Split (1)

train · 36k rows

text stringlengths 1.4k 8.19k	meta dict
2/(x/2). Suppose -5r + 4h + 43 = -187, -h + q = 0. Is 35 a factor of r? False Let r be ((-32)/(-20))/(2/5). Suppose -4a = 3m + 33, 0 = 3a - ra - 3m - 6. Is 2/(-1)a/1 a multiple of 16? False Suppose 4b + 3k = 8019, -392b + 3k - 4011 = -394b. Is 12 a factor of b? True Suppose -5g = -4z + 117, g - 6g - 3z = 131. Suppose 22u - 2m + 10 = 20u, u = -3m + 3. Let f = u - g. Is f a multiple of 22? True Let v = 0 - 6. Suppose -426 = 5s - 2w, 2w + 171 = -2s + 3w. Let n = v - s. Is n a multiple of 26? True Let z be 4/(-12) - (-22)/(-6). Let j(n) = 4n2 + 5n + 1. Let m be j(z). Suppose -95 = -5a + m. Is 26 a factor of a? False Suppose -2j + 3t - t = 2, -2t - 4 = -5j. Let d(w) = 0w*3 + 6w*2 + 0w*3 + 6w - 22wj + w3. Does 17 divide d(16)? False Let b(i) = i2 - 4i + 3. Let k be b(3). Suppose -648 = -w + 2w + 3c, k = -2w + 4c - 1316. Is (-4)/10 - w/10 a multiple of 23? False Suppose 4b - 3b = 5g - 2042, b - 814 = -2g. Is 34 a factor of g? True Let x(k) = -100k3 + 10k*2 + 9k - 1. Does 10 divide x(-1)? True Let j(h) = 9h + 28. Is j(4) a multiple of 64? True Let z = -3510 + 5478. Is 93 a factor of z? False Let t(k) = 4k*2 + 5k - 153. Is 18 a factor of t(-17)? True Let d be ((-6)/(-4))/(5/60). Let b = 21 - d. Does 25 divide 18/77b? False Let w(p) = -218p + 116. Does 52 divide w(-4)? True Let c(g) = -6g + 24. Let n be c(8). Is 2/2 - n - 3 - 1 a multiple of 5? False Let w(t) be the third derivative of -13t4/24 + 19t*3/6 - 6t*2. Let k be w(-15). Suppose -218 - k = -4a. Is a a multiple of 18? True Let c be 10(-4)/8176/(-10). Let k = -71 + c. Is k even? False Suppose -9i + 140 = i. Suppose 0 = 5j - 2x - 3x - 185, j = -4x + 22. Let n = j - i. Is n a multiple of 5? True Let c = 1189 - -603. Does 14 divide c? True Let z = 90 + 211. Suppose y + 4y = -4b - 287, 3b - z = 5y. Let i = 105 + y. Is i a multiple of 24? False Let m = 12 + -7. Suppose 41 + 47 = 2r + 4i, -3r + mi = -77. Is r a multiple of 11? False Suppose 6q - 10q + 2508 = 0. Suppose 4o = q + 317. Is 48 a factor of o? False Let w = 5 + -11. Let a(j) = j*2 + j. Let y be a(-6). Let h = w + y. Does 24 divide h? True Is (-3)/(-6) + 22673/158 a multiple of 18? True Is (-1 - -4)/(133/1804) a multiple of 4? True Let i(l) = -10l - 2. Let j(x) = 10x + 1. Let c(k) = 4i(k) + 5j(k). Let r = 160 - 157. Is 7 a factor of c(r)? False Let v(r) = 4r3 + 3r*2 + 17. Is 5 a factor of v(5)? False Suppose 3c + 25 = 34. Suppose -3b = b + 3f - 665, 4f = -cb + 490. Is 22 a factor of b? False Suppose 0 = 179u - 182u + 414. Is u even? True Suppose -73c - 756 = -79c. Is 7 a factor of c? True Let w = -34 + 46. Is w/(-27)-123 + (-1)/(-3) a multiple of 11? True Suppose -4w - 4t - 420 = w, -2t = 3w + 254. Let q = -26 - w. Is 11 a factor of q? False Suppose 12h = 16h - 3740. Is h a multiple of 10? False Let t = -343 - -525. Is t a multiple of 14? True Suppose -z + 0 + 3 = 0. Does 11 divide ((-51)/z + -1)(-5)/2? False Let z be (-1)/10 + 38538/180. Let s = z + -114. Does 10 divide s? True Suppose -111n + 3x - 1809 = -112n, -n + 4x + 1788 = 0. Does 83 divide n? False Let f be 2(-3)/(-24) - (-13)/(-4). Does 10 divide 5 - f - -12? True Suppose 245 = 2h + 77. Suppose -2 = 2y - 3p + 54, -p = 4y + h. Is ((-10)/(-10))/((-2)/y) a multiple of 11? True Does 14 divide 4/((-12)/3) - (-1054 + 3)? True Suppose 0 = 55g - 61g + 1272. Is g a multiple of 3? False Let u = 27 + 7. Let c = u + -9. Suppose 47 + c = 2f. Is 23 a factor of f? False Let h = 93 - 72. Let s be 2/(-2 - -1) + 4. Suppose f + h = sf. Is 15 a factor of f? False Let c(d) = -7d3 + 7d*2 - 4d + 8. Let v(k) = k*3. Let x(o) = -c(o) - 6v(o). Is 20 a factor of x(7)? True Let r = 16 + -12. Suppose -c - 3c + 49 = 3u, rc - 31 = 3u. Let f = c - -26. Is f a multiple of 12? True Suppose -5c + 0c - 15 = 0. Let k = c - -28. Let q = k + 7. Does 23 divide q? False Let a(v) = -v*2 + 6v + 22. Let r be a(10). Is 196 - (r/7 + (-12)/(-21)) a multiple of 22? True Let q(k) = k. Let b be q(4). Suppose -3h - 2j = -4h + 231, -bh + 3j = -949. Is h a multiple of 28? False Suppose 5x - 4b - 8 = 0, -4x = -3b + 7b - 28. Suppose 12 = xz - 60. Is 9 a factor of z? True Let s be (-2)/5 + 874/10. Suppose -60 = -7j + s. Does 21 divide j? True Suppose 2 = 2j - 10. Let y = 26 - j. Is y a multiple of 13? False Is 972 + 4 - -6 - -10 a multiple of 32? True Let g(t) = t3 - 5t*2 + 5t - 3. Let q be g(4). Let m be q/(-21/(-6)). Does 14 divide (-1)/(129/(-42) + m)? True Let z(a) = 4a*2 + 4a - 3. Let s be z(-7). Let t = s - 19. Is 15 a factor of t? False Let h be 0 - -4 - (-2)/1. Suppose -h = 4k - 2k. Does 11 divide (423/(-3))/(-3) + k? True Let r be -2 - (2 + -2 + (-4 - 44)). Let l = r - 6. Is l a multiple of 5? True Suppose 31k + 1200 = 36k. Is k a multiple of 12? True Suppose -t + m = -5t + 5961, 0 = 4t + 3m - 5963. Does 10 divide t? True Let f(r) = -132r + 96. Is f(-2) a multiple of 53? False Suppose -5c + 3161 = 161. Is c a multiple of 57? False Let k(p) be the second derivative of p5/20 + p4/12 + p3/6 + 30p*2 - 4p. Let o be k(0). Suppose o = 3u + 2u. Is u a multiple of 9? False Let m = -138 + 143. Let k = m - -9. Is 2 a factor of k? True Let q = 125 + 115. Is 30 a factor of q? True Suppose -91o = -10o - 2187. Is o a multiple of 17? False Let l be (6/15)/(7/1890). Let w be (-2)/(-4) + 238/(-4). Let o = w + l. Is o a multiple of 15? False Let b = 72 - 255. Is ((-2)/(-3))/((-2)/b) a multiple of 17? False Let d(k) be the second derivative of k*5/24 - 5k4/12 - k3 + 8k. Let m(c) be the second derivative of d(c). Is 5 a factor of m(8)? True Suppose 0 = -2o - 3o - 5f + 1660, -2o + 652 = -4f. Is o a multiple of 33? True Suppose -7 = h - 5k, 4k = -5h + 9k + 25. Does 6 divide (632/(-12))/(-2) + h/(-6)? False Let z = -1551 - -2225. Let u = 78 - 81. Does 17 divide z/10 + u/(-5)? True Let y(s) be the first derivative of 49s2/2 + 7s + 2. Does 7 divide y(1)? True Let h(o) = o*2 - 21o + 27. Suppose 14 - 110 = -4t. Is 25 a factor of h(t)? False Let u be -81 + -2(-1)/(-2). Let i(a) = 5a + 12. Let q be i(-11). Let r = q - u. Is r a multiple of 14? False Let n(h) = 2h*2 + 2h - 1. Suppose -8y + 4y = -24. Let q = -8 + y. Is n(q) a multiple of 2? False Let r = 60 - 107. Let s = 167 + r. Is 12 a factor of s? True Does 19 divide 1/(-2) + (-2548)/(-8)? False Suppose 0l = -5l. Suppose -5q = l, 2w + 0q - q - 58 = 0. Is 6 a factor of w/3 - 2/(-6)? False Suppose -n = -6n. Suppose n = 3o - 7o + 108. Suppose -38 - o = -5r. Does 3 divide r? False Suppose -19o = -54o + 22750. Does 65 divide o? True Suppose -l - 3 + 4 = 0. Let z(c) be the second derivative of 4c5/5 - c3/2 + c*2 + 53c. Is 15 a factor of z(l)? True Let t = 68 + -65. Suppose j - 104 = 4l, 0 = tj + 5l - l - 376. Does 9 divide j? False Let q = -27 - 18. Let o = 29 - q. Suppose 3p - p = o. Does 15 divide p? False Let u(l) = -l + 360. Does 18 divide u(0)? True Let c = 1276 + -1133. Is c a multiple of 14? False Suppose -105b + 47b = -11020. Is b even? True Let z be 387/614/21. Let j = 13 + z. Is j a multiple of 8? True Let b be ((-22)/(-33))/((-2)/33). Does 6 divide b/2-6 + 0/3? False Let b(c) = c + 204. Is 3 a factor of b(48)? True Let v be 89 + (-7)/(105/(-6))5. Let r = 134 - v. Is r a multiple of 29? False Suppose -5v - 120 = 3v. Suppose 5d = -5p + 4d + 128, 4d = -p + 37. Let k = v + p. Is k a multiple of 2? True Let z be (-1016)/12 + 1/(-3). Let t = 55 + z. Let s = 21 - t. Is s a multiple of 10? False Let p = -227 - -375. Is p a multiple of 17? False Let b = -15 + 14. Let t(u) = -15u2 - u - 2. Let p be t(b). Let j = 27 + p. Is j a multiple of 8? False Let v(i) = -i3 + 3i2 - 4. Let h be v(4). Let g = 1 - h. Is 5 a factor of g? False Let a(b) = 62b*2 - 2b. Does 8 divide a(-1)? True Let f(k) = 6k2 - 2k - 4. Let d be f(-3). Suppose 4s + w - d = -w, -3s + 3w = -42. Suppose -4v + 126 = -s. Is 10 a factor of v? False Let f be (1 - 0)/(3 + -2). Does 14 divide (f-1)/((-9)/126)? True Let b(i) = 2i*3 + 3i - 7. Let j be 8/3 - (-13)/39. Is b(j) a multiple of 28? True Let x = 119 + 247. Is 65 a factor of x? False Let j = -1257 + 1800. Does 48 divi	{ "pile_set_name": "DM Mathematics" }
. List the prime factors of i. 3, 37 Let l be (12/(-10))/(3/50). Let q = 85 + l. What are the prime factors of q? 5, 13 Let y(o) = -12o - 47. Let r(d) = -12d - 46. Let x(b) = 3r(b) - 2y(b). List the prime factors of x(-14). 2, 31 Let r be ((-6)/(-33) + (-120)/176)22. What are the prime factors of ((-44)/(-8))/r + 110/4? 3 Let v = 836 - 612. List the prime factors of v. 2, 7 Suppose 2h - 35 = -3h. Suppose h = -q + 24. Let z(l) = l3 - 18l*2 + 18l - 11. What are the prime factors of z(q)? 2, 3 Let b(i) = -6i + 26. Suppose 0 = -3x + 2h - 25, -h + 3 = -x - 4. What are the prime factors of b(x)? 2, 23 Suppose -i - 3i = -8. Suppose -50 = -3v + ip, 2p = -3v - 37 + 107. Suppose 23y - vy = 102. List the prime factors of y. 2, 17 Suppose -3a = -5o + 10, a = 2a. Let d(v) = 0v*3 - 14 - 7vo - v3 - 3v + 7v + 0v3. What are the prime factors of d(-8)? 2, 3 Let d = -21 - -17. Let b be (-8 - -22)/(d/(-2)). Suppose 0 = bt - 218 + 64. List the prime factors of t. 2, 11 Let w(x) = -4x + 228. What are the prime factors of w(9)? 2, 3 List the prime factors of -19 - (76 + -791). 2, 353 Suppose 3y + 371 = z, -4z + 155 + 109 = -2y. List the prime factors of (-3)/(-6)y2/(-1). 2, 61 Suppose 5u + 2u = 168. Suppose 0 = -c + 22 + u. What are the prime factors of (c - (-1 + 0))1? 47 Let j(i) = i*3 - 12i*2 - 12i - 10. Let b be j(13). What are the prime factors of (704/132)/((-1)/b + 1)? 2 List the prime factors of 45 + -2 + -3 - -5. 3, 5 Let a = 447 - 9. What are the prime factors of a? 2, 3, 73 Let j be (25/(-5))/(0 - 1). Suppose -jw + 24 = -2w. Let m = 12 - w. List the prime factors of m. 2 Let n = -10541 + 15332. What are the prime factors of n? 3, 1597 Suppose 5a - 4426 = -0a - k, -4k + 889 = a. What are the prime factors of a? 3, 5, 59 Suppose 14n - 5n = 1872. List the prime factors of n. 2, 13 Suppose 4l - 29 = -5m, 4 = 4l - 0. List the prime factors of 18/m75/6. 3, 5 Suppose 3l + 99 = p, 0p + 2l + 210 = 2p. Suppose 0 = 6i - 0i - p. What are the prime factors of i? 2, 3 Let v = -1121 + 3761. What are the prime factors of v? 2, 3, 5, 11 Let a(p) be the first derivative of -p3/3 - 21p*2/2 - 21p + 12. What are the prime factors of a(-14)? 7, 11 Let g = 3 + 8. Suppose go - 6o - 15 = 0. List the prime factors of o. 3 Let s(o) = 48o - 55. What are the prime factors of s(9)? 13, 29 Suppose 3248 = -9z + 13z + i, 4 = -i. What are the prime factors of z? 3, 271 Suppose 0 = -5h + 2n + 2647, 7n + 2112 = 4h + 11n. List the prime factors of h. 23 Let g be (-4)/(-18) + 21/27. Let f be 1 - ((-6)/2)/g. Suppose 78 = 4h - 3b, 2b = -fh + 6b + 80. What are the prime factors of h? 2, 3 Suppose -4r + 5 = -11. Suppose 0 = 3s - 2z - 238, 0s + 5z - 348 = -rs. Let j = s + -23. What are the prime factors of j? 59 Suppose -4j = 12, c - 4c + 5j + 795 = 0. Suppose -5x + c = 4u - x, -2u - 3x = -135. List the prime factors of u. 2, 3, 5 Let s = 0 - -4. Suppose -sz + 372 = -i, -3z - 2i + 279 = -i. What are the prime factors of z? 3, 31 Let p = -727 + 1499. List the prime factors of p. 2, 193 Let b(u) = -7u - 10. Let a(z) = -z*3 - 7z*2 + 11z + 16. Let n be a(-8). What are the prime factors of b(n)? 2, 23 Suppose -a = -4k - 5a + 32, -2k + 4a = 14. Suppose r + 3r - 369 = -5q, -87 = -r - kq. What are the prime factors of r? 2, 3 What are the prime factors of (1 - 0) + -23191/(-3)? 2, 3, 43 Suppose 2576 = -39x + 55x. List the prime factors of x. 7, 23 Let n(h) = -h + 12. Let u be (-672)/63 - (-1)/(-3). Let s be n(u). List the prime factors of (4 - 10)/((-2)/s). 3, 23 Let q(r) = 60 + 4r + 7r + r*2 - 2r*2 - 8r. List the prime factors of q(0). 2, 3, 5 Let a(n) = n*3 - 17n*2 + 13n + 7. Let u be a(16). Let o = u - -52. What are the prime factors of o? 11 Let j = -23 - -26. Suppose -147 = -jh - 0h. List the prime factors of h. 7 Let j(n) = 8n2 + 7n - 14. Let r be j(-7). Suppose 3l - r = -5x, l + 133 = 2l - 3x. What are the prime factors of l? 2, 59 Let t be (-4)/(4-2)4. Suppose -4j = -2 - t, 5i + 4j - 19 = 0. What are the prime factors of (-6 - -12)/(i - 1)? 3 Let v(n) be the third derivative of -n6/120 + n5/60 - n4/8 - n3/6 - 5n*2. Let d = 4 - 6. What are the prime factors of v(d)? 17 Let p be 3 + -79 + 1/((-2)/(-8)). List the prime factors of 16/p + 1/((-18)/(-886)). 7 Let d be 1/(-3)(-72)/6. Suppose 2q + 2 = dp, q + 6 = 5p - 4. Suppose -2a - 84 = -6a + 3k, -qa + k + 105 = 0. What are the prime factors of a? 3, 7 Let l(v) = -5v*3 + 15v*2 - 8v + 1. Let d(p) = -14p3 + 44p*2 - 23p + 3. Let g(n) = 6d(n) - 17l(n). List the prime factors of g(-8). 3 Let y be 1 + -3 - (-311 - (0 + 4)). Suppose -5t = 93 - y. What are the prime factors of t? 2, 11 Let u be (2 - -4) + (5 - 3). Suppose 2t - 6 = 4g, -4t = 3g - u - 4. What are the prime factors of t? 3 Let f = -152 + 178. Let h = f + 264. List the prime factors of h. 2, 5, 29 Let j(g) = 27g + 1. Let v be j(1). Suppose -4o + v = 2b, -3o + 12 = -6o. What are the prime factors of b? 2, 11 Let m(u) be the first derivative of u*2 + 34u + 3. List the prime factors of m(-11). 2, 3 Suppose 0 = i + 2u - 2 - 9, -3u = 2i - 17. List the prime factors of ((-720)/(-28) - i) + 4/14. 5 Let z(l) = l3 - 2l*2 - l + 569. What are the prime factors of z(0)? 569 Let s be ((-90)/7)/(-5) - 3/(-7). Suppose -sn + 80 = 2n. What are the prime factors of n? 2 Let q(l) = l2 - 1. Let f(z) = 2z*2 + 4. Let b(w) = -f(w) + q(w). Let s be b(0). Let o = s + 13. List the prime factors of o. 2 Suppose -418 = -r + 3y + 396, -4118 = -5r + 3y. What are the prime factors of r? 2, 7, 59 Let w(k) = k*2 - 10k + 19. Let s be w(8). Suppose -2b - sm + 195 = 2m, 315 = 3b + 3m. List the prime factors of b. 2, 5, 11 Let g(r) = r2 - 10r + 14. Let q be g(6). Let t be ((-12)/10)/(q/50). Suppose tx = 55 + 137. List the prime factors of x. 2 Let w(c) = -5c*3 + 0c + 5c2 + 4c*3 - 4c + 2. Let r be w(4). Suppose 3t + rg - 30 = 0, 0 = 2g + 2g. List the prime factors of t. 2, 5 Let n(q) = 5q2 - 7q. Let o be n(6). Suppose 4t = -o + 330. Suppose -3b = -b - t. List the prime factors of b. 2, 3 Suppose -5m = -0m + 20. What are the prime factors of (-156)/m + -1 + -1? 37 Suppose -10d = -9d - 1. Let u = d - -15. What are the prime factors of u? 2 Suppose 0 = -26f + 6f + 59700. List the prime factors of f. 3, 5, 199 Let w(l) = -25l2 + 2l - 2. Let y be w(1). Let d = y - -124. What are the prime factors of d? 3, 11 Let f = -813 + 1681. List the prime factors of f. 2, 7, 31 Let c = 9894 - 5506. What are the prime factors of c? 2, 1097 Let z(r) be the third derivative of r*5/60 + 7r*4/24 + 7r*3/6 - 4r2. Let k be z(-7). Let b(v) = v3 - 8v2 + 9v + 4. List the prime factors of b(k). 2, 3 Suppose -21p + 14p - 1036 = 0. Let k = 258 + p. List the prime factors of k. 2, 5, 11 Let r(o) = 6o3 + 5o + 9 - 4 - 8o3 - 3o*2. Let m be r(-4). Suppose 5k - m = 5n, 0 = k + 3n + 2n - 37. List the prime factors of k. 17 List the prime factors of 9 + 0 - (-5160 - 8). 31, 167 Suppose -20p + 1232 = -13p. List the prime factors of p. 2, 11 Suppose -4h = h - 20. Suppose 0 = hk - 19 - 13. Let s = -3 + k. What are the prime factors of s? 5 Suppose 7w = -0w + 49. Let s(z) = 30z - 26. What are the prime factors of s(w)? 2, 23 Let p be 4/14 - 390/(-7). Let a(y) = y*2 + 4y - 3. Let f be a(1). List the prime factors of p + f9/6. 59 Let k be 6/(((-5)/8)/(-5)). Let h = k + -13. What are the prime factors of h? 5, 7 Let a be 63/(-6) - -4. Let c = a - -8. Suppose -4z - 24 = -cz - v, z - v = 0. What are the prime factors of z? 2 Let t be (-1 - 0)/((-1)/(-9)). Let v be ((-148)/6)/(2/t). Suppose -9 = -5c + v. What are the prime factors of c? 2, 3 What are the prime factors of 5 + -8 - -8 - -458? 463 Suppose 0 = -5r + 10r - 2x - 1442, 3r - 859 = -5x. List the prime factors of r. 2, 3 Let x = -38 + 43. Suppose -xc + 4v = -8, 2c + 5v - 17 = 2v. What are the prime factors of c? 2 Let j(p) = 8p*2 + 2p - 19. List the prime factors of j(-6). 257 Let i = -193 + 879. List the prime factors of i. 2, 7 Let j = -819 - -1177. What are the prime factors of j? 2, 179 Let t = -47 + 49. Suppose 0 = -t*x +	{ "pile_set_name": "DM Mathematics" }
). 7 Let o(g) be the third derivative of -g4/12 + g3/2 + 20g2. Suppose -b - 2b - 2 = 5y, y - 18 = 4b. Determine o(y). -1 Let l(f) = -f*3 + 2f*2 + 2f - 3. Let j be 2/(-1)(-3)/2. Let o be l(j). Let c(r) = -r + 4. Let m(q) = -2q + 5. Let g(u) = oc(u) + 5m(u). Determine g(1). -3 Let w(r) = 6r2 + r - 1. Let f = -7 - -13. Let b = f - 9. Let v = -2 - b. Calculate w(v). 6 Let j = 15 + -18. Let y(x) = 2x. Give y(j). -6 Let b(n) be the third derivative of 0n3 + 0 - 1/24n*5 + 0n + 1/12n4 + 1/720n6 + n2. Let g(v) be the second derivative of b(v). Determine g(4). -1 Let o be 4(-2)/(16/(-12)). Let a(s) = -s + 8. What is a(o)? 2 Let l(n) = 3n*2 - 5 - 4n*2 + 0n*2 + 1 + 8n. Give l(8). -4 Let y = 7 + -4. Let b(r) be the first derivative of -r2 + r - 195. What is b(y)? -5 Let u(s) be the first derivative of -s4/4 + 5s3/3 + 7s - 9. Calculate u(5). 7 Let b(z) = z - 4. Let h be b(-3). Let g(r) = 2r - 2. Calculate g(h). -16 Let l(a) = -2a - 2. Suppose -t = -w + 1, 2w + 30 + 3 = -5t. Determine l(t). 8 Let v(n) = 0n3 - n - 3n*3 + 2 + 4n*3 + 0n. Let b(w) = 1 + 3w3 - 6w*3 + 3w - 7. Let i(l) = 6b(l) + 17v(l). Give i(-2). 4 Let y(o) = o*2 + 7o - 11. Let m be y(-8). Let n be 1 - (m + (4 - 0)). Let x(z) = z3 - z2 - 4. Calculate x(n). -4 Let a(u) be the second derivative of -2u + 1/2u*2 + 0 + 7/6u*3. Give a(-1). -6 Suppose -t + 4t - 4g + 93 = 0, 0 = 5g - 15. Let y = t + 28. Let o(i) = -5i - 1. Calculate o(y). -6 Let z be (2 + -2 - 1)2. Let l be z/(-6)-13. Let w(s) = -s - 4. Let q(f) = -4f - 11. Let j(n) = -3q(n) + 8w(n). What is j(l)? -3 Suppose 2a + 12 = 4a. Let o(y) = y3 - 9y2 - y + 3. Let t(c) = -c3 + 10c2 + 2c - 4. Let u(k) = ao(k) + 5t(k). Determine u(3). 1 Let a = -2 + -2. Let z(k) = -k*3 - 3k*2 + k - 4. Determine z(a). 8 Let p = 9 - 1. Let n(j) = -5 - 2 + 5 - 7j*2 + pj + 8. Let c(f) = f*2 - f - 1. Let y(r) = -6c(r) - n(r). Determine y(4). 8 Let m(z) be the second derivative of z7/840 - z6/180 - z5/120 + z3/2 + 2z. Let b(f) be the second derivative of m(f). Calculate b(-1). -2 Let w(y) = -10y2 - y + 1. Let x(t) = -t3 + 17t2 + 17t + 19. Let r be x(18). What is w(r)? -10 Suppose 5n - 4 = -4i - 12, i - 4n - 19 = 0. Let o(y) be the second derivative of -y4/12 + y3/3 - 3y*2/2 - y. What is o(i)? -6 Let w(y) = -3y*2 + 3y. Let n be 5/(2 + 4/8). What is w(n)? -6 Let n(q) = -26q3 + 9q*2 - 7q. Let j(c) = -13c3 + 4c*2 - 3c. Let h(f) = -5j(f) + 2n(f). Determine h(1). 12 Let r = -1 + 5. Let j(o) be the first derivative of -2/3o3 + 3o*2 - o + 1. Calculate j(r). -9 Suppose -4x - 3m = -0x - 4, 4x - 24 = 2m. Let w(g) = 2g3 - xg2 - g3 - g + 0g - 1 - 6g. What is w(5)? -11 Let p(g) = -2g2 + g. Suppose 2z + 5a = -z - 26, 0 = 2z - 3a + 11. Let r(x) = x + 9. Let k be r(z). Suppose -m = -0 - k. Calculate p(m). -6 Let o(s) be the second derivative of -3/2s*2 - 2s - 1/3s3 + 0. Calculate o(-4). 5 Let c(a) = -a3 + a2 + 1. Let n(f) = f + 6f - 8f2 - f3 + 4f*3 + 16 - 14. Let w(h) = 4c(h) + n(h). Give w(-5). -4 Let o(n) = n*3 + 5n*2 + 3n - 2. Let s be o(-4). Let h(v) = -2v + v2 - 5v - 5vs + 2 + 2v*2. Calculate h(-5). -13 Suppose -2h = 54 - 6. Let g = 22 + h. Let z(f) = -2f2 + f + 1. Give z(g). -9 Let p(a) = -a + 3a - a + 4a. What is p(-1)? -5 Let h(i) be the second derivative of 1/12i*4 - 5/6i*3 + 3/2i*2 + 0 - i. Let m = -3 - -6. What is h(m)? -3 Let r = -4 - -8. Let i be (-12 + r)(-2)/(-4). Let p(d) = d*2 + 6d + 6. What is p(i)? -2 Suppose 4t - 2 = 2x, x + t = -0 - 4. Let k(j) = -j - 6. Let l(m) = -5m - 25. Let q(w) = 9k(w) - 2l(w). Determine q(x). -7 Let b(j) be the second derivative of 2/3j*3 + 1/2j*2 + 0 + 1/12j*4 - 3j. What is b(-5)? 6 Let r(b) = b - 1. Suppose 3p = -p. Calculate r(p). -1 Let d(q) = 2q*2 - 5q - 4. Let c be d(3). Let a(r) = 2r - 1. What is a(c)? -3 Let m = 6 - 0. Let v(d) be the third derivative of d5/60 - 7d*4/24 + 7d*3/6 - 23d*2. What is v(m)? 1 Suppose -6q - 4k = -q - 26, 0 = -3q + 2k + 20. Let g(b) = -2b*3 - 6b*2 + 6b*2 - 4 + qb*2 + 3b3. Give g(-6). -4 Let x(l) be the second derivative of l4/2 - l*2 + 6l. Calculate x(-2). 22 Let c(f) be the third derivative of f7/1260 - f6/720 + f5/15 - f2. Let k(s) be the third derivative of c(s). Give k(1). 3 Let c(t) = t*2 - t + 1. Let b(l) = 7l*2 - 5l + 4. Let g(f) = -b(f) + 6c(f). Suppose -12 = -u - 3u. Suppose up + 8 = p. Calculate g(p). -10 Let s(m) = 2m*2 + m - 1. Suppose 6 = 3u - 0p + 5p, 0 = 5u - p - 10. Calculate s(u). 9 Let w(x) = -x3 - x2 + x. Suppose -q - 5n - 24 = 0, q - 6q - 3n = 32. Let f be (-6)/q2 + -1. Give w(f). -10 Let t(b) be the third derivative of -b8/2240 + b7/2520 - b6/720 + b5/20 + 4b*2. Let k(p) be the third derivative of t(p). What is k(1)? -8 Let z = 0 - -1. Let w be 0 + (28/2)/(-2). Let a(q) = 3q*2 - 3q + 3. Let i(g) = -2g2 + 2g - 2. Let t(j) = wi(j) - 5a(j). Give t(z). -1 Let w(y) = -y*3 + 9y*2 - 10y + 10. Let h be w(8). Let c be h/(-4) + 4/8. Let t(i) = 0i - 3i*c + 0i + 2 + i + i*2. Give t(2). -4 Suppose -j - k - 4 = 0, 3j + 4k + 16 = 6j. Let z(n) be the third derivative of -n5/60 + n3 - 5n2. Determine z(j). 6 Let y(w) be the second derivative of 2w + 0 + 7/6w3 - 1/12w*4 - 4w*2. What is y(6)? -2 Let h(q) = 4q + 49. Let f be h(-12). Let p(y) = -14y - 1. Give p(f). -15 Let f(r) be the third derivative of -r4/8 + 2r*3/3 - 13r*2. Determine f(3). -5 Let q(m) be the first derivative of -1 + 1/2m*2 + 2m + 1/2m4 - 4/3m*3. Determine q(2). 4 Let m be 6/4(-30)/(-9). Let g(x) = x*2 + x - 6. Let c be g(m). Suppose -5q = 25, -y = -2y + 5q + c. Let v(d) = d - 1. Give v(y). -2 Let d(j) be the second derivative of j6/60 + j5/20 + j*2 + 6j. Let c(o) be the first derivative of d(o). Give c(-2). -4 Let h(r) be the first derivative of r*4/4 + 5r*3/3 + 5r*2/2 + 4r + 3. Let o = -12 - -8. Calculate h(o). 0 Let t(x) = -x + 9. Let c be t(7). Let d(n) = 2nc + 1 - 3n*2 + 6n + 3. Suppose -3w = -7b + 2b, 19 = 5w - 2b. What is d(w)? 9 Suppose -4z + 10 = 2. Suppose 0 = -f + za - 5, f + 2f + 4a = 25. Let w(u) = u - 3. Determine w(f). 0 Suppose 3n + 3 = -6. Let w be (2 - n)-11. Let u(y) = 3y + 5. Give u(w). -10 Let t = 3 + -7. Let h(i) = 4i + 5. Let j(s) = s + 1. Let g(r) = h(r) - j(r). Calculate g(t). -8 Suppose -4y - 20 = 0, 2y + 17 = -5v - 23. Let t(n) = n3 + 6n*2 - 3. Determine t(v). -3 Let t = 6 - -10. Suppose 0g - t = -4g. Let v(f) = 7f - 2f + g + f2 + f. Give v(-4). -4 Let g(r) = -r3 + 6r*2 - 6r + 4. Let t be g(4). Let x be (-1)/(-3)(-1 - -10). Suppose -4v = -4h + 12, xv + v = -t. Let u(s) = s + 4. Give u(h). 4 Let w(r) = 16 - 4r2 + 14r*2 + 12r + 2r2 + r3. Let n be w(-11). Let c(x) = -x2 + 6x + 4. Calculate c(n). 9 Let y(k) = k*2 + 3k - 3. Let r = 15 - 13. Suppose -4n + 5i = -9, -2i = rn + n + 22. Determine y(n). 1 Let m = -2 + 6. Let h(j) = j*3 - 4j*2 - 3j. Let v(f) = -1. Let z(p) = h(p) - 5v(p). Give z(m). -7 Let i(o) = -o - 8. Suppose 2m + 24 = -m. Let b = m - -2. Calculate i(b). -2 Let j(h) be the second derivative of -h*3/6 + 4h*2 + 6h. Calculate j(7). 1 Let a(l) be the first derivative of 1 + l - 1/2l2. Let p(q) = -q - 1. Let i be p(4). Give a(i). 6 Let a(t) be the third derivative of t4/24 - t3/3 + 21t*2. What is a(-5)? -7 Suppose 0 = u + 4 - 2, 6 = 5r + 2u. Let q(v) = v3 + vr - 29v + 32v + v2. Give q(-2). -6 Suppose 8m - 27 = -11. Suppose 2x = -x + 9. Let u(z) = -2 - 2z3 + z3 - z + xz2 + 0z*3. Calculate u(m). 0 Let b(w) = 3w + 15. Let c(x) = x + 7. Let g(h) = -6b(h) + 13c(h). Determine g(-2). 11 Let x(q) be the first derivative of q*4/4 - 5q*3/3 - 4q*2 + 4q - 6. Determine x(6). -8 Let u(s) = -3s - 18. Let y(g) = -g - 6. Let w(h) = 6u(h) - 17y(h). Let c be w(-7). Let b(l) be the first derivative of -l4/4 - l3/3 + 1. Calculate b(c). -2 Let p(a) = 7a*3 - 13a - 7. Let j(z) = 6z3 + z2 - 12z - 7. Let w(u) = -6j(u) + 5p(u). Give w(-7). 7 Suppose -x = 2g + 2x - 2, 0 = 2g + x + 2. Let b(o) = 4o*2 + 3o + 3. What is b(g)?	{ "pile_set_name": "DM Mathematics" }
/(-6)29/132 -2/11 (3/3)/(43/(-172)) -4 What is (-3)/1-11? 3 Evaluate (-3)/((60/(-16))/5). 4 Calculate ((-14)/(-35))/(3/32). 1/5 Evaluate (-1)/(((-112)/21)/(-8)). -3/2 Evaluate ((-8)/(-40))/(-11). -1/5 Evaluate ((-6)/(-1))/(2/(-4)-4). 3 Calculate (15/(-1))/(-1). 5 (385/10)/(-11)24/(-14) 6 What is the value of (-238)/119(-2)/(-12)? -1/3 1/((-5)/(-4))(-2)/(-4) 2/5 What is 6/((315/(-6))/(-5))? 4/7 What is 12/14(-28)/(-16)? 3/2 Calculate 32(-1)/3. -2 (((-48)/54)/4)/((-8)/6) 1/6 Evaluate 2(-5)/303. -1 Calculate ((-1)/((-2)/(-4)))/((-28)/56). 4 Calculate 4/(40/(-10))0/1. 0 What is the value of (34/(-6))/11? -2/11 What is the value of ((150/(-8))/(-15))/((-1)/(-4))? 5 What is the value of 11-31/3? -1 Evaluate (3/2)/((-228)/304). -2 Evaluate ((-1)/34)/(2/(-24)3). 2/17 Evaluate (6/1205)/((-40)/32). -1/5 (-15)/21(-14)/(-35)2 -4/7 Calculate (5/((-100)/15))/(-31). 1/4 What is (-3)/((-9)/30(-285)/3)? -2/19 What is the value of ((-3)/(-7))/((-39)/(-182))? 2 ((-721)/206)/(7/(-12)) 6 What is the value of (10/135)/(6/18)? 2/9 15((-70)/(-21))/(-10) -5 What is the value of 24((-182)/13)/(-112)? 1 (1/(-3))/(7/(-14)) 2/3 Calculate (-7)/(63/(-3))3/4. 1/4 What is 4(-6)/(-312)2? 2/13 What is 12/(-408)-17-28? -8 (-1)/(-4)2426/(-195) -4/5 What is 24/(-24)1/1? -1 What is 1890/(-180)12/(-14)? 9 What is the value of (-30)/300(-2)/(-3)-15? 1 What is the value of (-4)/27(-75)/(-50)? -2/9 What is the value of (24/96)/(2/(-2))? -1/4 Evaluate (-1)/(-1)(-24)/180. -2/15 Evaluate 4/(-126)-6-3. -4/7 What is the value of (10/50)/((-6)/(-5))? 1/6 What is 54/(-4)(-6)/(-72)8? -9 ((-2)/(-9))/(2/(-27)-6) 1/2 What is 2(-15)/1014/(-6)? 7 Evaluate -1(-10)/(-4)(-54)/(-45). -3 224/28(-1)/4 -2 What is 14/(-7)(-15)/(-30)? -1 Evaluate (-6)/12-86/204. 2/17 5/(-15)-23/(-6) -1/3 9/((-882)/35)(-8)/10 2/7 Evaluate (1/((-4)/(-12)))/((-1)/(-1)). 3 What is the value of ((-2)/(-10))/((-776)/485)? -1/8 Evaluate ((-1)/102)/(52/390). -3/2 What is (-9(-8)/144)/((-5)/(-6))? 3/5 What is (-11)/(((-84)/(-14))/6)? -11 (1/(-39))/(((-1659)/(-126))/79) -2/13 What is the value of (-4)/63(-1)/13? 2/13 (-216)/(-90)(-15)/(-4) 9 What is ((-14)/(-5))/((-3)/(135/(-18)))? 7 Calculate 126/844/(-6)-7. 7 Calculate (-35)/(-14)18/(-15). -3 What is (2/10)/(((-72)/(-10))/9)? 1/4 Evaluate (24/(-40))/(((-9)/(-6))/1). -2/5 What is the value of (-45)/(-18)((-72)/(-15))/3? 4 Evaluate ((-8)/16)/(6/84). -7 What is (-9)/((-27)/6)(-21)/6? -7 20/30(-6)/82 -1 (-30)/(-12)(-52)/195 -2/3 What is -5((-12)/(-3))/(-20)? 1 (((-12)/(-9))/((-2)/(-9)))/3 2 What is (-30)/(-5)(-16)/48? -2 Evaluate ((99/11)/(-54))/(1/(-8)). 4/3 (-1)/(4/(40/5)) -2 Evaluate ((-65)/(-130))/(-1(-10)/(-4)). -1/5 8-15/8 -5 What is the value of (8/(-12))/((-238)/51)? 1/7 ((-132)/154)/(3/93) -6/7 Calculate (4/40)/(-4(-6)/(-60)). -1/4 What is (-63)/(-105)(-30)/(-2)? 9 Evaluate 4/56/(-12). -2/5 6/14(-2)/24-4 1/7 Evaluate ((-20)/18)/(9/((-81)/6)). 5/3 What is 6/(-4)(-24)/18? 2 What is ((-84)/90)/(-14)-3? -1/5 What is the value of (-1)/((-1)/(-24)-3-2)? -4 What is 0/(((-210)/(-10))/7)? 0 (-141)/(-470)15/(-12) -3/8 ((-1)/(-36)6)/(-1) -1/6 What is the value of (-16)/247/35? -2/15 What is ((-12)/(-8))/((-5)/(-50)3)? 5 ((-4)/10)/(5/(-5)2) 1/5 Calculate (152/(-57))/((-5)/((-60)/8)). -4 What is the value of ((-66)/693)/(6/7)? -1/9 Calculate -1-515/(-25). -3 Calculate (182/(-26))/(7/(-2)). 2 ((-6)/(-30))/((-1)/5) -1 (-8)/25/(300/(-6)) 2/5 Evaluate ((-1)/((-18)/9)-2)/(-1). 1 20/(-40)(-8)/78-3 -2/13 4/(-30)45/9 -2/3 (-18)/(-12)42/(-9) -7 Evaluate ((-8)/28)/(2(-1)/8). 8/7 Evaluate -2(-3)/(-4)(-20)/(-15). -2 Evaluate (116/(-4))/((-9)/18). 8 ((-12)/(-72))/((-3)/9) -1/2 (-5)/70-22 2/7 Calculate 1(48/(-160))/(3/(-2)). 1/5 What is (((-3)/(-2))/(63/168))/10? 2/5 Evaluate ((-1)/(-2))/((-3)/12). -2 Calculate (4/(-12))/((3/36)/1). -4 Evaluate 4/(-8)-5(-6)/30. -1/2 (-6)/180/(-6) 0 ((6/(-3))/(2/(-4)))/2 2 Evaluate (-1)/28/(-2). 2 Evaluate 4/(-8)-63/9. 1 Evaluate ((-27)/72)/(14/16). -3/2 -1(-12)/(-3)-1 4 Calculate ((4/(-2))/2)/((-33)/165). 5 Evaluate 10/((-240)/3)2. -1/4 Calculate ((-72)/60)/((-2)/10). 6 Calculate 9/54-7-6. 7 What is 12/8(-8)/30? -2/5 Calculate (-8)/(-12)279/434. 3/7 ((-11)/(165/(-10)))/((-4)/24) -4 Calculate ((-24)/16)/(-34/(-24)). -3 1/(-6)(-15)/2010 5/4 What is the value of (1010/200)/((-2)/3)? -3/4 Calculate 36/(-3)(-5)/15. 4 What is 6/(-5)(-200)/120? 2 What is (48/66)/((-20)/110)? -4 What is the value of (49/28)/(((-9)/12)/(-3))? 7 What is 0/(-3(-24)/18)? 0 Calculate (-29)/(-29)0/(1/1). 0 What is the value of 20/(-12)(-2)/(152)? 1/9 What is the value of 5/((-70)/(-6))1? 3/7 What is the value of 15/(-12)2-2? 5 Calculate ((-8)/(-48))/((-1)/((-18)/4)). 3/4 Calculate -27/14(-5)/1. 5 (-14)/(70/(-15)3) 2/7 What is the value of (-14)/(-24)(-111)/(-518)? 1/8 Calculate (2/20-2)/(9/(-27)). 3/5 What is the value of ((-10)/8)/1324/(-81)? 5 What is the value of ((-2)/(-4))/((-7)/56)? -4 18/162(-6)/(-1) 2/3 Evaluate 70/7(-2)/(-24). 5/6 1/(-6)120/(-110) 2/11 Calculate ((119/14)/(-17))/(1/2). -1 What is the value of ((576/(-84))/12)/((-4)/(-2))? -2/7 48/36((-21)/(-2))/(-7) -2 What is -24/(-48)36? 3 Evaluate (-61/2)/(-3). 1 Calculate (2/(-22))/(178/(-712)). 4/11 Calculate (-3)/((-4)/(8/2)). 3 4/(-1)111/148 -3 What is (1-1)/(((-25)/(-5))/(-5))? 1 Evaluate (-6)/(12/164/2). -4 Evaluate (-30)/(-2)(-132)/330. -6 What is (0(-3)/(-9))/(2-1)? 0 Evaluate (-1375)/1104/(-10). 5 What is 1/(-50)-54/1? 2/5 What is the value of 55/(-11)4/10? -2 Calculate (0/(28/7))/1. 0 Evaluate (3/3-1)/(-2). 1/2 What is ((-18)/(-3)-1)/(6/(-4))? 4 What is the value of (0/1)/(-45/(-20))? 0 What is the value of (-3)/220/45-3? 2 What is 2/((48/20)/(-6))? -5 43/(-6)6/4 -3 Calculate ((-2)/(-42)3)/(-1). -1/7 (-2)/82-10 5 What is the value of (((-2)/3)/(-1))/(2/12)? 4 Evaluate 32/(-48)2/34-3. 2/17 Calculate (-1)/(-2)(-20)/5. -2 Calculate (1/3)/((-28)/(-24)). 2/7 Evaluate (-90)/60(-8)/(-18). -2/3 Calculate ((-60)/(-8))/((-63)/84). -10 Calculate (((-4)/2)/(-6))/((-20)/(-24)). 2/5 ((-1)/5-1)/((-117)/(-65)) 1/9 What is the value of ((-9)/((-135)/(-24)))/((-6)/15)? 4 What is the value of ((-25)/(-225))/(2/18-3)? -1/3 What is 8/2010/6? 2/3 Calculate 2/(-8)121. -3 5/(-3)(-5)/5 5/3 What is ((-390)/(-520))/(9/(-2))? -1/6 2/((-6)/37) -1/7 Calculate 34/4(-1)/1. -3 (27/((-135)/2))/((-9)/(-5)) -2/9 What is the value of ((-16)/52)/4(-6)/3? 2/13 What is the value of ((-192)/(-120))/(2/5)? 4 Evaluate (-7)/2(-20)/(-35). -2 Evaluate 44/33(-9)/(-15). 4/5 What is the value of 45/(-39)12/(-30)? 6/13 Calculate 0/62/4. 0 Calculate ((-84)/98)/((-2)/(-21)-3). 3 What is the value of (6/(-31))/((-300)/30)? 1/5 What is 2/4((-100)/(-1))/(-10)? -5 Calculate (-4)/(-2)6/12. 1 (-36)/2(-20)/(400/10) 9 Calculate (6/(-108))/((-3)/12). 2/9 Calculate -21(80/(-15))/16. 7 Evaluate 64/(-540)3. -2/15 2(10/(-44))/(-5) 1/11 ((-4)/10)/(1(-4)/(-20)) -2 (24/(-21))/(3/(-21)) 8 Evaluate ((4/25)/(-2))/(222/370). -2/15 Calculate (-2)/8(-3)/6-2. -1/4 Calculate ((-1)/4)/(-614/112). 1/3 What is (-3(-12)/(-162))/(-2)? 1/9 (17/((-34)/(-24)))/(-2) -6 What is the value of (-3)/((26/65)/(16/60))? -2 What is the value of ((-20)/(-25))/((-3)/15)? -4 What is the value of 12/24016/(-6)? -2/15 Evaluate (9/12)/(4/32). 6 Calculate (1/1-2)/(13/(-26)). 4 Calculate (-10)/(-8)(-20)/45-9. 5 Evaluate (0/(-1))/(26/26). 0 Evaluate ((-4)/(-5))/(-16(-12)/(-480)). -2 Calculate 2310/(-15). -4 Calculate (5/((-30)/27))/((-135)/180). 6 4/16-3(-3)/18 1/8 Calculate (12/14)/((-69)/(-322)). 4 Calculate 3/(12(-10)/(-40)). 1 Calculate (2/(-5))/(7/7). -2/5 Evaluate ((-1)/(-12))/(38/(-114)). -1/4 What is 9((-6)/(-75))/((-18)/(-15))? 3/5 -11(-44)/(-44) -1 What is the value of 8/45/240-4? -1/6 What is the value of ((-1)/9)/(1/6)? -2/3 What is 1/(12/16)6/(-52)? -2/13 Evaluate 1-1(-26)/78. 1/3 Evaluate (-16)/(-10)(-385)/(-308). 2 Evaluate (6/2)/(-6)0/(-7). 0 Evaluate (8/423)/((-2)/(-2)). 4/7 Evaluate ((-3)/(-4)-4)/((-9)/15). 5 Evaluate -5-33/27-3. -5 (12)/(((-90)/5)/(-6)) 2/3 What is 2/(63/(35/5))-9? -2 Calculate ((-3)/(-5))/((2/2)/5). 3 What is the value of (18/(-2))/(189/(-42))? 2 4/14-3*(-35)/(-	{ "pile_set_name": "DM Mathematics" }
7 divide v? False Let u be (-22)/(-187) - (-925)/85. Does 27 divide (u/(-33))/(3/9)-262? False Let a = -4883 + 6676. Is 45 a factor of a? False Let b be (-2)/((-4)/123). Suppose r + r - b = 0. Is 3 a factor of 2/(r - (-5)/(-15))? True Let a(u) = 4u + 22. Let o be a(0). Is 9 a factor of 25/20o15? False Let i = -978 + 2038. Suppose a - 41 = -5n + 1735, -3n = 2a - i. Is 53 a factor of n? False Suppose 13w - 48 = 381. Suppose -4n + 47 + 17 = -o, -n - 4o + w = 0. Let b = n - -3. Is b a multiple of 4? True Let b = 1208 - -618. Does 16 divide b? False Let i(z) be the first derivative of z*4/4 + 10z*3/3 - 4z*2 - 10z - 4. Let j = -222 - -212. Is 14 a factor of i(j)? True Suppose -3r - 12 = d, 5d + 10 = 352r - 357r. Suppose 0 = -5c + 5m + 396 + 234, -630 = -5c + 2m. Is 2 a factor of 20/d + -7(-6)/c? False Let f be (-403 + 9)-2(-3)/(-6). Let n = f - 212. Is n a multiple of 14? True Let l = 17590 - 9791. Does 91 divide l? False Let y = -1398 - -4385. Is 29 a factor of y? True Suppose q + 2u = 3091 + 1350, 4u + 22219 = 5q. Is q a multiple of 37? False Let v(g) = 2g + 1. Let u be v(2). Suppose -j = 5z - 10, uz = z + 3j + 27. Suppose -5n + 350 = zq, -2q + 3q = 4n + 145. Is q a multiple of 19? False Let p(n) = -3n*3 - 11n2 + 6. Let q be p(-3). Let y(c) = c3 + 13c2 + 11c - 11. Let x be y(q). Is 26 a factor of 8 - (x - (-12)/4) - -126? True Let i = 180 + -173. Suppose -2776 + 235 = -id. Is 11 a factor of d? True Let o(v) = 10v*2 + 4v - 2. Let i be -6(-4)/36-18. Let q = -14 - i. Is 6 a factor of o(q)? True Is (17 - 16)/((-3)/(-31413)) a multiple of 72? False Is 10 - (-58284)/45 - (-12)/15 a multiple of 12? False Let g = 261 - 258. Suppose 4m = p - 9, p + gp + 5m - 99 = 0. Is p a multiple of 3? True Suppose -8p + 9873 = -17455. Is 7 a factor of p? True Suppose -6b = 3 + 3. Let t be -10(3 + (b - -1 - 4)). Suppose -6q = -tq + 372. Is 31 a factor of q? True Let s(g) = 32g + 15g - 1 - 35g + 4g*2. Suppose -t + 4z = -11 - 4, 0 = 4t - z + 15. Is 13 a factor of s(t)? True Let s be ((-6)/4 - -1)(-11 - -1). Suppose 2992 = sg + 2w, 16 + 0 = -4w. Is g a multiple of 20? True Let w be 72/198 - (-51)/11. Suppose -5j + 8j - 1197 = -wu, -1 = j. Is 60 a factor of u? True Let a be (-4)/(-6)(29 + 1). Suppose 0 = -aq + 19q - 6. Is 35 a factor of ((-34)/q)/(2/72)? False Suppose 2v + 43x - 4482 = 42x, 2259 = v + 5x. Let l = -1327 + v. Is 16 a factor of l? True Suppose -4x - 2j - 28 = 0, -9j + 5j - 21 = x. Does 10 divide 6/422x-21? True Let z = 25 + -22. Suppose 0 = -3y + zg - 294, -y + 2g + 110 = -2y. Is (4 + 48/(-9))y/4 a multiple of 5? False Let h be (1 - -2 - 4)(-4 - 0). Let s(b) = 130b - 44. Is 9 a factor of s(h)? False Let m(d) be the third derivative of d4 - d3/2 - 9d*2 + 12d. Suppose 3u + u = 12. Is 23 a factor of m(u)? True Suppose 66785 + 35138 = 4u - 5i, -25480 = -u + 2i. Is 28 a factor of u? False Suppose -73 + 107 = 2s. Let m = 23 - s. Is 3 a factor of (-5)/((-10)/m) - -28? False Let a be 7 + (-7 - -7) + 1-2. Suppose -ar + 318 = -4v, -5r - 2v + 72 = -4r. Does 9 divide (19/2 - 8) + r/4? True Let o = 33 + -31. Suppose 3t - 6f + 123 = -of, -f = -2t - 82. Let b = t - -53. Is b a multiple of 3? True Let s = -95 + 98. Suppose sh - 335 = -5j, -9h + 5j + 625 = -4h. Is h a multiple of 16? False Let o(a) = 271a + 2101. Is 15 a factor of o(-4)? False Suppose 6s + 3j - 1763 = s, -5s = 5j - 1755. Suppose -5g - s = -90. Let w = g - -117. Is 32 a factor of w? True Let n(v) = -v*2 + 25v - 6. Suppose 2q = i + 2i - 49, -2q = 4i - 42. Is 6 a factor of n(i)? True Let s(z) = -2z + 18. Let o be s(7). Suppose -og + 3u = -25, 2g + 0u = -5u - 7. Is 15 a factor of (g + 320/25)(-25)/(-2)? True Suppose 8w - 38125 - 1001 = 2w. Is w a multiple of 3? False Let i(b) = b3 - 6b*2 + 7b - 14. Let m be i(6). Let w(k) = -9k2 + k - 1. Let g be w(1). Let t = g + m. Is 13 a factor of t? False Let j = -61 - -64. Suppose -u - 5r + 66 = u, 4u + jr = 104. Is 7 a factor of u? False Suppose 4w = 5f - 1416, -2w = -15f + 20f - 1392. Does 5 divide f? True Let w(t) = -t2 + 7t + 7. Let h be w(6). Suppose -9 = 16b - 19b. Suppose -4i = -12, -32 = -by - i + h. Is 14 a factor of y? True Is (-14 + 97)/(-736/64 - -4) a multiple of 37? False Suppose 2t = 3a + 1110, 2t - 4a = 611 + 497. Is 18 a factor of t? True Is -2(1 - 3) - 5944/(-4) a multiple of 14? False Let b be 1012/10 + 56/70. Suppose bs - 104s = -34. Does 10 divide s? False Is 26 a factor of ((-22)/3 + 8)/(22/202125)? False Let j be (-5)/2 - (-438)/(-12). Is (-14948)/(-12) + (-13)/j a multiple of 45? False Let r(a) = -65a - 230. Let h(d) = -2d - 107. Let j be h(-47). Does 12 divide r(j)? False Let h(b) = 2b2 - 3b + 3. Suppose -5c + 3c = 6. Does 10 divide h(c)? True Suppose -84p = 59337 - 385761. Does 58 divide p? True Suppose -10p + 17p = 8p + 5p. Let t(n) = -n2 - n. Let f(d) = 2d*2 + 4d - 47. Let u(k) = -f(k) - 4t(k). Does 17 divide u(p)? False Let k be 15/(45/(-2)) - (-16)/6. Suppose -5p + k = -q - 2, p - 5 = 0. Is 2 a factor of q? False Let r be (8/(-10) + 4 + -4)-30. Let o = -28 + r. Let p = 1 - o. Does 2 divide p? False Suppose 5j - 13 = 3z - 0, 1 = -z + j. Let f(v) = -8v + zv - v3 + 14v - v + 11 - 8v2. Is 13 a factor of f(-10)? False Let g = 471 + 7836. Let c = g - 5711. Suppose 0 = 4f + 7f - c. Is f a multiple of 21? False Is 6 a factor of 435/(-25)(-220)/11? True Let m(l) = -l*2 - 12l + 32. Let c be 83/3 - (-1)/(-6)4. Suppose -3n + c = 66. Is m(n) a multiple of 2? False Suppose 140 = 9u - 5u. Suppose -9 = -d - u. Let w = d + 116. Is w a multiple of 45? True Let j = -525 + 528. Does 33 divide (j/(-5))/(56/(-10920))? False Is 40 a factor of (-2 - 12336/(-7)) + 158/(-553)? True Let q = 1219 + -863. Suppose -3m - 182 = -j - 2m, -2m = 2j - q. Is 27 a factor of j? False Let c(y) = y*2 - 4y - 2. Let d be c(4). Let l(q) = -741q2 + 3 - 743q2 - 1 - q3 + 1483q2. Is l(d) a multiple of 6? True Let f be 0 + 3 + 0 + 2. Suppose 0 = -h - fz + 8, 2h - 4z - 51 = -7z. Suppose 2b + 0b - 5k = h, 0 = 3b + 3k - 60. Does 17 divide b? False Let m(b) be the third derivative of -29b4/8 + 3b3 + b2 - 2. Is 33 a factor of m(-5)? False Let v(a) = 4a2 - 12a - 2. Let y(t) = 2t + 14. Let g be y(-10). Is 27 a factor of v(g)? False Let d = -40 + 172. Suppose -2r + 4o = 94, -3r - 4o + o - d = 0. Let h = 15 - r. Does 10 divide h? True Let u be (4/(-6))/(15/((-2025)/30)). Suppose -uf - f = -3200. Is 5 a factor of f? True Let f = 73 - 61. Is -1 - f/(-2) - -355 a multiple of 30? True Let d be (-2)/4 - (-3 + (-2964)/8). Suppose 14w - d = 131. Does 12 divide w? True Does 69 divide (-1382670)/(-378) + (-30)/35? True Let x(l) = 21l + 48. Let u be x(-2). Is 88 a factor of 1074 + 90/u + -7? False Let u = 358 - 104. Let b = 282 - u. Is 18 a factor of b? False Does 7 divide (2/(-4))/(40/(-30)) - (-2114383)/472? True Let d(s) = -4s - 21. Let g be d(-6). Suppose -m - gp = -436, -5m + p + 872 = -3m. Does 8 divide m? False Let i = 1520 + -1011. Let f be 7 + -9 + 1/(3/1998). Suppose 0 = -5p + 3z + f, 4p = 2z - 7z + i. Is 32 a factor of p? False Suppose 3b = 5b + 12. Let i be (2 - (-44)/b)/(12/108). Is (i/(-5))/(19/190) a multiple of 12? True Suppose 7o - 409 = 893. Let k = o + -163. Is 11 a factor of k? False Let k(q) = -5q3 - q2 + 36q - 11. Is 19 a factor of k(-6)? True Let i(y) = 157y + 9. Let l be i(5). Suppose 9h - l = 1942. Is 18 a factor of h? False Let h = 439 - 441. Let s(z) = -99z + 49. Is 13 a factor of s(h)? True Suppose 4t + 6 - 2 = 0, -t = -i + 3. Does 29 divide (i - (-2 - 2)) + 23? True Let u(i) = 3i2 + 16i + 18. Let z be u(9). Let r = 863 - z. Is r a multiple of 20? False Is (-1)/(5 - (-216)/(-42)) - -975 a multiple of 10? False Let h = -3496 + 8835. Is 92 a factor of h? False Is 159 a factor of (1021/(-2))/(13/(-1183))? False Suppose 30 = -5q - 5a, -q + 4q - a + 6 = 0. Let l(r) = 24r2 + 11r + 39. Does 7 divide l(q)? False Suppose -66x + 6x - 62x + 1001742 = 0. Is x a multiple of 51? True Let p = 536 - 536. Suppose -2s + 3y + 1764 + 1005 = p, -y = -s + 1387. Is 12 a factor of s? True Suppose 5o + 4*	{ "pile_set_name": "DM Mathematics" }
+ -306. What is the closest to 0.1 in 5, w, 0.2? 0.2 Let x = 0.568 + 0.242. Let r = x + -1.11. What is the closest to -2 in 13, r, -4? r Let s = 86 + -85.652. Let n = -0.1172 + 0.0692. Let g = n + s. What is the nearest to 1 in -2, -0.3, g? g Let m = -11.7 - -14.7. Let g = 24.9 - 24.6. Let j be (-6)/9 + (1 - 0). Which is the closest to -2/3? (a) j (b) g (c) m b Let t = 964 + -963.8. Let v = -5 - -7. Let y = -1.5 - -1.4. Which is the nearest to v? (a) -2/7 (b) t (c) y b Let s = -16490 - -16461. Which is the closest to -0.1? (a) -4 (b) s (c) -6 (d) 1/5 d Let i(o) = -2o2 - 7o - 14. Let j be i(-5). Let y = j - -29. Let h = 603/11 + -55. What is the nearest to y in -0.1, -3, h? -0.1 Let t(u) = -u*3 - 22u*2 + 76u + 27. Let k be t(-25). Let q be k/(-7)11/(-11). Which is the closest to 0.1? (a) q (b) -5 (c) 0 (d) -2/7 c Let o = -0.0517 + 0.0917. Which is the nearest to -1? (a) 0.2 (b) o (c) -4/7 (d) -8 c Let i be (-30)/675(10 + (-232)/16). Let k = -24/5 - -91/20. What is the closest to k in i, -3, 0? 0 Let w = -0.2 + 0.1. Let k = -348 - -375.8. Let j = k - 28.8. What is the nearest to w in 2/13, -5, j? 2/13 Let l = -63811 + 63811. Suppose -2 = k - 1. Which is the closest to -1? (a) k (b) l (c) 0.01 a Let p = -0.2 + -32.6. Let m = 32.4 + p. What is the nearest to 2 in 18, m, 3/5, -2? 3/5 Suppose 4f + 1 = -5o, -6f + 3f = 4o. Suppose 0 = -m + 5w, m - 9 = -7w + ow. Suppose 0 = -1338u + 1334u - 20. What is the nearest to 2/3 in 0.5, u, m? 0.5 Let r = -1.6261 - 59.8739. What is the nearest to r in 0, -0.2, 0.1? -0.2 Let x = -38 + 56. Let w = 15 - x. Let m = -12.2 - -12. Which is the nearest to 0.1? (a) w (b) 0.08 (c) m b Let f = -5 - -2. Let l = -154.725 - 0.275. Let t = l + 158. What is the nearest to 1 in 1, t, f? 1 Let w(y) = y*2 + 42y + 80. Let j be w(-31). Let z = j + 256. Which is the nearest to -6? (a) -2 (b) 0.4 (c) z c Let l = 3080.6 + -3081. Which is the nearest to -2/5? (a) 5 (b) l (c) -2/37 (d) 2/13 b Let z = -2001 + 773. Let d = 1239 + z. Let l = -3.5 + -0.5. What is the closest to -1/2 in d, 2/5, l? 2/5 Let m = 18 - 13. Let a = 2.39311 + -2.56311. What is the nearest to a in 3, m, -9? 3 Let m = -2156 - -2159. What is the closest to m in -0.2, -0.07, -1? -0.07 Let h = -1.7475 + 2.7475. Which is the closest to h? (a) -2/5 (b) -5 (c) 5 (d) -1/4 d Let j = 291.2 - 302.2. What is the closest to 1 in j, 2, 6? 2 Let x = 249649 + -249652. Let w = -0.76 + 0.7. Which is the nearest to 2/7? (a) w (b) -1 (c) x a Let h = -0.041 + 34.641. Let k = h + -34.3. Let l = -2/885 - -2683/12390. Which is the nearest to 2/3? (a) 4 (b) k (c) l b Let l = -66.9 + 66.8. Let w = -16/5 + 53/15. What is the closest to l in -3, -2, w? w Let i = 0.2 - -16.8. Let g = -2.263798 - -0.263798. Which is the nearest to i? (a) -0.2 (b) -1/2 (c) g (d) 2/11 d Let y(d) be the third derivative of -d*4/4 - 15d*3/2 - 129d*2. Let h be y(-8). Let n = -8/13 - -50/39. Which is the nearest to h? (a) n (b) -3 (c) 5 c Let p = 22.35 + -22.95. Let k = -3.84 + -0.16. What is the closest to -0.1 in p, 2/11, k? 2/11 Let m = 69200.7 + -69201. Let f = 3/4 - 5/4. What is the closest to f in 0.19, -5, m? m Let f be 8/2 + (6 + -4)-2. Let i = -15/454 + -503/12258. Which is the closest to i? (a) f (b) 4 (c) 3 (d) 1 a Let g = -283 - 269. Let i = 552.4 + g. What is the closest to i in -0.5, 5, 7/4? -0.5 Let i = -0.25 + 4.25. Let j = 26 - i. Let s = j - 21.9. What is the closest to s in 0.3, 2/7, -2? 2/7 Let n = -65.8 - -67.8. Suppose z = -4z - 50. Let r = 21/2 + z. What is the nearest to 0 in r, 6, n? r Let g = 25570 - 281888/11. Let v = 56 + g. Which is the closest to v? (a) 3/2 (b) -1/4 (c) 4 b Let u = 17 - 12. Let l = 2500 - 2501.986. Let z = 0.986 + l. Which is the closest to -2? (a) u (b) z (c) 4 b Let m = 41.57 + -41.77. Which is the closest to 0.1? (a) -2/9 (b) -5 (c) 1/3 (d) m c Let t(y) = -2y*2 - 4y + 2. Let p be t(3). Let u be (-4)/(-14) + 22/p. Let z = -16.65 - -12.65. Which is the closest to u? (a) 2/9 (b) z (c) -0.5 c Let j be (-2 + (-84)/(-49))-1. Which is the nearest to 1? (a) j (b) -24 (c) -10 a Let n = 195 - 195.36. Let x = n - -0.66. What is the closest to x in -0.2, -0.4, 0.4? 0.4 Let z = 1053 + -1052.5. Which is the nearest to 2/3? (a) z (b) 4 (c) 496 a Let p = 434 - 392. Let q be p/(-70)10/4. What is the closest to q in -2, 5, 1? -2 Let q = 5515.13 - 5590. Let j = 75 + q. Let x = j - -0.87. Which is the closest to 1/3? (a) -1 (b) x (c) -15 b Let k = 26.89 + -27. Let y = k + -0.31. Let i = y - -0.32. Which is the nearest to i? (a) -5 (b) 17 (c) -1 c Let g = -0.05 + -1.75. Suppose 0 = s - 2d + 15, -4s - 137d = -136d - 12. What is the nearest to s in -3, g, 1, -1/3? 1 Let j = -2 - -1. Let n = -19995 - -19994.8. What is the nearest to 2 in -5, n, j? n Let m = 0.4 + -0.2. Let c = -639 - -673.3. Let j = -34.6 + c. What is the closest to 9/2 in m, -2/5, j? m Suppose -15 = -5g, -g - 26 = 5x - 3g. Let r = -1982/5 + 1984/5. Which is the nearest to 3/2? (a) r (b) x (c) -1/6 (d) 0.3 a Let h = -573 - -572.5. Let g = 351 + -320. Which is the closest to -0.3? (a) 0.1 (b) h (c) g b Let k be (10 - (-816)/(-80))(0 + 3). What is the nearest to -2 in -5, k, -2? -2 Let y = 0.9 - -0.1. Let d = 193 - 191.85. Let v = d - 1.45. What is the closest to y in v, 1/4, -2/13? 1/4 Let i = 221.426 + -0.426. Let y = i - 222. What is the closest to 2/3 in y, 1/5, 6? 1/5 Let k = 334 - 1001/3. Let f = -140.9 - -141. Which is the closest to k? (a) 0 (b) f (c) 5 (d) 2/7 d Let c = 215/1122 + -1/102. Let i = 22 - 21.82. Let j = 15 + -12. What is the closest to -1/4 in c, j, i? i Let l = -16937/753986 + -93/20378. Let u = 7 - 25/4. Which is the closest to 0.1? (a) u (b) 4 (c) l c Let p = -0.8 + -0.2. Let o = 8.9576 - -0.0424. What is the closest to p in -1, -2, o? -1 Let g = -0.07 + -0.03. Let a = -0.7 - 2.72. Let p = a - -2.42. What is the nearest to p in -6, g, 0.4? g Suppose 109p - 113p + 40 = 0. Suppose -13 = pv - 3. Let i be (-6)/(-15)(-6)/(-4). Which is the nearest to -1? (a) i (b) 2 (c) v c Let k = 8 - 12. Let c = 17.356 - 0.356. Let d = 20 - c. What is the closest to 0.1 in d, -0.04, k? -0.04 Let t = -1.49 + 13.29. Let l = 16 - t. Let f = 4.7 - l. What is the nearest to 0 in 1, f, 5? f Let l = -500 - -313. Let n = 184 + l. Which is the nearest to 6/7? (a) 1 (b) 0 (c) n a Let r be (-22)/(-18) + 4/(-18). Let s = -189571 - -189598. What is the closest to s in 0, r, 2? 2 Let w be (0 - -1)/((-156)/51 + 3). Let b = 0.0392 + -0.0392. What is the nearest to b in 0.5, w, -1/5? -1/5 Suppose -2x - 30 = -36. Suppose 3k = 4y + 122 + 37, -123 = 3y - xk. Let h = y - -37. What is the closest to 0.1 in 0.4, 0.5, h? 0.4 Let u be 34/36 - 1210/(-15). Let c be ((-27)/u)/(8/6). What is the nearest to -2 in -5, -3/8, c? -3/8 Let n = 0.8 + -0.44. Let u = n + -1.36. What is the closest to 2 in u, 1/7, -4/9? 1/7 Let h(j) = -j*2 - 7113j - 21332. Let r be h(-3). Let k = -0.5 - 2.5. Which is the nearest to -0.1? (a) k (b) r (c) 3 (d) 4 b Let r = -6 + 10. Suppose -16 = 94y - 78y. Let a be y/2 - (-27)/162. What is the nearest to a in -0.07, r, -2? -0.07 Let x = -196 + 195.9. Let f be (-5 + 2)/(-3) - (-22)/(-20). Which is the closest to x? (a) f (b) 5 (c) -4 (d) -27/4 a Let n = 94 - 58.3. Let c = n + -35. Let p = c - 3.7. What is the nearest to p in -0.4, -4, 0.3? -4 Let t = 5692.9 + -5693. What is the closest to -2.51 in t, -1/3, -0.2? -1/3 Let r = 0.1 - -0.1. Let l = 70045 + -70045.06. Which is the closest to -1? (a) 4 (b) r (c) l c Suppose -3q + 8l = 11l + 483, q + 179 = -4l. Which is the closest to 0? (a) 0 (b) q (c) -7 a Let z = 0.02 - -0.98. Let p = 0.94197 + -0.44197. What is the closest to -1/3 in z, -0.2, p, 0.4? -0.2 Let y = 5 - 9. Let r = 367 + -5129/14. Let l = -87/70 + r. What is the closest to 8 in y, l, 0? 0 Let m = -0.3 + 0.2. Let p = 0.5 + m. Let w = -28973 - -28970. Which is the nearest to -0.13? (a) -2 (b) w (c) p c Let u = -83.4 + -1.6. Let l = -93.5 - u. Let v = l - -10.5. Which is the nearest to 2/19? (a) 5 (b) -5 (c) v c Let f = -0.2 + 0.5. Let j = -5.7627 - 0.2373. Which is the closest to f? (a) j (b) -3/2 (c) 1 c Let q = -2 - 1. Let m be q/(-20) + 2	{ "pile_set_name": "DM Mathematics" }
*2 - sqrt(242)))6 + 0. 99sqrt(2) + 4616 Simplify (-4 + (3 + 2sqrt(1584) + 3 + (2sqrt(1584) - sqrt(1584)))1-1)2. 720sqrt(11) + 14356 Simplify 4 + (((5sqrt(190)-1 + sqrt(190) + -4(-1sqrt(190) + sqrt(190)))4)/(((sqrt(30)-4)/sqrt(3) - sqrt(10)) + sqrt(30)/(sqrt(3)4)))2. 4172/19 Simplify 6(sqrt(2156) + 4 + 3 + sqrt(2156) + (sqrt(440) - (sqrt(440) - ((sqrt(440)-3 - sqrt(440) - sqrt(440))2 - sqrt(440))))/sqrt(10)). 42 + 36sqrt(11) Simplify (sqrt(119)/(-5sqrt(567)) + -5)*2 + sqrt(17) + 4 + 1 + 3(sqrt(17) + -5)*2. -259sqrt(17)/9 + 315917/2025 Simplify ((sqrt(270)-1)/(sqrt(60)/(sqrt(18)/sqrt(3))))2 + sqrt(48)2 + (sqrt(30)/sqrt(10))*22. 8sqrt(3) + 33 Simplify (sqrt(1728) - sqrt(1728)-1 - (2sqrt(60)/sqrt(5) + sqrt(12) + sqrt(12)))/(sqrt(216)-1-4 - (sqrt(216) + (sqrt(216) - 1sqrt(216)) - sqrt(216))5). 5sqrt(2)/6 Simplify ((sqrt(2432) + -1sqrt(2432))/(-2(sqrt(2) + sqrt(6)/sqrt(3))))*2 - -5(-6(5 + (sqrt(19) + 0 - sqrt(19))))2. 4500 Simplify (((sqrt(273) - (sqrt(273) - -5sqrt(273)1))/(sqrt(63)3 + sqrt(7)))/((sqrt(180)/sqrt(6))/sqrt(10) + sqrt(432)))*2. 1/52 Simplify -2(-2 + (sqrt(1331) - (-2 + sqrt(1331))) + (-1sqrt(66) + sqrt(66))/sqrt(6) + -4) + -5. 3 Simplify (-1sqrt(187)-4 - (sqrt(187) - (1sqrt(187)-2 + sqrt(187))))/(sqrt(396)-3 + sqrt(396) - sqrt(396) - (sqrt(88)3)/sqrt(8))-4. 8sqrt(17)/21 Simplify (-5 + -2sqrt(22)/sqrt(2) + sqrt(121)/(sqrt(11) + sqrt(33)/sqrt(3)))*2 + 3 + (sqrt(88)/(sqrt(288) - -2sqrt(288)))*2 + -1. 15sqrt(11) + 8389/162 Simplify (-4 + -3 + 2 + -4sqrt(448) + sqrt(448) + 3 + 1)2 + 5. 48sqrt(7) + 4038 Simplify (1sqrt(304)3)*2 + ((sqrt(114)/(1sqrt(6)))*2 - ((1sqrt(76))/sqrt(4))*2) + sqrt(475)-2 + -5 + sqrt(475) + sqrt(475) + 3 + -3. 2731 Simplify (sqrt(486) - (sqrt(486)1 + sqrt(486)) - (sqrt(384) + sqrt(384)-3 + sqrt(384) + sqrt(384) + sqrt(384)))/(2sqrt(320)/(-2sqrt(10))). 17sqrt(3)/4 Simplify (sqrt(4400) - (sqrt(4400) - (1sqrt(4400)-3 - sqrt(4400))) - -51sqrt(4400))/(-2sqrt(256)14). -5sqrt(11)/32 Simplify 5(-4sqrt(325)-3)*2 + -42sqrt(117)1. -24sqrt(13) + 234000 Simplify (-46-3(sqrt(275) + (sqrt(275) - -4sqrt(275)-6) + -1)-1)2 + 1. 1140480sqrt(11) + 689995585 Simplify ((43sqrt(112)4 - (sqrt(28) + -4 - 5sqrt(42)/sqrt(6))) + -3)*2. 390sqrt(7) + 266176 Simplify ((((-1 + sqrt(1700))5 - sqrt(1700))-2 + -5)*2-6 + 2)-1. -4800sqrt(17) + 652948 Simplify ((((sqrt(102)/sqrt(2))/sqrt(3) - (sqrt(2448)1 + sqrt(17))) + 1sqrt(68) + 1 + 4)-5-1)*2. -2500sqrt(17) + 43125 Simplify (4(sqrt(171) - (0 + sqrt(171))3))*2 + -4 - -6(sqrt(171) + 2(sqrt(171)1 + sqrt(171))*2 + sqrt(171) + 4). 36sqrt(19) + 19172 Simplify -1((sqrt(68)/(3sqrt(256) - sqrt(4)) - ((1 + sqrt(153))*2 + sqrt(153) + -1)) + -1). 206sqrt(17)/23 + 154 Simplify (-3sqrt(187)-5 + sqrt(187)1-4)/(((sqrt(121)-2 + sqrt(121))/sqrt(11) - sqrt(275)3)5). -11sqrt(17)/80 Simplify -1 + (sqrt(32)/sqrt(64) - (sqrt(128) - (sqrt(128) - (sqrt(128)-1 + sqrt(128)))))/(2(sqrt(4) + sqrt(144)-3)). -1 - sqrt(2)/136 Simplify (0 + 3sqrt(2057) + -5)-4 + 0 + (-5 + (0 + sqrt(2057))4)*2. -572sqrt(17) + 32957 Simplify ((sqrt(76)15 + sqrt(76) + (sqrt(76) - 1sqrt(76)2 - sqrt(76)) + sqrt(76))1)/(sqrt(8)/(sqrt(2) - sqrt(2)2) - sqrt(48)/(sqrt(12) + sqrt(300))). -30sqrt(19)/7 Simplify -1(sqrt(190)/(sqrt(10) + (2sqrt(90))/sqrt(9)) + sqrt(171)2 + 5)35. -95sqrt(19) - 75 Simplify (2sqrt(200))*2 + 4 - -1sqrt(200)-2 - (sqrt(16)/sqrt(2) + 1 - (sqrt(800) + sqrt(800) + sqrt(800) + -3 + sqrt(800)))2. -11380 + 604sqrt(2) Simplify ((1sqrt(168) - sqrt(168))/sqrt(12))/(sqrt(600)/sqrt(12)) + (sqrt(1008) + ((sqrt(1008) - (-3 + sqrt(1008)))2 - sqrt(1008)) - sqrt(63)5). -15sqrt(7) + 9 Simplify (3(((62sqrt(85) - sqrt(85)) + sqrt(85))/(sqrt(55)/(sqrt(11)-1)))23 + -3)4 + -1. 88115 Simplify ((4((sqrt(425) - (-1 + 1 + sqrt(425)) - 6(sqrt(425) + 1)) + -5))2 + -3)4. 42240sqrt(17) + 986932 Simplify (-5(3 + 0 + (1 + 2sqrt(1573) - sqrt(1573)) + 2sqrt(1573) + 0 + -1))*2. 4950sqrt(13) + 354150 Simplify (4(-6(sqrt(95) - -1sqrt(95)) + sqrt(95))-3)/(6(2sqrt(405) - sqrt(405)) + sqrt(405) + 5(sqrt(405) + sqrt(405)-1)). 44sqrt(19)/21 Simplify ((-5 + (sqrt(768) + -2 - sqrt(768)))-6)*2 - 1(sqrt(18)/(sqrt(6)-3) + sqrt(3) - 3sqrt(300)). 88sqrt(3)/3 + 1764 Simplify (2(sqrt(187) + (5sqrt(187)-1 - sqrt(187)) + sqrt(187))-1)/((sqrt(66)/sqrt(12))/(sqrt(32)1)). 64sqrt(17) Simplify 2 + ((-1(sqrt(119) + (sqrt(119) + (sqrt(119) - sqrt(119)1) - sqrt(119)))2-6)/((sqrt(504) + (-4sqrt(504)2 - sqrt(504)))/sqrt(8)))2. 25/4 Simplify 3 + (3 + (5 + (sqrt(448) - 5sqrt(448)-1) + 0)2)5. 2400sqrt(7) + 80783 Simplify 4(0 + sqrt(2299)) + sqrt(2299) + 1 + 2 - ((sqrt(19) - (sqrt(684) + (sqrt(684) + sqrt(684) + 0 - sqrt(684))*2)) + (-1sqrt(1900))*2). -1213 + 60sqrt(19) Simplify (-2(sqrt(3645) + (sqrt(3645) - (-3 + sqrt(3645) + sqrt(3645) + -1)) + 3sqrt(3645)-2)6-4)2. -2985984sqrt(5) + 302367744 Simplify (-44(sqrt(228) + -1sqrt(228) + sqrt(228)))/(-5(sqrt(108) - sqrt(12))4). 2sqrt(19)/5 Simplify (-6(-2 + sqrt(13)-1 + sqrt(1872) + -1))*2 + sqrt(6292) + sqrt(52) + -4sqrt(117). -2364sqrt(13) + 56952 Simplify (6-2-2sqrt(133)4)/(sqrt(448) - (sqrt(448) + sqrt(448)1)-6 - -62sqrt(448)). 12sqrt(19)/25 Simplify 1((sqrt(192)-21 - (sqrt(192) + 3 + sqrt(192) + 2))2 + 3)3. 960sqrt(3) + 9300 Simplify 2(5 + sqrt(304)-2) + 2(5(sqrt(171) - -3sqrt(171)))*2. -16sqrt(19) + 136810 Simplify (2 + (2sqrt(320) + 3)-4)*2 + (sqrt(245) + -3sqrt(245)-3 - (sqrt(245) - (sqrt(245) + -2))2-2). 1350sqrt(5) + 20588 Simplify (0 + (3 + (sqrt(2) - (-1 + sqrt(2))) - sqrt(10)/(sqrt(25)/sqrt(5))) + 1 + sqrt(8)/sqrt(4)4 + 4)*2. 54sqrt(2) + 99 Simplify (3(sqrt(84) - sqrt(84)2))/(sqrt(12) - (sqrt(1452)2 + sqrt(1452))) + 2 + (sqrt(49) + 1sqrt(49)-5)/(sqrt(7) - (sqrt(49) + sqrt(784))/sqrt(7)). 2 + 35sqrt(7)/32 Simplify (-1 + -6(5 + (0 + sqrt(1539) + 2 - -1-1sqrt(1539)) + -5))2. 169 Simplify (-54sqrt(448) + -2 + sqrt(448)-3 - (-5 + -2 + sqrt(448) - (sqrt(448) + sqrt(448)3)6))2 + -3. 22 Simplify (-1 + ((sqrt(1728) - (3 + sqrt(1728)))2 - sqrt(1728)) + 4 - ((-4 + 4sqrt(1728))-1)*2)6. -165912 + 4464sqrt(3) Simplify (((2 + sqrt(13))-4)*2 + sqrt(416)/sqrt(2) - 53sqrt(208))-1. -272 - 8sqrt(13) Simplify 6(-6(3 + -4(-1 + sqrt(252))1-43))2. -5598720sqrt(7) + 125848728 Simplify (-4 + sqrt(275)-1 - -2sqrt(275)1)2 - (-1 + sqrt(275) + -2 + (-2sqrt(275) + 4)*2). -822 + 35sqrt(11) Simplify 0 + 3(-4 + (-5 + 52sqrt(11) - (sqrt(99) - (1 + (sqrt(99) - (sqrt(99) + 0)))))). -24 + 21sqrt(11) Simplify 4 + ((-4sqrt(1701))/sqrt(3))2 + ((sqrt(3087) + sqrt(3087)3)/sqrt(9))*2. 14564 Simplify 1 + ((-2sqrt(76)/sqrt(2) + (sqrt(1862) + -2sqrt(1862) - sqrt(1862)))/(sqrt(14)/sqrt(252) - (sqrt(864)/sqrt(12) + sqrt(2))))2. 176785/1681 Simplify -1((5(1 + sqrt(147)))2 + sqrt(147) - (2(sqrt(147) + -3))*2)4. -12304 - 2100sqrt(3) Simplify ((6-2sqrt(147)2 + (sqrt(147) - (-2sqrt(147) + -4) - -3sqrt(147)1))2 + -5)6. -6048sqrt(3) + 285834 Simplify (3(sqrt(320) + -3) + 5)*2 - 1(sqrt(80)/sqrt(4) + 2)*2. -200sqrt(5) + 2872 Simplify sqrt(65)/(sqrt(45)-1)-1 - (sqrt(13) + ((sqrt(13) - sqrt(13)-1)2 - sqrt(13)) + 4 + sqrt(156)/(sqrt(96)/sqrt(8))). -56 - 2sqrt(13)/3 Simplify (sqrt(336)/(sqrt(35)/sqrt(5))-2)/(-5(sqrt(96) - 2sqrt(96)2)). -sqrt(2)/15 Simplify (-4-31(1 + sqrt(320))-145)*2. 921600sqrt(5) + 18489600 Simplify ((2sqrt(252))/sqrt(12) + sqrt(21))/(sqrt(363)2) + ((2sqrt(175) + 1)-3 + -5)*2. 10563sqrt(7)/22 + 6364 Simplify (5((sqrt(1872) - (sqrt(1872) + (-1 + sqrt(1872) + sqrt(1872))2)) + 2 + -6(4sqrt(1872) + -5)))*2. -571200sqrt(13) + 36720100 Simplify (0 + ((sqrt(8)/sqrt(2) - sqrt(4))-3)/(sqrt(8)-3) + (sqrt(12)/sqrt(3)-5 + sqrt(4))/(sqrt(242)3))*2. 32/1089 Simplify ((5sqrt(171)2 + sqrt(171) + -2sqrt(171)6)/(sqrt(81)/(-2sqrt(9))6))2 + 1. 28/9 Simplify -2 + -4 + sqrt(468) + (sqrt(1053) - -2sqrt(1053))2 - ((sqrt(13) + (sqrt(1300) + 0)2 - sqrt(13))6 + (-52sqrt(78))/sqrt(6)). 16sqrt(13) + 1671 Simplify 4*(sqrt(2448) + 1 + sqrt(68)/(sqrt(20)/sqrt(5))) - (sqrt(272) + (sqrt(27	{ "pile_set_name": "DM Mathematics" }
((cc*(5/4)c)/(cc(-12)/c))(-11) assuming c is positive. c(-7577/28) Simplify (v/v0)(-1/6)/(v(-1/4))(34/5)v(v/((v(1/5)vvv)/v))/vv(v/(v/(v*(2/13)/v)))/vv*(-8)/((vv*6v)/vvvv) assuming v is positive. v(-722/39) Simplify ((zzz(-2/7))(-28))(-5/2)(z0)39(z/(z/((z/(zz*(-3/2)zzz)zzz)/z))z)/zz/(zz*(-1/2)z) assuming z is positive. z120 Simplify ((v(-1/4)/(vv(2/13)))/(v(-6)/vv(1/7)))/((v/(v/(v/(v3/v))))/vv(3/7))(-1/36) assuming v is positive. v(8861/1638) Simplify ((c(c*(-6/5)c)/cc)/cc((c22c)/c)/cc26c(-26))(-1/15) assuming c is positive. c(-109/75) Simplify (h9/(h*(-2/3)h)h(-1)/(h/(h/(hh*(-7/3)hhh))))(-37) assuming h is positive. h(-222) Simplify ((k/((k*(-1/3)kk)/k)k)/(k/(kk/k(-3)kk)))(-30)(k/(k*0k))(-16/7)/((k/k3)/k3) assuming k is positive. k(-215) Simplify ((((t/(tt/(t(t/(t*(10/17)/t))/t)t))/tt/(tt*(1/45)t)tttt)(-3/10))(-42/11))(1/22) assuming t is positive. t(7441/102850) Simplify (qq/q45)/q40q/(q((q(-31)/q)/q)/q)q(-2/83) assuming q is positive. q(-4069/83) Simplify (ii/i(-2/3)(ii(-2)i)/ii)/(i(-5)i*(-2/5))((i*(-2)i)(-30))20 assuming i is positive. i(9121/15) Simplify ((v/v(7/5))/(v/v*(5/3)v))*45/((vv1/v)41(v(v/(v*(2/21)v))/v)/((vvv/(v/(v(4/5)/v)))/v)) assuming v is positive. v(-7676/105) Simplify ((k*(-21)kk17)/(k/(kk(-1/8)/k))21)42 assuming k is positive. k(-4473/4) Simplify ((i2/i)/i(-1/31)(ii(-2/39))/i(-13))(-1/3) assuming i is positive. i(-18112/3627) Simplify (jjj*3j/((j*(-2)j)/j)jj)*42(j*(-6)/(jjj/(j(jj(-2))/jj)))49 assuming j is positive. j(-21) Simplify ((x0/x)(2/9)/((x*(-1/12)xx)/x(-3)))/(x/x(-3/8)x/x*(-1)x*(-7)/(xx/x(2/9))) assuming x is positive. x(19/72) Simplify (((m*(-1)mm)(42/13)(mm1/m)7)39)(-3/16) assuming m is positive. m(-1197/16) Simplify ((y35/(y(y/(y*16/y))/y))/((yy/y(1/11))/((y7y)/y)))11 assuming y is positive. y595 Simplify dd*(-4)ddd*(-1/4)(dd(-1/4))/d(-1)(d(-1)/d(-2/11))/((d/(dd(-2)/d))/(d4/d)) assuming d is positive. d(-7/22) Simplify (y/y(-2))/yyy(-1/5)(y/y*0y)/y*(-2/7)(y*5/yy/y*(-4)y)/(y/(y*0/y)yy)(-49) assuming y is positive. y(7388/35) Simplify ((d(-1))(-5/2))(-15)/(((dd(4/7)/d)/(d0/dd))/((d(-2/11)/d)/d(5/6))) assuming d is positive. d(-9260/231) Simplify (l(2/17)/l2)/(l(-1/2)/l)8(l*(-3)/(ll(-1/13)))/(l(-1/5)l8) assuming l is positive. l(-1774/1105) Simplify (y3y(-2/15))(1/9)(y/y(-2))34/(y5/yyyy(-1/15)) assuming y is positive. y(13012/135) Simplify ((((z/z*(1/7))/zz)/zz)/z(-2/5)z1/z(-6))/(z(-4)/z(-5)z/z(6/7)z(-5)) assuming z is positive. z(424/35) Simplify (l*(4/7)l*(1/4)(l/(l/(ll/l3l)ll))/l(-2/9))/((l(4/5)l(1/10))/(l(2/9)l*(-1)ll)) assuming l is positive. l(-799/1260) Simplify ((z(-1/68))(-2/93)(zz13)(-31))(2/39) assuming z is positive. z(-1372307/61659) Simplify ((fff17f)*(-11/4)/((f(ff(1/22)ff)/f)/(f24/f)))(-12/13) assuming f is positive. f(4626/143) Simplify ((s/s1)/(s(-1/3)ss))(21/5)s/(s/(s/s*4))((ss/(ss*(2/7)))/s)/s(s(-2/5))(-31) assuming s is positive. s(39/35) Simplify (((h(-5)/h)/h)(-6)/(h(-1/9)/(h/h*(-2/15)h)))(-32) assuming h is positive. h(-63712/45) Simplify ((r(r/(r/((r/r(-1))/r))r)/r)25)(-28)/(((rr/((r(-1/4)r)/r)rr)/r7)/(r2/r(-3))) assuming r is positive. r(-5569/4) Simplify ((s*(-2/69)s/s(-1/27))/((s/((s/s(2/51))/s))/(s/(s(-1/8)/s))))(1/38) assuming s is positive. s*(176837/3209328) Simplify ((ll*29l)/l)/((l/((ll(-27)l)/l))/l)(l(-4/3)ll)/l(-34) assuming l is positive. l(116/3) Simplify (c/(c(-8)c)c(4/9)c*8/cc*(-4))/((cc/(cc0))/c(3/11)cc5/ccc5) assuming c is positive. c(-28/99) Simplify ((x(6/7)/(((x/x18x)/x)/x))/(x/(x*7/x)x3))(-11/2) assuming x is positive. x(-803/7) Simplify ((o/o(1/15))/o(-7))(16/9)/(o/(o/(o/(o*(-3)/o)))o*4/oo/(oo2)oo(-4)) assuming o is positive. o(1499/135) Simplify (r5/(r/(r/(r/(r/r(-2/15)))))(r*(-2/5)r)(-7))/(r(-1/3)r(-2/5)((rr(1/2)r)/rr)(-36)) assuming r is positive. r(275/3) Simplify (oo*14o/o*5oo)(17/5)((o*2ooo)/o(2/23))/((o/(o(-2/21)/o))/(ooo*(-2)o)) assuming o is positive. o(115963/2415) Simplify ((m(1/17)/m(2/21))/(m(1/17)/(m/(m(2/33)/m))))41 assuming m is positive. m(5822/77) Simplify (m11/(m*2/mm))*(2/47)mm1m*(-1/4)((mm(-2/7)m)/m)(-2/131) assuming m is positive. m(365837/172396) Simplify s/s*(-5)sss*(-1)/sssss/s(-1/10)ss(-4)/s(s/s*(1/2)(s(ssss*(-10)s)/ss)/s)(-10/11) assuming s is positive. s(111/10) Simplify ((q(3/5)qq(q/((q(q/(q/(qq*(-9))))/q)/qq))/q)/(q(-1/7)/q(3/7)))(-44) assuming q is positive. q(-17204/35) Simplify (w/w6)/(w(-1/2)ww)(w/w(-8))/w(-2/3)((ww(1/3)w)/w)/w*2(w/(((ww5w)/w)/w))/w(-3) assuming w is positive. w(3/2) Simplify ((((o(-2/13))19)19)34)40 assuming o is positive. o(-981920/13) Simplify ((d/d*8)/(dd*(-2/13)d)(d(-1/2)/d)(14/11))/(d(-1/16)/(d/(ddd(-13)dd)))44 assuming d is positive. d(247101/572) Simplify ((n(2/9)/(n/(n/(nn*10))n))/(nnn*(-2)nn/((n/(n(10/7)/nn))/n)n))(-2/37) assuming n is positive. n(2042/2331) Simplify ((a(-1/4)/a)34a*(-2/13)/aa*(-1/3)/a)/(aa*(-1/6)a/(a*(3/4)/a)aa(1/13)/(aa(-1)/a)) assuming a is positive. a(-7667/156) Simplify (z*(2/7)zz(-2/7))(-35)/(((z/(z/((z(-3)zz)/z)))/(z(z/(z*(-4)zz))/zz))/(z/z*(-2/9)zz(-1/3))) assuming z is positive. z(-244/9) Simplify ((k/(k(-1)k)kk)(-44))(-5/3)(k(2/9))(-3/29)/(k(2/5)/k(2/17)) assuming k is positive. k(1624642/7395) Simplify ((ll/(llll(2/5)ll))/ll*12/ll*(6/17)l/((l/(lll*(-4)l))/l))31 assuming l is positive. l(18321/85) Simplify (aa(-2/79)aaa/(a/a*(-16))(a/(a*16a))(-1/3))(-28) assuming a is positive. a(51044/237) Simplify ((v0v)(-1/13)/(v(-26/7)vv32))(1/6) assuming v is positive. v(-1336/273) Simplify (((q(-15/8)q)/(q/q20))37)(-10) assuming q is positive. q(-26825/4) Simplify (m/m*2m*(4/9)mm)4/(m7(m(m/(mm*3)m)/mmmm)/mm)(1/24) assuming m is positive. m(49/9) Simplify ((w(1/4))(-23/5)w(-2/7)www*(-5/3)/w)/(((ww*(1/7)/w)/(ww/w*(-2)w))/(w1)(1/10)) assuming w is positive. w(1199/420) Simplify ((v31v)/v(11/5))/(v(-9/8)vv(7/3)v) assuming v is positive. v(3191/120) Simplify ((d(-15))*(5/12)dd19d(d/(d/(d/(d/d(-38)d))))/d)(-18) assuming d is positive. d(909/2) Simplify u/u*(1/8)(uu(-3/20)/u)/uuu(8/7)u(-42) assuming u is positive. u(-11237/280) Simplify ((c*(7/3)/cc)/(c/c(-2/9)))27/(c*(-3/2)cc2cc((c(c/(cc*(-2/9)))/cc)/c)/(c(-2/13)/c)) assuming c is positive. c(5879/234) Simplify (j*(-10)j/((j/(jj(3/11)))/j)j)(-9)/(j(-2/21)/j(-2/13))(-4/5) assuming j is positive. j(909794/15015) Simplify j(-2)/(j/(j(jjj(-1/2)/j)/jj))((jjj(5/4)j)/j)/j*(1/7)(j/(j*(-1)j))*(11/8)jj(-6)j(jj*(-1/4)j)/j assuming j is positive. j(-15/56) Simplify ((r(-3/22)/(r/(rrr(-21)/r)))/(r(-11)rr(1/24)))44 assuming r is positive. r(-2951/6) Simplify ((h11h)/hh)(-2/7)/(((h(5/9)/h)/hhh)/h(3/34)) assuming h is positive. h(-8345/2142) Simplify ((l(-1))(-9/7))11/((((l/((l(2/5)/l)/l))/l)/l)*(-11/2)(l(-1/3))(-18)) assuming l is positive. l*(801/70) Simplify ((cc*(-1)c)(-25))(1/27)/(c*10(c/c4)/c)(-13/3) assuming c is positive. c*(677/27) Simplify ((ll(-6))/l(-5)((l(l/(l/(ll6l)))/ll)/ll)/l2)/((l(-1/4))(-5/8))(2/5) assuming l is positive. l*(111/16) Simplify ((dd*(3/4)/d)/(ddd(3/8)))28(dd(-5)d(-2))/(d4dd4/d) assuming d is positive. d(-119/2) Simplify ((zz/(z(1/18)/z))10/((z/(z/z10))/z)(5/21))1 assuming z is positive. z*(1720/63) Simplif	{ "pile_set_name": "DM Mathematics" }
at is the derivative of n(o) wrt o? -2007 What is the third derivative of 854p2 - 5 + 8 - 1319p*4 - 920p*2 wrt p? -31656p Let q be (2/156)/((-22)/(-715)). What is the second derivative of -qo*2 - 91o*3 + 26o + 2 + 186o3 - 98o*3 wrt o? -18o - 52 Find the second derivative of -833h + 176h - 267h + 473h3 - h2 wrt h. 2838h - 2 Suppose -11n + 10n + 6 = 0. What is the third derivative of -1 - 84s*n + 13745s - 13745s - 9s*2 wrt s? -10080s*3 Differentiate -6501 + 6866 - 382s3 + s3 wrt s. -1143s2 Let z(h) be the third derivative of -195h8/112 + h4/6 + 53h3/2 + 1556h*2. Find the second derivative of z(t) wrt t. -11700t*3 Let r(f) be the first derivative of 2f*7/7 - 14f*6/3 - 7f*3 + 51f - 3138. Find the third derivative of r(c) wrt c. 240c3 - 1680c*2 Let n = 270 + -265. Find the third derivative of 69u*5 - 30u*2 - 69u*n - 8u*6 wrt u. -960u*3 Let q(o) = -495o*3 + 5o + 1713. Let f(h) = -485h3 + 4h + 1715. Let u(r) = 5f(r) - 4q(r). What is the first derivative of u(z) wrt z? -1335z2 Let o(d) = -2d*2 - 1. Let c(b) = 300b*3 - 8b*2 - 792. Let h(s) = -5c(s) + 20o(s). Find the first derivative of h(l) wrt l. -4500l*2 Let g = 2 - 0. Let d be 8 + ((-3)/g)/(8/16). Find the third derivative of 758y - 758y + 2y*d + 17y*2 wrt y. 120y*2 Let u(h) = 16h - 63h + 32h*2 - 86h - 16. Let c(p) = -31p2 + 133p + 12. Let a(l) = -4c(l) - 3u(l). What is the second derivative of a(w) wrt w? 56 Let d(n) = -21n2 + 19n - 2275. Let t(c) = -6c2 + 9c - 1137. Let s(q) = -2d(q) + 5t(q). What is the derivative of s(l) wrt l? 24l + 7 Let f = -113 + 119. Suppose 9c - 6c = f. Find the third derivative of -59r*c + 43r*4 + 149r*2 - 64r*2 wrt r. 1032r Suppose 6g - 272 - 40 = 0. What is the first derivative of -51 - 89 + 41 - gj - 51j - 51j wrt j? -154 Find the third derivative of 485o4 + 60o*2 + 589o*4 + 1657o*4 - 912o*2 wrt o. 65544o Let c(s) be the first derivative of 0s2 - 10 - 2/3s*3 + 5/4s*4 + 31s. Find the first derivative of c(m) wrt m. 15m2 - 4m Differentiate 140 + 787 + 607l3 + 728l*3 + 1735l*3 + 110l*3 with respect to l. 9540l*2 Let l(i) = -64i*5 + 56 - 29 - 27 + 23i*2 + 3i. Let y(s) = 704s5 - 252s*2 - 32s. Let b(j) = 32l(j) + 3y(j). Find the third derivative of b(a) wrt a. 3840a2 Let i be -7 + (-39)/(-4) + 1(-2 + 0). Let q(p) be the second derivative of -5p2 + 0 - ip*4 + 19p + 0p3. What is the derivative of q(l) wrt l? -18l Let a(c) be the third derivative of 1135c4/12 - 527c*3/3 + 1320c*2. Find the first derivative of a(m) wrt m. 2270 Find the third derivative of 1087x4 + x4 + 1524x - 444x - 3x2 + x2 wrt x. 26112x What is the second derivative of 4z2 + 62045z*3 - 62251z*3 - 2z*2 + 2285z wrt z? -1236z + 4 Let d(l) = 1790l*2 - 3740l + 18. Let u(m) = 3578m2 - 7477m + 42. Let y(x) = -7d(x) + 3u(x). What is the second derivative of y(f) wrt f? -3592 Let b(k) = 3k2 - 251k + 372. Let v(p) = 4p2 - 268p + 376. Let f(j) = 2b(j) - 3v(j). Differentiate f(d) with respect to d. -12d + 302 Let k(j) = j4 - 284j*3 + 2521j2 + 2. Let a(r) = -r4 + 285r3 - 2522r*2 - 3. Let o(v) = -2a(v) - 3k(v). Find the third derivative of o(t) wrt t. -24t + 1692 Let s(d) = 227d + 1081. Let h(r) = 456r + 2163. Let g(x) = 4h(x) - 9s(x). What is the first derivative of g(l) wrt l? -219 Let h = 232 - 228. Find the second derivative of 4l + 14l*4 - 3 + 12l*h + 11l*4 + 0l wrt l. 444l2 Let g(r) = 2111r*2 - 23r + 58. Let n(b) = 10560b2 - 112b + 290. Let c(a) = -19g(a) + 4n(a). What is the second derivative of c(i) wrt i? 4262 Suppose 143a - 144a = -2. Find the third derivative of -k*3 + 1 + 3 + ak*6 - 6k*2 + 62k*3 wrt k. 240k*3 + 366 Find the third derivative of -5895s*3 - 1284 - s + 2512 - 1209 + 6s*2 wrt s. -35370 What is the derivative of 15 + 1393i - 214i - 25 + 15 - 7i wrt i? 1172 Let g(r) be the third derivative of r5/60 + r4/12 - 5r3/6 - 4r*2. Let m be g(2). Differentiate 72 - 7q*3 - 67 - 5q*m wrt q. -36q*2 Find the first derivative of -4578i*2 + 197i*2 + 501i*2 - 3221 wrt i. -7760i Let n(r) = -22r + 184. Let k be n(7). Differentiate 10 + k + h - 3h*2 + 12 with respect to h. -6h + 1 Suppose -2c + 3v = -29, -c + v = -6 - 7. Suppose 5x - 2n = 7 + 34, 0 = 5n - c. Differentiate 9i - xi + 28 - 13i*3 + 0i with respect to i. -39i2 Let l(j) = 13456j*3 - 3706j*2 + 2j - 6. Let q(f) = f3 + f2 - f + 3. Let o(s) = -l(s) - 2q(s). What is the third derivative of o(v) wrt v? -80748 Let b = 28 - 23. Let v(r) be the first derivative of -br + 7 - r - r*5 + 7r. Find the first derivative of v(k) wrt k. -20k3 Let v(a) = -66a*5 + 670a*2 + 4a. Let n(d) = -67d5 + 669d*2 + 5d. Let b(g) = 4n(g) - 5v(g). What is the third derivative of b(s) wrt s? 3720s2 Differentiate -41081l*3 - 41083l*3 + 75l*4 + 693 + 82162l*3 with respect to l. 300l*3 - 6l*2 Let l(k) be the first derivative of 4k*5/5 - 317k*4/4 + 1704k*3 - 2205. What is the third derivative of l(r) wrt r? 96r - 1902 Let y(g) be the second derivative of -4019g5/10 - 3823g*3/6 - 476g. What is the second derivative of y(o) wrt o? -48228o Let h(d) be the second derivative of 0d*2 - d - 19/20d*5 + 0d*3 - 5/3d*4 - 9. What is the third derivative of h(a) wrt a? -114 What is the third derivative of 6364237f*2 - 207f*3 - 6364851f*2 - 119f*3 wrt f? -1956 Let n(l) = 8l*2 - 5l + 3. Let d be n(2). Suppose 6u - 5g - d = u, -22 = -5u + 4g. Differentiate 1 + 7 - 2 - 22 + 20wu with respect to w. 40w Let v(d) be the first derivative of 3d5/5 + 33d*4/4 + 13d + 62. Let j(s) be the first derivative of v(s). What is the third derivative of j(z) wrt z? 72 Let b(y) = -1264y2 - 29y - 534. Let n(l) = 632l2 + 16l + 276. Let m(q) = -6b(q) - 11n(q). What is the first derivative of m(s) wrt s? 1264s - 2 Let n(r) be the second derivative of 0r*4 + 0r*5 - 3/10r*6 - 29/3r*3 + 1/21r*7 + 0 + 0r*2 - 90r. Find the second derivative of n(k) wrt k. 40k3 - 108k*2 Let p(d) be the first derivative of -41d*6/6 + 25d*4/4 + 2d*3/3 - 1183d*2 - 4197. What is the third derivative of p(j) wrt j? -2460j*2 + 150 Let j(i) be the second derivative of -1438i*5/5 + 204i4 - i2 - 10422i. Find the third derivative of j(q) wrt q. -34512 Let j(s) = -30 + 25s - 17s + s2 - 1. Let u be j(-11). What is the derivative of 19 - 2q - uq - 16q wrt q? -20 Let c(m) be the third derivative of -5537m5/60 - 6187m*3/6 - 12007m*2. Differentiate c(r) wrt r. -11074r Let k(n) be the first derivative of -23n2 + 0n*4 + 0n + 0n5 + 0n*3 + 169 - 103/3n*6. Find the second derivative of k(r) wrt r. -4120r*3 Let q(o) be the second derivative of -5o*4/12 + 49o*3/6 + 378o*2 - 2783o. Find the first derivative of q(r) wrt r. -10r + 49 Differentiate -14d*2 + 5639d - 2842d - 2834d - 1246 wrt d. -28d - 37 Let l = -326 + 329. What is the first derivative of -3d*3 - 5d - 3 - ld - 81 + 3d wrt d? -9d2 - 5 Let m = -55 + -14. Let i be -4 + 4 + 4 - m. Find the first derivative of -24 + i - 5o*4 - 2o*4 wrt o. -28o*3 Let j(p) = -69p - 10. Let x be (-18 + 20)((-6)/4 - 1). Let m(a) = 70a + 11. Let l(v) = xj(v) - 4m(v). What is the first derivative of l(o) wrt o? 65 Let o(b) = -3b4 + 7b*3 - 4b*2 + 9b - 928. Let w(f) = -13f4 + 28f*3 - 17f*2 + 34f - 3706. Let g(c) = 17o(c) - 4w(c). Differentiate g(j) wrt j. 4j3 + 21j*2 + 17 Suppose 309m = 312m - 156. What is the derivative of -2q*2 + 30q + 56q - 127 - 112 - 116 + m wrt q? -4q + 86 Suppose 0 = -2l - 4o + 26, -19 = -4l - 3o + 8. Let t(r) be the second derivative of -1/6rl + 15r*2 + 21r + 0. Differentiate t(u) wrt u. -1 Let p(u) = 1033u - 924. Let c(t) = -2047t + 1844. Let z(y) = -3c(y) - 5p(y). Differentiate z(h) wrt h. 976 Let v(n) be the first derivative of n*3/3 + 304n*2 - 1062n - 2605. What is the derivative of v(o) wrt o? 2o + 608 Suppose -13y = 14 - 170. Let p = 6 + 9. Differentiate 12 - p + 15 + 16s4 + y wrt s. 64s**3 What is the third der	{ "pile_set_name": "DM Mathematics" }
sqrt(153)/(sqrt(45)/sqrt(5)))*2). 3 Simplify -2-5(4 + (sqrt(300) + 5)2). 1000sqrt(3) + 3290 Simplify 2((4sqrt(3))*2 + -4 + sqrt(108)-3). -36sqrt(3) + 88 Simplify 4 + (-2 + 6(sqrt(1872) - (sqrt(1872) + -2 + sqrt(1872))))*2. -1440sqrt(13) + 67496 Simplify (((sqrt(352)2 + sqrt(352))/sqrt(8))/sqrt(144) + 0)2. 11/4 Simplify ((-1sqrt(544) + sqrt(544) + sqrt(544))-1)/(-4(sqrt(162) + 2sqrt(162) - sqrt(162))). sqrt(17)/18 Simplify (-4-3-15(sqrt(704)-1 + 1))*2. -57600sqrt(11) + 2538000 Simplify (34(-1 + 4sqrt(1300) + sqrt(1300) + 2))2. 14400sqrt(13) + 4680144 Simplify (sqrt(540)/(sqrt(192) + sqrt(12) + sqrt(12)))/sqrt(9) - (sqrt(50)/(sqrt(810) + -3sqrt(810)))2. -5/324 + sqrt(5)/6 Simplify (-3sqrt(16)/sqrt(8)6)2 - 21sqrt(8)/sqrt(4). -2sqrt(2) + 648 Simplify 6-2((sqrt(144)-1)/sqrt(12))2-5. 720 Simplify -2(-3sqrt(150)/sqrt(6))/(sqrt(10)/sqrt(2)-4)-5. 15sqrt(5)/2 Simplify ((sqrt(675) - (sqrt(675) + (-5 + sqrt(675) + -2 - sqrt(675) - sqrt(675))) - -3(-1 + sqrt(675)))-5)2. 12000sqrt(3) + 270400 Simplify (-1sqrt(1008)-4 + sqrt(1008)-1 + -2 - -6(sqrt(1008) + 1(sqrt(1008) + (sqrt(1008) - (sqrt(1008) + 1)))))2. -2880sqrt(7) + 226864 Simplify (((sqrt(330)2)/sqrt(11) + (sqrt(30) - (1sqrt(30) + sqrt(30))5 - sqrt(30) - sqrt(30)))/(sqrt(24)-1 + sqrt(24) + sqrt(72)/sqrt(3)))*2. 405/4 Simplify 2(sqrt(104)/(sqrt(2)24) + 3). sqrt(13)/2 + 6 Simplify ((sqrt(72)/sqrt(3)-5)/(sqrt(120)/sqrt(90) + sqrt(12)) + -2)2 + 2. 15sqrt(2) + 273/8 Simplify 3(63sqrt(209) - sqrt(209))/(sqrt(11) - (sqrt(22)/sqrt(2)3 - sqrt(11))) + 0. -51sqrt(19) Simplify 2 + (-65sqrt(77)2)/(sqrt(396) + sqrt(396) + (sqrt(396) + (sqrt(396) - (sqrt(396) + (sqrt(396) - (sqrt(396) - -1sqrt(396))))))-2 - sqrt(396)). 2 + 10sqrt(7)/3 Simplify ((sqrt(88) + sqrt(88)-3)/sqrt(4))/sqrt(2) - ((4sqrt(792))/sqrt(2))2. -6336 - 2sqrt(11) Simplify (sqrt(3645)2 + sqrt(720)-2)/(sqrt(1089) - 5sqrt(1089)2). -10sqrt(5)/99 Simplify (5 + (2sqrt(200) - sqrt(200)) + -2(3 + sqrt(200)) + sqrt(200) + 3)2. 4 Simplify ((sqrt(125) + (sqrt(125) - (-4 + -1 + sqrt(125))) + (-3(sqrt(125) + 1) - sqrt(125)) + 4)4)2. -2880sqrt(5) + 18576 Simplify (sqrt(325) + -1sqrt(325))2 - (-3sqrt(325)-5)*2. -73125 Simplify ((sqrt(1600) + sqrt(1600)-3 + sqrt(1600))4 - sqrt(1600))/(sqrt(30)/(1sqrt(6)-3)). 120sqrt(5) Simplify -2(sqrt(22)/(sqrt(1100) + (sqrt(1100) - (2sqrt(1100) + sqrt(1100)) - sqrt(1100))))*2 + (sqrt(288) - (0 + (sqrt(288)2 + sqrt(288))*2)) + 2. -259001/100 + 12sqrt(2) Simplify 3 + (-6(sqrt(612) - (sqrt(612) + -1)))2 - ((sqrt(612)1)*2 + 1 - (sqrt(612) - (-4(sqrt(612) - (2sqrt(612) + sqrt(612))))2)). -39742 + 6sqrt(17) Simplify (2sqrt(187))/sqrt(11) + 2 + 1 + (sqrt(17) - (-2 + sqrt(425) + sqrt(425) + sqrt(17)))2 + 5. -38sqrt(17) + 1712 Simplify -1(1(sqrt(1584) + 2 + sqrt(1584)) + 1)*2. -6345 - 144sqrt(11) Simplify ((sqrt(180) + sqrt(180)5)/sqrt(6))/(-5sqrt(160) + sqrt(10)). -6sqrt(3)/19 Simplify -1 + (sqrt(42) + (sqrt(42) - (sqrt(5082) + 4sqrt(5082) - sqrt(5082))))/(sqrt(96)-3)4. -1 + 14sqrt(7) Simplify -2((sqrt(11) + sqrt(539) + 3)*2 + -6(-2 + sqrt(11))). -1450 - 84sqrt(11) Simplify ((((-2sqrt(420))/sqrt(10))/sqrt(2))/((-4sqrt(192) + sqrt(192))3))*2. 7/1296 Simplify (-5 + (sqrt(108) + -1 + sqrt(108))41 + -1)2. -960sqrt(3) + 7012 Simplify (sqrt(1500) - -1sqrt(1500))/sqrt(12) - (2sqrt(560) - sqrt(560))/sqrt(7). 6sqrt(5) Simplify -1(-2 + (sqrt(52)-3)2 + 1). -467 Simplify -2 + (((sqrt(567) - 2sqrt(567)) + sqrt(567))1 - (1 + sqrt(7) + 1)-6)*2. 144sqrt(7) + 394 Simplify (((1 + sqrt(153))6 + sqrt(153) + sqrt(153) + ((-3 + sqrt(153))-3 - sqrt(153)))-1)2. 360sqrt(17) + 2673 Simplify (-5sqrt(153)1 - -2((-2sqrt(153) - sqrt(153)) + sqrt(153)))/(((sqrt(576)1 - sqrt(576)) + sqrt(576))-6). 3sqrt(17)/16 Simplify ((1(sqrt(567)2)2 - sqrt(56)/((sqrt(8) - (sqrt(8) - sqrt(24)/sqrt(3)))-2 - sqrt(8) - sqrt(8))) + -1)4. sqrt(7) + 9068 Simplify 3 + (0 + (sqrt(300) - (sqrt(300) + -2 + -1 + sqrt(300) - sqrt(300)))2)2. 21 Simplify -4(-4 + (sqrt(1300))24 + -2). -20776 Simplify ((2 + sqrt(468))3-5)2 - ((sqrt(468) + 0 + sqrt(468) + -4)2 + (0 + sqrt(468))*2 + 1). 5496sqrt(13) + 103843 Simplify (sqrt(192) + 1 + -4)2 + 3 + (sqrt(27))25. -48sqrt(3) + 339 Simplify 2 + (61sqrt(14))/(sqrt(4)/(sqrt(4)/sqrt(2))) + 4. 6 + 6sqrt(7) Simplify (-3 + (sqrt(288) + 0 - sqrt(2) - (-4 + sqrt(128)))2)3. 93 + 72sqrt(2) Simplify (sqrt(33)/sqrt(3) + 0)2 - (-5 + sqrt(11)-4)24. -804 - 158sqrt(11) Simplify (-6(sqrt(108) + sqrt(108) + -1 + 0 + (sqrt(108) - (sqrt(108) + -1 + -1) - sqrt(108))))*2. 432sqrt(3) + 3924 Simplify ((sqrt(280)/(sqrt(15)/sqrt(3)-1))/(sqrt(40)/sqrt(5)6 - sqrt(24)/(sqrt(3)-1 - sqrt(3))))2. 28/169 Simplify 0 + ((1 + sqrt(700) + sqrt(28)/(sqrt(4)1))-5)2 + -5. 550sqrt(7) + 21195 Simplify -3(51sqrt(110)2)/((sqrt(480) - (sqrt(480) + sqrt(480) + 1sqrt(480) + sqrt(480)) - sqrt(480))/sqrt(3)). 15sqrt(11)/8 Simplify -1 + (sqrt(132)/(3sqrt(3)) - sqrt(44))/(1(sqrt(4) + sqrt(28)/sqrt(7))). -sqrt(11)/3 - 1 Simplify ((-1 + (2 + sqrt(170)/sqrt(10) - sqrt(153)/sqrt(9)-1))-6)*2. 144sqrt(17) + 2484 Simplify (5(1sqrt(12) - sqrt(3) - sqrt(3) - (sqrt(432) + 2)))*2 + 2. 1200sqrt(3) + 10902 Simplify ((sqrt(20)2-3)/sqrt(4) + (sqrt(450)/(sqrt(9)-1 - sqrt(9)))/sqrt(10))2. 845/4 Simplify (-4 + (sqrt(308)/(sqrt(11) - (sqrt(11) - sqrt(176))) - ((sqrt(147) - 1sqrt(147))/sqrt(7))/sqrt(3)))-3. -3sqrt(7)/2 + 12 Simplify -52(-2 + 0 + sqrt(125))-3-3. -450sqrt(5) + 180 Simplify ((-1sqrt(80) + -2 - sqrt(80))2 - (3 + sqrt(80) + 1)2) + ((sqrt(80) + 2 + sqrt(80) + 0)5)2. 800sqrt(5) + 8328 Simplify -1 + (sqrt(475) + 0 + -3 + sqrt(475) + sqrt(475) + sqrt(475) + 0 + -2)*2 + -3. -200sqrt(19) + 7621 Simplify -1(sqrt(252) + sqrt(252) + 2 + sqrt(252) - sqrt(252)) - (-5 + sqrt(252) + 1 + sqrt(252))2. -1026 + 84sqrt(7) Simplify (sqrt(1872)-2-2 - -5sqrt(1872)5)*2. 1574352 Simplify (((sqrt(150)/sqrt(3) - sqrt(50)) + 0 + (sqrt(72) + 0 - sqrt(2)) + (sqrt(2) - (sqrt(2)-1 + -4)))5)2. 1400sqrt(2) + 2850 Simplify 2 + sqrt(7) + 3 + -4 - 5sqrt(14)/(sqrt(2) - (sqrt(2) + sqrt(8)/sqrt(4))). 1 + 6sqrt(7) Simplify (5(sqrt(76) - 1sqrt(76))6)/((sqrt(324) + (sqrt(324) - -2sqrt(324)))-4). 0 Simplify 3((0 + 3sqrt(112) + sqrt(112) - sqrt(112) - sqrt(112)) + 4) + -1. 11 + 24sqrt(7) Simplify -61((sqrt(2268) + -1)5)2-2. -10800sqrt(7) + 680700 Simplify (sqrt(187)-14)/(sqrt(22)/sqrt(2)-6) - (1sqrt(272)1)*2-4. 2sqrt(17)/3 + 1088 Simplify 0 + sqrt(405) + (sqrt(405)3 + 3)*2 + 1 + 5 + 2sqrt(405). 189sqrt(5) + 3660 Simplify 1(sqrt(112) + -2 + 1 - -4(3 + sqrt(112) + sqrt(112)))2 + -3. 792sqrt(7) + 9190 Simplify -1sqrt(55)/(-6(sqrt(20) - sqrt(5)))-1. -sqrt(11)/6 Simplify (sqrt(540)/(2sqrt(12)) - ((sqrt(5445) - (-2sqrt(5445) + sqrt(5445) + sqrt(5445))) + sqrt(45)))/((sqrt(144) + sqrt(144)1)5 + sqrt(144)) + -4. -4 - 23sqrt(5)/88 Simplify (-2 + sqrt(272)-5 + sqrt(2448)1 + 1 + sqrt(425) + sqrt(425))*2. -4sqrt(17) + 69 Simplify (0 + (sqrt(1584) + 1)-6 - -1(3 + (sqrt(1584) - 1sqrt(1584))))2. 432sqrt(11) + 57033 Simplify (sqrt(3) + sqrt(3) + (2sqrt(27)/sqrt(9) - sqrt(3)) + 2)-5 + -5. -15sqrt(3) - 15 Simplify -1(-6sqrt(114)-2 + 1sqrt(114)3)/(sqrt(54) + sqrt(108)/sqrt(2)1). -5sqrt(19)/2 Simplify -2 + ((sqrt(132) + (sqrt(132)-1 - sqrt(132)))6 - sqrt(132))/(sqrt(12) + (sqrt(72)-1)/sqrt(6) - sqrt(12)). -2 + 7sqrt(11) Simplify (1((-2sqrt(825) - sqrt(825) - sqrt(825)) + sqrt(825)) + sqrt(825) + sqrt(825))/((sqrt(33) - sqrt(4752)-2)/sqrt(3)). -sqrt(3)/5 Simplify (sqrt(272) - (sqrt(272) - (3sqrt(272) + sqrt(272))-1 - sqrt(272))2) + 0 + -5. -4357 + 4sqrt(17) Simplify (sqrt(119) - sqrt(119)43)/(sqrt(63)/(sqrt(63)/sqrt(7))). -11sqrt(17) Simplify ((sqrt(640) + 1(sqrt(640) - (sqrt(640)-1 - sqrt(640))) + sqrt(640))/((sqrt(6655)-2)/sqrt(11)))*2. 800/121 Simplify sqrt(143)/(-2sqrt(99) + sqrt(11))-4 - (0 + sqrt(117) + sqrt(91)/(sqrt(28)/sqrt(4)) + -3). -16sqrt(13)/5 + 3 Simplify (-2 + (-4 + -4(sqrt(1300) + 1)1)*2)6. 3840sqrt(13) + 125172 Simplify -5 + 2(sqrt(1539) - (sqrt(1539) - (5*(sqrt(1539) - (0 + sqrt	{ "pile_set_name": "DM Mathematics" }
Simplify (((z9/z)/z(-17))(4/5))21 assuming z is positive. z*420 Simplify (a(aa8)/aa*(1/9))/(((a(a*(-11)a)/aa)/a)/a5) assuming a is positive. a(217/9) Simplify (u/(u/(u/((u/(u/(uu/(uuu*(-2)u))))/u))u))(-4)/((u11u)/u(2/23)) assuming u is positive. u(-274/23) Simplify ((zz(-18)/z)/zz)/(zz(5/9)z)z(-2/11)/z(7/3) assuming z is positive. z(-2284/99) Simplify ((pp(pp*8)/p)/ppp/p3(p(1/3))(6/25))14 assuming p is positive. p(2828/25) Simplify (aa(-24/5))(-14)/(a(-2/3))(2/111) assuming a is positive. a(88598/1665) Simplify (((m/(m/m(1/13)))/(m/(m(2/33)m)))(-40))27 assuming m is positive. m(-21240/143) Simplify (z/z(-6))(-1/14)/(z(1/2)/z(-13)) assuming z is positive. z(-14) Simplify (nn/n13nn(8/9))/(n/(((nn*(-1))/n)/nnnn))(-8) assuming n is positive. n(-82/9) Simplify (d*(8/9)/(dd*10d))/(d*(-10)/(d/(ddd/(dd(3/11))))) assuming d is positive. d(-182/99) Simplify (v4)(4/11)/((v/v(2/17))/(v/v16)) assuming v is positive. v(-2698/187) Simplify ((i(-5)ii)/i)*29((i/i*5i)/i)/i17 assuming i is positive. i(-137) Simplify (g/((gg7)/g))(-10/9)g*(-4)g/((gg15)/g) assuming g is positive. g(-34/3) Simplify (((ll/(l/l3))/l)/(l(-1/4)l)((l/(l*2/l))/l)/(((lll(-4/9)l)/l)/l))(1/2) assuming l is positive. l(25/72) Simplify ((d(-3))(-24)/(d(-12)/(d/d(1/4))))(-1/5) assuming d is positive. d(-339/20) Simplify (d*14/dd)/(d*11dd)d(d/d(-1/4))/dddd8 assuming d is positive. d(49/4) Simplify ((jj(-13/3)/j)/j20)/(j/(j(-7)j)(jjj(-1/18)jj)/j) assuming j is positive. j(-617/18) Simplify ((yy1)(2/119)yy*(-6)y(yy(-3/5)/y)/y)(1/3) assuming y is positive. y(-1104/595) Simplify (t(1/4))*(-1/15)(t(-3/8))(-5) assuming t is positive. t*(223/120) Simplify (ppp/p(7/2))(1/31)/((p/(pp3/p))/p)(35/2) assuming p is positive. p(1627/31) Simplify ((((w(1/3)ww)/w)(-6/29))(-16/7))(3/8) assuming w is positive. w(48/203) Simplify ((p*(-1/19)pp)/(p/((p(p/(p/((p*(-10/3)/p)/p)))/p)/p)p))/(pp(1/4)pp(-23)) assuming p is positive. p(3275/228) Simplify ((q11)(2/17))(1/44) assuming q is positive. q(1/34) Simplify ((o(1/4)/oo)/o)*(-38)(oo(-13))/(o/(o/(o(-2/63)o))) assuming o is positive. o*(1957/126) Simplify ((w((w*(-3/7)/w)/ww)/w)44)30 assuming w is positive. w*(-13200/7) Simplify ((ll(-1/2))(2/25)/(l*(-1)/(ll/l*(1/2)l)))(-14/5) assuming l is positive. l(-1239/125) Simplify (d*1d*(-1/3)/dd5/d(-6))33 assuming d is positive. d352 Simplify (t*11/tt*(1/4)t)/(((tt/t(-2/31))/t)/tt((tttt*5tt)/tt)/t) assuming t is positive. t(147/124) Simplify (d(-2/7))*(-20/9)(d(-1/2))28 assuming d is positive. d*(-842/63) Simplify (dd/(d*(9/5)d))/d*6d/d*(-3/13)d/d9 assuming d is positive. d(-882/65) Simplify (((d((d(-9/4)d)/d)/d)/(d(-2)/d))(-4/5))(-10) assuming d is positive. d6 Simplify (rr/(r10r))/r*(-1)r*9/(rr*6rr) assuming r is positive. r(-8) Simplify u(-2/15)u/u*20u*8(u/u(-1/2))/u assuming u is positive. u(-319/30) Simplify sss/s*14ss/(s/(s(s*13ss)/s))ss(s4)(-43) assuming s is positive. s(-165) Simplify ((g(-2)ggg)(-2/17)((gg2)/gg)(-9))(-1/7) assuming g is positive. g*(461/119) Simplify (g/(ggg5g))/gg(g*12g)/g(g/(g(2/3)g))/(g(-6)/g) assuming g is positive. g(34/3) Simplify (rr(-3)r)*16r((r/(rrr8rr)r)/r)/rr(-1) assuming r is positive. r(-28) Simplify (xx(-11))/(x/x(-17/2)xxxx)x(-23)/xxx24/x assuming x is positive. x(-47/2) Simplify (x(-1/6))(9/7)(x/x0)/x(3/2) assuming x is positive. x(-5/7) Simplify (b(-4)b/b(1/10)(b*(2/3)b)(-35))(29/3) assuming b is positive. b*(-53447/90) Simplify ((n/((nnn(-1/2))/n)n)/n*6)/((nnn8)/(n(-1/4)/n)) assuming n is positive. n(-63/4) Simplify (m/m(-2/47)m)/((m/m*31)/m)(m(-5/12)/m)(-8) assuming m is positive. m*(6257/141) Simplify (qq(-7)/q)(-1)/(qq(-1/15)qq(-1/21)q) assuming q is positive. q(144/35) Simplify n(-4)nn*17nn(nn(nn(-11)/n)/n)/n(-2/11) assuming n is positive. n(68/11) Simplify i13iii*(-2/9)ii(i/(i/i*(-3/14)))/(ii11) assuming i is positive. i(575/126) Simplify ((g(-1/2))(-9/7)g/(g/(gg*(-7)/g))g(g/(g(g/((g/g*(1/7))/g))/g))/gg)(13/2) assuming g is positive. g(-143/4) Simplify (y*(10/3)/yy(-29))(-5) assuming y is positive. y(400/3) Simplify t(-3/11)t(-6/5)(tt(-1/10))/(t/(t(-2/7)t)) assuming t is positive. t(-661/770) Simplify (((l(-1/32)/l)/l)/l*9)/((lll/l(-14))/(l/(l(l/(l/l*(1/11))l)/l)l)) assuming l is positive. l(-9547/352) Simplify (cc/(cc(1/5))c)*35c(5/4)/((c(11/5)c)/c) assuming c is positive. c(1241/20) Simplify x5/(x(7/3)x)(x/(x(-2/5)/x)x)(5/2) assuming x is positive. x(61/6) Simplify j*1jj(-2/9)j/((j/(jj(-1/3)))/jj)j/j(2/5)j assuming j is positive. j*(182/45) Simplify hh/(h/(h*14/h)hh)h/(h/(h/h*12))h(-11)/(((h(-4)h)/h)/h) assuming h is positive. h(-5) Simplify (k/(kk*1)k/(k/(k/(k/k21))))(5/16) assuming k is positive. k(25/4) Simplify ((n(-3/5))(-1/4))(-1/19) assuming n is positive. n(-3/380) Simplify (j/j(-2/41))/j*(-20)(j(2/19))(-36) assuming j is positive. j(13445/779) Simplify (k(-33)k(-2/15))/((k(-1/27)/k)/k(-32)) assuming k is positive. k(-8653/135) Simplify (((aa/(a*(-2)a))/a)/(((a/((a*(-3/4)/a)/a))/a)/a))/(aaaa*(-6)a)(-2/47) assuming a is positive. a(31/188) Simplify (q(-3/2)/(q/q(1/11))qq/(q/(q/(q/(qqq*(-2/3)/q))))q/(q/((qq(-2/7))/q))q)29 assuming q is positive. q(-4843/462) Simplify (o*(2/5)/ooo)(-13)/((o(-4/5)oo)/o11) assuming o is positive. o(-42/5) Simplify ((cc/(c*(-31)/c)c)/c(2/7))(1/4) assuming c is positive. c*(243/28) Simplify h/(h/(hhh6/h))hh(1/3)h*(2/37)hhh*(-4)hhhh assuming h is positive. h(1153/111) Simplify ((v/v(2/5))(1/56)/(vvv/(v(-3)v)vv*(-5/4)vv))41 assuming v is positive. v(-77367/280) Simplify ((t(-2/5)tt/(tt*(2/5)t))/(t(-1))(12/7))(-10) assuming t is positive. t(-64/7) Simplify ((f(3/5))(3/5))(1/10) assuming f is positive. f(9/250) Simplify (r(1/4)/r)(-2/13)(r(2/9))(-2/107) assuming r is positive. r(2785/25038) Simplify (b(-2/5)bb(-2/9))/(bb(-1/33))(-2/11) assuming b is positive. b(3017/5445) Simplify ((y(2/5)/y)/yy)(3/7)/((y(2/27)/y)/(y(1/3)y)) assuming y is positive. y(1892/945) Simplify (d(-1/13))2/(d(2/21))(7/5) assuming d is positive. d(-56/195) Simplify oo/o(-16)o*(-2)(o/(((oo(1/2))/o)/o))(-23/2) assuming o is positive. o(-5/4) Simplify (t(-2/11)t/(t/(t(t(-24)t)/t)))/(tt(-1/2)tt(-8)t) assuming t is positive. t*(-389/22) Simplify (gg*(-2/21)/g)/(gg*8gg)(((gg/(ggg(-2/35)g))/g)/gg)/(g/g(2/25)) assuming g is positive. g(-7328/525) Simplify ((i(-11/6)ii)/(i/i(-11)))/(ii*1ii/(i/i(2/57))) assuming i is positive. i(-565/38) Simplify d(2/9)(d/d*(11/3))/dd((ddd/(d/d(-11)))/d)/(d(4/5)/dd) assuming d is positive. d(-596/45) Simplify (t(-5/8)t8)/(((tt*(9/5))/t)/ttt(-23)) assuming t is positive. t(1143/40) Simplify ((w(-11)w)/www3/w)(4/11) assuming w is positive. w(-32/11) Simplify ((h/((h/(h(-1/2)/h))/h))*20(hh(-3))/((h/(hh*(-2)h))/h))(-26) assuming h is positive. h312 Simplify ((rrr/(r/(r/(r/r*(-2/91))r)))/rr(-2/21))(-2/97) assuming r is positive. r(-1028/26481) Simplify y(-3)/y(2/9)(y(y/y(3/7))/y)(-5/9) assuming y is positive. y(-223/63) Simplify (w/(w(w*7/w)/ww))20/(w(-2/9))(-3/10) assuming w is positive. w(-1801/15) Simplify ((bb21b)/bb(-9/4))/(b/b(7/3))(2/21) assuming b is positive. b(5009/252) Simplify ((t/(tt(-2/13)))(3/10)/(t(2/13))(3/4))12 assuming t is positive. t(-54/65) Simplify ((j/(j/(j/j17)))(-5/2))(-5) assuming j is positive. j(-200) Simplify (i*(8/3)i(3/23))/(i16)**34 assumin	{ "pile_set_name": "DM Mathematics" }
at is the common denominator of -67/458 and 1 - (-20 + (-28)/7)? 458 Suppose -s = -2n + 35 - 255, -2s + 447 = 3n. What is the least common multiple of 14 and s? 1554 Suppose o + 5g = -0g + 22, 5o = -2g + 18. Suppose 0 = -0i - i + o. Find the common denominator of 31/10 and i/(-9) + 3028/(-144). 20 Calculate the common denominator of 19/35 and (-220)/(-50)6/4. 35 Suppose 19k = 18k + 42. Calculate the lowest common multiple of k and 14. 42 Let l(y) = -256y*2 - 6. Let c be l(-4). Let v = c + 57539/14. What is the common denominator of v and -25/7? 14 What is the lowest common multiple of 75/4 + 69/(-92) and 118? 1062 What is the common denominator of -65/34 and 1/9-1 - 4760/306? 102 Find the common denominator of -1(-5)/(-5)35/22 and -79/76. 836 Suppose -23j + 1302 = 198. What is the common denominator of 9/14 and j? 14 Find the common denominator of 49/80 and (-1)/28 + 22/(-77). 560 Let o be 5/(-2)28/(-5). Let p = 19 + o. Calculate the least common multiple of 10 and ((-18)/(-10))/(p/220). 60 Let o be (9/(-2))/(6/(-36)). Suppose o = 4h - 9. Calculate the smallest common multiple of h and 2. 18 Let u(t) = -t - 7. Let s be u(-10). Suppose 2b + 2m - 210 = -3b, -25 = -b + sm. What is the least common multiple of 32 and b? 160 Let x(g) = -2g*2 + 15g - 10. Let a be x(6). Suppose 5o - 22 = a. Calculate the smallest common multiple of 17 and o. 102 Let h(p) = -4p - 7. Let d be h(-2). Calculate the least common multiple of d + (-4)/(-5) + 17/85 and 5. 10 What is the common denominator of 11/2 + (-7)/((-392)/16) and -51/2? 14 Let f be (56/4-1)/(-2). What is the lowest common multiple of 2 and 36(7/3)/f? 12 Let r = 5939/1432 - 4/179. What is the common denominator of (-111)/33/30 and r? 40 Suppose -2c - 4 + 12 = 0. What is the common denominator of (0 - 40/(-9)) + (-15)/90 and (-1)/c - (-251)/(-12)? 18 Calculate the common denominator of -145/12 and -14 + 8 + (-17)/(-18). 36 What is the common denominator of (-192)/(-80)((-9)/7 + 2) and (66/(-10) - -1)/((-10)/25)? 7 Let u be (3/423)/(2/18159194). Let x = 64394 - u. Let a = 4993/5358 - x. Calculate the common denominator of 109/6 and a. 114 Let i = 66 - 51. Suppose -m = u - i, 0u + m + 5 = u. Calculate the lowest common multiple of u and 10. 10 Let b(c) = 13c2 + 2c - 1. Let d = -31 + 32. What is the smallest common multiple of b(d) and 27/62/3? 42 Let t = -100 - -256. What is the least common multiple of t and 4? 156 Let c be (-3)/(-2)14/1. Let k = c + -12. Suppose -4m + 12 = 4j, -2m = j + 2j - 7. What is the least common multiple of k and j? 9 Suppose -7m - 40 = -11m. Find the common denominator of (21/m - 2)-21 and ((-5)/3)/(8/(-33)). 40 Suppose -5s = -7s + 12. Let n(o) = o2 - 7o + 12. What is the lowest common multiple of n(s) and 2? 6 Let a = 784321/1182930 - 60/5633. What is the common denominator of 121/60 and a? 420 Let i(a) = -5a2 - 69a + 16. Calculate the least common multiple of 14 and i(-14). 14 Suppose -5y + 1800 = 10y. What is the least common multiple of 30 and y? 120 Suppose 12i + 5 = 11i. Calculate the smallest common multiple of 233i/(-35) + (-2)/7 and 3. 33 Let l = 7713 - 424229/55. Find the common denominator of l and -40/11. 55 Suppose 10p = 1378 + 422. What is the smallest common multiple of 14 and p? 1260 Let v(o) be the third derivative of -7o4/6 - 3o*2. Let b be v(-1). Suppose -b = 5c - 118. Calculate the least common multiple of c and 28. 252 Find the common denominator of -83/162 and (-12 - (-495)/44)/((-18)/(-76)). 162 Calculate the common denominator of (-1 - 8) + 8442/900 and 89/60. 300 Let p = 73 + -174. What is the common denominator of 18/5 and 2 + (p/(-10) - 3)? 10 Let a = 497899/6 - 83180. Let u = a - -9487/48. Find the common denominator of 3/6 - (-87)/(-4) and u. 16 Suppose 0 = 5l - 5i - 885, 4l + 2i - 315 = 387. Suppose c - 9c + l = 0. Let h(o) = o + 9. Calculate the least common multiple of c and h(-6). 66 Suppose 5w - w - 16 = 0. Suppose -2m - k - 4 = 2, k + 10 = -4m. What is the lowest common multiple of (m/5)/(w/(-80)) and 3? 24 Let m = -88/263 + 25873/8942. Let q = 1746 + -15785/9. What is the common denominator of m and q? 306 Let t(j) be the third derivative of -j4/8 - j3/3 - 3j2. Let b be t(-2). Suppose 22 = -bs + 86. What is the lowest common multiple of 2 and s? 16 Let c = -2260 - -2284. What is the least common multiple of c and 33 - 2 - (-1)/1? 96 Let b = -13 + 21. Suppose -5o + b = -o. What is the common denominator of 119/12 and 314/40 + (0 - o)? 60 Suppose -3j + 54 = -0j. Let l(z) = 13z*2 + 1. Let g(u) = 2u + 27. Let x be g(-14). What is the least common multiple of l(x) and j? 126 Let a = 71150357729 + -117398095202603/1650. Let s = a + -362/275. Let q = -2993 - s. What is the common denominator of q and -74/3? 6 Suppose 4b - 4 + 12 = 0. Let y be 135/10 - (-3)/b. Suppose y = -5f + 52. What is the lowest common multiple of 5 and f? 40 Let y = 30 + -32. Calculate the lowest common multiple of y + 25/2 + (-7)/(-14) and 1. 11 Suppose 5r = 5j + 150, -2r = -j - 86 + 28. What is the lowest common multiple of 36 and r? 252 Suppose -5y + 5m - 4m = 18560, 5m + 18590 = -5y. Let a = -37051/10 - y. Find the common denominator of a and -4 + 2 + 21/98. 70 Let y be 8/36 + 1407428/288 + -2. Let f = -4897 + y. Find the common denominator of -87/22 and f. 88 Let p = -2498 - -2514. Calculate the smallest common multiple of 6 and p. 48 Let o be 30/(-42) + (-2)/7. Let s(j) = -2j2 + 14j - 20. What is the smallest common multiple of s(3) and (-1)/(o/2) + 16? 36 Suppose 113s - 1974 - 3676 = 0. What is the least common multiple of 305 and s? 3050 Suppose a - 9451 = 5x, x - a + 1891 = -0a. Find the common denominator of 73/14 and 5595/x + (-3)/7. 126 Let l = -17 - -21. Let m(u) = 8u - u*3 + 6 + 5u*2 + 5u*3 - 3u*3 + lu*2. What is the lowest common multiple of m(-8) and 16? 48 Let r be (5 + -4)-1(1 - -13). What is the smallest common multiple of 22 and 48/28 - (-2)/r-2? 22 Let k be 4/(-5)12940/(-8). Let h = 1/9382 + -379981/93820. What is the common denominator of k/208 - 38/(-247) and h? 40 What is the common denominator of (-1070)/(-132)246/820 and 6/9 - 151/(-12)? 44 Calculate the common denominator of (-661)/(-180) + (-4)/18 and (-4 - -1)(-238)/(-252). 60 Suppose 0y - 3y = -3. Suppose 0 = 2j - g - 42, 3g + 34 = 2j - 4. What is the smallest common multiple of j and y/2 - 44/(-8)? 66 Let q = 10199/1110 + -4/185. Find the common denominator of (-20 - -35)/(45/(-35)) and q. 6 Let u(l) = -2l - 6. Let v be u(-5). Suppose 6a + 7 - 7 = 0. Suppose ax = -vx + 4. What is the lowest common multiple of x and 3? 3 Let t = 326 + -324. Suppose -x + 2u = -12, 2x - 4x = -2u - 22. Suppose x + 12 = i. Calculate the least common multiple of t and i. 22 Let w = 5949 - 588902/99. Find the common denominator of 52/9 and w. 99 Let y = -8 - -12. Let j be (1/(-77))/(y/(-1948)). Let k = j + -90/11. What is the common denominator of k and 31/8? 56 Suppose 5x = 4c + 1 + 13, x - 2c + 2 = 0. Calculate the smallest common multiple of 96 and x. 96 Suppose 13h = 146 + 49. Calculate the lowest common multiple of 87 and h. 435 Suppose z - 18 = -0z. Let j be ((-9)/12)/(3/84). Calculate the lowest common multiple of (-77)/j - (-1)/3 and z. 36 Let h = 66 - 58. Calculate the common denominator of (1476/162)/(h/(-3)) and 89/18. 36 Let w = 34 - 84. Let k = w + 52. Calculate the smallest common multiple of k and 17. 34 Let d be -14/(-8)2. Let k = 17 - d. Calculate the common denominator of -51/40 and (-4)/k - (-708)/(-16). 40 Suppose 0 = -3c + 2c - l + 115, -4c + 5l = -424. What is the smallest common multiple of c and 7? 777 Suppose -3 = 3v + 2b - 5, 0 = b - 1. Suppose o + 0o + 11 = v. Let n = 3 - o. What is the least common multiple of 20 and n? 140 Let j be (36/54702)/((-10)/(-3)). Let n = 238041/70910 + j. What is the common denominator of n and 5/4? 28 Let r(l) = l*3 - 8l*2 + 26l + 20. Calculate the lowest common multiple of 22 and r(6). 1144 Suppose -15z = -17z - 104. Let b = z - -54. Let i = 87 + -61. Calculate the lowest common multiple of i and b. 26 Suppose 2z - 30 = 2w, 2z = 5z - 2*w - 40. Calculate the lowest common multiple of 5 and z. 10 Let a be	{ "pile_set_name": "DM Mathematics" }
235. Let u = 138 - q. Solve -10 + u = k for k. -3 Let r be (399/14 + -6)(-72)/(-60). Solve 78 = -ru + 14u for u. -6 Let c(f) = 12f + 4. Suppose 3a + a = 52. Let r be a/(-26) + 6/4. Let v be c(r). Solve 0g = -4g - v for g. -4 Let m(j) = -j3 + 17j*2 + 4j - 24. Let x be m(17). Suppose -9b - 2b + x = 0. Solve 2p + 6 = bp for p. 3 Let b be (-72)/(-9) - -3 - 8. Suppose -m + 4 = 0, 3w + bm - 16 = 2. Solve -21 = wl - 9l for l. 3 Let a = 201 - 176. Suppose 22i - ai + 12 = 0. Solve -5s + 14 = i for s. 2 Let i be (5 - -1) + 147 + -6. Let o = i - 118. Solve ox = 25x for x. 0 Suppose -t + i = 2, 5t - 894i - 18 = -896i. Let z = 2 - 1. Let y = z - -1. Solve 4 + y = -tc for c. -3 Let b(f) = -f3 - 2f*2 - f - 23. Let p be b(-4). Let m(q) = -q + 24. Let l be m(p). Solve -ln + 2n + 27 = 0 for n. 3 Let p(q) = 14q - 89. Let a be p(6). Let j be -130(-1)/(-25)a. Solve jc + 12 = 23c for c. -4 Let n(j) be the third derivative of j5/30 - j4/8 - 7j3/2 + 4j*2 - 17j. Let g be n(-3). Solve -g = -5r - r for r. 1 Suppose -274 = 46m - 826. Solve -6o = mo + 90 for o. -5 Let r(t) be the second derivative of -t*4/3 - 13t*3/6 + 3t*2/2 - 33t. Let j be r(-3). Let s be 2 - (0 + -2 + j)/2. Solve s = -l + 2 - 7 for l. -5 Let m(u) = 19u - 1617. Let c be m(86). Solve cp = 184 - 269 for p. -5 Let r(v) = v*2 + 4v - 140. Let c be r(10). Suppose -4t = -8, 3t + ct - 14 = -2l. Solve -8d = -20 - l for d. 3 Let l(s) = -36s + 83. Suppose -15k - 3u - 1 = -11k, 0 = -2k + 2u + 10. Let z be l(k). Solve -4p + zp = 14 for p. 2 Let s be (3 - (5 + 5/(-1)))12. Let n be 0/(-2)s/(-108). Solve n = -0v - 5v - 5 for v. -1 Let n be ((94 - 4) + -5)/1. Suppose 2f = -15f + n. Suppose -5 + 20 = fp. Solve 4s - 5 = ps for s. 5 Let x(s) = 19s2 - 7s - 2. Let c be x(5). Let q be (-5)/20 - c/8. Let a = -51 - q. Solve ap - 8 = 6p for p. -4 Let p be -2 + 7/((-21)/(-15)). Suppose -12 = -3d + g, 5g + 9 = -3d + 21. Solve 0 = ph - 5h - d for h. -2 Suppose -14i + 14i + 17i = 0. Let m be (18/(-135))/(1/(-40))3. Solve 51f - 55f + m = i for f. 4 Let y be (-2)/3 - 2912/(-273). Solve 787 = yx + 727 for x. 6 Suppose -237t = -262t. Solve tc - 92 = -23c for c. 4 Let d(v) = 5v + 5. Let i be d(-11). Let j = i + 51. Suppose 2u + 3h - 3 = 0, 4h - 5 + j = -3u. Solve ut = -4t - 8 for t. -2 Let y(h) = 38h + 935. Let m be y(-19). Solve -mr = -185r + 252 for r. -9 Let d(w) = w*2 - 10w + 10. Let i be d(11). Let t = -21 + i. Let y be -14(2 - 3) - 12. Solve g = -tg - y for g. -2 Suppose 5t + 3t = -512. Let r = 64 + t. Let a be 8/(-5)(r - 10). Solve -4g + 0g = -a for g. 4 Let w be (7 - 116/(-16))(-104)/(-39). Solve -wj = -44j + 24 for j. 4 Let l be ((-816)/(-187))/24 + (-207)/(-11). Solve ln = 27n - 40 for n. 5 Suppose 52 = 9b - 11b. Let p be (b/36 - (-8)/36)-2. Let u be (1/(4 + -5))/(p/(-5)). Solve -u = i - 4 for i. -1 Suppose -13y + 15y - 96 = -30y. Solve ya + 114 = 126 for a. 4 Let u = 5952 - 5938. Solve uy + 84 = -7y for y. -4 Let q(n) = n + 4. Let o be q(-2). Suppose 0 = -oc - 21c + 46. Solve h = ch + 4 for h. -4 Suppose 4y - 28u = -23u + 209, 5u = 5y - 255. Solve ys - 352 = 90s for s. -8 Let z = -2620 + 1840. Let t be (3/2)/((-117)/z). Solve 5q + 10 + t = 0 for q. -4 Let t be (3304/140 - 16)/((-1)/(-5)). Solve -15 = 43a - ta for a. -3 Suppose -k - 9 = -2a - 0k, 0 = 3a - 4k - 11. Suppose -4u + 45 = -5y + 2, 65 = 5u + ay. Solve -13g = -ug + 2 for g. -2 Let k(d) = -d*2 + 11d - 26. Let y = -242 - -249. Let g be k(y). Solve -7 = gv - 5 for v. -1 Let j = 335 - 359. Let m be j(2/(-6))/1. Solve 4h + m = 6h for h. 4 Let m = -25887 - -25887. Solve -3408j + 3416j - 40 = m for j. 5 Let p = -816 - -840. Solve 0 = -11n + 20 + p for n. 4 Let q(w) = -w + 50. Let z be q(35). Suppose 0 = zi - 20i + 15. Solve -f - 2 - i = 0 for f. -5 Let j be 2/(-9) + 3310/(-90). Let u = 42 + j. Suppose 0n + 4n + 20 = -5h, n = 4h - u. Solve hd + 2d - 4 = 0 for d. 2 Suppose 0 = -2f + 9a - 11a + 76, -3f + 5a = -130. Solve 2 = 14x - f for x. 3 Let u = -68 - -72. Let v be (-3 - -3)/(4/(-1 + 5)). Let o(m) = m + 33. Let r be o(-13). Solve -p - up + r = v for p. 4 Let u = 138 - 8. Suppose -3j + u = -5w, -5w = -4j + 229 - 54. Let m be (-2)/((-2)/j3). Solve i + 2i = m for i. 5 Let z = -37 + 37. Let l be -1(1 - z) - (-12)/(-4). Let t = l - -6. Solve 4c + 2 = tc for c. -1 Let j(d) = -d + 4. Let l be j(2). Let b(o) = -40o + 8642. Let p be b(216). Solve pt = 3t - lt for t. 0 Suppose 0 = -3y + 5j + 1171, 4y - 2j = -6j + 1508. Solve y - 470 = -11q for q. 8 Suppose 3r + 15 + 24 = 3o, 3o + 3r - 51 = 0. Solve 0 = 303p - 300p - o for p. 5 Let i = 4038 - 4034. Solve 36a = -ia + 120 for a. 3 Let w be (-6)/4(-376)/6. Let r be (1470/(-10) - -9)/((-6)/(-4)). Let s = r + w. Solve -4 = sn - 0 for n. -2 Let n = 107 + -78. Let s be (21 - 15) + n2. Solve -x - 67 + s = 0 for x. -3 Suppose 3b + 139 = 4d, -d + 0b + 49 = 4b. Let h be -2 + 2 + -31 + (-4 - -1). Let j = h + d. Solve jy = 4y - 2 for y. 2 Suppose 0 = 5u + r - 10, -4u + 5u + 19 = 4r. Let n be 2/((14 + 900/(-54))/(1-4)). Solve -nz + 2z - u = 0 for z. -1 Suppose 0 = 13z + 50 - 193. Let j be ((-4)/12)/(1/(-3)). Solve -j + z = 2i for i. 5 Let b be ((-1)/(2/(-4)))/(40/3220). Suppose 148v = bv. Let f = 1 + 3. Solve -4 = fm - v for m. -1 Suppose 0 = 2i + 3d - 23, -1051d + 32 = 5i - 1052d. Solve ic = -4c - 22 for c. -2 Let r = -74 - -79. Suppose -3b = -k - 2, 5b = -rk - 5 + 15. Solve -2w = k + 5 for w. -3 Let f be (-5)/(324/(-318) + 1). Let g = f + -257. Solve g = -2m + 6m for m. 2 Let u be 4/26 + (-280)/364-18 - 7. Suppose 12 = 2j - 3l, l - 2l = -3j + 11. Suppose -5g = -2g - j. Solve 0 = -3a + u - g for a. 2 Suppose -135j = -149j + 714. Solve -6p = -j + 81 for p. -5 Let q = -8 - -8. Suppose q = -9u - 5u + 14. Let l be (-23)/4 - -6 - (-11)/4. Solve u + 8 = lb for b. 3 Suppose 16j = 17j. Let c be j/(6 + 20/(-5)). Suppose -13x = 2x - 30. Solve -2n - x + 0 = c for n. -1 Suppose 12d = 9d + 9. Let a be (6 - 9) + d - -15. Solve -ar + 25 = -10r for r. -5 Let c be 492/12 - (1 - (-10)/(-2)). Let x be c/99 + (-12)/(-22). Solve -2r + x = 3 for r. -1 Suppose 0 = h - 3h + 6. Suppose hu + 5x = 6u + 26, -56 = 5u - 2x. Let a be 2(-3)/u + (-9)/(-6). Solve aw + 4 = -4 for w. -4 Let d be 27/(-12)16/(-6). Let a = 1902 - 1890. Solve a = -dp - 6 for p. -3 Suppose 0 = -24x + 28x + 2r + 6, -3x - 15 = 5r. Solve 0 = -9b - x + 9 for b. 1 Let g(k) = -k*3 + 3k*2 + 9k - 6. Let d be g(5). Let o(z) = -3z - 28. Let q be o(d). Suppose -2f + f + 21 = 0. Solve 4r = -f + q for r. -4 Suppose -12k = 5k + 6k - 3749. Solve -kf = -167f + 16 for f. 4 Let q be 5((12 - 20) + 0 + (-219)/(-15)). Solve -qs = -31s + 2 for s. -1 Let b be ((-1026)/(-1368))/((-2)/(-32)). Solve bu + 16u = -84 for u. -3 Let p be (-2)/8 - 58(-10)/16. Solve 6h = -p + 72 for h. 6 Let k be (-104)/24 - 481/(-39). Solve kj - 20 = 28 for j. 6 Suppose 0 = -3x - x + 16. Let g be (40/(-5))/x + 6. Let m(q) = 3q - 9. Let b be m(g). Solve b = -o - 0 for o. -3 Suppose 5y + 2o = y + 122, -157 = -4y + 3o. Solve 28g + 42 = yg for g. 7 Suppose 2r + 2n = 22, 110 = 5r - n + 31. Suppose 8o + r = 39. Let m(a) = -a + 3. Let y be m(o). Solve t + 2 + 0 = y for t. -2 Suppose -2y - 68y - 72y + 710 = 0. Solve -16 = -ya + a for a. 4 Let d(x) = x*3 + 5x*2 + 5x - 3. Suppose -3 = -h + 7. Suppose -5j - f - 4 = h, 4f = 5j + 19. Let w be d(j). Solve -r - 2 + 5 = w for r. 3 Suppose 3m + g = -g + 16, m = g + 7. Let n(p) = -p*2 - 6p + 3. Let b be n(-6). Suppose b + m = 3y. Solve -yq = -12 + 3 for q. 3 Let z be (4 + -2)/(-2) - (405 - 7). Let s = z - -399. Solve 13o - 16o + 9 = s for o. 3 Let n(v) be the second derivative of v*4/12 + 5v3/6 - v2 + 2v. Let i be n(-6). Suppose -45 = 23766j - 23775j. Solve jz = iz for z. 0 Let q(m) be the first derivative of -m3/3 - 6m*2 - 27m - 41. Let g be q(-8). Solve -4 = gf + 21 for f. -5 Let m be (-26566)/(-592) + 6/16 + (-2)/8. Solve -46z + mz - 4 = 0 for z. -4 Let c = -3622 + 3758. Solve 56 = -cf + 122f for f. -4 Suppose 0 = -5g - 25, 0 = n - 4g - 8 - 20. Solve 17r	{ "pile_set_name": "DM Mathematics" }
