Split (1)

train · 36k rows

text stringlengths 1.4k 8.19k	meta dict
f - 1. Let b be k(-3). Suppose 0 = bs + d - 31, -4s + s + 46 = 2d. Calculate the lowest common multiple of 16 and s. 16 Suppose 0 = 3y - 27 + 87. Let o = -14 - y. What is the least common multiple of 4 and o? 12 Suppose 3s - s + 108 = 0. Let n = -47213/10 - -4725. Find the common denominator of n and (285/s)/1 + 1. 90 Let c be 1/(-2)(-23864484758307)/(-522206790). Let x = -1/17406893 - c. Let q = x - 22845. Find the common denominator of q and -67/16. 80 Let l(g) = g*3 + 6g*2 - 8g - 7. Let h be l(-7). Suppose hs = 2s. Suppose s = 2x - 0x - 28. Calculate the lowest common multiple of x and 4. 28 Let d = 43 - 40. Calculate the lowest common multiple of d and 30. 30 Let r = -90 - -51. What is the least common multiple of 10 and r/(-4) + (-6)/(-24)? 10 Let f be -1 - (0/(-3) - 1). Suppose 5c = -fc + 20. Suppose -cv + 40 = 4g, 3g - 2g - 6 = -5v. What is the least common multiple of 4 and g? 44 Suppose -l + 12 = -5m, 3l - 10 + 4 = 0. Suppose 3k - 42 = -12. What is the smallest common multiple of k and ((-1)/m)/((-1)/(-14))? 70 Let r(w) = 3w + 7. Let z be r(-5). What is the lowest common multiple of (-6)/z - (-85)/20 and 9? 45 Let r = 16 + -17. What is the common denominator of -9/11 and 130/(-110) + (-3)/r? 11 Let r(z) = z3 - 6z*2 - 8z + 8. Let p be r(7). Let v = 1 + p. Suppose -q + v = -1. What is the lowest common multiple of q and 5? 15 Suppose 2t + 4 = -3t + 2l, -l - 5 = t. Let a(b) = -b3 + 2b*2 + 2. Suppose 3x - 69 + 21 = 0. What is the smallest common multiple of a(t) and x? 144 Suppose 0 = 140a - 130a - 60. Suppose 0 = 3u - 9 - 15. Calculate the least common multiple of u and a. 24 Let o = 5/641 - 23857/17948. Calculate the common denominator of o and -23/32. 224 What is the common denominator of ((-4)/16)/((-3)/75) and 69/2 - (1 + 1)? 4 Calculate the least common multiple of 7(-3)/(-4) - 1/4 and 7. 35 Let r(u) = -58u + 7. Let v be r(-7). Let q = -62932 - -312606/5. Let c = q + v. What is the common denominator of 2/7 and c? 35 Let c be 1/(2 - 1)42. What is the smallest common multiple of (1/(-3))/((-2)/c) and 8? 56 Let v be 32855/((2/3)/(-2)). Let z be v/(-2122)(-1)/(-9). Let a = 6/1061 + z. Calculate the common denominator of a and -5/12. 12 Let g = 6 + -1. Suppose 0 = gx - 12 + 2. Calculate the least common multiple of 10 and 456/21 + x/7. 110 Calculate the common denominator of 17/10 + -4 + 3 + -3 and 19/2. 10 Let y = 428845/281602 - 311/206. Let a = y - -37744129/8202. Let u = -4584 + a. Find the common denominator of u and -20/7. 42 Suppose -4s = -0s + 64. Find the common denominator of 33/20 and (-22)/(-4) - s/72. 180 Let j = -15 - -25. Suppose -2i = -0 - 16. Calculate the smallest common multiple of j and i. 40 Let d = -645116 - -3859373/6. Let z = -1881 - d. What is the common denominator of (-261)/120 + (-2)/10 and z? 24 Let f(l) = 7l - 2. Let g be f(6). Suppose 5p = -5i + g, i + 4 = -i. What is the lowest common multiple of p and 2? 10 Let p(v) = -v*3 - 42. Let f be p(0). What is the common denominator of 229/f - 4/(-14) and 49/20? 60 Let q = -30 + 39. Calculate the least common multiple of q and 32. 288 Let a(c) = 2c - 6. Let f be a(6). Let h = 91 + -161/2. Find the common denominator of h and f/15 - 354/(-15). 2 Let c be 24/28137. Find the common denominator of (c/(-2))/(0 - -10) and 109/18. 90 Let c = -9 + 21. Calculate the lowest common multiple of c and 10. 60 Let n be (-1146)/(-572) + -4 + 2. Let m = -2291/858 + n. Calculate the common denominator of m and 31. 3 Find the common denominator of 1/46 and (-13 - -43)10/64. 368 Suppose 1 = -2d - 3. Let p = d - -4. Let b(j) = -j*3 + 7j*2 + j - 4. Calculate the smallest common multiple of p and b(7). 6 Suppose 0 = 4w + 2 - 26. What is the common denominator of 49/10 and 4/w + 182/(-48)? 40 Let x = -22 - -24. Calculate the lowest common multiple of 9 and x. 18 Let k(s) = -5s + 51. Calculate the lowest common multiple of 20 and k(7). 80 Let g(j) = j3 + 7j*2 - 8j + 6. Calculate the lowest common multiple of g(-8) and 65/4 + 7/(-28). 48 Let b = 1685/2 + -889. What is the common denominator of b and -77/18? 18 Let m = 155/2 + -86. What is the common denominator of m and -55/13? 26 Let v = -4 + 13. What is the lowest common multiple of v and 8? 72 Let j(r) = -2r2 + 23r + 16. Calculate the least common multiple of j(12) and 4. 4 Let n be (1/(-2))/(1/33757). Let h = -17752 - n. Let u = h + 844. What is the common denominator of u and -31/6? 6 Suppose -3g = -5s - 1, -3g - g = 3s - 11. Suppose -2w = 2w - 40. What is the smallest common multiple of w and g? 10 Suppose 0 = k - 2 - 1. Suppose -x - 42 = -7x. Calculate the least common multiple of k and x. 21 Let d(p) = p2 - 2. Let f(j) = j3 + 5j*2 + 4j + 6. Calculate the least common multiple of f(-3) and d(4). 84 Let n(x) = -x3 + x2 + 5x - 3. Let q be (5 - 2/1)1. Let s be n(q). Let v = s - -9. Calculate the least common multiple of 2 and v. 6 What is the common denominator of -87/20 and (21/(-22))/((-9)/21)? 220 Let l(q) = q - 6. Let p be l(0). What is the common denominator of 23/20 and 51/90 + (-2)/p? 20 Let c = -2663 - -24031/9. What is the common denominator of -48/5 and c? 45 Let y(c) = c*2 + 11c + 12. Let q be y(-10). Suppose 32 = 2r + qr. What is the smallest common multiple of 16 and r? 16 Let u(f) = f*2 + f - 3. Let a = 91 + -52. Find the common denominator of u(-5) and 2(2 - a/24). 4 Suppose 0 = -3x + 5q + 11 + 30, 5x + 2q - 120 = 0. Calculate the smallest common multiple of x and 18. 198 Let d = 251045/32 - 7846. Find the common denominator of d and 83/32. 32 Let m = -1939 - -3789/2. What is the common denominator of 35/12 and m? 12 Let q = -3098 - -4637705/1497. Let x = q - 5486/4491. Find the common denominator of x and -56/5. 45 Let x = 611/2 + -352. What is the common denominator of x and 20/3? 6 Let f(x) = 23x2 + x + 2. What is the least common multiple of f(-1) and 6? 24 Let s = -2/4321419 + 10905825443/9420693420. Let d = -5/654 + s. Calculate the common denominator of d and -65/4. 20 Calculate the common denominator of 26/126 - 10/(-45) and -53/5. 35 Find the common denominator of 8/3 and -7(4 - (-48)/(-7)). 3 Let v be (-80)/(-28)(-1)/(-376). Let q = 3/47 + v. Find the common denominator of (-4)/2 - 166/20 and q. 70 Suppose 0 = 6b - b + 10. Let v(f) = -3f + 2. What is the least common multiple of v(-2) and (10 + -2)/((-1)/b)? 16 Let m = 9 + -1. Suppose 0t + 4 = 2t. What is the least common multiple of m and t? 8 Let q be 84/30 - (-2)/10. Let b = 14477/20 - 721. Calculate the common denominator of b and ((-38)/q)/((-28)/21). 20 Let w = -8 - -8. Suppose -3a + 36 = -wa. What is the least common multiple of a and 0 + 0 + 2 + 8? 60 Let o = -4769269/9210 - -3107/6. Let l = -47609/9210 - o. Let b = -9/20 - -919/20. Calculate the common denominator of l and b. 6 Let g = 1 - 6. Suppose 1057 = 5q - 1318. Find the common denominator of q/g1/4 and 56/11. 44 Suppose b - 5m + 5 = -4, 12 = 2b + 5m. What is the common denominator of b + 1(-146)/28 and 46/8(-2)/10? 140 Let k = 3 - -19. Suppose -2s = -4a - 44, 4s - 84 = 4a - 0a. What is the smallest common multiple of k and s? 220 Calculate the common denominator of 51/8 and -5 - (-134)/26 - 1445/182. 56 Let m(u) = u2 - 15u + 18. Let n be m(14). Suppose -18 = -nc + 2c. Let i = -5 + 11. What is the least common multiple of c and i? 18 Let n(k) = -k - 7. Let x be n(-10). Find the common denominator of -1x + 806/(-39) and 89/10. 30 Let q = 1755/2 - 905. Find the common denominator of q and 17/20. 20 Let k = -25 + 32. Suppose kl - 12 = 16. Calculate the lowest common multiple of l and 12. 12 Suppose -c - 2h + 8 = 0, 4c = 3h - 5h + 38. Calculate the least common multiple of c and 1. 10 Suppose -3w + 2w - 140 = 2m, 3w + 4m = -416. Let z be 6/(-134)(-29606)/w. Let q = z + -3/1139. Calculate the common denominator of 45/4 and q. 4 Let u(y) = 19y. Calculate the smallest common multiple of 7 and u(1). 133 Suppose -2y - 1 = -5. Find the common denominator of 12/(-10)y/6 and 22/12(-18)/(-4). 20 Suppose -5r - 31 = -3o, -o + 3r = 4r - 13. Suppose 3g - 21 - o = 0. What is the least common multiple of 10 and g? 110 Suppose -23 = 2y - 3b, y - 11 = -5b + 10	{ "pile_set_name": "DM Mathematics" }
Let p = 1465.2 - 1465. Let w be ((-4)/(-16))/(1/8). Suppose 5j = -22 + w. Which is the smallest value? (a) j (b) p (c) -6 c Let w = -0.33 - -19.33. Let o = w - 19.3. Suppose 5d - 11 = -4f + 14, 3f = -2d + 10. What is the second smallest value in 0, d, o? 0 Let r = -47419/42 - -1129. Let n = 27 - 23. Which is the second smallest value? (a) -0.3 (b) r (c) n b Let b = 23 + -48. Let g = -25 - b. Let t = -3 - g. What is the third smallest value in t, 0.7, -3/4? 0.7 Let z = -11746/555 - -788/37. What is the third smallest value in z, 10.81, -4? 10.81 Let h = -59.737 - -60. Let o = h - 0.26. Let g = -4.003 + o. Which is the fourth smallest value? (a) 2/7 (b) g (c) 1 (d) -1/10 c Let b = 430 - 393.7. Let m = -36.6 + b. Let w = -0.3 + 1.3. What is the smallest value in w, -1/13, m? m Let c = -73 - -84. Let t = 9.1 - 14.1. What is the third biggest value in 5, -1, t, c? -1 Let q = -11 - -23. Let u = -7 + q. Let j = -1596 - -17552/11. Which is the biggest value? (a) u (b) j (c) 2 a Let m(p) = p3 + 7p*2 - 15p - 21. Let x be m(-9). Let n be ((-2)/8)/(x/64). What is the second biggest value in n, 0.3, -1/6? 0.3 Let s = -1142/3 - -400. Let l = -113/6 + s. Which is the second smallest value? (a) -2 (b) -0.4 (c) l b Let j = 5296 + -5298. Which is the third biggest value? (a) 2 (b) 3/7 (c) j (d) 4 (e) -0.4 b Let f = 55 - 54.7. Let k = -6 - -5.6. Let w = 795/4 + -199. Which is the biggest value? (a) -4/3 (b) f (c) w (d) k b Let f = -5918 - -5916. What is the second biggest value in f, -27/5, -5? -5 Let m = -0.04185 - -0.02685. Which is the biggest value? (a) 9 (b) m (c) 2/5 a Let l = -0.02 + 0.52. Let t = -16 + 58. Let q = -8961 - -8960. Which is the biggest value? (a) t (b) l (c) q a Let w = -0.3404 - -0.4304. Which is the second biggest value? (a) -12 (b) -3/7 (c) w b Let s = 133/22 - 61/11. Let p = -0.01 - 0.04. Which is the second biggest value? (a) p (b) 1/3 (c) s b Let m = -1.161 + 6.161. Which is the second biggest value? (a) m (b) 3 (c) 0.05 (d) 11 a Let x be ((-120)/132)/(10/(-44)). Which is the biggest value? (a) 69 (b) 0.6 (c) x a Suppose -61t = -5t + 112. Which is the fourth biggest value? (a) 34 (b) -5 (c) -0.4 (d) t b Let v = 465/3656 - 1/457. Let m = 80/3 + -26. Let q = 11 + -9. Which is the fourth smallest value? (a) q (b) v (c) 4 (d) m c Let d be ((-198)/9 - -18)/(1/5 + -1). What is the biggest value in 43/5, d, -2/15? 43/5 Let z = 6.68 + -10.68. Let m = -8 - -2. Let r = 6.4 + m. What is the second smallest value in z, r, 0.5? r Let n = 15.795 - 15.195. Which is the second smallest value? (a) n (b) -1 (c) 3 (d) -114 b Let q = -126 + 8. Let d = -123 - q. What is the third biggest value in 0.1, d, -0.1, 42? -0.1 Let x = 1971 - 1970.9. Which is the third biggest value? (a) x (b) 7/8 (c) 3 (d) -4 a Suppose -43h + 556 - 156 = -143h. Let q be (3/10)/(84/70). Which is the fourth smallest value? (a) h (b) -0.4 (c) 0.5 (d) q c Let l = -86 + 86.13. Let q = -0.025 + -0.205. Let g = l + q. Which is the second smallest value? (a) -1 (b) -3 (c) g a Let y = 2963 + -927416/313. Let t = 304/939 + y. Which is the second smallest value? (a) 33 (b) -1 (c) t c Suppose 53p = 50p - 12x + 39, 0 = x - 4. Let f be 15/(-108) - 1/(-4). Which is the biggest value? (a) f (b) -1 (c) 0.2 (d) p c Let p(f) = 12f*2 + 41f - 27. Let i be p(-4). Which is the third biggest value? (a) -10/41 (b) -2 (c) i b Let q = 2.97 - -0.03. Let n = -67097/2 - -33548. Let v = 0 + 0. What is the biggest value in n, q, v? q Let h = 1.323 - 1.36. Let s = h - -0.937. What is the smallest value in 1/6, -1, 1, s? -1 Suppose 2v = 2999 - 2981. Which is the fourth smallest value? (a) 0 (b) 1/6 (c) -1 (d) v d Let t be 550/693 + (-16)/28. Which is the smallest value? (a) -14 (b) 2 (c) t (d) -1/6 a Let m = -32.201 + 32.6. Let t = m + -0.699. What is the second smallest value in 0.5, 62, t? 0.5 Let p be (84/(-840))/(1/(-4)). What is the fourth smallest value in 0, 0.1, 1/4, 6.01, p? p Let i = 0.319 - -0.093. Let m = -0.012 + i. Let s = -25 + 31. Which is the second biggest value? (a) m (b) s (c) -3 a Let p = 1.913 + -3.913. Let r(u) = u2 + u + 1. Let v be r(-2). Suppose z - 8 = -vz. Which is the biggest value? (a) p (b) 0.1 (c) 4 (d) z c Suppose -18 = -3w - 2l, -469 = -3l - 460. Let z be 18/(-45) + (-47)/(-30). Let o = -3/2 + z. What is the biggest value in o, -14, w? w Let i = -26088 + 26087.6. Let t = 2.1 + -2. Let y = -3.1 + t. What is the fourth smallest value in 2/15, i, y, -0.2? 2/15 Suppose -2k - 1004 = -m - 7k, -1 = -k. Let i = m - 3997/4. Let o = 3 - 8. Which is the smallest value? (a) o (b) i (c) 1.2 a Suppose 24w = -2j + 21w + 15, 4j + 5w = 31. Let k be 12/8j/(-54). Which is the second biggest value? (a) k (b) 5 (c) 1 (d) -0.1 c Suppose -4j - 3o - 5 = 0, 0 = 3j + j + 4o + 4. Let d be (22/55)/(36/(-20)). Which is the smallest value? (a) -0.5 (b) j (c) d b Let r = 23784 + -23655. What is the second biggest value in -1/6, 4, r? 4 Suppose 3m = -3p + 6p + 18, -p + 3 = 0. Suppose -m = -5n + 11. Let w = 0.2486916 - -0.0513084. Which is the third smallest value? (a) 2/7 (b) n (c) w b Let q = 14.924 + -0.924. Let j be -4 + -3 + 0/1. Which is the third smallest value? (a) j (b) -0.1 (c) 0 (d) q c Let h = -19.74 + 23.74. Let o be ((-52)/6)/(4/(-6)). Let t(x) = -x3 + 13x*2 - x + 9. Let g be t(o). What is the third biggest value in -1, h, g? g Let w = -304 + 3954/13. Let c be (-1)/11 + (-45184)/2464. Let n = c + 131/7. What is the biggest value in -1/9, w, n, -7? n Let v = 0.01462 + -0.31462. Which is the smallest value? (a) -1/5 (b) v (c) -17/4 (d) -2/217 c Let q = 19166 + -55565/3. Let b = q - 645. What is the second biggest value in 10/3, b, 0.8? 0.8 Let o = -31297 + 31399. Which is the fifth smallest value? (a) -1/11 (b) -1/3 (c) 6/11 (d) 1 (e) o e Let p = 0.277 - -0.003. Let m = 0.28 - p. Let x = 3.8 - 3.84. Which is the smallest value? (a) x (b) m (c) 3 (d) 4 a Let q = -0.0964 + 514.0964. Let o = 514.1 - q. What is the biggest value in o, -27, 3, 0.2? 3 Let r = -6 + 8. Suppose -2p + 6 = -5s, 12 = 4p - 3s + rs. Let d = 132.7 - 133. What is the second smallest value in p, d, -1/7? -1/7 Let i = -170 - -2892/17. Let v = 233.5 + -234. Which is the smallest value? (a) v (b) i (c) -12 (d) 5 c Let u be 3346/(-1195) - 41/(-5). Which is the third biggest value? (a) -5 (b) -257 (c) u (d) -3 a Suppose 4h + 2x = 3h - 4, 11 = 4h - x. Let g = -6 - -2. Which is the smallest value? (a) h (b) -12 (c) -2 (d) g b Let n be ((-30)/105)/((-5)/14)35. Let r be -4 - (63/n)/((-6)/32). Let s = 0.6 - 0.3. What is the smallest value in s, -1, r, 1/5? -1 Let x be (3/1830)/(104/(-416)). What is the second smallest value in 2/7, 3, x, -3? x Let p = 4433/1413 + -510/157. Which is the fourth smallest value? (a) 2 (b) p (c) 0.06 (d) -4 a Let i = 3196 - 3031. Which is the third biggest value? (a) i (b) 5 (c) -0.4 (d) -2 c Let k = 3/2 - 2. Let w = 8446 + -42234/5. Which is the third biggest value? (a) w (b) k (c) -4/7 a Let s = -21.6 + 7.1. Let y = s + 14.9. What is the biggest value in 2/53, y, 3? 3 Let x(k) = 64k - 280. Let p be x(5). Let r = 93 - p. What is the biggest value in -0.1, 2/3, r? r Let z = -0.5574 + 0.3574. Suppose -2b + 3l + 2l = 6, l = -2b + 18. What is the biggest value in b, z, 2/25? b Let j = 0.2 + -1.2. Suppose -7z - 240 = -12z. Let f be z/(-45) + (18/(-30) - -1). Which is the second smallest value? (a) 0.1 (b) j (c) 2 (d) f d Let n(t) = 12t - 533. Let h be n(43). Which is the fourth smallest value? (a) 5/2 (b) h (c) 4/9 (d) 13 (e) 0 a Let x = -11754.7 - -11755. What is the third biggest value in x, 1.57, -2/13? -2/13 Let r = 0.34422 + -0.14422. Which is the fourth biggest value? (a) r (b) 0.1 (c) -0.2 (d) -0.1 (e) 8 d Let w = 670 - 320. Let c = 370 - w. What is the second biggest value in -1, c, -0.4? -0.4 Let j be (-4)/(6/3)16040/112. Let t = 287 + j. What is the second smallest value in t, 4, -0.3? t Let n(v) = 123v - 979. Let k be n(8). Which is the fourth biggest value? (a) 1.1 (b) k (c) -0.1 (d) 2 c Suppose 0 = -4k + u - 2u + 2, 5u = -k + 10. Suppose -9j + 52 - 70 = k. Which is the f	{ "pile_set_name": "DM Mathematics" }
0 = -8u + 11596 - 3324. Suppose -618 = 3d - 2t, 4t + u = -5d + 6t. Let b = -18 - d. Does 19 divide b? True Let c(s) = -2s3 + 6s*2 + 3s + 5. Let a be c(4). Let q(p) = -24p - 50. Does 31 divide q(a)? True Let r be (-1 - -5) + (-6 - (5 - 372)). Suppose -8m + 10m - 3a - 141 = 0, 5m + 5a - r = 0. Is m a multiple of 6? True Let u be (-464)/(-6) - (16/12 + -1). Let w = u - 25. Suppose r + 5k = k + w, 0 = -3r + 2k + 128. Is r a multiple of 18? False Let s = 80 + -77. Suppose -u - o = -54, -4o - 3 = -su + 138. Is u a multiple of 8? False Suppose -11j + 18 = -2j. Suppose 7 = jo - 0r + r, 12 = 3o + 3r. Suppose -5n + 82 = d, od - 107 = -5n + 159. Is d a multiple of 18? False Suppose 4z - 142 = -3h + 1090, 0 = -5h - 5z + 2050. Does 3 divide h? True Let q(h) = h*3 + 17h*2 + 9h + 165. Is 150 a factor of q(15)? True Suppose 2f + 0u + u + 8 = 0, f - 7 = 5u. Let o(g) = 8g + 46. Let l be o(-6). Is l + 20 + f + 6 a multiple of 3? True Suppose -49023 + 144027 = 28b. Is 23 a factor of b? False Let n = 224 + 760. Is n a multiple of 82? True Let g(u) be the second derivative of 25u4/12 + u3/2 + 3u2/2 + 8u + 5. Does 68 divide g(-2)? False Suppose -3144j - 95 = -3139j. Let v(r) be the first derivative of -r*3/3 - 21r*2/2 + 14r + 3. Does 26 divide v(j)? True Suppose -3h + 310 = 7h. Suppose -4c - 154 = -3o, -h - 21 = -o + 2c. Is 10 a factor of o? True Let w(o) = -5o*2 + 23o - 17. Let f be w(8). Let a = 241 + f. Does 11 divide a? True Let n(s) = -49s2 + 1. Let j be n(-1). Let y = 32 + j. Let f = y + 133. Is 16 a factor of f? False Let k be -4 + 9 + (-1 - 4). Suppose -4m - 3u + 272 = 0, -u + 240 = 3m + 36. Suppose 4o = -ko + m. Does 2 divide o? False Let n = 19742 + -6198. Is 60 a factor of n? False Let q(r) = 2r2 - 15r - 13. Let l(t) = -37 + 14t - 16t + 14t. Let h be l(4). Does 8 divide q(h)? True Suppose w - 225 = -2u, -4w + 624 = 4u - 252. Does 2 divide w? False Let d be (-5 - (-5)/3)-36. Let a = d - 107. Is a a multiple of 2? False Suppose 388 = -4j + 4r, 3j - r = 7j + 398. Let a = j - -128. Does 5 divide a? False Let g = -14168 + 15706. Is g a multiple of 2? True Let u = -6616 - -7100. Is 10 a factor of u? False Let d(m) = -m2 + 8m - 11. Let w be d(2). Let h be w + -3 - -5 - (13 + -1). Let j(t) = 2t2 + 7t - 5. Is 7 a factor of j(h)? False Let o(z) = 3z2 + 29z - 5. Suppose 4p + 55 = -5w, 2p + 22 = -5w - 13. Let j be o(p). Suppose -8m + jt = -5m - 250, -80 = -m + t. Is 4 a factor of m? False Suppose 3b + 3b = 24. Let m(j) = -b - 243j - j*2 + 0j*2 + 234j. Is 2 a factor of m(-7)? True Suppose 0t - 48 = 18t + 6t. Let q(p) = -206p - 13. Let y(f) = 103f + 7. Let n(z) = -3q(z) - 7y(z). Is n(t) a multiple of 10? False Is 12/(-27) - 42929488/(-1764) a multiple of 156? True Let g = -4855 + 8713. Is g a multiple of 37? False Let p = -393 + 692. Let a = 329 - p. Does 10 divide a? True Let j be ((-3)/2)/((-141)/470). Let t(c) = -12c*2 + 83c + 6. Does 3 divide t(j)? False Let i(y) = 3y3 - 38y*2 + 8y - 223. Is i(19) a multiple of 53? False Let u(f) = f*3 - 8f*2 - 37f + 256. Let l be u(9). Suppose 2 = 2b + 2o, 5o = -2b + 7b - 5. Does 13 divide ((-78)/(-24))/(1/lb)? True Let d(q) = -q*3 - 14q*2 - 58 + 105 - 71 - 12q. Does 48 divide d(-14)? True Let c(z) = 2z2 - 2z + 9. Let u(k) = -k*2 + k - 2. Let p(w) = -c(w) - 4u(w). Does 2 divide p(-2)? False Let f = 117619 + -82287. Is f a multiple of 14? False Let z(k) = k*3 + 6k*2 - 2k - 12. Let c be z(-5). Suppose -g - 22 + c = 0. Suppose -3m - 13 = -g, -2m = -4n + 152. Is 8 a factor of n? False Let r(x) = -36x - 73. Let h be r(-3). Suppose 0 = 8w - h - 949. Is 3 a factor of w? True Suppose 2o + 301 = 311. Suppose 73 = ov + 4x - 211, 0 = -v + x + 55. Is v a multiple of 40? False Let x = 18 - -26. Let l(k) = 2k2 + k - 259. Let q be l(-11). Let j = x - q. Is j a multiple of 23? False Let o(j) = -8j - 127. Let t(y) = 7y + 128. Let c(s) = -6o(s) - 5t(s). Does 41 divide c(19)? True Let n(i) = -i3 + 38i*2 - 95i + 221. Is 11 a factor of n(26)? True Let s = -122 + 123. Let l(c) = -7 - 4c + 6c - 4 + s + c*2. Is 38 a factor of l(-8)? True Suppose 5u + 5 - 25 = 0. Suppose 13l - 396 = ul. Let y = l - -17. Is y a multiple of 9? False Suppose 2t - 2124 = 1468. Suppose 3y - 505 - t = 0. Is y a multiple of 8? False Suppose -382 - 1158 = 20k. Is 75 a factor of 1/(1 + 10) + (-11543)/k? True Let a = 15951 + -11688. Is a a multiple of 25? False Let i be 28/63 + (-129136)/(-72). Suppose 531h - 525h = i. Does 13 divide h? True Suppose -76q - 3108 = -88q. Let r = 332 - q. Does 14 divide r? False Let g(v) = -8v + 24. Let q be g(-6). Suppose -2b = -5a - 929, 0 = -b - 0a + 2a + 466. Suppose 10x + q - b = 0. Does 12 divide x? False Suppose -4u - 5a - 157 = 146, 353 = -4u + 5a. Let z = -59 - u. Suppose 22 + 36 = 3j - 2b, -j = 3b - z. Is 10 a factor of j? True Let s be 8/(-16) + (-8540)/(-8). Let j = s + -392. Is j a multiple of 45? True Let q = 695 + -223. Does 24 divide q? False Let l = 289 - 298. Is 3804/32 + l/(-72) a multiple of 21? False Let l = 51 - 74. Is 17 a factor of (l - -218)/(1 + 2 + -2)? False Let z(r) = -r - 1. Let o be z(-3). Let g be 6/((-1)/o - (-2 - 0)). Suppose -f = gm - 244, 111 = 2f + 3m - 357. Is f a multiple of 43? False Suppose -z = 5j - 19, -4j - 3 = -15. Suppose 3l - 461 = zv, 2v + 5l + 77 = -160. Let w = v + 212. Does 8 divide w? True Suppose 22i - 16i - 984 = 0. Let l = -71 + i. Is l a multiple of 20? False Let r(n) = -5n*3 - 169n*2 - 38n - 69. Does 21 divide r(-34)? False Let l = -29 - 18. Let h be 0 - 0 - (2 - l). Let j = h + 69. Does 10 divide j? True Suppose -9 = -2b + 3k, k + 4k + 30 = 5b. Let m(v) = 4v + bv - 13 - 19v - 11. Is 13 a factor of m(-8)? False Suppose 0 = 5n + 15, 3x - n - 816 = n. Is x a multiple of 15? True Let f(h) = -h2 + 45h + 328. Let j(z) = 7z - 63. Let c be j(9). Is 49 a factor of f(c)? False Suppose 5a - 719 = 4x + 1185, 2x - 1898 = -5a. Let p be (-3)/18 - a/24. Let n = 22 + p. Does 4 divide n? False Suppose 13j - 3970 = 8j + 5k, 3k + 3174 = 4j. Suppose 7q - j = -4q. Is q a multiple of 8? True Suppose 19v - 6v = -3081. Let f = 70 + v. Let c = 247 + f. Does 8 divide c? True Suppose -6j - 5t = -j - 45, 0 = 5j + 3t - 37. Suppose -14 = 3l - 5, -jl = i - 147. Does 9 divide i? True Let i be 1/(1 + (-308)/304). Let u = i - -560. Is u a multiple of 44? True Let b = -22 - -20. Let r(p) = 13p + 9. Let k(j) = -2j + 3. Let u(x) = 5k(x) - r(x). Is 7 a factor of u(b)? False Let y be 3/(-6)2 - -3. Let n = -25 + 30. Suppose 5c - 59 = yc - 2l, 0 = nc + 2l - 97. Is 19 a factor of c? True Let k(a) = -3322a + 792. Is k(-4) a multiple of 110? True Let q be (-5720)/(-50) + (-2 - (-26)/10). Suppose 20 + 95 = 3d + 4x, -5d - 5x = -185. Suppose db + q = 38b. Is 23 a factor of b? True Let w = -194 - -196. Suppose n = -5, wy + n - 586 = -173. Is y a multiple of 19? True Let o(x) = 1841x*3 - 19x*2 + x - 3. Is o(1) a multiple of 13? True Suppose 0 = -f + 9 + 45. Let q be 2/7 + 1 + 25/35. Suppose 0 = -4h - qh + f. Does 2 divide h? False Suppose 0 = 5m - 0h + h + 101, -5m = -3h + 117. Let f be (-8)/(-6)(m/(-6) - 2). Suppose 0d + fd = 70. Is 14 a factor of d? False Let f(q) = 5 + 5 + q*3 - 5 + 5q*2 - 10q. Is 5 a factor of f(4)? False Let o(q) = -2 - 10q + 0 - 2 + 2. Let i = -137 + 126. Is 10 a factor of o(i)? False Let d be (-10)/(-35) + 13/1474. Let t = 201 - d. Let b = t + -18. Is 15 a factor of b? False Suppose 1198 = 7x - 27. Is 63 a factor of 490/x(-3)/(-2)60? True Let h(o) = -o + 21 - 53 + 29. Let t be h(-9). Suppose 0b - t = 3b, 3b = -4w + 162. Is w a multiple of 14? True Suppose -11f + 8f + 4i + 4141 = 0, -2774 = -2f - 4i. Does 4 divide f? False Let t = 92 - 87. Suppose -tj = -2j - 2091. Does 41 divide j? True Let o(i) = -7i - 197. Let w be o(-18). Let j = w + 91. Does 19 divide j? False Suppose 681912 = 664z - 631z. Is 6 a factor of z? True Let z(x) = -x + 168. Let a be z(20). Suppose 3m - 268 = -4y, a = 2m - 3y - 2y. Is m a multiple of 64? False Suppose 0 = -4c - 3l + 6 + 475, 4l = -5c + 601. Let i = c + 51. Is i a multiple of 9?	{ "pile_set_name": "DM Mathematics" }
g order. r, -2/9, a Let z be -2 - (0 - -1)/(3/(-12)). Put 5, z, -1, -25 in increasing order. -25, -1, z, 5 Let i = -271/7 + 39. Put -3, i, -4 in descending order. i, -3, -4 Let d = 9 + 3. Let a be 2/6 - 19/d. Let s = 63.8 - 61.8. Put a, 0, s in decreasing order. s, 0, a Let w = 2 - 7. Sort w, -6.6, -0.1, -0.4 in decreasing order. -0.1, -0.4, w, -6.6 Let s be 150/2 - 30/10. Sort 3, 1, s in increasing order. 1, 3, s Let v = -541 + 544. Sort -8, -3, 2, v in decreasing order. v, 2, -3, -8 Let z = -166 + 163. Put 0.19, z, 1/4 in ascending order. z, 0.19, 1/4 Let f(v) = v*3 + 11v*2 + 5v + 13. Let p be f(-8). Let j = p - 160. Put j, -12, -1, 0 in decreasing order. j, 0, -1, -12 Let n(o) = -o*2 - 14o - 22. Let v be n(-14). Sort -1, v, 2 in descending order. 2, -1, v Let o(g) be the third derivative of 5g4/24 - 10g*3/3 - 9g*2. Let h be o(5). Let v be (-6)/(-4)(-1)/(-2). Sort h, v, 3/8. 3/8, v, h Let q = 1082 - 1082. Let b = 4 - 7. Sort q, b, -8. -8, b, q Let j be (475/(-76))/(-25) + 1/4. Put -12, -2, j, -1/2 in ascending order. -12, -2, -1/2, j Suppose -m = -3m - 8. Suppose -9c + 5c = -i - 17, 3c = 5i + 34. Sort -1, i, m, 0. i, m, -1, 0 Suppose -4f + 4n = -20, 0n = -5f - 5n - 15. Sort 0, 105, -4, f in ascending order. -4, 0, f, 105 Let z = -295 - -295.1. Let n = 6 + -2. Sort n, 4/5, z. z, 4/5, n Let f(h) = h*3 + 36h*2 + 36h + 36. Let d be f(-35). Put -2, d, 16 in descending order. 16, d, -2 Let o be 24/3-1 + 3. Let a be o + 4 + 4/7. Put 13, 2/7, a in increasing order. a, 2/7, 13 Let g be 3 - (5/(-5) - 3). Let x = g - 3. Sort 5, -16, x, 3. -16, 3, x, 5 Let p be (-4)/(-7)(-135)/180. Put p, -20, -3 in increasing order. -20, -3, p Let k(j) = 65j2 + 2j - 3. Let x be k(3). Let r be x/(-315) - (2/(-2) + -1). Put -1, -0.5, -3, r in descending order. r, -0.5, -1, -3 Let l(h) = 2h2 - 14h - 36. Let a be l(-2). Put 5, a, 1, -1 in increasing order. -1, a, 1, 5 Let w be 4 - (0 - 24/4) - 5. Sort -2, -4, w. -4, -2, w Let f = -0.09 - 0.15. Let y = f + 0.24. Let h be 14/30 - (-1)/3. Sort h, y, 2/7 in descending order. h, 2/7, y Let j = -7.8 - -8.8. Sort j, -1, -1/6 in ascending order. -1, -1/6, j Suppose 2p = -4, -5a - 2p + 136 - 15 = 0. Sort 1, a, -4, 4. -4, 1, 4, a Let y(p) = p2 + 5p + 2. Let v be y(-5). Let z = -0.0444 - 0.0256. Put z, -5/6, v in increasing order. -5/6, z, v Suppose 3q + 2q = -40. Suppose -105 = -11f - 50. Sort -3, 4, f, q. q, -3, 4, f Let q = -24 + -1. Let p be (-3 - 170/(-55))(1 - -1). Sort -5, p, q in decreasing order. p, -5, q Suppose 0a - 5a - 18 = p, -2a + 5p = -9. Let r be -4 - 2(a - 1). Put -8, 0, r in descending order. r, 0, -8 Let p = 0 - 3. Let m = -5602 + 5597. Sort -15, p, m. -15, m, p Suppose -j + 4j + 79 = -2h, 0 = 4h - 3j + 131. Let y be (0 + -2)/(-6 + (-12 - -26)). Sort y, h, -3 in increasing order. h, -3, y Let x = -4.77 - -3.87. Sort -3/5, 8, x in descending order. 8, -3/5, x Let t = -5 + 4.94. Let q = 2.06 + t. Let i be (-5)/(-3)14/(-35). Put -1, i, q in decreasing order. q, i, -1 Let c = 2/1253 - -2480/16289. Sort 4, -0.3, c, -0.1 in decreasing order. 4, c, -0.1, -0.3 Suppose 0 = -5v - 4t - 5, 8v - t + 4 = 4v. Let r = -4 + 12. Suppose -f = 4w + w - 4, -2f - 2w = -r. Put -3, v, f in descending order. f, v, -3 Let r be (-2)/10(113 + -118). Suppose -s - 8 = -5s. Suppose 15 = m - 4a, -sm - 2m - 3a - 35 = 0. Sort -1, m, r in descending order. r, -1, m Let c = 0.2 - 0.7. Let w = 479.4 + -478.9. Put 1, w, c, 0.2 in decreasing order. 1, w, 0.2, c Let h = -7 - -3. Suppose -6n + 1052 = -556. Let x = n + -268. Put 1, x, h in ascending order. h, x, 1 Let y be -3 + (2/1 - 3). Suppose 4n - 3n = 9. Suppose -nk + 6k = -6. Sort y, k, 1 in descending order. k, 1, y Let m be -5(-3(-147)/35 - 1). Sort -4, m, 1 in decreasing order. 1, -4, m Let b = -2160 - -2154. Sort -114, b, -3, 0 in decreasing order. 0, -3, b, -114 Suppose 7o = -12o + 114. Put 1, -4, -5, o in ascending order. -5, -4, 1, o Let u be (-2)/4 - (-33)/(-6). Let t(g) = 2g + 1. Let m be 0/(-3) + 1 + -1. Let h be t(m). Sort -3, h, u in descending order. h, -3, u Let w be 45/(-231) + 3/(-33). Put w, 4, 1/7, 0.9 in increasing order. w, 1/7, 0.9, 4 Let i be 44/48 + (-20)/30. Sort -2/7, -1, -4, i in increasing order. -4, -1, -2/7, i Let u be 4 + -11-1. Let v = -159 - -184. Suppose -14g = -v - 31. Sort 2, u, g in increasing order. 2, g, u Suppose -5j + 3h + 6 = 0, -123j + h + 12 = -118j. Put j, 0.1, 71 in increasing order. 0.1, j, 71 Suppose 16 + 2 = -6c. Let x(a) = -82a - 16 + 13a2 + 3a*3 + 67a - a3 - a3. Let b be x(-14). Put c, b, 0 in increasing order. c, b, 0 Let g = -0.1827 - 3.8003. Let z = -0.017 + g. Put z, -3, 0.4 in descending order. 0.4, -3, z Suppose -3b = -n + 12, -b + 4n = 2 + 2. Let q(u) = u - 2. Let x be q(2). Sort b, x, -3. b, -3, x Let o = 5 + -5.06. Let v = o + 0.04. Let c = v - -2.02. Sort 1, c, -2 in descending order. c, 1, -2 Let w be ((-1)/44)/((-5)/(-20)). Sort w, -63, -2. -63, w, -2 Suppose 6a + 1 = 5a. Let t be a/2 + 34/(-4). Sort -5, t, -1 in decreasing order. -1, -5, t Let c(x) = 4x - 35. Let n be c(8). Let v be (-4)/(-6) - (-4)/3. Sort -5, v, n. -5, n, v Let n = 3 - -4. Let r = -16 + n. Sort 3/2, -5, r, 2 in decreasing order. 2, 3/2, -5, r Let m = 77 - 165. Let d = m + 84. Put 3, 1/4, d in descending order. 3, 1/4, d Let y = -13.5 + 13. Let u = 0.23 - -12.77. Let i = u + -13.1. Sort i, 5, y in ascending order. y, i, 5 Let v(d) = 23d + 98. Let l be v(-4). Put 22, l, 2 in ascending order. 2, l, 22 Let u be 48/(-16)1. Put 11, u, -4 in increasing order. -4, u, 11 Let i = 8819 + -8819. Let r = 7 - 3. Sort -2, r, 5, i in decreasing order. 5, r, i, -2 Suppose -2n = -2f + 14 - 0, -1 = -2n - 3f. Let p = -11 + 14. Let o = -30 - -29. Put p, n, o in ascending order. n, o, p Suppose 3c + c + 4g = -4, -5g = -2c + 5. Suppose c = -0x + 5x - 25. Let p be (1 - 2)/(4/243). Sort 0, p, x. p, 0, x Suppose 0 = -5l + 3m + 30, -2l = 4m - 2 + 16. Let g = 212 + -214. Let c = 0 + 0.1. Sort l, g, c in decreasing order. l, c, g Suppose -6n - 19 = 5. Sort 0.4, n, 130 in ascending order. n, 0.4, 130 Suppose -55 = -5h - 5. Let p = h - 11. Put p, 2, -2 in descending order. 2, p, -2 Let z be (-2)/3(-18)/4. Suppose zr + 6 = 0, 0y = 3y - r + 1. Let b be 3 + -3 + 4 + -2. Sort b, y, -4 in ascending order. -4, y, b Let v(b) = -14b + 37. Let i be v(1). Sort -1, i, -2 in increasing order. -2, -1, i Let r(f) = -f2 - f + 2. Let m be r(3). Suppose -2q + 35 = 3q. Let o = q + m. Sort 0, o, -5 in decreasing order. 0, o, -5 Let z be ((-81)/18 - -5)/(2/12). Let x = 11 - 7. Let o = -3.6 + x. Sort 2, o, z in ascending order. o, 2, z Let v = 91 + -47. Let o = v - 49. Let n = 0.5 - 1.5. Put o, 0.2, n in decreasing order. 0.2, n, o Let v = -1 - 2. Let l = 11 + -7. Suppose -2f - 10 = -14. Sort l, f, v. v, f, l Let k be (-4)/12((-22)/(-1) + -7). Sort -13, 3, 4, k. -13, k, 3, 4 Let b be ((-24)/(-40))/((-27)/60). Sort 0.3, 14, -0.2, b in descending order. 14, 0.3, -0.2, b Let w = -19 - -16. Suppose -40 = -6b - 28. Put w, -1/5, b, -2 in ascending order. w, -2, -1/5, b Let g(y) = -15y + 72. Let q be g(5). Sort q, -1, 5, 4 in descending order. 5, 4, -1, q Let f be 8/249/6. Sort -0.42, 2/3, f, 3. -0.42, f, 2/3, 3 Let t be 21/2 + 102/68. Suppose 1 + 2 = -p, -5n + 7 = -4p. Sort n, -5, t in descending order. t, n, -5 Let u = 768 + -767. Sort -1.6, u, 0.5. -1.6, 0.5, u Let z = 16 - 10. Suppose 12 = zh - 3h. Suppose 3n - 2l = 16, 3n = -3l - 5 - h. Put -4, 7, n in ascending order. -4, n, 7 Let c = 441 - 443.01. Let s = 0.01 + c. Let b = s - -1.7. Sort 0, -5, b. -5, b, 0 Let f = -5.02 + 0.02. Let x = -2887/10 - -289. Sort x, f, -2 in descending order. x, -2, f Suppose 0 = -p + 2p - 6. Let h be ((-10)/8)/((-115)/(-20) - p). Sort 2, -6, h. -6, 2, h Let l = 99 - 99.3. Sort -4, l, 3, -5/7 in ascending order. -4, -5/7, l, 3 Suppose -7n + 70 = -0n. Suppose -3z + 6z - 18 = -4l, 3*l = 9. Put -5, n, z, -4 in increasing order. -5, -4, z, n Let i = -1.99 - -28.99. Sort -4, 1, i, 0.5 in increasing order. -4, 0.5, 1, i Let c = 561/28 + -79/4. Let v = 34 - 21. Let j = v - 11. Sort c, 3, j in increasing order. c, j, 3 Let o = 1613 + -1607. Sort -11, 1, -2, o in decreasing order. o, 1, -2, -11	{ "pile_set_name": "DM Mathematics" }
e 25 = 5l, 0 = -3t + mt - 3l + 23. Is t a multiple of 3? False Suppose -1 - 16 = -x. Does 5 divide x? False Let s be ((-52)/6)/(4/(-60)). Let a = s - 79. Does 17 divide a? True Let p(t) = 96t - 28. Is 13 a factor of p(3)? True Suppose -4x - x + 147 = 2a, 3a + 84 = 3x. Is 12 a factor of x? False Suppose -7 = 5d - 2. Let p = 6 + d. Does 5 divide p? True Let m(a) = -17a - 5. Let u be m(-5). Let j = -40 + u. Does 8 divide j? True Let b = -2 + 5. Suppose -59 = -2i - 5l, i - 43 = -bi + 5l. Let p = i - 6. Is 11 a factor of p? True Suppose 0 = -2a - 2x + 12, -5x - 3 = -6x. Let u(o) = -2 + 6 - 3o*a + 0o*2 - 8o*2 + 2o3. Is 4 a factor of u(-8)? True Let w(i) = i. Let p(c) = c2 + 18c. Suppose 0 = -4a - 4, 2m + 0a = -4a - 6. Let j(k) = mp(k) + 5w(k). Is 13 a factor of j(-6)? False Let d = -27 + 69. Does 5 divide d? False Let a(j) = 12j. Let k be a(1). Suppose 0 = -3z + 5z - k. Does 6 divide z? True Let l = 251 - 87. Is 16 a factor of l? False Let z(x) = x*2 + 6x - 1. Is z(7) a multiple of 15? True Let u(h) = h*2 + h - 4. Suppose -5b - 15 = -2b. Is u(b) a multiple of 8? True Let i(j) = -j2 - 8j - 3. Let p be i(-7). Suppose -py - 112 = -8y. Is y a multiple of 6? False Suppose 0 = v + 9 - 61. Suppose g + v = 4k - g, -3g = -5k + 67. Is k a multiple of 3? False Let q(o) = o2 - 6o + 2. Let z be q(3). Let c(f) = -f*2 - 9f - 4. Does 10 divide c(z)? True Let k = 18 + -10. Let v be (15/4)/(2/k). Let u = v - 10. Is u a multiple of 5? True Suppose 5n - 25 = -r, 3n + r + 4r = 37. Suppose -4v = 4 + n. Let u = v + 20. Does 9 divide u? True Is 6 a factor of (-6)/2 + (13 - -8)? True Let q(j) = -j*3 - 4j*2 + 2j. Let b(t) = t*3 + 4t*2 - 5t - 5. Let z be b(-5). Is q(z) a multiple of 15? True Suppose 3b + 34 - 124 = 0. Is b a multiple of 15? True Suppose -2y = -3 + 1, -53 = -3i + 4y. Is 19 a factor of i? True Let i(s) = -s*3 + s - 23 + 7 + 0s + s2. Let a be i(0). Let d = a - -24. Is 4 a factor of d? True Let a = -143 + 31. Let n = -76 - a. Is n a multiple of 9? True Let d(n) be the second derivative of n5/20 + n*4/6 - 2n*3/3 + 3n*2/2 + 4n. Let s be d(2). Let w = 21 - s. Does 10 divide w? True Is 13/(-91) + 422/14 a multiple of 12? False Suppose 5a + 0 - 10 = 0. Suppose 3q - 5b - 7 + a = 0, 4q + 3b + 3 = 0. Suppose q = 2h - 6h + 44. Is h a multiple of 11? True Let p = -11 - -15. Suppose 0j = 3j + pg + 16, -20 = -2j + 5g. Suppose -t + 3 = -jt. Is t even? False Let y(i) = i3 - 15i*2 + 4i - 18. Does 7 divide y(15)? True Let c(j) = -13j - 19. Is 36 a factor of c(-7)? True Let l = -96 - -223. Let x = -67 + l. Is 10 a factor of ((-8)/(-5))/(8/x)? False Let d(u) = u + 5 + 7 - 1. Let z be d(-10). Is 6 a factor of (2 + -13)/(-1z)? False Let o = 12 + -7. Suppose t + 0a = -4a + 21, -3a - 220 = -ot. Is 16 a factor of t? False Let s = -33 + 50. Is s a multiple of 11? False Let k(x) = 2x2 + 8x + 6. Let a(v) = v*3 + 3v*2 + 3v + 4. Let r be a(-3). Is 16 a factor of k(r)? True Suppose 0h = 2h - 22. Let i = h - 4. Does 7 divide i? True Let k = -54 + 51. Let u = -3 + 8. Let o = k + u. Is o a multiple of 2? True Let x(w) = w. Let s(c) = -c*2 + 2c + 7. Let g(b) = s(b) + x(b). Let z be g(5). Let m(u) = u*2 - u + 2. Does 8 divide m(z)? False Let y(x) = 6 - 1 + 4x - 3x + 1. Is y(0) a multiple of 3? True Is -2 + 2128/6 a multiple of 16? True Suppose -5f - 3 = l, 4f + 9 + 3 = -4l. Suppose 4x = 4v + x - 3, -4v - 2x + 18 = f. Suppose 0g = vg - 45. Is g a multiple of 9? False Let b = 69 + -40. Is b a multiple of 9? False Suppose 5h - 242 = -4x + 250, 3x = -4h + 370. Does 31 divide x? False Let b(x) = 10x + 8. Let v be b(7). Suppose l = -2l + v. Is l a multiple of 7? False Suppose 0 = -0w - 3w + 90. Let g = w - 15. Is g a multiple of 12? False Let q(p) = p3 + 6p2 - 3. Let b be q(-6). Is 18 a factor of 4/6 - 82/b? False Let t(a) = a3 - 3a2 - 4. Let g be t(3). Let d(r) = -r + 1. Let p(m) = -m2 - 5m - 1. Let x(b) = 2d(b) - p(b). Does 7 divide x(g)? True Suppose 0 = 5k - 2s - s - 120, 0 = -3k - 4s + 43. Let m = -9 + k. Is m a multiple of 4? True Let h be 7/2 + 1/(-2). Suppose h = -2d - d, 0 = 5s - d - 201. Suppose c - s = 5v, 3v - v = -5c + 173. Is 9 a factor of c? False Suppose 0 = -0b + 4b + 2s - 62, 0 = 4b - 4s - 56. Does 15 divide b? True Let i be 2/5 - 53/(-5). Suppose i + 5 = -2t. Let l(a) = -a*2 - 10a - 5. Is 11 a factor of l(t)? True Let m(h) = 9h. Let a = -9 - -13. Does 13 divide m(a)? False Let m(c) = c2 - 2. Let l = 7 + -11. Is 11 a factor of m(l)? False Let q(z) = z2 - z - 1. Let u be 1(5/1 - 1). Let p be q(u). Suppose -36 = -5j - p. Does 2 divide j? False Let t = 3 + 17. Does 6 divide t? False Suppose 5z + 0z = 2w - 211, 2z - 3w + 80 = 0. Let j = z + 115. Suppose s - 5s = -j. Is 7 a factor of s? False Let o be 1/3(-3)/1. Let f = 17 - o. Is f a multiple of 18? True Is (4/(-10))/((-5)/375) a multiple of 15? True Suppose 4d - 2t = -28, 3t = 3d - 0t + 27. Let k(c) = -3 - 1 - 16c - 4 + 3. Is 26 a factor of k(d)? False Let i(f) = f - 10. Let h be i(10). Suppose 4w = -16, -4t + hw + 20 = w. Suppose -4d = b - 5b - 40, -d - t = -5b. Does 14 divide d? True Suppose -i = n - 7, 8n - 4n = -8. Is 9 a factor of i? True Let a(r) = r*2 - 5r - 13 - 2r + 12. Let l be a(6). Let k = 16 - l. Is 11 a factor of k? False Suppose 2s + x - 32 = 0, -65 = -4s - s + 5x. Is 5 a factor of s? True Let j = 59 + -41. Does 8 divide j? False Let f = -7 + 12. Suppose -5s + 7 = -h - h, -f = -s. Does 2 divide h? False Let s(v) = -9v3 + v2 + 2v + 2. Is s(-1) even? True Is 46 a factor of (36 - 0)((-23)/(-3) - 0)? True Suppose -141 = -2t - 3a, 5t = -a + 4a + 405. Is t a multiple of 13? True Let h be (52/(-16))/((-1)/4). Let i(o) = o*3 - 2o*2 + o + 1. Let n be i(2). Suppose b + nb + 3c = h, 5b - 19 = -c. Is b even? True Let a(c) = 18c2 + 4c + 2. Let l(o) = 3o + 1. Let r be l(-1). Does 22 divide a(r)? True Let p = -20 + 60. Is p a multiple of 20? True Suppose -4s - y + 5y = -204, 5y = s - 71. Does 23 divide s? True Let m(z) = -z*2 - 9z + 6. Let l be m(-7). Suppose 0 = 2f + 2f - l. Is 3 a factor of f? False Suppose -5q = -6q + 23. Suppose -5 - 20 = -5w. Suppose 0 = wt - 32 - q. Does 5 divide t? False Suppose b = -4b + 5. Suppose -b - 7 = -4z. Suppose 26 + 18 = zh. Is h a multiple of 9? False Let k be 1-4 - -1 - -3. Suppose i + i - 96 = k. Does 20 divide i? False Let u(z) be the third derivative of -z6/120 - z5/20 + z*4/6 + 2z3/3 - z2. Let a be u(-4). Suppose -a - 24 = -2j. Is 7 a factor of j? True Let z = 34 - -11. Let r = z - 23. Does 11 divide r? True Suppose 7 = -3n + n - j, -3 = -3j. Let l = n - -20. Is l a multiple of 8? True Let s = -33 - -68. Is s a multiple of 6? False Suppose 4a = 6a - 10. Let p(f) = -2f + 2f + af. Is 3 a factor of p(1)? False Let i = 7 + -2. Let h be (-2020)/(-15) - (-2)/(-3). Suppose 0 = -iu + h - 24. Is 11 a factor of u? True Suppose 0 = -v - 1 + 5. Let g = v + -2. Suppose -3a = -4p - 24, 4a - 3p - 31 = gp. Does 4 divide a? True Let v = 150 + -228. Let l = 110 + v. Is l a multiple of 23? False Let c = 61 + -36. Is 10 a factor of -2 + (-1 - 2) + c? True Suppose -x + 6 = k, 2k = x + 4k - 8. Suppose 4s - x = 4a, -5s = -0s - a - 9. Is 2 a factor of s? True Suppose -4d - 4 + 12 = 0. Let q(t) = -2t + 3 - 3t + 2t + dt. Is 3 a factor of q(-3)? True Suppose 5h - 2 - 4 = -4b, 3h + 5b = 1. Let g(q) = -q3 + 0q - 7q + 1 - 2q*h + 9q*2. Is 8 a factor of g(5)? True Suppose -i - 4 = -4y, 2y - 5i + 9 + 7 = 0. Let p be (y/3)/(4/84). Suppose -o + p = o. Is o a multiple of 7? True Let i be 1/(3 + 114/(-39)). Let h = -3 + i. Does 4 divide h? False Let n(h) = h + 14. Let i be n(-14). Suppose io - 4o = -24. Does 2 divide o? True Let s be 2/(-3 + 1) + 3. Is s + -4 + 1 + 64 a multiple of 18? False Let k(p) be the second derivative of p5/20 - p4/4 + 2p3/3 - p2 + 3p. Is k(3) a multiple of 5? True Let n be 1137 - (-12)/4. Let j = -68 + n. Does 19 divide 3472/j + 2/(-9)? False Suppose 5c - 34 = 41. Does 15 divide c? True Suppose 0q - 10 = -2q. Suppose -q*t - 44 = -154. Is t a multiple of 11? True Let l = 126 - -1. Is 19 a factor of l	{ "pile_set_name": "DM Mathematics" }
a(12) a multiple of 10? True Does 13 divide (-6)/(-432)-12 + 50894/12? False Let g = 457 + 107. Suppose -l + 0l = -g. Suppose 0 = 6d - 366 - l. Is 31 a factor of d? True Let z = 356 + -361. Let w(v) = -4v3 - v2 - 15v - 56. Is w(z) a multiple of 12? False Suppose 0 = -4z + g + 9981, 3g = 2z - 3275 - 1728. Does 29 divide z? True Suppose 5g + 3f - 72 = 0, -4 = -f - 0f. Suppose 0 = -9o + go - 255. Does 5 divide o? True Let w(p) = -126p - 514. Is 9 a factor of w(-16)? False Suppose -3060 = 77l - 94l. Suppose -19u = -l - 1872. Is 25 a factor of u? False Let s(r) = r3 + 7r*2 + 11r. Let l be s(-3). Suppose 0 = lb + 318 - 2208. Is b a multiple of 70? True Let x(u) = 1 + 6 - u3 - 29u - 1 - 806u2 + 827u*2. Is x(19) a multiple of 26? False Let x(n) = 10n*2 - 10n + 17. Let m(q) = -9q2 + 10q - 17. Let i(h) = -6m(h) - 5x(h). Is 13 a factor of i(3)? False Let o(f) = f*2 - 9f + 18. Let b = 36 + -29. Let r be o(b). Suppose 152 = 6c - rc. Is c a multiple of 19? True Let k = 37 + -3. Let a = k + -24. Suppose 1596 = 4r + ar. Is 19 a factor of r? True Let p(q) = -q - 109q2 + 7q - 4 + 3 - 5q. Let h be p(1). Let c = -61 - h. Is c a multiple of 5? False Let m(i) = i3 + i2 + 7i + 35. Let s be m(-3). Is 14 a factor of (s + 36/6)(1 - -190)? False Let y(j) = 176j*2 - 765j + 43. Does 308 divide y(-13)? True Let p(n) = 24n2 - 1 - 5n - 22n2 - 4n. Let q be p(5). Suppose -y = -qk - 116, -77 = 2y - 5k - 309. Is y a multiple of 29? True Suppose 0 = 2k - 3k - 5l - 3, 5 = -5l. Suppose kz - 1268 = -5o, -2o - z = -6z - 484. Suppose o - 60 = 8q. Is 4 a factor of q? True Let m(x) = -14x2 - 20x - 4. Let a(d) = -5d2 - 7d - 1. Let c(v) = 11a(v) - 4m(v). Let b be c(-3). Is 335/b - (4 + -1) a multiple of 4? True Let u = -184 - -3121. Is u a multiple of 3? True Let g(w) = 228w + 3572. Is g(43) a multiple of 32? True Let h be -4 + 1 + -1 + 8. Suppose 4t - 3u + 81 = 0, t - hu = 5t + 88. Is 24 a factor of (-2408)/t + 4/(-6) + -1? False Let y be ((-782)/(-4) - 0) + 3/6. Suppose -h = 6h - y. Suppose 4v + p = 78, 3p = v - p - h. Is v a multiple of 5? True Suppose 2t = 6m - 5m + 265, -1405 = -11t - 2m. Does 2 divide t? False Let j(u) = u3 + 6u*2 + 9u + 14. Let c be j(-5). Does 14 divide c + 1158/8 - 2/(-8)? False Suppose -d = g + 349, 109 = 2d - 2g + 795. Let b = d - -562. Is 24 a factor of b? True Let u = 142 + -60. Let c be (6/12)/((-4)/272). Let m = u + c. Is 12 a factor of m? True Let b = -195 - -247. Is 80 a factor of b/39 - (-1091)/3? False Suppose -8720813 = -494l + 2007385. Is 28 a factor of l? False Let v be (13035/(-44))/15 - (-1)/(-4). Let b(f) = f3 + 21f*2 + 4f - 41. Does 13 divide b(v)? False Let s(x) = -22x + 15. Let j be s(3). Let g = j - -55. Is 9 a factor of (-68)/(-6)g(-6)/(-16)? False Let f(w) = w2 - 15w + 3. Let y be f(0). Is 10 a factor of 1(-5 - (y - 117))? False Suppose 22y - 119543 = 145889 + 14562. Is y a multiple of 7? False Let q(m) = 2m - 1. Let n be q(3). Let h(x) = 23x*2 + 26x - 5. Let v(f) = 13f2 + 13f - 2. Let k(s) = 4h(s) - 7v(s). Is 10 a factor of k(n)? False Let c be (-11 + 12)/((-2)/(-2)). Suppose 0 = 4p - 2w - 17 - 5, 2w = -3p - c. Let k = p - -3. Is 3 a factor of k? True Suppose 13t - 10 = 8t. Suppose tf + 4 = -4s, -4s = -3f + 2 + 2. Suppose f = -3z + 2z + 59. Does 12 divide z? False Suppose 6x = 45 + 81. Suppose -224 = 20l - xl. Suppose -5t = 4o - 729, 5o + t + l = 1109. Is 27 a factor of o? False Let r(p) = 18p2 - 28p + 207. Let j be r(7). Suppose 4k = z + j, -8k + 7k + 4z + 227 = 0. Is k a multiple of 29? False Suppose -3i = -16i + 3185. Suppose i + 7 = 6a. Does 7 divide a? True Suppose 10w + 457 = -1783. Does 11 divide w/(-1 - 0 - (-21 - -21))? False Is ((-12)/(-10))/(3/5) - -17251 a multiple of 9? True Suppose 0 = 11t - 8t - 9. Suppose 0 = 4m + b - 33, -2m + 2b = -m - 15. Suppose -tc + m = -9. Is c even? True Suppose 0 = -4k + 6d + 33554, -5k - 52d = -51d - 41934. Does 152 divide k? False Let p = 105 + 2178. Let k = p + -1213. Is k a multiple of 13? False Suppose 0 = -5s + 20, -4j = 2s + 3s - 4912. Let h = j - 23. Is h a multiple of 35? False Let r(u) = 5u*3 - 12u*2 + 7u + 27. Let z(w) = -3w3 + 6w*2 - 3w - 14. Let l(j) = -4r(j) - 7z(j). Let t = 2 - 8. Is 6 a factor of l(t)? False Let a(u) = 58u - 159. Let z be a(3). Suppose 0 = -zf + 28f - 8359. Is f a multiple of 15? False Let b(s) = -11s + 17. Suppose 0 = v + 3v - 20. Suppose 2f - d + 13 = 0, -2f - vd = f + 39. Is 21 a factor of b(f)? True Let y be ((-50)/(-60))/(1/6). Suppose 1105 = yx - 4c, 24x - 665 = 21x + 2c. Is x a multiple of 45? True Let g = -35 - -40. Let d = 40 + g. Does 15 divide d? True Suppose -2k + 4110 = -5i, -3k + 2233 = -4i - 3918. Is 3 a factor of k? False Let i be (-27 + 6)/(2 + -3). Let y be 3/(-7) - 8496/i. Let g = 664 + y. Is g a multiple of 37? True Let l(z) = -z + 13. Let g be l(18). Let i be 25(1(3 + -4) - g). Suppose i = 3a - 206. Is a a multiple of 17? True Let n = 395 - 611. Let m = n - -909. Does 11 divide m? True Let y = 177 + -170. Suppose 6v + 370 = yv. Is v a multiple of 37? True Suppose -30x = -3178 - 4472. Is 78 a factor of x? False Suppose 7b + 9 - 16 = 0. Is b/((-2)/41) + 198 a multiple of 14? True Let l(r) = -4r - 16. Let m be l(-4). Suppose -a + mt - 4t + 7 = 0, -t - 2 = -a. Suppose -1 - 2 = 3y, -ay = 4h - 525. Is 33 a factor of h? True Let u be (4 - (-1 - -8))-48. Suppose 13f - u = 4f. Does 8 divide f? True Let c(y) = -2y3 + 87y*2 + 19y - 2025. Does 123 divide c(37)? False Let z = 4774 - 3610. Is z a multiple of 8? False Suppose -2m - a = -37956, -196a + 201a - 37932 = -2m. Is m a multiple of 40? False Let r be 3 + (-8 - (3 - 3)) + 391. Suppose 5c - 666 = 2w + w, 0 = 3c + 5w - r. Is c a multiple of 6? True Suppose 0 = -5y - 40, y - 792 - 2266 = -2s. Is s a multiple of 3? True Let l(g) = 2g3 + 15g*2 + 6g + 14. Let y be (-1 - -2)/((-54)/24 + 2). Is 4 a factor of l(y)? False Let q(y) = -24y - 230. Let z be q(-11). Is 6 a factor of 2 + (-6491)/(-9) + z/(-153)? False Suppose 86z + 120 = 81z. Let f = z + 142. Is 25 a factor of f? False Suppose -2w + 21 = 3q, -1 + 12 = q + 2w. Suppose 208 = 4x - 4v, -438 = -qx - 5v - 128. Let b = -39 + x. Is 3 a factor of b? True Let i(m) = -37m + 46. Let g be i(2). Let u(s) = s2 + 14s + 108. Is 49 a factor of u(g)? False Let g(f) = 13f + 75f + 15f - f + 5. Is 19 a factor of g(2)? True Let u = -169 + 208. Is (753/(-78) - (-6)/u)-18 a multiple of 19? True Suppose -3g + 3h = g + 555, 2g + 272 = -4h. Let a = g + 321. Does 42 divide a? False Let i(a) = -a*2 + 11a - 10. Suppose -4w = 3b - 2, -w = 3w + 4b. Suppose 3q - wu = 30, 4u = -16 + 4. Is 11 a factor of i(q)? False Let m(s) = -2s - 50. Let o be m(-26). Suppose 6h = -4g + oh - 36, -4g = 5h + 36. Let w = g - -55. Does 4 divide w? False Let w = 35367 - 29780. Is w a multiple of 11? False Let h be 310/15 - 2/3. Let y be 4/10 + 492/h. Let j = y + -11. Is 14 a factor of j? True Let o = 0 - -4. Let m be (1 + -6)((-36)/10 + o). Does 4 divide 32 + (-3)/m(-8)/6? False Suppose 19m - 2033446 + 582340 = 0. Is m a multiple of 11? False Let x(z) = -z + 1. Let d(j) = -25j + 13. Let a(h) = -d(h) - 3x(h). Does 4 divide a(3)? True Let t = -19 + 32. Suppose t = a - 12. Suppose 0 = -24u + au - 96. Is 6 a factor of u? True Let c = 1829 - -790. Is 4 a factor of c? False Let l(c) = c*3 + 15c*2 + 18c - 15. Let f be l(-14). Let k = -66 - f. Suppose ki + 0a - 4a - 351 = 0, 16 = -4a. Is i a multiple of 33? False Let n be 74/6 - 13/39. Let b be (-16)/n + (-2188)/6. Does 24 divide b/(-15) - 2/5? True Suppose 0 = -7h + 8h - 17. Suppose h = -d - 5m, -4d + 4m = -0d - 28. Is 5 a factor of -125/(-10)d? False Suppose 0 = -2z + 5x + 201, 2x - 4x - 318 = -3z. Let l = z + 45. Is 21 a factor of l? False Let c(f) = f2 - 44f + 855. Does 59 divide c(-88)? False Let t = -37 - -43. Is 5/((t/(-1468))/((-6)/4)) a multiple of 47? False Suppose 84k - 1 = 83k, -3k - 9019 = -2v. Is v a multiple of 49? False Let t(n) = 10n - 47. Let l be t(5). Suppose lm - 3z = -m + 2094, 5m - 2618 = 4*z. Is 58 a factor of m? Tr	{ "pile_set_name": "DM Mathematics" }
