2/7)d/(d/(((d/d*5)/d)/dd)) assuming d is positive. d(-314/21) Simplify (s/(s/s(7/4)))/ss(-5)s assuming s is positive. s(-13/4) Simplify p20p(-2/41) assuming p is positive. p(818/41) Simplify (yy*(-1/11)/yy(-3/11))3 assuming y is positive. y(-12/11) Simplify (r/(r/r(-1/2)r))(-15)((((r/(rr(-4)/r))/r)/r)/r)/r*10 assuming r is positiv	{ "pile_set_name": "DM Mathematics" }
f 42631, 85218, 127807, 170398, 212991? q*2 + 42584q + 46 What is the r'th term of -512655, -512813, -512957, -513081, -513179? r3 + r2 - 168r - 512489 What is the d'th term of -15426, -28417, -41422, -54447, -67498, -80581, -93702, -106867? -d3 - d2 - 12981d - 2443 What is the j'th term of 43511086, 43511088, 43511090, 43511092? 2j + 43511084 What is the t'th term of -483909, -1935684, -4355297, -7742742, -12098013, -17421104? t3 - 483925t*2 - 7t + 22 What is the g'th term of -730, -5970, -20192, -47884, -93534, -161630, -256660? -748g3 - 3g*2 + 5g + 16 What is the z'th term of 7124, 28629, 64456, 114593, 179028? -2z3 + 7173z2 - 47 What is the y'th term of 72848, 291161, 655008, 1164383, 1819280, 2619693? -y3 + 72773y2 + y + 75 What is the s'th term of -15674, -62064, -139380, -247622, -386790, -556884? -15463s2 - s - 210 What is the q'th term of -9407, -19413, -29421, -39431? -q2 - 10003q + 597 What is the h'th term of 50975, 51150, 51323, 51494? -h2 + 178h + 50798 What is the p'th term of 104661, 104652, 104639, 104622, 104601, 104576, 104547? -2p2 - 3p + 104666 What is the d'th term of 142, -265, -1328, -3371, -6718, -11693, -18620? -54d3 - 4d*2 - 17d + 217 What is the n'th term of 2522, 8510, 17708, 30116? 1605n2 + 1173n - 256 What is the y'th term of -29055939, -29055940, -29055941, -29055942, -29055943? -y - 29055938 What is the l'th term of 8239, 16534, 25015, 33778, 42919, 52534, 62719, 73570? 16l3 - 3l*2 + 8192l + 34 What is the h'th term of 1272, 1348, 1534, 1878, 2428, 3232, 4338? 8h3 + 7h*2 - h + 1258 What is the u'th term of -25533179, -25533180, -25533181, -25533182? -u - 25533178 What is the w'th term of 50, 401, 1374, 3293, 6482, 11265, 17966? 54w*3 - 13w*2 + 12w - 3 What is the q'th term of -4921, -10635, -16349? -5714q + 793 What is the p'th term of 56388, 112677, 168964, 225249, 281532, 337813, 394092? -p2 + 56292p + 97 What is the b'th term of -356309, -730159, -1104021, -1477901, -1851805, -2225739? -b*3 - 373843b + 17535 What is the g'th term of 131, 664, 1637, 3098, 5095, 7676, 10889? 8g3 + 172g*2 - 39g - 10 What is the x'th term of 74649, 298601, 671855, 1194411, 1866269, 2687429? 74651x2 - x - 1 What is the w'th term of -13884045, -13884073, -13884087, -13884081, -13884049, -13883985? w3 + w2 - 38w - 13884009 What is the i'th term of -8515, -17028, -25557, -34114, -42711, -51360? -2i3 + 4i*2 - 8511i - 6 What is the x'th term of -253201, -252814, -252427, -252040, -251653? 387x - 253588 What is the g'th term of -26945279, -26945267, -26945243, -26945201, -26945135, -26945039, -26944907? g3 + 5g - 26945285 What is the i'th term of 439898, 882412, 1324926? 442514i - 2616 What is the a'th term of 1863, 3901, 6111, 8493, 11047, 13773? 86a*2 + 1780a - 3 What is the u'th term of 57932687, 57932695, 57932703, 57932711, 57932719? 8u + 57932679 What is the b'th term of -30527881, -61055761, -91583641, -122111521, -152639401? -30527880b - 1 What is the x'th term of 517, 435, 277, 19, -363? -4x3 - 14x*2 - 12x + 547 What is the f'th term of 11819, 48951, 110827, 197447, 308811, 444919? 12372f2 + 16f - 569 What is the o'th term of -715992, -1431981, -2147968, -2863953? o*2 - 715992o - 1 What is the i'th term of -541, -398, -253, -106, 43? i*2 + 140i - 682 What is the x'th term of -10433, -42960, -97557, -174224, -272961, -393768, -536645? -11035x2 + 578x + 24 What is the k'th term of 10236, 11866, 13492, 15114, 16732, 18346, 19956? -2k2 + 1636k + 8602 What is the l'th term of 81432, 79359, 75902, 71061? -692l2 + 3l + 82121 What is the w'th term of -15313693, -15313694, -15313695? -w - 15313692 What is the c'th term of -3611, -16081, -36867, -65969? -4158c2 + 4c + 543 What is the z'th term of -3510, -6919, -10336, -13761, -17194? -4z2 - 3397z - 109 What is the c'th term of -412625, -411987, -411349, -410711, -410073? 638c - 413263 What is the g'th term of 3634, 29445, 99580, 236203, 461478? 3694g*3 - 2g*2 - 41g - 17 What is the a'th term of -126, -623, -1434, -2535, -3902? 4a3 - 181a*2 + 18a + 33 What is the g'th term of -108, 87, 372, 747? 45g2 + 60g - 213 What is the p'th term of 3086, 9511, 19274, 32375? 1669p2 + 1418p - 1 What is the v'th term of -5478915, -10957784, -16436653, -21915522? -5478869v - 46 What is the h'th term of 472005, 3775957, 12743801, 30207483, 58998949, 101950145, 161893017? 471991h*3 + 15h - 1 What is the i'th term of -183979, -183804, -183629? 175i - 184154 What is the y'th term of -937, -7541, -25549, -60691, -118697, -205297? -955y*3 + 28y*2 - 3y - 7 What is the v'th term of -85777, -171281, -256525, -341509? 130v2 - 85894v - 13 What is the r'th term of 821, 943, 1149, 1439, 1813, 2271? 42r2 - 4r + 783 What is the x'th term of 792, 2987, 6564, 11511, 17816, 25467? -2x3 + 703x*2 + 100x - 9 What is the g'th term of 2750737, 5501596, 8252455? 2750859g - 122 What is the f'th term of -1795, -7102, -15919, -28222, -43987, -63190, -85807, -111814? 4f*3 - 1779f*2 + 2f - 22 What is the t'th term of 113728539, 113728548, 113728569, 113728608, 113728671, 113728764, 113728893? t*3 + 2t + 113728536 What is the v'th term of -526820, -527027, -527234, -527441, -527648? -207v - 526613 What is the d'th term of 19359, 38707, 58055, 77403? 19348d + 11 What is the m'th term of -195257806, -195257803, -195257800, -195257797, -195257794, -195257791? 3m - 195257809 What is the q'th term of 953834, 1907515, 2861196, 3814877, 4768558? 953681q + 153 What is the y'th term of 459, 811, 1015, 1035, 835, 379? -6y3 - 38y*2 + 508y - 5 What is the a'th term of -2062202, -2062213, -2062224, -2062235, -2062246? -11a - 2062191 What is the b'th term of 6284915, 12569817, 18854719? 6284902b + 13 What is the n'th term of -61229, -61457, -61691, -61931, -62177, -62429, -62687? -3n2 - 219n - 61007 What is the m'th term of 398967921, 398967920, 398967919, 398967918, 398967917? -m + 398967922 What is the o'th term of -4177, -33498, -113085, -268072, -523593? -4189o3 + o2 - o + 12 What is the c'th term of 11354250, 22708512, 34062774, 45417036? 11354262c - 12 What is the s'th term of 99, 942, 2525, 4848, 7911, 11714, 16257? 370s2 - 267s - 4 What is the d'th term of 14690, 10539, -730, -22675, -58854, -112825? -593d3 - d2 + 3d + 15281 What is the s'th term of 534600, 534290, 533980? -310s + 534910 What is the a'th term of -551169, -2204941, -4961227, -8820027? -551257a*2 - a + 89 What is the r'th term of -4913343, -4913088, -4912663, -4912068, -4911303, -4910368, -4909263? 85r2 - 4913428 What is the q'th term of -7883, -8113, -8421, -8813, -9295? -q3 - 33q2 - 124q - 7725 What is the j'th term of -654635, -1309236, -1963837, -2618438, -3273039? -654601j - 34 What is the l'th term of 4368, 5709, 7064, 8439, 9840, 11273, 12744, 14259? l3 + l2 + 1331l + 3035 What is the h'th term of -847741, -1695855, -2543969, -3392083, -4240197, -5088311? -848114h + 373 What is the f'th term of -47861, -47932, -48133, -48530, -49189, -50176, -51557, -53398? -11f3 + f2 + 3f - 47854 What is the o'th term of -5289, -10374, -15263, -19962, -24477? -o3 + 104o*2 - 5390o - 2 What is the n'th term of 2819, 5550, 10075, 16400, 24531? n*3 + 891n*2 + 51n + 1876 What is the o'th term of -802, -1250, -1342, -1078, -458, 518, 1850? 178o2 - 982o + 2 What is the z'th term of 93078, 91649, 90220, 88791? -1429z + 94507 What is the b'th term of -1148, -2808, -4974, -7646, -10824? -253b*2 - 901b + 6 What is the l'th term of 205220, 205219, 205218? -l + 205221 What is the n'th term of 644637, 1289253, 1933869, 2578485, 3223101? 644616n + 21 What is the f'th term of 610, 2678, 7542, 16600, 31250? 233f*3 + 437f - 60 What is the q'th term of 336419, 339601, 342783, 345965, 349147? 3182q + 333237 What is the h'th term of 4102, 6710, 9306, 11890, 14462? -6h*2 + 2626h + 1482 What is the h'th term of -18665, -37377, -56093, -74807, -93513, -112205, -130877? h*3 - 8h*2 - 18695h + 37 What is the d'th term of 15306, 15276, 15254, 15252, 15282, 15356, 15486, 15684? 2d3 - 8d*2 - 20d + 15332 What is the d'th term	{ "pile_set_name": "DM Mathematics" }
allest value? (a) -4/3 (b) -736 (c) 2 (d) 3 (e) -4 b Which is the fourth biggest value? (a) 1/3 (b) -4 (c) 1 (d) -2 b What is the smallest value in -0.1, 2, -1, 16, -2/23? -1 What is the second biggest value in 0, 121, 9? 9 What is the second smallest value in -0.1, 6/11, -52? -0.1 What is the fourth smallest value in -1/7, -0.09, 2/9, 1/2, 82? 1/2 What is the third smallest value in 50, -1/2, 7/2? 50 Which is the third biggest value? (a) 5 (b) -6 (c) 0.2 b Which is the smallest value? (a) 860 (b) -0.3 (c) -0.1 b What is the fourth smallest value in -1.1, -3, 3, 0.3? 3 Which is the second biggest value? (a) -4 (b) -3/2 (c) 27 b Which is the third smallest value? (a) 0.2 (b) -0.23 (c) 3 c Which is the fifth smallest value? (a) 3/8 (b) -2 (c) 42/17 (d) 0.1 (e) -1 c What is the smallest value in 0.5, 54, -1/4? -1/4 What is the second smallest value in 0.1, 4/7, 0.2, -0.02? 0.1 Which is the smallest value? (a) -0.4 (b) 2/63 (c) 0.4 a What is the smallest value in -1/4, -4, -3? -4 What is the third smallest value in 2, 0.2, 1/16, 3, 2/5? 2/5 Which is the smallest value? (a) 0.1 (b) -2/17 (c) -3/7 c What is the fourth biggest value in 0, -0.3, 1/5, 3/32? -0.3 Which is the second biggest value? (a) -8 (b) -5 (c) 0.5 (d) -7/2 d What is the second biggest value in 2, -0.3, -34? -0.3 Which is the fourth smallest value? (a) 31 (b) -0.4 (c) -0.3 (d) 5 a Which is the smallest value? (a) -5 (b) 323 (c) 5 (d) 2/17 (e) 14 a What is the fourth smallest value in -4, -1, 0.3, -5, 232? 0.3 What is the third smallest value in 5, 2/9, -0.11, -5/8? 2/9 What is the fourth smallest value in -0.04, 0.5, -7, -19? 0.5 Which is the fourth biggest value? (a) 31.3 (b) -3 (c) 3 (d) 0.5 (e) 2 d Which is the second smallest value? (a) -1 (b) 51 (c) 15 c What is the second biggest value in -0.5, 0.2, -9, 5? 0.2 Which is the smallest value? (a) -0.2 (b) -2 (c) -4/7 b Which is the biggest value? (a) -1/3 (b) 0.01 (c) 0.05 (d) -1/4 c What is the third smallest value in 0.3, -1/3, 0.34? 0.34 Which is the second biggest value? (a) 0 (b) -94/7 (c) 2 a What is the smallest value in 386, -3, 0.5? -3 What is the third biggest value in 0.22, -2, 0, 0.12? 0 Which is the biggest value? (a) 6 (b) -9 (c) -34 a Which is the third biggest value? (a) 25 (b) -2 (c) -14 (d) 0 b What is the third smallest value in -0.13, -1/2, -1/10, 0? -1/10 What is the third smallest value in 8, -2/223, 5, 1/4? 5 What is the fifth biggest value in -10/7, 3, 19, 0.2, 2/3? -10/7 Which is the fourth biggest value? (a) -5.5 (b) 3 (c) -2/3 (d) 4 (e) -4 e Which is the third smallest value? (a) -74 (b) -2 (c) 2/11 c What is the second biggest value in -3, -2, 5, 4, -2/13? 4 Which is the biggest value? (a) 1/4 (b) 0.39 (c) -1 b Which is the biggest value? (a) -0.28 (b) -0.4 (c) -4 (d) 1 d What is the third smallest value in -197, 3, 13, 0.5? 3 Which is the fifth smallest value? (a) 0.4 (b) -3 (c) 0.2 (d) -105 (e) 0.19 a What is the second smallest value in 0.3, 6698, -1? 0.3 What is the second smallest value in 4, -4, -2/13, -2, 3? -2 What is the smallest value in 4, 3, 3/7, 0.257, 2/21? 2/21 What is the second biggest value in -1, -4, 0.61? -1 Which is the second smallest value? (a) 3/7 (b) 0.08 (c) -0.22 b What is the second biggest value in -28, 1, 2/15? 2/15 What is the second smallest value in 3/7, 4, 105? 4 Which is the biggest value? (a) -2 (b) 0.3 (c) 143 (d) 0 (e) -1 c What is the third smallest value in -9/4, 5/2, -2/3? 5/2 What is the second biggest value in 2/3, -2, -0.5? -0.5 What is the fourth biggest value in -5, -97, -2, 0? -97 Which is the second smallest value? (a) 2 (b) -1 (c) -5/7 (d) 0 c What is the fourth biggest value in -3/47, 2, 4, -31? -31 What is the second biggest value in 4, 3, -2/15, -0.1, 44? 4 Which is the fourth biggest value? (a) 814 (b) -0.3 (c) -5 (d) 0.2 c What is the biggest value in 0.2, 1/7, 0.07? 0.2 Which is the third smallest value? (a) -0.5 (b) 5/6 (c) 2/7 (d) 0.002 c Which is the second smallest value? (a) 1 (b) 0.02 (c) 7/2 (d) 2/5 (e) -0.3 b What is the biggest value in -0.5, -2/13, 0.0415? 0.0415 What is the third smallest value in 3, -0.3, -15/7, 1/2, 2/11? 2/11 Which is the biggest value? (a) 0.044 (b) -0.06 (c) 5 c Which is the fourth biggest value? (a) 4 (b) 0 (c) -0.17 (d) 3 (e) -5 c What is the second biggest value in -2/13, 3/2, 28? 3/2 What is the second biggest value in 1/2, -3316, -0.5? -0.5 What is the third smallest value in -0.2, 2/9, 1/6, -5/2? 1/6 Which is the second biggest value? (a) 0.06 (b) -0.8 (c) -28/5 (d) 1 a Which is the third biggest value? (a) -2/9 (b) 2447 (c) 5 a Which is the third biggest value? (a) -7 (b) 0.8 (c) -2/3 a Which is the third biggest value? (a) 5 (b) -4/7 (c) 0.5 (d) 2/11 d What is the second smallest value in 12, -5, -6? -5 What is the smallest value in -2, -0.2, -242.9? -242.9 Which is the second smallest value? (a) -0.4 (b) 1 (c) -0.1 (d) 2/7 c What is the biggest value in -5, -10, -1, 5? 5 What is the third biggest value in 0.5, 44/29, -2? -2 What is the second smallest value in 1/4, 21.2, 4? 4 What is the second smallest value in 2/3, 1/4, 0.22, 5, 3? 1/4 What is the third smallest value in -17, -16, 0? 0 What is the biggest value in -4, -1, 0.53? 0.53 What is the fourth biggest value in 3/11, 0.5, -1/9, -0.3, -0.4? -0.3 What is the fourth smallest value in 5, 1, 2/7, -19? 5 What is the second biggest value in -0.0675, 1, -1? -0.0675 What is the fourth smallest value in -3/5, -2, 2, 83/6? 83/6 Which is the second smallest value? (a) -5 (b) 0.1 (c) -169 (d) 2/5 a What is the second biggest value in -1, -3, -2/13, -32? -1 Which is the second biggest value? (a) -0.2 (b) 9 (c) -31 a Which is the biggest value? (a) -7440 (b) 0.1 (c) 0.3 c What is the fifth biggest value in 2, -0.5, -0.2, 0.2, 3? -0.5 What is the biggest value in -85, -0.5, -4/3? -0.5 Which is the biggest value? (a) -0.0142 (b) 4 (c) 9 c What is the third biggest value in 5, 4/9, 2/201? 2/201 Which is the biggest value? (a) -0.3 (b) 71.6 (c) -2 (d) 0.2 (e) -4 b Which is the third biggest value? (a) -4/5 (b) -36 (c) -3.3 b Which is the fifth biggest value? (a) 1/7 (b) -0.4 (c) -0.3 (d) 10 (e) 2 b What is the third smallest value in -0.3, 362, -2, -4, -1? -1 What is the third biggest value in 1/6, 238.6, 0.4, 0.5? 0.4 Which is the third biggest value? (a) -2/31 (b) 0.4 (c) -0.5 c What is the biggest value in -0.9, 3, -3, 2/9? 3 Which is the fourth smallest value? (a) 6 (b) -4 (c) 2/15 (d) -0.3 a Which is the smallest value? (a) -50 (b) 107 (c) -5/4 a Which is the smallest value? (a) -4/7 (b) -1 (c) -55 c Which is the second smallest value? (a) 0.3 (b) -2/3 (c) -0.406 c What is the second biggest value in 1/3, 2575, -0.3? 1/3 Which is the second smallest value? (a) -4 (b) -0.3 (c) 1494 b What is the second biggest value in -1, 2/7, -27, 2? 2/7 What is the second biggest value in -683, -2/9, -4/11? -4/11 Which is the fourth biggest value? (a) -3/2 (b) -1/5 (c) -0.4 (d) -14.2 d What is the biggest value in 1/17, -2, 4/5, -0.2? 4/5 What is the third smallest value in 1, -1/6, 2, 22/3? 2 Which is the biggest value? (a) -10/7 (b) 2/15 (c) 0.1 b Which is the fourth smallest value? (a) 20 (b) 4 (c) 0 (d) -3/7 a What is the second smallest value in -0.067, 2, 1/4? 1/4 What is the smallest value in 1, 1/2, -2/321, -0.5? -0.5 What is the second biggest value in 247, 0.04, -2? 0.04 What is the smallest value in 3, 5, -170? -170 What is the smallest value in 2, -10, 36? -10 What is the smallest value in -5, -15, 2/45? -15 What is the third biggest value in -97, -13, -1? -97 Which is the fourth smallest value? (a) 3 (b) 0 (c) -0.4 (d) 0.1 (e) 1 e Which is the smallest value? (a) -0.4 (b) 4 (c) 2.003 a Which is the biggest value? (a) -5 (b) -1/12 (c) -4.53 b What is the second smallest value in -3, -0.22, -9? -3 Which is the fourth biggest value? (a) 3 (b) -0.06 (c) 15 (d) -1/2 d What is the third smallest value in 4/9, -892, 2? 2 What is the third smallest value in 58.1, -5, -3? 58.1 Which is the third smallest value? (a) -4 (b) 5 (c) 1 (d) 0 (e) 3/299 e What is	{ "pile_set_name": "DM Mathematics" }
0 + 25505 = -4l + i for l. 4 Solve 0 = -4v - 4w + 44, -w = -415v + 415v - 12 for v. -1 Solve -4z + 80f - 40 = 76f, -2f + 27 = 5z for z. 1 Solve 5o - 4r + 40 = 0, -10 = 644r - 646r for o. -4 Solve 0 = 2a + 6m, -7m = -4m + 3 for a. 3 Solve 3a = 30b - 34b + 29, 2a + 2b = 16 for a. 3 Solve 31p - 4m = 55p - 28p + 8, -4m = -12 for p. 5 Solve 39i + d + 42 - 127 = 0, 5i - d - 3 = 0 for i. 2 Solve -28u + 46u + 5p = -82, 2u = -3p - 14 for u. -4 Solve 4j - 5 = 5w, -2 = 4w + 2 for j. 0 Solve 5t + 15 = 0, 495l + 3t = 496l - 16 for l. 7 Solve -t - 1086 + 1085 = 0, 2t - 2 = -x for x. 4 Solve -4t + 16 = -2n - n, 3n + 144767t + 10 = 144765t for n. -4 Solve -d - 8 = -4m, 98 = -5m - 5d + 83 for m. 1 Solve 3b + 8s - 36 = -s, 509b - 510b = -4s + 16 for b. 0 Solve 195t + 3z - 186 = 0, 1644z = -5t + 1645z + 8 for t. 1 Solve 4l - 3c - 27 = 0, 0 = -13l + 9l + 5c + 21 for l. 9 Solve t - 4 + 12 = -3b, 4b + 12 = 0 for t. 1 Solve -9 = -4c - g, -5g + 9 = 220c - 218c for c. 2 Solve 99j = 104j + 138z + 316, 3j - z = -22 for j. -8 Solve -88220n - o - 6 = -88218n, 0 = 2n + 3o + 2 for n. -4 Solve -11s + 8s = -2c + 16, -3s + 8 = c for c. 8 Solve -10d - 404c + 403c + 112 = 0, 5c = -4d + 54 for d. 11 Solve 2i - 4o - 54 + 30 = 0, -2i + 7o + 30 = 0 for i. 8 Solve -3y = -2k - 15, -3k + 5y - 1 = 24 for k. 0 Solve 4w + y + 15 = 0, -4w + 656y - 652y = 0 for w. -3 Solve 442f - 447f - 70 = -5v, 3 = 3v for f. -13 Solve 4a = 10l - 11l + 3, a + 4l = -3 for a. 1 Solve 6p - 2p + 9 - 1 = 2m - 0p, 0 = m + 2p for m. 2 Solve 130v - 120v + 4 = -2o, -3o - 5v = -14 for o. 8 Solve 5u = p - 19, 968 = -24u + 896 for p. 4 Solve -3q = 42g - 45g - 1 - 5, 14q = 70 for g. 3 Solve 0 = -4c - 3t - 493 + 475, 2t + 1 = c for c. -3 Solve 5w + 5r - 314 + 299 = 0, -w + 3r - 1 = 0 for w. 2 Solve -16 = -10u + x, -4u - 5x + 32 = 4 for u. 2 Solve 5w - 39 = -g, -3w + 16 = -4g + 80 for w. 4 Solve -5j - s = 1, 0j - 14 = -2j - 4s for j. -1 Solve t - 2m = -13, -3m + 768 = -m + 760 for t. -5 Solve -175o - 101 = -2z - 166o, 51 = -4z - 5o for z. 1 Solve -188786x + 40 = -188783x - 5v, -5x - 4v + 5 = 0 for x. 5 Solve -2y = -3p + 3, 11p + 5 = 16p for y. 0 Solve d - 22 = -2o - 9, 12 = -d + 3o - 0 for d. 3 Solve -5 = -z - 796m + 793m, 4z + 3m = 2 for z. -1 Solve -2g = 3s, 6g - 8g + 6g + 2 = -5s for g. -3 Solve 242 = 24c + 2m, 4m + 54 - 18 = 4c for c. 10 Solve 40921r - 40924r - 5s = 47, 5r - 6s = 22 for r. -4 Solve -11d - q - 61 = 7, -3q = 3d + 24 for d. -6 Solve 2m - 141 = -2o - 155, -5m - 26 = -4o for o. -1 Solve -4l = 4f + 32, 0 = 3l + 4f - 200 + 231 for l. -1 Solve -5s + u = -10, 2s = -25089u + 25090u + 1 for s. 3 Solve -853x = l - 848x + 6, -1 = 2l - x for l. -1 Solve 520 = 5u + 13h + 305, -u = -3h + 41 for u. 4 Solve 3u - 15m + 467 = 311, -u - 5m + 58 = 0 for u. 3 Solve 2d - n = 0, -d + 147n = 142n - 18 for d. -2 Solve 0 = q - 3l + 2, 2l + 236 = q + 238 for q. -2 Solve -4a + 12 = -g, 110g + 3 = 107g + a for g. 0 Solve 5v = -32r + 36r - 3, 0 = -3r - 3v + 9 for r. 2 Solve -f + 11o - 10 = 16o, o = -1 for f. -5 Solve -4t + 8 = -4671w + 4667w, t + 3 = -4w for t. 1 Solve n = -4x + 11, 2x = -4n - 65 + 95 for n. 7 Solve 0 = 2s - 2d - 18, -2d + 112 = 3s + 75 for s. 11 Solve 90t = -3c - 18, c + 3c - 5t = -24 for c. -6 Solve -5x + 17 = -3q, 2q + 4x - 31 = -57 for q. -9 Solve -4y - 5j = -6, 545j = 4y + 548j - 2 for y. -1 Solve -3o = 2n - 8, 5o = 10o + 2n - 12 for o. 2 Solve 5z + 8 = 7z, -2d + 44 = z - 20 for d. 30 Solve -8038n + 8033n - 21 = -4h, -10 = 2n for h. -1 Solve -11 = 3c + 4t, 36c - 2t = 33c - 17 for c. -5 Solve 0 = -r - 5c - 181 + 172, 4c = -r - 7 for r. 1 Solve -5q + 15 = -5i, -2i - 1750 + 1746 = -3q for i. -5 Solve 10o - 13287 = 3m - 13150, -2m = 5o - 72 for o. 14 Solve -8710f + 8711f = 5q - 10, -q = -3f - 2 for q. 2 Solve 31742r + 23 = 31739r - 8y, 4r = 5y - 15 for r. -5 Solve o = -2h - 4, -4o - 68h + 71h = 5 for o. -2 Solve 2s = 5n + 30, -14s + 18s - 2n - 28 = 0 for s. 5 Solve 5z + 1441 - 1443 = 2x, z + 22 = 6x for z. 2 Solve -3v - 138 + 106 = 17s, 4v + 24 = -4s for s. -1 Solve -5k = -x - 0x - 30, 0 = -314k + 310k - 4x for k. 5 Solve 3 = -4197b + 4196b + 2x, 0 = -5b - 4x + 27 for b. 3 Solve -898u + 910u + 5g + 41 = 0, -12 = 3u + 3g for u. -3 Solve n = 2f + 10, -3n - 3 = 554f - 549f for n. 4 Solve -2j + z - 8 = 0, 7z + 40 = -4j + 3z for j. -6 Solve 5c + 9 = -i, 2739i = 3c + 2737i + 8 for c. -2 Solve -14o = -15o - 5f - 1, -4f = -o - 28 for o. -16 Solve -63 = 2z + 3p - 108, -3p + 24 = -5z for z. 3 Solve 41 = -15f - 2m, 250 = f + 5m + 243 for f. -3 Solve -17l = -16l + 2p, 5p - 1 = -3l for l. 2 Solve -854f + 861f = -35, 0 = -2l + 5f + 37 for l. 6 Solve 5n - 9 = r + 7, 3n = 17 - 5 for r. 4 Solve -19l + 17l = -5o - 17, 0 = 7l + 5o + 8 for l. 1 Solve 8t = 13t + 5s - 30, -5t = s + 2 for t. -2 Solve -4t - d + 2454 - 2356 = 0, 100 = 4t + 2d for t. 24 Solve -5 = 3p + 4q + 16, 12 = -486q + 482q for p. -3 Solve -182m + 30 = -180m + 5p, -m - 15 = -5p for m. 5 Solve -15m = 6p - 37m + 19m + 24, 10m = 4p for p. -5 Solve 2h - 319 + 303 = 2v, 0 = -4v - 4h for v. -4 Solve -47a - 4t - 6 = -45a, -2t - 6 = 4a for a. -1 Solve o - 7 = -n, -o - 1573 + 1589 = 2n for n. 9 Solve -5t = -5b - 15, -8b + 231t - 37 = 236t for b. -4 Solve 1665j = 1668j - 3t + 12, 5t - 4 = -3j for j. -2 Solve 0 = -4z - 28, 0 = 4a + 126z - 124z + 26 for a. -3 Solve -y - 18 = -5n, -52 = 7y + 3n - 2 for y. -8 Solve x - 21 = -4k, -109 - 79 = -x - 5k - 163 for x. 5 Solve 7d = 4b + 77, 0 = d - 137b + 136b - 11 for d. 11 Solve 2r - 54 = 3x + 14r, 4x = 2r + 18 for x. 2 Solve 4x - 17 = 5f, 42x = 52x - 3f + 5 for x. -2 Solve -a - 556 = -5o - 561, 2o + 2 = -3a for a. 0 Solve 27f - 24f - 7 = 2j, 4j + 9 = f for f. 1 Solve 12q - 198 = 3y, 113q - 117q + 72 = -4y for q. 16 Solve -3r - 26 = 5w, 0 = 4w - 4r - 253 + 261 for w. -4 Solve 2p + 60 = 6f, 5f + 351p - 58 = 353p for f. 2 Solve 1140x = 1145x - 2d - 12, 17 = x - 15d for x. 2 Solve -76v + 38v - 8 = q - 35v, 2q = 3v + 2 for q. -2 Solve q - 2f = -11, 79f = 37f + 37f for q. -11 Solve k - 10 = 4v, 5v - 17 = 4k - 46 for k. 6 Solve 2g + 4 = r, -45 + 61 = 4g + r for g. 2 Solve -24x + 2w = -26x, w = 3x - 12 for x. 3 Solve 2 = -3r + 5h, -5r + 3 = 125907h - 125909h for r. 1 Solve 0 = 2l - 2j + 34, -328 + 303 = 2l - 5j for l. -20 Solve -4b - 20 = -3l - 13, 25 = -3l - 4b for l. -3 Solve 5u = 4t - 22898 + 22842, -2t = 4u + 50 for t. -1 Solve 2o - 32 = -34, -3o + 9 = -4n for n. -3 Solve -4f - 10124w = -10128w + 8, 0 = 5f + 2w - 11 for f. 1 Solve 126h = -2y + 129h + 19, -7h = -2y + 31 for y. 5 Solve -5z + 1460 = -6q + 1445, -4q = -2z - 2 for q. 5 Solve 2053h + 14 = n + 2056h, 2n - 5h + 27 = 0 for n. -1 Solve 3a = c - 5, -8a - 2c = -7a - 3 for a. -1 Solve -43t + 47t + 5y = 6, -13t - 19 = -3y for t. -1 Solve 0 = -z + j + 12 - 7, 0 = 4z - 5j - 20 for z. 5 Solve -13x - 4j - 2 = -18x, -42x - j - 87 = 0 for x. -2 Solve 3f = -67n + 70n - 12, -10 = 5n + f for n. -1 Solve 13i + 12 = 12i + 2m, 15 = -5i + m for i. -2 Solve -121s = -112s + 5k + 10, 0 = -s + 4k + 8 for s. 0 Solve 1 = -3v + 2q, 4v + 907 = 3q + 908 for v. -5 Solve -39j + 69 = 5u - 41j, -60 = -4u + 4j for u. 13 Solve 3l = -2m + 20, -m = -15m - l + 60 for m. 4 Solve 168x - 164x = 2v + 2, 0 = 2x + 2v + 2 for x. 0 Solve -5b + 5 = -5y, 0 = 13b - 16b - 3y - 15 for b. -2 Solve 0 = 5y + z - 16, 31y - 13 = 26y + 2z for y. 3 Solve 3y + 35 - 28 = -q, 0 = -5q + 25 for y. -4 Solve -7r - 4b = 48, -2r - 14b - 2 = -16b - 4 for r. -4 Solve -3o = 3l - 1505 + 1544, -3l + 3o + 33 = 0 for l. -1 Solve 4k - 2252q + 2250q - 18 = 0, -15 = -4k - q for k. 4 Solve -q - 3h + 1 = 0, -2q - 19h + 15h - 8 = 0 for q. -14 Solve -i + 2l - 6 = 0, -81i + 77i + 5l - 9 = 0 for i. 4 Solve -j + 4i - 31 = 0, 7i + 29 = -5j + 13i for j. 5 Solve -4a = 0, 14t + 2t - 12t - 9 - 7 =	{ "pile_set_name": "DM Mathematics" }
- 10, 4u + 5t - 2 = -0 for u. -2 Solve q - 5t = -5 - 1, 3q - t = 10 for q. 4 Solve -3w = -4v + 5, -5w + 5v - 15 = -3w for w. 5 Solve 20 = -6r + 7r - 5b, -3b = 9 for r. 5 Solve 12k - v = 17k - 2, -5v + 10 = -5k for k. 0 Solve 5w + 8 = -2z, -20w + 25w + 10 = 0 for z. 1 Solve 4o - 2y = 20, 9 = 2o - 3o - 3y for o. 3 Solve -m = 4t - 13, -5m - 1 + 26 = 0 for t. 2 Solve 3h - 4o + 4 = 0, -24 = -4h - 0h - 2o for h. 4 Solve 8u - 4w + 37 = 3u, 0 = -4u + 3w - 29 for u. -5 Solve -2l - 2b - 10 = 0, 0 = -12l + 16l + 2b + 22 for l. -6 Solve 4u - 2n + 22 = 0, 2n = -u - 3u - 2 for u. -3 Solve -2 = y + 5n - 22, 4y - 4n = 8 for y. 5 Solve -k - 9 = -565y + 563y, 4y - 5k - 21 = 0 for y. 4 Solve -3z - 2w = -1 - 1, -4z - 4 = w for z. -2 Solve -4w + u = 17, -4w - 5 = -3u + 14 for w. -4 Solve 3z - 31 = -5r, 115z + 17 = 5r + 111z for r. 5 Solve 0 = -2x + 5x - 6, -3 = -3q + 3x for q. 3 Solve p = 5y + 3, -5y - 4 = -y for p. -2 Solve -5p - x - 11 = -7p, 4p - 5x = 37 for p. 3 Solve 2j - 8 = 0, 5c - 21 - 3 = -j for c. 4 Solve -1 = 2q + x, 0q + 4x - 14 = -2q for q. -3 Solve -j = 5d + 34, 2j - 4d + 65 - 81 = 0 for j. -4 Solve 0 = -5w - 25, -j + 5w + 13 = 2j for j. -4 Solve -10i = -12i, 2i = -2d + 2 for d. 1 Solve 3 = s - n - 0, -3s = 3n + 21 for s. -2 Solve -10c - 5v - 21 = -14c, -v = -5c for c. -1 Solve 3s - 3b = -43 + 28, -5s - 4b + 20 = 0 for s. 0 Solve 0 = 5f + 2y + 3y - 30, 4f - 5y = 15 for f. 5 Solve -3c + 16 = 2k, 4c - k + 0k = 14 for c. 4 Solve 0 = -15f + 14f + 4j + 20, 0 = -4f - j - 5 for f. 0 Solve 5t = 8t, b + 2b + 12 = t for b. -4 Solve 0 = -5i - 2d - 0d - 5, -4d + 1 = -i for i. -1 Solve 0 = 3p + 2v + 1 + 7, 4p + 4v = -12 for p. -2 Solve r = -5m + 4, 4r - 1 + 6 = m for m. 1 Solve 4v + 4n - 8 = 0, 3n + 0 = -2v + 2 for v. 4 Solve 3q = 2p + 3, -23 + 22 = -q + 2p for q. 1 Solve 2m - 3 = -5, 4s - 2m = -14 for s. -4 Solve s = -2c + 10, -25 = s - 2s - 5c for s. 0 Solve 10 = -0n - 2n, 0 = h + 3n + 14 for h. 1 Solve a - 12 = -4o - a, -5a = -5o + 30 for o. 4 Solve -2v + v - 3l - 12 = 0, 5v + 2l = 5 for v. 3 Solve 2j = -2u - 4, 2u + 3 = j + 11 for u. 2 Solve 0 = 5n + m - 7, 2n + 5m + 13 = n for n. 2 Solve 2j + 12 = 3a - 5a, 0 = 3a - 5j - 14 for a. -2 Solve 9 = 2w - 3h, -h = -4w - 154 + 157 for w. 0 Solve q = t - 4, -q - 21 = -4t - 2q for t. 5 Solve v = 2a + 3, -45v = 2a - 44v + 1 for a. -1 Solve 5p - 7 = -5k + 2k, -16 = -3k + 4p for k. 4 Solve -u + 27i - 23i = -21, 4u = i + 9 for u. 1 Solve 9l + 3 = 10l + 4d, 3l + 5 = -5d for l. -5 Solve 3u - 5g + 84 = 102, 11 = 2u - 3g for u. 1 Solve 4h - b - 5 + 19 = 0, 0 = 3h + b + 14 for h. -4 Solve 4w + 4y + 14 = 6y, -10 = 2w + 2y for w. -4 Solve 4y + g = 8, 6g = 4y + g - 32 for y. 3 Solve 0 = -4p + 5i + 17, 39p - 42p - 16 = 2i for p. -2 Solve 2s - 4x - x + 15 = 0, 0 = s - 2x + 7 for s. -5 Solve 0 = 2l - 5x - 28, l - 6l - 2x + 12 = 0 for l. 4 Solve 3h + 0q = 5q + 22, 0 = -4h - 5q + 6 for h. 4 Solve 5h + 10 = 5o, 14h - 16h = 5o - 3 for o. 1 Solve -4w = 16, 5w + 2 = 3h - 3 for h. -5 Solve 5m + 4a = -5 - 16, -3m - 12 = 3a for m. -5 Solve 2r + 3y - 1 = 0, -3r + 3y = -7r + 17 for r. 8 Solve -5o = 5c + 25, -16c + 23 = -3o - 21c for o. -1 Solve 7l + 13 = 2t, 0l - 4l = 5t - 11 for t. 3 Solve 5u - 2y = 4u - 9, 0 = -5u - 2y - 21 for u. -5 Solve 3p - 4h - 17 = 0, 9p - 13p + 4h + 20 = 0 for p. 3 Solve -5j - 5r - 5 = 0, -5j = 8r - 9r + 17 for j. -3 Solve -6b + 3b = 0, -3v + 4b = 0 for v. 0 Solve 134h - 130h - 17 = -3a, -5a + 5h + 5 = 0 for a. 3 Solve 15l - 20l = 4i - 9, l - 3i - 17 = 0 for l. 5 Solve 4j + 8 = b, b + 13 = 4j - 7j for b. -4 Solve p + 3s + 0 + 12 = 0, -4p - 2s + 2 = 0 for p. 3 Solve -4m - 2 = -5h - 0h, -3h = 2m + 12 for h. -2 Solve -4g + 5n - 2n + 9 = 0, -4g = 2n + 6 for g. 0 Solve 0 = -4s, s - 2s - 10 = 2w for w. -5 Solve 5q - 4l - 7 = 0, -3q + 3 = 10l - 13l for q. 3 Solve -4n = 5x - 43 - 2, -3n = -x - 10 for x. 5 Solve -5g + 9 = 4h - 8, 4h = 2g + 10 for g. 1 Solve 2p - 2i = -6i - 4, -3p + i = 6 for p. -2 Solve -v = -2p - 6 - 4, -2v - 10 = 2p for v. 0 Solve 5p - 3y = 16, 0 = 2p - 64y + 65y - 13 for p. 5 Solve -u + 26 = 5j, 4j - 44 = -0u + 5u for u. -4 Solve -4 = 2w + 3x, w - 63 + 70 = -4x for w. 1 Solve 0 = -3y - 2c + 3, 2c = -9y + 5y + 4 for y. 1 Solve -9q + 6q + 4 = -h, -h + 2 = -q for h. 5 Solve -4p + 29 - 5 = -4j, 3p + 10 = -4j for j. -4 Solve -4u + 9 = z, 17z - 4u = 21z for z. -3 Solve -5m + 51 = -5z + 6, 5m - 37 = 3z for z. -4 Solve -2s + t = 2, 3t + 11 = 3s + 14 for s. -1 Solve 0p - p = 4x - 3, -2 = 2p + 4x for p. -5 Solve 5s - 2r - 17 = -13, -4s = 3r - 40 for s. 4 Solve 5l = -5b, -2b - 25 = -3l - 20 for l. 1 Solve -8m + 5v - 15 = -3m, m = -5v + 15 for m. 0 Solve 0 = -2y - 4b + 4, -2y + 2 = 14b - 11b for y. -2 Solve 2i + 4r + 16 = 0, i + 18 = -3i - r for i. -4 Solve -13 - 2 = -2r + 3o, 4o + 20 = 4r for r. 0 Solve 3g = -5m - 12, 2m = 3g - 8g - 20 for g. -4 Solve 3m - 3 = 3d, 36m - 4d + 24 = 39m for m. 4 Solve -3k + 8 = v, 3k - 2 = -4v + 6k for v. 2 Solve -5y + 4y = 5, -11 = -2s + 3y for s. -2 Solve -4r + f = -6, -f + 2f + 4 = 2r for r. 1 Solve 0 = 4c + 5y - 0y - 33, -5y + 27 = c for c. 2 Solve -v + n = 8, 5n = 4v + 8n + 11 for v. -5 Solve 0 = y - 4k + 19, -78k = 4y - 75k for y. -3 Solve -3 - 14 = 5w + 3j, w + 21 = -5j for w. -1 Solve z - 5d = -d, d = -2z for z. 0 Solve 4 = -3p + 4b + 39, 0 = -2p - b + 5 for p. 5 Solve -15 = t + 5n, n + 11 = -5t + 8 for t. 0 Solve 4a + 0h + 8 = 4h, 5a = -2h - 31 for a. -5 Solve -8x + 2t = -4x - 10, -4t = 5x - 19 for x. 3 Solve -9b = -5b + y - 12, b = -2y - 4 for b. 4 Solve -62k = -60k - a + 1, -5a + 25 = 0 for k. 2 Solve 8 = -4q - 4k, -2q = 4k + 3 + 5 for q. 0 Solve -3m = -4a - 8, -3m + 15 = -5a + 2 for a. -5 Solve c + d + 13 = 4c, -1 = c + d for c. 3 Solve 4l = 0, -3a + 162l - 164l = 3 for a. -1 Solve 5p + 35 = t + 4t, -3p + t = 17 for p. -5 Solve -6o = 4x - o + 35, 2o = -5x - 31 for x. -5 Solve 5g - 5 = 5d, -3 = 3g - 15 for d. 3 Solve -4m - d + 21 = 39, 5d = 4m + 30 for m. -5 Solve -3m = -2f - 14, 17 = 4m + 22f - 23f for m. 4 Solve 4w - 11d + 6d - 13 = 0, 0 = 5w - 5d - 10 for w. -3 Solve -5v - 2i = 12, -20 = 2v + 7i - 10i for v. -4 Solve 0 = -5r, -y + 16r - 13r = 2 for y. -2 Solve 0 = 2n - m - 6, 3n - 5m + 0 - 9 = 0 for n. 3 Solve -4 = -0v - 2v, 4v = b + 10 for b. -2 Solve 5s = -20, -12g - 1 = -11g - s for g. -5 Solve 3a + 0a = -u, -5a = -2u for a. 0 Solve q + 10 = -3i + 8i, -2q - 2i + 4 = 0 for q. 0 Solve -20 = l - 0l - 5q, 2l - 5q + 25 = 0 for l. -5 Solve -6 = 2q + 2d, 2q = 16d - 20d - 6 for q. -3 Solve n - 5k + 5 - 22 = 0, 0 = 5n + 5k + 5 for n. 2 Solve -a = 2r - 6, -17a = 4r - 19a - 20 for r. 4 Solve 5v + 53 = p + 41, p = -v - 6 for v. -3 Solve l + g + 4 = 1, 4g + 21 = 5l for l. 1 Solve 3k - 6 = -4n + 10, -k = -4n for k. 4 Solve 3i + 2g - 15 = 0, 4g = 5i + 2g - 9 for i. 3 Solve -20 = -4u - 5v, -5u + 4v - 3v = -25 for u. 5 Solve -7i + 4i = 4r + 22, 3r - 3i = -6 for r. -4 Solve 2h - 3x = 7, -1 - 10 = -h + 3x for h. -4 Solve 0s + s + 3n - 12 = 0, -2s + 5n = 31 for s. -3 Solve -1 = -2z - 3u, 7u = z + 4u - 5 for z. 2 Solve -4l - 14 = -0l - 2g, 3g = 3l + 15 for l. -2 Solve -2c = p - 6, 2c - 2p + 8 = 5c for c. 4 Solve -4m - 5w = -11, -4m + 3w + 18 + 1 = 0 for m. 4 Solve 0 = 5d - 2d + 5n + 21, -17 = d + 5n for d. -2 Solve -k - 5n - 18 = 0, 5k - 2n = 3k for k. -3 Solve -28h - 4t - 15 = -25h, 12 = 3h - 5t for h. -1 Solve h + z - 2 = 0, 4z + 3 = -3h + 9 for h. 2 Solve 2y - x - x = 2, -5y - x - 25 = 0 for y. -4 Solve 2v - 6 + 2 = 3m, -4m + 2 = v for v. 2 Solve -l + 1 - 3 = 0, -6 = -2j + 3l for j. 0 Solve -8o - f - 16 = -4o, 0 = -f for o. -4 Solve -3m = 2s + 11, 2m - 3m + s = 2 for m. -3 Solve 5c - 3m + 3 - 4 = 0, 4c - 4m - 4 = 0 for c. -1 Solve -28c - 5p = -24c - 3, 2p = c - 4 for c. 2 Solve 5m - 4 = -4y, 8y - 4*y = m -	{ "pile_set_name": "DM Mathematics" }
-g + 0g + 8r - 40 = 4g + 7r + 4r for g. -8 Solve 0 = -5b - 3r + 132, 8b + b - 4r + 0 = 247 for b. 27 Solve 3v = 4t - 96 + 19, 2071v - 2076v + 12t - 235 = 0 for v. 1 Solve -219004d = -219002d - 8, -a = -6d + 25 for a. -1 Solve 270r = -3j + 265r + 26, 5j - 2r = 2 for j. 2 Solve -10j + 15j = -5o + 10j - 40, -4j + 18 = 10o for o. -1 Solve -j - 40x + 45x - 21 = 0, 123x + 5 = 5j + 120x for j. 4 Solve 58 = -5u - 3j + 229, 0 = 4u - 6j - 162 for u. 36 Solve 2p = -48, 15k - 45p = -44p + 99 for k. 5 Solve 0 = 3q + 15, -5j - 24 - 29 + 118 = 22q + 45 for j. 26 Solve 366n = -5v + 368n - 19, v + 3v = 3n - 18 for v. -3 Solve 9358r + s - 11 = 9355r, -2r - 2s + 0s = -2 for r. 5 Solve 43 = -9b + 4r, 413498r - 14 = 6b + 413496r for b. 5 Solve -3c - 9 = 1785435q - 1785438q, 2c - 71 = -9q for c. 4 Solve 0 = 6w + 2n - 16, 0 = 2435511w - 2435514w + 3n - 36 for w. -1 Solve -17a = -a - 8t + 6t + 344, 0 = -5a + 5t - 125 for a. -21 Solve 9 = 5w - 331o + 330o, -15 = w + 4o for w. 1 Solve 0 = 2b - 10y + 6101 - 6023, -3y + 50 = -2b for b. -19 Solve -4b + 11y - 458 + 144 = 0, -2b - y + 38 = 0 for b. 4 Solve 4n - 40b - 223 = n, 0 = 4n - b - 83 - 5 for n. 21 Solve 4f + 97 = 85s - 88s, -f = 2s + 68 for f. 2 Solve y + 9n = 7n - 24, -y = 4n + 48 for y. 0 Solve -2279k + 2 = -2286k - 2y, -3 = 3k + y for k. 4 Solve g - 43 = -2c, 292255 = -4g + 292251 for c. 22 Solve -2f = -d - 33, -5f + 30d - 4d = 18d - 55 for f. 19 Solve 4c = -2v + 104, -891v - 175 = -895v + 2c + c for v. 46 Solve -2d = -5v + 1, -13d - 230v = -234v - 79 for d. 7 Solve 24q + 277 = 4n + 1617, q - 4n = -q - 0q + 130 for q. 55 Solve 3n - 6a + 42 = 0, 169971n + 3a - 16 = 169975n for n. 2 Solve -3a = -3c + 254851 - 254683, 296 = -5a - 3c for a. -58 Solve 430 + 81 = 108t - x, -6t + 6t + 145 = 5x for t. 5 Solve 4w - 18470 = 246n, 3w - 879 + 939 = -n for w. 5 Solve 4l - 3s - 28 = 0, -825l = -828l - 6s - 78 for l. -2 Solve 4r = -6q + 16, 2q - 2r + 9873 - 9865 = 0 for q. 0 Solve -7t + 2b = 109, -156t - b - 13 = -315t + 160t for t. -15 Solve s + 2k = 7k + 7, -50s + 2k = -8s + 122 for s. -3 Solve 2n - 5o - 19 = 0, -486n - 30 = -471n - 0o + 2o - 5o for n. -3 Solve -28967n - 2t = -28959n - 54, -n + 2t - 27 = 0 for n. 3 Solve 127 = -4r + c, -3r + 2367c - 2372c = 42 + 45 + 14 for r. -32 Solve -2w - 4o = -34, -897o + 9 = -900o for w. 23 Solve 2p - 4s - 134 = 0, 0 = 151p + 5s + 8994 - 8366 for p. -3 Solve -15q - 6 + 58 = 3a - 13q, -3q = -183a + 2922 for a. 16 Solve 12d = -48m + 44m - 284, -9d - 3m - 188 = -5d for d. -5 Solve -4k - 4o - 32 = 0, k - 12634o - 12 = -12631o for k. -3 Solve 0 = 11x - 103h + 98h + 21, 6h - 6 - 6 = 0 for x. -1 Solve -j + 105 = 3j + 43o + 276, -32 = -2j + 2o for j. 11 Solve -16v - 3q = -20v - 23, -164 + 128 = -4q for v. 1 Solve 0 = 9c + s - 74, 9c + s - 4s + 13s - 76 = 8s for c. 8 Solve -17p + 17 = -22p - 4f + 5, -8p + 2f = -11p - f - 9 for p. 0 Solve -240k + 234k + 16 = -5a, -a = -k + 3 for a. -2 Solve 68d - 735 = 2b - 653, 164 = -4b - d for b. -41 Solve -134 = 60i - 4h + 66, -4i - 2h - 2 = 0 for i. -3 Solve -180u + 0 + 6 = -355u + 171u - 5d, -u - 14d - 27 = 0 for u. 1 Solve 6087579c = f + 6087581c - 17, 0 = -f - 5c + 38 for f. 3 Solve 278w - 272w = -15k - 258, 2k = 4w - 8 - 12 for w. -3 Solve -3m = -55b - 232, 7m + 0m = 4b + 6m + 6m - 4 for b. -4 Solve 4i + 7q = 173, 17930i - 15 = 17928i + 4q - 131 for i. -4 Solve 0 = -6j + 4l - 8, -5111l + 5108l = -9j + 12 for j. 4 Solve -76 = 4z - 358j + 343j, 0 = 4z - 2j + 24 for z. -4 Solve -9x + 12x + 5o - 7o + 19 = -24 + 49, -x = -4x + 3o for x. 6 Solve 95u - 157u - 3z - 111 = -57u, -u + 3z + 111 = 0 for u. 0 Solve 0 = 16v + 14g + 19g - 14g + 76, 5g = 3 - 23 for v. 0 Solve -200 = -5f, 0f - 1015365 = 2b + 3f + f - 1015533 for b. 4 Solve 20 = 3i - 0g - 7g + 81, -2 = -i + 3g - 27 for i. -4 Solve o = 5v + 15, 0 = 3198v - 3198v - 2o + 40 for v. 1 Solve 147 - 227 + 110 = -3v - 3f, 6v = v - f - 38 for v. -7 Solve 4u = -3n + 8, u - 15n = -4n - 17n + 44 for u. -4 Solve -12 = o + 3o + 2c, -153o - 47o - 7c = -2c - 160 for o. 1 Solve 2g + 3 = -9o - 3, -174g - 4o - 61 = 179g - 356g for g. 15 Solve -337g + 323g + 4h + h = -336, 0g + 0g = 2h for g. 24 Solve w - 2u = -23, 10u - 290 + 181 = 3w for w. -3 Solve 4s + 8 = -49m, 34s - 16s - 13s - m + 12 = 2 for s. -2 Solve -4t + 2c = 18t - 814 + 1604, -16t + 2c - 574 = 0 for t. -36 Solve t + 9a + 6402 = 4a + 6432, -5a - 30 = -5t for t. 10 Solve -67w + 42 + 8 = 60w - 184w + 67w, -w - 1 = 4m - 26 for m. 5 Solve -2f + 11 = -9l, -2f - 1 = 16089l - 16094l for l. -3 Solve 5g + 2w + 88 = 110, 2g + 2g - 75w = g - 444 for g. 2 Solve 5r + 36 = -3u - 2, 4r - 99 = -18u - 457 for r. 5 Solve -18 = 5c - 13y - 60 - 14, 6c - 26 = -5y for c. 6 Solve -9z + 5n + 91 = 0, -2117115n + 2117119n = -3z - 83 for z. -1 Solve 10f = 13f + 5a - 17, 7f - 2a + 6 = 2f + 6f for f. 4 Solve 14d + 81 = 17d - 2w + 54, -4w - 14 = 2d for d. 5 Solve -5m + 4a = -11, 3m - 5a - 92 = -2a - 86 for m. 3 Solve 0 = -3w - 3b + 78, 3b + 14613 - 14691 = 0 for w. 0 Solve -4r - 1111j + 1117j = -18, -1 = j for r. 3 Solve 4a + k = -41, -1828k + 1826k - 31 = 2a + 3 - 6 for a. -9 Solve 0 = i + 3i - 2g - 8, -967g = -2i - 963g + 22 for i. -1 Solve 0 = 4z + 3g + 224 - 189, -130 = -2z + 28g for z. -5 Solve s + t - 11 = -4s + 11, -2162411t + 2162408t = -21 for s. 3 Solve 0 = -10g - 5b + 265, -3b = 5g - 8b + 882 - 692 for g. 5 Solve -118232 = -2v + 5y - 118288, 0 = -3v + 2y - 84 for v. -28 Solve -96m + 3w + 6216 = -19m + 16m, -3m + 166 = -7w for m. 67 Solve 4s = 18x + 66, -s + 101534x - 101536x - 16 = 0 for s. -6 Solve 2k + r = -3r + 18, -76833k + 2r = -76828k - 9 for k. 3 Solve 6 = 19512n - 19511n - 4w, 0 = -n - 3w - 15 for n. -6 Solve 3c - 55 = -2c - 5i, 346 - 335 = -8c + i for c. 0 Solve 0 = -3o + r + 71, -12o + 2r - 369 + 649 = 0 for o. 23 Solve 4x + 25077w - 12535w - 12541w - 186 = 0, w = -5x + 232 for x. 46 Solve -5z - 80 = 397b - 402b, 2b + 52 = -2z for z. -21 Solve 5j + 15 = -i - 9 - 5 + 8, j + 8i = -246 for j. 2 Solve 3l - 49 = -q, 48 = q + 11l - 129 for q. 1 Solve -4y - 102 = 7n, -4n + 6y = 10y + 75 + 33 for n. 2 Solve 2n + 4m + 3 = 1, n - 4m + 100 = 49 + 56 for n. 1 Solve -2h - 89 = -5j, 231 = -5j + 8h + 302 for j. 19 Solve -16s + 110 = 5i + 6, 5i + 36s - 41s - 20 = 0 for i. 8 Solve -4x = -37m + 73m - 40m + 6 - 2, x + 2x - 125m = 119 for x. -2 Solve -a + 0a - 453v + 67 = -457v, 2a = 4v + 62 for a. -5 Solve 0 = -3w - 11669r + 11671r - 12, -r = 28w + 112 for w. -4 Solve -39a + 87a - 2 - 52 = -5x + 132, -4x + 258 = 2a for a. -3 Solve -9s + 5v - 163 = 0, -6s + 15s + 147 = -5v + 2v for s. -17 Solve t + 176c + 2654 = -3t + 4606, 5t - 10 = c - 1 for t. 4 Solve 397k - 393k + 186 + 134 = 4f, 4f = 7k + 557 for f. 1 Solve 0 = 4x - 9t - 77, -202530t + 202526t + 4 = -0x + 3x for x. 8 Solve 3r - 22x = -20x - 39, -11r - 48 = -x for r. -3 Solve 4k + 22r + 86 = 0, 40 - 126 = -11k + 4r for k. 6 Solve 0 = -2f - 5t + 35, 48f - 1605 = -5t - 880 for f. 15 Solve -2n - 262 = 5w - 309, w + 9 = -5n for w. 11 Solve 4k + 0r + 110 - 154 = -2r, -k + 5r + 3 = -19 for k. 12 Solve 34 = 4j + 2p, 9j + 3j + 41 = 17j + 3p for j. 10 Solve 0 = -3b + 2c + 5, 0b - 5b - 21 = -25b + c for b. 1 Solve 24042y = 6p + 24037y - 15, -p + y + 2 = 0 for p. 5 Solve 14s + 4s + 207 = h + 386, 5h - 105s + 1045 = 0 for h. 1 Solve 25948u - 24 = -3j + 25945u, -5u + 46 = 2j for j. -2 Solve 9a + 4h + 9 = 8a - 2a, a + 21h = -62 for a. 1 Solve -i = 15, -93j - 15 = -98j + i for j. 0 Solve 5c + 5f = -20, -4f + 17 = 152c - 156c - 23 for c. -7 Solve -350t + 2u = -348t + 24, -359t - 3u = 2860 for t. -8 Solve 3c - 22 = -9o + 44, 5c = 6o + 26 for c. 10 Solve 0 = 2q - 3z + 8, 3q + z + 4790396 - 4790395 = 0 for q. -1 Solve 3i - 5n = -49, -54i - 752 + 691 - 564 = 21i - 5n for i. -8 Solve -10*o	{ "pile_set_name": "DM Mathematics" }
and 111276. 33 What is the greatest common factor of 49 and 227577? 7 What is the greatest common divisor of 323 and 9979? 17 Calculate the highest common factor of 6300 and 1440. 180 What is the highest common divisor of 859 and 380537? 859 What is the highest common factor of 2000 and 2828000? 2000 What is the greatest common divisor of 60 and 158880? 60 Calculate the highest common factor of 18325 and 8063. 733 Calculate the greatest common factor of 2 and 182194. 2 What is the greatest common factor of 15252 and 153504? 492 Calculate the highest common factor of 2013488 and 1952. 976 What is the highest common factor of 19044 and 483? 69 What is the highest common divisor of 204 and 1568964? 204 What is the highest common factor of 451836 and 99? 99 Calculate the greatest common divisor of 22 and 24596. 22 What is the greatest common divisor of 65 and 6331? 13 Calculate the greatest common factor of 37674 and 3150. 126 Calculate the highest common divisor of 40782 and 84. 42 Calculate the highest common factor of 874 and 253. 23 Calculate the greatest common factor of 634176 and 192. 192 Calculate the greatest common divisor of 223317 and 8748. 243 Calculate the greatest common divisor of 1269099 and 13. 13 Calculate the highest common divisor of 5 and 565885. 5 Calculate the greatest common divisor of 47080 and 3520. 440 What is the greatest common factor of 650 and 395005? 65 What is the greatest common divisor of 459 and 969? 51 Calculate the highest common factor of 5299 and 364. 7 What is the highest common divisor of 42728 and 5880? 392 Calculate the highest common factor of 2017806 and 42. 42 Calculate the highest common factor of 80 and 10256. 16 What is the highest common divisor of 55545 and 210? 105 What is the greatest common divisor of 46019 and 187? 17 What is the highest common factor of 19370 and 570? 10 What is the greatest common factor of 38437 and 135337? 323 Calculate the highest common divisor of 11426 and 16351. 197 What is the highest common divisor of 306 and 279? 9 What is the greatest common divisor of 304322 and 59? 59 What is the highest common divisor of 560 and 235? 5 What is the highest common divisor of 191168 and 1160? 232 Calculate the highest common divisor of 124 and 49011. 31 What is the greatest common factor of 3 and 3543? 3 What is the highest common divisor of 32 and 1429072? 16 Calculate the highest common factor of 5 and 17143. 1 Calculate the greatest common factor of 3160 and 1147870. 790 Calculate the highest common divisor of 920 and 19872. 184 What is the greatest common divisor of 22 and 10563850? 22 What is the greatest common factor of 772257 and 705? 141 What is the highest common factor of 1362 and 5512468? 454 What is the highest common factor of 44429 and 5467? 77 What is the highest common divisor of 1417140 and 10? 10 Calculate the highest common divisor of 2 and 94835. 1 What is the highest common divisor of 12510 and 1800? 90 Calculate the highest common factor of 52630 and 20498. 554 What is the greatest common divisor of 81 and 19143? 27 Calculate the greatest common factor of 3612 and 36. 12 Calculate the greatest common divisor of 610 and 1173030. 610 What is the greatest common divisor of 36 and 596? 4 What is the greatest common factor of 243 and 69093? 81 Calculate the highest common factor of 105996 and 1387. 73 Calculate the highest common factor of 60 and 125340. 60 What is the highest common divisor of 39 and 15202707? 39 Calculate the highest common divisor of 3288 and 107408. 1096 Calculate the highest common divisor of 264 and 2984. 8 Calculate the highest common factor of 5643 and 759. 33 What is the highest common factor of 24 and 333936? 24 What is the greatest common divisor of 67171 and 1313? 13 Calculate the greatest common divisor of 2 and 84192. 2 Calculate the greatest common divisor of 6720 and 21. 21 What is the greatest common divisor of 32776 and 5288? 8 Calculate the highest common divisor of 5920828 and 68. 68 What is the greatest common divisor of 1134 and 111888? 378 Calculate the highest common factor of 68304 and 432. 48 Calculate the highest common divisor of 640 and 2362560. 320 Calculate the highest common factor of 438420 and 2. 2 Calculate the greatest common factor of 6 and 153126. 6 Calculate the highest common divisor of 37300 and 200. 100 What is the highest common factor of 25899 and 873? 291 Calculate the highest common divisor of 5315 and 155. 5 Calculate the greatest common divisor of 19765 and 48374. 67 What is the greatest common factor of 4254 and 6? 6 What is the highest common divisor of 5348994 and 798? 798 What is the highest common factor of 6475 and 39997? 37 Calculate the highest common factor of 27 and 41490. 9 Calculate the greatest common factor of 196 and 76391. 49 What is the greatest common factor of 25944 and 6016? 376 Calculate the greatest common divisor of 11944 and 136. 8 What is the greatest common divisor of 122590 and 520? 130 What is the greatest common divisor of 26 and 1302717? 13 Calculate the highest common divisor of 450 and 211250. 50 What is the highest common divisor of 2133370 and 10? 10 Calculate the greatest common factor of 221483 and 304. 19 What is the greatest common factor of 5328 and 14976? 144 What is the highest common factor of 1024462 and 892? 446 Calculate the greatest common divisor of 8 and 309480. 8 Calculate the greatest common factor of 628638 and 6. 6 Calculate the greatest common divisor of 211172 and 1426. 62 Calculate the greatest common divisor of 322590 and 5. 5 Calculate the highest common factor of 882 and 73962. 126 What is the greatest common factor of 5353 and 1961? 53 Calculate the greatest common factor of 88 and 2931742. 22 What is the highest common divisor of 3690 and 8241? 123 Calculate the highest common divisor of 16050 and 48. 6 What is the highest common factor of 395940 and 60? 60 Calculate the greatest common factor of 2412 and 203948. 268 Calculate the greatest common divisor of 1616065 and 220. 55 Calculate the greatest common divisor of 11 and 2041061. 11 Calculate the highest common divisor of 80 and 18160. 80 What is the greatest common divisor of 857 and 1690861? 857 What is the highest common divisor of 80 and 6928? 16 Calculate the greatest common divisor of 11663 and 66875. 107 Calculate the highest common divisor of 113040 and 75. 15 What is the highest common divisor of 1008 and 21483? 63 Calculate the greatest common divisor of 15 and 13074. 3 Calculate the highest common factor of 5745674 and 44. 22 What is the greatest common factor of 17405 and 25665? 295 Calculate the greatest common divisor of 6 and 3060042. 6 Calculate the highest common factor of 36738 and 3042. 234 What is the highest common factor of 8 and 176108? 4 Calculate the greatest common divisor of 326258 and 4. 2 What is the greatest common factor of 710 and 778870? 710 What is the highest common factor of 435 and 809274? 87 Calculate the highest common divisor of 660 and 4800. 60 Calculate the greatest common divisor of 70775 and 950. 475 Calculate the greatest common factor of 265367 and 4997. 263 What is the greatest common divisor of 1274 and 22834? 98 Calculate the highest common factor of 99 and 2853. 9 What is the highest common divisor of 37305 and 180? 45 Calculate the highest common factor of 7220 and 160. 20 Calculate the greatest common factor of 453392 and 48. 16 What is the highest common factor of 10744 and 5304? 136 What is the greatest common divisor of 229376 and 812? 28 What is the highest common factor of 4508387 and 482? 241 What is the highest common divisor of 28049 and 56? 7 Calculate the highest common divisor of 5325 and 480. 15 Calculate the greatest common factor of 21060 and 22680. 1620 Calculate the greatest common divisor of 29072 and 207. 23 What is the highest common divisor of 780 and 14115? 15 What is the highest common factor of 200 and 92? 4 Calculate the greatest common factor of 22 and 48862. 22 Calculate the highest common divisor of 2700 and 5238. 54 What is the greatest common factor of 306 and 4964238? 306 What is the greatest common divisor of 29928 and 2666? 86 What is the greatest common factor of 24862 and 157994? 802 Calculate the	{ "pile_set_name": "DM Mathematics" }
. -2, c, o Let n = 22 + -21.9. Sort n, 7/3, -2 in increasing order. -2, n, 7/3 Let w = -4 + 9. Let q = 5 - 8. Suppose -h + 24 - 20 = 0. Put h, w, q in ascending order. q, h, w Let a be (3-7)/(7 - 6). Let m = a + 65/3. Put m, 0, -6 in descending order. m, 0, -6 Let x(m) = m + 2. Let v(a) = a3 - 6a*2 - a + 6. Let z be v(6). Let k be x(z). Let p = 2.7 - 2.9. Sort p, -0.1, k in decreasing order. k, -0.1, p Let c(y) = 1. Let h(a) = -a - 2. Let n(s) = -3c(s) - 4h(s). Let p be n(-2). Sort 5, p, 2 in descending order. 5, 2, p Let g be (6/4)/(6/8). Suppose 0 = -5w + 2j + 12, 0 = 3w - gw - 2j + 4. Suppose -wf = f. Sort 4, -4, f in increasing order. -4, f, 4 Suppose -2 - 2 = 4r. Let y be 6r2/(-4). Let d be (-2)/8 + 0 + 6/24. Put y, d, -4 in descending order. y, d, -4 Let a = 25.9 - 26. Put -1, a, -2/3 in increasing order. -1, -2/3, a Let p = -7 + 11. Let d = 8 - p. Suppose 0 = -db + 4m + 4, b + 3b + 3 = -3m. Put 5, b, 2 in increasing order. b, 2, 5 Let u = 201 + -202. Let m be (-2)/(-4)(0 + -6). Sort 4, m, u. m, u, 4 Let f be ((-16)/(-6))/(2 + 8/(-6)). Let w(z) = 2z + 4. Let a be 0/(-2) - (-1 - -5). Let o be w(a). Sort -2, o, f in decreasing order. f, -2, o Let v(z) = -3z + 19. Let r be v(8). Let f = -12 + 9. Put f, -4, r in descending order. f, -4, r Let n = 2.4 + 2.1. Let m = n - -0.5. Put m, 0, 3 in increasing order. 0, 3, m Let b = 16 + -11. Sort b, 0, 2 in descending order. b, 2, 0 Suppose -o - 4 = 1. Let u(j) = j3 + 6j*2 + 7j + 7. Let p be u(o). Let k = -162 + 813/5. Put k, p, -1 in ascending order. p, -1, k Let z(p) = p*3 + 2p*2 - p + 4. Suppose b + 6 + 10 = -4o, -4o - 28 = 4b. Let g be z(o). Put -4, g, -5 in increasing order. -5, -4, g Suppose 5s + 2p - 6p = 2, -4s = 2p - 12. Suppose -sr + 29 = -5g + 13, 0 = -3r - 4g + 24. Let h be 18/r - (4 - 2). Sort -1/5, -4, h. -4, -1/5, h Suppose -10m + 4m + 12 = 0. Put m, -5, -4, 1 in descending order. m, 1, -4, -5 Let q(c) = 4 + c - 6 + 8. Let w be q(-10). Let p = 9 - 6. Sort w, p, 2 in increasing order. w, 2, p Let y be 1 + (-2 - -4) - 2. Sort -1, 4, y in ascending order. -1, y, 4 Let t = -4/9 - -53/18. Sort 2/9, 1, t in decreasing order. t, 1, 2/9 Let c = -41 + 44. Suppose -2b - 2 = -3i + 2i, -i + 5b = -11. Let x be (-6 + 2)2/i. Sort -5, x, c in decreasing order. c, x, -5 Suppose 0 = 5y + 3b + 34, -1 - 7 = 4y - 4b. Let f = 17 - 18. Sort -2, f, y in decreasing order. f, -2, y Let k = 6 - 3. Let l(p) = p + 8. Let o be l(-6). Suppose -2r = a + o, r + 4 = 4a - 3r. Put k, a, -4 in descending order. k, a, -4 Let h = -1 - -3. Let m(f) = -2f*2 - 30f - 31. Let k be m(-14). Sort 0, h, k in ascending order. k, 0, h Let p be ((-2 - -4)1)/((-2)/(-4)). Let t(u) be the first derivative of u2/2 - 5u + 1. Let d be t(5). Put d, -2, p in descending order. p, d, -2 Let d = -62.1 + 62. Sort d, -1, -0.5 in descending order. d, -0.5, -1 Let k be 2/6 - 17/15. Let i = 111 - 110.6. Sort -0.4, k, i in descending order. i, -0.4, k Let p = -7.92 - -8. Let w = 0.92 + p. Sort w, 1/4, -1/3 in decreasing order. w, 1/4, -1/3 Let a = -26 + 209/8. Let b = 0.11 - -4.89. Put a, 0, b in descending order. b, a, 0 Suppose 0 = 4l + 21 - 93. Suppose -l = -t - 2t. Suppose 0 - t = -2m. Sort 4, -3, m in decreasing order. 4, m, -3 Suppose 3w + 3 - 15 = 0. Sort 5, 1, w in ascending order. 1, w, 5 Let w = 1/4 + 3/20. Put -3, -2, w in ascending order. -3, -2, w Let n(z) = -z. Let s be n(4). Suppose 0o + 1 = -o. Put s, 1, o in descending order. 1, o, s Suppose 4o - 30 = -2n, -2o - 15 = -9n + 4n. Sort 0, o, 10 in decreasing order. 10, o, 0 Let b = -0.04 - 0.06. Let v = 2.1 + b. Let i be 13/6 - 2/1. Put v, -3, i in decreasing order. v, i, -3 Let o = -8 - -6. Suppose -4v = 3s + 3 - 2, -s - 7 = -2v. Put v, o, -4 in increasing order. -4, o, v Let s = -38/15 + -1501/15. Suppose -2g = 202 + 2. Let b = g - s. Sort 0.5, b, -3/4 in descending order. b, 0.5, -3/4 Let x = 2 + 1. Let o = -9 + x. Let f = -1 - o. Sort -0.4, 0.2, f in ascending order. -0.4, 0.2, f Let k be (-91)/(-14) + (-3)/(-6). Put 4, 5, k in increasing order. 4, 5, k Suppose 5h - h - 4 = 0. Put -5, 0, h in increasing order. -5, 0, h Let q = -5.11 - -0.11. Let x = 0.025 - 2.125. Let l = -0.1 - x. Put l, q, -3 in decreasing order. l, -3, q Suppose 2u - 9 = v, -2u + 5 = -3v - 2. Put v, -2, -3 in descending order. v, -2, -3 Let v = 7/4 + -13/12. Let z = 2/261 + -791/1044. Sort v, z, -2 in decreasing order. v, z, -2 Let n = 0.19 - 0.55. Let l = 0.04 - n. Let v = 0.1 - -0.1. Put 3, v, l in ascending order. v, l, 3 Let g(b) = b*3 - 5b*2 + 4b - 4. Let k(h) = -h*3 + 2h*2 + 4h + 1. Let a be k(3). Let s be g(a). Sort 3, s, -3 in ascending order. s, -3, 3 Let q(r) = 2r2 - 5r - 4. Let c be q(4). Let h = c - 4. Suppose -2a + m + 13 = 0, ha - 2a + 5m + 5 = 0. Sort -1, a, 3 in increasing order. -1, 3, a Let c(s) = -s*2 + 9s - 17. Let z be c(6). Sort z, -5, -1 in decreasing order. z, -1, -5 Let y(x) = 4x3 + 2x*2 - 5x*3 + x + 0x. Suppose 0 = 4l - 2 + 6. Let g be y(l). Sort 3, -5, g. -5, g, 3 Let r be 171/(-12) + (6/8)/(-1). Sort 5, -2, r, 2 in increasing order. r, -2, 2, 5 Let y = -76.7 + 73. Let v = -0.4 - 3.6. Let u = v - y. Sort u, -1, 5/6 in decreasing order. 5/6, u, -1 Let n be 4/(-18) - (-2)/9. Suppose n = 4y - 2 + 22. Suppose -39r + 34r - 20 = 0. Sort y, 5, r in ascending order. y, r, 5 Let p be (128/20)/(1/5). Let w be -1 - 4/(p/(-11)). Sort -0.3, -2, w. -2, -0.3, w Let n(y) = y3 - y2 - 3y + 2. Let q be n(2). Suppose 2k = -qk. Suppose -v + k = 4. Put -3, v, 4 in descending order. 4, -3, v Let w = -155/3 + 49. Let v = 35/12 + w. Let h = -1 - -1. Put v, 0.5, h in decreasing order. 0.5, v, h Suppose 0 = 5w + 2p + 4, 5w = 2w - p - 3. Suppose -2r - 5k = -41, 2r + 2k - 88 + 32 = 0. Let u = r - 29. Sort 5, u, w in ascending order. w, u, 5 Let m = 35 - 25. Let u(g) = -g + 14. Let r be u(m). Let v(y) = y3 - 6y*2 + y - 5. Let q be v(6). Sort r, q, -5 in decreasing order. r, q, -5 Let h be (-1 - -4) + 16078/(-5360). Let d = h - 151/670. Let q = d + -3/8. Sort -5, 0.1, q. -5, q, 0.1 Suppose -4p = -2y - 0 - 8, 0 = -3p. Let s = 0.08 - 1.08. Let k be 11/10 + (-15)/25. Put y, k, s in increasing order. y, s, k Let v = -35/11 - -3. Put -4, v, -3 in decreasing order. v, -3, -4 Suppose 1 - 5 = o. Suppose 0 = 3t - 3 - 12. Let q = -4 + 8. Sort o, q, t in ascending order. o, q, t Let v = 0.7 + 3.3. Put -2/15, 0.2, v in decreasing order. v, 0.2, -2/15 Let l be -2 - (-9 + (2 - 0)). Suppose -30 = -lr - 10. Put -1, -6, r in decreasing order. r, -1, -6 Suppose 5r - 4h - 26 = 0, -4h + 23 = 3r + h. Let a = r - 3. Suppose 0 = -3x - 6 - a. Sort x, 0, 1 in decreasing order. 1, 0, x Suppose 0 = 2o - 5o + 6. Let p be o/(-6) - 1/(-3). Suppose 5d = 5a - 10, d = 4a - 6 - 2. Put p, 3, a in increasing order. p, a, 3 Suppose p = -2p - 9. Let g be p(3 + (-14)/(-48)). Let b = 41/4 + g. Put b, 0.5, 0 in ascending order. 0, b, 0.5 Let x = 1 - -9. Suppose 2p + 2g - 7 - 9 = 0, 5g - x = p. Let j = -14 + 9. Put p, 2, j in decreasing order. p, 2, j Let o be (-2 + 1)/(0 + 1). Let y be ((-9)/(-18))/(o/(-4)). Let l = 1 - 1. Sort l, 4, y in decreasing order. 4, y, l Let x = 4 - -3. Suppose 4z = xz + 12. Let o = -9 - -9.2. Sort o, z, -0.2 in ascending order. z, -0.2, o Suppose 34 = 5a - 1. Let b = a + -2. Sort -4, 1, b in descending order. b, 1, -4 Let c = -25 - -24. Sort 3, 5, -5, c in increasing order. -5, c, 3, 5 Let b be (-1)/(-2 - (-27)/15). Let w = -3 + b. Let g be (1(-3 - -2))/(-1). Put g, 5, w in increasing order. g, w, 5 Let w be (-9)/15(-2 - (-16)/6). Put 0.4, -2/11, w, 3 in descending order. 3, 0.4, -2/11, w Let i = -6 - -6. Let m = i + -1. Sort 0.3, m, 4. m, 0.3, 4 Suppose 0 = -g - 2g + 3t - 12, 0 = -g - 3t - 8. Sort g, 2/5, 3, 6/7 in decreasing order. 3, 6/7, 2/5, g Suppose -y + 14 = 3u, 3u + 5y = 2u - 14. Let a = -10 + u. Let p = -4 + 7. Sort p, -2, a in descending order. p, -2, a Suppose 5p = -6n + 2n - 1, -4n + p + 5 = 0. Let g be 4/(-2) + n - 0. Suppose 5i = -2d + 1, 4i - 26 = -3*d - 21. Sort g, d, 2 in decreasing order. d, 2, g Let p = -11 - -6. Let d = p - -11. Let k = 6 - d. Put 0.4, k, 4 in descending order. 4, 0.4, k Let m be 8 + -9 + (-3)/(-5). Put -0.3, m, -4/7 in dec	{ "pile_set_name": "DM Mathematics" }
of 13515? False Is 23 a factor of 506? True Does 106 divide 1953? False Is 13090 a multiple of 69? False Does 14 divide 26869? False Does 326 divide 31804? False Does 16 divide 22949? False Is 37532 a multiple of 11? True Is 652 a multiple of 163? True Does 9 divide 125? False Does 18 divide 9954? True Is 29487 a multiple of 176? False Is 482 a multiple of 241? True Is 47 a factor of 2866? False Is 45 a multiple of 15? True Does 5 divide 1565? True Is 39 a factor of 234? True Is 759 a multiple of 11? True Does 43 divide 517? False Is 8 a factor of 21696? True Does 24 divide 78266? False Is 6 a factor of 600? True Is 54 a factor of 60765? False Does 9 divide 855? True Is 520 a multiple of 40? True Is 9 a factor of 7906? False Is 20 a factor of 1840? True Is 338 a factor of 37655? False Is 53 a factor of 6678? True Does 11 divide 5806? False Is 72 a multiple of 3? True Does 208 divide 8320? True Is 134 a factor of 13066? False Does 24 divide 524? False Does 13 divide 1300? True Does 48 divide 8109? False Is 236 a multiple of 2? True Is 20247 a multiple of 27? False Does 17 divide 27285? True Is 8 a factor of 408? True Is 28 a factor of 1428? True Does 12 divide 1149? False Is 8 a factor of 3005? False Is 25 a factor of 696? False Does 7 divide 280? True Does 25 divide 266? False Is 333 a multiple of 9? True Does 78 divide 384? False Is 1159 a multiple of 70? False Is 4 a factor of 11737? False Is 2116 a multiple of 23? True Does 7 divide 3555? False Is 609 a multiple of 22? False Is 12 a factor of 97? False Is 534 a multiple of 75? False Is 138 a multiple of 14? False Is 27 a factor of 1701? True Is 5786 a multiple of 7? False Is 43 a factor of 2021? True Is 8 a factor of 64715? False Is 88 a factor of 4625? False Does 12 divide 1197? False Does 17 divide 1615? True Does 21 divide 19294? False Does 73 divide 1660? False Is 13583 a multiple of 24? False Does 48 divide 912? True Is 12 a factor of 1104? True Is 25 a factor of 1650? True Is 3 a factor of 2940? True Is 105400 a multiple of 155? True Is 13 a factor of 227? False Is 9231 a multiple of 17? True Does 39 divide 455? False Is 44862 a multiple of 9? False Is 68 a factor of 4964? True Is 1749 a multiple of 11? True Is 23 a factor of 15071? False Is 660 a multiple of 15? True Is 4 a factor of 1191? False Does 2 divide 295? False Is 12 a factor of 5220? True Is 61 a factor of 2745? True Is 25 a factor of 10396? False Is 351 a multiple of 19? False Is 55 a factor of 6957? False Is 31 a multiple of 2? False Is 25 a factor of 133123? False Does 303 divide 909? True Is 13 a factor of 16867? False Is 28 a factor of 833? False Is 15 a factor of 99120? True Is 145 a multiple of 12? False Does 49 divide 147? True Does 22 divide 1826? True Is 82 a multiple of 2? True Is 3 a factor of 38384? False Is 12 a factor of 1276? False Does 15 divide 3120? True Does 12 divide 2866? False Is 101750 a multiple of 25? True Does 28 divide 46234? False Is 10 a factor of 16783? False Is 22163 a multiple of 37? True Does 25 divide 643? False Is 5 a factor of 291? False Is 342 a multiple of 18? True Is 44 a factor of 220? True Is 10 a factor of 22503? False Does 143 divide 20735? True Is 106 a factor of 14100? False Is 10 a factor of 5770? True Is 3145 a multiple of 37? True Is 2207 a multiple of 4? False Is 16 a factor of 4544? True Is 33961 a multiple of 24? False Does 11 divide 1449? False Is 4 a factor of 187? False Is 2075 a multiple of 5? True Is 4788 a multiple of 14? True Is 23 a factor of 230? True Does 9 divide 1455? False Is 227 a factor of 29633? False Does 139 divide 11676? True Does 4 divide 635? False Is 33 a factor of 10791? True Does 16 divide 3367? False Is 46701 a multiple of 86? False Is 7 a factor of 128? False Is 26 a factor of 52? True Is 3202 a multiple of 108? False Does 46 divide 2688? False Is 2458 a multiple of 31? False Is 41 a factor of 21066? False Is 983 a multiple of 19? False Is 68 a factor of 204? True Is 27 a factor of 4266? True Is 34 a factor of 306? True Is 717 a multiple of 17? False Is 11 a factor of 1338? False Does 47 divide 3384? True Is 83 a factor of 7138? True Does 27 divide 5535? True Is 68 a factor of 1457? False Does 17 divide 2380? True Is 256 a multiple of 4? True Does 17 divide 340? True Does 170 divide 60520? True Does 21 divide 1176? True Is 170 a factor of 14301? False Is 15 a factor of 64290? True Does 86 divide 95976? True Is 4 a factor of 299? False Is 13 a factor of 3337? False Is 1094 a multiple of 9? False Is 39 a factor of 897? True Is 16 a factor of 5640? False Is 1617 a multiple of 11? True Is 12 a factor of 792? True Does 106 divide 3286? True Is 10 a factor of 60? True Does 209 divide 33440? True Is 81 a multiple of 9? True Does 85 divide 978? False Is 1763 a multiple of 43? True Does 7 divide 27? False Does 17 divide 19417? False Is 1010 a multiple of 5? True Is 18 a factor of 1659? False Is 76 a factor of 380? True Does 27 divide 275? False Is 23 a factor of 2001? True Is 11 a factor of 231? True Does 21 divide 977? False Does 56 divide 1120? True Is 12 a factor of 143? False Does 63 divide 24885? True Is 5346 a multiple of 36? False Is 3346 a multiple of 21? False Is 37 a factor of 481? True Is 56 a factor of 5432? True Is 13 a factor of 26? True Is 92 a factor of 1399? False Does 34 divide 24819? False Is 51 a factor of 26767? False Is 2 a factor of 5767? False Is 11 a factor of 363? True Is 4 a factor of 285? False Does 12 divide 5256? True Is 64 even? True Is 4712 a multiple of 6? False Is 5 a factor of 80? True Is 17 a factor of 2244? True Is 21 a factor of 357? True Does 16 divide 1376? True Does 8 divide 82? False Does 52 divide 941? False Is 21 a factor of 42? True Is 22 a factor of 660? True Is 24 a factor of 1712? False Is 9 a factor of 6363? True Does 5 divide 258? False Does 20 divide 587? False Is 23 a factor of 184? True Does 5 divide 429? False Is 105485 a multiple of 25? False Is 4789 a multiple of 84? False Does 4 divide 2572? True Is 607 a multiple of 14? False Is 33 a factor of 4521? True Is 3 a factor of 1317? True Is 22 a factor of 1506? False Is 37 a factor of 441? False Does 33 divide 5503? False Is 12 a factor of 90209? False Is 7 a factor of 1341? False Is 7 a multiple of 4? False Is 51987 a multiple of 93? True Is 10 a factor of 590? True Is 1119 a multiple of 51? False Is 7 a factor of 805? True Is 3 a factor of 141? True Is 58 a factor of 13688? True Is 65 a factor of 4307? False Is 35 a factor of 630? True Does 26 divide 3432? True Is 36 a factor of 8964? True Is 11 a factor of 1310? False Does 5 divide 1156? False Is 2589 a multiple of 54? False Is 18 a factor of 2718? True Is 1359 a multiple of 27? False Is 8 a factor of 8969? False Is 15 a factor of 4110? True Does 26 divide 1482? True Does 20 divide 33820? True Does 14 divide 3514? True Does 19 divide 27151? True Is 18 a factor of 1620? True Does 9 divide 1278? True Is 74764 a multiple of 33? False Is 42 a factor of 462? True Does 21 divide 30880? False Is 40568 a multiple of 8? True Does 58 divide 1044? True Is 1066 a multiple of 11? False Is 119647 a multiple of 286? False Does 8 divide 427? False Is 13 a factor of 173? False Is 225 a multiple of 15? True Is 21863 a multiple of 30? False Does 27 divide 2386? False Does 43 divide 1946? False Is 30 a factor of 3852? False Is 4 a factor of 75? False Is 20 a factor of 11712? False Is 37 a factor of 1761? False Is 14 a factor of 14406? True Does 20 divide 240? True Is 18285 a multiple of 12? False Is 1914 a multiple of 33? True Does 26 divide 260? True Does 34 divide 2773? False Is 18 a factor of 159? False Is 10 a factor of 3221? False Does 11 divide 9164? False Is 7 a factor of 16467? False Does 22 divide 2618? True Is 20 a factor of 1856? False Is 22 a factor of 506? True Is 8 a factor of 2842? False Is 630 a multiple of 15? True Is 28 a factor of 8565? False Is 174 a factor of 12876? True Is 48 a factor of 129? False Is 8 a factor of 1624? True Is 5 a factor of 20530? True Is 3 a factor of 1888? False Does 5 divide 97? False Is 14 a factor of 2002? True Is 540 a multiple of 90? True Is 9 a factor of 927? True Is 55 a factor of 28068? False Is 4 a factor of 30000? True Does 39 divide 1209? True Does 42 divide 10228	{ "pile_set_name": "DM Mathematics" }
1. 355 What is the remainder when 136525 is divided by 14? 11 What is the remainder when 496088 is divided by 266? 264 What is the remainder when 1414 is divided by 559? 296 Calculate the remainder when 79290 is divided by 73. 12 Calculate the remainder when 135034 is divided by 67512. 10 Calculate the remainder when 30619 is divided by 26. 17 Calculate the remainder when 14018 is divided by 136. 10 What is the remainder when 49137 is divided by 6141? 9 What is the remainder when 38192 is divided by 45? 32 What is the remainder when 216813 is divided by 515? 513 Calculate the remainder when 794 is divided by 504. 290 What is the remainder when 19696 is divided by 19693? 3 Calculate the remainder when 132154 is divided by 66045. 64 Calculate the remainder when 28330 is divided by 18. 16 Calculate the remainder when 20131 is divided by 40. 11 Calculate the remainder when 11918 is divided by 11820. 98 What is the remainder when 2921 is divided by 84? 65 What is the remainder when 6634 is divided by 8? 2 What is the remainder when 1808 is divided by 326? 178 Calculate the remainder when 6732 is divided by 173. 158 What is the remainder when 665 is divided by 167? 164 Calculate the remainder when 200637 is divided by 380. 377 Calculate the remainder when 10172 is divided by 3070. 962 Calculate the remainder when 259991 is divided by 49. 46 What is the remainder when 1163369 is divided by 1153? 1145 What is the remainder when 1203637 is divided by 401189? 70 What is the remainder when 7001008 is divided by 15? 13 What is the remainder when 9696 is divided by 4847? 2 Calculate the remainder when 6454 is divided by 920. 14 Calculate the remainder when 1991 is divided by 184. 151 Calculate the remainder when 12868 is divided by 331. 290 What is the remainder when 3019 is divided by 272? 27 What is the remainder when 78230 is divided by 6? 2 Calculate the remainder when 296494 is divided by 99. 88 What is the remainder when 1149116 is divided by 35? 31 What is the remainder when 12272 is divided by 586? 552 Calculate the remainder when 29173 is divided by 29. 28 What is the remainder when 2539 is divided by 427? 404 Calculate the remainder when 6387 is divided by 402. 357 What is the remainder when 1897 is divided by 39? 25 What is the remainder when 23425 is divided by 234? 25 What is the remainder when 372284 is divided by 15? 14 What is the remainder when 4482 is divided by 153? 45 What is the remainder when 8303 is divided by 5841? 2462 Calculate the remainder when 256583 is divided by 7127. 11 Calculate the remainder when 5061 is divided by 5060. 1 Calculate the remainder when 10601 is divided by 15. 11 What is the remainder when 86966 is divided by 453? 443 Calculate the remainder when 3083 is divided by 398. 297 Calculate the remainder when 28685 is divided by 3187. 2 What is the remainder when 10500 is divided by 62? 22 What is the remainder when 4989 is divided by 327? 84 What is the remainder when 17315 is divided by 1193? 613 What is the remainder when 412 is divided by 331? 81 What is the remainder when 1068477 is divided by 480? 477 Calculate the remainder when 24671 is divided by 6167. 3 Calculate the remainder when 5039 is divided by 334. 29 Calculate the remainder when 6705 is divided by 6607. 98 What is the remainder when 4177 is divided by 4143? 34 What is the remainder when 74219 is divided by 651? 5 Calculate the remainder when 109527 is divided by 21. 12 What is the remainder when 76455 is divided by 7643? 25 Calculate the remainder when 293 is divided by 143. 7 Calculate the remainder when 8123 is divided by 902. 5 What is the remainder when 3258 is divided by 223? 136 Calculate the remainder when 9040 is divided by 2254. 24 Calculate the remainder when 3241 is divided by 17. 11 Calculate the remainder when 297502 is divided by 96. 94 What is the remainder when 11684 is divided by 298? 62 What is the remainder when 728 is divided by 314? 100 What is the remainder when 9469 is divided by 16? 13 What is the remainder when 76285 is divided by 5446? 41 Calculate the remainder when 26466 is divided by 205. 21 Calculate the remainder when 211277 is divided by 10. 7 What is the remainder when 8613 is divided by 2685? 558 What is the remainder when 14562 is divided by 175? 37 Calculate the remainder when 170265 is divided by 1669. 27 What is the remainder when 220655 is divided by 110327? 1 Calculate the remainder when 647 is divided by 222. 203 What is the remainder when 282962 is divided by 5? 2 Calculate the remainder when 4893 is divided by 200. 93 What is the remainder when 10920 is divided by 73? 43 Calculate the remainder when 5220 is divided by 649. 28 Calculate the remainder when 61956 is divided by 712. 12 What is the remainder when 439690 is divided by 66? 64 Calculate the remainder when 2905 is divided by 53. 43 What is the remainder when 238851 is divided by 363? 360 What is the remainder when 66508 is divided by 289? 38 What is the remainder when 48988 is divided by 2441? 168 What is the remainder when 8779 is divided by 1462? 7 Calculate the remainder when 2947 is divided by 8. 3 What is the remainder when 180513 is divided by 106? 101 What is the remainder when 2612 is divided by 1132? 348 Calculate the remainder when 6039 is divided by 63. 54 What is the remainder when 43481 is divided by 57? 47 Calculate the remainder when 1047 is divided by 22. 13 Calculate the remainder when 263250 is divided by 1867. 3 Calculate the remainder when 88202 is divided by 44096. 10 Calculate the remainder when 87678 is divided by 52. 6 What is the remainder when 621976 is divided by 753? 751 What is the remainder when 1781 is divided by 136? 13 What is the remainder when 48 is divided by 19? 10 What is the remainder when 5969 is divided by 2699? 571 What is the remainder when 1350269 is divided by 64? 61 What is the remainder when 6936 is divided by 20? 16 What is the remainder when 431663 is divided by 756? 743 What is the remainder when 41656 is divided by 186? 178 What is the remainder when 18047 is divided by 36? 11 What is the remainder when 2075211 is divided by 1843? 1836 What is the remainder when 39027 is divided by 572? 131 What is the remainder when 167898 is divided by 25? 23 What is the remainder when 677 is divided by 351? 326 What is the remainder when 36291 is divided by 1352? 1139 What is the remainder when 397 is divided by 208? 189 Calculate the remainder when 154334 is divided by 182. 180 Calculate the remainder when 2414 is divided by 791. 41 Calculate the remainder when 16827 is divided by 429. 96 Calculate the remainder when 5289 is divided by 2448. 393 Calculate the remainder when 42910 is divided by 5361. 22 What is the remainder when 1899741 is divided by 56? 53 What is the remainder when 1496 is divided by 167? 160 What is the remainder when 10244 is divided by 8678? 1566 What is the remainder when 805 is divided by 30? 25 Calculate the remainder when 90674 is divided by 167. 160 What is the remainder when 251899 is divided by 19? 16 What is the remainder when 69211 is divided by 34521? 169 What is the remainder when 432 is divided by 419? 13 What is the remainder when 415754 is divided by 5939? 24 Calculate the remainder when 22898 is divided by 378. 218 Calculate the remainder when 387238 is divided by 2049. 2026 What is the remainder when 2082929 is divided by 30? 29 What is the remainder when 21792 is divided by 69? 57 What is the remainder when 181201 is divided by 90585? 31 What is the remainder when 86305 is divided by 30? 25 What is the remainder when 114216 is divided by 714? 690 Calculate the remainder when 2955 is divided by 579. 60 What is the remainder when 32362 is divided by 416? 330 Calculate the remainder when 435985 is divided by 579. 577 What is the remainder when 18891 is divided by 35? 26 Calculate the remainder when 601 is divided by 43. 42 Calculate the remainder when 8544 is divided by 577. 466 Calculate the remainder when 1498599 is divided by 1016. 1015 What is the remainder when 925630 is divided by 32? 30 Calculate the remainder when 645 is divided by 128. 5 What is the remainder when 4161 is divided by 1339? 144 Calculate the remainder when 2739 is divided by 349. 296 What is the	{ "pile_set_name": "DM Mathematics" }
x*4 + 17x*p wrt x. 144x Let i be (-4 - 32/(-7))/(3/21). Let o(u) = -u*3 + 5u*2 - 5u + 6. Let q be o(i). What is the third derivative of 6j2 - 41j*6 + 6jq + j6 wrt j? -4800j3 Suppose j - 3w + 19 = 0, -7 = j + 4w - 3w. Let p be -3(j/(-3))/(-5). Differentiate 10 - 14l + 14l + 15l*p with respect to l. 30l Let a(c) be the third derivative of -1169c5/12 - 2907c*4/8 - 10c*2 + 3c + 79. What is the second derivative of a(l) wrt l? -11690 Differentiate -959h3 + 3141h*2 - 3141h*2 - 1282 with respect to h. -2877h2 Let t(h) = h3 - 5h2 + 3h + 11. Let x be t(4). Differentiate -14 + 2s - 3s - 3s2 - 41 - 80 - xs with respect to s. -6s - 8 Let f(u) = -8228u*2 + 143u - 3. Let o(p) = 12341p2 - 215p + 7. Let z(i) = 14f(i) + 9o(i). What is the second derivative of z(c) wrt c? -8246 Let l = 31 - -1. Suppose -11v - 43 = -12v. What is the third derivative of -vq5 - 22q*4 + lq*2 + 22q*4 wrt q? -2580q*2 Let u = 10 + 11. Suppose -4v + 3i + u = -0i, -4i - 26 = -5v. Find the second derivative of 20w2 - vw - 8w + 4w wrt w. 40 Let w(k) = -k*3 - 10. Let b(t) = -950t*3 - 309t + 130. Let m(p) = -2b(p) - 26w(p). Find the second derivative of m(h) wrt h. 11556h Let i(d) be the first derivative of -482d*6/3 - 2d*5/5 - 2561d*3/3 + 3166. Find the third derivative of i(f) wrt f. -57840f*2 - 48f Let x(b) be the third derivative of -937b6/30 + 1269b*5/20 + 9b*2 + 70b. Find the third derivative of x(l) wrt l. -22488 Suppose 4o = 3p + 6, -19 = 5p - 3o + 2. Let q be (5 + p + 3)/(1/1). What is the derivative of -28 + 5jq + 30 + 6j*2 wrt j? 22j Let m(i) = -3i2 - 5i - 5. Let k be m(-2). Let c be (-1 - 11/k)/(2/14). Find the first derivative of 10 - 36tc - 4116t*3 + 4116t*3 wrt t. -144t*3 Let w(o) be the third derivative of 0 + 79/30o*5 + 103/120o*6 - 166o*2 + 0o*4 + 0o + 0o3. Find the third derivative of w(y) wrt y. 618 Let h be (0 - (-102)/6) + -4. Find the third derivative of 4c*2 - 65c*5 - hc*5 - 34c*2 + 17c*5 wrt c. -3660c*2 Suppose 3 = 6q - 3. What is the derivative of 6 - 7 - w + 14 - 19w3 - q wrt w? -57w*2 - 1 Let w be 1/(8/(-6) + 1). Let c = -1 - w. What is the second derivative of -9y + 18y + 3y*c + 3y*2 wrt y? 12 Let c(b) = -2b*2 - 2b - 1. Let n(t) = 1656t2 + 541t + 1. Let a(o) = -2c(o) + n(o). What is the second derivative of a(v) wrt v? 3320 Let n be ((9/(-12))/(3/(-6)))/(90/120). Let s(r) be the second derivative of 0 - nr*2 - 5/3r*3 - 2r. What is the first derivative of s(g) wrt g? -10 Find the third derivative of -2407 + 8456293n3 + n2 - 8456275n3 + n2 + 41n5 wrt n. 2460n*2 + 108 Find the third derivative of 6044r*2 - 2956r*2 - 1225r*3 - 2786r*2 wrt r. -7350 Let n(h) = -912h*3 + 53h*2 + 24h. Let m(q) = -1826q3 + 104q*2 + 44q. Let b(r) = 6m(r) - 11n(r). Find the third derivative of b(a) wrt a. -5544 Let k(y) be the third derivative of 287y6/60 - 81y5/20 + y2 + 553. Find the third derivative of k(n) wrt n. 3444 Let j(w) be the third derivative of w*5/20 - 73w*4/6 - 268w*3 + 641w*2. Find the first derivative of j(b) wrt b. 6b - 292 What is the second derivative of -8489642b3 + 107b - 11b + 168b - 4 + 8485068b3 wrt b? -27444b Find the second derivative of -444l4 + 616l2 + l3 + 614l2 - 2l - 1189l4 - 1230l*2 - 246 wrt l. -19596l*2 + 6l Suppose -24t - 11t = -2065. Differentiate 51 + t - 25y + 3y*3 - 37 wrt y. 9y*2 - 25 What is the third derivative of 2985t*2 - 2t*4 - 4194t*2 + 82t*3 + 2t*4 + 4t*6 - 2t*6 wrt t? 240t3 + 492 Let g(a) = a2 - 12. Let k(r) = 2 + 0 + 2 - 3. Suppose 32m + 13 = -19. Let c(s) = mg(s) + 5k(s). What is the first derivative of c(q) wrt q? -2q Let u(c) be the second derivative of 5/14c7 + 3c - 2/3c3 + 8 + 3c*2 - 1/4c*5 + 0c*6 + 0c*4. What is the second derivative of u(n) wrt n? 300n*3 - 30n Let l(q) be the second derivative of -q*6/15 - 23q*5/30 + 3q*2/2 - 41q. Let d(t) be the first derivative of l(t). Find the third derivative of d(o) wrt o. -48 Find the second derivative of -3047s + 411s*2 + 750s*2 - 9s2 wrt s. 2304 Let c(t) be the second derivative of t8/56 + 445t7/21 - 23t*4/12 - 12t*2 - 953t. What is the third derivative of c(n) wrt n? 120n3 + 53400n*2 Let t = 350 - 345. What is the second derivative of 25r - 3r - 3r*5 - 2r*5 - 13r*t wrt r? -360r*3 Let l(u) = 8u*3 + 3u*2 + 4u + 2. Let s be l(-2). Let b = 63 + s. What is the second derivative of -14i - 3i - 60ib + 52i*5 - 5i wrt i? -160i3 Find the second derivative of -4137n + 1969n3 - 2970n + 5428n wrt n. 11814n Let k(x) = 3x2 - 1. Let w(b) = -179b*2 + b - 1044. Let z(h) = 3k(h) - w(h). Differentiate z(u) with respect to u. 376u - 1 Let w(g) be the first derivative of 2g*5/5 - 2699g4/4 + g2 + 10153g - 108. What is the first derivative of w(h) wrt h? 8h*3 - 8097h*2 + 2 Let f be (-6)/(4/((-48)/9)). Let t be f/12 + (-14)/(-6). Find the third derivative of -4s*t - 26s*4 + 4s*3 + 188s*2 - 192s*2 wrt s. -624s Let o = 20 - -150. Let u be o/14 - (-3)/(-21). Find the second derivative of -5d4 - 8d + 2d4 - 4 + ud - 5d2 - 8d wrt d. -36d2 - 10 Suppose 3b = 6, -101k + 99k + 16 = 3b. Find the second derivative of -2 - 5y - y + 80y5 - 5y*5 + 8y*k wrt y. 1660y*3 Suppose 0 = -10g + 38 + 2. Find the second derivative of 44vg - 94v*4 - 1 - 7v - 5v wrt v. -600v*2 Differentiate 0n*4 + 2n*4 - 29n + 7n4 - 55n*3 + 2572 + 29n with respect to n. 36n3 - 165n*2 Let l be 11 + 27/18 - (17 + 4)/3. Let f(o) be the third derivative of lo*3 + 0o + 19/12o4 + 15o*2 + 0. Find the first derivative of f(a) wrt a. 38 Suppose -d - 10 = -f, 5d = 4f + 2d - 38. Suppose 27 = fi - 5. What is the second derivative of 12u*4 - 12u*i - 31u - 20u4 - 8u*4 wrt u? -336u*2 Suppose 20j - 504 = 12j. Differentiate 6l - 37l - 9l - jl + 20 wrt l. -103 Let f(j) be the third derivative of -j7/210 - 7j6/120 - j4/4 - 1046j3/3 - 2528j*2. Find the first derivative of f(o) wrt o. -4o*3 - 21o*2 - 6 Let d(n) = 11193n*2 + 1588n. Let t(l) = -3732l2 - 529l. Let r(q) = 2d(q) + 7t(q). What is the second derivative of r(m) wrt m? -7476 Let f(y) be the second derivative of 0y5 + 0y*2 + 0y*3 - 7y*4 - y + 25 + 0y*6 + 10/21y*7. Find the third derivative of f(p) wrt p. 1200p2 Let j(r) = 2 + 8 - 7 - r. Let b be j(-2). Find the second derivative of o5 + 7o3 - 7o*b + 15o - 7o3 wrt o. -120o*3 Let c(t) = -134t + 97. Let o(p) = -51 - 28 + 155p - 22 + 5 - 25p. Let w(i) = -3c(i) - 4o(i). Differentiate w(d) with respect to d. -118 Let q(g) be the second derivative of 583g3 - 9571g*2/2 + 23g + 91. What is the derivative of q(b) wrt b? 3498 Let n(m) = 6m - 5. Let w be n(13). Let q = w - -17. Find the first derivative of 13u*2 - 43 - 42 + q wrt u. 26u Let a be (-4)/4 + 10/(-5) + 28. What is the derivative of 62 + 111 - 11288w2 - aw*4 + 11288w*2 wrt w? -100w*3 Let z(a) be the second derivative of -23a*6/6 + 9a*5/20 + 19a*4 + 7a*3/3 - 638a + 1. What is the third derivative of z(y) wrt y? -2760y + 54 Let c(w) be the first derivative of -1/2w*2 - 63 + 0w + 15/2w4 + 35/3w*3. Find the third derivative of c(t) wrt t. 180 Suppose 27 = -110u + 113u. Find the third derivative of -uf*2 + 8f*3 + 8 - 28f*3 - 76f*3 + 0 - 128f*3 wrt f. -1344 Let h(z) = 7026z*4 + 3z*3 - 10z + 31. Let v(s) = 21079s4 + 8s*3 - 29s + 84. Let u(b) = 8h(b) - 3v(b). Find the second derivative of u(r) wrt r. -84348r2 Let l(h) be the second derivative of 7h*6/15 + 70h*3/3 - 107h*2 - 175h. Let o(x) be the first derivative of l(x). Differentiate o(a) wrt a. 168a2 Let z(i) be the first derivative of -5i*6/6 + 3i*4/2 + 204i*3 - 2687. Find the third derivative of z(p) wrt p. -300p*2 + 36 Let a(u) be the first derivative of 609u*3 + 625u*2/2 + 167. Find the second derivative of a(h) wrt h. 3654 What is the third derivative of -19r*2 + 3 - 90r*2 + 226r*3 - 16r*2 + 112r*3 - 39r**2 wrt r? 2028 Let b(f)	{ "pile_set_name": "DM Mathematics" }
73o - 496624973o - 225o3. -225o*3 Collect the terms in 311336y + 311334y + 1 - 622700y. -30y + 1 Collect the terms in -1194b + 457b + 429b + 394b - 1. 86b - 1 Collect the terms in -10z + 31519556255 - 31519556255. -10z Collect the terms in -10499z3 - 1304268 + 1304268. -10499z*3 Collect the terms in -247468 + 247468 - 253j + 270j. 17j Collect the terms in -22254n + 17128n - 36426n. -41552n Collect the terms in 455q2 - 405q*2 - 29q - 454q2 + 29q. -404q2 Collect the terms in -7634 - 22y*3 + 14837 - 7203. -22y*3 Collect the terms in -3c*3 + 4350c - 1842c - 2508c + 9c2. -3c*3 + 9c*2 Collect the terms in 2n*2 - 46n + 80n - 3n - 21n + 6n*2. 8n*2 + 10n Collect the terms in -35c - 20c - 5 + 6 + 122c. 67c + 1 Collect the terms in 6s + 2s - 19 - 3s - 4 + 15. 5s - 8 Collect the terms in 0n3 - 844n2 + n3 + 497n2 + 347n2. n3 Collect the terms in 5 - 4 - 3 + 1 + 358f - 934f + 433f. -143f - 1 Collect the terms in -611u2 + 489u*2 - 14u - 10u + 24u + 63u2. -59u*2 Collect the terms in 42 + 2 + 13 - 58c + 24c + 29c. -5c + 57 Collect the terms in -59348j + 19727j + 19750j - 2j2 + 19871j. -2j2 Collect the terms in 14030 + 13629 - 41271 - i + 13612. -i Collect the terms in 23376x - 61075x - 33376x. -71075x Collect the terms in 178u - 81u - 115u - 11u. -29u Collect the terms in 2064276b + 2064142b - 4128419b. -b Collect the terms in 651v*2 + 649v*2 - 2602v*2 + 599v*2 + 573v*2. -130v*2 Collect the terms in -389v*3 - 392v*3 - 567v*3 + 1705v*3 - 378v*3. -21v*3 Collect the terms in -16438i*3 - 136146i*3 - 157626i*3 + 38280i*3. -271930i*3 Collect the terms in 526o - 1595o2 - 527o - 568o2 + 434o*2. -1729o*2 - o Collect the terms in 13323764l*3 + 2l - 13323763l3 - 2l + 1. l*3 + 1 Collect the terms in 19r*3 + 6171301515998 - 6171301515998. 19r*3 Collect the terms in -471614c + 157201c + 157201c + 157201c. -11c Collect the terms in 2w2 + 0w - 29w + 676 + 16w + 16w. 2w*2 + 3w + 676 Collect the terms in 6605 - 6496 - 2n + 11n + 3n. 12n + 109 Collect the terms in o*2 - 10o + 2o + 12o - 10o + 6o - 24o2. -23o*2 Collect the terms in -38a*3 + 1211a*2 - 3785a*2 + 1222a*2 + 1347a*2. -38a*3 - 5a*2 Collect the terms in 196 + v + 228 + 216 + 183 - 869 + 126. v + 80 Collect the terms in 1867 - 77925m*2 + 77734m*2 - 1867 - 3m. -191m2 - 3m Collect the terms in 952m + 963m - 2876m + 962m + 47m3. 47m*3 + m Collect the terms in 11 - 2 + 32 - 12 + 26l + 18l. 44l + 29 Collect the terms in 75 - 100 + 3m + 78 - 5m - m - 51. -3m + 2 Collect the terms in 11141465l*2 + 9 + 6 - 11141465l*2 - 2l*3 - 15. -2l*3 Collect the terms in -2j*3 - 12962j*2 + 25925j*2 - 12963j*2 + 190 - 511. -2j*3 - 321 Collect the terms in -889j*2 - 628j - 881j2 + 624j + 501j2. -1269j*2 - 4j Collect the terms in 891s2 - 4211131789s + 4211131789s. 891s*2 Collect the terms in -28149b*2 + 56194b*2 - 28046b*2 + 213b*3. 213b3 - b2 Collect the terms in -16y + 251y + 165y - 198y - 200y. 2y Collect the terms in -26 + 3b3 - b + 8 - 181b*2 + 19 + b. 3b*3 - 181b*2 + 1 Collect the terms in -8 - 458g - 104g2 - 60g*2 + 8. -164g*2 - 458g Collect the terms in 359y + 810y - 363y + 732y + 595y. 2133y Collect the terms in -699u + 655u - 842u - 820u - 627u. -2333u Collect the terms in 77q + 100167 + q - 100167 + 10q*2 + 77q - 155q. 10q*2 Collect the terms in -1054l + 1664 + 1649 - 3313. -1054l Collect the terms in -39516m*3 + 4m*2 - 4m*2 + 79096m*3 - 39513m*3. 67m*3 Collect the terms in 1321v + 255v - 565v. 1011v Collect the terms in 10g - 12g3 + 15g - 160g + 135g - 31g3. -43g*3 Collect the terms in 5i - 46i2 - 4i + 342 - 473 - 12i2. -58i*2 + i - 131 Collect the terms in -3346 + 20539x - 3350 - 3341 + 13387 - 20544x - 3350. -5x Collect the terms in -1459s - 2187s + 81s - 7 - 8 + 452s. -3113s - 15 Collect the terms in -1048602v*2 - 240v - 365832v2 + 240v. -1414434v2 Collect the terms in -163f*3 + 33f*3 + 800f*3. 670f*3 Collect the terms in 1177 + 675 - 1737 - 2p*2. -2p*2 + 115 Collect the terms in -39t - 41t + 164t*2 - 40t - 198t + 318t - 165t2. -t2 Collect the terms in -244036x*3 + 731910x*3 - 243933x*3 - 243939x*3. 2x*3 Collect the terms in 5 + 3153868j + 3153865j - 19 - 6307737j. -4j - 14 Collect the terms in -599h - 23h - 2h*2 + 5h + 4h2. 2h*2 - 617h Collect the terms in 264y2 + 264y*2 + 266y*2 + 270y*2 - 1065y*2 + 10y*3. 10y3 - y2 Collect the terms in 8 + 1565r - 10830r - 7. -9265r + 1 Collect the terms in -12900k + 4055k + 4069k + 4794k. 18k Collect the terms in h*3 - 484 + 233 + 251 + 619h. h*3 + 619h Collect the terms in -14h2 + 17h*2 - 14h*3 - 8h*3 + 20h*3 + 18h*2 - 13h*3. -15h*3 + 21h*2 Collect the terms in 2405s*2 - 5506s*2 - 5039s*2. -8140s*2 Collect the terms in -232s - 7s2 + 116s + 2874 + 119s - 2874. -7s*2 + 3s Collect the terms in -559i2 + 42i*2 - 313i*2 + 245i*2 - 374i*2. -959i*2 Collect the terms in 2657r - 6067r + 4r*2 + 750r + 2660r. 4r*2 Collect the terms in -3473l + 0 - 4 - 3473l + 10408l - 3471l + 5. -9l + 1 Collect the terms in 71x - 5152x*3 + 5232x*3 + 151x. 80x3 + 222x Collect the terms in 87 - 11f - 84 + 43 + 165 - 35. -11f + 176 Collect the terms in 97l3 + 127852l - 71 - 127852l. 97l*3 - 71 Collect the terms in -19382x*3 - 17053x*3 + 10x*2 + 36447x*3 - 10x*2. 12x*3 Collect the terms in 11948y*2 + 64 + 55 - 119 + 59908y*2. 71856y*2 Collect the terms in 16605a*2 + 16607a*2 - 49818a*2 + 16616a*2. 10a*2 Collect the terms in -562x*3 + 197x*3 + 98x*3. -267x*3 Collect the terms in -383 - 7w*2 + 61 + 405 - 85. -7w*2 - 2 Collect the terms in 67266k - 11199k - 11214k - 11215k - 11212k - 11214k - 11210k. 2k Collect the terms in -2 - 13194o + 39620o + 2 - 13220o - 13206o + 11o*2. 11o*2 Collect the terms in 53t*2 + 229686 - 459378 + 229694. 53t*2 + 2 Collect the terms in -1918l + 3040l + 3581l. 4703l Collect the terms in -70314r*2 + 5 - 44373r*2 - 4. -114687r*2 + 1 Collect the terms in -1385a + 2a3 + 5776 - 2865 - 2911. 2a*3 - 1385a Collect the terms in -1490 + 2972 - 6l - 10l - 10l + 20l - 1482. -6l Collect the terms in 171591 - 171591 - 9883x. -9883x Collect the terms in -81472v - 81476v - 81466v + 325897v - 81473v. 10v Collect the terms in -4 - 46i*3 - 96i*3 + 7 + 157i*3 - 3. 15i*3 Collect the terms in -162d*3 + 806597d*2 + 7 - 806597d*2 + 159d*3. -3d*3 + 7 Collect the terms in 4259i*2 - 29820i*2 + 146982i*2 + 67946i*2. 189367i2 Collect the terms in -98 - c3 + 9 + 140c3 - 29c*2 + 29c*2. 139c*3 - 89 Collect the terms in 9612t*2 - 38503t*2 + 9657t*2 + 9620t*2 + 9620t*2. 6t*2 Collect the terms in 1843t + 55262 + 55261 - 110523. 1843t Collect the terms in -180 + 47v + 356 - 176 - 9v2 + 20v*2. 11v*2 + 47v Collect the terms in 619253 + b - 619253 - 28b3 - b + 11b*3. -17b*3 Collect the terms in -24m*2 - 594m*2 + 431m*3 + 1304m*3. 1735m*3 - 618m*2 Collect the terms in -9w*2 + 49372w*3 - 403868w*3 + 9w*2. -354496w*3 Collect the terms in 7960232o*2 - 9o*3 - 13o*3 - 7960232o*2 + 33o*3. 11o*3 Collect the terms in 293l*3 + 298l*3 + 294l*3 + 289l*3 + 292l*3 - 1472l*3. -6l*3 Collect the terms in 7q*3 + 11q*3 - 874 - 22q*3 + 2q*3. -2q*3 - 874 Collect the terms in -1570p*3 + 1569p*3 + 51p2 + 12 - 11. -p3 + 51p2 + 1 Collect the terms in -179 - 340y*3 - 130y*3 + 90 + 89. -470y*3 Collect the terms in 1079 + 241 - 2047 + t + 4t - 7t. -2t - 727 Collect the terms in 525d3 + 8418266d - 8418266d. 525d*3 Collect the terms in 180r + 1730847 - 1730847. 180r Collect the terms in -3q*2 - 1385 + 5q*2 - 8q - q*2 + 4q*2. 5q*2 - 8q - 1385 Collect the terms in -5w2 + 1206w*3 + 36w*2 - 1204w*3. 2w*3 + 31w**2 Collect the terms in 6	{ "pile_set_name": "DM Mathematics" }
