repo stringlengths 6 63 | path stringlengths 5 140 | func_name stringlengths 3 151 | original_string stringlengths 84 13k | language stringclasses 1
value | code stringlengths 84 13k | code_tokens list | docstring stringlengths 3 47.2k | docstring_tokens list | sha stringlengths 40 40 | url stringlengths 91 247 | partition stringclasses 1
value |
|---|---|---|---|---|---|---|---|---|---|---|---|
praxisnetau/silverware | src/Extensions/Lists/ListViewExtension.php | ListViewExtension.hideFields | protected function hideFields(FieldList $fields)
{
if ($this->owner->ListInherit) {
foreach ($fields as $field) {
$field->addExtraClass('hidden');
}
}
return $fields;
} | php | protected function hideFields(FieldList $fields)
{
if ($this->owner->ListInherit) {
foreach ($fields as $field) {
$field->addExtraClass('hidden');
}
}
return $fields;
} | [
"protected",
"function",
"hideFields",
"(",
"FieldList",
"$",
"fields",
")",
"{",
"if",
"(",
"$",
"this",
"->",
"owner",
"->",
"ListInherit",
")",
"{",
"foreach",
"(",
"$",
"fields",
"as",
"$",
"field",
")",
"{",
"$",
"field",
"->",
"addExtraClass",
"(... | Hides the given list of fields if the extended object inherits the list component.
@param FieldList $fields
@return FieldList | [
"Hides",
"the",
"given",
"list",
"of",
"fields",
"if",
"the",
"extended",
"object",
"inherits",
"the",
"list",
"component",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/Extensions/Lists/ListViewExtension.php#L813-L824 | train |
praxisnetau/silverware | src/Extensions/Lists/ListViewExtension.php | ListViewExtension.nest | protected function nest(FieldList $fields)
{
// Iterate Data Fields:
foreach ($fields->dataFields() as $field) {
$field->setName($this->nestName($field->getName()));
}
// Answer Fields:
return $fields;
} | php | protected function nest(FieldList $fields)
{
// Iterate Data Fields:
foreach ($fields->dataFields() as $field) {
$field->setName($this->nestName($field->getName()));
}
// Answer Fields:
return $fields;
} | [
"protected",
"function",
"nest",
"(",
"FieldList",
"$",
"fields",
")",
"{",
"// Iterate Data Fields:",
"foreach",
"(",
"$",
"fields",
"->",
"dataFields",
"(",
")",
"as",
"$",
"field",
")",
"{",
"$",
"field",
"->",
"setName",
"(",
"$",
"this",
"->",
"nest... | Nests the names of the given fields within the list config wrapper.
@param FieldList $fields
@return FieldList | [
"Nests",
"the",
"names",
"of",
"the",
"given",
"fields",
"within",
"the",
"list",
"config",
"wrapper",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/Extensions/Lists/ListViewExtension.php#L846-L857 | train |
praxisnetau/silverware | src/Extensions/Lists/ListViewExtension.php | ListViewExtension.nestName | protected function nestName($name)
{
// Obtain Bracket Position:
$bpos = strpos($name, '[');
// Has Bracket?
if ($bpos !== false) {
// Answer Bracketed Name:
return sprintf('%s[%s]%s', self::FIELD_WRAPPER, substr($name, 0, $bpos), substr($name, $bpos));
} else {
// Answer Regular Name:
return sprintf('%s[%s]', self::FIELD_WRAPPER, $name);
}
} | php | protected function nestName($name)
{
// Obtain Bracket Position:
$bpos = strpos($name, '[');
// Has Bracket?
if ($bpos !== false) {
// Answer Bracketed Name:
return sprintf('%s[%s]%s', self::FIELD_WRAPPER, substr($name, 0, $bpos), substr($name, $bpos));
} else {
// Answer Regular Name:
return sprintf('%s[%s]', self::FIELD_WRAPPER, $name);
}
} | [
"protected",
"function",
"nestName",
"(",
"$",
"name",
")",
"{",
"// Obtain Bracket Position:",
"$",
"bpos",
"=",
"strpos",
"(",
"$",
"name",
",",
"'['",
")",
";",
"// Has Bracket?",
"if",
"(",
"$",
"bpos",
"!==",
"false",
")",
"{",
"// Answer Bracketed Name... | Nests the given field name within the list config wrapper.
@param string $name
@return string | [
"Nests",
"the",
"given",
"field",
"name",
"within",
"the",
"list",
"config",
"wrapper",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/Extensions/Lists/ListViewExtension.php#L866-L887 | train |
praxisnetau/silverware | src/Extensions/StyleExtension.php | StyleExtension.updateCustomCSS | public function updateCustomCSS(&$css)
{
$template = $this->owner->getStyleExtensionTemplate(static::class);
if (SSViewer::hasTemplate($template)) {
$css = ViewTools::singleton()->renderCSS($this->owner, $template, $css);
}
} | php | public function updateCustomCSS(&$css)
{
$template = $this->owner->getStyleExtensionTemplate(static::class);
if (SSViewer::hasTemplate($template)) {
$css = ViewTools::singleton()->renderCSS($this->owner, $template, $css);
}
} | [
"public",
"function",
"updateCustomCSS",
"(",
"&",
"$",
"css",
")",
"{",
"$",
"template",
"=",
"$",
"this",
"->",
"owner",
"->",
"getStyleExtensionTemplate",
"(",
"static",
"::",
"class",
")",
";",
"if",
"(",
"SSViewer",
"::",
"hasTemplate",
"(",
"$",
"t... | Updates the array of custom CSS for the extended object.
@param array $css
@return void | [
"Updates",
"the",
"array",
"of",
"custom",
"CSS",
"for",
"the",
"extended",
"object",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/Extensions/StyleExtension.php#L82-L89 | train |
praxisnetau/silverware | src/Extensions/StyleExtension.php | StyleExtension.getAppliedStyles | protected function getAppliedStyles()
{
$applyStyles = $this->owner->config()->apply_styles;
if (is_array($applyStyles)) {
return $applyStyles;
} elseif ($applyStyles == 'none') {
return [];
}
} | php | protected function getAppliedStyles()
{
$applyStyles = $this->owner->config()->apply_styles;
if (is_array($applyStyles)) {
return $applyStyles;
} elseif ($applyStyles == 'none') {
return [];
}
} | [
"protected",
"function",
"getAppliedStyles",
"(",
")",
"{",
"$",
"applyStyles",
"=",
"$",
"this",
"->",
"owner",
"->",
"config",
"(",
")",
"->",
"apply_styles",
";",
"if",
"(",
"is_array",
"(",
"$",
"applyStyles",
")",
")",
"{",
"return",
"$",
"applyStyl... | Answers an array of the style extension classes to be applied to the extended object.
@return array | [
"Answers",
"an",
"array",
"of",
"the",
"style",
"extension",
"classes",
"to",
"be",
"applied",
"to",
"the",
"extended",
"object",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/Extensions/StyleExtension.php#L138-L147 | train |
sop/crypto-encoding | lib/CryptoEncoding/PEM.php | PEM.fromString | public static function fromString(string $str): self
{
if (!preg_match(self::PEM_REGEX, $str, $match)) {
throw new \UnexpectedValueException("Not a PEM formatted string.");
}
$payload = preg_replace('/\s+/', "", $match[2]);
$data = base64_decode($payload, true);
if (false === $data) {
throw new \UnexpectedValueException("Failed to decode PEM data.");
}
return new self($match[1], $data);
} | php | public static function fromString(string $str): self
{
if (!preg_match(self::PEM_REGEX, $str, $match)) {
throw new \UnexpectedValueException("Not a PEM formatted string.");
}
$payload = preg_replace('/\s+/', "", $match[2]);
$data = base64_decode($payload, true);
if (false === $data) {
throw new \UnexpectedValueException("Failed to decode PEM data.");
}
return new self($match[1], $data);
} | [
"public",
"static",
"function",
"fromString",
"(",
"string",
"$",
"str",
")",
":",
"self",
"{",
"if",
"(",
"!",
"preg_match",
"(",
"self",
"::",
"PEM_REGEX",
",",
"$",
"str",
",",
"$",
"match",
")",
")",
"{",
"throw",
"new",
"\\",
"UnexpectedValueExcep... | Initialize from a PEM-formatted string.
@param string $str
@throws \UnexpectedValueException If string is not valid PEM
@return self | [
"Initialize",
"from",
"a",
"PEM",
"-",
"formatted",
"string",
"."
] | b5958cc213d3092cb9fa7be179adf760a8fde1f6 | https://github.com/sop/crypto-encoding/blob/b5958cc213d3092cb9fa7be179adf760a8fde1f6/lib/CryptoEncoding/PEM.php#L73-L84 | train |
EcomDev/cache-key | src/InvalidArgumentException.php | InvalidArgumentException.generateMessage | private function generateMessage($value)
{
if (is_object($value)) {
return sprintf('An instance of "%s" is not suitable as cache key data', get_class($value));
}
return sprintf('A variable of type "%s" is not suitable as cache key data', gettype($value));
} | php | private function generateMessage($value)
{
if (is_object($value)) {
return sprintf('An instance of "%s" is not suitable as cache key data', get_class($value));
}
return sprintf('A variable of type "%s" is not suitable as cache key data', gettype($value));
} | [
"private",
"function",
"generateMessage",
"(",
"$",
"value",
")",
"{",
"if",
"(",
"is_object",
"(",
"$",
"value",
")",
")",
"{",
"return",
"sprintf",
"(",
"'An instance of \"%s\" is not suitable as cache key data'",
",",
"get_class",
"(",
"$",
"value",
")",
")",... | Generates message based on variable type
@param mixed $value
@return string | [
"Generates",
"message",
"based",
"on",
"variable",
"type"
] | 5f90f5a013100ec57d7f3a842f48222ba8a4ccf9 | https://github.com/EcomDev/cache-key/blob/5f90f5a013100ec57d7f3a842f48222ba8a4ccf9/src/InvalidArgumentException.php#L35-L42 | train |
praxisnetau/silverware | src/Extensions/Assets/RenderInlineExtension.php | RenderInlineExtension.getRenderInline | public function getRenderInline()
{
// Check File Exists / File Extension:
if ($this->owner->exists() && $this->owner->getExtension() == 'svg') {
// Create DOM Document:
$dom = new DOMDocument();
// Load SVG Data into DOM:
$dom->load(BASE_PATH . $this->owner->URL);
// Normalise SVG Data:
$dom->normalizeDocument();
// Render SVG as HTML:
return DBField::create_field('HTMLFragment', $dom->saveHTML($dom->documentElement));
}
} | php | public function getRenderInline()
{
// Check File Exists / File Extension:
if ($this->owner->exists() && $this->owner->getExtension() == 'svg') {
// Create DOM Document:
$dom = new DOMDocument();
// Load SVG Data into DOM:
$dom->load(BASE_PATH . $this->owner->URL);
// Normalise SVG Data:
$dom->normalizeDocument();
// Render SVG as HTML:
return DBField::create_field('HTMLFragment', $dom->saveHTML($dom->documentElement));
}
} | [
"public",
"function",
"getRenderInline",
"(",
")",
"{",
"// Check File Exists / File Extension:",
"if",
"(",
"$",
"this",
"->",
"owner",
"->",
"exists",
"(",
")",
"&&",
"$",
"this",
"->",
"owner",
"->",
"getExtension",
"(",
")",
"==",
"'svg'",
")",
"{",
"/... | Renders the content of the extended object inline.
@return DBHTMLText | [
"Renders",
"the",
"content",
"of",
"the",
"extended",
"object",
"inline",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/Extensions/Assets/RenderInlineExtension.php#L40-L63 | train |
praxisnetau/silverware | src/Extensions/Model/URLSegmentExtension.php | URLSegmentExtension.validURLSegment | public function validURLSegment()
{
$list = DataList::create(get_class($this->owner))->filter(['URLSegment' => $this->owner->URLSegment]);
if ($id = $this->owner->ID) {
$list = $list->exclude(['ID' => $id]);
}
return !$list->exists();
} | php | public function validURLSegment()
{
$list = DataList::create(get_class($this->owner))->filter(['URLSegment' => $this->owner->URLSegment]);
if ($id = $this->owner->ID) {
$list = $list->exclude(['ID' => $id]);
}
return !$list->exists();
} | [
"public",
"function",
"validURLSegment",
"(",
")",
"{",
"$",
"list",
"=",
"DataList",
"::",
"create",
"(",
"get_class",
"(",
"$",
"this",
"->",
"owner",
")",
")",
"->",
"filter",
"(",
"[",
"'URLSegment'",
"=>",
"$",
"this",
"->",
"owner",
"->",
"URLSeg... | Answers true if the extended object has a valid URL segment.
@return boolean | [
"Answers",
"true",
"if",
"the",
"extended",
"object",
"has",
"a",
"valid",
"URL",
"segment",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/Extensions/Model/URLSegmentExtension.php#L95-L104 | train |
praxisnetau/silverware | src/Extensions/Model/URLSegmentExtension.php | URLSegmentExtension.generateURLSegment | public function generateURLSegment($string)
{
if (!$string) {
$class = ClassTools::singleton()->getClassWithoutNamespace(get_class($this->owner));
$string = sprintf('%s-%s', $class, $this->owner->ID);
}
$segment = URLSegmentFilter::create()->filter($string);
$this->owner->extend('updateURLSegment', $segment, $string);
return $segment;
} | php | public function generateURLSegment($string)
{
if (!$string) {
$class = ClassTools::singleton()->getClassWithoutNamespace(get_class($this->owner));
$string = sprintf('%s-%s', $class, $this->owner->ID);
}
$segment = URLSegmentFilter::create()->filter($string);
$this->owner->extend('updateURLSegment', $segment, $string);
return $segment;
} | [
"public",
"function",
"generateURLSegment",
"(",
"$",
"string",
")",
"{",
"if",
"(",
"!",
"$",
"string",
")",
"{",
"$",
"class",
"=",
"ClassTools",
"::",
"singleton",
"(",
")",
"->",
"getClassWithoutNamespace",
"(",
"get_class",
"(",
"$",
"this",
"->",
"... | Generates a URL segment for the extended object based on the given string.
@param string $string
@return string | [
"Generates",
"a",
"URL",
"segment",
"for",
"the",
"extended",
"object",
"based",
"on",
"the",
"given",
"string",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/Extensions/Model/URLSegmentExtension.php#L113-L125 | train |
praxisnetau/silverware | src/Extensions/Model/URLSegmentExtension.php | URLSegmentExtension.generateValidURLSegment | public function generateValidURLSegment($string)
{
// Generate URL Segment:
$this->owner->URLSegment = $this->owner->generateURLSegment($string);
// Check for Duplicates:
$count = 2;
while (!$this->owner->validURLSegment()) {
$this->owner->URLSegment = sprintf(
'%s-%d',
preg_replace('/-[0-9]+$/', '', $this->owner->URLSegment),
$count
);
$count++;
}
} | php | public function generateValidURLSegment($string)
{
// Generate URL Segment:
$this->owner->URLSegment = $this->owner->generateURLSegment($string);
// Check for Duplicates:
$count = 2;
while (!$this->owner->validURLSegment()) {
$this->owner->URLSegment = sprintf(
'%s-%d',
preg_replace('/-[0-9]+$/', '', $this->owner->URLSegment),
$count
);
$count++;
}
} | [
"public",
"function",
"generateValidURLSegment",
"(",
"$",
"string",
")",
"{",
"// Generate URL Segment:",
"$",
"this",
"->",
"owner",
"->",
"URLSegment",
"=",
"$",
"this",
"->",
"owner",
"->",
"generateURLSegment",
"(",
"$",
"string",
")",
";",
"// Check for Du... | Generates a valid URL segment for the extended object based on the given string.
@param string $string
@return string | [
"Generates",
"a",
"valid",
"URL",
"segment",
"for",
"the",
"extended",
"object",
"based",
"on",
"the",
"given",
"string",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/Extensions/Model/URLSegmentExtension.php#L134-L155 | train |
EcomDev/cache-key | src/Generator.php | Generator.generate | public function generate($data)
{
if ($data instanceof InfoProviderInterface) {
$data = $data->getCacheKeyInfo();
}
if ($this->converter && !is_string($data)) {
$convertedData = $this->converter->convert($data);
if ($convertedData === false) {
throw new InvalidArgumentException($data);
}
$data = $convertedData;
} elseif (!is_string($data)) {
throw new InvalidArgumentException($data);
}
$cacheKey = $this->normalizer->normalize($data);
if ($this->prefix) {
return $this->prefix . $cacheKey;
}
return $cacheKey;
} | php | public function generate($data)
{
if ($data instanceof InfoProviderInterface) {
$data = $data->getCacheKeyInfo();
}
if ($this->converter && !is_string($data)) {
$convertedData = $this->converter->convert($data);
if ($convertedData === false) {
throw new InvalidArgumentException($data);
}
$data = $convertedData;
} elseif (!is_string($data)) {
throw new InvalidArgumentException($data);
}
$cacheKey = $this->normalizer->normalize($data);
if ($this->prefix) {
return $this->prefix . $cacheKey;
}
return $cacheKey;
} | [
"public",
"function",
"generate",
"(",
"$",
"data",
")",
"{",
"if",
"(",
"$",
"data",
"instanceof",
"InfoProviderInterface",
")",
"{",
"$",
"data",
"=",
"$",
"data",
"->",
"getCacheKeyInfo",
"(",
")",
";",
"}",
"if",
"(",
"$",
"this",
"->",
"converter"... | Generates a cache key based on provided data
@param mixed $data
@return string
@throws InvalidArgumentException in case if value was not converted | [
"Generates",
"a",
"cache",
"key",
"based",
"on",
"provided",
"data"
] | 5f90f5a013100ec57d7f3a842f48222ba8a4ccf9 | https://github.com/EcomDev/cache-key/blob/5f90f5a013100ec57d7f3a842f48222ba8a4ccf9/src/Generator.php#L60-L84 | train |
praxisnetau/silverware | src/Components/ContentComponent.php | ContentComponent.getLinkModeOptions | public function getLinkModeOptions()
{
return [
self::LINK_MODE_TITLE => _t(__CLASS__ . '.TITLE', 'Title'),
self::LINK_MODE_BUTTON => _t(__CLASS__ . '.BUTTON', 'Button'),
self::LINK_MODE_BOTH => _t(__CLASS__ . '.BOTHTITLEANDBUTTON', 'Both Title and Button')
];
} | php | public function getLinkModeOptions()
{
return [
self::LINK_MODE_TITLE => _t(__CLASS__ . '.TITLE', 'Title'),
self::LINK_MODE_BUTTON => _t(__CLASS__ . '.BUTTON', 'Button'),
self::LINK_MODE_BOTH => _t(__CLASS__ . '.BOTHTITLEANDBUTTON', 'Both Title and Button')
];
} | [
"public",
"function",
"getLinkModeOptions",
"(",
")",
"{",
"return",
"[",
"self",
"::",
"LINK_MODE_TITLE",
"=>",
"_t",
"(",
"__CLASS__",
".",
"'.TITLE'",
",",
"'Title'",
")",
",",
"self",
"::",
"LINK_MODE_BUTTON",
"=>",
"_t",
"(",
"__CLASS__",
".",
"'.BUTTON... | Answers an array of options for the link mode field.
@return array | [
"Answers",
"an",
"array",
"of",
"options",
"for",
"the",
"link",
"mode",
"field",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/Components/ContentComponent.php#L318-L325 | train |
kuzzleio/sdk-php | src/Security/Security.php | Security.createProfile | public function createProfile($id, array $policies, array $options = [])
{
$action = 'createProfile';
$data = [
'_id' => $id,
'body' => [ 'policies' => $policies ]
];
if (array_key_exists('replaceIfExist', $options)) {
$action = 'createOrReplaceProfile';
}
$response = $this->kuzzle->query(
$this->buildQueryArgs($action),
$data,
$options
);
return new Profile($this, $response['result']['_id'], $response['result']['_source'], $response['result']['_meta']);
} | php | public function createProfile($id, array $policies, array $options = [])
{
$action = 'createProfile';
$data = [
'_id' => $id,
'body' => [ 'policies' => $policies ]
];
if (array_key_exists('replaceIfExist', $options)) {
$action = 'createOrReplaceProfile';
}
$response = $this->kuzzle->query(
$this->buildQueryArgs($action),
$data,
$options
);
return new Profile($this, $response['result']['_id'], $response['result']['_source'], $response['result']['_meta']);
} | [
"public",
"function",
"createProfile",
"(",
"$",
"id",
",",
"array",
"$",
"policies",
",",
"array",
"$",
"options",
"=",
"[",
"]",
")",
"{",
"$",
"action",
"=",
"'createProfile'",
";",
"$",
"data",
"=",
"[",
"'_id'",
"=>",
"$",
"id",
",",
"'body'",
... | Create a new profile in Kuzzle.