is the value of 2375/1900(-6)/(-5)? 3/2 What is (((-180)/5)/(-18))/((-4)/(-16))? 8 Evaluate (12/(924/(-143)))/(2/(-14)). 13 153/187(-4)/18 -2/11 Calculate ((-588)/(-882))/(4/2)9. 3 (15/20)/((-13)/(468/45)) -3/5 What is the value of 420/(-280)(-168)/(-18)? -14 Evaluate ((-282)/(-188))/((-2)/(-8)). 6 Evaluate 18/(-9)((-2)/9)/((-8)/12). -2/3 What is 5/(5/(-54)(-84)/(1008/24))? 27 Calculate 2/((-110/(-15))/((-12)/16)). -9/4 (((-21)/21)/(-2))/(2/(-80)) -20 What is the value of -12(-9)/((-432)/8)? -2 What is the value of 16/24214762/5368? 2/11 Calculate ((-9)/18)/((-56)/128). 8/7 Evaluate 2/6171/304. 3/16 What is (23/2)/(32177/2798)? 1 20/(-1)(342/(-1197))/(4/(-7)) -10 Calculate ((-120)/(-18))/(174/(-261)). -10 What is the value of (-10504)/39390(-1)/12? 1/45 Calculate ((-352)/(-132))/(32/(-72)). -6 What is ((104/10)/2)/((11950/250)/239)? 26 What is the value of 11/(-2)(-268)/469? 2/7 Evaluate ((-225)/(-5))/(-5)(-104)/(-156). -6 Calculate 2/4(-9590)/6713. -5/7 Evaluate ((-6)/(-384)8)/((-21)/(-28)). 1/6 (2600/(-6500))/((-44)/10) 1/11 ((-50)/(-5))/(252/40) 8 What is ((-18)/(-14))/(21(-21)/3087)? -9 Calculate ((-16)/32)/(7/182). -13 Evaluate (5/3)/(15850/5706). 3/5 Evaluate 2(14/(-3))/(-7)(-171)/12. -19 (20/3)/(((-11120)/288)/139) -24 33/963/63 11/3 What is (((-24)/(-660))/((-12)/(-22)))/(2/5)? 1/6 What is the value of (13/(-8424)-18)/(((-6)/(-2))/12)? 1/9 What is the value of (35/(-14))/((-25)/140)? 14 Calculate (-1(-15)/20)/((-5)/703). -7/2 (-3)/(-18)854/12 6 What is the value of ((-270)/15)/216108? -9 What is 14/((-1232)/(-165))(-5)/(-15)? 5/8 What is the value of (-11(-20)/110)/(512/(-330))? -11 Calculate 8/((-64)/30)(-232)/87. 10 What is the value of ((-13)/(-6))/(16/355237)? 13 What is ((-2)/(-69))/((533/13)/123)? 2/23 (291/(-194)(-12)/(-18))/((-22)/4) 2/11 Evaluate (-644)/(-92)(-15)/(-21)3. 15 Evaluate (-77)/(21560/(-1750))16/5. 20 What is the value of 1214/(-273)(-14)/(-56)? -1/39 What is the value of (4/14)/(26/(-1001))? -11 What is the value of ((-153)/510)/((-2)/(-20))19/(-3)? 19 What is 7(1/2)/((-14)/(-68))? 17 (12(-10)/(-540))/((-80)/(-36)) 1/10 What is the value of 1974/329((-6)/(-10))/3? 6/5 What is (4/14)/((24/112)/(-3))? -4 Calculate (12/(-64))/(6/12). -3/8 Calculate (-1836)/306(-2)/8. 3/2 Calculate (-108)/841/1220. -15/7 Evaluate (-1)/(-1)(-3)/(-147)7. 1/7 What is ((-7)/(-168))/(2/12)? 1/4 What is the value of (27/6)/((-90)/(-120)-2)? -3 What is 61/72242/1? 7 Evaluate 140/(-14)44/3080. -1/7 What is the value of (32/(-1))/(1048/524)? -16 What is 220/(-11)(-16)/384? 5/6 What is the value of ((-164)/287)/((-2)/(-49))? -14 ((-156)/9)/(40/(-12))235/47 26 What is the value of 572/(-104)204/66? -17 Calculate ((-16)/28)/(31/((-35805)/33)). 20 Calculate ((-65)/52)/(31/372). -15 What is the value of (25800/(-175))/8614/(-4)? 6 What is the value of (-176)/(-1440)9(9/(-3))/(-33)? 1/10 Calculate (((-335)/(-201))/(75/12))/(4/(-9)). -3/5 What is ((-52)/218463)/(1/(4/(-51)))? 2/17 ((-280)/(-952))/(55/(-44)) -4/17 What is 1/(-28)64? -6/7 Evaluate -43/255(-440)/(-176). -2/17 Evaluate ((-10)/(-10))/(((-2)/(-3))/(430/903)). 5/7 (((-20)/(-220))/((-108)/(-396)))/((-2)/150) -25 Calculate 0-35/30(-5)/(-10). 0 Evaluate (2/8)/(3(-6)/936). -13 What is (0/(320/16))/((30/(-5))/3)? 0 (-5)/(85/8164) -12 What is the value of ((-704)/1056)/((-1)/15)? 10 What is the value of ((-80)/(-100))/((-2)/4)(-5)/(-1)? -8 What is (18/21)/(12/96-12)? -4/7 What is the value of (-6)/9(-315)/(-35)? -6 Calculate (-36(-22)/2640)/((-24)/380). -19/4 Evaluate 154/(-231)(-3)/(-8). -1/4 (234/12)/((-66)/(-440)-5) -26 Evaluate ((-25)/40)/((-91)/728). 5 What is (149/(-6705))/((-2)/(-12))? -2/15 6/4(-40)/(-90)-9 -6 Calculate 12/(-1)(-28)/810/(-140). -3 Calculate (((-30)/10)/(20/12))/((-6)/(-40)). -12 ((1677/(-301))/(-13))/(6/14) 1 Calculate (-12)/(-30)(-1470)/(-308)11. 21 Evaluate (1(-1)/4)/((-2)/32-8). -1/2 What is the value of ((112/8)/(-14))/(7/(-133))? 19 What is the value of ((-4)/(16/30))/6-8? 10 ((-10)/(-45))/((-74)/(-999))(-9)/3 -9 Evaluate (6/4)/((-2049)/(-2732)). 2 Calculate 1/14((-21)/(-28))/((-39)/(-104)). 1/7 Evaluate ((165/9)/(-5))/((-2)/(-66)11). -11 Evaluate (-120)/(-240)4/(-2). -1 Evaluate ((-3)/(-6))/((-25)/25). -1/2 Calculate ((-59)/((-2360)/(-20)))/(22/32). -8/11 ((-1656)/(-230))/((-10)/(-25)) 18 (-200)/1201326/85 -26 3963/5284128/6 16 Calculate 63/(-6)(-54)/(-21). -27 (-3(-160)/48)/(10/(-12)) -12 Calculate (79/(-395))/(8/(-5)). 1/8 What is ((-1520)/6270(-1)/((-2)/3))/2? -2/11 What is the value of (-2)/(-2)(-15)/81-36? 10/3 What is 9/84(-26752)/1254? -16/7 What is (66/12)/(11/((-198)/9))? -11 Evaluate ((-15)/(-7))/(117/819). 15 Evaluate (40/(-190))/11/1. -4/19 Evaluate 84/245(-14)/4(-10)/42. 2/7 648/81(-2)/(-60)1 4/15 What is (((-9)/3)/(-15))/(32/(-80))? -1/2 What is (270/168)/(((-171)/(-456))/((-2)/(-4)))? 15/7 Calculate (-36)/(-10)4/1220/108. 2/9 Evaluate 2/(-6)(-2)/(-3)(-3348)/124. 6 What is the value of ((-3)/20)/(24/64)? -2/5 What is (-11)/113/(3/8)? -8 Calculate (92/(-2)2)/(40/10). -23 (-20)/2((-144)/(-63))/((-288)/(-252)) -20 Calculate 49/422(-24)/196. -2/7 What is the value of 34/(-51)((-312)/(-182))/(6/(-21))? 4 Evaluate (825/(-75))/((-1)/(-3)). -8 What is the value of (2/119)/(((-169)/13)/(-91))? 2/17 Evaluate (-1026/780)/((-4)/(2/(-1))). -1/6 Evaluate (12/435)/((-15)/(-25))3/(-2). -2/29 Calculate ((-133)/4)/(-140(-14)/(-2240)). 38 What is ((-15)/(-2))/345192/8070? 14 Evaluate ((-16)/3)/4((-79866)/544)/(-27). -29/4 (15/(-120))/((-14)/448) 4 What is (((-30)/(-70))/(2/(-21)))/((-264)/(-352))? -6 What is (60/21)/(170/(-595))? -10 What is the value of 48/13(4186/28)/23? 24 What is the value of 1(254/(-254))/((-2)/(-14))? -7 What is the value of ((-4)/(-24))/((((-24)/8)/(-3))/1)? 1/6 Calculate ((-2)/(-15)-6)/(8133/(-140)). 2/19 Evaluate 20/(-8)(-256)/(-40). -16 Calculate (-84)/150-5(-15)/(-36)3. 7/2 Calculate 108/(-3996)-4(-2)/4. -2/37 Calculate ((-28)/4)/(14/(-20)). 10 What is the value of (-2)/10(-62)/931650/(-40)? -11/2 0/(35/(-30)90/15) 0 Evaluate ((10/(-16))/((-55)/22))/(3/84). 7 What is the value of (76/16)/(-19)64/(-120)3? 2/5 What is the value of 297/(-1716)-13-22? -9 What is ((-49)/(-147))/(92/24)? 2/23 What is the value of 12/45(-280)/336? -2/9 Evaluate ((-2124)/3068)/((-12)/26). 3/2 Calculate 8/(192/45)(-1)/(12/(-8)). 5/4 What is the value of ((-4530)/(-302))/((-10)/(-16))? 24 63/271/((-1)/((-10)/(-35))) -2/3 (-1)/(-2)-4(-72)/(-24) -6 Evaluate ((-1742)/(-469))/(2/(-7)). -13 Evaluate (2/(-8))/((-34)/408)(-5)/1. -15 Evaluate ((-36)/42)/((-459)/(-714)). -4/3 What is the value of 45/(-36)(-24)/140-2? -3/7 Evaluate ((-2)/2)/1(-77)/((-7161)/62). -2/3 Evaluate 11/(506/552)5/(-3). -20 (-1)/7(-798)/384 12 What is 10/(-70)(-105)/3? 5 What is (10/(-18))/(((-756)/243)/(-28))? -5 (-2611/(-2860))/(12/(-12)) -3/5 1/(21/((-273)/(-26)))54 27 104/12(-171)/(-114) 13 What is the value of ((-1)/(19/1))/((-1944)/(-5832))? -3/19 What is (-28)/(-7)(306/(-12))/(-17)? 6 Evaluate ((-16)/(-6))/(161/(-483)). -8 What is the value of ((-20)/7)/(1/(-56)-16)? -10 What is the value of 7/((-33)/((-2376)/126))? 4 -2((-1)/(-4))/((987/462)/47) -11 What is the value of (1230/328)/(10/48)? 18 Evaluate (((-561)/12)/(-11))/(4/(-16)). -17 What is (-24)/3821090/(-1665)? 8 (-1)/(2150/22527/12) -2/43 (-8)/2(8075/(-304))/25 17/4 (4/(-39))/((-2536)/(-951)) -1/26 What is the value of ((-915)/1281)/((3/((-15)/5))/1)? 5/7 Evaluate (((-63)/(-14))/(-3))/((-966)/(-552)). -6/7 Evaluate 20/(-480)-406/(-5). -2 What is (-18)/1052(-4)/(80/70)? 6/5 (-636)/(-1378)(-1)/(-6) 1/13 What is the value of ((-155)/620)/(((-27)/240)/((-3)/(-4)))? 5/3 What is the value of (21/42)/(((-9)/(-3))/(-48))? -8 Evaluate (-30)/603/4(-96)/(-90). -2/5 Evaluate (6/(-4))/(((-14)/(-21))/(2/9)). -1/2 What is ((752/128)/47)/(-1)? -1/8 Evaluate -2(-52)/8-1. -13 (39(-5)/(-30))/(3/(6/1)) 13 1/(4/15)26/91-14 -15 (99/55)/(((-1)/(-40))/((-7)/42)) -12 (960/(-240))/((-4)/3) 3 (1(-12)/(-2142)6)/(12/(-14)) -2/51 What is the value of 31/((-2325)/(-2125))(84/(-10))/(-7)? 34 Evaluate (-14)/(168/(-90))4/1687. 5/4 What is (17629/7259)/(2/(-14))? -17 What is (-4)/(-52)-1(-18)/	{ "pile_set_name": "DM Mathematics" }
iple of 2 and c(-8). 16 What is the lowest common multiple of 22 and (60/9)/((-2)/(-6))? 220 Let r = -25/51 + -299/153. Suppose 4f - 76 = o, 2f - 2o = -3f + 92. What is the common denominator of r and 7 + -4 - (-28)/f? 45 Let v(y) = -3y2 + 2y*2 + 3y + 4 + 0y. Let u be v(4). Suppose 2r = -2, -3n + un + 25 = -r. What is the least common multiple of n and 2? 8 Let u = -15 - -11. Find the common denominator of (71/u)/(5/(-2)) and 101/12. 60 Find the common denominator of 5/(-20)2 - (-303)/54 and 4/11. 99 Let g = -8 + 22. Calculate the common denominator of -87/4 and ((-6)/20)/(1/g). 20 Suppose 0 = 2d + 5g + 26, d + 4g + 7 = 4d. Let k be (0 - (1 + d)) + 1. Let b = k + -1. Calculate the least common multiple of b and 10. 10 Let y(h) = -h2 + 11h - 15. Let n be -3 - (-4 - -2) - -10. Suppose a + 3a + 13 = 3j, 5a = j - 8. Calculate the lowest common multiple of j and y(n). 3 Let w = -12/59 + -837/236. Find the common denominator of 23/8 and w. 8 Suppose 0m - 5m = -285. What is the smallest common multiple of m and 3? 57 Suppose 5q + 0q - 40 = 0. Suppose 0f = -4f - 24. Calculate the common denominator of -13/5 and (86/f)/(q/12). 10 Suppose 0k = 3k - 9. Find the common denominator of 39/5 and k - (2 + 16/(-6)). 15 Suppose -10 = 4m + 5n + 74, -3m - 4n = 63. Find the common denominator of m/(-5)1/3 and -89/8. 40 Let z(d) = d*2 - d. Let a be z(2). Suppose -ah + 8 = -0h. What is the least common multiple of h and 3? 12 Suppose 6 = 5a - 49. Suppose 3s + 38 - a = 0. What is the smallest common multiple of (24/s)/((-2)/6) and 2? 8 Let h be (1/(-5))/((-14)/(-791155)). Let w be 0 - (-111295 + -2). Let d = w + h. Find the common denominator of d and -3/16. 112 Find the common denominator of 23/8 and 89/(-1 + (6 - 3)). 8 Find the common denominator of 513/24 + 1 and (-5)/354/(-16). 8 Calculate the common denominator of (236/10)/((-36)/(-30)) and -83/21. 21 Let c(u) = 5u2 - 3u - 6. What is the smallest common multiple of 12 and c(-2)? 60 Suppose -2 = 3f - 2f. Let l be ((0 - f)/(-2))/(-431). Let a = l + -22415/1293. Calculate the common denominator of a and 23/7. 21 Let v = -18795/2 + 10000. Suppose 4c = -3f - 1803 - 107, -4f - 2c - 2550 = 0. Let l = f + v. Find the common denominator of -53/14 and l. 14 Let t = 1279/12 + -338/3. Find the common denominator of -1/4 and t. 12 Suppose -2f = 3f - 25. What is the common denominator of -19/2 and f/15 - 831/36? 4 Let o = 34 - -8. Calculate the least common multiple of o and 21. 42 Let a = 56/101 + 3223/2020. What is the common denominator of -115/28 and a? 140 Calculate the common denominator of -2 + ((-1428)/64)/(-7) and (7/(-3))/((-24)/68). 144 Suppose -128 = a - 32. What is the common denominator of 1438/120 - 4/10 and -3 + 4/(a/76)? 12 Suppose 0a = 3a - 30. Let c be 9 + (-5 + 0 - -3). Suppose 0 - c = -y. What is the least common multiple of a and y? 70 Find the common denominator of 59/9 and 74/(-27)(-2)/(-4). 27 Let a = -43/3 + 38. Find the common denominator of a and -11/30. 30 Let p(q) be the second derivative of -q5/20 - 5q*4/6 - 11q3/6 - q2 + 4q. Let f = -1 + 3. What is the lowest common multiple of f and p(-9)? 16 Let u = -5 + 21. What is the least common multiple of (0 - 14/3)/(10/(-30)) and u? 112 Let z = -247463/18 + 13744. Calculate the common denominator of z and -125/18. 18 Let s = 839/154 + -100/11. Let i be 85195/(-24) - 2/(-3). Let r = -3558 - i. Find the common denominator of r and s. 56 Let b be (-8)/4 - 2/(-1). Suppose -5x - 1 + 11 = b. What is the common denominator of x + 373/(-6) and 101/6? 6 What is the common denominator of -42 and (-2 - 16/(-7))/(8/(-236))? 7 Let k = -22 - -37. Let x = 22 - k. Calculate the smallest common multiple of 2 and x. 14 Suppose 6d - 3d = -25380. Let j = d + 118501/14. Find the common denominator of j and -5/4. 28 Suppose -f + 2 = -0. Let o(l) = -7l - 48. Calculate the smallest common multiple of f and o(-7). 2 Let b be 4 + (-2 - 3/(-1)). Suppose -3w + 10 + b = 0. Calculate the lowest common multiple of w and 5. 5 Let a(z) be the second derivative of z3/6 + 3z*2 - 3z. What is the least common multiple of 8 and a(5)? 88 Let f be (862/(-274))/((-1224)/(-2248)). Let w be -1 + -2 + 41920/13974. Let v = f - w. Find the common denominator of 16/11 and v. 99 Let v(j) = -50j + 12. Let h be v(11). Calculate the common denominator of 17/18 and 7/(-28) + h/(-24). 18 Find the common denominator of 11/(-66) + (-290)/6 and 63/34. 34 Let k = 44495/18 + -2477. Let z = -1085135/99784 - 2/12473. Find the common denominator of z and k. 72 Let t = -3/1466 - -45479/16126. Calculate the common denominator of -1/4 and t. 44 Suppose 0 = 2t - 3t + 3. Let j = 4 - 1. Suppose 4c + 35 = 2u + tu, 14 = 2u + jc. Calculate the lowest common multiple of u and 5. 35 Suppose 3b + 13 = b + 5o, 4b - o = 1. What is the smallest common multiple of b(-4 + 2) - -22 and 14? 140 Let l be ((-4)/7)/((-18)/63). Suppose 2d = 6d - 16, li = 2d - 4. What is the lowest common multiple of i and 44? 44 Suppose -4 = q + 4h - 5, 5 = 5q + 4h. Let z(x) = -10x*3 - 1. Calculate the smallest common multiple of z(-1) and q. 9 Suppose -4 = -2u, 2u + 64 = 5p - u. What is the least common multiple of 80 and p? 560 Let v = -53347527/91 - -586248. Let l = v - 80/13. Calculate the common denominator of l and -47/5. 35 Let a = 1899/1352 - 5/169. What is the common denominator of 5210/1120 + 4/14 and a? 16 Let x = 6367/510 - -4/255. Find the common denominator of x and 13/6. 6 Find the common denominator of 1162/288 - (-12)/(-54) and 85/8. 16 Suppose 0 = 2q - 3w - 7, -5 + 19 = 2q + 4w. What is the lowest common multiple of 5/312/2 and q? 10 Let g = -59 - -68. What is the lowest common multiple of g and 9? 9 Let g(h) = h - 3. Let z be g(7). Suppose -5u + zu + 20 = 0. Calculate the smallest common multiple of 10 and u. 20 Suppose -f - 3b = b - 24, f - 4b + 8 = 0. What is the lowest common multiple of f and 6? 24 Let k = 61 + -56. Calculate the lowest common multiple of 4 and k. 20 Suppose -4b - 23 + 7 = 0. Calculate the common denominator of (-2)/6 - (-74)/b and ((-2)/(-8) + 1)790/25. 6 Calculate the smallest common multiple of 11 and (-1146)/(-57) - (-2)/(-19). 220 Let t = 3/4028 + -191339/12084. Let y be (-12 - -9) + (-1 - -1356). Let w = 5507/4 - y. What is the common denominator of w and t? 12 Suppose -4p + 8 = -0p. Find the common denominator of (-224)/121/p and 65/4. 12 Let s be (-5388)/(-7) - (-2)/7. What is the common denominator of 69/(-4) - (-1)/1 and (-3)/(-15)s/24? 12 Suppose 4h + 5i + 20 = -h, -4i = 3h + 15. Let d = h - -2. Calculate the lowest common multiple of d and (-1)/((-2)/(-1))-12. 6 Let f(g) = g*2 - 2. Calculate the smallest common multiple of 14 and f(4). 14 Suppose -4y - 94 - 38 = 0. Let q = -19 - y. Calculate the lowest common multiple of (-5 + 3)-1 - -4 and q. 42 Let w be -1(3 - (2 + 1)). Let d(s) = s*2 + 1. Let q be d(-1). Suppose -t + 1 = -2v + 9, -3v - qt + 5 = w. Calculate the lowest common multiple of 7 and v. 21 Let c(a) = a + 10. Let z be c(-7). Suppose 0 = 3w + 3m - 15, 0 = w - 6w - zm + 15. Suppose ws + 36 = 3s. What is the lowest common multiple of s and 1? 12 Let i(q) = 4q. Let h(o) = 7o. Let a(c) = 3h(c) - 5i(c). Let d = 11 + -7. Calculate the smallest common multiple of a(2) and d. 4 Suppose m + x = 1, 3m + 3x + x = 0. Let p = 33 + -18. Suppose 2h - md - p = 3h, -2d = 2h. What is the least common multiple of h and 7? 35 Let h = 19 - 17. Let u(r) = -7r3 + 1. What is the least common multiple of u(-1) and h? 8 Let l = -3329/186 - 91/31. What is the common denominator of -25/12 and l? 12 Let v = -1055924/11 + 95920. Let m = -10915837/22 + 496291. Let x = v + m. Calculate the common denominator of x and 1/22. 22 Suppose 36 = x + 3. Calculate the lowest common multiple of x and 24. 264 Let v(i) = -i3 + 2i2 - 1. Let k be v(1). Suppose -l = 3l - 44. Calculate the lowest common multiple of (-9)/4(-4 - k) and l. 99 Let b = 11078/5 - 2227. What is the common denominator of b and 63/8? 40 Suppose 30y = 19y + 99. Calculate the smallest common multiple of y and 6. 18 Let z(j) = 2j - 2. Suppose -26 = -7*n + 23. Calculate the least common multiple of z	{ "pile_set_name": "DM Mathematics" }
5. Let b be (-105)/(-10)6/k. Let y be (-3)/1 + (-196)/b. Solve -y = 4u + 3v, -2v + 5v = -2u - 17 for u. -4 Suppose 8 = t + t. Suppose 9g - 5g = 0. Let z be g/5-1 - -2. Solve d + o = -0 - 1, zd - o - t = 0 for d. 1 Let v(r) = 2r + 7. Let o be v(-5). Let y be (-1)/(o + 10/4). Suppose -2n = ym + 2, 2n - m = 5n - 3. Solve 3g + 23 = -2w - 2w, 0 = 4g + nw + 24 for g. -5 Suppose -4l + 3h + 4 = 0, -2l + 4h = 28 - 20. Solve l = 4f - 3d, 3f - 13 - 1 = 5d for f. -2 Let v(b) = -4b + 35. Let m be v(11). Let f be (9/(-6))/(m/24). Solve -21 = k - fh, -6 = -2h + 2 for k. -5 Let w = -8 - -12. Let a be 4 - ((-1 - -3) + -2)/(-1). Suppose af = 4y + 23 + 9, 12 = -3y. Solve fx + 6 = -2h, 5 = -x + w for h. -1 Suppose 3c = 12, -2d - 5 + 29 = 5c. Suppose dy = -y + 27. Suppose k + 4 = y. Solve 12 = -2q + n, -n + 2 = -2q - kn for q. -5 Let j be (2 + 1)(-16 - -17). Solve jr + 0 = -3p + 30, 0 = p + 2r - 15 for p. 5 Let d be 2/(-11) - ((-48)/66)/4. Solve 4n - 3p + 14 = d, 4n = -3p - 29 + 3 for n. -5 Let r = -7 - -7. Let h(a) = -5a + 4. Let k be h(r). Solve -2i = -y + 4y - 19, -ky + 14 = -3i for y. 5 Let b(o) = -2o3 - 4o*2 - o + 2. Let h be b(-2). Suppose 3n = 3x, -3n + h = -x - 0n. Solve xl + 16 = 4d, -l + 13 = -2l + 3d for l. 2 Let b = 7 + -2. Let c = 2432 - 2431. Solve n + 0n + c = 2h, -10 = -bh + 4n for h. -2 Let w be (1 + 3)/1 - (127 - 125). Solve -d + 8 = wl, -4l = -4d - l + 10 for d. 4 Let h(z) = -3z - 23. Let y(w) = 8w + 68. Let o(p) = 17h(p) + 6y(p). Let m be o(-5). Suppose 8c - m = 32. Solve -3t + 5l = -0t - 12, 3l = 2t - c for t. 4 Suppose -5v + 20 = 0, j - 6 = -v - 0. Suppose w - 7 = -4n + 22, jw = -4n + 30. Suppose 0 = -2u + 4u - 16. Solve 3g + u = d, -d - ng = -3g + 6 for d. 2 Suppose 5 = -4f + 13. Solve fw - 3w - 17 = 5g, 5 = -4w + g for w. -2 Suppose 21 = 113i - 106i. Suppose -5b + 20 = -90. Solve r + b = -4r - m, -m = -i for r. -5 Suppose 24 = 2c + 4. Suppose -c = -5l - 0. Suppose -2a + 15 = 5r, -r + 16 = 5a - la. Solve -j + r = -4, 3m + 2j - 13 = 0 for m. 1 Let q be (2/(-4))/((-1)/4). Let b be -3 - ((-2)/10 - (-10302)/85). Let z = -119 - b. Solve zn - x = qx - 17, -5x = -20 for n. -1 Let d = -63 - -27. Let g be (-96)/d + 12/6. Solve 0 = c - 2c + gn - 17, -4c + 5n = 33 for c. -2 Suppose 176q + 65 = 181q. Suppose -3z - 2w = -q, -3z + 14 = z + w. Solve 0 = -3v + 5t - 34, -v + 6v - zt + 30 = 0 for v. -3 Suppose -g = p + 4, 0 = 7p - 9p - g - 4. Suppose w - 2 = 4r - 7, p = -5r + 3w + 15. Solve 0 = -b - k + 1, 3b + b - 2k - 10 = r for b. 2 Let f be 78/130 + (-4)/(-10). Solve 0 = 4p + 4i - 4, 2p - i = -11 + f for p. -3 Let g(c) = -c3 + 5c2 + c - 3. Let f(b) = -b2 + b. Let u(m) = -3f(m) - g(m). Let t be u(3). Solve 2k - r - 13 = 0, tk - 3r = 4k - 11 for k. 5 Let q(y) = y - 2. Let i be q(8). Suppose ig + 0g - 30 = 0. Solve 3h = -2x - x + 21, -23 = -2x - gh for x. 4 Suppose -3o - 18k = -22k + 8, 2k - 4 = 0. Solve 0 = -5u - 4t - 6, -u + 3t - 5 = -o for u. -2 Let w = -86 + 91. Suppose 0 = -2m + 4, 3 = -wd + m + 21. Solve -3p - 10 + 31 = -dt, 5p - 3 = -4t for t. -3 Suppose 86 = 3t - 2d, -5d - 59 = -5t + 91. Solve -4a = -2k + t, 5a + 25 + 0 = k for k. 5 Let j = -642 - -645. Solve 0s = -4y - js + 6, 2y - 8 = -4s for y. 0 Let z = -50 - -99. Let i = z + -37. Let k(m) = 3m3 + m2 - m. Let c be k(1). Solve 0 = -5x + n - c, -x + 3x = -5n - i for x. -1 Let s(b) = b*3 - 8b*2 + 9b - 4. Let i be s(7). Suppose 10 = -8j + ij. Solve 0 = -4m - 5q, -jq - 6 + 21 = m for m. -5 Let p = -1046 - -1049. Solve -3u + 5f + 24 = 0, 5u - 3f - 21 = p for u. 3 Let v = -376 - -378. Solve 0 = 2l + n - 3n + v, 4l + n = -9 for l. -2 Let w = 2602 - 2585. Solve -2r + 3 - w = -5v, 0 = -3v + 2r + 6 for v. 4 Let k(w) be the first derivative of -w*2/2 + 19w - 11. Let f be k(16). Solve 3o + t + 0t = 7, -o + 19 = -ft for o. 4 Let y = 3 - 3. Solve y = 2u + 2z - 4, -5z + 6 = 1 for u. 1 Let y = 6 - -4. Let u be (y/(-6) + 2)6. Let g(i) = 6i*2 + 8i + 8. Let p be g(-2). Solve p = -4b, -4m - ub = -3m + 4 for m. 4 Let u be ((-5427)/207)/(-9) + (-4)/(-46). Suppose 6 - 21 = -z. Solve -o + 3c - 7c - 20 = 0, o - uc = z for o. 0 Let t(y) = 2y + 21. Let g(f) = -f*2 + 7f - 11. Let k be g(6). Let z be t(k). Solve i = 2v - z, -3v = -0i - 3i - 18 for i. -1 Suppose 0 = 5l - 10. Suppose -7p = -2p - li - 19, 0 = -4p + i + 14. Suppose 0d = 3d - 12. Solve -pq - dc = -q - 14, 3c = 15 for q. -3 Let g be 4 + -19 + 8 + 28. Solve 0 = -5j - m - g, 6m - 16 = 2m for j. -5 Let h(b) = b2 - 2b - 1. Let l be h(3). Let m be ((-1)/l + 0)/(-1)4. Solve 5w = 2v - 10, -3w - 2 = -0v - mv for w. -4 Let w = 9 + -29. Suppose -4x = h - 2, 5x + 4h - 2 = 6. Let l be w/(-15)(x + 3). Solve 11 = -v - ln, -3n + 5n - 17 = -5v for v. 5 Suppose -4k - 2z + 23 - 17 = 0, -k + z - 3 = 0. Solve k = -g + 3l - 2 + 1, 6 = 2g + 2l for g. 2 Suppose 5a - 18 - 7 = d, -2d - 22 = -3a. Solve -2t + 3t - 2 = -m, at = 5m - 28 for t. -2 Suppose 101u - 95u - 12 = 0. Solve -m - 16 = 5q, -5 = 3q - um - 2m for q. -3 Let v be (2 + -1)-1 + 3. Suppose -3m + 16 = -vo, -3o + 0o + 14 = 5m. Let j be (-2 + (-16)/(-6))(-45 - -51). Solve t - j = -my - 18, -y + 4 = 4t for y. -4 Suppose z - 10 = 2i, 0 = -16z + 14z - 3i - 8. Solve f = -0j + zj - 5, j - 20 = 4f for j. 0 Let b(w) = w*3 - 9w*2 - w + 5. Let y be b(9). Let o be 83 + y + -3. Solve 9 = -3v - 2q, 0q = 4v + q + o for v. -5 Suppose -2 = -5s + 9s - 5b, -4s = 2b - 12. Solve sm - y + 4 = -0y, 2y + 4 = 0 for m. -3 Let t be 35/(-2)(-82)/287 - -12. Let s be 2/(-3(-3)/18). Solve 16 = 3b + sj, -5j = 4b - 4j - t for b. 4 Let b(o) = -5o + 2. Let x(h) = h*3 + 6h*2 - 5h + 8. Let q be x(-7). Let u be b(q). Suppose -15 = 29i - ui. Solve 0 = -2m + 3 + 3, m + 22 = ir for r. 5 Suppose 5m = 4m + 5. Suppose 67g = 64g + 57. Solve g = -l + ma, l = -4a - 0a + 8 for l. -4 Suppose -4 = 2x - 5j, -2j = -3 - 1. Solve -5h + 35 = 2b - 7b, -5h + xb = -31 for h. 5 Let j = 1991 - 1991. Solve 0 = -4f - jf - 3r + 1, 5f = -5r - 5 for f. 4 Suppose -24v = -116 - 4. Solve -3k + 3 = -4r, 5k = 3r - 4r + v for r. 0 Suppose 111 = 4u - 4v + 87, -3u - 4v = -11. Solve 12 = -t + 5b, ut - 9t = b + 6 for t. -2 Let y be 7/(0 - 5/(-75)). Let d = 105 - y. Solve -3p - 3q - 3 = d, 4p - 2p - 2 = -4q for p. -3 Let n(t) = t*2 + t + 4. Let s be n(-3). Let b(q) = 3q*3 - 35q*2 - 13q + 17. Let v be b(12). Solve 0 = 2k - 2f, k = vk + f - s for k. 2 Let o be (-4)/(-28) + (-3960)/35. Let m = o + 117. Solve 2t + 2p - m = 0, -5p + 18 = t - 0t for t. -2 Suppose -2b = 10, -3m - 5b = -3b - 29. Suppose 6v + 13 = m. Solve 2a - 15 = -a + 3c, v = a + 5c + 19 for a. 1 Let p = 331 - 329. Solve -2j = z + p + 9, -2j = 4z + 14 for j. -5 Let z be 2(-1 + (-3 - -6)). Suppose l + 3g = 2l - 5, -2g = -z. Suppose -3w - 5n = 2, -2w - 5n + 3 = l. Solve 17 = 4p + t, p - wp + 28 = -t for p. 5 Let k = -1 - -3. Let s = 2 + k. Suppose -5d + 20 = 5p, 3d - 2p - 3p = -s. Solve -4i + 16 = -4m - 0, 0 = -dm + i - 9 for m. -5 Suppose 0v - 8 = 2v. Let i be v/2 + 21/3. Solve -iq = 2p - 5p - 2, 4 = 5p - q for p. 1 Suppose 2l - 21 = -o + 23, 5l = -2o + 111. Let k = l - 7. Suppose 14y + 8 = ky. Solve -2z + 5p - 2 = 0, 0 = yz + 3p + 2 + 2 for z. -1 Let i = -120 + 123. Suppose -6 - 9 = -ib - 3n, -5n + 25 = -4b. Solve 2 = -m + 2l, m - l + 3l - 2 = b for m. 0 Suppose 19j - 93 = -17. Let z be (2/(-3))/((-10)/45). Solve zq = 2m + 10, -2q = -7q - jm - 20 for q. 0 Suppose 6m - 26 = -7m. Solve -mq - 4t = 12, 3t + t = 4q for q. -2 Let a be (-3)/(-1) + (16 - 35) + 17. Solve -3k - a = -2d, -3k - 2 = -d - 0k for d. -1 Let s = 9 + -17. Let t = 5 + s. Let x = t + 5. Solve 0 = u + 3k - 3, 5u - xk - 17 + 2 = 0 for u. 3 Suppose 141 = g - 2m + 3m, -m = 3. Let x = 147 - g. Solve 5n + 11 = -3r, -xr + 8 = -1 for n. -4 Suppose -193z + 197z - 172 = 0. Suppose -4d = -0c + 3c - z, 0 = -5c - 2d + 67. Suppose 0 = o - 5 - 0. Solve -ov = 3h + 36 - c, -13 = 5h + 2v for h. -1 Let d = -906 + 910. Let g(s) = -3*s	{ "pile_set_name": "DM Mathematics" }
is the tens digit of a? 3 Suppose a = -a + 480. Suppose 2x - 41 = 9. Suppose -4y + 310 = 2h, 5h + a + x = 3y. What is the tens digit of y? 8 What is the tens digit of (17/5)/((-6)/(-30180))? 0 Let h(v) = -v3 + v2 + 2v + 486. Let p be h(0). Suppose 3u - 21 - p = 0. What is the units digit of u? 9 Let a(i) = -i2 - 10i + 12. Let o be a(-11). Let w be (1 + o)/((-11)/(-22)). Suppose -10c + wc = -468. What is the tens digit of c? 7 Let s = -89 - -91. Suppose 640 = 3i + sz - 0z, 4z - 638 = -3i. What is the units digit of i? 4 Let l = -230 - -250. What is the units digit of ((-456)/l)/((-24)/540)? 3 Let y = 10610 - 5106. What is the units digit of y? 4 Let w(t) = -3t*2 + 18t - 47t + t3 - 3 - 4 + 22t. Let h be w(5). What is the units digit of 154/h - (-3)/(-12)? 9 Let q(z) be the first derivative of -25z2/2 - 49z - 14. What is the hundreds digit of q(-43)? 0 Let b = 79703 + -11734. What is the ten thousands digit of b? 6 Let x = 339 - 339. Suppose -b = -4, x = -4h - 5b + 1624 + 156. What is the units digit of h? 0 Suppose 9j + 4x = 4j - 380, 2x + 310 = -4j. Let r = 210 + j. What is the units digit of r? 0 Let g(m) = -154m + 3. Let q(r) = 2r + 19. Let f be q(-10). What is the hundreds digit of g(f)? 1 Suppose 0 = -4h + 3l + 15, l = -8h + 3h - 5. Suppose -9k + 11k - 734 = h. What is the units digit of k? 7 Let n(x) = 41x*2 - 14x - 14. Suppose 9j - 20j - 22 = 0. What is the tens digit of n(j)? 7 Suppose -1 = -4b + 11. What is the hundreds digit of b/(-6) - 1875/(-6)? 3 Suppose 50f - 8759 = 40f + 25391. What is the hundreds digit of f? 4 Let i(j) = -j2 + 35j - 97. Let f be i(3). What is the units digit of (-451 + (4 - f))/(-1)? 6 Let l = 6 - 4. Let z(t) = 11t2 + 6t + 2. Let q(p) = 3p. Let o(n) = -3q(n) + z(n). What is the tens digit of o(l)? 4 Let n(w) = w*2 + 17w - 26. Let r be n(-20). Suppose 0 = 5i + r - 439. What is the units digit of i? 1 What is the ten thousands digit of (600/16)/75 + 23141/2? 1 Let v = 1238 - 685. Let z = v - -290. What is the tens digit of z? 4 Let w(d) = -d3 - d2 + 6d + 5. Let z = 22 - 25. Let r be w(z). What is the units digit of 3/(-15) + 891/r? 8 Let x(z) = 7z3 + 59z*2 + 64z - 199. Let i(k) = 4k3 + 30k*2 + 33k - 100. Let g(d) = -5i(d) + 3x(d). What is the hundreds digit of g(-25)? 4 Let j(q) = 49q + 9748. What is the hundreds digit of j(29)? 1 Suppose -127j = -20j - 1287852. What is the thousands digit of j? 2 Let k(y) = y3 + 27y*2 - 19y - 77. Let o be k(-13). Suppose 2s + o = 2g, 4g - s - 5120 = -57. What is the hundreds digit of g? 2 Let y(x) = -x2 - 13x + 66. Let r(w) = -2w2 - 26w + 132. Let g(o) = -3r(o) + 5y(o). What is the units digit of g(-21)? 2 Let r = -2821 + 4388. What is the units digit of r? 7 Let i(h) be the third derivative of -h*5/30 + 5h*4/6 - 7h*3/2 + 3h*2 - 5. What is the units digit of i(8)? 1 Suppose 21c + 4278 = 20c + 5g, 8563 = -2c + 3g. Let n = -2898 - c. What is the thousands digit of n? 1 Let z = 1023 - 269. What is the hundreds digit of z? 7 Let n = 14591 - 5328. What is the thousands digit of n? 9 Let i(n) = -2n3 + 46n*2 + 3n - 8. What is the hundreds digit of i(7)? 5 Let k = -413 - -650. What is the hundreds digit of k? 2 Suppose 171h - 24 = 179h. What is the units digit of ((-1)/2 - 1)134/h? 7 Suppose -s - 8n + 25554 = 7751, 5n = -4s + 71023. What is the thousands digit of s? 7 Let h be ((-4)/8)/(31/204). Let y(z) = z2 + 14z + 32. What is the hundreds digit of y(h)? 7 Let d(n) = 39n3 - 8n*2 - 82n + 598. What is the ten thousands digit of d(7)? 1 Let v(m) = -8m - 102. Let l be v(-13). What is the units digit of (-6 - -289) + -2 + l? 3 Suppose 49w - 47971 = 38w. What is the thousands digit of w? 4 Suppose -5i - 15 - 10 = 0. Let a(p) = -42p + 49. What is the hundreds digit of a(i)? 2 Let v = 31 + -22. Suppose -vt + 615 = -1068. Let i = -25 + t. What is the hundreds digit of i? 1 Suppose -12g = -11g - 1, -11 = 4s - 3g. What is the hundreds digit of 151 + s + 3 + (-5 - -6)? 1 Let m = -42 - -75. Suppose 5t - 2f = -140, 5t = -3f - 107 - m. Let w = 2 - t. What is the tens digit of w? 3 Let q(y) = 3y2 - 39y + 458. What is the units digit of q(34)? 0 Let b(r) = -3r + 4r + r*2 + 264 - 292. What is the tens digit of b(-7)? 1 Suppose 5h = -4h + 18. Let s be (-54/(-60))/(h/24). Suppose -x + 237 = sx - 2u, 0 = 2x + 2u - 92. What is the units digit of x? 7 Let n(l) = l*2 - 23l + 84. Let u be n(19). Let b(z) be the second derivative of z*5/20 - 2z*4/3 + 3z3/2 - z2/2 - z. What is the tens digit of b(u)? 7 What is the hundreds digit of 2(-36158)/(-8) + ((-407)/22)/37? 0 Suppose 5n + 5g = 13847 + 66368, 3g + 16019 = n. What is the tens digit of n? 3 Let c = 59189 - 41010. What is the ten thousands digit of c? 1 Let q be 4 + 22/(-4). Suppose -29g + 30g = q. Suppose 2r - 4v - v - 428 = 0, gr + 3v = 642. What is the hundreds digit of r? 2 Let r = -56377 - -88497. What is the units digit of r? 0 Suppose -15i - 25800 = 19i - 42i. What is the hundreds digit of i? 2 Suppose -u = 3n - 83, -3u + 231 = -4n + 47. Let g = -15 + u. What is the units digit of g? 3 Let x = 70 + -75. Let k be -12/x + 83/5. Suppose 10w - kw = -651. What is the tens digit of w? 9 Let h(v) = v3 - v2 - 24v + 25. Let p be h(10). Let a = -266 + p. What is the hundreds digit of a? 4 What is the tens digit of (-8)/(-18) + -5(-25518)/270? 7 Suppose 0 = 3r - 8r - 25, 4f = -2r - 50. Let b = -3 - f. Suppose 0w - bw = -175. What is the tens digit of w? 2 Let c = 81272 - 44555. What is the thousands digit of c? 6 Suppose -29 + 14 = -3h. Suppose 67 = -f + 5s - 82, -hs = -2f - 318. Let c = 345 + f. What is the units digit of c? 6 Let d = 28 + -24. Let h be (-7 - -9)/((-1)/d). Let r(z) = z*3 + 9z*2 + 4z + 2. What is the units digit of r(h)? 4 What is the tens digit of (-4 + 664/(-12))-30? 8 Let x = 11457 - 469. What is the ten thousands digit of x? 1 Let l be 8/((-32)/(-9836)) + (-5)/1. Suppose 2g = 5g - 9, -3d + l = g. What is the hundreds digit of d? 8 Let l be 4(7 - (3 + 1)). Suppose -5g = 16f - lf - 2257, -2f + 1148 = -4g. What is the hundreds digit of f? 5 Suppose -25 = -3b + 5n, 5b + 5n = -14 - 11. Suppose b = -4r + 6r - 618. What is the tens digit of r? 0 Let g be (-8)/66/(-4). What is the units digit of (g + (-42)/9)(-1218)/8? 6 Suppose -3q - 12h + 12965 = -7h, -q + h + 4311 = 0. What is the thousands digit of q? 4 What is the hundreds digit of ((-4)/5 + (-24084)/180)-15? 0 Let z = -16039 - -30233. What is the thousands digit of z? 4 Suppose 0 = d - 3m - 31463, 4d - d = -5m + 94473. What is the units digit of d? 1 Suppose 0 + 128 = 4y. Suppose 5j = 3 + y. Let s = j + 4. What is the tens digit of s? 1 Let y be -8 + -446 + -10 + 2. Let d be (-3 + 2)(181 - 0). Let x = d - y. What is the tens digit of x? 8 Let x(h) be the second derivative of -31h4/12 + h3/3 - h2 - 6h. Let a be x(1). What is the units digit of 2 + (-5 - -3) - a? 1 Suppose 143b + 49150 = 153b. What is the hundreds digit of b? 9 Let u = -37546 + 54246. What is the tens digit of u? 0 What is the tens digit of 8/(-14)(-71065 - -120)? 4 Let g = 22023 - 8951. What is the ten thousands digit of g? 1 Let v = 6903 - 3593. What is the thousands digit of v? 3 Let y(h) = h3 - 13h*2 - 23h - 12. Let q be y(23). Let w = q - 3307. Suppose 428 + w = 10j. What is the tens digit of j? 8 Suppose s + 997 = 2x, 4x - x = 3. Let t = s + 1112. What is the hundreds digit of t? 1 Let l(n) = -32n*3 - 61n*2 - 16n + 23. What is the tens digit of l(-9)? 5 Suppose -4j = -9j + 375. Let k = j + 14. Suppose 2p = 25 + k. What is the tens digit of p? 5 Let m be 226/8 + 19/(-76). Suppose m = 4o + 96. Let a(n) = 2n2 + 25n + 10. What is the tens digit of a(o)? 6 Suppose -8v + 162 = 18. Let d be 3/v34 + 2/6. Suppose -100 = -dc + 116. What is the units digit of c? 6 Let s = 3318 + -2986. What is the units digit of s? 2 Let x(w) = 5w*2 + 4w*2 + 10w*2 + 3 - 22w*2 - w + 107w*3. What is the tens digit of x(1)? 0 Let x be (-4)/6 + (-957)/(-99). Suppose -4y + 3c + 1156 = 0, xc - 12c = 3y - 867. What is the units digit of y? 9 Suppose 0 = r - 4*g +	{ "pile_set_name": "DM Mathematics" }
ve of 0k3 + 0 - 2k + 1/126k7 + 0k*2 - 1/30k*6 + 0k*5 + 1/9k4. Factor y(x). x2(x - 2)2(x + 1)/3 Let y(k) be the first derivative of -k5/25 + k4/20 + 3. Determine f, given that y(f) = 0. 0, 1 Factor 9/5y4 + 9/5y*3 + 0y + 3/5y5 + 0 + 3/5y*2. 3y*2(y + 1)3/5 Let j(v) = -v2 - v + 1. Let u(n) = 5n2 + 5n - 2. Let s = -16 - -18. Let c(y) = sj(y) + u(y). Factor c(a). 3a(a + 1) Let f be 26/8 + (-7)/28. Let -fu*2 + 9u + 6 + 4u2 - 3u*2 + 5u*2 = 0. Calculate u. -2, -1 Let u be (((-14)/(-1))/(-2))/(-1). Let d be u/14 + (-77)/(-6). Let 16/3v*3 + 17/3v - 2/3 - dv2 = 0. Calculate v. 1/4, 2 Let u(a) be the second derivative of 0a*2 + 1/135a*6 - 6a + 0 + 0a4 + 1/90a*5 + 0a*3. Factor u(p). 2p*3(p + 1)/9 Solve -109y + 59y + y*2 + 54y = 0. -4, 0 Let r be 6/(-4)12/(-54). Let j(c) be the first derivative of -rc*3 - 1/4c*4 + 1/10c*5 + 1/4c*2 + 1/2c + 1/12c6 - 2. Factor j(s). (s - 1)2(s + 1)*3/2 Factor 15q - 3q - 5q2 + q2. -4q(q - 3) Let u = -4 + 6. Let t(o) be the second derivative of 1/6ou - 1/126o*7 + 0 - 5/18o*3 - 1/6o*5 + o + 5/18o*4 + 1/18o6. Factor t(c). -(c - 1)5/3 Let i(m) be the first derivative of m*4/22 + 2m*3/33 - 2m*2/11 - 3. Factor i(l). 2l(l - 1)(l + 2)/11 Let z = -1 + 5. Factor -3t3 + 5t*3 + 2tz + t4 - 3t2 - 6t + 4t3. 3t(t - 1)(t + 1)(t + 2) Let t(a) = 5a*2 - 24a + 39. Let g(x) = 10x2 - 47x + 77. Let w(y) = 6g(y) - 13t(y). Suppose w(f) = 0. Calculate f. 3 Let y(z) be the first derivative of z3/3 - z2/2 - 2z - 9. Factor y(x). (x - 2)(x + 1) Let n(m) be the third derivative of -m*5/150 - 3m*2. Factor n(t). -2t*2/5 Let f(o) = 2o*2 - 3o. Let s be f(2). Find d such that 0 + 0d + 2/3d*4 - 4/3d*3 + 2/3d*s = 0. 0, 1 Let f(n) be the third derivative of 0n*3 - 2/5n*4 + 8n*2 + 0n - 1/200n6 + 0 + 2/25n*5. Factor f(y). -3y(y - 4)2/5 Suppose 1/2q*2 + 0q - 1/2 = 0. Calculate q. -1, 1 Let m(u) = u*3 + u. Let v(y) = -12y*3 - 10y. Suppose 0 = z + 4z + 10. Let o be (1 - -1)/(z/(-2)). Let j(k) = ov(k) + 22m(k). Factor j(x). -2x(x - 1)(x + 1) Let b(u) be the third derivative of u6/360 - u5/45 + 5u4/72 - u3/9 + u2. What is q in b(q) = 0? 1, 2 Let u be (-11)/(-4) - (-6)/24. Let a(s) be the first derivative of -1/6s*4 - 1/3s + 2 - 2/3s2 - 5/9su. Find b, given that a(b) = 0. -1, -1/2 Let o(s) be the third derivative of s6/180 - s5/30 + s4/12 + s*3/2 + 4s*2. Let k(h) be the first derivative of o(h). Determine r so that k(r) = 0. 1 Factor 10z*2 + 5z*4 - 5z*3 - 9z2 - z4. z*2(z - 1)(4z - 1) Let r(t) = -t - 6. Let u(w) = 2w - 2. Let m be u(-3). Let v be r(m). Factor -4 - 10c - 2c3 - 3c*2 + 0 - 5c*v. -2(c + 1)*2(c + 2) Let s(g) = -g3 - g2 + g - 1. Let w(o) = 7o3 - o2 - 7o + 19. Let y(c) = -18s(c) - 2w(c). Factor y(u). 4(u - 1)(u + 1)(u + 5) Suppose 0 = 2v + 2v. Suppose -5 + v = -x. Solve -4b*2 + xb*4 - 4b*4 - 2 - 3b*4 + 8b2 = 0. -1, 1 Factor -t4 + 4t - 5t*4 - 4t*3 + 4t*4 + 2 + 0t*4. -2(t - 1)(t + 1)3 Factor 5i + 0 - 5/2i2. -5i(i - 2)/2 Factor 3f*4 - 7f*2 - 7f*2 + 11f*2 - 3f + 3f3. 3f(f - 1)(f + 1)2 Let y(o) be the first derivative of o3/3 + o*2/3 - o/3 + 2. Factor y(r). (r + 1)(3r - 1)/3 Let t(s) = -4s*5 - 2s*2 - 2s - 2. Let g(y) = 9y5 + y4 + y3 + 4y*2 + 5y + 5. Let q(z) = 2g(z) + 5t(z). Solve q(i) = 0 for i. -1, 0, 1 Let l be (-3 - -3)/21. Let r be (-16)/(-168)(-28)/(-6). Factor 2/9u2 + 0 - ru*3 + 2/9u*4 + lu. 2u2(u - 1)*2/9 Let b be (-4 - 24/(-6))/(3 + -1). Suppose -1/3o*3 + 1/3o*2 + 0o + b = 0. What is o? 0, 1 Let k(p) be the third derivative of p6/90 - p5/45 - p*4/18 + 2p*3/9 + 5p*2. Find t, given that k(t) = 0. -1, 1 Let i(x) = -2x*5 - 2x*4 - 22x*3 - 22x2 - 6. Let p(q) = q5 + 3q4 + 23q*3 + 21q*2 + 5. Let c(t) = 5i(t) + 6p(t). Find m, given that c(m) = 0. -1, 0, 4 Let f(t) be the third derivative of t2 - 1/120t*5 - 1/720t*6 - 1/3t*3 - 1/48t*4 + 0 + 0t. Let v(y) be the first derivative of f(y). Factor v(i). -(i + 1)*2/2 Suppose -78 = -12m - m. Factor -mu3 + 9/2u + 3/2 + 0u2. -3(u - 1)(2u + 1)2/2 Let i(f) = f4 - f3 - f2 - f - 1. Let k(r) = 3r5 + 3r + 3. Let x(z) = 3i(z) + k(z). Factor x(d). 3d*2(d - 1)(d + 1)2 Suppose -106z + 35z + 213 = 0. What is i in 2/5i + 8/5 + 6/5i4 - 14/5i*2 - 2/5i*z = 0? -1, 1, 4/3 Let l = 11 - 9. Let g(b) be the second derivative of -lb + 0b2 + 1/30b*4 - 1/50b*5 + 0b*3 + 0. Factor g(r). -2r*2(r - 1)/5 Let f(m) be the first derivative of -m6/1980 - m5/330 - m*4/132 - 5m*3/3 - 5. Let i(l) be the third derivative of f(l). Factor i(t). -2(t + 1)2/11 Let q(p) be the first derivative of p5/80 - p*4/12 + 5p3/24 - p2/4 - 2p - 3. Let a(l) be the first derivative of q(l). Suppose a(r) = 0. What is r? 1, 2 Let r = -189 + 191. Determine f, given that 9/2 - 6f + 3/2fr = 0. 1, 3 Let j(k) be the third derivative of k6/480 + 7k5/240 + k4/12 - 2k3/3 - 59k*2. Factor j(g). (g - 1)(g + 4)*2/4 Let c(d) be the second derivative of -1/15d*4 + 0 - 1/15d*3 + 0d*2 - 1/50d*5 + 3d. Factor c(b). -2b(b + 1)2/5 Let v(l) = -l2 + 2l + 1. Let u(t) = -t2 + 3t + 1. Let a(j) = 2u(j) - 3v(j). Solve a(r) = 0. -1, 1 Let c be (1/3)/((-3)/(-36)). Let a(m) = cm - 3 - 4m*3 - 2m*2 + 7 + 1 + 6m2. Let u(o) = -o3 + 1. Let w(z) = -a(z) + 5u(z). What is h in w(h) = 0? -2, 0 Factor -3q + 1 + 3q2 + 3q*3 - 3q*4 - 1 + 0. -3q(q - 1)2(q + 1) Suppose 34r - 12 = 30r. Determine u, given that 2u + 1/2u*r + 2u2 + 0 = 0. -2, 0 Let t(j) = -j3 - 6j2 - j - 3. Let h be t(-6). What is r in 1/3r*2 + 0 - 1/3r5 - rh + r*4 + 0r = 0? 0, 1 Let y = -788 + 790. Factor 0 + 0j + 0j*y + 2/5j*3 - 1/5j4. -j3(j - 2)/5 Let r(k) = 2k*3 + 4k*2 - 2k - 4. Let b be r(-2). Find m, given that 2/7m + 0 - 4/7m*2 + 4/7m*4 + bm*3 - 2/7m*5 = 0. -1, 0, 1 Suppose 5m + 3i - 143 + 56 = 0, -1 = m - 4i. Suppose -m = -9l + 4l. Suppose -1/4j4 + 0 - 1/2j*l - 1/4j*2 + 0j = 0. Calculate j. -1, 0 Let v(l) = -12l3 + 2l - 10. Let a(u) = 6u3 + 1. Let s(z) = -z3. Let p(m) = a(m) + 5s(m). Let j(r) = 10p(r) + v(r). What is d in j(d) = 0? -1, 0, 1 Factor -5 - 7i + 4i2 + 16i - 7i2 - 1. -3(i - 2)(i - 1) Let j(z) be the first derivative of 2z*6/27 - 2z5/15 + z4/18 + 9. Factor j(y). 2y3(y - 1)(2y - 1)/9 Let i(v) be the third derivative of -1/3v3 + 1/60v*5 - 1/24v*4 + 0v - 4v2 + 0. Factor i(n). (n - 2)(n + 1) Let d(w) be the first derivative of -w6/600 + w5/100 - w4/40 + w3/3 - 4. Let l(g) be the third derivative of d(g). Suppose l(a) = 0. What is a? 1 Let h(n) be the third derivative of -n9/37800 + n8/8400 - n7/6300 + n4/6 + 3n2. Let c(i) be the second derivative of h(i). Factor c(l). -2l*2(l - 1)*2/5 Let j(g) be the second derivative of -1/3g*3 + 0 + 0g*2 + 1/5g*5 + 1/6g*4 - g. Factor j(h). 2h(h + 1)(2h - 1) Suppose 4g - 2g + 4 = 0. Let b be (10/(-4))/(g - 0). Suppose 0 - 3/4p*4 - 1/4p + bp3 - p5 + 3/4p*2 = 0. Calculate p. -1, 0, 1/4, 1 Let h(x) be the first derivative of 3x4/20 - x3 + 9x2/10 + 27x/5 - 12. Factor h(g). 3(g - 3)2(g + 1)/5 Factor 9/4n - 1 - 3/2n*2 + 1/4n*3. (n - 4)(n - 1)2/4 Let h(g) be the first derivative of -g8/84 - 4g7/105 - g6/30 - g2 - 2. Let m(o) be the second derivative of h(o). Factor m(l). -4l*3(l + 1)*2 Factor 0 + 1/4v*3 - 1/2v - 1/4v2. v(v - 2)(v + 1)/4 Let v(o) be the third derivative of -o7/210 - 6o2. Factor v(p). -p4 Let o(k) be the second derivative of k9/68040 + k8/10080 + k7/3780 + k6/3240 - 5k4/12 + 6k. Let p(c) be the third derivative of o(c). Factor p(h). 2h(h + 1)3/9 Let u(n) = -n2 - 40n + 200. Let v(j) = 6j*2 + 200j - 1000. Let x(g) = 16u(g) + 3v(g). Factor x(i). 2(i - 10)2 Let t(y) = 5y*5 + 12y*4 - 17y*3 - 17y*2 + 5y + 12. Let d(u) = -3u5 - 8u*4 + 11u*3 + 11u*2 - 3u - 8. Let m(z) = -7d(z) - 5t(z). Factor m(w). -4(w - 1)2(w + 1)**3 L	{ "pile_set_name": "DM Mathematics" }
c - w - 16. Suppose 4k - 15 = 3q, -4q - c = k - 3k. Solve kj - 7 = 2 for j. 3 Suppose y - 6y = 0. Suppose -3a + 164 = 4b, yb - 232 = -4a - 2b. Let h = a - 56. Solve -hq - 2 - 6 = 0 for q. -2 Let w = -37 + 42. Suppose 0l - l + 11 = 3g, -21 = -2l - wg. Let x be 15/((-12)/l + 3). Solve b - x = -b for b. 5 Let m = -286 + 288. Suppose -4x + 23 = -3s + 4s, ms - 5x = -19. Solve 18 = -3y + s for y. -5 Let c = -1765 - -1886. Solve 4g = -133 + c for g. -3 Let o = 27 + -10. Let q(f) = -f2 + 18f - 15. Let r be q(o). Suppose -3p + 44 = 5t, -4t + 3t - 4p + r = 0. Solve 4g + t = 26 for g. 4 Let s = -19624 - -19714. Solve sw = -75 + 525 for w. 5 Suppose -3i = -3o - 11 - 52, 4i - 36 = o. Let a be (-174)/464 + (-70)/o. Let n(j) = j*3 + 3j*2 - 3j + 1. Let s be n(-3). Solve -2f - a + s = 0 for f. 3 Let j be (-125)/150 - 2/12. Let d be (-3 - 44/(-4)) + -3 + j. Solve 0 = -4w + 5w - d for w. 4 Suppose -a + 2 = -0a. Let g(d) = 56d + 504. Let y be g(-9). Solve y = -aw - 8 + 2 for w. -3 Let a be (-82)/(-123) - (-2)/(-3) - -267. Solve -ap = -269p + 4 for p. 2 Let q be (-3)/6(-6 - -2). Let i be 3 + 6 - -1 - (-6 - (-7 + -1)). Solve 10y - q - i = 0 for y. 1 Let j(y) = y*2 + 8y + 19. Let g be j(-5). Suppose -692 = 7q - 797. Solve gn = 9n + q for n. -3 Suppose -15b - 105 + 1305 = 0. Solve 219 + 101 = bx for x. 4 Let c(x) = -4x - 12x2 + 1 + 7x + 9x + 13x*2. Let p be c(-12). Let n be (-9)/((-36)/32)p. Solve n = -s - 3s for s. -2 Let r = 24 - 27. Let y be (-44)/(-2) + (1 + -1)/r. Suppose 0 = -2h + y - 6. Solve -f + h = 3f for f. 2 Let v = -26 + 20. Let x = v + 10. Suppose -xp + 78 = 2p. Solve -5w - 7 = p for w. -4 Let x = -87 + -211. Let s = -266 - x. Solve 7j = -j + s for j. 4 Suppose 5x - 2n + 6 = -0, 2x + n = 3. Suppose -2c = -4r + 40 + 16, 0 = -3r. Let a = -25 - c. Solve x = -ak - 0k + 6 for k. 2 Let y be (4/5)/((-2)/(-10)). Suppose -4b - 13 + 13 = 0. Let z be 4(27/(-6))/(-6 - b). Solve -ys = 1 + z for s. -1 Let d be (-10 + 4)1/(8/(-12)). Solve -du - 19 = 17 for u. -4 Let m be -1 + 1 + (-26 - -11). Let i be 2/(-5) + (-2 - 936/m). Let c = i - 60. Solve t - 3t + 6 = c for t. 3 Suppose 30 = 5r + 10r. Suppose -7a - r = -30. Solve 3 = -ak + 5k for k. 3 Let j = 106 - 70. Let a = -36 + j. Suppose a = -5o + 3o + 4r - 8, -5r = -10. Solve o = -4f + 7 + 1 for f. 2 Let z(l) = l2 - 14l - 15. Let p be z(15). Let j be (p - -8) + 0/9. Suppose 5t = -5d + 10, j = 5t - 2d + 6d. Solve t = -b + 7 - 3 for b. 4 Suppose 4l + s - 708 = 0, -562 = -5l + 4s + 302. Solve l = -10d + 126 for d. -5 Let s be 30/12 + 855/114. Solve -42 + 32 = sd for d. -1 Let m be 12/(-20) + 0 + (-2140)/(-25). Suppose 7o = -10o + m. Solve -8 = ok - 18 for k. 2 Let r be -10-2((-24)/(-3) + -7). Solve 5t + r = 9t for t. 5 Let y be 360/10 + (2 - 0). Solve -26j - 12 = -yj for j. 1 Let y = -2157 - -2157. Solve 12v - 18 - 42 = y for v. 5 Let o(x) = -x*3 + 16x*2 - 27x - 9. Let m be o(14). Let h be (10/(-8))/((-4)/96). Let a be (-40)/66/(-4). Solve -mw = a - h for w. 4 Let x be (011/55)/2. Solve x = 91d - 100d + 27 for d. 3 Suppose -2r = -4r + 4. Suppose 4h = 2w + 10, -5w + 26 = 5h - 3w. Let s(u) = -u*3 + 5u*2 - 4u. Let x be s(h). Solve c + 3 - r = x for c. -1 Suppose t - 60 + 47 = -5o, -3o = -5t + 233. Solve -tu + 424 = 123 for u. 7 Let p be (30/9)/(-5(-3)/315). Let q be (-14)/(-4)120/p. Solve 9 = -15s + qs for s. -1 Let d(j) = -5j - 4j + 3j + 10j - 38. Let s be d(10). Let c(n) = -3n + 3. Let p be c(-3). Solve -5q + sq + p = 0 for q. 4 Suppose -212301r + 6524 = -212287r. Solve -448z + 72 = -rz for z. -4 Suppose -4p - 153 = 5d, 3p - 2d = 3d - 141. Let m = -39 - p. Solve 4q = mq - 3 for q. -3 Let z = -5211 + 5259. Solve 6y = -2y + z for y. 6 Let i = 130 + -127. Suppose 2j + x = 4j - 3, -3x + i = 0. Solve -l = -jl - 5 for l. -5 Let c be 1/(2 - (-738)/(-147) - -3). Let f = c - -49. Suppose 0 = 3b - fb - 3. Solve -v = -b - 1 for v. 2 Let z(u) = u*2 - 3u - 1. Let m be z(4). Suppose -4h - 14 = -11h. Solve -hl = ml for l. 0 Suppose -6d = -5d - 5m - 13, -2d = 4m + 16. Let s be (-4)/6(-9)/d + 10. Solve 21 + 7 = -sr for r. -4 Let u(x) = x + 10. Let s be u(0). Let c(k) be the first derivative of -k3/3 + 4k*2 + 20k + 329. Let n be c(s). Solve -1 = -f - nf for f. 1 Suppose 0 = w + 4w - 100. Suppose 14b = 19b - w. Solve -5 = 5y - by for y. -5 Let g(j) = 11j2 + 16j + 22. Let r(f) = 9f2 + 9f + 24. Let k(n) = 4g(n) - 5r(n). Let m = 2 + 15. Let y be k(m). Solve 0 = 3z + 1 + y for z. -1 Let c(a) = 2a*3 - 16a*2 + 137a - 1094. Let k be c(8). Solve -4p + 2p = -k for p. 1 Let g be (-12)/(576/(-176))12. Solve -112 - 64 = gh for h. -4 Let o = 962 - 947. Solve o = 205q - 210q for q. -3 Let i(w) = -w*3 + 3w*2 + 64w - 39. Let z be i(-7). Solve -639 + 636 = zv for v. -1 Suppose 5y = -2t + 19 + 2, 3y = -2t + 15. Suppose 0 = -6d + 11 + 13. Solve yc - dc = -1 for c. 1 Suppose 29j + 43j - 7830 = 18j. Solve 32m - 3m = j for m. 5 Let o = 773 - 767. Solve -oy - 189 + 213 = 0 for y. 4 Let y(f) = 7f + 97. Suppose 5q = -94 + 34. Let m be y(q). Solve mg = 12g for g. 0 Suppose 8d = 46 + 90. Suppose -77 = -dc + 10c. Solve 0 = -9l + cl + 10 for l. -5 Let y(b) = -37b + 1492. Let j be y(37). Solve -109x = -jx + 42 for x. 3 Suppose -h + 42 + 23 = 3x, 4h - 2x - 204 = 0. Solve hf = 44f for f. 0 Suppose -p - 3 = r - 2r, 2r + 3p = -14. Let g be (0 + 0)(18/(-12) - r). Solve v = -g - 5 for v. -5 Suppose 5j = -8j + 5o + 8, 0 = 3o - 3. Solve -25 = -8t - j for t. 3 Let i = -33 - -43. Let a be -4 + (-5)/5 + i. Let h(c) = 2c2 + 2c + 1. Let v be h(3). Solve 0j - aj = v for j. -5 Let u = 14 + -12. Suppose 7015 = -37c + 7089. Solve 3z + c = uz for z. -2 Let t = -4142 - -4158. Solve 0 = -6m + tm + 30 for m. -3 Let g(s) = s3 - 41s*2 - 85s - 43. Let z be g(43). Solve 223m - 228m - 10 = z for m. -2 Let l = -512 + 525. Suppose 5c + l = -3v + 4, -4c - 12 = 4v. Solve -u = -cu + u for u. 0 Suppose -2304 = -65w + 25w - 8w. Solve -wl = -51l + 18 for l. 6 Suppose 3y + 4g = 114, 0 = 7y - 6y - 2g - 18. Let t = -12 + 14. Solve -tv = 22 - y for v. 4 Suppose -72 = -18g + 17g - v, -11v = 0. Solve -23r + 47r = g for r. 3 Let o(j) = -j3 + 4j*2 + 2j - 1. Let w be o(3). Suppose -u + w = -5x + 3, 2x = -u + 18. Suppose 6r + 4 = u. Solve -8 = rn - 6n for n. 2 Suppose -5z - x = -90, 0 = 5z + x - 6x - 90. Let d = z - 16. Suppose 4a + 2 = -n - 8, 2n = -da - 2. Solve -nq = -4q - 2 for q. -1 Let m be 7/(350/(-4))55. Let v be (-436)/(-36) + m/362. Solve -3 - v = -3k for k. 5 Suppose 3j + z = 138 + 108, -4j + 2z + 318 = 0. Solve -36 = -75c + jc for c. -6 Let l be (-1)/((-3)/27)1 - 2. Suppose -y = 2s + 23, -4y + ls - 152 = 3s. Let j = y - -33. Solve -q - q + 8 = j for q. 4 Let b(u) = 2u*2 - 3u + 3. Suppose 9 = -2n - 5f + 31, 5n = 2f - 3. Let g be b(n). Let j = 98 + -92. Solve x + j = -gx for x. -2 Let v = 12 - -10. Suppose 0 = -5m - 2 + v. Solve 4j - 16 = -m for j. 3 Suppose -77w + 396 = -55w. Solve wz - 24 = 21z for z. -8 Suppose -82f = -88f. Let i(b) = b2 + 4b + 5. Let z be i(-5). Solve f = -7s + zs + 6 for s. -2 Suppose -101f - 100f + 188f + 676 = 0. Solve -fz = -55z + 12 for z. 4 Suppose 0 = k + 3p + 3, -7p = 2k - 3p + 4. Suppose kg + 4g + 17 = -x, 0 = -3x + 5g + 34. Solve -i + 0i + x = 0 for i. 3 Let o(d) = -18d + 45. Let t be o(2). Suppose 33 = 6i + t. Solve f = if + 6 for f. -2 Let k(j) = 3j - 14. Let r be k(6). Suppose 2 = -2d - rf, 3d - 3f + 15 = -d. Let s be d - ((5 - 1) + -12). Solve 3 = -4b - s for b. -2 Suppose -47t - 16t = 0. Let a(f) = 48f + 16. Let z be a(t). Solve zk = -k + 17 for k. 1 Suppose 312 = -26z + 33z + 32z. Let h = -7 + 13. Solve -h = zg + 26 for g. -4 Let o = 1069 - 375. Let n = 707 - o. Solve 0 = -9d + nd + 20 for d. -5 Let n(j) = -j3 - 7j*2 - 6j + 8. Let t be n(-6). Suppose -d + 2m = -9 + 2, 3d + 2m - 29 = 0. Solve ta + 3 = da for a. 3 Let q(b) = -3081b + 22 + 3071b + 40. Let y be q(6). Solve yh + 4 = h for h. -4 Suppose 3u = -5k - 806, -5u = -0u + 10. Let x be (-3)/2(k/24 + 4). Solve -x	{ "pile_set_name": "DM Mathematics" }
4/5) assuming d is positive. d(288/115) Simplify (c6(c/(c(3/4)ccc))/c(c5/c)/(c(2/13)/c))(-5) assuming c is positive. c(-1845/52) Simplify (o/o(-3/2))15/((o(3/2)o)/((o/o6)/o)) assuming o is positive. o29 Simplify ((s*(3/8)s/(s(1/7)/s))(2/27))(-26/5) assuming s is positive. s(-325/378) Simplify x(-9)/(x(-22/3)/x)x12/(xxx(2/7)) assuming x is positive. x(190/21) Simplify ((d(25/2))(1/6))(5/3) assuming d is positive. d(125/36) Simplify (((i/(iii/(i/(i/(i((ii(-2))/iii)/ii))i))i)/i)/i)*(2/63)(ii(ii(2/9))/i)/i(11/4) assuming i is positive. i(-47/84) Simplify ((x(6/11)x)/(x/x(7/5)))/(x5/x(7/2)) assuming x is positive. x(49/110) Simplify (s*(-33)/(ss(-1/48)))/(s(1/2)/ss/(s(-11)s)) assuming s is positive. s*(-2135/48) Simplify ff*(-1/48)f*15(ff(-17))/((fff(4/3)f)/f) assuming f is positive. f(-161/48) Simplify (t/t(-5))(-32)/(t/((t13t)/t)t/t(3/4)) assuming t is positive. t(-721/4) Simplify ((dd(-1/4))36(d*6/d)/(d/(dd/d*5d)))(1/24) assuming d is positive. d(29/24) Simplify (b*(-2/21)b(-1/3))/(b(-1/3)/b(1/16)) assuming b is positive. b(-11/336) Simplify ((tt(-4))/t)(4/11)/(t/t14t/t9) assuming t is positive. t(215/11) Simplify (h*3h*(2/15)h/(h/(h/(h/(h*(-4/5)/h))))h(2/9))(-2/5) assuming h is positive. h(-28/45) Simplify (p6/pp/p(-4)((((p/((p/(p*(2/7)p))/pp))/p)/p)/p)/(pp*(-2/15)p))(-1/12) assuming p is positive. p(-337/630) Simplify (y(-17/5)/(y/(y/y(3/10))y))(-33) assuming y is positive. y(1551/10) Simplify (m(-11)m(-2/21))/(m(2/3))(4/21) assuming m is positive. m(-101/9) Simplify q(-2)/(q/(q(1/8)/q))(q/(qq*(-16)/qq))/(q(-3/10)/q) assuming q is positive. q(537/40) Simplify d(3/7)/d(-1/11)(d(-1/3)/d)40 assuming d is positive. d(-12200/231) Simplify (g(2/21)g)/g*3g*11g(-12/7) assuming g is positive. g(155/21) Simplify (w*4w)(2/37)/(w(3/7)/w30) assuming w is positive. w(7729/259) Simplify ((k/k*(1/5))/kk)*(36/5)k*(8/7)/kk(k(-3)/k)/k assuming k is positive. k(333/175) Simplify ((z(1/3)zz/((z/z6)/z))/(z(-4)zzz/z(2/7)))(-50) assuming z is positive. z(-10100/21) Simplify (((j(-2/7)/j)/j)(1/55))(2/29) assuming j is positive. j(-32/11165) Simplify (r(-1/7)/r)(5/2)/(r/(r19r)r19) assuming r is positive. r(-20/7) Simplify ((((m*(-1/12)m)/m)/(m/m*(-8)m))/((mm/((m(-5)/mm)/m)m)/(m/(m(2/5)m))))(-2/17) assuming m is positive. m(1169/510) Simplify (n(-2/7))(-1/19)/(n/n*(-2/27)n)(3/37) assuming n is positive. n(-6782/44289) Simplify ((k(kk14)/k)(-9))(-2) assuming k is positive. k270 Simplify (q(-4/3)/q)(8/5)(q0q)/q(q/(q/(qq(-15)/q)))/q assuming q is positive. q(-296/15) Simplify (a*(-10)/aa(1/2))/(a/(a/a(-1)a))(1/30) assuming a is positive. a(-313/30) Simplify (bb*(-2/21)b)/bb12(bb17)/(b15b) assuming b is positive. b(313/21) Simplify (((h/(h(-1)/h))31)(-2/3))(-5/6) assuming h is positive. h(155/3) Simplify (((w/w*(-10))/(ww*8w))(-22/7))30 assuming w is positive. w(-660/7) Simplify (i(7/6))*11i27/(i/(i/(i/i23))) assuming i is positive. i*(371/6) Simplify ((q/(q/(qq*(8/3))))/qq/(qq17))/(((q(11/3)q)/q)/q(4/5)) assuming q is positive. q(-86/5) Simplify (((l/(ll3)l)20)(-2/7))(-21) assuming l is positive. l(-240) Simplify (f*33ff(32/3)f)/((f*(-1)/f)/(f(f/(f/(fff34)))/f)) assuming f is positive. f(251/3) Simplify (u/(uuu*(-36))u(((uuu(4/5)/u)/u)/u)/u)/((u22u)/(u/u(-1/3))) assuming u is positive. u(197/15) Simplify (y*(-6)y)*(1/42)y*(-19/3)y/(yyy(-12)) assuming y is positive. y(191/42) Simplify n27/(n27n)(nn/(nn/(nn/(n/(n/n(1/5)nnn)))))/(n*(-1/6)n) assuming n is positive. n(89/30) Simplify (h/(h10/h))*(-7/11)h19/(h(-23)/h) assuming h is positive. h(529/11) Simplify (l(-10)lll(l*(-20)l)/l)/(l/((l/(ll/l8))/l))(5/14) assuming l is positive. l(-353/14) Simplify ((ttt/(tt/t*(-2/33)ttt))/(t/(t(-2)/t)))/(t(2/5)/(tt/(tt/t*(-6/11))t)) assuming t is positive. t(-991/165) Simplify (s/s(-11/4))/(ss(-1)ss)(s(-1/6))(-23) assuming s is positive. s(67/12) Simplify j(-13)/(jj(-23))j/(jjjj/(jj/j*(2/7)j)j)jj(-1/10) assuming j is positive. j(603/70) Simplify a10/(aaa(3/10)a)a/a(-2/7)aa/a(-15)a assuming a is positive. a(1819/70) Simplify (((t(-1)/t)(-40))(1/7))(-2/111) assuming t is positive. t(-160/777) Simplify ((o/(o(o/(ooo(-1/6)o))/o)o)/((o/(o/o(2/5)))/o)o*(4/3)oo(oo/o(1/9))/oo)(-19) assuming o is positive. o(-16511/90) Simplify (d*(-7)d)*(-48)(d(-2/5))(-47) assuming d is positive. d*(1534/5) Simplify (pp3/p)(-45)/(p*(-2)p(-9)) assuming p is positive. p(-124) Simplify ((ss7)/s(ss(-1/30)s)/s)/(s/(ss(-9)))(-46) assuming s is positive. s(12659/30) Simplify d(3/4)/(d15d)d(-1/5)d(-7) assuming d is positive. d(-449/20) Simplify (z27/(z/z(-9/2)z))/(z(-1/13)/(z(z/(z/((z/(zzzz(-6/5)))/z)))/z)) assuming z is positive. z(2441/130) Simplify (dd/(ddd(2/11)))(10/17)(ddd(-3))/(d/d9) assuming d is positive. d(1289/187) Simplify ((zzz/(z/(z(5/6)/z)))/(z/(zz*(-1/13)))(z0)11)12 assuming z is positive. z(274/13) Simplify (((h(h(1/10)h)/h)/hhh)/h*(2/33))/((h/((h/(hh/(h/((h/((h*8/hh)/h))/hh))))/h))/hh/(h(h(-3/10)h)/h)) assuming h is positive. h(1112/165) Simplify (r(2/3)r)(-18)r*(-9/5)rr9 assuming r is positive. r(-109/5) Simplify p(-4/3)p*(-12/13)p(4/7)/p29 assuming p is positive. p(-8377/273) Simplify (q(2/3))(14/9)/(q(1/5)/q)42 assuming q is positive. q(4676/135) Simplify (bb/(b/(bb*(5/3)b)))/(b/b*(-1/18)b)(((bbbb/b*8bb)/b)/b)(-2/127) assuming b is positive. b(6113/2286) Simplify (k(-24))(-16)/(((k(-7)/k)/kkk)/(kk(-1/23))) assuming k is positive. k(9015/23) Simplify (w*(-3/4)w)*(-1/2)(w*1w)(-27/4) assuming w is positive. w(-109/8) Simplify (b/(((bbbbb*(-6)b)/b)/b))/b*(-1/2)b(b(-6/7)b)/bbb(3/2) assuming b is positive. b(50/7) Simplify (d(-2))(2/5)(d/d(-2))(-2/63) assuming d is positive. d(-94/105) Simplify ((mm*(-1/3)mm)(1/4)/((((m(-1/4)/m)/m)/mm)/m)(-9))(-3/13) assuming m is positive. m*(343/52) Simplify (a/(aa/a*3a))(-5/7)/(a(-6)aa/(a/(aa(5/2)))) assuming a is positive. a(11/14) Simplify ((zz*(-3/28)z)/z(-2/33))/(z23/(z(((z/z23)/z)/z)/z)) assuming z is positive. z(-41623/924) Simplify (nnn/n(-4))(3/13)/((nnn(-18)/nn)/(n/n(-1/9))) assuming n is positive. n(2191/117) Simplify (l/(ll(11/2)))/lll0(l16/l)(-21/8) assuming l is positive. l(-359/8) Simplify (x(-3)/xx)(-2)/(x/x(-1/3)xx(-3/8)) assuming x is positive. x(97/24) Simplify (gg*(-3)g*(1/3)(g(-2/11)/g)/(g/(g(1/13)g)))(2/9) assuming g is positive. g(-2378/3861) Simplify (x(4/3)/xxx)/xxx(-12)/xx*(4/5)x(-3/11) assuming x is positive. x(-1673/165) Simplify (n(n11n)/n)/(n/((n*(-1/5)/n)/n))((n/((n/(n/(n(n(1/3)n)/n))n)/nn))/n)14 assuming n is positive. n(-358/15) Simplify ((d/d*(4/11)d)/(dd(-8)d))/(d0/d(1/2)) assuming d is positive. d*(179/22) Simplify ((f/((f/(ff*0fff))/f)f)47/(f/f(1/3))34)(-2/31) assuming f is positive. f(-1556/93) Simplify ((l/l(-1))/ll)/l*(-2/31)(l/l*(15/4))/lll/(l/l(-9)) assuming l is positive. l(-1201/124) Simplify (b/(bb*(-4/13))b)(3/8)/(b(1/56)bbb/(b(-4/17)b)) assuming b is positive. b(-2727/1547) Simplify (m8m/(m/(mmm8)))/(m1/m(-2/11)) assuming m is positive. m(185/11) Simplify ((m(-13)/m(-1/3))(-5/2))42 assuming m is positive. m1330 Simplify t(-16)/tt*(-2/31)t*(1/7)tt(-12)t assuming t is positive. t(-5842/217) Simplify f/f31f/(((f/(f/(ff*21)))/f)/f)(f(-3/7))(16/5) assuming f is positive. f(-1763/35) Simplify (m(3/13)/(mmmm(-11/5)/mm))/((m/m4)/m23) assuming m is positive. m**(1653/65) Si	{ "pile_set_name": "DM Mathematics" }
- 60. What is the units digit of 9/u + 8/5? 1 Suppose 0 = -3z - 5z + 112. Let k(a) = -6a + 30. Let b be k(z). Let w = b - -113. What is the units digit of w? 9 Suppose 13r + 32 = 17r. What is the units digit of (-2)/(16/(-2650)) + (-10)/r? 0 Let n(l) = -l3 + 7l*2 + 25l - 55. Let j be n(9). Suppose -3287 - 3465 = -jh. What is the hundreds digit of h? 8 Let x be 7 + (-6 + 2 - 0). Let b(f) = f3 + 2f*2 - f - 7. What is the units digit of b(x)? 5 Suppose 405 = 2h + 5j, -2j - 655 = -0h - 3h. Suppose 4a = -51 + h. Let p = a - 16. What is the tens digit of p? 2 What is the tens digit of -21((-1273551)/(-6))/(-19)? 4 Let x(s) = -s3 + 7s*2 + 9s + 2. Let k be (18/(-45))/((-1)/(-40)). Let g be (9 + -8)/((-2)/k). What is the units digit of x(g)? 0 Let h be 200/24(-3)/(-30). Suppose 4j = -j + h. What is the tens digit of 35 - (j/(-4) - -1)? 3 Suppose 5v + 5 = 0, 3o - 4v - 2349 + 20 = 0. Suppose -5q - 5m = -o, -6 = -0m + 2m. Let p = q - 32. What is the hundreds digit of p? 1 Suppose 0 = -15y + 5y. Suppose -7p + 13p - 1026 = y. What is the hundreds digit of p? 1 Let n(o) = 1203o2 - 6o - 4. Let m be n(-1). Suppose m = 4x - 1099. What is the units digit of x? 6 Let v be (45/(-5) - -6)/(-3). Let f(y) = 388y*3 - 2y*2 + y + 2. What is the units digit of f(v)? 9 Suppose -26 = 7d - 131. Suppose dy = 6y + 36. Suppose -2a - 3m = -105, m - 225 = -ya - 2m. What is the tens digit of a? 6 Let m = 38 - 42. Let f be (-1288)/(-42) + m/(-3). Suppose 29g - fg = -3. What is the units digit of g? 1 What is the tens digit of (130 - 11) + (-1)/((-3)/15)? 2 Let i be (-58)/63/(-1). Let w(z) = 52z - 68. Let t be w(8). Suppose -25m = -im + t. What is the tens digit of m? 8 Suppose 0 = -7n - 39n + 229080. What is the hundreds digit of n? 9 Suppose -40u + 8u = 6u - 126160. What is the hundreds digit of u? 3 Suppose -67c + 1099139 = -159941 + 223461. What is the units digit of c? 7 Let y = 21 - 44. Let o = y + -5. Let s = o - -67. What is the units digit of s? 9 Let x be ((-3)/2)/(36/(-2640)). Suppose -2u + x = 14. Suppose -t + 4t - u = 0. What is the tens digit of t? 1 Suppose 0 = k - 8k. Suppose 5f - 37 = -3p, kp + 4p = 3f + 1. What is the units digit of f? 5 Let n(l) = 35l + 6l - 20l + 38l + 7l + 231. What is the hundreds digit of n(18)? 4 Let q(z) = 3z + 52. Let u be q(-16). Suppose 4f = u, 5f = 3l + 6f - 1372. What is the units digit of l? 7 Suppose -25 = -6u + 3u - 5t, 14 = 2u + 2t. Suppose 13l + 2a + 3020 = 17l, -ul + a = -3769. What is the hundreds digit of l? 7 Let l(s) = 6s + s*2 + 10s + 9 + 2s2 + 0s2. Let o be l(-6). Let z(w) = -w2 + 28w - 27. What is the units digit of z(o)? 0 Let z(m) = 45m*2 + 58m + 3236. What is the ten thousands digit of z(-34)? 5 Let a = -20089 - -35022. What is the units digit of a? 3 What is the units digit of (21308/28)/(10/220)? 2 Let a(u) = 24u3 - 2u*2 + 13u + 9. Let i(k) = -k*3 - 3k*2 + 2k. Let g be i(-3). Let p be a(g). What is the hundreds digit of (-6)/27 - p/27? 1 Suppose 7259 = 3h + 14h. What is the hundreds digit of h + 2(-9 - -6)? 4 Suppose 0 = -6q - 0 - 24. Let p be (150/(-39) - q) + 1928/(-26). Let j = p + 233. What is the hundreds digit of j? 1 Let t = 19405 - 5918. What is the tens digit of t? 8 What is the thousands digit of 518601 - 712/(-178)? 1 Let i(h) = -h3 + 23h*2 - 21h + 20. Suppose -216 = -8w - 64. Let x be i(w). What is the units digit of 6/(-18) + x/9? 8 Let z = 4 - 0. Let c be (z + -2)2/4. What is the units digit of -1(0 + -1)/c? 1 Let a(s) = 3s*2 - 5s + 22. Let v(h) = h. Let u(o) = a(o) - 6v(o). Let n be u(15). Suppose 0 = -9q + 1025 + n. What is the units digit of q? 3 Let r(a) = a*3 - 15a*2 + 13a + 17. Let t be (-96)/(-7) - 14/(-49). Let d be r(t). What is the hundreds digit of d(-5)/60-548? 1 Let m be 3125 - ((-28)/2)/(-2). Let y = m - 2091. What is the tens digit of y? 2 Suppose 0 = 102c - 96c - 6090. Suppose -4k + c = -3073. What is the units digit of k? 2 Let i(d) = -d2 - d - 1. Let y be i(-1). Let c be y/(267/(-1008) + 6/21). What is the units digit of 8/c + (-470)/(-12)? 9 Suppose -27x = 22x - 503865 + 146998. What is the thousands digit of x? 7 Suppose 2o - 87 = -77. Suppose -2r - 5t + 4t + 159 = 0, o = 5t. Suppose -z + 5x + r = 0, 2z - 4x - x - 143 = 0. What is the tens digit of z? 6 Suppose 167x = -4r + 163x + 12020, -2990 = -r - 4x. What is the tens digit of r? 1 Let a = -16713 + 19686. What is the hundreds digit of a? 9 Let c(w) = 37w*2 + 31w + 601. What is the thousands digit of c(-14)? 7 Let k(w) = -811w - 8011. What is the thousands digit of k(-25)? 2 Suppose 289 = 6q + 43. Let s = q + 338. What is the units digit of s? 9 Suppose 20 = 13l - 19. Suppose 0 = -2m + 3x + 542, 432 + 384 = lm - 3x. What is the units digit of m? 4 Let o(b) = 66b*2 - 35b + 63. What is the thousands digit of o(9)? 5 Let s be 12/5 - (-51)/85. Suppose 2h = -sk - 129 + 961, 4k = 2h - 818. What is the units digit of h? 3 Suppose -2i - 218 = -2u, u - 436 = -3u + i. Suppose 5l - 170 = -12p + 7p, -4l + u = -5p. What is the units digit of l? 1 Let c = -129 + 92. Let q(u) = u*2 + u - 20. Let j be q(-6). Let h = j - c. What is the tens digit of h? 4 Suppose 4h - 19 = -f, -2h + 6 = -0h. Let d be (-357)/(-9) + f/21. What is the tens digit of (-70)/2d/(-28)? 5 Suppose 1001828 = 42r + 308702. What is the tens digit of r? 0 Suppose -2757752 = -72s + 1541482 + 630750. What is the units digit of s? 2 What is the tens digit of (123 - 17)/((15/(-335))/(6/(-4)))? 5 Suppose -3d + 95286 = -y, -334y = -4d - 330y + 127032. What is the hundreds digit of d? 7 Let v(t) = -9t + 509. Let q be v(0). Suppose 2269 = 20x + q. What is the tens digit of x? 8 Let v(i) = i3 + 5i*2 + 6i + 8. Let t be v(-3). Suppose j = 4c - 2488, -4c = 6j - tj - 2484. What is the units digit of c? 3 Let y = 278 - 179. What is the tens digit of 112((-75)/(-132) + 18/y)? 8 Let n(y) be the third derivative of -29y*4/4 - 17y*3/2 - 3y*2 - 27y. What is the hundreds digit of n(-5)? 8 Let i = 145 - 141. Suppose 2d = 4m - 438, -d = -i + 3. What is the units digit of m? 0 Suppose -8q = -26q + 33516. Suppose 21o + 4y = 23o - 1874, -y - q = -2o. What is the hundreds digit of o? 9 Let x = -303 + 374. Suppose -19264 = 57u - xu. What is the thousands digit of u? 1 Let h(p) = -p*3 + 16p*2 + 15p - 39. Let z = 108 - 92. Let y be h(z). Let m = y + -62. What is the tens digit of m? 3 Suppose 2m + 12f - 14f - 24096 = 0, 2m - 24126 = -4f. What is the tens digit of m? 5 Let b(w) = -2w*3 - 21w*2 - 23w - 19. Let q be b(-9). Let x(m) = -2m3 - 109m*2 + 31m + 18. What is the thousands digit of x(q)? 1 Suppose 20y + 18 - 78 = 0. Suppose -ya + 2625 = 48. What is the units digit of a? 9 Suppose 8o - 4o + 600 = 4g, 616 = -4o - 4g. Suppose c = -4c + 1135. Let z = o + c. What is the units digit of z? 5 Let h(w) be the second derivative of -3/2w4 + 0 - 3w*2 - 1/3w*3 - 12w - 1/20w5. What is the units digit of h(-18)? 0 Let l = -142 - -130. Let q(d) be the first derivative of -d4/4 - 10d*3/3 + 17d*2/2 + 6d + 4. What is the units digit of q(l)? 0 Suppose -128q + 1273 - 114953 = -142q. What is the thousands digit of q? 8 Let z(a) = 2a3 - 2a*2 - 4a - 9. Let q be z(-6). Let o = q + 1028. What is the units digit of o? 9 Suppose 2v - 3 - 12 = -b, 4v + 5 = 5b. Suppose -2f + vy = -390 - 529, 2340 = 5f - 4y. What is the hundreds digit of f? 4 Let s = 9251 - -530. What is the units digit of s? 1 Suppose 39w + 27898 - 59452 - 73122 = 0. What is the tens digit of w? 8 Let f(q) = 3q + 5. Let o be f(0). Let b(u) = u - 8. Let v be b(o). What is the units digit of v + 1 - (-90 - 4)? 2 Let u = -3685 + 6791. What is the tens digit of u? 0 Let q(p) = 2p*2 - 16p - 7. Let y be q(10). Let j = -31 + y. What is the tens digit of (935/44)/(j/8)? 8 Suppose -22o - 15o + 137760 = 59o. What is the thousands digit of o? 1 Suppose 18905 + 67335 = 20o. What is the units digit of o? 2 Let v(f) = -5f2 + 43f - 18. Let r be v(8). Suppose -4z + rz = 126. What is the units digit of z? 3 Suppose 8w = 3w + 3640. Let o = -191 + w. What is the units digit of	{ "pile_set_name": "DM Mathematics" }
+ 1/(38 + -43). -17 Calculate (-18 + 3718/195)((-9)/6 + 3). 8/5 (-18)/27(-3)/(-16)-2 1/4 What is the value of (4/(-3))/(148/1776)? -16 What is the value of (-15)/(-13) + 20/(-130) - (-354)/590? 8/5 (5 + 4)/1035(-75 + 77) 2/115 Calculate -34 + 40 - (-86)/(-16). 5/8 What is (-7 - 36)-1 - (10 - -5)? 28 9216/4224 - (-326)/22 17 What is 55860/(-3591) - (-2)/(-18)4? -16 What is ((-96)/(-10))/8 + 9 + -10? 1/5 What is the value of (58/14 - 4)(72 - 74)? -2/7 What is (((-850)/153)/25)/(8/(-18))26? 13 What is (753/8785)/((-2)/(-30))? 9/7 Calculate (-3 - -1)/((675/50)/((-7)/14)). 2/27 What is the value of (-3)/((-108)/(-13)) - 369/(-3321)? -1/4 (1/(-36)1)/((-2)/(-6))-3 1/4 What is the value of (-24)/391((-752)/(-64) + -12)? 2/13 What is the value of 42/105(-110)/187? -4/17 What is 21/(-56) - (5 - 1092/96)? 6 Evaluate (-46)/(-299) + (-1120)/2548. -2/7 Calculate (-4 - (-45)/10) + (6 - (-65)/10). 13 Calculate -6 + (121 - (-7980)/(-1365)). 2/13 (8/7)/((-6)/21-9) 4/9 What is the value of 67/18 + (-889)/254? 2/9 Calculate (-4)/86(40/(-6) + 4). 8 -24(-5)/(-2480)(-8)/6 2/31 Calculate 3340/2004 - 262/150. -2/25 What is the value of ((-21)/2)/((-276)/368)? 14 What is the value of ((-268)/(-1675))/(42/(-15))? -2/35 What is 45/15 + -2 + 11/((-1287)/120)? -1/39 (0 - 3)(-57)/(-27)33/11 -19 Calculate -44(-12)/23232(1 - -7). 2/11 Calculate -13 + (-4 - -8) + 9/1. 0 Evaluate 300/((-450)/30) + 15. -5 Calculate 20680/(-6204)(4 - 0 - 1). -10 Calculate (1/(-3))/((-10)/(-150)). -5 -5 - (-3 + 7) - (-7 + 867/(-442)) -1/26 Calculate 1/(-1)315/(-90). 7/2 Calculate 60/16(-96)/36. -10 What is the value of (-5)/159((-25)/625 + (-290)/250)? 2/53 What is 16214/1815 - (-18)/(-2)? -1/15 Evaluate (78/728 + -8)/(16/27). 9/8 255/(-18 + 3) - 3(-8)/12 -15 What is the value of 6(45/567)/(125/50)? 4/21 (-2 + 110/60)-186 31 (-2)/172/(-3)1644/1096 2/17 (1632/(-72) + 20)2/(-136) 2/51 Calculate (-6)/(-585)1155/(-154). -1/13 ((-792)/165)/((-8)/30) 18 Evaluate 1 - 5 - (-12)/16(-432)/(-81). 0 (-36)/(-4) + (-27)/((-4455)/(-1425)) 4/11 Calculate (-477)/106 + (-46)/(-4). 7 (-1)/((-66)/648) - (40 + -30) -2/11 What is the value of (-402)/(-16) - (70 - 45)? 1/8 What is the value of (-20 - -39 - 23)(-6)/(-8)? -3 Evaluate (2 + -3)/(-1145/(-825)). -5/3 430/(6 + -49) - -2 -8 ((-144)/(-152))/9 - (-861)/(-57) -15 Evaluate ((-350)/875)/(4/90). -9 What is (-9)/3 + ((-58)/(-4))/(27/6)? 2/9 What is the value of (211/(-3798))/((-4)/(-30))6/(-40)? 1/16 Calculate (-15(-20)/750)/((-48)/(-10)). 1/12 Evaluate 5/(-10) - 0((-48)/(-40))/6. -1/2 Calculate 2 + 8 + (-69 + 60 - -21). 22 Calculate ((-3267)/6831)/((-11)/6). 6/23 (-42)/(-14)((-56)/6)/2 -14 What is the value of -3 + 8 + 1 - (4900/(-63))/(-14)? 4/9 (1(-32)/14)/(-3 - (-95)/35) 8 Calculate (-5)/(10/(-16))(4 + (-153)/34). -4 Calculate (-2 + -1)230/207-3. 10 Evaluate (-3)/((-9)/(-20))330/(-220). 10 What is the value of ((-3)/(-4))/(22 + (-20985)/960)? 16/3 What is the value of (-74)/(-11) + 0 - 159/(-583)? 7 What is 4 + (51/6 - 10)? 5/2 (522/(-48) - 5) + 12 + 4 1/8 53/39 - (-2668)/8671 5/3 What is the value of (5 + -1 + 78/12)/(-9)? -7/6 Calculate (5 + -11 - 3/(-1))(-1 + -2). 9 Evaluate 24 - -1(-27 + 14) - 15. -4 Evaluate ((-210)/36 + 6)/(48/108). 3/8 (-43848)/2204 + (-4)/38 -20 What is 2/6-3(-80 + 67)? 13 2/843591/42 - 9/12 9/7 What is the value of (-10)/(-135) - (-5 + 572/(-297))? 7 (14/(-4) + 2)/((-1286)/(-76) - 17) 19 Calculate ((-25543)/356 - -73)/((-1)/4). -5 What is the value of (26/((-624)/18))/3? -1/4 What is the value of ((-192)/(-4896))/(6/68)? 4/9 1533/(-990) + 53/2 + -2 24 What is 4/(-6)67/335 + (-22)/10? -7/3 Calculate 12/(-1) - (-2870)/287. -2 Calculate ((-324)/63 + 5)/(-6 + (-108)/(-21)). 1/6 What is the value of (2(-17)/5)/(46/115)? -17 What is the value of (-13)/((-455)/21)-15? -9 (3 - 0) + 4011/(-711) + (-8)/(-3) 2/79 What is the value of 3(-1)/36 + (-9)/(-4) + -2? 1/6 What is (-24)/1008-18 - 132/14? -9 What is (-16048)/(-952) - 117? -1/7 (-12)/336 - (-2 - 89/140) 13/5 What is the value of 32 + 768/448 + ((-24)/(-21))/4? 34 Calculate 20/((-8)/(-16)-4). -10 (3/(-27))/(((-40)/(-24))/(5/(-3))) 1/9 What is the value of (1 - ((-11)/1 + 0)) + (-1635600)/134850? -4/31 ((-84)/18)/(-7)(1295/91 - 14) 2/13 What is (192/(-40))/(-8) + (-830)/1300? -1/26 Evaluate 80/(-96) - 285/90. -4 Calculate (2-8)/(19 + (10 - 28)). -16 What is the value of (275/(-22) + 12)/((-2)/(-434))? -34 Evaluate (-2)/(-6)(16 - 790/50). 1/15 What is the value of ((-96)/60)/(7/(-30) + 6/(-36))? 4 Calculate (18/60)/((-918)/(-136)). 2/45 Evaluate (291/4365)/(13/15). 1/13 What is the value of (4/3)/(-2)-6685/2040? 11/6 What is the value of (2/23 + (-7140)/18630)6/(-8)? 2/9 Evaluate 16 + -22 + 18 + -14. -2 Evaluate (-1)/((-4)/(9/18-2))18. -9/2 What is (-2 + 4)/8(9 + (-675)/99)? 6/11 Calculate ((-312)/96 + 2/4)-4. 11 Evaluate (3/(-22))/(-5128/(-2618)). -1/4 Evaluate (-30)/324((-16)/(-18))/4. -5/6 ((-12597)/(-34))/(-57)-12 13 Evaluate -14 + 5 + -6 + 5610/385. -3/7 What is the value of 14/2 + -103 + 80? -16 Evaluate (-1971)/999 - (-3)/(-111). -2 (5/2)/((-270)/(-72) - 4) -10 (-1 + 12/16)/((-1)/4) 1 Calculate ((-60)/75(-35)/(-42))/(39/(-18)). 4/13 Calculate (-251)/502(-1 - 3/(-21)). 3/7 Evaluate (4/9)/(-20 + 2 - 55876/(-2061)). 2/41 (-11 - -12)(-147)/(-3 - 4) 21 31 + 3 - ((-4)/7)/((-108)/1134) 28 What is 11/1 - (-15 + 8 - -2)? 16 Evaluate ((594/96)/11)/(36/24). 3/8 What is the value of (-5 + (-333)/(-74))/(26/(-8))? 2/13 What is the value of 6 - (33 + 825/(-25))? 6 Evaluate -7 + 858/154 + 7/(56/12). 1/14 What is 150/(-126) + -3130/(-2790)? -6/7 ((-368)/207 + (-8)/(-6))/(4/(-18)) 2 Calculate 6/9 - 658/42 - 3. -18 1312/(-492)32 -16 What is 6/12028 - (-12)/(-6)? -3/5 (-60)/930 - (-10)/(-2945)74 -6/19 Evaluate (-77)/(-1320)30 - (-178)/(-120). 4/15 Calculate 21 - 41993/19711. -3/23 (-18)/(-3(10 - 160/15)) -9 Evaluate (-15 + -27)/(-168) + -1 + 10/4. 7/4 Evaluate ((-44)/40 - 2 - -4)/(-29 + 26). -3/10 Evaluate (-31)/5 - (120/(-45))/((-7)/(-21)). 9/5 Evaluate (15 - (-3 + 17))-2. -2 What is the value of -8(-63)/72(22/(-7) + 0)? -22 Evaluate (-7 + 8)/(1/(-18)) + -2. -20 What is (-7)/(-20)(-186)/651? -1/10 (-54)/(-6) + -22 + 19 + (-6)/(-1) 12 What is the value of (1 + (-18)/4)/((-89)/356)? 14 What is 6 + (6/(54/(-3)))/((-5)/(-100))? -2/3 What is the value of 4 + -2 + 30 - 19? 13 Evaluate (105/(-30))/((-95)/(-342) - (-2)/9). -7 What is the value of 939/(-5634) + 33/6 + 0? 16/3 (-170)/(-374)22 - 105/(-7) 25 Evaluate (-102)/175513 - (-1)/5. -5/9 What is (-6)/(-33) + (-1974)/5170? -1/5 30/5 + 68(-5)/50 -4/5 Evaluate (((-54)/45)/(0 + -2))/(5 - 2). 1/5 What is (-16)/3520 - ((-54)/8)/9? 3/4 What is (-1026)/570 - -2 - (0 - (-56)/5)? -11 What is the value of (6-1)/(295 - 400)? 2/35 Calculate (9/21)/(184/(-161))(-116)/6. 29/4 Evaluate (-8 + (1 - -17))22/(-22). -10 What is the value of (-21)/45 - 20/45129/(-86)? 1/5 (-22)/42(-20)/220 1/21 Evaluate (-15)/75(-70)/(-42). -1/3 Evaluate (23/6 + 27 + -31)/((-2)/8). 2/3 What is ((-32)/(-2) - 17)/((-60)/(-84))? -7/5 What is the value of (24 - 6) + (-16480)/920? 2/23 Evaluate ((-79)/(-395))/((-1)/1). -1/5 What is the value of (-1)/(-1)-451/115? -4/23 What is 1390/(-1251) - 2/(-9)? -8/9 What is (-48)/90(-40 + 208/16) - 12? 12/5 (-21)/(-132)(-2728)/(-3472) 1/8 What is the value of 1/2(5 + -31)? -13 Calculate (-882)/(-1008) - 1/(-8). 1 What is the value of (36/(-7))/(-6 - 352/(-56))? -18 What is the value of ((-486)/(-405))/(8/(-30) - (-4)/24)? -12 6/9-15(432/(-45) - -10) -4 What is the value of 8299/41688 - (-2)/(-16)? 2/27 Evaluate (6/36)/((-3)/72). -4 What is the value of ((-2)/(-5)100/(-60))/((-19)/(-3))? -2/19 (102/238)/(0 + (10 - 11)) -3/7 Evaluate (-120)/(-132) + (-12)/(-132). 1 What is ((-400)/500 - (-3)/5)12? -12/5 What is the value of (14 - 1644/120)/1? 3/10 Calculate (2/65)/((-675)/(-2925)). 2/15 20/1655/((-144925)/(-248)) 2/17 -1 + 14 + 2015/(-156) + (-1)/(-6) 1/4 ((-6)/(-14))/(420/(-1470))(-40)/(-3) -20 What is the value of -127 + 134 - (-3 - 202/(-20))? -1/10 ((-330)/(-168) - (-14)/49)-4 -9 What is (1 + (-16)/14)/((1927/(-123))/47)? 3/7 (2/28)/(((-1635)/(-60))/(-109)) -2/7 Evaluate 16/(-296) - (-26884)/(-17390). -8/5 What is the value of ((-140)/(-315))/(18/	{ "pile_set_name": "DM Mathematics" }
= 4x - 1. Let l(u) = -6d(u) - 2g(u). Let o(z) = -8z + 8. Let c(h) = 9l(h) - 2o(h). Differentiate c(n) wrt n. -2 Find the third derivative of 76 + 20x3 + 17x*2 - 76 wrt x. 120 Let c(w) be the second derivative of -5w4/12 - w3 + 5w. Find the second derivative of c(u) wrt u. -10 Let m be (5/4)/((-2)/(-8)). Suppose -4f = w + 11, -5w = 3f - mf - 33. What is the second derivative of -7t*4 - 2t*w + 7t*4 + t wrt t? -40t*3 Let n be (-4)/2 + 3 - (-1 - -2). Let x(b) be the second derivative of 1/6b*3 + 1/2b*2 + n + 2b. What is the derivative of x(i) wrt i? 1 Let r be -1(2 - 0) - -7. What is the third derivative of -rj2 - j6 - 20j5 + 20j*5 wrt j? -120j*3 Find the third derivative of -19h*4 - 6h*4 - 19h*2 - 2h*2 wrt h. -600h Let w(r) be the first derivative of 10r3/3 + 7r*2/2 - 4. What is the second derivative of w(g) wrt g? 20 Let l(o) = 11o2 - 14. Let q(p) = -p2 - 1. Let g(i) = -l(i) + 5q(i). Find the first derivative of g(h) wrt h. -32h Let v(c) = -c*3 + 7c*2 + 2. Let k be v(7). Differentiate 2a + ka + 3 - 5 with respect to a. 4 Let r(d) = d3 + d2 - d + 3. Let j be r(0). Find the second derivative of 0c*3 + 3c*5 + 2c*3 - 2c - 2cj wrt c. 60c*3 Let p be (-3)/(-9) - (-59)/3. What is the second derivative of -36 - 3r + 16 + p - 8r2 wrt r? -16 Let s(a) = -5a*5 + 2a*4 + 2a*3 - 5a2 + 2. Let b(m) = m4 + m3 + m2 + 1. Let v(c) = 6b(c) - 3s(c). Find the third derivative of v(h) wrt h. 900h2 Let g(r) = -4r*5 - 3r*4 + 3r*3 - 3. Let x(u) = 3u*5 + 4u*4 - 4u*3 + u + 4. Let q(j) = -4g(j) - 3x(j). What is the second derivative of q(f) wrt f? 140f*3 Suppose -3q + 6 = -0. Suppose -q - 1 = -d. Find the first derivative of 0r2 + rd + 0r*2 + 3 wrt r. 3r*2 Suppose 2g = -0g + h + 13, 0 = -2g + 2h + 16. What is the third derivative of -2p*5 - 2p*g - 2p + 2p + 4p*2 wrt p? -240p*2 What is the second derivative of 5q + 17q2 - 3q2 - q wrt q? 28 Let h(d) be the second derivative of -d7/840 - d6/180 - d3/3 - 2d. Let x(n) be the second derivative of h(n). Find the third derivative of x(j) wrt j. -6 Let n(r) be the second derivative of -2r*7/7 + 3r*3/2 - 13r. What is the second derivative of n(j) wrt j? -240j3 Suppose 0 = -5z + 5d + 5, -2z + 3d - 8 = -d. Find the first derivative of 53r*2 - 53r*2 + 7r*3 + z wrt r. 21r*2 Let v(i) = -2i*2 - 16i - 5. Let j(x) = -2x2 - 17x - 6. Let l(d) = -5j(d) + 6v(d). What is the second derivative of l(m) wrt m? -4 Let u(l) be the third derivative of -4l7/35 + 3l*5/5 + 27l*2. What is the third derivative of u(d) wrt d? -576d Let h(b) = -4b - 3. Let w(o) = -o2 - o + 1. Let x(p) = h(p) + w(p). Let g be x(-4). What is the third derivative of 6n - 6n + 2n5 - ng wrt n? 120n2 Let s(h) = -9h*4 - 5h*2 + h + 5. Let y = -8 + 6. Let o(f) = -4f*4 - 2f*2 + f + 2. Let j(z) = ys(z) + 5o(z). Find the second derivative of j(r) wrt r. -24r*2 Let y be 98/28 + 1/2. What is the third derivative of -5w*2 + 5w*5 - 5w*4 + 0w*y + 5w*4 wrt w? 300w2 Let l be ((-3)/4)/(1/(-4)). What is the derivative of v4 + 0v3 + 4v*4 + 5 + 0v*l wrt v? 20v*3 Let z(k) be the second derivative of 0k*6 + 0 + 5/12k*4 + 0k*3 + 0k*2 + 2/21k*7 + 0k*5 - 6k. What is the third derivative of z(u) wrt u? 240u2 Let n = 5 + -3. What is the derivative of 3 - 2m - n + 0 wrt m? -2 Let g(s) be the second derivative of 7s4/6 + 3s*3 + 23s. What is the second derivative of g(c) wrt c? 28 Suppose -5u - 13 = -r, 3r - 3u = r + 12. Let g = r + -1. Differentiate -2 + 0 + gv*4 + 0v*4 with respect to v. 8v*3 Find the third derivative of -6u*2 - 34u*3 + 15u*3 - 2u - 22u2 wrt u. -114 Let g = -55 + 58. Let z(h) be the second derivative of h + 1/4h*4 + 0h*2 + 0 - 2/3h*g. Find the second derivative of z(a) wrt a. 6 Suppose -b + 5v + 27 = -0b, -2v - 18 = -4b. Let p(q) be the second derivative of 0 + q - 1/6q3 - qb. What is the first derivative of p(r) wrt r? -1 Let c(j) be the first derivative of 4j2 + 18j - 13. Differentiate c(a) wrt a. 8 Suppose g + 2z + 6 = -0g, 2g - 3z - 23 = 0. Let s(i) be the second derivative of 0i3 + 0 + 2i + 1/6ig - 1/2i*2. Differentiate s(b) wrt b. 4b Let n(c) be the second derivative of -c*7/7 - 5c*4/12 - 3c. What is the third derivative of n(a) wrt a? -360a2 Let h(a) = -a4 - a3 + a. Let l(s) = 57s*4 + 3s*3 - 3s - 33. Let w(r) = 3h(r) + l(r). Differentiate w(x) with respect to x. 216x3 Let l(y) be the second derivative of -y9/126 + y5/20 + y2/2 - y. Let o(d) be the first derivative of l(d). What is the third derivative of o(g) wrt g? -480g3 Let g(a) = -12a3 + a2 - 7a + 7. Let c(y) = -6y3 + y2 - 3y + 3. Let v(p) = 7c(p) - 3g(p). Find the third derivative of v(h) wrt h. -36 Let z(c) be the third derivative of -3c*2 + 1/105c*7 + 0 + 1/3c*3 + 0c*6 + 0c*5 + 0c*4 + 0c. Differentiate z(p) with respect to p. 8p3 Let t = -19 + 18. Let d(q) = 3 + 1 - 6. Let v(g) = -g. Let n(w) = td(w) - 2v(w). Find the first derivative of n(j) wrt j. 2 Let d be -2(-1 - (-2 + 0)). Let s be d/(-3) + 50/6. What is the third derivative of s - o*5 + 3o*2 - 9 wrt o? -60o*2 Suppose d - 2j + j = 7, -5d - 3j = -3. What is the third derivative of 4b2 + 2b*3 - 2b*d + 0b*3 - 4b*4 wrt b? -96b Suppose -3o + 2 - 14 = 0. Let d = 2 - o. Find the third derivative of i6 + i2 - i6 + 2i*d wrt i. 240i*3 Let g(h) = 14h*4 - 6. Let n = 25 + -8. Let r(j) = 41j*4 - 18. Let t(s) = ng(s) - 6r(s). What is the first derivative of t(d) wrt d? -32d*3 Let h(r) = -4r*2 + 5r - 16. Let y(c) = 5c2 - 5c + 18. Let l(b) = -2h(b) - 3y(b). Find the first derivative of l(q) wrt q. -14q + 5 Find the third derivative of -7q*5 + 16q*2 - 2q*5 - 9q*5 wrt q. -1080q2 Let c be 40/24 - (-2)/6. Let w(q) be the second derivative of q2 + 1/3q3 + cq + 0. Differentiate w(y) wrt y. 2 Let j(l) = -l*2 - 2l. Let z be j(-2). What is the third derivative of 3u4 - 3u*2 + zu2 + u2 wrt u? 72u Let i(p) = 4p + 12. Let z(u) = 2u + 3 + 2u + 14 - 6. Let d(x) = -6i(x) + 7z(x). Differentiate d(c) with respect to c. 4 Let k(g) be the third derivative of g9/504 - g6/90 + 7g3/6 + 2g*2. Let m(i) be the first derivative of k(i). Find the third derivative of m(x) wrt x. 360x2 Let h(n) = n4 - 1. Let l(w) = -12w4 - 10w*2 + 4. Let z(m) = -4h(m) - l(m). What is the third derivative of z(f) wrt f? 192f Let m(l) be the first derivative of -13l*6/6 - 5l*3/3 - 11. Find the third derivative of m(v) wrt v. -780v*2 Let k be (-30)/4(-12)/15. Find the second derivative of -r + kr + r + r - 3r2 wrt r. -6 Let i(f) = -f3 + 6f2 + 7f + 3. Let p be i(7). Let r(b) = -b*3 - 8b*2 - 7b + 3. Let k be r(-7). Differentiate -2y2 - py*2 + ky*2 + 1 wrt y. -4y Let x be (-1)/3(-4)/8. Let q(c) be the second derivative of xc*4 + 2c + 1/6c3 + 0 + 0c2. Find the second derivative of q(g) wrt g. 4 Let o(f) be the second derivative of -f7/168 - f6/120 - f3/6 + 5f. Let h(p) be the second derivative of o(p). Find the third derivative of h(n) wrt n. -30 Suppose -y + 3 = 1. Find the third derivative of 0h*5 + 6h*2 - 7h*2 - yh*5 wrt h. -120h*2 Let s(u) be the second derivative of -17u*6/30 - 13u*4/12 + 8u. What is the third derivative of s(l) wrt l? -408l Let j(s) be the first derivative of s6/3 + 3s*3 - 4. What is the third derivative of j(a) wrt a? 120a2 Let y(z) = -z2 + 5z + 8. Let p be y(6). Find the second derivative of 4v2 + v3 - 4vp - 3v wrt v. 6v What is the third derivative of 5x*6 + 5x*2 - 7x*6 - 11x*6 - 12x*6 wrt x? -3000x*3 Let w(l) be the second derivative of -3l + l*2 + 0l*3 + 3/20l*5 + 0 + 0l*4. Differentiate w(s) wrt s. 9s*2 Let n(k) = 27k*4 - 6k*2 - 17k + 6. Let s(c) = c4 - c2 - c + 1. Let i(h) = n(h) - 6s(h). Find the second derivative of i(y) wrt y. 252y*2 Find the first derivative of 5j*2 - 30 + 32 - 20 + 9j*2 wrt j. 28j Let y(l) be the second derivative of 6l3 + 3l*2 - 17l. Differentiate y(p) with respect to p. 36	{ "pile_set_name": "DM Mathematics" }
2 + 2q + 1. Let t be m(-1). Let o be -28 + t/((-6)/4). Let h = o + 28. Let r(u) = 3u2 + 2u. What is r(h)? 8 Suppose -2q = -6, 3p + 2q - 6q = 87. Let g = p - 34. Let d(t) = 3t - 1. What is d(g)? -4 Suppose x = -4a + 11, -a - 2x + 8 = -0a. Let q(u) = -13u2 - 19u + 11. Let v(r) = -5r2 - 8r + 5. Let n(o) = -2q(o) + 5v(o). Calculate n(a). 3 Suppose -t - 20 = 60c - 55c, -9 = 3t - 2c. Let k(p) = p*3 + 5p*2 + p - 4. Give k(t). -9 Let x(h) be the first derivative of -3h*2/2 - h + 46. What is x(-4)? 11 Let j(y) be the third derivative of 0y + 8y2 - 1/24y*4 + 1/3y*3 + 1/60y5 + 0. Give j(-2). 8 Let s(h) = h. Let m(i) = i3 + 17i2 - 19i - 12. Let l be (-6)/((-2)/(-6)-3)-3. Let y be m(l). Determine s(y). 6 Let o(c) = c + 5. Let r = -7 + 3. Let x be 24/((-16)/r) - 2. Suppose 14 = -xw - 2u, 3u + 2 + 1 = -3w. Calculate o(w). -1 Suppose -2 = -l - 8. Let f(h) = h*3 + 5h*2 - 6h - 5. What is f(l)? -5 Let d(p) be the second derivative of p*5/20 + 11p*4/12 - 13p*3/6 - 9p*2/2 - p. Let w be d(-12). Let h(f) = 2f - 1 + 1 + 0f. What is h(w)? 6 Let r(o) = o3 - 6o*2 - 6. Suppose 2v = 6, -3c + 4v + 9 = -0c. Suppose c = -7h + 49. Determine r(h). -6 Let k(p) = p*3 + 10p*2 + 23p + 15. Let r be k(-7). Let t(c) = -7c + 3c + 5c - 2c. Calculate t(r). -1 Suppose -4a + 2a + 5t = 25, -5a - 19 = 2t. Let k(x) = 7x - 7. Determine k(a). -42 Let k(y) = 4194y + 1 - 1398y - 1403y - 1397y. Determine k(-4). 17 Let a(p) = -p*2 - 10p - 11. Suppose 0 = 12j - 51 - 9. Suppose jt = g + 4g - 50, -2g + 4 = 0. Determine a(t). 5 Let k = 11 + -12. Let b be (-96)/(-3) + 2 + k. Let j(w) = -b + 33 + w. Give j(1). 1 Let r(m) be the third derivative of 1/12m4 + 0 + 1/3m*3 + 0m + 1/60m6 + 0m*5 + 11m2. Calculate r(-2). -18 Let h(r) = -r2 - 6r - 9. Suppose -3w - 6 = 0, -7 = 4v - 2w + 13. Give h(v). -9 Let j(v) be the second derivative of v*3/3 + 3v*2/2 + 2420v. Suppose -5t = 4 + 6. What is j(t)? -1 Let x(y) = -y2 + 7y - 3. Let a = -23 - -5. Let f be (-48)/a - 1/(-3). Determine x(f). 9 Let s(a) = 163a + 175a + a*2 + 166a - 498a. Calculate s(-5). -5 Let a(l) = -l3 + 5l*2 - l + 2. Suppose -3n = -9n. Suppose 0 = 3o - 5b - 15, -2b = -nb. What is a(o)? -3 Suppose 6 = 2r - 4. Let d(y) = -y*2 - y + 11. Let b be d(r). Let x = 16 + b. Let l(c) = 2c*2 + c - 3. Give l(x). 12 Let o(n) = 6n3 - n2 + 3n3 - 8n*3 - 1 - 3n. Suppose -5f = 4r + 18, -4f = -5r + 3 - 5. Calculate o(f). -7 Let r(v) = -6v2 - 12v - 3. Let c(y) = -y*2 - y - 1. Let g(x) = 5c(x) - r(x). Calculate g(-5). -12 Let s(y) = -y*3 - 3y*2 + 2y + 1. Let r(c) = 5c3 + 2c*2 - 3c - 7. Let i(f) = -r(f) - 4s(f). Give i(10). -47 Let m(x) = 2x*3 - 3x*2 - 2x + 4. Suppose 9u + 7 = 6u - 4v, 3u + v - 5 = 0. Determine m(u). 25 Let n(c) = 18c + 20. Let x(l) = 8l + 9. Let i(u) = -3n(u) + 7x(u). Calculate i(-2). -1 Let r = -6 + 1. Let q(t) = 1 - 81t3 - 6t*2 - 4t + 4 + 80t3 - 1. Calculate q(r). -1 Let h(t) = t2 + 7t - 22. Let v(r) = -2r3 + 14r*2 - 3r + 12. Let s be v(7). Calculate h(s). -4 Suppose -61o + 62o + 2 = 0. Let h(d) = -d*2 + 1. Give h(o). -3 Let z(h) = 32h - 410. Let o be z(13). Let n(w) = 3w + 9. Let x(v) = -4v - 9. Let c(k) = 5n(k) + 4x(k). What is c(o)? 3 Let y(u) = -29u3 + 2u*2 + 2u + 1. Let s be -12 - 10/60-6. Give y(s). 30 Let n(z) be the second derivative of -z6/720 + z5/60 + z4/2 + z2/2 + 6z - 1. Let i(k) be the third derivative of n(k). What is i(6)? -4 Suppose 357 = -30c - 21c. Let j(l) = 2l + 3. Calculate j(c). -11 Let y(l) = -l*2 + 2l - 5. Let s(k) = k*3 + 35k*2 + 99k + 99. Let m be s(-32). Give y(m). -8 Let a(l) = -12l3 + 21l*2 - 2l - 8. Let d(o) = -16o3 + 29o*2 - 3o - 11. Let b(i) = 11a(i) - 8d(i). Suppose -p + 5p = -8. Determine b(p). 24 Let q(d) = -d3 - 3d2 + 7. Let h be q(-3). Let v(u) = -u2 + 10u - 10. What is v(h)? 11 Let z(m) = 5m + 24. Suppose -50 + 100 = -10h. What is z(h)? -1 Let d(q) = 5q*2 + 16q - 8. Let a(h) = -8h2 - 17h + 7. Let t(c) = 2a(c) + 3d(c). Give t(13). 3 Suppose -2k - 5z - 32 = 0, 2z = 2k - 0z + 4. Let w be 44/16 - k/(-8). Let g(d) = dw + d - 7d + 1 - 3. Determine g(6). -2 Suppose 0 = -0v + 3v + 2v. Let p(i) = 2i*2 + i + 2. Let u be p(v). Let x(c) = -c + 3. Give x(u). 1 Let q(y) = -2y + 11. Let s be q(11). Let i = s - -15. Let d(w) = -2w2 - iw*2 + 5 - w + 7w*2 - 3w. Determine d(4). 5 Let w(d) be the first derivative of 7d4/4 - d3/3 - 100. What is w(-1)? -8 Suppose 0 = 4t - 0t. Let c(p) = -2p + 2 + 5p + tp. Suppose -95o = 78 + 492. Give c(o). -16 Let p(r) = -17 - 16 + 9r - 6r2 - r3 + 39. Calculate p(-7). -8 Suppose 0 = -3q + 39 + 18. Suppose 4w - 7 = -q. Let z(s) be the second derivative of s3/3 - s2/2 - s. Calculate z(w). -7 Suppose -73k + 77k = 20. Let b(g) = 7 + 39g + 4 - 37g - k. Give b(-4). -2 Let r be 9/(-6)8/(-6). Let q(s) = -s2 - r + 5 - 4 + s + s3. Let k(j) = -2j3 - 5j*2 + 6j - 6. Let i(m) = k(m) - 6q(m). What is i(1)? -7 Let f(g) be the second derivative of g5/20 - 5g*4/12 - 7g3/6 - g2 + g + 129. Calculate f(6). -8 Let w(a) = -a*2 + 6a. Let s(b) = -2b - 5. Let t be s(-5). Give w(t). 5 Suppose 5v + 2g - 13 = -2, -4g - 17 = -3v. Let z(x) = -4x - 1. Let j(l) = 17l + 5. Suppose 0u = -2u + 18. Let s(r) = uz(r) + 2j(r). Give s(v). -5 Suppose 0j = -4j + 12. Let u be (4 - j) + (-2 - -1). Let k(x) = -2 + 5x + 6 - 6x. Give k(u). 4 Let o(s) be the first derivative of s3/6 - s2/2 - 8s - 20. Let r(x) be the first derivative of o(x). Calculate r(2). 1 Let b(h) be the third derivative of h6/120 + h3/6 + 24h2. Calculate b(-1). 0 Let n(k) = 2k*2 - 12k + 5. Let r = -703 + 709. Calculate n(r). 5 Let p(a) = -a + 5. Suppose 4d - 236 = -2n, d + 353 = 3n + 6d. Let u = n - 112. Calculate p(u). 1 Let i be (16/(32/(-27)))/(3/(-4)). Let h(v) = v*2 - 19v + 17. What is h(i)? -1 Let y be (-2)/(-5)(-5)/(-3). Let k(c) be the third derivative of 3c*2 + 1/120c*6 - 1/30c*5 - 1/6c*4 + 0c + 0 + yc3. Give k(3). 1 Let r(a) = -5a*3 + 3a*2 - 2a - 6. Let x(t) = -4t3 + 2t*2 - t - 4. Let b(f) = -3r(f) + 4x(f). Calculate b(-2). 2 Let z(v) = -2v*3 - 5v*2 + 2v + 1. Let t(l) = l*3 + 5l*2 - 2l - 2. Let b(r) = 3t(r) + 2z(r). Let p be 3/(20/(-16)-4 + -4). Give b(p). 8 Suppose 4 = -3j + 7. Let u be (j/3)/(17/102). Let i(r) = 3r2 + ur*2 - 8r*2 + r + 4r*2. Give i(0). 0 Let x be (2/305)/((-1)/(-15)). Let p(r) = r*2 - 4r + 5. Calculate p(x). 10 Suppose 4i = -2v + 8i + 10, v - i - 5 = 0. Let z(u) = -u3 + 5u*2 + 2u - 9. Calculate z(v). 1 Let y(t) = -5t + 10. Let p(b) = 7b - 9. Let d(n) = 2p(n) + 3y(n). Determine d(6). 6 Let a(j) be the second derivative of 1/20j5 - 7/2j*2 + 1/6j*3 + 0j*4 - 10j + 0. Give a(0). -7 Let w(d) = -4 + 4 + 11 + 1 + 6d. What is w(7)? 54 Let f(m) = -m2 + m - 3. Let t be (-2 - -4) + 8 + -4. Determine f(t). -33 Let n(v) = -3v*3 - 6v*2 + v + 4. Let p(s) = 4s*3 + 7s*2 - s - 4. Let z(u) = 3n(u) + 2p(u). Let y be 4/26 - (-162)/(-39). What is z(y)? 0 Let c(g) = 6g2 - 1. Let p be c(1). Let m(l) = l2 - 7l + 5. Let q be m(p). Let h(j) = j3 + 5j*2 + 2j + 5. Determine h(q). -5 Let i(n) be the third derivative of -2n4/3 + n3/2 - 72n*2 - 1. What is i(2)? -29 Let j(u) = -3u*2 + u - 3. Let d(x) = -19x*2 + 7x - 9. Let z(y) = -d(y) + 6j(y). Give z(-4). 11 Suppose -5u = 2 - 27. Let n(p) be the third derivative of -p4/6 + p3/6 + p*2. Let i(s) = 2s - 1. Let f(k) = 5i(k) + 2n(k). Determine f(u). 7 Let t(z) = z*2 + 30z + 23. Let s(u) = 7u + 6. Let g(p) = -9s(p) + 2t(p). Give g(4). 12 Let c(q) = q2 - 7q. Let o be (-3 - (-1 + -2)) + 8. Let l = o - 14. Let d = 9 + l. Determine c(d). -12 Let u(l) = l3 + l2 - l + 1. Suppose -14 = 3a + 5m, 3a - 6 = 2a + m. Suppose 3h = 5k + 14, -4 = 3k - ak. Calculate u(h). -1 Let a(g) = g - 4. Let u(k) be the second derivative of -k*3/2 - 9k*2/2 + 2k. Let s be u(-9). Suppose 3b - b - 5r = -21, 2r = -4b + s. Give a(b). -2 Let r(u) = 7u + 5. Let c(t) = -3t - 3. Let w = -3 - -1. Let q(l) = wr(l) - 5c(l). Suppose 4s + 20 = -0	{ "pile_set_name": "DM Mathematics" }
4o - 3 - 1 = f. Let j = n + 41. Solve 4 = -2c + jc for c. 2 Let a(s) = -3s - 124. Let q be a(-42). Solve qj - 6 = -16 for j. -5 Suppose -9y + 8y + 5 = 0. Suppose u = -2t - 1, -yu + 1 + 1 = 3t. Solve 4 - u = -3h for h. -1 Suppose 0 = -14u + 13u - 2, 0 = 3a + 4u - 13. Solve 0 = 4z - a - 9 for z. 4 Suppose 3j + 34 = -2m + 9, m = -2j - 13. Let x = m + 9. Let w be (0x/8)/(-2). Solve wv = v + 2 for v. -2 Suppose 0f - 2f + 8 = 2o, 5f + 3o = 12. Let r = 154 - 56. Suppose f = 5n - g - r, -6 = -5g + 2g. Solve -d + n = -5d for d. -5 Let k(m) = -m. Let s be k(-3). Suppose 5y - 3x = 35, -sy + 4 + 13 = -x. Solve yi = 5 + 11 for i. 4 Let g be (-4)/6(-5 + -1) - 4. Suppose h = 3x + 11, g = -6h + h - 2x + 38. Solve 5n - 3 = hn for n. -1 Suppose 0 = -4v + 5s - 4s + 10, 2v - 12 = -3s. Let q(t) = -t2 + 8t - 10. Let j be q(v). Solve -ja = -6a - 1 for a. -1 Let l(q) = -q*2 + 5q + 7. Let c be l(6). Suppose 2u - c = n - 2, -u = -3n + 8. Suppose -3r + 3d - 6 = -3, 4d - 8 = 0. Solve n = o + r for o. 2 Let w be 1/(-4) - (-21)/(-28). Let h be 4/812 + w. Solve hn = 3n for n. 0 Let s be (-30)/((-180)/12) - -1. Suppose -m + 4m = 15. Solve -sq + 4 = -mq for q. -2 Suppose -2985i = -2984i - 3. Solve 4f - i = 7f for f. -1 Suppose 4h - 12 = -0h. Let m = h - 0. Suppose -7b + 8 = -mb - 3p, 5p - 45 = -5b. Solve 0z - 25 = bz for z. -5 Let h = -55 + 64. Suppose -7m - 2 = -hm. Solve 0 = -7c + 6c + m for c. 1 Let i = 3 - 2. Let f(c) be the second derivative of -c*4/12 + 3c*3/2 + 6c. Let k be f(9). Solve 4q - 15 - i = k for q. 4 Let l(i) = i - 18. Let c be l(22). Suppose -5x = -4b - 69, 0b - 68 = -5x + 3b. Suppose -4m - 1 = -2g - x, 5g = 4m - 18. Solve m = -cw - 2 for w. -1 Let o(l) = -l3 + 4l*2 - l + 2. Let q be o(3). Solve q = 5g - 9g for g. -2 Suppose -39k + 34k + 25 = 0. Solve p - k = -0p for p. 5 Let q(b) = b*3 - 9b*2 + 7b + 8. Let j(s) = -s*3 + 7s*2 + 8. Let i be j(7). Let g be q(i). Solve -5 = h - g for h. -5 Let h(a) = 4a - 18. Let m be h(5). Let s = m - -1. Solve 0 = y - sy - 6 for y. -3 Let i(a) = -a3 - 8a*2 - 3a - 9. Let y be i(-8). Let n = y - 16. Let d be (-4)/(-16)n-8. Solve dt - 2 = 4t for t. -1 Suppose 18o + 32 = 104. Solve -oj + 15 = j for j. 3 Let r(j) = j*3 - 6j*2 - 25j - 13. Let y = -10 - -19. Let s be r(y). Let v be (-2)/(-8) + 11/4. Solve s = -vg - 10 for g. -5 Suppose 0b = 2b - 6. Suppose 0 = 57w - 54w - 9. Solve w + b = -2c for c. -3 Let v = -22 - -22. Suppose -4o + 2j - 3j + 128 = v, 5o - 3j - 160 = 0. Suppose 5r - o = r. Solve r = -2i - 2 for i. -5 Let l(b) = -b. Let y be l(-8). Let u = 10 - y. Suppose -uh = -5h + t + 14, -22 = -5h + 3t. Solve -5v + h = -10 for v. 3 Let p(j) = j*3 + 15j*2 + 27j + 13. Let v be p(-13). Solve vo = 2o for o. 0 Let g be 2/(1 + 1)0/(-11). Let s = -13 - -3. Let j be ((-8)/s)/((-5)/(-75)). Solve 4c + 4 - j = g for c. 2 Suppose 7o = 5o + 16. Let c be ((-10)/1)/((-4)/o). Let b = c - 14. Solve -3r = -9 - b for r. 5 Let y(x) = 2x + 14. Let b be y(-4). Solve -b = 4u + 14 for u. -5 Let q(w) = w3 + 3w*2 - 5w - 4. Let x(p) = 3p + p + p - 2 - 6p. Let u be x(2). Let r be q(u). Solve -z - z = r for z. 0 Let a be (-2 - 1 - 0) + 8. Suppose 2n = 4r + 4n - 82, -4r + 4n = -52. Let h = r - a. Solve -2c = h - 3 for c. -5 Let u be (-18)/(-5) - 36/60 - -2. Solve -ua = -10a - 5 for a. -1 Let f be ((-10)/8)/(1/(-4)). Suppose 0 = 6r - 4r - fw - 25, -15 = 5r + 3w. Suppose p + 0 - 2 = r. Solve -3 = pv - 5 for v. 1 Suppose 49 - 69 = -4s. Solve 24 - 9 = sa for a. 3 Suppose -3n + 7n + 3v = 39, 6n - 3v = 21. Let c = 4 + -1. Solve c = -3t - n for t. -3 Suppose 14g - 10g = 84. Solve -5m + 4 = -g for m. 5 Suppose 0 = t + 2h - 24, t + 5h - 16 = 2. Let m be (-1)/(-3 + 80/t). Solve -md = -9d for d. 0 Suppose 2s - 27 = 15. Let r(n) = n + 12. Let v be r(6). Let o = s - v. Solve 0 = ow - 0 + 3 for w. -1 Let n = 700 - 690. Solve -nm + 4m + 30 = 0 for m. 5 Suppose 0 = 3s - 9, 20 = 3r - 4s + 8. Let b = r - 11. Let o = b - -4. Solve 4 + o = i for i. 5 Suppose -2f = 3 - 17. Let z = -7 + f. Suppose -3n + 2n + 5 = z. Solve j = 2j - n for j. 5 Let f be (4/6)/((-6)/(-27)). Suppose -7q + 2q = l - 55, 25 = 5l. Suppose -6p + q = 4. Solve -k - p = -f for k. 2 Suppose 2n - 5i - 11 = 0, -12 = -n - 4i - 0. Solve 0 = 11y + 36 + n for y. -4 Let t = 2 - 0. Suppose 3s - 4d = 31, 4s - 45 + 17 = td. Let c be (-9)/(9/(-3)) + -3. Solve c = -0w - sw - 10 for w. -2 Suppose 3p - 9p = -282. Let d = p - 37. Solve -5o - 30 = -d for o. -4 Let d = 187 + -115. Suppose -6q + 2q + d = 0. Let j = -13 + q. Solve -ju - 24 = -9 for u. -3 Let b be 28/8 - (27/6 - 4). Suppose 3z - 42 = -r, z = br + r + 27. Solve -z = -6o + 3o for o. 5 Suppose h = -3i + 7i, -2h = -4i - 4. Let j be (h/(-6))/((-5)/15). Solve -y - 12 = jy for y. -4 Suppose -5m - 4w - 13 = -4m, 1 = w. Let l = m - -22. Solve -ld - 10 + 0 = 0 for d. -2 Let b(z) = -6 - 33z + 21z - 9 + z2. Let f be b(14). Suppose -33 + f = -5u. Solve 0m - m + u = 0 for m. 4 Suppose 2t = 4w + 64, t - 2w = -7w - 3. Let v = 14 - 9. Let m = 234 - 232. Solve -m = -vh - t for h. -4 Let l(x) = -x*3 + x - 1. Let z(g) = -4g*3 - 6g*2 - 2g - 5. Let w(b) = 5l(b) - z(b). Let j be w(7). Solve -2t - 3t - 25 = j for t. -5 Let r be 22/3 - (10 - 174/18). Solve 10k = rk - 9 for k. -3 Suppose -30 = -n + 23. Let g = n - 32. Let a be 20/6 - 7/g. Solve -t = -at + 2 for t. 1 Suppose -5h + 4h + 17 = 0. Solve 5s + 8 = -h for s. -5 Suppose 15l - 60 = 12l. Let d = l + -5. Solve -j = -4j - d for j. -5 Let v = -77 - -73. Let a(c) = c*2 + c - 9. Let k be a(v). Solve -3r + 0 = -k for r. 1 Let y be (-2)/(-4)8 + 0. Suppose 5f - 63 = -0f - 4w, 51 = 5f - 2w. Suppose fx = 13x - 4. Solve 2b + y = -x for b. -3 Suppose -z - 2z = 0. Let m(x) = x + 5. Let c be m(z). Let r(v) = 137v - 680. Let u be r(5). Solve -10 + c = uf for f. -1 Suppose 3k = 3s - 141 + 27, 0 = -2s + 5k + 70. Solve 3a = -5a + s for a. 5 Suppose 2w = -r + 268, 0 = -4w - 4r + 5r + 524. Solve -5v + w = 142 for v. -2 Let y(r) = -r + 21. Let o(i) = -1. Let j(m) = 18o(m) + 2y(m). Let h be j(12). Solve 2c - 2 + 8 = h for c. -3 Suppose 20j - 200 + 40 = 0. Solve j = 2i + 2i for i. 2 Let j(m) = m3 - 21m*2 + 38m + 3. Let h be j(19). Suppose -15w + 12w + 51 = 0. Let k be 5(1 + -2 + 2). Solve kg = h + w for g. 4 Let i(a) = a + 18. Let y be i(-18). Suppose y = -4o + 60 - 48. Solve -n = -on for n. 0 Let f = 192 - 189. Solve -6 = -z - f for z. 3 Suppose 7k - 28 = 2k - 3n, 17 = 4k - 3n. Solve 3 + k = 2l for l. 4 Let a be (2/4)/(868/96 + -9). Solve az + 16 = -32 for z. -4 Let j(b) = -b3 + 9b*2 + 9b + 12. Let v be j(10). Let k(g) = 8g2 - vg*3 + 4g*3 - 9g + 6 - g*3. Let r be k(-9). Solve r = -z + 4z for z. 2 Let t(v) = v - 14. Suppose y = -3y + 104. Suppose -2d + 38 = 3i, -2d = -3i + 84 - y. Let w be t(i). Solve -4 - 6 = -wj for j. 5 Suppose 8t = 10t - 130. Suppose -60 = -69o + to. Solve -o = -10j + 5j for j. 3 Let k(x) = -3x - 31. Let z be (12/(-18))/(3/54). Let t be k(z). Solve -5s - 20 = t for s. -5 Suppose 0 = 3i - 2i - 12. Let g(p) = 5p. Suppose -9 = -4s + 5w, 4 = s - 2w + 1. Let y be g(s). Solve i + 3 = -ya for a. -3 Suppose 19g - 8 + 8 = 0. Solve g = 29v - 74 + 16 for v. 2 Let c(q) = -q + 13. Suppose 2k = -5a + 57, 0 = a - k + 4 - 14. Let v be c(a). Suppose -o = -v - 0. Solve os - 4s - 6 = 0 for s. -3 Suppose 2 = 3s + 5. Let r be 0s/21. Solve -10 = -rw + 2w for w. -5 Suppose -2p + 18 = -2y, 4y = 4p + 5y - 11. Solve -1 = -pr - 21 for r. -5 Suppose -106c + 61c + 135 = 0. Solve 4s - 9 = c for s. 3 Suppose y = -2z + 12, 4z + 4y = 36 - 4. Let w be 0 - -1 - (-1 - -2). Solve zp + p = w for p. 0 Suppose l - 46 = -5i, -3l - 3i = -0i - 78. Suppose 0k - 3k = 2b - l, 4b = 5k - 13. Suppose 6 = kc - 4c. Solve -cs = -3s for s. 0 Let t(y) = -2y2 - 4y - 2 + 4y2 - y3 - 7y*2. Let r be t(-4). Let a be (8/(-10))/(r/5). Solve 0 = ax + 2 + 2 for x. -2 Let j(s) = -3s + 4. Let d be j(-3). Solve -14k = -dk - 5 for k. 5 Let o be (-1)/((-6)/842). Solve 0 = 2k + ok - 27 for k. 3 Le	{ "pile_set_name": "DM Mathematics" }