actors of 3243? 3, 23, 47 List the prime factors of 13581. 3, 503 What are the prime factors of 15886? 2, 13, 47 What are the prime factors of 3049? 3049 What are the prime factors of 428? 2, 107 What are the prime factors of 479? 479 List the prime factors of 3807. 3, 47 What are the prime factors of 12751? 41, 311 List the prime factors of 4325. 5, 173 What are the prime factors of 190? 2, 5, 19 What are the prime factors of 823? 823 List the prime factors of 9108. 2, 3, 11, 23 List the prime factors of 3369. 3, 1123 What are the prime factors of 1012? 2, 11, 23 What are the prime factors of 3598? 2, 7, 257 What are the prime factors of 38157? 3, 7, 23, 79 What are the prime factors of 45962? 2, 7, 67 List the prime factors of 8504. 2, 1063 List the prime factors of 324. 2, 3 List the prime factors of 91782. 2, 3, 5099 List the prime factors of 110148. 2, 3, 67, 137 What are the prime factors of 134536? 2, 67, 251 What are the prime factors of 3139? 43, 73 List the prime factors of 77356. 2, 83, 233 What are the prime factors of 56596? 2, 14149 List the prime factors of 485. 5, 97 List the prime factors of 1485. 3, 5, 11 What are the prime factors of 1674? 2, 3, 31 List the prime factors of 1345. 5, 269 List the prime factors of 71061. 3, 23687 List the prime factors of 20830. 2, 5, 2083 List the prime factors of 161548. 2, 40387 List the prime factors of 4340. 2, 5, 7, 31 What are the prime factors of 57741? 3, 19, 1013 What are the prime factors of 126235? 5, 25247 List the prime factors of 37557. 3, 13, 107 List the prime factors of 2109. 3, 19, 37 What are the prime factors of 952? 2, 7, 17 List the prime factors of 1742. 2, 13, 67 What are the prime factors of 131415? 3, 5, 8761 What are the prime factors of 19779? 3, 19, 347 What are the prime factors of 797? 797 List the prime factors of 1036. 2, 7, 37 What are the prime factors of 1561? 7, 223 List the prime factors of 3465. 3, 5, 7, 11 List the prime factors of 33938. 2, 71, 239 List the prime factors of 416. 2, 13 List the prime factors of 14544. 2, 3, 101 What are the prime factors of 1637? 1637 What are the prime factors of 8797? 19, 463 List the prime factors of 685. 5, 137 List the prime factors of 20352. 2, 3, 53 List the prime factors of 50619. 3, 47, 359 List the prime factors of 52930. 2, 5, 67, 79 What are the prime factors of 290? 2, 5, 29 What are the prime factors of 850? 2, 5, 17 List the prime factors of 53925. 3, 5, 719 What are the prime factors of 33720? 2, 3, 5, 281 List the prime factors of 38807. 151, 257 List the prime factors of 888. 2, 3, 37 What are the prime factors of 27167? 7, 3881 List the prime factors of 102741. 3, 23, 1489 What are the prime factors of 1915? 5, 383 What are the prime factors of 41001? 3, 79, 173 What are the prime factors of 20871? 3, 773 List the prime factors of 7110. 2, 3, 5, 79 List the prime factors of 20091. 3, 37, 181 List the prime factors of 7402. 2, 3701 List the prime factors of 1312. 2, 41 What are the prime factors of 14748? 2, 3, 1229 What are the prime factors of 63322? 2, 7, 4523 List the prime factors of 1046. 2, 523 List the prime factors of 117502. 2, 7, 11, 109 List the prime factors of 632. 2, 79 What are the prime factors of 110? 2, 5, 11 What are the prime factors of 5639? 5639 What are the prime factors of 23474? 2, 11, 97 What are the prime factors of 7884? 2, 3, 73 List the prime factors of 2158. 2, 13, 83 What are the prime factors of 2779? 7, 397 List the prime factors of 9119. 11, 829 What are the prime factors of 10636? 2, 2659 List the prime factors of 155632. 2, 71, 137 What are the prime factors of 23166? 2, 3, 11, 13 List the prime factors of 10077. 3, 3359 List the prime factors of 38549. 7, 5507 List the prime factors of 377. 13, 29 List the prime factors of 9379. 83, 113 List the prime factors of 1012. 2, 11, 23 What are the prime factors of 4027? 4027 List the prime factors of 38503. 139, 277 List the prime factors of 18220. 2, 5, 911 List the prime factors of 70. 2, 5, 7 List the prime factors of 6419. 7, 131 What are the prime factors of 14477? 31, 467 List the prime factors of 17343. 3, 41, 47 What are the prime factors of 2002? 2, 7, 11, 13 List the prime factors of 16230. 2, 3, 5, 541 What are the prime factors of 14290? 2, 5, 1429 List the prime factors of 1077. 3, 359 List the prime factors of 658. 2, 7, 47 List the prime factors of 83504. 2, 17, 307 What are the prime factors of 7261? 53, 137 List the prime factors of 36546. 2, 3, 6091 What are the prime factors of 9465? 3, 5, 631 List the prime factors of 1088. 2, 17 What are the prime factors of 28304? 2, 29, 61 What are the prime factors of 11606? 2, 7, 829 What are the prime factors of 1720? 2, 5, 43 List the prime factors of 46114. 2, 23057 What are the prime factors of 89094? 2, 3, 31, 479 What are the prime factors of 16178? 2, 8089 What are the prime factors of 522? 2, 3, 29 List the prime factors of 7278. 2, 3, 1213 What are the prime factors of 2011? 2011 List the prime factors of 6805. 5, 1361 What are the prime factors of 29110? 2, 5, 41, 71 List the prime factors of 995. 5, 199 What are the prime factors of 4775? 5, 191 List the prime factors of 734. 2, 367 List the prime factors of 556. 2, 139 List the prime factors of 12909. 3, 13, 331 What are the prime factors of 531? 3, 59 List the prime factors of 410. 2, 5, 41 List the prime factors of 84878. 2, 31, 37 List the prime factors of 1302. 2, 3, 7, 31 List the prime factors of 4058. 2, 2029 What are the prime factors of 117468? 2, 3, 13, 251 List the prime factors of 29088. 2, 3, 101 List the prime factors of 18308. 2, 23, 199 List the prime factors of 76953. 3, 113, 227 What are the prime factors of 11408? 2, 23, 31 What are the prime factors of 3516? 2, 3, 293 What are the prime factors of 354? 2, 3, 59 What are the prime factors of 105296? 2, 6581 List the prime factors of 275. 5, 11 List the prime factors of 157802. 2, 78901 What are the prime factors of 2579? 2579 List the prime factors of 1037. 17, 61 What are the prime factors of 1204? 2, 7, 43 List the prime factors of 15500. 2, 5, 31 List the prime factors of 30658. 2, 15329 List the prime factors of 1112. 2, 139 List the prime factors of 6673. 6673 What are the prime factors of 228? 2, 3, 19 List the prime factors of 577. 577 List the prime factors of 14145. 3, 5, 23, 41 List the prime factors of 14175. 3, 5, 7 List the prime factors of 3111. 3, 17, 61 What are the prime factors of 4075? 5, 163 What are the prime factors of 11147? 71, 157 List the prime factors of 1869. 3, 7, 89 What are the prime factors of 2620? 2, 5, 131 List the prime factors of 2323. 23, 101 List the prime factors of 18000. 2, 3, 5 What are the prime factors of 2285? 5, 457 List the prime factors of 743. 743 List the prime factors of 195266. 2, 89, 1097 What are the prime factors of 4809? 3, 7, 229 What are the prime factors of 21989? 11, 1999 List the prime factors of 4128. 2, 3, 43 List the prime factors of 958. 2, 479 What are the prime factors of 85675? 5, 23, 149 List the prime factors of 43349. 67, 647 List the prime factors of 4227. 3, 1409 What are the prime factors of 22909? 31, 739 What are the prime factors of 382? 2, 191 What are the prime factors of 81863? 71, 1153 List the prime factors of 526. 2, 263 What are the prime factors of 18380? 2, 5, 919 What are the prime factors of 6046? 2, 3023 List the prime factors of 12190. 2, 5, 23, 53 What are the prime factors of 4987? 4987 List the prime factors of 3191. 3191 List the prime factors of 3503. 31, 113 What are the prime factors of 8768? 2, 137 What are the prime factors of 12599? 43, 293 List the prime factors of 147793. 147793 List the prime factors of 167237. 7, 3413 What are the prime factors of 7? 7 List the prime factors of 177. 3, 59 List the prime factors of 669. 3, 223 What are the prime factors of 4289? 4289 What are the prime factors of 646? 2, 17, 19 What are the prime factors of 60060? 2, 3, 5, 7, 11, 13 What are the prime factors of 4397? 4397 What are the prime factors of 3716? 2, 929 List the prime factors of 978. 2, 3, 163 List the prime factors of 4314. 2, 3, 719 List the prime factors of 3963. 3, 1321 List the prime factors of 3435. 3, 5, 229 List the prime	{ "pile_set_name": "DM Mathematics" }
637? 0 What is the units digit of 3718? 8 What is the thousands digit of 569854? 9 What is the hundred thousands digit of 189119? 1 What is the hundred thousands digit of 210940? 2 What is the hundreds digit of 199790? 7 What is the hundred thousands digit of 1579540? 5 What is the thousands digit of 17033311? 3 What is the tens digit of 3584570? 7 What is the thousands digit of 5167497? 7 What is the units digit of 2211799? 9 What is the thousands digit of 360720? 0 What is the thousands digit of 384059? 4 What is the tens digit of 6540372? 7 What is the thousands digit of 196355? 6 What is the thousands digit of 319125? 9 What is the hundreds digit of 591319? 3 What is the units digit of 4361092? 2 What is the units digit of 1029544? 4 What is the hundreds digit of 19710111? 1 What is the units digit of 18659618? 8 What is the tens digit of 548624? 2 What is the thousands digit of 21623868? 3 What is the ten thousands digit of 2722866? 2 What is the tens digit of 265903? 0 What is the ten thousands digit of 2243485? 4 What is the ten thousands digit of 330048? 3 What is the millions digit of 1244151? 1 What is the hundreds digit of 8120429? 4 What is the tens digit of 170983? 8 What is the hundred thousands digit of 205321? 2 What is the tens digit of 227568? 6 What is the units digit of 693371? 1 What is the ten thousands digit of 263984? 6 What is the ten thousands digit of 65627? 6 What is the hundreds digit of 635110? 1 What is the hundreds digit of 185275? 2 What is the hundreds digit of 153790? 7 What is the units digit of 1053583? 3 What is the tens digit of 77800? 0 What is the hundred thousands digit of 111621? 1 What is the hundred thousands digit of 243198? 2 What is the units digit of 2390550? 0 What is the units digit of 1209035? 5 What is the ten thousands digit of 14556478? 5 What is the hundred thousands digit of 940737? 9 What is the tens digit of 680607? 0 What is the ten thousands digit of 561317? 6 What is the ten millions digit of 28056236? 2 What is the ten thousands digit of 722956? 2 What is the units digit of 1075135? 5 What is the thousands digit of 2026479? 6 What is the units digit of 1187891? 1 What is the ten thousands digit of 3886299? 8 What is the tens digit of 3125061? 6 What is the ten thousands digit of 167879? 6 What is the hundreds digit of 214666? 6 What is the hundreds digit of 1325008? 0 What is the ten thousands digit of 1626745? 2 What is the units digit of 1018538? 8 What is the thousands digit of 44725? 4 What is the units digit of 1303267? 7 What is the thousands digit of 11329535? 9 What is the units digit of 568740? 0 What is the units digit of 40626? 6 What is the hundreds digit of 9459191? 1 What is the ten thousands digit of 1169413? 6 What is the hundred thousands digit of 5679162? 6 What is the millions digit of 9717503? 9 What is the millions digit of 4833585? 4 What is the millions digit of 2444806? 2 What is the thousands digit of 6913021? 3 What is the ten thousands digit of 117909? 1 What is the hundred thousands digit of 2100144? 1 What is the hundreds digit of 849672? 6 What is the thousands digit of 2576477? 6 What is the tens digit of 235557? 5 What is the hundred thousands digit of 25724798? 7 What is the ten thousands digit of 2583160? 8 What is the hundreds digit of 819318? 3 What is the ten thousands digit of 8631838? 3 What is the thousands digit of 26470? 6 What is the ten millions digit of 10890148? 1 What is the tens digit of 6884? 8 What is the hundreds digit of 3352427? 4 What is the millions digit of 1325377? 1 What is the ten thousands digit of 1469119? 6 What is the ten thousands digit of 4761283? 6 What is the hundreds digit of 1774062? 0 What is the hundred thousands digit of 2106266? 1 What is the thousands digit of 948507? 8 What is the units digit of 9167877? 7 What is the ten millions digit of 21016606? 2 What is the hundreds digit of 2569099? 0 What is the thousands digit of 414790? 4 What is the thousands digit of 693008? 3 What is the thousands digit of 293174? 3 What is the thousands digit of 105230? 5 What is the hundred thousands digit of 2960621? 9 What is the tens digit of 231013? 1 What is the hundred thousands digit of 104099? 1 What is the hundred thousands digit of 3611083? 6 What is the hundred thousands digit of 943462? 9 What is the thousands digit of 180949? 0 What is the ten millions digit of 15376720? 1 What is the hundreds digit of 28784787? 7 What is the hundred thousands digit of 148706? 1 What is the thousands digit of 981204? 1 What is the tens digit of 7151387? 8 What is the hundreds digit of 7625607? 6 What is the units digit of 644049? 9 What is the hundred thousands digit of 10675604? 6 What is the ten thousands digit of 141058? 4 What is the hundreds digit of 8526? 5 What is the units digit of 374633? 3 What is the units digit of 2976138? 8 What is the thousands digit of 787456? 7 What is the ten thousands digit of 153673? 5 What is the hundreds digit of 1099956? 9 What is the units digit of 49184? 4 What is the hundred thousands digit of 408258? 4 What is the ten thousands digit of 86449? 8 What is the units digit of 1051549? 9 What is the units digit of 1842446? 6 What is the ten thousands digit of 2476692? 7 What is the ten millions digit of 13761889? 1 What is the hundreds digit of 2784872? 8 What is the hundred thousands digit of 17395431? 3 What is the ten thousands digit of 351404? 5 What is the hundred thousands digit of 798026? 7 What is the hundreds digit of 631493? 4 What is the hundred thousands digit of 2079824? 0 What is the ten thousands digit of 1208372? 0 What is the hundreds digit of 1529737? 7 What is the thousands digit of 1199434? 9 What is the thousands digit of 787825? 7 What is the units digit of 3148736? 6 What is the units digit of 15050? 0 What is the hundred thousands digit of 323191? 3 What is the units digit of 20657478? 8 What is the ten thousands digit of 661056? 6 What is the thousands digit of 7587608? 7 What is the hundred thousands digit of 391256? 3 What is the hundreds digit of 339372? 3 What is the hundred thousands digit of 1196101? 1 What is the ten thousands digit of 20648072? 4 What is the hundreds digit of 824608? 6 What is the thousands digit of 457005? 7 What is the millions digit of 19402905? 9 What is the tens digit of 1933648? 4 What is the hundred thousands digit of 11022638? 0 What is the hundreds digit of 2925698? 6 What is the hundred thousands digit of 162304? 1 What is the units digit of 205570? 0 What is the units digit of 280738? 8 What is the hundred thousands digit of 997938? 9 What is the hundred thousands digit of 301379? 3 What is the millions digit of 5467532? 5 What is the millions digit of 5069146? 5 What is the millions digit of 1197632? 1 What is the units digit of 307914? 4 What is the units digit of 208310? 0 What is the ten thousands digit of 6066817? 6 What is the hundred thousands digit of 1772525? 7 What is the thousands digit of 29009? 9 What is the tens digit of 938055? 5 What is the ten thousands digit of 251708? 5 What is the tens digit of 571818? 1 What is the tens digit of 273545? 4 What is the tens digit of 434739? 3 What is the thousands digit of 9059797? 9 What is the hundred thousands digit of 5779350? 7 What is the ten thousands digit of 149476? 4 What is the millions digit of 2430707? 2 What is the ten thousands digit of 140429? 4 What is the hundred thousands digit of 675381? 6 What is the tens digit of 7887549? 4 What is the thousands digit of 128353? 8 What is the units digit of 5834542? 2 What is the thousands digit of 796310? 6 What is the hundred thousands digit of 1304398? 3 What is the tens digit of 311639? 3 What is the thousands digit of 177344? 7 What is the hundreds digit of 8361118? 1 What is the thousands digit of 9168371? 8 What is the millions digit of 9864208? 9 What is the millions digit of 4081339? 4 What is the ten thousands digit of 263923? 6 What is the units digit of 287176? 6 What is the hundreds digit of 14168658? 6 What is the hundred thousands digit of 723013? 7 What is the ten millions digit of 24955376? 2 What is the ten thousands digit of 17214185? 1 What is the hundred thousands digit of 3580490? 5 What is the ten t	{ "pile_set_name": "DM Mathematics" }
= 3j + h - 66. Solve jo - 15 = -3 for o. 1 Let o = -522 - -524. Let b = -313 - -328. Solve u = -ou - b for u. -5 Let o(i) = 2i*2 - 9i + 5. Let p be o(4). Let q(d) = -36d + 16. Let y(h) = h - 1. Let g(x) = pq(x) + 16y(x). Let t be g(-1). Solve -c + t = -6c for c. -4 Let s = -18 + 7. Let w = s + 15. Let z be (0 + w/8)10. Solve 4m = -m - z for m. -1 Let x(b) = -35b - 1430. Let z be x(-41). Solve 5l = -zl + 60 for l. 6 Suppose 4m - 9 + 27 = -2x, -5m - 6 = -3x. Let p(v) = v3 + v2 - 5v + 5. Let k be p(m). Solve 2z + kz = 8 for z. 2 Let j be (6/(-9))/(2/(-9)). Suppose -11i - 2a + 14 = -9i, -5i - 3a + 37 = 0. Solve -i = ju + u for u. -2 Let i = -1 - 1. Let p be (-24 - -25)(-27)/(i + -1). Solve -4a - 15 = -pa for a. 3 Let n be 2/(-9) + 29/9. Suppose -u = 15u - 32. Solve nh = h + u for h. 1 Let b(n) = -n. Let u be b(-4). Let x be 49(26/(-14) - -2). Let w be -2 + 12/x - (-185)/35. Solve -3a - u = w for a. -3 Let j(i) = i3 - 25i*2 + 31i + 53. Let p be j(24). Let v = p + -206. Solve 0 = 3m - v + 30 for m. -5 Suppose -5t = -2t - 2v + 114, t = 2v - 42. Let f(u) = -10u - 64. Let o be f(-10). Let c = t + o. Solve 5p = -cp for p. 0 Suppose -577v = -573v + 5x - 506, 3v - 4x = 395. Solve 0 = 14m - 57m - v for m. -3 Let v = -28262 - -28314. Solve 25 = -47u + vu for u. 5 Let p = 2 - -3. Let y be p/(-1)(-4)/10. Suppose -yx + 2s + 4 = -10, 27 = 5x - s. Solve -b - 4 + x = 0 for b. 1 Suppose -81o = -82o + 589. Suppose 5k + 528 = -n, -58 = -5k - 2n - o. Let h be 7/(k/(-12))50/4. Solve 3y - 2 = h for y. 4 Suppose -252 = 243y - 252y. Solve 0 = yh - 2h - 130 for h. 5 Suppose 10 - 26 = -4j. Suppose -5i + 16 + 44 = 0. Suppose s + i = 2x - s, -x - 4s = -16. Solve -jl = -xl - 12 for l. -3 Suppose -4q - 13o + 22 = -15o, 30 = 5q - 2o. Solve -8 = -0u + qu for u. -1 Let v be (-2)/12 - 2/(-12). Suppose 4n + 3j = -vn + 744, n - 185 = -j. Let c be n/35 + 6/(-15). Solve 11 = cp - 14 for p. 5 Suppose -362o - 20 = -366o. Suppose 5n = -6b + 2b - 75, 0 = -5b + 3n - 103. Let z be o/(b/(-18)) - 5/10. Solve -1 = -p + z for p. 5 Let s be (-2)/(-15) + 1630/37540. Solve s = 35v - 36 for v. 6 Let k(c) = -73c + 59. Let d be k(4). Let r = -228 - d. Solve 10 = -rm - 0 for m. -2 Let b = -16377 + 16386. Solve -39 - b = 12t for t. -4 Let m(o) = -3o - 34. Let y be m(-12). Let x be -1 - (1300/(-338) - y/13). Solve xg = -10 + 25 for g. 5 Let y(t) = -48t + 3938. Let a be y(81). Solve 0 = -163s + 138s + a for s. 2 Let y(o) = 2o3 + 4o*2 - 5o + 1. Let d be y(-5). Let f be (-2 + 0)(d/8 + 3). Solve 4p - f = -5 for p. 5 Let l(z) = -z*2 - 23z - 13. Let b be l(-22). Let c be 2/b + (-79)/(-9). Let t be c/6(-12)/(-9) + -2. Solve -k + 7 - 2 = t for k. 5 Suppose 5j - 4a = -494, 4j - 2j + 191 = -5a. Let n = -80 - j. Solve 5x - n = -x for x. 3 Let p(o) = o + 1. Suppose -38t = -32t - 12. Let y be p(t). Solve 1 = -g - y for g. -4 Suppose 2b = 2c - 0c - 6, 25 = 5b + 3c. Let j(y) = y*2 - 94y + 2211. Let z be j(45). Solve -b - 22 = zr for r. -4 Suppose 48 = 3n - 5d - 24, 5n + 2d - 120 = 0. Let z be 6/(-10)80/n-3. Solve 2m - 4m = -zm for m. 0 Let o = -111 + 136. Suppose -ol = -30l. Let h = 0 - -2. Solve -ha - 10 = -la for a. -5 Suppose -74i + 145i - 22578 = 0. Solve n = -i + 322 for n. 4 Let d be 39(-9)/(-27) + -13. Solve -12x + 25 + 35 = d for x. 5 Let n = 172 - 168. Let m be (12/3 - n)-1. Solve 65k - 66k - 4 = m for k. -4 Let k = 19942 - 19942. Let g(r) = r3 + 2r*2 - 4r. Let z be g(-3). Solve -zt + 9t = k for t. 0 Let a = 6327 - 5939. Solve -ac = -392c + 16 for c. 4 Let x(p) = 3p - 18. Let n be x(7). Let y(c) = -54c*2 + 24c*2 - c + 48c2 - cn + 20. Let i be y(18). Solve 2g - 2 = i for g. 2 Let j = -24 + 30. Let t(g) = 2g*3 - 14g*2 + 8g - 6. Let y be t(j). Let x be -4 + ((-14)/5)/(12/y). Solve -xh = -2h for h. 0 Let i(y) = 35y2 + 7y + 26. Let g be i(-3). Solve -2d - g = 38d for d. -8 Let v be 9/(-6)20/(-15). Suppose 0 = -vb - 12 + 82. Solve -34y = -by for y. 0 Let n(o) = 2o3 + 21o*2 - 43o - 38. Let t be n(-12). Solve -3 = -49r + t for r. 1 Let h = 792 - 795. Let s(l) = l3 + 2l*2 - 6l - 9. Let n be s(h). Let j(y) = -4y3 + y2 + y. Let a be j(-1). Solve -a + n = -x for x. 4 Let v = 3137 + -3130. Solve -715c = -722c + v for c. 1 Let m be 930/(-9) + (-7)/((-105)/20). Let i be (-3864)/m + 4/34. Suppose 3a - 3f - 26 = 2a, f = -2a + i. Solve -4q = -0q + a for q. -5 Suppose b - 4x = 9, -4b = -408x + 404x - 12. Solve -29p + b = -231 for p. 8 Let t = -339 - -349. Suppose -2c = 12d - td - 12, -3c + 4 = d. Solve d = -7u - 21 for u. -4 Let k(j) = 19j - 15. Suppose -6l + 25l - 57 = 0. Suppose -4n - 3u - 8 = 0, lu + u = -3n - 13. Let v be k(n). Solve 0p + 4p = -v for p. -1 Let z be ((-15)/18)/(-5)12. Let i be (1 - z) + (-299)/(-23). Solve -2o - 2o = -i for o. 3 Suppose l - 6l = 105. Let b = 24 + l. Let q(h) = -h - 8. Let c be q(-8). Solve cg + b = -g for g. -3 Let b be 4 - 1 - 1 - ((-56)/4 - -11). Solve bi = -19i - 48 for i. -2 Suppose -11a + a = -230. Suppose u - s - 13 = -6, -4u = -5s - a. Solve 0 = 4i + u + 4 for i. -4 Let x(w) = 3w*2 - w + 2. Let q be x(0). Suppose qd + 3d = 3l + 26, 0 = -5d - 2l + 16. Let n be (d + -6)1 + 6. Solve -nr - 6 - 6 = 0 for r. -3 Let v be -1 + 1 + 1 + 23. Let h be ((-1460)/(-100) - 17)/((-4)/10) + -4. Suppose 5c + 2u = 48, -c - hu = 2u - v. Solve -7k = -ck for k. 0 Let v = -12099 - -12144. Solve -158k = -149k + v for k. -5 Let b(q) = -q*3 - 8q*2 - 7q - 12. Suppose 43 = -5c + 2y, 2c + y = -2 - 8. Let m be b(c). Let a be 1/(1 + m/15). Solve -as = -2 - 8 for s. 2 Let f = 18771 - 18706. Solve 0 = 106p - fp - 246 for p. 6 Let s(i) = i*2 - 6i + 8. Let r be s(10). Let b be 36/(-16)r/9. Let o = b + 20. Solve 0 = -5m + o + 7 for m. 3 Let l(a) = 35a2 + 194a*3 - 193a*3 + 27 - 7a + 41a. Let i be l(-34). Solve -9z = i - 9 for z. -2 Let c = 6 + -4. Suppose -r - 27 + 53 = 18. Solve -ca = 2a + r for a. -2 Let i be -90 - 0 - (-8 - -4)1. Let k = i + 106. Solve 0m + 4m + k = 0 for m. -5 Let z(r) = -r2 - 27r - 21. Let a be z(-23). Let f = a + -4. Suppose f = 5u + 67. Solve -2h - 3h + 10 = u for h. 2 Let u = 2 - -6. Suppose -1720v = -1711v + 756. Let l = v + 84. Solve l = uh - 4h - 16 for h. 4 Suppose f - 11 + 7 = -3y, -2 = 4y + 5f. Suppose 3a = ya + 2a. Let d be ((a - 1) + 1)/(-2). Solve -5n + 38 - 13 = d for n. 5 Let v(x) = x*3 - 22x*2 - 21x - 7. Let r be v(23). Let o be (-2 - -1)/(36/r - 1). Solve 8u - ou = 10 for u. -2 Suppose 2x + 164 = -0c + 4c, 5x = -c + 19. Suppose -c = 2z - 15z. Solve a - 8 = -z for a. 5 Let m(h) = -3h2 + 41h - 97. Let r be m(10). Solve ra - 4 = 11a for a. 2 Let r = -3377 - -3433. Solve -96 = -10y - r for y. 4 Let u be 2 - (-16)/(-32) - (-6)/4. Solve -13n - 40 = -un for n. -4 Let w = 155 + -130. Suppose d = -4y + 41, -5y + w + 15 = 5d. Suppose -6i + yi = 15. Solve 0 = iu - 1 + 7 for u. -2 Let h = -239 + 244. Let j be 3 - (-13 + 7 + h). Solve -jy - 7 = 5 for y. -3 Let y(z) be the first derivative of -z*4/24 + 5z*3/3 + 17z*2/2 + 7. Let v(g) be the second derivative of y(g). Let o be v(8). Solve -ol = -4l + 2 for l. 1 Let r be 24/32 + (-34)/(-8). Suppose -rf = -3f - 3f. Suppose 4x = 4m - 16, 2x + f = m - 6. Solve md = -2d - 4 for d. -1 Let m be (-3)/18 + (-2)/(-9)12705/140. Solve -5b - m = 5b for b. -2 Let j(r) = -r*3 - 35r*2 + 12r + 328. Let b be j(-35). Let g = -144 + 239. Let l = g + b. Solve d = -ld for d. 0 Let a = -42 + 43. Let b(y) = 5y*3 - 4y + 3. Let j be b(a). Suppose -3p + p = -jp. Solve 3n = -pn + 12 for n. 4 Let a = 5970 + -5893. Solve ah - 4 = 79h for h. -2 Let y(u) = -u - 10. Let q(d) be the third derivative of d*4/24 - 11d*2. Let i(o) = -2q(o) - y(o). Let n be i(8). Solve 3z - nz = 0 for z. 0 Let d = -31532 - -31610. Solve -d = -14m - 36 for m. 3 Let y = -89 + 89. Let p(o) = 6o*2 + o. Let i be p(-1). Suppose y = -ih + 12h - 42. Solve 4w - 14 = h for w. 5 Suppose -4b + 12 = 2i, -5i + 1012 = -4b + 1010. Solve -51z + b = -52z for z. -2 Let r be (4 - 7) + 15 - -16. Solve 3a - r = -4a for a. 4 Let c be (11	{ "pile_set_name": "DM Mathematics" }
2k + 4 + i = 0. Let s(d) = d - 4. Give s(k). -9 Let k(w) = -w + 2. Let h be k(-2). Let q(d) = -2 + d + 4d - 2d - hd. What is q(-3)? 1 Let y be 1 + 0 + -2 + 18. Let v be y/5 + (-16)/40. Let p(b) = -b*3 + 2b2 + 2. What is p(v)? -7 Let i(p) = -p3 - 4p2 + 3p + 2. Let v(c) = c*3 + 5c*2 - 14c - 5. Let g be v(-7). Calculate i(g). 12 Let a(b) be the first derivative of b*2/2 + 5b + 16. Determine a(-7). -2 Suppose 8 - 23 = h - 5n, -2h + 3n = 16. Let p(m) = m + 3. Calculate p(h). -2 Let h(z) = -z3 + 5z*2 + z - 5. Suppose -16 = -2i - 2i. Suppose 3q + 10 = 2a, 6 = -iq + a + 1. Let o be (-1)/(q + 2/(-10)). Calculate h(o). 0 Suppose -1 = -f - 3. Let g(s) be the first derivative of s5/40 + s4/24 - 2s3/3 - 1. Let q(d) be the third derivative of g(d). Calculate q(f). -5 Let b be 3/4 - (-2)/8. Let j(t) = 2t + t*3 + 1 - b + 5t*2. Suppose -2h + 1 = 9. Calculate j(h). 8 Let p(a) = -a*2 + 4a - 2. Suppose -2y + 4z + 20 = 0, -4y = -5y + 3z + 12. Give p(y). -14 Let i(q) = -q - 7. Suppose 0 = 4g + 7h - 3h, h = -4g - 9. Let u be (2/g)/(12/108). Determine i(u). -1 Let f(z) = 2z - 4z2 + 0z - 6 + 2 + z*3. Suppose 4h - 15 = 9. Suppose -i = -hi + 15. Determine f(i). -7 Let m = 10 + -7. Suppose 7r = mr + 4. Let g(n) = 4n - 3n + r - 2n. Calculate g(2). -1 Let u(x) be the third derivative of -x6/120 - x4/24 + 7x3/6 + 2x*2. Let q = -5 + 13. Let o be 0/((-1)/((-4)/q)). What is u(o)? 7 Let n(c) = -10c*2 - 2c + 3c2 + 6c2 - 2. Give n(-2). -2 Let j(z) = -z2 + 5z - 1. Let b be j(5). Let r(o) = o2 - o + 1. Let v(s) = 6s - 8. Let n(m) = br(m) + v(m). What is n(6)? -3 Let y(s) = -2s3 + s3 - 10 + 6s2 + 8s + 4. Give y(7). 1 Let d(f) = 8 + 12f2 + 5f - 5f2 - 8f*2. Calculate d(7). -6 Let v(o) = -1 + 5o + 4 - 2. Let s = 14 + 5. Let b = -17 + s. What is v(b)? 11 Let g(k) = -6k2 + 13k - 6. Let b = -20 + 25. Let j(p) = -7p2 + 14p - 7. Let n(u) = bj(u) - 6g(u). Determine n(8). 1 Let i = -5 - -9. Let q(b) be the third derivative of 1/60b5 + 0 - b2 + 1/12b*i + 0b + 1/6b3. Give q(-1). 0 Let f(d) be the first derivative of 0d*2 + 2/3d*3 - 7/24d*4 + 0d + 1/120d5 + 3. Let l(g) be the third derivative of f(g). What is l(0)? -7 Let w(y) = -2y + 3. Let t be 9/(-45) + 21/5 + -2. What is w(t)? -1 Let m(l) = -l*3 + 5l*2 + 5l + 4. Suppose -4b - 5i = 0, 4i + 31 = 2b + b. What is m(b)? 29 Let y(u) be the second derivative of u*3/6 + 2u*2 + u - 2. Give y(3). 7 Let b(s) = -14s - 14. Let g(m) = 5m + 5. Let p(v) = 6b(v) + 17g(v). Give p(-5). -4 Let h(g) = -7g*2 + 1. Let d be 6/(-6) - (-1 + 8). Suppose 0m + 8 = 4m. Let q be (-4)/d(-4 + m). What is h(q)? -6 Suppose 5i + 26 = 3k, -k + 6i - 3i = -14. Let j be -3 + k - (4 - 3). Let t(b) = 3b + 1. Determine t(j). -5 Let a(m) = 11m*3 + m. Suppose 6s - s = 5. Calculate a(s). 12 Let o(l) = -6l - 3l*2 + 4 + 2 + 5l*2 - 3l*2. Determine o(-6). 6 Let d(t) = t - 19. Let j be d(14). Let f(q) = -3q + 3. Let p(s) = 3s - 4. Let v(o) = 5f(o) + 4p(o). Determine v(j). 14 Let q(r) be the third derivative of r5/60 - r4/24 - 5r3/6 - r2. Let x(z) = -z*3 - 5z*2 - 4z. Let i be x(-4). Determine q(i). -5 Let a(r) = 6r2 + r. Suppose 3k - 4 = 8. Suppose 3w + 1 - k = 0. What is a(w)? 7 Let c = 2 - 0. Let u(g) = 2g*2 - 2g. Let f be u(2). Let j(s) = -4 - f + 6 + s*2 + 3s. Calculate j(c). 8 Let t(v) be the third derivative of v6/360 - v4/24 + 5v3/6 + 5v*2. Let b(c) be the first derivative of t(c). Determine b(-2). 3 Let t = 10 - 7. Suppose o = 1, -f - 2o + 3 = -3. Suppose 0 = -tq - 4u - 6, 2q + 1 + f = -3u. Let c(k) = -2k + 3. Determine c(q). -1 Let k(v) be the first derivative of v5/60 - 7v*4/24 + 2v*3/3 - 5v*2/2 - 1. Let g(f) be the second derivative of k(f). Give g(5). -6 Let i(v) = -6v + 3. Let d be i(-1). Let g(s) = s - 11. Determine g(d). -2 Let b = 0 - -1. Let n be (b/(-2))/((-1)/(-4)). Let v(w) = 5w2 - 2w + 5. Let t(y) = 2y2 - y + 2. Let h(i) = 3t(i) - v(i). Calculate h(n). 7 Let y = -8 + 6. Let v(x) = -7x + 7. Let i(d) = 3d - 3. Let t(r) = 10i(r) + 4v(r). What is t(y)? -6 Let y(d) be the third derivative of -1/15d5 - 1/2d*3 + 0 + 1/24d*4 + 0d - 1/120d6 + 5d2. Give y(-4). -7 Let t = -3 - -6. Let x(d) = d3 - d - 1. Let z(f) = -4f3 - f2 + 2f + 4. Let s(r) = 5x(r) + z(r). Give s(t). 8 Suppose 0 = 2j - 5s + 13, 0 = -3j - 2s - 5 + 14. Suppose d - j = -0d. Let w(u) = -6u2 - 1. Give w(d). -7 Let b(l) be the first derivative of -l5/60 + l4/6 + l3/2 - 3l2/2 + 4. Let y(n) be the second derivative of b(n). Determine y(-2). -9 Let v(z) = z3 - 2z2 - 4z + 3. Let m(r) = r3 - r2 - 5r + 4. Let p(g) = 2m(g) - 3v(g). Give p(4). 7 Let t(r) = r2 - 8r + 9. Let z = 7 + -3. Suppose -5b + z = 2k - 3k, 8 = k + b. Give t(k). -3 Let n(q) be the first derivative of q6/120 - q5/10 + 5q4/24 + q3/6 - 2q2 - 3. Let m(r) be the second derivative of n(r). Give m(4). -11 Let k(f) = -2f*2 - 5f - 3. Let a(g) = g + 8. Let l be a(-9). Let i = -17 - -9. Let u be l/2 + 20/i. What is k(u)? -6 Let b(g) = g*3 + 5g*2 - 7g + 3. Suppose 0 = 4x - 2n - 128, -x + 54 = 7n - 2n. Suppose x = -4w + 10. Calculate b(w). 9 Suppose -3n - 25 = -5w + 2n, 5w + 5n + 5 = 0. Let a(s) be the first derivative of -1 + 5s + 3/2s*w. Give a(-4). -7 Suppose 0a = -m + 2a - 6, -3m - a + 17 = 0. Let i(h) be the first derivative of h4/4 - h3 - 3h2/2 + 4h + 3. Give i(m). 8 Let h(f) = -1. Let u(i) = 0i + 4 + i - 6. Let z(n) = -5h(n) - u(n). Let r be z(6). Let p(q) = -12q2 - q + 1. What is p(r)? -12 Let x be 1/22 - -1. Suppose 0g - 6 = -f + 4g, -4g = xf. Let o(u) = 3u - 2u*2 - 6u*2 - 3 - 2u*3 + 10u*2 + 0u3. Give o(f). -5 Let v(j) = -j2 + 4j - 3. Let g be v(2). Let n(p) = 8p + 1 + 1 - g. Determine n(-1). -7 Let k(x) be the second derivative of 2x + 0 + 1/6x*3 + 1/24x*4 - 1/2x*2. Let y(j) be the first derivative of k(j). Give y(-3). -2 Suppose 0 = -3x + 6x. Let p(j) be the third derivative of 0j4 + j2 + 0 + 1/60j5 + xj + 1/2j3. Give p(0). 3 Let f(z) = z2 + 5z + 2. Let l be f(-2). Let v(p) = p - 1. Determine v(l). -5 Let d(h) be the second derivative of h*4/12 + 5h*3/6 + 2h*2 + 21h. Give d(-4). 0 Let q(u) = u*3 + 4u2 + 5. Let m(b) = -b + 6. Let y be m(6). Let l be (y/(-2) - 4)/1. Determine q(l). 5 Let w(z) be the first derivative of -z4/4 + 5z3/3 - 3z*2/2 + z - 3. Determine w(4). 5 Suppose 2l - 5 = -3f + 3, 2l + 4 = 3f. Let x(g) be the first derivative of 2g*3/3 - g - 1. Determine x(l). 1 Let v(u) = u - 1. Let z(m) = -5m + 14. Let d(g) = -6v(g) - z(g). Let i be (-7 + 0 + 7)/(-1). Determine d(i). -8 Let w(n) = -8n. Suppose 2t - 3t - 14 = -5m, -15 = -5m. Give w(t). -8 Suppose -20 = -3a - 4w, -w + 5 = 4a - 0. Suppose -10 = -2h - af - 4f, -4h + 5f - 32 = 0. Let i(m) = m*3 + 3m2 + m - 4. Determine i(h). -7 Let q(s) be the second derivative of s5/20 - s4/3 - s3 - 3s2/2 + 9s. Give q(6). 33 Let t(g) = -3g2 + g + 2. Suppose 0 = 3k - 9, 5h + 4 - 34 = -5k. Suppose 4y = h + 5. Determine t(y). -8 Let u = -5 + 8. Let z be -1 + 0 + u + -2. Let k(j) = -j + 7. Calculate k(z). 7 Let v(o) be the first derivative of o6/360 - o5/30 - o4/12 - o3 - 3. Let b(h) be the third derivative of v(h). Determine b(4). -2 Let a = 0 - -4. Let k be (6/a)/((-3)/(-4)). Let z(p) = 1 - 2p + 2pk + 1 - 1. Calculate z(2). 5 Let d(m) be the second derivative of -m6/120 - m5/10 - m4/24 + m3/3 + 2m*2 + 6m. Let l(c) be the first derivative of d(c). Calculate l(-6). 8 Let d(k) = -8k2 + 12k - 2. Let u(f) = -3f2 + 6f - 1. Let m(t) = 2d(t) - 5u(t). Give m(-7). -6 Let d(k) = k*3 + 5k*2 - 6k + 2. Suppose -5p + 3t = -0t + 36, -4p - 22 = t. Give d(p). 2 Let o(k) = 5k + 30. Let p(t) = 2t + 10. Let z(l) = 3o(l) - 8p(l). What is z(7)? 3 Let d = 5 + 14. Suppose -2g + g = 4c - d, -5c + 4g + 29 = 0. Let k(u) = 6 + 0 + 4u - 5u. What is k(c)? 1 Let p(v) = -2v2 - 4v*3 - 3v + 3v3 + 9v - 4v - 3. Suppose 2k - 4 = 0, -5k + 16 = -2a - 2k. Let x = a + 2. Determine p(x). 0 Let b(y) be the third derivative of -y6/120 + y*5/10 +	{ "pile_set_name": "DM Mathematics" }
ive of -93287s5 - 73305s. -1865740s3 What is the first derivative of 4w*2 - 53513w + 156117? 8w - 53513 What is the second derivative of -tu*2 + 2tu + 24686u*2 + 3u - 7498 wrt u? -2t + 49372 What is the third derivative of 113x*4 - 309x*3 + 3x*2 + 17539x wrt x? 2712x - 1854 What is the first derivative of -6im4u + 10im*2 + 9iu - 371i - 20m2u - 11u + 2 wrt m? -24im3u + 20im - 40mu What is the first derivative of -117799fq + f + 11q + 550336 wrt q? -117799f + 11 What is the second derivative of -15800d5 + 8d4 - d2 + 6291d wrt d? -316000d*3 + 96d*2 - 2 Find the second derivative of -124x*5 + 414x*2 - 1003974x. -2480x3 + 828 Find the second derivative of 1029446b*2n2 + b2n + 3b*2 - 27214bn - n wrt n. 2058892b2 Differentiate h3i + 421h*3 - 2h*2i + 23717hir - 888hr wrt i. h3 - 2h*2 + 23717hr Find the second derivative of 310706l*2 + 16009l. 621412 Find the second derivative of 321910y5 + 16944y - 1 wrt y. 6438200y3 Find the second derivative of 6c*4 + 2c*3 + 1449c*2 + 58903c. 72c2 + 12c + 2898 What is the derivative of 2132g3 + 7g*2w - g*2 + 745w + 60 wrt g? 6396g2 + 14gw - 2g What is the second derivative of -2693901d2 - 3d + 73677? -5387802 Find the third derivative of -63q6 - 1216q*3 + 352268q*2 wrt q. -7560q*3 - 7296 What is the second derivative of -2517768i*4 - 579i + 166? -30213216i2 What is the third derivative of 295707r*2x*3 - 639r*2x*2 - 657r*2x + r wrt x? 1774242r2 What is the third derivative of m3z*3 - 2m*3z - 5m2z*2 - 47672mz3 - 5z*2 - 6222z - 2 wrt z? 6m3 - 286032m Differentiate -23i2k + 10155ik + 1107233k with respect to i. -46ik + 10155k Find the third derivative of -8a5b + 296a4b*2 + 22996a*2b*2 + 2b*2 wrt a. -480a*2b + 7104ab*2 Find the second derivative of 25oy3 + 327oy2 - 4oy - 10o + y*3 + 2y - 14 wrt y. 150oy + 654o + 6y Find the first derivative of -133414d - 44480. -133414 What is the third derivative of -1734296z*5 + 2z4 + z3 + 3317281z2 wrt z? -104057760z*2 + 48z + 6 What is the second derivative of 1618v4 + 212v*2 - 1274174v + 1 wrt v? 19416v2 + 424 Differentiate -1355n*3w*3 - 196361n*3 - 141w*4 wrt w. -4065n*3w*2 - 564w*3 What is the third derivative of -155610gjl*6 + 8gjl*2 + 2gjl - 2gj + gl5 + 16180gl - 3g + j wrt l? -18673200gjl3 + 60gl2 What is the second derivative of 848368t*3 - 208t - 2073 wrt t? 5090208t Find the third derivative of -79r*4 + 4065r3 - r2 - 87r + 3830 wrt r. -1896r + 24390 Find the third derivative of -46341x5 - 5x*2 - 4563 wrt x. -2780460x*2 Differentiate 34205f - 34673 with respect to f. 34205 Find the second derivative of -2q4 + 1202q*3 + 2q*2 - 252q + 509 wrt q. -24q2 + 7212q + 4 What is the second derivative of -4l3 - 12081l*2 - 673201l wrt l? -24l - 24162 What is the second derivative of -195066d*4 + 6d - 31559 wrt d? -2340792d2 What is the second derivative of 1292m*3q*2 - 97m*3q + 15m2q*2 - 5q wrt q? 2584m3 + 30m*2 Differentiate 648h*3 - 40h*2 - h - 433528. 1944h*2 - 80h - 1 Find the third derivative of -2c3l*2 + 3502998c*3l + 478818c2l*2 - 4cl2 wrt c. -12l*2 + 21017988l Differentiate 2g2 + 2gjt*2 + 7gt2 + 40g + 2jt*2 - jt - 3j - 104t*2 + t with respect to g. 4g + 2jt*2 + 7t*2 + 40 Find the third derivative of -16l*3v - 727l3 - 11034l*2v + 4l2 wrt l. -96v - 4362 What is the second derivative of 3q4 - 566q*2 + 13314q wrt q? 36q2 - 1132 Differentiate -13a*3 - 143a + 14216. -39a2 - 143 Find the first derivative of 29dv4 + 3391dv2 + 305915d wrt v. 116dv*3 + 6782dv Find the third derivative of 114816h*5 - 2h*3 + 3h*2 + 12549h. 6888960h2 - 12 What is the first derivative of 2p*2z*2 - 14p*2z + 170773p2 - 122pz wrt z? 4p*2z - 14p2 - 122p What is the derivative of 3343518df*3i*3 - 13f*3 + 2f*2i*3 + 31f*2i*2 - 570fi3 + i3 wrt d? 3343518f*3i*3 Differentiate -551cj + 2c + 57j + 61799 with respect to j. -551c + 57 What is the third derivative of -4j4 - 41155j*3 + 22464j*2 + 8j? -96j - 246930 What is the third derivative of -a5 - 61466a*3 + 2a*2 + 13734? -60a*2 - 368796 Differentiate -8422n*3x*2 + 161nx3 + 2x*3 + 474x*2 + 59 with respect to n. -25266n*2x*2 + 161x*3 What is the first derivative of 6i*3j*3 + 3i*3 + 18ijq + 9j3q - 6j2 + 4jq - 4j wrt i? 18i2j*3 + 9i*2 + 18jq What is the second derivative of -1682b*3 + 298b*2 + b - 63347? -10092b + 596 Find the third derivative of 830c4 + 1250c*3 - 23c*2 - 7393 wrt c. 19920c + 7500 What is the second derivative of -51411s3 - 2s - 5551 wrt s? -308466s Differentiate 20b*3k + 85770b2k + 2008713k - 1 wrt b. 60b*2k + 171540bk What is the derivative of 2630c3s*3t - 430c3s - 38c2s*3t + 254cs*3 wrt t? 2630c*3s*3 - 38c*2s3 Find the third derivative of f5 - 65362f4t*3 + 5f*2t*2 + 674ft3 - 11ft2 + 2t - 1 wrt f. 60f2 - 1568688ft3 Find the third derivative of -3m*3s*2 + 295m*3s - 7m3 + 40m*2s*2 + 27m*2s + ms2 + 5s*2 wrt m. -18s*2 + 1770s - 42 What is the second derivative of -4cm*5 + 34278cm2 - 29cm - c - 2m + 363 wrt m? -80cm*3 + 68556c What is the third derivative of -822b6 - 2b*5 + 8b*4 + 72952b*2? -98640b*3 - 120b*2 + 192b What is the third derivative of 126472w6 + w5 - 2w*3 + 3w*2 + 40117w? 15176640w3 + 60w*2 - 12 Find the third derivative of 1010j*2s*3 + 58j*2s*2 - 3j*2 - 34jo2s*3 - 3jo - o2s*2 wrt s. 6060j*2 - 204jo2 Find the second derivative of -5103549k*3 + 226399k wrt k. -30621294k What is the third derivative of 13df3z*3 - 35df3z*2 + 2df3z + 13df*2z*2 - 2dz3 + 5dz + 64009z*3 wrt z? 78df3 - 12d + 384054 What is the third derivative of 19221d4 - 2d*3 - 174104d*2? 461304d - 12 What is the first derivative of 1024j2 + 15j + 42258 wrt j? 2048j + 15 What is the third derivative of 15w*4 + 42820w*3 + 41w*2 - 18w - 411? 360w + 256920 What is the third derivative of -1668l*2n*4x*2 + 20l*2n*2x - l*2n*2 + 54l*2nx2 + 686ln4 - 13nx2 wrt n? -40032l*2nx2 + 16464ln What is the second derivative of 57072bs2 - bs + 180b - s + 10 wrt s? 114144b Differentiate 503i4p*2 + 120332p*2 wrt i. 2012i*3p*2 Differentiate -105o*3 + 496o*2 - 2o + 280312 with respect to o. -315o2 + 992o - 2 Differentiate -82530w3 + 58517. -247590w*2 Find the third derivative of -2689u6 + u4x - 144u*2x + 24u2 + 2ux wrt u. -322680u*3 + 24ux Find the first derivative of -jlv + 13306jv - 70lv + 358l wrt j. -lv + 13306v What is the third derivative of -239670l3 + 91670l2 + 3 wrt l? -1438020 What is the first derivative of o2 - 6473o + 119424? 2o - 6473 Find the third derivative of 30x6 + 36x*5 - 12x*3 - 464650x*2. 3600x*3 + 2160x*2 - 72 Find the third derivative of 1176z*6 - 111z*5 - 2z*3 - 313084z*2 wrt z. 141120z*3 - 6660z*2 - 12 Find the second derivative of 13831d*4 - 2d*3 - 304485d. 165972d2 - 12d Differentiate 75j2w*2 - 106jw3 - 4w*3 - 1143 wrt j. 150jw2 - 106w*3 What is the second derivative of -138407a*3 - 156832a wrt a? -830442a Find the second derivative of h3i*2 - 71508h*3i - 31i5 - 31622i*2 + 2i wrt i. 2h3 - 620i*3 - 63244 Differentiate 13391bgi*3 - 2bgi*2 - 12bg - 158gi2 + 94g - i*3 with respect to b. 13391gi3 - 2gi2 - 12g Find the second derivative of -808y3 - 30y*2 - 20y + 2462 wrt y. -4848y - 60 Find the first derivative of 17g*2x*2 - 12471g*2 + 93gx2 + x2 wrt x. 34g*2x + 186gx + 2x Find the third derivative of 11hs4 - 2hs3 + 2hs2 + 63hs - 3h + 19s4 - 114s*3 + 144s*2 wrt s. 264hs - 12h + 456*s - 684 Find the third derivative	{ "pile_set_name": "DM Mathematics" }
nder when (0 + 1 + 297)/1 is divided by r? 10 Let c(x) = 12x - 7. Let d be c(-2). Suppose h = -y + 40, -3y - 5h = -2y - 48. Calculate the remainder when (-790)/(-7) - d/217 is divided by y. 37 Let m(o) = 95o2 - 150o - 297. Let s(f) = 19f - 2. Calculate the remainder when m(-2) is divided by s(3). 53 Let v(n) = 358n + 2434. What is the remainder when v(0) is divided by 56? 26 Let m = 6420 - 6366. Calculate the remainder when m is divided by 5. 4 Let l(o) = 94o + 26. Calculate the remainder when 238 is divided by l(0). 4 Let u(q) = q3 + 9q*2 - 4q - 20. Let p be u(-9). Suppose -82 = -7d + p. What is the remainder when 55 is divided by d? 13 Suppose u + 5l + 22 = 53, 5l - 93 = -3u. Calculate the remainder when 3718 is divided by u. 29 Let l(r) = -8r + 1. Let f = -196 + 195. Calculate the remainder when 10 is divided by l(f). 1 Suppose 575 = 3d + 2d. Suppose -1521i - 21011 + 31982 + 36180 = 0. Calculate the remainder when d is divided by i. 22 Suppose 7m - 6m = 79. Let j = -14 + m. What is the remainder when j is divided by 34? 31 Let h(f) = 10f + 125. Let i be h(-13). Suppose 4z + 34 = 646. What is the remainder when z is divided by (78/i)/((-48)/80)? 23 Let l = 14 + 5. What is the remainder when l is divided by 641/4487 - (55/(-7) - 0)? 3 Let t(b) = 2b2 + 66b + 4533. What is the remainder when t(-76) is divided by 8? 5 Let h = 1654 + -1600. Suppose 896t + h = 902t. What is the remainder when t is divided by 7 + -1(-1 + 0)? 1 Suppose 5t - t + 2d = 254, 5d = -5t + 315. Let b = 68 - t. What is the remainder when 28 is divided by 15 + -4 - (b/2)/2? 8 Let a = 354 - 338. What is the remainder when 123 is divided by a? 11 Let f(t) = t2 + 4t + 5. Suppose 25 = 5g, 2c = -5g + 12 + 21. What is the remainder when 40 is divided by f(c)? 3 Let f = 38430 + -38204. Calculate the remainder when 1349 is divided by f. 219 Let d(r) = 172r*2 + 1545r - 3. Calculate the remainder when 1243 is divided by d(-9). 19 Suppose 0 = -28l + 25l + 87. What is the remainder when 314 is divided by l? 24 Let z = 57 + -54. Suppose r - 2t = 3t - 13, -3r + 3t = z. Suppose -3d = rs - 9, -3d + s = -3s - 27. Calculate the remainder when 7 is divided by d. 2 Suppose 3h + 5i + 167 - 750 = 0, -4h + i + 785 = 0. What is the remainder when 407 is divided by h? 15 Let o be 1786/6 - -5 - (-5)/(-3). Suppose 2p - 3p = 2u - o, -1530 = -5p - 5u. Calculate the remainder when p is divided by 12. 11 Suppose 28j - 5j = 184. Calculate the remainder when ((-7)/(-21))/((-4)/(-1044)) is divided by j. 7 Suppose 19k = 12k + 7. Let f(i) = -77i + 66. Let b(z) = 6z - 5. Let n(l) = 66b(l) + 5f(l). Calculate the remainder when 74 is divided by n(k). 8 Suppose 36 = -8m + 14m. What is the remainder when 89 is divided by -4 - -444/(m - -2)? 17 Let y(s) = 5s - 7. Let b be y(5). Let r = 29 - b. Let g = -72375 - -72380. What is the remainder when r is divided by g? 1 Let l(s) = s - 18. Let f be l(22). Suppose -5j + fi + 4 = 0, 4j - 4 = -3i + 6i. Calculate the remainder when 15 is divided by j. 3 Let z(k) = -k2 + 47k - 165. Let t be z(4). Suppose -4h + 3d = -2010, d + 502 = -6h + th. Calculate the remainder when h is divided by 39. 36 Suppose 5v - 287 = -4b + 300, -v + 5b = -129. Let l = -350 + 415. What is the remainder when v is divided by l? 54 Suppose -3a - 15a - 342 = 0. Let l(r) = 2r*2 + 40r + 55. Calculate the remainder when 116 is divided by l(a). 14 Suppose 326n = -354n + 1865920. What is the remainder when n is divided by 89? 74 Suppose -3b - 5l + 5185 = 0, 6b - 8610 = b - 2l. What is the remainder when b/(-60)(-15)/2 is divided by 12? 11 Suppose 0 = -29p - 91726 + 272396. Calculate the remainder when p is divided by 201. 200 Let h = 17085 + 4296. Calculate the remainder when h is divided by 99. 96 Let r(n) = 5n2 + 10n + 3. Let f be r(-2). Suppose -4y - h = -253, 0y + y - 55 = -fh. What is the remainder when 190 is divided by y? 62 Let n(r) = 31r + 184. What is the remainder when n(2) is divided by 125? 121 Suppose 7m - 11m = -336. Let i = 94 - m. What is the remainder when 42 is divided by i? 2 Let k(q) = q + 1. Let i(t) = 5t - 3. Let l(h) = -i(h) + 4k(h). Let f be l(4). Calculate the remainder when 68(f/(-2) - (5 + -8)) is divided by 13. 11 Let o = 6794 + -6634. What is the remainder when 736 is divided by o? 96 Let l be 3 - (0 - (-3 + 0)). Let v = l + -23. Let t = v + 34. What is the remainder when t is divided by 6? 5 Let n(i) = i3 - 13i*2 - 3i + 191. Calculate the remainder when 1666 is divided by n(13). 146 Let p = 105 + -162. Let z(j) = -j*3 + 23j*2 - 3j + 6. Let s be z(23). Let k = p - s. Calculate the remainder when 14 is divided by k. 2 Let z = 3129 + -3016. Calculate the remainder when 5308 is divided by z. 110 Suppose -p - p = -48. What is the remainder when 42/189 - (34384/36)/(-4) is divided by p? 23 Let n be ((-2)/(-5))/(5/450). Suppose -3f + 1 = d - 11, n = 2d + 2f. Suppose 0 = -da + 24a - 144. What is the remainder when a is divided by 10? 8 Let n(r) = r2 - 7r - 12. Let k be n(9). Suppose kb + 197 = 635. Suppose b = 2g - 33. Calculate the remainder when g is divided by 20. 13 Let m(y) = 55y - 2. Suppose -5z = 6c - 9c - 275, 5z - 2c = 275. What is the remainder when m(4) is divided by z? 53 Suppose 50l = 3094 + 4306. What is the remainder when l is divided by 98? 50 Let q be (-4)/(-6)3 - 0/1. Suppose 5j + 22 = q. Let p = 20 - j. Calculate the remainder when p is divided by 9. 6 Let o(s) = -38s - 78. Let f be o(-2). Let r = 27 - f. Calculate the remainder when r is divided by (-2 - -9 - -1) + 2. 9 Let y(f) = 24f - 182. Calculate the remainder when 482 is divided by y(9). 6 Let s(i) = -13i*2 + 474i - 156. Calculate the remainder when 73 is divided by s(36). 13 Let l be 9478/210 - 2/15. Suppose 47x - 56 = lx. What is the remainder when 85 is divided by x? 1 Let m = 54088 - 54062. Let t(b) = 18b2 + 2b. Calculate the remainder when t(2) is divided by m. 24 Let p be (-6)/214/21. Let i be (5 - 3)/(3 + p). Suppose 0 = -2j + iq + 116, 4q = -2j + 3q + 119. Calculate the remainder when j is divided by 9. 5 Suppose 2o - 2c - 12 = 0, -3o + 6 = -4o - 2c. Suppose -ok + 88 = 2k. Suppose 86z = 66z + 280. What is the remainder when k is divided by z? 8 Let v = 98 + -84. Suppose 3f - 3z - 180 = 0, 4f + vz - 13z - 230 = 0. Suppose -24 = -2h - 0h. Calculate the remainder when f is divided by h. 10 Let u be (-362)/(-10) - (-8)/(-40). Suppose -5p + 3t = -0p - 69, 4p + 4t - u = 0. Suppose 1 - p = -f. What is the remainder when 30 is divided by f? 8 Suppose -3s = 4t - t - 537, -4s = 5t - 716. Suppose -s = -3r - 17. Suppose 3u - 15 = 0, 5u - 60 + 7 = -2l. What is the remainder when r is divided by l? 12 Suppose -2o + 76 - 56 = 2k, 3o + 2k - 25 = 0. What is the remainder when 821 is divided by o? 1 Let r(g) = -4848g - 12328. What is the remainder when r(-3) is divided by 223? 209 Let k(t) = 8t2 - 2t + 1. Let v(m) be the first derivative of 7m3/3 - m2 + m + 7. What is the remainder when k(1) is divided by v(1)? 1 Let l = -550 - -1463. What is the remainder when l is divided by 10? 3 Suppose 237t = 216t + 105. Calculate the remainder when 638 is divided by t. 3 Calculate the remainder when 1040 is divided by (-4(-1 + 9/6))/(30/(-1005)). 35 Let f(t) = 4t2 + 31t + 28. Let r be f(-13). Calculate the remainder when (-341)/(-7) - (-86)/r is divided by 17. 15 Suppose -37 = -5u + 63. Suppose 30p = 42p - 2628. What is the remainder when p is divided by u? 19 Suppose 0 = -3m + g + 22, -7 + 13 = m - g. Suppose 0 = -2q - 2q + 108. Let o = -4 + q. Calculate the remainder when o is divided by m. 7 Let i = 1 + 6. Let r be ((-15)/(-6))/((-3)/90). Calculate the remainder when 3/2100/r - -19 is divided by i. 3 Let b(r) be the third derivative of 0 - r2 - 1/12r*4 + 0r + 2/3r3. Calculate the remainder when 53 is divided by b(-5). 11 Let r be -1 + 4 + 0 + 234. Suppose -2x = x - r. Let j = x - 56. What is the remainder when 67 is divided by j? 21 Suppose 52244 + 34699 = 199w - 52357. Calculate the remainder when w is divided by 175. 0 Suppose 3a - 251 = z, 2z + 430 = 5a - 2z. Suppose 8j = 46 + a. Suppose 5*	{ "pile_set_name": "DM Mathematics" }
s the third derivative of u(c) wrt c? 180c2 + 90 Find the first derivative of -368w - 136w + 681 - 384w - 480w + 358w wrt w. -1010 Let a be 5((-3)/(-12) - 29/20). Let r be (-2)/((-10)/a2/(-5)). What is the first derivative of -6s3 - 4s*r - 4s*3 + 15 wrt s? -42s*2 Let q(o) = 32 - 11 + 1 - 2o. Let m(t) = 2t - 22. Suppose -5j - 5 - 10 = 0. Let c(i) = jm(i) - 2q(i). Differentiate c(b) with respect to b. -2 Let l = 195 + -191. What is the third derivative of 36b2 - 760b + 33b2 - 6b*l + 760b wrt b? -144b Let n(p) = -40p*2 - 4p - 1. Let b(v) = -201v2 - 22v - 5. Let i = -369 + 363. Let a(c) = ib(c) + 33n(c). Find the first derivative of a(d) wrt d. -228d Let t(q) be the second derivative of -197q*4/12 - 554q*3/3 - 9q + 82. Find the second derivative of t(k) wrt k. -394 Let j(u) = -6 - 4 + 14u + 2 + 6. Let h be j(1). Find the third derivative of -18a*2 + 21a*6 - 44a*6 - ha*6 wrt a. -4200a*3 Suppose 0 = 3x - 20x + 85. Find the second derivative of -3m*2 + 331m*x - 4m*3 - 322m*5 + 4m*3 + 3m wrt m. 180m3 - 6 Let p(a) = 371a*4 + 941a*2 - 14a + 4. Let i(b) = b*2 + 3b - 1. Let s(f) = -4i(f) - p(f). What is the third derivative of s(t) wrt t? -8904t What is the second derivative of -4677w2 - 447w*2 + 273w - 1162w - 1247w - 339w wrt w? -10248 Let a be -92 - -96 - (-10)/2. What is the second derivative of 25 - 16 + 3c - a - 56c3 wrt c? -336c Let f(u) = 33u3 - 15u*2 + 7u + 2662. Let d(b) = -2b3 - 5b*2 + 3b - 1. Let t(a) = -3d(a) + f(a). Differentiate t(j) with respect to j. 117j*2 - 2 Let o(d) be the third derivative of -3 + 23/8d*4 + 0d + 26d3 - 18d*2. Differentiate o(b) wrt b. 69 Find the third derivative of 2g*2 + 1233g*3 + 5918 + 0g*2 - 5609 wrt g. 7398 Let p(x) be the second derivative of -231x5/20 + x3 + 111x2 + 2x + 291. Differentiate p(j) with respect to j. -693j2 + 6 Suppose o - 24 = p - 2o, -3o + 72 = -5p. Let j be p/(-16) - (-2)/813. Find the third derivative of -23x*2 + jx*3 + 7x*3 + 7x2 wrt x. 66 Let g(k) be the first derivative of -k6 - 35k4/12 - 67k - 66. Let b(r) be the first derivative of g(r). What is the third derivative of b(p) wrt p? -720p Find the second derivative of -x4 - 376 + 350 + 7x*3 - 8x + 8x3 + 9x*2 - 23x - 4x wrt x. -12x*2 + 90x + 18 What is the third derivative of -41 + 3s3 - 5s*3 + 34 + 5s*3 - 41s*2 + 1159s*4 - 308s*4 wrt s? 20424s + 18 Suppose -7507h = -7513h + 13 + 5. Let b(i) be the second derivative of 0 - 8i + 0i*2 - 10/3i*h - 2/3i*4. What is the second derivative of b(y) wrt y? -16 Let k(y) be the third derivative of -23y*5/4 + 391y4/12 - y3/3 - 307y2. What is the second derivative of k(z) wrt z? -690 Let a(k) = -k3 + k2 - 6. Let l(h) = -4103h*3 - 5h*2 - 390. Let j(q) = 5a(q) + l(q). What is the first derivative of j(p) wrt p? -12324p2 Let v(k) be the second derivative of 0k*6 - 6 - 17/14k*7 - 4k - 3k4 + 0k*3 + 0k*5 + 0k*2. Find the third derivative of v(c) wrt c. -3060c*2 Let a(u) = 6u*3 - 2u*2 - 3u. Let b(d) = 26d3 - 3813d*2 - 13d + 2249. Let z(g) = 4a(g) - b(g). Find the second derivative of z(c) wrt c. -12c + 7610 Let v(s) = s*5 + 48s*3 + 1491s + 8. Let u(b) = -b*5 - 143b*3 - 4472b - 22. Let z(g) = 4u(g) + 11v(g). What is the second derivative of z(j) wrt j? 140j3 - 264j Let j(h) be the first derivative of -610h4 - 234h*2 - h + 6468. Find the second derivative of j(w) wrt w. -14640w Let l(f) be the first derivative of 1651f6/2 - f2 - 6186f + 3702. What is the second derivative of l(r) wrt r? 99060r3 Suppose 31 = 7a + 3. Find the third derivative of 5j - 27j*4 + 317 - 317 - aj - 8j2 wrt j. -648j What is the second derivative of 5p + 170p + 37472 - 37473 - 19p5 + 279p*5 wrt p? 5200p*3 Let c(r) = r + 8. Let x be c(-4). Let j be (x/18)/(4/36). Find the second derivative of 9m*2 + 10mj + m2 + 2m + m2 wrt m. 42 Find the second derivative of 531w*5 - 1732w*5 - 209w - 1327w5 wrt w. -50560w3 Let x(c) be the third derivative of -c8/336 + 233c7/105 + c6/30 + 8707c*5/60 + 22c*2 - 30c. What is the third derivative of x(l) wrt l? -60l2 + 11184l + 24 Let q(h) be the second derivative of -22h - 1/4h*4 - 117/2h*2 - 3h*3 + 0. What is the first derivative of q(x) wrt x? -6x - 18 Suppose -6z + z - 1790 = 0. Let t be 3/18 - z/12. What is the second derivative of -2897i*2 + 29i*4 + 2897i*2 + ti wrt i? 348i2 Let h(i) = -114i*3 + 5i*2 - 229. Let z(v) = 2v3 + v2 + 1. Let b = -679 + 680. Let a(m) = bh(m) - 5z(m). Differentiate a(x) wrt x. -372x2 What is the second derivative of 84b*2 + 4 + 279b + 85b + 104b - 168b2 + 2b*3 - 470b*2 wrt b? 12b - 1108 Let w = 209 - 207. Find the third derivative of -1 + 97dw - 170d*2 + 85d*2 + 45d*6 wrt d. 5400d*3 Suppose 3h = 2j - 55, -5j + 115 = -0j - 3h. Suppose 0 = 2n - j + 16. Differentiate 3 + 2 + 1 + 13u*n with respect to u. 26u Let f = -158 + 161. Find the third derivative of 23if - 16i*2 + 2i*4 - 46i*3 + 21i*3 wrt i. 48i - 12 Let z(w) = 690w4 + 4w*3 + 4w + 214. Let m(l) = -l4 - l3 - l + 2. Let q(d) = -4m(d) - z(d). Differentiate q(c) with respect to c. -2744c*3 Let t(c) = -1246c*2 + 4c + 1463. Let l(f) = 2f2 + f + 6. Let s(p) = -4l(p) + t(p). Differentiate s(r) wrt r. -2508r Let l(k) = -6874k*3 - 5k*2 - 133k - 17. Let n(o) = -6871o3 - 6o*2 - 131o - 18. Let b(y) = 6l(y) - 5n(y). Find the second derivative of b(z) wrt z. -41334z Let b(f) = 4129f*4 - 2f*2 - 5725. Let c(u) = 4128u*4 - 2u*2 - 5724. Let l(z) = 3b(z) - 2c(z). What is the first derivative of l(s) wrt s? 16524s*3 - 4s Let f(g) = 2g + 1. Let v be f(3). Suppose -i - 1 = 0, -x + 3i + 11 = vi. Find the third derivative of -5q + 4q + q + q3 + xq*2 wrt q. 6 Let n(o) be the second derivative of -141o5/4 + o4/12 - 38o3/3 - 17o*2/2 - o + 195. What is the third derivative of n(b) wrt b? -4230 Let g(c) = -4263c*2 - 5085c - 4. Let t(p) = 4204p2 + 5086p + 3. Let v(w) = -3g(w) - 4t(w). What is the second derivative of v(j) wrt j? -8054 Let d(z) = -2102z - 8009. Let n(u) = 2181u + 8009. Let g(p) = 4d(p) + 5n(p). What is the derivative of g(r) wrt r? 2497 Let t(a) be the second derivative of -139a6/5 + 73a*4/12 + 1308a. Find the third derivative of t(x) wrt x. -20016x Let g(a) be the first derivative of a3 - 184 + 0a*6 - 2/7a*7 + 0a*4 + 0a + 26/5a5 + 8a*2. Find the third derivative of g(d) wrt d. -240d*3 + 624d Let a = 74 + -64. Suppose -ay = -6y - 40. Find the second derivative of 3h + yh + 2h4 - h - 2h wrt h. 24h2 Let p(c) = -700c*4 - 56c*3 + 994c - 56. Let d(j) = -j4 - j3 - j - 1. Let o(y) = -56d(y) + p(y). Find the second derivative of o(k) wrt k. -7728k*2 Find the second derivative of -1999t - 41 - 2551t2 + 1012t + 1013t wrt t. -5102 Let b(o) be the third derivative of 267o*2 + 0o*4 + 0o - 38o3 + 0 + 57/40o*6 + 0o*5. Find the first derivative of b(s) wrt s. 513s*2 Let r(w) = -497w*3 + 1073w - 30. Let f(h) = 2h3 + 2h - 6. Let m(x) = 5f(x) - r(x). What is the second derivative of m(n) wrt n? 3042n Let u be 2/(-6)(-140 + 1 + 1). Find the second derivative of 94o*4 + 101o + uo + 43o*2 - 81o*2 + 38o + 36o2 wrt o. 1128o*2 - 4 Let d(y) = -119y*4 + 6y*3 - 6y - 64. Let b = -19 + 13. Let h(q) = q4 + q3 - q. Let v(u) = bh(u) + d(u). Differentiate v(a) wrt a. -500a*3 Let l(i) be the third derivative of 4i7/3 - i5/15 - 11i3 + 39i*2 + 2i. Find the third derivative of l(r) wrt r. 6720r Let t(u) = 1967u*2 - 24u + 21. Let b(i) = 984i2 - 11i + 10. Let j(c) = 9b(c) - 4t(c). Find the second derivative of j(g) wrt g. 1976 Let r(g) = -2546g + 3372. Let f(a) = -1273a + 1686. Let h(v) = 5f(v) - 3r(v). Differentiate h(t) wrt t. 1273 What is the derivative of 1889 - 5057f - 34 + 2330f - 2410f wrt f? -5137 What is the second derivative of 21536h - 42889h + 4h*2 + 21467h + 409h3 - 4h*2 wrt h? 2454h Suppose -8z + 0 = -8. Let u(f) = 23f*3 + 2f**2 + f - 2. L	{ "pile_set_name": "DM Mathematics" }
5z - 6 What is the second derivative of 226v4 + v3 + 77v - 2? 2712v*2 + 6v Find the third derivative of ko4 + 66ko3 + 58ko2 wrt o. 24ko + 396k Find the second derivative of 2c2dk - 12c*2k*2 - 7c*2 + 2cdk*3 - 8cdk - 8dk*3 wrt k. -24c*2 + 12cdk - 48dk What is the second derivative of 72z4 + 2z - 13 wrt z? 864z2 Find the second derivative of -10b*3 + 11b*2w*2 - 36bw2 - b wrt b. -60b + 22w2 Find the second derivative of 2dn4 + 11dn + 142n*5 + 2n wrt n. 24dn*2 + 2840n*3 Find the second derivative of 633l*4 + 326l. 7596l2 What is the derivative of 27kp2 - k - 225p*2 wrt k? 27p2 - 1 Differentiate -i3q3 + 22i*3 - 9iq + 505q*3 with respect to i. -3i*2q*3 + 66i*2 - 9q Find the second derivative of -26829j4 - 2604j wrt j. -321948j2 What is the third derivative of 3f*5io - 22f*4o - f*3o - f*2i + 2f2o + 19io wrt f? 180f2io - 528fo - 6o Differentiate -20t2y2 - t2y - 3887t*2 - 4ty2 wrt y. -40t*2y - t*2 - 8ty What is the third derivative of -544i*6 + 1324i*2 wrt i? -65280i3 Find the second derivative of -k2s + 66k*2 + ks - 2k - 6s wrt k. -2s + 132 Differentiate -34bry + br + 36by - b + 9ry - 2 wrt r. -34by + b + 9y Find the second derivative of 169bh*2z*2 - bh*2z - 5bz + 2b - 4h*2 wrt z. 338bh2 What is the third derivative of -3a*4 + 57a*3z*2 - 2a*3z + 25a2 + 19z*2 wrt a? -72a + 342z2 - 12z What is the second derivative of 19h3p*3 - 22h*3p - h*2p*3 + hp - 1 wrt p? 114h3p - 6h2p Find the third derivative of 1220h3 - 7h*2 + 46h - 1. 7320 What is the third derivative of 1090r5 + 59r*2 + r + 7? 65400r2 Find the third derivative of -a2i3 - a2 - 4ai2 + 2a + 35i3 wrt i. -6a*2 + 210 What is the second derivative of -15011r*3 - 739r + 10? -90066r What is the derivative of 2p*2 - 742p - 680? 4p - 742 What is the first derivative of -2309p - 4611 wrt p? -2309 Differentiate -2h2k*3 + 69h*2k + 102k3 - 2 wrt h. -4hk3 + 138hk Find the third derivative of -585b6 - b2 - 321. -70200b3 What is the derivative of -3o*2 - 7ow2 - 2w*2 - 16 wrt o? -6o - 7w2 What is the second derivative of -2o*5 - 45o*2 + 270o wrt o? -40o3 - 90 Differentiate 2a*3d + 2a3o - 6a2dr - 3a*2or - 2a*2r + 14ado + 5ad with respect to o. 2a*3 - 3a*2r + 14ad What is the second derivative of -93b2h*2n + 3b2n - 3bh*2n - 9bn - 2n wrt b? -186h*2n + 6n Find the third derivative of -5b*4 + 95b*3 - 7b*2 - 72b - 2. -120b + 570 Find the first derivative of cm*2q - 267cq*2 - 50m*2 + 2q2 wrt c. m2q - 267q*2 Find the third derivative of -754o*4x3 - o4x + 2o*2x*3 + 1051o*2x wrt o. -18096ox*3 - 24ox Differentiate -6o*2 - 16o - 12 wrt o. -12o - 16 What is the derivative of 224f*2x + 14x + 5 wrt f? 448fx Find the third derivative of 2d*3s*3w*3 + 6d*3s*2w*2x + 2d3s*2 - 5d*2s*2w3 + d2w3x + 2s3w*3 + 42s*3x wrt s. 12d3w*3 + 12w*3 + 252x Differentiate 3c3op - 176c*3o + 3c2o - 52cop + 7c - 2op with respect to p. 3c3o - 52co - 2o What is the second derivative of -3c*2n*2 + 10c*2np2 - 183c*2p + 7n2p*2 + 3p*2 + 1 wrt p? 20c*2n + 14n2 + 6 Find the second derivative of -14614b*5 - 20b + 72. -292280b3 Find the third derivative of 1144m*3s*3 + 3m*3 + 2m*2s*2 - 10s*2 wrt s. 6864m*3 Find the third derivative of -2q*3u*3 - 3q*3u - q*3 - 19qu4 - 259u*4 + 26u*2 - 5u wrt u. -12q3 - 456qu - 6216u Find the second derivative of -322w2 - 471w wrt w. -644 What is the second derivative of 484v5 + 3v4 - v3 + 5072v? 9680v*3 + 36v*2 - 6v What is the derivative of -3844g3 - 794 wrt g? -11532g*2 Find the second derivative of 35b*2j*2s - b*2 - bj*2qs - 2bjqs + bjq - 22j*2qs + 4qs wrt j. 70b*2s - 2bqs - 44qs What is the third derivative of 3q*4 - 73q*3 - 100q*2? 72q - 438 Find the second derivative of 197j2 + 55j wrt j. 394 Find the third derivative of -214p3 + 180p*2. -1284 What is the second derivative of -9a*5x + 5a4x + 2a3 - 439ax wrt a? -180a*3x + 60a2x + 12a Differentiate -801m*3s - 2m3 + 2m*2s - 147s with respect to m. -2403m*2s - 6m2 + 4ms What is the second derivative of 172k*5 + 89k wrt k? 3440k3 What is the third derivative of 2a*5dp - 13a*3dp + 10a*3d - a*2dp + d + p wrt a? 120a*2dp - 78dp + 60d Find the first derivative of 1859m3y - 9645m3 + 2y wrt y. 1859m3 + 2 What is the derivative of 3648j - 1881 wrt j? 3648 What is the second derivative of -3a2y*3 - 2a*2 + 61ay4 - 177ay wrt y? -18a*2y + 732ay2 Find the third derivative of i5l + 105i*3l - 9i2l - 3i2 wrt i. 60i*2l + 630l Find the third derivative of -166i*3n + 2i2 - n - 3 wrt i. -996n What is the second derivative of -52dry2 - 12dr - 7dy wrt y? -104dr Find the third derivative of 28il3 + 11il2w + il2 - l3w - 2l2w wrt l. 168i - 6w Find the third derivative of -169h4n - 2h4 - h3n + 4h2 + 531hn wrt h. -4056hn - 48h - 6n Find the second derivative of -24r*3t*2 - 2r*3 - 7rt - 13r + 2t5 wrt t. -48r*3 + 40t*3 Find the second derivative of -764d*2q*3 - 14d*2 - 2q - 13 wrt q. -4584d2q What is the first derivative of x*3 + 47x - 339 wrt x? 3x2 + 47 Find the first derivative of 12j*3m - 286j3 - j2m + 3j - 60m wrt m. 12j3 - j2 - 60 Find the second derivative of -20u*4 + 35u*3 - 1223u + 2 wrt u. -240u2 + 210u What is the derivative of 697y + 285 wrt y? 697 What is the third derivative of 5145z6 - z2 - z + 1418 wrt z? 617400z3 What is the second derivative of -59b*2 + 22b - 15 wrt b? -118 What is the third derivative of -3d5u - 5d5 - 37d*3 - 1112d*2 + du wrt d? -180d2u - 300d2 - 222 Find the second derivative of -9f*3g - 51f2g*2 + 2fg2 - 3f + 6g2 wrt f. -54fg - 102g*2 What is the second derivative of 31a*4 - 3a + 7 wrt a? 372a2 Find the third derivative of 12d*6i - 6d3i*3 + 5d*2i*3 - 2d*2i*2 - 8di3 wrt d. 1440d*3i - 36i3 What is the second derivative of 884r*4 + 4r*2 - 2r + 6997? 10608r2 + 8 What is the second derivative of -3c*5 - 15c*4 - 4c + 1 wrt c? -60c3 - 180c*2 What is the derivative of -3js2x*3 - 89js2x2 - s2x2 - 120sx + x3 wrt j? -3s*2x*3 - 89s*2x*2 What is the third derivative of 600i*6 - 4i5 - i3 + 269i2 - 7i? 72000i3 - 240i*2 - 6 What is the third derivative of -1164l*4 + 2l*2 + 5l - 2 wrt l? -27936l Differentiate -i3k*2 + 7i*3p - 15ik*3 - 2ik2p2 - k3p2 wrt p. 7i*3 - 4ik2p - 2k3p What is the derivative of 2137k2 + 16 wrt k? 4274k What is the second derivative of -29h3n*2p + 3h3np + h3p + 4hn*2p - 2n5p + 3n wrt n? -58h*3p + 8hp - 40n3p What is the third derivative of -7622h6 - 3456h*2 - 1? -914640h*3 What is the derivative of 978j*2 + 2459? 1956j Differentiate -8c2 - c + 175 with respect to c. -16c - 1 Differentiate 24msxy + msy + 4sx + 18s + 2y - 2 with respect to x. 24msy + 4s Find the first derivative of -2189m - 3547. -2189 Find the third derivative of 453m*3 + 318m*2 wrt m. 2718 What is the derivative of 1603m - 2675? 1603 What is the first derivative of -22qs*3t + 16qs*2t - 65s3t wrt q? -22s3t + 16s2t What is the derivative of -3u3w*2 + 24uw2 + 340w*2 + w wrt u? -9u*2w*2 + 24w*2 Find the third derivative of -3437p*3t*3 + 1398p*2 - pt*3 wrt p. -20622t*3 What is the third derivative of -133f*3 - 3f*2 + 3f wrt f? -798 What is the first derivative of 373l4 - 2l - 1736? 1492l3 - 2 Find the first derivative of 2p*4w*2 - 2p*4 + 16p*2w + 17w2 + 2 wrt p. 8p*3w*2 - 8p*3 + 32pw Differentiate 2295	{ "pile_set_name": "DM Mathematics" }
292410 Calculate the common denominator of -31/20332 and -31/8840. 203320 Find the common denominator of -137/3216 and 161/45828. 183312 What is the common denominator of 67/210 and -43/107790? 754530 What is the common denominator of -73/15180 and 6/115? 15180 Calculate the common denominator of -149/22002 and 16/473043. 946086 Calculate the smallest common multiple of 165 and 942. 51810 What is the smallest common multiple of 250 and 952400? 4762000 What is the smallest common multiple of 18 and 3075052? 27675468 Calculate the common denominator of -47/48 and -17/489198. 3913584 Find the common denominator of -127/990 and 193/715860. 7874460 Find the common denominator of -113/4470 and -88/51405. 102810 Calculate the common denominator of -49/74030 and -113/220. 148060 Calculate the least common multiple of 1425897 and 27. 1425897 What is the lowest common multiple of 44872 and 628208? 628208 Calculate the smallest common multiple of 1521 and 8788. 79092 Calculate the lowest common multiple of 70266 and 1176. 281064 Calculate the smallest common multiple of 32 and 97376. 97376 Find the common denominator of -39/136 and -133/49488. 841296 Find the common denominator of 53/198098 and -81/8. 792392 Calculate the common denominator of -98/471735 and -50/351. 18397665 What is the common denominator of 80/155397 and -2/5049? 1398573 What is the common denominator of 44/363485 and 51/6799? 4725305 Calculate the common denominator of 85/153252 and 10/39. 1992276 What is the lowest common multiple of 63710 and 25484? 127420 What is the least common multiple of 388265 and 35? 2717855 What is the least common multiple of 1202526 and 648? 4810104 Calculate the least common multiple of 384 and 61920. 247680 Calculate the common denominator of 76/195 and 103/108498. 542490 What is the smallest common multiple of 275220 and 27522? 275220 Calculate the lowest common multiple of 67 and 65. 4355 Calculate the common denominator of -5/3834 and -53/702. 49842 Find the common denominator of -1/34903 and -85/12692. 139612 What is the least common multiple of 27 and 61302? 551718 Calculate the common denominator of -52/1629 and 73/5985. 1083285 What is the least common multiple of 1449 and 210749? 1896741 Find the common denominator of 53/1830693 and -101/1108. 7322772 What is the smallest common multiple of 107772 and 399? 2047668 Calculate the lowest common multiple of 160136 and 4328. 160136 What is the smallest common multiple of 37632 and 3577? 2747136 What is the lowest common multiple of 38979 and 153? 662643 Calculate the lowest common multiple of 3696 and 7546. 181104 What is the common denominator of -149/8274 and -53/3? 8274 Calculate the least common multiple of 1504503 and 121. 16549533 Calculate the smallest common multiple of 114 and 1152. 21888 Calculate the common denominator of 33/14 and -5/2338. 2338 Calculate the common denominator of -97/9846 and 27/9299. 167382 Find the common denominator of -55/46854 and -59/1370. 234270 What is the common denominator of -38/39077 and -101/138? 234462 What is the least common multiple of 10686 and 73021? 438126 Calculate the common denominator of 173/60 and -55/18252. 91260 Calculate the common denominator of -163/2640 and 169/6960. 76560 Calculate the common denominator of 23/10812 and 79/228. 205428 Find the common denominator of -43/590 and 48/6313. 63130 Find the common denominator of -36/68365 and 58/5445. 615285 What is the smallest common multiple of 169910 and 130? 169910 Find the common denominator of 38/20085 and 47/147. 984165 Calculate the smallest common multiple of 615 and 255. 10455 What is the common denominator of -17/1716 and 97/6760? 223080 Calculate the lowest common multiple of 19428 and 262278. 524556 Find the common denominator of 21/2 and 14/584849. 1169698 What is the lowest common multiple of 99 and 9918? 109098 Calculate the lowest common multiple of 57807 and 36. 231228 What is the least common multiple of 8938 and 2? 8938 Calculate the smallest common multiple of 3038 and 296205. 592410 What is the lowest common multiple of 15699 and 235485? 235485 Calculate the least common multiple of 628 and 13345. 53380 Find the common denominator of 103/17486 and 53/57454. 402178 Calculate the lowest common multiple of 135 and 8870. 239490 Find the common denominator of 41/5860 and -107/180. 52740 Find the common denominator of -89/34344 and 7/24. 34344 Calculate the lowest common multiple of 304476 and 8. 608952 Find the common denominator of -103/7708 and -151/4512. 184992 Calculate the common denominator of 58/81225 and -68/9. 81225 What is the smallest common multiple of 210 and 1395? 19530 What is the common denominator of -97/500 and -13/122? 30500 What is the smallest common multiple of 1876 and 5829? 163212 What is the common denominator of 22/21413 and -57/8? 171304 Calculate the common denominator of 93/1734890 and -67/114. 5204670 What is the lowest common multiple of 5604 and 44? 61644 Calculate the common denominator of -59/22 and 151/36306. 399366 Calculate the lowest common multiple of 25836 and 612. 1317636 Calculate the lowest common multiple of 48 and 928. 2784 Find the common denominator of 109/6 and -85/241872. 241872 What is the least common multiple of 38590 and 1340? 5171060 What is the common denominator of -53/8036 and -101/42? 24108 Calculate the least common multiple of 7790 and 8265. 677730 Calculate the common denominator of -9/11 and 57/21373. 21373 Find the common denominator of 175/24684 and 55/1632. 197472 Calculate the common denominator of 27/24955 and 107/49910. 49910 What is the lowest common multiple of 166144 and 96? 498432 Calculate the common denominator of -51/2092 and 8/39225. 156900 What is the common denominator of -31/413875 and -57/188125? 2069375 What is the common denominator of 56/74259 and 2/4237? 1410921 Find the common denominator of 57/1816 and -119/80. 18160 Find the common denominator of -53/42760 and -85/16. 85520 Calculate the common denominator of 34/551 and 7/684. 19836 Calculate the common denominator of 27/10 and 119/4110. 4110 Calculate the common denominator of -131/337110 and 57/52880. 2696880 Calculate the common denominator of -179/6660 and -53/60. 6660 What is the smallest common multiple of 105 and 11319? 56595 What is the common denominator of 53/21015 and 35/123? 861615 What is the common denominator of 71/220 and 33/23600? 259600 Calculate the common denominator of -67/103890 and -53/6. 103890 Calculate the least common multiple of 18960 and 660. 208560 Calculate the common denominator of -48/356771 and -71/82970. 3567710 What is the common denominator of 89/85226 and -143/12? 511356 Calculate the lowest common multiple of 77650 and 427075. 854150 What is the least common multiple of 61365 and 306825? 306825 Calculate the least common multiple of 48040 and 1110925. 8887400 Find the common denominator of -46/20905 and 107/54. 1128870 Find the common denominator of 11/210 and 17/570. 3990 Find the common denominator of -31/2330 and -131/53124. 265620 Calculate the smallest common multiple of 37575 and 142785. 713925 Find the common denominator of 61/9984 and -77/576. 29952 Calculate the common denominator of 65/4288 and 23/584. 313024 Calculate the common denominator of -43/33270 and -12/55. 365970 Calculate the lowest common multiple of 17479 and 2270. 174790 Calculate the smallest common multiple of 1 and 152812. 152812 What is the least common multiple of 126 and 8043? 48258 Find the common denominator of 41/3933 and -43/466716. 1400148 Calculate the common denominator of -49/1089 and 103/39688. 357192 Calculate the least common multiple of 7 and 374415. 2620905 Find the common denominator of -97/71420 and 61/228. 4070940 Find the common denominator of 1/50890 and 23/20356. 101780 Calculate the lowest common multiple of 3483 and 5289. 142803 What is the common denominator of -11/5 and 49/267174? 1335870 Find the common denominator of -163/150306 and -21/10. 751530 Calculate the lowest common multiple of 2316 and 24. 4632 Calculate the common denominator of -11/4419 and 67/164976. 494928 Calculate the common denominator of 45/832 and -61/97968. 391872 What is the common denominator of 61/455 and -57/3244? 1476020 Ca	{ "pile_set_name": "DM Mathematics" }
s the third biggest value in l, 0.5, 0? l Let r = -181/4 + 45. Let t be (19/(-209))/((-1)/2). What is the third smallest value in r, -3/4, t? t Let r = -0.5 + 0.4. Which is the third biggest value? (a) r (b) 0.3 (c) -2 c Suppose 0o = 5o - 15, 5n + 2o - 26 = 0. Let t = -7 + n. Which is the third biggest value? (a) t (b) 3/2 (c) 3/7 a Let s be ((5 - 5) + 183/95)1. Let v be ((-48)/(-10))/(19/10). Let f = v - s. Which is the second biggest value? (a) 0.5 (b) 2/13 (c) f a Let x be (-1)/(-3) - (-10)/(-21). Let m = 0.1 - 2.1. What is the third biggest value in 2/3, x, m? m Let u = 0.17 + 0.23. Which is the third smallest value? (a) -0.2 (b) 4 (c) u b Let a = 75 - 35. Let n be ((-8)/a)/((-18)/10). What is the third biggest value in 0.2, 0.01, n? 0.01 Let y be 6/(-9) - 26/6. Let m = 4.3 - -0.2. Let p = m + 0.5. Which is the smallest value? (a) y (b) -2 (c) p a Let i = -101 + 107.9. Let v = 7 - i. Which is the third smallest value? (a) v (b) 4 (c) -1 b Let h = -21.6 - -22. Let q = -0.22 - 0.08. What is the third smallest value in q, -0.4, h? h Let p = 0.01 + 0.29. Let t = -2 + 6.6. Let z = 5 - t. Which is the third biggest value? (a) p (b) z (c) -4 c Let h = -6.7 + 7. Let r = 0.4 - 5.4. Which is the second smallest value? (a) r (b) -4 (c) h b Let d be (-2)/8 - 185/(-20). Suppose 2p + d = 1. What is the smallest value in -0.1, p, -2? p Let z = -32/5 - -197/30. What is the third smallest value in 1, z, 5? 5 Let f(q) = -q*3 - 5q*2 - 4q + 3. Let m be f(-4). Let y = -1.2 + 2.2. Which is the third smallest value? (a) m (b) 0.4 (c) y a Let r = 81 + -79.08. Let p = -0.08 - r. What is the second smallest value in 4, -2/5, p? -2/5 Suppose 0 = 4i - 3i - 4. Which is the second biggest value? (a) -1/4 (b) 0.5 (c) i (d) -1/5 b Let f = 38 + -40. Let v = 0.05 - -2.95. Suppose 4k - 1 + 5 = 0. Which is the second smallest value? (a) f (b) k (c) v b Let d = 41 + -26. Let v be (1/(-15))/(d/18). Let o = 5 - 2. Which is the second smallest value? (a) 0 (b) v (c) o a Let y(w) = w2 - w - 1. Let o be y(-2). Let i = 9.4 + -9. Which is the smallest value? (a) o (b) i (c) -4 c Let v = 9 + -5. Suppose 40 = -vo + 6o. Suppose -i - 2f = 4i - 19, i - o = 5f. Which is the second smallest value? (a) 0.3 (b) i (c) -2/7 a Let v = 23 + -25. Let m = 0 - 0.4. What is the biggest value in m, -2/21, v? -2/21 Let r be (-6)/20(-8 + 10). What is the third smallest value in -0.3, r, -8/9? -0.3 Let m = 3.2 + -3. Let a = 0.009 + 0.991. What is the second biggest value in 3, a, m? a Let w(g) = -g2 + 7g - 1. Let m(i) = -i*2 - 7i - 6. Let c be m(-4). Let h be w(c). Let t = -2.9 + 0.9. What is the biggest value in t, -1, h? h Suppose -13j = -18j - 5. What is the fourth biggest value in -6, -4, 2, j? -6 Let h(y) = 2y3 - 2y*2 + 2y. Let g be h(2). Suppose -j + 5j = g. Let l be (-7)/4 + (-1)/4. Which is the third biggest value? (a) l (b) 1 (c) j a Let j be (-5)/(-3 + 1 + 1). Let p be (-2)/(-5) + 0/1. Let r be (-8)/52/24. What is the biggest value in p, j, r? j Let f be (-1)/1 + -12 + 13. What is the third biggest value in 0.1, 3, f? f Suppose 0z = 2z + 8. Let g be z/14 + 13/(-28). What is the third biggest value in 2, g, -4? -4 Let k = -5.12 + 0.12. Let r = k - -5.2. Let h = -0.1 + r. Which is the second biggest value? (a) -3/2 (b) -1 (c) h b Suppose 0 = -16g + 9g - 7. Let h = 0.2 + 0.3. Which is the smallest value? (a) h (b) -3/5 (c) g c Let n = -19 - -19.7. What is the biggest value in -5, -2/11, n? n Let i = -3.955 - -0.055. Let f = i - -1.9. Which is the smallest value? (a) 3 (b) -1/4 (c) f c Let q = 6/7 - 31/28. Let t = -5 - -5.4. Let c = -323/3 + 109. What is the third biggest value in q, t, c? q Let g = -0.08 - 3.92. What is the biggest value in -11, g, -1/4? -1/4 Let g = 77.4 - 77. Which is the fourth biggest value? (a) -0.3 (b) 0.05 (c) g (d) -4/5 d Let s be 21/(-35) - 203/(-5). Let r be (-2)/(-7) + s/(-42). Which is the smallest value? (a) -3 (b) 3/4 (c) r a Let q be (-12)/(-6) - (-5)/(-3). Let y = 29 + -31.1. Let z = y - -2. Which is the third smallest value? (a) z (b) q (c) 3/2 c Let j be -1 - (-1 - -1 - 21). Suppose -j = -4c, -3i - 2c + c = -20. Let z = -4 + 7. What is the biggest value in i, 0, z? i Let u be (-9001)/(-40464) - (-2)/(-9). Let l = u - -84289/49456. Let q = 16/11 - l. Which is the smallest value? (a) 0 (b) -3 (c) q b Suppose 4z + 8 = 0, -3z + 0z = -5y + 46. Let u = y + -14. Let s be u/(-24)(1 + 5). Which is the third smallest value? (a) 0.2 (b) 2/7 (c) s c Let d = 0.76 + -0.06. Let f = d + 0.3. Let k = 3.7 + -0.7. Which is the third smallest value? (a) f (b) 1/4 (c) k c Let x(c) = -c*3 - 4c*2 + 4c + 4. Let q = 0 - 4. Let y be x(q). Let s be ((-18)/(-16))/((-9)/y). What is the third biggest value in -4, -0.3, s? -4 Suppose -2s - 6 = 0, 5x + 6 = -2s - 5. Which is the second smallest value? (a) -28 (b) -3 (c) x b Let p = -0.14 - -0.1. Let r = p - 0.36. Let z = r + 0.4. Which is the biggest value? (a) 0.2 (b) 1/4 (c) z b Let x(s) = s3 + 1. Let p be x(0). Which is the second biggest value? (a) p (b) -4 (c) -1 (d) -2/3 d Let s = -42 + 42.2. Which is the smallest value? (a) -0.4 (b) 1 (c) s a Let q be 1/1(-2)/(-6). Let c be (-9)/3 - 71/(-23). Let y be 6/1(-10)/15. What is the third smallest value in c, y, q? q Let b = 29/2 + -77/6. Let z = -0.2 + 3.2. What is the smallest value in b, -1/3, z? -1/3 Let q = -1.51 + 0.01. Let t = 2 + -1. Let b = t + q. What is the second biggest value in 0.1, -0.4, b? -0.4 Suppose -19 = -5x - 9. Let r = 3.4 - -0.6. What is the biggest value in r, x, -2? r Let u(i) = -i*3 + 9i*2 - 8i + 6. Let o be u(8). Let y = -8 + o. Which is the third biggest value? (a) 2/13 (b) 4 (c) y c Suppose 71x + 10 = 73x. Which is the biggest value? (a) 2/5 (b) -2/23 (c) x c Let k be (1 - 6/5)/1. Let q = 1.3 - -2.7. Let s = 0 - 5. What is the second smallest value in s, q, k? k Let d = 2.4 + -2.9. What is the second smallest value in d, 0.4, 5? 0.4 Suppose q = 2q + 3. Let o be 5/(3/q) + 1. What is the third smallest value in 3, -0.1, o? 3 Let z be 1/30/(-10 - -7). What is the biggest value in z, -1.5, -2/7, 4? 4 Let t = 0.3 + 0. Let p = 70976 + -494862/7. Let n = 281 - p. Which is the third smallest value? (a) t (b) n (c) 1 c Let t = -106/3 - -34. Let z = 1.65 + 0.35. What is the third smallest value in t, -2, z? z Let i = -29 - -14. Let r = -15.5 - i. Which is the biggest value? (a) r (b) 3/4 (c) 1 c Let q = 2 + 1. Which is the smallest value? (a) q (b) -0.5 (c) 1/2 b Suppose 0z = 2z - 8. Suppose -6f + 4f + 4v = 20, 4f + 28 = -zv. Let n = f - -6. Which is the third smallest value? (a) -4/7 (b) 0.04 (c) n b Let n(k) = -k2 - 9k - 11. Let o be n(-7). Let q(r) = -2r - 4. Suppose 0 = 4t + t + 20. Let l be q(t). Which is the biggest value? (a) -1/6 (b) o (c) l c Let v = 12 + -12. Let k = 4 + -6. Which is the second biggest value? (a) -2/3 (b) v (c) k a Let n = 1 + -1. Let j = -733/4 + 182. Which is the second biggest value? (a) -0.1 (b) j (c) n a Let w = 10.6 + -11. Which is the second biggest value? (a) 4 (b) w (c) 5 a Let v = -1/3 + 2/15. Let y = -15 + 15.5. Which is the second biggest value? (a) 2 (b) v (c) y c Let t = 0 - -0.2. Let u = -4.2 + t. Let p = 0.112 + -0.412. What is the smallest value in u, 3, p? u Let d = -2 - -1.99. Let n = -26 - -25.89. Let x = d - n. Which is the second biggest value? (a) -5 (b) x (c) -0.2 c Let r = 1.7 + 10.9. Let z = 13 - r. What is the second smallest value in z, -1/5, 1/4? 1/4 Let w = 19 + -13. Let k = w + -5.9. Let v = -8/5 + 14/15. Which is the second biggest value? (a) k (b) -0.5 (c) v b Let o = -17/4 - -131/28. Which is the third smallest value? (a) 0.2 (b) 3 (c) o b Let d = -52 + 49. What is the second smallest value in 7, -1, d? -1 Let x(c) be the third derivative of -c6/120 + c5/12 + 7c4/24 - 4c3/3 + c2. Let n be x(6). What is the third smallest value in -1/5, n, 3? 3 Let r = -53 - -36.3. Let a = 17 + r. What is the smallest value in -1, -0.2, a? -1 Let x = -0.5 + -1.5. Which is the smallest value? (a) x (b) -3 (c) 0.1 (d) -0.1 b Suppose -3h + 4z + 24 = 0, 5z + 15 = 2h - 8. Let w = 0.55 + -0.05. Let t be (-4)/9	{ "pile_set_name": "DM Mathematics" }
by z? 12 Let d(w) = -w*2 - 4w + 6. Let o be d(-6). Let j = -107 - -87. Let p = o - j. Calculate the remainder when 54 is divided by p. 12 Suppose -25 = -g + 89. Let r(k) = -5k - 21. Let a be r(-2). Let t = a + g. Calculate the remainder when t is divided by 27. 22 Let h(m) = m3 - 29m*2 + 26m + 86. Let p = -44 - -72. What is the remainder when 147 is divided by h(p)? 27 Suppose -81924 = -9p + 5y + 23205, 23362 = 2p - y. Calculate the remainder when p is divided by 22. 21 Suppose -65k = -82k + 68. Suppose 53g - 55g = -4v + 166, -kv - 2g + 186 = 0. Suppose -6 = -2q + 12. Calculate the remainder when v is divided by q. 8 Let k(b) = 4b*2 - 92b + 255. Let p(t) = t*2 - 23t + 64. Let o(r) = 2k(r) - 9p(r). Calculate the remainder when (-5)/(-10) - 207/(-6) is divided by o(19). 5 Let n(h) = -3h2 - 220. Let j(z) = 5z*2 + z + 329. Let g(p) = -5j(p) - 8n(p). What is the remainder when 73 is divided by g(8)? 7 Let j(y) = y2 - 5y - 9. Let s be (-8)/65/(10/(-9)). Let w be 1 + (-22)/6 - (-4)/s. Calculate the remainder when j(w) is divided by 4. 1 Suppose -11b + 188b - 146016 = -39b. Calculate the remainder when b is divided by 151. 72 Let n = 299 + -289. Suppose -5z + n = 0, 3j - z = -j + 98. Calculate the remainder when j is divided by 2. 1 Suppose 0 = -66o + 4487 - 1121. Calculate the remainder when 1832 is divided by o. 47 Let m = -74 + 5. Let s = -63 - m. Suppose a - 1204 = -sa. What is the remainder when a is divided by 29? 27 Let s(y) = 12y3 + 26y*2 - 178y - 12. What is the remainder when s(5) is divided by 410? 18 Let j = 17 - -9. Suppose 3l - j - 184 = 0. Suppose 2x - 7x = -90. What is the remainder when l is divided by x? 16 Suppose -2w - 4y - 80 = -6w, w + 3y = 40. Suppose -68j + 17j - 1246 = -10630. What is the remainder when j is divided by w? 9 Suppose -3d - 4h + 8 = 36, 2h + 2 = 0. Calculate the remainder when 116 is divided by -1 + 1 + 4 - d. 8 Let z(h) = -2h - 3. Let j(f) = 3f - 26. Let x(q) = -j(q) - z(q). Calculate the remainder when 56 is divided by x(-7). 20 Let x(j) = -321j - 635. Calculate the remainder when 991 is divided by x(-2). 4 Let f = -1577 + 1679. Calculate the remainder when 222 is divided by f. 18 Suppose 2d + 40 = -4v + 192, 3d + 3v - 231 = 0. Let t(s) = s3 + 16. Suppose a + a = 0. What is the remainder when d is divided by t(a)? 14 Suppose 449 = -12x + 53. Let m = x - -186. Calculate the remainder when m is divided by 52. 49 Let i(q) = q*3 - 2q*2 + 2q - 2. Suppose 3g + 170 = 3l - 2l, -2g - 122 = -5l. Let d = g + 59. Calculate the remainder when 18 is divided by i(d). 5 Suppose 4a - 3d - 29 = 3a, -181 = -5a - 3d. What is the remainder when a is divided by 13? 9 Let n = 1001 - 993. Suppose 5d - 75 = -5w, -7 = -d - 2. Calculate the remainder when w is divided by n. 2 Let s(k) = 6k + 16k*2 + 2k*3 - 8 - 2k - 8k2 - 4k. What is the remainder when s(4) is divided by 36? 32 Let q(w) = w*2 - 31w - 99. Let g be q(34). Suppose 4i - z = 682, 3i - 502 = -gz - z. Calculate the remainder when i is divided by 29. 25 Suppose i = 2c - 41, c - 2i = 5c - 62. Suppose 0 = 9a + 3a - 1248. Suppose a = 22b - cb. What is the remainder when b is divided by 14? 12 Suppose -2b = 5 + 5, -50 = -5m + 2b. Let r be (7 - 8)(2 + 8). Let d(p) = p*2 + 8p - 5. Calculate the remainder when d(r) is divided by m. 7 Let y(i) = -i*3 + 75i*2 + 157i - 121. Calculate the remainder when 1978 is divided by y(77). 108 Let g(w) = -2w + 216. Let a be g(44). Let z = a - 125. Suppose -2t - 48 = -4j, -3j + t + 23 = 6t. Calculate the remainder when j is divided by z. 2 Let g(a) = -7a - 6. Let y be g(-1). What is the remainder when (-18 - -20)/(133/(-135) + y) is divided by 17? 16 Suppose -15 = -w - 13. Let u be (-4)/8w-35. Suppose 0 = -4f + u + 45. Calculate the remainder when f is divided by 7. 6 What is the remainder when 1795 is divided by (229120/64)/(5 + -1)? 5 Let n(d) = -d3 + d2 + 9d - 7. Let r be n(3). Let t = r + 4. What is the remainder when 117 is divided by t? 3 Suppose -519 = -2f + 343. Calculate the remainder when f is divided by (-6 + (-138)/(-15) - 5)/(36/(-480)). 23 Suppose -7v - 227 = -206. Suppose -g - 4 = -20. Let t = g + v. Calculate the remainder when 48 is divided by t. 9 What is the remainder when 245 is divided by (-4 - 3/((-42)/64))/(10/1085)? 59 Suppose 5k = -4i + 27, -12k - 5i = -11k - 18. Suppose -3j + km + 99 = 0, 3j + m = -0m + 99. Calculate the remainder when 193 is divided by j. 28 Let l(j) = -8j - 10. Let p be l(-1). Let x be (-3 + 0)/(p/18). Suppose -30 = 24q - xq. What is the remainder when 29 is divided by q? 9 Let u(q) = -5q3 - 3q - 11. Let d be u(-2). Suppose -f + 3o = -d, f - o - 5 = 24. What is the remainder when 122 is divided by f? 18 Let n = 19 + -14. Suppose -7j + 5j = 5b + 19, -3j = -9. What is the remainder when (b + 6)(n + 3) is divided by 4? 0 Let h = 4199 - 3659. Calculate the remainder when h is divided by 534. 6 What is the remainder when (185 - 171)2(-1341)/(-12) is divided by 349? 337 Suppose 0 = -98a + 9309 + 14077 + 9836. Calculate the remainder when a is divided by 106. 21 Suppose -2r = 2r + 128. Let y = r + 37. Let o(i) = -2i*3 + 24i*2 - 17i - 37. Calculate the remainder when o(11) is divided by y. 3 Let k(f) = 6f2 + 16f + 13. Let j be k(-2). Suppose 3t - jz = 697, 98z - 101z = 3t - 705. What is the remainder when t is divided by (59/2)/((-2)/(-4))? 57 Let s(a) = 9a*2 + 5a - 9. Let y be s(-5). Let c = y - 179. Calculate the remainder when 275 is divided by c. 11 Let a be 20/10 + 2/1. Suppose 0 = -4u - 334 - 378. Calculate the remainder when 53 is divided by u/(-10) + a/20. 17 Suppose -24v = -1064 - 3112. What is the remainder when v is divided by 61? 52 Calculate the remainder when 10/(-4)1875372/(-1585) is divided by 74. 72 What is the remainder when (522/7)/(146/2044) is divided by 1039? 5 Let v be ((-412)/20 - 5)5. Let m = v - -157. What is the remainder when 57 is divided by m? 28 Suppose 5g = 5t + 130, 4g + 4t - 112 = -8. Calculate the remainder when 839 is divided by g. 7 Let y = 1062 + -1048. Let k = 194 + -43. What is the remainder when k is divided by y? 11 Let v be (-6)/(-27) - (-10868)/99. Suppose -6g + v + 370 = 0. Suppose -2d - g = -5f - 7d, -2f - d + 31 = 0. What is the remainder when f is divided by 11? 4 Let z = 8420 + 2964. What is the remainder when z is divided by 156? 152 Let f(k) = -4k - 3. Let o be f(-7). Let g = o + -70. Calculate the remainder when (-110)/(g/(-24) + -2) is divided by 17. 12 Let l be 18/153 + 3776/(-17). Let f = 242 + l. What is the remainder when f is divided by 8? 4 Suppose -120842 - 11869 - 10383 = -21b. Calculate the remainder when b is divided by 71. 69 Suppose -5d - j = -3708, 48d - 5j + 756 = 49d. What is the remainder when d is divided by 95? 76 Let v = 22 - 17. Let k be (v + -6)/(4/(-20)). Calculate the remainder when 13 is divided by 3/5 + (22/k - -1). 1 Suppose 116 = 3l + 5o - 106, 5o + 222 = 3l. What is the remainder when (24/(-14))/((-7)/588) is divided by l? 70 Suppose -3d - 1 = -7. Let p be (2 + -4)/(d/(-7)). Suppose -pk + 12k = 15. What is the remainder when 6 is divided by k? 0 Suppose -7t = 242 + 248. Calculate the remainder when 21/t + (-16137)/(-90) is divided by 18. 17 Let v be 250/(-40) - (-1)/4. Calculate the remainder when 20 is divided by 51(-4 + 5) - v. 9 Suppose -20c = -11c - 261. Suppose -17v - 744 = -cv. What is the remainder when v is divided by (-30)/(-9)24/5? 14 Calculate the remainder when 663 is divided by (16/6)/(45/810). 39 Let o(s) = 10s*2 + 1470s - 515. Calculate the remainder when o(-148) is divided by 78. 29 Let b(c) = -c*3 - 48c*2 + 329c + 283. Calculate the remainder when 6/(-4)2848/(-24) is divided by b(-54). 9 Let y(n) = 14n + 86. Let z be y(-6). Suppose -zw + 6w - 12 = 0. Calculate the remainder when (1 - 0)/(7/28) is divided by w. 1 Let h = 15 + 13. What is the remainder when (-85)/10-12 + 7 is divided by h? 25 Let p(s) = -4s + 96. Let k be p(12). Suppose -k = -2o + 32. Calculate the remainder when (-1 - 4)236/(-10) is divided by o. 38 Suppose 1608 = 5a - 2d, -2a = 5d - 278 - 313. What is the remainder whe	{ "pile_set_name": "DM Mathematics" }
n -78n - 28 + 28 + 7n. -71n Collect the terms in -186x*2 - 178x*2 - 237x*2. -601x*2 Collect the terms in 545 + 81d*2 - 545 - 90d*2. -9d*2 Collect the terms in -28c*3 + 2 + 1 + 26c*3 - 3. -2c*3 Collect the terms in -51068c*2 + 3c*3 + 51068c*2. 3c*3 Collect the terms in -5l3 - 192 - 275 + 467 + l3. -4l3 Collect the terms in 272 - 19f - 272. -19f Collect the terms in 44y*2 - 11920 + 11920. 44y*2 Collect the terms in -3q + 67q2 + 3q - 70q2. -3q*2 Collect the terms in -51286 - 2p*3 + 51286 - 2p*3. -4p*3 Collect the terms in -113g*3 + 198g*3 - 100g*3. -15g*3 Collect the terms in -113 + 113 - 5o*3 + 6o. -5o3 + 6o Collect the terms in 23 + 69f3 - 23. 69f*3 Collect the terms in 4p*2 - 11 - 3p - 5p + p + 4p. 4p2 - 3p - 11 Collect the terms in 7k - k3 - 2k + 2k3 + 2k. k*3 + 7k Collect the terms in 9h2 - 11h*2 + 4h*2. 2h*2 Collect the terms in -39415 + 19707 + 7s + 19708. 7s Collect the terms in 0g*3 - 9g - 4g3 - g3 - 14g. -5g3 - 23g Collect the terms in 0b3 - b3 + 2b*3 + 2b*3. 3b*3 Collect the terms in 1068c*2 + 2 - 2 + 2c*3 - 1068c*2. 2c*3 Collect the terms in 27594k*2 + 2k - 27587k2 + 2k - 4k. 7k*2 Collect the terms in 107h - 14h + 127h - 6h. 214h Collect the terms in 7l - 87 + 87 + l. 8l Collect the terms in -2y2 + y2 - 4y*2 - 4y*2. -9y*2 Collect the terms in 391p - 391p - 34p*3. -34p*3 Collect the terms in 6u2 + u2 - 11u2 - 4u*3 + 4u*2. -4u*3 Collect the terms in 80p*2 - 91p*2 + 10p2. -p2 Collect the terms in -19392 + 5k2 + 19392. 5k*2 Collect the terms in -2i*2 - 3i2 - i2 + i*2. -5i*2 Collect the terms in -35 + 6w + 1 + 11 - 2. 6w - 25 Collect the terms in -3t*2 - 4t*2 + 10t*2. 3t*2 Collect the terms in -2v + v - 3v + 1 + 3v. -v + 1 Collect the terms in -1828 + 13v2 + 1828. 13v*2 Collect the terms in -603g*2 + 305g*2 + 300g*2. 2g*2 Collect the terms in 14b*3 + 8b*3 - 22 + 22. 22b*3 Collect the terms in 139q*2 + 136q*2 + 140q*2. 415q*2 Collect the terms in 327 + 2h*3 - 655 + 328. 2h*3 Collect the terms in -36v*2 + 12v*2 - 20v*2. -44v*2 Collect the terms in -3q + 3q3 - 11 - 11 + 3q. 3q3 - 22 Collect the terms in m3 + 10m*3 + 7m*3 + 3m*3. 21m*3 Collect the terms in -25p + 431 - 431. -25p Collect the terms in 6 + 4f - 2 - f + 3. 3f + 7 Collect the terms in -8q - 2q + 4q - 2q. -8q Collect the terms in 7x2 - 23x*2 + 6x*2 + 4x*2. -6x*2 Collect the terms in 19o*3 - 46o*3 + 22o*3. -5o*3 Collect the terms in -4 + 4 - 25a*2 + 122a*2. 97a*2 Collect the terms in -5l - 5l + 17l - 7l + 2l. 2l Collect the terms in 3w2 + w2 - 2w2 + 0w2 + w2. 3w2 Collect the terms in 2 + 0b3 - 2 + b3. b*3 Collect the terms in 8a - 16a + 4a. -4a Collect the terms in 14c - 5c - 6c - 2c. c Collect the terms in 43j - 71j + 27j - 4 + 4. -j Collect the terms in 2a2 + 461a - 187a - 274a. 2a2 Collect the terms in -3191p + 6396p - 3205p + p2. p2 Collect the terms in 7d + 7d + 7d. 21d Collect the terms in 65u3 - 43u*3 + 2u2 - u2. 22u3 + u2 Collect the terms in 23 - 2z*3 + 4 - 27. -2z*3 Collect the terms in -y + 101736 - 101736. -y Collect the terms in 0h - 516 - 2h + 3744. -2h + 3228 Collect the terms in -22a2 + 13a*2 + 13a*2. 4a*2 Collect the terms in -2o*2 + o - 19o + 17o + o. -2o*2 Collect the terms in -199a - 199a + 595a - 195a. 2a Collect the terms in 13z + 17z + 10z - 60z + 18z. -2z Collect the terms in -10x2 - 15x*2 + 27x*2. 2x*2 Collect the terms in 6d*2 - 296 + 588 + 14d*2 - 292. 20d*2 Collect the terms in 2c*3 + 70c*2 - 70c*2. 2c*3 Collect the terms in -v + 0v*2 - 6v*2 + v. -6v*2 Collect the terms in 5 - 5 + 2k + 2k. 4k Collect the terms in 3x - 5x - 3x. -5x Collect the terms in i - 5i - 2i + 6i3 - i3. 5i*3 - 6i Collect the terms in n2 + 11 + 22 + n2. 2n2 + 33 Collect the terms in 365k*2 + 3k*3 - 365k*2. 3k*3 Collect the terms in 1311g*3 + 1318g*3 - 2626g*3. 3g*3 Collect the terms in 7660 - 7660 - 2u. -2u Collect the terms in 36 + 28x - 117 + 42 + 39. 28x Collect the terms in 66i - 2 - 8i - 6i. 52i - 2 Collect the terms in 5l*3 + 4l3 - l3 - 7l3. l3 Collect the terms in 41 - 2v + 29 - 70. -2v Collect the terms in 122 - 242 + 8k + 119. 8k - 1 Collect the terms in 127256w - 127256w + 2w*3. 2w*3 Collect the terms in -15l + 16l - 10 + 10. l Collect the terms in 12i*2 + 41i*2 + 10i*2. 63i*2 Collect the terms in 852w*2 + 28w*2 - 168w*2. 712w*2 Collect the terms in 11v*3 - 8v*3 - 6v*3. -3v*3 Collect the terms in -31z*2 + z + 2z - 3z. -31z*2 Collect the terms in 152c*2 + 39c*2 + 42c*2 - 24c*2. 209c*2 Collect the terms in 1 + 4j*2 + 2j*2 - 22 - 3j*2. 3j*2 - 21 Collect the terms in -38i - 5i + 20i. -23i Collect the terms in -3 + 10 - 7 + 21b*2. 21b*2 Collect the terms in -23y*2 + 67y*2 - 19y*2 - 20y*2. 5y*2 Collect the terms in 13s*3 - 27s*3 + 24s*3 + 4s*3. 14s*3 Collect the terms in -40y*2 + 117y*2 - 31y*2 - 42y*2. 4y*2 Collect the terms in 262y*3 - 228y*2 + 228y*2. 262y*3 Collect the terms in 0g*2 - 45g*2 - 26g*2. -71g*2 Collect the terms in 0f + 260f2 + 0f - 257f2. 3f*2 Collect the terms in -18z*3 - 2 - 3z*3 + 5. -21z*3 + 3 Collect the terms in -14s + 4s2 - 21s + 86s - s2. 3s*2 + 51s Collect the terms in 4v2 + 2v*2 - 7v2. -v2 Collect the terms in -266d3 - 2d - 320d3 - 188d*3. -774d*3 - 2d Collect the terms in -9r2 + 16r*2 - 22r*2. -15r*2 Collect the terms in 6165 - 6165 + 10v. 10v Collect the terms in -u + u + 75u*3 - 31u*3. 44u*3 Collect the terms in d - 7d + 17d + 23d. 34d Collect the terms in -5l*3 + 7l3 - l3. l*3 Collect the terms in 4809 + 8d*3 - 4809. 8d*3 Collect the terms in 576 - 5j + 2j - 14j*3 - 576. -14j*3 - 3j Collect the terms in 81g + 87g - 174g. -6g Collect the terms in -303 + 56t + 303. 56t Collect the terms in -285j + 150j + j*3 + 135j. j*3 Collect the terms in -35y + 118y - 42y - 30y. 11y Collect the terms in 57f2 + 13f*2 + 3f*2. 73f*2 Collect the terms in -451p*2 + 3p - 2p - p - p. -451p*2 - p Collect the terms in -4s + 19s3 + 4s. 19s3 Collect the terms in -6m*3 - 2m + 2m + 54m*2. -6m*3 + 54m*2 Collect the terms in -26u*3 - 2 - 31u*3 + 2. -57u*3 Collect the terms in 38 + n - 38. n Collect the terms in r - 5r + 4r - 55r*3. -55r*3 Collect the terms in 80a + 8 - a2 - 8. -a2 + 80a Collect the terms in 19o - 4o3 - 3o*3 - 19o. -7o3 Collect the terms in 2 - 2 + 13b*3 + 3b*3. 16b*3 Collect the terms in 170q*2 - 85q*2 - 88q*2. -3q*2 Collect the terms in -16j*3 - 12j*3 + 18j*3. -10j*3 Collect the terms in 14w*2 - 26w*2 + 11w2. -w2 Collect the terms in -177h + 44h + 46h + 44h + 44h. h Collect the terms in -4w + 2w + 4w. 2w Collect the terms in -31i*3 + 12i*3 - 24i*3 - 12i*3. -55i*3 Collect the terms in -2 - 7f + 7f + 2 - f. -f Collect the terms in 34s*3 - 20s*3 - 19s*3. -5s3 Collect the terms in z2 - 5z2 + z2. -3z*2 Collect the terms in 34097 - 34097 - 5j*2 + 3j*2. -2j*2 Collect the terms in -145p*2 + 2p*3 + 145p*2. 2p*3 Collect the terms in 56v - 56v - 83v*2. -83v*2 Collect the terms in 97g - 190g + 106g. 13g Collect the terms in -107x*2 - 106x*2 - 109x*2 + 325x*2. 3x2 Collect the terms in -k3 - 4k3 - 31k*3. -36k*3 Collect the terms in 3g + 0g2 - g + g2. g2 + 2g Collect the terms in -7w2 + 6w*2 - 5w*2 + 4w*2. -2w*2 Collect the terms in 2 - 4p - 1 - 1 - 22p2. -22p*2 - 4p Collect the terms in -48 + 47 + 2m + 5m + 11m. 18m - 1 Collect the terms in -33g + 16g + 15g. -2g Collect the terms in 6 + 4 - 2c - 10. -2c Collect the terms in 3z2 - 7z*2 - 14 - 86. -4z*2 - 100 Collect the terms in 2739o - 2739o - 3o*2. -3o*2 Collect the terms in -14g*	{ "pile_set_name": "DM Mathematics" }