@param string $id Unique profile identifier
@param array $policies List of policies to apply to this profile
@param array $options Optional arguments
@return Profile | [
"Create",
"a",
"new",
"profile",
"in",
"Kuzzle",
"."
] | b1e76cafaa9c7cc08d619c838c6208489e94565b | https://github.com/kuzzleio/sdk-php/blob/b1e76cafaa9c7cc08d619c838c6208489e94565b/src/Security/Security.php#L60-L79 | train |
kuzzleio/sdk-php | src/Security/Security.php | Security.createRole | public function createRole($id, array $content, array $options = [])
{
$action = 'createRole';
$data = [
'_id' => $id,
'body' => $content
];
if (array_key_exists('replaceIfExist', $options)) {
$action = 'createOrReplaceRole';
}
$response = $this->kuzzle->query(
$this->buildQueryArgs($action),
$data,
$options
);
return new Role($this, $response['result']['_id'], $response['result']['_source'], $response['result']['_meta']);
} | php | public function createRole($id, array $content, array $options = [])
{
$action = 'createRole';
$data = [
'_id' => $id,
'body' => $content
];
if (array_key_exists('replaceIfExist', $options)) {
$action = 'createOrReplaceRole';
}
$response = $this->kuzzle->query(
$this->buildQueryArgs($action),
$data,
$options
);
return new Role($this, $response['result']['_id'], $response['result']['_source'], $response['result']['_meta']);
} | [
"public",
"function",
"createRole",
"(",
"$",
"id",
",",
"array",
"$",
"content",
",",
"array",
"$",
"options",
"=",
"[",
"]",
")",
"{",
"$",
"action",
"=",
"'createRole'",
";",
"$",
"data",
"=",
"[",
"'_id'",
"=>",
"$",
"id",
",",
"'body'",
"=>",
... | Create a new role in Kuzzle.
@param integer $id Unique role identifier
@param array $content Data representing the role
@param array $options Optional arguments
@return Role | [
"Create",
"a",
"new",
"role",
"in",
"Kuzzle",
"."
] | b1e76cafaa9c7cc08d619c838c6208489e94565b | https://github.com/kuzzleio/sdk-php/blob/b1e76cafaa9c7cc08d619c838c6208489e94565b/src/Security/Security.php#L89-L108 | train |
kuzzleio/sdk-php | src/Security/Security.php | Security.createUser | public function createUser($id, array $content, array $options = [])
{
$action = 'createUser';
$data = [
'_id' => $id,
'body' => $content
];
$response = $this->kuzzle->query(
$this->buildQueryArgs($action),
$data,
$options
);
return new User($this, $response['result']['_id'], $response['result']['_source'], $response['result']['_meta']);
} | php | public function createUser($id, array $content, array $options = [])
{
$action = 'createUser';
$data = [
'_id' => $id,
'body' => $content
];
$response = $this->kuzzle->query(
$this->buildQueryArgs($action),
$data,
$options
);
return new User($this, $response['result']['_id'], $response['result']['_source'], $response['result']['_meta']);
} | [
"public",
"function",
"createUser",
"(",
"$",
"id",
",",
"array",
"$",
"content",
",",
"array",
"$",
"options",
"=",
"[",
"]",
")",
"{",
"$",
"action",
"=",
"'createUser'",
";",
"$",
"data",
"=",
"[",
"'_id'",
"=>",
"$",
"id",
",",
"'body'",
"=>",
... | Create a new user in Kuzzle.
@param integer $id Unique user identifier, will be used as username
@param array $content Data representing the user
@param array $options Optional arguments
@return User | [
"Create",
"a",
"new",
"user",
"in",
"Kuzzle",
"."
] | b1e76cafaa9c7cc08d619c838c6208489e94565b | https://github.com/kuzzleio/sdk-php/blob/b1e76cafaa9c7cc08d619c838c6208489e94565b/src/Security/Security.php#L118-L133 | train |
kuzzleio/sdk-php | src/Security/Security.php | Security.scrollProfiles | public function scrollProfiles($scrollId, array $options = [])
{
$options['httpParams'] = [':scrollId' => $scrollId];
$data = [];
if (!$scrollId) {
throw new InvalidArgumentException('Security.scrollProfiles: scrollId is required');
}
if (isset($options['scroll'])) {
$data['scroll'] = $options['scroll'];
}
$response = $this->kuzzle->query(
$this->kuzzle->buildQueryArgs('security', 'scrollProfiles'),
$data,
$options
);
$response['result']['hits'] = array_map(function ($document) {
return new Profile($this, $document['_id'], $document['_source'], $document['_meta']);
}, $response['result']['hits']);
return new ProfilesSearchResult(
$response['result']['total'],
$response['result']['hits'],
$scrollId
);
} | php | public function scrollProfiles($scrollId, array $options = [])
{
$options['httpParams'] = [':scrollId' => $scrollId];
$data = [];
if (!$scrollId) {
throw new InvalidArgumentException('Security.scrollProfiles: scrollId is required');
}
if (isset($options['scroll'])) {
$data['scroll'] = $options['scroll'];
}
$response = $this->kuzzle->query(
$this->kuzzle->buildQueryArgs('security', 'scrollProfiles'),
$data,
$options
);
$response['result']['hits'] = array_map(function ($document) {
return new Profile($this, $document['_id'], $document['_source'], $document['_meta']);
}, $response['result']['hits']);
return new ProfilesSearchResult(
$response['result']['total'],
$response['result']['hits'],
$scrollId
);
} | [
"public",
"function",
"scrollProfiles",
"(",
"$",
"scrollId",
",",
"array",
"$",
"options",
"=",
"[",
"]",
")",
"{",
"$",
"options",
"[",
"'httpParams'",
"]",
"=",
"[",
"':scrollId'",
"=>",
"$",
"scrollId",
"]",
";",
"$",
"data",
"=",
"[",
"]",
";",
... | Returns the next profiles result set with scroll query.
@param string $scrollId
@param array $options (optional) arguments
@return ProfilesSearchResult
@throws \Exception | [
"Returns",
"the",
"next",
"profiles",
"result",
"set",
"with",
"scroll",
"query",
"."
] | b1e76cafaa9c7cc08d619c838c6208489e94565b | https://github.com/kuzzleio/sdk-php/blob/b1e76cafaa9c7cc08d619c838c6208489e94565b/src/Security/Security.php#L215-L244 | train |
kuzzleio/sdk-php | src/Security/Security.php | Security.scrollUsers | public function scrollUsers($scrollId, array $options = [])
{
$options['httpParams'] = [':scrollId' => $scrollId];
$data = [];
if (!$scrollId) {
throw new InvalidArgumentException('Security.scrollUsers: scrollId is required');
}
if (isset($options['scroll'])) {
$data['scroll'] = $options['scroll'];
}
$response = $this->kuzzle->query(
$this->kuzzle->buildQueryArgs('security', 'scrollUsers'),
$data,
$options
);
$response['result']['hits'] = array_map(function ($document) {
return new User($this, $document['_id'], $document['_source'], $document['_meta']);
}, $response['result']['hits']);
return new UsersSearchResult(
$response['result']['total'],
$response['result']['hits'],
$scrollId
);
} | php | public function scrollUsers($scrollId, array $options = [])
{
$options['httpParams'] = [':scrollId' => $scrollId];
$data = [];
if (!$scrollId) {
throw new InvalidArgumentException('Security.scrollUsers: scrollId is required');
}
if (isset($options['scroll'])) {
$data['scroll'] = $options['scroll'];
}
$response = $this->kuzzle->query(
$this->kuzzle->buildQueryArgs('security', 'scrollUsers'),
$data,
$options
);
$response['result']['hits'] = array_map(function ($document) {
return new User($this, $document['_id'], $document['_source'], $document['_meta']);
}, $response['result']['hits']);
return new UsersSearchResult(
$response['result']['total'],
$response['result']['hits'],
$scrollId
);
} | [
"public",
"function",
"scrollUsers",
"(",
"$",
"scrollId",
",",
"array",
"$",
"options",
"=",
"[",
"]",
")",
"{",
"$",
"options",
"[",
"'httpParams'",
"]",
"=",
"[",
"':scrollId'",
"=>",
"$",
"scrollId",
"]",
";",
"$",
"data",
"=",
"[",
"]",
";",
"... | Returns the next users result set with scroll query.
@param string $scrollId
@param array $options (optional) arguments
@return UsersSearchResult
@throws \Exception | [
"Returns",
"the",
"next",
"users",
"result",
"set",
"with",
"scroll",
"query",
"."
] | b1e76cafaa9c7cc08d619c838c6208489e94565b | https://github.com/kuzzleio/sdk-php/blob/b1e76cafaa9c7cc08d619c838c6208489e94565b/src/Security/Security.php#L298-L327 | train |
kuzzleio/sdk-php | src/Security/Security.php | Security.fetchProfile | public function fetchProfile($id, array $options = [])
{
$data = [
'_id' => $id
];
$response = $this->kuzzle->query(
$this->buildQueryArgs('getProfile'),
$data,
$options
);
return new Profile($this, $response['result']['_id'], $response['result']['_source'], $response['result']['_meta']);
} | php | public function fetchProfile($id, array $options = [])
{
$data = [
'_id' => $id
];
$response = $this->kuzzle->query(
$this->buildQueryArgs('getProfile'),
$data,
$options
);
return new Profile($this, $response['result']['_id'], $response['result']['_source'], $response['result']['_meta']);
} | [
"public",
"function",
"fetchProfile",
"(",
"$",
"id",
",",
"array",
"$",
"options",
"=",
"[",
"]",
")",
"{",
"$",
"data",
"=",
"[",
"'_id'",
"=>",
"$",
"id",
"]",
";",
"$",
"response",
"=",
"$",
"this",
"->",
"kuzzle",
"->",
"query",
"(",
"$",
... | Retrieves a single stored profile using its unique ID.
@param integer $id Unique profile identifier
@param array $options Optional arguments
@return Profile | [
"Retrieves",
"a",
"single",
"stored",
"profile",
"using",
"its",
"unique",
"ID",
"."
] | b1e76cafaa9c7cc08d619c838c6208489e94565b | https://github.com/kuzzleio/sdk-php/blob/b1e76cafaa9c7cc08d619c838c6208489e94565b/src/Security/Security.php#L336-L349 | train |
kuzzleio/sdk-php | src/Security/Security.php | Security.fetchRole | public function fetchRole($id, array $options = [])
{
$data = [
'_id' => $id
];
$response = $this->kuzzle->query(
$this->buildQueryArgs('getRole'),
$data,
$options
);
return new Role($this, $response['result']['_id'], $response['result']['_source'], $response['result']['_meta']);
} | php | public function fetchRole($id, array $options = [])
{
$data = [
'_id' => $id
];
$response = $this->kuzzle->query(
$this->buildQueryArgs('getRole'),
$data,
$options
);
return new Role($this, $response['result']['_id'], $response['result']['_source'], $response['result']['_meta']);
} | [
"public",
"function",
"fetchRole",
"(",
"$",
"id",
",",
"array",
"$",
"options",
"=",
"[",
"]",
")",
"{",
"$",
"data",
"=",
"[",
"'_id'",
"=>",
"$",
"id",
"]",
";",
"$",
"response",
"=",
"$",
"this",
"->",
"kuzzle",
"->",
"query",
"(",
"$",
"th... | Retrieves a single stored role using its unique ID.
@param integer $id Unique role identifier
@param array $options Optional arguments
@return Role | [
"Retrieves",
"a",
"single",
"stored",
"role",
"using",
"its",
"unique",
"ID",
"."
] | b1e76cafaa9c7cc08d619c838c6208489e94565b | https://github.com/kuzzleio/sdk-php/blob/b1e76cafaa9c7cc08d619c838c6208489e94565b/src/Security/Security.php#L358-L371 | train |
kuzzleio/sdk-php | src/Security/Security.php | Security.fetchUser | public function fetchUser($id, array $options = [])
{
$data = [
'_id' => $id
];
$response = $this->kuzzle->query(
$this->buildQueryArgs('getUser'),
$data,
$options
);
return new User($this, $response['result']['_id'], $response['result']['_source'], $response['result']['_meta']);
} | php | public function fetchUser($id, array $options = [])
{
$data = [
'_id' => $id
];
$response = $this->kuzzle->query(
$this->buildQueryArgs('getUser'),
$data,
$options
);
return new User($this, $response['result']['_id'], $response['result']['_source'], $response['result']['_meta']);
} | [
"public",
"function",
"fetchUser",
"(",
"$",
"id",
",",
"array",
"$",
"options",
"=",
"[",
"]",
")",
"{",
"$",
"data",
"=",
"[",
"'_id'",
"=>",
"$",
"id",
"]",
";",
"$",
"response",
"=",
"$",
"this",
"->",
"kuzzle",
"->",
"query",
"(",
"$",
"th... | Retrieves a single stored user using its unique ID.
@param integer $id Unique user identifier
@param array $options Optional arguments
@return User | [
"Retrieves",
"a",
"single",
"stored",
"user",
"using",
"its",
"unique",
"ID",
"."
] | b1e76cafaa9c7cc08d619c838c6208489e94565b | https://github.com/kuzzleio/sdk-php/blob/b1e76cafaa9c7cc08d619c838c6208489e94565b/src/Security/Security.php#L380-L393 | train |
kuzzleio/sdk-php | src/Security/Security.php | Security.getUserRights | public function getUserRights($id, array $options = [])
{
$data = [
'_id' => $id
];
$response = $this->kuzzle->query(
$this->buildQueryArgs('getUserRights'),
$data,
$options
);
return $response['result']['hits'];
} | php | public function getUserRights($id, array $options = [])
{
$data = [
'_id' => $id
];
$response = $this->kuzzle->query(
$this->buildQueryArgs('getUserRights'),
$data,
$options
);
return $response['result']['hits'];
} | [
"public",
"function",
"getUserRights",
"(",
"$",
"id",
",",
"array",
"$",
"options",
"=",
"[",
"]",
")",
"{",
"$",
"data",
"=",
"[",
"'_id'",
"=>",
"$",
"id",
"]",
";",
"$",
"response",
"=",
"$",
"this",
"->",
"kuzzle",
"->",
"query",
"(",
"$",
... | Gets the rights of given user.
@param integer $id Id of the user
@param array $options Optional arguments
@return array | [
"Gets",
"the",
"rights",
"of",
"given",
"user",
"."
] | b1e76cafaa9c7cc08d619c838c6208489e94565b | https://github.com/kuzzleio/sdk-php/blob/b1e76cafaa9c7cc08d619c838c6208489e94565b/src/Security/Security.php#L402-L415 | train |
kuzzleio/sdk-php | src/Security/Security.php | Security.isActionAllowed | public function isActionAllowed(array $rights, $controller, $action, $index = '', $collection = '')
{
// We filter in all the rights that match the request (including wildcards).
$filteredRights = array_filter($rights, function (array $right) use ($controller) {
return array_key_exists('controller', $right) && ($right['controller'] === $controller || $right['controller'] === '*');
});
$filteredRights = array_filter($filteredRights, function (array $right) use ($action) {
return array_key_exists('action', $right) && ($right['action'] === $action || $right['action'] === '*');
});
$filteredRights = array_filter($filteredRights, function (array $right) use ($index) {
return array_key_exists('index', $right) && ($right['index'] === $index || $right['index'] === '*');
});
$filteredRights = array_filter($filteredRights, function (array $right) use ($collection) {
return array_key_exists('collection', $right) && ($right['collection'] === $collection || $right['collection'] === '*');
});
$rightsValues = array_map(function ($element) {
return $element['value'];
}, $filteredRights);
// Then, if at least one right allows the action, we return Security::ACTION_ALLOWED
if (array_search(Security::ACTION_ALLOWED, $rightsValues) !== false) {
return Security::ACTION_ALLOWED;
} // If no right allows the action, we check for Security::ACTION_CONDITIONAL.
elseif (array_search(Security::ACTION_CONDITIONAL, $rightsValues) !== false) {
return Security::ACTION_CONDITIONAL;
}
// Otherwise we return Security::ACTION_DENIED.
return Security::ACTION_DENIED;
} | php | public function isActionAllowed(array $rights, $controller, $action, $index = '', $collection = '')
{
// We filter in all the rights that match the request (including wildcards).
$filteredRights = array_filter($rights, function (array $right) use ($controller) {
return array_key_exists('controller', $right) && ($right['controller'] === $controller || $right['controller'] === '*');
});
$filteredRights = array_filter($filteredRights, function (array $right) use ($action) {
return array_key_exists('action', $right) && ($right['action'] === $action || $right['action'] === '*');
});
$filteredRights = array_filter($filteredRights, function (array $right) use ($index) {
return array_key_exists('index', $right) && ($right['index'] === $index || $right['index'] === '*');
});
$filteredRights = array_filter($filteredRights, function (array $right) use ($collection) {
return array_key_exists('collection', $right) && ($right['collection'] === $collection || $right['collection'] === '*');
});
$rightsValues = array_map(function ($element) {
return $element['value'];
}, $filteredRights);
// Then, if at least one right allows the action, we return Security::ACTION_ALLOWED
if (array_search(Security::ACTION_ALLOWED, $rightsValues) !== false) {
return Security::ACTION_ALLOWED;
} // If no right allows the action, we check for Security::ACTION_CONDITIONAL.
elseif (array_search(Security::ACTION_CONDITIONAL, $rightsValues) !== false) {
return Security::ACTION_CONDITIONAL;
}
// Otherwise we return Security::ACTION_DENIED.