is bigger: i or 0? 0 Let u(k) = 4k. Let q be u(-2). Let l = q + 12. Suppose d + 33 - 8 = 4n, -ld - 3n = 5. Do -5 and d have the same value? True Let x = -0.8 + 1. Let n = 4 - 18. Let z = -16 - n. Which is smaller: x or z? z Suppose 0 = -9w + 16 + 164. Which is smaller: 21 or w? w Let v = -70 - -50. Let z be 4/(8/v-5). Which is smaller: 3/4 or z? 3/4 Let f be (0 - (-4)/(-2))/((-263)/(-1)). Which is smaller: 1 or f? f Let m be -5((-3)/5 - -1). Let p be (2/(-7))/((-2)/14). Let u be (2/(-6))/(p/12). Is m != u? False Let j be (-11)/3 - (-2)/3. Let k be j/3 - 1/(-1). Let c be (2/(-6))/(2/6). Which is greater: k or c? k Let y = 28 + -55/2. Let k = -2 - -1. Which is greater: k or y? y Suppose 5a + 4z + 18 = 48, 5a - 2z = 60. Is a greater than or equal to 10? True Let d(n) = -12n*2 + n - 1. Let t be d(1). Let i be t/(-78) + (-24)/(-13). Is i smaller than 3? True Let c = -0.3 + 0.4. Let l = c - 0. Do l and -2/21 have the same value? False Let g(c) = 7c - 1. Let a be g(-1). Let p = 7 + a. Is p < -1? False Suppose -u = 2 - 7. Suppose ui - i = 12. Suppose -5y + 8 = i. Which is smaller: -2/7 or y? -2/7 Let m be (3/(-4))/(21/(-2)). Let f(w) = w. Suppose 5s + 5x = 0, -3s + s - 4x + 2 = 0. Let q be f(s). Which is smaller: m or q? q Let d(t) = -t*2 + 1. Let k be d(-1). Suppose k = 2l - 0l + 5n + 8, n + 16 = -4l. Is -4 greater than l? False Let d = 3 + 2. Are d and 4 unequal? True Let d(w) = w2 + 6w - 6. Let t be d(-7). Suppose -n - 4 - t = 0. Let h be (-6)/(2 + n) - 2. Which is smaller: h or 0.1? h Let x = -3 - 0. Which is bigger: x or -1? -1 Let i = 81 - 62. Does 19 = i? True Let a be 89/(-249) + (-5)/(-15). Is a at most as big as 0? True Let k be 0/((-1)/2-2). Let m = k - -1. Let b be 44/(-12) - 0 - -4. Is m at most as big as b? False Let d = 27 + -16. Let p = -11 + d. Which is bigger: p or -1? p Let s(z) = 2z*2 + 23z - 22. Let x be s(-12). Is x greater than or equal to -10? True Let f be ((-3)/102)/(2/16). Is 1 equal to f? False Let m be (-13)/(-3) + (-16)/(-24). Suppose -k = -my - 4, k - 5 + 1 = -3y. Let x(j) = -j*3 + 3j*2 + 3j. Let q be x(4). Is y smaller than q? False Suppose 4k - 2k - 42 = 0. Suppose -19 = -3q + 4m, 0 = -0q + q - 5m - k. Are 0 and q unequal? True Let a(f) = f*2 - 1. Let g be a(2). Suppose 8 = -4p + 4c, gp - 5 = 5p - c. Let q be (p/2)/((-3)/6). Are q and 4 equal? False Suppose 2y + 3g = -9, -3y - 3g - 3 - 3 = 0. Suppose -5n = -2 - y. Do -1/2 and n have different values? True Let c(b) = -2b2 + 7b - 4. Let f be c(8). Is f at least as big as -76? True Let p be (-4)/8(-257)/2. Suppose -29 = -4s + 227. Let j = s - p. Which is bigger: j or 0? 0 Let a = -231/5 - -46. Let o be 30/8 - (-2)/8. Suppose 5c = oc. Is c equal to a? False Suppose -3a + 44 = -a. Let x = a - 8. Are x and 14 equal? True Let m(c) = c2 + 2c - 3. Let a be m(-3). Suppose 4b + a = -4. Let u(k) = k3 - 14k*2 + 12k + 12. Let g be u(13). Is g at most b? True Let c be ((-90)/(-12))/(6/8). Let t be c/4 + (-2)/4. Suppose 16 = 2p - 0g - 2g, p - 5g - 28 = 0. Is t bigger than p? False Suppose 0 = -4q + 3k - 45, 46 - 12 = -3q + 2k. Which is bigger: -1 or q? -1 Let w = 83/38 - 13/6. Which is bigger: w or -1? w Let o be ((-1)/3)/1-12. Suppose 2w + 17 = p - 2w, 4w + 5 = 5p. Let u = o + p. Which is bigger: u or 0? u Let m(f) = -f - 1 + 3f2 + f3 - 2f + f. Let b be m(-3). Let z = 5 - b. Which is smaller: z or 2? z Let u = -18 + 22. Suppose -5j = 3p + 7, p = -uj - 0p - 7. Which is smaller: j or -13/4? -13/4 Let y be (-6 + 2)/(-7 + 10). Let m = 31/12 + y. Which is smaller: m or 0? 0 Let f = -38 - -37. Is f smaller than 1/176? True Let h be -3 + 3 + 4 + -3. Which is greater: h or 0? h Suppose 0 = -y + 4n - n + 8, 2n = 2y - 12. Is y <= 2? False Let p be (-3)/(-1) + -1 + -1. Let o be 15/(-6) - (-1)/(-2). Let j be (6/o + 1)/p. Are -1/2 and j non-equal? True Let g(f) = -2f - 3. Let u(h) = -5h - 7. Let r(j) = -9g(j) + 4u(j). Let t be r(-1). Which is smaller: -1/8 or t? -1/8 Let o = 2.07 + -0.07. Let v = -2.2 + o. Which is smaller: 0.3 or v? v Let x be -2 - (4 + (-2 - 29)). Is 1/4 < x? True Let k(i) = 2i2 - 26i + 3. Let s be k(13). Are 3 and s unequal? False Let o = -18 - -18. Is o smaller than 0? False Let a = -42395/252 + 3369/20. Let y = a + -14/45. Is -1 less than y? True Let w = -5 - -5. Suppose 5d = 10, 3d + 2 = -wr + 4r. Is 3 at most as big as r? False Let m be (-6)/(-4)6/(-9). Which is smaller: m or -2? -2 Let w = 58 - 57.949. Is w smaller than -0.1? False Let u = 0.08 + -0.08. Let q be (-68)/20 + 4/10. Let c = q + 3. Is c less than or equal to u? True Let b be -1 - ((-30)/(-16))/(-3). Which is smaller: 0 or b? b Let h = 515/6 + -85. Is 0 equal to h? False Let c = 0 - -5. Let r be -1 - (-5)/(4 + -3). Do c and r have different values? True Let i = 2 - 1.7. Let z = i - 0.1. Which is bigger: 0.1 or z? z Let j = -171/8 - -21. Is j > 0.5? False Let k(s) = -s2 + s + 1. Let u be k(-1). Let a be (u - 0)10. Let o be (1 - 0) + a + -2. Is 2/11 greater than or equal to o? True Let x = 6967774/17 - 410002. Let p = -133 - x. Which is smaller: 1 or p? p Suppose -2t + 2 = -t. Suppose -ty + 4 = -3v + 4v, 0 = 5v - y + 35. Suppose -4n + 34 = -3x, 2x - 3x - 26 = -5n. Is x less than or equal to v? True Suppose 2l = -2l + 3d - 9, 2d + 2 = 0. Suppose 3 = -o - 0o. Let t = l - o. Which is smaller: t or 1? t Let p be (2/((-4)/6) - -4)0. Is p equal to -2? False Let l(q) = -59q3 + q2 + 2q + 1. Let h be l(-1). Let o = 529/9 - h. Which is bigger: o or 1? 1 Let p = 24 - 8. Let y = p - 15. Which is smaller: y or -3/13? -3/13 Let a be 01/(-2) - (-32)/(-32). Is a greater than -1/173? False Suppose 0 = -2i - 2g - 8, 0g - 12 = 2i + 3g. Suppose 0 - 4 = -u - 4x, -4u + 16 = 2x. Let c be (-1)/u + (-27)/(-12). Which is bigger: c or i? c Let w = 76 + -74. Are 0 and w nonequal? True Let h = 0.01 - -0.02. Which is greater: -1/4 or h? h Let y = 2.3 + 2.7. Let k = y + -5.1. Which is bigger: 2 or k? 2 Let b = -23/9 - -7/3. Suppose 3u + 2 = -1. Which is smaller: b or u? u Let f(s) = 5s - 1. Let i be f(1). Suppose 0c = -ic. Is c greater than or equal to 0? True Suppose 2b + 120 = 6b. Let y be 1/3 - (-26)/b. Is 0 smaller than y? True Let l = 0.653 + -0.053. Is 4/7 < l? True Let k be ((-45)/10)/(-3)(3 + -1). Let z be 3/12 - (-5)/4. Which is greater: k or z? k Suppose 0 = i + 6 + 3. Which is bigger: i or -7? -7 Let v be (1 - (-3)/(-9))-3. Let i be (-2)/(-3) + (-778)/6. Let q = i + 642/5. Which is greater: v or q? q Suppose 5g = -2u - 8, u + 7 = 3. Is g greater than 2? False Let v = -4 - 1. Which is greater: -2 or v? -2 Let l = -13 + 71. Is l greater than or equal to 59? False Suppose -3p = n - 10 - 3, p + 33 = 5n. Is 9 greater than n? True Suppose 2d = -4a - 14, 4d + 11 = -4a + 5d. Let f be (a/10)/((-27)/(-12)). Is f at most as big as -0.3? False Let g = 0 - 10. Which is greater: -8 or g? -8 Let b be (-18)/(-14) - 2/7. Suppose -r = -3 - b. Is 6 >= r? True Let q be 10/(-25) + 26/(-10). Let n be -2 - ((-15)/(-2))/q. Is n at most 1? True Let m = 1802/11 - 164. Let s = 3 - 2. Is s at least m? True Suppose 0 = -3n - x + 5 - 1, -n - x + 2 = 0. Which is smaller: n or -1/107? -1/107 Let u = 40 + -57. Which is smaller: -15 or u? u Let r = -24 - -2. Let z = r + 13. Are 0 and z equal? False Let m = -66 + 65. Is 1/24 < m? False Let x(z) = -z - 1. Suppose -2 + 13 = -3y - 4v, -3v - 7 = y. Let p be x(y). Suppose -2m + 5 - 3 = p. Is 1 less than or equal to m? True Suppose 0 = -3h + h + 2. Is h at most -1/26? False Let a = -27/10 + 31/30. Which is smaller: a or -2? -2 Let r be ((-7)/(-10))/((-2)/(-59)). Let s = -1937/92 - -37/46. Let g = s + r. Is g > -2? True Suppose -4j + 4 = -4. Let h be j/4(-18)/(-3). Are h and 4 nonequal? True Let u be ((-16)/876)/(4/(-6)). Which is smaller: 0 or u? 0 Suppose 5v - v - 2z = -14, -2z = 3v - 7. Which is greater: -0.006 or v? -0.006 Let m be 2/2 + 1 - -6. Let f(b) = -6b - 2. Let x be f(2). Let l = m + x. Is -5 not equal to l? True Let d(b) = b - 3. Let g be d(0). Let p be 3 + (-22)/(-1 - g). Let m be (-1)/(10/p)-5. Is m not equal to -4? False Let k(o) = 13o*2 + 3o - 21. Let v(a) = -3a2 - a + 5. Let h(m) = 2k(m) + 9*v(m). Let i be h(-4). Is -0.	{ "pile_set_name": "DM Mathematics" }
4/12 - q3 + 2q*2 - 7q. Let d be o(6). Solve 5k = -x + 2, dk - 5k = -vx - 16 for k. 1 Let u be -5 + (-12)/(-10)360/16. Solve f + 8 - u = 3o, 0 = -4o - f - 14 for o. -4 Let l be ((-10)/(-35))/((-3)/(-21)). Suppose 15 = lv - 7v. Let z be 2 + 3 + 6 + v. Solve -3a = -7a + 2g - z, a - 7 = 5g for a. -3 Let b be 27 + 3/((-6)/(-8)). Solve 0 = -3v - 12, -4v = 2i + 3i + b for i. -3 Let p = -3 + 8. Let d = -563 + 571. Solve 2u - pu = v + d, -4v + u + 20 = 0 for v. 4 Let d(x) = 2x3 + 36x*2 - 2x - 29. Let y be d(-18). Solve 0 = -yp + 2p - b + 4, 3b - 12 = -3p for p. 0 Let i(f) = -3f - 4. Suppose 0m + 2m = -4. Let u be i(m). Solve -4q + 0a - u = a, 0 = -2q + 2a + 4 for q. 0 Suppose -2s = -2h, -5h = 4s - 33 + 6. Suppose z + k - 33 = -sz, z + 4k = 27. Suppose -3p - 16 = -zp. Solve 0 = m - 0m - 5q + 12, -pq = 4m for m. -2 Let l(a) = -a3 - 5a - 15. Let h be l(-2). Let m = -13 - -28. Solve 3z = -z + hc + 23, -4z - 5c = -m for z. 5 Suppose 5n + 3x = -14 + 1, -5n + 2x - 8 = 0. Let a be 3/((n4/(-8))/1). Solve 3 - 2 = -2u + 3h, -4u - 11 = -ah for u. -5 Let s = 67 + -40. Suppose -u = -5x + 104, -3u + 135 = 5x + s. Solve -5a - x + 0 = -4o, 2o = -5a + 3 for o. 4 Let q = -44 - -47. Suppose q = -c + u, -4c + 26 = -c + 4u. Solve 2t - 3z + 3 = 0, 4t - cz + 3 = -7 for t. -3 Suppose 4r - 14 = 2m, -r + 2m = 4r - 17. Solve -7x + 5x = rl + 22, 2l + 23 = -3x for l. -4 Let t(j) = -6 + 1 - 20j + 29j. Let d be t(2). Suppose 5p = d + 2. Solve -3i - i - po - 1 = 0, -5i = o + 4 for i. -1 Let t be 54/10 + (-24)/60. Let l = t - 1. Solve 5z + 25 = -lm, -m + 0z = -5z for m. -5 Let q be (-18)/(-15) + (-12)/10. Solve q = 3g + 2i, -g = 3i - 6i - 11 for g. 2 Let p = -993 - -993. Solve -2m + 5b - 24 = p, 4m = -b - 4 - 0 for m. -2 Let g(b) be the third derivative of b*5/60 + 5b*4/12 - 19b*3/6 + 12b*2. Let l be g(-12). Solve 5q + 6 = 2r, -12 = -0r + lr + q for r. -2 Let f(h) = h2 + 10h - 8. Let q be f(-11). Suppose -120 = qm + 2m. Let r be m/2020/(-6). Solve rx - 3a + 4 = -a, a = 5x + 5 for x. -1 Let j(l) be the third derivative of l5/30 - l4/8 - l*3/6 - 40l*2. Let c be j(-2). Solve -3f = -5f - 3o + c, 3f = 4o + 11 for f. 5 Let z be (-4 + 2)/2 + 4. Suppose -u = zu. Solve -5n - 20 = 5i, 2n + 2n - i - 9 = u for n. 1 Suppose 2k + 18 = 2t - 0k, 8 = -3t - 4k. Let s be 10/t156/65. Suppose -su = -4u - 6. Solve 9 = un, -4n + 16 = -2f - 0n for f. -2 Let b(t) = -2t - 9. Let a be (3/(2 - -4))/((-3)/36). Let q be b(a). Solve -15 = 5d - 5j, d - qj + 8 = -d for d. -1 Let i(x) = x2 - 46x + 398. Let o be i(11). Solve -22 = 2r + 4v, 5r + 3v + 14 + o = 0 for r. -3 Let v(a) = -a*3 + 43a*2 - 43a + 46. Let x be v(42). Solve 0 = xn - 5h - 16, 3h = n + 2h - 4 for n. 4 Let k = 53 - 29. Suppose -v = -7v + k. Solve -vn + z = -z - 16, -5n - 5z + 20 = 0 for n. 4 Let t be (((-36)/8)/3 - 0)-2. Suppose -tv + 6 = -v. Suppose 27 - 2 = c. Solve 5r = 5x - c, -4x = -vx - 1 for r. -4 Let y = -129 + 131. Solve h - 6 = -3x, 0h + 3h = -yx + 11 for h. 3 Let a = 299 + -297. Solve -3x = 4n - 24, -3n + 7 = -2x + an for x. 4 Let u be (-68)/(-85) + (-2)/(-10) - -1. Solve 21 = 5l - 4t + ut, -2l - 9 = 5t for l. 3 Suppose 3d - 159 = -5n - 24, 2n - 33 = 3d. Let w be ((-6)/8)/(((-18)/n)/3). Solve -6 = 5v - wj, v = -3v + 2j - 6 for v. -3 Let a be ((-18)/4)/((-90)/24 - -3). Let t(w) = w*3 - 5w*2 - 3w - 14. Let h be t(a). Solve -c - 1 - 4 = 0, f = hc + 21 for f. 1 Suppose 3w - 49 = -13. Suppose 0 = -5j - 2g - 0g + w, 5g + 4 = -4j. Solve -c + 14 = -jq + 6, 2c - 8 = 0 for q. -1 Let t = -3 + 15. Let f = -1132 - -1160. Solve -2o + o - t = 2w, -2o = 5w + f for w. -4 Suppose -7z + 2z = 0. Let b(d) be the second derivative of -d5/20 - d4/4 + d2 + 18d. Let c be b(0). Solve 0 = ca - 6a, z = l + 3a - 1 for l. 1 Let r(l) = -l3 + 9l2 - l + 11. Let u be r(9). Let o(c) = -c2 - 8c + 13. Let v be o(-9). Solve 9b - 30 = 5x + 4b, -vx = -ub + 14 for x. -1 Suppose -g = g - 4. Let j = 10 - 5. Suppose 30n - 27n - 6 = 0. Solve 0 = 3l + gv - jv - 9, nl - 3v = 9 for l. 0 Let v = 16 - 10. Suppose 5j + 10 = -2m - v, -2j = 4m. Suppose -mx + 6 = x. Solve -2k - 8 = 3k - 3f, -xk - 4f = -2 for k. -1 Suppose 3q - 76 = 101. Let f = -56 + q. Solve 17 = -4o - 3l, -4o - 12 = -o + fl for o. -5 Let t(n) = 3n - 15. Let w be t(7). Suppose 2v = 4v - w. Suppose 0 = -vu - 3, -5u - 2 = 3k - 3. Solve 2q + 1 = -kl + q, l + 2q + 2 = 0 for l. 0 Let q(f) = f2 + f - 7. Let a be q(-9). Suppose 3h - 39 = 3k, h + a = 6h + 3k. Solve 3x + h = -2w, 0 = -3x - 0x - 5w - 10 for x. -5 Let f(p) = -2p2 + 13p + 15. Let u be f(8). Let v(t) = t*3 + 7t*2 - 18t + 3. Let z be v(u). Solve 5l = -zw, -2l = w - 2w - 11 for l. 3 Let q(d) = 3d - 13. Let b be q(5). Let u(g) = -5g*2 + 4g - 7. Let v be u(b). Let c = v + 24. Solve w + 4w = cf, -30 = 2w + 4f for w. -5 Suppose -5 + 24 = r + 5t, 0 = -2r - 4t + 68. Let k = r + -37. Solve -2m - 20 = -5b, -k = 4m - m + 4b for m. -5 Let l = 256 + -251. Let w = -4 - -9. Suppose 5f - 10 = -2t, 3f - 2 = 2f - 5t. Solve l = -wo, -fq - 5o = 3q + 25 for q. -4 Let q(a) = -a + 5. Let t be q(6). Let p be (2 + (t - 1))/(-5). Solve p = -n + 4d - 10, -3n + 4d = -7n for n. -2 Let k be (3 + -2)(13 - 13). Let w be (2 + -1)/(3/12). Suppose -w = 4g - 16. Solve -5j + 23 = 3p - kj, g = -p + j for p. 1 Let a = 59 + -3. Let l be (a/21)/((-2)/(-6)). Suppose 0 = -lf + 11f - 12. Solve f = -4g - 3j, -5g + 4j = -j + 40 for g. -4 Suppose -3j + 12 = -0j. Solve -2t = 5z + 20, jt - 4z + 13 - 1 = 0 for t. -5 Let n be 9 - 9 - (-184)/8. Solve 4t - 5v = -n + 2, 3v + 5 = -2t for t. -4 Let t be ((-8)/3)/((-3)/(18/4)). Let h = -41 + 58. Solve c + h = -tl, -c - c = 2l + 4 for c. 3 Let b(j) = -j3 + j2 + 2j + 2. Let q be b(2). Solve qy - 5w + 3 = -8, 4w - 16 = 4y for y. -3 Let s(x) = x*3 - 5x*2 - 5x + 1. Let f be s(6). Let q = -42 + 46. Solve qy - 4 = -4w, -4y + f = 4w - y for w. 4 Suppose f - 75 - 79 = 0. Suppose 8k - f = -18. Solve k = d + 5w, -4 - 8 = -4w for d. 2 Let y = -216 - -219. Let m be 2/(-1 + 9/6). Solve 3z = l, -ml + 4z = yz + 11 for l. -3 Suppose 2t + 24 = -0t. Let d = t + 29. Solve -2w - 3g - 14 = 0, 4w + 5 = -3g - d for w. -4 Suppose 8t - 3 = 13. Suppose -n - t = -2n. Solve 0 = 5f - nv + v - 21, -f + 2v = 3 for f. 5 Let m = -263 + 266. Solve -4s = mz - 12 - 7, -3z + 23 = 5s for s. 4 Suppose -7 + 1 = -f. Solve -u - f = -3a + 2u, -2a = -3u - 9 for a. -3 Let z(t) = -t*3 - 10t*2 + t + 5. Let h be z(-10). Let a be (3-1)/(-3h/(-20)). Solve 12 = 5p + 2u, -3p - 3u - 16 = -ap for p. 4 Suppose -4o + 4t + 24 = 0, -4o + 5t - 15 = -41. Suppose -u - 49 = -oa, -2a + u = -a - 13. Solve 0 = -2g - 2q - a, 0g - 3g = -q + 10 for g. -4 Let l(y) = -6y. Suppose 0r + r = -4c + 2, -2r = 4c. Let s be l(c). Let x be (0 + s)/((-3)/20). Solve -21 + 8 = 4i - 5f, -x = -5i - 5f for i. 3 Let m be (8/(-6))/((-1)/3). Let w(g) = g2 - 19g + 23. Let d be w(18). Solve -7 = t + r, -mr = -dt + r + 5 for t. -3 Suppose 51b - 828 = -18b. Solve -3u + b = u + 5i, 20 = 5i for u. -2 Let a(z) = -z3 + z2. Let q be a(1). Suppose 4w - 1 - 7 = q. Solve 3c = -wp + 4, 2p - c + 20 = 2c for p. -4 Suppose -2 = -j + 4. Let u be 9 - (1 + 1) - 3. Suppose -j = -2d - d - 2h, -3h = 2d - u. Solve f - 5 = -3s, -s - df - f + 7 = 0 for s. 1 Suppose p = 5j - 17, 2j + 5 = p + 10. Solve 3n = px - 7x + 1, 2x = 2n - 10 for n. 3 Let v be (-6)/(-2) + 6/(-2). Solve -o = 4g + 2, -3o + 4g - 4 - 2 = v for o. -2 Let o = 205 + -195. Solve -x + 0x = -2z - 10, 3x + o = -2z for z. -5 Let b(u) = -12u + 304. Let d be b(25). Solve i - 4l = 8, 2l = -2l - d for i. 4 Suppose 3a = 5g - 35, 3g + g - 4a - 28 = 0. Let w = 58 - 48. Let z be (-1)/(-5) + ((-2)/w)/1. Solve 4n + 0 = 2x + 10, z = 2n - 5x + g for n. 4 Let t = -80 + 86. Solve -p + 0p - t = -5h, 0 = -4h - 5p - 1 for h. 1 Suppose -6w - 18 = -4b - 4w, 5b = w + 18. Solve 5p + b = 3z, -5 = 3p - p - 5z for p. 0 Let s(d) be the third derivative of 3d*5/20 - d	{ "pile_set_name": "DM Mathematics" }
7d2 + 10d*4 + 234/7d*3 - 2/7d5 = 0. -3, -2, 1, 38 Let j(p) = p2 + 3p - 61. Let n be j(-10). Suppose 0 = 3k + 7u - 4u - 12, n = 2k + 3u. Let 0 + 0g + g2 - 3/2g*k = 0. What is g? 0, 2/3 Let s be 7690/(-3076)44/(-10). Suppose 29/3p2 - sp*3 - 3 - 40/3p*4 + 17/3p - 4/3p5 = 0. What is p? -9, -1, 1/2 Let d(z) be the first derivative of z4/6 + 206z*3/9 + 2600z*2/3 - 5408z/3 - 665. Factor d(o). 2(o - 1)(o + 52)2/3 Let s(q) be the third derivative of -q5/420 - 109q4/84 - 31q*3/6 - 2174q*2. Factor s(h). -(h + 1)(h + 217)/7 Let u(c) be the third derivative of -c*6/24 + 35c*5/3 - 2065c*4/24 + 685c*3/3 - 5c*2 - 113. Determine g so that u(g) = 0. 1, 2, 137 Determine o so that -31o + 7849 + 2135 - 542o - 21o*2 + 3o*3 + 93o - 36o2 = 0. -13, 16 Let q(l) be the second derivative of -105l + 0 - 320/3l3 + 5/12l*4 + 10240l*2. Factor q(w). 5(w - 64)2 Let p(r) = r2 - r. Let b(j) = -2j2 - 20 + 57j - 5j2 - 123j + 48j. Suppose -5 = -2d - 1. Let n(k) = dp(k) + b(k). Factor n(f). -5(f + 2)*2 Let g be (24/(-18))/(-2)(10 + 35/(-14)). Factor -2/7sg + 0 - 64/7s*2 - 64/7s*3 - 20/7s*4 + 0s. -2s2(s + 2)(s + 4)2/7 Let a = 17/2 + -7. Let l be (7 - 9) + -8 - ((-176)/11 + 4). What is i in 0i + i*4 + 0 - ai5 + il + 7/2i3 = 0? -1, -1/3, 0, 2 Let i(r) be the third derivative of -r5/210 + r3/21 + 3r*2 - 31. Determine v, given that i(v) = 0. -1, 1 Factor 4036r*2 + 39r*3 - 11r*4 - 4117r*2 + 12r*4 + 41r. r(r - 1)2(r + 41) Let c = 128612 - 257169/2. Determine g, given that -185g3 - 125g*4 + 1 - cg - 120g2 - 63/2g*5 = 0. -1, 2/63 Let y = -662 - -986. Factor -310x*2 + 5x*3 + yx*2 - 53x + 7 + 3. (x - 2)(x + 5)(5x - 1) Factor 552z + 713 + 1159 + 10z2 - 2z*3 + 18z*2. -2(z - 26)(z + 6)2 Let 732n*3 - 193n*3 + 31205n - 790n2 - 188n*3 - 150n*3 - 196n*3 = 0. What is n? 0, 79 Let l be (14 - (-20192)/(-1440))/((-2)/6). Let d(j) be the second derivative of 0 - 1/27j*3 + 31j + 0j2 - 5/54j*4 + lj*5. Factor d(c). 2c(c - 1)(6c + 1)/9 Factor -4/5r*3 + 616/5r - 768/5 - 108/5r2. -4(r - 3)(r - 2)(r + 32)/5 Let w = 2603 + -2601. Let h(a) be the first derivative of -48/5a - 48/5a*w - 24/5a*3 - 3/25a*5 - 6/5a*4 - 14. Find y, given that h(y) = 0. -2 Solve -1/5s*4 - 3/5s*3 + 15s + 10 + 23/5s2 = 0. -5, -2, -1, 5 Factor 240/13g - 2/13g2 - 7200/13. -2(g - 60)*2/13 Let o(b) = -4b*2 + 167b + 1320. Let s(k) = 11k2 - 333k - 2640. Let i(u) = 7o(u) + 3s(u). Factor i(v). 5(v + 12)(v + 22) Factor 300t3 + 3546t*4 - 497t*2 - 162t*2 - 3549t*4 - 493t*2. -3t*2(t - 96)(t - 4) Solve 0 + 182/9x*4 - 1012/9x*3 - 472/9x*2 - 16/3x = 0 for x. -2/7, -2/13, 0, 6 Let d(u) be the first derivative of 81/14u2 - 134 + 6u - 44/7u3 + 9/28u*4. Find y, given that d(y) = 0. -1/3, 1, 14 Find j, given that -13j*3 - 843j - 1095j2 + 180j*2 + 8j*3 - 75j + 8j3 = 0. -1, 0, 306 Factor 6y + 221y + y2 + 133y - 4y2. -3y(y - 120) Let l = 137127 + -137125. Let 6/7y*2 - 20/7 - ly = 0. What is y? -1, 10/3 Let m(r) be the second derivative of r*5/90 + 11r*4/9 + 305r*3/27 - 39r - 60. Factor m(y). 2y(y + 5)(y + 61)/9 Suppose 4p = -g + 23, g - 2 = p + 2p. Suppose gs*2 + 813s - 8s4 - 3s*2 - 809s - 4s5 = 0. Calculate s. -1, 0, 1 Factor -33/2f - 3/4f2 - 63/4. -3(f + 1)(f + 21)/4 What is w in 217/3w*2 + 145/6w - 1/2w3 + 0 = 0? -1/3, 0, 145 Suppose -41 = 3w + 532. Let s = w + 1529/8. Factor -sg + 1/2 + 1/8g*3 - 1/2g*2. (g - 4)(g - 1)(g + 1)/8 Find b such that -2506/3b - 2/3b3 - 920 + 84b*2 = 0. -1, 12, 115 Suppose -1514 = -5i - 1484. Suppose 8s = 12s, -2x = 4s - i. Factor -2 - 867/2q2 - 51q - 4913/4qx. -(17q + 2)*3/4 Suppose 0 = 17k + 77 + 25. Let d be (-55)/(-60)5 + k/(-8). Factor 8/3 - 2/3x*3 - dx + 10/3x2. -2(x - 2)*2(x - 1)/3 Let v(c) be the third derivative of c11/166320 + c10/75600 - 3c5/2 + 2c*2 + 8. Let f(l) be the third derivative of v(l). Factor f(i). 2i*4(i + 1) Factor 5/4y + 3/2 + 1/4y*2. (y + 2)(y + 3)/4 Suppose 2z - 3z = -22. Suppose zj - 3 = 21j. Factor -3m4 - 27m - 19m2 + 44m*2 + 15m*j - 34m*2. -3m(m - 3)2(m + 1) Let y(v) be the second derivative of v*6/90 + 79v*5/30 + 2027v*4/12 - 6320v*3/9 + 3200v*2/3 + 2667v. Find p such that y(p) = 0. -80, 1 Factor -1/4n3 - 149/2n*2 + 599/4n - 75. -(n - 1)*2(n + 300)/4 Let g = 90 + -289. Let d = g - -401/2. Factor -ds4 + 0s*3 + 3s + 0 + 9/2s2. -3s(s - 2)(s + 1)*2/2 Let n(f) = 8f - 75. Let c be n(11). Factor 5g3 + 178g + 115g2 + 70 - cg + 10 - 25g2. 5(g + 1)*2(g + 16) Suppose -57i + 54i + 4r - 29 = 0, 5i + 3r = 0. Let s be (-4)/(-16) + i(-4)/144. Factor sf2 - 4/3 + 0f. (f - 2)(f + 2)/3 Let l be 2/1 - (-378)/(-2 + -12). Let b be 10/l + -1 + 2 + 1. Solve -6/5z - b + 2/5z2 = 0 for z. -1, 4 Suppose 801 = 5q + 2z + 793, q - 5z = 34. Let n(f) be the first derivative of 25 + 1/22fq + 2/11f*3 + 10/11f - 9/11f2. Factor n(d). 2(d - 1)*2(d + 5)/11 Let n(z) = 2z2 - 2z - 2. Let r(i) = -9i2 + 54i + 84. Let w(p) = 6n(p) + r(p). Factor w(h). 3(h + 2)(h + 12) Let c(u) be the second derivative of u4/60 - 439u*3/15 - 879u*2/10 - 5570u. Solve c(a) = 0 for a. -1, 879 Let i(q) be the first derivative of 28q2 - 36q*3 + 12q*4 + 4/5q*5 + 0q + 54. What is n in i(n) = 0? -14, 0, 1 Let g(w) be the second derivative of -145w - 2/5w*6 + 19/2w*3 - 81/20w*5 + 9w*2 + 0 + 1/2w*4 + 2/7w*7. Find y, given that g(y) = 0. -2, -1/2, 1, 3 Let t = -55 + 51. Let g be t/6 + ((-385)/(-15))/7. Determine v so that 31v*3 + 25v*3 - 52v*g + 2v*4 = 0. -2, 0 Solve -32 + 248/5a + 4/5a3 - 92/5a2 = 0 for a. 1, 2, 20 Let g(l) be the third derivative of -l6/240 - 137l5/15 + 2195l*4/48 - 183l3/2 + l2 - 107l + 18. Solve g(o) = 0 for o. -1098, 1 Let c = -4604 - -253222/55. Let t(o) be the first derivative of 6 - 3/11o*4 + 8/11o*3 + co*5 - 10/11o*2 + 6/11o. Factor t(i). 2(i - 3)(i - 1)*3/11 Let c = -2386567031/4641120 - 1/515680. Let w = c + 516. Suppose 2/9i*4 + 8/9i - 10/9i3 - w + 4/3i*2 = 0. Calculate i. -1, 2 Let l be (3/4)/((-12)/(-32)). Factor -2w2 - w4 - 2788w3 + 3w + l + w*2 + 2785w*3. -(w - 1)(w + 1)*2(w + 2) Let p be (-462)/21 - -7 - -38. Let z(l) be the second derivative of 4/3l4 - 2l*2 + 0 + 2l*3 + pl. Solve z(x) = 0 for x. -1, 1/4 Let s(k) = 15k2 + 34k - 13. Let o(g) = 1 - 2479g + 2480g - 2 + 0. Let u(t) = 5o(t) + s(t). What is r in u(r) = 0? -3, 2/5 Suppose 13249 = 38u - 1001. Let t be ((-10)/(-4))/(-5 + u/45). What is q in -tq + 1/4q2 + 1/2 = 0? 1, 2 Let p(c) be the third derivative of -c5/12 - 805c4/24 - 265c*3 + 53c*2 + 10. Factor p(q). -5(q + 2)(q + 159) Let v = 1961 - 2116. Let n be 16/(-14) - v/7. Determine j, given that -180/7j - 24/7 - nj3 - 54j*2 = 0. -2, -2/7 Let d(q) = 2q + 120. Let v be d(-4). Let n be 21/181008/v. Factor -17/2l - 15l*2 - n. -(5l + 2)(6l + 1)/2 What is f in 3/2f2 + 50602347/2 - 12321f = 0? 4107 Let w = -14367 - -14373. Let x(h) be the first derivative of 1/24hw + h3 - 1/5h*5 + 39 + 0h - 1/8h4 + 9/8h*2. Factor x(z). z(z - 3)*2(z + 1)*2/4 Let r be (-13 - (-4340)/336)/(8/(-10816)). What is b in -r - 2/3b*2 + 52/3b = 0? 13 Let o = 11 + 1. Let w be 2/((-3)/(-6)(-16)/(-20)). Factor ou*2 - 11 - wu - u - 13 + 25 - 8u3. -(2u - 1)3 Let u(r) be the second derivative of r5/4 + 215r4/24 - 115r*3/12 - 55r*2/2 - 40r + 97. Factor u(l). 5(l - 1)(l + 22)(2l + 1)/2 Let p(k) be the first derivative of k*7/1890 + 11k*6/135 + 121k*5/30 + 5k*3/3 + 27k*2/2 + 217. Let x(c) be the third derivative of p(c). Factor x(j). 4j(j + 33)2/9 Let g(l) = -12l*2 + 50l + 46. Let x(z) = -z*2 - z + 1. Let a be (1/1)/(36 - 37). Let v(m) = ag(m) + 6x(m). Factor v(s). 2(s - 10)(3s + 2) Suppose 16/3 - z*2 - 1/6z*3 + 0z = 0. What is z? -4, 2 Let w(d) be the third derivative of -1/120d5 + 1/6d*4 - 49d*2 + 0 - 7/12d*3 + 0d. Factor w(k). -(k - 7)*(k - 1)/2 Let x	{ "pile_set_name": "DM Mathematics" }
se z = 5q + 15, -5q = l - 1 - 1. What is the units digit of l? 7 Suppose 0 = -156i + 102i + 262386. What is the units digit of i? 9 Let g be ((-272)/32)/(1/22). Let d = g + 331. What is the units digit of d? 4 Suppose -l + 2z = -300, 3 = -3z - 0. Let x = 466 - l. What is the tens digit of x? 6 Let w(a) = -a*3 + 6a*2 + 4. Suppose 3p + 9 - 18 = 0. What is the tens digit of w(p)? 3 Suppose 0 = -6v - 24 + 96. Let a = -4 + v. Suppose m = a + 31. What is the tens digit of m? 3 Suppose -5 = -7y + 9. Let h(d) = 7d - 3. What is the tens digit of h(y)? 1 What is the hundreds digit of 2844/28196/8? 9 Let s(c) be the second derivative of 4c4/3 + c3/3 - 10c2 + 8c. What is the hundreds digit of s(4)? 2 Let s = 6 - 3. Suppose -sm - 25 + 166 = -5h, m + 5h = 27. Suppose -m = 3n - 6n. What is the units digit of n? 4 Let c(t) be the second derivative of -t4/24 + 3t*3/2 - 5t*2/2 + 3t. Let r(k) be the first derivative of c(k). What is the tens digit of r(-7)? 1 Suppose -5h + 39 = 329. Let u = h - -168. What is the units digit of u? 0 Let b(u) be the first derivative of -3 + 1/2u*2 - 3u + 1/3u3. What is the units digit of b(4)? 7 What is the tens digit of 43 + (3/9 - 2/6)? 4 Let n(l) = l3 + 8l*2 - 10l - 2. Let u be n(-9). Let q be -70u/(105/(-6)). Let k = q - 27. What is the units digit of k? 1 Let v = -116 - -119. Suppose -306 - 51 = -vo. What is the units digit of o? 9 Let v be 0(0 - 1/(-2)). Suppose -i - u = 2i - 174, -3i + 5u + 156 = v. What is the tens digit of i? 5 Suppose q - 4q = 3f - 12, 3q = 3f - 24. Suppose -fo = -o. What is the units digit of 0 + -1 + (3 - o)? 2 Let a be (2/(-3))/((-26)/585). Let v = -12 + a. Suppose -5l + q + 83 = -0, -vl + 55 = 2q. What is the units digit of l? 7 Let t(m) be the second derivative of 1/6m3 + 19/2m*2 - 1/20m*5 - 1/12m*4 + 0 + 5m. What is the units digit of t(0)? 9 Let z = 92 - 98. Let b be 4/(0 - -2)-4. Let r = z - b. What is the units digit of r? 2 Let j = 779 - 426. What is the units digit of j? 3 Suppose 36k - 32k - 44 = 0. Let y(z) = 15z + 14. What is the tens digit of y(k)? 7 Let w = 958 - 466. What is the units digit of w? 2 Suppose 0 = -4a - z + 42, 4z = -a + 6a - 42. Suppose 3g - 29 = -3d + 43, 3g = -3. Let t = d - a. What is the units digit of t? 5 Let l(n) = 8n2 + 74n - 61. What is the hundreds digit of l(-26)? 4 Let i(n) be the third derivative of n*4/24 + 61n*3/6 + 2n*2. Suppose -46u = -65u. What is the units digit of i(u)? 1 Let z = 100 - -2695. What is the units digit of z? 5 Suppose 18j - 3701 = 15j + 5s, 4j - 4978 = -2s. What is the tens digit of j? 4 What is the units digit of 4/(-20) + (-2 - (-6663)/15)? 2 Let q(t) = -t*2 - 6t - 6. Let h be q(-4). Let g = h - -6. What is the units digit of 428/14 - g/14? 0 Let d be 1/((18/(-4))/(-9)). Suppose -815 = -5o + di, -2i - 66 = -2o + 254. What is the tens digit of o? 6 Suppose -5a + 4b + 8505 = -0b, 0 = a - b - 1700. What is the tens digit of 9/12 + a/20? 8 Let z(g) = -10g + 66 + 69 + 10g2 - 151. What is the units digit of z(6)? 4 Let o be 27 + (3 - (-4 + 4)). Let a = o - -39. What is the units digit of a? 9 What is the hundreds digit of 42/(1 - 0)(11 + 1)? 5 Suppose 0 = 4i - 12, -2w = -3i + 2i - 1. Suppose -p + ws - 5 = 0, -5p + 2s = -3s + 35. Let v(x) = -2x - 7. What is the units digit of v(p)? 1 Let q = -7 - -11. Suppose -2 = -v - 6, -5a = qv - 54. What is the tens digit of a? 1 Suppose 2l + 3a = l + 1, 0 = -5l + 2a + 90. What is the units digit of (-7 + 152/l)98/1? 5 Let r(i) = i*2 - 4i + 3. Let h be r(7). Let v = -7 + h. What is the tens digit of v? 1 Let l be 0 - -159 - (4 - 4). Let w = 410 - l. What is the units digit of w? 1 Let g(n) = 5n - 4. Let l(x) = 14x - 11. Let q(b) = -11g(b) + 4l(b). Let y(f) = 5f + 5. Let u(c) = 4q(c) - y(c). What is the units digit of u(-7)? 2 Suppose w + w + 22 = 0. Let b(d) = -d - 8. Let n be b(w). Suppose no + 5j - 8 = 0, 2j = 4o - 39 - 15. What is the units digit of o? 1 Let w be 21 + (-208)/(-8). Let z = -55 + w. Let f = -20 - z. What is the units digit of f? 7 Suppose 6 = 4i + g - 3g, 1 = g. Suppose 0 = -if - 3c - 106, -4f + 2c - 187 = 9. Let r = 86 + f. What is the units digit of r? 6 Let t = 18 + -15. Let s be (0 + t)/(6/6). Suppose -si + 12 = -30. What is the units digit of i? 4 Suppose 25 = -13j + 18j. Suppose 0i = -ji + 20, -t = -5i - 84. What is the units digit of t? 4 Let w = -364 - -362. Let c(p) = 2p*3 + 3p*2 - 3p - 5. Let f(a) = -2a3 - 4a*2 + 3a + 6. Let h(r) = -3c(r) - 2f(r). What is the units digit of h(w)? 9 Let z = -2115 + 3278. What is the hundreds digit of z? 1 Let m(z) = 54z + 63. What is the units digit of m(7)? 1 Suppose 8802 = -49s + 52s. What is the thousands digit of s? 2 What is the hundreds digit of 76/418 + (-7881)/(-33)? 2 Let o(h) = 164h*3 - 2h*2 - h + 1. Let y be o(1). Suppose 0 = 6f - f - 2b - 273, -3b - y = -3f. What is the units digit of f? 5 Let c = 14 + -12. Suppose -215 = -cd + 1. Suppose -d = -5t + 2z + 2z, 3z = -6. What is the tens digit of t? 2 Let m be (-4 - -3)(2 - 4). Suppose 2w - 172 = -4i, 3i - 115 = mw - 0w. What is the tens digit of i? 4 Let w(d) = -181d + 23. What is the tens digit of w(-6)? 0 Let n = 17 - 18. What is the tens digit of n/(4/(-56)) - 1? 1 Suppose z + 44 + 130 = c, 3c - 508 = -4z. Suppose 4a + 3b - c = 2b, -172 = -4a - 5b. What is the units digit of a? 3 Suppose 15 = 5l - 0. Suppose -4o + 260 = -2d, d + 156 = lo - 37. What is the tens digit of o? 6 Let u(z) be the third derivative of 1/3z3 + 0z - z*2 + 1/24z*4 + 0. What is the units digit of u(7)? 9 Suppose 4x + x - 105 = 0. Suppose -3o - 2o = -3i + x, -18 = 4o - 3i. Let h = o - -13. What is the units digit of h? 0 Let o = 2573 - 1331. What is the tens digit of o? 4 Suppose 101u - 160u = -69443. What is the tens digit of u? 7 Suppose 10c = 5c + 205. Suppose -273 = -g - c. What is the units digit of g? 2 Suppose -14 - 6 = -5p. Let r = 248 + -139. Suppose ps = 35 + r. What is the units digit of s? 6 Let j(o) be the third derivative of o4/8 + o3 + 4o*2. Let c be j(3). Let y = c - 7. What is the units digit of y? 8 Let j = 129 + -306. Let d = -120 - j. Suppose 5g = 2g + d. What is the tens digit of g? 1 Suppose -88 = -6l - 10. Suppose -y + l = -52. What is the tens digit of y? 6 Let a = -11 + 19. Suppose -d - a = 2d + 2q, 4d + 12 = -3q. Let b = d - -1. What is the units digit of b? 1 Let k(z) = 10z - 1. Let g be k(5). Let n = -11 + g. What is the tens digit of n? 3 Let c be (-1 - -2)/(4/32). Suppose -cv = -9v - 6. Let i = v + 46. What is the tens digit of i? 4 Let h = -286 - 18. Let o = h - -515. What is the units digit of o? 1 Let m = -685 - -2759. What is the tens digit of m? 7 Suppose 325 = s + 47. Suppose 2b - s = 140. What is the hundreds digit of b? 2 Let f be 1-3632/(-6). Let a = -34 + f. Suppose -a = -6g + 3g. What is the units digit of g? 9 Let s(j) = 0j - j + 403 - j3 - 403. Let z be s(0). Suppose 5t - q = 209, z = 3t + 4q + 54 - 161. What is the units digit of t? 1 Let z = -31 - -31. Suppose z = -2l + 4l - 240. What is the units digit of l? 0 Let g be 8/10(-60)/(-8). Let v = 7 + g. What is the units digit of v? 3 Let y = 13 + -11. Suppose -t + 39 = f, f + 0f - 73 = -yt. What is the tens digit of t? 3 Let d = 27 + -28. Let z(w) = -9w3 + w2 - 1. Let n be z(d). Suppose -39 = -4p + n. What is the units digit of p? 2 Suppose -10s - 56 = -8s. Let y = 73 + s. What is the tens digit of y? 4 Let q be (-4)/7(-56)/16. Suppose -9 = -qx - 5. Let y(z) = 2z*3 - 2z + 4. What is the tens digit of y(x)? 1 Suppose -3i = 53 - 839. What is the tens digit of i? 6 Let q be (-7)/(-3) + -5 + (-17)/(-3). Suppose qg - 188 = g. What is the units digit of g? 4 Let p(d) be the third derivative of -d*6/120 - 3d*5/20 + 5d*4/8 - 5d*3/3 - 4d*2. What is the units digit of p(-11)? 7 Suppose 3s = 3h - 2s + 9, 2s = 2h + 2. Suppose 3i = -hi. Let d = i + 9. What is the units digit of d? 9 Let r(b) = -b. Let q(h) = -h*3 - 5h*2 - 5h + 1. Let p(v) = q(v) - 2*r(v). Let a be p(-4). Let k = a + 11. What is the units digit of k? 8 Let s(t) be the second derivative	{ "pile_set_name": "DM Mathematics" }
. Let g be u(5). Let v be (-4)/g + (-7602)/(-63). Suppose -25i - v = -30i. What is the units digit of i? 4 Let s(z) = 108z + 72. What is the tens digit of s(5)? 1 Suppose -3p + 2p = -2h - 2, 3h - 3p = 0. What is the units digit of (14/35)/(h/(-180))? 6 Suppose -2l + 4 = 4r - 4, -4l = r - 16. Suppose r = -3p - 6a + a + 48, -2p - 2a = -32. What is the tens digit of p? 1 Suppose 0 = -5b + 7b - 14. What is the units digit of b? 7 Suppose -4k - 41 = -2k + 5v, 0 = 3k + 3v + 57. Let z = k + 17. Let a(n) = -48n + 1. What is the units digit of a(z)? 9 Let v be -3 - (3 - 3)(-4)/(-8). Let g(l) = 13l2 + 6l + 16. What is the hundreds digit of g(v)? 1 Let b = -629 - -1258. What is the tens digit of b? 2 Let v = 599 - 233. What is the tens digit of v? 6 Suppose -5v - 26 = -4i, 8 + 6 = i - 5v. Suppose -j = id - 13, 3d = -0d + 2j - 4. Suppose -dp - 3h + 0h = -31, -15 = 3h. What is the units digit of p? 3 Let x = 73 - 59. What is the tens digit of 7/x - ((-818)/4 - 0)? 0 Suppose 19l = 13l + 6570. What is the thousands digit of l? 1 Suppose 2m - 5y - 2 + 541 = 0, y - 262 = m. Let d = m + 508. What is the tens digit of d? 5 Let f = 250 + 9. What is the hundreds digit of f? 2 Suppose 4 = -2g, 0 = -i + g - 5g + 265. Suppose 0 = -5k + z + i, 279 = 4k + k + 2z. What is the units digit of k? 5 Let z(l) be the second derivative of 0l3 + 3/2l*2 + 0 + 1/4l*4 - 4l. What is the tens digit of z(3)? 3 Let n(r) = 300r - 152. What is the thousands digit of n(6)? 1 Suppose 0 = -16i - 10293 + 50421. What is the thousands digit of i? 2 Let r be 84/(-15) + 4/(-10). Let g = 9 + r. What is the units digit of g8/(-60)-25? 0 Let z(l) = 4l2 + 4l + 3. Let k be z(-2). Let w be (-1)/(-4) + k/4. Suppose 2r = s - 2s + 13, 3 = -ws. What is the units digit of r? 7 Suppose 0 = i - 2a - 94 + 34, -5i + 267 = a. Let j(n) = -5n + 1. Let d be j(1). What is the units digit of i/2d/(-12)? 9 Let y be 9/(27/12) - 12. What is the units digit of (y - -6)/(4/(-94)) + -1? 6 Let g be 368/20 + (-2)/5. Let y = g + 1. What is the tens digit of y? 1 Suppose -1058 = 23k - 4324. What is the tens digit of k? 4 What is the hundreds digit of 4734/22 + 4/132-6? 2 Suppose 12t - 7t - 20 = 0. What is the tens digit of t/12-3 - -42? 4 Let a = -20 - -14. Let b be 15/a(-3 - -1007). What is the tens digit of (-2)/(-12) + b/(-60)? 4 What is the thousands digit of -21(-8)/28 - -1459? 1 Let w = 4129 + -2733. What is the thousands digit of w? 1 Let x(d) = d + 6. Let q be x(-6). Suppose -l + 4 = -ql. Suppose 2 = -5v + 7, 4m = lv + 76. What is the units digit of m? 0 Suppose 12 = 4q + 4m, m + 7 = 3q + 5m. Suppose -qx = x - 330. What is the tens digit of x? 5 Let v(q) = -2q - 6. Let a be v(-6). Suppose 53 = i - a. What is the tens digit of i? 5 Let n(p) = 2p2 + 2p - 6. Let i be n(3). Let d(b) = -5b + ib + 0b. What is the units digit of d(2)? 6 Let z(m) = -9m*2 - 2m + 2. Let a be z(-2). Let p = -28 - a. Suppose px - 100 = -2. What is the tens digit of x? 4 Suppose -4y + 547 = -13133. What is the thousands digit of y? 3 Suppose -658 = -2r + 1922. What is the hundreds digit of r? 2 Suppose 21 - 56 = -7y. Suppose -yu - 101 = -0d - d, 5u - 20 = 0. What is the units digit of d? 1 Suppose -5g = 5i - 380, 3g = -0g - 9. Let j = i + -44. What is the units digit of j? 5 Let z be (-1 + -160)(3 - (-8)/(-2)). Suppose 2w + 25 = 2k + z, -w + 53 = -4k. What is the tens digit of w? 7 Let q(x) be the third derivative of -1/60x*5 + 0 + 1/3x*3 + 0x - 3x2 + 1/24x*4. What is the units digit of q(0)? 2 Let z(j) = -199j - 61. What is the units digit of z(-9)? 0 Let i be (3 + -2)(-2 + (-54)/(-2)). Suppose 0 = 23g - 18g - i. What is the units digit of g? 5 What is the tens digit of (-8346)/(-9) - 16/(-9)? 2 Suppose -2c + 2513 = 3g, -4g - 3c + 4188 = g. What is the hundreds digit of g? 8 Let w(y) = 210y2 - 8y - 20. What is the units digit of w(-3)? 4 Let f(z) = z*2 + 2z - 3. Let h be (1 - 2)/((-1)/(-3)). Let j be f(h). Suppose jn = 2n + 6, -3 = -3l - 3n. What is the units digit of l? 4 Let q = 1369 - 514. What is the units digit of q? 5 What is the hundreds digit of 2((-1)/(-6))/(6/35658)? 9 Suppose 5r = -4v - 116 - 60, 3v = -3r - 129. Suppose 5w + 4k + 39 + 28 = 0, 5k = 4w + 70. Let s = w - v. What is the units digit of s? 4 Suppose 16s + 4p - 164 = 15s, s = -3p + 161. What is the tens digit of s? 5 Let i(v) = -v3 - v + 1. Let z be i(1). Let y(c) = -116c*2 + 1 + 116c*2 + 70c*2 + c + 0c. What is the tens digit of y(z)? 7 What is the tens digit of (-4 - (-44)/4) + 368? 7 Let k(t) = t*2 + 9t - 11t + 5 - 9t - 33. What is the tens digit of k(14)? 1 Let y(o) = -o + 23. Let a be y(0). Suppose -5f + 893 - 753 = 0. Suppose -ax + fx = 30. What is the units digit of x? 6 Suppose -3u + 5u = v + 109, 119 = 2u + v. Let n = 8 + u. What is the tens digit of n? 6 Let d(f) be the second derivative of f*5/20 - 11f*4/12 - 4f*3/3 + 6f*2 + 11f. What is the tens digit of d(12)? 6 Let p = 688 + -310. Suppose -7g = -g - p. What is the units digit of g? 3 Let i(q) = -2q*3 + 2q*2 + 2q - 2. Let o be i(2). Let a = o - -11. Suppose av = 5, -3b - 2v = 2 - 49. What is the tens digit of b? 1 Let n(l) be the first derivative of l3/3 - 11l*2/2 + 5l - 10. Let z be n(11). Suppose 184 = 4m + o, 4m - zo - 205 = -m. What is the units digit of m? 5 Let m(s) = -340s - 74. What is the tens digit of m(-3)? 4 Let f(o) = -o*3 + 16o*2 + 2o + 20. Let x be f(16). What is the units digit of 8594/39 + 8/x? 2 Let z(t) = -t3 - 2t*2 + 3t - 2. Let k be z(2). What is the tens digit of 267/4 - -1(-3)/k? 6 Let q(r) = 34r + 113. What is the units digit of q(9)? 9 Suppose l + 25 = -20. Let r = 33 - l. What is the units digit of r? 8 Suppose -3n + 4n = 24. What is the units digit of (7/(-4))/((-2)/n)? 1 Let x(o) = o + 49. Let f be x(-23). Suppose f = -3r + 638. What is the units digit of r? 4 Let y(i) = -i3 + 9i*2 - 10i + 5. Let h be y(8). Let c = h - -15. Suppose -2d = 3d - q - 54, -cq + 34 = 5d. What is the units digit of d? 0 Let u(a) = 28a2 + 19a - 26. What is the thousands digit of u(12)? 4 Let o(w) = -w*3 + 10w*2 + 10w + 17. Let s be o(11). Suppose 0 = -3g - 5d + 259, sd - 9d = -2g + 141. What is the tens digit of g? 7 Suppose -26 - 31 = -3w. Suppose w - 3 = 4p. Suppose pi = 5i - 19. What is the tens digit of i? 1 Let p(v) = -v3 - 15v*2 + 11v + 30. Suppose -1 = 2d + 31. What is the tens digit of p(d)? 1 Suppose -2u = u. Suppose u = -2s + 6s - 144. What is the tens digit of s? 3 Let l(u) = 183u - 119. What is the tens digit of l(9)? 2 Let k(i) = -3i3 - i2 - 2i. Let y be k(2). Let m = 62 + y. What is the units digit of -1 - m/(-9)12? 9 Suppose 5b = i + 22, -2i + b = -2b + 23. Let w(z) = 2z*2 + 14z. Let u be w(i). Suppose -2j - 10 = 0, u = p + p - 3j - 23. What is the units digit of p? 4 Let r = 263 - 191. What is the units digit of r? 2 Let a(r) = -2 + 2 + 2 - 2r. Let d be a(0). Suppose z - b = -6b + 23, dz - 72 = 3b. What is the units digit of z? 3 Let z = -57 + 232. Suppose 4g = 5m - 876, 0g + z = m - g. What is the units digit of m? 6 Let p be 4/1(-90)/806. Let i = 119 - 69. Let j = p + i. What is the units digit of j? 3 Let w = 696 + -479. What is the tens digit of w? 1 Let d = -1910 - -4078. What is the hundreds digit of d? 1 Suppose 2m = 4s - 16, -2s = -0s + 4m - 8. Let l be s/(-10) + (-626)/10. What is the tens digit of (-2093)/l - 4/18? 3 Let p = -28 + 62. Let f = 98 - p. What is the units digit of f? 4 Let t = -133 - -89. Let k = 91 + t. What is the units digit of k? 7 Let i(k) = k*3 + 52k*2 + 40k - 61. What is the units digit of i(-51)? 0 Suppose 2 = c - 0. Suppose 2s = 3s - 1, -cv + 17 = 5s. Suppose -vk + 85 = -k. What is the tens digit of k? 1 Let g be -29/(-6) - 1. Suppose n - 3u = -4u + 63, 4n = u + 252. Suppose -5m + n + g = 0. What is the units digit of m? 3 Let o = 10 - 16. Let l be (-3 + 33)/(o/(-4)). What is the units digit of -1 - l(-1)/1? 9 Suppose 5j - 440 = -3j. What is the units digit of j? 5 Let y(h) = 21 - h2 + 0h - 6h + 0h**2 - 6. Let f be y(-7). What is the tens digit of (f + -4 - -7)	{ "pile_set_name": "DM Mathematics" }