1)/3 Suppose -4 = -n + 2. Let m = -4 + n. Factor -c*2 + 3c*2 + m + 0c*2 + 4c. 2(c + 1)2 Let a be (-74)/45 - (0 - 2). Let o(w) be the second derivative of -8/15w*5 - 1/18w*4 + 0 + 1/9w*3 - 2w + 0w2 + aw*6. Find y, given that o(y) = 0. -1/4, 0, 1/4, 1 Factor 56/5l*2 + 3/5l*4 + 0 + 16/5l + 5l3. l(l + 4)*2(3l + 1)/5 Let u(q) = -q2 + 2q - 1. Let z(y) = y*3 + 14y*2 + 14y + 19. Let b be z(-13). Let w(l) = -9l2 + 16l - 7. Let s(m) = bw(m) - 51u(m). Factor s(k). -3(k - 1)(k + 3) Suppose 8 = -7j + 9j. What is v in -15/4v + 9/4v*2 + 3/4v*3 + 3/2 - 3/4v*j = 0? -2, 1 Let l = -92 + 94. Factor 1/2c*2 + l + 2c. (c + 2)2/2 Let w = -1/6 - -5/6. Determine p so that -w - p2 - 3p + 4/3p*3 = 0. -1, -1/4, 2 What is n in 2/5n - 2/5n3 - 2/5n*4 + 0 + 2/5n2 = 0? -1, 0, 1 Let l(n) = -n2 + 3n + 1. Suppose 4k - 19 = -7. Let z(g) = -kg + 5g - g. Let d(s) = -l(s) + 3z(s). Let d(c) = 0. Calculate c. -1, 1 Let w(j) be the third derivative of j8/5040 - j6/540 + j4/72 - j3 - j2. Let f(p) be the first derivative of w(p). Factor f(h). (h - 1)2(h + 1)*2/3 Let u = 1 - -1. Factor 4g*2 - ug - g*3 - 4g*3 + 3g*3. -2g(g - 1)2 Factor -4/3k*2 + 0 + 2/3k - 2/3k5 + 4/3k*4 + 0k*3. -2k(k - 1)3(k + 1)/3 Suppose -10o + 16 = -6o. Let k be ((-9)/(-24))/(o/8). Factor -1/2g + 1/4g*2 + 0 + kg*3. g(g + 1)(3g - 2)/4 Suppose 3c - 12k + 16k + 5 = 0, 0 = 5c + 3k - 10. Find z, given that -3/5z*3 - 3/5z*4 + 0z - 1/5z2 - 1/5z*c + 0 = 0. -1, 0 Let w be 1/(-2)(3 + -3). Suppose 5s - 6 - 4 = w. Factor -k - k2 + ks + k2 + 2k. k(k + 1) Let u(j) = -2j*2 - 3 + 0 + 3 + 4j*3. Let g be u(2). Determine r, given that -gr + 3r2 + 8 + 10r*3 + 4 - 12r*2 + 17r*3 = 0. -1, 2/3 Let c(h) be the first derivative of -10h*6 + 424h*5/5 - 280h*4 + 448h*3 - 352h*2 + 128h - 17. Find x such that c(x) = 0. 2/5, 2/3, 2 Let l(u) = 2u - 3 - u4 + u - 2u3 + u2 - u. Let n(i) = 148 + 3i - i3 - 149 - 2i. Let y(s) = 2l(s) - 6n(s). Find d such that y(d) = 0. -1, 0, 1 Let u(v) be the second derivative of 0v2 + 0 - 1/10v*5 + 0v*3 - v + 1/30v*6 + 1/12v4. Factor u(c). c2(c - 1)2 Let q = -275/12 + 23. Let p(l) be the third derivative of 0l + 0 - ql4 + l2 - 1/30l*5 + 0l*3. Factor p(v). -2v(v + 1) Find j such that -3j*4 - 3j - 304j2 - 3j*5 + 3 + 6j*3 - 6 + 310j*2 = 0. -1, 1 Let f(i) be the second derivative of 0 + 1/12i*4 - i - 1/2i*2 + 0i*3. Factor f(a). (a - 1)(a + 1) Suppose 0r - 1125 = -5r. Find p such that 225 + p3 - r - p5 = 0. -1, 0, 1 Let m(b) be the third derivative of b*5/100 + 3b4/40 + b3/5 - 35b2. Find t, given that m(t) = 0. -2, -1 Let c(h) be the third derivative of -h8/112 - 3h7/70 - h6/20 + h*5/10 + 3h4/8 + h3/2 - 13h2. Factor c(w). -3(w - 1)(w + 1)4 Suppose -32/3j + 2/3j2 + 128/3 = 0. Calculate j. 8 Solve 2r*4 + 2r*5 - 3r4 - r4 + 0r5 = 0 for r. 0, 1 Let r be 462/12(-6)/9. Let t = 27 + r. Find h such that 6h3 - 40/3h*2 + 26/3h - t = 0. 2/9, 1 Factor 9/2 + 30q + 50q*2. (10q + 3)*2/2 Factor 0z*2 - 1/6z*3 + 0z + 0 - 2/3z4. -z3(4z + 1)/6 Let g(b) be the first derivative of b3 - 9b*2 + 27b - 17. Factor g(w). 3(w - 3)2 Suppose -10n*2 - 2n*3 + 7n4 + n4 - 6n - 6n4 = 0. Calculate n. -1, 0, 3 Let l(w) be the second derivative of -w9/37800 + w7/6300 - w4/4 + w. Let s(t) be the third derivative of l(t). Let s(z) = 0. Calculate z. -1, 0, 1 Let d(z) be the third derivative of 1/4z4 + 9/20z*5 + 0 + 0z + 0z3 + 2z*2. Factor d(f). 3f(9f + 2) Suppose d - 16 = 5n, -n - 128 = -3d - 2d. Suppose 3t + 4 = -b + 21, -4t = 3b - d. What is k in 1/3k3 - 1/3k*5 + 0 - 1/3k*4 + 0k + 1/3kb = 0? -1, 0, 1 Let s(f) be the third derivative of -3f*5/100 + 47f4/120 - f3/3 - 18f2. Find c, given that s(c) = 0. 2/9, 5 Let r(j) be the first derivative of -5j*4/12 + 2j3/3 - j2/6 - 5. Let r(a) = 0. Calculate a. 0, 1/5, 1 Let m(f) be the first derivative of -21f4/16 - f3/4 + 3. Factor m(q). -3q*2(7q + 1)/4 Let r be 3 - (3/5 + (-94)/(-60)). Let b(l) be the second derivative of -rl*4 - 4l*2 + 1/10l*5 + 8/3l*3 + 2l + 0. Factor b(m). 2(m - 2)2(m - 1) Let l(y) be the second derivative of 3y - 1/4y*4 - 2y*3 + 0 - 6y*2. Factor l(s). -3(s + 2)*2 Let a(o) = 18o3 - o2 + 7o + 6. Let b(q) = 17q*3 - 2q*2 + 6q + 5. Let i(p) = 5a(p) - 6b(p). Find d such that i(d) = 0. 0, 1/4, 1/3 Factor -3/5f5 + 3/5f*3 + 0 + 0f - 3/5f2 + 3/5f*4. -3f*2(f - 1)*2(f + 1)/5 Let i(k) be the first derivative of 1/8k4 + 1/3k*3 - 3/4k*2 + 0k - 1. Factor i(t). t(t - 1)(t + 3)/2 What is w in 20/3w4 - 4/3 - 16/3w*2 - 8/3w*5 - 8/3w*3 + 16/3w = 0? -1, 1/2, 1 Let v(o) be the second derivative of -o7/63 - o6/45 + o5/30 + o4/18 - 4o. Factor v(b). -2b*2(b - 1)(b + 1)2/3 Determine m so that 125/3m*4 - 180m*2 - 32/3 + 350/3m*3 + 232/3m = 0. -4, 2/5 Let j(c) be the first derivative of 27/4c - 9/4c*2 + 4 + 1/4c*3. Find o such that j(o) = 0. 3 Let d = -19 + 19. Factor 4/5 + 2/5c*3 - 6/5c + dc2. 2(c - 1)*2(c + 2)/5 Let s(u) be the first derivative of -2u6/3 - 4u*5/5 + 3u*4 + 20u*3/3 + 4u2 + 8. Find r such that s(r) = 0. -1, 0, 2 Let y(t) be the third derivative of t6/360 + t5/90 - t4/24 + 17t2. Solve y(g) = 0. -3, 0, 1 Suppose -5t - 19 = -5z - 2t, 4z - 2t = 14. Solve 27 + 3kz + 4k - 18k - 4k = 0. 3 Let q(f) be the first derivative of -f*4 - 4f*3/3 + 10f*2 - 12f + 16. Factor q(t). -4(t - 1)2(t + 3) Let r(i) be the third derivative of i5/15 + i4/3 + 12i2. Factor r(z). 4z(z + 2) Let i(u) be the second derivative of -u5/15 + u4/9 + 4u*3/9 - 14u. Determine t, given that i(t) = 0. -1, 0, 2 Let v = 59/114 - 1/57. Factor -1/4g2 + 0 + 1/4g*3 - vg. g(g - 2)(g + 1)/4 Find q, given that -9q4 + 22q - 21q2 + 12 - 65q + 31q + 30q*3 = 0. -2/3, 1, 2 Let w(f) be the second derivative of -3/8f*4 - 1/20f5 + f2 - f*3 - 3f + 0. Let n(m) be the first derivative of w(m). Factor n(g). -3(g + 1)(g + 2) Let w(h) be the first derivative of h6/270 - h5/120 - h*4/72 - 5h*3/3 + 4. Let m(x) be the third derivative of w(x). Factor m(y). (y - 1)(4y + 1)/3 Suppose a2 + 0a2 - a4 + 144a + 0a4 - a3 - 143a = 0. What is a? -1, 0, 1 Let w(c) = c2 - c. Let s be w(2). Factor -12d + 4 - 5 + 9 + 4ds. 4(d - 2)(d - 1) Let i be (-3 - -4 - 7)(-1)/2. Let l(u) be the first derivative of 1/2u - i + 1/2u*2 + 1/6u3. Factor l(j). (j + 1)2/2 Let y(u) be the second derivative of 1/20u5 + 0u*3 - 1/42u*7 + 0 + 0u*2 - 1/12u*4 + 1/30u*6 + 3u. Factor y(a). -a*2(a - 1)*2(a + 1) Suppose 21 = 3g - 4j, -g - j = 3g - 9. Factor -12 - 4h*2 + gh*3 - 3h - 6h2 - 5h*2 + 27h. 3(h - 2)2(h - 1) Let z(r) = 2r2 + 3r + 3. Let g be z(-2). Suppose 6n + gi = 3n + 10, -4i = n - 1. Find u, given that 3u4 + 5u4 + u3 - nu4 = 0. -1/3, 0 Let w = 0 + 3. Factor -4k*5 + 8k5 - k4 + wk4 + 2k*4. 4k*4(k + 1) Let d(u) be the first derivative of u*3 - 3u - 11. Factor d(t). 3(t - 1)(t + 1) What is y in 11/7y2 - 4/7 - 25/7y*4 + 12/7y - 30/7y3 = 0? -1, 2/5 Let i be (1 - (-21)/(-9)) + -1 + 3. Factor 0s*3 + 0 + is*2 + 0s - 2/3s4. -2s*2(s - 1)(s + 1)/3 Let x be 12/54 + (-300)/(-108). Find d, given that 4/3d*2 + 1/3d - 2/3 + 1/3d5 - 2/3d*x - 2/3d*4 = 0. -1, 1, 2 Determine c, given that 1/7c*2 + 6/7 + c = 0. -6, -1 Let r = 150 - 73. Let d be 1/(-2) - r/(-66). Let -4/9x*4 - 2/9x + dx2 - 2/9 + 2/9x3 = 0. Calculate x. -1, -1/2, 1 Let r(l) = l3 + 1. Let k(m) = -5m3 - 2m*2 + 2m - 1. Let b(d) = -2d2 - 8d + 7. Let g be b(-5). Let o(y) = gr(y) - k(y). Factor o(u). 2(u - 1)(u + 1)2 Let i be -1 - -2 - 60/64. Let h(y) be the first derivative of 0y + 1/24y6 + 0y*3 + 1/10y*5 - 2 + iy*4 + 0y2. Factor h(l). l3(l + 1)2/4 Let b = -50/19 + 502/133. What is d in 1/7d*3 - 4/7 + bd - 5/7d2 = 0? 1, 2 Factor -41425c*2 - 20495c*3 + 7106c - 1681 - 3815c4 - 819 - 245c**5	{ "pile_set_name": "DM Mathematics" }
)/1852)? 21 What is 1625/(-650)148/(-10)? 12 ((-147)/5620/(-35))/((-3)/10) -5 (8/(-24)(135/(-50))/3)/(-9) -1/30 Calculate ((-14)/(-14))/(5/(-45)). -9 What is ((-100)/(-300))/(1/782)? 13 What is the value of (-3)/(21/254133)? -11 Calculate (-7)/(((-14)/21)/((-204)/(-63))). 34 Calculate 161/92-24/(-56)-26. -13/2 (1/32)/(((-15566)/(-2193))/(-181)) -17 What is 9/15(-9900)/594? -10 Calculate (-87)/(-87)((-1)/(-1))/1. 1 What is (((-3)/(-35))/(6/(-8)))/((-16554)/(-13795))? -2/21 What is the value of (8/(-13))/(658/(-4277))? 4 What is -2(-110)/(-125)5(-140)/(-112)? -11 What is the value of (-576)/(-144)2/(-48)? -1/6 40/6862/(-155) -4/17 What is the value of ((-4)/95)/(((-2254)/(-245))/23)? -2/19 Evaluate (1/(-3))/((222/108)/37). -6 Calculate (-16)/(-36)2/(-8). -1/9 Calculate 21/(-1260)-1250/(-5). -2 What is (-1059)/(-3530)(-4)/(-6)? 1/5 Evaluate -542/(-12)-1. -9 What is (-456)/228(-2)/412/8? 1/41 What is the value of (-950)/150(-9)/(-3)? -19 Calculate ((-2)/6)/((-216)/(-3240)). -5 Calculate ((-3)/((-10)/10))/((-2)/(66/9)). -11 Calculate (((-42)/(-6))/(-35))/((256/(-16))/(-1520)). -19 Evaluate (-33054)/3935(-10)/(-4). -21 What is the value of (-22)/22(-12)/(-4)? -3 ((-10)/(-12))/(-19180/(-1026)) 1/4 59/((-1888)/32)-218 36 (2/(-21))/1(-133)/3044 1/6 What is (-3)/((-3)/(-5))6(-75)/90? 25 Calculate ((-4)/(-22))/(121/((-25289)/(-228))). 1/6 What is the value of (538/(-20713))/((-6)/(-22))? -2/21 (6/10-18)/(72/(-120)) 18 What is the value of (-34)/((-544)/(-32))((-14)/(-64))/(-7)? 1/16 What is 3(-23)/(9660/28)? -1/5 Calculate 92235/(-3354)2/5. -11 Evaluate 115210/(-315). -10 Evaluate ((-1083)/(-2527))/(4/(-14)). -3/2 What is 12/(-10)(-83655)/(-3861)? -26 What is the value of (-40)/(-30)5(-30)/(-4900)? 2/49 Calculate (1/7)/((-110)/(-385)). 1/2 Calculate ((-1)/(-63)1)/(18/(-3564)-66). 1/21 What is the value of ((-5)/302)/((16/120)/(-2))? 5 ((-3)/1)/12644/(-483) 1/3 Calculate (-144)/(-360)3/(-6). -1/5 What is (-1)/(-2)-5210/(-2100)? 1/4 Calculate ((-396)/495)/((-16)/(-100)). -5 What is (-1)/(((-135)/(-3375))/(1/(-5)))? 5 Evaluate (23/207)/((-1)/(-2)). 2/9 What is ((-1235)/(-76))/(275/(-660))? -39 Evaluate (-72)/108(-7)/(-70). -1/15 (-117)/1092-28(-24)/(-2) 36 Evaluate (11/((-110)/15))/((-2)/16-6). -2 What is (2(-1)/4)/(((-460)/(-880))/23)? -22 Evaluate 3/11(-12)/18. -2/11 Evaluate (-45)/30(-21)/((-14)/(-2))6. 27 -712/12(45/10)/3 -21/2 ((-2)/((-36)/(-2)))/(2/(-3)) 1/6 What is the value of ((420/1000)/7)/((-63)/28)? -2/75 What is ((-608)/1368)/((40/6)/2)? -2/15 What is 11(2(-1)/5)/((-26)/65)? 11 Evaluate ((-8)/3)/2(-90)/60. 2 What is the value of ((-75)/(-5900))/(15/40)? 2/59 57/(570/4)(275/(-2))/(-5) 11 Calculate (-8)/(1008/(-18))-81. -8/7 What is the value of 660/(-110)4/252? -2/21 Calculate ((-3)/2)/(90/(-70)1). 7/6 What is (-96)/(-176)330/(-240)? -3/4 11170/(-52)(-12)/(-15) -18 What is the value of ((-175)/(-225))/(56/(-96))? -4/3 Calculate (-70)/430/140. -15/4 Evaluate (3/(-4))/((-99)/(-22)). -1/6 Evaluate 28/(-63)81/126. -2/7 (-40)/(-25)(-100)/(-16) 10 Calculate ((-16)/(-8))/(-52)(-11)/(55/(-20)). -2/13 What is (3/((-36)/21))/(6/(-24))? 7 Calculate ((1265/(-1430))/(1/2))/(16/(-208)). 23 ((-4)/12)/(28/546)(-72)/117 4 ((-52)/130)/(((-3)/(-5))/((-57)/(-703))) -2/37 Evaluate 14-66/42. -12 What is (-2)/(168/6)22/11? -1/7 What is (120/70)/(9/1525/70)? 8 What is 1/51(-200)/940? -2/47 What is the value of ((-72)/(-16))/((-19)/(-76))? 18 Evaluate (9/(-72))/((-60)/96). 1/5 What is the value of 6/(((-2)/4)/(80/120))? -8 Calculate ((-36)/(-12))/(18/(-6)). -1 Evaluate (-12)/13(-3302)/127. 24 Calculate 50/(-2850)2/(96/(-18))-8. -1/19 What is the value of -7-11/(-2)1053/(-4914)? 3/4 Calculate -24(-4)/26/24. 12 What is ((-24)/(-243))/((-10)/(-3))(-516)/344? -2/45 What is ((-2)/12)/(11/(264/(-3)))? 4/3 What is 3/(-8)(1834/(-1179))/((-5)/(-6))? 7/10 (704/5808)/(4/6) 2/11 ((3887/78)/(-23))/(2/(-12)) 13 (((-672)/(-28))/(-48))/(4/(-216)) 27 What is (224/1344)/((-2)/18)124/(-6)? 31 Calculate (((-114)/209)/1)/(6/(-44)). 4 What is the value of (3/(-1))/(3(-130)/30)? 3/13 What is (32/(-480)5)/(-22/36)? 3 Evaluate 18/(-24)(18/54)/((-3)/(-2)). -1/6 222/13323/(-1) -1/2 What is the value of 2(((-6)/(-7))/(-2))/((-2658)/96131)? 31 What is -217125/450? -19 Evaluate 40/(-30)(-115)/20. 23/3 What is the value of (55/10)/((-33)/66)? -11 Evaluate 8/(-168)47/8. -1/6 What is the value of (-4)/(18/((-540)/(-105)))1/(-20)? 2/35 What is 75/(-5)(5/(-1))/(-15)? -5 Evaluate (555/(-75))/(1/3). -11 What is the value of ((36/27)/((-10)/(-15)))/(2/2)? 2 What is the value of ((-24)/(-432))/(51/6)? 1/15 What is -10(-3)/1212/112550? 4/3 ((-2)/(-4))/(-6(-40)/(-3520)) -22/3 Evaluate 124/93(2/8)/((-35)/42). -2/5 What is (2860/2002)/(8/14)? 5/2 Evaluate (770/(-11))/(-210)-94. -12 What is the value of (624/18)/(-712/(-21))? 2 Evaluate (16/12)/(((-1156)/(-1071))/(-17)). -21 What is the value of ((-476)/14)/(-7072)24? 3/26 (24)/(26(-23)/((-368)/(-8))) -8/13 What is (3/(9/6))/(-4)(-1)/10? 1/20 What is the value of 1001/(-429)(-2)/3? 14/9 What is the value of (72/(-16))/(9/(-6))? 3 What is the value of ((-3)/75-5)/((-126)/90)? -1/7 What is the value of (-510)/(-3740)(-2)/1? -3/11 Evaluate (30/230)/(((-195)/(-10))/13). 2/23 What is the value of ((-2)/22)/(((-528)/(-12))/(-44))? 1/11 Evaluate 1551/(-125)15. -9 ((-24)/(-3))/(((-3)/(-36))/(15/80)) 18 What is the value of -2(-9)/(-27)-1? 2/3 What is the value of 18/16(-26880)/(-2016)? 15 What is the value of ((180/(-2475))/((-4)/5))/((-1)/(-8))? 8/11 What is 26/(2288/330)8/(-18)? -5/3 What is 91/117(-30)/(-70)? 1/3 18/15155/62 3 ((-4)/182-3)/((-29)/609) -18/13 What is ((-169)/(-338)(-16)/18)/(110/(-9))? 2/55 What is the value of 14/((-504)/(-10))-241/(-15)? 4/9 Calculate (1/6)/(70/(-525)). -5/4 Evaluate ((-21)/(-336)16)/((-3)/45). -15 ((-2)/(66/187))/(2(-5)/60) 34 Calculate (19/57)/(25/(-6)). -2/25 What is the value of 42/987(-8)/2? -12 What is (-26)/(-4)126/912/3? 6 -12(6/28)/(164/2296) -36 What is (156/858)/((-45)/(-33))? 2/15 What is (-10)/((-77)/(11/(-1)))? -10/7 What is the value of ((-1140)/19)/(-20)-2(-2)/(-30)? -2/5 Calculate (-2)/((-10)/(-315)-45). 7/5 Evaluate (-1)/((-63)/12)2/(140/(-15)). -2/49 What is the value of (-24)/12(-15)/(420/266)? 19 Evaluate ((-7)/(-35))/((10/12)/(560/(-336))). -2/5 What is (2800/(-88200))/((-2)/45)? 5/7 What is the value of (5/(-15))/((-74)/(-1554))? -7 What is the value of (-37)/(2960/(-290))-8? -29 Evaluate 90/(-180)64/(-4). 8 Evaluate (252/(-105))/(34/(-85)). 6 What is the value of ((-225)/(-10))/(63/6)? 15/7 Calculate ((-8)/16)/(-2(-8)/128). -4 Evaluate 2/(((-138)/(-18))/23). 6 What is the value of (-2)/(-3)100/(-60)? -10/9 What is (12/14)/(33/(-77))-11? 22 Evaluate (((-4)/(-21))/((-52)/546))/(2/(-24)). 24 What is the value of (6/5)/(15/900-3)1? -24 (5/(165/12))/((-362)/3982) -4 Evaluate (-15)/20(-40)/(-45). -2/3 Evaluate -913/(-208)-16. -9 30/3(-176)/(-880) 2 What is the value of (78/247)/(6/(-2))? -2/19 (-10)/452(-11)/3086 2/21 What is the value of ((-32)/(96/(-9)))/(171/(-12))? -4/19 What is the value of (-154)/(-176)682/(-217)? -11/4 Evaluate -9(6/36)/(13/(-130)). 15 What is 3/(-21)(((-308)/33)/(-4))/(-2)? 1/6 (36/9(-9)/8)/((-147)/(-392)) -12 What is the value of ((-7)/924-6)/((-8)/32)? -2/11 What is ((-5)/14-4)/(-18/7)? -5/4 Calculate (((-160)/10)/16)/(((-3)/3)/(-13)). -13 What is (-14)/242(-19)/((-10640)/(-60))? 1/8 What is (-189)/2835(-5)/(20/12)? 1/5 Calculate (3360/98)/30(-1)/41. -2/7 Evaluate ((-4)/12)/((16/(-832))/(33/44)). 13 What is the value of (((-112)/24)/(-14))/((-20)/60)? -1 11/33(-36)/2 -6 What is 1/2264/198? 2/3 What is ((-192)/(-576))/((2/1)/(22/(-1)))? -11/3 What is the value of -52/9878/195? -2/49 What is 17/(170(-10)/(-2600))? 26 6(-3)/(-24)(-972)/81 -9 Calculate (-42)/(59/((-472)/(-16))). -21 What is the value of -5((-128)/120)/818? 12 What is 3822/3185(-10)/3? -4 Calculate (-43)/((-258)/(-156))-1. 26 Evaluate 12/(10/(180/27))7/70. 4/5 What is 6/189/6(-114)/95? -3/5 (1/3)/((-4)/7563) -21 Evaluate ((1216/16)/(-19))/((-2)/(-11)). -22 Calculate -68120/(-1680)228/(-8). -34 Calculate 4/(-47)*((-554)/(-831))/((-4)	{ "pile_set_name": "DM Mathematics" }
k Let f(x) = x*2 - 5x - 16. Let u be f(8). Let w(l) = -l*2 + 8l + 3. Let i be w(u). Suppose z = -iz - 4. Is z less than 1/7? True Let s = -0.002 - -0.662. Let w = s + 0.04. Are -2 and w nonequal? True Let b be -156 + 3 + -3 + 3. Which is smaller: b or -145? b Let h be (-5 - (-64)/12)(-72)/(-1324). Are 1 and h equal? False Suppose 0 = 11w - 818 + 246. Let q be (-6)/(-8) - (-205)/4. Is w < q? False Let u = 14 - 25. Let x = 3.01 + -6.01. Is x at least u? True Suppose 3c + 33 = -12. Let r = c - -17. Let t(j) = -2j - 1. Let d be t(-1). Which is bigger: d or r? r Let u(m) = 4m*3 + 3m - 4. Let b(p) = -3p3 + p2 - 3p + 5. Let h(s) = -3b(s) - 2u(s). Let v be h(3). Which is greater: v or 1? v Suppose 0 = -d - 0d - 3d. Which is smaller: -2/273 or d? -2/273 Let q = 1237 - 1222. Is 7 at most as big as q? True Let s = 41 - 41.158. Which is greater: s or 3? 3 Suppose 2y + 3m - 6 = 31, -2y - m + 39 = 0. Let v be (-5)/(y/(-16)) - 4. Let b = 18 + -13. Is b at least as big as v? True Let c be (-584)/368 - (-3)/2. Let z(v) = -v - 11. Let l be z(-12). Which is smaller: c or l? c Suppose -5j + 12 = -0g + 3g, -4j - 8 = -2g. Which is smaller: j or 39? j Let u = -0.06 - 32.44. Let g = u + -1.5. Is 0.2 greater than g? True Let i = 6.7 - 11.7. Suppose -h + 5y + 1 = 13, 4h + 2 = -3y. Let x be 2 + h + (1 - 2). Which is greater: i or x? x Let x = 20905/3 - 7070. Let h = x - -105. Is h < 3? False Suppose 2v + v = 156. Let a = v - -2. Is a greater than 54? False Let u = 409 + -447. Which is smaller: u or -17? u Let f = -502 + 500. Is -15.4 <= f? True Let x be 2(6/(-24))/(5/250). Which is smaller: 3/4 or x? x Let m(t) = -t3 + 13t*2 - 41t + 15. Let r be m(9). Let f(h) be the third derivative of 7h4/12 - h3/3 + 3h*2. Let o be f(-2). Is r at most o? True Let f(d) be the first derivative of -2d3/3 - d2 + 5d + 14. Let w be f(-4). Which is smaller: -20 or w? -20 Let u be ((-4)/(-8))/((-1)/34). Let g = u - -2. Let x = g - -21. Do x and 6 have the same value? True Suppose 5d - 49 = 2s, -19 = -s - 4d - 63. Let t be ((-92)/s - 4)/(6/(-8)). Which is smaller: 0.2 or t? 0.2 Let s = 2974785 + -3525119992/1185. Let i = -5/79 + s. Does i = 0? False Let n(a) = -4 + 4a + 4 - 3 + 0. Let d be n(1). Let o be -6(-1 + d/(-3)). Which is bigger: o or 9? 9 Let t be -22/(5 - 539). Is 1 less than or equal to t? False Let u be (-28)/4-1 + (-89991)/12859. Is u at least as big as 0? True Let v be 12/10(6 + -1 + -3). Which is greater: v or -8? v Let m = -284 + 301. Are 17 and m non-equal? False Let f = 5.565 - 4.48. Let n = -0.085 + f. Which is bigger: -2.1 or n? n Suppose -6m - 470 = 664. Let d = m + 3583/19. Which is greater: -1 or d? d Let x be (-30)/25 - 4/(-10) - -1. Let a = x + -1/55. Suppose -4z - f - 7 = 0, 5f + 15 = -3z + f. Which is smaller: z or a? z Let d = 74.6 + -75. Let h = 0.5 + d. Is h at least 3? False Let g = -3 + 3. Let z(y) = 3y + 14. Suppose -16 = 3j + o, -2o + o = j + 6. Let u be z(j). Which is bigger: u or g? g Suppose 2 - 42 = -2h. Suppose 17y = 21y - h. Suppose 7u - 8 = 5u. Is y bigger than u? True Let v(c) = -7c + 20. Let o(n) = -5n + 8. Let i(w) = -4w + 7. Let y(m) = 6i(m) - 4o(m). Let p(l) = -3v(l) + 5y(l). Let t be p(0). Are -11 and t non-equal? True Suppose 0 = x - 3u, -2x - 3u = 3x + 18. Let m be x/((-9)/15) - 15/10. Suppose 3h + 4g - 35 = -0g, -4g = -5h + 5. Is h > m? True Let y = 1559 - 1561. Let t = 2 - 3. Is y at most as big as t? True Suppose 0 = -n - 31 + 97. Let f be 153/n + (-1)/2. Suppose -24 = -10a + 2a. Which is smaller: a or f? f Let g be (-548)/(-36) - (2 + (-80)/45). Which is smaller: g or 14? 14 Let z = -23 - -17. Let y = 6.1 + z. Let m = y + -0.3. Which is greater: 2 or m? 2 Let v be (-10)/456/(-70). Suppose -4j - p - 374 = p, -vj - 196 = 4p. Which is greater: j or -93? j Let g = -0.6 + 0.599. Let f = 0.899 - g. Is f not equal to 1/4? True Let x = 66 + -72. Let a(q) = -3q*2 + 5q - 3. Let d be a(3). Let j = d - -12. Which is smaller: j or x? x Let w(s) = s*3 - 2s*2 + 2s. Let b be w(2). Suppose bp = -0p + 8. Suppose pt - 5t = 0. Do t and -3/11 have different values? True Let r(w) = 11w - 12. Let b be r(2). Suppose -bz - 6z = -32. Is z equal to 6/5? False Let f = -23410/459227 + 2/5813. Let g = f + 218/1185. Let c = g + 4/15. Which is smaller: -1 or c? -1 Let j = 16 + -14. Suppose -ju + 3 = -u. Suppose o - 2 = -u. Is -1/5 smaller than o? False Let c = -31 + 34. Suppose -2z - 32 = -5g + 88, 0 = -2g + cz + 48. Which is bigger: 26 or g? 26 Let u = -508 + 917. Which is bigger: -2 or u? u Let y = 19/15 + -4/3. Let o(q) = 0 - 4q + 0q2 - q2 - 6q - 9. Let m be o(-9). Which is smaller: m or y? y Suppose 1901l - 1915l = 1050. Let g = 17 - 92. Is l bigger than g? False Let o = 56 - 20. Let m be (-188)/o + (-8)/(-36). Suppose 4 = -g - g. Which is bigger: g or m? g Let w = -36 - -22. Let f = w + -5. Let q = 14 + f. Is q bigger than 0? False Suppose -4f + f = 3i + 6, -2i - f - 4 = 0. Let v be ((-9)/6)/((-7)/i). Let x = 0 - 0. Is v < x? True Let h = -91/15 + 31/6. Suppose -3p = 4u + 12, 9 = -p + 5p - 3u. Is h < p? True Suppose 0 = -7w + 9w + 1594. Is w greater than or equal to -797? True Let f = 672 - 436. Which is bigger: f or 1? f Let r = 4 - 4.06. Let o = r + 0.06. Let i = 0.04 - -0.06. Is i != o? True Let y = -3.9 - -4. Suppose 209k - 212k = -6. Which is smaller: k or y? y Let g(q) = 8q2 + q - 39. Let o be g(0). Which is greater: -3 or o? -3 Let n = -4640/3 - -1547. Is -1/435 less than or equal to n? True Suppose -112 = -w - 3. Let r = -982/9 + w. Let v = -14 + 14. Are v and r non-equal? True Suppose -3g - i = -6g + 26, -62 = -5g - 3i. Let r = -6 + g. Suppose 0 = rz - p + 15, -5p + 4 = 3z + 21. Which is smaller: z or -7? -7 Suppose v = -5 + 6. Suppose 3t + t + 12 = 0. Let l be 7 + t + 24/(-2). Which is greater: l or v? v Suppose s + 5b = -0s - 17, 35 = 5s - 5b. Is -6 > s? False Let y = -15 + 14. Let n = -85 - -1363/16. Which is bigger: n or y? n Let p = -62 - -249/4. Let u = 24 + -23. Let a be (9/(-7))/u - -1. Is p >= a? True Let q = -596 + 591. Which is smaller: -31/7 or q? q Let y(l) = l3 - 20l*2 - l + 22. Let v be y(20). Let q = 2 - v. Which is greater: q or -3? q Let k = -0.01 - 0.29. Let p = 1.31 - 0.01. Let y = p + k. Which is smaller: 0.06 or y? 0.06 Let p = -519/143 + 45/11. Suppose -2f + 1 = -1. Which is bigger: p or f? f Let r(v) = -3v2 + v + 2. Let u be r(2). Let x be -320/48u. Let z be (-5)/x - (-1)/(-2). Is 2/107 smaller than z? False Let o = 20 + -14. Suppose -on = -2n. Suppose -6i + 10i = n. Which is bigger: i or 1/39? 1/39 Let s be 1/(-4) - 34/(-8). Suppose -s + 4 = -2u. Let c = 1 + 0. Is u >= c? False Let y(h) = -h3 - h2 + 2h - 2. Suppose -24r = -26r + 14. Suppose -r + 15 = 4o. Let w be y(o). Which is greater: w or 1? 1 Suppose -7474 + 662 = -52a. Which is greater: 130 or a? a Let j = -100 + 99. Let r be (22/30 + j)(-20)/(-24). Which is smaller: r or 10? r Let u = -2 - -3. Let c = 1 - u. Let w(d) = d*2 - d - 5. Let p be w(c). Is p not equal to -4? True Suppose -11p - 660 = -6p. Let q be -23/p6. Do q and 0 have the same value? False Suppose 2w = -w - 21. Let j = -1.253 - -0.253. Which is bigger: j or w? j Let r(m) be the second derivative of m*4/12 + 3m*3/2 + 3m*2 - 12m. Let z be r(-9). Suppose -5k + 15 = -10. Is z less than or equal to k? False Let l(w) be the third derivative of w6/120 - 2w*5/15 + 7w*4/24 - 5w*3/6 + 8w*2. Let j be l(7). Which is greater: -2 or j? -2 Suppose -208r + 212r = 4. Which is greater: -2/4671 or r? r Let g(i) = -i3 + 7i*2 + 7i + 8. Let v be g(8). Suppose -6h - 3o + 51 = -2h, 5o - 25 = v. Let l = 15 - h. Which is greater: l or 5? l Let b = 307 - 7677/25. Let m be (-27)/6(1 + -3). Suppose -4k = -mk. Which is smaller: b or k? b Suppose -6c + 42 = -8c. Let i(x) = -x2 - 2x - 5. Let d be i(-5). Is d greater than or equal to c? True Suppose 6o - 45 = o. Suppose 45 = 13g - 4g. Suppose 0 = 4a + 16, g = 2s - 4a - 25. Is s <= o? True Let y be 29*(-3 - (-13 + 3)). Is y not equal to 203? False Let c = 0.2 + 0.8. Let d = 1.269 - -20.731. Which is bigger: d or c? d Let f = -41 - -46.9. Let o = -4.9 + f. Which is smaller: o	{ "pile_set_name": "DM Mathematics" }
. 4 Suppose 2n + 100 = 7n. Let q(z) = -z*3 - 7z*2 + 7z - 8. Let y be q(-8). Suppose y = -7h + 2h + n. What is the smallest common multiple of h and 16? 16 Let g = 27 - 19. Suppose 0 + 36 = 3o. What is the least common multiple of g and o? 24 Suppose -2d = 3 - 15. Calculate the lowest common multiple of 10 and d. 30 Let f = -8890/9 - -986. Calculate the common denominator of f and (4 + 22)(-1)/12 - 0. 18 What is the least common multiple of 1 and 2/4 + (-11)/(-2)? 6 Let l(q) = -41q + 1. Let v be l(1). What is the common denominator of 468/v + (-2)/5 and 101/22? 110 Let g(f) = f - 1. Suppose -24y + 16 = -23y. What is the lowest common multiple of g(5) and y? 16 Let d(c) = -c*2 - 7c - 6. Let h be d(-7). What is the common denominator of (-4)/h(-57)/(-8) and -2 + 3/30 - -2? 20 Suppose 0w - 5w = -50. Let c = 30 - w. Calculate the lowest common multiple of 10 and c. 20 Suppose -4l = -2x + 56, 5x - l - 63 = 41. Let s(c) = -4c - 6. Calculate the lowest common multiple of x and s(-5). 140 Let p = 118 - 106. What is the smallest common multiple of 2 and p? 12 Suppose 2t + o + 0o = 1, 5o - 5 = 2t. Suppose 0 = -tf - 5f + 185. Find the common denominator of -71/4 and (2/(-16))/(2/f). 16 Let x = 97223/4496 - 35391301/2657136. Let m = x - -22/197. Let v = -111 - -1501/14. Calculate the common denominator of v and m. 84 Let x be ((-2)/54)/((-8)/(-1074)). Let c = 19/18 + x. Calculate the common denominator of 51/20 and c. 60 Let z = -73 + 109. Calculate the smallest common multiple of z and 16. 144 Let n = 3 + -2. Suppose 10b - 7b - 12 = 0. Suppose 2j + 2u - 18 = u, bu - 16 = 0. Calculate the least common multiple of j and n. 7 Let r = 387 + -1565/4. What is the common denominator of (-1 - 1466/(-84)) + (-14)/49 and r? 12 Suppose 6a + 50 = 11a. What is the least common multiple of a and 9? 90 Let j = 34 + -18. Suppose 0 = 4y - 5p - 58, -3y + 4p - 52 = -8y. What is the smallest common multiple of j and y? 48 Let i(o) = o2 - 2. Let g be -23 + (0 - (-3 + 2)). Let y be 6/33 + (-40)/g. What is the lowest common multiple of i(y) and 6? 6 Calculate the common denominator of 131/30 and (-2320)/(-32)(-3)/(-50). 60 Let u(q) = q*2 + 11q - 1. Let o be u(-11). Let r be 3/o - (0 + -7). What is the common denominator of r/(-10) + (-21)/(-4) and 51/14? 140 Find the common denominator of 87/26 and 5/(-18)1 - (-3 + 0). 234 Suppose 3q - 5j = 41, -q + 5 + 8 = -j. Calculate the smallest common multiple of (-2)/(-6) - 385/(-33) and q. 12 Let f = -1289 - -10371/8. Find the common denominator of f and -35/16. 16 Suppose -6 = -5q + 4t + 41, -3t - 44 = -5q. Calculate the smallest common multiple of 2 and q. 14 Let h(m) = 2m*2 + 2m. Let g be h(3). Let v = 13 + -9. Calculate the smallest common multiple of v and (-7)/(-35) - g/(-5). 20 Let l be 0/(-2)(-3)/(-6). Suppose -k = 5d - 16, 3d - 4 - 5 = l. Let g(h) = 5h*3 - 2h*2 + 2h - 1. Calculate the lowest common multiple of g(k) and 7. 28 Calculate the common denominator of ((-30)/(-120))/((-1)/(-162)) and -143/6. 6 Let k be ((-155)/24380)/(4395/(-23208154)). Let r = k + 21/77645. Let h = 500/23 - r. Calculate the common denominator of 125/6 and h. 6 Let x = 2594 + -15515/6. Find the common denominator of x and -43/7. 42 Let x(h) = 22h3 + 5h*2 + 7h - 6. Let o(d) = 23d3 + 6d*2 + 8d - 7. Let k(c) = -5o(c) + 6x(c). What is the smallest common multiple of k(1) and 22? 198 Suppose 30 = q + 2q. What is the least common multiple of 2 and q? 10 Suppose -2t + 5d = -41, -t + 47 = 3t - 3d. Let p be (-245)/4 + 2/t. Calculate the common denominator of 83/12 and 3/12 - p/(-28). 84 Let i be (4 - 1) + (-24)/8. Let v be (0 + i/3)/2. Suppose v = 5a + 3b - 116, -a + 8b = 4b - 14. What is the lowest common multiple of 16 and a? 176 Let q(c) = -c + 9. Let k be q(7). Let g be -2 - (-1 + k + 8). Calculate the smallest common multiple of 2/g + 272/44 and 2. 6 Let l be ((-36)/15)/((-2)/(-20)). Calculate the common denominator of 3/(-9) - (-20)/l and 4/6 + (-59)/(-18). 18 Suppose -6v + 109 = -11. What is the smallest common multiple of v and 35? 140 Suppose b + 1 = 0, 3i + 0b - b = 49. Suppose 5f + 8 + 12 = 0, 2j - 44 = 5f. Calculate the smallest common multiple of i and j. 48 Suppose 2a = 3a - 5. Suppose 4y = -q - 35, -2y - aq = -4 - 1. Let s = -4/17 - 99/85. What is the common denominator of s and y? 5 Let i = 117 - 110. What is the lowest common multiple of 5 and i? 35 Let j(k) = -k + 7. Suppose 4c - 5c = -10. What is the smallest common multiple of j(0) and c? 70 Suppose 0y - 2y + 180 = -3o, 0 = 4y + 5o - 360. What is the least common multiple of -15y/(-75) and 12? 12 Let u be (-36)/(-14) + 27/63. Find the common denominator of 47/6 and (60/88 - 3) + u. 66 Let a = -22623/8 + 2840. Calculate the common denominator of a and 41/3. 24 Suppose -47 = -4i - 3u + 2u, 0 = -2i - 2u + 22. What is the lowest common multiple of i and ((-28)/(-10))/((-2)/(-10))? 84 Find the common denominator of (-6)/(-4)21/10 and 3 - (-206)/(-8) - 1. 20 Suppose g - j + 50 = 4g, -2j + 84 = 5g. Suppose -3 = -5i + 7. Suppose 3d - 7d + 65 = 5z, 0 = d + iz - 20. What is the least common multiple of d and g? 80 Let d = -201737/24 + 8403. Find the common denominator of 35/16 and d. 48 Let c = 29 - 11. Let m(z) = 2z*2 + 8z + 4. Let p be m(-5). Calculate the least common multiple of 4/p - (-110)/7 and c. 144 Calculate the common denominator of (380/(-18))/(32/24) and -56/5. 30 Let k = 22 + 14. Let f = k + -18. What is the smallest common multiple of 22 and f? 198 Let x = -5 + 8. Suppose t = 2l + 22, -xt + 3l + 2l + 64 = 0. What is the least common multiple of 22 and t? 198 Suppose -3z - s - 6 = 2z, -3z + 4s = 22. Let l = 39 + -23. Calculate the least common multiple of ((-3)/z + 0)12 and l. 144 Let f = 1815/8 - 228. Let h be (-6616)/16(-1 - -2). Let x = h + 428. Calculate the common denominator of f and x. 8 Let r = -1082 - -7557/7. Let z(b) be the second derivative of -b*5/20 + 3b*4/4 + 4b*3/3 - 5b*2 - 2b. Calculate the common denominator of r and z(10). 7 Let w(t) be the third derivative of t6/120 - t4/12 - t3/6 - t2. Let d be w(-2). Calculate the least common multiple of ((-9)/d - 1)5 and 6. 12 Suppose -5y + 4y = -4u + 4, 0 = 5u - 4y - 16. Suppose 0m + m - 2 = u. Calculate the least common multiple of m and (-210)/(-27) - (-2)/9. 8 Suppose -4i - 37 = 3m, 5i + 23 = -m - 4. Find the common denominator of 13/6 and (-1)/2 - m/16. 48 Let w = 14 - -6. What is the least common multiple of w and 18? 180 Let c(x) = -x*2 - 5x. Let i be c(-5). Suppose io + 2o = 10. What is the smallest common multiple of 3 and o? 15 Let p = -304/17 + 15013/850. Calculate the common denominator of p and 70/9. 450 Let i = 35839137/178 + -201350. Let k = i + 3/89. Calculate the common denominator of k and -20/3. 6 Suppose 1 = 4n + 5r, -n - 2r = 2n - 6. Suppose 5x = 5v - 65, 0 = 5v - x + nx - 25. Calculate the least common multiple of v and (-49)/(-5) + (-3)/(-15). 40 Let m = 9 + 0. What is the lowest common multiple of (-8)/28 + (-32)/(-14) and m? 18 Let j(t) = t*3 - 7t*2 - 8t - 6. Let l be j(8). Find the common denominator of (153/l)/(7/2) and -33/8. 56 Let q = 1/6067 - 236623/60670. What is the common denominator of -137/12 and q? 60 Suppose 3q - 4q = -8. Calculate the lowest common multiple of 6 and q. 24 Let x be 5/(-3)(-4 - -7). Calculate the common denominator of (-215)/x(-2)/4 and -75/8. 8 Let w be (-2)/7 + 13731/(-693). Let l = -286/7 - w. Let q = -10/11 + l. Calculate the common denominator of q and 17/5. 15 Let j = 15377 - 307607/20. Calculate the common denominator of 41/50 and j. 100 Suppose -k = -3, 0k - 9 = b - 2k. Let i = b - -13. Calculate the lowest common multiple of i and 6. 30 Let j(d) = d*3 - 6d*2 - 5d - 4. Suppose -42 = n - 5n - 2t, -5n - 2t = -53. Calculate the least common multiple of j(7) and n. 110 What is the common denominator of ((-7)/(-16))/(1/(-9)) and -133/6? 48 Let l = 171523/20 + -8572. Let o be (-1393)/36 - 3/4. Let b = 7757/180 + o. What is the common denominator of b and l? 20 Let u = -95558680375 + 4807748326718823/50312. Let n = u + 2/6289. What is the common denominator of -23/16 and n? 16 Suppose	{ "pile_set_name": "DM Mathematics" }
27) Simplify (x*(-13/5)/x(x/(x*(-2)x))/x)/(x/(x/x*(8/7))x)(1/9) assuming x is positive. x(-298/105) Simplify ((z/(zzz*(-9)z))/(z((z/(z((z*(-21)z)/z)/z))/z)/z))/((z((zz*9)/z)/z)/((zz*20z)/z)) assuming z is positive. z(-2) Simplify (m3)*12(m(mm*(-2/7)m)/m)(5/3) assuming m is positive. m(272/7) Simplify (t/(t/(tt2)))(3/5)t(tt*(-1))/ttt(-1/4)/t assuming t is positive. t(31/20) Simplify (rrr(-7))(9/7)r*14r5/r assuming r is positive. r(81/7) Simplify y/(y/y*(1/13)y)y/(y(y/y*(-1))/y)(y/(y3/y))37 assuming y is positive. y(-506/13) Simplify (s(-35)s(7/6)ss)(-1/3) assuming s is positive. s(191/18) Simplify (ggg(-20))/(g(-17)/g)(ggg*15g)/(g/g18) assuming g is positive. g35 Simplify u*(2/37)/(u/(uu/(uu5)))(uuuuu*(5/2)/uuuu)/(u(-4/21)/u) assuming u is positive. u(7373/1554) Simplify (w*(5/3)w*5(w(-1/4))(1/7))(-25/2) assuming w is positive. w(-13925/168) Simplify (m/(mm/(mm/m(-7/4))))(7/2)/(m14)46 assuming m is positive. m*(-5075/8) Simplify ((cc*(-3)c)/(c*(-1)/cc))/(cc(-3)c(-3/7)) assuming c is positive. c(17/7) Simplify ((((s/(ss/(s(-2/5)s)s)s)/s)/(ss(-2)))(-3/8))29 assuming s is positive. s(87/20) Simplify i(-23)i*(-2/5)((ii/(iii(-3/7)i))/i)(-2/13) assuming i is positive. i(-10537/455) Simplify (zz(4/3)/zz)*(-15)z*(-6/19)z/z*(-3/4)z assuming z is positive. z(-2475/76) Simplify (d0d)/dd*(-3)(d*29/dd)/d(11/2) assuming d is positive. d(41/2) Simplify ((q(-6)/q(-1/7))/(q*3(q/(q/q*(-5)q))/q))(1/11) assuming q is positive. q(-13/77) Simplify (u(-7)/(u/u(1/3)u))12 assuming u is positive. u(-104) Simplify ((u2/uu(-7))/(u(5/3)(uu*(-4/9)u)/uu))(-4/7) assuming u is positive. u(332/63) Simplify (w(-31)w)/(ww(-3))(ww/w7)/(w(1/3)/ww) assuming w is positive. w(-100/3) Simplify (h(2/7))34/(h(-1/17)(hh/h(-2/3))/h) assuming h is positive. h(2894/357) Simplify (oo(11/3)(oo/o10)/o)(-33) assuming o is positive. o143 Simplify (k(4/3))(-5)/(k(k*(-23)k)/kkk/((kk/(k/k17)k)/k)) assuming k is positive. k(94/3) Simplify ((l(-2))5/(l/((l(-1)/ll)/l))(17/3))(-2/97) assuming l is positive. l(54/97) Simplify ((t(-9)/t)/t)(-1/7)/(t/t(6/19)tt(-18)) assuming t is positive. t(2379/133) Simplify ((q(-1)/q)(1/25)((q/q(-1))/q)(9/7))(1/2) assuming q is positive. q(211/350) Simplify ((v(2/3)/v)(-18/17)/(v*0((vvv*(-2))/v)/vv))(1/5) assuming v is positive. v(23/85) Simplify (x*0x)(-1/64)/((x/x(2/19))/xx(6/11)x) assuming x is positive. x(-19473/13376) Simplify k(-16)/(k*(-22)/k)k*19kkk23 assuming k is positive. k51 Simplify ((mm(-8))/(m/(mmm(-3/7))))/(m(2/39)/mmm/m(-1/4)) assuming m is positive. m(-8441/1092) Simplify (s/(s3s))*(-29)(ss(-13)s)/((s*(2/17)s)/s) assuming s is positive. s*(1290/17) Simplify (uu(-19))/u(-1/3)u/(u(-5)u)u0 assuming u is positive. u(-38/3) Simplify (u/(u/(u/u(-1)))u*(9/2))/(uu*(2/25)(((uu7/u)/u)/u)/u) assuming u is positive. u(71/50) Simplify ((q1/(q10q))/(q*5qq(-5/6)))18 assuming q is positive. q(-273) Simplify ((r/r(-2/3))4rrr*(-2/9)rr/((r0r)/r))33 assuming r is positive. r(1034/3) Simplify (jjj*(2/17)jj(-4))/(j/j(2/3))(1/6) assuming j is positive. j(-287/306) Simplify k((k/(kk(-1/4)))/k)/kkk/(k/(kk*33))k/((kk27/k)/k)k14 assuming k is positive. k(93/4) Simplify (((jj/((j/j11)/j)jj)/j)/j)/(j/(j(j*5/jjj)/jjj))(jj(-1/2))(1/56) assuming j is positive. j(2241/112) Simplify ((h(-2))(-2/37)h(2/25)/h(-2))(3/11) assuming h is positive. h(552/925) Simplify (y/(yyy*14/y)y11)/(y(-2/69)y(13/4)) assuming y is positive. y(-1717/276) Simplify ((h/h(4/7)h(-1/5))44)33 assuming h is positive. h(11616/35) Simplify (m(-4)/m)(1/47)(m(2/7))(2/19) assuming m is positive. m(-477/6251) Simplify ((p/(p((pp(-1))/pppp)/p)p)(-1/13))(-23) assuming p is positive. 1 Simplify (k(1/9))(-2/45)/((k/(k/(k/((kk*(-16)kk)/k)k)))/(kkk*(3/5)k)) assuming k is positive. k(-5024/405) Simplify (n(-3/5))(-1)/(n(2/19)/((nn(-13/5))/n)) assuming n is positive. n(-40/19) Simplify (s(-12))50(s/(s/s*14))/sss(-3/5) assuming s is positive. s(-2933/5) Simplify (g26/(g/g(-7/2)))/(g(2/97)g/(g/(g/((g/(gg(2/23)g)g)/gg)))) assuming g is positive. g(90991/4462) Simplify p(-1/17)/(p*(1/11)/p)pp(4/11)/ppp/(p/((p(1/4)/p)/pp)) assuming p is positive. p(1095/748) Simplify (r(-8)/r)/(rr(-12))r*(2/9)r(-1/9) assuming r is positive. r(19/9) Simplify ((qq/(qq/(qqq*(-3)))q/(qq(3/4)/q))(-43))(-11) assuming q is positive. q(-1419/4) Simplify (l(1/4))(-2/5)/(l6/(l/l(2/13))) assuming l is positive. l(-683/130) Simplify (l/(ll(-4)))(1/10)(l(-2)l)(4/9) assuming l is positive. l(-2/45) Simplify (w(2/39)/w)/w(-1)w/(ww*(-2/19))ww(ww(2/5))/www assuming w is positive. w(16882/3705) Simplify (a(-22)a(5/3))27 assuming a is positive. a*(-549) Simplify ((vvv7v)/((v*(-2/11)v)/v))/(vv(3/5))(16/3) assuming v is positive. v(272/165) Simplify l(1/5)/(l/(l/((ll*(-4)l)/l)))l(-1/3)/(l(-21)/l) assuming l is positive. l(373/15) Simplify (fff(3/7)f)*(-6/17)f/f*(-1/4)f4 assuming f is positive. f(1923/476) Simplify ((s*3ss)(-30)s*6s(-4/11))25 assuming s is positive. s(-39700/11) Simplify (b/(b/(b/b(1/19)))b(-2/15))(-31) assuming b is positive. b(-7192/285) Simplify t21/tt*(-1/31)t*4/(((tt*22)/t)/tt) assuming t is positive. t(61/31) Simplify ((h/h(-5/3)hh)/(h*(-11)h))/(hh/((hhh/((h/((hh*12)/h))/h))/h)hh(-2)h) assuming h is positive. h*(80/3) Simplify ((((f/(ff5))/f)/f(-3/11))/((ff(1/3))/(ff(-5)/f)))(-4) assuming f is positive. f(1592/33) Simplify (l(-4)/lll/(l*0l)ll*(5/6)l/l2)16 assuming l is positive. l(-152/3) Simplify (((m/(m(-2/13)/m))/m)/((m/(m*19m))/m))/(m(-1)/m(9/8)) assuming m is positive. m(2421/104) Simplify x23/(xx16)x*(-8)xx/(x/(x(xx(-15/7))/x)x)x assuming x is positive. x(-15/7) Simplify n/n8nnn*(-11)n(1/14)/(n17/n) assuming n is positive. n*(-447/14) Simplify ((((q/(qq*(-23)))/q)/qq)/(q(-22)/q))/(q(1/4))(-44) assuming q is positive. q56 Simplify ii(-12)i*(-1/2)(i1)25 assuming i is positive. i*(27/2) Simplify ((cc*(2/11)(cc(-6))/c)/(c0)31)(1/40) assuming c is positive. c(-53/440) Simplify (y11y(yy(-4/13))/y)/(y(2/43)/y(-13)) assuming y is positive. y(-757/559) Simplify ((p(-1/3)/p(-5/3))/((ppp*1)/pp)(-1/14))(-2/13) assuming p is positive. p(-5/21) Simplify ((b/b(-2/13))(-12))(12/19) assuming b is positive. b(-2160/247) Simplify ((j/(j(1/26)/j))/j(-15))/(j(3/4))(3/14) assuming j is positive. j(12231/728) Simplify (y*(-2/33)y(y/y(-4/5))/y)(-3/19) assuming y is positive. y(-287/1045) Simplify (((b8b)/b)/b(4/5))/(b(3/7))20 assuming b is positive. b(-48/35) Simplify f*21ff/(f/(f((f*(7/2)/f)/fff)/f))(f/f(-4))(1/32) assuming f is positive. f(821/32) Simplify (y(3/7))(-35)/(y(-3/4))(-10) assuming y is positive. y(-45/2) Simplify ((o*(13/7)/oo)/(o/o*(11/2)oo))/(((o/o13)/o)/(o(-1/14)/o)) assuming o is positive. o(114/7) Simplify (d(-10/3)d(-7))42 assuming d is positive. d(-434) Simplify q(-29)qqq(-7)q*(6/13)(q(-4/5)/q)/q assuming q is positive. q(-2362/65) Simplify (ss/(s/(s/(ss*(-2/17))))s*(-1/6)s(s/(s/s8s)s)/s(-2/19))46 assuming s is positive. s(448247/969) Simplify ((f/f(-2/11)f)/(ff/f(1/33)))(-2/51) assuming f is positive. f(-14/1683) Simplify (u(-1/26)/u(-6/13))/((u/(u/(uu/u*15uu)))/u(uuu/u(1/16))/u) assuming u is positive. u(2181/208) Simplify ((ss(s*(-29)s)/s)/(s*(5/7)s))/((ss(2/5)s)/(s/(ss(3/10)))) assuming s is positive. s(-2199/70) Simplify (((y(-1))(-13/3))9)*30 assuming y is po	{ "pile_set_name": "DM Mathematics" }
(h) = -3h2 + 4h + 35. Let d(c) = -7g(c) + 4o(c). List the prime factors of d(a). 3, 13 Let j = -13120 - -19407. List the prime factors of j. 6287 Let m(t) = 6t3 - 4t*2 - 4t - 115. Let j(o) = -7o3 + 5o*2 + 5o + 115. Let x(s) = -5j(s) - 6m(s). List the prime factors of x(0). 5, 23 Suppose 18m - 37m = -29317. List the prime factors of m. 1543 Let i be ((-5)/10)/((-3)/(-96)). Let c be -23i/(-12). Let a(j) = -j*3 - 9j*2 - 9j + 2. List the prime factors of a(c). 2, 5 Let w = 33 + -29. Suppose 0n + 3n + 4b + 5 = 0, -2n + wb + 30 = 0. Suppose nh = 46 + 159. List the prime factors of h. 41 Let s be 6 + -4(-2)/(-4). Let g(q) = -8q - 4. Let k be g(s). What are the prime factors of (-1 + 6)k/(-10)? 2, 3 Suppose 5f = 6f + 5q - 7, 2f = -3q + 14. Suppose -25 = z - 3z - 5y, 5y = 25. Suppose z = 3k - f - 14. List the prime factors of k. 7 Let u(a) = -8a + 34. Let s be u(10). Let y = s - -81. What are the prime factors of y? 5, 7 Suppose -55 + 786 = m. What are the prime factors of m? 17, 43 Let j(x) = -x2 - 2x - 10. Let b be j(-5). Let y = 39 + b. List the prime factors of y. 2, 7 Suppose -28 = -3a - 4. Let m = 10 - a. Suppose -2c + 48 = mc. What are the prime factors of c? 2, 3 Let i(y) = -5y*2 + 3y + 2. Suppose -3p - 4z = -p - 6, -3z = -3p - 9. Let g be i(p). Let f = g + 45. List the prime factors of f. 3, 13 Suppose 7o - 5o = -8. List the prime factors of 8(-14)/(3 + o). 2, 7 Suppose 2p + 8 = -0p. Let t = -23 - -21. What are the prime factors of (0 - p/(-1))t? 2 Suppose 5z = -5g + 10, 0 = 4z - g - 6 - 7. Suppose -p + 9 = z. What are the prime factors of 80/6(9 - p)? 2, 5 Let p(s) = -11s. Let m be 12/8 + 2/4. Let c be m5/((-40)/12). What are the prime factors of p(c)? 3, 11 What are the prime factors of (17(-3)/6)/((-2)/20)? 5, 17 List the prime factors of (22332/8)/((-3)/(-4)). 2, 1861 Let a(k) = 6k3 - k2 + 1. Let f be a(1). Suppose g = -2q + f, -3q = -2q - 5. Let h(m) = 2m*2 + 3m - 2. What are the prime factors of h(g)? 2, 3 Let t = -8 + 6. Let a be (-3)/t(-3 - -15). Let f = 12 + a. What are the prime factors of f? 2, 3, 5 Suppose 1 = 5q - 19. Suppose -9x + qx = -550. List the prime factors of x. 2, 5, 11 Let h(t) be the second derivative of 17t3/6 + 3t*2/2 + 6t. What are the prime factors of h(4)? 71 What are the prime factors of 469 - (11 + 30/(-5))? 2, 29 Let x be (-66)/(-15) + 2/(-5). Suppose -2r = z + 386, -xr + 262 = 4z + 1030. What are the prime factors of r/(-6) + 4/6? 3, 11 Suppose -6p = -4p - 3g, 0 = 3p + 2g - 13. Suppose -2n = 2n - 20. Suppose 92 = 3q + nd, pq - 84 = -d + 4d. List the prime factors of q. 29 Suppose 19d - 10145 = -2a + 18d, -2a + 5d + 10175 = 0. List the prime factors of a. 5, 7, 29 Let j be 5/((-20)/(-8)) - 6. Let q be j + 3 + 691. Let v = q + -47. List the prime factors of v. 3, 7 Let j(z) = -z*3 - 14z*2 - 2z - 16. Let l be j(-14). Suppose lc - 57 = 9c. What are the prime factors of c? 19 Suppose -2s + 65 = -0n - 3n, 2n - 210 = -5s. Suppose -5h + s = -4m, 2m + 0m + 22 = 3h. What are the prime factors of (3/(-9))/(h/(-36))? 3 Let g(q) = -69q - 231. What are the prime factors of g(-8)? 3, 107 Let i(d) = -d3 - 24d*2 - 56d + 27. What are the prime factors of i(-27)? 2, 3, 23 Suppose -9768 = -2y - 2y. Suppose -y = -9m + 6. List the prime factors of m. 2, 17 Suppose y = -z + 3z - 6654, z = 2y + 3327. List the prime factors of z. 3, 1109 Suppose 2p + 2300 = 3n, 958 - 2482 = -2n - p. List the prime factors of n. 2, 191 List the prime factors of (4/(-30) - (-968779)/255) + 1. 2, 5, 19 What are the prime factors of (-6)/1554275/(-26)? 5, 167 Let k = 379 - 576. Let y = 437 + k. List the prime factors of y. 2, 3, 5 Suppose -2v = -0 + 2. Let h be v/(-4) - 28/(-16). Suppose -4g + 2g = 5z - 150, -3g - 79 = -hz. List the prime factors of z. 2 Let j = -101 + 159. Let p = 328 - j. List the prime factors of p. 2, 3, 5 Let d(l) = 62l*3 - 4l*2 + 9l - 18. List the prime factors of d(3). 3, 61 Let u(o) = -14o - 19. Suppose 11v = -67 - 10. List the prime factors of u(v). 79 Let w be (-6 - -8 - 3)/(2/(-4)). Suppose -133 = -wg + 115. What are the prime factors of g? 2, 31 Let a(h) = -7h - 8. Let m be a(-3). What are the prime factors of (m/26)/((-2)/(-188))? 47 Suppose -3p - 130 + 148 = 0. Suppose 0 = 3y - 2x - 1 - 15, x = 4y - 23. Let r = y + p. List the prime factors of r. 2, 3 What are the prime factors of ((-450)/60)/(3/(-422))? 5, 211 Let c = -2176 - -3094. What are the prime factors of c? 2, 3, 17 Suppose 288 = f - 4b, -b = 4b - 20. List the prime factors of 4/(-3) + f/3. 2, 5 Let n(z) = -2 + 11z - 7z*3 + 10z - 4z3 - 20z. What are the prime factors of n(-2)? 2, 3, 7 Suppose 0 = 5m + h - 292, -m = -5h + 4h - 62. Let r = m + -11. List the prime factors of r. 2, 3 Suppose -x + 127 = 2c, c + c + 2x - 126 = 0. Let i be (12/10)/(2/(-10)). What are the prime factors of 12/(-8)c/i? 2 Suppose -8 = 3f - 7f. Suppose -3v + 6 = -v, -4v = -fo + 118. Suppose -o = -4z + 87. List the prime factors of z. 2, 19 Suppose -7x - 266 = -77. List the prime factors of (0 - 41/(-3)) + (-9)/x. 2, 7 Let x(c) = -c2 - 11c - 8. Let s be 6/(-8)(-360)/(-10). Let m be 18/s - (-28)/(-3). List the prime factors of x(m). 2 List the prime factors of ((-7)/49)/((-7)/21511). 439 Let t = 296 + 317. List the prime factors of t. 613 List the prime factors of 16 - (-6 - -3)/(-1). 3 Let k(i) = -i*3 + 23i*2 - 12i + 10. List the prime factors of k(8). 2, 19, 23 Let f = -10 - -9. Let w(c) = 40c2 - c. Let l be w(f). Suppose 0 = 3t + 3j - 45, -3t = 3j - 2j - l. List the prime factors of t. 13 Let y = -4235 - -6067. What are the prime factors of y? 2, 229 Suppose -t = -5q - 3t + 7450, 2q - 5t - 2951 = 0. What are the prime factors of q? 2, 3, 31 Let g(s) = -s*3 + 2s*2 + 2s + 3. Let k be g(3). What are the prime factors of 11 - 4/16k? 11 Let z(l) = l3 - l2. Let h be z(1). Suppose h = -f + 6. What are the prime factors of ((f29)/(-3))/(-2)? 29 Suppose -3y - 3842 = -2z, 0 = 2z + 2y - 0y - 3862. What are the prime factors of z? 41, 47 Suppose 4o + 3 = 5o + l, 4l + 4 = 0. Suppose 0 = r - or + 108. Suppose 2j - r = 2. List the prime factors of j. 19 Let n = -22 + 21. List the prime factors of (7 - 1) + n + -1. 2 Suppose p = -0p + 4n - 314, 5p = -3n - 1639. List the prime factors of p/(-6) - (-3)/(-9). 2, 3 Suppose 0 = 18n + 13n - 18569. What are the prime factors of n? 599 Suppose 162a - 160a = 944. List the prime factors of a. 2, 59 Let d(s) = 2s3 - 13s*2 + 7s - 8. Let w be d(6). What are the prime factors of (w + 2 - 1)/((-2)/538)? 269 Let j(o) = o*2 - 9o + 9. Let s be j(8). List the prime factors of 50 - ((-4)/s + 5). 7 Let q(f) = 6f + 3. Let o be q(-4). Suppose 17s = 16s + 2. List the prime factors of (o/9)/(s/(-12)). 2, 7 Let n(z) = -9z + 8. Let o be n(-7). Let k = o + -8. Suppose k = 5s + 13. What are the prime factors of s? 2, 5 Suppose -21q + 16q = -3y + 2969, q = y - 993. What are the prime factors of y? 2, 499 Let z(j) = 194j - 252. List the prime factors of z(7). 2, 7, 79 Let h(x) = -3x + 5. Let c = 35 + -31. Suppose cg + 0g = a - 44, 3g + 5a + 33 = 0. List the prime factors of h(g). 2, 19 Suppose 0 = -19n + 24n + 155. What are the prime factors of (-1 + -3 + 6)n/(-2)? 31 Let o = 1103 - 331. List the prime factors of o. 2, 193 Let n = 105 + 261. List the prime factors of n. 2, 3, 61 Suppose -4g + 24 = -2l, -l - 2l + 5g - 31 = 0. What are the prime factors of 8/((l(-2)/52)/1)? 2, 13 Let d(l) = 131l2 + 2l + 29. List the prime factors of d(4). 3, 79 Let h(j) = j*3 - 19j*2 - 6j + 40. What are the prime factors of h(21)? 2, 199 Suppose 4z - 3o + 17 = 268, o = 5z - 311. List the prime factors of z. 2, 31 Let w = 30 + -30. Suppose -4q = -3q - 5. Suppose w = -r + q + 9. What are the prime factors of r? 2, 7 Let q(d) = 3d*2 + 14 - 2d2 + 15. Let v = -192 + 192. What are the prime factors of q(v)? 29 Let n(t) = -t3 - 3t - 6. Let b be n(-5). Let k = 251 - b. List the prime factors of k. 3, 13 Let i(o) = 43o - 202. List the prime factors of i(25). 3, 97 What are the prime factors of ((-11856)/91)/((-2)/21)? 2, 3, 19 Le	{ "pile_set_name": "DM Mathematics" }
+ 626985 + 417654 = 0. Do d and -7009 have the same value? False Suppose s = 2c + 80, 4s - c - 307 - 6 = 0. Let v = s - 1797/23. Suppose 5o - 5l + 40 = 0, 5l + 64 = 99. Which is bigger: o or v? v Suppose 4r - 3r = -6265. Let q be 1000/r - (-3)/(21 + 0). Let o = q + 1632/1253. Which is greater: o or 1? o Let k = -4975 - -5030. Which is smaller: 24 or k? 24 Let m = 15469 - 12887. Is 2582 less than or equal to m? True Let w = 2791 - 2945. Is -7 < w? False Let m(x) = -11x*3 - 11x*2 - 29x - 5. Let w be m(-4). Is w at least as big as 640? False Let f = -3/20 + 67/180. Let z = 470 + -476.01. Let a = z - -5.61. Is f bigger than a? True Let v = -2892 - -2862. Suppose r + 45 = -3h, -h - 72 = 3r + 39. Let n = r - v. Which is greater: n or -8? n Let t(o) = -2o3 - 27o*2 + 281o + 111. Let n be t(-31). Is n not equal to 25035? False Let c = -281/816 - -3/272. Suppose 5d = -v - 20 - 5, -5v + d = -5. Let n = v + c. Which is smaller: -1/5 or n? n Suppose -397 - 87 = -4b. Suppose -5w = -i + 103, -2w + 340 = 5i - b. Let n = i + -467/5. Which is greater: n or 6/13? 6/13 Let b(l) = -15l3 + 14l*2 - 30l + 5. Let z(v) = 7v3 - 7v*2 + 14v - 2. Let g(f) = 6b(f) + 13z(f). Let k be g(7). Is k smaller than 15? False Let i be (10 - 5)(-6 - -3). Let p be (11/4)/(i/12). Suppose 5w + 4h = -18, 10 = -4w - 4h - 6. Which is bigger: w or p? w Let t(f) = f3 + 8f*2 + 3f - 25. Let q be t(-7). Let k be 5 - (-3 - (-2 + 0)). Suppose -k + 6 = qa. Is 2/53 less than a? False Suppose 647f - 643f + 154 = u, 0 = f + 4. Is -6 <= u? True Let s = 15638 - 15842. Are -189 and s non-equal? True Let r be (-24)/3 - 484/(6 - -5). Which is bigger: r or 0.2? 0.2 Suppose 20 = 4j, -2j + 17 = 3n - j. Let c be (-3)/(-4 - 5) - (-88)/6. Let f be (-36)/(-15) + (-51)/c + 3. Which is greater: f or n? n Let l = -289 - -20. Let n = l + 269. Is 0.41 bigger than n? True Let r = 18.43 - 1.44. Let c = -17 + r. Let q = -15.01 - c. Is q bigger than -1? False Let w = 22.042 + -0.042. Let a = w + -20. Let y = -0.57 + -0.23. Is y < a? True Let z = -0.819 - -0.756. Let x = 403.063 + z. Is -1/3 less than or equal to x? True Let p be ((-6090)/(-29))/(-35) + 2 + (-4)/(-1). Is 16/19 at least p? True Let l(c) = -36c - 31. Let o be l(-6). Let w = -185 + o. Does w = 3/103? False Let z = 315.1 + -508.1. Does 20 = z? False Suppose 5c + 297 = 252. Let d be (5000/(-45))/(-5) - (-2)/c. Suppose -3p - 3w + 2w = -66, -p + d = -w. Is p <= 22? True Let c = 7216 + -4978. Let z = -194261/2 - -1391213/14. Let s = z - c. Is 5 equal to s? False Let t(q) = q3 + 20q*2 - 2q - 37. Let v be t(-20). Let m = v + 0. Let b be 75/11 + m/(66/4). Is 8 != b? True Let a = 3211/1104 - 77/48. Is a != 2? True Let a(z) = -6z2 + 11z + 23. Let w be 83/17 + 4/34. Let t be a(w). Is 1 smaller than t? False Let p(n) = -n*2 + 4n - 5. Let g be p(5). Let m be g + 5 + -1 + 4. Let b(l) = 53l + 374. Let j be b(-7). Which is greater: m or j? j Suppose 594 = 113a + 481. Is a less than or equal to 2/22551? False Let q = 3.33 + -2.2. Let c = q - -17.61. Let m = c - -0.26. Is 1 less than or equal to m? True Let b be 2/(-4)-14 + -3. Let c(f) = 2f - 3. Let x be c(5). Is x > b? True Let n be -9 + 0 + 141685/(-215). Which is greater: n or -670? n Let i = -18.98 + 19.98. Suppose 3t = 2n - 1042, 4t - 3n - 594 = -1982. Is i != t? True Suppose 2i = 2b + 2, b = 2b + 5i - 5. Let a(j) = j - 6. Let z be a(b). Let f be 208/(-64) - z/(-8). Which is smaller: f or -24/7? f Suppose -2g = 134 + 44. Let y(x) = 12041x + 300931. Let n be y(-25). Which is greater: n or g? g Let k be (-777)/49 + -1 - 1. Let r = k - -1613/77. Which is bigger: 3 or r? r Let q be (-4)/(-14) + 648/(-14). Let b(r) be the third derivative of r*5/30 - 31r*4/12 - 47r*3/6 - 5r*2 + 4r. Let h be b(31). Is q > h? True Let f = 5 + -3. Let j = -36.27 - 2.23. Let s = 36.5 + j. Which is greater: f or s? f Let w(o) = 3o2 + 58o - 280. Let p be w(-24). Let k be 9/(13/18). Which is bigger: k or p? p Let p = 2262831/572 + -3956. Does p = 1? False Let o(m) = -m - 22. Let g(v) = -3v - 21. Let x(n) = -2g(n) + 3o(n). Let c be x(8). Which is greater: 1/26 or c? 1/26 Let b = -463.3 - -472.4. Let w = 0.26 + 1.64. Let j = -0.9 + w. Which is smaller: b or j? j Let n(s) = 8s - 27. Let r be n(6). Let l be -3 - (7/r)/(2/(-12)). Let u = 6.16 - 0.16. Which is smaller: l or u? l Let k = 836 - 916. Let b be 1 + -66 + 1 + 1. Let p = b - 16. Which is smaller: p or k? k Let n(d) = -9d - 3. Let f(y) = -2y2 + 2y - 1. Let x be f(5). Let l = x + 39. Let u be n(l). Is 15 smaller than u? False Suppose -z + 5z + 3p = 660, 2p = 3z - 478. Let j = -104 + z. Which is greater: 59 or j? 59 Let y = -11 + -5. Let q be (-15)/7(-8)/y. Let t(v) = v3 - 2v*2 - v + 2. Let g be t(1). Which is smaller: g or q? q Let b = -6113 + 18337/3. Which is smaller: b or 2577? b Suppose 473 = -r - 2z - 451, 4z + 3680 = -4r. Do r and -914 have the same value? False Let z be (-2(-5)/(-10))/(-1). Let r be -5 + (-6)/z + 4. Is -0.17 at most r? False Let q = 28 + -36.4. Let a = -16.6 + q. Let j = a - -24.9. Which is greater: -1.6 or j? j Let z(m) = -m2 - 3m + 28. Let p be z(7). Suppose 0 = -5c + 4i - 12, -2c + c = 3i - 9. Are p and c equal? False Let y be -420 - 600/(3 + 22). Is y < -1/5? True Let g(m) = 60m - 250. Let y be g(38). Let n be (-6)/(-33) - y/154. Which is smaller: n or -17? -17 Let p = 73 + -69. Let i be (4 - (9 - (-4 + p)))-25. Let s be i/6 - 9/(-54). Are 22 and s equal? False Suppose -45j + 43j + 15032 = -2h, 0 = -j + 3h + 7524. Which is smaller: j or 7514? j Let b = -164623/16810875 + 2/134487. Which is smaller: b or -1? -1 Let x = 167 + -1026. Let s = -18725 - -53620/3. Let q = x - s. Is q < -1? True Let n = 69 + -69.047. Let a = 9119.953 + -9125. Let g = a - n. Which is greater: g or -3? -3 Let l = 5 - 5. Let a = -115.5107 - 0.4893. Is a != l? True Let s(f) = -4f. Let t be s(4). Let c be (t/(-64))/(1/12). Suppose -cp + 4d = 18, -2p + 0p = d + 1. Is p at least -14/13? False Let m = -1.5 + 0.5. Let q = 59 - 58.23. Let b = -12.23 - q. Are m and b nonequal? True Let b(z) = z3 - 7z*2 + 5z + 1. Let d be b(6). Let w(i) = 3i. Let x be w(d). Let o be (-108)/10(-1175)/(-705). Is o at least as big as x? False Let b be -110(-226)/(-26724) - -1. Let x = 4/131 - b. Let h = 0.12 - 2.12. Which is smaller: x or h? h Let k = 32985/4 + -313449/38. Let f = k - -3/19. Which is smaller: f or -0.4? f Suppose 475d = 470d - 4980. Let z = -40845/41 - d. Is z equal to 1? False Let w = -754 + 250. Let k = w - -478.2. Which is bigger: 2/5 or k? 2/5 Let x(p) = -3p*2 - 2p - 1. Let f = -48 - -47. Let r be x(f). Let c be 2/(r - -1) + (-31)/(-8). Which is smaller: 1 or c? 1 Let f = -375 - -624. Suppose -5x + 2q - f = 0, -5x + 3q - 6q = 264. Do x and -51 have different values? False Let k = 175242053/4604 - 38063. Does k = 2? False Let l = -54 - -305. Let k = l - 255. Does k = 0? False Let w(a) = 8a*2 + 2a - 3. Let t be w(-3). Let q = -280143/4 + 140197/2. Which is smaller: q or t? q Let n(z) = 477 + 3z - 477 + 2z*2. Let k be n(-2). Let p be (-258)/(-33) + k/11. Is p greater than 8? False Let g be 0/(((-32)/12)/(6/9)). Let c = -1387/14 + 99. Which is smaller: g or c? c Let q be -7(-120 + 0) - 0/3. Let r be 1 - -3 - q/208. Suppose -h + 1 = -2h. Is h <= r? True Let j be 1 + -4 + 0/1. Let w be j - 1 - (77/(-26) - 1). Which is smaller: -1 or w? -1 Let q be (-4)/(-8)(-1 + -141). Let c = q - -640/9. Suppose 7f - 7f = 3f. Which is bigger: f or c? c Let y be (15/(-9))/(1110/369 - 3). Let g be (-82)/y(-10)/12. Which is smaller: 23/5 or g? g Let y be ((-6)/(-24))/(29/8). Let d(i) = i*3 - 18i*2 + 33i - 16. Let q be d(16). Are q and y nonequal? True Let d be (2/4)/((-20)/(-40)). Let y = 50 + -62. Let a be (0 + (-1 - -1))/(14 + y). Which is bigger: a or d? d Let l = 1.99 - 2. Let m be 2 - (-3)/210/(-20). Is l smaller than m? True Suppose 2b - 9 = -5a, -a = a - 2. Suppose 2l + 9991 = 5k, 4k - bl + 6l - 8004 = 0. Let u = 18019/9 - k. Which is smaller: u or 2? 2 Let c = 43 + -120.2. Let t = c + 78. Let k = t - 0.9. Is k at most as big as 13? True Let t(o) = -10*o + 72. Let d be t(7). Let m be (1389/(-708) + d)/((-21)/14). Which is smaller: -1 or m	{ "pile_set_name": "DM Mathematics" }
((sqrt(56)/sqrt(4))/sqrt(2) + sqrt(7)))3. -7sqrt(7) - 3 Simplify -3 + ((sqrt(288) - 3sqrt(288))1)/(sqrt(40)/((2sqrt(120))/sqrt(12))). -24sqrt(2) - 3 Simplify 2(sqrt(192) + -4(sqrt(192) + -1)*2) + (sqrt(192) + (4-2sqrt(192) - sqrt(192)) + 3sqrt(192)-2)2. 144sqrt(3) + 36088 Simplify 2 + ((sqrt(250) - (sqrt(250) + sqrt(250)-1))-5)/(-1(sqrt(162) + sqrt(2))) + 3. 5 + 5sqrt(5)/2 Simplify (2sqrt(84)4 + -4sqrt(84)-1)/(-3sqrt(12)-4 + sqrt(132)/(sqrt(110)/sqrt(10))). 12sqrt(7)/13 Simplify (4-2sqrt(1331)-45 + (1(sqrt(1331) + sqrt(1331)2) - (-4 + (sqrt(1331) + -1 - sqrt(1331)) + sqrt(1331))))2. 17820sqrt(11) + 34930789 Simplify ((-5sqrt(84)-1 - (sqrt(84) - -2sqrt(84)2))3)/(sqrt(192)-2 + (sqrt(588) + sqrt(12))-3). 0 Simplify 4 + (-2 + sqrt(300) + 2)2 + ((-1sqrt(192))*2 - (-2 + sqrt(3) + 4)) + 0. -sqrt(3) + 494 Simplify -1((sqrt(475) - (sqrt(475)5 + -4 - sqrt(475))) + -1 + (sqrt(475) - (5sqrt(475) + sqrt(475))4)6)*2-3. -12690sqrt(19) + 28330452 Simplify (1-6((-3 + sqrt(6)/sqrt(2) - (1sqrt(3) + 3)) + sqrt(108) + sqrt(3) + sqrt(9)/sqrt(3) + 1))*2. -2880sqrt(3) + 7812 Simplify sqrt(288) + 1 + sqrt(288) + -1 + ((sqrt(288) - (0 + sqrt(288)))-6 - sqrt(288)) + 1 + 3 + -3. 1 + 12sqrt(2) Simplify -3(sqrt(704) + (-5sqrt(704)-5 - sqrt(704)) + -4 + sqrt(396) + 5)4. -2472sqrt(11) - 12 Simplify (sqrt(44)/(sqrt(2) - (sqrt(2) - (sqrt(2) - sqrt(200)/sqrt(4)))))/(sqrt(20)/(sqrt(640)-2)). 4sqrt(11) Simplify 1 + ((-1-4sqrt(605)-2)*2 - 3((0 + sqrt(5))*2 + -5 - (-1 + sqrt(5) + 3))). 3sqrt(5) + 38727 Simplify ((sqrt(65) - (sqrt(65) + sqrt(65) + (sqrt(65) - 3sqrt(65))))-5 - (sqrt(65) + -2-3sqrt(65)))/((sqrt(450) + sqrt(50))/sqrt(10)5-2). 3sqrt(13)/10 Simplify (-2 + 1(sqrt(272) - sqrt(272)-1) + 3)-3-11. 3 + 24sqrt(17) Simplify 2 + (-5(sqrt(44) + sqrt(11))-5)2 - (4sqrt(1584) - sqrt(11) - (sqrt(11) - (sqrt(396) + -3)))*2. 312sqrt(11) + 32124 Simplify (((sqrt(168) + sqrt(168)-1 + sqrt(168))-5)/(sqrt(192)2))/(4((sqrt(7200) - sqrt(7200)2 - sqrt(7200)) + sqrt(7200))). sqrt(7)/384 Simplify -5((-1sqrt(180) + 3 + -4)-5-4)2 + -3. -362003 - 24000sqrt(5) Simplify (((1 + sqrt(99))-5)2 - sqrt(99)) + ((sqrt(99) - -3sqrt(99)-4)2 - sqrt(99)) + 1((sqrt(539) - (4 + 0 + sqrt(539))) + 4). 144sqrt(11) + 14479 Simplify 5(3 + ((1sqrt(136)-1)/(-1sqrt(512)) + -1)1)-2. -20 - 5sqrt(17)/4 Simplify (-6sqrt(19)3 + 5 + sqrt(19) + -1)*2 - (5sqrt(228))/((sqrt(12) + sqrt(36)/sqrt(3))/sqrt(4)). -141sqrt(19) + 5507 Simplify ((-5sqrt(117) + sqrt(117) + sqrt(117))4 - (sqrt(117) - (sqrt(117) + 5sqrt(117)4 + sqrt(117))))/(sqrt(324) + sqrt(324)1 + -4sqrt(9)-3 + sqrt(9)). 9sqrt(13)/25 Simplify ((-2 + 2 + sqrt(5))2 - 2(sqrt(25)/sqrt(5))*2) + 4 + (-63(sqrt(5) - (sqrt(5) + 2)))2. 1295 Simplify -3(((3 + sqrt(19))6 - (sqrt(475) + sqrt(19) + -4)) + (6(3 + sqrt(19) + 1))*2 + 2). -3852 - 864sqrt(19) Simplify (-2((-2sqrt(6336) - sqrt(6336)) + 3 + sqrt(44) + (sqrt(88)/sqrt(2) - sqrt(44)) + 5 + 3))*24. -24640sqrt(11) + 864336 Simplify ((4(-2 + (sqrt(675) + -2sqrt(675) - sqrt(27)) + sqrt(162)/(sqrt(96) - (2sqrt(96) + sqrt(96)))))*2 + -1)6. 7056sqrt(3) + 195237/2 Simplify (-5sqrt(168)/(sqrt(392)-1))/(-6sqrt(175) - (2sqrt(343) + sqrt(343) - sqrt(343))). -5sqrt(3)/308 Simplify 0 + (0 + 0 + sqrt(720) + sqrt(720) + -2 - ((sqrt(720)2 + 2 - sqrt(720)) + 1-1sqrt(720))) + 1. -3 + 24sqrt(5) Simplify ((sqrt(36)/(-4sqrt(3))-3)/((sqrt(60) - (sqrt(960) + sqrt(60) + sqrt(60)))/sqrt(10) - (sqrt(66)-2 + sqrt(66))/sqrt(11)) + 3)2. -9sqrt(2)/8 + 1161/128 Simplify (sqrt(768)13 - (sqrt(768) + 3sqrt(768)2))/(-3(-1sqrt(6)-6 - (sqrt(48)/(sqrt(16)/sqrt(2)) + sqrt(6)))). 8sqrt(2)/3 Simplify ((1sqrt(704) - sqrt(704)) + -2 - (-21sqrt(704))2) + 4 + (-1 + -2(sqrt(11) + 2 + sqrt(11)-3) + -4)2. -2557 - 72sqrt(11) Simplify 3 + (-4(-2 + sqrt(1008))-5 - (5 + sqrt(1008)24))*2. -12960sqrt(7) + 147180 Simplify ((4 + sqrt(288) + 3 - (-3 + -2sqrt(288))) + (sqrt(288)1 + -4)-63)*2. -29520sqrt(2) + 71524 Simplify 2(-6(2sqrt(343)-4 + (6sqrt(343) - sqrt(343)) + -5 + 5)1)*2. 222264 Simplify ((sqrt(170) + (sqrt(170) - -1sqrt(170)-1) - 5(sqrt(170) - (sqrt(170) + 2sqrt(170)) - sqrt(170)))2)/(-5sqrt(1210) - 3sqrt(10)-4). -32sqrt(17)/43 Simplify -4 + 5 + ((sqrt(1125) + (sqrt(1125) + (sqrt(1125) - (-3 + (sqrt(1125) - (sqrt(1125) + 2)))) - sqrt(1125)) + sqrt(1125) + 3sqrt(1125)2)6)2. 48600sqrt(5) + 3281401 Simplify 2 + ((sqrt(810) + sqrt(810)-4)1)/(((sqrt(40)-4 - sqrt(40))-5)/sqrt(8)). -27sqrt(2)/25 + 2 Simplify 0 + 5 + 3 + (((sqrt(1100) + sqrt(1100) + 0 + sqrt(1100))5 - (-1 + (sqrt(1100) - 1sqrt(1100))))-4)*2 + -1. 4800sqrt(11) + 3960023 Simplify (5 + 1 + 2 + -3 + ((sqrt(475) + sqrt(475) + sqrt(475) + 0)2 - (sqrt(475) + -2 + sqrt(475) + 0)))2. 280sqrt(19) + 7649 Simplify 5((-2 + (sqrt(605) + sqrt(605) + 2 + sqrt(605))1)*2 + 6(3 + (-3sqrt(605) - sqrt(605))2) + 1). 317720 Simplify ((sqrt(135)/sqrt(5) + sqrt(96)/sqrt(2) + sqrt(3))2 + 2 - (3sqrt(36)-1)/(sqrt(192)-5))-4. -776 + 3sqrt(3)/5 Simplify (sqrt(294)2)/(sqrt(18)/(sqrt(36)/sqrt(4) + sqrt(9)))-3 - ((sqrt(441) + sqrt(441)-1 + sqrt(9))/sqrt(3) - (0 + (1sqrt(12))/sqrt(4))). -84sqrt(3) Simplify ((sqrt(308) + (sqrt(308) - 1sqrt(308))5 + sqrt(308))/sqrt(7) + 2 + 0)-12. -8sqrt(11) - 4 Simplify 1(2 + 4((sqrt(112)1 - sqrt(112))2 + sqrt(112))) - 2(-2 + -1 + sqrt(112) + -1 + sqrt(112) + 3). 4 Simplify -3 + ((6(sqrt(170)2 + sqrt(170)) + 3sqrt(170)6)/((-35sqrt(120) + sqrt(120))/sqrt(12)))*2. 5361/49 Simplify ((2(sqrt(300) + 1) - (sqrt(300) + sqrt(300) + 0 + -1 + sqrt(300))) + -3)*25. 1500 Simplify (5 + -5 + sqrt(76) + (sqrt(76) - (-5 + sqrt(76)1)) + (0 + -4sqrt(76) - (sqrt(76) - (-2 + -4sqrt(76)))))26. -576sqrt(19) + 29238 Simplify (56(sqrt(84) + sqrt(84)-2 + sqrt(84) - sqrt(84))-3)/((sqrt(60)-2-6)/(sqrt(125)-2)). -75sqrt(7) Simplify (sqrt(136)/((sqrt(56)2)/sqrt(7)) + 5 + (-2sqrt(136))/sqrt(8))2 + (2sqrt(85)6 + sqrt(85))/(sqrt(25)/(sqrt(10)/sqrt(2))). -2sqrt(17) + 253/4 Simplify (sqrt(2880)-2-1)*2 + 6((sqrt(15)/sqrt(3))*2 + 4 + -3). 11556 Simplify (((sqrt(385) + -1-2sqrt(385) - sqrt(385))/((2sqrt(56) - sqrt(56))/sqrt(8)))/(sqrt(264)/sqrt(6) + (sqrt(11) - sqrt(99))2))2-3. -15 Simplify -2 + ((sqrt(420)11)/((sqrt(84)-2 + sqrt(84))/sqrt(7)))/(sqrt(7) + -6sqrt(343) + sqrt(21)/sqrt(3)6). -2 + sqrt(5)/35 Simplify ((sqrt(132) - 1sqrt(132)4) + -3-3sqrt(132))/(2sqrt(72)/sqrt(6) + (sqrt(48) - (sqrt(48) - sqrt(1200)))/sqrt(4)). 6sqrt(11)/7 Simplify (2 + -3 + -4((sqrt(72) - 1sqrt(72)) + sqrt(72)))2 - -2(-6sqrt(72)-2)*2-4. -81791 + 48sqrt(2) Simplify (4((3(sqrt(78) + 4sqrt(78)) - sqrt(78)) + (sqrt(78) - (sqrt(78) - 4sqrt(78))-3))/(3sqrt(108)/sqrt(18)))2. 832 Simplify (sqrt(456)/sqrt(108) + sqrt(1368)2)/(5sqrt(22)/(sqrt(11) + (sqrt(11) - (sqrt(1331) - -1sqrt(1331) - sqrt(1331))))). -111sqrt(19)/5 Simplify ((4(sqrt(2299) + 1sqrt(2299)-1 + 3) + 3)-3)2 + -3. 2022 Simplify (25((-3sqrt(475) + -4 - sqrt(475)) + sqrt(475))-4)2 + -1. 192000sqrt(19) + 6865599 Simplify (33sqrt(135) + -3-3sqrt(135))/(sqrt(108)6 - sqrt(192)). 27sqrt(5)/14 Simplify -6((sqrt(120)5)/sqrt(6))*24 - (3 + (sqrt(5) - ((sqrt(5) + 0)6 - sqrt(5))) - ((sqrt(245) + (sqrt(245)-2)*2)3 - sqrt(245))). -9063 + 18sqrt(5) Simplify (4 + sqrt(48) + sqrt(3) + (sqrt(3)1 - sqrt(3)) + sqrt(3) + 2)*2 + 0 + (-4sqrt(9)/sqrt(3)-6-55)2. 72sqrt(3) + 1080144 Simplify -1(-32(sqrt(252) - 2sqrt(252))/sqrt(7))/(sqrt(36)/(sqrt(3)-1)-41). -3sqrt(3)/2 Simplify (((sqrt(95) - (sqrt(95) + 5sqrt(95)-1)) + sqrt(95))5-2)/(sqrt(405)-33-6). -10sqrt(19)/81 Simplify ((sqrt(88) - (sqrt(88)-5 + sqrt(88)) - sqrt(88))2)/(sqrt(100)/sqrt(2) - 2sqrt(50)). -16sqrt(11)/5 Simplify (5(sqrt(228)-1-1 - sqrt(228) - (sqrt(228) - 2sqrt(228))-6))/((2sqrt(120)-5)/(sqrt(90)/(1sqrt(9)))). 3sqrt(19) Simplify 3-4(sqrt(364)/sqrt(7)31)/(1sqrt(100) + sqrt(36)/sqrt(81)). -27sqrt(13)/4 Simplify ((sqrt(2448) + 4sqrt(2448)-6 - (3(sqrt(2448) + 0) + sqrt(2448))) + -1)*2-2. -3569186 - 1296*sqrt(17) Simplify (sqrt(182)/(sqrt(35)/sqrt(45)))/((sqrt(14)	{ "pile_set_name": "DM Mathematics" }
/(10/25). Let x = -8.47 - -8.6. What is the nearest to 0 in p, -1/2, x? p Let t = 144.16 + -2.16. Let g = t - 142. Which is the closest to 4? (a) g (b) 10 (c) -0.4 a Let h = 439 - -895. Let q be 1 + h/(-1460)2. Let w = -2/73 - q. What is the closest to -4/5 in 3/4, w, 5? 3/4 Let q be -3 - -4 - (-25)/(-10) - 0. Let f = 33/61 - 587/183. Which is the closest to -1? (a) q (b) f (c) 15 a Let g(f) = -59f - 166. Let v be g(-3). Let n be (-170)/(-55) - 1/v. What is the nearest to -0.1 in n, 4, 0, 0.3? 0 Let k = 893 - 893.05. Which is the closest to -1/26? (a) k (b) -5 (c) -2/13 (d) -2 a Let d = -10 + 14. Let c = -3894 - -27256/7. Let v = -5 - -4. What is the closest to v in c, 2/9, d? c Let t = -517/150 - -296/75. Which is the nearest to 2/9? (a) t (b) 28/5 (c) 2/9 (d) 0.14 c Let z = -3763.08 - -3763. What is the closest to 2 in 3, z, 1/5? 3 Let u be ((-2)/1)/(3 - 1). Let j = -9343 + 9342.9. What is the nearest to 0 in u, -0.42, j? j Let s be (-132)/22 + (-112)/(-19). Let v = -26 - -25.8. Which is the nearest to -1? (a) v (b) -0.11 (c) 5/4 (d) s a Let o = 951 - 949.4. Which is the closest to -8? (a) o (b) 0 (c) 0.1 b Let o = 5 + 10. Let z = o + -15. Suppose -16 = -m - 11. What is the nearest to 0.1 in z, m, 4? z Suppose -5h - o + 12 = 0, 4 - 10 = -4h - 2o. Let u = 27.954 - -0.046. Which is the nearest to u? (a) -2/3 (b) 2/7 (c) h c Let r = -17556.057 + 17556. Which is the closest to -0.1? (a) 5 (b) 2 (c) 1 (d) r d Let a = -1.4599 - -0.4799. What is the nearest to -2/5 in a, -4, 1/4? a Let w = -0.07 - 3.93. Let o = -41 - -40. Let j = o - -6. Which is the closest to -1? (a) j (b) -9 (c) w c Let q = 28.837 + 0.363. Let u = q + -30.2. Let z = -2 - 0. What is the closest to u in 5/4, z, 2/7? z Let u = -0.0646 + 0.1646. Which is the nearest to -1/22? (a) 0.5 (b) u (c) 0.06 (d) 3 c Let l = -189440/7 + 27062. Which is the closest to 3? (a) 5 (b) l (c) -4/3 (d) 13 a Let r = 19369 - 35939. Let n = r - -1640387/99. Let v = n - -6/11. Which is the nearest to 1? (a) v (b) -1/2 (c) 4/19 c Let q = -172/7 - -24. Suppose 3h = 11 - 2. Let f(o) = -2o2 + 8o - 3. Let l be f(h). Which is the closest to 0.1? (a) 1/5 (b) l (c) q a Let x be ((-10)/(-6))/(6020/1032). Which is the nearest to -0.2? (a) -0.4 (b) x (c) -216 a Let s = 297/380 - 3/95. Let x = -73.5 + 73.1. Suppose 0 = 4u, 0 = -5m - 3u - u - 20. Which is the nearest to -2/5? (a) m (b) x (c) s b Let r be (390/1430 - (-138)/(-22)) + 32. What is the nearest to r in 1, -2/95, -0.3, -1/2? -2/95 Let u be (2/22)/(9/(-54)). Suppose -6s = -l - 3s + 11, 4l - s = 22. Which is the nearest to u? (a) 0 (b) l (c) -4 a Let y = 2922 - 2925.8. What is the closest to -1 in -1, -24, y, -5? -1 Suppose -3n - 2n - 4j + 30 = 0, -4n + 3 = -j. Let m = 488.3 + -488.1. What is the closest to n in -1/5, m, -7? m Let v be ((-1)/(-2))/((-6)/4). Let h = -2035.3 + 2033.3. What is the nearest to v in h, -8, 6/11, 4? 6/11 Let a(p) = p3 + 10p*2 - 8p + 34. Let o be a(-11). What is the nearest to o in 1, -9.9, -0.4, 4/5? 1 Let w be (1 + 1)(14/(-9))/((-436)/981). What is the nearest to 5 in w, 0.4, 2? w Let h be -4(-6)/(-13758)(-2)/(-4). Let u = 4604/20637 + h. Which is the closest to 0? (a) u (b) 0.5 (c) 4 a Let g = -1418 + 1416. Let z be -24(6 + g + (-430)/105). Suppose 2i - 2 = -0i. What is the closest to 0 in z, -3, i? i Let x = -15.87 - -15.85. What is the closest to x in 0.5, 4, -2/5? -2/5 Let c = 0.1273 + 0.1727. Let u = 2654/13 + -204. What is the nearest to c in 1/4, u, 0? 1/4 Let v = -26.415 + 22.415. Which is the nearest to 1/6? (a) -1/4 (b) -1/6 (c) v (d) -3 b Let k = -20.244 + 16.244. Which is the nearest to k? (a) 1/10 (b) 1/7 (c) -3 (d) 566 c Let v = 36.1 - 35. Let x = -1110 + 1107. Which is the nearest to -1? (a) 5 (b) x (c) v b Let z = -5865 + 5865. Which is the nearest to z? (a) 0.212 (b) 4 (c) -5 a Let q = 151483/14700 - 1421/150. Let n = q + -4/49. Suppose v + 1 = 3u, -4u = -11v + 8v - 3. Which is the closest to -0.1? (a) 0.5 (b) u (c) n b Let o be 0 + -1 + 48/30. Let l = 32.1 - 32.2. Let r = 1.0797 - 0.0797. What is the closest to l in o, -2, r? o Let i = -79090 - -79094. Let b = -0.8 + -0.2. What is the nearest to b in i, -3/5, 1? -3/5 Let u(q) = -q*2 - 15q + 24. Let y be u(-17). Let f = 1274.9 + -1275. What is the nearest to f in 0.3, 1/2, y? 0.3 Let v = -29.7 + 29.843. Let n = 0.123 - v. Which is the closest to n? (a) -0.5 (b) 0.1 (c) 4 b Let m = -55.4 + 71.4. Let a be (-22)/(-102) - (-1)/(-9)3. What is the nearest to m in 1, a, -0.2? 1 Let p = 2951/3 - 984. Let n = -0.2 + 0.1. Let k = 0.2 + n. What is the closest to 2/3 in k, p, -4? k Let j = 200.5 - 74.6. Let m = j - 126. What is the closest to 5/4 in 0.1, 0, m? 0.1 Let w = -22411/42 - -3199/6. What is the closest to -0.1 in 1.6, -0.01, w? -0.01 Let a be ((-2)/6)/((-4)/36). Suppose 24y = 20y, 3y + y + 3 = -3l. Let g = 0.6 - 0.3. What is the closest to -4 in a, g, l? l Let d be 2/(-6)11565/(-10) + -2. Let y = -384 + d. Which is the nearest to y? (a) 1/3 (b) -4/7 (c) 2 b Let y = -86196/7 - -12314. What is the closest to y in 1/5, 7, 5/6? 1/5 Let d be (-28)/70 - 261/25. Let t = d + 47/50. What is the nearest to 2 in -2/7, -5, t? -2/7 Suppose 5g - 6 = 2t, 4g - 43t = -47t - 12. Let m(n) = n*2 + 5n + 4. Let j be m(-3). What is the closest to g in j, -4, 0.2? 0.2 Let g = -588 - -521. Let k = g - -67. Suppose -2w - w = 5n - 23, -15 = -3n - 3w. Which is the nearest to -5? (a) -3 (b) k (c) n a Let c = 12250 - 12250. What is the nearest to 182 in c, 0.1, -29? 0.1 Suppose 4t + t - 30 = 5f, -4f + 3t - 28 = 0. Let j be 22/55f/8. Let h = -7.8 - -7.5. Which is the nearest to j? (a) h (b) -1 (c) -0.2 a Let l = 63 - 62. Let w = -208 - -203. Which is the nearest to w? (a) l (b) -1/3 (c) -0.2 b Let q = -22143 - -88573/4. What is the closest to -3/19 in -0.05, q, 1/5, -3/7? -0.05 Let y be -37 + (-4767)/(-126) - 7/3. What is the nearest to -2 in -2/7, y, 0.4, -9? y Let n = 4863 - 4900. Which is the closest to 1? (a) n (b) -9 (c) 5 c Let f = 0.08092 - 0.18092. Which is the closest to f? (a) 82 (b) 0.2 (c) -3/16 c Let w = 21.98 - -3.32. Let g = 25 - w. Let p = -0.27 + 0.27. What is the nearest to 1 in p, g, 0.3? 0.3 Suppose -6 = l - 3l. Let f be ((-2)/(-8))/(1620/4160). Which is the nearest to f? (a) l (b) -2 (c) -5 a Let f = 1138 - 1133. Let n = 33 - 33.02. Let q = -0.02 - n. Which is the nearest to 1? (a) 3 (b) q (c) f b Suppose z + 9z - 23z = 0. Let t = -8/9 + 11/9. What is the closest to z in t, -5, 2/19? 2/19 Let z be (-18)/(-28) - 2/4. Let n = 1038 - 1037. Which is the nearest to n? (a) 1 (b) z (c) -0.2 a Suppose 39 = 5w - 2d, -w + 1416d - 1412d + 51 = 0. Let q = 5 - 3. Which is the nearest to 2/7? (a) 4/3 (b) q (c) w a Let w be (-690)/414 + 4/3. Let s = -4212/23 + 183. Which is the nearest to w? (a) 4 (b) s (c) 2 b Let r = -72 - -74. Suppose -5b - 17 = g, 0 = 2b - rg + g + 4. Let m = -5 - -3. What is the nearest to m in -0.1, b, 0.08? b Let u(d) = d*3 - 20d*2 - 73d + 87. Let i be u(23). Which is the closest to -16? (a) 0.06 (b) -1/4 (c) i c Let d = 30497 - 30500. Which is the nearest to d? (a) -6/7 (b) -0.09 (c) -1/5 a Let x be (-7)/(-4) - 18(-4)/(-36). Let f = 29/195 + 2/39. Let i = 140 + -134. Which is the nearest to f? (a) x (b) i (c) 5 a Let u = -28.6 - -29.6. Let l = 644 - 642. Which is the nearest to l? (a) 5 (b) -2 (c) u c Let m = 464.737 - 29.737. What is the nearest to 0 in m, 5, 0.4? 0.4 Let w = -1919/52 + 147/4. Let s = -2 - 2. Let n = -3.7 - s. What is the nearest to -1/2 in n, w, 2? w Let y be (-147)/105(-12)/(-14). Let o = 2.15 + -0.15. Let k = -130 - -127. What is the closest to y in o, -4, k? k Let u be (0 - 13) + 27 - 8. Let w = -3.6 - -3. Which is the closest to -1/4? (a) 3 (b) w (c) u b Let d = -1.039 - -0.119. Let f = d - -4.92. Suppose 29j + 4 = 27j. What is the closest to 0.3 in j, f, -3? j Let l = 3622 - 3627. Which is the nearest to 2/3? (a) l (b) -1/3 (c) 16 (d) 3 b Let x be (2587/(-597))/((-26)/(-4)). Let n = -0.22 - -0.2. Which is the nearest to x? (a) 5 (b) -3/5 (c) n b Let o = 4 + -4.9. Let s = 0.1 - o. Let g = -0.01858 + -6.98142. What is the nearest to	{ "pile_set_name": "DM Mathematics" }
7, q, 0.5, 0.4 in ascending order. 0.4, 0.5, 6/7, q Suppose 0 = -5g - 98 - 357. Let s = g - -77. Let n be s(-2)/(-4)(-2)/7. Put n, -4, -6 in descending order. n, -4, -6 Suppose 0 = 2g + 74h - 69h + 7, 2g + 6 = -4h. Sort g, -216, 1/2, 2 in descending order. 2, 1/2, g, -216 Let o(j) = 2j3 + 3j*2 + 2j. Let k be o(-1). Let l = -1028 + 1028.5. Sort k, l, -3.3. -3.3, k, l Let a be 46/(-46) - (-16)/22. Put a, -1/9, -6, 4 in increasing order. -6, a, -1/9, 4 Let o = -80 + 7. Let i = 73.5 + o. Let k = 0.1 + 0.2. Put k, 5, 2, i in descending order. 5, 2, i, k Let h = 216 - 1509/7. Let i = -2.05 - 0.25. Let o = i - -2.4. Put o, -0.1, h in descending order. h, o, -0.1 Let o be 0/(-2)-1 - (-5 - -2). Suppose -o = 3u - 9. Suppose 0 = -7d + ud + 15. Sort 2, d, -4 in ascending order. -4, 2, d Let u(r) = -737r + 369r + 0 + 371r + 17. Suppose -q = 2q + 12. Let k be u(q). Put -4, k, -3 in decreasing order. k, -3, -4 Let s = -48 + 76. Let d be s/7 - (0 + 6). Let r be (-4)/(-14) + (548/(-56) - -9). Put 0.5, r, d in decreasing order. 0.5, r, d Let f = 53 - 50. Let n be 30/f + -13 + 7. Suppose 0r + 4r + 16 = 0. Put 5, n, r, 2 in descending order. 5, n, 2, r Let h be (-12)/15 + 261/45 + -5 + 5. Sort 0.4, h, -0.5, -5, -1/15 in ascending order. -5, -0.5, -1/15, 0.4, h Let t(r) = 150r - 3600. Let b be t(24). Sort b, -5, 5 in decreasing order. 5, b, -5 Let x be 3 + (3/6)/(3/6). Let v = -34 + 41. Suppose h - 3f + v + 20 = 0, -16 = -xf. Put 0, h, -1 in decreasing order. 0, -1, h Suppose 399i - 555i + 329i = -39963. Sort -5, 1, -3, i. i, -5, -3, 1 Suppose -4p + 3x = 19, -p + x = 4p + 21. Let t = 8 + -16. Let d = -724 - -725. Sort t, d, p. t, p, d Suppose 8c + 49 = 5m, 6c + 22 = -2m + 4c. Sort 6, 9, m, -5 in increasing order. -5, m, 6, 9 Let q be (5/150)/(8/40). Sort 1/13, q, 0.8, -0.3 in decreasing order. 0.8, q, 1/13, -0.3 Suppose 3v + 22 = 2a, 4v + 11 = 4a - 25. Let q = -54 - -54.1. Sort a, q, 6 in ascending order. q, a, 6 Let b be ((-4)/(-6))/(208/(-48)). Let u = -985 - -988. Put -1.2, b, -4, u in descending order. u, b, -1.2, -4 Let j be ((-2)/(-10))/(28/210). Let v = -475.08 + 504. Let o = v - -0.08. Sort j, o, 1. 1, j, o Let p = -0.7197 - 612.5803. Let c = p + 613. Put c, -16, 4 in descending order. 4, c, -16 Suppose 8l = 5 - 5. Suppose lr + d + 38 = 5r, r - 10 = -d. Sort -5, -1, r, 2. -5, -1, 2, r Suppose 51r = 989 - 938. Put r, 0.136, -5, 0 in decreasing order. r, 0.136, 0, -5 Let y be -51157/1170-3. Sort 5/3, 4, y. 5/3, 4, y Let f(b) = 20b2 - 7b - 5. Let h be f(-1). Suppose 33s = -4i + 38s - h, 4s = 3i + 16. Sort 3, -1, i in ascending order. i, -1, 3 Let w(k) = k3 - 5k*2 + 4k. Let h be w(4). Let o be (5/(-3))/(4 - 26/6). Suppose -5d + g - 30 + 6 = 0, og = 20. Put h, d, 2 in descending order. 2, h, d Suppose 1277w = 1253w + 48. Suppose 4g = -3k, 2g + 2 = -2k - 0. Sort w, -0.5, 14, g in increasing order. -0.5, w, g, 14 Let f = -2 - -1. Let s = -72 + 155. Let w = s + -83.3. Sort f, w, -4/5. f, -4/5, w Let a(q) = q - 25. Let u be a(50). Put 2, 4, -1, 3, u in descending order. u, 4, 3, 2, -1 Suppose -2b + 0b + 2r = -4, 3r + 12 = 0. Suppose 0 = c + 5y - 120, -4y - 4 = 8. Let j be c/(-117) + (-6)/(-195)5. Sort b, j, -5 in decreasing order. j, b, -5 Let j be 11/(-33) - 2/3. Let b = 5 - 18. Let g = b - -16. Put -63, g, j in increasing order. -63, j, g Suppose -u = u - 4. Let p be (u/14)/((-336)/392). Sort -0.02, p, -1/10 in decreasing order. -0.02, -1/10, p Let m(i) = -19i2 - 6. Let f be m(3). Let a be f/(-15) + ((-12)/15 - -1). Let x be (0 - a/(-3)) + -4. Sort -3, -1, x in descending order. x, -1, -3 Let w = 0.0381 + 3.9619. Sort w, 0.703, -0.4 in ascending order. -0.4, 0.703, w Let g = 15 + -19. Let y = -2390 - -2393. Sort g, 14.1, y in ascending order. g, y, 14.1 Let w = 43623/104 + -5448/13. Let v(r) = -r3 - 5r2 + r + 4. Let d be v(-5). Sort -82, d, w in descending order. w, d, -82 Let z be (-20 + 19)(-4 + 5)-1. Sort 5, -44, 4, z. -44, z, 4, 5 Let x = -19 - -23. Suppose -xu + 19 + 17 = 0. Suppose 2 = ua + 38. Sort 4, 1, a in decreasing order. 4, 1, a Let f = -0.4272 + 0.0272. Let r be -4 - (2 + -2) - 10/(-5). Sort f, -1/4, r, 0.2 in ascending order. r, f, -1/4, 0.2 Suppose 0 = 60d - 52d + 120. Let h be (2/d-3)/((-8)/(-680)). Sort h, -1/4, -2/19 in decreasing order. h, -2/19, -1/4 Suppose 4k - 3k = 3d - 25, -4d = -5k - 37. Let q be (-4)/d - (41/2)/(-1). Suppose 0 = 17j - qj + 3. Put 5, j, -2 in descending order. 5, j, -2 Let i = 256 - 257. Let x = -9 + 9. Suppose 2p = 3c + 1, -3p + 8 = -xc + 2c. Sort c, 3, i, 2. i, c, 2, 3 Let t = -0.24 - 11.76. Let d = -382.9864 + -0.0136. Let k = -386 - d. Put 2, -1, t, k in decreasing order. 2, -1, k, t Suppose 0 = -4c + 3f - 134 + 157, -5 = 5f. Put -1, 2, 1, -253, c in increasing order. -253, -1, 1, 2, c Let z be 322/(-98) - 14/(-49). Let g be (2 - 2) + 6/9. Sort 6, z, 3, g in decreasing order. 6, 3, g, z Let i(s) = 238s + 4764. Let k be i(-20). Let v(q) = q - 2. Let h be v(0). Put h, 14, k in increasing order. h, k, 14 Let v = -5660.2 + 5660. Put 1/10, -0.4, v, -0.9, 2/11 in descending order. 2/11, 1/10, v, -0.4, -0.9 Suppose -5m + 416 = 251. Suppose ml = 30l + 15. Put 4, 3, l, 1 in decreasing order. l, 4, 3, 1 Suppose 21f = -132978 - 17729 + 23531. Sort 2, f, -4. f, -4, 2 Let i(w) = -10 + 3w + w3 - 6w - 6w + 7w*2. Let b be i(-8). Suppose -5x + 0m - 25 = -5m, 4x - 34 = -5m. Sort x, b, 4 in descending order. 4, x, b Suppose 8431 = -14z + 8361. Put z, 4, 5, -16 in decreasing order. 5, 4, z, -16 Let b = 6 + -3. Suppose 0k = 2k - 10. Let m be (-5)/(-2)26/(-65). Sort k, m, b, -2 in increasing order. -2, m, b, k Suppose -119 = -5t + j + 319, 0 = 4j + 32. Sort -4, -1, -2, -8, t. -8, -4, -2, -1, t Let j = 743.42 - 747.42. Let o = -0.8 - -0.3. Sort 5/3, o, 1, j in ascending order. j, o, 1, 5/3 Let t = -11260 + 11262. Put 4, t, -142 in ascending order. -142, t, 4 Suppose -15c = -16c - 20c. Let q(y) = -y2 - 7y - 6. Let b be q(-5). Sort c, b, 6 in descending order. 6, b, c Suppose 2x - 9m = -8m + 1, -m - 2 = -3x. Sort x, 980, -2, -4 in decreasing order. 980, x, -2, -4 Let s = -3.97538 + -0.02462. Put 0.4, 9, 0.5, 0.1, s in descending order. 9, 0.5, 0.4, 0.1, s Suppose -683p + 586p = 2813. Let y be ((-8)/6)/(2/(4 - -2)). Sort y, -5, p in ascending order. p, -5, y Let x = 8.9 - 9.3. Let t(b) = -6b2 + 70b + 25. Let r be t(12). Put x, 12, -2, r in descending order. 12, r, x, -2 Let l = 10124 - 10128. Suppose -3x + 6x - 3 = 2m, 0 = 3m - 2x - 8. Sort -5, l, m, -2 in decreasing order. m, -2, l, -5 Let b = 103 - 107.988. Let r = -2351.988 - -2352. Let c = r - b. Put 4, 2/7, 1, c in ascending order. 2/7, 1, 4, c Let k = -363/32 - -367/32. Let r = 1.2 - 0.2. Let n = r + -1. Put k, n, -0.1 in ascending order. -0.1, n, k Suppose -3w + 20 = -2p + p, -p = -4. Let i = 7 - w. Let c = -0.1457 + 0.2457. Sort c, i, 3, 19 in ascending order. i, c, 3, 19 Let h = 0.07 + -0.37. Let x = -144155/12 + 72079/6. Put -0.2, -0.5, x, h in descending order. x, -0.2, h, -0.5 Suppose -2a = -3u - 9, 5u + 11 = -4. Let y be (5/(-10) - 1)(-20)/6. Suppose 3s = -4r - as - y, 14 = -r - 5s. Sort -8, -4, 5, r in decreasing order. 5, r, -4, -8 Suppose b + 4g + 13 = 3, -3b - 5g = 9. Suppose -2 = bu - 16. Suppose 0 = i - 5 + u. Sort -9, -1, i. -9, i, -1 Let d = 59.9 - 65.8. Sort -0.3, -2, 1/2, d in ascending order. d, -2, -0.3, 1/2 Let s = 9 + -5. Let h = 0.8333 - 0.8933. Sort h, s, 1, -0.01. h, -0.01, 1, s Let b = 0.64 + -31.64. Let v = 28 + b. Sort -0.78, -0.1, v. v, -0.78, -0.1 Let h = 25205.02 + -25205. Put h, -3/55, 0.4 in decreasing order. 0.4, h, -3/55 Suppose 7n = 10n. Let m be (-2)/(-6)n + 0. Suppose 17u - 18u = -2t - 6, -5u + t = -12. Sort 25, u, m in descending order. 25, u, m Let v be (-1)/((-4)/(-36)3). Let z = 44.84 - 44. Let k = z + -0.44. Sort v, k, 4 in decreasing order. 4, k, v Let s = 54 + -52. Suppose -5k - 16 = n, -n + sk = 1 - 6. Let u be ((-1)/(-2))/((-9)/(-30)). Sort u, n, -3. -3, n, u Let t(u) = -u3 + 6u*2 - 7u + 7. Let r be t(5). Let v = -52 - -121. Suppose -65k = -vk - 28. Sort -4, k, r in decreasing order. r, -4, k Let w be (-2)/(-1) - (-119 + 1 - -1). Let t = w + -116. Let g = -9	{ "pile_set_name": "DM Mathematics" }
j = h + 42, 8h = 4j + fh - 163. What is the units digit of j? 7 Let n = -61 + 65. Suppose 10 = 4k - 2k, -k - 279 = -ng. What is the tens digit of g? 7 Suppose 5s = 4h + 1589 - 483, -h - 440 = -2s. Let g = s + -143. What is the tens digit of g? 7 Let a be (-20 + 118)/((-1)/1). Let h = a - -173. What is the tens digit of h? 7 Suppose -4m + 2i - 12 = 0, 5i - 12 = 2i. Let u be 3 - (m - 4/2). Suppose 0 = 2s + 5p - u, 2s - s = 4p + 16. What is the units digit of s? 8 Let j = -1217 - -1931. What is the tens digit of j? 1 Let k(h) = -4h - 1. Let m be k(0). Let y(f) = -219f + 3. What is the hundreds digit of y(m)? 2 Suppose 5v = 6v + 15. Let d(q) = -q + 29. What is the units digit of d(v)? 4 Suppose -3l = -2w + 338, 195 - 26 = w + 4l. Let t = 78 - w. What is the tens digit of (-4)/(-6) + t/(-3)? 3 Suppose -5p + 2v + 4110 = 0, -3p + 5v + 2216 + 231 = 0. What is the hundreds digit of p? 8 Let k = -821 + 1914. What is the thousands digit of k? 1 Let z = 9 + 5. Let f be (-4)/z - (-10)/35. Suppose 3r - 8r + 50 = f. What is the units digit of r? 0 Let l = -5815 - -8976. What is the units digit of l? 1 Suppose -5k = -4 + 19. Let z(j) = -j2 - 5j - 6. Let l be z(k). Suppose 3t - t - 58 = l. What is the tens digit of t? 2 Let f(m) = -2m - 2. Let r be f(-2). Let w(b) = 4b2 + 19 - b2 - 25 + br. What is the tens digit of w(3)? 3 Let q = 558 - 320. What is the units digit of q? 8 Suppose 4 = x - m, 2x + 0x = -2m. What is the hundreds digit of (0 - (-15)/x)(-40)/(-3)? 1 Suppose -12 = -j + 3t, -5j - 20t + 27 = -24t. Suppose 104 - 40 = p. What is the tens digit of (-36)/27 + p/j? 2 Suppose 3z - z = 4d + 156, 3d = -z + 93. What is the tens digit of (-4 - -5) + 1 + z? 8 Let c(f) = -589f3 - 5f - 4. What is the tens digit of c(-1)? 9 Suppose 4n - 40 - 104 = 0. Let z be 8/12n/8. Suppose -4u + zc + 117 = -2u, 62 = u + 2c. What is the tens digit of u? 6 Let r(w) be the second derivative of 1/6w4 + 4w*2 + 11/6w*3 + 0 + 8w. What is the units digit of r(-9)? 1 Suppose 18s = -18s + 26748. What is the tens digit of s? 4 What is the tens digit of (-1299)/(-15) - 54/(-50)? 8 Suppose 17p = 14p + 2229. What is the units digit of p? 3 Let l(y) = -y3 + 26y*2 - y - 21. What is the thousands digit of l(18)? 2 Suppose -63751 = -41x - 17298. What is the thousands digit of x? 1 Let m = 27 - 2. Suppose m = 3t - 32. What is the tens digit of t? 1 Let q(c) = 2c - 17. Let f be q(10). Suppose 4a = fa + 62. What is the tens digit of a? 6 Suppose 7t - 199 = 123. What is the tens digit of (-66)/11t/(-4)? 6 Suppose -j - 2j = c - 58, 3j + 3c = 48. What is the tens digit of j? 2 Suppose 0 = 3u + 4t - 7t - 405, t + 663 = 5u. Let f = 258 - u. Suppose 4l + f = 5z, 2z - l - 56 = 2l. What is the units digit of z? 2 Suppose 4r + 0t = 3t + 144, 0 = 2r + 5t - 98. Let v be -14/(-10) + (-70)/50. Let z = v + r. What is the units digit of z? 8 What is the tens digit of -5(5 + -4)-21? 0 Suppose -4m + 577 = 3j - 0j, -3m - 5j + 419 = 0. What is the hundreds digit of m? 1 Let w(y) = 7y2 - 2y - 1529. Let q(p) = 4p2 - p - 765. Let b(c) = -11q(c) + 6w(c). Let x be b(0). What is the units digit of 4/(-3)x/22? 6 Suppose 6c = -5c + 33. What is the units digit of (-2 + c/2)/(1/(-66))? 3 Let a = 164 + -142. What is the tens digit of a? 2 Let x = -439 + 810. What is the units digit of x? 1 Suppose 5p + 883 - 2297 = -w, 3w - 294 = -p. Let i = p + -149. What is the tens digit of i? 3 Suppose -11q = -9q + 5n - 505, -5q + 1247 = -3n. What is the tens digit of q? 5 Let i = 719 - 398. What is the hundreds digit of i? 3 Let b be (-4)/8226-5. Suppose 3t = -2t + b. Suppose 5s - 5f = 85, 5s - 2f + 25 = t. What is the tens digit of s? 1 Suppose -q = -5m + 15, -2q + 4m + 9 = 7m. Suppose q = -2c - c. Suppose cg - 4g = -28. What is the units digit of g? 7 Let v(q) = -q - 2. Let i be v(-3). Suppose l - 6 = -i. Suppose 0 = -5x - lu + 40, 2u = 5x - 0u - 75. What is the units digit of x? 3 Let l = -340 + 638. What is the units digit of l? 8 Let c = -2393 + 3372. What is the hundreds digit of c? 9 Let q(w) = -77w + 159. What is the hundreds digit of q(-6)? 6 Let c be 16/88 - (-1842)/33. Suppose -22 + c = f. What is the tens digit of f? 3 What is the tens digit of (-9)/((-36)/3176) + 3 + -7? 9 What is the units digit of 2/(-6) + (-17948)/(-42)? 7 Suppose c + 7a - 1981 = 3a, 2026 = c - 5a. What is the tens digit of c? 0 Let k(q) = -q3 - 9q*2 + 11q + 10. Let h be k(-10). Suppose 5t - 82 - 173 = h. Let j = -30 + t. What is the units digit of j? 1 Suppose -3 - 13 = -4q. Suppose -858 = -5v - qu, 0v - 3v + 506 = -2u. What is the tens digit of v? 7 Let k = 25 - 21. Suppose ks = -31 - 5. Let f(j) = -j*2 - 14j - 6. What is the units digit of f(s)? 9 Suppose -10 = -6v + v. What is the units digit of 57 + (-2)/1 + v? 7 Let n be (-16)/(-6) - 8/(-24). Let t = 128 - n. Suppose g = 4g + 3f - 84, 0 = -5g - 2f + t. What is the units digit of g? 3 Suppose -3b - 128 - 32 = -4m, 5m - 4b = 200. What is the units digit of m? 0 Suppose 10z - 91497 = -11z. What is the tens digit of z? 5 Let j be (-16)/69/(-6). Suppose -js = -s - 138. Suppose -2y + 5y + p - s = 0, -5y = -4p - 88. What is the tens digit of y? 1 Let k be (54/21)/((-6)/(-56)). Let l = k - 23. What is the units digit of (11 - l)/5 - -66? 8 Let h = 549 + 7. What is the hundreds digit of h? 5 Suppose 8x - 10x = 2n - 64, 5n + 29 = 2x. What is the tens digit of x? 2 Suppose 0 = p + 5, -4l = 23p - 27p - 5724. What is the thousands digit of l? 1 Let m(l) = -l2 - 2l + 4. Let w be m(0). Suppose 4c - wz = z - 33, 0 = -3c + z - 11. What is the tens digit of 4/(-8)c + 11? 1 Suppose 0 = -643j + 630j + 30875. What is the tens digit of j? 7 Let l(k) = -23k - 24. Let i be l(5). Let s = 196 + i. What is the units digit of s? 7 Let t(s) = 29s + 23. Let m be t(13). What is the units digit of (-4)/(-3) + -1 + m/6? 7 Let d be (-4)/699/(-22). Suppose db = c + 32 + 75, 3c + 173 = 5b. What is the units digit of (-3)/9(-2 - b)? 3 Suppose 0o - f + 15 = -o, 8 = 2f. Let z(a) = -a2 - 11a + 51. Let c be z(-16). Let w = o - c. What is the units digit of w? 8 What is the hundreds digit of 4606/(-21)90/(-35)? 5 Let q = -2053 - -5506. What is the tens digit of q? 5 Suppose -v = v - 4. Suppose 0 = -4w - 3t, vw = 4w - 4t - 22. Suppose -4n - 5j + 20 = 0, 2j + 4 = wn - 11. What is the units digit of n? 5 Suppose -j = -6 + 1. Suppose 2c + 2z - 12 = 0, -jc - z - 3z = -30. Suppose 2n = -s + 16 + 13, s - 5n = -c. What is the tens digit of s? 1 Let a be ((-6)/(-4))/((-1)/6). Let k(i) = i + 11. Let v be k(a). What is the tens digit of 10/(v/4 + 0)? 2 Let n(h) = 257h2 + 2h + 1. Let a be n(-1). Suppose -12k = -8k - a. What is the tens digit of k? 6 Let s(k) = k + 2. Let g be s(5). Let q = g - 3. Suppose -7 = -qx + 97. What is the units digit of x? 6 Suppose 3r + 9904 = 2t, r = 9t - 7t - 9904. What is the thousands digit of t? 4 Let w(f) = f + 12. Let b be w(-11). Let p be 2/b - (-16)/(-4). What is the units digit of (0 + 3)/(p/(-6))? 9 Suppose 4s - 59 = -7. Let t = 13 + 0. Let k = t + s. What is the units digit of k? 6 Suppose -23 = -j - 0. Let v = 49 + -50. What is the units digit of (j - v - 0) + 1? 5 Let v(h) = h*3 - 5h*2 - h - 6. Suppose 0 = r + 4r - 30. Let f be 18/1020/r. What is the tens digit of v(f)? 2 Let z(s) = 66s*3 + 4s*2 + 7s - 9. Let a(j) = 33j3 + 2j*2 + 4j - 5. Let f(w) = 7a(w) - 4z(w). What is the units digit of f(-1)? 2 Let v = 22 + 148. What is the units digit of v? 0 Let j(s) = -23s3 - 1. Let i be j(-1). Suppose 0 = 5g + 188 + i. What is the tens digit of 1 + -2 - (1 + g)? 4 Let f(y) = y*3 + 3y*2 + 5y - 1. Let w be f(-2). What is the hundreds digit of (-672)/w + (1 - -3)? 1 Let q = 24 - 15. Let z = 59 - q. What is the tens digit of z? 5 Let l = -669 + 1634. What is the units digit of l? 5 Let q(g) = -g*3 + 9g*2 - 8g + 7. Let n be q(8). Let w = n + -7. What is the units digit of (w + -9)/((-15)/50)? 0 Let c = -5639 - -8731. What is the hundreds digit of c? 0 Let w(p) = -p*2 - 10 + 21p - 4 + 2 - 10p. Let n be w(8). What is the units digit of (-15)/(-6)n/10	{ "pile_set_name": "DM Mathematics" }
. Calculate qk(t) + 6a(t). 2t - 1 Let h be 4/(143/65 + 2/(-10)). Let d(i) = 8i - 6i - i + 2i*h - 5i. Let c(u) = -4u2 + 9u + 1. Determine 2c(g) + 5d(g). 2g2 - 2g + 2 Let w(c) = 3c3 - c2 + 4c. Let u(o) = 4o3 - o2 + 4o. Determine -4u(a) + 5w(a). -a3 - a2 + 4a Let g(d) = -15d - 1. Let k(j) = j*3 + 7j*2 + 9j - 4. Let i be k(-4). Let z(w) = 23w + 2. Calculate ig(q) + 5z(q). -5q + 2 Let s be (10 + -12 - (-2 - -4))/(-2) + 4. Let l(c) = 9c - 5. Suppose 5 = -3w + 2w. Let d(n) = 10n - 6. Give sl(x) + wd(x). 4x Let v(o) = o2 - 6. Let u(f) = -f2 + 13f + 6. Suppose -3n + 40 = 4x, n = 4x - 5x + 9. Let t be u(x). Let z(p) = -5p2 + 35. Give tz(j) + 35v(j). 5j*2 Let k(n) = 7n*2 + 7. Let u(r) = -14r*2 - 15. Suppose -38b - 145 = -639. Determine bk(f) + 6u(f). 7f2 + 1 Let y(o) = -o3 - o2 - o + 1. Let h(f) = 3f*3 + 2f*2 + 51f. Determine h(x) + 2y(x). x3 + 49x + 2 Let d(o) be the third derivative of -o*3 + 0 + 1/20o*5 + 0o*4 + 0o + o2. Let i(z) = -1 - z2 - z*2 + 3z*2. Calculate d(k) - 4i(k). -k2 - 2 Let i(k) be the first derivative of -k - 9. Let v(g) = -g2 + 4g + 1. Let t = 80 + -79. Give ti(z) - v(z). z*2 - 4z - 2 Let v(a) = 8a + 39. Suppose 4k = -l + 16, -12l - 4 = -k - 8l. Let d(g) = -3g - 13. Calculate kv(q) + 11d(q). -q + 13 Let i = -6 - 0. Suppose 5 = -2d + j + 8, 3j + 13 = 2d. Let o(b) = -1. Let n(f) = f + 6. Give dn(w) + io(w). -w Let w(o) = -9o + 6. Let q(z) = -z + 1. Let x(t) be the first derivative of -t2/2 + 13t - 7. Let p be x(7). What is pq(y) - w(y)? 3y Suppose 8 - 2 = -2r. Let m(v) = 2v*3 - 3v2 - v + 3. Let i(f) be the third derivative of -f6/120 + f5/60 - f3/6 + 31f2. What is ri(w) - m(w)? w*3 + w Let h(l) = -l + 17. Let n(y) = 0 + 7 - 6 + 5. What is 3h(d) - 8n(d)? -3d + 3 Let x(k) = 89k3 - 3k. Let d(q) = -90q3 + 4q. Determine 3d(o) + 4x(o). 86o3 Let f(p) = -7p + 7. Let i(b) = -1. Give 2f(a) + 6i(a). -14a + 8 Let p(j) be the third derivative of 0j - 1/12j4 + 10j*2 - 5/6j*3 + 0. Let y(q) = -6q - 14. Let k = 2 - 6. What is ky(z) + 11p(z)? 2z + 1 Let w(u) = u2 + 3u - 1. Let m(z) = 8z2 + 49z - 8. Determine -m(h) + 6w(h). -2h*2 - 31h + 2 Let w(x) = 3x + 3x*2 - 16x + 3 + 4x + 4x. Let t(z) = 4z2 - 6z + 3. Give -5t(u) + 6w(u). -2u2 + 3 Let z(v) = -25530v*3 - 1265v*2 - 1265v - 1265. Let q(b) = 121b3 + 6b*2 + 6b + 6. Determine -1265q(j) - 6z(j). 115j3 Let k(d) = -2d*2 + 150d + 5. Let y(c) = -3c2 + 225c + 7. Calculate 7k(q) - 5y(q). q*2 - 75q Let h(c) = 5c + 8. Let i(t) = -23 + t - 9 + 33. Determine -h(p) + 4i(p). -p - 4 Let a(g) = 202g3 - 7g*2 + 5g + 28. Let k(t) = -303t3 + 11t*2 - 8t - 44. Calculate 8a(n) + 5k(n). 101n3 - n2 + 4 Let v(n) = -4n*3 - 7n*2 + 6n - 6. Let m(a) = a3 + a2 - a + 1. Let s = 1502 + -1508. Give sm(j) - v(j). -2j3 + j2 Let u(m) = 4m - 7. Let p(v) = 18 + 2v - 3v - 17. Let w be (45/20)/((-30)/80). Give wp(k) - u(k). 2k + 1 Let t(k) = 1851k + 14. Let u(x) = -463x - 3. Give 4t(v) + 18u(v). -930v + 2 Let l(u) = -356u2 - 12u + 12. Let h(z) = 1069z2 + 34z - 34. What is 6h(p) + 17l(p)? 362p2 Suppose 3h + 1 = -8. Let y be -2 - ((-3)/60 + h). Let s(v) = 2v*2 + 7v - 5. Let i(z) = z*2 + z - 1. What is ys(c) - 5i(c)? -3c*2 + 2c Let f(z) be the third derivative of -z6/30 + z4/12 - z*2. Let t be ((80/2)/(-10))/(-2). Let v(m) = 5m*3 - 3m. Determine tv(o) + 3f(o). -2o3 Let t(a) = 48a - 1. Let b(n) = 141n - 3. Give -6b(p) + 17t(p). -30p + 1 Let o(u) = 2u3 + 11u*2 + 6u - 8. Let w(x) = -3x3 - 23x*2 - 13x + 17. Let n(p) = -13o(p) - 6w(p). Let q(t) = t3 + t2. Calculate -n(f) - 4q(f). 4f3 + f2 - 2 Let w(a) = 220a - 3. Let c(x) = 20240x - 275. Calculate 3c(t) - 275w(t). 220t Let o(n) = -n3 - 3n*2 - 3n - 3. Let d(i) = i*3 + 3i*2 + 4i + 4. Let k = -407 - -410. Give kd(l) + 4o(l). -l*3 - 3l*2 Let y(h) = 15 + 3h*3 + 0 - 4 - 7 + 0h*2 - 2h*2. Let o(w) = 1. What is -4o(b) + y(b)? 3b3 - 2b*2 Let s(i) = 8i + 4. Let u(f) = -f - 1. Let m be 13(-2 + (5 - 6/3)). Suppose -5r + 29 = 4, 0 = -3b - r - m. What is bu(t) - s(t)? -2t + 2 Let h(z) = z3 + z + 1. Let x(s) = -12s*3 - 8s + 4. What is 8h(f) + x(f)? -4f*3 + 12 Let w(y) = 85y - 2. Let t(j) = -1. What is 4t(m) - w(m)? -85m - 2 Let t(d) = 3d3 + 6d - 5. Let m = -314 - -313. Let n(x) = -x*3 - x + 1. Calculate mt(r) - 6n(r). 3r*3 - 1 Let m(s) = 95s + 4. Let i(l) = -190l - 9. Calculate 2i(j) + 5m(j). 95j + 2 Let d(g) = -g*3 - 5g*2 + 3g - 20. Let a be d(-6). Let x(y) = y3 - y2. Let n(p) = 4p3 - 5p*2. Give an(u) + 10x(u). 2u3 Let q(x) = x3 + x*2 - 1. Let b(j) = -5j*3 - 4j*2 + j + 1. What is b(h) + 2q(h)? -3h3 - 2h*2 + h - 1 Let p be -30(4 + -14 - -4). Let j(x) = x*2 + px - 8x2 - 179x - 4x3. Let a(o) = -2o*2 - 3o3 - o2 + o*3. Give -7a(u) + 3j(u). 2u*3 + 3u Let m(t) = -3t + 6. Let r(o) = -3o + 5. Let q = -16 + 16. Suppose qu = -11u + 66. Determine ur(f) - 5m(f). -3f Let s(a) = -17a*2 - a. Let b(g) = -16g*2 - g. Give -4b(q) + 5s(q). -21q*2 - q Let c(s) = -31s - 977. Let t(g) = 23g + 976. What is -3c(n) - 4t(n)? n - 973 Let t(i) = -i2 + 5i - 1. Let h(p) = -p*2 + 6p - 1. Suppose 2y = -0y. Suppose 6 = 2l - g, 0 = -yl - 3l - 4g + 20. Determine lh(s) - 5t(s). s*2 - s + 1 Let b(x) = -623x - 622x + 1249x. Let j(d) = 2d2 + 3d - 2. Let u be j(-3). Let v(p) = -9p. Determine ub(y) + 3v(y). y Let l(j) = -1. Let x(q) = q - 5q + 2q + 4 + 4. Let s(r) = 3l(r) + x(r). Let n(m) = m*3 - 1. Calculate -3n(f) - s(f). -3f3 + 2f - 2 Let k(b) = 6b2 + 76b + 109. Let j be k(-11). Let v(g) = -1 - 4 + 2g - 6g + g*3. Let x(i) = i + 1. Give jv(n) - 5x(n). -n3 - n Let o(i) = -6i*3 + 3i*2 - 9i - 2. Let w(n) = n3 - n2 - n. Determine -o(h) - 5w(h). h3 + 2h*2 + 14h + 2 Let h(y) = 4y3 - 4y*2 + 3y + 3. Let o(n) = -3n3 + 3n*2 - 2n - 2. Determine -4h(c) - 5o(c). -c3 + c2 - 2c - 2 Let w(s) = 7s*3 + 16s + 2. Let n(m) = -10m3 - 24m - 3. What is 5n(p) + 8w(p)? 6p3 + 8p + 1 Let p(y) = 4y + 1. Let v(r) = -20r - 6. Suppose -7q - 236 = -124. Calculate qp(f) - 3v(f). -4f + 2 Let n(f) = 5f2 + 2f - 2. Let q(o) = 44o2 + 16o - 6. Let v(h) = 175h2 + 63h - 21. Let a(d) = 21q(d) - 5v(d). Determine 2a(g) - 21n(g). -7g2 Let h(v) = 2v - 49. Let o(r) = 6r - 146. Calculate 11h(y) - 4o(y). -2y + 45 Let i(z) = z2 - 4. Let b = 85 + -61. Let g = b - 15. Let v(q) = q2 - 2q + 2q*2 + q - g. Calculate 5i(u) - 2v(u). -u2 + 2u - 2 Let z(u) = -1 - 5u3 - 2u3 - u2 + 5u - 2. Suppose 0 = 117h - 122h - 25. Let k(n) = 6n3 + n2 - 4n + 3. What is hk(r) - 4z(r)? -2r3 - r2 - 3 Let n(b) = -b - 7. Let r(m) = 8m - 24. Determine -5n(i) + r(i). 13i + 11 Let q(t) = t2 - t. Let n(a) = 2a*3 + 9a*2 + 2a. Calculate -n(f) + 4q(f). -2f*3 - 5f*2 - 6f Let q(m) = -5m3 - 4m*3 + m + 10m*3 + 3. Let r be q(0). Let l(j) = -j + j - 2j - 3 + rj. Let y(z) = 6z - 16. Calculate -22l(f) + 4y(f). 2f + 2 Let b(a) = -2a + 4. Let w(d) = 1369d - 444. Calculate -111b(u) - w(u). -1147u Let j(l) = -2l - 179. Let p(t) = t + 90. Give -3j(w) - 5p(w). w + 87 Let y(x) = 5x3 - 4x + 1. Let p(f) = 44 - 25 - 4f3 + 3f + 0f - 20. Determine -6p(j) - 5y(j). -j3 + 2j + 1 Let y(f) = -7f2 + f - 9. Let o(b) = -b3 + 12b*2 + 29b - 11. Let r be o(14). Let q(j) = 4j2 - j + 5. What is ry(n) + 5q(n)? -n2 - 2n - 2 Let d(l) = 2l3 - 10l*2 - 12l. Let b(r) = 2r3 - 7r*2 - 11r + 1. Give 3b(g) - 2d(g). 2g3 - g2 - 9g + 3 Let l(q) = 4q2 - 14q + 2. Let i(f) = 5f2 - 16f + 1. Calculate 5i(a) - 6l(a). a*2 + 4a - 7 Let j(l) = 7l - 3. Let x(s) = s + 1. Let p(m) = 3m + 1. Let k(f) = -p(f) + 2x(f). Let a be 2 + (-70)/22 - (-16)/88. What is aj(g) - 4k(g)? -3g - 1 Let r(w) = -2w2. Let j(d) = d2. Let v(s) = 2s*2. Let i(p) = -4j(p) + v(p). Let u = -1 + -3. Give ur(h) + 5i(h). -2h2 Let v(p) = -2 + p2 - p3 - 1 - p + 2. Let y(u) = -2u*2 + 5u	{ "pile_set_name": "DM Mathematics" }