fi2 - 3fk - 53389f + 8i3 + 4794ik + 3k + 4 with respect to f. -22i3 + i2 - 3k - 53389 Find the third derivative of 160112t5 + 45t*4 + 9t*2 - 44t - 37671 wrt t. 9606720t2 + 1080t Find the first derivative of 676i2m - i*2 - 4523im + 64624i - 2 wrt m. 676i2 - 4523i Find the second derivative of -786077852m5 - 412560m - 723. -15721557040m3 Find the second derivative of -291363191w*2 + 332983744w. -582726382 Differentiate 14551002m3 - 21091876 wrt m. 43653006m*2 Find the second derivative of 114701019o*5 - 1615o + 14376 wrt o. 2294020380o3 What is the first derivative of 621dkt - 19dt*3 + 4dt2 + 108dt + d + 16753kt3 - 2t*3 + 23t*2 wrt k? 621dt + 16753t*3 Differentiate -132899134r*2 + 136030260 wrt r. -265798268r What is the third derivative of -871503935b5 - 26785937b*2 + 2b? -52290236100b2 What is the second derivative of -642885f*3 - 8f*2 + 2918687f? -3857310f - 16 Find the third derivative of d2s*3 + 54d*2s*2 + ds*3 + 165000ds2 - 2ds + 11097723s*3 wrt s. 6d*2 + 6d + 66586338 What is the third derivative of 10c3k*2 - 19609399c*3ks + c2ks - 21c*2k - 2c + 12k*2 - 819ks - 4k wrt c? 60k2 - 117656394ks Differentiate 82689s*4 + 333s - 101835765 with respect to s. 330756s3 + 333 Find the third derivative of -1770257w5 - w4 - 15w2 - 21w + 2127. -106215420w2 - 24w Find the first derivative of 6d3 + 446670d + 66968647 wrt d. 18d2 + 446670 Differentiate -672629212ct - 24t - 2537858 wrt c. -672629212t Find the third derivative of -191897152l*2p*3 - 872l*2p*2 + 37655l*2 wrt p. -1151382912l2 What is the second derivative of -b3h2 - b3 + 1436b*2hj - 78bh2 + 12b - 112h2j - h*2 + 7j wrt h? -2b3 - 156b - 224j - 2 Find the second derivative of -472531g3 - g2 - 13452828g wrt g. -2835186g - 2 Find the second derivative of -315297b3 - 12505347b wrt b. -1891782b Find the third derivative of 27n*4 - 7927964n*3 - 16n*2 - 3618n - 18. 648n - 47567784 What is the derivative of 69c*4 - 1041c*2 - 21c - 31775130 wrt c? 276c3 - 2082c - 21 Find the third derivative of 1362d6 + 209d*5 - 5d*3 + 291d*2 - 49d - 39 wrt d. 163440d3 + 12540d*2 - 30 What is the first derivative of -1491436cp + 287543p - 10 wrt c? -1491436p Find the second derivative of -134837764f*3 - 6166789f wrt f. -809026584f Find the second derivative of -5740773l*2 - 378321l - 10. -11481546 What is the third derivative of -6284216j3s3 + j3 - 339211j2s*3 - 3s*3 wrt j? -37705296s*3 + 6 Find the second derivative of -120337668x*4 + 2x + 25054812 wrt x. -1444052016x2 What is the third derivative of 13981i*6 - 9149i*3 + 464662433i*2 wrt i? 1677720i*3 - 54894 Differentiate 18248b*3 - 3182b*2 - b + 65110681. 54744b*2 - 6364b - 1 Find the second derivative of 261s3 + 177084s*2 + 7s + 6665757. 1566s + 354168 What is the second derivative of 28460y*4 + 96y*3 + 17332y - 47? 341520y2 + 576y Find the second derivative of -1103096f2n - 2f2 + 71421f - 78n wrt f. -2206192n - 4 Find the second derivative of 2h5 + 3183018h*3 + 47h - 46572. 40h3 + 19098108h What is the second derivative of -253643880m4 + 159149m + 76? -3043726560m2 Find the third derivative of -262367530l6 - l2 + 215963l - 666 wrt l. -31484103600l*3 What is the first derivative of 87tz - 26673914t + 69656z wrt z? 87t + 69656 Find the third derivative of 82249163i3 - 19i*2 + 2040891 wrt i. 493494978 What is the third derivative of -109896ct3 + 3ct2w + ct2 - 12093745ctw + 1324t3w wrt t? -659376c + 7944w What is the derivative of 6964211x2 + 1468179 wrt x? 13928422x What is the first derivative of -750p2 - 3906p - 19202992 wrt p? -1500p - 3906 What is the third derivative of -3r*6 - 2022595r*4 + 2r*2 + 67094r? -360r3 - 48542280r Differentiate -173264gm + 1249979605g + 201m wrt m. -173264g + 201 Find the third derivative of 53278885g*5 - 5741g*2 - 1460g - 1. 3196733100g2 What is the second derivative of -45803m*4 - 16m*2 - 14140036m wrt m? -549636m2 - 32 What is the second derivative of 33991349i*3 + 3i + 8187571 wrt i? 203948094i Find the first derivative of -32413417h*2 - 34434564. -64826834h Differentiate 37134828c + 17507240. 37134828 Find the third derivative of -1708905b*3 - 6130674b2. -10253430 Differentiate -d4 - 437540d3 + 6d*2 + 14295832 with respect to d. -4d*3 - 1312620d*2 + 12d Differentiate -2c2p*2 + 104c*2z - 2c2 + 2422p*2z - 3610406p2 with respect to z. 104c*2 + 2422p*2 Differentiate -7325w*2 + 2224w + 179506364. -14650w + 2224 Find the second derivative of 10n*4 - 3n*3 - 5022n*2 - 2n + 9569657 wrt n. 120n2 - 18n - 10044 Find the third derivative of -33230552r5 - 4516r*2 + 21r + 49. -1993833120r2 What is the second derivative of 601078528b*2 + 2088b - 94012? 1202157056 What is the third derivative of -1528972q4 + 55q*3 - 781741660q*2 wrt q? -36695328q + 330 What is the second derivative of 78g3t*2 - 92g*3t - 78601g2t*2 - 2g*2t - 19g2 - 8247t wrt t? 156g3 - 157202g*2 What is the third derivative of 723363f*5 - 3f*4 - 31f*3 - 75f*2 - 750290f + 2? 43401780f2 - 72f - 186 What is the third derivative of -26423200z3 - 8355z*2 + 733? -158539200 Differentiate 4004962f*3m + 419f3 - f2 - 31fm - 5f - 462 with respect to m. 4004962f3 - 31f Find the first derivative of -61557gz*4 + 90gz + 77g + 9 wrt z. -246228gz*3 + 90g Find the third derivative of -8938186m3 + 7m*2 + 1434m + 492 wrt m. -53629116 What is the first derivative of 6102309k2r - kr + 252254443r + 2 wrt k? 12204618kr - r What is the second derivative of -293540a2v*3 + 3a*2v - 5a2 + 25890av3 + 13av + 2a + v wrt a? -587080v3 + 6v - 10 Find the second derivative of 370171211z2 + 100495995z. 740342422 What is the first derivative of 322507741xy - 402760283x wrt y? 322507741x Differentiate 3j3z - 17j3 + 6359022j*2z + 13513j2 + 3j + 1 with respect to z. 3j3 + 6359022j*2 Differentiate -75008044j*2 - 77005126. -150016088j Find the second derivative of 16015077o3 - 136669o - 14. 96090462o What is the first derivative of -410i*2r*2 - 70i*2 + 247ir2 - 728302r*2 - 3r - 8 wrt i? -820ir*2 - 140i + 247r2 Find the first derivative of 8dl3 - 177dlm - 4dl + 18573l3m - 577l3 + 2l*2 + 5 wrt m. -177dl + 18573l*3 What is the third derivative of -30935305s*3 + 170s*2 + 10106s + 6? -185611830 What is the third derivative of 34106422b5 + b3 + b2 - 3458385b - 2 wrt b? 2046385320b2 + 6 What is the second derivative of -73866423f*5 - 102189771f? -1477328460f3 What is the third derivative of 19b*5 - 24870b4 + b3 + 1504554b2 - 3 wrt b? 1140b*2 - 596880b + 6 Find the third derivative of -353731n2u*3 + 7n*2u*2 + 3n*2u + 2nu*3 - 151nu - 172u*2 wrt u. -2122386n*2 + 12n Find the third derivative of 878d6 + 1433d*4 + 44d*2 + 2d - 11847. 105360d3 + 34392d Find the second derivative of 184254h2pt - 6h*2p - h*2 - 10hpt - 158ht + pt + 5p - 5 wrt h. 368508pt - 12p - 2 Find the third derivative of -28150158l*4 + 155l*2 - 25l + 782. -675603792l Find the second derivative of 368015lo4x + 10lo*3 - 17298lox - 47lo + 3l - ox wrt o. 4416180lo*2x + 60lo What is the third derivative of -3935703p6 - 3p*4 - 7p*3 + 463p*2 - 227191 wrt p? -472284360p*3 - 72p - 42 Differentiate -35k2ou + 1075750k*2 + 5ko - 14ku + 777ou - 3u wrt o. -35k2u + 5k + 777u What is the second derivative of b*4 + 15b*3 + 1506040b*2 - 117941316b? 12b2 + 90b + 3012080 Find the first derivative of -70n4 + 242991n*3 - 7626477 wrt n. -280n*3 + 728973n*2 What is the third derivative of -937p*5 - 3185p4 + p3 + 64726147p2? -56220p*2 - 76440p + 6 Find the third derivative of -15v5 + 1027v*4 + 12v*3 + 25187507v**2. -900	{ "pile_set_name": "DM Mathematics" }
)((m/(m/(mm*(2/11)m)))/m)/(m/(mm(2/15))) assuming m is positive. m(10567/8085) Simplify ((d(2/5))(-20/7))1 assuming d is positive. d(-8/7) Simplify (n/n(-1))17n((nn*1)/n)/nn(4/7) assuming n is positive. n(249/7) Simplify (u/((u*(1/6)/uu)/u))/(u/(u/(u/u*(1/4))))(((u*0/uuu)/u)/u)(1/47) assuming u is positive. u(599/564) Simplify (uu/u*(1/2)uu)/u(-17) assuming u is positive. u(41/2) Simplify ((u/(uu*(1/3))u)/(u/((u/(u(u(-2/9)/u)/u))/u)u))/(u/(u*1u)u(1/5)) assuming u is positive. u(31/45) Simplify (uuuu*(-6/5)u0)1 assuming u is positive. u(9/5) Simplify (z/z(-32/5))7 assuming z is positive. z(259/5) Simplify (y(-1)/y)26(y(-2/3)y)(-48) assuming y is positive. y(-68) Simplify (hh(2/27)h)/((hh(4/5))/h)h*(2/9)(hhh/h*(3/5)h)/h assuming h is positive. h(526/135) Simplify r(2/13)/r(-11/4) assuming r is positive. r(151/52) Simplify (bb(-4/11))/b(10/3) assuming b is positive. b(-89/33) Simplify (l/l(11/4))/ll(-4) assuming l is positive. l(-27/4) Simplify y*(-2/21)yy(3/19)/y assuming y is positive. y(25/399) Simplify (yyy29)/((yy(5/16))/y) assuming y is positive. y(491/16) Simplify (j1)41/(j(-1))(-32) assuming j is positive. j*9 Simplify ((w/((w((www/w0)/w)/w)/w))/w)36/(ww2/w)1 assuming w is positive. w(-38) Simplify (bb/((b*34b)/bb)b)/((b(4/9)/b)/b) assuming b is positive. b(-274/9) Simplify (x*(-22)x)(-4) assuming x is positive. x84 Simplify pp(-9)ppp/p7 assuming p is positive. p(-12) Simplify c(2/37)/(c(-10)/c) assuming c is positive. c(409/37) Simplify ((n/(n/(n(-3)n)))/(n(1/4)n))/(n/(n*(-1)n))(-1/2) assuming n is positive. n(-11/4) Simplify (x/(xx(1/2)x))*45x*(-2/35)xx(-9) assuming x is positive. x(-5289/70) Simplify (l(-2/3))(-34)(l*(-2/3)l)36 assuming l is positive. l(104/3) Simplify ww(-10)w*(-5)(w/((w(w(-3/7)w)/w)/w))/w(3/5) assuming w is positive. w(-461/35) Simplify v22/((v29v)/vv) assuming v is positive. v*(-8) Simplify ((c/((cccccc*(2/7)c)/c))/(c/c*8))/(cc(-1/3))(-11) assuming c is positive. c(211/21) Simplify r(-1/3)rrr(1/9) assuming r is positive. r(16/9) Simplify (q(11/3)(q/(q/(q/(q(q/(q12/qq))/q))))/q)(-3/4) assuming q is positive. q(-11) Simplify ((u/u*(-13))/uu)/uuu(3/4) assuming u is positive. u(59/4) Simplify ((t*(4/3)t)/(tt(5/4)ttt))5 assuming t is positive. t(-175/12) Simplify bb(2/49)bb/(bb/(b/(bbb(5/4)))) assuming b is positive. b(-237/196) Simplify f(1/7)/f(-2/15)(f/((f/(f/((ff*(1/10)f)/f)))/f))/(ff/(f/(f(f(-3)/f)/f))) assuming f is positive. f(877/210) Simplify (n1)(-41)/((n/(n*(1/2)n))/(((n/n(2/5))/n)/n)) assuming n is positive. n(-419/10) Simplify (jj(1/4))(-42)/((jj*(-1/4)j)/(j(-4)/j)) assuming j is positive. j(-237/4) Simplify v/(v/v*3)v/(v*(-3/2)vv) assuming v is positive. v(7/2) Simplify ((y/((y/y(-3))/yy)y)/(yy(-8)))(-1/7) assuming y is positive. y(-5/7) Simplify r(-8/3)/r*(-8)r(-1/2)/(r/r(-3/5)) assuming r is positive. r*(97/30) Simplify (((v((v*(2/7)v)/v)/v)/v)/v)/((v*(13/2)v)/v) assuming v is positive. v*(-115/14) Simplify (zz(1/8))/z(-2/19)(z(-2/9))(-49) assuming z is positive. z(16579/1368) Simplify (y(-4/5)y)/(yy(-6/13)) assuming y is positive. y(-22/65) Simplify ((c/((c(-1)/c)/c))47)(-40) assuming c is positive. c(-7520) Simplify (k4/k(k(k/((k(3/5)/k)/k)k)/k)/kkk)/(k2/k)(-15) assuming k is positive. k*(112/5) Simplify (b(bb0bb)/b)(-9)/(b(2/7))44 assuming b is positive. b(-277/7) Simplify y(-3)(y/y*(1/4))/yy/((yy/(y/(y/(yy*(-3/2))))y)/y)y(yy(2/5)y)/y assuming y is positive. y*(-47/20) Simplify hh*(-12/11)hh/(h/h14) assuming h is positive. h(164/11) Simplify (ww(1/2))(-3/4)(w(-1/10)/w)/(((wwww/(w*(-2/13)w)wwww)/w)/w) assuming w is positive. w(-3837/520) Simplify (z(-13))(2/33) assuming z is positive. z(-26/33) Simplify ((j/(j*(1/8)/jj))/j9)(-25) assuming j is positive. j(1625/8) Simplify v(-3)/v*(1/12)(v(-1/2))46 assuming v is positive. v(-313/12) Simplify (b(2/5)/b)*(-1)(b*(2/17)b)/(b/(b/(bb(-2)))) assuming b is positive. b(231/85) Simplify (t0/t3)(-23) assuming t is positive. t69 Simplify (h(5/6)/h3)/(h(hh(-1/3)/h)/h)(-41) assuming h is positive. h(-95/6) Simplify r/r31r(-2/31) assuming r is positive. r(-932/31) Simplify (l*6l/(l/(l*(-1)l))ll)(-1/3) assuming l is positive. l(-8/3) Simplify ((kk(-7))/k)/k(4/19) assuming k is positive. k(-137/19) Simplify (d(1/3))(-28/9) assuming d is positive. d(-28/27) Simplify ((l/(ll*(-2)/l))/(lll(l/((ll/(lll/(l(-2)l)ll)l)/l))/lll))/(l(-1))43 assuming l is positive. l37 Simplify z(-2/5)zz/(z/(zz/(zz(3/10)/z)))z(z/(zz/z*(-2/9)z))/zz(1/5) assuming z is positive. z(5/18) Simplify yy/y*(1/5)yyyyy*(-2/11)(y1)(6/5) assuming y is positive. y*(75/11) Simplify ((yy*0/y)/yyy)5/((y(-2)y)/yyy*5) assuming y is positive. y Simplify (r/(r/(r/(rr/r*4)))r(2/3))/(r5r(-2/17)) assuming r is positive. r(-62/51) Simplify (((x(-2)x)/x)/(x/(x/(x/(xx0)))))(3/2) assuming x is positive. x(-3) Simplify ((bb(-16))/b)/(b/(b/(b/(b13bbb)))) assuming b is positive. 1/b Simplify (zz*(2/3)z)*(-6/5)z*2zzz*(-4)z assuming z is positive. z*(-11/5) Simplify (qq(q(-3/14)/q)/q)/q10 assuming q is positive. q(-143/14) Simplify z(-43)/(zzz/z(-20/9)z) assuming z is positive. z*(-443/9) Simplify (t/(tt/(tt40)t))/tt/t35 assuming t is positive. t4 Simplify (r(-4)r)(-34) assuming r is positive. r102 Simplify o*(-1/4)/ooo(-2/3)o(o(2/5)/o)/o(2/5) assuming o is positive. o(-11/12) Simplify (ii/i(-1/58))/i(3/7) assuming i is positive. i*(645/406) Simplify (yy/(y/(y/(yy27))))(-15/2) assuming y is positive. y195 Simplify (lll/l(-6)ll)/ll*(-2/17)(l(-2/5))(-16) assuming l is positive. l*(1384/85) Simplify h/((h/(hhh(2/9)))/h)hhh*2h*(-6)/hhh(-1) assuming h is positive. h(2/9) Simplify (n(2/3)n*9n)(-9/14) assuming n is positive. n(-48/7) Simplify (aa(-2/7)a5)/(a(4/5)/a(1/2)) assuming a is positive. a(379/70) Simplify (i/(ii(2/5)))15(ii/i(-1/4)i)(-3/11) assuming i is positive. i(-303/44) Simplify (i(2/7))(-6/13)/(i*(1/6)ii(2/25)ii) assuming i is positive. i(-46117/13650) Simplify ((jj*4/j)/jjjj/((j/j*(2/7))/jj))/(j*(-1/4)j)(-28/3) assuming j is positive. j(86/7) Simplify b*8/(bb(bb(b/(bb*(-7)b)b)/bb)/b)((bb/(bbbb(-2)/bbbbb))/b)20 assuming b is positive. b(-62) Simplify ((y/y(-7))/(y6yy))/(yyy(1/4)y)(-3/29) assuming y is positive. y(39/116) Simplify ((a/(a/(a*0a))a)/a)2/(a/(aaaa*7)aa(1/4)) assuming a is positive. a(39/4) Simplify (a(-1/4)aa(a/(aa(-6)/aaa))/a)/((aaa/(a/(a/(a/((a(4/3)a)/a))))a)/(a/(a(-5)a))) assuming a is positive. a(77/12) Simplify (n/n8)/(n*(-2)/n)(n/(n/n(-2/9)))/((n/(n/(n5/nn)))/nn) assuming n is positive. n*(-83/9) Simplify (((zzz/z(2/13))/z)/z(1/5))/((z/(z/(zz/z*(-3/8)))z)/zz(1/7)) assuming z is positive. z(-3173/3640) Simplify ((d18/dd)/d(-9))(-2/65) assuming d is positive. d(-54/65) Simplify w(-2/9)/((w/(w(w(2/15)/w)/w))/w)(wwww/((w/(www/w(-3/8)))/w)w)/w(-1/2) assuming w is positive. w(2803/360) Simplify (mm/(mm/(m/(m*(-1/2)mmmmm))m)m)(2/27) assuming m is positive. m(-7/27) Simplify ((k((kk(1/3))/k)/k)/k)(3/8) assuming k is positive. k(-1/4) Simplify (y1)(2/37) assuming y is positive. y(2/37) Simplify (s(s/(s(-1/6)s))/s)/((ss(-2/3))/s)(s/s*(-6/5))/((s/(ss1/s))/s) assuming s is positive. s(121/30) Simplify (n(2/11)/n(-1))/(n*(3/2)n*5n) assuming n is positive. n(-139/22) Simplify b(13/4)b/(b/((b/(b(1/7)/b)bb)/bb)) assuming b is positive. b(199/28) Simplify (c(-5/3)/(cc(-5)/c))/(cc*(-2/23)c**(1/3)) assuming	{ "pile_set_name": "DM Mathematics" }
9764. 244 What is the highest common factor of 96 and 12? 12 Calculate the highest common factor of 1089 and 66. 33 Calculate the highest common divisor of 6 and 116. 2 Calculate the highest common divisor of 30 and 12. 6 Calculate the greatest common factor of 1323 and 735. 147 What is the greatest common factor of 1743 and 336? 21 What is the greatest common divisor of 8 and 7976? 8 Calculate the greatest common divisor of 1368 and 972. 36 Calculate the greatest common divisor of 24 and 354. 6 What is the highest common factor of 47 and 235? 47 What is the greatest common factor of 95 and 10? 5 What is the highest common divisor of 364 and 65? 13 What is the greatest common divisor of 512 and 1664? 128 What is the highest common factor of 123 and 287? 41 What is the greatest common divisor of 97 and 11834? 97 What is the highest common divisor of 380 and 988? 76 Calculate the highest common factor of 14 and 322. 14 Calculate the highest common factor of 1539 and 324. 81 Calculate the greatest common factor of 154 and 132. 22 Calculate the greatest common factor of 29 and 2233. 29 Calculate the highest common factor of 130 and 240. 10 What is the greatest common factor of 29353 and 298? 149 What is the greatest common factor of 752 and 2068? 188 Calculate the greatest common factor of 16 and 2608. 16 Calculate the highest common divisor of 86 and 32809. 43 Calculate the greatest common factor of 189 and 35343. 189 Calculate the highest common divisor of 697 and 85. 17 What is the greatest common factor of 656 and 5986? 82 Calculate the highest common factor of 98 and 154. 14 What is the greatest common divisor of 516 and 12? 12 What is the greatest common factor of 38 and 608? 38 Calculate the greatest common factor of 8789 and 187. 187 Calculate the highest common factor of 350 and 42. 14 What is the highest common divisor of 24 and 372? 12 Calculate the highest common divisor of 71 and 497. 71 Calculate the highest common divisor of 172 and 559. 43 What is the highest common divisor of 28 and 6524? 28 What is the highest common factor of 1140 and 420? 60 What is the highest common factor of 90 and 150? 30 Calculate the highest common factor of 2 and 54. 2 What is the highest common factor of 17 and 6885? 17 Calculate the highest common divisor of 736 and 529. 23 Calculate the greatest common divisor of 1989 and 156. 39 What is the highest common divisor of 30 and 12? 6 Calculate the highest common factor of 60 and 1520. 20 What is the greatest common factor of 156 and 12? 12 Calculate the highest common factor of 20 and 3. 1 What is the greatest common factor of 1 and 728? 1 What is the highest common divisor of 18003 and 51? 51 What is the greatest common divisor of 4 and 10880? 4 What is the greatest common factor of 46 and 667? 23 What is the greatest common divisor of 10 and 45? 5 Calculate the highest common factor of 3 and 478. 1 What is the highest common divisor of 3502 and 238? 34 What is the greatest common factor of 2924 and 153? 17 Calculate the highest common divisor of 108 and 660. 12 What is the highest common divisor of 34 and 17? 17 Calculate the greatest common divisor of 288 and 792. 72 Calculate the highest common factor of 245 and 147. 49 What is the greatest common factor of 3311 and 3010? 301 Calculate the highest common factor of 1030 and 190. 10 Calculate the greatest common divisor of 63 and 63. 63 Calculate the greatest common divisor of 9 and 1263. 3 Calculate the greatest common divisor of 100 and 275. 25 Calculate the greatest common factor of 12 and 60. 12 Calculate the highest common factor of 15 and 2865. 15 Calculate the greatest common factor of 1216 and 38. 38 What is the greatest common factor of 26 and 13780? 26 What is the greatest common divisor of 472 and 8? 8 Calculate the greatest common factor of 710 and 40. 10 What is the greatest common factor of 24 and 1128? 24 What is the greatest common divisor of 90 and 585? 45 Calculate the greatest common divisor of 1157 and 65. 13 What is the greatest common factor of 22 and 4895? 11 Calculate the greatest common divisor of 2904 and 176. 88 Calculate the greatest common divisor of 112 and 7. 7 What is the highest common divisor of 23263 and 43? 43 What is the highest common divisor of 19845 and 270? 135 Calculate the highest common factor of 50 and 5375. 25 Calculate the greatest common divisor of 2768 and 128. 16 Calculate the greatest common divisor of 2581 and 445. 89 What is the greatest common factor of 1539 and 81? 81 What is the highest common divisor of 36 and 84? 12 Calculate the highest common factor of 63 and 153. 9 What is the highest common factor of 4401 and 27? 27 What is the greatest common factor of 497 and 4757? 71 What is the greatest common divisor of 960 and 180? 60 What is the greatest common factor of 348 and 16? 4 What is the greatest common divisor of 352 and 224? 32 Calculate the greatest common factor of 57 and 1159. 19 Calculate the greatest common factor of 20 and 40. 20 What is the highest common factor of 228 and 474? 6 Calculate the highest common divisor of 126 and 168. 42 What is the greatest common divisor of 235 and 115? 5 What is the greatest common divisor of 189 and 1197? 63 Calculate the greatest common divisor of 3097 and 19. 19 Calculate the greatest common factor of 18 and 390. 6 What is the greatest common factor of 869 and 11? 11 What is the highest common factor of 76 and 57? 19 What is the highest common factor of 66 and 2354? 22 What is the greatest common factor of 44 and 1969? 11 Calculate the highest common divisor of 351 and 243. 27 Calculate the greatest common factor of 25 and 20. 5 What is the greatest common factor of 72 and 2484? 36 Calculate the highest common divisor of 88 and 24. 8 What is the highest common factor of 4088 and 952? 56 Calculate the greatest common divisor of 66 and 1122. 66 Calculate the greatest common factor of 34 and 11492. 34 What is the highest common factor of 39 and 975? 39 Calculate the greatest common factor of 62 and 5952. 62 Calculate the greatest common divisor of 544 and 640. 32 Calculate the greatest common factor of 128 and 16. 16 Calculate the highest common factor of 91 and 35. 7 What is the highest common divisor of 26 and 767? 13 What is the greatest common divisor of 6453 and 9? 9 What is the highest common factor of 290 and 58? 58 What is the greatest common factor of 32 and 1576? 8 Calculate the greatest common factor of 64 and 2048. 64 Calculate the greatest common factor of 1411 and 3403. 83 Calculate the greatest common divisor of 7439 and 43. 43 What is the greatest common divisor of 759 and 6? 3 Calculate the highest common divisor of 4579 and 19. 19 What is the highest common divisor of 40 and 100? 20 Calculate the highest common factor of 400 and 80. 80 Calculate the highest common factor of 667 and 391. 23 Calculate the greatest common factor of 14 and 10346. 14 What is the greatest common divisor of 8550 and 1539? 171 What is the highest common divisor of 119 and 7259? 119 What is the highest common divisor of 132 and 462? 66 What is the greatest common factor of 448 and 7? 7 Calculate the highest common factor of 31 and 589. 31 Calculate the greatest common divisor of 325 and 175. 25 Calculate the greatest common divisor of 693 and 99. 99 What is the greatest common divisor of 87 and 3712? 29 What is the greatest common factor of 55 and 1243? 11 Calculate the highest common factor of 57 and 551. 19 Calculate the greatest common divisor of 84 and 56. 28 Calculate the highest common divisor of 301 and 1075. 43 What is the greatest common divisor of 54 and 594? 54 What is the highest common factor of 16 and 2? 2 Calculate the greatest common divisor of 423 and 893. 47 Calculate the greatest common divisor of 539 and 1715. 49 What is the greatest common divisor of 113 and 18871? 113 What is the greatest common divisor of 69 and 184? 23 Calculate the greatest common factor of 462 and 1056. 66 What is the highest common factor of 4453 and 949? 73 What is the greatest common divisor of 511 and 21? 7 What is the highest common divisor of 11 and 583? 11 What is the greatest common factor of 13068 and 108? 108 Calculate the greatest common factor of 14	{ "pile_set_name": "DM Mathematics" }
1. Let k be p(-9). Suppose 0 = -d + 4d - 324. Suppose 5w - kc = -d + 496, -2c + 383 = 5w. Does 26 divide w? False Let t(z) = -5z - 37. Let m be t(-8). Suppose 0 = -y + 4r + 3 + 7, -13 = -my - 5r. Suppose 2i - 256 = q, yi = 3i - 5q + 358. Is i a multiple of 9? True Let y = -61 - -74. Suppose -yl - 8 = -21l. Is -8 + 11 - (2 - l50) a multiple of 7? False Let v be (6/(-9))/(4/36). Let b(q) = -q*3 - 7q*2 - 5q + 13. Let p be b(v). Let o(n) = n*3 - 4n*2 - 13n + 4. Is o(p) a multiple of 10? True Let c = -24 + 19. Let v be (-96)/(-10) + -2 + (-2)/c. Suppose -b - 364 = -vb. Is 26 a factor of b? True Let k be -5 + ((-2)/3)/((-16)/(-72)). Does 26 divide (-15)/(9k/624)? True Let o be (-41)/1599 - 3160/(-39). Let v = -102 - -160. Let x = o - v. Is x a multiple of 3? False Let n be (2/(-6))/(12/(-360))-1. Does 5 divide (-22)/4 + 4 - 1125/n? False Let b(w) = -6w*3 + 8w*2 + 44w + 262. Is b(-5) a multiple of 42? False Suppose -2x = 39 - 41. Let m be x(-2)/13 + 469/91. Suppose mk = 0, 0k = -2q - 4k + 226. Does 25 divide q? False Let n = 7 + -7. Suppose -5b + 2g + 1 - 7 = n, 0 = 3b + 2g - 6. Suppose b = 40x - 38x - 106. Is x a multiple of 15? False Let d = 1056 + -626. Suppose 2k - q = d, 14q = -k + 12q + 220. Is k a multiple of 46? False Suppose -686x + 681x = -3350. Is 102 a factor of x? False Let m(j) = -j2 + 8j + 14. Let l be m(9). Suppose lg - 875 = -255. Is g a multiple of 11? False Let g be 49/(-14)(-114 + 2). Let n be 9/2 - g/28. Suppose 6 = -na + 2a - 3d, -5d = 15. Is 3 a factor of a? True Suppose -149184 = 1246k - 1278k. Does 21 divide k? True Let l(z) = -2z - 3. Let m be l(0). Let u be (4/m)/((-10)/45). Suppose -uo + 105 = -5o. Does 15 divide o? True Let n be (-1630)/(-25) + 16/20. Is 8 a factor of 93 + -1 + n/11? False Suppose 0 = -16m - 65 + 17. Does 31 divide m/(-5)7440/72? True Suppose -135g + 100g + 208348 - 11998 = 0. Does 51 divide g? True Let s(c) = 35118c + 522. Is s(1) a multiple of 120? True Let h(s) = 159s*2 + 10s - 12. Let i be h(-5). Suppose -x + 8x - i = 0. Suppose 4v = x - 151. Is 17 a factor of v? True Suppose 0q + 2q - 2916 = -5b, -3b - 4q + 1744 = 0. Is 4/12 - b/(-3) a multiple of 12? False Let a = 616 - 910. Let g = a - -490. Does 11 divide g? False Let t(u) = 6u*2 - 4. Let z(f) = -6f*2 + 2f + 3. Let x(i) = 3t(i) + 2z(i). Is x(-6) a multiple of 31? True Suppose -17n - 336 = -13n. Let i = 356 - n. Suppose -z + 6z = i. Is 16 a factor of z? False Let x(r) = r3 - 38r*2 - 12r + 156. Does 25 divide x(39)? False Suppose 80j = 60j + 250440. Does 8 divide j? False Suppose 0 = 3i - 379 - 701. Let q be (i/(-35))/(-6) + 4/14. Suppose o + qo = 249. Does 29 divide o? False Suppose -36q + 217669 = -73211. Does 40 divide q? True Let y = 373 - 373. Suppose u - 2u = -3o - 217, y = -2o - 4. Does 12 divide u? False Let y = 8512 - 4489. Does 129 divide y? False Let n be 145 + (16 + -11)/(10/4). Let m = n + -77. Does 15 divide m? False Let i(s) = 48s2 - 17s + 15. Let v(g) = 50g2 - 18g + 14. Let p(n) = 7i(n) - 6v(n). Is p(2) a multiple of 13? True Is 7 a factor of (-1537225)/(-153) - (-10 - -6)(-2)/36? False Suppose 4n - 13 - 39 = 0. Suppose 17w = nw + 676. Does 13 divide w? True Let m be ((-8)/(-10))/((-3)/(-15)). Suppose 2v + 4u + 16 = 0, 7 = -4v - 4u + u. Suppose mk = -5g + 587, 2g - 454 = -vg + 2k. Is g a multiple of 23? True Let a(y) = -2y*2 + 35y - 40. Let k be a(16). Let c(v) = 3v2 + 4v - 14. Is 7 a factor of c(k)? True Suppose 9h = 1669 + 833. Is h a multiple of 6? False Let o be ((-2)/(-7))/((-9)/(-63)). Does 3 divide (21/(-35) - 0)/(o/(-250))? True Let u be (-1)/2(-1 + -19 - -2). Suppose -10t = -5n - ut + 111, 2n = 5t + 49. Is (-4)/n + 23156/308 a multiple of 15? True Does 31 divide 5715 - (-4 - (-26)/6)12? False Suppose 0 = 169l - 168l - 5832 - 5999. Does 5 divide l? False Let a(m) = -m*3 - 10m*2 - 15m + 7. Let w be a(-8). Let h be (-8)/(-12) + 416/(-12) + w. Is 19 a factor of 7/h - 952/(-10)? True Let y(g) = -g*2 + 16g - 19. Let a be y(15). Let c be 5 + (-8 - a) - 3. Does 27 divide (584/40 - 5)/(c/(-45))? True Let j(i) = 16i3 + i2 + 4i + 5. Let p(r) = -r3 - r2 - 1. Let h(f) = -j(f) - 2p(f). Let x be h(-3). Suppose -7q = -3q - x. Does 11 divide q? True Suppose 4l = 2f + 26868, 5l - 20048 - 13546 = -2f. Is l a multiple of 54? False Suppose 9p + 118 = -17. Let f(r) = -24r + 72. Does 24 divide f(p)? True Let s(b) = 31b*2 - 754b + 19. Is s(37) a multiple of 35? True Suppose -2502 = -18x + 16x + 2m, m = -1. Suppose 373u - x = 363u. Is 22 a factor of u? False Let n(l) = 10l + 2. Let k be n(0). Suppose 604 = 2f + 2f + 3s, -f - ks = -146. Let c = 336 - f. Is 13 a factor of c? True Let u(c) = -2c3 - 6c*2 + 6c + 11. Suppose 13y + 62 = -3. Does 17 divide u(y)? False Let l = -119 - -125. Let j(n) = n3 - 5n*2 - 7n + 24. Let x be j(l). Let c(u) = -u*3 + 19u*2 - 20u + 49. Is c(x) a multiple of 10? False Suppose 5t = 4o + 8, -4t + 7 - 1 = -3o. Suppose t = 5f + 5l - l - 358, 4f - 3l = 305. Let i = -58 + f. Does 7 divide i? False Suppose 0 = 2b - 2i - 8, -4b - 4i - 23 = -b. Is (100 + -52)/(1/2 - b) a multiple of 16? True Suppose 5s - 5 = 10. Suppose 0 = 66d - 1700 + 644. Is 13 a factor of ((-1040)/d)/((-1)/s)? True Is 25970/4 + (-76)/(-1064)(1 + 6) a multiple of 40? False Let y = 715 - 51. Is y a multiple of 8? True Suppose 3c + 76 = 2c. Let f be 107 - 10/((-60)/(-6)). Let h = c + f. Is h a multiple of 5? True Let j(x) = 5x*3 + 6x*2 - 7x + 19. Let k(n) = n*3 + 1. Let p(r) = j(r) - 4k(r). Let d be p(-7). Suppose -dt = -20t + 200. Is t a multiple of 5? True Let y(b) = -3b - 36. Let g be y(-18). Suppose -15x - 1632 = -gx. Suppose 5p - x = -3p. Does 34 divide p? True Let u(p) = 177p - 225. Let m = 207 - 202. Is 12 a factor of u(m)? True Suppose 39x - 217428 = 376620. Does 128 divide x? True Let l = 539 - -4713. Suppose -95n + 82n = -l. Does 6 divide n? False Suppose 4o - 4579 = 682x - 685x, -20 = -4x. Is o a multiple of 7? True Let u be ((-102)/(-34))/((-2)/(-4)-3). Suppose -14m = -19m - 25. Does 7 divide (u - m)((-1)/(-1) - -13)? True Suppose -35t - 38243 = -34669 - 108889. Is 17 a factor of t? True Suppose i - 906m + 903m - 27963 = 0, 3m = 2i - 55926. Is i a multiple of 23? False Suppose 2910l - 2870l = 1343200. Is 115 a factor of l? True Suppose 2y - 7y = -5u + 40355, u - 8073 = 3y. Is 83 a factor of u? False Suppose -r + t + 33675 = 0, 12t = -4r + 126749 + 8063. Is r a multiple of 9? False Let x = -6183 + 9391. Does 9 divide x? False Let w be 226/8. Suppose 3p = h - 5, 47h - p = 52h - 9. Suppose -wd - hd + 85 = 0. Is 17 a factor of d? True Suppose 0 = 16c - 32. Suppose -8g + ca + 770 = -6g, 0 = -5a + 25. Does 20 divide g? False Suppose -15d + 20d = 2p + 34246, 0 = d - 2p - 6854. Is d a multiple of 32? True Let o(x) = -4x2 + 58x - 6. Let h be o(12). Let z = h - -108. Is z a multiple of 6? True Let f = 6798 + -2486. Does 28 divide f? True Let x(s) = 1539s3 - 2s - 3. Let l be x(2). Suppose -l = -29g + 18319. Is g a multiple of 48? True Is 65284 + (-594)/54 + (7 - 0) a multiple of 10? True Let f be 4152/(-20) + -5 - (-21)/35. Let z = f + 695. Is 60 a factor of z? False Let g be (14/21)/(2/36). Let n be 1(g - -1) + (1 - 0). Suppose nq - 6q = 528. Does 28 divide q? False Let u(r) = -21r - 11. Let m(k) = 7k + 4. Let q(z) = 8m(z) + 3u(z). Let s(d) = -7d - 2. Let t(a) = -3q(a) + 2s(a). Does 11 divide t(8)? True Let v(b) = 5b*2 + 15b. Suppose 4m = -3f + 6f - 41, 3f - 52 = 5m. Is v(m) a multiple of 55? True Let l = 182 + -174. Suppose 66 = ld - 174. Is d a multiple of 10? True Let d(u) = -u*3 - 5u*2 - 3u - 9. Let n be d(-5). Suppose -2h + 2w = 2h + n, -w - 5 = 0. Is 2/h - 219/(-2) a multiple of 18? False Let b = 453 - -1155. Is 214 a factor of b? False Let a(t) = -401t - 2864. Does 42 divide a(-31)? False Let p = -399 - -751. Suppose -3c + p + 237 = -4u, 0 = -5c + u + 1010. Is 10 a factor of (3 - -1)1 + (c - -2)? False Let m(s) = s*2 + 4s - 3. Let u be m(-6). Suppose 0 = -h + t + 3, 13 = -3t + 10. Suppose -4b + 15 = hz - 7, -3b - 4*z = -u. Is 5 a factor of b?	{ "pile_set_name": "DM Mathematics" }
2/7, -1/11? -1/11 Let z = -128 + 257/2. Let i = -1.7 + 1.4. What is the second biggest value in 30, z, i? z Let g = 661/7 - 94. What is the second biggest value in g, 1, -1/4? g Suppose 37 = -104j + 245. Let b = 0.3 + 6.7. What is the third smallest value in b, j, -1? b Suppose 12 = 2s + 5y, 2s - 10 = 3y - 30. Which is the second biggest value? (a) 0.4 (b) s (c) -23 (d) -5 b Let x = 57 + -65. Let f be (6/x)/((-30)/(-4)). Which is the second smallest value? (a) 2 (b) f (c) 0 c Let l = 4967/115 - 975/23. Let m = 0 - -1. Which is the third biggest value? (a) m (b) l (c) 2/9 (d) -0.01 c Let r = 155/167 + 346776/1169. Let g = 297 - r. Let s(x) = -x3 + 7x*2 - 7x + 8. Let n be s(6). Which is the third smallest value? (a) 2/3 (b) n (c) g b Suppose 74 - 69 = -l. Let f = 33971/114 + -595/2. Let r = -3/19 + f. Which is the biggest value? (a) 0.5 (b) r (c) l a Let q = -17.66 + -0.34. Let l = -17.95 - q. Which is the third smallest value? (a) -4 (b) l (c) -1 b Suppose -4j + 18 = 2m, -m + 3 = -2. Suppose o - 3 = -4t - 12, 2t + j = 2o. What is the second biggest value in 0.1, 1/4, 34, o? 1/4 Let h = 5.7 + -4.58. Let f = h + -1.1. Let q = f + 7.98. Which is the smallest value? (a) -1 (b) -2 (c) q b Suppose 5z - 14 = -f, -2f - 17 = -5z - 0f. Suppose zw - 21 + 15 = 0. Which is the biggest value? (a) -5 (b) 0.1 (c) w c Let z = 112 + -6. Let o = -106.2 + z. Let x = 0.2 + 3.8. Which is the second biggest value? (a) x (b) -3/7 (c) o c Let x = 0.1 - 0.6. Let p = x + -13.5. Let h = p - -11. Which is the biggest value? (a) h (b) 0.5 (c) 3/2 c Let i = 0.26 - -1.14. Let k = 2.48 + 0.12. Let r = k + i. Which is the second smallest value? (a) r (b) 0.4 (c) -3 b Let t be ((-146)/(-365))/(4/(-10) - 1). What is the fourth biggest value in -4, -1/2, t, 2? -4 Let t = -32.7 + 34.7. What is the biggest value in -3, t, 1, -0.02? t Let m(k) = k*3 + 6k*2 - 9k - 12. Let h be m(-7). What is the second smallest value in -4/11, 0, -0.2, h? -0.2 Let l(w) = -w*3 - 15w - 6 + 1 + 2w3 + 13w*2 + 0. Let s be l(-14). Suppose -2x - 1 = s. What is the second smallest value in 2/7, -3, x? -3 Let j be 2/(3 + (-7)/3). Suppose jz + 5x - 3x = 11, 0 = -2z + 3x + 3. Let f = 0.1 - 0.11. Which is the biggest value? (a) f (b) -0.5 (c) z c Let x = 5 - 6. Let i be (2 + x)(-4)/12. Let u = -32 - -32.1. Which is the second smallest value? (a) u (b) 2 (c) i a Let d be (-6)/9(470/(-65) - -7). What is the third smallest value in -0.3, d, 0.09? d Let g be (4/(-3))/(-1) - 2. Let q = 356 - 345. Which is the third smallest value? (a) g (b) -0.2 (c) q c Let y = 0.05 - 1.05. Which is the fourth biggest value? (a) -2/5 (b) 0.3 (c) -4 (d) y c Let a = -312 + 302. What is the fourth smallest value in a, 0.5, 4, 0.3? 4 Let p = 53689/15 - 3574. Let f = -23/5 + p. Let v = 28 - 33. What is the smallest value in -2/7, v, f? v Let p be (-21(-22 - -9))/(-1). Let y = -26 - p. What is the biggest value in -0.4, -0.19, y? y Let h = -0.16 - -15.16. Let q = 147 + -131. Let m = q - h. Which is the third smallest value? (a) -1 (b) -2 (c) m c Let g be -2 + 48/(10 - 4). Which is the third smallest value? (a) 1 (b) g (c) 69 c Let v be 96/210 - (-2)/5. Let w = 9 - 4. Let s = 4.5 - w. Which is the biggest value? (a) 3 (b) v (c) s a Let v = 297 + -126. Let j = -120 + v. Let d = 99/2 - j. Which is the biggest value? (a) d (b) -0.3 (c) 0 c Let q = -5 + 3. Let x = -11 - -16. Let h = -21/4 + x. What is the smallest value in h, q, 4/3? q Let m = 587.98 + -588. What is the biggest value in 0, -5, m? 0 Let d = -89 - -76. What is the fourth biggest value in 1, 0.2, d, -0.3? d Let j = 11/8 - 9/8. What is the smallest value in 2.9, 4, j, 0.4? j Let q = -1.58 - -84.58. Let n = q - 72. What is the smallest value in n, -2/9, 0.4? -2/9 Let d = -322 + 325. Let x(w) = w3 - 8w*2 + 6w + 10. Let g be x(7). Suppose o + g = -2. Which is the third biggest value? (a) o (b) 5 (c) d a Let y = 22.8 - 15.79. Let i = y + -0.01. Which is the second biggest value? (a) i (b) -1/3 (c) -1/7 (d) -3 c Let g be 3/(-15) - (-156)/30. Suppose 5z - 3x = 36, -3z - gx - 22 = -5z. Let o be z/(-9) - (-84)/18. Which is the smallest value? (a) -3 (b) 0.02 (c) o a Let w = 422 - 422.5. What is the second biggest value in -3, 226, w? w Let s = -235 - -233. What is the second smallest value in -43, 2, s? s Let k = 86.7 - 91.7. Which is the third smallest value? (a) -1 (b) 16 (c) k (d) 1 d Let i = -140 + 196. Let z = 61 - i. What is the biggest value in z, 0, -4? z Let v = 0.7 - 0.4. Let k = 84.3 - 85. Let s = k + v. What is the second smallest value in s, -0.2, 4? -0.2 Let q = 11/10 + 2/5. Let a = 2.3 - 20.3. Let x = 8 + a. What is the third biggest value in 3, x, q? x Let v(f) = f3 - 10f2 - 5. Let p be v(10). Let j = -1060 + 1065. What is the biggest value in p, 6, j? 6 Let c be (-1836)/(-5103) + (-2)/27. What is the smallest value in c, -0.3, 11? -0.3 Let y = 131.4 - 131. What is the third biggest value in 24, 3, y? y Let x(v) = v3 + 160v2 + 0 - 146v*2 + 1 - 15v. Let n be x(-15). Which is the second biggest value? (a) 0.5 (b) n (c) -2 a Suppose 3q + 5m + 18 = 0, -4q - 40m + 35m - 19 = 0. Which is the biggest value? (a) 1 (b) 78/11 (c) q b Let v = -50 - 101. Let f = 153.6 + v. Which is the second biggest value? (a) 2 (b) f (c) 1 a Let x = -27.6 - 6.4. Let h = -14 - x. Let t = -20 + h. What is the second biggest value in -1/2, -0.2, t? -0.2 Let a = -292 + 291. Let h = -5.1 + 1.1. Let k = a + h. What is the smallest value in k, -3/2, 0.2? k Suppose 0j - 3j - 6 = -z, -2z = 6. Let l = -4 - -8. What is the smallest value in j, l, 3? j Let l = 77 - 82. Let n be (-2)/(l/(40/28)). What is the smallest value in 2, n, 0.01? 0.01 Let l = 0.125 - -0.275. Which is the third biggest value? (a) -3/4 (b) l (c) -0.87 c Let x(i) = -i*3 + 8i*2 + 9i + 1. Let b be x(9). Let d = -0.024 + 0.114. What is the fourth biggest value in -1/2, d, 5, b? -1/2 Let t = 195 + -352. Let f = t - -155. Let s = 9 + -17/2. What is the third smallest value in s, -13, f? s Let s be (-8)/(0 - -2) + 15 + -11. Which is the smallest value? (a) s (b) -7 (c) -0.2 (d) 0.1 b Let o = 0.9 + -1.18. Let t = 0.02 - o. Which is the second biggest value? (a) -4 (b) t (c) -5 a Let t = -2.161 + 2.181. Let p be ((-6)/16)/((-1)/2). Which is the second smallest value? (a) t (b) 4 (c) p c Suppose 2h + 100 = 7h. Suppose 11p - 7p + h = 0. Which is the third biggest value? (a) 5 (b) p (c) -3/4 b Let z = 2 + -4. Suppose -i + 5i = -4s + 64, 5s = -i + 60. Suppose 5b - s = -4q, 4b - 3q = -0b + 15. What is the third biggest value in z, b, -5? -5 Let l = -0.7935 + 0.0935. Which is the fourth smallest value? (a) 0.2 (b) l (c) -2/9 (d) 4 d Suppose -2x = -4k - 16, 3x + 16 - 10 = 0. What is the biggest value in 0.15, -0.4, -3/5, k? 0.15 Let z = 116.9 + -116.6. Which is the second biggest value? (a) z (b) -6 (c) 4/7 (d) -1/5 a Let s = -147 + 65. Let i = s - -82.04. What is the second biggest value in i, -1/4, -1/3? -1/4 Suppose -5j + 2 - 3 = 4x, 0 = 2j + x + 1. Which is the biggest value? (a) -0.5 (b) j (c) 1.2 (d) -5 c Let o(d) = 3d3 + d3 + 3d - 3d3 + 4d**2 + 4. Let w be o(-3). What is the third smallest value in -0.4, w, 3? w Let c = -17.6 + 18. Let f = 116 + -115.5. What is the fourth biggest value in 2/9, f, c, 0? 0 Let w be (-3 - 0)/((-12)/548). Let m = -406/3 + w. Let t = 113 - 113. Which is the third biggest value? (a) t (b) -0.5 (c) m b Let l = 0.28 + -0.3. Let s = l + -1.98. Let h = -0.04079 + -0.15921. Which is the third biggest value? (a) h (b) s (c) 0.4 b Let c = 49.5 - 50. Let p = 0.15 + 0.05. What is the third smallest value in c, p, 4? 4 Let l be 68/(-170) - (-104)/10. Let z be (l/20)/((-23)/12 + 2). Which is the smallest value? (a) 0.4 (b) z (c) -2/17 c Let c = 2.8 - 3. Let b = 6.29 + -6. Let v = -0.11 - b. What is the biggest value in v, c, -3/7? c Let s = 240.2 + -186. Let h = -54 + s. What is the second biggest value in 5, -2, 0.1, h? h Let o = -3.18 - -7.88. Which is the biggest value? (a) o (b) 0 (c) -6/5 a Let n = 323 - 328. What is the fourth biggest value in 2/7, n, 2, 1? n Let k = 3/4412 + -2920765/30884. Suppose	{ "pile_set_name": "DM Mathematics" }
Suppose -2i + 15 = 3d, -d + 15 + 4 = 3i. Calculate ix(v) - 5f(v). -2v3 Let i(u) = -u3 + u*2 + 1. Let k(a) = -3a*3 + 8a*2 - 11a + 6. Let v(s) = 3i(s) + k(s). Let q(g) = -g3 + 2g*2 - 2g + 2. Give -11q(j) + 2v(j). -j*3 - 4 Let n(w) = -76w*3 + 38w. Let q(g) = -g*3 + g. Give n(j) - 38q(j). -38j3 Let t(o) = 9o. Let g(d) = -8d - 1. Let a(j) = -5g(j) - 4t(j). Let k(c) = -6c - 8. Give -8a(n) - 5k(n). -2n Let g = 6 - 2. Suppose 0 = x - d - 4, 0x + gx = -3d - 5. Let n(i) = -i3 - i2 - i. Let k(o) = 5o3 + 2o*2 + 6o. Give xk(v) + 4n(v). v*3 - 2v*2 + 2v Let v be 22/2-1 - (-5 + 8). Let q(y) = 6y + 14. Let t(n) = 2n + 5. Calculate vt(b) + 5q(b). 2b Let o be 3 + ((-9)/(-3) - 1 - 0). Let i(b) = -7b2 + 3b + 4. Let j(p) = -6p2 + 2p + 3. Calculate oj(y) - 4i(y). -2y2 - 2y - 1 Let y(j) = -j*3 - 4j*2 + 3. Let x(s) = 1. What is 5x(n) - y(n)? n*3 + 4n*2 + 2 Let j(g) = 7g. Suppose 15 = -p + 5c, 0 = -4p + 3c - 2c - 22. Let l(t) = -2t + t + 7t + 5t. Give pl(m) + 8j(m). m Let z(m) = 4m. Suppose -5o = 5t + 60, 2o + 38 = -7t + 3t. Let g = t - -2. Let y(i) = -3i. What is gy(p) - 4z(p)? -p Let n be 21/(-28) - 42/8. Let a = 8 + n. Let k(l) = 6 - 3 - 9 + al - 7. Let d(m) = -m + 7. Give -11d(w) - 6k(w). -w + 1 Let a(h) = -h - 4. Let d(l) = 2l - 5 - 4l + 7. Let g be d(3). Let o(f) = 2f + 9. What is go(y) - 9a(y)? y Suppose 155 = -3b - 2b. Let k = 17 + b. Let h(g) = -5g. Let f(j) = 2j. Give kf(x) - 6h(x). 2x Let w(f) = 2f*2 + 2f - 2. Let s(y) = 0 - y*2 - y + 2y*2 + 1 - 2y*2. Determine -3s(r) - w(r). r*2 + r - 1 Let w(r) = -10r*3 - 6r*2 - 36r. Let z(d) = 2d3 + d2 + 7d. What is -3w(q) - 16z(q)? -2q3 + 2q*2 - 4q Let b(f) = f*2 - 8f - 8. Let v(r) = r + 1. Give -2b(g) - 14v(g). -2g2 + 2g + 2 Suppose 48 = 12q - 6q. Let x(g) = -2g - 3. Let s(d) = 5d + 9. Give qx(z) + 3s(z). -z + 3 Let k = -11 - 0. Let u(n) = -29n + 12 + 4 - 15. Let i(o) = 15o - 1. Let h(p) = ki(p) - 6u(p). Let r(f) = -4f - 2. Give -2h(m) - 5r(m). 2m Let n(f) = 3f. Let p be (2 + -1)(1 - 11). Let s(d) = -d. Let m be -2 + 3/(3/(-2)). Give mn(r) + ps(r). -2r Let v(l) = -l. Let z(t) = -2t*2 - 10t + 6. Calculate -8v(d) + z(d). -2d*2 - 2d + 6 Let o(l) = l - 1. Let j = 15 + -12. Let v = -6 + j. Let b(t) = -t + 4. Give vo(m) - b(m). -2m - 1 Let s(n) = 3n - 3. Let l(m) = 2m - 2. Calculate 5l(c) - 4s(c). -2c + 2 Let u = 6 + -3. Suppose -4q = -q + u. Let y = q - 2. Let g(i) = -5i2 - 3i. Let f(c) = -4c2 - 2c. Give yg(d) + 4f(d). -d*2 + d Let f = -41 + 37. Let u(d) = 15d*3 - 7d*2 + 7d + 7. Let z(q) = 8q3 - 4q*2 + 4q + 4. What is fu(l) + 7z(l)? -4l3 Let p(h) = -3h - 1. Let o(q) = 2q + 1. Let b(z) = -7o(z) - 5p(z). Let y(a) = -2. Calculate 4b(c) - 3y(c). 4c - 2 Let f(t) = -t*2 - 1. Let c(q) = 59q*3 - 177q*2 - 177. Give c(k) - 177f(k). 59k3 Let x(y) = -4y*2 + 4. Suppose -p + 2j = 2p - 10, 4p - j - 10 = 0. Let k(r) = -9r2 - r + 9. Let b be 0 - (6 + -3 + (0 - -2)). Give bx(l) + pk(l). 2l*2 - 2l - 2 Let m(f) = 3f3 + 7f*2 - 2f + 5. Let i(z) = -2z3 - 4z*2 + z - 3. Calculate -5i(a) - 3m(a). a3 - a2 + a Let h(t) be the first derivative of -t3/3 - 5t*2/2 + 7t - 2. Let j(g) = -8 + 12 - 5 + g. Calculate -h(p) - 6j(p). p2 - p - 1 Let c be ((-10)/6)/(1/(-9)). Let f = -7 + c. Let w(l) be the first derivative of -2l*2 + 2l - 2. Let j(o) = -11o + 5. What is fw(z) - 3j(z)? z + 1 Let q(c) = c2 + 3c + 3. Let j be 5/(-15) + 21/9. Let r be 15/(-5) + (j - -3). Let x(m) = m + 1. Determine rq(l) - 6x(l). 2l2 Let l(z) = z3 - 1. Let q(k) = -3k*3 + 2k + 6. Suppose -15j = -22j - 42. Calculate jl(u) - q(u). -3u*3 - 2u Let t(y) = -9y2 + y + 6. Let q(o) = -26o*2 + 2o + 17. Calculate 3q(x) - 8t(x). -6x2 - 2x + 3 Let x(j) = 1. Let b(o) = -o + 1. Suppose -m - 4t = -2, -m - 2t = -0t. Let s = 5 - 3. Suppose 0 = -6q + 5q + s. Give mx(r) + qb(r). -2r Let p(z) = -4z2 + 5z + 5. Let i(d) = -d*2 + d + 1. Let j be (-24)/(-60)(-24 + -1) + 0. Let r(f) = f*2 - 7f + 2. Let o be r(7). Give ji(l) + op(l). 2l2 Let w(v) = v - 6. Let f(x) = -2x + 11. Let k be (1 + -5)/(-4 - -6). Let r be (-17)/(-4) + k/8. Suppose -ro - 37 + 9 = 0. What is ow(l) - 4f(l)? l - 2 Let m(w) be the second derivative of -3w*5/20 + 5w4/12 - w3/3 - 5w2/2 - 44w. Let i(r) = -r*2 + 1. Give -5i(l) - m(l). 3l3 + 2l Let j(p) = -p. Let t(s) = -4s + 8. Let o(v) = 5j(v) - t(v). Let d be o(-7). Let m(c) = 5c - 1. Let w(i) = -i + 1. What is dm(g) - 3w(g)? -2g - 2 Let n(y) = 2y3 + 7y + 7. Let v(x) = 19 - 15 + 4x + 4x*3 - 3x*3. Give 4n(u) - 7v(u). u3 Let a(o) = 17o - 20. Let i(q) = -9q + 11. Let t(k) = -3a(k) - 5i(k). Let y(z) = -5z + 5. Calculate -6t(f) + 7y(f). f + 5 Let y(u) be the third derivative of -u4/24 + u3/6 + 3u2. Let i(l) be the third derivative of -l4/24 - l3/6 + l2. Give i(b) + y(b). -2b Let v(u) = -u*3 + 2u2 - u - 5. Let g(h) = h3 - h*2 + h + 3. Give -5g(t) - 3v(t). -2t3 - t2 - 2t Let y(t) = t3 - 7t*2 - 9t + 5. Let u be y(8). Let g(i) = 3i2 + 7i + 3. Let s(n) = 2n2 + 4n + 2. Give ug(k) + 5s(k). k*2 - k + 1 Let m(c) = -7c*3 + 5c*2 - 5c. Let l(s) = 20s3 - 14s*2 + 14s. Let b be (4/6 - 0)/(10/75). What is bl(x) + 14m(x)? 2x3 Let p(u) = 3u + 8. Let s(q) = -q - 3. Let c(z) = -4p(z) - 11s(z). Let r(f) = -46 + 0f + 3f + 44. What is -6c(m) - 3r(m)? -3m Let q(h) = -2h*2 - 5h - 15. Let c(n) = -n*2 - 3n - 7. Calculate 13c(r) - 6q(r). -r*2 - 9r - 1 Let w(p) = -4p2 + 3p*2 + 3p*2. Let h(k) be the first derivative of -2k3/3 + k2/2 + 2. What is 2h(i) + 3w(i)? 2i2 + 2i Let h = -6 - -6. Let f(b) = 2b + b - 2b + hb - 4. Let g(s) = 2s - 9. Determine -14f(i) + 6g(i). -2i + 2 Let o(a) = a3 - a2 + 1. Let y(t) = t3 - 11t*2 + 11t - 12. Let r be y(10). Let u(g) = g*3 + 2g*2 - 2. What is ro(d) - u(d)? -3d3 Let u(h) = 37h*2 - 47h + 19. Let z(r) = 12r2 - 16r + 6. Let n(x) = 3u(x) - 8z(x). Let l(m) = 7m2 - 6m + 4. What is -13l(g) + 6n(g)? -g*2 + 2 Suppose 4h + 8 = -5y, -4h + y + 7 = 39. Suppose -3o + 3 = -2o. Let k = o - 6. Let c(u) = -u + 3. Let p(f) = 2f - 7. What is hc(x) + kp(x)? x Let a(f) = 220f + 52. Let u(w) = -13w - 3. Determine -6a(o) - 104u(o). 32o Let g(m) = 7m - 2. Let w(s) = 15s - 4. Let v(y) = 5g(y) - 2w(y). Suppose 3 = 4o - 21. Let c(p) = p. Give oc(l) - v(l). l + 2 Let d(b) = -20b3 - 17b*2 + 17b - 17. Let s be 1/2 + 70/(-4). Let l(y) = -7y3 - 6y*2 + 6y - 6. Let j be (-185)/(-30) + 1/(-6). Give jd(r) + sl(r). -r*3 Let t(c) = 24c*2 - 14c. Let s(x) = 8x2 - 5x. What is 14s(y) - 5t(y)? -8y2 Let c(m) = -115m*2 + 4m. Let b(g) = 8164g2 - 286g. Calculate 2b(t) + 143c(t). -117t2 Let r(i) = -4i*2 - i - 1. Let p(g) = 10g*2 + 2g + 2. Calculate 5p(j) + 12r(j). 2j2 - 2j - 2 Let s(t) = t - 1. Let r(x) = x + 3. Let g be 2/((-56)/76) + (-2)/7. Determine gs(d) - r(d). -4d Let x(c) = -c*2 + 6c + 1. Let k(d) = 1 + d - 1. Let h = 0 + 5. Let a be (h - 3)/(0 + 2). Calculate ax(s) - 6k(s). -s*2 + 1 Let n(h) = 2h*3 + 2h*2 - 4h - 2. Let o(m) = m + 1. Calculate -n(f) - 4o(f). -2f*3 - 2f*2 - 2 Let j(s) = -5s. Let q(l) = 4l + 1. What is -5j(i) - 6q(i)? i - 6 Let g(c) = 9 + 5 - 3 + 13c - 7c2. Let a(y) = 10y*2 - 7y - 9. Let l(r) = 18r2 - 14r - 17. Let i(o) = -5a(o) + 3l(o). What is 6g(k) + 11i(k)? 2k2 + k Let g(s) = -12s*3 - 5s*2 + 5s. Let t(x) = -11x3 - 4x*2 + 4x. Give 4g(l) - 5t(l). 7l3 Let m(g) = -g - 1. Let v(k) = 1 - 3 - 3 + 6. Let b(s) = s - 2. Let x(j) = -b(j) - 2v(j). Determine 2m(z) - 3x(z). z - 2 Let z(h) = h*3 + 6h*2 + 2h - 6. Let a = -126 - -120. Suppose 0j - 5 = 5j. Let t(c) = c*2 + 8 + 2c*2 - 4c*2 - 7. Give at(g) + jz(g). -g3 - 2g Let d(j) = -21j3 + 7j*2 + 7j - 7. Let v(k) = 7k3 - 2k*2 - 2k + 2. What is 2d(u) + 7v(u)? 7u3 Let g(c) = 2c + 2. Let i(h) = 8h + 9. Let o = -4 + 2. What is oi(z) + 9g(z)? 2z Let y = -72 - -76. Let u(j) be the third derivative of j3/6 - j2. Let	{ "pile_set_name": "DM Mathematics" }
rest to z? (a) 2 (b) m (c) 1 c Let o = 265 - 252.1. Let a = 15 - o. Let r = 0.1 - a. What is the nearest to 1 in 0.3, 1/2, r? 1/2 Let j be ((-12)/90)/((-8)/(-10)). Which is the nearest to 0? (a) -3 (b) j (c) 1 b Let r = 3.1 - 3. Let k(v) = -v*2 - 3v + 4. Let l be k(-3). Which is the closest to r? (a) 3/8 (b) l (c) 0.4 a Let o = -175 + 175.02. Which is the closest to o? (a) -0.03 (b) -0.2 (c) 1/8 a Let i = -0.14 + 0.04. Let o = i + -3.9. Let u = -797/1407 + -1/201. Which is the closest to -0.1? (a) -3 (b) o (c) u c Let j = 0.46 + -0.06. Let s = -2 + 1. Let n = s - 0. Which is the nearest to 0.1? (a) j (b) -1/2 (c) n a Let t = 13/22 + -1/11. Which is the nearest to 0? (a) 1/3 (b) -4 (c) t a Let g(x) = x*3 - 7x*2 - 7x - 10. Let l be g(8). Suppose 3a - 3a = -4a. What is the closest to a in -4, l, 0.4? 0.4 Let q = 0.15 - 0.55. Which is the nearest to 23? (a) q (b) -1 (c) 0 c Let m be 2/1 - (-156)/(-91). What is the nearest to m in -0.3, -2/9, 1? -2/9 Let i = 0.4 + -0.3. Let s = 5.2 + -9. Let g = s + 4. Which is the closest to i? (a) g (b) -5 (c) 1 a Let b = -4.2 - 0.8. What is the closest to -4 in -0.5, -4, b? -4 Let s = -3642/13 - -280. Let r = 2 - 7. Let v = 0.06 + -1.06. What is the nearest to v in -2, r, s? s Let n be (1 - 2)/(2/(-6)). Let b = 17.451 + 0.049. Let u = 18 - b. What is the nearest to -2/3 in n, 1, u? u Let y = -1 - 0. Let c be (14/10)/(6/375). Let x = c - 86. What is the nearest to y in 2, 3, x? x Let t = 0.76 + -0.74. Which is the closest to -0.2? (a) -0.3 (b) -1 (c) t a Let o = -12 + 13. What is the nearest to o in -4/7, -3/4, 1/5? 1/5 Let v = 0.093 + -0.163. Which is the closest to 0? (a) 1 (b) -4 (c) v c Let i = -2.5 + -0.5. Let y = -10.5 + 10.9. Which is the closest to 2/5? (a) i (b) y (c) 2 b Let g be ((-7)/(-56))/(3/8). What is the nearest to 2 in g, -3/7, -1? g Let y = -0.013 - 3.987. What is the closest to 0 in 1, 0.2, y? 0.2 Let c = 37 + -36.93. What is the nearest to 1/5 in -3, c, 0? c Let z = 0.77 - -5.33. Let b = z - 6. Let u be 28/6 - 2/3. What is the nearest to -3 in b, u, -5? -5 Let g = -5 - -4.6. Suppose 5u - 7 - 13 = 0. Which is the closest to 0? (a) g (b) -0.5 (c) u a Let m = 0.06 + -0.36. What is the closest to -1/4 in 3, m, -4? m Suppose -8 = -4l - 32. What is the nearest to 1 in l, -0.2, -3? -0.2 Let t = -12 + 11.8. Which is the nearest to 1? (a) 0 (b) -2 (c) t a Let p be 2 - 3/((-4)/(-4)). Let s = -0.2 - -0.4. Which is the nearest to -2/3? (a) 2/3 (b) p (c) s b Suppose -5a - 2 = -3a. Let d = 4.5 + -4.1. What is the nearest to a in d, -2/19, 1? -2/19 Let k = -9 + 12. What is the nearest to -2 in 20/3, 4, k? k Let g be (-4)/525/(-1930). Let z = g + -396/965. Let b = 233/3 - 77. What is the nearest to 2/5 in -2/3, b, z? b Let j = -934/9 - -104. What is the closest to j in 2, 0.4, -0.1? 0.4 Let m = -8 + 8.1. Let n = 4.7 + -4. Let p = n - 1. What is the nearest to -1 in m, 5, p? p Let q = 2 + -1. Which is the nearest to q? (a) 0.3 (b) 0 (c) -4 a Let t be (3 + -1)90/36. What is the nearest to -1 in 7, t, 4? 4 Let m = 0.003 - 0.103. What is the closest to m in -1/9, -5, 2? -1/9 Suppose 15 = t - 4s, -3t + 7t - 2s = 32. What is the nearest to -0.1 in 4, t, -0.1? -0.1 Let t = -2.7 + -1.3. What is the nearest to 0 in t, -5, -2/21? -2/21 Let b = -2 + 1.6. Let i = -738/5 - -148. What is the nearest to i in b, 2, 3? b Let k = -11 + 13. Let y be (20/95)/(0 - -2). What is the nearest to -0.1 in k, -0.1, y? -0.1 Let j = -5 + 7. Suppose 7v = jv + 20. Suppose 3k + 16 = v. Which is the closest to -1? (a) -1 (b) -1/6 (c) k a Let x be (-1)/((-4 + 1)/(-3)). Which is the nearest to x? (a) -8 (b) 0.4 (c) -5 b Let z = -8 + 16. Let w = 7.7 - z. What is the closest to 1 in 2/9, w, -2? 2/9 Let a = 841/10 - 84. Suppose -24r - 13r = -13r. What is the closest to r in 2/3, -1/4, a? a Suppose 5d + 2 = 7. Let k be (d-3)/(9/2). Which is the closest to -2/3? (a) 2/9 (b) k (c) 1/3 b Let u = -38 - -340/9. What is the nearest to 2 in u, -1, -3/5? u Let s = -13.85 + 14. Let o = 0.05 - s. Which is the closest to -2? (a) o (b) -2/7 (c) -0.2 b Let t be 1 + (-1 - 1) - 6/(-10). What is the closest to -1/3 in -2/7, -0.1, t? -2/7 Let y = 7/3 + -29/15. Let g = 0.9 - 1.1. What is the nearest to y in g, -3/7, -1? g Let h = -13 - 9. Let s be 18/(-12) - h/20. Let c = 1.3 - -0.7. What is the nearest to 0 in 1, s, c? s Let j = 0 - 0.5. Let n = j - -1. Let r be -4(2 - (-39)/(-21)). What is the closest to 0 in n, 0.3, r? 0.3 Let n(c) = -16c - 1. Let z be n(-9). Suppose 8 = 4s + 3r - 2, -3r + 6 = 0. Let i be z/(-33) - (-3)/s. What is the closest to -0.1 in -0.2, i, -0.3? -0.2 Let h = -3/47 - -68/329. What is the nearest to -1/4 in -3, -2/9, h? -2/9 Let i = 21 + -20.7. Let g = 7 + -11. What is the nearest to 2 in -2, g, i? i Let g = 2.95 - 0.05. Let l = g + 2.1. Let s = 1 - 3. Which is the nearest to s? (a) -1 (b) l (c) -1/5 a Let j = -1 + 2. Let n = -1.0207 - -0.0207. Which is the nearest to j? (a) 0.4 (b) n (c) -2 a Let y = -2 - -1.9. Let g = -75 - -75.1. Suppose -5o - 28 = -2z, 3o = z - 9 - 7. Which is the nearest to -1? (a) g (b) y (c) o b Let u = -14244/5 - -2858. Let h = u - 9. Which is the closest to -1/3? (a) h (b) -1/3 (c) -0.1 b Let h be (-4)/(-30)(12 - 7). What is the closest to 0 in 0.1, 2/5, h? 0.1 Let y = -46 + 140/3. Suppose -2d = -5h + 1, 0d = h - 2d - 5. Which is the closest to 0? (a) h (b) y (c) -5 b Let v = 34.8 + -35. What is the closest to -0.3 in 3/7, v, 1/6? v Let j be 20/6(-3)/(-45). Which is the nearest to -2/11? (a) j (b) -1/3 (c) -4 b Let z = -0.8 - -0.8. Let w be (45/(-21) - -2)2. Which is the nearest to z? (a) -1 (b) 4 (c) w c Let y = 12.2 + -12. Which is the closest to 2/3? (a) y (b) 5 (c) 0.5 c Let y = 0.42 - 0.02. Which is the nearest to 0.1? (a) 2 (b) y (c) -0.08 c Let r = 0.05 - 0.03. What is the nearest to r in 1, 0.3, 5? 0.3 Let m = -76 - -301/4. Let k = 0.09 + -6.09. What is the nearest to k in m, -2/5, -4/3? -4/3 Let r = 3/37 - -65/111. Let m(p) = -p*2 - 3p + 2. Let c be m(-4). What is the nearest to r in -0.3, c, -5? -0.3 Let x = 3.2 - -0.8. What is the nearest to -0.2 in -5, x, 0? 0 Let m be ((-3)/(-2))/(39/(-104))1. What is the closest to 2/11 in -2, m, -3? -2 Let p = -0.12 + -3.88. Let w = p + 9. Which is the closest to -2? (a) 2/3 (b) w (c) 1 a Let t = 0.103 - 0.603. Which is the closest to -6? (a) 4 (b) -2/11 (c) t c Let i = 0.28 + 0.02. Let q = i - -0.7. Let r be ((-8)/(-12))/((-2)/9). Which is the closest to q? (a) r (b) 1 (c) 4 b Let s = -9 + 9. Suppose s = -g - g - y + 9, -5y + 23 = -g. What is the nearest to 0 in 0.1, g, 1? 0.1 Let k = -0.453 - -0.053. Which is the nearest to 1/2? (a) k (b) 0.5 (c) 1/3 b Let q = 0.9 + -1.9. Let x = -6 - q. Let l = -6.3 + 6. What is the closest to -2/9 in l, x, 3? l Let c = -5.31 + 5.11. Let m be -5(-2)/4-2. What is the closest to 1 in c, 1/3, m? 1/3 Suppose d + 5 = 4. Which is the closest to 5? (a) -2/3 (b) d (c) 0.4 c Let t be (-2)/(-2)(9 - 11). Let z be (-3(-2)/1)/t. Which is the nearest to 1/2? (a) 0.1 (b) -2 (c) z a Let r(g) = g*3 + 3g*2 - 3g + 3. Let j be r(-4). Let h be 0 + (1 - 3) - j. Let p be (-2)/12 - 2/6. What is the closest to 0 in -4, h, p? p Let b = 4.4 + -4. Let q = -0.04 - 4.96. What is the closest to -0.1 in b, 0.3, q? 0.3 Let s = 2.22 + -0.22. Let r = s + -6. What is the closest to 0.2 in 0, r, -5? 0 Let x = 20.5 - 20. Which is the nearest to -2/7? (a) x (b) 1/3 (c) -0.03 c Let d = -4/39 - -98/195. Which is the closest to 5/7? (a) 5 (b) 4 (c) d c Let j = 2.95 + 0.05. Let l = 4 + -7. Let n = -96 - -482/5. What is the closest to n in 1/5, l, j? 1/5 Let g be 2 + 160/(-32). Which is the nearest to -1? (a) g (b) 2 (c) 0 c Let u = 0.9 + -1.9. Let w = 0.4 - 0.3. What is the closest to w in u, 4/5, 1/5? 1/5 Let h = 25 + -26.5. Let w = h + 1.5. What is the closest to w in -3/2, 1, -1/4? -1/4 Let y = 62.01 - 62. What is the nearest to 1/4 in y, -4/5, -1? y Let l = -15 + 9. Let p(f) = f2 + 6f. Let s be p(l). Let u = 0.3 - -0.1. What is the closest to s in 0.1, -5, u? 0.1 Suppose -3z = y + 1, -5z + 7y - 4y - 25 = 0. Let g = -7 - -21. Suppose -j + g = 17. Which is the closest to -1/2? (a) 5 (b) j (c	{ "pile_set_name": "DM Mathematics" }
asing order. 5, y, -2 Let p = -0.1 - -0.2. Let y = 0 + p. Let q = 5 + -2. Put q, 1/3, y in ascending order. y, 1/3, q Let i = -7.03 - -0.03. Let x = i + 7.1. Sort x, 3/8, -2 in increasing order. -2, x, 3/8 Let o = 18/25 - 16/25. Put 1, 4, o, -0.5 in decreasing order. 4, 1, o, -0.5 Let x(j) = -j*2 - 4j + 8. Let z be x(-6). Suppose -r = 1 + 1. Put -3, r, z in descending order. r, -3, z Suppose 2z - 6z + 8 = 0. Sort 1, z, 3. 1, z, 3 Let w = -2.949 - 0.051. Sort -0.2, -1.6, w in descending order. -0.2, -1.6, w Let h = -1 - 13. Let q = -14.4 - h. Suppose 2j + 3j - 20 = 0. Put j, 0.5, q in ascending order. q, 0.5, j Let b(m) = -m - 4. Let u be b(-6). Let r = u + -2. Sort -3, r, 1 in descending order. 1, r, -3 Suppose -27 + 7 = -4h. Let l = 5 - h. Let m = -2 + 1. Sort -4, l, m in ascending order. -4, m, l Let o = -82 - -71. Put o, 4, -3, -4 in ascending order. o, -4, -3, 4 Suppose 7u + 20 = 3u. Let o(j) = -j2 - 4j + 1. Let l be o(-3). Sort u, 1, l in decreasing order. l, 1, u Let p be 1 - 0 - (-3 - -4). Suppose pr - 4 = r. Sort r, 1, -3. r, -3, 1 Suppose 0 = -4c - w - 4w, -6 = 2c + 4w. Let a be (2/4 + 0)0. Sort c, -3, a in descending order. c, a, -3 Let y = 4.8 + -1.6. Let d = -2.8 + 3. Let p = d - y. Sort -0.5, -1/3, p in descending order. -1/3, -0.5, p Suppose 7v - 3v = 4. Let y be ((-1)/(-2))/(v/8). Let s be (-18)/63 - y/35. Sort -4, -1, s in ascending order. -4, -1, s Let o be 1 - (2 - 4) - 4. Let n = 0 - o. Let s = -6 + n. Put -1, s, 5 in ascending order. s, -1, 5 Let z = 2 - 3. Let a be (12/(-8))/(z/(-2)). Let b = -12 + 10. Put b, a, 1 in increasing order. a, b, 1 Let j = -52 - -48. Let t = -2 - -3. Put -6, j, t in increasing order. -6, j, t Let t = -0.05 + -0.03. Let v = t - 2.92. Let y = -2 - v. Put 0, 4/3, y in increasing order. 0, y, 4/3 Let a = 8 - 8.3. Let d = 4962/17 - 292. Sort d, a, 4 in decreasing order. 4, d, a Let b = -109 + 117.1. Let a = b - 8. Sort a, 0.5, 4/7 in ascending order. a, 0.5, 4/7 Let y = -22 + 27. Let l = -9 + 5. Sort -5, l, y in descending order. y, l, -5 Let h = 26 + -25. Sort 5, 3, h. h, 3, 5 Let u be -1(1 - 0) - (-34)/26. Put -0.3, -0.5, u, -1 in decreasing order. u, -0.3, -0.5, -1 Let l = 0.705 + -0.075. Let y = l + -0.13. Sort -0.1, y, 0.1 in descending order. y, 0.1, -0.1 Let x = 84 - 926/11. Let b(o) = 2o*3 + 16o*2 + 14o + 3. Let i be b(-7). Sort x, 6, i in increasing order. x, i, 6 Let t(u) = u*2 - 4u - 8. Let b be t(6). Suppose -k = -4g + 8, 0k - 2k + 2g = b. Put -1, k, 5 in increasing order. -1, k, 5 Let y be 32(-2)/12. Let z be -8 - (y - -4)-1. Put 1, z, 2 in increasing order. z, 1, 2 Let f be -5 - 8(-1)/2. Sort f, 0, -17, 3 in ascending order. -17, f, 0, 3 Let j be 6/(-9) - (-16)/(-12). Let f = 7 + j. Sort 2, f, 1 in descending order. f, 2, 1 Let f = -27 + 26. Put -2, -3, f in decreasing order. f, -2, -3 Let u(f) be the third derivative of 3f2 + 0f - 1/60f5 - 1/3f*4 + 0 - 7/6f*3. Let d be u(-7). Put 4, d, 2 in decreasing order. 4, 2, d Suppose -16 = -10p + 8p. Suppose -3b + 1 = -p. Sort 5, b, 4 in decreasing order. 5, 4, b Let s = 2.6 - -1.4. Put s, -5, 3/2, -7 in increasing order. -7, -5, 3/2, s Suppose x = 0, 60 + 40 = 5y + 4x. Put y, -5, 2/9 in ascending order. -5, 2/9, y Let j(y) = y*2 + 13y + 5. Let r be j(-13). Sort -12, r, 1, 3 in descending order. r, 3, 1, -12 Let h(a) = a*2 - 15a + 15. Suppose -y = 3w - 40, 2w - y = -3y + 24. Let v be h(w). Sort 4, -3, v in ascending order. -3, v, 4 Suppose 3 = -5d + 18. Sort d, 5, -1. -1, d, 5 Let q(u) = u*3 - 2. Let s be q(0). Let x = 51 - 55. Sort x, s, -3 in decreasing order. s, -3, x Let p(g) = 3g - 13. Let d be p(6). Put -4, d, 3, -42 in decreasing order. d, 3, -4, -42 Let h be 0 + 0 + (1 - (-1 - -2)). Let w = -6 + 17. Sort -3, w, h in descending order. w, h, -3 Suppose 23 = 4f - s, 3f + 5s - 13 - 10 = 0. Let q(j) be the first derivative of -j2/2 + 8j + 11. Let h be q(f). Put 5, -4, h in decreasing order. 5, h, -4 Let c = -0.24 - -1.24. Let m = -0.7 + 0.2. Sort -4/5, m, c in descending order. c, m, -4/5 Let r = -40 + 39. Sort -1/4, r, 2 in ascending order. r, -1/4, 2 Suppose -3n = -177 + 21. Suppose n = 5k - d, d - 18 = -k + 5d. Suppose 4l - k = -l. Put 3, l, 0 in increasing order. 0, l, 3 Let q = 2.1 + -5.1. Sort -4, -0.4, q in increasing order. -4, q, -0.4 Let a be (-46)/4 + -1 - (-11)/22. Let t = 0.04 + -0.24. Put a, -2, t in decreasing order. t, -2, a Suppose o - 5t = 2 + 4, -5o - 30 = 5t. Sort -3, -5, o, -10. -10, -5, o, -3 Suppose -3i - 4 = -4s, -4i + 11 = -s - 1. Let j(b) = 10b - 20. Let p be j(2). Sort p, -4, i in decreasing order. i, p, -4 Let c = -6 + 11. Let d = -1 - 5. Let j = d + 3. Sort c, j, -0.3 in descending order. c, -0.3, j Let s = -1557/7 - -223. Put s, -1/4, -0.3, -1/5 in ascending order. -0.3, -1/4, -1/5, s Let d(m) = m2 + 5m - 1. Let x(r) = r*3 + 3r*2 - 2r + 3. Let a be x(-4). Let l be d(a). Sort -2, 5, l in descending order. 5, l, -2 Suppose 61f = 63f - 2. Suppose -2h - 3 = -1. Sort f, h, 4. h, f, 4 Let l = 54 - 53.5. Sort l, -7, -0.3 in increasing order. -7, -0.3, l Let h(s) = s3 - 7s*2 + 6s - 2. Let c be h(6). Let q(g) = g*2 - 12g + 3. Let m be q(12). Put c, m, 0 in ascending order. c, 0, m Let a = -0.37 - -2.27. Let s = 1.9 - a. Sort 2/11, -4, s in ascending order. -4, s, 2/11 Let r = 1162130 - 87151369/75. Let q = r - 335/3. Sort 4, -1/6, q in increasing order. -1/6, q, 4 Let b = 28 - 25. Let i = 0.2 + -0.3. Sort 1/2, i, b. i, 1/2, b Let n = -8 + 7. Let o be (n - 0)/(-9 - -5). Let l = -718/885 - -2/177. Sort l, o, 2 in increasing order. l, o, 2 Let x = -2398/7 - -342. Sort 4, -0.4, x in decreasing order. 4, -0.4, x Let b be (-4)/3126/(-28). Sort 5, b, 1/4 in descending order. b, 5, 1/4 Suppose 12 = 4q + 2m - 24, m = 2. Suppose 6 = 3k - 3. Suppose -kj = q + 1. Put -4, -2, j in decreasing order. -2, j, -4 Let t = -53 - -58. Sort -3, t, -30/13. -3, -30/13, t Let b = -41/74 + 2/37. Sort -5, b, 0. -5, b, 0 Let v be -1 - (-21)/(-2 - -1). Let a = -16 - v. Suppose aw - w = 10. Put 5, w, 4 in decreasing order. 5, 4, w Let p = -9 + 12. Let g = 7 - 5. Put -2, p, g in ascending order. -2, g, p Let q = 630 + -633.07. Let w = q - -0.07. Sort -0.5, w, 0.3 in ascending order. w, -0.5, 0.3 Suppose -3q = -15, -5 = c + 4c + q. Suppose 5u - 6 = -2i, 0 = -u + 3i + i - 12. Put 9, c, u in descending order. 9, u, c Let i(l) = -l3 - 8l*2 + l + 8. Let h be i(-8). Suppose 5a - 8a + 42 = h. Sort 5, -3, a in descending order. a, 5, -3 Suppose 0c + n = 2c - 3, -4n + 12 = 0. Let s = 5 - c. Sort 4, -3, s in increasing order. -3, s, 4 Let n = -71 + 211/3. Sort 5, 0, 1/7, n. n, 0, 1/7, 5 Let g be 24/(-35) - 4/(-10). Let c = 7.56 + 1.04. Let q = 9 - c. Put g, -1/2, q in increasing order. -1/2, g, q Let m = 0.12 - 6.12. Let x = m - -6.2. Let d = -3.2 + x. Put d, -2, -0.5 in increasing order. d, -2, -0.5 Let g be (2 + -1)0/4. Suppose -2m - 6 = -gm. Suppose -12 = -4o - 0o. Sort m, o, 0 in descending order. o, 0, m Suppose 6 = 3c, n - 2n = 5c - 5. Put 2, -0.5, 4, n in decreasing order. 4, 2, -0.5, n Let f = 0.1 - -8.9. Let u = f + -14. Put 2/5, -4, u in decreasing order. 2/5, -4, u Suppose -4o = -5g - 25, -5g + 2o = -o + 25. Put 5, 2, g, 0 in descending order. 5, 2, 0, g Let h = -40 - -50. Put h, 4, 0 in ascending order. 0, 4, h Let u = -6 + 10. Let k(f) = f*3 - 5f*2 + 4f - 1. Let a be k(u). Sort a, -4, 4. -4, a, 4 Let t = -6/5 + 7/10. Sort 0.5, -7, t in increasing order. -7, t, 0.5 Let o(q) = q. Let t be o(2). Suppose -5z = -2z + 9. Sort z, t, 3. z, t, 3 Let t be -22(-3)/12. Let g = 0 + t. Suppose 11 = -2k - 0k + 5q, 2k + q - 7 = 0. Put k, g, -1 in increasing order. -1, g, k Let l = -0.2 + 0.1. Let p = -0.1 - l. Let j = p + 2. Sort 5, -0.2, j in increasing order. -0.2, j, 5 Suppose 0m = m + 5, -5y = -m + 10. Sort 6, y, 0. y, 0, 6 Let l = 24 + -21. Put 2, -4, l in decreasing order. l, 2, -4 Let f = -0.05 + -0.03. Let o = 0.22 - f. Let x = -3 - -2. Sort -0.2, x, o. x, -0.2, o Let b be 5/(-18) - 1/(-2). Let m be -22 - -24 - (0 - 12/(-5)). Put m, b, -4 in increasing order. -4, m, b Let f = -8 - -3. Let d(q) = q*2 - 4q - 1. Let c be d(5). Suppose n + 12 - 4 = -cw, -2w = 3*n + 14. Put -4, f, w in increasing order. f, -4, w L	{ "pile_set_name": "DM Mathematics" }
338 - 2/13? 5 Calculate (-154 + 155)/((-2)/8). -4 What is the value of 0 - (-1)/(-9)-2? 2/9 Evaluate 5/(-45)-34 + -4. -2/9 What is 2 - (62/10 + -4)? -1/5 Calculate (2/1)/(7/(-14)). -4 Evaluate ((-4)/(-5))/((-56)/(-35) - 2). -2 Evaluate -5-2(-5)/(-225). 2/9 Calculate 75/10(5/(-3) - -1). -5 (-10 - -4)(-2)/(-4) -3 2/10 - (-1)/(-15)3 0 Calculate (-2)/18 - 728/252. -3 Evaluate ((-133)/539 - 2/11)1. -3/7 4/(-76) + 42/(-285) -1/5 Evaluate 7 - 8 - 7/(-9). -2/9 Evaluate (6/7)/(-4 + (-145)/(-35)). 6 What is (-650)/(-500) - (-1)/(-2)? 4/5 Evaluate 114/(-108)3 + (-10)/(-60). -3 Evaluate (-3)/64-2. 4 (-6)/3 + (-1)/(2/(-12)) 4 Evaluate ((-24)/44 + 0)/((-60)/20). 2/11 Calculate 24/(-378) + (-10)/45 + 0. -2/7 Evaluate -18(-1)/(-2 - -5). 6 (-297)/(-63) + 2/7 5 What is the value of 0 + ((-69)/161)/((-2)/14)? 3 ((-14)/385)/((-1)/(-5)) -2/11 What is (-5)/((-1)/((-1)/1)-1)? 5 Evaluate ((-20)/30)/(-1 + -2). 2/9 Calculate ((-21)/84)/1 - (-42)/8. 5 Evaluate (-18)/(-144)(0 + -12). -1/4 Evaluate (-1)/((6/(-4))/3). 2 Calculate -1 + (-12)/(-8) - 18/20. -2/5 (-3)/5 - (-28)/5 5 What is (-460)/65 + (-13)/(-2197)13? -7 Calculate ((-14)/(-4) + -4)2. -1 Calculate 15 + -13 - (1 - -4). -3 What is the value of 3/(-9) + (1 - (-40)/(-105))? 2/7 What is 315/(-36) + 5 + 3? -3/4 Evaluate 416/(-1240) - 10/155. -2/5 What is 16/(-78)42/56? -2/13 What is the value of (-16)/(-12)(-15)/5? -4 3 + (-36)/(-9) + -2 5 Calculate (-6)/(-8)(-1020)/459. -5/3 What is the value of (0 + (-12)/(-8))2? 3 Calculate -12 + 19/(228/27). 1/4 Calculate 16/(-46)(12/16)/(-3). 2/23 What is 245(-10)/(-300) - (-5)/6? 9 425/(-1309) + (-4)/(-22) -1/7 What is the value of ((-4)/(-10))/(-38/(-30))? 1/2 Calculate (-38)/(-40) - 240/200. -1/4 Calculate 3/(-6)((-48)/(-39))/(-4). 2/13 ((6/4)/1)/(252/(-1344)) -8 (-3)/(-4) - (-304)/(-320) -1/5 What is the value of (-49)/63 + 8/72? -2/3 Calculate 2/5 - 1598/1645. -4/7 Calculate 120/(-55) + (-10)/(-55). -2 Calculate 1/(-1 - (5/(-2) + 1)). 2 Calculate (0 - 0)/((-34 + 8)/(-13)). 0 What is -6 + 1/(3 - 2/1)? -5 What is the value of 10(-12)/(-45)(-3)/(-14)? 4/7 What is the value of (3/(-12)2)/(7 - 3)? -1/8 Calculate 0 + (-56)/(-10) - (30 - 24). -2/5 (24/10)/((-748)/(-55) + -14) -6 What is the value of (56/16 + -4)-16? 8 (-12)/((-72)/54) 3/2 What is (-4)/(-3) + ((-56)/24 - -2)? 1 ((3/(-2))/3)/((-24)/(-32)) -2/3 (2 - 1) + 3/(-1)-1 4 What is the value of 4 - (-2 - 545/(-40))? -3/4 Evaluate (3/(27/(-6)))/((-4)/6). 1 What is (-203)/174 + 2/3? -1/2 Evaluate 32/(-10) - 172/215. -4 Calculate (45/(-48))/(36/48). -5/4 What is the value of (-1)/((-26)/182(-14)/22)? -11 What is the value of (-6)/(-27) + -1291/(-27)? 5 What is the value of (-2 - -7)/(130/104)? 4 What is the value of (1647/244)/((-9)/(-12))? 9 Calculate (-7)/(5 - -2) + 9/11. -2/11 Calculate (-55)/(-360) + (1 - 21/27). 3/8 What is (-78)/(-351) + (-2)/9 + -1? -1 What is (12/9)/(15 - 1233/81)? -6 What is -8 - (4 + (-136)/12)? -2/3 (-38)/(-8) + (3/12 - 0) 5 ((-385)/28 - -13)/(2/12) -9/2 What is the value of ((5 + -6)3)/((-81)/(-6))? -2/9 Calculate ((-2)/(-8))/(63/72). 2/7 What is 1/3 + (-40)/(-60)? 1 What is the value of 4/18 - 1888/3717? -2/7 Evaluate ((-2)/(-5) + -1)/((-17)/(-85)). -3 0 - (-48)/(-20 + 12) -6 Calculate (-8)/(-9) - (-18)/(-81). 2/3 Calculate (-7 + 4)/(-18 - 3). 1/7 What is (-10)/4(-108)/135? 2 Calculate -1 + -5 - (-8 - -4). -2 What is (-13)/5 + (-42)/105? -3 What is the value of (4/(-66)-6)/(-9 - -7)? -2/11 Calculate 105/27 + (-14)/(-126). 4 7/14-43 -6 Evaluate (-12)/(-10)(-4 + 13/3). 2/5 Calculate (-11)/9 + 1/(-1)-1. -2/9 What is the value of (-4)/118/(-12)-1? -6 Evaluate (7(-4)/(-56))/(1/(-10)). -5 What is (-1135)/125 + 4/50? -9 What is (-7)/9 - 10/(-90)? -2/3 (-126)/(9/3)(-59)/354 7 What is (3 - 76/66) + 38/(-209)? 5/3 (-3)/((-9)/(-10))60/40 -5 Evaluate (8 - 9) + 48/6 + 1. 8 Evaluate (-8)/((-18)/(-9)) + (-1)/(-1). -3 448/(-128) + 21 -3/2 What is 2/((-175)/704/15)? -3 What is the value of ((-6)/(-4))/(12/(-2))4? -1 Calculate (-12)/((-14)/66). 6/7 Evaluate (-450)/462 + -4 + 155/35. -6/11 15((-14)/(-6) - 2) 5 Evaluate 111/(-74) + 22/4. 4 Evaluate (((-18)/(-20))/9-2)/1. -1/5 What is -3 - (14/2 - 0)/(-4)? -5/4 Calculate (-5)/6 - (-4)/(-24). -1 Calculate 11 + (-1 - (-1 - -6)) + -3. 2 Evaluate 1/(10/18)370/111. 6 What is 2/(8/(-6)) - (-36)/(-24)? -3 What is -4 - (-18)/(-16)-4? 1/2 Evaluate 0 - ((-2)/(-6))/(3/72). -8 Calculate (9/(-102))/(3/(-4)). 2/17 What is 5/(-2) - 7/(-14)? -2 What is the value of (1/(-1) + 2)(-120)/(-90)? 4/3 What is the value of (7 + 3)6(-7)/84? -5 (-2)/3(2 + 10) -8 Evaluate -3(1 - (-2)/3). -5 Calculate 8 - 1 - (10 - -3 - 8). 2 Evaluate (2/16 - 0)/((-5)/10). -1/4 What is ((-2)/20)/(7/28)? -2/5 Evaluate (-60)/15051. -2 Calculate (6/(-8)24/9)/8. -1/4 Evaluate 4/(-7)245/70. -2 (1/4)/((-260)/(-64) + -4) 4 Evaluate 221/6 - (17 - 12). -4/3 Calculate (-2)/21 - (-558)/1890. 1/5 What is the value of 4/(-2 - (-7 - -6))? -4 What is the value of 4 - (245/42 + -4)2? 1/3 Evaluate 4/(-14) - (-13)/(1456/368). 3 Calculate 104/26 + (-4)/3 - 1. 5/3 What is the value of 10 + -2 - 2 - 2? 4 What is (6/4)/(6/10)? 5/2 What is the value of 0 + -5 + (-8)/(-2)? -1 Calculate (-261)/(-174) + 11/(-2). -4 What is the value of (-12)/(-5) + -2 + (-3 - -3)? 2/5 What is (3/(-2))/(27/126)? -7 (-17)/170(-45)/6 3/4 Evaluate ((-100)/(-180))/((-2)/(-18)). 5 678/36 + -7 6 What is the value of 88/(-20) - -4 - (-37)/5? 7 Calculate 14 - (0 + 48)/6. 6 What is the value of 1(-6)/(30/(-1))? 1/5 11/(-15) + (-48)/(-36) 3/5 Evaluate 26/39(-3)/(-8). 1/4 Calculate ((-5)/(-20))/(0 + (-1)/(-20)). 5 Evaluate 5/30 - (-21)/(-18). -1 (2/(-6))/((-5)/15) 1 What is (-30)/(-8) - -4(-6)/(-96)? 4 What is 4(-91)/(-56) - 7? -1/2 ((-10)/(-6) - (-17)/(-102))/2 3/4 Calculate -3((-4)/(-2) + -1). -3 Evaluate (-8)/(-20)(9/6)/3. 1/5 What is (-87)/(-24) + -3 + -3 + 2? -3/8 What is 4/1223? 2 What is the value of ((27/(-12))/3)/((-2)/(-8))? -3 Evaluate 6/(-21) + (-4)/(-7). 2/7 Evaluate 1-2(-27)/(-18)-1. 3 2 - ((-15)/(-2))/((-7)/(-2)) -1/7 Calculate 10/6 + 46/(-12). -1/3 What is ((-1)/(-9 - (-8 - -2)))/1? 1/3 What is (-1 - -1)/(-6 - -2)? 0 Calculate 7 - ((-8)/2 - -7) - 3. 1 What is the value of 36/(-9) + (-156)/(-40)? -1/10 Evaluate ((-10)/(-6) - 1)/((-162)/(-1944)). 8 What is ((-15)/(-25))/((-8)/30-6)? 3/8 What is the value of ((-1)/(-4))/(26/(-104))? -1 What is the value of 6/5(-15)/(-24)? 3/4 (2/10)/(21/(-105))-7 7 (-15)/(-10)(2 + (-14)/3) -4 What is the value of ((-1834)/(-393))/(4/(-6))? -7 Calculate (4/(-5))/((-28)/(-20) - 1). -2 Calculate 64/10 - (-112)/(-280). 6 Calculate (14 + 0 - 11)/(-1). -3 Calculate (-6 - -3)/(-6)(-2)/(-7). 1/7 What is (-51)/(-15) + (-33)/(-55)? 4 Calculate (-150)/462 - 3/((-42)/2). -2/11 Calculate (-2119)/169 + 15 - 2. 6/13 What is the value of ((8346/90)/(-13))/1 + 7? -2/15 What is the value of 2/5 - 6/40? 1/4 0 + 4 + (0 - -1) 5 Calculate (-20)/(-6)(-186)/(-124). 5 Evaluate 5/(4 + (3 - 10) + 4). 5 Evaluate 36/60 - (-46)/(-110). 2/11 What is (-7)/(-15) - 32/48? -1/5 Calculate (-14)/(-12) - ((-230)/(-60))/23. 1 Calculate -1 + 8 + (-25)/4. 3/4 What is -33/54 - 38/(-12)? 3 Evaluate 1(-4)/(2 - 4). 2 Evaluate ((-16 - -7)/(-3))/3. 1 (-6)/(-14) + (-4)/(-7) 1 2/(-28) - 6138/(-8316) 2/3 1-459/(-59) 4 What is (1 + -9 - 2) + 5/1? -5 Evaluate -2 + (-44)/(-28) + (-115)/140. -5/4 (-51)/34(1 - 2/6) -1 Evaluate -11 - 4/(44/(-55)). -6 Calculate (95/15 - 6)-2. -2/3 (2 - 1)/(-133/6) -2/11 Evaluate 8/(-28) + 66/35 - 2. -2/5 Evaluate 3((-24)/2 - -13). 3 2 + 12/22(-90)/27 2/11 What is ((-10)/20)/(-2 - 6/(-4))? 1 (-30 - -27) + 12 + -4 -5 Calculate (7/(-28))/(1/(-4)). 1 Calculate (-2)/(-11)((-3263)/(-156) + -20). 1/6 Evaluate (-1)/10((-14)/(-7) - -2). -2/5 What is the value of (0 - -4)(-1)/4? -1 Calculate 3/8 + (738/(-48) - -9). -6 What is the value of (8/(-36)-6)/(-7 - 3)? -2/15 (2/5)/(441/105) 2/21 Calculate (30/20)/((-2)/(-6))2. 9 Evaluate (-60)/(-33) - 1 - 1. -2/11 Evaluate ((-36)/150)/((-15)/(-100)) - -2. 2/5 Calculate 2/((-28)/10)(-10)/(-25). -2/7 Evaluate ((-15)/(-6))/(11/22). 5 Calculate (-56)/(-10) + (-27)/45 - 1. 4 -14(-11 - -5)/12 7 What is the value of 0 - (3/(-15))/(6/(-10))? -1/3 Calculate 160/(-16) - -3. -3/4 (-6)/(-15)*(-1)/2 -1/5 Calculate (6/(	{ "pile_set_name": "DM Mathematics" }
- 52269, -359o = -362o + 3c + 52275. What is the tens digit of o? 1 Let v(o) = -69o*3 - 5o*2 + 14o + 47. What is the units digit of v(-3)? 3 Let j(n) be the third derivative of -1/120n6 + 30n*2 + 0 + 0n - 13/60n5 + 13/3n*3 + 7/12n*4. What is the tens digit of j(-14)? 2 Let u be -544(-3 + (-1 - -5)). Let r = 666 - u. What is the tens digit of r? 1 Suppose -5v - 4j = -164623, -1307 = v + 2j - 34228. What is the tens digit of 1/2 - v/(-38)? 6 Suppose 1447222 = 76o + 5o - 147911. What is the hundreds digit of o? 6 Let l be 4/((5 + 3 + -4)/6). Suppose -q + lq = 2x + 27, q = 5x + 10. Suppose -5a = 3s - 317, q = 5a - 15. What is the tens digit of s? 9 Suppose 0 = -2q + q + 2. Suppose 0 = -3x + 9i - 7i + 179, -qi - 8 = 0. What is the tens digit of x? 5 Suppose -2u + 8s = -110488, 4u = -185s + 189s + 220988. What is the ten thousands digit of u? 5 Let w(v) = -v2 - 22v - 45. Let t be w(-19). Let n be 8/t(1 - (-1892)/(-8)). Let x = -20 - n. What is the tens digit of x? 3 Let a(s) = 7s*3 - 3s*2 + 33s - 23. Let k(p) = -23p3 + 8p*2 - 100p + 68. Let d(q) = 7a(q) + 2k(q). What is the tens digit of d(6)? 2 What is the tens digit of (-192)/528 - 34042/(-22)? 4 Let q(x) be the third derivative of -x*7/1008 + 7x6/48 + x5/4 + 10x2. Let v(s) be the third derivative of q(s). What is the units digit of v(0)? 5 Let r be (-25 + 26)/((-1)/(-67)). Suppose 10p - r = 303. Let w = p + 131. What is the units digit of w? 8 Let g = -5982 + 25815. What is the thousands digit of g? 9 Let i be (-3 + 14/4)-6 + 74. Suppose 64k + 2625 = ik. What is the tens digit of k? 7 Suppose 2t - 3g - 112080 = -t, -g = -3t + 112080. What is the units digit of t? 0 Suppose -68q + 2113346 = 61q - 46q. What is the thousands digit of q? 5 Suppose -2b - 237 = -5b. Let i(w) = -635w - 1165. Let h be i(-2). Let s = h - b. What is the units digit of s? 6 Let r = -63 + 66. Suppose -rx + 5 + 7 = 0. Suppose 4u - x = 0, 575 = 5c - u - 459. What is the hundreds digit of c? 2 Let g = -12 + 31. Suppose gi - 24i = 0. Suppose i = k + 4r - 103, -84 = -2k - 3r + 112. What is the tens digit of k? 9 Suppose 10g = 15g - 160. Let x(o) = o*2 - 25o + 97. What is the tens digit of x(g)? 2 Suppose 4w = -5q + 46775 + 123780, 4w = 20. What is the thousands digit of q? 4 Let d(s) = -23s - 5s - 14 + 18s - 2s3. What is the hundreds digit of d(-5)? 2 Let c(n) = -2n + 41. Let m be c(19). Suppose -j + m = -0x - x, -2x - 3j = -9. Suppose 4i - 8i + 248 = x. What is the tens digit of i? 6 Let x(w) = -2w3 + w2 - 6w - 6. Let t be x(-1). What is the hundreds digit of 3/(-2)(3 + (-653)/t)? 3 Suppose 0 = -z - i + 8, -6z + 2z = 2i - 26. Let h be (8/10)/(2/z). What is the units digit of (h + -2 - (-8 + 7)) + 37? 8 Suppose 59l + 15016 = 61l + 2s, 5l + 3s - 37526 = 0. What is the tens digit of l? 0 Suppose 5k - 84 - 21 = 0. Suppose 0 = -kx + 17x + 1796. What is the tens digit of x? 4 Suppose 0 = -a - 37 + 38. Let i be a(2 + 0)/(-2)-293. Suppose -i = 6c - 1841. What is the tens digit of c? 5 Let m = 25 + -10. Suppose 0 = -11x + mx - 4. What is the tens digit of (39 + (-3 - -5))/x? 4 Let v(g) = 13g + 80. Let m be v(-6). Suppose -mb = -5o + 1418, 0b - 282 = -o + 2b. What is the hundreds digit of o? 2 Suppose -9j + 113568 = 26133. What is the thousands digit of j? 9 Let h = 9504 + -3561. What is the tens digit of h? 4 Let u be (5 - 1460)6/18. Let c = -386 - u. What is the tens digit of c? 9 Suppose v - 14 + 12 = 0. Let d be v(4 + (-10)/4). What is the units digit of 37 - 4/d3? 3 What is the tens digit of 1878876/72(70/15)/7? 9 Let u(p) = -23p + 209. Let j be u(9). What is the thousands digit of (-2)/(7 + -3)(-3770 - j)? 1 Let y(w) = 14w + 35. Let o(v) = 0 + 1 - 5v + 5v2 + 3 + v3 - 2v. Let k be o(-6). What is the units digit of y(k)? 5 Let s(o) be the second derivative of -7o3/3 + 15o*2 - 27o. Let u(x) = 14x - 30. Let g(n) = -5s(n) - 4u(n). What is the hundreds digit of g(10)? 1 Let f(y) = 34y - 62. Let t be (-15(-6)/60)/((-3)/(-44)). What is the hundreds digit of f(t)? 6 Let w = -7476 + 8217. What is the units digit of w? 1 Let j = 88 - 86. Suppose 4z = 6 + j. What is the units digit of -4z/4 + 81 - -3? 2 Let c(d) be the first derivative of d4/4 + 2d*3 - 11d*2 - 9d + 15. Let n be c(-7). Let t = 266 - n. What is the units digit of t? 0 Suppose 3y + 268 = -j, -2j - 5y - 792 = j. Let r = j + 503. What is the units digit of r? 4 Suppose 16 = 4z - 2a, -z = -4a + 3 - 0. Suppose -2f + 2532 = 4i + f, -zi + f = -3184. What is the units digit of i? 6 Let b(u) = 4u*2 - 11u - 7. Let a = -349 - -342. What is the units digit of b(a)? 6 Let z be ((-124)/(-155))/(2/25). Suppose -216 = -2s + 4o, 2o + 524 = -5s + zs. What is the units digit of s? 4 Let r = 133 - 65. Let n = r + -63. Suppose -ns = -315 - 600. What is the tens digit of s? 8 What is the hundreds digit of 2 + 209/(-88) - (-163455)/40? 0 Suppose 0 = -580m + 607m - 1138455. What is the units digit of m? 5 Let a(l) = -l*3 - 11l2 - l - 6. Let v(c) = c2 - 12c. Let r be v(11). Let i be a(r). What is the tens digit of 0 + (-15)/i + 67? 6 Let l(r) be the first derivative of -r2/2 + 226r - 225. What is the units digit of l(0)? 6 Suppose -610 = 600x - 597x - o, -4x = 2o + 800. Let p be ((-2)/(-4))/(1/(-632)). Let l = x - p. What is the units digit of l? 4 Let x(g) = g*2 + 9g + 11. Let m be x(-7). Let y be (m - 2/(-1))/(-1). Suppose 2p + p - 15 = -3j, 3j = 4p + y. What is the units digit of p? 2 Let v be 9/18(-2)/22. What is the tens digit of 86(-2)/(-4)(0 - v)? 4 Let f = 4 + -2. Let u(g) = g*2 + 6. Let h be u(4). Suppose 2y = -4s + h, -3y - 2 = s - fs. What is the units digit of s? 5 Suppose -189i + 840126 + 651990 - 556188 = 0. What is the units digit of i? 2 Let b be (-3)/((-45)/42) - (-2)/10. Suppose -bg - 2g = -1920. Let v = g + -272. What is the tens digit of v? 1 What is the tens digit of (-2 + 839)/((-24)/((-11592)/23))? 7 Let d be 2(3 - 2) - (0 - 45). Suppose -3t + d + 502 = 0. Suppose -3w = -3b + 180 + t, 119 = b - 3w. What is the hundreds digit of b? 1 Suppose -3h - 1042 = -4s - 3226, -4h + s + 2938 = 0. What is the units digit of h? 6 Let a be -1661(-3 + 4 + -5). Suppose -22244 + a = -8b. What is the units digit of b/14 + (-4)/14? 9 Let r(l) = -6l - 22. Let y be r(-5). Let z(m) = 2m*3 - 8m*2 - 10m + 3. Let h be z(y). Suppose -56b + 53b = -h. What is the tens digit of b? 4 Let v be -3 + (2 + 2 - 1). Suppose -7d + 3d = v. Suppose d = 7j - 626 - 1012. What is the hundreds digit of j? 2 Let f(j) = 2j*2 + 8j + 4. Let p be f(-3). Let b(w) = 2w2 + 11w + 21. Let t be b(p). Suppose tv = 8v - 290. What is the hundreds digit of v? 2 Let r(i) = i*3 - 40i*2 + 100i + 287. What is the hundreds digit of r(40)? 2 Suppose -4z = -3p + 27, -2z - 15 = -4p + p. Let t(n) = n*3 + 2n*2 - 8n - 6. Let x be t(z). Let h = -38 - x. What is the units digit of h? 4 Suppose -6z + 1051 + 251 = 0. What is the hundreds digit of z? 2 Let m = 11 + -12. Let y be (-14)/(0 + m/20). Suppose 2l = -3l + 3o + y, 0 = 2o. What is the units digit of l? 6 Suppose -2p + 5p = 5b + 385, b + p + 77 = 0. Let q = b + 224. What is the tens digit of q? 4 Suppose -3b + 973 = 4f, 5f + 4b = 3b + 1219. Let q = f + 158. What is the hundreds digit of q? 4 Suppose 4q = -5a + 293597, -2q + a + 106149 = -40660. What is the tens digit of q? 0 Suppose 2 = -h + r + 10, -10 = -2h + 4r. Let j = 86 + h. What is the units digit of j? 7 Let q be 13 + (-6)/6. Suppose qo = 10o - 16. What is the tens digit of (-2886)/(-143) + o/(-11)? 2 Let p(z) be the third derivative of 5z5/4 + z4/12 + z*3/6 + 12z*2 - 2. What is the units digit of p(-1)? 4 Let f(m) = 2m*3 - 6m*2 - 2m + 13. Let v(x) = 3x2 + 27x + 3. Let a be v(-9). Let o be a/44(-4)/(-3). What is the units digit of f(o)? 7 Let u = -2728 + 3983. Suppose k = 2y - u, 7k - 2515 = -4y + 10k. What is the units digit of y? 5 Suppose 567r - 59360 = 560r. What is the tens digit of r? 8 Suppose 0 = -22r + 25469 + 158341. What is the thousands digit of r? 8 Suppose 5m - 4m = -4t, 3m - 2t - 14 = 0. Let r be 30/18*(m +	{ "pile_set_name": "DM Mathematics" }
2 + 0c*5 wrt c. -240c*2 Let d(f) be the second derivative of 2f*5/5 + 3f*2/2 - 16f. Find the first derivative of d(v) wrt v. 24v2 Let n be (-4)/(3/(-2) - -1). Differentiate -w3 + nw3 - w3 + 1 wrt w. 18w2 Let y(m) be the first derivative of m7/140 + 3m*5/40 + 2m*3 - 4. Let a(l) be the third derivative of y(l). Find the second derivative of a(x) wrt x. 36x Let n(k) be the second derivative of -k*5/10 + 2k*3 + 14k. What is the second derivative of n(p) wrt p? -12p Let r(g) be the third derivative of g6/120 + 11g*3/3 - 10g*2. What is the first derivative of r(v) wrt v? 3v*2 Find the second derivative of 14f*4 - 4f*4 - 3f*2 + 20f - 14f4 wrt f. -48f2 - 6 Let a(g) be the third derivative of g7/42 + g*5/20 + 4g*2. Find the third derivative of a(u) wrt u. 120u Find the second derivative of -3y5 + 6y*5 + 6y - 4y5 + 2y*5 wrt y. 20y*3 Let k(x) be the first derivative of -3x5/10 + x3/2 - 3x - 3. Let i(w) be the first derivative of k(w). What is the second derivative of i(g) wrt g? -36g Let h(f) be the first derivative of -3f3 - 9f*2/2 - 8. Find the second derivative of h(u) wrt u. -18 Find the third derivative of 2z*3 + 2z*4 - 5z*2 + 5z*3 - 7z*3 wrt z. 48z Let t = 80/3 + -26. Let q(p) be the first derivative of 1 + tp3 + 0p - 2p2. Find the second derivative of q(j) wrt j. 4 Let w(z) be the second derivative of -1/2z*2 + 0z*3 - 5z - 1/6z6 + 0z*4 + 0 + 0z*5. Differentiate w(f) with respect to f. -20f*3 Let c be 12/(-8)(-16)/3. Find the second derivative of -r + 0r - cr*2 - 2r wrt r. -16 Find the first derivative of 0s3 - 20s*3 + 2s*3 + 12 wrt s. -54s2 Let t(d) be the third derivative of d7/840 - d*4/8 - 2d*3/3 - 3d*2. Let u(c) be the first derivative of t(c). What is the first derivative of u(z) wrt z? 3z2 Let j(x) be the first derivative of -x3 + 3x - 2x - 4x - 2 + 2x. What is the first derivative of j(p) wrt p? -6p Let j(i) be the second derivative of -9i*5/20 + 2i*3 + 2i. What is the second derivative of j(k) wrt k? -54k What is the second derivative of -107k - 17k5 + 62k + 66k wrt k? -340k*3 Let i(m) = 2m*4 - 3m*3 - 3m - 4. Let r(g) = -3g4 + 4g*3 + 4g + 3. Let t(b) = -4i(b) - 3r(b). Differentiate t(f) wrt f. 4f3 Let h(f) be the second derivative of f5/2 + f4/12 - 8f*3 + 59f. What is the second derivative of h(c) wrt c? 60c + 2 Let d(o) be the second derivative of 11o*4/12 + 6o*2 + 2o. Find the first derivative of d(z) wrt z. 22z Let o(m) = -m2 + 3m + 2. Let c be o(3). Find the third derivative of 2k4 + 2k*3 + 2k*2 + 0k*2 - ck*3 wrt k. 48k Let q(w) = 21w4 + 13w*2 - 34w. Let i(y) = -10y4 - 6y*2 + 17y. Let f(a) = -13i(a) - 6q(a). Find the second derivative of f(h) wrt h. 48h2 Suppose 2l - 15 = -3l. What is the third derivative of -ls*2 + 6s*6 + 0s*6 - 3s*6 wrt s? 360s*3 Let t(s) = -5s*3 - 5s - 4. Let y(d) = -2d3 - 3d - 2. Let v(i) = 3t(i) - 5y(i). Differentiate v(x) wrt x. -15x2 Let z(f) be the first derivative of -7f*4/4 + 17f*2/2 - 11. What is the second derivative of z(s) wrt s? -42s Let r(t) = -4t2 + 3 - 2 + 0 - 3t + t. Let w(y) = 8y2 + 5y - 1. Let o(u) = 5r(u) + 2w(u). What is the derivative of o(k) wrt k? -8k Differentiate -5 - 6 - 3 - 9b*4 wrt b. -36b*3 Let i(m) be the second derivative of 0m*5 + 2m + 0m4 + 0m*2 - 2/15m*6 + 0 - 1/3m*3. What is the second derivative of i(f) wrt f? -48f*2 Let c(s) = 8s*3 - 6s*2 - 4s - 4. Let n(a) = 16a3 - 11a*2 - 9a - 9. Let v(z) = -9c(z) + 4n(z). What is the third derivative of v(l) wrt l? -48 Find the second derivative of -t*4 + 0t + 12t + 6t wrt t. -12t2 Let y(w) = -37w + 2. Let j(m) = 110m - 6. Let n(g) = -5j(g) - 16y(g). What is the first derivative of n(x) wrt x? 42 Let y be (2 - 10)-1 + -3. Find the first derivative of -yx3 + 5x*3 + 2x*3 - 5x*3 - 4 wrt x. -9x*2 Let p(c) be the first derivative of -3 + 0c*2 + 0c + 0c5 - 1/6c*6 + 5/3c*3 + 0c*4. Find the third derivative of p(k) wrt k. -60k*2 Find the second derivative of s - 33s*4 + 4 + 3273s*2 + 1 - 3273s*2 wrt s. -396s2 Let f(k) be the second derivative of k5/10 - k*2/2 + 5k. Differentiate f(z) wrt z. 6z2 Let p(m) be the third derivative of m7/840 + m4/24 - m3/3 - 2m*2. Let o(t) be the first derivative of p(t). What is the first derivative of o(b) wrt b? 3b*2 What is the third derivative of -17c*2 + 10c*6 - 1758c*3 + 1758c*3 wrt c? 1200c*3 Let p(q) = 30q*4 + 12q*3 + 4q*2 - 12q. Let i(x) = -2x4 + x3 + x2 - x. Let u(n) = -12i(n) + p(n). What is the third derivative of u(z) wrt z? 1296z Suppose 2k = -0 + 8. Let x(o) = -4o3 + o + 4. Let w(h) = h5 - 3h*3 + h + 3. Let z(f) = kw(f) - 3x(f). What is the second derivative of z(d) wrt d? 80d*3 What is the second derivative of 31v + 5v2 - 32v - 4v2 + 2v*2 wrt v? 6 Suppose -x - 3 = 2, -25 = -5s + 5x. Suppose -2t - 3t + 15 = s. Find the second derivative of -3i - t + 3 + 2i4 wrt i. 24i*2 Let n(y) = 3y*2 - 4y + 7. Let z(q) = 6 - 4 + 4q2 + 6 - 5q. Let v(a) = -5n(a) + 4z(a). Differentiate v(k) with respect to k. 2k Let m(i) be the second derivative of i4/8 + i3/2 + 2i*2 - 3i. Let g(h) be the first derivative of m(h). What is the first derivative of g(l) wrt l? 3 Let u(c) be the second derivative of 3/20c5 + 0c*2 + 0c*4 + 8c - 7/6c3 + 0. Find the second derivative of u(j) wrt j. 18j Find the third derivative of 34l2 + 1 - 2 + 23l*5 - 35l*2 + 3 wrt l. 1380l*2 Suppose 4a = 2m + 20, -2a - 3a - 5m = -40. Find the second derivative of -34j2 - aj + 34j2 - 6j*4 wrt j. -72j*2 Suppose -5r + 32 = -243. What is the third derivative of ra + 6a*6 - 55a - 3a2 wrt a? 720a*3 Let n(o) be the first derivative of -43o*6/6 + 4o*3 - 52. What is the third derivative of n(f) wrt f? -2580f*2 Let u(q) be the first derivative of -1/3q*3 + 0q*5 + 2/3q*6 + 0q*4 + 0q + 5 + 0q2. Find the third derivative of u(f) wrt f. 240f*2 Let d(g) = 19g*3 + 14g. Let m(h) = h*3. Let k(c) = d(c) + 6m(c). Find the second derivative of k(y) wrt y. 150y Let z(d) be the first derivative of d9/1512 - d5/40 - d3/3 - 2. Let s(i) be the third derivative of z(i). What is the second derivative of s(q) wrt q? 40q*3 Let u(f) = 165f*2 + 65f - 175. Let b(s) = 15s2 + 6s - 16. Let r(y) = 65b(y) - 6u(y). What is the derivative of r(a) wrt a? -30a Let o(d) be the third derivative of -d6/120 + d5/12 + 5d*4/24 + 4d*3/3 + 2d*2. Let s be o(6). Differentiate 0 - s - 2a*2 + 1 wrt a. -4a Let n = -1 + 4. What is the second derivative of -13v2 - nv + 5v + 15v*2 wrt v? 4 Let r(p) be the second derivative of 0p*2 + 2p - 5/42p7 + 0p*5 + 0 + 0p*3 + 1/12p*4 + 0p*6. Find the third derivative of r(z) wrt z. -300z*2 Let a(o) = 2o - 2. Let l be a(-3). Let y = -5 - l. Differentiate -y + 3 - 2 + k with respect to k. 1 Let t(r) = r3 - r2 - r + 1. Let u(y) = 3y3 - 15y*2 - 2y - 15. Let w(d) = -2t(d) + u(d). Differentiate w(g) with respect to g. 3g*2 - 26g What is the derivative of 2f3 + 30 + 2f*3 - 59 wrt f? 12f*2 Suppose 2u + 2q = 19 - 5, 4q = -3u + 25. What is the first derivative of 3r - ur + 5r - 2 wrt r? 5 Let j be 4 - (6 - 3/1). Find the first derivative of -3 - j + 2d3 + 0d*3 + 2d*3 wrt d. 12d*2 Let x(w) be the first derivative of -1/3w*3 + 1/2w*2 - w + 1. Let n(z) = 7z*2 - 5z + 4. Let a(q) = -n(q) - 5x(q). What is the derivative of a(f) wrt f? -4f What is the second derivative of -2q5 - 4q*5 - 13q - 3q5 wrt q? -180q3 What is the third derivative of y2 + y*4 + 188 - 188 wrt y? 24y Let n(l) = l - 5. Let t be n(9). What is the first derivative of -4 - w*3 + 7wt - 6 + w3 wrt w? 28w3 Suppose g - 4o = 5, -5o - 7 = -2g - 3. Let r be 15/12 + g/12. Differentiate i4 - 1 - r + i4 wrt i. 8i3 Let f(y) be the second derivative of -17y*5/20 + 3y*4/2 - 5y. What is the third derivative of f(z) wrt z? -102 Let d(p) be the second derivative of 0 + 0p4 + 11p - p*2 + 0p**3 - 1/	{ "pile_set_name": "DM Mathematics" }
7h(f) - 6z(f). Let m be u(-12). Is 54/4 + (-1)/m composite? True Suppose i = -4d - i - 30, -5d = -i + 55. Let j = -6 - d. Suppose -g + jq + 453 = 2g, g - 5q - 140 = 0. Is g prime? False Let f be ((-3)/2)/((-12)/16). Suppose -f = j - 2j - 2o, -8 = 3j - o. Is (-26)/4(j - 0) a prime number? True Let d(x) = -x3 + 6x*2 + 2x - 3. Is d(-4) a prime number? True Let p = -225 + 401. Suppose 0q = -2y - q + 180, -p = -2y + q. Is y prime? True Let j(t) = -t + 7. Let c be j(5). Suppose cd = -d - 1104. Let r = 263 - d. Is r a prime number? True Suppose -t + 8 + 7 = 2d, 0 = 4d - 12. Suppose -4f = -7f + t. Is f a prime number? True Let r(t) = t*3 + 16t*2 + 28t - 19. Is r(-12) composite? True Suppose -2h - 17 = -4j + 1, 0 = -3j - h + 1. Suppose 0 = jn + n - 105. Is n composite? True Suppose -4w - 40 = 2n, 0w + 2w - 12 = n. Let f = n + 47. Is f composite? False Let k be (-4)/6 + (-8)/(-12). Suppose kc + c = 47. Is c a prime number? True Let q(r) = r + 3. Let a be q(-5). Let z be (6 - 6)/(2/a). Suppose -4g + 290 - 62 = z. Is g composite? True Let q(v) = 98v2 - 2v + 1. Let w = -3 - -4. Is q(w) prime? True Let m be 1612/(-6)(-2 - 1). Suppose -3s = -s - m. Let g = s - 168. Is g a composite number? True Let g = 518 - 217. Suppose -g = 5x - 936. Is x composite? False Let v(g) = g2 - g - 1. Let k be v(2). Let q be k/((1 - -1)/4). Suppose 0 = -qs - 3 + 105. Is s composite? True Suppose -959 = -k + 2g, 0 = -2k - k - g + 2863. Is k a prime number? False Let b = 812 - 334. Is b composite? True Let c be (-2)/(-2)(1 + 0). Let p be 1(-1)/c-1. Let q(l) = 22l + 1. Is q(p) a prime number? True Is 10149/68 + 2 + 9/(-4) composite? False Let d(q) = -q*2 - 7q + 4. Let o be d(-6). Suppose -z + 2z - o = 0. Is z a prime number? False Suppose 2t + 148 = 6t. Is t composite? False Let c be 2 + -3 - (1 - -2). Let i = c - 16. Let h = 69 - i. Is h composite? False Is (-3748)/(-4) + (3 - 1) a prime number? False Let n(m) = 7m - 42. Let j(u) = -1. Let d(r) = -42j(r) + n(r). Let f be d(-4). Is (10/8)/((-1)/f) prime? False Suppose -3v - 158 = 76. Let c be 2/4(-1 + -1). Is v/c3/6 a prime number? False Let p(f) = 5f2 - 2f*2 + 2 - 6 + 2f*3 - 2f. Let m be p(3). Let y = 124 - m. Is y a prime number? True Let x(l) = -l*2 + 3l - 2. Let g be x(2). Suppose -4o + go = -676. Is o a composite number? True Let y(g) = 5g3 - g2 + g - 1. Suppose -2x + f = -3f - 6, -3x - 3f + 9 = 0. Let c = x - 1. Is y(c) prime? True Let a = -1 + 5. Is (5 - a)/((-3)/(-159)) composite? False Suppose 2i + 29 = -15. Let u = 41 + i. Is u a prime number? True Let w(d) = -2d3 + 5d*2 + 6d + 1. Suppose -2o = -o + 4. Let v be w(o). Suppose 2p + 3p - v = 0. Is p a prime number? True Suppose -m + 117 = -4h, 3m - 269 = -5h + 14. Suppose 0 = 7s - 2s. Suppose 0 = -u + a + 58, 2u + su + a = m. Is u composite? False Let q(u) = -42u2 - 4u - 1. Let r be q(-3). Let y = -166 - r. Is y a prime number? False Let q(j) be the second derivative of 2/3j3 + 0 + 9/2j*2 - j. Is q(7) composite? False Suppose -12 = -3s + 3z + 9, -11 = 2s + 3z. Suppose -sg + g = -19. Is g prime? True Suppose -4h - 46 = -f - 4f, -2h + 10 = 3f. Let o(r) = -r + 3. Let d be o(f). Is (-1 + 1 - -142) + d a prime number? True Let k(c) = 3c2 - 11c - 19. Is k(-13) a composite number? False Let c be (-42)/(-9)-3-1. Let h = 36 - c. Is h composite? True Suppose 2y - 4y - 3r + 1025 = 0, -r = 4y - 2025. Is y prime? False Suppose -3b = -3z - 2b + 19, b = 2. Let u be (-1 + z)/(6/4). Let k(n) = 2n*2 - 4n - 2. Is k(u) composite? True Let k(b) = -b*3 + 11b*2 - 2b + 14. Suppose 5y - x = 9 + 12, -9 = -3y - 3x. Suppose l - 6 = y. Is k(l) prime? False Suppose 5g - 728 = -4b, 2g - g - 712 = -4b. Is b composite? True Let i = 3 + -1. Suppose 417 = 4v + f, -v = if - 79 - 27. Suppose 5n + 3k = v, -3n = -5k + 2 - 44. Is n a composite number? False Let a = 3159 - -40. Is a a composite number? True Let s(q) = -5q*3 - 7q*2 - 4q + 5. Let m be s(-8). Is m/2822 prime? True Let c(v) = -5v3 + 2v + 1. Let j be c(-1). Suppose -y - y = -j. Suppose -d - 2d - 38 = -u, -71 = -yu + d. Is u a prime number? False Let w = -1 + 1. Suppose w = 7v - 2v - 20. Suppose 2n - 6 = -4b + 10, -vn + 5b = -45. Is n composite? True Let r = -300 - -454. Let c = r - 105. Let m = -34 + c. Is m composite? True Suppose 2 = -2b + 4t - 6t, -13 = b + 5t. Suppose -bk + 41 + 31 = 2i, 5k = 4i + 135. Is k a composite number? False Suppose 3k = -5w - 536, 713 = -4k + 3w - 8w. Let z = k - -319. Let h = 216 - z. Is h a prime number? False Let a(w) = 8w*2 - 12w + 7. Is a(6) a prime number? True Let q(w) be the second derivative of 0 + w - 1/6w3 + 1/6w*4 - 1/2w*2. Is q(-2) a composite number? True Suppose -7a = -5f - 2a + 20025, f = 3a + 3997. Is f prime? False Let x(p) = 3p*3 - 2p*2 - 2p + 2. Let d(j) = j*2 + 5j + 2. Let y be d(-5). Is x(y) a composite number? True Let y(k) = k*2 + 2k - 1. Let q = 4 + -6. Let g be 1 + (-1)/(q/(-12)). Is y(g) composite? True Suppose 0 = 4w - b - 4b + 31, -b + 11 = -2w. Let q be (3/6)/((-3)/174). Let k = w - q. Is k a composite number? True Suppose -4i = 0, 3i + 51 = -3g - 24. Let l be 6/10 - 10/g. Let q(t) = 20t - 1. Is q(l) composite? False Let q(n) = -n3 + 11n*2 + 6n - 17. Is q(-11) a composite number? False Let d be (6 + -2)/(6/(-15)). Let r = -5 - d. Suppose 4m - rm + 79 = 0. Is m a prime number? True Let t(x) = -x*3 - 16x*2 - 8x - 31. Is t(-16) a prime number? True Suppose 40 = -x - 50. Let b = -32 - x. Is b a prime number? False Suppose o - 2q = -3q + 809, 3o = 2q + 2427. Is o prime? True Let z(i) = 2i2 - 7i + 1. Suppose -14l + 20 = -12l. Is z(l) a prime number? True Let b(f) = 1 + f*3 - 2f + 1 - f - 2f2. Let h be b(3). Suppose -4r + hz - z + 133 = 0, -5r - 4z + 161 = 0. Is r composite? True Let z(g) = -g3 - g2 + g. Let j(w) = 8w3 + w2 - 8w - 1. Let y(k) = -j(k) - 5z(k). Is y(-2) composite? True Suppose 3n + 16 = -3p + 112, -2p = 3n - 99. Let q = -14 + n. Is q prime? False Suppose -4p = -5c + 37, 4c - 11 = -0p - 3p. Suppose -3y + 120 = -cz - 132, 0 = -4y + 2z + 322. Is y a composite number? False Let f(b) = -3b + 70. Let o(j) = -2j + 35. Let l(m) = 3f(m) - 5o(m). Let n(a) = a3 + 6a*2 - a - 6. Let k be n(-6). Is l(k) a prime number? False Let b(n) = -1401n*3 - 2n*2 - 2n. Is b(-1) composite? True Let f(g) be the second derivative of -g*4/12 + 4g*3/3 - 4g*2 - 2g. Let r be f(6). Suppose o - r = 11. Is o prime? False Let s(f) = 3f3 - 43f*2 + 10f + 33. Let u(y) = -y*3 + 14y*2 - 3y - 11. Let k(n) = 3s(n) + 8u(n). Is k(18) prime? True Let g be ((-7)/21)/(2/12). Let w = 0 - g. Suppose -x + 4h + 70 - 15 = 0, 0 = wx - 5h - 113. Is x prime? True Let q = -4 - -4. Suppose qc + c = 0. Suppose c = f - 94 - 19. Is f a prime number? True Let j be (-4 - -5)(203 + -1). Suppose 39 - j = -o. Is o a composite number? False Let t(m) = -8m*3 - 6m + 6. Let a(k) = -k*3. Let y(s) = 6a(s) - t(s). Let v be y(4). Suppose o = -o + i + 99, -v = -3o + i. Is o prime? True Let k(d) = -3 + 1 - 4d - 16d2 - 5d*2 + 3. Let c be k(3). Is c/12(-6)/4 a prime number? False Suppose 0 = 4m - q - 1232, q = m - 431 + 120. Is m a composite number? False Suppose -5s = -0y - 5y + 5, 0 = -4s + y - 1. Suppose 2k - 3k + 59 = s. Is k a prime number? True Let x be (6/9)/((-1)/(-6)). Suppose -xj + 177 = -331. Is j a composite number? False Suppose -43h - 993 = -44h. Is h composite? True Let f(u) = -u*2 - 29u + 1. Is f(-14) a composite number? False Let k be (15/6)/52. Is k - -5 - 3 - -124 a prime number? True Suppose -2v + 1616 = 2v. Suppose 0 = 3p + p + v. Let o = 170 + p. Is o composite? True Let y be (27/2 - 1)2. Let v(b) = b3 - b2 - 12. Let m be v(0). Let o = m + y. Is o a composite number? False Let l = -464 - -665. Let k(t) = t3 + 10t*2 + 7t + 5. Let q be k(-6). Let r = l - q. Is r a composite number? True Let j(k) = 2 - 5k + 8k - 8. Let c be j(4). Is (-784)/(-6) + 2/c prime? True Let n = 9 - -338. Is n composite? False Let n = 5 - 11. Let l = 5 - n. Is l prime? True Let l(o) = -o3 + o2 + 14. Let m be l(0). Suppose 4	{ "pile_set_name": "DM Mathematics" }