= 2y - 5b, 15 = y - 3b. List the prime factors of 1(-2 - y) - -30. 2, 7 Suppose 5x - 238 = 3b + 239, 4 = 4b. Suppose x = n + 2n. Let i = n - 18. What are the prime factors of i? 2, 7 Let c be (1/3)/(1/12). Let g be 2/c108. Suppose 4o - g = -0o. What are the prime factors of o? 2, 5 Let f = -64 - -81. What are the prime factors of f? 17 Suppose 4a + 1734 = 10a. What are the prime factors of a? 17 Suppose -m + 5u + 8 = -14, 12 = -3u. Let j be 14 + (-2)/m + 3. Let w = j + -11. What are the prime factors of w? 5 Let t(x) = x*2 - 2. Suppose 3k + 2k = 15. Let d be t(k). Let i = 14 - d. List the prime factors of i. 7 Suppose -5h - 5 + 0 = 5i, -4i + h = -1. Let l be (0 - -3) + 0 + i. Let o = 8 - l. List the prime factors of o. 5 Let y = -1 - 6. Let j = y + 19. What are the prime factors of j? 2, 3 Suppose j = 3v - 94, 2j + 122 = 4v - j. List the prime factors of v. 2 Suppose 8b - 3b = 10. Suppose -5j = 4x - 3, bj + 7x - 3x - 6 = 0. What are the prime factors of 0/j - (-5 + 3)? 2 Suppose -4z + 9 = -11. Suppose -zf + 36 = -2f. List the prime factors of f. 2, 3 Suppose -2k - c + 3c + 174 = 0, -3k = c - 241. List the prime factors of k. 2, 41 Let m be (6 - 3) + -1 + 3. Let g = m - -2. What are the prime factors of g? 7 Let r(q) = q + 4. Let o(g) = -2g - 9. Let m(p) = 3o(p) + 5r(p). List the prime factors of m(-12). 5 Let r = 81 - -37. List the prime factors of r. 2, 59 Let c(u) = 328u*2 + 2u + 2. What are the prime factors of c(-1)? 2, 41 Suppose 0 = -3i - 4t + 453, -2i + 2t + 302 = -3t. What are the prime factors of i? 151 Let u = -1 - -16. What are the prime factors of u? 3, 5 Let f = -223 - -349. What are the prime factors of f? 2, 3, 7 Let t be (-2 - (-4 - -2))/(-2). Suppose 4w - w - 93 = t. List the prime factors of w. 31 Suppose -168 = -2k - 2k - 3f, 5k = -f + 210. What are the prime factors of k? 2, 3, 7 Suppose -y - 4c - 1 = -2, 0 = -3y - 5c + 10. Suppose ya - 5 = -5b, 2 = -3a - 4b + 3. What are the prime factors of a? 3 Let q be (-3)/9(1 - 1). Let t(m) = -m + 24. What are the prime factors of t(q)? 2, 3 Suppose -19 - 1 = -5c. Let z(h) = h3 - 3h*2 - 3h + 2. What are the prime factors of z(c)? 2, 3 Suppose -5l + 475 = -0l. Suppose 10g - l = 5g. List the prime factors of g. 19 Let u(o) = o*2 - o + 1. Let p be u(1). Suppose p + 0 = -w. What are the prime factors of 0 + 2 + 0 - w? 3 Let c be (-6)/(-5)5/2. What are the prime factors of 4/(1 + c) + 18? 19 Suppose 12 = 5k - 3. Suppose k = d + 1. Suppose -3g = dg - 75. List the prime factors of g. 3, 5 Let r = 869 - 621. What are the prime factors of r? 2, 31 Suppose -5x + 20 = 3g - 0, 3x - 12 = -4g. Suppose -4n + 0 + x = 0. Suppose c - a - n = 1, a = 5c - 18. What are the prime factors of c? 2 Let y be 25/4 + (-5)/20. Suppose 0z + 198 = yz. List the prime factors of z. 3, 11 Let o be (2/4)/((-4)/(-88)). Let a be (1 + o)(-1)/(-3). Suppose -al = l - 20. What are the prime factors of l? 2 Let b(o) = -2o*3 - 5o*2 - 2o + 4. Let w be b(-4). Suppose 2p = 6, -w = -2g - 3p - 9. List the prime factors of g. 3, 7 Suppose -4r - 4c - 60 - 8 = 0, -4 = -4c. Let s be (-15)/(-2) - 9/r. Suppose z + 0z - s = 3u, -4z - 5u = -83. What are the prime factors of z? 17 List the prime factors of 33 - (2 + (-4 - -6)). 29 Suppose -4w + 2t = 16, 0w + 5t = 2w + 24. Suppose -p + 2 = 0, -4p + 13 = -k - 1. List the prime factors of (k + 5)/(w/26). 13 Let s(n) = 39n2 - 1. What are the prime factors of s(1)? 2, 19 Let d(l) = -2l + 7. Let c be d(5). Let w be (2/c)/((-2)/(-12)). List the prime factors of (-98)/w - 6/4. 23 Let c = 191 - 110. List the prime factors of c. 3 Suppose 3q + u = 22, 0 = -4q + q + 5u + 34. Suppose -4o - 48 = -qo. List the prime factors of o. 2, 3 Let f(g) = 2g*2 + 5g + 3. Suppose 57 = 4o - 3n, o - 3o - 2n + 32 = 0. Suppose -2s - 3s - o = 0. List the prime factors of f(s). 2, 3 Suppose -4u + 35 = c, 2u + 2 = u. Suppose -4w + c = o, -5w - 17 = o - 70. List the prime factors of w. 2, 5 Let d be 2 + (0 - (0 + 2)). Let t(o) = o*2 + 51. Let g be t(d). Suppose -4i + 70 = 5h + i, 4h + 3i - g = 0. List the prime factors of h. 3 Let k be 1 - -1 - 29/(-1). Suppose 0 = -5h + 3p + 15, -5p + k = h. Suppose -4r - h = -2z, -z - r - 1 = -16. What are the prime factors of z? 11 Let y = -22 - -37. Let d be (-3 - 33/(-9))30. Suppose m = -5k - 21, 3k + y + d = 5m. What are the prime factors of m? 2 List the prime factors of 138/2(-7)/(-21). 23 Let m = 38 - 53. Let z = m - -36. List the prime factors of z. 3, 7 Let m(p) be the third derivative of -p5/60 + 11p*4/24 + 8p*3/3 + 3p2. What are the prime factors of m(11)? 2 Let m(o) = o3 + o - 3. Let z be m(-4). Let l = z + 99. What are the prime factors of l? 2, 7 What are the prime factors of 3 - (-4170)/21 - (-8)/(-14)? 3, 67 Let i = 1 - 1. Suppose i = -g + 7 - 2. Suppose 2t - 31 = -t - f, -gt + f + 65 = 0. List the prime factors of t. 2, 3 Let o(v) = v*3 - 19v*2 - v + 22. Let c be o(19). Let s(j) = 3j - 4. Let g be s(-3). Let r = c - g. What are the prime factors of r? 2 Suppose h - 2h + 10 = 0. Suppose 4o - 10 = k, -k + 0 + h = o. Suppose 2p + k = 4p. List the prime factors of p. 3 Let b = -1 + 0. Let d(g) = g*2 - g - 1. Let i(x) = -2x*2 + x + 1. Let u(p) = -2d(p) - 3i(p). List the prime factors of u(b). 2 Let g(y) = y3 - 10y*2 + 13y - 10. Let i be g(9). Let m = i + -2. What are the prime factors of m? 2, 3 Let x(d) = d*2 + d - 7. What are the prime factors of x(-5)? 13 Let k(b) = -b + 7. Suppose -3t - 5 = -20. Let h be k(t). Let y = 1 + h. List the prime factors of y. 3 Let s(a) = -a*3 + 2a*2 + 2a - 2. What are the prime factors of s(-2)? 2, 5 Let t = 18 + -9. List the prime factors of t. 3 Suppose 4a - 4 = -k + 4, a = 5k - 82. Let h = k - 11. Suppose h = 2o - 5. What are the prime factors of o? 5 Let j be (2 + (-5)/2)-8. Suppose 3v = -o + 7, v - 3 = 2o + j. Suppose -vu = u - 24. List the prime factors of u. 2, 3 Let a(d) = -d3 - 6d*2 - d + 4. Let r be a(-6). Let j(l) = -2l*2 + 5l*2 - 8l - 2l2 + r. What are the prime factors of j(7)? 3 Suppose 3g - 129 = -2p, 3g - 3p - 147 = p. List the prime factors of g. 3, 5 Suppose -171 = -2x + 4u + 3, -4x + 3u = -338. What are the prime factors of x? 83 Let y = 60 + -29. What are the prime factors of y? 31 Let z = -19 - -29. What are the prime factors of (z + (-4)/(-4))2? 2, 11 Let g(j) = -3j2 + 4j*2 + 4j*2 + 6j - 4j2. What are the prime factors of g(-9)? 3 Suppose 0 = -n + 3u - 5 + 79, -450 = -5n - 5u. List the prime factors of n. 2, 43 What are the prime factors of (3 - 0 - 18)204/(-20)? 3, 17 Let u = 49 - 9. List the prime factors of u. 2, 5 Suppose 0 = -g + 3 + 2. Suppose 3s = s - 2m + 18, gs = -4m + 40. Suppose n = -2, -sb - 3 + 17 = n. List the prime factors of b. 2 Let b(r) = r*3 - 3r*2 - 2r. Let p be b(-2). Let c be (p/5)/(2/(-25)). Suppose 5f - c = -0f. What are the prime factors of f? 2 Let c(x) = x*3 - 5x*2 + 5. Let l be c(5). Suppose -2k - 24 = -lk. What are the prime factors of k? 2 Suppose -14l + 9l = -20. List the prime factors of l. 2 Let o(d) be the second derivative of 7d6/720 - d5/60 + d*4/6 - d. Let k(y) be the third derivative of o(y). What are the prime factors of k(2)? 2, 3 Let v(g) = -5g - 6. Let d(w) = -w*2 + 4w + 5. Let a(k) = -5d(k) - 4v(k). Let i be a(-1). Let m = -2 + i. List the prime factors of m. 2 Let j = -36 - -55. List the prime factors of j. 19 Let h(b) = -10b - 2. Suppose -3o - 8 = -3c - 2, 2o - 4c = -4. Let k be h(o). Suppose 0 = 4n + 3l - k, 4l - 22 = -5n - 0n. List the prime factors of n. 2, 3 Suppose -26 = -2f - 0w + 4w, -3f + 2w + 19 = 0. Suppose fl - l = 0. Suppose -3j - i + 24 = l, j - 2 - 19 = 4i. What are the prime factors of j? 3 Suppose -5n - 16 = 19. Let i(t) be the first derivative of -t2 - 2t - 1. What are the prime factors of i(n)? 2, 3 Let a be (-8)/(-12)(-30)/(-4). Suppose -5w - h = -0h - 29, -5h = -3w - a. What are the prime factors of w? 5 Suppose -3r + 141 = -4f, -4r + 0f + 188 = -4f. List the prime factors of r. 47 Suppose c = -0 + 2. Suppose -5u + 21 = -4r, -cu + 4 + 9 = 3r. What are the prime factors	{ "pile_set_name": "DM Mathematics" }
digit of m? 2 Let j(g) = g + 1. Let x be j(-7). Let a = -3 - x. What is the units digit of a? 3 What is the units digit of (24/9 + -3)-45? 5 Let b(l) = 13l - 10. What is the tens digit of b(3)? 2 Let h be -9 + (-1 - 0) + 3. Let p(l) = l + 9. What is the units digit of p(h)? 2 What is the tens digit of (1 + -4)/((-30)/710)? 7 Suppose -2s + 11 = c, 21 = 5s - 6c + 2c. Let q(l) = -l*2 + 5l + 6. What is the units digit of q(s)? 6 Let r(j) = 6j + 3. Let n be r(5). Suppose 81 = 5s + a, 4a = s - n - 0. What is the tens digit of s? 1 Suppose 0q - 15q + 90 = 0. What is the units digit of q? 6 Let x(y) = 162y*2 + 3y + 3. What is the tens digit of x(-1)? 6 Suppose -7w + 86 = -292. What is the tens digit of w? 5 Suppose -8d - d + 675 = 0. What is the tens digit of d? 7 Let m(p) = -p. Let u(y) = -y*2 - 17y - 10. Let x(w) = -6m(w) + u(w). What is the units digit of x(-4)? 8 Suppose -7n = -5n - 74. What is the tens digit of n? 3 Suppose 3x - 5 = 31. What is the tens digit of x? 1 Suppose 6 + 3 = 3w. Suppose -h = -0h - w. What is the units digit of 2/h(2 - -25)? 8 Let r(i) = 2i*2 + 6i - 5. Let c be r(-6). Let z = 38 + -60. Let y = z + c. What is the units digit of y? 9 Let m(a) be the first derivative of 4a2 - 2 + 0a*2 - 2a + 1 - 3a2. What is the units digit of m(3)? 4 Suppose -5o = -5f - 45, -4f - 5o + 1 = 10. Let d(h) = h + 7. What is the units digit of d(f)? 1 Let q(c) = -c - 5. Let g be q(4). Let n be (-4)/18 + (-47)/g. Suppose -n = 3i - 23. What is the units digit of i? 6 Let u(z) = 2z + 14 + 0z - z3 - z2 - 6z + 5z. What is the tens digit of u(0)? 1 Let z(c) be the second derivative of 0 - 1/20c5 - c + 5/2c*2 - 7/12c*4 + 0c*3. What is the units digit of z(-7)? 5 Suppose -3p - 33 = -99. Suppose -g = -2t - t + p, 2t = 4g + 8. What is the units digit of t? 8 Suppose z + 1 = 2. Let o(h) = 5h*2 + 2h - 1. Let i be o(z). Suppose 24 = 3a + i. What is the units digit of a? 6 Let q(l) = 1 - 6 + 4l - 2l. Let i be q(6). Suppose c = -4b + i + 25, 2b = -c + 14. What is the units digit of b? 9 Suppose -5j - 31 = -2m, -2m = j - 7 - 6. Suppose -5f = -2q - 68, 3f - 35 - m = -q. What is the units digit of f? 4 Let n be -16(-3)/(-9)3. Let l be 9/(-6)n/6. Suppose lj - 3j - 3 = 0. What is the units digit of j? 3 Let n = 13 + -2. Suppose 7f - 2f - 115 = -5o, 3f = o - n. What is the units digit of o? 0 Suppose -4m + 733 - 165 = 0. Let s = m + -50. Suppose t - 5t - s = -4v, -t + 109 = 5v. What is the tens digit of v? 2 Let r(n) = -n*2 + 16n - 11. What is the tens digit of r(8)? 5 Let f(p) = -p - 3. Let u be f(-6). Suppose -n + ul = 3n - 85, 3n = 5l + 61. What is the units digit of n? 2 Let m(k) = 3k3 + 3k - 6. What is the tens digit of m(3)? 8 Suppose 3y + 150 = 6y. Suppose -i - 19 + 84 = 5d, 5d - y = 2i. What is the tens digit of d? 1 Let d(a) = 9a*2 - a - 4. What is the units digit of d(-2)? 4 Suppose 19 = 5k + 4. Suppose 108 = kf + f. What is the tens digit of f? 2 Let d(g) = g + 3. Let k be d(-3). Suppose 2z - 22 = -kz. What is the tens digit of z? 1 Let j(a) = 7a + 77. What is the units digit of j(24)? 5 Suppose -4o - 29 = a, -3a + 2o + 21 = -4a. Let u(t) = -t*3 - 12t*2 - 10t + 4. Let k be u(-11). Let q = k - a. What is the units digit of q? 6 Let l(i) = 2i - 12. Let y = -5 - -16. What is the units digit of l(y)? 0 Let l(h) = h3 + 3h*2 - 4h + 3. Let j be l(-4). Suppose z + 2z - j = 0. What is the units digit of z? 1 Let h(y) = -4y + 41. What is the units digit of h(-21)? 5 Let w(k) = -k*2 - 22k + 6. What is the tens digit of w(-14)? 1 Let t(b) = b*2 - 5b + 1. What is the units digit of t(5)? 1 Let n(h) = -h*3 + 7h*2 - 7h. What is the tens digit of n(4)? 2 Let v = 6 + -1. Let g be v/3 - 2/(-6). What is the units digit of 16/2 - 0 - g? 6 Let i(j) = -27j3 + 2j*2 - 3j + 2. Let n be i(1). Let u be 230/6 - 4/(-6). Let p = u + n. What is the tens digit of p? 1 Suppose -4v - 44 = -4r, 5v - 3v = r - 20. Let j = v + 14. What is the units digit of j? 5 Let y(z) = -2z + 9. Let v be y(4). What is the units digit of (v - 5)/(4/(-6))? 6 What is the units digit of ((-3)/(-2))/((-39)/(-910))? 5 Let y be 0 - (0/(-1) + -1). Let s = 3 + y. Suppose 0 = -k + s + 2. What is the units digit of k? 6 Suppose -3t + 419 = 5q, t - 401 = -5q + 4t. What is the tens digit of q? 8 Let h be -1 - ((-1)/(-1) - 3). Suppose -h = -s + 1. Suppose -sd = 2q - 32, -q = 2d - 21 - 10. What is the tens digit of d? 1 Let i(v) = 12v - 13. Let y(w) = 11w - 12. Let p(j) = 5i(j) - 6y(j). Let z(d) = 6d - 6. Let n(s) = 5p(s) + 6z(s). What is the units digit of n(1)? 5 Let z = -11 + 8. Let m be 101/4-2. Let h = z - m. What is the units digit of h? 2 Let g(z) = 6z - 8. What is the units digit of g(4)? 6 Suppose 0 = 6a - 2a - 124. Let i = 62 - a. What is the tens digit of i? 3 Let b(x) = -x*2 - 10. Let y be b(0). Let k = y - -14. Suppose 64 = 8g - kg. What is the tens digit of g? 1 Suppose -2v + 2p - 25 = -69, 2v + p - 29 = 0. What is the units digit of 5/(-20) + v/4? 4 Let i = 13 + -8. Suppose -25 = -ic + 25. What is the units digit of c? 0 Suppose 18i - 9i = 1755. What is the hundreds digit of i? 1 Suppose -5h = -4n - 23, -7 = h + n + 4n. Let y = 4 + h. What is the units digit of y? 7 Suppose k + 4k = 5. Let i(y) = 4y + 1. What is the units digit of i(k)? 5 Let v = 111 + 7. What is the tens digit of v? 1 Let a = 8 + -7. What is the units digit of (4/6)/(a/3)? 2 Suppose -z + 10 = 6. Let o be -1 + 0 - -327. Suppose 0 = -4m - zf + o, 5m + f - 12 = 88. What is the units digit of m? 0 Suppose -u - 5z + 6 = 0, 2z = -u + 6u - 3. Let k = u + 1. Suppose 4j + 2v = 4v + 6, kj + v - 9 = 0. What is the units digit of j? 3 Suppose 3d - 575 = -5q, 8q - 3q - 575 = -4d. What is the units digit of q? 5 Let d be 1 - 1(0 - -3). What is the units digit of d/11 + 280/88? 3 Let r be (-11)/(-3)(-1 + 4). Let m = -7 + r. What is the units digit of m? 4 Let z = 45 - 24. What is the units digit of z? 1 Let u(y) = 34y - 29. What is the hundreds digit of u(5)? 1 Let q be (-1 - -3)(17 + 1). Suppose 0 = -4x - n - n + 40, q = 3x + 3n. What is the units digit of x? 8 Suppose 4 + 4 = 2n. What is the units digit of (9/(-2))/(-3)n? 6 Let y(k) = -16k + 7. What is the tens digit of y(-4)? 7 Let i be 0/1 - (-12)/4. What is the tens digit of (-1 - 8/i)-3? 1 Let d(b) = -b3 + 5b*2 + 6b + 4. Suppose -200 = -y - 4y. Suppose 2n + y = 4p + 10, 0 = -3n - 9. What is the units digit of d(p)? 4 Let d(l) = -15l2 - 1. Let o be d(1). Let g = o + 23. What is the units digit of g? 7 Let h = -53 + 161. What is the units digit of h? 8 Let t = -23 - -26. Suppose -tk = 5s - 231, -s = -0k + k - 47. What is the tens digit of s? 4 Let a = -2 - -8. Suppose -c = -ac - 60. What is the units digit of (4/c)/((-1)/18)? 6 Let i = 35 + -8. What is the tens digit of i? 2 Let q(n) = -n2 - 8n - 6. Let y(g) = g*2 + 8g + 6. Let z(t) = -2q(t) - 3y(t). What is the units digit of z(-6)? 6 Let z(y) = -18y - 4. Let g be z(-3). Let a be -328/9-3. Let r = g - a. What is the units digit of r? 2 Let x(t) = t3 - 5t*2 - 4t - 8. Let y be x(6). Suppose 3r + 23 = 4d - 0d, -r + 3 = yd. What is the units digit of d? 2 Let g = -6 + 7. What is the tens digit of 13/2(g + 1)? 1 Suppose -3g - 2u = -548 + 30, -174 = -g - u. What is the hundreds digit of g? 1 Let s(i) = 2i*2 - 8i - 3. What is the tens digit of s(7)? 3 Let i be 0 + 2 + (0 - -10). Suppose 0 = -4w + 40 + i. What is the units digit of w? 3 Let p(t) = 2t*2 + 3t + 1. Let w(a) = a*3 + 3a*2 - 4a + 5. Let y be w(-4). Let f = 3 - y. What is the units digit of p(f)? 3 What is the tens digit of (5/(-10))/((-2)/116)? 2 Suppose -352 = -5h - 72. What is the units digit of h? 6 Let r(h) = 9h - 5. Let w be r(7). Let u = -38 + w. What is the tens digit of u? 2 Let c = 43 + -12. What is the tens digit of c? 3 Suppose 5y - 5c + 115 = 0, -3y + 4c = -8y - 115. Suppose 10s = 5s - 65. Let l = s - y. What is the tens digit of l? 1 Let o = 62 - 15. Let v = o + -7. What is the tens digit of v? 4 Let b(a) = 43a*2 + a. Let x be b(1). Suppose 5d - x = 61. What is the units digit of d? 1 Let d(p) = 4*p - 29. Let t(n)	{ "pile_set_name": "DM Mathematics" }
4 Let k(m) = -4m. Let z(d) = -107d + 24d + 326d. Determine z(k(s)). -972s Let n(y) = -39959y2. Let q(b) = -b2. Give q(n(m)). -1596721681m4 Let j(n) = -n2 - n + 12. Let w be j(3). Let i(v) be the third derivative of w + 0v - 1/30v5 - v2 + 0v3 + 0v*4. Let q(d) = -2d. What is i(q(b))? -8b2 Let c(p) = 17p*2. Let l be ((-4)/(-4)-1)/((-2)/326). Let q(i) = -82 - 81 + i + l. Give q(c(k)). 17k2 Let t(q) = -2q. Suppose -2f + 5l + 22 = -3, 4l = -20. Let p(h) = 0h + 22h2 - 21h*2 + fh. Determine t(p(r)). -2r2 Let p(g) = 6g - 157. Let y(f) = -440f - 1. Determine p(y(x)). -2640x - 163 Let d(l) = -10l. Let s(v) = -17v*2 + 47 - 73 + 26. Calculate d(s(c)). 170c*2 Let z(f) = 16f + 11. Let p(j) = -59j. Determine z(p(i)). -944i + 11 Let k(s) = 5s2. Let o(i) = i + 1. Let w(v) = 5v + 4. Let x(f) = -11o(f) + 2w(f). Let u(g) = -2g - 7. Let a(l) = 6u(l) - 14x(l). Give k(a(y)). 20y*2 Let p(a) be the first derivative of -5/2a*2 + 0a + 3. Let c(u) = -u. Calculate p(c(j)). 5j Let i(t) be the third derivative of -11t*5/60 - 4t*2. Let r(c) = 358c - 181c - 175c. Give r(i(v)). -22v2 Let f(i) = -16i*2 + 65i*2 - 24i*2 - 22i*2. Let c(a) = 141a*2 - 1. Give c(f(z)). 1269z4 - 1 Let j(v) = -v2 + v + 1. Let i(x) = 2x2 + 2x + 2. Let k(d) = i(d) - 2j(d). Let y(l) = 5l + 5. What is k(y(h))? 100h2 + 200h + 100 Let o(v) = -4 + 3 + 7083v2 + 1 - 7092v*2. Let q(z) = 22z. What is o(q(l))? -4356l2 Let o(z) = 3z + 5. Let b(q) = -2q - 3. Let k(r) = -5b(r) - 3o(r). Let j = 544 - 383. Let f(w) = 161 + 5w - j + 7w. What is f(k(u))? 12u Let m(o) = -4o. Let i(d) be the first derivative of 37d*2 - 202. Calculate i(m(f)). -296f Let a(v) = 12v. Let c(h) = -h + 104. Let n(l) = l - 86. Let o(f) = -3c(f) - 4n(f). Determine o(a(s)). -12s + 32 Let i(l) = 24l2. Let p(g) = 34 + 14 + g2 - 48 - 7g*2. Give i(p(k)). 864k*4 Let c(s) = -12s - 1. Let i(b) = -b - 10b + 3b - 9b + b. Give i(c(v)). 192v + 16 Let x(i) = 490i2. Let s(k) = -410k*2. Give s(x(b)). -98441000b*4 Let r(l) = 2l*2 - l - 3. Let i(y) = 616y*2 - 22y - 66. Let o(s) = -i(s) + 22r(s). Let m(u) = u2. Calculate o(m(a)). -572a*4 Let s(p) = -13p*2. Let d(j) = j + 1. Let l(x) be the third derivative of 7x*4/24 + 2x*3/3 - 32x*2 + 2. Let h(g) = 4d(g) - l(g). Give h(s(v)). 39v2 Let a(f) be the third derivative of -f5/4 - f2. Let m(x) be the second derivative of x3/6 - 5x - 129. Calculate a(m(o)). -15o2 Let s(y) = -9y*2. Let k(l) be the second derivative of -25l*3/6 + 16l - 6. Calculate s(k(r)). -5625r2 Let f(r) = -r2 - 5r - 1. Let k(c) = -9c2 - 90c - 18. Let t(j) = 18f(j) - k(j). Let v(o) be the third derivative of o5/30 + o2. Calculate v(t(y)). 162y*4 Let n(r) = -2r. Suppose 0 = 5z + 6 - 36. Let t(y) = -7y*2 + 5y - 5y - zy*2. What is t(n(p))? -52p*2 Let h(u) = 7u*2. Let b(v) = 139508v. What is b(h(j))? 976556j2 Let b(x) = -113x*2 + 2x - 659. Let j(v) = 6v2. What is b(j(t))? -4068t*4 + 12t*2 - 659 Let t(o) = -o - 38. Let q(x) = 29x*2 + x. Give t(q(i)). -29i*2 - i - 38 Let a(t) = -4t. Let f(m) = 14754m. Determine f(a(i)). -59016i Let j(f) = -5f. Let h(o) = 3066o*2 + 67o. Determine j(h(q)). -15330q2 - 335q Let c(u) = -4u2. Let v(p) = -8p - 5p - 1 + 15 - 17. Give v(c(y)). 52y*2 - 3 Let d(t) be the second derivative of 0 + 0t*3 + 5/6t*4 - 6t + 0t2. Let v(j) = 2j - j + 2j - 4j. What is v(d(b))? -10b2 Let t(k) be the first derivative of 61k*2/2 + 697. Let o(y) = 2y. Calculate o(t(f)). 122f Let b(u) = 8u*2. Let m(k) be the first derivative of 5k*3/3 - 59. Calculate m(b(z)). 320z*4 Let u(j) = -2j. Let d(z) = -2z2 + 22z - 906. Give d(u(f)). -8f2 - 44f - 906 Let f(g) = 16048 + 3g - 16048. Let j(p) = -2p*2 + 20. Calculate f(j(l)). -6l*2 + 60 Let v(o) = -6298 + 6298 + 2o. Let a(z) be the third derivative of z4 - z2. Determine a(v(i)). 48i Let s(n) = n. Let a(f) = -4213f + 519. What is a(s(i))? -4213i + 519 Let v(j) be the second derivative of 0 + 0j*2 - 1/2j*3 + j. Let u(a) = 3a*2. Calculate u(v(g)). 27g*2 Let m(i) be the third derivative of 1/12i*4 + 0i*3 + 0 + 12i*2 + 0i. Let u(n) = 8n2 + 2. Determine m(u(t)). 16t2 + 4 Let p(t) = t2. Let y(m) be the first derivative of 2 + 0m + 1/2m2. Calculate y(p(c)). c2 Let v(x) be the first derivative of -x*3/3 + 17. Let j(m) = -2m - 19. Calculate j(v(o)). 2o2 - 19 Let a(s) = -3s. Let p(i) be the first derivative of -15i2/2 - 56. What is a(p(d))? 45d Let f(z) = -104326z. Let w(u) = -16u. What is w(f(o))? 1669216o Let f(q) = -53q. Let c(p) be the second derivative of 13p3/6 + 607p. Give c(f(s)). -689s Let y(d) = -3d - 25. Let i(c) = 3c + 34. Let k(q) = -4i(q) - 5y(q). Let z(t) be the third derivative of t5/60 + t2. Determine k(z(w)). 3w*2 - 11 Let z(g) = -8g*2. Let c(a) = -98a - 20 + 117a + 20. Calculate z(c(i)). -2888i*2 Let m(d) = -55941d. Let b(a) = -4a. What is b(m(f))? 223764f Let k be (2 - 4) + 1-18. Let p = 132 + -131. Let d(x) = -16x - 20. Let r(o) = -o - 1. Let s(h) = kr(h) + pd(h). Let y(b) = b*2. What is s(y(g))? 4g*2 Let d(r) = 12r. Let b(i) = 12i - 14. Let s(f) = 4f - 5. Let t(x) = -5b(x) + 14s(x). Give t(d(z)). -48z Let n(h) = -981h. Let a(m) = 1182m - 1. What is n(a(z))? -1159542z + 981 Let g(m) = -8m2. Let k(c) = c - 17. Calculate k(g(i)). -8i*2 - 17 Let a(t) = 16t. Let v(x) = -19709x + 2. Calculate v(a(s)). -315344s + 2 Suppose -15 = -5d - 3f, 44f - 12 = -4d + 47f. Let m(z) be the second derivative of 1/3z*d + 0 - 11z + 0z2. Let c(p) = -12p*2. Calculate c(m(i)). -48i*2 Let i(m) = -2m*2. Let j(c) = -19c*2 + 1006c. What is j(i(u))? -76u4 - 2012u*2 Let h(z) = 2z*2. Let b(v) = 3v - 2 - 4 + 2. Suppose 65 = -4d + 21. Let k(q) = 9q - 11. Let u(n) = db(n) + 4k(n). What is h(u(l))? 18l2 Let d(h) = 8h*2. Let j(b) = 5b. Let y(f) = 0 + 0 - 51f + 42f. Let n(r) = 11j(r) + 6y(r). Calculate n(d(p)). 8p2 Let b(k) = -6k. Let f(r) be the third derivative of r4 + r2 - 54r. Give b(f(o)). -144o Let x(f) = -2f2. Let t = 5929 + -4184. Let z(q) = 105q - t + 1745. Give x(z(y)). -22050y2 Let w(q) = -88q*2 + 1 - 1 + 171q*2 - 82q*2. Let a(j) be the second derivative of 0 - 5/12j*4 + 0j*3 - 2j + 0j2. Give w(a(h)). 25h*4 Let r(w) = 3w. Let k(d) = 7d2 + 127. Give k(r(s)). 63s*2 + 127 Let w(o) = 2o*2. Let z(j) be the third derivative of -9j*2 + 0j*3 - 11/6j*4 + 0j + 0. Give z(w(i)). -88i2 Let l(x) = -2x - 55. Let z(d) = d + 63. Give l(z(k)). -2k - 181 Let o(f) = -79f. Let h(u) be the first derivative of -2u3/3 - 401. What is o(h(i))? 158i*2 Let u(m) = 2m + 1. Let h(w) = 496. Let a(c) = -h(c) + u(c). Let r(t) = -t*2. Give r(a(k)). -4k*2 + 1980k - 245025 Let n(r) = 10631r. Let w(f) = -18f*2 - f. Calculate w(n(y)). -2034326898y*2 - 10631y Let g(x) = 704673x2. Let v(z) = -2z*2. Determine g(v(d)). 2818692d*4 Suppose -z = 5q + 5, -5q + 2 = 3z + 7. Let k(d) = zd + d + d. Let y(i) = 17i - 2. Let s(h) = 120h - 15. Let c(g) = 2s(g) - 15y(g). Determine k(c(r)). -30r Let n(o) = 7o - 19. Let p(l) = -752l*2. Calculate n(p(w)). -5264w*2 - 19 Let k(v) = 22v2 + 62. Let c(f) = f2. Determine c(k(i)). 484i4 + 2728i*2 + 3844 Let t(l) = 22l. Let x(u) = -86u - 82u - 87u + 263u. What is t(x(f))? 176f Let x(k) be the second derivative of 0 + 7k + 0k2 - 35/12k*4 + 0k3. Let j(f) = f2. Give x(j(v)). -35v4 Let n(u) = -143u. Let h(s) = -1927s + 3. What is n(h(q))? 275561q - 429 Let t(b) = -16b. Let m(a) = -17a2. Let j(v) be the second derivative of -v4/2 + 4v. Let q(s) = 11j(s) - 4m(s). What is q(t(k))? 512k*2 Let v(w) = 2w*2 + 5w. Let d(u) = 3u2 + 8u. Let c(g) = 5d(g) - 8v(g). Let p = -4 + 7. Let a(f) = -2f + 4f + pf. Determine a(c(t)). -5t2 Let f(c) be the second derivative of c4/2 - 227c. Let o(j) = 16j. Give o(f(w)). 96w2 Let h(f) = 6f. Let m(l) = 39l2 - 5l + 10. Let c(z) = 58z2 - 8z + 16. Let k(q) = -5c(q) + 8m(q). What is h(k(u))? 132u*2 Let p(t) be the second derivative of	{ "pile_set_name": "DM Mathematics" }
= 4g - 35200, 21g + 5n + 8800 = 22g. Is g a multiple of 100? True Let s = -78 + 122. Suppose 0 = -a - 3r + 4, 3a = a + 3r + s. Is a a multiple of 3? False Let s be -50(168/30 - 5). Let z be 114/4(-4)/3. Let n = s - z. Is 8 a factor of n? True Suppose 0 = 9o - 13o + 60. Let h be 4(o/2 + 3). Suppose 3m - h = 6. Is m even? True Let q(w) = -5w*2 - 8w + 8. Let i be q(1). Does 29 divide i/(-30) + 3479/6? True Suppose 17u = 15u + 238. Suppose 5z = 2l - 88, 0l - z - u = -3l. Is 13 a factor of 4/16 + l/4 + 3? True Suppose 3t - 8666 = 2d, -d - 103 = -105. Does 34 divide t? True Let w be (-3(-24)/45)/((-2)/5). Let g(f) = 0f + 2f + 4f*2 + 2f + 8. Is g(w) a multiple of 14? True Let w(x) be the first derivative of x*3/3 - 2x*2 + 24x - 6. Is w(-8) a multiple of 6? True Let u(p) = -57p - 667. Is u(-34) a multiple of 13? False Let u(h) = -h3 + 10h*2 + 3h - 9. Let k be (-44/24)/((-1)/15). Does 6 divide u(k)? False Does 116 divide ((-744)/10)/((792/35728)/((-30)/7))? True Let w be -4 + (-17 + 1)/(-4). Suppose 0 = -3g - wg + 12. Does 22 divide 0/6 + 352/g? True Let a = 353 + -339. Suppose -ao + 12o = -154. Is o a multiple of 30? False Let g(k) = 2186k*2 + 46k + 42. Does 3 divide g(-1)? False Suppose 3v + 25 - 247 = -3d, d = 2v + 83. Let n = 229 + d. Does 18 divide n? True Is 16 a factor of (249570/(-1175))/((-6)/130)? False Let v be (-87)/18 - 9/54. Let g(z) = z3 + 3z*2 - 11z - 3. Let a be g(v). Is 19 a factor of (4/(-8) + 0)/(a/(-260))? False Let x be (8 - 3) + (-1 - -1). Suppose -f - 44 = xt - 9t, 4t + 3f = 44. Does 11 divide t? True Suppose -13s + 1467 = -4s. Suppose 599 = 2j + s. Does 22 divide j? False Let f(r) = -7r - 57. Let k(z) be the third derivative of -z4/3 - z3/2 - 40z2. Let t be k(2). Is 5 a factor of f(t)? False Let a = 19582 - 15607. Is 30 a factor of a? False Let g(l) = l2 + 349. Let d be g(0). Suppose y + 5y - 161 = -149. Suppose 0 = 2z - 5z - c + d, 226 = yz - c. Is 47 a factor of z? False Suppose 3m + 246 = 1206. Does 55 divide (m/12)/16 - 1315/(-3)? True Let w = 535 - 533. Is (w - 1) + -5 - (-25 + -290) a multiple of 31? False Suppose 4i - 82 = 206. Let b = -38 + i. Is b a multiple of 4? False Does 31 divide ((-4)/3 + (-2366678)/732)-2? False Let j = 392 - 392. Suppose j = 15f - 1297 - 893. Is f a multiple of 10? False Let o(b) = 3b*3 - 29b*2 + 147b + 30. Let q(m) = m*3 - m - 5. Let v(c) = o(c) - 2q(c). Is 32 a factor of v(24)? True Let u = -153 + 157. Suppose 0 = -9a + ua + 600. Is a a multiple of 24? True Let z = -123 - -123. Suppose 3a - k = 302, -4k + zk - 508 = -5a. Is 8 a factor of a? False Let w(o) = -2o2 + 77o - 128. Let q be w(37). Let r(p) = 5p2 + 65p + 6. Does 15 divide r(q)? False Let x(d) = -161d3 - 2d*2 + d + 2. Suppose -66 = -2o + o. Let y = o - 67. Is x(y) a multiple of 16? True Let x(g) = 40g2 + 61g - 58. Does 5 divide x(-22)? True Suppose -39f + 1294 = -11537. Suppose 11o + f = 1088. Is 23 a factor of o? True Suppose 143o - 21o - 1288587 = 11933. Does 13 divide o? True Suppose -2c = -5v - 29485, -163v = -164v + 7. Does 13 divide c? False Let m(s) = 300s - 135. Let q(j) = 299j - 134. Let w(g) = 4m(g) - 3q(g). Does 35 divide w(6)? True Let o be (3/3)/((-2)/6). Let m(l) = -l*3 - 3l*2 - 2l - 9. Let i be m(o). Let a(v) = -2v3 - v2 + 2v + 2. Does 8 divide a(i)? False Let r = -53 + 53. Suppose 5b - 816 - 614 = -5z, -3b + 4z + 879 = r. Is 33 a factor of b? False Let y = 864 - 859. Suppose -5w + 2p = -1599, -3w + 597 = yp - 350. Is w a multiple of 28? False Let z = 9656 + -7100. Is z a multiple of 3? True Let n = 294 + -297. Is 20526/27 + n/((-135)/(-10)) a multiple of 20? True Let l(k) = 2k2 + 4k - 20. Let c(d) = d*2 + 9d + 8. Let m be c(-7). Does 11 divide l(m)? False Let s be 483/115 + 3/(-15). Suppose -sw + 1128 = -5q - 882, -4w - q + 2022 = 0. Is 42 a factor of w? False Let c(s) = -116s*2 - s + 25030. Does 10 divide c(0)? True Suppose 28l - 29l + 2592 = 0. Suppose 31o = 22o + l. Is 18 a factor of o? True Suppose -6 = 9i - 42. Let a(v) be the first derivative of 14v3/3 - 10v*2 + 3v + 1. Is a(i) a multiple of 21? True Suppose 2v + 5t = 103, -4v + 0v + 5t + 221 = 0. Is 11 + 11136/v - 2/9 a multiple of 7? True Let n(z) = 32z*2 - 29z*2 - 21z - 13z. Is 58 a factor of n(-8)? True Suppose 0 = 1134w - 1174w + 1048000. Is 40 a factor of w? True Suppose 4j + 3o = 3497, 133o = 4j + 138o - 3503. Does 3 divide j? False Suppose -4p - 2g + 17538 = 0, 24g = p + 28g - 4388. Does 16 divide p? True Let u = -305 - -313. Suppose 64 = -6z + uz. Does 16 divide z? True Let z(s) = -723s3 - 52s*2 - 53s + 1. Is 29 a factor of z(-1)? True Let m be 4/18 + 129/27. Suppose -2n + 7n = -3g + 17, 15 = 5g - mn. Is (-105)/(-4) + 3/g a multiple of 27? True Suppose 7g = 3614 + 36657. Is 92 a factor of g? False Let j(n) be the second derivative of 5n3/6 - 24n*2 + 37n. Let z be j(10). Suppose -i - z = 0, -w + 2i + 94 = 2w. Is w a multiple of 5? True Suppose 5t = -43 - 82. Let w = -25 - t. Is 8 a factor of 0 - w - (1 - 9)? True Let u be -4 + ((-9)/3 - -2 - 1). Is (-391)/(-6) - u/(-36) a multiple of 13? True Let l(q) = -2q - 11 - 5 + q - 5. Let m be l(18). Is 20 a factor of (m + -1)/(2/(-10))? True Suppose 101y - 117y + 32 = 0. Suppose -yf + 34 = -5m + 134, 40 = 2m - f. Is 20 a factor of m? True Does 29 divide 1696 + 0 + -127/21? False Let m(z) = -26z2 + 15z*2 + 10z*2 - z. Let d be m(-1). Suppose -4v = -dv - 144. Does 6 divide v? True Let a(v) = 3v*3 - 30v*2 + 25v - 30. Let s(c) = 2c3 - 16c*2 + 13c - 14. Let z(n) = 3a(n) - 5s(n). Does 23 divide z(-12)? False Let w be ((-8)/(-12))/(3 - (-15520)/(-5172)). Is 30 a factor of 9/(-12)(-18 + w)? True Let i(m) = -m2 - 25m - 43. Let a be i(-23). Suppose -13c + 10c = -aq - 375, 0 = q - 5. Is c a multiple of 22? False Suppose 30 + 54 = -4x. Let j = x + -37. Let k = j - -89. Is k a multiple of 24? False Suppose -11y + 7y = -z - 53185, 5y + 5z - 66500 = 0. Is 8 a factor of y? False Let z(h) = -9186h + 2769. Does 8 divide z(-3)? False Let h = 6716 + -6577. Does 3 divide h? False Let m = 2825 - 2213. Does 12 divide m? True Is (1 - -10347) + (-85)/(-5) a multiple of 157? False Let f be ((-27)/(-12) + -2)/((-2)/(-808)). Let v = f + 89. Is v a multiple of 35? False Let l be 20/70 - (-60)/(-14). Let v be (2 + -3)(5 + l). Does 3 divide (2v)/(18/(-153))? False Let i = -7057 + 27945. Is i a multiple of 56? True Suppose 5w + 165 = y, 3y - 3w + 137 - 620 = 0. Suppose -4b + 156 = -y. Suppose 0 = 74a - ba + 785. Is a a multiple of 10? False Let n be 125 + 0/(-34/6). Let x = n - 86. Is 13 a factor of x? True Let p(y) = y*2 + 2y - 26. Let g = -46 + 54. Suppose 7c = 2n + 3c + 46, 2c - g = 0. Does 13 divide p(n)? True Suppose -6n = -227 - 13. Is 14 a factor of 4/2 - (n17)/(-5)? False Let x = -8198 - -8553. Is x a multiple of 5? True Let p = 281 + -198. Suppose 4t - 3t + 2 = -o, o - 2t = 10. Suppose -3y + 195 = 2f, -p - 47 = -oy - f. Is 21 a factor of y? False Let p = -28073 - -29178. Does 13 divide p? True Let l(n) = 68n - 1031. Does 5 divide l(27)? True Suppose d + 5 = 0, -5f + 15d + 45380 = 11d. Is f a multiple of 4? True Suppose 4i = -m - 75, -3i = 2i + 2m + 90. Let u = 804 - 802. Is (u + 8/(-3))9i a multiple of 12? True Suppose -k - 5c = -544, -15 = 4c + 5. Suppose 12v - k = 1303. Is 12 a factor of v? True Let i = -161 + 225. Suppose -2c + 156 + i = 0. Is c a multiple of 9? False Let b = -7066 + 12168. Does 10 divide b? False Suppose -d - 4 = -3s, -2d + 9 = -2s + d. Suppose 0o + a + 416 = 5o, sa - 246 = -3o. Is 6 a factor of o? False Is 14 a factor of 48930/20(272/6)/17? True Let j = -6 - -8. Suppose jy - 90 = -4o, 61 + 19 = 3y - 5o. Is 2 a factor of y? False Suppose 1445055 = 399h - 3941046. Is 8 a factor of h? False Suppose -3j = 12, -4r = 4j - 126283 + 13983. Is r a multiple of 43? True Let s = -16726 + 38221. Is s a multiple of 8? False Suppose 3c = 5k + 5405, -2c - 719 - 4711 = 5k. Let z = k - -1778. Suppose -l - b = l - z, 0 = 4l - 3b - 1398. Is l a multiple of 32? False Let n be (7 + (2 - 8))*(-346)/(-2). Let q = -81 - n. Let h =	{ "pile_set_name": "DM Mathematics" }
59/(-58795)? 50 ((-62)/(-5859)-21)/(-4(-4)/(-32)) 4/9 Evaluate (54/(-4068))/(189/(-42))-12. -2/339 Calculate ((33/77)/(115/18515))/3. 23 ((-375)/(-350))/(-6(-3)/252) 15 What is -4(4(-10)/((-240)/(-261)))/(-6)? -29 Evaluate (1/63714)/((2/210)/((-121)/(-363))). 10/13 Evaluate (-110)/6050/(-275)(-10)/1. -10/3 What is (-4)/(24/(-5))((-41070)/26825)/(-74)? 1/58 Calculate (-63)/(-14)(-34)/(-4284). 1/28 Evaluate -3(-2)/(-6)(-4016)/9036. 4/9 What is the value of (-48)/(-75)6845/208088? 2/95 Calculate (-2)/((4956/210)/59). -5 Evaluate -2705/(-275)-11. -54 (-2)/6(-12)/(-10)12(-210)/(-15624) -2/31 ((-4)/(-44)11)/(35/2030) 58 What is (12472/28062)/(2/279)? 62 What is (5/83452/(-5178))/((-585)/24)? 2/117 Evaluate (-12880)/(-1400)(-130)/(-416). 23/8 3/((2/(-230))/((-1042)/(-7815))2/(-3)) 69 What is the value of (3/(-10))/(59616/(-2880))32? 2/23 (-10)/(-1)(-378)/(-6804) 5/9 5/(-50)0(-113)/339 0 What is (1/3)/(5(-2)/180)10/(-26)? 30/13 What is the value of (1/(-1))/(((-225)/27)/5)(-1155)/(-11)? 63 (1188/(-8))/9(-350)/(-1365)-13 55 What is -42((12285/486)/91)/((-20)/84)? 49 Calculate (295/(-236))/(170/32). -4/17 Evaluate (-23)/(52003/(-76))-7(450/(-12))/(-15). -10/17 (61/((-12932)/106))/(1/34) -17 ((-8)/(96/(-95)))/(-50(-90)/2400) 38/9 What is the value of 8/12804033/140/15? 22 Evaluate -48/(-80)180/((-32)/(-16)). 36 What is (-65)/11748/144? -5/27 Calculate (-1(-5)/69)/((-12170)/(-29208)). 4/23 Calculate (480/(-600))/(((-1)/5)/((-9)/27)-1). 4/3 14/(-4)(-1760)/(-20)(-21)/84 77 9/(-4)((-11544)/468)/((-3)/6) -111 What is the value of 1(9/(-3))/(-3)87/2523? 1/29 (1/((-987)/(-18)))/(2031/(-4739)) -2/47 Calculate ((-2009)/(-14))/41-1(-216)/28. 27 What is 1266/59628618/2(-1)/3? -1/157 Calculate 81/12(-12)/(-594)(-36)/27. -2/11 1/8-6((-1475520)/(-261))/(-80) 53 ((-2)/(-6))/(152/24624) 54 What is (-1044)/(-87)1/(20/(-830))(-5)/30? 83 What is the value of 65/(-26)(320/100)/((-190)/133)? 28/5 4/((-16)/(-42))(-288)/(-1056)(-22)/18 -7/2 Evaluate 8470/(-1815)(-984)/(-56). -82 What is ((-4)/10)/(17/((-54145)/(-98)))? -13 What is the value of 132/1(-54)/(-1188)? 6 What is the value of (-252)/24(3942/(-84))/(-73)? -27/4 What is (217/12799528-219)/(26/(-16))? 1/202 What is 4(-151(-45)/750)/((-6)/(-85))? 51 What is ((662/2317)/(5/(-1435)))/1? -82 What is ((-1392)/384)/(2/(-8))52/(-13)? -58 What is (-13)/(((-136136)/6512)/(-119))? -74 Evaluate 10/5425/(-34). -25 What is the value of -22(-9)/(594/(-77))5/(-175)? 2/15 What is the value of ((-222)/(-592))/(7/2248)? 3/2 Evaluate ((225/1320)/15)/(792/(-4224)). -2/33 ((-1677753)/(-44385))/((-6)/(-10)) 63 What is 57/(-209)(626/313)/(3/5)? -10/11 ((-19032)/780)/(-122)-2951 -59 112((-4)/308)/(113/(-2486)) 32 What is ((-1)/184)/((81576/(-1408))/309)? 2/69 (5688/474)/(26)4/(-14) -2/7 (-8)/41265/(-55) 46 Evaluate (27400/(-98640))/(3/(84/10)). -7/9 13/(52/24)20330/28710 14/11 (-4550)/(-40)(-6762)/(-102557) 15/2 What is the value of (((-318)/20)/((-453)/1208))/(25/((-2125)/34))? -106 Calculate (68/(-1190))/((-28)/10)-3. -3/49 1764(-869)/(-35392) 11 (-33)/((-3960)/48)14/410 14 What is the value of 2/(-177)13179/(-8786)? 1/59 What is ((28/(181300/(-105)))/(3/(-10)))/((-24)/(-6))? 1/74 What is (10/6)/(((-2266)/(-22))/2781)? 45 140/(-7230)(-2424)/5656 2/241 Evaluate ((-123)/(-8118)-1617)/(-2(-3)/24). -98 Calculate 82(-1)/(-3)1008/672. 41 What is (19623/287804)/((-3)/11)? -1/4 What is the value of (-13)/(-26)-29(-8)/4814? 29/3 Evaluate (246160/408)/181148/25. 32/5 What is the value of (26/6)/(11/495-15)? -13 What is 279252/4804383/18? 1/41 What is the value of (18/(-14)(-2737)/4692)/(-62/(-268))? 67/4 Evaluate (2/5)/(2572/6000). 4/3 What is the value of (-7512/(-4350))/((-4)/(-2))? 3/29 (40/(-7))/(((-5)/(-360)40)/((-10)/12)) 60/7 What is the value of (40/1296)/(((-1275)/204)/(-5))? 2/81 Evaluate (-3)/(-4)(48/(-84))/(936/273). -1/8 Evaluate -1611454/(-332)1/12. 46 Calculate (4/(-44))/(((627/110)/19)/((-17)/425)). 2/165 Calculate (166/(245016/(-410)))/(30/81). -3/4 Evaluate -63(-70)/(-2695)-41/(-6). -12/11 ((-688)/(-24))/(7(-41)/861) -86 What is the value of 20/(-1)(-22)/(-5)(-7140)/(-13090)? -48 Evaluate ((-12)/80)/((3016/390)/58). -9/8 What is (-10)/(-4)3280/(-23124)-141? 50 Evaluate 540/(-74466)-71/(-5). -2/197 What is the value of 22/(-15)1151122/1182775? -4/25 Calculate (-3)/22(-336)/980/280. 32 Evaluate (210/3604)/(-4(-91)/7020). 45 4((-5)/100-30)/(24/(-152)) -38 What is (-3)/((-4)/44(-30)/21049/(-7))? 33 What is (4/(-4)(-49)/196)/((-5)/(-740))? 37 (-12)/1037/((-17760)/64) 4/25 What is the value of (185(-2)/2)/(2/(-22(-8)/220))? -74 What is the value of (13/((-1404)/18))/(9/(-918))? 17 (-18)/(-6)(-3)/(-405)-2 -2/45 Calculate ((-135)/(-36))/(70/168)(-10)/(-45). 2 Calculate 1/(3/(-864)6). -48 What is ((-1)/(-26))/(62/34844281)? 1/13 ((-250)/(-2275)-7)/((-6)/429) 55 What is (-4)/(-75)520/8(-171)/(-2)? 57 Evaluate (-40)/1018/(1260/14). -4/5 Evaluate 242937/(-1958)17/(-36). 17 Calculate (112/(-1050)-5)/((-120)/(-36)). 4/25 Evaluate ((-7711)/2804)/((-1419)/12). 1/43 ((-2)/(-6)-1(-20706)/(-6902))/((-1)/23) 23 What is (6(-2)/(-195))/(172(-25041)/(-548938))? 2/255 What is (-1)/(-2)-148/8522035783/1082? -53 What is (6/(-4)39/10424781)/((-1)/(-2))? -1/11 What is the value of ((-7)/((-140)/16))/((-10856)/460)? -2/59 (-216)/(-20)(-6528)/(-1728)((-5)/(-2))/(-1) -102 409/(1862177/1884)29 12 What is the value of 55/60608/4562? 22/9 Calculate (-1)/(-2)200/650((-15730)/20)/(-11). 11 What is ((-6)/(-4)116/(-87))/((-168)/(-252))? -3 Evaluate ((-8)/(-8))/(4/(-5)9/216). -30 What is 45(-8)/9614/28? -15/8 ((16/10)/(-4))/(12(-49)/(-294)) -1/5 1008/(-2688)8(-14)/483 2/23 Evaluate -2465/(-240)-8. -31 What is the value of 1575/(-2100)(-55)/22(-8)/(-5)? 3 (-164)/(-2337)(4/(-16))/(3/36) -4/19 Evaluate 33/15(-592110)/(-15147). 86 What is the value of 11/(-462)898/(-112)4-1? -2/3 Calculate (-15)/48(-9)/(-495)22. -1/8 What is the value of (40/6)/((14/(-120))/(119/1904))? -25/7 What is 8/6(-21)/(-8)13632/174944? 3/11 ((-58)/(-116))/(((-630)/2664)/(-35)) 74 Evaluate 1/(8/6)348/((-430128)/(-2266)). 11/8 What is the value of (147726/615525)/((-666)/(-50))? 2/111 What is the value of 8/(-740)((-60)/(-84))/(117/(-273))? 2/111 -31330/2793(-42)/(-75) -4/5 Calculate 250/(-5400)-8110/(-3)12/(-10). 15 What is the value of 5764/12969(-252)/((-4)/(-1))? -28 Evaluate 21552/8082(-3)/(-6)-9. -12 Evaluate (-1)/(-35)124540/(-43589). -4/49 What is the value of (766/18767)/(-120/28)? -2/35 Evaluate ((-20569)/1535)/((-9)/(-45)). -67 What is the value of ((-28)/10)/(862/6465)? -21 Evaluate -24(-4)/1987/(28/(-15)). -20/11 What is (18/(-3))/((6/8)/(1178/(-248)))? 38 21106/(12190/(-69)) -63/5 Evaluate 49/609((-51)/(357/14))/(14/(-2)). 2/87 Calculate (-178)/((-1168)/1898(-65)/10). -89/2 ((-17)/255-25)/((-8)/40-5) 5/3 28/(-96)3(-160)/560 1/4 What is (((-4)/(-714))/(401/(-5614)))/(((-8)/6)/(-2))? -2/17 Calculate 76/(-19)360/560(-7)/(-60). -3/10 Evaluate -55(-130)/(-28600)252. -63 Calculate (28/126)/((-219)/(-1533)). 14/9 What is the value of 156/361(-1)/((-9)/((-27)/(-39)))? 1/3 Evaluate (-1848)/775/10. -12 What is ((-78)/(-351))/((-56)/(-63))-36? -9 What is (77/(-56)2)/(186/(-2976))? 44 Calculate (69/7590-22)/(219/15). -1/73 What is ((-16)/(-28))/((-28)/831/(926590/40))? -122 ((-107460)/(-300888))/((151)/((-4)/(-1))) 2/21 (-4)/24(-576)/2256 2/47 What is (6096/14224)/((-31)/(-7))? 3/31 What is the value of -1(-2)/3(-191)/545496-252? 1/17 What is the value of (((-12)/322)/(153/4488))/(10/30)? -66 What is the value of (35/(-7)14)/((108/12)/9)? -70 What is the value of (0/(-8(-13)/(-104)))/2? 0 Calculate -21140/(-1428)-17. -35 What is the value of (20/(-120))/((-10)/40)(-135)/10? -9 Evaluate 15097/2922(-105)/35. -31/2 What is (((-32)/(-10))/4)/(151/(30200/(-10320)))? -2/129 What is 45474/4823(-14)/(-3)? 44 (25/10)/((-2100)/280)(-9)/6242 1/104 What is the value of ((209/(-19))/297)/(-2(-1)/60)? -10/9 What is the value of (108/(-72))/((-36)/(-768))? -32 Evaluate (2625/700)/((-2)/(-16)). 30 What is the value of (8/(-54))/((80/44)/(48/88))? -2/45 Calculate ((-1044)/24)/(	{ "pile_set_name": "DM Mathematics" }
968567.30438. Let u = d + -6521402751. Let x = 29 + u. Round x to seven dps. -0.0000004 Let z = 34 - 31. Suppose 0q - 321000 = zq. Round q to the nearest ten thousand. -110000 Let a = 646 + -643.824. Round a to one dp. 2.2 Let j = 3364 - 3363.999997669. Round j to seven dps. 0.0000023 Let o be (-5)/(-4)12/3. Suppose -921 = -2t + o. Round t to the nearest one hundred. 500 Let k = 138.271 - -1.129. What is k rounded to the nearest ten? 140 Let y(s) = -s - 13. Let p be y(-13). Suppose -3m + pm - 5j = 80980, 4j = 16. What is m rounded to the nearest 10000? -30000 Let n = 0.0188 + -7.1588. Let d = -4.8 + n. Let i = 12 + d. What is i rounded to 1 decimal place? 0.1 Let s(x) = -51110x + 18. Let c be s(-9). Suppose 5r + 4w + c = 0, -5r - 2w + 0w = 460004. What is r rounded to the nearest ten thousand? -90000 Let y = -23 - -24.44. What is y rounded to one decimal place? 1.4 Let h = -1030 + 441. What is h rounded to the nearest 10? -590 Let c = 6.195 + -1.305. What is c rounded to 1 dp? 4.9 Let g = 11.4621 + -0.0121. Let s = 11.8 - g. What is s rounded to zero dps? 0 Let f = -35.60775 - 0.02225. Let y = f - -3.23. What is y rounded to the nearest integer? -32 Let w = 0.382 + -0.052. Let p = w - -0.09. Let u = p + -0.419924. Round u to 5 dps. 0.00008 Suppose 0 = -2l - 3n + 58439997, 0l = -l + 2n + 29220002. What is l rounded to the nearest 1000000? 29000000 Let z = 2177024.99999985 - 2177022.1. Let f = -2.9 + z. Round f to seven dps. -0.0000002 Let s(k) = -k - 2. Let a be s(-3). Let m be a/(-3) - 2505/(-9). Suppose -54278 = -2w + 2l - m, 4l + 135000 = 5w. What is w rounded to the nearest 10000? 30000 Let g = -12.9 - -137.9. Let z = g - 66. Let m = -58.99871 + z. What is m rounded to four decimal places? 0.0013 Suppose -2l + 2i = 8, -4i = l - 0i + 19. Let n be l/21 - (-6751)/3. Round n to the nearest 100. 2300 Let n = 772 + -771.99999334. What is n rounded to 6 decimal places? 0.000007 Let p(b) = -760b3 - 4b*2 + b + 3. Let a be p(-2). Round a to the nearest one thousand. 6000 Let s = -3439049.7 - -3439066.700063. Let w = 12 - 29. Let m = s + w. What is m rounded to five decimal places? 0.00006 Let y = -601 - -285. Let g = -329.3 - y. What is g rounded to the nearest integer? -13 Let x = -0.04244 + -0.061. What is x rounded to 3 decimal places? -0.103 Let r = -288759.5600315 + 288759. Let u = 0.56 + r. Round u to 6 dps. -0.000032 Let f = 12.4 - 47.3. Round f to the nearest integer. -35 Let c = 3.24 + -1.75. Let p = 0.19 - c. Let b = 1.30000005 + p. What is b rounded to seven decimal places? 0.0000001 Let o = -1.2572984663 - -1.2573. What is o rounded to 7 decimal places? 0.0000015 Let v be (-129 + -1)2506/88. Round v to the nearest ten. -1500 Let c = -0.0257 + 282.0257. Let d = c - 283.71. What is d rounded to one decimal place? -1.7 Let a = 31329 - 31263.067. Let c = 66 - a. What is c rounded to 2 dps? 0.07 Let q = -673 - -732.3. Let y = -57 + q. Let p = -2.304 + y. Round p to 2 decimal places. 0 Let v = 27 + -3. Let i be 2/4 - (-108)/v. Suppose -4n - 563991 = -3w, -5w - 705015 = in - 0n. What is n rounded to the nearest ten thousand? -140000 Let m = -682 + 625.9. Let j = -150 + 210. Let v = j + m. What is v rounded to zero dps? 4 Let k = 177 - 84. Let w = 154 - k. Let a = -61.0118 + w. What is a rounded to three dps? -0.012 Let d = -2817308.2058469 + 200373.2058461. Let q = -2616933 - d. Let l = q - 2. What is l rounded to 7 dps? 0.0000008 Suppose -45603 = 2b + p, -25b + 23b + 2p - 45594 = 0. Round b to the nearest 10000. -20000 Let g = -6430.3679798 + 6429.828. Let y = -0.54 - g. What is y rounded to 6 dps? -0.00002 Suppose 4y + 103018 + 40582 = 0. What is y rounded to the nearest one thousand? -36000 Let a = 113.041 + -113. Round a to two dps. 0.04 Let y = 3.37 - 3.54856. Let k = 0.08138 - y. Let x = k + -0.26. What is x rounded to four decimal places? -0.0001 Let k(g) = g2 + 11g + 5. Suppose 0 = -3i + 2 + 7. Let r = i + 4. Let c be k(r). Round c to the nearest 10. 130 Let n = 67 + -65. Suppose -8q + 3g - 171000006 = -5q, -ng + 57000004 = -q. What is q rounded to the nearest one million? -57000000 Suppose -4f - 4y + 43644 = 0, 8 = 7y - 3y. Let z(h) = 79h*3 - 3h*2 - h + 5. Let n be z(4). Let d = n - f. Round d to the nearest one thousand. -6000 Suppose 1053531607 = 16h - 474628393. What is h rounded to the nearest one million? 96000000 Let j = -10906224 + 19506224. What is j rounded to the nearest 1000000? 9000000 Let t = -2445 - -2618.1. Let a = t - 186. Round a to 0 decimal places. -13 Let m(b) = b*3 - 16b*2 + 24b + 51. Let y be 4 + 15/(-4) + 83/4. Let o be m(y). Round o to the nearest one hundred. 2800 Let h = -52 + -9.8. Let j = 54 + h. What is j rounded to 0 decimal places? -8 Let i = -2942760 + 1949160. What is i rounded to the nearest 10000? -990000 Let n = -480.99422 + 481. What is n rounded to four decimal places? 0.0058 Suppose 0 = 6t - 6118 - 6944. What is t rounded to the nearest one hundred? 2200 Let k = 58651 - 36956. Suppose 0 = -4l + k + 18305. What is l rounded to the nearest 100000? 0 Let k = 1285 - 1285.007738. Let u = 95 - 94.992. Let s = u + k. What is s rounded to 5 decimal places? 0.00026 Let d = -74.75 - -1.45. Let v = -70.114 - -0.114. Let n = d - v. What is n rounded to 0 dps? -3 Let j = -7833312 - 26688. Round j to the nearest 100000. -7900000 Let u = -33650000.00326 - -33649624. Let m = u - -376. Round m to 4 dps. -0.0033 Let x be (0 + (-2)/(32/(-20)))4. Suppose -xl = 2z - 19149996, -4l - 4z + 4363682 = -10956310. Round l to the nearest one hundred thousand. 3800000 Let g = 622.369438 - 619.14765087. Let r = g + -91.22179283. Let o = r - -88. Round o to six dps. -0.000006 Let n = -99476.43441 - -99486.414074501. Let y = 0.979664481 - n. Let t = 9 + y. Round t to 7 decimal places. 0 Let v = 248731.08845 + -249012.08844606. Let f = -281 - v. What is f rounded to six dps? -0.000004 Let m = -54 + 45.6. Let b = -12.1 - m. Let o = b + 3.69966. Round o to four dps. -0.0003 Let t(z) = -732014z - 98. Let n be t(-7). Round n to the nearest one hundred thousand. 5100000 Let v = -0.1337 - -0.08025. What is v rounded to two decimal places? -0.05 Let i = 6127 - -576. Let r be (-2 - (-6)/(-2))i. Let m = -9485 + r. What is m rounded to the nearest ten thousand? -40000 Suppose -12037083 - 71802917 = -16l. What is l rounded to the nearest 100000? 5200000 Let z = 0.62 - 9.22. Let n = z - -7. Let s = n - -1.60035. Round s to 4 decimal places. 0.0004 Let d = -6.6431 + -0.1649. Let t = -6.7 - d. Round t to 2 decimal places. 0.11 Let u = 9348055675.90000461 + -9348055724. Let k = u + 48.1. What is k rounded to seven decimal places? 0.0000046 Let t be 250(488/5 + -12). Round t to the nearest one hundred. 21400 Suppose -1 = -f + 2. Suppose -112 = 4o + fu, -3o - 4u = -u + 87. What is o rounded to the nearest 10? -30 Let z = 7 + -4. Let y be 214/(-36) + 24/(-108). Let r be (-30000)/((z/890)/y). What is r rounded to the nearest 1000000? 9000000 Let d = 3.6199 + 0.0301. What is d rounded to the nearest ten? 0 Suppose -6a - a = 0. Let h(z) = z2 - z - 183000. Let c be h(a). What is c rounded to the nearest 10000? -180000 Let y = -326 + 325.999999926. What is y rounded to 7 decimal places? -0.0000001 Let n = 1928081367 + -1928081586.9999863. Let y = 219.9095 + 0.0905. Let s = y + n. Round s to 6 dps. 0.000014 Let v = -36 - -35.994. Let p = -0.0059914 - v. What is p rounded to 6 dps? 0.000009 Let b(c) = c + 6. Let i = -29 + 23. Let l be b(i). Let s be 11300001 + (3 - l) + -4. What is s rounded to the nearest 1000000? 11000000 Let f(y) = 532077y + 3. Let g be (-1 + -1)(-1 - 0). Let b be f(g). Let s = -264157 + b. Round s to the nearest one million. 1000000 Suppose 0 = 14c - 24c + 9060. Round c to the nearest 10. 910 Let s = 741.99996392 + -742. Round s to six decimal places. -0.000036 Let h = -1920.00008645 + 1920. What is h rounded to 6 decimal places? -0.000086 Suppose -60 = 3s - s - 5y, 4s + 104 = 2y. Let f = 18 - s. What is f rounded to the nearest ten? 40 Let v(c) be the second derivative of 610c4/3 - c3/2 + 15c2/2 - 22c. Let h be v(5). What is h rounded to the nearest ten thousand? 60000 Let x = -236.5 - -261. What is x rounded to the nearest integer	{ "pile_set_name": "DM Mathematics" }