return Security::ACTION_DENIED;
} | [
"public",
"function",
"isActionAllowed",
"(",
"array",
"$",
"rights",
",",
"$",
"controller",
",",
"$",
"action",
",",
"$",
"index",
"=",
"''",
",",
"$",
"collection",
"=",
"''",
")",
"{",
"// We filter in all the rights that match the request (including wildcards).... | Tells whether an action is allowed, denied or conditional based on the rights provided as the first argument
@param array $rights Rights list (@see Security::getUserRights)
@param string $controller The controller
@param string $action The action
@param string $index Optional index
@param string $collection Optional collection
@return string
Security::ACTION_ALLOWED
Security::ACTION_DENIED
Security::ACTION_CONDITIONAL
@throws ErrorException | [
"Tells",
"whether",
"an",
"action",
"is",
"allowed",
"denied",
"or",
"conditional",
"based",
"on",
"the",
"rights",
"provided",
"as",
"the",
"first",
"argument"
] | b1e76cafaa9c7cc08d619c838c6208489e94565b | https://github.com/kuzzleio/sdk-php/blob/b1e76cafaa9c7cc08d619c838c6208489e94565b/src/Security/Security.php#L432-L465 | train |
kuzzleio/sdk-php | src/Security/Security.php | Security.searchProfiles | public function searchProfiles(array $filters, array $options = [])
{
$data = [
'body' => $filters
];
$scrollId = null;
$response = $this->kuzzle->query(
$this->buildQueryArgs('searchProfiles'),
$data,
$options
);
$response['result']['hits'] = array_map(function ($profile) {
return new Profile($this, $profile['_id'], $profile['_source'], $profile['_meta']);
}, $response['result']['hits']);
if (isset($response['result']['scrollId'])) {
$scrollId = $response['result']['scrollId'];
}
return new ProfilesSearchResult($response['result']['total'], $response['result']['hits'], $scrollId);
} | php | public function searchProfiles(array $filters, array $options = [])
{
$data = [
'body' => $filters
];
$scrollId = null;
$response = $this->kuzzle->query(
$this->buildQueryArgs('searchProfiles'),
$data,
$options
);
$response['result']['hits'] = array_map(function ($profile) {
return new Profile($this, $profile['_id'], $profile['_source'], $profile['_meta']);
}, $response['result']['hits']);
if (isset($response['result']['scrollId'])) {
$scrollId = $response['result']['scrollId'];
}
return new ProfilesSearchResult($response['result']['total'], $response['result']['hits'], $scrollId);
} | [
"public",
"function",
"searchProfiles",
"(",
"array",
"$",
"filters",
",",
"array",
"$",
"options",
"=",
"[",
"]",
")",
"{",
"$",
"data",
"=",
"[",
"'body'",
"=>",
"$",
"filters",
"]",
";",
"$",
"scrollId",
"=",
"null",
";",
"$",
"response",
"=",
"... | Executes a search on profiles according to a filter
@param array $filters List of filters to retrieves profiles
@param array $options Optional arguments
@return ProfilesSearchResult | [
"Executes",
"a",
"search",
"on",
"profiles",
"according",
"to",
"a",
"filter"
] | b1e76cafaa9c7cc08d619c838c6208489e94565b | https://github.com/kuzzleio/sdk-php/blob/b1e76cafaa9c7cc08d619c838c6208489e94565b/src/Security/Security.php#L513-L536 | train |
kuzzleio/sdk-php | src/Security/Security.php | Security.searchRoles | public function searchRoles(array $filters, array $options = [])
{
$data = [
'body' => $filters
];
$response = $this->kuzzle->query(
$this->buildQueryArgs('searchRoles'),
$data,
$options
);
$response['result']['hits'] = array_map(function ($role) {
return new Role($this, $role['_id'], $role['_source'], $role['_meta']);
}, $response['result']['hits']);
return new RolesSearchResult($response['result']['total'], $response['result']['hits']);
} | php | public function searchRoles(array $filters, array $options = [])
{
$data = [
'body' => $filters
];
$response = $this->kuzzle->query(
$this->buildQueryArgs('searchRoles'),
$data,
$options
);
$response['result']['hits'] = array_map(function ($role) {
return new Role($this, $role['_id'], $role['_source'], $role['_meta']);
}, $response['result']['hits']);
return new RolesSearchResult($response['result']['total'], $response['result']['hits']);
} | [
"public",
"function",
"searchRoles",
"(",
"array",
"$",
"filters",
",",
"array",
"$",
"options",
"=",
"[",
"]",
")",
"{",
"$",
"data",
"=",
"[",
"'body'",
"=>",
"$",
"filters",
"]",
";",
"$",
"response",
"=",
"$",
"this",
"->",
"kuzzle",
"->",
"que... | Executes a search on roles according to a filter
@param array $filters List of filters to retrieves roles
@param array $options Optional arguments
@return RolesSearchResult | [
"Executes",
"a",
"search",
"on",
"roles",
"according",
"to",
"a",
"filter"
] | b1e76cafaa9c7cc08d619c838c6208489e94565b | https://github.com/kuzzleio/sdk-php/blob/b1e76cafaa9c7cc08d619c838c6208489e94565b/src/Security/Security.php#L545-L562 | train |
kuzzleio/sdk-php | src/Security/Security.php | Security.searchUsers | public function searchUsers(array $filters, array $options = [])
{
$data = [
'body' => $filters
];
$scrollId = null;
$response = $this->kuzzle->query(
$this->buildQueryArgs('searchUsers'),
$data,
$options
);
$response['result']['hits'] = array_map(function ($user) {
return new User($this, $user['_id'], $user['_source'], $user['_meta']);
}, $response['result']['hits']);
if (isset($response['result']['scrollId'])) {
$scrollId = $response['result']['scrollId'];
}
return new UsersSearchResult($response['result']['total'], $response['result']['hits'], $scrollId);
} | php | public function searchUsers(array $filters, array $options = [])
{
$data = [
'body' => $filters
];
$scrollId = null;
$response = $this->kuzzle->query(
$this->buildQueryArgs('searchUsers'),
$data,
$options
);
$response['result']['hits'] = array_map(function ($user) {
return new User($this, $user['_id'], $user['_source'], $user['_meta']);
}, $response['result']['hits']);
if (isset($response['result']['scrollId'])) {
$scrollId = $response['result']['scrollId'];
}
return new UsersSearchResult($response['result']['total'], $response['result']['hits'], $scrollId);
} | [
"public",
"function",
"searchUsers",
"(",
"array",
"$",
"filters",
",",
"array",
"$",
"options",
"=",
"[",
"]",
")",
"{",
"$",
"data",
"=",
"[",
"'body'",
"=>",
"$",
"filters",
"]",
";",
"$",
"scrollId",
"=",
"null",
";",
"$",
"response",
"=",
"$",... | Executes a search on users according to a filter
@param array $filters List of filters to retrieves users
@param array $options Optional arguments
@return UsersSearchResult | [
"Executes",
"a",
"search",
"on",
"users",
"according",
"to",
"a",
"filter"
] | b1e76cafaa9c7cc08d619c838c6208489e94565b | https://github.com/kuzzleio/sdk-php/blob/b1e76cafaa9c7cc08d619c838c6208489e94565b/src/Security/Security.php#L571-L594 | train |
kuzzleio/sdk-php | src/Security/Security.php | Security.updateProfile | public function updateProfile($id, array $policies, array $options = [])
{
$data = [
'_id' => $id,
'body' => [ 'policies' => $policies ]
];
$response = $this->kuzzle->query(
$this->buildQueryArgs('updateProfile'),
$data,
$options
);
return new Profile($this, $id, $response['result']['_source'], $response['result']['_meta']);
} | php | public function updateProfile($id, array $policies, array $options = [])
{
$data = [
'_id' => $id,
'body' => [ 'policies' => $policies ]
];
$response = $this->kuzzle->query(
$this->buildQueryArgs('updateProfile'),
$data,
$options
);
return new Profile($this, $id, $response['result']['_source'], $response['result']['_meta']);
} | [
"public",
"function",
"updateProfile",
"(",
"$",
"id",
",",
"array",
"$",
"policies",
",",
"array",
"$",
"options",
"=",
"[",
"]",
")",
"{",
"$",
"data",
"=",
"[",
"'_id'",
"=>",
"$",
"id",
",",
"'body'",
"=>",
"[",
"'policies'",
"=>",
"$",
"polici... | Performs a partial update on an existing profile.
@param string $id Unique profile identifier
@param array $policies List of policies to apply to this profile
@param array $options Optional arguments
@return Profile | [
"Performs",
"a",
"partial",
"update",
"on",
"an",
"existing",
"profile",
"."
] | b1e76cafaa9c7cc08d619c838c6208489e94565b | https://github.com/kuzzleio/sdk-php/blob/b1e76cafaa9c7cc08d619c838c6208489e94565b/src/Security/Security.php#L604-L618 | train |
kuzzleio/sdk-php | src/Security/Security.php | Security.updateRole | public function updateRole($id, array $content, array $options = [])
{
$data = [
'_id' => $id,
'body' => $content
];
$response = $this->kuzzle->query(
$this->buildQueryArgs('updateRole'),
$data,
$options
);
return new Role($this, $id, $response['result']['_source'], $response['result']['_meta']);
} | php | public function updateRole($id, array $content, array $options = [])
{
$data = [
'_id' => $id,
'body' => $content
];
$response = $this->kuzzle->query(
$this->buildQueryArgs('updateRole'),
$data,
$options
);
return new Role($this, $id, $response['result']['_source'], $response['result']['_meta']);
} | [
"public",
"function",
"updateRole",
"(",
"$",
"id",
",",
"array",
"$",
"content",
",",
"array",
"$",
"options",
"=",
"[",
"]",
")",
"{",
"$",
"data",
"=",
"[",
"'_id'",
"=>",
"$",
"id",
",",
"'body'",
"=>",
"$",
"content",
"]",
";",
"$",
"respons... | Performs a partial update on an existing role.
@param string $id Unique role identifier
@param array $content Data representing the role
@param array $options Optional arguments
@return Role | [
"Performs",
"a",
"partial",
"update",
"on",
"an",
"existing",
"role",
"."
] | b1e76cafaa9c7cc08d619c838c6208489e94565b | https://github.com/kuzzleio/sdk-php/blob/b1e76cafaa9c7cc08d619c838c6208489e94565b/src/Security/Security.php#L628-L642 | train |
kuzzleio/sdk-php | src/Security/Security.php | Security.updateUser | public function updateUser($id, array $content, array $options = [])
{
$data = [
'_id' => $id,
'body' => $content
];
$response = $this->kuzzle->query(
$this->buildQueryArgs('updateUser'),
$data,
$options
);
return new User($this, $id, $response['result']['_source'], $response['result']['_meta']);
} | php | public function updateUser($id, array $content, array $options = [])
{
$data = [
'_id' => $id,
'body' => $content
];
$response = $this->kuzzle->query(
$this->buildQueryArgs('updateUser'),
$data,
$options
);
return new User($this, $id, $response['result']['_source'], $response['result']['_meta']);
} | [
"public",
"function",
"updateUser",
"(",
"$",
"id",
",",
"array",
"$",
"content",
",",
"array",
"$",
"options",
"=",
"[",
"]",
")",
"{",
"$",
"data",
"=",
"[",
"'_id'",
"=>",
"$",
"id",
",",
"'body'",
"=>",
"$",
"content",
"]",
";",
"$",
"respons... | Performs a partial update on an existing user.
@param string $id Unique user identifier
@param array $content Data representing the user
@param array $options Optional arguments
@return User | [
"Performs",
"a",
"partial",
"update",
"on",
"an",
"existing",
"user",
"."
] | b1e76cafaa9c7cc08d619c838c6208489e94565b | https://github.com/kuzzleio/sdk-php/blob/b1e76cafaa9c7cc08d619c838c6208489e94565b/src/Security/Security.php#L652-L666 | train |
wallstreetio/ontraport | src/Response.php | Response.item | public function item()
{
if (!empty($this->response['data'])) {
return new Fluent($this->resource, $this->response['data']);
}
// On a valid response that does not have a data field, we can assume that
// the request is an update/delete type of request that does not return an object.
return true;
} | php | public function item()
{
if (!empty($this->response['data'])) {
return new Fluent($this->resource, $this->response['data']);
}
// On a valid response that does not have a data field, we can assume that
// the request is an update/delete type of request that does not return an object.
return true;
} | [
"public",
"function",
"item",
"(",
")",
"{",
"if",
"(",
"!",
"empty",
"(",
"$",
"this",
"->",
"response",
"[",
"'data'",
"]",
")",
")",
"{",
"return",
"new",
"Fluent",
"(",
"$",
"this",
"->",
"resource",
",",
"$",
"this",
"->",
"response",
"[",
"... | Retrieve an item from the Ontraport response.
@return bool|\Wsio\Ontraport\Fluent | [
"Retrieve",
"an",
"item",
"from",
"the",
"Ontraport",
"response",
"."
] | 55467fd63637083f76e497897af4aee13fc2c8b1 | https://github.com/wallstreetio/ontraport/blob/55467fd63637083f76e497897af4aee13fc2c8b1/src/Response.php#L35-L45 | train |
wallstreetio/ontraport | src/Response.php | Response.collection | public function collection()
{
if (!empty($this->response['data'])) {
$data = [];
foreach ($this->response['data'] as $object) {
$data[] = new Fluent($this->resource, $object);
}
return $data;
}
return [];
} | php | public function collection()
{
if (!empty($this->response['data'])) {
$data = [];
foreach ($this->response['data'] as $object) {
$data[] = new Fluent($this->resource, $object);
}
return $data;
}
return [];
} | [
"public",
"function",
"collection",
"(",
")",
"{",
"if",
"(",
"!",
"empty",
"(",
"$",
"this",
"->",
"response",
"[",
"'data'",
"]",
")",
")",
"{",
"$",
"data",
"=",
"[",
"]",
";",
"foreach",
"(",
"$",
"this",
"->",
"response",
"[",
"'data'",
"]",... | Retrieve an array of items from the Ontraport response.
@return array | [
"Retrieve",
"an",
"array",
"of",
"items",
"from",
"the",
"Ontraport",
"response",
"."
] | 55467fd63637083f76e497897af4aee13fc2c8b1 | https://github.com/wallstreetio/ontraport/blob/55467fd63637083f76e497897af4aee13fc2c8b1/src/Response.php#L52-L65 | train |
joomla-framework/facebook-api | src/User.php | User.createPhoto | public function createPhoto($user, $source, $message = null, $place = null, $noStory = null)
{
// Set POST request parameters.
$data = array();
$data[basename($source)] = '@' . realpath($source);
$data['message'] = $message;
$data['place'] = $place;
$data['no_story'] = $noStory;
return $this->createConnection($user, 'photos', $data, array('Content-Type' => 'multipart/form-data'));
} | php | public function createPhoto($user, $source, $message = null, $place = null, $noStory = null)
{
// Set POST request parameters.
$data = array();
$data[basename($source)] = '@' . realpath($source);
$data['message'] = $message;
$data['place'] = $place;
$data['no_story'] = $noStory;
return $this->createConnection($user, 'photos', $data, array('Content-Type' => 'multipart/form-data'));
} | [
"public",
"function",
"createPhoto",
"(",
"$",
"user",
",",
"$",
"source",
",",
"$",
"message",
"=",
"null",
",",
"$",
"place",
"=",
"null",
",",
"$",
"noStory",
"=",
"null",
")",
"{",
"// Set POST request parameters.",
"$",
"data",
"=",
"array",
"(",
... | Method to post a photo on user's wall. Requires authentication and publish_stream permission, user_groups or friends_groups permission.
@param mixed $user Either an integer containing the user ID or a string containing the username.
@param string $source Path to photo.
@param string $message Photo description.
@param string $place Facebook ID of the place associated with the photo.
@param boolean $noStory If set to 1, optionally suppresses the feed story that is automatically
generated on a user’s profile when they upload a photo using your application.
@return mixed The decoded JSON response or false if the client is not authenticated.
@since 1.0 | [
"Method",
"to",
"post",
"a",
"photo",
"on",
"user",
"s",
"wall",
".",
"Requires",
"authentication",
"and",
"publish_stream",
"permission",
"user_groups",
"or",
"friends_groups",
"permission",
"."
] | e7666ec1e9516f288a6f55f23a43a3d4a4edc76d | https://github.com/joomla-framework/facebook-api/blob/e7666ec1e9516f288a6f55f23a43a3d4a4edc76d/src/User.php#L646-L656 | train |
praxisnetau/silverware | src/View/Renderable.php | Renderable.loadRequirements | public function loadRequirements()
{
// Load Required Themed JavaScript:
if (ContentController::config()->load_themed_js) {
foreach ($this->getRequiredThemedJS() as $js) {
Requirements::themedJavascript($js);
}
}
// Load Required Themed CSS:
if (ContentController::config()->load_themed_css) {
foreach ($this->getRequiredThemedCSS() as $css => $media) {
Requirements::themedCSS($css, $media);
}
}
// Load Required JavaScript:
if (ContentController::config()->load_js) {
foreach ($this->getRequiredJS() as $js) {
Requirements::javascript($js);
}
}
// Load Required CSS:
if (ContentController::config()->load_css) {
foreach ($this->getRequiredCSS() as $css => $media) {
Requirements::css($css, $media);
}
}
// Load Required Custom CSS:
if (ContentController::config()->load_custom_css) {
if ($css = $this->getCustomCSSAsString()) {
Requirements::customCSS($css, $this->HTMLID);
}
}
// Load Required JavaScript Templates:
foreach ($this->getRequiredJSTemplates() as $file => $params) {
ViewTools::singleton()->loadJSTemplate($file, $params['vars'], $params['id']);
}
} | php | public function loadRequirements()
{
// Load Required Themed JavaScript:
if (ContentController::config()->load_themed_js) {
foreach ($this->getRequiredThemedJS() as $js) {
Requirements::themedJavascript($js);
}
}
// Load Required Themed CSS:
if (ContentController::config()->load_themed_css) {
foreach ($this->getRequiredThemedCSS() as $css => $media) {
Requirements::themedCSS($css, $media);
}
}
// Load Required JavaScript:
if (ContentController::config()->load_js) {
foreach ($this->getRequiredJS() as $js) {
Requirements::javascript($js);
}
}
// Load Required CSS:
if (ContentController::config()->load_css) {
foreach ($this->getRequiredCSS() as $css => $media) {
Requirements::css($css, $media);
}
}
// Load Required Custom CSS:
if (ContentController::config()->load_custom_css) {
if ($css = $this->getCustomCSSAsString()) {
Requirements::customCSS($css, $this->HTMLID);
}
}
// Load Required JavaScript Templates:
foreach ($this->getRequiredJSTemplates() as $file => $params) {
ViewTools::singleton()->loadJSTemplate($file, $params['vars'], $params['id']);
}
} | [
"public",
"function",
"loadRequirements",
"(",
")",
"{",
"// Load Required Themed JavaScript:",
"if",
"(",
"ContentController",
"::",
"config",
"(",
")",
"->",
"load_themed_js",
")",
"{",
"foreach",
"(",
"$",
"this",
"->",
"getRequiredThemedJS",
"(",
")",
"as",
... | Loads the requirements for the object.
@return void | [
"Loads",
"the",
"requirements",
"for",
"the",
"object",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/View/Renderable.php#L124-L181 | train |
praxisnetau/silverware | src/View/Renderable.php | Renderable.getRequiredCSS | public function getRequiredCSS()
{
$css = $this->config()->required_css;
$this->extend('updateRequiredCSS', $css);
return $this->processCSSConfig($css);
} | php | public function getRequiredCSS()
{
$css = $this->config()->required_css;
$this->extend('updateRequiredCSS', $css);
return $this->processCSSConfig($css);
} | [
"public",
"function",
"getRequiredCSS",
"(",
")",
"{",
"$",
"css",
"=",
"$",
"this",
"->",
"config",
"(",
")",
"->",
"required_css",
";",
"$",
"this",
"->",
"extend",
"(",
"'updateRequiredCSS'",
",",
"$",
"css",
")",
";",
"return",
"$",
"this",
"->",
... | Answers an array of CSS files required by the object.
@return array | [
"Answers",
"an",
"array",
"of",
"CSS",
"files",
"required",
"by",
"the",
"object",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/View/Renderable.php#L202-L209 | train |
praxisnetau/silverware | src/View/Renderable.php | Renderable.getRequiredThemedCSS | public function getRequiredThemedCSS()
{
$css = $this->config()->required_themed_css;
$this->extend('updateRequiredThemedCSS', $css);
return $this->processCSSConfig($css);
} | php | public function getRequiredThemedCSS()
{
$css = $this->config()->required_themed_css;
$this->extend('updateRequiredThemedCSS', $css);
return $this->processCSSConfig($css);
} | [
"public",
"function",
"getRequiredThemedCSS",
"(",
")",
"{",
"$",
"css",
"=",
"$",
"this",
"->",
"config",
"(",
")",
"->",
"required_themed_css",
";",
"$",
"this",
"->",
"extend",
"(",
"'updateRequiredThemedCSS'",
",",
"$",
"css",
")",
";",
"return",
"$",
... | Answers an array of themed CSS files required by the object.
@return array | [
"Answers",
"an",
"array",
"of",
"themed",
"CSS",
"files",
"required",
"by",
"the",
"object",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/View/Renderable.php#L230-L237 | train |
praxisnetau/silverware | src/View/Renderable.php | Renderable.getRequiredJSTemplates | public function getRequiredJSTemplates()
{
$js = $this->config()->required_js_templates;
$this->extend('updateRequiredJSTemplates', $js);
return $this->processJSTemplateConfig($js);
} | php | public function getRequiredJSTemplates()
{
$js = $this->config()->required_js_templates;
$this->extend('updateRequiredJSTemplates', $js);
return $this->processJSTemplateConfig($js);
} | [
"public",
"function",
"getRequiredJSTemplates",
"(",
")",
"{",
"$",
"js",
"=",
"$",
"this",
"->",
"config",
"(",
")",
"->",
"required_js_templates",
";",
"$",
"this",
"->",
"extend",
"(",
"'updateRequiredJSTemplates'",
",",
"$",
"js",
")",
";",
"return",
"... | Answers an array of JavaScript templates required by the object.
@return array | [
"Answers",
"an",
"array",
"of",
"JavaScript",
"templates",
"required",
"by",
"the",
"object",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/View/Renderable.php#L244-L251 | train |
praxisnetau/silverware | src/View/Renderable.php | Renderable.getAttributesHTML | public function getAttributesHTML($attributes = null)
{
// Initialise:
$remove = [];
// Detect Excluded Attributes:
if (is_string($attributes)) {
$remove = func_get_args();
}
// Detect Passed Attributes:
if (!$attributes || is_string($attributes)) {
$attributes = $this->getAttributes();
}
// Ensure Array Data Type:
$attributes = (array) $attributes;
// Remove Excluded Attributes:
if (!empty($remove)) {
$attributes = array_diff_key($attributes, array_flip($remove));
}
// Answer Markup:
return ViewTools::singleton()->getAttributesHTML($attributes);
} | php | public function getAttributesHTML($attributes = null)
{
// Initialise:
$remove = [];
// Detect Excluded Attributes:
if (is_string($attributes)) {
$remove = func_get_args();
}
// Detect Passed Attributes:
if (!$attributes || is_string($attributes)) {
$attributes = $this->getAttributes();
}
// Ensure Array Data Type:
$attributes = (array) $attributes;
// Remove Excluded Attributes:
if (!empty($remove)) {
$attributes = array_diff_key($attributes, array_flip($remove));
}
// Answer Markup:
return ViewTools::singleton()->getAttributesHTML($attributes);
} | [
"public",
"function",
"getAttributesHTML",
"(",
"$",
"attributes",
"=",
"null",
")",
"{",
"// Initialise:",
"$",
"remove",
"=",
"[",
"]",
";",
"// Detect Excluded Attributes:",
"if",
"(",
"is_string",
"(",
"$",
"attributes",
")",
")",
"{",
"$",
"remove",
"="... | Answers the HTML tag attributes of the object as a string.
If $attributes is a string, all arguments act as named attributes to exclude from rendering.
