messages listlengths 2 2 | images images listlengths 1 1 | score float64 -1.23 2.6 | score_label class label 3
classes |
|---|---|---|---|
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[N-]=IPP",
"role": "assistant"
}
] | -1.233717 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CONN(N)ON",
"role": "assistant"
}
] | -0.806316 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[Fe]=[Eu]",
"role": "assistant"
}
] | -0.37165 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CCCCCP1OS1",
"role": "assistant"
}
] | -0.263536 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CCCCCCSC1=NNN=N1",
"role": "assistant"
}
] | -0.21594 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "F[Mn](F)(F)(F)(Br)Br",
"role": "assistant"
}
] | -0.005107 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[Mg]=[As][Mg][As]=[Mg]",
"role": "assistant"
}
] | -0.000424 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[3H]P=S(=BO)([3H])N",
"role": "assistant"
}
] | 0.068718 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "F[Xe](F)(F)(F)(F)F",
"role": "assistant"
}
] | 0.07602 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[N-]=P(=S)Cl",
"role": "assistant"
}
] | 0.163069 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[N-]=[N+]=NN(F)F",
"role": "assistant"
}
] | 0.204516 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[3H]P(F)P(F)P([B])C",
"role": "assistant"
}
] | 0.248708 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[Mn]=[Pb]",
"role": "assistant"
}
] | 0.249347 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CCCCCCP(=S)(S)S",
"role": "assistant"
}
] | 0.256555 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "F[W](F)(F)(F)(Cl)Cl",
"role": "assistant"
}
] | 0.260206 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "F[Ru](F)(F)(F)(F)(F)(F)F",
"role": "assistant"
}
] | 0.306973 | 1Redundancy | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[N-]=[N+]=NI(N=[N+]=[N-])N=[N+]=[N-]",
"role": "assistant"
}
] | 0.349877 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[N-]=[N+]=NS(=[V])N=[N+]=[N-]",
"role": "assistant"
}
] | 0.351312 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[3H]P([B][B]P([3H])F)F",
"role": "assistant"
}
] | 0.366879 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "COP=[Mo]",
"role": "assistant"
}
] | 0.372218 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[N-]=[N+]=N[Al](N=[N+]=[N-])N=[N+]=[N-]",
"role": "assistant"
}
] | 0.399359 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CCCCOC(=S)OCI",
"role": "assistant"
}
] | 0.4087 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[3H]C([3H])(F)[Te][3H]",
"role": "assistant"
}
] | 0.433787 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[Ti+2]=[Ge]",
"role": "assistant"
}
] | 0.441525 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "B12[As]3[As]1[As]23",
"role": "assistant"
}
] | 0.447284 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[N-]=[N+]=NN(Br)Br",
"role": "assistant"
}
] | 0.451129 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "F[Cr](F)(F)(Cl)(Cl)Cl",
"role": "assistant"
}
] | 0.45777 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "FSSS(F)(F)F",
"role": "assistant"
}
] | 0.461764 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CN=S=NC",
"role": "assistant"
}
] | 0.479289 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CC(=CC(=C(C)C(NCC=CCOC)(F)F)F)Br",
"role": "assistant"
}
] | 0.484888 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[2H]C1=C(C(=C(C(=C1[2H])[2H])C2=C(C(=C(C(=C2[2H])[2H])Br)Br)C3=C(C(=C(C(=C3[2H])[2H])[2H])[2H])[2H])[2H])[2H]",
"role": "assistant"
}
] | 0.485648 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CCCC[Sn]1(OOO1)OOO[Sn]2(OOO2)CCCC",
"role": "assistant"
}
] | 0.4934 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CCCC[SnH2]C1=NC=CN=C1",
"role": "assistant"
}
] | 0.499987 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[Fe]=[Bi+]",
"role": "assistant"
}
] | 0.513601 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[3H]B(C)C(=O)Cl",
"role": "assistant"
}
] | 0.53174 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CCOP(C#N)Cl",
"role": "assistant"
}
] | 0.532691 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[3H]C(CO)(CO)O",
"role": "assistant"
}
] | 0.533844 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[3H]CS(=O)(=[W])[B]",
"role": "assistant"
}
] | 0.548252 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CN(CN)F",
"role": "assistant"
}
] | 0.556821 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "N[BiH2]",
"role": "assistant"
}
] | 0.561891 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[3H]C(=C)[BH]",
"role": "assistant"
}
] | 0.561966 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CCCCCCC(=O)OCSC1=NNN=C1",
"role": "assistant"
}
] | 0.570422 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[3H]B([O-])S",
"role": "assistant"
}
] | 0.573947 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "C(SI)SI",
"role": "assistant"
}
] | 0.581535 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CC1=C(CCO1)OC(=O)Cl",
"role": "assistant"
}
] | 0.583584 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[N-]=[N+]=NN=S(=O)=O",
"role": "assistant"
}
] | 0.5906 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[3H][I-]CP",
"role": "assistant"
}
] | 0.591537 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[Ca][Ca][Ca][Ca][Ca][Ca][Ca][Ca][Ca][Ca]",
"role": "assistant"
}
] | 0.59313 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "P1P2P1P2P3P4P3P4P5P6P5P6P7P8P7P8",
"role": "assistant"
}
] | 0.599486 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[Mg]=[Hg]",
"role": "assistant"
}
] | 0.605488 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[3H]S[I-]O",
"role": "assistant"
}