maller: 0.1 or v? v Suppose 30o - 3161 = t + 35o, -2t - 6217 = -5o. Is t less than or equal to -3127? False Suppose 17 = -9g - 28. Suppose 25w = 28w - 81. Which is smaller: w or g? g Let z(c) = 0c*3 - 42 + 10c2 + c3 - 45c2 - 72c - 26. Let u be z(37). Which is smaller: -20 or u? -20 Suppose 0 = 5n + 168 + 187. Let a = 72 + n. Let i be (-23 - -22)(0 - a). Are -8/21 and i non-equal? True Let a be (-8 - 49/(-6))/(5285/225 + -6). Is a > 0? True Let v = 654 + -694. Let s = 251 + -290.7. Let f = v - s. Which is bigger: f or 4? 4 Let g = 0.02 + 0.98. Let j = 166.28 - 1.68. Let h = 167 - j. Which is greater: h or g? h Let w(y) = -25y + 4. Let i be w(-7). Let m = i + -121. Let n(c) = 5c*2 + 38c + 42. Let h be n(-8). Is m greater than or equal to h? True Suppose 34 = -13c + 15c. Suppose 0 = cl - 22l + 20. Is 38/9 > l? True Let b(t) = 280t - 2241. Let l be b(8). Is -3/2926 smaller than l? False Suppose 4o + 1695 = 12275. Let w = -97858/37 + o. Is w bigger than 1? False Let u = -6.6 + 10.33. Let w = -0.863 + -0.067. Let k = u + w. Is k at least as big as 1? True Let r be 163/(-2 - (-407)/33). Which is smaller: 16 or r? r Let g = -7.657 - -6.657. Which is smaller: -17182 or g? -17182 Let w be 1-1(0 - 4). Let m be (8/6 + -2)(-3)/1. Suppose mh + h = g, -wh - 4g = 16. Which is bigger: -20/9 or h? h Let w = -872771/36 + 24239. Is w at most as big as -5? False Let x(a) = -29a2 + 731a - 65. Let w be x(26). Which is smaller: -662 or w? w Let u = 92 - 101. Let f be 9(-8 - -9) + u. Which is bigger: 9/8 or f? 9/8 Let g = -3132 - -3133. Let d = 79087/123 + -643. Let x = d - 101/1353. Which is greater: x or g? g Let u = 11596.71 - 11597. Which is smaller: u or 1/131? u Suppose -168 = -32k + 4k. Suppose -kl = 2l - 600. Is -2/11 not equal to l? True Let z = 63 + -60. Let u(g) = 8g*3 + 4g*2 + 3g - 4. Let l be u(z). Suppose -l = 4y + 39. Is y at least as big as -73? False Suppose -6f - 4p = -4f - 356, -4f + 2p + 742 = 0. Let g = f - 409. Which is bigger: -224 or g? -224 Let c be (3 + (-111)/9)/((-98)/21 - -8). Let w be 12/(-4)1/10. Is w less than c? False Let v(c) = 3c*2 - 22c + 15. Let h be v(7). Let p be (-37)/3(-1 + h). Which is smaller: -85 or p? p Suppose 116t + 6843 + 3133 = 0. Let w = -4 + -82. Are w and t equal? True Let q = -105487/21 + 35160/7. Suppose 4n - 245 + 765 = 0. Let g = -4288/33 - n. Which is smaller: q or g? q Let b be (-1 + 3)/(-6) - (-113607)/(-27). Is -4207 >= b? True Suppose 0 = 8f - 6 + 14. Let p be (-5)/(-30)f(-54)/8. Are 0 and p non-equal? True Suppose -30c - 608592 = 53c + 10c. Which is bigger: -6545 or c? c Let f be (-16 + 0)(816145/(-38))/55. Are 2339 and f non-equal? True Let o = -10061 - -8942. Is -5 at least o? True Let a = 53 + -50. Suppose 5j - 3j - 25 = 5d, -5j + ad + 15 = 0. Suppose 4p = -5w + 24, -p + jw = 3w - 6. Is 9 at most p? False Let c be 64/96 - 860/1284. Let w be (2 + 1 + -4)1. Which is smaller: w or c? w Suppose 0 = -2u + 5x + 14, 0u + 50 = 5u - 5x. Suppose 4r - 24 = -5f, 2r + 3f + 0 - u = 0. Let d = -49 + 56. Is r != d? True Suppose 0 = 11i + 8874 - 8148. Which is greater: i or -67? i Let c(v) = -9v + 1. Let b be c(-18). Let k = -6030/37 + b. Which is bigger: 0 or k? k Let u = 811/14 + -251431/4340. Which is smaller: u or -1? -1 Let u = 3800.4 + -3802. Is u equal to 40/11? False Let a(t) = -39t + 21. Let s(q) = 3q - 1. Let n(g) = a(g) - 4s(g). Let d be n(-3). Which is smaller: 177 or d? 177 Suppose 5m - 102m - 53 = 44. Which is bigger: m or -35/94? -35/94 Let x be (402 + -462)/(-2 + 2/3). Which is smaller: -97 or x? -97 Suppose -4084 = 4b - 2436. Let t be (-4)/31-3208 + -2. Let o = t + b. Do 1 and o have the same value? False Let l = 78.028 + -0.028. Let y = -78.47 + l. Is 1 less than or equal to y? False Suppose 2u + 3l - 13 = 0, 3u - 12 = -4l + 2l. Let x be 4/3 - u - (-2)/3. Let v be 1 - (59/30 - 1). Which is smaller: x or v? x Let c(s) = 2s3 + 12s*2 + 5s + 5. Let o(x) = -2x3 - 12x*2 - 4x - 6. Let m(b) = 5c(b) + 4o(b). Let u be m(-4). Is u greater than -5/2? True Let s be 486600/160 - 20/16. Which is greater: s or 3038? s Suppose 1048 = 14m - 9m - p, -2m + 406 = 4p. Suppose -ms = -216s. Is s at least -5/32? True Let w = 563.37 + -563. Let a = 36 - 41.37. Let q = w + a. Which is bigger: q or 4? 4 Suppose -27j - 5904 = -13086. Suppose 0 = s - 5y - 368 + 91, -5s + 1343 = -4y. Is j equal to s? False Let y = 62.94 + -61.94. Which is smaller: -77 or y? -77 Suppose 2d = 2m - 8, 2d + 10 = 5m - 13. Suppose -k + 567 = mr + 152, -5k - 166 = -2r. Are r and 2 non-equal? True Let d = -0.2 + 0. Let r = -210 - -210.05. Let u = r - 3.05. Which is greater: d or u? d Let d be 625/20 + 6/(-4). Let c be d/(-66)123. Let q = 230/77 + c. Is 4/5 <= q? False Let a be 2/12 + (3 - 82/(-12)). Suppose -2h - 40 + a = 0. Is -22 greater than h? False Let l(f) = -99f + 3355. Let m be l(42). Which is greater: m or -806? m Let o = -4211.89 - -4212. Which is greater: o or -1/33? o Suppose -2q + 1926 = 2d - 6q, 3d - 5q - 2886 = 0. Let k = 953 - d. Is k >= -31/6? True Let p = 310/7 + -790/21. Let y = 41/6 - p. Is 2/13 at most y? True Let i be 20/8(-12)/(-15). Suppose ik - 5j + 15 = 0, 4j = -3k - j + 15. Which is smaller: k or 11? k Let g = 484 + -484.023. Let r = 1.826 + -0.763. Let s = r - 0.063. Which is greater: g or s? s Let x(h) = 4h2 + 4h - 7. Let p be x(-4). Let v = p + -39. Suppose -s = -w - 4, 6w = vw + s - 7. Which is greater: 32 or w? 32 Let x = -10862 - -11245. Is 384 < x? False Suppose -2o = -20f + 25f - 73, 0 = 3o + 5f - 122. Let s = -22757/5 + 4598. Let i = o - s. Is i bigger than 3? False Let h(f) = -41f - 38. Let s be h(-2). Suppose -9i - 35i = -s. Which is bigger: i or -4/91? i Let d be 0 - (-4 + 2 + 4). Let u = -114/25 - -209/150. Let f = 77/30 + u. Is d <= f? True Let t(a) = a*2 - 15a + 2. Let c be t(17). Suppose 18 = -w + 5g - g, 0 = -4w + 4g - c. Are 8 and w equal? False Let n = 7.07 - 6.8. Let f = -1182 + 1174.23. Let g = f + n. Is g greater than 1? False Suppose -24261 - 984 = 5t. Let f be t/542/(-1). Let p be 12/(-102) + 56/f. Is -1 > p? False Suppose 2w + 5j = -65, -3w - 7 - 68 = 5j. Do -71/7 and w have different values? True Let q = 67 + -58. Let j be ((-6)/243)/(q/(-27)). Let d = 42 + -40. Is j less than d? True Suppose -31y = 2584 - 44124. Which is bigger: 1342 or y? 1342 Let h = -0.3687 - -0.0657. Let j = h + 0.303. Which is smaller: j or 2/73? j Suppose -i + 3r + 5 = 4r, r - 35 = 5i. Let v be 31-1 + (0 - 2). Which is greater: i or v? i Let d = -477 - -484. Suppose 0 = dh + 13 - 27. Which is greater: -0.011 or h? h Let n = 165 + -100. Let u = -61 + n. Suppose -t - z - 2 = -0, 0 = ut + z + 17. Is t < -3/5? True Let u(t) = -7t + 42. Let l(i) = -i3 - 14i*2 - 11i + 32. Let r be l(-13). Let z be u(r). Are z and -5/114 non-equal? True Let k(x) = 2x2 + 3x - 2. Let o be k(1). Suppose 0 = -os + 3, -s = 4p + s - 14. Suppose -pf + f = 12. Is f less than -6? False Let k = -553828/87 + 6366. Is 0 less than k? True Let v = 1456/3 + -90281/186. Let n = -1.9 + 2. Which is bigger: n or v? n Let r be (-1295)/(-6725) - (-1)/(-5). Let f be 3/(-4) - (-5)/(-20). Is r less than f? False Let q be (-102294)/(-936) + (-12)/(-26). Is 111 at most q? False Let m = 326 - 310. Suppose -16 = 9u - m. Which is bigger: 2/885 or u? 2/885 Let m be (-16)/6 - (-133438)/(-1461). Is m bigger than -8? False Let p = -107257 + 245296773/2287. Is 1 bigger than p? True Let o = 843/511 - 110/73. Which is greater: -16.4 or o? o Let z = -241 - -193. Let o be (3/12)/(-4 + (-206)/z). Which is smaller: o or -2/9? -2/9 Suppose 10553 = 236o - 63o. Is o smaller than 65? True Let d be 2/5181/(-816). Let w = 3/136 + d. Let s be ((-8)/10 - -1) + 0. Is w at most s? True Suppose -5z + 2z - 6z = 0. Suppose -28o + 24o + 16 = z. Suppose 54 = -3h + oh. Which is smaller: 1 or h? 1 Suppose d - 2d = -5. Suppose -124 = 4w + do - 15, -2o + 68 = -2w. Let s be (5/(-25) + w/(-5))/(-1). Is -4 less than or equal to s? False Suppose -178 = 8m - 34. Let d be 3472/(-36) - 8/m. Is d less than -95? True Let f = -18324 + 164648/9. Which is greater: f or 0? 0 Let v(p) be the third derivative of -p*	{ "pile_set_name": "DM Mathematics" }
*2 + t. Let j be f(1). Sort l, 3, j. l, j, 3 Let u = 53 - 43. Sort u, -3, 3, 5 in increasing order. -3, 3, 5, u Suppose 0 = -4s - 3j + 11, 0 = -2s + 3j - 1 + 2. Suppose -o + 4m = -so + 25, o - 3m = -10. Sort o, -4, 7, -3 in ascending order. -4, -3, o, 7 Let m = 585 - 581. Sort 3, m, -5, -69. -69, -5, 3, m Let u = 0.276 - -52.724. Put -0.4, -4, u, 0.5 in ascending order. -4, -0.4, 0.5, u Let q = -6 + 5.93. Let y = -0.87968 - 0.12032. Put -3/4, y, -2, q in ascending order. -2, y, -3/4, q Let f = 5 + 0. Let s = -19 - -17. Let a be (2 + -1)/(7/s). Sort -1, f, a. -1, a, f Let m = 8 + -3. Suppose 8r + 9 = 5r. Sort -2, m, -9, r in descending order. m, -2, r, -9 Let r = -189 + 188.79. Sort 4/5, -1/3, r in decreasing order. 4/5, r, -1/3 Suppose -73 = -6i + 11. Suppose 18 - i = 4c. Let f be 0 + (-5 - 0) + 0. Put c, f, -3 in increasing order. f, -3, c Let r be 7 + (-9 - -9) + -9. Suppose 0 = 2u - 0u + 8. Sort 7, r, u in ascending order. u, r, 7 Let b = -1/157 - 303/1727. Let l = 13.5 - 13. Put -0.04, l, b in increasing order. b, -0.04, l Suppose 18 = 4y - 54. Suppose 4z = -14 - y. Let b = z - -10. Put b, -1, 1 in ascending order. -1, 1, b Let p = -383 - -383.3. Put p, -0.25, 3/2, 0.2 in decreasing order. 3/2, p, 0.2, -0.25 Let s = -1957 + 1978. Sort s, 3, -4, -6 in increasing order. -6, -4, 3, s Suppose 9x - 33 = 6x. Suppose 0 = -15h - 34 - x. Let b = 0 + -2. Put h, -4, b in decreasing order. b, h, -4 Suppose 2r - 3h = -8, -3r + 22 = -h + 5h. Suppose 6 = 4c + r. Suppose 0 = 4w + i + 1, 3 = 3w + 2i - 5i. Sort -3, w, c in ascending order. -3, w, c Let b = -13 + 17. Let m = b + 0. Let y be 16/(-6) + (-1 - -4). Put 2, m, y in decreasing order. m, 2, y Suppose 41 = 5x - 39. Let c be 1 + x/12 + -31. Sort 4/5, 4, c, 1/4 in decreasing order. 4, 4/5, 1/4, c Let t(u) = -7u2 + 2u*3 + 13u + 10 - 13u2 - 9u*2. Let d be t(14). Sort -2/11, -0.4, d, 2/5. d, -0.4, -2/11, 2/5 Let a = -613/20 - -125/4. Sort 5, -0.1, a in ascending order. -0.1, a, 5 Let p = -0.1608 + 0.3608. Let r = -0.4 - 0. Sort r, 0.4, p, 2/11 in descending order. 0.4, p, 2/11, r Let c be -1 - ((-18)/16 + 0). Let p = 3/1412 + -2839/7060. Put c, -6, p in increasing order. -6, p, c Let n = 484 - 434. Sort n, 0.4, -3, 0 in decreasing order. n, 0.4, 0, -3 Let n = 3069 - 3069.4. Sort -0.1, n, 0.11, 6 in increasing order. n, -0.1, 0.11, 6 Let b be (-7)/28 + (-2 - 36/(-16)). Let w be ((-16)/(-7))/1 + -2. Put -1, w, 1, b in descending order. 1, w, b, -1 Let t = 10717.5 - 10717. Let v = 0.2 + -0.1. Let i = v - 0.7. Sort i, t, 5/4 in decreasing order. 5/4, t, i Let h be 9/(1 - 1 - -1). Let z = h - 14. Let c = z - -6. Sort c, 2, 3 in increasing order. c, 2, 3 Let v = 12 + -12. Let y(g) = -g + 3. Let u be y(v). Sort u, -13, 2 in increasing order. -13, 2, u Suppose -2o - 9 = 5r, -22 + 16 = 3r + o. Put -528, -1, r in ascending order. -528, r, -1 Let w = -341.2 + 382. Let b = w + -41. Sort 1/5, -1/6, b, 3/2. b, -1/6, 1/5, 3/2 Let v(j) = -10j + 165. Let f be v(16). Put f, -2, 2 in decreasing order. f, 2, -2 Let i(z) = -8z - 7. Let q be i(-2). Suppose 4t - q = h, -3t + 7t - 15 = -h. Suppose -2v = 5n - 16, -n + 4 - 11 = -3v. Put n, 4, h in descending order. 4, h, n Let h = -127.5 - -128. Sort -21, h, 0, -2. -21, -2, 0, h Suppose -7q = -4q + 12. Let i be q(-1 + 0) + 0 + -3. Sort -4, 0, i, 3 in ascending order. -4, 0, i, 3 Suppose 0 = 3z + 2 + 7. Let h(x) = 3x3 - 48x*2 - 8x + 131. Let y be h(16). Put -2, z, 4, y in decreasing order. 4, y, -2, z Suppose b + 11 = -k, 5b - 19k + 34 = -21k. Let u(v) = -v2 + 4v + 1. Let x be u(4). Sort b, -7, x in decreasing order. x, b, -7 Let x(h) = 76h - 149. Let y be x(2). Sort 12, 4, y, 0 in decreasing order. 12, 4, y, 0 Let s be (-110)/(-7) - 16/(-56). Suppose 12 = sw - 13w. Put -6, w, -2 in ascending order. -6, -2, w Let x = -0.19 - -0.35. Let g = x + 20.84. Let w = g - 21. Sort 2, w, 0.01. w, 0.01, 2 Suppose -v - c + 1 = 0, -2v + 4c = -7v + 1. Let w = 1.3 - 0.8. Put 0.3, w, v in increasing order. v, 0.3, w Let x = -3.301 + 0.011. Let n = x + -0.71. Sort -0.1, 4, -0.36, n. n, -0.36, -0.1, 4 Let o = 17 + -16.95. Let s = 0.303 - 0.103. Put 5, s, o in decreasing order. 5, s, o Let p(m) = -m*3 + 9m*2 + 20m + 21. Let v be p(11). Sort 1/7, v, 1, 5 in ascending order. v, 1/7, 1, 5 Let c = -231 + 240.7. Let h = 14.7 - c. Put h, 4, 3, -5/4 in descending order. h, 4, 3, -5/4 Let w be -10 - 1 - -62/3. Suppose 8 = 4b, -f - 3b - 2 = -4b. Sort f, 1/8, 1/4, w in descending order. 1/4, 1/8, f, w Let u(n) = -12n - 9 - 16 + 0. Let p be u(-3). Put -3, 1, p in descending order. p, 1, -3 Let x be (-156)/36 - 2/(-6). Let n(z) = -z2 - z - 3. Let g be n(0). Let o be 3/g + 2 + -2. Sort 6, x, o. x, o, 6 Suppose -15u + 1163 = 1148. Sort 3, u, 0, -6 in descending order. 3, u, 0, -6 Let a(r) = r*3 + 19r*2 - 42r + 5. Let g be a(-21). Put -2, g, 4, 12 in descending order. 12, g, 4, -2 Let h = -57/2 + 29. Let z = -4 - -7. Let k = 19 + -19.3. Sort k, h, z in descending order. z, h, k Let b = -0.16 + 1.16. Sort -0.3, -0.1, b in descending order. b, -0.1, -0.3 Let d be (-24)/(-9)(-45)/(-20). Let j = -3 + d. Sort j, 6, -4 in descending order. 6, j, -4 Let s = -110 + 106. Suppose 2y = -4 - 2. Put s, -5, -6, y in descending order. y, s, -5, -6 Suppose 3s + 77 = -c, -21c + 16c = -3s - 101. Sort s, 3, -1. s, -1, 3 Let n = 1026 - 1022. Sort 7, 5, -1, n. -1, n, 5, 7 Let u = 877.4 + -877. Put 3, -0.62, u in ascending order. -0.62, u, 3 Let r = 691 - 755.6. Let t = -65 - r. Let j = -20/9 + 2. Put -4, t, j in decreasing order. j, t, -4 Let j = 35.2 - 35. Let y be 4/(-6)36/8. Let l be (-8)/(-9) - (-2)/y. Sort j, 0.08, l in increasing order. 0.08, j, l Let w(m) = -2m - 3. Let y be w(-4). Let h = 0.98 - -0.12. Let a = h - 0.8. Put 0.2, a, y in descending order. y, a, 0.2 Let o = -252 - -239.7. Let u = o - -12.1. Let s = -265/52 + 21/4. Put s, 2/3, u in descending order. 2/3, s, u Let p = -116.39 + -2.61. Let w = p + 120. Sort w, 3/7, -0.2, 0.3 in ascending order. -0.2, 0.3, 3/7, w Suppose -p + 9 + 7 = 0. Suppose -5o + 3o - p = 0. Put 5, -1, o in ascending order. o, -1, 5 Suppose 20 = 4k + 2b, 0 = -4k + b + 7 + 1. Sort -3, k, -2. -3, -2, k Let y be (39/9)/13 + -1. Put 1/4, -4/11, y in descending order. 1/4, -4/11, y Let j(y) = 3y*2 + 24y - 2. Let r be j(-7). Sort -5, r, 4 in ascending order. r, -5, 4 Suppose 0 = -10i + 6i. Let v = -35 - -16. Let k = v - -22. Put i, -4/7, k in decreasing order. k, i, -4/7 Suppose -2z - 2u + 26 = 0, -3z = -4u + 6 - 17. Sort z, -6, 1 in descending order. z, 1, -6 Let a(q) = -q*2 + 2q + 4. Let u be a(4). Let s(d) = -d*3 + 1. Let m be s(0). Sort u, -2, m. u, -2, m Suppose 0 = -2q - 2q + 12, -4l - 4q = -84. Let w be 390/(-104) - (l/8)/(-3). Let r(g) = -g - 8. Let p be r(-6). Sort p, w, 2. w, p, 2 Let m = 0.1012 + -0.0012. Let v = -8 - -8.8. Let x = v + 0.2. Put x, m, 3 in descending order. 3, x, m Let s = -1 + 5. Let j(m) = m3 - 10m*2 + 15m - 4. Let y be j(5). Let r be (y/(-36))/(1/(-2)). Sort 1/12, s, r in increasing order. r, 1/12, s Let k be ((-33)/22)/((-1)/(-4)). Sort -2, -5, k, 4. k, -5, -2, 4 Let u be (-14 - 0 - -41)/2. Sort -4, u, -5/3 in decreasing order. -5/3, -4, u Let q = -546 + 554. Put q, -1, -3, 20 in ascending order. -3, -1, q, 20 Let w = 9 - 4. Suppose 4a = -m - 0a + 50, 5a - 122 = -3m. Suppose -m + 6 = -7l. Sort w, l, 0 in descending order. w, l, 0 Let b(p) = -7p + 13 - 2p*2 - 5p + 5p - 9. Let f(x) = x3 + 5x*2 + 2x + 6. Let r be f(-5). Let q be b(r). Put -4, q, -1 in ascending order. -4, -1, q Let b = -120.2 + 123. Let s = -3.8 + b. Sort 4, -2/17, s in descending order. 4, -2/17, s Let f(x) = 22x2 - 7x - 1. Let d be f(2). Put -3, d, -4 in descending order. d, -3, -4 Let t be -3(2 - 1) + -1. Suppose 4x - 2k + 1354 - 1352 = 0, -5x + 5k = -5. Put -9, -3, t, x in increasing order. -9, t, -3, x Let j(a) = -a3 + 102. Let c be j(0). Let q be (3/c)/((-1)/2). Let r(f) = -f3 - 7f*2 - 10f. Let h be r(-2). Sort 1/4, h, q. q, h, 1/4 Let b = -2192 - -2184. Put 0.01, 5, b in increasing order. b, 0.01, 5 Let d be (2 - 3)(-6)/(131 - -7). Let p be (-3)/6 + (-146)/(-184). Let n = p - d. Sort -1/8, n, -5 in decreasing order. n, -1/8, -5 Suppose 5t - 20	{ "pile_set_name": "DM Mathematics" }
ainder when 84 is divided by 43? 41 Calculate the remainder when 2343 is divided by 102. 99 Calculate the remainder when 98 is divided by 23. 6 What is the remainder when 335 is divided by 19? 12 What is the remainder when 764 is divided by 13? 10 What is the remainder when 535 is divided by 511? 24 Calculate the remainder when 90 is divided by 64. 26 What is the remainder when 60 is divided by 25? 10 What is the remainder when 1193 is divided by 199? 198 What is the remainder when 1177 is divided by 113? 47 What is the remainder when 104 is divided by 29? 17 Calculate the remainder when 184 is divided by 32. 24 Calculate the remainder when 32 is divided by 22. 10 Calculate the remainder when 2146 is divided by 525. 46 Calculate the remainder when 379 is divided by 35. 29 Calculate the remainder when 621 is divided by 115. 46 What is the remainder when 2838 is divided by 14? 10 Calculate the remainder when 100 is divided by 25. 0 Calculate the remainder when 317 is divided by 101. 14 Calculate the remainder when 31142 is divided by 136. 134 Calculate the remainder when 579 is divided by 53. 49 What is the remainder when 2231 is divided by 22? 9 What is the remainder when 64 is divided by 33? 31 Calculate the remainder when 61 is divided by 47. 14 What is the remainder when 1938 is divided by 37? 14 What is the remainder when 4280 is divided by 3? 2 Calculate the remainder when 89 is divided by 29. 2 What is the remainder when 183 is divided by 57? 12 What is the remainder when 313 is divided by 75? 13 What is the remainder when 1682 is divided by 24? 2 Calculate the remainder when 573 is divided by 36. 33 Calculate the remainder when 1760 is divided by 254. 236 Calculate the remainder when 343 is divided by 39. 31 Calculate the remainder when 417 is divided by 35. 32 Calculate the remainder when 213 is divided by 7. 3 What is the remainder when 1108 is divided by 11? 8 Calculate the remainder when 9098 is divided by 37. 33 Calculate the remainder when 185 is divided by 90. 5 Calculate the remainder when 93 is divided by 20. 13 What is the remainder when 111 is divided by 26? 7 Calculate the remainder when 10 is divided by 10. 0 Calculate the remainder when 7611 is divided by 29. 13 What is the remainder when 253 is divided by 46? 23 Calculate the remainder when 945 is divided by 269. 138 What is the remainder when 2915 is divided by 243? 242 Calculate the remainder when 44 is divided by 17. 10 What is the remainder when 44397 is divided by 37? 34 Calculate the remainder when 4025 is divided by 212. 209 Calculate the remainder when 72 is divided by 21. 9 What is the remainder when 581 is divided by 204? 173 Calculate the remainder when 66 is divided by 11. 0 Calculate the remainder when 924 is divided by 116. 112 Calculate the remainder when 3533 is divided by 19. 18 Calculate the remainder when 1452 is divided by 2. 0 What is the remainder when 1188 is divided by 92? 84 What is the remainder when 308 is divided by 37? 12 What is the remainder when 1050 is divided by 3? 0 What is the remainder when 1733 is divided by 143? 17 What is the remainder when 456 is divided by 147? 15 Calculate the remainder when 3586 is divided by 52. 50 Calculate the remainder when 111 is divided by 7. 6 What is the remainder when 3457 is divided by 19? 18 Calculate the remainder when 562 is divided by 146. 124 What is the remainder when 19088 is divided by 83? 81 Calculate the remainder when 1123 is divided by 371. 10 What is the remainder when 139 is divided by 80? 59 What is the remainder when 2336 is divided by 18? 14 What is the remainder when 1037 is divided by 52? 49 What is the remainder when 295 is divided by 31? 16 Calculate the remainder when 3826 is divided by 6. 4 What is the remainder when 3125 is divided by 46? 43 What is the remainder when 664 is divided by 22? 4 Calculate the remainder when 13394 is divided by 17. 15 What is the remainder when 2798 is divided by 100? 98 Calculate the remainder when 237 is divided by 40. 37 Calculate the remainder when 52 is divided by 15. 7 Calculate the remainder when 86 is divided by 22. 20 Calculate the remainder when 342 is divided by 32. 22 What is the remainder when 717 is divided by 123? 102 Calculate the remainder when 6230 is divided by 20. 10 Calculate the remainder when 262 is divided by 35. 17 What is the remainder when 222 is divided by 169? 53 What is the remainder when 18 is divided by 10? 8 What is the remainder when 681 is divided by 39? 18 What is the remainder when 26053 is divided by 367? 363 Calculate the remainder when 561 is divided by 145. 126 What is the remainder when 145 is divided by 40? 25 Calculate the remainder when 13 is divided by 2. 1 Calculate the remainder when 588 is divided by 253. 82 Calculate the remainder when 598 is divided by 29. 18 Calculate the remainder when 3647 is divided by 192. 191 What is the remainder when 4723 is divided by 15? 13 What is the remainder when 163 is divided by 11? 9 What is the remainder when 8 is divided by 6? 2 What is the remainder when 153 is divided by 68? 17 What is the remainder when 107 is divided by 12? 11 What is the remainder when 178 is divided by 85? 8 Calculate the remainder when 122 is divided by 31. 29 Calculate the remainder when 108 is divided by 84. 24 Calculate the remainder when 1098 is divided by 50. 48 Calculate the remainder when 2687 is divided by 158. 1 Calculate the remainder when 112 is divided by 44. 24 What is the remainder when 323 is divided by 138? 47 Calculate the remainder when 93 is divided by 15. 3 Calculate the remainder when 164 is divided by 80. 4 What is the remainder when 372 is divided by 17? 15 What is the remainder when 149 is divided by 51? 47 Calculate the remainder when 14298 is divided by 20. 18 Calculate the remainder when 376 is divided by 14. 12 Calculate the remainder when 30 is divided by 20. 10 Calculate the remainder when 836 is divided by 56. 52 Calculate the remainder when 81 is divided by 23. 12 Calculate the remainder when 3557 is divided by 6. 5 Calculate the remainder when 118 is divided by 28. 6 What is the remainder when 1543 is divided by 82? 67 What is the remainder when 1406 is divided by 57? 38 Calculate the remainder when 2042 is divided by 186. 182 What is the remainder when 411 is divided by 24? 3 Calculate the remainder when 205 is divided by 80. 45 What is the remainder when 2270 is divided by 16? 14 What is the remainder when 443 is divided by 248? 195 What is the remainder when 265 is divided by 131? 3 Calculate the remainder when 249 is divided by 112. 25 What is the remainder when 14746 is divided by 6? 4 Calculate the remainder when 508 is divided by 248. 12 What is the remainder when 3623 is divided by 29? 27 What is the remainder when 1262 is divided by 71? 55 What is the remainder when 378 is divided by 24? 18 What is the remainder when 1570 is divided by 123? 94 Calculate the remainder when 2030 is divided by 28. 14 Calculate the remainder when 176 is divided by 93. 83 What is the remainder when 295 is divided by 209? 86 Calculate the remainder when 3318 is divided by 71. 52 Calculate the remainder when 447 is divided by 14. 13 Calculate the remainder when 334 is divided by 175. 159 Calculate the remainder when 183 is divided by 33. 18 What is the remainder when 3320 is divided by 41? 40 What is the remainder when 155 is divided by 39? 38 Calculate the remainder when 380 is divided by 65. 55 Calculate the remainder when 755 is divided by 21. 20 Calculate the remainder when 490 is divided by 46. 30 Calculate the remainder when 1594 is divided by 797. 0 Calculate the remainder when 2114 is divided by 93. 68 What is the remainder when 7227 is divided by 139? 138 Calculate the remainder when 119 is divided by 53. 13 What is the remainder when 76 is divided by 25? 1 What is the remainder when 3309 is divided by 182? 33 Calculate the remainder when 532 is divided by 132. 4 Calculate the remainder when 30166 is divided by 12. 10 Calculate the remainder when 4353 is divided by 36. 33 Calculate the remainder when 155 is divided by 40. 35 What is the remainder when 414 is divided by 142? 130 What is the remainder when 126 is divided by 63? 0 What is the remainder when 266 is	{ "pile_set_name": "DM Mathematics" }
quence crz when three letters picked without replacement from zkczrrrzzrrmicrrz? 7/408 Calculate prob of sequence wwx when three letters picked without replacement from xxxxxxxxxwwxwxxxxxwx. 8/285 Three letters picked without replacement from npnpnpnn. Give prob of sequence npn. 5/28 Four letters picked without replacement from {h: 5, r: 5, q: 4}. What is prob of sequence rrqr? 10/1001 Calculate prob of sequence quq when three letters picked without replacement from uqqqquuquuqqqq. 15/91 Three letters picked without replacement from jjjrrbrrjrrrjrj. What is prob of sequence jbj? 1/91 Calculate prob of sequence tsu when three letters picked without replacement from {t: 1, b: 4, s: 12, u: 3}. 1/190 Three letters picked without replacement from wwwwuwwwwwwuwwwwuuww. What is prob of sequence uuw? 8/285 What is prob of sequence pyp when three letters picked without replacement from ppppyyeep? 5/63 What is prob of sequence pk when two letters picked without replacement from rtwkwhp? 1/42 Four letters picked without replacement from aaazzaazzaa. What is prob of sequence azaa? 7/66 What is prob of sequence qq when two letters picked without replacement from {q: 1, k: 5, y: 5}? 0 Calculate prob of sequence gg when two letters picked without replacement from {c: 3, g: 6, t: 3, b: 7}. 5/57 What is prob of sequence hku when three letters picked without replacement from eqmkhhuqhehm? 1/330 Calculate prob of sequence efoe when four letters picked without replacement from eoeef. 1/20 Two letters picked without replacement from jjjjj. What is prob of sequence jj? 1 Four letters picked without replacement from {j: 6, d: 3, u: 4, n: 1, i: 2}. Give prob of sequence uinu. 1/1820 What is prob of sequence jr when two letters picked without replacement from nxjrxpry? 1/28 Three letters picked without replacement from {r: 2, b: 7, h: 1, d: 7}. What is prob of sequence ddh? 7/680 Two letters picked without replacement from ccccctttct. What is prob of sequence tc? 4/15 What is prob of sequence qqrq when four letters picked without replacement from {q: 3, r: 1}? 1/4 Two letters picked without replacement from nnnnnn. What is prob of sequence nn? 1 What is prob of sequence kj when two letters picked without replacement from jkjkkk? 4/15 Four letters picked without replacement from tajaryyytyjyyaj. What is prob of sequence yjjy? 1/182 Four letters picked without replacement from {i: 3, o: 5, k: 5, u: 2}. Give prob of sequence ukik. 1/273 Four letters picked without replacement from atat. What is prob of sequence atat? 1/6 Two letters picked without replacement from jllncc. What is prob of sequence ln? 1/15 Calculate prob of sequence hhgh when four letters picked without replacement from hhzzzfgzghhf. 2/495 Calculate prob of sequence hju when three letters picked without replacement from {h: 3, j: 2, a: 1, p: 9, u: 4}. 4/969 Calculate prob of sequence jrz when three letters picked without replacement from {r: 4, x: 2, v: 3, u: 1, z: 2, j: 2}. 2/273 Four letters picked without replacement from qniqiepinpqqner. What is prob of sequence npii? 1/910 Two letters picked without replacement from vuccbzkk. Give prob of sequence vk. 1/28 Three letters picked without replacement from pcccfckpfkcc. Give prob of sequence fcp. 1/55 Three letters picked without replacement from rrprprrpprpppppprpp. What is prob of sequence ppp? 220/969 Calculate prob of sequence zzk when three letters picked without replacement from kkkzkczkkzzgzckkzzcc. 14/285 Calculate prob of sequence lk when two letters picked without replacement from {k: 5, l: 5, f: 2, x: 1, v: 5}. 25/306 Two letters picked without replacement from imamging. Give prob of sequence ig. 1/14 Calculate prob of sequence yqqy when four letters picked without replacement from qyyyyqyqqqqqqqyyyyq. 45/646 Four letters picked without replacement from {n: 4, a: 7, r: 1, e: 2}. What is prob of sequence eenr? 1/3003 Four letters picked without replacement from {g: 3, e: 5}. Give prob of sequence eeee. 1/14 What is prob of sequence qsau when four letters picked without replacement from aujajjsqjj? 1/2520 What is prob of sequence ss when two letters picked without replacement from xsxsexee? 1/28 Calculate prob of sequence zdd when three letters picked without replacement from {d: 3, z: 1}. 1/4 Three letters picked without replacement from {k: 1, d: 7, y: 2, n: 8}. What is prob of sequence ynk? 1/306 Calculate prob of sequence fpp when three letters picked without replacement from ffpfpp. 3/20 Four letters picked without replacement from sosoososos. What is prob of sequence soso? 5/63 What is prob of sequence tt when two letters picked without replacement from ttttutytutyttyt? 3/7 Calculate prob of sequence zaaj when four letters picked without replacement from nzzaanajaazzzjaan. 1/136 Two letters picked without replacement from zlulqq. Give prob of sequence uq. 1/15 Three letters picked without replacement from {m: 3, c: 12}. What is prob of sequence cmc? 66/455 Three letters picked without replacement from isfzxzl. What is prob of sequence isz? 1/105 What is prob of sequence ddpp when four letters picked without replacement from ppvvvpvdvdvvvvppvpv? 5/7752 Four letters picked without replacement from yymyymyymmymyy. Give prob of sequence mymy. 60/1001 What is prob of sequence zs when two letters picked without replacement from {s: 3, z: 2}? 3/10 What is prob of sequence mm when two letters picked without replacement from {p: 3, m: 2, c: 3}? 1/28 Calculate prob of sequence uee when three letters picked without replacement from {c: 3, a: 7, k: 3, e: 5, u: 1}. 10/2907 Two letters picked without replacement from {y: 1, b: 2, s: 1, x: 1, o: 2, n: 1}. What is prob of sequence sn? 1/56 Two letters picked without replacement from jjjjjjjjjrjjrrjjrrjj. Give prob of sequence jr. 15/76 Four letters picked without replacement from zvlvzrpzrz. What is prob of sequence zvpv? 1/630 Four letters picked without replacement from vbbbbvbbbvvbqbbvvb. Give prob of sequence vqbv. 11/2448 Two letters picked without replacement from skknscsnssns. What is prob of sequence nn? 1/22 Four letters picked without replacement from yyjcjyjuyjjjcyyjjj. Give prob of sequence jujc. 1/510 Four letters picked without replacement from fffffxffxfxfxfffxxx. Give prob of sequence ffff. 165/1292 Calculate prob of sequence qdr when three letters picked without replacement from {p: 1, d: 11, i: 2, r: 3, q: 1}. 11/1632 Four letters picked without replacement from mmmtdmllmtld. Give prob of sequence mddl. 1/396 Four letters picked without replacement from {d: 2, k: 7}. What is prob of sequence kdkd? 1/36 What is prob of sequence kkcp when four letters picked without replacement from {p: 4, k: 3, c: 4, w: 6}? 1/595 Calculate prob of sequence elx when three letters picked without replacement from eclex. 1/30 Three letters picked without replacement from oqzmd. What is prob of sequence zoq? 1/60 Four letters picked without replacement from oooo. Give prob of sequence oooo. 1 Three letters picked without replacement from {b: 6, h: 3, f: 1, r: 5, d: 3}. Give prob of sequence dbb. 5/272 What is prob of sequence jj when two letters picked without replacement from nnnjjjnjnnnnnn? 6/91 What is prob of sequence lm when two letters picked without replacement from {m: 4, f: 1, l: 2}? 4/21 Four letters picked without replacement from {n: 1, z: 1, y: 2, w: 1, a: 3, g: 4}. What is prob of sequence agyw? 1/495 Four letters picked without replacement from {r: 9, l: 11}. What is prob of sequence llll? 22/323 Three letters picked without replacement from {a: 16, u: 4}. What is prob of sequence aaa? 28/57 Calculate prob of sequence dwv when three letters picked without replacement from vqvqwdgqvqqg. 1/440 Two letters picked without replacement from vflodadfl. Give prob of sequence od. 1/36 Three letters picked without replacement from riirgtlgrgild. What is prob of sequence llr? 1/286 What is prob of sequence bq when two letters picked without replacement from qqyqqqbbqqqqqyqqqqqb? 9/76 Two letters picked without replacement from yifiificxxyffflyff. What is prob of sequence xf? 7/153 Calculate prob of sequence rku when three letters picked without replacement from kru. 1/6 What is prob of sequence xrt whe	{ "pile_set_name": "DM Mathematics" }
-3 Suppose -4a = -9x + 6x - 3487, 4a = 5x + 3481. Let y be 1/13 + a/299. Solve 0 = yq + 2q - 2h + 19, -q + 5h + 10 = 0 for q. -5 Suppose -2k + r + 1615 = 0, -r + 10 - 9 = 0. Suppose 4 = kf - 806f. Solve 1 = -l + 3c, 2l = -0l - fc + 14 for l. 5 Let u(w) = 2w2 - 58w + 312. Let o be u(7). Solve -2h = -5x + 33, 2h - ox + 18 = -10 for h. -4 Suppose 5t - 3t - 230 = 0. Suppose -3l + 481 = 4o, -l + 475 = 7o - 3o. Let k = o - t. Solve -3m = -0w + 4w + 26, -m = -kw - 13 for w. -5 Let h be ((-18)/15)/(6/(-50)). Let v = -12 + 7. Let n = v + h. Solve nw + 4 - 26 = -c, 2w + 3c - 1 = 0 for w. 5 Let t = -6 - -9. Let p = -1142 + 1145. Solve -2w - 2 = -pi, 7w + 18 = tw - i for w. -4 Suppose -2m + 93 - 19 = 0. Suppose -5o + 43 + m = 0. Let k = o - 10. Solve k = -u - 0u - 2q, 5u = -5q - 10 for u. 2 Let w(x) = 11x*2 + 42x - 15. Let q(b) = -7b2 - 28b + 10. Let p(c) = 8q(c) + 5w(c). Let u be p(0). Solve l - 8 = 2s + ul, 3l + 1 = s for s. -2 Suppose 2x - 41 + 85 = 0. Let p(s) = s*2 + 21s - 20. Let i be p(x). Solve 0 = -z + il + 15, -2z - 5l = -4z + 35 for z. 5 Let u(h) = h*3 + 24h*2 - 28h - 75. Let r be u(-25). Solve -4g = 3k - rk - 22, 2k + 8 = 3g for g. 4 Let v be ((-1)/(-3))/((-1)/(-15)). Let m = -5 + 6. Let t = 3 + m. Solve 0 = 5y + vc + 45, ty - 8 = 4c - 4 for y. -4 Let s = -3 - -10. Let v = s + -5. Let k(y) = -y2 + 36y - 311. Let l be k(17). Solve -4x + vx + 7 = -f, 4f + l = 0 for x. 2 Let d be 6 + (12 + -10 - 1). Solve -dx + 4s + 12 = -8x, 4s = -4x for x. 4 Let o = 177 - 177. Suppose -3a = i + 3, 2a + 3i + 9 = 3a. Suppose a = 5p - p - 16. Solve -5x - 2v + 24 = o, x + 8 = 5x - pv for x. 4 Suppose -4r + 2r = -20. Suppose rs - 5s - 35 = 0. Solve -2d = -3f - s, 3d - 17 = -2f - 0f for d. 5 Suppose j - 27 = -5o + 8o, 4o + 8 = 0. Solve -5x = -4 - j, -3b = x - 32 for b. 9 Let f(j) = j2 + 6j + 10. Let o(x) = -11x + 82. Let z be o(8). Let k be f(z). Solve -k = -s - 5m, -4 = -4s + s - 2m for s. 0 Let s(a) = -a*2 - 8a + 21. Let g be s(2). Let q be (-1 + (g - -1))/(3/6). Solve 14 = qz - 5h, 10 = 2z - 4h - 2 for z. 2 Let p(w) = -2w + 52. Let a be p(32). Let m be -6 + 5 + a/(-3). Solve f = -0o - o - m, 3f = 3o + 15 for f. 1 Suppose -5z - 5q + 100 = 0, -6z + 5q + 75 = -4z. Solve -2a - 2a - 5s + z = 0, 10 = -a + 2s for a. 0 Suppose y = -0y + 22. Let i be (-12 + 693/55)5. Solve iw = 3k + 9, -2w + w - 4k = y for w. -2 Suppose 2798p - 2772p = 156. Solve 8c = 3u + 6c + 2, -3c - p = 0 for u. -2 Let o = -18 - -18. Suppose -5u + 14 + 1 = o. Let b be ((-10)/4)/(u/6-1). Solve -2q - g - 10 = 0, -2q + bq + 4g = -15 for q. -5 Suppose 3s = 4j - 962, 15 = 2j + 4s - 455. Let k = 242 - j. Solve q + 3 = -0q, 34 = 5w - kq for w. 5 Let m be (-102)/34(-13)/3. Suppose 34 = -mw + 216. Solve -5i - w = u, 0 = 3u - 4 + 1 for i. -3 Suppose -4d + 5t = -26, 16 - 4 = 2t. Solve 4c + m = 5, -dc - 3 = -16c - m for c. 1 Let f = 171 + -94. Let t = 95 - f. Solve 5y - 6 = 2l - 19, 3l + 5y + t = 0 for l. -1 Let i(t) = -202t + t3 + 44t*2 + 192t - 37t2 - 16. Let j be ((-4)/(-6))/((-2)/24). Let u be i(j). Solve -4o + 20 = 3x, u = -5x + o - 5o + 20 for x. 0 Let s be (1 - 2)(57 - 0). Let z = s - -61. Suppose -zb - 2 + 14 = 0. Solve 2q = x + b, 5x = 4q - 3q + 12 for q. 3 Let r = 3 - -14. Suppose 6317s - 6314s = 2j + 104, -3s - j + 74 = 0. Solve n = -3c - c + r, 5c - s = n for n. -3 Let v be 1504/224 - -12/7. Let j(a) = -a*3 + 6a*2 + 22a - 87. Let n be j(v). Solve l + 2g - 6g + 21 = 0, 0 = 3l - 3g + n for l. -1 Suppose v + 81 = 101. Let f be -3 - v/(-5 - -1). Solve 4a = -4, 0 = -2b - 3a - fa - 11 for b. -3 Let v = 6100 - 6100. Solve -11w + 14w + 2l + 19 = 0, 4l + 20 = v for w. -3 Suppose -6f + 28f = 6820 - 6820. Solve f = -a - 4t + 8t, 5t = 5a for a. 0 Let f = 56 + -65. Let c be (-112)/42f/6. Solve -5b - cj = 0, 4b - b - 4j + 32 = 0 for b. -4 Suppose -22l - 37 = -27l - 4h, -3l - 2h = -23. Solve 5u = -x - 25, -lx = -5u - 11x - 25 for u. -5 Let c(g) = 4g2 + 4g - 3. Let q be c(2). Suppose 3a - q = -6. Suppose -5k + 26 = m, -2k - m = -a - 3. Solve -2y = 2w - k, -w + 3y + 9 + 2 = 0 for w. 5 Let q = -170 - -177. Let v(l) = -l*2 + 2l + 39. Let f be v(q). Solve 5d - 26 = -fh, h + 3h - 14 = d for h. 4 Let d = -161 - -83. Let y = d - -161. Let j = 99 - y. Solve 0 = 4s - j, 4s - s + 8 = -5r for r. -4 Suppose 4v + 73 = -q, 2q + 2q - 14 = 2v. Let z be -5 - (-186)/42 - (-496)/(-14). Let l = v - z. Solve -k = -2o + 9, 0k - 3o + l = 4k for k. 1 Let m(t) = -17t - 32. Let g be (4 + (-5)/5 + -4)2. Let y be m(g). Solve 3d - 3 = -3r - 15, -yr = -2d - 8 for r. 0 Let s be -941 + 1/1. Suppose 3798 = 37w + 209. Let i = w + s. Solve r + iz - 1 + 13 = 0, 0 = -5r - 2z + 12 for r. 4 Suppose -5y + 3872 = 3857. Solve 3j - 5 = 2w, y = -w - 5j + 6j for w. -4 Suppose 34d + 27 = -11d + 252. Suppose 0 - 2 = -n. Suppose df + 3 = b, 0b - nb - 4f = -20. Solve 5t = 2o + b, t + 3o = -2t - 12 for t. 0 Let o(j) = -j*3 - 14j*2 - 13j + 19. Let h be o(-13). Suppose -z + hz = 108. Solve 3l - zl - 3u = -3, 2l - 3u - 22 = 0 for l. 5 Suppose 8 = -4j, -391y - 2j = -387y - 24. Solve 0 = -5c - 6n + yn + 25, -n + 5 = c for c. 5 Suppose 203 + 202 = 45t. Let d(q) = -q*2 + 8q + 12. Let l be d(t). Solve -o + 2 = n, l = o - 5n - 17 for o. 5 Suppose a + 3f = -261 + 274, -22 = -4a - 2f. Solve -az = 5p + 6 + 4, 16 = -2z + 3p for z. -5 Let i = 15104 - 15102. Solve 0 = -5j - 15, 143d - 142d + i = -2j for d. 4 Suppose -5j + 43 = 8. Suppose j + 1 = 4q. Let l be (-2 - -2)/(0 + -2). Solve -2h = -2, -qn + 5h + 0 - 13 = l for n. -4 Let q = 5 - 2. Suppose -qn = -2m - 22, -5n - m + 26 = m. Suppose 5z - 19 - n = 0. Solve -12 = -4o - 2c + 6c, o - 7 = zc for o. 2 Suppose 0 = -5a - 4a - 14a. Solve a = 5g + 3c + 40, 4c + 15 = c for g. -5 Let z be 12/(-15) + ((-28)/(-5))/2. Solve 5l - 8 = za + 11, 0 = a + 3l - 18 for a. 3 Suppose 4c + 2s = -0s + 22, 2s - 2 = 0. Solve -5f + r = 15, -17 = cf - 3r + 8 for f. -2 Let c be (-290)/(-12) - 12. Solve 5a = -4y - 13, -6y = -ca - 5y - 18 for a. -5 Let n = -2 + 6. Suppose 3f = -no + 2f + 2, 0 = 4f - 8. Let m = -375047 - -375053. Solve 2t - mz + 2 = -2z, 4t - z - 3 = o for t. 1 Suppose 0 = 4n - 9 - 7, -4n + 7 = -3u. Solve -4a + 27 - 1 = 2g, -ua + 15 = 0 for g. 3 Let q be -4(-6)/36 + 376/12. Suppose g - 4 = 3c, 0 = -3g - 3c + 4 + q. Solve -g = -2h + 5w, 15 = 3h + 4w - 7w for h. 5 Let f be (3 - 4)(-6)/(3 + -1). Suppose -6l + fl = 5l. Solve -y + 6 = -2j, ly - j = -y + 4 for y. 2 Suppose -3550 = 42s - 397s. Solve -3p - 5v + 10 = 6, 0 = 5v - s for p. -2 Suppose -2w + 122 - 114 = -p, 5w - 4p = 23. Solve -2r = -wj + 13, -2j - 4 = 8r - 3r for r. -2 Let p(x) = 238x*3 - 4 - 3x - 237x3 - 4 - 9 + 8x*2. Let m be p(-9). Let u = -68 - m. Solve -uc - 2 + 15 = -4i, 16 = -i + 5c for i. -1 Let z be (-2 - (-28)/4) + -2. Let j(p) = 4p2 - 4p - 3. Let l be j(-2). Suppose 5i + 11 = 31. Solve in + zr - 4 = -l, -r = -5n - 26 for n. -5 Suppose 0 = -4b + 5y + 19, -3b + 35y = 39y + 9. Solve 0 = -n - 3x - 2x + b, -4x = n - 1 for n. 1 Let b = 118 + -112. Let w be -6 + 66/b + 6. Solve d + 29 - 2 = -5i, -3d - w = i for i. -5 Let h be 6 + (-186)/9 + 2/(-6). Let w be 1 + 2 - (h - -16). Solve 2i + 2 = 0, 4f = 6f - wi - 2 for f. 0 Suppose 5o + 275r = 272r + 166, 5r + 50 = o. Solve 0 = 4z - 3h + o, 2h = 5z - 8z - 5 for z. -5 Suppose -5n + 8 = -8s - 169, 4n + 3s - 151 = 0. Solve 32o = -2b + no + 8, 12 = 3b + 2o for b. 4 Let y be ((-1)/(-6) - 142/(-12))3. Suppose -11z + 8 = -y. Solve zu + 3c = -28, -4c - 11 = u + 9 for u. -4 Let t = 5283 - 5280. Let v = 20 + -18. Solve -6 = -tp + f, f - 5 + v = 0 for p. 3 Let f = -461 + 469. Let z be (-3)/(4 + -3) - (-13 + f). Solve 14 = 3x + 5r, -4x + 0r = -zr + 16 for x. -2 Let z = -58 - -52. Let q(y) = y3 + 5y*2 - 12y - 32. Let f be q(z). Suppose fb + 20 - 72 = 0. Solve -2o = i + 2o - b, 0 = o - 3 for i. 1 Let g = -201 - -208. Suppose 52 = 19n + gn. Solve -y = nl + 4 - 14, 20 = -2y + 4l for	{ "pile_set_name": "DM Mathematics" }
4370560r3 - 4 Differentiate 157468an + 2083a + 252n + 2156963 wrt a. 157468n + 2083 What is the third derivative of 13961610c4 - 2c*3 - 430c*2 - 25c - 2133? 335078640c - 12 Find the second derivative of -23h*3s + 101777h2s - 3hs + 263335h - s + 2 wrt h. -138hs + 203554s Find the third derivative of 2014443c4z*2 - 2c*3z*2 - 3c*2z*2 - 3c*2z - 4339cz*2 - 13z wrt c. 48346632cz*2 - 12z*2 What is the second derivative of 15111c*2kp + 397c*2k - 99ckp + 13ck - 2c + 2k - 1 wrt c? 30222kp + 794k What is the second derivative of 64955ho*2 - 600h + 465o2 - 89817o wrt o? 129910h + 930 Differentiate 5826989j*4 - 89324869 wrt j. 23307956j*3 Find the second derivative of -32o*3r*2 - 18o*3r - o*3 + 6o*2r3 - o2 - 76or + o + 227483r2 + 5939 wrt r. -64o*3 + 36o*2r + 454966 What is the second derivative of 2r5 + 9544702r*2 - 22415468r? 40r3 + 19089404 What is the second derivative of 6793j*3 - 2j*2 - 2j - 12061103 wrt j? 40758j - 4 What is the third derivative of -37d*3j*2 - 344517d*3j + 8d3 - 1033d*2j - 5dj*2 - 996j*2 - 2 wrt d? -222j*2 - 2067102j + 48 Find the second derivative of -77242053f3 - 24003017f wrt f. -463452318f What is the second derivative of 769776972z*2 + 329285214z wrt z? 1539553944 What is the first derivative of 3p2t*2 + 231626330p*2 - 18283081pt4 wrt t? 6p*2t - 73132324pt3 Find the third derivative of -g5 - 23g4 - 782872g*3 + 14515831g*2 + 3g - 1 wrt g. -60g2 - 552g - 4697232 Find the first derivative of 22006at*3 - 1134at - 55835442t*3 wrt a. 22006t*3 - 1134t Find the third derivative of 825803202n4 + 12258n*2 + 6n - 211 wrt n. 19819276848n What is the third derivative of 466449389n*3 - 117511449n*2 - 3 wrt n? 2798696334 What is the first derivative of -172529777ln2 + 31642873n*2 wrt l? -172529777n2 What is the second derivative of h2p + 8618920h*2 - 8351hp - 2h - 14p - 7 wrt h? 2p + 17237840 Find the second derivative of -19j4 - 10289j*3 - 6j*2 - 698050j + 1 wrt j. -228j2 - 61734j - 12 Find the third derivative of 48448r6 + 2r*4 - 27r*3 + 18708748r*2 wrt r. 5813760r*3 + 48r - 162 Differentiate 282870c4 - 24c*3w*3 - 29w*3 - 2w*2 - 2w + 15777 wrt c. 1131480c3 - 72c*2w*3 Differentiate 2844753v*3 - 13vy - 86764920y with respect to v. 8534259v2 - 13y Find the third derivative of -918548059a3 + 457109264a2 + a - 2. -5511288354 What is the third derivative of w6 - 47615279w4 + 8272690w*2? 120w*3 - 1142766696w What is the first derivative of -53307v2 + 576v + 1155862127 wrt v? -106614v + 576 What is the second derivative of -159h*2j3 - h2j + 72h*2 + hj*3 - 2hj - 2180j*3 - 155j*2 - 2 wrt h? -318j*3 - 2j + 144 Find the first derivative of -46339131z + 60948872. -46339131 Differentiate -su*2 + 566655suv - 3u2v - 996044u2 - uv wrt s. -u*2 + 566655uv Find the second derivative of -2i*3 - 105253i*2 + 3462i - 645. -12i - 210506 What is the third derivative of -16l*4 + 1185850l*3 - 148l*2 + 9l + 689 wrt l? -384l + 7115100 What is the derivative of -4914278z - 101324530? -4914278 Differentiate 55838295u - 105467842. 55838295 Find the first derivative of 1479n*4 + 2n*2 + 4571n - 137009630. 5916n3 + 4n + 4571 Find the third derivative of 598042461h6 + 2h*5 - 47102554h*2 - 3h + 1. 71765095320h3 + 120h*2 Differentiate 18057b*3 - 40b*2 + 12831970 wrt b. 54171b*2 - 80b What is the derivative of 4172884t - 3585387 wrt t? 4172884 Find the third derivative of -23kq4 - 36378kq3 + 1120kq2 + 3k - q*4 - 11q - 11 wrt q. -552kq - 218268k - 24q What is the second derivative of 8024n5 - 1273n4 - n3 - 211950099n wrt n? 160480n*3 - 15276n*2 - 6n Differentiate y*2 + 6825537y - 41398953 wrt y. 2y + 6825537 What is the first derivative of -64692593a*2 - 78596640? -129385186a Differentiate 133503245m - 91816689 wrt m. 133503245 What is the second derivative of -47160235o*2 - o + 5927485? -94320470 Find the third derivative of -10096256w*4 - 54149520w*2. -242310144w What is the third derivative of 30275256a3 - 19117881a*2? 181651536 Differentiate 113os2 - 2512os + 310o + 686609371s2 + 2 wrt o. 113s*2 - 2512s + 310 Find the second derivative of -2q2vx2 - 6q*2x*2 - 6339q*2x + qvx*2 + qvx + 62qv + 2qx2 - qx + 8vx*2 + 32vx wrt q. -4vx2 - 12x*2 - 12678x What is the second derivative of -10369185q2 + 12394555q wrt q? -20738370 Differentiate m*4 - 114m*3 + 418m + 5139821 with respect to m. 4m3 - 342m*2 + 418 What is the derivative of 135jl2 + 112433j + 5308l3 - 2l*2 - 16 wrt l? 270jl + 15924l*2 - 4l Find the second derivative of -514074604l2 + 15552l - 3321 wrt l. -1028149208 Differentiate -10920586fg + 5576092f wrt g. -10920586f Find the third derivative of -340311b6 + 3b4 + b2 + 3926b + 271 wrt b. -40837320b*3 + 72b What is the second derivative of -158j2l*3 + 1036j*2l*2 + 29j*2 + 6jl3 + 56jl2 - 2l*3 + 2l*2 - 72l - 3 wrt j? -316l3 + 2072l*2 + 58 Find the second derivative of -170s*3w*2 - 71630282s*3w - 4s3 + 671864s*2w*2 wrt w. -340s*3 + 1343728s*2 What is the third derivative of 50320629f*3z*3 - 2f*3 + 4447f*2z*2 - 22f wrt z? 301923774f3 Find the third derivative of 407204i*5 + 51i*4 - 149i*2 + 352i + 1 wrt i. 24432240i2 + 1224i What is the second derivative of d*3jw3 - 405421d*2j*2w*3 + 9386dj2w2 + j2w2 + 68w*3 wrt d? 6djw*3 - 810842j*2w*3 Find the second derivative of 3y*4 + 4y*3 + 5278y*2 + 2585y + 2083. 36y2 + 24y + 10556 Find the third derivative of 132299w5 - 2w*4 - 41w*3 - 9952298w*2. 7937940w*2 - 48w - 246 What is the first derivative of -4523752t + 23986215 wrt t? -4523752 Find the first derivative of 35980h*2 - 1509h + 119428183. 71960h - 1509 Differentiate -f3p*3 - 202f*3px - 9f*2p*2 + 206fp3 - 32fp2 + 16396p*3x + 21p3 - 3p with respect to x. -202f3p + 16396p3 Find the third derivative of 58t*3v*3 + 18407t*3 - 115t*2v*3 - 9t*2v + 3tv*3 - 7tv2 - 5v*3 wrt t. 348v*3 + 110442 What is the third derivative of 69968701y*3 + 2384130y*2 + 2 wrt y? 419812206 What is the third derivative of 2629358v*3 + 35v*2 - 475v + 16? 15776148 What is the third derivative of -29ajz3 - 1540az3 - 58az2 + 2jz3 + 2jz + 2j + 2z3 + 1362 wrt z? -174aj - 9240a + 12j + 12 What is the derivative of 84m*2nv2 + m2v*2 + 3m*2 - 6m + 138567nv*3 - 1261v*3 + 29v*2 wrt n? 84m*2v*2 + 138567v*3 Differentiate 4881t*2 - 2891t - 43129205 with respect to t. 9762t - 2891 Differentiate 271q*2wz - 10125qw3z - 7q + 15904w*3z - 52w3 - 25w*2z - 2w2 + 2z + 2 wrt q. 542qwz - 10125w*3z - 7 What is the second derivative of 12470526l2 + 13182311l wrt l? 24941052 What is the second derivative of 845f4 - 711f*3 - 15f*2 + 300873f - 2 wrt f? 10140f2 - 4266f - 30 Find the first derivative of 5a2d*3 - 230054ad3 - 1821315d*3 wrt a. 10ad3 - 230054d*3 What is the third derivative of 463660o*5 + 38o*3 + 540o*2 + 4o + 38887 wrt o? 27819600o2 + 228 Differentiate 10b*4f*2 - 6601818bf2 + 270f*2 - 227666f wrt b. 40b3f*2 - 6601818f*2 Find the second derivative of 41101g*5 + 6g*4 - 694g*3 + 38g + 322624 wrt g. 822020g3 + 72g*2 - 4164g Differentiate -14938558b3k - 1154580b3 - b + 2 with respect to k. -14938558b*3 What is the third derivative of -88c*4 + 116354c*3 + 3c*2 - 202616c + 152? -2112c + 698124 Find the first derivative of 5s*3 - 9364s*2 - 64s + 12007487. 15s2 - 18728s - 64 Find the first derivative of -60fl*2 + 2fl - 2826f - 1461569l2 wrt f. -60l*2 + 2l - 2826 Find the second derivative of 8078019x2 + 66789954x wrt x. 16156038 What is the second derivative of -17489i5 - 114i*3 - 5i + 2869478 wrt i? -349780i*3 -	{ "pile_set_name": "DM Mathematics" }
o*4. 56237o*4 Expand -2790 + 2790 + 19f + f2 - f3 + (7 + 35 - 63)(2f*3 - 5f3 + f3) + 3f - 3f + f*3. 42f3 + f2 + 19f Expand (-2 + x + 1 - 2)(-530x + 5 + 1005x - 593x). -118x*2 + 359x - 15 Expand ((-3 + 4 + 1)(-3t3 + t3 + 4t3) + 20t*3 - 3t*3 + 61t*3)(-37t + 2t - 36t + (5t - 5t - 2t)(-2 - 3 + 3)). -5494t*4 Expand -2t*5 - 6t*4 - 124t + 126t + 5t*4 + (2t*5 - 2t*5 + 2t*5)(62 - 236 + 122). -106t5 - t4 + 2t Expand g - g*3 - g + (-g - g + 0g)(-g + g - 3g*2) + 4g*3 + 2g*3 - 4g*3 + 35g - 25g - 21g*3 + 27g*3. 13g*3 + 10g Expand (-2g - 1 + 1)(2g - 4 + 4) - 38g + 112g2 + 38g + (-5g + 4g + 8g)(3g + 2g - 3g). 122g*2 Expand (42 + 7t - 42 + (-3 + 5 - 1)(-2 - t + 2) - 3t - t + 6t - 5t + 3t + 3t - 16 + 11t + 16)(-2t - t + 2t)(6t*3 + 5t*3 - 2t*3). -180t*5 Expand (d + 0d - 2d)(14d + 15d - 11 - 2d2 - 17d). 2d3 - 12d*2 + 11d Expand (1638u - 8242 + 8242)(-3u + 0u + 2u)(3u - 3u - u). 1638u3 Expand -2l + 7l + 2l + (2 + 0 - 1 - 3l)(-33 - 38 - 28) - 2l + 5l - l. 306l - 99 Expand (4n*4 - 6n4 + n4)(180n + 640n + 969n)(4 - 3 - 3). 3578n*5 Expand (1 - 22 + 7)(-1 + 2 + 1)(3u*2 + 11u*2 + 12u*2). -728u*2 Expand (-6v*2 + 4v*2 + 0v*2)(-1 + 3 - 1) - 58 - 9v2 + 58 + 12v2 + v2 - 45v2 + (1 - 5 - 1)(-3 + 1 + 3v2 + 0). -58v*2 + 10 Expand (-8b - 3b - 10b*4 + 121b*2 - 11b*2 + 11b)(2 - 4b - 2). 40b5 - 440b*3 Expand (2r + 2r - 2r)(-7r + 2r + 3r) + 0r2 - r2 + 3r*2 + 4 - 14r*2 - 4 + (-r + 4r - 5r)(15r - 90r - 111r). 356r*2 Expand (4 + 27 - 1)(-4 - 1 + 4)(-15x*3 - 9x*3 + 54x*3)(7x - 2x + x). -5400x4 Expand -224a*2 - 634a*2 - 195a*2 + (-2a - 2a + 2a)(2a + 0a - 4a) + 0a2 + 3a2 - a2. -1047a2 Expand (7o - 87 + 87)(4o3 - o3 + 0o3 + (0 + 0 + 2o*3)(-2 + 5 - 1)) + (2o + 2o - 2o)(o3 + o3 + 0o3). 53o*4 Expand (1441 + 1357 + 22 + 1719 - 924)(-3y2 + 3y2 - y5). -3615y5 Expand -6g*5 - 6g*5 - 3g*5 + (-3g + 20g - 6g)(-3g*3 + 7g*4 + 3g*3). 62g*5 Expand (3i - 2i + i)(0 + 0 + i)((-3 + 2 - 1)(3260 - 3260 + 486i) + 0i + 3i - i). -1940i*3 Expand (d + 2d - 2d)(-73 - 36d2 + 60d*2 - 26d*2)(-3d - 4d + 6d). 2d*4 + 73d*2 Expand (-48 - 54 + 30)(-8h + 2h - 2h4 + 69h*5 - 70h*5). 72h*5 + 144h*4 + 432h Expand (-7 + 4 + 11)(196 - 55c*2 - 196) + (3c - 3c + c)(-2c + c - c). -442c*2 Expand (54x - 83x + 68x)(-15 - 10x*2 + 26 + 2x - 16). -390x3 + 78x*2 - 195x Expand (2 - 1 - 3)(3w - 5w + w) + (-11 + 399 - 1)(4 - 4 + 2w). 776w Expand (2 - 2s - 2)(-2 - 2 + 3)(-3s + 49159s2 - 49173s*2 + 2s + 12). -28s3 - 2s*2 + 24s Expand (-21 + 13 - 41)(-62c*5 - 36c*5 + 78c5) + c5 + c*5 - 5c*5. 977c*5 Expand (13 + 110 - 13)(-4n + n - 5n + (-4n + 0n + 5n)(5 - 1 - 2)). -660n Expand (1 - 1 - 3n*4)(n + 2n - 2n) - 374n2 + 374n*2 + 3332n5 + n5. 3330n5 Expand (-60 - 54t + 60 + t*5)(-22 + 21 - 23). -24t5 + 1296t Expand -4i2 + 2i*2 + 0i*2 + (-4i + 4 - 4)(-82 - 521 - 64)(9 + 3i - 9). 8002i*2 Expand (51b - 3 + 4b - 28b)(-3b + b + 7b)(6 + 4b - 6). 540b*3 - 60b*2 Expand (-16 + 3 - 19 + ((4 - 2 - 3)(3 - 2 - 3) + 0 + 0 + 1)(-2 - 2 + 2) + 2 - 5 - 3)(0b4 - 2b*4 - 2b*4). 176b*4 Expand (-3798d - 1625d + 622d)(-1 + 3 - 1)(-6 - 1 + 2). 24005d Expand ((-o + 3o - 3o)(-4 + 1 + 1) + 7o - 5o + 9o)(-4o + 2 - 2)(-24o3 + 11 - 11). 1248o*5 Expand -346n*2 + 164n*4 + 240n*4 - 405n*4 + (4n + 2n - 5n)(-5n*3 + 3n*3 + 4n3). n4 - 346n2 Expand (3 + 4 - 5)(-2b - b + 0b) + 4b - 3b + b + 2b - 2b + 3b + (1 + 2 - 4)(-4b + 5b - 3b) - 35b - 28b - 7b. -69b Expand (-43q*2 - 37q*2 + 78q*2)(8q3 - 17q*3 - 4 + 2). 18q*5 + 4q*2 Expand (-2p + p*2 + 2p)(-4 - 2p2 + 4) + p4 + 0p2 + 0p*2 + 0p4 - p4 - 2p4 - 6p*2 - 5p*4 + 17p*2 - 4p*2. -9p*4 + 7p*2 Expand (-2f3 - f3 - 3f3 + (1 - 1 + 2f)(-3 + 3 + 2f*2))(-3f + 2f - 4f + (2f - f + 0f)(-10 + 14 + 14)). -26f4 Expand (3l - 3l - 2l)(l - 4l + l) + l - l + l2 - 1 + 1 + l2 + 4l2 - 6l2 - l2 + 3l + 2l*2 - l + 0l*2 + 2. 5l*2 + 2l + 2 Expand (4u3 - 2u*3 + 0u*3)(-2u + u + 3u) - 89u4 + 537 - 1068 + 533. -85u*4 + 2 Expand (-3f*2 - 3f*2 - 4f*2)(f - f + f*2) + (-2f + 0f + 0f)(-33f*3 - 10f*3 - 5f*3). 86f4 Expand ((-u2 + 1 - 1)(3 + 0 - 1) - 3u*2 + 0u2 + u2)(1060u*2 + 3757u*2 - 127 + 127). -19268u*4 Expand (-k + 3k*2 - 2 - 4k*2 + 3)(22k - 205k + 779k). -596k*3 - 596k*2 + 596k Expand (1 - 1 - 1)(-2652s - 3 - 61s + 3). 2713s Expand (0 + 0 + 5b + b3)((-1 + 1 - 2b)(2 + 0 + 0) + (-5 + 4 + 5)(2b - 3 + 3) - 3b + 5b + 0b). 6b*4 + 30b*2 Expand (-3q + 3q + 3q*2)((1 + 6 - 3)(-4 + 0 + 3) + 2 - 1 - 3 - 3 + 2 + 2 + 94 - 161 + 225). 459q*2 Expand (3i - 2i + 2i)(1178 - 941 - 762)(1 + 0 - 2). 1575i Expand 60212h*3 - 60211h*3 + 71 + 13h*4 - 4h*4 + (-2 + 2h*2 + 2)(3h2 - 2h2 + h2). 13h4 + h3 + 71 Expand ((0 - 1 + 3)(0 + 0 - 1) - 2 - 3 + 2)((z3 + 3z*3 + 2z*3)(-1 + 1 + 3z) + 6z*3 - 6z*4 - 6z*3). -60z*4 Expand (-4q - 3q + 5q)((-1 - 1 + 4)(1 - 1 - 2) + 2 + 23 - 5)(-9q - 3q - 3q). 480q2 Expand 19w*2 + 4w2 + w2 + (0 + 0 + 2w)(-46w + 85w + 3w). 108w*2 Expand -2k + k + 3k - 4k + k + k + (-3 + 0 + 1)(2k - 4k + 0k) + 4k - 4k - k - 7468k - 31960 + 31960. -7465k Expand (1024o - 1431o - 2146o)(-4o + 2 + 2o*3 + 4o). -5106o4 - 5106o Expand (-1100 - 416 + 416 + 158 - 1408)(0a*5 + 8a*5 + 3a*5). -25850a*5 Expand (12296l - 25449l - 8834l)(2 - 2 - 2). 43974l Expand 3r5 + 5r*5 + 8r*5 + (3r3 + r3 - 3r3)(-2r2 - 1 + 1) + 6r*5 - 3r*5 - 2r*5 + (-2r3 + r3 - 5r3)(4r2 - 5r*2 - 5r*2). 51r*5 Expand (6y*4 - 4y*4 + 6y*4)(-26 - 128 + 287)(-3 + 2y + 3). 2128y5 Expand ((-2 + 1 - 1)(-1 + 1 - 1) - 11 + 20 + 20)(-7o - 5 + 5). -217o Expand (-1 + 0 - 1)(-x3 - x3 + 3x3) + (13x + 9x - 3x)(x2 - 2x*2 + 0x*2 - 2 + 2 + 2x*2 + (4 - 4 + 2)(2x2 - 2 + 2) + 0 - 2x*2 + 5 - 7). 55x*3 - 38x Expand 7 - 7 - 9y2 + 3 - y2 - 3 + (0y - 4y + 0y)(0y + 6y - 3y) - 20y2 + 217 - 217. -42y2 Expand (-j2 - 2j2 + j2)(339680 + 13338j3 - 339680). -26676j*5 Expand (144 - 51 + 162)(-p - 3p - 41p). -11475p Expand -f4 + f4 + 4f*4 + (3f - 3f - f)(25000f2 - 312f*3 - 25000f2) - 1 + 1 + f4. 317f4 Expand (-2 + 5 + 0)(-h - 3 + 3) + (-42 + 6h + 18 + 27)(5 - 5 - 3). -21h - 9 Expand (1 - 6 + 1)(-30u3 - 48u*3 + 0u*3). 312u*3 Expand -404t*3 - 65t*3 - 235t*3 - 3t*3 - 2t3 + t3 + (4t + 0t - 6t)(-3t2 + 2t*2 + 0t*2). -706t*3 Expand (-10 + 1 + 1)(-374 - 148 - 29)(4s*4 + 0s*4 - 3s*4). 4408s*4 Expand -14k + 5k4 + 14k + (-2k2 - 2k2 - k2)(-k2 - k2 + 0k*2) + 33 - 13k*4 - 33. 2k*4 Expand (2z2 + z2 - z2 + (-z2 + 5z - 5z)(1 + 7 + 0) - 4z - 6z2 + 4z)(-3z*2 + 3z2 - z2). 12z4 Expand (0w3 + w3 + w*3)(-3w2 + 2w*2 + 3w*2) + (-w + 3w - 4w)(-11490w4 - 5242w*4 + 6460w*4). 20548w*5 Expand (3f3 - f3 - f*3)(3 - 8f + 144f + 5 - 4). 136f4 + 4f*3 Expand (-3 + 2 - 1)(0o2 + 0o*2 + 2o*3) + 0o*3 + 4o*3 - 2o*3 + 2 + 3o*3 - 2 + (-3o + 4o + 0o)(o2 + 2 - 2) + 56o*3 + 6o*3 + 15o*3. 79o*3 Expand (20w - 8 + 8)(-815w - 812w - 839w + 2493w - 27). 540w*2 - 540w Expand (-8254 + 9083 - 17934)(-4b*5 + 5b*5 - 3b*5). 34210b*5 Expand (-1 - 1 + 3)(2v2 + 0v2 - v2) + 0v2 - 53062v - 2v2 + 53060v. -v*2 - 2v Expand (-1 - y*2 + 1)(-5y2 + 3y*2 + 3y*2) + 111y*4 - 4004833 - 7y*2 + 4004833. 110y*4 - 7y*2 Expand 1 - 1 - 7d + (5d + 24d - 14d)(1 + 2 + 7). 143d Expand (4l*3 - 2l*5 - 4l*3)(7 - 9 + 4 + (-2 - 1 + 4)(-4 + 6 - 9) - 1 - 5 + 1). 20l*5 Expand (6 - 20q - 2 - 6)(23q + 270 - 270) + 2 + 2	{ "pile_set_name": "DM Mathematics" }
(i) = -2 - 1851782i - 1181550i - 2. Let g be (2/4 - 0)6. Let u be c(g). What is u rounded to the nearest 1000000? -9000000 Let m = 32 + -31.9951. What is m rounded to 3 dps? 0.005 Let d(q) = q2 + q2 + 1 + q3 + 0q*3 - 2q. Let o be d(-2). What is o rounded to the nearest integer? 5 Let p = -80 + 9. Let w = p - -70.9909. Round w to three dps. -0.009 Let h = -2 - 10.2. Let d = h + 13.97. Let n = 1.7699913 - d. Round n to six dps. -0.000009 Let v(g) = 81g2 - 20g - 16. Let s be v(16). Round s to the nearest 1000. 20000 Let n = -0.1628 + 0.17. Round n to three dps. 0.007 Let v = 233221486289.1 - 233221380078.1939929. Let d = v - 106211. Let p = -0.094 - d. Round p to 6 dps. -0.000007 Let m = 1.030216 - 0.94021. Let g = m + -0.09. Round g to five decimal places. 0.00001 Let s = -5 - -4.5. Let v = 0.50000095 + s. Round v to seven decimal places. 0.000001 Let m = 0.16 + -0.1649. Round m to 3 decimal places. -0.005 Let h = 1071.5 - 1073.4012. Let w = -1.9 - h. Round w to 4 dps. 0.0012 Let j = -319.0203 + 319. What is j rounded to 3 decimal places? -0.02 Let l = -3 - -2.6. Let h = 0.39999904 + l. What is h rounded to seven dps? -0.000001 Let d = 3.1 + -3.09848. What is d rounded to four decimal places? 0.0015 Suppose -4f = -f - 360000. Round f to the nearest 100000. 100000 Let t(u) = -112u*2 + 8u - 6. Let j(n) = 223n2 - 16n + 11. Let k(x) = -3j(x) - 7t(x). Let h be k(-7). What is h rounded to the nearest 1000? 6000 Let z = -0.081 - -0.044. Round z to 2 dps. -0.04 Let n = 10.21 + 36.49. Let q = -36 + n. Let y = -12 + q. Round y to 0 decimal places. -1 Let h = -0.1 - -0.058. What is h rounded to 2 decimal places? -0.04 Let i = 5.3 - 72.3. Let s = i - -45. Let q = 21.99945 + s. What is q rounded to 4 dps? -0.0006 Let a = 7781.84418 - 7773.84417982. Let g = -8 + a. What is g rounded to seven decimal places? 0.0000002 Suppose -56 = -5j - 2a, 5a - 35 = j - 3j. Let d = j - 8. Suppose -dx = -7x - 8600000. Round x to the nearest one hundred thousand. -1700000 Let t = 230.59 - 232. Round t to one decimal place. -1.4 Let b(z) = z*3 - 5z*2 - 5z + 2. Let d be b(6). What is d rounded to the nearest ten? 10 Let v = 8.500397 + -8.5. Round v to 4 decimal places. 0.0004 Let k = -0.7509188 + 305.7648188. Let m = k - 305. Round m to 3 decimal places. 0.014 Let s = 3.617 - -0.243. Let r = 3.3 - s. Round r to 1 decimal place. -0.6 Let d = -1.81 + -0.19. Let h = d - -11.6. Round h to the nearest integer. 10 Let h = 65 - 65.106. Let f = -0.11 - h. Round f to 3 decimal places. -0.004 Let d = 5010 - 4586.4. Let l = -352 + d. Let z = -78 + l. What is z rounded to 0 decimal places? -6 Let k = -52.23771955457 + 24852765.23830955457. Let f = k + -24852570. Let v = f - 143. Round v to four dps. 0.0006 Let h = 0.13 - 0.206. Let x = h - -0.137. Round x to 2 dps. 0.06 Let u be (-16500)/((-4)/((-480)/(-9))). Let j be u/(-2)(0 + -10). Round j to the nearest 1000000. 1000000 Let f = 0.052 - 0.051929. Round f to 5 dps. 0.00007 Let c(v) = v - 3. Let g be c(7). Suppose 4 = -gt - 5b, 3t + t = 3b + 28. Suppose d + 126 = td. Round d to the nearest ten. 40 Suppose -5r + 8r = 438. Round r to the nearest 10. 150 Let a = -1637 + 1638.907. Let t = a - 2.01. Let o = -7.003 - t. Round o to 0 decimal places. -7 Let v = 50.7 - 47. What is v rounded to zero decimal places? 4 Let u be (-4)/6 - (-214)/6. Suppose -3l = -4l + u. Round l to the nearest ten. 40 Suppose 7z - 3z = 35200000. Suppose 4v - z = -0v. What is v rounded to the nearest one hundred thousand? 2200000 Let z = -3 + 3. Suppose z = -0k + 4k - 12. Let l(f) = -1544445f2 + f + 2. Let p be l(k). Round p to the nearest 1000000. -14000000 Let m = 0.07 + -0.37. Let l = 102 + -97.9. Let n = m - l. What is n rounded to the nearest integer? -4 Let j = -39 - -37.88. Let x = j + 48.12. Let f = -46.999942 + x. What is f rounded to five decimal places? 0.00006 Suppose 2c - 4c = -54. Let q(l) = 3l + 15l2 - 6l*2 + cl*2 - 3. Let d be q(3). Round d to the nearest one hundred. 300 Let r = 6.65 + -7. Let j = -0.1 - r. Let f = -0.24922 + j. Round f to four decimal places. 0.0008 Let r = 19916848450 - 19916840263.349999. Let v = r - 8186.7. Let t = v - -0.05. What is t rounded to five dps? 0 Let x(a) = 10a - 5. Suppose -2y + 12 = -5y. Let u be x(y). Round u to the nearest ten. -50 Suppose y + 0y - 3 = 0. Suppose -12 = yc + 4a, 3a + 9 = -2c - 0. Let j be -1(2 + c - 2). What is j rounded to 7 decimal places? 0 Suppose j + 3j - 760 = -5i, 0 = -5i. What is j rounded to the nearest 100? 200 Let s = -30946.928 - -30938.9564852. Let k = s + 5.67151521. Let r = 2.3 + k. Round r to 7 dps. 0.0000004 Let w = 74 + -73.99815. Round w to four decimal places. 0.0019 Let o = 6 + -6.1. Let p = 0.4 - o. Let z = p - 0. Round z to 0 decimal places. 1 Suppose 4k = -11 + 27. Suppose 2v + 0v = 8, 0 = kq + v. Let f be (-123)/(-2)374 + q. What is f rounded to the nearest 10000? 20000 Let w = 2.3 - 2.384. Let g = w + 46.084. Let i = -44.84 + g. What is i rounded to 1 dp? 1.2 Let d(u) = -107u3 - 4u*2 + 5u. Suppose 0o = -3o + 24. Let t be d(o). Round t to the nearest 10000. -60000 Let r(y) be the third derivative of -y*2 + 1/6y*3 - 1367/40y*6 + 0 + 0y*4 + 0y - 1/30y5. Let s be r(-1). Round s to the nearest one thousand. 4000 Let y = -22 + -31. Let n = -462.1 + 515.56. Let d = y + n. Round d to one decimal place. 0.5 Suppose -3r + 7731 = 33831. Round r to the nearest 1000. -9000 Let w = 4.5 - 4. Let y = 1.89 - 1.6. Let o = y - w. What is o rounded to one decimal place? -0.2 Suppose 0 = r + r - u + 198, -3r = 2u + 311. Let a = r - -44. Round a to the nearest ten. -60 Let t(b) = b + 5b - 5b + 0 + 6. Let c be t(-6). What is c rounded to 2 decimal places? 0 Let c be 4 + -7 + (-1)/(-1). Let g be -11000000 + c/(-8)0. Round g to the nearest 1000000. -11000000 Let z = 323 + -103. What is z rounded to the nearest 100? 200 Let a(p) be the second derivative of -9/2p*2 + 0 + 3p + 2/3p3. Let q be a(7). What is q rounded to the nearest 10? 20 Let l = 3.69 + -0.19. What is l rounded to the nearest integer? 4 Suppose -3w + 4w - 2 = 0. Suppose -7a + 5l = -3a - 25, wa - 10 = 2l. Let s be 1 - 180002/2 - a. Round s to the nearest 10000. -90000 Suppose -t + 20700 = 8t. Round t to the nearest 1000. 2000 Let t = 391 - -1409. What is t rounded to the nearest 1000? 2000 Suppose 0 = 3d + 12, 6f = 2f + d + 12. Suppose -fi = -i. Suppose b + 7322 + 678 = i. What is b rounded to the nearest ten thousand? -10000 Suppose 7310 = 4z - z + y, -4z = 5y - 9765. Let o = z - 1295. Round o to the nearest 100. 1100 Suppose 0 = -k + 2k - 3d, 0 = -5k + 2d + 26. Let q(a) = 8a - 6a - 12a. Let t be q(k). Round t to the nearest 10. -60 Let d = 0.3 - 1.9. Let t = 9.6 + d. Let f = 8.36 - t. Round f to 1 dp. 0.4 Let z = -32 - -28.4. Let m = z + -14.4. Let r = m - -16.6. What is r rounded to the nearest integer? -1 Let t = -0.35062 - -0.35. Round t to 4 dps. -0.0006 Let y = -0.33 - -33.33. Let m = 1240647.2 + -1240680.200108. Let t = m + y. Round t to 5 decimal places. -0.00011 Let l = -2350.501 - -2348.851131. Let c = 1.65 + l. What is c rounded to 5 dps? 0.00013 Let j = 0.3 + 0. Let p = j - 0.30000058. What is p rounded to 7 dps? -0.0000006 Let z = -0.06 - -7.06. Let d = 7.3 - z. Let s = 1.1 - d. What is s rounded to 1 decimal place? 0.8 Suppose 0a + 4500000 = a. What is a rounded to the nearest 1000000? 5000000 Let s = -38125876 - -38125876.90000045. Let b = s + -0.9. Round b to seven dps. 0.0000005 Let y = 0.570563 - 0.0405653. Let t = y + -0.53. Round t to six decimal places. -0.000002 Let f = -7 - -11. Suppose -2s = -f - 2. Let a be (0 - 12875)(s + -83). What is a rounded to the nearest one hundred thousand? 1000000 Let r = -0.0549 - 427.9451. Let z = -476.6 - r. Let f = -59 - z. Round f to the nearest integer. -10 Let l = -28 + 28.00072. What is l rounded to 4 decimal places? 0.0007 Let n = -1.13 - -134.13. Let z = n - 133.87. What is z rounded to one decimal place? -0.9 Let x = 4 - 1. Suppose 0 = -0n + xn + 93. Let z be -1 - (n*229 + -2). What is z rounded to the nearest 1000? 7000 Let b = -17 + 15.7. Let g = b - 0.9. Round g to zero decimal places. -2 Let d = -3.4896 - 0.0204. Round d to one de	{ "pile_set_name": "DM Mathematics" }
ch is the fourth biggest value? (a) j (b) 0.3 (c) -1 (d) h c Let f = 1896.7 - 2009. Let b = f + 105. Let r = b - -7. What is the fourth smallest value in r, -2/5, 5, -5? 5 Let f = -203.27 + 0.27. Let n = 202 + f. Which is the second biggest value? (a) 2 (b) 18 (c) n a Let d(n) = n*3 + 4n*2 - 6n. Let w be d(-5). Let q = 409/6314 - -3/451. What is the third smallest value in -2/5, 1/2, w, q? 1/2 Let l = 15554 - 15553.8. Which is the biggest value? (a) l (b) 0.5 (c) 0.1 (d) 0.06 (e) -0.1 b Let g = -0.423 + -274.577. Let i = g + 274. Which is the smallest value? (a) -2/9 (b) i (c) -2/17 (d) -3 d Let q = 13 - 17. Let h be 4(4 + 8982/(-84)). Let v = -412 - h. Which is the second biggest value? (a) 7 (b) q (c) v c Let x be ((-280)/245)/(22/14). What is the third biggest value in x, 5, -6? -6 Let w = -9.94 - -10.4. Let m = w + -0.46. What is the fourth smallest value in -0.07, m, -5, -5/6? m Let r(t) = 3t*2 + 6t - 22. Let z be r(-12). Let y be z/(-156) - (1 - 3 - 1). Let k = 0.2 - 0.6. Which is the second biggest value? (a) 2 (b) k (c) y c Let j = -45347/4 + 4128185/364. Let p = 17594/7 + -2518. Let y = j + p. What is the third biggest value in y, 1, 5/4? y Let z(v) = v*3 + 10v*2 - 51v - 327. Let x be z(-12). What is the second biggest value in 0.8, -0.07, x, -0.5? -0.07 Let u = -0.083 - -0.583. Let s = 36 + -31. What is the fourth biggest value in 0.4, 4, s, u? 0.4 Suppose 0 = t + 2t - 15. Let x = -37.294 - -34.294. Which is the second biggest value? (a) -2 (b) x (c) t a Let s = 5005 + -5005. Which is the third smallest value? (a) 2.1 (b) -3 (c) -0.2 (d) s d Let s = 6.2551 + -6.23. Let r = s + -0.3251. What is the third smallest value in r, 5/6, 8? 8 Let g be ((-3)/66)/((-23)/((-759)/(-6))). Which is the fifth smallest value? (a) 36 (b) g (c) 2/17 (d) 1/3 (e) 0 a Let w = -29.78 + 29.79. Which is the smallest value? (a) -2/19 (b) w (c) -2 (d) 223 (e) 2 c Let y = 1.375 - 51.375. Let g = 1 - -4. Which is the second biggest value? (a) -2 (b) g (c) y (d) -2/15 d Let y = -3.89 + -0.11. Let w = 0.0955 - 0.3955. Let u = 165.4 - 165. What is the biggest value in u, w, y, 1? 1 Let m be ((-28)/84)/((-2)/(-276)). Let v = m + 48. Let u = 3.9 + 1.1. Which is the second smallest value? (a) -0.1 (b) u (c) v c Let o = -6 + 13. Let f = o - -4. Let m = 483 + -488. Which is the biggest value? (a) 0 (b) f (c) m (d) 0.5 b Let j(b) = b - 1. Suppose -4x + 3a + 10 = -0x, 5x - 5a = 15. Let o be j(x). Let w = 45 + -38. What is the third biggest value in -0.2, o, w, -2? -0.2 Let r be ((-10)/6)/56. Let c be (((-12)/96)/(2/8))/(56/(-16)). What is the fourth biggest value in r, c, -0.4, 1.8? r Let s = -404.2 - -10.2. Let v = s + 389. What is the second smallest value in 0.5, 2/17, v? 2/17 Let y = -1112 + 1131. Let w = -4 + 45. Let k = -163/4 + w. Which is the third biggest value? (a) k (b) 2 (c) y a Let r(u) = -u3 + 212u*2 - 1237u + 8. Let i be r(6). Suppose 4v - 122 = -3s, 5s + 42 = -v + 2v. Which is the smallest value? (a) -0.4 (b) v (c) i a Let v = 23.629 - 23.229. Which is the smallest value? (a) -2/3 (b) v (c) -560 (d) -2 c Let b = 1846 - 1848. What is the biggest value in b, -1, 0? 0 Let i be (-4)/(-28)40/(-460). Which is the second smallest value? (a) 4 (b) 0.2 (c) i (d) 24 b Let z = -0.1982 - -0.6982. Let i be 1/191-2. What is the smallest value in z, 3, i, 4? i Let i = 0.3 - -0.2. Let s = -754 - -748. What is the second smallest value in s, i, 0.3? 0.3 Let c = 18 + -17.3. Let v be (-6 + 1)(-88)/10 - 3. Suppose -vq + 44q = -9. What is the biggest value in c, -3/2, q, -0.1? c Let x = -0.53 - -0.56. What is the third smallest value in 13/3, x, -5? 13/3 Let a = 0.18105 + -10.18105. What is the second smallest value in 1/2, a, -7, -17? a Let p = 1335 + -73427/55. Let d = -20213 + 20213.4. What is the third smallest value in p, d, -5? d Let b = 0.46 + -0.06. Let h = -0.063 - 92.937. Let s = h - -96. What is the second smallest value in b, s, 2/7, -2? 2/7 Let q = -2 + -3. Suppose 0 = -2t - 4s + 10, 0 = -3t - 3s + 5 + 1. Let u = 475 + -473. Which is the third biggest value? (a) q (b) u (c) t a Let v = -12 + 15. Let g be 12/(-24) + (-89)/(-2). Suppose 0 = 24q - 28q - g. Which is the second biggest value? (a) 1/2 (b) v (c) q a Let w = 20 - 17. Let m(x) = x*3 - 4x*2 + x + 1. Let k be m(4). Let z = -83.8 + 84. Which is the third smallest value? (a) 0 (b) w (c) z (d) k b Let d = -0.0875 - 0.4125. Which is the second smallest value? (a) d (b) 61 (c) 1 c Let h = -3269 - -3265. What is the biggest value in h, -0.177, -7? -0.177 Let s = -15720 + 15719.8. Let g(j) = -6j + 1. Let z be g(2). What is the second smallest value in s, z, 3/4? s Let f = -1/224 + -111/224. What is the third biggest value in 14, f, -83? -83 Suppose s + 5n - 51 = 0, 4s - 5n - 87 - 42 = 0. Suppose 3a = -h - 22 + s, h = 4a - 14. What is the biggest value in h, -0.3, 2/3? h Let l = -35.7 - 2.3. Let y = 133/17 + -1047/136. What is the biggest value in y, -0.4, l? y Let f(d) = 3d*3 - 46d*2 - 32d + 12. Let x be f(16). What is the fourth biggest value in 0.1, -3/7, 0.13, x, -1/2? -3/7 Let r(l) = 7l2 - 53l + 24. Let v be r(7). Which is the biggest value? (a) 0.02 (b) 4/13 (c) 0.5 (d) v c Suppose -3o + d - 22 = 0, 3d = -4o + 100 - 99. What is the fifth smallest value in -1, -6/7, o, 0, 2? 2 Let w = -433.47 - -438. Let f = -1.53 + w. Which is the second smallest value? (a) f (b) -2/19 (c) -3/5 (d) 1 b Suppose -47l + 37l - 3500 = 0. Let y be ((-4)/6)/(l/150). Let n = 5.3 + -0.3. Which is the second smallest value? (a) n (b) -0.1 (c) y c Let s = 122 - 5. Let f = 309 - s. Let p be (-21/(-16))/((-32)/f). Which is the second biggest value? (a) 0.4 (b) p (c) -0.1 c Let y be (13/11 + -1)/((-2226)/(-8162)). Which is the fourth biggest value? (a) 0.3 (b) y (c) -44/7 (d) -0.1 c Let f = -297 - -102. Let z = 195 + f. What is the smallest value in 26/5, z, 3/8? z Let v = -0.8776 + 26.8776. What is the second biggest value in v, 4, 1/50? 4 Let w = 0.5172 + 258.4828. Which is the biggest value? (a) -0.3 (b) w (c) 2/19 (d) 2 b Let q be (-352)/(-33) - 4 - 3 - 3. Which is the third smallest value? (a) q (b) 0 (c) -0.6 (d) 1/5 d Let g = -20955 - -21486. What is the second biggest value in -2, -5, g, -4? -2 Let s = 6/1753 - 19301/5259. Which is the fourth biggest value? (a) -4 (b) 0.3 (c) -5/3 (d) s a Let y = 571 + -574. What is the fifth biggest value in 0.2, y, 0.3, -26, -15? -26 Let d = 2.29 + -2.4. Suppose -14 = -4v + 5x, -2v - 5065x = -5060x + 38. What is the third biggest value in -0.2, 1, v, d? -0.2 Let l(u) = u3 - 9u*2 - 21u - 5. Let t = 39 + -28. Let q be l(t). Let s be 9/(-6)8/q. What is the second smallest value in -0.4, s, 9? -0.4 Let a = 3771.3 - 3770. What is the second biggest value in a, -1/6, -3/5, -0.4? -1/6 Let d = 0.5 + -2.5. Let k = -0.0415 - -23.9415. Let a = k + -23.9. What is the biggest value in a, -25, d? a Let r = -310 - -4032/13. Let g = -0.15 + 0.1. Let k = -0.45 - g. Which is the smallest value? (a) r (b) k (c) 0 b Let q = 201.2625 - 201. Let v = -0.0375 - q. Which is the biggest value? (a) -0.13 (b) v (c) 0.5 c Let u be ((-200)/(-20))/(1/38). Let r be -4 + (u/45)/2. Which is the second biggest value? (a) r (b) 2 (c) -6 (d) -3/5 a Let v = 5.559 - -0.361. Let x = -852.92 + 853. Let t = x + v. What is the smallest value in -2, t, 4? -2 Let j = 7.02 + -0.02. Let h = 81.83 - 78.83. What is the smallest value in h, 23, 5, j? h Let p = -71.1819 + 0.1819. What is the biggest value in 0.11, p, 2? 2 Let u = -3197 + 47957/15. What is the biggest value in u, -346, 4, 2? 4 Let g = -0.06 - 3.94. Let k = -24323 + 24322. What is the smallest value in -5, k, g, -2/5? -5 Let g = -187/4 - -2423/52. Let n = 1521 + -13691/9. What is the third biggest value in g, -1.2, n? -1.2 Let y = -1.97 + -0.03. Let q = -1502079 + 1502079. Which is the fourth biggest value? (a) -11 (b) q (c) y (d) 4 a Let r = -220.41 - -6.41. Let y = r + 241. Which is the biggest value? (a) 2/19 (b) -4 (c) y c Suppose 0c = -3c + 15. Suppose -y + cs - 50 = 4y, -y - 3s = -10. Let r be (-2)/12 - (-28)/56. What is the second smallest value in 4, r, y? r Let u(w) =	{ "pile_set_name": "DM Mathematics" }
- 52392. Is z prime? True Let v = 1801904 - 1261269. Is v a prime number? False Suppose 6 = 7l - 8. Suppose -6 = -4s + s - 3d, -7 = -ls - d. Suppose -sc + 4139 = 204. Is c a prime number? True Is (-6)/1 - (-263841 - -11)/14 composite? False Let o(j) be the second derivative of j4/12 - 7j*3/6 + 4063j*2/2 - 111j. Is o(0) prime? False Let b(h) = -4h3 + 24h*2 + 29h + 1726. Is b(-35) prime? True Let u be (419 - (0 - 1))/((-30)/(-20)). Suppose l + 2l - 747 = 0. Let d = u + l. Is d composite? True Let s be (-14)/(-4) + 3/6. Suppose f + 3r = 4f - 17253, -5771 = -f - sr. Is f a prime number? False Suppose 1922571 = 45p + 118491 + 26625. Is p prime? True Let c = -17345 - -32568. Is c a composite number? True Let w = 325892 - -62207. Is w a prime number? True Suppose 20u = 30222 + 3218. Suppose -2c + 3162 = -u. Is c a prime number? True Let k(j) = j3 + 4j*2 - 3j - 9. Let q be k(-4). Suppose -5b - 5286 = -2s, 2s - qb - 5270 = -2b. Is s a composite number? False Suppose 2t = -8o + 3o + 772438, -2t + 2o + 772438 = 0. Is t composite? False Suppose 3v = -k + 1721, -4k - 5v = 987 - 7899. Is k prime? True Let a = -17135 + 18048. Is a a composite number? True Let x = -2763 - 1385. Let v = x + 6453. Is v a composite number? True Let o = 190 - 186. Suppose ou - 7u = -9, 0 = 5j + 2u - 23921. Is j a prime number? True Suppose -64k + 28k - 41k = -42017437. Is k composite? True Is 1386/20602 - (-16)/40 composite? False Suppose 74r - 71r = 0. Suppose 3 = 3p - rp, 5p = 5c. Is ((-25)/(-10) + -3)(-1501 - c) composite? False Let q be 2/1 + -4 + 4. Let z(j) = 1541j - 11. Is z(q) a composite number? True Suppose -5n = -3n - 2. Let d(z) be the second derivative of 485z*3/6 - 1575z. Is d(n) a composite number? True Let c(a) = 117a + 53. Suppose 4h = -2d + 10, 5d - 7d + 4h = -42. Is c(d) a composite number? True Let j(o) = 1966o2 + 26o - 323. Is j(18) a composite number? False Suppose -i + 7 = 2z, 2i + 2z - 14 - 6 = 0. Let m(u) = -u2 + 14u - 17. Let g be m(i). Is 1/g + -29384/(-32) composite? False Let n be ((-140)/(-8))/(-7)(-3 - -9). Let j = 118 - n. Is j a composite number? True Suppose -3f + z = -955100, f - 6z - 24190 = 294171. Is f a prime number? False Let y(f) = -200f + 15. Let q be y(-14). Suppose 0 = l + 5w - 925 - 9, 0 = -3l - 2w + q. Is l a prime number? False Let s(h) = h*2 - 9h - 8. Suppose m - 42 = -4b, -5b - 2m + 30 = -24. Let z be s(b). Suppose j - 3k + 514 = 5j, -3j = zk - 385. Is j a composite number? False Let x = 72 - 68. Suppose -xq - 4h = 0, q - 5h - 30 = -4q. Suppose -qw + 1357 = -764. Is w prime? False Let s(x) = -553x + 1447715. Is s(0) a prime number? False Suppose 41 = 5n + 11. Suppose -12v + n = -9v. Suppose vc = -2c + 136. Is c a composite number? True Suppose -b - 2w = -1437, 2w + 2w + 7241 = 5b. Suppose -r - d = -5d - b, d - 5 = 0. Suppose 4m - r = -m. Is m prime? True Let l(c) = -4c2 - c2 - c3 - c + 0c + 3c2. Let r be l(-2). Suppose h + 1893 = 4s + 6h, -3s + rh + 1391 = 0. Is s prime? True Let m be (-10)/(-4)(-25 + 27). Let b(w) = 30w2 - 13w + 6. Is b(m) a composite number? False Let a be (20023/(-3))/((-70)/210). Suppose -3j = -x + a, x + 3j = 7j + 20021. Is x a prime number? True Suppose 3j = -0r - 2r + 3425, -2r + 3428 = 4j. Suppose z = 5i + r, -3z - 5i + 5224 = -0z. Is z a composite number? False Let x(r) be the first derivative of 3r - 23 - 1/2r*2 + 95/3r*3. Is x(-4) prime? False Let x be (-18)/(-15)(-50)/(-15). Suppose -10n - x = -14n. Suppose 4 = -y - n, -y = 4z - 2519. Is z a composite number? False Let o be (-48)/(-40)(-110)/3. Let r be 0 + (-478096)/o + (-4)/(-22). Suppose r = -0h + 6h. Is h prime? True Suppose -2m + 10 = 3m. Suppose -2v + 5s = 0, -v - 5s - 4s + 4s = 0. Suppose v = mu - 7u + 335. Is u prime? True Let t(p) = p3 + 8p*2 + 2p + 16. Let k(z) = -7z2 + 4z + 3. Let s be k(-1). Let f be t(s). Is (1 - 0)(2843 + f) a prime number? True Suppose -38o = -490o + 268789484. Is o a composite number? False Suppose 8z = 19781 - 517. Suppose -405f - z = -407f. Suppose 13v + 125 - f = 0. Is v a prime number? True Let y(o) = 14o*3 + 2o*2 + 16o - 13. Let u = 247 - 239. Is y(u) a prime number? True Let b(z) = -z*3 - 12z*2 - z + 27. Let d be b(-13). Let f be 1(d + -4)/5. Suppose 0 = -fm + 32m + 5067. Is m a composite number? False Suppose 6t + t - 209382 = t. Is t prime? True Let f be (((-224)/49)/(-4))/(2/14). Suppose -5c - 3v + 4460 = -fv, -c + 5v + 880 = 0. Is c composite? True Suppose -19y + 856 = -15y. Let h = y + -27. Is h a composite number? True Let s = 98 - 102. Let c be (-21)/9(-7 - s). Is 5 + c/(7/902) prime? True Suppose 4r - 5f + 501281 = 2410014, 5f - 1431506 = -3r. Is r a prime number? False Suppose 28l - 62 = -342. Let t = -987 + 2603. Is (-4)/(-10) - (t/l + -1) a prime number? True Suppose -104024 = -6s - 3296. Suppose 12u + 0u = s. Is u prime? True Let i(w) = 16w3 - 3w*2 + 2w - 2. Let h be i(2). Let x = 255 - h. Let u = x + -90. Is u a prime number? True Suppose -15203 = -i - 3z, -4i + 40z = 41z - 60834. Is i a prime number? False Let x be 1380/170 - 2/17. Suppose -xi + 56528 = -46904. Is i a composite number? True Suppose -2s - 4d + 3d = -4829, 2d + 12059 = 5s. Let t = s + -1659. Let w = t - -3573. Is w a composite number? False Let k(w) = 86w + 14 + 8 - 23. Let t be k(4). Suppose t = 4o - 1229. Is o composite? True Let k(h) = -2 - 7h2 + h3 + h - 3h + 2h. Let u be k(7). Let y(o) = -40o*3 + 2o*2 - 2o - 1. Is y(u) prime? True Let d = -496 - -504. Suppose -dc + 18750 = -3c - 5q, -15 = 5q. Is c a prime number? False Suppose 39n + 1588 = 38n. Let b = n - -2427. Is b a composite number? False Suppose -5z - 17z - 335403 = -31z. Is z prime? False Let c(a) be the first derivative of -93a2 - a - 110. Is c(-3) prime? True Let c(w) be the third derivative of w6/120 + w5/15 - w4/4 - 2w3/3 - 6w*2. Let m be c(-5). Is -901(-3 + 2)m/1 prime? False Suppose 20k + 124245 = 29k. Suppose 24g - 46757 + k = 0. Is g a composite number? False Suppose -11g = -5g - 72. Suppose 0 = r - 9 - g. Suppose 20n + 317 = rn. Is n prime? True Let k(p) = -1589p + 53. Is k(-6) a prime number? True Let x be 4(5 + -3 + -1). Suppose -xa - 32 = -348. Suppose -2u + 27 + a = 0. Is u a composite number? False Suppose -4a + 5 + 67 = -4k, 4a - 57 = -k. Let u(q) = 6q*2 - 30q - 26. Let h(t) = 7t2 - 32t - 25. Let b(y) = 5h(y) - 6u(y). Is b(a) prime? False Let s = -13795 - -283502. Is s prime? False Is -3 + (-3792(-700)/21 - 4) a composite number? True Let x(r) = r3 + 16r*2 + 9r + 31. Let t be -14 + ((-1)/3)/(6/18). Is x(t) a composite number? True Let q be -67 - (-7 - (0 - 3)). Let z be 4/(-14) - 18/q. Suppose -2x + 290 + 1808 = z. Is x a prime number? True Is (-4 - (-24)/(3 + -9)) + 53155 prime? True Suppose -9s - 2s + 192967 = 6s. Is s prime? True Let t = 210780 + -149357. Is t a composite number? True Let t be 1252/36 + (-4)/54-3. Let w = 37 - t. Is -1w(-1)/(-2) - -292 a composite number? True Suppose 115104 = 17x - 13x - w, -86311 = -3x + 5w. Is x prime? False Let x(p) = -p3 + 2p*2 - 2. Let b be x(2). Let a be (-1)/b2456/(-2). Let m = -31 - a. Is m a prime number? False Let a be (211 - -2) + (-1 - 6). Suppose -24970 = -216w + aw. Is w a prime number? False Let i(c) = -37c3 + 3c*2 + 59c - 4. Let b be i(-7). Let g = b + -8762. Is g a composite number? False Let d = 106 + -101. Suppose 4m = -dw + 9174, -m + 4m = 4w + 6865. Is m a prime number? False Let j(k) = -7660k - 2693. Is j(-7) prime? False Let q = 687 + -4633. Is q(-2)/1 - -13 a prime number? False Suppose -39m = -34m + 13880. Suppose -596 = -2j - 4334. Let i = j - m. Is i a composite number? False Suppose 981s - 980s = -6, 2s - 4715 = -r. Is r a composite number? True Suppose 976656 = 75z - 9981530 - 2624539. Is z a composite number? True Let x be 62/8 - (38/8 + -5). Let d(f) = f*3 - 11f*2 + 24f - 4. Let j be d(x). Is 35312/(-12)3/j a prime number? True Suppose 0 = -47d + 25d + 32d - 2777090. Is d prime? False Suppose 6c + 2o - 1356510 = -194606, -2c - 3o = -387313. Is c a pr	{ "pile_set_name": "DM Mathematics" }
sest to 0.3? (a) 0.3 (b) -315 (c) 158 a What is the closest to -91 in 63, 5, -0.5, 6? -0.5 Which is the nearest to 45? (a) -0.3 (b) -0.5 (c) -0.57 a What is the nearest to 1/3 in 16, -2753, -0.1, 2, 1? -0.1 Which is the nearest to -0.02? (a) -2/11 (b) 1 (c) -1.3 (d) 4 (e) 3 a Which is the nearest to 6897/2? (a) 5 (b) 5/6 (c) 0.1 (d) 2/31 a Which is the nearest to -3? (a) -4/31 (b) -3 (c) 0.3 (d) -0.36 b What is the closest to -5483 in 2/7, -1/2, 1, -2/7, -7? -7 What is the nearest to -2/7 in 3/8, -20, 0.3, 7? 0.3 Which is the nearest to -1.5? (a) 4 (b) 0.2 (c) -334 b What is the nearest to 2 in -2, -452, 1, 2? 2 What is the nearest to 0.1 in 0.02, 0.6, -2, 1/195? 0.02 What is the nearest to -9 in 0.04, -50, -5, -83? -5 Which is the nearest to 0? (a) 5/3 (b) -3/2 (c) 0.94 (d) 0 (e) -2 d Which is the nearest to 2? (a) 0 (b) 7 (c) -489 (d) -2/7 (e) -5 a What is the closest to -3 in 22027, -5, 0.5? -5 Which is the nearest to 2/23? (a) 0.2 (b) -6 (c) 0.11 (d) 1/6 (e) -1/5 c Which is the closest to 1? (a) -1 (b) -79 (c) -2/13 (d) 12 (e) -2 c Which is the nearest to 5? (a) -4/5 (b) -0.5 (c) -0.2 (d) 3 (e) -34/9 d What is the closest to -8 in 219.36, -7, -2? -7 What is the closest to -32 in -0.2, 5, -3071, -5? -5 What is the nearest to -0.073 in 5, 0.08, -7? 0.08 What is the nearest to -2 in 1, -3/7, 61, 929? -3/7 Which is the closest to -2? (a) 0.5 (b) -3/4 (c) 1 (d) -1/16796 b What is the nearest to 155 in -5, -0.2, 2/13, 0.1, -3? 2/13 What is the closest to -2 in -5, 0.3, 1/5, 9, 135? 1/5 Which is the closest to -3/2? (a) -2 (b) 0.2 (c) -287 (d) 4 (e) 8 a Which is the nearest to 2/5? (a) 2 (b) 2/33 (c) 0.3 c Which is the nearest to 2/3? (a) 43 (b) 1/6 (c) -2/9 (d) 14 b What is the closest to -0.3 in -791, 1/8, 62? 1/8 Which is the nearest to -3/5? (a) -0.1 (b) 2 (c) 1.2 (d) -5 (e) -25 a Which is the closest to -0.1? (a) 2 (b) -2 (c) -49127 b Which is the nearest to 1.12? (a) 0.3 (b) 5 (c) -14 (d) 4 a What is the closest to -52.9 in 2/11, 4, -2/15, -2/7, 3? -2/7 Which is the closest to 0.3? (a) -5 (b) -16 (c) -18/7 c What is the nearest to 21 in -24, -5, 0? 0 Which is the nearest to -15? (a) 23 (b) 0.5 (c) 57 b Which is the closest to 10/33? (a) 0.03 (b) -1 (c) 0.2 (d) 39 c What is the nearest to 0.1 in 0.5, -3, -19383, -5, 0.3? 0.3 What is the nearest to -1 in 0.1, 7, 1.41? 0.1 What is the closest to -15/7 in -4, -2, 26, -1? -2 Which is the nearest to 0.11? (a) 4 (b) -2 (c) 63 b Which is the closest to -212? (a) 0.4 (b) 1 (c) 3 (d) -4 d Which is the nearest to -2/3? (a) 0.3 (b) 2/274563 (c) -6 b What is the nearest to 92 in -0.4, 0.1, 64/3, 46, 5? 46 Which is the closest to -742? (a) -3 (b) 4.1 (c) -3/8 a Which is the closest to -1? (a) 4 (b) 0.09 (c) -1 (d) -298 (e) -1/5 c Which is the nearest to -1? (a) -1/5 (b) -29/28 (c) 8/5 (d) -0.3 (e) -3/2 b What is the closest to -1/4 in -0.1, 0.2, 851? -0.1 What is the nearest to 3/4 in 2/1521, -0.3, 4, 3? 2/1521 Which is the nearest to -1? (a) 2/3 (b) 9 (c) 7379 a Which is the closest to 0? (a) 4/7 (b) -20 (c) 0.004 (d) 4/5 c Which is the closest to 2/9? (a) 0.3 (b) -3/7 (c) -649 a Which is the nearest to 1/2? (a) 2 (b) -70 (c) 0.5 (d) 4 c Which is the closest to -74325? (a) 2/5 (b) 0 (c) 0.2 b Which is the closest to 0.1? (a) -76 (b) -0.1 (c) -3 (d) 53/38 (e) -1/8 b What is the nearest to 2/21 in 18, 4, -0.3, 25/3, -1/2? -0.3 What is the closest to -3/7 in 1, 0.12, 0.4, -0.015, -0.7? -0.7 What is the closest to 1 in 181, 1/2, 0.4, -13? 1/2 What is the nearest to 0.2 in 5.8, 0.072, -4/3? 0.072 Which is the closest to 2/5? (a) 0 (b) -2/11 (c) 1426/5 (d) -1/7 (e) -0.1 a What is the closest to 1/377 in -2, 4, -26, -3/7? -3/7 Which is the closest to 3/8? (a) 96 (b) -2/5 (c) 0 (d) -5 (e) -2 c Which is the nearest to 2? (a) 2 (b) -0.1 (c) 3 (d) 36 a Which is the closest to -0.1? (a) -10/21 (b) 1/2 (c) -2.1 (d) -2/9 d Which is the nearest to 90.1? (a) 0 (b) -3 (c) -0.4 (d) -0.3 a What is the nearest to 37 in -14, 4, -4, 1/3? 4 What is the nearest to -2/21 in 3, -2, 21, -0.19, -1? -0.19 What is the closest to -11 in -377, -3, -5/4? -3 What is the closest to -1 in -99.7, 5, 5/2, 2? 2 What is the closest to -9/26 in 3, -2/3, -8? -2/3 What is the nearest to 2/621 in 2/7, -0.1, 6, -1? -0.1 What is the closest to 34 in 0.11, 2/7, -0.9? 2/7 What is the nearest to 0.05 in 1, -0.2, 97459? -0.2 Which is the closest to -78? (a) 4 (b) 1 (c) -4 c Which is the closest to 0.045? (a) -1/9 (b) -2/19 (c) 2/7 (d) -1.13 b Which is the nearest to -2.1? (a) -5 (b) -0.1 (c) 2/19 (d) -3 d What is the closest to 0.1 in 1, -11, 4/7, -0.3? -0.3 What is the nearest to 81 in 1/3, -4, -3, 0.8? 0.8 Which is the nearest to -296? (a) -3 (b) -4 (c) 5/4 (d) -0.3 (e) 0.6 b What is the closest to 0 in -2/3, 68/71, 5, 22? -2/3 Which is the closest to 0.4? (a) 2 (b) 2/417 (c) 0.2 (d) -1.1 c What is the nearest to -0.1 in 0, -48, 73, 1/6? 0 What is the nearest to -0.2 in -5, -0.5, 1/4, -3/38, 0.004? -3/38 What is the nearest to -2/7 in -19/8, 0, -0.01, -0.2, 4? -0.2 Which is the closest to 0.6? (a) -4 (b) -45 (c) -1.9 c What is the closest to 1/644 in -5, -0.3, 1? -0.3 Which is the closest to 2/25? (a) -3/5 (b) -1 (c) -0.7 (d) -3 (e) 3/2 a What is the closest to -3/2 in 4, 40, -8? 4 What is the closest to 0 in 1, 0.01, -0.024, 3? 0.01 Which is the closest to 0? (a) -0.2 (b) 3 (c) -0.014 (d) 0.27 c What is the closest to 0 in -0.1, -1.3, -1, 0.5, -119? -0.1 Which is the closest to 6? (a) -4 (b) 2/3 (c) 2/299 (d) 8 (e) -2/17 d Which is the closest to -0.1? (a) -14/9 (b) 0 (c) 38 (d) 3/8 b Which is the nearest to 0? (a) -1/11 (b) 15 (c) -3/484 c What is the closest to -7 in -4/5, -2901, 12? -4/5 Which is the nearest to 0? (a) -3 (b) 28 (c) 63/8 (d) 15 (e) -4 a Which is the nearest to -6? (a) 3 (b) 0.053 (c) 3/4 (d) 10 (e) 5 b What is the closest to 1 in 0.038, -2/43, 279, -2/11? 0.038 Which is the nearest to -0.182? (a) 1/16 (b) -0.3 (c) 3 b What is the closest to 8 in 0.1, 1/6, -1.3, -2/5, 2/53? 1/6 What is the closest to -1 in -29, 0, -7, -4/13? -4/13 Which is the closest to 3/2? (a) -1/3 (b) 0.4 (c) 6.286 b Which is the closest to -0.3? (a) -5.7 (b) 2/27 (c) 2 b What is the nearest to -0.2 in -0.03, 2, 5, -4? -0.03 Which is the closest to 0.1? (a) -0.21 (b) 0.1 (c) 939 b What is the nearest to 0.064 in -5, -0.0019, -2, -2/7? -0.0019 Which is the closest to -7? (a) -0.1 (b) -155.5 (c) -2 c What is the nearest to 106 in 0.35, -2/3, 0.06? 0.35 What is the nearest to 11 in 0.6, 0.3, 10/7, 3/4, 1/7? 10/7 What is the closest to 0.2 in -3, -0.1, 1454, 5? -0.1 Which is the nearest to 0? (a) -1 (b) 4 (c) 2/3251 c What is the closest to 2/5047 in 0.4, -2/23, -5? -2/23 What is the closest to 4.7 in -3, -9/8, -4, 1/6, 3/2? 3/2 Which is the nearest to 0? (a) 704 (b) 2 (c) 6 b What is the nearest to 34 in 15136, -3/7, 0, 0.2, 0.3? 0.3 Which is the closest to -242? (a) 4/9 (b) -1/8 (c) -0.49 c Which is the nearest to 8? (a) -2.3 (b) 0.3 (c) -2.9 b What is the nearest to 1 in -0.3, -3, -34, -1/3? -0.3 What is the closest to -2/5 in -4779, 3, -3? -3 Which is the closest to -2? (a) -0.2 (b) 2/23 (c) -18 (d) 1 a Which is the nearest to 2? (a) 2.99 (b) -2/15 (c) -2 a Which is the closest to 1? (a) 2/3 (b) -0.4 (c) 1/6 (d) 2 (e) -96 a Which is the closest to -3? (a) 0.5 (b) 450 (c) 91 a Which is the closest to -0.6? (a) 4 (b) 1/71 (c) 3 b Which is the nearest to -1? (a) -2/3 (b) -4 (c) -332 (d) -0.5 (e) 29 a What is the closest to -7/92 in -12, 1/6, -3/4, -0.5? 1/6 Which is the nearest to -7? (a) 4 (b) -22 (c) 0 (d) -3 d Which is the closest to 4? (a) 0.04 (b) 0.05 (c) -0.27 (d) -2/15 (e) 0.1 e What is the closest to 25 in 1, 0.2, -0.3, -19/11? 1 Which is the closest to -0.1? (a) 1 (b) 1.323 (c) -43 a Which is the closest to 38? (a) -8/3 (b) -4 (c) -0.1 (d) -3/7 c What is the closest to 1.7 in -3, -0.8, 5/9? 5/9 Which is the nearest to -2? (a) 1/10 (b) 1 (c) -124 (d) -1/25 (e) 3/8 d Which is the nearest to 27? (a) 64 (b) 2/13 (c) 0.04 b What is the nearest to -4 in -0.04, -0.03, -0.5? -0.5 Wh	{ "pile_set_name": "DM Mathematics" }