-3q + 2q + o = -5l. List the prime factors of q. 2, 3, 31 Suppose v + 3z = 62, -v + z + 50 = -0v. Suppose 534 = 2a - 2m, -4m - v = -a + 199. Let f = a + -158. List the prime factors of f. 2, 3, 19 Let t be (-89)/(-1(-1)/(-2)). Let m(q) = 34q + 1051. Let w be m(-34). Let j = t + w. What are the prime factors of j? 73 Suppose 244i = 238i + 65064. What are the prime factors of i? 2, 2711 Let x(n) = 5n + 426. Let h be x(0). What are the prime factors of h - (9 - 49/12)? 2, 3, 5, 7 Suppose 45x - 7x = 271738. List the prime factors of x. 7151 Suppose 2q = 3p + 15558 - 675, -12 = 4p. What are the prime factors of q? 3, 37, 67 Let g(j) = -136j + 64. Let o be g(-7). Suppose 4h - 31 = -3. Suppose o = b + hb. What are the prime factors of b? 127 Let k be 387/27 - 4/(-6). Suppose 0x = -4x. Suppose -2o - 2o + 5a + 67 = x, k = -5a. List the prime factors of o. 13 Let d = -22893 + 33057. What are the prime factors of d? 2, 3, 7, 11 Suppose 16n - 20n = -1832. What are the prime factors of 2-1n/(-2)? 2, 229 Suppose 22 = 4i - 18. Suppose 0 = -ig - 1049 + 5799. Suppose v + g = 6v. List the prime factors of v. 5, 19 Suppose 86p - 908502 = -108p. What are the prime factors of p? 3, 7, 223 What are the prime factors of 6233/(-5)130/104-4? 23, 271 Let i = -17 - -62. Let j be 58/18 + (-10)/i. Suppose -jz + 294 = -30. List the prime factors of z. 2, 3 Suppose -7545 = -511r + 341r + 1765725. List the prime factors of r. 3, 19, 61 Let a(q) = 3q2 + 83q + 2715. What are the prime factors of a(-71)? 5, 2389 Let s = -35972 - -61540. List the prime factors of s. 2, 17, 47 Let x(v) be the third derivative of v*4 + 3v*3/2 + 26v*2 + 1. What are the prime factors of x(4)? 3, 5, 7 Suppose -5s + 16q - 15q = -12295, 2s - 4918 = -5q. Suppose -4x - s = -6811. What are the prime factors of x? 2, 17 Let s(o) = -8o*3 - 21o*2 - o + 39. Let c(u) = 4u*3 + 10u*2 - 20. Let r(b) = 7c(b) + 3s(b). List the prime factors of r(4). 3, 37 Let p(j) be the first derivative of 20j*3/3 + 3j*2/2 + 2j - 8. What are the prime factors of p(-4)? 2, 5, 31 Suppose 5f - 2o = 49023, f - o = 6355 + 3446. List the prime factors of f. 3, 7, 467 Let v(c) = -52c - 52. Suppose 10y + 111 = -79. List the prime factors of v(y). 2, 3, 13 Suppose -s = -a - 8593 + 1462, -5s - 5a = -35635. What are the prime factors of s? 7129 Suppose -4c + 67628 = -4r, 6r + 36 = 10r. List the prime factors of c. 2, 4229 Suppose 5k - 26107 = 4w, 2w - 10447 = -2k + 5w. List the prime factors of k. 17, 307 Let a(p) = 37p*2 + 30p - 81. Let y be a(8). Let q = y - 1499. What are the prime factors of q? 2, 257 Let t = -3300 - -6794. What are the prime factors of t? 2, 1747 List the prime factors of (1322816/14)/2 + (-18)/42. 7, 17, 397 Let y(i) = 93i2 - 4i - 22. List the prime factors of y(-11). 5, 11, 41 Let v be 0(-2)/4 - -56. Suppose 0 = vd - 35d - 14952. What are the prime factors of d? 2, 89 Suppose -34h + 33h + 2 = 0. Suppose 132 = m - y, -47 = -hm - 2y + 209. What are the prime factors of m? 2, 5, 13 Suppose -4o = -4s + 42388, 0 = 5s - 3o - 47645 - 5358. List the prime factors of s. 2, 5303 Suppose -24320 - 34688 = -64y. What are the prime factors of y? 2, 461 Let f(i) = 79i2 + 364i - 26. What are the prime factors of f(18)? 2, 16061 Let h(y) = 4y2 - 8y + 22. Let q be h(8). What are the prime factors of -38q/(-20) + 4/10? 11, 37 Let q = 7 + -7. Let z be (q + -8)(-6)/12. Suppose 0 = -i + 4y + 3 + 23, 3i = -zy + 14. List the prime factors of i. 2, 5 Let q(v) = v3 - 26v*2 - 90. Let g be q(26). Let x = g - -294. List the prime factors of x. 2, 3, 17 Suppose -405d + 382d + 176157 = 0. What are the prime factors of d? 3, 23, 37 Suppose 2p = -4h - 12, -8 - 8 = 4h. Let z be 23 + 0 - (1 - p). Suppose -z = -2d + 14. List the prime factors of d. 19 Let m(k) = 493k*2 + 135k + 24. What are the prime factors of m(5)? 2, 11, 37 Let h(z) = -4314z - 5401. What are the prime factors of h(-6)? 20483 Let k(v) be the third derivative of v6/120 - 11v*5/30 - 19v*4/12 - 23v*3/6 - 24v*2. What are the prime factors of k(24)? 7, 31 Let h = -36514 - -87068. List the prime factors of h. 2, 7, 23, 157 Let q(d) = -1138d + 1017. List the prime factors of q(-31). 5, 7, 17, 61 Suppose 0 = -5d - 2h + 26, -3d + 4h - 8 = -2d. Let a be 5 - (-23d)/4. What are the prime factors of 6/(-21) + (-8)/a-561? 2, 5 Let a(w) = -13w3 - w2 + 4w + 6. Let q be a(5). Let j = -1145 - q. Let r = -281 + j. What are the prime factors of r? 2, 3, 11 Let m = 25 + -24. List the prime factors of -9m2603/(-57). 3, 137 Suppose 85 = -161s + 144s. Let h(m) = 0 - 1 + 3m + m + m*2. What are the prime factors of h(s)? 2 Let n be ((-4)/(-30))/(39/585). Let v be -71(-20)/14. List the prime factors of 148 + 0(v/4 - n). 2, 37 Let a(j) = j3 - j2 - j - 1. Let s be a(2). Let v = s + -3. List the prime factors of (-1712)/(-24) - v/3. 2, 3 Let p be 1172(-6)/(-8). Let g = -24 + 27. Suppose -2o + o = -gx - 21, -5o + 3x = -p. What are the prime factors of o? 3 Let j = -1146 + -989. Let v = -881 - j. List the prime factors of v. 2, 3, 11, 19 Let u be (-2 + -1 + 6)/((-30)/(-75830)). Suppose u = -4k - 8037. List the prime factors of (-1)/31 - k/33. 2, 59 Let u(i) = -5i3 + 79 + 240i + 4i3 - 216i + 21i2. List the prime factors of u(22). 3, 41 Suppose -26487 = -29t + 2484. What are the prime factors of t? 3, 37 Suppose 0 = -19y + 17y - 4. Let v(x) = -5x2 - 5x - 7. Let a be v(y). Let r(b) = -12b - 20. List the prime factors of r(a). 2, 23 Suppose 4v - 5y + 46 + 159 = 0, -15 = 5y. List the prime factors of -1 - (v + 5 + -3). 2, 13 Let k be 42 + 0 + 0 + (9 - 6). Let j = -45 + k. Let b(h) = -h3 + h2 + 136. List the prime factors of b(j). 2, 17 Let y = 5079 + 7249. What are the prime factors of y? 2, 23, 67 Suppose -5p - 5k + 0k + 45 = 0, 12 = 4p - 2k. Suppose -15o = -20o + p. Let a(u) = 89u*3 - 2u*2 - u + 1. What are the prime factors of a(o)? 3, 29 Suppose 2i = 4, 2368 + 185 = 5s + 4i. Let x = 1081 - s. What are the prime factors of x? 2, 11, 13 Let i(c) = 3c2 - 20c - 645. List the prime factors of i(-57). 2, 3, 569 Let i(t) = 2t3 + 2t*2 + t + 1. Let g be i(-3). Let f = g - -42. Suppose 2y + 4z = 7y - 245, 0 = -fy + 2z + 196. List the prime factors of y. 7 Let f(d) = -d + 30. Let l be f(24). Let k be (-3 - -2) + (3 - l) + 8. Suppose 0t - kt = -2h + 226, -5h = -t - 610. List the prime factors of h. 3, 41 Let v = 590 - 587. Suppose -vg + 1224 = 4o - 2380, 3o - 2724 = 3g. List the prime factors of o. 2, 113 Let t(v) = 9v2 - 2v + 15. Let k(d) = 8d + 116. Let g be k(-15). List the prime factors of t(g). 167 Let d(o) = 134o*2 - 7o - 2. Let b be d(-1). Let h = 30 + b. List the prime factors of h. 13 Suppose 141 = t + 7p - 5p, -5t + p + 749 = 0. Suppose r - 2n = 2n + 87, -2r + 4n = -158. Let z = t - r. List the prime factors of z. 2, 3, 13 Suppose -714t + 61926378 = 20764278. List the prime factors of t. 2, 5, 1153 What are the prime factors of (0 - (0 - 82474/4))(-3880)/(-6790)? 2, 43, 137 Let j(b) = 14b - 78. Let d be j(7). Let z = d + 18. What are the prime factors of z? 2, 19 Let d be ((-1140)/8)/15-406. Suppose 5f - 1123 = d. What are the prime factors of f? 2, 3, 83 Let l(j) = -5j2 - j + 1. Let c(h) = -6h*2 - h + 1. Let b(p) = 4c(p) - 5l(p). Let z be b(0). List the prime factors of (z/(-1))/(-1 - -2) - -16. 17 Let k = 253 - 150. Let m(g) = -70g*2 + g + 1. Let c be m(-1). Let r = k + c. List the prime factors of r. 3, 11 Let k(a) = 102a - 53. Let i be k(-8). Let f = -97 - i. What are the prime factors of f? 2, 193 Suppose 67r = 66r + 8. Suppose rm - 310 = -46. List the prime factors of m. 3, 11 Let t(g) = 12g - 6. Let f = 3 + 1. Suppose 52 - f = 8n. What are the prime factors of t(n)? 2, 3, 11 Let c(r) be the second derivative of -r5/20 - 31r*4/12 + 13r*3/3 + 22r*2 - 4r - 29. List the prime factors of c(-32). 2, 59 Let f be 5/((-90)/4) - (-72226)/126. Let d be 24/(-4) + 4 + f - 2. Let i = d - 404. List the prime factors of i. 3, 5, 11 Let j(s) = 53s2 - 3. Let n(f) = f3 - 9f*2 - 10f + 3. Let z be n(10). What are the prime factors of j(z)? 2	{ "pile_set_name": "DM Mathematics" }
2 - -1. Sort m, v, c in decreasing order. c, m, v Let y = 28.56 + -28. Let n be (-3)/((-59)/236 - (-4 + (-12)/(-4))). Put 0.5, 3/5, n, y in increasing order. n, 0.5, y, 3/5 Suppose -2 + 5 = -3g. Let b = 5.001 - 4.001. Put b, -1/3, -1.1, g in descending order. b, -1/3, g, -1.1 Let q = 5/7533 - 23399/1205280. Put q, -1, 2, 1/5, -2 in increasing order. -2, -1, q, 1/5, 2 Suppose l = -4l + 10. Let d(n) = -2n2 + 61n + 314. Let y be d(35). Sort y, -3, l, 0 in ascending order. -3, y, 0, l Let j(n) = 204n + 5727. Let p be j(-28). Put -2.7, -2/7, p in decreasing order. p, -2/7, -2.7 Suppose -20 = f - 5v, -2f - 4v = -3f - 18. Let g be -65/f + -1. Put -1, 3, g, -4 in decreasing order. 3, g, -1, -4 Suppose -4j + 0v + 26 = -5v, -5v - 10 = 0. Let z be (-22)/j - 4/(-3 + 2). Sort z, 2, -0.04, 0.5 in descending order. 2, 0.5, -0.04, z Let r be ((-272)/(-20))/(3/90). Let l = 412 - r. Sort 1, 13, l, -3. -3, 1, l, 13 Suppose -x + 4b = 22, -4b - 2 = x + 12. Suppose -t + 4v + 16 = 3t, -4v = -t + 16. Sort -3, 1, x, t in ascending order. x, -3, t, 1 Suppose -159 = 3w - 6w. Suppose c + 62 - w = 0. Let o be ((-5)/(-3))/((-3)/9). Sort c, 2, o. c, o, 2 Suppose 0 = -v - 0v + a + 2, -5a = -4v + 7. Suppose 3y = -v, -3d + 5y - 8 = 5. Put -5, d, -2 in descending order. -2, -5, d Suppose -4r - 2 = 14. Let z = -3 - r. Suppose -77j + 75j + x + 30 = 0, 4x + 30 = 2j. Put z, 0.1, 2, j in descending order. j, 2, z, 0.1 Let i = -2105 - -2127.13. Let s = i - -0.87. Let d = -19 + s. Sort d, -1.1, 5 in descending order. 5, d, -1.1 Suppose 0 = 59m - 51m - 200. Sort m, -4, 0, -3 in descending order. m, 0, -3, -4 Let h be ((-36)/16)/(-9)(32/14)/((-17)/(-119)). Let d(m) be the first derivative of m3/3 - 3m*2/2 - m - 1. Let w be d(2). Put w, 12, h in increasing order. w, h, 12 Suppose -2s + 5s = 0. Let f(o) = o3 - 3o*2 - 11o - 1. Let x be 86/18 + 40/180. Let h be f(x). Put -5, 5, h, s in ascending order. h, -5, s, 5 Let i be -6 - (2/(-4) - 15/6). Let b be (-4 - i)/(3/(-6)). Let r be 15/51 + 1. Put b, r, -4 in increasing order. -4, b, r Let i = -125.9 + 92. Let v = i + 34. Let k = 0.8 + -1. Sort v, k, -5/2. -5/2, k, v Let l = 70/3 - 212/9. Let k be 6498/(-684) - (-10 - 1). Put 11, l, k, -0.1 in descending order. 11, k, -0.1, l Let g = -173 - -175. Let c = 64.09 - 63. Let z = -0.09 + c. Sort -0.04, z, g. -0.04, z, g Suppose -16n + 1160 = 13n. Let i be (-1)/(-6)n/50. Let m be (-2)/(-44)16/4. Sort 0.4, m, i in ascending order. i, m, 0.4 Suppose 0 = -m + 303 + 689. Suppose 0 = 4k + 3b - 5b + m, 5k - b + 1234 = 0. Let d be (-3 - k/78) + (-10)/(-104). Put d, -4/11, 0.2 in ascending order. -4/11, 0.2, d Let j = -12846 - -12947. Sort j, 6, 5, 0.1 in descending order. j, 6, 5, 0.1 Suppose -f + 866 = 3n + 227, 0 = 5n + 4f - 1072. Let x = n + -217. Put -13, x, -3 in decreasing order. -3, x, -13 Let r = -0.01005 + 1.01005. Sort r, -1/2, 280, -2 in decreasing order. 280, r, -1/2, -2 Let z(u) = -3u2 - 65u - 42. Let g be z(-21). Suppose -7i = -14i - 21. Put g, i, 26 in ascending order. i, g, 26 Let i(s) = -14s2 + 1443s - 99. Let g be i(103). Sort g, 5708, 1 in increasing order. 1, g, 5708 Let h = -1215 - -1304. Put 0, -3, h, -5 in decreasing order. h, 0, -3, -5 Suppose -5o + 11 = 4q, q + q + 14 = 4o. Suppose 2a + 114 = 3p, 3a = -0a - 9. Suppose pu + 74 = -u. Sort 0, o, u, 4 in increasing order. u, 0, o, 4 Let v = 1.28 + -0.28. Suppose -15j + 112 = -19j. Let m be j/(-70) - (-33)/(-20). Sort m, -3, v. -3, m, v Let k = -40051 + 40053. Let x = 0.25 - -0.05. Sort x, -19/2, -3, k in decreasing order. k, x, -3, -19/2 Let n = -592.1 + 643. Let m = 52.9 - n. Sort m, 3, -39, -1/4 in decreasing order. 3, m, -1/4, -39 Let b = -6267 + 6323. Put 3/4, 0, b in decreasing order. b, 3/4, 0 Let y = 0.03 - -177.97. Let i = y - 176.2. Let r = -157/1128 - -2/141. Put r, -2/13, i in descending order. i, r, -2/13 Let f be 6/9 + (-694)/(-3). Suppose -4l = 2s - 0s - f, 0 = -3l + 6. Let n be (-1)/(-2)64/s. Sort -2/7, 0.2, n in decreasing order. n, 0.2, -2/7 Let q be (-11 - (2 + 1))(-1)/(-2). Let k(t) = -5t - 35. Let c be k(q). Sort c, 2, -14 in descending order. 2, c, -14 Let d be -14 + (-846)/(-45) + -5. Sort -16, d, 12 in decreasing order. 12, d, -16 Let h be (-2)/(-5) + (-13)/(-5). Let y(b) = -b2 - 9b - 10. Let g be y(-8). Let j = -2175 - -2179. Sort 0, h, g, j in decreasing order. j, h, 0, g Let n be ((-193)/(-965))/((-4)/(-12) - 2/60). Sort -4, n, 0.03, 2/7 in descending order. n, 2/7, 0.03, -4 Let n = -1188 - -1190. Suppose -a - 1 = -0a. Sort -4, 5, n, a. -4, a, n, 5 Let i(o) = 6o + 30. Let a be i(-5). Suppose -5k + 10k - 25 = a. Suppose 5m + 6 = -kj - 4, 0 = 2j - 6. Sort 3, 0, m, 1 in increasing order. m, 0, 1, 3 Let y(j) = j3 - 4j + 10j + 0 + 5 + j - 8j*2. Let z be y(7). Let a be (9/135)/((-1)/(-15)). Put 3, z, a in descending order. z, 3, a Let a = 1.2 + -1. Let v = -26 + 24.9. Let c = 0.0217 - 1.0217. Sort v, c, a. v, c, a Suppose 0 = -4u + 2v + 32, 3u - 3v = 11 + 22. Put 24, -10, u, 4 in increasing order. -10, 4, u, 24 Let y = 27 + -26.7. Suppose 80 + 117 = -m - 5q, -m + q - 209 = 0. Let b = -1038/5 - m. Put -2/5, b, y in decreasing order. y, -2/5, b Let t be 232/(-72) + (-304)/171 + (-1 - -3). Put t, -5, -296 in ascending order. -296, -5, t Let k(x) = x*2 - 40x + 38. Let a be k(39). Let f(h) = 50h + 48. Let l be f(a). Put -0.14, l, -4/5 in decreasing order. -0.14, -4/5, l Let p(r) = 26r - 312. Let b be p(12). Sort -5, -80, 2, b. -80, -5, b, 2 Let l(a) = a - 53. Suppose -2n - 32 = 12. Let q be l(n). Let x = q - -82. Sort 3, -2, x, -4 in decreasing order. x, 3, -2, -4 Suppose 71 + 848 = -278x - 471. Let i = 3 + 8. Put -3, x, i in descending order. i, -3, x Let p = -22.51 - -22.21. Sort p, -2/13, 136 in increasing order. p, -2/13, 136 Let g = -1153 - -1064. Sort 5, 1, g, -4 in decreasing order. 5, 1, -4, g Let r = -135 - -140. Let f = 44 - 51. Sort r, f, 0, -2/3. f, -2/3, 0, r Let v be (-1 - 2)(-1 + 0). Suppose 332u = 333u - 8, -5b = 5u - 45. Suppose 0 = 4m - 0m + 5x + 9, -4 = 4x. Sort v, m, b. m, b, v Let c be (10 - (-57)/(-6))(-2)/((-3)/(-3)). Put c, -4, 68, 3 in increasing order. -4, c, 3, 68 Suppose -639y + 9372 = -285y - 321y. Put -1, 4, 3, y in increasing order. -1, 3, 4, y Let b = 497.13 + -495. Let g = -10.77 - b. Sort g, 4, -5. g, -5, 4 Let u = -6204 - -6209. Sort 2, -81, u in ascending order. -81, 2, u Let p = -1.46 - -4.12. Let h = 2.36 - p. Let a = 4 + -3. Put -0.8, a, h, -4 in decreasing order. a, h, -0.8, -4 Let o = 20 + -5. Let s = o - 14.7. Let v = -1084 + 1088. Put 0.5, v, s, 3 in decreasing order. v, 3, 0.5, s Let d be 110/(8 + -19) - -8. Sort d, -9, 31, 5. -9, d, 5, 31 Let o = 3.02 - 0.02. Let v = -78869/13 + 6067. Sort v, o, 4, 0.1 in descending order. 4, o, v, 0.1 Let t be 11/12 + 3/(-12). Let i be 15/30 + 2/(-6). Let d = 5.073 - 13.073. Put t, d, i in descending order. t, i, d Suppose 0 = 5g - 3t + 5, 3g + 5t = 7t - 3. Let s be (-8 - -2 - -7)(4 - g). Put -2, 1/8, 2/5, s in increasing order. -2, 1/8, 2/5, s Let u = 262.9 - 262.9. Sort -0.4, 0.1, 4/3, u in increasing order. -0.4, u, 0.1, 4/3 Let r = 7020/19 + -63218/171. Put -0.46, -4, 2/5, r, 1/6 in decreasing order. 2/5, 1/6, r, -0.46, -4 Let m = -3.16 + 4.7. Let p = m - -1.46. Let q = -39 + 38.6. Put 0.3, q, p in descending order. p, 0.3, q Let y be 2/(-10)(-1 - 2). Let r = -2039 - -3056. Let h = r - 1016. Sort y, -4, -1, h. -4, -1, y, h Let j = -194 + 190. Let r = 225 + -261. Put j, r, -0.5 in descending order. -0.5, j, r Let z = 0.02 - 0.92. Let h be 2/14 - (-30)/(-14) - 1615/(-969). Let g = -127/3 - -41. Put -4, g, z, h in ascending order. -4, g, z, h Let w = 3.7 + -2.1. Let j = w - 0.56. Let f = -0.74 + j. Sort f, 1, 6, -1 in descending order. 6, 1, f, -1 Let j(t) = -t - 14. Let o be j(8). Suppose 0 = b + b - i + 8, 5i - 19 = 3b. Let p = -2 - -2. Put p, b, o in ascending order. o, b, p Let r be -18 - (31 + -12 + -36). Put -2, 17, -4, 1, r in decreasing order. 17, 1, r, -2, -4 Let g = -924 + 747. Let u = g - -155. Let b = -1 - -1. Sort 1/4, -5, b, u. u, -5, b, 1/4 Let k = -476 + 476.04. Let v = -0.09 + 0.25. Let b = v + 0.04. Sort b, k, -2 in decreasing order. b, k, -2 Suppose 58h - 45h = 195. Sort -2, 4, h in	{ "pile_set_name": "DM Mathematics" }
+ 867s - 1170 = 0 for s. -39, -3, 1, 10 Suppose y3/3 + 250076y*2/3 + 250075y/3 = 0. What is y? -250075, -1, 0 Factor 2s2 + 4802s + 156288. 2(s + 33)(s + 2368) Factor -2o3/9 - 2282o*2/9 - 654350o/9 - 647522/3. -2(o + 3)(o + 569)*2/9 Suppose -4i*4 + 2468i*3 + 4984i*2 - 19808i = 0. What is i? -4, 0, 2, 619 Determine a so that -a*5 - 248a*4 - 734a*3 + 248a*2 + 735a = 0. -245, -3, -1, 0, 1 Let 12j3/5 + 50666j*2/5 + 53484296j/5 + 8912642/5 = 0. What is j? -2111, -1/6 Find x, given that -10x3/3 + 8924x*2/3 + 4766x + 1788 = 0. -1, -3/5, 894 Let 4l2/7 - 768704l + 258521304832 = 0. Calculate l. 672616 Solve 5p2 + 9800p + 19580 = 0. -1958, -2 Suppose -t*5/2 + 73t*4/2 + 941t*3/2 - 7701t*2/2 - 60804t - 161352 = 0. Calculate t. -9, -4, 12, 83 Suppose 2b2/17 + 3618b/17 + 64476/17 = 0. What is b? -1791, -18 Let -3c5 - 7515c*4 - 89781c*3 - 82269c*2 = 0. Calculate c. -2493, -11, -1, 0 Solve -3i*2 + 3912i - 364509 = 0. 101, 1203 Suppose -38u3/9 - 23518u*2/9 + 49672u/9 - 552 = 0. Calculate u. -621, 2/19, 2 Factor -3u3/4 + 249999u*2/2 + 1500075u + 4500306. -3(u - 166678)(u + 6)2/4 Factor -h3/7 - 1454h2/7 + 16115h/7. -h(h - 11)(h + 1465)/7 Determine o, given that 4o3 + 12796o*2 + 10252768o + 30643248 = 0. -1598, -3 Factor 3f2 + 4551f. 3f(f + 1517) Factor -19v3/3 + 2626v*2/3 - 30337v + 6348. -(v - 69)*2(19v - 4)/3 Suppose -22t*2 + 1720t - 312 = 0. Calculate t. 2/11, 78 Factor -2i2/3 - 20552i/3 - 6850. -2(i + 1)(i + 10275)/3 Find u, given that u*5 - 18u*4 - 67u*3 + 84u*2 = 0. -4, 0, 1, 21 Suppose 4o*5/9 - 928o*4/9 - 2216o*3/3 - 10496o*2/9 - 4780o/9 = 0. Calculate o. -5, -1, 0, 239 Factor -2q4 - 32q*3 + 446q*2 + 4004q. -2q(q - 13)(q + 7)(q + 22) Factor y*4/6 + 21y*3/2 - 329y*2/3 - 120y. y(y - 10)(y + 1)(y + 72)/6 Determine u so that u4/3 - 304046u*3/9 + 506737u*2/9 - 202694u/9 = 0. 0, 2/3, 1, 101347 Determine p, given that 5p5 + 680p*4 + 30465p*3 + 491490p*2 + 2298780p + 1837080 = 0. -54, -21, -6, -1 Factor -2t3/5 + 171986t*2/5. -2t*2(t - 85993)/5 Solve 4g5/13 - 454g*4/13 + 12742g*3/13 + 9474g*2/13 - 85842g/13 + 38988/13 = 0 for g. -3, 1/2, 2, 57 Find i such that 2i4/5 - 93i*3/5 + 296i*2/5 + 219i/5 - 172/5 = 0. -1, 1/2, 4, 43 Factor -x*3 - 33585x*2 - 282139128x - 2536532496. -(x + 9)(x + 16788)2 Factor -2m*4/21 - 12440m*3/21 - 19269416m*2/21 + 77526080m/7 - 233026944/7. -2(m - 6)2(m + 3116)*2/21 Factor 4w*2 + 4712w + 4708. 4(w + 1)(w + 1177) Find z, given that -z*5 + 449z*4 - 51069z*3 + 150079z*2 - 99458z = 0. 0, 1, 2, 223 Find i such that -2i3 - 1534i*2 - 317822i - 8889474 = 0. -367, -33 What is c in 5c5 + 120c*4 + 570c*3 - 2080c*2 - 2535c = 0? -13, -1, 0, 3 Factor -57b2/2 - 119185b/2 + 2091. -(b + 2091)(57b - 2)/2 Determine w so that 20w4 + 11445w*3 - 148775w*2 + 233835w - 96525 = 0. -585, 3/4, 1, 11 What is k in -3k5 + 4614k*4 + 51126k*3 - 13836k*2 - 162579k - 102234 = 0? -11, -1, 2, 1549 Find p such that p*3 - 727p*2 + 5767p - 10785 = 0. 3, 5, 719 Factor -4w3 - 520w*2 - 6252w - 19656. -4(w + 6)(w + 7)(w + 117) Find k, given that 5k*5 - 267k*4 - 5424k*3 - 26648k*2 - 26256k + 15120 = 0. -9, -6, -2, 2/5, 70 Determine o, given that o*2/6 + 1051o/3 - 701/2 = 0. -2103, 1 Factor -3645810045k2 + 14041560k - 13520. -5(27003k - 52)*2 Solve 18k*4 - 1554k*3 + 7081k*2/2 - 1051k + 84 = 0. 1/6, 2, 84 Find j, given that -j*2 - 18192j - 18191 = 0. -18191, -1 Factor 3t4 + 5448t*3 - 32772t*2 + 43728t. 3t(t - 4)(t - 2)(t + 1822) Factor 5t2 - 1716560t + 147328911680. 5(t - 171656)2 Suppose 42q*4/5 + 537646q*3/5 + 1720908804q*2/5 + 376842240q + 32768000 = 0. Calculate q. -6400, -1, -2/21 Factor -v*2/11 - 3090v/11 + 6184/11. -(v - 2)(v + 3092)/11 Let -98i*5/5 - 6202i*4 + 48908i*3/5 - 20344i*2/5 + 2544i/5 = 0. Calculate i. -318, 0, 2/7, 1 Factor 2i2/5 - 1006i/5 + 15876. 2(i - 405)(i - 98)/5 Find a, given that -2a3/11 + 658a*2/11 - 8188a/11 - 8848/11 = 0. -1, 14, 316 Determine g, given that g*4/2 - 461g*3/2 + 2259g*2 - 1772g - 14432 = 0. -2, 4, 8, 451 Suppose 2g3/5 - 34g*2/5 + 184g/5 - 64 = 0. Calculate g. 4, 5, 8 Factor 5g4 + 200g*3 + 985g*2 - 1190g. 5g(g - 1)(g + 7)(g + 34) Let 2c2/3 - 49276c = 0. What is c? 0, 73914 Solve -5n3 + 345n*2 + 725n - 1065 = 0. -3, 1, 71 Factor 5115975k2/8 + 255795k - 3/2. 3(5k + 2)(341065k - 2)/8 Find z such that 5z5/4 + 105z*4/2 + 380z*3 + 555z*2/2 - 1525z/4 - 330 = 0. -33, -8, -1, 1 Factor -t*5 - 523t*4 - 11143t*3 - 60621t2. -t2(t + 11)2(t + 501) Let -2f4/9 - 32f*3/9 + 98f*2/9 + 968f/9 - 680/3 = 0. Calculate f. -17, -6, 2, 5 Suppose -4i4/7 - 161792i*3/7 - 69336i*2 - 485344i/7 - 161780/7 = 0. What is i? -40445, -1 Determine n, given that 84n5 + 2354n*4/3 + 4250n*3/3 + 240n*2 - 872n/3 - 224/3 = 0. -7, -2, -1/2, -2/7, 4/9 What is t in -5t4 + 1615t*3 - 150815t*2 + 3174465t - 3025260 = 0? 1, 28, 147 Factor 3d2 - 5706d - 298809. 3(d - 1953)(d + 51) Determine z so that -4z5 - 1676z*4 + 6792z*3 + 10136z*2 - 6788z - 8460 = 0. -423, -1, 1, 5 Factor 8a3 + 1052516a*2 + 34618698448a + 17309086096. 4(a + 65782)2(2a + 1) Let 20n*5 + 305n*4 - 3495n*3 - 12115n*2 - 12625n - 4290 = 0. What is n? -22, -1, 39/4 Find m such that 2m2 - 3280m/3 - 6584/3 = 0. -2, 1646/3 Let -5u2 - 88850u - 394716125 = 0. What is u? -8885 Factor -2v2/15 - 4032v/5 - 24184/15. -2(v + 2)(v + 6046)/15 Determine d, given that d*2 + 588d + 47232 = 0. -492, -96 Factor -2u3/7 + 179556u*2/7. -2u*2(u - 89778)/7 Solve -4t2 - 257392t - 4140665104 = 0 for t. -32174 Factor -3x2 + 2380644x. -3x(x - 793548) Factor 5j2 + 41420j - 2209305. 5(j - 53)(j + 8337) Find c, given that -4c4/9 - 1668c*3 - 5000c*2 + 16c/9 + 20000/3 = 0. -3750, -2, 1 Suppose 4n2 - 52028n = 0. Calculate n. 0, 13007 Find u, given that -2u3/7 - 6u*2/7 + 146u/7 + 90 = 0. -7, -5, 9 Factor s*3/4 - 173s*2/4 - 705s/4 - 531/4. (s - 177)(s + 1)(s + 3)/4 Let 3m2/5 - 2418m/5 - 2421/5 = 0. What is m? -1, 807 Factor -3d3 + 213015d*2 + 12d - 852060. -3(d - 71005)(d - 2)(d + 2) Factor 5w*4/7 + 227w*3/7 + 520w*2/7 + 172w/7. w(w + 2)(w + 43)(5w + 2)/7 Let h*2/6 + 290h/3 + 2288/3 = 0. Calculate h. -572, -8 Let v*4/6 + 3799v*3/2 + 22783v*2/6 - 26587v/2 + 22790/3 = 0. Calculate v. -11395, -4, 1 Find k, given that 30k3 - 97018k*2/11 - 393948k/11 - 2384/11 = 0. -4, -1/165, 298 Determine v so that -2v3/5 + 1514v*2/5 - 51982v - 2059530 = 0. -33, 395 Factor -2j2/15 - 38j/15 + 6768. -2(j - 216)(j + 235)/15 Factor 5w2 + 836530w + 34989122045. 5(w + 83653)2 Factor -3m*5/2 + 12681m*4/2 + 38079m*3 + 76182m*2 + 50796m. -3m(m - 4233)(m + 2)3/2 Factor -v3/9 - 1060v*2/9 + 10739v/9 + 13910/3. -(v - 13)(v + 3)(v + 1070)/9 Let 3y3 - 21y*2 - 15924y + 396480 = 0. Calculate y. -80, 28, 59 Determine x, given that x*2 - 7662x + 84161 = 0. 11, 7651 Let 55j5/2 - 281j*4/2 + 249j*3/2 - 19j*2/2 - 2j = 0. What is j? -1/11, 0, 1/5, 1, 4 Solve -5v5 - 180v*4 + 510v*3 + 10900v*2 - 41625v = 0. -37, -9, 0, 5 Factor -4d2 + 15736d - 15732. -4(d - 3933)(d - 1) Factor -4s3 - 70072s*2 - 308207360s - 11610915200. -4(s + 38)(s + 8740)*2 Suppose -4i*5 + 5972i*4 + 11956i*3 + 5980i*2 = 0. What is i? -1, 0, 1495 Factor 4u*2 - 362092u + 362088. 4(u - 90522)(u - 1) Factor -2s3 + 276s*2 - 7654s + 31620. -2(s - 102)(s - 31)(s - 5) Factor -3c*2 + 50676c - 50673. -3(c - 16891)(c - 1) Factor 2l4/11 + 58986l*3/11 - 117980l*2/11. 2l*2(l - 2)(l + 29495)/11 Suppose -f4 - 614f*3 - 114745f*2 - 5898900f = 0. What is f? -265, -84, 0 Factor 4p3/3 - 968p*2/3 + 18860p + 80688. 4(p - 123)2(p + 4)/3 Find n, given that 9n4/8 + 33n*3/8 - 9n*2/2 - 33n/2 = 0. -11/3, -2, 0, 2 Determine l, given that -2l3 - 386l*2 + 35496l = 0. -261, 0, 68 Factor -3i3 + 4710i*2 - 949539i	{ "pile_set_name": "DM Mathematics" }
0003 Suppose 0 = -5r - d + 8, -3r + 5d = 2r - 20. Let j = -8 + 8. Suppose jf = -rf + 1200000. What is f rounded to the nearest 100000? 600000 Let o(y) = -5y - 27. Let w be o(-6). Let l be ((-25994)/2 - w)(-1 - 0). Round l to the nearest one thousand. 13000 Let m = -0.05500033 + 0.055. What is m rounded to seven dps? -0.0000003 Let w be ((-6)/9)/(33/(-42570000)). Round w to the nearest 1000000. 1000000 Let p be (-1748)/(-8) + (-6)/(-4). Let a be (-9)/((-9)/p) - 2. Let s be (a/6 - 3)60. Round s to the nearest ten thousand. 0 Let u = -1.2 + 33.2. Let r = u + -31.999938. Round r to 5 dps. 0.00006 Let o = 150 - 295. Let w = o - -145.00000161. Round w to 7 decimal places. 0.0000016 Let v = -9.2138 - -0.0938. Round v to one dp. -9.1 Suppose -103t + 967070 = -90t. Round t to the nearest ten thousand. 70000 Let c(f) = -124f + 92. Let x be c(18). Round x to the nearest one hundred. -2100 Let f = 5331.99988434 + -5332. What is f rounded to six dps? -0.000116 Let f = -10 - -22. Suppose 30n = 26n - f. Let d be n + 2 + 3700011. What is d rounded to the nearest 100000? 400000 Let n = 4714636.6 + -4714617.600003. Let z = n + -19. What is z rounded to five dps? 0 Let a(k) be the third derivative of 29k4/24 + k3/6 - 10k2. Let c be a(6). Let y be c(20002 - 8/4). Round y to the nearest 1000000. 4000000 Let u be 2/(-3) + 9 + 66205/(-3). Round u to the nearest ten thousand. -20000 Let g be 16/20 + (-3486)/70. Round g to the nearest ten. -50 Let f = 9548 + -5238. What is f rounded to the nearest 1000? 4000 Let b(h) = -2h - 8. Let v be b(-5). Let q be 25454816/(v/(-1)) + 2. Let w = q + 18227406. What is w rounded to the nearest one million? 6000000 Suppose 8h + y = 11h - 12886, 0 = 2h + y - 8594. Round h to the nearest 100. 4300 Let d = -9198.0017164 - -9198. What is d rounded to four decimal places? -0.0017 Let g = -48.000336 + 48. Round g to 4 dps. -0.0003 Let d = -1789 - -1789.000001816. Round d to six decimal places. 0.000002 Let d = 202.9999653 + -203. What is d rounded to five dps? -0.00003 Let l = -308 - -290.3. Let m = l + 17.6999613. What is m rounded to six decimal places? -0.000039 Let r = 0.476 + -0.6. Let v = -13.076 + r. Round v to the nearest integer. -13 Suppose 226y = 221y - 9050. What is y rounded to the nearest one hundred? -1800 Let i = 998 - 1025.48. Round i to the nearest integer. -27 Let z = -650.0219848 + 649.692. Let j = z + 0.33. Round j to six dps. 0.000015 Let v be 1 + -6 + 368525/5. Round v to the nearest 1000. 74000 Let d(j) = 9j2 + 1 + 2 + 13j - 2j3 - 17j. Let y be d(4). Suppose yr + 322896 = -22104. What is r rounded to the nearest ten thousand? -120000 Let q = -1339 - -9. What is q rounded to the nearest one thousand? -1000 Let t be (-4)/6 + (-117)/27. Let k(j) = 139999j*2 - 6j - 5. Let g be k(t). Round g to the nearest one million. 4000000 Let k be (-44)/8 + 2/(-4). Let t be (1 - 9)36/12. Let z be k/(-8) - (-5112018)/t. Round z to the nearest ten thousand. -210000 Let s = 49.84 - -0.16. Let r = s + -49.51. Let f = r - 0.48939. What is f rounded to four dps? 0.0006 Let b = 1151434 + -1151434.2000066. Let t = 0.2 + b. Round t to 6 decimal places. -0.000007 Let q = 3027.99998144 + -3028. What is q rounded to 5 dps? -0.00002 Let p = -12.49 + -40.81. What is p rounded to the nearest 10? -50 Suppose 4s = 2s + 4. Suppose -11u = -u - 3130. Let g be u + (s/2 - 4). What is g rounded to the nearest 100? 300 Let u = -1546268.796479 + 1546270. Let a = -1.203 + u. What is a rounded to 4 dps? 0.0005 Suppose -2n = v - 1, 3 + 9 = -n - 3v. Let p be (-1672)/(14/5 - n). What is p rounded to the nearest one thousand? 8000 Let g be (1 + 1)/(4/6). Suppose gi - 2696545 = 492686. Let d = 6063077 - i. What is d rounded to the nearest 1000000? 5000000 Let l = -0.3 - -0.2. Let b = -0.05 - l. Let u = -0.1 + b. What is u rounded to two dps? -0.05 Let x = -242.39997174 - -242.4. What is x rounded to six decimal places? 0.000028 Let p = -2.1 - -2.44. Let m = p - 59.34. Let w = m - -55.7. Round w to zero dps. -3 Let t = 37447792.20000075 - 37447788. Let l = t - 4.2. Round l to seven dps. 0.0000008 Let b = 92.8 - 75.12. Let r = -2.38 + b. What is r rounded to the nearest integer? 15 Let x be 0 - 10/(-6)3. Suppose l = 2 + x. Let t = -3 + l. What is t rounded to the nearest ten? 0 Suppose -5n = -4v + 103370, 2n + 48586 = -4v + 7266. Round n to the nearest one thousand. -21000 Let s = -481 - -481.000000273. Round s to 7 dps. 0.0000003 Let m = 391337 - 391337.940036. Let h = m - -0.94. Round h to 4 dps. 0 Let r = 177 - 176.94024. Round r to 2 dps. 0.06 Let g = 104.65932 + -6.66562. Let w = g - 98. What is w rounded to three dps? -0.006 Let s = 8.9438 - 9. Round s to 3 decimal places. -0.056 Let v = -10539.48 - -10539.3700114. Let d = -0.11 - v. Round d to five decimal places. -0.00001 Suppose -2o - 2o = -32. Let m be (14781/6)/(4/o). Suppose -m = 4j - 927. Round j to the nearest 1000. -1000 Suppose -5f + 469364 - 75854 = -2c, -5 = c. Round f to the nearest one thousand. 79000 Let r = 156 + -159.66. Let v = r - -4.6. Let s = v + -0.939951. What is s rounded to five decimal places? 0.00005 Let w = -20 + 19.997. Let y = w - -8.203. Let l = 0.8 - y. Round l to the nearest integer. -7 Let b(y) = 11015y - 36013y - 117 + 113. Let j be b(2). Round j to the nearest one hundred thousand. -100000 Let v(c) = c2 + 2c - 1. Let k be v(-3). Let a be (-3)/(-6)k + -621. What is a rounded to the nearest 100? -600 Let q = 179607 - 179615.1219. Let w = q + -8.8764. Let s = w - -17. Round s to four decimal places. 0.0017 Let v = -0.0561 + 0.053932. Round v to four dps. -0.0022 Suppose 0 = 2a - 323106 - 662732. Let u be a - (-3)/(6/4). Let z = u + -302921. What is z rounded to the nearest one hundred thousand? 200000 Let x = 25 - 21. Suppose 512 = 5f + u + 14463, -4u - x = 0. What is f rounded to the nearest one hundred? -2800 Let z = 1575 - 2375. Let a be ((-123)/(-12) + -2)z. Round a to the nearest 1000. -7000 Suppose -5r - r + 12 = 0. Suppose -ra + a = -52200. What is a rounded to the nearest one thousand? 52000 Let g = -0.6 + 10.6. Let d = g - 38. Let a = -27.999996 - d. What is a rounded to 6 decimal places? 0.000004 Let w = -4935000 + 4935000.53681244. Let r = -9.23680304 + w. Let t = r - -8.7. What is t rounded to six decimal places? 0.000009 Let a = 9.74001423 - 9.74. Round a to six dps. 0.000014 Let y = 28.76417 + 3387.90983. Let n = y - 3412.574038. Let m = n + -4.1. Round m to five decimal places. -0.00004 Let w = -0.156 + 481.156. Let q = w - 481.000291. What is q rounded to five decimal places? -0.00029 Let k = 0.467703 - -18.537597. Let t = k + -19. Round t to three dps. 0.005 Suppose 2c + 3c - 5 = 5n, 0 = c + 2n + 2. Suppose x - 2 - 2 = c. Suppose 2p - xp = 22000. What is p rounded to the nearest 10000? -10000 Suppose 2t = 7t. Suppose -w = -tw + 1203. Let p be w/(-6)2 + -1. Round p to the nearest 100. 400 Let l = -292.689 - 0.311. Let j = l + 293.000237. Round j to four dps. 0.0002 Let u = -16.89929 + 16.89. What is u rounded to 3 decimal places? -0.009 Let p be 14/2 - 2/1. Suppose -ps = -5x - 95, 3 - 56 = 2x + s. Round x to the nearest integer. -24 Let v(i) = -271i2 - 11i + 162. Let s be v(16). Round s to the nearest 10000. -70000 Let w = -5484 + 5742.3. Round w to the nearest one hundred. 300 Let n = -0.01 - 0.0111. What is n rounded to 2 dps? -0.02 Let z = -6.76968 + 9.6702. Let c = 0.034 - 2.934. Let k = z + c. Round k to four decimal places. 0.0005 Let h = -1780 + 1779.9999995078. Round h to 7 dps. -0.0000005 Let d = -2.13792 - -0.1308. Let x = -2 - d. Round x to 3 decimal places. 0.007 Let c(n) be the first derivative of -103334n3 + 4n*2 - 6n + 20. Let g be c(3). Round g to the nearest one hundred thousand. -2800000 Let m = 15.26 - 16. Let l = m - -0.743. Round l to three decimal places. 0.003 Let p be ((-10)/3)/((-6)/9). Let o(k) = -171150k - 6. Let y be o(-3). Suppose 0 = pb + 158444 - y. What is b rounded to the nearest 10000? 70000 Suppose 613c + 924 = 616c. Round c to the nearest 10. 310 Let a(f) = -f + 73000. Let p(h) = h*2 + 9h - 7. Let s be p(-10). Suppose -6z = -sz. Let b be a(z). What is b rounded to the nearest 10000? 70000 Let y = 82.748 + 1.352. What is y	{ "pile_set_name": "DM Mathematics" }
(-14)) and g. 180 Let t be ((-4)/(-2))/(-8) - 1431/(-108). Let m = 29 - t. Calculate the lowest common multiple of (-2)/(-12/22) and m. 176 Let m(x) = 2x + 36. Let z be m(-26). What is the lowest common multiple of 9 and 0(-4)/z + 4? 36 Calculate the least common multiple of 10554 and 22/38 - 8(-151)/76. 84432 Let f = -21/389897 - -11733817/7924266628. Find the common denominator of 143/12 and f. 60972 Let b be ((-3)/273)/((-1)/3). Suppose -1 = -2t + b, 2t = 4f - 6. What is the smallest common multiple of 64 and f? 64 Let y = 1554 + -7734/5. Let i = -282573/5 - -282544/5. What is the common denominator of i and y? 5 Suppose 2q - 7 = 2v + 3q, -3q - 9 = 0. Let n(l) = -l3 + 4l + 4. Let p = 23/62 + 1079/434. Find the common denominator of n(v) and p. 7 Suppose -2h = 4, h - 43 = 2l - 5l. Suppose o - 102 = l. Let x = o + -115. Calculate the smallest common multiple of 5 and x. 10 Suppose 0 = 99u - 106u + 4410. Calculate the least common multiple of 630 and u. 630 Let i = 131/30 + 2/15. Let c = -1224308/30155 + 3/6031. Let a = -1649/40 - c. What is the common denominator of a and i? 8 Find the common denominator of -89/8 and (-30)/(-195)-13 + (-2343)/(-1220). 2440 Let j = -17210 + 17738. Calculate the least common multiple of 8 and j. 528 Suppose -x - t + 98 = -6t, -4x + 4t = -360. Let z = 124 - x. Let u = z - 25. What is the lowest common multiple of u and 8? 88 Suppose -28q = -24q - 20. Suppose -ql = 5g - 55, 2g - l + 5 - 18 = 0. What is the least common multiple of 26 and g? 104 What is the common denominator of 7/(-1652)(3/3 + (-25)/(-3)) and -3/8? 1416 Let w(d) = -152d*3 - 2d*2 - 2d. Let k be w(-3). Let o = k - 131027/32. What is the common denominator of -7 - ((-14)/(-56))/(4/(-177)) and o? 32 Let g = -1378205/56559132 + -2/224441. Find the common denominator of g and -79/70. 8820 Suppose 16q + 20 = 11q. Let l(g) = -5g - 5. Let n be l(q). What is the common denominator of (-29)/(-18) - (n - 20) and 121/12? 36 Let j = -42457/140220 + 13/1558. What is the common denominator of j and -187/60? 180 Suppose 22f - 44 = 23f. Let y = f - -49. Suppose 0 = -4d + w + 187, 0w + 235 = yd - w. What is the common denominator of d and -67/2? 2 Let x = 4/1887 + 66013/15096. Find the common denominator of x and -103/1298. 5192 Let w be ((-1)/2)/(-6 + (-115)/(-20)). Let u be (w + -259)/(-9 + 8). Let z = 6157/24 - u. Calculate the common denominator of -7/5 and z. 120 Suppose -14a - 1409 = -17a + x, a - 4x = 488. Calculate the lowest common multiple of 1170 and a. 2340 Let u = 564 - 555. Suppose um = 28m - 1235. Calculate the smallest common multiple of 52 and m. 260 Suppose 8v = 5295 + 1201. Calculate the common denominator of (((-12)/(-32))/(-1))/((-35)/v) and -39/20. 20 Let o = -32475443/470084610 + 3/377578. What is the common denominator of o and -29/18? 7470 Let t(v) = 6v2 + 53v + 3. Let a be t(-13). Suppose 10s - 72 = a. What is the least common multiple of 40 and s? 40 Let d(h) = -2h*3 - 31h*2 - 29h + 2. Let i(o) = -o*2 + o + 38. Suppose 4p = x, x - 2p = -p. What is the smallest common multiple of d(-1) and i(x)? 38 Let j = 48 - 30. Let q = -193 + 207. Calculate the least common multiple of j and q. 126 Let g = 3932 - 3652. What is the lowest common multiple of g and 120? 840 What is the common denominator of -5/12 and 0 + 6 - 2945/1710? 36 Let j(p) = 2p*2 - 51p + 644. Calculate the smallest common multiple of 32 and j(16). 2720 Let n = -184963/2 + 96180657/1040. Find the common denominator of n and -11/312. 3120 Let o = -9563/18 - -527. Calculate the common denominator of 121/12 and o. 36 Let o = -4426813/6045 + 9520/13. What is the common denominator of o and -79/1240? 3720 Let f = 1206489/212 - 5691. Find the common denominator of -21/106 and f. 212 Suppose -28 = 4v, -47r + 44r + 111 = -3v. What is the lowest common multiple of 4200 and r? 4200 Let n = -1999 + 2001. Let g be ((-26)/(-6) - 1)3. Let v = -4 + g. Calculate the least common multiple of v and n. 6 Let k = 2595317002 + -809738110963/312. Let g = k - 15269/6. What is the common denominator of 2/39 and g? 312 Let q(k) = 42k*2 + 23k - 26. Let b be q(-13). Let u be b/(-26)(-1166)/26. Let w = -11684 + u. Find the common denominator of -61/2 and w. 26 Let r = 128 + -218. Let f be (-123)/(-1554)r/(-8). Let d = f - 4/259. What is the common denominator of -53/10 and d? 40 Let t = 427 + -514. Let p = -81 - t. Calculate the least common multiple of 252 and p. 252 Suppose -4073 = 4i + 4u - 16197, 0 = -5u + 25. Let s = i - 45373/15. Find the common denominator of s and -19/54. 270 Suppose -33h = -489 - 10203. What is the smallest common multiple of h and 2970? 17820 Let c(k) = k*3 - 20k*2 + 43k - 98. What is the least common multiple of 39 and c(18)? 1092 Suppose 0 = -7w - 0w + 70. Let f(y) = -5y + 8. Let h(b) = b2 + 11b - 126. Let q be h(-18). What is the lowest common multiple of w and f(q)? 40 Find the common denominator of (1256/(-360) - (-8)/(-20))40/300 and -109/7482. 67338 Let k = 1714 + -27499/16. Calculate the common denominator of k and (-330)/(-280) + -1 + 1. 112 Let r = 20415 - 40771/2. What is the common denominator of 51/902/8 and r? 120 What is the smallest common multiple of 6 and 4/(20/(-152)(-1 - (-42)/90))? 114 Find the common denominator of (-2 - 955/(-50))3/(-9) and (-296)/5010/(-12). 30 What is the least common multiple of 0 + 2814 - (54 + -68 - (3 + -13)) and 5? 14090 Let m(x) = -x2 + 5x + 92. Calculate the least common multiple of 136 and m(8). 136 Let u be -10(165/22)/((-6)/8). What is the lowest common multiple of 45 and (0 + 7)(-2 - u/(-35))? 90 What is the common denominator of -169/840 and 2144/(-192) - (-5 + 6)? 840 Let p(l) be the first derivative of l*4/4 + 8l*3/3 + 7l*2 + 11l + 3. Let g be p(-6). Calculate the lowest common multiple of (1/g)/(1/(-27)) and 24. 216 Let i = 292 - -744. Suppose -2z - 4d - 528 = -4z, -4z + i = -3d. What is the least common multiple of z and 4? 256 Let b = -2765921/10768310 - 1/190029. Find the common denominator of b and 58/9. 1530 What is the common denominator of 1/231 and (-4)/(-22) - (261792/(-48972))/(-27)? 12243 Let w = 113127 + -113121. Let r = 47 + -11. Calculate the least common multiple of r and w. 36 Let t(p) = -p - 16. Let y be t(-24). Suppose 2k + 5l = -18, -yl = 2k - 5l + 14. Calculate the common denominator of -1 + (-196)/(-32) + k and 37/5. 40 Find the common denominator of 6 - (981/66)/(3537/1425) and 95/18. 25938 Suppose -60 = -2z + 2d, -3d + 105 = 4z - 2d. Let x = -18 - -18. Suppose x = za - 25a - 4. What is the smallest common multiple of 14 and a? 14 Let j = -496/7 - -23983/336. Calculate the common denominator of -27/4192 and j. 12576 What is the smallest common multiple of 4100 and (-10 + 15)/((-3)/(-240))? 16400 Suppose -4m + 9m - 144 = -2s, m = 4s - 310. Let h = s - 111. Let o = h - -55. Calculate the least common multiple of 18 and o. 126 Let z(n) be the third derivative of 29n*4/24 + 121n*3/2 - 300n*2. What is the smallest common multiple of z(-9) and 99? 3366 Let k = 24/1801 + 217345/43224. What is the common denominator of (50/80280/50)/(-178) and k? 2136 Let k be (2/(-3))/((-8)/24). Suppose -kj - 4s = -26, 4j + 3s = -8 + 35. Let f(n) = -n*3 + 9n + 12. What is the lowest common multiple of f(0) and j? 12 Suppose 20 = 5b, -3b - 48 = 5m - 210. Suppose w - m + 0 = 0. Let n = -58 + 91. Calculate the smallest common multiple of w and n. 330 Let s = 293 + -224. Suppose 3a = s - 42. Calculate the lowest common multiple of 8 and a. 72 Suppose 30l - 35 = 23l. Suppose 3w = -5g + 96, -4g + 65 = -w - l. Calculate the smallest common multiple of 6 and g. 18 Let r = -9574961/112 - -85490. Let j = -5/17 + 403/272. Find the common denominator of j and r. 112 Suppose 32v + 82v - 14364 = 0. What is the smallest common multiple of (2 + 26)/(-4 + 3 - -2) and v? 252 Let n = -2062 + 1269. Let u = n + 1505. Find the common denominator of (6/(-40))/(4 + (-2860)/u) and -151/30. 30 Suppose 14z - 16z + 4n + 48 = 0, -z + 3n = -22. Suppose -4t = -92 - 84. What is the smallest common multiple of z and t? 308 Suppose -5u + 76 = -4d + 10, -4 = d. Let l = -33 + u. Let g = 43 + l. What is t	{ "pile_set_name": "DM Mathematics" }