79, l - 2d - x = 258. What is the highest common divisor of l and 36? 36 Let u(z) = 4z*2 - 46z - 578. Let l be u(-8). Calculate the greatest common divisor of l and 134. 2 Suppose 12u = -397 - 23. Let l(h) = -3h*2 - 103h + 74. Let g be l(u). Let s(z) = -2z + 2. Let b be s(-4). Calculate the greatest common factor of b and g. 2 Let i be 20/(4/(-2)) - (1348 + -1382). Calculate the highest common factor of 5484 and i. 12 Let w(v) = 240v - 168. Let h be w(3). What is the highest common factor of h and 966? 138 Let s = 95 - 91. Suppose sb - 7b + 30 = 0. What is the highest common divisor of b and 12? 2 Let y(q) = 2651q - 227698. Let g be y(86). Let v = -9 + 18. What is the greatest common divisor of v and g? 9 Suppose -3a + 9472 = 2n, -3158 = -a - 26n + 25n. Calculate the greatest common factor of 36 and a. 12 Let i(f) = -f3 - 14f*2 - 31f + 24. Let v be i(-11). Suppose 0 = vl - 2z - 98, z = 5l + 178 - 443. Calculate the highest common divisor of l and 126. 18 Let i(t) = 93t + 4318. Let z be i(34). Calculate the highest common factor of z and 88. 88 Let g = -187 + 83. Let z = g - -124. Calculate the greatest common divisor of z and 140. 20 Let s(t) be the first derivative of 1/3t3 + 5t - 13/2t2 - 10. Let k be s(13). What is the highest common divisor of 40 and k? 5 Let i = 25 - -29. Let l be (1 - (-7 + 6))/((-2)/(-27)). What is the highest common factor of i and l? 27 Suppose 3y + 2178 = -47y + 116y. Suppose 12 = 4c - 0c. Calculate the highest common factor of y and c. 3 Suppose -2054t + 658764 = 470t. Suppose 3n - 116 = -3b - 20, 4b - 5n = 164. What is the greatest common divisor of b and t? 9 Let r be (2/(-2))/(13/(-13 - 52)). Suppose -2 = -2f - 66. Let l = r - f. What is the greatest common divisor of l and 74? 37 Let z(q) = -18q - 34. Let u be z(11). Let f = -21 - -37. Let s be (-2)/4 + 0 - u/f. Calculate the greatest common divisor of 14 and s. 14 Suppose b = 4b + r - 1843, -2r = -3b + 1858. Calculate the highest common factor of 396 and b. 44 Let y(p) = -25 - 6p - 3p + 6p. Let c be y(-13). Let l = 54 - c. What is the greatest common divisor of 16 and l? 8 Let a(n) be the first derivative of 70n3/3 - 11n*2/2 + 11n - 21. Let p be a(1). What is the greatest common factor of p and 56? 14 Let p(g) = 4g3 - 17g*2 - 41g + 247. Let t be p(7). Calculate the greatest common factor of 1 and t. 1 Let k(r) = -r + 11. Suppose 3 = 4q + 5c, 3q - 1 = -5c + c. Let d be 2/q - (-94)/14. Let x be k(d). Calculate the greatest common factor of x and 20. 4 Suppose -6w + 6w - 3w = 0. Suppose w = 3a - 5u - 49, -4u = -a + 17 - 3. What is the highest common factor of a and 12? 6 Let l(u) = -16u2 - 182u + 54. Let b be l(-8). Calculate the greatest common factor of 12 and b. 6 Let v be (1 - (-18)/(-14)) + 484/28. Suppose r + v = -24. Let i = r - -48. Calculate the highest common divisor of 28 and i. 7 Let s(v) = -2v3 - 120v*2 - v - 75. Let k be s(-60). Suppose -217 = -5o - 42. Let y = o + k. What is the greatest common factor of 15 and y? 5 Suppose -u + 19q - 114 = 0, 2q - 165 = -2u - 73. Let m be (-4)/(-10) + 2/(-5). Suppose m = 5r - 85 - 390. Calculate the highest common factor of u and r. 19 Let h(y) = 208y3 - 7y*2 - y + 8. Let l be h(1). What is the highest common factor of l and 3458? 26 Let l = -3243 - -3253. Let r(x) = -x + 13. Let o be r(-9). Calculate the greatest common factor of l and o. 2 Suppose -4r = -3i - 16 + 618, -2i + 404 = -4r. Calculate the greatest common factor of i and 264. 66 Suppose -56o = -53o + 225. Let a be (((-11)/(-2))/(-1))/(o/6150). What is the highest common factor of 41 and a? 41 Suppose -74n = -93n + 532. What is the highest common divisor of 3430 and n? 14 Let x = -11883 + 11910. Let a be 2262/21 + (-4)/(-14). Calculate the greatest common divisor of a and x. 27 Let z(g) = -4g - 11. Let s be z(-4). Suppose 4b - 19 = w + 8, sb = -3w + 38. Suppose 2o - 29 = -b. What is the greatest common divisor of o and 1? 1 Suppose u + k + k = 84, 0 = 2u - 2k - 174. Suppose 5h + 3f - 1896 = 0, 5f + 2000 = 785h - 780h. Calculate the highest common factor of h and u. 43 Let t(i) be the first derivative of i2 + 29i + 9. Let s be t(-12). Suppose 0 = sw - 2w - 21. Calculate the greatest common divisor of w and 21. 7 Suppose -13a - 4a - 8a + 5600 = 0. Calculate the highest common factor of 21 and a. 7 Suppose -149c - 20c - 29c + 720918 = 0. What is the greatest common divisor of 33 and c? 11 Suppose -4n + 136 = s, 47 = 2s + 31. What is the highest common factor of 1028 and n? 4 Let l = -1886 - -1903. Calculate the highest common divisor of l and 1088. 17 Suppose 11a + 9632 = 10402. Calculate the highest common factor of 525 and a. 35 Let w be ((-15)/(-6))/(6/4 + -1). Let y be w(-16)/120(-1 + -11). What is the highest common factor of y and 64? 8 Let z be (-1)/(-3) + (20/(-15))/1. Let b be (-4)/((-12)/309) - z. Suppose b = -7g + 11g. What is the greatest common factor of g and 286? 26 Suppose 7s - 27 = 6s. Suppose 4c + 5 - 9 = 4w, -4c + 7 = -3w. What is the highest common divisor of s and w? 3 Let v = 331 + -346. Let k be (-418)/v - 17/(1275/(-10)). What is the highest common factor of 154 and k? 14 Let k = -587 + 1063. Let h(i) = ki*3 - 480i*3 - 4i2 - i2 - 4 + i + 3. Let m be h(-4). What is the highest common factor of 9 and m? 9 Let l = 437 + -336. Let t = l + 133. Calculate the highest common factor of t and 18. 18 Let w(u) = -4u3 - 8u*2 - 2u + 85. Let t be w(-7). What is the highest common divisor of t and 39? 13 Let u(w) = 74w2 + 7w - 7. Let h be u(1). Suppose -g = 3p - h, 3p + 4g - 54 = 8. What is the greatest common factor of 182 and p? 26 Suppose f - 120 = 5q + 338, 2368 = 5f + q. Let u = f + -459. Let n = 206 - 108. Calculate the highest common divisor of n and u. 14 Suppose 3h - 5q = h + 76, 5h + 3q - 190 = 0. Let l(p) = -3p*3 - 157p*2 - 37p + 1141. Let n be l(-52). What is the highest common factor of n and h? 19 Let o be (-9)/15-5 + -52. Let c = -19 - o. Suppose -2w = -54 - 186. What is the highest common divisor of w and c? 30 Let j(x) = x*2 - 8x + 12. Let f be j(8). Suppose 4g = -m + 53, 3g - 43 = -g + m. Suppose -go + 1385 = -487. Calculate the highest common factor of o and f. 12 Let p be 2 + ((-2)/(-4)6 - 1). Suppose 30 = pd + 190. Let l be (18/8)/(105/d + 3). Calculate the greatest common factor of 78 and l. 6 Let k = 38 + -27. Let l = -398 + 125. Let r = -152 - l. What is the greatest common divisor of k and r? 11 Let w be -7 - ((-30 - 42456/36) + (-5)/3). Calculate the highest common divisor of 364 and w. 28 Let u = -124 + 208. Let o(y) = 2y*2 - 7y - 410. Let n be o(18). Calculate the highest common factor of u and n. 28 Let z = 38 - -55. Suppose 8g + z = 893. Calculate the highest common factor of g and 80. 20 Let y be -2 + 44 + 6/3. Let c = -500 - -500. Suppose 3a - 4z = -2a + 95, 3a - 5z - y = c. What is the highest common divisor of 92 and a? 23 Suppose -25f = -12f + 28f - 263917. Calculate the greatest common divisor of 41 and f. 41 Let a(y) = 24 + 4y + y*2 - 7 - 17y + 5y. Let p be a(5). Suppose 2z = 3n + 11, pn + 15 = 3z - n. What is the greatest common divisor of 44 and z? 4 Suppose -1115x + 553x - 49657 = -579x. What is the highest common factor of x and 161? 23 Suppose 41b - 68719 = -15624. What is the highest common divisor of b and 49? 7 Suppose 10w = 59 + 111. Suppose -c + 0c + 62 = -3n, -4c + w = -n. Let m be 8/(-60)n10. What is the highest common divisor of m and 8? 4 Suppose 910 = 4z - 3i + 2643, 2i = -2z - 856. Let g = z + 653. What is the highest common divisor of g and 6? 6 Suppose 0 = -3h + 4f - 1, 2h - 5f = -f - 2. Let m(r) = -8 + 17r*2 + 4r*3 + 0 - 5r*3 + r. Let z be m(17). What is the highest common factor of h and z? 1 Suppose -353 = -a - 19p + 17p, -5p + 710 = 2a. Calculate the greatest common divisor of a and 30. 15 Let x(g) = g2 - 25g + 29. Let r be x(24). Suppose -276 = -4k - 3u + 363, r*k + u = 785. What is the highest common factor of 39 and k? 39 Let b = -2271 + 3054. Calculate the highest common factor of 432 and b. 27 Let q = 1184 + -1024. Calculate the greatest common factor o	{ "pile_set_name": "DM Mathematics" }
108494738. 2(s - 513)2(s - 349)*2 Determine y, given that -2y*2/5 - 7638y - 686772/5 = 0. -19077, -18 Factor 2k3/9 - 225854k*2/9 + 2125455530k/3 - 708460082. 2(k - 56463)2(k - 1)/9 Factor -18i3 - 100704i*2 - 67130i - 11188. -2(i + 5594)(3i + 1)2 Suppose 4c*4/7 - 26540c*3 + 2157230904c*2/7 - 2156673584c/7 - 4314090272/7 = 0. What is c? -1, 2, 23222 Factor p*2/6 + 739p/6 + 22425. (p + 325)(p + 414)/6 Let n2/5 - 579n/5 - 5292/5 = 0. What is n? -9, 588 Factor -3p2/7 - 632529p/7 + 632532/7. -3(p - 1)(p + 210844)/7 Find o such that 3o4 - 423o*3 + 5622o*2 + 6048o = 0. -1, 0, 16, 126 Solve 4x4 - 176x*3 + 500x*2 - 328x = 0. 0, 1, 2, 41 Determine l, given that -2l5/9 - 8l*4 + 830l*3/9 + 100l*2 = 0. -45, -1, 0, 10 Factor -12n*2 - 148n + 9520. -4(n + 35)(3n - 68) Solve 2d*3/15 - 188900d*2 + 66906018750d = 0 for d. 0, 708375 Factor f*5/7 + 2070f*4/7 + 1075357f*3/7 + 4276620f*2/7 + 4268356f/7. f(f + 2)2(f + 1033)*2/7 Suppose -2q*4/19 - 8128q*3/19 - 8118716q*2/19 + 283122624q/19 - 2426675778/19 = 0. Calculate q. -2049, 17 Let -15b2 + 43b/3 + 2/3 = 0. What is b? -2/45, 1 Factor 4y2 + 1720y - 117600. 4(y - 60)(y + 490) Let 2h2/7 - 1516h/7 + 287282/7 = 0. What is h? 379 Suppose n*2/4 - 2281n + 4561 = 0. What is n? 2, 9122 Let 4l4 + 1460l*3 - 92852l*2 - 190068l - 95760 = 0. Calculate l. -420, -1, 57 Determine t so that -t*3/5 + 759t*2 - 15143t/5 - 79611/5 = 0. -3, 7, 3791 Factor -y*3 + 556y*2 - 513y - 23310. -(y - 555)(y - 7)(y + 6) Let 50s3/7 - 78090s*2/7 + 62448s/7 - 1784 = 0. Calculate s. 2/5, 1561 Suppose 3k5/5 - 33k*4/5 - 201k*3/5 + 1113k*2/5 - 882k/5 = 0. What is k? -7, 0, 1, 3, 14 Find c, given that -3c5 + 237c*4 + 3777c*3 + 11907c*2 + 8370c = 0. -10, -3, -1, 0, 93 Determine s so that s*2 - 46s - 2952 = 0. -36, 82 Find q, given that -3q4 + 852q*3 + 20139q*2 + 17568q - 38556 = 0. -21, -2, 1, 306 Solve 550z5 - 74255z*4 + 362575z*3 - 577490z*2 + 291220z - 2600 = 0 for z. 1/110, 1, 2, 130 Find j, given that 2j2/7 + 10036j/7 - 660790/7 = 0. -5083, 65 Solve -n*3 + 193n*2 - 8732n + 8540 = 0 for n. 1, 70, 122 Suppose 3f2 + 2055492f + 352087280172 = 0. Calculate f. -342582 Factor z*3/3 + 385z*2/3 + 1900z/3. z(z + 5)(z + 380)/3 Determine c so that -c*4/3 + 6c*3 + 20c*2 + 62c/3 + 7 = 0. -1, 21 Find p such that -2p3 - 4306p*2 + 4312p + 8616 = 0. -2154, -1, 2 Solve -5a5 - 680a*4 - 27980a*3 - 199430a*2 + 6110545a - 5882450 = 0. -49, 1, 10 Determine b so that 2b2 + 1328b + 156366 = 0. -511, -153 Suppose 2y2/5 - 727376y/5 + 66134480672/5 = 0. What is y? 181844 Determine f, given that 3f2 - 1273254f + 135097979043 = 0. 212209 Factor -4z2 - 568z - 10948. -4(z + 23)(z + 119) Suppose 1418c2/13 + 2572c/13 - 528/13 = 0. What is c? -2, 132/709 Solve b*3 - 62121b*2 + 964661472b + 2894543532 = 0. -3, 31062 Determine y so that -y*5 + 83y*4 - 1233y*3 - 4207y*2 - 4378y - 1488 = 0. -1, 24, 62 Suppose 8o5/11 - 58o*4/11 - 1530o*3/11 + 6970o*2/11 - 6638o/11 + 1248/11 = 0. Calculate o. -13, 1/4, 1, 3, 16 Factor -2a3 + 113a*2/2 - 101a/2 - 109. -(a - 2)(a + 1)(4a - 109)/2 Factor -5f*3/2 + 1105f*2/2 + 2245f/2 - 3345/2. -5(f - 223)(f - 1)(f + 3)/2 Suppose -x4/5 - 38x*3/5 + 7032x*2/5 + 67662x - 345303/5 = 0. What is x? -63, 1, 87 Factor -3l3/5 - 261l*2/5 - 633l - 7227/5. -3(l + 3)(l + 11)(l + 73)/5 Determine l, given that 2l*5/3 + 4472l*4/3 - 4484l*3 - 40312l*2/3 - 22390l/3 = 0. -2239, -1, 0, 5 Factor 4o5/7 - 720o*4/7 + 24000o*3/7 - 32000o*2. 4o*2(o - 140)(o - 20)2/7 Find i such that -i5 - 60i*4 + 530i*3 - 960i*2 - 529i + 1020 = 0. -68, -1, 1, 3, 5 Factor d*2/6 - 233d/2 + 13180/3. (d - 659)(d - 40)/6 Factor t3/7 - 1728t*2/7 + 3453t/7 - 1726/7. (t - 1726)(t - 1)2/7 Let 2h*5 + 436h*4 + 1702h*3 - 2140h*2 = 0. Calculate h. -214, -5, 0, 1 Factor 1539x*4 - 9228x*3 + 18432x*2 - 12240x - 48. 3(x - 2)3(513x + 2) Factor 2a*2/13 - 64a/13 - 73986/13. 2(a - 209)(a + 177)/13 Factor g*3/4 - 465g*2/4 - 5761g + 11985. (g - 510)(g - 2)(g + 47)/4 Suppose -20n5 - 516n*4 + 1204n*3 - 780n*2 + 112n = 0. What is n? -28, 0, 1/5, 1 What is z in 4z2/3 + 1388z/3 - 21784 = 0? -389, 42 Factor 3o3/2 - 163836o*2 + 8947739295o/2 - 8947083963. 3(o - 54611)2(o - 2)/2 Factor -182z3 + 48z*2 + 54z. -2z(7z + 3)(13z - 9) Determine m so that -65m*5/2 + 7601m*4/2 - 14417m*3/2 - 8521m*2/2 + 7241m + 460 = 0. -1, -4/65, 1, 2, 115 Factor -5q2 - 1840q + 870400. -5(q - 272)(q + 640) Find a such that 3a3 - 1140a*2 + 1137a = 0. 0, 1, 379 Find x such that 5x5 + 18835x*4 - 56550x*3 + 20x*2 + 75400x = 0. -3770, -1, 0, 2 Solve -t*5/3 - 6t*4 + 47t*3 - 82t*2/3 - 80t = 0 for t. -24, -1, 0, 2, 5 Factor -w*4 + 358w*3 - 1977w*2 - 47120w - 140800. -(w - 352)(w - 16)(w + 5)*2 Suppose -3x*5 - 870x*4 + 26457x*3 - 86292x*2 - 1654236x = 0. Calculate x. -318, -6, 0, 17 Solve 5n3 + 3829990n*2 + 733441170005n = 0 for n. -382999, 0 Find s, given that 4s4 - 33972s*3 - 135964s*2 + 101892s + 611784 = 0. -3, 2, 8497 What is y in -4y2 + 148976y - 1387115536 = 0? 18622 Determine j so that -3j5 - 1998j*4 + 10047j*3 - 12090j*2 - 8028j + 16104 = 0. -671, -1, 2 Factor -2469g2 + 49378g + 40. -(g - 20)(2469g + 2) Find f such that -3f3 + 93246f*2 + 466323f - 559566 = 0. -6, 1, 31087 Factor -b*5 + 1106b*4 + 2216b*3 + 2b*2 - 2215b - 1108. -(b - 1108)(b - 1)(b + 1)3 Determine m, given that -m4/4 - 77207m3/4 - 496736970m*2 - 4261009715792m + 4261506472064 = 0. -25736, 1 Solve 4f4 + 228f*3 - 65704f*2 - 132288f = 0 for f. -159, -2, 0, 104 Find o, given that -3214o5/7 + 16066o*4/7 - 25692o*3/7 + 1832o*2 + 16o/7 = 0. -2/1607, 0, 1, 2 Factor 2m4/3 - 10480m*3/3 + 6162156m*2 - 11288129216m/3 + 547886809834/3. 2(m - 1729)3(m - 53)/3 Determine p so that 2p5/3 + 296p*4/3 - 202p*3 - 884p*2/3 + 2392p/3 - 400 = 0. -150, -2, 1, 2 Determine z so that 4z3 + 5620z*2 - 85264z - 90880 = 0. -1420, -1, 16 Suppose g*3/10 + 22g*2/5 - 202g/5 + 312/5 = 0. What is g? -52, 2, 6 Factor -2i4 - 82i*3 - 296i*2. -2i*2(i + 4)(i + 37) Let 5m*2 + 4456045m/3 + 990230 = 0. Calculate m. -297069, -2/3 Determine t so that 8t3/7 - 822t*2/7 - 1038t/7 - 208/7 = 0. -1, -1/4, 104 Suppose -2b3/3 + 5167b*2/3 + 12937b/3 - 6034 = 0. What is b? -7/2, 1, 2586 Find b such that -b*2/8 + 1435b/8 + 2157/4 = 0. -3, 1438 Factor -2f2/9 + 20f - 688/9. -2(f - 86)(f - 4)/9 Solve -363q4/4 + 24981q*3/2 + 68661q*2/4 + 5001q + 417 = 0. -1, -2/11, 139 Let -3w4/5 + 588w*3/5 - 18897w*2/5 - 1035552w/5 - 1016064/5 = 0. Calculate w. -27, -1, 112 Solve z*3/4 + 1213z*2/4 - 4865z/4 + 3651/4 = 0 for z. -1217, 1, 3 Let -2v3/9 - 746v*2/3 + 2992v/3 - 8984/9 = 0. What is v? -1123, 2 Let 52i3 + 292i*2 - 4592i = 0. What is i? -164/13, 0, 7 Factor -x*2/12 - 2659x/3 - 3545/4. -(x + 1)(x + 10635)/12 Factor -3z*3/2 + 3981z*2/2 + 1992z. -3z(z - 1328)(z + 1)/2 Let 4t*3/7 + 776t*2/7 + 12036t/7 = 0. Calculate t. -177, -17, 0 Suppose 605a3 - 2169255a*2 - 11845800a - 16159500 = 0. Calculate a. -30/11, 3591 Let -371k4 + 275283k*3 - 50789158k*2 - 102544032k + 276768 = 0. What is k? -2, 1/371, 372 Factor -3y3/2 + 192y*2 - 16383y/2 + 116487. -3(y - 43)2(y - 42)/2 Factor 5a3 + 3278a*2 - 1328a - 10496. (a - 2)(a + 656)(5a + 8) Factor m4/8 + m3/8 - 21m*2/8 - 45m/8. m(m - 5)(m + 3)*2/8 Factor 4z*3 + 1520z*2 - 121100z + 2205000. 4(z - 35)2(z + 450) Determine l so that -l*3 - 1749l*2 - 13944l - 27856 = 0. -1741, -4 Solve 4k4/7 + 132k*3/7 - 12584k*2/7 + 36768k/7 - 24320/7 = 0 for k. -76, 1, 2, 40 Suppose -h*2 - 31324h + 62652 = 0. Calculate h. -31326, 2 Find v such that v*3/9 - 202v*2/9 + 10279v/9 - 6586/3 = 0. 2, 89, 111 Determine r, given that r*2 + 406r - 56135 = 0. -515, 109 What is v in 4v2 - 16460v - 16464 = 0? -1, 4116 Factor 3x2 + 292899x	{ "pile_set_name": "DM Mathematics" }
/(a/a*1)a)*(-3/8)((a0)(-10))(-24/7) assuming a is positive. a(29/8) Simplify ((ddd*(2/23)ddd*(-4)d)/(d*(-2/49)/(ddd/(d/d(-16))d)))36 assuming d is positive. d(-481680/1127) Simplify ((mmm1)(3/10)/(m*4/(m((m(-1/5)/m)/m)/m)))/(m(-3/10)m(-1/3))(-28) assuming m is positive. m(-691/30) Simplify ((k(-6)/k)/k(7/5))/(k(-1/8)/k0)(k/(k/k*3k)k)/k(-6)((k*(1/15)k)/k)/(k(kk*(2/5)k)/k) assuming k is positive. k(-193/120) Simplify o(5/4)/oo/(((ooo/(oo*(-2)o))/o)/ooo)(o/o(2/7))(3/31)o*0/(o/(o/(ooo/(o/o0))))o*7o(4/7) assuming o is positive. o(3377/868) Simplify ((p(-1))(-26))*(2/73)/((pp*(2/3)/p)/pp*(-3)p*(-2/15)p(-4/7)/p) assuming p is positive. p(44077/7665) Simplify (w*(-10)/(ww/(w(w/((w/(w(1/3)/w)w)/w))/w)w))7/(w(6/5)/w(-4/3)(ww5ww)/ww(-3/4)) assuming w is positive. w(-2089/20) Simplify (f/(f/(f/f*6))(f*5f)/f)/((f/(f*(-1/3)f))/f*1)(ff((ff(1/3))/f)/fff)(2/39)f(-4)/((f/(f/(f(-3)f)))/f) assuming f is positive. f(-19/117) Simplify (n(-14)n)*(-7/12)(nnn*(-24)n)(-5/8) assuming n is positive. n(497/24) Simplify ((((dd/d9)/ddd/d(1/5))(-5))(5/6))(2/73) assuming d is positive. d(155/219) Simplify ((k(-1))(-5/7))(-47)(kkkkkk(-1/4)/kkk)/(k/(k/k(-2/5)))k*(-6)k(-2/5) assuming k is positive. k(-947/28) Simplify ((r((r22/rr)/rr)/r)/r14r(2/31)/(r/r(31/5)))(-23/3) assuming r is positive. r(-47288/465) Simplify (l/(l/(l/(l/((ll/(ll*(-8)))/l))l)))/llll/(l/l(-6/11))l/l*(-8)l*0((l*(1/6)/l)/ll*(2/15)l)(-4/11) assuming l is positive. l(1029/55) Simplify (((uu(((uu/((u7/u)/u))/u)/u)/u(u/(u/(u*(5/4)u)uu))/u)40)(-15/7))(-49) assuming u is positive. u(-19950) Simplify (g(-1))9(g1g)*31(gg(-4))/g(-4)(g*(-4)g)/(g/(g/g*(3/2))g) assuming g is positive. g*(97/2) Simplify ((hh(-2))(-13/2))(7/2)/(h(-8/3)h9hh)12 assuming h is positive. h(-309/4) Simplify ((((h(-1/7)h)/hh(-4)h)/(h*4(h/h(-9))/h))43)(2/53) assuming h is positive. h(-9718/371) Simplify ((o(-2/21))(-28)(o/o(-3)o)/o(-5/3))(-13) assuming o is positive. o*(-364/3) Simplify (x/((xx/x*2xx)/x))11(x/(x(-2/21)/x))/(x/(x/(x/(x/x(-1))x)))(x(1/3)/x(-1))/(x*(-4)x(-7/2)/x) assuming x is positive. x(167/14) Simplify (((mm(3/5)/m)/mm(1/4))/((m(1/10)m)/((m/(m((m/m*2m)/m)/m))/m)))/(m/(m/m*(-5))m(-7))(1/33) assuming m is positive. m(5/44) Simplify ((w(-1/7)w(-3))/(w(w/(w/(ww/(w/(ww/(ww(1/5)))))))/ww/w(-9)))17 assuming w is positive. w*(-8891/35) Simplify ((k((k/k(-3))/k)/k)/k(-1))(-20)/(k(-5/4)kk*(-7)k(k0)1) assuming k is positive. k(-295/4) Simplify ((((x12/x)/(xx/x22))(30/11))38)(1/22) assuming x is positive. x(17670/121) Simplify ((l(2/5))*(-6/7)(ll(-3)l)/l1)/((l(2/5))(-34))(1/5) assuming l is positive. l*(66/175) Simplify ((aa/(a/(aa/a6))a)/(a/(a*6aaa)))(-5/12)/((a0)*(22/3)(a0)45) assuming a is positive. a*(-5/2) Simplify ((ggg(-2/13)g)*(-2/27)/(gg*(3/10)(ggg(g(1/20)g)/g)/ggggg))(19/2) assuming g is positive. g(-1008463/14040) Simplify ((y(2/21))(2/31)(y(-18/7))(-41))(-1/11) assuming y is positive. y(-68638/7161) Simplify (f1fff*(-32)(f(26/7))(17/2))5 assuming f is positive. f(90/7) Simplify (n(2/5))(-1/8)/(n*5n*(3/8))(nn1/nn(-2/7))/((n/n0)/n)4 assuming n is positive. n(-1319/280) Simplify (ff(-1/7)f(-8))(-48)/((f/(ff(-2)))19/(f(-1/4))(5/6)) assuming f is positive. f(51181/168) Simplify ((gg(2/7))(-2/43)g(-12)gggg(-7/6))(4/9) assuming g is positive. g(-36938/8127) Simplify (a4aaaaa(aa*(1/6))/aaaa)/(a*(-1/2)/aa/(a/(aa/(aa*2/a)aaa)a))(a(-2/5))(-10/9)a/a(-2)a(-1/2) assuming a is positive. a(263/18) Simplify ((r/(r/((r/((r(r/(rr*(-1/3)))/rr)/r))/rr)))(-4/19))(2/3)(r(2/3))(-40)/(r*(-6)/rr(-3/7)) assuming r is positive. r(-23140/1197) Simplify ((j/(j/((jj/((j/(jj*(2/5)j))/j))/j))j)(1/2))(-28)/(((j/(j(1/7)/j)j)/j*(2/9))/(j/(jj*3)j((jj(3/5))/j)/j)) assuming j is positive. j(-4198/63) Simplify ((v(vv/v*(4/17))/vv(-1/25))/(v10v0v))(-42/5) assuming v is positive. v(165564/2125) Simplify ((k*(-9)kk/((k0/kk)/k)k)/(k(1/2))(-26))/(((kk*(2/3)k)/k0)/(k(-1)k)14) assuming k is positive. k(16/3) Simplify (((a31/aa)/a)/a)/(a/(a/((a/(a/a*(6/5)))/a)))(aa(-1/67))/((a(aa/(a(a*14a)/a))/a)/a) assuming a is positive. a*(14668/335) Simplify ((j(j(-10/11)/j)/j)/j(3/4)(j/j4)7)(-22/7) assuming j is positive. j(1041/14) Simplify (g0)40g(2/7)/(g/((g(-7)g)/g))(g*1/((ggg/(gg*(-5)))/g))/(((gg*(-5/6)g)/g)/(g/((gg(3/7))/g))) assuming g is positive. g(-517/42) Simplify (r(-16)(r*(-5/4)r)/r(r(2/3)rrr)(-2/53))(-1/44) assuming r is positive. r(11059/27984) Simplify (w(2/61)w41)/((w(w*29w)/w)/w)(-44) assuming w is positive. w(80339/61) Simplify (y/y*(-9)y/(yy/(y/y(5/2)))y)*(2/21)(y*(2/15)y(-1/3))/(y1/y(1/6)) assuming y is positive. y(-47/210) Simplify (d(-2)/d28d(-2/3)d(-2/65))(4/27) assuming d is positive. d*(-23944/5265) Simplify (o/(oo*(-3))o(o/o0)/ooo(-1/4)/o(-5))50 assuming o is positive. o(975/2) Simplify ((o(-1/6)/((o(-1/4)/o)/o))/(o(-1))48)/(oo*(6/11)o(-7/2))(-9/8) assuming o is positive. o(25283/528) Simplify (a(2/9)a3aa(-1)aa4)/((a0)(-32)/((a/(a6/a))/aaaaa/a(2/5)aaa)) assuming a is positive. a*(442/45) Simplify ((b/((bb(-3/8))/b))(6/11)(b/b11)/b4)33 assuming b is positive. b(-1749/4) Simplify ((z(z/(z/z*(1/8)z))/zz(3/5))/(z/(z/(z(1/7)/z))(z/(z*2/zz))/z))/(z/((zz(3/4))/z)zzzzz(7/5))(-1/10) assuming z is positive. z*(2203/700) Simplify ((c(cc/c(-45))/c)/(c(2/69)c))/(ccc/c38)13 assuming c is positive. c(34567/69) Simplify (h(-2/11)h)/((h/h(-3))/h)(hh(1/3))/(hh*(-2)/h)(hh(2/21)hhh*(-6/11))/(h(h*(-2/3)h)/h)(-41) assuming h is positive. h(4012/231) Simplify (((ll1)/l)/(ll(-1/2)))(-48)/((l(-2/3))8)(-2/43) assuming l is positive. l(-3128/129) Simplify m*(-7)/(mm*(1/5))m*0/(mm*(-6))(m(-2))(7/4)/((mmm*(-3/2)mmmm)/((m/m(-4/3)m)/m)) assuming m is positive. m(-133/15) Simplify ((v(3/7)/v*(5/6)((vvv/(v(v/(v1/v))/v)v)/v)(-1/8))45)37 assuming v is positive. v(-30525/28) Simplify (m/m*(-5)m*(1/2)(mm1)13)/(m(1/8)/mm/(((m/(m/(m/(mm/((mm*(-1)mm)/m)))))/m)/m))11 assuming m is positive. m(73/8) Simplify (z/z(-2/5)(((z/z*(-1/8))/z)/z)/zz*(-8)/(z/(zz/(z/(zz/(zz0))))))37 assuming z is positive. z*(-11063/40) Simplify ((uu(-36))/u)25u(9/8)uu(-31) assuming u is positive. u(-7431/8) Simplify (d(d/(d*16/d))/dd38/d)/(d(-1/82)/((ddd*(-34))/ddd)) assuming d is positive. d(-655/82) Simplify (m/(m/(m/(m/m(4/3))))m(-3/4)/m)/((m/m(-1))/m)*(19/2)((m(-4/5)/m)/m)/m(-1/4)(m5m)/mmm6/m assuming m is positive. m(-22/15) Simplify ((ddd*(-1/8)ddd)*(-1/39)d*(-3/2)d(-5/6))19 assuming d is positive. d(-1121/24) Simplify (((z/z9zz(-31))(-32))(-3/16))(-45) assuming z is positive. z*10260 Simplify ((ss(2/5))(-21))*(-19/5)/(s/(s/(s/(s/(s(s*(-7)s)/s))))ss(-4)/s)27 assuming s is positive. s*(9543/25) Simplify (((g/((ggg/g5g)/g))/gg)/gg/(g*(-10)/gg)(g(-2))(-5))22 assuming g is positive. g506 Simplify ((i/i(2/3))(-2)(i(-1/3))(-2/49))/((i/i(1/5))/((i/(i/(i/(i(-6)/i))))/i))(-10) assuming i is positive. i(-3070/49) Simplify ((n*(2/9)n)(-31))(-17)n/n3n/(nnn/n*4)(n(-1/3))(-4/3) assuming n is positive. n*(5801/9) Simplify ss/(s(s(-5)/s)/s)s*(2/11)/s(s/(s/(ss/s(-2/5))))20(sss*(-11)s*(-4/3)s)22 assuming s is positive. s(-4955/33) Simplify (((a*(-1/3)a)/(aa(-3)))/(a(-4/3)/a4))/((aa*(-2)aaa*(4/7)/a)/(aaaa(a/(a(-1)/a)a)/aaa	{ "pile_set_name": "DM Mathematics" }
u be ((-105)/60)/((-1)/(-4)). Let n(d) = 2d - 11d*3 + 3d - 7d2 + 2d. What is uz(o) - 3n(o)? -2o3 Let c(n) = -3n*3 - 2n - 4. Let q(f) be the third derivative of 0f - 1/4f*4 - 11/6f3 + f2 - 1/15f6 + 0 + 0f*5. What is 11c(y) - 4q(y)? -y3 + 2y Let w(j) = 11j2 + 8j + 2. Suppose 35 = 2q + 3q + d, 0 = -5q - 5d + 15. Let v(u) = -4u2 - 3u - 1. Give qv(b) + 3w(b). b*2 - 2 Let l(n) = -4n*2 - 12. Let k(h) = 9h*2 + 23. Calculate -2k(v) - 5l(v). 2v*2 + 14 Let n(d) = -d + d + 8 + 11d. Let u(p) = -4p - 3. What is -3n(h) - 8u(h)? -h Let u(m) be the third derivative of m5/60 - m4/24 - m3/6 - 40m*2. Let l(q) = -2q*2 + 2q + 5. What is -l(k) - 5u(k)? -3k*2 + 3k Let b(y) = y - 2y2 + y3 + 0y + 3y + 6. Let n(f) be the second derivative of -f5/20 + f4/6 - f3/2 - 5f*2/2 - 37f. Give 5b(p) + 6n(p). -p*3 + 2p*2 + 2p Let y(d) = 0d - 3d*3 + 6d*2 + 4d + 10 - 15. Let a(w) = 6w3 - 11w*2 - 7w + 9. What is 6a(s) + 11y(s)? 3s3 + 2s - 1 Let o(z) = -26z - 3. Let v(k) = 12k + 1. Let y(r) = -4o(r) - 9v(r). Let i(l) = -12l + 10. Calculate 3i(u) - 10y(u). 4u Let w(t) = t*3 + 2t*2 - 2t. Let a(x) = -5x3 - 9x*2 + 9x. Suppose n - 54 = -n. Let d be 1/(((-12)/n)/4). Let h be 4/3 - 6/d. Determine ha(u) + 9w(u). -u3 Let r(x) = x2 + 5x + 5. Suppose -2s + 1 = -0s - k, -2s - 5k - 5 = 0. Let b = s + 2. Let c(y) = y + 2y + y*b + 0y + 3. Give 5c(d) - 3r(d). 2d2 Let b(t) = t2 + t. Let o(k) = -k2 - 2k + 2. Calculate 2b(d) + o(d). d2 + 2 Let b(k) = -k2 - k + 1. Let l(i) = 3i*2 + 5i - 6. Suppose 0 = -2j + 6j + 8. Let o be (j/4)/(4/8). Determine ol(d) - 5b(d). 2d2 + 1 Let m(t) = t - 14. Let v(w) = 1. Give m(q) - 2v(q). q - 16 Let p(z) = -4z2 + 2z - 10. Let o(b) = 5b2 - 3b + 11. Give 2o(f) + 3p(f). -2f2 - 8 Let i(w) = -3w2 - 12. Let k(p) = -p2 + 4p - 7. Let x be k(5). Let b(y) = y2 + 5. Determine xb(c) - 5i(c). 3c*2 Let y(w) = w. Let t be -1 - (-6 - 0 - -2). Suppose -5v - 15 = 4m, -5m + m = v + t. Let s = 19 + -20. Let i(n) = -n - 1. Determine si(h) + vy(h). -2h + 1 Let x(d) be the first derivative of 2d*2 + 6d - 51. Let t(m) = 1. Calculate 6t(n) - x(n). -4n Let y(h) = 19h3 + 4h*2 + 4. Let t(n) = 39n*3 + 7n*2 + 7. Calculate 4t(x) - 7y(x). 23x*3 Let y(h) = 9h - 11. Let j(w) = 1 - 9 + 2 + 5w. Determine -11j(p) + 6y(p). -p Let h(q) = 28q - 8 - 23q + 4. Let o(j) = -11j + 9. What is -5h(a) - 2o(a)? -3a + 2 Suppose 2p + 1 = 5i, 3p + 7 = i + i. Let z = -1 - -3. Let a(t) = -t - 2t - zt. Let v(r) = r. Give pv(y) - a(y). 2y Let g(s) be the first derivative of -11s5/120 + s4/4 + 2s*3/3 + 3. Let y(d) be the third derivative of g(d). Let k(z) = 4z - 2. Give 8k(o) + 3y(o). -o + 2 Let o(m) = -6m3 + 3m*2 - 4m - 1. Let f(k) = -11k3 + 5k*2 - 7k - 1. Calculate -3f(i) + 5o(i). 3i3 + i - 2 Let i be (0/(-8))/(5 + -2). Let q(p) be the second derivative of -7/12p*4 - 1/3p*3 + i + p - 7/2p*2. Let o(x) = -3x*2 - x - 3. What is 10o(h) - 4q(h)? -2h*2 - 2h - 2 Let o(s) = 25s. Let t(f) = -49f. Give -11o(j) - 6t(j). 19j Let x(v) be the first derivative of -5v*2 - v + 1. Let c = -65 - -58. Let l(k) = 3k. Calculate cl(u) - 2x(u). -u + 2 Let x be 9/1 + (-1 - 1). Let b(o) = -7o2 + o - 6. Let i be (-9 - -2)1/(-1). Let l(y) = y - 2y2 + i - 2y + 10y2. Give xb(h) + 6l(h). -h2 + h Let f(z) = 3z + 2. Let x(m) = -2 - 3 - 149m + 73m + 69m. What is 5f(l) + 2x(l)? l Let g(a) = 16a*3 + 7a*2 + 7a - 7. Let t(x) = 5x3 + 2x*2 + 2x - 2. Determine 2g(s) - 7t(s). -3s3 Let h(m) = -11m + 31. Let s(u) = 6u - 16. Calculate 4h(c) + 7s(c). -2c + 12 Let q(u) be the first derivative of 3u2 + 6u - 2. Let c(s) be the third derivative of -s4/24 - s3/6 - 3s2. Determine -10c(g) - 2q(g). -2g - 2 Let z(s) = s*2 - s + 1. Let t(r) = -11r*2 + 4r - 3. Calculate t(d) + 3z(d). -8d*2 + d Let o(t) = -9t*2 - 8t + 10t2 + 3t + 2. Let z(q) = q*2 - q. What is -o(j) + 3z(j)? 2j2 + 2j - 2 Let a(f) = -f + 1. Let z(m) = -14m + 7m + 4 + m. What is 2a(o) - z(o)? 4o - 2 Let i(o) = o*3 - 2o*2 + 3o - 3. Let h(p) be the first derivative of 1/2p4 + 2p2 + 1 - p3 - 4p. Give -2h(x) + 3i(x). -x3 + x - 1 Let v(a) = -a. Let z(j) = -j3 - 2j*2 + j - 4. Let k be z(-4). Suppose 0 = -x + 5, -b - 7x + k = -2x. Let r(w) = -4w. Determine br(g) + 3v(g). g Let w(q) = -q2 + 1. Let u be (4/6)/(4/6). Let n = 3 - 6. Let y(h) = h2 - 5h2 - h + 0 + 3. What is nw(v) + uy(v)? -v2 - v Let k(z) = -9z - 18. Let n(o) = -1. Give -k(u) + 18n(u). 9u Let i(g) = 2g2 + 17g. Let b(n) = 2n2 + 16n. What is -6b(a) + 5i(a)? -2a2 - 11a Let l(n) = n*2 + n - 1. Let o be 10/(-4)(-8)/10. Let w(k) = -k. Let c(m) = -2m - 2m + 2m. Let y(i) = oc(i) - 6w(i). Give l(t) - y(t). t2 - t - 1 Let d(k) = -5k*3 - 5k*2 + 11k. Let g = -3 - -5. Let n(m) = -m3 - m2 + 2m. Let w = -332 - -321. What is gd(a) + wn(a)? a3 + a2 Let h(j) = 3j*2 - 7j - 4. Let l(z) = -3z2 + 8z + 3. Determine 3h(d) + 4l(d). -3d2 + 11d Let h = -449 - -444. Let g(l) be the third derivative of -7l6/120 - l4/8 - l3/2 + l2. Let u(x) = 3x*3 + x + 1. Calculate hu(t) - 2g(t). -t3 + t + 1 Let s(c) = -2c - 5. Let x(u) = 5u + 14. Let k(o) = -o3 + 3o*2 + 3o - 4. Let t be k(4). Let l(b) = -2b + 3. Let v be l(3). Calculate ts(p) + vx(p). p - 2 Let n(p) = p + 5. Let c be (-5)/90-6 + 16/(-3). Let b(x) = 2x + 8. Suppose 44 = 3j - 5h, 4j + 3h - 36 = 4h. Determine cb(s) + jn(s). -2s Let y(m) = -14m + 6. Suppose -x - 3j = -5x - 41, -x = 5j + 16. Let h(r) = 9r - r - 2 - 3r. Determine xh(g) - 4y(g). g - 2 Let c(i) = -6i - 1. Let m(u) = -6u - 1. Give -6c(z) + 5m(z). 6z + 1 Let c(o) be the third derivative of -o6/120 - o4/24 - o*3/6 - 9o*2. Let y(d) = -5d3 - d2 - 3d - 3. Determine 3c(h) - y(h). 2h3 + h2 Let w(q) = 3 + 6q - 3q - 3q + q. Let v(n) = n + 6. What is -3v(h) + 5w(h)? 2h - 3 Let t(q) = 4q + 1. Suppose -3z - 3p - 10 = 2p, -4z + 4p - 24 = 0. Let a(s) = -7s - 1. Determine zt(u) - 3a(u). u - 2 Let w(t) = 1. Let o(b) = -b + 3. Let u(l) = -l*2 - 4l + 1. Let n be u(-3). Suppose -4a - ng - 3 = 1, 3g + 10 = 4a. Calculate ao(j) - 3w(j). -j Let i(p) = 4p - 1. Let g(o) = 7o - 2. Suppose -24 = -6d + 14d. Give dg(u) + 5i(u). -u + 1 Let n(o) = 21o2. Let f(s) = s2. Determine -6f(j) + n(j). 15j2 Suppose -3s = 2r - 6s, -4s = 3r - 17. Let z(v) = v*3 - 5v - 4. Let b(f) = f*3 - 4f - 4. Calculate rb(c) - 2z(c). c*3 - 2c - 4 Let s(k) = 46k2. Let h(x) = 231x*2. Give 3h(f) - 14s(f). 49f*2 Let r(g) = -7g*3 + 2g2. Let k(z) = -z3. Determine -6k(f) + r(f). -f3 + 2f*2 Let w(z) = 9z*3 - 4z*2 - 5. Let a(b) = -8b*3 + 3b*2 + 4. What is -5a(i) - 4w(i)? 4i3 + i2 Let u(f) = -8f3 + f2 - 6f + 7. Let n be (13 - 1)(-4)/(-8). Suppose t = -5 - n. Let m(o) = -15o*3 + 2o*2 - 11o + 13. Determine tu(a) + 6m(a). -2a3 + a2 + 1 Let u(d) = -d + 14. Let s(t) = -t - 20. Let i be s(-25). Let f(x) = x - 9. Give iu(r) + 8f(r). 3r - 2 Let a(x) = -2x3 - 5x + 5. Suppose -4q + 19 + 1 = 2v, q - 3 = 0. Let i(w) = -2w3 - 4w + 4. Let u = -7 - -2. Calculate ui(f) + va(f). 2f3 Let z(p) = -5p*2 + 9p - 88. Let u(c) = -3c2 + 5c - 44. Calculate -7u(a) + 4z(a). a2 + a - 44 Let d(p) = -p3 - 2p. Suppose 6o + 11 = -1. Let x(k) = -2k3 - 3k. Determine ox(i) + 3d(i). i*3 Let i(k) = 6k*2 + 5k - 2. Suppose -5q - 17 = -s, 4q = -0q - 16. Let d(t) = -5t*2 - 4t + 2. Determine si(r) - 4d(r). 2r2 + r - 2 Let u(k) = 21k*2 + 9k. Let m(z) = 5z2 + 2z. Let w(g) = g*3 - 10g*2 + 2g - 7. Let s be w(10). Let l = s + -4. Determine lm(a) - 2u(a). 3a2 Let s(b) = b2 - 6b - 7. Let z be s(6). Let m(a) = a*2 + 0a*2 - 2a + 0a2. Let t(c) = -10c - c*2 + 7c + 2c2. Determine zm(p) + 5t(p). -2p*2 - p Let k(y) = y - 1. Let w(p) = -p - 2p + 5p - 3 + 0p. Let o be (-4)/2 + 2/2. Suppose -5v - 19 = m, 5m + 7 = -v - 2v. Give mk(q) + ow(q). -q + 2 Suppose 18t - 15*t = 9. Let l(z) = -z	{ "pile_set_name": "DM Mathematics" }
What is (-4 - 3)/74/(-22)? 2/11 What is ((-8)/(-9))/((-12)/(-54))? 4 What is the value of (-8)/(224/(-70))(-36)/(-15)? 6 Evaluate (3/(-3))/(-4) - 35/20. -3/2 (3/(-5))/((-36)/40) 2/3 What is the value of (-118)/15 + 44/(-330)? -8 3-1 + (-8 + 4 - -3) -4 What is (-12)/36(-24)/(-56)? -1/7 What is the value of -29 - -27 - 7/(-1)? 5 Calculate ((-9)/15 + 1)/(-1). -2/5 -116/14 + (-370)/(-2590) -1 What is 2/(-8) + (-1)/4-2? 1/4 What is the value of (-413)/(-84) - 4 - (-4)/48? 1 (-2)/(-8)-1 - (-2)/(-8) -1/2 Evaluate ((-87)/(-203))/((-20)/(-14)). 3/10 2/3 + 7 + (-285)/36 -1/4 (3/7)/(17/(-119)) -3 Calculate 11 + (-9 - -7) + -8. 1 What is (27/(-198))/(-3 + (-21)/(-6))? -3/11 What is the value of 70/84 + 2/(-6)? 1/2 What is (3 - 88/33) + (-5)/6? -1/2 What is -8 + (-166)/(-21) - (-4)/6? 4/7 ((-3)/2)/(33/6 - 5) -3 Calculate (-30)/18(-36)/15. 4 What is the value of 9/10 + 12/20 + -1? 1/2 What is the value of (10/30)/((-8)/6 - 1)? -1/7 Evaluate (2/4)/(((-2)/(-2))/(-4)). -2 What is 24/(-42) + (-13)/14? -3/2 What is the value of ((-84)/273)/(30/(-13))? 2/15 Evaluate 42/216 + ((-224)/(-63) - 4). -1/4 Evaluate (-96)/(-32) - (8 + -1). -4 (-28)/49(-49)/(-70) -2/5 Calculate (30/21)/(114/(-133)). -5/3 Evaluate ((-6)/(-165))/((-3)/(2 - 17)). 2/11 Evaluate 4/10 - ((-51)/(-15) + -5). 2 2 - (52/(-44) + 3) 2/11 Evaluate (-504)/24 - (-28)/2. -7 (-64)/72 + -63/(-27) -2/9 Calculate ((-54)/(-8))/((-24)/32). -9 What is 2 + 185/65 - 10/(-65)? 5 What is (-1)/((0 - 0) + 3)? -1/3 Evaluate (-8)/32 + ((-38)/8 - -2). -3 Evaluate 5 + 8 + -14 + 2. 1 What is ((-72)/(-42))/(18/84) + 2? 10 -8 - -10 - -361/(-17) -2/17 (-124)/120 + 3/15 -5/6 What is (12 - 4)/(-4)(1 + 0)? -2 (20/(-6) + 3)(-3)/(-4) -1/4 (-5)/(-2)2/702 1/7 What is ((-8)/32)/((-84)/(-288))? -6/7 (1/(-2))/((-117)/(-52)) -2/9 Calculate (-14)/42(-6)/(-10). -1/5 What is 1204/238 + 1/(-17)? 5 Calculate (-8)/3((-44)/8 + 4). 4 What is 2/(-15)2/(4/6)? -2/5 Evaluate 80/30 - ((-4)/(-6) + 0). 2 Calculate (2 - 8)(-2)/(-3). -4 Evaluate (16/14)/((-2)/7). -4 What is (36/210)/(17/(-10) - -2)? 4/7 What is (-6)/16 - (-13 + 630/112)? 7 What is ((-4440)/72)/37 + 2/3? -1 What is the value of (6/30)/((-3)/(-20)2)? 2/3 Calculate (((-102)/4)/1)/6 + 4. -1/4 Evaluate (-104)/(-12) + -9 - 16/(-3). 5 What is the value of -12(11 - (-64)/(-6))? -4 Evaluate -2 + 0 - (-9 + -36)/(-9). -7 Calculate ((-11)/((-66)/12))/(-2). -1 Calculate (-13)/52(16/12 - 0). -1/3 Calculate 34/(-5) + 9/5. -5 (-4 - 0)(1 - -1 - 1) -4 Calculate (391/30)/(-23) + (-2)/(-5). -1/6 What is the value of (-2)/(-17) + -2 + (-12)/102? -2 (168/(-126))/(22/3) -2/11 What is the value of (-36)/63 + 54/168? -1/4 Evaluate 1/(18/(-4)) + (-6)/(-27). 0 What is the value of 234/(-26) - 1/((-1)/4)? -5 Evaluate 3(-10)/(-15) - (-1 + 0). 3 What is the value of 28/49 - (-10)/(-15)? -2/21 What is the value of 2/12 + -24 + 573/18? 8 Calculate (132/(-176))/((-12)/(-64)). -4 What is (266/24 + -11)14? 1/3 Calculate (6/10)/((-33)/(-110)). 2 What is (-30 - -32) + 33/(-15)? -1/5 36/(-45) - 0 - 77/35 -3 What is the value of 104/(-30) - 2/(-3) - -3? 1/5 (168/(-20) - -8)(-4)/8 1/5 (2/52)/((2 - -4)/24) 2/13 (-6)/((-840)/(-68)) - 3/(-15) -2/7 Calculate 6 - 114/(-90)-5. -1/3 Evaluate (-96)/14 + 19/(-133). -7 What is 18 - 15 - (2-6)/(-3)? -1 What is ((-12)/(-10))/(4/10) + 0? 3 ((-376)/120 - -2) + (-2)/10 -4/3 Calculate (-4)/((-28)/(-16) + 2/8). -2 What is (0 - -1)(17 + -12)? 5 What is (((-90)/105)/(2/(-7)))/(-3)? -1 Calculate 1 + 4 + -5 - (-8)/(-52). -2/13 What is the value of (-1240)/(-4340) - (-1 - (-8)/7)? 1/7 Evaluate -3 - -15(-10)/(-45). 1/3 What is ((-294)/153 + 2)/(26/39)? 2/17 What is (2/(-4))/((-1)/404)? 5 What is 1/(((-28)/6)/(4/6))? -1/7 ((-5)/6)/((-1)/2) 5/3 Evaluate 4((-2)/16)/((-2)/8). 2 What is ((-1)/2)/((-55)/640) - 6? -2/11 Evaluate 30/(-9) + (-70)/6 + 11. -4 What is (-14)/(-12) + 75/90? 2 (-4)/22 + (-2345)/(-737) 3 What is 154/21 - 8/6? 6 ((-10)/60)/((-1)/(-2)) -1/3 Evaluate (11 + -1)(-30)/(-75). 4 Evaluate -1(4 + (3 - 4)). -3 What is (9 + -11)/(5 - (-45)/(-10))? -4 ((-4)/(-42))/((-1)/73) -2/9 (0 + -3 + 2)1 -1 Calculate 516/387 - -21/(-3). 2/3 Calculate ((-35)/(-42))/(2/4). 5/3 What is (21/(-6) - -1) + 2? -1/2 (196/35 - 5)/((-2)/10) -3 Evaluate 2(-5)/(-15)(-1)/4. -1/6 What is the value of 68/11 - 6 - 0/1? 2/11 Calculate (-4)/3(-86)/(-1376). -1/12 What is (102/153)/(4/42)? 7 What is (-17)/85 + (-6)/(-5)? 1 Calculate 2/4(-4)/(-4). 1/2 Evaluate (-8)/20 + (-69)/151. -5 ((-9)/(-6))/((0 - 3)/6) -3 2 + 92/(-16) + 3 -3/4 Evaluate 7 - (9 + 24/(-36)). -4/3 What is the value of (1/(-4))/((-3)/(-18))? -3/2 Calculate ((-124)/(-279))/((-52)/(-18)). 2/13 What is the value of (-90)/(-35) - 26/13? 4/7 Evaluate (-36)/8 - (-6)/(-12). -5 What is (55/99 + (-1 - -1))/5? 1/9 (-6 + 3)(-1)/1 3 What is the value of (-40)/110(-6 - 5)? 4 What is 1-1 - ((-5)/(-20) + -1)? -1/4 (406/(-42) + 8)/1 -5/3 What is the value of 4/(-6) - 1955/(-1785)? 3/7 Calculate (-4)/46 + 1288/(-9522). -2/9 What is (48/(-60))/(0 + 2/(-5))? 2 Evaluate ((-32)/(-28))/(70/(-49)). -4/5 What is the value of -11 - 3 - (-24 + 15)? -5 Calculate 11/(-10) - 60/(-100). -1/2 Calculate 136/(-714)18/(-8). 3/7 What is (-8)/(-4 + (2 + -4 - -4))? 4 What is (2 + (-3)/2)(-3 + -7)? -5 (-8)/(-10) - (-946)/(-645) -2/3 What is (0/(-6) - -15)/(1 + 2)? 5 What is (-10)/(-9)7/35? 2/9 What is (3/(-6))/(15/6)? -1/5 1/(-3)(52 - 43) -3 What is ((-27)/(-30))/(34/(-10) - -4)? 3/2 What is (-8)/60 - 22/(-15)? 4/3 What is the value of (17/(119/(-14)))/(0 + 11)? -2/11 2/8 + (2 - (-27)/(-12)) 0 Evaluate 8/67613 + (-218)/(-104). 9/4 What is the value of (-27)/(-9) - (-8)/(-6)6? -5 What is the value of (-3)/(-2)4/6? 1 What is (37/(925/600))/((-6)/(-2))? 8 What is the value of ((-3)/(-44))/(((-6)/16)/(-1))? 2/11 What is 36 - 36 - 4/(-10)? 2/5 Evaluate 56/5 + -11. -5 Calculate (40/(-16) - -2)(0 - -2). -1 What is the value of (-1)/2(90/(-63) + 2)? -2/7 What is the value of (-1 - 3/(-5))/(42/35)? -1/3 (33/(-22))/(-2 - (3 + -6)) -3/2 What is the value of 2/3 - (2 + 60/(-18))? 2 What is the value of (39/(-65))/((-1)/(-5))? -3 Calculate 26/(390/75)(-18)/(-10). 9 (-3)/((2/(-10))/(4/(-90))) -2/3 What is 2 + -1 - (-198)/(-154)? -2/7 What is the value of (-14)/(-77) + (-63)/(-77)? 1 (1 + -3 - -6) + 76/(-18) -2/9 What is (1 - 13/12)/(244/(-366))? 1/8 1 - (18/(-45))/((-2)/(-5)) 2 Evaluate -4 + (4 - (-6)/21). 2/7 What is (-38)/1337/2? -1 (-12)/(-9)(-16)/32 -2/3 What is the value of 5/1 - (5 + (-20)/(-25))? -4/5 Calculate (-552)/(-115) - (0 + 6). -6/5 Evaluate ((-32)/(-9))/2 + (-64)/(-288). 2 What is the value of -22 - (-378)/99? -2/11 Calculate -38/3030/(-12). 2 (-102)/9 - 93/(-279) -11 What is the value of 0 + -3(4 + -5) + 0? 3 Calculate 2/19 + 1872/8208. 1/3 Calculate 4/4 - (-2 + 1). 2 What is the value of (-1)/(-6)13? 1/2 What is 2/(-20)9(-50)/(-30)? -3/2 What is 5/12 + -2 + 101/404? -4/3 What is the value of (3/4)/(-1 - 14/(-32))? -4/3 (-21/8)/((-18)/96) 4/3 What is 408/(-56) + (9 - 2)? -2/7 What is (6/9)/(30/9 - 5)? -2/5 What is the value of ((-27)/(-135) - (-27)/(-35))/2? -2/7 What is (-9)/28510/(-3)? 2/19 What is (-3)/(-2)(0 + (-2)/3)? -1 What is the value of 5/(175/(-10))2/(-1)? 4/7 Evaluate (-8 - -6)/((-6)/(-2)). -2/3 What is ((-5)/25)/(3(-3)/135)? 3 What is the value of (-28)/(-6) - -1 - 7? -4/3 Calculate (-12)/(-6) - (-18)/(-10). 1/5 What is 180/(-40)4/3? -6 What is the value of (-30)/372(368/(-40) + 10)? -2/31 Calculate (-5)/((-45)/6)(-3)/(-15). 2/15 15/604/(-5) -1/5 What is 2/(-4)-4 - -1? 3 What is ((-10)/(-4) - 1)28/(-105)? -2/5 Evaluate (-2)/(-6) + 56/(-312). 2/13 Evaluate (-4)/39/24. -1/2 What is the value of (-6 - -2) + (-1 - (-7 - 1))? 3 Calculate (0 - 24/(-15))(-365)/(-438). 4/3 What is (-2)/(5 + -3 - (-3 - -2))? -2/3 Evaluate (-1 - 3/15)/(18/60). -4 Calculate (42/12 + 1)/(21/28). 6 Calculate (2/4)/(42/(-36)). -3/7 What is (-15)/(-6)10/(-5)? -5 What is the value of (-3)/((-63)/(-2))1? -2/21 What is -183/94/(-6)? 4 What is (-3 - 135/18) + 9? -3/2 What is ((-89)/1780)/(2/(-8))? 1/5 (-16)/(-12) + 2/(-6) 1 What is the value of (-1)/(-9) + 57/(-27)? -2 What is ((-9)/90)/((-2)/36) - 2? -1/5 What is the value of (-66)/12(-32)/44? 4 What is the value of 2/(-3)(-8 - 1308/(-168))? 1/7 Evaluate ((-184)/(-16) + -12)/	{ "pile_set_name": "DM Mathematics" }
sqrt(77))/sqrt(7))5)*2. -200sqrt(11) + 4425 Simplify (1sqrt(132)-5 - 4(sqrt(132) + 2sqrt(132)))/(sqrt(84)/(sqrt(700)-1)) + -2. -2 + 170sqrt(11) Simplify (sqrt(176) + -1 + 2 - -5(-1sqrt(176) - sqrt(176)))*2 + -5((sqrt(77)2 + sqrt(77))/sqrt(7))24. -72sqrt(11) + 12277 Simplify (1sqrt(68)2 + sqrt(68) + 5((sqrt(68) - (1sqrt(68) - sqrt(68))) + sqrt(68)))/(2sqrt(36)-4). -13sqrt(17)/24 Simplify -4(0 + sqrt(637) + -5 + 0 - -6(-4(sqrt(637) + 0) - sqrt(637))2). -382180 - 28sqrt(13) Simplify ((6(sqrt(128)-1 + sqrt(128) + 5))*2 - (((sqrt(128) + -1)2)*2 + 4)) + 4. 64sqrt(2) + 384 Simplify -5 + sqrt(28)/(1sqrt(196)) + 2. -3 + sqrt(7)/7 Simplify 1(1 + (-1sqrt(520))/sqrt(10))-6. -6 + 12sqrt(13) Simplify 4 + 2 + sqrt(143)/sqrt(11) - (((sqrt(91) + -1sqrt(91))1)/sqrt(7))2. sqrt(13) + 6 Simplify -1 + ((sqrt(143) - 2sqrt(143))2 + (sqrt(143) - 3sqrt(143)-2))/((sqrt(121) + sqrt(121)-2)/sqrt(11) + 1sqrt(11)3). -1 + 5sqrt(13)/2 Simplify ((sqrt(77) + 3(sqrt(77) - (sqrt(77)-4 + sqrt(77) + sqrt(77))))/(sqrt(539)2 + sqrt(539)))*2. 100/63 Simplify ((3(sqrt(68)1 + sqrt(68)) + sqrt(68) - sqrt(68))/(sqrt(324)4 + sqrt(4))5)2. 15300/1369 Simplify -3 + (2(sqrt(85) - sqrt(85)-1)-3)/((sqrt(5) + sqrt(270)/sqrt(6))6). -3 - sqrt(17)/2 Simplify (((2sqrt(60))/sqrt(6) + sqrt(10))/(((sqrt(30)-1)/sqrt(6) - sqrt(5)) + sqrt(5)) + 4)2. -24sqrt(2) + 34 Simplify sqrt(132)/(4sqrt(1100) + sqrt(1100))5. sqrt(3)/5 Simplify -4 + ((4-5sqrt(88)1)/(sqrt(392) - (sqrt(392) - -1(sqrt(392)-2 - sqrt(392)))))2. 2636/441 Simplify (((sqrt(110) + (sqrt(110)-22 + sqrt(110) - sqrt(110)))3)/((sqrt(480)-1 - sqrt(480))/sqrt(3)))2. 891/64 Simplify 0 + sqrt(119)/sqrt(448) + 5(sqrt(17) - (-4 + sqrt(17))). sqrt(17)/8 + 20 Simplify 1 + -4(sqrt(19) - -5sqrt(1900)) + 1. -204sqrt(19) + 2 Simplify -3 + (sqrt(21)/sqrt(3))2 + 4 - (sqrt(56)/(-1sqrt(8)) - (-3 + sqrt(28)/sqrt(4))). 5 + 2sqrt(7) Simplify -5 + (sqrt(108)-3 + 3 + -1sqrt(108)6)*2 + -1. -324sqrt(3) + 8751 Simplify (sqrt(27) + 0)-24 + -3((sqrt(12)/sqrt(4) - sqrt(3))2 - (sqrt(300)-2 + sqrt(3))2). -24sqrt(3) + 3249 Simplify ((sqrt(567) - (sqrt(567) + 0 + sqrt(567)))3)2 + -5 + -4. 5094 Simplify (sqrt(48)1 - ((sqrt(3) - (sqrt(3) + 1))-5)2) + 5 + 1(0 + sqrt(3)). -20 + 5sqrt(3) Simplify (-2sqrt(272)-2 + 4 + -2 + sqrt(272))2. 80sqrt(17) + 6804 Simplify (sqrt(1573) - ((sqrt(1573)2)2 + sqrt(1573)))-1 + sqrt(1573) + 1(sqrt(1573) + 1) + ((2 + sqrt(1573))1)*26. 286sqrt(13) + 15755 Simplify ((2sqrt(324))/sqrt(3) - (-1sqrt(3) + -1)2) + 2. 4 + 14sqrt(3) Simplify (5 + sqrt(85)/sqrt(5)1)*2 - 2(sqrt(1088) + 2). -6sqrt(17) + 38 Simplify (0 + ((sqrt(108)-3)/sqrt(6))/(sqrt(486) + -2sqrt(486)))-2. -2sqrt(3)/3 Simplify (-55-3sqrt(114))/(sqrt(216) + (sqrt(216) + -1sqrt(216))6). 25sqrt(19)/2 Simplify ((1sqrt(209))/sqrt(11) - (sqrt(931) + -2sqrt(931))2) + ((1(sqrt(171) + sqrt(171)2 + sqrt(171) + sqrt(171)) - sqrt(171))/sqrt(9))2. -627 + sqrt(19) Simplify (-1 + sqrt(22)/(sqrt(33)/sqrt(3)) + (4(sqrt(98) + 2 - sqrt(98)) - sqrt(98)))*2. -84sqrt(2) + 121 Simplify (-5 + 1 + sqrt(171))*2 + -1((sqrt(19) - 2sqrt(38)/sqrt(2)) + sqrt(19)). -24sqrt(19) + 187 Simplify 4 + (sqrt(170)/sqrt(160) - (sqrt(17) + -1)1 - (sqrt(119)/(sqrt(14)/sqrt(2))1)*2). -12 - 3sqrt(17)/4 Simplify (sqrt(504) + sqrt(504)-2 + -21sqrt(56))/(sqrt(24)/(sqrt(27)2)). -30sqrt(7) Simplify (sqrt(10)/(-2sqrt(6)/sqrt(3)) - sqrt(45)13) + -2. -19sqrt(5)/2 - 2 Simplify (1-35(1 + sqrt(252) + 4))*2-4. -249300 - 54000sqrt(7) Simplify ((-5sqrt(112)1 - sqrt(112)) + -4 + (sqrt(112) - sqrt(112)24 - sqrt(112) - ((sqrt(112) - (0 + sqrt(112))) + 2 - sqrt(112) - sqrt(112))))2. 576sqrt(7) + 16164 Simplify (5sqrt(70)4)/(5sqrt(490)). 4sqrt(7)/7 Simplify 6(-4 + (sqrt(2) - (sqrt(20)/sqrt(90))2) - -5(sqrt(2) - (sqrt(2) + (-2sqrt(4))/sqrt(2)))). -76/3 + 66sqrt(2) Simplify ((sqrt(21) - (sqrt(252)1)/sqrt(12))/sqrt(7) + 3)-15. -15 Simplify (1 + 2 + sqrt(12) + 3)2 + (1 + -2(sqrt(12) + -2))*2. -16sqrt(3) + 121 Simplify -4 + sqrt(7) + (-2sqrt(77) + sqrt(77))/sqrt(11) + sqrt(7) + -4 + -2sqrt(7) + -4 + 2. -10 - sqrt(7) Simplify 5 + sqrt(114)/sqrt(6) + -2 + (sqrt(228)/(sqrt(12) - sqrt(12)-2) + 2)2. 82/9 + 7sqrt(19)/3 Simplify (5(sqrt(117) - (sqrt(117) + (sqrt(117)2 + sqrt(117))-4))/sqrt(9))26. 280800 Simplify ((sqrt(1539) - 13sqrt(1539)) + sqrt(1539) - (sqrt(1539) + -2)1)21. -72sqrt(19) + 6160 Simplify 0 + -31sqrt(1053) + -5(sqrt(1053) + 4). -72sqrt(13) - 20 Simplify 3(2-5(sqrt(1216) - sqrt(19)) + 2)*2. -840sqrt(19) + 279312 Simplify 3(-2 + -4 + (-1 + sqrt(1573) - sqrt(1573) - sqrt(1573))1 + sqrt(1573))*2. 147 Simplify (-44sqrt(156))/(sqrt(432)-5). 8sqrt(13)/15 Simplify (sqrt(42)/sqrt(32))/(sqrt(36)/sqrt(48)). sqrt(7)/2 Simplify ((sqrt(66) + sqrt(66) + (sqrt(66) - -2sqrt(66)-6))/(sqrt(6) + (sqrt(864) - sqrt(864)-4)))*2. 891/3721 Simplify -4(sqrt(405) - (sqrt(405) + -2)-1)2. -144sqrt(5) + 16 Simplify ((sqrt(5) + sqrt(80) + 0 - (-2 + sqrt(5))-1) + 2sqrt(500) + sqrt(10)/sqrt(2)5)*2. -124sqrt(5) + 4809 Simplify (sqrt(26)/(-5sqrt(6)/sqrt(3))1 + 2(sqrt(91)/(sqrt(28) - sqrt(7)) - sqrt(130)/(sqrt(10)-1)))*2. 4693/25 Simplify ((sqrt(78) - (sqrt(78) - (5sqrt(78)-1 + sqrt(78) + sqrt(78) - sqrt(78)) - sqrt(78)))/(sqrt(600)-2)5-3)*2. 1053/16 Simplify ((sqrt(448)1)*24 + 0)-5 + -2. -8962 Simplify (sqrt(3) - (sqrt(48)/sqrt(4))2 - (sqrt(147) + 1 + sqrt(147))) + (-3(sqrt(12) + 0)*2 - sqrt(24)/sqrt(2)4). -49 - 21sqrt(3) Simplify (sqrt(400) + sqrt(400) + -2sqrt(400)-6 + sqrt(400))/(-2sqrt(288)). -25sqrt(2)/4 Simplify ((sqrt(1911) + -2sqrt(1911))-6)/((sqrt(36)/sqrt(3)-4)/sqrt(4)). -21sqrt(13)/2 Simplify 5((-4 + -4 + sqrt(20)1)2 + -5). -160sqrt(5) + 395 Simplify -5(-5(sqrt(5) + -2) + -2 + 4). -60 + 25sqrt(5) Simplify ((1 + sqrt(2))-4 - ((sqrt(2) - (-4 + sqrt(32) + sqrt(2) + sqrt(2))) + sqrt(2) - sqrt(2))) + sqrt(72)2 + (sqrt(128) + -2)2. -19sqrt(2) + 124 Simplify -2(0 + (2(1 + sqrt(147)) + 3)*2). -1226 - 280sqrt(3) Simplify (2sqrt(170)1 - (sqrt(170) - 1sqrt(170)5))/(4sqrt(30)/sqrt(3) - sqrt(10) - (-2-2sqrt(10) + sqrt(10))). -3sqrt(17) Simplify (-1 + sqrt(1053) + -1)*2 - (2sqrt(78)-2)/sqrt(6). -32sqrt(13) + 1057 Simplify sqrt(1900) - (31sqrt(1900))*2 - ((1 + sqrt(1900))-4)*2 - (5(0 + sqrt(1900))*2 + 3). -57019 - 310sqrt(19) Simplify -5(3sqrt(1539) + 4 - (sqrt(19) + sqrt(76)/sqrt(16) - ((sqrt(19) - sqrt(304)) + -5 + sqrt(19))))*2. -209875/4 + 235sqrt(19) Simplify ((-21sqrt(153) + sqrt(153) - sqrt(153)) + -3(sqrt(153) + sqrt(153)-2) + sqrt(153))/(sqrt(81)2 + sqrt(9) - sqrt(36)2). 2sqrt(17)/3 Simplify -5 + 5 + ((-1 + sqrt(1100))-2)*2 + 4. -80sqrt(11) + 4408 Simplify 0 + (sqrt(136)/(sqrt(648) - sqrt(648)4))23 + 2. 503/243 Simplify ((sqrt(135) - -2sqrt(135))/sqrt(9) - sqrt(135)/sqrt(81))/(sqrt(300) + 31sqrt(300)). sqrt(5)/15 Simplify (sqrt(77) + sqrt(77) + (sqrt(77) - (sqrt(77) + (-2sqrt(77) - sqrt(77)))))/sqrt(11) + ((sqrt(189)/sqrt(3))/sqrt(9))*2 + (sqrt(21)/sqrt(3)-2)*2 + 3. 5sqrt(7) + 38 Simplify ((sqrt(204) + (sqrt(204) - 5sqrt(204)))-4 - sqrt(204))/(sqrt(72)/(sqrt(36)/sqrt(6))) + 1. 1 + 11sqrt(17) Simplify 0 + 0 + sqrt(84)/(sqrt(144)/sqrt(432))-5. -30sqrt(7) Simplify ((sqrt(456) - (sqrt(456) + -3sqrt(456)1))/sqrt(8))/((sqrt(3) + sqrt(6)/sqrt(2))5-5). -3sqrt(19)/50 Simplify ((sqrt(3) - (sqrt(3) + (sqrt(3) - (sqrt(75) - sqrt(3))-4))) + 4 - (0 + (sqrt(12)/sqrt(4)-2)*2)) + 5. -17sqrt(3) - 3 Simplify 6((sqrt(132) + (sqrt(132) - (sqrt(132) + (sqrt(132) - (sqrt(132) - (sqrt(132)1 + sqrt(132)))))))4)/(sqrt(1200)1). -12sqrt(11)/5 Simplify (2 + -2sqrt(363)-2 + sqrt(363) + sqrt(363) + sqrt(363) + 5(0 + sqrt(363)) + sqrt(363) + -1sqrt(363) + -5 + sqrt(363))2 + 1. -858sqrt(3) + 61357 Simplify (5sqrt(18)/(sqrt(9)-2 - sqrt(9)))2 - (3 + (-1 + sqrt(2))25). -112/9 + 10sqrt(2) Simplify (sqrt(171) + 1 + sqrt(171)1 + 0 + 2 + -3)2. 684 Simplify ((sqrt(15) - sqrt(150)/(1sqrt(10)))/sqrt(3) - (-5 + sqrt(245) + sqrt(245) + 1 + sqrt(245) + sqrt(245) - sqrt(245))*2) + 3. -2218 + 168sqrt(5) Simplify (sqrt(85)/sqrt(5) + -2)*-2 + sqrt(	{ "pile_set_name": "DM Mathematics" }
remainder when 25 is divided by o? 12 Let m(g) = -3. Let x(b) = b + 7. Let l(p) = 7m(p) + 3x(p). Let w be l(-1). Calculate the remainder when 25 is divided by (-38)/w + 3/9. 12 Suppose 0 = -0p + 2p - 6. Let l be ((-2)/p)/(3/54). Calculate the remainder when (-2)/(-3) - 88/l is divided by 3. 2 Let f = -11 + 13. Suppose 2l + 4y = 40, 0 = -fy - 2y + 12. Let g = 42 + -16. What is the remainder when g is divided by l? 12 Let q(g) = g + 11. Let m be q(-9). Suppose -ms = 2s - 4. Calculate the remainder when 2 is divided by s. 0 What is the remainder when 84 is divided by 33 + (-3 - -7)-1? 26 Let b(n) = 6n - 7. Suppose -r = 3r - 108. Let d = 39 - r. What is the remainder when b(5) is divided by d? 11 What is the remainder when 9 is divided by ((-6)/(-2))/(6/4)? 1 Suppose -4t = -s + 7 - 40, 2s + 30 = 4t. What is the remainder when 62 is divided by t? 8 Suppose -5h - 6 = -81. Calculate the remainder when 72 is divided by h. 12 Suppose 113 - 15 = 7g. Suppose -u + 5 + 7 = -2m, 0 = -5u + m + 33. Let n = u + 2. Calculate the remainder when g is divided by n. 6 Let q(t) = -t + 14. Let z = 14 + -7. What is the remainder when q(z) is divided by 2? 1 Let c = -5 - -6. Let i be c + 4 - (-2 + 4). Suppose -g - l = -6l + 3, -3l - 15 = -ig. What is the remainder when 19 is divided by g? 5 Let b(q) = q2 - 3q + 9. Calculate the remainder when 33 is divided by b(0). 6 Let f(g) = -g*3 + 19g*2 + g - 8. Calculate the remainder when f(19) is divided by 7. 4 Let g = 196 - 128. Let i = 32 + -9. Calculate the remainder when g is divided by i. 22 Suppose 4o + 0r - 49 = -3r, 4o - 46 = -2r. Let b(l) = -2l3 - 5l*2 + 2l - 3. What is the remainder when b(-4) is divided by o? 7 Let r(l) = -l*3 + 5l*2 + 7l - 1. Let t(u) = -u*3 + 5u*2 + 8u + 7. What is the remainder when t(6) is divided by r(6)? 4 Suppose 3m - 60 = m. Suppose 0 = -4s + 7s - m. Calculate the remainder when 39 is divided by s. 9 Suppose 2o - 27 = -3t + 152, -t + 63 = 4o. Let f be 103/((-6)/(-4)). What is the remainder when t is divided by 2/(2 - 38/f)? 19 Let c(m) = 8m*2 + 30m + 6. Let n = -9 + 14. Calculate the remainder when c(-4) is divided by n. 4 Let j(k) = k*3 + 9k*2 + 6k + 3. Let u be j(-8). Let d = u + -2. Calculate the remainder when d is divided by 6. 5 Suppose -p + 4a - 18 = 0, 3a - 23 = -4p - 0p. Suppose -r + 9 = p. Calculate the remainder when 13 is divided by r. 6 Suppose 4u + 0w + w - 131 = 0, -2u + 5w = -49. What is the remainder when 94 is divided by u? 30 Let i = -3 + 29. Calculate the remainder when 49 is divided by i. 23 Let w(g) = 2g - 2. Let y be w(4). Suppose -o + yo = v + 173, -4o = -5v - 130. What is the remainder when o is divided by 12? 11 Let d(c) = 15c2 + 2c + 1. Calculate the remainder when 25 is divided by d(-1). 11 Let j = -46 + 72. Calculate the remainder when 127 is divided by j. 23 Let f be -1 + 62/4. Let k(z) = 70z*2 + 4z - 3. Let h be k(f). Suppose -h = -i - 4i. Calculate the remainder when i is divided by 15. 12 Suppose 4 = r - 5. Calculate the remainder when 80 is divided by r. 8 Let w(q) = -q3 - 3q*2 + 4q + 3. Let p be w(-4). Suppose -pl = -0l - 75. Calculate the remainder when l is divided by 13. 12 Let z(t) = t*2 - 5t + 4. Let y = -4 - -9. Let d = y + 1. What is the remainder when d is divided by z(5)? 2 Suppose 8 = -2p + 3p. What is the remainder when 47 is divided by (-7)/((-21)/6)p? 15 Suppose -6g + 277 = -77. Calculate the remainder when g is divided by 10. 9 Suppose 5d - 348 = l, d - 2l - 27 = 48. Calculate the remainder when d is divided by 18. 15 Let q(s) = -2s + 1. Let j be q(-2). Suppose 7 = jk - 8. What is the remainder when 11 is divided by k? 2 Let p(o) = -o*3 + 4o*2 - 2. Let s be p(4). Let k(t) = 1 + 8 - 15t - 7. Calculate the remainder when k(s) is divided by 11. 10 Let j = 2 + 0. Suppose -3o + jb + 51 = 5b, 130 = 5o - 4b. Calculate the remainder when 65 is divided by o. 21 Suppose z = 5h - 102, -z = -3h + 2z + 54. Suppose 5k = 34 + h. Calculate the remainder when 21 is divided by k. 10 Let g be (15 - 8/4)-1. Let r = -6 - g. What is the remainder when 17 is divided by r? 3 What is the remainder when 22 is divided by (-1)/4 - (-99)/12? 6 Let v(c) = 2 - 2 + 468c - 463c. Suppose 0 = p - 0p - 2. What is the remainder when v(p) is divided by 6? 4 Suppose 0 = -2f + 2, 3d + 7 - 20 = 2f. Let c = 0 + 3. Suppose dw + c = 43. Calculate the remainder when w is divided by 3. 2 Suppose 4y = j - 26, -3j = -4y + y - 78. What is the remainder when j is divided by 10? 6 Suppose -5f = -5z + 1355, 3 = -2f + 5. Suppose 0j = j + 5g - 93, 4j - z = 5g. Let c = -48 + j. What is the remainder when c is divided by 14? 11 Suppose 5w - 13 + 243 = 0. Let m = 76 + w. What is the remainder when m is divided by 11? 8 Let y = 122 - 113. Calculate the remainder when y is divided by 5. 4 Let i(t) = -t3 - t + 8. Let b be i(0). Let k = 68 - b. Let q = k - 13. Calculate the remainder when q is divided by 16. 15 Suppose 5 = y - 5. What is the remainder when 58 is divided by y? 8 Let c(m) be the second derivative of m4/6 - m*3/6 + 2m. Suppose 9 = 3n + 3. What is the remainder when c(-1) is divided by n? 1 Suppose 0 = -f - f - 2m + 22, -10 = 5m. Suppose 2l - 10 = -0. What is the remainder when f is divided by l? 3 Suppose 5i + 34 - 149 = 0. Calculate the remainder when 43 is divided by i. 20 Let k = 2 + 3. Let d(g) be the third derivative of 5g4/12 - g3 - 2g2. Calculate the remainder when d(k) is divided by 15. 14 Let k = 30 - -1. What is the remainder when k is divided by 8? 7 Let c(b) = b2 - 3b - 34. Calculate the remainder when (-8)/10290/(-4) is divided by c(-6). 18 Let k(h) = -h2 - 9h - 7. Suppose 4l = -5j - 19, 3l + 14 = -4j - 0j. Calculate the remainder when 32 is divided by k(l). 10 Suppose 0 = -4h + 2h + 4. Suppose -p - hp = -15. Suppose -5s - 3j + 19 = 0, 5j - 5 = 2s + 3s. What is the remainder when p is divided by s? 1 Suppose -53 = -5u + 27. Calculate the remainder when 2 is divided by 1/(-4) - (-20)/u. 0 Let a(p) = -p + 9. Suppose 2g - 85 = -3g. What is the remainder when g is divided by a(3)? 5 Let i(t) = -t*2 - 9t + 16. Let o be i(-11). What is the remainder when 8 is divided by -2(-3)/o-5? 3 Let m(y) = -6y - 7. Let c = -2 + -3. Let v be m(c). Let t = 33 - v. What is the remainder when t is divided by 4? 2 Let g(l) = -l3 + 4l*2 + 4l - 6. Let h(f) = f + 4. Calculate the remainder when g(4) is divided by h(0). 2 Let p = 125 + -278. Let l = -32 - p. Suppose 4v + 9 - l = 0. Calculate the remainder when v is divided by 10. 8 Suppose 2g - c = 25, -97 + 30 = -5g + c. Calculate the remainder when 25 is divided by g. 11 Suppose 56 = 2x + 4. Calculate the remainder when 99 + (-1 + 4)/((-3)/(-2)) is divided by x. 23 Suppose 0 = 2h - 27 - 199. Let w = h - 48. What is the remainder when w is divided by 33? 32 Suppose 0 = -5f + f. Suppose -4z + 3y - 23 + 63 = f, 2y + 1 = -z. Calculate the remainder when z is divided by 3. 1 Calculate the remainder when 56/(-10)10/(-2) is divided by 10. 8 Suppose -3 = 4q - 31. Let b(u) = 2u - 8. Let p be b(q). Let d = p - -23. Calculate the remainder when d is divided by 10. 9 Suppose 5 = -2n - 9. Let a(l) = -l3 - 7l*2 - 5l - 10. Calculate the remainder when 48 is divided by a(n). 23 Let b = -118 - -139. Calculate the remainder when 143 is divided by b. 17 Suppose 0f = 2f - 2. Calculate the remainder when 24 + (0 - -1)f is divided by 13. 12 Suppose -3p + u + 161 = 0, -2u = 6p - 3p - 173. What is the remainder when p is divided by 15? 10 Let a(t) = -t + 22. Calculate the remainder when a(12) is divided by 2. 0 Let z(u) = -69u - 6. Calculate the remainder when z(-1) is divided by 17. 12 Suppose -2k - 12 = k. Let r = -5 - k. What is the remainder when 67/6 + r/6 is divided by 4? 3 Let n(v) = -v + 11. Let b(r) = -r + 16. Let s be b(11). What is the remainder when 21 is divided by n(s)? 3 Let y(l) = 3l*2 - 4l + 2. Suppose 2j + 0j - 4 = 0. What is the remainder when 22 is divided by y(j)? 4 Let n(w) = -7w + 8. Let i be n(-8). Let z = 99 - i. Calculate the remainder when z is divided by 17 + -1 + (-4)/(-2). 17 Let s be (-20)/(-9) - 6/27. Suppose 4y - 85 = -x, 0*	{ "pile_set_name": "DM Mathematics" }
/l))/(l(1/6))40 assuming l is positive. l(-29/3) Simplify (r(-1/10)/((((r*(-1/4)r)/r)/r)/r))/(r/(r(2/5)/r))(-8) assuming r is positive. r*(299/20) Simplify qq/(qqq(qq*2)/qq)qq(2/21) assuming q is positive. q(-61/21) Simplify ((j*(-4)/j)/(jj*10j))(-28) assuming j is positive. j476 Simplify (zz11z(-4))(-7) assuming z is positive. z(-56) Simplify (q0)(7/11) assuming q is positive. 1 Simplify (c/(c1/c)c)(4/25)/(cc*(2/3)c)(-1/16) assuming c is positive. c(73/150) Simplify (ff(2/67))/f(-1/24) assuming f is positive. f(1723/1608) Simplify ((k(-4/5)k)/(k*4/kk))/(k(2/7)/k7) assuming k is positive. k*(102/35) Simplify ((ww/(ww(3/5))ww)/www18)(-15) assuming w is positive. w(-306) Simplify ((t(-6)/t)(-38/7))(9/2) assuming t is positive. t171 Simplify (b(-2))(-2/7)/((b7b)/(((bb(-7/3)/b)/b)/bb)) assuming b is positive. b(-226/21) Simplify z(-2/3)/z13 assuming z is positive. z(-41/3) Simplify ((uuuu(-3)uu)/(u/(u/(u/(uu*8)))u))/(u(2/3))48 assuming u is positive. u(-23) Simplify z(-12)z/(z/(zz(zzz/z(-1/9)z)/zz)) assuming z is positive. z(-53/9) Simplify (a/(a/(a(1/5)a))aa(1/5))32 assuming a is positive. a(384/5) Simplify (t(-3/4)t(2/13))10 assuming t is positive. t(-155/26) Simplify (k/(k/(k/k5))k)/kk/(k/k(-3))(k*(2/13)kkk)/((k/((kkk/k*(2/9)k)/k))/k) assuming k is positive. k(-125/117) Simplify ((b/(b/b(-1/2)))27)(2/63) assuming b is positive. b(-3/7) Simplify i/(i(1/8)i)i*(1/8) assuming i is positive. 1 Simplify (((u(u/(u*36/uu))/u)/u)/u)/u(-5/4) assuming u is positive. u(-143/4) Simplify ll(2/9)ll(-39) assuming l is positive. l(-331/9) Simplify ((gg*(-3)/gg)/(g*(-7)g))(-1/29) assuming g is positive. g(-4/29) Simplify (u1/u(-3/4))/(u*(3/5)u*5u) assuming u is positive. u(-97/20) Simplify (t(4/15))41 assuming t is positive. t(164/15) Simplify u*11/((u/(uuu(2/15)))/u) assuming u is positive. u(197/15) Simplify (((uu/u*3u)/uu)/(u(2/3)/u))/((u/u0)/(u0u)) assuming u is positive. u(1/3) Simplify (q(2/25)/q)/(q*(2/5)/q)q6/(q/(q(-1/5)q)q) assuming q is positive. q*(112/25) Simplify ((kk*(-18)k)/(k/(k/k(4/3))))7 assuming k is positive. k(-364/3) Simplify ((v(-2))18)17 assuming v is positive. v*(-612) Simplify ((v/(vv*0v))/v(vv*(-2))/vv)(-23) assuming v is positive. v69 Simplify (v(5/4))(-40) assuming v is positive. v(-50) Simplify (x/((x/(x/x(-7/6))x)/x))/x(-19) assuming x is positive. x(127/6) Simplify ((qq((q/(qq/(qq(-9))))/q)/q)/q)(-6/11) assuming q is positive. q(60/11) Simplify (oo(1/2))(-4/15)/(o1)(1/23) assuming o is positive. o*(-51/115) Simplify ((rr*(-1/12)rr)/(r/r(-1/4)))35 assuming r is positive. r(175/3) Simplify (u(-1/5)u/u(-6/7))(2/31) assuming u is positive. u*(116/1085) Simplify (b/(bb*(1/12)b)b(-8))(3/29) assuming b is positive. b(-109/116) Simplify (p/(p/(pp((p/p(-5/4)p)/p)/pp)))(-23) assuming p is positive. p(-391/4) Simplify (o(-6)oo/(o5/oo)oo)/((oooo/((ooooo0o)/o))/o)4 assuming o is positive. o(-3) Simplify (qq3q)/q*4(q/q(-2/7))(-23) assuming q is positive. q(-200/7) Simplify (k/k(-1/5))(-40) assuming k is positive. k(-48) Simplify a/(a/a*(-1/3))(a/(a/a(2/11)))/a assuming a is positive. a(-38/33) Simplify (c(3/5))(-12) assuming c is positive. c(-36/5) Simplify c(-1/17)/(c*(4/17)/cc) assuming c is positive. c*(-5/17) Simplify (qq(1/3))(2/39)(((q/(q(q/((qq(1/6))/q))/q)q)/qqq)/q)/(qqq*(-2)q) assuming q is positive. q*(55/234) Simplify (l/(ll/l(-2/19)))(-24/7) assuming l is positive. l(72/19) Simplify (m(-4)(mm*(2/3))/mm)/(m0/m(-4/7)) assuming m is positive. m(-61/21) Simplify (m(-1/3)/m*(-1/3))/(((m/(mmm(3/4)mm))/m)/m0) assuming m is positive. m(19/4) Simplify qqqq/(q*(-13/3)q)qq8 assuming q is positive. q(49/3) Simplify ((ff(3/4)/f)/f)/ff(f(-1/7)/f)/f assuming f is positive. f(-67/28) Simplify (s/(s/(s/(s(-16)/ss))))(3/5) assuming s is positive. s(51/5) Simplify (t/(t/t(-1)))(1/5)((ttt(2/11)/tt)/t)/((tt(5/4))/t) assuming t is positive. t(-59/220) Simplify h2h(2/27) assuming h is positive. h(56/27) Simplify i*(-1/21)/i(ii/(i/(((ii/i*0)/ii)/i)i))/i assuming i is positive. i(-22/21) Simplify ((r(-1))(-5/6))7 assuming r is positive. r(35/6) Simplify q/((q/((qq*(-7))/qq))/q)(q30/q)/q assuming q is positive. q23 Simplify (iii/(i/(ii*(5/2)i))ii(iii(1/2))/i)/(i(-5/3)/i(6/7)) assuming i is positive. i(263/21) Simplify (h(-2/3)/h)(-20/3) assuming h is positive. h(100/9) Simplify (f((ff4)/f)/ff/f(-4/5))(-23/4) assuming f is positive. f(-667/20) Simplify ((k(1/3)k)40)(28/3) assuming k is positive. k(4480/9) Simplify (b/b(2/43))(1/5) assuming b is positive. b(41/215) Simplify (o/(((o5/o)/o)/o))(-3/4) assuming o is positive. o(3/4) Simplify (w(-2/7)/(ww(1/6)))0 assuming w is positive. 1 Simplify (nn/n(-2))/(nnn(-5/12)n) assuming n is positive. n*(17/12) Simplify (dd(-1))33/(d/(ddd*(2/3)/dd)ddd(-4)dd) assuming d is positive. d(5/3) Simplify v(-2/7)/(v(v/(v*(3/5)v))/v)(v/(v(v/v0)/v))(2/13) assuming v is positive. v*(11/35) Simplify ((aa/a0)/(a/(a/(a(6/11)/a))))(10/7) assuming a is positive. a(270/77) Simplify u/(uu/u5)uu(uu0)/uu(u/u0u)(-3/2) assuming u is positive. u4 Simplify (n7/n(-5/3))(-27) assuming n is positive. n(-234) Simplify (t/(t*0t)t(-5))37 assuming t is positive. t(-185) Simplify (s(-1/3))47/(ss*0ss)(-1/18) assuming s is positive. s(-31/2) Simplify (ss/(sss/(s/(s/(((s*5/s)/ss)/s)))s)s(-4/3)/s)/(s(-6)/(s3/s)) assuming s is positive. s(20/3) Simplify w*(-3)w*(1/4)ww(-5)w/(w/((w/(w/(w/(w*(5/3)w)))w)/w)w) assuming w is positive. w(-113/12) Simplify ((g(-1/14)/g)/ggg*1g)/(((g/(g/g(1/7)))/g)/(g/(g/(g/(g/g(1/13)))))) assuming g is positive. g(339/182) Simplify u(-2/9)/u*(4/5)u*0uu(-2/21) assuming u is positive. u(-37/315) Simplify (i/((i0i)/i)i2i)/(i0)(-19) assuming i is positive. i4 Simplify (t23t)/(t/(t(2/55)t)) assuming t is positive. t(1322/55) Simplify (m(-1))*(8/7)(m*(-1/4)mm)31 assuming m is positive. m(1487/28) Simplify q(-4/13)/(q((q/((((q/(qqq/(q/q(-1/7))))/q)/q)/q))/q)/q) assuming q is positive. q(-379/91) Simplify (f(-3/8))(2/85) assuming f is positive. f(-3/340) Simplify (z(-8/3)/z(-2/19))(-27) assuming z is positive. z*(1314/19) Simplify h/(hh*(-5))h*6hh(-4/5)h/((hh/h(2/5))/hh) assuming h is positive. h*(53/5) Simplify (m/(mmm(2/15))mm/m(-1/8))/(m/m(-2/3))4 assuming m is positive. m(-227/40) Simplify (m/(m/(m(2/7)/mm)))*(-45)m*(3/4)/(mm/(m*(4/5)m)) assuming m is positive. m*(-1723/140) Simplify (rr3)(-36) assuming r is positive. r(-144) Simplify ((k(2/5))(-16/9))(9/4) assuming k is positive. k*(-8/5) Simplify (ii(-13/2))/(i/(i/i(-3/5))i) assuming i is positive. i(-59/10) Simplify (r(2/9))(4/27)r*(-2/15)r(-1/3) assuming r is positive. r(-527/1215) Simplify (g(-3)/(((g0/g)/g)/g))/((g*2g)/g(-2)) assuming g is positive. g(-5) Simplify (j(-2/11))(11/8)j/((jj*9)/j)j(-1/13)/j assuming j is positive. j(-485/52) Simplify ((www*6w)/(ww/(ww*(-4)/www)))/(ww(2/5))33 assuming w is positive. w(-206/5) Simplify r(2/153)/r13 assuming r is positive. r(-1987/153) Simplify (x/(x/(x*(-1/2)xxxxxx))x)29/(x/(x/x2))(1/3) assuming x is positive. x(1127/6) Simplify (t9)(-7/9) assuming t is positive. t*(-7) Simplify ((kk*19k)/k)(-23) assuming k is positive. k(-460) Simplify (g*(3/4)g2)/(g(2/5)/g3) assuming g is positive. g(107/20) Simplify (hh29)(4/9) assuming h is positive. h(40/3) Simplify (n14/n)/(n/(nn/n(-3/8))) assuming n is positive. n(115/8) Simplify i*6i/(ii/i(-5/4))i*(-3/2)ii*(-2/3) ass	{ "pile_set_name": "DM Mathematics" }
1 a factor of (47 - 53) + j + 892? False Let k = -219 + 212. Is (-6 - -6)/k + 50 even? True Let c = -20719 - -23129. Is 5 a factor of c? True Suppose 43 = z - 2. Suppose -4n - w + 404 = 0, -n - z = 2w - 139. Suppose c - 2c = -n. Is c a multiple of 16? False Suppose -7p + 12p = -2630. Let g = 814 + p. Does 48 divide g? True Let s(y) = -4y - 37. Let m be s(-10). Suppose -mx - 2x = -1170. Does 15 divide x? False Suppose -5 = -5g, 2g - 3g - 121547 = -7d. Is 120 a factor of d? False Suppose -4o = 2m - 4024, 2m - 157o - 4030 = -155o. Is m a multiple of 19? True Let g(p) = -79p + 1051. Is 37 a factor of g(-34)? True Let x = 6541 + -5281. Does 6 divide x? True Is -1 - 1 - (21 - (14 - -3524)) a multiple of 29? False Let p(g) = 2g2 - 31g + 11. Let h be p(15). Is 19 a factor of -6791h/14? False Suppose -36t + 34t = 0. Suppose 0c - 3c + 6 = t, 0 = -f - 3c. Let q = f - -110. Is 13 a factor of q? True Let y = 8114 + -4047. Is y a multiple of 35? False Suppose p - 3p + 5r = -17, -61 = -4p + r. Let u = p - 36. Is (u/12)/((-6)/45)2 a multiple of 2? False Let t = -13868 - -25550. Is 28 a factor of t? False Let k(c) = 7c + 61. Let m be k(-9). Is 12 a factor of m - (46/(-3) - 24/(-18))? True Let y(t) = t*2 - 49t + 59. Let v be y(37). Let f = v + 710. Is 13 a factor of f? True Suppose -2g - 63 = 5v - 7, v + 4g + 22 = 0. Suppose 25j - 34j = -522. Let h = v + j. Is h a multiple of 24? True Let b = 704 - -2050. Suppose -388m - b = -391m. Is m a multiple of 51? True Suppose -3x + 843 = -330. Let l = x + -251. Is l a multiple of 14? True Suppose -2a + 3u + 13 = 2u, u - 15 = -5a. Suppose -4v - 4q - q + 36 = 0, aq - 28 = -3v. Let c(n) = -n*3 + 5n*2 + 5n - 1. Does 7 divide c(v)? True Let t(u) = -2u3 + 82u*2 + 60u - 104. Does 32 divide t(39)? True Let m = -560 - -846. Is 72069/39 + 22/m a multiple of 84? True Let r = -17205 + 25746. Does 34 divide r/36 - 3/(-4)? True Let m be 80/60 - 16/3. Let k(t) = -9t3 + 5t*2 + 10t + 11. Is 13 a factor of k(m)? False Let x = -3092 - -5038. Does 3 divide x? False Let o = -57 + 57. Suppose o = 8a + 11 - 3. Does 4 divide (-3)/(a + (-60)/(-65))? False Let i = 58267 - 40077. Is i a multiple of 214? True Suppose -5w + 4r = -1877, -119w + 731 = -117w + 5r. Is w a multiple of 7? False Suppose 2c - 33 = 3a, -4c + 16 = 4a - 0. Suppose 2k + 4d = c + 25, 5k - 113 = -3d. Suppose 3g = -n + k, 2n - 3g = -0n + 5. Is n a multiple of 10? True Suppose 3t - 107808 = -2t + i, -i = -t + 21568. Does 35 divide t? True Let f be ((-4)/(-10))/(436/40 - 11). Is 6 a factor of ((-822)/(-24) + f)/(1/12)? False Does 80 divide (-230)/(-3)22110/275 + -13? False Suppose 5y - 209095 = -5n, 154n = y + 150n - 41824. Does 205 divide y? True Does 42 divide 420/1470 - (-28516)/7? True Suppose -17v = 2v - 71630. Is v a multiple of 29? True Let q be (6 + 10)(-20 - -1). Let x = q + 704. Does 40 divide x? True Suppose -211s + 68s + 69804 = -2336886. Is s a multiple of 55? True Let f = 6260 - 2699. Is f a multiple of 28? False Let q be ((-21)/(147/(-1400)))/(-1). Let o = 386 + q. Is 62 a factor of o? True Does 88 divide (0 - (-4)/20 - (-155364)/55) + 3? False Suppose 7z - 2k - 15 = 4z, 0 = 4z - 3k - 20. Suppose -g = -3t - 335, 3t - 2621 + 874 = -zg. Is g a multiple of 29? False Let z = 27 + -21. Let s(u) = u*3 - 7u*2 + 7u - 6. Let r be s(z). Suppose r = -q + 51 + 18. Is q a multiple of 13? False Suppose 2a - 283 = 5y, 0 = 5a + 5 - 0. Let z = 82 + y. Is 5 a factor of z? True Let v(c) be the second derivative of 5c4/12 - c3/3 + c*2 + 13c. Let h be v(3). Let m = h + 49. Is 30 a factor of m? True Suppose -64t + 46277 = -118t + 61t. Does 7 divide t? False Let m(i) = 6 - 161i*3 - 4i - 5i2 + 0i + 160i3. Let y be m(-4). Does 7 divide (4/y)/(((-78)/(-216))/13)? False Does 10 divide 1/(2/6) - (-3072 + -8)? False Let o be (-3 - (-9 - -3))/(3/(-46)). Let w be o/(-2)60/(-15). Let a = w + 129. Is 6 a factor of a? False Let t(l) = -l*2 - 7l - 269. Let j be t(0). Let n = j - -599. Is 10 a factor of n? True Let o(w) = -w3 + w2 + w - 1. Suppose q + 30 = 3q. Let l(a) = a2 - 15a - 3. Let s be l(q). Is o(s) a multiple of 16? True Let d(h) = h - 10 - 17 + 35 - 30h. Suppose 15o + 20 = 10o. Is d(o) a multiple of 19? False Let m(p) = 2p3 - p2 + p + 1. Let c be (-2)/(3/((-9)/6)). Let j be m(c). Suppose 3l - jq + 4q = 248, l - 92 = 2q. Is l a multiple of 21? True Suppose 313q - 319q + 36 = 0. Suppose 2b - 612 = -2r, -qr - 2b = -9r + 893. Does 10 divide r? False Let l(w) = -56w - 15. Let r be l(-2). Let h = r + -62. Is h a multiple of 35? True Suppose 68 = -8g + 20. Suppose 0r + 4i = -r + 14, -3i = 3r - 6. Is 33 a factor of (4 + r + (-27)/g)18? False Suppose 13 = -22w - 9. Let a(l) be the first derivative of -39l4/2 + l3/3 + 5l2/2 + 4l + 13. Is 13 a factor of a(w)? True Let n = 162 + -178. Does 17 divide 2 - (-4)/(n/(-196))? True Let h = -33067 - -46798. Is 59 a factor of h? False Let q(v) = v - 17. Let f be q(22). Suppose 37 = fy - 18. Let m = y + 28. Is 13 a factor of m? True Let m(i) = 3i*2 - 9i + 3. Suppose 40 = 6h - 26h. Is m(h) even? False Suppose 2g + 3a - 5 = 0, -3g - 12 + 19 = 5a. Suppose -gh = -2y + 4230, 281 + 1828 = y - 4h. Does 21 divide y? True Let n = -8395 - -13036. Is 16 a factor of n? False Suppose i - 3i + 3r = -1, 0 = 2i + 3r - 7. Let q(u) = -12u - 5. Let j be q(i). Let g = j - -33. Is g a multiple of 3? False Let c(p) = -175p - 2322. Is 42 a factor of c(-44)? False Let j be ((-4038)/(-12) - 0) + 3/6. Let b = j + -177. Is b a multiple of 20? True Is 5 + (15555 - (3 - 16)) a multiple of 134? False Let f = -14904 - -21168. Is f a multiple of 116? True Suppose 45p - 43335 - 52020 = 0. Does 10 divide p? False Let m(c) = 1784c2 - 157c - 482. Is m(-3) a multiple of 26? False Let w be (16/144)/((-2)/6)0. Suppose w = 38x - 28x - 640. Does 16 divide x? True Let a(j) be the third derivative of j4 - 57j*3/2 - 186j*2. Is 9 a factor of a(12)? True Let d = -3712 - -3872. Is d a multiple of 5? True Let t(q) = 553q*2 + 26q - 33. Does 116 divide t(6)? False Let i = 2253 + -1020. Let a = -8 + i. Suppose 5c + 2c = a. Does 19 divide c? False Let l = 90014 + -61124. Does 24 divide l? False Suppose 4o - 19 = 9. Suppose -17 - 25 = ok. Does 7 divide 4/63/k-117? False Let x(i) be the first derivative of 17i3/3 - 81. Is x(-2) a multiple of 2? True Let u be (-6)/(-8)(364/21 - 12). Suppose -741 = uf - 3173. Is 38 a factor of f? True Suppose -4n - 5x + 26778 = -47812, 0 = -2n + x + 37274. Is n a multiple of 20? True Let y(i) = -i*3 + 27i*2 + 65i + 33. Let r be y(29). Let a = -94 + r. Does 3 divide a? False Let d = -4339 - -6092. Let g = -934 + d. Is 12 a factor of g/12 + 4/(-16)? False Suppose 3r + 3f = 4983, 1284r = 1287r + 4f - 4978. Is r a multiple of 6? False Suppose 10d - 7223040 = -72d - 83d. Is d a multiple of 12? True Let m(l) = 14l2 + 8l - 24. Let u be m(-11). Let d = 4237 - u. Suppose 4a - d = -11a. Is 24 a factor of a? False Suppose 2h - 656 - 3998 = 0. Is h a multiple of 14? False Let v = -85197 - -119941. Is v a multiple of 86? True Suppose -26v + 25900 = 24v. Let i = 2023 - v. Is i a multiple of 22? False Let q(t) = -5t*3 + 12t*2 - 49t - 63. Let b(w) = 6w3 - 11w*2 + 50w + 63. Let j(n) = 6b(n) + 7q(n). Is 18 a factor of j(-19)? False Suppose -9g + 39g = 582781 + 331559. Is g a multiple of 49? True Let j(x) = 4x2 - 51x - 62. Let h be j(36). Suppose 83v - h = 21v. Does 5 divide v? False Suppose -x + 4 = 2b - 2, 3x = 4b - 12. Suppose -28 = -bw + w. Is 7 a factor of w? True Let h = 11 - 11. Let n be (-4)/(0 + 1) - h. Let i(o) = -10o + 14. Is 6 a factor of i(n)? True Let b = 83 + -44. Let u = b + 41. Is u a multiple of 8? True Let a(u) be the third derivative of u6/180 + u5/20 + u4/8 - u3/3 + 30u*2. Let s(f) be the second derivative of a(f). Does 3 divide s(6)? True Let u(f) = 13f*2 - 66f - 18. Is 18 a factor of u(-12)? True Let d = -25919 - -42103. Does 23 divide 2/11 + d/44? True Let s = -299 + 143. Does 5 divide (s/(-30))/((-1)/(-25))? True Does 54 divide -5840(2/(-7))/((-120)/(-210))? False Let g(f) = -3f*3 + 5f*	{ "pile_set_name": "DM Mathematics" }
for r. -2 Let r be (-2)/(-4) + 15/10. Let l be (4 - (-9)/(-3))r. Solve -z + 0z - l = 0 for z. -2 Let o(h) be the first derivative of 3h2/2 - 12h - 8. Let p be o(5). Let y(x) = 2x2 + 3x + 3. Let n be y(-3). Solve -6r + pr - n = 0 for r. -4 Let d = 34 - 30. Solve 6 + 14 = -do for o. -5 Let k = -1 + 3. Solve kt = -3 - 1 for t. -2 Suppose -5l - 3i = -7, -5l + 3i + 14 - 1 = 0. Solve 6f - lf + 16 = 0 for f. -4 Suppose -3f + 12 + 6 = 0. Solve -5r + f - 1 = 0 for r. 1 Suppose -3z - x - 3 = -15, -3x = 9. Solve z = -2y + 3 for y. -1 Suppose 89o = 90o - 1. Solve -r = -o - 2 for r. 3 Let b be 84/(-48)(-7 - 1). Solve -39 = 5f - b for f. -5 Let g(s) = -2s*2 + 10s + 6. Let n be g(5). Solve 9 = -np + 3p for p. -3 Suppose 3y - 10 = 23. Let r = -16 + y. Let m = -5 - r. Solve m = 5f - 5 - 5 for f. 2 Let p = 14 - 6. Let y be 6 - 6 - p/(-2). Solve -2s + 4 = -ys for s. -2 Let a(m) = -m*2 - 4m - 3. Suppose -3y = -2y + 3o + 12, -4o = 12. Let w be a(y). Solve 2c - 5c = w for c. 0 Suppose 0 = 2l + 3z - 15, -5l = -z - 12 - 0. Solve 6 + l = -3k for k. -3 Suppose 3 = 2u + 3a + 5, 13 = 5u + 3a. Suppose 0 = 3y + 2f - 13, y - 5y = f - 14. Solve -4q + yq = u for q. -5 Let o be (0 + 0)(-2 - -3)/1. Solve -2b - 6 = -ob for b. -3 Suppose -4m - 5 = -5m. Let f(s) = s*2 + 6s - 9. Let u be f(-7). Let i = m + u. Solve -3p + 0 + i = 0 for p. 1 Suppose 34 = 2c + 5a, 2a - 22 = -2c - 0c. Let q = c - 4. Suppose -z = qb + 2z - 30, 2b - 5z - 13 = 0. Solve 3u = -3 - b for u. -4 Suppose 0 = -0j + j - 5. Solve -6x = -x + j for x. -1 Let o be 6 - (-7 - -5 - -4). Solve -ox + 10 = -2x for x. 5 Suppose 4h = -2d + 18, -3d + 18 = 3h - 0h. Let m(r) = -7r + 5r*3 + 1 + 5 - 6r*h + 7r*2. Let y be m(6). Solve y = -7n + 3n for n. 0 Let a = -183 - -186. Solve 0 = -ak + 4 - 7 for k. -1 Let y = -47 - -47. Solve -2v + 5v - 3 = y for v. 1 Let v(i) = -i3 - i2 + 5i + 5. Let s be v(-3). Solve 3p = sp + 5 for p. -1 Let x(d) = -d2 + 1. Let n be x(1). Let w be (1/(-3))/(1/(-9)). Let k(i) = -i2 - 7i - 7. Let q be k(-5). Solve nh + q = wh for h. 1 Suppose -5u + 60 = -u. Let f be -23/(-6)3. Suppose 0 = -5w - 0w - 25, u = 3v + fw. Solve -p - 4p = v for p. -2 Let c(f) be the second derivative of f4/12 - f2 + 2f. Let w be c(5). Suppose -2g + 5i + 0 = -w, -29 = -5g + 3i. Solve g + 0 = z for z. 4 Let k be (4/6)/((-1)/(-3)). Let g be 0 + 1 + (10 - 9). Let m = k - g. Solve m = -i + 1 - 0 for i. 1 Let k = 2 - -1. Solve 0 = -2l + kl for l. 0 Suppose 3c = 5c - 4. Suppose 3h = 15 + 15. Suppose -3a + h = -3p - 8, 3a - 22 = 4p. Solve -cl = al + 16 for l. -4 Let x(j) = j - 1. Let s be x(4). Let w = -7 - -9. Suppose 12 = q - 5y, 7q = 4q - wy + 2. Solve so = qo - 3 for o. -3 Let w(x) = -2x3 + 4x*2 - 2x. Suppose -3s = -3r + 2s - 19, -2s + 4 = -3r. Let b be w(r). Let v be (-8)/(2 + b)5. Solve -6n - v = -2n for n. -5 Let g(k) = -k*2 + 5k - 1. Let u be g(4). Let r be (-34)/170 + (-2)/(-10) + 12. Solve -v - uv = r for v. -3 Let n(w) = 5w - 15. Let l be n(5). Solve -l = 5g + 5 for g. -3 Let a be (-2)/(-12) + 2/(-12). Suppose h - 4h + 42 = a. Solve -h + 4 = -2v for v. 5 Let n = -8 - -12. Let f be (1/(-1))/((-3)/18). Suppose u + 10 = fu. Solve uh = n + 6 for h. 5 Let t = -92 - -96. Solve -u - 1 = -t for u. 3 Suppose -3s + r = -3, -2s - 3s + 2r = -6. Let q = s - -2. Solve 2h - q = 2 for h. 2 Suppose 2g = g + 10. Solve -h + g = h for h. 5 Let c(p) = p3 + 2p*2 + p + 3. Let f be c(-3). Let w be (-3)/(-6) - f/2. Solve 3a - 10 = w for a. 5 Let n(i) = 14i - 1. Suppose -2 + 0 = 2k. Let b be n(k). Let x = b + 25. Solve -4f + 10 = -x for f. 5 Let l be (-3 + 8)(-2)/5. Let u be (-24)/(-9)(-3)/l. Solve uj + 12 = j for j. -4 Let r(l) be the first derivative of -l*3/3 + 4l*2 + 1. Let y be r(8). Solve yk = -k + 4 for k. 4 Let z(f) be the first derivative of -f*2/2 + 9f + 1. Let c be z(-7). Solve c + 0 = 4i for i. 4 Let t = -6 - -10. Let h(i) = 2i - 6. Let w be h(6). Let a be (t/3)/(2/w). Solve -ar = r - 25 for r. 5 Suppose 20 = 4j - 4h, j - 3h + 0h = 11. Let b = 8 - 3. Solve 3 = jl - bl for l. -1 Let r(x) = x2 + 4x + 3. Let q be r(-4). Suppose s = -0s + q. Let p be 2 + (-1 + 7 - -1). Solve -3d + s = -p for d. 4 Let o = -32 + 32. Solve oz = -4z for z. 0 Let c be (-21)/(-35) + 44/10. Let p = 0 + c. Solve 0 = -4v + 11 + p for v. 4 Let p(g) = g2 - 3g. Let a be p(5). Suppose 0 = 2o - a - 2. Suppose -3x = -0x - o. Solve -4 = -u - x for u. 2 Let a = -10 + 15. Let y(n) = 5n*2 - 12n - 8. Let l(c) = 4c2 - 11c - 7. Let u(o) = ay(o) - 6l(o). Let s be u(-7). Solve -3j = -6j - s for j. -3 Let b = 6 + -3. Suppose 5 = -2s + bs. Suppose 5d + s = 80. Solve -d = -q - 4q for q. 3 Suppose -8 = 2w + 4o, o - 3o = 2w. Solve c - 3 = -w for c. -1 Let v(i) = 2i - 21. Let f be v(12). Solve y - fy + 10 = 0 for y. 5 Suppose 21 = 4y + 5. Solve -j - j = -y for j. 2 Suppose -4f + 0f - 16 = 0. Let t = f + 8. Solve 16 + t = -4k for k. -5 Suppose 0 = b - 6 - 0. Let r be (8/(-6))/((-2)/b). Suppose -ru = -t - 14, -3u + 5u = -4t - 2. Solve 0 = -0p - p - u for p. -3 Let j(a) = 3a*2 - 5a + 2. Let l be j(4). Suppose -2t - t = -x - l, x + 25 = 2t. Let u be -3-4x/(-9). Solve u = 4f + f for f. 4 Let g(s) = s3 - 4s*2 + s - 4. Suppose 4t - 21 = -5. Let i be g(t). Solve -16 = -iw - 4w for w. 4 Suppose 5l + 17 = -f + 3f, f - 13 = l. Let t be (0 + 6)/(2/5). Let q = -11 + t. Solve -qp = -0p - f for p. 4 Let k(n) = -n - 3. Let d be k(-7). Let l = -101 + 101. Solve -2f + l + d = 0 for f. 2 Let t(i) = i2 - i + 1. Let r be t(2). Suppose -r = x - 13. Solve 9k - 4k = -x for k. -2 Let v = -9 - -5. Let k(l) = l3 + 3l*2 - 4l + 3. Let i be k(v). Solve -3 = 3m + i for m. -2 Let c(t) = -t2 + 4t - 2. Let d be c(2). Suppose 0 = -4h + 2h - 3p + 17, -2p + 6 = 0. Suppose 3u - 47 = -17. Solve dr - hr = -u for r. 5 Let t be -12((-2 - -1) + 0). Suppose z = -3z - 4y - 16, 20 = -3z - 5y. Solve -3f + zf = -t for f. 4 Let z(o) = o3 - o2 + o - 2. Let b be z(2). Suppose 16 + 4 = -bp. Let r = 7 + p. Solve -rf = -5f + 15 for f. 5 Let r(n) = -4n*2 + 4n + 8. Let a(s) = -3s2 + 4s + 7. Let d(p) = 5a(p) - 4r(p). Let u be d(-5). Solve u = 3t - 1 for t. 3 Let d be (-1)/2 - (-11)/2. Suppose 4z - 25 = -t + 6, 0 = -2z - 3t + 23. Suppose 3r - z = 5. Solve 0 = -3j + rj - d for j. 5 Let i(x) = x + 4. Let q be (-1)/(0 + -2)-6. Let m be i(q). Solve 4 = -5k - m for k. -1 Suppose 0 = 2n - 3n - 4i + 11, 5i = -5n + 25. Let b be 1/3(n - -6). Suppose -3a = -bs - 9, s + 4a - 12 = 2a. Solve -sj + 1 = -3j for j. -1 Let t(o) = -3o*3 + 4o*3 - 1 + 3 + 0o*3. Let k be t(0). Solve r - 3 = -kr for r. 1 Suppose -3a - 2l = -5l - 9, -3a + l + 11 = 0. Solve a = 3f - 2 for f. 2 Let s be -1 - -81/2. Solve 2 = -h + sh for h. 1 Let o be (26 - -2)12/14. Let b = o - 21. Solve 2i = -b - 3 for i. -3 Suppose 3s = 5 - 2. Let b be (s/2)/((-4)/(-8)). Let q(g) = g*2 - 4g + 4. Let f be q(4). Solve -fd + b + 11 = 0 for d. 3 Let n(t) = 0 - 1 - 1 + 0 + t. Let v be n(7). Suppose -vw + 0w - 10 = 5k, 15 = -5w. Solve 3z = k + 2 for z. 1 Suppose 13i - 18 = 14i. Let r = i - -35. Solve 3 + r = 5l for l. 4 Let c = -15 + 8. Let y be 8 + c + 0/1. Solve -7 = 2o - y for o. -3 Let j(w) = w*3 + 5w*2 + w + 5. Let c be j(-5). Let p = -2 + 5. Suppose -pa - 1 = -4a. Solve -t + 6 - a = c for t. 5 Let q be (-15)/232/(-48). Solve -qg = 18 + 7 for g. -5 Let z(s) = 5s - 2. Let r(q) = -6q + 1. Let t(v) = -4r(v) - 5z(v). Let a be t(3). Solve 6c = 3c + a for c. 1 Suppose -33 = -4z - 5. Suppose -d = -5t + 14, -4t - 4d = -zd - 20. Suppose -5h + t = -23. Solve 4 - 9 = -hj for j. 1 Let b be 2(4 - 2)/1. Solve bx - 6x + 4 = 0 for x. 2 Suppose 5d = 5c - 30, d - 16 = -2c + 5d. Solve 0a + 20 = -ca for a. -5 Let l = 18 - 11. Suppose -16 = -2r - 2v + lv, -4 = 2v. Solve 0k = -rk for k. 0 Suppose 3h - 47 + 35 = 0. Solve s + h = -s for s. -2 Let s(u) = u + 8. Let r be s(-3). Solve -r = -5p - 0 for p. 1 Let h = -5 + 5. Solve 0 = -ho - o + 2 for o. 2 Let b(t) = -2t - 8. Let g be b(5). Let r be (7/21)/((-2)/g). Solve f = rf + 2 for f.	{ "pile_set_name": "DM Mathematics" }
(k) = -2k. Let z(p) = -31323p. What is z(n(u))? 62646u Let g(c) = 7c*2. Let m(k) = 19k. Calculate m(g(h)). 133h2 Let v be (-26)/(-7) - 6/(-21). Let o be (2 + (0 - 2))/((-1)/1). Let h(g) = -4 + og + g + v. Let x(k) = -k2. Determine h(x(i)). -i2 Let s(l) = -l. Let m(o) be the second derivative of 31o4/12 + 18o. Give m(s(d)). 31d2 Let q(a) = 23a. Let s(m) = -29m - 2. Give s(q(w)). -667w - 2 Let y(p) = 9p. Let i(k) = -9k. Calculate i(y(h)). -81h Let w(d) = 2d - 20d - 17d + 7d. Let x(f) = 3f*2. Determine x(w(g)). 2352g*2 Let r(z) = 4z. Let w(j) = 56j. Give r(w(u)). 224u Suppose 0 = -3t - u - 18, -4u = -2t - 0 - 12. Let d(s) = -2s - 7. Let r be d(t). Let h(l) = -r + 5 - 2l2. Let k(b) = -b. Calculate k(h(i)). 2i*2 Let b be (2 - 4)-12. Let g = -6 + 8. Let d(h) = 4 - b + 3h*g. Let l(f) = f. Determine d(l(j)). 3j*2 Let m(g) = 55g*2 - 2g. Let i(b) = -7b. What is i(m(x))? -385x*2 + 14x Let o(l) = -2l2. Let w(f) be the second derivative of f4/12 - 14f. Give w(o(x)). 4x4 Let q(x) = 2x. Let v(k) = -11769k. Determine v(q(i)). -23538i Let o be ((-2)/(-4))/((-1)/(-8)). Let v(a) = -4 + 3a + o. Let k(m) = -m2. Give k(v(s)). -9s*2 Let u(j) = -23j*2 - 9j*2 + 41j*2. Let l(x) = -2x*2. Give u(l(r)). 36r*4 Let g(b) = -86b. Let d(c) = 7c. Give g(d(l)). -602l Let q(i) = 2i2. Let p(u) = u. Let w(c) be the first derivative of -5c*2 + 5. Let o(k) = 12p(k) + w(k). Calculate q(o(v)). 8v2 Let p(l) = -2 + 60l*2 - 54l*2 + 2. Let c(r) = 2r. Determine c(p(o)). 12o2 Let u(n) be the third derivative of n4/24 + 27n*2. Let p(q) = -4q*2 + 2. Give u(p(a)). -4a*2 + 2 Let i(r) = -2r*2. Let m(q) = 11 - 3q - 11 + 7q. Give m(i(d)). -8d*2 Let a(q) = q. Let p(k) = 3k*2 + 31k + 36. Give p(a(v)). 3v2 + 31v + 36 Let o(z) = -5z. Let n(d) = 1211d*2 + 1. What is o(n(v))? -6055v*2 - 5 Let s(q) = 5q - 3q + q - 4q. Let g(a) = 76a2. What is g(s(p))? 76p2 Let p(r) be the third derivative of -r5/15 + 6r2 + 4. Let l(j) = 4j*2 + 0j + 0j. Determine l(p(f)). 64f*4 Let v(c) = 23 + 4c*2 - 2c*2 - 23. Let y(i) = -74i*2. What is y(v(h))? -296h*4 Let l(y) = 3y*2. Let b(n) = -38n*2. Give b(l(f)). -342f*4 Let l(a) = 15a2. Let s(v) = v2 - v + 1. Let z(c) = 5c2 - 6c + 6. Let j(f) = -6s(f) + z(f). Calculate j(l(o)). -225o*4 Let a(x) = -x. Let s(z) = 2z + 4331. Determine a(s(o)). -2o - 4331 Let z(a) = -93a*2. Let y(n) = -45n. Determine z(y(g)). -188325g2 Let h(c) = 7c*2 - 6c. Suppose -3v + 30 = -8v. Let t(y) = -20y2 + 17y. Let n(j) = vt(j) - 17h(j). Let z(a) = 5a2. Determine z(n(f)). 5f4 Let b(i) = i2. Let f(g) = 6g + 9. Let m(w) = w3 - 10w*2 - 12w + 9. Let x be m(11). Let r(k) = -k - 1. Let y(q) = xf(q) - 18r(q). Calculate y(b(z)). 6z2 Let d(s) = 3s. Let g(z) = -6z. Let j(m) = -7d(m) - 3g(m). Let t(u) = -4u. What is t(j(c))? 12c Let x(m) = -2m - 2 + 2. Let s(u) = 3u2 - 5u + 10u + 2u. Let r(d) = d*2 + 2d. Let y(z) = 7r(z) - 2s(z). Calculate x(y(f)). -2f2 Let y(i) be the third derivative of -i7/5040 - i5/20 - 2i*2. Let k(j) be the third derivative of y(j). Let r(v) = 2v*2. What is k(r(n))? -2n*2 Suppose 2 = -6w + 26. Let q(v) be the third derivative of -1/60v5 + 0 + 2v*2 + 0v*3 + 0v*w + 0v. Let l(z) = 2z2. Determine q(l(d)). -4d*4 Let f(r) = -74r. Let h(a) = -12a. What is h(f(w))? 888w Let w(y) be the second derivative of y4/12 + y2 + 7y. Let r(n) = -4n*2 - 7. Let h(z) = 2r(z) + 7w(z). Let v(s) = 9s*2. Calculate h(v(q)). -81q*4 Let l(i) = -i. Let z(u) = u - 1. Let k(s) = 3s*2 - 13s + 5. Let v(p) = -k(p) - 5z(p). Give v(l(f)). -3f*2 - 8f Let b(y) = -2y2. Let x(c) = -3c - 44. Give x(b(o)). 6o2 - 44 Let y(w) = -2w. Suppose -2x - 5r = 2, -9 = -3x - 2r - 1. Let n(s) = -3s. Let k(b) = xn(b) - 5y(b). Let p(f) = f2. Calculate p(k(a)). 4a*2 Let z(r) = -r + 1. Let p(f) = -6 + 0f + 3f + 3 - f. Let u(y) = -p(y) - 3z(y). Let g(m) = 15m2. Determine g(u(l)). 15l*2 Let v(x) = -7x*2. Let m(n) = 27n. Let t(p) = 11p. Let k(b) = -5m(b) + 12t(b). Determine k(v(q)). 21q*2 Let m(w) = 2w*2. Let x be (-2)/7 - 99/21. Let z(g) = g + 6. Let t be z(x). Let c(n) = -t - 3n*2 - 5 + 6. Determine m(c(j)). 18j*4 Let c(l) = 28l + 22. Let m(t) = -9t - 7. Let s(w) = -6c(w) - 20m(w). Let g(k) = -4k - 3. Let v(n) = 8g(n) + 3s(n). Let x(r) = -r. Calculate v(x(a)). -4a Let f(w) = -2w. Let h(s) = -121s. Determine f(h(x)). 242x Let y(x) = 11x. Let m(z) = -z2 + 3z*2 + 5z*2 - 3z*2. Give y(m(d)). 44d*2 Let n(d) = -2d*2. Let k(u) = -1194u. Calculate k(n(j)). 2388j2 Let w(m) = -4m. Suppose -3 = -4q + 5. Let s(z) = -z - qz + z + 4z. Give s(w(l)). -8l Let j(h) = -18h2. Let c(s) = -3s2 + 5. Let r(o) = o2 - 2. Let l(t) = 2c(t) + 5r(t). Give l(j(v)). -324v4 Suppose -2q + 3g + 61 = 3q, q - 5g - 21 = 0. Let s(d) = -3 + 3 + 6d*2 - qd*2. Let m(w) = -2w. What is s(m(p))? -20p2 Let w(s) = s2. Let h(d) be the second derivative of 5/3d*3 + 0d*2 + 5d + 0. Give w(h(z)). 100z2 Let w(h) = 10h. Let i(m) be the first derivative of 2m3/3 + 9. Calculate i(w(u)). 200u2 Let o(r) = -r2 + r + 4. Let y be o(0). Let b(d) = yd + 0 + 0 + 0. Let x(p) = -2p. What is b(x(g))? -8g Let c(k) = -8k*2. Let g(v) = -167 - 4v + 167. Calculate g(c(w)). 32w2 Let p(d) be the first derivative of -2d*3/3 - 7. Let y(m) = 2m*2. Determine p(y(f)). -8f*4 Let l(r) = -5r*2. Let f(z) = -2z*2 - 6z*2 + 11z*2. Determine l(f(h)). -45h*4 Let r(v) = 2v*2. Let c(g) be the second derivative of -23g*4/3 + 28g. What is c(r(q))? -368q4 Let y(q) = 2q. Let z(x) = -10x2 + 5x + 4. Let h(l) = -29l2 + 16l + 14. Let t(n) = -2h(n) + 7z(n). Calculate t(y(o)). -48o2 + 6o Let j(y) be the first derivative of -1/2y2 + 6 + 0y. Let z(m) = 2m2. Calculate z(j(v)). 2v2 Let i(m) be the third derivative of -m5/20 - 3m2. Let k(x) = -x. What is k(i(v))? 3v2 Let l(d) be the first derivative of -d2/2 + 1. Let n(s) = s - 1. Let f(r) = 1. Let y(v) = f(v) + n(v). Determine y(l(u)). -u Let h(r) be the first derivative of r*2 + 50. Let g(f) = 5f*2. Give g(h(n)). 20n*2 Let u(x) = 3x. Let d(s) = 17s. Let g(r) = -9r. Let i(f) = -2d(f) - 5g(f). Determine u(i(v)). 33v Let x(m) = 392m - 783m - 60m*2 + 391m. Let i(u) = 3u2. What is x(i(j))? -540j4 Let j(o) be the first derivative of o2 + 12. Let b(d) = 12d2. Calculate b(j(q)). 48q*2 Let m(b) = -2b*2. Let a(z) be the second derivative of 0z*3 + 0 - 11/12z*4 + 6z + 0z2. Give m(a(g)). -242g*4 Let z(p) be the second derivative of -7p*3/6 - 5p. Let m(s) = 2s2. Calculate m(z(j)). 98j*2 Suppose -2q = -4 - 0. Let p(i) = -2i - i + qi. Let s(r) = -r + 1. Let n(t) = 9t - 12. Let l(u) = n(u) + 12s(u). Determine p(l(d)). 3d Let c(f) = -f. Let i(p) = p - 1. Let v(g) = 8g*2 + 4g - 4. Let z(q) = 4i(q) - v(q). What is c(z(h))? 8h*2 Let g(p) = 7p*2 - 6p - 6. Let y(h) = 13h2 - 11h - 11. Let q(t) = 11g(t) - 6y(t). Let j(x) = -9x2. Determine q(j(r)). -81r*4 Let d(g) = -g - 147. Let f(y) = 3y*2. Give d(f(b)). -3b*2 - 147 Let d(f) be the second derivative of -2f*3/3 + 62f. Let u(k) be the first derivative of -k*2 - 1. Determine d(u(a)). 8a Let u(l) be the second derivative of 1/2l3 + 2l + 0l2 + 0. Let h(i) = -2i - i + 2i. Determine h(u(c)). -3c Let x(o) = -1. Let h(u) = 68. Let y(n) = -n*2 - 1. Let t(w) = h(w) - 17y(w). Let m(c) = -t(c) - 85x(c). Let q(i) = 2i. What is q(m(v))? -34v2 Let b(k) be the second derivative of -k + 0 + 0k*3 - 1/12k*4 + 0k2. Let m(y) be the first derivative of -y3/3 - 4. Calculate b(m(r)). -r*4 Let h(u) = -5u. Suppose 0 = 5v - 10v - 5. Let c(j) = j*2 - 1. Let x(y) = -4y*2 + 3. Let s(i) = vx(i) - 3c(i). What is s(h(a))? 25a*2 Let o(t) = t. Let g be o(4). Let z(s) = -2s - 4s + s + gs. Let f(l) = 4l - 5. Let b(h) = 3h - 4. Let x(v) = -5b(v) + 4f(v). Determine x(z(r)). -r Let a(p) be the first derivative of -p*5/60 + 4p*3/3 - 8. Let s(m) be the third derivative of a(m). Let h(b) = 10b*2. Calculate h(s(i)). 40i**2 Let m	{ "pile_set_name": "DM Mathematics" }
2. 10sqrt(7)/3 + 252 Simplify (-1sqrt(324) - sqrt(288)/sqrt(128))/(5(sqrt(12) + sqrt(60)/sqrt(5)1 - -3sqrt(60)/sqrt(5))). -13sqrt(3)/100 Simplify 33(-4 + 5(-4 + sqrt(605)2 + sqrt(605) + sqrt(605) + sqrt(605))2 + 0)-6. -4087854 + 118800sqrt(5) Simplify (3sqrt(133)2)/(sqrt(567) - (sqrt(567) + (sqrt(567) + -2sqrt(567) - sqrt(567)))) + -1(-3 + 51sqrt(684))2. -17109 + 541sqrt(19)/3 Simplify -4 + (0 + sqrt(363))*2 + -4 + (-3sqrt(3))*2 + -5 + 5 + -4 + -1. 377 Simplify -65(-1sqrt(475) + -3 + sqrt(133)/(sqrt(7) + sqrt(21)/(sqrt(15)/sqrt(5)) - sqrt(7))). 90 + 120sqrt(19) Simplify (2(-2(1 + sqrt(1100) + 1 + -3) + 4(sqrt(891) + 0 + sqrt(891) - (sqrt(11)-1 + 0)) + 3))2. 2240sqrt(11) + 138084 Simplify 6(-4 + -4 + sqrt(1584) + sqrt(1584) + (sqrt(1584) + sqrt(1584) + -1sqrt(1584))6 + sqrt(1584) + (2 + sqrt(1584))-6 + 0 + 1)*2. -8208sqrt(11) + 87702 Simplify (5 + -6(-4(sqrt(1539) + -3) + sqrt(1539) + 0 + 2 + (sqrt(1539) + -5)-1))2. -47088sqrt(19) + 898345 Simplify ((sqrt(180) + 0 + sqrt(180) - sqrt(180))-2)2 + sqrt(180) + 1 + 0 - (sqrt(50)/(sqrt(10)4) - (-5(sqrt(80) + sqrt(5)))2). 23sqrt(5)/4 + 3846 Simplify (sqrt(4400) + 4-2sqrt(4400) - (sqrt(4400)-15 + sqrt(4400)))/(sqrt(144)-2-6 + (11sqrt(144) - sqrt(144))). -5sqrt(11)/12 Simplify (-4sqrt(350)5)/((sqrt(252) + sqrt(252) + -5sqrt(252) + sqrt(252) - sqrt(252) - sqrt(28))/sqrt(4)). 10sqrt(2) Simplify -2(((-2sqrt(468))22 - (sqrt(468) - (5 + sqrt(468) + 1))*2) + -2 + sqrt(468) + -2 + -4). -7400 - 12sqrt(13) Simplify -4((sqrt(28)/(sqrt(8)/sqrt(4)) - -2sqrt(14)-1)/(-3sqrt(32)-2))2. -7/144 Simplify ((-6(sqrt(612) + -3) + 4 - (-1 + sqrt(612) + -2 + sqrt(612) - (sqrt(612) - (sqrt(612) + 1sqrt(612) + 5)))) + -2)2. -1944sqrt(17) + 49896 Simplify ((-62sqrt(3300)2)/(-1sqrt(3)-3 + sqrt(21)/(sqrt(7)-4)))*2. 921600/11 Simplify ((-5 + 2(-3 + sqrt(171)/(-2sqrt(9)))2)3)2 + 2. 612sqrt(19) + 3287 Simplify -5 + -1sqrt(2673)/sqrt(3) - (sqrt(22)/(5sqrt(2)) - sqrt(396)-1). -76sqrt(11)/5 - 5 Simplify (-5 + 2(-3 + -6((1 + sqrt(80))-2 - sqrt(80) - sqrt(80)))6)*2. 237312sqrt(5) + 6646129 Simplify -1(4sqrt(1700) + -4 - (-2sqrt(1088) + -5))2. -53313 - 112sqrt(17) Simplify -1((2 + sqrt(108) + 1)-6 + (sqrt(9)/sqrt(3) + -4 - (2sqrt(3) + -3)) + 4) + 1. 16 + 37sqrt(3) Simplify (1 + 2(sqrt(35)/(2sqrt(5)))*2 - ((sqrt(56)/(sqrt(8)3))*2 - (-5 + (-3sqrt(7))*2))) + -4. 1039/18 Simplify ((2sqrt(1584) + 3 - sqrt(1584)) + 1sqrt(1584)2 + 1)*2 - ((sqrt(132) + (sqrt(132)2-6 - sqrt(132)))/sqrt(12) + 5)5. 348sqrt(11) + 14247 Simplify (3 + (-5(-2 + 1 + sqrt(833) - sqrt(833)) - ((2sqrt(833) - sqrt(833))4 - (2 + (sqrt(833) - 1sqrt(833)) + sqrt(833) - sqrt(833)))))2. -560sqrt(17) + 13428 Simplify (-1(-6-1sqrt(425) - sqrt(425) - -5-1sqrt(425) - (-2sqrt(425) + 4 + -5))-2 + 3)2. 200sqrt(17) + 6825 Simplify (((-1(sqrt(144) - (sqrt(144) - (sqrt(144) + -2sqrt(144)))) - sqrt(144))3)/(sqrt(18)/(sqrt(6) - sqrt(750)/sqrt(5))))2. 0 Simplify 5(-5 + 4 + (-2sqrt(1008))2) - (4 + (42sqrt(70))/sqrt(10))4. -32sqrt(7) + 20139 Simplify ((-5((sqrt(13)-5 - sqrt(13)) + -2) + 0 - (-3 + (5sqrt(832) - sqrt(832)) + -4))2)2. -272sqrt(13) + 1364 Simplify -1(((sqrt(17) + (sqrt(17) + 0 - sqrt(17)) + -4)2 + -5sqrt(2057)-1)2)2. -221188 + 3648sqrt(17) Simplify -4(-3(sqrt(4) + (sqrt(4) - sqrt(144)/sqrt(9)) + sqrt(4))-4)/(sqrt(18)/(sqrt(36)/sqrt(4)) - (sqrt(162) + (3sqrt(162) - sqrt(162)))). 24sqrt(2)/13 Simplify -1((sqrt(275)2)2 + sqrt(275) + 2 + 1 + -2sqrt(275)) + -5 + 1 + (3 + (sqrt(275) - (sqrt(275) + -4sqrt(275)1)*2 - sqrt(275)))2. -6051 + 5sqrt(11) Simplify (5sqrt(132)/sqrt(6) - (sqrt(198) + (sqrt(198) - 3sqrt(198)))/sqrt(9))/((sqrt(96)/sqrt(3) - sqrt(2) - sqrt(2)) + (sqrt(72)/sqrt(3))/sqrt(12)). 2sqrt(11) Simplify (34(sqrt(192) - sqrt(192)3)-3 + (sqrt(192) - sqrt(192)43) + sqrt(192) + (sqrt(192)-4 - sqrt(192))-4 + sqrt(192))*2. 1322688 Simplify ((sqrt(84)-1)/sqrt(12) + (((sqrt(84)1)/sqrt(12))2 - sqrt(7)) - 1((1 + sqrt(112) + sqrt(112))*2 + sqrt(7))) + 2. -440 - 19sqrt(7) Simplify ((-1sqrt(84))/sqrt(12) + sqrt(7) + 5 + 4 + (sqrt(42)/sqrt(6)-5 + 4)-5)2. -550sqrt(7) + 4496 Simplify (-2(4(sqrt(363) + (-2 + 1 + sqrt(363) + sqrt(363) - sqrt(363))) + -4(-2 + sqrt(363))-5))*2. -108416sqrt(3) + 1146112 Simplify ((0 + sqrt(12)/sqrt(4) - sqrt(3)) + 2 + -6(sqrt(3) + 1 - sqrt(3)) + 2 - ((sqrt(36) - (sqrt(900) + sqrt(36)))-4)/((sqrt(120)-3)/sqrt(10)))2. -80sqrt(3)/3 + 412/3 Simplify -2(1 + (sqrt(180) - 2sqrt(180))) - (sqrt(810)-1)/(sqrt(8)/sqrt(4)2). -2 + 33sqrt(5)/2 Simplify (5sqrt(5)2 + -5)3 + (sqrt(60)/sqrt(48) + -4)-2. -7 + 29sqrt(5) Simplify -2(-6((sqrt(189) + -2sqrt(189) + sqrt(189))3 - sqrt(189)))/(sqrt(35)/(-6sqrt(80)))5. 4320sqrt(3) Simplify ((-6-2sqrt(136)-3)/((sqrt(8) - (2sqrt(72) + sqrt(72) + sqrt(72))/sqrt(9)) + sqrt(800)-1 + sqrt(800))5)2. 61200 Simplify (4-2sqrt(17)1 - (-1 + -3 + sqrt(153)))*2 - (((sqrt(17) + 1)-2)2 + (sqrt(833) + 0)2)1. -96sqrt(17) + 1168 Simplify (2-343-3(0 + sqrt(1584) + sqrt(1584))565)*2. 6651279360000 Simplify ((((sqrt(180) + (1sqrt(180) - sqrt(180)) + sqrt(180))/sqrt(10))/(2sqrt(900)) - (0 + sqrt(16)/(sqrt(24)/sqrt(3)))5)4)2. 19208/25 Simplify ((1sqrt(84)3-6)/(sqrt(12)15 - sqrt(48)/sqrt(4)1))2. 567/4 Simplify (5 + sqrt(304) + 4)2 - (2 + -2 + sqrt(304) + sqrt(304))2 - (2 + 3(1 + sqrt(304) + 2)). -842 + 60sqrt(19) Simplify 5 + -1 + -4((-1 + sqrt(448)1 + 4)-3)*2. -16448 - 1728sqrt(7) Simplify ((5sqrt(7)-3-4 - (sqrt(7)-3 + sqrt(7) + 3)-1)-6)*2 + -5. 12528sqrt(7) + 848047 Simplify -5((2 + sqrt(80) + sqrt(5) + (sqrt(5) - ((sqrt(25)/sqrt(5))2 + -4)) - (sqrt(30)/(sqrt(216)/sqrt(4)) + 1)) + -1). -85sqrt(5)/3 + 5 Simplify ((sqrt(63)-2-6 - sqrt(63) - sqrt(441)/(sqrt(7)6)) + sqrt(378)/(sqrt(726)6)-4)2. 3538647/484 Simplify ((-6sqrt(76) - sqrt(76))4-3)/(sqrt(24)/sqrt(6)1 - (-3sqrt(324) - sqrt(324))). 84sqrt(19)/37 Simplify -2((5 + -2 + sqrt(117) - sqrt(117))2 - ((sqrt(117))2 + -3 + 0 + sqrt(1300)))-2. -420 - 40sqrt(13) Simplify ((4-1sqrt(9) + (sqrt(9) - (sqrt(9) + sqrt(81)))-6 + sqrt(9))1)/(3sqrt(15)/sqrt(5) + sqrt(3) + (sqrt(300) - (sqrt(300)3 - sqrt(300)))). -5sqrt(3)/2 Simplify 43((sqrt(110)/sqrt(2))/sqrt(11))2-6 + ((sqrt(720) + sqrt(720) + 1sqrt(720) + sqrt(720) + sqrt(720) + 3 - sqrt(720)) + -1(-3 + sqrt(720)))*2. 432sqrt(5) + 6156 Simplify (2 + ((3 + sqrt(171))-6 - sqrt(171)) - (sqrt(171) - (sqrt(171) - (sqrt(171) + sqrt(171)1-6)) - ((0 + sqrt(171) - sqrt(171))4 + sqrt(171))))*2 + 3. 96sqrt(19) + 430 Simplify 4 + ((65sqrt(85) - sqrt(85)) + sqrt(85))/(sqrt(180)3 - sqrt(5))-1. -30sqrt(17)/17 + 4 Simplify ((1 + 4(sqrt(588) - (0 + sqrt(588))) + (2sqrt(588) + 1 + sqrt(588))5)3 + 5)2. 28980sqrt(3) + 1191229 Simplify (-2 + -3((1sqrt(704) - sqrt(704))3 + ((sqrt(704) - (sqrt(704)4 - sqrt(704))) + -1)*2 + sqrt(704))-5)4. 2400sqrt(11) + 169012 Simplify -4 + sqrt(108) + 1 + 5 + -2 + -5((1 + sqrt(108))2-4 + sqrt(108))-6 + -4. -13084 - 1254sqrt(3) Simplify 1((-1 + -1sqrt(1331)6 - (0 + 3(sqrt(1331) + 1 - sqrt(1331)))) + 5)*2 + 2. -132sqrt(11) + 47919 Simplify 1 + (5((sqrt(605) + (sqrt(605) - (-2 + sqrt(605) + -5)) - sqrt(605)) + sqrt(605) + -2 + sqrt(605) + -2) + 4 + 1)2. 4400sqrt(5) + 60901 Simplify (-1 + 0 + sqrt(125) + 1 + -1 + 4(sqrt(125) + 0) + sqrt(125) + sqrt(125) + -6(1 + sqrt(125)))*2. -70sqrt(5) + 174 Simplify (-2(sqrt(104) + (sqrt(104) - 32sqrt(104)) + sqrt(104) - -2sqrt(104)-2)/(-2-2sqrt(800)))21 + 3. 1837/400 Simplify 6((sqrt(190) - sqrt(190)-24 - sqrt(190))/((sqrt(30) + 1sqrt(30))/sqrt(3)) - ((2 + -1 + sqrt(19))*2 + 3 + 1)). -144 + 12sqrt(19) Simplify (-5(sqrt(468)-1 + sqrt(468) + sqrt(468) - sqrt(468)) + -4 + -3 + -1 + -6(2 + sqrt(468) + 1) + -2)2. 2016sqrt(13) + 17632 Simplify 6(((6sqrt(209)-3 + sqrt(209) + sqrt(209))-5)/(-4-3sqrt(11)3) + 0). 40sqrt(19)/3 Simplify 1(-1 + -1sqrt(1300))*2 + (0 + (sqrt(104)/(sqrt(4)-2))/sqrt(2))*2. 20sqrt(13) + 5217/4 Simplify 4((2 + sqrt(1539) + 1 + sqrt(1539) - sqrt(1539))6 + (2*sqrt(2736) - sqrt(133)/(sqr	{ "pile_set_name": "DM Mathematics" }
= -12 + 15. Suppose 5g = -4v + d, 3g - 6g = -2v + 7. Solve 4x - v = y - 0y, -5y + 5x = -5 for y. 2 Let j be ((-1)/2)/(1/(-6)). Let u = j + -1. Let p be (1460/(-300) + 5)(1 - 6)-9. Solve -5 = uk + b, 4b + p = -3k - 4 for k. -2 Suppose -w + 27 = 3n + 12, -4n - 4w + 12 = 0. Solve b - 2 = 0, -z + n = -4b + 8b for z. -2 Let o be (-58)/21 - 2. Let y = -24 - o. Solve -10 = 5h - 2n, -2h + n = h + y for h. -4 Let b(u) = -2u + 30. Let q be b(14). Suppose 0t = t - q. Solve 0 = -5m - v - 20, 6m + tv = m - 15 for m. -5 Suppose -195 = -p - 4p. Let w = p + -31. Solve 2o = -o - 4i - 1, 2i = -w for o. 5 Let f be 10(36/30)/3. Let x = 5 - 5. Solve -fg = -xg + 5u - 11, 2g - 13 = 5u for g. 4 Let g(m) = m*2 - 20m + 46. Let j be g(18). Solve 3p - 2u = 6, -10 = -2p - 4u + j for p. 4 Let n(b) be the second derivative of -b*5/20 - 23b4/12 + b3/6 + 27b2/2 + 34b. Let y be n(-23). Solve 4q - 4x + 24 = 0, 22 = -5q + x + y for q. -3 Suppose -5 - 15 = -5q. Suppose -y - 7 = -5z, -11 = -28z + 24z - y. Solve 3u - 3 = -3h, -zh - qu + 17 = u for h. -4 Let t(w) = -3w - 21. Let k be t(-9). Suppose -3 = -3g + k. Solve 0 = -gm + 3z + 24, -5m + 0z + 2z + 31 = 0 for m. 5 Suppose -8d + 21 = -11. Let a(o) = o + 7. Let b be a(d). Solve -h + 0w - 10 = -3w, -5w = 4h - b for h. -1 Suppose -4 = -0g - 2g + x, -2g - 3x + 20 = 0. Suppose 2t = -1 - 7, -v = -t - g. Suppose vs - 2s = -2. Solve 3a + 19 = -5z, 3z = -2a + 2z - s for a. 2 Let d be 396/(-110)10/(-6). Solve 3u + 2p + 0 = -d, -3u + 2p = -6 for u. 0 Let o(t) = 2t2 - 44t + 149. Let i be o(18). Solve -5q + 2r - 8 = -28, r = -i for q. 2 Let a(l) be the first derivative of l*3/3 + 10l*2 + 40l + 29. Let i be a(-18). Solve -w + 3 = 2j - 9, -ij - 4w = -32 for j. 4 Suppose 2o = -13o + 15. Solve 3g + k = o, 5g + 5 = 5k - 0k for g. 0 Let p be (-4)/12(1 + -1). Suppose p = -5k + k - 24. Let s be -1 + ((-12)/4 - k). Solve 30 = sf + f - 3v, f = -3v - 10 for f. 5 Suppose 0 = -17i + 15i + 5n + 21, 0 = -5n - 15. Solve -4t - 4s + i = -9, t = -3s + 11 for t. -1 Let g be (6 - 133/21)-9. Solve -5d + ga = -a - 4, 2d - 2a = 0 for d. 4 Let b be (26/10)/((-2)/(-10)). Let x = b - 9. Let r = -2 + 4. Solve r = -2o - 5j - x, 2j = -4 for o. 2 Let a = 52 - 48. Solve au = -2q + 16, 2u - 16 = 3q - 0q for u. 5 Suppose 4z = 20, -2l + 5l + z - 14 = 0. Solve 16 + 2 = -4o + 2p, -lo - 3p = 0 for o. -3 Let m = 401 + -398. Solve -2b + mj = 7, 5b + 10 = -3j + 8j for b. 1 Let d = -2 + 4. Suppose -g + d = -0. Solve -3c + 4z = -29, -4c + gz = -3c - 13 for c. 3 Suppose -2n + 5c = c - 162, 3 = c. Let i = n - 84. Solve 0 = -2m - 3y - 11, im + y - 2y = 0 for m. -1 Suppose -3x + 8 = -7x. Let k(q) = 5q + 14. Let s be k(x). Solve 12 = sg + 3y - 8, 4y + 10 = 2g for g. 5 Let z be 10/35 - (-1)/((-14)/(-38)). Solve -5g - 2x + 25 = 3x, -2g + zx = -10 for g. 5 Let s(d) = 7d - 14. Let j be s(2). Suppose 4w + 16 = -jk - 4k, 2k = 5w - 15. Solve -w - 1 = h, -u = -4h - 4 for u. -4 Let f = -8 - -14. Suppose -37 = 10w - 67. Solve -f = 3u - 3t, -wt - 1 = u + 3u for u. -1 Suppose -4l = w - 14, -4w - 13 = -5l - 3w. Let j be 3/(-18)l + 54/4. Solve -r - j = -5c - 0r, 3c = -4r + 17 for c. 3 Suppose 0 = 4d - 2r - 42, -2d - 4r = -4d + 36. Let i = 6 + d. Solve 0 = 3h - 3f - 9, -2f + 0f = 3h - i for h. 4 Let u be 40/(-25) + 19/(-20)-8. Solve u = -9b + 7b, 5b + 15 = -4j for j. 0 Let n(y) = 2y + 12. Suppose 0z + 3z + 24 = 0. Let g be n(z). Let s be 9 - (-6)/g-2. Solve i - 20 = -3i, -2i + s = -2j for j. -1 Suppose 12i + 3t = 11i + 17, -5i + 5t + 5 = 0. Solve iv - 5m + 1 - 36 = 0, -m - 1 = v for v. 3 Suppose 5a = -a - a. Suppose -4k = -5x - 6, -3k + 10 = -x - ax. Solve kj = -5u + 2 - 0, u = -2j - 2 for u. 2 Let w = -38 + 58. Suppose 5v - 2k = 13, 3v + 2k - w = -9. Solve 2p - 3b - 1 = -6b, v = 3b for p. -1 Let p(l) = -l2 + 29l - 136. Let x be p(6). Solve 5u + 2 = -xm, -4u = -3m - 6 + 3 for m. -1 Let c be 2 + (-56)/30 - 146/(-30). Solve 3o = 5g + 26, -cg - 3o = -2o + 18 for g. -4 Let g(o) = -o. Let p be g(-4). Let z be p/(-5)(-70)/4. Let w = 20 - z. Solve -n = 3, -m + w = -0n - 3n for m. -3 Let y(b) = b*3 + 5b*2 + 7b + 50. Let d be y(-5). Solve 17 = 2z + 3k, -4z - 3k + 4 = -d for z. 1 Let t(l) = -l*3 + 15l*2 + 15l + 23. Let m be (16/12)/((-1)/(-12)). Let w be t(m). Let y be (4/10)/(w/70). Solve -4q + a + y = 0, q - 3q + 4a = -16 for q. 0 Let f be (-3)/(-81) - (-4960)/1674. Suppose 2x = 5g + 10, 2g = -0g - 4x + 20. Solve q - fh + 18 = 4q, -2h + 8 = g for q. 2 Let o be (-4)/2-42 + 0. Suppose -t + 0a - a + 6 = 0, -3a = 2t - o. Solve 4z - 2 = 5b, -tb + 0 = -4z - 4 for b. -2 Suppose 0 = -11k - 125 - 469. Suppose 447 = 5j + 4c, 0j + 176 = 2j + 3c. Let x = j + k. Solve -5o = 3z - x, -2z = 2z - 5o + 9 for z. 4 Suppose -4 + 10 = 3s. Solve -2p + 2 = 2u, p + 3u - 3 + s = 0 for p. 1 Suppose -4g = -9g + 90. Let v = g + -18. Suppose 0f + 5f - 80 = v. Solve -4q + 3q = -s + 7, -s = -4q - f for s. 4 Let s be (24/18)/((-4)/(-6)) - -1. Solve 4p + 0k = -k - 8, 0 = -p + k + s for p. -1 Let s(k) = -k*2 - 13k - 35. Let h(g) = -4g2 - 8g - 9. Let p be h(-2). Let y be s(p). Solve 2n + 19 = -3r, -n + r - 3 = -y for n. -5 Let g(q) = -2q. Let w(x) = -x2 - x. Let i be w(-2). Let k be g(i). Solve -kz + 5n = -19, 3z + 0n = -4n - 9 for z. 1 Let f = 177 - 174. Solve -5x + 8g - 5 = 3g, 0 = -x + 5g + f for x. -2 Let f(o) = -o*2 + 10o - 1. Let r be f(7). Let g = 27 - r. Solve 4n - 4u = -12, -2n - 2u = 3 + g for n. -4 Suppose -5m - 4l = -105, 2m + 3l = l + 42. Solve 6k - m = -5f + 3k, 0 = 5f - k - 13 for f. 3 Let c = 35 - 43. Let p be ((54/15)/3)/(c/(-20)). Solve -z - 4y + 15 = 0, y + 12 = pz + 2y for z. 3 Let q be 1 + (28/(-7) - (-1 + -2)). Solve u + qo = o + 3, -2u + 5o = -6 for u. 3 Suppose -15k = -213 + 33. Solve 3g = -4s + 8 + k, s - 5 = -5g for g. 0 Let c be (-8)/36 + ((-94)/(-18))/1. Suppose 3y = -cg + 25, 0 = -2g - 2y + 3 + 11. Solve 0 = 2z + 2z - gu - 4, -u = 2z - 2 for z. 1 Let b = 548 - 543. Let m = 10 + -5. Solve bn - 35 = 5k, 2k + 3n - 2n = -m for k. -4 Let p = -5 - -3. Let y be (-2)/(-4) - p/(-4). Suppose 21d = 13d + 40. Solve dw - 3u + 2 - 8 = y, 4w - 3u - 6 = 0 for w. 0 Let q(t) = 23 + 3t - 5t - 9 + 3t. Let u be q(-8). Solve -4w - 2z = u, 3z = 3w - 0w for w. -1 Suppose -2p - 29 = -5c - 89, 0 = -c + 5p + 11. Let s be (-2 - -5) + 7/(c/(-4)). Solve 0t - 20 = st, 2o + t + 2 = 0 for o. 1 Let y(w) = -w3 - 9w*2 - 14w + 6. Let j be y(-7). Solve -5b - 4q = -j, 2q + 3q - 10 = -5b for b. -2 Suppose 2z + 24 = -0z. Let u be (z/(-36))/((-1)/(-9)). Solve ul + a + 3a = 27, 3l - a = 12 for l. 5 Let r(l) = -l*3 + 7l*2 - 10l + 26. Let w be r(6). Suppose 0 = -wp - 5p + 140. Solve -d - 3d + p = -5k, k - d = -4 for k. -4 Let z = -4 - -4. Solve -5n - a - 12 = z, -n + 15 = -4n + 2a for n. -3 Suppose r = 5p + 23, p = 3r + 5p + 7. Let w be r14/6 + -2. Solve -l - 2 = 0, wl - 4l = -4s - 22 for s. -5 Let r = 41 - 19. Let j(h) = -28h + 47. Let o be j(-4). Let c = o - 154. Solve -2l = 3m + r, cl - 7 + 32 = 0 for m. -4 Let o(k) = -4k + 1. Let x be o(-3). Solve -9 = 4r - r, 3r + x = l for l. 4 Let n be 10/(-65) - 10/(-65). Solve 4c + 2u = -20, -c + 5c - 5u + 6 = n for c. -4 Let y = -34 - -46. Let o be 3/y + 417/12. Let m be (-7)/o + (-11)/(-5). Solve -u - 24 = 3x + mu, -5u = 15 for x. -5 Let v be -1((-4)/1)/2 - -1. Solve -24 = -5g + 4z, vg + 0g = z + 13 for g. 4 Suppose 15n = 11n + 12. Solve -5b + b = 4, -nm - 5 = -b for m. -2 Let z(k) = k3 - 9k*2 + 3. Let p be z(9). Solve -g - b = -p, b - 2 = -3 for g. 4 Let w be (3/(-6))/(2/(-12)). Suppose -4d = -n + 15 + 1, -d - w = 0. Solve -3y - 2 = 3v + 1, 5v = 4y + n for v. 0 Let b be -2((-987)/294 - (-6)/7). Solve -2o - o = -5w + 35, bo = -5w - 5 for w. 4 Let b = 92 + 2. Let c be -1 - b/(-18) - 56/252. Let x be (-1)/2 + 87/6. Solve -y = 7h - 3h - 1, -2h + x = -cy for y. -3 Suppose -4a - 20 = -14a. Solve x + 5v - 3 = a, -2v + 25 = 5x for x. 5 Suppose 0 = 3s - 2s + 4*i	{ "pile_set_name": "DM Mathematics" }