4t - 3g. What is the highest common divisor of t and 108? 27 Let k(t) = 16t. Let d be k(6). Suppose -2p + 1 = -5. Suppose l - 66 = -5m + pl, -5l + 21 = 3m. What is the greatest common divisor of d and m? 12 Let t = 7 - 19. Let r be (t/(-18))/((-2)/(-9)). What is the highest common factor of 6 and r? 3 Suppose -5m + 33 + 2 = 0. What is the greatest common divisor of 7 and m? 7 Suppose 12 = -7k + 5k. Let a be 0 - 3/(k/68). What is the greatest common divisor of a and 85? 17 Let g = 15 - 10. Let s = -1 + g. Suppose v - 72 = -v. Calculate the greatest common divisor of s and v. 4 Let m = 38 - 71. Let v be m/(-9) + 4/(-6). What is the greatest common divisor of 3 and v? 3 Let a be (-2)/4 - 63/(-6). What is the highest common factor of a and 5? 5 Let g be 5/(-2)(-2)/(-1). Let d = 15 + g. Let l(b) = 2b2 - b - 2. Let r be l(2). What is the greatest common divisor of d and r? 2 Suppose 17o = -4o + 42. Calculate the highest common factor of 16 and o. 2 Suppose 7y = -0y + 7. Calculate the highest common factor of 5 and y. 1 Suppose 6h - 2p = h + 150, -4p + 36 = 2h. What is the greatest common factor of 42 and h? 14 Let t = 4 + -4. Suppose t = 3o - 715 + 205. Suppose 0 = 2l - o + 20. What is the greatest common divisor of l and 15? 15 Let y be (9/27)/(2/102). What is the highest common factor of 102 and y? 17 Let c be 30(-3 - -2)/(-1). What is the highest common factor of c and 45? 15 Let b = 42 + -29. Calculate the highest common divisor of b and 117. 13 Let t = 33 + -32. What is the greatest common factor of t and 9? 1 Suppose 141 - 37 = 2q. Suppose p = i + 129, -i + 30 = p - 101. What is the greatest common divisor of p and q? 26 Let p(n) = 31n + 3. Let r be p(1). What is the greatest common factor of 136 and r? 34 Let r be 11 + 6/(-3) + 1. What is the greatest common divisor of r and 10? 10 Let m be 1 + 5/((-15)/(-9)). Let u = m + -12. Let z be (-62)/u - (-1)/4. What is the highest common divisor of z and 80? 8 Suppose 2k - 28 = -0k. What is the greatest common factor of k and 21? 7 Let y(f) = 10f3 + 2f - 1. Let w be y(1). Calculate the greatest common divisor of w and 33. 11 Let x(h) = h - 7. Let m be x(8). Let a be (8 - 2) + (m - 1). What is the greatest common factor of 48 and a? 6 Suppose k + 4q - 232 = 0, 0 = 3k + 4q - 606 - 58. What is the greatest common divisor of 27 and k? 27 Suppose 0 = -5z - l + 80, -3l + 4l - 65 = -4z. Let k = z - 3. Suppose -t = 4u - 61, u - 2u + k = -3t. What is the greatest common divisor of 15 and u? 15 Let j be (-3)/(-12) + 11/4. Suppose -4q + 19 = 3l, l = -jq + 17 - 4. Calculate the greatest common factor of q and 20. 4 Let j be (-4)/((2/9)/(-1)). Suppose 2s - 24 = 8. Suppose 6 = 4o - 3f + 2f, 0 = -5o - 3f + s. What is the greatest common divisor of o and j? 2 Suppose -38 = -2s + 22. Calculate the greatest common factor of s and 12. 6 Let f(u) = u*3 + 8u*2 + 7u - 2. Let n be f(-7). Let s be ((-1)/n)/(2/80). Calculate the highest common divisor of 30 and s. 10 Let p be 30/4 - (-2)/(-4). Let x be (p + -1)(3 - -2). Let w = 185 + -175. Calculate the highest common divisor of x and w. 10 Let v be 10/(-75) - ((-2121)/45 - -3). What is the greatest common divisor of v and 4? 4 Suppose 41 = 2q + 1. What is the greatest common factor of 2 and q? 2 Let r be 4 + 2/(0 + 2). Let d = -3 + r. Let z be ((-3)/d)/((-3)/8). What is the greatest common divisor of 44 and z? 4 Suppose 4q - 173 - 15 = 0. Suppose 0v + 2v = -42. Let g = v + q. Calculate the highest common factor of 13 and g. 13 Suppose 8t - 1152 = 4t. Calculate the greatest common divisor of t and 32. 32 Let w be 4/129 + 17. Calculate the highest common factor of 5 and w. 5 Suppose -4t = -3t - 9. Calculate the greatest common factor of t and 99. 9 Let c be (-54)/10 + 10/25. Let o be 1/(c/2 - -2). Let k be (24/(-9) + o)-3. Calculate the highest common factor of 126 and k. 14 Suppose -45 = -4v - 3u, -v + 0v = -3u - 30. What is the greatest common factor of v and 165? 15 Let k be 0 + 13(14 + 5). What is the highest common divisor of 13 and k? 13 Suppose 152 = 5p - 68. Calculate the highest common factor of 66 and p. 22 Let z = 44 + -31. Suppose -c = 4k - 40, 0k - 58 = -c + 2k. Calculate the greatest common divisor of z and c. 13 Let p(g) = -4g3 + 26g*2 - 5g + 6. Let s be p(6). Calculate the highest common divisor of 32 and s. 16 Let w(h) be the second derivative of -h3/3 - h2 - 3h. Let j be w(-3). Calculate the greatest common factor of j and 20. 4 Let a be (17 + 3)2/5. Calculate the highest common divisor of 32 and a. 8 Suppose 0 = k - 5 - 3. Let b = 14 - k. What is the greatest common divisor of 9 and b? 3 Suppose 48 = 4h + 4j, 2h - 4j = h + 27. Calculate the highest common factor of 60 and h. 15 Let j = -44 - -100. What is the highest common divisor of j and 14? 14 Suppose 2m = -0m. Let n = 11 + m. Calculate the highest common factor of 121 and n. 11 Suppose 48 = 5v + 3h - 11, -4v - 3h + 46 = 0. What is the highest common factor of 117 and v? 13 Let x be ((-12)/3 + 35)11. What is the greatest common factor of 31 and x? 31 Suppose -o = 2o - 3. Calculate the greatest common divisor of o and 6. 1 Suppose -61 = -4g - 5d, -d = g + 2d - 17. Suppose 4 = 3s - g. Let o be 8/s42/4. Calculate the highest common factor of o and 126. 14 Let x be 1/20 + (-3 - -18). Calculate the highest common divisor of 30 and x. 15 Suppose -5z - 48 = 5f - 8, -23 = 4f + z. Let k be (-212)/f - (-6)/(-15). Calculate the highest common divisor of 28 and k. 14 Let x = 9 - 6. Suppose 5l - 4f - 23 = 2l, 0 = 3l + 4f - 7. Suppose 4d + 5o = 32, 2d - lo + 2 = -3o. What is the highest common factor of d and x? 3 Let i = -5 - -68. Let b(p) = 2p*2 + 5p - 21. Let a be b(-6). What is the greatest common divisor of i and a? 21 Suppose -2v - 3v = -25. Let y(s) = s*2 - 4s - 1. Let n be y(v). Suppose 61 = 6c - c - 3p, 0 = np - 12. What is the highest common factor of c and 56? 14 Let c = -6 - -22. Calculate the highest common factor of 32 and c. 16 Let u = 17 - 16. Let s be (-12)/4u - -16. What is the highest common factor of s and 143? 13 Let u be (-3)/(3/((-3)/1)). Suppose 7s = us + 24. Calculate the highest common factor of 6 and s. 6 Let o be 2 + -1 + 0 - -3. Suppose -3i - 5 + 41 = 0. Suppose -4s = 4c - 0c - 64, 3c = 2s - i. What is the greatest common factor of o and s? 4 Suppose -l + 4l = 93. Let s = l + -17. Calculate the greatest common factor of s and 70. 14 Let i(s) = -29s*3 - 2s2 + 1. Let n be i(-1). Let p(c) = c3 + 14c2 + 12c - 6. Let h be p(-13). Calculate the greatest common divisor of n and h. 7 Suppose 2j - 7 - 53 = 0. Calculate the greatest common factor of 10 and j. 10 Let t be (-2)/(-10)825. Let i be (-3)/((-2 + 3)-1) - -13. Calculate the greatest common factor of t and i. 8 Suppose -8a + 173 = -19. Let r = 23 - -37. What is the greatest common divisor of a and r? 12 Suppose 3u - 5k = 260, 4u - 2k - k - 332 = 0. Let i be 3/(-2)20/(-6). Suppose -u - 550 = -iw. What is the highest common factor of 14 and w? 14 Suppose 63 = 2f - 3u, 17 = 3f - 2u - 70. Calculate the greatest common factor of f and 27. 27 Let v be -38 - (2 + -5)/3. Let c = 54 + v. What is the highest common factor of 187 and c? 17 Suppose -4p = -4 - 8. Let j(i) = -i + 0i + 3 - ip + 5i + 2i2. Let u be j(-2). What is the highest common divisor of 121 and u? 11 Let q = 28 - 8. What is the highest common factor of 30 and q? 10 Let v(n) = -n - 4n2 - n3 + n + 4n - 2n. Let y be v(-5). What is the greatest common factor of 165 and y? 15 Suppose 0 = 2x - 15 - 25. Calculate the highest common factor of x and 5. 5 Let h(r) = -r2 + 40r - 4. Let a be h(17). Calculate the greatest common divisor of a and 43. 43 Suppose -7q - 5q = -132. Let h = 13 + -9. Suppose 2n = 4x - 2n - 240, -hx = -2n - 230. What is the highest common divisor of x and q? 11 Let y be 15 - (-4 + (-2)/(-2) + 2). Calculate the highest common factor of 112 and y. 16 Let q(w) = 2w*3 - 3w*2 - 5w + 3. Let n be q(3). Calculate the highest common factor of n and 30. 15 Let n(b) = 12b2 + b - 3. Let l be n(3). Calculate the highest common factor of 12 and l. 12 Suppose 5q - 5z = 128 + 42, -5	{ "pile_set_name": "DM Mathematics" }
? -1/3 Let f = -31.3 + 31. Let r = 3880 - 3883. Let a = 3 - 2.8. What is the closest to a in f, r, 4/7? 4/7 Let f = 27 - 19. Let n = -2835 + 2839. Let z be ((-6)/n - -4)f/(-70). Which is the nearest to z? (a) 0.2 (b) -4 (c) 4 a Let r = -21 + 21.06. Let j = r - -0.14. What is the closest to j in -2/3, -1/5, -1? -1/5 Let q = -0.7 - -0.7. Let g = -0.34 - -0.61. Let f = g + -0.37. Which is the closest to f? (a) -0.6 (b) q (c) 5 b Suppose -6d - 9d = 308 - 233. What is the closest to -9 in 4, d, -5/4, 6? d Let r = -89/186 + -2/93. Suppose 3t + 7 = -w, 3w - 12 = 6w. Which is the nearest to t? (a) 0.3 (b) 4 (c) r c Let x = -0.77275 - 0.22725. Which is the closest to 0.4? (a) x (b) 9 (c) -18 a Let r(k) = 5k2 - 2k - 2. Let t be r(2). Let n be (t/21)/((-2)/(12/5)). Let d = 2.06 - 0.06. What is the nearest to -0.1 in n, d, -3? n Let d = -1434 + 1434.42. What is the closest to -1 in d, 0.7, -1/3? -1/3 Let v = 145 + -146. Let a = 3 - -3. Let d = a + -1. What is the nearest to -1 in d, -5, v? v Suppose r - 1 = 2t, -t - 5 = -4r + 13. Let l(m) = m3 - m2 + m + 6. Let z be l(3). Suppose z = -14j - 15. What is the closest to -0.1 in -2/7, j, r? -2/7 Let q = 5590 + -5207. What is the nearest to 2/5 in q, -1/7, -3, -4? -1/7 Let v = 74 + -74. Let w = 39 - 30. Let g = w + -8. What is the closest to -1 in g, v, 0.5? v Let t be (2/5)/((-9)/5). Let v be ((14 - -5) + -10 + -13)(-3)/(-12). Which is the nearest to t? (a) v (b) 4 (c) 0.03 c Let m be (-2322)/473 - 40/(-44). Which is the nearest to -0.1? (a) 0.8 (b) 4 (c) m (d) 6 a Let m = -4.1425 + 0.1425. What is the nearest to -21/43 in m, 2/17, -0.4, 2/9? -0.4 Let u = -11325/4 + 2831. What is the closest to -2 in 0.3, -0.2, u? u Let b = -9.3 + 74.3. Let v = 23 - b. Let c = v - -42. What is the nearest to 4 in c, 3/8, -0.3? 3/8 Let k = 27.1 - 27. Let d = -1253 - -1258. Which is the nearest to -0.1? (a) d (b) 31 (c) k c Let f = -1/4475 - 4469/26850. Which is the closest to 8? (a) f (b) 2/13 (c) -2 b Let u = 23/19 + 48/133. Let r = u - 41/35. Let i be -4 - (-172)/28 - 2. Which is the closest to r? (a) i (b) 5 (c) 1 a Let c = -17.85 - -15.85. What is the nearest to -4 in c, 13, -0.3? c Let h = 146 - 202.7. Let k = -57 - h. Which is the nearest to 0.2? (a) k (b) 9/7 (c) 0.2 c Let d(t) = -3t + 37. Let n be d(9). Suppose -n = 11j + 34. Let s = -0.99 + -0.01. Which is the nearest to 0? (a) -3 (b) j (c) s c Let f = 60197 - 10955729/182. Let u = 3/26 - f. What is the nearest to -5 in 0.1, -4, u? -4 Let y be 32/4116/(-3). Let k = y + 57. Let w be (k/2)/(-3(-2)/(-6)). Which is the nearest to -1/5? (a) 5 (b) 0.1 (c) w b Let m = -245 - -248. Let r be (-9 + m)(5 - 7)/4. What is the closest to -5 in r, 4, -1? -1 Suppose -5v = -0 + 5. Let n be 2/6 + 1/(-3) + (-464)/464. What is the closest to n in 1, v, 2? v Let q be ((-4)/16)/((81/36)/(-9)). Let u = -102/319 + 4/29. What is the nearest to 1/3 in -2/45, u, q? -2/45 Let z be (-105)/40 + (6/(-4))/(5/(-10)). Which is the closest to 0.6? (a) z (b) -1/7 (c) 5 (d) 1/4 a Let z be (-8)/(-30) + 32/60 + (-112)/280. Which is the nearest to 1/2? (a) 0.1 (b) -7/5 (c) z (d) -3 c Let r be (-10)/3 - (-3)/9. Let x be ((-3117)/2)/(-1210/80). Let h = x + -594. Which is the closest to -3/5? (a) -1 (b) h (c) r b Let v be (-6 - 128/(-21))(-1)/((-30)/(-70)). What is the nearest to -2/7 in -4, 2/9, -1/3, v? -1/3 Let q be 12/54 + 222/99. What is the closest to 0 in -28, q, 0.2? 0.2 Let l = 7284.04 + -7284. Which is the nearest to 0.4? (a) -2/15 (b) -7 (c) 0.08 (d) l c Suppose 3z - 29 + 11 = 0. Let u be 3/z-4 + (-120)/(-63). What is the nearest to -0.2 in 18, u, 5? u Suppose 3t - 4t + 169 = 2q, 2t + 5q - 337 = 0. Let k = t - 685/4. Which is the nearest to 0.4? (a) 0.5 (b) 2 (c) k a Let d = 335.8 - 335.569. Which is the nearest to -0.2? (a) d (b) 2/3 (c) -1/8 c Let s = 534/5 - 107. Let v = -5 + 5. Which is the closest to 3? (a) -0.12 (b) v (c) s b Let v(t) = 2t + 3. Let k be v(-3). Let c = 2091/3773 + -3/343. Let u be 203/(-29) - (-9)/(-8) - -8. What is the closest to k in c, u, 0? u Let g be ((583/(-154))/(-53))/(1/2). Which is the closest to -5? (a) g (b) 1.3 (c) 1/2 (d) -2/5 d Let o = 89.12 + -88.92. Let v = 13 - 9. Let n = -6 + v. Which is the nearest to 3? (a) o (b) 2 (c) n b Let h = -1.5 + 1.8. Let s = 12 + -64. Let l = s + 52.08. Which is the closest to 2/3? (a) h (b) l (c) -2 a Let x = -10 - 51. Let z = x - -64. Suppose -zp - 3l = -24, -33 = -5p + 2l - 0l. Which is the closest to 0.1? (a) -2 (b) -2/7 (c) p b Let t = 10.46 - 389.46. Let s = t + 373. Let a = 1.1 + -1. What is the closest to s in -3/4, a, 3? -3/4 Let z be 4/(-10) + 16/40. Let f = -147 + 147. What is the nearest to z in f, 5, -3? f Let i = -0.24 + 0.14. Let q = 74.3 - 77.3. What is the closest to 0 in i, q, 0? 0 Let f(v) = 13v*2 - 121v + 37. Let z be f(9). Which is the nearest to 1/4? (a) -3 (b) -12 (c) 4/15 (d) z c Let g = 11159/67026 - -2/11171. Which is the closest to -2? (a) 1 (b) -1.1 (c) -1/8 (d) g b Let t = -88.9 + 89.014. Let l = -13 - -12.7. What is the nearest to t in 3, 1, l? l Let k = 127/273 + 55/273. Let t = -2/1311847 + -320087742/1919232161. Let x = t - 2/133. What is the nearest to x in 1, 4, k? k Let r = 373.01 - 5.51. Let d = 370 - r. What is the closest to 1/4 in d, -1, -1/3? -1/3 Suppose -21x + 1484 - 1379 = 0. Let m = -57/5 + 181/15. Which is the closest to m? (a) 19 (b) x (c) -0.1 c Suppose 58v + 56 + 43 + 17 = 0. Which is the nearest to -0.7? (a) 0 (b) 4 (c) 0.4 (d) v a Let d = 1605 + -1595.192. Let u = d - -0.192. Let y = 61/2 + -309/10. What is the nearest to y in -0.4, u, -0.1? -0.4 Let t be 3/((-405)/(-740))-3. Let s = -4606/279 - t. Let k = -0.719 - -3.719. Which is the nearest to s? (a) k (b) -4 (c) -2 c Let r = -97 - -358. Let u = -266 + r. Which is the closest to 0? (a) -4/5 (b) u (c) 4 a Let n = -0.2 - -0.2. Let s be 10506/1265 + -10 + 336/35. Let r = s + -86/11. Which is the nearest to n? (a) r (b) -3 (c) -2 a Let b = 153 + -156. Let k = 152 - 911/6. Let l = 2.7 + 0.3. What is the nearest to l in b, -1/3, k? k Suppose 8q - 20 = 6q. Suppose -x = -f + 10, -6f + x - q = -9f. What is the closest to 1/5 in f, -6, -0.1? -0.1 Let s = 2.3257 + -0.3257. Let l = 6 + -5.8. What is the nearest to -3/2 in s, 4, l? l Let c = -3/44 + -67/308. Let r = 3/59 - 127/177. Let i = 3.91 + 0.09. What is the nearest to c in r, i, -0.1? -0.1 Let m = -0.028 - -56.028. Let p = m + -5. Let g = 51 - p. What is the nearest to g in 1/13, -0.1, 0.5? 1/13 Let h = -10385/3 - -3462. Which is the closest to -0.1? (a) -17/2 (b) 1 (c) 0.1 (d) h c Let h = -0.182 + 0.582. Which is the nearest to -3? (a) h (b) 1 (c) -0.0655 c Let j be 95/((-15390)/4)9/(-1). Suppose 8g = 4g - 12. Which is the nearest to -1? (a) 0.3 (b) j (c) g b Let d = -6.51 - -8.7. Let k = d - 1.19. Which is the closest to 1? (a) -9 (b) k (c) -5 b Let v(r) = -58r3 + 7r*2 + 3r + 3. Let m be v(4). Let l be m/(-4275) - (-4)/(-10). Let t = l - 2/19. Which is the nearest to t? (a) 0 (b) -5 (c) 3 a Let z = 1542.7 + -1543. What is the nearest to -0.4 in -2, z, -1? z Suppose -19y + 119 + 129 = -50y. Which is the closest to y? (a) 92 (b) -1/2 (c) 4 b Let g = 12 + -15. Suppose -3u - 13 = -5z, -123u + 122u - 11 = -5z. Which is the nearest to 0.12? (a) g (b) 4 (c) z c Let t be (10754/(-665) + 16)/(4/10). Suppose 25 = 3y + 2y. Which is the nearest to 0.1? (a) -2.8 (b) y (c) t (d) -1 c Let t = -834 - -1605/2. Suppose -x = -3d + 19, 4d - 31 - 77 = 4x. Let f = t - x. Which is the nearest to -1? (a) f (b) -3 (c) -1/3 a Let t = -0.24 - -0.24. Let z = -4.209 - -4.309. What is the nearest to t in z, 2/5, -8.7? z Let s = -2 + 54.8. Let d = -0.98 - -53.98. Let b = s - d. What is the closest to 0.1 in b, 0.8, 0.3? 0.3 Let w = 9 - 8. Let o be (-807)/(-180) + 4/(-10) - 4. Let v = -7 + 5. Which is the closest to -0.2? (a) v (b) w (c) o c Let d be (-9028)/7686 - 1(-4)/14. What is the closest to 1 in 0.31, 3, d? 0.31 Let m(k) = -3k2 - 1. Let x be m(-1). Let a(q) = -q3 - 21q2 - 88q + 34. Let p be a(-15). What is the nearest to -1 in p, -0.08, x? -0.08 Let s = -550.5 - -12.5. Let p = 531 + s. Which is	{ "pile_set_name": "DM Mathematics" }
orm ct + h and give h. 3 Express -348 + 120 + 104 + 106 + 50l in the form ql + f and give q. 50 Rearrange -1155 + z - 88z*4 - 3z - z*3 + 27z*4 + 1156 to the form uz*4 + h + az + xz3 + kz*2 and give u. -61 Rearrange (2 - 2 + q + (5 - 4 + 0)(4 - q - 4) - 55 - 49q + 55)(-4 + 0 + 2) to aq + p and give a. 98 Express 2z*2 + 15z + 1 + 28z3 + 3z*3 - 30z*3 in the form az*2 + yz + v + nz3 and give y. 15 Rearrange (n - 3n + 4n)(-6n + 2n + 3n) + (-n + 6n - 2n)(-6 - n + 6) + 4n2 - 10n*2 - 7n*2 to c + bn + an2 and give c. 0 Rearrange -839q*4 - 3959 + 3959 + (-2 - 2q*2 + 2)(2 - 2 - 2q2) + (-3 + 4 - 3)(-q*4 + 3q4 - q4) to pq2 + oq + h + gq3 + sq*4 and give s. -837 Express (-4 + 53 + 5)(-2r - r + 5r) + (-2 - 4 + 4)(-r + r - r) + 0r - 4r + 6r as b + gr and give g. 112 Express 45 - 38 - 11 - 20 - 8t in the form xt + s and give x. -8 Express (-1 - 1 + 4 - 3)(-p*4 - 2p*4 + 4p*4) in the form z + sp*3 + tp + lp4 + gp*2 and give l. -1 Express (3y - y*2 - 3y)(-33y + 71y - 36y) - 3y3 + 3y*3 - 2y*3 in the form my + qy3 + f + uy*2 and give q. -4 Rearrange 2p*2 + 0p2 + p2 + (-2p2 + 2p2 + p2)(-2 + 4 - 3) + 13p*2 - 7p*2 + 26p*2 to the form up + op2 + g and give g. 0 Rearrange 279z*4 - 137z*4 + 6z - 140z4 - 8z*2 to the form rz*2 + w + hz + fz3 + qz*4 and give w. 0 Express -15743 + 16s*3 + 15743 - s - 2s*2 as rs + js2 + bs*3 + t and give r. -1 Express 26 - 13 - 38u*2 - 13 in the form o + yu + tu2 and give t. -38 Rearrange (3 - 3 - f)(63f - 2608 + 2608)(0 + 3f2 + 0) to the form xf*3 + wf*2 + r + zf*4 + jf and give z. -189 Rearrange -2f2 - f + f + (0f - 3f + f)(0f + 4f - 3f) - 177652f - 376f2 + 177652f + f2 - f2 + 2f2 to the form l + df*2 + hf and give d. -378 Express (-752 + 381 + 374 - 20a2)(3a2 - a2 - 11a*2) in the form ja*2 + ka*3 + xa*4 + ha + b and give j. -27 Rearrange 6n + 39n - 9n + 13n to un + o and give u. 49 Express 5 + 17c*2 + 5c*2 - 65 - 16c*2 in the form mc*2 + kc + q and give q. -60 Rearrange -298b + 87b - 184b to i + ob and give o. -395 Rearrange -145487 + 145487 - 661n2 to a + in + hn2 and give h. -661 Rearrange -130s2 - s + 11955 - 11955 - s2 + 2s2 - 3s*2 + (0s + s - 3s)(0s + 0s + s) - s2 + s2 + 2s2 to ys + ks2 + h and give k. -132 Rearrange -11 + 33 - 19 + 51a*2 - 380a*2 to the form pa + qa2 + z and give q. -329 Rearrange -31u*3 + 9 + 8 - 2 - 13 + 4u to xu + hu*2 + yu*3 + i and give x. 4 Rearrange -7z - 4 + z*2 - 7z + 15z + 18 to mz*2 + l + sz and give m. 1 Rearrange -4 - 3c + 4 + 2 - 176c*2 - 176c*2 + 355c*2 + 4c4 + c3 to the form gc + lc*4 + x + oc*3 + vc*2 and give v. 3 Rearrange 4q2 - q2 - 1539q3 + 1538q3 + q4 - 2q to the form z + nq*3 + gq + iq4 + rq*2 and give r. 3 Express (5r + 6r + 0r)(12 + 1 + 22) in the form p + mr and give m. 385 Rearrange -4 + 4 + 27q3 + 7q - 4q3 + 0q*3 - 1 to w + sq + kq3 + yq2 and give k. 23 Express -j3 + 2j2 - 83j + 59j - 2j*2 - 8j in the form q + bj2 + lj*3 + uj and give l. -1 Express 5 - 33t - 36t + 64t as m + zt and give m. 5 Express (9 - 5 - a - 7 + a*2)(24a + 8a + 3a) as fa*3 + ja*2 + wa + i and give f. 35 Rearrange (3y2 - 8y2 - y2)(2 + 1 - 8)(-9 + 4 - 10 - 5) to z + xy + ny*2 and give n. -600 Rearrange 153 + 126 - 279 - 60w*2 to r + jw + bw2 and give b. -60 Rearrange h + 2h - h + (-1 + 0 + 3)(-3h - 2h + 3h) + 99064 - 1102h - 99063 - 1092h to ah + q and give a. -2196 Rearrange 21m - 18m + 39m2 - m3 - 2m2 + 3m*3 to the form am*2 + y + um + tm3 and give y. 0 Express (5 - 5 - 3o*2)(-126 + 99 - 121 - 226) in the form h + mo + po*2 and give p. 1122 Express -3w*2 - 5w - w + 12w3 - 16w*3 + 0w*2 as mw*3 + uw + z + gw2 and give m. -4 Rearrange 5 + 14o*4 + 7o*2 - 3 - 15o*4 - 10o*2 - 8o*3 to the form q + uo*2 + jo + co3 + vo*4 and give u. -3 Express (-4 - 2 + 7)(-32r - 7r + 20r)(2r3 + 2r*3 - 5r3 + r2) as lr4 + kr + xr2 + pr*3 + m and give p. -19 Rearrange -3 + 3j - 12 + 12 - 15j2 - j3 to the form h + oj*2 + mj*3 + wj and give w. 3 Express (0 - 1 + 2)(-37 + 41 + 14 - 49q) in the form t + cq and give t. 18 Express (-t + t - 2t + (-2 - t + 2)(-2 + 0 + 1))(-16t2 + 24t*2 - 76t*2) as i + ct*2 + kt + ht3 and give k. 0 Express -2v - 203 - 935 + 0v as g + pv and give g. -1138 Express -12j - 10j + 34j + 63 - 8j in the form n + kj and give n. 63 Rearrange (0 + 0 - a)(-8 - a + 8)(-2 + 2 - 2a2) + 1 - a4 - 1 + (2a3 + a2 - a2)(6a + 0a - 8a) to ca*4 + ia*3 + za*2 + k + xa and give c. -7 Express (778 + 1263 - 745)(r + r - 3r) in the form s + hr and give h. -1296 Rearrange 263 - 529 + 245 - 9i*2 to the form ni + v + li2 and give l. -9 Express -5f + 11 - 13 - 12 - 3f - 3 in the form n + pf and give n. -17 Express 5550l - 5550l + 1194l2 - 381l*2 in the form yl + tl2 + i and give t. 813 Rearrange -22235 + 22235 + 1011f*4 + (4 + 2f*2 - 4)(f2 + f2 - f*2) to the form yf*3 + df*2 + if*4 + mf + o and give d. 0 Express (-3a + a + 0a)(-6a - 2a + 4a) + 347a - 347a + 45a2 + (-3a + 5a - a)(-1 - a + 1) + 1 - a*2 - 1 as m + sa + xa2 and give x. 51 Rearrange (-49 - 14 + 19)(11 - 7 + 7)(-5 + 5 - t3) to zt + wt3 + m + ot*2 and give w. 484 Rearrange (-3 + 3 + 3r)(4 + r - 4) + ((-r - r - 4r)(4 - 3 + 0) + 2 + 2r - 2)(r + 2r - 6r) to k + xr*2 + pr and give x. 15 Express -139o - 126o - 41o + 114o as no + v and give n. -192 Rearrange -70 - 265m + 24 + 16 + 26 to the form v + jm and give j. -265 Express (-3n + n + n - 2 + 2 + 2n + (-2 + 0 + 0)(-5n - n + 4n) + 4n + 0n - n)(0 + 2 - 6) + 0n - n + 0n in the form z + kn and give k. -33 Rearrange (-d*3 + 0d*3 + 4d*3)(-127 - 1452 - 1332 + 402 - 559) to the form fd3 + hd + bd2 + r and give f. -9204 Rearrange (996 - 454 + 343)(s*2 - 2s2 - s2) to o + vs2 + as and give a. 0 Express 54p + 94p*2 - 26p - 28p as up*2 + g + rp and give u. 94 Rearrange (3i - 3i + 2i)(0i - 4i + 2i) - 84i*2 - 293i*2 + 41i*2 to a + fi*2 + li and give f. -340 Express (-4 + 4 - 2f)(309 + 93 + 133 - 91 + 9) as jf + g and give j. -906 Rearrange 25w*2 + 2w + 0 - 7 - 4 + 9 to tw2 + j + fw and give t. 25 Rearrange 6595z + 6002z - 13286z to c + kz and give k. -689 Express -53 + 324p2 - 24 - 2p*3 - 323p*2 in the form b + tp*3 + ap*2 + vp and give b. -77 Express 254 - 134 - 127 - x*2 - x in the form mx + z + vx2 and give m. -1 Rearrange 3u*3 - 13u + u*2 - 2u*2 + 10u - 1 to the form b + ju + ou*3 + ku2 and give k. -1 Express -t3 + 11t - 9t + 3t3 + 23 - 22 - 3t*4 + 3t*2 as zt*4 + rt + pt2 + lt*3 + d and give d. 1 Rearrange (62t + 34t - 33t)(8 - 6 + 1)(2t + 2t + 0t) to the form ht + wt2 + l and give w. 756 Rearrange 7a*3 - 12a - a - 4a3 - a3 + 2 to the form sa*2 + t + xa*3 + ma and give m. -13 Rearrange (-2 + 3 + 1)(-13 + 2 + 2k + 14)(2 + 5 - 2) to the form h + fk and give f. 20 Rearrange -1 - 18326t2 - t4 + 18302t*2 - 2t + 4t4 to the form a + dt*3 + st + it2 + kt*4 and give k. 3 Rearrange (53 + 12 + 21)(2x - 3 + 3)(-x - 2x + 2x) to the form qx2 + h + yx and give h. 0 Rearrange 1276u3 + 3u*4 + 1092u*3 - 3175u*3 - 2u + 1239u3 - 5u*4 to hu*3 + g + xu*2 + nu + wu4 and give n. -2 Rearrange 4 + 4q*3 + 2q + q*4 - 5 + 13q*3 to iq*2 + z + cq*4 + kq*3 + dq and give k. 17 Express (-28 - 19 + 53)(h3 + 0h*2 - 5h*3 - 2h*2) as p + uh*2 + vh + rh3 and give r. -24 Rearrange -u3 + 0u*3 - 16u*2 + 21u*2 - 3 - 3u*2 to ou*3 + yu + fu2 + w and give w. -3 Express -r2 + 8r2 + r2 + (r + 2 - 2)(-3r - 6r + 4r) - 2r2 + 28 - 2r - 28 in the form br2 + m + fr and give f. -2 Rearrange 2w4 + 0w - 3w4 - w + 1323w*2 + 2w - 1262w2 + 1 to the form aw*2 + i + zw*3 + bw + cw*	{ "pile_set_name": "DM Mathematics" }
- -246. Let w = g + -737/7. What is the second smallest value in w, 3, l? l Let m = 7 + -3. Suppose -87 = -10q - 4q + 11. Let f = 7/8 + -3/8. Which is the third smallest value? (a) f (b) m (c) 2/11 (d) q b Let u be 204((-511)/(-420) + (-20)/12). Let n = u - -92. Which is the third smallest value? (a) -8 (b) -0.1 (c) n c Let d = -5555.2 + 5555. Which is the third biggest value? (a) d (b) -1.54 (c) -4/5 b Let w = -2038.3 + 2038. Which is the second smallest value? (a) 19/13 (b) 3/4 (c) w b Let t = 204 - 324. Let p = -121 - t. What is the second biggest value in -4, 0.4, 3, p? 0.4 Let h be 20/52((-12)/5 + 2). What is the biggest value in 5/19, h, -2? 5/19 Let x = 2.2 + -2. Let i = 321566 + -321565. Which is the second biggest value? (a) 6 (b) -3/2 (c) x (d) i d Let r = 0.2493 - 0.5493. Which is the biggest value? (a) r (b) 3 (c) -0.68 b Let h be (-2 - -2) + (-120)/400. Let t = -3.6 + 9. Let z = t + -0.4. What is the second smallest value in -2/11, z, h? -2/11 Suppose -4i + 42 + 18 = 3y, i + 4y - 15 = 0. Suppose 2n - 14t + 13 = -it, t = 5n + 15. What is the third biggest value in 56, 4, n, 0.4? 0.4 Suppose 0i + 36 = 18i. Suppose 5k - k = 4v, v - ik - 3 = 0. Which is the third smallest value? (a) -1/4 (b) 4/7 (c) v b Let x = -246.1 - -250.1. What is the third biggest value in 1, x, -3? -3 Let u = 2.35 - 5.35. Which is the third smallest value? (a) -653 (b) -4 (c) u (d) -1/4 c Let x = -214 - -110.5. Let m = -103 - x. Let f = -15/2 - -9. What is the third smallest value in -2/9, f, 0.05, m? m Let h be 6/3(1 - 2). Let l = -37515/4 + 9379. Let p = -6.4 - -6. Which is the fourth biggest value? (a) p (b) h (c) l (d) 4/5 b Let d = 229 + -321. Let w = -90 - d. Which is the third smallest value? (a) w (b) -0.1 (c) 5/4 a Let u = -0.0242 + -56.5758. Let n = u + 57. Which is the second smallest value? (a) -0.06 (b) 1.3 (c) n c Let i = -314 - -304. Let g be -2(1 - (-9)/i). Which is the second biggest value? (a) g (b) -2 (c) -5 b Let u(f) = -2f3 - 4f - 3 - 1 + 0f3 + 0. Let n be u(-1). What is the smallest value in -2/9, n, -36? -36 Let b = 2.0971 - 1.7971. What is the third smallest value in -2/7, 7/2, b, -40? b Suppose 0 = 2z + 8, 0 = -0r - 4r + z - 16. Which is the second biggest value? (a) 53 (b) -0.6 (c) r b Let x(p) = -p*3 - 27p*2 + 66p + 233. Let i be x(-29). Which is the biggest value? (a) -0.5 (b) 4 (c) 2 (d) i (e) -2 b Let f = 0.056 + -0.356. Suppose 454w - 105 = 433w. What is the second smallest value in -2/5, -7, w, f? -2/5 Let n = -0.1 - -0.2. Let q = 6459 + -6453. What is the fourth biggest value in -1/2, 2/11, q, n? -1/2 Let s = -376 + 717/2. What is the second biggest value in 2, -1/2, s? -1/2 Let a = -497.3 - -502.3. What is the smallest value in a, 29, -0.34? -0.34 Suppose 2p = -0p. Let w = -1.9 + -2.1. Let z be (-22)/4686/(-473). What is the third biggest value in p, 1, w, z? p Let y = 11 - 21. Let k = -15 - y. Let z = 3.0464 - 2.0464. Which is the second biggest value? (a) k (b) z (c) 0 c Let a = 5.4138 - 0.4138. What is the smallest value in 0.085, a, 0.3? 0.085 Let t = -3297 - -16484/5. Let n be (15/10)/((-6)/(-223)). Let s = n + -56. What is the fourth smallest value in -3/2, s, t, 5? 5 Let h be 1/35 + 4/10. Let d(i) = -3i + 115. Let n(k) = -k + 117. Let c(j) = -4d(j) + 5n(j). Let w be c(-18). What is the second smallest value in -4, w, h? w Let o = -865/147 - -25/147. What is the third smallest value in o, 1/2, 2/9? 1/2 Let d = 298 - 661. Let n = 361 + d. Which is the biggest value? (a) n (b) -212 (c) 0 c Let x = -10996 + 10998. Which is the third smallest value? (a) -7 (b) x (c) 2/19 (d) -5 (e) 14 c Let m = -1 - -0.5. Let t be 12 - ((-85312)/(-6336) - (-28)/(-18)). What is the biggest value in 1/2, t, -5/2, m? 1/2 Let r = 1342 - 1340.8. Suppose j + 3h = 18, -4j = -h + 2h - 28. Suppose 0 = 4g - jg - 6. What is the third biggest value in 0.5, r, g, -5? g Suppose 0 = -5y - 4m - 19, 0 = 5y - 2m - 7 + 20. Which is the second smallest value? (a) y (b) 0.5 (c) -4/5 c Suppose -5005 = -97f + 84f. Let y = 1157/3 - f. What is the fourth smallest value in y, 1, 0.3, 1/5? 1 Let t be (-27)/(-40) + (-96)/120. Let d(m) = -17m - 44. Let h be d(-3). Which is the third biggest value? (a) -3 (b) h (c) t a Let b(w) = -2w2 + 10w + 45. Let d be b(7). What is the second biggest value in -1/4, -0.4, d, -11? -1/4 Suppose -85 = -5r - 10. Let l = -21 + r. Let x be ((-2)/9)/(l/9). Which is the second smallest value? (a) 3 (b) 5 (c) x a Let m = 1642 + -1595. Let q = -52 + 52. What is the second smallest value in q, m, 3/5, 2? 3/5 Let t = 5.01 + -4.01. What is the third smallest value in t, -58, -4? t Let b(t) = 106t - 2967. Let s be b(28). What is the second smallest value in -3/2, 1394, s? s Let p be 2 - (3 + (0 - -47))/(-2). Suppose -p = 3b + 3j, -3b - 31 + 9 = 2j. Let m = 0.31 + -0.11. What is the third biggest value in m, -1, b, 2? -1 Let i(v) = -2v2 + 5v - 8. Let h be i(9). Let t = -877/7 - h. What is the second smallest value in -1/13, 2/7, 0, t? -1/13 Let q = 66086.1 + -66086. Let z = -1.15 - -0.05. What is the third smallest value in z, -5, -5/3, q? z Suppose -2f + 4z + 549 = f, 0 = -3f - 5z + 522. Let v = f - 182. What is the third biggest value in v, 0.07, 0? v Let n = -2151 + 45169/21. What is the second smallest value in -2, n, -8? -2 Let j be 4/66/8. Let h = 126 - 132. Let f be (1/1)/((-14)/h + -3). Which is the smallest value? (a) j (b) 1 (c) f c Let v = 3670.9 + -3671.1. Which is the third biggest value? (a) 60 (b) v (c) -0.01 (d) 5 c Let m be 3/(-6)((-1360)/(-765) - (5 + -1)). What is the fifth smallest value in m, 0.1, -2/15, -1, 0.3? m Suppose 69j - 51j - 5940 = 0. Let u be 15/(-50)j/(-72) + -1. Which is the second biggest value? (a) u (b) -2 (c) -0.2 (d) 22 a Let z = -3/88 - 131/1320. Suppose -31o = 193 - 38. Which is the fourth smallest value? (a) z (b) -4 (c) -1 (d) o a Let z = 6 - 5.6. Suppose 25 = -6t + 73. Let p be -26 - -24 - t/(-3). What is the smallest value in p, -0.02, z, -1? -1 Let w be 30/93 - 168/17. What is the fifth smallest value in 81, -2/15, w, -1/6, 0? 81 Let d = -492 + 6393/13. Let z(u) = -u*2 + 13u - 34. Let l be z(3). Let i be 1/(-5) - l/(-30). Which is the second biggest value? (a) i (b) -0.1 (c) d c Let o = -299 + 7473/25. Suppose 4h = 2n + 50, -3n - 4 = -h + 16. Which is the biggest value? (a) 3 (b) h (c) o b Let i = -161.13 + 162. Let f = 0.77 - i. Which is the fourth smallest value? (a) f (b) 23 (c) -3 (d) 2/3 b Suppose -3l + g = -4 - 3, 8 = 4g. Let i be (-5 + l)20/8. Which is the fourth smallest value? (a) 3 (b) i (c) 6 (d) -0.1 c Let h = -211.099 - -0.099. Let q = h + 209. Let b(d) = -d + 4. Let w be b(8). What is the smallest value in w, -29, q? -29 Let n = 75.6 + 9.4. Let g = 39 - n. Let q = -45.7 - g. Which is the third biggest value? (a) 0 (b) 5 (c) q a Let v(i) = i*2 - 13i - 85. Let z be v(18). Suppose t - 9 = 4x - 9x, 2x = t + z. Which is the biggest value? (a) x (b) 0.8 (c) 2/7 a Let l = -205.3 - -212. Let x = 6.4 - l. What is the biggest value in -1/2, 1, x? 1 Let h = -0.0706 + 1.0706. Suppose -4x - 8 = -0x. Which is the fourth smallest value? (a) -0.1 (b) -7 (c) h (d) x c Suppose -5y = 15f - 10f + 255, -5f - 5 = 0. Let x be (y/30 + 2)(-6)/4. Which is the second biggest value? (a) 5 (b) x (c) 3 c Let y be -1 - (1 + 3)/(-4). Let l = -3.5 + 3.505. Let q = -9.005 + l. Which is the fourth biggest value? (a) y (b) -0.1 (c) q (d) -3/5 c Let c = -269/6 + 45. Let s = c + -1/3. Let k = -0.944 + 3.944. What is the smallest value in k, 1/5, s? s Let v = 16.8 - -13.2. Let o = -35 + v. What is the third smallest value in -3, -0.3, o? -0.3 Let o = -908/3129 + 2/447. Let c = -138 + 1244/9. What is the second smallest value in 4, c, o, 14? c Let b = -126 - -113.2. Let h = b - -7.8. What is the third smallest value in 1, h, -1? 1 Let m = -4.98201 + -0.01799. What is the second biggest value in 1, m, 2, -2/9? 1 Suppose 4q + 37 = 5t, 2t = q + 14 - 1. Let v = 1132.8 + -1130.8. Which is the biggest value? (a) v (b) 0.07 (c) t (d) -1/2 c Suppose -4j - 2q + 1862 = 0, q - 1389 = -3j - 2*q. Suppose -j = v - 464. W	{ "pile_set_name": "DM Mathematics" }
7. Let h = l + m. Which is the nearest to -2? (a) h (b) -0.3 (c) -2/5 c Let q be ((-6)/8)/(16/(-2048)). Let u be 4/(-2) - q/(-56). Which is the nearest to -16? (a) -0.4 (b) u (c) -3 c Let q(r) = r - 1. Let l be q(5). Let u = 0.4 + 2.6. Let g = -63.07 - -60.07. Which is the nearest to u? (a) 2/5 (b) g (c) l c Let p be 1(0 + -7) + 0. Let g be ((-476)/(-16))/p - -4. Which is the nearest to g? (a) -0.5 (b) -12 (c) -2 a Let o = 455.7 - 481.7. What is the closest to o in 0.2, -2, -1/12? -2 Let s be (-448)/336(-3)/(-4). Which is the closest to s? (a) -0.1 (b) -44 (c) 0.4 a Let u = 79 - 391/5. Let l = -3.183 + -1.817. What is the nearest to -0.2 in l, u, 2/5? 2/5 Let t be 6/204/6. Suppose 43a - 376 = -72a + 199. What is the closest to 1 in a, t, 0? t Suppose 5n = -m - 25 - 14, 4m + n + 42 = 0. What is the closest to 0 in 24, 0.5, m, 4? 0.5 Let k = -53485/80232 + -1/26744. Suppose 4v - 41 = -9. What is the nearest to 0.3 in v, -5, -3, k? k Suppose -4p = -3g - g - 8, 2g = -4. Suppose -170t + 166t = 3o - 25, 0 = -3o - 2t + 5. Which is the closest to -0.4? (a) o (b) p (c) 7 b Let j be -1(-8)/(-20)70/154. Let r be (-2)/(-6) + (-8)/(-3). Which is the closest to 3? (a) r (b) j (c) 1/4 a Let w = 39983 - 39944. What is the closest to 0.1 in w, -3/5, -5? -3/5 Let g be 3 + 14/10 - 4. Let u = 90 + -31. Let m = -52 + u. Which is the nearest to -2/3? (a) g (b) -2/7 (c) m b Let h be ((-3)/27)/((-3)/(-9)). Let t = -105172/9 + 11686. Let x = 1 + -4. Which is the closest to 0.3? (a) t (b) x (c) h a Let c = -27605 - -27606. What is the closest to -16 in c, -5, -2/5, -2.2? -5 Let r = 4.1728 - 0.1728. Which is the nearest to 1? (a) 1/8 (b) r (c) -9 a Let u = -1.9 - -2. Let q = -5272 + 5267. Which is the nearest to u? (a) -2/11 (b) 44 (c) q a Let g = 0.97 + -0.97. Let o be 2((-12)/(-3) - 18). Let v = -30 - o. Which is the closest to v? (a) 2/17 (b) g (c) -3/5 c Let s = 317.684 - 318. Let o = s + -0.084. Which is the closest to -5/4? (a) 1 (b) o (c) -0.5 c Let t = -0.8774 + -2.1226. Which is the nearest to 0? (a) t (b) 2 (c) 98 (d) 1/5 d Let y = 79377 - 79376.7. Let q = 11.13 - 0.13. Which is the nearest to q? (a) -2/9 (b) -2/13 (c) 0.1 (d) y d Let n be ((-2)/(-8))/((-46)/((-14352)/(-117))). Let t be (-1)/1 - (-10)/12. What is the closest to n in -1/4, 0, t? -1/4 Let x = -151 - -1663/11. Let d = 974419 + -974419. Let m = 7.4 + -7. Which is the nearest to d? (a) x (b) -0.2 (c) m a Suppose 3k = -k. Let s be 7 + -12 + 7 + 8/(-2). Let j = -5/9 + -7/36. What is the closest to k in s, j, -1? j Let n = -61 + 28. Let h = 5.34 - -25.66. Let z = h + n. What is the nearest to z in 7, -5, 3/2? -5 Let u = -3672 - -3672.19. Let p = 23 - 21. What is the closest to -1 in 7, p, u? u Let t = 16/75 + -2/25. Let y = t + 8/165. What is the closest to -1 in y, 5, -9? y Let g = -2/3417 - 10241/17085. What is the closest to -52 in -2/3, g, -0.4? -2/3 Let t be (3/(-18))/(-1)1. Let l = -13.94 - -16.1. Let w = l + -5.16. Which is the nearest to w? (a) -4 (b) t (c) -5 a Let r = 9123 - 9122.6. Let l be -2 - 4/(-28)13. Which is the closest to 6? (a) r (b) 2 (c) l b Let w = -19282 + 19277. What is the nearest to 0.1 in 4, w, -30.3? 4 Let i = 267 - 270.35. Let v = i - -3.15. Which is the closest to 26? (a) -1/9 (b) 3 (c) v b Let j = 0.335 + -0.335. Let h be 3/((-6)/(-4))(2 - 0). What is the nearest to j in 1, h, -11? 1 Let f = 3/14 - 13/28. Let r = 8/15 - 1/30. Let j = 55991 + -55994. Which is the nearest to f? (a) -0.3 (b) j (c) r a Let x = -232 + 139. Let u = x + 92.96. What is the nearest to -0.5 in -3/4, u, -1/3? -1/3 Suppose -9j - 78j = -383 + 35. Let q be 1 + -1(5 - 1). Which is the closest to 1? (a) 0 (b) -0.4 (c) j (d) q a Suppose 5908 + 2144 = 121r - 2475. What is the closest to 0.1 in r, -12, 2/11? 2/11 Let i = 2380 + -40458/17. Let y = -8 - -3. Suppose 5r + 2m + 1 + 0 = 0, 3m = 3r + 9. Which is the closest to 2/7? (a) r (b) i (c) y b Let w(j) = -j3 - 7j*2 - 6j + 3. Let n be w(-6). Let v = 74 - 98. Let x be (-16)/v(-3)/6. What is the closest to x in -3/2, 1, n? -3/2 Suppose -183z + 186z = 15. Let c be 27/(-6)(-10)/15. Let n = 8/9 + -23/36. What is the closest to -2/3 in c, n, z? n Let a = 2118.1 - 2118. Let g(x) = x*2 + 5x + 8. Let p be g(-4). What is the nearest to a in 2.4, p, -1? -1 Let u = -6123.2 - -6123.4. Let s = -5 - -7. Which is the closest to 1? (a) s (b) 0.1 (c) u c Let b(n) = n*3 - 5n*2 + 4n + 6. Let x be b(3). Suppose 6r - r = x. Suppose -g = 1 - r. What is the closest to -2 in 2, g, -1/6? g Let t = -234 - 303. Let o = 537 + t. What is the closest to -0.3 in 1, -0.1, -3, o? -0.1 Let u be (32/64)/((-2)/48). Let p be (-15)/u + (-410)/360. What is the closest to 2 in p, -3, 3? 3 Let s = 606 + -615. Let j = -8.9 - s. Let l = 5 + -2. What is the closest to 1 in j, l, 2? j Let s = 40.01 + 0.99. Let f = s - 41.1. Let v = -0.47 - 0.03. What is the closest to f in v, -0.2, 1? -0.2 Let p(i) = 77i*2 - 2i + 1. Let a be p(1). Let u be 3/5 - a/60. Let f = 981 + -982. What is the closest to f in 2, -2/5, u? u Let j = -0.105 - -0.305. Let h be (74/(-76) + 1)(3 - 1). Which is the nearest to 1? (a) h (b) j (c) 0.5 (d) -5 c Suppose 24z - 78 = -15z. Suppose -zn - 13 = 3s, -3s + 2 = n + 10. What is the closest to s in 103, 0, -1? -1 Let u = -99 - -108. Let d be (1/27)/(9/243u). Let t(s) = s2 + 3s - 4. Let y be t(-4). Which is the nearest to 2/7? (a) y (b) 0.03 (c) d c Let n = 4 + -3. Let h = 20.02 + -22.3. Let t = h - -2.08. Which is the nearest to t? (a) -2 (b) 2/9 (c) n b Let l = -2.2 + 0.2. Let g = 4.989623 - -0.010377. What is the nearest to 1 in g, 11, 0.1, l? 0.1 Let i = 653 - 751.1. Let j = 98 + i. Let q = 5.1 - 0.1. Which is the nearest to -1? (a) 0.5 (b) q (c) j c Let s = 33 - 29. Let d = 35.53 + -30.53. What is the nearest to -1/4 in d, s, 0? 0 Let s = -219241/882 + 32/441. Let n = s + 248. Let o = -8.01 - -8. Which is the nearest to o? (a) -4 (b) n (c) 5 b Let v = 1880 - 1883. Which is the closest to 0? (a) v (b) 5.3 (c) -4/7 c Let j be ((-357)/90 + 4)(0 - (-5 + 1)). Which is the closest to j? (a) -2/11 (b) -4 (c) 0.3 (d) 2 c Let y = -5.046 + -2.954. What is the nearest to 3/4 in 1, 0.2, 0.02, y? 1 Let l = 211 - 215. Which is the closest to l? (a) -2/5 (b) -2 (c) -0.24 b Let q = -0.17 + 0.1. Let w = -0.23 + q. Let h = 21348/7 - 3050. Which is the closest to w? (a) 5 (b) -2 (c) h c Let t be (80 + -71)/((-243)/(-18)). Let n = 0.2 + 0.4. Let q = -0.06 - -1.06. What is the nearest to q in -2/15, n, t? t Let g = 1265/4512 + -31/96. What is the closest to -0.2 in 2/9, 0.5, g? g Let u be (2/(-5))/((-8)/15). Let g = 9.374 + -9.174. Which is the closest to 2/5? (a) u (b) g (c) 9/2 b Let n = 153 + -148. Let r be n/10((-1 - 5) + 2). Let z = 1.3 + -1. Which is the closest to r? (a) 0.5 (b) -0.4 (c) z b Let h = -0.0375 + 0.0449. Let i = h + -0.2074. What is the closest to i in 6, 3/4, 0? 0 Let n = 7521 - 7521. Which is the nearest to -54? (a) -0.2 (b) n (c) 0.2 (d) -0.4 d Suppose 0 = -3666j + 3547j + 238. What is the closest to 2/3 in 4, j, 28.23, -3/2? j Let h be -11 - ((-2)/(-30) - 11). Which is the closest to h? (a) 0.3 (b) -46 (c) 4 a Let f be (-3 + 4)/(24/88 + 9567/132). Which is the closest to 2/5? (a) f (b) -0.3 (c) -0.4 (d) -1/4 a Suppose -3d = 9i - 146 - 169, 0 = -4i - 24. What is the nearest to -0.1 in -2, d, 1/4? 1/4 Suppose a = -a + 2. Let n = -1 - a. Let f = 0.095 + -0.095. What is the closest to -1/4 in f, -1, n? f Let k = 113.46 - -19.84. Let o = 133 - k. Let r = -2.7 + 1.7. Which is the nearest to r? (a) 2/7 (b) o (c) 2 b Let i = 417 + -413. Suppose 8 = 2r + 10u - 15u, -16 = iu. Which is the closest to -1/4? (a) r (b) -3 (c) 5 b Let r be (-17 + 2)/5 - (-184)/64. What is the closest to r in 0.07, 3, 0.5? 0.07 Let q = -15.797 - -15.997. Let n = 0.26 - -0.04. What is the nearest to 2 in q, n, -6? n Let r = 84 - 79. Let p = 35.36 + -0.36. What is the closest to p in -2, -2/7, r? r Suppose -25c = -161 - 102 + 13. What is the nearest to 1 in -3/2, -0.3, 1/5, c? 1/5 Let l = -131.3 + 10.3. Let y = 122 + l. Which is the nearest to y? (a) 2 (b) 2/9 (c) -1 b Let r = -32.37 + 0.37. Let m = -170 - -170	{ "pile_set_name": "DM Mathematics" }
-17101040s2 + 24199s - 58. -34202080 Differentiate 109177ftu + 77fu2 - 1917tu - 2t + 822u2 wrt f. 109177tu + 77u*2 What is the derivative of 5276425p*4 + 12895620? 21105700p*3 Find the third derivative of 2q*4s + 11767522q3s + 2q2s - 13083880q2 wrt q. 48qs + 70605132s What is the derivative of 3f3w - 552f3 + 12f*2 + 60385fw2 - 5fw - 1102 wrt w? 3f*3 + 120770fw - 5f Find the first derivative of -8731073r3 - 46035043 wrt r. -26193219r*2 Find the third derivative of 258432474p*4 + 4p*2 - 1098p - 3231 wrt p. 6202379376p What is the second derivative of -120907859a*2 - 118702602a wrt a? -241815718 Differentiate -104166566n + 33065853. -104166566 Find the third derivative of 3306805m*3 + 15m*2 - 224761m - 2 wrt m. 19840830 Find the second derivative of -2t5 + 265952597t*3 + 395364042t. -40t3 + 1595715582t Find the third derivative of 72114448o3 + 807o*2 - 918o + 20 wrt o. 432686688 What is the third derivative of 535683m4 - m3 + 4m*2 - 883m + 147? 12856392m - 6 Find the third derivative of 28506995ry3 - 6ry2 - 119547y*2 wrt y. 171041970r Differentiate 65692790w3 - 74595970. 197078370w*2 What is the third derivative of 11961973j*3 - 87323284j*2? 71771838 What is the third derivative of 13661178h*6 - 2h*4y2 - h2y2 + 54h*2 + hy + 3h - 418y + 3 wrt h? 1639341360h3 - 48hy2 What is the first derivative of -77uz2 + 53247uz - 86659194u - 2z2 wrt z? -154uz + 53247u - 4z What is the first derivative of -420211410j - 265383474 wrt j? -420211410 What is the third derivative of 783958w4 - 9w*3 - 2w*2 - w - 6589008 wrt w? 18814992w - 54 What is the second derivative of 2p5 + 458p*4 + 494p*2 - 9286p + 271? 40p3 + 5496p*2 + 988 Differentiate -25480q*2 + 1301q - 300035355 with respect to q. -50960q + 1301 Find the third derivative of dlp3 - 2487064dl - 6dp3 - 7lp3 + 33p3 + p2 wrt p. 6dl - 36d - 42l + 198 Find the third derivative of 179909616s6 + 130s*2 + 8528s - 8 wrt s. 21589153920s3 What is the second derivative of 1105039p*5z - 1026pz + 15423z + 2 wrt p? 22100780p*3z What is the third derivative of 83819n5o + 60n3s*2 - 35n*2o - 2849nos - 25s*2 wrt n? 5029140n*2o + 360s2 What is the second derivative of 58p*3t*3 - 55851p*2t*3 - 2pt2 - 3t*3 + 68t*2 - 30t + 2 wrt p? 348pt*3 - 111702t*3 Differentiate 2019602y - 1895089 with respect to y. 2019602 What is the second derivative of jk3 + 7226jk2 + 21jk - 2j - 21293k3 + 73k - 189 wrt k? 6jk + 14452j - 127758k What is the second derivative of 31h2s*2u + 640h2su - 10h*2u + 57hs*2 + 24hs - hu - 4h - 14u wrt h? 62s2u + 1280su - 20u Find the second derivative of 67716962m*5 - 28516530m. 1354339240m3 What is the second derivative of -25625i*3 - 395i*2 - 114i - 51614 wrt i? -153750i - 790 What is the second derivative of -1776swz*2 + swz - 34372w*2z2 - w2z - w2 + 6858990w wrt z? -3552sw - 68744w2 What is the third derivative of -27160559f4 + f3v2 + 20f*2v*2 + 6720938v wrt f? -651853416f + 6v*2 Find the third derivative of -657206577f*3 - 1056111126f*2 wrt f. -3943239462 Find the third derivative of 443f*6 - 8148f*3 + 30710960f*2 wrt f. 53160f*3 - 48888 Find the third derivative of 387k*2n*3 + 11k*2n - 5491kn*3 + 2kn - 39809k - 2n3 - n2 wrt n. 2322k*2 - 32946k - 12 Find the third derivative of -822i6 - 2i*4 + 36917i*3 - 9656i*2 - 40i + 31 wrt i. -98640i3 - 48i + 221502 What is the first derivative of -222c3i*2 - 117ci2 - 24c - 106514i2 + 158 wrt c? -666c*2i*2 - 117i*2 - 24 What is the second derivative of 36o*2s*3 - 83o*2s*2 + 4o*2s + 120o2 + 28os3 - os*2 + 2o + 1050s3 - 9s*2 wrt o? 72s*3 - 166s*2 + 8s + 240 What is the third derivative of 10441888s4 + 17083885s*2? 250605312s Find the third derivative of -13q4 - 6574605q*3 - 863022571q*2 + q wrt q. -312q - 39447630 Differentiate 18695429fu - 71u - 17283 with respect to f. 18695429u What is the second derivative of 2h2i*2j*2 + 4766h*2j*2 - 26h*2 + hj + 274367i2 + 905j*2 wrt j? 4h*2i*2 + 9532h*2 + 1810 What is the derivative of -13l*2v*2 - 246lv2 - 39lv + 5614v*2 - 86v wrt l? -26lv*2 - 246v*2 - 39v Find the second derivative of -80fq*2u*2 + 17381fq2u - 1641fqu2 - 3fu + 41q*2 - 3u*2 wrt u. -160fq2 - 3282fq - 6 What is the second derivative of 60r*2t*3 + 19385r*2t*2 - 2r*2t - 16rt + 3t - 1077 wrt t? 360r*2t + 38770r2 What is the derivative of 2x*3 - 9885958x*2 + 12699066? 6x*2 - 19771916x What is the derivative of 17f3l - 13140f3 - 12flx + 2987fl + 1416fx - l wrt l? 17f3 - 12fx + 2987f - 1 Find the third derivative of -102211y6 - 12y*4 - 2y*3 + 16248969y*2 + 9 wrt y. -12265320y*3 - 288y - 12 Find the second derivative of 8539150p2 - 103860p + 294 wrt p. 17078300 Find the second derivative of -87h3n*2t + 29975h3nt2 + h3n - 4h2n*2t + 2hn*2 - 124ht + 3h - 247n2t*2 wrt t. 59950h*3n - 494n2 What is the derivative of 76681267l + 176121906 wrt l? 76681267 Find the second derivative of -5109c2g*2 + 108c*2g - 65cg*2 + 2g*2 - 887g wrt g. -10218c2 - 130c + 4 Find the second derivative of -5592u5 + 392u*3 + 5u + 15325 wrt u. -111840u3 + 2352u What is the third derivative of -45957852mz*3 - 28375m + 830z2 wrt z? -275747112m Find the third derivative of -82230878t4 + 33t*2 - 2406317 wrt t. -1973541072t Find the third derivative of 22g2i3 + g2i + 6g*2 + 227gi3 - 8gi2 - 424i*3 - 3i*2 + 23740 wrt i. 132g*2 + 1362g - 2544 Find the third derivative of -4723867j2v3 - j2v2 + 5227592j*2 - 2jv4 - jv*2 wrt v. -28343202j*2 - 48jv Find the third derivative of -77157820u*3 + 69972u*2 + 367u. -462946920 What is the derivative of 110793859k3w - 1763k3 - 2k*2w - k*2 - 1409 wrt w? 110793859k*3 - 2k*2 Differentiate 21296m*2w*2 + 73006302m*2 + 512mw2 with respect to w. 42592m*2w + 1024mw What is the third derivative of 699335t5 - 3t*3 + 1513t*2 - 1058 wrt t? 41960100t*2 - 18 Find the first derivative of 27799512y*2 - 49564282 wrt y. 55599024y Differentiate 6597981iu*3 - 9u*3 - 4u*2 + 4814u wrt i. 6597981u3 Find the second derivative of 145801961p*4 + 140050p - 14. 1749623532p2 What is the second derivative of -5537932o*3v*2 - 19o*3v - 1061o2v - 2ov - 2o wrt v? -11075864o*3 Find the third derivative of -324669n*6 + 21n*4 - 2n*2 - 154874466n wrt n. -38960280n3 + 504n What is the first derivative of -49858040m - 91174102? -49858040 Find the second derivative of 4355232j*2 + 1018j + 7161 wrt j. 8710464 Differentiate 32849422t3 - 35690342 with respect to t. 98548266t*2 Find the third derivative of -2k*3s*3 - 677454k*3 - 553k*2s - k*2 - 2ks2 + 820s*3 wrt k. -12s*3 - 4064724 Find the second derivative of 7w*4 + 16583586w3 - w2 + 853323444w. 84w*2 + 99501516w - 2 Find the third derivative of -12o5 + 90o*4 - 1000o*3 - 188o*2 - 6340o. -720o2 + 2160o - 6000 Find the second derivative of 2637939l2t + 1368246l + 2t wrt l. 5275878t What is the third derivative of 19833058p*3 + 3592p*2 - 24773p wrt p? 118998348 What is the first derivative of 8bx - 252496227b + 9869987x*2 wrt x? 8b + 19739974x What is the second derivative of 758458p*5 - 3p*3 + 2517203p wrt p? 15169160p3 - 18p Find the third derivative of 7p5 + 8075603p*4 + 70894p*2 - p - 100. 420p*2 + 193814472p What is the second derivative of 46f3t*3 - 16f*3t + 86f2t - 53968ft*3 - 22ft - f - 144t wrt t? 276f3t - 323808ft What is the third derivative of -4f6 - 921f*5 + 207f*3 - 10646f*2 - 69f? -480f3 - 55260f*2 + 1242 Find the second derivative of -233782h*3 + 836h*2i + 10hi + 2330391h - 3i wrt h. -1402692*h	{ "pile_set_name": "DM Mathematics" }
assuming q is positive. q*(179/11) Simplify (v/(v/(vv*(-38)))v)/(v/(vv(-14)v)) assuming v is positive. v(-49) Simplify ((f/(f(-1/9)/f))/f9)(2/9) assuming f is positive. f*(-124/81) Simplify (ii(-1/14))/(i/i2)(i(-1))(-34) assuming i is positive. i(503/14) Simplify (q/q(-3))/(q/q(2/17))(q(-1/2))(5/4) assuming q is positive. q(339/136) Simplify g(-5)g13 assuming g is positive. g8 Simplify (v0/(v/(v/(v1v))))/(v*(-2)/(vv(-1/3))) assuming v is positive. v(2/3) Simplify (zz(-5/2))/z8z*8z/(z*(1/6)z) assuming z is positive. z(-5/3) Simplify (g(-2/9)/(g(1/7)/g))(-6/11) assuming g is positive. g(-80/231) Simplify q3qq(-6/11) assuming q is positive. q(38/11) Simplify (bb1)(-31)/((b4b)/((bb5bb)/b)) assuming b is positive. b(-60) Simplify ((k/(((k/((kk/k*(-5))/kk)k)/k)/k))/k)/(kk/k17) assuming k is positive. k22 Simplify (p*(1/7)p)20 assuming p is positive. p(160/7) Simplify (ccc/(c/(cc/(c/((c/c(1/10))/c))))c(3/2))(-8/7) assuming c is positive. c*(-176/35) Simplify vv*(-7/6)v(vvv(2/73)v)/v assuming v is positive. v*(1253/438) Simplify (ff*(-4)f1)/(f(-2/3))(-2/27) assuming f is positive. f(-166/81) Simplify (m/m0)27/(m/(m*2m)mm/m*3m) assuming m is positive. m*29 Simplify ((fff(3/4)ff)/f(f/f*(-4/7)f)/f)/(f(2/13)/f(-3)) assuming f is positive. f*(789/364) Simplify ii*3i(ii*(1/7)i)/ii((i/(i*0i))/ii)(-41) assuming i is positive. i(50/7) Simplify (n2(nn/(nnn/(n1/n)nn))/n)/(n7n/n*(-3)n) assuming n is positive. n(-14) Simplify ((z(-1/3)z)13)(-12/5) assuming z is positive. z(-104/5) Simplify (o/(oo7))/((o/o(-6/7)o)/o) assuming o is positive. o(-62/7) Simplify x8x*(-2/7)(x/(x2/x))(-9/8) assuming x is positive. x*(54/7) Simplify (ggg8)(-18) assuming g is positive. g(-180) Simplify ((i(-2/5))(-9/4))26 assuming i is positive. i(117/5) Simplify ((q(-1/5)q)/q*(-5))/(((q/(qqq(3/5)))/q)/(q6/q)) assuming q is positive. q(67/5) Simplify p(-1/6)/(p/(p/(p/p(-2))p))(p/p(5/2))/(p(-1/8)pp) assuming p is positive. p(-133/24) Simplify (n1/(nnn(-6)/n))/(n/(n(1/11)n)n/n(-2)) assuming n is positive. n(34/11) Simplify ((u(-5)u)/((u/u*(-2/9)u)/uu))(-18) assuming u is positive. u112 Simplify (g(-8)/gg8)20 assuming g is positive. g*(-20) Simplify (v(v/(v/v*(-2/15)v))/vv)/(v/(v/(vv*(-2/9))))(v/(vv1))(-6/5) assuming v is positive. v(13/45) Simplify (www/w2ww)49 assuming w is positive. w147 Simplify ((x(-1))(-26/3))46 assuming x is positive. x(1196/3) Simplify ((q(1/4))39)(-22) assuming q is positive. q(-429/2) Simplify r(2/11)r*(-2)rrr*(1/7)r4 assuming r is positive. r(333/77) Simplify (d(-4/11)/d(-9))42 assuming d is positive. d(3990/11) Simplify l/(l*(-17)/l)llllll15 assuming l is positive. l39 Simplify (m(2/7)m)*(-2/3)/(mm*(1/3)m/((((mmm*(-1)m)/m)/m)/m)mm) assuming m is positive. m(-130/21) Simplify (s(-4/13)s)/s(-2) assuming s is positive. s(35/13) Simplify (x(2/5)xx)(-34/7)/(xxx1)(-13) assuming x is positive. x(957/35) Simplify (g/(gg*13)ggg*(-2/15)g)29 assuming g is positive. g(-4408/15) Simplify (h0)(-3/19)h(-1/2)h*0 assuming h is positive. 1/sqrt(h) Simplify (h/(h/((h/(hh*(-3)h))/hh)h)h)/(h(-1/9)/h) assuming h is positive. h(28/9) Simplify (h/(hh*15h))(-6/5) assuming h is positive. h(96/5) Simplify (((y0/y)/y)(-21))(-20) assuming y is positive. y(-840) Simplify (nnn*(1/4)n)(4/25)/(n(-3/5)/(n/(n/(nn(-1/2)n)))) assuming n is positive. n(131/50) Simplify d(-4)/d*(1/6)(dd(-2/21))/dd*(2/9)/dddd assuming d is positive. d(-257/126) Simplify (l33/l)/(ll/(ll1)) assuming l is positive. l32 Simplify (v(-1)/v)37(v/(vvv/(v/(vvv(-10)))))/((vv/v4)/v) assuming v is positive. v(-64) Simplify l/l*0l/(ll(-3/2))l assuming l is positive. l*(7/2) Simplify (((y/((y/(y(y*(-3)/yy)/yy))/y))/y)/((((y(-5)/y)/y)/yy)/y))16 assuming y is positive. y96 Simplify (b*(6/7)/bb(7/4))/((b(-8)b)/(((bbb(-1/6)b)/b)/b)) assuming b is positive. b(793/84) Simplify (p(-1/2)p)(6/11) assuming p is positive. p(3/11) Simplify (((gg*24g)/g)/g)(-8/3) assuming g is positive. g(-64) Simplify (o/(o(ooo(o/(o/(o/o20)))/o)/o))/(o/o(2/9)) assuming o is positive. o(155/9) Simplify (r(-1/13)/r(2/7))(2/21) assuming r is positive. r(-22/637) Simplify h(-2/19)/(h*(-1)h)h(-2/7)h(-3)/h assuming h is positive. h(-584/133) Simplify (c*1c)/(c*8c) assuming c is positive. c(-7) Simplify p(1/2)/ppp/(ppp*0p)(p/(p(pp/p(-1/3))/p))16 assuming p is positive. p(-137/6) Simplify ((o/(o/((oo/o*(-1/4))/oo))o)/((oo(2/13))/o))(2/29) assuming o is positive. o*(161/754) Simplify (kk(1/2))(19/5)/((kk/k2)/kk)(-15/4) assuming k is positive. k(57/10) Simplify (g/(g*(-1/3)/g)g/g*0)/((((ggg/(g2g))/g)/g)/g(-5/3)) assuming g is positive. g(11/3) Simplify (j*(21/4)/jj)/(jjj/j*(-17)jjj) assuming j is positive. j(-71/4) Simplify (l(-9)/l)/((l(((ll*7)/l)/l)/ll)/l)(l0)26 assuming l is positive. l(-16) Simplify ((d/(dd/d(2/13)))(-49))8 assuming d is positive. d(4312/13) Simplify g*(-5/9)gg(-3/5)/g assuming g is positive. g(-52/45) Simplify (((h(1/2)/h)/h)/((hhh(2/5)h)/hhh))(-37) assuming h is positive. h(2183/10) Simplify z15/z(-8) assuming z is positive. z23 Simplify (k8k)/kk/(k/(kk(kk(-3/11)k)/k)) assuming k is positive. k*(118/11) Simplify (hh15)(-37) assuming h is positive. h*(-592) Simplify ((rr/(r/(rr3))r)/r)/r(1/4) assuming r is positive. r(19/4) Simplify ((k*(-1)/k)/kkkk*2kkk)/((k/k*3)/(((k(kk(-2/7))/k)/k)/k)) assuming k is positive. k(33/7) Simplify (t(17/3))(-2/7) assuming t is positive. t(-34/21) Simplify (f/(ff*(3/19)))/ffff(-3/10) assuming f is positive. f(103/190) Simplify (i*3/ii)/i(i/i19)/i assuming i is positive. i(-17) Simplify bb/(b/(bb0b))b(1/4)(b*(2/5)b)/(b(1/9)/b) assuming b is positive. b(997/180) Simplify (r(1/10))29 assuming r is positive. r(29/10) Simplify (v(-1)vv/(v*(-5/2)/vvv))/((v/(((vv(-2))/v)/v))/(v/(v7/v)vvvv)) assuming v is positive. v(-5/2) Simplify ((l/(l/(((l14/l)/l)/l)))/l)(13/5) assuming l is positive. l26 Simplify (ff(2/5)f(1/3)/f)34 assuming f is positive. f(374/15) Simplify (z/z(-2/7))/(zz(-1/6)) assuming z is positive. z(19/42) Simplify ((o/o(5/3))/o)/(oo17) assuming o is positive. o(-59/3) Simplify (k/k(4/5))(-37) assuming k is positive. k*(-37/5) Simplify (ttt2tt)/(tt(-33)) assuming t is positive. t38 Simplify (t/(t(tt(ttt(-4/9)t)/tttt)/t)tt(-4/9)t)/(t*4t*1t) assuming t is positive. t*(-10) Simplify (dd/d*6d*(3/2)d)/((d/d*(2/11)d)/d(-1/6)) assuming d is positive. d(-115/33) Simplify ((l*(2/15)ll)/l(1/2))/((l/l7)/ll/(l/(l(-2/3)/l))) assuming l is positive. l(103/10) Simplify ((u*(1/3)/u)/((uuu/(u/u(-6))uu)/uu))/(u*3u(-2/7)/u) assuming u is positive. u(-8/21) Simplify (w/(((w/w(-27/2))/w)/w))/w(-25) assuming w is positive. w(27/2) Simplify (m(-3/2))*(-37)(m/((mm(2/5))/m))/(m/(mmm(-4))) assuming m is positive. m(531/10) Simplify (w/(w/(w/(w(-7/2)/w)))w(3/2))8 assuming w is positive. w56 Simplify (v/((v(-1)/v)/v))*(-32)(v*(-4)/v)/(vvv/(v(v/((v0/v)/v))/v)) assuming v is positive. v(-133) Simplify ((vv(2/7))/v)(6/13) assuming v is positive. v(12/91) Simplify (t/(tt*(-1/8)/tt)ttt)50 assuming t is positive. t(625/4) Simplify w(-3/10)w17 assuming w is positive. w(167/10) Simplify (ll3l)36 assuming l is positive. l180 Simplify ((i*(4/7)/i)/(iiii(3/2)/i))/((i(-4)i)/ii(-3/4)) assuming i is positive. i(23/28) Simplify (cc/((cc/((cc4/c)/c))/ccc))/c(7/5) assuming c is positive. c(3/5) Simplify ((ww(-3/2))/w)(-17) assuming w is positive. w**(51/2) Simpli	{ "pile_set_name": "DM Mathematics" }
6. Let a be o(v). Let k = -30 + a. Let w(c) = c*3 + 2c*2 - 2c + 2. What is w(k)? -1 Let h(d) = -2d - 5. Let f be 17/6 + 37/6 + -6. Determine h(f). -11 Let y be -42/12(-3 - 0). Suppose 3i - 14 = -5. Let m(h) = 1 + 7h + yh - 3h - ih. Give m(-1). -2 Suppose -122z = -108z - 28. Let c(p) = -6p - 1. Suppose 3m + 20 = -5d - m, m + 4 = -d. Let u(w) = 6w + 1. Let k(o) = dc(o) - 5u(o). Calculate k(z). -13 Let v = 23 - 25. Let f be (-2)/4 - v/4. Let w(k) = k2 - 1. Determine w(f). -1 Let m(k) = -k2 + 6. Let d = 3 - 0. Let q(r) = -r2 - 2. Let o be q(0). Let v(g) = -g2 - g + 7. Let w(p) = dm(p) + ov(p). Determine w(5). -11 Let n(t) = 5t + 1. Let z(x) = x2 + 8x + 2. Let f be z(-8). Suppose fr = -u + 4, r = -2u - 2u - 5. Determine n(u). -9 Suppose -3m = k - 16, 0k + 3k = -m. Let j(g) = -g + 2. Calculate j(m). -4 Let l(c) = -c*3 + 0c + 11c2 + 2287 + 0c*3 - c - 2271. Calculate l(11). 5 Let j(h) = 4h + 27. Let m be j(-5). Let v(x) = -9 - mx + 14x*2 - 8x*2 - 5x*2. Calculate v(7). -9 Let d(s) be the first derivative of 3s + 16 - 1/2s2. What is d(7)? -4 Let p be (-1 - 7)(-1)/2. Suppose -5c = -2o - 113, 7c = pc + 4o + 65. Let r = c + -18. Let a(k) = -k2 + 5k + 2. Determine a(r). 2 Let p(m) = 13m2 + m. Suppose 4l - 2i + 4 - 50 = 0, -l + 8 = 3i. Suppose ln - 1 = 12n. Give p(n). 12 Let p(q) = 10q2 - 7q + 6. Let s be p(1). Let w(x) = 5x - 2x + 3 - sx. What is w(3)? -15 Suppose 2c - 4i = -68, 0 = -5c - i - 156 + 8. Let w be (-12)/c + (-6)/(-10). Let s(j) = w + 2j + 2 - 3. Determine s(2). 4 Let f(k) = 4k + 141. Let w be f(-37). Let b(r) = -2r2 - 11r - 10. Give b(w). -31 Let k be ((-243)/(-135))/(6/(-20)). Let y(d) = -6 - 2d + 2 + d + 1. Determine y(k). 3 Let u(l) = -11l*2 - 35l - 48. Let c(v) = -2v2 - 3v - 1. Let s(a) = -6c(a) + u(a). Determine s(19). -4 Let h(m) = -7 - 10 + 10 - 2m + m*2. Let j be h(5). Suppose jo - 3o + 30 = 0. Let g(l) = -l3 - 7l*2 - 5l - 2. Give g(o). -8 Let v = 10 - 5. Suppose -vy - 25 = 3f, f - 10 = -0f + 2y. Let z be -2 + -5 - (f + -1). Let t(m) = -m*2 - 5m + 3. Determine t(z). -3 Let l(z) be the first derivative of -1/360z6 - 2/3z*3 + 0z + 0z2 + 7/120z*5 + 3 - 1/6z*4. Let t(g) be the third derivative of l(g). Calculate t(6). 2 Let x(v) = -3v*2 - 3v - 2. Let o(k) = -4k2 - 5k - 1. Let y(j) = -4o(j) + 5x(j). Suppose 0 = -0q + 4q + 3c + 28, 3q - 4c + 21 = 0. What is y(q)? 8 Let k(m) be the first derivative of -m4/4 - 4m*3/3 + 5m2/2 - m + 6. Calculate k(-5). -1 Let l(h) = -h3 - 9h2 - 7h + 5. Suppose -31j = -j + 240. What is l(j)? -3 Let c(n) = -n - 1. Let u(x) = 20x + 7. Let a(p) = 6c(p) + u(p). Let j(l) = l3 - 17l*2 + 37l - 335. Let y be j(16). What is a(y)? 15 Let a(d) = d*2 + 3d - 5. Let t be ((-3)/4)/(117/(-520))-3. Let p(i) = i3 + 11i*2 + 12i + 15. Let u be p(t). Calculate a(u). 5 Suppose 0 = -2q - 1 + 17. Let o(n) = 4n*2 - 16n - 7. Let p(w) = 3w2 - 13w - 7. Let c(b) = 2o(b) - 3p(b). Calculate c(q). -1 Let k(s) be the first derivative of -29s2 + 0s + 9s - 24s*2 + 54s*2 + 14. What is k(-8)? -7 Let i be (-15 - -1)/(-4 - -2). Let g = 0 - -9. Let t(y) = -y + 9 + 8 - g. Determine t(i). 1 Suppose 62z - 24 = 66z. Let a(t) be the first derivative of t2/2 + 2. Give a(z). -6 Let u(k) = k3 + 8k*2 + 4k + 6. Let c be u(-7). Suppose -5m + c = 12. Let t(f) = 2f - 1 - 6 + 4. Calculate t(m). 3 Let t(p) = -4p2 + 4p - 3. Let j(n) = -n*3 - 10n*2 - 12n - 2. Let x be j(-8). Let b = x - -36. Determine t(b). -11 Let f(g) = -g*2 + g + 1. Let s(u) = -5u*2 + 10u + 10. Let o = 44 - 38. Let y(p) = of(p) - s(p). What is y(-4)? -4 Let a(b) = 3b + 6. Let i(u) = 3u - 9 + 10 + 4. Let n(o) = 6a(o) - 7i(o). What is n(-5)? 16 Let f(u) be the first derivative of 2u*2 + 7u - 7. Calculate f(-4). -9 Suppose -5g - 10 = 2h - 2, -2h = 3g + 8. Let q(m) = 0m - 14m - m*2 + 8m + gm2 + 5. Give q(-5). 10 Suppose 33 = 5c - 34j + 36j, 5c - 32 = -3j. Let o(m) = -3m + 14. Calculate o(c). -7 Let x(b) = -b2 - 3b + 5. Let r be -432/(-32)10/(-8). Determine x(r). -5 Suppose -46s = -51s + 640. Let o = s + -129. Let i(v) = v3 - 1. Calculate i(o). -2 Let b(n) = n2 + 7n + 7. Suppose -3 = -6k + 81. Let v be (0 + 8/6)(-63)/k. Calculate b(v). 1 Let g(y) be the second derivative of y5/10 - y4/4 + y3/6 - y2 - y. Let q = -4 - -7. Suppose -2p + qp - 2 = 0. Calculate g(p). 4 Let v be (2 - (-5)/(-2))(9 + -9). Suppose 3h + 0h = 9. Let a(s) = 4s - 5s + s*h + 0 + 2s - 1. What is a(v)? -1 Suppose 4f - 30 = -f. Let n(k) = 0k + k - k*3 - fk*2 - 5k. What is n(-5)? -5 Suppose 0 = 2y - 0 - 4. Let s be ((-3)/(-2))/(1/2). Let b(z) = sz - 3z - zy + 2z + 5 - z. Determine b(0). 5 Let k(w) be the first derivative of w4/8 - w3/3 + 13w2/2 - 12. Let y(r) be the second derivative of k(r). Let g = 41 + -37. Determine y(g). 10 Let i(t) be the first derivative of t3/3 + 7t*2/2 + 5t + 14. Let b(s) = s + 1. Let m(g) = b(g) - i(g). Suppose 4f + 16 = -0f. Determine m(f). 4 Let g(m) = -1. Let t(u) = 4u - 13. Let p(q) = 6g(q) - t(q). Calculate p(-4). 23 Let a(u) = 2 + 0u - 1 + 3u. Let n(f) = -f*2 - 63f - 654. Let w be n(-50). Give a(w). -11 Let m(w) = -17w2 - 24w. Let s(j) = 19j2 + 27j. Let q(p) = 9m(p) + 8s(p). Determine q(1). -1 Let r = -11 + 21. Let y be ((-4)/r)/(1/(-15)). Let c(o) be the second derivative of -o4/12 + o3 + o*2 + 195o + 2. Calculate c(y). 2 Let b(q) = -q*2 + 2q + 18. Let p be b(5). Let c(w) = -2w + 2. What is c(p)? -4 Suppose -2c + w - 11 = 0, 3c - 6c = 2w + 6. Let h(k) be the third derivative of k6/120 + k5/15 - k4/12 + k3/3 - 61k2. Determine h(c). 10 Let r(p) = -p - 1 + 2 + 0 - p2 + 2p3. Let b = -60 - -105. Let s = b + -44. What is r(s)? 1 Let c(x) = -x2 + 6x - 8. Suppose -120 + 90 = -10p. Determine c(p). 1 Suppose 14r = -3r. Let p(d) = 2d - 11. Determine p(r). -11 Let p be (-8)/(-32)16(-2 - -1). Let n(k) = k*2 + 4k - 2. Calculate n(p). -2 Let u(f) = -2f + 14. Let i be u(0). Suppose -21 = -5w + i. Let l(d) = -d*2 + 6d + 5. Give l(w). -2 Suppose 0 = -4q - 2p - 4, -4q + 2p + 0p = 20. Let u be q - (5/(-1) - -3). Let f(z) = -4z - 6z - 9z + 21z - 1. Calculate f(u). -3 Let c(o) = o3 + 33o*2 - 33o + 40. Let l be c(-34). Let h(t) = -t*3 + 5t*2 + 8t + 5. Give h(l). 17 Let z(d) = -d*3 + 6d*2 + 17d - 11. Let s be z(8). Let n(h) be the second derivative of h*3/2 + 2h2 + h. Let x be n(s). Let w(t) = -t + 2. What is w(x)? 7 Let t(x) be the first derivative of x2/2 + 2x - 111. Let h = -18 - -12. Determine t(h). -4 Let t(r) = 2r*2 - 14r + 4. Let b(l) = -4l2 + 29l - 9. Let c(a) = 6b(a) + 13t(a). Let j(p) = -p + 14. Let y be j(8). Calculate c(y). 22 Let g = 24 - 18. Let x(f) = -7f2 + 16f + 2. Let u(a) = -15a2 + 34a + 3. Let p(o) = 6u(o) - 13x(o). What is p(g)? 4 Suppose 6d + 3d + 90 = 0. Let l be (-8 - 0)/((-1)/(-2)). Let q = d - l. Let g(c) = c - 1. Calculate g(q). 5 Let r(o) = o*3 - 4o*2 - 6o. Suppose -c - 5h = -4 - 10, 2c = -h + 10. Suppose cj + 9 = -11, 5j + 29 = 2g. Suppose g - 17 = -3a. Determine r(a). -5 Let v(o) = o*2 - 14o - 67. Let x be v(-4). Let m(i) = 2i2 - 3i - 9. What is m(x)? 26 Let s(v) = -3v + 0v + v*2 + 0v - v + 3. Suppose 0 = 21u - 57 + 15. Give s(u). -1 Let m(y) be the second derivative of -y4/12 + 17y*3/6 + 6y*2 + y + 19. Calculate m(18). -6 Suppose 55 - 95 = -20x. Let v(j) = -j*3 + 3j - 2. Calculate v(x). -4 Let t(q) = 0q + 5q*2 - 7q*2 - q + 1. Determine t(-2). -5 Let z(v) be the first derivative of 1/2v*2 + 7/6v*3 + 2 - 5v. Let f(m) be the first derivative of z(m). Calculate f(-2). -13 Let u(a) be the third derivative of -a5/5 + a3/6 - 117a2. Calculate u(-1). -11 Let y(i) = -i3 - 9i*2 - 8i + 3. Let q be y(-8). Let t(m) = -10 + m + 11 + 3m2 - qm2 - m2. Determine t(1). 1 Let t = 4395 + -4395. Let q(k) be the first derivative of -k3/3 + k2/2 + 9k + 1. What is q(t)? 9 Let a(l) = l + 12. Let i = -194 + 194. Calculate a(i). 12 Let g be (4 + -2 - 0)-2. Let t(q) = 2q3 - 2q*2 - 9q. Let u(v) = 3v3 - v2 - 10v. Let i(b) = gt(b) + 3u(b). Suppose 20	{ "pile_set_name": "DM Mathematics" }
) -0.2 (c) x (d) 0 c Let h = 1.4327 + 1.5673. Which is the third smallest value? (a) 7 (b) -0.13 (c) h (d) -9 c Let j = -0.191 - 0.209. Let w = 4 - 3. Let z = -25 + 20. Which is the third biggest value? (a) w (b) j (c) z (d) -3 d Suppose 33 = -1271h + 1238h. Let v = -2/13 - 16/65. What is the biggest value in h, -3.6, v? v Suppose -3m + 8m + 271 = 2b, b = -3m - 167. Let c = m - -50. What is the smallest value in -11, -2/7, c? -11 Let q = -1/192 + -569/1344. Let n = -196 + 198. What is the fourth smallest value in 0.1, q, -0.4, n? n Let x = 29.9921 + 0.0079. Which is the smallest value? (a) x (b) -4 (c) 4 (d) 2/21 b Let y be 2/(-14)(-38 + 15 + 20). Which is the second biggest value? (a) 5 (b) y (c) 4 (d) 1.2 c Suppose 53x - 54 - 211 = 0. Which is the third smallest value? (a) 0 (b) x (c) -4/5 (d) -3 (e) -2/5 e Let t = -3/386 - -11631/6562. Let v = 317.347 - 317.047. Which is the second biggest value? (a) -5 (b) v (c) t b Let n = 994/27 - 1012/27. Let f = 0.1 + -0.09. What is the third smallest value in 0, f, n, -0.07? 0 Let o = 66.5 - -8.5. Let q = 126 - o. Which is the third smallest value? (a) q (b) 3/2 (c) 5/2 a Let h = 482/7 - 69. Let k = 30 + 17. Let u = -49 + k. Which is the third biggest value? (a) u (b) h (c) -0.3 a Let v = 143 - 343. Let q = v - -201. Which is the third smallest value? (a) q (b) 0.07 (c) -4 (d) -0.01 b Suppose -96 = -45m + 13m. What is the third smallest value in -0.2, 196, m? 196 Let f(x) = 3x3 - 72x*2 - 75x - 4. Let r be f(25). Which is the biggest value? (a) 0.146 (b) -1 (c) -5/8 (d) r a Suppose 33l + 12l = 225. Suppose 28w - 6 = 27w - 5g, -lw - 78 = -2g. What is the third biggest value in -1/3, w, -0.2? w Let f = 39233 - 156933/4. Which is the biggest value? (a) -3 (b) 2/3 (c) f (d) 1/4 (e) 31 e Let o = 12.35 + -12. Let y be 12/(-10)(493/34 + -15). Let k be -5 + (-329)/(-63) - 376/72. Which is the third smallest value? (a) k (b) y (c) o b Let j = 2378 + -2377. Let k = 208.6 - 209. Suppose -5i = -0i + 20. What is the fourth smallest value in k, 0.4, j, i? j Suppose 12n - 14n + 4480 = -4k, -4484 = -2n + 3k. Which is the biggest value? (a) 2 (b) n (c) 2/15 (d) 0.1 b Let d(f) = f2 + 4f - 6. Let o be d(2). Suppose 0z + 3z - o = 0. Suppose -2m + z = 4. Which is the third biggest value? (a) m (b) 3 (c) 3/7 a Let u = -399 + 381.3. Let k = 14 + u. Let q = k - -3.8. Which is the third smallest value? (a) q (b) -6/5 (c) -3 a Let d = 0.3 + -1.3. Let b = -368 + 1183. Let h = 810 - b. What is the fourth biggest value in h, -8, d, -0.3? -8 Let v = 6576 - 39455/6. Which is the fifth smallest value? (a) 4 (b) 0.3 (c) 0.05 (d) -0.004 (e) v a Let r = -5.094 - -5.294. Which is the second biggest value? (a) r (b) 1 (c) 65 (d) 2/13 b Let r = -683 + 683.3. Suppose 0 = 4p - 2p - 8, -13 = -5m + 3p. What is the third biggest value in -3/5, r, m, 2/3? r Let s = 24 + -24.265. Let d = s + -0.035. Which is the second smallest value? (a) -2/5 (b) d (c) 2/7 b Let i = -1337 + 14706/11. Which is the smallest value? (a) 1 (b) -3 (c) i (d) -9 d Suppose 4f - 8 = 0, 2f = 6k - 11k + 4. Which is the biggest value? (a) -0.1 (b) -0.4 (c) -2/23 (d) k d Let z = -4 + 8. Let i = -58065 + 754841/13. Which is the second smallest value? (a) 1/3 (b) z (c) 2/5 (d) i a Let t = -545835/68 + 8027. Which is the third biggest value? (a) 2 (b) -1 (c) t (d) -0.4 (e) -7 d Let q = 2.691 + -2.791. Which is the third biggest value? (a) 5 (b) q (c) -0.3 (d) -441 (e) 1 b Let p = -672 + 656. Let h = -14 - -24. Let o = p + h. Which is the smallest value? (a) -4 (b) o (c) 5 b Let j = -0.8878 - -1.0878. Which is the smallest value? (a) 1/3 (b) 176/7 (c) j c Let y = 0 + 0.5. Let n = -2948 - -85484/29. Let k be -73/(-4) + 558925/(-84900). What is the biggest value in y, n, k? y Let o = -949.17 - -945. Let p = 0.17 + o. Let n be (10 + 194/(-18))6/21. Which is the fourth smallest value? (a) n (b) 0.3 (c) p (d) 3 d Let w = 791 - 735.7. Let t = w + -63.3. Which is the second biggest value? (a) -9 (b) t (c) 2/11 b Let p = 13.4 + 3.5. Let u = 16.9 - p. What is the second biggest value in u, 2, 5, 0.3? 2 Let u = 2808 + -2810. Let h(p) = -p3 - 6p*2 - 5p + 3. Let o be h(-4). Let k = o - -13. Which is the smallest value? (a) 0 (b) u (c) k (d) 3/8 b Let m = 529.5 - 529.7. What is the biggest value in m, -7, 165? 165 Let i = 0 - 0.5. Let h = 69.325 - 72.325. Which is the third biggest value? (a) -5 (b) 0.1 (c) h (d) i c Suppose -2y = -0q - 4q, 0 = 2y + 5q - 45. Which is the biggest value? (a) y (b) -10 (c) 4 (d) -1 a Let q be (-22)/(-8) + 25/(10 + -15) - -2. Suppose -4d - 22 = -26. What is the third biggest value in 0.14, 2/11, q, d? 0.14 Let j = 108 - -96. Let b = j + -2242/11. What is the second biggest value in b, -6, -3? -3 Let o be (-1 + 2)(26 + -4). Suppose 17t = ot - 5. Let i = t - 6/5. Which is the fourth biggest value? (a) 4/5 (b) 0.1 (c) i (d) 5 c Let f = 0.1582 + 0.1418. What is the second biggest value in f, -2/5, -125? -2/5 Let s = 2 + 1. Let d = 4.54 + 0.46. Let r = -4 - -3. What is the smallest value in 4/5, d, s, r? r Let x = -134 + 131. Let h be 3 - (-5 - 42)1/(-15). What is the fourth biggest value in -5, x, 10, h? -5 Let r = 27095 - 27094.7. Which is the third smallest value? (a) 700 (b) 1 (c) -2/13 (d) r b Let h = -98/11 - -96/11. Suppose -4l - 13 = -3t - 2l, -30 = -5t - 5l. Which is the fourth biggest value? (a) 0 (b) t (c) h (d) -7 d Let f = 24112/9 + -2679. Which is the third smallest value? (a) f (b) 127 (c) 0 b Let x be 50/88 + (297/(-44))/9. Which is the fifth smallest value? (a) x (b) 3 (c) 0 (d) 216 (e) -3 d Let w = -1.28 - -0.28. Let s = -16.96 + 45.96. What is the third biggest value in 5, w, 0.5, s? 0.5 Suppose 4t + i + 8 = 0, -4i + 4 = -2t - 6i. Let y be (176/(-770))/(((-12)/(-15))/(-1)). Which is the biggest value? (a) 3 (b) t (c) 8 (d) y c Suppose 0 = 5w - 4d - 11, 5d = 3w + 9 - 26. Let g = -4.424 + 4.474. What is the second biggest value in g, 0.02, w? 0.02 Let k = -236842/27 + 8772. Which is the second biggest value? (a) k (b) 12 (c) 6 c Let w = 291.4 + -291.1. Let s = 0.1 + 0. Let q = w - s. Which is the third biggest value? (a) 0.7 (b) -1/5 (c) q (d) 3 c Let v = -7.5012 + 7.49. Let q = -0.1112 - v. Which is the biggest value? (a) -5/2 (b) q (c) 3/2 c Let l = -4.163 - -4.663. Let v = 0.1 - -4.9. What is the fourth biggest value in -0.5, -1/8, l, v? -0.5 Let u = -0.18 + 11.18. Let y = u - 14. Let t be (-35)/42 - 11/(-24). Which is the biggest value? (a) -4 (b) y (c) t c Let b = -146 + 1020/7. Suppose 12k + 588 = 5k. Let u = 87 + k. What is the second smallest value in b, 0, -0.4, u? b Let r be 2(-18 - (-3 + -7)). Let z be (-1)/(1 - 5)r. Let n = 11632/259 + -314/7. What is the third smallest value in n, z, -2/19? n Let c(o) = -6o - 4. Let m be c(-3). Let l be (-6)/22 + 496/528. What is the smallest value in 0, l, m? 0 Let z = -8.5871 + -0.4129. Which is the second biggest value? (a) z (b) 0.4 (c) 0.7 (d) 3/5 d Suppose 0 = -12u + 5u + 21. Suppose z + uz + 127 = -5v, v = -2z - 23. Let c = 30 + v. What is the smallest value in -1, 1, c? -1 Let g(r) = r3 + r - 4. Let f be g(0). Let l = -336.02 + 0.02. Let y = 333 + l. Which is the smallest value? (a) y (b) 0.2 (c) f c Let u = 33 + -33.3. Let p(t) = 3t - 29. Let f be p(11). Which is the third smallest value? (a) 2 (b) u (c) f (d) 5 c Let f = -0.979 - -0.479. Which is the second smallest value? (a) f (b) 1 (c) 47 (d) -2 a Let w be 2 + (-5)/(-6 + -4). Let t = 42/29 + -55/58. What is the second smallest value in w, t, 0.3, -1/8? 0.3 Let z = -150 + 321. Let v = 171 - z. Which is the second biggest value? (a) 0.5 (b) 3 (c) 0.03 (d) v a Let r(q) be the first derivative of -5q2/2 - 7. Let m be r(-4). Suppose m = 6f + 8. What is the fourth biggest value in f, -3, 0.1, 5? -3 Let p be (3/((-12)/10) + 1)288/(-216). Which is the biggest value? (a) 59 (b) -0.4 (c) p a Let t = -3.9 - -3.5. Let d(s) = -s2 + 11s - 21. Let o be d(8). What is the biggest value in t, o, -6.1? o Let d = -3099/24220 + -3/4844. Which is the biggest value? (a) 4/7 (b) 3/2 (c) d b	{ "pile_set_name": "DM Mathematics" }
or of a and 12? 6 Suppose 20n = 2i + 18n - 310, 467 = 3i - 5n. Calculate the greatest common divisor of 539 and i. 77 Let j(o) = o - 3. Let c be j(9). Suppose -15q + 117 = -cq. Calculate the highest common factor of q and 26. 13 Let h = -18 + 94. Suppose -4m + h = 4. What is the greatest common factor of m and 9? 9 Suppose 9t = 11t. Suppose -n + 0n + 2 = t. Calculate the highest common factor of 18 and n. 2 Suppose -2f = -6f + 1136. Suppose -5n = -0n + 2u - f, -u + 226 = 4n. Calculate the greatest common divisor of 14 and n. 14 Let r = 2 - -6. Suppose 5n - 339 = 2n. Let k = n + -49. Calculate the highest common divisor of k and r. 8 Let b be (2 - 0)/(((-10)/16)/5). Let x = 43 + -22. Let i = b + x. Calculate the greatest common factor of i and 35. 5 Let k(r) = r3 + 15r*2 - 20r - 31. Let u be k(-16). Calculate the greatest common divisor of u and 11. 11 Let b = 96 + -63. Let p be (110/b)/((-4)/(-6)). What is the highest common factor of 25 and p? 5 Suppose 5y + 26 = 2j, 9 = -j - 3y - 0y. Suppose 0 = 3n + j, 3n + 237 = -0c + c. Let u = -13 - -39. What is the highest common divisor of u and c? 26 Suppose 4q = -5v - 5, 4v + 6 - 23 = q. Let r = 19 + -17. Suppose 0 = rx + vx - 80. What is the greatest common divisor of 80 and x? 16 Let c(u) = -u*3 - 10u*2 - 10u - 10. Let m be c(-11). Suppose -5b + m + 69 = 0. Calculate the highest common divisor of 29 and b. 29 Let y(h) = 8 + 2h + h*2 - 8h*2 + 19h + 6h2. Let o be y(16). What is the highest common divisor of o and 8? 8 Let w(u) = u3 - 6u*2 + 6u. Let o be w(5). Suppose 3f + 9 = 0, 0 = -b + of - 5 + 22. Suppose -bn = n - 297. What is the highest common factor of n and 9? 9 Let c(j) = 5 - j3 + 11j*2 + 2j - 10 + j + 2. Let w be c(11). What is the greatest common factor of 60 and w? 30 Suppose -126l + 127l - 96 = -3a, 64 = 2a + l. What is the highest common divisor of 440 and a? 8 Let s(i) = -i + 16. Let p be s(1). What is the highest common factor of p and 75? 15 Suppose 0p = -4p + y + 49, 0 = -4p + 2y + 50. Let b be (-2 + (-50)/(-4))/(p/64). What is the highest common divisor of 84 and b? 28 Let h = -4 + 5. Let d(i) = -5i - 27i - 7i - h. Let v be d(-2). Calculate the greatest common divisor of 7 and v. 7 Let o be ((-4)/(-2) - 1)11. Suppose 0 = -5f - p - 175, 3f = 2p + 68 - 186. Let y = -25 - f. Calculate the highest common factor of y and o. 11 Suppose -4u - 54 = -94. Calculate the greatest common factor of u and 6. 2 Let l = 178 - 143. Suppose 37 + 14 = 3g - d, 2g - d - l = 0. What is the highest common factor of g and 2? 2 Let i(l) = -3l - 5 - 7l*2 - 6l*3 + 5l*3 + 6l. Let k be i(-9). Suppose -d = d - 104. Calculate the highest common divisor of k and d. 26 Suppose 4u - 360 = -4x, 49x + 477 = 54x - 4u. What is the greatest common factor of 3 and x? 3 Suppose 7x = 2x + 240. Let y = 22 - -10. What is the greatest common factor of y and x? 16 Suppose 21r - 3276 = -21r. What is the highest common divisor of r and 819? 39 Let h(b) = 8b - 28. Let n be h(11). Suppose -2a - 2a + 8 = 0. Suppose aq - n = -q. Calculate the highest common divisor of q and 5. 5 Let x(a) = -a3 + 7a*2 + 7a + 6. Let k be x(8). Let l be (8/10)/(k/(-60)). What is the greatest common factor of l and 6? 6 Let z(g) = g*3 + 4g*2 - g - 10. Let b be z(3). Let l = b - 41. Suppose -5h + 14 + 1 = 0. Calculate the highest common factor of h and l. 3 Suppose -3j + 53 + 43 = 0. Let m = j + -26. Suppose 0 = mw - w - 45. Calculate the highest common divisor of 27 and w. 9 Let r(u) = -2u2 + 3u + 5. Let l be r(-2). Let g be (-2)/l - (-748)/36. Calculate the greatest common factor of g and 147. 21 Let r be 6/4 - ((-42)/4)/3. Let k be (2 - 1) + -1 + 0. Let b = r - k. What is the highest common divisor of 1 and b? 1 Suppose 234 + 45 = f. Let c = -490 - -521. Calculate the highest common factor of c and f. 31 Let o(z) = 3z + 3 - 8 + 7z. Let x be o(4). Let p(r) = r*2 - 29r + 59. Let l be p(27). What is the highest common divisor of l and x? 5 Let n(o) = -o + 1. Let b(v) = -2v + 6. Let q(g) = -b(g) + 3n(g). Let h be q(-4). What is the greatest common divisor of 2 and h? 1 Suppose 4s = -i + 3403 + 1017, 5s - 5i - 5525 = 0. What is the greatest common divisor of 255 and s? 85 Let a(u) = -u2 + u + 6. Let z be a(-2). Suppose -5l + 71 - 1 = z. What is the highest common factor of l and 98? 14 Let y = -15 + 21. Let b be ((-2)/y)/(8/(-96)). Suppose -5h - bd = -151, h + 4h - 115 = 5d. What is the greatest common factor of h and 9? 9 Let u = 24 + -40. Let c be 2u/(-6)(-24)/(-16). Let m be (2/4)/(2/8). Calculate the highest common divisor of c and m. 2 Let o(f) = f - 7. Let t be o(-1). Let l(n) = n + 17 + 0n + 0n. Let j be l(t). What is the greatest common factor of j and 45? 9 Let d(k) = 7k2 - 4k + 13. Let n be d(9). Calculate the highest common factor of 17 and n. 17 Let g be (2 - (-5)/(-1))-1. Suppose 2n + 0n - 2 = 0. Let w be 3 + (n + 0 - -2). What is the highest common factor of w and g? 3 Let x(d) = 31d - 14. Let y be x(2). What is the greatest common factor of y and 552? 24 Let y = 760 - 718. What is the highest common factor of 2 and y? 2 Let r(t) = t + 31. Let n be r(-22). Let f be 201/n + (-24)/(-9) + -3. Calculate the highest common divisor of 242 and f. 22 Suppose 0 = 8m + 45 - 205. Suppose 0j + 5j - m = 0, -3j - 244 = -4n. What is the greatest common factor of n and 8? 8 Suppose 0n = -2n + 374. Let h(b) = -b3 - 4b*2 - 44b - 228. Let f be h(-5). What is the highest common factor of f and n? 17 Suppose 7b - 2502 = 536. What is the highest common divisor of 62 and b? 62 Let p(v) = v2 + 5v - 1. Let r be p(-9). Let g = 43 - r. Calculate the highest common factor of 88 and g. 8 Let m be 171/456 + 45/8. Calculate the greatest common factor of 124 and m. 2 Let v = 184 + -127. Suppose -8r = -5r - v. Calculate the greatest common factor of 19 and r. 19 Let a(j) = -4j - 17 - 9j - 3j - 2. Let l be a(-2). Calculate the greatest common factor of l and 91. 13 Let u = -237 - -421. Suppose u + 20 = 6p. What is the highest common factor of 51 and p? 17 Let b(x) = x*3 + 4x*2 + 12x + 27. Let v be b(-2). Calculate the greatest common factor of 913 and v. 11 Let a(w) = 5w2 + 8w - 1. Let d = 55 + -60. Let m be a(d). Calculate the highest common factor of m and 14. 14 Suppose 4s - 188 = 5t, -s - s = 5t + 176. Let j be 9/(t/16) - -6. Suppose -3y + 17 = j, 2m - 89 = -y. What is the greatest common divisor of 21 and m? 21 Let f(b) = -b3 + 6b*2 - 7b + 6. Suppose 3t - 7 = 2t. Let z = t + -3. Let h be f(z). Calculate the highest common factor of 15 and h. 5 Let l(s) = -s*3 - 6s*2 - 10s. Let k be l(-3). Let j be (-3 + 1)/(k/(-15) - 0). Calculate the greatest common divisor of 50 and j. 10 Suppose 5f = 4y - 92, -2y + 16 + 0 = 5f. Suppose g - 143 = 1. What is the greatest common divisor of y and g? 18 Suppose -187 = -3c - 2a, 5a + 154 = 4c - 126. Suppose -2y = -2 + 6. Let b be 127 + 2/y. Calculate the highest common factor of b and c. 13 Let v be (2/((-8)/5))/(2/(-8)). Let u be 4 + (0 - 3) - -1. Suppose -uj + 4j = 2f - 30, -4f + 61 = -vj. What is the greatest common factor of f and 98? 14 Suppose -2o = 6, -2o + 7o + 167 = 2y. What is the greatest common divisor of y and 171? 19 Suppose 4m = 3h - 2689, -45m = 2h - 50m - 1802. Calculate the highest common divisor of 81 and h. 81 Let d(t) = t*2 + t + 78. Let l be d(-13). Calculate the highest common divisor of 78 and l. 78 Suppose 0 = d - 4x - 166 + 10, 0 = -x + 1. Calculate the highest common factor of d and 720. 80 Suppose 3p = -0p. Let y be p - (2 + -1) - -17. Let l be 9/(-6)-164/6. Calculate the greatest common factor of y and l. 16 Suppose 0 = -10n + 7n - 87. Let z = n - -48. Calculate the greatest common divisor of z and 95. 19 Suppose t - 187 + 15 = 2d, 4t - 660 = d. Calculate the greatest common factor of 41 and t. 41 Let x be ((-4 - 2) + 0)(-16)/24. Let q be x + 0 - (-5 - 2). Suppose -3a - 2y + 4y = -293, 0 = -4y + 8. What is the highest common factor of a and q? 11 Let u be 1 - (-1 - (-11 - 1)). Let q be (12/u)/((-2)/40). Suppose -6p + 5 = -139. What is the highest common divisor of p and q? 24 Let g(	{ "pile_set_name": "DM Mathematics" }
n = 0.3 + -0.3. Sort 1/6, n, o in increasing order. n, 1/6, o Suppose 5r = -5b + 11 + 154, 105 = 3r + b. Let o be (24/(-84) - 522/(-14))-1. Let m = o + r. Sort -3, 3, m. -3, m, 3 Let z = 10/7 + -73/56. Let o = -0.1 + -0.06. Let r = -0.15 - o. Sort z, -0.4, r in descending order. z, r, -0.4 Suppose -i - 4c = 10 - 23, 37 = 4i + c. Sort -3, i, 1/11. -3, 1/11, i Let m be (-2)/(-9) - 210/(-27). Let x be (-1)/(-4) - 98/m. Let w be 8/x12 + 4. Sort 4, 1, w. w, 1, 4 Let l = -2.8 + 3. Let c = 45.3 - 44.7. Sort -2, c, l in ascending order. -2, l, c Let r = -7 + 4. Let d be 10(-2)/10. Suppose -5m + 0m + 4j = d, -2m = -j. Put r, m, -4 in decreasing order. m, r, -4 Let r be 1035/21 - (-18)/(-63). Let i = 44 - r. Put 7, 0, i in descending order. 7, 0, i Suppose -51h = -57h - 66. Let x = h - -6. Sort -1, x, 3. x, -1, 3 Let u(t) = 3t*3 + 2t*2 + 3t + 6. Let s(o) = -5o3 - 3o*2 - 6o - 11. Let k(x) = 4s(x) + 7u(x). Let f be k(-3). Put -1, f, 0 in ascending order. f, -1, 0 Let d = -0.036 - -2.136. Suppose 77z = 81z + 4. Sort d, 2, z in descending order. d, 2, z Let l be (7/(21/(-6)))/(-2). Put l, 4, -2, -3 in decreasing order. 4, l, -2, -3 Let i = 11.353 - -0.047. Let l = i + -11. Let z = -18.5 + 14.5. Sort z, -1, l in ascending order. z, -1, l Let d = 0.23 + -14.83. Let b = -15 - d. Put -0.3, b, -1/2 in descending order. -0.3, b, -1/2 Suppose -5u + 3p + 1 = -4, -11 = 3u + p. Let q(r) = -r + 7. Let a be q(3). Let z be 18/(-4) + 2/a. Sort z, 1, u in increasing order. z, u, 1 Let l = 5.208 + -1.208. Let j = -0.2 - 0. Let f = -0.2 - j. Sort f, l, -3. -3, f, l Let z(p) = -3p*2 + 21p + 26. Let t(d) = -2d2 + 14d + 17. Let j(o) = -7t(o) + 5z(o). Let n be j(8). Sort 5, -4, n, -5 in ascending order. -5, -4, n, 5 Let q be (2 + -4)/(-1 - -6). Let s = -92.1 + 92.03. Put q, s, 0.4 in ascending order. q, s, 0.4 Let a = 109 + -102.8. Let m = a - 3.2. Put m, -0.3, -3, 1 in descending order. m, 1, -0.3, -3 Let w = 626 + -626.4. Let t = -4.11 + 0.11. Sort w, 3, t. t, w, 3 Suppose -7c + 6c = -245. Let a be 196/c - (-14)/(-20)4. Sort -3, -1/9, a in descending order. -1/9, a, -3 Suppose 2h + 64 = -2o - 3h, -3o = 2h + 74. Suppose -4l = -43 + 119. Let s = o - l. Sort s, -7, 0. -7, s, 0 Let l be 490/(-56) - 2/8. Put l, 6, -2 in descending order. 6, -2, l Suppose -2p + 7n - 9n = -6, 5p - 6 = 4n. Sort -4, p, 54. -4, p, 54 Let l(h) = -h*3 - 7h*2 - 6h + 2. Let j be l(-6). Let n = 324 - 320. Sort n, 5, j. j, n, 5 Let o = 4 - -1. Put -32, 3/5, o in decreasing order. o, 3/5, -32 Suppose 2t = -4z + 3t - 13, z + 3t = -13. Let f = 23 - 25. Let c be ((-6)/4)/(f/(-4)). Put 3, c, z in ascending order. z, c, 3 Let w(i) = -3i2 - 37i - 9. Let c be w(-12). Sort 5, 4, c, -92 in decreasing order. 5, 4, c, -92 Suppose 2k - t - 5 = 2, 2t + 6 = 0. Suppose -2n + 20 = 3n. Sort -5, n, k, 19. -5, k, n, 19 Suppose 3i - 18 = -6i. Put -2, -3, 4, i in descending order. 4, i, -2, -3 Let j = 58 - 58.5. Let z = -0.96 - -1. Sort z, 3, j in decreasing order. 3, z, j Suppose -6 = -3u + 3p, -10 = u - 7p + 2p. Let f(j) be the second derivative of j*3/3 - 3j*2 - 4j. Let y be f(u). Sort 0.1, -0.3, y in descending order. y, 0.1, -0.3 Let f be (-86)/731 + (-25)/(-68). Put 0.5, 0.11, f, -3/2 in decreasing order. 0.5, f, 0.11, -3/2 Let j(z) = z + 13 - 5z + z + 2z. Let n be j(12). Suppose 3w + 23 = -5f, 5w - 5 - 6 = 4f. Sort f, n, -1 in increasing order. f, -1, n Let d = -0.019 - -2.019. Let s = 13 - 14.3. Put d, -5, s in increasing order. -5, s, d Let g = 12/7 + -41/28. Let h = -4.937 + -0.063. Put h, g, -1/5 in decreasing order. g, -1/5, h Let n = -0.05 - 0.85. Let g = -8 + 11. Put n, g, -4 in increasing order. -4, n, g Let r = -282 - -1411/5. Sort r, -4, -13 in increasing order. -13, -4, r Suppose -2s + 5s - 15 = 0. Let x = 505 - 505. Let q = -1 + 0.5. Sort x, q, s. q, x, s Let c = -9 + 11. Suppose b + 4t - 1 = 16, -b + ct = 13. Sort -0.2, 2, 1, b in decreasing order. 2, 1, -0.2, b Let a = 12 - 7. Let g = -29.8 - -30. Sort a, -0.5, -2/17, g in decreasing order. a, g, -2/17, -0.5 Let y = 9.7 + -5.7. Let c = -2.46 - 1.54. Put c, y, 0 in descending order. y, 0, c Let r(h) = -4h + 5. Let n be r(7). Let i = n - -21. Sort i, -5, -20, 1/4 in decreasing order. 1/4, i, -5, -20 Let j = 2 - -1. Suppose -5f + 19 = -3r, 2r + 2r + 30 = 2f. Put 4, r, j in increasing order. r, j, 4 Let o = 219 - 182. Let p = -31.992 + -0.008. Let f = o + p. Sort 1/13, 2/9, f. 1/13, 2/9, f Let o = 96 + -90. Sort 2, 4, o, 1 in descending order. o, 4, 2, 1 Let y = -3.8 + -0.2. Sort y, -0.3, -5, 5. -5, y, -0.3, 5 Let z = -51 - -78. Suppose -3w = -3d + z, -2w + 4 = 2d + 2. Suppose -6j + 5j = 5. Sort j, w, 0 in increasing order. j, w, 0 Suppose -4g + 114 = -130. Let t = 14 - 1. Let q be -3 + g/t + -2. Put 0.1, q, 1/2 in descending order. 1/2, 0.1, q Let p(s) = -2s*2 + 67s - 99. Let b be p(32). Sort -2, b, -6 in decreasing order. -2, b, -6 Suppose 3v - k = 15, 3v + 36k = 39k + 15. Suppose 0w + 40 = 5w. Let c = 12 - w. Put v, -3, c in descending order. v, c, -3 Let q be ((-5)/(15/27))/(78/(-1196)). Put q, 1, -3 in descending order. q, 1, -3 Let y be (-1)/(-4)(165/30 - 4). Sort -2, 0, 32, y in descending order. 32, y, 0, -2 Let n(s) be the third derivative of -s4/12 - s3 + 3s*2. Let k be n(-5). Suppose -ky + 9 = -y. Put -2, -5, y in increasing order. -5, -2, y Suppose -2o - 9 = o, -4l = 3o + 21. Put -5, -1, l, 1 in increasing order. -5, l, -1, 1 Let h(x) = 0 + 2 + x - 7 + 0x. Let c be h(7). Let w = -1.94 - 0.06. Sort c, w, -4 in decreasing order. c, w, -4 Let a = 163 - 166. Let l be (-110)/30 + (-2)/6. Sort l, a, -6 in decreasing order. a, l, -6 Suppose -3a + 2a = 4p - 3, 12 = 4a - p. Let w(h) = -h + 1. Let l be w(-1). Suppose -13 = lx - 3. Put x, a, -1 in ascending order. x, -1, a Let g = -5/2 + 1. Let p = -10 - -10.2. Let r = 0.238 - 4.238. Put g, r, p in ascending order. r, g, p Let u(y) = -y2 - 16y + 335. Let l be u(-28). Suppose 0z + 11 = 3h - z, 10 = 4h + z. Sort l, 4, h. l, h, 4 Let s = -0.51 - -0.04. Let h = 0.27 + s. Sort 0.4, 0.2, h. h, 0.2, 0.4 Let r = -33 - -15. Let v = -23 - r. Put v, 2, 4 in decreasing order. 4, 2, v Suppose -s = -4, 38j = 43j - 3s - 118. Sort -1, 0.1, j, -5/2 in increasing order. -5/2, -1, 0.1, j Let q = 279 + -279.5. Sort 1/4, q, -4/9 in ascending order. q, -4/9, 1/4 Let j(a) = -18a - 7. Let m(b) = 9b + 4. Let p(q) = 6j(q) + 11m(q). Suppose 4u = 3x + 2u - 7, 5u = -10. Let t be p(x). Put -5, -3, t in descending order. -3, -5, t Suppose 4r - 3j + 24 = 7r, -2r + 5j = 19. Put 5, -4, r, -2 in ascending order. -4, -2, r, 5 Let l be ((-2)/4)/((-1)/4). Suppose 3o - lo = x + 7, x = -2o + 8. Put 2, -4, o, 3 in decreasing order. o, 3, 2, -4 Suppose 20 = -4i - 3w, 0 = 8i - 6i + w + 10. Put i, 4, 13 in decreasing order. 13, 4, i Let i = -184 + 171. Let f be ((-3)/(-6))/((-1)/14). Let o = f + 10. Sort i, o, -2 in ascending order. i, -2, o Let x = -357 - -353. Let f = -63/2 - -32. Sort -4/5, x, f, -0.5 in descending order. f, -0.5, -4/5, x Let k = 280 - 283. Let p(c) = c*2 - 5c + 2. Suppose 7f = 4f + 9. Let u be p(f). Put -8, u, k in increasing order. -8, u, k Let m(q) be the third derivative of q*5/60 + 2q*4/3 + 19q*3/6 - 3q2. Let k be m(-15). Sort -1, k, -3 in increasing order. -3, -1, k Let s = -20 + 5. Let t = 19 + s. Let d(j) = -j2 + 16j + 12. Let v be d(17). Sort 6, t, v. v, t, 6 Suppose -56 = 16z + 8. Sort z, -16, 5. -16, z, 5 Suppose 0g - 20 = -4g. Suppose 0 = 2a - 5t - g, 5t - 5 - 5 = -a. Sort 3, a, -2 in ascending order. -2, 3, a Let l = -324 - 260. Let w be l/78 - 12/(-78). Let d = w - -7. Put -3/7, 0.04, d in descending order. 0.04, d, -3/7 Let b = -4 + 9. Let c = 14.8 - 17.8. Sort c, -1, b in ascending order. c, -1, b Suppose -6k + 112 = -10k. Let u = k - -23. Let f(n) = -n3 + 4n*2 - 4n + 2. Let i be f(3). Sort u, 2, i in decreasing order. 2, i, u Let b = -344 + 334. Sort 5, -0.1, 0, b. b, -0.1, 0, 5 Let i = -1151/11865 + 1/565. Let g be 15/(-42)2 - 2/(-7). Sort g, 3/4, i in descending order. 3/4, i, g Let x = 155 - 157. Sort 1, -1, x, -8 in ascending order. -8, x, -1, 1 Let i(f) = 7f*3 + 6f*2 + 15f + 17. Let t(j) = 8j3 + 6j*2 + 16j + 17.	{ "pile_set_name": "DM Mathematics" }
-226300 What is next in -1897328, -1897311, -1897282, -1897241? -1897188 What is next in -50669, -50873, -51229, -51749, -52445, -53329, -54413? -55709 What comes next: -74968, -74980, -75014, -75082, -75196, -75368, -75610? -75934 What is the next term in 49, 118, 239, 418, 661? 974 What is the next term in 6285142, 12570281, 18855412, 25140535, 31425650? 37710757 What is next in 79, -277, -1157, -2801, -5449, -9341, -14717, -21817? -30881 What is the next term in -93087, -89267, -82901, -73995, -62555? -48587 What comes next: 3265372, 3265457, 3265598, 3265795? 3266048 What is next in 1387311, 1387049, 1386775, 1386483, 1386167, 1385821? 1385439 What is next in -6563, -13006, -19423, -25814? -32179 What is next in -2482, -20409, -69074, -163849, -320106, -553217? -878554 What comes next: -678, -1377, -2104, -2871, -3690? -4573 What is the next term in -38972, -155948, -350922, -623894? -974864 What is next in 99171, 99240, 99415, 99750, 100299, 101116? 102255 What comes next: -15526, -31389, -47252, -63115, -78978? -94841 What is the next term in 26293, 60074, 93855, 127636? 161417 What is the next term in -41171, -41188, -41209, -41234, -41263, -41296, -41333? -41374 What comes next: -240, -1032, -2784, -5976, -11088, -18600? -28992 What is next in 323, -648, -2263, -4528, -7449, -11032? -15283 What comes next: -66630477, -66630480, -66630483, -66630486? -66630489 What comes next: 2348891713, 2348891714, 2348891715? 2348891716 What is next in -102309, -102225, -102139, -102051, -101961, -101869? -101775 What is the next term in 3312, 6023, 8124, 9615, 10496? 10767 What comes next: 122493, 122142, 121791, 121440? 121089 What is next in -1047, -1558, -2349, -3420? -4771 What is next in -160813, -160831, -160863, -160909, -160969, -161043, -161131? -161233 What is next in 19086206, 76344838, 171775892, 305379368, 477155266? 687103586 What comes next: 174888, 174573, 174258, 173943, 173628? 173313 What comes next: -7233, -15759, -25579, -36687, -49077? -62743 What is the next term in -686206324, -686206325, -686206326, -686206327, -686206328? -686206329 What is the next term in 875, 102, -1097, -2932, -5613, -9350? -14353 What comes next: 145, 435, 901, 1627, 2697? 4195 What is the next term in -3465, -3392, -3321, -3252? -3185 What is next in 25350, 39615, 53892, 68187, 82506? 96855 What is the next term in -2018008138, -2018008139, -2018008140, -2018008141, -2018008142? -2018008143 What comes next: -276180, -276643, -277106, -277569, -278032? -278495 What comes next: -50040, -47401, -44762, -42123? -39484 What is the next term in 20401, 20407, 20449, 20545, 20713, 20971? 21337 What is the next term in -215984, -215929, -215874, -215819, -215764, -215709? -215654 What is next in -10606780, -10606783, -10606786, -10606789, -10606792? -10606795 What is the next term in 2726705, 2726666, 2726601, 2726510? 2726393 What is next in 325057, 325087, 325137, 325207? 325297 What comes next: -814990, -1630014, -2445052, -3260110, -4075194, -4890310, -5705464? -6520662 What comes next: -1310715, -1310713, -1310711, -1310709, -1310707? -1310705 What comes next: 1475087, 1475108, 1475131, 1475156, 1475183, 1475212? 1475243 What comes next: -1839066, -1838833, -1838600, -1838367, -1838134? -1837901 What is next in 198, 260, 358, 492, 662? 868 What comes next: -1464, -2792, -4102, -5382, -6620, -7804, -8922? -9962 What is next in 92492502, 92492504, 92492510, 92492520? 92492534 What is next in -3034, -12659, -28686, -51103, -79898, -115059? -156574 What is the next term in -21611, -87356, -196883, -350186, -547259, -788096? -1072691 What is next in -4303, -4086, -3865, -3640, -3411, -3178, -2941? -2700 What is the next term in 288970, 289010, 289040, 289054, 289046? 289010 What is the next term in -816851, -6534513, -22053859, -52275731, -102100971, -176430421, -280164923, -418205319? -595452451 What is next in 89, -330, -1145, -2452, -4347, -6926, -10285? -14520 What is next in -100570, -201132, -301694, -402256, -502818, -603380? -703942 What is the next term in -23068, -92226, -207478, -368812, -576216, -829678, -1129186? -1474728 What is the next term in -2151, -1954, -1741, -1506, -1243? -946 What is the next term in -35399829, -35399815, -35399791, -35399757, -35399713? -35399659 What is next in 591, 135, -1271, -3627, -6933? -11189 What is the next term in -379, -1457, -3219, -5647, -8723, -12429? -16747 What is next in -1570332, -3140541, -4710746, -6280947, -7851144, -9421337? -10991526 What is next in 7465, 30026, 67635, 120292? 187997 What comes next: 3405884, 6811763, 10217642, 13623521, 17029400? 20435279 What is the next term in -25015, -200459, -676661, -1603999, -3132851, -5413595, -8596609, -12832271? -18270959 What comes next: 12185, 12227, 12279, 12335, 12389? 12435 What comes next: -605, -1139, -1611, -2021, -2369? -2655 What comes next: 143611, 143632, 143659, 143692, 143731, 143776? 143827 What is the next term in -19066, -38342, -57618, -76894? -96170 What comes next: -20980, -42174, -63368, -84562, -105756? -126950 What comes next: -12318, -24738, -37362, -50292, -63630, -77478, -91938, -107112? -123102 What comes next: 6171, 9648, 13125? 16602 What is next in -2485, -2432, -2053, -1348, -317, 1040? 2723 What is next in -100970, -99508, -98046, -96584, -95122? -93660 What is the next term in -48134, -47457, -46776, -46091, -45402? -44709 What is next in 748, 2116, 4732, 9220, 16204, 26308, 40156? 58372 What is the next term in 4035, 4147, 4441, 5007, 5935? 7315 What is the next term in -25580, -108749, -249512, -447875, -703844, -1017425, -1388624, -1817447? -2303900 What is next in 21994, 44219, 66472, 88759, 111086, 133459, 155884? 178367 What is the next term in 566, 778, 970, 1142, 1294, 1426? 1538 What is next in 7815811, 15631591, 23447369, 31263145, 39078919, 46894691? 54710461 What is next in -20211367, -40422724, -60634083, -80845444, -101056807? -121268172 What comes next: 3860, 18058, 41754, 74954, 117664, 169890, 231638? 302914 What comes next: -820, -4877, -15414, -35677, -68912, -118365? -187282 What is the next term in 612293, 2449145, 5510543, 9796481, 15306953? 22041953 What comes next: 248361, 248591, 249209, 250407, 252377, 255311? 259401 What is next in -119879140, -239758286, -359637432, -479516578, -599395724, -719274870? -839154016 What comes next: -8347638, -8347634, -8347630, -8347626? -8347622 What comes next: -317951, -635910, -953869, -1271828? -1589787 What is next in -8993, -17969, -26931, -35873, -44789? -53673 What is the next term in -4536, -36089, -121556, -287835, -561824, -970421? -1540524 What is the next term in -31432, -125704, -282770, -502588, -785116, -1130312, -1538134, -2008540? -2541488 What is the next term in 200349568, 200349563, 200349558, 200349553, 200349548? 200349543 What is the next term in -250525, -501281, -752037? -1002793 What comes next: -83927, -167844, -251761, -335678, -419595? -503512 What is next in -18056, -55453, -117782, -205043, -317236, -454361? -616418 What comes next: -3127, -2834, -2549, -2272, -2003, -1742? -1489 What comes next: -21489587, -21489579, -21489571, -21489563, -21489555, -21489547? -21489539 What is the next term in -35598, -34517, -33396, -32223, -30986? -29673 What comes next: -80031, -79972, -79877, -79746, -79579, -79376, -79137? -78862 What comes next: 315388, 630743, 946098, 1261453, 1576808? 1892163 What is the next term in -2085467, -2085461, -2085455, -2085449? -2085443 What is the next term in -1969875, -3939749, -5909623? -7879497 What is the next term in -1111945010, -2223890020, -3335835030, -4447780040, -5559725050, -6671670060? -7783615070 What is the next term in 7536, 15092, 22692, 30348, 38072, 45876, 53772? 61772 What comes next: 151795, 607241, 1366317, 2429017, 3795335, 5465265? 7438801 What is the next term in 28255, 28996, 29737, 30478, 31219, 31960? 32701 What is next in 207, 271, 213, 45, -221, -573, -999? -1487 What comes next: 6368971, 6368970, 6368967, 6368962, 6368955? 6368946 What comes next: 5155631, 5155632, 5155633, 5155634? 5155635 What is next in 34212081, 34212080, 34212079, 34212078, 34212077, 34212076? 34212075 What is next in 4111261, 4111253, 4111245, 4111237, 4111229? 4111221 What is the next term in -148	{ "pile_set_name": "DM Mathematics" }