third smallest value in f, i, g? f Let u = 6 + -5. Let i be (4 + -3)u/(-2). Let h = -221/14 + 31/2. Which is the smallest value? (a) i (b) -3/5 (c) h b Let c be 236/(-4)(-1)/(-280). Let p = c - 3/40. Let f = -0.6 - -0.3. What is the second smallest value in f, p, -0.2? p Let v = 14 + -10. Which is the smallest value? (a) 1 (b) 0 (c) v b Let p = 41/18 + -5/2. Suppose 7w - 2w - 20 = 0. Let z be w/(-6)(-3)/(-11). Which is the second smallest value? (a) p (b) 0.5 (c) z c Suppose 5p - 14 = -4. Let i be ((-1)/p)/(2/4). Suppose 5t - 20 = -0t - 4w, -20 = -5t - 5w. Which is the biggest value? (a) 5 (b) i (c) t a Let x = -62 - -62.61. Let y = x + -0.21. Let g = -137/12 + 43/4. Which is the second smallest value? (a) g (b) 0.3 (c) y b Let p = 299/5 + -60. Let a = 17 - 16.7. What is the smallest value in a, p, 3? p Let j(i) = i2 - 5i + 4. Let z = 2 + 3. Let r be j(z). Let f be (r/(-21))/((-2)/3). What is the smallest value in 1/11, -5, f? -5 Suppose 2n = 1 + 11. Let t be (-20)/135n/(-4). What is the second biggest value in 1, t, 0.4? 0.4 Let y be (-4)/(-14) - (-64)/(-126). Suppose 0 = -5m + 10 - 5. What is the third smallest value in y, 5, m? 5 Let f(p) = -p3 - 3p*2 - 2p + 2. Let j be f(-2). Suppose -7q = -2v - 2q - 15, -3v - jq - 13 = 0. What is the biggest value in 1/11, v, -2? 1/11 Let q = -39 + 38.8. Let n = -0.1 + 0.2. Let w = q - n. What is the third biggest value in -1, -0.1, w? -1 Let t = 0 - -0.5. Let r = t + -0.9. Suppose 0y - y + 4l - 17 = 0, 3y = -3l + 9. Which is the third biggest value? (a) 0 (b) y (c) r b Let g = 3 - 6. Let r = g + 3.2. Let k = -7 - -7.5. Which is the third smallest value? (a) r (b) -4 (c) k c Let l = 1.2 - 1. Let k = -5.05 + 0.05. Let f = -0.4 - -0.4. Which is the second smallest value? (a) k (b) f (c) l b Let n = 8.4 + -1.4. Let s = 11 - n. Let j = -1 - -1.06. What is the smallest value in s, 1/2, j? j Suppose 0 = -4c + c - p + 65, 0 = 2c - 2p - 30. Let q be ((-6)/195)/((-4)/c). What is the second biggest value in q, -7, 0.1? 0.1 Let m = -39 - -35. Which is the second smallest value? (a) 0.4 (b) m (c) 1/7 c Let f be (-156)/(-91)14/4. What is the second biggest value in -3, f, -5? -3 Let y = -0.08 - -1.08. Which is the second biggest value? (a) -0.4 (b) -3 (c) y a Let u(y) = y2 - 4y - 1. Let m be u(5). Suppose 2g + m = 3g. Suppose -i - 15 = 4i. Which is the biggest value? (a) i (b) g (c) 0.5 b Let k = -53.98 + 54. What is the third biggest value in 3/5, k, 1? k Let j be 2/(-6)(-9)/21. Let y = -5.29 - -0.24. Let v = -0.05 - y. Which is the second smallest value? (a) v (b) -3/7 (c) j c Let b = -34 - -38. Let m be (0 + 2)1-2. What is the third biggest value in b, 2, m? m Suppose 25 = k + 5u, 4 = 4k + 2u - 6. Which is the biggest value? (a) -5 (b) 3/7 (c) k b Let r = 21 + -33. Let y = 17 + r. Which is the second biggest value? (a) -3 (b) -0.5 (c) y b Suppose 6 = -5g - 4. Which is the second smallest value? (a) 1 (b) 0 (c) g b Let t = -21.036 - -0.036. Let q = t + 21.5. Which is the second smallest value? (a) q (b) 2/7 (c) -2 b Suppose 9 = -4k + 1. Let v = 0.34 + -0.24. What is the second smallest value in k, 1, v? v Let v = -0.5 - -0.5. Let b = 132/13 + -10. What is the second biggest value in v, -4, b? v Let p(j) = j3 + 2j*2 - 3j + 3. Let x be p(-3). Let m(v) = 2v - xv + v + 7 + v. Let r be m(-11). What is the second smallest value in r, -1, -1/2? -1 Let v(j) = -10j. Let x be v(-2). Suppose -7q = -3q - x. Let l = -0.7 + -2.3. What is the biggest value in 1, q, l? q Let h = 0.1 + -0.2. Let w = h - -1.1. Let m be ((-19)/114)/(2/4). Which is the biggest value? (a) -0.5 (b) w (c) m b Let r = 0.4 + 0. Let h = 43.1 - 43. What is the third smallest value in r, 7, h? 7 Let j(x) = -x3 + 6x*2 + 8x. Let v be j(7). Which is the second smallest value? (a) -0.3 (b) v (c) 0.4 (d) -1/6 d Let o = -2 + 5. Let w = -7 + 6.6. Which is the second smallest value? (a) o (b) 5 (c) w a Let w = -57.8 - -58. Let j = -3.8 + 5. Let p = j + -0.2. What is the second biggest value in -2/3, w, p? w Let j(k) = k*3 - 4k*2 + k + 5. Let n be j(4). Suppose n = -4g - 3, 2s + g + 9 = 0. Which is the second biggest value? (a) 0.2 (b) -3/5 (c) s b Let w = -28.9 - -25. Let u = -1.1 + w. What is the third biggest value in -2/3, u, -2/5? u Let w = 72 - 1221/17. Let l = w + 5/68. Let b(n) = 2n - 18. Let d be b(11). What is the second smallest value in d, l, 0.2? l Let m = -6 - 3. Let x = m - -6. Which is the second smallest value? (a) -0.2 (b) -0.4 (c) x b Let t be 2(15/(-9) - -1). Suppose 0 = -3a - 0a - 540. Let m = -3058/17 - a. What is the third biggest value in t, 0, m? t Let l = -1.01 + 1.51. What is the second biggest value in 2, -1/5, l, 5/6? 5/6 Suppose -4h + 5v - 7 = 0, -4h - 2v + 13 = -1. Suppose c - 5n = -n - 17, -3c - hn + 19 = 0. Let o = 64/21 - 10/3. What is the smallest value in o, c, -2? -2 Let i = 11/2 + -65/14. What is the third biggest value in -1, 2/9, i, 5/6? 2/9 Let k = -3908/17 - -230. What is the fourth smallest value in 1/8, -0.4, k, -0.1? 1/8 Let v = 2.9 + 0.1. Let h = v - 1. Let u = -0.3 + 0.5. Which is the biggest value? (a) u (b) 1 (c) h c Let u = -67/2 - -101/3. Let r = -4 - -3.5. Which is the smallest value? (a) u (b) r (c) -0.3 b Let i = -5.47 + -9.11. Let f = i - -15. Let w = f + -0.02. Which is the biggest value? (a) 5 (b) -0.3 (c) w a Let n = -4 + 3.4. Let u = -0.6 - n. What is the second biggest value in 5, u, 0.2? 0.2 Let w = -0.4 + 0.2. Suppose 4f + 15 = 9f. Let x = 3 - 1. Which is the biggest value? (a) w (b) x (c) f c Let o = 10.32 - 0.32. Which is the smallest value? (a) -3 (b) o (c) -1/5 a Let w = 69 + -68.6. Which is the third smallest value? (a) 5 (b) 0.3 (c) w (d) 0.01 c Let p = 2 - 6. Let t be (69/14 - 5)-2. What is the third biggest value in p, 1/4, t? p Let n = -0.13 - -0.57. Let z = n + -0.4. Let s = -4.96 - z. Which is the biggest value? (a) -2 (b) s (c) 1 c Let s be (2/3)/(20/6). Let f = 312 + -308. Which is the third biggest value? (a) f (b) s (c) 3 b Let l = -1 + 7. Which is the biggest value? (a) 5 (b) 1/8 (c) 0.1 (d) l d Suppose 0 = 3d - 5x, 2x + 21 = 3d + 4x. Which is the third biggest value? (a) -6 (b) d (c) -0.4 a Let m = 4/7 + -46/105. Suppose -4z - 1 = -3u + 1, -3u - 16 = 5z. Let r be (-1)/2z/10. What is the third biggest value in m, -2, r? -2 Let h = -235/2403 + 12/89. Let x = 79/54 + h. Let p = 2 + -2.4. What is the second smallest value in -2/3, x, p? p Let c be (-91)/28 - (-2 + -1). What is the third smallest value in c, 3/4, 0? 3/4 Let t be 118/360 + (-1)/2. Let g = 1/20 - t. Let x = -2.3 + 2.4. What is the third smallest value in x, 0.5, g? 0.5 Let p(g) = -3g*2 + 3g - 4. Let d be p(-3). Let k = d - -119/3. Which is the biggest value? (a) k (b) -0.2 (c) 2 c Let y = 27/38 + -4/19. Let a = 2 - 2.3. What is the third smallest value in y, 1/4, a? y Let v be 0 + 2/13 + 1340/(-260). What is the third smallest value in v, 4, 0.2? 4 Let h = -2.314 - -0.014. Let l = h - -4.3. What is the second biggest value in l, -2, -0.08? -0.08 Let r = -1/28 - 25/84. What is the second biggest value in -2/9, r, 5? -2/9 Let d = 12 + -6. Let w(f) = -f + 8. Let t be w(5). Suppose 0 = -q - 4, ts - 10 = q + d. Which is the third smallest value? (a) -0.2 (b) s (c) 3 b Suppose 17z = 47 + 4. Let f = -17 - -50/3. Which is the second biggest value? (a) z (b) 2/9 (c) f b Suppose 0k + 4 = 4k. Let a = -0.04 + -1.96. What is the second smallest value in k, 1/5, a? 1/5 Let i be 4/(-6) + 55/60. Which is the third biggest value? (a) 0.2 (b) -8 (c) i b Let k = 2.7 + -3.2. Which is the third biggest value? (a) -0.1 (b) 2/7 (c) k c Suppose -3s + 19 = 5c, 4*c = -s + 4 + 14. What is the smallest value in 1, s, -0.2, -7? -7 Let p = -9 + 23. Let z = p + -12. Which is the third smallest value? (a) -2/7 (b) z (c) -3/2 b Let i = -0.13 + -0.37. Let w be -1 + 69/21 + -2. What is the second smallest value in i, w, 1/6? 1/6 Let l = -0.18 + -1.92. Let p = -2 - l. Let c = -23/42 + 3/14. What is the third biggest value in c, 0.3, p? c Let x = -2.1 - -3. Let c = -0.91 + x. Let y = -4.99 + c. What is the second biggest value in 1/8, -3/5, y? -3/5 Le	{ "pile_set_name": "DM Mathematics" }
nearest to d? (a) -4/3 (b) h (c) -0.4 c Let o be (3 - 1)/(4 + -2). Let z(u) = u*3 - 2u*2 - u - 2. Let k be z(3). Let n be 4/(-190)(-9 + k). Which is the nearest to 0.1? (a) o (b) -3 (c) n c Let q be ((-1)/(-2))/(6/(-12)). Let k = 159/52 - 30/13. What is the nearest to q in k, -2/23, 3? -2/23 Let o(t) = t*3 + 2t*2 - 3t + 1. Let r be o(-3). Let c = -130 + 1948/15. What is the closest to 0.1 in r, -0.3, c? c Let w = 9 + -9.4. Which is the closest to -2? (a) -2 (b) -5 (c) w a Let l(w) = 2w2 + 11w - 7. Let x be l(-6). What is the nearest to -0.3 in 1/2, 1/3, x? 1/3 Let x = 36 + -41. What is the closest to 0.2 in x, -2/11, 8? -2/11 Let h = -9 + 7. Let o = 2/9 + 5/18. What is the nearest to -2/3 in 1, h, o? o Suppose 4j + 12 = -0j. Let o = 75 - 76. Which is the closest to -1? (a) -2 (b) j (c) o c Let u = -2.8 + 3.1. Which is the nearest to 1/2? (a) u (b) -0.2 (c) 3 a Let k = -3 - -9. Let g(y) = -y*2 + 7y - 3. Let h be g(k). Let l = 1360/7 - 194. Which is the closest to -2? (a) l (b) h (c) 5 a Let f = 160/3 - 53. What is the closest to 2 in f, 1, -2/7? 1 Let x = 49.1 - 49. What is the nearest to -1/2 in 0, -2/5, x? -2/5 Let x = 0.199 - -0.001. Let a be 2/7 - (-17)/(-35). What is the closest to -1 in x, a, -0.1? a Suppose i + 13 = 2h + 4i, -3h - 3 = -3i. Which is the nearest to h? (a) 2/9 (b) -5 (c) -2 a Suppose -3i + 2c + 41 = -4, 5c = -15. Suppose i = -2g + 7. What is the nearest to -1/4 in 4, 1/7, g? 1/7 Let s = -10 + 9.5. Which is the nearest to 1/4? (a) 0 (b) s (c) -0.1 a Let i = 1.3 + -1. Let v = -0.01 - -0.16. Let g = v + 0.05. What is the closest to i in 2, g, -2/5? g Let n = -8038801/88638 + 43/4029. Let a = -181/2 - n. What is the closest to 0 in a, 1, -0.2? a Let w = 40 + -41. Let s = 78720 + -7871937/100. Let h = -3/25 - s. Which is the closest to 0.1? (a) w (b) h (c) -5 b Let v = 3.61 + -0.51. Let g = 0.1 - v. Which is the nearest to 0? (a) g (b) -4 (c) 2 c Let m = 0.9 + 4.1. Let b = 1.5 - -0.5. Let z = b - 2.4. What is the closest to 0 in m, 2, z? z Let i = 0.9 - -0.1. Let o = 17 + -11. Let v = o + -5. What is the closest to v in 4, 5/2, i? i Let d = 1.2 - 0.2. Let h = -1.5 + d. Let l = -11/12 + 2/3. Which is the closest to l? (a) 2/11 (b) h (c) 1 b Let g = 346 - 346. Let w = 575/14 + -81/2. Which is the nearest to 2? (a) 1/7 (b) g (c) w c Let z = -55.4 - -55. Which is the closest to 1? (a) 1/10 (b) -3/8 (c) z a Let z be (-6)/12 - (-1)/(-2). Which is the closest to 0.1? (a) -0.08 (b) -4 (c) z a Let d = 0.14 - 0.13. What is the closest to 2/3 in 4, 5, d? d Let w = 590 + -584.89. Let i = w - 0.11. What is the nearest to 1 in -1, -2/13, i? -2/13 Let j = 19 + -19. Let h = j + -3. Which is the nearest to -2? (a) 4 (b) h (c) 1/5 b Let j(v) = 1 - v2 - v2 + v*2 + 6v. Let t be j(6). Which is the nearest to t? (a) -0.5 (b) -5 (c) 5 a Let b = -1 - -0.8. What is the closest to b in -2/11, -5, 1? -2/11 Let b = 12.5 + -8.5. What is the nearest to 0 in 3, 0.1, b? 0.1 Let g = 1.37 - 0.07. Let t = g - 0.3. Let z = t - 4. What is the closest to 0 in z, -5, -2? -2 Let m = -0.27 - 1.33. What is the closest to -1/2 in 2, m, 2/7? 2/7 Let m be ((-6)/(-27))/(4/(-12) - -1). Which is the closest to m? (a) -2/3 (b) 0 (c) 5 b Let l = -31.2 - -35. Let g = -11 - -7. Let o = l + g. Which is the nearest to -1/4? (a) 2 (b) o (c) 3 b Let t(r) be the first derivative of -r*3/3 + 2r*2 + 3r + 3. Let h be t(5). Which is the closest to h? (a) -5 (b) 2 (c) 0.1 c Let i = -8.3 + 9. Let g = -0.3 - i. Let n be 0/2 - 2/5. What is the nearest to 0 in -0.1, n, g? -0.1 Let m be -12/(-6) + 4/24. Let d = 0 - 0. Let i = 2/565 + -1711/4520. Which is the closest to m? (a) i (b) d (c) 2/17 c Let x = 3.3 - 4. Let g = -0.4 - x. Which is the nearest to -1/4? (a) 1 (b) g (c) -1 b Let y be (5/((-225)/12))/((-5)/15). What is the nearest to 1 in 2, 0.4, y? y Let h = 3.1 + -3.06. Let m = -0.46 + 0.6. Let z = m - h. Which is the nearest to z? (a) -2 (b) 0 (c) -1/3 b Let q = -23/312 + -2/39. Let p = -3 - -2.9. What is the nearest to p in q, -0.4, 1/4? q Let q = -1.5 + 2.5. Which is the nearest to q? (a) 1 (b) -1/20 (c) -2/7 a Let o = -0.13 + 5.13. Let d = -0.7 - -0.6. What is the closest to 1 in o, -2, d? d Suppose 2c + 5 + 5 = 0. Suppose k - 1 - 5 = -3d, 2k - 2 = -d. What is the closest to 2 in c, d, 3? d Suppose 9 = 3y, 11 = g + 3g + 5y. Let i = -2 + 8. Suppose 0 = 3h - ih. Which is the closest to -0.1? (a) g (b) h (c) 3 b Let l = -938/13 - -72. Let q = 71 - 71.2. What is the closest to -1/2 in 2/5, l, q? q Let n = 3 - 1.9. Let l = -0.9 - n. What is the nearest to l in 5, 0.1, 4/3? 0.1 Let z = -262 + 263. Suppose 3m = -u + 3, -u - 15 = -6u + 2m. Which is the nearest to z? (a) 5 (b) -2 (c) u c Suppose -4n + 3n = -2. Let g be 0 - 13/(-6) - n. Which is the closest to 0? (a) 0.3 (b) -0.2 (c) g c Let o = 185/8 - 23. What is the closest to -1/2 in o, -0.03, -1/4? -1/4 Let f be -3 - (-191)/72 - 2/(-9). Which is the closest to 3? (a) f (b) 0 (c) 1/6 c Suppose 5t + q = 3 - 13, -3q - 19 = 4t. What is the closest to -0.1 in -0.4, 1, t? -0.4 Let t = 75/4 - 19. What is the nearest to 0.2 in 3/5, 1/2, t? 1/2 Let m be -109/18 + (-4)/(-1). Which is the nearest to m? (a) 4 (b) -0.5 (c) 0.3 b Let t = -46.8 - -47. What is the nearest to 2 in 0.12, 0.3, t? 0.3 Let a = -129 - -128.6. Let c = 2 - 7. Let d = -5.3 - c. What is the closest to -0.1 in a, -4, d? d Let v be (-2)/6 - 16/(-3). Let k(m) = -m*2 + 4m + 3. Let d be k(v). Which is the nearest to 2? (a) -1/5 (b) d (c) 0.1 c Let j = -190 + 189. Which is the closest to -0.1? (a) -0.3 (b) j (c) 0.3 a Let s be (2 + 0)(-1)/(-1). Let q = -2 - 3.1. Let p = -5 - q. Which is the nearest to p? (a) s (b) 1 (c) -1/5 c Let t be -2 - (-1)/(-3)-3. What is the closest to 1/7 in -3, -2/3, t? -2/3 Let j = 0.1 + -0.5. Let u be 39/63 + 4/(-12). Which is the nearest to u? (a) 4 (b) -1/2 (c) j c Let y = -1.54 + 1.04. What is the nearest to 2/9 in y, 4, -6/7? y Let f = -3 - -3.4. Which is the nearest to 1/5? (a) 2/15 (b) -3 (c) f a Let c = -0.16 + -0.14. Let t = -9/10 + 2/5. What is the nearest to c in t, 4, -5? t Let m be ((-3)/(-21))/((-24)/(-28)). Which is the nearest to 2/13? (a) 1 (b) m (c) 0.5 b Let p = -14 - -14. What is the nearest to 1 in 3, p, 6/11? 6/11 Suppose l - 13 + 4 = -4r, -2l = 5r - 9. Which is the nearest to -28? (a) r (b) -2 (c) -3 c Let n be (2 - -11) + -3 + 2. Let z = -11 + n. Let o = 6 - z. Which is the nearest to -0.2? (a) 0.1 (b) o (c) 1 a Let q = -0.035 - -5.035. What is the nearest to 0 in 0.6, 1, q? 0.6 Let g = 107 + -114.7. Let j = -8 - g. What is the closest to 1/3 in -1, -5, j? j Let n = 0.8 - 3.8. Let j = 0.6 + 3.4. Let h = j + n. Which is the nearest to h? (a) -0.3 (b) 0.4 (c) -3 b Let s = 30 + -30.2. Which is the closest to 11/3? (a) -1/12 (b) 0.5 (c) s b Let i = -1.5 - -1. Let n = 0.6 - 0.4. Which is the closest to 0.3? (a) 0.3 (b) n (c) i a Let x be (-154/(-6))/(-2). Let k = -3.2 - -3. Suppose 4v - 3o + 5o + 8 = 0, -v = 4o + 16. What is the nearest to v in k, 0, x? 0 Suppose 0 = -6f + 11f - 25. Let k be 3/(-10)10/(-12). Which is the closest to k? (a) -5 (b) f (c) -2/3 c Let i be 7/15 - 8/12. Let a = -3143/2 + 1539. Let k = a - -32. What is the closest to 0 in i, k, 2/5? i Let z = 0.13 + 1.47. Let n = 1.4 + z. Let u = -3 - -1. Which is the nearest to -0.1? (a) u (b) n (c) -1/6 c Let d = -0.009 + 0.109. Let u = -117 - -821/7. Which is the nearest to u? (a) -2/13 (b) d (c) -1/5 b Let g = 5 + -2. Let q = -0.1 + 0.2. Suppose -20 = -4b, 10b + 13 = -2c + 11b. What is the nearest to q in c, -3, g? g Let v be (4/(-10))/(255/75). Which is the nearest to -1? (a) -0.3 (b) 4 (c) v a Let p be 2/6(6 - -31). Let h = -13 + p. Which is the closest to 0? (a) 0.2 (b) 3/8 (c) h a Let s be 77/664/(-21). Let n = -4 + 8. Let k = n + -1. Which is the nearest to 1? (a) 0.3 (b) s (c) k a Let q = -0.028 + 0.328. Which is the nearest to 3? (a) q (b) -1/4 (c) -0.5 a Let p = 7 + -7.1. What is the nearest to -2 in p, -3/4, 4? -3/4 Let a be -4 + ((-2)/(-1) - 0). Let m = 4 + a. Suppose -2h - 6 = -t - m, -4 = -3*h - t. What is the closest to h in -4, -0.4, 4/5? -0.4 Let q = -0	{ "pile_set_name": "DM Mathematics" }
3 - 26f2 - f + 32. Let p be j(26). Solve -3z - 17 = 4x, 3x + 2z - 6z - p = 0 for x. -2 Let a = 2 - 5. Let z be 21 + -3 + a + 2. Let l be ((-2)/(-4) + 0)(z + -9). Solve lf = -2n - 10, n + 0n = -5f - 5 for n. -5 Suppose -2652 = 4v - 4a, 0 = 2v - 0v - a + 1323. Let g be v/24(-8)/(-5). Let u = -41 - g. Solve 0 = -b + ux + 19, 4b + 3x - 26 = 5x for b. 4 Suppose -19f + 72 = -61. Let k be (32/f)/8 - (-31)/7. Solve -3q + 2 = u - 1, ku = -15 for q. 2 Suppose -10i + 454 = 4. Suppose 48 = -37m + im. Solve 5d + 3p = -m, -6 = 2d - 0p + 3p for d. 0 Let c be (-12 + 1184/112)/(2/(-7)). Suppose -2s = 2s + 3n - 20, 3n - 22 = -cs. Solve -sk + k + 2 = 5g, 0 = -3g + 5k + 18 for g. 1 Let d(t) = -t*2 + 16t + 10. Let y be d(16). Suppose -y = -5c + 2i, 0 = -2c - i + 4. Solve -6 = m + ck, k = 5k + 4 for m. -4 Suppose 1915x - 1980x + 130 = 0. Solve 3j = r + 3, 14r - 19r + 36 = xj for j. 3 Suppose -v = -2o + 3, -51v + 5 = 5o - 56v. Suppose -18 = -5d - 8. Solve -2a = s - a - o, -ds - 4a + 10 = 0 for s. -1 Suppose -204c - 296 = -431 - 885. Solve -17j + cn - 13 = -14j, 4n - 8 = 0 for j. -1 Let d = 2519 + -2516. Let c be (-4 - 2/(-1))/(4/(-22)). Let a(v) = 6v3 - v2 + v - 1. Let i be a(1). Solve -z = 3, -c = du + u + iz for u. 1 Suppose -13 = 1229s - 1234s - i, 4s - 4i = 44. Solve -sw = k - 7, -2w - 5k - 8 = -25 for w. 1 Suppose -2c - 13 = -3a, 0 - 3 = -a + 2c. Let q be 3/4 + 945/420. Solve -4z = as, qz + z = 3s for s. 0 Suppose -12d + 15 = -7d. Suppose 0 = -v - 4y + 12, 0 = -3v - 4y - 2 + 6. Let o be (-22 + 20)/(v/6). Solve -1 = -2x - om, -6m + dm = -3x - 6 for x. -1 Suppose 0 = -9y - 13y + 5434. Let c = 274 - y. Solve -3h - 4o - 11 = 0, 2h - c = -2h + 3o for h. 3 Let a be -109/(-15)1. Suppose 0 = ar - r. Suppose 2k + 5u = 6k - 12, -k + 3u + 3 = 0. Solve r = -4o + kq - 32, 2o = -2o + 4q - 36 for o. -5 Suppose 20n - 510 = -94n + 12n. Solve 5y = -5j, 7y = -nj + 6 - 8 for y. -1 Suppose 0 = -195o + 101o + 95o - 2. Solve 8 = -q - od, 0q = q - 5d - 13 for q. -2 Let m be 8(2/(-18))/(0 + (-7)/63). Solve -2k + mp - 3p + 20 = 0, 2k - 3p = 12 for k. 0 Let r = 2692 + -2682. Solve -5j = -p + r, 0p - 10 = -5j + 5p for j. -3 Suppose -3v - 12 - 3 = 0. Let b be (6 + 3 + v)-7. Let s be ((-16)/b)/((-2)/(-7)). Solve 5y = sp - 19, -5y + 3p = 20 + 1 for y. -3 Suppose 2j + 684h - 1 = 683h, 5h + 10 = -5j. Solve -2d = 5i - 5 - 3, ji - 3d + 12 = 0 for i. 0 Let t = 187 - 186. Let r be (t + -2)/(4(-8)/288). Solve r = 4x + o, 4o - 6o + 6 = 4x for x. 3 Let z = -1902 + 1284. Let c = 620 + z. Solve 4v + 33 = 5a, 0 = -6v + cv - 5a + 17 for v. -2 Suppose -39d + 1461 - 57 = 0. Solve -4q + d = -4n, 2n + 15 - 7 = 0 for q. 5 Suppose 115 = 51f - 229 - 64. Solve -3l + 10 = fc, -5l + l + 3c = 14 for l. -2 Let r(k) = 10k*3 - 107k*2 + 69k + 12. Let a be r(10). Solve -2g - m = -4, 10 = 2g - am - 0 for g. 3 Let i = -8 + -11. Let g = i + 22. Suppose 6 = gq - 0q. Solve 0 = qm - k - 0 - 1, 3m + 5 = -5k for m. 0 Suppose 2a + 21 = -2x + x, 28 = -a + 3x. Let g(p) = -p2 - 22p - 110. Let d be g(a). Solve -3v - n = 0, 4n + 1 = -4v - d for v. 1 Let y(l) = -l3 - 3l*2 - 133l + 23. Let x be y(0). Solve 0m + 4p - x = m, 5m = 4p - 35 for m. -3 Let s be -39 + (0 + -4)1. Let b = 12 + s. Let g = b + 37. Solve 3q - g = 2u + 1, q = 5 for u. 4 Suppose 4b = 20 - 68. Let o be (45/b - -4)(4 + 4). Solve 6 = -w - 3w + or, -3r = -5w - 6 for w. -3 Suppose 2d = -2d - 7u, -4d - 13u = -14u. Suppose -8l + 4l = 0. Let j = l - 0. Solve j = -q, db - 4 = 2b + 2q for b. -2 Let z(j) = -j + 11. Let y be z(7). Let m(w) = 2w2 + 77w + 730. Let v be m(-22). Solve 0 = 4r - 3r + 5, vc - yr - 24 = 0 for c. 1 Suppose 4n = -5x + 102 - 904, 0 = -3n - 4x - 601. Let o = n - -204. Solve q - o = -k - 4, 0 = -3q + 5k - 17 for q. -4 Suppose -10 = -3a + 29. Let n(o) = 5o - 63. Let j be n(a). Let i = 2 + j. Solve -3t = 2u - 0u + 4, -iu + 5t - 8 = 0 for u. -2 Let p be (-1)/(4 + (-34)/8). Let h be (6/(-14))/(p/(-28)). Suppose 0 = -3l + 4z + 71, -z + 95 = 5l - hz. Solve 0c + 5t = 3c + 30, t + l = -4c for c. -5 Let o be (-2)/(-2)(0 + 0/(-2)). Let i be 2/44 - 15. Let n be 0 - i - o - 36/12. Solve -6 + 0 = 3u, -4l - 3u - n = 0 for l. -1 Let g(y) = 12y - 60. Let x be g(5). Let o be x/(-1(-8 + 6)). Solve 0f - f + 5 = o, h = f - 9 for h. -4 Let c = -135348 - -135358. Suppose -5k + 42 = -3k - 4a, -k = -4a - 29. Solve 3l - k = 4g, 3g = -2 - c for l. -1 Let h be ((-80)/60)/((-1)/21). Suppose 22c - hc + 24 = 0. Solve -c + 2 = -2o, -8 = 2i - 4o for i. -2 Suppose -8g + 11 + 192 = 43. Solve 2p = t - 5, 0 = -18p + 23p - 4t + g for p. 0 Let i(h) = -h*2 + 34h - 33. Let g be i(33). Solve g = 2y - 5c + 22, 4y - 4c + 3 = -17 for y. -1 Suppose n - 62 = 4s, 156 = 3n - 5s + 3s. Let l = n + -48. Solve -2d = 3h + 11, -ld + 0d = -h + 7 for d. -4 Let a = 177 + -169. Suppose g = -4g - 2o + a, -3o + 12 = 5g. Solve l = -2x - 2, -1 = -5x - l - gl for x. 1 Suppose 5x = 4p - 23, -2x - 382 + 378 = p. Solve h + 7 = -4r, -ph + 0 + 2 = 0 for r. -2 Suppose 3b - 5 + 4 = y, 2b = -4y + 24. Suppose 0 = -bq + 477 - 449. Solve 5d - 2f - 1 = 0, 0 = -d + 4f - 3 + q for d. -1 Suppose 52r - 51r - 2g - 13 = 0, -5r = -2g - 33. Solve 0 = 4i + 12, 12s - 16s + ri + 27 = 0 for s. 3 Let c be 36/(-450) + (-52)/(-25). Suppose 0 = 5f - 3d - 4, -5f + cd + 16 = 5d. Let j = -5 + 8. Solve -jt - 5 = 10, -2r - 20 = ft for r. -5 Let p(w) = -57w + 6270. Let s be p(110). Solve s = -5q + 30, a - 3q + 7 + 16 = 0 for a. -5 Suppose -977i = 2l - 982i - 4, 2l + 3i - 4 = 0. Solve 3j - x - 16 = 0, 81j - 13 = 78j - lx for j. 5 Let s = 9155 + -9155. Solve 5l - 3f - 6 = s, 5l + 2f + 4 = 3l for l. 0 Let f be 50/(-18) - (-8)/(-36). Let d be f/(6/5)48/60. Let h be (-4)/36/d. Solve k - 2o = -4o + 3, k - 9 = -ho for k. -3 Let r = 8339 + -8336. Solve rk = 3q + 9, 5q - 13k = -9k - 11 for q. 1 Suppose 42 = 56c - 139 - 43. Solve -4d - 6k + ck = -16, -4k - 3 = d for d. 5 Suppose -204v = -208v + l + 6, 4v - 10 = -l. Solve -29 + 9 = -5h, -4u - vh - 12 = 0 for u. -5 Let p be 32/6 - (8 + 23/(-3)). Suppose -p = -m + 2w + 31, 4m - 89 = -3w. Solve 12 = -3j + 3d, -6j + j - m = d for j. -5 Let i = -2509 - -2514. Solve 14 - i = 8d - 3a, 0 = -3d - 5a - 15 for d. 0 Let l = -26 - -23. Let x be 8/6 + (-8)/l. Suppose 2t = n + n - 20, -n = -3t - 20. Solve -u = -xd - 17, -2d = 2u - nu + 21 for d. -3 Suppose 0z = 2z - 8. Let m = -8005 + 8007. Solve -3b = -mp + z, 2p - 8 = 8b - 3b for b. -2 Let j(t) = 3t*2 - 8t - 21. Let f be j(-2). Suppose -25 = 5k, 6g + 2 = fg + 4k. Solve -g = 2u - 4z, 5u - z + 25 = 3z for u. -1 Let f = 9 - 6. Let w = 109979 + -109975. Solve 0 = fu - 6, -4u = wk - 9k - 28 for k. -4 Let f be (2 + -5 - -3)/3 - -3. Solve 0 = -j + f, 35 = 4z - 0j + 5j for z. 5 Let j(r) = -52r - 1247. Let s be j(-24). Solve -11m + 6m - 2 = 2w, w + s = 0 for m. 0 Let h(d) be the second derivative of 2d*3/3 + 19d*2/2 - 174d. Let b be h(-3). Solve 2p = -0p - 3i + 19, -b = -p - i for p. 2 Let z = 197091 - 197081. Suppose -4c = -2c. Let o(x) = 5x*3 - 1. Let v be o(1). Solve p = -0d + vd + 19, c = -5p - d - z for p. -1 Let r be (36/(-45))/((-4)/(-30)). Let t be (-16)/(-6)(r - 45/(-6)). Solve 4j = -8, 0 = -tc - j + 3j - 12 for c. -4 Let k = -62 + 71. Suppose -4z - kz + 572 = 0. Suppose 36 = 2c - 4n, c - 4n = 4c - z. Solve -3s + 4x = -c, -2s + 5x - 11 = -6s for s. 4 Suppose 32 = -x + 3d, 4 = x - 2d + 31. Let y = 23 + x. Solve 3o + 6 = 0, -yp - 4o - 12 = -5p for p. -4 Suppose 0 = -2742g + 2740g + 10. Solve -5r - 10 = 5h, 13 = -4r - h + g for r. -2 Suppose -1829u + 1783u = -92. Solve -4f - 28h + 26h - 12 = 0, h + u = 0 for f. -2 Suppose 96p = -372 + 1524. Solve -5c + 20 + p = -4y, -3c = y - 9 for c. 4 Let c(y) = 9y*2 + 86y - 18. Let i be c(-10). Suppose -21z + 8 = 2s - iz, -z - 10 = -3s. Solve -p - 4n = -17, p + 3n - sn - 5 = 0 for p. 1 Suppose 28540v - 28530v - 50 = 0. Let k = 53 - 31. Solve -va = u - k, 0u - u + 18 = 4	{ "pile_set_name": "DM Mathematics" }
-2227. Solve -h + 0m - m = n, -m = -h for h. -2 Suppose -2y + 0 = m - 8, 5y = -4m + 20. Suppose 0 = 3k - m - 12. Solve 5j - 28 = ku - 2, 3j + 2u = -2 for j. 2 Let f(s) = s3 - 18s*2 + 18s - 18. Let h be f(17). Let r(c) = -5c3 - 3c*2 - 4c - 2. Let m be r(h). Solve -4t - d + 2 = 0, 2d - 5d = mt + 2 for t. 1 Let p(y) = -y*2 + 5y - 4. Let w be p(5). Let i be (-14)/28 - 18/w. Solve 0g - 7 = -ig - 5l, -5l = -2g + 11 for g. 3 Let t be (-1)/20/(-4 - 0). Suppose 2r + 2b - 3b - 5 = 0, 4r + 5b = 31. Solve 4l = -n + 4, t = -n - 2l + l + r for n. 4 Suppose d - 3 = -2y + 3, y = -4d - 11. Let f be 39/3(3 + -2). Solve 4j = 3b - 23, -3b + yj + f = 6j for b. 5 Suppose -7o + 58 = -68. Suppose o = -6n + 390. Suppose -4p + n = -58. Solve 25 = -a + 6a, -5a + p = -5b for b. -1 Suppose -3l - 20 = -7l. Suppose ly - o - 21 = 0, 0y + 5o + 1 = -y. Solve 0 = -yh + 3p + 1, -h - 3p + 8 - 4 = 0 for h. 1 Suppose 0 = 3x - 39 - 6. Let v be 31 - (-6 + 1)(-9)/x. Solve -3p - w = 3w - v, -5w = -5p for p. 4 Suppose 0 = -11p + 13p - 12. Suppose -10h + 32 = -ph. Solve -v - h = -3l, -l - v + 7 = 3 for l. 3 Suppose n + 3n = -2s - 2, 4s + n = 17. Suppose -9 = -x - 4c, -8 = -sx - 2c + 1. Let m = 10 - x. Solve -4w - 3j - 12 = -5j, 0 = 3w + j + m for w. -3 Let z be -2(0 + -2 + (-17 - -7)). Solve -3u + 5n = z, -4u + 5u = 4n - 15 for u. -3 Let h(k) = -k*3 + 10k + 15. Let s be h(-2). Solve -5d - r - 15 = 7, -d + sr = 14 for d. -5 Suppose 5k - 4d - 24 = 0, 0 = -3k - 17d + 15d + 10. Solve -ka = -4x + 20, 0 = 5a + 4 + 11 for x. 2 Let q(c) = 4c3 - c2 - 2c. Let x(m) = -2m3 + m. Let d(j) = -2q(j) - 5x(j). Let l be d(1). Solve 0 = -5s + p - 2p - 3, 5p = -ls + 7 for s. -1 Let n(m) = m3 + 5m*2 + 6m - 1. Let r be n(-3). Let d be r/4 - (-30)/24. Solve -3 = 4x - 2f - f, d = f for x. 0 Let q = -146 - -154. Suppose -f = 3o + q + 3, 0 = 4o + 20. Solve -2l = 3c - 7l - 19, -4c - fl - 28 = 0 for c. -2 Let v = 14 - 8. Let m(k) = k2 - 7k + 6. Let p be m(6). Suppose -h + 3h = p. Solve 2f - v = y, 5f - 14 = -hy + 3y for f. 4 Let d(a) = 4a + 53. Let v be d(-12). Solve v = -3u + s, -5u + 3s - 3 = -0s for u. -3 Suppose 2w + 1 - 3 = 0. Let l be (0 + -1)(5 - 1). Let j be (12/(-3) - l)/w. Solve 0g + 3 = -g - 2b, -3g + 2b + 23 = j for g. 5 Let c = 1 - -3. Let q = 0 + 3. Let h be q/1 - 190/(-10). Solve -cn = 5u - h, -u - 2n + 11 = n for u. 2 Let h = 179 - 174. Solve 2f = 3f + h, 0 = 3q - f - 17 for q. 4 Let l(i) = i + 12. Let s(w) = -w*2 + 6w + 9. Let o be s(-2). Let h be l(o). Solve -2c + 5t = 16, -hc - 2 = t - 4t for c. 2 Let h(g) = g*3 - 6g*2 - 4g - 16. Let y be h(7). Suppose yt - 16 = -6. Solve -2o + 0l - tl = 10, -3l = 0 for o. -5 Let n(p) = 5p*3 - 2p*2 - 2p + 2. Let d be n(2). Suppose 0 = -36c + dc + 168. Solve -w - 4w = 2f + c, -f = 4w + 20 for f. -4 Let g = -20 - -23. Suppose 0 = 5s - 7 - g. Solve -2j - 3j + 3 = -sh, -h + 3j - 1 = 0 for h. -4 Let k be 4/8 - 37/(-2). Suppose -kn + 22n - 9 = 0. Solve 0 = 2g - 10, -nb - 3g + 6g - 12 = 0 for b. 1 Suppose 430 = -6w + 46. Let j = 82 + w. Solve -4i = -n + j, 3i + 2 = 2n - 9 for n. -2 Suppose 21h - 170 = 271. Solve -x - x = 5v - h, x + 2v = 8 for x. -2 Suppose 45b - 48b - 9 = -5k, b - 2 = 0. Solve -u - 5 + k = -i, u - 6 = 5i for u. -4 Suppose -3 = -3t, -3t + 0 + 5 = r. Suppose 27 = 4i + 4p - 7p, -ri - 2p - 4 = 0. Solve -w - 3m + 2m = -i, 0 = 3w - m - 1 for w. 1 Let r = 67 - 63. Suppose 3x = -2x + 20. Solve -3h + w = -xh + r, 2h = -4w + 18 for h. -1 Let d(v) = -v3 + 14v*2 - 16v. Let n be d(13). Let q be (-3)/((-27)/(-24))n/4. Solve 5a - 5i + 2 = -3, 4a + 2i - q = 0 for a. 4 Let m(a) = a3 - 5a*2 + 2. Let b be m(5). Let x = -18 - -23. Suppose 0 = xl - 147 + 87. Solve l = 2z + 5q, 5q = -bz + 4q - 4 for z. -4 Suppose 36d - 619 = -79. Solve -20 = -5h + 5q, -q - 2q = d for h. -1 Let d be (-2 - -2) + -1 - -26. Let k be -30((-10)/(-4) + -3). Suppose 2h - k = -h. Solve 0o - 5t = -4o + d, 25 = -ht for o. 0 Suppose 0 = -28d - 5d + 66. Solve db + 7 = -2z - 5, 0 = -5b + 3z - 14 for b. -4 Let m(o) = -2o + 4. Let v be m(4). Let l be 5 - 4(v - -3). Let q be ((-9)/(-2))/(-3)-2. Solve -qd = -4n - d + 6, n - l = 3d for n. 0 Suppose -m + 1 = 0, x - 3m - m - 12 = 0. Suppose -k - 3j + x = 0, 2k - 3j + 4 = -0k. Let h = 737 + -731. Solve -hc = 3n - 3c, 2 = -3n - kc for n. 2 Suppose 4o - 3o + 6 = -2i, -3i = 4o - 1. Suppose -2d + ox = -d - 32, 0 = 5d + 5x - 110. Solve 4f = 4y + 20, 2y = -5f + d + 1 for f. 5 Let x be 2/(-3) + (-272)/(-48). Let m be (9/3 - x) + 8. Solve -j = 2u + 1, -5j = -2u + mu + 17 for u. 2 Let v be 114/76 + (-3)/2. Solve -4c + 8 = 2g - v, -24 = -5c + g for c. 4 Let f(r) = r3 - 5r*2 - 35r + 152. Let l be f(7). Solve 31 = -4x - x + 2z, 2x - 5 = -lz for x. -5 Let x be 1(1 + 0 - 0)10. Suppose xq = 4q + 24. Suppose 3o = -0 + 6. Solve -13 - 15 = qw - 4n, -4n - o = 2w for w. -5 Let i(z) = -z2 + 11z + 2. Let t be i(11). Suppose 0 = 5j + tb - 18, -3j - 2b + 22 = 2b. Solve -4v = 3u + 10, -3v + ju - 20 = v for v. -4 Suppose -1565l = -1570l - 90. Let b = -14 - 8. Let x = l - b. Solve 2w + 8 = -y, y + xw - 2 = -16 for y. -2 Suppose 2q - 78 = -5z + 78, 0 = -5z. Let x = q + -53. Let f be (21/(-6))/70. Solve -2g - x = 5a, f = -g - 2a - 1 - 10 for g. -5 Let g = 1632 - 1630. Solve 0 = 4o - a - 11, 4o + a = -ga + 15 for o. 3 Let j be (4/3 - -1)6. Solve y - 5 = -u, 3u + 4y - 1 = j for u. 5 Suppose -5j + 8j = 3n - 9, j + 3n = 17. Solve d = -4x + 1, -5d - x + 22 = jx for d. 5 Let j(h) = h3 + 18h*2 + 16h - 5. Let p be j(-17). Suppose 11o - 7o = p. Suppose y - 4 = -0y. Solve 3g - 6g = 3n + o, yg + 3n + 6 = 0 for g. -3 Let k(q) = 2q + 0q - 3 - q - 2q. Let c be k(-6). Suppose 14 + 0 = 4l + cv, 0 = l + 2v - 1. Solve -o + 16 + 1 = -5g, 0 = g - 3o - l for g. -4 Suppose -3m + 9 = -0v + 3v, 3m - 17 = v. Let c be (43)/4 - 14. Let u = 3 - c. Solve 2l = -5h + 2, -u = h + ml + 4 for h. 2 Let z = 3 + 0. Let p be -2 + 10 - 9/z. Suppose 3s + po = 4s - 26, -3o = s + 6. Solve -s = -3l - 2k, -5l + 11 = 4k - k for l. 4 Let u be (-3)/(-12)36/637. Solve -3x = o - 4, 0 = -3o + 2 + u for x. 1 Let p = -17 - -10. Let z be 8 - (p + 2 - -2). Suppose zg - 25 = 6g. Solve r + 8 = 2i, -5r - 18 + g = -i for r. -2 Let c(a) = 9a - 13. Let y be c(2). Solve 5o = 3g, 0g + yo = 5g for g. 0 Suppose -42 = l + 10. Let p = -50 - l. Solve 0 = -5m + pj - 19, 5j - 5 = -20 for m. -5 Let o(a) = -6a - 21. Let c be o(-5). Let s = c - 4. Suppose sb - j - 2 + 1 = 0, 0 = 5b + j + 1. Solve -3k = 3m + 15, -2k + bk = 4m + 18 for k. -1 Suppose -2f = -12 - 22. Let r = -2 + 2. Let h be (-2 + 2)/(-2) - r. Solve h = -4o + 5w - f, -w = 3o + 2o + 14 for o. -3 Let i = -162 - -310. Let h = i - 148. Solve 2k - 4 = 3v - 7, h = 4v - k - 9 for v. 3 Let w be 9(1 + 2/3). Suppose -20j + 2j + 306 = 0. Let t = j - w. Solve 3u + 15 = u + 5k, 0 = -tu + 4k - 10 for u. 5 Let o be 1/2(7 + 9 - 4). Solve -4c + 1 = -5m, 0 = 4m + 3c - c + o for m. -1 Let p(d) = -d + 4. Let w be p(2). Suppose 0 = 3t - w - 4. Let a be (1 + t)28/6. Solve -22 = 4l - l + 5q, a = -5l + 3q for l. -4 Suppose -109 = 2p - b - 112, -p = 5b - 18. Solve -4x - p + 21 = -2w, -2x = -2w - 12 for w. -3 Let y(d) be the third derivative of d4/8 + d3/2 - 16d*2. Let i be y(-1). Solve -3j = 7t - 3t - 25, -2t + 4j - 4 = i for t. 4 Let k be 6/(-3)(-5)/102. Let a be (-84)/(-18) - (-2)/6. Solve 2c + av - 2 = 0, 0 = 3c - kc - v + 6 for c. -4 Let z(i) = i*2 - 7i. Let m be z(8). Suppose -4o + mo = 0. Suppose 37 = 5c + 7. Solve -3a - v - c = o, -3v = -2v for a. -2 Let j = 1292 - 1279. Solve -4c - 2a = -j + 1, -c + a + 6 = 0 for c. 4 Suppose 0 = 5r + p - 10, -r - 2p - 3p = 22. Let s be (-11 - -21)(-6)/(-4). Solve -4v = -3f + s, rv - f + 13 = 3f for v. -3 Let h(f) = 3f3 - 7f*2 - 15f. Let s be h(4). Solve -3x - 5 = 2d + 3d, -4x = -s for d. -4 Let n be -163(1 + -2). Suppose -5q + 4t + n = t, -5q + 43 = 2t. Solve 3p = 3g + 18, g - 2p + q = -0g for	{ "pile_set_name": "DM Mathematics" }
+ (-6)/21. 5/6 What is 6/28(69/(-90) + (-48)/(-480))? -1/7 What is (-6)/(-4) + ((-129)/24)/((-1)/4)? 23 What is ((-2000)/4500)/(2/(-45))? 10 What is 6912/9216(-208)/6? -26 (99/4450 + -11)/((-56)/(-16)) 29 Calculate 1(-170)/45 + 4 - 780/108. -7 Evaluate (10 - (-2 - -3))(11 + -38 + 26). -9 What is the value of 700/(-40)(2 + (540/35)/(-6))? 10 Calculate -4 - -2 - 18/(-21). -8/7 1/(-253/(-750)) 10 What is ((-87)/135 - -1) + 80/180? 4/5 Evaluate (-2)/(-13) - 2725/141716/70. -2/7 Calculate (0/(-112))/(1/1) + (-30)/(-27). 10/9 What is 2/2-4 - (-86 + 32 - -36)? 14 Calculate (39/(-26)12)/((-1)/(4/6)). 12 Evaluate 1691/95 - (35 + -20). 14/5 1/1710/14 + 2 7 What is the value of 26/51 - ((-204)/1530)/((-2)/5)? 3/17 What is the value of (-30)/3 - (126/28 - 0)-2? -1 What is (-957)/(-609) + 1/(-1)? 4/7 What is (-33)/77 - (-60)/238? -3/17 What is (10 + 64/(-3 + -5))/48? 1/24 What is the value of (4 - (-84)/(-18))(-4)/1690? 15 Evaluate ((-110)/(-24) + (-660)/198)/(-2). -5/8 What is the value of ((-5670)/36)/6332/(-10)? 8 What is ((-1)/2)/(-1) + ((-2627)/(-74) - 13)? 23 What is the value of ((-2)/3)/(188/846)? -3 Calculate (-20)/25 - (-30)/225. -2/3 What is the value of (3/4)/((-252)/2328) - -7? 1/14 32 - (-26)/((-468)/(-54)) 35 What is the value of 41/((-861)/(-819))1/3? 13 What is the value of ((-9)/3)/((36/(-8))/3)? 2 What is the value of (-10 - 168/(156/(-13))) + (8 - -2)? 14 Evaluate 2 + (-228)/(-14) + 23/(-7) + 3. 18 Evaluate (-208)/(-1768)(-1)/23. -3/17 ((-16)/4 - -5)(-18)/3 -6 What is (-4)/1 + 15/1500-598 + 10? 1/50 Evaluate (30/(-75))/(64/2680) + 6/8. -16 Calculate (0 - (-4)/(-3))(-1296 + 1293). 4 Evaluate (6/(-5))/(-12 + 1746/90 + -7). -3 (-3)/(-21) - (-9)/(-21) -2/7 What is the value of -3 - (25 - 14) - 4-2? -6 Evaluate 31/11 + (6/(-88))/(30/(-80)). 3 What is the value of ((5 - 3)/2 + -2)(-4 - -1)? 3 What is 1723/102 - 5/(11 + -10)? 1/17 What is ((-150)/12)/(320/384)? -15 What is (-30)/(-36)(-8)/10? -2/3 Evaluate (-12)/101240/1984. -3/4 Calculate (-36)/((-4)/1) - (-3)/(-1). 6 What is (-22)/(-2464)64 - 178/(-7)? 26 What is the value of (-494)/(-380) - (-20)/(-25)? 1/2 -5 + -20162/(-90) - 17 14 What is -1 + 319/(-580)(-3 - (-3)/3)? 1/10 Calculate 13 - 7 - (-8 - 759/(-54)). -1/18 480/7920 - (-200)/(-33) -6 Calculate (-66)/(-4)(-9)/(270/(-20)). 11 What is the value of ((-768)/(-112))/(38/(-133))? -24 Calculate 72/(-315)(10 + (-1098)/72). 6/5 Evaluate 9 + 6 + (-5344)/352. -2/11 Calculate (-111)/24 - (-1683)/(-4488). -5 Evaluate 47/(2773/177)5/(-3). -5 Calculate (1022 - 1034) + (-230)/(-19). 2/19 What is 21 + (-64)/4 + (-4 - 32)? -31 What is the value of (-1)/(0 - (-20)/(-8))? 2/5 What is the value of 6 - ((-18)/(-10))/(7/((-35)/1))? 15 5/(-45(-40)/(-11520)) -32 Calculate (14/(-21))/((7 - 14)/126). 12 Calculate (-20(-28)/210)/(2/3) + 5. 9 Evaluate (840/100)/((-4)/34 + (-48)/170). -21 (3/4)/((-184)/736) -3 What is (22/10 - 2)/(171/(-1368))? -8/5 5445/1980 + (-178)/24 -14/3 Calculate (4/12)/(16/384) + -18. -10 Evaluate -12 + 14/65. -1/3 (1296/(-972))/((-2)/9) 6 ((-2)/(-5) + 26/(-40))-44 11 (-19 - 4136/(-220))(2 - 33/39) -3/13 (((-8)/132)/(36/162))/(3/(-4)) 4/11 Evaluate (-4)/(-18)3(17 - (-12348)/(-720)). -1/10 Calculate (-64)/(-44) - (69 - 67). -6/11 What is the value of (54 + -106 + 20)2/(-4)? 16 What is (-28)/(-21)33/(-187)? -4/17 (0 + 1)/(58 + 33198/(-572)) -26 Calculate ((-20)/(-7))/(-21 + 5662/266). 10 (-960)/(-315)3 - 9 1/7 Evaluate (-2)/(-4)(18 - (31 - 11)). -1 (-84)/(-6) - (-15 - (-972)/33) -5/11 -11 + 30247/1192(-3)/(-7) -1/8 What is the value of 6(-4(-581)/(-210) - -9) + 10? -12/5 Evaluate (-37 + 14 - 816/(-36)) + (-176)/(-6). 29 Evaluate (-5 + -3)46/2024. -2/11 Calculate (-8 + (-1328)/(-168))(4 + -1 - 38). 10/3 What is (-5)/(-2)(-10)/(-175)? 1/7 Calculate 0 - (-2)/(8/32 - 0). 8 What is the value of (-30 - -33)/(((-21)/(-12))/(-7))? -12 Calculate -41 + 992/32 + -9. -19 ((-12)/18)/(11/(-18))143/26 6 ((-4)/6)/(-112 + (-15648)/(-1296)) -9 Evaluate (((-1075)/(-250))/(-43))/(4/(-45)-3). -3/8 Evaluate 26 - 10(-9 - -11). 6 What is the value of ((-274)/56 - -5)2(4 - 0)? 6/7 Evaluate 31 - (-1692)/((-1260)/35). -16 What is the value of 6 + -4 - (-364)/28? 15 Calculate (-207)/(-115)((-2)/10 + (-112)/(-60)). 3 (-6)/4((-36)/8)/3-4 -9 (-75 - -63)/((-14)/4 + (-8)/(-16)) 4 What is the value of ((-1)/(-13)-3)/(27(-19)/342)? 2/13 (68 + -39 - 32)1/(-2) 3/2 What is the value of (-14)/5 - 284/(-355) - (-31)/17? -3/17 Calculate (-42 + 32)/((-175)/(-42)). -12/5 Evaluate 24/(-24)(-5 + (-424)/(-88)). 2/11 4/14 - (2632/(-3136))/(6/(-8)) -5/6 (-23088)/1184 + 38/2 -1/2 Evaluate (0 - -2)(-4732)/1352. -7 What is the value of (-32 - -35)(7/(-3) - 2)? -13 What is the value of 9 - (((-784)/(-35))/28)/(4/10)? 7 Calculate (243/18 + -16)(-24)/(-10). -6 Calculate 50/(-46) + -3 + -11 + 60/4. -2/23 What is the value of (-1309)/(-748) + 4 + (-19)/4? 1 What is (-285)/60 + 2552/544? -1/17 Evaluate (-112)/(-210)9/(-2) - -2. -2/5 Evaluate (-4)/(-48)-2 + (-649)/66. -10 Evaluate 17 + (-28 - -16) + (-7 - 1). -3 What is the value of (4/10)/(4 + (-159)/40) + -5? 11 Evaluate (-660)/(-275) - 524/210. -2/21 What is ((-2)/9 - 44/(-36))82/(-287)? -2/7 Calculate 24/(-5) - (-31)/(-155). -5 Evaluate ((-1)/3)/(8/(-6)). 1/4 Evaluate (-310)/4216-817/4. 5/2 Evaluate 2/(-6)(-18)/(-4)20/30. -1 Evaluate (20 - 228/9)/((80/15)/(-8)). 8 630/(-126)9/5 -9 ((-4)/44-1)/(-106 - -107) 1/11 What is (-40)/(-20)(-2 + -10)? -24 What is (-42746)/1206 + (120/27 - 5)? -36 Evaluate ((-596)/(-5960))/((-4)/25). -5/8 What is the value of -61 + 44 - 2816/(-154)? 9/7 What is ((-12)/50)/((-693)/(-1155))? -2/5 Evaluate (-31)/5 - ((-264)/(-55))/(-24). -6 Calculate (18/(-15))/(64/20)(-7)/(-21). -1/8 Calculate ((8/(-24))/(5/(-15)))/(8/40). 5 What is the value of ((-2024)/(-143) - 14)/(-2)? -1/13 What is the value of ((-1)/2 - 1)/(2418/(-52) - -47)? -3 ((-536)/(-48) - 12)/((-2)/12) 5 Evaluate (-2)/5 + 520/800. 1/4 60480/36800 - (-24)/(-15) 1/23 Calculate 1(28/(-294) + (-527)/(-21)). 25 (8 - 5908/728)(-4)/3 2/13 Calculate 1 + (-20)/14 + (47 - 47). -3/7 What is 901/1855 + (-3)/(-63)2-3? 1/5 What is the value of 3/8(-5590)/258 - -8? -1/8 What is the value of ((-9842)/1624)/19 - (-3 + (-340)/(-116))? -1/4 Evaluate (1 - -3) + -11 - (-288)/(-42)-1. -1/7 What is the value of (1 - 0)-17(-1181)/1181? 17 12/(-78) - 220/(-416) 3/8 6/16 - 415/40 -10 (-132)/14 + 495/666/105 -9 1/(70/(-135)) - 180/(-72) 4/7 What is the value of (-86)/(-20) + (-48)/32 + 42/35? 4 What is the value of 0 - (-1)/6 - (-976)/1056? 12/11 Calculate 10 + (90/(-15) - 3). 1 Calculate 1/(-2)(8060/(-420) + 19). 2/21 Calculate (33/(-110))/(-5 - -4)(-8)/(-12). 1/5 Evaluate -20(((-176)/(-110))/4)/((-4)/5). 10 What is -140((-104)/(-91) - 1)/((-2)/4)? 40 Evaluate -37 + 42 - (2 - 152/(-24)). -10/3 What is (32/3 - 2)/((-256)/384)? -13 What is the value of 9 + ((-90)/9 - -3)? 2 What is ((-1)/(1 + (14 - 13)))/((-1)/(-2))? -1 What is (-3 + 9/18965)/((-9)/42)? -4/9 Calculate (-150)/(-15) - -14 - 35. -11 Evaluate 12/((-612)/(-147)) - (-6)/(-2). -2/17 What is (3 - 6)/(231/(-385))? 5 Calculate (1/20)/(10/(-84) + 36/126). 3/10 What is ((-107)/((-2354)/(-132)))/(-7)? 6/7 What is the value of (35/10 - (-10)/(-2))/(4/(-8))? 3 (-112)/(-252)6/16 - (-6431)/(-354) -18 What is the value of ((-60)/(-700)14)/(3/15)? 6 (-200)/(-49980)231 + (-4)/7 6/17 Evaluate 5(-4)/(-20)(-60)/96. -5/8 What is 312055/(-12510) - (-2)/(-36)? -25 What is the value of ((-255)/(-25) - 10)-61 + 28/(-35)? -13 What is the value of (-8)/6(-24 - 1235/(-52))? 1/3 Calculate -7 + (-56)/1428 + (-6)/(-153). -7 What is the value of (933/(-5909))/(1 + -4)? 1/19 What is the value of (15 + 3)3/6? 9 Calculate (35/(-7))/(8/(-8)) + 7. 12 Evaluate ((-96)/128)/(12/42 + (-9)/56). -6 Calculate (60/(-21))/(12/(-21)). 5 Calculate ((-2160)/195 + 11)/(54/120). -6/13 What is (-18(-18)/(-1296))/(6/16)? -2/3 Evaluate 9/12 - (8 - (7850/520 + -8)). -2/13 What is the value of -4 + 9/6(-2002)/(-455)? 13/5 Calculate ((-10)/45)/(510/153 - (-4)/(-2)). -1/6 (78/9 + 2)(195/6 + -33) -16/3 Evaluate -24 - -14 - (-5 - 7). 2 Calculate ((-44)/14)/221. -1/7 (-740)/11655*14/(-12) 2/27 What is ((-1394)/984)/(6/(-144))? 34 What is the value of ((-1125)/(-2700))/(1/(-3	{ "pile_set_name": "DM Mathematics" }
Let p(g) = 1. Let q(j) = -2j2 + 2j - 7. Suppose 0 = -0c - 4c + 8. Suppose 7i - ci - 30 = 0. Calculate ip(r) + q(r). -2r*2 + 2r - 1 Let j(n) = 8n3 + 3n*2 - 3n + 1. Let u(g) = -9g3 - 4g*2 + 4g - 2. Determine 4j(q) + 3u(q). 5q3 - 2 Let t(y) = -8y. Let j be ((-2)/3)/(4/6). Let k(f) = 7f - 9. Let l(w) = -3w + 4. Let a(q) = 4k(q) + 9l(q). Determine jt(b) - 6a(b). 2b Let q(o) = -o2 + 3o + 9. Let t be 3 + -1 + 3-3. Let r be -5 - t - 1-3. Let u(n) = 2n2 - 5n - 14. Calculate ru(c) + 8q(c). 2c2 - c + 2 Suppose -4f = -4n - 0n + 32, 7 = f + 2n. Let p(s) = -4s*3 + 10s2 + 10. Let k(h) = -h3 + 3h2 + 3. Give fp(w) + 10k(w). 2w3 Let c(y) be the third derivative of y4/4 + 4y3/3 - y2. Let u(t) = 15t + 19. Let l(i) = 8i + 10. Let z(f) = 5l(f) - 3u(f). What is -6c(b) - 7z(b)? -b + 1 Let l(n) = 2943n + 72. Let f(c) = 203c + 5. What is 72f(j) - 5l(j)? -99j Let r(y) = -y*2 + 2y - 3y2 + y2 - y2 - 1. Let z(g) = 5g2 + 2 - g2 - 5g + 7g*2. Calculate -8r(u) - 3z(u). -u2 - u + 2 Let n(g) = 0g*2 - 5g + 3g2 + 6 + 0g2 - 4. Let l(w) = w2 - 2w + 1. Give 10l(t) - 4n(t). -2t2 + 2 Let x(b) = -b3 - 1. Let t(y) = y*3 + 6y*2 + 2. Calculate t(i) + 2x(i). -i*3 + 6i*2 Let v(f) = f + 3. Let s(w) = -w - 1. Let i(y) = -2s(y) - v(y). Let l(z) = 4z - 4. Calculate -18i(m) + 4l(m). -2m + 2 Let k be (-21 + -1)7/(-14). Suppose 0o + 5d = o + k, 3o + 20 = 2d. Let i(f) = 8f*2 - 6. Let u(b) = -7b*2 + 5. Calculate ou(t) - 5i(t). 2t2 Let k(z) = -z3 + z*2 - 1. Let w(n) = -3n*3 + 2n*2 + n - 1. Give -2k(u) + w(u). -u3 + u + 1 Let j(m) = -m2 - m - 2. Let o(z) = -1. Let u = -1 - -2. Suppose 2v - 3 = u. Calculate vo(a) - j(a). a*2 + a Let p(r) = 3r*2 - 6r*2 + 3r2 + r - r2. Let n(q) = 4q2 - q - 2. Give n(k) + 3p(k). k*2 + 2k - 2 Let v(l) = -8l + 6. Let u(q) = 105q - 77. Determine -6u(o) - 77v(o). -14o Let u(i) = -4i*3 - 6i*2 + 4i - 1. Let n(j) = 17j3 + 25j*2 - 17j + 4. What is -6n(r) - 26u(r)? 2r3 + 6r*2 - 2r + 2 Let t(i) = 4i + 1. Let u(x) = 3x + 1. Let c(f) = 2t(f) - 3u(f). Let g(y) = 3. Suppose -a = -0k + 2k - 7, k = -2a + 11. Calculate kg(s) + 2c(s). -2s + 1 Let b(k) be the second derivative of 2k3/3 - 4k2 + k. Let o(z) be the third derivative of -z4/24 + z*3/3 - 24z*2. Calculate -2b(m) - 9o(m). m - 2 Let y(b) = 7b*2 - 6b. Let c(o) = 78o2 - 65o. Determine -6c(s) + 65y(s). -13s2 Let y(r) = -2r - 5. Let c(t) = -5t - 9. Determine -3c(g) + 5y(g). 5g + 2 Let o(j) = 3j - 3. Let s(h) = 4h - 4. Give -6o(c) + 5s(c). 2c - 2 Let z(k) = -3k + 2. Let m(n) = -n + 1. Let u be ((-1)/(-2))/(6/60). Give um(o) - 2z(o). o + 1 Let n(j) = 3j. Let v(t) = -6t. Give 14n(o) + 6v(o). 6o Let a(q) = -10q - 11q + 16q - 3. Let r(h) = 2h + 1. Calculate 4a(g) + 11r(g). 2g - 1 Let y(k) = -k2 + k + 1. Let s(p) = 1. Give s(o) + y(o). -o2 + o + 2 Let r(u) = 2u + 5. Let p(s) = -3s + 3. Let c be p(2). Let i(y) = 1. Let x(j) = -3j - 9. Let l(k) = 3i(k) + x(k). Determine cl(a) - 4r(a). a - 2 Let q(t) = t + 1. Let a(z) = 3z3 + 4z + 4. Determine a(n) - 4q(n). 3n*3 Let u(d) = -d. Let b(x) = 4x. Let z(l) = -b(l) - 3u(l). Let c(q) = 2q*3 - q. Give -3c(p) + 3z(p). -6p3 Let p(z) = -z3 - z*2 + z. Let y(q) = q + 4. Let b be y(-4). Suppose 4f - 9f - 25 = b. Let r(a) = 6a*3 + 3a*2 - 6a. Calculate fp(t) - r(t). -t3 + 2t*2 + t Let j(y) = 13y + 9. Let u be (-12)/24 - (-11)/2. Let n(h) = -14h - 8. Let b(g) = uj(g) + 4n(g). Let s(a) = -5a - 7. Determine 4b(x) + 7s(x). x + 3 Let c(j) = 14j3 + 8j*2 - 8j + 5. Let i = 6 + -4. Let v(r) = 3 - 3r + 5r*3 + 2ri - 1 + r2. Give 3c(h) - 8v(h). 2h3 - 1 Let l(c) = 5c. Let x(a) = 64a. Give 80l(v) - 6x(v). 16v Let v(s) = 9s + 2. Let f(w) = -37w - 9. Give -4f(n) - 18v(n). -14n Let u(s) = 2s*3 + 3s*2 - s. Suppose 5b = -b - 24. Let v(g) = 3g3 + 4g*2 - 2g - 1. Give bu(q) + 3v(q). q*3 - 2q - 3 Let t(j) = -j*2 + j. Let n be 3/2 + (-1)/(-2). Suppose -k - 6 = -x - 2, -nk + 22 = 3x. Let w(a) = 4a*2 - 6a + 1. Determine xt(g) + w(g). -2g*2 + 1 Let i(m) = 3m - 14. Let h(b) = -3b + 13. Determine -6h(q) - 5i(q). 3q - 8 Let v(s) = -5s + 7. Let a(x) = -14x + 22. Determine -3a(b) + 8v(b). 2b - 10 Let y be (0 + -3)/(1/1). Let k be (-11)/(y/9). Let q(r) = 4. Let n(v) be the third derivative of -v*5/60 - 5v*3/6 + 33v*2. What is kq(w) + 2n(w)? -2w*2 + 2 Let z(h) = -2h + 9. Let t(y) = -1. Let n(i) = -5t(i) - z(i). Let w(s) be the second derivative of -s3/3 + 3s*2/2 + s. Determine -5n(j) - 6w(j). 2j + 2 Let w be 5/3 + (-6)/9. Let t(a) = 4a - 1. Let r(d) = 1 - 1 + d. Give wt(y) - 3r(y). y - 1 Let q(g) = -17g*2 + g - 11. Let a(z) = 6z*2 + 4. Determine -11a(b) - 4q(b). 2b*2 - 4b Let r(f) = f. Let w(h) = -17h3 + 153h. Determine -306r(n) + 2w(n). -34n3 Let y(j) = -3j - 5. Let f(o) = o + 3. Give -10f(b) - 4y(b). 2b - 10 Let s(c) = -5c*2 - 1. Let v(t) = 1. Determine -2s(o) - 2v(o). 10o2 Let q(w) be the third derivative of w5/60 - w4/8 + w3/6 + w*2 + 9w. Let i(y) = -5y2 + 13y - 4. Give 2i(h) + 9q(h). -h*2 - h + 1 Let v(m) = 17m*2 + 4m + 4. Let a(w) = -w - 1. Give 4a(y) + v(y). 17y*2 Let i(j) = -14j - 1. Let r(y) = 29y + 3. What is 7i(g) + 3r(g)? -11g + 2 Let l(k) = -11k - 5. Let t(h) = -10h - 5. Let y(n) = -6l(n) + 7t(n). Let a(w) = -w - 1. Calculate 11a(q) - 2y(q). -3q - 1 Let l(v) = -17v*2 + 4v. Let x(q) = 390q2 - 91q. What is -91l(w) - 4x(w)? -13w2 Let v = -2 - -7/3. Let y(n) be the third derivative of 1/60n*5 + 0n + vn3 + 1/12n*4 - 2n2 + 0. Let z(m) = m2 + 2m + 2. Determine -6y(q) + 5z(q). -q2 - 2q - 2 Let o(w) = -2w2 - 5w. Let r(a) = -2a2 - 4a. Suppose 5y + 5 + 15 = 0. Calculate yo(g) + 5r(g). -2g*2 Let j(f) = -13f - 7. Let h(w) = 6w + 3. Let r = 0 + 4. Let v be (-68)/16 - (-1)/r. Determine vj(l) - 9h(l). -2l + 1 Let u(i) = -i + 1. Let t(k) = -k*3 + 2k*2 - 2k + 1. Determine t(o) - 2u(o). -o3 + 2o2 - 1 Let o(c) = c2. Let f(r) = -r*2. Calculate 5f(m) + 10o(m). 5m*2 Let v be (6/21)/((-1)/(-7)). Let r(f) = -4f - 2 + 1 + 5 + 2fv. Let k(o) = -5o*2 + 9o - 9. Determine -4k(i) - 9r(i). 2i2 Let n(f) = -f - 5. Let x(k) = -k - 6. Calculate 5n(g) - 4x(g). -g - 1 Let l(a) = -1. Let n(h) = -16h - 176. Calculate -704l(r) + 4n(r). -64r Let k(a) = a3 + 3a*2 + 2a - 1. Let q(w) = w*2 + w - 1. Suppose -d = -0 + 2. Calculate dq(v) + k(v). v3 + v2 + 1 Let k(o) = -4o3 + 3o*2 - 3o - 3. Let x(a) = 7a3 - 6a*2 + 5a + 6. Let h(d) = -5k(d) - 3x(d). Let i(l) = -l*3 + 2l*2 - 2. Give 2h(w) - 3i(w). w3 Let m(y) = -y2 - y + 1. Let p(g) = 12g*2 + 10g - 10. Let i(t) = -5m(t) - p(t). Let o(k) = -3k*2 - 2k + 2. What is 2i(v) - 5o(v)? v*2 Suppose 3 = -3b + 21. Let x be (-12)/(-18) - 28/b. Let u be (14/3)/(2/3). Let h(t) = -2t - 6. Let l(p) = -4p - 11. What is uh(d) + xl(d)? 2d + 2 Let q(l) = l - 1. Let b(u) = -12u + 15. Calculate b(i) + 15q(i). 3i Let m(g) = -1. Let j(a) = 4a. Let v(s) = 1. Let h(i) = -j(i) + 2v(i). Determine -h(f) - 3m(f). 4f + 1 Let v(w) = 0w2 - 13w*3 + 13w + 3w2 + 10 + 4w*2 - 14. Let x(a) = 3 - 9a + a - 5a2 + 9a*3 - a. Determine 5v(n) + 7x(n). -2n*3 + 2n + 1 Let o be 0 + (-5)/22. Let c be (o - -2)/(18/96). Suppose -2 + 22 = -4x. Let k(w) = 10w + 16. Let j(y) = -3y - 5. What is cj(h) + xk(h)? -2h Let b(x) = -3x - 4. Let t(u) = -24u - 33. Let h = 18 - 51. Give hb(p) + 4t(p). 3p Let r(o) = -3o2 + 5o. Let a(q) be the second derivative of -q4/6 + q3/2 + q. What is -5a(i) + 3r(i)? i*2 Let c(h) = -2h - 2. Let f(d) be the second derivative of -2d3/3 - 2d*2 + 3d. Calculate -7c(r) + 4f(r). -2r - 2 Let v(z) = 8z*2 + 11z. Let q(m) = -3m2 - 4m. Let c = -26 - -30. What is cv(b) + 11q(b)? -b*2 Let x(q) = 5q*3 - 3q - 3. Let w(a) = -a*3 - a - 1. What is 3w(r) - x(r)? -8r3 Let i(x) = 15x*2 - 9x + 13. Let z(l) = 7l2 - 4l + 6. Let j be (3 - 7) + (0 - 2). What is ji(t) + 13z(t)? t*2 + 2t Let m be (1 - 2) + 1 + 6.	{ "pile_set_name": "DM Mathematics" }