tors of 65 + (-3 - b)v? 2, 17 Let r = -6 + 12. Let j = -3 - r. List the prime factors of ((-4)/3)/1j. 2, 3 Let i(k) = -k*3 - 6k*2 + k + 9. Suppose -6l = -6 + 42. What are the prime factors of i(l)? 3 Suppose 0j - 5j + 6795 = -4x, 2x - 1373 = -j. List the prime factors of j. 29, 47 Let f = 154 + -88. Let u be f/912/(-8). List the prime factors of -3 - ((1 - -2) + u). 5 Suppose -3r + 2c = -2c + 14, -c + 15 = 5r. Suppose -d - z - rz + 3 = 0, d + 5z = 3. What are the prime factors of 19 - ((-3)/d - -4)? 2 Let t be 6/((16/684)/2). Suppose t = -d + 10d. What are the prime factors of d? 3, 19 Suppose d + 120 = 43. Let j = -34 - d. What are the prime factors of j? 43 Let o be (5/((-140)/(-8)))/(2/14). Suppose 0 = 5m - om - 390. What are the prime factors of m? 2, 5, 13 Suppose -z + 4v = z - 62, -5v = -z + 16. Suppose 6 = -2q, -170 = -3h - 3q - z. What are the prime factors of h? 2, 23 List the prime factors of 29926/12 + (1 - (-10)/(-12)). 2, 29, 43 Suppose -284 = -3q + 97. Let o = q + -81. List the prime factors of o. 2, 23 Let q(o) be the first derivative of 29o3/3 + o2/2 + o + 9. List the prime factors of q(-1). 29 Suppose -3g = 2l + 6, -3 = l - 0g - 2g. Let h(k) = k3 + 4k*2 + 2k + 1. Let o be h(l). Let p = o + 57. List the prime factors of p. 61 Suppose 0 = 3r + 3t - 3111, 18r = 17r - 2t + 1035. What are the prime factors of r? 1039 Suppose -1624 - 58 = -2k. List the prime factors of k. 29 Let p be -2 + 3 + (-194)/(-1). Suppose 0 = -w + 4w - p. What are the prime factors of w? 5, 13 Let v = -4 + 6. Let m be (v/(-6))/(3/(-36)). Suppose -w = -mw + 93. List the prime factors of w. 31 Let f be 58/(-12) - 7/42. What are the prime factors of (-6)/(-15) - 493/f? 3, 11 What are the prime factors of ((-396)/30)/((-21)/1610)? 2, 11, 23 List the prime factors of (-20)/(-50) + 2536/10. 2, 127 Suppose 8t - 6t = 0. Let x(c) = c*3 - c + 110. Let s be x(t). Suppose 9b = 4b + s. What are the prime factors of b? 2, 11 Suppose -522 = 22o - 46392. What are the prime factors of o? 3, 5, 139 Let i = -57 + 63. Suppose -2u + 3k + 108 = -15, 3u - 207 = -3k. What are the prime factors of i/(-3 - u/(-20))? 2, 5 Let b be (-3)/(-36)1414. Let r = -28 + b. Suppose 0 = -21c + rc + 6. List the prime factors of c. 3 Let b = 118 - 113. Suppose 0 = bz - h - 1000, z + 4h - 179 = -0z. What are the prime factors of z? 199 Let j = -66 - -75. List the prime factors of j. 3 Let z be 14 - -99 - (-1 + -2). Suppose -5m = -m - 2h - 464, z = m - 3h. Suppose 0 = 5v - m - 119. List the prime factors of v. 47 Suppose -5w - 4i = -6535, -36w + 3i - 1307 = -37w. List the prime factors of w. 1307 Suppose -5n + 524 = -g, -2g + 732 = 5n + 205. List the prime factors of n. 3, 5, 7 Let d(w) = -w + 2. Suppose 3a - 8a - 15 = 0. Let o be d(a). Suppose -3v + 96 = 4h + v, -2h + 63 = ov. List the prime factors of h. 19 Suppose -5z + 11 + 9 = 0. Let y = 0 + 0. Suppose 2o + z - 10 = y. What are the prime factors of o? 3 Let o(p) = -29p - 12. Suppose 4d - 6t + 20 = -t, 4d - 4t + 24 = 0. What are the prime factors of o(d)? 2, 139 Let q(g) = 10g + 5. Let t(i) = 10i + 4. Let v(k) = 2q(k) - 3t(k). What are the prime factors of v(-6)? 2, 29 Suppose 0x = -3x - t + 729, 4t = -3x + 729. What are the prime factors of x? 3 Let p = -66 - -152. Suppose 2b - 38 = 2f + 50, 0 = 2b - 4f - p. What are the prime factors of b? 3, 5 Suppose 65k - 64k = 2. Let t(z) = 17z - 5. What are the prime factors of t(k)? 29 Let z(s) = 50s*2 - s + 15. Let r be z(-7). What are the prime factors of 2/(-11) - r/(-44)? 2, 7 Suppose 21f + 3136 - 38605 = 0. What are the prime factors of f? 3, 563 Let m = 290 - 72. What are the prime factors of m/4(-4)/(-2)? 109 Suppose 2q - 14 = -4r, 3r - 3 = 3. Let n be 80 + q/(9/6). Suppose 2j = 8 + n. List the prime factors of j. 3, 5 Let x(a) = -a - 1. Suppose -o - 10 = -2. Let w be x(o). Suppose -2t = -w - 57. List the prime factors of t. 2 Suppose 63f - 65f = -4. Suppose -m + 5m + 2g - 40 = 0, 3m + fg - 30 = 0. What are the prime factors of m? 2, 5 Let w be -2-6(-3)/(-12). Suppose 0o + 5o + 300 = 0. Let p = w - o. What are the prime factors of p? 3, 7 Let t = 853 + -499. List the prime factors of t. 2, 3, 59 Let y(s) = -264s - 165. List the prime factors of y(-8). 3, 11, 59 Let t(b) = -92b*3 - 2b*2 + 16b + 36. What are the prime factors of t(-2)? 2, 3, 61 Let w(r) be the second derivative of -r6/360 - r5/8 - r*4/6 - 12r. Let q(n) be the third derivative of w(n). List the prime factors of q(-14). 13 Suppose -5n = -3t + 5t, -4n = -2t. Suppose 3g + 0x = 4x + 92, 3x + 6 = t. What are the prime factors of g? 2, 7 Suppose -12h + 1194 = -10h. List the prime factors of h. 3, 199 Let s = 6535 + -4546. List the prime factors of s. 3, 13, 17 Let d(h) = -11 + 4h*2 + 12 - h - 3h2. Let a(t) = t3 - 7t2 + 9t + 5. Let c(n) = -a(n) + 5d(n). List the prime factors of c(10). 2, 3, 5 Let q = 66 - 54. Suppose 1312 = -4w + qw. List the prime factors of w. 2, 41 Let q(f) be the second derivative of f5/20 - 2f4/3 - f3 - 5f2 - 9f. List the prime factors of q(9). 17 Let q = 2218 - 1331. What are the prime factors of q? 887 Let n be (11 + -9)/(2-1). Let r be (-232 + n)/(-5 + 4). Suppose 0 = -5c - 25, 4j - 2c - r + 79 = 0. List the prime factors of j. 2, 3 Suppose 0n = 2n + 42. Let r = n + 40. What are the prime factors of (0 - 0)/(-3) + r? 19 Let p be (-1 + 0/(-1))7. Let v(c) = c2 + 2c + 7. What are the prime factors of v(p)? 2, 3, 7 Let k be -1 - (4 + (-8)/1). Suppose -2o = 6y - 3y - 15, 3y = ko. Suppose -2p = -yw + 139, 2w - 70 - 32 = -p. What are the prime factors of w? 7 Let s = 1021 - 690. List the prime factors of s. 331 Let n(m) = 96m - 8. What are the prime factors of n(1)? 2, 11 Let j be (-1)/(-3) + (-56)/42. Let k = 16 + j. Let d = k + -11. List the prime factors of d. 2 Let j(n) = 2n - 15n2 + 9 + n3 - 4n - 5n - 7n. What are the prime factors of j(16)? 41 Let n(x) = 2x - 11. Let o be n(-8). Let d = -5 - o. What are the prime factors of d? 2, 11 Let h = 32 + -36. Let o(a) = -18a - 14. List the prime factors of o(h). 2, 29 Suppose 0 = 2j + 4y - 1148, -8j + 3y = -12j + 2301. What are the prime factors of j? 2, 3 Let u be -2(-1)/(-2) + -1. Let m be (8/14)/(u/(-7)). Suppose -4t + mt + 36 = 0. What are the prime factors of t? 2, 3 Let x(a) = 60a - 4. Let n be x(2). Let s = n - 66. What are the prime factors of s? 2, 5 Suppose 0 = 2z + 2b - 4280, z - 7b + 4b = 2132. List the prime factors of z. 2, 1069 Suppose 5b - 5 - 10 = d, 3 = 2b - d. Suppose 3h - bn = 219, -6 - 9 = -5n. Suppose -h = -m - 3. What are the prime factors of m? 2, 37 Let f(o) = -o - 2. Let s be f(4). Let w be ((-8)/s)/((-4)/6). What are the prime factors of (w + 31)(-1)/(-1)? 29 Suppose 18q - 9009 = 12375. List the prime factors of q. 2, 3, 11 Let m = -47 - -55. Suppose mo = 4o + 176. What are the prime factors of o? 2, 11 Suppose -2272 - 274 = -2p. List the prime factors of p. 19, 67 Let p(i) = 35i*2 + i + 2. Let n be p(3). Let h = -220 + n. List the prime factors of h. 2, 5 Let t = 10249 - 5487. What are the prime factors of t? 2, 2381 Suppose 35 = 2w + 9. Let k(h) = -h*3 + 12h*2 + 13h + 24. List the prime factors of k(w). 2, 3 What are the prime factors of ((-40)/24)/(-5) - (-1064)/3? 5, 71 Suppose -5b + 37 + 38 = 0. Suppose w - b = 33. List the prime factors of w. 2, 3 Suppose -2f = -7f - 395. Suppose -59b + 51b = -1048. Let p = b + f. List the prime factors of p. 2, 13 Suppose -4o = o - 520. Suppose -3f = x - 0x - o, 3f = -15. List the prime factors of x. 7, 17 Let b(d) = d2 + 4. Let a be b(0). Suppose -af = -4z + 256, -2z = -3z - 5f + 88. List the prime factors of z. 2, 17 Let b = -14 + 20. Let d(v) = 9v + 11. What are the prime factors of d(b)? 5, 13 Let n(o) = -o - 10 - 1 + 2. Let f be n(-4). What are the prime factors of (160/(-3))/f3? 2 Suppose -689 = -4f - 5w, -f - 9w + 191 = -4w. What are the prime factors of f? 2, 83 Let n(j) = 174j2 + 21j - 47. List the prime factors of n(4). 7, 13, 31 Let f(l) = -13l - 2. Suppose -3w = 15, -2a - 2w - 25 = 3*a. Let i be 1 + a - (-1 + 1). List the prime factors	{ "pile_set_name": "DM Mathematics" }
5n + 4. Let r be a(5). What is the highest common factor of 44 and r? 4 Suppose 2a + 440 = 6a. Let p = -15 - -25. What is the greatest common factor of a and p? 10 Suppose 0 = 3f + 11 - 2. Let s be 14/(-1)9/(-6). Let k = s + f. Calculate the highest common factor of k and 27. 9 Let g(x) = -3x - 2. Let n be g(-3). Let h be (-2)/n - (-8)/28. Let w be h - -16 - 0/(-1). Calculate the highest common divisor of w and 4. 4 Let f(o) = 27o2 + 2. Let n be f(2). Calculate the greatest common factor of 10 and n. 10 Let y(t) = t2 + t - 5. Let i be 0 + 1 - 2 - -5. Let z be y(i). Let k = 30 - z. Calculate the highest common divisor of k and 6. 3 Suppose -4o + 12 = -0o. Suppose -15 = oc, c - 2c = -4j + 113. Let h be (1/(-1))/((-1)/9). Calculate the highest common divisor of j and h. 9 Suppose 3a + 114 - 309 = 0. What is the highest common factor of 26 and a? 13 Let g(y) = 2y*2 + 9y + 10. Let q be g(-6). Suppose 13 = -3z + 34. Calculate the highest common factor of q and z. 7 Let c = 51 + 66. Let y = -34 + 23. Let i = y - -24. Calculate the greatest common factor of c and i. 13 Let o = 62 - 38. What is the greatest common divisor of o and 12? 12 Let h(i) = i3 - 4i*2 + 4i + 4. Let u be 10/2 - (0 + 1). Let v be h(u). Let c = v - 8. What is the highest common divisor of 96 and c? 12 Suppose -4p + 334 = -2d + 76, -3p + 188 = 4d. Let v = -36 + 52. Calculate the highest common factor of v and p. 16 Suppose 103 = 2t - 167. What is the greatest common divisor of 27 and t? 27 Let f be (-24)/10 + (-2)/(-5). Let p be -17(1 + f)1. What is the greatest common divisor of 170 and p? 17 Suppose -30l + 231 = -129. Suppose -p + 2w = -8, 14 = -p + 2p + w. What is the greatest common factor of p and l? 12 Let m be (42/(-8))/(-7) - 61/(-4). Calculate the highest common divisor of 40 and m. 8 Let a be 5(-2)/(-4)2. Let w be (-3)/(-15) + 114/a. What is the greatest common factor of w and 230? 23 Let r(n) be the second derivative of -n*4/12 - 7n3/6 + n2/2 - 2n. Let k be r(-6). Calculate the highest common divisor of 56 and k. 7 Let g = -62 + 82. Calculate the greatest common factor of 220 and g. 20 Let y be (-8)/(-1 + 0 + 0). Let n = 2 - 6. Let c(a) = 4a*2 - 2a. Let g be c(n). What is the highest common divisor of y and g? 8 Let h(p) = 2p2 - 16p - 15. Let z be h(13). Let o = -33 - -56. What is the greatest common factor of z and o? 23 Suppose -375 = -10f + 225. What is the highest common divisor of f and 420? 60 Suppose -4w + 396 = -2v, -2w - 4v + 108 = -w. Let p = -2 - -5. Suppose 3q = pk - 69, 3q = -5k + q + 94. What is the highest common divisor of w and k? 20 Suppose -2g + 60 = g. Suppose -2k + k = -g. Calculate the highest common divisor of 220 and k. 20 Let f = 186 - 87. Let t be 3/978/2. Let l = t + -4. What is the highest common factor of f and l? 9 Let h(u) = u*2 - 9u + 9. Suppose 0m - 3m = -27. Let v be h(m). What is the greatest common factor of v and 72? 9 Let y = -741 + 1473. Suppose 5n - 279 = -2a - 0a, 0 = 5a + n - y. Let c be ((-4)/6)/((-2)/a). Calculate the greatest common divisor of c and 7. 7 Suppose 4 = 3q - s - 3, 5 = -5s. Suppose 2r - q - 2 = 0. Suppose -r = -v + 4. Calculate the greatest common divisor of 12 and v. 6 Suppose 0 = -2v + 125 - 39. Suppose a = -j + 2 + 8, 4a + 3j - v = 0. What is the greatest common divisor of a and 13? 13 Let b be (9/15)/((-2)/(-10)). Suppose 2k = -4j, -4j = -2k - bj + 10. Let s be 23/2 - 6/k. Calculate the highest common factor of s and 20. 10 Suppose 3s = g - 5g + 115, -s - 45 = -2g. Let l(j) = -3j - 3. Let q be l(4). Let a be (q/2)/(3/(-4)). Calculate the highest common divisor of g and a. 5 Let v(u) = 19u*3 - 2u*2 + 1. Let l be v(1). Suppose -2c = -2q + 246, -4c - 366 = -3q - 0q. Calculate the greatest common divisor of q and l. 18 Let l(t) = -t*2 - 6t - 2. Let q(n) = -n*2 - n - 4. Let b be q(0). Let v be l(b). Calculate the highest common divisor of v and 6. 6 Let j be (-30)/4-2 + (-4 - -6). What is the greatest common factor of j and 221? 17 Suppose -4f - i + 61 = 0, 2f - 22 = -2i + 10. What is the highest common divisor of f and 105? 15 Let b(z) = 5z*2 - 2z - 1. Let d be b(2). Suppose 0 = -2u - 2u. Suppose u = -3m + d + 9. Calculate the highest common factor of m and 88. 8 Let z = -15 + 17. Calculate the greatest common factor of 14 and z. 2 Let l be -10(-2 - (-8)/5). Let k = l + -3. Let i be 5 + (4/2)/k. Calculate the greatest common divisor of 35 and i. 7 Let k be 339/11 - 16/(-88). Suppose k = 4g - 13. Calculate the greatest common divisor of g and 44. 11 Suppose 0 = 4n + 4y - 40, 4n + 2y = 5y + 26. Suppose -n = -4q + 76. Suppose 2k + k = q. What is the highest common factor of 7 and k? 7 Suppose 0 = 5u + 10, -54 = 4i + 6u - 3u. Let q be (13/(-3) + 1)i. What is the highest common divisor of q and 60? 20 Let g = 10 + -5. Suppose gn + k - 4 = 0, n + 3k + 3 = 1. What is the highest common divisor of n and 7? 1 Suppose -5w + 6 = -4. Let g(j) = 2j - 2. Let c be g(w). Suppose 3h - 5d - 36 = 0, -4d + d = h + c. What is the highest common divisor of h and 14? 7 Let c(z) = z*2 - 10z + 24. Let m be c(10). What is the highest common factor of 72 and m? 24 Let z = 37 - 27. Calculate the highest common factor of z and 2. 2 Suppose -5w = -3j + 101, j + 4w + 4 = 32. Let q be (-2)/5 - (-42)/5. Calculate the highest common divisor of j and q. 8 Let x be (-128)/(-20) - (1 + (-6)/10). Calculate the highest common factor of 6 and x. 6 Let i(z) = z + 6. Let x be i(16). What is the greatest common factor of x and 2? 2 Suppose 3x = -2x + 855. What is the greatest common divisor of 19 and x? 19 Let t = 7 - -2. Calculate the greatest common factor of t and 36. 9 Suppose -7 - 133 = -5r. Suppose 2l - 9 = -1. Calculate the greatest common factor of r and l. 4 Suppose 3h - 8h = 0. Suppose -2w - 10 = -hw. Let a = w + 9. What is the highest common divisor of 4 and a? 4 Suppose -4t = -20, -t + 219 = 4j - 2j. Suppose 37 = -5k + j. Calculate the highest common divisor of k and 2. 2 Suppose -3k = -2n + 61, -n - 4k = 4n - 210. What is the highest common divisor of n and 304? 38 Suppose c - 2b - 94 = 0, -c + 85 = -3b - 8. Calculate the greatest common divisor of c and 24. 24 Let q(f) = 8 + 3f*3 + 2f*3 - 4f*3 - 7f*2. Let w be q(7). Calculate the highest common factor of w and 8. 8 Let f = -110 + 214. Let u be (-10)/14 + 6/(-21). Let p(o) = -14o*3 - 2o*2 + 1. Let l be p(u). Calculate the highest common factor of l and f. 13 Let a(t) = 4t*3 + 2t - 1. Let y be a(-3). Let w = y + 191. Suppose 20 - w = -4k. Calculate the highest common factor of 14 and k. 14 Suppose -4v - 416 = -3i - i, 3i - 314 = v. Let n be 71 + 0/1 - 1. Calculate the greatest common factor of i and n. 35 Suppose 2p + 93 = 4k + 305, -233 = -2p - 3k. Suppose 0 = -3y - 3 + 6. Let f be 12 - (2 - 4/y). What is the greatest common divisor of p and f? 14 Suppose -5r = -3r. Let c(j) = j2 + j + 20. Let n be c(r). Calculate the highest common divisor of 5 and n. 5 Let i = 56 + 6. Let l = -7 + i. Let r = 77 - 55. What is the highest common divisor of l and r? 11 Let b(z) = z + 42. Let n be b(0). Let x = 26 - 4. Suppose -5i = -3s + 37 + x, 0 = s + 5i - 53. Calculate the greatest common divisor of n and s. 14 Let c be (-260)/(-16) - (-1)/(-4). Calculate the greatest common factor of 8 and c. 8 Let s(j) = -42j - 3. Let t be s(-2). Suppose -12 = -3g - 60. Let u = -7 - g. Calculate the greatest common factor of u and t. 9 Let h(g) = 5g3 + 1. Let j(p) = -6p*2 - 7p - p + 0p2 + 8 + p3. Let a be j(7). Let t be h(a). What is the greatest common divisor of 4 and t? 2 Suppose 0 = -11x + 57 + 108. Let d be (2 - 10)(-30)/4. Calculate the highest common divisor of x and d. 15 Let y(p) = 3p - 11. Let h be y(8). Let j = h - 9. Calculate the highest common divisor of j and 16. 4 Let x be (-48)/(-5)20/6. Let z(w) = w3 - 4w*2 - 5. Let s be z(4). Let a be (6-2)/(s/20). Calculate the greatest common factor of x and a. 16 Let z = 16 - 9. Let h = z + -1. Suppose 3u + 3i + i = 4, u - i - h = 0. Calculate the greatest common factor of u and 36. 4 Suppose 2f - 145 = -3f. Let w = f - 8. Calculate the highest common diviso	{ "pile_set_name": "DM Mathematics" }
e (-91)/(-2)134/469. 13 What is (1/(-6))/(-1520/5400)? 3 Evaluate (3 - 0) + (49/7 - -1). 11 Calculate 99/(-17) + 13/(26/(-6)) + 9. 3/17 Calculate 5 + (-6)/(-2) + -10. -2 What is the value of ((-1602)/(-27412))/((-6)/(-28))? 3/11 -65 - (462 + -42)/(-15) -37 2/(6/(-7) + (-2592)/(-3402)) -21 Calculate -10 - 136/((34160/126)/(-20)). 2/61 Evaluate 51/(-3) + 3870/215. 1 What is (-1 + (-4)/28)/((-61)/1281)? 24 What is (-18)/84-7 - (266/(-16))/(-19)? 5/8 2/12 - 426/(-20)(-205)/(-369) 12 (-1 - (1/(-4))/((-12)/(-96)))16 16 Evaluate (25/10)/((-7)/14). -5 Evaluate ((-27)/12)/(22/(23232/(-72))). 33 ((-2 + 3)/(11/(-44)))/((-102)/(-3)) -2/17 What is the value of ((-24)/120)/((-3)/(-12))? -4/5 What is (6(-2)/9)/(352/(-1848))? 7 Evaluate (-1 + 55/15 - (6 - 3))39. -13 Calculate 17/((-51)/(-2)) - ((-125)/15 + -3). 12 Calculate (45/(-30))/(((-27)/(-30))/(-3)). 5 Calculate -1(860/60 + -14). -1/3 ((-1)/2)/(360/(-7920)) 11 Evaluate ((-6)/168)/(1360/(-952)). 1/40 What is the value of -3 + 9 - (-81)/(-12)(-180)/(-210)? 3/14 Calculate (-229)/301 - (-5 + (-30)/(-7)). -2/43 Evaluate (-14 - (-272)/20)/((-6)/30). 2 What is the value of 70/(-6)(9585/225)/71? -7 Calculate 33/270 - (-98)/980. 2/9 Evaluate 24/720 + 28/105. 3/10 Calculate (-3(-9)/(-45))/((-357)/45 + 8). -9 What is 12/5((-429)/(-22) - 20)? -6/5 ((-5)/42)/(120/(-96)) 2/21 Calculate ((-26)/(-14) + -2 - (-325)/(-175))/1. -2 (-30)/14(-2296)/738(-3 + 6) 20 What is -2((-24)/28 - 0)/(8/42)? 9 Evaluate (-128)/(-12) - ((-154)/33)/(-7). 10 Calculate ((-5)/(50/12))/((-279)/(-3720)). -16 What is (99/(-22) + -1 + 6 + -1)2? -1 Evaluate 30/4(-20 - (-1008)/60). -24 What is the value of 9 + (10 - (-11 - -30))? 0 6((-1420)/(-180) + -8) -2/3 What is -13 + (1 - 1146/(-96))? -1/16 What is (9/1086)/(60/40)? 1/3 What is -3(17 - (-4340)/(-255))? 1/17 What is (-4)/14 + (-296)/14 + 927/2163? -21 (-33)/(-36) - 38/57 - 7/(-420) 4/15 What is 7 + -26 + (-8528)/(-451)? -1/11 Evaluate 28/(-7) + (-7)/(-4). -9/4 Calculate (-3)/(-27) + 697/(-4896). -1/32 Calculate (8/(-32))/1(-16)/78. 2/39 What is the value of 26/(-5)(-28)/(-45 - -17)? -26/5 What is ((-4)/18)/(184/828)? -1 Calculate (-10)/205 - (-16620)/(-12300). -7/5 -16 - -10 - ((-78)/18 + -2) 1/3 What is (-202)/650 - (6118/247 - 25)? -2/25 What is the value of 5 - 33 - (-35903)/1338? -7/6 Evaluate 24/20(21/12 + (-319)/(-116)). 27/5 Calculate 2 - (13/((-12675)/(-2880)) - (-4)/(-26)). -4/5 Calculate 20/2 - (-549)/(-54). -1/6 What is (14586/(-1989))/(11/(-6))? 4 (-480)/(-70) + 128/112 8 What is 3/9-6(1 - (-25)/(-10))? 3 Evaluate (-95)/(-285)63/15 - (-9)/(-35). 8/7 What is (-18)/297((-81)/18 - 0 - -6)? -1/11 What is (-42)/(-33)-1(-22)/(-2)? -14 Evaluate -4284/(-32). 14 What is (-6)/(-12)-6(13 - (-2 + 9))? -18 What is the value of (0(-1 + 24/16))/(-2)? 0 Evaluate (-3)/15(108/24 + -7). 1/2 636/(-576)-8 - 5/6 8 Evaluate (-47)/(-4) - (28 + 2260/(-80)). 12 (6/(-2))/61/70 0 Evaluate ((1 - 4) + 2)/((-32)/(-43680)65). -21 Evaluate (-23 - -22) + (-17)/(612/(-56)). 5/9 ((-3)/(-36))/((-4329)/2664) -2/39 Calculate (8/30)/(36/(-30)) - 304/(-1044). 2/29 What is the value of (68/85)/(1/5) - (3 + -3)? 4 Calculate (-36)/(-3402)-335/(-5). 2/9 Evaluate (-15)/42 - (-41202)/1764. 23 Evaluate 53(814/(-66) - -13). 10 What is (-27 + 0)/((-2739)/132 + 20)? 36 Calculate -12((-5600)/(-64))/(-35). 5 20144/(-64)(-2)/(-9) -10 Evaluate (-34)/306 - (-82)/9 - 72/18. 5 What is the value of 33 - 8 - ((-33)/3 - 2)? 38 Calculate 978/(-98) + (95 - 99) + 14. 1/49 What is the value of (-279)/45 - -4 - 301/(-215)? -4/5 What is the value of 8/23(-2703)/7208? -3/23 Calculate ((10 - 11)(1 + 0))/((-740)/555). 3/4 What is (-3 - 0)/((-2)/6 + (-22)/(-33))? -9 What is the value of (-570)/216-6 - 16? -1/6 What is the value of 276/370-1 + 6492/8115? 2/37 What is the value of (-32)/(-6)29/92824? 4 What is -14 + 4 - (160/48)/(5/6)? -14 What is the value of -30 + 13 + 3 - 0? -14 Calculate ((-20)/(-3))/512/80-2. -2/5 Calculate (-3)/(6/4)(-7695)/1026. 15 Calculate -15(2/1205)/(12/48). -5 Calculate (5 - 1)(-39)/2730. -2/35 Evaluate 7/(-2)((-612)/168 + 8 - 5). 9/4 -25 - 18830/(-525) - 2/(-15) 11 Calculate (-270)/(-30)(-15)/((-315)/(-56)). -24 What is 624/18235/(-170)? -12/17 What is (-1240)/(-88) - 92/(-1518)(-9)/6? 14 ((-1122)/154 - -7)(2 - -54) -16 9/(-90)(-3 + -42) - 4 1/2 Evaluate (5/(-180))/(5/(-150)). 5/6 What is (-215)/5 + 28 - -33? 18 (4/1734)/(-14 + 0 - 0) -4/7 Calculate ((-72)/60)/2 - 8/(-12). 1/15 (-70)/(-24) + -32 + 14245/444 - -5 8 Calculate (12(23 + -24))/(3/4). -16 Evaluate ((-2)/(-3))/(-22(-48)/(-1848)). -7/6 What is (-26319)/1209 + 22 + ((-240)/26 - 0)? -9 Calculate (-9)/165335 - (-26 - -9). -14/11 What is (-2 - -1)(634 + -609)? -25 Evaluate 8/(-2)1(-5 + (-26)/(-5)). -4/5 What is (-31416)/(-5355) - (9 + (-2 - 1))? -2/15 What is the value of 43/(-65) + (-302)/(-1510)? -6/13 What is 232/(-22) + (15/12)/((-110)/(-880))? -6/11 What is ((-493)/51 - -10) + (-38)/60? -3/10 -29 - (-50 + (-25)/(-1)) -4 What is 49 + -49 - -9(-3 - -2)? -9 (-160)/85 - -6 - (-72)/(-612) 4 ((-19626)/(-16355))/((-42)/(-10)) 2/7 What is the value of (2 - 1)/(65/39(-3)/(-6))? 6/5 -2(-11)/444 2 What is 105/(-70)1/4? -3/8 What is the value of ((-143)/44 + (-5)/(-1))/1-4? -7 ((-840)/(-112))/(-10(-3)/2) 1/2 What is the value of 2/(50/25 - (9 - 3)2)? -1/5 (-266)/(-1178)((-156)/(-42) + -4) -2/31 10692/(-792) + -2(-26)/4 -1/2 (1 - 2)4444/(-404) 11 What is (-6)/70 + 3/(-15) - 1598/238? -7 What is (-2 - -20) + 6/16 + (-690)/(-80)? 27 What is the value of (-21/6)/(75/(-18))? 2/25 (-141)/(-60) + (-4 - (-351)/156) 3/5 Evaluate (-3)/((-42)/(-40)) + (21 - (-1332)/(-63)). -3 What is 323680/(-12460) - (-8)/(-356)? -26 Evaluate 310/34 - (561 - 552). 2/17 What is the value of ((-55)/(-10))/((-6)/24 - 6/(-8))? 11 Evaluate 12/4(6 - (-476)/(-42)). -16 What is (-42532)/(-3773) - (-1 - -12)? 3/11 Calculate 15/8(32/(-120) + (-2)/5). -5/4 What is 0 + 4 - (-9 - (1 - 16))? -2 Calculate 16/(-30)(-333)/(-222). -4/5 Evaluate -2 - 27/(756/(-88)). 8/7 What is the value of 208/1173/(-6)1/12? -2/27 Evaluate ((-54929)/(-735))/(-19) - 1/15. -4 What is (114/57)/(6/7 - 1)? -14 What is the value of (-4324)/282((-22)/(-20) + (-12)/(-30))? -23 Calculate (-132)/69 + (10 - (1 + 7)). 2/23 What is the value of (14 + -23)/((-9)/(-15))? -15 Calculate 24/(-90) - (-168)/(-420). -2/3 (106/371)/(0 - -1)84/76 6/19 What is ((-1288)/140)/23-10? 4 3658/7086/10 + (-3)/1 1/10 Calculate -5 + 5 + -11 + (-57)/(-5). 2/5 Calculate ((-24)/(-32))/((-15)/140). -7 What is 51 - 40 - (5 - (0 - 1))? 5 What is -75(-2 + (-448)/(-240))(-2)/4? -5 Evaluate 1 - (-1447)/(-1443) - 1414/(-26159). 2/39 What is the value of (-38 + (-2528)/(-48))/((-8)/(-6))? 11 15/12(-340)/255 -5/3 Evaluate (33 - 1737/54)4/(40/9). 3/4 What is the value of 710/50 + 121/(-55)? 12 What is the value of (-10142)/594 - ((-18)/243 - 0)? -17 Evaluate (-3 - -11) + (-3)/(6/(1 - 7)). 11 What is (-9)/(-12) - ((-8789)/238)/(-47)? -1/28 What is the value of 44/682 - (-384)/(-2108)? -2/17 Evaluate (50/(-32))/(2860/(-2288)). 5/4 376/(-10340) - 12744/440 -29 -28((-136)/(-374) - (-76)/(-88)) 14 What is the value of 35/(-15) + 1 + (-2 - (-738)/189)? 4/7 What is the value of (56/924)/((-16)/(-6) + 9/(-3))? -2/11 What is 2/3 - (-24053)/1077? 23 Calculate (3 + (-48)/15)/(1962/(-3270)). 1/3 Evaluate ((-40460)/80)/17 + 30. 1/4 Evaluate (-3)/865(-52)/1014. 5/4 1 - 113/(-9) - (-8)/18 14 Evaluate (4 + (145/70 - 5))49/42. 5/4 3/26-426 -12 What is ((-129)/8127)/(4/(-14))? 1/18 Evaluate 970/291((-2 - 424/(-100)) + -2). 4/5 What is ((-2)/617)/((-17)/(-51))? -17 What is the value of (2(-1)/(-5))/(((-224)/490)/8)? -7 Calculate (1275/(-119) + 10)/(-5). 1/7 What is the value of (-20)/(-6)3 + (-930)/(-62)? 25 Calculate (1 - 1)/((12 - 29)/17). 0 Calculate ((-13890)/(-247) - 56) + (-2)/26. 3/19 Calculate -5(0 - -1) + ((-4319)/(-287) - 10). 2/41 -27 - (-21)/(147/329) 20 Calculate (-483)/23 + 16 + 15/6. -5/2 Evaluate 3/(-9) + (-238)/42. -6 Calculate 2/30(-217 + 112). -7 What is the value of (-9)/(-3)((-17304)/(-864) - 20)? 1/12 (480/56)/12 + (-3438)/(-126) 28 What is (-5 + (-148)/(-28))(-567)/(-18)? 9 Calculate 2/(-10)(-79 - -24). 11 What is the value of (-4*1 - -1) + 2668/552? 11/6 Evaluat	{ "pile_set_name": "DM Mathematics" }
Simplify (sqrt(288) + (-3 + sqrt(288))*2)-3. -891 + 180sqrt(2) Simplify 6(3 + sqrt(19)) + ((sqrt(171)3)2 - sqrt(171)). 3sqrt(19) + 1557 Simplify 1(-1 + 3sqrt(176))*2. -24sqrt(11) + 1585 Simplify sqrt(26)/sqrt(50)2. 2sqrt(13)/5 Simplify (-2(0 + sqrt(252)))2. 1008 Simplify (sqrt(304) + 5 - sqrt(190)/sqrt(250)) + 2. 7 + 19sqrt(19)/5 Simplify (sqrt(12)2 + 0)-2. -8sqrt(3) Simplify (1(sqrt(27) + 2sqrt(27)))/(-4sqrt(36)/sqrt(4)). -3sqrt(3)/4 Simplify ((sqrt(3) - (sqrt(3) + -3 + 4)) + 0 + -5)2. 36 Simplify -1sqrt(38)/sqrt(2)-5. 5sqrt(19) Simplify (sqrt(3024)-2)/(sqrt(30)/(sqrt(40)/sqrt(4))). -24sqrt(7) Simplify 4 + ((sqrt(38) - (-2sqrt(190) + sqrt(190) - sqrt(190))/sqrt(5) - sqrt(38))/sqrt(2))2. 80 Simplify (sqrt(180)/(-2sqrt(6)))/sqrt(6). -sqrt(5)/2 Simplify ((sqrt(77) + (sqrt(77) - (sqrt(77) + 1sqrt(77) + sqrt(77)))-6)/((sqrt(84)/sqrt(3))/sqrt(4)))*2. 1859 Simplify 2((sqrt(26)/(sqrt(8)/sqrt(4)))*2 + sqrt(13)). 2sqrt(13) + 26 Simplify -3sqrt(3328). -48sqrt(13) Simplify ((sqrt(143) - 3sqrt(143))/sqrt(11) - sqrt(13))2 - sqrt(416)/sqrt(8). -2sqrt(13) + 117 Simplify -5 + (4(sqrt(2) + 0) - sqrt(2)) + sqrt(2) + 1. -4 + 4sqrt(2) Simplify (sqrt(68) + 2 - sqrt(17)) + 3. sqrt(17) + 5 Simplify (1sqrt(3)3 + (sqrt(12) - (sqrt(12) - sqrt(48)/sqrt(4))) + -1)*2. -10sqrt(3) + 76 Simplify 2(sqrt(52) + -3). -6 + 4sqrt(13) Simplify sqrt(117)/(3sqrt(108)/sqrt(12))5. 5sqrt(13)/3 Simplify -6((sqrt(700)-2 + sqrt(700))2 + (sqrt(28) - sqrt(28)-1) + sqrt(7)). -4200 - 30sqrt(7) Simplify sqrt(133)/((sqrt(35) + sqrt(140)/sqrt(4))/sqrt(5)). sqrt(19)/2 Simplify (1sqrt(2) + -2)*2 + 4. -4sqrt(2) + 10 Simplify ((sqrt(33)3 - sqrt(33))-1)/sqrt(3). -2sqrt(11) Simplify -1 + (sqrt(130) + -3-3sqrt(130))/sqrt(10). -1 + 10sqrt(13) Simplify ((-2sqrt(351))/sqrt(9))/(sqrt(3) - sqrt(36)/sqrt(48)). -4sqrt(13) Simplify 3 + -2sqrt(19) - (sqrt(1900) + 2 + sqrt(1900) - sqrt(19)). -21sqrt(19) + 1 Simplify sqrt(325)-5 - (sqrt(637) + 2)2. -641 - 53sqrt(13) Simplify (2(sqrt(39) + sqrt(156)/sqrt(4)) - sqrt(39))/((sqrt(66)/sqrt(2))/sqrt(11)). 3sqrt(13) Simplify sqrt(11) + 2 + 3 + sqrt(11) + (-4sqrt(176) + sqrt(11))2 + sqrt(11). 3sqrt(11) + 2480 Simplify (sqrt(72)-1 - sqrt(18))/sqrt(6). -3sqrt(3) Simplify 3 + sqrt(20)-5. -10sqrt(5) + 3 Simplify sqrt(20)/sqrt(40) + -5. -5 + sqrt(2)/2 Simplify -3 + (sqrt(27) + -3sqrt(27))2. 105 Simplify -3 + sqrt(70)/sqrt(490). -3 + sqrt(7)/7 Simplify (2sqrt(17) + 3)6. 18 + 12sqrt(17) Simplify (sqrt(351)/sqrt(3) + -4 + 4)*2. 117 Simplify (sqrt(7) + 3 + 4)-2 + 0. -14 - 2sqrt(7) Simplify (3sqrt(637) - sqrt(637) - sqrt(637)) + 4sqrt(1872). 55sqrt(13) Simplify (sqrt(1700) - (sqrt(1700) + 1)-5)2. 600sqrt(17) + 61225 Simplify ((sqrt(88) - 2sqrt(88))-6)/sqrt(8). 6sqrt(11) Simplify ((sqrt(425) + -1)-5)*2 + -3. -250sqrt(17) + 10647 Simplify -5 + ((sqrt(10)3)/sqrt(2))2. 40 Simplify ((sqrt(448) + sqrt(7))-6-1)2. 20412 Simplify ((sqrt(30)/sqrt(6))2 + 1)-2. -12 Simplify -1 + (sqrt(637) + (1 + sqrt(637) - sqrt(637)) - 5(sqrt(52) - sqrt(13))2). -65 + 7sqrt(13) Simplify sqrt(7) + sqrt(7) + sqrt(7) + (sqrt(7) + -2 + 4 - sqrt(7))*2 + -5. -1 + 3sqrt(7) Simplify (-5 + 1(-4 + (sqrt(44) - sqrt(11)) - sqrt(11)))2. 81 Simplify (sqrt(168)/(sqrt(32)/sqrt(4)))/(sqrt(7) + sqrt(63)-5). -sqrt(3)/14 Simplify -4(sqrt(28)/sqrt(4))2-1. 28 Simplify (sqrt(243)2)2 - -62sqrt(3). 12sqrt(3) + 972 Simplify sqrt(15)/sqrt(80). sqrt(3)/4 Simplify (sqrt(26)-2)/sqrt(2) + -3 + 0. -2sqrt(13) - 3 Simplify 2 + 2 + (sqrt(3) - sqrt(24)/sqrt(512))*2. 403/64 Simplify (-2(-5 + sqrt(1900)-26 + sqrt(1900)))*2. 4400sqrt(19) + 919700 Simplify (-3 + sqrt(192)2)2-4. -3108 + 384sqrt(3) Simplify sqrt(85)/(sqrt(5) + (sqrt(560) - sqrt(35))/sqrt(7)). sqrt(17)/4 Simplify (sqrt(102) + 44sqrt(102))/(sqrt(6) + sqrt(36)/sqrt(24)). 34sqrt(17)/3 Simplify (sqrt(5) - (1 + sqrt(5))) + 4 + sqrt(35)/(sqrt(14)/sqrt(2)). sqrt(5) + 3 Simplify (2sqrt(56)-1)/(sqrt(8) + sqrt(16)/sqrt(8)). -4sqrt(7)/3 Simplify ((3sqrt(1100) - sqrt(1100))2)2 + sqrt(1100) + -1(sqrt(1100) - (sqrt(1100)2)2). 22000 Simplify sqrt(26)/(sqrt(242) + 2sqrt(242) + sqrt(242) + sqrt(2)). sqrt(13)/45 Simplify ((sqrt(77) + -3sqrt(77))-6 + sqrt(77) + sqrt(77))/sqrt(7). 14sqrt(11) Simplify -3((sqrt(152) - sqrt(152)22)/(sqrt(8) + (sqrt(96)2)/sqrt(12)))2. -57 Simplify ((-3 + sqrt(108))2 + sqrt(3))-2. -234 + 70sqrt(3) Simplify ((sqrt(125) - sqrt(125)-4)-5 - sqrt(125))2 + 5. 84505 Simplify -4 + sqrt(432) + 5 + (1 + sqrt(432) - sqrt(432))2. 2 + 12sqrt(3) Simplify 5sqrt(36)/(sqrt(12)-2). -5sqrt(3)/2 Simplify (2sqrt(1100))*2 + -1 + -4. 4395 Simplify -5 + 4sqrt(176)-5. -80sqrt(11) - 5 Simplify (sqrt(11) - (-1 + sqrt(275) - sqrt(11)) - ((sqrt(11) + -1)2 + -2)) + (sqrt(1584) + 1 + sqrt(1584) + -1)2. -sqrt(11) + 6327 Simplify (sqrt(133) - (2sqrt(133) + sqrt(133)))/sqrt(7) - sqrt(19) - (sqrt(152)-3)/sqrt(8). 0 Simplify (4 + 1(sqrt(5)-3 + -5))*2. 6sqrt(5) + 46 Simplify (sqrt(117))*2 + -1 + (sqrt(91)1 - sqrt(91) - sqrt(91))/sqrt(7) - (sqrt(1872) - (1 + sqrt(1872) + -3))*2. -sqrt(13) + 112 Simplify (-2-1sqrt(44))/(sqrt(36)5). 2sqrt(11)/15 Simplify (sqrt(396) + 2)5. 10 + 30sqrt(11) Simplify sqrt(704) + (sqrt(704) - (sqrt(704) + (sqrt(704)-3-2)2 + sqrt(704)) - sqrt(704)). -25344 - 8sqrt(11) Simplify -1sqrt(28) + sqrt(7) + -4. -4 - sqrt(7) Simplify sqrt(15)/(sqrt(5)-23). -sqrt(3)/6 Simplify 3sqrt(288) - (sqrt(16)-2)/sqrt(8). 38sqrt(2) Simplify (-2 + sqrt(2057) + -4)*2. -132sqrt(17) + 2093 Simplify -3(0 + sqrt(2) + 0). -3sqrt(2) Simplify ((sqrt(88) - sqrt(88)1)4)/(sqrt(8) + (sqrt(8) - (sqrt(8) + -2(sqrt(24)/sqrt(3) + sqrt(8))))). 0 Simplify ((2sqrt(520))/sqrt(10))/(sqrt(36)/(sqrt(36)/sqrt(4) + sqrt(9))). 4sqrt(13) Simplify 3(sqrt(1872) - (2sqrt(1872) - sqrt(1872)))6-4. 0 Simplify (sqrt(85) - (sqrt(85) + (sqrt(85) + (sqrt(85) - -5(sqrt(85)1 - sqrt(85))) - sqrt(85))))/(1sqrt(500)). -sqrt(17)/10 Simplify (-2 + sqrt(275) - sqrt(11)) + (sqrt(33)/sqrt(27) + sqrt(11))*2. 4sqrt(11) + 158/9 Simplify (sqrt(78)1-4 - sqrt(78))/((sqrt(150)/sqrt(5))/sqrt(5)). -5sqrt(13) Simplify 2(6(sqrt(320) + 0)6)*2. 829440 Simplify ((sqrt(136) + sqrt(136) + sqrt(136) + 1sqrt(136) + sqrt(136) + sqrt(136))-4)/(sqrt(48)/sqrt(96)). -96sqrt(17) Simplify (5(sqrt(147) - (sqrt(147) + (2sqrt(147) - sqrt(147))))1)2. 3675 Simplify (5(sqrt(132) + (sqrt(132) - ((-5sqrt(132) - sqrt(132) - sqrt(132)) + sqrt(132)))))/sqrt(12) + 1. 1 + 40sqrt(11) Simplify (sqrt(66)/(sqrt(6)4))2 + -2. -21/16 Simplify (-1 + sqrt(11) + -5)2 + -4. -12sqrt(11) + 43 Simplify sqrt(55)/(sqrt(11) + 2sqrt(539)) + -2. -2 + sqrt(5)/15 Simplify (((sqrt(700) + -1)2 - sqrt(700)) + 4)-1. -705 + 30sqrt(7) Simplify 1(sqrt(396)/sqrt(4) - sqrt(11)). 2sqrt(11) Simplify ((sqrt(99)3 - sqrt(44)5)1)*2. 11 Simplify -3 + 2 + sqrt(76)/sqrt(4) + -4. -5 + sqrt(19) Simplify sqrt(170)/((2sqrt(60))/sqrt(6)). sqrt(17)/2 Simplify (-3 + sqrt(32) + sqrt(4)/sqrt(2) + 5 + 1)*2. 30sqrt(2) + 59 Simplify ((sqrt(1872) - (sqrt(1872) - ((sqrt(1872)1 - sqrt(1872)) + sqrt(1872)))) + sqrt(1872))/sqrt(4). 12sqrt(13) Simplify 1 + (sqrt(42)-15)/sqrt(6). -5sqrt(7) + 1 Simplify (2(sqrt(70) - -2sqrt(70)))/(sqrt(10) - sqrt(80)/sqrt(32)). 12sqrt(7) Simplify (-2 + -2 + sqrt(19)-2)2 + sqrt(152)/(sqrt(8) - (sqrt(8) - -4-1sqrt(8)) - sqrt(8)). 49sqrt(19)/3 + 92 Simplify ((0 + sqrt(320) + -1)*2 + -4)6. -96sqrt(5) + 1902 Simplify (sqrt(45)-21)/(sqrt(9) + sqrt(81)3 + sqrt(9) + sqrt(9)). -sqrt(5)/6 Simplify 1-1sqrt(5)2 + -4. -2sqrt(5) - 4 Simplify sqrt(76)1 + 0. 2sqrt(19) Simplify (6(-6(sqrt(12)/sqrt(4) + sqrt(3)) - sqrt(3)))*2. 18252 Simplify ((sqrt(2) - -4sqrt(8)/sqrt(4)) + sqrt(2))*2 + sqrt(36)/sqrt(2). 3sqrt(2) + 72 Simplify (sqrt(77)/(-2sqrt(11)))2 - (-2sqrt(84))/sqrt(12). 7/4 + 2sqrt(7) Simplify (sqrt(121) - (sqrt(121) - (2(sqrt(121) - 1sqrt(121)) + sqrt(121))))/(sqrt(539)-1). -sqrt(11)/7 Simplify sqrt(60)/(sqrt(12) - sqrt(768)) + 0. -sqrt(5)/7 Simplify (-4 + sqrt(200))*2 + (sqrt(2) - (sqrt(2) - (3sqrt(2) + -2)*2)). -92sqrt(2) + 238 Simplify (sqrt(11) - (sqrt(11) + (sqrt(110) + 1*sqrt(110))/sqrt(10)))	{ "pile_set_name": "DM Mathematics" }
r2 - 9. Calculate the remainder when a(5) is divided by 19. 15 Suppose 4 = 5j - p, -2j + 4 = j - p. Suppose j = -y + o + 51, -3y + 2y + 63 = 2o. What is the remainder when y is divided by 19? 17 Suppose -z - w + 3w + 8 = 0, -5z + 5w = -15. Let p be (-5)/2(z + 0). Suppose pt - 38 = 3t. Calculate the remainder when t is divided by 5. 4 Suppose 5d + 18 = 8d. What is the remainder when 2/6 + 280/6 is divided by (d/(-9))/(1/(-24))? 15 Let c = 22 - 7. Suppose 3u = c + 3. What is the remainder when u is divided by 2? 0 Let f be -1 + 1/(2/(-12)). Let g = -5 - f. Calculate the remainder when 2 is divided by g. 0 Let a = 18 + -25. Let i(j) = j + 8. Let n(h) = -h2 + 6h + 8. Calculate the remainder when i(a) is divided by n(7). 0 Let g be (((-12)/(-3))/(-2))/(-1). Suppose 5s - gs - 39 = 0. Calculate the remainder when 37 is divided by s. 11 Let b(u) = -u*3 - 5u*2 - 3u - 7. Let k be b(-5). What is the remainder when ((-2)/4)/(k/(-224)) is divided by 5? 4 Suppose -5l + 3p = -2p - 690, -4l + 552 = -2p. Calculate the remainder when (3/(-2))/((-3)/l) is divided by 24. 21 Let l = 4 + -3. Suppose -q = -l - 1. Calculate the remainder when 4 is divided by q. 0 Let v(l) = -l3 + 9l2 - 5. Let r be v(9). Let c(x) = -x2 - 6x + 4. What is the remainder when 16 is divided by c(r)? 7 Suppose 5j + 49 - 219 = 0. What is the remainder when 66 is divided by j? 32 Let n(p) = -p*3 - 8p*2 - 2p + 9. Let b(w) = -w + 1. Let a be b(7). Let k(z) = z*3 + 5z*2 - 9z - 5. What is the remainder when n(-8) is divided by k(a)? 12 Suppose -5 = -4f + 43. Suppose 2p + 3p = 165. Calculate the remainder when p is divided by f. 9 Let z be (-15)/(-10)(-14)/(-3). What is the remainder when 20 is divided by (z/4)/(3/12)? 6 What is the remainder when 2 - 0 - (-111 - -5) is divided by 28? 24 Let d(f) = f + 4. Let b be d(3). Let v(x) = x*3 - 2x + 1. Let m be v(2). Let g = m + b. Calculate the remainder when 35 is divided by g. 11 Calculate the remainder when -115(2 - (-84)/(-30)) is divided by 33. 26 What is the remainder when (39/9 + 1)(-6)/(-4) is divided by 5/((-1 - 1) + 3)? 3 Let u = 2 - 0. Suppose -uw = -7w + 70. Calculate the remainder when 25 is divided by w. 11 Let r = -136 - -501. Suppose 0 = -10v + 5v + r. Calculate the remainder when v is divided by (-1 - 0 - 0) + 20. 16 Suppose 8 = x + 1. Suppose -131 - 194 = -5i. Suppose 2n - xn + i = 0. What is the remainder when 37 is divided by n? 11 Let j = 56 - 46. What is the remainder when 19 is divided by j? 9 Calculate the remainder when (-12)/4 + (-208)/(-2) is divided by 26. 23 Suppose -18s + 22s - 568 = 0. What is the remainder when s is divided by 18? 16 Let q be (-4)/4 + 0 - -3. Suppose -3x + 23 = qb - 19, 0 = -2x + 3b + 41. What is the remainder when x is divided by 9? 7 Suppose 4f - 44 = -8. What is the remainder when 13 is divided by f? 4 Let l(v) = 119v2 - 1. What is the remainder when l(-1) is divided by 17? 16 Let h be (-2)/(-3) - (-813)/9. Let r = 53 - 105. Let b = h + r. Calculate the remainder when b is divided by 10. 9 Calculate the remainder when 33 is divided by (-100)/(-55) + -2 + 134/11. 9 Let o(m) = m - 16. Calculate the remainder when 15 is divided by o(19). 0 Suppose -4 - 141 = -5u. Let p = u + -2. What is the remainder when p is divided by 7? 6 Suppose -4r + 0r + 40 = 0. What is the remainder when 17 is divided by r? 7 Let s be 2/8 + 7/(-28). Suppose s = -4c + 16 + 8. Suppose 3h = c + 24. What is the remainder when h is divided by 6? 4 Let q(s) = s*3 - 6s*2 + 3s - 5. Suppose -5a = -a - 24. What is the remainder when 25 is divided by q(a)? 12 What is the remainder when (132/(-154))/((-6)/28) is divided by 3? 1 Suppose 0 - 2 = z, -3z = -3l + 30. What is the remainder when 22 is divided by l? 6 Suppose c + 8 = v, 3c - 4 = -v + 6c. Calculate the remainder when v is divided by 8. 2 Suppose r + n - 65 = 5r, 4r + 3n = -61. Let x = 43 + r. Calculate the remainder when 53 is divided by x. 26 Suppose 0 = -5m - 4g + 89, 2m - 3g + 0g - 54 = 0. Let l(k) = 9k - 9. What is the remainder when l(10) is divided by m? 18 Suppose -4l + 9l - 11 = 3h, 5h + 4l + 80 = 0. Let s = -8 - h. Suppose -6k - 15 = -k, sj + 2k - 66 = 0. What is the remainder when j is divided by 10? 8 Calculate the remainder when (64 - 7) + (0 - (1 + -3)) is divided by 5. 4 Let r(t) be the second derivative of -11t3/6 + 5t*2/2 + 8t. Calculate the remainder when r(-6) is divided by 18. 17 Let o(h) = 26h + 2. Let x(q) = 13q + 1. Let r(k) = 3o(k) - 5x(k). Let s(p) = 2p2 - 12p. Calculate the remainder when r(4) is divided by s(7). 11 Let l = 61 - 49. What is the remainder when 130 is divided by l? 10 Suppose -2k + 3 = 11. What is the remainder when ((-114)/k)/(3/4) is divided by 13? 12 Suppose n + 3r + 2r - 42 = 0, -5n - 5r = -210. Calculate the remainder when n is divided by 9. 6 Let z(y) = -1 - y + y + 2y. What is the remainder when z(7) is divided by 5? 3 Suppose 90 = 4q + 5q. What is the remainder when 27 is divided by q? 7 Let f(w) = 10w2 + 2w - 1. Let p = 1 + 0. Calculate the remainder when f(p) is divided by (-2)/(-10) - (-38)/10. 3 Suppose -103 = -5z + 127. Calculate the remainder when (9 + -5)z/4 is divided by 12. 10 Let j be 0(0 + 3/6). Let p = 10 + j. Calculate the remainder when p is divided by 2/((-6)/(-4) - 1). 2 What is the remainder when 23 is divided by (-7)/(2(-3)/6)? 2 Suppose 16a - 446 = -78. What is the remainder when 41 is divided by a? 18 Let o(k) = -k2 + 3k - 6. Let j(a) = -2a2 + 3a - 5. Let s(m) = -2j(m) + 3o(m). Calculate the remainder when s(3) is divided by (-1)/(-3) + 34/6. 4 Suppose 0c + 3c = 12. Suppose cg - 68 = 3b, -4g + 7 = 5b - 61. Calculate the remainder when 32 is divided by g. 15 Let h(x) = 4x - 4. Let g = -19 + 66. What is the remainder when g is divided by h(4)? 11 Let v(f) = 0f*3 - 3f*2 + 2 + 9f2 + 2 - f3. What is the remainder when v(5) is divided by 10? 9 Suppose -2a + 63 = -0a + 5m, 5m + 70 = 5a. What is the remainder when 55 is divided by a? 17 Suppose 6 + 249 = 5j. What is the remainder when j is divided by 11? 7 Suppose 3v - z = 5v - 23, 5v - 47 = z. What is the remainder when v is divided by (-5 + -1)6/(-9)? 2 Let m(h) be the first derivative of -h*4/4 - 5h*3/3 + 3h*2/2 - 4h + 1. Suppose 5n - 54 = 3n. What is the remainder when n is divided by m(-6)? 13 Calculate the remainder when 25((0 - 0) + 1) is divided by 5. 0 Let p = 172 + -119. Let b(r) = -r3 + 4r - 3 + 3r3 - 8r*2 + 0r*2 + 3r*2. What is the remainder when p is divided by b(3)? 17 Let q = 7 - 4. Calculate the remainder when 14 is divided by q. 2 Calculate the remainder when (11/22)/(((-6)/(-436))/3) is divided by 37. 35 Let r(x) = -34x - 2. Calculate the remainder when r(-1) is divided by 17. 15 Suppose 4h + 17 = p + 4, 3p = h + 6. Let v(z) = 3z2 - 17z - 40. What is the remainder when v(-3) is divided by (2 + (-32)/6)h? 8 Suppose -4t - 10 = -2i, i + 17 = 4i - 5t. Let h = -11 + 25. Suppose 0 = -2y + h + 18. Calculate the remainder when y is divided by i. 7 Suppose -5k + 107 = 622. Let y = 62 + k. Let z = -23 - y. Calculate the remainder when z is divided by 10. 8 Suppose 8 = -5n - 2, 3m + n - 31 = 0. Calculate the remainder when m is divided by 8. 3 Let b be (-9)/6(-222)/(-9). Let d = -25 - b. Calculate the remainder when 33 is divided by d. 9 Suppose -2r = -14 - 8. Calculate the remainder when (13/3)/((-1)/(-6)) is divided by 6 + 0 + -3 + r. 12 Suppose -4p = -2j + 20 + 2, 0 = 4p. What is the remainder when 42 is divided by j? 9 Let z = -42 + 70. What is the remainder when z is divided by (-42)/(-5) + 8/(-20)? 4 Let g be 2968/40 - (-2)/(-10). Suppose -s + g = s. Calculate the remainder when s is divided by 13. 11 Let v(b) = 4b. Let o be v(1). Suppose -z = 3z + o, -3y + 4z = -13. Calculate the remainder when y is divided by 3. 0 Suppose 0n + 2y = -5n + 1266, 2n = -4y + 516. Let g = -177 + n. Suppose m - g = -4m. Calculate the remainder when 43 is divided by m. 13 Suppose -11t + 8t = -84. What is the remainder when 111 is divided by t? 27 Suppose o - 116 = -3*o. Let n be (-248)/(-14) + 2/7. Let y = -8 + n. What is the remainder when o is divided by y? 9	{ "pile_set_name": "DM Mathematics" }
c*(3/5)c(-3/25) assuming c is positive. c(12/25) Simplify p*(-5)p(2/11) assuming p is positive. p(-53/11) Simplify (n/n(-2))(2/15)/(nnn(-1))(-12/11) assuming n is positive. n(82/55) Simplify (y(2/19))1 assuming y is positive. y(2/19) Simplify d*(2/3)d/d*5dd(d/(d/((dd1/d)/d)dd))50 assuming d is positive. d(-304/3) Simplify ((l/(l/(l/(ll/(l/(((l*(1/2)l)/lll)/l))))))/ll)(1/9) assuming l is positive. l(-1/6) Simplify (y(-8))(5/12) assuming y is positive. y(-10/3) Simplify (r/(r(3/7)/r))/rr*2(rr0)(-24) assuming r is positive. r(-150/7) Simplify (((yy*(-2/7)y)/y)/y)(-3)/(y/y(2/7)y)(-6) assuming y is positive. y(78/7) Simplify (zz*(1/3)zz(2/13))(3/2) assuming z is positive. z(97/26) Simplify (kk*4)/kkk(-7)(kk/k(2/5))45 assuming k is positive. k70 Simplify cc*(3/13)c(-2/7) assuming c is positive. c(86/91) Simplify p*(-13)pp(22/3)/p assuming p is positive. p(-17/3) Simplify (n(2/7)/n(-1/3))(-17/6) assuming n is positive. n(-221/126) Simplify (q(-2/5))7/((q/q(-5))/(((qq/(q/(qq(-3)/q))q)/qq)/qq)) assuming q is positive. q(-49/5) Simplify (f1/f)(-2/39) assuming f is positive. 1 Simplify c(-23)cc*(-15)c assuming c is positive. c*(-36) Simplify llll*(-34)/ll/(lll10) assuming l is positive. l(-43) Simplify ((rr14)/r)/(r/(r/(r/((rr/(r/(r*8r))r)/r)))) assuming r is positive. r23 Simplify ((w(ww(-5)ww)/www)/(w/(((w/((w/w5)/w)w)/w)/w)w))(-20/11) assuming w is positive. w(-60/11) Simplify ((cc/(c/(c/c(-2))))(-3/16))(-34) assuming c is positive. c(51/2) Simplify (((w/w*0)/ww)4)5 assuming w is positive. w20 Simplify v(-8)v/(v/(v/(v/(v/(v/(v(vv/v7)/vv))v))))(vv0)41 assuming v is positive. v30 Simplify (m(2/5))(-7)/(m/(m(-3/2)m)m(1/6)) assuming m is positive. m(-67/15) Simplify x(3/5)x/(xx(4/13))xxx assuming x is positive. x(214/65) Simplify y35/y(-11) assuming y is positive. y46 Simplify (t*12t)(-4/29) assuming t is positive. t(-52/29) Simplify ((ll0l)/l)*(-45)(l(ll(2/3))/l)(2/75) assuming l is positive. l*(-2023/45) Simplify (uu(-2/9))(1/10)/(u*1u)(-9/5) assuming u is positive. u(331/90) Simplify t*(-5)t*(-3/4)t*(-7)/ttt5 assuming t is positive. t(-31/4) Simplify (j(-1/7))(-3/13) assuming j is positive. j(3/91) Simplify y(1/3)/y(-2/9)y/y*4y(y/(yyy(-2/7)yy))/y assuming y is positive. y(-325/63) Simplify (n0)(1/2)(n0)18 assuming n is positive. 1 Simplify ((u/u*(-8/3))/((u/(u(uu/((u/(uu6))/u))/u))/u))/(u(-5)/(u/(uu(-1/7)))) assuming u is positive. u(374/21) Simplify (w(5/3))(2/89) assuming w is positive. w(10/267) Simplify hh*(-2/21)h(3/5) assuming h is positive. h(158/105) Simplify ((g(ggg(-1/2))/gg)/g)(-50)/((g/(g3/g))/g(-4/7)) assuming g is positive. g(-522/7) Simplify (c/c*(1/3)c)/ccc*3(c*(-2/5)c)/c(-2/11) assuming c is positive. c(899/165) Simplify y*(-31)y/(yy(13/2)y) assuming y is positive. y*(-77/2) Simplify (ss(-2))(8/11)/(s(1/2)/s)(9/11) assuming s is positive. s(-7/22) Simplify g(-23)g27 assuming g is positive. g4 Simplify (n/n(-8))/n(3/8) assuming n is positive. n(69/8) Simplify (qq*(-18)q)/(q*7q) assuming q is positive. q(-24) Simplify (k5k)/((kk/(kkk*(-3/20)k))/kk) assuming k is positive. k(137/20) Simplify ((g(-2))(7/6))(-2/45) assuming g is positive. g(14/135) Simplify (b(-1/4))(-30) assuming b is positive. b(15/2) Simplify (c/c(-1/5))(-45)/(c(-2))(-3/50) assuming c is positive. c(-1353/25) Simplify v(-3/10)/(v/v3)(v*1/v)/vv/(v*(-4)v) assuming v is positive. v(47/10) Simplify ((h(-2/5)/h)/hh(-6/11)h)/(h*(1/8)hh/(h(-2/11)h)) assuming h is positive. h(-1431/440) Simplify (t/(t/t(1/4)))/t*(-2/19)tt/(tt/t*7)tt8t assuming t is positive. t(1319/76) Simplify (n/n(2/37))/nnn/((n*(-3/8)n)/nn) assuming n is positive. n(391/296) Simplify ((nn(-1/2))/n(-8))(-13) assuming n is positive. n(-221/2) Simplify (v(v/(v/v10))/v)(2/87) assuming v is positive. v(20/87) Simplify p7/(p/(p(pp/(p/(p(2/9)/p))p)/p))(pp(-2/5))(-22) assuming p is positive. p(-269/45) Simplify (p(2/3))(-48)/(p1)(-2/17) assuming p is positive. p(-542/17) Simplify ((z0/z)/z)(7/3) assuming z is positive. z*(-14/3) Simplify ((xx(-2))/x(2/17))/(x/(x/(x(xx(x1/x)/x)/x)))(-14/5) assuming x is positive. x(143/85) Simplify n(-1/12)/(n/(n/((n/n(6/7)n)/n))nnnn) assuming n is positive. n(-355/84) Simplify (b7/b)/bb(-8)/bb(b(b/((b*(2/5)/b)/b))/b)/bb((b4/b)/b)/bb assuming b is positive. b*(8/5) Simplify (aa(-2/7))(5/4)a5/aaa(-1/5) assuming a is positive. a(797/140) Simplify r/(r(-10)/r)r13 assuming r is positive. r25 Simplify (a*(1/6)/(aa/(aa(1/17)/a)))(-2/99) assuming a is positive. a(181/5049) Simplify (d/d(-1/4))(-29) assuming d is positive. d(-145/4) Simplify (ff*(-1)f)41 assuming f is positive. f41 Simplify (y/(y/(y*(2/7)y)))(3/7)/(y(-5/3)/(yy(2/7))) assuming y is positive. y(515/147) Simplify (z/z9)(-1/2) assuming z is positive. z4 Simplify (s7)46 assuming s is positive. s322 Simplify (f/f(2/53))13 assuming f is positive. f(663/53) Simplify ((aa(-27))/a)/(a/a(-2/17)) assuming a is positive. a(-478/17) Simplify (z(-2)z(-1))5 assuming z is positive. z(-15) Simplify (vv/(v/v29))(17/4) assuming v is positive. v*(255/2) Simplify ((x/(x/(x/(xx/x*(1/4)x))))/x*(-3))/((xx*0)/xx(xxx/x3)/x) assuming x is positive. x(5/4) Simplify (c6cc)/(c5/c)((c/((c/(c/c(-1/2)))/c))/c)43 assuming c is positive. c(137/2) Simplify x/x(3/8)x(2/121) assuming x is positive. x(621/968) Simplify y/(y/(y/(yyy(-30))))y/y(2/17) assuming y is positive. y(508/17) Simplify ((mm/(mm*(-31))mmm)/m)/(m*15mm) assuming m is positive. m17 Simplify a5aa(1/15) assuming a is positive. a(91/15) Simplify (gg/(g/(g/(gg(-1/2)))))12/((g/g(1/2)g)/g(-1/3)) assuming g is positive. g(97/6) Simplify h*17hh/(h/h(1/13)) assuming h is positive. h(235/13) Simplify (k(-1)/k)47(k/((kk(1/4))/k))/(kk/(kk(4/3))) assuming k is positive. k(-1115/12) Simplify (gg12)/g(1/18) assuming g is positive. g*(233/18) Simplify bb*11b/((b/(b/(b/b3)))/b) assuming b is positive. b16 Simplify ((uu(-12)u)/u)/(u10/u) assuming u is positive. u(-20) Simplify ((z/(z*(-4)/z)z)/(z/(z/(z/z4))))(-1/41) assuming z is positive. z(-10/41) Simplify (g(-22)/(gg(-1/25)))25 assuming g is positive. g(-574) Simplify ((u18/u)/u(-18/7))44 assuming u is positive. u(6028/7) Simplify ((k5/k)/((k/k(-3)k)/k))(-39) assuming k is positive. 1 Simplify (m(2/15))(-43/5) assuming m is positive. m(-86/75) Simplify x*(-22/3)x/x(-2/7) assuming x is positive. x(-127/21) Simplify (www*(-2/9)w)*(-36)w(4/9)/(w/w(2/5)) assuming w is positive. w(-4507/45) Simplify (j(-2)jjj(-1)j)/(((j/j*(-4))/j)/(j/(jj/j(-1/7)))) assuming j is positive. j(-36/7) Simplify (c(-2/5))(-3/5)/(c(1/3))(-22) assuming c is positive. c(568/75) Simplify (a(1/2))*(-12/5)/(aaa(-1/3)aaa(1/5)/a) assuming a is positive. a(-61/15) Simplify (t(2/7))(-1/11)/((tt/(t/(tt/t(-1/5))))/((((t(-2/23)/tt)/t)/t)/t)) assuming t is positive. t(-55901/8855) Simplify ((g(-8)/g)/g(-2/11))/((gg/g*(-2/7)gg)/g)(2/61) assuming g is positive. g(-41925/4697) Simplify (y(-2/17)yy(-8))(-6) assuming y is positive. y(726/17) Simplify (k6kkk)/kkk*22/kkk assuming k is positive. k32 Simplify ((w1)(-4/31))(-5) assuming w is positive. w(20/31) Simplify (w(-16/9)ww)/www/((ww2/w)/w) assuming w is positive. w(2/9) Simplify (h/((h/(h(h/h(2/23))/h))/hh)h/(h(3/10)/h))/(((h/(h/h(-2/21))h)/h)/h(h(-4/5)/h)/hhh) assuming h is positive. h(4355/966) Simplify o(-9)/(((o/(oo(-15)))/o)/o) assuming o is positive. o(-22) Simplify ((c6)(2/19	{ "pile_set_name": "DM Mathematics" }
, 4s = -3g - 3. Suppose -sx - 7 = -7. Let u = -3.07 - 0.93. What is the nearest to 2/7 in x, u, 16? x Let q be (-26)/4 + 6/(12/5). What is the closest to 1.1 in -1, 12, 0, q? 0 Let q = 875.338 + -870. Let x = -0.908 + q. Let y = 0.43 - x. Which is the closest to 0.2? (a) 3 (b) 1 (c) y b Let x = -13.2 + 13. Suppose -5q = 3a - 7, 3a + 3q - 7q - 16 = 0. Let g be ((-33)/(-44) - 11/a)/8. What is the closest to 0.2 in g, -2/5, x? x Let v = -34.2 - 1.8. Let m = 31.2221 + -0.2221. Let o = m + v. What is the closest to 0.3 in o, -0.4, -3? -0.4 Let y = -0.157 + 43.657. Let m = -43 + y. Let l = 0.043 + 0.057. Which is the nearest to 1? (a) l (b) m (c) 3 b Let h = -349541 + 249572143/714. Let m = h + 2/119. Let c = -3 + 2.8. What is the closest to c in m, 2, -2? m Let v be (((-4)/260)/(64/(-832)))/((-2)/(-10)). What is the closest to v in -1/4, 29, -52/3? -1/4 Let j = -8562 + 8644. Which is the nearest to -0.1? (a) j (b) -0.3 (c) -3 (d) -3/7 b Let n = 0.04 - 0.024. Let m = -0.116 + n. Let i = -74 + 73. Which is the closest to -2/5? (a) m (b) i (c) -3/4 a Let g be (4 - 3)/(0 + 1)(-42)/(-63). Which is the nearest to 0.1? (a) -5 (b) 2/181 (c) g b Let i = 7.7 - 7.746. Let t = i - -1.046. Which is the closest to 0? (a) -0.38 (b) 3 (c) t a Let n = -9758.5 - -9758. Let z = -7 - -6. Which is the nearest to -0.1? (a) -2 (b) z (c) n c Let s = -23423 + 23780. Which is the nearest to s? (a) -0.4 (b) 4 (c) 0.1 b Let k = -0.738 - -0.638. Let n = -28 - -27. Which is the closest to 1/5? (a) n (b) -0.4 (c) k c Let s(q) be the third derivative of -7q*4/6 - 191q3/6 - q2 - 75. Let p be s(-7). Which is the closest to -41? (a) -1 (b) p (c) 2 (d) 4 a Let o(n) = n*2 - 9n + 13. Suppose 22 = 3f + 8f. Let w = 5 + f. Let v be o(w). Which is the closest to v? (a) -4 (b) 2/15 (c) -0.4 c Suppose -28h + 52h + 107h - 524 = 0. Which is the closest to 2? (a) h (b) -5 (c) 1/5 (d) 0.44 d Let d = 4.129 - 3.929. What is the closest to d in 0.09, 3, 1, 2? 0.09 Suppose 29h - 313 = -565 + 339. What is the nearest to 2/29 in -2, h, -5? -2 Let u = -0.546 + 0.546. Let k = 0.4 - -2. Let h = -3.6 - k. Which is the closest to u? (a) h (b) 0.3 (c) -0.5 b Let m = 7163 + -7164. Which is the nearest to m? (a) 2/5 (b) 16 (c) -0.1 (d) 2/13 c Let o be (-8)/(-15)(49 - 52)5. Which is the nearest to -2? (a) 3 (b) 0 (c) -0.5 (d) o c Let j = 19.585 - 19.585. Which is the closest to j? (a) -2/3 (b) 2 (c) -0.04 (d) 2.8 c Let x = 884.7 - 883.4. What is the closest to x in -2/3, -4, 0.8? 0.8 Let n = 106.5 + -108. Let t = -0.19 - -0.25. Let a = t - -0.14. What is the closest to -2/5 in a, -3, n? a Let z = -15 - -254. Let x = z - 214. Which is the closest to x? (a) -2 (b) 4 (c) 0 b Suppose -2 = -l, 6h + 8 = 7h + 4l. Which is the nearest to 0? (a) -3 (b) h (c) 39 (d) -0.5 b Let t = 189 - 189.4. Let x = -0.004 + 0.074. What is the nearest to 1/6 in t, x, -2? x Let s(o) = o3 - 4o*2 - 126o + 259. Let n be s(2). Which is the nearest to n? (a) 2/5 (b) -1/21 (c) 4 b Let h be 0 + -3 + 58/18. Let k(j) = 1444 + 0j + 5j*2 - 1447 - 2j. Let m be k(-1). What is the closest to 3 in -5, h, m? m Suppose 2i - 2z = 4, 11z = 2i + 7z - 4. Let u = 103/336 + -1/48. What is the closest to 1 in -0.5, u, i? u Let n = 16986/1141 + -2380/163. Let d = -0.2 + 0.15. Let v = 1.8 - 2. What is the closest to n in v, 4/7, d? 4/7 Let q = 3.12 + 1.88. Let p = 1 - 0. Let t be (3p)/(21/(-2)). What is the nearest to 3 in -3, t, q? q Let y(n) = -8n2 - 55n - 52. Let w be y(-6). What is the nearest to 1/2 in 41, w, -0.1, 5? -0.1 Let h = -3140 + 3143. What is the closest to -2/11 in h, 2, 1/8, 1.5? 1/8 Let z = -24.9717 - -13.9717. Let t = 3 + -3.1. Which is the closest to 2? (a) z (b) t (c) 2 c Let p = 1158 - 1162. Which is the closest to 1? (a) 50/3 (b) -5 (c) p (d) 2/11 d Suppose 185f = 31f + 154. What is the nearest to 0.1 in 0.6, f, 4, 2/7? 2/7 Let j = -31 - -51. Let o = 22.36 - 0.36. Let d = j - o. Which is the closest to 2/7? (a) -1.1 (b) d (c) 2/9 c Let h be (-195)/30 + 6 + 7/(-2). Which is the closest to 0.1? (a) -13 (b) -2/5 (c) h b Let f = 198529/19 + -10449. Which is the nearest to 1? (a) 2/23 (b) 0.1 (c) f b Let m be (13 - 2940/216) + -1 + 11/6. Suppose -j - 2g + 28 = 0, -3g + g - 32 = -j. Let x = j + -208/7. What is the closest to m in x, 0.4, 4? x Let h be (-4)/6 + (-14)/(-3). Let o(g) = 15g + 3g*2 - hg*2 - 13g + 1. Let j be o(2). Which is the nearest to 0? (a) j (b) -2/13 (c) 0 c Let t = -9754 - -19867/2. Let s = t - 178. What is the nearest to -1/3 in 0.4, s, 2? 0.4 Let q = -14079 + 84475/6. Which is the nearest to 2/5? (a) -0.06 (b) q (c) 2/11 (d) 0.57 d Let u = -185.84 + 183.84. What is the nearest to 1/2 in 0.49, u, 5? 0.49 Let k = -3 - -3.3. Let z be (-754)/5 + (-45)/(-75). Let s = z - -150. Which is the closest to 1.3? (a) -2 (b) k (c) s b Let x = 1804.6 - 1805. Which is the nearest to 3? (a) 3/2 (b) x (c) -0.5 a Let p be (-555)/(-2025) - (1507/297 - 5). What is the closest to -29 in 5, 48, p? p Let n be (-15)/18128/(-960). Which is the closest to 98.2? (a) -4 (b) -2/11 (c) 5 (d) n c Suppose 2o - k - 12 = 0, -5o + k + 3k = -33. Let f = 0.13 - 0.48. Let b = 0.25 + f. What is the closest to b in o, 0.3, 4? 0.3 Let y be (9(-8)/(-1386))/((-45)/(-21) - 3). What is the nearest to -2 in y, 0.4, 5? y Let a = -32 + 45. Let z = 18 - a. Let s be (-126)/15 + (-6)/10 - (-189)/18. What is the closest to -3 in s, z, 0.4? 0.4 Let u = 428.61 + -9.61. Let z = u + -423. What is the nearest to 0 in z, -0.4, -1/5? -1/5 Let h(t) = -4t*3 + 13t*2 + 13t. Let k be h(-1). Suppose o + 4y - 2y + 7 = 0, -o = -ky - 23. What is the closest to -1 in 2, o, 0, -0.2? -0.2 Let d = 2.97 - 536.97. Let l = -530 - d. Which is the nearest to 0.2? (a) -3/2 (b) 2/3 (c) l b Let v = 168.1 - 63.9. Let y = v - 104. Suppose -4m = -4 - 16. Which is the closest to y? (a) m (b) -3 (c) -1 c Let r = 5 + -4. Let n = 0.02 - 6.02. Let l = -157.4 - -157. Which is the nearest to r? (a) 1/4 (b) n (c) l a Let y = 18.6 + -190.9. Let z = 172 + y. Let x be 0 + 0 + (-4)/(-6). Which is the nearest to z? (a) -0.4 (b) x (c) -2/3 a Let u = 854 + -853.15. Let z = -2.15 - u. What is the closest to -2 in -1/2, -58, z? z Let t(c) = -45c. Let u be t(-1). Let l be u/175 + 7/49. What is the nearest to 3 in l, -2/11, -2? l Let z = 14276 - 14278. Which is the closest to 2? (a) z (b) 4 (c) -1 (d) 79 b Suppose -8l - 5y = 47, 3l + y = 5y. Which is the nearest to -0.1? (a) -3 (b) -6/19 (c) -19 (d) l b Let i = 3468.5 - 3468. Which is the nearest to 37? (a) 2 (b) -4 (c) i a Suppose 34 = -40j + 44 - 330. What is the nearest to j in 0.4, 4, 10? 0.4 Let v = -3.07 - -0.07. Let i = -0.1026 + 3.4026. Let w = i + v. What is the nearest to 1/4 in -4, 0.1, w? w Let y = -43.083 + 43.183. What is the nearest to y in -11, 0.3, -0.3, 5? 0.3 Let i = 388 + -777/2. Let y = 0.315 + 0.685. Let n = 0.3 + 4.7. What is the nearest to i in 2/17, n, y? 2/17 Let d be (2 - -2)1/1. Let l = -759 + 758.9615. Let u = l + -1.9615. Which is the closest to 6? (a) d (b) 0 (c) u a Let o = 6435.91 - 6440.91. Let f = -6 + 2. Let x = f + 6. What is the closest to -1/2 in 1/2, x, o? 1/2 Let h be (-14)/(-126) + (-528)/(-108). Which is the nearest to 2/35? (a) 0.1 (b) 2/11 (c) h a Let l(h) = -h2 + 315h + 53332. Let d be l(437). Let g = 2.05 + -0.05. Let v = -0.3 - -0.5. Which is the nearest to 1? (a) g (b) d (c) v c Suppose 6o = -15o - 4 - 17. What is the closest to -3 in 2/15, o, -0.5? o Suppose -o + 3 = -0. Suppose 2 + 10 = -oh. Let g be 448/240 + (-1)/5. What is the nearest to -2/3 in -0.4, g, h? -0.4 Let u = -1592 - -1589. Let a be (2/(-10))/(1/((-25)/20)). Let s = -23/2 + 11. What is the closest to 0.2 in u, a, s? a Let i = -0.375 - -10.65. Let q = 10.2 - i. What is the nearest to q in 4, 3/8, 1? 3/8 Let v = -77 + 3. Let y = v + 73.925. Let p = y + 5.075. Which is the closest to -0.3? (a) -0.03 (b) p (c) 0.5 a Let m = -0.2177 + -3.7823. Let c = 0.1 - 0.4. Let y = -0.3 - c. What is the closest to y in 0.3, m, 0.2? 0.2 Let n = -0.1 - -0.2. Let c = -16236/7 - -2320. What is the nearest to -2 in -3, n, c, -1/4? -3 Suppose 85k = 89*k - 8. Let m	{ "pile_set_name": "DM Mathematics" }
5, l + 4a = 3602. Does 199 divide l? True Let u(n) = -7n + 7. Let k(w) = -15w + 13. Let h(t) = -4k(t) + 9u(t). Let q be h(6). Is 22 a factor of (21/9)/q-66? True Suppose -14h + 26212 = -10h. Is h a multiple of 110? False Let y(z) = 7z2 - 100z - 559. Is y(-7) a multiple of 95? False Suppose -19x = 68x + 51x - 1522692. Is 75 a factor of x? False Let j = -38 + 28. Let a be 6/j + 1 - (-92)/20. Suppose -aq + 46 + 279 = 0. Is 13 a factor of q? True Let p be -2 - ((-3 - -2) + -1). Suppose -16y + 11y + 1965 = p. Is 53 a factor of y? False Let h(j) = -3j2 + j + 1. Let c be h(1). Let r(y) = -9y*2 + y + 2. Let f be r(c). Is 4 a factor of (-4 - 46/f)16? True Let h(i) = -2i2 + 53i + 2. Let n(k) = -k*2 + 12k - 12. Let c be n(6). Does 5 divide h(c)? False Let j = 18582 + 2726. Is j a multiple of 28? True Let l(u) = 4u2 + 12u + 13. Let h(i) = -11i2 - 36i - 40. Let f(p) = -3h(p) - 8l(p). Let w be f(-7). Let k = w - -26. Is k even? False Let j = 11596 - 6786. Does 65 divide j? True Suppose 33 = -i + 16y - 12y, -12 = -4y. Let k = i + 124. Does 11 divide k? False Let v(x) = -3x*3 - 14x*2 - 4x - 15. Let m(h) = -2h3 - 47h*2 - 25h - 53. Let k be m(-23). Is 23 a factor of v(k)? False Suppose 21987 + 18347 = 86m. Does 11 divide m? False Let m(g) = 38g - 108. Let s be m(7). Suppose z + 1035 = 4b, -b + 3z + 87 = -s. Does 20 divide b? True Suppose -144i = 346i + 7618228 - 27969888. Is i a multiple of 38? True Let b(y) = -y*3 - 7y*3 - 4y - 1 + 0y + 6y*3 - 11y*2. Does 13 divide b(-8)? True Suppose 0 = -11t + 8t + 8091. Suppose 4o - 2156 = 4u, -t = -5o + 6u - 3u. Does 60 divide o? True Suppose 0 = 11t - 9t. Suppose t = -5u + 20, 0 = 3b - 0b + 2u - 185. Let y = b + -17. Does 6 divide y? True Let s be (-6)/(-4) + 11/(154/(-1421)). Let f = s + 230. Is f a multiple of 10? True Suppose -67b + 39 = -64b. Let f(i) = -i*2 + 8i + 30. Let r(j) = 3j2 - 25j - 90. Let y(p) = -7f(p) - 2r(p). Is 13 a factor of y(b)? False Let k(r) = 2r2 + 10r + 10. Let f(q) = -4q + 16. Suppose -3t = 5n - 0 + 2, 5n = t - 26. Let b be f(t). Does 6 divide k(b)? False Let s = 10537 + -5667. Is s a multiple of 21? False Suppose 5t + 2076r = 2077r + 211381, t = -2r + 42274. Is t a multiple of 13? True Suppose 0 = -5a + 25, -4m - 4a = -2m + 456. Let t = m + 371. Is 10 a factor of t? False Suppose 0 = 5y - 0y - 25. Let p(o) = 5o3 - 11o*2 - 8. Does 19 divide p(y)? True Suppose -4s + 3s = -5c + 24, 0 = 3s + 2c + 4. Let k be (-25)/5 + s - -3. Is 14 a factor of ((-6092)/(-9))/4 - k/(-27)? False Suppose -346g + 347g = 4y - 17701, -5 = g. Does 79 divide y? True Is 8 a factor of (-1)/((-2)/29738) - (-3)/6-6? False Let l = -2496 + 5952. Is 72 a factor of l? True Let k = -26 - -74. Suppose k = 4g - 8. Is g/70 - (-2)/(20/1198) a multiple of 20? True Let g(i) = -2i*2 + 36i + 3. Let b be g(18). Suppose 4q = 20v - 19v + 682, 504 = bq + 3v. Does 10 divide q? True Suppose 132a = 140a - 10912. Does 11 divide a? True Let f = 8694 - 5204. Does 5 divide f? True Let r(l) = -2l*2 - 10l + 53. Let n be r(-8). Suppose 4f - 954 = 4u + u, 2f = -4u + 464. Suppose nw - f = -16. Is w a multiple of 13? False Let b = 100239 + -64741. Is 37 a factor of b? False Suppose x = -11i + 10i + 12851, -2x = -i - 25720. Does 48 divide x? False Let u = -25 - -23. Let q = u - 0. Is (11/q + 4)-12 a multiple of 10? False Suppose -35q + 276q - 220203 - 65382 = 0. Does 3 divide q? True Suppose -992q - 329358 - 28824 = -1003q. Is q a multiple of 6? True Suppose -2j = -4b, -21j - 2 = -24j + 5b. Suppose 4v - 3v = -p + 277, 3p = 3v + 825. Suppose 0 = jx - 8x + p. Is x a multiple of 15? False Let i = 12755 - 3300. Is i a multiple of 61? True Let d be ((-10)/(-4) + -2)/((-11)/(-44)). Let b(l) = -3085ld - l3 - 7l + 3085l2. Does 8 divide b(-3)? True Let m be (4/6 + 0)/((-6)/27). Let j be (12/(-4))/(-1) + m. Suppose -8p + 246 - 22 = j. Is p a multiple of 4? True Suppose 2l - 3152 = -4h, -24h + 26h = -10l + 1540. Does 6 divide h? False Let z be (642/8)/(684/48 - 14). Suppose -19u + z = -1883. Does 6 divide u? False Let f = -4760 - -4826. Is f a multiple of 2? True Let u = -24 + 27. Let v(l) = -10l3 - 10l - l - u - 4l + 11l. Is 43 a factor of v(-2)? False Let v = 25538 - 13754. Is 148 a factor of v? False Is (-5 + (-38374)/(-70))25 a multiple of 140? True Let n(c) = c3 - 18c*2 + 33c + 17. Suppose 0 = -40p + 33p + 112. Is n(p) a multiple of 17? False Let p(m) = 15m - 95m + 3 - 42m. Is p(-2) a multiple of 19? True Let j(f) = f - 43. Let m(p) = 44. Let y(l) = -3j(l) - 2m(l). Let a be y(12). Suppose -3k + 311 = -ab, -5b + 107 + 142 = 2k. Does 16 divide k? True Suppose -s + 1 = 0, -67 = 2t + 3s - 2670. Is 25 a factor of t? True Suppose -2i - z = -2, -z - 17 = i + 4z. Let f be (i - 0)/((-1)/55). Let j = f + 369. Is j a multiple of 34? True Is -14 + 66/6 + (-31083)/(2 - 5) a multiple of 26? False Suppose -5z - 14685 = -v, -3z + 7885 = -2v + 37213. Does 27 divide v? False Let m be 6(1053/(-156))/(3/(-32)). Suppose m = -60a + 66a. Is 4 a factor of a? True Suppose 7o - 26o + 66690 = 0. Is 18 a factor of o? True Let d be -3 - (-327 - -1). Suppose 6x + d + 505 = 0. Let c = x + 109. Is c a multiple of 4? True Suppose -4n + 5r = 1062, -2r - 2r = n + 276. Let t = 728 + -1156. Let a = n - t. Is a a multiple of 32? True Suppose -2n - p + 39 = -11, p + 118 = 5n. Suppose 0z + 4z = 4h - n, 0 = -4h - 2z + 42. Suppose -hu = -60 - 903. Is u a multiple of 11? False Suppose -141q + 15 = -136q. Suppose -qx = 2m - 710, 3x - 1070 = 2m - 352. Does 14 divide x? True Suppose 0 = 128s - 137s + 2862. Suppose sp = 323p - 700. Does 28 divide p? True Let x = -48 + 72. Suppose -5o + 2b + 1145 = 0, -4o + 914 = 18b - 20b. Suppose -4j + n + o = 0, -312 = -5j + n - x. Is j a multiple of 12? False Let t(f) = -f*2 + 53f + 227. Does 61 divide t(45)? False Let v(p) = -56 + 27 - 127 + p*2 - p. Is 6 a factor of v(15)? True Let z = 120167 - 50555. Does 50 divide z? False Let p be (2 + 3/(-3))0. Let x be 0 - (10/6)/(-5)p. Suppose x = -5r + 28 + 117. Is 29 a factor of r? True Suppose 5n + 40824 = 5o - 14051, -65844 = -6o + 5n. Does 113 divide o? False Suppose -37998x - 976374 = -38025x. Is x a multiple of 49? True Let q be (-21)/7 + 6 + 5893. Suppose -1364 = -20n + q. Does 11 divide n? True Let f(a) = a3 + 2a*2 - 15a - 14. Let s be f(-7). Let t = 815 - s. Is t a multiple of 19? True Let y = -5634 + 17198. Does 98 divide y? True Let s be (1 - 2) + 3 - (-28 + 25). Suppose 83 - 489 = -4d + 3v, -5d + 490 = sv. Is d a multiple of 10? True Suppose l + 146 = -5w, -4l + 2w = 7w + 509. Let c = 132 + l. Is 3 a factor of c? False Suppose -2r - 11358 = -6r + 4866. Is r a multiple of 26? True Let c be ((-4)/10)/((-16)/40). Suppose f = -c, 2l = 4f - 5 + 19. Suppose 3r + 3u = 45, -lr + 0r + u + 105 = 0. Is 4 a factor of r? True Let m(z) = -48z3 - z2 + 7z + 2. Let p(d) = -29d3 - d2 + 7d + 3. Let f(t) = -2m(t) + 3p(t). Let n be 3/(-2(-1)/2). Does 10 divide f(n)? True Let l(b) = -b2 - 5. Let q be l(3). Let f = q - -2. Is 12 a factor of (f/8 - 1 - -2)-30? False Let u(h) = -9h - 1. Let l(g) = -2g*3 - 6g*2 + 11g + 6. Let a be l(-4). Is u(a) a multiple of 3? False Let b(t) = -t*2 + 1. Let l(s) = -8s*2 - 11s - 31. Let a(y) = -b(y) - l(y). Let z be a(-5). Suppose 4r - 211 - 93 = 4n, -4n + z = 3r. Does 18 divide r? True Let v = 55492 + -22914. Does 179 divide v? True Let h(f) = 71f + 3609. Is h(-50) a multiple of 13? False Let j(y) = 2y*3 - 3y*2 - 12y + 23. Let n be j(4). Suppose 5d - nz - 6829 = -53z, 0 = -d - 4z + 1357. Is 15 a factor of d? True Suppose 2f - 25 = -91. Let y = -31 - f. Is 141/y - 12/24 a multiple of 14? True Let y = 82 - 61. Let c = 23 - y. Suppose 134 - 30 = ct. Is t a multiple of 13? True Suppose 41 = -o + 45. Suppose -ol + 2p + 704 = -58, 5l - 939 = -2p. Does 9 divide l? True Does 12 divide 2620 - (-7 - -4)/616? True Suppose 3u + 17 = v, 0 = u - 5u - 2v - 6. Let h be u(-4)/163. Suppose -3a - 12 = 0, -ha - 41 + 7 = -2k. Does 5 divide k? False Suppose -3n = 3s - 4s - 3729, 3729 = 3n - 2s	{ "pile_set_name": "DM Mathematics" }
fy -3 + sqrt(13) + (1 + sqrt(13)-2 + sqrt(13))2 + (sqrt(208) + -1 + 3)2. 15sqrt(13) + 223 Simplify (4(sqrt(88) - (sqrt(88) - -2sqrt(88))) - sqrt(88))/(sqrt(8) - sqrt(512)-4). -3sqrt(11)/11 Simplify -4(sqrt(3) + ((sqrt(3) - (sqrt(6)/sqrt(50))2) + sqrt(3) - sqrt(3))) - (sqrt(54)/sqrt(2)-2)/sqrt(9). -6sqrt(3) + 12/25 Simplify ((sqrt(1584) - (sqrt(1584) - (sqrt(1584)5 - sqrt(1584))))4 - -45sqrt(891))2. 1522224 Simplify ((sqrt(1053) - ((-4sqrt(1053) + sqrt(1053))5 - sqrt(1053)))2 - (sqrt(1053) + 0 + 1 - (sqrt(1053) - -1sqrt(1053)4 - sqrt(1053))))*2. -666sqrt(13) + 1441558 Simplify 2(-1sqrt(66)3)/(sqrt(486) + sqrt(486)-2 + sqrt(486) + sqrt(486)). -2sqrt(11)/3 Simplify 2(sqrt(114) - (sqrt(114) + sqrt(114)-3)6 - sqrt(114))/(sqrt(6) + 3sqrt(6)3)-3. -36sqrt(19)/5 Simplify (1(-1 + ((sqrt(60) + sqrt(180)/sqrt(3))/sqrt(4) + sqrt(15))/((sqrt(5) - sqrt(45)/(sqrt(9) + sqrt(36)/sqrt(4)) - sqrt(5)) + sqrt(5))))2. -12sqrt(3) + 109 Simplify -3 + (sqrt(1700) + (sqrt(1700)-2 + 4)2 - sqrt(1700)) + 5(-1sqrt(1700) - sqrt(1700)). -260sqrt(17) + 6813 Simplify ((sqrt(3500) - (sqrt(3500) + (sqrt(3500) - sqrt(3500)2-1))) + sqrt(3500))/((sqrt(660)/(sqrt(11) + sqrt(11)-2))/sqrt(12)). 20sqrt(7) Simplify ((3 + (sqrt(500)-2-4 - sqrt(500)) + 1)5)2. 14000sqrt(5) + 612900 Simplify 5(sqrt(72)/sqrt(16))/(1sqrt(9)3)-3. -5sqrt(2)/2 Simplify ((1 + ((sqrt(30) - -1sqrt(30))6)/sqrt(10))-5)*2. 600sqrt(3) + 10825 Simplify ((sqrt(95) + 32sqrt(95) + sqrt(95) + -1sqrt(95)2)/((sqrt(1210)-3)/sqrt(2)))2. 76/121 Simplify -5(sqrt(704)-1)/(sqrt(48)/sqrt(108))-5. -300sqrt(11) Simplify (-2((sqrt(156) - (sqrt(156) - (-1sqrt(156) + sqrt(156))))-1 - sqrt(156)))/(sqrt(72)/(sqrt(54)-2 + sqrt(6))). -10sqrt(13) Simplify (sqrt(66)/(sqrt(6) + 1sqrt(6)5 + sqrt(6) + sqrt(6)) + sqrt(132)/(sqrt(12) + 4sqrt(588) + sqrt(12)))2. 3971/14400 Simplify sqrt(21)/sqrt(3) + 4 - sqrt(14)/sqrt(2)-4 - (sqrt(7) + -2 + 0 + (sqrt(7) - (1sqrt(7) + -5)2)). -7sqrt(7) + 38 Simplify (-3 + -5(sqrt(5) + -2)4 + -3)-3. -102 + 60sqrt(5) Simplify 1((-2(sqrt(1100) + -2 + sqrt(1100)))*2 + -4). -320sqrt(11) + 17612 Simplify sqrt(88)/(3sqrt(392)) + sqrt(132)/(sqrt(300)1 + sqrt(300) + sqrt(300) - sqrt(12)). 5sqrt(11)/42 Simplify ((sqrt(8) + sqrt(24)/(-1sqrt(3)))/sqrt(4))*2 - (-3 + sqrt(18) + sqrt(2) + -3sqrt(18))*2. -59 - 30sqrt(2) Simplify -2 + ((sqrt(2448) + -2 + 3 + sqrt(2448))-5)2-2. -489652 - 2400sqrt(17) Simplify -4sqrt(352)/sqrt(8) + -3 + sqrt(11)3-5. -23sqrt(11) - 3 Simplify 26((-1sqrt(24)/sqrt(2))/((sqrt(120)/sqrt(4))/sqrt(5)))*21. 24 Simplify (sqrt(208) + -1 + sqrt(208) + -4)*2-2 - ((2 + sqrt(208) + 0 + sqrt(208))*2 + (sqrt(208) + 1 + sqrt(208) + sqrt(208) - sqrt(208))2). -2552 + 112sqrt(13) Simplify 6(-4(-2 + sqrt(605))4)*22. -135168sqrt(5) + 1870848 Simplify 0 + ((sqrt(52) + 1)-2 - (sqrt(208) + 5)*2) + -2. -237 - 44sqrt(13) Simplify 6((sqrt(1700) + 2 + 2 - sqrt(1700)) + -2 + 4). 36 Simplify ((sqrt(2057) + sqrt(2057)-2-5)2 - sqrt(2057)) + (sqrt(2057) + (-1 + sqrt(2057) + sqrt(2057))2)1 + 0. -44sqrt(17) + 257126 Simplify (-3(-5sqrt(1100)2 + 0 + -2sqrt(1100) - (2 + (sqrt(1100) - (sqrt(1100) + (-1 + sqrt(1100) - sqrt(1100)) + sqrt(1100) + 2)))))2. 1980sqrt(11) + 1197909 Simplify (sqrt(2736)2 + -2)2 + sqrt(2736) - ((sqrt(2736) - (2 + -1 + sqrt(2736)))2 - sqrt(2736)). -72sqrt(19) + 10947 Simplify (4sqrt(135)/sqrt(3)6)/(-5(sqrt(324) + (sqrt(324)-2 + sqrt(324) - sqrt(324) - sqrt(324)) + sqrt(324))). 4sqrt(5)/5 Simplify ((2 + sqrt(1088))5 + 3 + -3)35. 150 + 600sqrt(17) Simplify (5 + sqrt(891)-2-3 + sqrt(891) + sqrt(891)-21 + sqrt(891))2. 540sqrt(11) + 32101 Simplify 5((5sqrt(1100) + sqrt(11))4)25. 11444400 Simplify (-53sqrt(117))/((sqrt(360)/sqrt(8) + sqrt(45))/sqrt(5)). -15sqrt(13)/2 Simplify 2 + (sqrt(76)/((sqrt(484) + sqrt(484)3 - sqrt(484)) + sqrt(484) + sqrt(484)))*2-3. 5993/3025 Simplify ((sqrt(180)-2)/sqrt(12))/sqrt(5) + 5 + (sqrt(45)/sqrt(3))/sqrt(5). -sqrt(3) + 5 Simplify 2((sqrt(98) + sqrt(98)-5 + 3 - sqrt(98))-56)2. -378000sqrt(2) + 4426200 Simplify -2 + 2 + -4 + -4 + sqrt(475). -8 + 5sqrt(19) Simplify -3 + (-1(4 + 1 + sqrt(7)) - 4sqrt(448)2)*2. 650sqrt(7) + 29597 Simplify (-5 + (sqrt(17) + 0 - sqrt(17)) + 0 - (-1 + sqrt(833) - (sqrt(272) + sqrt(272) + 1 + sqrt(272))))*26. -180sqrt(17) + 2604 Simplify ((3 + sqrt(1377) + 5 + 5 + -5)3)*2. 1296sqrt(17) + 12969 Simplify ((sqrt(90)/sqrt(2))/sqrt(9) + -5 + ((sqrt(720) + -2)-1 - sqrt(720))2)4. -380sqrt(5) + 11516 Simplify (-5 + (sqrt(300) + 2)6 + -1sqrt(300)1)*2. 700sqrt(3) + 7549 Simplify ((-1 + -4 + (sqrt(1053) + sqrt(1053) + (0 + sqrt(1053) - sqrt(1053)))6)1)*2. -1080sqrt(13) + 151657 Simplify ((0 + sqrt(112))-4 + 1 + sqrt(252) + -5)2 + 3. -20sqrt(7) - 5 Simplify (sqrt(3) - (sqrt(48) + -5) - (sqrt(3) + -1)-4) + 0 + ((-1sqrt(192))2 - sqrt(192)). -7sqrt(3) + 193 Simplify (sqrt(475) - (sqrt(475) + sqrt(475)2 + 2)2) + (2 + sqrt(171) + sqrt(19) + sqrt(19) + 1sqrt(19) + 3)*2 + -1. -3571 + 5sqrt(19) Simplify (sqrt(171) - (sqrt(171) + 4sqrt(171)1))/(sqrt(360)/sqrt(10)). -2sqrt(19) Simplify ((2sqrt(85)-1)/(3(sqrt(5) + sqrt(5) + sqrt(80)))-5 + 3)2. 10sqrt(17)/3 + 1154/81 Simplify 5 + ((-1(sqrt(204)2)/sqrt(12))*2 - (5(sqrt(425) + 0) + sqrt(425))*2) + 1. -15226 Simplify (sqrt(24)/(-62sqrt(12)))2 + 3 - 4(55(sqrt(8)/sqrt(4) - sqrt(2)))*2. 217/72 Simplify -2 + sqrt(34)/sqrt(2) - (sqrt(425)-1)*2 - (-5(sqrt(17) - (sqrt(17) + 0) - sqrt(17)) + sqrt(34)/sqrt(2) + 2)*2. -1043 - 23sqrt(17) Simplify ((sqrt(405)-2 - sqrt(405)) + -5 + 2(sqrt(45) + 0))*2. 210sqrt(5) + 2230 Simplify -4(-2 + sqrt(187)/sqrt(176) + -5 + sqrt(153) + sqrt(51)/sqrt(48)). -14sqrt(17) + 28 Simplify (sqrt(76) + sqrt(76)25 - sqrt(76))/sqrt(4) + (4 + (sqrt(19) - 1sqrt(19)-4))*2. 50sqrt(19) + 491 Simplify (sqrt(384) + sqrt(384) + 3sqrt(384)2 + sqrt(384))/(sqrt(60)/(sqrt(10)/sqrt(2))). 36sqrt(2) Simplify 0 + (5(-1 + sqrt(1008))6 - (41sqrt(1008) + sqrt(1008))-4)*2. -36000sqrt(7) + 2520900 Simplify -4 + (-4 + sqrt(117) + 1 + -5 - 2((sqrt(117) + 0)-3)*2). -2118 + 3sqrt(13) Simplify (-1 + sqrt(405) + -5)*2 - sqrt(30)/(sqrt(18)/(sqrt(3)2)). -110sqrt(5) + 441 Simplify ((-2sqrt(6)/sqrt(2))*2 + sqrt(3) - sqrt(30)/(sqrt(10)-2 + sqrt(10))) + sqrt(24)/(sqrt(1400)/sqrt(7)). 11sqrt(3)/5 + 12 Simplify ((sqrt(3) + 0)2 + 2 - ((-2 + sqrt(3))2 + 3)) + -4. -9 + 4sqrt(3) Simplify ((sqrt(189)2 - sqrt(21))3)/(sqrt(49)/(sqrt(21)/sqrt(3)) - (sqrt(7) - sqrt(448)2)). 15sqrt(3)/16 Simplify 1 + sqrt(300) - sqrt(3) - (sqrt(3) + 1)-2 - (sqrt(18)-2)/sqrt(6)3. 3 + 17sqrt(3) Simplify sqrt(14)/((-1sqrt(6))/sqrt(3)) + (2 + 1sqrt(847))*2. 43sqrt(7) + 851 Simplify -1(6(sqrt(684)-3 + sqrt(684) - sqrt(684))2 + (-1sqrt(171))*2-4). -36252 Simplify 0 + (5(-2sqrt(3) + 3) + (sqrt(27) - (sqrt(81) - -2sqrt(81))/sqrt(3))/sqrt(9))2. -360sqrt(3) + 657 Simplify 2((sqrt(330) + (1sqrt(330) - sqrt(330)))/sqrt(6))/(sqrt(60)/(sqrt(24)/sqrt(2))) + 4. 4 + 2sqrt(11) Simplify (sqrt(140)/sqrt(4)3)/(-4sqrt(500) + sqrt(5)). -sqrt(7)/13 Simplify (1(sqrt(121) - (sqrt(121) + (sqrt(121)3 - sqrt(121))) - sqrt(121))-4)/(sqrt(264)/(3sqrt(6))). 18sqrt(11) Simplify (-1(-1sqrt(190) - sqrt(190)) + sqrt(190) + -6(sqrt(190) - sqrt(190)1))/(sqrt(10) - 1sqrt(10)-5 - sqrt(20)/sqrt(2)-4). 3sqrt(19)/10 Simplify (sqrt(44)/sqrt(275))/(sqrt(200) + sqrt(200)-4) + 1. -sqrt(2)/150 + 1 Simplify -4((sqrt(98) - sqrt(98)4) + 5 + (sqrt(98) + (sqrt(98) - (sqrt(98) + 2 - sqrt(98)))1 + sqrt(98))*2). -3564 + 420sqrt(2) Simplify (sqrt(648)-3 + sqrt(8))2 + (sqrt(200) - (sqrt(200) + 2 + sqrt(200) + 3)2). -190sqrt(2) + 4583 Simplify (2 + 2(sqrt(20) + 2) + sqrt(2420) + 2 + 2)2. 520sqrt(5) + 3480 Simplify ((sqrt(52)-1 - (sqrt(65)-2)/sqrt(5))5)2 + ((-2sqrt(91) + sqrt(91))4)/(-1sqrt(63)). 4sqrt(13)/3 Simplify ((sqrt(343) + -1sqrt(343))-4 - (sqrt(343) + sqrt(343) + 1 + 0 - sqrt(343))2)-6 + -4. 84sqrt(7) + 2060 Simplify (1sqrt(7260))/(sqrt(1728)-1 - sqrt(1728))-6. 11sqrt(5)/4 Simplify (3(-2 + sqrt(55)/((sqrt(240)/sqrt(4))/sqrt(12)))5)2-6. -20250 + 5400*sqrt(1	{ "pile_set_name": "DM Mathematics" }
0. -1, 0, 1 Let m be 69/24/3. Let y be (-4)/14 + m/14. Factor yo + 4o2 - 6o*2 - o. -2o(o - 1) Let x be (4/7)/((-52)/28 - -2). Factor -2/9b + 0 + 2/9b3 - 2/9b*x + 2/9b*2. -2b(b - 1)2(b + 1)/9 Let h(f) be the second derivative of 0f2 + 1/36f*4 - 4f + 0f3 + 0. Factor h(g). g2/3 Suppose 2 = 2z + 8. Let w(k) = -2k2 + 4k + 10. Let c(i) = -2i2 + 3i + 11. Let t(y) = zw(y) + 2c(y). What is h in t(h) = 0? -1, 4 Let y(c) be the second derivative of c8/3360 + c7/560 + c6/240 + c5/240 + c*3/6 + c. Let q(z) be the second derivative of y(z). Factor q(h). h(h + 1)*3/2 Let g(z) be the first derivative of 2z5/5 + z4/4 - 2z3/3 - z2/2 - 6. Factor g(j). j(j - 1)(j + 1)(2j + 1) Factor -27 + 36a + 3/4a3 - 39/4a*2. 3(a - 6)*2(a - 1)/4 Let i be 1/(-3) - (-143)/195. Let g(f) be the first derivative of 0f3 + if*5 + 0f*4 + 0f + 1 + 1/3f6 + 0f*2. Factor g(x). 2x*4(x + 1) Let f(p) = p*2 - p. Let b be f(0). Let k = -38 - -40. Find x, given that -8/5 + bx + 6/5xk + 2/5x3 = 0. -2, 1 Let w(q) = q4 - 29q3 - 31q*2 + 25q + 26. Let f(j) = 30j3 + 30j*2 - 25j - 25. Let r(n) = 4f(n) + 5w(n). Factor r(b). 5(b - 6)(b - 1)(b + 1)2 Let t(u) be the first derivative of u7/5460 - u6/2340 - u5/390 - u3/3 + 7. Let n(k) be the third derivative of t(k). Suppose n(o) = 0. What is o? -1, 0, 2 Let i(u) be the third derivative of -u6/30 + u4/2 - 4u*3/3 + 8u*2. Factor i(k). -4(k - 1)*2(k + 2) Suppose 0 = 4d - d + 111. Let n = 113/3 + d. Find t such that 2t*2 + 2t + 2/3 + nt3 = 0. -1 Let r(l) = -l5 + 2l*3 + 3l*2 - 4l - 3. Let g = -7 - -9. Let y(t) = -t*2 + t + 1. Let z(o) = gr(o) + 6y(o). Factor z(b). -2b(b - 1)2(b + 1)*2 Factor -3/2q*2 - 3/2q*5 + 3/2q*3 + 3/2q*4 + 0 + 0q. -3q2(q - 1)*2(q + 1)/2 Let q be ((-10)/(-7) - (-24)/42) + 0. Factor -1/8aq - 1/8a + 1/4. -(a - 1)(a + 2)/8 Suppose 5r = -4j, -3r - 17 = -5. Let h(f) be the first derivative of 0f3 - 3/5f*j + 0f*4 + 0f - 1/2f6 + 2 + 0f*2. Solve h(t) = 0. -1, 0 Let c(w) be the second derivative of -3w*4/4 - 10w*3/3 - 2w*2 + 3w. Determine i so that c(i) = 0. -2, -2/9 What is l in -23/4l + 5l*2 + 3/2 = 0? 2/5, 3/4 Let o be 61(0 + (-5)/(-10)). What is p in -1/3p*o + 2/3 + 0p2 + p = 0? -1, 2 Let f(g) be the first derivative of -g6/105 + g*5/70 - 3g - 2. Let u(a) be the first derivative of f(a). Find b such that u(b) = 0. 0, 1 Let a = -2 - -4. Let u(j) = j*3 + 4j2 - j - 4. Let i(p) = -p2 + 1. Let b(q) = -q + 2. Let l be b(1). Let m(v) = ai(v) + lu(v). Solve m(x) = 0 for x. -2, -1, 1 Let g = 4033 - 1451879/360. Let o(u) be the third derivative of gu6 + 1/9u*3 - 1/72u4 - u2 + 0 - 1/90u5 + 0u. Factor o(k). (k - 2)(k - 1)(k + 1)/3 Let o(y) = y4 + y3 - y*2 + y. Let v(w) = 9w*4 + 11w*3 - 7w*2 + w - 2. Let p(l) = 6o(l) - v(l). Factor p(r). -(r - 1)(r + 1)2(3r + 2) Suppose -3f = -w - 0w - 8, -f = 5w - 8. Determine q, given that 2q4 + 3q*4 - 3q4 - qf - 2q + 3q*3 - 2q2 = 0. -1, 0, 1 Let k(g) be the third derivative of g8/1512 - g7/315 - g6/270 + g5/45 + g4/108 - g*3/9 + 8g*2. What is f in k(f) = 0? -1, 1, 3 Let o = 62 + -123/2. Let b(i) be the first derivative of oi4 - i2 - 2 + 4/3i - 4/9i*3. Factor b(q). 2(q - 1)(q + 1)(3q - 2)/3 Let k(n) be the second derivative of -n6/1440 + n4/96 - n3/6 + 2n. Let o(b) be the second derivative of k(b). Factor o(i). -(i - 1)(i + 1)/4 Let m(y) be the second derivative of -y5/60 + y2 - 3y. Let g(v) be the first derivative of m(v). Factor g(a). -a*2 Let y(j) be the first derivative of 1/210j5 - j2 + 1 + 1/84j4 + 0j*3 + 0j. Let w(k) be the second derivative of y(k). Determine m so that w(m) = 0. -1, 0 Let c(m) be the first derivative of -m5/90 - m4/18 + 4m2 + 6. Let y(d) be the second derivative of c(d). Factor y(a). -2a(a + 2)/3 Let u = -17 + 17. Factor c4 + uc*3 + 0c*3 + 4c*5 - 4c*3 + 3c*4 - 4c*2. 4c*2(c - 1)(c + 1)2 Let h(n) be the second derivative of 8n*7/7 - 124n*6/45 - 53n*5/20 + 181n*4/36 - 8n*3/3 + 2n*2/3 + 23n. Suppose h(j) = 0. Calculate j. -1, 2/9, 1/4, 2 Let s(m) = -36m3 + 45m*2 + 15m - 66. Let n(c) = -7c3 + 9c*2 + 3c - 13. Let p(a) = -21n(a) + 4s(a). Factor p(f). 3(f - 3)(f - 1)(f + 1) Let m be 0 + (3/(-3) - -2). Suppose -2j - 5j2 - j - m + 4j*2 - 1 = 0. What is j? -2, -1 Let f be ((-2)/21)/(11/(-33)). Let p(x) be the first derivative of -fx + 2/7x2 - 2/21x*3 - 1. Find t such that p(t) = 0. 1 Let p = 15 - 12. Factor 0d*5 + 3d*2 + 9d*4 + 0d*4 + 9d*p + 0d*5 + 3d*5. 3d*2(d + 1)*3 Let r(n) = 4n + 32. Let y be r(-8). Let v(i) be the first derivative of -1/3i3 - 5/8i*4 + yi + 2 + 0i2 - 2/5i*5 - 1/12i6. Factor v(j). -j2(j + 1)2(j + 2)/2 Let a(y) be the second derivative of -1/45y5 - 2y + 1/54y4 + 0 - 1/9y*2 + 2/27y*3. Factor a(v). -2(v - 1)(v + 1)(2v - 1)/9 Let j be (-4)/(-3)(480/66 + -7). Factor -jr - 10/11r*2 + 6/11. -2(r + 1)(5r - 3)/11 Suppose -3l + 13 = -2. What is f in -4f*3 + 3f*3 + lf - f*3 - 3f = 0? -1, 0, 1 Let u = -10 - -8. Let b be (9/(-6) - 0)u. Suppose 3 + 12v*2 + 2v*b + 4v + 7v3 - 3 = 0. Calculate v. -2/3, 0 Let d = -4/89 + 222/979. Determine y so that 162/11 + 216/11y + 108/11y2 + dy*4 + 24/11y*3 = 0. -3 Suppose -19 = 5y - 54. What is c in yc5 - 71/4c*4 + 0 - 19/4c*2 + 1/2c + 15c3 = 0? 0, 1/4, 2/7, 1 Let v be -1 - (2 + -1) - -5. Let w(x) = x3 - 2x*2 - x - 4. Let s be w(v). Suppose -2c + 2c2 + sc*3 - 4c*4 + 5c*4 - 3c4 = 0. What is c? -1, 0, 1 Let k(c) be the first derivative of c6/1080 + c5/360 - c4/36 + 2c3/3 - 2. Let l(w) be the third derivative of k(w). Let l(g) = 0. Calculate g. -2, 1 Let a(j) be the second derivative of j7/420 + j6/120 - j4/24 - j3/12 + j2 + 3j. Let m(o) be the first derivative of a(o). Factor m(h). (h - 1)(h + 1)3/2 Suppose g4 + 1/4g*5 - 3g*2 - 1/2g*3 + 0 + 9/4g = 0. What is g? -3, 0, 1 Let v(m) be the first derivative of 3m5/25 + 3m*4/10 - 3m*2/5 - 3m/5 + 3. Solve v(q) = 0 for q. -1, 1 Let z(k) = k. Let c be z(-2). Let n = 0 - c. Solve -2o2 + 2o + 2o4 - no*3 + 0o*3 + 0o*3 = 0. -1, 0, 1 Let 0 + 0w - 6/5w4 - 6/5w*3 - 2/5w*2 - 2/5w*5 = 0. Calculate w. -1, 0 Let y = -31 - -22. Let o be (1 + y)(2 + -3). What is a in 2a3 + oa*4 - 4a*4 - 6a*2 - 6a*2 - 14a - 4 = 0? -1, -1/2, 2 Let d = -144 + 2161/15. Let s(r) be the second derivative of -3/50r5 + r + 2/15r*4 + 0 - 2/5r*2 + dr*3. Factor s(y). -2(y - 1)*2(3y + 2)/5 Suppose 0w = -5k - 3w - 4, w = -3. Suppose j - q + 2 = 0, -k + 3 = -5j + q. Factor 1/4n*3 - 1/4n*2 + j - 1/4n*5 + 0n + 1/4n4. -n2(n - 1)*2(n + 1)/4 Determine o, given that 0 - 2o5 + 4/7o*3 + 10/7o*4 + 0o*2 + 0o = 0. -2/7, 0, 1 Suppose 6j - 3j - s = 17, -5j = 3s - 19. Let o = j + -3. Solve -8g4 - 1 - 2g*5 + 1 - 8g*o - 12g*3 + 2g - 4g = 0. -1, 0 Let 3 - 95y + 92y + 13y*2 - 3 - 4y*3 = 0. What is y? 0, 1/4, 3 Let y(d) be the third derivative of 32d*6/75 + 16d*5/15 + 17d*4/30 + 2d*3/15 - 3d*2. Factor y(u). 4(u + 1)(8u + 1)2/5 Let w(r) = -r3 + 5r2 + 2r - 6. Let z be w(5). Suppose 2j + za - 20 = 0, -j + 4a - 16 = -2. Factor 0q - 2/11q3 + 0 - 2/11q*j. -2q*2(q + 1)/11 Let i(l) be the second derivative of l*8/960 + 5l7/756 + l6/180 - l5/45 + l4/3 + 2l. Let b(p) be the third derivative of i(p). Factor b(h). (h + 2)(3h + 2)(7h - 2)/3 Let b(y) = y3 + 6y*2 + 9y + 2. Let x be b(-2). Factor -1/4j + 1/4j*5 + 0j*3 + x - 1/2j*2 + 1/2j*4. j(j - 1)(j + 1)3/4 Let s(w) be the second derivative of 3w4/4 - w3/2 - 3w2 + 16w. Factor s(m). 3(m - 1)(3m + 2) Suppose 12 - 3 = 3r. Find h, given that 0h3 + h5 + h - 3 + 3 - 2h*r = 0. -1, 0, 1 Factor -2/9n*2 - 2/9n + 4/9. -2(n - 1)(n + 2)/9 Let u(k) = 4k + 4. Let f(g) = -g - 1. Let m(s) = -5f(s) - u(s). Let l be m(1). Let 8/7b + 0 + 8/7b*l + 2/7b**3 = 0. Calculate b. -2, 0 Let b = 3211/15 + -214. Let t(p) be the first derivativ	{ "pile_set_name": "DM Mathematics" }
positive. r(-169/7) Simplify (k(-17)/(k(k/(k/(kk*(-2/19))))/kkk))/(k/(k(-9)/k)k)(1/16) assuming k is positive. k(-1569/76) Simplify oo(-20)o*(-21)o*(-29)o(-30) assuming o is positive. o(-99) Simplify (l(3/4))(-2)(lll(-2))(-9) assuming l is positive. l(-3/2) Simplify ((v(2/5)/vv(-6/5)/v)/((v/(v9/v))/(v/(vvv/(v/(v/(v/((v/((v/(v/(v/((vv(-2/11))/v))))/v))/v))))))))(-2/41) assuming v is positive. v(-372/2255) Simplify ((x((xx(-15))/x)/x)/(x/(xx/(x/x19))))/((x/x(-12/13))/(x(x/(x(-3/16)/x))/x)) assuming x is positive. x(887/208) Simplify g(3/8)gg(-3/5)g(((ggg15)/g)/g)/((gg*(-14/5)g)/g) assuming g is positive. g(743/40) Simplify (b/(b/b(-3))bb*(-4)(b/b(-3))/b(-4/3))31 assuming b is positive. b(-62/3) Simplify ((((s/s*(-16)ss)/ss)/s)/s17)/(s(-1/12)s(4/5)) assuming s is positive. s(17/60) Simplify (((uu*(-13))/u)/(u/(uu*(-2)uu)))/((uu*4u)/((u/u(-6/17))/u)) assuming u is positive. u(-317/17) Simplify (y/(yy/y0)y(2/9))(-22) assuming y is positive. y*(154/9) Simplify (((nn/((n/n*10)/n))/n)/((nn/n*(2/11)n)/nn))/(n(-4)/n)(-44) assuming n is positive. n(-2330/11) Simplify ((q/(q/q(2/29)q)q/(qq*(-2/13))q)47)(-38) assuming q is positive. q*(-150024/377) Simplify ((dd*(-9/5)d)/d)(32/5)/(d(2/11))(-2/93) assuming d is positive. d(-130844/25575) Simplify g28/(g/g(4/5)g)(((ggg*(-7)g)/g)/g)/(gg(-32)) assuming g is positive. g(259/5) Simplify (((ttt(3/4))(-40))39)(7/5) assuming t is positive. t(-6006) Simplify (((f5/fff)/f(-2/11))/(f(-1)f/f(5/4)))6 assuming f is positive. f(981/22) Simplify ((z(-1/4))(-48)/((z/z0)/(z/z(-6))))(-1/25) assuming z is positive. z(-18/25) Simplify y(-1/3)y(-7/3)/yy*13yy2 assuming y is positive. y(37/3) Simplify (s/s(-7))(-42)/((s(1/5)s)/s)(22/3) assuming s is positive. s(-5062/15) Simplify (q12)31(q/(q(-10/7)/q))39 assuming q is positive. q(3540/7) Simplify ((p(2/39)/p)/p14)/(pp/(p/p*1p))16 assuming p is positive. p(-1207/39) Simplify (((ww/(w(w(-2/7)/w)/w))24)(-32/7))40 assuming w is positive. w(-706560/49) Simplify (j1)*2(j(j(1/5)/j)/jj)*(-10) assuming j is positive. 1 Simplify (v(vv/(v/(((v/(v/v(3/5)v))/v)/v)))/v)*(-29/4)v*(1/12)/(v/(vvv(-4)/vvvvv)) assuming v is positive. v(307/30) Simplify ((((k/k1)/k)/k)(13/4)/((k/k(-5))/(kk4)))22 assuming k is positive. k(-165) Simplify (i/(i/i(-1/4))i/((i(i/(((ii/i(-3/4))/i)/i))/i)/ii))/(i/(i((i0/ii)/i)/i))(-19/3) assuming i is positive. i(79/6) Simplify (u*7u*(-2/33))/(u(u3/u)/u)(-30) assuming u is positive. u*(2209/33) Simplify (n/(n/(n/((nn*(4/11)n)/n))))(-1/51)/(n(2/21))(6/7) assuming n is positive. n(-2048/27489) Simplify (j(-6))(-24)/(j/j(2/3))(-5/2) assuming j is positive. j*(869/6) Simplify (hh/(h/(h*(6/5)h)))*23(h/(hh22)h)/hh(-1/4) assuming h is positive. h(1027/20) Simplify nnn/(n/(n/n(3/4)))n*(-31)n(-18)/n(-2/45) assuming n is positive. n(-8407/180) Simplify (r(-15)/r*(-1/15))/(r(rr/r(-4/11))/rr(-10)/r) assuming r is positive. r(-1039/165) Simplify (((h*(1/4)h)/hh((h*(-3)/h)/hh)/h)/(h*6h*2h))(-6) assuming h is positive. h(153/2) Simplify s/(s/s*22)s*25/s(sss/(sss*(2/29)s)s)49 assuming s is positive. s(2657/29) Simplify ((k/(kk20/k))/(k/(k/k(-3/11))))/(k*17kkkk10/k) assuming k is positive. k(-525/11) Simplify ((i2/i)/ii/(ii(-2/19)i))/(i0/i)44 assuming i is positive. i(819/19) Simplify (a(1/4))47/(a/a7aa/(a0/a)) assuming a is positive. a(59/4) Simplify (t*14t(-6))/(t6t10) assuming t is positive. t(-8) Simplify (n3nn/n(2/5))(-12) assuming n is positive. n(-276/5) Simplify ((o/o(-3/5)o)/o*(-10/7))/((o/(oo1))/o)(1/60) assuming o is positive. o(853/210) Simplify n(-3/8)nnn(1/4)n*14n*(-3/11)n assuming n is positive. n(1461/88) Simplify (k(1/7))(12/11)/(k/(k(1/3)k))11 assuming k is positive. k(883/231) Simplify ((y(-6/5)/y)/yy)*9y*(-7)y3 assuming y is positive. y(-119/5) Simplify (k(-28)/k(-28))/(((k/k21)/k)/(k(-3/11)k)) assuming k is positive. k(239/11) Simplify ((v/(v/(vv/(v/(vv/(v/(v(vv25)/vvv)v)vv))v)))/(((v1/v)/v)/v))/((vv*(2/9))/vv(5/11)) assuming v is positive. v(3299/99) Simplify ((u/(u*(-5)u))/u)*10(u(2/7))(-2/5) assuming u is positive. u(1396/35) Simplify (h(-2/7)/h)(18/5)/(h12hhh2hh) assuming h is positive. h(-792/35) Simplify (uu(1/4))(-44)(u4/uu)(1/22) assuming u is positive. u(-603/11) Simplify (v*1v*10vv(-3/2)v/(v(2/3)/v))(-21/4) assuming v is positive. v*(-497/8) Simplify (d((dd/d(-1))/ddd)/d)42(d/(((d(d/((d(7/4)d)/d))/dd)/dd)/d))/(dd(2/51)) assuming d is positive. d(34417/204) Simplify ((j/(jjj(15/4)j))/(jj(-7/2)))(2/7) assuming j is positive. j(-13/14) Simplify ((bbb0b)/b)(2/23)/(b/b(7/3)(b/b(2/3))/b) assuming b is positive. b(50/23) Simplify ((x(-1/6)/(x/(xx*(-1/3)xx)))(-48))(3/38) assuming x is positive. x(-108/19) Simplify (ss*(2/11))/((s/(sss10))/s)(s/((s/(s2/s))/s))(-47) assuming s is positive. s*(-889/11) Simplify r/(rr*(-6))rrr*(-4/9)(r/(rr(-11)))/(r(1/22)r) assuming r is positive. r(3467/198) Simplify (o/o(-9/4)(o/((oo/(ooooo*(-9/4))o)/o)o)/o)/((ooo1/o)/o3) assuming o is positive. o5 Simplify (((ll(-2/29))/l)/l(-15/4))/(l*(2/61)l*(-4/5)/ll) assuming l is positive. l*(157379/35380) Simplify (xx*(-2/19)x(xx*(-1/2)x)/x)/((x/(x(2/9)/x))/x)5 assuming x is positive. x(-511/342) Simplify (((x/x(-15)x)(-22))25)(-19) assuming x is positive. x177650 Simplify ((b(1/9)b(1/6))(8/5))8 assuming b is positive. b(32/9) Simplify (q/q(-14))/(q/q(-27))(q/((q/(q/q(-1/8)))/q))/qq*17q assuming q is positive. q(49/8) Simplify ((h7/(h/h*(-6/7)h))(-2/3))(-1/2) assuming h is positive. h(29/21) Simplify ((w(-2/3))*(-34)(ww/(w/(w/w(-1/2)))w)(4/25))8 assuming w is positive. w*(13936/75) Simplify ((j/(jj*1)j)*(-3/7)j/((j*(-4/5)j)/j)j0/j)(2/15) assuming j is positive. j(8/75) Simplify (w(-5/3)/w(1/19))/(w/((w(-11)w)/w)w/w8) assuming w is positive. w(-383/57) Simplify (((s/(s(-2/27)/s))/s)/s(-1/5))/(s(1/14)/(s(2/31)/s)) assuming s is positive. s(15653/58590) Simplify (((v(-1/6)/v)/v)/vv/v*4v)/((v*10v)/v(-1/4)) assuming v is positive. v(-197/12) Simplify (((v(v/v(1/5))/v)/v)/(v(1/13)v))/((vvv*(2/5))/vv/(v/(v/(vv(vv3v)/vv)))v) assuming v is positive. v*(151/65) Simplify (((g/(g/(g/(g(g/(ggg*6))/gg))))/g)/g*(-2/9)g/((g/g*4)/g)(gg4/g)/g)50 assuming g is positive. g(6400/9) Simplify x/(xx*2)xxxx(4/3)x(-2/7)/x(-7) assuming x is positive. x(190/21) Simplify (l/(l(-5)l)l*10)/(((ll/l*4ll)/l)/l)(-6) assuming l is positive. l3 Simplify (l/((ll*(1/10)/l)/l))/((lll/(l/(l/(l11ll))))/ll)l6/(l(-1/5)/l) assuming l is positive. l(191/10) Simplify (z/(z(z*(1/10)zz)/z))/zzz(-2/3)zz(-4/11)zzz(-9) assuming z is positive. z(-2683/330) Simplify (k(-4/11))(-7)((kk/k*(-3/19)kk)/k)/(k(4/23)kk) assuming k is positive. k(16966/4807) Simplify (n/((nn*(-7/2)/n)/n)nn/(n/(nn*(11/4)))nn)5 assuming n is positive. n(245/4) Simplify (((xx*14)/((xx/((((x/(x*(-3/5)x))/xx)/xx)/x)x)/x))(-48))(-41) assuming x is positive. x(123984/5) Simplify ((h/(hh1))(-14/3)/(h*(-3)h/(hh/h(-3/4))))47 assuming h is positive. h(5311/12) Simplify ((k/(k/(kkk(-10))k)k)/k)(-2/107)(k/k(-1/5))/k(-5) assuming k is positive. k(3407/535) Simplify ((w(-2/3))*(-9)/((w(w*5w)/ww)/(wwww/(ww/(www1)))))(-30) assuming w is positive. w(-120) Simplify (w34w(-5/13))(-4/21) assuming w is positive. w(-1748/273) Simplify (b(-2))(-8/9)/((b/(b/b5b))/(b/(b/((b/(bb12))/b)))) assuming b is positive. b(-137/9) Simplify (((q/q**(-1/14))/(q	{ "pile_set_name": "DM Mathematics" }
-452 + 694. Is z a multiple of 11? True Suppose -2117 = -12i - 665. Does 29 divide i? False Let l(q) = 17q + 7. Let t(j) = 2j - 8. Let r(s) = s - 1. Let d(x) = 12r(x) - 2t(x). Let n(i) = -7d(i) + 3l(i). Is n(-5) a multiple of 10? False Let t(b) = -74b - 1040. Is 7 a factor of t(-15)? True Does 20 divide ((-28)/16 - 6)-160? True Let f(a) = -2a*3 - 11a*2 - 4a + 15. Suppose 3 + 4 = -c. Is f(c) a multiple of 10? True Suppose -2o + 3m + 52 = 0, 0 = -5o - m - 2m + 109. Is 4 a factor of o? False Suppose 6u = 5u + 77. Let g = -17 + u. Does 5 divide g? True Suppose 4c - 2006 = 2w, -894 - 613 = -3c + w. Is 56 a factor of c? True Let a be 2(0 - -2) + 11. Let y(z) = -2z + 15. Let q be y(8). Is (q + 3)/(3/a) a multiple of 5? True Let m be (-1)/6 - -863/36. Suppose 0 = -4f - 5h + 285, mf - 4f = 5h + 205. Is 10 a factor of f? True Let p be -1 + 4 - 15/(-5). Suppose 0 = pw - 4w + 2. Is 22 a factor of (21-2)/w + 2? True Suppose -3r + 7 = 43. Let n be 0 - -3 - r/(-3). Does 7 divide 54/(4 + n) + 3? True Let x = 3 + 0. Suppose xp = -94 - 110. Let j = p - -128. Is 12 a factor of j? True Suppose -43x + 44x = 279. Does 10 divide x? False Let i(p) = 3p2 + 6p - 13. Let v be i(15). Suppose -1808 - v = -16z. Is 10 a factor of z? True Let n be (-3)/(-7) + -3(-1048)/(-84). Let l = -6 - n. Is 7 a factor of l? False Let w(h) = -1 - 2h2 - 12h + 11h2 - 6 + 3 - h3. Does 3 divide w(7)? False Let j(g) be the first derivative of 7g3/3 - g2/2 - 2g + 8. Is 8 a factor of j(2)? True Let s(d) = -2d + 20. Let f be 1/840. Suppose 3j + j + 32 = f. Does 9 divide s(j)? True Let f(z) = -8z - 2. Let w(s) = 16s + 5. Let o(g) = 9f(g) + 4w(g). Does 6 divide o(-2)? True Does 15 divide ((-31)/4 - 0)/(6/(-192))? False Let k(q) = q2 + 15q - 59. Is k(-27) a multiple of 22? False Does 8 divide ((-224)/(-84))/(1/(333))? True Let d(r) = 152r + 25. Is 22 a factor of d(2)? False Let i = 54 + 58. Suppose -2r - 40 = -4x + 116, -3x + 4r + i = 0. Does 11 divide x? False Let a(x) = -23x3 - 3x*2 + x + 1. Let c be a(1). Let l = 16 - c. Is l a multiple of 8? True Let w = 1865 + -1333. Is 14 a factor of w? True Let l be (-4)/(2 + (-36)/16). Suppose -t - l = -5t. Suppose 0y + 163 = 3y - 2i, 0 = ty - 5i - 208. Is 17 a factor of y? False Suppose 0 = -3r + 2r + 3d + 2274, -4d = -3r + 6832. Suppose -h + r = -5h. Does 5 divide h/(-45) + 4/(-6)? False Let g(i) = -i3 + 7i*2 + 8i - 8. Let z = 22 + -19. Suppose zh - 35 = -2h. Is 12 a factor of g(h)? True Let z = 690 - 688. Let v be 221/2. Is 8 a factor of v(-2 - -7)z? False Let i = -83 + 80. Let a = 62 - -70. Is i - a/(0 - 4) a multiple of 15? True Let j(k) = 184k + 202. Does 22 divide j(16)? True Let l(h) = 13h*2 + 16h + 1. Let p be l(-4). Let k = p + -25. Is 12 a factor of k? True Let l = -773 + 1498. Does 6 divide l? False Let z(q) = q*2 + 8q + 9. Let v be z(-7). Is v/(-10) + (-488)/(-40) a multiple of 4? True Does 20 divide (-84 + -17)5/(-1)? False Suppose -3w + 371 = 5u, 4w - 5u = 269 + 179. Is w a multiple of 13? True Let o(f) = f2 + f - 12. Let d be o(6). Let r be (d/(-9))/(2/(-204)). Suppose 2c - r = -3g, 2c - 5c = 3g - 339. Is g a multiple of 32? False Suppose 5p - 18695 = -5y, 3p - 2y + 3y = 11225. Is 97 a factor of p? False Let t(w) = 5w*2 + 4w + 9. Suppose 8b - 15 = -47. Does 12 divide t(b)? False Let r = -460 + 1026. Does 17 divide r? False Suppose 5x = 5w + 20, 2w + 2w = -5x + 2. Let a be 0 - 0 - (-11 - w). Suppose -27 = at - 12t. Is t a multiple of 9? True Let j(m) = 53m2 + 25m + 123. Is j(-6) a multiple of 33? True Let a = -19 + -5. Suppose 2p - 94 - 24 = -4v, -5v = p - 62. Let h = a + p. Is 11 a factor of h? True Let n(h) = -h3 - 26h*2 - 61h + 96. Does 17 divide n(-24)? True Suppose -5h = 3j + j - 672, 516 = 4h - 4j. Is 27 a factor of h? False Let q(t) = -t3 + t2 - t - 1. Let c be q(-1). Suppose -2w = cw - 224. Suppose -u = u - w. Is u a multiple of 14? True Let q(v) = 33v3 - v2 + 19v - v*2 + 32v*3 - 66v*3. Is q(-7) a multiple of 28? True Suppose 160z + 8 = 158z. Does 10 divide (-18)/36 - (482/z + 0)? True Is (-9 + -2 - -220)/1 a multiple of 23? False Let y(v) = v3 - 6v*2 - 2v + 5. Let r be y(7). Suppose 2i + r = 132. Suppose -9 = j - i. Is 26 a factor of j? False Let o(m) = -m2 - 16m - 8. Let p(b) = 4b + 6. Let n be p(-5). Let k = n + 4. Is o(k) a multiple of 13? True Let a = -325 - -214. Let z = 171 + a. Is z a multiple of 12? True Let v = -61 + 63. Suppose -p - vp + 333 = 5w, 5w - 5p = 325. Is w a multiple of 21? False Suppose 0 = 2i - 5i + 6. Suppose 5v - iv = -2t + 128, -5t - 140 = -4v. Is v a multiple of 10? True Let o(z) = z*2 - 15z - 29. Let l be o(21). Suppose -4k = -3i + l, -93 = -3i - 0i + 3k. Is i a multiple of 3? True Let c = 3712 - 1164. Does 13 divide c? True Let w(c) = c + 0 - 8 - 6c. Let f be (6/14)/(-1) - 1014/182. Is 11 a factor of w(f)? True Suppose -4a + 2t + 331 = a, 2a + t = 127. Is a a multiple of 22? False Let z(v) = -v3 + 8v*2 + 12v + 3. Suppose -3k + 10k = 63. Is 30 a factor of z(k)? True Let f(z) = 459z - 459z + 72z2. Does 12 divide f(1)? True Suppose -10 = 2a + 2l, 0 = a - 2l - 3l + 5. Suppose 0 = 5x + 49 - 84. Is a/(-2 + x) + 79 a multiple of 29? False Suppose -9j = 140 + 310. Suppose -3x + 258 = -0x. Let d = j + x. Is 21 a factor of d? False Is 83 a factor of 1005 + 9/((-72)/(-16))? False Let a(b) = 2b*2 + 5. Is 37 a factor of a(-4)? True Let w = -14 + 7. Let o be w/(-21) - 14/(-3). Suppose -oa = -a - 88. Is 11 a factor of a? True Let l be ((-1)/4)/(4/(-48)). Suppose i = lc - 1 - 1, 2i = 3c - 4. Let n = 29 - i. Is 8 a factor of n? False Suppose -3z = 5z - 5040. Suppose 13v - 7v = z. Does 15 divide v? True Let y(r) = r2 + 7r + 8. Let p be y(-6). Suppose 5b = 0, -1 - 5 = -ph + 2b. Is h a multiple of 3? True Let s(i) = 6i*2 - 4i + 3. Let j be s(1). Suppose 62 = k - 4r, -jr - 60 = k - 2k. Is k a multiple of 14? True Let y(t) = 7t*2 + 5t + 216. Does 46 divide y(-14)? True Let r be (-1)/(-7) - (-4)/(-28). Suppose -2j + 4 + 40 = r. Does 8 divide j? False Suppose 0 = -3a - 288 - 783. Let b be 1/(2 + 711/a). Let c = 197 - b. Is c a multiple of 27? False Let i(v) = v*3 - 8v*2 + 3v + 10. Suppose 26 = 5y + 4a, -y - 4a = -6 - 12. Suppose yh - 7 = 9. Is 17 a factor of i(h)? True Suppose 4c + 8 = -4d, -c + d = 3d + 4. Suppose -4h = 2i - 356, c = 5h - h + i - 352. Suppose 0 = -7s + h + 88. Does 8 divide s? False Let b = -251 + 471. Does 22 divide b? True Suppose -4649 = -11i + 5108. Is i a multiple of 10? False Let b = -201 + 216. Is b a multiple of 15? True Let y = 1533 + -1132. Does 6 divide y? False Suppose -10 = 2h - 0. Let o be ((-2)/h)/((-5)/275). Is (-2174)/o - (-10)/55 a multiple of 25? False Suppose -4v = -4o + 332, 3v - 165 = -2o + 4v. Let d = 76 + o. Is 18 a factor of d? False Let r be 3 - 53(3 + -4). Suppose f = 4a + r, -5a - 24 = -f + 27. Does 18 divide f? False Suppose -674 - 1114 = -3g. Suppose a = 5c - g, 0c + 3c = -5a + 380. Does 12 divide c? True Let s(n) = -4n2 - 2n + 5. Let h be s(-6). Suppose -4k - 58 = 254. Let t = k - h. Is 16 a factor of t? False Suppose 355 = -3d - d - o, -d - 2o = 80. Let f = -46 - d. Is 17 a factor of f? False Let k = -57 - -58. Does 8 divide (7 - -31)/(1 + k)? False Does 46 divide ((-1)/2)/((-7)/644)? True Let r(h) = -h2 - 9h + 192. Is 36 a factor of r(8)? False Let u = 47 - 42. Suppose 6k = 3k - 2n + 79, 0 = -uk + 3n + 119. Is k a multiple of 13? False Suppose -5u - 3d = -5d - 276, u - d - 54 = 0. Let a = u + 4. Does 20 divide a? True Let i(j) = 12j2 + 3j + 2. Suppose -17g + 4 = -19g. Is 11 a factor of i(g)? True Suppose -15 = -3i - 0i. Suppose w + 232 = 4y, 0 = -y - 2y + iw + 191. Let u = y + -39. Is u a multiple of 6? True Let u be (-4 - (-21 - -4))1. Let f(r) = 9r - u + 1 + r. Is f(6) a multiple of 12? True Let r(c) = -11c + 5. Let w be r(3). Suppose 123 = -2s - 3q, -5q = -5s - 259 - 36. Let z = w - s. Is z a multiple of 5? False Let c = 7 + -18. Let i = c - -15. Suppose q + iq + 3m = 264, -5q + m = -252. Is q a multiple of 17? True Suppose 2x = 4a - 2216, -12x = a - 16	{ "pile_set_name": "DM Mathematics" }
n - 1. Let a be d(v). What are the prime factors of 19 - (a + (-3)/(-3))? 3, 7 Let c(w) = -4w2 - 3w + 12. Let h(z) = -9z2 - 5z + 25. Let x(d) = 7c(d) - 4h(d). List the prime factors of x(-5). 3, 7 Let n(q) = q*2 + q + 6. Let s be n(13). Suppose -5j = -4j + 5o - 88, -2j = 4o - s. List the prime factors of j. 2, 7 Let d = 35 - 26. Suppose dm = 333 + 162. What are the prime factors of m? 5, 11 Suppose 17c + 187704 = 83c. List the prime factors of c. 2, 3, 79 Suppose -4p + 2616 = 4p. List the prime factors of p. 3, 109 Suppose -55 = -5d + 5c, -4c = 3d + 9 - 49. Let y = d - -35. Let k = y - 21. What are the prime factors of k? 2, 13 Let x be 127/5 + 9/(225/(-10)). What are the prime factors of ((-106)/5)/((-5)/x)? 2, 53 Suppose -5s + 3582 = -l, 14s + 2l = 9s + 3576. List the prime factors of s. 2, 179 Let z(l) = -2l*2 + 15l + 21. Let v(r) = r*2 - 8r - 11. Let u(f) = -11v(f) - 6z(f). Let i = -5 + 15. List the prime factors of u(i). 3, 5 Suppose 337 - 1247 = -7b. Suppose -b = -3m + 3p + 104, 2p - 136 = -2m. What are the prime factors of m? 73 Let t = -14 + 10. Let y be 166/8t/(-1). Suppose -2q + y = 17. List the prime factors of q. 3, 11 Suppose 0 = 2h - i - 134, 5h + 0h - 5i = 325. Suppose 0 = 4y - 3y - h. List the prime factors of y. 3, 23 Let h = 43 - 27. Suppose -4s + h = -0s. Let q(g) = -g2 + 10g + 2. List the prime factors of q(s). 2, 13 Let h = 436 - 18. What are the prime factors of h? 2, 11, 19 Let u(y) = -235y + 688. What are the prime factors of u(-5)? 3, 23 Suppose -13h + 10277 = 5u - 9h, -2u + 4104 = 5h. List the prime factors of u. 11, 17 Let c be 1(-1 + 0)-2. Let y be 1 - (c/(-1) - 2). Suppose -r = 4s - 7, -s + ys = -2r + 34. List the prime factors of r. 3 Let t(j) = -4j + 4j - 5 + 3j. Suppose 5u + 30 = 5d, -5d + 4u + 16 = -12. List the prime factors of t(d). 7 Let m(h) = 152h3 + 3h - 3. What are the prime factors of m(1)? 2, 19 Let u(d) = 12d2 - 7d + 2. Let m = 95 + -91. What are the prime factors of u(m)? 2, 83 Let z be 2((-9)/122)/(-3). Suppose -3x + 183 = 4a, 3x + z = 4. What are the prime factors of a? 3, 5 Let o = -1964 - -3736. List the prime factors of o. 2, 443 Suppose -11 - 9 = -5q. Suppose -qo + 335 = -5. List the prime factors of o. 5, 17 Suppose -5x - 80 = -0x. List the prime factors of x/(-20) - (-536)/5. 2, 3 Let s(f) = 318f*3 - 2f*2 - 3f + 2. What are the prime factors of s(1)? 3, 5, 7 Suppose -46t + 21852 + 53312 = 0. List the prime factors of t. 2, 19, 43 Let k(v) = v3 + 17v*2 - 18v - 24. List the prime factors of k(-13). 2, 443 Let u = 156 - -74. List the prime factors of u. 2, 5, 23 Let w(h) = h*3 + 7h*2 + 8. Let a be -1 + 1 - (-2 - -9). Let x be w(a). Suppose -32 = -y - x. What are the prime factors of y? 2, 3 Let x(t) = -5 + 0 - 13 + 5t + 2t. List the prime factors of x(12). 2, 3, 11 Suppose -3i = i + 728. Let k = i + 327. List the prime factors of k. 5, 29 Let f be (6/(-8))/(2/(-160)). Suppose 3m = -m + f. Suppose 3 + m = t. List the prime factors of t. 2, 3 Suppose -5d = -3o + 7187, -2393 = -250o + 249o + 3d. List the prime factors of o. 2399 Suppose -5a + 36 = -a. Let o be (-9)/(a/(-2)) - 2. Suppose -3l + 12 - 3 = o. List the prime factors of l. 3 Suppose -v + 5h = 64 - 512, 1792 = 4v - 2h. List the prime factors of v. 2, 7 Let h(f) = 2f - 12. Let u be h(9). Let n be (0 + (-4)/(-8))u. List the prime factors of n(-22)/(-3) + -3. 19 Let q(z) = z + 1. Let o be q(1). Suppose 4 = -3s + 4s. Suppose -2u - oi = -u - 33, 0 = -su + 3i + 88. What are the prime factors of u? 5 Let b(l) = -l*3 - 9l*2 + 4l - 4. Let m be -11 - 24/(-8). Let c be b(m). What are the prime factors of c/10(5 + 0)? 2, 7 Suppose 0 = -20w + 5w + 35775. List the prime factors of w. 3, 5, 53 Let a = -165 + 365. Let d(m) = m*3 - 6m*2 + 5m - 6. Let r be d(5). List the prime factors of r/4 + a/16. 11 Suppose -4n + 8 = 0, -3r - 5n + 1910 = r. What are the prime factors of r? 5, 19 Let d = -1504 + 2645. List the prime factors of d. 7, 163 List the prime factors of (285/6)/(-3 + (-254)/(-84)). 3, 5, 7, 19 Suppose 2712 = -8z + 11704. What are the prime factors of z? 2, 281 Suppose 5m = 448 + 182. Suppose 9h + m = 12h. What are the prime factors of h? 2, 3, 7 Let z(g) = -g3 - 6g*2 + 5g - 23. List the prime factors of z(-9). 5, 7 Let b(h) = -2h + 34. Let f be b(15). Suppose -312 = -fg + 3x, 7g + 4x = 4g + 234. What are the prime factors of g? 2, 3, 13 Suppose 3t + t + 31 = -3f, 5t + 53 = f. Let q(a) = 5a*3 + 8 + 6a - 4a3 + 4a + 11a2. What are the prime factors of q(t)? 2 Suppose 35 = -w + 188. Let j be (1 + -2)(-6)/2. Suppose -6p = -jp - w. List the prime factors of p. 3, 17 Let p(z) = -43 + 41 + 0z - z + 5z. What are the prime factors of p(2)? 2, 3 Suppose 15m = -6m + 1134. List the prime factors of m. 2, 3 Let u(n) = 11n2 + 4n + 3. Let x be 6/(-4)(4 + 16/(-6)). List the prime factors of u(x). 3, 13 Let s(l) = l3 - 4l*2 - l - 5. Let h be s(5). Let p = h + -21. Let q(v) = -5v + 17. What are the prime factors of q(p)? 47 Suppose q = 3v - 148, -11v + 9v + 2q = -100. Suppose -2h + v = -153. List the prime factors of h. 101 Let r(d) = 56d*2 - d + 10. List the prime factors of r(-5). 5, 283 Let l be -448 - (-4 + (1 + -2 - -3)). What are the prime factors of (2/(-3))/2 + l/(-6)? 2, 37 Let i(r) = -158r - 263. What are the prime factors of i(-10)? 3, 439 Suppose -3x - c + 3754 = 0, -3x - 21c + 3748 = -17c. List the prime factors of x. 2, 313 Let u be 17/(-5) + (-18)/(-45). Let b(x) be the third derivative of x5/60 - x4/24 + x3/6 + x2. List the prime factors of b(u). 13 Suppose -m = 4j - 85, 8 = -j + 2m + 18. List the prime factors of (-21 - (0 + -1))j/(-4). 2, 5 Let w be (-3 + 3)/(1(-3 + 2)). Suppose -2d + 4a + 128 = w, 4d + a - 64 = 3d. What are the prime factors of d? 2 Suppose 4l = -7y + 10y + 16, 2y - 4l = -12. List the prime factors of 2/y((-3 - 6) + 3). 3 Let s(c) = -c*2 - 11c - 2. Let o be s(-4). Suppose 0 = -od + 22d + 232. List the prime factors of d. 2, 29 Let v be (-7 - 7)6/(-4). Let z be 2/6 - (-1778)/v. Suppose -4y - 3d = -z, -3y - 2d + d + 60 = 0. List the prime factors of y. 19 Let d(o) = o2 + 3o - 2. Suppose 5w - 3p = -19, 10p - 5p + 35 = -5w. Let f be d(w). Suppose 0 = i + 3i - f. What are the prime factors of i? 2 Suppose 0 = -3d + 15, -6a - d = -2a - 2617. What are the prime factors of a? 653 Suppose 3f = f - 3n + 3885, 4n - 12 = 0. What are the prime factors of f? 2, 3, 17, 19 Suppose g + 1 = -y - 3g, 0 = -5g - 20. Suppose yi + 24 = 18i. What are the prime factors of i? 2 Suppose o + 2o + 2t = 565, -562 = -3o - 5t. Suppose -4d - q = -o, 2d + 3q - 98 = -q. List the prime factors of d. 47 Let b = 415 - 183. List the prime factors of b. 2, 29 Suppose 0 = 4x - 9x + 4k + 2085, 0 = 5x + k - 2110. List the prime factors of x. 421 Let o(c) = c + 1. Let i(b) = 148b + 222. Let n(u) = -i(u) + 222o(u). What are the prime factors of n(2)? 2, 37 Let f(w) = 12w + 1. Let o be f(5). Let y = o + -107. What are the prime factors of (0 - 2/4)y? 23 Suppose 2s = s + 1697. Let c = 1099 - s. List the prime factors of c/(-13) - -11. 47 Suppose 0 = -o - 3t + 367, 0 = 4o - 3o + 2t - 365. List the prime factors of o. 19 Let y = 1617 - 1140. What are the prime factors of y? 3, 53 Let a(j) = -j3 - 2j*2 + 6j + 6. Let h be a(-6). Suppose 0 = -2n - 10, -h - 30 = -4y - 4n. What are the prime factors of y? 41 Let u(d) = -d - 1. Let t(g) = 3 + 0 + 4 - 5. Let i(j) = -2t(j) - 3u(j). What are the prime factors of i(9)? 2, 13 Suppose 8y - 20 = 3y. Suppose -yx = -x - 27. Let n = x - 5. What are the prime factors of n? 2 Let y = -2656 - -3834. List the prime factors of y. 2, 19, 31 Let c = 17 + -14. Let d = -1 + c. What are the prime factors of 4/(0 - d/(-17))? 2, 17 Let k(d) = -d - 5. Let m be k(-3). Let r be (m/5)/((-7)/35). Suppose rb - 112 = -3p, 9 = 4b - 11. What are the prime factors of p? 2, 17 Let l(b) = -414b + 31. Let a(k) = 83k - 6. Let f(n) = -11a(n) - 2l(n). List the prime factors of f(-3). 7, 37 Suppose -3s - 91 = 2. Let w = s - -13. Let h = w + 25. List the prime factors of h. 7 Let w(v	{ "pile_set_name": "DM Mathematics" }