@param array|string $attributes
@return string | [
"Answers",
"the",
"HTML",
"tag",
"attributes",
"of",
"the",
"object",
"as",
"a",
"string",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/View/Renderable.php#L460-L491 | train |
praxisnetau/silverware | src/View/Renderable.php | Renderable.setStyleIDFrom | public function setStyleIDFrom(DataObject $object, $suffix = null)
{
$this->StyleID = sprintf(
'%s_%s',
ClassTools::singleton()->getClassWithoutNamespace(get_class($object)),
ClassTools::singleton()->getClassWithoutNamespace(get_class($this))
);
if (!is_null($suffix)) {
$this->StyleID = sprintf(
'%s_%s',
$this->StyleID,
$suffix
);
}
$this->StyleID = $this->cleanStyleID($this->StyleID);
return $this;
} | php | public function setStyleIDFrom(DataObject $object, $suffix = null)
{
$this->StyleID = sprintf(
'%s_%s',
ClassTools::singleton()->getClassWithoutNamespace(get_class($object)),
ClassTools::singleton()->getClassWithoutNamespace(get_class($this))
);
if (!is_null($suffix)) {
$this->StyleID = sprintf(
'%s_%s',
$this->StyleID,
$suffix
);
}
$this->StyleID = $this->cleanStyleID($this->StyleID);
return $this;
} | [
"public",
"function",
"setStyleIDFrom",
"(",
"DataObject",
"$",
"object",
",",
"$",
"suffix",
"=",
"null",
")",
"{",
"$",
"this",
"->",
"StyleID",
"=",
"sprintf",
"(",
"'%s_%s'",
",",
"ClassTools",
"::",
"singleton",
"(",
")",
"->",
"getClassWithoutNamespace... | Defines the style ID of the receiver from the given data object and optional suffix.
@param DataObject $object
@param string $suffix
@return $this | [
"Defines",
"the",
"style",
"ID",
"of",
"the",
"receiver",
"from",
"the",
"given",
"data",
"object",
"and",
"optional",
"suffix",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/View/Renderable.php#L543-L562 | train |
praxisnetau/silverware | src/View/Renderable.php | Renderable.getClassNameWithID | public function getClassNameWithID($includeNamespace = false)
{
$className = static::class;
if (!$includeNamespace) {
$className = ClassTools::singleton()->getClassWithoutNamespace($className);
}
return sprintf(
'%s_%s',
$className,
$this->ID
);
} | php | public function getClassNameWithID($includeNamespace = false)
{
$className = static::class;
if (!$includeNamespace) {
$className = ClassTools::singleton()->getClassWithoutNamespace($className);
}
return sprintf(
'%s_%s',
$className,
$this->ID
);
} | [
"public",
"function",
"getClassNameWithID",
"(",
"$",
"includeNamespace",
"=",
"false",
")",
"{",
"$",
"className",
"=",
"static",
"::",
"class",
";",
"if",
"(",
"!",
"$",
"includeNamespace",
")",
"{",
"$",
"className",
"=",
"ClassTools",
"::",
"singleton",
... | Answers the class name and ID of the object as a string.
@param boolean $includeNamespace If true, also include the namespace of the object.
@return string | [
"Answers",
"the",
"class",
"name",
"and",
"ID",
"of",
"the",
"object",
"as",
"a",
"string",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/View/Renderable.php#L571-L584 | train |
praxisnetau/silverware | src/View/Renderable.php | Renderable.getCustomCSS | public function getCustomCSS()
{
// Create CSS Array:
$css = [];
// Merge Custom CSS from Template:
foreach (ClassTools::singleton()->getObjectAncestry($this, self::class) as $class) {
$template = $this->getCustomCSSTemplate($class);
if (SSViewer::hasTemplate($template)) {
$css = ViewTools::singleton()->renderCSS($this, $template, $css);
}
}
// Update CSS via Extensions:
$this->extend('updateCustomCSS', $css);
// Filter CSS Array:
$css = array_filter($css);
// Answer CSS Array:
return $css;
} | php | public function getCustomCSS()
{
// Create CSS Array:
$css = [];
// Merge Custom CSS from Template:
foreach (ClassTools::singleton()->getObjectAncestry($this, self::class) as $class) {
$template = $this->getCustomCSSTemplate($class);
if (SSViewer::hasTemplate($template)) {
$css = ViewTools::singleton()->renderCSS($this, $template, $css);
}
}
// Update CSS via Extensions:
$this->extend('updateCustomCSS', $css);
// Filter CSS Array:
$css = array_filter($css);
// Answer CSS Array:
return $css;
} | [
"public",
"function",
"getCustomCSS",
"(",
")",
"{",
"// Create CSS Array:",
"$",
"css",
"=",
"[",
"]",
";",
"// Merge Custom CSS from Template:",
"foreach",
"(",
"ClassTools",
"::",
"singleton",
"(",
")",
"->",
"getObjectAncestry",
"(",
"$",
"this",
",",
"self"... | Answers an array of custom CSS required for the template.
@return array | [
"Answers",
"an",
"array",
"of",
"custom",
"CSS",
"required",
"for",
"the",
"template",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/View/Renderable.php#L611-L640 | train |
praxisnetau/silverware | src/View/Renderable.php | Renderable.render | public function render($layout = null, $title = null)
{
// Initialise:
$html = '';
// Load Requirements:
$this->loadRequirements();
// Obtain Cached HTML (if enabled):
if ($this->isCacheEnabled()) {
$html = self::getRenderCache()->get($this->getRenderCacheID());
}
// Render HTML:
if (!$html) {
// Render Self:
$html = (string) $this->renderSelf($layout, $title);
// Cache Rendered HTML:
if ($this->isCacheEnabled()) {
self::getRenderCache()->set($this->getRenderCacheID(), $html, $this->getRenderCacheLifetime());
}
} elseif (isset($_REQUEST['debug_cache'])) {
// Output Debug Information:
Debug::message(
sprintf(
'Rendered from cache: "%s" [%s]; lifetime: %d second(s)',
$this->getTitle(),
$this->getRenderCacheID(),
$this->getRenderCacheLifetime()
),
false
);
}
// Answer HTML:
return $html;
} | php | public function render($layout = null, $title = null)
{
// Initialise:
$html = '';
// Load Requirements:
$this->loadRequirements();
// Obtain Cached HTML (if enabled):
if ($this->isCacheEnabled()) {
$html = self::getRenderCache()->get($this->getRenderCacheID());
}
// Render HTML:
if (!$html) {
// Render Self:
$html = (string) $this->renderSelf($layout, $title);
// Cache Rendered HTML:
if ($this->isCacheEnabled()) {
self::getRenderCache()->set($this->getRenderCacheID(), $html, $this->getRenderCacheLifetime());
}
} elseif (isset($_REQUEST['debug_cache'])) {
// Output Debug Information:
Debug::message(
sprintf(
'Rendered from cache: "%s" [%s]; lifetime: %d second(s)',
$this->getTitle(),
$this->getRenderCacheID(),
$this->getRenderCacheLifetime()
),
false
);
}
// Answer HTML:
return $html;
} | [
"public",
"function",
"render",
"(",
"$",
"layout",
"=",
"null",
",",
"$",
"title",
"=",
"null",
")",
"{",
"// Initialise:",
"$",
"html",
"=",
"''",
";",
"// Load Requirements:",
"$",
"this",
"->",
"loadRequirements",
"(",
")",
";",
"// Obtain Cached HTML (i... | Renders the object for the HTML template.
@param string $layout Page layout passed from template.
@param string $title Page title passed from template.
@return DBHTMLText|string | [
"Renders",
"the",
"object",
"for",
"the",
"HTML",
"template",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/View/Renderable.php#L778-L827 | train |
praxisnetau/silverware | src/View/Renderable.php | Renderable.processCSSConfig | protected function processCSSConfig($config)
{
if (!ArrayLib::is_associative($config)) {
return array_fill_keys(array_values($config), null);
}
return $config;
} | php | protected function processCSSConfig($config)
{
if (!ArrayLib::is_associative($config)) {
return array_fill_keys(array_values($config), null);
}
return $config;
} | [
"protected",
"function",
"processCSSConfig",
"(",
"$",
"config",
")",
"{",
"if",
"(",
"!",
"ArrayLib",
"::",
"is_associative",
"(",
"$",
"config",
")",
")",
"{",
"return",
"array_fill_keys",
"(",
"array_values",
"(",
"$",
"config",
")",
",",
"null",
")",
... | Processes the given CSS config and answers an array suitable for loading requirements.
@param array $config
@return array | [
"Processes",
"the",
"given",
"CSS",
"config",
"and",
"answers",
"an",
"array",
"suitable",
"for",
"loading",
"requirements",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/View/Renderable.php#L836-L843 | train |
praxisnetau/silverware | src/View/Renderable.php | Renderable.processJSTemplateConfig | protected function processJSTemplateConfig($config)
{
$templates = [];
foreach ($config as $key => $value) {
if (is_integer($key)) {
$templates[$value] = [
'vars' => $this->getJSVars(),
'id' => $this->getHTMLID()
];
} else {
$templates[$key] = [
'vars' => $this->getJSTemplateVars(array_shift($value)),
'id' => $this->getJSTemplateID(array_shift($value))
];
}
}
return $templates;
} | php | protected function processJSTemplateConfig($config)
{
$templates = [];
foreach ($config as $key => $value) {
if (is_integer($key)) {
$templates[$value] = [
'vars' => $this->getJSVars(),
'id' => $this->getHTMLID()
];
} else {
$templates[$key] = [
'vars' => $this->getJSTemplateVars(array_shift($value)),
'id' => $this->getJSTemplateID(array_shift($value))
];
}
}
return $templates;
} | [
"protected",
"function",
"processJSTemplateConfig",
"(",
"$",
"config",
")",
"{",
"$",
"templates",
"=",
"[",
"]",
";",
"foreach",
"(",
"$",
"config",
"as",
"$",
"key",
"=>",
"$",
"value",
")",
"{",
"if",
"(",
"is_integer",
"(",
"$",
"key",
")",
")",... | Processes the given JavaScript template config and answers an array suitable for loading requirements.
@param array $config
@return array | [
"Processes",
"the",
"given",
"JavaScript",
"template",
"config",
"and",
"answers",
"an",
"array",
"suitable",
"for",
"loading",
"requirements",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/View/Renderable.php#L852-L877 | train |
praxisnetau/silverware | src/View/Renderable.php | Renderable.getJSTemplateVars | protected function getJSTemplateVars($vars)
{
if (is_array($vars)) {
return $vars;
}
if ($this->hasMethod($vars)) {
return $this->{$vars}();
}
return [];
} | php | protected function getJSTemplateVars($vars)
{
if (is_array($vars)) {
return $vars;
}
if ($this->hasMethod($vars)) {
return $this->{$vars}();
}
return [];
} | [
"protected",
"function",
"getJSTemplateVars",
"(",
"$",
"vars",
")",
"{",
"if",
"(",
"is_array",
"(",
"$",
"vars",
")",
")",
"{",
"return",
"$",
"vars",
";",
"}",
"if",
"(",
"$",
"this",
"->",
"hasMethod",
"(",
"$",
"vars",
")",
")",
"{",
"return",... | Answers an array of variables for a required JavaScript template.
@param string|array $vars Array of variables or method name.
@return array | [
"Answers",
"an",
"array",
"of",
"variables",
"for",
"a",
"required",
"JavaScript",
"template",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/View/Renderable.php#L886-L897 | train |
EcomDev/cache-key | src/Converter/HashConverter.php | HashConverter.convert | public function convert($value)
{
if (!is_array($value)) {
return false;
}
$value = json_encode($value);
return md5($value);
} | php | public function convert($value)
{
if (!is_array($value)) {
return false;
}
$value = json_encode($value);
return md5($value);
} | [
"public",
"function",
"convert",
"(",
"$",
"value",
")",
"{",
"if",
"(",
"!",
"is_array",
"(",
"$",
"value",
")",
")",
"{",
"return",
"false",
";",
"}",
"$",
"value",
"=",
"json_encode",
"(",
"$",
"value",
")",
";",
"return",
"md5",
"(",
"$",
"va... | Converts array values into hash
@param mixed $value
@return bool | [
"Converts",
"array",
"values",
"into",
"hash"
] | 5f90f5a013100ec57d7f3a842f48222ba8a4ccf9 | https://github.com/EcomDev/cache-key/blob/5f90f5a013100ec57d7f3a842f48222ba8a4ccf9/src/Converter/HashConverter.php#L19-L27 | train |
i-am-tom/schemer | src/Formatter/Collection.php | Collection.sort | public function sort(callable $comparator = null) : Collection
{
return $this->pipe(
function (array $value) use ($comparator) : array {
$comparator !== null
? usort($value, $comparator)
: sort($value);
return $value;
}
);
} | php | public function sort(callable $comparator = null) : Collection
{
return $this->pipe(
function (array $value) use ($comparator) : array {
$comparator !== null
? usort($value, $comparator)
: sort($value);
return $value;
}
);
} | [
"public",
"function",
"sort",
"(",
"callable",
"$",
"comparator",
"=",
"null",
")",
":",
"Collection",
"{",
"return",
"$",
"this",
"->",
"pipe",
"(",
"function",
"(",
"array",
"$",
"value",
")",
"use",
"(",
"$",
"comparator",
")",
":",
"array",
"{",
... | THe array will be sorted, possibly by a given function.
@param callable $comparator
@return Schemer\Formatter\Collection | [
"THe",
"array",
"will",
"be",
"sorted",
"possibly",
"by",
"a",
"given",
"function",
"."
] | aa4ff458eae636ca61ada07d05859e27d3b4584d | https://github.com/i-am-tom/schemer/blob/aa4ff458eae636ca61ada07d05859e27d3b4584d/src/Formatter/Collection.php#L32-L43 | train |
i-am-tom/schemer | src/Formatter/Collection.php | Collection.truncate | public function truncate(int $maximum) : Collection
{
return $this->pipe(
function (array $value) use ($maximum) : array {
return count($value) > $maximum
? array_slice($value, 0, $maximum)
: $value;
}
);
} | php | public function truncate(int $maximum) : Collection
{
return $this->pipe(
function (array $value) use ($maximum) : array {
return count($value) > $maximum
? array_slice($value, 0, $maximum)
: $value;
}
);
} | [
"public",
"function",
"truncate",
"(",
"int",
"$",
"maximum",
")",
":",
"Collection",
"{",
"return",
"$",
"this",
"->",
"pipe",
"(",
"function",
"(",
"array",
"$",
"value",
")",
"use",
"(",
"$",
"maximum",
")",
":",
"array",
"{",
"return",
"count",
"... | The array will have no more than a given number of elements.
@param int $maximum
@return Schemer\Formatter\Collection | [
"The",
"array",
"will",
"have",
"no",
"more",
"than",
"a",
"given",
"number",
"of",
"elements",
"."
] | aa4ff458eae636ca61ada07d05859e27d3b4584d | https://github.com/i-am-tom/schemer/blob/aa4ff458eae636ca61ada07d05859e27d3b4584d/src/Formatter/Collection.php#L50-L59 | train |
hakito/php-wirecard-checkout-seamless | src/Api/ConfirmationResponse.php | ConfirmationResponse.InitFromArrayWithSecret | public function InitFromArrayWithSecret($data, $secret) {
if (!isset($data['paymentState']))
{
throw new \InvalidArgumentException('No paymentState provided.');
}
$validStates = array('CANCEL', 'PENDING', 'FAILURE', 'SUCCESS');
$paymentState = $data['paymentState'];
if (!in_array($paymentState, $validStates))
{
throw new \InvalidArgumentException('Invalid paymentState "'
. $paymentState . '".');
}
$this->InitFromArray($data);
if ($this->GetPaymentState() != 'SUCCESS')
{
return;
}
$this->CheckFingerprint($secret);
} | php | public function InitFromArrayWithSecret($data, $secret) {
if (!isset($data['paymentState']))
{
throw new \InvalidArgumentException('No paymentState provided.');
}
$validStates = array('CANCEL', 'PENDING', 'FAILURE', 'SUCCESS');
$paymentState = $data['paymentState'];
if (!in_array($paymentState, $validStates))
{
throw new \InvalidArgumentException('Invalid paymentState "'
. $paymentState . '".');
}
$this->InitFromArray($data);
if ($this->GetPaymentState() != 'SUCCESS')
{
return;
}
$this->CheckFingerprint($secret);
} | [
"public",
"function",
"InitFromArrayWithSecret",
"(",
"$",
"data",
",",
"$",
"secret",
")",
"{",
"if",
"(",
"!",
"isset",
"(",
"$",
"data",
"[",
"'paymentState'",
"]",
")",
")",
"{",
"throw",
"new",
"\\",
"InvalidArgumentException",
"(",
"'No paymentState pr... | Initializes from data array. In case of success the fields will be
validated using the fingerprint and the secret.
@param type $data Normally you should forward the $_POST array here
@param type $secret Your wirecard secret
@throws \InvalidArgumentException when mandatory fields are missing
@throws InvalidFingerprintException when fingerprint validation fails | [
"Initializes",
"from",
"data",
"array",
".",
"In",
"case",
"of",
"success",
"the",
"fields",
"will",
"be",
"validated",
"using",
"the",
"fingerprint",
"and",
"the",
"secret",
"."
] | cdea47abb2fdcc2a4f7de7cafd64e3ba1a1b28ce | https://github.com/hakito/php-wirecard-checkout-seamless/blob/cdea47abb2fdcc2a4f7de7cafd64e3ba1a1b28ce/src/Api/ConfirmationResponse.php#L19-L42 | train |
crisu83/yii-sentry | components/SentryClient.php | SentryClient.captureException | public function captureException($exception, $options = array(), $logger = '', $context = null)
{
if (!$this->isEnvironmentEnabled()) {
return null;
}
$this->processOptions($options);
try {
$eventId = $this->_client->getIdent(
$this->_client->captureException($exception, $options, $logger, $context)
);
} catch (Exception $e) {
if (YII_DEBUG) {
throw new CException('SentryClient failed to log exception: ' . $e->getMessage(), (int)$e->getCode());
} else {
$this->log($e->getMessage(), CLogger::LEVEL_ERROR);
throw new CException('SentryClient failed to log exception.', (int)$e->getCode());
}
}
$this->_loggedEventIds[] = $eventId;
$this->log(sprintf('Exception logged to Sentry with event id: %d', $eventId), CLogger::LEVEL_INFO);
return $eventId;
} | php | public function captureException($exception, $options = array(), $logger = '', $context = null)
{
if (!$this->isEnvironmentEnabled()) {
return null;
}
$this->processOptions($options);
try {
$eventId = $this->_client->getIdent(
$this->_client->captureException($exception, $options, $logger, $context)
);
} catch (Exception $e) {
if (YII_DEBUG) {
throw new CException('SentryClient failed to log exception: ' . $e->getMessage(), (int)$e->getCode());
} else {
$this->log($e->getMessage(), CLogger::LEVEL_ERROR);
throw new CException('SentryClient failed to log exception.', (int)$e->getCode());
}
}
$this->_loggedEventIds[] = $eventId;
$this->log(sprintf('Exception logged to Sentry with event id: %d', $eventId), CLogger::LEVEL_INFO);
return $eventId;
} | [
"public",
"function",
"captureException",
"(",
"$",
"exception",
",",
"$",
"options",
"=",
"array",
"(",
")",
",",
"$",
"logger",
"=",
"''",
",",
"$",
"context",
"=",
"null",
")",
"{",
"if",
"(",
"!",
"$",
"this",
"->",
"isEnvironmentEnabled",
"(",
"... | Logs an exception to Sentry.
@param Exception $exception exception to log.
@param array $options capture options that can contain the following structure:
culprit: (string) function call that caused the event
extra: (array) additional metadata to store with the event
@param string $logger name of the logger.
@param mixed $context exception context.
@return string event id (or null if not captured).
@throws CException if logging the exception fails. | [
"Logs",
"an",
"exception",
"to",
"Sentry",
"."