s -12c(h) + w(h)? -2h*2 + 4h - 2 Let o(l) = l3 + l2 - 1. Let c(j) = 3j3 + 16j*2 - 3j - 1. Let g(x) = -4x3 - 36x*2 + 7x + 1. Let b(y) = 14c(y) + 6g(y). Give 3b(k) - 24o(k). 30k3 Let l(o) = 4o + 2. Let t(k) = 28k + 28. What is 4l(x) - t(x)? -12x - 20 Let u be (-12)/(-30)(5 - 8 - 2). Let l(s) = 1196s2 - 115s - 115. Let p(k) = -21k2 + 2k + 2. Calculate ul(x) - 115p(x). 23x2 Let g(o) = -o3 + o2 + 8. Let x(v) = -9v*3 - 241v*2 + 64. Determine 8g(l) - x(l). l*3 + 249l*2 Let l(a) = 2a + 26. Let d(m) = -30m + 130. Let u(q) = 14q - 58. Let g(c) = 6d(c) + 13u(c). Determine 2g(w) - 3l(w). -2w - 26 Let b(d) = -11d - 3. Let a(p) = -795 + 794 + 0p - 6p. What is 7a(o) - 4b(o)? 2o + 5 Let k(j) = -15. Let n(u) = 2u - 21. Let a(o) = -3k(o) + 2n(o). Suppose 5b + 0 = 10. Suppose 8 = -by - 12. Let s(h) = 9h + 7. Calculate ya(g) + 4s(g). -4g - 2 Let x(o) = 143052445o2 - 224356o + 448712. Let q(s) = 5101s2 - 8s + 16. Determine 56089q(v) - 2x(v). 5099v2 Suppose -101k = -106k + 75. Let s(t) = -5t + 5t2 - t - 5t - 7 + 3t + kt. Let v(m) = 5m2 + 6m - 6. Determine 6s(c) - 7v(c). -5c2 Let b = -11986 - -11979. Let r(c) = -7c*3 - 9c*2 - 7c + 7. Let v(o) = -3o3 - 5o*2 - 4o + 4. Determine bv(n) + 4r(n). -7n3 - n2 Let r(n) = 18n*2 + 10n + 336. Let f(p) = 13p2 + 8p + 335. Determine -4f(x) + 3r(x). 2x2 - 2x - 332 Let a(p) = 2000p3 + 12p*2 + 8p + 2. Let x(g) = -6000g3 - 33g*2 - 22g - 5. Calculate 11a(r) + 4x(r). -2000r3 + 2 Let v(i) = -3i*2 - 8i - 6. Suppose -345 + 10539 = 1699x. Suppose -2b + 3 = -5b. Let u(l) = -l - 1. What is bv(d) + xu(d)? 3d*2 + 2d Let n(j) = -6j2 + j + 5. Let p(d) = 11d*2 + 2d - 32. Determine -2n(v) + p(v). 23v*2 - 42 Let q(p) = 19p*2 + 8p - 4. Let v(x) = 18x2 + 11x - 5. Give -4q(i) + 3v(i). -22i2 + i + 1 Let g(t) = -71t*2 - 45t + 4. Let f(a) = 36a2 + 27a - 3. Let j(r) = -5f(r) - 3g(r). Let w(m) = 395m2 + 35. What is 35j(y) - 3w(y)? -30y*2 Let m be 3(-11)/(-66)2. Let x(l) = -l3 + l2 + l. Let h(b) = b3 - 5b*2 - 6b. Give mh(p) + 6x(p). -5p3 + p2 Let z(y) = -29y*3 - 55y*2 + 33949y - 11. Let t(w) = -16w3 - 30w*2 + 16976w - 6. What is -11t(p) + 6z(p)? 2p3 + 16958p Let z(j) be the first derivative of -3j2/2 - 4j + 6. Let r = 35 - 32. Let a be (-20)/(-12)r - 0. Let l(c) = 4c + 5. Determine al(m) + 6z(m). 2m + 1 Let q(v) = 17v + 291. Let c(o) = -o - 23. Determine -6c(x) - q(x). -11x - 153 Let g(k) = 8k2 + 11k - 263. Let m(h) = 3h2 + 3h - 88. Give 2g(v) - 7m(v). -5v2 + v + 90 Let u(k) = -7k - 16. Let v(r) = -110r - 250. Let x(l) = 95u(l) - 6v(l). Let a(d) = -d - 1. Determine 4a(f) - x(f). f + 16 Let t(a) = -2a2 - 6a + 2. Let d(l) = -2l2 - 7l + 2. Suppose -7 = 885n - 884n + p, -34 = n + 4p. What is nt(g) - 3d(g)? 2g*2 + 9g - 2 Let c(h) = -8h2 - 2h + 1. Let z(a) be the first derivative of -7a3/3 - a2 + 2a + 6531. Give 6c(i) - 7z(i). i*2 + 2i - 8 Let n(q) = -q*2 + 7q - 9. Let y = 5158 + -5163. Let w(f) = -f*2 + 10f - 13. Give yw(o) + 7n(o). -2o2 - o + 2 Let v = -3 - -4. Let r(g) = 2g*3 + 2g*2 - 4g + 2. Let u(y) = -1041526 + 3y3 - y + y2 + 1041527 - 4y*3. Calculate vr(w) - 2u(w). 4w*3 - 2w Let j(r) = 128r3 - 31r + 13. Let n(a) = 64a3 - 14a + 6. Calculate -4j(l) + 9n(l). 64l3 - 2l + 2 Let q(x) be the third derivative of -2/3x3 + 3x*2 + 4 - 1/6x*4 + 0x. Let p = 20 + -11. Let v(k) = k*3 + 9k + 9. Give pq(w) + 4v(w). 4w3 Let j(a) = -6a. Let w(t) = -7t. Suppose -9 = -16n + 13n. Suppose 5i - 22 = -l, ni - i - 16 = 2l. Give iw(h) - 6j(h). h Suppose -17h + 19h = 2z - 2, 3h + 23 = -2z. Let c(g) = 24g*3 - 6g*2 - 6g - 6. Let i(j) = -25j3 + 5j*2 + 5j + 5. Determine hc(s) - 6i(s). 30s3 Let r(s) be the third derivative of s6/120 + s5/60 + s4/24 + s3/6 + 6s*2 - 54. Let b(i) = 3i*3 + 5i*2 + 7i + 6. What is b(j) - 5r(j)? -2j*3 + 2j + 1 Let s(j) = 7j3 + 4j*2 + 2442j. Let u(o) = 5o3 + 3o*2 + 2446o. Give -2s(y) + 3u(y). y3 + y2 + 2454y Let c(y) = -87y*2 - 15y + 4. Let a(g) = 95g2 + 16g - 2. Calculate -3a(d) - 2c(d). -111d2 - 18d - 2 Let h(q) = -1139429246q + 5145536. Let g(w) = -14615w + 66. Determine 233888g(v) - 3h(v). 14618v Let d(q) = 732110q*3 - 1253q*2. Let o(s) = -2339s*3 + 4s*2. Determine 4d(j) + 1253o(j). -2327j*3 Let c(b) = b + 1. Let l(k) = 123k*2 - 33 - 124k*2 - 8k + 0 + 2k. What is -6c(p) - l(p)? p*2 + 27 Let s(q) = 2q*3 - 3q*2 + 3. Let g = 4377 + -4381. Let v(x) = 2x*3 - 4x*2 + 3. Give gs(d) + 3v(d). -2d*3 - 3 Suppose 88u - 20 = 90u + 2k, -4k = u + 22. Let q(s) = 43s + 5. Let p(g) = 43g + 6. Determine uq(l) + 5p(l). -43l Let i(p) = 26p + 4757. Let k(u) = -5u - 12. What is i(w) + 5k(w)? w + 4697 Let q(j) = -9j*2 + 6. Let s(r) = -26r2 + 17. Let d(t) = t2 - 135t + 768. Let k be d(6). Give ks(u) + 17q(u). 3u*2 Let c(t) = 22t - 2. Let l(w) = -45w + 4. Suppose 21210 = 3m + 21219. Give ml(s) - 7c(s). -19s + 2 Let r(h) be the third derivative of -h4/24 + h3/6 - 3751h*2. Let m(q) = q + 7. Determine -m(j) + 5r(j). -6j - 2 Let q(s) = 17s*2 + 161. Let j(k) = -7k*2 - 54. Calculate -17j(l) - 6q(l). 17l*2 - 48 Suppose d + 486 = 28d. Let h(m) = 1 - 40m + 23m + dm. Let y(r) = -r + 1. Determine h(t) - 2y(t). 3t - 1 Let g(j) = -j3 + j2 + j + 1. Suppose 39f = 3f - 0f - 72. Let v(q) = 10q3 + 10q*2 + 10q + 10. Calculate fv(s) + 20g(s). -40s3 Let m(k) = 117k + 86. Let s(i) = -21. Give -m(g) - 5s(g). -117g + 19 Let p(g) = 9g3 + 3g - 5. Suppose 0h + 6 = 2h. Let o(f) = 4f3 + f - 2. Suppose 173c + 55 = -5a + 175c, c - 24 = 2a. What is ao(d) + hp(d)? -d3 + 2d - 1 Let h(m) = 87m + 421. Let y(x) = -41x - 215. Determine 4h(i) + 9y(i). -21i - 251 Suppose 404 = -10m - 311 - 1035. Let n(c) = -900c3 + 175c*2 - 175. Let i(t) = 31t*3 - 6t*2 + 6. Calculate mi(v) - 6n(v). -25v3 Let r(i) = -i2 - 7i - 8. Let h(l) = -2l - 3. Give 14h(m) - 4r(m). 4m2 - 10 Let q(v) = -2923v*2 - 259v + 259. Let r(z) = -z*2 + 83z - 1413. Let b be r(24). Let j(l) = -34l2 - 3l + 3. Give bq(t) - 259j(t). 37t2 Let a(s) = 11s. Let f(n) = -4n. Suppose -d + 30 = 2d. Let x(v) = 18v - 6v - 4v3 - 3 - 11v*2 + 5v*3. Let m be x(d). Calculate mf(r) + 6a(r). -2r Let h(q) = -q*2 + 6q + 71. Let b be h(-6). Let k(f) = 2f + 6 + 6f*3 - 3 - 1 - 2f2 - f3. Let j(n) = n*2 - n - 1. Give bk(g) - 2j(g). -5g*3 Let a(o) = -8o*3 + 6o2 - o + 6. Let g(j) = j3 - j*2 - 1. Let w = 13 - 41. Let s be (-16)/(-6)63/w. Give sg(m) - a(m). 2m*3 + m Let y(i) = 15i*3 + 9i*2 - 784i - 18. Let g(h) = 7h3 + 4h*2 - 392h - 8. What is 9g(d) - 4y(d)? 3d3 - 392d Let x be (-13)/3 - 1/(-3). Let t(g) be the second derivative of -2/3g3 - 7/12g*4 - 50g + 0g2 + 0. Let y(u) = 6u*2 + 3u. Determine xy(m) - 3t(m). -3m2 Let h(d) = -d - 1. Suppose f - 2j = -15, -4f + j = -5f. Let g(b) = -65b - 70. Let c(l) = 32l + 33. Let p(v) = fc(v) - 2g(v). Calculate -25h(w) + p(w). -5w Let a(c) = -8c2 + 1. Let x(u) = 52806u*2 - 6770. What is 20310a(m) + 3x(m)? -4062m*2 Let p(k) = 3k + 8. Let u(c) = 212c - 116. Calculate 28p(r) + 2u(r). 508r - 8 Let r(k) = 20k2 + 4k - 1. Let b(m) = 35m2 + 717m + 3. Let q(o) = 106o2 + 2033o + 8. Let v(h) = -17b(h) + 6q(h). What is -5r(x) + 2v(x)? -18x2 - 2x - 1 Let z(f) = -83f3 + 2f*2 + 2f + 2. Let t(h) be the second derivative of -33h5/4 + 5h*4/12 + 5h*3/6 + 5h*2/2 + 758h + 6. What is -2t(k) + 5z(k)? -85k3 Let o(y) = 13y. Let m(a) be the first derivative of 39a2 + 3072. Give 6m(t) - 34o(t). 26t Let t(u) = -1. Let a = -247593 - -247592. Let y(d) = -d*2 - 5d - 4. Let s be y(-3). Let c(j) = 1 - 6 + s + j. Give ac(v) + 3t(v). -v Let b(n) = 96 - 91 - 190n + 193n. Let x(t) = 5t - 1. Let v be x(1). Let f(a) = -6a - 11. Give vf(i) + 9b(i). 3i + 1 Let d(f) = 6f*2 - 7f + 6. Let j(m) = -7m2 + 2m*2 + 6m + 0m2 - 16842 + 0m**2 +	{ "pile_set_name": "DM Mathematics" }
(-2340) Simplify g(-8)/g*(-2/53)g/g*34g(-3/14) assuming g is positive. g(-30553/742) Simplify vv/v(-3/20)vvvv(2/15)v*(-3/5)v(-9) assuming v is positive. v(-259/60) Simplify (r/r*(-9))/rr*(-8)/r(r/(r9/r))(-45) assuming r is positive. r315 Simplify ((w(-9/8)/w)/(w*(-7/5)w))/(ww(-10)w/(w/w*(1/3)w)) assuming w is positive. w(953/120) Simplify (m/m21)/((mm(-9/5))/m)(m(-11))(-1) assuming m is positive. m(-36/5) Simplify (b(-1)/bb/(bb*14b)bb)/(b*(-2/7)b)(-24) assuming b is positive. b(15/7) Simplify (w*(-2)w)*13(ww13www)/ww(-5) assuming w is positive. w(-2) Simplify gg/g*(-7/5)g*(3/2)(g/(gg(-4)/g))14 assuming g is positive. g(749/10) Simplify (p(-4/5)(p*(-3)p)/p)/((p/p*(-3))/ppp(2/5)) assuming p is positive. p(-41/5) Simplify (j(-14)j*(3/4)j)38 assuming j is positive. j(-931/2) Simplify (jj(-2/51))/(j/j(6/7))((jj/j(-12))/j)/jj(-11) assuming j is positive. j(649/357) Simplify ((rr2)/(r/(r5r)))/(r/(rrr(-6)))(-25/4) assuming r is positive. r(157/4) Simplify (i(-1/13)/(iii/i*(2/11)))/(ii*(-3/11)i/i*22i) assuming i is positive. i(2342/143) Simplify q7/qqq/(qq(-7/3)/qq)(qq*(1/9))/qq(-1/3) assuming q is positive. q(82/9) Simplify ((m*11/(mm/(m/((m/m(-1/13))/m))))/((m/(m(1/5)/mmmmmm))/(m/(m/m(-5/7))m)))(-11/4) assuming m is positive. m(-67111/1820) Simplify (y*(-15)y(-17))/(y8)(16/5) assuming y is positive. y(-288/5) Simplify (b((b/(bbb/b12))/bb)/bb)/bbbb*2b*(1/6)bb/(b/(b(b*11/b)/bbb)) assuming b is positive. b(163/6) Simplify ((r(2/5)/rr)*(-1/10)r*(-1)r/r(1/5))(-24) assuming r is positive. r(144/25) Simplify (z12zz(6/5))/(z0z(-2/9)) assuming z is positive. z(649/45) Simplify (p(1/3)/p(-2/3))3 assuming p is positive. p3 Simplify ((j(7/2)j(2/5))/(j(-1/2))(-3/23))36 assuming j is positive. j*(15876/115) Simplify nn*(-3/8)(n/(n(nn/(nn(-2/79)/n))/n))/nn*(4/3)/(n/(nn(3/28))) assuming n is positive. n(533/13272) Simplify r*(-3)/(rrr/((r(-3/5)r)/r))((rr/(r/((r/(r(r(10/3)/r)/rr)r)/r))r)/r)/(r/r(-2/11)) assuming r is positive. r(-1504/165) Simplify (((r*5r)/r)/(rrrr(-3/14)/rrrr))/(((rr/(r/r(-5/7)))/rr)/((r/r7)/r)) assuming r is positive. r(-99/14) Simplify ((qq(-16)q)/(qq(-1/38)))(-14) assuming q is positive. q(3983/19) Simplify (tt*(9/5)t)*20/((tt14/t)/t)23 assuming t is positive. t(-223) Simplify q(-7)/(((q*8/q)/q)/q)q(-4/7)/q(-1/3) assuming q is positive. q(-257/21) Simplify (a6)29/(a(-3/4))(-46) assuming a is positive. a(279/2) Simplify (j(2/13))31(j(1/5))(1/4) assuming j is positive. j(1253/260) Simplify (d/(d(-9)/d))/(d/(d/d(2/9)))(d/(d/d*2)d)(5/8) assuming d is positive. d(911/72) Simplify (c*(3/5)c)*(-14/15)(c/((cc(-15)c)/c))/c(-2/17) assuming c is positive. c(17371/1275) Simplify (i(-8)/(i/i(-34)))(-23) assuming i is positive. i989 Simplify (g*(2/13)/gg)*(-33)g/((g/g*(1/2))/g)g/((g*(5/4)g)/g) assuming g is positive. g(-199/52) Simplify (q/q(-2/31)q((qq(1/8))/q)/q)/(q(3/5)/(q/(qq*20qq)q)) assuming q is positive. q(-25309/1240) Simplify (p(-1/3))*(7/5)/(pp*(-2/33)ppp/(pp(-2/9))p) assuming p is positive. p(-2291/495) Simplify ((i/(i31ii))/i(2/5))/(i(-15))(11/4) assuming i is positive. i(177/20) Simplify ((fff(1/2))16(f(ff/(f(1/2)f))/ff)(1/21))(8/7) assuming f is positive. f(2244/49) Simplify ((i(-30)i/(ii(-29)))(2/51))(2/29) assuming i is positive. i(-4/1479) Simplify (k(-13)/(kk/(kk18kk)))/(k(-3)/k(8/7)) assuming k is positive. k(71/7) Simplify (n(-7/4)n)/nnn*(-9)/n(n*(5/4)/n)/nn/(nn2/n)n assuming n is positive. n(-23/2) Simplify w(7/4)w9w13/w(-6) assuming w is positive. w(119/4) Simplify n8/(nn(2/23))(n(-6)/n)39 assuming n is positive. n(-6120/23) Simplify (m5/m*(-1/2)m*(-3/4)m(-1/2))(1/4) assuming m is positive. m(17/16) Simplify (a13/(a*(-18)a))/(aaa/(aa/(a/(a/a(-2)))a)aa/(a(-1/8)/a)) assuming a is positive. a(231/8) Simplify (((n(3/10))(-12))(-9))(-4/11) assuming n is positive. n*(-648/55) Simplify (hh(-8)/h)/h(2/3)(((hhh(-1))/h)/h)(-1) assuming h is positive. h(-23/3) Simplify n31n/n*(14/9)((n/n(-3))/n)(-9/7) assuming n is positive. n*(1675/63) Simplify (qq*(-1/8)/qq)*1qqqq(-4)qqq*(-18)q assuming q is positive. q(-121/8) Simplify (m5/m)*(-50)/(m(m/m*6)/mm)(-33) assuming m is positive. m(-332) Simplify ((q/((q/((q/((qq(-2/85))/q))/q))/q))/(q14/q))11 assuming q is positive. q(-11198/85) Simplify ((r3r)/rr(-1/15))/((r/r(-2/17))/(rr(-6/7))) assuming r is positive. r(3496/1785) Simplify (p0)39(p(-16/9)/p)/p(3/13) assuming p is positive. p(-352/117) Simplify g2ggg*(-10)/g(g(-2))(-7/4) assuming g is positive. g(-7/2) Simplify x(-27)x(-9)/xx*(1/2)/xx(-15/8) assuming x is positive. x(-315/8) Simplify (zz/(zzz/z(-2/13)))(-3/20)/(z(20/3)z(z/(z(-12/7)/z))/zz) assuming z is positive. z(-12239/1092) Simplify ((k(-2/9))*(-48)(kk(-2/3)/k)(2/33))(-4) assuming k is positive. k(-4208/99) Simplify ((zz(1/4)/z)47(z(-2/7))17)(-25) assuming z is positive. z(-4825/28) Simplify (c(-4/9)cc(3/2)cc(-8)c/(cc/(c/c(2/19))))(5/9) assuming c is positive. c(-8635/3078) Simplify (s/s(3/5)s16)(4/7) assuming s is positive. s(328/35) Simplify (o(-15)oo*(-14)oo)/((o(-4/3)/o)/(oo/((o*(-23)/o)/oo)o)) assuming o is positive. o(10/3) Simplify ((yy(-1))(-41)(yy*(1/4)y)(36/5))(-3/22) assuming y is positive. y*(-243/110) Simplify ((a/(a(aa(-2/23))/aa))/aa9)(-37) assuming a is positive. a(-6031/23) Simplify h(-1/4)h(h/h(-10))/hh(-1)/(h/h(-3)) assuming h is positive. h(23/4) Simplify ((v7v)/(vv/v(3/7)))/(v(-5)/(v*(1/5)v)) assuming v is positive. v(442/35) Simplify ((j7/(j(j0j)/j))/(j*1j/j(4/5)))(-2/51) assuming j is positive. j*(-16/85) Simplify (ssss/(((ss0)/s)/ss))*(-27)s(-2)/(s/(s/(s/(s14/s)))) assuming s is positive. s*(-98) Simplify ((jj*(-4/7)j)/(j/(j/(jj(-5)j)))(j(2/17)j)/(j(j(1/18)/j)/jj))(-45) assuming j is positive. j(-58805/238) Simplify (h(-9/7)/(h23/h))/(h/(h/(h/(h/h*(-3/2)h))))(2/135) assuming h is positive. h(-4394/189) Simplify (c/(cc12c)(c(c/((cc/(c(c/(cc(-1/6)cccc))/c))/c))/cc)/cc)/((c0c)/(ccc(-2/11))) assuming c is positive. c(-991/66) Simplify ((s/s*21s)(1/31))(-29) assuming s is positive. s*(551/31) Simplify (bb/(b(-8)/b))(-49)b(-27)b(-7/5) assuming b is positive. b(-2837/5) Simplify ((s(-3)/s)/(s/(s(-6)s)))/(s(-1/14)s*(-13/5)s) assuming s is positive. s*(-583/70) Simplify (hh(-3))(9/10)/((hhhh2h)/((h*(2/11)h)/hh)) assuming h is positive. h(-364/55) Simplify (((((a(10/3)a)/a)/a)/a(-2/13))(-10))(4/19) assuming a is positive. a(-3880/741) Simplify (p*(3/4)/p)/p(p/(p*(-5)p))/pp(p(-4))40 assuming p is positive. p(-625/4) Simplify (a(-5)a/a(-8))(1/50) assuming a is positive. a(2/25) Simplify ((v(-4/7)/v)/v)8/((v((v/(v1/v))/v)/v)/v)(-10) assuming v is positive. v(-214/7) Simplify (u/u(-1/26)u(-2/31))(-28) assuming u is positive. u(-10990/403) Simplify (u/(u/(u14/u)u))*(1/54)uuuu/(uu*(-3/5))u/((u/((u/(u/u*(-4/5)))/u))/u)u assuming u is positive. u(181/45) Simplify (q(-6/13)qq)/(q/((qq/(q/(qqq(10/9))q))/q))(q(4/9)q)(-13/4) assuming q is positive. q(-319/156) Simplify (ssss(-6))(2/3)((s/(ss8))/s)/(ss(-7/3)) assuming s is positive. s(-29/3) Simplify (kk/(k/k2k))*(-1/47)k*9k/(kk/((kkk13)/kkk)) assuming k is positive. k(1126/47) Simplify ((ww22)(-45))(1/12) assuming w is positive. w(-345/4) Simplify ((p/(p/((p*(-9/4)pp)/pp)))/pp)/(p/(pp*(-4))p)p/p(-1/6)p((p/(pp5))/p)/p assuming p is positive. p(-121/12) Simp	{ "pile_set_name": "DM Mathematics" }
f t5/30 + t4/6 - t*3 - 11t*2 + 3. Let r be d(6). Suppose -p = 5p - r. Solve 6h = h + p for h. 3 Suppose -44j + 179 = -43j. Let p = j + -175. Solve 7g - 5g = p for g. 2 Let a(l) be the third derivative of -37l6/120 + l5/30 - 5l4/24 + l3/2 + 31l*2. Let b be a(1). Let n = -35 - b. Solve -2p - 6 = -n for p. -2 Let n be (3/(5 + 1))/(2/24). Let q be (-352)/(-20) + n/15. Suppose 196o - 195o = q. Solve -5b - 2 = o for b. -4 Suppose 0 = -4s + t + 53 + 275, 3s = t + 244. Solve 44 = sj - 95j for j. -4 Let a = 155 - 157. Let x be (a/(-6))/(5/15) - -1. Solve 0 = -xs - 3s - 10 for s. -2 Suppose 27i - 18i - 162 = 0. Let h(s) = s2 - 13s - 87. Let j be h(i). Solve -jo - 12 = -3 for o. -3 Let x(c) be the second derivative of c4/6 + 53c*3/6 - 11c*2 + 2c + 3. Let u be x(-27). Solve 0d = ud for d. 0 Suppose 1552 = -16z + 1616. Solve -87 = -zv - 99 for v. -3 Let m(x) = -x*3 - 20x*2 - 19x - 2. Let y be m(-19). Let u be y - ((-8)/2 - -2). Let b be u - -2 - ((-10)/2 + 5). Solve br - 6 = 5r for r. -2 Let m(x) = 31x + 270. Let j(p) = -47p - 405. Let f(b) = -5j(b) - 7m(b). Let a be f(-7). Solve 0 = -3q + a for q. 3 Let v(u) = -u3 - 7u*2 + 6u - 4. Let p be v(-6). Suppose -2112 = 1387c - 1365c. Let l = p - c. Solve a - l = -3a for a. 5 Suppose 62s - 60s = -5u - 10, 0 = 3s - 2u - 42. Solve 24 = -7j + s for j. -2 Suppose 28f - 33f = -33f + 616. Solve 6o = fo - 96 for o. 6 Let p = 16336 - 16336. Solve p = -51w + 60w + 18 for w. -2 Let d(x) = -x*2 + 4x - 5. Let r be d(2). Let b be (-954)/(-117) - (4/(-26))/r. Solve 2 = 2s - b for s. 5 Let d = 1686 - 1655. Solve 14l + d = -11 for l. -3 Let n = 23373 - 23333. Solve 42l = -nl + 72l for l. 0 Let d = 4607 + -4597. Solve 10n + 30 - d = 0 for n. -2 Let r(t) = 55t2 - t - 9. Let u be r(-3). Suppose -3s = 438 - u. Solve 0 = 5k - 42 + s for k. 5 Let b be (-1224)/17(-3 + 3 + -2). Let q be (6/(-8))/((-54)/b). Solve -3y = -0y + qy for y. 0 Let t(w) = w2 - w + 1. Let p(g) = 9g*2 + 37g + 16. Let j(b) = -p(b) + 6t(b). Let o be j(-14). Let h be ((-4)/(-18))/(3/27). Solve 0l - hl + o = 0 for l. 2 Let a(g) = g3 - 11g*2 + 18g + 12. Let s be 6/33 - (-356)/(-22). Let m be (-3)/(-12) + (-140)/s. Let w be a(m). Solve -w - 8 = 5q for q. -4 Let s(g) be the third derivative of -7g*3 + 0 + 7/12g4 - g2 - 1/60g5 + 0g. Let m be s(9). Solve -17 - m = 4h for h. -5 Let f(s) = -s3 - 8s - 9. Let x be f(0). Let z be 6/x-9 - 1-2. Suppose 24 = 6a - 0a. Solve ar + 12 = zr for r. 3 Let k be (39 + -1)/1 + 79/((-2449)/(-248)). Solve -kx + 25 = -113 for x. 3 Let y be (-12)/(-9)(-7 + -8). Let l = y - -23. Suppose 0 = -r + 3j + 7, 0r + 4r - lj = 10. Solve w - r = 2w for w. -1 Let q = -1101 - -1127. Solve -14 = -12j + qj for j. -1 Let r = -513 + 520. Suppose -y + 11 = -d + r, 0 = -y - d + 4. Solve -8 = yp + 12 for p. -5 Let s(p) = p + 11. Let x be s(-3). Suppose 0 = 5r - xr + 30. Solve -3o = 1 - r for o. 3 Let t be (0(-6)/36)/(25 + -24). Suppose 5o = -5c + 20, -5o + 4 + 7 = -4c. Solve t = r + c for r. -1 Let p be 4/10 + 348/(-20). Let a = p + 24. Suppose -d - 21 = 3n, -3n - 33 = -5d - 12. Solve d = -2c + ac for c. 0 Let z(m) = 17m*2 + 114m + 4. Let o be z(-11). Solve 8r - 759 = -o for r. -6 Suppose -18 = -5q - 3k, -2k - 13 = 2q - 21. Suppose 3m + q + 2 = 2z, 0 = 4z + 2m - 18. Solve -l = -zl - 9 for l. -3 Let k(b) = 22 + 34b + 29b + 24b - 85b. Let f = -16 + 6. Let q be k(f). Solve 6 = qz - 5z for z. -2 Let p(t) = 2t3 - 9t*2 + 16t - 48. Let w be p(4). Solve w = 2x + 136 - 150 for x. 7 Suppose 3n + 14 - 26 = 0. Let z(o) = 2o2 + 54o + 197. Let i be z(-4). Solve -i = 17c - nc for c. -1 Suppose -5q + 5 = -5b, 31b - 3 = q + 34b. Solve x + 3x + 7x = q for x. 0 Let x(g) = 7g - 88. Let s be x(13). Suppose sn + 21 = 6n. Solve nv = -21 - 0 for v. -3 Let l(b) = -285b - 518. Let z be l(-2). Solve -z = 8f - 21f for f. 4 Suppose -33 = -14v + 3v. Suppose -3 = -vx + 6. Suppose -xz = -6z + 6. Solve -3 = 3q - zq for q. -3 Suppose -21s = -510 - 582. Solve -53n + sn = -4 for n. 4 Let b(s) = s + 1. Let p(f) = 2f + 80. Suppose 15 = -4o + 4r + 3, -o = -5r + 19. Let n(q) = op(q) + b(q). Let c be n(-24). Solve 3m = -0 + c for m. 3 Let g = 13776 - 13638. Solve -23r + 69r - g = 0 for r. 3 Suppose 5z + 19 - 3 = 2m, 2z + 4m = 32. Solve -12t + 435 - 399 = z for t. 3 Suppose 17l = 15l + 8. Suppose 6a - 68 = l. Solve -2r = r + a for r. -4 Let g = -45 + 34. Let f be -7 - g - ((-26)/1 - 0). Suppose -f = -5m + 5h, -3h - 17 = -4m - 6h. Solve 3i + 7 = -m for i. -4 Let u(w) = -w*3 - 2w*2 - 2w - 3. Let k be u(-3). Suppose -3o - 10 = -34. Suppose oq - k = 2q. Solve -10 = -qx + 4x for x. -5 Let l = -8655 + 8657. Let g = 12 - 8. Suppose 0w - gd = -5w + 14, lw = -2d + 20. Solve -3x + 0x - w = 0 for x. -2 Suppose -d = -2p - 196, -3p = -4p - 5d - 120. Let o be ((-9)/(-5) - 1)/((-10)/p). Let y = -6 + 8. Solve -ya = -0a + o for a. -4 Let h(b) = 5b - 52. Let t be h(14). Suppose 11w = tw - 28. Solve wo - 4 = 16 for o. 5 Let a be 2-5(-5 - 72/(-16)). Let r be 19/a + 180/150. Solve 6s = -7 - r for s. -2 Let d(o) = -4o*3 + 8o*2 + 5o - 17. Let i(v) = 5v3 - 9v*2 - 4v + 18. Let t(a) = -4d(a) - 3i(a). Let l be t(6). Solve -l - 1 = -f for f. 3 Let q(u) = -u*3 + 14u*2 - 13u + 3. Let p = 33 + -20. Let y be q(p). Let k(n) = 2n2 + 15n - 17. Let r be k(1). Solve -v + yv = r for v. 0 Let x be (-720)/96((-4)/(-6) + -2). Suppose 23j - 442 = xj. Solve 26 - j = 4o for o. -2 Let d(v) = 17v + 922. Let f be d(-53). Solve 9a + f - 3 = 0 for a. -2 Suppose 0 = 2z + 3z - 2n - 31, 5z - 28 = n. Solve -zh = -37h - 128 for h. -4 Suppose l - 115 = -91. Suppose -340 = -lv + 7v. Solve -8a - v = -52 for a. 4 Suppose 1295 = 34b + b. Suppose bc + 200 = 607. Solve -5r = -c - 14 for r. 5 Let w(q) = -4q + 30. Let u be w(-9). Suppose 8h = 5h + u. Suppose 5a - h - 18 = -4p, -3a = -2p + 20. Solve 0 = r + r + p for r. -5 Let f be (-44770)/(-666) - (-2)/(-9). Solve 34s - f = 35 for s. 3 Let n = -25 - -31. Let z(b) = -n - b - 3 + 15 - 7. Let f be z(-3). Solve -5t + ft - 3 = 0 for t. -1 Suppose 36 = 4u - 0z + 3z, -8 = 2z. Suppose -2p + 3n + 9 = -8, 3p + u = -3n. Solve -t - p + 0 = 0 for t. -1 Suppose 0 = -2o + 8 + 6. Suppose -5b + 14r + 20 = 9r, 4b - 15 = 5r. Suppose -x - q = 4q + b, 5q = -10. Solve -o = -xt + 3 for t. 2 Let l(f) = -f*3 + 6f*2 + 10f + 3. Let j be l(7). Suppose -188 = -26k - 32. Suppose 2y = j + k. Solve 4n + y - 3 = 0 for n. -3 Suppose 5t = 8t - 3. Suppose 3h = -3g + 3, -g + h = -4g + t. Let n be (-8)/((-40)/15) - g. Solve nu = -0u - 3 for u. -1 Let f(a) = 3a + 20. Suppose 21 = 4u - 5y - 128, -u + 2y = -38. Suppose uh - 12 = 39h. Let z be f(h). Solve -2i = z - 2 for i. -3 Let w = 1 - 71. Let q be (7/2 - 1)(-168)/w. Suppose 5y - 4o = 29 + 5, 2y = -o + 24. Solve -f = -qf + y for f. 2 Let c(l) = l*3 + 7l*2 + 34l - 206. Let b be c(5). Solve -bw = -269w - 15 for w. -3 Let d = -11978 - -12001. Solve dn - 762 + 670 = 0 for n. 4 Let q(g) = 3g + 2. Let p be q(-10). Let s = -10 - p. Let y be (-15)/(-10)(-8)/s-3. Solve -yl - l - 6 = 0 for l. -2 Let r(y) = -11y*2 - 4y - 2. Let t be r(-4). Let f = 190 + t. Solve 0 = 7d - f - 0 for d. 4 Suppose 19r = 15r. Let z(m) = -7m*2 + 163m - 44. Let n be z(23). Solve ns - s + 2 = r for s. -2 Let a(y) = 2y*2 - 26y - 29. Let l be a(12). Let g = l - -59. Solve gu - 11u = 15 for u. -3 Suppose 113v = 116v - 723. Let a = v + -236. Solve 6q - aq - 3 = 0 for q. 3 Let x(g) = 8g2 + 4g + 4. Let c be x(-1). Let o(v) = -v + 8. Let k be o(c). Solve k = 3b - 11 + 14 for b. -1 Let q be -47/5610. Let a be (20/(-14))/(q + (-102)/(-21)). Solve -an = -8n for n. 0 Let r be (-3)/(46/(-40) + 1). Let k be (0/14)/(19 + -18). Solve 3w + w - r = k for w. 5 Let s be 72/(-45) - 6/(-10) - -3. Let c be s/10-3 - (-552)/120. Solve -cu - 2 = -10 for u. 2 Let s(q) = 2q2 + 258q - 908. Let x be s(-133). Solve -x = 100i - 74i for i. -6 Suppose -5h + 3m - 404 = 0, h + 254 = -2h - 4m. Let r be (h/(-8))/(8/(-32)). Let v = r + 56. Solve 5*y + v = -0 for y. -3	{ "pile_set_name": "DM Mathematics" }
65 = 33. Suppose -296 = -gq + 5v, -v = 2q + 11 - 283. Does 69 divide q? True Let l be 20/3 + 44/(-24). Suppose 0 = u + lu. Suppose u = -2i + n + 39, 0n - 39 = -3i - 5n. Is i a multiple of 6? True Let m = -5 - -8. Suppose 107n - 114n = -21. Suppose 0 = -nd - 12, -my + 2d = -d - 84. Is 22 a factor of y? False Let b = 10 + -33. Let l be 1 + -1 + (154/(-22))/(-7). Is lb/3(-18)/6 a multiple of 13? False Suppose -6974h = -6979h + 99675. Is h a multiple of 15? True Is (15/6 - 889/14-145) + 1 a multiple of 151? True Suppose -20i + 36i = 18848. Is 19 a factor of i? True Suppose -188782 = -2061w + 2057w - 2z, 5z + 47212 = w. Is w a multiple of 56? False Let x(q) = q3 + 23q*2 - 26q - 53. Let t(f) = -4f3 - 70f*2 + 78f + 161. Let d(u) = -2t(u) - 7x(u). Does 35 divide d(21)? True Is 9 a factor of 624/572 + 985862/22? False Is 13 a factor of ((-893)/94 - -6)(60400/(-14))/2? False Suppose 244t = -2q + 245t + 2766, -q + 3t + 1388 = 0. Does 44 divide q? False Let y(a) be the third derivative of -a5/30 - a4/8 - 7a*3/2 - 21a*2. Let m be y(-5). Let t = m - -107. Is t a multiple of 5? False Let r(u) = 24u - 28. Is r(17) a multiple of 115? False Suppose 0 = -3m - 5k - 383, 8k - 11k = 2m + 255. Suppose f = 2l - 94, -4f + 5l - 132 = 259. Let r = f - m. Is r a multiple of 11? True Suppose -4c - 2q + 28 = 0, 0 = 4c - 3q - 10 - 18. Suppose 10o - 3 = co, 0 = -h - 3o + 6. Does 2 divide h? False Suppose -47240 = -40b - 5015 - 2425. Is b a multiple of 25? False Let x = 569 + -577. Let u(l) = -l*3 - 3l*2 - 4l - 16. Does 7 divide u(x)? True Suppose -5386 = 44d - 54d - 116. Is 110 a factor of d? False Let l = 502 + -258. Suppose -7c - 183 = l. Let d = 112 + c. Is d a multiple of 12? False Suppose -19102 = -2q + 4d, 2d + 7 - 19 = 0. Does 2 divide q? False Let t(b) = -b2 - b. Let j be t(0). Let s(h) = 290 + h - h3 + jh3 - h + 2h. Is s(0) a multiple of 18? False Suppose 0 = -108l - 65l + 123l + 317500. Is l a multiple of 4? False Let n(w) = -w3 - 65w*2 + 19w - 939. Is n(-66) a multiple of 3? True Let j = 2156 - 1400. Suppose -8p + 9p - j = 0. Is 12 a factor of p? True Suppose -2m = -3c + 17, -4c = -m + c + 9. Is (-6452)/m + -2 + 7/4 a multiple of 47? False Let k(a) = 5a*2 + 0 + 5a + a + 2. Let c be 2(-15)/101. Is 12 a factor of k(c)? False Let t(p) = -p*3 + 5p*2 - 6p + 11. Let v be t(4). Suppose vb - x = 1313, -8x + 10x + 10 = 0. Is 4 a factor of b? True Let o(x) be the third derivative of -x6/120 - x5/5 - 25x4/24 + x3 - x*2 + 24x. Is 51 a factor of o(-12)? True Let j(v) = 2v - 46. Let i be j(27). Does 54 divide -1(-5)/20 - (-2670)/i? False Let r be (8/10)/(-4)0. Suppose 33c - 2390 - 3583 = r. Is 4 a factor of c? False Let g(q) = 4633 + q - 4666 - 5q. Suppose 5a + 2 = -4b - 40, -5a + 2b - 54 = 0. Is 5 a factor of g(a)? False Let u = -537 + 548. Let k(j) = 7j*2 + 9j - 25. Does 35 divide k(u)? False Suppose -w - 6w = -2128. Is (36/(-16))/((-12)/w) a multiple of 19? True Let u(m) = 9m - 68. Let d be u(8). Suppose 5l - dl = 294. Does 14 divide l? True Let v be 8/(-44) + 13262/(-22). Let w = 734 + v. Is w a multiple of 11? False Is 39 a factor of ((-61)/2)/(30/(-4380))? False Suppose -564r - 47980 = -584r. Is r a multiple of 27? False Suppose -2p = -2j + 364 - 2682, 4p + 5j - 4600 = 0. Is p a multiple of 11? True Let m(s) = -103s + 7. Let i = -32 + 34. Let j be m(i). Does 22 divide j/(-3) - 1/3? True Suppose 113h - 4798880 = 370079. Is 15 a factor of h? False Let w(h) = h + 13. Let u be w(-4). Let p be (-1 + 34/4)/(u/12). Suppose 512 = 18k - pk. Does 8 divide k? True Suppose -22 = 2w - 2k, -2k = -w - 0w - 8. Let j(b) = 12b - 5 - 26 + 57b - 84b. Is j(w) a multiple of 21? False Let w(s) = 10772s*2 + 139s + 140. Does 27 divide w(-1)? True Let l = -394 - 116. Let p be l(16/(-10))/4. Does 3 divide (1 - 1/3)/(4/p)? False Let i be 2 + 2 - (1 - 4). Suppose 3c + ic = 4840. Let t = c - 296. Does 14 divide t? False Let j(c) = c2 + 11c + 6. Let w(p) = 2. Let v(a) = -j(a) + 6w(a). Does 12 divide v(-9)? True Suppose -3l + 10l - 560 = 0. Let p = 230 + l. Is p a multiple of 31? True Let o(a) = a3 + a2 - 23a - 19. Let s be o(-5). Does 16 divide (14/(-5))/(s4/4960)? False Let v(t) = t3 + 36t*2 + 28t - 8. Does 6 divide v(-26)? True Let w(l) = 2l + 1. Let g(j) = -11j - 33. Let p(s) = g(s) - 3w(s). Is 33 a factor of p(-10)? False Let d(u) = -5u + 65. Let j be d(13). Suppose j = 13a - 2a - 1474. Is 10 a factor of a? False Suppose -4a - a - 3z = -46, -4a - 5z + 42 = 0. Let k(c) = 3c2 + 2c - 30. Let p be k(a). Let i = p - 90. Does 17 divide i? False Let m(j) = -j*2 + 4j + 6. Suppose 0 = 3x - 3n + 21, -5x + 1 - 36 = -3n. Let s be m(x). Let l = 60 - s. Is l a multiple of 43? False Let z be -71 - (-19 + 15). Let v = z + 5. Is 14 a factor of 74 + v + 0 + 1? False Let m(b) = b2 + 22b + 105. Let r be m(-6). Suppose -11y + 15580 = ry. Does 8 divide y? False Suppose -2220596 = -52t - 292t + 60t. Is 7 a factor of t? True Is 3/8 - (91 + -89 + 129549/(-8)) a multiple of 130? False Suppose 100i - 102i - 4374 = -5z, 4z - 4372 = 2i. Let s = -1226 - i. Is 66 a factor of s? False Suppose 337i - 342i + 4994 = -a, -4a - 1976 = -2i. Is i a multiple of 8? True Let a(i) = i*3 - 15i*2 - i + 19. Let g be a(15). Let t be g/(-28) + (3693/(-21) - -1). Let q = 85 - t. Does 20 divide q? True Let o(r) = -51r*3 + 39r*2 + 49r + 42. Is o(-6) a multiple of 104? True Does 5 divide ((-1)/(-30) + (-4)/(-24))12085? False Suppose -4t = 3q + 4, 11q - 6q + 15 = -5t. Does 9 divide (-4)/(-3) + q + (-2853)/(-27)? True Let t = 9544 + -2105. Is t a multiple of 17? False Let h(t) = 25t - 87. Let k be h(-36). Is 11 a factor of k/(-6) + ((-7)/(-2) - 3)? True Suppose -64n + 311564 = -21n + 30n. Is n a multiple of 97? True Let d be ((-40)/(-6) + 0)(-264)/20. Let t = d - -250. Does 27 divide t? True Let f be (9/2 + -4)4. Suppose 5o - 334 = -b, 3b = 2o + fb - 128. Let z = o - 45. Is z a multiple of 9? False Let a = 175 + -168. Suppose 4z = 5q - 2183, aq - 2z - 1311 = 4q. Is q a multiple of 58? False Let q(n) = n3 + 13n*2 - n + 8. Let g be q(-13). Suppose 5o = 3w + 91, g = -4o + 5o - 2w. Is 2 a factor of o? False Let p be (-1)/(-2) + 31/2. Suppose -80 = -3a - pa. Is 16 a factor of 1 + (3 - a)-3? False Let b = -12 - -6. Let j be (-4)/(-12) - 10/b - -28. Let t = 65 + j. Is t a multiple of 22? False Suppose -4k + 4170 = 2a, 2075 = a - 4k + k. Does 87 divide a? False Let v(o) = o3 + 7o*2 - 23o - 41. Let p be v(-9). Suppose -3h - 3i = -894, 353 = h - pi + 55. Does 9 divide h? False Suppose -105 = 46n - 11n. Is 47 a factor of (-47)/1(1 + -8 + n)? True Suppose 241500 = 292l - 269l. Is 100 a factor of l? True Suppose -5n + 13661 + 4616 = 3a, 0 = -4a + n + 24377. Does 22 divide a? True Suppose 1088 = f - 3i, -i + 6i - 10 = 0. Let l = 3018 - f. Is l a multiple of 27? False Let b(j) = j2 + 16j - 47. Let l be b(-22). Suppose -la - 7380 = -95a. Is a a multiple of 18? True Let t(j) = -2j2 - 22j + 28. Let o be t(-12). Let q(u) = 60u + 14. Let g be q(o). Suppose 2n - 18 = g. Is n a multiple of 34? True Suppose 2 = 3x - 4. Suppose 0 = xq - 10s + 5s - 21, 4q = 2s + 18. Does 8 divide q(-22)/(-3) - -1? False Let h(z) = 3z + 110. Let l be h(-35). Suppose -165 = -lc + 4c. Is 55 a factor of c? True Let y be (-63)/12 - (-2)/8. Let v(i) = -18i3 - 6i*2 - 3i - 5. Let u be v(y). Is u/25 - -5 - (-2)/(-5) a multiple of 8? False Let v = -90 - -308. Is (-14)/((-112)/24) + v/2 a multiple of 5? False Suppose -2q + 36 = -2l - 5q, -2l = 4q + 36. Is 4/l + (-1 - 389/(-9)) a multiple of 11? False Suppose -15h + 19h - 3886 = -5l, 5h + 5l - 4860 = 0. Is h a multiple of 9? False Let x be -95 + -4 + 1/((-3)/(-18)). Let o = x + 96. Is ((-8)/o + -1)/(18/(-162)) a multiple of 25? False Suppose 0 = 2m - o - 5627, 3m - 9868 = 2o - 1430. Does 11 divide m? True Suppose -2i = -x + 5860, 0 = -2x + 5i - 0i + 11714. Is x a multiple of 140? False Does 14 divide (-60)/160 + -1710321/(-72) + -4? True Let m(d) = 220d*2 + d + 4. Let t be ((-18)/(-9))/8 - (-9)/(-4). Is m(t) a multiple of 63? Tru	{ "pile_set_name": "DM Mathematics" }
3)/u + (-12)/6. What is the biggest value in n, m, 2/5? n Let q = 0.01 + 1.99. Let u(h) = h*3 + 6h*2 + 5h - 1. Let w be u(-5). Let l = -15.6 - -16. Which is the second smallest value? (a) q (b) w (c) l c Let h = -304 - -904/3. What is the third smallest value in h, 1, 0.4? 1 Let a = -0.29 + 5.29. What is the third biggest value in 1, a, -1/2? -1/2 Let f = -6.19 - -0.19. Let g = -7 - f. Which is the third biggest value? (a) -0.06 (b) g (c) 0.4 b Let j = -4 + -3. Let l = j - -7. Which is the smallest value? (a) -2/3 (b) l (c) 1/4 a Let i = 0.77 + -0.9. Let t = i + -0.07. Which is the third smallest value? (a) 0.1 (b) -1/12 (c) t a Let i = -314 + 310. Let o = -2 + 6. Which is the biggest value? (a) 2/5 (b) o (c) i b Let i be (8/6)/((-2)/3). Let l = -0.5 + 0. What is the biggest value in i, l, 0? 0 Suppose o + 0 = -3j - 9, 3o - 4j = -1. Which is the second smallest value? (a) -0.1 (b) o (c) 4 (d) -0.5 d Suppose -19v + 60 = -7v. Let u(y) = y2 - 3y. Let r be u(3). Let x = r - 0. Which is the second smallest value? (a) -1/2 (b) x (c) v b Suppose 5 = 2t + 1. Let j = 4.4 + -0.4. Let r = -603/5 - -121. What is the second smallest value in j, t, r? t Let h = 2084/57 - 110/3. Let x = -0.3 + 0.3. What is the biggest value in h, x, -2/15? x Let f = 22.2 + -22. What is the third biggest value in -1, f, -3/23? -1 Let p be (1 - 0) + (-3)/5. Let a = 107 + -112. What is the biggest value in a, -1, p? p Let k = 4 - 13/3. Let i = -2/21 + k. Let g(t) = 5t - 3. Let y be g(1). What is the third smallest value in i, 5, y? 5 Let n = 1/155 + 6/31. Let y be 63060/(-432) + (-1)/4. Let z = y - -146. Which is the third biggest value? (a) z (b) n (c) 3 a Let q = -53 + 53.4. Let p(u) = -u*3 + 7u*2 - 7u + 2. Let d be p(6). Which is the second biggest value? (a) q (b) d (c) 2/9 c Let k be (-2)/(-4)(1 + -1). Suppose -5r + 25 = -kr. What is the third smallest value in r, 0.3, 3? r Let p be 13/12 - (-1)/(-3). Let i(d) = d3 - 11d*2 - 3d - 6. Let q be i(11). Let j be (-26)/q6/(-8). Which is the smallest value? (a) -5 (b) p (c) j a Let g be (4 - 9/3)(-5)/(-3). Let k = 3.4 - 4. What is the biggest value in g, -1, k? g Suppose -2d + 16 = -0d. What is the third biggest value in 3/5, -4/9, d? -4/9 Let g = 2 + -1.5. What is the smallest value in g, -4, -1/8? -4 Let x = 6 - 7. Which is the third biggest value? (a) x (b) 2/3 (c) 4 a Suppose 0 = 3a + 3y - 6, -3a + 3 = -4a + 4y. Let j = -0.149 - -0.449. What is the second biggest value in 1/2, a, j? 1/2 Suppose 3t + 2 = 11. Suppose -3 = -tb + 3w, 5b - 3w - 4 = 1. Let d be -2(-3)/(-18)b. What is the second smallest value in 0.3, d, -4? d Let v = -0.39 + 8.39. Which is the third biggest value? (a) 0.5 (b) -0.5 (c) 1 (d) v a Let n = 37 + -42. Which is the second biggest value? (a) 4/9 (b) 1.5 (c) n a Let k = -3.974 - 0.026. What is the second biggest value in -0.1, k, 0.4? -0.1 Let f = -0.12 + 0.22. What is the second smallest value in f, 0.3, 2/7? 2/7 Let t = 6.5 - 6. What is the biggest value in -2, t, 1, 4? 4 Let m = 1.9 - 2. Let r = m - -0.5. Let o = -3/2 - -3/4. What is the third biggest value in r, o, -0.4? o Let p = -0.68 + 0.28. Let z be 6/(-9)2/(-4). What is the second biggest value in p, z, -1/12? -1/12 Let a = -0.037 - 0.463. What is the biggest value in a, 4, -20, -5? 4 Let d = 0.28 - -0.22. What is the third biggest value in d, -4, -0.5? -4 Let q = -3 + 2.96. Let d = q - 0.36. Let b = 0.5 + -1.5. What is the biggest value in b, -4, d? d Let h = 1.9 + 0.1. Suppose -2x + 2 = -5k, 2k = 2x - 2k - 4. Suppose 13 = 2i - l + xl, 4l - 4 = 0. Which is the smallest value? (a) i (b) h (c) -4 c Let q be (-34)/(-10) - (-4)/(-10). Suppose 0 = -2h - h + q. Which is the second biggest value? (a) 5 (b) h (c) 0.5 b Suppose -388 = -4y + 2k - 128, 3y - 188 = -2k. Which is the second smallest value? (a) 2 (b) 5/3 (c) y a Let p = -52 - -363/7. Suppose -2u - 28 + 3 = 5z, -5z = -2u + 25. What is the second smallest value in p, z, 0.5? p Let i be (-9)/2(-3)/27. What is the biggest value in i, -0.2, 1? 1 Suppose 2s = 3s + 36. Let z = 106/3 + s. What is the second biggest value in 0.15, -3, z? z Let k = -90.93 + 96. Let t = k - 0.07. Which is the second smallest value? (a) t (b) -2/3 (c) 5/2 c Let t be 2/(-4) - 24/(-72). Let l = 4 - 4.3. Which is the third biggest value? (a) t (b) l (c) -5 c Let a = 30 + -29.5. What is the third biggest value in 2, a, 1? a Let f = -3.2 + 3.4. Let d = 11 + -15. Which is the second smallest value? (a) f (b) d (c) -2 c Suppose 3x - 3o + 15 = 0, 5x = 2x + 2o - 15. Let v be (-3 - -15)/(4/6). Let k be v/(-9) - (0 - -2). Which is the second biggest value? (a) x (b) k (c) 2 b Let u = 7.4 - 2.4. Which is the third biggest value? (a) -4 (b) -0.4 (c) u a Let v be 5/(30/4) + (-182)/(-42). Let z(g) = -g + 1. Let c be z(-2). What is the third smallest value in -0.4, c, v? v Let q = 12.3 - 12.7. What is the third biggest value in -1/4, 0.2, q, 0? -1/4 Suppose 0 = -2x - 2, 20 = -2z + 3z - 5x. Suppose 4i - 1 = z. Which is the smallest value? (a) -0.2 (b) i (c) 0 a Let w = 159 - 154. What is the third smallest value in 1, 4, -5/2, w? 4 Let q = 25 - 24.6. Let c = -0.03 + 0.63. Let b = -0.1 + c. What is the third biggest value in q, 2, b? q Let i = -0.4 + -2.4. Let z = i - -3. What is the smallest value in z, -1/3, -0.5? -0.5 Let x be (2/4)/((-11)/22). What is the biggest value in x, 1/6, -0.3? 1/6 Let p = -7 + 7.04. Let b = 0.06 - p. What is the second smallest value in b, 0.5, -0.4? b Let u = 0.58 + -0.08. Suppose h + 2 - 6 = 0. Let t be -1(-1 + h - 2). Which is the third smallest value? (a) 0 (b) t (c) u c Let w = -20 + 20.08. What is the second biggest value in -1, -4, w? -1 Let m = -11 + 15. Let g = 7 - m. Which is the third biggest value? (a) -1 (b) g (c) -2/15 a Suppose 0 = -4n + 17 + 7. Let b(f) = 7 - 7f - 2 - f*3 - 3 + 2 + 7f*2. Let l be b(n). What is the second biggest value in -2/7, 0, l? -2/7 Suppose -10l = -5l - 40. What is the smallest value in 0.2, l, -4? -4 Let l = -0.02 + -0.18. Let g = -320 + 4158/13. What is the biggest value in g, 2/7, l? 2/7 Suppose -4 = 2g, 7 = 4b - 2g - 9. Let y = 0.12 - 0.32. What is the second smallest value in b, y, 1? 1 Suppose 4k + 0k + 11 = -i, 0 = 2k + 4i + 2. Which is the third biggest value? (a) -2/17 (b) k (c) 1 b Let k = -14.8 + 16. Let d = -2.8 - k. Which is the smallest value? (a) -5 (b) d (c) 0.1 a Let z = 14.2 - -2.8. Let s = -17.4 + z. What is the biggest value in s, 3, -0.2? 3 Let p be (-4)/(-10)(270 - 0). Let v be 2 - 1/(57/p). Which is the third biggest value? (a) -2/9 (b) v (c) -5 c Let w = 0.4 + 3.6. Let v = 1474393/280 + -5266. Let o = v + 1/40. Which is the third biggest value? (a) o (b) 0.4 (c) w a Let p = -0.12 - -0.82. Let l = 1 - p. What is the second biggest value in 1, l, 0.2? l Let u = -2 - -1.7. Suppose 3 = 3q - f, 10f - 3 = -3q + 7f. Which is the second biggest value? (a) -3 (b) q (c) u c Let j = 58 - 59. Which is the third smallest value? (a) -0.2 (b) 0 (c) -5 (d) j a Suppose 5b = 15b + 10. What is the biggest value in 5, 0.2, b? 5 Let l = 6.1 + 0.9. Let k = -6 + l. What is the third biggest value in -4, 0, k? -4 Let l = 3 - 7. Let v = -2 - -17. Let o = v - 15.3. Which is the biggest value? (a) -5 (b) o (c) l b Suppose -2 = -j - w, 0 = -3j + 3w - 5 - 7. Which is the second biggest value? (a) j (b) 5 (c) 3 (d) 0.5 c Suppose -4f = -f. Suppose -9 = 3p - fp. Let l be p5/((-330)/4). What is the third smallest value in l, -0.1, 0.3? 0.3 Let p = 3.8 - 3.7. Which is the second smallest value? (a) -1/4 (b) p (c) -0.8 a Let d be (-29)/(-203) - ((-220)/(-7))/(-4). Suppose 0 = -4t + t + 15. What is the biggest value in 4, d, t? d Let u be 2*(-3)/2 + (-319)/(-99). Which is the second smallest value? (a) u (b) 13 (c) -4 a Let t = 1.4 - -4.6. Let f = t - 1. What is the smallest value in f, -3, -3/5? -3 Let m = 10 - 9.5. Let j = -1 + m. Which is the third smallest value? (a) -0.1 (b) j (c) -10 a Let j = 3.1 - 0.1. Let k = -4 + j. What is the second biggest value in -0.3, -3, k? k Let h = -3.1 - 0.9. Let o = -2.5 - -0.5. Let y = 2.06 + o. What is the biggest value in h, -5, y? y	{ "pile_set_name": "DM Mathematics" }
5)*(-2/15)(p/(pp(-4/7)))(-2/7) assuming p is positive. p(-122/147) Simplify (s6)(6/13)(ss(1/12)ss)(-29/5) assuming s is positive. s(-11789/780) Simplify ((k(1/11)k)/(k/((k/(kk(-3)))/kk)k))/((k/(kk/(k/k*(-7)))k)/(k/k(3/16))) assuming k is positive. k(-897/176) Simplify ((ddd(-9/5))(-45))(-3/14) assuming d is positive. d(27/14) Simplify (n*(3/16)n(-3/11))(-14) assuming n is positive. n*(105/88) Simplify ((oo(-3/4))/(o/(o/(o/o7)))o(1/3)/(o(3/2)/o))(2/7) assuming o is positive. o(73/42) Simplify ((p/p(-1/13))(1/11))(-34) assuming p is positive. p(-476/143) Simplify ((q/q(6/11))/q)13/(((qqq((q/(q*(-3)qq)q)/q)/q)/q)/(q/q(-2/83))) assuming q is positive. q(-8278/913) Simplify (aa(1/5)aa(-1/60)/a)/(a12aa1/a) assuming a is positive. a(-709/60) Simplify (ww*12w/(w/(w/w17)))/(w(1/2))(1/3) assuming w is positive. w(-19/6) Simplify (y(y/y(-9)y)/yy)49(y10)(1/38) assuming y is positive. y*(11177/19) Simplify ((tt*(-3/2)t)/t)17/(t/t21t)(1/2) assuming t is positive. t Simplify (f/f17f/(f*13/f))/((fff(-10/13)ff)/f(-2/31)) assuming f is positive. f(-12209/403) Simplify (r3/((((r/((rr/(r(rrr20r)/r))/r)r)/r)/r)/r))/(((rr/(r/(r*(-2)r))r)/r)/r)(-1/8) assuming r is positive. r(-145/8) Simplify (((o/o(-2/9))/(oo/((o(o(2/19)/o)/o)/o)))/(ooo0)49)(1/6) assuming o is positive. o(-17215/1026) Simplify (h(-4)/h)(1/6)h*(-10)h0 assuming h is positive. h(-65/6) Simplify ((w*(-1)/www(-2))5)12 assuming w is positive. w(-180) Simplify (b/(b/b(4/11)))/(b/(bb/b*(3/11)))(bb(-1))/(b(b*(3/5)b)/b) assuming b is positive. b*(-28/55) Simplify ((ss0)(-3)s(-5)s*(3/2)/ss)(-25) assuming s is positive. s(325/2) Simplify (pp/(pp*3)pp/(p(-1)p)(p0)48)(-8) assuming p is positive. 1 Simplify ((q/(qqq(1/7)q)qq5)39)(2/37) assuming q is positive. q(2106/259) Simplify ww(w/(ww(-2/37)))/wwwww(-9/5)(ww(-1/2))(-15) assuming w is positive. w(-1941/370) Simplify ((s(1/13)s)/(ss13))/(ss*(1/19)/ss(4/9)/s) assuming s is positive. s(-27610/2223) Simplify p(p(p(p(-21)p)/pp)/p)/ppp(-30)p/(p/p*(6/5))p/(((p/(p*(-3/17)p))/p)/p) assuming p is positive. p(-3738/85) Simplify (c(-9/4))*6c*(-8)/(c(c/(c/(cc19)cc))/cc) assuming c is positive. c*(-81/2) Simplify ((((zzz(-3/7)z)/zz)/z)/z)(-11/4)(z1)(5/4) assuming z is positive. z(-9/28) Simplify (w(7/4)w/(www(-15)))/((w(((((w*32/w)/w)/ww)/w)/w)/w)/www(1/17)) assuming w is positive. w(-837/68) Simplify b/(b/b*0)bbb/(bb(1/6))(b3)40 assuming b is positive. b*(731/6) Simplify (w(w*(2/9)/w)/wwww4)/(w15/w(-1/16)) assuming w is positive. w(-1417/144) Simplify (i(1/4))(-2/3)(i(i/((i(-3)/i)/i))/i)/(i/(i15/i)) assuming i is positive. i(113/6) Simplify q(-19)q/((qqq(-7/8)/qq)/q)(q7)(-16/3) assuming q is positive. q(-1331/24) Simplify (m(1/11)m/(mm(-1/3))m(mm*(-6)m)/m2)(-16/7) assuming m is positive. m(2416/231) Simplify ((z/z(2/5))/zz)(-1/17)z*11z/(z27/z) assuming z is positive. z(-1193/85) Simplify (l(-16)/l(1/3))/((ll(ll(1/13))/l)/(l7/l)) assuming l is positive. l(-484/39) Simplify ((tt(-16))(-25))13 assuming t is positive. t4875 Simplify ((g/(gg(-2)g))/gg)(-3)/(g(7/3)/gg/(((g*(-1/11)gg)/g)/g)) assuming g is positive. g(-179/33) Simplify ((c4/c(-2/27))23)33 assuming c is positive. c(27830/9) Simplify ((h(-1/2))24(hh(-1)h)(-36))(-19) assuming h is positive. h*912 Simplify ((o/(o/(oo4)))/o)(-2/117)/(o*(-9)(((oo9oo)/o)/o)/o) assuming o is positive. o(-8/117) Simplify ((m/(m/(m(1/2)m)))/m(-4))/(m1m)(-13/6) assuming m is positive. m(59/6) Simplify ((v(1/2))(-34)((vv(-1/4))/v)(2/45))(2/17) assuming v is positive. v(-1531/765) Simplify (n(-2)n/(nnn/n(-1/7)))(-24) assuming n is positive. n(696/7) Simplify y(8/5)y(-1/5)(yyy*(-10)y)(2/37) assuming y is positive. y(189/185) Simplify ((z/z*(-7)z4)/(z/(z(1/6)/z))(2/89))(4/3) assuming z is positive. z(12772/801) Simplify g(-5/3)gg*3(g/(g(g(2/3)/g)/ggg))(-42) assuming g is positive. g(91/3) Simplify (((g/g(-14))/(g/((g/(gg/(g/(g/(ggg*(-2/25))))))/gg)))(3/8))17 assuming g is positive. g(19023/200) Simplify ((d(-13)d)/(d/(d/(d(-3/4)dd))d))/(d*(-10)d/d(-8/3)) assuming d is positive. d(-95/12) Simplify (oo/o0oo)(2/9)/((ooo12)/(((o/(o/o(11/3))o)/o)/oo)) assuming o is positive. o(-85/9) Simplify (((rr*(-9))/(r/(((rr(-2/3))/r)/r)))15)(-1/2) assuming r is positive. r80 Simplify (z(1/5)/(z/(z/(z(-2/15)z)z)))/((z*(-1/14)z)/(z/z(2/5))) assuming z is positive. z(1/210) Simplify ((i6/i3)/((i*7/ii)/i6))(-18) assuming i is positive. i(-36) Simplify o13/((o/(o/(oo(-6/13)o)))/oo)o*(-6/11)oo(3/7)o assuming o is positive. o(13358/1001) Simplify i(4/25)i/((i/((i/i(-11))/i))/i)ii7/ii(6/13) assuming i is positive. i(6377/325) Simplify (o2)(2/3)(o(oo/(o/o11))/o)/(o/((o(-1/20)/o)/o)) assuming o is positive. o(617/60) Simplify (z20)38(z(-2/25))35 assuming z is positive. z*(3786/5) Simplify (m/(mm*(-5/3))m)*46(m/m(-2/3))/m(10/7) assuming m is positive. m(2581/21) Simplify (y(1/11)/y)/(y*(-7/3)/yy)y(-8)y(-1/9) assuming y is positive. y(-662/99) Simplify (((l*(3/20)l)/l)/((l/(l/(l/l*(-9))))/l))/(l/(l/(l/(l/((ll*15)/l))))(l(-19/4)/l)/l) assuming l is positive. l(-171/10) Simplify (((qq/q(3/5)q)/(qq/(q(-3/5)q)q))(-39))(-12) assuming q is positive. q(-468/5) Simplify (i0/ii*(-5))/(iii(i/(i*11i))/iiiiii/i7) assuming i is positive. i5 Simplify (f11)(1/60)(f/f(4/19))(-29/4) assuming f is positive. f(-1579/285) Simplify w(2/67)w/(w0w)w(-32)(w/(ww/(ww/w(15/4))))/w assuming w is positive. w(-9573/268) Simplify l*(3/8)/ll*(2/25)(ll/(l(-6/7)/l))/ll15/l assuming l is positive. l(22837/1400) Simplify ((f/(f(ff/(f*(-4/7)ff))/f))/f)(-1/2)(f/((f/(f/(f/((f/f*0)/ff)f)))/fff))(1/3) assuming f is positive. f(-1/21) Simplify ((rr/r*(-2))/r)/rrr(-2/37)r*(-3)r(-6/5) assuming r is positive. r(-232/185) Simplify ((c(5/3))(3/5))11 assuming c is positive. c11 Simplify ((j/(j(jj((j/j(-1/5))/j)/jj)/jj))/jj)*10j*(-3/2)((j*(-1/14)j)/j)/j assuming j is positive. j(-172/7) Simplify (((t1)(2/7))22)(-29) assuming t is positive. t(-1276/7) Simplify (k(3/4))(-39/4)/((kk(-5))/(((kk*(-3))/kk)/k)) assuming k is positive. k*(-101/16) Simplify ((cc(-17/3))/c)41c10/(c/(c/c(25/3))) assuming c is positive. c(-692/3) Simplify (p17/(pp(12/5)))(2/11) assuming p is positive. p*(136/55) Simplify (vv*12vv/(v/v(-1/4)))/((v(-1/3)v)/v)(5/2) assuming v is positive. v(175/12) Simplify ((v/(vv/(v(-2/7)/v))vvv*(7/3))/(((vv*(-7/3)v)/v)/v(-8)))(-13/4) assuming v is positive. v(1261/84) Simplify ((l2/(l*(1/2)l))/(l*1/llll)(-2/37))(1/10) assuming l is positive. l(49/740) Simplify ((z/(z/z(-4/9))zz)/z)*(-1)z*19z(1/14) assuming z is positive. z(2333/126) Simplify ((dd/(dd*(-13)/d)d)/(d/((ddd/d*6)/d)d))/(dd(3/10)d(d(d(-8/3)/d)/d)/d) assuming d is positive. d(371/30) Simplify ((q/(q/((qq4/q)/q)))/q9(q*(1/3)q)(-19))(9/4) assuming q is positive. q(-141/2) Simplify ((n/(n(-2/13)n))/(n/(n/(n(2/15)/nn))nn))/(n*12/((nn*(-6/11)n)/n)) assuming n is positive. n*(-29011/2145) Simplify (xxx(-32)/xx(10/9))/(x(5/4)x39/x) assuming x is positive. x(-2489/36) Simplify (v(-2/3))(2/89)v*(-9/5)v/v(-1/2) assuming v is positive. v(-841/2670) Simplify (a/a*(-3)a*(-6)a*2a/(a/a(2/3)))(-6/11) assuming a is positive. a*(-4/11) Simplify (zz*(-1/12)z*(-18))/((z/(zz*(-16)))/(z/((z/(zz/(z*12z)))/z))) assuming z is positive. z(-517/12) Simplify ((k/k(1/2)k(4/3))(-7/4))(3/10) assuming k is positive. k	{ "pile_set_name": "DM Mathematics" }