Let z(o) = o*2 + 7o + 6. Let q be z(-5). Let g = -11 - -11. Put q, g, -3 in descending order. g, -3, q Let c = 8 + -7.8. Let d = 1090.2 - 1091. Sort c, d, 0 in increasing order. d, 0, c Let s(x) = -x*3 + 8x*2 - x + 6. Let h be s(8). Let k be (-9)/3 + (2 - h). Sort -5, -4, k in increasing order. -5, -4, k Let l = 0.31 - 0.91. Put 1, -2/5, l in descending order. 1, -2/5, l Suppose -x = -4x + 12. Let w(p) = -p*2 - 22p - 15. Let z be w(-21). Suppose 2s = zs - x. Sort -1, -3, s in ascending order. -3, -1, s Let c(d) = d*3 + 11d*2 - 18d - 29. Let h be c(-12). Let z = h + -40. Sort -1, -8, z. -8, -1, z Let t = -330 - -332. Sort 0, -6, t, -4 in descending order. t, 0, -4, -6 Suppose 3h + 3j = 7j + 404, -3h - 5j + 440 = 0. Put 2, h, 5 in descending order. h, 5, 2 Let i(x) be the first derivative of -x4/4 - 8x*3/3 + 5x*2 - 34. Let r be i(-9). Put r, -4, 5 in decreasing order. 5, -4, r Suppose -n + 50 = 16. Let r = -34 + n. Sort r, -4, -9. -9, -4, r Suppose -42g - 62 = -38g - 2b, -5b - 37 = 2g. Put g, -1, -2, 5 in ascending order. g, -2, -1, 5 Let f = 48 + -17. Let p = f - 27. Sort 5, 0.4, p in ascending order. 0.4, p, 5 Let o = 0.1 + -0.1. Let w = 197.6 + -197.4. Suppose -d + 3d = 2q + 8, 0 = -3d + 2q + 10. Sort o, d, w. o, w, d Let t = 11144.92 - 11145. Suppose -3n = -6n + 3. Let d be (n/(-2))/(2/4). Sort 4, d, t in increasing order. d, t, 4 Let o = 432 - 429. Sort o, 5, 11 in descending order. 11, 5, o Let l = -175 + 174. Sort -3, l, 36. -3, l, 36 Let v = 0.081 - -31.919. Let r = v + -35. Put 1/2, r, -1/2 in descending order. 1/2, -1/2, r Let n = 10 - 9. Let s be 4 - 5 - (n + 9 + -2). Sort -1, s, 3 in increasing order. s, -1, 3 Suppose 3l + l - 100 = 0. Let m = l - 14. Suppose -11q - 29 = -40q. Put q, 3, m in decreasing order. m, 3, q Let v(f) = f3 + 14f*2 - 13f + 28. Let k = 78 + -93. Let a be v(k). Sort 3, a, 5, 0. a, 0, 3, 5 Suppose 3s - 130 + 22 = 0. Let h = s + -41. Suppose 8x = 5x - 42. Sort 5, x, h. x, h, 5 Let d be ((-30)/(-27)-15)/((-3)/(-9)). Let h = d - -44. Put 1/5, -3, h in descending order. 1/5, -3, h Let o(y) = y*2 - 6y - 3. Suppose -21 = -3p - 0. Let u be o(p). Let v(k) = k - 4. Let f be v(5). Sort 0, u, f. 0, f, u Let a(t) = -t3 + t2 + 2t + 8. Let l be a(0). Put 4, -14, l in increasing order. -14, 4, l Let a be (32/12)/(8/36). Suppose 4w + 4 = a. Sort -1, 3, w, -5 in descending order. 3, w, -1, -5 Let l be -1 + -37172/(-3976). Let m = 9/14 - l. Let u = 373/426 - m. Put 5, u, -3 in decreasing order. 5, u, -3 Let n be 2/15-3 + (-108)/(-20). Sort -3, n, 7, 3 in decreasing order. 7, n, 3, -3 Suppose -123 = 69q - 28q. Suppose 5d - i - i = 28, 0 = 5d + i - 16. Let a be 1(5 - (2 + -2)). Put q, a, d in decreasing order. a, d, q Let k(z) = 2z3 + z2 + z + 4. Let a be k(3). Suppose 5i + 0i = -a. Let t = i - -13. Sort t, -5, -3 in descending order. t, -3, -5 Let f = -590 - -591. Put 183, -4, f in decreasing order. 183, f, -4 Let q = 52075/4 + -584245/44. Let r = -259 - q. Let o = -1.96 - 0.04. Put 4, r, o in decreasing order. 4, r, o Let r = -812.7 - -738. Let s = 75 + r. Sort s, -1, 2. -1, s, 2 Let m(c) = -2c*2 - 3c - 3. Let a(d) = -6d2 - 8d - 8. Let j(o) = -2a(o) + 7m(o). Let k be ((-4)/6)/((-2)/(-6)). Let t be j(k). Sort t, -4, 5. -4, t, 5 Suppose -2h + 6 = -3y, 3h + 0y - 3y = 9. Put -1, -4, h, -5 in descending order. h, -1, -4, -5 Suppose -9o - 14 = 4. Sort 0, -3, 1, o in descending order. 1, 0, o, -3 Let v(n) = 15n - 26. Let d be v(2). Put 72, 1, d in descending order. 72, d, 1 Let k be ((-24)/(-30))/((-18)/(-45)). Suppose -4p = -0p + 4g + 8, 2p + g = 1. Sort -1, 47, p, k in descending order. 47, p, k, -1 Let r(p) = -p3 - 5p*2 - 3p + 5. Let m be r(-4). Suppose 0 = 5d - 1 + m. Sort 2/11, d, -0.5, 5. -0.5, d, 2/11, 5 Let t(i) = 2i*2 - 21i + 52. Let b be t(5). Sort -2/11, 1, -1, b in increasing order. b, -1, -2/11, 1 Let o = -26 - -27. Suppose -p + o = -5. Let w be p(33/(-18) - -2). Sort 14, -4, w. -4, w, 14 Let d = -0.4 + -5.6. Let n = -1346/7 + 192. Put -0.1, n, d in descending order. -0.1, n, d Let i = -468 + 470. Sort -66, i, 1 in descending order. i, 1, -66 Let j = 8 + -6. Suppose -5z - 16 = 2y + j, 4y - 5z = 24. Suppose -6a + 9 = -3a. Put a, 2, y in descending order. a, 2, y Let c be 4/18 + 3/108. Let t = 37/22 - 3/2. Let w(f) = f3 - 5f*2 - 5f - 7. Let i be w(6). Put t, c, i in increasing order. i, t, c Let c be 0 + (4 + -4 - -2). Suppose cs = 5s. Sort s, -4, -2. -4, -2, s Suppose 3w - 2m = 0, 0m + 5 = 5w - 5m. Sort 15, w, 3 in descending order. 15, 3, w Suppose -5r + 34 = 19. Sort r, -1/3, -6 in ascending order. -6, -1/3, r Let p = 1.48 + -141.48. Let v = p + 139. Sort 0.3, -3/7, -12, v. -12, v, -3/7, 0.3 Suppose -2n + 18 = 2y, 10y = 7y - n + 27. Let o be 120/28 - (-2)/(-7). Put o, 1, y in descending order. y, o, 1 Let v = 73444 + -7344507/100. Let r = v + 8/25. Let y = 16 + -14. Sort 4, y, r. r, y, 4 Let p(d) = -d + 15. Let o be p(0). Let z = o - 13. Let y be -2 + 1 + z + 0. Put 4, 3/8, y in increasing order. 3/8, y, 4 Suppose 0 = -s - 0s + 7. Let c = 13 - s. Suppose c = 4k - 2a, 3k - 2a + 3 = a. Put 0.2, -1, k in decreasing order. k, 0.2, -1 Let o(s) = -2s + 43. Let y be o(22). Sort 4, -3, -4, y in descending order. 4, y, -3, -4 Let z(p) = -5p + 5. Let c be z(5). Let f be 2/(-10) + (-614)/c. Let u = 31 - f. Put u, 5, 0.4 in decreasing order. 5, u, 0.4 Let z = -2.08 + 2.14. Put z, 1/3, 1, 4 in descending order. 4, 1, 1/3, z Let k(p) = -p2 - p + 1. Let n(u) = u3 - 6u + 3. Let i(w) = -3k(w) + n(w). Let f be i(-4). Put f, -1, 15 in descending order. 15, -1, f Suppose 93 = -9u + 120. Suppose -7k = -3k - 8. Let o(h) = -h*2 - h + 6. Let t be o(-3). Put t, u, k in descending order. u, k, t Let u = 1397 - 1392. Sort u, 4, -4, -3 in descending order. u, 4, -3, -4 Let n be -3 + (-3)/((-6)/2). Let g(y) = -4y*2 + 6y + 1. Let l be g(2). Put -4, n, l in decreasing order. n, l, -4 Suppose -32 - 16 = 2s. Let x be -3(-4)/18s. Let q = -13 - x. Put -7, -5, q in ascending order. -7, -5, q Let b be 1/2 - (-14)/4. Let k be (-14)/(-6) - (-2 + (-24)/(-18)). Suppose 3s = -kw, -4w + 4 = -s - 1. Put w, 3, b in descending order. b, 3, w Suppose -8 = 3z - 2s, 5s = 2 + 3. Suppose f - 8f = -21. Put -9, f, z in descending order. f, z, -9 Let s = -453 - -456. Suppose 0 = 3o - 3g + 15, 2o - 2g = o - 6. Sort 0, -3, o, s in increasing order. o, -3, 0, s Suppose 3t + 5h = 3, 40h + 3 = 3t + 35h. Suppose -8i - 15 = -3i. Sort i, 3, t in increasing order. i, t, 3 Let t be 3 + (-165)/(-3) - 9. Sort 0, t, -11 in descending order. t, 0, -11 Suppose h - 6h - 2 = -2m, -h = 2m + 10. Let g be 4((-17)/(-2) - 2). Suppose -5t + g = 1. Sort -5, t, m in decreasing order. t, m, -5 Suppose 4f - 2c + 54 = 0, 4c = c - 3. Let w be (12 + f)/(2/(-5)). Suppose -35 = -wr - 0g - 5g, -4r - 5g = -33. Put 3, r, -1 in increasing order. -1, r, 3 Let g = 20 + -21.6. Let z = g - -6.46. Let w = z - -0.14. Sort w, -5, -3 in descending order. w, -3, -5 Suppose -2s + 10 = 5y - 25, 0 = s + 5y - 30. Sort -2, 1, s, -1. -2, -1, 1, s Let s = -4 - -3. Let z = -114 - -568/5. Put 2/15, 2, s, z in ascending order. s, z, 2/15, 2 Let o(b) = -5b + 154. Let p be o(30). Sort -3, 103, p in descending order. 103, p, -3 Let h = 27 + -23. Suppose 2f - 7 = -4o - 19, 3f + 17 = -5o. Let n = 4 + -1. Sort h, n, f. f, n, h Let v = 27 + 26. Put 0, 2, 4, v in decreasing order. v, 4, 2, 0 Let i = -1099/2442 - -19/66. Put 1, i, 1/3 in ascending order. i, 1/3, 1 Let m = -3 - -2.5. Let h = 169.284 + -0.284. Let f = h - 164. Sort m, f, -4. -4, m, f Let g = 9/29 + 24/203. Sort 3/5, -1, g, -0.6 in ascending order. -1, -0.6, g, 3/5 Let d(p) = -3p - 10. Let w be d(-7). Let a = w + -15. Let i be (-4)/(a/(4/2)). Sort 4, i, 1 in descending order. 4, i, 1 Let g(f) = -f2 + 3f + 56. Let c be g(9). Let i = 3 - 7. Let z = -60.2 - -60. Sort c, z, i in descending order. c, z, i Let c = -2.4 - -2.7. Put -1/2, c, 2, -2 in increasing order. -2, -1/2, c, 2 Let r = -121 - -121.1. Let f = 0.21 + 0.09. Put r, -0.4, f in decreasing order. f, r, -0.4 Let z(b) = -b*2 + 5b + 2. Let l be z(-4). Let w be (-2)/(-21)*51/l. Put -2/7, w, 0.2 in descending order. 0.2, w, -2/7 S	{ "pile_set_name": "DM Mathematics" }
o 12 and i have different values? True Suppose 7r - 3 = -10. Let c = 565 + -2813/5. Let g = 7/3 - c. Which is smaller: r or g? r Let y = -4.14 + 4.04. Let u = -113 + -31. Is y greater than u? True Suppose -4n - 8 = 4w - 0n, 5n + 17 = 2w. Suppose 0 = -2i + 2k + 3358, 0 = -28i + 27i + 5k + 1691. Let v = i + -73741/44. Is w at most as big as v? False Suppose -26v + 443 - 172 + 561 = 0. Is v smaller than -46? False Let q be (-3)/(1 + 2) - -479. Let p = -2861/9 + q. Let c = 12 - 11. Is p <= c? True Let y = -621 - 214. Let t = y - -818.26. Let n = -0.26 + t. Is 0 < n? False Let j = -262432 + 3449668636/13145. Is j at most as big as -1? False Let f be -25 + -2 - (2 + -1). Suppose -4p - 116 = 4b - 3b, b - 3p + 88 = 0. Let m = b - -72. Are f and m nonequal? False Let f = -9 - -19. Let g = -138.8 + 18.8. Let r = -120 - g. Which is smaller: r or f? r Let f = -70.35 - -221.36. Let u = f + -151. Does u = -5? False Suppose 7m - 150 = 13m. Suppose -p = 5w + 4p - 50, 3w + p - 34 = 0. Let z(j) = -j*3 + 13j*2 - 15j + 11. Let v be z(w). Is v bigger than m? False Let k be (4/(-18) - (-50)/225)/(1 - 3). Does -20208 = k? False Suppose -86h = 128h + 66h + 9520. Which is greater: h or 22? 22 Let l = 7771.1 - 7775. Is l at least -30? True Let l = -2803443 + 1132594975/404. Let v = l - 16/101. Let q = -619 + 629. Is v at most as big as q? True Let v = -6537 - -6540. Let z be (3 + -2)/(17/(-2)). Which is bigger: v or z? v Suppose -96m = -113m - 1394. Are m and -404/5 unequal? True Let s(x) be the second derivative of -7x*3/6 + 15x*2/2 - 186x. Let k be s(2). Which is bigger: 6 or k? 6 Let i = -6503/4 + 57911/36. Let y = -13 + -3. Is i greater than y? False Let v = -6135 - -6141. Let k = 17 + -35. Let w be (v/(-7))/(k/126). Which is bigger: w or 23/4? w Suppose 2 = -c - 5h, c + h - 1 = -3. Let q be ((-3)/6)/((-4)/(-56)). Let t(l) = l3 + 7l*2 + l + 4. Let a be t(q). Which is smaller: a or c? a Let h be 0 + 0/(-4) - (-2 + 45). Let z = 44 + h. Let x be (-2 + z)/((-618)/(-12)). Which is bigger: 1 or x? 1 Suppose c + 3z - 1468 = 1035, 0 = -4c + 8z + 10052. Do c and 2509 have the same value? True Let d(i) = 2i3 - 24i + 84. Let w be d(8). Let u = -906 + w. Is 1 greater than u? False Suppose -288 = 35x - 27x. Let v be (0 + 5)/(49/x). Let t(j) = -5j - 26. Let p be t(v). Is p smaller than -5/22? True Let l = 78249 + -41941449/536. Let d = -2721/268 + l. Is -11 at most as big as d? True Suppose -26j + 29j = -249. Let p = -88 - j. Suppose 4d = 0, 4d + 3 = 3f + 15. Is p smaller than f? True Let n(y) = y3 - 11y*2 + 9y + 10. Let f(c) = -2c + 31. Let o be f(5). Let h = -11 + o. Let d be n(h). Which is bigger: d or -4/29? d Let c = 223 - 56. Suppose 0 = 5j - 7j + 5m - c, -5j = -4m + 392. Is -77 less than or equal to j? True Suppose 7 = 2n + 29. Suppose 43z + 14 = 36z. Let o be z + -2 - (10 - 8). Is o <= n? False Let f = -7872 + 7859. Is f greater than or equal to 156? False Let u(z) = z3 - 2z*2 - 7. Let j be u(3). Suppose jd - 2 = -8. Let p be d/(-21) - 78/(-1218). Which is bigger: p or -1? p Let m(w) = 39w2 + 8w - 5. Let k be m(4). Let d be ((-2)/3)/(84/k). Which is greater: -5 or d? -5 Suppose 0 = -2m + 4f + 20, 4m + 10 = -4f + 2f. Suppose mb + 30 = -6b. Do -6 and b have the same value? False Let g = 17.3 + -17.284. Suppose -2d + 4d = 24. Let f be ((-3)/(-2))/(45/d). Which is greater: g or f? f Let u = -2 - -4. Let q be -1 + u + -8 + 19. Suppose -4v + v + 2h = -4, 4v + 4h - q = 0. Are v and 3 unequal? True Let c = -453.626 - -0.626. Let g = -436 - c. Which is bigger: 2 or g? g Let r = -2/8777 + -16540/4449939. Do 1 and r have the same value? False Let l = 0.05999 + 0.03001. Which is smaller: 88/3 or l? l Let z = 4479 + -4484. Which is smaller: -20/11 or z? z Let j = 12 - 11. Suppose -t + g + 39 = 0, t - 39 = -12g + 10g. Let n be (-3)/t(-2)/4. Is n at most as big as j? True Suppose -3v - 842 = -n + 483, -4v - n - 1769 = 0. Let a = -637 - v. Is -195 at most as big as a? True Let n = 49.118 + -0.118. Let o = n - 48.979. Let s = o + -35.021. Is 0 >= s? True Let y be (-13593)/(-105) + 3 + 1748/95 + -19. Which is bigger: 131 or y? y Let d = -51925/6 + 8726. Which is bigger: 72 or d? 72 Let z = -23590 + 16449. Is -7141 >= z? True Let o be ((-12)/5 + 2)(-530 - -10). Let g = o + -84. Does 123 = g? False Let b = -840 + 832. Let u be (-24)/b + 105/(-34). Which is bigger: u or 0? 0 Let d(j) = 3j*2 - j - 16. Let v be d(0). Let h be 111/12 + (12/v)/3. Which is smaller: 8 or h? 8 Let n = 218 - 217. Let w be (-2(-104)/(-48))/(n/(-18)). Let y(k) = k*3 - 4k*2 - 10k + 2. Let f be y(7). Which is smaller: w or f? w Let o = 557 - 545. Let k be -4 - 801/(-54) - (-2)/o. Is 13 less than or equal to k? False Let c be (216/1890)/(4/14) - (-166)/(-40). Is 26/9 less than or equal to c? False Let t = 0.08 - 12.08. Let w(g) = g + 15. Let n be w(-11). Let o be ((-2)/n)/((-30)/4 + 6). Is t < o? True Suppose -27378 = -138v + 1993 + 7475. Let i(c) = -c3 + 14c*2 - 5c + 8. Let a be i(6). Is a <= v? True Let a(j) = -j*3 + 9j*2 - 9j + 8. Let g be -4 + (-3)/(-7 - -4). Let c be 3/((-45)/40)g. Let o be a(c). Which is greater: o or -2? o Let a be (6/(12/(-242)))/(-4). Let l = -31 + a. Let d = -6.7 + 6.3. Which is smaller: d or l? l Let k(r) = 7r + 53. Let w be k(-14). Let d = 45 + w. Is 7 not equal to d? True Let u = 16105/7049 + 1/1007. Let k be 5 + (2 - 3 - 2). Which is bigger: k or u? u Let l = -6 - -8/3. Let w = -6/109 - -1022/2725. Let b = w + 9/50. Which is smaller: b or l? l Let b = 2/10465 + 11792/47814585. Which is bigger: b or 1? 1 Let q be 7/(-1) + ((-1456)/65)/(-8). Let h be (2 - 1) + 9/(-3). Let x = h - 1. Which is bigger: q or x? x Let d = -781 + 36709/47. Which is smaller: d or 5/6? d Let q be (-10)/(-4)(-6 - -4). Let t(g) = -2g*2 - 6g + 3. Let j be t(q). Suppose -80 - 64 = 8n. Are n and j equal? False Let p = -556.14 + 786.17. Let l = 230 - p. Is -1 greater than l? False Suppose -9821 = -c - 9389. Which is bigger: c or 433? 433 Let q = 3012 + -2965. Let o = 53 - 98. Let z = o + q. Is z > -11? True Let z = -5 - -3. Let k = -141 + 179. Suppose 7t - k = -3. Is t less than or equal to z? False Let s(g) = -3g2 - 64g - 707. Let n be s(-68). Is -10227 > n? False Suppose 2l = 2g + 264, 3g - 9l + 10l = -372. Are g and -132 non-equal? True Let c(i) = i3 - 12i*2 + 17i + 1. Let q = 6 + 1. Let a be c(q). Is a less than -125? False Let v = 105 + -109.7. Let j = v + -18.3. Let r = 25 + j. Which is smaller: r or 12? r Let u be -8 - 97(-6)/(-30). Let t = 136/5 + u. Which is bigger: 254 or t? 254 Suppose -10g - 103 = -113g. Is -2/5505 > g? False Suppose 4l - 30 = -34, 5l + 1195 = 5t. Are t and -6/17 equal? False Let h = 66 + -65.8. Let t = 27 - 23. Let p be 64/(-296)(-1)/t. Which is smaller: h or p? p Suppose 146m - 131m - 11880 = 0. Let j be (10/50)/(0 + m/(-10)). Do -2 and j have the same value? False Let i be 49761/(-342)16/6. Is i bigger than -1160/3? False Let r be 1706/4 - (-9)/(-18). Suppose 0 = -4t - 0t - 3u - 425, -4t - 2u - r = 0. Which is bigger: t or -106? -106 Let u = -68 + 69. Let i = -1 + u. Let o = 1.1 - 1.086. Is i at least o? False Suppose 0 = 5v - 2w - 29 - 13, 5 = v + 3w. Let a be 2/v - (-63)/36. Suppose ag = 3z + 151, -4g + 2g = z - 131. Is 68 at most g? True Let j = 120 - 106. Let w = j - 15.2. Let s be ((-3)/(-9))/((-14)/12). Which is smaller: s or w? w Let y(r) = -2r3 + 12r*2 - 2r + 11. Let l be y(6). Which is greater: l or -1/395? -1/395 Let y = -1119 - -2056. Let b = -771 + y. Is b not equal to 1/2? True Let s = 645 - 645.0527. Let k = s + 0.052. Which is smaller: k or 1? k Let z(k) = 3k3 + 2k*2 - 1. Let d be z(1). Let b(q) = 2q*2 + 18q + 40. Let v be b(-7). Let p be 2/(-3) + 8/v. Which is bigger: p or d? d Let z = -152.9 - -147. Let m = -1.05 - -0.987. Let p = m + -0.037. Is p greater than or equal to z? True Let f be 411647/132770 + 29/(-290) + -3. Is f at most 1? True Let s be (-6)/(-208) + (-27)/6 + 791/182. Which is bigger: -68 or s? s Let n = 1.19 + 536.81. Let l = n - 538. Is -19 at most l? True Suppose -5w = 2o + 36349, 0 = 35o - 43o - 56. Is -7266 at least w? True Let c = 418 - 192. Let o = c - 225.97. Let b = 0.7 +	{ "pile_set_name": "DM Mathematics" }
r a. -5 Suppose -s = 4g + 15 + 26, -4s - 20 = 0. Let b = g + 12. Solve b = -2l + 5l for l. 1 Let o(j) = -2j3 - j2 + 2j - 1. Let f = 3 - 2. Let d be o(f). Let u be (-9)/d + (-1)/2. Solve -uy = -2y + 10 for y. -5 Suppose 33s - 36s = 0. Solve sy + 4 = -2y for y. -2 Suppose 2 = 4p - 3p. Solve -2 - 2 = -pr for r. 2 Let i = 5 - -2. Solve -2a - 1 + i = 0 for a. 3 Suppose 5c - 4l - 21 = -l, -10 = 5l. Solve cb - 5 = 2b for b. 5 Suppose 3f = 11 + 4. Suppose 24b = 7b. Solve b = fn - 4 - 1 for n. 1 Let p(x) = 5x*2 + 4x - 4x2 - 3x - 2x + 4. Suppose j = 5d - 1, -5j + 0 = -2d + 5. Let s be p(d). Solve -si = i for i. 0 Suppose -4u + 17 = 5x, -5x = u - x - 7. Let r = 2 - u. Let z be (2 + r)(6 - 3). Solve 0 = d - zd + 10 for d. 5 Let x be (2/(-2))/((-4)/12). Suppose -34 = 2l - xa, 3l + 31 = -5a - 58. Let c = 33 + l. Solve 4r = 2r + c for r. 5 Let y = 124 - 119. Solve -5 = -0r - yr for r. 1 Suppose -4 = k + 5z - 17, 5k = -4z + 23. Suppose 0 = l + 4l. Suppose 0 = -4s - x - x + 4, 4 = 2s + 2x. Solve l = -c - k - s for c. -3 Let v = -23 + 23. Solve -3n + 6 = -v for n. 2 Suppose 7u - 3u + 76 = 0. Let s = u + 28. Suppose 0 = 2f - f - s. Solve -2n - n = f for n. -3 Let w = 15 - 10. Suppose -wy - 40 = -10y. Solve s = -3s + y for s. 2 Let g = -13 + 32. Solve 5i - 4 = -g for i. -3 Suppose w - 1 + 0 = 0. Suppose 5j - 18 = 4i, -5i - 7 = -j + 5. Let q be (j/6)/((-1)/(-3)). Solve -q = -r + w for r. 2 Suppose 4o - 9 - 9 = -2l, -13 = -4o - l. Solve 0 = j + oj - 3 for j. 1 Let x = 1 - -2. Let a(z) = -z2 - z3 - 1 - 5z*2 + 6z + 0zx. Let b be a(-7). Solve bc = c for c. 0 Suppose -z + 1 = -5y, -4 = 4y + z - 5. Solve y + 5 = f for f. 5 Let j = 8 + -5. Suppose -4o = 8, 3z = jo + 91 - 1. Let n be (-8)/z - 60/(-14). Solve -r - n = -5r for r. 1 Let s(j) = -5j - 21. Let p be s(-6). Solve -2q + p - 1 = 0 for q. 4 Suppose s = -s - 8. Let x = 11 - s. Solve 2u - 5 = -x for u. -5 Suppose 4m - 4o - 36 = 0, 2m + 3 = 3m + o. Solve v + v = m for v. 3 Let q(l) = l2 + 5l + 3. Let i be q(-3). Let m be -3 + (-1 - -4 - 0). Let w = m - i. Solve 0 = -v - wv + 20 for v. 5 Suppose -5m + 4r + 62 = 0, -35 = -5m - r + 12. Solve 6 = 4t - m for t. 4 Let m be (-8)/2(-9)/36. Solve x + 1 = -m for x. -2 Suppose -h + 0j = 3j + 7, -3j = 3h + 51. Let d(p) = -p*3 + 8p*2 - 2p + 3. Let m be d(8). Let s = m - h. Solve 5u = -4 + s for u. 1 Let w(d) = d2 - 5d - 9. Let h be w(7). Solve 0t = ht - 20 for t. 4 Let k = 3 + -1. Solve f - 4 = kf for f. -4 Let a be 41 - (-3 - -5). Let q(j) = -7j + aj + 2j + 2j - 1. Let c be q(-3). Solve -c - 10 = 3o for o. -4 Let a = -29 - -41. Let f be 90/25 + (-2)/(-5). Suppose 4r - y + 15 = -4y, -5r - 10 = 2y. Solve -a = -rb - fb for b. 3 Let x(f) = -f2 - 3f - 1. Suppose -3o = 2d + 9 + 10, -2d + 16 = -4o. Let r be x(d). Let j be ((1 - 0)0)/r. Solve j = m + 5 - 2 for m. -3 Suppose 4f + 4n + 3 = -5, -3n - 6 = -4f. Suppose f = 2c + 1 - 9. Suppose -3y + cm + 2 = -5y, 0 = -2y - m + 1. Solve -3j - y = -7 for j. 2 Let v = 34 + -14. Suppose 7s - 3s = v. Solve sr + 2 = -3 for r. -1 Let b(a) = -a*3 - 6a*2 + 16a + 12. Let c be b(-8). Solve q = -3q + c for q. 3 Let m = -15 + 15. Solve m = 2a + 8 + 2 for a. -5 Let m be (34/2 - 4) + -5. Solve m = 3l - 1 for l. 3 Let u be (24/(-10))/(32/(-80)). Solve 0 = -0o + 2o - u for o. 3 Let p = -8 - -5. Let a(l) = l3 - l2 - 4l - 4. Let x be a(p). Let c be x/(-5) - (-4)/10. Solve g + c = -g for g. -3 Let y(r) = -7r3 + 2r*2 + 2r + 1. Let u be y(-1). Let w(h) = h3 + h2 - h. Let p be w(0). Solve pv = 4v - u for v. 2 Let q(v) = v + 4. Let d be q(4). Let s be ((-8)/(-6))/((-4)/(-6)). Suppose 5t - 3z = -s + 11, 3t - 7 = z. Solve d = -tp + 17 for p. 3 Let w = 147 - 147. Solve -3 = -k - w for k. 3 Let u be 39/4 + 1/4. Let r(i) = -i*3 + 3. Let k be r(0). Suppose -3h + 6v - v - u = 0, -4 = kh - 2v. Solve 2f = -hf for f. 0 Let g = -80 + 82. Solve 4u + 6 = g for u. -1 Suppose 2l - 5 = 2b - 1, 5b = 2l + 11. Let q = 11 - l. Solve -d = qd + 20 for d. -4 Let y be (-388)/(-16) - 2/8. Let j be 45/y - 3/(-24). Solve ju = u - 1 for u. -1 Let v be 6/(3/2 - 0). Solve -vw = w for w. 0 Let v = 16 + -7. Let h be -13 - (4 - v). Solve j = -hj - 3 for j. -1 Let i(f) = -f + 1 + 0f - 4. Let t be i(-6). Solve -tk - 2 = -8 for k. 2 Let g(j) = j2 - 6j + 5. Let k be (4/(-3))/((-20)/210). Let h be 22/77 + 66/k. Let n be g(h). Solve nq = 3q - 15 for q. 5 Let t(i) = 22i - 1. Let l be t(1). Let v be 57/l - 8/(-28). Solve -vz - 20 = 2z for z. -4 Let q = -11 - -16. Let b = -3 + q. Solve -bc - 6 = c for c. -2 Suppose i - 4r = 12, 2i - 17 + 3 = 3r. Let y(u) = 2u + 5. Let v(f) = 6f + 16. Let n(d) = -4v(d) + 11y(d). Let k be n(-6). Solve -p - i = -kp for p. 2 Let u(v) = v*3 + 11v*2 - 12v + 1. Let o be u(-12). Let j be (2 + 0)(2 - o). Suppose 3x + x = 0. Solve x = -jp + 4 + 2 for p. 3 Let u = 69 + -64. Solve -ub + 17 = 2 for b. 3 Let p(l) = l*3 + 4l*2 - 11l + 6. Let i be p(-6). Solve -s - 2 = -is for s. -2 Let l(x) = x2 - 3x + 2. Let t be l(2). Suppose t = 3r - 2r + 3. Let c be (-2)/(-2) - (r - -1). Solve -u = cu for u. 0 Suppose -3 = x - 2x. Suppose -5j = o - 31, -xo - j + 6 = -17. Solve -o = i - 3i for i. 3 Suppose -2i + 1 = -2l + 3l, -l + 4i = -7. Solve l = -4o - 1 for o. -1 Let i(r) = r*2 + 10r - 2. Let d be ((-55)/15)/((-1)/(-3)). Let k be i(d). Solve a + k = 4a for a. 3 Let a = 9 + -8. Let i be (-1 - -7)a/2. Solve -d = -i + 2 for d. 1 Suppose 0 = -4l + 20 - 8. Solve 3 = lu - 6 for u. 3 Suppose -3s + 45 = 2s. Solve 3d + 0 + s = 0 for d. -3 Let k = 14 + -9. Solve -6 = kc - 31 for c. 5 Suppose -3 + 0 = -3u. Suppose 6 = -2m + 4q - 0, 4m = -5q + 1. Let j = m + u. Solve -r - 4 = -jr for r. -4 Let k be 5/10 + (-53)/(-2). Suppose 5r - 3o - 3 = o, -k = -5r - 4o. Suppose 0 = -rw + 3, -2f - 2 + 9 = -w. Solve g + f = -g for g. -2 Let l(d) = d*2 + 10d + 12. Let h be l(-9). Solve hj = -j + 8 for j. 2 Suppose 3b - 20 = -2b + s, 5b = -s + 10. Solve bv - v = 0 for v. 0 Let t = -35 + 55. Suppose t = 3g + 2g. Solve gs - 6 - 2 = 0 for s. 2 Let o = 12 + -10. Let i be (-14)/(-35) - o/5. Solve -p - p = i for p. 0 Suppose 0 = 40g - 35g - 5. Solve 2c = -g - 9 for c. -5 Suppose -4g - 3a = 6, 0g + 5g + 8 = -4a. Solve gb + 1 = b for b. 1 Let o be (-10)/44/(-10)4. Solve -10 = oz + 2 for z. -3 Let f be ((-25)/125)/((-2)/20). Let s = -2 + 12. Solve s = -0x - fx for x. -5 Let c = -21 - -22. Solve -c = 3p - 7 for p. 2 Let a = -65 - -67. Solve -7 + 15 = -ai for i. -4 Let q(v) = v*3 + 9v*2 + 7v - 11. Let p be q(-8). Let s be p + 10(-2)/(-4). Suppose so - 16 = -2o. Solve 5l - 3l = o for l. 2 Let c be ((-4)/10)/((-1)/(-5)). Let g = 5 + c. Suppose -gr = -6 - 0. Solve -rh + h + 5 = 0 for h. 5 Suppose -3w + 5u - 11 = 0, -4u - 2 = -3w - 9. Suppose -36 = -0l - wl. Let g = l - 6. Solve 5v + g = 2v for v. -2 Let p(c) = c - 5. Let j(u) = -u2 + 8u - 4. Let i be j(6). Let v be p(i). Solve 5y - 10 = vy for y. 5 Let d(q) = q - 15. Let j be d(17). Suppose jf = f. Solve k = -f - 1 for k. -1 Let f = 30 - 18. Let y(g) = -2g + 12 + 2g - g. Let t be y(f). Solve -3i + 0i + 6 = t for i. 2 Suppose -7u - 3o = -2u + 33, 0 = -3u + 5o - 47. Let k = -4 - u. Let i = 5 - k. Solve i = -5l + 5 for l. 1 Let s(r) = r3 - 9r*2 - 11r + 10. Let l be s(10). Solve -n - n + 8 = l for n. 4 Let x = 6 - 0. Let m be (x1)/(6/3). Suppose 0b = 2a - 5b - 28, 3b = -ma. Solve -ap + 0p + 12 = 0 for p. 3 Suppose -2a + 2l = 2, -3l + 8 = 4a - 4l. Solve -ar = -7 - 5 for r. 4 Suppose 0 = 3z + 2d - 14, 0 = z - 2d - 3 - 7. Let o(i) = i + 2. Let j be o(2). Suppose 9m = 4n + jm - 15, 15 = 5n - 5m. Solve -zv + v = n for v. 0 Suppose q = 5n - 42, -6n - 4q + 21 = -5n. Let i = 6 + -3. Let x(c) = c3 + 3c*2 - 11c - 5. Let p be x(-5). Solve -ia = -pa + n for a. -3 Let i be (10 + (2 - 2))2. Solve -i + 4 = 4s for s. -4 Let r = 1 + -2. Let k be ((-3)/r)/((-4)/(-4)). Suppose kb - 10 = 20. Solve -3d + b = -d for d. 5 Let a(o) = -o*2 + 2o - o*3 - 2 + o + 2o*2. Let q be a(2). Suppose -v - v = q. Solve v = g - 5g - 12 for g. -3 Let t be	{ "pile_set_name": "DM Mathematics" }
3 - op wrt o? -60o2 Suppose 4p - 8 = -4k, 5k - 2p + 2 + 2 = 0. Let x(v) = v3 + v2 + v + 6. Let w be x(k). What is the third derivative of 3 + 3 + 4n4 - w + n2 wrt n? 96n Let h be ((-3)/(-9))/(41/4). Let u(m) be the third derivative of 0 + 0m - 1/24m*4 + 2m*2 - hm*3. What is the first derivative of u(r) wrt r? -1 What is the third derivative of 22 - 3b*6 - 22 - 4b*2 wrt b? -360b*3 Find the second derivative of 10v + 54 - 54 - 30v + 28v*2 wrt v. 56 Suppose 7 = 4t - 13. Let k be 34/30t. What is the second derivative of 5v - v2 - v + 0v*k - 2v wrt v? -2 Let r(o) be the first derivative of -5 - 3 + 3o - o2 + 6. Find the first derivative of r(c) wrt c. -2 What is the first derivative of 15c*4 + 8 - 4 + 1 wrt c? 60c*3 Let g(l) = -15l + 14. Let z(n) = 7n - 7. Let j(r) = -2g(r) - 5z(r). What is the first derivative of j(t) wrt t? -5 Find the first derivative of 2 + 11f*3 - 4f3 - f3 - 11 wrt f. 18f2 Find the second derivative of 2g*5 + 4g*5 - g + 4g*5 - 11g*5 wrt g. -20g*3 Let u(r) be the first derivative of -5/2r*2 + 0r*3 - 7 + 0r + 7/4r4. Find the second derivative of u(j) wrt j. 42j Let l(u) = -u - 1. Let b(j) = -4j - 9. Let a(h) = -b(h) + 5l(h). Let f(o) = 3. Let k(q) = -2a(q) + 3f(q). Find the first derivative of k(x) wrt x. 2 Find the second derivative of 9d - 3d + d*2 + 3d + 0d wrt d. 2 Find the second derivative of 29c*4 - 29c*4 + 7c*5 + 8c wrt c. 140c3 Suppose 4b = -b - 30. Let k(l) = -10l4 - 4. Let z(u) = 9u*4 + 3. Let c(f) = bk(f) - 7z(f). What is the derivative of c(y) wrt y? -12y*3 Let z(i) = i. Let x(v) = -6v. Let t(c) = 5c - 1. Let a(r) = 2t(r) + 3x(r). Let q(p) = -a(p) - 5z(p). Differentiate q(u) with respect to u. 3 Differentiate 178o + 13o*4 + 12 - 178o with respect to o. 52o3 Suppose 4a = -j - 1 + 2, 4j - 4a = 24. Let v = 5 - 2. Differentiate b*4 + 1 - vb*4 - 3 + jb*4 with respect to b. 12b*3 Let f(p) = 19p*2 + 9. Let c(u) = 9u*2 + 4. Let n(a) = -5c(a) + 2f(a). What is the derivative of n(v) wrt v? -14v Suppose 0 = 2m + 2m - 8. What is the first derivative of -2v + 6v*m - 2 + 1 + 2v wrt v? 12v Suppose 2z - 24 - 4 = 0. Suppose -2d - 2k = -z, -13 = 3d - 4d - 4k. Find the second derivative of dy*2 - 3y*5 - 2y - 3y2 - 2y*2 wrt y. -60y*3 What is the third derivative of 5x*2 + 0x*2 - 2x5 - x2 + x*5 wrt x? -60x*2 Let g(v) be the second derivative of 3v + 0v2 + 1/6v*4 + 0 + 1/6v*3. Find the second derivative of g(n) wrt n. 4 Let x(m) = m + 3. Let a(n) = 3n + 8. Let d(i) = 6a(i) - 17x(i). What is the first derivative of d(l) wrt l? 1 What is the first derivative of -2 + 0 + 3 + 2g wrt g? 2 Let u be 3/3 + -1 + 4. Find the third derivative of cu - 3c2 + c2 + 3c2 - 6c*2 wrt c. 24c Suppose 0 = 8h - 4h - 32. What is the derivative of 3u2 - h + 4 + 4u*2 wrt u? 14u Let z = 3 - 0. What is the second derivative of 25 + za - 25 - 2a*5 wrt a? -40a3 What is the third derivative of l4 + l*4 - 4l*4 + 11l*2 - 2l*4 wrt l? -96l Let n(v) be the first derivative of v7/70 + v3 - 2v2 + 10. Let p(y) be the second derivative of n(y). Differentiate p(m) wrt m. 12m3 Let p(w) be the first derivative of w2 - w*2 + 2w*4 - 3w + 4 - 2w. What is the first derivative of p(b) wrt b? 24b2 Let w(z) = -z3 + 4z2 - 2z - 1. Let l be w(3). Find the third derivative of 3k5 - k5 + 5k*l - 2k*2 wrt k. 120k*2 Suppose -m + 14 = 2m - 4p, -29 = 2m + 5p. Let n be -2 - m/(4/10). What is the derivative of -2k*2 - nk*2 + 2k*2 - 3 + 0k*2 wrt k? -6k Let d(t) be the second derivative of -t*6/6 + 5t*2/2 - 13t. Differentiate d(b) with respect to b. -20b3 Let z(w) = -4w*3 - 3w2 + 6. Let t(s) = s2 + 1. Let d(f) = -3t(f) - z(f). What is the derivative of d(l) wrt l? 12l2 Let i(q) = -q5 - q*4 - q. Let j(u) = 16u*6 - 3u*5 - 3u*4 - 14u*2 - 3u. Let v(f) = 3i(f) - j(f). Find the third derivative of v(m) wrt m. -1920m*3 Find the third derivative of -3t*3 + 11t*3 + 13t*3 - 4t*2 - 33t*2 wrt t. 126 Suppose -2y + 10 = 3y. Suppose yp - 1 = 5. Find the third derivative of -2i2 + pi*4 + 3i*2 - 4i*4 wrt i. -24i Let c(d) be the second derivative of 2d6/15 + 7d*3/6 + 27d*2/2 + 6d. What is the first derivative of c(v) wrt v? 16v3 + 7 Let d = 26 - 22. Differentiate 1 - md + 6 - 2m*4 wrt m. -12m*3 Let z(x) be the third derivative of 3x7/70 + x3 + 8x2. What is the first derivative of z(k) wrt k? 36k*3 Let n be 10/(-3)(-1 - 2). Suppose -2i - 2 = -n. What is the third derivative of g4 + 3g*2 - 2g2 + gi wrt g? 48g Let b(s) be the third derivative of 0s*3 - 1/24s*4 + 0 + 2s*2 - 1/20s*5 + 0s. What is the second derivative of b(y) wrt y? -6 Let j(r) = -104r4 + 44r*2 - 120r + 44. Let z(b) = -7b4 + 3b*2 - 8b + 3. Let k(x) = 6j(x) - 88z(x). Find the second derivative of k(y) wrt y. -96y2 Let t(p) be the third derivative of 17p*7/210 - 53p*3/6 - 63p*2. What is the first derivative of t(l) wrt l? 68l*3 Differentiate 23z*2 - 4 - 14 + 5 + 5 with respect to z. 46z Let n = 5 + -2. What is the third derivative of nd5 + 4d*5 + 11d*6 + 7d*2 - 7d*5 wrt d? 1320d*3 Let b(w) be the second derivative of 0 + 0w*2 + 3w + 1/3w3 - 5/12w*4. Find the second derivative of b(u) wrt u. -10 Find the third derivative of -48r*6 - 10r*2 + 40r*2 + 34r*6 wrt r. -1680r*3 Suppose -20 = -2j - 8. Let u(k) = -k*2 + 1. Let z(m) = -2m*2 + 9. Let f(b) = ju(b) - z(b). Find the first derivative of f(w) wrt w. -8w Let o(z) be the first derivative of 3z5/20 - z3/3 + z + 1. Let g(p) be the first derivative of o(p). Find the second derivative of g(a) wrt a. 18a Differentiate 20 + 14b - 2b + 5b - 3b wrt b. 14 Suppose -5p + 2t = -5, 6p - 3t - 3 = 3p. Differentiate -p - 10h2 + 6h*3 + 10h*2 - 2h*3 with respect to h. 12h2 Let c(x) be the first derivative of -x7/14 + x*4/3 - 3x + 2. Let v(m) be the first derivative of c(m). What is the third derivative of v(k) wrt k? -180k2 Suppose -3j + 1 = 5r + 3, 2r + 12 = -4j. Differentiate -3y*2 - 6 + 0y*r - 3y*2 + 2y*2 wrt y. -8y Let v(z) = 3z3 + 10z*2 - 23z + 1. Let l(r) = -r*3 - 5r*2 + 11r - 1. Let k(b) = 5l(b) + 2v(b). What is the second derivative of k(x) wrt x? 6x - 10 What is the third derivative of -8r*6 + 48r*2 + 42r*6 + 213r*5 - 213r*5 wrt r? 4080r*3 What is the second derivative of -2w - 12w3 - 14w + 5w wrt w? -72w Find the third derivative of -6k6 + 4k*2 - 8k6 + k6 + 4k2 wrt k. -1560k*3 Let j(b) be the third derivative of 3b*6/40 + 11b*5/60 - 7b*2. What is the third derivative of j(s) wrt s? 54 Let m(y) be the third derivative of 0y*6 + 0y + 0y4 + 0y*3 - 2y*2 + 0 + 1/210y*7 - 1/60y*5. What is the third derivative of m(u) wrt u? 24u Let d(t) = -5t3 + 53t*2 + 11t + 11. Let g(r) = -2r3 + 18r*2 + 4r + 4. Let i(y) = -4d(y) + 11g(y). Find the third derivative of i(v) wrt v. -12 Let a(z) be the third derivative of -7z5/20 - 10z*3/3 - 7z*2. Differentiate a(u) wrt u. -42u Let h(c) = -c2 + 1. Let u(g) = 2 - g + g2 - 2g2 - 1 - g3. Let a(q) = 3h(q) - 3u(q). Find the second derivative of a(s) wrt s. 18s Find the second derivative of -20k2 - 80k + 38k - 10k wrt k. -40 Let x(r) be the third derivative of r6/60 - r4/4 - 7r2. Find the second derivative of x(m) wrt m. 12m Suppose 7 = 2h - 1. Find the second derivative of -2l - l + hl - 4l*2 wrt l. -8 Let w(i) = 36i*4 + 5i*3 - 5i*2 + 5i - 26. Let p(o) = -o4 - o3 + o*2 - o. Let y(c) = 5p(c) + w(c). Differentiate y(l) with respect to l. 124l3 Let v(q) = 4q3 - q4 + 4q4 + 3q*4 + 9. Let u(z) = 17z*4 + 11z*3 + 26. Let a(m) = 4u(m) - 11v(m). Find the first derivative of a(n) wrt n. 8n*3 Let j(v) = 29v*2 - 22v + 5. Let r(n) = -30n2 + 23n - 6. Let x(k) = 6j(k) + 5r(k). Find the second derivative of x(t) wrt t. 48 Let c(u) be the second derivative of -9u6/10 + 23u*3/6 - 64u + 2. Find the second derivative of c(r) wrt r. -324r*2 Let j be 2/(-8) +	{ "pile_set_name": "DM Mathematics" }
Calculate the remainder when c is divided by n. 1 Suppose 505h - 509h = 3x - 771, 956 = 5h - 4x. Calculate the remainder when h is divided by 61. 9 Calculate the remainder when 140 is divided by 3/(4 + 235/(-60)). 32 Suppose 68 = 10i - 7i - 4y, y - 11 = -i. What is the remainder when 59 is divided by i? 11 Suppose -4k - 4 = 48. Let d(u) = u2 + 8u - 16. Suppose 0 = 4l + 3q - 37, -5l + 22 = -q - 29. Calculate the remainder when d(k) is divided by l. 9 Let k = 71 + -31. Let q be 2/(-3)267 - -12. Calculate the remainder when k is divided by (q/56)/(-1 + 12/14). 18 Let p = 88 + -80. Calculate the remainder when 63 is divided by p. 7 Let h(x) = x3 + 2x*2 - x + 2. Let l be h(-3). Let c = l + 4. Suppose -j - 6 = -3a, j = -2a - ca + 4. What is the remainder when a is divided by 1? 0 Suppose 4j - 2f = 10, -3j + 3f + 2f = -11. What is the remainder when 10/6(28 + j) is divided by 4 - 0/5 - -9? 11 Suppose -3g - q = -0q - 85, -2q = g - 35. Suppose -8 = -4s + 48. Calculate the remainder when g is divided by s. 13 Let l be (440/(-77))/((-4)/14). Suppose l + 25 = 3f. Calculate the remainder when f is divided by 6. 3 Suppose 371 = 2o - 5z, -2o + 5z + 365 = 6z. What is the remainder when o is divided by 46? 45 Suppose 31 + 0 = t. What is the remainder when (-3 - 77/(-21))/(3/234) is divided by t? 21 Let i = 536 - 520. Calculate the remainder when 73 is divided by i. 9 Suppose 1 + 7 = 2b, 2b = -5h - 217. Let v = h + 127. Calculate the remainder when v is divided by 22. 16 Let t(y) = -y2 - 7y - 3. Let j be t(-3). Suppose 9r = 18 - j. What is the remainder when r is divided by 1? 0 Calculate the remainder when 114 is divided by 1 + 0 - (-39 + 0 + 9). 21 Let y(t) = t2 - 3t - 26. What is the remainder when 90 is divided by y(-5)? 6 Suppose -l = 4l + 15. Let a = l + 8. Let y = a + 2. Calculate the remainder when 24 is divided by y. 3 Suppose 26s - 80 = 18s. Calculate the remainder when 59 is divided by s. 9 Suppose -2n + 64 = -5v, -95 = -5n - 3v + 34. Calculate the remainder when 344 is divided by n. 20 Let f = 499 - 478. What is the remainder when 1112 is divided by f? 20 Let v = 14 + 2. Let w be (1 + 12 - 1) + -1. Let b = v - w. What is the remainder when b is divided by 2? 1 Suppose 105 = j + 4j. Calculate the remainder when j/((-3)/9-1) is divided by 8. 7 Let l(r) = -2r*2 - 3r + 2r2 + 6 + r + r2. What is the remainder when 83 is divided by l(5)? 20 Let h = -19 - -21. Suppose -4o + 13 = -b - 4, -2b = ho - 16. Let s = -5 + 10. Calculate the remainder when s is divided by b. 2 Let f = 10 - 7. Suppose 53 + 61 = fv. What is the remainder when v is divided by 10? 8 Let a be -5(0 - (-6)/(-5)). Let d = 19 + -17. Let y = a - d. What is the remainder when 10 is divided by y? 2 Let v(t) be the third derivative of 0t + 1/6t*3 + 0 + 0t*4 - 3t*2 + 1/12t*5. What is the remainder when 10 is divided by v(-1)? 4 What is the remainder when (-2 + 1)/1(-132 + 108) is divided by 7? 3 Suppose -2b - 6 + 38 = 2c, 0 = -5c + b + 74. What is the remainder when 131 is divided by c? 11 Suppose -305 = 3j + 2j. Let n = j - -120. What is the remainder when n is divided by 15? 14 Suppose 20k - 346 - 454 = 0. Calculate the remainder when k is divided by 29. 11 Let n = 112 + -110. What is the remainder when 31 is divided by ((-21)/(-6) - 5) + 27/n? 7 Let k(i) = -i*3 + 8i*2 - 3i - 24. Let t be k(7). Suppose tn - 38 - 82 = 0. Let g(r) = -12r. What is the remainder when n is divided by g(-1)? 6 Let b(n) = -2 - 2n2 - n - 5n*3 + 2n + n*3. What is the remainder when b(-2) is divided by (-15)/10 + (-500)/(-40)? 9 Suppose 0y - 3y = -4v + 38, 34 = 4v - y. What is the remainder when 71 is divided by v? 7 Let v be -1 - -5 - (13 + -16). Suppose -3y = -v - 56. Suppose z + 2 = 0, -z + 22 = 3n - y. Calculate the remainder when 59 is divided by n. 14 Suppose 0x = 2x. Suppose -20 = -4r - x. Calculate the remainder when 19 is divided by r. 4 Suppose -919 + 861 = -2n. What is the remainder when 82 is divided by n? 24 Let i = -160 - -157. Suppose -5 - 7 = -3d. What is the remainder when 8 is divided by d - (i - -3)/(-2)? 0 Let g = 839 - -58. What is the remainder when g is divided by 11? 6 Let q(b) = 26b - 24. What is the remainder when q(3) is divided by 7? 5 Let t(f) = -3f*3 - 3f*2 - 3f - 2. Suppose 4b = 5m + 174, -5m + 38 + 64 = 2b. What is the remainder when b is divided by t(-2)? 14 Suppose 2q + 156 = 4k, -k - k + 5q + 86 = 0. Let y = -267 - -275. What is the remainder when k is divided by y? 6 Suppose 4a - 3t + 4t = 198, 4a - 206 = -5t. Let o = a + -15. Calculate the remainder when o is divided by 12. 10 Let d be 40/15 - (2 - (-12)/(-9)). Suppose -dh + 23 = -3. What is the remainder when 34 is divided by h? 8 Suppose -12s = -16s + 12. Suppose -4j + 31 = s. What is the remainder when 13 is divided by j? 6 Let d(n) = -8n3 - 3n*2 + n + 4. Let y(w) = 4w + 14. Let b be y(-4). Calculate the remainder when d(b) is divided by 19. 16 Suppose 2y = 2r + 34, y + 3r = -2 - 1. Let q be (-1581)/12 + (-1)/4. Calculate the remainder when ((-2)/(-6))/((-2)/q) is divided by y. 10 Suppose 3i - 13 - 14 = 0. Let d = 15 + -9. What is the remainder when i is divided by d? 3 Calculate the remainder when 99 is divided by (((-231)/14)/11)/(3/(-40)). 19 Let x = 84 - 22. Let o = 87 - x. Calculate the remainder when o is divided by (21/(-6))/(-55/50). 4 Let g = 33 - 20. Let v = 38 - -29. What is the remainder when v is divided by -1 + g + (-6 - -4)? 7 Let t = -13 + 19. Let f(p) = 2p + 24. Let q be f(-8). Calculate the remainder when q(-6 + 3)/(-3) is divided by t. 2 Let j = -756 - -796. What is the remainder when 244 is divided by j? 4 Let w be (8 - 9) + (-3 - 0). What is the remainder when 134 is divided by (-9)/((1/w)/((-15)/(-20)))? 26 Let z be (3/2)/(5/10). Suppose zb - 976 = -b. Suppose 5i - i - b = 0. Calculate the remainder when i is divided by 16. 13 Let l(j) = 45j*2 - 6j - 2. What is the remainder when l(-1) is divided by 40? 9 Let p(t) = -3t2 + 7t + 20. Let r be p(6). Let j = r - -86. What is the remainder when j is divided by 7? 5 Suppose 5x + 4k - k = 37, 0 = 5x + 4k - 41. Let n = 20 - x. Calculate the remainder when n is divided by 4. 3 Suppose 16 = -6p + 88. Let m(z) = 2z*2 - 19z + 34. What is the remainder when m(p) is divided by 33? 28 Let x = -279 - -306. What is the remainder when x is divided by 25? 2 Let l be ((-21)/(-14))/(6/16). What is the remainder when 45 is divided by -1 + l/(7 + -3) - -10? 5 Let j = 967 + -586. What is the remainder when j is divided by 51? 24 Let a be 1 - 4 - (-3 - -1). Let t = -12 - -17. Calculate the remainder when a - (-5 + 3) - -5 is divided by t. 1 Suppose -10 = -l - 0l. Calculate the remainder when (-7)/3(-18)/3 is divided by 2/l - (-48)/10. 4 Calculate the remainder when 244/3(-792)/(-96) is divided by 136. 127 Let b = 154 - 155. What is the remainder when b - 2 - 2/(-1) - -43 is divided by 15? 12 Let m = 40 - 76. Let b = 53 + m. Let n = 91 + -44. Calculate the remainder when n is divided by b. 13 Suppose 6o - 1500 = -24o. Calculate the remainder when o is divided by 15. 5 Let k = -1048 + 1219. Calculate the remainder when k is divided by 6. 3 Let k be 48 + -6 - (-1 - 0). Suppose -5a = 2q - 133 - k, 3a - 5q - 118 = 0. What is the remainder when 34 is divided by 1/((4/a)/1)? 7 Let k(v) = -38v - 580. What is the remainder when 550 is divided by k(-20)? 10 Suppose -3 = k - b + 1, 2b - 10 = 0. Suppose 1 = -l + 3. Calculate the remainder when l is divided by k. 0 Let n = 5 + 22. Let i = 58 - 6. Let t = i - n. Calculate the remainder when t is divided by 9. 7 Let x(b) = 2b + 18. Suppose -5y + 7y + 24 = 0. Let k be x(y). Let t(c) = c*3 + 8c*2 + 7c + 2. What is the remainder when 61 is divided by t(k)? 29 Let y(m) = -10m + 5. Let w be y(-7). Let b = -41 + w. What is the remainder when b is divided by 12? 10 Suppose -3v + 23 + 22 = 0. Suppose -b + 21 = 1. Let q = b - -22. What is the remainder when q is divided by v? 12 Suppose -5n + 5r + 1349 - 9 = 0, -r = 2. Suppose -5k - n = -12k. Calculate the remainder when k is divided by 14. 10 Suppose -311 = -5w - 4m, 3w - 5m + 68 = 225. Let z = -34 + w. What is th	{ "pile_set_name": "DM Mathematics" }
sqrt(19) Simplify (2 + sqrt(468))5 + sqrt(468) + (5 + (sqrt(468) + 0)*2 - sqrt(468)). 30sqrt(13) + 483 Simplify (2sqrt(245)-1)*2 + (-2 + sqrt(5) + 0)5. 5sqrt(5) + 970 Simplify 66(sqrt(27))2 + -2. 970 Simplify 5(((-2sqrt(132))/sqrt(12))2 - sqrt(11)). -5sqrt(11) + 220 Simplify sqrt(54)/sqrt(2) + sqrt(3)-23 + sqrt(3) + 5. -2sqrt(3) + 5 Simplify (sqrt(88) + (-5(sqrt(88) + (sqrt(88) - sqrt(88)1)) - sqrt(88)))/(3sqrt(72) - sqrt(72)). -5sqrt(11)/6 Simplify (-3sqrt(152)-2)/(sqrt(64)/(-1sqrt(8))). -6sqrt(19) Simplify (sqrt(1700) - (sqrt(1700) - -2sqrt(1700)) - sqrt(17))-6. 126sqrt(17) Simplify -1(sqrt(11) + -1 + sqrt(11)) + (sqrt(11) + 0 - sqrt(11))-1. -2sqrt(11) + 1 Simplify (sqrt(12)/sqrt(6) + -4)25. -40sqrt(2) + 90 Simplify 4sqrt(833) + sqrt(833) + sqrt(102)/sqrt(6)-4. 31sqrt(17) Simplify (sqrt(77) + 31sqrt(77))/(-4sqrt(7)1). -sqrt(11) Simplify (3(sqrt(144)/sqrt(6))/sqrt(2))2. 108 Simplify ((-3sqrt(468) + sqrt(13) - sqrt(13)) + (2sqrt(78))/sqrt(6))2. 3328 Simplify (-6(sqrt(2) + 2) + sqrt(2)-3 + -1)2. 234sqrt(2) + 331 Simplify sqrt(160)/(sqrt(200) - sqrt(8)). sqrt(5)/2 Simplify (31sqrt(91))/(sqrt(7) - sqrt(189)/sqrt(3)). -3sqrt(13)/2 Simplify sqrt(147) + 2 + sqrt(147) + 0. 2 + 14sqrt(3) Simplify (sqrt(2448) + (sqrt(2448) - (sqrt(2448) + 2))-4 + sqrt(2448) - sqrt(2448))2. 192sqrt(17) + 2512 Simplify 2 + (sqrt(68)/sqrt(4) + -4)2 + (-1 + sqrt(2448) + 2)2. 16sqrt(17) + 2484 Simplify (sqrt(525) - sqrt(525)2)/sqrt(3). -5sqrt(7) Simplify -2sqrt(275) + (sqrt(11) - (((3 + sqrt(11))-2 - sqrt(11)) + sqrt(11) - sqrt(11))2). -45sqrt(11) - 135 Simplify (sqrt(475) + 1)*2 - (sqrt(19) + -2 + 5). 9sqrt(19) + 473 Simplify (-3 + (-1 + sqrt(21)/sqrt(3) - (sqrt(7) - (0 + sqrt(7) + 4))))2. 7 Simplify (5 + sqrt(33)/(sqrt(11) + sqrt(77)/(sqrt(21)/sqrt(3))))2. 5sqrt(3) + 103/4 Simplify (sqrt(363) - (sqrt(363) + sqrt(363) + sqrt(363) + (sqrt(363) - (sqrt(363) + 0)2) + -1)) + -2. -33sqrt(3) + 362 Simplify -2(sqrt(325))2-4. 2600 Simplify -2(1(sqrt(162) + ((sqrt(162) + 1)*2 - sqrt(162))) + sqrt(162)). -326 - 54sqrt(2) Simplify (2 + 1 + sqrt(2) - (1 + sqrt(18)))*2. -8sqrt(2) + 12 Simplify -5((sqrt(7) + sqrt(56)/(sqrt(16)/sqrt(2)) + sqrt(7))2 - sqrt(7))-2. -10sqrt(7) + 630 Simplify 2(-1 + sqrt(288) + -1)-1. -24sqrt(2) + 4 Simplify -3(sqrt(38)/sqrt(2)4 - sqrt(304)1). 0 Simplify (sqrt(55) - (sqrt(385)/sqrt(7)3 + sqrt(55)))/sqrt(5)2. -6sqrt(11) Simplify (-1sqrt(91)2)/((sqrt(63)-1)/sqrt(9)). 2sqrt(13) Simplify sqrt(8)/(sqrt(4) + sqrt(8)/sqrt(2)) - (sqrt(288)2)2. -1152 + sqrt(2)/2 Simplify (3-1sqrt(143))/(sqrt(1331) + sqrt(1331) + sqrt(1331)1). -sqrt(13)/11 Simplify 0 + sqrt(637) + (1sqrt(637))2-4. -2548 + 7sqrt(13) Simplify (2sqrt(144))/(-1sqrt(242))-1. 12sqrt(2)/11 Simplify (5 + sqrt(1088) + -2 + sqrt(1088) - (sqrt(1088)2-6 - sqrt(1088)))2. 720sqrt(17) + 244809 Simplify (2 + (sqrt(88)-4 - sqrt(88))/sqrt(8))2. -20sqrt(11) + 279 Simplify 3-2((4(sqrt(1088) + 1) + sqrt(1088))2 - sqrt(1088)). -163296 - 1872sqrt(17) Simplify (4 + (sqrt(19) - sqrt(114)/sqrt(6)2))2. -8sqrt(19) + 35 Simplify 1 + (0 + sqrt(19)2 - (-1sqrt(114))/sqrt(6))*2 + -2. 170 Simplify (-2sqrt(882))/(sqrt(18)/sqrt(3)-4). 7sqrt(3)/2 Simplify (sqrt(325) + sqrt(325) + (sqrt(325) - 1sqrt(325)) + sqrt(325) + -3)2. -90sqrt(13) + 2934 Simplify 0 + (sqrt(80) + 0 + sqrt(80) + sqrt(80))*2 + sqrt(40)/sqrt(128). sqrt(5)/4 + 720 Simplify 3 + 2 + (sqrt(52)-2)*2. 213 Simplify -2sqrt(891)4 + -4. -72sqrt(11) - 4 Simplify (sqrt(63)/(sqrt(28)/sqrt(4)) - sqrt(9))/sqrt(3). 0 Simplify ((sqrt(400)2)/sqrt(10))/sqrt(8). 2sqrt(5) Simplify ((sqrt(57) - sqrt(57)1-1)/(sqrt(96)/sqrt(2)))*2. 19/4 Simplify -5((sqrt(637) - (sqrt(637)1)2) + sqrt(637) - sqrt(13)). -65sqrt(13) + 3185 Simplify 1 + sqrt(19) + sqrt(2736)-2. -23sqrt(19) + 1 Simplify (4 + 1sqrt(5) + sqrt(5))4. 16 + 8sqrt(5) Simplify 3(sqrt(147) - (-1sqrt(147) + 0)). 42sqrt(3) Simplify (1 + 2 + (sqrt(7) - (sqrt(28)/sqrt(4) + sqrt(7))) + (sqrt(252) + -1 - sqrt(252)))*2. -4sqrt(7) + 11 Simplify ((sqrt(81) + sqrt(9))3 + sqrt(9))/(sqrt(9)/sqrt(3)5 - sqrt(3)). 13sqrt(3)/4 Simplify 3(sqrt(45) + (sqrt(45) - (sqrt(45) + 3)) + sqrt(45) + sqrt(45) + 2 + sqrt(5)). -3 + 30sqrt(5) Simplify 4(sqrt(252)4)/(sqrt(9) + sqrt(18)/sqrt(8)). 64sqrt(7)/3 Simplify ((sqrt(198) + -1sqrt(198) + sqrt(198))5)/sqrt(11). 15sqrt(2) Simplify (-2sqrt(2940))/(-1sqrt(972) + sqrt(972) + sqrt(12)). -14sqrt(5) Simplify (-3 + -1sqrt(11) - sqrt(99)/(sqrt(18)/sqrt(2))) + -5. -8 - 2sqrt(11) Simplify -5-2((sqrt(209) - (sqrt(209) + sqrt(209)5))/sqrt(11) - sqrt(19)). -60sqrt(19) Simplify -4sqrt(156)/(4sqrt(48)). -sqrt(13)/2 Simplify ((sqrt(187) - 1sqrt(187))1 - sqrt(187) - sqrt(187))/(-4-2sqrt(11)). -sqrt(17)/4 Simplify 1sqrt(931)-4. -28sqrt(19) Simplify (4 + sqrt(17))5 - (sqrt(153) + -5). 2sqrt(17) + 25 Simplify (5(sqrt(7) + -4 + -1))*2. -250sqrt(7) + 800 Simplify sqrt(63)/(-6sqrt(81)). -sqrt(7)/18 Simplify 4 + (-2sqrt(1216))*2 + 2. 4870 Simplify ((sqrt(10) - sqrt(40)/sqrt(4))-3)/(sqrt(405)-1). 0 Simplify 5(sqrt(117) + sqrt(117) + -2 + 0)*2. -120sqrt(13) + 2360 Simplify (-2 + sqrt(190)/(sqrt(110)/sqrt(44) - sqrt(10)))-5. 10 + 10sqrt(19) Simplify sqrt(152)/(3sqrt(200)). sqrt(19)/15 Simplify -1((sqrt(48)-2)/sqrt(12))/(sqrt(2) + sqrt(256)/sqrt(8)). 2sqrt(2)/5 Simplify 2 + (-5 + sqrt(343))*2. -70sqrt(7) + 370 Simplify 1 + sqrt(1100) - ((sqrt(132)-3 + sqrt(132) + sqrt(132))/sqrt(12) + sqrt(11))2. 1 + 10sqrt(11) Simplify (sqrt(136) + (sqrt(136) - (sqrt(136) + sqrt(136)-2)-5))/(-3sqrt(16)/sqrt(2)). sqrt(17) Simplify (-1 + sqrt(272))2 - (5 + sqrt(170)/sqrt(10)). -9sqrt(17) + 268 Simplify sqrt(2736) + sqrt(2736) + 6(sqrt(2736) - (sqrt(2736) + -3)). 18 + 24sqrt(19) Simplify ((sqrt(720)/(sqrt(12)1) + sqrt(60))/((sqrt(96) + -2sqrt(96) + sqrt(96) + sqrt(96) - sqrt(96))/sqrt(8) - sqrt(12)))*2. 20 Simplify -3 + 2 + sqrt(720) + 3. 2 + 12sqrt(5) Simplify -4 + -5 + 5sqrt(275) + sqrt(275). -9 + 30sqrt(11) Simplify ((sqrt(119) + -2sqrt(119))3 + sqrt(119))/((sqrt(7) - sqrt(7)-1)-1). sqrt(17) Simplify (sqrt(9) + (sqrt(27)/sqrt(3) + sqrt(9))-6 + sqrt(9))/(sqrt(75) + (sqrt(75) - ((-2sqrt(75) - sqrt(75)) + sqrt(75))) - sqrt(75) - sqrt(75) - sqrt(75)). -2sqrt(3) Simplify (2 + sqrt(98))-4 + 3. -28sqrt(2) - 5 Simplify (0 + sqrt(847) + sqrt(847))2 + sqrt(847) + ((1sqrt(84) + sqrt(84))/sqrt(12))*2. 11sqrt(7) + 3416 Simplify 4 + (sqrt(1700) + 1 + 3)*2. 80sqrt(17) + 1720 Simplify ((1sqrt(567))/(sqrt(9) - (sqrt(9) + 5(sqrt(9) - sqrt(36)))))*2. 63/25 Simplify sqrt(7) + (4(-1 + sqrt(7)))*2 + -3. -31sqrt(7) + 125 Simplify -3((sqrt(6300)1)*2 + 2). -18906 Simplify 3(1sqrt(144))/(-2sqrt(72)). -3sqrt(2)/2 Simplify (sqrt(128) + 1 + sqrt(128))2. 32sqrt(2) + 513 Simplify (sqrt(6)/(sqrt(3)2))2 + (sqrt(2) + 0 + -1)2. -2sqrt(2) + 7/2 Simplify (sqrt(7) - 2(sqrt(7) + 1))2 + 0 + sqrt(700). 11 + 14sqrt(7) Simplify sqrt(17) + (4 + sqrt(68) + sqrt(17))*2 - ((1 + sqrt(17))-3)*2. 7 + 7sqrt(17) Simplify (((sqrt(170) + (sqrt(170)-1 + sqrt(170) - sqrt(170)))4)/(2sqrt(40)/sqrt(4)))2. 0 Simplify ((3sqrt(425))*2 + sqrt(425))6. 30sqrt(17) + 22950 Simplify -5 + sqrt(343) + sqrt(7) + (sqrt(7) - (4 + sqrt(28)) - sqrt(7)). -9 + 6sqrt(7) Simplify (5(-1sqrt(187) + sqrt(187)))/(sqrt(11)-11). 0 Simplify (-2sqrt(243)4)2 + (4 + (sqrt(243) + 0 - sqrt(243) - sqrt(243) - sqrt(243)))2. -144sqrt(3) + 16540 Simplify sqrt(500) - 3(sqrt(500) + 2 + sqrt(500))*2. -6012 - 230sqrt(5) Simplify ((sqrt(190)3 + sqrt(190))-2)/sqrt(10). -8sqrt(19) Simplify sqrt(288) + (sqrt(288)-5 + sqrt(288))2 - (sqrt(242) + -1). sqrt(2) + 4609 Simplify (-2 + sqrt(125) + 5)2. 30sqrt(5) + 134 Simplify 2sqrt(30)/(sqrt(40)/sqrt(4)). 2sqrt(3) Simplify 0 + -2(sqrt(51)/sqrt(3) + sqrt(17)). -4sqrt(17) Simplify 5(sqrt(52) - sqrt(208)) - (sqrt(156)/((sqrt(96)-1)/sqrt(8) - sqrt(12)))2. -10sqrt(13) - 13/4 Simplify (sqrt(57)/(-1sqrt(3)) - (sqrt(19) - (sqrt(95) - -1sqrt(95))/sqrt(5) - sqrt(19))) + -5. -5 + sqrt(19) Simplify 2sqrt(28) - (sqrt(70)3)/sqrt(10). sqrt(7) Simplify (sqrt(200) + -1 + 0)*2 + -5(1 + sqrt(2	{ "pile_set_name": "DM Mathematics" }
- 2w5/15 + w2 + 5. Let f(g) be the second derivative of o(g). Factor f(s). 2s*2(s - 2)*2(s - 1) Suppose -4 = -j + 1. Suppose 2g4 - jg*4 + 2g*2 - 2g + 2g3 + g4 = 0. What is g? -1, 0, 1 Suppose 0 = r - 2z + 2, r + r + 16 = z. Let y be r/2824/(-30). Factor -2/7c*3 + yc + 0 + 2/7c2 - 2/7c*4. -2c(c - 1)(c + 1)*2/7 Suppose 0 = 5f - 6 + 61. Let h be 12/4 - f/(-5). Solve h - 14/5o3 - 24/5o*2 - 6/5o = 0 for o. -1, 2/7 Suppose 2j = -10, 5j = -5z - 9 - 1. Let h(c) be the third derivative of 0c*4 - 1/120c*6 + zc*2 + 0 - 1/60c*5 + 0c + 0c3. Factor h(r). -r2(r + 1) Let a be (4 + -4)/(-2 - -1). Suppose a = -f - 0f - 5, 4f + 28 = 4p. What is g in -1/2g*4 + 1/2g*p - 1/2g*5 - g + 0 + 3/2g3 = 0? -2, -1, 0, 1 Let c(a) be the third derivative of -a5/20 - a*4/2 + 5a*3/2 + 3a*2. Solve c(i) = 0 for i. -5, 1 Let x(u) be the first derivative of -4 - 3/4u*4 + 6u + 3/10u5 + 3u*2 - 3/2u3. Find a such that x(a) = 0. -1, 2 Let w(p) = -p2 + 2p + 5. Let j be w(4). Let u be (7 + j)/(-1 - -2). Factor -10n*u + 0n + 14n3 - 4n*2 + 0n. -2n2(n - 1)(5n - 2) Let j(o) be the second derivative of -7o6/15 - 9o*5/5 - 10o*4/7 - 8o*3/21 + 40o. Factor j(a). -2a(a + 2)(7a + 2)*2/7 Let u(a) be the second derivative of 2a*6/105 + 3a*5/35 + 13a4/84 + a3/7 + a*2/14 - 7a. Suppose u(b) = 0. Calculate b. -1, -1/2 Suppose 13x = 18x - 15. Let n(f) be the first derivative of -x + 0f - 1/4f*4 + 0f*2 + 2/3f*3. Solve n(o) = 0 for o. 0, 2 Let m = 2 + -6. Let p be (-2 + 0 + 1)m. Factor -2jp - 2j*3 + 0j*3 - 3j4. -j3(5j + 2) Let v be (-10)/(-6) + 3/9. Suppose 4n - 8 - 16 = 0. Determine p so that 0p*3 - 3p*4 + 2p - vp3 - 5p*2 - np*5 + 14p4 = 0. -2/3, 0, 1/2, 1 Let w(l) = l4 - 7l3 - 3l*2 + 7l - 6. Let x(v) = 7v3 + 3v*2 - 7v + 7. Suppose 0 = -2i + i + 4. Let n(s) = ix(s) + 5w(s). Factor n(o). (o - 1)2(o + 1)(5o - 2) Let l be (7/(-3) + 2)10/(-35). Let i(n) be the third derivative of -5/84n*4 + 0n + 5n2 + 0 - 1/30n*5 + ln*3. Solve i(u) = 0. -1, 2/7 Let x(j) = -11j*3 + 10j*2 - 2j. Let n(m) = -54m3 + 50m*2 - 10m. Let c(q) = -3n(q) + 14x(q). Solve c(k) = 0. 0, 1/4, 1 Let i = 6 - 5. Suppose i - 2v + v3 - v4 + 4v + 0v4 - 3v*3 = 0. What is v? -1, 1 Let l(z) = z + 9. Let k = 1 + -8. Let c be l(k). Let -40/9i*5 - 16/3i*3 + 4/9i + 0 - 2/9ic + 86/9i4 = 0. Calculate i. -1/4, 0, 2/5, 1 Let j(h) be the third derivative of -h8/560 - 4h7/525 - h6/100 + h4/120 - 2h2. Solve j(n) = 0 for n. -1, 0, 1/3 Let v(q) be the second derivative of q4/18 - q*3/9 + 6q. Find h such that v(h) = 0. 0, 1 Let h be 8/3(-18)/(-8). Let r(l) be the third derivative of 0l*3 + 0 + 1/12l*4 + 2/15l5 - l2 + 1/10lh + 4/105l*7 + 0l + 1/168l8. Factor r(y). 2y(y + 1)4 Let u(l) be the third derivative of 0l*5 + 2l*2 + 0l + 0 + 0l3 + 0l*6 + 0l*4 - 1/630l*7. Suppose u(t) = 0. What is t? 0 Let d = 3225/11 - 293. Factor dc*2 - 2/11c + 0. 2c(c - 1)/11 Let g(m) = 5m4 - 4m*3 + 5m*2 + 3. Let s(w) = 15w*4 - 13w*3 + 14w*2 + 8. Let b(j) = -8g(j) + 3s(j). Factor b(a). a2(a - 1)(5a - 2) Let c be 1/((-3)/(-2) - 1). Let w be 3/(-2 + 24/3). Factor 0d + wdc + d3 + 1/2d4 + 0. d2(d + 1)*2/2 Factor 10/7q*3 + 1/7q*5 + 5/7q - 5/7q4 - 10/7q2 - 1/7. (q - 1)5/7 Let y(w) = -8w2 + 28w - 22. Let h(x) = -x*2 + 4x - 3. Let a(g) = 44h(g) - 6y(g). Factor a(s). 4s(s + 2) Let x(s) = -s*3 + 3s - 1. Let h be x(2). Let p be (1/(-9))/(h/18). Find q such that pq + 2q*2 - 2/3q*4 - 4/3 - 2/3q*3 = 0. -2, -1, 1 Factor 28x*2 + 20x*3 - 32x*3 + 6x - 7x2. -3x(x - 2)(4x + 1) Let g(o) be the second derivative of 16o*7/189 - 8o*6/135 - 23o*5/90 + 7o*4/54 + 7o3/27 + o2/9 + 32o. Determine a so that g(a) = 0. -1, -1/4, 1 Let f(a) = -2a*5 - 38a*4 + 42a*3 - 18a2. Let t(l) = l5 + 13l4 - 14l*3 + 6l*2. Let m(u) = -3f(u) - 8t(u). Factor m(n). -2n*2(n - 3)(n - 1)2 Let b be -2 + 42/12 + 0. Factor 1 + 1/2x*2 + bx. (x + 1)(x + 2)/2 Let u(z) = z + 16. Let v be u(-10). Suppose 0 = -2y - 4b + v + 14, -5y + b = 5. Factor -1/2a3 + a2 + y - 1/2a. -a(a - 1)2/2 Let f(i) = -i2 - i + 1. Let w(a) = -a4 + a2 + 3a + 8. Let x(u) = u*2 - 4u - 1. Let n be x(-3). Let k(t) = nf(t) - 4w(t). Factor k(o). 4(o - 3)(o + 1)*3 Solve -4/3d - 4/3 + 4/3d2 + 4/3d3 = 0 for d. -1, 1 Let b(c) = c3 - 43c2 - 187c - 256. Let w = 25 - 31. Let s(x) = -2x3 + 42x*2 + 186x + 256. Let m(y) = wb(y) - 5s(y). Find p, given that m(p) = 0. -4 Suppose 6w - 2w = 0. Suppose w = t + 4t. Factor tu*2 - 4/9u*3 + 0 + 2/9u + 2/9u5 + 0u*4. 2u(u - 1)2(u + 1)2/9 Let i(r) be the first derivative of -r8/9240 - r*7/4620 - 4r*3/3 + 8. Let p(f) be the third derivative of i(f). Factor p(g). -2g*3(g + 1)/11 Let j be (-4)/(-6) - (-7)/3. Let l be 1 - ((-12)/j)/(-12). Solve -lf + 10f2 - 4/3 = 0 for f. -1/3, 2/5 Let j(r) be the second derivative of -r4/6 + r*3 - 2r*2 + 9r. Let j(w) = 0. Calculate w. 1, 2 Let z(i) = i3 + i2 + 3i - 5. Let q(k) = 6k*3 + 4k*2 + 16k - 26. Let j(y) = 6q(y) - 33z(y). Factor j(w). 3(w - 3)(w - 1)(w + 1) Let q(x) be the third derivative of 0 + 1/210x*5 + 5x*2 + 0x + 0x3 + 0x*4. Factor q(l). 2l*2/7 Suppose 24 = 3n - 6. Let s = -17 + 19. Factor 2 - 33i3 - 26i + 44i4 + 64i*s - ni*5 + 2 - 43i*3. -2(i - 1)*4(5i - 2) Let c(i) = i4 + i3 + i2 - i + 1. Let p(x) = 2x*5 - 9x*4 + 19x*3 + 15x*2 - 21x + 3. Let s(a) = -3c(a) + p(a). Solve s(w) = 0. -1, 0, 1, 3 Suppose -3g = g + 384. Let y be (-2)/9 - g/189. Factor 0h - y + 2/7h*2. 2(h - 1)(h + 1)/7 Let y(j) = 12j*3 - 4j*2 - 12j. Let i(q) = -q4 - q2 + q. Let s(z) = -4i(z) + y(z). Factor s(k). 4k(k - 1)(k + 2)*2 Let y be 1/((-6)/21)2. Let c(w) = -13w3 - 24w*2 - 30w - 5. Let k(n) = 9n3 + 16n*2 + 20n + 3. Let a(b) = yk(b) - 5c(b). Factor a(z). 2(z + 1)2(z + 2) Let t(x) be the first derivative of 2x3/9 + 4x*2/3 + 2x - 4. Find w, given that t(w) = 0. -3, -1 Let k(y) = 3y3 - y2 - y + 2. Let n be k(2). Find c such that -10c + nc2 + 7c*3 - 13c*3 + 4 - 8c = 0. 1/3, 1, 2 Let p(a) = 3a - 6. Let m be p(6). Suppose 3i = -i + m. Solve ij + 2 - j2 - 3j*2 + 5j*2 = 0. -2, -1 Let u(p) be the third derivative of 1/525p*7 + 0 + 1/100p*6 + 0p*3 + 3p*2 + 1/60p*4 + 0p + 1/50p5. Suppose u(j) = 0. What is j? -1, 0 Let s(t) = 8t*4 - 21t*3 - 61t*2 - 13. Let v(y) = 4y*4 - 10y*3 - 30y*2 - 6. Let r(p) = -6s(p) + 13v(p). Factor r(z). 4z*2(z - 3)(z + 2) Let f(p) be the second derivative of -p8/2800 + p7/6300 + p6/900 - 5p*4/12 - 3p. Let a(t) be the third derivative of f(t). Find r such that a(r) = 0. -1/2, 0, 2/3 Let 8g5 - 4g - g - 2g2 + 12g*2 - 3g*5 - 10g*4 = 0. What is g? -1, 0, 1 Factor 0j*2 - 1/4j*3 + 0 + 0j. -j*3/4 Let y(f) be the first derivative of 2f*3/21 - 2f*2/7 - 6f/7 - 13. Factor y(h). 2(h - 3)(h + 1)/7 Let l be 0(-4 + (-2 - -5)). Factor -7s*2 - 4s*3 + 6s*2 + 4s + ls2 + 1. -(s - 1)(s + 1)(4s + 1) Solve 0j2 - 6/5 + 3/5j*3 - 9/5j = 0 for j. -1, 2 Let k = 1/493 - -6893/4437. Suppose 2g2 - 10/9g*3 + 2/9g*4 - kg + 4/9 = 0. What is g? 1, 2 Let v(g) = -162g4 - 563g*3 - 548g*2 - 163g - 11. Let a(z) = 81z4 + 282z*3 + 274z*2 + 81z + 5. Let u(y) = 5a(y) + 3v(y). Factor u(q). -(q + 1)(q + 2)(9q + 2)2 Let v = -3 + 9. Let w be 0 + -1 - (-8)/v. Factor 1/3 - 2/3a + wa2. (a - 1)2/3 Let n = -14 - -13. Let j(s) = -s4 + s2 - s + 1. Let w(u) = 3u*4 - 4u*3 + 4u*2 - 2u - 1. Let k(r) = nw(r) - 2j(r). Factor k(l). -(l - 1)*4 Suppose 0 = 3w + 4 - 13. Suppose -wj - 6 = -5j. Solve -2r2 + 2r*j + 3r - 2r2 - r = 0. 0, 1 Factor 3z - 3 - 3/4z2. -3(z - 2)*2/4 Let t = 5 - 3. Factor 0 - 11r - 2r2 + 0r*t + 3r - 8. -2(r + 2)2 Let p(q) be the third derivative of 1/10q*5 + 0 + 1/40q*6 + 0q + 0q3 + 1/8q*4 - 3q2. Solve p(n) = 0 for n. -1, 0 Let p(s) = s3 + 5s2 - 4s - 28. Let l be	{ "pile_set_name": "DM Mathematics" }
) + sqrt(152))1)/(sqrt(8) - sqrt(64)/(sqrt(24)/sqrt(3) + sqrt(8) + sqrt(8))). 3sqrt(19)/2 Simplify -4 + sqrt(1331)-2. -22sqrt(11) - 4 Simplify ((sqrt(7) - (sqrt(7) + -1)) + -4)2. -6 Simplify 1sqrt(13)1 + (sqrt(65)1)/sqrt(5). 2sqrt(13) Simplify ((-2 + sqrt(304))-4)*2. -256sqrt(19) + 4928 Simplify (sqrt(330)/(sqrt(30)/sqrt(5)))/(sqrt(320)2 + sqrt(5) - sqrt(5)). sqrt(11)/16 Simplify (4 + (sqrt(605) + 3)-5)*2. 1210sqrt(5) + 15246 Simplify 2 + 2 + sqrt(363) + -5. -1 + 11sqrt(3) Simplify 6(1 + sqrt(78)/(2sqrt(54) + sqrt(54))). 2sqrt(13)/3 + 6 Simplify (sqrt(12)/(sqrt(42)/sqrt(7)))*2 + sqrt(2) + 1 + -3. sqrt(2) Simplify ((sqrt(500) - -1sqrt(500) - sqrt(500)) + sqrt(500))*2. 2000 Simplify sqrt(27)/(sqrt(9) - (-2sqrt(72) + sqrt(72))/sqrt(8)). sqrt(3)/2 Simplify (1 + 6sqrt(2448)-2)*2. -288sqrt(17) + 352513 Simplify -3 + 1 + sqrt(7) - (sqrt(14)/sqrt(2) + 1). -3 Simplify 5(sqrt(36)/sqrt(3) + 0). 10sqrt(3) Simplify 1 + ((sqrt(77) - sqrt(77)-2)/sqrt(11))2 + sqrt(49)/sqrt(112). sqrt(7)/4 + 64 Simplify (sqrt(1331)2-2 - (sqrt(1331)1 + -1))*2. -110sqrt(11) + 33276 Simplify (((sqrt(5) - 1sqrt(5)) + -1)2 + -1)6 + 2. 2 Simplify ((-2sqrt(104))/sqrt(2))2. 208 Simplify (sqrt(1176) - -1sqrt(1176) - sqrt(24))/(sqrt(32)2). 13sqrt(3)/4 Simplify (sqrt(700) + -2 + sqrt(700) + -3)*2 - sqrt(700). -210sqrt(7) + 2825 Simplify sqrt(16)/(sqrt(8) + sqrt(16)/sqrt(2)-4). -sqrt(2)/3 Simplify (sqrt(153)/sqrt(3)-3)/(sqrt(24)/sqrt(2)). -3sqrt(17)/2 Simplify sqrt(153)/((sqrt(72) + (sqrt(72) - (sqrt(72) + (sqrt(72) - (sqrt(72)5 - sqrt(72))) + sqrt(72))))/sqrt(8)). sqrt(17)/3 Simplify (0 + sqrt(17) + -1)-4. -4sqrt(17) + 4 Simplify ((2 + 1sqrt(147) + sqrt(147) + sqrt(147) + 4 + sqrt(147) + sqrt(147))-4)*2. 6720sqrt(3) + 59376 Simplify (sqrt(102)/(-5(sqrt(6) - -3sqrt(6))))*2. 17/400 Simplify (-4((sqrt(288) - 1sqrt(288)) + sqrt(288) - sqrt(288)) - (3 + sqrt(32) + sqrt(32)2 + sqrt(32)))*2. 96sqrt(2) + 521 Simplify 2 + -3 + sqrt(153) + 0. -1 + 3sqrt(17) Simplify (sqrt(3) + 0)2-2 - (sqrt(48) + -1 + sqrt(48))*2. -199 + 16sqrt(3) Simplify (sqrt(468) + -1sqrt(468)2 + (sqrt(468) - 2sqrt(468)) + 1)2. -24sqrt(13) + 1873 Simplify ((sqrt(91) + (2sqrt(91) - sqrt(91)))/sqrt(7) + 2)5. 10 + 10sqrt(13) Simplify (5-2(sqrt(153) - (sqrt(153) + -1 + sqrt(153))))2. -600sqrt(17) + 15400 Simplify sqrt(304)-2 + sqrt(475)2. 2sqrt(19) Simplify -3(6sqrt(325)-3)*2. -315900 Simplify (0 + sqrt(637))-4. -28sqrt(13) Simplify sqrt(363)-2 + 3 + (sqrt(363)2)2-1. -1449 - 22sqrt(3) Simplify (((sqrt(98)1)/sqrt(2))/sqrt(7))*2 + 1. 8 Simplify -2((-1 + sqrt(396))*25 - sqrt(396)). -3970 + 132sqrt(11) Simplify (sqrt(38)/sqrt(8))2 + -5. -1/4 Simplify sqrt(110)/(-3sqrt(30)/sqrt(3)). -sqrt(11)/3 Simplify (5 + sqrt(2057)1)2. 110sqrt(17) + 2082 Simplify -5((-4 + (sqrt(208) - (sqrt(208) + -2)))-3)*2. -180 Simplify (2sqrt(5200))/(sqrt(4)-1-6). 10sqrt(13)/3 Simplify sqrt(12)/sqrt(6) + -5 + (sqrt(108)/sqrt(6))2. sqrt(2) + 13 Simplify (1sqrt(22)-6)/(sqrt(8)-3). sqrt(11) Simplify ((sqrt(66)3-4)/(sqrt(96) - (sqrt(96) - (sqrt(96)-3 + sqrt(96)))))2. 99/4 Simplify (1-1sqrt(15))/(sqrt(243)-1). sqrt(5)/9 Simplify -5 + (sqrt(209)/(sqrt(1584) + sqrt(1584) + (2sqrt(1584) - sqrt(1584))))2. -6461/1296 Simplify 1 + (sqrt(11) - (sqrt(11) + sqrt(275))) + (sqrt(22)/sqrt(2) + -3 - sqrt(11))2. -5sqrt(11) + 10 Simplify (2(sqrt(12) - (-2sqrt(12) - sqrt(12) - sqrt(12))))/(sqrt(16)5). sqrt(3) Simplify (sqrt(22)/sqrt(176))2 + sqrt(2)-1-3. 1/8 + 3sqrt(2) Simplify (sqrt(40) + (-1sqrt(480))/sqrt(12))/sqrt(8). 0 Simplify sqrt(20)/sqrt(4) + -5 - ((sqrt(720) + 3sqrt(720))*2 - sqrt(5)). -11525 + 2sqrt(5) Simplify sqrt(204)/(2sqrt(768)). sqrt(17)/16 Simplify sqrt(209)/(sqrt(77)/sqrt(7)) + -1. -1 + sqrt(19) Simplify (0 + sqrt(243)1)*2. 243 Simplify ((2 + sqrt(343)1)2 + (-1 + sqrt(343) + -5)2)-3. -2178 + 168sqrt(7) Simplify (sqrt(5) - (sqrt(20)/sqrt(4) + -5) - (sqrt(180) - (sqrt(180) + 0 - sqrt(180)))*2)-5. 875 Simplify -6(sqrt(192) + -1 - sqrt(3) - sqrt(3))1. -36sqrt(3) + 6 Simplify 2(sqrt(1700) + -2 + 4). 4 + 20sqrt(17) Simplify 2 + sqrt(52) + sqrt(13) + (sqrt(13) - (sqrt(117)-2)/sqrt(9)). 2 + 6sqrt(13) Simplify ((-2sqrt(12))/sqrt(4) - (sqrt(36)-2)/sqrt(12))2. 0 Simplify 3 + sqrt(27) - sqrt(12)-1. 3 + 5sqrt(3) Simplify 26(sqrt(343) - sqrt(343)1)4. 0 Simplify (1 + sqrt(1573) + 0 + -1)-6. -66sqrt(13) Simplify sqrt(11) + (sqrt(99)-2)/sqrt(9) + sqrt(44)/sqrt(4)5 + 1. 1 + 4sqrt(11) Simplify (sqrt(351)/sqrt(3) - sqrt(13))*2 + (sqrt(130)-1)/sqrt(10). -sqrt(13) + 52 Simplify -6(5sqrt(343)-1 + -4). 24 + 210sqrt(7) Simplify sqrt(22)/(sqrt(24)/sqrt(108)) - ((sqrt(11) - (sqrt(99) + -3)) + 5)*2. -108 + 35sqrt(11) Simplify (sqrt(75)2)26. 1800 Simplify ((sqrt(198) - sqrt(198)21) + sqrt(198))/(sqrt(66)/(sqrt(24)/sqrt(4))). 0 Simplify 4 + sqrt(2448) + -1. 3 + 12sqrt(17) Simplify (((sqrt(1008) + 1)2 + sqrt(1008) - sqrt(1008)) + sqrt(7) - (sqrt(70)-1)/sqrt(10)) + (1 + sqrt(343))-6. -16sqrt(7) + 1003 Simplify -3 + (5(sqrt(175) + 2))2. 500sqrt(7) + 4472 Simplify (4 + -2sqrt(13) - (sqrt(13) + 0)-5)-3. -9sqrt(13) - 12 Simplify -2 + 1(-1sqrt(2)5)2. 48 Simplify (sqrt(2835)2 - sqrt(2835) - sqrt(35) - sqrt(35))/((sqrt(50) - sqrt(50)2)/sqrt(10)). -7sqrt(7) Simplify 1(sqrt(468) - (sqrt(468) - sqrt(468)-4)). -24sqrt(13) Simplify (sqrt(425))2-5 + -4. -2129 Simplify 4 + (sqrt(18))*2 - sqrt(8)/(sqrt(4)2). -sqrt(2)/2 + 22 Simplify 5-2sqrt(243). -90sqrt(3) Simplify (sqrt(300) + sqrt(300)2 + 0)-5. -150sqrt(3) Simplify ((sqrt(36)/sqrt(3) - sqrt(3)) + 2 + sqrt(6)/sqrt(2))6. 12 + 12sqrt(3) Simplify (-65(sqrt(76)/sqrt(4) + sqrt(19)))*2. 68400 Simplify -5 + ((sqrt(153) + sqrt(153) + sqrt(153)1)4 - (-1 + (sqrt(153) - (sqrt(153) + -1))))2. 22027 Simplify (-5(sqrt(5) + (-2sqrt(45))/sqrt(9)))2. 125 Simplify -5(-4sqrt(252))2. -20160 Simplify 2(sqrt(192) - -4-2sqrt(192)). -112sqrt(3) Simplify (sqrt(121) - 5sqrt(121)-3)/sqrt(11). 16sqrt(11) Simplify 4(-1sqrt(3520))/(sqrt(15)/(sqrt(3)-1)). 32sqrt(11) Simplify -3sqrt(13)-21. 6sqrt(13) Simplify (sqrt(363) + 1 + -2)*2. -22sqrt(3) + 364 Simplify (sqrt(187) - -6(sqrt(187)-2 - sqrt(187)))/(sqrt(176) + (sqrt(176) - sqrt(176)1)). -17sqrt(17)/4 Simplify 4(sqrt(19) + (sqrt(19) + sqrt(19)-4)*2 + 3 + sqrt(19)). 8sqrt(19) + 696 Simplify 6sqrt(38)/(sqrt(2)4)-3. -9sqrt(19)/2 Simplify ((-1sqrt(1008) + sqrt(1008))/sqrt(9))2-1. 0 Simplify ((-4(sqrt(21) - (sqrt(21) - (sqrt(21) - (sqrt(84) - sqrt(21))))))/sqrt(7))2. 0 Simplify sqrt(99) - (-3sqrt(99) + 1)*2. -892 + 21sqrt(11) Simplify (sqrt(75)-2-2 - -3sqrt(75)-1)*2. 75 Simplify ((sqrt(171) - (sqrt(171) - -1sqrt(171))6) + sqrt(171) + sqrt(171))/sqrt(9). -9sqrt(19) Simplify (sqrt(95) + -6(sqrt(95) + sqrt(95)2 + sqrt(95) - sqrt(95)))/(-1sqrt(5)-3). -17sqrt(19)/3 Simplify sqrt(5) + -3 + (0 + sqrt(5))2 + -6sqrt(80). -23sqrt(5) + 2 Simplify (-2((sqrt(275) - sqrt(11)) + 3 - sqrt(11)))*2. 72sqrt(11) + 432 Simplify (-1sqrt(88))/(sqrt(77)/(sqrt(7)-1)). 2sqrt(2) Simplify -5 + (4 + sqrt(13) + -1)-5. -20 - 5sqrt(13) Simplify (sqrt(2) + -6(sqrt(2) + sqrt(12)/sqrt(6)))3. -33sqrt(2) Simplify (sqrt(1584)2 + 3)2. 144sqrt(11) + 6345 Simplify (sqrt(110) + (sqrt(110) + (sqrt(110) + (sqrt(110) - -1sqrt(110)3) - sqrt(110)) - sqrt(110)))/sqrt(10). 5sqrt(11) Simplify 5sqrt(152)/sqrt(128). 5sqrt(19)/4 Simplify 2(sqrt(132)/sqrt(192))*2-5. -55/8 Simplify (-1 + sqrt(2) + -2)*2 - sqrt(4)/sqrt(2)-3. -3sqrt(2) + 11 Simplify (sqrt(1872) + 1 + 1)2. 48sqrt(13) + 1876 Simplify -4 + (sqrt(121)/(sqrt(44)/sqrt(4)) + 2)*2. 11 + 4sqrt(11) Simplify (sqrt(66)/sqrt(6) + sqrt(11) + 5 + -3)*2. 8sqrt(11) + 48 Simplify sqrt(152)/(sqrt(392) - (sqrt(392) - 1sqrt(392))). sqrt(19)/7 Simplify (sqrt(44)-6)*2 - (sqrt(110)/sqrt(2))/sqrt(5). -sqrt(11) + 1584 Simplify 1(sqrt(13) + (sqrt(65) - -1sqrt(65))/sqrt(5)). 3sqrt(13) Simplify 4(sqrt(12) + sqrt(3)) + -1 + -2sqrt(3). -1 + 10sqrt(3) Simplify (sqrt(1152)-5 - sqrt(18))/(-5sqrt(12)/sqrt(2)). 41sqrt(3)/5 Simplify 5(sqrt(567) + 0)2-16. -17010 Simplify (2sqrt(2057)*-6 + 4 + 0 + sqrt(2057) +	{ "pile_set_name": "DM Mathematics" }
composite? False Suppose 0 = t + 5, -j + 3t - 4t = -726. Is j prime? False Suppose -5b + 31 = 1. Let o = 20 - b. Suppose o = a - 23. Is a a prime number? True Let h be (-1)/5 - 63/(-15). Suppose -4q + 54 = 4p - 178, 5q - 235 = -hp. Is p a composite number? True Let w(m) = -m2 - 7m + 10. Let u be w(-8). Let j(t) = -t*u + 35 + 4t - 3t - t. Is j(0) prime? False Suppose -22519 = -4b - u - 3459, -2u = -5b + 23825. Is b a composite number? True Let k(u) = -7u + 5. Let l be k(-6). Let r(s) = -3s - 3. Let y be r(-2). Suppose yn - 34 = -2i + 63, 2n = -i + l. Is i composite? False Let m(j) = -12j - 1. Let z = -7 - -6. Let x be -3 + 0/z - -2. Is m(x) composite? False Let w be ((-15)/9)/(4/96). Is (-2)/((w/(-796))/(-5)) composite? False Is (-9 + 10)/(1/1585) a composite number? True Let k(a) = -2a - 2. Let y be k(-2). Suppose -yi + 93 = i. Is i prime? True Is 1/(((-20)/(-1676))/5) prime? True Let n(i) be the third derivative of 11i6/120 + 3i*2. Is n(1) prime? True Suppose 3z + 2138 = 16865. Is z composite? False Let y = -2019 - -2958. Suppose -2d - 2t = -0t - 382, 5d - 3t = y. Suppose 0 = -5m - 24 + d. Is m prime? False Is (1 - 1 - -1)2353 composite? True Let x be (-3)/(-33/12). Suppose 5v + 4k - 1 = 0, v = -3k - x + 2. Suppose v = -3f + 43. Is f a composite number? True Let n be ((-32)/(-12))/((-1)/3). Let p(q) = -q*2 - 3q + 11. Let v be p(n). Let a = 24 - v. Is a a composite number? False Suppose 3o + 4614 = 9o. Is o prime? True Is (7 - (16 + 2))/((-2)/58) prime? False Let x = 29 + -52. Let a = x - -60. Is a composite? False Suppose 5t - 3 - 9 = -2b, 4t - 24 = 2b. Suppose 2y = d - t + 1, -2d = 4y - 14. Is y - 2 - -15 - 0 composite? True Let b be 0 + 0 - 4/(-2). Suppose by + l - 30 = -0y, -45 = -3y + 4l. Is y prime? False Suppose 3p - 15 = 546. Is p composite? True Suppose 2h = -2q + 16, -q = 4h + q - 34. Suppose -3n - 4s - 3 = -h, 0 = 2s. Is n/6(2 - -289) a prime number? True Suppose 11r + 3110 = 17597. Is r a composite number? True Let l(t) = t*3 - 10t + 5. Is l(8) composite? True Let h(y) = 5y - 85. Let l(z) = 11z - 170. Let s(n) = -13h(n) + 6l(n). Is s(0) prime? False Suppose 0 = -5n + 15. Suppose 2g = f - nf + 1080, g = 4f + 555. Let i = 916 - g. Is i prime? True Let o(l) = 164l2 - 2l + 1. Is o(1) a prime number? True Let v = 256 + -89. Is v a prime number? True Let z = 982 - 648. Is z a prime number? False Let m(n) = -2n + n - 2n*2 - 2n*2 - 2 + 8n*2. Is m(-3) a composite number? False Let c be (3-1)/(9/30). Let u(o) = -2o3 + 9o*2 + 10o + 3. Let p be u(8). Is 1/2 + p/c prime? True Let n(p) = 2 + 2p - 3p + 3. Is n(-5) a composite number? True Suppose 4r - 1 = 3b - 5, 3b + 20 = -2r. Let o be 1281/2r/(-3). Suppose 4k + 0w = -5w + o, 635 = 3k + w. Is k prime? True Suppose -3s - 2j = -147, 5j - 203 = -4s - 0j. Let w = s + -12. Is w a prime number? False Let p(h) = 12h2 - 3h - 3. Suppose 5w + l = -3l + 32, -4l = -3w. Is p(w) a composite number? True Suppose -211 + 1792 = 3i. Is i prime? False Let z(y) = y2 - 19y + 4. Let m be z(-15). Suppose -m = -i - i. Is i prime? True Suppose -2u + 58 = -132. Is u a prime number? False Let t(k) = -3k*2 - 6k - 1. Let j be t(-8). Let w = 315 + j. Suppose b - 2b = -d + 91, 0 = -2d - 4b + w. Is d prime? True Let l = 0 + -3. Let v = 1 - l. Suppose -5c + 401 = -va, -2c = -0a + 2a - 146. Is c a prime number? False Suppose 72 + 48 = 5d. Suppose -m + d = -10. Is m a composite number? True Suppose 3w - 1213 = 2m, w - 426 = 7m - 2m. Is w a prime number? True Let a = 659 - 28. Is a composite? False Let p be ((-1)/(-3))/((-3)/(-1287)). Suppose -11 = -2l + p. Is l composite? True Let s be 18/(-4)(6 + 0). Suppose 18 = -3d - 0d. Let t = d - s. Is t a composite number? True Let w = 568 - 345. Is w a composite number? False Let r be (-1 + (-7)/3)-3. Let k be 36/r + (-4)/(-10). Suppose -kw = -134 - 174. Is w composite? True Let q(l) = 245l + 12. Is q(11) a composite number? False Let w = -2 + -19. Is w/(-2) + (-3)/6 a composite number? True Suppose 7g + 6 = 8g. Suppose -537 = -gh + 3h. Is h a prime number? True Suppose -l + 219 = -3u, -3l = 2u - 0l + 157. Let q be u1/(-2) + -3. Let i = 103 - q. Is i composite? True Suppose 4c = 5q + 85, -q + 20 = -5q. Let b = c + 40. Is b composite? True Suppose 2d + c = -d + 10, 4c = -4d. Suppose -y - 387 = -5h - dy, -y = 3h - 235. Is h prime? True Suppose 6a - a = -120. Let z be 2 - 1/((-2)/a). Is 4/6(-285)/z a composite number? False Let f(r) = -r*3 + 6r*2 - 6r - 1. Let b be f(5). Let c(x) = -x*2 - 5x + 8. Is c(b) a composite number? False Let f(q) = -q*3 - 6q*2 + 6q - 4. Is f(-7) composite? False Is 2 + 1 + 3201 - 1 prime? True Let j(x) = 5x2 + 11x - 19. Is j(14) a prime number? False Let l = -95 + 388. Is l a prime number? True Let a(y) = y*2 - 9y + 8. Let p be a(8). Suppose 6 = 2f - 3d, pd = d. Suppose -fq + 481 = 2b, 4b + 806 = 5q + 3b. Is q a composite number? True Suppose p = 2g + 259, -g + 498 = 2p - 0g. Is p a composite number? False Let r be (3 - 1)-2 - 4. Let h(p) = p*3 + 6p*2 - p - 8. Let y be h(-6). Is 53y/8r composite? True Suppose -178 = 3f + 44. Let m = 109 + f. Is m composite? True Suppose -5j + 5y + 456 = -7964, y = 3. Is j composite? True Suppose -3b - n = -30, 2n + 6 = b - 4. Let o(y) = 3y + 7. Let v(q) = -4q - 7. Let l(t) = -3o(t) - 4v(t). Is l(b) a composite number? True Let g be 130/(-4) + 5/10. Is 1/(-4) - 2216/g composite? True Let h be (-3)/2 - (-45)/6. Is (170/h)/(1/3) composite? True Suppose -t - 6 = 2w, 4w = -0w - 12. Suppose 0 = -v - tv + 47. Is v prime? True Let s(p) = -2 + 2p - 174p - 6p - 129p. Is s(-1) prime? False Suppose -n + 4n = 18. Suppose -3j + nj + 3 = 3a, 1 = -5a - j. Suppose x - 33 = -ax. Is x composite? True Let t = 23 - 17. Let l = 25 - t. Is l a composite number? False Let g = -22 + 12. Is (-93)/(-2) - 5/g a composite number? False Suppose d + 18 = m + 2m, 4d = 2m - 22. Let u be -2 + 1(m - 3). Suppose 0 = -0j - 3j - f + 9, u = -5f. Is j a prime number? True Suppose 0 = 5j - 6 - 19. Suppose -16 = -ja + 34. Is a a composite number? True Let l(s) = s3 - 7s*2 + 2s + 9. Is l(8) composite? False Suppose -2i + 1293 = -3i. Is (4/6)/((-2)/i) prime? True Let z(o) = -10o2 + o + 3. Let a be z(-7). Let y = -281 - a. Is y a composite number? True Suppose 0 = w + 4w - 75. Is (2/5)/(1/w) a composite number? True Let l = 2062 - 1337. Suppose 4n - l = -n. Is n composite? True Suppose 4m + 32 = 5w, 3w + 0m - m = 15. Suppose 5l - wn = 175, 3n = -3l + 7n + 97. Suppose 5k = 66 + l. Is k composite? True Let a = -6 + 10. Suppose 5b = -ap + 87, 5b - p - 2p - 101 = 0. Is b a prime number? True Suppose 4d + 1395 = 9d. Suppose -t = -140 - d. Is t a composite number? False Let b = 12 + -6. Suppose -bd + 12 = -2d. Suppose dh - 6w + w - 247 = 0, -3w = 2h - 152. Is h composite? False Suppose 7 = 5b + 5r - 78, -2r = -3b + 71. Let k = 36 - b. Is k a composite number? True Let v(d) = 5d - 2 + 0 - 2. Suppose 12 + 6 = 3b. Is v(b) a composite number? True Let x = 138 - -11. Is x composite? False Let y = 7 - 2. Let z(f) = -yf + 2f2 - f2 + 14 + 4f. Is z(0) prime? False Let w(z) = -z*3 + 15z*2 + 15z - 17. Is w(14) a prime number? True Suppose -3s + 1203 = -1437. Suppose 2j = -4y + 4j + s, 0 = 3y + 4j - 671. Is y a composite number? True Let o(q) = -q + 4. Let y be o(5). Let b be (-2)/((-6)/9) + y. Suppose br + 3t - 108 = 0, 0t + 149 = 3r - 2t. Is r prime? False Suppose 0 = -3z - 9, -4z = -3p - 5z + 921. Is p/8 + (-1)/(-2) prime? False Let g = -8 - -3. Let a(s) be the first derivative of -s4/4 - s3 + 2s*2 + 7s - 3. Is a(g) prime? True Let a(y) = 210y3 - y + 2. Is a(1) a prime number? True Let j(m) = m2 + m + 157. Let w(o) = 3o - 2. Let d be w(2). Suppose dz = 4x - 12, 0 = -5x + 2z - 0z + 6. Is j(x) a prime number? True Let d(v) = 5v*2 + 6v - 2. Let t be d(-8). Suppose 275 = 4m - 3i + 56, -5i - t = -5m. Is m composite? True Suppose 2f - 3f + 37 = 0. Is f prime? True Suppose -2m - 3 = -3m. Suppose -mj - 188 = -5z + 92, -202 = -4z - 2j. Is z prime? True Suppose x + 1476 =	{ "pile_set_name": "DM Mathematics" }
. What is the highest common factor of 1242 and o? 23 Let k(j) = -3j + 40. Let d be k(11). Suppose -dw + 134 = -377. Calculate the greatest common factor of 146 and w. 73 Let x = -8288 + 14904. What is the greatest common divisor of x and 8? 8 Let f = -25054 - -25103. What is the greatest common divisor of f and 2989? 49 Suppose -75p + 38282 + 18850 = -6p. What is the highest common divisor of p and 207? 207 Let p be (-1)/((-5)/(-6) + 1737/(-918) + 1). Calculate the highest common factor of 7939 and p. 17 Let x = 16979 - 5283. What is the highest common divisor of 32 and x? 16 Let m be (9828/(-10))/(-6)5(-6)/(-9). Calculate the greatest common divisor of m and 588. 42 Let s(c) = -54 - 126c - 64 - 36. Let z be s(-3). What is the highest common factor of 48 and z? 16 Suppose -36c - 51c = -26c - 135054. Calculate the greatest common divisor of 1558 and c. 82 Suppose -29236 + 273436 = -4a. Let d be a/(-231) + (-2)/7. Calculate the highest common factor of d and 22. 22 Suppose 69y + 21833 = 73y + 3h, 0 = 2h - 6. What is the greatest common divisor of 352 and y? 176 Let k = 53274 + -35382. What is the greatest common divisor of 54 and k? 18 Suppose 0 = -3z + 4l + 120 + 942, 5z + 3l - 1741 = 0. What is the greatest common divisor of 1120 and z? 70 Suppose 5753 = 158j + 2593. Let s be (-4)/(-14) + 243/7. What is the highest common factor of j and s? 5 Suppose 0 = 2i - 1 + 95. Let r = i + 6. Let d = r - -61. What is the highest common divisor of 20 and d? 20 Let g be (-15)/(315/14)(-108855)/10. Calculate the highest common divisor of 531 and g. 177 Suppose 3r - f = 260, -r - 110f = -106f - 52. Let s(b) = 72b. Let m be s(2). What is the greatest common divisor of m and r? 12 Let s = -603 + 967. Suppose 35f = 7f + s. What is the greatest common divisor of f and 182? 13 Let s(z) = 2z - 17. Let o be s(11). Suppose 11i - 8i - 153 = of, -4i = 4f - 172. Calculate the highest common divisor of 414 and i. 46 Suppose -3k + 2903 = 2v, 4v + k - 2517 = 3254. Calculate the greatest common divisor of 2 and v. 1 Let v = -119 - -117. Let r(p) = 24p*2 + 4p + 10. Let t be r(v). Calculate the highest common divisor of 49 and t. 49 Let g(d) = d*3 - 3d*2 + 2d - 6. Let r be g(4). Suppose 280i - 337i = -1368. What is the highest common divisor of i and r? 6 Suppose 0 = -j + 2s + 13, 4j - j - s - 19 = 0. Suppose w = -z + 98, jz - 358 - 124 = -w. Calculate the greatest common divisor of 3 and z. 3 Suppose 44a - 45a = 26. Let w = -13 - a. Suppose 4 = -2h + y + w, -3h + 9 = -3y. What is the greatest common divisor of 90 and h? 6 Let v be (-54)/(-63) - ((-243270)/(-70))/(-9). Calculate the greatest common factor of v and 9159. 129 Let i be 1249 - 11/((-209)/(-323)). Calculate the greatest common factor of i and 140. 28 Let d be (6/(-9))/(13/(-78)) - -67. Let f(b) = b*3 - 8b*2 - 10b + 10. Let v be f(9). Calculate the highest common factor of v and d. 1 Suppose -5s - j = 3 - 7, -3s - 2j + 8 = 0. Let a be -8(-3)/8 - (-39 + s). What is the greatest common factor of a and 42? 42 Let q be 10/(-45) - 1412/(-36). Suppose -20 = 34h - qh. Suppose -ho + 209 = w, 2w - o + 0o = 454. What is the highest common divisor of 25 and w? 25 Suppose 2x - 8 = -16, -3x = 3n - 9387. Calculate the greatest common factor of 208 and n. 13 Let m(i) = -634i - 372. Let d be m(-14). Calculate the greatest common factor of d and 8. 8 Let r be (693/(-35) - -3)/(2/(-5)). Let m be (72/r)/((-4)/(-42)). Suppose 0 = 5i - y - 92, -5y - 6 = -2y. What is the greatest common factor of i and m? 18 Suppose -4b = o + 9 - 4, -4b = -o - 5. Suppose -5n + 123 = x, 2x + 13n - 12n - 264 = b. Calculate the greatest common factor of 171 and x. 19 Suppose -2k = 2k - 152. Let a be ((-307)/(-3377))/(1(-1)/(-418)). Calculate the highest common factor of a and k. 38 Suppose -33333 = 7664j - 7669j - 3i, 5i - 5 = 0. What is the highest common factor of j and 22? 22 Let k = 15222 + -13267. Calculate the highest common divisor of k and 5. 5 Let i(j) = j2 - 5j - 2. Let d be i(5). Let l = -637 - -649. Let y = l - d. What is the highest common divisor of 112 and y? 14 Suppose 635 = 7r - 2r + 5w, 0 = -5w - 10. Let y = r - 125. Suppose -2c - c = 3u - 63, u - 4c + 4 = 0. What is the highest common factor of u and y? 4 Let u(m) = -2m*3 - 84m*2 + 55m + 123. Let c be u(-44). What is the greatest common divisor of 13 and c? 13 Suppose 101r - 99234 = 27r. What is the highest common factor of 149 and r? 149 Let i = 3537 + -3449. Calculate the highest common divisor of i and 506. 22 Suppose 91 = 19f - 4. Suppose 0 = -fl - 2t + 50, -l + 36 = 5t + 3. Calculate the highest common factor of l and 10. 2 Suppose -3y = -18, 6m - 10m - 3y + 882 = 0. What is the highest common divisor of 189 and m? 27 Let r(a) = 6098a + 42983. Let l be r(-7). Suppose -123 = -5p - 4b, 2b - 126 = -5p - b. What is the highest common divisor of p and l? 27 Suppose -26932 = -9q - 16564. Calculate the greatest common divisor of 90 and q. 18 Let x be 43870/110 + (-10)/(-55). What is the greatest common divisor of 119 and x? 7 Let n = 1857670 - 1857656. Suppose -g - d = -3 - 0, -5g = -3d + 1. Let j be 70 - g - (0 - 1). What is the greatest common divisor of n and j? 14 Suppose -5x + 0x - 4i = -1996, 4i + 1204 = 3x. Let j(o) = 5o*2 - 4. Let c be j(2). Calculate the highest common factor of x and c. 16 Suppose -5k + 564 = -2721. Let f(t) = 122t + 1351. Let j be f(-11). Calculate the highest common divisor of j and k. 9 Let r be (-1689)/(-3) - (-19 - -31). Calculate the greatest common divisor of r and 608. 19 Let p = -23 + 23. Suppose -31o + 25o + 192 = p. Suppose 0 = 3t - 2t - 80. Calculate the highest common divisor of t and o. 16 Let x(b) = -b3 + 4b*2 + 31b + 11. Let t be x(8). Let s be ((-6)/12)/(t/(-60)). What is the greatest common divisor of s and 4? 2 Let z = -920 - -606. Let k = -158 - z. Let o be -1 + k/2 + 4. Calculate the greatest common factor of 9 and o. 9 Suppose -21k + 22k + 4d - 459 = 0, 0 = 2k + 2d - 918. Calculate the highest common divisor of 531 and k. 9 Suppose t - n = 37 - 14, 0 = -4t + 3n + 89. Let u be 5/t1/(2/872). Suppose 6j - 71 = u. What is the highest common divisor of 45 and j? 15 Suppose 0 = 4w + q + 9, 1 = 2q + 3. Let v be (((-120)/(-21))/w)/((-80)/280). Calculate the highest common factor of v and 45. 5 Suppose 19z + 56 - 170 = 0. Suppose -2t + 1800 = zt. Calculate the greatest common divisor of 50 and t. 25 Let o(u) = -30u3 + 6u*2 + 2u - 2. Let l be o(-1). Suppose -4i - 2t + 2180 = -3t, -4t - 2736 = -5i. What is the highest common factor of l and i? 32 Suppose 1406 = -85x - 79x + 12886. What is the highest common factor of x and 890? 10 Let x(c) = c2 - 861c - 8686. Let m be x(-10). Calculate the greatest common divisor of m and 4952. 8 Let x = 171 - 168. Let n(v) = v*3 - 3v*2 + 2v - 5. Let z be n(x). Calculate the highest common factor of 52 and z. 1 Let p = 12 - -76. Let n(v) = 3v - 15. Let d(t) = 10t - 45. Let o(w) = 2d(w) - 7n(w). Let z be o(7). Calculate the greatest common divisor of z and p. 8 Let o = -57 - -32. Let t = o + 38. Suppose 18g = 547 + 389. What is the greatest common factor of t and g? 13 Suppose d + 8 = -d. Let g = 7 + d. Suppose 68 = 2v - 4q, 10 = -0q - 2q. Calculate the highest common divisor of v and g. 3 Suppose 4r + 26 = 2s, s + 5r = 16 + 4. Let t = -322 + 325. Suppose p = -5f - 5, 0p = tp - 4f - 80. What is the highest common factor of s and p? 5 Let g = 1292 - 6801. Let k be g/(-9) + 2/(-18). Calculate the greatest common factor of 36 and k. 36 Suppose 0 = 91a + 78a + 24a - 12352. Let q be 2397/15 + (-2)/(-10). What is the greatest common divisor of a and q? 32 Let s(f) be the first derivative of -3f*2/2 + 39f + 57. Let o be s(0). Calculate the highest common divisor of o and 3. 3 Let s = 5417 + -5389. Calculate the greatest common factor of s and 450. 2 Suppose h - 2k - 64 = 0, 0 = -17h + 14h + 2k + 164. What is the greatest common divisor of h and 2175? 25 Suppose 3u + 2i - 16709 = 4i, u - 2i - 5559 = 0. What is the greatest common divisor of u and 223? 223 Let y = -3829 - -5189. What is the greatest common divisor of 1105 a	{ "pile_set_name": "DM Mathematics" }
igit of x? 9 Suppose 8x = 5x + 30. Let v = -9 + x. What is the units digit of (2 - 1)v - -1? 2 Suppose -2x - 2z = -0x - 2452, 3z = x - 1246. What is the tens digit of x? 3 Let x = 1 - 0. Suppose -38 = -6v - 56. What is the units digit of (v + 2)(-23)/x? 3 Suppose 2u + 3l - 2318 = 0, 4u + 34l = 33l + 4636. What is the thousands digit of u? 1 Let q(v) = 4 + 5v3 + 6v - 21v3 - 8v*2 + 15v*3. Let u = -3 - 6. What is the tens digit of q(u)? 3 Suppose -30y + 84569 = -20161. What is the thousands digit of y? 3 Let x be 6/(-4) + 27/18. Suppose x = 4h + 16. What is the units digit of ((-6)/h)/((-3)/(-54))? 7 What is the thousands digit of (1199 - 1)/(35/70)? 2 Let z = -494 - -911. What is the tens digit of z? 1 Let c(t) = 4t*3 - 26t*2 - 15t - 6. What is the tens digit of c(8)? 5 Let f be (-22)/(1(-4 - -2)). Let t = f + -22. Let x = t + 39. What is the units digit of x? 8 Let l be 6/(-14) + (-34)/(-14). Suppose -103 - 397 = lp. What is the units digit of 16/(-10)p/20? 0 Let u = -24 + 126. What is the units digit of u? 2 Let u(n) = -5n + 13. Let o(y) = -y. Let c(z) = -6o(z) + u(z). Let j be c(6). What is the tens digit of 3(-1 + j)/3? 1 Suppose 0 = -m - 3u + 11, 3m + 2u + 3 - 15 = 0. Suppose 5j = 3r + 84, 5j = -mr - 3r + 60. What is the units digit of j? 5 Suppose -4s - 4s + 4696 = 0. What is the units digit of s/6 - 5/(-30)? 8 Let b(l) = -l*2 - 12l - 18. Let d be b(-8). Let o(n) = -n*3 + 16n*2 - 24n - 20. What is the tens digit of o(d)? 3 Let g be 192(-1 + (-7)/2). What is the tens digit of g/76296/(-3)? 2 Suppose 4o + 0o + 316 = 0. Let c = o - -124. Suppose -c = -3y + 6. What is the units digit of y? 7 Let j(f) = -11f + 512. What is the tens digit of j(-34)? 8 Let x(u) be the first derivative of -u2/2 + 5u - 5. Let j be x(3). What is the units digit of (-7)/(-7) - (j + -38)? 7 Let r(x) = -x*3 - 7x2 + 13. What is the hundreds digit of r(-10)? 3 Let s(f) = f3 + 7f2 + 4f - 2. Let v be s(-6). Let y be 190/(-25) - 4/v. Let q = -2 - y. What is the units digit of q? 6 Let s(v) = 107v + 125. What is the thousands digit of s(14)? 1 Suppose -400 = 5h - 4p - 1255, -4h = -p - 695. What is the tens digit of h? 7 Let q = -433 + 740. Suppose -q - 333 = -4n. Suppose 8r = 13r - n. What is the tens digit of r? 3 Let z be (-44)/(-20) + -3 - 18996/(-20). Suppose 0 = j - 4 + 5. What is the tens digit of (z/26)/(j/(-2))? 7 Let x(a) = -a3 - 4a*2 + 39a + 8. What is the units digit of x(-12)? 2 What is the units digit of -1(-4)/((-24)/(-66))? 1 Let r = 170 - -657. What is the hundreds digit of r? 8 What is the hundreds digit of -3 + 64/20 - 364176/(-120)? 0 Suppose -2j - 3r + 17 = -48, -43 = -j - 5r. What is the units digit of j? 8 Let c = -1500 + 2386. What is the hundreds digit of c? 8 What is the hundreds digit of 12/((10/(-39))/(-5))? 2 Let c = 2679 + -1434. What is the tens digit of c? 4 Suppose 0 = 2w - 21 + 9. What is the units digit of (w - 0)282/18? 4 Suppose -2y + 3745 = 5y. What is the tens digit of y? 3 Suppose 7 = 2l + 1. Suppose 672 = lx + 4c - 2c, -4x + 900 = 4c. Suppose x = 5s + s. What is the units digit of s? 7 Let o(r) = 2r + 12. Let k be o(3). Suppose -kl + 6l + 2496 = 0. What is the tens digit of l? 0 Let s = -39 + -138. What is the units digit of (-8 + 6)/(6/s)? 9 Let s = 199 - -143. What is the hundreds digit of s? 3 What is the tens digit of (-86534)/147(-2 + (-3)/(-6))? 8 Let k be 524/(3/(-6)4). Let v = k + 387. What is the tens digit of v? 2 Let m(i) = -i*2 + 10i - 11. Let v be m(8). Suppose 2x - 31 = v. What is the units digit of x? 8 Let m(y) be the third derivative of y5/60 - y4/24 - 2y*3 - 7y*2. Let n be m(5). Suppose -nv + 3v = -170. What is the units digit of v? 4 Suppose 6s - 104 = 4s. Suppose -2a = -3w + s, -3w - 2a + 0a = -68. What is the tens digit of w? 2 Let o(c) = 29c2 + 35c*2 - 3c*2 - 1. Let w be o(1). Suppose 2v = j + 24, -4v - v + 4j + w = 0. What is the units digit of v? 2 Let k = 33 - 29. Suppose -ki + 24 + 44 = 0. What is the units digit of i? 7 Suppose 50b = 49b + 10. Suppose by = -233 + 2323. What is the hundreds digit of y? 2 Let l be 2/7 + (-288)/126. What is the tens digit of 19 - ((l - 2) + 8)? 1 Let y(i) = i*3 + 10i*2 - 13i - 15. Suppose s + 3s = -4w + 176, 132 = 3s - 4w. Suppose g - s = 5g. What is the units digit of y(g)? 7 Let y(k) = k3 + 34k*2 + 115k - 2. What is the thousands digit of y(-25)? 2 Let n(u) = -4u - u3 - 4u + 17 - 10 - 3u - 11u*2. What is the units digit of n(-10)? 7 Suppose 0 = 4o - o. Suppose o - 4 = -d. What is the units digit of 163/7 - d/14? 3 Let p = 20 + 175. What is the hundreds digit of p? 1 Suppose -3a + 456 = -9j + 10j, -5a = -15. What is the units digit of j? 7 Let o be (-2)/(-10) - -3(-801)/15. Let l = o - -354. What is the units digit of l? 4 Let w be (-2)/(-8) + 19/4. Suppose -v + 21 = 6v. Suppose -vt - 6 + 161 = 4h, t = wh - 189. What is the units digit of h? 8 Let u = -48 + 34. Suppose 3x - w = 1, 4w + 18 = 4x + 6w. What is the tens digit of u/((-2)/(x + 0))? 1 Let k = 1408 - 944. Suppose -2l - k = -4l. Suppose 0 = -5r + l + 13. What is the units digit of r? 9 Let w(t) = -t*3 + 17t*2 + 15t - 22. What is the tens digit of w(17)? 3 Let v = 151 + 801. What is the units digit of v? 2 Suppose -4a = 0, 8s = 12s - 3a - 808. What is the tens digit of s? 0 Suppose 10m - 18378 = 4912. What is the thousands digit of m? 2 Let h(p) = 1 + 5 - 34p*2 + 37p*2 + p. What is the tens digit of h(-3)? 3 Suppose -3i + 16i = 7332. What is the hundreds digit of i? 5 Let j(y) = y3 + 9y*2 + 7y + 9. Suppose 0 = -4d + r + 12, 0 = -2d - 2d - 4r - 8. Suppose dc = -4, -c - 23 = 3m - 0. What is the units digit of j(m)? 8 Let q(z) be the second derivative of -z5/20 + z4/2 - 5z3/6 + 3z*2/2 - 6z. Let d be q(5). Suppose 0 = -m - dm + 48. What is the tens digit of m? 1 Let h = 29 + -12. Let m = h - -4. Let z = m - 1. What is the tens digit of z? 2 Suppose 2u + o = 1092, 95 + 462 = u - 5o. What is the hundreds digit of u? 5 Let s be (0 - 1) + (-1 - 13). Suppose 0 = 3c - h - 57, c + 6 = 2c + 4h. Let x = s + c. What is the units digit of x? 3 Let d(g) = -49g3 + 1. Let q be (-1 + -13)/((-6)/(-3)). Let i = q - -6. What is the units digit of d(i)? 0 Suppose 5 = 5v, -2v - 343 = b - 4b. Suppose b = -4s + 547. What is the tens digit of s? 0 Let s(f) be the second derivative of f7/1260 - f6/360 - f4/3 - 6f. Let o(g) be the third derivative of s(g). What is the tens digit of o(3)? 1 Suppose 0 = 4x + 3v + 15, -2x - 10 = 2v - 0. Suppose x = 3h + h. Suppose f - t - 36 = h, 0 = 4f - f - 4t - 108. What is the units digit of f? 6 Let i(g) = -g - 15. Let t be i(-18). Suppose -o - t = -32. What is the tens digit of o? 2 Suppose -4b = 6l - 2l - 1068, -4l + 3b = -1033. What is the tens digit of l? 6 Suppose -475 = -16c + 11c. Suppose -5l - 2r + c = 3r, 14 = l + 2r. What is the units digit of l? 4 Let p = -437 + 514. What is the tens digit of p? 7 Let j = -302 + 921. What is the tens digit of j? 1 Let u(z) be the first derivative of z6/360 + z5/120 - z*4/4 - 4z*3 + 5. Let w(t) be the third derivative of u(t). What is the units digit of w(-4)? 6 Let q = 29 - 24. Suppose 2p + 8 = 0, 2n + qp - 241 = -n. What is the tens digit of n? 8 Let s(g) = 1029g2 + g - 8. What is the units digit of s(-2)? 6 Suppose 0 = -4z + 5w + 26, -4z - 6w + w = -6. Let q(d) = d2 - 2d + 3. What is the tens digit of q(z)? 1 What is the hundreds digit of (0 - 0) + -22 + 2021? 9 Let l = 574 + 7. Suppose 3f = -4r - 75 + 531, -f = 5r - l. What is the tens digit of r? 1 Suppose 2c + 3c = -4l + 16, -16 = -4l + c. Suppose 0 = 2z - 4d + 30, -ld - d + 95 = -5z. Let k = -12 - z. What is the units digit of k? 1 Let g be (4/(-12))/(2/(-18)). Suppose c - 224 = 2l + 3c, -gl - 4c = 334. What is the tens digit of 7/35 - l/5? 2 Let n(r) = r3 - 34r*2 + r + 126. What is the units digit of n(34)? 0 Suppose -3d = 15, 3o + d = 2d + 1601. What is the tens digit of o? 3 Suppose 0 + 12 = -3x. What is the units digit of -2 + (-3 - (x - 5))? 4 Suppose y + 3s - 93 = 0, 0y + y - 4s = 72. Suppose r = y - 19. What i	{ "pile_set_name": "DM Mathematics" }
-5 + 22sqrt(5)/27 Simplify 3 + (((sqrt(150) + sqrt(150)-2)-6)/(-6sqrt(40)/sqrt(4)))/(5((1sqrt(240) + sqrt(240) - sqrt(240))/sqrt(4))/sqrt(12)). -sqrt(3)/5 + 3 Simplify -6(3 + -2 + (sqrt(55) - sqrt(220)/sqrt(4))/sqrt(11) + sqrt(45) + sqrt(135)/sqrt(3)6 + sqrt(45)). -144sqrt(5) - 6 Simplify (3-3(sqrt(72) - -1sqrt(72)))/((3sqrt(18))/sqrt(2) + sqrt(9) + (sqrt(9) + -3sqrt(9)5 - sqrt(9))). 36sqrt(2)/11 Simplify (sqrt(165)/sqrt(108) - sqrt(165)/sqrt(75))/((sqrt(77)2-2)/((sqrt(7) - (sqrt(7) - (sqrt(7) - sqrt(63))))-1)). sqrt(5)/60 Simplify -1 + (((sqrt(847) + 2)-4 + -5 + -5(sqrt(7) - sqrt(63)))-3)*2. 7956sqrt(7) + 74348 Simplify (2(-3sqrt(162)3 + (sqrt(162) + sqrt(162) + -5(sqrt(162) - (0 + sqrt(162))) + sqrt(162) - sqrt(162)))2)26. 762048 Simplify ((sqrt(136) + (sqrt(136)-32 - sqrt(136)) + sqrt(136) + sqrt(136) - (sqrt(136) + sqrt(136)-3)-2)/(-2sqrt(8)4 - sqrt(512)6))2. 17/49 Simplify (-1sqrt(50))/sqrt(10) + -4(sqrt(5) - sqrt(15)/sqrt(3)) + -1 + -1 + 2 + 1sqrt(5). 0 Simplify (((sqrt(99) - sqrt(11)) + -2 + 4)-1 + -4 + ((2 + sqrt(1100) + sqrt(1100))5 + sqrt(1100) - (sqrt(1100) + -1)2))2. 1056sqrt(11) + 85220 Simplify (-2 + (sqrt(125) + -1)1 + -2 - ((sqrt(125) - (sqrt(125) + 0 + sqrt(125)))4 + -2 + 5))*2. -400sqrt(5) + 3189 Simplify (sqrt(245)-3-2)*2 + ((2 + sqrt(245))-3)*2 + 1((sqrt(245) - (sqrt(245) - (-4 + (sqrt(245) - sqrt(245)2))2)) + 4). 308sqrt(5) + 11326 Simplify -5sqrt(204)/(sqrt(1452)-4) - (-1 + 1sqrt(17) - (sqrt(17) + (-4sqrt(170) + sqrt(170))/sqrt(10))). -127sqrt(17)/44 + 1 Simplify -6(-5 + ((sqrt(520)-2)/sqrt(10))/(-1sqrt(20)/sqrt(5)))-3. -90 + 36sqrt(13) Simplify -2(sqrt(272)2-1)22 - (-4(-2sqrt(85) + sqrt(85) + sqrt(85) + sqrt(85)))/(sqrt(20) + sqrt(80)/sqrt(4))-4. -4352 - 4sqrt(17) Simplify (6sqrt(209)2-6)/(sqrt(44)/(sqrt(4) - sqrt(256)))-2. -1008sqrt(19) Simplify (2-3(-2 + 2sqrt(405) - (sqrt(405) - 3(sqrt(405) + sqrt(405) + 1)))1-1)2. 4536sqrt(5) + 714456 Simplify ((sqrt(729) + sqrt(729)-2)2)/(5(sqrt(3) + sqrt(300)-1 + sqrt(300))) + 1. -18sqrt(3)/5 + 1 Simplify (((sqrt(3600) + (4sqrt(3600)-1 - sqrt(3600)) - sqrt(3600)) + (sqrt(3600) - -1sqrt(3600))6)/((sqrt(36)/(-1sqrt(3)) - sqrt(48)/sqrt(4)2)2)2)2. 4900/3 Simplify (-3 + (sqrt(1573) - (0 + sqrt(1573) + sqrt(1573) - sqrt(1573))) + sqrt(1573) + 1 + 3)2 - (sqrt(143) + (sqrt(143) + sqrt(143)-1)3)/(-1sqrt(891)). 199sqrt(13)/9 + 1574 Simplify ((-1 + -4(sqrt(171) + 1 + sqrt(171))1 + (sqrt(171) + sqrt(171) + (sqrt(171) + 0 - sqrt(171)) + -5)-5)-5)2. -54000sqrt(19) + 1395100 Simplify (sqrt(162)/sqrt(9))*2 + (3sqrt(72))*2 + ((sqrt(162) - (-5 + sqrt(162)-1 + sqrt(162)))*2 - (1 + -2 + sqrt(162) + sqrt(162) - sqrt(162))). 81sqrt(2) + 854 Simplify (-2 + 6(sqrt(80)3 - sqrt(10)/sqrt(2)-3 - (sqrt(50) + -4sqrt(450))/(sqrt(1210)-2)))2. -348sqrt(5) + 37849 Simplify ((sqrt(180)-1)/sqrt(12))/(1sqrt(147)) - (-3 + (2sqrt(720) + sqrt(720))2 + 5 + (0 + sqrt(720))*2). -722 - 505sqrt(5)/7 Simplify 2(-3 + (sqrt(275) - 6(2 + sqrt(275)))2 + (sqrt(275) + (sqrt(275) + -1)2)1 + 5). 1190sqrt(11) + 14594 Simplify ((1sqrt(180)-3)/((sqrt(270) + sqrt(30))/sqrt(6)))/(-5sqrt(1200) + (sqrt(1200) + sqrt(12))-3). 3sqrt(3)/332 Simplify ((-1 + sqrt(176))6 + 1)2 + (5 + sqrt(176)-2)3 + -2 + -4. -1 + 24sqrt(11) Simplify (sqrt(912) + sqrt(912)-4 - sqrt(912) - sqrt(57) - 6(sqrt(57) + -4sqrt(57)))/(4sqrt(36)/(sqrt(12) - (3sqrt(108) + sqrt(108)))). -11sqrt(19)/4 Simplify 0 + -5(3(sqrt(1584) + sqrt(1584) + -1 + -4) + sqrt(1584)1 + 3 + ((sqrt(1584) + 0 - sqrt(1584)) + -3 - sqrt(1584)))2. -286245 + 10800sqrt(11) Simplify (sqrt(75) + ((sqrt(75) + sqrt(75) + 1)4)2 + -5)4 + -4 + sqrt(48) + 4 + 2 + (1 + sqrt(3))-1. 1303sqrt(3) + 19245 Simplify ((sqrt(2400) - (sqrt(2400) + sqrt(2400)-5))4)/(-1(1(sqrt(12) - sqrt(108)) + sqrt(12))). 200sqrt(2) Simplify 4(sqrt(833) + (sqrt(833) - (sqrt(833)-2)2)) - -2(sqrt(833) + sqrt(833) + 2) - (-1 + -1 + sqrt(833) + 1 + sqrt(833) + (sqrt(833) + 0)2)2. -26653 + 140sqrt(17) Simplify (sqrt(450)/(sqrt(63)/sqrt(7) + sqrt(9)) - sqrt(300)/(sqrt(18)/sqrt(3)))/(3sqrt(1210) + (sqrt(80)/sqrt(8) - sqrt(10))-5). -sqrt(5)/66 Simplify (sqrt(50)/(sqrt(2)3) - sqrt(100)/sqrt(4)-3)/(3sqrt(1080)/sqrt(6)). 5sqrt(5)/27 Simplify -4(sqrt(85)11 + (sqrt(85)15 - sqrt(85)))/((sqrt(55) - (1sqrt(2695) + sqrt(2695) - sqrt(2695)))/sqrt(11)). 10sqrt(17)/3 Simplify 4 + 2 + (1(1 + (sqrt(5) - (sqrt(5) + 1))) - (sqrt(280)/sqrt(112))/sqrt(8)). -sqrt(5)/4 + 6 Simplify (1sqrt(1728)5 + sqrt(1728) - sqrt(1728))*2 - ((6sqrt(1728)-3)2 + sqrt(1728) + sqrt(1728)) - (-3 + (-5 + sqrt(1728)1)3)2. -532548 + 2544sqrt(3) Simplify (1(sqrt(19) + (sqrt(95)/sqrt(5)3 - sqrt(19)) + -2sqrt(304) - ((sqrt(19) + 0 + sqrt(19))6-3 + 1)))2. -62sqrt(19) + 18260 Simplify 5 + ((3sqrt(156)2)/(sqrt(3) + (sqrt(3) + 1sqrt(3))2) - (sqrt(5200) + -1 + sqrt(5200) + 1)*24). -83195 + 12sqrt(13)/5 Simplify 1(-6(2 + sqrt(1088))5 - (sqrt(17) - (sqrt(17) + -3)*2-2 - (sqrt(17) - (-1 + sqrt(17) + 3)))). -229sqrt(17) - 114 Simplify -4(4 + ((5 + -1sqrt(432) + (sqrt(432) - (sqrt(432) + sqrt(432)-2)4))2 - (2 + sqrt(432) + -2(sqrt(432) + -3))*2)). -25780 - 2688sqrt(3) Simplify (-33sqrt(204))/(sqrt(12) - sqrt(72)/(sqrt(6)2)) - ((sqrt(1836)-1 - sqrt(1836))/(sqrt(6)/sqrt(8) - sqrt(3)) + 0). -42sqrt(17) Simplify (5(-1 + -4sqrt(320)))2 + -3(-2 + (-3 + sqrt(125))*2) + -2. 1690sqrt(5) + 127627 Simplify (-4sqrt(700)2-66)*2 + -5(sqrt(112)5 - (sqrt(7) + (sqrt(7) - (sqrt(70)/sqrt(2))/sqrt(5))2))5. -475sqrt(7) + 58060800 Simplify (1sqrt(153)-1)/sqrt(9) + 2 + (sqrt(17)2)*2 + sqrt(17) + -2 - (sqrt(204) + sqrt(204) + 43sqrt(204))/(5sqrt(60)/sqrt(5)). -14sqrt(17)/5 + 68 Simplify 6(5 + (-4 + -3 + sqrt(448) - (sqrt(448) + ((sqrt(448) - 2(2 + sqrt(448))) + sqrt(448) - sqrt(448)))) + -1)2. 96sqrt(7) + 2694 Simplify (3(-1sqrt(68) - sqrt(68)) - -21sqrt(68))/(sqrt(36) - (sqrt(36) - (sqrt(396) + sqrt(396)-2 - sqrt(396))/sqrt(11)))-5. -10sqrt(17)/3 Simplify (sqrt(14)/(sqrt(6)/sqrt(3)) + 4 + sqrt(112))22 + -1 - (-3sqrt(77)-1)/(sqrt(77)/sqrt(7)4). 317sqrt(7)/4 + 381 Simplify ((sqrt(8)1 - sqrt(2)) + sqrt(24)/(sqrt(24)/sqrt(2)) - 3(-1 + sqrt(50))) + (sqrt(800) - 2sqrt(2)4) + (sqrt(10)/sqrt(45)1)2. -sqrt(2) + 29/9 Simplify (-3sqrt(84)14)/(62sqrt(7) + sqrt(49)/sqrt(175)) + 2. -120sqrt(3)/61 + 2 Simplify (1(sqrt(216) - (sqrt(216)1 + sqrt(216)))/sqrt(12))/((2(sqrt(294) + sqrt(294)2) - sqrt(294)) + sqrt(294))-6. sqrt(3)/7 Simplify (sqrt(80) + 1 + sqrt(80) + 0)*2 + -5sqrt(80)-1 + 3(sqrt(80) + (3 + sqrt(80) - sqrt(80)) + 0 + sqrt(80))*2. 180sqrt(5) + 1308 Simplify -3(-5 + -4sqrt(76) + -1 - (4 + (sqrt(76) + 0)-4)2). -168sqrt(19) + 3714 Simplify (-4sqrt(77)3-2)/(-1(4sqrt(704) - sqrt(704))). -sqrt(7) Simplify (sqrt(2160)1 - ((-1sqrt(240) - sqrt(240) - sqrt(240)) + sqrt(240) - sqrt(15)))/(-2sqrt(720)3)-2. 7sqrt(3)/12 Simplify 2 + 3 + ((2 + (sqrt(720) - (sqrt(720) - (sqrt(720) - 3sqrt(720)4))))-4)*2-1. -1393979 + 8448sqrt(5) Simplify ((-2sqrt(66))/sqrt(2) + -3(sqrt(33) - sqrt(99)/sqrt(3)))/(-4((sqrt(55)2 - sqrt(55))/sqrt(5) + (sqrt(11) - (sqrt(132)1)/sqrt(12)))). sqrt(3)/2 Simplify (-4(sqrt(75) - 1sqrt(75)) - 3(sqrt(75) + -1))2 - -4(3-4(sqrt(75) + sqrt(75)-1))2. -90sqrt(3) + 684 Simplify 0 + (sqrt(243) + 1)*2 + (1sqrt(363))*2 - (3 + -1 + -4 + sqrt(189)/sqrt(7)). 15sqrt(3) + 609 Simplify ((sqrt(270)/sqrt(6) + (-1sqrt(605))2)35 + 2)2. 90sqrt(5) + 18154 Simplify 1 + (sqrt(392)/(sqrt(448) + -3sqrt(448)))/((sqrt(32) - (sqrt(32) - (sqrt(32) - (sqrt(32) + -22sqrt(32)))))/sqrt(4)). -sqrt(7)/64 + 1 Simplify -5 + -5 + 6(sqrt(7) + -3 + 1 - sqrt(567)4)*21. 840sqrt(7) + 51464 Simplify ((1 + 5 + (-3 + 0 + sqrt(1088) - -6(sqrt(1088) + (1sqrt(1088) - sqrt(1088))))5 + -5)-4)2. -125440sqrt(17) + 21327936 Simplify (-4(0 + sqrt(605)))2 + (-1 + sqrt(6480) - sqrt(45))2 - (-4 + (2sqrt(2450) - sqrt(2450) - sqrt(50))/(sqrt(110)/(2sqrt(11))))2. 30sqrt(5) + 14390 Simplify 2 + ((sqrt(90)/(sqrt(120)/sqrt(3)))/((sqrt(6)22)/sqrt(2)))*26. 73/32 Simplify -6*((sqrt(176)	{ "pile_set_name": "DM Mathematics" }