] | beacc88e06a0eb32903e4eae63cc6cddea901524 | https://github.com/crisu83/yii-sentry/blob/beacc88e06a0eb32903e4eae63cc6cddea901524/components/SentryClient.php#L111-L132 | train |
crisu83/yii-sentry | components/SentryClient.php | SentryClient.captureMessage | public function captureMessage($message, $params = array(), $options = array(), $stack = false, $context = null)
{
if (strlen($message) > self::MAX_MESSAGE_LENGTH) {
throw new CException(sprintf(
'SentryClient cannot send messages that contain more than %d characters.',
self::MAX_MESSAGE_LENGTH
));
}
if (!$this->isEnvironmentEnabled()) {
return null;
}
$this->processOptions($options);
try {
$eventId = $this->_client->getIdent(
$this->_client->captureMessage($message, $params, $options, $stack, $context)
);
} catch (Exception $e) {
if (YII_DEBUG) {
throw new CException('SentryClient failed to log message: ' . $e->getMessage(), (int)$e->getCode());
} else {
$this->log($e->getMessage(), CLogger::LEVEL_ERROR);
throw new CException('SentryClient failed to log message.', (int)$e->getCode());
}
}
$this->_loggedEventIds[] = $eventId;
$this->log(sprintf('Message logged to Sentry with event id: %d', $eventId), CLogger::LEVEL_INFO);
return $eventId;
} | php | public function captureMessage($message, $params = array(), $options = array(), $stack = false, $context = null)
{
if (strlen($message) > self::MAX_MESSAGE_LENGTH) {
throw new CException(sprintf(
'SentryClient cannot send messages that contain more than %d characters.',
self::MAX_MESSAGE_LENGTH
));
}
if (!$this->isEnvironmentEnabled()) {
return null;
}
$this->processOptions($options);
try {
$eventId = $this->_client->getIdent(
$this->_client->captureMessage($message, $params, $options, $stack, $context)
);
} catch (Exception $e) {
if (YII_DEBUG) {
throw new CException('SentryClient failed to log message: ' . $e->getMessage(), (int)$e->getCode());
} else {
$this->log($e->getMessage(), CLogger::LEVEL_ERROR);
throw new CException('SentryClient failed to log message.', (int)$e->getCode());
}
}
$this->_loggedEventIds[] = $eventId;
$this->log(sprintf('Message logged to Sentry with event id: %d', $eventId), CLogger::LEVEL_INFO);
return $eventId;
} | [
"public",
"function",
"captureMessage",
"(",
"$",
"message",
",",
"$",
"params",
"=",
"array",
"(",
")",
",",
"$",
"options",
"=",
"array",
"(",
")",
",",
"$",
"stack",
"=",
"false",
",",
"$",
"context",
"=",
"null",
")",
"{",
"if",
"(",
"strlen",
... | Logs a message to Sentry.
@param string $message message to log.
@param array $params message parameters.
@param array $options capture options that can contain the following structure:
culprit: (string) function call that caused the event
extra: (array) additional metadata to store with the event
@param bool $stack whether to send the stack trace.
@param mixed $context message context.
@return string event id (or null if not captured).
@throws CException if logging the message fails. | [
"Logs",
"a",
"message",
"to",
"Sentry",
"."
] | beacc88e06a0eb32903e4eae63cc6cddea901524 | https://github.com/crisu83/yii-sentry/blob/beacc88e06a0eb32903e4eae63cc6cddea901524/components/SentryClient.php#L146-L173 | train |
crisu83/yii-sentry | components/SentryClient.php | SentryClient.captureQuery | public function captureQuery($query, $level = CLogger::LEVEL_INFO, $engine = '')
{
if (!$this->isEnvironmentEnabled()) {
return null;
}
try {
$eventId = $this->_client->getIdent(
$this->_client->captureQuery($query, $level, $engine)
);
} catch (Exception $e) {
if (YII_DEBUG) {
throw new CException('SentryClient failed to log query: ' . $e->getMessage(), (int)$e->getCode());
} else {
$this->log($e->getMessage(), CLogger::LEVEL_ERROR);
throw new CException('SentryClient failed to log query.', (int)$e->getCode());
}
}
$this->_loggedEventIds[] = $eventId;
$this->log(sprintf('Query logged to Sentry with event id: %d', $eventId), CLogger::LEVEL_INFO);
return $eventId;
} | php | public function captureQuery($query, $level = CLogger::LEVEL_INFO, $engine = '')
{
if (!$this->isEnvironmentEnabled()) {
return null;
}
try {
$eventId = $this->_client->getIdent(
$this->_client->captureQuery($query, $level, $engine)
);
} catch (Exception $e) {
if (YII_DEBUG) {
throw new CException('SentryClient failed to log query: ' . $e->getMessage(), (int)$e->getCode());
} else {
$this->log($e->getMessage(), CLogger::LEVEL_ERROR);
throw new CException('SentryClient failed to log query.', (int)$e->getCode());
}
}
$this->_loggedEventIds[] = $eventId;
$this->log(sprintf('Query logged to Sentry with event id: %d', $eventId), CLogger::LEVEL_INFO);
return $eventId;
} | [
"public",
"function",
"captureQuery",
"(",
"$",
"query",
",",
"$",
"level",
"=",
"CLogger",
"::",
"LEVEL_INFO",
",",
"$",
"engine",
"=",
"''",
")",
"{",
"if",
"(",
"!",
"$",
"this",
"->",
"isEnvironmentEnabled",
"(",
")",
")",
"{",
"return",
"null",
... | Logs a query to Sentry.
@param string $query query to log.
@param string $level log level.
@param string $engine name of the sql driver.
@return string event id (or null if not captured).
@throws CException if logging the query fails. | [
"Logs",
"a",
"query",
"to",
"Sentry",
"."
] | beacc88e06a0eb32903e4eae63cc6cddea901524 | https://github.com/crisu83/yii-sentry/blob/beacc88e06a0eb32903e4eae63cc6cddea901524/components/SentryClient.php#L183-L203 | train |
crisu83/yii-sentry | components/SentryClient.php | SentryClient.processOptions | protected function processOptions(&$options)
{
if (!isset($options['extra'])) {
$options['extra'] = array();
}
$options['extra'] = CMap::mergeArray($this->extraVariables, $options['extra']);
} | php | protected function processOptions(&$options)
{
if (!isset($options['extra'])) {
$options['extra'] = array();
}
$options['extra'] = CMap::mergeArray($this->extraVariables, $options['extra']);
} | [
"protected",
"function",
"processOptions",
"(",
"&",
"$",
"options",
")",
"{",
"if",
"(",
"!",
"isset",
"(",
"$",
"options",
"[",
"'extra'",
"]",
")",
")",
"{",
"$",
"options",
"[",
"'extra'",
"]",
"=",
"array",
"(",
")",
";",
"}",
"$",
"options",
... | Processes the given options.
@param array $options the options to process. | [
"Processes",
"the",
"given",
"options",
"."
] | beacc88e06a0eb32903e4eae63cc6cddea901524 | https://github.com/crisu83/yii-sentry/blob/beacc88e06a0eb32903e4eae63cc6cddea901524/components/SentryClient.php#L218-L224 | train |
crisu83/yii-sentry | components/SentryClient.php | SentryClient.createClient | protected function createClient()
{
$options = CMap::mergeArray(
array(
'logger' => 'yii',
'tags' => array(
'environment' => $this->environment,
'php_version' => phpversion(),
),
),
$this->options
);
try {
$this->checkTags($options['tags']);
return new Raven_Client($this->dns, $options);
} catch (Exception $e) {
if (YII_DEBUG) {
throw new CException('SentryClient failed to create client: ' . $e->getMessage(), (int)$e->getCode());
} else {
$this->log($e->getMessage(), CLogger::LEVEL_ERROR);
throw new CException('SentryClient failed to create client.', (int)$e->getCode());
}
}
} | php | protected function createClient()
{
$options = CMap::mergeArray(
array(
'logger' => 'yii',
'tags' => array(
'environment' => $this->environment,
'php_version' => phpversion(),
),
),
$this->options
);
try {
$this->checkTags($options['tags']);
return new Raven_Client($this->dns, $options);
} catch (Exception $e) {
if (YII_DEBUG) {
throw new CException('SentryClient failed to create client: ' . $e->getMessage(), (int)$e->getCode());
} else {
$this->log($e->getMessage(), CLogger::LEVEL_ERROR);
throw new CException('SentryClient failed to create client.', (int)$e->getCode());
}
}
} | [
"protected",
"function",
"createClient",
"(",
")",
"{",
"$",
"options",
"=",
"CMap",
"::",
"mergeArray",
"(",
"array",
"(",
"'logger'",
"=>",
"'yii'",
",",
"'tags'",
"=>",
"array",
"(",
"'environment'",
"=>",
"$",
"this",
"->",
"environment",
",",
"'php_ve... | Creates a Raven client
@return Raven_Client client instance.
@throws CException if the client could not be created. | [
"Creates",
"a",
"Raven",
"client"
] | beacc88e06a0eb32903e4eae63cc6cddea901524 | https://github.com/crisu83/yii-sentry/blob/beacc88e06a0eb32903e4eae63cc6cddea901524/components/SentryClient.php#L241-L264 | train |
crisu83/yii-sentry | components/SentryClient.php | SentryClient.checkTags | protected function checkTags($tags)
{
foreach ($tags as $key => $value) {
if (strlen($key) > self::MAX_TAG_KEY_LENGTH) {
throw new CException(sprintf(
'SentryClient does not allow tag keys that contain more than %d characters.',
self::MAX_TAG_KEY_LENGTH
));
}
if (strlen($value) > self::MAX_TAG_VALUE_LENGTH) {
throw new CException(sprintf(
'SentryClient does not allow tag values that contain more than %d characters.',
self::MAX_TAG_VALUE_LENGTH
));
}
}
} | php | protected function checkTags($tags)
{
foreach ($tags as $key => $value) {
if (strlen($key) > self::MAX_TAG_KEY_LENGTH) {
throw new CException(sprintf(
'SentryClient does not allow tag keys that contain more than %d characters.',
self::MAX_TAG_KEY_LENGTH
));
}
if (strlen($value) > self::MAX_TAG_VALUE_LENGTH) {
throw new CException(sprintf(
'SentryClient does not allow tag values that contain more than %d characters.',
self::MAX_TAG_VALUE_LENGTH
));
}
}
} | [
"protected",
"function",
"checkTags",
"(",
"$",
"tags",
")",
"{",
"foreach",
"(",
"$",
"tags",
"as",
"$",
"key",
"=>",
"$",
"value",
")",
"{",
"if",
"(",
"strlen",
"(",
"$",
"key",
")",
">",
"self",
"::",
"MAX_TAG_KEY_LENGTH",
")",
"{",
"throw",
"n... | Checks that the given tags are valid.
@param array $tags tags to check.
@throws CException if a tag is invalid. | [
"Checks",
"that",
"the",
"given",
"tags",
"are",
"valid",
"."
] | beacc88e06a0eb32903e4eae63cc6cddea901524 | https://github.com/crisu83/yii-sentry/blob/beacc88e06a0eb32903e4eae63cc6cddea901524/components/SentryClient.php#L271-L287 | train |
crisu83/yii-sentry | components/SentryLogRoute.php | SentryLogRoute.processLogs | protected function processLogs($logs)
{
foreach ($logs as $log) {
$this->getSentryClient()->captureMessage(
$log[0],
array(),
array(
'extra' => array(
'message' => $log[0],
'level' => $log[1],
'category' => $log[2],
'log_time' => date('Y-m-d H:i:s', $log[3]),
),
)
);
}
} | php | protected function processLogs($logs)
{
foreach ($logs as $log) {
$this->getSentryClient()->captureMessage(
$log[0],
array(),
array(
'extra' => array(
'message' => $log[0],
'level' => $log[1],
'category' => $log[2],
'log_time' => date('Y-m-d H:i:s', $log[3]),
),
)
);
}
} | [
"protected",
"function",
"processLogs",
"(",
"$",
"logs",
")",
"{",
"foreach",
"(",
"$",
"logs",
"as",
"$",
"log",
")",
"{",
"$",
"this",
"->",
"getSentryClient",
"(",
")",
"->",
"captureMessage",
"(",
"$",
"log",
"[",
"0",
"]",
",",
"array",
"(",
... | Processes log messages and sends them to specific destination.
Derived child classes must implement this method.
@param array $logs list of messages. Each array element represents one message
with the following structure:
array(
[0] => message (string)
[1] => level (string)
[2] => category (string)
[3] => timestamp (float, obtained by microtime(true)
); | [
"Processes",
"log",
"messages",
"and",
"sends",
"them",
"to",
"specific",
"destination",
".",
"Derived",
"child",
"classes",
"must",
"implement",
"this",
"method",
"."
] | beacc88e06a0eb32903e4eae63cc6cddea901524 | https://github.com/crisu83/yii-sentry/blob/beacc88e06a0eb32903e4eae63cc6cddea901524/components/SentryLogRoute.php#L32-L48 | train |
praxisnetau/silverware | src/Forms/GridField/GridFieldConfig_MultiClassEditor.php | GridFieldConfig_MultiClassEditor.setClasses | public function setClasses($classes, $default = null)
{
if ($component = $this->getComponentByType(GridFieldAddNewMultiClass::class)) {
$component->setClasses($classes, $default);
}
return $this;
} | php | public function setClasses($classes, $default = null)
{
if ($component = $this->getComponentByType(GridFieldAddNewMultiClass::class)) {
$component->setClasses($classes, $default);
}
return $this;
} | [
"public",
"function",
"setClasses",
"(",
"$",
"classes",
",",
"$",
"default",
"=",
"null",
")",
"{",
"if",
"(",
"$",
"component",
"=",
"$",
"this",
"->",
"getComponentByType",
"(",
"GridFieldAddNewMultiClass",
"::",
"class",
")",
")",
"{",
"$",
"component"... | Defines the classes that can be created using the grid field.
@param array $classes Class names optionally mapped to titles.
@param string $default Optional default class name.
@return $this | [
"Defines",
"the",
"classes",
"that",
"can",
"be",
"created",
"using",
"the",
"grid",
"field",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/Forms/GridField/GridFieldConfig_MultiClassEditor.php#L69-L76 | train |
kuzzleio/sdk-php | src/Document.php | Document.delete | public function delete(array $options = [])
{
if (!$this->id) {
throw new InvalidArgumentException('Kuzzle\Document::delete: cannot delete a document without a document ID');
}
$this->collection->getKuzzle()->query(
$this->collection->buildQueryArgs('document', 'delete'),
$this->collection->getKuzzle()->addHeaders($this->serialize(), $this->headers),
$options
);
return $this->id;
} | php | public function delete(array $options = [])
{
if (!$this->id) {
throw new InvalidArgumentException('Kuzzle\Document::delete: cannot delete a document without a document ID');
}
$this->collection->getKuzzle()->query(
$this->collection->buildQueryArgs('document', 'delete'),
$this->collection->getKuzzle()->addHeaders($this->serialize(), $this->headers),
$options
);
return $this->id;
} | [
"public",
"function",
"delete",
"(",
"array",
"$",
"options",
"=",
"[",
"]",
")",
"{",
"if",
"(",
"!",
"$",
"this",
"->",
"id",
")",
"{",
"throw",
"new",
"InvalidArgumentException",
"(",
"'Kuzzle\\Document::delete: cannot delete a document without a document ID'",
... | Deletes this document in Kuzzle
@param array $options Optional parameters
@return integer Id of document deleted
@throws InvalidArgumentException | [
"Deletes",
"this",
"document",
"in",
"Kuzzle"
] | b1e76cafaa9c7cc08d619c838c6208489e94565b | https://github.com/kuzzleio/sdk-php/blob/b1e76cafaa9c7cc08d619c838c6208489e94565b/src/Document.php#L88-L101 | train |
kuzzleio/sdk-php | src/Document.php | Document.exists | public function exists(array $options = [])
{
if (!$this->id) {
throw new InvalidArgumentException('Kuzzle\Document::exists: cannot check if the document exists without a document ID');
}
$response = $this->collection->getKuzzle()->query(
$this->collection->buildQueryArgs('document', 'exists'),
$this->collection->getKuzzle()->addHeaders($this->serialize(), $this->headers),
$options
);
return $response['result'];
} | php | public function exists(array $options = [])
{
if (!$this->id) {
throw new InvalidArgumentException('Kuzzle\Document::exists: cannot check if the document exists without a document ID');
}
$response = $this->collection->getKuzzle()->query(
$this->collection->buildQueryArgs('document', 'exists'),
$this->collection->getKuzzle()->addHeaders($this->serialize(), $this->headers),
$options
);
return $response['result'];
} | [
"public",
"function",
"exists",
"(",
"array",
"$",
"options",
"=",
"[",
"]",
")",
"{",
"if",
"(",
"!",
"$",
"this",
"->",
"id",
")",
"{",
"throw",
"new",
"InvalidArgumentException",
"(",
"'Kuzzle\\Document::exists: cannot check if the document exists without a docum... | Checks if this document exists in Kuzzle.
@param array $options
@return boolean
@throws InvalidArgumentException | [
"Checks",
"if",
"this",
"document",
"exists",
"in",
"Kuzzle",
"."
] | b1e76cafaa9c7cc08d619c838c6208489e94565b | https://github.com/kuzzleio/sdk-php/blob/b1e76cafaa9c7cc08d619c838c6208489e94565b/src/Document.php#L111-L124 | train |
kuzzleio/sdk-php | src/Document.php | Document.refresh | public function refresh(array $options = [])
{
if (!$this->id) {
throw new InvalidArgumentException('Kuzzle\Document::refresh: cannot retrieve a document without a document ID');
}
$data = [
'_id' => $this->id
];
$response = $this->collection->getKuzzle()->query(
$this->collection->buildQueryArgs('document', 'get'),
$this->collection->getKuzzle()->addHeaders($data, $this->headers),
$options
);
$documentContent = $response['result']['_source'];
$documentContent['_version'] = $response['result']['_version'];
$documentMeta = $response['result']['_meta'];
return new Document($this->collection, $response['result']['_id'], $documentContent, $documentMeta);
} | php | public function refresh(array $options = [])
{
if (!$this->id) {
throw new InvalidArgumentException('Kuzzle\Document::refresh: cannot retrieve a document without a document ID');
}
$data = [
'_id' => $this->id
];
$response = $this->collection->getKuzzle()->query(
$this->collection->buildQueryArgs('document', 'get'),
$this->collection->getKuzzle()->addHeaders($data, $this->headers),
$options
);
$documentContent = $response['result']['_source'];
$documentContent['_version'] = $response['result']['_version'];
$documentMeta = $response['result']['_meta'];
return new Document($this->collection, $response['result']['_id'], $documentContent, $documentMeta);
} | [
"public",
"function",
"refresh",
"(",
"array",
"$",
"options",
"=",
"[",
"]",
")",
"{",
"if",
"(",
"!",
"$",
"this",
"->",
"id",
")",
"{",
"throw",
"new",
"InvalidArgumentException",
"(",
"'Kuzzle\\Document::refresh: cannot retrieve a document without a document ID'... | Creates a new KuzzleDocument object with the last version of this document stored in Kuzzle.
@param array $options Optional parameters
@return Document
@throws InvalidArgumentException | [
"Creates",
"a",
"new",
"KuzzleDocument",
"object",
"with",
"the",
"last",
"version",
"of",
"this",
"document",
"stored",
"in",
"Kuzzle",
"."
] | b1e76cafaa9c7cc08d619c838c6208489e94565b | https://github.com/kuzzleio/sdk-php/blob/b1e76cafaa9c7cc08d619c838c6208489e94565b/src/Document.php#L134-L155 | train |
kuzzleio/sdk-php | src/Document.php | Document.save | public function save(array $options = [])
{
$response = $this->collection->getKuzzle()->query(
$this->collection->buildQueryArgs('document', 'createOrReplace'),
$this->collection->getKuzzle()->addHeaders($this->serialize(), $this->headers),
$options
);
$this->id = $response['result']['_id'];
$this->version = $response['result']['_version'];
return $this;
} | php | public function save(array $options = [])
{
$response = $this->collection->getKuzzle()->query(
$this->collection->buildQueryArgs('document', 'createOrReplace'),
$this->collection->getKuzzle()->addHeaders($this->serialize(), $this->headers),
$options
);
$this->id = $response['result']['_id'];
$this->version = $response['result']['_version'];
return $this;
} | [
"public",
"function",
"save",
"(",
"array",
"$",
"options",
"=",
"[",
"]",
")",
"{",
"$",
"response",
"=",
"$",
"this",
"->",
"collection",
"->",
"getKuzzle",
"(",
")",
"->",
"query",
"(",
"$",
"this",
"->",
"collection",
"->",
"buildQueryArgs",
"(",
... | Saves this document into Kuzzle.
If this is a new document, this function will create it in Kuzzle and the id property will be made available.
Otherwise, this method will replace the latest version of this document in Kuzzle by the current content of this object.
@param array $options Optional parameters
@return Document | [
"Saves",
"this",
"document",
"into",
"Kuzzle",
"."
] | b1e76cafaa9c7cc08d619c838c6208489e94565b | https://github.com/kuzzleio/sdk-php/blob/b1e76cafaa9c7cc08d619c838c6208489e94565b/src/Document.php#L166-L178 | train |
kuzzleio/sdk-php | src/Document.php | Document.publish | public function publish(array $options = [])
{
$this->collection->getKuzzle()->query(
$this->collection->buildQueryArgs('realtime', 'publish'),
$this->collection->getKuzzle()->addHeaders($this->serialize(), $this->headers),
$options
);
return $this;
} | php | public function publish(array $options = [])
{
$this->collection->getKuzzle()->query(
$this->collection->buildQueryArgs('realtime', 'publish'),
$this->collection->getKuzzle()->addHeaders($this->serialize(), $this->headers),
$options
);
return $this;
} | [
"public",
"function",
"publish",
"(",
"array",
"$",
"options",
"=",
"[",
"]",
")",
"{",
"$",
"this",
"->",
"collection",
"->",
"getKuzzle",
"(",
")",
"->",
"query",
"(",
"$",
"this",
"->",
"collection",
"->",
"buildQueryArgs",
"(",
"'realtime'",
",",
"... | Sends the content of this document as a realtime message.