/10) Simplify (n2/n2)/(n*(-3/8)/((nn/(n(n/((nn/(n*(3/8)/n))/nn))/nn)nn)/n))(n*(-6)nn/(n(-1/4)n))(-49) assuming n is positive. n(947/4) Simplify (c*(-1/16)c)/cc11c(1/4)/c17 assuming c is positive. c(-93/16) Simplify ((b(1/4))(-1/57)/(b(-12)/bbbbb(-2/35)))(-1/12) assuming b is positive. b*(-80221/95760) Simplify (((j/(jj*(-33))j)/j)/((jj24)/j))/(j18)(-5/4) assuming j is positive. j(63/2) Simplify (((t10/(tt*(-5)))/((tt(tt/(tt/(tt*(3/7))))/ttt)/tttt/t*(-7)t))(24/11))(-2/49) assuming t is positive. t*(144/3773) Simplify ((ii/i*(-4/9)i)/(ii(-10)/iiii))*8(i/i*(-9)i(-10))(-1/18) assuming i is positive. i*(752/9) Simplify ((ff(2/5)/f)(2/51))(-6)/((f0)6/(f/f0f)(-1/13)) assuming f is positive. f(-274/1105) Simplify (z(-6/7)z(zzzzz/(zz*(-1/4))z)/z)/(z(-2/7))(-2/97)z/z(2/9)z*(-2/3)z*(-5)z/(((z*3z)/z)/z) assuming z is positive. z*(-36713/24444) Simplify ((i/(ii*(-6))i*(1/3)i)/((i/i*(-1/2))/ii*6i))/(i(3/4)/(i/i(-1/7))i/i6i/((ii(1/7))/i)) assuming i is positive. i(367/84) Simplify ((k(-9)/k(2/11))/(k/(k/(k(5/3)kkkk)))(-1/4))(-7) assuming k is positive. k(7175/132) Simplify q/(q(-2/9)q)q/q1(qq1q)*(-2/71)(q/q*(-3)q(-4))(4/5) assuming q is positive. q(88/639) Simplify (n(-6)/(n(-3)/n))/((((n(-2/9)/nn)/n)/n)/(n(-2)/nn))(n(2/7)n1)(-14/9) assuming n is positive. n*(-34/9) Simplify ((((aa*(-2/5)aa)29)(-42))(-43))(-1/14) assuming a is positive. a(-48633/5) Simplify (ss(-2))(-18)/(s(2/9)/s(-2/27))((s9/s)/(s(4/3)s))/(s0/s)(-1/42) assuming s is positive. s(8825/378) Simplify ((q1/q)/((q/(q*(-1/3)/q))/q))/(qq*(4/3)q*(-1/8))q((q/(q/(q(-4)/q)))/q)/qqq/((q7q)/q)q2q(-2/3) assuming q is positive. q(-317/24) Simplify ((((bb(-9))(-1))34)(1/3))33 assuming b is positive. b2992 Simplify ((h/(hh/(hh/(hh*25)hhh)))/hhh(7/2))/(h(38/3)h/(hhhh(-17))) assuming h is positive. h(-277/6) Simplify ((kk(-18))/k(1/27))/(k/(kkk/(kkk(-25))kk)k*6k) assuming k is positive. k*(80/27) Simplify ((ll*(1/12)l(-2/9))/(l/(l/l(12/7)))(-2/9))(-35) assuming l is positive. l*(-1565/36) Simplify (yy(5/3))/(y(1/8)/y)(y(4/7))(-16/3) assuming y is positive. y(83/168) Simplify (c(-2)cc6(c(-2/7))(-5/9))/((c/(c/c*(-2))ccc)/cc5(c/((c/(cc1)c)/c))(7/3)) assuming c is positive. c(-284/63) Simplify (a*(-4/3)a/(aaa2))/(a(-4)aa*(-5)/a)(a/(aa2)a/(a5/a))28 assuming a is positive. a(-406/3) Simplify ((d(-2/33)/dd)/(dddd*(-23)d)(d/((d14dd)/d)dd)/(d(-1)/d))(-43) assuming d is positive. d(-12685/33) Simplify ((o/o(-2)ooo*(-2)((o(o/(o(1/9)/o))/o)/o)/(o(-7)/o))(-33))(-24) assuming o is positive. o9416 Simplify (((gg*1/ggg)/g)/gg)44/(g(-3)gg*(2/17))((g/((g/g(-1/7))/g))(-22))(-1/16) assuming g is positive. g(43345/476) Simplify (g/g*(-2/11)g/(g*5/g))/((gg/(g*3ggg))/g(g(-3/4)/g)/g)(g/(g/(g(g/g(-1))/g)))16/(gg/g*(1/4)ggg)(12/7) assuming g is positive. g(9175/308) Simplify w/w*(1/18)w(w/w18)/ww(-11/5)/w25 assuming w is positive. w*(-3893/90) Simplify (i/(i(i/(i/(i*(1/2)ii)i))/i))(-17)/(i8ii*(-1/6))((i(-2/5)/i)/(i/(i/(i(4/3)/i))))(-28) assuming i is positive. i(241/5) Simplify ((j/j*(-5)j)*3j11/j(-11/4))(-9/4) assuming j is positive. j(-1251/16) Simplify (f/(ff2))(-5/8)/(f(-2/13)/f1)((f/(f*(-6)/f))/(ff0))/(f(-1))(22/3) assuming f is positive. f(2611/156) Simplify (r/(r/(r/r*(-5)))rrrr(4/13))(2/5)/(((rr/(r/r*(-2))r)/r)(1/12)/(r(-1))(1/3)) assuming r is positive. r(903/260) Simplify ((c/c*7)/(cc*(4/7)c))/(c(-1))(2/9)(c((cc/c(2/11))/c)/c)/((cc/c*(2/5))/cc)(c(-4)/c)/c6 assuming c is positive. c(-69754/3465) Simplify c0ccc/(c/(c/(c*(-1)c)))((c(-2/5)c)/c)*23(c/(c/c(-1)))1/(c*(-1)/(((ccc0)/c)/ccc)) assuming c is positive. c(-21/5) Simplify (((((yyy7)/y)/y)/(y3y))/(y1)4)/((y2)(6/13))(-2/141) assuming y is positive. y(-603/611) Simplify (c*(-28)c)*50/(c/(ccc14/c)c/(c/(c*(-1/4)/c)cc)) assuming c is positive. c(-5331/4) Simplify ((p/(p/(pp5)))/(p(4/3)p))(-1/9)/((pp*(3/7)p)/pp/p3(pp/(pp/p(1/7)))/p1) assuming p is positive. p(193/189) Simplify (n(-2)n8n*(2/7)n(-22)/n)(-27) assuming n is positive. n(3159/7) Simplify ((p1)(11/3))(36/11)/((p*(-1/7)p(-2/15))/(p(2/3))(6/5)) assuming p is positive. p(1373/105) Simplify (m*3mm6/m)/(m(2/5))(3/26)(m*(1/5)m*(-1/2)mm)(-2/67) assuming m is positive. m(38773/4355) Simplify ((((k/k(-2/5))/k)/(k((kkk*(-2))/k)/k))/(kk*(2/3)k(-7/4)))/((k(2/15)kk(-3))/(k/k(1/2)kk*(2/15)k)) assuming k is positive. k(359/60) Simplify (l(-5)/l(1/2))(-6/5)(ll*(2/7)l)*(-19/3)(lll*(-2/3)l)(-10/9) assuming l is positive. l(-9893/945) Simplify ((z(1/2)/z4(z((zz(2/7))/z)/z)/z(3/8))(-14/5))(-49) assuming z is positive. z(-9849/20) Simplify (((w6w)/(w*1w))/(ww/w(-13)w/w3))(-1/7) assuming w is positive. w(8/7) Simplify (l(-2/5)/(l/(l/(l(((ll*8/l)/l)/l)/ll))))*41((l/((ll(-1/5)l)/l))/l8)5 assuming l is positive. l(-1712/5) Simplify (w/w(1/4))*(6/23)((w(w(2/7)w)/w)/w)/(w/(w*(1/8)/w))(w(-2/9))(-18/5)(w/(w/(w/(w/w(4/11)))))/(ww/(ww9)) assuming w is positive. w(550427/70840) Simplify (s(-1)/s5)(-26)(s*2/s)/(ss*(-1/5)s)(s(-1/4))(-2/25) assuming s is positive. s(7761/50) Simplify (d4d/(d2/d))/(d1)*(-44)((d*(3/2)dd)/(d/d0d))/(dd(2/13)d(3/7)) assuming d is positive. d(8721/182) Simplify (d(-12)/d(2/9)ddd23dd/((ddd(-33))/d))29 assuming d is positive. d(12209/9) Simplify ((((((nn*(-1))/nnn)/n)/nn(3/20))(-2/23))(36/7))(-27) assuming n is positive. n(-8262/805) Simplify (((((x(5/7)/x)/x)/x16)(-23))(-32))(-44) assuming x is positive. x*(3918464/7) Simplify ((u(u/(u/(u(u/(uu*(2/3)))/uuuuu))u)/u)(2/3))26(((u/(uu/(uuu/u2)))/u)/(u/(u(-8)/u)))(-35) assuming u is positive. u(4141/9) Simplify ((h/(h/(h/(h/h15))))/(h/((h(3/2)/h)/h))(h28/h)/(h(h*16h)/hhh))(-31) assuming h is positive. h(-1333/2) Simplify ((u/(u/(u/((u*(-3/2)/uu)/u)))uu)/u*(-2)((uu(-1/50)u)/u)/u(3/16))(-22/5) assuming u is positive. u(-36487/1000) Simplify ((s/(s/(s/(s(2/3)/ss))))34s*(-6)ss/((s(1/9)/s)/s))/((s/(s/s(-2/13)s))10)(-23) assuming s is positive. s(-29971/117) Simplify (n(-19))*(2/33)((nn9)/nn)/(n/(n/(n*29n))n) assuming n is positive. n(-731/33) Simplify ((i(-5)/((i/(i(-18)/i))/i))/((ii(-7))/(i/i7)))(-1/24) assuming i is positive. i Simplify (w(-2/5)/(ww(1/10)w))*(-5)/((ww2/w)(-12/13))37 assuming w is positive. w(2101/26) Simplify ((pp(-1/5))(-12/11)/((pp*(-2))/ppp7))/((p/(p0ppp))*24p*(-2/13)p/p(5/2)) assuming p is positive. p(61177/1430) Simplify (q*(-12)qq(q(-9)/q)/q)(-8/13)/(((q/((q/(qqq/(q(2/3)/q)))/q))/q)(-49))3 assuming q is positive. q(6538/13) Simplify (ff34ff)33(f/(f/(f(f/(ff*(-26)f))/f))f)/(f(f*37ffff)/f) assuming f is positive. f1206 Simplify ((r(r*(1/2)/r)/rr)(2/7)/(r(-1/3)rr(-20)))28 assuming r is positive. r(1636/3) Simplify (m(4/7)/(m*15/m)(m/(m/((m(-4/11)/m)/m)))/m(2/11))(-38) assuming m is positive. m(46740/77) Simplify ((a10/a14)/(aaaa(-8)aaaaa((a/a(-7))/a)/aaaa))(-2/119) assuming a is positive. a(26/119) Simplify ((i/(ii/(i(-3/4)i))ii*(-1/6))/((i/(ii*2)i)/(ii5)))/(i(-7)/((ii10)/i))(-1/44) assuming i is positive. i(221/33) Simplify (((p(2/7))*(5/18)/((pp(p(-1/9)/p)/p)/(p/((p/(pp*(-2)))/pp))))30)(13/5) assuming p is positive. p(-442/7) Simplify (f(3/19)/f)35/(f/f22fff(-6)) assuming f is positive. f(-85/19) Simplify (((m(-2/35)m)/m)/m(-6))(-2)(mm*4m(3/8))(20/7) a	{ "pile_set_name": "DM Mathematics" }
11. Let r = 32 + x. Let a be 2 - (144/(-15))/(-4). What is the nearest to 1/3 in r, a, 2/19? 2/19 Let n = -4/57 + 199/399. Let m = 4/21 - 2/35. Which is the closest to 0? (a) -1/3 (b) m (c) n b Let f be (-2)/((-8)/18) - (0 - -4). Let n be 24/((-128)/(-6)). Let d = -77 + 691/9. Which is the nearest to f? (a) d (b) 2 (c) n c Let k = -3 + 20. Let z = k + -15. Suppose -d - 24 = 4m, 0 = zm - 3d + 3 - 5. What is the closest to 1 in -3, m, 4? 4 Let k = 47.21 + -0.21. Let i = -46.7 + k. Which is the nearest to -1/2? (a) 3 (b) 2 (c) i c Suppose 13k + 6 + 20 = 0. What is the nearest to 1 in -20/7, k, 0? 0 Let k(r) = -4r + 30. Let u be k(8). Which is the nearest to 0.2? (a) 13 (b) -2/5 (c) u b Let f = 7 + -7.5. Let p = -17 + 3. Let v = p + 14.4. Which is the closest to -3? (a) v (b) f (c) 2 b Let d = 713 - 712.99. What is the nearest to -1/4 in 4, d, 0.3, -0.4? -0.4 Let t = 21 - 28. Let d be (t/147)/(2/(-12)). Let a = 2 - 4. What is the closest to a in -5, d, 0? 0 Let u = 3.2 - 4.5. Let p = -1.6 - u. Let o = 0 - p. Which is the nearest to -0.2? (a) -3 (b) 2/3 (c) o c Let o = -0.946 + -0.054. Suppose -5s + 3w = w - 14, w = s - 4. Let g = -8 + 3. What is the nearest to g in -5, o, s? -5 Suppose -q + 2 = -3h, 1 = -2h - 3. Let k = -1.9 - -2. Let f = -219 - -218. What is the closest to -1/2 in f, k, q? f Let m = 0.71 + -4.71. Which is the nearest to -1? (a) m (b) -0.8 (c) -3 (d) -1/3 b Let m = -3.01 - -2.9. Let f = m + -1.89. Which is the nearest to 0? (a) -1/10 (b) -5 (c) f a Suppose 2p - 27p + 25 = 0. Let k = 0.26 + -0.17. What is the closest to p in 1, k, -3? 1 Suppose -20 + 54 = 17y. What is the nearest to 1 in y, 0.17, -2? 0.17 Let o = 0.6 - 0.9. Let q = 0 - o. What is the nearest to -2 in q, -4, -1? -1 Let d be 26/(-42) + (-4)/(-14). Let r be 531/(-708) - (0 + (-1)/12). Which is the closest to 1? (a) -2/11 (b) d (c) r a Let j = 96/7 - 295/21. Which is the closest to j? (a) -5 (b) 2/5 (c) -1 (d) 5 c Let k = 1.8 + -2.06. Let r = k - 0.74. Let c = 21 + -20. What is the nearest to r in -0.7, c, 0.3? -0.7 Let d = 1082/9 - 120. Let o be ((-2)/24)/(1/(-2)). Let n be (1/3)/(2/(-6)). What is the closest to n in 4, d, o? o Suppose 0 = -10v + 5 + 45. Suppose 5w = vo + 50, -o = -4w - 5o. What is the nearest to 1 in -1/2, 0, w? 0 Let y = 4 - 4. Let o = -30.7 - -35.7. What is the nearest to y in -1, -0.5, o? -0.5 Suppose 0 = -4i + 3d - 51, -5i = d + 4d + 90. Let o be (6/4)/((-9)/12). Let p be -4 + i/(-6) - o. Which is the closest to 0? (a) p (b) 5 (c) -2/7 c Let s = 116 - 124. What is the closest to 0 in -3, 2, s? 2 Let h be ((-33)/(-198))/(4/6). Which is the nearest to -0.1? (a) 2 (b) -3/4 (c) h (d) -7 c Let r(t) = 30t - 206. Let v be r(7). Let k = 116/91 + -11/13. What is the nearest to -0.1 in v, 0.06, k? 0.06 Let y be (1 - 0)/(-7 + 2). Let m = 22 + -21.8. Let h = -2 + 2.4. Which is the closest to m? (a) h (b) 0.3 (c) y b Let r = -11.3 - -2.2. Let t = 9 + r. Suppose -5d + 6 = -4q, -4d + q + 3 = -4. What is the nearest to 2/5 in t, 1/5, d? 1/5 Let g = 19 - 16.5. Let l = g - 2.9. Let k = 0.76 - -0.24. Which is the closest to k? (a) 4 (b) l (c) -5 b Let s = -49.8 - -46. Let c = 4 + s. Let f = -1.95 + -0.05. What is the nearest to f in -2/5, c, -3? -3 Let o = -39762 + 439012/11. Let q = -148 + o. Let x = -131 + 388/3. Which is the closest to -1/2? (a) -2/3 (b) x (c) q a Let c be (5/15)/(-1 - (-9)/6). Let v = 15.36 - 0.36. Let s = -11 + v. What is the closest to s in -5, c, 2/9? c Let p = -187 + 933/5. Which is the closest to 1? (a) 0.3 (b) 0.6 (c) 0 (d) p b Let z = -30 + 35. Let t = 5 - z. Which is the closest to 1? (a) -0.1 (b) -3 (c) t c Let t = -3/20 + -1/10. Let d be -23 - -20 - 4/(-1). What is the closest to d in -2/11, 3, t? -2/11 Let f = -5.36 - -5.56. What is the nearest to 2/9 in -3/8, -1, f, -5/3? f Let f = -1247 - -1247.3. Which is the nearest to 2? (a) -1 (b) -0.4 (c) f (d) -0.1 c Let o(f) = f + 7. Let x be o(-2). Let j = 23/48 - -3/16. Which is the closest to 1? (a) x (b) 4 (c) j c Let h = -1981 + 7923/4. Let r = -683/1155 - 2/231. Let w be -2 - (-2)/((-16)/(-18)). What is the nearest to w in 1/3, h, r? 1/3 Let q be (-2)/10 - (-1)/5. Suppose r - 3d = -qr - 6, -3d = 15. Let x = -19 - r. What is the closest to -2 in 0, x, -2/3? -2/3 Let p = -14641/17 + 861. Which is the closest to -2/7? (a) -0.4 (b) -3 (c) 1 (d) p d Let h = 1.18 + -0.18. Let z = 0.03 - 0.13. What is the nearest to 3/5 in z, h, -3/5? h Let s be (-1)/(-4) - 7/42. Let q = -0.112 + 0.012. What is the nearest to q in 0.4, -1/6, s? -1/6 Let k = 3 - -1. Let l = k - 3.9. Let o = 27/116 - -1/58. What is the nearest to o in 0.3, l, -3? 0.3 Let z = -19486/21 + 928. Which is the nearest to 1/2? (a) z (b) 0.4 (c) -11.9 (d) 5 b Let o = -206/595 + 8/35. What is the nearest to 0.5 in 1, -1/4, o? 1 Suppose 3c = a + 2 - 0, 4a + 1 = 5c. Let u = -3.7 - -4. What is the nearest to a in 3, 2/13, u? u Suppose -2h + 112 = 2u + 14, 2u = 5h + 84. What is the closest to -2 in u, -1, 3/5, 2? -1 Let g = -172 + 508/3. What is the closest to g in -3, -5, -1.8? -3 Let q(f) = 2f3 + 11f*2 - 4f - 2. Let w be q(-6). Let v be (-4)/w - (1 + -1). Which is the closest to v? (a) 1/5 (b) -5 (c) -2 a Let h be (-15)/(-9)(-2)/5. Let b = -119.6 - -121.6. What is the nearest to h in 0, -3, b? 0 Let o be 18/(-21) - (-9)/(-693)11. Let y = 4.1 - 0.1. Which is the nearest to -1? (a) y (b) 1 (c) o c Let u = -13 - -18. Suppose 0 = -4h - 8, 0 = -5c + uh - 0h. Let m be (((-1)/(-1))/12)/(21/28). What is the closest to c in 2/5, m, 4? m Let h(y) = -2y2 + 3y + 76. Let o be h(7). Which is the nearest to -2/7? (a) 5 (b) 3 (c) 16 (d) o d Let y(k) be the third derivative of -k*5/60 - 7k*4/24 - 2k*3/3 + 4k2. Let z be y(-6). Let s = -1 + 1.3. What is the nearest to s in 1, 3, z? 1 Let m(o) = o2 + 7o - 6. Let q be m(-8). Suppose z - qz = 0. Let w be 1(z - 4/12). Which is the nearest to 0.1? (a) 0 (b) -2/5 (c) w a Let i = 994 + -990. Which is the nearest to -1/3? (a) i (b) -1/13 (c) -0.3 c Let c = 160 - 159. What is the closest to 9 in -2/9, -1/4, 5, c? 5 Let x = 503/6 - 84. Let h = -26.722 + 0.022. Let z = -27 - h. What is the nearest to 1 in z, -0.4, x? x Let v = 105/1363 - 186513/1784167. Let x = v + -16/77. What is the closest to x in -1/5, -5, 4? -1/5 Let y = -62 - -37.1. Let x = -25 - y. Which is the nearest to 1/3? (a) x (b) 0 (c) 1 b Let s = 0.471 - 0.771. Which is the nearest to 0? (a) 0.1 (b) s (c) 4/11 a Let l = 19 + -25. Let i(d) = d3 + 7d*2 + 7d + 8. Let k be i(l). Suppose 2z = 3z - k. Which is the closest to -4? (a) z (b) -0.5 (c) 1/8 b Let c = 22 + -24. Let o = -339 - -338. What is the nearest to 1/2 in c, o, 0.4? 0.4 Let s = 501 + -500. Let r = 0 + -0.2. Let u = r + 0.2. Which is the closest to s? (a) 0.5 (b) -1/4 (c) u a Let i = 5.5 - 0.5. Let d be (3 - 49/14) + (-6)/(-4). Let w = d + -3. What is the nearest to -1/4 in -0.1, i, w? -0.1 Let w = -0.06 + 0.09. Let f = -305 - -306. Let c = -473/5 - -95. What is the closest to f in w, c, -3? c Let f = -148/5 - -1111/35. Which is the closest to -0.1? (a) -3/2 (b) 2/5 (c) f (d) 0.5 b Let y = 16.16 + -15.7. Which is the nearest to 3/7? (a) -3 (b) 3/5 (c) y c Let s(w) = -4w - 4. Let l be s(-7). Let u be (3/7)/(l/42). Let z = -17/12 + u. Which is the nearest to z? (a) 1 (b) -2/3 (c) -3 b Let p = 0.0099 - 29.9099. Let n = 30.1 + p. Let g = -5 - -5.4. Which is the nearest to n? (a) -3 (b) -4 (c) g c Let n = 28.094 - 28. Let b = -17.606 - n. Let f = b - -18. What is the closest to f in 0.4, 0, -0.1? 0.4 Let n = -0.6 + 4.6. Let s = 1.4 - 1.9. Let u = 0.023 - -0.077. Which is the nearest to u? (a) 1/4 (b) n (c) s a Let p = -0.26 - 0.14. Let q = 8.8 - 14.8. What is the closest to 0 in p, q, 0? 0 Let p = 50/9 - 6. Let y = -2 - 2. Which is the nearest to p? (a) y (b) -0.5 (c) -2/11 b Let o = 46/3 - 140/9. Let l be 6(0 - (-15)/21). Let m = -141/28 + l. Which is the closest to -2/7? (a) o (b) m (c) -3/7 a Let l = -38 - -34. Let p = 2 + -2.5. Let y = -0.14 + 0.24. What is the nearest to y in l, p, 1/7? 1/7 Let y = 126/31 - 1010/279. What is the closest to -2.3 in y, 2/11, 2? 2/11 Let x = -56.86 - -76.7. Let m = -0	{ "pile_set_name": "DM Mathematics" }
2 + -5. Let m(x) = -1890 + 1890 - 2x. What is the units digit of m(h)? 4 Suppose -3t - 12 + 3 = 3u, 4u + 2t + 8 = 0. Let j = 1 - u. Suppose -d = jd - 27. What is the units digit of d? 9 Suppose 0 = -n - 1 + 15. What is the units digit of n? 4 Suppose 4v - 2v + 4 = 0. What is the units digit of (0/(-3))/v + 3? 3 Let v(w) = w*2 + 7w + 2. Let h be v(-7). Suppose h = -u + 4. What is the units digit of u? 2 What is the units digit of (-2)/6186/(-2)? 1 Suppose 4l = -2o + 14, -3o + 13 = -2o + 5l. Suppose -16 = -g - og. What is the units digit of g? 4 Let m = 4 - 12. Let g be (-2)/m - (-78)/(-24). What is the tens digit of 4/g(-42)/4? 1 Let k(c) be the third derivative of 0 + c*2 - 1/60c*5 - 1/4c*4 + 1/2c*3 + 0c. What is the units digit of k(-6)? 3 Let r(t) be the second derivative of t + 1/20t5 + 0 + t2 + 1/6t*3 + 1/4t*4. What is the units digit of r(-2)? 4 Let x(p) = -17p*3 - 2p*2 + 1. Let n be x(-1). Suppose m = -2m + 33. Let r = n - m. What is the units digit of r? 5 What is the tens digit of 23 + 3 + -6 + 7? 2 Let b(v) = -5v2 + 7v + 41. Let c(d) = -3d2 + 4d + 21. Let w(a) = 4b(a) - 7c(a). What is the units digit of w(0)? 7 Let i(h) = 11h2 + 14h + 34. What is the hundreds digit of i(-4)? 1 Let n(a) = 3a + 9. Let b be 2(405/(-6))/5. Let i(d) = 39d + 117. Let h(q) = bn(q) + 2i(q). What is the tens digit of h(-7)? 1 Let q(o) = -7o - 7. Let y be q(-6). Let c = y - 61. What is the units digit of c/(-3)6/4? 3 Suppose m - 16 = -m. Suppose l = -l + m. Suppose 5q - 61 - 34 = -n, 57 = lq - 3n. What is the tens digit of q? 1 Suppose -2l + 51 - 13 = 0. What is the units digit of l? 9 Let k(j) = j3 - 1. Let d(g) = 2g*3 - 3. Let l be 2 + (-3 + 2 - 0). Let o(w) = ld(w) - k(w). What is the units digit of o(2)? 6 Suppose 5h - 99 - 61 = 0. What is the tens digit of (3 - h/(-2)) + 0? 1 Suppose a + 2u = -a + 24, 5a - 2u - 32 = 0. Suppose 0 = -k - k + a. What is the units digit of k? 4 Let z(n) = 3n. Let k(l) = l3 + 12l*2 - l - 9. Let r be k(-12). What is the units digit of z(r)? 9 Suppose -4k + 7k - 207 = 0. What is the tens digit of k? 6 Let g = 33 - 13. Suppose g = 4u + u. Suppose -2o - 4y + 20 = 0, -4o = -y + uy - 35. What is the units digit of o? 8 What is the units digit of 2/(-9) - ((-1124)/36 - 3)? 4 Suppose -2v - 5y - 85 = 0, 5v - 36 = -4y - 223. Let r be (42/v)/(6/20). What is the units digit of 4/6 + r/(-12)? 1 Let d be (2 + (-3)/6)-2. Let f(x) = -2x. Let q be f(d). Suppose 5i - c - 12 = 0, 6c + q = 3c. What is the units digit of i? 2 Let k(r) = 10r*2 - 6r - 6. What is the tens digit of k(-4)? 7 Let t(p) = p + 8. What is the units digit of t(3)? 1 Suppose 3i - 49 = 23. Suppose 2z + 0z = -4q + 16, 3z + 2q - i = 0. What is the units digit of z? 8 Let t = 22 + -20. What is the units digit of t/(-6) - 1088/(-24)? 5 Let r(q) = -7q3 + 2q*2 + 2q + 1. Let p = 4 + -4. Suppose n = -1 - p. What is the units digit of r(n)? 8 Let h(x) = -2x3 - x2 + 3x + 1. Let o(k) = k*2 + 3k - 5. Let g be o(-5). Suppose 3n = -gq + 9, 2q + q = 9. What is the units digit of h(n)? 7 Let g be ((-6)/(-4) + -2)2. Let r be (3 + -9)(-2)/(-4). What is the units digit of 2g/(2/r)? 3 Let l = 50 + -40. What is the tens digit of l? 1 Let t(i) = 2i + 2. Let l be t(-2). Let s = 19 + l. What is the units digit of s? 7 Let h(i) = 3i*3 + 13i2 + 2. Let v(p) = p3 + 6p2 + 1. Let q(y) = 2h(y) - 5v(y). Let l be q(3). What is the units digit of 2/7 - l/14? 1 What is the units digit of (-1023)/(-21) - 4/(-14)? 9 Let t(c) = -c + 2. Let p(x) = x2. Suppose 2v = v. Let r be p(v). What is the units digit of t(r)? 2 Suppose 679 = 7i - 0i. What is the units digit of i? 7 Let k = 29 + 21. What is the tens digit of k? 5 Suppose -3x - 5w + 735 = 0, -4w = -2x + 536 - 24. What is the hundreds digit of x? 2 Let j(p) = p*2 + 2p + 4. Suppose -3c = -2c + 4. What is the tens digit of j(c)? 1 Let j = 400 + -234. What is the units digit of j? 6 Let c = 182 + -263. Let n = c + 113. What is the tens digit of n? 3 Suppose -15 = 4r - 7r. What is the units digit of (-15)/r(-2)/6? 1 Let n(t) = 5t2 + 1. What is the units digit of n(-1)? 6 Let c(m) be the second derivative of m5/20 - 2m3/3 + m2/2 - 3m. What is the tens digit of c(3)? 1 Let r = -11 + 23. Let s = 22 - r. What is the units digit of s? 0 Let t(r) = r*2 + 6r - 6. Let g = -12 - -6. Let h be t(g). What is the units digit of ((-4)/h)/((-2)/(-21))? 7 Let m = -4 - -9. Suppose 0 = 5c - 3d - m, 6c - 2c - d = 11. Suppose -ca = -a - 9. What is the units digit of a? 3 Let k(b) = -b + 72. Let v be k(0). Suppose 4s = 4u - v, 3u - 14 = 5s + 38. What is the units digit of u? 9 Let f(v) = -6 + 0 + 0 - 2 + 2v. What is the units digit of f(8)? 8 Let a(o) = o*2 - 7o + 7. Let g be 4/(-14) + (-36)/21. Let b be -7(-2 - (g + 1)). What is the units digit of a(b)? 7 Let s(f) = -f + 0 - 4f + f*3 + 2 + 3 - 5f2. What is the tens digit of s(6)? 1 Let d(b) = b2 + 10b + 15. Suppose 0c + c + 10 = 0. What is the tens digit of d(c)? 1 Let v = -6 - -2. Suppose 0 = -3q + 10 + 8. Let y = q + v. What is the units digit of y? 2 Suppose -4h + 38 = -2n + 124, 0 = -4n - 5h + 107. What is the units digit of n? 3 Suppose 2u = 544 - 110. What is the hundreds digit of u? 2 What is the tens digit of 4/(-1)(-3)/(6/59)? 1 Let r(s) = -s3 + 7s*2 + 10s + 8. What is the tens digit of r(8)? 2 Suppose 18 = -2k - 24. Let o = -7 - k. Suppose o = -r + 3b, -17 = -2b - 7. What is the units digit of r? 1 Let i be (-3)/1 + (-66 - -1). What is the units digit of i/23/(-6)? 7 Let z be (-154)/(-12) - (-4)/24. Suppose z = 2x - 1. What is the units digit of x? 7 Let c(q) = 6q + 1. What is the tens digit of c(2)? 1 Let i(k) = -k*3 - 2k*2 + k + 1. Suppose -g - 11 = -2j - 0, 3g = -5j + 55. Let d = j - 11. What is the units digit of i(d)? 7 Let w(y) = -2y + 1. Let k be w(1). What is the units digit of (k/(-3))/(1/3)? 1 Suppose -2y + y - 15 = -3r, -3r - 2y + 24 = 0. Suppose -2o - 60 = -ro. What is the units digit of o? 5 Let c(q) = 3q - 4. What is the tens digit of c(8)? 2 Let c(k) = -k*3 - 2k*2 - 3k - 1. Let o be c(-2). Suppose -2w + 3l = -l - 36, 5w + ol - 30 = 0. What is the tens digit of w? 1 Suppose -4s - 3j = -96, 0j + 2j = -4s + 92. What is the units digit of s? 1 Let q(r) = -9r*3 - 5r*2 + r - 5. Let b(n) = -10n*3 - 4n*2 + n - 4. Let d(x) = 6b(x) - 5q(x). What is the tens digit of d(-1)? 1 Let h(q) = q3 + q2 - 2q. Let u be h(4). Suppose 5n - 33 = -c, 7c + 5n - u = 3c. What is the tens digit of c? 1 Suppose -4w = 3w - 455. What is the tens digit of w? 6 Let t(k) = -k*2 + 7k + 17. Let i be t(8). Let p(n) = n + 5. Let d be p(-6). What is the units digit of -315/id? 5 Let r be (-19)/(-7) - (-14)/49. Let p be 19/2 + r/2. Let x = -8 + p. What is the units digit of x? 3 Let h be 2/((-15)/(-9) + -1). Suppose -h = -y - 0y. Suppose yi = -0 + 12. What is the units digit of i? 4 What is the units digit of (-4)/(-20) + (-58)/(-10)? 6 What is the units digit of 1 + -24(0 + 0 - 2)? 9 Let r = -43 - -60. Let m = 24 - r. What is the units digit of m? 7 Let z = 21 - 10. What is the units digit of z? 1 Let k(j) = -j2 + 5j + 1. Let h be k(5). What is the units digit of h(7/1 + -1)? 6 Let c = -11 - -26. Suppose -3n + c = -15. What is the tens digit of n? 1 Let f(p) = -5p - 24. What is the units digit of f(-13)? 1 Let j = -10 - -6. Let f be 2/2 - (2 + j). Suppose -3p + f = -0. What is the units digit of p? 1 Let o be (-4)/(-14) - 60/(-35). Suppose 2b - 8 + o = 0. What is the units digit of b? 3 What is the units digit of (4 - (4 + -3)) + 3? 6 Let w be (-4920)/(-56) - (-2)/14. Suppose -4h + w = 4p, -3p - 2h + 28 = -39. What is the tens digit of p? 2 Let b = -1 + 3. Let p(y) = y - by + 6 - 11. What is the units digit of p(-8)? 3 Suppose -5w = 20, -2i + 2w - 4w = 0. Suppose 6 = 2v - i. What is the units digit of (-2)/v(4 - 19)? 6 Suppose -5 = -r - 2. Suppose -2 + r = -m - k, -5m + 5k + 5 = 0. What is the units digit of (0 + 0 - m) + 1? 1 Let u(j) = -5j2 - 6j + 1. Let d(a) = -6a2 - 6a + 2. Let g(x) = 6d(x) - 7u(x). What is the units digit of g(6)? 5 Suppose 5*c + 15 = 0, -	{ "pile_set_name": "DM Mathematics" }
*4/2 - 2752s*3/3 - 11857s. Find the second derivative of a(l) wrt l. -12l2 - 12l + 756 Let b(i) be the second derivative of 2081i4/6 + 3113i*3/2 - 11221i. What is the second derivative of b(v) wrt v? 8324 Let w(q) = q*3 - 2q*2. Let x(d) = 236d*4 - 3d*3 + 6d*2 + d + 1201. Let b(m) = 3w(m) + x(m). What is the first derivative of b(j) wrt j? 944j3 + 1 Let j be (-3)/(18/(-12)) - 0. Find the first derivative of 233o - 85 + 229o - 459o - 12oj wrt o. -24o + 3 Let f(u) = -2491u3 - 6u*2 - 6u - 1170. Let s(r) = 2490r3 + 4r*2 + 4r + 1170. Let x(g) = -2f(g) - 3s(g). Differentiate x(l) wrt l. -7464l2 Let v(w) be the first derivative of -653w*4/2 + 2w*3/3 - 6349w - 10651. Find the third derivative of v(i) wrt i. -7836 Let q = -227 + 253. Let d = -9 + 27. Find the first derivative of 7x3 + x3 - q + d + 16 wrt x. 24x*2 Let v(r) = 2r*2 - 31r + 82. Let p be v(3). Let a(l) be the first derivative of 0l4 + 0l*2 - 8l - 8/5l5 + 0l*3 - p. Differentiate a(w) wrt w. -32w*3 Differentiate -5884q + 5578q + 1182 - 119 with respect to q. -306 Suppose -24a + 12 = -21a. Suppose 9 = ax - 7. Find the third derivative of 9n4 - 38n*2 + 3n*x + 9n*2 wrt n. 288n Let o(d) be the first derivative of -1137d4/4 - 1501d - 924. What is the first derivative of o(w) wrt w? -3411w2 Let k = -45 - -23. Let a = 43 + k. What is the second derivative of f2 - 7f - 20f5 - f2 + af*5 wrt f? 20f*3 Let h be (-57)/(-133) + (-59)/7. Let f = h - -10. Find the second derivative of 19k*f - 14k*2 - 8k - 8k2 - 9k*2 wrt k. -24 Let s(u) = 2u*2 + 6u + 8. Let q be s(-2). Find the second derivative of 247x - 225x - 3 + 5 - 3 - 78xq wrt x. -936x2 Let r(o) be the third derivative of -o6/30 - 95o4/24 - 191o*3/6 - 1155o*2. Differentiate r(f) with respect to f. -12f*2 - 95 Suppose -4y + 20 = -2r + 4r, 0 = y - 2r - 10. What is the third derivative of -39g*2 - 70g*y + 10046g*3 - 10046g*3 wrt g? -8400g*3 Find the second derivative of -5w*3 + 13w*3 - 6w*2 - 2w*2 - 6w + 142 + 2w + 33w*2 wrt w. 48w + 50 Suppose 5p - 3p - 2612 = 0. What is the first derivative of -46 + py - 70y*2 - 1306y wrt y? -140y Let p(s) be the first derivative of 70s6/3 - s5 + 1039s3/3 + 1190. Find the third derivative of p(h) wrt h. 8400h*2 - 120h Let z(f) = 5f2 - 7f + 113. Let o be (-1)/(-2) - (-20)/8. Let a(g) = -9g2 + 12g - 228. Let w(k) = oa(k) + 5z(k). Differentiate w(y) with respect to y. -4y + 1 What is the second derivative of -732q - 767q + 19919q*5 - 21823q*5 wrt q? -38080q*3 Suppose -30 = -5u - 4n, 0 = 4u - 4n + 9n - 33. Find the third derivative of 91s2 + 176s*2 - 150s*u - 66s*4 wrt s. -1584s Let p(b) be the second derivative of -2/3b3 + 33/2b*2 + 11/20b*5 + 0 - 1/3b*4 + 29b. What is the second derivative of p(r) wrt r? 66r - 8 Let x(p) = 419p*4 - 1082p*2 - 4p + 8. Let m(r) = -836r4 + 2163r*2 + 9r - 18. Let d(k) = 4m(k) + 9x(k). What is the third derivative of d(s) wrt s? 10248s Let y(q) = -40q - 12. Let j be 1/2 - 14/4. Let f be y(j). Find the second derivative of 2d2 + 53d - fd + 51d wrt d. 4 Find the third derivative of 391 - 221c + 2c*2 + 517 + 0c*2 + 221c + 1420c3 wrt c. 8520 Let t(i) be the second derivative of 1553i4/6 - i3/3 + 653i2/2 + 180i + 18. Differentiate t(m) wrt m. 6212m - 2 What is the second derivative of -3226x + 98352x2 + 239x*3 - 98354x*2 + 4x*4 - 14x*4 wrt x? -120x*2 + 1434x - 4 Let k = 27 - 27. Suppose k = 7w - 2w - 20. What is the second derivative of -2u - 41u*w - 26u*4 + 23u + 32u4 wrt u? -420u*2 Let n(k) be the second derivative of 0k*2 + 0 - 31/28k*8 - 51k + 0k5 + 0k*7 + 0k*6 + 1/12k*4 - 2/3k*3. Find the third derivative of n(u) wrt u. -7440u*3 Let f(c) be the first derivative of 39c5 - c3 + 14558c - 297. Find the first derivative of f(l) wrt l. 780l*3 - 6l Differentiate 2277 + 198j2 - 16j*2 - 179j*2 + 221j*2 - 5j*3 + 20j*3 with respect to j. 45j*2 + 448j Let h(l) = 647l3 + 1541l*2 - 6l - 12. Let u(z) = 647z3 + 1540z*2 - 4z - 8. Let f(c) = -4h(c) + 6u(c). Find the third derivative of f(n) wrt n. 7764 What is the third derivative of -8359343 + 8359343 - 1996x2 + 12783x*3 wrt x? 76698 Let p(u) = 12310u*2 + 9u + 1723. Let y(w) = -3w2 + 3w + 1. Let j(r) = p(r) - 3y(r). Differentiate j(o) with respect to o. 24638o Let o(h) be the second derivative of 724h6/15 - 244h*2 - 97h - 3. Differentiate o(p) wrt p. 5792p3 Find the third derivative of 3548c*3 + 2848c*2 + 110594c - 110594c wrt c. 21288 Let d(l) = 741l*3 - 3l*2 - 70l - 2. Let k(b) = 742b3 - 4b*2 - 80b - 3. Let i(x) = -4d(x) + 3k(x). What is the second derivative of i(z) wrt z? -4428z Let x(z) = 19z - 18z2 - z3 + 9z*2 + 62 - 15z*2. Let k be x(-25). Find the second derivative of -18v - 24v2 + k - 212 wrt v. -48 Let q(c) be the first derivative of -1730c*3/3 + 10c*2 + 9c + 1848. Find the second derivative of q(g) wrt g. -3460 Let w(x) be the first derivative of 3x2/2 - 28x + 6. Let c be w(10). Find the third derivative of -7l2 - 16l*2 + 5l*6 - 2l + cl wrt l. 600l*3 Let r be (-46)/(-161) - 200/14. Let p be 63/(r/(-78) + 10/65). Find the third derivative of 166z2 - z3 + 0z - pz*2 + 0z + 13z4 wrt z. 312z - 6 Find the third derivative of 14 - 46 + 4z2 - 167 - 6z*2 - 42 - 1345z*3 wrt z. -8070 Let g(i) = -1178i - 3043. Let x(y) = -14135y - 36550. Let d(c) = 35g(c) - 3x(c). Differentiate d(j) with respect to j. 1175 Let c(u) be the third derivative of 493u6/8 - u5/20 + 10u4/3 + u3/6 + 9u*2 + 20. What is the third derivative of c(l) wrt l? 44370 Find the third derivative of 6 + 12 - 16 + 797n4 + 17 - n2 wrt n. 19128n Let b(i) = -i2 + 11i - 22. Let q be b(8). What is the first derivative of -24rq - 13r*3 + 22 - 47 + 28r*2 wrt r? -39r*2 + 8r Let c(d) = -10d4 - 162 + 244d - 6d4 - 6d*3 - 246d. Let s(m) = -81m4 - 33m*3 - 11m - 810. Let h(f) = -11c(f) + 2s(f). Differentiate h(a) wrt a. 56a3 What is the first derivative of -5k*3 + 103 - k - 12k*2 + 49 + 12k*2 - 21k wrt k? -15k2 - 22 Let n = 80 + -84. Let v be 2 - (n - 0 - (-8 - -5)). What is the second derivative of z2 - 6z - z + 5z - vz*2 wrt z? -4 Let p(r) = -5r*3 - 33r - 697. Let m(y) = 4y3 + 31y + 697. Let c(w) = 7m(w) + 6p(w). Differentiate c(l) with respect to l. -6l2 + 19 Let r(t) be the second derivative of 251t*4/12 - 2t*3 - 2805t*2 - 789t + 4. What is the derivative of r(n) wrt n? 502n - 12 Find the third derivative of -642o*4 + 745o*2 - 3o + 32o3 + 1946o*4 - 32o*3 + o wrt o. 31296o Let m(q) = -27q2 - q + 2. Let v(i) = 78i*2 + 14i - 7 - 20i + 9i. Let h(s) = -7m(s) - 2v(s). What is the second derivative of h(t) wrt t? 66 Let x = -66 + -3. Let o = -18 - x. Differentiate o + 7k2 - 31 + 14k*2 with respect to k. 42k Let i(b) = 2371b3 + 2b*2 + b - 7076. Let v(l) = 4742l*3 + 5l*2 + 2l - 14149. Let r(w) = 7i(w) - 3v(w). What is the derivative of r(h) wrt h? 7113h2 - 2h + 1 What is the derivative of 1169b2 + 1636 + 3560 - b - 799b*2 wrt b? 740b - 1 What is the third derivative of -60 - 2s3 + 4721s*4 + 3s + 13 - 27s2 + 11 + 16 + 15 wrt s? 113304s - 12 Let u(t) be the first derivative of -t*4/2 - 635t*3/3 - 410t + 274. Differentiate u(j) wrt j. -6j2 - 1270j Let s(x) be the third derivative of 0x - 107/60x*5 - 13/4x*4 + 70x*2 + 0 + 1/3x*3. What is the second derivative of s(l) wrt l? -214 Let c(b) = 20b - 21. Let x(s) = s + 1. Let p(t) = -t - 2. Let h(f) = -p(f) - 2x(f). Let a(w) = c(w) - 3h(w). What is the derivative of a(k) wrt k? 23 Let w(c) be the first derivative of -c*5 + 11c3 - c2/2 - 55c + 822. Find the second derivative of w(f) wrt f. -60f*2 + 66 What is the derivative of 1218 - 26 + 90l*3 - 170l*3 + 88l*3 wrt l? 24l*2 Let q be (74 - 70) + (-2)/(-2) + 0. What is the second derivative of 0g*5 - g - 3g*q + 41g + 28g wrt g? -60g*3 Let r(g) = 6532g*4 + 16g**3 + 3162. Let d(h) =	{ "pile_set_name": "DM Mathematics" }
a = 28 + -25. Suppose -d + 3d + 4f - 84 = 0, af + 112 = 2d. What is the tens digit of d? 5 Let s = 4 + 4. Suppose -2n - 2n + s = 0. Suppose -j = -nk - 49, -3j - 2k + 179 = -0j. What is the tens digit of j? 5 Let t = -984 + 984. Let z be (-192)/(-14) + (-4)/(-14). Suppose t = -18j + zj + 28. What is the units digit of j? 7 Let k = 1381 + -472. What is the units digit of k? 9 Let n(w) = -196w - 5. What is the units digit of n(-1)? 1 Suppose 3m - 2j = -14, j = -2m + 6j - 24. What is the units digit of (m/(-4))/((-5)/(-610))? 1 Let f = -13 - -17. Suppose -2x - 13 = -0q - 3q, 0 = fq - 2x - 18. Suppose 2n - 70 = -j, -qn - 4j + 172 = -0j. What is the tens digit of n? 3 Let b be (1 + 3/(-6))312. Let y = b + -91. What is the tens digit of y? 6 Suppose 4p - 5w + 336 = 1404, 4p = -2w + 1040. What is the tens digit of p? 6 Suppose -13d - 78 = -26. What is the tens digit of (52/(-10))/(3d/180)? 7 Let k(d) = 2d - 10. Let u be k(9). Let y(z) = 6z - 1 + 12z*2 + z - uz. What is the units digit of y(-1)? 2 Let d = 588 - -1306. What is the tens digit of d? 9 Let g be 11 - 3 - (-6)/(-2). Suppose -212 + 782 = 4l + gw, 5l + 4w = 717. What is the units digit of l? 5 Let s(r) = 3r3 - 5r*2 - 6r - 11. Let w be s(9). Suppose 0 = 10d - 13 - w. What is the hundreds digit of d? 1 Let b(i) = 3i*2 - 39i + 5. Suppose 20w - 247 = 7w. What is the units digit of b(w)? 7 Let g(b) = -139b3 - b2 - b - 1. Let r be g(-1). Suppose k + 25 = r. Suppose -3d - 183 = -3n, k = 2n - 2d + 3d. What is the units digit of n? 8 Let z(b) = -793b + 4. What is the hundreds digit of z(-1)? 7 Let r be -2 - (25/(-5) + -1). Suppose 0 = ri - 3w - 462, -212 = -2i + 3w + 22. What is the hundreds digit of i? 1 Suppose -5a + 2 = -5p + 17, -p = a - 7. Suppose at = -2t + 228. Let o = t - 12. What is the tens digit of o? 4 Suppose 2t = -0t - 5n + 1311, -n + 651 = t. What is the hundreds digit of t? 6 Let f(s) be the first derivative of -s4/4 + s3/3 + s*2 + 2s + 16. What is the units digit of f(2)? 2 Suppose 21k = 11k + 2490. What is the hundreds digit of k? 2 Suppose -i + 3y = -691, 5i - 3i + 3y - 1364 = 0. What is the units digit of i? 5 What is the hundreds digit of 10/6 - 296(-234)/108? 6 Let r(c) = -2c*2 + 13c - 2. Let j be r(6). What is the units digit of j - (-4 - 136 - 2)? 6 Let v(a) = 2a2 + 4a + 4. Let g be v(-3). What is the units digit of (-168)/(-20) - 4/g? 8 Suppose -x + 9 = 2x. Suppose 0 = xz - 4b + 4, -3z + 5b + 0 = -1. Let f = z + 13. What is the units digit of f? 5 Let l(t) = -t2 + 8t - 5. Let h be (-24)/(-40)(-1 - -11). Let d be (-2)/((-4)/h) + 3. What is the units digit of l(d)? 7 Suppose u + 5t - 20 = 0, 0u + u - 5t + 10 = 0. Suppose 4d = uc + 201, 0c - 103 = -2d + 5c. What is the units digit of d? 9 Let s = 49 - 50. What is the units digit of s/3(155/(-1) - -2)? 1 Let n be (-81)/184/(-6). Suppose -106 + 304 = na. What is the tens digit of (-11)/11 + 1 + a? 6 Let f(m) = 2m - 6. Let o be f(-9). Let l be 4/6 - o/(-9). What is the tens digit of (-4)/(-2) - (-18 - l)? 1 Suppose -2o - 2o - 2k + 294 = 0, 4o - 5k - 287 = 0. Suppose -2d - 180 = 2d + u, 5d + 225 = -2u. Let m = o + d. What is the tens digit of m? 2 Let d be 1 + 15/(-5) + -146. Let g = -94 - d. What is the tens digit of g? 5 Suppose -h = c + 2c + 13, -3h = c + 71. Let f = 35 + h. What is the tens digit of f? 1 Suppose 610 = u - 6u. Let d = -203 - u. Let k = -43 - d. What is the tens digit of k? 3 Let k = 10 + -16. Let s(z) = z2 + 5z - 3. Let b be s(k). Suppose -bo - 3u = -111, 2u = -5o + 4u + 178. What is the units digit of o? 6 Let z be (0 - (-4 + 4))/2. Suppose z = t - 4t + 24. Let h = t - -3. What is the units digit of h? 1 Let j be (-2)/(-5) + -1 + (-322)/(-70). Suppose jk = 17 - 1. What is the units digit of k? 4 Let t(r) = r3 - 5r*2 - 3r + 5. Let x = -1 + 4. Suppose 0o = 4o + 3k - 24, 3o - xk - 18 = 0. What is the units digit of t(o)? 3 Let s = 721 + -447. Suppose s = 2n + 74. What is the hundreds digit of n? 1 Suppose -5l = -2l - 6. Let c be (-1125)/(-18) + l/(-4). Let b = 89 - c. What is the units digit of b? 7 What is the tens digit of ((-5621)/(-28))/((-2)/(-8))? 0 Suppose 0 = -5p + 4r - 9r + 3340, 0 = -4p - 5r + 2670. What is the hundreds digit of p? 6 Suppose 2t + 3490 = 42k - 39k, -5t + 5 = 0. What is the tens digit of k? 6 Let a be (1/1)/((-3)/(-33)). Let l(g) = g2 - 10g + 1. Let w be l(a). What is the units digit of 76(15/w)/5? 9 What is the units digit of (27/(-36))/(12/(-8136))? 1 Let z = 7 + -9. Let p be ((-10)/(3 + 2))/z. What is the units digit of 2 + p + (9 - 11)? 1 Let t(s) be the first derivative of -s*3/3 + 15s*2/2 - 5s - 10. Let z(v) be the first derivative of t(v). What is the tens digit of z(-17)? 4 Let h(p) = p*2 + 4p - 5. Let y = 17 - 9. Let c be 0 + -9 - (-11 + y). What is the units digit of h(c)? 7 What is the units digit of 195342/315 - (-2)/(-15)? 0 Let j(g) be the third derivative of -5g4/12 + g3/6 + g2. Let z = 43 + -46. What is the units digit of j(z)? 1 Let z be 1 + (2 - 1) - -2. Suppose z = -l + 3. What is the units digit of 4/((-2)/l - 0)? 2 Let n(l) = -2l*3 - 7l*2 + 18l - 18. What is the hundreds digit of n(-10)? 1 Suppose 3z + 3j - 740 = 439, 2j + 1596 = 4z. What is the units digit of z? 7 Let j(k) = -k*3 - 2k*2 + 6k + 7. Let x(p) = -p*2 + 7p + 5. Let t be x(8). Let l be j(t). What is the units digit of (l - -6)/(14/91)? 6 Let x = -4963 - -7912. What is the thousands digit of x? 2 Let w be (-27)/(-5) + 4/(-10). Suppose 0 = wc - 40 - 35. Suppose -4s - 3 + c = 4g, 5g = -3s + 21. What is the units digit of g? 6 Suppose -5f + k + 2255 = -752, -4f + 4k = -2396. What is the tens digit of f? 0 Let u(r) = -19r + 2. Let p be u(2). Let o = 65 + p. Let f = o - -12. What is the tens digit of f? 4 Let l(m) = 14m - 5. Let u = -5 - -17. What is the tens digit of l(u)? 6 Suppose -1600 = -5r - 4h, -4r - 4h - 270 + 1546 = 0. What is the hundreds digit of r? 3 Suppose -46h + 29h + 60452 = 0. What is the units digit of h? 6 Let c = 11 + -4. Let u be 5/3 - (-6)/18. Let x = c - u. What is the units digit of x? 5 Let k(h) = -h*2 - h + 27. Let m be k(0). What is the units digit of ((-18)/m)/((-1)/6)? 4 Let b = 14 + -12. What is the tens digit of (3 - b)(-1 - -48)? 4 Let j = -175 - -185. What is the tens digit of j? 1 Let f(y) = 3y - 13. Let m be f(6). Suppose 5l - 103 = -j + 3l, -ml + 490 = 5j. What is the tens digit of j? 9 Suppose -5 = -5n + 5. Suppose -4t - 424 = -4h, -nh - t + 536 = 3h. What is the tens digit of h? 0 Let o(r) = 2168r3 - 3r*2 - 3r + 5. What is the hundreds digit of o(1)? 1 Suppose 3s - 33 = -0s. Suppose 3j - s = 5u, 2j = -j + 2u + 17. Suppose -5h - 4d = -231, -5h - jd = -2d - 235. What is the tens digit of h? 4 Suppose 4g - 2g = -252. Let c = g - -232. What is the units digit of c? 6 Let n = 13 + -10. Suppose -11 = nr + 7. What is the units digit of -1(-26 + 3 + r)? 9 Let v = -468 + 1185. What is the tens digit of v? 1 Let i(d) = 16d*2 - 7d - 1. Let a(u) = 2u - 4u*2 - 2u*2 + 7u*2 - 3u. Let s(k) = -6a(k) + i(k). What is the tens digit of s(-2)? 4 Suppose 0 = -2d + 237 + 37. What is the hundreds digit of d? 1 Let p = 94 + -91. Suppose -730 - 45 = -5i - pz, -z = 4i - 627. What is the units digit of i? 8 Suppose -22 = 3t - 484. Suppose -5f + 302 = 3p, -5p - t = -3f - 0f. What is the units digit of f? 8 Let a(z) = -41z - 74. What is the hundreds digit of a(-7)? 2 Let v(o) = 2o3 - 3o*2 - o + 1. Let b be v(-1). Let n be ((-6)/4)/(3/(-6)). What is the tens digit of 16 + b/(-3)n? 1 Suppose 17186 = 5z + 3p, -5z + 3430 = -4z - 3p. What is the hundreds digit of z? 4 Let i(h) = -52h - 2. Let f be i(-2). Suppose -4v + 5v = l - 34, -3v = 3l - f. What is the units digit of l? 4 Suppose 3k = -4k + 805. Let i = 171 - k. What is the units digit of i? 6 Let z = -49 + 2709. What is the hundreds digit of z? 6 Let o(c) = c*3 + 26c*2 - 15c - 216. What is the tens digit of o(-17)? 4 Suppose 2j + 65 = 43. Let s = j + 152. What is the hundreds digit of s? 1 Let b be (-92)/(-22) + 6/(-33). Suppose 35 = -bs + 135. What is the units digit	{ "pile_set_name": "DM Mathematics" }
u for u. -2 Let x = -96 + 101. Suppose -xl + 9l = 60. Suppose 5y - 21 = -b, -y + 0b - l = 5b. Solve -yo = -3o + 2 for o. -1 Let j be (-59)/(-3) + (-22)/6. Solve 42w = jw for w. 0 Let r(q) = 2q3 + 16q*2 + 23q + 24. Let b be r(-6). Solve 58a + 86 = -b for a. -2 Let b(g) = -g3 - 6g*2 + 73g + 21. Let y be b(6). Solve 0 = 15q + 12q + y for q. -1 Let t = 15819 - 15758. Solve 57r = tr - 24 for r. 6 Let o be ((-2)/(2 - 0))/((-51)/1377). Suppose -a - 8a + o = 0. Suppose 3j + 2n = 36, 0j + 36 = aj + 3n. Solve j = 4k - 4 for k. 4 Suppose 20z - 18z + 3x = 167, 3z - 250 = -5x. Solve 0 = -80g + zg + 15 for g. -3 Let u(g) = -6g - 47. Let z be u(13). Let l be (z/(-20) - 7)/(1/(-16)). Solve i + 2i + l = 0 for i. -4 Let v(a) = -a - 2. Let d be v(-4). Suppose -b + 2b = 4. Let k be (b/(-5))/((-6)/75). Solve 0u = -du + k for u. 5 Let w be (409 - -67)1/4. Solve -19j - w = -195 for j. 4 Let z be 6/(-9) + -13 + (-396)/(-27). Let p(a) = -a3 - 2a*2 + 2a*3 + 5a*3 + a. Let c be p(z). Solve -c + 2 = 3t for t. -1 Let s(j) = 292j + 1764. Let f be s(-6). Solve -31u - f = -43u for u. 1 Let l(m) = -375m - 1409. Let r be l(-4). Solve 75s + r = 62s for s. -7 Suppose 0 = 5o + 835 - 1075. Suppose -721y + o = -718y. Solve -3n = -yn - 26 for n. -2 Let w be -1 - -9 - (4 - (-4)/(-2)). Suppose -4y + w = -2y. Suppose -2d = -118 + 116. Solve q + y = d for q. -2 Let b = 10926 - 10691. Solve -236 = o - b for o. -1 Suppose 3024o - 3034o + 110 = 0. Solve x - ox = 40 for x. -4 Let c be (-2 - (-11 + 9))/3. Suppose 3t - 2r - 38 = c, 5r + 52 = 4t - 1. Let w(a) = a2 + 3a - 3. Let h be w(2). Solve ho - 3o = t for o. 3 Let c(j) = j*3 - 8j*2 - 8j + 3. Let f be c(9). Let k be 12/515/f2. Solve k = -z + 7z for z. 1 Let z = 823 - 798. Suppose 210y - z = 205y. Solve -20 = 5m + y for m. -5 Let b be -5(3 + 90/(-25)). Let u(g) = -18 - 3g - 7g2 - 3g - 10g + gb. Let r be u(9). Solve rh = 3h - 12 for h. 4 Suppose -b - 11b - 24b + 396 = 0. Solve -7y - 10 - b = 0 for y. -3 Let f = 4195 + -4189. Solve 40 + f = -23x for x. -2 Let h be -5((-2240)/25 + 3). Let q = 439 - h. Solve -24 = 12i - qi for i. -4 Let k = 7536 - 7471. Solve 40h = 53h - k for h. 5 Let r be -9 + (-9)/(-9) - -190. Solve -ry = -180y - 8 for y. 4 Let z = -13 - -15. Let f(d) = d*3 + 5d*2 - 21d + 3. Let i be f(-8). Let y be (15 - -1)/z - (-17 - i). Solve v + y = -0 for v. -4 Let r = 10330 + -10120. Solve -2a = -44a - r for a. -5 Suppose -312p + 1912 = 166p. Solve 10q = -84 + p for q. -8 Let d be ((-21)/(-28)4 - (-1 + 3))3. Solve 20 = dh - 8h for h. -4 Suppose -2d - 56j + 52 = -53j, 0 = -4j - 16. Solve 3 = -dn + 35n for n. 1 Let y be 28/(-1 - 6) + 4. Suppose y = -11r - 6r + 136. Solve o - 3o = r for o. -4 Suppose 12v + 297 = -903. Let o = v + 99. Let p be ((-6)/3)/(-2)(-5)/o. Solve -7j = -pj + 8 for j. -4 Let x = -48 + 47. Let j be (-30)/(1 + x/(-2)). Let y be (1/(-4))/(5/j). Solve y = -s - 2 for s. -3 Suppose 0 = -5v + 10v - 20. Suppose 0 = 3r + 5s - v, -7 + 27 = 4r + 3s. Suppose -r = -6q + 2q. Solve 3c = -qc - 25 for c. -5 Suppose -4s + 20 = 3n, -2 = 4n - 5n + s. Let w(y) = -2y3 + 3y*2 - y + 1. Let t be w(2). Let x = 30 + t. Solve nj + x = -j for j. -5 Suppose 4q - 2y = 66, 22y = 24y + 6. Solve 0 = 6x - 9x - q for x. -5 Let p be ((15/6)/5)/((-10)/(-8940)). Let b = p - 437. Solve 0 = -bd + 2d - 16 for d. -2 Suppose 19g - 36 = 10g. Suppose -4l + 0l = 3u + 6, -gl = 5u + 10. Let h(a) = 6a*2 - 1. Let x be h(1). Solve l = xt + 1 + 4 for t. -1 Let j = -5 - 31. Suppose -2 - 3 = -5n. Let w be (n/(1/(-1)))/(9/j). Solve -wa = -a - 3 for a. 1 Let l be -6 - ((-2 + -1)/3)/((-59)/(-1770)). Solve 78 = 2z + lz for z. 3 Let i be -66 + -2 + 1 + 59/(-59). Let x be (-52)/(-6) - i/51. Solve 12 = -xq + 6q for q. -3 Suppose 0 = 5s + 467m - 466m - 107, 3m + 78 = 4s. Solve -sq - 49 = -14q for q. -7 Let i = 558 - 490. Suppose -ir + 33 = -57r. Solve 2o + ro + 20 = 0 for o. -4 Let j be 32/22. Let o = -3360 - -3364. Solve 6 + j = ov for v. 3 Suppose -76t - 72t = -154t + 18. Solve ts + 132 = 144 for s. 4 Suppose -w + 12i - 13i - 470 = 0, -2w - 5i - 934 = 0. Let q = 502 + w. Solve -24 + q = -2j for j. -3 Let x(w) = -2w*3 + 15w*2 - 7w + 16. Let v be x(7). Suppose 10r - 76 = -5b + 9r, b = -r + v. Solve 0 = 7l - 4l + b for l. -5 Suppose 0 = 27i - 3502 - 3680. Solve 39a + 32 - i = 0 for a. 6 Suppose -10 = -z + 2k + 3, z + 5k + 22 = 0. Let r be (0 + 2)(z - 5). Let g(v) = v*3 + 5v*2 + 2v - 3. Let a be g(r). Solve af - 9 = 2f for f. 3 Suppose -32r - 4r = -216. Suppose 2h = 2j - r, -2 = -5j - 2h + 6. Solve -jf + 5f = 0 for f. 0 Suppose -9v + 45 = -0v. Suppose k + 2q - 28 = -3k, vq = 20. Solve 0t = t - k for t. 5 Let s(n) = -3n - 16 + 2n + 44 - 4n. Let v be s(5). Solve z = 4z - v for z. 1 Let l be (1 - -103) + (15 - (-14)/(-1)). Solve -193q + l = -208q for q. -7 Let g be (-6 + (-231)/(-42))-242. Solve 0 = gs - 115s - 30 for s. 5 Suppose -7i + 125 - 69 = 0. Solve -i - 64 = 24z for z. -3 Let h = 10164 + -10110. Solve -59m + h = -68m for m. -6 Suppose k + 3c - 2 = 0, -2c - 8 = -k + c. Suppose -10 = 3n + 3f - f, -kf - 25 = -3n. Solve 4r = -nr - 20 for r. -5 Suppose b - 40 = -3o, 4o + o - 67 = -2b. Suppose -2u + ou = 55. Solve -11i = -6i + u for i. -1 Let b be 2/12 - 2996/(-24). Suppose -b = -6t - 29. Suppose t = y + 4c, 3c = 2c + 3. Solve 0 = 5o + 1 + y for o. -1 Let a(b) = -b2 + 7. Let q be a(-4). Let o be (6/q-3)/(6/(-12)). Let s be (o - -6) + 6/(-3). Solve s = 3k - 2k for k. 0 Let b = 89513 + -89505. Let p(t) = t + 7. Let x be p(-4). Solve -xz = -bz for z. 0 Suppose 0k + 18k - 36 = 0. Suppose -4h + 5q = 20, -kh = -10q + 15q - 20. Let w(z) = -z. Let d be w(-3). Solve -l = -hl - d for l. 3 Let o(i) = 6i2 + 18i - 33. Let d be o(2). Solve 43c = 52c - d for c. 3 Let i(o) = 2o3 + 51o*2 + 27o + 34. Let y be i(-25). Let r(d) = -d*3 + 6d*2 + 11d - 7. Let z be r(7). Let a = z + y. Solve -au = -u for u. 0 Suppose 162b - 6673 = 7421. Solve -ba + 76a + 22 = 0 for a. 2 Let a(j) = j*2 - j - 24. Let s be a(-10). Suppose 6q = -38 + s. Suppose -ql = -35 + 3. Solve g = -lg for g. 0 Let x be -98((-3)/1 - (-3)/2). Let p = x + -86. Let b = 62 - p. Solve -7 + b = 3y for y. -2 Let g be (-3360/108)/(5/(-3)). Solve 14h - gh + 9 = 0 for h. -3 Suppose -q - 3 = 0, -14q + 13q = -3r + 51. Solve -177s + 173s = r for s. -4 Let b = -159 + 171. Suppose 0 = z - 5q + 20, 4z - b = 4q - 7q. Solve z = -8j + 6j - 6 for j. -3 Let k = -1 - -4. Suppose 5v = 6a - a - 10, 5a - 3v = 16. Suppose -2x = -2r + 2 + 8, 0 = -ax - 15. Solve k - 1 = -rw for w. -1 Suppose o + 2 = -p + 7, 0 = 3p - 2o - 20. Suppose -5b - 3n = -54, -2b - 4n = -8n - p. Solve -5 + b = j for j. 4 Let d = -2829 + 2968. Solve da + 15 = 136a for a. -5 Let o be (-292)/657 + 436/9. Solve 0 = 54h - 62h - o for h. -6 Suppose 3i - 60 = -3i. Let w be (-3)/(6/i)(-75)/125. Solve 3p = w - 6 for p. -1 Suppose 60 = -1342a + 1343a. Solve av = 40v - 180 for v. -9 Let q be 0/(5(-14)/(-10)). Solve k - 61 + 55 = q for k. 6 Let v(d) = d*2 + 10d + 8. Let q be v(-8). Let o = q + 11. Suppose -a - 3a + 5 = -5j, -oa = -5j. Solve -20 = as - 0s for s. -4 Let r(n) be the third derivative of n5/60 + n4/24 - n*3 - 31n*2. Let f be r(-5). Let k be (-2)/(-7) - (-3 + 46/f). Solve -6j + j + 25 = k for j. 5 Let w = 26 - 28. Let t be w/(-8)(-5 + 13). Suppose 6p - p - 2i - 13 = 0, 2p - ti - 10 = 0. Solve -d - 3 = -p for d. -2 Suppose 2d - a - 2 - 5 = 0, 7 = 3d - 5a. Suppose -dv = -3s - 22, -5v + 13 - 2 = -s. Let m be (9/s)/(3/(-6)). Solve h = m - 2 for h. 1 Suppose 5n + 4b + 4 = 0, -7n + 3n = 4b + 8. Solve 13l = -nl - 12l for l. 0 Suppose -25x = -74x + 98. Solve x = 2q + 14 for q. -6 Let u = 2611 - 2596. Solve -8o + u = -3o for o. 3 Suppose 169w - 30368 = -123w. Solve -w + 99 = z for z. -5 Let m = -12 - -6. Let z be 1-332/m. Let q(d) = d*2 + 48d + 323. Let t be q(-7). Solve -5i + z = t for i. -5 Suppose 2w + 1268 - 1270 = 4j, -2j + 2w - 10 = 0. Solve 0 = -jf + 7 + 17 for f. 6 Suppose -38*s - 8 = -42	{ "pile_set_name": "DM Mathematics" }