composite? False Let d(o) = -14o2 - 5o + 22. Let x(b) = 29b2 + 10b - 43. Let i(h) = -13d(h) - 6x(h). Is i(-13) composite? False Suppose -5 = -j, 2h = h + 5j + 164. Suppose 18 = 4i - 2b, i - 4i - 5b = 19. Suppose ig - h = -23. Is g prime? True Suppose -16w = -17w, a - 2833 = -2w. Is a a prime number? True Suppose 12y - 12 = 6y. Is 2710/(-15)(-3)/y a prime number? True Let c(t) = 2t*3 - 3t*2 + 2t - 3. Suppose 2 - 6 = -2r. Let u be c(r). Suppose 0 = us - 5a - 1080, 0 = 4s + 2a + a - 857. Is s a composite number? True Let j(l) = 15l*2 + 40l - 30. Let f(p) = -p*3 - 3p*2 + 4p - 11. Let i be f(-5). Is j(i) composite? True Suppose 381d - 265542 = 375d. Is d composite? False Suppose 0l = -5s - 5l + 975, 0 = -4l - 20. Suppose -5r + f + 370 = -3f, 3r + 2f - s = 0. Suppose 105 = k + 2k + w, 2k - r = -4w. Is k a prime number? False Let y = 8 + -9. Let n be (36/24)/(y/(-102)). Suppose -n = -3t + 2g, -5g = 5t - 76 - 179. Is t a prime number? False Let d(u) = 8u*3 - 3u*2 - u - 3. Let x be d(3). Suppose 0 = 3l + x - 30. Let w = -36 - l. Is w a composite number? True Suppose 2o + 3o = 5y - 23655, -3o = 12. Is y prime? False Let u(d) = 14d2 + 9d + 2. Is u(-11) a composite number? False Let a(l) = -5l + 1. Let w be a(1). Let c(q) = 3q + 2. Let o be c(w). Is (24/o)/((-4)/10) a prime number? False Let d(s) be the second derivative of 29s3/3 + 3s*2/2 - 15s. Is d(7) a composite number? False Let n(u) = 10u3 + 3u*2 - 5u + 4. Let d be n(2). Suppose -188 = -2o - 4a + d, -16 = 4a. Is o a composite number? True Suppose -f + 0f + 2r = -3017, 2f - 2r = 6028. Is f prime? True Let v be 18/45 - 5052/5. Let z = -511 - v. Is z a composite number? False Suppose 11278 = 2v - 0g + 4g, -5v = 4g - 28195. Is v a composite number? False Let k(m) = 74m2 + 7m + 14. Is k(9) composite? True Let j = -21 - -4. Let i = 9 + j. Let u(x) = -x*3 - 3x2 + 11. Is u(i) a prime number? True Let b(o) = -o2 + 3o + 7. Let d(m) be the first derivative of -2m*3/3 + 3m*2/2 + 7m - 5. Let h(f) = 5b(f) - 4d(f). Is h(-5) a prime number? True Let t(f) = 186f2 - 18f - 41. Is t(-7) composite? False Suppose 4n + 72527 = 3g - 11610, -2n = g - 28059. Is g a prime number? True Let k(h) = h3 + 6h*2 + 4h - 7. Suppose 0 = -3q - 2f + 14, q = -q - f + 10. Is k(q) a composite number? False Suppose -2v = 2f - 8, 0 = f - 2f + 2. Suppose 261 = b - vo - 154, o = -2b + 815. Is b prime? True Let g(b) = 16590b*2 + 7b + 6. Is g(-1) a composite number? True Let o = 14191 - 3462. Is o a prime number? True Let o be 28/21 + (-4)/(-6). Suppose -4920 = -5i - 5p, i - oi - 4p = -987. Is i a prime number? True Suppose -5h + 9h - 3a - 3359 = 0, 4213 = 5h + a. Let k = -435 + h. Is k composite? True Let i = 5769 + 232. Is i a prime number? False Let w = 37589 + -24742. Is w prime? False Let v = 36162 + -23682. Let s = v + -8539. Is s a composite number? True Let p = 87841 - -8820. Is p prime? True Let q = 17 - 38. Is (-6495)/q - (-2)/(-7) composite? True Suppose 4l + 8 = -8. Let u be 42/(-4) + (-2)/l. Let s(i) = -i3 - 5i*2 + 14i + 13. Is s(u) a composite number? False Suppose 59452 + 47967 = 13i. Is i composite? False Let a be 4/6 - (-1352)/6. Suppose -4b = 7b + 1584. Let v = b + a. Is v prime? False Suppose 58936 = 19n - 11n. Is n prime? False Let g(y) be the first derivative of -28y*2 + 21y + 20. Is g(-13) prime? False Suppose -2t + 3t = -13. Let y(d) = 2d3 + 2 + 15d*2 + 9d - 11 - d*3 + 5. Is y(t) a prime number? False Let o = 14 - 11. Suppose -5y + 63 = 2u + 365, -y - 453 = ou. Let p = u - -236. Is p composite? True Let i(w) be the first derivative of -3w4/2 - 4w*3/3 + 4w*2 - w - 6. Is i(-4) composite? True Is 6483/((-23)/(-5) + -4) composite? True Let n = -3930 - -7721. Is n a composite number? True Let u be 3((-6)/(-2) + -1). Is (u/3 + -253)/(-1) composite? False Let v = -30 + 42. Let f be (-80731)/(-114) - 2/v. Suppose 3m - f = -m. Is m prime? False Suppose 14346 = 4w + 30a - 28a, -w + 4a = -3609. Is w a composite number? True Let z be (-9)/2 + (-5)/10. Let b be (3 + z + 2)/(-1). Suppose -5a - d + 13 = 0, 3a + d + b = 7. Is a a prime number? True Let k be -541(-2 - 9/(-3)). Let v = k + 1986. Suppose -v = -2y - 3y. Is y composite? True Let z(k) = -9 - 4 - 9 - 235k + 11. Is z(-6) a prime number? True Let a(y) = 73y*2 + 36y + 211. Is a(-16) prime? False Suppose 0 = 27w - 22852 - 59255. Is w a prime number? True Is 6997(0 + (5 - 4)) composite? False Let j(d) = -131d - 80. Is j(-21) composite? False Let q(h) = -382h + 25. Is q(-6) a composite number? True Suppose -g - 244 = -723. Suppose -3q = -2q - g. Is q composite? False Suppose 476 = 6l - 1006. Suppose j + 4h = 2j - l, 467 = 2j + h. Is j prime? False Let l = -8 - -12. Suppose 0 = lm + t - 17 + 3, 0 = -2m + 2t + 2. Is (-62)/m(-3)/2 composite? False Let v(o) = -3040o - 3. Let m = 91 + -92. Is v(m) prime? True Suppose 367919 + 352951 = 30u. Is u a prime number? True Let x be 34/9 + 10/45. Suppose -xi - i = -5. Is ((-139)/5)/(i/(-5)) prime? True Suppose 65z - 6155 = 64z. Is z a composite number? True Is 100058 + -63/2 a prime number? True Let l be (2 + 1)-110/(-15). Suppose p - 3d = 365 + 249, 4d = -lp + 1228. Is p a composite number? True Let v = 5615 + -3504. Is v composite? False Let p(i) = 3i - 9. Let j be p(4). Suppose s = -3m + 1820, -1825 = -jm + s - 3s. Suppose -4w + m = w. Is w composite? True Let f be (3/2 - 1)4. Suppose q = -2n + 5q + 2136, -fq - 8 = 0. Suppose -a + n = 3a. Is a composite? True Let f(d) = 69d*3 + 6d*2 + 41d - 389. Is f(9) prime? True Let s = 81645 + -53352. Is s prime? False Suppose -2u + 3o + 8 = 0, -12 = -3u + 4o - o. Suppose 0 = -ux + i + 122, -2x = -3x - 5i + 20. Suppose 7 = l - x. Is l composite? False Let w = 37 - 36. Let k(j) = 2042j + 3. Is k(w) composite? True Is ((-217004)/14)/((-110)/385) prime? True Let x = -10 + 12. Suppose 3k + 22 = -b, -4k - 3b = -xb + 28. Let y(m) = -m3 - 3m*2 + 2m - 11. Is y(k) composite? True Suppose 2n + 276 - 61 = 5d, 5d + 4n - 185 = 0. Suppose -4q + 3 = -d. Is q prime? True Suppose 0 = -4c - y + 56407, 17199 - 45395 = -2c + 2y. Is c a prime number? False Let g be (-2 + 6 - (-4 + 3)) + -2. Suppose -4q = gi - 4776 - 753, 4i = -q + 7372. Is i a prime number? False Suppose 52s = 2s - 4s. Let k = 6 - 0. Suppose s = -kn + 3n + 4197. Is n a prime number? True Let n = -4567 - -2027. Is (-22)/81n/5 a prime number? False Suppose -1171 = 8u + 53. Let c = 58 - u. Is c a prime number? True Suppose -23v + 21352 = -15v. Is v a composite number? True Let r(k) = -k - 37k - 49k - 3. Let g be r(8). Let m = 1184 + g. Is m a prime number? False Suppose 0v = -2v + 2006. Is v a composite number? True Is (-27)/(-189) - 324987/(-14) prime? True Suppose 10 = -2v + 32. Suppose -3a + y + v = -0a, 4a - 18 = -2y. Is 634 - (13 + -1)/a composite? False Let o(n) = -23n - 34. Let i(s) = 70s + 101. Let c(l) = 6i(l) + 17o(l). Is c(17) prime? True Let c = 13994 + -2223. Is c a prime number? False Let z(w) = w + 33. Let v be z(0). Let f = v + -20. Let j = f + 40. Is j a prime number? True Let j be 1 + -5 + (15925/(-7))/(-1). Is 1/2 - j/(-12)2 prime? True Let f(w) = 55w2 - 66w - 114. Is f(-25) prime? True Suppose -r + 5 = -4m, 3r + 2m = 1 + 28. Suppose -4o - 1555 = -ro. Is o prime? True Let b = -6721 + 9494. Is b prime? False Suppose -3v = -5s - 7v + 60673, 15 = -5v. Is s prime? False Let c(s) be the first derivative of 2s*3 + 2s*2 + 11s - 2. Is c(6) a composite number? False Suppose 17328 = 25z - 859097. Is z a composite number? True Suppose 2n + 5j - 9146 = 0, -4n + 3j - 4j = -18328. Is n composite? False Suppose -108 = 8z + 4z. Is ((-9258)/z)/((-44)/(-12) + -3) composite? False Let b(u) = 5u3 - 22u*2 + 9u - 10. Let i be b(12). Suppose -3m = -8m + i. Is m a prime number? False Suppose k - 11540 = 30929. Is k composite? True Is 128 - 10 - (-1 + -3) a prime number? False Let i(r) = 139r2 - 54r - 20. Is i(9) a composite number? False Suppose 6 = 4m - 2m. Suppose -4a + 3047 = -mv, -2280 = -3a - v - 2v. Suppose -314 = -5*p + a. Is p compos	{ "pile_set_name": "DM Mathematics" }
f x(f)? 7 Let w(f) = 7f + f - 3 - 6f. What is the units digit of w(3)? 3 Let a = 0 + 0. What is the units digit of (3 - -9)(2 + a)? 4 Suppose -h = -5p - 20, 3p - 1 + 5 = -h. Let i be 4(h/2)/(-5). What is the units digit of (-6)/(i - (-12)/9)? 9 Let m(c) = c*3 - 5c2 - 3. Let v be m(5). What is the units digit of v + 3 + -3 - -22? 9 Let c = 74 + -33. What is the units digit of c? 1 Let x(y) = -y3 + 10y2 - 9y + 5. Let p be x(9). Let h = p + -3. Suppose 2i = -2, 0d = hd + 2i. What is the units digit of d? 1 Suppose 42 + 10 = 4r. Let a be ((-18)/42)/(-1). Let w = r - a. What is the units digit of w? 4 Let z = -12 - -8. What is the tens digit of z1119/(-28)? 1 Suppose b - 58 - 29 = -2w, 2w + 5b = 91. Suppose 2d + 8 - 20 = -4t, 0 = 5d - 3t - w. What is the units digit of d? 8 Suppose 2v + 0v + 5b - 1 = 0, 0 = v + 4b + 1. Let s(y) = y2 - 3y + 2. Let k be s(2). Suppose -vj + 6 = -kj. What is the units digit of j? 2 Let c(k) = -4k3 - 23k*2 - 12k + 10. What is the units digit of c(-7)? 9 Let i(q) = -3q - 10. Let n be i(-7). Let a be (-5 + 1)(-10)/8. Let l = a + n. What is the tens digit of l? 1 Let a = -1 + 10. What is the units digit of a? 9 Let w be (-4)/(-10) + 36/10. Let h = w + -2. Suppose 0 = -hd - 2d + 32. What is the units digit of d? 8 Let d(u) = -u*3 + 13u*2 + 2u + 12. What is the tens digit of d(13)? 3 Let y(x) = -x + 4x3 - 17 - 3x3 - x2 + 31. What is the units digit of y(0)? 4 Suppose -7k - 2 = -3s - 2k, -2s - 5k + 18 = 0. Suppose -85 - 19 = -so. What is the units digit of o? 6 Let f(g) be the second derivative of g4/6 + g3/2 - 3g2/2 + 2g. What is the tens digit of f(2)? 1 Suppose 0v - 36 = -9v. Suppose 0n + 6 = 3n. What is the units digit of 124/8 + n/v? 6 Let a be (18/15)/(4/10). Let u(h) = -a - h + 2 + 2. What is the units digit of u(-7)? 8 Let p be -11 + 3 + (-1 - -1). Let a = -5 - p. Suppose 0 = -am + m + 2. What is the units digit of m? 1 Let w be 2 + (1 - 2 - -2). Suppose 2c - wc = -4i - 16, -5c + 143 = i. What is the units digit of c? 8 Suppose 4 - 2 = u. What is the units digit of u? 2 What is the units digit of (-326)/4(-30 - -28)? 3 Let q(h) = h - 3. Let f be q(4). Let s(b) = -7b2 + 6b + 4. Let c(w) = w*2 + w + 1. Let p(r) = 5c(r) - s(r). What is the units digit of p(f)? 2 Suppose -2f + 233 = -47. What is the tens digit of f? 4 Suppose -62 - 19 = -3s. What is the tens digit of s? 2 Suppose -z - 3f - 7 = 0, 6f = -4z + 4f + 22. Suppose -3k + 13 = 4h, 0 = -zh + 3h - 5k + 20. What is the units digit of h? 1 Let w(u) = u2 + 3u - 3. Let y be w(-5). Suppose 5r - 38 = y. What is the units digit of r? 9 What is the units digit of 31230/27? 0 Let s be -18((-27)/6 + 1). Let k = s + -43. What is the units digit of k? 0 Let z(g) = -g + 3 - 3 + 14 - 2. What is the tens digit of z(-10)? 2 Let m(v) = -v*3 - 8v*2 + 2v + 6. Let g be m(-8). What is the units digit of (0 + 5)(-16)/g? 8 Let n = -8 - -13. Let y be (-2)/7 + 576/56. Suppose w + y = 3w + s, nw - s - 11 = 0. What is the units digit of w? 3 Let v = -20 - -23. What is the units digit of ((-8)/v)/(6/(-9))? 4 Let z(g) = -g + 12. Let a be z(9). Let s = a - -18. What is the units digit of s? 1 Let n = -8 + 5. Let b = -29 - -27. Let s = b - n. What is the units digit of s? 1 Let u be (2 - -10)(-2)/3. Let c = -1 - u. What is the units digit of c? 7 Suppose -5v + 640 = -3y, -4y + 24 = -v + 169. Suppose 3w - 52 = -n + 23, v = 5w + n. Let s = w + -5. What is the units digit of s? 0 Let v = 3 + 120. What is the units digit of v? 3 Suppose 6 = 3d - 0d. Let a(g) = 3g - d - 12 + 2g + 5. What is the tens digit of a(6)? 2 Let m(p) = 3p - 2. Let y(l) = l*2 + 14l - 10. Let b(s) = -11m(s) + 2y(s). What is the units digit of b(3)? 5 Suppose 4m - 99 = 3s, 2m - s - 25 = m. Suppose 2o = p - m, -11 - 5 = 2o + p. Let j = o - -19. What is the units digit of j? 9 Let l = -9 - -1. Let u be l/3(-15)/4. Let w = u + -6. What is the units digit of w? 4 Suppose 0 = -30m + 35m - 470. What is the tens digit of m? 9 Let z = -18 - -49. What is the tens digit of z? 3 Suppose 4 = n - 3n. Let u be -1(42)/n. Let y(b) = b2 - 3b + 2. What is the units digit of y(u)? 6 What is the units digit of 186/12 + (-1)/(-2)? 6 Let y = 74 + -29. Suppose 3d + 0d = y. What is the tens digit of d? 1 Suppose -6 = -b - 2, -63 = -5x - 2b. Let h be 1/((-2)/(-6))x. What is the units digit of (-1)/3(3 - h)? 0 Let v = 16 - 6. What is the tens digit of v? 1 Let p = -22 - -16. Let t be 28/(-6)45/p. Let j = -23 + t. What is the tens digit of j? 1 Let g(l) = l. Let i be g(-2). Let t be 3/5 + i/(-5). Let z = t + 4. What is the units digit of z? 5 Suppose -38 + 14 = -3g. Let s(b) = -b*2 + 7b + 2. Let w be s(g). What is the units digit of -3 - 5/(5/w)? 3 Suppose f = -2 - 1. Let u = 5 + f. Suppose -5 = -3p + 2o, 2p + 3o - 35 = -uo. What is the units digit of p? 5 Suppose -19 = -3n - 4u, 0 = 2u + 3 - 11. What is the units digit of n? 1 Let t = 4 - 2. Suppose 0 = -5b - z + 135, -5b + 164 = -3z + 9. Suppose t = 5l - b. What is the units digit of l? 6 Let o(m) = m3 - m2 - 3m - 3. Let t be o(3). Let p = t + -5. What is the units digit of 0 - 1 - (-3)/p? 2 Let j(h) = h3 - 6h*2 + 6h + 7. Let z be j(6). Suppose z = 5u + 3s, -3s + 4 = 2u - 15. Let q(n) = n - 4. What is the units digit of q(u)? 4 Let y = -15 + 38. What is the units digit of y? 3 Let o = 58 + 9. What is the units digit of o? 7 Let i be (-123 + -9)/(3/2). Let g = -63 - i. What is the tens digit of g? 2 Let a be ((-164)/3)/(3/9). What is the tens digit of (-22)/(-33) + a/(-6)? 2 Let h = -133 - -77. What is the tens digit of 15/6h/(-10)? 1 Let j = -224 + 399. What is the tens digit of j? 7 Let k(g) = -3g + 10. Let h be k(5). What is the units digit of (-6)/15 + (-47)/h? 9 Let g = -21 - -35. What is the tens digit of g? 1 Let b(x) = 9 - x + 4x + 0x - 4x. What is the units digit of b(5)? 4 Suppose 0z - 3z = -2h + 72, -z + 214 = 5h. What is the tens digit of h? 4 Let o(u) = 2u*3 + 2u*2 + u. Suppose h + 3h - 9 = t, 4t = -4h + 4. Let k be o(t). What is the units digit of 1 + k + 3 + -2? 1 Suppose -4b = i - 175, -b + 579 - 65 = 3i. What is the units digit of i? 1 Suppose -12 = 2v - 6v. Suppose -v = 2x - 43. What is the tens digit of x? 2 What is the units digit of 3 - 0 - (-20 - 8)? 1 Let x(v) = v3 - v + 14. Let g be x(0). What is the units digit of (-4)/g - 18/(-14)? 1 Let v(f) be the third derivative of f6/120 + 2f5/15 - f4/8 + 2f3/3 - 7f2. What is the units digit of v(-8)? 8 Let f(b) = b3 - 2b2 + 3b - 2. Let y be f(2). Suppose -y + 20 = 2l. What is the units digit of l? 8 Let l = 0 + 2. Let g be (1/l - 1)-2. Suppose 0 = 5w - k - 42, -g = k + 1. What is the units digit of w? 8 Suppose -3m + 2a + 5 = -12, -2a = 8. Let r be 6/(-27) - (-4 + 274/(-18)). What is the tens digit of ((-18)/m)/(-2) + r? 2 Let f be (8/6)/((-1)/(-3)). Let r = f - 2. Suppose -rg = g - 9. What is the units digit of g? 3 Let q be (-24)/(-28)(-14)/(-3). Let u(i) = i*3 - 4i*2 - i + 4. Let r be u(q). Suppose 10 = -rp + p. What is the tens digit of p? 1 Let o = -155 - -342. What is the units digit of o? 7 Let f(u) = 26u3 - u2 + u. What is the tens digit of f(1)? 2 Let p(l) = 1 - l2 + 3l + 0 + 4l3 - 7l*3. What is the tens digit of p(-2)? 1 Let c be (-9)/21 + 1035/(-35). What is the tens digit of c-3(-3)/(-18)? 1 Let q be (-1)/(-1) + (0 - -3). Suppose 0 = qu - 8 - 12. Suppose -uz = -z - 16. What is the units digit of z? 4 Let u(d) be the third derivative of d5/60 + d4/12 - 4d*2. What is the units digit of u(-3)? 3 Suppose 10 = -5w, 4q - 5w - 658 = -0w. What is the tens digit of q? 6 Suppose -37 = -4i + 39. What is the tens digit of i? 1 Suppose 3a - 117 = 2z - 5z, -a - 3z + 45 = 0. Let c = -13 + a. What is the tens digit of c? 2 Let g(b) = -8b - 15. What is the units digit of g(-19)? 7 Let a = 2 - 8. Let l(j) = j3 + 6j*2 + 5. Let o be l(a). Suppose -ok + 15 + 15 = 0. What is the units digit of k? 6 Suppose -4y = -6y + 6. Suppose 0l - 39 = -yl. What is the tens digit of l? 1 Let j = 2 - 0. Suppose j*m = m + 14. What is the units digit of m? 4 Let d be (6 + -4)/(2/4). Suppos	{ "pile_set_name": "DM Mathematics" }
, k, q Let q = 45/14 + -43/14. Put -1/18, q, 0.3 in decreasing order. 0.3, q, -1/18 Let q = -637.7 - -638. Sort 0.1, -3, q, -9. -9, -3, 0.1, q Let w be -7 - 64/(-8) - -6. Put -3.4, w, -1/3 in descending order. w, -1/3, -3.4 Let f = -107 + -43. Let k = 150 + f. Suppose -2s - p = 3, -5s - 4p - 5 = -2. Put s, 3, k in descending order. 3, k, s Let j = -410 + 414. Put 8, -1/7, j in descending order. 8, j, -1/7 Let n be -3(-5)/1(-4)/(-10). Put -7, -5, -2, n in decreasing order. n, -2, -5, -7 Let y be 6/(-8)(0 + 10/15). Put 1, 4, 82, y in increasing order. y, 1, 4, 82 Let t = 3 - 2.91. Let d = t - 0.29. Let u = -9 + 14. Put 0, d, u in decreasing order. u, 0, d Suppose -5n = l - 22, 0 = -l - 0n - 3n + 14. Suppose 2z = 6 + l. Let u be (96/(-392))/(4/14). Put -1, z, u in descending order. z, u, -1 Let z = 7 + -43. Let y = z - -36.4. Sort -5, 3, y. -5, y, 3 Let x = -0.0138 + -0.4862. Sort -1, -1/7, 0.1, x. -1, x, -1/7, 0.1 Let f(u) = u*2 + 10u - 11. Let z be f(-7). Let r = z - -36. Sort -5, 11, r in decreasing order. 11, r, -5 Let j be 4(-12 + 360/32). Put 1, 7, j, 21 in ascending order. j, 1, 7, 21 Let s = -13 - -18. Suppose v = -st - 17, t = -4v - 2t. Suppose -v = -4z + 5. Sort -1, z, -4. -4, -1, z Let l = -3 + 6. Let y be 0/(-37) - 15/(-3). Put y, 2, l, -3 in descending order. y, l, 2, -3 Let q = 5 - 3. Let r = 3593 - 3590. Put -10/3, q, 1/2, r in ascending order. -10/3, 1/2, q, r Let c(l) = -l3 - 24l*2 + 47l - 132. Let f be c(-26). Sort -4, -3, f, 8 in decreasing order. 8, f, -3, -4 Suppose -83 = -18g + 97. Sort g, -33, 5 in decreasing order. g, 5, -33 Suppose 0 = -4t + 4m - 7 + 3, -26 = 5t + 2m. Sort t, -1.1, -2. t, -2, -1.1 Let b be (-2)/((48/(-40))/3). Put 2, 1, -2, b in descending order. b, 2, 1, -2 Let l = 0.2 + 0. Let u = 19.84 + -20.24. Sort l, 1/3, u, 5. u, l, 1/3, 5 Suppose 0u + u = -1. Let d(j) = -9j - 20. Let f be d(-3). Suppose 0 = -2r, 5r = -fq + 2q. Put u, q, 4 in decreasing order. 4, q, u Let w = 2151 + -2151.4. Put -31, 1, w, 2 in increasing order. -31, w, 1, 2 Let l = 108.66 - 107. Let z = l + -0.83. Let c = 0.13 - z. Sort c, 2/7, 0. c, 0, 2/7 Let z be (1 - 1/2)-2. Let i = 6 + z. Suppose 4d + 3w = 0, -3d - 40 = -iw - 11. Put d, -1, -2 in decreasing order. -1, -2, d Let a be ((-2)/4)/(1/2). Let s(k) = 2k + 54. Let x be s(14). Let w = x + -87. Sort -3, a, w. w, -3, a Let w = 2.05 + -2. Let u be 28(-70)/(-200) + -9. Sort -1, w, u. -1, w, u Suppose -t - 5 + 2 = 0. Let x = -6 - -1. Sort 1, 0, x, t. x, t, 0, 1 Let p = -456 - -7760/17. Let h = p - -12/119. Sort h, 4, 1. h, 1, 4 Let g = -3.2 + 2.6. Let c = -1 - 1. Let m be c + (-1 + -1 - 0). Sort m, g, 2 in descending order. 2, g, m Let d be 21/(-2)(-320)/24. Let r be 4/(d/44 + -3). Let i = -17 + r. Put 10, i, 1 in ascending order. 1, i, 10 Let r = 1302 + -1298. Sort r, -5, -6 in decreasing order. r, -5, -6 Let x(m) = -4m*2 - 3m + 2. Let n be x(-3). Let b = n + 22. Sort b, -1, 3, 1 in descending order. 3, 1, -1, b Let m = 6.795 - -0.105. Let q = -0.9 + m. Let k = -5 + 0. Put -0.1, q, k in descending order. q, -0.1, k Let x be (-2 - -3)/1(8 + -5). Suppose xi - 8i = 2h + 22, 2i = 3h - 5. Put 2, -1, i, 0 in decreasing order. 2, 0, -1, i Let f = 197/160 - -3/160. Let q = 0 - 1. Sort q, -5, f in increasing order. -5, q, f Let i = 0.7 - 0.1. Let m = 28 + -28.4. Let w = m + i. Put w, 0.3, 2/11 in decreasing order. 0.3, w, 2/11 Suppose -r = 6p + 3p + 40, -5p = 3r + 32. Sort -2, p, -7 in increasing order. -7, p, -2 Suppose -3b = 5a - 33, 5a = 4a + 5b + 1. Suppose -l - 15 = -al. Sort 5, l, 2/9. 2/9, l, 5 Suppose 19 = -3r + 7. Let m = 433 - 428. Sort r, 0, 3, m in increasing order. r, 0, 3, m Suppose -q + 4q + 39 = 0. Let y(v) = -v*3 + 7v*2 + 9v - 5. Suppose 4o - 9o - 40 = -5i, 0 = 2o. Let s be y(i). Put s, q, -5 in ascending order. q, -5, s Let x = -760 - -765. Put 6/11, 9, x in ascending order. 6/11, x, 9 Let x = 583 + -578. Let z(c) = c*2 - 2c + 2. Let u be z(2). Sort u, x, 7. u, x, 7 Let g = -25 + 23. Let n = 6 - g. Let t = 13 - n. Sort 1, t, -6 in descending order. t, 1, -6 Let k = 6 + 32. Let a be (216/(-28))/((-2)/(-14)). Let q = a + k. Sort q, -5, 2 in ascending order. q, -5, 2 Let s = 225.2 - 225.3. Sort s, -36/7, 2/3, 0.2 in ascending order. -36/7, s, 0.2, 2/3 Let z = -67/3 - -30. Put -1/6, 0.4, z in decreasing order. z, 0.4, -1/6 Suppose 36b - 32b = -20, 0 = 2n - 3b - 11. Let m be 54/10 + 2/(-5). Sort 3, n, m in descending order. m, 3, n Let a = 2594 + -2576. Sort a, -14, 4 in descending order. a, 4, -14 Let o = 34 + -56. Let p = 19 + o. Sort -2/9, 0.3, p, 0.1 in descending order. 0.3, 0.1, -2/9, p Let n = -0.05 - 0.25. Let u = 0.074 - 39.074. Let q = -38 - u. Sort n, 0, q. n, 0, q Suppose 2c - 2 = -0, -2j = -2c - 4. Let t(l) = l3 - 3l*2 + 2l - 4. Let m be t(3). Let y be 0/(1m/2). Put y, j, 5 in decreasing order. 5, j, y Let q be ((-1)/(-2))/(11/220). Suppose 6i + q = 100. Suppose -6y + 11y + i = 0. Put 2, y, -5 in descending order. 2, y, -5 Let o(t) = 2t - 41. Let w be o(19). Sort -1, w, 10 in descending order. 10, -1, w Suppose -4 = -3w + 5. Let j = -1 + 7. Let z be (5/25)/(j/20). Sort -0.6, w, z. -0.6, z, w Suppose 14 = 2w + 4t, -4w + 8 = -t + 4t. Let a = -7 - -8. Sort a, w, -5. -5, w, a Let o = 3 - 5. Let d = -84 + 91. Sort -4, o, d in decreasing order. d, o, -4 Suppose 3w - 20 = 5k, w = 4w - k - 4. Suppose 5t + 5 = -wt. Put 7, t, 1 in descending order. 7, 1, t Let x be (-2)/(-4) + 93/(-6). Let g = 7 + -10. Put x, g, 3 in increasing order. x, g, 3 Let f = -102 + 54. Let x = f - -34. Let v be 16/(-14)x/56. Sort -2/11, 0.3, v in decreasing order. 0.3, v, -2/11 Let x = 0.4 + 1.6. Let d = -0.6 - -0.3. Sort -0.1, d, 0, x. d, -0.1, 0, x Let w(g) = g*2 - 8g - 5. Let a be w(8). Suppose -15 = -6l + l. Let p(h) = -h + 4. Let k be p(7). Sort a, k, l. a, k, l Let g(s) = 4s - 30. Let w be g(7). Let f be (w/(16))/(4/24). Suppose 2u - 15 = -5h + 3u, 5u = 5h - 35. Sort 0, f, h in ascending order. f, 0, h Let m = 91.8 - 93. Put 5, 2/5, m in ascending order. m, 2/5, 5 Let w = 49 + 31. Let x = -80 + w. Sort x, 5, 31. x, 5, 31 Suppose 5l - 9 = -2v, 5v + 4l = 2l - 9. Let b(k) = k3 + 4k*2 - k. Let d = 0 + -4. Let s be b(d). Put -2, s, v in ascending order. v, -2, s Suppose i - 19 + 21 = 0. Put 3, 1, i in decreasing order. 3, 1, i Suppose 0 = w - 32 + 29. Suppose h + 0 = -w. Put h, -4, 37 in increasing order. -4, h, 37 Let i = -0.084 - 1.776. Let b = i + -0.14. Sort b, 2/11, -16 in descending order. 2/11, b, -16 Let c = -16 - -15.9. Let t be (4 + 136/(-36))6/(-2). Sort c, t, 1/5, 2/9. t, c, 1/5, 2/9 Let d be 16/1598 + 6/51. Sort -0.6, d, -5 in decreasing order. d, -0.6, -5 Suppose -21z + 102 + 129 = 0. Put z, 2, -1, -5 in decreasing order. z, 2, -1, -5 Let z = 77 - 83. Let y be ((-3)/z + 0)/(6/(-24)). Let g = -3 - -2.6. Sort y, -5, g in ascending order. -5, y, g Suppose -4p - 2t = -7 - 11, p - 2 = -3t. Suppose f + 5r = 6 + 2, -5f + pr + 130 = 0. Suppose -f + 20 = -q. Sort -2, 0, q. -2, 0, q Let q(k) = 6k*2 + 182k + 62. Let f be q(-30). Sort -1, f, -10, 3. -10, -1, f, 3 Let b = -35 + 37. Suppose 0 = 4l - l + 9. Let a(s) = -s2 - 2s. Let t be a(l). Sort 3, t, b. t, b, 3 Suppose -6g = a + 17, -2a + g = -g + 6. Sort 1, -105, a in increasing order. -105, a, 1 Let l = -115 - -122.9. Let y = l + -8. Put -2/9, -0.4, 4, y in decreasing order. 4, y, -2/9, -0.4 Suppose -26k = -7k - 76. Sort 85, -2, k. -2, k, 85 Let z(u) = -u*2 - 3. Let b be z(0). Let x(v) = 2v*2 + 108v - 114. Let p be x(-55). Let i = -21 - -11. Sort p, i, b in decreasing order. b, p, i Suppose -5s - 8 = -23. Let h be (-3)/(3/(-6) + (2 - s)). Put h, 6, -2 in ascending order. -2, h, 6 Let u = 39 + -42. Put -2/9, -9, u in increasing order. -9, u, -2/9 Let q be (1794/(-15))/13-15. Put 5, 3, q in increasing order. 3, 5, q Let x be 17/26 - (-1)/(-2). Let s = 30072 + -90214/3. Put s, 0, x, 4 in decreasing order. 4, s, x, 0 Let a = 127 + -124. Put -0.5, 7, -4/7, a in descending order. 7, a, -0.5, -4/7 Let a be 1/(2/(-4)*-1). Let s be 4 + (-81)/(-9) + -8. Sort a, -4, s. -4, a, s Let v = 0.338 + -0.138. Let p = -0.4 - 0.1. Sort p, v, -1/4. p, -1/4, v Let a = 885059/2286 + 579/254. Let f = 389 - a. Let h be (-1 - 78/(-9	{ "pile_set_name": "DM Mathematics" }
/(sqrt(90)/(sqrt(10) + 2sqrt(30)/sqrt(3))). 39sqrt(17) Simplify (43sqrt(612) - (sqrt(612) + 2 + -3))*2-4. -296212 - 528sqrt(17) Simplify -45((sqrt(171) + -3(1sqrt(171) + sqrt(171)))/sqrt(9) + 5)2-2. -2000sqrt(19) + 20000 Simplify 23sqrt(34)/(sqrt(2) + sqrt(10)/sqrt(5))-4-2. 24sqrt(17) Simplify ((sqrt(390)-3-3)/sqrt(10))/((sqrt(147)-1 - sqrt(147) - sqrt(147))-1). 3sqrt(13)/7 Simplify (sqrt(343)-2)*2-4 + (5sqrt(7)-2-2)2. -2688 Simplify ((-4 + 4 + sqrt(2299) + sqrt(2299) + (sqrt(2299) - ((sqrt(2299) - -4sqrt(2299)) + -2)))-4)2. -1408sqrt(19) + 147200 Simplify -5 + (sqrt(99)/(sqrt(27)/sqrt(3)4))2-4 + -3. -43/4 Simplify (sqrt(325)-1-1)*2 - (sqrt(52)/sqrt(4) + 4 + -2). -sqrt(13) + 323 Simplify 2 + (((sqrt(72)/sqrt(2))/sqrt(2) - sqrt(18) - (sqrt(18) + sqrt(18) + sqrt(288)-6))/(sqrt(27)/(sqrt(3) + sqrt(27)6)))2. 349450 Simplify (sqrt(10) - sqrt(40))/sqrt(2) + (2 + -1 + sqrt(5) + sqrt(5))2 + sqrt(35)/(sqrt(77)/sqrt(44)). 5sqrt(5) + 21 Simplify (sqrt(200)2 - (sqrt(1152) + sqrt(1152)1))/(sqrt(72)/sqrt(2) - sqrt(4) - 1sqrt(484)). 14sqrt(2)/9 Simplify -3 + -1sqrt(468) - (-3 + sqrt(637) + -2). -13sqrt(13) + 2 Simplify ((sqrt(187) + ((sqrt(187) + sqrt(187)-1)4 - sqrt(187) - sqrt(187)))-4)/(-5sqrt(33)/sqrt(3) - sqrt(99)1)1. -sqrt(17)/2 Simplify -5-3(3((sqrt(99) - (sqrt(99)2 - sqrt(99)))*2 + -4) + 4). -120 Simplify sqrt(65)/(-1sqrt(720) - sqrt(720)) + 4 - ((-3-2sqrt(65))/(sqrt(10)/(sqrt(6)/sqrt(3))))*2. -464 - sqrt(13)/24 Simplify ((1(sqrt(153) + 3sqrt(153) + sqrt(153)))/sqrt(3))/(((sqrt(2304) - sqrt(36))3)/sqrt(12)). 5sqrt(17)/21 Simplify -2(-5 + (-1((sqrt(833) - sqrt(17)) + sqrt(17)))22 + -4). -3314 Simplify (sqrt(13) + sqrt(13) + -4 + 2 + (-1sqrt(117))/sqrt(9) + -1)6. -18 + 6sqrt(13) Simplify sqrt(10)/(sqrt(100)/sqrt(2)) - ((sqrt(45) + -1)-4)*2. -736 + 481sqrt(5)/5 Simplify (-5 + -1 + 5 + 0 + sqrt(363) + -2)*2. -66sqrt(3) + 372 Simplify 2(-2 + (-4 + -3sqrt(245) - (1 + sqrt(245) + -4)))*2. 336sqrt(5) + 7858 Simplify (-4(sqrt(13) + -2) - sqrt(13)) + (1sqrt(1053))*2 + 3 + -4. -5sqrt(13) + 1060 Simplify 5((3 + sqrt(468) + sqrt(468))2 + (sqrt(26)/sqrt(2)-5 - sqrt(13)) + 4) + 3. 330sqrt(13) + 9428 Simplify ((sqrt(408) + sqrt(408)5)/sqrt(12))/(sqrt(90)/sqrt(5)). 2sqrt(17) Simplify -411(sqrt(1872) - (sqrt(1872) + 2))-2. -16 Simplify 1 + ((((sqrt(187) + sqrt(187)1)2)/sqrt(11))2 - 4(-1sqrt(17)-1)*2). 205 Simplify -1sqrt(720) - (sqrt(5) + -5(sqrt(5) + 2 + sqrt(5)) + sqrt(5)) - (sqrt(140)4)/sqrt(7). -12sqrt(5) + 10 Simplify ((sqrt(152) - ((sqrt(152)1 - sqrt(152)) + sqrt(152)))5 + sqrt(152)-2-5)/((sqrt(192)3)/sqrt(6)). 5sqrt(19)/3 Simplify sqrt(35)/(sqrt(30)/sqrt(6))-6-6-2. -72sqrt(7) Simplify ((sqrt(567) + 2sqrt(567)-6)1 + 0)-2. 198sqrt(7) Simplify (sqrt(3) + (sqrt(3) - sqrt(27)) + -3 + sqrt(27)/(-2sqrt(9)) + (sqrt(300) + 1)-3)*2. 378sqrt(3) + 12051/4 Simplify (sqrt(130) + 3(sqrt(130) + (sqrt(130) - ((sqrt(130)-2 - sqrt(130)) + sqrt(130) - sqrt(130)) - sqrt(130))) + sqrt(130))/(-1sqrt(20)/sqrt(2))3-3. 126sqrt(13) Simplify 3 + (5(-6sqrt(12)/sqrt(6) + sqrt(2) - (sqrt(72) + 0)))*2 + 2. 6055 Simplify (5 + -3sqrt(19)1)2 + ((sqrt(19) + (sqrt(1900) - (sqrt(1900) + -2)))2 - (sqrt(19) + (sqrt(19) + (-1sqrt(2736) - sqrt(2736)))*2)). -9832 - 27sqrt(19) Simplify (sqrt(228)/(sqrt(300)1 + sqrt(300)) - sqrt(228)/(22sqrt(12)))2. 171/400 Simplify (0 + 4sqrt(2057)4 + -3 + sqrt(2057)-2)*2. -924sqrt(17) + 403181 Simplify (25sqrt(75)-1 + 1 + (sqrt(75) - (-1 + -1sqrt(75))))*24. -640sqrt(3) + 19216 Simplify (sqrt(68)/(sqrt(2) - sqrt(12)/(2sqrt(6))))/(sqrt(2) - (sqrt(2) - ((sqrt(2) + -1sqrt(2))3 - sqrt(2))) - (sqrt(2) + (sqrt(66)/sqrt(3))/sqrt(11))). -2sqrt(17)/3 Simplify 4 + -34(sqrt(684) + sqrt(684) + ((sqrt(684) + -1 + sqrt(684))1)*2). -32840 + 144sqrt(19) Simplify (4 + -4 + (sqrt(75)4)2)1. 1200 Simplify -2 + 1sqrt(76)2 + sqrt(76) + -5. -7 + 6sqrt(19) Simplify (sqrt(11)-2-5)2 + -2 + 1 + (sqrt(275)-1 - sqrt(275)) + -5. -10sqrt(11) + 1094 Simplify ((sqrt(70) + (sqrt(70) - (5(3sqrt(70) - sqrt(70) - sqrt(70)) - sqrt(70))))-4)/(2sqrt(1440)). sqrt(7)/3 Simplify (sqrt(448)4 + sqrt(448))*2-6 + (sqrt(7) + sqrt(84)/sqrt(3))*2 + 1. -67136 Simplify (5(sqrt(65)/sqrt(5) + -5)1 - (-12sqrt(13) - sqrt(13) - (sqrt(637) + 1))-3)*2. 1400sqrt(13) + 8909 Simplify (1sqrt(22)/sqrt(2) + sqrt(11) + 0 + sqrt(33)/sqrt(3))2 - (5 + 2sqrt(11)-2). 4sqrt(11) + 94 Simplify sqrt(44)/sqrt(4)1 + 0 + sqrt(1331) + sqrt(132)/(-6sqrt(24)/sqrt(2) - sqrt(12)). 83sqrt(11)/7 Simplify sqrt(119)/(-2(sqrt(35)/sqrt(5) + sqrt(7))) + (sqrt(1700)-2 - sqrt(17))2 + -4sqrt(34)/sqrt(2). -17sqrt(17)/4 + 7497 Simplify (sqrt(72)/(sqrt(28)/sqrt(7)))/(sqrt(9)16). sqrt(2)/6 Simplify -3 + (5sqrt(34)/((sqrt(126)/sqrt(7))/sqrt(9)))*2. 422 Simplify 3sqrt(425) + (sqrt(17)2 + -4)2 - ((1sqrt(136) + sqrt(136) - sqrt(136))/sqrt(8))*2-3-2. -18 - sqrt(17) Simplify (-3 + sqrt(2448))5 - (sqrt(2448) + -2)4. -7 + 12sqrt(17) Simplify (6(sqrt(121)2 + sqrt(121)) - sqrt(121))/(3(sqrt(88)/sqrt(8) + sqrt(11))). 17sqrt(11)/6 Simplify (1 + -3((sqrt(192) + 2)3 + sqrt(192))-4)2. 56064sqrt(3) + 447697 Simplify 0 + 4 + (sqrt(160)/sqrt(2) + -3)*2. -24sqrt(5) + 93 Simplify (sqrt(3)-2)2 + 2 + (sqrt(12)/sqrt(4)4)*2 + (sqrt(3) + -2 + 4 - (0 + sqrt(3) + (sqrt(3) - sqrt(3)-2))). -3sqrt(3) + 64 Simplify 4((sqrt(210)/(sqrt(90)/sqrt(9)))/(sqrt(14)/(4sqrt(2))))2. 192 Simplify (3 + sqrt(24)/sqrt(8) + 2 - (-2sqrt(150) - sqrt(6))/sqrt(2))*2. 120sqrt(3) + 457 Simplify 1((sqrt(1377) + (sqrt(1377) - -3sqrt(1377)-3) + sqrt(1377))2)*2. 198288 Simplify (-3(-4sqrt(2299) + 1 + (2 + sqrt(2299))-2 + sqrt(2299))4)2. 47520sqrt(19) + 8277696 Simplify (-3(-2sqrt(3146) + sqrt(3146)))/((sqrt(648) + sqrt(18))-4). -11sqrt(13)/28 Simplify 0 + (-5(sqrt(325))2 + (sqrt(13) - sqrt(130)/(sqrt(10)2)))-22. -2sqrt(13) + 6500 Simplify (-22sqrt(156)1)/(((sqrt(12) - 2(sqrt(24)/sqrt(2) - sqrt(12))) + sqrt(12))-6). sqrt(13)/3 Simplify (0 + 2(sqrt(147) + -1))-5 + -3. -70sqrt(3) + 7 Simplify (sqrt(42)/(sqrt(7) + sqrt(112) + (sqrt(112)3 - sqrt(112))))/((sqrt(162) - sqrt(162)3)-2). sqrt(3)/468 Simplify ((1((sqrt(35) - (sqrt(140)/sqrt(4) - sqrt(35))) + sqrt(35)))/sqrt(5)2-4)2. 1792 Simplify -2(sqrt(48)/(sqrt(48) + sqrt(3)))/(sqrt(8) - sqrt(48)/(-1sqrt(6))). -sqrt(2)/5 Simplify 1((sqrt(162)1 + -1)2 - (sqrt(162) - (sqrt(162) + -4 + 4))2). -18sqrt(2) + 163 Simplify (sqrt(38)/(sqrt(2) - sqrt(96)/sqrt(12)))*2 - ((sqrt(1900)2)*2 + 0). -7581 Simplify (((sqrt(2835) + (4sqrt(2835) - sqrt(2835)) + sqrt(2835) - sqrt(2835)) + sqrt(2835))/(sqrt(15)/sqrt(3)2))2. 14175/4 Simplify (5(sqrt(2448) - -1(sqrt(2448) + 1)) - (2sqrt(2448)1 - (sqrt(2448) + 0)-6))*2. 240sqrt(17) + 9817 Simplify (sqrt(153)/(-2sqrt(9)) + 1 + sqrt(17) + 2 - sqrt(85)/(-6sqrt(25)/sqrt(5)))*2. 4sqrt(17) + 149/9 Simplify (2 + (sqrt(19) + sqrt(19) + -1 + sqrt(19) - sqrt(19)) + 5 + 3 + -3)*2. 24sqrt(19) + 112 Simplify (-3 + 3 + ((sqrt(117) + 1 + sqrt(117))4 - -2(-1 + sqrt(117))))*2. 120sqrt(13) + 11704 Simplify -5(1 + (-5sqrt(120)/sqrt(5))/sqrt(8)). -5 + 25sqrt(3) Simplify (-11sqrt(3388))/(2sqrt(100) - (sqrt(16)-1 + sqrt(4) - sqrt(4))). -11sqrt(7)/12 Simplify sqrt(140)/sqrt(5)4 - 1(sqrt(567) - (sqrt(567) + 1)). 1 + 8sqrt(7) Simplify ((sqrt(7)3 - sqrt(7)) + -2)3 + (1sqrt(252) - sqrt(252))4. -6 + 6sqrt(7) Simplify (-4sqrt(88)2 - 2sqrt(88)-1)/(sqrt(8) - sqrt(96)/(sqrt(36)/sqrt(3)) - (sqrt(392) + 1sqrt(392))) + -2. -2 + 3sqrt(11)/7 Simplify (6((0 + sqrt(800))-4 - (sqrt(800) + 3 + (sqrt(800) + 1 - sqrt(800)) + sqrt(800) - sqrt(800))))*2. 28800sqrt(2) + 720576 Simplify ((sqrt(475)3 + sqrt(475))2 + 2)2 + 1 + 1. 15206 Simplify (1-1(0 + sqrt(208) + -3 + sqrt(208) + ((sqrt(208) + -1)1 - sqrt(208)))3)*2. -576sqrt(13) + 7632 Simplify (1(4sqrt(119) + sqrt(119) + sqrt(119)) + sqrt(119))/(sqrt(847)-4). -7sqrt(17)/44 Simplify (sqrt(896)-13)/(sqrt(63)/(sqrt(108)/(sqrt(36)/sqrt(3)))). -24sqrt(2) Simplify 4 + ((5 + sqrt(44))2 - sqrt(44)) + sqrt(1100) + 5. 78 + 28sqrt(11) Simplify (1 + 61sqrt(112) + -1*(sqrt(112	{ "pile_set_name": "DM Mathematics" }
se -3z = 17z - 3z. Suppose 0 = 2h - zh, h = -4r. Solve r = 2v - 2y, v - 4y = -v - 2 for v. 1 Let v be 0 - 0 - (1 - 11). Suppose 4l - 1074 = -1122. Let n be 25/(-10)1l/v. Solve n = 3z - 3p, z + 2z = -4p + 24 for z. 4 Suppose -l + 31 = 160t - 164t, 4l + 4t = -16. Solve -13d + 6 = -10d, 0 = lu - 5d + 7 for u. 1 Let y be ((-4)/(-4))/1 - (-6 + 8)-2. Solve 5m = -3b - 7, -19 + 9 = ym for b. 1 Let i(w) = 13w2 + 12w + 12. Let d be i(-1). Suppose -5r - d = -2s + 5s, 2s + r = 3. Solve 4k = -p + sp + 4, -5k + 8 = -3p for k. 4 Let a = -68 - -68. Suppose ar = -l + r, 2 = r. Let u be (6/15)/l - (-58)/10. Solve -c = -m + 6, -7m = -2m + 3c - u for m. 3 Suppose 2n = 3n - 26. Suppose 0 = 2r - 4a, -35a - 4 = -39a. Solve 4u + l = -l + 4, -ru + 5l + n = 0 for u. 3 Let u = -6213 + 6215. Solve f = -uh + 4, -5f + 5h - 10 = -0f for f. 0 Let i be 59(-3)/6(-2 - 0). Let n = 62 - i. Let y be n - (-16 - -1)/(-5). Solve 0 = -2k + 10, 5h - 2k = -y - 10 for h. 0 Let n be (1/(-4))/(67/(-1340)) + -1. Solve -nt - 4w = 24, t = 6t - 2w - 5 for t. -1 Suppose 94 + 20 + 28 = 2g + 4t, 0 = t. Solve -8 = 3x - r, 75r - 10 = x + gr for x. -2 Let f(t) be the third derivative of -2t*5/15 - 47t*4/24 + 4t3/3 + t2 - 39t. Let h be f(-6). Solve 4p + h = -3n - 20, -14 = 3p + n for p. -4 Let k = 0 - -4. Let a = 4470 + -4469. Solve -p - a = -4u + 4, -5p = -ku + 25 for u. 0 Suppose -631 - 454 = -35x. Let z be 28 - x - 4-2. Solve 5g + 3a = -2a + 5, 0 = -3g + za - 29 for g. -3 Let y(u) = -409u - 1224. Let o be y(-3). Solve -ok = 9, -4a + 5k - 4k + 3 = 0 for a. 0 Let a = -85 - -81. Let p be (4 - -8)/((18/a)/(-3)). Solve p = 4d + 4o, -10 = -2d - 3d + o for d. 2 Let m = -20830 + 20835. Solve 117d - 112d - 31 = -2a, ma - 3d = 0 for a. 3 Let b(d) = d*3 - 10d - 4d - 1 - 5d*2 + 15d. Suppose -5p = -p - 20. Let n be b(p). Solve -nl + 20 = -4k, 3k = -3l - 2l + 1 for k. -3 Let j(s) = -5s - 30. Let w be j(-10). Suppose -6i + w = -2i. Solve -4m + 1 = -5m, -23 = -ic + 3m for c. 4 Let v(z) = 4z*2 + 39z + 5. Let l be v(-10). Let g be l/(-12) - (-187)/44. Solve 0 = gy - 3m - 21, -2y = -y - 2m - 11 for y. 3 Suppose 68h - 62 + 62 = 0. Solve 2a - o = 0, -2a + ha + 3o = -8 for a. -2 Let x be (-2)/(-17) - (300/(-51) - -2). Suppose 2 = -xk + 18. Let w be 152/48 - (-1)/(-6). Solve 0 = wy + 2m - 0m - 8, ky = -4m + 16 for y. 0 Let f be (0 + 3/(-10))/(154/(-1540)). Let v = -10 - -36. Suppose g - 1 = 0, 5q + 4g - 3g - v = 0. Solve -2n = 5o - 3, -3 + 1 = -qo - fn for o. 1 Let c = 5430 + -5416. Solve 2o + 20l = 19l + 6, 5o = -2l + c for o. 2 Suppose 190p - 194p = 1060. Let z = -233 - p. Solve 0 = -2b + 2x, 6x - 2x = -4b + z for b. 4 Suppose n - 6 = 45. Suppose -83 = -2a - n. Suppose 20c - ac - 16 = 0. Solve -cr = 3t - 10, -2t + 2 = 4r - 6 for r. 1 Let x be -11 + (-176)/(-16) - -37. Solve n + l + 9 = 0, 3l = -71n + 66n - x for n. -5 Suppose 5q - 131 = -2u, -2u = -q + 33 - 2. Let n be 2/4221. Suppose -5y = -2y + 2i - n, 5i + 30 = 4y. Solve 18 = -l + 3g + g, -yg = l - q for l. 2 Let q be 291/194(3 - 1). Solve 20 = 4v - 2f, -8v + qv + 11 = f for v. 3 Let q be (5/(-9))/(25/(-210)) + (-10)/(-30). Solve 0 = -9m + 4m + 2o + 10, 0 = -5m + qo + 10 for m. 2 Let x be (-45)/(-8) + (-70)/112. Solve -11 = -v + 5r, xr - 63 = -4v - 69 for v. 1 Let n be 2/(11/(-9 + 20)). Solve -10 - 5 = -nq + 5a, 0 = 3a + 15 for q. -5 Let o(f) = -19 - 34f - 31f + 98f - 36f. Let x be o(-7). Suppose -5n + 0n - 2r + 4 = 0, -4n = xr - 4. Solve c + ng - 5 = 5g, -2g = -c + 5 for c. 5 Let g(l) = -15l3 - 2l - 3. Let y be g(2). Let v = -131 - y. Let o be v + (-248)/(-60) + 146/30. Solve -5i - x = 22, 4i + 4x + x + o = 0 for i. -5 Let u(m) be the third derivative of 0m + 43m2 + 1/12m*4 + 0 - 10/3m*3. Let w be u(11). Solve -8 = -a + i + i, -a - wi = 0 for a. 4 Let t be (-54)/99(-209)/38. Solve 11s - 16s = -5o, -to - 5s - 32 = 0 for o. -4 Let d(p) = 15p3 + 10p*2 + 9p*3 - 22 - 38p*3 + 15p*3 - 13p. Let r be d(-11). Solve r = -5z - 4b - 28, 0z - b = z + 6 for z. -4 Let c = 3116 + -3103. Solve 2d + q = -c, 7d - 3d + q = -23 for d. -5 Let k(c) = c*2 + 13c + 51. Let y be k(-5). Suppose 2p = 8, -12p + 8p + y = -o. Solve s - 10 = -ol, -l = -4s - 3 + 1 for l. 2 Suppose 0 = 2l - 7l - w - 1, -5l + 4w + 4 = 0. Suppose 6j + 45 = j. Let v = j + 11. Solve 0 = -2i + 3c + v, lc - c + 22 = 5i for i. 4 Suppose -3a - a + 8 = 0. Suppose 1 = d, 9 = al + 5d - 2. Suppose 5z + 3t - 16 = 0, t = -z + lt + 11. Solve 0 = y - j, 2j = 4y - y - z for y. 5 Suppose -h + 10 = h. Suppose -2k + 5i = -6, 3k - 8k + 15 = hi. Solve -2s = kb - 11 - 5, 3b - 8 = 2s for b. 4 Let v(i) = i3 + 33i*2 + 100i + 33. Let g be v(-3). Suppose 16 = 8s - 4s. Solve -y + 3m = -gy + 19, 4m - 28 = -sy for y. 2 Let v(t) = 27t + 58. Let z be v(-2). Suppose -4s - 2 = -5d - z, 4s + d - 14 = 0. Solve -sb + 2x = 1, 0x = -5b + x - 11 for b. -3 Let l = -46 + 48. Let x(g) = 3g3 - 2g*2 + 1. Let n be x(-1). Let k be (-12 - -10)/(n/6). Solve -kf = -5s - 4, s - f = lf - 8 for s. 1 Let i = -2778 + 2788. Solve -i = -5u - 0, 0 = 4j + 2u - 16 for j. 3 Let k(s) = 14s + 210. Let c be k(-21). Let w be ((-12)/14)/(9/c). Solve 3m + w = -4y, 2m - m = 5y + 29 for m. 4 Suppose 0 = 6m - 2m - 4n + 4, 3m + n - 9 = 0. Suppose 5z + t - m = 0, z + 2t = -0t + 4. Solve 5p + y + 5 = z, -2p + 3y = -3 - 12 for p. 0 Let p be -19 - (-11)/((-154)/(-1246)). Solve c - b + 4 = 0, 5c + pb - 71b + 24 = 0 for c. -5 Let v(m) = 8m*2 + 15m + 1. Let b be v(-2). Suppose 5x - 11 = -by + 110, -2x = y - 48. Solve 0n = 3n - 2u + 11, -3n - x = -5u for n. -1 Suppose -5w + 4k + 31 = 0, -3 = -k - 7. Solve 75i + wp = 73i + 8, -p = 5i - 7 for i. 1 Let z(l) = l*3 + 6l*2 + 6l + 9. Let u be z(-4). Suppose -13k - 24 = -uk. Let f be (-20)/156/(-4) + k. Solve f = 3p + 5i, -p + 4i = 8i - 12 for p. -4 Suppose -2y = -3m + 12, -m - 2y = 3y - 21. Let j = 470 - 464. Let d be j/16 + 481/296. Solve -w = -v - m, -v + w = dv + 12 for v. -3 Let i = 170 + -171. Let x be ((-40)/24)/(i/3). Solve -c = xo + 26, 5c + 13 = 4o + 28 for c. -1 Let x(i) = -3i + 31. Let w be x(7). Let z = -273 + 275. Solve 7c + 20 = 3c, -zc - w = -2v for v. 0 Let i(v) = 2v2 + 7v + 15. Let c be i(-20). Let u = c - 675. Solve u = 2t - 4, p + 4t = -4p + 8 for p. 0 Suppose 23l - 21l - 4o = 112, 0 = 4l - 3o - 239. Solve p = -4y + 12, -2p = -4y - l + 86 for p. -4 Let k = -5965 + 6001. Solve 0 = -2a + l + 5, 3a + l + 26 = k for a. 3 Let f(i) = 33i*2 + 256i - 56. Let s be f(-8). Solve 9p - 6 = sp + 4u, 0 = p + 4u - 6 for p. 6 Suppose 5h - 15 + 5 = 0. Suppose -4q = -2q + 2, hk = -4q. Suppose -2u = 5t - 11 - 14, u = 5t - 10. Solve ux - 10 = kf, -5x = -f - 4f - 25 for f. -5 Let k = 723 + -721. Solve -n + 4 = d, -3d = kn - 13 + 6 for d. -1 Let r(x) = -x3 - x2 + 4x - 4. Suppose o = -4u - 23, 2u + 16 = -3o - 3. Let t be r(o). Solve 5i = 4d - 9, 2d + 21 - 3 = -ti for i. -5 Let h be (-1(-1)/3)/((-8)/(-72)). Suppose 4l - 3 - 15 = -o, -11 = -hl - 2o. Let x be (-6)/(-30) - (-99)/l. Solve 10r - 25 = 5r + 2y, 0 = -4y - x for r. 3 Let h be 3 + 6 + -1 + -6. Suppose -y + h = 0, -3y + 37 = a + 9. Solve 4t - a = 2q, 0 = -4t + 5 + 7 for q. -5 Suppose l - 3m + 112 = 0, -3m + 2m = 4. Let y be (l/(-93))/((-8)/(-18)). Solve -o - yp = -10, p - 2 = -3o - p for o. -2 Let o be (4/7)/(8/28 + 0). Suppose -ok + 5c = -38, -2k - 10 = -3c - 40. Solve k = 3s + 3d, -5s - d + 23 = -4d for s. 4 Suppose 26 = 4t - 195b + 194b, 3t + 5b = -15. Suppose -2p = 2p - 12. Suppose 0y = -y + p. Solve 2s + 2a = 0, ys - 7s - 4 = ta for s. 4 Suppose 4j = -3h - 31, -2j - 3h - 14 + 3 = 0. Let d be (-2)/(-5) - 56/j. Let m be 9/2 - (-3)/d. Solve 0 = -mt + 4g - 30, -t - 3g = -4 - 9 for t. -2 Let i(m) = 21m - 1. Let u be i(2). Suppose 8q - 39 = u. Suppose -q = -l - 8. Solve -5r - v + 29 = -lv, -r = -v - 9 for r. 5 Let x(b) = 7b*2 - 8b + 7. Let n be x(2). Suppose 0 = nq + 21 - 59. Solve -5c = -0t - 5t - 30, 3 = -q*t - c for t. -3	{ "pile_set_name": "DM Mathematics" }
hat is the third smallest value in k, b, -2/13? k Let h = 180.1 + -180. Let p be (-3)/1216/(-12). Let y = -0.2 - -0.4. Which is the third biggest value? (a) y (b) p (c) h c Let d = 29 + -6. Let h = -18 + d. Let v = 0.32 + -0.02. Which is the second smallest value? (a) h (b) 10 (c) v a Let i(r) = 2r + 12. Let h(l) = -2l - 12. Let v(q) = 3h(q) + 2i(q). Let y be v(-7). What is the smallest value in 2/17, -0.2, y, -0.3? -0.3 Let y(d) = d - 16. Let g be y(19). Suppose 0 = 4c - 4r - 28, gc - 6 = 2r - 4r. What is the third biggest value in c, -2, -3? -3 Let r = -3.71 - -4. Let n = 0.31 - r. What is the biggest value in 2/7, n, -1, -0.2? 2/7 Suppose 0 = -c - 3c + 4. Let k be c - (-3 - (3 + -4)). Suppose 2r - y - 4 = 0, -kr = 2r - 5y. What is the third biggest value in -7, -1, r? -7 Let w be (-11 - -1)/(-3 + 4/4). Let r = 2 - 2.2. Which is the smallest value? (a) 0.4 (b) r (c) w b Let x = -10.82 + 11. Let d = -6.1637 + -0.0163. Let w = x + d. Which is the biggest value? (a) w (b) -3/7 (c) -0.3 c Suppose -3q = -6q. Let z = -6 - -2. Let r = z + 4.1. What is the smallest value in -4, r, q? -4 Suppose 5s + 16 = s. Let p = 0.2 - -0.3. Let m = -8821 + 8825. What is the second smallest value in p, s, m? p Let h = -48.5 - -49. Which is the second biggest value? (a) 3 (b) 1.3 (c) h (d) 0.4 b Let p be 6/(-9) + 17/3. Suppose 0 = 4h + 19 + p. Let z be ((-2)/h - 0)-15. What is the third smallest value in -1, -2, z? -1 Let w = 0.241 - -12.759. Which is the third biggest value? (a) 1/3 (b) -4 (c) -1 (d) w c Let s = 17.1 + -21. Let o = -3.73 - s. Let y = 0.23 + o. Which is the third smallest value? (a) -3/11 (b) y (c) -4 b Let i be 10(4 - 69/18). Let y = -5.1 - -1.1. Let x(c) = -c2 + c. Let z be x(0). What is the second smallest value in i, z, y? z Let l = 78 + -82. What is the third smallest value in -5, l, 1/7? 1/7 Let h be (170/24 - 7)16. Which is the second biggest value? (a) -0.2 (b) 9 (c) h c Let o = -22 - -25. Let j = 68 - 67. Which is the second biggest value? (a) -5 (b) j (c) o (d) -3 b Let h = -654 + 653.7. Which is the third biggest value? (a) -15 (b) -2 (c) h a Suppose -u - 18 = -5o, 5o + 4u - 21 = -18. Let v = -6 + 11. Which is the fourth smallest value? (a) -0.1 (b) v (c) o (d) 1/4 b Let j = 161/11 - 655/44. What is the third smallest value in j, 9, -1/5? 9 Let t = 7 - 12. Let q = 35.078 + -0.078. Let g = 34.6 - q. Which is the second smallest value? (a) g (b) -1.1 (c) t b Let n = 176 + -180. Which is the fourth smallest value? (a) 1 (b) n (c) 1/2 (d) -5 a Let f = 0.9 + -1.22. Let i = 129 - 128.78. Let s = f + i. What is the second smallest value in s, 0.3, -9? s Let q = -188.8 + 189. Which is the biggest value? (a) 0.6 (b) 5 (c) q (d) 2/13 b Let p = 6 + -4. Let m = -6.09 - -0.09. Let s = -9 - m. Which is the third smallest value? (a) p (b) s (c) 5 c Suppose 2u - 36 = -5x, -18 = -3x + 7u - 10u. Let r(n) = -n + 5. Let v be r(5). Suppose v = -s + xs + 35. Which is the biggest value? (a) 3 (b) s (c) -3 a Suppose 0 = w - 25 - 18. Let n = w + -44. Which is the second biggest value? (a) 4 (b) -11 (c) n c Let l = 245.7 + -244. Which is the biggest value? (a) l (b) 3 (c) -0.4 b Let t = -34 - -10. Let h = -21 - t. Let b be (9/(-6))/((-3)/4). What is the biggest value in h, 1, b? h Let g = 3 + 1. Suppose -1462i + 30 = -1456i. What is the third biggest value in g, -0.4, i? -0.4 Let q = 4131 - 4134. Let x = -2.5 - -30.5. What is the second biggest value in -1/9, q, x? -1/9 Let k = -0.687 - 128.373. Let y = k + 131. Let v = 0.06 + y. Which is the smallest value? (a) 1 (b) v (c) -2 c Let x = 106.82 - 107. Which is the third biggest value? (a) -1 (b) x (c) 1/6 a Let f = 1498 - 1502. Let p be (-6)/4(-4)/15. Which is the second smallest value? (a) f (b) p (c) 3 b Let l be 9/(-15)60/18. Which is the third biggest value? (a) -265 (b) -1/2 (c) l a Suppose -28 = -4i - 5f, -i + 4i - f - 2 = 0. Suppose 4d - id = 0. Let m = -1 - 3. Which is the second smallest value? (a) 3/2 (b) d (c) m b Let v be 7/(56/180) + (-3)/(-6). Let g = v - 165/7. Let l = -2.5 - -2. What is the second smallest value in 0.2, g, l? l Let n = -3513 - -3511. Let m = 0.1 - -0.4. What is the third smallest value in 0.1, 1, n, m? m Let z(q) = -264q2 - q - 2. Let t be z(-1). Let l = 1067/4 + t. Which is the biggest value? (a) -0.2 (b) l (c) 4 c Let n = -59 - -59.12. Let k = n - -0.38. Let a be (-1)/82/3. What is the biggest value in -3, k, a? k Suppose -3q + 4q = 5. Suppose -3r + 3b + 18 = 0, -1 = 2r + 3b + 2. Suppose q = 4v - r. What is the third smallest value in 0.4, -2/7, v? v Let p be (6 - 7) + -43. Which is the third smallest value? (a) p (b) 3 (c) -1/5 b Suppose 6d = -d + 182. Let w = 28 - d. Which is the third smallest value? (a) 0.4 (b) w (c) -8 b Let k = 21.4 + -25. Let m = k + -0.4. Which is the third biggest value? (a) -1/5 (b) 0.1 (c) m (d) 2/9 a Let a = -13 - -15. Let j = 0.018 + -4.018. What is the fourth biggest value in 0.1, a, j, -3/5? j Let z = 17 - 9. Let y = z + -5. Let w = 3.9 - 4.3. What is the third biggest value in y, 1/3, w? w Let j(t) = t3 - 5t*2 - 2t + 5. Let x be j(5). Suppose 0 = 6d - 4d - 22. What is the smallest value in -0.3, x, d? x Let i = -0.16 - 0.24. Let l = 98.3 + -106. Let z = l - -8. Which is the third smallest value? (a) i (b) z (c) -4 b Let f = -8 + 10. What is the third biggest value in -16, -1, f? -16 Let m(r) = -3r + 21. Let z be m(6). What is the biggest value in 0, 2, z, 2/57? z Let g = -0.094 + 2.094. Let x = -1.1 - -0.1. Which is the third smallest value? (a) 0.1 (b) g (c) x b Suppose 2o = -3p - 104, 5p + 4o + 172 = o. Let s = p + 35. Let v = -2.4 + 2. What is the second smallest value in s, -1, v? v Let o = 0.2 + -0.4. Let k = -11.2 - -10.891. Let s = k - -0.009. Which is the second biggest value? (a) o (b) s (c) -3 b Let i = -558 + 558.4. Which is the third biggest value? (a) 0.1 (b) i (c) -0.3 (d) -10 c Let x = -0.8 + 5.8. Let i = -4/7 + 5/21. Let y be -2 + ((-28)/(-98) - 62/(-28)). Which is the third smallest value? (a) i (b) x (c) y b Let g = 0.554 - 0.154. What is the biggest value in 1, -0.4, g? 1 Let w be (156/18)/((-2)/3). Let z(y) = -y - 13. Let q be z(w). What is the third biggest value in 1, 0.01, q? q Let r be ((-3)/(-14))/(90/70). Suppose 2a + 6 = -2w, 2a + w = 2w + 6. Let h be (a - -1)6/4. What is the third smallest value in -1/2, h, r? h Let d = -96.5 - -96.9. Which is the second smallest value? (a) 2/15 (b) d (c) 13/14 b Let m = -23 + 24. Let y = 12 + -15. What is the smallest value in m, y, -2? y Suppose 1 = 5h + 11. Let i be (-4 + 207/51)h. What is the second biggest value in i, -3/5, -10? -3/5 Let v = 200.17 + -201. Let y = 0.13 + v. Let s = y - -0.4. Which is the biggest value? (a) s (b) -1/11 (c) 5/3 c Suppose -3n + n - 10 = -5c, c + 4n - 2 = 0. Suppose -a = ca. Let l = -88.8 - -89. What is the biggest value in l, 12, a? 12 Let z = -1501 + 1500. Which is the smallest value? (a) z (b) 5 (c) 0.17 a Let c = 129.89 - 129.89. Let q = 0.3 + -0.5. What is the third biggest value in q, -0.3, c? -0.3 Let n be (-5 - -8) + (-356)/118. Let z = n + 179/118. Which is the third biggest value? (a) 18 (b) 3 (c) 1/3 (d) z d Let h = -0.02 - -0.02. Let s = -3.166 - -0.066. Let v = 3.3 + s. What is the biggest value in h, 0.5, v? 0.5 Let y = -0.57 + 1.07. Let v = 0.17 + -0.07. What is the second biggest value in 7/13, v, y? y Suppose 5l + 260 = 15l. Let h be (l/(-195))/((-8)/6 + 2). Which is the third biggest value? (a) 1/5 (b) -2 (c) h b Let y be (-6 - -1) + 2/(-2). Let p = 14414.2 + -14414. Let l = 6 - 6.3. Which is the smallest value? (a) y (b) p (c) l a Let h be (0 - 10/(-50))(-10)/8. What is the smallest value in h, -1/9, -3/2? -3/2 Let g = -5.33 - -4.83. Which is the biggest value? (a) g (b) 1/7 (c) -8 (d) 4/5 d Suppose -8 = 4u - 3g, -16 + 0 = 4u - 5g. What is the fourth biggest value in 2/11, u, 3/8, 10? 2/11 Suppose 2w + 5 = -z + 14, 15 = 5z. Suppose -wq - 2q - 10 = 0. Let k be 1 - ((-56)/20)/q. Which is the third smallest value? (a) -1/4 (b) k (c) -0.5 a Let x(r) = -r3 - 8r*2 - 5r + 3. Let l be x(-7). Let k = l + 9. Let p = -0	{ "pile_set_name": "DM Mathematics" }
j + 45/2jb - 75/4j*3 + 0. -3j(5j - 3)2/4 Let a(x) be the second derivative of -x5/4 - 25x4/3 + 5x*3/6 + 50x*2 + 115x. What is u in a(u) = 0? -20, -1, 1 Let c = 41 + -19. Suppose -4t + c = 2h, 12 + 7 = h + 4t. Factor 2/3y*h + 10/9y*2 + 0 + 4/9y. 2y(y + 1)(3y + 2)/9 Let u(t) = t*4 + 63t*3 + 960t*2 - 1030t + 6. Let i(w) = -2w + 2. Let l(k) = -15i(k) + 5u(k). Suppose l(a) = 0. What is a? -32, 0, 1 Let j be 2/(-11) + (-114)/(-22). Suppose 0 = -5b + d + 48, -31 = -4b + d + 7. Factor bx - 19x2 + 20x*3 + 2x*j - 10x4 + 1 - 3 - x2. 2(x - 1)5 Let r = 391445 - 3518873/9. Let j = r - 458. Factor 20/9q*3 - 2/9 + 10/9q - 20/9q2 - jq*4 + 2/9q*5. 2(q - 1)*5/9 Let h(a) be the first derivative of 16a + 4a5 - 12a*3 + 3a*4 - 23 + 20 - 11a*4 + 16a*2. Solve h(s) = 0. -1, -2/5, 1, 2 Let o(b) be the first derivative of -2b5/35 + b4/7 + 2b3/21 - 2b*2/7 + 282. Solve o(u) = 0. -1, 0, 1, 2 Factor 60w + 14791w4 + 924w*2 - 640w*3 - 14683w*4 + 12w. 4w(w - 3)*2(27w + 2) Let h(j) = -7j*3 - 3j + 10. Suppose 137 + 186 = 19u. Let d(t) = -20t3 + t2 - 10t + 29. Let b(w) = uh(w) - 6d(w). Factor b(r). (r - 4)(r - 1)*2 Let s(x) = 3x + 45x3 + 3x + 7 + 5x - 18 + 4x4. Let b(g) = g4 + 9g3 + 2g - 2. Let i(w) = 11b(w) - 2s(w). Solve i(c) = 0. -3, 0 Suppose 124 = -12p + 43p. Let a(y) be the third derivative of -1/48yp + 0 + 0y - 1/240y5 - 1/24y*3 - 7y2. Factor a(f). -(f + 1)2/4 Suppose 3b + 14 = 5b. Factor -4m2 - 55m - m*2 - 8 + 75 - b. -5(m - 1)(m + 12) Let l be (15/9)/(2/(32/200)). Let g(w) be the second derivative of 1/6w*4 + 0w*2 + 2/25w*5 - 6w + lw3 + 0 + 1/75w6. Find p, given that g(p) = 0. -2, -1, 0 Let w(o) be the first derivative of o4 - 148o3/3 + 142o*2 - 140o - 260. Factor w(t). 4(t - 35)(t - 1)*2 Suppose 3l + 33 = 3v, l + 0l + 25 = 3v. Suppose -z - vz = -16. Suppose -2i4 + 0 + 0i - zi3 - 2/3i*5 - 2/3i*2 = 0. Calculate i. -1, 0 Let q = 121/120 - 5/24. Factor -2/5i*2 - qi + 6/5. -2(i - 1)(i + 3)/5 Let h be 2 + (-2688)/(-147) - 16. Let u be (-2)/(-56) - 3/(-12). What is i in -2i2 + ui*3 - 18/7 + hi = 0? 1, 3 Suppose -3d - 7d = -20. Let k be -9(8/12 - 1). Solve 4/7t + 0 - 2/7td - 6/7t*k = 0. -1, 0, 2/3 Let k(c) be the first derivative of 7 - 27/2c*2 + 12c - c*3. Let b(u) = -2u*2 - 14u + 6. Let r(h) = 9b(h) - 5k(h). Factor r(g). -3(g - 2)(g - 1) Let n(j) be the third derivative of j5/75 - j4/120 - 74j2. Solve n(q) = 0. 0, 1/4 Let w be -3 - -581/18. Let o = 40 - 118/3. Factor 0 - wp2 + op. -2p(p - 3)/9 Let d = 75 + -28. Factor 3t3 + dt - 3t4 + 6t*2 - 3t*2 - 50t. -3t(t - 1)*2(t + 1) Let u(b) = 3b3 - 17b*2 - 18b. Let s(x) = -20x3 + 120x*2 + 125x. Let d(c) = -2s(c) - 15u(c). Factor d(m). -5m(m - 4)(m + 1) Let j be 150/140168/120. Factor -js2 - 30s - 150. -3(s + 10)2/2 Suppose r = 5t - 156, 0t - 148 = -4t - 5r. Solve 92x*3 + 4 + 28 - 32x*5 - tx*4 - 16x*3 - 112x + 56x2 + 12x*5 = 0 for x. -2, 2/5, 1 Suppose 36x*2 - 2x*3 - 14x + 0x3 - 7x*3 + 6x*3 - 46x = 0. Calculate x. 0, 2, 10 Let s be (-28)/(-21)-1(-3)/(-2). Let l be (s + 2)/(18 - 14). Factor -2/3w2 - 2/3w*4 + 0 + lw - 4/3w3. -2w*2(w + 1)2/3 Let d(r) be the third derivative of -r7/420 + r*5/60 + 7r*3/6 + 18r*2. Let m(s) be the first derivative of d(s). Factor m(k). -2k(k - 1)(k + 1) Let m be (42/(-12))/74/(-82). Let b = m - -75/287. Solve 4/7r*3 - 2/7r*5 + 4/7r*2 - 2/7r*4 - br - 2/7 = 0 for r. -1, 1 Suppose -2 - 4 = -3o - t, -8 = -4o - 3t. Suppose 2d + 3d + 10 = 0, op + 2d = 2. Factor -3x + 5x3 - 3x*4 - 3x + x*p + 3. -3(x - 1)*3(x + 1) Factor 0i + i4 - 22i*3 - 10i*3 - 45i*2 + 0i + 36i3. i2(i - 5)(i + 9) Let 1/7z*2 + 160/7z + 6400/7 = 0. Calculate z. -80 Solve 74m - 26m3 - m4 - 75 + 48m + 546m*2 - 566m*2 = 0 for m. -25, -3, 1 Let d(z) be the third derivative of 0 + 0z + 25/1176z8 - 1/12z*4 - 13/147z*7 + 1/105z*5 - 1/21z*3 - 14z*2 + 23/210z*6. Factor d(n). 2(n - 1)*3(5n + 1)2/7 Suppose -f + 4n - 4 = 0, 4f - 8 = -2n + 30. Suppose 2c + p = 4c - f, 10 = -c - 3p. Determine j, given that 8/7j - 16/7 - 1/7jc = 0. 4 Factor 0h + 2/15h4 + 0 + 0h*2 - 4/15h*3. 2h*3(h - 2)/15 Let t = 37 - 19. Factor -4k3 + tk*2 + 17k*2 - 31k*2. -4k*2(k - 1) Let p(a) be the first derivative of 0a + 3a*3 - 3a*2 - 3/4a*4 + 2. Factor p(i). -3i(i - 2)(i - 1) Let h(t) be the second derivative of 0 - 3/4t2 - 13t - 5/24t4 - 1/40t*5 - 7/12t3. Factor h(c). -(c + 1)2(c + 3)/2 Let n(c) be the second derivative of -c6/75 + c5/25 + 2c*4/15 - 2c*3/15 - 3c*2/5 - 15c + 11. Determine s, given that n(s) = 0. -1, 1, 3 Let y(i) = -11i2 - 6i. Suppose b + 2a + 6 = 0, -3a = 3b + 2a + 18. Let q(j) = -45j2 - 25j. Let k(p) = bq(p) + 25y(p). Factor k(f). -5f2 Let i(v) = -4v*2 - 5v - 3. Let h(b) = -8b2 - 11b - 5. Let p(w) = 3w - 6. Let u be p(3). Let s(g) = uh(g) - 5i(g). Factor s(r). -4r(r + 2) Let r(u) be the first derivative of u4/14 - 2u*3/7 - 6u*2/7 + 16u/7 + 31. Let r(m) = 0. Calculate m. -2, 1, 4 Let x = -49/6 + 269/30. Let s(q) be the second derivative of 11/15q6 + 4q - 2/3q4 + 1/7q*7 + xq*5 + 0 + 0q*3 + 0q*2. Factor s(z). 2z*2(z + 2)*2(3z - 1) Let r = -150992/945 - -4132/27. Let k = r - -50/7. Factor -2/5y + ky2 + 0. 2y(y - 1)/5 Let z = -1035/182 - -99/14. Let z + 30/13p + 14/13p2 + 2/13p*3 = 0. Calculate p. -3, -1 Suppose -10b - 8 = -28. Suppose -5w2 + 2w*2 - 10w - 8 + 18w + wb = 0. What is w? 2 Let j = 700 + -697. Let v(r) be the second derivative of -7r + 14/3rj + 1/5r*5 - 6r*2 - 5/3r*4 + 0. Factor v(d). 4(d - 3)(d - 1)2 Let g(n) = n3 + 6n*2 - 9n + 1. Let r be g(-7). Factor 20s2 - rs + 528s4 - 516s*3 + 199s*2 + s - 28s - 192s5 + 3. -3(s - 1)*2(4s - 1)3 Let y = -2/1101 + 1111/5505. Let f(k) be the second derivative of 1/20k*4 + yk*3 + 3/10k*2 + 7k + 0. Solve f(q) = 0 for q. -1 Solve -46/11o - 2/11o*3 - 2/11o*4 + 20/11 + 30/11o*2 = 0. -5, 1, 2 Let l(q) = -2q3 - q - 1. Let u(a) = -a3 + 40a2 - 65a + 10. Let g(x) = 12l(x) - 3u(x). Factor g(c). -3(c - 1)(c + 7)(7c - 2) Let l be (14/279321)/((-1)/(-19)). Solve -1/7g*l + 1/7g*3 + 1/7 - 1/7g = 0. -1, 1 Let h(m) be the first derivative of m*4 - 64m*3/3 - 34m*2 - 678. Factor h(o). 4o(o - 17)(o + 1) Solve 116/7q - 12/7q*4 + 16/7 + 10/7q*3 + 122/7q*2 = 0 for q. -2, -1, -1/6, 4 Let x(b) = 8b + 47. Let l be x(-12). Let h = l - -51. Factor 64/7g + 32/7 + 48/7g*h + 16/7g*3 + 2/7g*4. 2(g + 2)*4/7 Let k(g) be the third derivative of -7/4g*5 - 2g*3 + 0g + 0 + 11g2 + 5/16g*6 + 11/4g*4. Factor k(s). 3(s - 2)(5s - 2)2/2 Let j(v) be the first derivative of v5/15 + 7v4/12 + 2v*3 - 3v*2/2 + 6v - 8. Let h(x) be the second derivative of j(x). Find f such that h(f) = 0. -2, -3/2 Let n(q) = 2q4 + 10q*3 + 20q*2 + 16q + 6. Let b(g) = g*2 + g + 1. Let k(w) = -2b(w) + n(w). Factor k(j). 2(j + 1)3(j + 2) Let x(q) = -q*3 + 12q*2 - 12q + 13. Let i be x(11). Let 25 - 95k + 69k*3 + 29 + 15k*4 - 58k + 15ki = 0. Calculate k. -3, 2/5, 1 Factor 64f*2 + 5 - 15f - 16f4 - 3 - 4f*5 + 79f - 2. -4f(f - 2)(f + 2)3 Let q(r) = -4r*4 - 54r*3 - 171r*2 + 126r + 88. Let b(i) = -2i4 - 27i*3 - 86i*2 + 63i + 43. Let k(l) = 5b(l) - 3q(l). Factor k(y). (y - 1)(y + 7)2(2y + 1) Let d(y) be the third derivative of -2/105y*7 + 0y*4 + 0y*3 + 0y*6 + 0y + 0 + 0y5 - 22y*2. Factor d(h). -4h*4 Factor 0 + 2/13f*4 - 20/13f + 12/13f3 + 6/13f*2. 2f(f - 1)(f + 2)(f + 5)/13 Suppose -66 = -2o - o. Suppose 22g2 + g3 - 48g + og2 + 4g*5 - 5g*3 - 12g*4 + 16 = 0. What is g? -2, 1, 2 Let z be (-60)/39(472/40 - 12). Let 14/13l4 - 6/13l*3 - 14/13l*2 + 10/13l*5 - zl + 0 = 0. What is l? -1, -2/5, 0, 1 Let f(r) = -r*3 + 43r*2 - 153r - 117. Let d be f(39). Factor -3/4w4 + d - 9/2w*3 - 6w - 9w2. -3w*(	{ "pile_set_name": "DM Mathematics" }
ppose -5w - 4p = -2w - 130, 0 = -4w - 5p + 174. Is 13 a factor of w? False Let d = 19 - -93. Does 28 divide d? True Let c(w) = w2 + 11w + 1. Let j be c(-8). Let o be (-4)/(-8) - j/(-2). Let n = 20 + o. Is n a multiple of 9? True Let g = -49 + 133. Let u = g - 39. Suppose 5y - u = -0y. Is 8 a factor of y? False Let i(r) = 10r2 + 3r - 5. Let p be i(5). Suppose -5t - 4q = -p, 2t - q - 101 = -2q. Is t a multiple of 12? True Let t = 84 + -46. Let o = -6 + 29. Let m = t - o. Is 15 a factor of m? True Let z(w) = 4w - 1. Let k be z(4). Suppose -3s + 18 = -k. Is 11 a factor of s? True Suppose 3y - 6y + 2s + 16 = 0, 10 = 5y + 5s. Suppose -yu + 406 = 150. Suppose 0x - 4x + u = 0. Is x a multiple of 6? False Let j(c) = c*2 + 8c - 2. Suppose r - 13 = -0q + q, -22 = q - 4r. Is 5 a factor of j(q)? False Suppose 5w + 343 = -3n + 1322, 2n - 658 = 2w. Does 42 divide n? False Suppose -5u + 2u - 240 = -3p, 160 = 2p - u. Is 13 a factor of p? False Suppose -12z = -6z - 1512. Does 19 divide z? False Let v be -1 + (0 - -991). Let q = 180 - v. Is 35 a factor of q? False Let w(l) = 2l*3 - 3l*2 + 4. Let u be (3 + -2)/((-1)/(-3)). Let g be 2/u(-81)/(-18). Does 11 divide w(g)? False Suppose -17 = 2p - 105. Does 22 divide p? True Suppose 0 = -3t, -3j + t + 329 = -31. Is j a multiple of 30? True Let a = 5 - 0. Let d = 42 - a. Is d a multiple of 10? False Suppose s - 143 = -0s. Does 13 divide s? True Suppose -445 = -5q + h, 3q - h + 6h = 295. Is 30 a factor of q? True Let b be (-115)/(-30) + (-2)/(-12). Suppose bf = -3i + 28, 5i - 10 = -2f + 18. Suppose 28 - 8 = fd. Is d even? False Suppose 3 = i - m, -2i - 4m = -0m - 6. Suppose -62 = -ih - j + 5j, 0 = -3h + 3j + 60. Is 5 a factor of h? False Let l = 145 - 91. Does 18 divide l? True Suppose -5s - 4z + z = -149, 4z = -2s + 54. Suppose k = -1 + s. Does 15 divide k? True Suppose 3a - 1 = 11. Suppose -5 = c, ac + 3 = -2b + c. Let w = b - -2. Does 4 divide w? True Let a(o) = o*3 + 8o*2 + 2o - 7. Is 9 a factor of a(-4)? False Let t be 1544/24 - 4/(-6). Suppose -6y = -y - t. Is 3 a factor of y? False Suppose -26x = -29x + 120. Does 13 divide x? False Let r be (-5 + 1/1)2. Is 7 a factor of 1(1 - 2) - r? True Let v = 91 - 7. Does 28 divide v? True Suppose 3t + k = -26, -4t + 2k - 25 - 3 = 0. Does 11 divide (t - -10) + (-20)/(-1)? True Suppose -5z = q - 48, 0 + 6 = 2z - 4q. Is 6 a factor of z? False Is 1504/20 - 2/10 a multiple of 25? True Let t = 377 - 126. Is t a multiple of 24? False Suppose 53q = 51q + 182. Is 7 a factor of q? True Suppose -2t + 62 + 98 = 0. Is 18 a factor of t? False Suppose -3n + 0 = -s - 1, -s + 5 = 3n. Is 3/n - (-24 - 4) a multiple of 18? False Let k(u) = -2u + 1. Let p be k(-4). Suppose -p - 15 = -3h. Is 4 a factor of h? True Let y(a) = -a*3 + 7a*2 - 4a. Is y(5) a multiple of 3? True Suppose 4q = -0q - 36. Let k be -2 - q - (-2)/(-1). Suppose -3i + 43 = 2i + 2l, 5l - 55 = -ki. Is 7 a factor of i? True Let s(q) = -q2 - 9q - 2. Let x be s(-8). Suppose -40 = -5v + v. Let p = v + x. Does 15 divide p? False Let c = -3 - -2. Let n be -22c/2. Suppose -n = -2j + 26. Is j a multiple of 11? False Let x be (4 - (-14)/(-4))166. Suppose z - m = 95, 0z - z = 2m - x. Does 19 divide z? False Let p = -134 + 233. Does 9 divide p? True Let t(j) = j2 - j + 48. Let i be (-14)/(-4)8/14. Suppose -io = -3z - 5o, 4z - 3o = 0. Is t(z) a multiple of 19? False Let v(n) = 1 - 2n3 + n3 + 0n3. Let f be v(-2). Does 11 divide 178/f + (-2)/(-9)? False Suppose -c - 616 = -4u - 5c, 2u = 3c + 333. Suppose u = 3l + 21. Suppose -3f + l = -11. Is 7 a factor of f? False Suppose -4g + 25 = 9. Suppose 14 = gv - 38. Let s = -8 + v. Does 5 divide s? True Suppose -o = 5a - 5o - 20, 2a - 2o = 10. Suppose x + a - 8 = 0. Is x a multiple of 7? False Let r(i) = 5i + 4i2 + 3 - 2i*2 - i. Does 13 divide r(4)? False Let r(d) = 19d*2 + 2d - 1. Suppose 3z + 17 = 2z - 3y, -4y - 21 = z. Let g be 6/5 + 1/z. Is r(g) a multiple of 7? False Let m = -9 - -13. Let g = m - 0. Is g even? True Let k be 3 + (1 - (5 + -3)). Is 27 - -4 - (-2)/k a multiple of 8? True Suppose 23b - 234 = 22b. Is b a multiple of 49? False Let t = -5 + 9. Suppose 9 = -tr - 15. Is r/30 + 241/5 a multiple of 21? False Let q = -51 + 77. Is q a multiple of 8? False Suppose -3n = 10n - 3497. Is n a multiple of 15? False Suppose 58 = 3n - 98. Suppose -2c = 5s - n, -5c + 9s + 130 = 4s. Is c a multiple of 13? True Let b(n) = 7n + 2. Let m(r) = -13r - 4. Let a(z) = 11b(z) + 6m(z). Does 8 divide a(-10)? True Does 2 divide ((-2)/5 - -1)/((-23)/(-115))? False Let j(r) = 15r*2 - r. Let v be j(-1). Suppose 0 = -2o + 40 + v. Suppose 4z + 3t - 18 = 13, 4t - o = -2z. Does 4 divide z? True Let z be 8/12 + (-25)/(-3). Suppose 0b + z = -3b. Is (b + 4)/(1/6) a multiple of 3? True Let d(s) = s - 1. Let z be d(5). Let a(n) = -n*2 + 7n. Is a(z) a multiple of 6? True Suppose -124 = -5c - 44. Let i = c + -10. Is 3 a factor of i? True Let g be 5 + 0 - (1 + 1). Suppose gj - n - 110 = -3n, -5n - 162 = -4j. Is j a multiple of 19? True Suppose -3o + 0o + 962 = -h, 3h + 326 = o. Is o a multiple of 43? False Let h(q) = -2q3 - 9q*2 + 4q + 4. Is h(-7) a multiple of 13? True Let f = 2 - 0. Let q be 10/4272/20. Suppose -3r + fr = -q. Does 17 divide r? True Suppose -b = 2b - 12. Let m(a) = 2a2 - 5a + 4. Let p be m(b). Suppose -56 = -s - p. Does 20 divide s? True Suppose 162 = 4k - 50. Let x = k + -21. Is (x + 1)/(9/6) a multiple of 11? True Let r(j) = -j2 + 7j - 3. Let f be r(6). Let v(w) = -fw + 4w*2 + w + 5w + w3. Is v(-2) a multiple of 2? True Let p(q) = -q - 15. Does 3 divide p(-18)? True Let m(i) = i3 + 7i2 + 7i + 11. Let q be m(-6). Suppose 2j - 97 = -qo, 7 = -3j - 3o + 130. Is j a multiple of 12? True Let y(c) = c*2 - 4c - 4. Does 5 divide y(7)? False Suppose -h = 3h - 12. Let b(g) = -g3 + 6g*2 - 4g - 1. Is b(h) a multiple of 4? False Let o(z) = -3z. Let x be o(-2). Let m(a) = 2 - 2a*2 + 3a + 2a2 - xa2 + a3. Is m(6) a multiple of 20? True Suppose 0 = -v + 4y - 22, 2v - 3y = 7v + 87. Is v/(0 - (-6)/(-8)) a multiple of 15? False Let b = -4 + -1. Let a(d) = d*3 + 6d*2 + 2d - 1. Is a(b) a multiple of 7? True Suppose p - 146 = 28. Suppose -5k + 3g = -p, 4k - 2g + 43 = 181. Does 20 divide k? False Suppose 0 = 6x - 4x + 5f - 61, -4x = -3f - 57. Let i = x - 10. Is i a multiple of 4? True Let s = 10 - 5. Suppose -357 = -3v + 123. Suppose -so + v = -0o. Is 16 a factor of o? True Suppose -6 = 4v - 22. Suppose 0 = -3o - r + 94 + 238, 5o + 4r = 558. Suppose -vt + o = t. Is 11 a factor of t? True Let g(v) be the third derivative of -2/3v*3 + 0v + 1/6v4 + 1/12v*5 + 0 - 3v*2 - 1/120v*6. Does 13 divide g(3)? True Suppose 4i = -2d - 6, 0i - 37 = -5d + 3i. Suppose dy + 5 = 6y. Is 3 a factor of y? False Suppose 2v = 3v - 29. Is v - (1 + (-1)/(-1)) a multiple of 9? True Let c = -41 + 62. Let s = -1 - c. Is 1 + 1 + -1 - s a multiple of 12? False Let i = -30 + 85. Does 7 divide i? False Let h be ((-5)/3)/((-3)/(-45)). Let k = 62 + h. Is 13 a factor of k? False Let q(s) = -5s - 8. Let f(t) = 2t + 3. Let o(w) = -8f(w) - 3q(w). Let g(i) = -4i. Let c(m) = -2g(m) + 9o(m). Does 3 divide c(-5)? False Suppose -3f + 8 = -2h, 0 = 2h - 4h - 2. Does 2 divide (-9)/(-12)(f - -10)? False Let l be 6/(1/(18/4)). Suppose -l - 18 = 5a. Let w = 24 + a. Does 6 divide w? False Let v = -64 + 95. Let j be (-3)/6 - 13/2. Let y = v - j. Does 19 divide y? True Is (0 - -3)(16 - 2) a multiple of 6? True Let b = 10 + -5. Suppose -25 - 50 = -bn. Is n a multiple of 9? False Let r(i) = i2 + 17i - 1. Let p be r(-8). Let s = p + 164. Does 25 divide s? False Let i = 0 - -8. Does 8 divide i? True Let r(t) be the second derivative of -t4/12 - t3 + 7t2/2 - 3t. Let f be r(-7). Let c(n) = n + 16. Is c(f) a multiple of 8? True Suppose -2w = -21 - 29. Does 10 divide w? False Suppose 3o - o = -10. Let q = 20 - o. Is 9 a factor of q? False Let z = 11 - -8. Suppose 2n - 67 = -z. Is 8 a factor of n? True Let i = 9 + -7. Let k be i/4 - 70/(-4). Suppose -5d + k = -57. Is 15 a fac	{ "pile_set_name": "DM Mathematics" }
(-656)/24)1/8. Let a = -2/3311 - -122579/119196. Let n = -7/9 + a. What is the closest to n in 0.5, h, -1? 0.5 Let d = -0.3 - -0.29. Let g be (10/(-25))/((-871)/335). Let y = 0 - -0.3. What is the nearest to 3 in y, g, d? y Let i = 0.23171 - -0.06829. What is the nearest to 0.3 in i, -0.3, 43, -0.1? i Let a = -945 - -633. Let c = 309.904 + a. Let b = c + 0.096. What is the closest to b in -3/4, -5, 0.3? -3/4 Let s be ((-15)/50)/(2/8). Let b be 5916/(-15) + ((-198)/(-30))/(-11). Let n = b + 1183/3. What is the nearest to -1 in n, 2/11, s? s Let y = 42 + -42.03. Let s = 7 + -12. Let l be (4 + s + 2)/(-5). Which is the nearest to 0? (a) 7 (b) l (c) y c Let i be -66/(-63)7/6. Let b = -0.3 + -0.1. Suppose 8948k - 8946k + 2 = 8. What is the nearest to k in i, b, -2? i Suppose -26d + 36d = 0. Let g be 247/(-38) + (-2 - -8). Which is the nearest to d? (a) -2.2 (b) -0.1 (c) g b Suppose 4d + 4i + 143 = 103, -5i - 47 = 2d. Suppose 3t = -t + 4. Which is the closest to d? (a) -4 (b) t (c) -0.02 c Let d = -147.804 + -0.196. Let n = d + 148. Which is the nearest to -0.2? (a) -1.14 (b) n (c) 5 b Let i = -3637.9 - -3638. What is the nearest to -2/29 in 1/4, 5.1, i? i Let d = -3/2275 - -2284/6825. What is the nearest to -0.1 in -1, 0.1, d, -2? 0.1 Suppose -4y - 5n + 11 = 0, 3y - n + 15 = 3n. Let i = 788 - 788.9. Which is the closest to -0.1? (a) 4 (b) i (c) y b Let y be (57/(-18))/(11/(64911/28)). Let o = y + 667. What is the closest to -2 in o, -3, -9? -3 Let l be 79/(-11) - 74/(-407). What is the nearest to 1 in 4, -10, l? 4 Let z = 22/25 - 2/25. Let q = 2271 - 2272. Which is the closest to q? (a) 0.3 (b) -8 (c) z a Let z = 0.4 + 0.1. Let s = -132 + 127. Let w(o) = -27o - 215. Let t be w(-8). Which is the closest to t? (a) z (b) -5/3 (c) s a Let h = 0.56169 - 4.56169. Let l = -5 + 8. Let v be (-3)/(-14) - 2/(-7). Which is the nearest to 2? (a) v (b) h (c) l c Let w be ((-5)/(-40))/((-1)/6). Let k = 1.6 - 1.785. Let j = -0.085 - k. What is the closest to -7/3 in 1/8, w, j? w Let f = 20132 + -20126. What is the closest to f in 1, -3, -20? 1 Let h be ((-8)/30)/(28 - 5456/198). Let i = -0.3 - -0.4. Let m = 0.1 + i. Which is the closest to m? (a) -0.5 (b) h (c) 2 a Let w(c) = -219c - 2849. Let x be w(-13). Let b = -2 - -6. What is the closest to x in b, -16, -3? -3 Let w = -758 + 767. What is the nearest to -2 in 2/9, w, -0.12? -0.12 Let b be (-1429)/(-8) - (-9 - (-9 - -3)). Let d = b + -182. What is the nearest to 2/3 in -4, d, 0.3? 0.3 Let g = -19.6316 - 3.0984. What is the closest to 0 in g, 1/6, 3, -2? 1/6 Let p = -170 - -174. Let u = 3 + 60. Let o = 59 - u. What is the nearest to 1 in o, p, 0.06? 0.06 Let p = 0.4 - 0. Let j be ((-6)/21 + (-5)/7)5. Let v be (8/32)/(j/15). Which is the closest to 0.4? (a) v (b) p (c) 2/3 b Let k be (-2)/2 + (1 - 1). Suppose -7j + 181 = -85. Suppose -15s = j + 37. What is the closest to -4 in s, k, -0.4? s Suppose k - 2 = 0, -3k - 17 = -4d - 27. What is the nearest to 16/5 in 0.5, 0.6, -0.1, d? 0.6 Let z be -8(-6)/(-20) - -2. Let u = 75 - 93.3. Let j = -18.5 - u. Which is the closest to z? (a) j (b) 0.06 (c) 0.2 a Let f = -8 - -7.9. Let z = -118 + 198. Let n = -80 + z. What is the closest to n in -0.4, -5/2, f? f Let t = 1 - 1.5. Let p = -82/5 - -16. Which is the closest to p? (a) t (b) -1 (c) -11 a Let y = 86.2592 - 0.1092. Let f = -85 + y. Let p = f - 0.65. Which is the closest to 0? (a) 5 (b) p (c) -0.2 c Let q be 5/(-3 + 50/15). Suppose 6w + 3z - 59 = 4w, 0 = 3z - q. Let p = -20 + w. Which is the closest to p? (a) -1/3 (b) -7/5 (c) 4 c Let y be (1625/13)/5(-8)/(-70) + -4. What is the nearest to 2/13 in -2, y, 3? y Let f = -0.2 - -0.6. Let l = f - 0.3. Let g = 0.137 + -0.037. What is the closest to l in -1, g, 2/7? g Let u = -4/11 - -27/44. Let z(y) = y2 - 97y - 2. Let i be z(97). Which is the nearest to i? (a) u (b) 3/2 (c) 22/9 a Suppose -35x + 45x - 40 = 0. Let i = -5189/5 + 1037. What is the closest to 0 in i, 2/13, x, -2? 2/13 Let k be (-88)/(-2) - (0 + 2 + 2). Suppose 0 = 3w + 4m - 18, km = -3w + 44m - 6. Which is the nearest to -4/9? (a) w (b) -0.2 (c) 2/3 b Let w = -0.008 + 272.008. Let c = 276 - w. What is the nearest to 1/4 in c, -3/5, 5? -3/5 Let l = -1/1456 - 2907/7280. What is the closest to 1 in -0.2, 1/3, l, -113? 1/3 Let z = 8.9 + -8.949. Let a = z - -28.549. Let x = a + -29. What is the closest to -8 in -3, 5, x? -3 Let s = -10176 + 10174. Which is the nearest to -1/4? (a) 2/45 (b) s (c) 0.02 c Let g(i) = i2 + 4i - 18. Let s be g(3). Which is the nearest to -5? (a) -0.02 (b) s (c) 1/24 (d) -3 d Let d = -0.059 + 0.259. Let r = 337 - 336. What is the closest to -1/2 in d, r, 2/13, -3? 2/13 Suppose 0m - 2t = 5m - 45, -5m - 3t = -45. Suppose m + 7 = -8w. Let j = 5 - 4.9. Which is the nearest to 1/4? (a) j (b) w (c) -1/5 a Let w(k) = 15k - 118. Let r be w(8). Let i = 0.38 - 0.08. Which is the closest to r? (a) 3/2 (b) i (c) -3 a Let c = 7232 - 7231.9. What is the closest to c in 18, -32, 1? 1 Let p be 90/24 - 3/4. Suppose 3m + m = 4j + 4, 0 = -5j - 3m + p. What is the closest to -0.3 in -5, 2/11, j? j Let a be (14 + 1188)(-1)/6. Let m = a - -202. What is the closest to 0 in 0.3, 1/4, m? 1/4 Let k = -1 - 5. Let a = -3.2 + 5.53. Let b = -1.67 - a. What is the closest to b in k, 4, 5? k Suppose -6x = -9x - 6. Let z be x/(8/(-20)) - 2. Let w be z + -1 + -2 + 2. What is the nearest to w in -0.1, 3, -3? 3 Suppose 0 = 7i + 4 - 32. Let s be 1/(((-17)/51)/(i/66)). What is the closest to s in -2, -5/3, -4/9? -4/9 Let d(h) = 2h + 164. Let u be d(-78). What is the nearest to 3/10 in 0.1, u, -2/5? 0.1 Let p be (-4)/(-6) - 80/(-6). Let k be (-2688)/(-1728) - (-8)/(-9). Which is the closest to k? (a) 0.4 (b) -5 (c) p a Let l = 0.04 + 1.96. Let y = -0.817351 - -0.817351. What is the closest to l in y, -1/2, 0.02? 0.02 Let f = -762.1 + 991. Let b = -229 + f. What is the closest to b in 1.2, 4, 2/13? 2/13 Let x = 839 - 921. Let p = x + 82.075. What is the nearest to -0.2 in -1, p, -0.2, 0.1? -0.2 Suppose -4t = 5g + 15, 397g + 5t = 402g - 30. What is the closest to g in 4/11, -8, -0.1? 4/11 Let q = 2.1105 - 0.1105. What is the nearest to 1 in -4, 1/15, q, 0.9? 0.9 Let q = -3797/15 + 2533/10. Which is the nearest to -1? (a) q (b) -0.2 (c) -0.01 (d) 0.219 b Let j = 1.727 - 1.727. Which is the closest to j? (a) -3 (b) 5 (c) 0.4 c Let v(k) = -157k*2 - 631k. Let x be v(-4). Which is the closest to 2/5? (a) 2/17 (b) x (c) 0 a Let b = -4774.932 - -4775. What is the closest to 0 in 3/8, 5, b, 2/7? b Suppose s + 4f + 1 - 17 = 0, 2s = -f + 11. Let n be (6/(-28))/(s/(-42)3). Let y = 4.1 - 0.1. What is the closest to n in -3/2, y, -3/4? -3/4 Let d = -25 + 23. Let a be -3 - ((-24)/(-20) + -4). Let i = 3.1 + -2.1. What is the closest to d in i, 5, a? a Let w = -5550.032 - -5550. Let y be (-22)/(-8) - (5 + -2). What is the nearest to 0.1 in -0.3, y, w? w Suppose 4v - 14v = 11v - 147. Which is the closest to 1? (a) 0.3 (b) v (c) -1/2 (d) -5/4 a Let c = 44.961 + -45. Let q = c + -0.161. Suppose -4h = -0h, 0 = 2y + 3h. What is the nearest to y in 3, -0.1, q? -0.1 Let y be (-2893)/(-44) + 4/16. Which is the closest to 1? (a) y (b) 2 (c) 5 (d) 3 b Let g(u) = -89u - 717. Let x be g(-8). What is the nearest to -2 in x, -0.202, -9? -0.202 Let p = 39.3 - 39. Let f be (1/(-3))/((-11)/264). Let d be ((-4)/f)/(4 - 0)-2. What is the closest to d in 3, p, -4? p Let d = 6517 + -6512. Which is the closest to -0.15? (a) -1/3 (b) d (c) -0.11 c Let h = 0.087 + 457.913. Let u = h + -462. What is the nearest to -21 in -0.3, 2/5, u? u Let j be (-9)/(108/4134) + -6 + 3/(-6). Which is the nearest to 2? (a) j (b) 0.4 (c) 0 b Let z = 2553.2 - 2557.2. What is the closest to -14 in 1/3, 0.01, 8, z? z Let w = -87.781 + 87.731. Let p = 0.1 + 0. What is the nearest to w in 2/17, p, -4, -2/7? p Let q = -21 + 26. Let h = 307.3 - 309.3. What is the closest to 2 in h, 7/2, q, -0.4? 7/2 Let l = 22517 + -22516.3. Let f = 0.03 - -0.97. Which is the closest to l? (a) 0.1 (b) 5 (c) f c Let q = -15.3292 + -0.0708. Let l = q + 15.7. What is the nearest to 12 in 2/3, -3, -3/7, l? 2/3 Suppose 5j - 30 = 0, -186x + 23 =	{ "pile_set_name": "DM Mathematics" }
-144 + 146. Find z, given that -15z2 + 17z*k - 4z - z*4 + 1 + 4z*3 - 5z*2 + 3 = 0. -1, 1, 2 Let z = 143 - 141. Let s be z/(-13) - 3(-20)/390. Solve 3/4g + s + 9/4g*3 - 3g*2 = 0 for g. 0, 1/3, 1 Let n(h) = -10h*2 - 315h + 325. Let x = 280 - 283. Let k(j) = -5j2 - 157j + 162. Let b(d) = xn(d) + 5k(d). Factor b(m). 5(m - 1)(m + 33) Let o(x) be the third derivative of -2x + 1/480x*6 - 32x*2 + 0x*4 + 1/120x*5 + 0 + 0x3. Factor o(v). v2(v + 2)/4 Suppose -2944i = -3031i + 261. Factor 3p - 15/4pi + 3/4p*4 - 6 + 9/2p*2. 3(p - 2)*3(p + 1)/4 Let t = -612 + 623. Let u be (t - (-5344)/(-504)) + 2/(-18). Factor -8/7o3 + 10/7 + 8/7o + uo4 - 12/7o*2. 2(o - 5)(o - 1)(o + 1)*2/7 Let r = 230 + -221. Let g(z) be the first derivative of -r + 26/3z*4 - 70/27z*6 - 124/45z*5 + 0z - 16/9z2 - 16/27z*3. What is w in g(w) = 0? -2, -2/7, 0, 2/5, 1 Let d(q) be the second derivative of 1/2q*3 + 1/16q*4 + 105q + 0 - 15/8q2. Determine p, given that d(p) = 0. -5, 1 Let v = 23 - 20. Let 74r - 105r2 + 432 - 2r*4 + 379r + 48rv + 369r*2 + 123r + 5r4 = 0. Calculate r. -6, -2 Let u = -643 - -642. Let p be u - ((-161)/45 + 36/45). Let 4/9b*3 - pb + 0 + 2/9b4 - 8/9b*2 = 0. What is b? -2, 0, 2 Let p be 3 + (-220)/209 + 28/532. Factor 4l + 2/3lp + 6. 2(l + 3)*2/3 Let f be (-5)/5186/(-31). Let b(u) be the second derivative of 7/50u5 + 1/15u*f + 0 - 9u + 1/10u4 + 0u*2 + 1/105u*7 + 0u*3. Factor b(y). 2y*2(y + 1)*2(y + 3)/5 Let o(b) be the third derivative of -b6/24 - b5/2 + 35b4/24 + 50b*3 + 323b*2 - b. Let o(g) = 0. Calculate g. -5, -4, 3 Factor 104907 + 561s + 3/4s2. 3(s + 374)*2/4 Let h(b) = 15b*3 + 46b*2 + 47b + 16. Let u(m) = 45m3 + 139m*2 + 143m + 49. Let o = -420 + 416. Let s(d) = ou(d) + 11h(d). Factor s(q). -5(q + 1)2(3q + 4) Let r(g) be the first derivative of -g4 + 136g*3/3 - 342g*2 - 1944g - 1414. Let r(t) = 0. What is t? -2, 9, 27 Let i(s) be the second derivative of -2 + 4/3s2 + 16/9s*3 - 44s + 1/6s5 + 17/18s*4. Factor i(n). 2(n + 1)(n + 2)(5n + 2)/3 Suppose -7616 + 32681 = 15u. Let p = -1669 + u. Determine j so that 0jp + 0j + 1/5j4 + 0 - j3 = 0. 0, 5 Let y(g) be the third derivative of -g5/12 - 25g*4/6 - 95g*3/6 + 152g*2 + 5g. Factor y(l). -5(l + 1)(l + 19) Let s(z) = 7z + 36. Let a be s(-8). Let i be (11/(-55))/(2/a). Factor -ci - c3 + 1 - 48c + 38c + 11c*3. (c - 1)(c + 1)(10c - 1) Let f(k) be the first derivative of k*8/7560 - 11k*6/810 - 2k*5/45 + 5k4/12 - k3 + k + 78. Let v(b) be the third derivative of f(b). Solve v(h) = 0. -3, 1, 5 Let i(z) = 15z3 - 628z*2 - 3884z + 4497. Let b(m) = -m*3 + 42m*2 + 259m - 300. Let x(q) = 93b(q) + 6i(q). Find r, given that x(r) = 0. -6, 1, 51 Let u(q) = -3q2 + 18q - 11. Let d be u(5). Solve -8a3 + 4a + 41a4 + da*5 - 6 - 2 - 49a*4 + 16a*2 = 0. -1, 1, 2 Let w be 62/12 - (23/2 - 7). Factor -2g*2 + wg*3 + 0 + 0g. 2g2(g - 3)/3 Let c(y) be the third derivative of -y7/210 + y6/60 + 56y5/15 - 75y*4/4 + 75y*3/2 - 2y*2 - 5y + 13. Factor c(x). -(x - 15)(x - 1)2(x + 15) Let -930 - 805o3 - 194o - 646o + 160o*3 + 1530o*2 + 10o*4 + 2095o = 0. What is o? -1, 1/2, 3, 62 Let d = 23 - 17. Factor -18s2 - 23s*2 + 46s*2 - ds + s*3. s(s - 1)(s + 6) Suppose 217l - 208l = 4905. Let c = 545 - l. Factor 1/2a*3 + c + 2a*2 - 5/2a. a(a - 1)(a + 5)/2 Let l(k) = -3k2 - 13k + 13. Let p be l(-5). Factor -302a2 + 3a*5 + 104a - 13a4 - 23a*4 + 171a*p + 364a - 216 - 100a2. 3(a - 3)*2(a - 2)*3 Let z be ((-320)/(-160))/((0 - -1)/(11/110)). Let 0 - 1/5w*5 + zw*3 - 2/5w*2 + 2/5w*4 + 0w = 0. Calculate w. -1, 0, 1, 2 Let n(a) = a*2 + a. Let z(r) = -r + 10. Let i be z(9). Suppose 2c - i = c. Let w(y) = -4y. Let f(m) = cw(m) + n(m). Let f(x) = 0. Calculate x. 0, 3 Suppose -4s + 163 = -49. Factor 32 + 6 + sz + 4 + 8z2 + 9z. 2(z + 7)(4z + 3) Let q(j) = -29j*2 + 86j - 53. Let s be q(2). Factor -2/11ds - 4/11 + 0d*2 + 6/11d. -2(d - 1)2(d + 2)/11 Let u = -45911/1200 - -957/25. Let z(v) be the third derivative of -4v2 + 0v*4 + uv*6 + 0v + 0v3 + 0 + 1/24v*5. Factor z(h). 5h*2(h + 1)/2 Find a, given that 2a3 - 78a*2 - 5a*3 + 351a + 11200 - 11470 = 0. -30, 1, 3 Suppose 0 = 5t + 5g - 35, -g - 3 = -5t + 2g. Suppose -36d2 - td*3 - 33d - 1104 + 1104 = 0. Calculate d. -11, -1, 0 Let i be 453663/46683 + (-4)/78. Suppose 1/3u2 - iu + 0 = 0. What is u? 0, 29 Let y = 43068 - 43066. Solve -15/7 - 3/7uy - 18/7u = 0. -5, -1 Suppose 0 = -3z - 2g - 1567, 3z + 3g + 0g + 1566 = 0. Let y = -3660/7 - z. Determine u so that -1/7u*2 + y + 0u = 0. -1, 1 Let f(h) = -1627h - 84. Let r be f(-2). Let l be r/300 - 3/18. Factor -338/5 - li - 2/5i2. -2(i + 13)*2/5 Let b be -38 - 0 - (-14 - -2). Let l = b - -43. Let x(v) = 19v2 + 8v + 3. Let k(u) = -13u2 - 5u - 2. Let p(s) = lk(s) + 5x(s). Factor p(j). (j + 1)(4j + 1) Determine v, given that 816 - 4/3v2 + 2444/3v = 0. -1, 612 Let i(g) be the second derivative of -g*5/40 + 29g*4/8 + 59g*3/4 + 89g*2/4 - 4g + 1. Let i(z) = 0. What is z? -1, 89 Factor -172h2 + 164h + 169h2 + 3471 - 392h. -3(h - 13)(h + 89) Let k(f) = -3f4 + 9f*3 - 43f*2 + 47f - 16. Let j(t) = -7t4 + 16t*3 - 87t*2 + 94t - 31. Let g(i) = -2j(i) + 5k(i). Let g(q) = 0. What is q? 1, 2, 9 Determine o so that -4o - 1/3o*2 - 32/3 = 0. -8, -4 Let j(n) be the third derivative of 2/45n*5 - 161n*2 + 0 + 2/3n*3 - 1/180n*6 + 0n + 11/36n4. Suppose j(c) = 0. What is c? -1, 6 Factor -f4 + f3 - 14f2 - f3 + 138 - 58 - 65 - 16f3 + 16f. -(f - 1)(f + 1)2(f + 15) Let o(j) be the first derivative of 53 - 23/4j4 - j - 3/4j*6 + 17/5j*5 + 4j*3 - 1/4j*2. Determine w, given that o(w) = 0. -2/9, 1 Suppose 27 = -11083w + 11092w. Let t(p) be the first derivative of 2/3p*2 - 1/12p*4 - 4/3p - 5 + 1/9pw. Determine d so that t(d) = 0. -2, 1, 2 Let a(o) = 2o + 6. Let f(i) = i*2 - 271i - 12. Let y(b) = -2a(b) - f(b). Let y(u) = 0. Calculate u. 0, 267 Suppose 0 = -11p - 751 + 795. Let r(u) = -2u. Let z be r(-1). Factor -5n3 - n3 + zn4 + 2n*p - 2n*4 + 6n*2 - 2n. 2n(n - 1)*3 Let x be (32/6)/(((-40)/15)/(-4)). Suppose -u = 3f - 6, -3u + x = 4f + 2u. Factor 4w*2 + 15w*3 - 3w*f - 5w*2 - 6w*2 - 5w*5. -5w*2(w - 1)*2(w + 2) Find c such that -1/5c2 + 39/5c - 224/5 = 0. 7, 32 Let y(o) be the second derivative of -3o5/80 + 3o*4/4 + 8o*3 - 1350o. Suppose y(p) = 0. Calculate p. -4, 0, 16 Let u(v) be the first derivative of 2v3/39 + 804v*2/13 - 248v + 15927. Factor u(j). 2(j - 2)(j + 806)/13 Let m(a) be the third derivative of -a*9/12096 - 5a*8/576 - 17a*7/504 - 31a*5/30 + 170a*2. Let y(q) be the third derivative of m(q). Factor y(u). -5u(u + 1)(u + 34) Determine y, given that -15/2y3 + 15/2y*2 - 5/2y*4 + 55/2y + 15 = 0. -3, -1, 2 Factor y*2 + 1/2y*5 + 163/2y - 82y3 - 41 + 40y4. (y - 1)3(y + 1)(y + 82)/2 Let q(j) be the third derivative of -j6/10 + j5/20 + j4/2 - j3/2 - 1143j2. Factor q(n). -3(n - 1)(n + 1)(4n - 1) Let n(a) be the second derivative of 75a + 3a2 + 0 + 1/15a*6 - 2/3a*4 + 2/3a*3 - 1/5a*5. Factor n(f). 2(f - 3)(f - 1)(f + 1)*2 Let w be 12/(-26) - (-324696)/5395030/9. Factor -wn2 + 28/5n - 2/5. -2(7n - 1)*2/5 Solve 2/5w*5 - 126w + 0 + 1056/5w2 - 44w*3 - 208/5w*4 = 0 for w. -3, 0, 1, 105 Let t be 756/7(-4)/(-6). What is h in 168h3 + t + 32h*5 + 308h*2 - 12h*5 + 108h*5 - 266h*4 - 300h - 118h4 = 0? -1, 1/2, 3/4, 2 Let c = 167 + -165. Find a such that a + 5a*2 + 6a*3 + 9a + 8a2 + 2 + ac = 0. -1, -1/3 Let r(v) be the second derivative of -v7/6300 - v6/90 - v5/3 + v4/12 + 38v*3/3 + 130v. Let g(j) be the third derivative of r(j). Factor g(i). -2(i + 10)2/5 Let n = 434 - 441. Let d be n - (-20 + (-5 - -13)). Factor -24/5b*2 - 6/5 + 6/5b*4 - 21/5b - 6/5b3 + 3/5b*d. 3(b - 2)(b + 1)4/5 Let a(w) = -5w*2 + 18w	{ "pile_set_name": "DM Mathematics" }
69.1. Let j = u + -68.97. Which is the smallest value? (a) -2 (b) -3 (c) 2 (d) j b Let f = 37 - 35. Let a = -1.6 + f. What is the biggest value in a, -0.2, -2/3? a Let x = 878.7 + -879. Let y = -0.3 + 0.1. Which is the third smallest value? (a) x (b) 4 (c) y b Let l = -0.102 - -0.602. What is the third smallest value in l, -2, -4? l Let g be -4 + (-6)/(-15)38/4. What is the third smallest value in 0.18, -0.04, g? 0.18 Let r = 48 + -44. Suppose -55 = -5o - 0q + q, ro - 23 = 5q. What is the biggest value in o, 1, -3/7? o Suppose -5h - 5n = 15, -h - 3n = -n + 4. Let f be -1(-5)/(-23 + h). Which is the second biggest value? (a) 0.2 (b) f (c) -2/5 b Let o = -542.031 + 545. Let w = o + 0.031. Which is the third smallest value? (a) 0.2 (b) w (c) -0.1 (d) -0.13 a Let x = 497/4290 + 5/286. What is the second biggest value in x, 0.3, 0.36? 0.3 Let x = 3 - 17. Let s = x - -10. Let r = -0.7 + 1. What is the third biggest value in s, 0.5, r? s Let l = -61.5 - -61. Let b = -0.06 + 5.06. Let m = 58/91 - 12/13. What is the biggest value in l, m, b? b Let r = 23639/12616 - -2/1577. Which is the smallest value? (a) -2/7 (b) r (c) 5 a Let a = -0.04 - -0.54. Let b = -80 + 77. What is the biggest value in a, b, -2? a Let p = -733.9 + 734. What is the second smallest value in p, -0.5, 8, -1/14? -1/14 Suppose 0 = -z - m + 9, 5m - 33 = -6z + 4z. What is the biggest value in -1, 3, z, 2/17? z Let h(y) = -21y - 443. Let r be h(-17). Which is the second biggest value? (a) 0.4 (b) r (c) 2 (d) 2/7 a Suppose -2 - 6 = -8z. Let g(p) = -9p2 + 2p - 2. Let c be g(z). What is the second biggest value in -4/5, c, 0.3, -3? -4/5 Let r = -1350 + 1351.86. What is the biggest value in r, -1, 2? 2 Let m(w) be the first derivative of 4 + 1/2w2 + 2w - 1/3w3. Let n be m(-2). Which is the second biggest value? (a) -2 (b) n (c) -2/9 a Let q = -0.529 + 0.099. Which is the biggest value? (a) 4 (b) 0 (c) q a Let s(p) = 2p*2 + 2p + 1. Let x be s(2). Let l = -27.2 - -25.2. What is the second smallest value in x, 1, l? 1 Let s = -12 - -8. Let p(t) = 6t - 50. Let y be p(8). What is the third biggest value in y, -1/3, -4/3, s? y Let r = 0.07 - -2.93. Let n = 12.5 - -3.5. Let w = -17 + n. What is the third biggest value in 5, r, w? w Let v = 57/203 - 4/29. Which is the fourth biggest value? (a) v (b) -5 (c) 0.1 (d) 1 b Let g = -6.6 - -6.3. Let z = -0.11 + 0.06. Which is the second biggest value? (a) -1 (b) g (c) z b Let o be 619-23/(-22). Let j = 169 - o. Suppose 37x + 9x = 414. Which is the third biggest value? (a) 0 (b) j (c) x a Let u = 0.4 - 1.4. Let k(x) = 3x + 1. Let q be k(1). Suppose -4o = v + q, -8 - 20 = 4o - 5v. Which is the smallest value? (a) o (b) u (c) 0 a Let l = 2.52 + -2.62. What is the third biggest value in 0.06, l, 9/4? l Let u be (20/(-12))/((-10)/24). Let m = 276/5 + -55. Which is the third smallest value? (a) u (b) m (c) -0.4 a Let a be (1 + 0)/((-172)/(-58) + -3). Let g = 100 - 1702/17. What is the second biggest value in 0, a, g? g Let v = -76 - -57. Let q = v - -14. Which is the second smallest value? (a) -11 (b) q (c) 5 b Let b be (-7763)/3465 - 6/(-3). Let n = b + 1/55. What is the third biggest value in 2, n, 5? n Let q = -0.15 - -0.2. Let z = 49.653 - 0.753. Let a = z - 49. What is the second biggest value in -5, q, a? a Suppose -5h - 1 = -3w, 3h - w - 113 = -112. What is the third smallest value in h, 1/3, 11? 11 Let o be (-46)/14 - (-244)/854. What is the smallest value in o, -12, 1, 0? -12 Let i be 8/((-14)/20 + 4/20). Let h be ((-15)/150)/(i/10). Which is the second smallest value? (a) 5 (b) h (c) 0 b Let t = -74 - -88. Let h = t - 14.06. What is the biggest value in h, 5, 2/21? 5 Let c = -23 + 139/6. Let l be 4/28((-85)/15 + 8). What is the second biggest value in 0.4, l, 0, c? l Suppose -d - 2 + 5 = 0. Suppose j - d - 6 = 0. Let x be 2j/6 - 2. Which is the third biggest value? (a) x (b) 4 (c) 2/3 c Let a = -0.4 + 0.8. Let i = -0.201 + 5.201. Let g = 0.24 + 0.06. What is the third smallest value in g, i, a? i Let f = -4415/8 + 552. Which is the second smallest value? (a) -1/20 (b) f (c) 1/3 (d) -0.1 a Let y = -1/126 + 257/630. Which is the third biggest value? (a) -1/3 (b) 3 (c) -1/8 (d) y c Let l(o) = -4o + 18. Let w be l(4). Let y = 0.2 + 0.1. Let i = 0 + 1. Which is the third smallest value? (a) w (b) i (c) y a Let n be -1 - (12/30)/((-8)/30). Let p = 4/2317 - -836413/13902. Let d = 60 - p. Which is the third biggest value? (a) d (b) -5 (c) n b Let y = 3.758 + 0.242. What is the second smallest value in y, -22/5, 0.3? 0.3 Let r = -0.5389 + 4.4379. Let q = r - -0.101. Which is the third biggest value? (a) 9 (b) -4 (c) q b Let g = -5/3 + 4/3. Let a = 0.11 - 0.12. What is the biggest value in 1/6, a, g? 1/6 Let x = -0.076 - -0.676. Which is the third biggest value? (a) x (b) -1/4 (c) 0.07 (d) -0.4 b Let p = 13 - 8. Suppose -6 + 3 = 3d. Let j = -39 + 37. Which is the biggest value? (a) j (b) p (c) d b Let o be 1 - (-3)/(12/20). Let v = o + -20/3. Suppose -y = -3l - 1, 3l - 3y - 7 + 10 = 0. Which is the biggest value? (a) l (b) -4 (c) v a Let r = -1.007 - -0.007. Let q = -1.7 - -2. Suppose -5t = 3s, -5t - s = -2t. Which is the third smallest value? (a) q (b) t (c) r a Let r(m) = -3m - 4. Let j be r(2). Let v = j + 13. Let p = 68 + -209/3. What is the smallest value in p, -1, v? p Let x = 57 - 56. Let t(r) = -r - 13. Let d be t(-10). What is the fourth smallest value in x, d, 2, -0.5? 2 Let b(q) = -q - 1. Let p be b(5). Let g be p/(-9) - 16/15. Let j be 42/104 + 7/(-28). What is the second biggest value in j, g, 2? j Let z = -21/17 + 25/34. Let t be 14/(-6) - 2/3. Let l = -2 - t. Which is the second smallest value? (a) 4 (b) z (c) l c Let u be ((-2)/(-10))/(3 + 120/(-18)). Let v = u + -6/11. Which is the fourth biggest value? (a) -4 (b) -5 (c) v (d) -1 b Let p = -3.24 + 2.25. Let k = p - -2.09. Which is the smallest value? (a) 0.1 (b) 1/5 (c) k a Let h(k) = k*2 - 2k - 4. Let s be h(3). Let d be (-7)/(-14)s/(-2). Let t be (-9)/14(-4)/(-6). Which is the third smallest value? (a) t (b) d (c) 0.1 b Let j(m) = m*2 + 6m + 7. Suppose -2i - 2i = 24. Let t be j(i). Suppose -tg + 3g - 16 = 0. What is the biggest value in 5, g, 3? 5 Let m = 1562 + -1564. Which is the second smallest value? (a) m (b) 2/27 (c) -6 a Let x = -47 + 49.3. Let i = -2 + x. Let t = 0.03 + -3.03. What is the smallest value in i, t, 1? t Let v = 0.35 - -0.05. What is the biggest value in v, -0.17, 0.3, 0.06? v Let s = -96/11 - -94/11. What is the fourth biggest value in 2, 6, s, -5? -5 Let m = 33 - 73. Let x = m - -39. Let n = 0 + -0.05. Which is the second biggest value? (a) 5 (b) x (c) n c Let u = 2/37 - -68/111. What is the smallest value in u, 2/13, 0.005, -3? -3 Let r be (-3 - (4 - 3))1 + 0. What is the biggest value in r, -0.02, 0.5? 0.5 Let k = -6 + 6.1. Let s = 1652 - 1656. Which is the biggest value? (a) s (b) -1/20 (c) -2/3 (d) k d Suppose 5o = -0o + 50. Let v = 1.312 + -1.412. Which is the biggest value? (a) v (b) -4 (c) o c Let u = 8 + -5. Suppose u = -3i - 9. Let m = -4 + 9. What is the smallest value in i, -0.3, m? i Let w = 784.7 - 783. Let s be (-120)/(-16)(-2)/6. What is the third biggest value in w, s, 1/3? s Let t = -1577.96 + 1578. Suppose 0 = 3d + 3 + 6. What is the fourth biggest value in t, d, 1, -4? -4 Let p = 1 + 3. Let v = 4351/7 - 5266/7. Let s = 131 + v. Which is the smallest value? (a) 7 (b) p (c) s c Let r = -1.7 - -2. Suppose -m - 20 = -3z, -4z - 311m + 35 = -314m. Which is the third biggest value? (a) -5 (b) z (c) r a Let m be (-4 + 7)1/3. Let v be -1((-2)/4 - m). Let j = -0.14 - 0.36. What is the third smallest value in j, -2/5, v? v Let m be ((-2)/6)/(5/15). Let d be 8/(-2) - (-252)/70. What is the fourth biggest value in m, 5, d, -3/5? m Suppose 0 = 14z + 17 - 59. Let o be ((-4)/4)/(z/(-15)). Let j = -67/3 - -23. Which is the third biggest value? (a) j (b) 4 (c) o a Let g = 8.9 - 9. Let j = -0.1 - g. Let x = j - -3. What is the third biggest value in -0.3, x, 2/19? -0.3 Let s be (-31)/((-1209)/(-26))(-6)/(-16). What is the second biggest value in s, 16, -23? s Let s = -4.6 - 0	{ "pile_set_name": "DM Mathematics" }
l + 18 = 0. Suppose -d - l = 2q - 3q, 3q - d = 14. Suppose 3p + qi + 82 = 6p, -4i + 8 = 0. What are the prime factors of p? 2, 3, 5 Let y = 227 + -162. What are the prime factors of y? 5, 13 What are the prime factors of (3/1)/((-282)/(-151058))? 1607 Suppose 0 = 4k + c - 3526, k + c - 872 = -4c. List the prime factors of k. 2, 3, 7 Suppose -71 = -4k + 37. Let s = 24 + k. Suppose -s = 2u - 5u. What are the prime factors of u? 17 Suppose 2z + 446 = 5c, 0 = 2c - 7c - 10. Let i = z + 319. List the prime factors of i. 7, 13 List the prime factors of 3/(-33) + 25830/22. 2, 587 Let x(l) = -2 + 9 - 3l + 2l. Suppose 18 + 2 = -4y. List the prime factors of x(y). 2, 3 Suppose -328 = 18r - 1462. What are the prime factors of r? 3, 7 Let d = -12 + 14. Suppose dm - 2 = -4s, -17 = 3m - s - 48. List the prime factors of m. 3 Let v be (-2 - (-72 + -3)) + 0. What are the prime factors of v/6 - 14/84? 2, 3 Suppose -v + 23 = 3l, 0 = -5l - v + 16 + 21. Suppose 0 = h - l - 37. List the prime factors of h. 2, 11 Let d(z) = -115z + 122. List the prime factors of d(-8). 2, 521 Let l be (1 + 0 + -1)/(-4) - -4. Suppose -3g = 3d + 2d + 10032, -5g = 5d + 10030. What are the prime factors of d/(-33) + l/22? 61 Let y be ((-501)/9 - 3)/((-3)/18). Suppose -5c = m - 128, 3m + c - y = 2c. List the prime factors of m. 2, 59 Let d = -13 + 7. Suppose -2y + y + 39 = 2g, -5y + 217 = -g. Let s = d + y. What are the prime factors of s? 37 Let t = 624 - 349. Suppose -2j - t = -7j. What are the prime factors of j? 5, 11 Let n = 102 + -3. What are the prime factors of n? 3, 11 Suppose 0 = 5k + 106 + 49. Let o(w) = -w3 - 27w*2 - w + 41. Let h be o(-27). Let y = h + k. List the prime factors of y. 37 Let b = -32 + 35. Suppose 0 = bj + 4j - 1484. Suppose u = -3u + j. What are the prime factors of u? 53 Let i(s) = -2s - 8. Let t be i(-5). Suppose tp - 233 = -27. What are the prime factors of p? 103 Suppose -5u + 55 = 5n, 4n - 17 = 2n + 3u. Suppose 4f + n = -0p - p, -f + 2p = 7. What are the prime factors of (-58)/f - (-1)/(-3)? 19 Let f be 4/8-1(0 - 4). List the prime factors of ((-68)/12 - f/(-3))-16. 2, 5 Suppose -2y - 2111 + 5229 = -2f, 3f + 3123 = 2y. List the prime factors of y. 2, 3, 7, 37 Let p = -1382 - -1551. List the prime factors of p. 13 Let u(q) be the second derivative of 19q4/8 - q3/6 - 4q2 + 12q. Let a(v) be the first derivative of u(v). List the prime factors of a(1). 2, 7 Let d(x) = -8x3 - 5x*2 + 55x + 9. List the prime factors of d(-8). 3, 5, 223 Suppose -2a + 35 = 3w, -60 + 9 = -3a - 5w. Let h = a + 20. List the prime factors of h. 2, 3, 7 Let m = 225 - 134. Suppose s - m = -30. Let g = -36 + s. List the prime factors of g. 5 Let r = 1 + 3. Let g = -152 + 155. Suppose 4b + 70 = gx, 4x = rb + 37 + 63. What are the prime factors of x? 2, 3, 5 Suppose -270 = -o - 2c, -2c = -2o + 4o - 544. List the prime factors of o. 2, 137 Let h(z) = 8z2 - 18z - 91. List the prime factors of h(12). 5, 13 Let d = 865 - -535. What are the prime factors of d? 2, 5, 7 Let a = 3223 - 2225. List the prime factors of a. 2, 499 Let d(m) = -m*3 - 22m*2 - 20m + 17. Let k be d(-21). What are the prime factors of k/(-14) - (-47)/7? 7 Let t = -705 + 1150. What are the prime factors of t? 5, 89 What are the prime factors of (2 - 1217)/(0 + (-15)/10)? 2, 3, 5 Suppose -k = -5n + 28 + 1, 3k = -2n - 2. Suppose 554 = 5j - nc - 6, -2j + 3c + 226 = 0. What are the prime factors of j? 2, 5, 11 Suppose 4z + 6n + 1092 = 10n, 5z = 2n - 1368. Let f = z - -560. What are the prime factors of f? 2, 11, 13 Let t be 4((5 - 2) + -2). Suppose -i + 10 = -5k - 10, -5i + 37 = -tk. Suppose is = 7s - 46. What are the prime factors of s? 23 Suppose -21t + 17t = 5d - 12753, 0 = -2t + 2d + 6390. What are the prime factors of t? 2, 3, 7, 19 Let c(h) = 4h + 5. Let d(o) = -7o - 11. Let j(t) = -9c(t) - 4d(t). List the prime factors of j(-2). 3, 5 Let r = 380 + 164. Let g = r - 372. What are the prime factors of g? 2, 43 Suppose 3n + 11 + 15 = 2i, 16 = 4i. Let h(w) be the second derivative of -2w3/3 + 13w*2/2 + 22w - 1. What are the prime factors of h(n)? 37 Let d(w) = 3w + 16. What are the prime factors of d(9)? 43 Let i(s) = s + 15. Let l be i(-12). Let a be (-1)/1 + 7 + 2. Suppose a = -2c + lc. List the prime factors of c. 2 Suppose 0 = 3q - 6, 5q = r + q - 645. List the prime factors of r. 653 Suppose -4q - q + 750 = 0. What are the prime factors of q? 2, 3, 5 Let v = 142 + 236. What are the prime factors of v? 2, 3, 7 Let z(a) = 6a2 + 3a - 1. Let h be z(1). Suppose 4v - 72 = -hv. What are the prime factors of v? 2, 3 Let n be (-1)/((-2)/10) + -3 + -124. Let x = n - -212. List the prime factors of x. 2, 3, 5 Suppose -3x - 150 = -4x. Let m = x + -89. Let a = 1 + m. What are the prime factors of a? 2, 31 Let f = -5 + 5. Suppose -4c - s - 21 = f, -4c - 19 = 3s + 4. Let z = c + 22. What are the prime factors of z? 17 Suppose t = 2q + 5, 2q + 0q + t - 5 = 0. Suppose -8a + 5a + 6 = q. List the prime factors of -6(a - 84/9). 2, 11 Suppose -524x + 539x - 55200 = 0. What are the prime factors of x? 2, 5, 23 Let l = -1393 + 1939. List the prime factors of l. 2, 3, 7, 13 Let y be (-10)/(-4)36/3011. What are the prime factors of (-10150)/(-77) + 6/y? 2, 3, 11 Suppose -p + 0p = 2j - 8, -2j - 3p = 0. Let t = -3 + j. Suppose -3s + 39 = tz - 27, -s = 5z - 6. List the prime factors of s. 2, 13 Let w be -4((-6)/(-27) - (-210)/27). Let y = 137 + w. What are the prime factors of y? 3, 5, 7 Let r = 226 + -100. Suppose -4c + c + r = 0. What are the prime factors of c? 2, 3, 7 Let r(a) = -5a - 2. Let b(w) = -1. Let h(m) = -2b(m) + r(m). Let s be h(-1). Suppose -sy + 83 = 3. List the prime factors of y. 2 Let v(c) = -2c - 10. Let w(x) = 5x + 20. Suppose 5l + 9 = 2l. Let j(u) = lw(u) - 7v(u). What are the prime factors of j(7)? 3 Let u = -159 + 280. What are the prime factors of u? 11 Let c(r) be the second derivative of -r4/12 + 17r*3/6 - 3r*2 + 2r. What are the prime factors of c(7)? 2 Suppose 0 = 6b + 6 - 12. List the prime factors of 6184/40 - b/(15/9). 2, 7, 11 Suppose 5x - 5f - 137 = 1253, 3f - 1147 = -4x. What are the prime factors of x? 283 Let m(o) = 2o*2 - 12o - 3. Let t be m(10). Let z = t - 120. Let x = z - -79. What are the prime factors of x? 2, 3 Let d = -295 + 423. What are the prime factors of d? 2 Let s(k) = 9k + 8. Let v(f) = 13f + 12. Let q(x) = -8s(x) + 5v(x). Let y be q(-4). Let c = y + -13. What are the prime factors of c? 11 What are the prime factors of -6 + -5073(-3)/9? 5, 337 Suppose 1 = -2k + 9. Suppose 0 = -ki + 5n + 12, i + 4n = -0n - 18. What are the prime factors of (-4 - i)/(-4)90? 3, 5 Suppose -2w + 13j = 8j - 1557, -4j - 1558 = -2w. List the prime factors of w. 11, 71 Suppose -3i - 2q = 2 + 3, -3i + q = -7. What are the prime factors of (-27)/(8/(-5 + i) + 1)? 3 Let r(d) = 2d*2 - 12d - 1. Suppose 2b + 2b + 24 = -4g, 5b - 5g - 10 = 0. Let t(c) = c2 - c + 1. Let s be t(b). What are the prime factors of r(s)? 13 Let p be (-5)/5 + -1 + 10 + -2. Suppose -14d = -pd - 952. What are the prime factors of d? 7, 17 Let b be -4 - 11/((-22)/6). Let j(a) be the second derivative of -7a5/10 + a2/2 - a. What are the prime factors of j(b)? 3, 5 List the prime factors of ((-130)/104)/((-1)/428). 5, 107 Suppose -2o = -o - 5. Let b(k) = k2 - 3k + 2. Let t be b(o). Let s = t + -10. What are the prime factors of s? 2 Suppose 25 = h - 23. Let k = h - 22. List the prime factors of k. 2, 13 List the prime factors of -1-1(-3 - -362). 359 Suppose t - 1582 = -16o + 12o, -5o = 4t - 6306. What are the prime factors of t? 2, 787 What are the prime factors of (-56 - -5)(-6)/(108/1770)? 5, 17, 59 Suppose 0 = -4k + 38 + 10. Let g = -136 + 126. Let o = g + k. What are the prime factors of o? 2 Suppose -17707 = -5z + 2668. List the prime factors of z. 5, 163 Suppose 0 = 4j - 8, -4k + 3j + 6 = -2j. What are the prime factors of k? 2 Let h = 31 - 14. Suppose -h = -4k + 3w - 4, -14 = -4k + 2w. Let x(r) = r3 - 4r*2 + 2r + 6. What are the prime factors of x(k)? 2, 7 List the prime factors of ((-28)/(-4)	{ "pile_set_name": "DM Mathematics" }