when two letters picked without replacement from ussuluaslslsusbbsu. 1/153 Three letters picked without replacement from xxddnxddxx. Give prob of picking 2 d and 1 n. 1/20 Three letters picked without replacement from yhhhyhhyhhhhyhyhhhhd. What is prob of picking 1 d and 2 h? 91/1140 Two letters picked without replacement from {j: 2, w: 2}. Give prob of picking 2 w. 1/6 Calculate prob of picking 1 i and 1 c when two letters picked without replacement from fafficaif. 1/18 Calculate prob of picking 4 b when four letters picked without replacement from blblbbllbbblb. 14/143 Three letters picked without replacement from {g: 1, b: 4, n: 6}. What is prob of picking 2 n and 1 g? 1/11 What is prob of picking 2 z when two letters picked without replacement from szassazss? 1/36 Two letters picked without replacement from {e: 2, b: 1, g: 2}. Give prob of picking 2 g. 1/10 Four letters picked without replacement from jzjzzjzjzjjjz. Give prob of picking 1 j and 3 z. 28/143 Four letters picked without replacement from {e: 1, u: 3, s: 1}. What is prob of picking 1 e and 3 u? 1/5 Four letters picked without replacement from wsabrsv. Give prob of picking 2 s, 1 w, and 1 a. 1/35 Calculate prob of picking 1 v and 1 m when two letters picked without replacement from mmmvmmomomvvo. 7/26 Calculate prob of picking 1 f and 2 c when three letters picked without replacement from ffccff. 1/5 What is prob of picking 1 r, 1 k, and 2 a when four letters picked without replacement from {j: 1, r: 1, n: 1, k: 1, a: 2, w: 1}? 1/35 Calculate prob of picking 1 w, 1 h, and 1 j when three letters picked without replacement from jlfwjhn. 2/35 Three letters picked without replacement from stzvtskkzkktskd. What is prob of picking 2 s and 1 z? 6/455 Four letters picked without replacement from kkzzzksszskkz. Give prob of picking 1 k and 3 s. 1/143 Calculate prob of picking 4 g when four letters picked without replacement from kkggkggggkggggggkkg. 715/3876 What is prob of picking 1 c and 1 l when two letters picked without replacement from {l: 9, c: 7}? 21/40 Calculate prob of picking 2 f and 2 z when four letters picked without replacement from {z: 6, f: 6}. 5/11 Calculate prob of picking 3 k when three letters picked without replacement from {v: 7, k: 4, r: 3}. 1/91 What is prob of picking 2 u when two letters picked without replacement from {u: 11, i: 9}? 11/38 Two letters picked without replacement from {e: 1, i: 6, d: 5, a: 6}. Give prob of picking 1 i and 1 e. 2/51 What is prob of picking 3 u and 1 s when four letters picked without replacement from {s: 13, u: 3, q: 1}? 13/2380 Three letters picked without replacement from yyynnywcycy. Give prob of picking 1 c and 2 y. 2/11 Three letters picked without replacement from xdxgdg. Give prob of picking 1 g and 2 x. 1/10 Calculate prob of picking 2 t when two letters picked without replacement from tncttjjnujttjtc. 1/7 Two letters picked without replacement from {z: 5, r: 7}. What is prob of picking 1 z and 1 r? 35/66 Four letters picked without replacement from yyeueeyeuyye. Give prob of picking 1 y, 1 e, and 2 u. 5/99 What is prob of picking 2 b when two letters picked without replacement from {f: 6, w: 1, b: 8, u: 3}? 28/153 Two letters picked without replacement from yyymmmmymyym. What is prob of picking 2 m? 5/22 What is prob of picking 4 x when four letters picked without replacement from {d: 1, t: 3, l: 3, x: 4}? 1/330 What is prob of picking 1 c, 1 n, and 1 h when three letters picked without replacement from nmccphmhmh? 1/20 Calculate prob of picking 1 f and 1 j when two letters picked without replacement from {f: 1, t: 2, j: 1, r: 4}. 1/28 What is prob of picking 1 e and 2 o when three letters picked without replacement from {e: 7, o: 7}? 21/52 Three letters picked without replacement from nuucyy. Give prob of picking 1 u and 2 y. 1/10 Two letters picked without replacement from jqqjuqqtq. What is prob of picking 1 t and 1 j? 1/18 What is prob of picking 1 o, 2 j, and 1 u when four letters picked without replacement from {o: 1, k: 4, u: 9, j: 2}? 9/1820 Calculate prob of picking 1 n, 2 q, and 1 a when four letters picked without replacement from {a: 1, v: 1, o: 8, n: 1, q: 4}. 2/455 Calculate prob of picking 2 l, 1 p, and 1 t when four letters picked without replacement from ttprteppltltll. 90/1001 Four letters picked without replacement from dddqsqd. Give prob of picking 2 q and 2 d. 6/35 Calculate prob of picking 1 t and 1 m when two letters picked without replacement from {t: 1, l: 2, j: 1, m: 1, e: 2}. 1/21 Three letters picked without replacement from {c: 2, j: 5, u: 1, t: 3, h: 3, w: 1}. What is prob of picking 1 w, 1 h, and 1 u? 3/455 Three letters picked without replacement from feffffxfffffxf. What is prob of picking 2 f and 1 e? 55/364 What is prob of picking 1 b and 1 q when two letters picked without replacement from pbdqqbqzq? 2/9 Three letters picked without replacement from {a: 3, e: 9, p: 4}. Give prob of picking 2 a and 1 p. 3/140 What is prob of picking 1 f and 2 s when three letters picked without replacement from sssfsf? 3/5 Four letters picked without replacement from jjhjjxhjhhh. Give prob of picking 4 j. 1/66 Calculate prob of picking 2 v when two letters picked without replacement from vvktxmmxmtxxkkmmmmm. 1/171 What is prob of picking 2 v when two letters picked without replacement from {e: 2, v: 16}? 40/51 Two letters picked without replacement from {c: 3, m: 5, f: 3, v: 1, l: 1}. What is prob of picking 1 l and 1 c? 1/26 Calculate prob of picking 1 i, 2 w, and 1 f when four letters picked without replacement from iwiwff. 4/15 What is prob of picking 2 m when two letters picked without replacement from mjjijpipjijjpjjpjpm? 1/171 Four letters picked without replacement from yfwwdfwfddwfwfw. Give prob of picking 4 w. 1/91 Calculate prob of picking 1 t and 2 v when three letters picked without replacement from {q: 6, t: 1, v: 4, y: 4, d: 5}. 1/190 Four letters picked without replacement from ozxzxxoo. What is prob of picking 2 o and 2 x? 9/70 What is prob of picking 1 e and 3 z when four letters picked without replacement from zzeez? 2/5 Calculate prob of picking 1 e and 1 s when two letters picked without replacement from {e: 2, s: 2}. 2/3 Calculate prob of picking 2 k when two letters picked without replacement from kfkkfkkfkkffk. 14/39 What is prob of picking 1 k, 1 e, and 1 d when three letters picked without replacement from uduekduideuupe? 9/364 Calculate prob of picking 2 k and 1 t when three letters picked without replacement from {o: 1, h: 2, t: 1, k: 3}. 3/35 What is prob of picking 1 d and 1 e when two letters picked without replacement from dedxdeexdedxxxedeede? 28/95 Calculate prob of picking 2 u and 2 w when four letters picked without replacement from uuwuuwuuuuu. 6/55 What is prob of picking 1 w and 1 i when two letters picked without replacement from wwwiiiiiiwwi? 35/66 Four letters picked without replacement from vveeeevgeeeevveeeevv. Give prob of picking 2 e and 2 v. 462/1615 Three letters picked without replacement from {s: 1, z: 1, m: 1, d: 1, l: 1, i: 2}. Give prob of picking 1 d, 1 i, and 1 m. 2/35 Two letters picked without replacement from {w: 2, k: 1, x: 1, y: 2, p: 2}. What is prob of picking 1 y and 1 x? 1/14 Two letters picked without replacement from {h: 2, b: 3}. What is prob of picking 1 h and 1 b? 3/5 What is prob of picking 1 u and 1 x when two letters picked without replacement from auaapxaxa? 1/18 Four letters picked without replacement from {p: 2, y: 3, h: 4}. Give prob of picking 4 h. 1/126 What is prob of picking 1 a and 1 g when two letters picked without replacement from tsagtssgsgtttstasga? 4/57 Two letters picked without replacement from rrgggag. Give prob of picking 2 r. 1/21 What is prob of picking 1 d, 1 g, and 2 n when four letters picked without replacement from rrwwgnnngnnnwd? 30/1001 What is prob of picking 2 a when two letters picked without replacement from akmmzz? 0 Two letters picked without replacement from {g: 3, o: 8}. Give prob of picking 2 o. 28/55 Three letters picked without replacement from {f: 1, v: 12}. What is prob of picking 1 f and 2 v? 3/13 Three letters picked without replacement from ngnd. Give prob of picking 1 g, 1 n, and 1 d.	{ "pile_set_name": "DM Mathematics" }
vide -163830955 by -1. 163830955 310590260 divided by -155295130 -2 9 divided by -45919891 -9/45919891 -6980427 divided by -775603 9 What is 11979 divided by 1689? 3993/563 Calculate -2509540 divided by -2057. 1220 What is -28469688 divided by -104? 273747 Calculate -5 divided by 112120535. -1/22424107 What is 77505 divided by -25835? -3 What is 735039405 divided by -3550915? -207 Divide -3039471 by 13. -3039471/13 What is 66349168 divided by 8293646? 8 Calculate 22502130 divided by 3873. 5810 Calculate -275290 divided by 1. -275290 -17651153 divided by -2 17651153/2 Calculate 258 divided by 722352. 43/120392 Divide 94394409 by -31464803. -3 Calculate -596758 divided by -46. 12973 What is 197286324 divided by 6? 32881054 Divide -5 by -120146295. 1/24029259 Calculate -1539743 divided by 64. -1539743/64 -12744466 divided by -6372233 2 Divide 48130 by 159. 48130/159 What is 18811054 divided by -5? -18811054/5 Calculate 333760029 divided by 3. 111253343 What is 10646967 divided by -3? -3548989 What is -798554277 divided by -153? 5219309 526 divided by -36762 -263/18381 Calculate -2046 divided by 65776. -1023/32888 Calculate 1675187268 divided by 3. 558395756 Calculate 2436281 divided by 280. 2436281/280 Calculate 4 divided by -2573495. -4/2573495 -20658708 divided by 70749 -292 -2 divided by 8952651 -2/8952651 Divide -14 by 3846717. -2/549531 -811212 divided by 114 -135202/19 -220 divided by 3004392 -55/751098 Calculate 241234100 divided by 4. 60308525 What is -228425 divided by 56? -228425/56 -47144889 divided by -6 15714963/2 Divide -1023380 by 19. -1023380/19 Divide -12105084 by -2157. 5612 Calculate -355637837 divided by -839. 423883 What is -491602 divided by 2? -245801 6333 divided by 38970 2111/12990 Divide -70671766 by 2. -35335883 Divide -285651 by -4017. 95217/1339 -242315288 divided by -30289411 8 Calculate -504051 divided by 19. -26529 Calculate -2361905 divided by 145. -16289 Calculate -1 divided by -102756905. 1/102756905 Calculate 57188885 divided by -65. -879829 What is -30487216 divided by 4? -7621804 What is -1201 divided by 6293? -1201/6293 -188308840 divided by 37661768 -5 What is -778 divided by -22387? 778/22387 Divide 1114919508 by 278729877. 4 Divide -28 by -142722. 14/71361 Divide 16349234 by -38. -430243 Divide -3307328730 by -5. 661465746 171990324 divided by 6 28665054 -4697686 divided by -335549 14 What is -53412390 divided by 90? -593471 What is -12303593 divided by 2? -12303593/2 Calculate -19 divided by 583504. -19/583504 Divide 1259 by -2085. -1259/2085 Divide 703087950 by 117181325. 6 Calculate 2 divided by -52323669. -2/52323669 -12214806 divided by -62 197013 -12386050 divided by -1891 6550 Calculate -195666685 divided by -5. 39133337 Divide 0 by -4048270. 0 Divide 14562916 by -212. -68693 Calculate 1940706 divided by 71878. 27 Calculate -15295 divided by 263. -15295/263 Calculate 24035004 divided by 5334. 4506 Divide -32960640 by -80. 412008 What is -143718200 divided by 2792? -51475 Divide -940577966 by -1. 940577966 Divide -5504835 by -2. 5504835/2 What is -129 divided by 1840412? -129/1840412 Divide 126601090 by -11. -11509190 What is -5845 divided by 161? -835/23 Calculate 649321140 divided by 3509844. 185 39822510 divided by -13195 -3018 What is 10486250 divided by 41945? 250 Calculate -11163 divided by -4142. 11163/4142 Divide -255198925 by -10207957. 25 What is -19381 divided by -26? 19381/26 -22217223 divided by 7405741 -3 -127040172 divided by 1 -127040172 228 divided by 1157671 228/1157671 What is -275275765 divided by 171085? -1609 What is -650168 divided by 273? -650168/273 What is 482417 divided by -8? -482417/8 209050120 divided by 54088 3865 Calculate -280760494 divided by 12206978. -23 Divide 14376 by -14934. -2396/2489 Calculate -42026 divided by 1113. -42026/1113 What is 10198463 divided by -31? -10198463/31 26456 divided by 13228 2 Calculate 62041200 divided by 4656. 13325 Divide 229586092 by -4. -57396523 -1 divided by 33083378 -1/33083378 Calculate -60162440 divided by 5080. -11843 What is -38726 divided by 2278? -17 651044 divided by -14 -325522/7 Divide -151271027 by 6. -151271027/6 Divide 8868128 by -1. -8868128 Calculate 127238136 divided by -248. -513057 Divide -40 by -5452662. 20/2726331 -251328 divided by 3 -83776 -71797128 divided by 2 -35898564 What is -146 divided by 172344? -73/86172 -940422147 divided by 1652763 -569 Calculate -1610271 divided by -64. 1610271/64 Calculate -7277440 divided by -3638720. 2 What is -18573028 divided by -9286514? 2 -24299866 divided by 7 -24299866/7 Divide 4604 by -229. -4604/229 What is -3982595 divided by 3? -3982595/3 Calculate 1342 divided by 1809. 1342/1809 Divide -132015005 by 4. -132015005/4 What is -27529733 divided by 11? -2502703 What is -113030552 divided by 4? -28257638 Calculate 0 divided by -6351461. 0 Divide 23193804 by -10884. -2131 Divide 1 by -191411173. -1/191411173 Divide -2742 by 8306. -1371/4153 Divide -212860076 by -270127. 788 Calculate 3105765 divided by -621153. -5 -156890290 divided by 78445145 -2 What is -532 divided by -10855? 532/10855 Calculate 4 divided by -17063233. -4/17063233 24252403 divided by 1 24252403 Calculate -200623566 divided by -3. 66874522 Divide 68504558 by 1. 68504558 Calculate 1339 divided by -13548. -1339/13548 -395 divided by -18526 395/18526 16953930 divided by -28494 -595 Calculate 21414480 divided by 535362. 40 What is 1570419031 divided by -1? -1570419031 Divide -1 by -737151. 1/737151 What is -16649946 divided by 924997? -18 Divide -160 by 43829. -160/43829 Calculate 3 divided by -2893624. -3/2893624 Calculate -61 divided by 13051929. -61/13051929 Divide -4651151 by 46051. -101 354837516 divided by 19756 17961 Divide -11894464 by 15. -11894464/15 Calculate 4206406 divided by -89498. -47 Calculate -1495008 divided by -498336. 3 What is 3 divided by 54131871? 1/18043957 Calculate -705294 divided by -646. 352647/323 Divide -73609050 by 3. -24536350 What is -87 divided by -10064? 87/10064 Calculate 9 divided by 2010045. 3/670015 Calculate -7548228 divided by 108. -69891 -185172834 divided by -6 30862139 Calculate -925 divided by -1381. 925/1381 Divide -10685 by -2751. 10685/2751 Divide -3948804 by -3. 1316268 What is 1840862 divided by -1867? -986 Divide 8584608 by 268269. 32 Calculate 8006216 divided by -1000777. -8 154547630 divided by -30909526 -5 What is -8431832 divided by -6778? 1244 What is -1 divided by 5530792? -1/5530792 63329144 divided by -7916143 -8 Divide -281 by 116938. -281/116938 23425504 divided by 29 807776 Divide 10 by 3176897. 10/3176897 Calculate 4 divided by -2345551. -4/2345551 What is 31853164 divided by 4550452? 7 -75788645 divided by -6 75788645/6 What is 5 divided by -2160226? -5/2160226 Divide -11153 by 1775. -11153/1775 What is -4426359 divided by 21? -210779 What is -227603 divided by 1738? -227603/1738 Calculate 9521596 divided by -4760798. -2 What is -378658 divided by 7? -54094 Calculate -73804084 divided by 18451021. -4 Calculate -255236446 divided by -2407891. 106 What is 131284368 divided by -26064? -5037 Calculate -1929 divided by -2113. 1929/2113 346935096 divided by 28911258 12 Divide 44020280 by -44020280. -1 -4750167 divided by 110469 -43 What is -5739 divided by 4141? -5739/4141 Divide 339336660 by 63570. 5338 Divide 17101 by -1. -17101 -1929641 divided by -6 1929641/6 Divide -3022 by 2693. -3022/2693 Calculate 8 divided by -127339562. -4/63669781 Divide -1091852 by -26. 545926/13 Calculate 0 divided by -1058349. 0 Calculate -65 divided by 340539. -65/340539 -9790200 divided by -9 1087800 What is 1 divided by -1659000? -1/1659000 Calculate -18294250 divided by 13. -1407250 Divide -198 by -829232. 99/414616 Divide -1 by -6757320. 1/6757320 Calculate 865 divided by 19619. 865/19619 Calculate 596383218 divided by 6. 99397203 Calculate -72921849 divided by -3003. 24283 -4 divided by 31731030 -2/15865515 Calculate 40637850 divided by 165. 246290 Divide 1595880 by 78. 20460 Calculate -1217 divided by 3902. -1217/3902 11764010 divided by 74930 157 Calculate -11334366 divided by -3778122. 3 What is -283972 divided by -80? 70993/20 2 divided by 10961339 2/10961339 Divide -3 by 97964. -3/97964 -8589207 divided by 11 -780837 212459 divided by 419 212459/419 Calcu	{ "pile_set_name": "DM Mathematics" }
14h(t)? -4t + 2 Let u(t) = 9t2 - 3t - 7. Let l be ((-105)/(-12))/(320/512). Let z(y) be the first derivative of -4y - y2 + 5/3y*3 - l. Give 4u(w) - 7z(w). w2 + 2w Let f(j) = -3j2 + 113j - 146. Let z(l) = -l*2 + 45l - 73. What is 2f(g) - 5z(g)? -g*2 + g + 73 Let o(m) = -191. Let i(h) = -5538. Let j(t) = -3i(t) + 87o(t). Let s(c) = -3 + 0c2 + c2 - 1. Give -4j(a) + 3s(a). 3a2 Let d be (1402/2103)/(-12/(-9)). Let a(j) = 2j2 - 2j + 5. Let l(y) = -4y2 + 3y - 9. Calculate dl(c) + 5a(c). -2c2 - c - 2 Let y = 88 + -125. Let v = y + 43. Suppose 0 = 3p - vp - 33. Let a(c) = c2 + 1. Let o(b) = 3b*2 + 3. Calculate pa(f) + 4o(f). f2 + 1 Let r(w) = -w. Let d(k) = -2834k + 5701k - 2847k. Determine -3d(n) - 15r(n). -45n Let t(b) = -b - 1. Let m(c) = -4c - 1. Let a(q) be the first derivative of 3q2 + 2q - 13. Let l(r) = 5a(r) + 7m(r). What is l(p) + 4t(p)? -2p - 1 Let v(h) = -5h3 + 8h*2 + 4h - 7. Let s(k) = -k*3 + 2k*2 + k - 2. Let y(o) = -4s(o) + v(o). Let l(u) = -5u3 - u2 - 2u + 6. What is l(m) - 6y(m)? m3 - m2 - 2m Let a(s) = -24s3 + 16s*2 + 3s - 4. Let w(b) = -b*3 - 4b*2 - 2b + 1. Determine a(y) + 4w(y). -28y*3 - 5y Let n(j) = -350j + 6305. Let o be n(18). Let s(u) = -4u + 5. Let b(l) = 2l - 2. What is ob(w) + 2s(w)? 2w Let x(t) = t. Let h(o) = -3o3 + 5o - 2. Let p = 2168 - 2174. Calculate px(r) + h(r). -3r*3 - r - 2 Let w(i) = -12i + 59. Let u(a) = 16a - 88. Calculate -5u(f) - 7w(f). 4f + 27 Let n(s) = 26s3 + 4. Let k(d) = d3 + 2d*2 + 10d - 3. Let y(h) = h3 + h2 + 5h - 1. Let c(v) = -k(v) + 2y(v). Calculate -4c(q) + n(q). 22q*3 Let y(f) = -21f + 40. Let h(b) = b3 - b2 + 26b - 94. Let q be h(3). Let p(i) = -5i + 10. Calculate qy(d) - 9p(d). 3d - 10 Let x(u) = 64u*2 + 9u - 8. Let j(t) be the second derivative of 4t4/3 + t3/3 - t2 + 9538t. Give 9j(w) - 2x(w). 16w2 - 2 Let j(r) = -158r2 + r2 + 79r2 + 5 + 80r*2. Let s(u) = -2u2 - 6. Let l(h) = h2 - 3h - 4. Let q be l(5). Give qj(y) + 5s(y). 2y*2 Let t(d) = 3d + 3. Let s = -1453 - -1448. Let k(q) = -q + 1. What is sk(i) + t(i)? 8i - 2 Let z(a) = -94a - 6. Let s be (74 - 69)((2/1)/(-2) + 0). Let q(j) = -63j - 4. Give sz(o) + 8q(o). -34o - 2 Let q(z) = -2z - z2 - 810z*3 + 623z*3 + 1 + 188z*3 + z. Let g(k) = 9k*3 - 12k*2 - 12k + 9. Calculate -g(r) + 12q(r). 3r*3 + 3 Let q be (-24 - (-3502)/136) + 2/8. Let r(m) = -3m*2 - 2. Let f be 0 + 1 - -23 - -1. Let x(w) = 35w*2 + 25. Calculate fr(b) + qx(b). -5b*2 Let q(m) = 11m*2 - 32m + 1. Let o(a) = -13a2 + 32a - 2. Determine 6o(b) + 7q(b). -b*2 - 32b - 5 Let n(m) = -70m - 2m*2 - 71m - 1 + 3m2 + 198m + m*3 - 58m. Let b(x) = -4x2 + x + 4. Calculate b(u) + 4n(u). 4u3 - 3u Let a(y) = 20y3 + 9y*2 - 5. Let s(m) = -5m*3 - 2m*2 + 1. Let f = -3699 - -3697. Give fa(w) - 9s(w). 5w*3 + 1 Let f be ((-4)/82)/((-12)/12). Let l(p) = -1. Let h(y) = y - 5. Calculate fh(r) - 6l(r). r + 1 Let x(c) = 11c3 + 9c*2 - 11c - 6. Suppose 0 = -126m + 114m. Suppose 7h + m = -28. Let t(z) = -5z*3 - 4z*2 + 5z + 3. Determine hx(y) - 9t(y). y*3 - y - 3 Let a(x) = -51x*2 - 10x + 73. Let c(j) = -23j2 - 5j + 35. Calculate -4a(v) + 9c(v). -3v2 - 5v + 23 Let d(a) = a*3 - 18a*2 - 37a - 1. Let f(m) = 2m3 - 26m*2 - 36m - 2. Determine -3d(q) + 2f(q). q*3 + 2q*2 + 39q - 1 Let f(m) = m + 943. Let c(d) = d + 939. Calculate 6c(t) - 5f(t). t + 919 Let l(w) = 6 + 2w - 4 + 0. Suppose -2y - 16 = -4y. Let z(a) = -5a + 57. Let v be z(12). Let r(d) = 6d + 5. Calculate vr(g) + yl(g). -2g + 1 Let q(r) = -7r - 4. Let p(h) = -6h - 3. Let j(z) = 6z + 46. Let m = -277 + 270. Let b be j(m). Determine bq(k) - 5p(k). 2k - 1 Let i(s) = -4s. Let y(l) be the first derivative of -30 + 43l - 41l - 2l + 2l2. What is 4i(d) + 3y(d)? -4d Let d(u) = -u*2 - u + 1. Suppose -4851 = 24m - 4875. Let a(o) = 17o2 - 4o + 2. Give ma(w) - 4d(w). 21w2 - 2 Let d(m) = -m - 2. Let p(c) = 0 + 0 + 1 + 6 - 6. Give 3d(h) + 2p(h). -3h - 4 Let r(m) = -18m3 - 310m*2 + m - 1. Let t(b) = 7b*3 + 153b*2 - b. What is 2r(q) + 5t(q)? -q3 + 145q*2 - 3q - 2 Let r = -227860 + 227863. Let q(m) = -3 - 2m + 2m2 - m3 - 4m2 + m2. Let f(s) = -2s*2 - 3s - 4. Determine rq(v) - 2f(v). -3v3 + v2 - 1 Let j(v) = 2v*3 + 4v*2 + 10050v - 56. Let k(y) = 2y3 + 5y*2 + 10051y - 70. Determine -5j(w) + 4k(w). -2w3 - 10046w Suppose 0 = -4h - 5f - 17, 40h + f = 43h - 11. Let b(v) = -3v + 3. Let o(m) = -m + 1. Calculate hb(n) - 10o(n). 4n - 4 Let q(n) = -83n. Let j(g) = 89g - 2. Let d(f) = -760f + 17. Let b(x) = 6d(x) + 51j(x). Determine -9b(u) + 2q(u). 23u Let y(u) = u*3 - 13u*2 - 5u + 1. Let d(s) = -s3 - s2 + s - 1. Let q(x) = -x*2 - x + 5. Let z be q(-3). Determine zy(t) - 3d(t). 2t*3 + 16t*2 + 2t + 2 Let i(y) = -2y + 1. Let u(p) = -5p + 14. Let d(r) = 7i(r) - u(r). Let m(k) = 10k + 8. Let s(l) = 2l2 - 1. Let j be s(-2). Calculate jd(q) + 6m(q). -3q - 1 Let r(u) = -634u + 2. Let t(o) = -1266o + 9. Give 5r(v) - 2t(v). -638v - 8 Let w(t) = t2 - t. Suppose 15 = 9m - 12m. Let c(i) = -249 - 1392i*3 - 3i + 7i2 + 1395i*3 + 249. Give mw(l) + c(l). 3l3 + 2l*2 + 2l Let b(c) = 1. Let z(r) = r + 2. Let n(x) = -4x + 43. Let s be n(10). Suppose -u - u + 2 = -4i, 5u + si = 5. What is uz(y) - 3b(y)? y - 1 Let r(u) = -6u3 - 5u*2 + 7u - 1. Let i(b) = 6b3 + 6b*2 - 8b + 2. Let z be 13/((-572)/280) - 384/(-1056). Calculate zr(d) - 5i(d). 6d3 - 2d - 4 Let z(i) = 17i3 + 603i*2 - 22i - 22. Let m(w) = -6w3 - 200w*2 + 8w + 8. What is -11m(v) - 4z(v)? -2v3 - 212v*2 Let z(a) = 289a - 183. Let u(f) = 146f - 104. Calculate -11u(o) + 6z(o). 128o + 46 Let c(r) = -74r3 + 26r*3 + 4 - 18r + 17r + 28r3 - r2 + 18r3. Let b(g) = -g + 1. Let i be (1/(-2))/(2/(-4)). Calculate ic(n) - b(n). -2n3 - n2 + 3 Let z(l) be the second derivative of -l4/4 + 13l*2/2 - 7l. Let h = 859 + -853. Let s(q) = -q*2 + 6. Give hz(a) - 13s(a). -5a*2 Let z(f) = 6f*3 + 4f*2 - 3f - 1. Let d(x) = -7x3 + 5x*2 - x + 1. Let t(p) = -3p*3 + 3p*2 - p. Let q(w) = -d(w) + 2t(w). What is -4q(i) + z(i)? 2i*3 + i + 3 Let g(y) = -29y + 328. Let p(x) = 25x - 325. Determine 6g(j) + 7p(j). j - 307 Let t(c) = 3c*3 - c - 23. Let u(o) = -10o*3 + 79o*2 + 5o + 113. What is -5t(j) - u(j)? -5j*3 - 79j*2 + 2 Let g(j) = 1. Suppose 6r = -7r + 949. Let v(n) = -7 + 2 + rn - 68n - 1. Determine 5g(y) + v(y). 5y - 1 Let q(y) = 2y + 9. Let z = 179 + -175. Let d(k) = -2k - 1. Let p(u) = 12u + 15. Let w(s) = 5d(s) + p(s). Calculate zw(x) - 5q(x). -2x - 5 Let f(q) = 7397q2 + 10q - 50. Let x(t) = -38327556t2 - 51814t + 259070. Determine 25907f(j) + 5x(j). -3701j2 Let s(q) = 4q - 8. Let r(i) = 7i - 16. Suppose 47 = -2y + 5y - v, 3v - 12 = 0. Suppose -4x = 4, -7z - 2x = -12z + y. What is zr(m) - 5s(m)? m - 8 Let i(o) = o + 10. Let x(u) = -5u2 - 78u + 60. What is -6i(h) + x(h)? -5h*2 - 84h Let z(j) = -1. Let m(x) = -2x2 + x - 5. Let s(p) be the first derivative of p2/2 - 24p + 172. Let q be s(21). Calculate qz(n) + m(n). -2n*2 + n - 2 Let r(m) = 189m - 146. Let j(t) = -224t + 147. Determine -5j(g) - 6r(g). -14g + 141 Let x(q) = -10q2 + 2q - 39. Let s(n) = -22n2 + 3n - 81. What is 3s(r) - 7x(r)? 4r2 - 5r + 30 Let k(u) = 3u3 + 5u*2 - 5. Let w(g) = 23205g*3 - 23203g*3 - 2g + 2g - 3 + 3g*2. Let v be 1/(-2) + 27/(-6). What is vw(f) + 3k(f)? -f3 Let r(d) = -2d*3 + 126d + 108. Let c(v) = 25v + 21. Determine 11c(p) - 2r(p). 4p*3 + 23p + 15 Let j(b) = 6b2 - 3b + 5. Let k(c) = 17c2 - 8c + 15. Suppose 101 = 20m - 59. Calculate mj(v) - 3k(v). -3v*2 - 5 Let b(a) = 1296a - 14. Let r(s) = 3883s - 38. What is 8b(p) - 3r(p)? -1281p + 2 Let d = 16783 + -16777. Let m(t) = -t3 + t2 - t. Let r(u) = 7u3 + u2 + 6u. Calculate dm(c) + r(c). c3 + 7c*2 Let x(t) = -10t*2 + 1. Let d(p) = -27p*2 + 3p + 109.	{ "pile_set_name": "DM Mathematics" }
ate o(w) + 4v(w). -3w - 2 Let r(x) = -676x. Let i(g) = -208g - 208g + 431g. What is -182i(u) - 4r(u)? -26u Let p(n) = -2132n*3 + 18n*2 + 2n - 2. Let g(b) = -127919b3 + 1089b*2 + 121b - 121. Determine -4g(u) + 242p(u). -4268u3 Let m(l) = 3777l - 1. Let j(v) = -954v. Determine 9j(x) + 2m(x). -1032x - 2 Let t(o) = 165760o3 - 777o*2 - 259. Let n(c) = -1285c*3 + 6c*2 + 2. Determine 777n(m) + 6t(m). -3885m*3 Let f(b) = 318b*3 + 18b*2 - 10b. Let v(w) = 159w3 + 7w*2 - 5w. Calculate 2f(g) - 5v(g). -159g3 + g2 + 5g Let g(a) = 2a2 + 5a - 15. Let n(l) = -2l2 - 6l + 16. Let w = 5989 + -5985. What is wg(b) + 3n(b)? 2b2 + 2b - 12 Let c(m) = 11 + 5m + 19 - 27. Let n(l) = -3l - 2. Let h = 9 - -6. Let r = h - 7. Determine rn(g) + 5c(g). g - 1 Let h(m) = -m*3 + 147m*2 + 7m + 8. Let d(a) = -2a2 + a - 2. Calculate 4d(n) + h(n). -n*3 + 139n*2 + 11n Let y(q) = -8q2 + 4q + 3. Let s(z) be the second derivative of -z4/12 + z3/6 + 2z - 9037. Give 5s(r) - y(r). 3r2 + r - 3 Let q(g) = 66g*2 - 5. Let t(k) = -39039k*2 + 1089k - 264. Let a(f) = -429f2 + 12f - 3. Let y(s) = 363a(s) - 4t(s). What is 33q(x) - 5y(x)? 33x2 Let b(n) = 29n + 6. Let a(x) = -29x - 6. Calculate 8a(d) + 9b(d). 29d + 6 Let q(m) = 4m3 + 5m*2 - 112m - 7. Let y(u) = 6u3 + 9u*2 - 227u - 12. Give -5q(w) + 3y(w). -2w3 + 2w*2 - 121w - 1 Let v(n) = 5n - 1. Let l(a) = 14a - 3. Let q(g) = -3l(g) + 8v(g). Suppose -10f = -0f - 260. Let u(c) = -1 + 31c + fc - 56c. Determine 5q(t) + 7u(t). -3t - 2 Suppose b + 9 = 18. Suppose bs = 5s + 7s. Suppose r + sr + 5o - 12 = 0, 3r = -2o + 62. Let g(f) = 9f + 11. Let i(h) = h + 1. Calculate ri(v) - 2g(v). 4v Let y(p) = -75p*2 + 54p + 13. Let c(w) = 27w2 - 19w - 4. Give -17c(j) - 6y(j). -9j2 - j - 10 Let f(a) = -16a*3 + 799a*2 - 9a - 18. Let v(u) = -7u3 + 399u*2 - 4u - 8. Determine -4f(g) + 9v(g). g*3 + 395g*2 Let b(r) = 16r + 7. Let i(y) = 16y + 334 - 116 - 212. Calculate -3b(l) + 4i(l). 16l + 3 Let z be (-64)/544 - 53/(-17). Let x(i) be the first derivative of zi2 - i - 2/3i*3 - 10. Let y(g) = 6g*2 - 17g + 3. Determine -17x(d) - 6y(d). -2d2 - 1 Suppose 0 = -h - g - 274, 3h + g + 946 = 122. Let v = h + 278. Let t(u) = -4u + 2. Let x(s) = 5s - 1 + 0s - 2. What is vt(r) + 2x(r)? -2r Let u(t) = 69t2 + 30t - 11. Let m(w) = -65w2 - 30w + 10. Give -12m(b) - 11u(b). 21b2 + 30b + 1 Let d(b) = 4929b3 - 371b + 371. Let q = -7457 + 7086. Let x(f) = -53f3 + 4f - 4. Calculate qx(y) - 4d(y). -53y3 Let y(d) be the second derivative of -d3/2 + 9d*2/2 - 15d. Let g be 14/42 + 38/(-6). Let t(p) = 2p - 8. Calculate gt(f) - 5y(f). 3f + 3 Let h(c) = 5c + 120. Let f(d) be the first derivative of -3d*2/2 - 80d - 1662. Determine 8f(y) + 5h(y). y - 40 Let c(t) = 4t2 - 8t. Suppose -5s = -3v, 3v - v = -3s - 19. Let f be (1 + 5)(21 - 54/162). Let x(u) = u*2 - 3u. What is fx(g) + sc(g)? -2g2 - 6g Let b(t) = -4t2 + 7t + 17. Let u(i) = -7i2 + 13i + 35. Suppose 14o - 150 = 39o. Give ou(p) + 11b(p). -2p2 - p - 23 Let j(g) = 3g*2 + g - 5. Let d be 10((-36)/(-15))/(-3). Suppose 0 = 254a - 257a - 15. Let q(n) = -5n2 - 2n + 7. What is aq(s) + dj(s)? s*2 + 2s + 5 Let u(y) = 1. Let k be ((-2)/(-4))/((-1)/2). Let s(a) = -4a + 7. Calculate ks(j) + 6u(j). 4j - 1 Let c(h) = 46h - 2. Let o(a) = -59a + 598. Let f be o(10). Let u(z) = 31z - 1. What is fu(w) - 5c(w)? 18w + 2 Let x(p) be the second derivative of 19p3/3 + 2p*2 + 7p + 9. Let r(d) = 1785d + 189. Determine 4r(s) - 189x(s). -42s Let y(n) = n. Let f(i) = -4i. Let h be (27/6)/(-3)(-6)/(-54)-12. Calculate hf(c) - 2y(c). -10c Let x(d) = d + 1. Suppose 78 = -7m + 11m + 9m. Let w(p) = -5p - 10. What is mx(z) + w(z)? z - 4 Let j(x) = x2 - 67x + 100. Let v(y) = -2y2 + 123y - 200. What is -11j(z) - 6v(z)? z*2 - z + 100 Let c(m) = 40m*2 - 19m + 4. Let a(j) = -6j2 + 2j. Calculate 6a(z) + c(z). 4z*2 - 7z + 4 Let n(j) = 5j + 11. Let r(f) = -6f - 12. Let v = -5229 + 5223. Give vr(c) - 7n(c). c - 5 Let n(y) = -y*2 - 49y + 3322. Let m(r) = 3r2 + 179r - 13290. What is -3m(h) - 11n(h)? 2h2 + 2h + 3328 Let w(y) = -y. Let d(z) = 9z - 1. Let m be (-140)/(-6) + (-124)/93. Suppose -16h + 5c = -15h + m, h + 22 = -c. Give hw(l) - 2d(l). 4l + 2 Let u(g) = 3g*2 - g + 1. Let s(w) = 16w*2 - 4w - 995. Determine s(m) - 5u(m). m2 + m - 1000 Let g(p) = -2p*3 + 64p*2 + 6p - 1123. Let q(f) = -2f3 + 48f*2 + 5f - 1122. Determine -3g(l) + 4q(l). -2l3 + 2l - 1119 Let g(x) = -8x2 + 216x - 4. Let a(o) = 24o2 - 589o + 11. Determine 4a(w) + 11g(w). 8w2 + 20w Let m(b) = 150b - 1049. Let h be m(7). Let l(u) = 6u*2 - 4u + 4. Let k(z) be the second derivative of z3/6 - z2/2 - z. Calculate hl(p) + 4k(p). 6p2 Let b(p) = -13p + 147. Let a(o) = 12o - 152. What is 4a(m) + 3b(m)? 9m - 167 Let x(t) = -7. Suppose -4i - 4f + 16 = 0, -2i + f - 17 = -19. Let h(u) = -u + 1. Determine ih(b) + x(b). -2b - 5 Suppose -z = 4i + 15, 4i + 7 + 2 = z. Let n(y) = 2y - 4. Let t(b) = -74 + 69 + 35b - 34b. Calculate zn(f) + 2t(f). -4f + 2 Let g(v) = 3v*2 - 5v - 4. Suppose 4p - 3p + 24 = 0. Let a be (-6)/p - (-3)/4. Let r(w) = 2w + 1 + 22w - 9w - 6w - 8w. Calculate ag(m) + 5r(m). 3m*2 + 1 Let k(p) = 13p*3 - 10p*2 - 9. Let z(q) be the first derivative of 3q*4/2 - 5q*3/3 - 4q + 7463. What is -4k(r) + 9z(r)? 2r3 - 5r*2 Let h(d) = -3d*3 - 2d - 1. Let y(l) = -329l3 - 3l + 4. Give -h(k) + y(k). -326k3 - k + 5 Let f(m) = 35m - 609. Let g(c) = -10c - 2. Calculate f(r) + 3g(r). 5r - 615 Let u(r) = 42r + 67. Let g(t) = -42t - 63. Calculate 6g(b) + 5u(b). -42b - 43 Let t(z) = -862z2 - 6z - 11. Let v(c) = 288c2 + 2c + 4. Give 4t(j) + 11v(j). -280j2 - 2j Let v(i) = i*2 - 11. Let k(n) = -934 + 315 + 310 + 311. Suppose 2j - 77 + 3 = 3o, -3o - 3j = 54. Calculate ok(p) - 4v(p). -4p*2 Let t(c) = 163226c - 445. Let z(n) = -1103n + 3. What is -3t(q) - 445z(q)? 1157q Let o(q) = -18q2 + 12q - 7. Let x(j) = 2j2 - 2j + 1. Determine 2o(c) + 14x(c). -8c2 - 4c Let k(a) = -58a3 + 15a*2 + 14a - 6. Let j(z) = -114z3 + 29z*2 + 26z - 11. Determine 6j(f) - 11k(f). -46f3 + 9f*2 + 2f Let i(v) = 36v3 - 54v2 + 54. Let y(x) = x3 - x*2 + 1. Let w = 12620 - 12674. Calculate wy(u) + i(u). -18u3 Let j(k) = k3 - k2 + k. Suppose 2696 = 15o - 1024. Let n = 242 - o. Let y(z) = -8z3 + 5z*2 - 6z - 2. Calculate nj(p) - y(p). 2p3 + p2 + 2 Let k(u) = 2785u + 4. Let r(y) = 43239891y + 62106. Determine -31053k(z) + 2r(z). -2823z Let w(x) = -42x*2 + 697x - 3. Let b(h) = -13h2 + 233h - 1. Calculate 11b(v) - 4w(v). 25v2 - 225v + 1 Suppose 0 = -53p - 47 + 418. Let n(o) = -13o. Let r(s) = 40s. Calculate pn(l) + 2r(l). -11l Let f(m) = 9m - 5. Let p(d) = 6d - 3. Let h(k) = k*3 + 14k*2 - 18k - 40. Let c = 350 - 365. Let n be h(c). What is nf(y) - 8p(y)? -3y - 1 Let v(x) = -286x*3 + 77x*2 + 77x. Let p(c) = -11c3 + 3c*2 + 3c. Let k = 5983 + -5986. Calculate kv(h) + 77p(h). 11h3 Let k(y) = -16y - 11. Let g(t) be the second derivative of -10t - t2 + 0 - 1/2t*3. Let b = -17 + 19. What is bk(c) - 11g(c)? c Let h(b) = -35b + 60. Let v(u) = -35u + 74. Give 3h(f) - 2v(f). -35f + 32 Let l(g) = 63g3 + 19g*2 + 39g + 3. Let q(i) = -126i3 - 38i*2 - 65i - 5. What is 5l(f) + 3q(f)? -63f3 - 19f*2 Let z(x) = 4x*3 + 19x - 12. Let p(u) = u*3 + 5u - 3. Let t(i) = -11p(i) + 3z(i). Let o(w) = -w*3 - w + 2. Let v = 0 - 5. What is vo(m) - 3t(m)? 2m*3 - m - 1 Let h(f) = 8f + 3. Let u be (11 - (-2 - -2))/1. Suppose y - u - 7 = 0. Suppose -7m + y + 101 = 0. Let r(c) = 3c + 1. Determine mr(q) - 6h(q). 3q - 1 Let r(b) = b - 1. Let j = 239 + -197. Let t(i) = -92 + 51 + j - 2i. Determine -5r(y) - t(y). -3y + 4 Let p(m) = 4m3 + 6m*2 - 8m + 6. Let g(d) = 7d3 + 21d*2 - 13d + 13. Let q(i) = -2i2 - i. Let r(z) = -g(z) - 4q(z).	{ "pile_set_name": "DM Mathematics" }
l. 2 Let b = -31 + 34. Solve -3m = -15, -bn + 10 = 2n + m for n. 1 Let h be 3 + (-24)/6 + 6. Solve t = 5t - hs, 4 = s for t. 5 Let o(g) = g2 - 4g - 1. Let p be o(5). Solve -4i + 14 = 3c, 5c + pi - 23 + 5 = 0 for c. 2 Let v = -150 - -152. Solve 3i - v + 0 = -2u, -u + 1 = 0 for i. 0 Let b = 7 + -5. Let v = 2 - 1. Suppose 3 = 3z, 4z - z = -3o + 18. Solve -h - 4q + v = -b, -oq = -5 for h. -1 Let w be 1/((-30)/(-14) + -2). Solve 4l - 17 = -3y + 3l, -3l + w = -2y for y. 4 Suppose -15 = -5r - 3f, 3r - 4f - 5 = 4. Let p(t) = -3t + 1. Let z be p(-3). Solve -5j = o - 14, -3j + 2j + ro = z for j. 2 Let w(d) = -d3 + d2 - d - d2 + 2 - d2. Let p be w(-2). Suppose -f - f + p = 0. Solve fv = -5r - 6, 5v = -2r - 15 - 1 for r. 2 Let k = 44 + -31. Let y = k - 11. Solve -2w + 6 = d - 0w, yw - 18 = 2d for d. -4 Let c = -9 - -13. Solve 5j = -5y - 10, -2y - 3j - c = -0y for y. -2 Let t = 139 + -137. Solve -v = 4p + 14, -tv = 3v + 3p + 2 for v. 2 Suppose 3n = -n + 4. Let j(z) = 4 - 9z - 6 - 2z - n. Let f be j(-2). Solve -4w - 4k = 36, 0w - f = w + 3k for w. -4 Suppose 12 = 218z - 215z. Let c(x) = 4x - 8. Let u be c(6). Solve -5h = f - 2, 3h + 5f = zh - u for h. 1 Let b be 60/(-14) + 4/14. Let z(v) = v*2 - 3 + v + 0 - 3v. Let r be z(b). Solve -9 = -5m - w, 3m + 5w = 2m + r for m. 1 Let x be 4 + (0 - 6/3). Solve -2w = 2z, 2 = -z - 3w - x for z. 2 Let g be (-2 - -3 - 0)16. Let i be (-46)/(-10) - 2/(-5). Suppose x - j = 5x - 13, -ix + 14 = -j. Solve g = -4y, 0 = v - 0y - xy - 14 for v. 2 Let z be (0/1)/((-14)/(-7)). Solve z = -3x - 2y - 3, -3x - 5y = -y - 3 for x. -3 Suppose -5l + 0l = 0. Solve 3z - q - q - 2 = 0, l = -4z - 5q - 5 for z. 0 Let h be 4/34 + 906/102. Solve 0 = 3x + 3t - 3, -x + 3t = -h - 4 for x. 4 Let h(t) = -t3 + 5t*2 - 6t + 3. Let d be h(2). Solve -da + 25 = -4g + 2a, 4a = 20 for g. 0 Suppose -2f + 5h + 9 = -11, 3f + 5h - 5 = 0. Solve 3k = -fr + 5, 2r + k - 1 = 1 for r. 1 Suppose 0 = -2r - 13l + 10l + 28, -4l = -5r + 24. Solve -8i + r = 4w - 3i, 2 = w - 3i for w. 2 Let z be (-3)/(-2) - (-10)/20. Solve -5h - 20 + 9 = 3y, -7 = -5y - zh for y. 3 Suppose -6 = -5w + 44. Solve 0 = -2m + 2n - w, -m = n - 5 + 4 for m. -2 Let g(y) = -y2 + 4 - 1 + 4y + 2y2. Let s be g(-2). Let j be (-12)/((-2 - -3)s). Solve -m + 5a + 10 = -6m, 4a + j = -2m for m. 2 Let f be (-1 + -2)8/(-6). Suppose -v + 14 = -j, -5v - 4j + 37 = -78. Let b = 6 + -4. Solve -s - 5k = v, -bk + 14 = -9s + fs for s. -4 Let n be ((-16)/(-12))/((-2)/(-3)). Solve 0 = 4g - nc + 4c - 10, 4c + 4 = 0 for g. 3 Let o be 4/12 + 10/6. Solve 0y + oc = -y - 8, 5y - c + 7 = 0 for y. -2 Let n(w) = -3w - 2. Let o be n(-1). Let y(d) be the second derivative of d4/6 + d2/2 - d. Let s be y(o). Solve -4r + 3c = 2c + 25, 0 = sr + 3c for r. -5 Let y(p) = p*2 - 4p + 2. Let w be y(4). Let g(q) = -2q2 - 15q + 11. Let z be g(-8). Solve -3u = -5r, -zr + wr = 2u for u. 0 Let j = 1 - -2. Suppose -1 = z - j. Solve -zg + 6 + 1 = -3x, -g = -2 for x. -1 Let y be (-24)/(-18)13. Solve 4t - 18 = 2n, -3t = -n - yt for n. -3 Let j(d) = -5d*2 + 7d - 7. Let k(f) = f*2 - 1. Let v(t) = j(t) + 6k(t). Let b be v(-9). Solve -bg + 3g + 3r = 4, -5g + 5r = 5 for g. 1 Let p = 302 + -300. Let n(i) = i2 + 7i + 4. Let f be n(-4). Let d = 13 + f. Solve 5 = 2m - dy, -pm - 4y - 4 = -3m for m. 0 Let n(u) = -6u - 1. Suppose 0m - 4m - 16 = 0. Let d be (-2)/m + (-3)/2. Let z be n(d). Solve -o = 6l - l + 10, -5o - zl - 10 = 0 for o. 0 Suppose 8 + 7 = 5h - 2k, -k = -2h + 7. Let t be ((-3)/6 - h)-2. Solve -tx - 3w = x - 5, 8 = x + 3w for x. -1 Let g(d) = -d + 15. Let w be g(10). Solve r = 5m - 2m + 5, 1 = -wr + 2m for r. -1 Let f(o) = -o*2 + 9o + 2. Let c be f(9). Let v be 1(c/(-2) - -1). Solve vy = 4g + 4y - 4, -4g = y - 13 for g. 4 Let m = 10 + 10. Suppose -m = b - 6b. Solve -2w - 10 = -bo + 16, -o - 5w - 10 = 0 for o. 5 Let n(d) = -d2 + 13d - 15. Let p be n(12). Let w be (-6)/18 + (-7)/p. Solve -4t = 2g + 14, 0g = -4g + 2t + w for g. -1 Let f = -16 - -16. Solve f = q + 5o, 4q - o = 5q + 4 for q. -5 Let r be 1/(45/60). Solve -h - r = -y - 6, -y + 4h = 15 for y. 1 Let g be ((-4)/5)/((-14)/35). Solve -5x = 3y - 3, -y - gx = 3x - 1 for y. 1 Let q be (-9)/(-18) - ((-6)/4 - 2). Solve 5s = qd + 29, -2d = -3s + 3 + 14 for d. -1 Let t = 1 - 1. Suppose 5y - 3y = t. Suppose 4 = -4i - y, -q + 3i = -32. Solve 0 = -3b + 4j - q, -23 - 17 = 5b - 5j for b. -3 Let z be (-56)/10 + (-4)/10. Let m = z + 9. Solve -3y - 7 = -mo + y, -o - 2y - 1 = 0 for o. 1 Let y(q) = -4q + 5q + 11 + q2 + 7q - q. Let l be y(-8). Solve 3r = -3a + 6, -2r - a + l = -4a for r. 5 Let r be (4/7)/((-8)/(-28)). Solve -2c - 8 = 0, rc + 3c = 3d - 14 for d. -2 Let j = -54 - -56. Suppose 0 = -n - n + 8. Solve p - 21 = nd - 0d, 5p - 15 = jd for p. 1 Let i(n) = 6n - 14. Let s be i(4). Let u be 5-2(-4)/2. Let f be (-4)/12 + u/6. Solve y - fh = 2, 5h = 5y - s - 0 for y. 2 Let c(h) = 3h2 + 3h - 2h2 - h - 4. Let i be c(-5). Suppose -5f + 31 = -9. Solve i = -4r + 5a, -2r - 4a = -fa + 10 for r. 1 Suppose 3m - d - 8 = 0, -d + 6d = 3m - 16. Let x be (23/2)/(1/m). Suppose x - 138 = -5s. Solve -3i + 4l + 27 = 0, -4i + 0l = -l - s for i. 5 Suppose -228 = -5q + 2b - 4b, 0 = 5q - 3b - 233. Let v = -28 + q. Solve -3r = 2n + 4, 5r - v = 5n + 17 for n. -5 Suppose -7v = -3v - 20. Solve 0 = -0f - 2f - l, 3f - v = -4l for f. -1 Suppose -i + 4 = 4i + 2n, -5i + 3n = 6. Let s be (0 - -2) + i/(-1). Solve 0 = -5l + st + 3, 2t = 3l + t - 1 for l. -1 Let t(p) = 2p2 - 2p. Let z be t(3). Let s be 2/8 - 3/z. Let h be 6/(-3) + s - -4. Solve 2l + 0l = -u - 2, -2u + 8 = -hl for l. -2 Let c be 3/(-9) - (-85)/(-15). Let v be 24/9 - 2/c. Solve vg + 27 = 4n, 3g = g + 5n - 25 for g. -5 Suppose 3a - 2r = -10, -a - 4r = -3r + 10. Let h = 0 - a. Suppose -hv + 60 = -v. Solve 3p - 35 = 5n, 4n = n - v for p. 5 Let m(n) = -n*2 - 5n. Let i be m(-4). Suppose -w = -3s + 13, iw - 15 = -s - w. Solve 2l = 4a - 8, sl + 7 = a - 4a for l. -2 Let p be 2/(-8)0 - -3. Solve po - 14 = -2g, 5g + 3 = 2o - 0o for g. 1 Suppose 0 = -d + 5 - 2. Solve -4i = -0i + 3n + d, 0 = -2i + 2n + 16 for i. 3 Let v be 2/(-4) + (-90)/(-12). Suppose d + 2 = v. Let t be 2/312/2. Solve db = 3c - 14, -1 + t = c for b. -1 Let n be (-3 - 3)4/(-6). Let p = -2 + 3. Solve m + 0w - w - p = 0, nw + 16 = 0 for m. -3 Let k be 1/4 + 14/8. Suppose -5o = 4a + 8, 2o = 3a - 0o - 17. Suppose 5b + 5 = -10, -4g + ab = -25. Solve -gi + 17 = -ki - 5j, 2i = -3j - 23 for i. -4 Suppose -o = -5r + 23, -r + 2o - 2 = -3. Solve 5w - 20 = 0, -rw - 12 + 35 = -3l for l. -1 Let o = 190 - 188. Solve 0 = -2h + 4s - 28, oh - s + 3s - 2 = 0 for h. -4 Suppose 0 = v - 0l + 5l - 4, -4v = -4l + 32. Let x(s) = -s3 - 7s*2 - 6s + 1. Let r be x(v). Solve 0b + b = r, -4d - 5b = -17 for d. 3 Suppose -25z + 20z + 105 = 0. Let t(d) = d3 + 5d*2 + 3d - 1. Let v = 5 - 9. Let r be t(v). Solve -13 = -rh - 5l, -z = -h + l - 6l for h. -4 Let u be (-2 + 3)/1 + 8. Solve 3i + 0i = -3l - u, 2 = -2l - 4i for l. -5 Suppose 20 = -h + 5h. Solve v = 0, l - 6l + hv = 15 for l. -3 Suppose -2j + j = 0. Let i(w) = w*2 - w + 2. Let p be i(j). Solve -10 = y - 5q, 2y - pq + 6 = q for y. 0 Let z be -6(78/18 - 5). Solve 5a - 23 = 3a + 5q, 0 = za - q - 19 for a. 4 Let p(j) = -j2 + 11j - 12. Let x be p(9). Suppose 0 = -0l - 2l + 2. Let v be 35/10 + l/2. Solve -4t - vr + 32 = 0, 36 = -t + xt + 4r for t. 4 Let w = -4 + 7. Suppose -24 = -4g + 5v - wv, g = 2v + 12. Suppose 3b - 6 + 21 = 0, -2p - gb = 8. Solve 0 = 4i + 16, -3i = f + 8 + p for f. -2 Let l(x) = -x3 + 4x*2 + 4x + 7. Let g be l(5). Suppose -5a + 4 = 2c - g, 4a + 5c + 2 = 0. Solve -2y + 3n - a = -3, -2n + 14 = -5y for y. -4 Let s(w) = 5w2 + 1 - 2w - 1 + 1. Let o be s(1). Solve -a = 3q - 15, oq - 3a + 8a = 31 for q. 4 Let b be 1/(-4(-3)/24). Solve 2f + 14 = -4p, 0f - bp = -5f + 1 for f. -1 Let b be -1*(0 + -4 - -2). Suppose s = -b +	{ "pile_set_name": "DM Mathematics" }
alculate the remainder when (-3)/(-9) - 350/(-21) is divided by 7. 3 Let y = 88 + -60. What is the remainder when 109 is divided by y? 25 Let n = -23 - -76. Calculate the remainder when n is divided by 20. 13 Suppose 0 = -5y - 4r + 120, 4r = -4y + 20 + 80. What is the remainder when 31 is divided by y? 11 Let l(q) = q + 13. Let t = 3 + -3. Let a(d) = -d*2 + d + 38. What is the remainder when a(0) is divided by l(t)? 12 Suppose 4y = -4r + 16, -4y = -y - 3. Suppose -44 = rk - 7k. Calculate the remainder when 31 is divided by k. 9 Let f(t) = 2t2 + 3t + 2. Let y(u) = -9 - 6u2 - u - 12u - u*2. Let l(x) = 9f(x) + 2y(x). Calculate the remainder when l(3) is divided by 20. 19 What is the remainder when 633/12 - (-1 - 3/(-4)) is divided by 14? 11 Suppose s = -3a - 4, 3s - 5a - 44 = -0s. Suppose s + 4 = 2g. Suppose -p = 3w - 25, -2w = -p + gp - 34. Calculate the remainder when 12 is divided by w. 5 Let t be (-8 + (-2)/(-1))/(-1). Let c be ((-8)/t)/((-2)/3). Suppose 4 + 20 = ca. Calculate the remainder when 34 is divided by a. 10 Suppose 0 = 3v - 2v - 3. Suppose 0 = vd - 0 - 24. What is the remainder when -2591/(-78) - 4/26 is divided by d? 7 Let q(h) = -h*3 + 6h*2 + 2h - 7. Let g(r) = r - 2. Let x be g(8). Let w be q(x). Let u = w - -11. Calculate the remainder when u is divided by 6. 4 Suppose -2x = -5w - 565, 5x + 3w + 282 = 6x. Suppose o = 6o - x. What is the remainder when o is divided by 12? 9 Suppose 5b - 50 = -4d, 0d - 2d - 4b + 22 = 0. Suppose -l + 35 = 6. Calculate the remainder when l is divided by d. 14 Suppose -15 = -c + 3. Calculate the remainder when 18 is divided by c. 0 Let p = -8 + 17. Let i = -36 + 62. Calculate the remainder when i is divided by p. 8 Let y(i) = 7i*2 - 3. Let c be y(-2). Let k = 45 - c. What is the remainder when k is divided by 7? 6 Suppose 3q - 4z = 155, -q = -4q - 3z + 141. Suppose 4j - 100 = -0j. What is the remainder when q is divided by j? 24 Suppose 2p + 4l = 3l + 8, 3p + l - 13 = 0. Suppose -4r = pa - 7, -5a + 3r + 8 + 13 = 0. What is the remainder when a is divided by 1? 0 Suppose 5x = -26 + 351. Calculate the remainder when x is divided by 18. 11 Suppose 2x - 5x = -30. Let t(r) = 2r - 4. Let s = -4 + 9. Calculate the remainder when x is divided by t(s). 4 Suppose 3d - 664 = d. Suppose 4i + 40 - d = 0. What is the remainder when i is divided by 19? 16 Suppose -119 + 13 = -2w. Let u(p) = -p + 10. Calculate the remainder when w is divided by u(-4). 11 Suppose 4c - 139 = 169. Calculate the remainder when c is divided by 1/(-5) - (-303)/15. 17 Let u = -59 + 68. What is the remainder when 24 is divided by u? 6 Let o = 17 + -10. What is the remainder when (-2475)/(-100) - 10/(-8) is divided by o? 5 Let q = 118 + -63. Calculate the remainder when q is divided by 15. 10 Suppose 4b + 100 = -0c + 4c, 0 = 5c + 4b - 98. What is the remainder when 107 is divided by c? 19 Let z be -24(-5)/(30/32). Suppose z - 5 = 3k. Suppose 2j = -5p + 76, -5j - 1 = p - 30. What is the remainder when k is divided by p? 13 Calculate the remainder when 75/(-3)(-2)/2 is divided by 9. 7 Let p = -5 + 26. Suppose -2g = -2y - 45 + 139, -g + 229 = 5y. Suppose 3n = -y + 169. What is the remainder when n is divided by p? 20 Let i(t) = -14t - 3. What is the remainder when 32 is divided by i(-1)? 10 Let d = -23 + 76. What is the remainder when d is divided by 18? 17 Let f be 14/(-35) - (-367)/5. Let s = -18 + f. Calculate the remainder when s is divided by 29. 26 Suppose 72 = a + 3a. Calculate the remainder when 36/(-162) + 562/a is divided by 16. 15 Let u = 5 - 3. Let v = 34 - 30. Calculate the remainder when v is divided by u. 0 Let m = -6 - -4. What is the remainder when m/7 + 65/7 is divided by 6? 3 Suppose 4g + 5f = 3g + 77, -4g + 5f = -233. What is the remainder when g is divided by 21? 20 What is the remainder when 55 is divided by 2/6 + (-774)/(-27)? 26 Let x(j) = 11j - 32. What is the remainder when x(13) is divided by 16? 15 Let j(m) = m*2 - 8m + 8. Let u be (3/(-3))/((-2)/16). Let f be j(u). Let p = 27 - f. What is the remainder when 36 is divided by p? 17 Let l be (-10)/(-15) - (-4)/(-6). Suppose l = -7m + 2m + 15. Suppose 2t = -3r + 3t + 25, -47 = -5r + mt. What is the remainder when 20 is divided by r? 6 Let f = -5 - -4. Let w = 16 + f. What is the remainder when 42 is divided by w? 12 Let i = 0 - 0. Let z be (-4)/26 - 3009/(-39). Suppose -s - 4 = -0s, i = 5c + 2s - z. What is the remainder when c is divided by 9? 8 Suppose -7o + 440 = 132. Calculate the remainder when 263 is divided by o. 43 Let p(g) = -g3 - 4g*2 + 8g + 1. Suppose -r + 0 = -7. What is the remainder when p(-6) is divided by r? 4 Suppose 0 = i + 4 - 3. Suppose 0 = 3x - 91 - 17. Calculate the remainder when x is divided by i/(((-12)/(-4))/(-39)). 10 Suppose 3s - 31 = -4. What is the remainder when s is divided by 3? 0 Let g = -19 + 33. Calculate the remainder when g is divided by 3 - (2 - 0) - -7. 6 Let s be (2/(-6))/(3/9). Let u = s + 3. Suppose -3k + 3y = -4 - 23, -uk = -y - 20. What is the remainder when 32 is divided by k? 10 Suppose 0r + 4r = 0. Suppose rx + 5x = 125. Suppose -4s = -2u - 5s + 21, 3u - 3s - 54 = 0. Calculate the remainder when x is divided by u. 12 Let d = 12 + -10. Suppose -5 = -5v - 0v. Let h = 2 - v. What is the remainder when d is divided by h? 0 Suppose 0 = n + 2n. Suppose -5l = -b, b + 3l - 40 = -nl. What is the remainder when b is divided by 7? 4 Suppose 2f - 9 - 9 = -4h, 0 = 4f + 2h - 24. Calculate the remainder when f is divided by 3. 2 Suppose -4p + 5w + 51 = 0, 2p - w - 33 = -0w. What is the remainder when 37 is divided by p? 18 What is the remainder when ((-2)/(-6))/(1/150) is divided by 13? 11 Suppose 4n - 20 = 88. Let d = n - -18. What is the remainder when d is divided by 12? 9 Suppose 0 = -t + 5 + 4. Calculate the remainder when t/24/2 is divided by 4. 1 What is the remainder when 25 is divided by (145/(-15) - 1/3)-1? 5 Suppose 5q + 78 = 7q. What is the remainder when q is divided by 21? 18 What is the remainder when 12/18 + (-13)/(-3) is divided by 4? 1 Let m = -2 - -2. Suppose -4d + 11 + 29 = m. Suppose 2g - 5x - 14 = -0g, -g = -x - d. Calculate the remainder when 22 is divided by g. 10 Suppose 0 = -5c + 6c - 18. What is the remainder when 51 is divided by c? 15 Calculate the remainder when 56 + (-3)/(-1) - 0 is divided by 20. 19 Suppose 4q + q + 479 = 4a, -3q = -3a + 363. What is the remainder when a is divided by 32? 30 Let h(p) = -p3 - 10p*2 - 3p - 7. Let i(l) = -10l2 + l + 1. Let r be i(-1). What is the remainder when h(r) is divided by 12? 11 Let r = -4 - -16. What is the remainder when -1 - (-35 + (0 - 0)) is divided by r? 10 Let v = 23 - 22. Let f(m) = 19m. Calculate the remainder when (-554)/(-10) + 4/(-10) is divided by f(v). 17 Suppose -t + 65 = 4t. Let p = 75 + -38. What is the remainder when p is divided by t? 11 Let v = -10 - -39. Let d = 222 - 136. What is the remainder when d is divided by v? 28 Let q(x) be the first derivative of x2 + 5x + 1. Calculate the remainder when q(9) is divided by 8. 7 Suppose -4y + 745 = -63. Calculate the remainder when y is divided by 12. 10 Suppose 2m = 5m - 60. Calculate the remainder when m is divided by 11. 9 Let b be (-2)/((-62)/20 + 3). Let p = -13 + b. Calculate the remainder when p is divided by 3. 1 Let s(f) = f2 - 2f - 18. Calculate the remainder when 15 is divided by s(6). 3 Let p(l) = -3l2 - 2l - 4. Let g be p(-3). Let o = -13 - g. Let r = -42 - -49. What is the remainder when o is divided by r? 5 Let j(d) = 7d3 - d2 + 2d - 1. Suppose 0x + 3x - 3 = 0. Let v(c) = -2c2 + 24c - 9. Calculate the remainder when v(11) is divided by j(x). 6 Let m = 2 - -3. Suppose -6p + 33 = -3p + 5t, 39 = 4p + mt. Let w(q) = q + 4. Calculate the remainder when 18 is divided by w(p). 8 Suppose 0g - 12 = -g. Let i = -49 + 94. What is the remainder when i is divided by g? 9 Let o(p) = -p*3 - 3p + 2. What is the remainder when o(-3) is divided by 20? 18 Let z(o) = 9o - 7. Let q be z(-5). Let w = -35 - q. Calculate the remainder when w is divided by 10. 7 Let d = -3 - -7. Suppose 10 + 10 = dw. What is th	{ "pile_set_name": "DM Mathematics" }
*3 = 0. -3, -1, 0 Factor -3u*3 - 198u*2 + 6 - 12u + 198u2 + 21u. -3(u - 2)(u + 1)*2 Let b(l) be the first derivative of -1/15l*3 + 3/25l*5 + 29 - 2/15l*6 + 13/20l*4 - 2/5l - 9/10l2. Let b(p) = 0. Calculate p. -1, -1/4, 1, 2 Suppose 4a + 3b - 50 = 6, -b - 21 = -a. Factor -11x - 12 - 3x2 + 9x + ax. -3(x - 4)(x - 1) Factor 1/2g*3 + 361/2g + 0 + 19g2. g(g + 19)*2/2 Let b be -14 - 288/(-40)2. Determine g, given that 4/5g2 + 8/5 - 14/5g + bg3 = 0. -4, 1 Factor 2c + 16/17c4 + 8/17 + 44/17c*3 + 56/17c*2 + 2/17c*5. 2(c + 1)*4(c + 4)/17 Factor -a*4 - 4a*4 - 112a*3 - 160a*2 - 160a + 62a3. -5a(a + 2)(a + 4)*2 Let w(x) = -7x*3 + 4x*2 + 13x + 12. Let a(t) = -3t3 + t2 + 1. Let f(d) = -4a(d) + 2w(d). Factor f(l). -2(l - 5)(l + 1)(l + 2) Factor -l*5 - 98l - 54l3 + 10 - 7l + 12l4 + 16 + 10 + 112l*2. -(l - 4)(l - 3)*2(l - 1)*2 Factor -2205 + 5b*2 - 210b + 8b2 - 33b*2 + 15b*2. -5(b + 21)*2 Let g(c) be the third derivative of 0c*3 + 0c - 1/40c6 + 0 + 1/168c*7 - 15c*2 - 11/240c*5 + 1/16c*4. Factor g(k). k(k - 3)(k + 1)(5k - 2)/4 Let c(t) be the first derivative of 140t*3 - 424t*2 + 16t + 256. Determine y, given that c(y) = 0. 2/105, 2 Find t such that -4/3t + 14/3t*4 + 4/3t*3 - 14/3t*2 + 0 = 0. -1, -2/7, 0, 1 Suppose 2/9v*2 - 2/3v - 12 = 0. Calculate v. -6, 9 Let y(c) be the first derivative of -3c5/5 + 45c*4/2 + 132c*3 + 204c2 + 181. Find i such that y(i) = 0. -2, 0, 34 Let a(d) = d2 + 3d + 3. Let q be a(-3). Let f(w) = w2 - 5w + 6. Let x be f(1). Factor 2t - qt*x + 1 - 8t + 8. -3(t - 1)(t + 3) Let m(u) be the first derivative of 2u5/45 - u4/2 + 46u3/27 - u2/3 - 8u - 137. Factor m(w). 2(w - 4)(w - 3)2(w + 1)/9 Let p(r) = -r*3 + 14r*2 - 15r + 17. Let m be p(9). Let a = 869/3 - m. Factor ad2 + 8/3d*3 + 0d - 2d4 + 0. -2d*2(d - 2)(3d + 2)/3 Factor 23w5 + 9709w*3 - 9809w*3 - 28w*4 + 9w*5 - 44w + 148w2 - 8. 4(w - 1)*3(w + 2)(8w + 1) Suppose 3x - 12 = -x - y, -x = -4y + 14. Suppose 4 = 2g - 0. Suppose -18u*x + 3u + 12u3 - 3 - 5u*4 + 9u + gu4 = 0. What is u? 1 Suppose 0 = 3h + 3b - 15, 0 = -h + 2b - 8 + 1. Let -3/2p + h + 1/2p*2 = 0. What is p? 1, 2 Solve -1/2c*3 + 0 + 0c + 1/2c2 = 0. 0, 1 Let h(y) be the second derivative of 0 + 2/39y*4 + 7/39y*3 - 2/13y*2 + 17y. Find k, given that h(k) = 0. -2, 1/4 Let -3/2j3 + 0j*4 + 3/4 - 3/4j*2 + 3/8j*5 + 9/8j = 0. What is j? -1, 1, 2 Suppose 2t4 + 8t*4 + 384 - 5t*4 - 640t - t*4 - 60t*3 - 665t*2 + 977t*2 = 0. What is t? 1, 4, 6 Let m(j) be the third derivative of -1/180j*6 + 0 + 0j - 5/36j4 - 2/9j*3 - 2/45j*5 + 18j*2. Find k, given that m(k) = 0. -2, -1 Let y be (4/(-6))/((-11)/(-66)). Let s be y/(-28) - 5/(-14). Determine x so that 2x*2 + 2x*4 + 1/2x + 3x3 + 0 + sx*5 = 0. -1, 0 Let p be 104/(-676) - (-2 - (-75)/(-65)). Solve 0 - 1/8t*5 - 1/8t*p + 3/4t*4 - 3t*2 - 2t = 0 for t. -1, 0, 4 Suppose -1645 = -9p + 2p. Let 13 + 11 + 23 - 260o + 410o*2 - 7 - po*3 + 45o*4 = 0. Calculate o. 2/9, 1, 2 Let z = 5/3759 + 81440/3759. Factor 80x + zx2 + 5/3x*3 + 60. 5(x + 1)(x + 6)2/3 Let b(r) be the second derivative of 0r*2 + 9/16r*5 - 3/8r*3 - 1/2r*4 + 15r + 0 - 1/10r6. Suppose b(d) = 0. What is d? -1/4, 0, 1, 3 Let y(k) be the third derivative of 0k*3 - 1/70k*7 + 3/5k*5 + 0k + 0 + 0k6 - k2 + 2k*4. Factor y(d). -3d(d - 4)(d + 2)*2 Suppose 35v + 18 - 88 = 0. Let m(k) be the second derivative of 0 - 1/5k5 + 0k*v + 1/24k*4 + 2k + 1/12k6 + 1/6k*3. Let m(y) = 0. Calculate y. -2/5, 0, 1 Let w(n) be the third derivative of 0n + 0n3 + 0n*4 + 0n*5 + 23n*2 + 8/105n*7 + 0 - 1/30n*6. Suppose w(j) = 0. What is j? 0, 1/4 Suppose -3m - 3w - 144 = -m, -148 = 2m + 4w. Let x be ((-9)/(-2))/(11/(m/(-36))). Factor 3 + 3j + xj2. 3(j + 2)*2/4 Let s(w) = 4w*4 + 5w*3 - 12w*2 + 13w. Let a(q) = -4q4 - 4q*3 + 12q*2 - 12q. Let u(r) = 5a(r) + 4s(r). Factor u(i). -4i(i - 1)*2(i + 2) Let g(c) = -c*3 - 14c*2 - 14c + 9. Let u be g(-13). Suppose -6 = 20n - un. Factor 0 + 7/4w2 + 1/2w + 5/4wn. w(w + 1)(5w + 2)/4 Let x be (2 - 6 - (-1136)/14) + 4. Let c = x - 81. Solve co3 + 4/7o*2 + 0 + 4/7o = 0. -2, 0 Let a(g) be the second derivative of -g5/70 + g4/42 + 25g3/21 - 25g*2/7 - 97g. Suppose a(w) = 0. Calculate w. -5, 1, 5 Let u be (-1)/(((-48)/18)/8). Let q(d) be the third derivative of -6d2 + 1/12d*6 + 2/15d*u - 19/60d*4 + 4/15d*5 + 0 + 0d. Factor q(g). 2(g + 2)(5g - 1)2/5 Let z = -2653 + 18576/7. Suppose 4 = 4x + 4b, -x - 3x = 2b - 6. Factor 4/7g*x + zg + 2/7 + 1/7g3. (g + 1)2(g + 2)/7 Let l(a) = 6a2 - 1084a + 153458. Let z(r) = -r*2 - 6r. Let f(u) = -l(u) - 4z(u). Factor f(i). -2(i - 277)*2 Suppose -87j + 621 + 1281 = -4362. Solve 54 + 39/2s2 + js + 3/2s3 = 0. -6, -1 Let t(n) be the third derivative of -n6/300 - 66n*5/25 - 4356n*4/5 - 766656n*3/5 + 4n*2 + 30. Find g such that t(g) = 0. -132 Let q(v) be the third derivative of 5v*9/1512 - 23v8/840 - v7/42 + 6v3 + 10v*2. Let r(g) be the first derivative of q(g). Factor r(n). 2n*3(n - 5)(5n + 2) Let y = -9 - -12. Let n be (-7)/(-3) + (-1 - 0/6). Factor -2/3l4 + 10/3l*2 - nl - 2ly + 2/3l*5 + 0. 2l(l - 1)3(l + 2)/3 Find s, given that -26s4 + 275s*2 + 5s*5 - 5s*3 - 1486 - 420s - 1538 + 3204 - 9s4 = 0. -3, 1, 2, 6 Let z(h) = 350h*2 - 270h - 10. Let m(r) be the third derivative of 13r5/20 - 5r4/4 - r3/6 - 38r2. Let k(v) = -55m(v) + 6z(v). Factor k(x). -5(3x - 1)2 Let u(m) = m5 - m4 + 2m3 + m2 - m - 1. Let o(l) = -9l5 + 11l*4 - 18l*3 - 8l*2 + 8l + 8. Let s(g) = 3o(g) + 24u(g). Factor s(v). -3v3(v - 2)(v - 1) Suppose 0 = 464k - 374k - 720. Factor kb*2 - 11/2b - 7/2b3 + 1. -(b - 1)2(7b - 2)/2 Let s(w) be the first derivative of 2/7w*3 + 3 + 0w + 1/7w2 - 1/14w*4 - 6/35w*5. Let s(p) = 0. What is p? -1, -1/3, 0, 1 Let f be ((-714)/2380)/(-1 + (-6)/(-8)). Factor 3/5x*2 - 9/5x + f. 3(x - 2)(x - 1)/5 Let p = -121 + 122. Suppose -2c = -0w - 3w - 13, -2c - w + p = 0. Factor 2/7 + 6/7r + 6/7r*c + 2/7r*3. 2(r + 1)3/7 Let b(p) be the second derivative of -p5/80 + 3p4/32 + p3/2 - 3p*2/2 + 47p. Let j(x) be the first derivative of b(x). Determine m so that j(m) = 0. -1, 4 Factor -55o3 - 28o*2 - 20o*2 + 15o - 17o2 + 25o*4. 5o(o - 3)(o + 1)(5o - 1) Factor -350/3f2 + 0 - 2/3f*4 + 58f + 178/3f3. -2f(f - 87)(f - 1)*2/3 Let r(j) be the first derivative of 3/5j*2 - 1/30j*3 + 3 - 18/5j. Factor r(o). -(o - 6)*2/10 Factor -22 + 2z*2 - 32 - 28 + 20 - 60z. 2(z - 31)(z + 1) Suppose -2f - 72 = -4n, -2f = 3f - 20. Let i be (0 + n)15/25. Suppose 52 + 8u - 52 + iu5 - 2u*2 + 4u*4 - 2u*2 - 20u*3 = 0. Calculate u. -1, 0, 2/3, 1 Let n = 71072/15 + -4738. Factor 0r*2 + 0r + 0 + 0r3 + nr*4 + 2/15r*5. 2r*4(r + 1)/15 Determine a so that -2a + a2 + a - 7a - 2 + 6a - 13 = 0. -3, 5 Let f = 100/1197 + 2/171. Let j(m) be the first derivative of -4/7m - fm3 + 1/7m*4 - 5/7m*2 + 6. Factor j(w). 2(w - 2)(w + 1)(2w + 1)/7 Let w = -149413/7 + 21345. Factor -12/7o + 0 + wo2. 2o(o - 6)/7 Suppose -33l = 15l - 240. Factor -3/11k*4 - 1/11k*l + 0k - 2/11k3 + 0 + 0k2. -k3(k + 1)(k + 2)/11 Let 0 + 64/7k - 4/7k*2 = 0. Calculate k. 0, 16 Let j(r) = 3r*2 - 16r + 24. Let z(t) = -t*2 + 3t. Let v(l) = -2j(l) - 4z(l). Let v(s) = 0. Calculate s. 4, 6 Let b(c) be the third derivative of -22c2 + 0 - 1/6c*4 - 1/60c*6 + 1/10c*5 + 0c + 0c3. Factor b(d). -2d(d - 2)(d - 1) Let w(t) be the second derivative of -t4/72 - t3/9 - t*2/3 + 75t. Suppose w(l) = 0. What is l? -2 Let m be ((-422)/633)/(14/(-6)). Suppose -2/7 - mj2 + 5/7j = 0. What is j? 1/2, 2 Let m(g) = -g*2 + 1. Let l(c) = -2c*3 + 12c*2 - 62c + 52. Let n(d) = -2l(d) + 20m(d). Factor n(j). 4(j - 7)(j - 3)(j - 1) Suppose 6/5j - 91/5 + 1/5j*2 = 0. Wh	{ "pile_set_name": "DM Mathematics" }
b - 20/21r3 + 2r. Let a(d) = 0. What is d? -2, -2/5, 1 Suppose 5g + v = 176 - 53, 0 = 4g + 4v - 108. Solve -24h*2 + gh*2 + 2h4 + h5 = 0. -2, 0 Let y(s) = -85s2 + 320s + 255. Let b(d) = 3d2 + d + 3. Let f(c) = -30b(c) - y(c). Factor f(w). -5(w + 1)(w + 69) Determine p, given that 9p - 46/5 + 1/5p*2 = 0. -46, 1 Let v(o) be the second derivative of -10/3o*4 + 2/3o*3 + 20/3o*5 + 0 - 4o - 1/15o2. Factor v(t). 2(10t - 1)3/15 Solve -75 - 3/7s*3 - 51/7s*2 - 285/7s = 0. -7, -5 Let k(y) = y - 17. Let p be k(14). Let v be (p/(-6))/(2/(-64)-4). Determine m, given that 2m*2 - m - 3/2 - 1/2mv + m3 = 0. -1, 1, 3 Let -74c + 57c*2 - 173c*2 + 50c*2 + 56c2 - 28 = 0. What is c? -7, -2/5 Let w(c) be the third derivative of c7/945 - c6/60 + c5/10 - c*4/4 + 160c*2. Determine k so that w(k) = 0. 0, 3 Suppose -3d + 257 = 5t, -4t + 9d - 4d = -176. Suppose 60w4 - tw*2 - 148w*3 - w - 8 - 35w - 24w3 + 205w2 = 0. Calculate w. -2/15, 1 Let s(o) be the first derivative of -o6/72 - 7o5/30 + o4/48 + 7o*3/18 - 75. Find u such that s(u) = 0. -14, -1, 0, 1 Suppose -4z = 4o - 472, -4o + 607 = -2z + 147. Let q = o + -111. Suppose -1/3 + 1/3s - 1/3s4 + 2/3s*2 + 1/3s*q - 2/3s3 = 0. Calculate s. -1, 1 Let g(m) be the third derivative of -m6/80 - m*5/5 - 7m*4/16 + 4m2. Solve g(y) = 0. -7, -1, 0 Let f(c) = -c4 + 6c3 + 8c*2 + 12c - 16. Let t(z) = z*3 + 2z. Let j(i) = -f(i) + 6t(i). Let j(n) = 0. Calculate n. -2, 2 Let l = -4 + 13. Let j = l - -37. Factor -32f - 18f2 - 12f*3 - 16 + jf*2 + 16f*2. -4(f - 2)*2(3f + 1) Let s(a) = 3a - 11. Let u be s(5). Find g, given that 32g2 + 0g*3 - 8g - 36gu + 12g*3 - 8g = 0. -1, 0, 2/3 Let k(x) be the first derivative of x*4/4 + 8x*3 + 72x*2 - 296. Find o such that k(o) = 0. -12, 0 Suppose 0 = -10o - 3o + 104. Suppose o = -x - x - 4w, 0 = x - 5w - 17. Factor -7/6q*x - 5/6q + 1/3. -(q + 1)(7q - 2)/6 Find k such that -k*3 - 2k*4 + 2k*2 - 1/2k*5 + 3/2k + 0 = 0. -3, -1, 0, 1 Let g be (3/1)/(7/189). Factor -54y2 - 178y4 + g - y3 - 23y3 + 175y*4. -3(y - 1)(y + 3)3 Let j(b) = 7b*2 - 63b + 186. Let l(d) = 155d2 - 1385d + 4095. Let y(m) = 45j(m) - 2l(m). Find w, given that y(w) = 0. 4, 9 Let k(d) = -2d2 + 50d - 4. Let t(g) = g + 1. Let v(p) = -k(p) - 4t(p). Factor v(q). 2q(q - 27) Factor -25/4t*2 + 45/4 - 5/4t*3 - 15/4t. -5(t - 1)(t + 3)*2/4 Let u(a) be the third derivative of 21/32a*4 + 0a + 17a2 + 3/4a*5 + 0 + 5/32a*6 + 1/4a*3. Solve u(r) = 0 for r. -2, -1/5 Let h = 61 - 58. Suppose -2k + v - 5 = 2v, -3k - 15 = hv. Factor -2/5z*3 - 1/5z*4 + 1/5 + kz*2 + 2/5z. -(z - 1)(z + 1)3/5 Let p be ((-3)/(90/4))/((-60)/1675). Let s = p + 43/9. Let -sz - 3 - 5/2z2 = 0. Calculate z. -3, -2/5 Let 58h - 10h3 + h5 - 144 + 62h - 3h4 + 47h*2 - 11h*3 + 0h = 0. Calculate h. -3, 1, 4 Let z(w) be the third derivative of w*5/20 - 7w*4/8 - 15w*3 - 3w*2 - 32. Factor z(t). 3(t - 10)(t + 3) Factor 0 - 164/7n*2 + 2/7n*3 + 162/7n. 2n(n - 81)(n - 1)/7 Let c = 43 + -39. Let u be c/40(-225)/(-10). Solve 3/2z + 0 + uz*2 = 0 for z. -2/3, 0 Factor -34/5 - 2/5a*2 + 36/5a. -2(a - 17)(a - 1)/5 Let m be (-54)/(-1) + (-4 - 0). Let h = m + -48. Solve -19/3a3 + 2/3a - 29a4 + 7/3a*h + 0 - 21a5 = 0 for a. -1, -1/3, 0, 2/7 Let c(u) be the second derivative of u4/42 + 8u3/7 - 25u*2/7 - 135u. Let c(p) = 0. Calculate p. -25, 1 Let n(x) be the first derivative of -x3/18 + x2/3 - x/2 - 78. Find w such that n(w) = 0. 1, 3 Let z(j) be the first derivative of j*5/10 + 11j*4/8 + 5j3/3 + 109. Factor z(r). r2(r + 1)(r + 10)/2 Let t(j) be the third derivative of -j*7/945 + 2j*6/45 - 44j*5/135 - 56j*4/9 - 784j*3/27 - 15j*2 + 3j. Factor t(f). -2(f - 14)2(f + 2)*2/9 Let z = 301/1368 - 2/171. Let g(t) be the second derivative of -2/3t*3 - 1/40t*5 + 0 - zt4 - t2 + 5t. What is i in g(i) = 0? -2, -1 Let a(q) be the first derivative of 11q3/15 + q2/5 + 74. Factor a(b). b(11b + 2)/5 Suppose -137 = 84x - 401 - 744. Factor 3/4d*2 - 6d + x. 3(d - 4)2/4 Let k(j) be the second derivative of 8/3j*3 + 6j*2 + 0 - 2/15j*6 - 4/5j*5 - 15j - 2/3j4. Determine w, given that k(w) = 0. -3, -1, 1 Suppose 0 = 2p - 4 - 0. Let j(r) = r*3 + 18r*2 + 15r - 30. Let z be j(-17). Factor 4h2 + zh*2 - 10h*p. -2h2 Let p(b) be the third derivative of b6/40 - 9b5/2 + 675b*4/2 - 13500b*3 + 233b*2. Factor p(r). 3(r - 30)*3 Let y(n) be the third derivative of 0n*6 + 0n*5 + 0n + 1/560n7 + 0n*4 + 0 + 3n*2 + 0n*3. Find m, given that y(m) = 0. 0 Let l be 1664(3 + 1 + -3) + 0. Suppose 1662s2 - 8 - ls*2 - 16s + 26 = 0. Calculate s. -9, 1 Let s be ((-7)/((-49)/21) + -6)/(18/(-12)). Factor 2zs - 3 - 1/2z - 1/2z3. -(z - 3)(z - 2)(z + 1)/2 Let u(o) be the second derivative of 27o + 5/3o3 - 1/6o*4 + 0 + 0o2. What is v in u(v) = 0? 0, 5 Let n(z) be the third derivative of -z6/80 - z*5/40 + 3z*4/8 + 2z*2 - z. Solve n(w) = 0 for w. -3, 0, 2 Suppose x - 6x + 75 = 0. Let n be ((-2)/((-6)/x))/1. Factor -25c5 + 13c*5 + 11c*n + 4c*4 + c - 2c*4 - 2c*2. -c(c - 1)*3(c + 1) Let s(a) be the second derivative of -a*5/15 - 86a*4/9 - 341a*3/18 - 85a*2/6 - 65a. Factor s(g). -(g + 85)(2g + 1)2/3 Let u(k) = -k3 - 6k2 + k - 17. Let g be u(-7). Let w = -11 + g. Factor 4n*4 - 13n*2 + 44n*2 + 28n*3 + 32 + 27n*2 + 80n + wn2. 4(n + 1)(n + 2)3 Let y = -140 - -703/5. Let w(o) be the second derivative of 0o*6 - 1/14o*7 + 0 - 3/2o*3 - 5o + yo5 + 3o*2 - 1/2o*4. Let w(l) = 0. Calculate l. -2, -1, 1 Let d(t) be the second derivative of 2t + 0t2 + 0t*4 - 1/8t*3 + 0 + 3/80t5. Solve d(s) = 0. -1, 0, 1 Let r = 45 - 43. Factor a4 - 466a3 - ra*4 + 465a3 + a2 + a. -a(a - 1)(a + 1)*2 Let j(d) be the second derivative of 27/10d*4 + 3/10d*2 + 0 + 9d + 6/5d3 + 21/10d*6 + 84/25d*5 + 18/35d*7. Solve j(s) = 0. -1, -1/3, -1/4 Suppose 13 - 40 = -69i + 111. Let t be (-1)/(-1 - (-2)/4). Find w, given that 0 - 2/3w + iw*t + 8/3w*3 = 0. -1, 0, 1/4 Let g be (2/3)/(6/27). Let r(u) be the first derivative of -2/9u*g + 0u + 2 + 0u2 + 1/12u4. Factor r(x). x2(x - 2)/3 Let g(n) = -n2 - 2134n - 222609. Let z(a) = 2140a + 222610. Let h(b) = -5g(b) - 4z(b). Determine q so that h(q) = 0. -211 Suppose 6u - 23 = -5. Solve 3bu - b3 - 2b*3 + 10b + 8b2 - 2b3 = 0. -1, 0, 5 Let g(w) = -w3 - 63w2 - 835w + 21. Let u be g(-19). Factor -7/6 + k + 1/6ku. (k - 1)(k + 7)/6 Factor -48/7b + 4/7b*2 - 2/7b*4 + 10/7b*3 + 0. -2b(b - 4)(b - 3)(b + 2)/7 Let t = -6 - -8. Suppose 2q - 2z - t = -3z, -5z = -2q + 26. Determine f, given that -21f + 234f*3 + 3f*4 + 1 + 27f*2 + 5 - 249f*q = 0. 1, 2 Let r(b) be the third derivative of 2 + 10b*2 + 1/540b*5 + 2/27b*3 - 1/54b*4 + 0b. Determine a, given that r(a) = 0. 2 Let o(s) be the second derivative of -s*6/210 - 9s*5/140 - 2s*4/21 + 42s. What is h in o(h) = 0? -8, -1, 0 Let n be (-4 - 0) + (155/(-15))/(49/(-21)). Suppose -648/7f + 39/7f*4 - 201/7f*3 + 324/7 - nf*5 + 513/7f*2 = 0. What is f? 2, 3 Let n be (4 - 412/(-8)) + 2/(-4). Factor 6j*2 + 0j - 57j4 + nj*4 + 4j. -2j(j - 2)(j + 1)2 Suppose 10f = -3f + 78. Let g(o) be the third derivative of -1/30o*f + 0o + 0 + 5/42o5 + 0o*3 - 4o*2 - 1/14o*4. Factor g(b). -2b(2b - 3)(7b - 2)/7 Let i be (-27)/15 + (-1)/5. Let o be (i/(-4))/(3/60). Let -5 - 3 + 0u - 18u*2 - ou - 4u3 - 14u = 0. What is u? -2, -1/2 Let f(i) = 4i3 - 10i*2 - 2i + 6. Let a = 45 - 81. Let t = a + 31. Let u(m) = -4m3 + 9m*2 + 3m - 5. Let b(g) = tf(g) - 6u(g). Factor b(o). 4o(o - 2)(o + 1) Let w(r) be the first derivative of r6/1800 - r5/150 + r4/30 + r3/3 - 15. Let s(y) be the third derivative of w(y). Find n, given that s(n) = 0. 2 Let o = -1886/255 + 128/17. Determine h, given that -2/15h - 2/15 + oh2 + 2/15h*3 = 0. -1, 1 Let p = -13 + 15. Solve 8 + 1 - pa*2 - 5 + 2a = 0.	{ "pile_set_name": "DM Mathematics" }
4 Suppose 3a + 6 = 3. Let j = a - -56. Calculate the remainder when j is divided by 19. 17 Suppose 3n - 2 - 7 = 0. Let h(c) = -3c - 4. Let m be h(3). Let y = -3 - m. What is the remainder when y is divided by n? 1 Let a = -6 - -8. Suppose 3x + a = 8. Suppose xo - 99 = -o. Calculate the remainder when o is divided by 17. 16 Let n = -25 - -24. Let l(s) be the second derivative of -2s5/5 + s3/6 - s. Calculate the remainder when l(n) is divided by 2. 1 Let y = 5 + -8. What is the remainder when -1(y + 4 - 32) is divided by 11? 9 Suppose -2 - 1 = -3w. Suppose -4x + w = 3k - 14, -x = 4k - 33. Let c(g) = -g3 - 6g*2 + 6g + 10. What is the remainder when c(-7) is divided by k? 8 Suppose 2n - 54 = -2u, n + 2n - 75 = -u. What is the remainder when 91 is divided by n? 19 Let p = -124 - -143. What is the remainder when p is divided by 3? 1 Suppose -12y = -5y - 154. Calculate the remainder when 42 is divided by y. 20 Let x = 13 + -8. Let r = 205 - 196. Calculate the remainder when 2/x + 156/10 is divided by r. 7 Suppose -p + 7 = -2y - 2y, 6 = p - 3y. Let o = 4 + p. Calculate the remainder when 11 is divided by o. 4 Let j(u) = -u3 - u2 + u + 63. What is the remainder when j(0) is divided by 13? 11 Let d be -4((-28)/8 - -1). Let a(b) = b3 - 11b*2 + 11b + 1. What is the remainder when 43 is divided by a(d)? 10 Suppose -2g = 2g - 5z - 45, -z = 3g - 10. What is the remainder when 17 is divided by g? 2 Suppose -10 = 3c - 4c. Calculate the remainder when 18 is divided by 5/(c/(-4)) - -12. 8 Suppose o + 3o - 336 = -4s, 0 = 2s + 5o - 153. Calculate the remainder when s is divided by 6. 5 Let z = -34 + 50. Calculate the remainder when 30 is divided by z. 14 Let x = -8 - -24. Suppose u = -0u + 3l - 9, 5u - 40 = -2l. Calculate the remainder when x is divided by u. 4 Let l = -2 - -6. Suppose p = lu + 37, 22 = p - 5u - 15. Calculate the remainder when p is divided by 20. 17 Let v(r) = r + 14. Suppose q + 0x = -4x - 20, q = 2x + 10. Suppose 0 = 3g - 10 - 5. What is the remainder when v(q) is divided by g? 4 Suppose -24 = 3d - 11d. Calculate the remainder when d is divided by 1. 0 Let f be (188/8)/((-1)/(-2)). Suppose l - f = -9. Calculate the remainder when l is divided by 10. 8 Let m(y) = -y + 2. Let t be m(0). Suppose -3w = tw - 55. What is the remainder when 19 is divided by w? 8 Suppose -10u + 107 + 63 = 0. Calculate the remainder when 48 is divided by u. 14 Suppose 3a - 28 = a. Calculate the remainder when a is divided by 8. 6 Let v = -15 - -17. What is the remainder when 4 is divided by v? 0 Let d(r) = -7 - 3 - 4r + 4. Let n = -5 - -17. What is the remainder when d(-7) is divided by n? 10 Suppose v + 4a + 9 = 0, 3v + 0v - 2a = -97. Let d = 42 + v. Calculate the remainder when 23 is divided by d. 10 Let d(z) = 3z*2 + 2z + 5. What is the remainder when d(-4) is divided by (24/15 + -2)-30? 9 Let k(i) = 3i + 4. Let x be k(4). Let g be (-2)/(-1 + 2) - 34. Let a = x - g. What is the remainder when a is divided by 18? 16 Suppose 0 = z - 13. Let a(j) = j*2 - j + 2. What is the remainder when z is divided by a(3)? 5 What is the remainder when (2/(-2) + 1 - -224) + -1 is divided by 25? 23 Suppose 4q + 10 = 9q. Suppose l + 5r = 0, 0 = -l + 4l - 3r. Let k = l + q. What is the remainder when 3 is divided by k? 1 Let r = 12 - 9. Suppose -3j - rj = -156. Calculate the remainder when j is divided by 7. 5 Let h = 0 - -23. Let a(j) = 0j + j - 3j. What is the remainder when h is divided by a(-6)? 11 Let m = 31 + 2. Let y = -51 + 29. Let n = y + m. What is the remainder when 32 is divided by n? 10 Suppose 0t - 712 = -4t. Suppose 0 = 5c + t - 33. Let j = c - -62. Calculate the remainder when j is divided by 17. 16 Suppose -24 = -2i + 2x, 3x + 6 = x. Suppose l + 5z + 10 = -5, 3l = z + 19. What is the remainder when i is divided by l? 4 Suppose 4n + 2 = 14. Suppose -5t + 8z - nz = -260, -3t + 176 = 2z. Let u = -48 + 67. What is the remainder when t is divided by u? 18 Let o(a) = a - 1. Let q be o(6). Suppose -47 = -2n - qw, -3n - 3w + 2w = -64. What is the remainder when 82 is divided by n? 19 Suppose 3z - 10 = 5z. Let j(a) = -a3 - 3a*2 - a - 3. What is the remainder when j(z) is divided by 18? 16 Let k(x) = -x - 9. Let v be k(-13). Suppose 7t - vt = 126. Calculate the remainder when t is divided by 11. 9 Let w(x) = x2 - 7. Let n be w(-3). Suppose -5a - 4 - 18 = g, -a - 5g = 14. What is the remainder when 3 is divided by (-2)/4a/n? 0 Suppose 2 + 6 = -x. Let c(v) = -2v - 12. Suppose 0 = 4w + 4 - 44. Calculate the remainder when w is divided by c(x). 2 Suppose -3s = -0s - 33. Let h = s + -6. What is the remainder when 9 is divided by h? 4 Suppose 4m + 2t - 1 = -3, -3m - 3t = 6. What is the remainder when 4 is divided by m? 0 Suppose -50 = 3l + 10. Let w = 45 + l. What is the remainder when 21 is divided by 62/5 + (-10)/w? 9 Let d be (-41)/6 - 3/18. Let z = 26 + d. Let y = -30 - -86. Calculate the remainder when y is divided by z. 18 What is the remainder when 50 is divided by -1(-1 + 4) - -21? 14 Let g = -18 + 33. Calculate the remainder when 74 is divided by g. 14 Let u be (-2)/40/5. What is the remainder when 20 + (u - 3 - 0) is divided by 9? 8 Let z = 0 + 0. Let l(q) = q2 - 8q + 8. Calculate the remainder when l(11) is divided by (-1 - -15) + z/1. 13 Let f = 63 - 53. Calculate the remainder when 26 is divided by f. 6 Let v(d) = d*3 + 7d2. Calculate the remainder when v(-5) is divided by 13. 11 Let n(s) = s3 + 13s2 - 2s - 22. What is the remainder when n(-13) is divided by 2? 0 Let y(o) = 4o - 3. Let d(h) = h2 + 5h + 4. Let x be d(-6). Suppose -26 + x = -g. Calculate the remainder when g is divided by y(3). 7 Let j = 18 + -1. Suppose 2k + 0k - 96 = 0. What is the remainder when k is divided by j? 14 Suppose k + 4 = 2k. Suppose -2c + 2 = -kx + 3c, 4x = 4c. Calculate the remainder when x is divided by 8/12 - 0 - 1/(-3). 0 Let f(v) = 7v2 - 4v + 3. Let g = 7 - 5. Let q be f(g). Suppose -q = -p - 0. What is the remainder when p is divided by 8? 7 Let w(u) = -u*3 - 5u*2 + 8u + 2. Let f be w(-6). Let z = 1 - f. Let a = 38 + -19. Calculate the remainder when a is divided by z. 8 Let x(l) = -2l - 10. Let r be x(-5). Suppose r = 2u + 3u - 60. Calculate the remainder when 22 is divided by u. 10 Let z be 5/((-21)/(-10) + -2). Let c = z + -26. Calculate the remainder when 71 is divided by c. 23 Suppose 2n + 90 = 5p + 6n, p - 18 = 2n. Suppose f + 0s - s + 35 = 0, 4f + 128 = s. Let b = f - -65. Calculate the remainder when b is divided by p. 16 Suppose 127s - 209 = 126s. Calculate the remainder when s is divided by 53. 50 Suppose 4t = -3b + 11, 6 = -3t + 3. Let l(y) = y*2 + 5y + 7. Calculate the remainder when l(-6) is divided by b. 3 Let j = -24 + 16. Let p = 3 - -2. What is the remainder when p is divided by j/69/(-6)? 1 Suppose 33 = 7d - 4d. What is the remainder when 41 is divided by d? 8 Suppose -2i + i + 4 = 0. Suppose 0 = -ik + 131 - 15. Calculate the remainder when k is divided by 10. 9 Let z = -53 + 75. Let o(m) = -26m2 - m + 1. Let r be o(1). Let v = r + 34. Calculate the remainder when z is divided by v. 6 Let t(h) = -h3 + 6h2 - 3h + 5. What is the remainder when t(4) is divided by 7? 4 Suppose 13i - 15i + 24 = 0. Calculate the remainder when i is divided by 5. 2 Let d = -19 - -31. Calculate the remainder when 47 is divided by d. 11 Let n(r) = r*3 + 17r*2 - 2r - 25. What is the remainder when 2 - 5/((-10)/64) is divided by n(-17)? 7 Suppose 10 = -2r, -2r = -2z - 0r + 56. Let w(f) = f*3 + 8f*2 - 2f - 8. Calculate the remainder when z is divided by w(-8). 7 Let u(s) = -s + 7. What is the remainder when 54 is divided by u(-4)? 10 Let p(f) = -f*2 - 10f - 3. What is the remainder when 21 is divided by p(-9)? 3 Let n(f) = 7f + 13. What is the remainder when n(7) is divided by 16? 14 Let a = -21 - -60. Suppose 4g = a - 11. Suppose -y = q - 18, 0 = 4y + 5 + g. What is the remainder when 41 is divided by q? 20 Suppose 0 = 4k + 2v - 49 - 3, 4k + 4v = 60. What is the remainder when 83 is divided by k? 6 Suppose -4 = -5l + 4s, -2s + 6 = -2. What is the remainder when 15 is divided by l?	{ "pile_set_name": "DM Mathematics" }
204)-1 + sqrt(204) - sqrt(204) - sqrt(204))6 + sqrt(204) - 2sqrt(204)4)/(sqrt(12) - (2sqrt(96))/sqrt(8) - -1sqrt(300)). -19sqrt(17)/4 + 5 Simplify (((sqrt(2299) + sqrt(2299) + 0 + sqrt(2299))-1 + -4 + -5 + ((sqrt(2299) + -1)-6 - (sqrt(2299) - (-1 + sqrt(2299) + -4)))-4)-5)2. -150150sqrt(19) + 25350700 Simplify (sqrt(2299) - sqrt(2299)1)2 + -3 + sqrt(2299)1-4 + ((sqrt(2299) - (sqrt(2299) + 0))-5 + 4)*2 + 4. -44sqrt(19) + 17 Simplify (sqrt(176) + sqrt(176) + -2 + -5 + (sqrt(176) - (3sqrt(176)6 + sqrt(176))))*2 - 66(5(1 + sqrt(11)) + sqrt(11)). 680sqrt(11) + 44925 Simplify (-5 + -6(-4 + 2 + sqrt(112) + 1 + sqrt(112) - (4(0 + sqrt(112) + sqrt(112)) - (sqrt(112) + (4 + sqrt(112) + 1 - sqrt(112)) + sqrt(112)))))2. -5568sqrt(7) + 65353 Simplify ((-1 + (sqrt(112)/sqrt(2)1)/(3sqrt(128)) + 2)5)2. 25sqrt(7)/6 + 3775/144 Simplify (-1(4 + (1(sqrt(2736) + 0) - (sqrt(2736) + (2 + sqrt(2736) + sqrt(2736))3 + sqrt(2736)))))22-1. -268136 - 672sqrt(19) Simplify ((-4 + 1 + sqrt(1700) + sqrt(1700) + sqrt(1700) - (sqrt(1700) + 1)-5) + (3-3sqrt(1700) - (sqrt(1700)-3 + 5)))*2. -120sqrt(17) + 6809 Simplify -4((2(sqrt(891)-1 + -5 - 5-1sqrt(891)))2 + -5). -228476 + 5760sqrt(11) Simplify (sqrt(54)/(sqrt(24) + sqrt(6)))/(sqrt(3) + sqrt(243)-1) + -22((sqrt(3) + -1)2 + 1). -20 + 191sqrt(3)/24 Simplify (0 + 3 + (sqrt(108) - (1 + sqrt(108))) + 1 + 0 + -2)*2 + 5 + 4. 10 Simplify -53(1 + -1 + sqrt(200))2 - (3 + (sqrt(264)/(sqrt(11) - sqrt(11)2))/(sqrt(12) - (sqrt(12) - sqrt(108)3))). -3003 + sqrt(2)/9 Simplify ((-4 + 0 + (1 + sqrt(539) - sqrt(539)) + 0 + 6(-2 + 2sqrt(539) - (-1 + sqrt(539))-3))5)2. -346500sqrt(11) + 12154725 Simplify ((-4 + 32-5(-1 + sqrt(200) + -1)4)-2)2. -2265600sqrt(2) + 11742784 Simplify -5 + (-1(sqrt(76) - (sqrt(76) - (0 + sqrt(76))) - sqrt(76))2 + 5 + (2 + -2sqrt(76) - ((sqrt(76) + (-1 + sqrt(76) - sqrt(76)))4 + sqrt(76))))-5. -60 + 70sqrt(19) Simplify 0 + (-6(sqrt(637) + -2 - sqrt(637))2 + (-3 + sqrt(637) + sqrt(637) + 1)2)51-6. -75840 + 1680sqrt(13) Simplify (1(5 + 5 + (sqrt(19)1-1 - sqrt(19))) - -2(32sqrt(19) + sqrt(19) + sqrt(931) + (sqrt(931) - 2sqrt(931)) + sqrt(931))1)*2. 520sqrt(19) + 12944 Simplify ((sqrt(275) + -5 + -1sqrt(275))22 + (4sqrt(275)12)2)-2 + -4. -35304 Simplify (2sqrt(500) + 0 - (sqrt(5) + sqrt(55)/(sqrt(33)/sqrt(3)) + -2)) + sqrt(30)/((sqrt(72)/sqrt(6))/sqrt(2) + sqrt(6)) + 1 + 0. 3 + 37sqrt(5)/2 Simplify ((sqrt(144)1 + sqrt(36) + sqrt(36) - (sqrt(5184) + (-2sqrt(5184) - sqrt(5184))))4)/(sqrt(768) + (sqrt(768) - 2sqrt(768)-6) - -2sqrt(768)1). 7sqrt(3)/8 Simplify (sqrt(504) + 1sqrt(504))/(2sqrt(847) + sqrt(847) + sqrt(847)) + (1 + 32-3sqrt(162))2. -3561sqrt(2)/11 + 52489 Simplify ((-3 + sqrt(125) + (0 + sqrt(125) - sqrt(125)))-3 + 5 - (-1sqrt(125) + -2 + (sqrt(125) + -1 + sqrt(125) - sqrt(125))4 + 4))2. -960sqrt(5) + 4756 Simplify (3sqrt(80)2 + sqrt(80) + sqrt(80) - sqrt(80)-2-1)*2 - 1(5 + sqrt(80) + 1sqrt(80) + -2(sqrt(80) + 1))*2. 2871 Simplify 3 + (5(-1 + -1sqrt(75)) - (sqrt(75)-1 + 0)6)2 + 3. -50sqrt(3) + 106 Simplify (sqrt(196) + sqrt(196) + sqrt(196)1 - (sqrt(4) + sqrt(12)/(-1sqrt(3) - sqrt(3))))/(sqrt(32) - sqrt(128)/sqrt(4) - sqrt(8))1. -41sqrt(2)/4 Simplify (0 + -11sqrt(242)-2 + (1 + sqrt(242) - sqrt(242)) + -2 + sqrt(242) + -2 + -4)2. -462sqrt(2) + 2227 Simplify (-1 + sqrt(833)2 + -1-3sqrt(833) + -6sqrt(833)-15-6)2-5. -127553130 - 12250sqrt(17) Simplify (sqrt(209) + 1sqrt(209)-5 - (-6(sqrt(209) + (sqrt(209)-3 - sqrt(209))) - sqrt(209)))/(-1sqrt(704)2 - -2sqrt(704)-1) + -3. -3 + 21sqrt(19)/32 Simplify (((1sqrt(6480))/(1sqrt(9)2) + -5sqrt(315)/(sqrt(7)-2 - sqrt(7)))2 + 5)1. 610 Simplify (((sqrt(17) + 1)1)22 - (0 + ((1sqrt(833))2 - sqrt(833)))) + ((1sqrt(119) - sqrt(119))-2)/(sqrt(42)/sqrt(6)-4). -797 + 11sqrt(17) Simplify (-6((sqrt(408) + sqrt(408) + 2sqrt(408) + sqrt(408))-3 + sqrt(408))/((1sqrt(64) + sqrt(64))/sqrt(8)))/(6sqrt(300)23-5). -7sqrt(17)/300 Simplify ((3 + sqrt(1573) + -1 + 2 + 2sqrt(1573) + sqrt(1573) + 3 - (2 + 3-3sqrt(1573))-2) + 1)*2. -3696sqrt(13) + 308452 Simplify 3(sqrt(22) - -1(sqrt(22) + sqrt(88)))/sqrt(11) + (sqrt(40)/(sqrt(6)/sqrt(3) + sqrt(2) - sqrt(2)) - sqrt(20))/(-2sqrt(10)-3). 12sqrt(2) Simplify 0 + ((5(sqrt(429) + -2sqrt(429)))/sqrt(11))/(sqrt(192)/sqrt(4) + 4sqrt(3)2)6. -5sqrt(13)/2 Simplify (((sqrt(72) + 1 + 3)2 + 4 + -1 + sqrt(72) - ((6(sqrt(72) - -1sqrt(72)))2 - (1 + 2sqrt(72)))) + -1)2. -20554 + 132sqrt(2) Simplify (sqrt(66)/(sqrt(20)/sqrt(10)-3))/(1sqrt(270)/sqrt(10)). -sqrt(11)/9 Simplify (-3 + -6((-4sqrt(156)6 + sqrt(156))/sqrt(12) - ((sqrt(117) + 0)2 + 5)))1. 138sqrt(13) + 729 Simplify (0 + sqrt(45)/(sqrt(9) - (sqrt(9)-2 + sqrt(9))) + -2sqrt(125) + sqrt(10)/(2sqrt(2) - sqrt(2)) + -4 + sqrt(30)/sqrt(6))-3. 12 + 45sqrt(5)/2 Simplify (((sqrt(102) - -1sqrt(102) - sqrt(102)) + sqrt(102))/sqrt(3) - sqrt(4896)-5)/(((sqrt(250) - sqrt(250)1)/sqrt(5) + sqrt(50))-1). -62sqrt(17)/5 Simplify (-6-34(sqrt(110) + -1sqrt(110)))/(-1sqrt(810) - ((sqrt(60) - sqrt(60)-1)/sqrt(6) + sqrt(10))) + 1. 1 Simplify 664sqrt(160)/sqrt(2)-3. -1728sqrt(5) Simplify (sqrt(612) + -3)2 - ((sqrt(408)/sqrt(8))/sqrt(3))2 - 6(sqrt(1700) + 1 + -4 + sqrt(1700))2. -40250 + 684sqrt(17) Simplify (2((-1 + -1sqrt(300) - sqrt(300) - (sqrt(300) - ((1sqrt(300) - sqrt(300) - sqrt(300)) + 2))) + 5 + -3)-4)*2. -15360sqrt(3) + 307776 Simplify (sqrt(140)/(2-1sqrt(10)))/(sqrt(242)2 + sqrt(242) - sqrt(242) - (-1sqrt(72) + sqrt(2))) + 1. -sqrt(7)/54 + 1 Simplify (-3(1 + (1(sqrt(117) - (-1sqrt(117) + sqrt(117))) - sqrt(117))/(sqrt(36)6) + 2)3)2. 729 Simplify ((((sqrt(117) + -2)5 + 5 - ((sqrt(117) + 0)-5 - (-1 + sqrt(117) + sqrt(117) + 0))) + -1)-4 + -4)*2. -6912sqrt(13) + 270144 Simplify (-3(sqrt(180) + sqrt(20)) + sqrt(20) + sqrt(20) - (sqrt(20) + (sqrt(1280) - -2sqrt(1280))))/(sqrt(288)/(sqrt(64)/sqrt(2) + sqrt(8) + sqrt(8))). -140sqrt(5)/3 Simplify ((-2-1sqrt(16)/sqrt(2) + 5 + 3(sqrt(200) - (sqrt(200) + -1)))-5)2. 1600sqrt(2) + 2400 Simplify ((1 + sqrt(396) - (1sqrt(44))/sqrt(4) - (sqrt(704)1)*2-4) + 3)3. 15sqrt(11) + 8460 Simplify (sqrt(130)3)/sqrt(10)2 + (((sqrt(143) + -5sqrt(143))6)/sqrt(11))*2 + 2 + 1. 6sqrt(13) + 7491 Simplify (-2sqrt(15)-2 + sqrt(2160) + sqrt(2160)-1 - -1sqrt(135)1)/(-6-3(sqrt(5) - sqrt(20)/sqrt(4)) - (sqrt(15)-22)/sqrt(3)). 7sqrt(3)/4 Simplify (sqrt(180)/(2sqrt(3) + sqrt(3)) - sqrt(660)/(sqrt(11)-2))/(sqrt(24)/sqrt(2)5 - -2sqrt(1728)). 5sqrt(5)/174 Simplify (((sqrt(55) - (sqrt(55) + sqrt(1375))-5) + 5sqrt(55)-2)/(-2sqrt(539) + -2sqrt(275)))*2 + 5. 565/64 Simplify (-1sqrt(1188) - sqrt(33))/(sqrt(300)-2) + (sqrt(11) - (sqrt(1331) + sqrt(1331) + -1) - 1(sqrt(44) - sqrt(11))*2). -413sqrt(11)/20 - 10 Simplify ((-41sqrt(99)5-3)/(-3sqrt(729) + sqrt(225)-5) + 3)*2. -90sqrt(11)/13 + 3996/169 Simplify -3 + ((1sqrt(300)-1 - sqrt(36)/((sqrt(84) + sqrt(84) + (-2sqrt(84) - sqrt(84)))/sqrt(7))) + -4)2 + -5. 72sqrt(3) + 251 Simplify (13sqrt(119)2-3)/(sqrt(252)1 + sqrt(847)3). -6sqrt(17)/13 Simplify ((sqrt(81) - -2sqrt(81)-3) + sqrt(81) + (sqrt(81) - (sqrt(81) - (sqrt(81) + sqrt(81) + sqrt(81)-1-5))))/((sqrt(3) + sqrt(3)2)4 + 2sqrt(48)). 9sqrt(3)/20 Simplify ((-3sqrt(209)5 - sqrt(209)33)/(3-3(sqrt(11) + sqrt(1100) - sqrt(11))))2. 304/225 Simplify 2 + sqrt(12) + -3sqrt(12) + 1 - (sqrt(18)/(4sqrt(6)) + 5 + sqrt(75)). -37sqrt(3)/4 - 2 Simplify (sqrt(252)-1-4)/sqrt(9) + (sqrt(77) + (sqrt(77) + sqrt(77) + 3(sqrt(77) - 2sqrt(77)) - sqrt(77)))/(sqrt(77)/(sqrt(28)/sqrt(4))). 7sqrt(7) Simplify (sqrt(539) - sqrt(539)3)*2 + 4 - 5(sqrt(539) + 2sqrt(539))2 - (1 + (sqrt(44)-2)*2 + (sqrt(77)-1)/sqrt(7) + -5). -22267 + sqrt(11) Simplify -1((sqrt(128) + sqrt(128)1)*2-6 - ((sqrt(98) + 1)*2 - sqrt(98) - (1 + sqrt(288))))4 + -1. -20sqrt(2) + 12679 Simplify (2 + (-3sqrt(833) + 4 - sqrt(833) - (-2 + (sqrt(833) + -2)*2)) + 2)2 + -4. -1658 Simplify ((((sqrt(2106) + -1sqrt(2106))-4 - (2sqrt(2106)-2 - sqrt(2106)))-6)/(-4sqrt(242)*1 - ((s	{ "pile_set_name": "DM Mathematics" }
h - 5f + 655 = 0, 5h = -3f - 379 + 1040. Let r = h + u. Is r prime? True Suppose 0 = a + 4a + 15. Is 27/6(-34)/a composite? True Suppose 10 = 3l - 4a - 1, 4l + 2a = 0. Let f(x) = 2x3 - 6x*2 + 2x - 3. Let t be f(4). Let k = l + t. Is k prime? False Let a be (32/(-40))/((-4)/50). Suppose 0 = 15g - ag - 485. Is g a prime number? True Let p(c) = 6c3 + c2 + c - 1. Is p(1) a prime number? True Suppose s = -0s + 1. Is (s - 2) + 1 - -55 prime? False Suppose 0 = -j - 2j + 57. Let a be -1(1 - 2j). Let l = -16 + a. Is l prime? False Suppose -2i - 50 + 288 = 0. Is i composite? True Suppose -6q + 3q = -183. Suppose 2d - q = -2x + 3d, 0 = 5d - 5. Is x a prime number? True Let p = 14 - -9. Let u = p + -12. Is u a prime number? True Let s be 2/(2/4 - 0). Suppose -p - sp + 265 = 0. Is p prime? True Suppose -2u - 322 = -4f, f - 3f = 5u - 167. Let m = f + -128. Let x = m - -82. Is x a composite number? True Let c(k) = k3 + 5k*2 + k + 10. Let o be ((-55)/22)/(1/(-2)). Is c(o) a composite number? True Let v = 11 + -5. Suppose 2u = -3k + 853, -vk - 15 = -k. Is u prime? True Let h = -48 - -85. Is h prime? True Let t = 0 - -2. Suppose 34 = ti - 0i. Is 1(-15)/(-3)i prime? False Let h be (-192)/(-9)(-9)/(-4). Suppose 5a = 47 + h. Is a prime? True Let d(r) = 17r3 - 7r*2 + 4r - 6. Let c be d(5). Suppose 4v - 2m - c = 2m, -3m = v - 475. Is v composite? False Suppose 0 = h + 4h - 45. Suppose -5j - 1780 = -hj. Is j prime? False Let z(i) = 4i - 1. Let p be z(-5). Let t = p - -52. Is t prime? True Suppose 0j + 4j = -220. Let d be 31/11 - 10/j. Suppose -do + 59 = 2h - 0o, 0 = -4o - 20. Is h composite? False Let h(f) = -f*3 + 13f*2 + 16f + 8. Let o(p) = p*3 - 14p*2 - 17p - 9. Let d(a) = 6h(a) + 5o(a). Is d(8) a composite number? True Let f(q) = 0 + 21q - q - 4 - 2. Let j be f(6). Is (-1)/(-1 + j/117) prime? False Suppose -2f + 7 = -3. Suppose -5u - 171 = -3a + fa, a = -2u - 69. Let s = 66 + u. Is s a prime number? False Suppose 0 = -5c - 4u + 1985 - 326, -662 = -2c - 2u. Let a = -238 + c. Is a prime? True Let j be (-2 - -3) + -1 + -1. Let n = j - 2. Let s = 6 + n. Is s prime? True Let c = -241 + 342. Let w = -12 + c. Is w a composite number? False Let y be 6/14 - 570/105. Let p(d) = -d*3 + 6d*2 + d - 8. Let l be p(6). Is (-6 - y) + (-316)/l prime? True Suppose -2x - g = -0x - 395, -g + 594 = 3x. Is x a composite number? False Suppose 0 = -5l - k - 16098, -9651 = 3l - 5k + 3k. Let s = l + 1625. Is s/(-6) + 6/(-9) a composite number? True Let o(c) = -c*3 + 10c*2 - 8c + 2. Let a = -5 - -5. Suppose a = -f - f + 18. Is o(f) a composite number? False Let h = -7 + 8. Is h215 + (-12 - -8) composite? False Let h = -1762 + 3015. Is h a prime number? False Let n(t) = t3 - t2 - t. Let a be n(2). Suppose ax + 6 - 22 = 0. Let f(m) = 7m - 1. Is f(x) a composite number? True Let k(a) = -a3 + 2a*2 + 2a + 1. Let g be k(3). Let m be (-984)/(-26) - g/13. Let v = m + -5. Is v a prime number? False Let z = -7 + 12. Suppose w = 6w + z. Is w(-3)/((-6)/(-194)) a composite number? False Let u(v) = v*3 - 10v*2 + 5v + 2. Let q be u(10). Suppose q = h + h. Is h composite? True Let a(q) = -6q3 - 4q*2 - 3q - 1. Suppose -2p = 3k - 75, -50 = 4k - 6k - 4p. Let g be (-55)/k - (-2)/10. Is a(g) a prime number? True Let t be -12(1/(-2) - -1). Let z = -8 - -27. Is z(t + 3)/(-3) a prime number? True Let u be 2(-2 - (-171)/6). Suppose 4z - 5z = -u. Suppose -z - 9 = -2w. Is w a composite number? False Let u = 56 + -31. Is 7/((-105)/(-6))u a prime number? False Suppose 5w + 0w - 80 = 0. Is (117 + -1)8/w composite? True Suppose 4j - 3 = 3j. Let p(c) = c2 + 4 + 4c + 1 - 2 - jc3. Is p(-2) a prime number? True Let v = -427 - -1172. Suppose -5z - g = -1615, -4z - 2g + 547 = -v. Is z composite? True Suppose 2x - 28 = -2x. Let t = -14 + x. Let m = t - -14. Is m composite? False Suppose -v + 5a + 9 = 0, 0 = v - 2a + 4a - 2. Let z = v + 21. Is z prime? False Suppose -2k + 4 = -0k. Suppose -ky + 30 = -y. Is 205/y - (-1)/6 composite? False Let z = 33 - 13. Let i = -14 + z. Is i composite? True Is (-9)/(-21) + 928/7 a composite number? True Let m = -15 + 80. Is m composite? True Is -11463(-3)/182 composite? False Suppose -3j + 20971 - 6862 = 0. Is j composite? False Let x(b) = -b2 - 9b + 12. Let f be x(-10). Is f11143/18 composite? False Suppose 0 = -a + 3, k - 4k + 117 = 4a. Is k prime? False Let m(k) = 5k2 + 5k - 194. Let i(t) = 3t2 + 3t - 97. Let y(v) = 7i(v) - 4m(v). Is y(0) a prime number? True Suppose -j - j = 2z, 0 = 3j + 5z + 10. Let f be ((-98)/(-4))/((-3)/(-6)). Suppose -3c + f = p + 6, 189 = jp + 2c. Is p composite? False Suppose -4j = j - 565. Is j a prime number? True Let g = 107 + -65. Let d(u) = -u + 5. Let a be d(4). Is (-5)/ag/(-10) a prime number? False Let g = -2 - -4. Suppose -925 = -z - 4z. Suppose -z = -gc - 3c. Is c prime? True Let c(r) = r3 + 7r*2 + 7r + 8. Let q be c(-6). Suppose qz - 516 = -2z. Is z prime? False Let d(r) = r*3 - 6r*2 + 3r + 4. Let g be d(5). Let u = g + 11. Suppose 5k - 335 = -3i, -k + 3i = -uk + 268. Is k a composite number? False Suppose 2r = -0r + f + 11, 4r = -3f + 27. Is r composite? True Let r be 3 + (-3 - -1) + 14. Let v = r + 24. Is v a prime number? False Let g(t) = -t + 8. Let y be g(6). Let s(z) = 11z3 - 4z*2 + 2z + 1. Is s(y) composite? True Suppose 8n = -0n + 1112. Is n a composite number? False Let m(c) = -2c + 2c - 2 + 11 - 14c. Let k be m(-8). Suppose 2y + n = 220, -3y + 2y = -5n - k. Is y prime? False Let d(o) = o3 - 7o*2 + 4o + 1. Let c be d(6). Let k = -9 - c. Suppose k = -2f + 44. Is f composite? True Let r = -197 - -558. Let v = -102 + r. Is v composite? True Let u = 14 + -13. Let d(o) = o2 - o - 1. Let x(w) = 89w*2 - w. Let t(l) = -d(l) + x(l). Is t(u) prime? True Suppose -2k = -5k - 9. Let b = k - -18. Is b a prime number? False Suppose 2f = -3w + 48, -2w - 3w - 2f + 76 = 0. Suppose w + 17 = z. Is z a prime number? True Let r be (-613)/(-4) - 3/(-4). Suppose l - r = -23. Is l a composite number? False Let b(l) = 17l2 + 7l - 7. Is b(4) a composite number? False Let l(c) = c + 1. Let o(m) = 96m2 - 2m - 1. Let n(z) = 3l(z) + o(z). Is n(-1) a prime number? True Let u(f) = -f - 2. Let b be u(-7). Suppose bl = -2w + 139 + 304, 2l - 181 = 3w. Is l a composite number? False Let c = -19 + 9. Let v = c - -15. Suppose 111 = vm - 2m. Is m composite? False Let i(o) = 25o*3 - 4o*2 + o - 1. Is i(3) prime? True Let w(v) = v + 4. Let j be w(-2). Suppose jt = -4a + 130, -t + 2t = 4a - 145. Is a a composite number? True Let l = 380 - -663. Is l a composite number? True Let n be (-3)/(-12) - 63/(-4). Let v = -11 + n. Suppose 6 + 169 = vr. Is r composite? True Suppose -2w - 2w = -4z - 32, 4 = -2z. Is (-2)/3 + 208/w a prime number? False Is (-7)/(175/(-42720)) - 2/(-10) a prime number? True Let p = 567 + -382. Is p a composite number? True Is (-8 - -7)502/(-2) prime? True Let v(u) be the first derivative of -17u*2/2 + u - 2. Let b be (-3 - -2)(0 - -2). Is v(b) a prime number? False Suppose 4j - 5j + 143 = 0. Is j a prime number? False Is ((-98)/(-21))/(6/261) a composite number? True Suppose -v - 3d = 153, -4d + 623 = -5v - 218. Is -1v/(-3)-1 prime? False Is (-3333)/(-5) + 10/1255 a composite number? True Let a be 3/15 + 42/15. Suppose 0 = 4c - 8, -ar - 4c + 20 = -0c. Suppose 3f = 3z - 90, 0 = z - rz - 2f + 95. Is z a prime number? True Suppose 9 = -h + 4h. Suppose -hs + 123 = -138. Suppose 2r + 2r = g + s, 5g = -2r + 71. Is r prime? True Let p = -2 + 4. Let u be 1 + p + -2 - -3. Suppose 14 + 14 = um. Is m composite? False Suppose -5u = -6u + 395. Is u prime? False Is (-1337)/(-15) - 4/30 prime? True Suppose 3c + c - 3y = 7, 4c + 2y = 22. Let m(x) = 4x3 + x2 - 2x - 1. Is m(c) prime? True Suppose 0h - 4h = -28. Let s(b) = -b3 + 11b*2 - 4b - 8. Let j be s(h). Let q = -109 + j. Is q a composite number? True Let b = 147 + 298. Is b a prime number? False Suppose -3g - 6158 = -5g. Is g a prime number? True Suppose -2b - 557 = -5x - 6b, 0 = 4x + 2*b - 448. Is x composite	{ "pile_set_name": "DM Mathematics" }