Takes an optional argument object with the following properties:
- volatile (object, default: null):
Additional information passed to notifications to other users
@param array $options
@return Document | [
"Sends",
"the",
"content",
"of",
"this",
"document",
"as",
"a",
"realtime",
"message",
"."
] | b1e76cafaa9c7cc08d619c838c6208489e94565b | https://github.com/kuzzleio/sdk-php/blob/b1e76cafaa9c7cc08d619c838c6208489e94565b/src/Document.php#L190-L199 | train |
kuzzleio/sdk-php | src/Document.php | Document.setContent | public function setContent(array $content, $replace = false)
{
if ($replace) {
$this->content = $content;
} else {
foreach ($content as $key => $value) {
$this->content[$key] = $value;
}
}
return $this;
} | php | public function setContent(array $content, $replace = false)
{
if ($replace) {
$this->content = $content;
} else {
foreach ($content as $key => $value) {
$this->content[$key] = $value;
}
}
return $this;
} | [
"public",
"function",
"setContent",
"(",
"array",
"$",
"content",
",",
"$",
"replace",
"=",
"false",
")",
"{",
"if",
"(",
"$",
"replace",
")",
"{",
"$",
"this",
"->",
"content",
"=",
"$",
"content",
";",
"}",
"else",
"{",
"foreach",
"(",
"$",
"cont... | Replaces the current content with new data.
This is a helper function returning itself, allowing to easily chain calls.
@param array $content
@param bool $replace true: replace the current content with the provided data, false: merge it
@return Document | [
"Replaces",
"the",
"current",
"content",
"with",
"new",
"data",
".",
"This",
"is",
"a",
"helper",
"function",
"returning",
"itself",
"allowing",
"to",
"easily",
"chain",
"calls",
"."
] | b1e76cafaa9c7cc08d619c838c6208489e94565b | https://github.com/kuzzleio/sdk-php/blob/b1e76cafaa9c7cc08d619c838c6208489e94565b/src/Document.php#L210-L221 | train |
praxisnetau/silverware | src/Extensions/Style/ThemeStyle.php | ThemeStyle.getDropdownOptions | public function getDropdownOptions($name)
{
$config = Config::inst()->get(static::class, 'theme_styles');
return (isset($config[$name]) && is_array($config[$name])) ? $config[$name] : [];
} | php | public function getDropdownOptions($name)
{
$config = Config::inst()->get(static::class, 'theme_styles');
return (isset($config[$name]) && is_array($config[$name])) ? $config[$name] : [];
} | [
"public",
"function",
"getDropdownOptions",
"(",
"$",
"name",
")",
"{",
"$",
"config",
"=",
"Config",
"::",
"inst",
"(",
")",
"->",
"get",
"(",
"static",
"::",
"class",
",",
"'theme_styles'",
")",
";",
"return",
"(",
"isset",
"(",
"$",
"config",
"[",
... | Answers an array of options with the given style name for a dropdown field.
@param string $name
@return array | [
"Answers",
"an",
"array",
"of",
"options",
"with",
"the",
"given",
"style",
"name",
"for",
"a",
"dropdown",
"field",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/Extensions/Style/ThemeStyle.php#L153-L158 | train |
praxisnetau/silverware | src/Model/Component.php | Component.setParentInstance | public function setParentInstance(SiteTree $parent)
{
$this->parentInstance = $parent;
$this->setStyleIDFrom($parent);
return $this;
} | php | public function setParentInstance(SiteTree $parent)
{
$this->parentInstance = $parent;
$this->setStyleIDFrom($parent);
return $this;
} | [
"public",
"function",
"setParentInstance",
"(",
"SiteTree",
"$",
"parent",
")",
"{",
"$",
"this",
"->",
"parentInstance",
"=",
"$",
"parent",
";",
"$",
"this",
"->",
"setStyleIDFrom",
"(",
"$",
"parent",
")",
";",
"return",
"$",
"this",
";",
"}"
] | Defines the parent instance of the receiver.
@param SiteTree $parent
@return $this | [
"Defines",
"the",
"parent",
"instance",
"of",
"the",
"receiver",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/Model/Component.php#L270-L277 | train |
praxisnetau/silverware | src/Model/Component.php | Component.getDefaultStyleID | public function getDefaultStyleID()
{
$ids = [$this->getTitleID()];
$parent = $this->getParent();
while ($parent instanceof Component) {
$ids[] = $parent->getTitleID();
$parent = $parent->getParent();
}
return implode('_', array_reverse($ids));
} | php | public function getDefaultStyleID()
{
$ids = [$this->getTitleID()];
$parent = $this->getParent();
while ($parent instanceof Component) {
$ids[] = $parent->getTitleID();
$parent = $parent->getParent();
}
return implode('_', array_reverse($ids));
} | [
"public",
"function",
"getDefaultStyleID",
"(",
")",
"{",
"$",
"ids",
"=",
"[",
"$",
"this",
"->",
"getTitleID",
"(",
")",
"]",
";",
"$",
"parent",
"=",
"$",
"this",
"->",
"getParent",
"(",
")",
";",
"while",
"(",
"$",
"parent",
"instanceof",
"Compon... | Answers the default style ID for the HTML template.
@return string | [
"Answers",
"the",
"default",
"style",
"ID",
"for",
"the",
"HTML",
"template",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/Model/Component.php#L488-L500 | train |
praxisnetau/silverware | src/Model/Component.php | Component.getAllChildren | public function getAllChildren()
{
// Answer Cached Children (if available):
if ($this->cacheAllChildren) {
return $this->cacheAllChildren;
}
// Obtain Child Objects:
$this->cacheAllChildren = $this->stageChildren(true);
// Answer Child Objects:
return $this->cacheAllChildren;
} | php | public function getAllChildren()
{
// Answer Cached Children (if available):
if ($this->cacheAllChildren) {
return $this->cacheAllChildren;
}
// Obtain Child Objects:
$this->cacheAllChildren = $this->stageChildren(true);
// Answer Child Objects:
return $this->cacheAllChildren;
} | [
"public",
"function",
"getAllChildren",
"(",
")",
"{",
"// Answer Cached Children (if available):",
"if",
"(",
"$",
"this",
"->",
"cacheAllChildren",
")",
"{",
"return",
"$",
"this",
"->",
"cacheAllChildren",
";",
"}",
"// Obtain Child Objects:",
"$",
"this",
"->",
... | Answers a list of all children within the receiver.
@return DataList | [
"Answers",
"a",
"list",
"of",
"all",
"children",
"within",
"the",
"receiver",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/Model/Component.php#L517-L532 | train |
praxisnetau/silverware | src/Model/Component.php | Component.getAllComponents | public function getAllComponents()
{
// Answer Cached Components (if available):
if ($this->cacheAllComponents) {
return $this->cacheAllComponents;
}
// Obtain Component Objects:
$components = ArrayList::create();
foreach ($this->getAllChildren() as $child) {
$components->push($child);
$components->merge($child->getAllComponents());
}
$this->cacheAllComponents = $components;
// Answer Component Objects:
return $this->cacheAllComponents;
} | php | public function getAllComponents()
{
// Answer Cached Components (if available):
if ($this->cacheAllComponents) {
return $this->cacheAllComponents;
}
// Obtain Component Objects:
$components = ArrayList::create();
foreach ($this->getAllChildren() as $child) {
$components->push($child);
$components->merge($child->getAllComponents());
}
$this->cacheAllComponents = $components;
// Answer Component Objects:
return $this->cacheAllComponents;
} | [
"public",
"function",
"getAllComponents",
"(",
")",
"{",
"// Answer Cached Components (if available):",
"if",
"(",
"$",
"this",
"->",
"cacheAllComponents",
")",
"{",
"return",
"$",
"this",
"->",
"cacheAllComponents",
";",
"}",
"// Obtain Component Objects:",
"$",
"com... | Answers a list of all components within the receiver.
@return ArrayList | [
"Answers",
"a",
"list",
"of",
"all",
"components",
"within",
"the",
"receiver",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/Model/Component.php#L551-L573 | train |
praxisnetau/silverware | src/Model/Component.php | Component.getEnabledChildren | public function getEnabledChildren()
{
// Answer Cached Children (if available):
if ($this->cacheEnabledChildren) {
return $this->cacheEnabledChildren;
}
// Obtain Child Objects:
$this->cacheEnabledChildren = $this->getAllChildren()->filterByCallback(function ($child) {
return ($child instanceof Component) ? $child->isEnabled() : false;
});
// Answer Child Objects:
return $this->cacheEnabledChildren;
} | php | public function getEnabledChildren()
{
// Answer Cached Children (if available):
if ($this->cacheEnabledChildren) {
return $this->cacheEnabledChildren;
}
// Obtain Child Objects:
$this->cacheEnabledChildren = $this->getAllChildren()->filterByCallback(function ($child) {
return ($child instanceof Component) ? $child->isEnabled() : false;
});
// Answer Child Objects:
return $this->cacheEnabledChildren;
} | [
"public",
"function",
"getEnabledChildren",
"(",
")",
"{",
"// Answer Cached Children (if available):",
"if",
"(",
"$",
"this",
"->",
"cacheEnabledChildren",
")",
"{",
"return",
"$",
"this",
"->",
"cacheEnabledChildren",
";",
"}",
"// Obtain Child Objects:",
"$",
"thi... | Answers a list of the enabled children within the receiver.
@return DataList | [
"Answers",
"a",
"list",
"of",
"the",
"enabled",
"children",
"within",
"the",
"receiver",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/Model/Component.php#L592-L609 | train |
praxisnetau/silverware | src/Model/Component.php | Component.getEnabledComponents | public function getEnabledComponents()
{
// Answer Cached Components (if available):
if ($this->cacheEnabledComponents) {
return $this->cacheEnabledComponents;
}
// Obtain Component Objects:
$components = ArrayList::create();
foreach ($this->getEnabledChildren() as $child) {
$components->push($child);
$components->merge($child->getEnabledComponents());
}
$this->cacheEnabledComponents = $components;
// Answer Component Objects:
return $this->cacheEnabledComponents;
} | php | public function getEnabledComponents()
{
// Answer Cached Components (if available):
if ($this->cacheEnabledComponents) {
return $this->cacheEnabledComponents;
}
// Obtain Component Objects:
$components = ArrayList::create();
foreach ($this->getEnabledChildren() as $child) {
$components->push($child);
$components->merge($child->getEnabledComponents());
}
$this->cacheEnabledComponents = $components;
// Answer Component Objects:
return $this->cacheEnabledComponents;
} | [
"public",
"function",
"getEnabledComponents",
"(",
")",
"{",
"// Answer Cached Components (if available):",
"if",
"(",
"$",
"this",
"->",
"cacheEnabledComponents",
")",
"{",
"return",
"$",
"this",
"->",
"cacheEnabledComponents",
";",
"}",
"// Obtain Component Objects:",
... | Answers a list of all the enabled components within the receiver.
@return ArrayList | [
"Answers",
"a",
"list",
"of",
"all",
"the",
"enabled",
"components",
"within",
"the",
"receiver",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/Model/Component.php#L616-L638 | train |
praxisnetau/silverware | src/Model/Component.php | Component.renderChildren | public function renderChildren($layout = null, $title = null)
{
$html = '';
foreach ($this->getEnabledChildren() as $child) {
$html .= $child->render($layout, $title);
}
return $html;
} | php | public function renderChildren($layout = null, $title = null)
{
$html = '';
foreach ($this->getEnabledChildren() as $child) {
$html .= $child->render($layout, $title);
}
return $html;
} | [
"public",
"function",
"renderChildren",
"(",
"$",
"layout",
"=",
"null",
",",
"$",
"title",
"=",
"null",
")",
"{",
"$",
"html",
"=",
"''",
";",
"foreach",
"(",
"$",
"this",
"->",
"getEnabledChildren",
"(",
")",
"as",
"$",
"child",
")",
"{",
"$",
"h... | Renders the enabled children within the component for the HTML template.
@param string $layout Page layout passed from template.
@param string $title Page title passed from template.
@return DBHTMLText|string | [
"Renders",
"the",
"enabled",
"children",
"within",
"the",
"component",
"for",
"the",
"HTML",
"template",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/Model/Component.php#L909-L918 | train |
praxisnetau/silverware | src/Components/ImageComponent.php | ImageComponent.getImageAttributes | public function getImageAttributes()
{
$attributes = [
'src' => $this->ImageURL,
'class' => $this->ImageClass,
'title' => $this->ImageTitleText,
'alt' => $this->ImageAltText
];
if ($this->hasVectorImage()) {
if ($width = $this->ImageResizeWidth) {
$attributes['width'] = $width;
}
if ($height = $this->ImageResizeHeight) {
$attributes['height'] = $height;
}
}
$this->extend('updateImageAttributes', $attributes);
return $attributes;
} | php | public function getImageAttributes()
{
$attributes = [
'src' => $this->ImageURL,
'class' => $this->ImageClass,
'title' => $this->ImageTitleText,
'alt' => $this->ImageAltText
];
if ($this->hasVectorImage()) {
if ($width = $this->ImageResizeWidth) {
$attributes['width'] = $width;
}
if ($height = $this->ImageResizeHeight) {
$attributes['height'] = $height;
}
}
$this->extend('updateImageAttributes', $attributes);
return $attributes;
} | [
"public",
"function",
"getImageAttributes",
"(",
")",
"{",
"$",
"attributes",
"=",
"[",
"'src'",
"=>",
"$",
"this",
"->",
"ImageURL",
",",
"'class'",
"=>",
"$",
"this",
"->",
"ImageClass",
",",
"'title'",
"=>",
"$",
"this",
"->",
"ImageTitleText",
",",
"... | Answers an array of attributes for the image element.
@return array | [
"Answers",
"an",
"array",
"of",
"attributes",
"for",
"the",
"image",
"element",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/Components/ImageComponent.php#L344-L368 | train |
wallstreetio/ontraport | src/Objects.php | Objects.set | public function set($object, $id = null)
{
if (is_array($object)) {
return $this->setAll($object);
}
$this->objects[$object] = $id;
} | php | public function set($object, $id = null)
{
if (is_array($object)) {
return $this->setAll($object);
}
$this->objects[$object] = $id;
} | [
"public",
"function",
"set",
"(",
"$",
"object",
",",
"$",
"id",
"=",
"null",
")",
"{",
"if",
"(",
"is_array",
"(",
"$",
"object",
")",
")",
"{",
"return",
"$",
"this",
"->",
"setAll",
"(",
"$",
"object",
")",
";",
"}",
"$",
"this",
"->",
"obje... | Set an Ontraport object by its name and id.
@param string $object
@param mixed $id
@return void | [
"Set",
"an",
"Ontraport",
"object",
"by",
"its",
"name",
"and",
"id",
"."
] | 55467fd63637083f76e497897af4aee13fc2c8b1 | https://github.com/wallstreetio/ontraport/blob/55467fd63637083f76e497897af4aee13fc2c8b1/src/Objects.php#L34-L41 | train |
wallstreetio/ontraport | src/Objects.php | Objects.get | public function get($name = null)
{
if (is_null($name)) {
return $this->all();
}
return $this->find($name);
} | php | public function get($name = null)
{
if (is_null($name)) {
return $this->all();
}
return $this->find($name);
} | [
"public",
"function",
"get",
"(",
"$",
"name",
"=",
"null",
")",
"{",
"if",
"(",
"is_null",
"(",
"$",
"name",
")",
")",
"{",
"return",
"$",
"this",
"->",
"all",
"(",
")",
";",
"}",
"return",
"$",
"this",
"->",
"find",
"(",
"$",
"name",
")",
"... | Retrieve all Ontraport objects.
@param string $name
@return mixed | [
"Retrieve",
"all",
"Ontraport",
"objects",
"."
] | 55467fd63637083f76e497897af4aee13fc2c8b1 | https://github.com/wallstreetio/ontraport/blob/55467fd63637083f76e497897af4aee13fc2c8b1/src/Objects.php#L70-L77 | train |
wallstreetio/ontraport | src/Objects.php | Objects.find | public function find($name)
{
$name = strtolower($name);
if (isset($this->objects[$name])) {
return $this->objects[$name];
}
throw new InvalidCustomObject("The object [{$name}] does not exist.");
} | php | public function find($name)
{
$name = strtolower($name);
if (isset($this->objects[$name])) {
return $this->objects[$name];
}
throw new InvalidCustomObject("The object [{$name}] does not exist.");
} | [
"public",
"function",
"find",
"(",
"$",
"name",
")",
"{",
"$",
"name",
"=",
"strtolower",
"(",
"$",
"name",
")",
";",
"if",
"(",
"isset",
"(",
"$",
"this",
"->",
"objects",
"[",
"$",
"name",
"]",
")",
")",
"{",
"return",
"$",
"this",
"->",
"obj... | Find an Ontraport object by its name.
@param string $name
@return void | [
"Find",
"an",
"Ontraport",
"object",
"by",
"its",
"name",
"."
] | 55467fd63637083f76e497897af4aee13fc2c8b1 | https://github.com/wallstreetio/ontraport/blob/55467fd63637083f76e497897af4aee13fc2c8b1/src/Objects.php#L85-L93 | train |
slimphp-api/slim-phinx | src/Module.php | Module.loadDependencies | public function loadDependencies()
{
$config = [];
$files = glob(dirname(__DIR__).'/config/*.config.php', GLOB_BRACE);
foreach ($files as $file) {
$config = array_merge($config, (require $file));
}
return $config;
} | php | public function loadDependencies()
{
$config = [];
$files = glob(dirname(__DIR__).'/config/*.config.php', GLOB_BRACE);
foreach ($files as $file) {
$config = array_merge($config, (require $file));
}
return $config;
} | [
"public",
"function",
"loadDependencies",
"(",
")",
"{",
"$",
"config",
"=",
"[",
"]",
";",
"$",
"files",
"=",
"glob",
"(",
"dirname",
"(",
"__DIR__",
")",
".",
"'/config/*.config.php'",
",",
"GLOB_BRACE",
")",
";",
"foreach",
"(",
"$",
"files",
"as",
... | load the dependencies for the module. | [
"load",
"the",
"dependencies",
"for",
"the",
"module",
"."
] | 48560f6083e0651389ef0790e59325c751e6574e | https://github.com/slimphp-api/slim-phinx/blob/48560f6083e0651389ef0790e59325c751e6574e/src/Module.php#L9-L17 | train |
terra-ops/terra-cli | src/terra/Command/Environment/EnvironmentDomains.php | EnvironmentDomains.executeAddDomain | protected function executeAddDomain(InputInterface $input, OutputInterface $output) {
// Ask for a domain
$domain_question = new Question('What domain would you like to add as a VIRTUAL_HOST for the server? (Do NOT include http://) ');
$name = $this->getAnswer($input, $output, $domain_question, 'domain', 'argument', TRUE);
// Add the domain to the domain property.
$output->writeln("Adding domain: <info>{$name}</info>");
$this->environment->domains[] = $name;
$helper = $this->getHelper('question');
$question = new ConfirmationQuestion("Add the domain <comment>$name</comment> to the environment <info>{$this->app->name}:{$this->environment->name}</info> [y/N]? ", FALSE);
if (!$helper->ask($input, $output, $question)) {
$output->writeln("<fg=red>Domain not added.</>");
$output->writeln('');
exit;
}
// Save the new version to the config.
$this->getApplication()->getTerra()->getConfig()->add('apps', array($this->app->name, 'environments', $this->environment->name), (array) $this->environment);
$this->getApplication()->getTerra()->getConfig()->save();
$output->writeln("<info>Domain added!</info> Changes won't take effect until the environment is restarted.");
$output->writeln('');
} | php | protected function executeAddDomain(InputInterface $input, OutputInterface $output) {
// Ask for a domain
$domain_question = new Question('What domain would you like to add as a VIRTUAL_HOST for the server? (Do NOT include http://) ');
$name = $this->getAnswer($input, $output, $domain_question, 'domain', 'argument', TRUE);
// Add the domain to the domain property.
$output->writeln("Adding domain: <info>{$name}</info>");
$this->environment->domains[] = $name;
$helper = $this->getHelper('question');
$question = new ConfirmationQuestion("Add the domain <comment>$name</comment> to the environment <info>{$this->app->name}:{$this->environment->name}</info> [y/N]? ", FALSE);
if (!$helper->ask($input, $output, $question)) {
$output->writeln("<fg=red>Domain not added.</>");
$output->writeln('');
exit;
}
// Save the new version to the config.