] | 0.605613 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CCCC1C(P1)CF",
"role": "assistant"
}
] | 0.60635 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CCCCCP(=S)(S)S",
"role": "assistant"
}
] | 0.616555 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CN(C)CI",
"role": "assistant"
}
] | 0.625913 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CP(F)Cl",
"role": "assistant"
}
] | 0.649498 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CCCSSOC(=O)C(Cl)(Cl)Cl",
"role": "assistant"
}
] | 0.650356 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CCCCSNC(=S)S",
"role": "assistant"
}
] | 0.651294 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CP(=S)(F)Cl",
"role": "assistant"
}
] | 0.65226 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[N+](=O)([O-])SS(=O)S[N+](=O)[O-]",
"role": "assistant"
}
] | 0.660235 | 1Redundancy | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[3H][Sn]([3H])([3H])C",
"role": "assistant"
}
] | 0.667038 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CCI(C)C(C)(C1CCC1)N",
"role": "assistant"
}
] | 0.672637 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[2H]P(CSBr)Br",
"role": "assistant"
}
] | 0.675555 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[2H]P(O[3H])[Si]",
"role": "assistant"
}
] | 0.693415 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[3H]B=S=BN=BO",
"role": "assistant"
}
] | 0.69405 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CC(=O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@H]4[C@@]3(CC[C@H](C4)O)C)C",
"role": "assistant"
}
] | 0.696677 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[N-]=[N+]=N[Ge](=O)[O-]",
"role": "assistant"
}
] | 0.696818 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[Nb](I)(I)(I)(I)I",
"role": "assistant"
}
] | 0.706016 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CC(OOC=C)Br",
"role": "assistant"
}
] | 0.713313 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[B]C[Si]",
"role": "assistant"
}
] | 0.716931 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CNN(C)OO",
"role": "assistant"
}
] | 0.718747 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[SiH2]1[SiH2]P2[SiH2][SiH2]P([SiH2]1)[SiH2]2",
"role": "assistant"
}
] | 0.718918 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[Si]=[Zn]",
"role": "assistant"
}
] | 0.722302 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CC[C@@H]1[C@H](C[C@H]2[C@H](O2)C[C@@H](O1)[C@H]([C@@H](/C=C\\C#C)Cl)O)Br",
"role": "assistant"
}
] | 0.7245 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CC1=CC(=C(C=C1)N([Si](C)(C)CC2=CC=CC=C2)[Si](C)(C)CC3=CC=CC=C3)Br",
"role": "assistant"
}
] | 0.728815 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCOC(=O)CSC1=NN=C(O1)SC",
"role": "assistant"
}
] | 0.733682 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "C1[C@H]2[C@H]([C@@H]([C@@H]1Cl)[NH2+]C2(C(F)(F)F)C(F)(F)F)Br",
"role": "assistant"
}
] | 0.734543 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CCCCC1=NC(=NC(=N1)Br)Br",
"role": "assistant"
}
] | 0.734687 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CCC1=NC=CP1",
"role": "assistant"
}
] | 0.737172 | 1Redundancy | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "NN1NN1N",
"role": "assistant"
}
] | 0.740808 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CC[Te]Cl",
"role": "assistant"
}
] | 0.741861 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[P-]1P=P1",
"role": "assistant"
}
] | 0.742032 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CC1=C(C(=NS(=O)(=O)N1)C)Br",
"role": "assistant"
}
] | 0.742384 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CC(C)(CCC(=O)Cl)[SiH2]Cl",
"role": "assistant"
}
] | 0.743184 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[N-]=[N+]=NO[I-](F)(Cl)Br",
"role": "assistant"
}
] | 0.745457 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CC1=NC(N(N1C)C)[Si]",
"role": "assistant"
}
] | 0.748157 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CC(C(=C)Cl)NC(=S)N",
"role": "assistant"
}
] | 0.751876 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[3H]NI(F)[I-]P=S=S",
"role": "assistant"
}
] | 0.755567 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[3H]S(=[B])[Si](S(=[B])[3H])(S(=[B])[3H])S(=[B])[3H]",
"role": "assistant"
}
] | 0.757977 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CC1=NC(N=C1Br)(CO)[N+](=O)[O-]",
"role": "assistant"
}
] | 0.758985 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CC(C)OC(=S)Cl",
"role": "assistant"
}
] | 0.760583 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[3H]C=NN=B[I-]P",
"role": "assistant"
}
] | 0.760804 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CP(SC)Cl",
"role": "assistant"
}
] | 0.761724 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[N+](=[N+]([O-])O[N+](=[N+](O)[S-])[O-])(O)[S-]",
"role": "assistant"
}
] | 0.762578 | 1Redundancy | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[N-]=[N+]=N[Bi]1N=[N+]=N1",
"role": "assistant"
}
] | 0.762605 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[SiH]#[Zr]",
"role": "assistant"
}
] | 0.764299 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CC(CC=CC(C(=O)O)Br)C(C(C)NC)O",
"role": "assistant"
}
] | 0.764959 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CCN(CC)C(=O)SCC1(CC=CC=C1)Cl",
"role": "assistant"
}
] | 0.765286 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "[As-](I)(I)(I)(I)(I)I",
"role": "assistant"
}
] | 0.767849 | 2Synergy | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CC(C#N)(C(=O)Cl)F",
"role": "assistant"
}
] | 0.768628 | 0Uniqueness | |
[
{
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: ",
"role": "user"
},
{
"content": "CC(C(N1CCN=C1)SC)O",
"role": "assistant"
}
] | 0.769963 | 0Uniqueness |
End of preview. Expand in Data Studio
README.md exists but content is empty.
- Downloads last month
- 7