10o3 + 2o*2 - o + 1 What is the o'th term of 2185, 2203, 2245, 2323, 2449, 2635, 2893? 2o*3 + 4o + 2179 What is the b'th term of -177, -628, -1343, -2316, -3541? b*3 - 138b*2 - 44b + 4 What is the h'th term of 660, 1329, 1998, 2667, 3336, 4005? 669h - 9 What is the w'th term of -136, -227, -290, -325, -332, -311? 14w*2 - 133w - 17 What is the q'th term of -1179, -2127, -2851, -3351, -3627, -3679? 112q2 - 1284q - 7 What is the r'th term of 3140, 3087, 3000, 2879? -17r2 - 2r + 3159 What is the y'th term of 502, 8, -806, -1946, -3418, -5228? -y*3 - 154y*2 - 25y + 682 What is the a'th term of 12, 74, 220, 486, 908? 6a3 + 6a*2 + 2a - 2 What is the u'th term of -9796, -19619, -29436, -39247, -49052? 3u2 - 9832u + 33 What is the g'th term of 34806, 34808, 34810, 34812? 2g + 34804 What is the z'th term of 1408228, 1408224, 1408220, 1408216, 1408212? -4z + 1408232 What is the f'th term of 564, 473, 382, 291, 200? -91f + 655 What is the n'th term of -183, -692, -1537, -2730, -4283, -6208, -8517, -11222? -2n*3 - 156n*2 - 27n + 2 What is the g'th term of -199, -455, -883, -1483? -86g2 + 2g - 115 What is the u'th term of -762, -1523, -2280, -3033? 2u2 - 767u + 3 What is the c'th term of 8686, 8696, 8704, 8710, 8714? -c*2 + 13c + 8674 What is the k'th term of 2020, 2056, 2102, 2158, 2224, 2300? 5k2 + 21k + 1994 What is the l'th term of -143, -312, -481? -169l + 26 What is the p'th term of 117, 132, 47, -138, -423, -808, -1293? -50p*2 + 165p + 2 What is the l'th term of 118274, 118266, 118258? -8l + 118282 What is the d'th term of 26504, 26340, 25890, 25010, 23556, 21384, 18350, 14310? -24d3 + d2 + d + 26526 What is the q'th term of 261, 424, 545, 624? -21q2 + 226q + 56 What is the m'th term of 1405, 1106, 281, -1334, -4003, -7990? -44m3 + m2 + 6m + 1442 What is the z'th term of -3627, -3591, -3541, -3471, -3375, -3247, -3081, -2871? z3 + z2 + 26z - 3655 What is the j'th term of -199528, -199537, -199560, -199603, -199672, -199773? -j3 - j2 + j - 199527 What is the x'th term of -28, -61, -82, -85, -64, -13? x3 - 40x + 11 What is the u'th term of -563, -1694, -3587, -6248, -9683, -13898, -18899, -24692? -u*3 - 375u*2 + u - 188 What is the s'th term of -674, -793, -982, -1241, -1570? -35s*2 - 14s - 625 What is the w'th term of -2236, -4455, -6674, -8893, -11112, -13331? -2219w - 17 What is the b'th term of -37, 5, 43, 77, 107? -2b*2 + 48b - 83 What is the t'th term of 10587, 9884, 9181? -703t + 11290 What is the d'th term of -4687, -9377, -14067, -18757, -23447, -28137? -4690d + 3 What is the o'th term of 1871, 7465, 16789, 29843, 46627, 67141, 91385? 1865o2 - o + 7 What is the b'th term of 2111, 4202, 6289, 8372, 10451, 12526, 14597? -2b*2 + 2097b + 16 What is the x'th term of -15, 53, 121, 189, 257, 325? 68x - 83 What is the m'th term of 995, 1099, 1259, 1475, 1747? 28m*2 + 20m + 947 What is the u'th term of 7150, 7148, 7146, 7144, 7142? -2u + 7152 What is the s'th term of 444, 215, -14? -229s + 673 What is the y'th term of 21, -2, -53, -132, -239? -14y2 + 19y + 16 What is the i'th term of 193, 237, 277, 313, 345, 373, 397? -2i2 + 50i + 145 What is the y'th term of -3867, -7770, -11673, -15576, -19479? -3903y + 36 What is the p'th term of -1976, -2912, -3848, -4784, -5720, -6656? -936p - 1040 What is the h'th term of 15629, 31260, 46891, 62522? 15631h - 2 What is the r'th term of -171962, -171964, -171966, -171968? -2r - 171960 What is the i'th term of 42571, 42578, 42589, 42604? 2i2 + i + 42568 What is the t'th term of 7654, 30516, 68628, 121996, 190626? t3 + 7619t*2 - 2t + 36 What is the b'th term of 64524, 64528, 64530, 64530, 64528, 64524, 64518? -b*2 + 7b + 64518 What is the q'th term of 6793, 13522, 20141, 26596, 32833? -9q3 - q2 + 6795q + 8 What is the l'th term of -66, -107, -152, -189, -206, -191, -132, -17? 2l3 - 14l*2 - 13l - 41 What is the d'th term of -15968, -15963, -15956, -15947, -15936? d*2 + 2d - 15971 What is the w'th term of 180, 1347, 4472, 10533, 20508, 35375, 56112, 83697? 163w3 + w2 + 23w - 7 What is the h'th term of 5145, 10309, 15473, 20637, 25801? 5164h - 19 What is the u'th term of -30, 212, 956, 2454, 4958, 8720, 13992? 42u3 - u2 - 49u - 22 What is the d'th term of 335, -202, -1097, -2350? -179d*2 + 514 What is the v'th term of -4375, -8736, -13075, -17392? 11v*2 - 4394v + 8 What is the i'th term of 200, 599, 1294, 2291, 3596, 5215, 7154, 9419? i*3 + 142i*2 - 34i + 91 What is the m'th term of -1086, -1046, -968, -834, -626? 3m3 + m2 + 16m - 1106 What is the p'th term of 720, 2823, 6330, 11241, 17556, 25275? 702p2 - 3p + 21 What is the p'th term of -938, -3849, -8910, -16289, -26154? -28p3 - 907p*2 + 6p - 9 What is the n'th term of -1175, -4526, -10105, -17906, -27923? n*3 - 1120n*2 + 2n - 58 What is the a'th term of 486, 1688, 3662, 6414, 9950, 14276, 19398, 25322? a*3 + 380a*2 + 55a + 50 What is the l'th term of 3355, 6481, 9607, 12733? 3126l + 229 What is the q'th term of 495, 1616, 3365, 5742, 8747? 314q*2 + 179q + 2 What is the r'th term of 4, -41, -84, -125, -164? r*2 - 48r + 51 What is the w'th term of 44, 34, 72, 206, 484, 954, 1664? 8w3 - 24w*2 + 6w + 54 What is the z'th term of 36, 27, 10, -15? -4z2 + 3z + 37 What is the j'th term of -284, -338, -370, -368, -320, -214? 2j3 - j2 - 65j - 220 What is the q'th term of 114, 227, 306, 321, 242, 39, -318? -5q3 + 13q*2 + 109q - 3 What is the j'th term of -408255, -1633023, -3674303, -6532095, -10206399, -14697215, -20004543? -408256j2 + 1 What is the l'th term of -2995, -2822, -2485, -1978, -1295? l3 + 76l*2 - 62l - 3010 What is the z'th term of -603, -1214, -1825, -2436, -3047? -611z + 8 What is the o'th term of 795, 1732, 2647, 3534, 4387, 5200, 5967? -o3 - 5o*2 + 959o - 158 What is the s'th term of 397369, 397380, 397397, 397420? 3s2 + 2s + 397364 What is the y'th term of -111, -282, -523, -834, -1215, -1666? -35y2 - 66y - 10 What is the j'th term of 760279, 1520560, 2280841, 3041122, 3801403, 4561684? 760281j - 2 What is the s'th term of -1551481, -3102959, -4654423, -6205867, -7757285, -9308671, -10860019? s3 + s2 - 1551488s + 5 What is the s'th term of -19685, -19672, -19657, -19640, -19621, -19600, -19577? s*2 + 10s - 19696 What is the u'th term of 4746, 9486, 14250, 19050, 23898? 2u3 + 4726u + 18 What is the k'th term of -221296, -221306, -221316, -221326? -10k - 221286 What is the z'th term of -3334, -5957, -8580, -11203, -13826? -2623z - 711 What is the l'th term of 136, 339, 600, 919, 1296, 1731, 2224? 29l2 + 116l - 9 What is the p'th term of -23914, -47828, -71742, -95656, -119570? -23914p What is the t'th term of -289, -306, -345, -418, -537, -714, -961, -1290? -2t3 + t2 - 6t - 282 What is the u'th term of 1482, 1567, 1652, 1737, 1822? 85u + 1397 What is the l'th term of 291, 473, 605, 663, 623, 461, 153? -4l3 - l2 + 213l + 83 What is the n'th term of -281920, -281906, -281890, -281872, -281852? n*2 + 11n - 281932 What is the x'th term of -854, -1892, -2930, -3968, -5006, -6044? -1038x + 184 What is the f'th term of -16022, -15972, -15844, -15602, -15210, -14632, -13832, -12774? 6f*3 + 3f2 - f - 16030 What is the f'th term of 56, 306, 716, 1280, 1992, 2846, 3836, 4956? -f3 + 86f2 - f - 28 What is the t'th term of 510, 512, 514, 516, 518? 2t + 508 What is the w'th term of 1868, 3705, 5542, 7379? 1837w + 31 What is the b'th term of 328543, 657086, 985629? 328543b What is the l'th term of -27, -74, -129, -198, -287? -l*3 + 2l*2 - 46l + 18 What is the m'th term of 232, 219, 208, 199, 192, 187, 184? m*2 - 16m + 247 What is the h'th term of 47, 153, 311, 515, 759, 1037, 1343, 1671? -h*3 + 32h*2 + 17h - 1 What is the h'th term of 33104, 66190, 99276? 33086h + 18 What is the r'th term of -53, -72, -65, -20, 75, 232, 463, 780? 2r3 + r2 - 36r - 20 What is the a'th term of 1401, 1488, 1649, 1896, 2241? 2a*3 + 25a*2 - 2a + 1376 What is the q'th term of 11244, 11226, 11186, 11112, 10992, 10814, 10566, 10236? -2q3 + q2 - 7q + 11252 What is the m'th term of	{ "pile_set_name": "DM Mathematics" }
there in twenty-nine fifths of a microgram? 5800 How many kilometers are there in 320.121mm? 0.000320121 Convert 4.3828 litres to millilitres. 4382.8 Convert 26.13088 millennia to decades. 2613.088 How many hours are there in 7/8 of a week? 147 What is 0.6647423 centuries in months? 797.69076 What is 1/36 of a hour in milliseconds? 100000 How many micrograms are there in 3/50 of a gram? 60000 Convert 9884.879 nanoseconds to seconds. 0.000009884879 How many decades are there in one tenth of a millennium? 10 What is three eighths of a meter in millimeters? 375 Convert 3.3643ng to micrograms. 0.0033643 How many micrometers are there in 7/4 of a millimeter? 1750 What is 37/5 of a litre in millilitres? 7400 Convert 738361.6 nanograms to milligrams. 0.7383616 How many hours are there in thirteen eighths of a day? 39 What is 197685.6 months in decades? 1647.38 How many centimeters are there in 81/4 of a meter? 2025 How many minutes are there in 7/2 of a hour? 210 What is one twentieth of a second in microseconds? 50000 Convert 196919.5 centimeters to nanometers. 1969195000000 What is twenty-nine halves of a millimeter in micrometers? 14500 How many micrograms are there in 51/5 of a milligram? 10200 How many nanoseconds are there in 0.5030169 minutes? 30181014000 How many months are there in 29/3 of a century? 11600 How many centuries are there in 6/5 of a millennium? 12 How many milliseconds are there in five quarters of a minute? 75000 What is 3.4221t in nanograms? 3422100000000000 How many nanometers are there in 11/2 of a micrometer? 5500 How many meters are there in 51/4 of a kilometer? 12750 How many millilitres are there in 4375.373 litres? 4375373 What is thirty-three fifths of a century in years? 660 How many kilograms are there in 84794.89mg? 0.08479489 What is 62719.87 nanometers in meters? 0.00006271987 What is 788111.5cm in millimeters? 7881115 What is 5/42 of a week in minutes? 1200 How many kilograms are there in six fifths of a tonne? 1200 How many millimeters are there in thirteen fifths of a meter? 2600 How many years are there in 0.2233074 decades? 2.233074 What is 3/40 of a week in minutes? 756 How many milligrams are there in 0.8246626ng? 0.0000008246626 How many seconds are there in 2/63 of a week? 19200 How many meters are there in 18/5 of a kilometer? 3600 How many kilometers are there in 935369.1 micrometers? 0.0009353691 How many millilitres are there in nineteen quarters of a litre? 4750 What is 9/10 of a microgram in nanograms? 900 How many millilitres are there in seventy-three fifths of a litre? 14600 How many millilitres are there in 5/4 of a litre? 1250 Convert 5709.342 grams to tonnes. 0.005709342 What is 93360.2l in millilitres? 93360200 What is 513568.7 micrometers in nanometers? 513568700 What is 13/5 of a litre in millilitres? 2600 How many millilitres are there in 21/5 of a litre? 4200 How many millilitres are there in one twentieth of a litre? 50 How many months are there in 1/60 of a millennium? 200 What is 1743.4323s in hours? 0.48428675 Convert 45.51415 centuries to millennia. 4.551415 How many milligrams are there in thirteen quarters of a gram? 3250 Convert 16198.49448 seconds to weeks. 0.026783225 What is 1/10 of a millisecond in nanoseconds? 100000 What is 7/8 of a gram in milligrams? 875 How many months are there in 82093.14 millennia? 985117680 What is 85405.7 milligrams in kilograms? 0.0854057 How many millilitres are there in twenty-one eighths of a litre? 2625 What is 7/4 of a litre in millilitres? 1750 What is 3/25 of a milligram in micrograms? 120 How many millilitres are there in 3.651098 litres? 3651.098 How many years are there in 17/4 of a millennium? 4250 How many months are there in twenty-one quarters of a century? 6300 How many years are there in 3/25 of a millennium? 120 What is sixty-four fifths of a litre in millilitres? 12800 What is 32484.39 millennia in years? 32484390 How many meters are there in 5.981098 centimeters? 0.05981098 How many nanometers are there in 30.6366 meters? 30636600000 How many decades are there in 1/5 of a century? 2 What is 15688.98 decades in years? 156889.8 How many nanometers are there in thirty-seven fifths of a micrometer? 7400 Convert 262.6816ug to nanograms. 262681.6 What is 51/5 of a centimeter in millimeters? 102 Convert 4804.543 hours to microseconds. 17296354800000 What is one tenth of a gram in milligrams? 100 What is 51/8 of a litre in millilitres? 6375 How many centuries are there in 0.4014359 millennia? 4.014359 How many micrometers are there in thirteen quarters of a centimeter? 32500 Convert 1822.151mg to micrograms. 1822151 How many litres are there in 7.07622ml? 0.00707622 What is 158.985288us in weeks? 0.0000000002628725 Convert 0.303641 litres to millilitres. 303.641 Convert 2886.48ng to micrograms. 2.88648 How many minutes are there in seven halves of a week? 35280 How many millimeters are there in 2184.44 kilometers? 2184440000 What is 37/2 of a litre in millilitres? 18500 What is 45/8 of a litre in millilitres? 5625 What is 0.1497298 litres in millilitres? 149.7298 How many meters are there in 7/4 of a kilometer? 1750 How many kilograms are there in 30.41264 grams? 0.03041264 What is 49418.77 kilometers in centimeters? 4941877000 Convert 22.18517 microseconds to seconds. 0.00002218517 Convert 7.143076 centuries to decades. 71.43076 What is 6/5 of a kilogram in grams? 1200 How many millilitres are there in 25/4 of a litre? 6250 Convert 0.9416666 nanograms to grams. 0.0000000009416666 What is 58.90258ml in litres? 0.05890258 How many decades are there in 11/4 of a millennium? 275 How many millimeters are there in 3/25 of a meter? 120 How many millilitres are there in nineteen quarters of a litre? 4750 How many minutes are there in 12/7 of a week? 17280 How many seconds are there in 28615.35 nanoseconds? 0.00002861535 Convert 89702.98 litres to millilitres. 89702980 What is 7/4 of a kilometer in meters? 1750 What is five sixths of a hour in seconds? 3000 What is seven sixths of a century in months? 1400 How many litres are there in 364901.6ml? 364.9016 How many millilitres are there in five quarters of a litre? 1250 What is 2571723.9 months in millennia? 214.310325 How many seconds are there in 84.27399 weeks? 50968909.152 How many weeks are there in 10425693.6 hours? 62057.7 How many decades are there in three fifths of a century? 6 Convert 47.7118 grams to kilograms. 0.0477118 How many micrometers are there in 8/25 of a millimeter? 320 Convert 70859.82 millilitres to litres. 70.85982 Convert 726634.3 tonnes to milligrams. 726634300000000 What is 546.809km in millimeters? 546809000 Convert 7455.421 decades to centuries. 745.5421 What is 156150.4cm in meters? 1561.504 What is 4669.309kg in milligrams? 4669309000 How many months are there in 8.268614 decades? 992.23368 What is 80060.91 milligrams in nanograms? 80060910000 How many months are there in three tenths of a century? 360 What is 77208.49 weeks in nanoseconds? 46695694752000000000 Convert 3.385018ms to seconds. 0.003385018 How many months are there in seventy-seven fifths of a decade? 1848 What is 1/5 of a litre in millilitres? 200 How many kilograms are there in one quarter of a tonne? 250 How many micrograms are there in 879625.2 nanograms? 879.6252 How many millilitres are there in 0.6833284 litres? 683.3284 How many centimeters are there in twenty-seven halves of a meter? 1350 How many nanograms are there in 1/5 of a microgram? 200 What is 5/4 of a kilogram in grams? 1250 Convert 98391.5mg to micrograms. 98391500 How many micrograms are there in nine tenths of a milligram? 900 How many milligrams are there in 148946.6t? 148946600000000 How many decades are there in 32/5 of a millennium? 640 What is 21/4 of a hour in minutes? 315 What is 33/5 of a millennium in decades? 660 How many months are there in 5/6 of a millennium? 10000 How many kilograms are there in 11429.59g? 11.42959 What is 69626.09 nanograms in kilograms? 0.00000006962609 What is 21/8 of a litre in millilitres? 2625 Convert 2.5151 millilitres to litres. 0.0025151 How many micrometers are there in 6.67366 millimeters? 6673.66 How many micrograms are there in 5/4 of a milligram? 1250 What is 8405.041 micrograms i	{ "pile_set_name": "DM Mathematics" }
= -4 - 4 for x. -2 Solve -4g - 7 = -0g + f, -15 = 5f for g. -1 Solve -10 = f - 3r, -2r + r = 4f - 12 for f. 2 Solve 4i - 9 - 11 = 4l, 4l = -4i - 12 for i. 1 Solve -8l = -10l + 10, 0 = 2o - 2l + 12 for o. -1 Solve 2y + 15 = y + 4f, 4y = -4f for y. -3 Solve -5a + a - 5 = 5h, -3h + 14 = -a for h. 3 Solve 3q + 3l = -30, -20 = -q + 4l + l for q. -5 Solve 0 = 4n + 2k + 10, 13n - 12n - 2k = -5 for n. -3 Solve -4j - 4b = -0 + 28, -18 = 2j + 3b for j. -3 Solve 0 = p - 4a, -8a + 2 = -6a for p. 4 Solve f - b = -4b - 3, 2 = -4f - 2b for f. 0 Solve -4f = 7x - 3x + 40, 0 = 2f - 2x for f. -5 Solve -22 - 11 = 5p + 3s, 0 = 3p - 3s + 15 for p. -6 Solve 3u + 2i = -2u + 2, 3u + i = 2 for u. 2 Solve s - 5 = m, -4s + 18 = 25m - 27m for m. -1 Solve g + 3 = 0, -41n + 45 = -46n - 5g for n. -6 Solve 5d - 10 = -5l, -5d + 4d - 8 = -l for l. 5 Solve r - 9 = 2l, -5l - 6r = -r for l. -3 Solve y + 1 - 14 = -3x, 3y = 4x for x. 3 Solve -6 = -2p, 3l - 95p + 91p + 9 = 0 for l. 1 Solve 3r - s - 26 + 17 = 0, 3s = 3r - 3 for r. 4 Solve 4h = -5t + 10, h + h - 4t = 18 for h. 5 Solve 0 = -2w - 2b + 8, 0 = -0w - w - 4b + 4 for w. 4 Solve 2r - 5u + 1 = -4, 4u = 12 for r. 5 Solve -4i - 7 = -56c + 59c, -3c + 21 = -3i for i. -4 Solve 5q + 3c = -7 - 8, 0 = -5q - c - 5 for q. 0 Solve 3 = -7n + 6n - w, -n - 9 = 3w for n. 0 Solve 3t = -4o + 7t - 12, 0 = 4o + 3t - 9 for o. 0 Solve 0 = 39s - 36s + 2j + 8, 4s - 5j - 20 = 0 for s. 0 Solve -4h - 5o + 13 = -6o, -4o + 5 = 3h for h. 3 Solve -6u + u - 2x + 15 = 0, 4x = -3u + 23 for u. 1 Solve -2m + 9 + 9 = -4z, 2m - 20 = 5z for z. -2 Solve -2c = 3x + 2x + 17, -4c + 3x + 31 = 0 for c. 4 Solve 4f - 2d + 0 + 18 = 0, -3f = 5d - 6 for f. -3 Solve -4a - 7 = 3q, a - 3q - 17 = -0 for a. 2 Solve 2h + 3l = 4l + 4, 4h = -5l + 8 for h. 2 Solve -2r + 2 - 11 = 3m, 14 = -2r - 4m for r. 3 Solve -3n - 5p - 2 = -0, n = -5p + 6 for n. -4 Solve 17 = -3f - 2z, 4f = f + 6z - 9 for f. -5 Solve 0 = 3v - 2a + 5a + 3, 0 = -4v - 2a - 10 for v. -4 Solve 2k = 4m + 13 - 15, -2m = -3k + 5 for k. 3 Solve 32q + 3y + 16 = 28q, -2y = -5q + 3 for q. -1 Solve 0 = 4s - 5s - 5k + 15, 6 = -4s + 2k for s. 0 Solve -5g = -7g + 5b + 16, -4b = -g + 14 for g. -2 Solve -11j = -b - 10j, 4j - 6 = 2b for b. 3 Solve 2k - 6 = 4v, -4 + 3 = 5k + 6v for k. 1 Solve 3f - 2 + 3 = -2z, 2f - 2z + 4 = 0 for f. -1 Solve 9b = 13b - 3c + 11, -4b + 2c - 6 = 0 for b. 1 Solve -b - 5v + 1 = -0b, 0 = 3b + 5v - 3 for b. 1 Solve -3h - 507c + 505c = -6, 0 = -h + 2c + 2 for h. 2 Solve 5d - 6 = -2i, -1 = -2d - 6i + 17 for d. 0 Solve 5i = -g - 1, 5i + 4 = -26g + 22g for i. 0 Solve -s + 10 + 13 = -4v, 19 = 3s - 2v for s. 3 Solve 2q + 4u + 12 = 0, -7u - 12 = 5q - 3u for q. 0 Solve 2g + 5t = 12, 91g = 92g - 4t + 7 for g. 1 Solve -4t - 2h - 22 = -0, 6 = -t - h for t. -5 Solve 4w - 5t - 4 = 3w, -t + 2 = -3w for w. -1 Solve 4h - 7h = -5s + 11, 0 = h + 4s - 2 for h. -2 Solve 5w - 7h = -12h, -2w + h = -6 for w. 2 Solve -4a - 3u = -31, a - 13 = -3u + 6 for a. 4 Solve -2w = -5s + 3, 5s = 3w - 2w + 4 for w. 1 Solve 2b - 5b - 20 = -5l, 0 = -4b - 2l + 8 for b. 0 Solve -22 = 4o - 2z, 21 = o - 4o + 3z for o. -4 Solve -41g - 6 = b - 43g, -3b - 8 = -4g for b. 4 Solve -4 = -3w + u, 4u = -2w + 7u - 2 for w. 2 Solve 4i = -x + 78 - 70, 5i - 4x - 31 = 0 for i. 3 Solve 4d = -h, 0 = -7d + 2d + 4h for d. 0 Solve 6a - 10 = 2a - 2s, -2a + 5s = 25 for a. 0 Solve 5w - 4x - 33 = 0, 7w - 30 = 3w + 5x for w. 5 Solve 5o - 5w = 0, -56o + 2w = -61o + 21 for o. 3 Solve 0 = 5t - d - 15, -5t + 15 = 16d - 18d for t. 3 Solve -4t - m - 17 = 0, t + 59m = 60m - 3 for t. -4 Solve f - 2 = h, -h - 3f + 24 = 2h for h. 3 Solve 0 = -5p - 5, 3o + 7 = 4p + 8 for o. -1 Solve v + 21 = 6v + g, -5g = 4v for v. 5 Solve 0 = 4q + r - 7, -5r - 16 = 6q - 3q for q. 3 Solve 3k + 3 = 0, 0 = 5h + 2k - 2 + 9 for h. -1 Solve -2r + 10a - 14a - 2 = 0, 5r + 3a - 16 = 0 for r. 5 Solve -3w + 0w = -6, 4w = 5o + 8 for o. 0 Solve 4i - 5m = 7, 2m - 49 + 53 = 2i for i. 3 Solve -4h + 64 = -4w + 52, -5w - 4h + 30 = 0 for w. 2 Solve 3h = 5u - 0 + 15, 0 = 3u + 2h - 10 for u. 0 Solve -3v - v - 3p = -31, -v + 4p - 16 = 0 for v. 4 Solve -a = 0, -20 = -2u - 5a - 18 for u. 1 Solve 5z + c + 17 = 6, 3z - 5c + 1 = 0 for z. -2 Solve -11h + 12 = -13h + 3g, 0 = 5g - 20 for h. 0 Solve -4o + 17 = z, 5o - 32 = 4z - 16 for z. 1 Solve -5z + 3z + 2r = -12, 0 = 5z + r - 6 for z. 2 Solve -2z = -5p - 7z, 18 = -3p + 3z for p. -3 Solve 5r = 5n - 30, -86n + 5r = -89n + 18 for n. 6 Solve f = 3j - 12, 4 = j + 7f - 5f for j. 4 Solve -3q - 4 = -y - 13, 3q - 4y - 18 = 0 for q. 2 Solve -5a - 2 = 4b, -4b = 2a + 2a for a. -2 Solve -23 = -3w + 2y, -3w = y - 21 + 10 for w. 5 Solve -2a - 3k = -4k + 10, -25 = 5a - 3k for a. -5 Solve 2s - 13 = -c, s - 2c - 5 + 11 = 0 for s. 4 Solve 35u - 5 = 34u + 5m, m = -4u - 1 for u. 0 Solve -5a = -4a + 5, -3r = -6a - 51 for r. 7 Solve -2v - 7 = 2r + 7, -3r - 9 = 0 for v. -4 Solve -4q = 3j - 7, -4j + 8j = -2q - 4 for j. -3 Solve 2a = -0a + 5k - 13, a - 5k + 9 = 0 for a. -4 Solve -3f - 22 = -5x, -5x - 6 + 30 = -f for f. 1 Solve 4n + 6 = 3h, -2n - 4 = -10h + 8h for n. 0 Solve 6 = -g + h, 1 + 8 = -2g - h for g. -5 Solve -70j + p + 2 = -67j, -3j + 2p = 2 for j. 2 Solve 0 = 4c - 0a - a + 3, 0 = 2a - 6 for c. 0 Solve 3y - 6 = 2y + 4l, 2l + 12 = 5y for y. 2 Solve 3p + 5h - 3 + 38 = 0, 0 = -4p - 5h - 40 for p. -5 Solve h = 2i - 7, 2h = 3i - h - 15 for i. 2 Solve 2s = s - i + 3, 0 = 5s - 5i + 15 for s. 0 Solve -3a - 55 + 49 = x, 5a + 4x + 17 = 0 for a. -1 Solve -2w - 14 = 4i, w + i + 4i = -19 for w. 1 Solve -3a + 3m = 0, -2a + 3m - 3 + 6 = 0 for a. -3 Solve 3v - 5o + 3 = 7, 13 = 3v + 4o for v. 3 Solve -10k = -15k + 5l + 15, 3k = 4l + 7 for k. 5 Solve s - 48 = 3k - 41, 5s = -25 for k. -4 Solve 6 = -2t - 2t - 2i, -4i + 1 = -5t for t. -1 Solve y = 2s + 7, 7y + 3 = 11y - 3s for y. -3 Solve -4u + 3r = 2, -4u - 2r = 3r + 18 for u. -2 Solve -4i = -5q - 18, 2q + i + 0i = -2 for q. -2 Solve -4n + 5f = 0, -2n - 4f + 25 = -1 for n. 5 Solve 0 = 4x - 3n - 7, 0 = -n - 23 + 22 for x. 1 Solve -5v - 20 = -2z, 0 + 12 = -2z - 3v for z. 0 Solve -2a + 5v - 8 = 0, 3v = -4a - 5 + 15 for a. 1 Solve -3x = -5x + 5v + 9, -9 = 4x - v for x. -3 Solve -3c - 28 = 5u - 8, 4c - 4 = u for u. -4 Solve -m + 25 - 6 = 4g, -4m = 4g - 16 for g. 5 Solve -2j = -j + 4g + 8, -3j = 4g + 16 for j. -4 Solve -2y + 7 + 1 = 2x, 0 = 5y - 2x + 15 for y. -1 Solve 3s + 10 = -l, 5s + 30 = 25l - 24l for l. 5 Solve 3d = -2l + 5 + 1, -2d + 15 = 5l for l. 3 Solve -4v + 3p = 26, 13 + 8 = -5v - 2p for v. -5 Solve n - k - 8 = 0, -52n = -56n + 2k + 22 for n. 3 Solve 10 = -5a + 15d - 20d, 0 = a - 3d - 10 for a. 1 Solve -3h = -5f + 12, 2f - 11 = 319h - 324h for f. 3 Solve 4r - 5 = y + 5r, 5r + 25 = 3y for y. 0 Solve -3n = -3, 3p + 3 = -n - 8 for p. -4 Solve -g + 4u + 10 + 3 = 0, 5u = g - 15 for g. 5 Solve -9u + 10u + 2j = 1, -2j + 16 = 4u for u. 5 Solve -5d = -4f + 20, 20 = -6d + d for f. 0 Solve -y + 1 = 4g, 3g = 3y - 38 + 5 for y. 9 Solve -2t = 2w - 2, 0 = 24t - 21t - 2w - 18 for t. 4 Solve -33 = n - 4i, 619n = 624n + 5i - 35 for n. -1 Solve 0 = -f + 26v - 24v + 7, -4v - 8 = 0 for f. 3 Solve 0 = 2k + 4v, -2k + 47v + 8 = 43v for k. 2 Solve 4h = 16, -4m - 50h + 24 = -47h for m. 3 Solve 3j - 11 = -s + 9, 4j - 28 = 0 for s. -1 Solve 17 = -3r + l + 2, 0 = -r + 3l - 13 for r. -4 Solve -2u = 3r - 5u + 18, 0 = 4r + 3u - 11 for r. -1 Solve -3i = -4y - 8, 15y - 11y - 4i + 12 = 0 for y. 1 Solve 6 = -3o - 3p, -38p - 3 = -37p for o. 1 Solve 4y - 9 = -5p, -y + 3 = 5p - 3 for y. 1 Solve -3 = -2t + x, -t - 3x - 4 + 16 = 0 for t. 3 Solve -2q - 8 = 6t - 7t, -3t = -2q - 12 for q. -3 Solve 3n + 67 = 2c + 87, 2n + 20 = -7c for c. -4 Solve -4 = 2k - 2l, -4k + 6 = 3l + 28 for k. -4 Solve -5z = b + 11, 3z = 4	{ "pile_set_name": "DM Mathematics" }
. Suppose -6s + 25 = -s. What is the highest common divisor of s and l? 5 Let t = 9 + 17. Let h be (-411)/(-9) - 4/6. Suppose 5c - 150 = h. What is the greatest common factor of c and t? 13 Let l(v) = -1. Let s(r) = -31r - 5. Let w(x) = 3l(x) - s(x). Let g be w(2). What is the highest common divisor of g and 16? 16 Suppose 2l + 2 - 8 = 0. What is the highest common divisor of l and 1? 1 Let r(o) be the third derivative of -o6/120 - o5/60 + 5o3/6 - o2. Let s be r(0). What is the greatest common divisor of 20 and s? 5 Let h be (-100)/(-15)30/4. What is the highest common divisor of 10 and h? 10 Let f(j) = 3j*2 + 2j - 5. Let u be f(-6). Suppose -z = z - 26. What is the greatest common factor of u and z? 13 Suppose 0 = 4l - 240 - 208. Calculate the highest common factor of 16 and l. 16 Suppose q = 13 - 7. Calculate the highest common factor of q and 6. 6 Let x = 20 + 1. What is the highest common factor of x and 63? 21 Let h = -2 - -3. Let s be 8/(h4/66). Let j(p) = 3p. Let v be j(4). Calculate the greatest common divisor of v and s. 12 Let h = -19 - -36. Calculate the highest common divisor of 34 and h. 17 Suppose -21 + 61 = 4b. Calculate the greatest common factor of b and 50. 10 Suppose -4r = -r - 36. What is the highest common factor of 30 and r? 6 Let m be -4 + (-15)/(-3) + 4. Calculate the highest common divisor of 15 and m. 5 Let t = 41 + -19. What is the greatest common factor of t and 11? 11 Let u(n) = 13n - 7. Let g be u(4). What is the greatest common factor of 5 and g? 5 Let i be 764/(-10)20/4. Let s be (-10)/(-40) - i/8. Suppose r - 2n = -n + 11, -3r - n + 53 = 0. Calculate the highest common divisor of s and r. 16 Suppose 17 = 5o - 38. Let s = -43 + 76. What is the highest common factor of o and s? 11 Let k(f) = 5f - 8. Let z be k(7). Suppose -2v + 70 = -0v. Suppose 3w + 8 = v. What is the greatest common factor of z and w? 9 Suppose w - 5r = 32, 2w - 4r - 22 = 30. Suppose 4a - w = -6. What is the highest common divisor of 36 and a? 4 Let o(s) = 2s - 21. Let a be o(15). Let h = 58 - a. Calculate the greatest common factor of 7 and h. 7 Let u be 2/(-4)(8 - 2). Let a = 5 + u. Calculate the greatest common factor of 22 and a. 2 Let c(t) = 26 - t - 9 + 8t - 2t. Let w be c(5). What is the highest common divisor of w and 28? 14 Suppose -108 = -0h - 2h. Let b be 3/(3 - h/20). Calculate the highest common factor of b and 80. 10 Let b(z) = -z + 72 - 2z + 4z - z2 - z3. Let q be b(0). Calculate the greatest common factor of 8 and q. 8 Let j(p) = -p3 - p2 + 2p + 3. Let c be j(-4). Suppose t - 4 + 5 = 0. Let v be c + (5 - 2) + t. Calculate the highest common divisor of 9 and v. 9 Let n(w) = 48w + 6. Let u be n(4). Calculate the greatest common factor of 18 and u. 18 Let d = 115 + -35. What is the greatest common divisor of 20 and d? 20 Let p(c) = c*2 - 10c - 47. Let q be p(19). Calculate the greatest common factor of q and 31. 31 Suppose 0 = 2t + 2m - 2, -5t + 4 = -3m - 9. Let h(y) = ty - 3y + 10y + 2y*2 + 7. Let p be h(-7). What is the highest common factor of 21 and p? 21 Let u be 8/(-20) - 27/(-5). Suppose -u - 7 = -3m, 4v + 2m - 372 = 0. Let k = v - 49. What is the highest common divisor of k and 14? 14 Let f be 20/6(5 - -13). Let u(y) = y2 + y. Let k be u(3). Calculate the highest common divisor of f and k. 12 Suppose 8c - 3c = 520. Calculate the greatest common factor of 39 and c. 13 Suppose 0v = v. Suppose k + vt = 2t - 4, -5k - 2t + 4 = 0. Suppose -j + 10 = -kj. What is the highest common factor of j and 20? 10 Let m(f) = 4f - 26. Let u be m(10). What is the highest common divisor of 112 and u? 14 Let r = 263 - 144. What is the highest common factor of 17 and r? 17 Suppose 22 = -4w + 6w. Let y = 7 - w. Let m = 9 + y. Calculate the highest common factor of m and 55. 5 Let t be 9 - 10 - (-1 - 0). Suppose t = -5w + 83 + 117. Calculate the greatest common factor of 10 and w. 10 Let y(r) = 12r*2 + 4r + 6. Let h be y(-4). Let c = -110 + h. Calculate the highest common factor of 8 and c. 8 Let q = -291 + 651. Calculate the highest common factor of q and 45. 45 Let j(u) = 177u3 - 3u*2 + 4u - 2. Let r be j(1). Calculate the highest common factor of r and 16. 16 Suppose 2k + 2k = 12. Let m be -1k-301. Let o(r) = r + 36. Let y be o(0). What is the greatest common divisor of m and y? 18 Suppose -3h - k = -17, 5h - 5k + 1 = -4. Suppose -i = hi - 30. Calculate the highest common factor of i and 6. 6 Let r(u) = -6u*3 - 2u*2 - 2u - 1. Let o be r(-1). Suppose -4f + 34 = oc - 7, 2f - 15 = 3c. Calculate the greatest common divisor of 99 and f. 9 Let v(z) = -2z3 - 5z*2 - 4z - 3. Let y(i) = i*3 + 4i*2 - 4i + 2. Let d be y(-5). Let x be v(d). Calculate the greatest common factor of x and 45. 9 Suppose -41 = q - 2k, q + k + k = -45. Let b = q + 21. Let s = -7 - b. What is the greatest common divisor of s and 3? 3 Let w be (1 + -4)/((-6)/28). Suppose 3q - 102 = -3i, -q + 145 = 3q - 5i. Calculate the greatest common factor of w and q. 7 Let j be ((-33)/(-3) - 5)/2. Calculate the highest common factor of 3 and j. 3 Let g(r) be the first derivative of 13/3r*3 + 0r*2 + r + 2. Let p be g(1). What is the greatest common divisor of 21 and p? 7 Let z be 1/(-6) + (-323)/6. Let y be 4/10 - z/15. Suppose -4r + 2u = -2u - 184, 0 = 5r + 2u - 216. What is the greatest common factor of y and r? 4 Suppose 3y - o = 237, -5y + 3o = 8o - 415. Let u = 26 + -16. Calculate the highest common divisor of y and u. 10 Let a be -6(-3 + 2) + 2. Calculate the highest common divisor of 12 and a. 4 Let v = 4 + -2. Suppose -144 = -6i + vi. Calculate the highest common divisor of 4 and i. 4 Let r be ((-3)/6)/(4/(-24)). Let x be 24/r - (3 - 2). Calculate the greatest common factor of 63 and x. 7 Let b(t) = 5t + 12. Let x be b(12). Calculate the highest common divisor of 8 and x. 8 Let g be (-21)/(-1(0 - -1)). Let b(r) = 3r - 7. Let c be b(7). What is the greatest common divisor of g and c? 7 Let b(h) = 2 + 0h - 3 - 6 + 2h. Let p be b(5). Suppose -280 = -pi - 4j, j = 2i - 3j - 160. Calculate the highest common factor of 11 and i. 11 Let j = 66 - 42. Let g(x) = 2x - 8. Let c = -18 - -25. Let q be g(c). What is the greatest common divisor of q and j? 6 Suppose -5z - 45 + 120 = 0. Let s = -1 + 8. Let k be 2526/21 + (-2)/s. Calculate the greatest common divisor of z and k. 15 Let v(f) = -10f. Let s = -3 + 2. Let g be v(s). Let r be (45/12)/(3/24). Calculate the highest common factor of g and r. 10 Let n(o) = -o + 7. Suppose -34 = -5b - 9. Let t be n(b). Suppose 5 = 7x - tx. Calculate the greatest common divisor of x and 1. 1 Let k = -16 - -166. What is the highest common divisor of k and 50? 50 Let w be 222/4 + -4 + 4/8. What is the highest common divisor of w and 130? 26 Suppose -75 = -0u - 5u. Let d be 0/(-4 - -2) + u. Let g = 23 - d. What is the highest common factor of g and 32? 8 Let w = -80 - -85. What is the greatest common factor of 20 and w? 5 Suppose 6f - 285 = 135. Calculate the highest common factor of 14 and f. 14 Let d = -38 + 68. Calculate the highest common divisor of d and 12. 6 Let c(y) = 4y. Let h be c(5). Let z = -7 - -8. Let k be 20/((0 - -1) + z). Calculate the greatest common factor of k and h. 10 Let r be ((-63)/(-12))/((-5)/(-20)). What is the greatest common factor of 14 and r? 7 Suppose -6d - 80 = -8d. Calculate the greatest common factor of d and 16. 8 Suppose 3i + 2d - 27 + 1 = 0, 5d - 44 = -4i. Let x = 0 - -3. What is the highest common factor of i and x? 3 Let s = 19 + -19. Suppose sh = h - 4. Let c = 45 - 17. What is the highest common factor of c and h? 4 Suppose 47 = 4r - 25. Let v(w) = w3 - w2 + w + 45. Let n be v(0). What is the highest common divisor of r and n? 9 Let h = 395 - 275. Calculate the highest common divisor of 30 and h. 30 Suppose 5a + 3x - 355 = 8x, 3a - 220 = -4x. What is the highest common divisor of 48 and a? 24 Suppose -y + 4p = -0y - 101, 5y = 4p + 585. Calculate the greatest common divisor of y and 11. 11 Let d(s) = s2 - 1. Let i be d(3). What is the greatest common divisor of 1 and i? 1 Let r(p) = p2 + 5p + 7. Suppose -3o = -8o - 60. Let v be (4/8)/(1/o).	{ "pile_set_name": "DM Mathematics" }
5 - 11p4/3 + p3 + 9p2 - 4p/3 - 4 = 0. Calculate p. -3, -2, -2/3, 1 Let 20l4 - 42l*3 - 20l*2 = 0. Calculate l. -2/5, 0, 5/2 Determine p, given that 34p*5/7 + 20p*4 + 152p*3/7 + 16p*2/7 = 0. -2, -2/17, 0 Let 2l*5/11 - 2l*4 + 84l*3/11 - 140l*2/11 + 106l/11 - 30/11 = 0. Calculate l. 1, 3, 5 Find h such that 2h2/15 + 176h/3 = 0. -440, 0 Find a, given that -2a5 - 258a*4 + 530a*3 + 778a*2 - 1056a - 1048 = 0. -131, -1, 2 Find y such that -5y4 - 290y*3 - 280y*2 + 290y + 285 = 0. -57, -1, 1 Factor -2b5 - 4b*4 + 6b*3. -2b*3(b - 1)(b + 3) Determine c, given that 6c*5 - 49c*4 + 371c*3/3 - 121c*2 + 139c/3 - 6 = 0. 1/3, 1, 2, 9/2 Factor -3t4 - 33t*3 - 24t*2 + 60t. -3t(t - 1)(t + 2)(t + 10) Factor 38b2/13 + 602b/13 - 96/13. 2(b + 16)(19b - 3)/13 What is s in -s5 + 5s*4 + 17s*3 - 21s2 = 0? -3, 0, 1, 7 Factor -u2/2 + 663u + 1327/2. -(u - 1327)(u + 1)/2 Factor -9g3 - 57g*2 - 18g. -3g(g + 6)(3g + 1) Factor -2x2 - 64x. -2x(x + 32) Solve -8w4/5 + 254w*3/5 - 1704w*2/5 - 5066w/5 - 1156/5 = 0 for w. -2, -1/4, 17 Find r such that r*3/3 - 5r*2/3 - 22r/3 + 56/3 = 0. -4, 2, 7 Solve 5r3/2 + 58r*2 - 97r/2 - 12 = 0. -24, -1/5, 1 Factor 4h3/7 + 16536h*2/7 + 33060h/7 + 16528/7. 4(h + 1)2(h + 4132)/7 Factor 3j3/4 + 15j*2 + 111j/4 + 27/2. 3(j + 1)2(j + 18)/4 Determine t so that -2t5/9 - 6t*4 - 62t*3 - 2690t*2/9 - 1904t/3 - 392 = 0. -7, -6, -1 Factor -2d2/3 + 14d - 136/3. -2(d - 17)(d - 4)/3 Suppose 2n3/13 + 46n*2/13 + 192n/13 + 216/13 = 0. What is n? -18, -3, -2 Suppose -3l2/2 - 279l/2 - 405 = 0. What is l? -90, -3 Find z, given that 5z4 - 90z*3 - 995z*2 + 2100z + 22500 = 0. -6, 5, 25 Factor -28o3 - 180o*2 + 376o + 192. -4(o - 2)(o + 8)(7o + 3) Suppose 2z4 - 34z*2 + 72z - 40 = 0. Calculate z. -5, 1, 2 Factor -3l2/2 + 81l/2. -3l(l - 27)/2 Factor -l*4 - 12l*3 + 243l*2 + 518l + 264. -(l - 12)(l + 1)2(l + 22) Find f, given that -2f3/19 + 30f*2/19 - 132f/19 + 160/19 = 0. 2, 5, 8 Solve 5p2 - 5530p - 5535 = 0 for p. -1, 1107 Suppose -2r3 - 10r*2 - 14r - 6 = 0. Calculate r. -3, -1 Let 4l5 - 24l*4 + 4l*3 + 96l*2 - 80l = 0. What is l? -2, 0, 1, 2, 5 What is l in -14l3 - 220l*2 - 832l + 256 = 0? -8, 2/7 Determine k, given that 3k3 - 33k*2 - 3k + 33 = 0. -1, 1, 11 What is m in -21m2 - 132m - 36 = 0? -6, -2/7 Solve l5/4 + l4/4 - 3l3/4 - l2/4 + l/2 = 0 for l. -2, -1, 0, 1 What is q in 2q*5/11 - 32q*4/11 + 144q*3/11 - 108q*2/11 - 54q + 972/11 = 0? -2, 3, 9 Factor 2m4/13 + 1112m*3/13 + 152320m*2/13 - 627200m/13. 2m(m - 4)(m + 280)2/13 Factor 4y*2 + 20y - 24. 4(y - 1)(y + 6) Determine z so that -4z2 - 1128z - 79524 = 0. -141 Factor -32v5 - 132v*4 + 1656v*3 - 2916v*2. -4v*2(v - 3)*2(8v + 81) Let 6v*4 - 34v*3 - 108v*2 - 32v = 0. Calculate v. -2, -1/3, 0, 8 Let -x*3/8 + 393x*2/8 - 4851x + 4802 = 0. What is x? 1, 196 Let d*4 - 13d*3 - 3d*2 + 41d - 26 = 0. Calculate d. -2, 1, 13 Suppose -g*2/10 + 311g/10 - 31 = 0. Calculate g. 1, 310 Factor q*5 + 4q*4 + 6q*3 + 4q*2 + q. q(q + 1)*4 Determine r so that -4r*4 + 28r*3 + 156r*2 + 212r + 88 = 0. -2, -1, 11 Factor 75l3 - 144l*2 - 12l. 3l(l - 2)(25l + 2) Factor 2h2/3 - 176h/3 + 344/3. 2(h - 86)(h - 2)/3 Let 3f2/2 - 3f + 3/2 = 0. What is f? 1 Factor 3h2 - 75h + 342. 3(h - 19)(h - 6) Find f, given that f*3 + 11f*2 - 4f - 224 = 0. -8, -7, 4 Solve -t*2/8 - 19t/8 + 105 = 0. -40, 21 What is u in -u*3/9 - 275u*2/9 + 92u/3 = 0? -276, 0, 1 Factor -5n3 + 15n*2 + 45n + 25. -5(n - 5)(n + 1)*2 Factor -4c*2 - 328c - 2880. -4(c + 10)(c + 72) Determine q so that 4q2 - 340q - 1056 = 0. -3, 88 Factor -5i2 + 177i - 70. -(i - 35)(5i - 2) Suppose -22a2/9 + 526a/9 - 56 = 0. What is a? 1, 252/11 Solve -3b4 - 30b*3 - 39b*2 + 180b - 108 = 0. -6, 1 Find p such that 11p5/5 - 483p*4/5 + 868p*3/5 + 612p*2/5 - 1008p/5 = 0. -12/11, 0, 1, 2, 42 Find k such that k5/3 - k4/3 - 18k3 + 268k*2/3 - 472k/3 + 96 = 0. -9, 2, 4 Factor -7x2/8 + 31x/4 - 6. -(x - 8)(7x - 6)/8 Suppose -3u2/7 - 24u/7 - 48/7 = 0. Calculate u. -4 Determine a so that 5a4 + 113a*3/3 + 182a*2/3 - 128a/3 - 32/3 = 0. -4, -1/5, 2/3 Factor 4w4 + 44w*3 + 8w*2 - 368w - 480. 4(w - 3)(w + 2)*2(w + 10) Find d, given that 15d3 + 141d*2 - 90d = 0. -10, 0, 3/5 Suppose -y5/8 + y3/2 - y*2/4 - 3y/8 + 1/4 = 0. Calculate y. -2, -1, 1 Factor 4d4 + 17d*3 + 4d2. d2(d + 4)(4d + 1) Find i such that -4i*4/3 - 16i*3/3 + 4i*2/3 + 16i/3 = 0. -4, -1, 0, 1 Suppose -6f2 + 57f/2 + 15/2 = 0. Calculate f. -1/4, 5 Let -5v5/2 + 5v*4/2 + 45v*3/2 - 65v*2/2 - 20v + 30 = 0. Calculate v. -3, -1, 1, 2 Find g, given that -g*3 + 2g*2 + 55g - 200 = 0. -8, 5 Factor -3h3/8 + 75h/2. -3h(h - 10)(h + 10)/8 Find s such that -s4 + 8s*3 + 49s*2 - 188s + 132 = 0. -6, 1, 2, 11 Solve 5p3 + 250p*2 + 1885p + 1640 = 0. -41, -8, -1 Suppose -b*4 - 11b*3 - 18b*2 + 56b + 64 = 0. Calculate b. -8, -4, -1, 2 Determine n, given that -5n5 - 10n*4 + 60n*3 + 90n*2 - 135n = 0. -3, 0, 1, 3 Suppose 39d2/7 - 7806d/7 + 1200/7 = 0. What is d? 2/13, 200 Suppose -2f5/5 - 42f*4/5 - 112f*3/5 + 472f*2/5 + 192f - 2176/5 = 0. Calculate f. -17, -4, 2 Suppose -9o4/5 - 13o*3/5 + 41o*2/5 - 7o/5 - 12/5 = 0. What is o? -3, -4/9, 1 What is d in 2d4/7 + 18d*3/7 - 30d*2/7 - 106d/7 - 60/7 = 0? -10, -1, 3 Factor 2l3 + 10l*2 + 14l + 6. 2(l + 1)2(l + 3) What is w in -2w4 - 1692w*3 - 359544w*2 - 712336w = 0? -422, -2, 0 Let -b*4 - 56b*3 + 305b*2 = 0. Calculate b. -61, 0, 5 Factor -3t*2/4 + 1013t/4 - 337/2. -(t - 337)(3t - 2)/4 Find y such that 2y3 + 1156y*2 + 167042y = 0. -289, 0 Factor -l*4/6 - 7l*3/3 - 16l*2/3 + 64l/3. -l(l - 2)(l + 8)2/6 Let l4/4 + 167l3/2 + 663l*2/4 - 167l/2 - 166 = 0. Calculate l. -332, -2, -1, 1 Suppose 6f3/5 - 42f*2/5 - 84f - 624/5 = 0. What is f? -4, -2, 13 Determine k, given that -2k3 + 5702k*2 - 4066950k + 4061250 = 0. 1, 1425 Let 3z3 + 279z*2 - 570z = 0. Calculate z. -95, 0, 2 Determine x so that -2x4 - 1476x*3 - 270842x*2 + 546120x - 273800 = 0. -370, 1 Factor 2p2/11 + 18p/11 - 104/11. 2(p - 4)(p + 13)/11 What is r in -r*2/3 + 13r/3 + 10 = 0? -2, 15 Let b*4 - 24b*3 + 184b*2 - 480b + 400 = 0. What is b? 2, 10 Find d such that d*2/4 + 205d - 821/4 = 0. -821, 1 What is u in -675u3 - 2880u*2 - 732u - 48 = 0? -4, -2/15 Solve -2a3/7 - 24a*2 + 18a/7 + 216 = 0 for a. -84, -3, 3 Factor -5z2 - 66720z - 222577920. -5(z + 6672)2 Determine a, given that a4 - 7a*3/3 + 5a*2/3 - a/3 = 0. 0, 1/3, 1 Solve 3b*2 - 3b - 6 = 0. -1, 2 Let -4g3/3 + 520g*2/3 - 1028g/3 + 512/3 = 0. Calculate g. 1, 128 Solve 8m2 + 2244m - 1124 = 0. -281, 1/2 Find q, given that 20q3 - 245q*2 - 500q + 140 = 0. -2, 1/4, 14 Suppose 2w3/13 - 16w*2/13 - 8w/13 + 64/13 = 0. What is w? -2, 2, 8 Let 2a4/3 - 16a*3/3 + 22a*2/3 + 64a/3 - 40 = 0. Calculate a. -2, 2, 3, 5 Find k, given that 5k3 - 5k*2 - 1530k = 0. -17, 0, 18 What is z in -z*2 + 102z - 200 = 0? 2, 100 Determine q so that 2q4/9 + 184q*3/9 - 1586q*2/9 + 1400q/9 = 0. -100, 0, 1, 7 Solve 4n5 + 48n*4 - 256n*3 + 64n*2 + 960n - 1024 = 0. -16, -2, 2 Solve -2x3 - 60x*2 - 208x = 0. -26, -4, 0 Let -2r5/11 - 3150r*4/11 - 1238734r*3/11 + 1245038r*2/11 + 1238736r/11 - 1241888/11 = 0. What is r? -788, -1, 1 Factor 2x3/5 - 44x*2 + 6264x/5 - 11664/5. 2(x - 54)2(x - 2)/5 Determine j so that j*2/4 - 57j/4 + 14 = 0. 1, 56 Factor -4l2/3 - 116l/3 - 72. -4(l + 2)(l + 27)/3 Factor -2o2/3 + 14o/3 + 20. -2(o - 10)(o + 3)/3 Find c, given that 4c2 + 204c + 2376 = 0. -33, -18 Find t such that -2t4 + 282t*3 + 2670t*2 + 4486t + 2100 = 0. -7, -1, 150 Factor -4k3 + 8k*2. -4k*2(k - 2) Solve -o*2/5 - o + 14/5 = 0 for o. -7, 2 Let 436o*3 - 40o**2 = 0. Calculate o. 0, 10/109 Find j, given t	{ "pile_set_name": "DM Mathematics" }
Let p be (1 + -2)-5 + (-178)/(-89). What is the highest common divisor of p and w? 7 Let c(g) = g2 - 7g - 11. Let p = 21 - 12. Let z be c(p). Calculate the highest common divisor of 1 and z. 1 Let p(o) = o*3 + 6o*2 + 6o. Let m be (-6)/(-18) - (-39)/(-9). Let z be p(m). Calculate the greatest common divisor of 104 and z. 8 Let d be (1/3)/((-33540)/(-3726) + -9). What is the greatest common divisor of d and 299? 23 Suppose a + 1225 = 2w, 33a = 2w + 38a - 1255. What is the highest common factor of 45 and w? 15 Suppose -100o + 86o + 7714 = 0. What is the greatest common factor of 19 and o? 19 Let h be 1 + 18 + -1 + -2. Let r(g) = g*3 + 9g*2 - 21g + 27. Let o be r(-11). Calculate the greatest common divisor of h and o. 16 Let a be (-2640)/(-2 + 11/22). Calculate the highest common divisor of a and 11. 11 Let q = 15 - 14. Let f be 118/2 + 0 + q. Let h = 75 + -51. Calculate the greatest common factor of f and h. 12 Suppose 2s + 4d = 180, 3d = 2s - 5s + 261. Let c be 1(s + 6/(-2)). Calculate the highest common divisor of 9 and c. 9 Let n(k) = -k + 5. Let t be n(4). Let z be (-57)/(-12) + t/4. Calculate the greatest common divisor of z and 35. 5 Suppose 0 = 4h + 3k - 255, 4k + 140 = 5h - 140. Suppose -2w = -795 - 705. Suppose -w = 4z - 9z. Calculate the greatest common divisor of z and h. 30 Suppose -112 = 6r + r. Let a be (-90)/(-3)(2 + r/12). What is the greatest common divisor of a and 60? 20 Let u = -513 + 599. What is the highest common divisor of 1376 and u? 86 Let k = 222 - 30. What is the highest common divisor of 16 and k? 16 Let k = 660 - 642. What is the greatest common factor of k and 306? 18 Let x = 59 + -36. Let d(h) = 7h*2 + 17h + 25. Let r be d(-5). Calculate the highest common factor of x and r. 23 Let v(r) = 2r2 + r - 4. Let b be v(-3). Let t = -70 + 81. What is the highest common factor of b and t? 11 Let t(n) = n3 - 16n*2 + 14n + 17. Let j be t(15). Let d be (91/(-78))/(j/(-12)). Suppose -m - 189 = -4m. What is the highest common factor of d and m? 7 Let v be (-2)/1(-493)/34. Suppose 6t = -v + 113. Calculate the greatest common divisor of 14 and t. 14 Let s be 31912/204 + 6/(-51). What is the highest common factor of s and 140? 28 Suppose -5h - s = -318 - 1073, h = 5s + 273. Suppose -4x + 42 = -h. Calculate the greatest common factor of 10 and x. 10 Let o(r) = 2r*3 - 8r*2 - 30r + 31. Let z be o(10). Calculate the highest common factor of z and 98. 49 Let d = 5 - -3. Suppose -4u - 5h - 24 = -98, -3h = 2u - 38. What is the greatest common divisor of u and d? 8 Let l = 2397 - 2392. Suppose 3j - 11 = w, 0j = -5j - 4w + 41. What is the highest common divisor of l and j? 5 Let f = -10 + 12. Let s be (-3)/(-2)f - 10. Let z be (s + 22)(-96)/(-10). What is the greatest common factor of z and 18? 18 Let x be 21/(-4)1672/(-57). Calculate the highest common divisor of x and 98. 14 Let m(s) = -s3 - 14s*2 + 17s + 51. Let d be m(-15). Calculate the greatest common factor of d and 63. 21 Let u = 26 + -21. Suppose -um = -4m - 32. Calculate the greatest common divisor of m and 4. 4 Suppose -10v = -13v + 30. Let c(w) = -w*3 + 9w*2 + 12w - 3. Let d be c(v). Let o = -86 + 273. What is the highest common factor of d and o? 17 Let l be (-1897)/(-49) + (-2)/(-7). Let g be (l/(-6)2)/(-1). Calculate the greatest common factor of 52 and g. 13 Suppose -2q = -3w + 67, 4q = -0w + w - 19. Suppose -507 = 2v - 5v. Let m = v + -8. Calculate the highest common divisor of m and w. 23 Suppose 5q - 17 = 23. Let j = q + -3. Let w be 5/j(-20)/(-2). Calculate the highest common divisor of w and 30. 10 Let m be (-4411)/(-143) - 2/(-13). Suppose -9k + 660 = -177. What is the greatest common divisor of k and m? 31 Let m be (1071/105)/(((-9)/(-10))/3). Calculate the highest common factor of 68 and m. 34 Let b be 24/(-108) + (-209)/(-9). Let w be (-4)/(-18) + (-238)/18. Let t = w + b. Calculate the highest common factor of t and 110. 10 Let f = -13 + 52. Suppose 4o - 376 = -5q + 2q, 3o - 285 = -3q. What is the highest common factor of o and f? 13 Let a be (-5 - 8) + 5 - -327. What is the highest common divisor of 44 and a? 11 Suppose 20 = i + 5. Suppose 0 = -3n - 4k + i, -4k + 0k - 25 = -5n. Suppose 0r - 425 = -nr. What is the greatest common factor of 34 and r? 17 Let o = -8 - -21. Suppose 12n - 9n - 36 = -3r, 2n = -2. Calculate the greatest common divisor of r and o. 13 Suppose 745 = 5c + 5w, -2w - 1 = 5. Let b be c + -11 + (2 - 0) + 1. Calculate the greatest common factor of b and 6. 6 Suppose -9v + 1380 - 327 = 0. Calculate the greatest common factor of v and 18. 9 Suppose 3z + 3l - 9 = 0, -3z = z + l - 27. Let r be 785/z - 8/64. Calculate the highest common factor of r and 14. 14 Suppose -3g - 2a + 16 = -0a, 12 = -3a. Suppose -4m - 72 = 6d - gd, 25 = -5m. Calculate the highest common divisor of 208 and d. 26 Let u be (1 - (-3)/(-6))-6. Let r be u3/((-9)/5). Suppose 4d - rf = 27, 4f + 10 = -2d + 30. Calculate the greatest common factor of d and 40. 8 Suppose 3w - 10 - 2 = 0. Suppose 92 = ws + 28. What is the highest common factor of 16 and s? 16 Suppose 3y - 2y - 4g - 336 = 0, 0 = -2y + 3g + 652. Calculate the greatest common divisor of y and 5. 5 Let w = 138 - 150. Let g be w/(-9)87/2. Calculate the highest common divisor of 406 and g. 58 Let m(i) = -i3 - 17i*2 - 18i - 16. Let s be m(-16). Let c = 16 - 8. What is the highest common factor of c and s? 8 Let f = 19 - 11. Suppose -10d + 8 = -fd. What is the greatest common divisor of 32 and d? 4 Let c = -75 - -180. Let i(v) = v*2 - 4v - 18. Let x be i(-6). Suppose 12t - 10t = x. Calculate the greatest common factor of t and c. 21 Suppose 14n - 64 - 664 = 0. Let d(r) = -7r - 1. Let o be d(-2). What is the greatest common divisor of o and n? 13 Suppose -3r = 2r + 35. Let g = r + 16. Suppose 0 = -4p + 3p + 72. What is the greatest common divisor of p and g? 9 Let n = 645 - 393. Let v be ((-4)/3)/(9/(-1458)6). Calculate the highest common divisor of n and v. 36 Let f(n) = 7n - 2. Let k be f(2). What is the greatest common factor of k and 6? 6 Let h = 8 + -19. Let i = -23 - h. Let j be 210/i(-8)/10. Calculate the greatest common divisor of j and 154. 14 Suppose g - 2x = 78, -12 = -g - 5x + 101. Calculate the highest common factor of g and 198. 22 Suppose 165 = -2k + 5k. Let i be ((-44)/(-3))/(96/144). What is the greatest common divisor of i and k? 11 Suppose 1029 = -3a + 288. Let i = 359 + a. Calculate the greatest common divisor of 14 and i. 14 Let x(l) = l*3 - 2l*2 - 3l - 2. Let z be x(3). Let f be (-11)/(-33) - z/(-6). Suppose fm = -2m + 176. Calculate the highest common divisor of 11 and m. 11 Let w be ((-84)/(-18))/((5/6)/(-5)). Let p = -24 - w. What is the greatest common divisor of p and 16? 4 Suppose 0 = 227w - 301w + 11100. Calculate the greatest common divisor of w and 90. 30 Suppose 2y - 3y + 2 = 0. Suppose -yk = -0k. Suppose k = 4w - 7w + 18. Calculate the greatest common factor of 2 and w. 2 Suppose 9o - 690 = 183. Let z = -53 + o. What is the highest common factor of 11 and z? 11 Let w = 616 + -434. Let p(z) = -115z. Let a be p(-1). Suppose 4q - 7r = -2r + 129, -5q - 3r + a = 0. What is the highest common divisor of w and q? 26 Let m be -18((-14)/3)/((-12)/(-9)). Calculate the greatest common factor of 9 and m. 9 Let i = 1414 - 1390. What is the highest common factor of 48 and i? 24 Let g = 1 - -18. Suppose 3t - g = 23. What is the greatest common factor of 154 and t? 14 Let b(c) be the second derivative of 19c*3/3 + 2c*2 - 5c. Let s be b(1). Calculate the greatest common factor of 28 and s. 14 Let i(o) = -o3 + o2 + 33o + 38. Let t be i(-5). What is the greatest common factor of t and 253? 23 Let l = 135 - 87. What is the highest common factor of l and 3? 3 Let l be 4/(-14) + 10272/(-112). Let h = -36 - l. Let w = h - 40. What is the highest common factor of w and 32? 16 Let p be (1 - -33) + 2/(-9)9. Suppose 5g = g + 1408. What is the greatest common divisor of p and g? 32 Let s = 86 - 46. Suppose -4v = -2k + 5k - 385, -2k = -5v + 510. What is the greatest common factor of v and s? 20 Let l be 0/(-3)*(-4 - -1)/(-6)	{ "pile_set_name": "DM Mathematics" }
- 12 = 3z. Let g be j(o). Is 5/5 + (g - 1) composite? False Is 5855(7/(-21))/(1/(-3)) prime? False Let f = -5079 - -8022. Suppose o + 2o - 4t = f, -3949 = -4o - 3t. Is o a prime number? False Let s = 10 + -8. Suppose 0 = -i - 4u + 515, 3i - 453 = su + 1148. Suppose 2r = -3b + r + i, 896 = 5b - 2r. Is b a prime number? False Let p(s) = -s3 + 10s*2 - 10s + 9. Let t be p(9). Suppose -12x + 9x = t. Suppose x = -5w - 3q + 4520, -4q + 36 + 3572 = 4w. Is w prime? True Let n(s) = 4s + 0s - 3s. Let i(a) = -2a*2 + 8a + 8. Let u(c) = -i(c) + n(c). Is u(11) a prime number? True Suppose -z + 1974 - 71 = 3l, 2z - 3806 = -2l. Is z prime? False Is (-1 + 3 + -1)172038/106 a prime number? False Let w be (-1)/(4 - 51/12). Suppose 2j + 3t = 531, 2t - w = -2t. Let z = j + -130. Is z a prime number? False Let x be 207/21 - 2 - (-1)/7. Suppose -10038 = 2q - xq. Is q a composite number? True Suppose 5d = u + 1684, -2u = -2d - u + 673. Is d a prime number? True Let t(b) = b3 + 19b + 17. Is t(8) prime? False Suppose -46d + 53d = 380905. Is d a composite number? True Suppose -7d + 12d - 1621 = 3b, 0 = 3d + 12. Let y be (2/(-4))/(2/1024). Let k = y - b. Is k composite? True Let h = -24 - -17. Is -890(h/2 + 3) a composite number? True Let p(z) = z3 - 8z*2 - z + 8. Let r be p(8). Suppose r = 3n - 6n + 885. Is n composite? True Suppose -f - 1058 - 13452 = -2k, 5k - 3f = 36275. Is k a prime number? False Let v = 17 + -12. Suppose -vf + 316 = 2j, 5j - 4f + f = 821. Suppose j = 4p - 5t, -343 + 118 = -5p + 2t. Is p a composite number? False Suppose 0 = -5w - 4b + 1129 + 4070, 2w - b - 2077 = 0. Is w a composite number? False Suppose -9 = 3b, -11j + 13j + 3b = 1133. Is j composite? False Let y(m) = -104m*2 + 7m + 15. Let j be y(6). Is 12/(-3) + j/(-1) a prime number? False Let n(m) = 477m2 + 2m + 344. Is n(-21) a prime number? True Let d(v) = -390v - 291v + 79v + 3. Is d(-4) prime? True Let t be ((-5)/(-2))/((-10)/(-20)). Suppose 2306 = -tx + 6501. Is x a composite number? False Let o(k) = 4k3 - 4k*2 - 11k - 5. Is o(6) prime? False Suppose 15v - 28 = 8v. Suppose vx = -0d + 5d + 7184, -1817 = -x - 4d. Is x a prime number? True Let b(t) = -2t3 + 7t*2 + 4t - 4. Let i be b(4). Is -7558(-3 + 3 + 2/i) a prime number? True Let r(c) = c + 17. Let f be r(-8). Is (-6)/f(-582)/4 prime? True Let p be 0 - ((-10)/(-3))/(4/(-30)). Suppose 3q = pq - 27566. Is q prime? False Let v(j) = 26j2 + j - 8. Suppose 9w = 7w - 14. Is v(w) a composite number? False Let f(a) = -5a - 9. Let l(b) = -b - 1. Let t(d) = f(d) - 4l(d). Let o be t(-5). Suppose 0 = -ow + 3w - 537. Is w prime? True Suppose k - 2f = 3k - 202, -3 = -f. Suppose 0 = 2i - 5t - k, -3i + 6t + 133 = 2t. Let w = 46 + i. Is w composite? True Suppose -2j - 5f - 14129 = -6j, 3f = j - 3534. Suppose -3i = -5g - 2585 - 946, 3i - 2g = j. Is i a prime number? False Let f = -6283 + 10744. Let c = 7556 - f. Is c composite? True Suppose 0 = -7t - 7t + 504. Suppose 34 + t = 7r. Is r a composite number? True Let j(s) = 284s*2 + 2s - 9. Is j(-2) composite? False Let m(t) = 1046t - 3. Is m(1) a composite number? True Let u be 119/9 + 6/(-27)1. Let p be 0/((-2)/(-1)) - -8. Let l = p + u. Is l prime? False Is ((-41)/(-123))/((-2)/(-112686)) composite? True Suppose -7c + 175294 + 12453 = 0. Is c composite? False Let v = 754 - 305. Is v a composite number? False Suppose 0 = 12o - 220 + 52. Let c = o + 0. Is c a prime number? False Is (70/(-350))/(1/(-64205)) a prime number? True Suppose -1701 = 9j + 15075. Let i = 3506 + j. Is i composite? True Is 6/9 - (26720/(-12))/2 composite? True Let x(g) = -g2 - 4g - 3. Let f be x(-3). Suppose -v - 1 + 7 = f. Is 865/15 - v/9 a composite number? True Is ((-4)/5 - -1) + 469872/90 prime? False Suppose -4l - 10 = 38. Let q be 6/7(l + 19). Let z = 25 - q. Is z prime? True Let t = -754 - -1327. Is t composite? True Let h(d) = 38d3 - 6d*2 + 5d - 1. Let z be h(4). Let c be (-9)/3 - z/(-5). Let n = -147 + c. Is n prime? False Suppose 77p = 81p - 5t - 2136, -1038 = -2p - 5t. Is p a prime number? False Let t(o) = 9o*2 - 7o - 7. Let c be t(6). Suppose -3w = 2h - c, -w + 668 = 7h - 2h. Is h a composite number? True Suppose -10668 = 2t - 3t - 5y, 0 = 3t + 5y - 31994. Is t a prime number? True Let p(w) = -w2 + 7w + 7. Let r(n) = 3n + 12. Let q be r(-5). Let s = q - -9. Is p(s) composite? False Let f = -3507 - -1405. Is f/(-8) + 15/60 composite? False Suppose -s - 8 = 4. Let l(x) = -353x + 13. Is l(s) prime? False Let q(b) = -b - 5. Let p be q(-8). Let t(n) = 4n3 + 3n*2 + n - 5. Is t(p) composite? True Suppose 4g - 9g - 5g = 0. Suppose -2h - 3h - 62 = -2s, 5s - 3h - 117 = g. Is s a composite number? True Let g = 65763 + -36542. Is g prime? True Is (-2)/4 + 59229/6 prime? True Is (23/(-8) - -3) + (-71991)/(-8) prime? True Let t be (27/36)/(2/(-8)). Let o be (-4)/t(-42 + -3). Let h = 191 - o. Is h prime? True Let b(o) = 7o3 - 3o*2 + 3o + 5. Suppose 4i - 12 - 4 = 0. Let h be (7 + -3)2 - i. Is b(h) a composite number? True Let d(n) = 308n2 - n. Let y be d(1). Is y/1 - 4/200 a composite number? False Let v(d) = -34d + 27. Is v(-19) prime? True Suppose 27q - 25q = 10, f + 4q = 1834. Is f a composite number? True Let g(y) = 16y3 - 2y*2 - 7y + 4. Suppose 0j = j - 15. Suppose -15u = -20u + j. Is g(u) a composite number? False Suppose -4w = -4u + w + 30, 42 = 4u + w. Suppose -3b + u = -5b, -2b + 1445 = 3h. Is h composite? True Let y = 30692 - -17085. Is y a composite number? False Is (-3 - -4) + -5 + (2 - -165) a composite number? False Let m(r) = r*3 + 6r*2 + 3r + 1. Let l be m(-3). Let y = l - -172. Is y prime? True Suppose 0 = -83j + 77j + 79770. Is j a prime number? False Let s be 77/33 + 1/(-3). Suppose -14 = -4h + sr - 96, 5h = r - 95. Let d = h - -101. Is d a prime number? True Suppose 18c - 38291 = 2839. Is c a composite number? True Suppose -5p - 5 = 0, 10 = m - 5p + 1. Let v(z) = 16z + 3. Let h be v(m). Suppose -h = -d + 24. Is d a composite number? True Let b be (13/26)/((-2)/(-12)). Is -2 + 1214 + b + -4 prime? False Let k(u) = -134u - 117. Is k(-5) a composite number? True Let z(c) = 184c - 127. Is z(29) a composite number? False Suppose 0 = -2r + 2s - 56, 3s = r + 39 - 3. Let l = -17 - r. Is l composite? False Suppose 2s - 10 = -3c, -5s - 4c + 0c = -32. Let a(j) = 2j - 3. Let z be a(s). Is (-2332)/(-6) + z/39 prime? True Let n(w) = -w*2 - 6w + 11. Let p be n(2). Suppose -5l - 4i + 570 = 0, i + 0i = 0. Let y = l + p. Is y a composite number? False Suppose 4u = 4q + 2164, 5u - 4q - 4005 + 1300 = 0. Is u a composite number? False Let t(q) = 42q*2 - 14q + 57. Is t(7) a composite number? False Suppose y = 4t - 1279, -72y + 15 = -77y. Is t a prime number? False Suppose 5d + 2c = 70149, -2d + 5440 = 4c - 22626. Is d prime? True Let i(o) = 3o*2 - 13o + 18. Let k be i(9). Let a = k + 118. Is a prime? False Suppose 3s - 6s = 0, 2w - 2988 = -s. Suppose 2n - 1506 = 2c, 0 = -2c + 4c + n + w. Let l = 1962 + c. Is l composite? False Is (-22)/231 - (-1909870)/42 composite? True Let z = 5008 + 8953. Is z composite? True Suppose 333 + 551 = 4j. Suppose 2b = 2335 - j. Is b prime? False Let k(l) be the second derivative of l5/20 - 2l*4/3 + 4l*2 + 9l. Is k(11) a composite number? True Let j(y) = -y*3 + 16y*2 - 2y + 4391. Is j(0) composite? False Suppose 4n = 5m - 2887, -2m - 3m + 3n = -2884. Suppose 3x - m = b, -4x + 3b = -2x - 388. Suppose 0 = -5y + 64 + x. Is y prime? False Let k(u) = 9u2 - 16u + 23. Let p be k(-13). Suppose 9a - p - 1677 = 0. Is a a prime number? False Suppose 3d - 4v = 17, -5v = 4d - v - 4. Suppose -dq + 1290 = -q - 4b, 1929 = 3q - 3b. Is q prime? True Suppose -2l - 4 = -3l - 3n, n = l. Let u(f) = 184f2 - 3f - l + 0f + 2f - f. Is u(-1) a prime number? False Let r = 41 + -40. Is r1(152 + -3) a prime number? True Let v(j) = 14 - 5j - j + 3j - 27 + 3j2. Is v(-5) a prime number? False Suppose s = -4b + 19, -3 + 9 = b - s. Suppose 0 = 2h - bz - 497, -135 = 5h - z - 1389. Suppose 3o - 5t + 4 = h, -o = -3t	{ "pile_set_name": "DM Mathematics" }
t replacement from {b: 1, o: 1, s: 1}. What is prob of picking 1 b and 1 o? 1/3 Three letters picked without replacement from {o: 2, e: 1, z: 1, s: 2, u: 1}. What is prob of picking 2 o and 1 s? 2/35 Three letters picked without replacement from {q: 1, h: 1, k: 2, g: 5}. Give prob of picking 1 g, 1 k, and 1 h. 5/42 Calculate prob of picking 2 i, 1 n, and 1 p when four letters picked without replacement from iponbboibbpibpbieo. 1/170 Two letters picked without replacement from etsyqtm. What is prob of picking 1 q and 1 y? 1/21 What is prob of picking 2 u when two letters picked without replacement from {v: 2, u: 4, a: 6}? 1/11 What is prob of picking 1 i and 1 f when two letters picked without replacement from igzzif? 2/15 What is prob of picking 2 a and 2 u when four letters picked without replacement from {u: 2, i: 5, a: 3}? 1/70 Three letters picked without replacement from pptppptpttp. Give prob of picking 3 p. 7/33 What is prob of picking 2 e and 1 h when three letters picked without replacement from {h: 3, e: 7}? 21/40 What is prob of picking 2 h and 1 p when three letters picked without replacement from pghhgghg? 3/56 Three letters picked without replacement from zzxfdzvdvzd. Give prob of picking 1 d, 1 z, and 1 v. 8/55 Three letters picked without replacement from {u: 3, f: 9}. Give prob of picking 2 f and 1 u. 27/55 Calculate prob of picking 1 y and 1 o when two letters picked without replacement from soyywoooosyos. 3/13 What is prob of picking 1 q, 1 b, and 1 u when three letters picked without replacement from {q: 2, u: 13, b: 3}? 13/136 Two letters picked without replacement from rhdrzzv. What is prob of picking 1 v and 1 d? 1/21 Calculate prob of picking 2 v when two letters picked without replacement from bbbvbbbvbbvbbbbbvb. 2/51 Calculate prob of picking 2 k when two letters picked without replacement from {k: 4, x: 10}. 6/91 Calculate prob of picking 3 m when three letters picked without replacement from jmmjoummu. 1/21 Two letters picked without replacement from {h: 1, q: 4, t: 4, r: 3, u: 1, f: 2}. Give prob of picking 1 t and 1 h. 4/105 Four letters picked without replacement from {g: 2, q: 3, b: 4, l: 1, y: 3, k: 3}. Give prob of picking 1 l, 1 k, 1 b, and 1 q. 9/455 Two letters picked without replacement from pzpjjzpj. Give prob of picking 2 p. 3/28 Two letters picked without replacement from {q: 17, f: 3}. What is prob of picking 2 q? 68/95 Two letters picked without replacement from ntltkn. Give prob of picking 1 l and 1 n. 2/15 What is prob of picking 1 f and 1 e when two letters picked without replacement from {e: 1, o: 1, c: 1, r: 1, f: 1, b: 2}? 1/21 Calculate prob of picking 1 e and 1 m when two letters picked without replacement from {i: 3, m: 4, e: 1, v: 1, b: 7}. 1/30 Two letters picked without replacement from {y: 1, k: 11}. What is prob of picking 1 k and 1 y? 1/6 Two letters picked without replacement from {a: 1, t: 1, j: 1, n: 1, b: 5}. Give prob of picking 1 b and 1 t. 5/36 Three letters picked without replacement from wwwccjwnzwonccj. Give prob of picking 2 w and 1 j. 4/91 Two letters picked without replacement from {o: 1, f: 2, b: 1}. What is prob of picking 1 o and 1 f? 1/3 Calculate prob of picking 1 m, 1 a, and 1 u when three letters picked without replacement from mmazzu. 1/10 Two letters picked without replacement from {z: 1, v: 3, c: 7, a: 7, y: 1}. Give prob of picking 1 c and 1 a. 49/171 Three letters picked without replacement from iinnhihahaini. Give prob of picking 1 i and 2 n. 15/286 Two letters picked without replacement from vkvvk. What is prob of picking 2 k? 1/10 Three letters picked without replacement from {o: 3, x: 1, f: 2, g: 1}. Give prob of picking 1 x, 1 g, and 1 o. 3/35 Calculate prob of picking 1 w and 1 n when two letters picked without replacement from {n: 2, w: 6, h: 2, g: 10}. 6/95 What is prob of picking 2 q and 2 f when four letters picked without replacement from {j: 1, f: 2, q: 2, n: 1}? 1/15 Two letters picked without replacement from wmqmwuqko. Give prob of picking 1 o and 1 q. 1/18 What is prob of picking 2 t when two letters picked without replacement from {g: 9, t: 3, b: 4}? 1/40 Three letters picked without replacement from {n: 3, t: 3}. Give prob of picking 2 t and 1 n. 9/20 What is prob of picking 2 v when two letters picked without replacement from {t: 5, v: 8}? 14/39 Three letters picked without replacement from cccfcwfccypffccy. Give prob of picking 2 f and 1 w. 3/280 Calculate prob of picking 2 r when two letters picked without replacement from {r: 7, e: 3}. 7/15 Two letters picked without replacement from {q: 5, i: 5, x: 1, c: 1, f: 4, n: 1}. What is prob of picking 2 q? 5/68 Calculate prob of picking 1 p and 1 u when two letters picked without replacement from xxupm. 1/10 What is prob of picking 1 y and 1 m when two letters picked without replacement from {m: 6, y: 2}? 3/7 What is prob of picking 2 y, 1 b, and 1 f when four letters picked without replacement from frzlyylzbfzzrllrflzr? 1/1615 What is prob of picking 1 i and 1 r when two letters picked without replacement from {g: 2, r: 1, o: 2, b: 1, i: 1}? 1/21 Calculate prob of picking 1 b and 2 h when three letters picked without replacement from bhbbbhbbbbbbbbbbhh. 7/68 Three letters picked without replacement from {f: 4, a: 6, r: 2}. Give prob of picking 1 a and 2 r. 3/110 What is prob of picking 3 s when three letters picked without replacement from {o: 2, m: 4, w: 4, s: 5}? 2/91 Three letters picked without replacement from lllzlqlllll. What is prob of picking 1 q and 2 l? 12/55 Four letters picked without replacement from {p: 4, j: 6, k: 4, a: 1, e: 1, h: 3}. Give prob of picking 2 k, 1 h, and 1 a. 3/646 Two letters picked without replacement from {q: 5, g: 8, b: 5}. What is prob of picking 1 q and 1 b? 25/153 Two letters picked without replacement from {m: 7, j: 2}. What is prob of picking 2 j? 1/36 Three letters picked without replacement from {k: 3, b: 1, d: 3, i: 3}. Give prob of picking 2 k and 1 i. 3/40 Two letters picked without replacement from jjeujjejyjyjeujjjyj. What is prob of picking 2 j? 55/171 Four letters picked without replacement from warrraa. What is prob of picking 3 r and 1 w? 1/35 Four letters picked without replacement from glgggggglggglggggglg. Give prob of picking 1 l and 3 g. 448/969 Two letters picked without replacement from zmmhwhwmmemmcwwwc. What is prob of picking 1 e and 1 z? 1/136 What is prob of picking 1 a and 1 o when two letters picked without replacement from {i: 2, a: 7, e: 1, o: 10}? 7/19 Calculate prob of picking 4 y when four letters picked without replacement from yiymiyyiyymyyi. 10/143 Three letters picked without replacement from {o: 2, u: 3, x: 12}. What is prob of picking 3 x? 11/34 Three letters picked without replacement from zzfwzzmwzmwzdmfznw. What is prob of picking 1 w and 2 f? 1/204 Four letters picked without replacement from {l: 1, c: 3, y: 5, i: 2, f: 5}. What is prob of picking 1 y, 2 c, and 1 f? 15/364 Four letters picked without replacement from gjtjjjfmjt. Give prob of picking 1 g, 2 j, and 1 t. 2/21 Calculate prob of picking 1 b and 1 c when two letters picked without replacement from mccbbbbcbc. 4/9 What is prob of picking 1 e and 1 n when two letters picked without replacement from nmkxvevevvmnmee? 8/105 Three letters picked without replacement from uwqqwppppspuwpq. What is prob of picking 2 q and 1 w? 9/455 Calculate prob of picking 3 n when three letters picked without replacement from nnnnmnm. 2/7 Three letters picked without replacement from {j: 9, i: 10}. Give prob of picking 2 i and 1 j. 135/323 Calculate prob of picking 1 k and 3 n when four letters picked without replacement from knnaaannaanaanaana. 7/612 Two letters picked without replacement from fshs. What is prob of picking 2 s? 1/6 Two letters picked without replacement from {t: 1, r: 1, p: 2, u: 2, s: 7, n: 2}. What is prob of picking 1 p and 1 r? 2/105 Two letters picked without replacement from tvtdttddttddtttv. What is prob of picking 1 d and 1 v? 1/12 Calculate prob of picking 1 k, 2 s, and 1 d when four letters picked without replacement from ssssddddkjsss. 84/715 Two letters picked without replacement from iiiisfidifisissi. What is prob of picking 1 s and 1 i? 3/10 F	{ "pile_set_name": "DM Mathematics" }
cking 1 r, 1 h, and 1 q when three letters picked without replacement from {r: 9, q: 6, j: 1, c: 1, h: 1, k: 2}? 9/190 Calculate prob of picking 2 e when two letters picked without replacement from {r: 4, u: 4, d: 3, e: 3, p: 1, i: 5}. 3/190 Calculate prob of picking 2 l when two letters picked without replacement from cdcvll. 1/15 What is prob of picking 2 p when two letters picked without replacement from {y: 10, p: 10}? 9/38 Two letters picked without replacement from {h: 1, c: 2}. What is prob of picking 1 c and 1 h? 2/3 What is prob of picking 2 y, 1 v, and 1 z when four letters picked without replacement from uyuyvzuyvuvycc? 18/1001 Four letters picked without replacement from hztttztuyh. Give prob of picking 2 z, 1 y, and 1 u. 1/210 Two letters picked without replacement from yjjvjjmyj. Give prob of picking 1 v and 1 m. 1/36 Two letters picked without replacement from qdqdllqqdlqldlll. Give prob of picking 2 l. 7/40 Calculate prob of picking 2 z, 1 i, and 1 v when four letters picked without replacement from zqzvzizzlqooiliqzz. 7/340 Calculate prob of picking 3 k when three letters picked without replacement from {a: 4, k: 10}. 30/91 Three letters picked without replacement from uuupuuupupupuuup. Give prob of picking 3 p. 1/56 Two letters picked without replacement from {l: 9}. What is prob of picking 2 l? 1 Three letters picked without replacement from {n: 1, m: 1, u: 1, o: 1, f: 4}. What is prob of picking 1 n and 2 f? 3/28 Calculate prob of picking 2 d when two letters picked without replacement from {m: 2, d: 6, l: 5}. 5/26 Three letters picked without replacement from {z: 10, u: 1, m: 9}. Give prob of picking 3 z. 2/19 Two letters picked without replacement from {h: 1, j: 1, y: 1}. Give prob of picking 1 j and 1 y. 1/3 Three letters picked without replacement from mvmlmlmlmfvlmmmmm. What is prob of picking 1 m and 2 l? 3/34 What is prob of picking 1 c, 2 v, and 1 y when four letters picked without replacement from {u: 1, v: 2, o: 2, y: 1, j: 1, c: 1}? 1/70 What is prob of picking 1 g, 1 x, and 1 s when three letters picked without replacement from {s: 1, k: 1, x: 1, g: 1, o: 1}? 1/10 What is prob of picking 1 x and 1 c when two letters picked without replacement from {f: 2, x: 4, c: 2}? 2/7 What is prob of picking 2 z and 1 b when three letters picked without replacement from {y: 6, z: 2, b: 7}? 1/65 What is prob of picking 1 j and 3 r when four letters picked without replacement from {j: 5, r: 14}? 455/969 Calculate prob of picking 2 u and 1 y when three letters picked without replacement from {q: 1, u: 2, y: 1, w: 1, f: 2, s: 1}. 1/56 Four letters picked without replacement from {s: 2, t: 3, o: 1, m: 1}. Give prob of picking 3 m and 1 t. 0 Two letters picked without replacement from qqqqqqq. Give prob of picking 2 q. 1 Two letters picked without replacement from wenbwwwsw. Give prob of picking 1 w and 1 b. 5/36 Two letters picked without replacement from {g: 8, e: 3, o: 1, j: 2, m: 3, i: 1}. Give prob of picking 1 g and 1 i. 8/153 Three letters picked without replacement from {x: 1, z: 1, w: 1}. Give prob of picking 2 w and 1 x. 0 Calculate prob of picking 1 s and 1 o when two letters picked without replacement from ongsr. 1/10 What is prob of picking 1 m and 2 i when three letters picked without replacement from {s: 2, u: 4, m: 3, i: 2, v: 1}? 3/220 What is prob of picking 1 s, 1 e, 1 d, and 1 n when four letters picked without replacement from {e: 3, j: 3, n: 1, s: 5, d: 3}? 3/91 Three letters picked without replacement from {x: 5, e: 2, m: 8}. Give prob of picking 1 x and 2 m. 4/13 Three letters picked without replacement from {e: 2, j: 2, h: 1}. What is prob of picking 1 j and 2 e? 1/5 What is prob of picking 1 h, 1 v, and 1 a when three letters picked without replacement from {a: 1, v: 4, h: 2, m: 1, d: 3}? 8/165 Two letters picked without replacement from bbbbhbbhbbbbhbhhbbb. What is prob of picking 1 b and 1 h? 70/171 Three letters picked without replacement from fofffffxffoffffffxfo. Give prob of picking 1 o and 2 x. 1/380 Calculate prob of picking 2 y and 1 u when three letters picked without replacement from ufyyquybyy. 1/6 Two letters picked without replacement from gnggggng. What is prob of picking 2 g? 15/28 Calculate prob of picking 1 r and 2 m when three letters picked without replacement from {y: 5, r: 1, g: 1, j: 1, m: 6}. 15/364 Four letters picked without replacement from avzvazvwva. Give prob of picking 1 w and 3 a. 1/210 Three letters picked without replacement from ntffntttntnn. What is prob of picking 2 n and 1 t? 5/22 Two letters picked without replacement from {r: 1, b: 1, a: 1}. Give prob of picking 1 a and 1 b. 1/3 Four letters picked without replacement from btoobwtotwwtbwbt. What is prob of picking 1 b, 1 w, 1 o, and 1 t? 12/91 Calculate prob of picking 1 n and 1 v when two letters picked without replacement from {p: 6, z: 2, a: 1, b: 4, n: 3, v: 3}. 1/19 What is prob of picking 3 q when three letters picked without replacement from hqhqq? 1/10 Calculate prob of picking 2 g and 2 c when four letters picked without replacement from {g: 2, c: 18}. 3/95 What is prob of picking 2 z and 1 m when three letters picked without replacement from {h: 1, z: 2, t: 3, p: 8, j: 1, m: 3}? 1/272 What is prob of picking 2 x and 1 m when three letters picked without replacement from oxmdooqmxomgmgggxo? 1/68 Four letters picked without replacement from {b: 1, t: 7}. Give prob of picking 1 b and 3 t. 1/2 Two letters picked without replacement from ccqcqqccqcccccqccc. Give prob of picking 2 c. 26/51 What is prob of picking 3 o when three letters picked without replacement from opooop? 1/5 What is prob of picking 2 d when two letters picked without replacement from {i: 1, d: 3}? 1/2 Calculate prob of picking 1 u, 1 i, and 1 b when three letters picked without replacement from {u: 4, y: 1, i: 7, g: 2, b: 5, l: 1}. 7/57 Calculate prob of picking 2 t and 1 q when three letters picked without replacement from {t: 2, q: 4}. 1/5 Calculate prob of picking 1 t and 1 s when two letters picked without replacement from rtqsgtgrbggrrbbrbrrr. 1/95 Four letters picked without replacement from hgdhgdhgdb. Give prob of picking 1 b, 1 h, 1 g, and 1 d. 9/70 What is prob of picking 3 f and 1 a when four letters picked without replacement from {a: 1, f: 1, l: 1, k: 2, o: 2, i: 1}? 0 Three letters picked without replacement from euugvgeugueu. What is prob of picking 1 u, 1 e, and 1 g? 9/44 Three letters picked without replacement from ymdyyyycd. Give prob of picking 1 c and 2 d. 1/84 Calculate prob of picking 1 d and 2 x when three letters picked without replacement from {d: 2, w: 3, x: 4}. 1/7 Three letters picked without replacement from bswsssssswswssssbb. Give prob of picking 1 b, 1 w, and 1 s. 9/68 Three letters picked without replacement from {y: 1, v: 1, f: 1, g: 2, d: 4}. What is prob of picking 1 y and 2 g? 1/84 Calculate prob of picking 2 x when two letters picked without replacement from {w: 3, x: 3}. 1/5 Calculate prob of picking 1 h, 1 e, and 1 o when three letters picked without replacement from heeeeeehoeoee. 18/143 Calculate prob of picking 1 c and 1 o when two letters picked without replacement from sgocggi. 1/21 Three letters picked without replacement from {w: 1, u: 2, k: 1, h: 1}. Give prob of picking 1 w, 1 k, and 1 h. 1/10 Four letters picked without replacement from iiiiiioixiioixiioi. What is prob of picking 1 i and 3 o? 13/3060 Three letters picked without replacement from {r: 6, m: 4, u: 7, b: 2, a: 1}. Give prob of picking 2 u and 1 m. 7/95 Two letters picked without replacement from {p: 4, h: 2, g: 12, y: 1}. Give prob of picking 2 h. 1/171 Calculate prob of picking 2 f and 2 e when four letters picked without replacement from ppweepppwwfwpfpppw. 1/3060 Two letters picked without replacement from {i: 4, n: 1, j: 6, w: 4}. Give prob of picking 1 j and 1 w. 8/35 Calculate prob of picking 1 u, 1 y, and 1 c when three letters picked without replacement from ybyycbybycrucbybbyu. 14/323 Four letters picked without replacement from xcxcccxccccxxc. What is prob of picking 4 c? 18/143 Four letters picked without replacement from {i: 5, y: 1, k: 3, s: 2, n: 1}. Give prob of picking 1 s, 1 y, and 2 k. 2/165 Two letters pic	{ "pile_set_name": "DM Mathematics" }
out replacement from {x: 9, o: 9}. What is prob of picking 4 o? 7/170 Calculate prob of picking 1 t and 2 g when three letters picked without replacement from tgbtbbbbtbbbbbgtgb. 1/68 Two letters picked without replacement from gddddrgggigdmddggdg. Give prob of picking 1 m and 1 i. 1/171 Two letters picked without replacement from xmfxmffmfxx. Give prob of picking 2 f. 6/55 What is prob of picking 3 c and 1 m when four letters picked without replacement from {q: 2, o: 1, c: 4, w: 1, m: 1}? 2/63 What is prob of picking 1 s and 2 q when three letters picked without replacement from {q: 4, s: 1, m: 4, w: 2}? 2/55 Three letters picked without replacement from hshhhhsshhss. Give prob of picking 1 h and 2 s. 7/22 Three letters picked without replacement from {j: 6, l: 1, h: 3, d: 4, e: 2}. What is prob of picking 2 j and 1 e? 3/56 Calculate prob of picking 1 o and 1 v when two letters picked without replacement from doddvdododfddofddooo. 7/190 Four letters picked without replacement from ilidilolliliiilooi. Give prob of picking 1 d, 1 i, and 2 o. 2/255 Calculate prob of picking 2 l and 2 a when four letters picked without replacement from alllllaaalaa. 5/11 Calculate prob of picking 2 h when two letters picked without replacement from {h: 2, c: 2, t: 4}. 1/28 Four letters picked without replacement from {h: 2, n: 3, s: 9, a: 3}. What is prob of picking 1 h and 3 s? 6/85 What is prob of picking 1 i and 1 v when two letters picked without replacement from {i: 2, v: 4, t: 2, f: 2, x: 7}? 1/17 Two letters picked without replacement from uuauwauuwuuufuwuwa. What is prob of picking 2 w? 2/51 What is prob of picking 1 h and 1 x when two letters picked without replacement from hxhh? 1/2 Three letters picked without replacement from {x: 1, s: 1, g: 3, v: 3, e: 5}. Give prob of picking 2 e and 1 g. 15/143 What is prob of picking 1 e and 1 j when two letters picked without replacement from hhjhhhheh? 1/36 What is prob of picking 1 c and 2 i when three letters picked without replacement from {c: 2, s: 1, p: 8, i: 2}? 1/143 What is prob of picking 2 x, 1 f, and 1 v when four letters picked without replacement from nxnnnnffxxfmvxxnm? 3/238 Two letters picked without replacement from {v: 1, s: 2, x: 2}. What is prob of picking 2 x? 1/10 Three letters picked without replacement from rjkcrrkrjwlwlw. Give prob of picking 1 j, 1 l, and 1 k. 2/91 Three letters picked without replacement from zzqzjbzjcjzzjzczz. Give prob of picking 2 j and 1 q. 3/340 Three letters picked without replacement from {x: 3, e: 1, n: 2, h: 3, l: 1}. What is prob of picking 2 x and 1 l? 1/40 Four letters picked without replacement from vqkkkvqkqzsqvkzkkq. What is prob of picking 1 q, 2 v, and 1 k? 7/204 Two letters picked without replacement from {t: 1, z: 2}. Give prob of picking 2 z. 1/3 Calculate prob of picking 1 p, 2 s, and 1 o when four letters picked without replacement from xospxppsws. 3/70 What is prob of picking 1 b and 1 i when two letters picked without replacement from {p: 5, b: 8, i: 5}? 40/153 What is prob of picking 2 o and 2 k when four letters picked without replacement from {o: 7, k: 2}? 1/6 Calculate prob of picking 1 v and 1 r when two letters picked without replacement from rolrvl. 2/15 Calculate prob of picking 1 g and 2 d when three letters picked without replacement from {i: 1, h: 1, d: 2, g: 4, v: 2}. 1/30 What is prob of picking 2 h and 1 l when three letters picked without replacement from lddljdhdtdltjdllhdd? 5/969 Three letters picked without replacement from {o: 2, m: 2, c: 1, h: 4, q: 1}. What is prob of picking 1 o and 2 m? 1/60 Two letters picked without replacement from {y: 5, r: 2, s: 2}. What is prob of picking 1 s and 1 r? 1/9 Calculate prob of picking 2 w when two letters picked without replacement from {u: 3, w: 11}. 55/91 What is prob of picking 2 q when two letters picked without replacement from qqqqqqqqq? 1 What is prob of picking 1 l and 1 q when two letters picked without replacement from {e: 2, q: 3, x: 2, s: 3, l: 1, r: 9}? 3/190 Calculate prob of picking 3 m when three letters picked without replacement from {m: 1, e: 1, j: 2}. 0 Calculate prob of picking 2 w and 1 s when three letters picked without replacement from wtswwwtntnt. 2/55 Two letters picked without replacement from {u: 2, r: 4, o: 2, e: 1}. What is prob of picking 2 o? 1/36 Two letters picked without replacement from yfeykjyfkkeeykfyrfe. What is prob of picking 1 r and 1 y? 5/171 Four letters picked without replacement from sjsssssssssssss. Give prob of picking 1 j and 3 s. 4/15 Calculate prob of picking 1 l and 1 v when two letters picked without replacement from bvlbbbbdbbbbdlndbve. 4/171 Two letters picked without replacement from {w: 1, a: 2, q: 2}. What is prob of picking 1 a and 1 q? 2/5 Two letters picked without replacement from vtttgggvgt. Give prob of picking 1 v and 1 g. 8/45 What is prob of picking 1 n and 1 v when two letters picked without replacement from vnv? 2/3 What is prob of picking 1 e and 2 l when three letters picked without replacement from {s: 10, l: 5, e: 4}? 40/969 Two letters picked without replacement from aawawww. Give prob of picking 2 w. 2/7 What is prob of picking 2 s and 2 q when four letters picked without replacement from sqqqqqqqsqqqqqqqqqq? 2/57 Four letters picked without replacement from vvvkvkkkkmkmkq. Give prob of picking 1 m, 2 v, and 1 k. 12/143 Three letters picked without replacement from {s: 9, v: 4, z: 1}. Give prob of picking 1 v, 1 z, and 1 s. 9/91 What is prob of picking 4 n when four letters picked without replacement from nnnnn? 1 Two letters picked without replacement from wmdqbjb. What is prob of picking 1 b and 1 m? 2/21 Calculate prob of picking 3 z when three letters picked without replacement from zczcmzmmmmcmmmmc. 1/560 Two letters picked without replacement from nnnrwnqnraaanqrni. Give prob of picking 2 n. 21/136 Calculate prob of picking 1 p, 2 l, and 1 t when four letters picked without replacement from leplppeptpp. 1/55 What is prob of picking 1 e, 1 a, 1 q, and 1 k when four letters picked without replacement from {c: 4, a: 7, q: 3, e: 1, k: 1}? 3/260 Two letters picked without replacement from {l: 1, e: 1, m: 1, f: 4, b: 6}. What is prob of picking 1 b and 1 f? 4/13 Two letters picked without replacement from okkioi. Give prob of picking 1 o and 1 k. 4/15 Four letters picked without replacement from tddifdffwxwt. Give prob of picking 1 x, 1 i, 1 f, and 1 t. 2/165 Two letters picked without replacement from sfssbfllfssbfsbsffs. Give prob of picking 2 s. 28/171 Calculate prob of picking 3 g and 1 z when four letters picked without replacement from ggggggzgggggggg. 4/15 Two letters picked without replacement from {i: 1, n: 5, d: 3}. What is prob of picking 2 n? 5/18 Two letters picked without replacement from {v: 2, e: 1, k: 2, w: 1, p: 2}. What is prob of picking 1 k and 1 p? 1/7 Four letters picked without replacement from ggggbbrgpbpgrrg. What is prob of picking 2 g, 1 p, and 1 b? 6/65 Two letters picked without replacement from ooooxox. Give prob of picking 2 x. 1/21 Three letters picked without replacement from {b: 2, l: 2, m: 1, q: 6, n: 4, w: 2}. Give prob of picking 1 q and 2 l. 3/340 Calculate prob of picking 2 d when two letters picked without replacement from dlddlydlldmddlmdlddl. 9/38 Four letters picked without replacement from {n: 15, f: 4}. What is prob of picking 3 n and 1 f? 455/969 Three letters picked without replacement from {e: 7, b: 2}. What is prob of picking 1 e and 2 b? 1/12 Three letters picked without replacement from {w: 1, e: 1, j: 5, l: 2, y: 1}. Give prob of picking 1 j, 1 y, and 1 e. 1/24 Calculate prob of picking 1 s and 1 z when two letters picked without replacement from {q: 1, z: 1, w: 2, p: 1, s: 2, g: 1}. 1/14 What is prob of picking 2 j when two letters picked without replacement from iiiijiiiijijiiijiji? 10/171 Four letters picked without replacement from rrrrrrhrrrhrr. What is prob of picking 4 r? 6/13 What is prob of picking 1 n, 1 a, and 1 z when three letters picked without replacement from {w: 4, a: 1, n: 4, g: 1, z: 6}? 3/70 Three letters picked without replacement from okkkkokkk. Give prob of picking 2 k and 1 o. 1/2 Three letters picked without replacement from rqrffrr	{ "pile_set_name": "DM Mathematics" }
= 388w - 442. What is -11m(c) + n(c)? 388c - 2 Let d(p) = -344p - 19. Let u(n) = -176n - 10. What is 5d(j) - 9u(j)? -136j - 5 Let p(l) = -l - 185. Let g(d) = -3478d - 1930290. What is -g(s) + 10434p(s)? -6956s Let j(c) = c. Let q(h) = 30h + 2. Let w be (14/(-2))/((-49)/42). What is wj(t) + q(t)? 36t + 2 Let p(z) = 19z3 + z2 + 18z - 9. Let h(s) = 2s3 + 2s - 1. Let n(f) = 9h(f) - p(f). Let b(a) = 70a*3 + 35a*2. What is b(i) + 35n(i)? 35i3 Let d(p) = -139p + 18. Let q(g) = 3g - 2. Determine -d(h) - 6q(h). 121h - 6 Let q(h) be the first derivative of -h2/2 - h - 11. Let n(s) = 8 + 10s + 19 - 23. Determine -n(f) - 2q(f). -8f - 2 Suppose -10q + 1655 = -825. Let l = -246 + q. Let f(h) = 7h - 15. Let d(s) = -3s + 7. Calculate lf(n) + 5d(n). -n + 5 Let w(k) = 3k*2 - 24k + 3. Let u be w(8). Let r(b) = 95b + u - 45b - 49b. Let x = -16 + 26. Let d(l) = -2l - 7. What is xr(c) + 4d(c)? 2c + 2 Let s(m) = 7m*3 - 4m*2 + 5m + 6. Let x = -122 + 123. Let y(k) = -k3 + k2 - k - 1. Calculate xs(g) + 4y(g). 3g3 + g + 2 Let p(s) = -9s*3 + s + 13. Let q(i) = 2i*3 - 3. Suppose -7o = -121 + 65. Let t be (2 - (-40)/(-32))o. Calculate tp(u) + 26q(u). -2u*3 + 6u Let y(g) = -g*2 + g + 1. Let v = -268 - -269. Let q be (-1 + -6 + v)-1. Let n(m) = -8m2 + 6m + 2. Give qy(x) - n(x). 2x*2 + 4 Suppose -z = 3a + 7, -2a = 552z - 553z + 18. Let i(x) = 2x + 14. Let h(r) = -r - 13. Give ah(j) - 4i(j). -3j + 9 Let m(t) = 2t*3 + 7t*2 - t + 2. Suppose -425 = 1100l - 1185l. Let o(q) = 3q*3 + 11q*2 - q + 3. Determine lo(v) - 8m(v). -v3 - v2 + 3v - 1 Let w(v) = -153v3 - 24v + 6. Let j(s) = 152s3 + 18s - 6. Give -4j(t) - 3w(t). -149t3 + 6 Let a(i) = 10i - 1 + 25 - 5. Let b(g) = 5g + 9. Let n(o) = 3a(o) - 7b(o). Let q = -40067 + 40070. Let z(c) = 6c + 7. Determine qz(x) + 4n(x). -2x - 3 Let y(h) = -714h - 1425. Let j be y(-2). Let x(r) = 6r2 - 48r. Let v(n) = -2n2 + 16n. What is jx(w) + 8v(w)? 2w2 - 16w Let p(a) = -1721a + 5. Let g(x) = 3446x - 12. Determine -4g(c) - 10p(c). 3426c - 2 Let u = -41 - -44. Let q(v) = 4v*u - 3v*2 + 26v - 27v + 4v*3. Let o(t) = -15t*3 + 5t*2 + t. Determine -3o(g) - 5q(g). 5g*3 + 2g Let c(v) = 6v2 - 69v + 8. Let q(x) = 3x2 - 35x + 4. What is 6c(p) - 11q(p)? 3p2 - 29p + 4 Suppose -7154s - 208 = -7050s. Let p(u) = 67u3 - 2u*2 + 2u - 2. Let d(i) = 66i3 - 3i*2 + 3i - 3. Calculate sd(x) + 3p(x). 69x3 Let t = 82 - 82. Suppose a - 23 + 24 = t. Let g(q) = -q + 1. Suppose 0 = 2p + 5m + 16, 3p + 4m + 8 = -9. Let f(h) = 4h. Determine af(w) + pg(w). -w - 3 Let c(p) = p - 2. Let t(l) = -1. Let w = -384 + 356. Let a be w/(-32) - (3 + -10)/56. What is ac(f) - t(f)? f - 1 Let f(x) = -48x*2 + 116. Let c(j) = -25j*2 + 55. Give -7c(d) + 4f(d). -17d*2 + 79 Let p(q) = -4q + 27. Let k(c) = 2c - 5. What is -42k(f) - 7p(f)? -56f + 21 Let o(c) = -14c2 + c + 6. Suppose 1096 = 28g + 116. Let p(i) = 14 - gi + 35i - 12 - 5i2. What is -3o(x) + 8p(x)? 2x*2 - 3x - 2 Let i = -21 - -15. Let v(w) = -4w + 2. Let k(y) = 3834y - 3845y - 23 + 51 - 22. What is ik(h) + 17v(h)? -2h - 2 Let r be (-128)/20 - (688/80 + -9). Let z(k) = -7k3 + 6k*2 + 9k + 6. Let h(w) = -w3 + w2 - w + 1. Give rh(m) + z(m). -m3 + 15m Let o(n) = 6n3 + n - 1. Let b(k) = -14726k*3 - 2786k + 2786. Calculate 2b(m) + 5572o(m). 3980m3 Let n(s) = 4 - 4 - 4s. Let f(t) be the first derivative of 13t2/2 + 345. Let r = -1279 + 1277. Calculate rf(q) - 7n(q). 2q Let o(m) = m*2 + 5 - m + 8m + 2. Let q(s) = -6s2 + 24s. Let y be q(4). Let v be y/2 + (51 - 45). Let h(j) = -j*2 - 6j - 6. What is vo(b) + 7h(b)? -b*2 Let b(t) = -32t*2 - 610t + 20. Let p(r) = 10r2 + 203r - 6. Determine -3b(l) - 10p(l). -4l2 - 200l Let d(a) = 64a + 22. Let m(p) = 35p + 12. Let w(h) = -6d(h) + 11m(h). Let v(f) = -f. Determine 24v(q) + 3w(q). -21q Let f(d) be the first derivative of 5d*3/3 - 1565. Let j(q) = -88q*2. Calculate -80f(o) - 5j(o). 40o*2 Let m(q) = -2q + 2. Let p be (6 + 0)31(-3)/(-186). Let k(g) = -3g + 4. Determine pk(c) - 7m(c). 5c - 2 Suppose -82n + 60 - 98 = 454. Let k(y) = -y3 + 6y - 1. Let m(o) = -1 - 4o3 + 5o + 2o + 2o*3. Calculate nm(d) + 7k(d). 5d*3 - 1 Let g(i) = 4i - 1. Let y(p) = p. Let t(n) = -n - 79. Let r be t(-77). Calculate ry(a) - 2g(a). -10a + 2 Let w(r) = -r3 - 15r*2 + 76r + 3. Let m be w(-19). Suppose mf - 18 = -2c - c, -c - 2f = -7. Let y(u) = -u. Let v(q) = 15q. Give cy(a) + v(a). 10a Let j(h) = 24h - 23h - 1 - 58h2 + 57h*2. Let i(n) = 27n*3 + 2n*2 - 3n + 3. Determine i(p) + 2j(p). 27p*3 - p + 1 Let h(w) = 1. Let a(g) = -11g + 4. Let k(m) = -a(m) - 4h(m). Let j(l) = 4l - 3. Let u(t) = -166t - 13106. Let q be u(-79). Calculate qj(o) - 3k(o). -o Let f(p) = -8p*2 + 4. Suppose -943d + 1670d - 836d - 218 = 0. Let z(a) = -7a2 + 9. Let h(u) = 1. Let k(t) = 6h(t) - z(t). Determine df(y) - 3k(y). -5y2 + 1 Let w(g) = g2 + 6931g - 13854g + 1 + 1 - 3 + 6922g. Let b(s) = -2s3 + 10s*2 - 11s - 11. What is -2b(a) + 22w(a)? 4a3 + 2a*2 Let y(i) = 113i + 1720. Let g(x) = -27x - 430. Calculate 25g(o) + 6y(o). 3o - 430 Let u(r) be the third derivative of -167r6/120 - 7r*5/60 + 7r*4/24 + 7r*2 + 510. Let w(n) = 84n*3 + 3n*2 - 3n. Calculate -3u(k) - 7w(k). -87k3 Let p(y) = -5y*2 + y - 2. Let i(n) = -12n*3 + 40n*2 - 24n + 15. What is -i(o) - 8p(o)? 12o*3 + 16o + 1 Let h(t) = -64. Let i(c) = 51. Let a(w) = -4h(w) - 5i(w). Let d(u) = u + 4. What is -9a(v) + 2d(v)? 2v - 1 Suppose 2u + 19 = -5d, 10d + 5u + 22 = 6d. Let k(b) = 4b3 - 3b*2 + 2b. Let s(l) = -4l3 + 2l*2 - 2l. Give ds(t) - 2k(t). 4t3 + 2t Let t(h) = 60h3 + 16h*2 - 29h - 4. Let i(q) = -58q3 - 17q*2 + 23q + 3. What is -5i(m) - 4t(m)? 50m3 + 21m*2 + m + 1 Let v(u) = -6u*3 + u - 3. Let f(q) = 35q*3 - 4q*2 - 6q + 104. Give f(w) + 6v(w). -w3 - 4w*2 + 86 Let v(y) = 3y*2 - 5y + 24. Let h(j) = -25j2 - 2j - 8. Let z(q) = 81q2 + 7q + 24. Let i(l) = -13h(l) - 4z(l). Determine -11i(k) + 4v(k). k*2 + 2k + 8 Let r(h) = 2h2 - 2h + 3. Let m(p) be the second derivative of -p4/12 + p3/6 - p*2/2 + 424p. Give -5m(l) - 2r(l). l*2 - l - 1 Let n(w) = -3w*3 - 5w*2 + 2w - 4. Let a(c) = 3c2 - 87c + 232. Let q be a(26). Let o(j) = -j3 - j2 + j - 1. What is qo(r) + n(r)? -r3 - 3r*2 - 2 Let f(d) = 4d - 2. Let t(a) = -2a + 1. Let s(m) = -3m + 86. Suppose -3v - 2v + 135 = 0. Let r be s(v). Determine rt(l) + 3f(l). 2l - 1 Let c(p) = -14p*2 + p. Let l be (-5)/(4/14((-2751)/252 + 8)). Let h(j) = 13j2 - j. Give lh(q) + 5c(q). 8q*2 - q Let w(y) = -4. Let h(n) = n - 10 + 6 + 1. Let i be 6(8/18)/(12/(-18)). Give iw(u) + 5h(u). 5u + 1 Let c(r) = 1. Suppose 306 = -3093j + 3042j. Let o(y) = -8y - 3. Give jc(a) - o(a). 8a - 3 Let a(z) = 4581z + 27. Let w(x) = -2297x - 16. Determine -4a(y) - 7w(y). -2245y + 4 Let s(q) = -2q*3 + q. Suppose -w + 4y - 2y = -15, 0 = -w + 3y + 11. Let f(i) = -6i2 + wi - 46i - i3 + 24i + 6i2. Give 6f(z) - 6s(z). 6z*3 Let r(p) = p. Let n(m) = 19m. Let h(l) = -l*3 - 22l*2 - 94l - 43. Let x be h(-5). Determine xn(i) - 22r(i). 16i Let w(k) = -6k*2 + 4k + 2. Let m be (0 + 1)/((-148)/592). Let o(r) = -13r2 + 9r + 5. Give mo(a) + 9w(a). -2a2 - 2 Let c(d) = -15d + 29. Let x(f) = 33f - 64. What is 9c(k) + 4x(k)? -3k + 5 Let r(d) = 21d3. Let x(h) = -388070183 + 43h*3 + 388070183. Give -9r(z) + 4x(z). -17z*3 Let w(l) = -2 - 25l*3 - 12l*3 + 68l*3 + 3 - 21l*3 - 5l. Let f(r) = 9r3 - 4r + 1. Determine -6f(x) + 5w(x). -4x3 - x - 1 Let q(a) = 4a - 1. Suppose 55 = 4j - 85. Let r be 7/1(j + -36). Let v(s) = 3s - 1. Determine rv(z) + 5q(z). -z + 2 Let l(n) = 12n*3 + 5n*2 - 3n - 5. Let g(b) be the first derivative of 3b4/2 + b3 - b2/2 - 3b + 1204. Determine 5g(a) - 3l(a). -6a3 + 4a Let u(p) be the second derivative of -p*3/2 + 7p*2/2 - 4p. Let b be ((-188)/28 + 5)*7/	{ "pile_set_name": "DM Mathematics" }
. 13 Let v be -6((-6)/24 - 111/36). Calculate the highest common factor of v and 50. 10 Suppose p = -3v + 120 - 1, -3p = -2v + 61. Calculate the greatest common factor of 38 and v. 38 Let l(v) = v*3 - 3v*2 + 9v - 17. Let k be l(3). What is the greatest common divisor of k and 35? 5 Let v = 2059 - 1093. Calculate the greatest common divisor of 92 and v. 46 Suppose 2g = 6l - 7l + 62, -5g = 20. Calculate the highest common divisor of l and 455. 35 Let o = -261 - -285. Suppose -4k = 4, -3 + 198 = 2t - 3k. Calculate the highest common factor of t and o. 24 Let y be (-111)/(-6) + 2/(-4). Suppose 0 = -m - 0m. Suppose m = a - 0a - 6. What is the highest common divisor of a and y? 6 Suppose -163p = -154p - 2430. What is the greatest common factor of p and 36? 18 Let d = -21 + 30. Let r(u) = -u3 + 28u - 2u2 - 4u + 2u2 + 9u*2 - 13. Let a be r(11). What is the greatest common factor of a and d? 9 Suppose -7d + 127 + 6 = 0. What is the highest common divisor of d and 361? 19 Let g(t) = t*3 - 5t*2 + 3t + 4. Let r be g(5). Let m = 586 - 325. Let q = m - 223. Calculate the greatest common divisor of q and r. 19 Let i be (-2)/(5(-4)/(-10))-3. Suppose -j + 4t + 25 = 3t, 15 = -it. What is the highest common divisor of 100 and j? 20 Suppose 417 = 3b - 27. Let p = 260 - b. Let c = p - 35. Calculate the greatest common factor of 7 and c. 7 Suppose 0 = 2h + 5k - 68 - 7, 0 = 5k + 5. Calculate the greatest common factor of h and 25. 5 Let d be (4 + (-3)/6)24/21. Let v(t) = 2t3 + 8t*2 - 4t + 2. Let k be v(d). What is the highest common factor of 22 and k? 22 Suppose -5q + 9q - 88 = 0. Let u be 4 - (0 - 0)1. Suppose 0 = uy - 55 - 33. Calculate the highest common factor of q and y. 22 Let a be (169 + -91)(3/2 - -1). Calculate the greatest common divisor of a and 234. 39 Let v(c) = 3c*2 + 11c - 8. Let j(h) = -8h2 - 33h + 23. Let s(g) = -4j(g) - 11v(g). Let t be s(10). Calculate the greatest common factor of t and 6. 6 Let n(w) = -10w - 3 - 2w2 - w2 + 1 + 2w2. Let j be n(-8). Suppose -j - 10 = -2z. Calculate the greatest common divisor of 4 and z. 4 Suppose 4o + 117 = -3h, 2h + 2h - o = -156. Let a = h + 50. Let i = 148 - 27. Calculate the highest common factor of i and a. 11 Suppose 234 = -16y + 10y. Let g = 83 + y. What is the greatest common factor of g and 110? 22 Let f be (0 - (-4 + 2))/((-6)/801). Let a(c) = 170c - 1. Let x be a(-1). Let p = x - f. Calculate the greatest common factor of p and 12. 12 Let z be ((-24)/(-28))/(2/7). What is the highest common factor of z and 3? 3 Suppose 0 = -m + 132 + 288. What is the highest common divisor of 20 and m? 20 Let h = -37 + 60. Let g(u) = u3 - 24u*2 + 22u + 24. Let k be g(h). What is the greatest common factor of k and 11? 1 Let g(f) be the third derivative of f5/60 + f4/3 - 26f2. Let k be g(-14). What is the greatest common factor of 12 and k? 12 Suppose 2 = -0p + p. Suppose 17b - 864 = 5b. Suppose 3k + 72 = 7k + j, 4k + pj - b = 0. What is the highest common divisor of 18 and k? 18 Suppose 17 - 14 = 3a. Let w be (6/a4)/(2/2). What is the highest common divisor of 36 and w? 12 Let k be 16/(-10)15/(-6). Suppose ky + 0 = 12. Let z(l) = 9l2 + l - 3. Let a be z(y). Calculate the highest common factor of 9 and a. 9 Suppose 0 = 5o - 171 + 131. Let j be -2 + 5 + -1 + 3. Suppose -2d = jl - 198, -5d = -d + 4. What is the greatest common divisor of l and o? 8 Let w be (4 + 65/(-15))/(2/(-42)). Suppose 2i + 110 = wi. Let q be ((-4)/6)/((-3)/495). What is the highest common divisor of q and i? 22 Let o(y) = 148y + 12. Let n be o(3). What is the greatest common factor of 57 and n? 57 Let k(v) = -v*2 - 10v - 16. Let p be k(-7). Suppose -o - 80 = -pf + 4o, o + 44 = 3f. Calculate the highest common divisor of 154 and f. 14 Suppose 3q - 157 = -x - 13, 0 = -3q. Calculate the highest common divisor of 36 and x. 36 Let u = -43 - -23. Let q be (5/4)/(5/u). Let n = 11 + q. What is the greatest common factor of n and 2? 2 Let s = -72 - -55. Let z(v) = -2v - 19. Let g be z(s). Suppose -3 - 6 = -3c, -5u + 660 = -5c. Calculate the greatest common divisor of u and g. 15 Let f(j) = j3 + 10j*2 - 10j - 30. Let r be f(-7). What is the greatest common divisor of 77 and r? 11 Let z(o) = -2o3 + 66o*2 - 62o - 48. Let c be z(32). What is the greatest common factor of 28 and c? 4 Suppose 3d = d + 8. Suppose 2 + d = t. What is the highest common divisor of 42 and t? 6 Suppose 4t - j - 95 - 198 = 0, -t + 5j = -97. What is the highest common divisor of 396 and t? 36 Let i(q) = -11q + 15. Let g be i(-6). Suppose -g - 117 = -2j. Calculate the highest common factor of j and 11. 11 Suppose 230 = 2o + 3o. Let d = 822 + -799. Calculate the greatest common factor of o and d. 23 Suppose -3o + 48 = 2b - 5o, -4o - 8 = 0. Suppose -20h - 44 = -24h. Calculate the highest common factor of h and b. 11 Let y(z) = z3 - 7z*2. Let i be y(10). Suppose 7b = 2b + i. Suppose -5v + 0v + b = 0. Calculate the greatest common factor of v and 108. 12 Suppose -3h = -5m + 8, -3h - h = 2m - 24. Suppose hr + 3k - 2k = 67, k = -5. Suppose -4a + a = -135. Calculate the greatest common factor of a and r. 9 Let h(s) = 2s + 6. Suppose 3 = x - 2x. Let c(v) = 2v + 5. Let o(z) = xc(z) + 2h(z). Let q be o(-4). What is the greatest common factor of 25 and q? 5 Let u = 0 + 3. Suppose g + y = -ug + 19, 0 = 3g + 2y - 8. Suppose -125 = s - gs. What is the greatest common factor of 5 and s? 5 Suppose -6k + 2k + 56 = 0. Suppose 0 = -3n + 47 - k. Suppose -2d - 3d - f + 56 = 0, 4d = -f + 45. Calculate the greatest common factor of d and n. 11 Suppose -2p = 2p - 48. Let f(m) = m*3 - 20m*2 + 23m - 28. Let z be f(19). What is the highest common divisor of p and z? 12 Let a = -307 - -647. Calculate the highest common factor of 17 and a. 17 Let a(j) = 4j2 + 15j - 38. Let p be a(2). Let o = -48 - -79. Let w = -15 + o. What is the greatest common factor of w and p? 8 Suppose -3w - 1 = -16. Suppose -113 = 4g + wb + 53, -g + 5b - 54 = 0. Let u be (g/8)/(3/(-6)). What is the greatest common divisor of u and 88? 11 Let b = -1415 - -3015. What is the highest common divisor of 50 and b? 50 Suppose 371 = -4x + 1187. Let v = 347 - x. Let w = 9 - -4. What is the greatest common divisor of v and w? 13 Suppose 44 = -2z + 280. Let w = -63 + z. Let p be (1/(-3))/((-10)/330). Calculate the highest common divisor of p and w. 11 Suppose -4 = -j - 2. Calculate the greatest common factor of j and 74. 2 Suppose 4x = x - 3l + 69, -2x + 4l = -58. What is the highest common factor of x and 15? 5 Suppose -10g - 94 = -4n, -4g = 3n - 41 + 28. Suppose -223 - 525 = -4x. What is the highest common factor of n and x? 11 Suppose 4t = 3t + 110. Suppose y = -y + t. Suppose -5g + 10 = -3g. Calculate the highest common divisor of y and g. 5 Let m = -294 - -334. Suppose -5q + 52 = -q. Suppose -4l + 53 = q. What is the greatest common factor of l and m? 10 Let s(g) = 18 + 3g*2 + 19g*2 + 9g - 30g - 3 - g3. Let y be s(21). What is the greatest common divisor of y and 20? 5 Let k be 10 - ((-3)/1 + 2). Suppose x - 6 = 2y, -x + y = -k + 2. Calculate the highest common divisor of x and 6. 6 Let a = 28 - 4. Let i = a - 8. Let r be 20/(-1)(-96)/15. What is the greatest common factor of i and r? 16 Suppose 0t + 12 = 3t, 0 = -3g + 3t. Suppose -20 = -gr, -c + 4r - 110 = -4c. Suppose 0 = -4p + c + 34. Calculate the greatest common factor of p and 48. 16 Suppose 0 = -4t + 70 - 18. Suppose -5n + 17 = -3w + 52, -2n + 5 = -5w. Let x be (-4)/(-10) - 776/n. What is the greatest common divisor of t and x? 13 Let f(k) = 28k - 52. Let i = 17 + -10. Let l be f(i). What is the highest common factor of l and 18? 18 Let c(u) = -47u + 51. Let o be c(1). What is the greatest common factor of 12 and o? 4 Let x(z) = -50z3. Let l be x(-1). Let c be (-2)/10 + 1110/l. What is the highest common divisor of c and 2? 2 Let s be 1/(3/(-174)-1). Let c = s - 50. What is the greatest common divisor of 4 and c? 4 Suppose -2t - 81 = -5u, 6t - t - 30 = -3u. Let b(l) = -l + 26. Let g be b(21). Calculate the highest common factor of u and g. 5 Let t	{ "pile_set_name": "DM Mathematics" }