$this->getApplication()->getTerra()->getConfig()->add('apps', array($this->app->name, 'environments', $this->environment->name), (array) $this->environment);
$this->getApplication()->getTerra()->getConfig()->save();
$output->writeln("<info>Domain added!</info> Changes won't take effect until the environment is restarted.");
$output->writeln('');
} | [
"protected",
"function",
"executeAddDomain",
"(",
"InputInterface",
"$",
"input",
",",
"OutputInterface",
"$",
"output",
")",
"{",
"// Ask for a domain",
"$",
"domain_question",
"=",
"new",
"Question",
"(",
"'What domain would you like to add as a VIRTUAL_HOST for the server?... | Add a domain.
@param InputInterface $input
@param OutputInterface $output | [
"Add",
"a",
"domain",
"."
] | b176cca562534c1d65efbcef6c128f669a2ebed8 | https://github.com/terra-ops/terra-cli/blob/b176cca562534c1d65efbcef6c128f669a2ebed8/src/terra/Command/Environment/EnvironmentDomains.php#L118-L143 | train |
terra-ops/terra-cli | src/terra/Command/Environment/EnvironmentDomains.php | EnvironmentDomains.executeRemoveDomain | protected function executeRemoveDomain(InputInterface $input, OutputInterface $output) {
// If no domains are left, exit
if (empty($this->environment->domains)) {
$output->writeln('<comment>There are no domains assigned to this environment!</comment>');
exit;
}
// Ask for a domain
if ($input->getArgument('domain') == NULL) {
$helper = $this->getHelper('question');
$domains = $this->environment->domains;
$question = new ChoiceQuestion(
'Which domain would you like to remove? ',
$domains,
null
);
$name = $helper->ask($input, $output, $question);
}
// Confirm removal.
$helper = $this->getHelper('question');
$question = new ConfirmationQuestion("Remove the domain <comment>$name</comment> from the environment <info>{$this->app->name}:{$this->environment->name}</info> [y/N]? ", FALSE);
if (!$helper->ask($input, $output, $question)) {
$output->writeln("<fg=red>Domain not removed.</>");
$output->writeln('');
exit;
}
// Find and remove the domain from the config.
$key = array_search($name, $this->environment->domains);
unset($this->environment->domains[$key]);
// Save the new version to the config.
$this->getApplication()->getTerra()->getConfig()->add('apps', array($this->app->name, 'environments', $this->environment->name), (array) $this->environment);
$this->getApplication()->getTerra()->getConfig()->save();
$output->writeln("<info>Domain removed.</info> Changes won't take effect until the environment is restarted.");
$output->writeln('');
} | php | protected function executeRemoveDomain(InputInterface $input, OutputInterface $output) {
// If no domains are left, exit
if (empty($this->environment->domains)) {
$output->writeln('<comment>There are no domains assigned to this environment!</comment>');
exit;
}
// Ask for a domain
if ($input->getArgument('domain') == NULL) {
$helper = $this->getHelper('question');
$domains = $this->environment->domains;
$question = new ChoiceQuestion(
'Which domain would you like to remove? ',
$domains,
null
);
$name = $helper->ask($input, $output, $question);
}
// Confirm removal.
$helper = $this->getHelper('question');
$question = new ConfirmationQuestion("Remove the domain <comment>$name</comment> from the environment <info>{$this->app->name}:{$this->environment->name}</info> [y/N]? ", FALSE);
if (!$helper->ask($input, $output, $question)) {
$output->writeln("<fg=red>Domain not removed.</>");
$output->writeln('');
exit;
}
// Find and remove the domain from the config.
$key = array_search($name, $this->environment->domains);
unset($this->environment->domains[$key]);
// Save the new version to the config.
$this->getApplication()->getTerra()->getConfig()->add('apps', array($this->app->name, 'environments', $this->environment->name), (array) $this->environment);
$this->getApplication()->getTerra()->getConfig()->save();
$output->writeln("<info>Domain removed.</info> Changes won't take effect until the environment is restarted.");
$output->writeln('');
} | [
"protected",
"function",
"executeRemoveDomain",
"(",
"InputInterface",
"$",
"input",
",",
"OutputInterface",
"$",
"output",
")",
"{",
"// If no domains are left, exit",
"if",
"(",
"empty",
"(",
"$",
"this",
"->",
"environment",
"->",
"domains",
")",
")",
"{",
"$... | Remove a domain.
@param InputInterface $input
@param OutputInterface $output | [
"Remove",
"a",
"domain",
"."
] | b176cca562534c1d65efbcef6c128f669a2ebed8 | https://github.com/terra-ops/terra-cli/blob/b176cca562534c1d65efbcef6c128f669a2ebed8/src/terra/Command/Environment/EnvironmentDomains.php#L150-L189 | train |
i-am-tom/schemer | src/NestableResult.php | NestableResult.isError | public function isError() : bool
{
if ($this->outer->isError()) {
return true;
}
foreach ($this as $inner) {
if ($inner->isError()) {
return true;
}
}
return false;
} | php | public function isError() : bool
{
if ($this->outer->isError()) {
return true;
}
foreach ($this as $inner) {
if ($inner->isError()) {
return true;
}
}
return false;
} | [
"public",
"function",
"isError",
"(",
")",
":",
"bool",
"{",
"if",
"(",
"$",
"this",
"->",
"outer",
"->",
"isError",
"(",
")",
")",
"{",
"return",
"true",
";",
"}",
"foreach",
"(",
"$",
"this",
"as",
"$",
"inner",
")",
"{",
"if",
"(",
"$",
"inn... | Are there any errors within this result?
@return boolean | [
"Are",
"there",
"any",
"errors",
"within",
"this",
"result?"
] | aa4ff458eae636ca61ada07d05859e27d3b4584d | https://github.com/i-am-tom/schemer/blob/aa4ff458eae636ca61ada07d05859e27d3b4584d/src/NestableResult.php#L110-L123 | train |
i-am-tom/schemer | src/NestableResult.php | NestableResult.isFatal | public function isFatal() : bool
{
if ($this->outer->isFatal()) {
return true;
}
foreach ($this as $inner) {
if ($inner->isFatal()) {
return true;
}
}
return false;
} | php | public function isFatal() : bool
{
if ($this->outer->isFatal()) {
return true;
}
foreach ($this as $inner) {
if ($inner->isFatal()) {
return true;
}
}
return false;
} | [
"public",
"function",
"isFatal",
"(",
")",
":",
"bool",
"{",
"if",
"(",
"$",
"this",
"->",
"outer",
"->",
"isFatal",
"(",
")",
")",
"{",
"return",
"true",
";",
"}",
"foreach",
"(",
"$",
"this",
"as",
"$",
"inner",
")",
"{",
"if",
"(",
"$",
"inn... | Are there any fatals within this result?
@return boolean | [
"Are",
"there",
"any",
"fatals",
"within",
"this",
"result?"
] | aa4ff458eae636ca61ada07d05859e27d3b4584d | https://github.com/i-am-tom/schemer/blob/aa4ff458eae636ca61ada07d05859e27d3b4584d/src/NestableResult.php#L129-L142 | train |
praxisnetau/silverware | src/Tools/StringTools.php | StringTools.getContentSummary | public function getContentSummary(DBHTMLText $content, $maxWords = 50, $add = '...')
{
// Get Plain Text Version:
$value = $this->getContentAsPlainText($content);
// Bail Early (if empty):
if (!$value) {
return '';
}
// Split on Sentences (do not remove period):
$sentences = array_filter(array_map(function ($str) {
return trim($str);
}, preg_split('@(?<=\.)@', $value)));
$wordCount = count(preg_split('#\s+#u', $sentences[0]));
// If the First Sentence is Too Long, Show Only the First $maxWords Words:
if ($wordCount > $maxWords) {
return implode(' ', array_slice(explode(' ', $sentences[0]), 0, $maxWords)) . $add;
}
// Add Each Sentence (while there are enough words to do so):
$result = '';
do {
// Add Next Sentence:
$result .= ' ' . array_shift($sentences);
// If More Sentences, Count Number of Words:
if ($sentences) {
$wordCount += count(preg_split('#\s+#u', $sentences[0]));
}
} while ($wordCount < $maxWords && $sentences && trim($sentences[0]));
// Answer Result String:
return trim($result);
} | php | public function getContentSummary(DBHTMLText $content, $maxWords = 50, $add = '...')
{
// Get Plain Text Version:
$value = $this->getContentAsPlainText($content);
// Bail Early (if empty):
if (!$value) {
return '';
}
// Split on Sentences (do not remove period):
$sentences = array_filter(array_map(function ($str) {
return trim($str);
}, preg_split('@(?<=\.)@', $value)));
$wordCount = count(preg_split('#\s+#u', $sentences[0]));
// If the First Sentence is Too Long, Show Only the First $maxWords Words:
if ($wordCount > $maxWords) {
return implode(' ', array_slice(explode(' ', $sentences[0]), 0, $maxWords)) . $add;
}
// Add Each Sentence (while there are enough words to do so):
$result = '';
do {
// Add Next Sentence:
$result .= ' ' . array_shift($sentences);
// If More Sentences, Count Number of Words:
if ($sentences) {
$wordCount += count(preg_split('#\s+#u', $sentences[0]));
}
} while ($wordCount < $maxWords && $sentences && trim($sentences[0]));
// Answer Result String:
return trim($result);
} | [
"public",
"function",
"getContentSummary",
"(",
"DBHTMLText",
"$",
"content",
",",
"$",
"maxWords",
"=",
"50",
",",
"$",
"add",
"=",
"'...'",
")",
"{",
"// Get Plain Text Version:",
"$",
"value",
"=",
"$",
"this",
"->",
"getContentAsPlainText",
"(",
"$",
"co... | Answers a summary of the given content field using an improved method of removing tags.
@param DBHTMLText $content
@param integer $maxWords
@param string $add
@return string | [
"Answers",
"a",
"summary",
"of",
"the",
"given",
"content",
"field",
"using",
"an",
"improved",
"method",
"of",
"removing",
"tags",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/Tools/StringTools.php#L46-L93 | train |
praxisnetau/silverware | src/Tools/StringTools.php | StringTools.getContentAsPlainText | public function getContentAsPlainText(DBHTMLText $content)
{
// Preserve Line Breaks:
$text = preg_replace('/\<br(\s*)?\/?\>/i', "\n", $content->RAW());
// Convert Paragraph Breaks to Multi-Lines:
$text = preg_replace('/\<\/p\>/i', "\n\n", $text);
// Remove HTML Tags:
$text = $this->removeTags($text);
// Implode >3 Consecutive Linebreaks into 2:
$text = preg_replace('~(\R){2,}~', "\n\n", $text);
// Decode HTML Entities Back to Plain Text:
return trim(Convert::xml2raw($text));
} | php | public function getContentAsPlainText(DBHTMLText $content)
{
// Preserve Line Breaks:
$text = preg_replace('/\<br(\s*)?\/?\>/i', "\n", $content->RAW());
// Convert Paragraph Breaks to Multi-Lines:
$text = preg_replace('/\<\/p\>/i', "\n\n", $text);
// Remove HTML Tags:
$text = $this->removeTags($text);
// Implode >3 Consecutive Linebreaks into 2:
$text = preg_replace('~(\R){2,}~', "\n\n", $text);
// Decode HTML Entities Back to Plain Text:
return trim(Convert::xml2raw($text));
} | [
"public",
"function",
"getContentAsPlainText",
"(",
"DBHTMLText",
"$",
"content",
")",
"{",
"// Preserve Line Breaks:",
"$",
"text",
"=",
"preg_replace",
"(",
"'/\\<br(\\s*)?\\/?\\>/i'",
",",
"\"\\n\"",
",",
"$",
"content",
"->",
"RAW",
"(",
")",
")",
";",
"// C... | Converts the given content field to a plain text string using an improved method of removing tags.
@param DBHTMLText $content
@return string | [
"Converts",
"the",
"given",
"content",
"field",
"to",
"a",
"plain",
"text",
"string",
"using",
"an",
"improved",
"method",
"of",
"removing",
"tags",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/Tools/StringTools.php#L102-L123 | train |
praxisnetau/silverware | src/Tools/StringTools.php | StringTools.removeTags | public function removeTags($string)
{
// Remove HTML Tags:
$string = preg_replace('/<[^>]*>/', ' ', $string);
// Remove Control Characters:
$string = str_replace("\r", '', $string); // replace with empty space
$string = str_replace("\n", ' ', $string); // replace with single space
$string = str_replace("\t", ' ', $string); // replace with single space
// Remove Multiple Spaces:
$string = trim(preg_replace('/ {2,}/', ' ', $string));
// Answer String:
return $string;
} | php | public function removeTags($string)
{
// Remove HTML Tags:
$string = preg_replace('/<[^>]*>/', ' ', $string);
// Remove Control Characters:
$string = str_replace("\r", '', $string); // replace with empty space
$string = str_replace("\n", ' ', $string); // replace with single space
$string = str_replace("\t", ' ', $string); // replace with single space
// Remove Multiple Spaces:
$string = trim(preg_replace('/ {2,}/', ' ', $string));
// Answer String:
return $string;
} | [
"public",
"function",
"removeTags",
"(",
"$",
"string",
")",
"{",
"// Remove HTML Tags:",
"$",
"string",
"=",
"preg_replace",
"(",
"'/<[^>]*>/'",
",",
"' '",
",",
"$",
"string",
")",
";",
"// Remove Control Characters:",
"$",
"string",
"=",
"str_replace",
"(",
... | Removes HTML tags from the given string while maintaining whitespace.
@param string $string
@return string | [
"Removes",
"HTML",
"tags",
"from",
"the",
"given",
"string",
"while",
"maintaining",
"whitespace",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/Tools/StringTools.php#L132-L151 | train |
praxisnetau/silverware | src/Model/Slide.php | Slide.getSlideAttributes | public function getSlideAttributes($isFirst = false, $isMiddle = false, $isLast = false)
{
$attributes = ['class' => $this->getSlideClass($isFirst, $isMiddle, $isLast)];
if ($this->getParent()->hasMethod('getSlideAttributes')) {
$attributes = array_merge(
$attributes,
$this->getParent()->getSlideAttributes(
$this,
$isFirst,
$isMiddle,
$isLast
)
);
}
$this->extend('updateSlideAttributes', $attributes);
return $attributes;
} | php | public function getSlideAttributes($isFirst = false, $isMiddle = false, $isLast = false)
{
$attributes = ['class' => $this->getSlideClass($isFirst, $isMiddle, $isLast)];
if ($this->getParent()->hasMethod('getSlideAttributes')) {
$attributes = array_merge(
$attributes,
$this->getParent()->getSlideAttributes(
$this,
$isFirst,
$isMiddle,
$isLast
)
);
}
$this->extend('updateSlideAttributes', $attributes);
return $attributes;
} | [
"public",
"function",
"getSlideAttributes",
"(",
"$",
"isFirst",
"=",
"false",
",",
"$",
"isMiddle",
"=",
"false",
",",
"$",
"isLast",
"=",
"false",
")",
"{",
"$",
"attributes",
"=",
"[",
"'class'",
"=>",
"$",
"this",
"->",
"getSlideClass",
"(",
"$",
"... | Answers an array of HTML tag attributes for the slide.
@param boolean $isFirst Slide is first in the list.
@param boolean $isMiddle Slide is in the middle of the list.
@param boolean $isLast Slide is last in the list.
@return array | [
"Answers",
"an",
"array",
"of",
"HTML",
"tag",
"attributes",
"for",
"the",
"slide",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/Model/Slide.php#L381-L402 | train |
praxisnetau/silverware | src/Model/Slide.php | Slide.getSlideAttributesHTML | public function getSlideAttributesHTML($isFirst = false, $isMiddle = false, $isLast = false)
{
return $this->getAttributesHTML($this->getSlideAttributes($isFirst, $isMiddle, $isLast));
} | php | public function getSlideAttributesHTML($isFirst = false, $isMiddle = false, $isLast = false)
{
return $this->getAttributesHTML($this->getSlideAttributes($isFirst, $isMiddle, $isLast));
} | [
"public",
"function",
"getSlideAttributesHTML",
"(",
"$",
"isFirst",
"=",
"false",
",",
"$",
"isMiddle",
"=",
"false",
",",
"$",
"isLast",
"=",
"false",
")",
"{",
"return",
"$",
"this",
"->",
"getAttributesHTML",
"(",
"$",
"this",
"->",
"getSlideAttributes",... | Answers the HTML tag attributes for the slide as a string.
@param boolean $isFirst Slide is first in the list.
@param boolean $isMiddle Slide is in the middle of the list.
@param boolean $isLast Slide is last in the list.
@return string | [
"Answers",
"the",
"HTML",
"tag",
"attributes",
"for",
"the",
"slide",
"as",
"a",
"string",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/Model/Slide.php#L413-L416 | train |
praxisnetau/silverware | src/Model/Slide.php | Slide.getSlideClass | public function getSlideClass($isFirst = false, $isMiddle = false, $isLast = false)
{
return ViewTools::singleton()->array2att($this->getSlideClassNames($isFirst, $isMiddle, $isLast));
} | php | public function getSlideClass($isFirst = false, $isMiddle = false, $isLast = false)
{
return ViewTools::singleton()->array2att($this->getSlideClassNames($isFirst, $isMiddle, $isLast));
} | [
"public",
"function",
"getSlideClass",
"(",
"$",
"isFirst",
"=",
"false",
",",
"$",
"isMiddle",
"=",
"false",
",",
"$",
"isLast",
"=",
"false",
")",
"{",
"return",
"ViewTools",
"::",
"singleton",
"(",
")",
"->",
"array2att",
"(",
"$",
"this",
"->",
"ge... | Answers a string of slide class names for the HTML template.
@param boolean $isFirst Slide is first in the list.
@param boolean $isMiddle Slide is in the middle of the list.
@param boolean $isLast Slide is last in the list.
@return string | [
"Answers",
"a",
"string",
"of",
"slide",
"class",
"names",
"for",
"the",
"HTML",
"template",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/Model/Slide.php#L427-L430 | train |
praxisnetau/silverware | src/Model/Slide.php | Slide.getImageClassNames | public function getImageClassNames()
{
$classes = ['slide-image'];
if ($this->getParent()->hasMethod('getImageClassNames')) {
$classes = array_merge($classes, $this->getParent()->getImageClassNames($this));
}
$this->extend('updateImageClassNames', $classes);
return $classes;
} | php | public function getImageClassNames()
{
$classes = ['slide-image'];
if ($this->getParent()->hasMethod('getImageClassNames')) {
$classes = array_merge($classes, $this->getParent()->getImageClassNames($this));
}
$this->extend('updateImageClassNames', $classes);
return $classes;
} | [
"public",
"function",
"getImageClassNames",
"(",
")",
"{",
"$",
"classes",
"=",
"[",
"'slide-image'",
"]",
";",
"if",
"(",
"$",
"this",
"->",
"getParent",
"(",
")",
"->",
"hasMethod",
"(",
"'getImageClassNames'",
")",
")",
"{",
"$",
"classes",
"=",
"arra... | Answers an array of image class names for the HTML template.
@return array | [
"Answers",
"an",
"array",
"of",
"image",
"class",
"names",
"for",
"the",
"HTML",
"template",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/Model/Slide.php#L471-L482 | train |
praxisnetau/silverware | src/Model/Slide.php | Slide.getSlideImage | public function getSlideImage()
{
if ($this->hasImage()) {
if ($this->Image()->exists()) {
return $this->Image();
} elseif ($this->LinkPage()->hasMetaImage()) {
return $this->LinkPage()->getMetaImage();
}
}
} | php | public function getSlideImage()
{
if ($this->hasImage()) {
if ($this->Image()->exists()) {
return $this->Image();
} elseif ($this->LinkPage()->hasMetaImage()) {
return $this->LinkPage()->getMetaImage();
}
}
} | [
"public",
"function",
"getSlideImage",
"(",
")",
"{",
"if",
"(",
"$",
"this",
"->",
"hasImage",
"(",
")",
")",
"{",
"if",
"(",
"$",
"this",
"->",
"Image",
"(",
")",
"->",
"exists",
"(",
")",
")",
"{",
"return",
"$",
"this",
"->",
"Image",
"(",
... | Answers the image for the slide.
@return Image | [
"Answers",
"the",
"image",
"for",
"the",
"slide",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/Model/Slide.php#L577-L588 | train |
praxisnetau/silverware | src/Model/Slide.php | Slide.getImageResized | public function getImageResized($width = null, $height = null, $method = null)
{
if ($this->hasImage()) {
$image = $this->getSlideImage();
if ($width || $height || $method) {
return ImageTools::singleton()->resize($image, $width, $height, $method);
}
if ($this->getParent()->hasMethod('performImageResize')) {
return $this->getParent()->performImageResize($image);
}
return $image;
}
} | php | public function getImageResized($width = null, $height = null, $method = null)
{
if ($this->hasImage()) {
$image = $this->getSlideImage();
if ($width || $height || $method) {
return ImageTools::singleton()->resize($image, $width, $height, $method);
}
if ($this->getParent()->hasMethod('performImageResize')) {
return $this->getParent()->performImageResize($image);
}
return $image;
}
} | [
"public",
"function",
"getImageResized",
"(",
"$",
"width",
"=",
"null",
",",
"$",
"height",
"=",
"null",
",",
"$",
"method",
"=",
"null",
")",
"{",
"if",
"(",
"$",
"this",
"->",
"hasImage",
"(",
")",
")",
"{",
"$",
"image",
"=",
"$",
"this",
"->... | Answers a resized image using the dimensions and resize method from the parent object.