6)/4(0 - 2)1. Suppose 3w = 2b + b - 12, -db + 27 = 2w. What is the remainder when 17 is divided by b? 3 Suppose 0 = 29d + 28343 - 99741. What is the remainder when d is divided by 112? 110 Let y(g) = -g3 - 7g*2 + 17g - 3. Calculate the remainder when 137/5 + (-4)/10 is divided by y(-9). 3 Suppose -2f + 7f = 3d - 783, -d = 3f - 275. Calculate the remainder when d is divided by 27. 23 Let w(n) = 2n2 - 2n + 2. Let t(u) = -u. Let s be t(-3). What is the remainder when ((-4)/6)/(8/6)-106 is divided by w(s)? 11 Suppose -3b - 30 = -8b. Suppose 6 = -4a + 4d - b, -5d + 17 = -4a. Calculate the remainder when 2 is divided by a. 0 Suppose 5k + 4g - 101 = 50, -2k + 3g = -42. What is the remainder when 158 is divided by k? 23 Let l = -31 + 77. What is the remainder when l is divided by 8? 6 Suppose 0r + 6r = 0. Suppose -2m + 59 + 21 = r. What is the remainder when m is divided by 7? 5 Suppose 3k + d - 49 = 6, -4d + 94 = 5k. Let q = 1112 - 1082. Calculate the remainder when q is divided by k. 12 Suppose 16i = 14i - 3v + 24, 0 = -i + v + 7. What is the remainder when 61 is divided by i? 7 Let n(z) = -z*2 + 9z - 6. Let r be n(8). Suppose 5s = rk + 38, 5s + 3k = s + 35. Calculate the remainder when (-1)/(-3)(66 + 21) is divided by s. 5 Suppose 0 = 2a - 41 + 9. Suppose -180 = -n - 3n. What is the remainder when n is divided by a? 13 Suppose 2j = -2l + 10, 0 = 3l - 0j - 5j + 25. Suppose 3a + 2a - 245 = l. Suppose h - 12 = 5. Calculate the remainder when a is divided by h. 15 Let r(x) = -x*3 - 3x*2 - 12x - 85. Calculate the remainder when 33 is divided by r(-5). 8 Let t = 8 + -5. Let z(y) = -5y2 - 73y + 32. Calculate the remainder when t is divided by z(-15). 1 Suppose -4c + 158 = 2y, y = -4c + 3y + 146. What is the remainder when 911 is divided by c? 37 Let p be (2 + -4)(-3)/2. Let l(n) = -n + 12. Let r be l(6). Suppose -r = -pw + 9. Calculate the remainder when 12 is divided by w. 2 Suppose -211 = n + 4f - 62, -4n + f - 511 = 0. Calculate the remainder when 52 is divided by n/(-12) + (-3)/(-12). 8 Let b = -29 + 28. Calculate the remainder when (4/14)/(b/(-49)) is divided by 5. 4 Calculate the remainder when 14570/93 + (-2)/(-6) is divided by 23. 19 Suppose -5c - d + 22 = -0c, -11 = -c + 2d. Let p(j) = 12j + 1 - 16j - c + 9j. Calculate the remainder when p(4) is divided by 5. 1 Let c be -3(-2)/6-2. Let j(d) = 13d + 45. Let h(l) = -3l - 11. Let r(x) = cj(x) - 9h(x). What is the remainder when r(8) is divided by 10? 7 Suppose 2j - 6j + 196 = 4i, -j - 176 = -4i. Let s(c) = 3c2 + 8c + 6. Let u be s(-5). Let f = u - 25. Calculate the remainder when i is divided by f. 13 Let p be (-816)/9 - 3/(18/(-4)). Let c = p - -126. What is the remainder when 70 is divided by c? 34 Let d = -78 + 8. Suppose -87 + 8 = -5s - m, 2s - m - 33 = 0. Calculate the remainder when -6(4 - d/(-6)) is divided by s. 14 Let a(r) = -4r + 6. Let x be (-2 - 1) + ((-2)/(-1) - 5). What is the remainder when 117 is divided by a(x)? 27 Suppose -2b + 2n = -3b + 624, 0 = -b + 2n + 604. Calculate the remainder when b is divided by 26. 16 Suppose -1 = -2x - 3r + 4r, -x + 23 = 4r. Let t(u) be the first derivative of u*2 - 4u - 1. Calculate the remainder when t(4) is divided by x. 1 Suppose 0p = -3p + 4m + 189, 0 = -2p - 4m + 106. Calculate the remainder when 707 is divided by p. 58 Suppose 0z + 2z + 48 = 4h, -z = 4h - 48. Let m = -1 + 24. What is the remainder when m is divided by h? 11 Let h = 1460 + -1433. What is the remainder when 126 is divided by h? 18 Let x(r) = r3 - 5r*2 - 84r + 24. What is the remainder when 285 is divided by x(12)? 21 Suppose 0 = 5g + 2b - 14, -2g - b - 4b = 7. Suppose -j - 3y - g = y, -3y = 4j - 23. Calculate the remainder when 47 is divided by j. 7 Suppose 4 = -6x + 2x. Calculate the remainder when 39 is divided by (-4 - 1/x) + 23. 19 What is the remainder when 332 is divided by 20((-42)/(-5) - (-14 + 20))? 44 Calculate the remainder when 133-1(2 - 10 - -7) is divided by 17. 14 Suppose -4c = -4y - y + 138, 5c + 105 = 4y. Let d(a) = -a*3 + 12. Let r be d(0). What is the remainder when y is divided by (-1 - -3)66/r? 8 Let r(f) = 2f + 5. Let j be r(0). Suppose jo + 61 + 4 = 0. Let n = -5 - o. What is the remainder when 30 is divided by n? 6 Let u(c) = c*3 - 9 + 14c + 3c2 - 2 - 6 - 14c*2. Let n = 14 + -8. Calculate the remainder when u(10) is divided by n. 5 Suppose 4h = -0h + 20. Suppose 7 = i - 0i + 2g, 4g - 4 = 0. Suppose -16 = ia - 9a. What is the remainder when h is divided by a? 1 Let q = 519 - 384. Calculate the remainder when q is divided by 68. 67 Suppose 0 = -4k - k + 65. Let u(s) = -s2 + 12s + 14. Let l be u(k). Suppose 4n + l = 37. Calculate the remainder when 33 is divided by n. 6 Let i = -1488 - -1506. Suppose 5b = -45 + 205. What is the remainder when b is divided by i? 14 Let k(h) = 3h - 4h - 2h - 3. What is the remainder when k(-5) is divided by 18/(-39) + (-194)/(-26)? 5 Let i(a) = 4a + 258. Calculate the remainder when i(-45) is divided by 49. 29 Let w(s) = -15s2 + 108s + 3. Calculate the remainder when 1846 is divided by w(7). 22 Let s(c) = 2c2 - 6c + 2. Let l be 0/((-4)/(-4) + (0 - 2)). Suppose l = -10r + r + 162. Calculate the remainder when r is divided by s(4). 8 Suppose -364 = -64k + 148. What is the remainder when 694 is divided by k? 6 Suppose 525 = 31i - 6i. Calculate the remainder when 314 is divided by i. 20 Let z(r) = r*2 - 7r + 25. Calculate the remainder when 52 is divided by z(5). 7 Suppose 0 = 4t, -2v - 3t + 7t + 14 = 0. Calculate the remainder when 34 + -3 + 2 + 1 is divided by v. 6 Suppose -4c - 5o = -312, 0 = 15o - 18o. Calculate the remainder when c is divided by 56. 22 Let b = 143 + -58. Let s = b - 20. Calculate the remainder when s is divided by 11. 10 Let z(h) = -h*3 + 25h*2 - 18h - 102. Calculate the remainder when z(24) is divided by 25. 17 Let i(l) = 4l2 - 47l + 44. Calculate the remainder when i(18) is divided by 71. 68 Suppose 7p = 6p + 147. Let c = 158 - p. Calculate the remainder when 41 is divided by c. 8 Let s(i) = -7i + 87. What is the remainder when 213 is divided by s(9)? 21 What is the remainder when 205 is divided by (4 - 39/15)30? 37 Suppose 3b - 141 = -4d, 83 = -b + 3b - d. Calculate the remainder when 944 is divided by b. 41 Let n = 882 + -863. What is the remainder when 394 is divided by n? 14 Let k(i) = i2 - 5i - 112. Calculate the remainder when 134 is divided by k(-10). 20 Let a be 0/(-2) - (-2 - 2). Suppose -ao + 22 = -2o. What is the remainder when 17 is divided by o? 6 Let t(g) = -7g3 - 5g*2 - 7g + 3. Let p = 10 + 8. What is the remainder when t(-2) is divided by p? 17 Let u = 631 + -528. Calculate the remainder when u is divided by 49. 5 Let j(s) = 35s + 195. Calculate the remainder when 157 is divided by j(-5). 17 Let h = -102 + 149. Let o = 7630 - 7611. What is the remainder when h is divided by o? 9 Calculate the remainder when 284 + -2 - -75/(-5) is divided by 26. 15 Let w(r) = 23r3 + 2r*2 - r. Let a be 15/(-25) - 138/(-5). Suppose 0 = 5u - 43 - a. Calculate the remainder when w(1) is divided by u. 10 Suppose 5i + v = 163, 5i = -0v + v + 167. What is the remainder when ((-4)/6 + (-663)/(-117))13 is divided by i? 32 Let u = 13 - 9. Suppose -5m - 3n = -23, 0 = -um - n + 17. Suppose 38 = mt - 14. Calculate the remainder when 37 is divided by t. 11 Suppose 0 = -4o - 4a + 208, 3o - 131a + 130a - 168 = 0. Calculate the remainder when 1207 is divided by o. 52 Calculate the remainder when 50 is divided by (-4)/((-6)/57 - (-170)/(-1995)). 8 Calculate the remainder when 215 is divided by (-436)/(-6) + 14/(-21). 71 Suppose -4a + 37 = -63. Suppose -9f + 135 = 6f. Calculate the remainder when a is divided by f. 7 Let p be -1 + 2 - (-1)/1. Suppose 5t + 17 = pb, 5t - 3t = -2. What is the remainder when 29 is divided by b? 5 Let w(q) = q*3 + 30q*2 - 6q - 58. What is the remainder when w(-30) is divided by 58? 6 Let g(j) = -j*2 - 5j + 3. Let k be g(-9). Let n = 37 + k. Calculate the remainder when 17 is divided by n. 1 Let w be (-1)/(0/(-3) + 1). Calculate the remainder when 0 - 3 -	{ "pile_set_name": "DM Mathematics" }
ose -y = -r - 4r. Suppose 4h = -2k + 1 + r, 5h - 15 = 0. What is the highest common factor of 12 and k? 4 Let p = 18 + -16. Calculate the greatest common factor of p and 4. 2 Suppose 20 = -0m + 4m - 4d, -2m = 5d - 38. Suppose -4r + 106 = 5b, 3b - r + 94 = 8b. Calculate the greatest common factor of m and b. 9 Suppose -4d - 30 = 2v - 0v, -d = -4v - 15. Let g(m) = -3m + 1. Let l be g(v). What is the greatest common divisor of l and 2? 2 Suppose 117 = l + 47. Let q be (28/16)/(1/16). What is the greatest common factor of q and l? 14 Suppose -g + 4g = 0. Suppose g = -t + 4. Suppose n = 4n - 96. What is the highest common divisor of t and n? 4 Let i(h) = h - 3h + 1 + 2h*2 + 3h - 6. Let w be i(3). Calculate the highest common divisor of 4 and w. 4 Let d be -1 - ((2 - 1) + -270). Let h = -160 + d. Let w be -3 - 489/(-33) - 2/(-11). What is the greatest common factor of w and h? 12 Let l(h) = h*3 - 3h*2 + 3h - 3. Suppose 6 = -5n + 16. Let m be l(n). Let b be m - (-17 - -12). What is the greatest common factor of 126 and b? 14 Suppose 12 = 3n - 45. What is the highest common divisor of 209 and n? 19 Let r = 122 - 82. Let z = -16 + r. Let j be 12 + (-4)/4 - 3. What is the greatest common divisor of j and z? 8 Let o = -14 - -44. Suppose 3p = 9 + 21. What is the highest common factor of p and o? 10 Let i(r) = -r*2 - 4r - 3. Let k be i(-4). Let y be (1 + 104)(-1)/k. Calculate the highest common factor of 7 and y. 7 Let k(z) = z3 + 14z*2 - 4z - 4. Let b be k(-14). Calculate the greatest common divisor of b and 4. 4 Let i be (-6)/21 + 23/7. Let f be 14(i + 0)/3. What is the greatest common factor of f and 112? 14 Let k be (-4 - (-48)/9)9. What is the highest common divisor of 8 and k? 4 Suppose 172 = 5c - 4y, -2y - 2 = 2c - 78. Suppose 3h + 8 = 5h. Calculate the greatest common factor of h and c. 4 Suppose 2c - 42 - 48 = 0. What is the greatest common divisor of 15 and c? 15 Let g = -47 - -91. What is the highest common factor of 11 and g? 11 Let c(d) = -8d*2 - 4d + 6. Let q be c(5). Let v = q - -319. Let s = v + -35. What is the highest common factor of 28 and s? 14 Let a be 16 + -13 + (-7)/(-1). What is the highest common divisor of a and 6? 2 Let q(p) = 12p + 6. Let t be q(-4). Suppose -36 - 23 = -y. Let i = y + t. Calculate the highest common divisor of i and 34. 17 Let r(k) = 2k*2 + 4k - 12. Let u be r(-5). What is the highest common divisor of u and 9? 9 Suppose -5b + 15 = -165. Let d(n) = -n2 - 10n + 3. Let g be d(-6). Let l be 6/g - (-428)/18. What is the highest common factor of b and l? 12 Suppose -44 = -2f + 10. What is the greatest common divisor of 18 and f? 9 Suppose 8 = -2r - 3p - 0, 3r - 3p - 3 = 0. Let y = 19 - r. What is the greatest common factor of y and 20? 20 Let m(q) = q2 + 6q - 10. Let t = -68 + 95. Suppose 0 = o - 4o - t. Let v be m(o). Calculate the highest common divisor of v and 119. 17 Suppose -2r = 4r - 126. Calculate the highest common divisor of 252 and r. 21 Suppose 0 = 4s - 2w - 14, -2s = s + 2w. Suppose -sx = -2i + 3i + 15, i + 5 = 3x. Let z = 23 + i. What is the highest common divisor of 12 and z? 12 Suppose 4f - z = 572, -15 = -4z + 1. Suppose -x + 3x - f = 0. Suppose -3h + 0r = 3r - 30, 0 = -5r + 10. What is the highest common divisor of h and x? 8 Let q = 23 + -5. Suppose p - 1 = -0p. Let g be 6/(3 - p) - 1. Calculate the greatest common factor of g and q. 2 Suppose 2m - 4w = 56, 0 = 4m - m - 5w - 86. Calculate the greatest common divisor of m and 256. 32 Suppose 6q = 3q + 2y + 94, 2q - 3y = 66. Calculate the highest common divisor of 40 and q. 10 Let m(k) = -k*3 + 3k*2 - 4k. Let i be m(3). Let o be (-40)/(23/i). What is the highest common divisor of o and 16? 16 Let m be (-6)/9-91. Calculate the highest common divisor of m and 12. 6 Suppose 8n - 4n = 48. Calculate the greatest common divisor of n and 30. 6 Let o(f) = f2 + 8f - 1. Let d be 1-3(-6)/(-2). Let c be o(d). What is the greatest common divisor of c and 24? 8 Suppose 3j + 48 = 7j. Calculate the greatest common divisor of j and 108. 12 Suppose -2 = -b + 2b. Suppose -w = -x + 3, -w + 0x - 18 = -4x. Let l be 8 - (b + 3 - w). What is the greatest common factor of l and 1? 1 Suppose -5f - 5j = -25, -7 = -4f - 5j + 17. Let g(s) = 4s*2 + 3 - 4s + s*2 - 4s*2. Let n be g(4). What is the greatest common factor of f and n? 1 Let x(o) = -8o + 11. Let k be x(-10). Let q be (26/8)/((-1)/(-4)). What is the greatest common divisor of q and k? 13 Let u = -5 + 8. Suppose -4o - 54 = -9o - 3l, uo - 28 = -4l. Suppose o = 5z - z. What is the greatest common factor of 21 and z? 3 Let h(s) = 3s - 13. Let v be h(8). Calculate the greatest common factor of v and 2. 1 Let m = 51 - 9. Calculate the highest common divisor of 56 and m. 14 Suppose 2n = 7n. Suppose n = -3v - 2w + 129, 0w + 3w = -v + 50. Let y = -22 + v. What is the highest common factor of y and 19? 19 Suppose -5a + 340 = 4b, -5b + 2a = -420 - 38. Calculate the greatest common factor of b and 60. 30 Let x be 3 - (0 + 1 - 31). Calculate the greatest common factor of x and 3. 3 Suppose 0 = -6w + 11w - 20. Suppose -2l + x + 6 = 0, 3l - wx - 4 + 5 = 0. What is the greatest common divisor of l and 5? 5 Let t(o) = o*2 + 3o + 1. Let q be t(-2). Let y be (q - (-3)/9)-6. Let m = -1 + 5. Calculate the greatest common divisor of m and y. 4 Let q(s) = s3 + 2s*2 - 2s - 3. Let o be q(-3). Let g be ((-12)/8)/(o/56). Calculate the greatest common factor of g and 98. 14 Let c(o) = -10o - 6. Let d be c(-6). Calculate the highest common divisor of d and 135. 27 Let i(c) = c + 1. Let y be i(-1). Suppose yp - 2p + 18 = -2l, 5p = l + 57. What is the greatest common divisor of 4 and p? 4 Let d be (12/(-14)112/(-24))/4. Calculate the highest common factor of d and 5. 1 Let a = 0 + 3. Suppose -i + k = -4 - 2, -ak = 5i - 14. What is the greatest common divisor of i and 4? 4 Let r = -13 - -16. What is the highest common factor of r and 24? 3 Let m(b) = -4b3 - 6b*2 - 2b - 8. Let i be m(-4). Calculate the highest common factor of 64 and i. 32 Suppose 4y - x - 136 = 0, 2y - 66 = -0y + x. Suppose -u + 9 = 3q, 5q = 2u + 3u + y. Calculate the highest common divisor of 2 and q. 2 Let z be (-4)/(-6) + (-1940)/(-15). Let v = z - 73. Let c(i) = i3 + 8i*2 + 3i + 10. Let s be c(-7). Calculate the highest common factor of v and s. 19 Let n = 9 - 5. Suppose 4l + 4d - 20 = 0, nl - 6l - 5d + 19 = 0. What is the greatest common factor of l and 14? 2 Suppose 3m + 5r + 7 + 8 = 0, 5r = -5m - 25. Let k = m - -12. Suppose h - 3q = 1, -4h - 3q = q - 4. Calculate the greatest common factor of k and h. 1 Let v be (-1 + 3)7(-24)/(-28). What is the highest common factor of 8 and v? 4 Suppose 2 = -k, v + v = -5k + 74. Let m = -18 + 46. Calculate the highest common divisor of v and m. 14 Suppose 0 = -5t + 102 + 123. Let w(r) = r + 3. Let z be w(-5). Let x be (-36)/z - (0 - 0). Calculate the greatest common divisor of x and t. 9 Let i be (-7 + 10)/(6/128). Calculate the greatest common divisor of i and 16. 16 Let c = 37 + 117. Calculate the highest common factor of c and 14. 14 Let p be 2/5 - 13/(-5). Suppose ps = s. Suppose l + 4l - 280 = s. What is the highest common divisor of 7 and l? 7 Let r be 20/(-6)3/(-2). Suppose -83 = -rf + d + 2d, -3d + 77 = 5f. What is the greatest common divisor of f and 4? 4 Let m be 33/7 + (-10)/(-35). Suppose -4n - h - h - 14 = 0, -n = mh - 19. Let k = 9 + n. Calculate the highest common factor of 18 and k. 3 Let q be ((-1)/3)/(5/(-120)2). What is the highest common factor of q and 28? 4 Suppose -4m + 1 + 31 = 0. Let r be 2/(-3)45/(-6). Let o be (r3)/(12/16). What is the greatest common factor of m and o? 4 Suppose 2p = -5x - 71 + 224, 0 = x - 5. What is the highest common divisor of p and 16? 16 Let s = 7 - 3. Suppose sb - 2b - 22 = 0. What is the highest common divisor of 77 and b? 11 Let i(j) = -3j + 2. Let q be i(2). Let c be (-1)/(-2) - 2/q. Let n be (-2 - 3 - c)-18. What is the greatest common divisor of 12 and n? 12 Let b(v) = 3v - 7 - 2v + 0v - 3*v. Let r be b(-5). Calculate the greatest common divisor of r and 1. 1 Let	{ "pile_set_name": "DM Mathematics" }
the thousands digit of m(-13)? 3 Let f = -17 - -17. Suppose -3y + 144 - 57 = f. What is the units digit of y? 9 Let c(r) = r3 + 8r*2 + 11r + 15. Let d be c(-6). What is the tens digit of 8d(-4)/(-24)? 2 Let a be 4/(-22) + (-24)/(-11) - 11. Let i = a - -105. What is the tens digit of i? 9 Suppose -47 = -3d - 2. Let x = d + -12. Suppose xl = -24 + 207. What is the units digit of l? 1 Suppose 3499 + 6691 = 10n. What is the tens digit of n? 1 Let q(o) = -5o + 15. Let f be q(7). What is the units digit of 36 - (-12)/(f/(-5))? 9 Let o be (-1 - 2/(-2)) + 0. Let f be (-14 - -10)(0 - 1). Suppose c = 4z - 2, fz - 8 = -2c - oz. What is the units digit of c? 2 Suppose 0 = 179w - 172w - 119. What is the units digit of w? 7 What is the tens digit of 5 + (6 - 21150/(-9))? 6 Suppose z - 4 = 4u - 0, 3u = -z + 4. Suppose -za - 5p = 39 - 172, -99 = -3a - 4p. What is the tens digit of a? 3 Let n(d) = d + 21. Let g be n(-12). Suppose -w - g = -10. What is the units digit of (1 + (0 - -16))/w? 7 Let a = 6 + -17. Let d = -7 - a. Suppose b - db + 69 = 0. What is the units digit of b? 3 Suppose -1864 = -8d - 72. What is the hundreds digit of d? 2 Let c = -197 - -500. What is the hundreds digit of c? 3 Let g(w) = -w2 + 4w + 4. Let n be g(6). Let s(k) = -k - 10. Let l(c) = -3c - 21. Let u(z) = 3l(z) - 7s(z). What is the tens digit of u(n)? 2 Let u(s) = s2 + 3s + 2. Let p be u(-3). Let j(c) = c*3 + 0c*3 + 9c*p + 7 - 4c*2 - c. What is the tens digit of j(-5)? 1 Let f = 767 + 625. What is the hundreds digit of f? 3 Let k(w) = -9 + 18w + 6w - w3 - 32w + 9w2 + 21. Suppose c + d - 9 = 0, -5c + 4d + 1 + 35 = 0. What is the units digit of k(c)? 2 Let a be (12/24)/((-2)/(-208)). Let w = -18 + a. What is the units digit of w? 4 Suppose 4k = -0k + 20. Suppose -3n = kn - 2000. Suppose 5i + 2t - n = 0, -i = t + 4t - 73. What is the units digit of i? 8 Suppose 3n + 418 - 514 = 0. What is the tens digit of n? 3 Let y(s) = s3 + 11s*2 + 4s + 2. Let b be y(-5). Suppose 0 = 6p - 0p - b. What is the tens digit of p? 2 Suppose -1 = -s, -31g + 30g - 4s = -1055. What is the units digit of g? 1 Suppose -5z + q + 4379 = 0, 68q - 1 = 67q. What is the tens digit of z? 7 Let b be (1 + -3)(-3)/((-3)/(-16)). Let y = -12 + b. What is the units digit of y? 0 What is the units digit of 8 + (-1019)/(-2)4? 6 Let u = 394 - 201. What is the units digit of u? 3 Let j be (33)/(9 + -6). Suppose 0 = 6t - jt - 39. What is the tens digit of t? 1 Let h = 39 - 49. Let x(y) = 2y*2 + 9y - 14. What is the units digit of x(h)? 6 Let w(j) = -114j - 35. What is the units digit of w(-9)? 1 Let d = -344 + 2344. What is the units digit of d? 0 Let g(m) = 13m. Let h be g(3). Suppose 6q + h = 147. Suppose 0 = -6r - q + 342. What is the tens digit of r? 5 Let k(w) = 6w2 - 2w + 3. Suppose c - 2y + 4 = 0, -2c = 2c + y - 11. Suppose -u = -2u + c. What is the tens digit of k(u)? 2 Let b(d) = d*3 + 11d*2 - 6d - 4. Let u be b(-11). Let h = u + 13. What is the tens digit of h? 7 Let a = 59 - 53. What is the units digit of a/(-2) - (-4 + -69)? 0 What is the hundreds digit of ((-64)/(-160))/(1/10) + 402? 4 Let p(d) = 9d - 3. Let m be p(1). Suppose -ma - 2 = -5a. Let r(j) = -15j + 3. What is the tens digit of r(a)? 3 Suppose -5t + 31 = -2n, t + 2t = -5n. Let a be 4/12 + t/3. Suppose -3k - 2k - 2b = -85, 20 = 2k - ab. What is the units digit of k? 5 Suppose -2p + 3p = 5. Suppose pq - 239 = -4j, j - 4q = -19 + 84. What is the tens digit of j? 6 Let v be (-203775)/(-231) + (-2)/14. Suppose 3t - 2d - 769 = 0, -v - 401 = -5t + 2d. What is the hundreds digit of t? 2 Let i be (-2 + -4)(-2)/(-6). Let k(l) = l2. Let d be k(i). What is the units digit of -18(-21)/d? 2 Let h be -5(0 + 1)1. Suppose 8n - 27n - 57 = 0. What is the tens digit of (3 + h - n)41? 4 Let n(o) = -o*2 - 6o + 2. Let q(r) = 3r2 + 11r - 5. Let a(y) = -5n(y) - 2q(y). Let u be a(7). Let p = u - -16. What is the units digit of p? 3 Suppose 0 = w + 1 - 118. Let m = w + -70. What is the units digit of m? 7 What is the units digit of ((-840)/200)/((-14)/20)? 6 Let u be (102/8)/(6/64). Suppose -l + 26 = -5v, 5l - 4v - 99 = u. What is the tens digit of l? 5 Let j(a) = a2 + 7a + 10. Suppose 6 = -4k - 18. Let h be j(k). Suppose 3u = hz + 21, 5u - 33 = 5z + 2. What is the units digit of u? 7 Let c = 1931 + 3029. What is the units digit of c? 0 Suppose -3k = 2k - 735. Suppose 4b - 451 = -k. Suppose 6q = 2q + b. What is the units digit of q? 9 What is the hundreds digit of (-2790)/(-27)(22/4 + -1)? 4 Suppose 7j = 6j + 40. Suppose -13 + j = -3t. Let r = t + 11. What is the units digit of r? 2 Let p(q) = -q + 17. Suppose 4k - n = 64, -2n + 0n = 3k - 37. Let x be p(k). Suppose x = -z + 28. What is the tens digit of z? 2 Let x(s) = -s + 9. Let w be x(9). Let u be w - (2 - 4)4. Suppose 2o + 35 - u = 3a, -4a - 5o + 59 = 0. What is the units digit of a? 1 Let t(l) = 31l*2 - 7l - 5. Let i be t(-2). Let v = 231 - i. What is the units digit of v? 8 Suppose 0 = 22m - 15904 - 55970. What is the hundreds digit of m? 2 Suppose 2a - 5a = -12. Suppose -2w - q + 5 = -0, 0 = 4w - 5q - 3. Suppose -3x = wr - a - 21, -3r + x = -10. What is the units digit of r? 5 Suppose -2 = 3o + 5z - 1, -6 = 5o + 4z. Let m(v) = 14v*2 + v. What is the units digit of m(o)? 4 Suppose 2j - 444 = -2l, 1094 = -0l + 5l + j. What is the hundreds digit of l? 2 Let s(d) = -96d + 3. Suppose 0 = -2r - 3x - 5, -3r + 1 = -4x. Let p be s(r). Suppose 0 = 3y - y + b - p, -4y = 4b - 208. What is the units digit of y? 7 Let u(p) = 12p*3 - 8p*3 - p - 5p*3 - 3p*2. Let o be u(-3). Suppose -5b - oa + 134 = 0, -2a - 50 - 44 = -4b. What is the tens digit of b? 2 Suppose -10y = 4o - 5y - 578, -2y = -5o + 739. What is the tens digit of o? 4 Let i(r) = -r*3 - r + 14. Let q be i(0). Suppose 2k + 5h - 12 = 0, -5k - 4h - 6 = -6k. Let d = q - k. What is the units digit of d? 8 Let a = -472 + 964. What is the hundreds digit of a? 4 What is the units digit of (20/(-30))/2 + (-13268)/(-6)? 1 Let w(u) = 14u - 74. What is the units digit of w(17)? 4 Let t be (-57)/(-30)46 + (-12)/30. Let h = -43 + t. What is the units digit of h? 4 Let g = 5626 - 3957. What is the hundreds digit of g? 6 Let n = -44 - -64. Suppose 2h - 82 = n. Let v = h + -25. What is the tens digit of v? 2 Suppose -20g = -19g - 3. What is the units digit of (6 + 17)/(3/g)? 3 Suppose -4s + 3g = -85, 0s - 2s + 50 = -4g. Let t(c) = -c*2 + 25c + 1. What is the units digit of t(s)? 5 What is the tens digit of 1/(-9) - 5/(-180)80284? 3 Suppose -27z + 32z = -b + 4750, 3z + 9565 = 2b. What is the units digit of b? 5 Suppose -3f + 1470 = 3u, -58 + 2016 = 4u + 2f. What is the hundreds digit of u? 4 Suppose 0p - 15 = -5p. Suppose -3 = pf - 21. Suppose -3l - 21 = -fl. What is the units digit of l? 7 Let q = -17 + 776. What is the tens digit of q? 5 Suppose 0 = -5x - b + 4080, 2b = -3x - 2b + 2465. What is the hundreds digit of x? 8 Suppose -5t + 4x + 5 = 0, t - 4t - 2x = -3. Let j = -2 + t. What is the tens digit of (-1 + j)/((-1)/5)? 1 Suppose 7607 + 16717 = 12u. What is the hundreds digit of u? 0 Suppose 3p + 94 = -x + 546, 2p - 300 = -2x. What is the hundreds digit of p? 1 Let a(p) = -p*2 - 29p + 2. What is the tens digit of a(-7)? 5 Let h = -568 - -922. What is the hundreds digit of h? 3 Suppose -d + 12 - 2 = 0. Let u be ((-4)/d)/((-10)/300). Suppose 0 = -4o + 68 + u. What is the tens digit of o? 2 Suppose -272 = 25u - 21u. Let g = u - -141. What is the tens digit of g? 7 Suppose 4a - 23a + 15713 = 0. What is the hundreds digit of a? 8 Let i = -1610 + 3000. What is the units digit of i? 0 Suppose 0 = 3m + 3f - 285, 2m - 14f + 19f - 175 = 0. What is the tens digit of m? 0 Let k = -27 + 20. Let j(x) = -x*2 - 12x + 1. What is the tens digit of j(k)? 3 Let m = -8 - -12. Let w(c) be the second derivative of -c5/20 + c4/2 - c3/6 + c2 + 2c. What is the tens digit of w(m)? 3 Suppose -32u + 29u = -189. Suppose 2z - 107 + 2 = -5s, -5z + u = 2s. What is the tens digit of s? 1 Let t = -518 - -754. Suppose 281 = 11z - t. What i	{ "pile_set_name": "DM Mathematics" }
plify 2 + -4 + (5 + sqrt(320) - (sqrt(5) + 2sqrt(40)/sqrt(8)) - (-2 + 2 + 1 + sqrt(5) + ((sqrt(220)/sqrt(4))/sqrt(11))2)). -3 + 4sqrt(5) Simplify (5(2sqrt(76)1 + 5sqrt(76)2))/(((sqrt(264)-2)/sqrt(6))/(sqrt(176)-5)). 600sqrt(19) Simplify -1 + (0 + -1 + sqrt(147))*2 + -1 + -5 + -6(sqrt(147)-1)2 + 3. -738 - 14sqrt(3) Simplify 2 + (((sqrt(1300) - (-2 + 1sqrt(1300))) + sqrt(1300))2 - sqrt(1300)) + 3 + ((sqrt(1300)-1-4 + sqrt(1300) + -5)4)*2. -7970sqrt(13) + 521709 Simplify (1(-2 + sqrt(176)-5) - (-3sqrt(66)-1)/(sqrt(864) - sqrt(54)))*2. 244sqrt(11)/3 + 40967/9 Simplify -3 + 4(5(sqrt(1862)1 - sqrt(1862)))/(32sqrt(288)). -3 Simplify ((sqrt(1539) + sqrt(1539) + 1 + 3 + 1)-3)*2 - ((-2sqrt(1539) + -1 + 2 + (sqrt(1539) + 0 - sqrt(1539)))3)2. 216 + 1944sqrt(19) Simplify (sqrt(52) + sqrt(208))*2-6-4 + -3 - -4(sqrt(104)/sqrt(128) - sqrt(13) - ((sqrt(156)3)/sqrt(12))2). -3sqrt(13) + 10761 Simplify (-4 + (sqrt(1539) - (-1 + sqrt(1539))) - ((sqrt(1539) + 1 - sqrt(1539))-5)2 - (4(sqrt(1539)-2 - sqrt(1539)) - -2(0 + sqrt(1539)))-6) + -2. -540sqrt(19) - 30 Simplify (1(-2sqrt(320)-2 + 4) + (sqrt(320) + -2 + -3 - (sqrt(320) + -1 + sqrt(320) + -3)))2. 144sqrt(5) + 2889 Simplify (2-1sqrt(70)-24)/(4(sqrt(40)/sqrt(2))/sqrt(2)3). 4sqrt(7)/3 Simplify (-5 + (sqrt(10)/sqrt(45))2)5 - (-3(sqrt(2) - sqrt(6)/sqrt(75) - sqrt(2)))26. -6347/225 Simplify -2 + (-2(sqrt(832) + 3) + sqrt(832) + 0)2 + (-2-1(sqrt(832) - (sqrt(832) - -1(sqrt(832) - (sqrt(832) + 3)))))*2. 96sqrt(13) + 902 Simplify (sqrt(18)/(-2sqrt(9)) + sqrt(2) - ((sqrt(242) + -1sqrt(242))*2 + sqrt(242))) + 5 + (sqrt(8)/sqrt(4) + -2 - (sqrt(32) + 0)). -27sqrt(2)/2 + 3 Simplify (sqrt(99)1-62-4 + 3 + 4)3. 21 + 432sqrt(11) Simplify (sqrt(8)-4 - (sqrt(2) - (sqrt(200) + 2sqrt(200))) - (-4sqrt(14)/sqrt(7) + -3)-3)*2. -162sqrt(2) + 243 Simplify (4(24sqrt(153))/(-6sqrt(90)/sqrt(10)) + 2)*2. -64sqrt(17)/3 + 4388/9 Simplify (-1(((sqrt(143)-2 - sqrt(143)) + sqrt(143))2 - sqrt(143)-15))/(4(sqrt(99) + (sqrt(99) - (sqrt(99) + sqrt(99)3)))3). sqrt(13)/72 Simplify ((3(1 + sqrt(171)) - sqrt(171) - (sqrt(171) + -1)6) + -4 - 34(sqrt(171) + 1 - sqrt(171))5)2. 1320sqrt(19) + 5761 Simplify ((0 + sqrt(245) + (1 + sqrt(245))1 - ((sqrt(245) + 1)-5 + sqrt(245))-2)-1-5)2. 18900sqrt(5) + 222525 Simplify (sqrt(75) + -3 + 0 + -3 + (sqrt(75) + (sqrt(75) - (2 + sqrt(75))))-5 + (2sqrt(75) + -5 - sqrt(75)))*2. 30sqrt(3) + 676 Simplify -54(sqrt(1584)-1 + sqrt(1584) + sqrt(11))2 + 1(3 + sqrt(33)/sqrt(3) + -2). -219 + sqrt(11) Simplify 4(3 + (sqrt(99) - sqrt(99)-1)2) + -31sqrt(99)-2 + -2 + 2. 12 + 66sqrt(11) Simplify (3 + (sqrt(208)/(sqrt(324) + (sqrt(324) - -2sqrt(324)) + sqrt(324) - sqrt(324)))/((-1sqrt(112))/sqrt(7)))-6. -18 + sqrt(13)/12 Simplify ((5(sqrt(72) - (sqrt(72) - (sqrt(72)2 + sqrt(72)))))/((2sqrt(6) + sqrt(6))-1))/(1sqrt(6)-1 + sqrt(30)/(-2sqrt(5))). 10sqrt(2)/3 Simplify ((sqrt(130) - -4sqrt(130))/sqrt(10) - (-3 + 0 + sqrt(13)))2-6 - (2(sqrt(117) - (sqrt(117)2 - sqrt(117))) + sqrt(117))/(sqrt(324)3). -1302 - 2593sqrt(13)/18 Simplify -3(6sqrt(336)2)/(sqrt(448)-2)2-4. -72sqrt(3) Simplify (4sqrt(121)-2 + sqrt(121) + (3sqrt(121)-1 - sqrt(121)))/(1(sqrt(880)6)/sqrt(5)). -11sqrt(11)/24 Simplify (0 + ((sqrt(720)1)/sqrt(10)-5 - (-1-1sqrt(2) - (-4 + (sqrt(2) - (2 + sqrt(2)))))))*2 + -4. 372sqrt(2) + 1954 Simplify ((sqrt(275)2 + sqrt(11) + -3)6 - (-1 + (sqrt(11)2 + sqrt(11))5 + 0))*2. -1734sqrt(11) + 28900 Simplify -3 + ((2sqrt(416) + sqrt(416))4)/(2(sqrt(162) - (1sqrt(162) + sqrt(162)))). -8sqrt(13)/3 - 3 Simplify ((2sqrt(252)3 + sqrt(252) - sqrt(252) - sqrt(252))/(-2sqrt(175)))/(-6(sqrt(1200) - sqrt(1200)-1 - sqrt(1200))-6). -sqrt(3)/720 Simplify (-3 + sqrt(8)33 + 5 + (sqrt(98) + -4)5 + sqrt(98))*2. -2160sqrt(2) + 7524 Simplify sqrt(26)/(-4sqrt(72))-6 - ((sqrt(637))*22 + (sqrt(13) - 6(2 + sqrt(13)))2). -1743 - 479sqrt(13)/4 Simplify 3(sqrt(1210) - (sqrt(1210) + sqrt(1210) + sqrt(1210) + sqrt(1210) + (1sqrt(1210) - sqrt(1210)))-6)/((sqrt(12)-4-5)/sqrt(6)). 165sqrt(5)/4 Simplify ((sqrt(21)/(sqrt(9)/sqrt(3)) + (sqrt(224)/sqrt(4))/sqrt(8) - (sqrt(700) - (-1 + (sqrt(700) - 2sqrt(700))))) + (0 + 2sqrt(14)/(sqrt(2)-2))2)*2. 40sqrt(7) + 2801 Simplify ((((sqrt(3600) + (sqrt(3600)-1 - sqrt(3600)) + sqrt(3600))/sqrt(12) - sqrt(30)/(-2sqrt(490) - sqrt(490))) + -1)*2 + -5)6-6. 24sqrt(3)/7 + 7044/49 Simplify -1(5(sqrt(147) - (sqrt(147)1)2) + sqrt(147) + sqrt(147)) + (sqrt(21) - sqrt(84)/sqrt(4))/sqrt(7) + sqrt(3) + sqrt(9)/(sqrt(15)/sqrt(5)). -47sqrt(3) + 735 Simplify -3(sqrt(6)/(sqrt(2) + (sqrt(2) - sqrt(32)))3 + 3 - (sqrt(4356)-2)/(1sqrt(432) - sqrt(432) - sqrt(432)))*2. -1069/4 + 93sqrt(3) Simplify (-6(sqrt(225) - (sqrt(225) - -1sqrt(225)1)))/((3sqrt(200)/sqrt(4))/sqrt(10)) + 3. 3 + 6sqrt(5) Simplify 6(sqrt(153)2)22 + -4 + ((sqrt(119)2 - sqrt(119))-1)/(-2sqrt(1008) - sqrt(1008)). sqrt(17)/36 + 7340 Simplify 4 + -5 + sqrt(288) + -2 + 1sqrt(22)/sqrt(11) + 4 + 2. 3 + 13sqrt(2) Simplify -4 + 1(sqrt(144) + sqrt(144)-24)/(sqrt(3) + (sqrt(3) - sqrt(27)/(sqrt(9) - -1sqrt(9) - sqrt(9)))) + 5. -28sqrt(3) + 1 Simplify (-2(2 + (sqrt(1008) - -4(-1 + sqrt(1008))) - (-4 + sqrt(1008)-1 - -4sqrt(1008)1)) + -1)2. 480sqrt(7) + 16153 Simplify 2 + (sqrt(1100) - (sqrt(1100) - (3 + sqrt(1100)-1) - sqrt(1100))2) + (sqrt(1100)53)2 + 5 + -1. 70sqrt(11) + 246397 Simplify ((sqrt(14) - (3sqrt(70))/sqrt(5))/sqrt(2))21 + -2sqrt(343)-65. 28 + 420sqrt(7) Simplify (((sqrt(130) - -3-1sqrt(130)) + (sqrt(130) + sqrt(130) + (sqrt(130) - sqrt(130)-1))4)/((sqrt(70)1-6)/sqrt(7)))*2-6-5. 6370/3 Simplify -1 + ((-1(sqrt(11) + 1) + sqrt(1331)2)-5)*2 + (-4 + sqrt(1100)1 + -3 + (4 + sqrt(1100)-2 + sqrt(1100) - sqrt(1100)))2. -990sqrt(11) + 122408 Simplify (sqrt(140) + sqrt(140) + (sqrt(140) - sqrt(140)-1) - ((sqrt(385)3)/sqrt(11) - sqrt(35) - sqrt(35)))/(sqrt(28)/(sqrt(4) - 5sqrt(64))). -133sqrt(5) Simplify (-5(sqrt(81)/sqrt(3) - sqrt(27)) - sqrt(135)/sqrt(5)5)/((sqrt(81)5 - (sqrt(9) - 6sqrt(9)2))4). -5sqrt(3)/104 Simplify 2 + sqrt(2) + -3 + sqrt(2) + 2 + sqrt(288) + 5 + 1(-1 + sqrt(2)) + -5. 15sqrt(2) Simplify (sqrt(20) + sqrt(20) + (sqrt(20) - -2sqrt(2880)))/((sqrt(200)/sqrt(5) + sqrt(40))/sqrt(10)) - ((2sqrt(180) + -1 + 1)2 + -1). -719 + 27sqrt(5)/2 Simplify -5((4sqrt(76)/sqrt(2))/sqrt(2)5 + (-4sqrt(95)-2 + sqrt(95))/(sqrt(30)/(sqrt(6)1)))*2. -79895 Simplify ((sqrt(2) - (sqrt(2) + 4sqrt(20)/sqrt(10))) + (sqrt(14)-4)/sqrt(7))2 - (4 + -3sqrt(2)26). 36sqrt(2) + 124 Simplify (sqrt(528)/sqrt(3) + 2 + -2 + -2(sqrt(176) - sqrt(176)-2)-4)*2-5. -550000 Simplify (sqrt(2880)-2 - sqrt(2880) - (sqrt(45) + (-3sqrt(720) - sqrt(45))))/((sqrt(576)-6)/sqrt(4)). sqrt(5)/2 Simplify (((sqrt(192) + 0)-1)*2 - (-1sqrt(192) + 3)) + 1 + (4-2sqrt(15))/sqrt(5). 190 Simplify ((2 + sqrt(468)-5 + sqrt(468) + sqrt(468) + 0)2 - (6(sqrt(468) + 2 + sqrt(468)) + 4)) + -5. -144sqrt(13) + 4195 Simplify ((sqrt(33) + sqrt(363)/(sqrt(11) - sqrt(891)))-3)/(5((sqrt(704) - -1sqrt(704)) + sqrt(704))). -7sqrt(3)/320 Simplify -4 + (-2(sqrt(112) - (0 + (sqrt(112) - (3 + sqrt(112)))) - (4 + sqrt(112) + -4))2)2 + 3. 143 Simplify -4(3 + ((sqrt(1300) - (0 + sqrt(1300)))*2-33 + -2)-2 + -5). -8 Simplify (5(sqrt(363) + -1 + -1) - (-1 + ((1sqrt(60))/sqrt(2) + sqrt(30))/sqrt(10)))-5. -265sqrt(3) + 45 Simplify (-3 + -1 + (1sqrt(11))2 - (sqrt(99) + -1 + 1)2) + (1-2sqrt(77) - sqrt(77))/(-4sqrt(28)) + -4. -96 + 3sqrt(11)/8 Simplify (5(-3sqrt(832) - sqrt(832) - sqrt(832)))/(-1sqrt(484) - 5sqrt(100)). 25sqrt(13)/9 Simplify -3 + (-1(sqrt(160)/sqrt(8) - (sqrt(55) + 2sqrt(55))/sqrt(11)) - 4(-5 + sqrt(45) + 1)). -11sqrt(5) + 13 Simplify (52sqrt(209)2)/(sqrt(1584)-1 + 6sqrt(99))3. 10sqrt(19) Simplify 6(-25-2sqrt(99))/(sqrt(81) + sqrt(81)1 + 1sqrt(9)5)-6. -720sqrt(11)/11 Simplify (21sqrt(64))/(sqrt(64)/(2sqrt(8))) + (0 + (sqrt(162) + -1 + 0 + sqrt(162) - sqrt(162))2)-6. -978 + 116sqrt(2) Simplify -5 + (-2sqrt(832)*-3 + (sqrt(832) - (2 + sqrt(832))) + -1	{ "pile_set_name": "DM Mathematics" }
ded by v? 12 Let q be 2 - ((-3)/(-2))/((-3)/6). Suppose -2m + qo = 3 + 1, -5m + 20 = -5o. What is the remainder when 54 is divided by m? 6 Let h(n) = 2n + 76. Let a(q) = -3q - 153. Let g(k) = -3a(k) - 5h(k). Calculate the remainder when g(13) is divided by 34. 32 Let k(d) = -d*3 + 6d*2 + 8d + 8. Let q = 139 - 110. What is the remainder when q is divided by k(7)? 14 Suppose 356p - 352p = 100. Calculate the remainder when 222 is divided by p. 22 Let s be (10/30)/((-2)/(-42)). Let t(h) = 3h2 - 14h - 17. What is the remainder when t(s) is divided by 9? 5 What is the remainder when (-3)/((-6)/4(-10)/(-4855)) is divided by 12? 11 Let l = -13 + -28. Let b = l - -85. What is the remainder when b is divided by (-12 - 2)/(-1) - 2? 8 What is the remainder when -8 + (-6566)/(-13 - 1) is divided by 153? 2 What is the remainder when (-2 - -2) + 168 - (9 - 8) is divided by 54? 5 Let a be -2 + 180/8 - (-1)/2. Suppose 27 + a = 6t. What is the remainder when 63(-10)/(-6) is divided by t? 6 What is the remainder when (-36)/6(82/(-12) + -1) is divided by 26? 21 Suppose -o + 94 = -a + 9, 3a + 12 = 0. Calculate the remainder when o is divided by 63. 18 Let m = 55 + -94. Let x = m - -95. Calculate the remainder when x is divided by 58/((-8)/(-2) + 20 + -22). 27 Let c be (5/2)/((9/102)/3). Let g = c + -65. Calculate the remainder when g is divided by 8. 4 Calculate the remainder when 277 is divided by (-70)/71-4. 37 Let i(o) = o*3 + 4o*2 - 3o + 1. Suppose 2v + 39 = -3z, 3v = -2z - 6 - 15. Let u = 20 - z. What is the remainder when u is divided by i(-3)? 16 Let d = 18 - -60. Calculate the remainder when d is divided by 44. 34 Suppose 3i = 5a - 131, -4a - 23 = 3i - 144. What is the remainder when 192 is divided by a? 24 Suppose -2k + 549 = x, 2x + 2211 = 8k + 3x. What is the remainder when k is divided by 57? 49 Let x be 0 + 2 - (-186 + 5). Let q = x - 127. Calculate the remainder when q is divided by 30. 26 Suppose -15o + 1135 + 290 = 0. Let n = 3 + 3. Suppose -h - o = -nh. What is the remainder when h is divided by 7? 5 Let u = -317 - -333. Calculate the remainder when 55 is divided by u. 7 Suppose 0 = g - 0g - 8. Let z(l) be the third derivative of l4/24 - l3/2 + 7l*2. Calculate the remainder when z(g) is divided by 2. 1 Suppose -8s = -0s - 440. Suppose -v + 12b + 4 = 10b, 5v - 3b - s = 0. What is the remainder when v is divided by 5? 4 Let n(y) = 26y*2 - 2y - 15. What is the remainder when n(-3) is divided by 78? 69 Let j(b) = -b + 62. Let l be j(0). Suppose -l = -6w + 4w. Calculate the remainder when 92 is divided by w. 30 Let r(s) = s*3 - 9s*2 - 13s + 13. Let a be r(10). Let t = 44 + a. What is the remainder when t is divided by 15? 12 Let j = 74 + -35. Let q = j + -25. Calculate the remainder when 55 is divided by q. 13 Let o = 171 - 95. Let r = 30 + -10. Calculate the remainder when o is divided by r. 16 Let r(v) = -v*3 - 2v + 2. Let o be r(0). Suppose -5s - op = -107, -3p - 65 = -3s - 4p. Calculate the remainder when s is divided by 13. 10 Let b = 103 - 97. Calculate the remainder when 59 is divided by b. 5 Suppose -358 = 5i - 1108. Calculate the remainder when i is divided by 52. 46 Suppose 0 = -2o + 2 + 30. Suppose 4m + o = -0x + x, x - 3m = 13. Let l = x - -2. Calculate the remainder when 9 is divided by l. 3 Let h(y) = 8y2 - 4y - 7. Let m(d) = 9d2 - 3d - 7. Let x(k) = 6h(k) - 5m(k). Calculate the remainder when x(7) is divided by 16. 13 Let n(z) = z*3 + 16z*2 - 30z - 28. What is the remainder when n(-17) is divided by 87? 19 Suppose 15 = 4x + x. Let i = x + 11. Calculate the remainder when 726/i - (-2)/14 is divided by 27. 25 Suppose 144 + 72 = 4z. Let x = 72 - 49. Suppose 3l = -l - 4, -5l = m - x. What is the remainder when z is divided by m? 26 Let k(w) = -w*2 - 6w + 2. Let j(r) = -7r + 3. Let u(d) = 6j(d) - 7k(d). What is the remainder when u(-2) is divided by 7? 4 Let d(z) = -z3 - 19z*2 - 7. Let s be d(-19). What is the remainder when (4356/231)/((-2)/s) is divided by 23? 20 Suppose 2u - 4u + 120 = 0. Suppose -5q - 55 = -4g, -7g + 80 = -2g + 5q. Calculate the remainder when g is divided by 228/u - (-1 - 4/(-5)). 3 What is the remainder when 303 is divided by ((-2)/(-3))/(15(-24)/(-4320))? 7 Let d = -23831 + 23845. Suppose 4 = -w - 2. Calculate the remainder when (-1 + 34/w)-6 is divided by d. 12 Suppose 0 = 5b - 5t - 65, 0t - 2t - 62 = -4b. Calculate the remainder when (-2)/(-12) + 1005/b is divided by 16. 8 Let h(j) = j2 - j + 1. Let x(s) = 7s*2 + 3s + 12. Let k(c) = 6h(c) - x(c). Suppose -46v = -35v + 66. What is the remainder when 34 is divided by k(v)? 10 Let f(o) = 2o*2 - 9o + 11. Let l be f(6). Let t = 34 - l. What is the remainder when 18 is divided by t? 3 Let b = -43 - -26. Let p = b - -35. Calculate the remainder when 34 is divided by p. 16 Suppose -5t + 2x + 1 = -99, 0 = -2t - 2x + 40. What is the remainder when 272 is divided by t? 12 Suppose 24 = 5v - 36. Suppose 16g - 1479 = -567. What is the remainder when g is divided by v? 9 Suppose 4s + 131 = 2l + 3s, -5s - 5 = 0. Let r = -53 + l. Calculate the remainder when 81 is divided by r. 9 Suppose 88 = 16l - 12l. Let f = 51 + -45. Calculate the remainder when l is divided by f. 4 Let o(f) = -f*3 - 31f*2 - 142f + 54. Let w = -9 - -15. Calculate the remainder when w is divided by o(-6). 0 Let b be (-1)/((-9)/(-30))9. Calculate the remainder when -2(-9)/117 - (-271)/13 is divided by 10/b(-34 - -1). 10 Let m(d) = 26d + 242. What is the remainder when m(-5) is divided by 69? 43 Suppose -3w - 126 = 4w. Let f = w - -23. Let u(n) = 3n2 - 8n - 6. What is the remainder when u(f) is divided by 15? 14 Suppose -y - 42 = -8y. Suppose -4z = -yz + 4. What is the remainder when ((-18)/4 + 2)-2 is divided by z? 1 Calculate the remainder when 124 is divided by 330/(-40)(0 + -8). 58 Suppose 29 - 3 = a - 5f, 0 = -2a + 4f + 28. Let k(p) = -30p3 - 2p*2 - 2p - 1. Calculate the remainder when k(-1) is divided by a. 5 Let f = 391 + -271. Let b = -75 + f. Calculate the remainder when 133 is divided by b. 43 Suppose 141 = 7t + 29. What is the remainder when t is divided by 4? 0 Let l be (6 + 2)(-1)/2. Let h(p) = p*2 + p + 4. Calculate the remainder when (-748)/(-28) - l/14 is divided by h(-3). 7 Let g = -2 + 10. Calculate the remainder when 186 is divided by g. 2 Let c(n) = 23n + 7. Let h be c(-3). Let l = h - -73. What is the remainder when 41 is divided by l? 8 Let m(a) = -a*3 + 11a*2 + 22a + 74. Calculate the remainder when 54 is divided by m(13). 10 Suppose 4s - 98 = -3x, s + 0s = -4x + 109. What is the remainder when 292 is divided by x? 6 Let c be 1/62 + 112/(-12). Let h(x) = x2 - 29. What is the remainder when h(c) is divided by 18? 16 Calculate the remainder when (-6)/(72/(-2508)) + 5-1 is divided by 32. 12 Let n(p) = -17p + 103. Calculate the remainder when 31 is divided by n(5). 13 Let r(l) = 3l*3 - 2l*2 + l. Suppose -u - u = 10, -11 = -2v + u. Calculate the remainder when r(2) is divided by v. 0 What is the remainder when -4 - 1 - -15(-88)/(-24) is divided by 33? 17 Let l(q) = -q3 - 3q*2 + 2q. Let t be 1/(-4) - (-13215)/60. Suppose -6p - 4p + t = 0. Calculate the remainder when p is divided by l(-4). 6 Suppose 0p - 4p = 0. Suppose m - 4n - 9 = p, -5m + 0m - 3n = -22. Calculate the remainder when 83 is divided by (-2 + m)(0 + 7). 20 Suppose 0 = 3k + b - 5b - 172, -3b - 114 = -2k. Let d = -19 - -16. Let m(h) = h2 - 7h - 9. What is the remainder when k is divided by m(d)? 18 Suppose -3k - 136 = -i, 4k = 5i + 6k - 765. Calculate the remainder when i is divided by 19. 18 Calculate the remainder when 92/(-138) + 220/6 is divided by 15. 6 Suppose -3g + 336 = -9g. Let l = 72 + g. Calculate the remainder when ((-31)/3)/((-2)/6) is divided by l. 15 Suppose -2q - 5f + 24 = 0, 0q + 3q - 36 = 4f. Suppose a = -5, -2n - 5a - 4 = -1. Calculate the remainder when q is divided by n. 1 Let x(v) = 7v*2 + 13v - 17 - 6v2 + 0v*2. Let a be x(-14). What is the remainder when 20 is divided by (-2 - a)/(2/14)? 6 Suppose -3i - 5x = 133, 27x - 22*x = i + 11. Let z be 1/(-4) + 26/8. Calculate the rema	{ "pile_set_name": "DM Mathematics" }
(389/30) Simplify (w(-11)/(((w/w(-18))/w)/w))/(w/(w/(w/(www5))))(5/7) assuming w is positive. w(-166/7) Simplify (h(-14))*(-11)(hh(-4/11)/h)(-6) assuming h is positive. h(1718/11) Simplify ((z(-2/5)/z)(-3/4)/(((zzzzz0z)/z)/z)(-46))4 assuming z is positive. z*(2781/5) Simplify ((aaaaa2)(2/55)/(a(2/3)/(a(-4/9)a)))(-1/59) assuming a is positive. a(-53/29205) Simplify (((r/r*(10/3))/r)/(rr/(((r/r*(-33))/r)/r)))/((rr/r*(2/7)r)/(rr(4/13)/r)) assuming r is positive. r(6623/273) Simplify (nn1)(7/11)n10(((n/(n/(n*(-8)/n)))/n)/n)/nn assuming n is positive. n(3/11) Simplify (s(1/9)/(s*6ss))/(s3/(((s/s(-2/21))/s)/s)) assuming s is positive. s(-743/63) Simplify (r/(rr*(-3/4))r)/(r*(4/3)r)((r/r(-2/3))/r)(-28) assuming r is positive. r(-77/4) Simplify ((h(-4))(-3/35))(-2/91) assuming h is positive. h(-24/3185) Simplify qq*(-10)qqq*(-1)(qq9)(-10/13) assuming q is positive. q(-204/13) Simplify (w(1/2)w*(-8))/(((((w(ww/(ww/((w/w*(-5))/w)))/w)/ww)/ww)/w)/w(-1/8)) assuming w is positive. w(-93/8) Simplify (mm(-3/11))/m(-1/2)(m1m)/(mmm/m(-10)) assuming m is positive. m(-215/22) Simplify (x(-4/7)/x)(-24/7)(x(-7))13 assuming x is positive. x(-4195/49) Simplify (s/((ss*(-9)/s)/sss)s*(-2/11)s)/((s*8s)/((s/(s*(-4/5)s))/s)) assuming s is positive. s*(34/55) Simplify (y(yyy(-7)/y)/y)/y(-3)(y/y(-9)y)(-2/65) assuming y is positive. y(-217/65) Simplify ((f*(2/9)ff)/(f/f(-10/9)))/(ff*(2/49)f(f9/f)/f) assuming f is positive. f(-3938/441) Simplify ((f/f(3/5))/(f/(ff/((ff(f/(f*(-3/8)ff))/f)/f))))/(f(2/27)/f)(-3/10) assuming f is positive. f(629/360) Simplify (s(6/13)s/((s/(s/(s/s11)))/s))/(s(-2/11)s(1/6)) assuming s is positive. s(10705/858) Simplify ((v0)(-32)v*(-2/9)(vvv(-2/25))/v)(-8/11) assuming v is positive. v(-1256/2475) Simplify ((a(-1/4)a)/a4)/((a/(a/a(-8)))/(a/(a/((a/(aa/a*(1/8)))/a)a)a)) assuming a is positive. a(23/8) Simplify (k(k/(kkk*38k))/kk16)5 assuming k is positive. k(-120) Simplify (p/(p/p(2/7))p/(pp(-14)/p))/((pp*(-8)/pp)/p)(-7/11) assuming p is positive. p(785/77) Simplify (r(1/19))(-3/4)/(rrr10)48 assuming r is positive. r*(-43779/76) Simplify (((d(d/d(2/9))/d)/d)/(d/(d(6/11)d))(d/(d*(-3)/d)d)(-3/5))(-2/33) assuming d is positive. d(3244/16335) Simplify ((d(5/2)/d)/(d/(d(dd/d*(-10)d)/dd)))/((dd(3/2))/d)(-1/71) assuming d is positive. d*(1031/71) Simplify ((bb/b(-4))/b4)(16/7) assuming b is positive. b(32/7) Simplify ((((j*(-6)j)/j)/(j(j1j)/jjj))/((j/(jj/j2j)j)/j)(5/11))(-45) assuming j is positive. j450 Simplify (c/(c/(c/(c15/c)))c1)/(((c(-3/4)/c)/c)/(c/(cc/((c/c(-10/7)c)/c)))) assuming c is positive. c(-219/28) Simplify (k16k)/k(1/9)k*7kk(-15) assuming k is positive. k(89/9) Simplify s(2/31)/s(-1/8)(s*(-2/39)/s)/(ss/s(-11/4)) assuming s is positive. s(-54277/9672) Simplify (x(2/47)/x)(10/9)(x(-6/11)/x)/(x(-11/4)/x) assuming x is positive. x(2359/2068) Simplify oo*(-1/23)o*3oo(2/41)oo/(o/(o/o(-1))) assuming o is positive. o(7549/943) Simplify ((c/((c/((c/c(-2))/c))/cc))/c*(-1/2)(c/(c*(-1/3)c))(-2/19))(14/13) assuming c is positive. c(1967/741) Simplify ((q(-13)/(q(-5)/q))28)(2/5) assuming q is positive. q(-392/5) Simplify (f(-16))5((f/(f(ff19)/f))/f)(-28) assuming f is positive. f480 Simplify (((i/i(-1/23))/i)33)0 assuming i is positive. 1 Simplify (((rr*(2/7)r)/r)*(-2/33)r/(r*(3/4)/r)r/(rr/(r8r)r))(-34/3) assuming r is positive. r(-14263/154) Simplify (b5)(-27)(b(-2/13))8 assuming b is positive. b*(-1771/13) Simplify (((a/(a/((aaa(-12))/aa))a)/aa)/a)(-21)/(a/a(2/69)aa*(2/5)a) assuming a is positive. a(71287/345) Simplify ((m/(m(-9)/m))/((m(m/m(7/4))/m)/m))/(m(-3))15 assuming m is positive. m(231/4) Simplify (l/l(-8/11))/l(26/7)l(2/9)/l(2/39) assuming l is positive. l(-16361/9009) Simplify (g/(g(-2/17)/g)(gg*4g)/g)/((ggg*(-11))/(ggg17g)) assuming g is positive. g*(614/17) Simplify ((((jjj(1/3))/j)/j)/jj/j*6j(-3)/(j/(j0/j)))(-2/11) assuming j is positive. j(64/33) Simplify l(-15)/l(-11)l/l(2/9)ll/(ll*(-2/5)ll) assuming l is positive. l(-172/45) Simplify (d(4/9)d)(2/3)/(d(-17)/dd(-4/17)d) assuming d is positive. d(8353/459) Simplify ((z/z22)/(z(3/13)/z))(-6/13) assuming z is positive. z*(1578/169) Simplify (f/(ff/f*(-1))f*(4/3)(f/f(-1))(2/59))1 assuming f is positive. f(-106/177) Simplify (u/(u*(-15)/u)uu6u)/(u2)10 assuming u is positive. u*5 Simplify ppp(-1/3)p*(-1)p(-1/4)/p(-1/2) assuming p is positive. p(11/12) Simplify (((m/(m(2/11)m))(2/69))(-32/5))(-3/4) assuming m is positive. m(-32/1265) Simplify (d/(d/(d(dd(-4/11)/d)/d))d/(dd(-16)))49 assuming d is positive. d(8428/11) Simplify ((x/((x/(x6/x))/xx)xx)/(x/x2))/((x(3/2)x)/xx)47 assuming x is positive. x(-219/2) Simplify (r(-2/5))3/(r*(4/15)r18/r) assuming r is positive. r(-277/15) Simplify (((t(-3/4))(-2))(-4))(-2/11) assuming t is positive. t(12/11) Simplify (i(1/9)/i(-7))/(i(-3)i(2/5)) assuming i is positive. i(437/45) Simplify ((a(-1/2)aa/(aa*(-5/2)))/((a/(aa/(aa/(aa/(a/a*4)a))aa))/aa/(a(1/3)/a)))(1/76) assuming a is positive. a(7/57) Simplify ((u1)(-39)u*8uu/(u(1/7)u))(12/13) assuming u is positive. u(-2532/91) Simplify (g27/g(-18))/(((ggg*2g)/gg)/(g/(g(gg/(g(-12)/gg))/g))) assuming g is positive. g*27 Simplify yy/(y*(2/9)y)yy*12/yy*3y8 assuming y is positive. y(214/9) Simplify (f/(f/(f*(-12)/f)))/(f/(((f(f/f*(1/5))/f)/f)/f))f*(-2/9)ff((f/f*(-2/5))/f)/ffff assuming f is positive. f(-496/45) Simplify (((o(-3))(12/19))9)(-44) assuming o is positive. o(14256/19) Simplify ((w/w(3/2))/(w/w(-5/4)w))/(((w6/w)/ww)/(www/(w/(w/w*(-5)w)))) assuming w is positive. w(1/4) Simplify (w(1/2))39/(((w/(w/(w/(w/w(-11))w)))/w)/(w(1/12)w)) assuming w is positive. w(379/12) Simplify b(-8)/b*2b*(-2/83)/(bb/((b/(b/b(-8)))/b)) assuming b is positive. b(-1745/83) Simplify ((s*(6/5)s)/s26)/((s/s(3/5)ss)/(s/((ss7ss)/sss))) assuming s is positive. s(-181/5) Simplify (w0)(-2/67)(w*6/w)/(w/(ww(-17))) assuming w is positive. w(-12) Simplify ((y/(y(-1/11)/y))/y7)/((y/(y/(y/(y/((y/(y*(-1/3)y))/y)yy))))/y)50 assuming y is positive. y(5888/33) Simplify (uuu*2)/u(uu(-8))/uu/(uuu*(-6))((u/(uu(u(3/4)/u)/u))/u)/u assuming u is positive. u(-7/4) Simplify (w23)38/((w*18w)/(www/w*(-2/19)ww)) assuming w is positive. w(16342/19) Simplify ((tt0)(1/3)/(t(tt(t/(t0t))/ttt)/t)31)(-1/17) assuming t is positive. t(278/51) Simplify (b/(b/b10)b(-24))/((b/((b/(b/(b/b(-3/10))))/b)bb)/bb24/b) assuming b is positive. b(-387/10) Simplify (r(1/2)/r)(-48)/(r*16rr(-5/9)) assuming r is positive. r(68/9) Simplify t32/t34(tt(-15/8))/t13 assuming t is positive. t(-127/8) Simplify (((uu(u/(u(-1/15)u)uu)/uu)/u)/uu*(-5/2)(u(-6)/u)/u9)30 assuming u is positive. u(-493) Simplify (vv(-1/4)v*(10/3))/(((v/(vv/(v/((vv(-12)v)/v))))/v)/((v(vv*(-3/10))/vv)/vv)) assuming v is positive. v(-253/60) Simplify ((((k/(k/((kk/k*(-1/2)kk)/kkk)k))/k)(-37))46)(-1/2) assuming k is positive. k(5957/2) Simplify ((p*6p(-2/11)/p)/(p(-1/8)p(-3)))(12/5) assuming p is positive. p(2097/110) Simplify (((o/(o/o(-2/3)))(-31))28)(2/9) assuming o is positive. o(3472/27) Simplify (mm(-2/7)/m)/m(2/13)(mm(-9))/(m11m) assuming m is positive. m(-1860/91) Simplify (((l/(l(1/4)/l))/(l/((l/l(1/8)l)/l)))/((l(l/(ll*0l))/l)/l(-9)))(-2/19) assuming l is positive. l*(51/76) Simplify (jjj(-35))/j(-3/4)((jj(-3/19)/j)/j)/(jj(1/63)) assuming j is positive. j(-164821/4788)	{ "pile_set_name": "DM Mathematics" }
e of v(p). What is the third derivative of n(b) wrt b? 96b Let s(a) = 12a*2 - 2a + 1. Let j be s(1). What is the second derivative of b - j - 10b2 + 11 wrt b? -20 Let r be 436/(-6)(-15)/10. What is the third derivative of -ri2 + 5i5 + i5 + 114i2 wrt i? 360i2 Let f(q) = q3 - 4q2 + q + 3. Let g be f(3). Let h = 14 - g. What is the third derivative of 7m*3 - hm*3 + 8m*3 + 5m*2 wrt m? -12 What is the derivative of 2 - 125c - 104 + 103c - 67 + 176c wrt c? 154 Let h = 42 - 38. Find the second derivative of 0z2 - 186z + 174z - z2 + 8zh - z2 wrt z. 96z2 - 4 What is the second derivative of 154a*3 - 97a + 49a + 45a wrt a? 924a Find the first derivative of 188z + 73 + 33 + 135 wrt z. 188 Suppose 3c + 555 = 564. Let o(u) be the second derivative of -1/3u*4 + 0u*2 + 0 - 1/2u*c + 4u. What is the second derivative of o(l) wrt l? -8 Let u(c) = 143c2 + 138. Let l(d) = d2 + 1. Let b(r) = l(r) - u(r). What is the first derivative of b(g) wrt g? -284g Let u(r) = 1. Let z(f) = 215f4 + 2f*2 - 11f - 29. Let b(k) = -2u(k) + z(k). What is the second derivative of b(w) wrt w? 2580w2 + 4 Let s(a) be the second derivative of -a9/168 + 7a5/30 + a2 - 3a. Let l(j) be the first derivative of s(j). Find the third derivative of l(p) wrt p. -360p3 Let x be (-4)/((117/6)/(-13)). Let p(n) be the first derivative of -9 + xn*3 + 0n + 0n2 + 5/4n*4. Find the third derivative of p(q) wrt q. 30 Let r be (-21)/14(106/(-6) + 1). What is the third derivative of -rb5 - 4b*2 + 42b*5 - 19b*2 wrt b? 1020b*2 Let i(n) = 419n*3 + 363n*2 + 2. Let h(v) = 1676v*3 + 1451v*2 + 9. Let l(g) = 2h(g) - 9i(g). Find the third derivative of l(j) wrt j. -2514 Find the third derivative of -2s*3 - 126s*3 - 11s - 24s3 - 8s*2 wrt s. -912 What is the second derivative of -36k - 263k4 + 307k*4 - 178k*4 wrt k? -1608k*2 Let r(a) = -4a*2 - 1. Let j(i) = -3i*2. Let x(s) = -7j(s) + 3r(s). What is the first derivative of x(b) wrt b? 18b What is the third derivative of 2 - 2o5 + 13o*2 - 1134o*3 - 2o*4 + 1134o*3 + 9o*5 wrt o? 420o*2 - 48o Let q(m) = -3m - 8. Let a(x) = x. Let k(n) = 4a(n) + q(n). Let z be k(11). Differentiate -o - z + 4 + 7o wrt o. 6 Let n(t) = 2t*2 - 56t - 249. Let u(p) = -6p2 + 111p + 499. Let k(j) = 5n(j) + 2u(j). What is the derivative of k(l) wrt l? -4l - 58 Let d = 25 + -13. Let l be 4/d15 + -3. Find the first derivative of -106cl + 2 + 117c*2 - 1 wrt c. 22c Let j(t) = t*2 + t. Suppose 6y - 13y - 21 = 0. Let q(u) = 5u*2 - 7u. Let n(g) = yj(g) + q(g). Find the second derivative of n(d) wrt d. 4 Suppose -27p + 23p = 0. Let n(j) be the first derivative of 0j4 + j2 + 0j - 5 + 6/5j*5 + pj*3. Find the second derivative of n(b) wrt b. 72b*2 Let v = 16 + -14. Suppose -3z = 3c - 6, -z + v = 3c - 7c. Find the third derivative of 15h*6 + 18h*6 - 41h*6 - 3h*z wrt h. -960h*3 Let a(c) be the second derivative of -17c + 5c2 + c3 - 12c + 6c2 + 3c*2. What is the first derivative of a(h) wrt h? 6 Let x = -28 + 32. Find the second derivative of xh*4 - 7h + 15h + 6h*4 wrt h. 120h2 Let a(n) = -n2 + 4n + 1. Let q be a(3). Suppose 14 = v + qj, 2 = -j + 2j. What is the third derivative of -9b*v - 2b*2 - 3b*2 - 2b*6 wrt b? -1320b*3 Let f(r) = -3r*2 + 9r + 2. Let q be f(10). Let g be (-37)/(-13) - 32/q. Find the first derivative of 6 - 116t + 116t - 4tg wrt t. -12t*2 Let p(o) = -19o*3 - 22o*2 - 2o - 141. Let j(h) = -20h3 - 19h*2 - 2h - 143. Let f(x) = 7j(x) - 6p(x). What is the second derivative of f(z) wrt z? -156z - 2 Suppose -4q = -16, -5l + 4 = -2q + 2. Find the third derivative of -6x2 - x4 - 9x*4 + 0x*l wrt x. -240x Let l(c) = -577c4 - 2c*3 + 5c - 14. Let g(u) = 5u4 - u3 + u - 2. Let d(f) = -2g(f) + l(f). What is the second derivative of d(b) wrt b? -7044b2 Let v(i) = 14i*4 + 6i*3 - 8i*2 + 17i + 18. Let l(t) = t4 + t3 - t*2 + t + 3. Let j(u) = -6l(u) + v(u). Find the second derivative of j(y) wrt y. 96y2 - 4 Let p = -4 + 6. Let n(q) be the first derivative of -5/4q*4 + 0q*p - 4 + 0q + 4/3q3. What is the third derivative of n(d) wrt d? -30 Let m(j) = -j3 + j2 + j - 1. Let k(c) = -88c*3 + 5c*2 + 5c - 3. Let n(l) = -k(l) + 5m(l). What is the derivative of n(g) wrt g? 249g*2 Suppose 6w + 0w = 24. Let v be (-5)/(-3) + 3/9. Differentiate -2u*2 - v + 5u*2 + wu*2 - 3u*2 with respect to u. 8u Let f = -15 + 43. Let t be (4/14)/(2/f). Differentiate -2 + t + 0 - 12l wrt l. -12 Let v(c) = c3 + c2 - c + 4. Let b(u) = -260u*3 + 38u*2 + 22u - 88. Let o(q) = 2b(q) + 44v(q). Find the third derivative of o(s) wrt s. -2856 Let c(k) = -k*2 + 2k + 1. Let m(p) = -113p2 + 18p + 4. Let z(h) = -4c(h) - m(h). Find the second derivative of z(l) wrt l. 234 What is the second derivative of 22q*3 - 3617q*5 + 3622q*5 + 29q + 270q wrt q? 100q*3 + 132q Let u(k) be the second derivative of 4k + 0k*3 + 0k*5 + 0k*4 + 1/10k*6 + 0 + 5/2k*2. Find the first derivative of u(s) wrt s. 12s*3 Let n(u) = 0 + 5u - u*2 - 5 - 15u. Let q be n(-9). Find the first derivative of 2 + 8i4 - 10i*q + 6i*4 wrt i. 16i*3 Suppose 4i + i - 3m - 67 = 0, 4i + 4m - 28 = 0. What is the first derivative of 16y*2 - 11 + iy*2 - 21y*2 wrt y? 12y Let i be 6/(-8) - (-2115)/36. What is the second derivative of 111s - 38s*2 - 55s - is wrt s? -76 Let q = 17 - 19. Let m(f) = 41f*4 + 59f*2 + 11. Let h(n) = 8n*4 + 12n*2 + 2. Let i(l) = qm(l) + 11h(l). What is the third derivative of i(j) wrt j? 144j Let u(a) be the third derivative of -23a5/15 + 61a*4/12 - 66a*2. Find the second derivative of u(x) wrt x. -184 Let m(g) = -g - 15. Let d be m(-17). Let p(a) be the first derivative of -1 + 0a + da3 + 5/2a2. Find the second derivative of p(u) wrt u. 12 Let j(d) be the second derivative of d8/80 - 3d5/20 + 7d*3/2 - 17d. Let i(g) be the second derivative of j(g). Find the second derivative of i(m) wrt m. 252m2 Suppose -18t - 80 = -13t. Let h be (-141)/2t/24. What is the third derivative of -hf4 + 47f*4 - 10f*6 + 3f*2 wrt f? -1200f*3 Let d(j) = 3j*2 - 3j - 6. Let u be d(5). What is the third derivative of 4m3 - 27m*2 + 0m*3 + um*2 wrt m? 24 Let a be 43/9 + (-4)/(-18). Find the second derivative of 17g + 0ga - 3g*5 - 4g*5 wrt g. -140g*3 Let k(b) be the second derivative of -8b6/5 + b3/3 - 94b2 + 92b. What is the first derivative of k(r) wrt r? -192r3 + 2 Let w be (-3)/2(1 + -3). Suppose -5c = 3d - 32, w = 3c - 9. What is the second derivative of 2r*d + 5r*4 + 14r - 4r wrt r? 84r*2 Let r = 15 - 16. Let p be r(8/(-4) + 0). Differentiate -4 + 8 - 4m3 - 3 + pm*3 wrt m. -6m2 Let t be (-3)/(-1) + 2/(-6 + 8). Let u(o) be the second derivative of -o3 + 0o2 + 2o + 0 - 1/6ot. What is the second derivative of u(k) wrt k? -4 Let a(j) = -4j*4 + 49j*3 + 3j*2 + 63. Let q(x) = -5x*4 + 50x*3 + 4x*2 + 63. Let f(p) = -4a(p) + 3q(p). Differentiate f(c) wrt c. 4c*3 - 138c*2 Let l = -100 - -117. Find the second derivative of -l + 17u - 2u + 3u*5 + 17 wrt u. 60u*3 Let b = 17 + -13. Suppose -bx + 390 + 470 = 0. Find the second derivative of 5h5 - x + 215 + 4h + 2h5 wrt h. 140h*3 Let k(n) be the second derivative of 0n*2 + 0n*6 + 0n*5 + 0n*3 + 0n*7 + 22n + 3/4n8 - 3/4n*4 + 0. What is the third derivative of k(m) wrt m? 5040m*3 What is the second derivative of -27 - 33 + 140b*4 + 60 - 78b wrt b? 1680b2 Let k(w) = w3 - 2w*2 - 4w - 7. Let n be k(4). Find the third derivative of 3p2 + 9p*3 + np2 - p2 + 0p3 wrt p. 54 Let k(j) = 49j*4 - 3j*3 + 8j - 5. Let v(i) = -97i4 + 5i*3 - 15i + 11. Let a(h) = 5k(h) + 3v(h). Find the second derivative of a(l) wrt l. -552l2 Let c(z) = -112z*2 + 65z + 172. Let v(x) = 13x. Let u(r) = -2c(r) + 10v(r). Differentiate u(s) wrt s. 448s Let a(z) be the third derivative of -51z7/70 + 3z5/10 + z4/6 + 58z2. What is the third derivative of a(k) wrt k? -3672k Let	{ "pile_set_name": "DM Mathematics" }
(-48) Simplify (k3/kk/k(-2/9))30/((kk/(k/(k(1/7)k)k)k(1/3))/(k(-1/4))(-23)) assuming k is positive. k(8479/84) Simplify (((c*19c/(c*(-1/30)c))(-1/13))(2/3))(-8) assuming c is positive. c(4568/585) Simplify (h(-9/2)/(h/((h(2/15)h)/hhh))(h/(h/(hh(-2/7))h))(-4/21))26 assuming h is positive. h(-21099/245) Simplify ((m(-38)mmm(-2/21)/mm)/((mm(2/21))/mm)(2/39))(-20) assuming m is positive. m(592160/819) Simplify (((o(-9)o/(o/(o(o*(-5/4)/o)/o)o))12)(-15))(-3/25) assuming o is positive. o(-1323/5) Simplify ((c(8/13))(12/13)c/c(-3/20)c(-2/103))(17/3) assuming c is positive. c(10053137/1044420) Simplify ((b(2/7))*17/(b/(b(b*(15/8)/b)/bb)bb/(b/(b/(b/(b/b29))))))(-17) assuming b is positive. b(-31161/56) Simplify (j(-3/7)/(jj8jjjj))(-2/33)(j/(j/j(-3/4)))/j(-2/11)j1j6 assuming j is positive. j(6695/924) Simplify ((t/(t/(t(ttt(5/6)t)/t))tt*4/tt)/(t/t1)(-1/11))/(tt(-2/5)t*5t)(-1/34) assuming t is positive. t(2302/255) Simplify (jj(1/3)/jjj(-1/14)j(j(-1))(-13/4))/(jjj/j(-1/9)j(-1/21))(2/13) assuming j is positive. j(2359/468) Simplify ((z(-2/13)/z)/z(-8))(2/3)/((zz2)(-14/3))(-9) assuming z is positive. z(-4736/39) Simplify (j(-2)j((jjjj*(3/5)j)/j)/j)*(-2/57)(jj(2/5)j)*3/((jj/((j*(-3/11)jj)/jj))/(j(jjjj*(1/12))/jj)) assuming j is positive. j(137369/12540) Simplify f(-1/4)/(((f*(2/15)/ff)/ff)/f)(f/(f((ff*(2/17))/f)/f))/ff(ff*1)/ff((f(-1)f)/f)*(4/25)(f(1/5))14 assuming f is positive. f(31309/5100) Simplify (((h(-2/5))(2/41)/((((h(7/6)h)/h)/h)/((hh(-6))/h)))(-29))(-15/7) assuming h is positive. h(-31523/82) Simplify (hh(-5/4))/hh/h*(3/7)h(h/(h(-2)hh))13(h*(-3)h(6/11))(-12) assuming h is positive. h(13175/308) Simplify (((w4w0)/(w1)(9/2))(-2/33))(-23/2) assuming w is positive. w(-23/66) Simplify (f(-5)/(f/f2))/((ff*2/ff)/((f/(ff(f*(1/6)/f)/fffff))/f))(ff/(f(-5)/f)f(2/5))(-3/13) assuming f is positive. f(-5111/390) Simplify (x(1/2)/x)*19(x(-2/7)/x)/(x(1/5)x)(x(-1)/(x(-2/11)x))24 assuming x is positive. x(-42829/770) Simplify (k(3/5)/kk*5/kk)/(((k/(k(-2/3)/k))/k)/k5)(k/(k/(kk*(-2))k))*36(kk(kk/((k/k(1/4)k)/k))/k)/(k*(2/7)k) assuming k is positive. k*(-26503/420) Simplify (((rr(rr(9/4)/r)/r)/r(1/4))/(r*(3/11)/(rrr/r(-10))))(23/5) assuming r is positive. r(3979/55) Simplify ((ww*(-1/30)w(-24)/w)/(w(-33))49)(-18) assuming w is positive. w(-143367/5) Simplify (k1)(-11)/(k(-7)/kk2)(k(2/7))(-17/2)/(k*(-2)k/k0) assuming k is positive. k(-45/7) Simplify (((((z/((z*20/z)/z))/zz)/z18)47)(2/5))(3/20) assuming z is positive. z(-987/10) Simplify (k1/(k/k*(-2/19)k)(k/k0)(-38))/((k(-1))(2/51)/((k/k(2/13))/kkkk/k(1/5))) assuming k is positive. k(-2293907/62985) Simplify ((((w/w*(1/5)w)/www/(w*(-1/7)w))/(wwww(-1)w(w/w1)/w))(1/29))(-24) assuming w is positive. w(48/1015) Simplify ((ss*(-1/2)s)/s)/(sss*5)s1/(s(-7/3)/s)(s/s(1/5)ss)/((ss/s*(-1/3)s)/s)(s(2/9))(10/7) assuming s is positive. s(-871/630) Simplify ((q3qqq(q/(q/((qq*(-3))/q)q))/q)/(q(-1/4)/(q(3/7)q)))/(q7q(2/9))31 assuming q is positive. q*(-55745/252) Simplify ((z/(zzz(zz/z(3/10)zz)/z)z)/zz(-6)(z0)(-15/8))/(z*(-1)/zzzz*(-6)(z((z(-2/7)/z)/z)/zz)/(z/z(2/5))) assuming z is positive. z(-197/70) Simplify ((b/(b*(-1/7)bb)b(-5))/(b1)*(14/9))/((b(b((b/b1)/bb)/bb)/b)/b(-3/5)bb(-1/2)b/b(2/7)) assuming b is positive. b(-6443/630) Simplify (k(-7))33/((kk(-19/6)k)/k12) assuming k is positive. k(-1307/6) Simplify ((s*(-4/5)s/(s/s*(-13)s))/(s*(1/12)sss(ss/s*(-5/3)ss)/ss))20 assuming s is positive. s(-471) Simplify (g(1/3)/g(-1))*(-10/3)(((g/g*(-3/5))/gg)/(gg1g))(-2) assuming g is positive. g(-74/45) Simplify ((b/(b/((b*2b)/b)))(-1/11))(-3/7)(b/(b/b(-10/3))b(-1/2))35 assuming b is positive. b(-61949/462) Simplify (m(2/9)/((mm(-1/16))/m))/(m4m*(-1/11))(m/(mm(6/11)mm))/m(2/19)m*(-5/6)(m*1/mm)/m assuming m is positive. m(-213935/30096) Simplify ((y/(y/y(-1)))49)(14/11)((y4y)/yy(-3)y)/(y0)34 assuming y is positive. y(-664/11) Simplify g(2/3)g(-5)(gg(3/5))/g(-1/8)(((g/(g(g/(gg*(2/13))g)/gg))/g)/((g(-3/2)/g)/g))(28/9) assuming g is positive. g(11873/4680) Simplify (((k/(kk*(-5/4)k))/((k*(-15/4)/k)/kk))48)(-17) assuming k is positive. k(-4080) Simplify ((s4)*(3/17)((s(-14)/s)/s)/(s/s(2/27)))(-5/6) assuming s is positive. s(37225/2754) Simplify ((v0)(1/11)/((v/(v/(vv(-26))))/(vv/((v/(v/v*9vvv)v)/v)v)))(-44) assuming v is positive. v(-968) Simplify ((pp/p(-25))/p(2/7)(p/((((pp/(p14/p))/p)/p)/pp))5)(-11/6) assuming p is positive. p*(-7447/42) Simplify (((((oo/((ooo*(1/13)o)/o)o)/o)(1/27))(-10))(1/3))37 assuming o is positive. o(370/1053) Simplify ((t(2/5))(-5)/(t0t(-2/3)))/(t7/((t/t*5)/t)t*(3/8)ttt(-6/5)) assuming t is positive. t(-1741/120) Simplify (((h*(2/3)/hhh)/h)(8/7)/(hh*(-6/5)hhh(-2/23)))4 assuming h is positive. h(-9188/2415) Simplify (z(1/6)(((z/z(2/13))/z)/z)/zz)/(z((z(-37)z)/z)/z)2 assuming z is positive. z(5695/78) Simplify (((k*3k)/k)/kk7(k(2/5))(-16))/((k(-1/2))(-29)/(k/((k*(-5)k)/k)kkk(-3/4))) assuming k is positive. k(-93/20) Simplify ((sss(-34))(-29)/(s(s/(ss24s))/sss/s*(-41)s))(4/5) assuming s is positive. s(3636/5) Simplify ((r/(r/(r/r*(-1/2)rr)))(-38)/((rr*(5/3))/rr*2r))/(((rrr*(-6)rr)/(r/r(-1/3)r))/(r/r(-1))(2/69)) assuming r is positive. r(-9196/69) Simplify ((u/u(-1))28)(1/86)/(u*8u*3uu(-2/31)uu(-2/5)) assuming u is positive. u(-79209/6665) Simplify (b(-4)/bb(-1/4))(43/3)(b(-2/3)/bb)*(-7)/(b/(b/(bb*3))b2) assuming b is positive. b(-919/12) Simplify (((u/u(1/3))/u)(-26)(u1/u)(-48))/((u(-1/3))(-1/41)/(u(2/7))(-2/147)) assuming u is positive. u(365131/42189) Simplify ((d/d(2/11))42(d0)(-18/7))(-47) assuming d is positive. d(-17766/11) Simplify ((ii/(iiii/(i/i*(-2/9))i)i7i)/((i/((i/i*(-7))/ii)i)/i(-1/2)))/((i(-7/2)/i)/(i(-1/13)i))35 assuming i is positive. i(23579/117) Simplify (d*30d/(d*(-2/59)/d))/(dd*(-28)d)(-1) assuming d is positive. d(356/59) Simplify (r*(-6)/(rr*11)r/((rr(-13))/r)r8)(-6/11) assuming r is positive. r*(-24/11) Simplify ((jjjjjjj/(jj/(j/j*(5/4))j)jjj/((jj*(2/3)j)/j))/(jj/j1)(-30/11))/((jjj(-2/5))(-12))(1/2) assuming j is positive. j(11491/660) Simplify (b1)(1/12)/(b/b(-2))5((b*(-2/5)b)/b)/bb(-2/5)bb7/bbbb/(b/(bbb(-3/4))) assuming b is positive. b(-97/15) Simplify (((y(2/5))(1/14)(((y4y)/y)/yyy)/y(-7))(-1/51))(27/5) assuming y is positive. y(-3789/2975) Simplify (((f*(-6)f)/f*(7/6))/(ff*(-2/77)f/f(-2/43)))44 assuming f is positive. f(-325294/903) Simplify ((s7/(ss(-2/5)s))/(s*(-3/8)(ss/(ssss/s*2))/s))/((ss/(s/s(2/37)))/(s(5/4)s))(-2) assuming s is positive. s(6487/1480) Simplify ((y(-4/5)y(-2/15))/(y(-4)(y/(y(2/7)y))/yy))/((y(-2/5))(-37)((yyy(-2/5))/y)(-29)) assuming y is positive. y(125/21) Simplify (b11/(((bb(2/25)b)/b)/b))*(-2/9)(b*(7/2)/((bb/(bb8)b)/b))/(b*1(((b*8/b)/bb)/b)/b) assuming b is positive. b*(311/150) Simplify ((mm/((m/m*(-3/10))/m)mm/(mm(m/(m(m/m*(2/21))/m))/mm))/(m/((m*(8/11)m)/m)m20/mm))7 assuming m is positive. m(-43123/330) Simplify (x/(x*6/x)(xx(-3/5))/x(x/((xx(-1)x)/xx)x)(-20))(2/99) assuming x is positive. x*(-82/165) Simplify ((nnn2/nn)*(4/5)n/n*(2/9)n(-5))/(((n/n(3/4))/n*(-1/2))/((nn*(2/5)n)/n(-7))) assuming n is positive. n(1373/180) Simplify ((q/(q*7/q))/qqq*(8/7)/q)/(q	{ "pile_set_name": "DM Mathematics" }
(-5 + 0 + sqrt(396))*2). -183sqrt(11) + 1281 Simplify -3 + (sqrt(49)/(sqrt(14)/sqrt(2)))*2 + (sqrt(42) + (sqrt(42) - sqrt(504)/(sqrt(192) + sqrt(12) - sqrt(12))))/sqrt(6). 4 + 7sqrt(7)/4 Simplify 1(4 + -31(-2 + sqrt(171)) + -5). -9sqrt(19) + 5 Simplify ((sqrt(320) + sqrt(320) + -1 + sqrt(320) + 2 - sqrt(320) - (sqrt(320) + sqrt(320) + 1 + sqrt(320))-5)-5)*2. 40800sqrt(5) + 2312900 Simplify (sqrt(1458) - (sqrt(1458) - sqrt(1458)-1))/(-2sqrt(225)) + sqrt(72)15-4. -1191sqrt(2)/10 Simplify (sqrt(450)4 + sqrt(18))/(sqrt(9) + -1sqrt(81)). -21sqrt(2)/2 Simplify -1(sqrt(51)/(sqrt(6)/sqrt(2)) + (2sqrt(612) - sqrt(612)) + 0)2. -833 Simplify (-4 + (sqrt(684)-4 - sqrt(684)) + sqrt(684) + sqrt(684)-4 + sqrt(684) + sqrt(684) + 4)2. 24624 Simplify -4 + sqrt(132)/(sqrt(12)/sqrt(4)) - ((5(sqrt(11) + sqrt(33)/sqrt(3)))*2 + (3 + sqrt(11)-2 - sqrt(11))). -1107 + 5sqrt(11) Simplify ((5(sqrt(528) + 1sqrt(528) + sqrt(528)) + sqrt(528))/(-1sqrt(99)))*2-3. -4096 Simplify sqrt(20)/sqrt(36) + sqrt(45)/(sqrt(36)/sqrt(4)) + (sqrt(5)2 + -5 - 5sqrt(20))*2 + -2. 244sqrt(5)/3 + 343 Simplify 0 + (sqrt(13) - sqrt(117))4 + 5 + (sqrt(13) - 2sqrt(13)) - (2 + 1sqrt(208) + sqrt(52))2. -467 - 33sqrt(13) Simplify ((-2sqrt(130)12)/((2sqrt(90) + sqrt(90))5))2. 208/2025 Simplify ((sqrt(135) - -1sqrt(135))/sqrt(3))/(sqrt(9) - sqrt(27)/sqrt(3)-6)-63. -36sqrt(5)/7 Simplify (sqrt(114) - sqrt(114)-3)/sqrt(6) + ((3sqrt(19) + 5)*2 - sqrt(19)) + -1 + 1. 33sqrt(19) + 196 Simplify (sqrt(33)/(sqrt(33)/sqrt(3)) + 4)*2 - (sqrt(9)/(sqrt(3) + sqrt(3) + 2sqrt(363)))*2. 8sqrt(3) + 3647/192 Simplify -4 + (sqrt(77) + (sqrt(77) - (-6(sqrt(77) - 3sqrt(77)) - sqrt(77))))/(4sqrt(7)-2). -4 + 9sqrt(11)/8 Simplify (0 + sqrt(162) + -3 + 5 + sqrt(162)4 + sqrt(162) + -4)*2. -216sqrt(2) + 5836 Simplify -1(0 + sqrt(11)-1 + (3 + (sqrt(11) + 3)*2 - sqrt(11))). -23 - 4sqrt(11) Simplify -5 + sqrt(80)/sqrt(4) + 4 + sqrt(320) + -2 + -5. -8 + 10sqrt(5) Simplify (1 + (sqrt(3) - sqrt(240)/sqrt(5)) + sqrt(3) + sqrt(3))2 - (sqrt(147) + sqrt(147)2 + -5 - sqrt(147) - sqrt(147)). -9sqrt(3) + 9 Simplify -5(((-6(sqrt(2057) + -2) + sqrt(2057))2 - sqrt(2057)) + 0 + sqrt(2057)1)5. -1289225 + 33000sqrt(17) Simplify (1 + (3 + sqrt(3) + (-2sqrt(27))/sqrt(9))2)*2. -28sqrt(3) + 61 Simplify (3-2(-1 + sqrt(13)) - ((sqrt(104)/sqrt(2) + sqrt(52) - sqrt(52))5)/sqrt(4))2. -132sqrt(13) + 1609 Simplify (4 + 1 + -5 + -2sqrt(448)3 + 1)*2. -96sqrt(7) + 16129 Simplify ((-1(-1 + sqrt(32)) - sqrt(32))2 - (-1sqrt(384) + sqrt(384) - sqrt(384))/sqrt(12))-1. -129 + 12sqrt(2) Simplify (3((sqrt(2299) + 0)2 - sqrt(2299)) - (sqrt(2299) + (sqrt(2299)-1 + 4)*2 + sqrt(2299) + sqrt(2299)))-4 + -4. -18332 - 88sqrt(19) Simplify (((sqrt(170) - (sqrt(170) - (sqrt(170) - sqrt(170)1-5)))-6)/(-1sqrt(360) - (sqrt(50)/sqrt(5) - sqrt(10))-2))*2. 612 Simplify (-1 + (sqrt(300)-2 + sqrt(300) + sqrt(300))4 + sqrt(300) + -2 + 0)2. -60sqrt(3) + 309 Simplify (sqrt(7056)-1-1)/((sqrt(567) - 4sqrt(567))-6). 2sqrt(7)/27 Simplify -4(sqrt(190) + (-1sqrt(190) + sqrt(190))3 + sqrt(190))/(sqrt(10)1-5). 8sqrt(19)/5 Simplify (sqrt(35)-66)/((sqrt(240)/sqrt(6))/sqrt(8) + sqrt(5))-2. 36sqrt(7) Simplify (sqrt(33)/(sqrt(3) - sqrt(24)/(sqrt(8)-2)) - (1sqrt(539) + -2))2. -76sqrt(11)/3 + 4007/9 Simplify ((sqrt(1539) + (sqrt(1539) - (sqrt(1539) + sqrt(1539)2))3)*2 - (-2(2 + sqrt(1539)))*2)4. -576sqrt(19) + 129212 Simplify (6(sqrt(65) + sqrt(65)-16))/(2sqrt(320) - (sqrt(5) - (sqrt(5) + 1sqrt(605)))). -10sqrt(13)/9 Simplify 3((sqrt(1100) - (1 + sqrt(1100)))2 - (((sqrt(77) + (sqrt(77) - sqrt(77)2) + sqrt(77) + sqrt(77) + sqrt(77) + sqrt(77))3)/sqrt(7))2). -4758 Simplify (-2(sqrt(450) + -4 + sqrt(450) + -5))*2 + 3. -2160sqrt(2) + 7527 Simplify (sqrt(96)1 - sqrt(96) - 2sqrt(24))/((6(sqrt(9) - -1sqrt(9)))/sqrt(3)). -sqrt(2)/3 Simplify ((-1sqrt(143) - sqrt(143))-2)/(sqrt(176)5) + (((sqrt(78)2 + sqrt(78))4)/(sqrt(60)/(sqrt(10) + sqrt(10)1 + sqrt(10))))*2. sqrt(13)/5 + 16848 Simplify ((5 + sqrt(252)-2-1 + -1 + ((sqrt(252) + -2sqrt(252))-5 + sqrt(252) - sqrt(252)))3)*2. 3024sqrt(7) + 111276 Simplify 3 + (sqrt(396) - 5(sqrt(396) + 2sqrt(396)))/(sqrt(90)/(1sqrt(10))). -28sqrt(11) + 3 Simplify 4(-5 + ((sqrt(216) + 1sqrt(216) - sqrt(216) - sqrt(216))/sqrt(6) - sqrt(36))/sqrt(12)). -20 - 4sqrt(3) Simplify (3(sqrt(209) - (-1sqrt(209) + sqrt(209))))/((-1sqrt(77) - sqrt(77))/sqrt(7) + sqrt(11)) + 1. -3sqrt(19) + 1 Simplify (-5 + (-1 + sqrt(891) + -2)4 + 1 + -1)*2. -1224sqrt(11) + 14545 Simplify (-3 + 1sqrt(468) - (-5 + sqrt(468) + 1 + sqrt(468)) - ((1 + sqrt(468))-4 + (1 + sqrt(468))-6))2. 1188sqrt(13) + 38029 Simplify ((sqrt(3) + 0)6 + (sqrt(3) - sqrt(48)))-2. -6sqrt(3) Simplify ((sqrt(121) + sqrt(121) + (1sqrt(121) - sqrt(121))-6)/(sqrt(99)4))*2 - (((sqrt(132)2 + sqrt(132))-2)/(sqrt(36)/sqrt(3)4))*2. -220/9 Simplify (2sqrt(84)2)/(sqrt(1728) + (-4sqrt(1728) - sqrt(1728)) + sqrt(1728) + sqrt(1728)). -sqrt(7)/6 Simplify (-1sqrt(4000))/sqrt(8) + (sqrt(5) + ((sqrt(35) - (sqrt(140) - sqrt(35)))/sqrt(7))2 + sqrt(5) + sqrt(5))4 + -2. -2 + 2sqrt(5) Simplify 1 + 0 + sqrt(15)/(sqrt(30)/sqrt(10)) + 5. sqrt(5) + 6 Simplify -1 + ((sqrt(1300) + -1sqrt(1300) + sqrt(1300) + sqrt(1300))-4)2 + -3 + (sqrt(637)1)*2 + 3. 83836 Simplify -1 + (-6sqrt(60)-5)/(sqrt(972) - (sqrt(972)-2 + sqrt(972))). -1 + 5sqrt(5)/3 Simplify sqrt(700) + 1 + 4 - (-5 + sqrt(700) + -1). 11 Simplify (-4 + 1(sqrt(425) + sqrt(425)2) + 5)2. 30sqrt(17) + 3826 Simplify 0 + (((6(sqrt(112)-2 - sqrt(112)) - sqrt(112) - sqrt(112))/sqrt(8))/(sqrt(98) + 3sqrt(98)-1 + sqrt(98)))*2. 400/7 Simplify (-3 + 3-6(sqrt(300)2 + -3 + 2sqrt(300) + 1))2. -47520sqrt(3) + 1556289 Simplify ((-2-1sqrt(152) + sqrt(152))/(sqrt(64)/(sqrt(72)/sqrt(9))))*2. 171 Simplify 6-5((4 + sqrt(605)-2 + 1)-4)2. -1173600 + 105600sqrt(5) Simplify (5 + 1 + 3sqrt(60)/(-2sqrt(12)-1) + -3)2. 9sqrt(5) + 81/4 Simplify ((sqrt(66)/sqrt(2) + sqrt(33))-5)/(sqrt(88)/(sqrt(16)/sqrt(2) + sqrt(8))). -20sqrt(3) Simplify (-3(sqrt(147) + -1)-3 - (0 + (sqrt(147) - -6(sqrt(147) + -1))))2. -84sqrt(3) + 597 Simplify -6(-1 + (-2sqrt(512) + 5 + -3)*2). -12306 + 768sqrt(2) Simplify (((4 + (sqrt(1053) - (3 + sqrt(1053))) - sqrt(1053))*2 + sqrt(1053) - sqrt(1053)) + sqrt(1053) + (sqrt(1053) - 6(sqrt(1053)-1)2))6. -31584 Simplify (sqrt(63)/sqrt(28) - (sqrt(72)-2)/sqrt(8))/(((-1sqrt(192) - sqrt(192)) + sqrt(192))6). -5sqrt(3)/96 Simplify (-41sqrt(6336)25-6)2. 364953600 Simplify (-1sqrt(3024)-4)/((sqrt(2430) + -2sqrt(2430))/sqrt(10)). -16sqrt(7)/3 Simplify (sqrt(700)-3 + sqrt(700) + -4 + sqrt(700))*2 - (-4 + sqrt(7) + 1sqrt(7) + 4). 78sqrt(7) + 716 Simplify (2(-3 + ((sqrt(132)2 - sqrt(132)) + sqrt(132))/(-5(-2sqrt(11) + sqrt(11)))))2. -96sqrt(3)/5 + 1092/25 Simplify (1 + (-3sqrt(833) + 1 - sqrt(833))-6 + 3)*2. -672sqrt(17) + 479812 Simplify (sqrt(950)-25)/(2sqrt(8)/sqrt(4)2). -25sqrt(19)/2 Simplify (1(sqrt(144) - sqrt(16))1)/(1(sqrt(32)-1 + sqrt(8))). -2sqrt(2) Simplify -3 + (1sqrt(1053)3 + sqrt(1053) - (1sqrt(1053) + -1))2. 54sqrt(13) + 9475 Simplify sqrt(104)/((sqrt(16) - (sqrt(48)/sqrt(3) + sqrt(16)))/sqrt(2))-6 - (((sqrt(117) + -1 - sqrt(117)) + sqrt(13)2 + 5)*2 + -3). -65 - 10sqrt(13) Simplify (sqrt(7) - sqrt(84)/sqrt(3)) + -5 + (((sqrt(42) - -1sqrt(42))/sqrt(6) + sqrt(7) + sqrt(7))2 - -1sqrt(7)-6). -7sqrt(7) + 107 Simplify (sqrt(147) + (sqrt(147) - 2(2 + sqrt(147))2))42. -2416 - 336sqrt(3) Simplify sqrt(18)/((sqrt(36)/sqrt(3))/sqrt(2) + sqrt(6)) + sqrt(3) + (sqrt(72)/sqrt(3))/sqrt(8) + 0. 5sqrt(3)/2 Simplify ((sqrt(91) - -2sqrt(91))-6 + -6sqrt(91)2)/(sqrt(700)-1-5). -3sqrt(13)/5 Simplify (4-1sqrt(189))/(sqrt(6)/(sqrt(2) + -2sqrt(2))). 12sqrt(7) Simplify 6(-1 + -2 + 1 + sqrt(176) + sqrt(176) + -2 + (sqrt(176) + 1)-2 + sqrt(176))*2. -288sqrt(11) + 1272 Simplify 3(-2sqrt(76))*2 + -2 + 2sqrt(19) + 2sqrt(76). 6sqrt(19) + 910 Simplify 4((-5(sqrt(832) + 2 + sqrt(832)) - sqrt(832)) + -6(-2 + sqrt(832)))26. -13056*sqrt(13) + 5770848 Simplify (sqrt(99) + (sqrt(99)	{ "pile_set_name": "DM Mathematics" }
15 Let t = -1 + 5/4. Let u be 84/(-12) + (-1 - -9) - (-9)/(-12). Factor -ux - tx*2 + 0. -x(x + 1)/4 Let j = -94739/4368 + 282/13. Let d(f) be the third derivative of -5f2 + 0f*4 - 1/105f*7 + 0 + 0f*3 + 0f*5 + jf*8 + 0f + 1/120f6. Factor d(p). p3(p - 1)*2 Suppose -74s - 3 = -75s. Let -4y - 4ys - 18y*4 - 25y*3 - 4y*5 - 18y2 + y3 = 0. Calculate y. -2, -1, -1/2, 0 Let v(k) be the third derivative of -1/224k8 + 1/16k*4 + 0k + 0k6 + 0k*3 - 12k*2 - 1/20k*5 + 0 + 1/70k*7. Factor v(s). -3s(s - 1)3(s + 1)/2 Let j(a) be the third derivative of -a7/315 + a5/30 + a*4/18 + 20a*2 - 4. Factor j(t). -2t(t - 2)(t + 1)*2/3 Factor 0 + 12/17q*3 + 16/17q*2 - 2/17q*5 + 0q*4 + 6/17q. -2q(q - 3)(q + 1)3/17 Let d = -5 - -14. Suppose -2g + 15 = d. Determine j so that 3/5j4 - 3/5j*5 + 9/5j*3 + 6/5j + 0 - gj2 = 0. -2, 0, 1 Let x(h) be the second derivative of -h7/21 + h6/15 + h5/2 - h4/6 - 8h*3/3 - 4h*2 - h + 15. Determine f so that x(f) = 0. -1, 2 Let x = -7389 - -7393. Suppose 3/2j + 0j3 + 0 - 3/4j*x + 9/4j*2 = 0. Calculate j. -1, 0, 2 Let w(h) be the first derivative of 3/5h*3 + 0h*2 + 0h - 3/20h4 + 6. Find i, given that w(i) = 0. 0, 3 Let h = 5372 + -5370. Find y, given that -12/7y + 1/7yh + 36/7 = 0. 6 Let b = -13 - -16. Suppose 0 = -4y + 2y - 2, -5 = -2a - by. Solve -2s*3 - 4s*2 + a + 0 + 0s*3 + 2s = 0. -2, -1, 1 Factor -148955/3j - 5/3j*4 + 0 - 155j*3 - 4805j*2. -5j(j + 31)3/3 Let a(h) be the third derivative of 5h*8/504 + 67h*7/945 + 101h*6/540 + 19h5/90 + h4/27 - 4h3/27 - 24h*2 + h. Suppose a(f) = 0. What is f? -2, -1, -2/3, 1/5 Let k = 2049/100 - 506/25. Let -t + kt*2 + 1 = 0. What is t? 2 Let g(w) be the second derivative of 3w*5/20 - 2w*4 + 5w*3/2 + 75w*2 - 37w. Factor g(q). 3(q - 5)2(q + 2) Let c(b) = b*2 + 6b + 7. Let f be c(-5). Suppose 0 = 3a + 5y - 11, fy - 4 = -4a + 6y. Find i, given that -6 - 4i - 2/3ia = 0. -3 Factor -21t + 1744748 - 1744748 + 3t3 + 18t*2. 3t(t - 1)(t + 7) Let h(u) be the second derivative of u*4/3 - 10u*3/3 + 8u*2 + 139u. Find p such that h(p) = 0. 1, 4 Let t(l) be the second derivative of l6/60 - l5/8 + l*4/8 + 3l*3/4 + 47l - 1. Determine g so that t(g) = 0. -1, 0, 3 Let p = -9/4 + 73/36. Let r = p - -5/9. Factor 2/3i3 + 2/3i*2 - ri*4 - 1/3i*5 - 1/3i - 1/3. -(i - 1)*2(i + 1)*3/3 Find l, given that -74/3l*2 + 14/3l*3 - 8 + 104/3l = 0. 2/7, 2, 3 Factor 0 + 5/2g3 + 50g - 105/2g2. 5g(g - 20)(g - 1)/2 Let v(c) be the second derivative of -c7/210 - c6/120 + c5/60 + c4/24 - 5c2 + 13c. Let o(x) be the first derivative of v(x). Factor o(m). -m(m - 1)(m + 1)*2 Let l(n) = -16n*2 + 34n - 33. Let c(m) = -3m2 + 7m - 6. Let z(g) = -22c(g) + 4l(g). Factor z(b). 2b(b - 9) Let t(n) be the second derivative of -2n6/15 - 9n*5/5 - 8n*4 - 32n*3/3 - n + 101. Let t(z) = 0. What is z? -4, -1, 0 Let a(s) = 59s*2 + 205s + 60. Let g(y) be the third derivative of y*5/3 + 17y*4/6 + 10y*3/3 + 15y*2. Let q(c) = 6a(c) - 17g(c). Factor q(i). 2(i + 5)(7i + 2) Factor 51/4 + 12n - 3/4n*2. -3(n - 17)(n + 1)/4 Let o = 18 - -67. Suppose 4x - o = 2k - 19, 43 = 3x + 5k. What is a in -xa*2 - 15a*2 - 6 + 4a*2 + 21a - 3a4 + 15a*3 = 0? 1, 2 Suppose -10x + 12 = -6x. Suppose 0 = xd + 9, -2j = -3d - 13. Determine i, given that 6i3 + 10i*4 + 0i - 10i2 + ji - 4i5 - 4i*5 + 0i = 0. -1, 0, 1/4, 1 Factor 4/5j2 + 0 - 4/5j*4 + 16/5j*3 - 16/5j. -4j(j - 4)(j - 1)(j + 1)/5 Let p(b) be the second derivative of 37/90b5 + 1/189b*7 - 10/9b*4 + 0b*2 + 0 - 2/27b*6 - 28b + 4/3b3. Solve p(l) = 0. 0, 2, 3 Let q(f) = -34f*2 + 474f + 30. Let x be q(14). Factor -3/2yx + 0 - 3/2y. -3y(y + 1)/2 Let m be ((-256)/(-80))/(5 + (-1 - 158/40)). Determine s, given that 4s4 + 76s*2 + 25s*3 + 112s + 1/4s5 + m = 0. -4, -2 Let t = 7 - 2. Let r(q) = q + 9. Let y be r(-7). Determine n so that 12n*2 - tny + n3 - 3n2 = 0. -4, 0 Let m(u) = -29u*2 + 105u + 9. Let j(t) = -13t2 + 52t + 4. Let p(r) = 9j(r) - 4m(r). Factor p(f). -f(f - 48) Let v(f) be the third derivative of 0f - 10f2 + 10/3f*3 + 0f*4 + 0 - 1/4f*5 + 1/24f*6. Factor v(w). 5(w - 2)*2(w + 1) Let n(x) be the third derivative of -x*6/40 + 7x*4/8 - 3x*3 + 234x*2. Determine u, given that n(u) = 0. -3, 1, 2 Factor 0 + 2/15c*4 + 2/3c*3 + 2/5c*2 - 6/5c. 2c(c - 1)(c + 3)2/15 Let f be 2/3 + 102/15. Determine u, given that -5/3u + 0u*f + 5/3u3 + 0 = 0. -1, 0, 1 Let q(s) be the first derivative of s4/16 + s*3/4 - s + 2. Factor q(l). (l - 1)(l + 2)2/4 Let u(f) = -f - 1. Let m(n) = n2 - 18n - 2. Let v(i) = 5m(i) - 10u(i). Let v(t) = 0. What is t? 0, 16 Solve -4 + 2801r*5 + 5r*4 + 2 + 2 - 2800r*5 + 4r*3 = 0. -4, -1, 0 Factor -4r*3 - 10r*4 - 2 + 241r*2 - 229r*2 - 2r + 2r5 + 4r*5. 2(r - 1)*3(r + 1)(3r + 1) Let b = -128/13 + 9229/936. Let r(s) be the third derivative of 0s - 7s*2 + bs*4 + 1/9s*3 - 1/180s*5 + 0. Determine w, given that r(w) = 0. -1, 2 Let z = -1466/5 - -5879/20. Let -3/4i + 1/2i3 + 1/4i*5 - 1/2i*2 + zi4 - 1/4 = 0. Calculate i. -1, 1 Let k(a) = a2 - 4a - 3. Let b be k(7). Let z = 21 - b. Find d, given that -2 - 2d - d - zd2 + 2d*2 = 0. -2, -1 Let -5/7v*3 + 0 - v + 13/7v*2 - 1/7v*4 = 0. What is v? -7, 0, 1 Let h = 178/93 + -1876/775. Let x = 4/25 - h. What is i in 1/3i*2 + 0 - xi = 0? 0, 2 Let x(r) be the third derivative of -r10/378000 - r9/75600 - 17r5/60 - 18r*2. Let q(y) be the third derivative of x(y). Factor q(o). -2o*3(o + 2)/5 Let x(p) be the second derivative of -p*5/4 + 5p*4/2 - 15p*3/2 + 106p. Factor x(q). -5q(q - 3)*2 Suppose 112 + 4/7z*2 + 16z = 0. What is z? -14 Let q = 1/5172 + 31025/36204. Factor -12/7j2 - 27/7j - q. -3(j + 2)(4j + 1)/7 Let h(x) = 2x - 13. Let k be h(11). Let q = 11 - k. Determine j so that -q - 5j - j + 2j*5 - 2j*4 - 4j*4 + 4j*3 + 4j2 + 4 = 0. -1, 1 Let o(r) be the second derivative of r6/24 + r*5/3 + 5r*4/8 - 23r*2/2 - 3r. Let l(i) be the first derivative of o(i). Determine s so that l(s) = 0. -3, -1, 0 Let g = 2204/23 - 33014/345. Factor -4/15d2 + 2/15 - 4/15d*3 + 2/15d + 2/15d4 + gd*5. 2(d - 1)*2(d + 1)3/15 Let u(x) be the first derivative of x6/3 - 76x5/15 + 32x*4/9 + 68x*3/9 - 73x*2/9 + 8x/3 + 345. Suppose u(r) = 0. What is r? -1, 1/3, 1, 12 Let f(t) be the second derivative of 6859t5/12 - 1805t*4/4 + 285t*3/2 - 45t*2/2 + t + 55. Factor f(k). 5(19k - 3)3/3 Factor 48/5m*3 + 0m + 16m2 + 0 + 4/5m*4. 4m*2(m + 2)(m + 10)/5 Suppose -58/5b*2 - 42/5b*3 - 4/5 - 2b*4 - 6b = 0. Calculate b. -2, -1, -1/5 Let o(b) be the first derivative of -5 - 1/3b3 + 1/4b4 - b2 + 0b. Determine p so that o(p) = 0. -1, 0, 2 Let m = 624 - 6239/10. Factor 1/5c*4 + 0 - 1/10c*3 - mc*5 + 0c + 0c2. -c3(c - 1)*2/10 Suppose s = -5 + 20. Suppose -p + s = -5r, -2r = 6 - 0. Factor 0v + p + 1/2v2. v2/2 Find z, given that 0z + 1/3z4 + 1/3z*3 + 0 + 1/9z*2 + 1/9z*5 = 0. -1, 0 Let d be (-250)/(-100)(-12)/(-15). Factor 3x3 + 3/4x*4 + 27/4 - 9x - 3/2xd. 3(x - 1)*2(x + 3)2/4 Let k(s) be the second derivative of s6/30 + 19s5/100 + 7s4/20 + s3/6 - s*2/5 + 127s. Solve k(y) = 0 for y. -2, -1, 1/5 Let x = 65 - 60. Let a(r) = -3r3 - 3r*2 - 4r. Let t(h) = 3h3 + 4h*2 + 5h. Let w(u) = xt(u) + 6a(u). Factor w(f). -f(f - 1)(3f + 1) Let i(x) be the first derivative of 26 + 0x*2 + 5/4x*4 - 5/3x*3 + 0x. Factor i(w). 5w2(w - 1) Let v(a) be the third derivative of -a*5/15 - 3a*4/2 - 40a*3/3 + 8a*2 + 12. Factor v(y). -4(y + 4)(y + 5) Let d(m) be the first derivative of 4m*3/3 + 10m*2 - 24m + 455. Solve d(f) = 0 for f. -6, 1 Solve -3969 + 25f + 2434f*2 + 101f - 1219f2 - 1216f*2 = 0 for f. 63 Let l = -1/5819 + 110567/34914. Find z, given that -3/2z*3 + 1 - lz + 7/2z2 + 1/6z4 = 0. 1, 6 Let f(y) = y3 + y*2 - 2y + 1. Let r(c) = c*4 + 6c	{ "pile_set_name": "DM Mathematics" }
n 7 is divided by s. 3 Suppose 0 = -5j + 2j + 39. Calculate the remainder when 258 is divided by j. 11 Let o(t) = t*3 - 7t*2 + 4. Suppose -x - 4a + 15 + 4 = 0, 0 = -5x - 3a + 44. Calculate the remainder when 15 is divided by o(x). 3 Let m be ((-32)/20)/(2/35). Let z be (4/8)/(2/m). What is the remainder when 47 is divided by (-2)/z - 220/(-14)? 15 Suppose -3u + 7u = 16. Calculate the remainder when 15 is divided by u. 3 Suppose -5q - 5p - 250 = -3p, 5q = -5p - 265. What is the remainder when 11 is divided by 10/(-4)q/20? 5 Suppose 0 = -2k - 5y + 54, 2k - 7k + 4y + 135 = 0. Suppose 3i - 86 = -41. What is the remainder when k is divided by i? 12 Suppose k - 2t = 37, -3k + 18 = 2t - 85. What is the remainder when 68 is divided by k? 33 Suppose 3m - 42 - 6 = 0. What is the remainder when 30 is divided by m? 14 Let f(z) be the second derivative of -z*4/12 + 7z*3/3 + 7z*2/2 - 2z. Suppose 12 = -2p + 3p. What is the remainder when f(10) is divided by p? 11 Let t = -30 - -35. Calculate the remainder when 13 is divided by t. 3 Suppose 2w = 4w + 8. Let u = 23 + w. What is the remainder when 35 is divided by u? 16 Let l(v) = v*2 - 5v + 8. What is the remainder when 30 is divided by l(5)? 6 Suppose 0 = -3x - 4s + 174, -3s + 285 = 5x + 2s. What is the remainder when x is divided by 28? 26 Suppose -w + 4k + 33 = 0, -2w = 2w + 2k - 60. Suppose 0v + 6 = v. What is the remainder when w is divided by v? 5 Let z be (0 + -2 - 0) + 0. Let q = z + 8. What is the remainder when 10 is divided by q? 4 Suppose 4d + 12 - 36 = 0. Suppose -86 = -4m - u + 2u, -m + 28 = 3u. Calculate the remainder when m is divided by d. 4 Let c(k) = -k*2 - 16k + 26. Calculate the remainder when c(-13) is divided by 17. 14 Suppose -7d = -0d - 294. Suppose -4j + 3y + 2y + 69 = 0, 2j - 2y = 32. Calculate the remainder when d is divided by j. 9 Suppose -2l = 2, 4u - 3l + 4l = 15. Suppose -uz + 6z - 66 = 0. Calculate the remainder when z is divided by 9. 6 Let k(y) = y3 - 8y*2 - 9y + 13. Let p(f) = f*2 - 5f + 3. Let n be p(6). What is the remainder when 25 is divided by k(n)? 12 Let h = 40 - -3. Calculate the remainder when h is divided by 11. 10 Let m(d) = 3d2 + d. Let w be m(-2). Suppose w = 3a + 1. Suppose 2j - a - 1 = 0. Calculate the remainder when j is divided by 1. 0 Calculate the remainder when (-93)/(-5) - (-54)/(-90) is divided by 12 - (2 + 0/(-3)). 8 Let c = 40 - 20. Suppose 3g = -d - 12 + 27, -4g + 2d + 20 = 0. Suppose -gs = -120 - 170. What is the remainder when s is divided by c? 18 Suppose 119 = 5g + 2n, 2g + 0g - 5n = 65. Calculate the remainder when g is divided by 5. 0 Suppose 3s = -5v - 79, -2s = 3s + 2v + 100. Let p = -7 - s. Let r = 11 + p. Calculate the remainder when r is divided by 8. 6 Suppose 0v + 2 = 4v + 5i, 4i - 8 = 0. Let d(y) = -7y - 2. Let f(b) = 2b2 + 37b + 74. What is the remainder when f(-17) is divided by d(v)? 11 Calculate the remainder when 77 is divided by 1 - 5/3 - 450/(-27). 13 Let k = -4 - -10. Calculate the remainder when 22 is divided by k. 4 Let a = 4 - 1. Let k = -2 + 7. Suppose -n + 0 = 3, n = -4y + k. Calculate the remainder when a is divided by y. 1 Let a = 2 + -2. What is the remainder when 21/(-63) + 1 + 25/3 is divided by -1(10 - a)/(-2)? 4 Suppose -3s + 8 = -91. Calculate the remainder when 62 is divided by s. 29 Suppose 2q - 45 = -3q. Calculate the remainder when 102/4 - (-3)/6 is divided by q. 8 Suppose 37 = 3a + 2r - 7r, -4r = -a + 17. Suppose 5c - 86 = 2x, -4c - x = x - 58. Calculate the remainder when c is divided by a. 7 Suppose 9c - 561 - 51 = 0. What is the remainder when c is divided by 23? 22 Let j = 0 - -11. Suppose -4n - j + 43 = 0. What is the remainder when n is divided by (-2)/8 - 13/(-4)? 2 Let m(f) = 4f + 3. Calculate the remainder when m(8) is divided by 20. 15 Let l be 9 + -1 - (1 + -4). Let j = l - 1. Suppose 3k = 2x - j - 46, -2k = -5x + 118. Calculate the remainder when x is divided by 6. 4 Let v(m) = -m + 9. Suppose -5c + 179 = 5j - 3c, -c = -j + 40. What is the remainder when j is divided by v(-4)? 11 Let b(h) = h*3 + 9h*2 + 6h + 4. Calculate the remainder when b(-8) is divided by 7. 6 Let v(o) = -o*3 + 5o*2 + 6o + 7. Let z be v(6). Let f = z + -3. What is the remainder when ((-28)/10)/(2/(-10)) is divided by f? 2 Let g(v) be the third derivative of -v*6/120 + 3v5/20 - v4/3 + v*3/6 - 2v*2. What is the remainder when 1 is divided by g(8)? 0 Suppose 4l + 2i - 2 = 0, 17 = -l - 7i + 3i. Suppose 6 = j - l. Calculate the remainder when 24 is divided by j. 6 Let y(v) = v2 - 5v - 3. Let t(i) = i + 9. Calculate the remainder when y(-5) is divided by t(7). 15 Suppose -5d - 5x = -35, -3d = -4x + 2x - 41. What is the remainder when (-5)/(84/(-16) + 5) is divided by d? 9 Calculate the remainder when -5252/(-8) is divided by 17. 14 Suppose 0 = -3t - 2h + 26, 0h - 4h = -4t + 48. What is the remainder when 28 is divided by t? 8 Let p(c) be the first derivative of c3 + c2 + 4c + 4. What is the remainder when p(-3) is divided by 14? 11 Suppose 4 = 5r - 6. What is the remainder when 26/6 - 2/6 is divided by r? 0 Let j = -95 + 117. Calculate the remainder when 55 is divided by j. 11 Suppose 0 = 3q - 33 - 6. Let t(k) = 6k + 3. Let d be t(5). Let p = d + 3. Calculate the remainder when p is divided by q. 10 Let w(k) = -k*2 + 6k - 6. Let j be w(4). Suppose -2 = z, -64 = -h + jz - 5z. Suppose 0 = -y - y + h. What is the remainder when y is divided by 18? 17 Let q(l) = -35l. Calculate the remainder when 138 is divided by q(-1). 33 Suppose -4l = -5 - 19. Suppose 28 = -2i + 58. Calculate the remainder when i is divided by l. 3 Suppose -4z + z = -228. What is the remainder when z is divided by 13? 11 Let s = 8 + -6. Suppose -2h = -k - 14 - 7, 0 = sk + 2. Suppose -3j = 4p - 56 - 48, -3p - 3j + 75 = 0. Calculate the remainder when p is divided by h. 9 Let b be 86/10 - 24/40. Suppose bm - 42 = 5m. Calculate the remainder when 68 is divided by m. 12 Let g(c) = c3 + c2 - c + 2. Calculate the remainder when g(3) is divided by 13. 9 Suppose 0q = 3l - 4q - 14, -5q = -4l + 18. What is the remainder when 6 is divided by l? 0 Let d = -41 - -73. What is the remainder when 62 is divided by d? 30 Let g(u) be the first derivative of -u4/4 - 2u*3 - 3u*2/2 - 9u + 1. Let f = -10 - -4. What is the remainder when g(f) is divided by 3? 0 Let c(p) = -3p2 - 22p - 10. Calculate the remainder when 98 is divided by c(-5). 23 Let y(p) = 3p + 22. Suppose 0 = z + 2z. Calculate the remainder when 86 is divided by y(z). 20 Let m(c) = 16c3 - 2c*2 + c. What is the remainder when m(2) is divided by 41? 40 Let i = -152 - -215. Suppose 66d = 60d + 96. Calculate the remainder when i is divided by d. 15 Suppose -2p = -25 - 17. Let f = 37 - -2. What is the remainder when f is divided by p? 18 Calculate the remainder when 43 is divided by 6/27 + 4/(-18) - -15. 13 Suppose -f + 90 = -34. What is the remainder when f is divided by 18? 16 Suppose -14h = -8h - 198. What is the remainder when 63 is divided by h? 30 Let y = 2 - 1. Suppose -n = -8 - y. Calculate the remainder when 34 is divided by 10 - -36/n. 10 Let k = -9 + 11. Suppose 29 = -0m + km + b, -2m = 3b - 31. Calculate the remainder when 26 is divided by m. 12 Suppose y = -2n + 7 + 17, -37 = -3n - y. Calculate the remainder when 37 is divided by n. 11 Calculate the remainder when (-2)/(-4)0 + 18 is divided by 7. 4 Suppose w - 2u - 53 = 0, -w - 5u + u + 35 = 0. What is the remainder when w is divided by ((-120)/35)/((-1)/((-7)/(-2)))? 11 Let n(h) = 14 + 51 - 2h2 + h2. What is the remainder when n(0) is divided by 22? 21 Let q be 4/(-8)2 + 1. Suppose q = -5g + 2w + 82 + 74, 5g = w + 158. What is the remainder when g is divided by 11? 10 Suppose t + 4t + 4f + 15 = 0, -2f = 3t + 11. Let h = t + 29. Calculate the remainder when 87 is divided by h. 21 Calculate the remainder when 63 is divided by -3 - (-1 + 2 - 20). 15 Suppose 3a + 45 = 2m, 106 = 5m - a - 0a. Calculate the remainder when 81 is divided by m. 18 Let b(l) = -l2 + 3l. Let h be b(3). Suppose 4a - 4n + n = -5, h = -a + n - 1. What	{ "pile_set_name": "DM Mathematics" }
ose -58g - 13 = -45g. What is the closest to 5 in b, 4, g? 4 Let t = -1.5 + 1.2. Let y = 13.74 - 14. Let m = -2.26 - y. Which is the closest to -0.4? (a) m (b) -5 (c) t c Let p = -0.037 + -0.063. Which is the nearest to 0? (a) -4 (b) 14 (c) p c Let o be 2 - -2 - (-2)/(-1 - 1). Let q = 4798447/145 + -33093. Let l = q + -4/29. Which is the nearest to l? (a) -2 (b) -5 (c) o a Let y = -63 - -62.874. Let l = y + 0.026. Let s be 0 - (2 + (-4)/3). Which is the nearest to s? (a) 3 (b) l (c) 0 b Let i = -2.409 - -2.459. What is the closest to i in 4, -4, 0.2, -3? 0.2 Let y be 10/24 - 2/3. Let p = -100 - -90. Let o be 35/p - 43/(-3). Which is the closest to y? (a) 0 (b) -0.1 (c) o b Let s = 2/457 - -2720/5027. What is the nearest to s in -4, 0, -0.3? 0 Let m = -4.3 + 0.3. Suppose -4j + 26 = -5x, -j + 6 = x + 4. Which is the closest to 2? (a) -0.1 (b) m (c) j c Let a = 600.7 - 601. What is the closest to -2 in 0.1, a, -3/2, -2/9? -3/2 Let d = 8 + -6. Let r = -290 - -293. What is the nearest to 0 in r, -4, d? d Let f = -46/7 + 361/56. Let u = 0.3 + -0.4. Let t = -1/1023 - -2053/7161. What is the closest to u in -2, t, f? f Let x = 880 - 6162/7. What is the nearest to x in 2, 6/13, -2? 6/13 Let z be 1/(-1)(-14 + 13). What is the closest to z in 3/8, 5, -2? 3/8 Let s = 629/28 - 159/7. Which is the closest to -2? (a) s (b) 3/5 (c) 3 a Let a = -3 - -2.7. Let t be (-16)/(-30) + 2/(-10). Suppose -3 + 0 = -3p. What is the nearest to -1/2 in a, p, t? a Let o = 1447 + -1444. What is the closest to -2/5 in o, 4, -1/15, -2/11? -2/11 Let x = -3 + 5/2. Let l = 0 + 9. Let i be (l/30)/(1/(-12)) + 4. What is the nearest to 0 in 1, x, i? i Let i = 5 - 2. Let t be -31 + (-24)/(-9). Let g = 23.9 + -24. What is the closest to t in g, -4, i? g Let u be (-138)/336 + (-4)/(-32). Let x = -1 - -0.5. What is the closest to x in u, 0.2, 0.3? u Let n = -0.27 - -0.13. Let r = n - -0.44. What is the closest to 0.1 in 5, 2/7, r? 2/7 Let w be (-31)/(-18) + (-6)/4. Let j = -3.92 + -0.08. Let r be ((-4)/(-8))/(12/(-6)). Which is the nearest to w? (a) r (b) 5 (c) j a Let s = -1046 - -1039. What is the nearest to 5 in s, -0.5, 0? 0 Let i be 12/4 + (-7)/(28/(-12)). Which is the nearest to 0? (a) 13 (b) i (c) 0.5 (d) 1 c Let c = 0 - -0.5. Let s = 14 + -12. Let y = s + -2. What is the nearest to y in c, -2, 3? c Let a = 20 - 20.5. Let x be 4/7-621/180. Let l = 0 - -2. What is the nearest to -2 in l, x, a? a Let w be (12/10)/((-6)/15). Let x(h) = h*2 + 6h + 3. Let o be x(w). Let p be (-20)/(-12)o/2. Which is the closest to -2/3? (a) 2/9 (b) p (c) -3 a Let j(z) = -5z*2 - 44z + 40. Let x be j(-9). Which is the nearest to x? (a) 2 (b) -1/5 (c) 0.4 a Let m = -2.1 - -2. Suppose 5w + 4z = -41, 3w + 5z = -21 - 14. Let q(s) = s - 6. Let y be q(10). What is the nearest to -1/4 in w, m, y? m Let w = 3.63 - 1.63. What is the closest to -3 in 3, w, -5, 5/4? -5 Let u = 2.154 - 2.254. Let q = 4.7 + -5. What is the nearest to 0 in q, u, -2.6? u Let m = -61 - -791/13. Let l = -1444 + 1449. Which is the nearest to m? (a) 3/7 (b) -2 (c) l a Let k be 4/(-7) - (-5 + 4). Suppose -4a - 5d + 3d = 22, -a - 7 = 2d. Let v(x) = x*2 + 3x - 5. Let p be v(a). What is the nearest to 0 in p, -1/9, k? -1/9 Let q = -156.7 - -160.7. Let y be (-16)/10 + (-2)/5. Which is the closest to -0.1? (a) y (b) q (c) -4/3 c Let z = 8943/5 - 1788. What is the nearest to -2/13 in z, 2, -2, 3? z Let d = 4.8 - 9.8. What is the nearest to 2 in 4, 0.5, d? 0.5 Suppose 5o = 2b - 2 + 20, 5o = 3b + 22. Suppose 20 = -9l + 4l. Let g be (l - -8)o/12. What is the nearest to g in 0.5, -0.4, 2? 0.5 Suppose 5y = 5r + 15, 0 = 2r - 5r + 4y - 14. Let u = -22.8 - -22. Which is the closest to u? (a) -3 (b) -0.2 (c) r b Let j = 0.375 - -0.025. Let v(m) = -m*3 - 4m*2 + 3m + 4. Let u be v(-3). Let g be 18/u + (0 - -1). Which is the nearest to -2/7? (a) j (b) 0.2 (c) g c Let w = 1158 + -1157.9. Which is the closest to 0? (a) -0.06 (b) -3 (c) w a Let d = -55.4 + 57.4. What is the nearest to -0.1 in 1, d, 5? 1 Let u = -54.9 - -54.7. Which is the closest to -0.3? (a) 3 (b) 2/11 (c) 0.3 (d) u d Let p = -1/458 + -901/6870. Which is the closest to 2? (a) p (b) 0.1 (c) -0.3 (d) 1 d Let z = -217 + 219. What is the nearest to z in 0.25, -0.2, -0.4? 0.25 Let w = 2.1 + -2. Let z = 8.57 - 8.87. Which is the nearest to w? (a) z (b) 2/7 (c) 5 b Suppose 0 = 4n - x + 101, 26 = -2n + 2x - 32. Let q be -4(-3 + (-69)/n). Which is the closest to 1? (a) -1 (b) 5 (c) q c Let g = -1.6 - -2.6. Let o = 424 - 2118/5. Which is the nearest to o? (a) -0.1 (b) g (c) 1/2 c Let y = 44.081 + -0.081. Let n = 43.6 - y. Let s be (9/(-12))/12. Which is the nearest to 0? (a) s (b) n (c) -0.3 c Let w = -47 + 44. Let i = 8 + -13. What is the nearest to 0.4 in i, -2, w? -2 Let t = -52197 + 2087993/40. Let g = 1387/8 - 176. Let s = t + g. Which is the closest to 2? (a) -5 (b) s (c) -0.2 b Let m = -23.972 + -0.028. Let l = -24 - m. Let r = 370 - 6292/17. Which is the closest to 5? (a) l (b) r (c) 0.1 c Let r = -16 + 20. Let y = 7 - 6.9. Let d = y - -0.5. Which is the closest to 1? (a) 2/7 (b) r (c) d c Suppose -3s + y = -14, 0s - 22 = -4s + 3y. Let z = 271.204 - 272. Let r = z - -0.196. Which is the closest to 1? (a) s (b) 1/2 (c) r b Let j = -138 - -140. Let r = 11 - 9. What is the closest to r in j, -2, 0.2? j Let x = 0.99 + 0.01. Let t = -477.9 - -478. Which is the closest to 2/7? (a) t (b) -2/17 (c) x a Suppose 4a = -4w + 36, -62a + 59a - w + 19 = 0. What is the closest to -5 in 3/2, a, 4/15? 4/15 Let v = 544.9 - 545. Which is the closest to 0.11? (a) 4 (b) -4 (c) 0.4 (d) v d Let r = -446 + 448. Let w be (-1 + (-15)/(-6))/(-3). What is the nearest to w in 0, r, 4? 0 Let x = 6/335 + 311/1340. Which is the closest to -3? (a) -1/5 (b) 0.4 (c) 0.5 (d) x a Let u = -1 - -2. Let y be -48(-12 - 490/(-40)). Which is the nearest to -0.1? (a) 1/3 (b) u (c) y a Let f = -520 - -520. Let y = -0.06 + -0.04. Suppose 0 = -4i - 5o - 9 - 7, -3o - 11 = i. What is the closest to y in -1, i, f? f Let f = 371 - 372. What is the nearest to 5 in 0, f, 0.5? 0.5 Let i = 0.38 - 0.08. Let a = 0.2 - i. Suppose 8m - 4m + 12 = 2f, 0 = 4f + 16. What is the closest to a in m, 1, -1/4? -1/4 Let f = 5099143/155 - 32898. Let o = f - 3/31. Which is the nearest to 3? (a) 1 (b) -0.3 (c) o a Let u(i) = 3i + 4. Let j be u(-1). Let f be (-54)/(-40) + (-2)/2. Let a = f - 3/4. What is the nearest to 0.1 in -3/2, j, a? a Let i be (5 + 168/(-30))30. What is the closest to 1 in -2, 0, i? 0 Let m = -4.1062 - -0.1062. Let p be ((-6)/(-4))/(0 - -3). What is the closest to p in 6, m, -1/6? -1/6 Let f = -306.966 + 309. Let y = 0.034 - f. What is the nearest to 2/3 in 0, -5/2, y? 0 Let j be ((-55)/14 + 4)/((-5)/(-20)). Let s = 20 - 17. What is the nearest to -1/5 in j, s, -17/4? j Let h = -4.461 - -0.461. Let a = -5.8 - -6. Let i = -2.2 + a. What is the closest to 0 in 0, i, h? 0 Let l = -48 + 47.7. Let s = 4 + -3.6. What is the nearest to 1 in s, 4/3, l? 4/3 Let m = 173.26 - 174. Let z = -0.26 + m. Which is the nearest to -1? (a) z (b) 0.4 (c) -0.3 a Let q = -2.1 - -2. Let t = -3.789 + -0.211. What is the closest to -4 in q, t, -3/5? t Let q be 1 - (42/10 + -2). Let o be 1/2-34. Which is the closest to 0.1? (a) o (b) -2 (c) q c Let z = -251 + 253. What is the closest to 0 in 3, 0.9, 3/5, z? 3/5 Let c be 20536/(-906)(1 - (-7)/(-4)). What is the nearest to -0.1 in c, 4, -0.08? -0.08 Let x = 80 - 93. Which is the nearest to 1/2? (a) -3 (b) 4/5 (c) x b Let k be (-6)/10 - (-735)/975. Let l = 3 + 0. Let h = -244/3 - -82. What is the closest to h in k, l, -1? k Let x be 584/40. Let j be (-2)/x + (-76)/(-8). Suppose 4s - 24 = -2q, q + 0q - 2 = 0. Which is the nearest to 1/2? (a) s (b) -1/4 (c) j b Let h = -16.87 + -0.13. Let j = -21 - h. What is the closest to -1 in j, 0.1, -2/11? -2/11 Let f = -1.18 + -8.62. Let d = f + 10. Let w(s) = s2 + 4s - 4. Let r be w(-5). What is the nearest to 1 in r, d, -0.5? r Let i = 102 + -107. Let x be 3/(-6)4/2. Let g(j) = 2j*2 + 2j + 1. Let z be g(x). Which is the closest to z? (a) 0 (b) i (c) -0.06 a Suppose 0 = 3y + 3, y + 2y - 1 =	{ "pile_set_name": "DM Mathematics" }
/7) assuming q is positive. q(-1644/287) Simplify ((g14gg(-6/5))(10/7))42 assuming g is positive. g828 Simplify (s*(-17)/ss0)/(((s/s16)/s)/s)32 assuming s is positive. s526 Simplify (c(c/c(-7))/cc)*(-2/3)c*(-1/4)c(-2) assuming c is positive. c(-33/4) Simplify ((d/(dd(-9/5)))/(d9d))(2/99) assuming d is positive. d(-82/495) Simplify ((y*(-2/35)/yy)/y)*(-20)/((y/(yy(-18)))/y)(4/9) assuming y is positive. y(856/63) Simplify (t(-2))43/(t7t)(-1/15) assuming t is positive. t(-1282/15) Simplify ((d(-19)/d)/(d/(dd/((((dd20dd)/ddd)/d)/d)d)))/(d/(dd(4/5)d))34 assuming d is positive. d(106/5) Simplify ((y/(y/y(-1/8)))/(y(-5/3)y))/((yy2)/y)(-8/11) assuming y is positive. y(527/264) Simplify (b(-7/4)/(bb/((b23/bb)/b)))/((b(b(-18/11)b)/b)/b(-1/10)) assuming b is positive. b(4133/220) Simplify ((w*(-1/5)ww(-17)/w)(-11/3))35 assuming w is positive. w(6622/3) Simplify (k(-1/5)k*7/k)/(k/(kk*(-4))k)(3/25) assuming k is positive. k(26/5) Simplify (x(2/13)/x)(-2)(x(-2))(2/7) assuming x is positive. x(102/91) Simplify (v/((((v(-8)/v)/v)/v)/v))/v(-3/11)((vv/(v/(v/(vv*(-6/11)v))))/v)/v(-4) assuming v is positive. v(185/11) Simplify (z(z(-3)z)/zz)1/(z(3/5))(-23/4) assuming z is positive. z(49/20) Simplify (rr/(r*1/r)rr(1/12)r*0r/(r((r/(r(-1/7)/r))/r)/rr))(-4/43) assuming r is positive. r(-163/903) Simplify ((bb(-14/11))/(b12b))/((bb18)/b23) assuming b is positive. b(-102/11) Simplify ppp(-6)/p((p*(-2)/p)/p)/p(p/p(-4/7))/p5 assuming p is positive. p*(-94/7) Simplify rr*(-25)rrr*(-25)(r/(r/r(-1/10)))(1/2) assuming r is positive. r(-941/20) Simplify ((v(-2/13)/((vv(-6))/v))/(v(-3))13)(-5/13) assuming v is positive. v(-2915/169) Simplify (uu*(-12)/uu/u*14)/((uu(u(-5)/u)/uu)/(uu(-3/13)/u)) assuming u is positive. u(-276/13) Simplify (q(-5/7)/qqq(-1/26))(-3/2) assuming q is positive. q(411/364) Simplify (d/(d/d(-1/5)d))4/(d(4/5))34 assuming d is positive. d(-32) Simplify ((t*20/(t/(tt/(t*(15/2)t)t)))(-24))26 assuming t is positive. t(-8424) Simplify h(2/37)h*13(h*6h)(1/20) assuming h is positive. h(9919/740) Simplify (bbb*(-3)bbb)/b*(1/8)(b*(-2)b)41 assuming b is positive. b(-313/8) Simplify ((t*(-23)t)/tt)(14/13)((t/t(8/3))/t)/t(-27) assuming t is positive. t*(25/39) Simplify (oo*31o21)(8/13) assuming o is positive. o(424/13) Simplify (l(2/45)l)/ll(ll*(-13)/ll)/ll/l(1/5)ll(-17) assuming l is positive. l(-1222/45) Simplify (((s(1/2)s)(-46/3))(-2/9))(-1/35) assuming s is positive. s(-46/315) Simplify (x/(x*(-1/2)x)x/(xx(xx*31x)/x))(-1/7) assuming x is positive. x(65/14) Simplify (ooo/(oo2)o)*14(o*(1/3)oo)/oo(-2/41) assuming o is positive. o(1880/123) Simplify ((r/r13)/r)/(((r/(r/(r/(r(3/5)r))))/r)/rr)(r3r)33 assuming r is positive. r(603/5) Simplify (t/t*(-20)t/(t(t/(t/(t20/t)))/t)t)/(tt1/t)32 assuming t is positive. t(-28) Simplify (r(-7/6))4r*(-15)rrr(11/5) assuming r is positive. r(-232/15) Simplify (mm/(m14m))/mm((m/(mm2))/mm)/mm10/m4 assuming m is positive. m(-10) Simplify (x/x(1/6)xx(6/11)x)/(x/((x/(xx/(x(-12)x)x)x)/x))(-12/11) assuming x is positive. x(1231/66) Simplify (f/(f*(-2/37)/f)f2)/(f6f(-2)) assuming f is positive. f(2/37) Simplify (a/a(-6))/aa*(-2/5)((a/a*(2/15))/a)/(aaa/(aa*(-2/11)aa)aaa) assuming a is positive. a(377/165) Simplify ((t(7/4))(-25))(-20) assuming t is positive. t*875 Simplify (((xx(-1/2))(-2/7))(3/4))(-4) assuming x is positive. x(3/7) Simplify q(-3/2)/(q(q/(q/q(2/17)))/q)(((qqq*(2/53))/q)/q)/qq/(q*(-2/11)/q)qq assuming q is positive. q(31753/19822) Simplify (((ff*2f)25)(2/5))5 assuming f is positive. f200 Simplify ((g*(4/3)g/g1)/((g/g(-4))/g(-6)))(-1/15) assuming g is positive. g(29/45) Simplify (((v(2/3)v)5)18)32 assuming v is positive. v4800 Simplify (s/s(2/5))(-12)(s11/s)/(s/s(-9/2)) assuming s is positive. s(-27/10) Simplify (((m22m)/mmmm)/mm(1/21))/(m/(m(m*(2/19)m)/m)m)(-43/4) assuming m is positive. m(53731/1596) Simplify a(-1/8)/(a(3/2)/a)((aa(-1/10))/a)(2/21) assuming a is positive. a(-533/840) Simplify ((g/(g/g(-12))g)/(g/(g(-27)/g)))29 assuming g is positive. g(-1160) Simplify (h/(h/h(2/7)))*(-2/11)/(hh4)(-10) assuming h is positive. h(3846/77) Simplify (k9/kk)(-46)/(k(-3/4)/k)(-13/3) assuming k is positive. k(-5059/12) Simplify aa(a(-1)a)/aa(-8)(aa(6/5)a)/a10 assuming a is positive. a(-69/5) Simplify ((kk15)/k)/k(-2/13)(k3)(6/11) assuming k is positive. k*(2401/143) Simplify (h/(hh(3/8)))/(h/h(-15))h(hh(-13)h)/h(h/h11h)/h assuming h is positive. h(-299/8) Simplify ((g(-20))(-3/23))(-44) assuming g is positive. g(-2640/23) Simplify h(-1/7)h(2/21)/hh/h*2h(h14/h)/h assuming h is positive. h(230/21) Simplify (s14/(ss(ss*14)/s))/((ss/(s*12s))/sss(-6/7)) assuming s is positive. s(69/7) Simplify (ggg/((g*(-2/5)/ggg)/g))20(g(-1/3))(-46) assuming g is positive. g*(250/3) Simplify (cc/((c/(c*(-2/19)cc))/c))30/(c/c(-9)c(9/5)) assuming c is positive. c(9979/95) Simplify (((yy(-1)y)/y)/y)*(1/4)y/y*(-2/3)yy(((y(yy*(-1))/yyy)/y)/y)/y assuming y is positive. y(29/12) Simplify b/(bb*(-7))bb/((b/(bb*(-40)/b)b)/b)((b(3/23)/b)/b)(2/11) assuming b is positive. b(-8182/253) Simplify d(-6/5)d*(-15)(d/d*(5/6)d)/(d/(d(-11/3)/d)) assuming d is positive. d(-207/10) Simplify (((ss/s5)/sss)/(s(s/(s*(-1)s)s)/ss))/(ss(-17)s/s*(-9)ss) assuming s is positive. 1/s Simplify ((jjj(5/8)j)/jj/j(1/40))/(j(j*(-2/31)j)/jj1/j) assuming j is positive. j(413/155) Simplify ((t/(tt(7/2)))(-4/17))(-12) assuming t is positive. t(-168/17) Simplify (g(-7))(-3/43)g(7/6)g/g15 assuming g is positive. g(-3185/258) Simplify (t*(4/11)t(tt*(2/35)t)/t)/(t/(t*7t))23 assuming t is positive. t(62917/385) Simplify ((j(-2/21))16)12 assuming j is positive. j(-128/7) Simplify ((p*(2/3)/p)/((p/(ppp25p))/pp))/(pp9)(-12) assuming p is positive. p(440/3) Simplify (h(2/3)h)/(hhh/(h(h/((h*(-7/4)/h)/h)h)/hh)h)h5/h8 assuming h is positive. h(17/12) Simplify (n4)(-21)n*4n(-5) assuming n is positive. n(-85) Simplify ((h*5h(1/6))/(h0hh)13)(-8/13) assuming h is positive. h*(500/39) Simplify (t/(t/(t/((tt(4/3))/t))))/t(3/7)(t/t(1/20))/t(2/5) assuming t is positive. t(-89/420) Simplify ((ttt3tt(-2/9)t)/(t*(-8)tt/(ttt/(t(tt/t(-2/33))/t)t)t))14 assuming t is positive. t(19012/99) Simplify (t(2/29)t)/(ttt/(((t/t*(-2/7))/t)/t)t)(tt/t*0t)(-4) assuming t is positive. t(-3176/203) Simplify r*(-3)/rrr9r/r*(-5)r(rr(-2/33))/r assuming r is positive. r(427/33) Simplify ((h*1hh)(-20)/(h(-2/7))(-45))(-47) assuming h is positive. h(23970/7) Simplify (((cc/(cc/(cc*(1/4)))c)/(c/(ccc*(-2/13)/cc)))/(c*11c(-3/5)))(-1/11) assuming c is positive. c(1899/2860) Simplify (q(1/2))(2/11)/(q(-3/11)q/q(-6)) assuming q is positive. q(-73/11) Simplify u8u/u*(4/9)(uu(-2))(-4/33) assuming u is positive. u(859/99) Simplify ((a0a)*(-1/20)(a/(a/a*(-1/6)a))/a(-2/21))41 assuming a is positive. a(-6437/140) Simplify ((u/((u6u)/uu))/u)(-12)/(u(4/13)((u/(uu*31/uu))/u)/u) assuming u is positive. u*(1517/13) Simplify (l/(ll*(-15)/l)l*(-2)l)/(l*(-14)l/(l*13l)) assuming l is positive. l42 Simplify ((d/d7)7)(-2/3) assuming d is positive. d*28 Simplify (q/(q/(qq*2q))q/(q/(q/((q(2/15)q)/q)q))q*(1/14)q/(q7/q))17 assuming q is positive. q(3349/210) Simplify (w(-3/11)ww/(w/(w*1w))(w1)(8/7))(-16) assuming w is positive. w(-4768/77) Simplify ((v/(v/(v/v(-2/9))))/v)(-11/3)(v**	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.