7 = -lt, 2t + t = -3b - 3 for b. -3 Let o be (1/(-2))/(2/(-44)). Let b = o - -3. Solve 0 = -4c + 3d + b, 0d + 8 = c - 3d for c. 2 Suppose 2i - 2p = 14, -8i - 2p = -7i + 5. Solve l - il = 5o + 1, -4o + 10 = -2l for o. 1 Let y(k) = k + 4. Let f be y(-4). Suppose -7 = -2n - 2o + 3, f = 3n + o - 11. Solve -4u - 21 + 9 = 0, 2j + n = -u for j. 0 Let p be 28 + 0 + (-1 - -1). Let b = p + -10. Let v(t) = -t + 3. Let y be v(1). Solve 3r - b = yr + 4o, o = 3r + 1 for r. -2 Suppose 0 = -2a + 6a - 12. Let v = 0 + a. Let r = 1 - -2. Solve 0 = -vz + g + rg + 6, 3z - 6 = -3g for z. 2 Let j = -6 + 16. Solve 3n + 2z = -j + 1, -2z = -2n - 16 for n. -5 Let t be (0/2)/(-4 + 5). Let c = -99 + 139. Suppose -6j + 2j - 4f + 72 = 0, -5j + 5f + c = t. Solve o = -3s + j, -5o = -2s + 4s - 13 for o. 1 Let z(m) = -m*3 + 4m*2 - 4m + 4. Let b be z(3). Let u = 2 - b. Let d be u/(-2 - (-27)/12). Solve -3t = -o - 11, 4t = -0t - 4o + d for t. 3 Let x(w) = -w*2 + 5w + 4. Let a be x(6). Let i be ((-10)/6 - a)6. Suppose iz + z = 18. Solve 0 = -4j - 4d + 40, -zj + 2d = -4j for j. 5 Let j(m) = -2m - 9. Let s(r) = r - 11. Let o be s(5). Let h be j(o). Solve 0 = 4n + 2x - 16, -2n = -0n - hx - 16 for n. 5 Suppose -19 = -2p - 3c, 3p - 5c = -3c + 61. Solve -5q - j + p = -11, -q + 2j - 1 = 0 for q. 5 Let d be 0/(3/9 + 4/(-3)). Solve 2q = -2 - d, -r = -2q - 3 for r. 1 Let w = -245 + 350. Suppose -q + 53 - 192 = -4b, 3b - q - w = 0. Solve 5k - 2y - b = y, 2k - 1 = -3y for k. 5 Let d be (-6)/(-9) + 2/(-3). Suppose t = 4o - 10, -3o + dt = -2t - 10. Solve -ou - 6l + 12 = -l, -3u - 32 = -5l for u. -4 Let p(j) = -8j + 4. Let l be p(-2). Suppose 4 - 1 = -u. Let h(w) = 2w*2 + 3w - 4. Let g be h(u). Solve 3q - l = -4a, 0q = a + 3q - g for a. 5 Suppose 3n - 4l - 20 = 18, 0 = -n - 5l - 19. Let j be 16 - -1 - (-3 + n). Solve -z - 6 + 4 = v, -2v = -3z + j for z. 2 Let u = -11 - 8. Let j = -11 - u. Suppose j = 2g - 8. Solve 2v + 7 = 3r, -2 = -3v - g for r. 1 Suppose 7k = 3k + 12. Solve 3q = -0u + 4u - 16, kq = -5u + 20 for q. 0 Suppose -2s + 7s - 10 = 0. Solve -3r = -3l + sr - 3, 0 = -2r for l. -1 Suppose 29p - 26p - 30 = 0. Solve -2j + 10 = 2k, p = j + 2j + 2k for j. 0 Let k(w) = 3w3 - 6w + w + 4w - 6 - 7w*2 - 4w*3. Let n be k(-7). Suppose -p - n = -4. Solve 3l + 3 = 3f - p, 5f - 20 = -5l for l. 1 Let s(o) = o3 - o2 + o + 12. Let v be s(0). Suppose 2f - 3 + 27 = 0. Let t be f/(-42) - 12/(-7). Solve 4d - v = -0m + 2m, -3d + tm + 10 = 0 for d. 2 Let r be 1/2 + 5/10. Let d be 0 - 0 - r - -1. Suppose d = 5l - 20 - 20. Solve w - c = 0, 3w - l = -w - 4c for w. 1 Let u be (7 - 9) + (-20)/(-1). Suppose g + 4g + 4p = 12, p = -5g + u. Solve -4v + 2v = -3c - 1, -gc = 3v + 7 for v. -1 Suppose -p - p + 16 = 0. Let m(c) be the first derivative of -c*3/3 + 9c*2/2 - 5c + 1. Let t be m(p). Solve tu + 2u - 2i = 23, u + 2i + 5 = 0 for u. 3 Let o(g) = 4g + 16. Let q(f) = -5f - 17. Let x(k) = 4o(k) + 3q(k). Let p be x(-11). Solve 0 = -2i - p, 3w + 4i = 2w - 2 for w. 2 Let h be (-8)/20-5 - 2. Let o = 2 + h. Solve 0 = 2l - od - 4, 5l - 7d = -5d + 13 for l. 3 Let c be 0/1 - 0/(-1). Suppose -x + 3 = u - 2x, 0 = -3u - 2x + 4. Let s be 195/27 + u/(-9). Solve 5h + b + 13 = 0, c = 5h - 0b - b + s for h. -2 Suppose p = 2r + 10, -3p + 2 = 3r - 2r. Solve -3b + pz + 2 = 10, 0 = -2z + 2 for b. -2 Let u(r) = -r + 2. Let z be u(-3). Let j = -5 + z. Suppose 5x - 5p + 5 = 0, 0x + x = 3p - 11. Solve j = 4n - n + 2v, -xn = 5v for n. 0 Let o be 1/(2/(-9))2. Let p = 9 + o. Solve -5t - 2r + 9 = 0, 0 = -pr + 3r + 9 for t. 3 Suppose -16z = -21z. Solve -g + 4n + 1 = 0, -3g + n - 3n + 3 = z for g. 1 Suppose -5q + 23 + 43 = 3d, 0 = -3q + 4d + 28. Solve -2w - w = 4v - q, 12 = 4v for w. 0 Suppose 0m = -3f + m + 10, -13 = -4f + m. Suppose -4h - 8n + 3n = 20, h + fn = -12. Solve -w + 2g - 3 = -7, h = 3w - 4g - 12 for w. 4 Let k(s) = s*3 - 2s*2 + 2s. Suppose 4 = -w + 6. Let i be k(w). Solve -5n + z - iz = 0, 4z = 3n - 29 for n. 3 Suppose -2x = -w - 28, 0 = -5x + 3w - 1 + 70. Suppose -6u = -11u + x. Solve 0f = uf - 5j + 8, 0 = 3f + 3j for f. -1 Let c be (-3)/(-2) - (-6)/12. Suppose -cw + 4v + 30 = 0, 5v = 5w + 4v - 30. Solve -4r + 3q + 23 = -2q, wq = -4r - 7 for r. 2 Suppose 3m - 10 = 5. Solve 11 = h + 2u, -u = -mh + h + 17 for h. 5 Let o(p) = -p2 + 7p + 11. Let b be o(8). Suppose 0j - bj - 6 = 0. Let d be ((-1)/(-2))/(j/(-8)). Solve -4s + 22 = -dk, 2s = -3k - 0 - 1 for s. 4 Suppose 2v + 2v = n + 25, 4v = 4n + 40. Suppose r + 20 = vy, -4 = r - 9. Solve -o = s - 0o - 9, 4s = yo for s. 5 Let u = 8 + -18. Let a be u(-2)/(-12)-3. Solve 0 = -az + 3b + 14 + 26, b + 25 = 4z for z. 5 Suppose 2l - l - 3 = 0. Let s(z) = -z*3 - 4z*2 - 3z + 3. Let u = 2 + -5. Let t be s(u). Solve ti + 2 = -lj + 5, 3j - 17 = 4i for j. 3 Suppose 3p - 3 = 3g, 4p - 13 - 1 = -g. Suppose 2 = -4m - f, 0f - 4 = m + gf. Let c be 24 - 1/3m. Solve -c = 4r + 3q, -5r - 1 = -4q - 2 for r. -3 Suppose -4r + v = -24, -2v = -3r - 4v + 7. Let k = 1 - -1. Suppose 0 = 9s - 6s - 36. Solve -3i + 1 = 5t, 0 = rt - ki + s - 3 for t. -1 Suppose -5h = -30 + 5. Let t = h - 3. Let b = -7 - -11. Solve 8 = to - bz, 2z = -5o + o + 16 for o. 4 Let x = 114 + -14. Suppose -6z + z = -x. Let c be 0 - (z1)/(-1). Solve 2h - 2 = v + 6, -5h + c = 0 for v. 0 Suppose 6a - 10a + 44 = 0. Suppose 2b = 5 + a. Solve 3r - b = -4q, r + r + 5q = 3 for r. 4 Let g(c) = -1. Let k(x) = -x*2. Let z(m) = g(m) - 4k(m). Let n be z(-1). Let i = 36 - 35. Solve -l + nv = 8, 0v - i = -v for l. -5 Let x = -41 - -53. Solve 0 = -2g - 3g + s - 12, -3g + 3s = x for g. -2 Let u = 8 + -4. Let n be 5(0 + u/10). Solve nw + 3x = w + 10, 5x = -2w + 18 for w. 4 Let r be (15/6)/((-1)/(-2)). Suppose rp - 16 = -0z - 2z, -6 = -3p - 3z. Let o be 1 - (-1)/((-3)/(-6)). Solve -2j + 8 = 0, a = oa - j - p for a. 4 Suppose -i + 0 = -2. Let y be (-2)/4(-5 - -5). Suppose 12 = 2z - yz. Solve 2n - 20 = iu, -26 = n + 5u - z for n. 5 Suppose 452 = 5i + 92. Suppose -19u + 15u = -i. Solve -5n + u = -2a - n, 3n - 13 = a for a. -1 Let i(t) = t - 1. Let k be i(6). Suppose -kn + 2 = -13. Solve 0 = nu + 3x - 3 - 0, 4x + 12 = 0 for u. 4 Let o be 3/((-7)/(56/(-12))). Solve -om + 38 = 5d + 9, 0 = 4d + 2m - 24 for d. 5 Let q be (0 - 12)/(-3) - 0. Suppose -10 + 7 = -a. Suppose 0 = 3s - 8s + 20. Solve 0 = r - qx + a, x + sx = 0 for r. -3 Suppose -6x + x - 5 = 0. Let o be 66/9 - x. Solve -m + 5m = oy + 25, -y - 3m = 5 for y. -5 Let z be 10/((-40)/(-15) + -2). Solve 4m = 5l + 25, 0m - 3l - z = -2m for m. 0 Let o(k) = k*3 - 2k*2 - 4k + 4. Let n be o(3). Solve -d + 1 = b - n, b = d + 8 for d. -3 Suppose 2i - 88 = -c, -5c = -2i - 2c + 72. Let a = -25 + i. Solve 2l + a = -5g, g - 2 = 2l + 3l for g. -3 Let n(f) = f*3 + 9f*2 + 4. Suppose -s = -1 + 10. Let g be n(s). Solve 12 = gz - 4a, a + 15 = 5z - z for z. 4 Suppose -253 = -6w - 241. Solve wc = 5n + 15, -4c + 20 = -8c for n. -5 Let z be (-26)/(-22) - 1 - 341/(-121). Solve 2a - zx = 2, -2a = -0a + 3x - 14 for a. 4 Let d(j) = j + 2. Let y be d(3). Let v(h) = -h*3 + 6h*2 - 4h - 4. Let x be v(y). Suppose 3f = -0f + 15. Solve -4i - 3n = -f + x, -4i = -2n - 24 for i. 4 Let d be (-1 + 3)(-10)/(-4). Let g be 22/2 - (d - 5). Solve 0 = t - 3k - 8, 4k + 6 + g = -5t for t. -1 Let q = -100 + 100. Solve -4w = -0w - 20, z - 3w + 14 = q for z. 1 Suppose -12 = -2q - q. Let k be (-5 - -1)(-1)/2. Solve -4w = 5v + 31, -2w + qw + k = 2v for w. -4 Suppose 2w + 2 = -3a + 29, a = 5w - 59. Suppose -6s + s + 15 = 0, 2g = s + 5. Suppose -o - go = -20. Solve od = -2y - w, y = -d - 4 + 1 for y. 0 Let j(q) = -q - 1. Let l be j(-3). Solve -4b + 22 = 2w, 1 = 2b - 3w + l for b. 4 Let s be (-2)/(-5) + (-143)/(-55). Solve -3y - 2d = 4 - s, 3y = d + 14 for y. 3 Suppose 4z = 0, 5z - 5 = -2j + 3. Solve 17 = -5n - x - x, -jx + 1 = 3n for n. -5 Let m = 10 - 2. Suppose 0 = 5z - mz + 9. Solve u - z = x - 0, 0 = -2x + u - 7 for x. -	{ "pile_set_name": "DM Mathematics" }
mon denominator of k and 125/6. 138 Suppose 5n - 110 = 2w, -5n - 95 = -10n - w. What is the lowest common multiple of 16 and n? 80 Suppose -23f = 38f - 2684. Calculate the least common multiple of 6 and f. 132 Suppose -2y - 2y = -4q + 32, -4q + 2y + 34 = 0. Suppose -7k + qk - 2 = 0. Find the common denominator of 56/11 and k(-124)/(-20)-1. 55 Let s be -1540/(-50). Let o = -19 + s. What is the common denominator of (-2 - 0) + 290/o and 70/9? 9 Suppose 0 = -5z + 155 + 65. Calculate the common denominator of -71/57 and (-1 - z/(-42))(-82 - -3). 399 What is the common denominator of (-5 - (-252)/52) + (-952)/(-4160) and 127/240? 240 Suppose 0f - 4f + 8 = 0. Let r be 0 - (-1)/f4. What is the lowest common multiple of 0 + r - (-24)/6 and 7? 42 Suppose -5h - 14 = y, 4h = 4y - 14 - 2. What is the least common multiple of (-14)/h + 1/3 and 5? 5 Find the common denominator of -47/21 and (-7648)/(-5040) + (-2)/10. 63 Suppose -80 = -5z + z. Suppose 8v - z = 6v. Calculate the lowest common multiple of 5 and v. 10 Let k be (-2)/((-3)/(-7) + 66086/(-154217)). Let p = -1586119/36 - k. Calculate the common denominator of p and ((-2)/(-21))/((-24)/(-1162)). 36 Suppose 0 = -3q - 0q - j + 23, -29 = -5q + 3j. Let k(m) = m*2 - 5m + 2. Let r = -7 - -37. Calculate the lowest common multiple of k(q) and r. 240 Let a be 273/(-14)(-4)/2. Find the common denominator of (a/(-8))/(20/16) and 47/3. 30 Suppose 0 = 5t + 2918 + 3877. Let s be 320/t + 6/27. Let l = s + 3175/302. Calculate the common denominator of l and 45/28. 28 Let h be (-4)/6 + (-582)/396. Let n = 1021/66 + h. Find the common denominator of n and -20/3. 3 Let l = -21445 + 42712. Let u = -467957/22 + l. Find the common denominator of u and -73/12. 132 Let t = 10003/18 + -1669/3. What is the common denominator of (-4)/(-30)(-2670)/(-80) and t? 180 What is the least common multiple of 5/(9/((-540)/(-25))) and 249? 996 Let g = 643/2 - 328. Calculate the common denominator of 6/(-40)12/(-144)128 and g. 20 Let m be (17/(-102))/(-1 + (-147670)/(-147676)). Let v = 4094 - m. Calculate the common denominator of v and 32/17. 153 Let m = -10306 - -164823/16. Let h be (4/75)/((-83)/3). Let w = h - -139057/16600. What is the common denominator of m and w? 16 Let m = -35643/62 - -575. Let r = 507 + -2033/4. What is the common denominator of r and m? 124 What is the common denominator of 39/46 and ((-92)/(-1150))/((-12)/(-565))? 690 Suppose 3j - m = 2m + 18, 4j + m - 4 = 0. Suppose jl + 8 = -4. What is the common denominator of (2/l)/(22/30) and -20? 11 Find the common denominator of (-297)/30 + 3/1 and ((-1)/5)/(2/43). 10 Let t = 5 - 1. Suppose o = -5q + 26, 3o = 2q + to - 8. Calculate the lowest common multiple of ((-12)/(-5))/(q/15) and 11. 66 Let u be -5 - (-2 - 1/(-1)). Let w = -311/24 - -101/6. Calculate the common denominator of w and (89/(-24))/(u/(-6)). 16 Let v = 1 + 3. Suppose -b + 0b + v = 0. Suppose 4r - b = 20. What is the least common multiple of r and 10? 30 Let d = -2157/4 - -543. Calculate the common denominator of d and 65/6. 12 Let l be (-15)/(-3)6/10. Suppose 0 = -lc - 1 + 31. What is the least common multiple of 3 and c? 30 Let y = -7051247/132 + 53419. Calculate the common denominator of 21/16 and y. 528 Let f = 315647/25455 + -1/5091. Let o = 573790/27 - 21254. What is the common denominator of o and f? 135 Suppose -874 = -4q + 366. Calculate the common denominator of q/(-12) - (-2 + 0) and -143/6. 6 Let f(b) = -b3 + 5b*2 + 5b + 5. Let w be f(6). What is the lowest common multiple of ((-11)/4)/(w/(-8)-2) and 12? 132 Suppose 0 = 2u + 3u - 60. Suppose -6b + 80 = -2b - 4o, 0 = -b - 5o - 10. Find the common denominator of (-2)/u + 112/b and -43/8. 40 Find the common denominator of (-136)/18 - (-21)/3 and 49/66. 198 Suppose -5m = 10 - 5. Suppose 5k - r = -6 - 22, -5r - 5 = 4k. Calculate the smallest common multiple of 1 and (m + -1)/(k/25). 10 Let s = 29706 - 1604275/54. What is the common denominator of -151/18 and s? 54 Let q = -122/547 + -27991/33914. Calculate the common denominator of q and -59/18. 558 Suppose 12 = -3q, -8j - 2q = -6j. Calculate the lowest common multiple of 2 and j. 4 What is the common denominator of ((1 - 1) + 59)(-2)/42 and -13/57? 399 Suppose -z + 4z + 4v - 141 = 0, v = 0. Let c = z + -19. Calculate the common denominator of -67/18 and c. 18 Let i = -50771/8 - -6355. What is the common denominator of i and 39/11? 88 Let s(k) = -k*3 + 14k*2 - 5k - 100. What is the lowest common multiple of 714 and s(13)? 1428 Suppose 42 = 4t + 2b + 2, b = t - 10. What is the smallest common multiple of 4 and t? 20 Let l = -7/1333 + -51287/133300. Calculate the common denominator of l and 19/12. 300 Suppose -5d + 20 = -15. Suppose 0 = -r + d. What is the lowest common multiple of r and 1? 7 Suppose o = 3o. Suppose o = t - 2. Suppose p + t = 2p. What is the lowest common multiple of 10 and p? 10 Calculate the common denominator of -3/20 and (-1)/((-411)/(-327) + -1). 140 Find the common denominator of (-2675)/(-800) + 1 + -4 and -123/40. 160 Let n = 4/25 - 91/100. What is the common denominator of n and 4/(-6) - 1396/(-168)? 28 Let b(m) = 23m*3 + m + 1. Let v be b(-1). Let g = -20 - v. Suppose gd - 18 = -0d. Calculate the smallest common multiple of 10 and d. 30 Let w(i) = i + 5. Let j be w(-6). Let b = 7 - j. Calculate the least common multiple of 6 and b. 24 Let x = -121 + 222. Calculate the lowest common multiple of 5 and x. 505 Let o be (-254)/(-9) - (-4)/(-18). Suppose 6i - o = -i. What is the smallest common multiple of i and 24? 24 Let l = -18 - -21. Find the common denominator of -55/18 and 1/l + (-177)/36-2. 18 Let m(p) = 4p*2 + 7p + 3. Suppose -6q = -0q + 18. What is the lowest common multiple of 11 and m(q)? 198 Let k = -562/175 + 12/175. Find the common denominator of k and 10/943. 6601 Suppose 2t = -7t + 18. Suppose s + 0s - 19 = -tp, 5s + 5 = 0. What is the least common multiple of 3 and p? 30 Let v = 685 + -655. What is the least common multiple of v and 176? 2640 Suppose 0 = -w - 4q + 5q, -2q = 3w. Let z = 0 + 0. Suppose -3o + z + 30 = w. Calculate the least common multiple of o and 6. 30 Suppose 0 = -10k + 6k + 12. Calculate the common denominator of (k/4)/(3/(-46)) and -37/6. 6 Let j(z) = -5z - 50. Suppose -2f - 5 = -19. Calculate the lowest common multiple of f and j(-11). 35 Let k = 29 - 27. Let s(f) = -f*2 + 2f. Let x be s(k). Suppose -n + 16 = -xn. Calculate the lowest common multiple of n and 22. 176 Suppose 0 = -9y + 23y + 28. What is the common denominator of -47/2 and 10 - -13 - y/6? 6 Suppose 665 = 50v - 85. What is the least common multiple of v and 160? 480 Let j = 4 + 0. Suppose 3n - 3s - 102 = -6s, -3s - 122 = -jn. Suppose n = 4m - 0. Calculate the least common multiple of 3 and m. 24 Let k be 1/(2(-1)/(-22)). Let c = 7 - -59. Calculate the common denominator of -41/4 and (-153)/c + (-2)/k. 4 What is the lowest common multiple of (-11 - (-7 + -11)) + -5 and 767? 1534 Suppose -4325 = -17c - 4308. Suppose 0 = 3b - b - 6. What is the least common multiple of b and c? 3 Calculate the common denominator of 10/120-13(-21)/(-10) and -109/80. 80 Calculate the least common multiple of (228/380)/(-1 - 11/(-10)) and 56. 168 Suppose 8q + 70 = 246. Suppose -4s + q = 2z, -17 = -2z - s - 4. Calculate the smallest common multiple of z and 6. 30 Let y = -690 - -8255/12. Calculate the common denominator of 5 - ((-3575)/60)/13 and y. 12 Let z = -346 - -351. Calculate the least common multiple of 10 and z. 10 Let h = -15539 - -776839/50. Calculate the common denominator of h and -41/80. 400 Let b = 474077090/9 - 7574283953/144. Let i = -76041 + b. Calculate the common denominator of i and -31/6. 48 Suppose 0 = 4p - 1 - 223. Calculate the least common multiple of 378 and p. 1512 Suppose -34 - 26 = -3g. Suppose p + g = 6p. Let t(v) = v + 4. What is the lowest common multiple of p and t(0)? 4 Let f be 3/((-804)/(-160) + -5). Let y = f + -111. What is the least common multiple of 24 and y? 72 Let o = -18 + 17. Find the common denominator of 3 - (o + 2 + (-190)/(-12)) and -3/112. 336 Suppose 67u - 75u + 48 = 0. What is the lowest common multiple of (-2 -	{ "pile_set_name": "DM Mathematics" }
mmon multiple of 12 and k. 516 Let v(s) = 25s2 - s. Calculate the smallest common multiple of v(1) and (2 + 3/(-6))/(-16 - (-5772)/360). 360 What is the least common multiple of 900 and (-721)/21-14 + (2 - (-16)/(-6))? 7200 Calculate the common denominator of ((-115)/(-252) + 15/60)(-39)/195 and 41/210. 630 Let b be (2452078/(-8) - -2)/(-26). Let r = b + -11788. Calculate the common denominator of 3/(-12)101 - (-90)/15 and r. 104 Suppose -2i - 244 = -2n, -382 = -6n + 3n - i. Find the common denominator of ((-1)/(-6) + 0)n/4 and 14. 4 Let m(s) = -s2 - 30s + 69. Let j be m(-32). Suppose -2p = jp - 14. What is the lowest common multiple of 10 and p? 10 Let a = -2304875/32 + 60294365/736. Let f = a + -9906. Let c = f - -3131/322. What is the common denominator of -79/2 and c? 14 Let y(v) = 256 + 8 + 77v2 - 3v - 76v2. What is the least common multiple of 6 and y(0)? 264 Let x be (-10)/40 + 2518/(-8). Let u = -275 - x. What is the lowest common multiple of u and 20? 40 Let k = 281/4 + -63. Let s = 8683601/1700 + -5108. Let g = s + -4931/1700. What is the common denominator of k and g? 20 Let u = 8783 - 8675. What is the least common multiple of u and 297? 1188 Let o = 53560128115/714 - 75014210. Let z = 24/119 - o. Find the common denominator of -41/70 and z. 210 Find the common denominator of 7(-9)/(-3780)(-4706)/221 and -49/850. 2550 Let i be (-260057)/(-14)(-7)/56. Let b = 2320 + i. Let z = -30/41 - -2397/82. What is the common denominator of b and z? 16 Suppose -r - 4 = 2p, -1144p - 4 = 3r - 1140p. What is the least common multiple of 808 and r? 808 Let d(r) = -31 - 30r + 9 + 72r - 35r. Let l be d(5). Calculate the common denominator of 18/624-222 + 2/l and 21. 4 Let n = 2706 + -37853/14. Let f = 1599/44 + -221/11. What is the common denominator of f and n? 28 Let l = -2759 - -2755. Suppose 3w - 5w = -5c + 149, c + 287 = -4w. What is the common denominator of 81/8 and l/(-6) + 3/w-530? 8 Let k(g) = 165g*2 - 1234g - 4. What is the smallest common multiple of 3648 and k(8)? 10944 Suppose z - 4 = 5o + 20, -o = -3z + 16. Suppose -5x + 89 = 3r, zr + x = -3x + 124. Calculate the lowest common multiple of r and 154. 462 Let w = 271 + -207. Calculate the least common multiple of w and 672. 1344 Let y = 3222 - 1538. Let o = -6813/4 + y. Find the common denominator of -99/4 and o. 4 What is the least common multiple of 181510/125 - 48/600 and 32? 11616 Suppose m + 13 = -2n + 6m, 3n + 2 = 4m. Suppose 0 = 3z + 5r + 367, r = nz - 2z + 451. Find the common denominator of (6/80)/(19/z) and -11/70. 140 Suppose -5v = -4u - 35, -7 - 3 = -u + 5v. Suppose 6 = -2g - 0g. Find the common denominator of 52/11 and (183/u - g) + 10/25. 55 Find the common denominator of (312/117 - (-2941)/(-1104))/((-12)/159) and 9/320. 7360 Find the common denominator of 32/15 and 51 + -21162/396. 330 Suppose 18 = c + 4h, -5c - 5h = -43 + 13. What is the common denominator of ((-146)/16)/((-21)/(-28)) and (-2720)/(-528) - ((-4)/(-6))/c? 66 Let n(m) = 3m2 - 106m - 293. Let j(q) = -q*2 + 2q + 2q3 - q2 - 1 + 0q*2. What is the least common multiple of n(38) and j(2)? 11 Let q be 6/(-225)6704402/(-4). Let k = q - 44695. What is the common denominator of -83/120 and k? 600 Let h = 266 - 272. What is the lowest common multiple of 25 and 29 + 4 - h/93? 175 Let l = -214 + 227. Calculate the common denominator of 1/(-2) + (-41)/l and 10. 26 Let r(y) = 8y + 5. Let b be r(6). Suppose -32c + 8576 = 66c + 30c. Let t = c - b. Calculate the smallest common multiple of t and 6. 42 Let c(t) be the first derivative of t2/2 + 6t - 289. Let n = -28 - -147. What is the smallest common multiple of n and c(3)? 1071 Suppose 0 = 3l + 102 - 18. Let i = -22 - l. What is the smallest common multiple of i and (1 + 2 - 6)-6? 18 Let f(q) = -q*2 - 6q + 32. Let g be f(6). Calculate the common denominator of 5 + -2 - (-138)/132 and 106/g(-3 - -2). 220 Let x(q) = -17q - 8. Let l be x(0). What is the common denominator of 149/66 and l/28 - (-4)/((-504)/741)? 66 Suppose 20 = -4q, 0t + 2t + 5q - 143 = 0. What is the lowest common multiple of t and -8 + (-11)/((-66)/168)? 420 Let g = -8985 - -9039. Calculate the lowest common multiple of 648 and g. 648 Let o = -279785/24 - -11657. Calculate the common denominator of o and 55/123. 984 Let p = 1366688413/1446 - 945151. Find the common denominator of p and 7/8. 5784 Let k = 1203247/186 - 6469. What is the common denominator of -91/36 and k? 1116 What is the common denominator of (-62)/(-713)55/(-6) and (459/90)/(2 + 46/(-14))? 690 Find the common denominator of (5751/6480)/(2/5) and -113/288. 288 Let v = -245 + 248. Suppose 2c + c = 5z + 190, -vz = -2c + 127. Calculate the smallest common multiple of c and 55. 715 What is the least common multiple of 52 and ((-25484)/92)/(1 + -2)? 14404 Calculate the common denominator of -3(-855)/17823 and -77/24532. 269852 Suppose 2k + 6 - 4 = 0, 4k = q - 391. Let b = q - 367. Calculate the lowest common multiple of 4 and b. 20 Let x = 2936/83 + -3570487/101094. Calculate the common denominator of x and 37/63. 3654 Let k = -53 - -53. Let t be ((-111)/12 - k)/(45/187765). Let n = -38593 - t. Calculate the common denominator of n and 13/6. 36 Let a = -50307/28 - -1800. Find the common denominator of 127/18 and a. 252 Let n = 9/91 + -13775/2184. Find the common denominator of -139/648 and n. 648 Suppose -q - 6 = 5o - 48, -2o - q = -18. Calculate the smallest common multiple of o and ((-15)/(-5))/((-30)/(-20)). 8 Let i be 3(-2 + (-24)/(-9)). Suppose -b = -i - 10. Let d(z) = -3z2 - 24z - 23. What is the smallest common multiple of b and d(-5)? 132 Let a(y) = -y*2 + 7y + 5. Calculate the lowest common multiple of a(6) and (-1)/(1(-9)/45). 55 Let a = 29 + -20. What is the common denominator of (-10)/4 - a/((-378)/833) and ((-10)/(-12))/((-3)/3)? 6 Suppose 0 = 3h - 86 + 77. Let o be (-25914)/(-77904) - 1/h. Let n = o + 104963/12984. Find the common denominator of n and -13/170. 1020 Let y(a) = -24a3 - 4a - 61a2 + 61a*2. Let x be y(3). What is the common denominator of (-3609)/x + 10/55 and 63/20? 20 Suppose -25188 = -22w + 41978. Calculate the least common multiple of 86 and w. 6106 Suppose -s - 10 = 2x - 5s, x = -4s + 13. Calculate the lowest common multiple of 253/69 - x/(-3) and (-147)/(-5) + (-2)/5. 116 What is the common denominator of (1/6)/((-15)/23) and 16346/539(-7)/(-18) + -12? 630 Let i be 153(10/(-3) + 2). What is the common denominator of (i/119)/(-1 + -1) and 16/(-5) + 3 - 1672/(-385)? 7 Let h be 1/1(-8 + -10). Let s be 4/h(-3 - 464298/(-40)). Let k = -2578 - s. Calculate the common denominator of k and -11/10. 30 Let o(a) = -a2 + 6a - 1. Let f be o(5). Let b be (0 - f - -4) + 3. Calculate the smallest common multiple of 20 and b(1 - 0) - 6/(-2). 60 Suppose 0 = -4r - 4, -4r = -10c + 11c - 716. Calculate the lowest common multiple of 912 and c. 13680 Let g = -2/7 + 109/14. Suppose 0 = -z - 117 - 30. Calculate the common denominator of g and (-177)/(-2)7/z. 14 Let w = 54762/85 + -19277703/29920. What is the common denominator of 23/240 and w? 5280 Let u(v) = -391v + 10316. What is the lowest common multiple of 8 and u(22)? 6856 Calculate the common denominator of (99/88)/9 - 3 and (-796)/112 - (-6)/2. 56 Let c(v) = -v3 + 10v*2 + 8v + 35. Let m be c(11). Suppose -g - 1 = ms, 0 = -3g + 2g - 5s - 10. Calculate the smallest common multiple of 45 and g. 45 Suppose 3a + n - 97 = -33, -5a + 2n = -125. Calculate the lowest common multiple of 31 and a. 713 Find the common denominator of (-2)/(-26334)1291 - (-106)/(-1007) and 37/7. 693 What is the common denominator of ((-31)/7)/(59/((-11977)/348)) and 29/28? 84 Let a(v) = v*2 + 6v + 2. What is the smallest common multiple of a(-7) and (1806/172)/(1/2)? 63 Suppose 28s = -63s + 1496 + 142. Calculate the least common multiple of 1392 and s. 4176 Let p = -46331 - -556009/12. Calculate the common denominator of p and (-19)/(-96) + (-1)/(-3). 96 Let x(a) = -9a - 59. Let v(l) = 8l + 49. Let o(b) = 6v(b) + 5x(b). Suppose -3*m + 32 = 11. What is the least common multiple of o(m) and 24? 120 Let i = -111069/4 + 62976215/2268. Calculate the c	{ "pile_set_name": "DM Mathematics" }
= 1251790 + 106360. What is the ten thousands digit of k? 1 Let h be (-4)/7 + (10 - (-7190)/14). Suppose 25 = 5c, 2c + 142 - h = -p. What is the units digit of p? 1 Suppose -4l = -3n - 53, -4n = -4l + 2l + 24. Let d be 40/l - (-7)/49. Suppose y = -dy + 12, -5a + 131 = 2y. What is the tens digit of a? 2 Suppose -22h = -3l - 19h - 5301, 3l = h - 5307. Let z = l + 2567. What is the hundreds digit of z? 7 Let k be (6 - 31/5) + (-22)/(-10). What is the hundreds digit of (-1 + -3 + 79)(3 + k)? 3 Suppose 3 - 9 = 2f + 4k, 5f = -5k - 20. What is the hundreds digit of ((-8)/(-8))/(f/(-4835))? 9 Let a(b) = -2b*3 - 32b*2 + 33b - 13. Let g be a(-17). Suppose 2002 = 2z - 2m, m = 2z - gz + 1987. What is the hundreds digit of z? 9 Let q = 9083 - 3573. What is the hundreds digit of q? 5 Let i(w) = -w*3 - 20w*2 - 24w - 64. Suppose 27p + 742 - 202 = 0. What is the tens digit of i(p)? 1 Let l be ((-1)/(-3))/((-8)/(-8472)). Suppose -o - 3v + l = -0o, o - 4v = 367. Suppose 371 = 10k - o. What is the units digit of k? 3 Let u be 114/27 - 4/18. Let h be (-2)/(0 + u/(-560)). Suppose -3a - 4k = -h, 290 = -a + 4a - k. What is the units digit of a? 6 Let y = 584 + 5726. What is the hundreds digit of y? 3 Suppose -6l + 2833 + 36749 = 0. What is the units digit of l? 7 Suppose -7r = 13 - 27. Let m(u) = 158u3 - 4u*2 + 5u - 4. What is the thousands digit of m(r)? 1 Let b = 1061 + -687. Suppose -6f = -370 - b. What is the hundreds digit of f? 1 Suppose 0 = 41i - 31i - 108930. What is the units digit of i? 3 Let r = 2043 - -16484. What is the hundreds digit of r? 5 Suppose 34k + 120k - 3470576 = 1179762. What is the hundreds digit of k? 1 Let k = -858 - -19087. What is the units digit of k? 9 Suppose y - 12 = 7y. Let d be -2 + (-3 - y) + 3. Suppose -2j + 42 = v, d = 4j + 2v + v - 86. What is the tens digit of j? 2 Let o = 61 - 49. What is the tens digit of 2/3 + 1948/o? 6 Suppose -k - j - 37 = 0, -7k + 3k + 3j - 141 = 0. What is the hundreds digit of -62(-2 + k/8) - 4? 3 Let z(x) = -256x*2 + 448x + 10. Let v(m) = -171m2 + 299m + 7. Let d(y) = 7v(y) - 5z(y). What is the units digit of d(5)? 9 Let s(o) = 5o2 + 8o + 229. What is the tens digit of s(37)? 7 Let l be ((-4)/(-3) + 0)(-3)/(-2). Suppose -s + 432 = 2p, 0 = ls + 2p - 283 - 589. What is the tens digit of s? 4 Suppose 0 = -876i + 880i - 30300. What is the tens digit of i? 7 Let y = -38 + 43. What is the tens digit of 2 - (y - 234) - -3? 3 Let v(b) = b3 + b2 - 4b - 40. Let n(i) = -4i*3 - 2i*2 + 10i + 118. Let c(g) = 5n(g) + 14v(g). What is the tens digit of c(-5)? 1 Suppose 36b + 7513 = 38b - 3q, -2b - q = -7509. What is the tens digit of b? 5 Let z = 10538 + -1219. What is the hundreds digit of z? 3 Let n = 120 - 112. What is the tens digit of (n + (-22)/3)3913? 3 Let q = -36061 - -98593. What is the hundreds digit of q? 5 Let z(k) = 16k2 - 3k - 50. Let w be z(7). Let u = 1249 - w. What is the tens digit of u? 3 Let v be (50/30)/((-2)/(-1332)). Suppose 4b + v = 2i, 0 = 6i - 10i - b + 2229. What is the hundreds digit of i? 5 Suppose -a + 50 = 4a - 5x, -a + 22 = 5x. Suppose 0 = -f - 48 - 31. Let t = a - f. What is the units digit of t? 1 Let g(m) be the second derivative of m5/20 + 25m*4/12 - 11m*3/6 - 29m*2 + 97m. What is the hundreds digit of g(-25)? 2 Let c = -34 - -24. Let j(l) = -l + 6. Let d be j(c). Suppose 13h = dh - 192. What is the units digit of h? 4 Suppose -3238596 = -125t + 601154. What is the ten thousands digit of t? 3 Suppose 0 = -4a - 1487 + 5863. Let h = a - 730. What is the hundreds digit of h? 3 Let d(a) = 406a - 1507. What is the thousands digit of d(20)? 6 Suppose 190k + 2302072 = 6061117 + 11848695. What is the hundreds digit of k? 1 Let k be (113103/(-3))/(-9) + 9. What is the tens digit of k/7 + 72/252? 0 Suppose 4 = -4s, -n - 354 + 1724 = 4s. Let k = 2433 - n. What is the thousands digit of k? 1 Let a(q) = -1 + 126q + 438q + 0 + 6. What is the units digit of a(1)? 9 Let l = 55389 - -5554. What is the hundreds digit of l? 9 Let h be (-2)/27-996 - (-8)/36. Let v = h - -207. What is the tens digit of v? 8 What is the units digit of -3(4/(-6) - (-12 + 124))27? 6 Let h(i) be the third derivative of 0 + 3/10i*5 + 1/3i*3 - 33i*2 + 0i + 1/8i4. What is the units digit of h(2)? 0 Suppose -4k = 3p - 102, 150 = 4p - k - 5. Suppose 35g = pg - 1083. What is the units digit of g? 1 What is the units digit of 495 + 1 + -2 + 514/514? 5 Suppose -5y + 114569 = n, 91690 = -3y + 7y - 5n. What is the hundreds digit of y? 9 Suppose 3684866 = 40m - 8m + 35m. What is the ten thousands digit of m? 5 Suppose 15d = 18d, 0 = -14s + 5d + 94486. What is the thousands digit of s? 6 What is the hundreds digit of (-3670)/(-2) + -3 - (5 - -4 - 1)? 8 Let l = -1012 - -5130. What is the tens digit of l? 1 Suppose o + 45c - 892 = 40c, 0 = 5o - 5c - 4580. What is the hundreds digit of o? 9 Let t = 41 - 38. Let l(m) = -53m*3 + 2m*2 - 2. Let i(u) = 107u*3 - 5u*2 + 5. Let v(j) = ti(j) + 7l(j). What is the tens digit of v(-1)? 5 Let r = 225 - -4244. What is the hundreds digit of r? 4 Suppose -77q = 265q - 5864958. What is the tens digit of q? 4 Suppose -10w = -15820 + 1140. What is the hundreds digit of w? 4 Let r be (3 - 1 - 1) + -160. Let f be (-9 - 11/(-22))10. Let g = f - r. What is the tens digit of g? 7 Let m(f) = f3 - 19f*2 + 57f - 266. What is the units digit of m(19)? 7 Suppose -2i + 2p = 0, -2p + 1 = -2i + p. Let j be (i/2)/((-5)/10). What is the tens digit of (-3)/3j85? 8 Suppose 31440 = -123m + 133m. What is the tens digit of m? 4 Let k(q) = -q*3 + 11q*2 + 12q - 10. Let p be k(12). Let s be (p/(-6))/(5 - (-100)/(-24)). What is the tens digit of ((-942)/(-12))/((-5)/s + 3)? 5 Suppose -195x + 5v = -194x - 13629, -2v = 3x - 40768. What is the hundreds digit of x? 5 Suppose -5g + 10 = 0, 2g = -2p - 3p + 659. Let v = -221 + p. Let h = v + 147. What is the units digit of h? 7 Let z(l) be the third derivative of l5/60 + l4 + 9l3/2 - l2 - 9. What is the hundreds digit of z(11)? 4 Suppose -4d - 4r = 0, 3d - 3r = -4r - 8. What is the units digit of (82/d)/((-2)/603)? 5 Let n(j) = -j*3 + 34j*2 + 211j + 19. What is the hundreds digit of n(23)? 6 Let n = -52 - -56. Suppose l + 3l = -nr + 124, -l + 37 = -2r. Let q = l - 13. What is the units digit of q? 0 Let i(g) = 62g*2 + 111g - 2233. What is the thousands digit of i(19)? 2 Let f be ((-2)/5)/(104/260). Let w(x) = 1 - 3 + x + 3 - 5x3. What is the units digit of w(f)? 5 Let k(m) = -8m*2 - 15m + 4. Let u be k(-4). Let z = -49 - u. Suppose -3t - z - 59 = -d, t = 5. What is the units digit of d? 9 Let y = -22 - -28. Let j be 18((-3 - -2) + 2/y). What is the units digit of (j/18)/(1/(-9))? 6 Suppose 4o - 8 = -3l, -27 + 23 = -2l - 2o. Suppose -16 = -4c, 2q - c - 1648 = c. Suppose l = -5m - m + q. What is the tens digit of m? 3 Let s(a) = a3 + 9a*2 - 41a + 1. Let x be s(-12). Let b = 520 + x. What is the units digit of b? 1 What is the thousands digit of (-3083768)/(-264) + 32/528? 1 What is the units digit of (-8)/(-256) + (-1431166)/(-64)? 2 Let b = -22894 + 32466. What is the hundreds digit of b? 5 Let r(s) = 14s - 2. Let d be r(2). Let t = d + -22. Suppose tj - 355 = -111. What is the units digit of j? 1 What is the tens digit of -1439(-3 + -8 + 7) + -1? 5 What is the thousands digit of (65/26)/((-185)/(-2852404))? 8 Let d(g) = 3g*2 - 5g + 1. Let o be d(6). Let v(w) = 2w3 + 7w*2 + 27w + 84. Let y be v(-4). Let p = y + o. What is the tens digit of p? 3 Suppose 3v = -7x + 4x - 3309, x - 4392 = 4v. Let m = v + 1962. What is the units digit of m? 3 Let v = 21015 - 13869. What is the tens digit of v? 4 Suppose 2a - 4i = 7a + 22, 16 = -3a - i. Let y(x) = 2x3 + 15x*2 + 4x - 2. Let b be y(a). Let u = -48 + b. What is the units digit of u? 4 Let f(h) = -h*3 - 4h*2 + 4h + 3. Let b be f(-5). Suppose 2s = 4g + 740, -bs + 3s = -g - 1805. What is the tens digit of s? 6 Let b(l) = -l*2 + 8l + 35. Let h be b(11). What is the units digit of -2h/4(-176 - 2)? 8 Let v(a) = -a*3 + 14a + 3. Suppose -30 = 7*f + 12. What is the hundr	{ "pile_set_name": "DM Mathematics" }
at most as big as a? False Let n = -2.1 - -1.6. Is n smaller than -0.2? True Let d(h) = -2h3 + h2 - 1. Let s(t) = t3 + 2t*2 - 2t + 2. Let z be s(-3). Let j be d(z). Let p be 3/j4/2. Which is smaller: 4 or p? p Let f = -3.02 - -0.02. Let n = f - -6. Which is greater: -3/5 or n? n Let p = -22 + 21. Which is bigger: p or -4/9? -4/9 Let f be 8/(-52) + (-2)/(-13). Is f at most as big as -1/33? False Suppose p = -3i + 3 - 5, 3i = 2p + 4. Which is greater: p or 1? 1 Let y = 765/7 - 109. Does -1 = y? False Let j = 2.2 - 2. Let w = 0.12 - 0.22. Which is bigger: w or j? j Let x(b) be the first derivative of 9b2/2 - 13b - 3. Let u(i) = 5i - 6. Let l(k) = -5u(k) + 3x(k). Let m be l(7). Is m smaller than -0.1? False Let b = -33 + 61. Let o be (-7 + -1)(-21)/b. Is o equal to 8? False Suppose 0 = -3c + 3n + 12, -2c = -5c - 5n + 4. Which is bigger: c or 0? c Let h be ((-27)/15)/((-1)/5). Let t = h - 6. Which is bigger: -1 or t? t Let u(h) = -2h2 - h3 - 2h2 + 5h - h*2 - 4. Let b be u(-6). Suppose 3x + t = 8, 12 = -5x + 4t - 3. Which is smaller: x or b? x Let w(a) be the third derivative of a*5/60 + 5a*3/6 - 3a*2. Let t be w(0). Let u = -13 - -18. Is u <= t? True Let h(r) = -3r3 - r2 + r - 7. Let c(n) = -13n3 - 3n*2 + 3n - 29. Let i(m) = 2c(m) - 9h(m). Let q be i(-4). Which is bigger: q or -2/9? q Let a be 3 + (0 - -2 - 1). Let c = a - 0. Is c less than or equal to 4? True Let f(j) = -j*2 + 9j. Let t be f(9). Which is greater: t or 2/37? 2/37 Let s = 6/11 - 34/143. Is s less than 1? True Let o be (-16)/(-99) - (-22)/(-121). Which is smaller: 1 or o? o Let z(d) = d*2 + 8d - 9. Let g be z(-9). Is g != 8/7? True Let p = 8 - 8.8. Let i = -0.1 + 0.8. Let s = p + i. Is 6 greater than s? True Let z = 11 - 22. Let c = z + 12. Is c smaller than 4? True Let f(h) = h - 2. Let l be f(2). Suppose lw = 2w + 2. Let m be 1/(-3) - (-2)/3. Which is bigger: w or m? m Suppose 4p = 3f + p + 39, -4f - p - 72 = 0. Is f less than -17? False Let z = 0 - 0.1. Let m = -11.866 + -0.234. Let h = m + 12. Is h >= z? True Let u be ((-8)/(-22))/(-1 + 2). Which is bigger: u or 0? u Let x = -1.9 - -2. Suppose b - 7 = 2s, 5b - 10 - 11 = -4s. Let y be ((-2)/35)/(s/10). Is y less than or equal to x? False Let t be (0 + 1)/(9/(-3)). Let b = 123037/28 + -4392. Let u = b - 17/7. Which is smaller: t or u? t Let z = 34 + -58. Let d be ((-6)/1)/((-15)/10). Let c be (4/z)/(1/d). Which is smaller: c or -2? -2 Suppose -2f = 22 - 50. Which is smaller: 10 or f? 10 Let u(g) = -2g*3 + 19g*2 - 4g - 6. Let q be u(10). Is q at least as big as -146? True Let g be (-2)/(-1) - 1/((-2)/(-46)). Which is bigger: -20 or g? -20 Let w(h) = -2h + 1. Let g be w(0). Let x be g/4 + 25/(-20). Suppose -u + 10 = -6u. Are u and x nonequal? True Let x = -0.52 + -36.48. Which is smaller: -2 or x? x Let t = 3218 + -685432/213. Is t not equal to 1? True Let n(c) = -7c2 - 7c - 2. Let a(m) = -m3 - m2. Let z(t) = -a(t) + n(t). Let g be z(7). Which is smaller: 0 or g? g Let g = 59 - 41. Suppose -g = 4o + 3j - 0, -1 = 3o - 4j. Let i be (o + 2)(-4)/(-3). Is 0 <= i? False Suppose 2 + 0 = -2l. Let a(z) be the second derivative of -z*3/6 - 7z*2/2 + z. Let u be a(-8). Is u at most l? False Let x = -0.21 - -0.15. Let r = -31/3 + 29/3. Is x less than or equal to r? False Let g be (5 + 0 - 1) + 1. Suppose -g - 19 = -3d. Suppose -3s + s = -d. Is s > 5? False Let z(t) = t2 + 13t - 72. Let p be z(-18). Is p greater than or equal to 18? True Suppose 2a + 6 = 3a. Suppose -4w = 5q - 16, aq = q + 3w - 12. Which is smaller: 9 or q? q Let i = 0 - -17. Let x = i + -12. Suppose 2h + 21 = -5l, 4l + x + 11 = -2h. Is 3 bigger than h? True Let i(t) = -4t - 20. Let v be i(-7). Which is greater: v or -3/2? v Let a = -1 - -0.8. Let u = -0.25 - -1.25. Which is smaller: a or u? a Let f = -107 + 108. Let i = -0.2 - -0.1. Which is bigger: i or f? f Suppose 0 = 4a + 3l - 0 - 4, 4l + 28 = 3a. Suppose -am + 11 = -9. Suppose 2s = j - 9, -j - 19 = -0j + ms. Which is smaller: j or 0? 0 Suppose -3s + 4 = -s. Suppose 2a = -sa - 4. Let w be (a/2)/((-2)/4). Which is bigger: -1/6 or w? w Let q(k) = k*3 - 4k*2 + 2k - 5. Let w be q(4). Let n = -3 + w. Which is bigger: -1 or n? n Let y(t) be the first derivative of t*3/3 - 5t*2 + 8t + 2. Let a be y(9). Is a at most as big as 6? True Let j = 91 + -86.1. Let x = j - 4. Let m = 2.9 - x. Is m < -2? False Let c be ((-1)/(-23))/(2 + -3). Is -1/3 at most c? True Suppose 3j + 2h = 85 + 241, h = -j + 107. Let y = 2127/19 - j. Are 0 and y nonequal? True Let s = -107 - -110. Is s greater than or equal to 4? False Suppose 3t = 8 - 23. Which is greater: -6 or t? t Let h(q) = -q3 + 3q*2 - 2. Let f be h(2). Let l be 3 - (-1 - (f + -5)). Let w be ((-20)/15)/((-4)/(-6)). Which is smaller: w or l? w Let s be -2 + 4 - (-6)/(-4). Let i be ((-2)/455)/(2/3). Which is smaller: i or s? i Let y be 4/6 - (-44)/(-12). Which is greater: -2 or y? -2 Let h(c) = -c + 1. Let y be h(-6). Let q be y/3 + (-1)/3. Let s be (-16)/(0 + q) - -1. Is -6 less than or equal to s? False Let u = -7 - -7. Let b be (-2)/8 - 2/4. Is u != b? True Let p = 1.98 - -0.02. Let w = 3 - 4. Let v = 0 - w. Which is smaller: v or p? v Let x be 8/(-20)(3 + -5). Which is smaller: x or 1? x Let k = 4252/657 + -58/9. Is k != -1? True Let p be ((-15)/(-8))/(36/(-48)). Let y be 0 - 2 - (-1 + 1). Is p at least y? False Let r be 3/5 - 26/(-65). Is 2/25 bigger than r? False Suppose -11 - 16 = 3l. Are l and -9 nonequal? False Let h be 5-1 - 3/(-3 + 6). Are -13/2 and h equal? False Let m = 0.23 + -14.23. Let b = 13.9 + m. Which is smaller: b or -13? -13 Let k = 0.27 + -11.27. Let v = -12.4 - k. Are v and -1 equal? False Suppose 0 = 4k - t, -2k = -3t + 7 + 3. Which is smaller: 0 or k? 0 Let w = -0.077 + 0.025. Is 1 > w? True Let w(f) = -4f3 - f + 1. Let l = 16 - 15. Let b be w(l). Is b != -5? True Suppose 62 = -4a - 22. Let d = a - -20. Is d at most -2/31? True Let m = -12 + 11. Is -1/34 smaller than m? False Suppose 0 = -4n + 2r - 6, 3r = -n - r + 12. Let g = -727/63 + 80/7. Which is bigger: n or g? n Let g be 0/2 + 9/(-4). Suppose -8 = h - 2v, 4v + 16 = 2h - 4h. Let b be 3/(-9) - h/(-3). Which is bigger: g or b? g Let x = -26.02 + 26. Is -1 <= x? True Let u be (-39)/84 + 15/20. Suppose 4 = 2o + 2o. Are u and o non-equal? True Let t = 25.33 - 22.4. Let w = t - -0.07. Is w greater than or equal to 1/4? True Let l = -8 + 4. Which is bigger: 0.2 or l? 0.2 Let v(z) = z + 1. Let b be v(2). Suppose 7t = 10t - 6. Which is smaller: t or b? t Let s(k) be the second derivative of k4/12 - k3/6 - 2k. Let v be s(0). Let n be 0 + 0 + (-4)/14. Which is smaller: n or v? n Suppose 4q + c = -3c - 24, 3c = -5q - 22. Let v = 0.6 + -0.3. Do v and q have the same value? False Suppose 5b - 10 + 50 = 0. Let t be (-28)/(-6)6/(-4). Which is greater: b or t? t Let m = -303/385 + -1/77. Which is smaller: m or -1? -1 Let u(w) = -w + 7. Let i be u(5). Suppose -5a + 2 + 13 = 0. Let f = i - a. Which is greater: 1/5 or f? 1/5 Let t = -0.1 + -1.7. Let l = t + 1.8. Which is smaller: 0.04 or l? l Let n be (4 - (0 + 4))/2. Do n and -5/6 have the same value? False Let u = -9/2 + 19/4. Which is bigger: u or 0.03? u Let u = 0.35 - 0.35. Is u > -0.12? True Let t(j) = j. Let p(k) = 6k + 2. Let q(m) = -p(m) - 3t(m). Let a be q(-7). Let s = 303/5 - a. Do 0 and s have different values? True Let j(f) be the first derivative of f3/3 - 5f*2 - 5f + 4. Let y be j(11). Let u be (-3 + 16/y)3. Which is greater: u or 3/11? 3/11 Let s = 28 - 16. Let y be s/4 + 2/2. Is y at most as big as 3? False Let t be 2/(-2)3-1. Let z(d) be the first derivative of -d2/2 + 5d - 3. Let a be z(t). Is 2 greater than or equal to a? True Suppose 0 = -2h - 4r + 22, -4r - r + 5 = -2h. Suppose 0 = -3u - 7 - 2, 2a + hu = -19. Are -2 and a equal? True Let m = -20 - -12. Let x = m + 6. Suppose 2q = -4 + 2. Which is smaller: x or q? x Let m be ((-62)/(-3))/(10/715). Let v = m - 22597/15. Let h = v - -1574/55. Is -1 at least h? False Suppose -y - 27 = 4y + 2c, 5y + 20 = 5c. Let n = y + 8. Does 2 = n? False Let b = 39 + -37. Let i be 1-1(-3 + 2). Which is greater: b or i? b Let o = -	{ "pile_set_name": "DM Mathematics" }
inder when 398 is divided by 258. 140 What is the remainder when 9245 is divided by 18? 11 What is the remainder when 1193 is divided by 394? 11 What is the remainder when 16868 is divided by 148? 144 What is the remainder when 11230 is divided by 11? 10 Calculate the remainder when 169 is divided by 40. 9 Calculate the remainder when 282 is divided by 80. 42 What is the remainder when 484 is divided by 9? 7 What is the remainder when 235 is divided by 96? 43 What is the remainder when 100 is divided by 2? 0 Calculate the remainder when 498 is divided by 105. 78 What is the remainder when 428 is divided by 54? 50 What is the remainder when 272 is divided by 21? 20 Calculate the remainder when 41 is divided by 18. 5 What is the remainder when 130 is divided by 59? 12 What is the remainder when 424 is divided by 13? 8 Calculate the remainder when 1951 is divided by 93. 91 What is the remainder when 410 is divided by 25? 10 What is the remainder when 230 is divided by 34? 26 What is the remainder when 2133 is divided by 22? 21 Calculate the remainder when 583 is divided by 98. 93 Calculate the remainder when 45 is divided by 23. 22 What is the remainder when 206 is divided by 58? 32 What is the remainder when 3638 is divided by 14? 12 Calculate the remainder when 7821 is divided by 289. 18 What is the remainder when 275 is divided by 30? 5 What is the remainder when 848 is divided by 209? 12 What is the remainder when 1877 is divided by 4? 1 Calculate the remainder when 748 is divided by 58. 52 What is the remainder when 2105 is divided by 124? 121 Calculate the remainder when 104 is divided by 22. 16 Calculate the remainder when 1676 is divided by 35. 31 Calculate the remainder when 502 is divided by 142. 76 Calculate the remainder when 914 is divided by 66. 56 Calculate the remainder when 394 is divided by 57. 52 Calculate the remainder when 42 is divided by 9. 6 What is the remainder when 920 is divided by 19? 8 Calculate the remainder when 237 is divided by 49. 41 Calculate the remainder when 632 is divided by 313. 6 Calculate the remainder when 105 is divided by 22. 17 Calculate the remainder when 1002 is divided by 437. 128 What is the remainder when 3636 is divided by 281? 264 What is the remainder when 142 is divided by 59? 24 Calculate the remainder when 83 is divided by 54. 29 Calculate the remainder when 581 is divided by 8. 5 Calculate the remainder when 3470 is divided by 184. 158 Calculate the remainder when 154 is divided by 12. 10 Calculate the remainder when 556 is divided by 92. 4 What is the remainder when 1793 is divided by 78? 77 Calculate the remainder when 406 is divided by 143. 120 Calculate the remainder when 264 is divided by 51. 9 Calculate the remainder when 210 is divided by 37. 25 What is the remainder when 75 is divided by 19? 18 Calculate the remainder when 409 is divided by 31. 6 Calculate the remainder when 208 is divided by 11. 10 Calculate the remainder when 369 is divided by 31. 28 What is the remainder when 129 is divided by 20? 9 Calculate the remainder when 312 is divided by 45. 42 Calculate the remainder when 68 is divided by 4. 0 What is the remainder when 78 is divided by 43? 35 Calculate the remainder when 549 is divided by 140. 129 Calculate the remainder when 2141 is divided by 17. 16 What is the remainder when 317 is divided by 2? 1 Calculate the remainder when 885 is divided by 294. 3 What is the remainder when 87 is divided by 46? 41 What is the remainder when 6044 is divided by 93? 92 Calculate the remainder when 121 is divided by 92. 29 What is the remainder when 130 is divided by 19? 16 What is the remainder when 2357 is divided by 59? 56 Calculate the remainder when 418 is divided by 28. 26 What is the remainder when 890 is divided by 12? 2 Calculate the remainder when 71 is divided by 18. 17 What is the remainder when 313 is divided by 303? 10 What is the remainder when 29914 is divided by 9? 7 What is the remainder when 136 is divided by 35? 31 What is the remainder when 492 is divided by 26? 24 Calculate the remainder when 266 is divided by 63. 14 What is the remainder when 175 is divided by 16? 15 Calculate the remainder when 825 is divided by 205. 5 What is the remainder when 128 is divided by 11? 7 Calculate the remainder when 94 is divided by 24. 22 Calculate the remainder when 359 is divided by 73. 67 What is the remainder when 259 is divided by 66? 61 What is the remainder when 2516 is divided by 72? 68 Calculate the remainder when 945 is divided by 74. 57 What is the remainder when 526 is divided by 86? 10 Calculate the remainder when 270 is divided by 34. 32 Calculate the remainder when 536 is divided by 16. 8 Calculate the remainder when 33574 is divided by 25. 24 What is the remainder when 502 is divided by 44? 18 Calculate the remainder when 483 is divided by 4. 3 What is the remainder when 36 is divided by 14? 8 Calculate the remainder when 79 is divided by 24. 7 What is the remainder when 4344 is divided by 394? 10 What is the remainder when 221 is divided by 139? 82 Calculate the remainder when 223 is divided by 71. 10 Calculate the remainder when 337 is divided by 68. 65 What is the remainder when 2962 is divided by 38? 36 What is the remainder when 34 is divided by 15? 4 Calculate the remainder when 120 is divided by 33. 21 Calculate the remainder when 31 is divided by 12. 7 What is the remainder when 166 is divided by 22? 12 What is the remainder when 1617 is divided by 45? 42 What is the remainder when 1607 is divided by 95? 87 What is the remainder when 3216 is divided by 37? 34 What is the remainder when 9499 is divided by 76? 75 What is the remainder when 278 is divided by 155? 123 Calculate the remainder when 925 is divided by 101. 16 Calculate the remainder when 365 is divided by 6. 5 Calculate the remainder when 50 is divided by 6. 2 Calculate the remainder when 152 is divided by 14. 12 Calculate the remainder when 103 is divided by 21. 19 Calculate the remainder when 95930 is divided by 153. 152 What is the remainder when 4434 is divided by 29? 26 Calculate the remainder when 1732 is divided by 178. 130 What is the remainder when 269 is divided by 30? 29 Calculate the remainder when 34 is divided by 11. 1 What is the remainder when 169 is divided by 52? 13 Calculate the remainder when 347 is divided by 59. 52 What is the remainder when 42 is divided by 20? 2 What is the remainder when 1114 is divided by 15? 4 Calculate the remainder when 5935 is divided by 56. 55 Calculate the remainder when 2159 is divided by 60. 59 Calculate the remainder when 956 is divided by 43. 10 What is the remainder when 4778 is divided by 954? 8 Calculate the remainder when 255 is divided by 70. 45 Calculate the remainder when 1024 is divided by 18. 16 What is the remainder when 3065 is divided by 26? 23 What is the remainder when 1374 is divided by 27? 24 What is the remainder when 202 is divided by 42? 34 Calculate the remainder when 6883 is divided by 153. 151 What is the remainder when 1292 is divided by 148? 108 Calculate the remainder when 62 is divided by 23. 16 What is the remainder when 1895 is divided by 16? 7 Calculate the remainder when 279 is divided by 65. 19 What is the remainder when 1151 is divided by 185? 41 What is the remainder when 9 is divided by 7? 2 Calculate the remainder when 234 is divided by 44. 14 What is the remainder when 981 is divided by 31? 20 Calculate the remainder when 90 is divided by 13. 12 Calculate the remainder when 350 is divided by 69. 5 Calculate the remainder when 111 is divided by 98. 13 Calculate the remainder when 305 is divided by 117. 71 What is the remainder when 58 is divided by 6? 4 What is the remainder when 369 is divided by 54? 45 What is the remainder when 249 is divided by 68? 45 Calculate the remainder when 13572 is divided by 20. 12 Calculate the remainder when 39 is divided by 21. 18 What is the remainder when 8007 is divided by 89? 86 Calculate the remainder when 122 is divided by 41. 40 Calculate the remainder when 656 is divided by 216. 8 Calculate the remainder when 2783 is divided by 42. 11 Calculate the remainder when 362 is divided by 31. 21 What is the remainder when 3118 is divided by 120? 118 What is the remainder	{ "pile_set_name": "DM Mathematics" }
64. 2, 19079 List the prime factors of 750867. 3, 13, 1481 List the prime factors of 801508. 2, 151, 1327 What are the prime factors of 888634? 2, 41, 10837 List the prime factors of 2869766. 2, 1434883 List the prime factors of 121168. 2, 7573 What are the prime factors of 1069540? 2, 5, 53, 1009 List the prime factors of 232529. 11, 21139 List the prime factors of 502272. 2, 3, 109 List the prime factors of 607062. 2, 3, 23, 53, 83 What are the prime factors of 7650469? 2179, 3511 List the prime factors of 3901043. 3901043 What are the prime factors of 3604588? 2, 13, 103, 673 List the prime factors of 586875. 3, 5, 313 What are the prime factors of 202250? 2, 5, 809 List the prime factors of 345605. 5, 13, 409 What are the prime factors of 620127? 3, 68903 What are the prime factors of 900646? 2, 401, 1123 List the prime factors of 6685117. 6685117 What are the prime factors of 15485037? 3, 5161679 List the prime factors of 127078. 2, 7, 29, 313 What are the prime factors of 348753? 3, 101, 1151 What are the prime factors of 2157163? 2157163 List the prime factors of 233. 233 List the prime factors of 19905875. 5, 11, 31, 467 List the prime factors of 1625320. 2, 5, 179, 227 What are the prime factors of 21209324? 2, 29, 182839 What are the prime factors of 761898? 2, 3, 23, 5521 What are the prime factors of 1317172? 2, 329293 List the prime factors of 194473. 113, 1721 What are the prime factors of 25149046? 2, 13, 19, 50909 List the prime factors of 11760955. 5, 2352191 What are the prime factors of 63608? 2, 7951 What are the prime factors of 2458325? 5, 107, 919 List the prime factors of 818806. 2, 43, 9521 List the prime factors of 687859. 31, 22189 List the prime factors of 1382246. 2, 37, 18679 What are the prime factors of 1363034? 2, 139, 4903 List the prime factors of 2708055. 3, 5, 7, 8597 List the prime factors of 1796025. 3, 5, 7, 11, 311 List the prime factors of 74680. 2, 5, 1867 List the prime factors of 750633. 3, 13, 19, 1013 What are the prime factors of 2196020? 2, 5, 19, 5779 What are the prime factors of 7574800? 2, 5, 29, 653 List the prime factors of 11289549. 3, 31, 233, 521 List the prime factors of 2709726. 2, 3, 451621 List the prime factors of 6339566. 2, 3169783 List the prime factors of 390170. 2, 5, 11, 3547 What are the prime factors of 49449? 3, 53, 311 What are the prime factors of 2736253? 13, 210481 What are the prime factors of 7827769? 17, 137, 3361 List the prime factors of 90930. 2, 3, 5, 7, 433 What are the prime factors of 27136961? 659, 41179 List the prime factors of 398561. 41, 9721 What are the prime factors of 144182? 2, 72091 What are the prime factors of 7161027? 3, 23, 67, 1549 What are the prime factors of 1187467? 17, 23, 3037 What are the prime factors of 4752380? 2, 5, 237619 List the prime factors of 507073. 7, 107, 677 List the prime factors of 112343. 7, 11, 1459 What are the prime factors of 1422685? 5, 11, 25867 What are the prime factors of 73224? 2, 3, 113 What are the prime factors of 6075166? 2, 3037583 What are the prime factors of 988076? 2, 19, 13001 What are the prime factors of 119438? 2, 11, 61, 89 List the prime factors of 176779. 176779 What are the prime factors of 3553815? 3, 5, 79, 2999 What are the prime factors of 1326702? 2, 3, 13, 73, 233 What are the prime factors of 6259131? 3, 47, 14797 What are the prime factors of 3565364? 2, 11, 81031 What are the prime factors of 219282? 2, 3, 7, 23, 227 What are the prime factors of 6475421? 773, 8377 What are the prime factors of 13750382? 2, 17, 404423 List the prime factors of 5157789. 3, 7, 13, 2699 What are the prime factors of 2342531? 919, 2549 What are the prime factors of 1030884? 2, 3, 271, 317 What are the prime factors of 5314348? 2, 13, 102199 What are the prime factors of 2544037? 79, 32203 What are the prime factors of 4906582? 2, 2453291 What are the prime factors of 3732577? 3732577 List the prime factors of 4338529. 13, 107, 3119 List the prime factors of 8970572. 2, 13, 167, 1033 List the prime factors of 1085261. 19, 57119 List the prime factors of 159224. 2, 13, 1531 List the prime factors of 525912. 2, 3, 17, 1289 List the prime factors of 17530431. 3, 5843477 What are the prime factors of 1251303? 3, 37, 11273 List the prime factors of 1914227. 7, 151, 1811 What are the prime factors of 33638701? 33638701 What are the prime factors of 960678? 2, 3, 19, 53 List the prime factors of 306839. 13, 23603 List the prime factors of 11907261. 3, 23, 41, 61 List the prime factors of 1588693. 59, 26927 List the prime factors of 7960941. 3, 173, 5113 What are the prime factors of 249727? 249727 List the prime factors of 1235808. 2, 3, 7, 613 List the prime factors of 1127493. 3, 41759 What are the prime factors of 634611? 3, 199, 1063 What are the prime factors of 5445418? 2, 11, 247519 What are the prime factors of 3467016? 2, 3, 7, 2293 List the prime factors of 6339558. 2, 3, 367, 2879 List the prime factors of 27963073. 47, 594959 What are the prime factors of 229243? 7, 32749 What are the prime factors of 1878767? 11, 15527 List the prime factors of 103369. 7, 14767 What are the prime factors of 419849? 17, 24697 What are the prime factors of 601588? 2, 13, 23, 503 List the prime factors of 46991. 7, 137 List the prime factors of 89402. 2, 44701 What are the prime factors of 1241830? 2, 5, 124183 What are the prime factors of 727534? 2, 363767 List the prime factors of 1332416. 2, 109, 191 List the prime factors of 4169833. 73, 239 What are the prime factors of 5551638? 2, 3, 925273 What are the prime factors of 877022? 2, 73, 6007 What are the prime factors of 27540157? 27540157 What are the prime factors of 5966052? 2, 3, 497171 List the prime factors of 312798. 2, 3, 37, 1409 List the prime factors of 153134. 2, 23, 3329 List the prime factors of 3018005. 5, 31, 19471 What are the prime factors of 3743729? 11, 340339 List the prime factors of 3072273. 3, 1024091 List the prime factors of 4365897. 3, 281, 5179 What are the prime factors of 9667922? 2, 11, 19, 101, 229 What are the prime factors of 1453213? 557, 2609 List the prime factors of 122425. 5, 59, 83 List the prime factors of 561043. 7, 80149 List the prime factors of 317747. 17, 18691 List the prime factors of 171409. 7, 47, 521 What are the prime factors of 100262? 2, 50131 List the prime factors of 1220273. 977, 1249 List the prime factors of 17873573. 557, 32089 What are the prime factors of 378760? 2, 5, 17, 557 What are the prime factors of 498442? 2, 7, 35603 List the prime factors of 10968850. 2, 5, 219377 List the prime factors of 1364751. 3, 19, 23, 347 List the prime factors of 857862. 2, 3, 47659 List the prime factors of 222610. 2, 5, 113, 197 What are the prime factors of 141973? 13, 67, 163 List the prime factors of 94025. 5, 3761 What are the prime factors of 3807267? 3, 457, 2777 List the prime factors of 101428. 2, 25357 What are the prime factors of 357341? 47, 7603 What are the prime factors of 128314? 2, 64157 List the prime factors of 717973. 557, 1289 What are the prime factors of 712014? 2, 3, 118669 List the prime factors of 777134. 2, 388567 What are the prime factors of 2444483? 19, 128657 List the prime factors of 89708. 2, 41, 547 List the prime factors of 327170. 2, 5, 32717 List the prime factors of 4248. 2, 3, 59 What are the prime factors of 910553? 7, 130079 List the prime factors of 355893. 3, 97, 1223 What are the prime factors of 464541? 3, 7, 11, 2011 What are the prime factors of 830961? 3, 127, 727 List the prime factors of 22452. 2, 3, 1871 List the prime factors of 189563. 11, 19, 907 What are the prime factors of 1734960? 2, 3, 5, 7229 What are the prime factors of 25229202? 2, 3, 619, 6793 What are the prime factors of 172229? 157, 1097 List the prime factors of 148891. 148891 What are the prime factors of 3878888? 2, 13, 19, 151 What are the prime factors of 6858719? 7, 31, 31607 What are the prime factors of 1732773? 3, 7, 109, 757 What are the prime factors of 1009660? 2, 5, 19, 2657 What are the prime factors of 26608119? 3, 8869373 What are the prime factors of 2643269? 53, 941 List the prime factors of 6679585. 5, 11, 121447 List the prime factors of 317931. 3, 105977 What are the prime fac	{ "pile_set_name": "DM Mathematics" }
54 - 189. Calculate the lowest common multiple of 30 and a. 90 Let k(d) = -2d - 8. Let i = 6 - 4. Let b be 1(-1)/(i/26). What is the least common multiple of k(b) and 10? 90 Suppose -7 + 4 = -o. Calculate the common denominator of ((-2)/(-48))/(o/426) and 111/(-36) - (-7 + (-721)/(-105)). 60 Suppose -3p + 40 = p. Suppose 2y + 5 = -3y. Calculate the lowest common multiple of 616/33(10/4 + y) and p. 140 Let l = 3884650268/14280673 + -2130550/7743. Let v = 1/3018 + l. Find the common denominator of 3/9 + (-94)/(-12) and v. 66 Let n = 52679 - 6005455/114. Find the common denominator of n and (-6)/21 + ((-1486)/14)/(9 + 1). 570 Let j(n) = -n - 6n + 4n. What is the smallest common multiple of j(-2) and 44? 132 Let j = -913 - -21907/24. Find the common denominator of j and -49/18. 72 Suppose 4a + n = -3n + 64, -3n = 6. Suppose 0 = -43j + 17j + 702. Calculate the least common multiple of a and j. 54 Let w = 561 - 549. Let v = 11 - 8. What is the lowest common multiple of w and v? 12 Let s = 5763 + -5717. Suppose 0o + 2o = 0. What is the common denominator of 68/28(o + 1) and s? 7 Let q = 26831/4 + -9865. Let s = q - -3139. Let f = 229/12 + 5/12. Find the common denominator of s and f. 4 Let d(o) = -o + 37. Let h be d(19). What is the least common multiple of 178 and 4/(-18) - (-328)/h? 1602 Let f = -13 + 16. Suppose 3k + 16 = fn + k, -k + 4 = 0. Let z = 2 - -3. What is the least common multiple of n and z? 40 Let b = -2 + 14. Let n = b - 2. What is the smallest common multiple of 45/n + 3/(-6) and 7? 28 Let r(i) = -2i + 2. Let f be (3 - 1) + (-4)/2. What is the lowest common multiple of (-6 - f)1/(-2) and r(-4)? 30 Suppose r = 3m + 25, 62 = 5r + 3m - 9. What is the least common multiple of 12 and r? 48 Let m = -3 + 13. Suppose 0 = t + 4 - 15. Calculate the smallest common multiple of (m/(-4))/((-10)/20) and t. 55 Suppose 0b + 6 = b - 4d, -2d - 30 = -5b. Calculate the smallest common multiple of b and 56. 168 Let n = -2566/5 + 516. Let d be 8/6223/4. Let p = 421/6 - d. Find the common denominator of p and n. 30 Let h = -40 + 69. What is the common denominator of 236/20 + 1 - 3 and h? 5 Let f be 4 + 0 - (3 + -3). Suppose 5i - 5 = 3p, 4p = i - p + 21. Suppose 32 + i = fz. Calculate the lowest common multiple of 8 and z. 72 Let i be (-8)/(-5 + 3) + (1 - 3). Let q(n) = n*3 - 3n*2 + 3n. What is the least common multiple of q(i) and 18? 18 Let h = -9/53 + -661/477. Find the common denominator of (-381)/121/3 and h. 36 Let u(m) = -m3 + 13m2 - m + 12. Let f be u(13). What is the lowest common multiple of 4 and ((-210)/(-75))/(f/(-5))? 28 Let w = -43 - -72. Let g = w + -10. Find the common denominator of 87/8 and (g/(-27))/((-2)/(-15)). 72 Let m = 673 - 2018/3. Find the common denominator of m and 3/41. 123 Let c(t) = t2 - 2t - 1. Let q be c(-2). Suppose 4k - q = 17. Let r(n) = 22n - 510. What is the least common multiple of k and r(24)? 18 Let j = 230960/1177393 - 217808521036/93754627197. Let r = j - -14/2413. Calculate the common denominator of r and -44/27. 297 What is the common denominator of 27/14 and (-7 - (-16471)/1904) + -2? 1904 Let r be (-8885)/4442 - 12/(-6). Let v = r + 76628/15547. Calculate the common denominator of v and ((-18)/(-54))/(1/18310). 70 Find the common denominator of -82/45 and ((-1363)/3384)/((-1)/5). 360 Calculate the common denominator of (-19795)/296(1 + 17/(-15)) and 95/44. 132 Let m be ((-36)/(-12))/((-2)/18). Let q = m + 38. Calculate the least common multiple of q and 2. 22 Let i = 74 + 5. Let h = -71 + i. Calculate the least common multiple of 8 and h. 8 Suppose 34h + 2l + 30 = 36h, h = 5l + 43. Let p(x) = -4x + 4 - x3 + x2 - x + 5x2. What is the least common multiple of h and p(4)? 16 Let i be 88/2 + (-2)/1. Let g = i - 21. Calculate the smallest common multiple of (-2(-18)/20)/(11 - 1026/95) and g. 63 Let h(u) = 2u2 + 15u + 7. What is the lowest common multiple of h(-11) and 132? 924 What is the common denominator of (-1144)/720 - 3/(2 + -17) and 73/54? 54 Let w = -57/2 + 6. Let y = -75 + 348. Let a = y + -1351/5. Find the common denominator of w and a. 10 What is the common denominator of 24/25 and (-1026)/(-150) - 9 - (-1)/5? 25 Let c = 1303/14 + -27445/294. Calculate the common denominator of c and -55/168. 1176 Let g = 2679/169 - 692741/45630. What is the common denominator of g and 97/90? 270 Calculate the least common multiple of 63 and ((-35)/(-6) - (-176)/(-132))2. 63 Let y(n) = 2n + 405. Let g be y(0). Calculate the common denominator of 5/66 and (-1 - -4) + g/(-150). 330 Let k = -1407314/2805 + -4106/255. Let l = 193081/374 + k. Find the common denominator of l and -73/6. 102 Let s = -151 + 227. Suppose s = -5m + 24m. Calculate the smallest common multiple of m and 2. 4 Suppose -8 = -2n + 2. Suppose -ni - 28 = 2w, -6i + i + 4w = 4. Let m(p) = -6p - 6. Calculate the lowest common multiple of 10 and m(i). 90 Let k(u) = 5u + 8. Let q be k(4). Let b be (-72)/q(-42)/9. What is the common denominator of ((-1190)/b)/7 - 3 and 29/18? 18 Let s = -34181/10 + 3414. What is the common denominator of -55/116 and s? 580 Let u = -77/201 - -13391/9246. Find the common denominator of u and 21/20. 460 Suppose 1 + 9 = t + 5p, -4 = -4p. Suppose 0 = -5w - 3l + 90, -w = -4w - tl + 54. Let r = -2 + 22. Calculate the least common multiple of r and w. 180 Let u = -42 + 39. Calculate the lowest common multiple of 14 and u/(-9) - (-140)/12. 84 Let r(m) = m*3 + 10m*2 + 11m + 18. Let h be r(-9). What is the common denominator of (-99)/(-21) + 1 - h and 85/12? 84 Suppose 2k + 0 = 36. What is the smallest common multiple of k and (-12)/(49/(-14) + (-10)/(-4))? 36 Let z(r) = -r2 + 5r + 6. Let a be z(-3). Let v = a - -8. Let g = 17 + v. What is the least common multiple of 9 and g? 63 Let f = -13 - -8. Let p(q) = -q*2 - 9q - 10. What is the least common multiple of p(f) and 5? 10 Let h(v) = v*3 - 4v2 - 4. Let x be h(4). Let b(n) be the first derivative of n3/3 + 5n2/2 + 6n + 20. What is the lowest common multiple of b(x) and 7? 14 Let o be (-3)/(9/3) + 2/1. Let x = 728 - 7189/10. Calculate the common denominator of x and 4o/2 - 155/(-10). 10 Calculate the common denominator of 31/2 and 52/12033 - 4. 10 Let y = -6385/24 + 266. Let x = -853 - -7721/9. What is the common denominator of x and y? 72 Let o = 215 - 185. What is the lowest common multiple of o and 15? 30 Let p = -6 + 21. Let j be -4 + p - (-2 + 1). Suppose 0 = -4z - 2c + 10 + j, -c = 3z - 19. What is the smallest common multiple of z and 24? 24 Let j = 10989 + -15846141/1442. Let q = j + 27766/3605. Calculate the common denominator of -41/14 and q. 70 Let d = -5 - -11. Let o be d/(-39) + 485532/(-286). Let f = -1694 - o. Calculate the common denominator of 89/6 and f. 66 Suppose 21x = 20x + 3. Suppose 5i - 13 = -x. Suppose 13 = 5v - 2c, 0 = v - c - 0 - i. Calculate the lowest common multiple of v and 7. 21 Find the common denominator of 24/203 and (-50)/(-105)36/5. 203 Let n be 6/(-10) + (-189)/(-15). Suppose -b + 5o - 46 = b, 3o + n = 0. Find the common denominator of -87/16 and 2/b126/8. 176 Let h = -6/10603 - -435035/551356. Let w = 218339/14 + -15602. Calculate the common denominator of w and h. 364 Let j be 2 - (4 - -2)/3. Suppose j = i + 2i - 204. Suppose 5u + 2h = 2u + i, 0 = u + 2h - 24. What is the smallest common multiple of u and 16? 176 Let d = -3653 + 7807. Let g = d - 45750/11. Calculate the common denominator of (-42)/(-5)(-18)/21 and g. 55 Find the common denominator of (2/(-2310)-11)/((-4)/(-159)) and 67/22. 1540 Suppose 3a + 1 = 4. Let w be ((-6)/(-10))/(a/5). What is the common denominator of -13/2 and w/(-60)327/(-6)? 40 Let s(z) = z2 - 2z + 13. What is the least common multiple of s(-5) and 6? 48 Let n = 481/48 - 2425/176. Let t = n + 155/11. What is the common denominator of 2/8 + 346/88 and t? 33 Let y be (-4 - -6) + 33/(-3). Let b be (-4732)/(-848)y/(-6). Let k = -40/53 - b. Find the common denominator of -57/22 and k. 88 Suppose -505 = -6j - 445. What is the least common multiple of j and 16? 80 Let d be 1/10*(-256)/6. Let p = d - -25/6. What is the common denominator of p and 41/9? 90 Calculate the common denominator of 101/8	{ "pile_set_name": "DM Mathematics" }
. 522 Let k(v) = 27v - 19v - 5 - 24v - 21v*2. Let m(x) = -64x*2 - 48x - 16. Let g(j) = -16k(j) + 5m(j). What is the second derivative of g(a) wrt a? 32 Suppose 0 = 72k - 814 + 22. Let p(z) be the second derivative of 0z3 + 0 - z2 + kz - 1/10z*5 + 0z*4. What is the derivative of p(g) wrt g? -6g*2 Let x(g) be the first derivative of 10 + 0g*5 - 5/7g*7 - 8/3g*3 + 0g*2 + 0g*4 + 0g*6 + 0g. Find the third derivative of x(o) wrt o. -600o3 Differentiate 456y*3 - 229y*3 + 4y*4 + 22 - 223y*3 wrt y. 16y*3 + 12y2 Let z(l) = -l - 4 - l3 - 2l - l - 3l*2. Let m be z(-2). What is the derivative of ma*3 - 11a*3 - 3 + 13 wrt a? -33a*2 What is the third derivative of 22o*5 - 2o*3 - 172o - 8o2 + 183o + 4o2 wrt o? 1320o*2 - 12 Let b(z) be the third derivative of 0z*3 + 7/24z*4 + 0z*5 + 0 + 0z + 1/20z6 + 27z*2 - 2/105z*7. What is the second derivative of b(j) wrt j? -48j*2 + 36j Suppose -b = -6b - 20, 3b + 4 = -4p. What is the second derivative of -x + 6x*p + 0x + 13x wrt x? 12 Let h(t) be the third derivative of 3t*2 + 0 + 0t*5 + 0t + 7/24t4 - 1/15t*7 + 0t*6 + 0t*3. What is the second derivative of h(w) wrt w? -168w*2 Let z(d) = -3d - 4. Let p be z(-2). Find the third derivative of -6o2 - 4o*2 - 2o*5 + 13o*5 + 3o*p wrt o. 660o*2 Let s(h) = -17h*3 - 9. Let o(r) = 1. Suppose 12 = -4d, -5d + 13 - 52 = 4v. Let f(i) = vo(i) - s(i). Differentiate f(p) with respect to p. 51p*2 Let i = -3 + 5. Differentiate -58b*i + 58b*2 - 11b*4 - 17 wrt b. -44b*3 Let s(a) be the third derivative of 0a*5 + 0a*3 + 1/10a*6 + 0 + 17/24a*4 + 0a - 5a2. What is the second derivative of s(h) wrt h? 72h Find the second derivative of 118a3 + 39 - 3a*2 + 30 + 3a*2 - a wrt a. 708a Let y(p) be the first derivative of -93p5/5 - p2 + 2p - 64. Find the second derivative of y(m) wrt m. -1116m2 Let y(l) = 950l*3 - 112l*2 - 3l - 11. Let g(r) = -316r3 + 37r*2 + r + 4. Let x(c) = -11g(c) - 4y(c). What is the third derivative of x(q) wrt q? -1944 Let m(d) be the first derivative of 0d*2 - 5 + 0d - d*7 + 0d*6 + 0d*4 + 0d*5 + 19/3d*3. What is the third derivative of m(o) wrt o? -840o*3 Let x be (-3)/(-9 + 0)18. Let d = -2 + x. Find the third derivative of -4i2 + 3i*2 - di*2 + 3i*6 wrt i. 360i*3 Find the second derivative of 27h*5 + 4h*3 + 17h - 4h3 + 3h*5 - 6h wrt h. 600h3 Let y(a) = 3a*2 - 7a - 3. Let c be y(4). What is the second derivative of -9t + ct - 8t + 10t*2 - 11t wrt t? 20 Let b(h) be the third derivative of -h*7/105 - 7h6/40 + h5/30 - 35h4/12 + h2 - 3. Find the third derivative of b(l) wrt l. -48l - 126 Let k(r) be the second derivative of 46r3/3 + 36r*2 + 2r - 56. Differentiate k(j) with respect to j. 92 Suppose -2v = -10v + 304. Find the second derivative of 31h + vh*5 - 53h*3 + 53h*3 wrt h. 760h*3 Let f(a) = -2a*4 + 4a*2 + 4a - 101. Let t(q) = -3q4 + 3q*2 + 3q - 100. Let i(z) = 3f(z) - 4t(z). What is the derivative of i(d) wrt d? 24d3 Let x(p) be the first derivative of 0p*2 + 0p - 9 + 0p5 + 2p*6 + 0p*4 + 1/3p*3. What is the third derivative of x(j) wrt j? 720j*2 Let s(c) be the third derivative of 169c6/120 - c4/24 + 2c3/3 + 48c*2 - 1. What is the second derivative of s(r) wrt r? 1014r Let g = 8 - -2. Suppose 0 = 2w + 3w - g. Find the third derivative of 2m3 - 5m*3 + 6mw - m3 - 2m3 wrt m. -36 Let d(a) be the third derivative of 79a*4/24 - 28a*3 - 155a*2. Differentiate d(y) with respect to y. 79 Find the second derivative of -112a - a*5 + 28a*3 + 52a - 4a3 wrt a. -20a*3 + 144a Let v(t) be the third derivative of -3t7/5 + 14t5/15 + t4/4 + 48t2 - 4. What is the third derivative of v(s) wrt s? -3024s Let c(b) = -224b2 - 568b. Let a(j) = 224j2 + 561j. Let u(g) = -2a(g) - 3c(g). Find the second derivative of u(m) wrt m. 448 Let h(w) be the third derivative of 63w6/40 - 71w*3/3 + 115w*2 - 2. Differentiate h(a) wrt a. 567a*2 Let v be ((-21)/(-6) - 4)-10. Find the second derivative of 5m - m - 5m*v - 8m*5 + 5m wrt m. -260m3 Let h(o) be the first derivative of -3o*8/28 + 13o*4/4 + 29o - 20. Let s(y) be the first derivative of h(y). Find the third derivative of s(c) wrt c. -720c3 Let k be (1/2 - 0)6. Let s = 213 + -210. What is the second derivative of -2n - 10n*s + kn*3 + 7n - 2n wrt n? -42n Let i(t) be the third derivative of 16t2 + 23/60t*5 + 0t*3 + 0t - 5/24t4 + 0. What is the second derivative of i(n) wrt n? 46 Let r(c) = 9c2 + 32. Let d(b) be the second derivative of -b4/12 - b*2/2 + 21b. Let i(m) = 4d(m) - r(m). What is the derivative of i(k) wrt k? -26k Suppose 0n - 2n - 4q - 18 = 0, 5n - 5q = 0. Let y be 9 - (-2 + 3 - n). Find the second derivative of o5 + 18o - 11oy - 13o wrt o. -200o3 Let k(v) be the third derivative of 103v*4/12 + 553v*3/6 + 12v*2 - 14v. What is the first derivative of k(w) wrt w? 206 Let y(q) = 367q2 + 13q - 202. Let h(u) = -182u2 - 6u + 101. Let f(a) = -5h(a) - 2y(a). Find the second derivative of f(d) wrt d. 352 Let b = 66 + -43. Suppose -2t = -33 + b. What is the second derivative of 2z + 8z - 11z*4 - tz wrt z? -132z2 Let h(g) = -g. Let k(r) = -11r*2 + 2r + 61. Let s(u) = h(u) - k(u). What is the derivative of s(v) wrt v? 22v - 3 Suppose 43f = 45f - 138. Differentiate -69a*3 + 4a*4 + fa*3 + 9 wrt a. 16a*3 Let r be (-7)/((-7)/(-33))-1. Let g be 93/r - (-2)/11. What is the derivative of -v*4 + 1 - 2v*4 + g wrt v? -12v*3 Suppose 3z + 15 = 8z. Suppose -3 = -3l + 12. Find the second derivative of -16bz + lb*4 + 5b + 16b3 wrt b. 60b*2 Suppose -2d = -20 - 0. Let n(f) = f*2 - 11f + 16. Let g be n(d). What is the third derivative of 2t4 + 3t*4 + 0t*4 - gt*4 + 7t*2 wrt t? -24t Let f(a) = -a + 3. Let y be f(1). What is the second derivative of -32b4 - 15b - 3 + y + 1 wrt b? -384b2 Let j(t) = t3 - 4t*2 + 6t - 5. Let n be j(5). Differentiate -87 + 49 - 12h2 + n with respect to h. -24h Let a(u) = -2u + 37. Let y be a(17). Find the third derivative of -38d*2 - yd*3 + 41d*2 - 3d*6 + 3d*3 wrt d. -360d3 Let w(i) = -i3 - 6i2 + 6i + 3. Let k be w(-7). Find the second derivative of -86l4 + 180l*4 - kl - 109l4 wrt l. -180l*2 Let s(w) = 2w4 + w2 + 2. Let n(g) = 51g4 + 11g*3 - 889g*2 + 10. Let k(j) = n(j) - 5s(j). What is the third derivative of k(y) wrt y? 984y + 66 Let r(c) be the second derivative of -3c5/20 + c3 + 90c2 - 10c. Differentiate r(x) wrt x. -9x2 + 6 Let q be 4/(-6) + -4 + 4911/9. Find the second derivative of -qt + 8t3 + 554t + 34t3 wrt t. 252t Let s(r) = 13r2 - 2r + 1. Let c be s(1). Let o = c + -10. Find the third derivative of 5io + 7 - 7 + 6i*3 wrt i. 36 Let v = 20 - 20. Find the third derivative of -7p*2 + 15p*2 + vp*6 + 2p*6 - 18p*2 wrt p. 240p*3 Let h = 1720 - 1717. Let s(w) be the second derivative of 0w*2 + 0w*h + 0 + 2w + 3/10w5 + 1/4w*4. What is the third derivative of s(p) wrt p? 36 Let g(n) be the first derivative of -27n5/5 - n4/4 + 2n3/3 - 5n*2 - 69. What is the third derivative of g(t) wrt t? -648t - 6 Let v = -18 - -18. Suppose -5f + 30 = 5h, 5h + 0h - 5f - 10 = v. Differentiate -h + o4 + 0 + 8o*4 - 1 wrt o. 36o*3 What is the first derivative of 73j*3 + 98 - 24j*3 - 361 - 56j*4 - 25j*3 - 25j*3 wrt j? -224j*3 - 3j*2 Let y(i) = -1308i - 1220. Let m(f) = -3268f - 3048. Let c(b) = 5m(b) - 12y(b). Find the first derivative of c(k) wrt k. -644 Let q(s) = 136s*4 - 18s3 - 110. Let t(z) = z4 - 2z3. Let u(n) = -2q(n) + 18t(n). Differentiate u(j) wrt j. -1016j*3 Let r be (-6)/15 - (-44)/10. Suppose -5 = -rd + 3. What is the derivative of d + 0o + 0o - 1 - 3o4 wrt o? -12o*3 Let k(q) = -56q*3 + 3q*2 - 5q + 334. Let d(t) = 111t3 - 5t*2 + 9t - 670. Let o(z) = -4d(z) - 7k(z). What is the second derivative of o(x) wrt x? -312x - 2 Suppose -6 = 61c - 64*c. What is the first derivative of 2 - 8	{ "pile_set_name": "DM Mathematics" }
t to 1/9 in -1.4, -2, -4/349, -0.4, -0.2? -4/349 Which is the closest to 0? (a) 92 (b) 0.1 (c) -4 (d) -43/158 b What is the nearest to -0.2 in -85, 2/85, -4, 0.2, -3, 5? 2/85 Which is the nearest to 0? (a) -2 (b) 577 (c) 1/9 (d) 57 (e) -4/5 (f) 4 c Which is the nearest to 1? (a) -14 (b) -2/231 (c) 2/5 (d) -2/3 (e) 3 c What is the nearest to 2/3 in 333, -11, -0.2, -402, 0.3? 0.3 What is the closest to -1/13 in 151, -3/2, 3/7, 8? 3/7 What is the nearest to 3/37 in -0.05, 0.5, 1, 8, 2/17, 3? 2/17 What is the nearest to 3/7 in 923, -1, 143, -0.4? -0.4 What is the closest to 437 in -4, 0, 0.2875? 0.2875 What is the closest to -0.17 in 1, 602, 0.3, -3, -0.1? -0.1 What is the closest to -2/15 in -3/38, 0, 5, -0.3, -0.1, -711? -0.1 Which is the closest to -0.038? (a) 1 (b) -60 (c) 0.08 (d) -6 (e) -3 c What is the closest to 0 in -0.09, 579, -5, -47.54? -0.09 Which is the nearest to -0.364? (a) 10 (b) -1 (c) -3 (d) -10 b Which is the closest to -5412? (a) 10 (b) -8/7 (c) -10 (d) -1 c What is the closest to -1 in 3/23, 2016, -2/17? -2/17 Which is the closest to -1/14? (a) 3/2 (b) -0.2 (c) -0.09986 (d) -8/3 c Which is the closest to -3/7? (a) -469844 (b) 8 (c) 4 (d) -4 d What is the closest to 9/5 in 0.1, 3, 164, -35? 3 What is the closest to 1/11 in -2, 1, 6, -1.737? 1 Which is the nearest to 0.08? (a) -2 (b) 97 (c) 0.1 (d) -112 c What is the closest to 0.1 in 1, 2.1997, 0, -4? 0 Which is the nearest to 24? (a) 3 (b) 0.04 (c) -0.1 (d) -8.47 (e) -2 a What is the nearest to -0.1 in -2/31, -2/189, -4/2661? -2/31 Which is the nearest to 4/23? (a) -0.3 (b) 6 (c) -67 (d) -2/3 a What is the nearest to -30/17 in -0.01359, -1, 0.14? -1 Which is the nearest to -1451? (a) 5 (b) 1/6 (c) -2 (d) -0.7 (e) 1/5 c Which is the closest to -1/3? (a) -409 (b) -2/13 (c) 4753/2 b Which is the closest to -1? (a) 1/178 (b) -7 (c) -5342 a Which is the closest to -1.69333? (a) -7 (b) -2/15 (c) -5 (d) 2/9 (e) 2/5 b What is the nearest to -0.1 in 12, -36, -100, 5/4? 5/4 Which is the nearest to -3? (a) -34 (b) -1326 (c) 0.4 (d) 2 c What is the closest to 29 in 2/9, 1200, 3.2, 9? 9 Which is the nearest to 196? (a) 0.6 (b) 409 (c) 2 (d) 1 (e) -0.2 c Which is the nearest to 4? (a) -0.07 (b) -7 (c) 90 (d) 0 d What is the nearest to -1 in 2/13, 205, 1.2341, 4, 3? 2/13 Which is the nearest to -0.4? (a) -4 (b) -1/2 (c) 10595 (d) -58 b What is the nearest to -2/3 in 1878, 0, -2, -6/11, -18.62? -6/11 What is the closest to 0.064 in -0.22, -2, 4.14? -0.22 What is the closest to -0.1 in 4, -346, 0.3508? 0.3508 What is the nearest to 0.2 in 0.3, 0, -1/3, 217, 814? 0.3 Which is the closest to 0.9? (a) -5 (b) 7 (c) 2.6 (d) 11 (e) 52 (f) -1 c Which is the nearest to 150? (a) -1 (b) -13 (c) 1854/7 c Which is the nearest to -2/395? (a) 0.3 (b) 617/4 (c) 2 (d) -2 a What is the nearest to -1 in -5, 7, 842551? -5 What is the closest to 0.04 in -0.3, 0.07, -0.13, -149, 5/2? 0.07 Which is the closest to 2? (a) -0.02 (b) -193 (c) -2 (d) 8 a What is the closest to 0 in 0, 133292, 1, 3, -0.3? 0 What is the closest to -6 in 19, -1/1839, 5, 18? -1/1839 What is the closest to -1/3 in -5, -375, 0, -1/3, -1, 26.5? -1/3 Which is the nearest to -22201? (a) 0 (b) -0.2 (c) 5 (d) -49 d What is the nearest to -2/61 in 0.037, 996, 4, 1? 0.037 Which is the closest to -0.019? (a) 0 (b) 1/2 (c) 6 (d) -1/6 (e) 4 a Which is the nearest to 105? (a) 3 (b) -3 (c) -0.09 (d) 15 (e) -3/17 (f) 5/4 d What is the nearest to -249247 in 0.2, 0.7, 0.3? 0.2 Which is the nearest to 54? (a) 3/16 (b) 2 (c) 2/3 (d) 1/5 (e) 0.061 (f) 0.4 b Which is the closest to 3? (a) 8 (b) -1/2 (c) 578212 b What is the closest to 0.2 in -0.9, 0, 2/67, 2/13, -0.2? 2/13 Which is the closest to -0.032? (a) 3 (b) 2/13 (c) 6 (d) 4 (e) -0.17 e What is the nearest to 2/7 in 13, -5, -3, -2.7, -32? -2.7 What is the closest to -0.2 in -5, -0.7, 129.58? -0.7 Which is the closest to -32? (a) 5/2 (b) 22 (c) 0.2 (d) -2/11 (e) 3584 d Which is the closest to 15? (a) -0.2 (b) 48/103 (c) -5 b Which is the closest to 2/3? (a) 0.5 (b) -3/17 (c) -0.12 (d) 2/3 (e) 102 d What is the closest to -1 in -0.5, 1, -127, -4, -7, 56? -0.5 What is the closest to -0.1 in -22, -1/4, 2/13, 28/173, 1/2? -1/4 What is the closest to 1/916 in -3/80, -2/37, -5? -3/80 Which is the nearest to 19? (a) 1/6 (b) -47 (c) -0.9 (d) -13 (e) 0.1 (f) -2 a Which is the closest to 0.1? (a) -6.8 (b) -1/23 (c) 123 b Which is the closest to -1? (a) 24.10758 (b) -2/9 (c) 0 b What is the closest to -372 in 0.07, -0.4, -1/3, 89, -2/3? -2/3 What is the nearest to -2/5 in -9, -1/3, 2, 0.03, -62, 1? -1/3 What is the closest to 1 in -2407, 14, 7596? 14 Which is the closest to 1.6? (a) 13 (b) -2/91 (c) 0.1 (d) 7/10 d What is the closest to -1 in 2, -2, 95/37, 6.27? -2 What is the closest to -1/4 in 0, -0.1676, -2, -173? -0.1676 Which is the closest to 1? (a) -3/4 (b) -5 (c) 2/19 (d) 462810 (e) -0.3 c Which is the nearest to -15/8? (a) -24 (b) 6.12 (c) -27 b Which is the closest to -4/7? (a) 0.2 (b) -1/121 (c) 24.78 (d) -2/5 d Which is the nearest to 2/7? (a) 0.2 (b) 1/3 (c) -2/11 (d) 7/16 (e) 30 b What is the closest to 3 in 2, -75/2, -156? 2 What is the nearest to 3/9518 in 1, -19, -2/5? -2/5 Which is the closest to 4/13? (a) 2.8954 (b) -0.3 (c) -1 (d) 4 b What is the nearest to 0.1 in -11, 1/4, 7.2, -905? 1/4 What is the nearest to -53.129 in -1, 0, -2, 7/5, -2/5? -2 Which is the nearest to -158? (a) -1 (b) -66919 (c) -2/9 (d) 3/7 (e) -5 (f) -3 e Which is the nearest to 2/7? (a) 3 (b) -2 (c) -1/4 (d) -511 c What is the nearest to 17 in 5/2, 0.5, -1.1, 4, 5.7927? 5.7927 Which is the closest to 0.1? (a) 0 (b) 0.011 (c) -1/6 (d) 2/949 (e) -0.032 b What is the nearest to -12/11 in -21, -4, 5, -155? -4 Which is the nearest to 0.5? (a) -4.9 (b) -0.4 (c) 0.03 (d) 21 c Which is the closest to -1/2? (a) -1.2 (b) -2.3 (c) -1249 (d) -1 d Which is the closest to -1/9? (a) -2/11 (b) 37 (c) -5 (d) 0.4 (e) 1606 a What is the nearest to 0.14 in 18, -282, 0.15? 0.15 What is the closest to -333 in -4/9, 2, -10, 8/155? -10 What is the nearest to 3 in 5, 627/2, 0.076? 5 What is the nearest to -918 in 4/5, 2, -10.1? -10.1 Which is the closest to 3? (a) -2/1165 (b) -2 (c) -0.02 a What is the nearest to 0 in -87/56, -8783/3, -2/9? -2/9 Which is the nearest to 7/46? (a) 114 (b) 0.01 (c) -0.3 b Which is the nearest to -1/4? (a) 87 (b) -1/3 (c) -1/32 (d) 37 b Which is the nearest to 0? (a) 23/14535 (b) 0 (c) 0.02 b What is the nearest to -10 in -0.5, 0.08, -2, -0.26, -4? -4 Which is the nearest to 0.1? (a) 24.35 (b) 1/7 (c) -8 (d) -1/4 b What is the nearest to -0.4 in -2, 1/425, -4, 0.35? 1/425 Which is the nearest to 405? (a) 4 (b) -2/17 (c) 0 (d) -3/2 (e) -0.1 a Which is the closest to 9? (a) 0.4 (b) -2 (c) 2/15 (d) 0.3 a Which is the nearest to 5/2? (a) -0.15 (b) 15824 (c) 3 c What is the closest to 2 in -0.19, 21, 180, 0.4? 0.4 What is the closest to 274 in -80/7, -1/5, -2, -0.4, 0.5, 0? 0.5 What is the closest to -0.2 in 290/3, 14.3, -9, -0.3, -0.01, 2? -0.3 Which is the nearest to 66? (a) -2.4 (b) 1 (c) 31 (d) -6 c Which is the nearest to 109? (a) -55 (b) 7/2 (c) -2 b Which is the nearest to 1/2? (a) 0.1 (b) 3 (c) -5/7 (d) -0.021 (e) -82 (f) -0.1 a What is the closest to -2/15 in -0.11, -1/2, 75, -30, -2, -1? -0.11 What is the nearest to 6 in 174079/6, -5/4, -3? -5/4 What is the nearest to 3.2 in 3/2, 15.41, -0.04? 3/2 What is the nearest to -2/9 in -18280, 0.3, -4, 13? 0.3 Which is the closest to -0.7505? (a) -5/3 (b) 0.9 (c) -3 (d) 1 (e) 0.01 e Which is the nearest to 0? (a) 0.2 (b) 16 (c) -2/11 (d) 0.5 (e) 15.086 c What is the closest to -10854 in 2, -1/626, -0.2? -0.2 What is the nearest to -2 in -0.23, -5, -2/17, -2/8539? -0.23 What is the closest to 1/2 in 1, -14, 0.09014? 0.09014 Which is the closest to 354? (a) -4 (b) -246 (c) 2 (d) -21 c What is the closest to 0.1 in -0.3, -531, 0, 0.037, -1? 0.037 What is the nearest to -0.155 in -2, -2/7, -3.7, 0.0985? -2/7 What is the nearest to -0.1 in -2, 1/73, 1245, -2/27, 2? -2/27 Which is the nearest to 2? (a) 157 (b) 422	{ "pile_set_name": "DM Mathematics" }
m) - 2t(m). What is the second derivative of k(f) wrt f? 8 Let b(t) be the third derivative of -t8/420 + t5/15 - t3/3 - t2. Let p(n) be the first derivative of b(n). Find the second derivative of p(w) wrt w. -48w2 Let g(h) be the second derivative of h9/3024 + 7h6/720 + h4/3 + 2h. Let r(z) be the third derivative of g(z). Find the second derivative of r(d) wrt d. 60d2 Let y(h) be the third derivative of -19h*6/60 + 11h*5/60 - 38h2. What is the third derivative of y(s) wrt s? -228 Let l(r) be the third derivative of r7/30 - 3r4/8 + 10r*2. What is the second derivative of l(u) wrt u? 84u*2 Find the third derivative of 0c*2 + 1 + 6c*2 - 1 + 3c*6 wrt c. 360c*3 Let b be (0 - 0)/(4/2). What is the second derivative of 2x + b + 0 + x*2 wrt x? 2 Let y(t) be the first derivative of 0t*5 + 0t - t*3 + 0t*4 + 3 + 0t*2 + 1/2t*6. Find the third derivative of y(a) wrt a. 180a*2 Let m(x) be the first derivative of 17x*3 + 25x*2/2 + 44. Find the second derivative of m(w) wrt w. 102 Let u(d) be the third derivative of 0 + 1/2d*3 + 0d + 1/12d5 + 0d*4 - 3d*2. Differentiate u(c) wrt c. 10c Find the first derivative of -1 + 31a3 - 1 - 28a*3 wrt a. 9a*2 Let p(v) be the first derivative of -13v*4/4 - 17v + 6. Find the first derivative of p(t) wrt t. -39t2 Suppose -2f - 30 = -5f. What is the derivative of j + 2j - fj - 7 + 14 wrt j? -7 Let o(w) = w5 + w4 - w2 - w + 1. Let m(z) = -2z5 + z4 - z*2 - 5z + 1. Let t(f) = -m(f) + o(f). What is the second derivative of t(r) wrt r? 60r3 Let k(z) be the first derivative of 16z*5/5 - 22z*3/3 - 28. Find the third derivative of k(f) wrt f. 384f Let c(a) = a - 1. Let i = 6 - 2. Let l be c(i). Find the third derivative of 2g + g2 + 2g*4 + g - lg wrt g. 48g Let y(p) = -p4 - p3 + p2 + p + 1. Let u(a) = -2a*4 + 4a*3 - 4a*2 - 2a - 4. Let m(o) = u(o) + 4y(o). Find the second derivative of m(h) wrt h. -72h2 Let s(y) be the third derivative of y6/24 - y*4/24 + 23y*2. Find the second derivative of s(p) wrt p. 30p Let p(y) be the first derivative of 1/3y3 + 1 - 3/2y*2 + 0y. Find the second derivative of p(a) wrt a. 2 Let i = -68 - -71. Let r(n) be the first derivative of 3/4n4 + 0n*2 - 2n + 0n3 - i. What is the first derivative of r(q) wrt q? 9q*2 Let b(x) be the second derivative of -9x7/14 - x4/4 + 13x. What is the third derivative of b(s) wrt s? -1620s*2 Let j(g) be the second derivative of 0g*4 + 3g - 1/2g2 + 1/10g*5 + 0 + 0g*3. Find the first derivative of j(l) wrt l. 6l2 Let r(h) be the first derivative of h2 - 3 + 1/6h3 + 2h. Let c(b) be the first derivative of r(b). Find the first derivative of c(d) wrt d. 1 Suppose 0 = -i - c - 0c + 4, -20 = -4i - 5c. Differentiate -14 - 3p*4 + ip + 8 + 0p with respect to p. -12p*3 Let p(b) = 2 + 0b + 10 - b. Let i be p(6). What is the first derivative of 2 - 2r3 - ir + 6r wrt r? -6r*2 Find the third derivative of -16z*5 + 16z*2 - 8z*2 + 4z*2 wrt z. -960z*2 Differentiate -36 - 13b - 8b - 17b - 28b wrt b. -66 Let x(p) = 6p*4 - 5p*3 + 5p*2 - 34p + 5. Let z(w) = -w4 + w3 - w*2 - w - 1. Let c(l) = x(l) + 5z(l). Find the second derivative of c(o) wrt o. 12o2 Suppose 0 = 4x - 16, 0z - 3z = -4x + 4. Let w = -3 - -5. What is the third derivative of -v2 - 1 + wv*z + 1 wrt v? 48v Let g(h) = -9h3 + 6h*2 + 6h + 2. Let o(v) = 19v3 - 13v*2 - 13v - 4. Let j(q) = 13g(q) + 6o(q). Differentiate j(m) wrt m. -9m2 Let c(b) be the second derivative of -1/6b*4 + 0 + 6b + 0b3 + 0b*2 + 1/30b*6 + 0b*5. What is the third derivative of c(d) wrt d? 24d Let h(k) be the third derivative of k9/72 - k5/20 + 7k2. What is the third derivative of h(c) wrt c? 840c3 Let w(x) be the second derivative of -x5/4 - x*3/2 - 6x. Find the second derivative of w(q) wrt q. -30q Let d(b) = 4b*5 - 4b*4 - 7b. Let j(f) = -f5 - f4. Let y(g) = d(g) - 4j(g). Find the second derivative of y(v) wrt v. 160v3 Let v(l) be the second derivative of -l4/6 - 2l3/3 - 10l. Find the second derivative of v(q) wrt q. -4 Let s(q) = -q2 + q. Let k be s(1). Let g(w) = w2 + w + 2. Let o be g(k). Find the third derivative of 2f4 - of4 - f4 + f*2 wrt f. -24f Let m(b) = -b. Let n(l) = -l*3 + 2l + 1. Let d(g) = 10m(g) + 5n(g). Find the first derivative of d(k) wrt k. -15k2 Let y be (5 - 2) + (-5 - -3) + 5. Let o(a) be the third derivative of 0a - 1/120ay + 0a*5 + 0a*4 + 0 + 1/3a3 - a2. Differentiate o(k) wrt k. -3k2 Suppose -3d = -3g + 24, 5g + 5d = -0g. What is the third derivative of -20t6 - tg + 17t6 + t4 + t*2 wrt t? -360t*3 Find the second derivative of 0g*2 - 12g + 7g2 + 0g*2 wrt g. 14 Let i = 10 + -8. Suppose t = io + o - 7, 4t - 40 = -5o. Find the first derivative of -2d + td - 3 + 0 + 2 wrt d. 3 Let b(t) = -t + 11. Let h(u) = -12. Let l(j) = -4b(j) - 3h(j). What is the derivative of l(p) wrt p? 4 Let c(y) be the first derivative of -y*5 + 0y*4 + 0y*3 + 3/2y*2 - 4 + 0y. What is the second derivative of c(w) wrt w? -60w2 What is the second derivative of 5b*2 + 13b*2 + 23b + 2b2 wrt b? 40 Find the second derivative of 0l + 6l + 7l*3 - 5l wrt l. 42l Let r(b) = -b2 + 5b - 3. Let n(u) = -4u + 2. Let t(z) = -3n(z) - 2r(z). What is the second derivative of t(m) wrt m? 4 Find the second derivative of -9u - u*2 - 6u*2 - 4u wrt u. -14 Let y(v) be the third derivative of 8v2 + 7/24v*4 + 0 + 0v - 5/6v3. What is the first derivative of y(z) wrt z? 7 Let g(i) be the second derivative of -i6/15 - 3i*4/4 + 3i2 - i. Let c(v) = v2 - 1. Let f(l) = 6c(l) + g(l). Find the third derivative of f(a) wrt a. -48a Let m(p) = 15p4 - 2p*3 + 2p*2 + 12. Let v(f) = -46f*4 + 7f*3 - 7f*2 - 37. Let y(w) = 7m(w) + 2v(w). What is the derivative of y(n) wrt n? 52n*3 Let l(j) = 3j + 1. Let p be l(1). Suppose 0 = py + y. What is the second derivative of 2n + 0n - n5 + yn wrt n? -20n3 Let a(f) = -3f*2 - 2f + 5. Suppose 0u = -6u + 42. Let d(m) = -9m2 - 7m + 16. Let z(n) = ua(n) - 2d(n). What is the first derivative of z(i) wrt i? -6i Suppose 1 = o - 2. Suppose -d + 3d - 4 = oh, 0 = d - 5h + 5. Find the second derivative of 0v5 - vd + 2v*5 + 2v wrt v. 20v3 Let k(x) = -x4 + x3 - x2. Let h(s) = 4s*4 - 2s*3 + 2s*2 - 7s + 31. Let c(m) = -h(m) - 2k(m). Find the first derivative of c(n) wrt n. -8n*3 + 7 Let h be 69/21 - 4/14. What is the first derivative of -22 - 6s*h + 9 + 5 wrt s? -18s*2 Let f(j) be the second derivative of 0j*4 + 0j*2 + 1/2j*3 + 0 - 1/5j*5 - 3j. Find the second derivative of f(q) wrt q. -24q Let b(y) = -14y + 5. Let i(c) = -5c + 2. Let p be 4/1 + 0/(-1). Let h(d) = pb(d) - 11i(d). Differentiate h(t) wrt t. -1 Let w(g) be the third derivative of g6/10 - 19g*4/24 - 4g*2. What is the second derivative of w(h) wrt h? 72h Let k(d) be the first derivative of d3 + d2 - d*3 + 2d2 + d3 + 1. What is the second derivative of k(f) wrt f? 6 Let p = 15/2 - 71/10. Let k(u) be the first derivative of -1 - pu5 + 0u*4 + 0u + 2/3u3 + 0u*2. What is the third derivative of k(w) wrt w? -48w Find the first derivative of -10 + 21 + 17 + 3 + 34g2 wrt g. 68g Let w(k) = 6k2 - 9. Let u(d) = -24d*2 + 37. Let x(s) = 2u(s) + 9w(s). Differentiate x(m) with respect to m. 12m Let r(j) = j - 1. Let n be r(6). Suppose -1 = nh - 11. What is the derivative of -2 - b4 - 2 + hb*4 + 2 wrt b? 4b*3 Suppose 4r + 16 = 0, 0 = -2m + r - 0r + 8. Suppose 2c - 6 = -b, 2c - 3 = -1. What is the third derivative of -o*4 + 2ob + o4 + o*m wrt o? 48o Let b be ((-6)/2 - -2)-1. Let u(m) = -m2 - 13m + 15. Let q be u(-14). What is the third derivative of p4 + p2 + q - b wrt p? 24p Let c(b) = 0b + 0b + 5b - 9b2 + b2. Suppose l + 2 = -0. Let t(x) = -2x*2 + x. Let m(o) = lc(o) + 9t(o). What is the second derivative of m(g) wrt g? -4 Let g(r) be the third derivative of -4r7/105 + r5/10 - 9r2. Find the third derivative of g(p) wrt p. -192p Let l(m) = -m.	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.