@param integer $width
@param integer $height
@param string $method
@return Image | [
"Answers",
"a",
"resized",
"image",
"using",
"the",
"dimensions",
"and",
"resize",
"method",
"from",
"the",
"parent",
"object",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/Model/Slide.php#L599-L616 | train |
praxisnetau/silverware | src/Model/Slide.php | Slide.getLinkClassNames | public function getLinkClassNames()
{
if ($this->isButtonLink() || !$this->LinkInFooter) {
return [];
}
$classes = [
$this->style('button'),
$this->ButtonTypeClass
];
if ($this->ButtonExtraClass) {
$classes[] = $this->ButtonExtraClass;
}
return $classes;
} | php | public function getLinkClassNames()
{
if ($this->isButtonLink() || !$this->LinkInFooter) {
return [];
}
$classes = [
$this->style('button'),
$this->ButtonTypeClass
];
if ($this->ButtonExtraClass) {
$classes[] = $this->ButtonExtraClass;
}
return $classes;
} | [
"public",
"function",
"getLinkClassNames",
"(",
")",
"{",
"if",
"(",
"$",
"this",
"->",
"isButtonLink",
"(",
")",
"||",
"!",
"$",
"this",
"->",
"LinkInFooter",
")",
"{",
"return",
"[",
"]",
";",
"}",
"$",
"classes",
"=",
"[",
"$",
"this",
"->",
"st... | Answers an array of link class names for the template.
@return array | [
"Answers",
"an",
"array",
"of",
"link",
"class",
"names",
"for",
"the",
"template",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/Model/Slide.php#L673-L689 | train |
praxisnetau/silverware | src/Model/Slide.php | Slide.renderSlide | public function renderSlide($isFirst = false, $isMiddle = false, $isLast = false)
{
return $this->customise([
'isFirst' => $isFirst,
'isMiddle' => $isMiddle,
'isLast' => $isLast
])->renderWith($this->getTemplate());
} | php | public function renderSlide($isFirst = false, $isMiddle = false, $isLast = false)
{
return $this->customise([
'isFirst' => $isFirst,
'isMiddle' => $isMiddle,
'isLast' => $isLast
])->renderWith($this->getTemplate());
} | [
"public",
"function",
"renderSlide",
"(",
"$",
"isFirst",
"=",
"false",
",",
"$",
"isMiddle",
"=",
"false",
",",
"$",
"isLast",
"=",
"false",
")",
"{",
"return",
"$",
"this",
"->",
"customise",
"(",
"[",
"'isFirst'",
"=>",
"$",
"isFirst",
",",
"'isMidd... | Renders the object as a slide for the HTML template.
@param boolean $isFirst Slide is first in the list.
@param boolean $isMiddle Slide is in the middle of the list.
@param boolean $isLast Slide is last in the list.
@return DBHTMLText | [
"Renders",
"the",
"object",
"as",
"a",
"slide",
"for",
"the",
"HTML",
"template",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/Model/Slide.php#L760-L767 | train |
praxisnetau/silverware | src/Forms/HasOneField.php | HasOneField.getDataDefault | public function getDataDefault($name)
{
return isset($this->dataDefaults[$name]) ? $this->dataDefaults[$name] : null;
} | php | public function getDataDefault($name)
{
return isset($this->dataDefaults[$name]) ? $this->dataDefaults[$name] : null;
} | [
"public",
"function",
"getDataDefault",
"(",
"$",
"name",
")",
"{",
"return",
"isset",
"(",
"$",
"this",
"->",
"dataDefaults",
"[",
"$",
"name",
"]",
")",
"?",
"$",
"this",
"->",
"dataDefaults",
"[",
"$",
"name",
"]",
":",
"null",
";",
"}"
] | Answers the value of an individual data default.
@param string $name
@return mixed | [
"Answers",
"the",
"value",
"of",
"an",
"individual",
"data",
"default",
"."
] | 2fa731c7f0737b350e0cbc676e93ac5beb430792 | https://github.com/praxisnetau/silverware/blob/2fa731c7f0737b350e0cbc676e93ac5beb430792/src/Forms/HasOneField.php#L165-L168 | train |
terra-ops/terra-cli | src/terra/Command/Command.php | Command.initialize | protected function initialize(InputInterface $input, OutputInterface $output)
{
// Determine app and environment from path.
$cwd = getcwd();
$config = $this->getApplication()->getTerra()->getConfig();
foreach ($config->get('apps') as $app) {
if (!isset($app['environments'])) {
$app['environments'] = array();
}
foreach ($app['environments'] as $environment) {
if (strpos($cwd, $environment['path']) === 0) {
if ($input->hasArgument('app_name')) {
$input->setArgument('app_name', $app['name']);
}
if ($input->hasArgument('environment_name')) {
$input->setArgument('environment_name', $environment['name']);
}
$environment_string = $app['name'] . ':' . $environment['name'];
$output->writeln("Using environment <question>$environment_string</question>");
}
}
}
} | php | protected function initialize(InputInterface $input, OutputInterface $output)
{
// Determine app and environment from path.
$cwd = getcwd();
$config = $this->getApplication()->getTerra()->getConfig();
foreach ($config->get('apps') as $app) {
if (!isset($app['environments'])) {
$app['environments'] = array();
}
foreach ($app['environments'] as $environment) {
if (strpos($cwd, $environment['path']) === 0) {
if ($input->hasArgument('app_name')) {
$input->setArgument('app_name', $app['name']);
}
if ($input->hasArgument('environment_name')) {
$input->setArgument('environment_name', $environment['name']);
}
$environment_string = $app['name'] . ':' . $environment['name'];
$output->writeln("Using environment <question>$environment_string</question>");
}
}
}
} | [
"protected",
"function",
"initialize",
"(",
"InputInterface",
"$",
"input",
",",
"OutputInterface",
"$",
"output",
")",
"{",
"// Determine app and environment from path.",
"$",
"cwd",
"=",
"getcwd",
"(",
")",
";",
"$",
"config",
"=",
"$",
"this",
"->",
"getAppli... | Detect app and environment from current path.
@param InputInterface $input An InputInterface instance
@param OutputInterface $output An OutputInterface instance | [
"Detect",
"app",
"and",
"environment",
"from",
"current",
"path",
"."
] | b176cca562534c1d65efbcef6c128f669a2ebed8 | https://github.com/terra-ops/terra-cli/blob/b176cca562534c1d65efbcef6c128f669a2ebed8/src/terra/Command/Command.php#L28-L55 | train |
terra-ops/terra-cli | src/terra/Command/Command.php | Command.getAnswer | public function getAnswer(InputInterface $input, OutputInterface $output, Question $question, $argument_name, $type = 'argument', $required = FALSE)
{
$helper = $this->getHelper('question');
if ($type == 'argument') {
$value = $input->getArgument($argument_name);
} elseif ($type == 'option') {
$value = $input->getOption($argument_name);
}
if (empty($value)) {
// If we are in non-interactive mode, we have no choice but to return nothing.
if ($input->getOption('yes')) {
return '';
}
if ($required) {
while (empty($value)) {
$value = $helper->ask($input, $output, $question);
}
}
else {
$value = $helper->ask($input, $output, $question);
}
}
return $value;
} | php | public function getAnswer(InputInterface $input, OutputInterface $output, Question $question, $argument_name, $type = 'argument', $required = FALSE)
{
$helper = $this->getHelper('question');
if ($type == 'argument') {
$value = $input->getArgument($argument_name);
} elseif ($type == 'option') {
$value = $input->getOption($argument_name);
}
if (empty($value)) {
// If we are in non-interactive mode, we have no choice but to return nothing.
if ($input->getOption('yes')) {
return '';
}
if ($required) {
while (empty($value)) {
$value = $helper->ask($input, $output, $question);
}
}
else {
$value = $helper->ask($input, $output, $question);
}
}
return $value;
} | [
"public",
"function",
"getAnswer",
"(",
"InputInterface",
"$",
"input",
",",
"OutputInterface",
"$",
"output",
",",
"Question",
"$",
"question",
",",
"$",
"argument_name",
",",
"$",
"type",
"=",
"'argument'",
",",
"$",
"required",
"=",
"FALSE",
")",
"{",
"... | Helper to ask a question only if a default argument is not present.
@param InputInterface $input
@param OutputInterface $output
@param Question $question
A Question object
@param $argument_name
Name of the argument or option to default to.
@param string $type
Either "argument" (default) or "option"
@return mixed
The value derived from either the argument/option or the value. | [
"Helper",
"to",
"ask",
"a",
"question",
"only",
"if",
"a",
"default",
"argument",
"is",
"not",
"present",
"."
] | b176cca562534c1d65efbcef6c128f669a2ebed8 | https://github.com/terra-ops/terra-cli/blob/b176cca562534c1d65efbcef6c128f669a2ebed8/src/terra/Command/Command.php#L72-L99 | train |
ejsmont-artur/php-circuit-breaker-bundle | Factory.php | Factory.getDoctrineCacheInstance | public static function getDoctrineCacheInstance(Cache $doctrineCache, $maxFailures = 20, $retryTimeout = 30) {
$storage = new ArrayDecorator(new DoctrineCacheAdapter($doctrineCache));
return new CircuitBreaker($storage, $maxFailures, $retryTimeout);
} | php | public static function getDoctrineCacheInstance(Cache $doctrineCache, $maxFailures = 20, $retryTimeout = 30) {
$storage = new ArrayDecorator(new DoctrineCacheAdapter($doctrineCache));
return new CircuitBreaker($storage, $maxFailures, $retryTimeout);
} | [
"public",
"static",
"function",
"getDoctrineCacheInstance",
"(",
"Cache",
"$",
"doctrineCache",
",",
"$",
"maxFailures",
"=",
"20",
",",
"$",
"retryTimeout",
"=",
"30",
")",
"{",
"$",
"storage",
"=",
"new",
"ArrayDecorator",
"(",
"new",
"DoctrineCacheAdapter",
... | Creates a circuit breaker instance using doctrine cache adapter.
@param Cache $doctrineCache instance of a doctrine cache backend to use
@param int $maxFailures how many times do we allow service to fail before considering it offline
@param int $retryTimeout how many seconds should we wait before attempting retry
@return CircuitBreakerInterface | [
"Creates",
"a",
"circuit",
"breaker",
"instance",
"using",
"doctrine",
"cache",
"adapter",
"."
] | 3327b0fff0c5f87154376eb3b0d8984358a3e033 | https://github.com/ejsmont-artur/php-circuit-breaker-bundle/blob/3327b0fff0c5f87154376eb3b0d8984358a3e033/Factory.php#L24-L27 | train |
digiaonline/paytrail-php | src/Http/Client.php | Client.processPayment | public function processPayment(Payment $payment)
{
$response = $this->postRequest('/api-payment/create', $payment->toJson());
if ( ! in_array('application/json', $response->getHeader('Content-Type'))) {
throw new PaymentFailed('Server returned a non-JSON result.');
}
$body = json_decode((string)$response->getBody());
if ($response->getStatusCode() !== 201) {
throw new PaymentFailed(
sprintf('Paytrail request failed: %s (%d)', $body->errorMessage, $body->errorCode)
);
}
$result = new Result;
$result->configure(
array(
'orderNumber' => $body->orderNumber,
'token' => $body->token,
'url' => $body->url,
)
);
return $result;
} | php | public function processPayment(Payment $payment)
{
$response = $this->postRequest('/api-payment/create', $payment->toJson());
if ( ! in_array('application/json', $response->getHeader('Content-Type'))) {
throw new PaymentFailed('Server returned a non-JSON result.');
}
$body = json_decode((string)$response->getBody());
if ($response->getStatusCode() !== 201) {
throw new PaymentFailed(
sprintf('Paytrail request failed: %s (%d)', $body->errorMessage, $body->errorCode)
);
}
$result = new Result;
$result->configure(
array(
'orderNumber' => $body->orderNumber,
'token' => $body->token,
'url' => $body->url,
)
);
return $result;
} | [
"public",
"function",
"processPayment",
"(",
"Payment",
"$",
"payment",
")",
"{",
"$",
"response",
"=",
"$",
"this",
"->",
"postRequest",
"(",
"'/api-payment/create'",
",",
"$",
"payment",
"->",
"toJson",
"(",
")",
")",
";",
"if",
"(",
"!",
"in_array",
"... | Processes the payment.
@param Payment $payment The payment object.
@return \Paytrail\Http\Result
@throws \Paytrail\Exception\PaymentFailed | [
"Processes",
"the",
"payment",
"."
] | a49c5e6742c42907fe329ff9b070fe7b21add74a | https://github.com/digiaonline/paytrail-php/blob/a49c5e6742c42907fe329ff9b070fe7b21add74a/src/Http/Client.php#L135-L161 | train |
digiaonline/paytrail-php | src/Http/Client.php | Client.validateChecksum | public function validateChecksum($checksum, $orderNumber, $timestamp, $paid = null, $method = null)
{
return $checksum === $this->calculateChecksum($orderNumber, $timestamp, $paid, $method);
} | php | public function validateChecksum($checksum, $orderNumber, $timestamp, $paid = null, $method = null)
{
return $checksum === $this->calculateChecksum($orderNumber, $timestamp, $paid, $method);
} | [
"public",
"function",
"validateChecksum",
"(",
"$",
"checksum",
",",
"$",
"orderNumber",
",",
"$",
"timestamp",
",",
"$",
"paid",
"=",
"null",
",",
"$",
"method",
"=",
"null",
")",
"{",
"return",
"$",
"checksum",
"===",
"$",
"this",
"->",
"calculateCheck... | Validates the given checksum against the order.
@param string $checksum Checksum to validate.
@param string $orderNumber The order number.
@param int $timestamp The timestamp of the order.
@param string|null $paid Payment paid.
@param int|null $method The method.
@return bool | [
"Validates",
"the",
"given",
"checksum",
"against",
"the",
"order",
"."
] | a49c5e6742c42907fe329ff9b070fe7b21add74a | https://github.com/digiaonline/paytrail-php/blob/a49c5e6742c42907fe329ff9b070fe7b21add74a/src/Http/Client.php#L174-L177 | train |
digiaonline/paytrail-php | src/Http/Client.php | Client.calculateChecksum | protected function calculateChecksum($orderNumber, $timestamp, $paid = null, $method = null)
{
$data = array($orderNumber, $timestamp);
if ($paid !== null) {
$data[] = $paid;
}
if ($method !== null) {
$data[] = $method;
}
$data[] = $this->_apiSecret;
return strtoupper(md5(implode('|', $data)));
} | php | protected function calculateChecksum($orderNumber, $timestamp, $paid = null, $method = null)
{
$data = array($orderNumber, $timestamp);
if ($paid !== null) {
$data[] = $paid;
}
if ($method !== null) {
$data[] = $method;
}
$data[] = $this->_apiSecret;
return strtoupper(md5(implode('|', $data)));
} | [
"protected",
"function",
"calculateChecksum",
"(",
"$",
"orderNumber",
",",
"$",
"timestamp",
",",
"$",
"paid",
"=",
"null",
",",
"$",
"method",
"=",
"null",
")",
"{",
"$",
"data",
"=",
"array",
"(",
"$",
"orderNumber",
",",
"$",
"timestamp",
")",
";",... | Calculates the checksum.
@param string $orderNumber The order number.
@param int $timestamp The timestamp of the order.
@param string|null $paid Payment paid.
@param int|null $method The method.
@return string | [
"Calculates",
"the",
"checksum",
"."
] | a49c5e6742c42907fe329ff9b070fe7b21add74a | https://github.com/digiaonline/paytrail-php/blob/a49c5e6742c42907fe329ff9b070fe7b21add74a/src/Http/Client.php#L189-L201 | train |
digiaonline/paytrail-php | src/Http/Client.php | Client.postRequest | protected function postRequest($uri, $body = null, $options = array())
{
if ($this->testMode) {
$options['debug'] = true;
}
$headers = array(
'Content-Type' => 'application/json',
'Accept' => 'application/json',
'X-Verkkomaksut-Api-Version' => $this->apiVersion,
);
$options = array_merge(
array(
'auth' => array($this->_apiKey, $this->_apiSecret),
'timeout' => 30,
'connect_timeout' => 10,
),
$options
);
$request = new Request('POST', $uri, $headers, $body);
return $this->_client->send($request, $options);
} | php | protected function postRequest($uri, $body = null, $options = array())
{
if ($this->testMode) {
$options['debug'] = true;
}
$headers = array(
'Content-Type' => 'application/json',
'Accept' => 'application/json',
'X-Verkkomaksut-Api-Version' => $this->apiVersion,
);
$options = array_merge(
array(
'auth' => array($this->_apiKey, $this->_apiSecret),
'timeout' => 30,
'connect_timeout' => 10,
),
$options
);
$request = new Request('POST', $uri, $headers, $body);
return $this->_client->send($request, $options);
} | [
"protected",
"function",
"postRequest",
"(",
"$",
"uri",
",",
"$",
"body",
"=",
"null",
",",
"$",
"options",
"=",
"array",
"(",
")",
")",
"{",
"if",
"(",
"$",
"this",
"->",
"testMode",
")",
"{",
"$",
"options",
"[",
"'debug'",
"]",
"=",
"true",
"... | Runs a POST request.
@param string $uri The URI to post to.
@param string|null $body The body to post.
@param array $options The options.
@return \Psr\Http\Message\ResponseInterface | [
"Runs",
"a",
"POST",
"request",
"."
] | a49c5e6742c42907fe329ff9b070fe7b21add74a | https://github.com/digiaonline/paytrail-php/blob/a49c5e6742c42907fe329ff9b070fe7b21add74a/src/Http/Client.php#L212-L236 | train |
digiaonline/paytrail-php | src/Http/Client.php | Client.setApiVersion | public function setApiVersion($apiVersion)
{
if ( ! in_array($apiVersion, self::$supportedApiVersions)) {
throw new ApiVersionNotSupported(sprintf('API version %d is not supported.', $apiVersion));
}
$this->apiVersion = $apiVersion;
} | php | public function setApiVersion($apiVersion)
{
if ( ! in_array($apiVersion, self::$supportedApiVersions)) {
throw new ApiVersionNotSupported(sprintf('API version %d is not supported.', $apiVersion));
}
$this->apiVersion = $apiVersion;
} | [
"public",
"function",
"setApiVersion",
"(",
"$",
"apiVersion",
")",
"{",
"if",
"(",
"!",
"in_array",
"(",
"$",
"apiVersion",
",",
"self",
"::",
"$",
"supportedApiVersions",
")",
")",
"{",
"throw",
"new",
"ApiVersionNotSupported",
"(",
"sprintf",
"(",
"'API v... | Set the Paytrail API version.
@param int $apiVersion The API version.
@throws \Paytrail\Exception\ApiVersionNotSupported | [
"Set",
"the",
"Paytrail",
"API",
"version",
"."
] | a49c5e6742c42907fe329ff9b070fe7b21add74a | https://github.com/digiaonline/paytrail-php/blob/a49c5e6742c42907fe329ff9b070fe7b21add74a/src/Http/Client.php#L275-L281 | train |
digiaonline/paytrail-php | src/Http/Client.php | Client.getLogoUrl | public function getLogoUrl()
{
$params = [
'id' => $this->_apiKey,
'type' => $this->logoType,
'cols' => (int)$this->logoCols,
'text' => (int)$this->logoText,
'auth' => $this->calculateLogoAuth(),
];
return self::LOGO_BASE_URL . '?' . http_build_query($params);
} | php | public function getLogoUrl()
{
$params = [
'id' => $this->_apiKey,
'type' => $this->logoType,
'cols' => (int)$this->logoCols,
'text' => (int)$this->logoText,
'auth' => $this->calculateLogoAuth(),
];
return self::LOGO_BASE_URL . '?' . http_build_query($params);
} | [
"public",
"function",
"getLogoUrl",
"(",
")",
"{",
"$",
"params",
"=",
"[",
"'id'",
"=>",
"$",
"this",
"->",
"_apiKey",
",",
"'type'",
"=>",
"$",
"this",
"->",
"logoType",
",",
"'cols'",
"=>",
"(",
"int",
")",
"$",
"this",
"->",
"logoCols",
",",
"'... | Get the URL to the dynamic Paytrail logo.
@return string | [
"Get",
"the",
"URL",
"to",
"the",
"dynamic",
"Paytrail",
"logo",
"."
] | a49c5e6742c42907fe329ff9b070fe7b21add74a | https://github.com/digiaonline/paytrail-php/blob/a49c5e6742c42907fe329ff9b070fe7b21add74a/src/Http/Client.php#L288-L299 | train |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.