et j be 6/8 - (-507)/c. Let p = j + -38. Solve -6 = -pa + 3a for a. 3 Let o(a) = -3a3 + 16a*2 - 17a + 1. Let w(r) = 7r3 - 31r*2 + 34r - 1. Let u(f) = 5o(f) + 2w(f). Let d be u(17). Solve s = ds for s. 0 Suppose g - 2j - 8 = -0, -2j = 4g - 12. Let k be ((-8)/32)/((-3)/36). Suppose 2p + 2f - kf = 20, 0 = -p + 2f + g. Solve 4a = a - p for a. -4 Suppose 2g = 4g - 10. Let j = 5 - g. Solve -4z = -jz for z. 0 Let r be (-2)/((-1 + 6)/(70/(-28))). Solve -3w + r = -14 for w. 5 Let s(x) = -8x - 5. Let f be s(-1). Suppose 5r - 2b = 16, -2b = -3b - f. Solve r = 2y + 4 for y. -1 Let f(o) = -o*2 - 20o - 11. Let q be -19 + (4 + -1 - 2). Let y be f(q). Solve y = -3k + 8k for k. 5 Let s(l) = l*3 + 7l*2 - 11l - 12. Let t = 12 - -4. Suppose -4n - 16 = t. Let d be s(n). Solve 6o = 3o + d for o. 4 Let x(h) = -h - 2. Let g be x(-2). Suppose 0 = 4p - 5b + 3, 7 = 5p - 3b + 1. Let y = p + g. Solve 2m - 1 = -y for m. -1 Let a(d) = d - 19. Let r be a(17). Let o(h) = h*2 + h - 2. Let q be o(r). Solve qn = -n - 5 for n. -5 Let j = -8 - -11. Suppose -c + jc = 32. Suppose -m = -3p + 12, 0 = -m - 4m + 4p - c. Solve 4b + 7 - 3 = m for b. -1 Let n be -4 + 2 + (0 - 1). Let g be ((-104)/12)/((-1)/n). Let k be (-6)/(-5)(-65)/g. Solve y - 8 = -ky for y. 2 Suppose 5l = -2f + 36, -11 - 7 = -4l + 2f. Solve 18 = 3z + lz for z. 2 Let z be (-2180)/(-140) - (-7)/((-196)/(-12)). Solve 11y - zy + 10 = 0 for y. 2 Let x(g) = g3 - 31g*2 + 83g + 28. Let l be x(28). Let w(c) = c*2 + 5c - 2. Let t be w(-6). Solve -9m + tm - 20 = l for m. -4 Let c(g) = 2g + 41. Let n be c(-19). Solve -4s - n = 9 for s. -3 Let d be (-1 - 50/(-6)) + 1/(-3). Suppose f = df. Solve f = -4p - 3 + 7 for p. 1 Let a(h) = h*2 - 18h + 89. Let u be a(9). Solve 6r = ur - 4 for r. 2 Let w(h) = -2h2 + 3h. Let g be w(2). Let d be 6 - ((-6)/g - 3). Suppose 0 = -di + 2i + 24. Solve 3 = l + i for l. -3 Let k = -485 + 564. Solve -kv + 75v - 4 = 0 for v. -1 Let c = -295 + 312. Solve 0l + cl - l = 0 for l. 0 Suppose -h + 4o = -78 + 49, -2h + 37 = -o. Solve -20z = -hz + 3 for z. -1 Let k(o) = 4o2 + 19o + 12. Let p be k(-4). Suppose 0 = 3i + 2i. Let g be 6 - 4 - (-1 - i). Solve -l + gl - 6 = p for l. 3 Let m(r) = -2r*2 - 71r - 98. Let u be m(-34). Let k(p) = p*2 - 2p - 1. Let v be k(3). Solve v = ua - 10 for a. 3 Let y(b) = 16b*2 - 16b + 19. Let u be y(2). Solve 0 = -3x - 36 + u for x. 5 Let w = 8 - 3. Suppose -j + 5n = -0n + 2, -n = -wj - 34. Let b be -4 - j(-3)/(-3). Solve -br = -r for r. 0 Let n(u) = 2u + 25. Let o be n(-9). Suppose -g + 5 = -4p, g - o + 2 = 2p. Solve -gz = -2z - 15 for z. 5 Suppose -5a - 4h + 36 = -3h, 0 = h - 1. Solve 8z - az + 4 = 0 for z. -4 Let u be -1 + 3/(5 - 2). Suppose 4a = -0w - 2w - 6, -a + 3w + 16 = u. Solve -3d - a = 2 for d. -1 Let z be -1(-1)/4 - (-11)/(-44). Let r(h) = -8h + 8. Let x be r(z). Solve -6g + 4g = -x for g. 4 Suppose -5g - w = -27, -21g + 23g + 2w - 14 = 0. Let v(x) = -x2 - 8x. Let q be v(-8). Suppose -5t = -t. Solve gd + td = q for d. 0 Let l = 341 - 331. Solve -4r + 2 = -l for r. 3 Let l(h) = 7h - 1. Let w be l(1). Suppose -2y + 16 = w. Suppose -4v - yj = v - 55, 15 = 3j. Solve v + 2 = 2m for m. 4 Let w be 0(-4)/12 - (0 + 0). Solve 10z - 24 - 26 = w for z. 5 Suppose -5r + 34 = 24. Let v = 0 - -2. Solve ri + 0 = v for i. 1 Let d = 443 - 439. Solve -4 = di - 0 for i. -1 Let f(z) = 2z - 9. Let c be f(6). Suppose 5p - 35 = -10. Suppose -d = -pd + 12. Solve 3 = dy - c for y. 2 Suppose 9 = -9d + 12d. Solve d = -6k + 9 for k. 1 Let a be 2 - (-4 - -9)/5. Suppose -4x + 2 = 2l - 4, x - 7 = 5l. Solve -xo - 7 = -a for o. -3 Let o(i) = i + 3. Let c be o(-1). Suppose -cf + 2x + 38 = 0, 2f + 3x - 6x - 42 = 0. Let b(l) = 6l - 1. Let u be b(1). Solve 5m = f + u for m. 4 Suppose 55 = 19j - 8j. Solve -jk - 12 = -2 for k. -2 Let q(y) = y*2 + 11y + 3. Let r(b) = -2b - 1. Let t be r(5). Let k be q(t). Suppose ki + 28 = 7i. Solve -6x + ix = 3 for x. 3 Let z(r) = -r3 + 11r*2 - 10r. Let b be z(10). Let y(u) = u*2 - 22u + 6. Let j be y(22). Solve q + 4 - j = b for q. 2 Suppose 9 = 2l + 17. Let r(d) = -d2 - 2d + 8. Let f be r(l). Suppose -16 + f = -8c. Solve 1 = cy - 3 for y. 2 Let r = 236 + -220. Solve -r = -6k + 2k for k. 4 Suppose -3g = -4t + 145, -3g = -8g + 25. Solve 14d = 6d + t for d. 5 Let i(h) = h*3 + 5h*2 - 9h - 37. Let f be i(-5). Solve 0 = 5o - o - f for o. 2 Let c(v) = -v3 + 33v*2 - 33v + 42. Let b be c(32). Solve bu = -u + 11 for u. 1 Suppose -6m = -5 - 79. Let x be (2/m - 1)/(7/(-49)). Solve -3f - 6 = x for f. -4 Suppose 5b = -a - 8, -2b = -0a + 5a - 6. Let p(t) = -9t + 7. Let d(z) = -z + 1. Let r(u) = -40d(u) + 5p(u). Let f be r(b). Solve f = -6s + s for s. -1 Let t(q) = q3 - 18q - 3. Let y be t(-4). Solve y = 2z - 3z for z. -5 Let l = 108 + -100. Suppose 0 = -k + 7r - 10r + 27, -4r + l = 0. Solve 0 = -5j - k + 1 for j. -4 Let h be 10/7(-1764)/(-630). Solve -hx + 7x = 5x for x. 0 Let h(d) = -4 + 1 + d - 4d. Let p be h(-2). Solve 0 = -2j + pj for j. 0 Let w = -33 + 59. Suppose -3h + 5h - w = 0. Solve -4k + h = 1 for k. 3 Suppose -2x + 18 = 16. Let h be 0/((-3)/1 - x). Solve -4i + hi = 4 for i. -1 Let o(t) = t3 + 3t*2 - 7t - 10. Suppose -c = 2p + 4, -4p + 5c - 32 = 4. Let d be o(p). Solve dn + 2n = 8 for n. 2 Let v be (5475/(-150))/((-2)/4). Suppose i = -d - 2i + 51, -5d + 4i = -236. Let x = v - d. Solve 6j - j - x = 0 for j. 5 Let k = -27 - -44. Suppose 0 = -5t - 5, g + 4t - 6 = k. Let r = g + -12. Solve 4l - r = 1 for l. 4 Suppose -5y = 2f - 27, -5y - 3f + 7 + 16 = 0. Solve -11d + yd + 16 = 0 for d. 4 Suppose -8x = -4x. Let j = -100 + 105. Solve -jy - 12 - 3 = x for y. -3 Let c(g) = -2g - 7. Let i be c(-5). Suppose 4b - 4s - 24 = 0, -2b + 3 = is + 6. Suppose 5a - 3 = 2a + bw, 5w + 1 = 3a. Solve 3z = 4z - a for z. 2 Suppose 0k + 3k = 0. Let f be (-3 - (0 + -2))k. Solve 0 = -fv + v for v. 0 Suppose 2h = -2d + d + 5, -8 = -4d + 4h. Solve -ds - 9 = -0s for s. -3 Let v(i) = -11i - 3. Let k(j) = 12j + 4. Let n(t) = -6k(t) - 7v(t). Let z be n(3). Solve -4 = 4y + z for y. -4 Let v(p) = p + 8. Let r be v(-6). Suppose -t = 5, -3w = 2t - 1 + r. Let g(c) = -c*3 - 7c*2 - 8c. Let y be g(-6). Solve wd - y - 3 = 0 for d. 5 Suppose -17f = -6f - 682. Suppose -k - 2l + 16 = -4l, -l + f = 3k. Solve -k = -13y + 9y for y. 5 Let o be (2/8-1)/((-1)/(-4)). Let c = 7 + o. Solve 5s + c = 1 for s. -1 Suppose 2v + 6q - 5q + 14 = 0, 7 = -v - 2q. Let x(n) = -n - 2. Let t be x(v). Let p be (-2)/t - 10/(-25). Solve 0 = -4c - p + 12 for c. 3 Suppose -11 = -k + 3h, -4k + 6k - 7 = h. Solve kp - 2p = -5p for p. 0 Let l(m) = -m3 + 10m*2 - 5m + 14. Let y be l(10). Let q = y + 56. Suppose -4s + q = -4g, -5s - 4g - 6 + 40 = 0. Solve -3b + sb = 15 for b. 5 Let b be (581)/(8 - 7). Let j = b - 55. Solve jp - 10 = 5p for p. -5 Let j = -5 + 13. Suppose w + 7 = j. Solve -w = -4b - 21 for b. -5 Suppose 3u - 2l = 3l - 14, 2u - 3l + 8 = 0. Solve 2b = 4 - u for b. 1 Suppose -5j = -4j + 1. Let i = j - -3. Let o be (-12)/(-6)(-21)/(-3). Solve 4u + i = -o for u. -4 Let m be ((-8)/10 - 152/(-190))/2. Let t = 0 + 1. Let k = t + -1. Solve k = 4d - md for d. 0 Let d be 2/(6/3)2. Suppose c = dx + 8, 2x + 6 = -0x. Solve ch = 3 - 9 for h. -3 Suppose 4b + 5 = -5x, 3b = 2x + 3x - 30. Let k be -1 + 0 + (x - -1). Solve -16 = kt + t for t. -4 Let i(x) = x2 + 10x - 6. Let v be i(-11). Suppose 0 = vs - 6 - 54. Solve 0 = -5t + t + s for t. 3 Let h(z) = -z*2 + 4z + 1. Let b be h(7). Let c be 5((-64)/b + -2). Let d be c3/124. Solve -g = g + d for g. -3 Let n = 26 + -26. Suppose n = -q - 12q. Solve q = 4x - 0 + 20 for x. -5 Let d be (-48)/(-2 - (-4)/3). Let a = d - 67. Solve -2k = -3k - a for k. -5 Let a(o) = -2o - 2. Let z(d) = -25d - 25. Let w(n) = 40a(n) - 3z(n). Let q be w(-2). Solve 23 = -qv + 8 for v. -3 Let r be 2/1 + -23 + 36. Solve 7y - r = 2y for y. 3 Let s = 706 - 694. Solve 4 = -sq - 20 for q. -2 Let y(p) = p3 - 10p*2 + 2p - 17. Let l be y(10). Suppose 3j = 3	{ "pile_set_name": "DM Mathematics" }
= 3l - 4m - m, -3m - 6 = 0. Suppose -2s - 2u - 292 = 2u, 0 = 4s + 2u + 590. Let d be 103/s - (-27)/36. Is l smaller than d? False Let m(f) be the third derivative of -f*6/120 + 2f*5/5 + 9f*3 - 19f*2. Let x be m(24). Which is smaller: 55 or x? x Let i be (-3(-6)/(-18))/17. Let h = 25 + -17. Let k = 1 - h. Is k <= i? True Let j = 652.4 - 651. Which is greater: j or 13/3? 13/3 Suppose -5t = 46 - 61. Suppose 0 = -z - tz. Is -1/23 greater than or equal to z? False Suppose -4q + 5s = -17, 0 = 2q + 2s + 2s - 2. Suppose 3b + 5n + 15 = 0, qb = -n - 2n - 9. Let x be 8/(-6)3/22. Which is bigger: x or b? b Let h be 6((-2)/(-6) + 0). Suppose a = 3i + 18, 2i + a + h = -5. Suppose 48l - 3k - 39 = 53l, -2l + 2k = 6. Which is smaller: i or l? l Let b be -502(0 - (3 - 5))/4. Is b less than or equal to -252? False Let m = -30.2 + 26.2. Which is greater: -113 or m? m Let l = 59.7 + -70.7. Let c = 7 + -7.2. Which is smaller: c or l? l Let q = -1/227 + -223/908. Let i = -0.02 - 0.28. Which is smaller: q or i? i Let i = -215 - -171. Which is bigger: i or -43? -43 Let t = -103/40 - -16/5. Let h = -4 + 5. Which is greater: h or t? h Suppose -5t - 4u + 10 = -15, -2t - 5u = -27. Let o be (2/(-2) + 5)t. Suppose 6 = 2w - ow. Is -4 bigger than w? False Let r = -0.146 + -71.854. Let b = -71 - r. Which is smaller: b or 0.4? 0.4 Let z = 53.8 - 8.8. Let y = z - 44.3. Which is greater: -3 or y? y Let f be -7((-296)/28 + 2). Let w = f - 88. Let z be (-6)/w(-49)/(-14). Which is greater: z or -0.01? z Let z be ((-3648)/19)/(-4 + -1 - 0). Is 37 at most z? True Let p = -9314/57 - -52/19. Are -161 and p unequal? True Suppose 18 = -7v + 16v. Is 25/36 at least v? False Let y = 46.7 + -15.7. Is y at most as big as 2/7? False Suppose 2z + 3z = 10. Let j = 1769/980 + -1/196. Which is greater: z or j? z Let u(g) = -1. Let v(w) = -w2 - 10w - 9. Let o(r) = 6u(r) + v(r). Let l be o(-8). Is l != 6/7? True Suppose 2a + 3v = 4a - 299, -2a - 2v + 274 = 0. Let p be a/35 + (-44)/11. Which is greater: p or 0? p Let p = 165 - 36. Let z be 1/23/((-18)/p). Is z at least as big as -10? False Suppose 3x + 33 = 2a, 4a - 5x = -5 + 68. Let s = a - 12. Suppose 2d - 3d + 1 = s. Which is smaller: d or 2/91? 2/91 Suppose 0a - a + 5 = 0, -z + 18 = 4a. Let l(y) = y + 3. Let w be l(z). Is w >= -2/215? True Let g = 27 + -27.2. Let c = -3.2 - g. Let r = -15/2 - -71/10. Are r and c unequal? True Let y = 72 + -66.9. Let l = y - 5. Is -4 > l? False Suppose 3n + 20 = -2n + 5w, -n + 3w - 12 = 0. Let i = -9/1568 + 370075/4704. Let p = 79 - i. Is p less than n? False Let b = 14041/247638 + -5/1662. Do 0 and b have the same value? False Suppose -2k + 17 = 3. Suppose -70 = -2t - 3t. Let g = -6 + t. Which is smaller: g or k? k Let r = 2 + 1. Suppose 12 = -rk - 5z, 2k = 5k + z. Which is greater: k or -4/11? k Suppose 0 = 2i - 14 - 16. Let p = -15 + i. Suppose -4a = -5a + 2d + 15, p = -4a + d + 25. Which is bigger: 6 or a? 6 Let k be (-2 - 1)/((-3)/3). Suppose 8a = 11a + 12. Let t be 2/(-41/a). Is t <= k? True Let s be 48 - 2/10-5. Which is smaller: 53 or s? s Let u be 1/(5/(20/2)-2). Is u bigger than -2/671? False Let i = -47 + 80. Let x = i - 28. Does 4 = x? False Let z = -3067 + 52195/17. Which is smaller: z or 4? z Let z(p) = p*2 + 4p + 5. Let q be z(-3). Let a(l) = 6l2 + 6l*2 - 17 - 3l + 11l2 - 22l*q. Let o be a(0). Which is bigger: o or -18? o Let a be (-20)/(-70) + 139/(-364). Let i = -137/884 - a. Which is bigger: 1 or i? 1 Let x(s) = -12s + 49. Let r be x(5). Which is greater: -9 or r? -9 Let l be 2376/(-104) - (2/13 - 0). Let w = -23 - l. Which is bigger: -12 or w? w Suppose 152 = -5k + 4t, 11k - 8k - 3t + 93 = 0. Let a be -2 - 86/k. Let l = -105/4 + 287/12. Is l less than or equal to a? True Let k(b) = 0b + 4 - b - 27 - b. Let c be (-1)/(-5) - 244/20. Let m be k(c). Which is bigger: 16/9 or m? 16/9 Let f be (-26)/14 + (-1 - -3). Let r be (-3 + 3(-16)/(-12))-1. Are f and r non-equal? True Let u = 58/9 - 433/63. Let m be 8/6 + (-11)/(-3). Let g(b) = -b + 6. Let r be g(m). Which is greater: u or r? r Suppose 3x - 5n = 21, 0 = -x - n + 2n + 5. Let t be ((-24)/16)/((-13)/x). Which is smaller: t or 0? 0 Suppose -50k + 51k - 2a = -15, 0 = -4k - a - 87. Let r be 4 + 0 + (1 - 1). Let l be -1 - k - 1r. Is l != 17? True Suppose -98f + 3 = -101f, -3f + 8 = -q. Is -19 >= q? False Let v = 2.01 - 0.11. Let d = 1.8 - v. Is d greater than -6/31? True Let x be 630/(-189) + -2 + 10/3. Suppose 4h = 3h - 3. Is x at least as big as h? True Let u be (-108)/(-7335)15/4. Which is smaller: u or -0.1? -0.1 Suppose 3c = 304 + 38. Suppose -c = 4z - 5r, 2z - 4r + 2 = -58. Which is bigger: z or -27? z Let q = 1266/7 + -16514/91. Which is greater: q or -1/2? -1/2 Let c be 2 + -1 + -4 + 3. Let l = -3733 - -33592/9. Is c at most as big as l? False Let g = -5455 + 60061/11. Suppose -4x - 12 = -6x. Which is smaller: x or g? g Let n be 0/(0 - (-2 - -1)). Let f be (-1806)/7160 + (-3)/(-12). Let t = f + 1848/25955. Which is greater: t or n? t Suppose 3i + 20 = -2x, -6i - 5x = -i + 35. Let z be 18/i4/39. Let t be (0 - -2)(-2)/(-4). Is t smaller than z? False Let b = -39 - -83. Suppose -a + 40 - b = 0. Suppose -4c - 3 = -2c - l, 0 = -4c - 5l + 29. Which is smaller: c or a? a Let o be (0 + -2)(10/(-4) - -2). Is o > 12/17? True Let t = 1397/15801 + -1/687. Let x be 4/(-2) - 65/(-46). Let c = t + x. Which is smaller: c or 0.3? c Let g(s) = s2 - 13s + 15. Let t be 4/(-12) - (-37)/3. Let l be g(t). Which is greater: 5 or l? 5 Let n be (-3 + (7 - 3))(-1 - 0). Is n greater than -198? True Let p = -161 - -160.8. Let x = 0.08 - 0.98. Let y = -1 - x. Is y != p? True Let z(l) = 22l - 1. Let m be z(1). Let n be 3/7 - (-33)/m. Let v be -1 + -1 - (2 - n). Which is greater: -7/5 or v? -7/5 Let y be ((-12)/9)/((-8)/12). Let f be ((-12)/9)/y(-9)/(-12). Which is greater: f or 0.05? 0.05 Let u = -619 + 620. Is -22 less than u? True Suppose -2p - 64 = 14p. Let s be 2 - -1(-1 + 5). Suppose 4l + 16 = -2c, -sl = -4c - l + 7. Is p greater than c? False Let o = -13 + -25. Let f = o + 20. Is f <= 2/3? True Suppose 8m + 36 = 17m. Suppose -1 = 5t + l, m = 2t - 2l - 2l. Let q be 1/28 + (-2)/8. Is q equal to t? False Let q(m) = m*3 - 18m*2 + 15m + 32. Let j be q(17). Suppose -3d - 5u + 30 = 0, u + 40 = 4d - u. Is d less than or equal to j? False Let y be (-78)/104 - 614/(-8). Are y and 76 non-equal? False Let l(v) = -v2 - 7v + 12. Let n be l(-6). Let f = n + -107/6. Which is smaller: f or -1? -1 Suppose 7 + 0 = 3t + 13. Suppose 0 = -5b + 10. Let z be 0 + b/((-2)/(-1)). Is t > z? False Suppose -30q + 3634 + 8966 = 0. Is q at least as big as 420? True Let b = -681 - -668. Which is greater: -15 or b? b Suppose -t + 2t + 6 = 0. Let j be -6(-7)/(84/8). Suppose -196 = ja - 176. Is t greater than a? False Let a be (-2)/4 - (-2457)/5886. Is a bigger than -1? True Let x = -184 - -1308/7. Is 0 at most x? True Suppose -101 + 31 = -14u. Let k(v) = -3v + 30. Let s be k(u). Is -0.2 at least s? False Let l = -2/63 + 136/315. Which is greater: -3/32 or l? l Let f = 104 - 107. Suppose -2a + 0a = 2. Let t = a + -1. Which is smaller: t or f? f Let f be -4 + (-404)/(-58) + -3. Suppose 5u = -4q - 7, -3u - 10 = -u - 2q. Let t be u/31/(-1). Is t < f? False Let u = -5264 - -1873989/356. Is u > 0? True Suppose 9h - 19 = 8h - 3k, 0 = -5k + 15. Is h at most 6? False Suppose -133 - 287 = -7z. Which is greater: 63 or z? 63 Let a(q) = -4q - 44. Let o be a(-11). Are o and -14/151 non-equal? True Let n(h) = h3 - 5h*2 - 3h + 1. Let o be (-5)/((-100)/(-12))-10. Let c be n(o). Let j = 18 - c. Which is smaller: 4 or j? j Suppose -1 = -79n + 80n - 5j, -n - 5j - 1 = 0. Is n greater than or equal to -4/481? False Let x = -6.24 + 7.24. Is x at most -62? False Suppose 0 = m + 3p + 5, -2m + 3m + 5 = -5p. Let x(i) = i2 - 4i - 1. Let u = 15 + -13. Let j be x(u). Is j smaller than m? False Let t(i) = -i*3 - 12i*2 - 15i - 35. Let k be t(-11). Let b = -10 + k. Is -2/161 less than b? False Let i(d) = -d - 6. Let r be i(-16). Let p(k) = -2k2 - k3 + r + 11k - 2k2 - 5k**2. Let b be p(-10). Are 1/25 and b noneq	{ "pile_set_name": "DM Mathematics" }
order. p, -4, -1 Suppose 20 = -4u - 0u. Let a be 61/(-50)u. Sort a, 0.1, -2 in decreasing order. a, 0.1, -2 Let g = -0.09 - -9.09. Let q = -8.6 + g. Let m be ((-2)/3)/(4/6). Put q, 5, m in decreasing order. 5, q, m Suppose 4x + 1 = 17. Let o = -13 - -9. Put o, 2, x in ascending order. o, 2, x Let v = 0.1 + -0.1. Let b = 83 - 743/9. Put 3, v, b in decreasing order. 3, b, v Let a(f) = -7f*2 + f. Let y be a(1). Let v be (-15)/y(-4)/2. Let h be 55/(-66)(-1 + -5). Put v, h, 3 in decreasing order. h, 3, v Let r(t) = -2t - 36. Let d be r(-21). Sort 2, d, -2 in descending order. d, 2, -2 Let b = -0.6 - -0.3. Let n = 75 + -74. Put b, n, 4 in descending order. 4, n, b Let m(b) = -b*2 + 5b. Let l = -14 + 19. Let h be m(l). Sort 4, -4, h in ascending order. -4, h, 4 Let m = 2 + 2. Let p be (4 - 0) + (-18)/m. Sort p, 4, 3 in ascending order. p, 3, 4 Suppose -z + 5z - 57 = 3p, 5z - 31 = 2p. Let c = p - -19. Sort c, -5, -3 in descending order. -3, c, -5 Let u = 3 + -3.2. Let j = -4.9 + -0.1. Let z = -0.18 - 0.12. Put j, u, z in descending order. u, z, j Let p = 2 + 2. Suppose 0 = -5n + g + 16, -5 = -n + 2g - 0. Suppose -5 = -5k - 4l, 7k - 4 = nk - 3l. Put k, p, 2 in decreasing order. p, 2, k Let b(n) = -n + 4. Let q be b(5). Let a be 2 + 2 - (0 - q). Let g = -44 - -45. Put a, -4, g in ascending order. -4, g, a Suppose -2a + 0o = 4o + 20, 3a - 2o + 6 = 0. Suppose 0 = -3g + 6 - 3. Put g, a, -2 in descending order. g, -2, a Let g(k) = -k - 8. Let o be g(-5). Let r = 11 - 16. Sort o, 0, r in descending order. 0, o, r Suppose a = -4o + 6, -3o + 16 - 4 = 0. Let t = 31/3 + a. Put 0, -1, t in decreasing order. t, 0, -1 Let p(a) = -2a*3 - 3a*2 + 3a + 2. Let i be p(-2). Suppose -5x = 3r - 15 - 20, 4x = -3r + 31. Sort i, x, -2 in decreasing order. x, i, -2 Let o = 7 - 8.1. Let p = -0.1 + 1.1. Let r = p + o. Put r, 0.2, 1 in ascending order. r, 0.2, 1 Let n = 0.19 + 0.01. Sort -11, 3, n, 1/4 in descending order. 3, 1/4, n, -11 Let f(x) = 2x2 + 13x - 9. Let b be f(-7). Sort 1, 3, b, -1. b, -1, 1, 3 Let i = -1 - -4. Sort i, 2, 0.2. 0.2, 2, i Let h(g) = -g - 9. Let c be h(-9). Let i = 4 + -4.2. Let f = i - 0. Put -5, f, c in decreasing order. c, f, -5 Let p be (-1 - -5)1 + -1. Sort 0, p, -1, -4 in increasing order. -4, -1, 0, p Let l be 6/9(-9)/120. Let f = 2 + -8. Let b be 26/(-6) + (-2)/f. Sort 4, b, l in ascending order. b, l, 4 Let f = -1.6 - -2. Put 2, f, 1 in increasing order. f, 1, 2 Let l be 1102/(-4). Suppose 0 = -4m + 9 + 3. Put m, 5, l in decreasing order. 5, m, l Suppose -y + 60 = 2y. Suppose -6o + y = -o. Suppose 6 - 31 = -5z. Put o, z, -5 in increasing order. -5, o, z Suppose -3 + 28 = -5o. Suppose -3z - 200 + 188 = 0. Put o, 3, z in descending order. 3, z, o Let n = 9 - 16. Let q = -9 - n. Let t(b) = b + 8. Let w be t(-9). Sort q, -2/7, w in descending order. -2/7, w, q Let h = -9 + 11. Let m = -1.4 + 1. Sort h, m, -1/2. -1/2, m, h Let c = -12 - -8. Let g = 8 - 4. Put 0, g, c in decreasing order. g, 0, c Let b = 2 + -2.4. Let f = -8 + 8. Let t = f - b. Put t, -3, 1/2 in decreasing order. 1/2, t, -3 Let w(n) = -2n*2 - n + 4. Let f(u) = 3u*2 - 3. Let d(k) = 3f(k) + 4w(k). Let q be d(3). Put 2, q, 0 in descending order. q, 2, 0 Suppose a = 6a - 50. Suppose 3j + a = -2j. Suppose 5 = i + 4p - 11, 0 = -5i - 3p + 12. Sort i, 2, j in descending order. 2, i, j Let y = 100 - 97. Sort -4, -2/3, 2/11, y in decreasing order. y, 2/11, -2/3, -4 Let s = 2/111 + -119/444. Put s, -4/7, -1 in increasing order. -1, -4/7, s Let q(x) = -3x + 6. Let i be q(4). Let m be (6/(-9))/(i/(-9)). Let g be m/5 + 48/(-10). Sort g, -4, 4. g, -4, 4 Suppose 0 = 4a - 3k + 18, 3a - 3 = k - 14. Sort 1, 2, a, -4 in descending order. 2, 1, a, -4 Let x(a) = a2 + a + 2. Let z be x(-2). Suppose 20 = -zq + 2q. Let l = 6 + q. Sort l, 5, 3. l, 3, 5 Suppose y = 1, 0 = -i + y + 3y - 2. Sort i, -2, 9 in descending order. 9, i, -2 Suppose 0 = 3y + 3, -2s = 3y - y + 6. Let n be (-39)/9 - (-8)/24. Put s, n, -3 in descending order. s, -3, n Suppose -4r = -0r. Let q(i) = 6i - 1. Let v be q(1). Suppose vw + 2n + 17 = 0, w + 2 = 4n - 19. Sort r, 1, w in increasing order. w, r, 1 Let n(f) = 5f - 1. Let b(i) = 14i - 2. Let j(x) = -4b(x) + 11n(x). Let l be j(-3). Let d be 2/(-5)-1 - 1. Sort l, 1, d in descending order. 1, l, d Let q = 4 - 8. Sort q, 0, 2 in ascending order. q, 0, 2 Suppose -55 = 5w + 45. Let n = -24 - w. Sort n, -2, 1 in descending order. 1, -2, n Suppose 1 - 5 = 4a. Put a, 1, 4 in increasing order. a, 1, 4 Suppose 5n = -39 + 4. Suppose 21 = -5v - 34. Let s = n - v. Sort 1, -5, s in decreasing order. s, 1, -5 Let m(j) = -j*2 - 5j + 7. Let o be m(-6). Let b be 3 + (o - -1) + -2. Sort b, -4, -5 in decreasing order. b, -4, -5 Let q = 820 + -819.5. Let d = 281/5 - 3643/65. Sort q, -0.5, d in ascending order. -0.5, d, q Let d = -1/170 - 333/1190. Sort 3/4, -3/8, -0.2, d in increasing order. -3/8, d, -0.2, 3/4 Suppose 0 = -3p - 0r + r + 6, -2r = -p - 3. Sort 1, 36, p. 1, p, 36 Suppose 0 = 2m + 5n, 2 + 13 = m - 5n. Suppose -5p + 0a = -3a + 52, -4 = -2p - ma. Let l = -6 - p. Sort 1, -5, l in increasing order. -5, 1, l Let r = 7 - 11. Sort -3, 3, r in decreasing order. 3, -3, r Let s(x) = -9x*3 + 4x + 7. Let f(m) = 14m3 - 6m - 11. Let n(j) = 5f(j) + 8s(j). Let k be n(-1). Sort k, 0, -3 in ascending order. -3, 0, k Suppose -c = -1 + 6. Let b = 101 - 101. Put b, -0.2, c in increasing order. c, -0.2, b Let b be (-14)/6 + 2/(-3). Let z = -2 - b. Let n = 71 + -68. Sort z, 4, n. z, n, 4 Let a = -0.2 - -0.3. Put -0.2, -4, a in descending order. a, -0.2, -4 Suppose -2t + 2 = n, -4t + 3 = -2n + 7. Let v(b) = b - 7. Let c be v(15). Sort n, 0, c in ascending order. 0, n, c Let g = 43 + -38. Let x = 3 + -6. Sort x, -2, g in increasing order. x, -2, g Suppose -s - 34 = 2s - 5q, -4s - 2q - 2 = 0. Let k(d) = -d2 - d + 3. Suppose z - 5 = 2y, -2y + 3 = z - 2. Let n be k(y). Sort s, n, -5. -5, s, n Suppose 0 = x - s + 3, 3x + 5 = 7s - 2s. Put 1, x, -2, 5 in descending order. 5, 1, -2, x Let c be -3 - 2(-1)/(-2). Put c, 5, -3 in descending order. 5, -3, c Suppose 3k - 7k = 20. Let x = -0.3 + 0.8. Put x, k, 2/5 in decreasing order. x, 2/5, k Let b = 2.14 + -5.07. Let p = 0.12 + -0.05. Let l = p - b. Sort l, 0.2, -2/11 in descending order. l, 0.2, -2/11 Suppose 0k - k - 2 = 0. Let j be -52/4k. Sort -5, j, 0.2. -5, 0.2, j Let i = -253/12 - -21. Sort -0.5, 0.5, i, 0.1 in descending order. 0.5, 0.1, i, -0.5 Let l(h) = h*2 - 6h - 4. Let o be l(7). Sort -1, -2, o in decreasing order. o, -1, -2 Let k = 28.15 + -30. Let r = 0.15 + k. Let b = r - -2. Sort 2/13, b, -0.2 in decreasing order. b, 2/13, -0.2 Suppose -5i - 5r = 40, -i - r + 8 = -4r. Suppose -2q - 20 = 3q. Let m be 1(q/5)/(-4). Sort -3, i, m in descending order. m, -3, i Let z(v) = -v*3 + 3v*2 - 2v - 1. Let a be z(2). Let m(p) = p*2 + p - 29. Let g be m(-6). Sort 0, a, g in decreasing order. g, 0, a Suppose u = -2u + 9. Sort -1, -4, u. -4, -1, u Let f = 17 + -18. Sort -4/3, -0.2, f in descending order. -0.2, f, -4/3 Let q = 0.12 - -0.58. Let z = q - 2.7. Let o = 120/781 - -2/71. Sort z, 1, o in ascending order. z, o, 1 Let o = 23 - 27. Sort o, 0.1, -2. o, -2, 0.1 Let v = 0.2 + -0.2. Let y = v - 0. Let g = y - 0.5. Sort g, -0.3, 0.2. g, -0.3, 0.2 Let f = 20.5 + -1.5. Let d = f - 9. Let q = 5 - d. Sort 3, 1/6, q in descending order. 3, 1/6, q Suppose -1 = -s - 4s - 4m, 5s - m = 6. Put 2, s, -1 in decreasing order. 2, s, -1 Let h be ((-2)/2)/((-1)/(-1)). Suppose 0 = -2p + 2b + 4, 3b + 5 = 5p - 3. Sort h, p, 0 in increasing order. h, 0, p Suppose v + 2v - 3q = 6, -q = 4v - 33. Suppose 0 = -5u + 23 + v. Sort 1, 2, u in descending order. u, 2, 1 Let u = -85 - -89. Let a(z) be the second derivative of z5/20 - 7z*4/12 + 4z*3/3 - 7z*2/2 - z. Let l be a(6). Sort -3, l, u in ascending order. -3, u, l Let a(h) = 8h + 1. Let c(d) = d. Let v(o) = a(o) - 2c(o). Let r be v(-1). Sort 1, r, -2 in descending order. 1, -2, r Let o(w) = -w2 + 8w - 8. Let t(i) = i*2 - 9i + 8. Let s(y) = -2o(y) - 3t(y). Let g be s(10). Suppose -4*f - 6 + g = 0. Sort 2, -5, f in descending order. 2, f, -5 Let d = 0.78 - -0.02. Let f = 0.5	{ "pile_set_name": "DM Mathematics" }
7) Simplify 6-1(sqrt(76)/sqrt(4) + sqrt(19)) + sqrt(76)/(sqrt(64) - sqrt(4)) + sqrt(190)/(sqrt(30)/sqrt(3)). -32sqrt(19)/3 Simplify (0 + (-61sqrt(242) - 6sqrt(242)1))2. 34848 Simplify (sqrt(96) + sqrt(96) + sqrt(96) + -1(sqrt(96)-2 - sqrt(96)))/(6(sqrt(2) + sqrt(18))). sqrt(3) Simplify -6(4-2sqrt(1617))/(-5sqrt(30)/(sqrt(30)/sqrt(3))). -336sqrt(11)/5 Simplify -5(-1 + (sqrt(3)21 - sqrt(3))) + (-3sqrt(54)/sqrt(2))2 + -4. -5sqrt(3) + 244 Simplify -5 + (4-1sqrt(288) - (sqrt(8)/sqrt(2)5)/sqrt(2)). -53sqrt(2) - 5 Simplify (sqrt(448)/sqrt(32) - (2sqrt(280))/sqrt(5))/(-2sqrt(24)/sqrt(3) + 1sqrt(968)). -sqrt(7)/6 Simplify ((-3 + (2(sqrt(1584) + 1 - sqrt(1584)) - (sqrt(1584) + (sqrt(1584) + sqrt(1584) + 0 - sqrt(1584)) + 3)))6)2. 6912sqrt(11) + 228672 Simplify (3 + -3sqrt(17)2)*2 - (2 + sqrt(136)/(-2sqrt(8))). -71sqrt(17)/2 + 619 Simplify ((0 + sqrt(3))-4)*2 + (sqrt(243)-2)*2 + 5 + sqrt(108) + sqrt(108)-2 + 1. -6sqrt(3) + 1026 Simplify (sqrt(17) + ((sqrt(17) + -1)4 - sqrt(17)) - (sqrt(17) - sqrt(833)2))2 + (3sqrt(136)3 + sqrt(136) - sqrt(136))/sqrt(8). -127sqrt(17) + 4929 Simplify (5-5((-2 + sqrt(125))4)2 + 1)6. -309594 + 48000sqrt(5) Simplify (-2 + sqrt(12)/sqrt(4) - (-1sqrt(27) - sqrt(27))/sqrt(9))-5. -15sqrt(3) + 10 Simplify (1 + sqrt(425) + 2)*2 - (-1sqrt(1700) - 5((-2 + sqrt(17))2 - sqrt(17))). 15sqrt(17) + 539 Simplify (3(sqrt(143) + (sqrt(143) - sqrt(143)2) + sqrt(143) - sqrt(143))6)/(2(sqrt(11) + sqrt(44)/sqrt(4)) + -1sqrt(11)-4). 0 Simplify sqrt(39)/(sqrt(3) - (sqrt(3) - sqrt(6)/sqrt(2))-2) + ((1 + sqrt(13))2 - sqrt(13))2 + 5. 3sqrt(13) + 33 Simplify ((-1sqrt(605))/sqrt(11) - 1sqrt(55)-2)/(4sqrt(66)/sqrt(6)6). sqrt(5)/24 Simplify ((sqrt(45)2-4 - ((-2sqrt(1620) + sqrt(1620) - sqrt(1620)) + sqrt(45)))/((sqrt(9) - sqrt(729)-2)5))2. 9/1805 Simplify ((sqrt(3) - 1sqrt(75)) + -4)*2 + (sqrt(12)/sqrt(4) + 4 - sqrt(3) - (sqrt(81)/sqrt(3))/sqrt(9)). 31sqrt(3) + 68 Simplify (2sqrt(1088))2 + -1 + -2 + 1. 4350 Simplify -64((sqrt(121)12)/(sqrt(55)/sqrt(20)))2. -4224 Simplify -26((-3 + sqrt(108) + 1)2 + 4)-4. -1152sqrt(3) + 5568 Simplify 3 + (1 + 0 + (sqrt(38)/sqrt(2) - sqrt(19)) - (2 + (0 + sqrt(171))2)). -169 Simplify -2 + ((sqrt(98)2)/sqrt(7))/((sqrt(14) + sqrt(224))/sqrt(2) - sqrt(7)) + -5. -7 + sqrt(2)/2 Simplify (0 + 33sqrt(1377) + (sqrt(1377) + 5(-2 + sqrt(1377)) - sqrt(1377)) + sqrt(1377) + -3 + 0 + sqrt(1377))2. -3744sqrt(17) + 352681 Simplify (-2 + -2 + -2 + (sqrt(2448)-1 - sqrt(2448)) + sqrt(2448))2. 144sqrt(17) + 2484 Simplify -2 + (-3 + -4sqrt(931))2 + -1 + -5. 168sqrt(19) + 14897 Simplify -5((sqrt(3) - (sqrt(3) - -2sqrt(3)))*2 + 4) + 2 + sqrt(3) + sqrt(18)/(sqrt(24)/sqrt(4)). -78 + 2sqrt(3) Simplify 3(-4(sqrt(117) + 2)*2 + (sqrt(117) - ((sqrt(117)-1 + 3)*2 - sqrt(117))))5. -9150 - 360sqrt(13) Simplify ((sqrt(80)/sqrt(2))/sqrt(5))/sqrt(4) - (sqrt(2) - (sqrt(8) + -3))6. -18 + 7sqrt(2) Simplify sqrt(63)/(sqrt(36)2) + 3 - -1(sqrt(1792) - (sqrt(1792) + sqrt(1792) + 1)). -63sqrt(7)/4 + 2 Simplify 4(-4sqrt(78)6 + sqrt(78))/(sqrt(72)/sqrt(12)-6 + sqrt(6)). 92sqrt(13)/5 Simplify -2 + ((1(sqrt(70) + sqrt(70)2))/(-2sqrt(1000) - sqrt(10)))*2. -13/7 Simplify ((sqrt(98) - (sqrt(98) + sqrt(98) + -1 + 0))14)2. -224sqrt(2) + 1584 Simplify -4 + ((-2 + sqrt(1216) + sqrt(1216) + 0 - sqrt(1216)) + 1 + sqrt(1216) + 4 + 0 + sqrt(1216) + 1 + 1 + (sqrt(1216)2 - sqrt(1216)))2. 320sqrt(19) + 19477 Simplify ((-5sqrt(500)1)/(sqrt(70)/(sqrt(7)-2)) + 0)2. 5000 Simplify (-2 + ((4(sqrt(1584)-2 - sqrt(1584)))2 - (-6(sqrt(11) + 0 - sqrt(11)) - (sqrt(22)/sqrt(2) + -2))))-1. -228092 - sqrt(11) Simplify -3(2(-2 + sqrt(1573) + -1 + sqrt(1573))3)*2 + -5. -680513 + 14256sqrt(13) Simplify (1sqrt(128)-2 - -1(sqrt(128) + -2))2. 32sqrt(2) + 132 Simplify (1((0 + sqrt(13) - sqrt(13)) + 5 - (4 + sqrt(13) + 4))-5)*2. 150sqrt(13) + 550 Simplify (-5 + -5 + 5 + sqrt(500) + (3sqrt(500) - sqrt(500)))2. -300sqrt(5) + 4525 Simplify (-5 + (sqrt(76) - sqrt(76)-2))-4 - (sqrt(19) - ((sqrt(19) + 3)*2 + -5) - (sqrt(475)2)*2). -19sqrt(19) + 1943 Simplify (sqrt(65) + (sqrt(65) + (sqrt(65) - ((sqrt(65) - 2sqrt(65)) + sqrt(65))) - sqrt(65))1)/(1sqrt(125)) - (3 + 2 + sqrt(1573)2). -108sqrt(13)/5 - 5 Simplify 4(0 + sqrt(1008) + 4 - sqrt(1008))2 - (sqrt(21)/(sqrt(9)/sqrt(3)) + sqrt(7) + sqrt(42)/(sqrt(30)/sqrt(5)))2. 1 Simplify (sqrt(275) + sqrt(275)1 + -1 + 5 - -3sqrt(275)31)*2. 440sqrt(11) + 33291 Simplify -4(0 + 5(1sqrt(833))2). -16660 Simplify 3(2(-1sqrt(500)5 - (2(1 + sqrt(500) + sqrt(500)) + sqrt(500))))*23. 14400sqrt(5) + 1800144 Simplify (sqrt(114) - 3sqrt(114)-4)/((sqrt(294) - sqrt(6))-4). -13sqrt(19)/24 Simplify -4 + -6-3-6sqrt(200). -1080sqrt(2) - 4 Simplify 5 + ((sqrt(210)-1)/sqrt(6))/(-32sqrt(5)). sqrt(7)/6 + 5 Simplify 4((4sqrt(55)-1)/(sqrt(66)/(-2sqrt(6))) + 3). 12 + 32sqrt(5) Simplify -4(0 + sqrt(2299) + 1)-4. 16 + 176sqrt(19) Simplify ((sqrt(96)/sqrt(3))*2-3 - -2((1 + sqrt(32))2 - sqrt(32)))-3. -24sqrt(2) + 90 Simplify ((-1 + sqrt(5) + 4)6 + 1 + 5)*2. 288sqrt(5) + 756 Simplify 0 + (sqrt(7623)-2)/(-62sqrt(9)) + -5. -5 + 11sqrt(7)/6 Simplify -2(6sqrt(18)4)/((sqrt(81) - sqrt(81)3 - sqrt(81))/sqrt(9)). 16sqrt(2) Simplify -1((5sqrt(77) - sqrt(77))-6)/(sqrt(11) - (sqrt(66)-1 + sqrt(66) - sqrt(66))/sqrt(6)). 12sqrt(7) Simplify ((-6sqrt(20)-2)/sqrt(4))*2 + -3 + -1 + sqrt(245). 7sqrt(5) + 716 Simplify ((1sqrt(204)-1)/(-3sqrt(1200)) + -2)2. -2sqrt(17)/15 + 3617/900 Simplify 3 + (1 + (sqrt(125) - 2sqrt(125)) + (sqrt(40) + sqrt(40)1)/sqrt(2))*2. -2sqrt(5) + 9 Simplify (2(sqrt(175) + 2 + (-1 + sqrt(175) - sqrt(175)) + sqrt(175) + sqrt(175)))2 - (-3 + -1 + sqrt(175) + -3). 115sqrt(7) + 6311 Simplify -1 + (sqrt(112)/sqrt(4)-5)/((sqrt(40)-1)/sqrt(10)). -1 + 5sqrt(7) Simplify 2((sqrt(55)/(sqrt(10)/(sqrt(8)/sqrt(4))))*2 + ((1 + sqrt(891))5)*2). 900sqrt(11) + 44622 Simplify (0 + sqrt(13)-3 + 4 - (3 + (sqrt(117) + sqrt(117)-1)/sqrt(9))*2)1. -3sqrt(13) - 5 Simplify ((-4(sqrt(637) + -1) + sqrt(637) - sqrt(637)) + (sqrt(13) + (-2 + sqrt(13))-5)-6)*2. 448sqrt(13) + 3344 Simplify ((sqrt(68) - 4sqrt(68))4)/(sqrt(20)/sqrt(180)). -72sqrt(17) Simplify (1 + sqrt(171) + -2)3 + ((-3 + sqrt(171)-1)5)*2. 459sqrt(19) + 4497 Simplify ((-1sqrt(600) + sqrt(600))/(sqrt(3) - -2sqrt(363)) + 2)-3. -6 Simplify ((2sqrt(12)-1)/(sqrt(6)2-6)1 + 5)*2. 5sqrt(2)/3 + 451/18 Simplify ((sqrt(38)/sqrt(32) + -1 + (1sqrt(133))/sqrt(7) + -3)-64)2. -5760sqrt(19) + 26316 Simplify (sqrt(75) - 1(sqrt(75)-1)*2) + (-1sqrt(75) + sqrt(75))6 + ((0 + sqrt(75))-1 + 3)*2. -25sqrt(3) + 9 Simplify (3 + 2sqrt(175) - (-2 + sqrt(175)2) - 2(0 + sqrt(175) + 1 - sqrt(175)))2. 9 Simplify sqrt(6)/sqrt(3)-6 + -3 + ((-1sqrt(72) - sqrt(2)) + 0)2. -6sqrt(2) + 95 Simplify ((sqrt(24) + sqrt(72)/sqrt(3))/sqrt(12) - sqrt(2)) + (sqrt(16)/sqrt(2))/sqrt(4) - (sqrt(112)/(sqrt(16)/sqrt(2)) - sqrt(14))/sqrt(7). 2sqrt(2) Simplify 5(-1 + (sqrt(117)26 + sqrt(117))/(-2sqrt(9)3))*2. 65sqrt(13)/3 + 11165/36 Simplify (sqrt(91)/(6(-1sqrt(7) - sqrt(7)))-2-5)*2. 325/36 Simplify (-4 + -4 + 2(sqrt(176) - (sqrt(176) + 1))*2 + sqrt(176))-5. -20sqrt(11) + 30 Simplify 4 + ((sqrt(1100) + -2 + -2 + sqrt(1100) - sqrt(1100))2 + sqrt(1100) + sqrt(1100) + -1((1sqrt(1100))2 - sqrt(1100)))1 + 1. -50sqrt(11) + 21 Simplify (3(sqrt(56)/sqrt(2) + sqrt(28)) - (1sqrt(252) + sqrt(252))/sqrt(9))/(5(sqrt(576) - 2sqrt(576) - sqrt(4))). -4sqrt(7)/65 Simplify -2 + (3(4 + (sqrt(125) - (sqrt(125) + -1))) + -3)2. 142 Simplify (sqrt(408)/(sqrt(288) - sqrt(8) - sqrt(8)))/(sqrt(3) - (sqrt(75) - (4sqrt(75) + sqrt(75)) - sqrt(75)))2. sqrt(17)/52 Simplify (4(sqrt(200) - (sqrt(200) - (1 + sqrt(200) + (sqrt(200) - (sqrt(200) + sqrt(200) + 2)))))2)2. 64 Simplify 4 + -3((3 + sqrt(637) + sqrt(637) + 3 - sqrt(637)) + -2). -21sqrt(13) - 8 Simplify (0 + (sqrt(153) - (sqrt(153) + -1 + sqrt(153) + 2) - (-1 + (sqrt(153) - (sqrt(153) + 1)) - sqrt(153))) + 0)2. 1 Simplify (-1 + sqrt(112) + -4 + (sqrt(112) + 0)2)*2. -120sqrt(7) + 1033 Simplify sqrt(24)/(s	{ "pile_set_name": "DM Mathematics" }
rt n, o, 10. o, n, 10 Let q = 0 + -25. Let w be (-21)/5 - 5/q. Let b be 2/6171/57. Put w, -5, 4, b in descending order. 4, b, w, -5 Let j be 5 - (-1 - -9)102/(-24) - -6. Put -1, j, 0, 5, -2 in increasing order. -2, -1, 0, 5, j Suppose 6l + 74459 = 74429. Sort -1/4, l, -1/2, -0.6, 3 in decreasing order. 3, -1/4, -1/2, -0.6, l Let p be (6/(-14))/((-2)/7). Let u = -0.9035 - -0.0315. Let g = 0.472 + u. Sort 2, p, g, -5. -5, g, p, 2 Let o(q) = 2q*3 - 11q*2 + 9q - 17. Suppose -21 = -9h + 24. Let b be o(h). Let j(r) = r + 13. Let m be j(-13). Sort -3, b, m, -8 in decreasing order. b, m, -3, -8 Let i = -1.5 - -7.8. Let x = 6.71 - i. Let o = -0.46 + x. Put 2/5, o, -0.3 in descending order. 2/5, o, -0.3 Suppose -3k = 12k. Sort -4, 3, -2, k in decreasing order. 3, k, -2, -4 Suppose -2722 + 905 + 907 = -91u - 910. Let d = 20 + -36. Suppose k = -4j + 12, 4j + 9 = 5k - 3. Sort u, k, d. d, u, k Suppose 2r = 5h - 67, -4h + 5r - 35 = -5h. Suppose -5 + h = 2f. Sort 4, -94, f in descending order. f, 4, -94 Suppose 17g - 36 = -2. Suppose 10 = gn - 5y, 0y + 2y + 3 = n. Suppose 3p = 2v - 4, 4p = -0p + 4v. Sort p, 13, n in descending order. 13, p, n Let i be ((-12)/(-18))/((-4)/(-6)). Let z = 588 + -582. Sort i, z, 0, 5 in decreasing order. z, 5, i, 0 Let r be 6 - 56/(35/5). Put 37/5, r, -1/3 in decreasing order. 37/5, -1/3, r Let g be (-56)/35(-175)/(-45). Let q = 6 + g. Let h = -5 + 9. Sort h, q, 0.3, 3 in descending order. h, 3, 0.3, q Suppose 235t - 231t = -r - 18, -5t - 10 = -5r. Put -1, t, 39 in decreasing order. 39, -1, t Suppose 2v = 3g + 9, 3g + 9 = -501v + 498v. Let k(x) = -x2 - 14x. Let y be k(-12). Put y, g, 0 in decreasing order. y, 0, g Let v(b) = -3b2 - 56b - 261. Let r be v(-10). Sort r, -3, 0, -5, 23 in decreasing order. 23, 0, r, -3, -5 Suppose -4p = -11 + 7, w - 5p = 25. Suppose 6m = 12m + w. Put 4, m, -3/8, -1.7 in descending order. 4, -3/8, -1.7, m Let g = -23 + 71/3. Let d = 213652/3 + -71218. Let t = -95/3 - -32. Sort g, d, 5/6, t in decreasing order. 5/6, g, t, d Suppose -3q + 6 = q + 3i, 2i - 4 = 0. Let k = 14527 + -14524. Sort -1, k, q, -6 in decreasing order. k, q, -1, -6 Let w be (-7 + 4)/(6/(-1500)-5). Let p = w + 149. Sort -3, p, -9, 3. -9, -3, p, 3 Let a = 12665 - 12662. Sort a, -1, 0, 116 in decreasing order. 116, a, 0, -1 Let y be (9/30)/(51/510). Sort 5, -83, y, 1, -5 in descending order. 5, y, 1, -5, -83 Let y(q) = -32q - 2. Let b be y(-1). Suppose bk = 29k. Put k, -11, 2 in decreasing order. 2, k, -11 Let s = -63 + 58.6. Let l = s - -4.4. Let k = -993/7 + 142. Sort k, l, -3 in descending order. k, l, -3 Let n be 9(-3)/(-27)5 - (0 + 27). Put 17, -1, n in decreasing order. 17, -1, n Let m = -0.01 + -0.39. Let f = 1735 - 1734.9. Put f, m, -0.1, 0.2 in decreasing order. 0.2, f, -0.1, m Let x = 0 - 0.5. Let s = 1.8857 - 1.9657. Sort 22, x, s in increasing order. x, s, 22 Let h be ((-1869)/189 + 10)-36. Let m(z) = 2z + 1. Let o be m(-6). Let k = -8 - o. Put h, 9, k in decreasing order. 9, k, h Let a(b) = b2 - 24b - 76. Let o be a(27). Put 0, -5, 80, 3, o in decreasing order. 80, o, 3, 0, -5 Suppose 2g + 16 = -4h, h + 3g - 8 = -17. Put 50, h, -16 in ascending order. -16, h, 50 Let g(k) = k2 - 2k - 5. Let t be g(4). Suppose -o + 2z = 5z + 11, 0 = 2o - tz + 4. Let d be 1 + o9/(-15). Put d, -3, 6 in ascending order. -3, d, 6 Suppose 4d + 13 = 59f - 62f, 2f - 31 = 3d. Let a be ((-3)/d)/(16/112). Sort -5, a, 5, -18 in descending order. 5, a, -5, -18 Let o be (-1 + (-8)/4)2/(-3). Let l = o + 43. Suppose 5n = -3k - 2k - l, -3k + 1 = -4n. Sort n, 4, 1. n, 1, 4 Let f(t) = -4t3 - t2 - t - 1. Let q be f(-2). Let d = 631 + -597. Let j = q - d. Put 1/6, j, 5 in decreasing order. 5, 1/6, j Let v = 2.38 - -1.62. Let y = 160.6 + -160.2. Sort 2/65, v, 0.3, y in decreasing order. v, y, 0.3, 2/65 Let k(s) = s3 - 4s*2 - 4s - 3. Let t be k(5). Let h be (1/(-4))/(87/435). Sort t, -1/8, h in increasing order. h, -1/8, t Let j be -2(338/104 - 15/6). Sort j, 23, -10, -4, 3/7 in decreasing order. 23, 3/7, j, -4, -10 Suppose 4u + 2f = 3u, 4f = 12. Let w(i) = i2 + 5i + 3. Let j be w(u). Put 5, j, 2, -3 in increasing order. -3, 2, 5, j Let t = -1254 + 1254.3. Sort t, -1/11, -2/9, -1/35. -2/9, -1/11, -1/35, t Let o = -0.28 - 0.02. Let u = -59 - -55. Let c = u + 4.4. Sort 2/11, c, o in ascending order. o, 2/11, c Let a = 12 - 11.6. Suppose -20 = -3u - 5z, 0u + 9 = u + 4z. Suppose 0 + 2 = 4d - 5t, 0 = 5d + ut - 25. Put a, d, 5/7 in ascending order. a, 5/7, d Let h = 4402.7 - 4402. Sort 4, 0.1, h, -2/7 in descending order. 4, h, 0.1, -2/7 Suppose 0 = -20g - 63g - 80 + 163. Sort g, -2, 5, -4, 2 in decreasing order. 5, 2, g, -2, -4 Let s = -32508.1 + 32508. Put s, 1, -2, 9, -7/5 in descending order. 9, 1, s, -7/5, -2 Let g be 2/(8/(-4)) + 6. Suppose -5t + i + 16 = 0, 6i - 10i + 11 = gt. Put t, 2, 5, 0 in decreasing order. 5, t, 2, 0 Let z be (-18)/(-2) - 45/(1215/234). Sort z, 0.11, 6. 0.11, z, 6 Let n be 12 + 1/(-34)412. Put -2/3, n, -163, -3 in decreasing order. n, -2/3, -3, -163 Suppose -80 = -15b + 130. Suppose 2z - 5h = -3h + b, 39 = 5z - h. Suppose 2t + 2 = 0, 4u = 5t - 4t + 13. Sort u, -5, z in descending order. z, u, -5 Suppose 0 = 5b, -3x + 17b = 2x + 8b + 20. Sort x, 10, -7, -5, -1. -7, -5, x, -1, 10 Let f be (-6)/(-4)(1/3 + 1). Suppose -7d + 29 = -6. Suppose 50 = dn + 5n. Sort n, 8, f, 1 in descending order. 8, n, f, 1 Let m be (-351)/(-91)1/6. Let h = m - 25/28. Let a = 0.01 + -0.31. Sort 5, h, a in descending order. 5, h, a Let o = -247667/95 + 2607. Let w = o - -216/1235. Let u = -17.4 + 15.4. Sort 0.2, u, 0.5, w in descending order. 0.5, 0.2, w, u Let u be (0/(-14))/(-1 + -1 + -7). Put -4, u, -5, 1538, -3 in descending order. 1538, u, -3, -4, -5 Suppose 45 = p + x - 14, -2x + 240 = 4p. Let k(j) = j*3 - 117j - 19. Let w be k(-11). Let d = w + p. Sort d, 2, -1, 5. d, -1, 2, 5 Suppose 18 = -q - 3. Let y be 0(q/9)/(-7). Let r = 2089/3465 - 2/693. Sort -0.09, y, r in decreasing order. r, y, -0.09 Let l be (576/5)/(-16)10. Put -3, l, -5, 5 in increasing order. l, -5, -3, 5 Suppose -b + 2a + 3245 = 3257, 0 = 4b + 4a - 12. Sort b, 8, 12, 2. b, 2, 8, 12 Let c be -4 - (-2 + 45/8)-1. Let w be ((-6)/(-4))/(18 - 15). Sort -1, -18, w, c in ascending order. -18, -1, c, w Suppose 10c = -19 - 16 + 5. Let w = 15 + -11. Put 6, 0, c, w in ascending order. c, 0, w, 6 Let r be (-60)/(-900) - 120/(-225). Let k = -0.57 + -0.03. Let q = -2.4 + k. Put r, q, 0.2 in ascending order. q, 0.2, r Let f be -168/(-12). Suppose 5o - 40 = 5n + 4o, fn = 5o - 53. Sort n, -2, 5 in ascending order. n, -2, 5 Let n = -29 + 26. Let l = 0.39 - 42.39. Let x = l - -45. Put 2, n, x, -17 in decreasing order. x, 2, n, -17 Let t be 13/(156/(-27)) - (-18)/(-24). Sort t, -30, -5, -4 in increasing order. -30, -5, -4, t Let q = -516/37 + 8373/481. Let x = 199/65 - q. Suppose 0 = -i + 5. Put -0.3, x, i, 2 in decreasing order. i, 2, -0.3, x Let l(c) = 5c. Let i be l(-1). Let f = -6153 + 6153. Let s be ((-16)/7 + 2)/2. Sort -2/13, f, i, s in descending order. f, s, -2/13, i Let j = 18 - 14. Suppose 5t + 5b + 4 = -1, jt - b = -9. Let f be 2/(-2 + t - -1). Sort 1/4, f, -4, -3 in descending order. 1/4, f, -3, -4 Suppose -6w + 328w - 1620 = -2w. Sort w, -65, 3, -3 in increasing order. -65, -3, 3, w Suppose -6g = -7 + 1. Suppose -2o + x = -5, 0o - 2 = -2o - 2x. Suppose -25 = 5s, 8 = -4k + s + 25. Put k, g, o in increasing order. g, o, k Let o = 739 + -775. Let h be 8/5 + (-1 - (-28)/20). Sort 0, o, h in descending order. h, 0, o Let w = 41 + -36. Suppose 20 = 9x - wx. Suppose 2g = g + x. Sort -3, 2, 4, g. -3, 2, 4, g Suppose 2d = -5u + 23, 0 = -4d + 5u - 43 + 14. Let y be d-42/(-8). Sort -4, 3, 5, y in increasing order. -4, y, 3, 5 Suppose 0 = 2k + f + 4, 4k + 5f = -12 - 8. Suppose -5a = -66 - 54. Let r = -27 + a. Put 1, r, k in increasing order. r, k, 1 Suppose -2m - 2t = 124, -5m + 5t - 180 - 80 = 0. Let d be 66/(-17 - -6) + (-53 - 0). Let v = d - m. Put v, 14, -4, 1 in increasing order. -4, v, 1, 14 Let l = -54.681 + 55.681. Suppose -k + 3k = 0. Put k, 6, 2, l in ascending order. k, l, 2, 6 Let b(r) = -2*r. Let c be b(-1).	{ "pile_set_name": "DM Mathematics" }
der. -4, j, f Let i(y) = 2y + 13. Let g(p) = -2p - 19. Let o be g(-7). Let n be i(o). Let r be (14/(-6) + 1)-3. Put r, 1, n in decreasing order. r, n, 1 Let p(i) = -2i*2 - 60i + 62. Let m be p(-31). Sort -2, -5, 22, m in increasing order. -5, -2, m, 22 Let o = -5.7 + -75.3. Let m = 83 + o. Let p be 1(28/2)/(-2). Sort p, 0.3, m in descending order. m, 0.3, p Suppose 0 = -44d + 48d - 4. Let q = 56 - 730/13. Sort -7, d, q in increasing order. -7, q, d Let f be ((-2)/(-5))/((-18)/(-135)). Sort f, -2, 2, -3 in ascending order. -3, -2, 2, f Let k = -2036 + 2033. Let z be 9/2 + 1/2. Suppose 7w + z = 2w. Put k, 12, w in descending order. 12, w, k Let l = -53 + 54.5. Let c = l + -0.5. Let p(y) = 2y - 7. Let n be p(9). Sort n, c, 0.4 in decreasing order. n, c, 0.4 Suppose 0 = -2m + 55 - 9. Let n = m - 25. Sort n, -4, 4, 2. -4, n, 2, 4 Let q be ((-2)/10)/((-48)/(-60)). Put 1/5, 8, q in decreasing order. 8, 1/5, q Let r = 770 - 774. Sort 6, 1, r, 2 in increasing order. r, 1, 2, 6 Suppose -2230 = 15f - 2335. Sort -6, f, -1/2, 0.2 in increasing order. -6, -1/2, 0.2, f Suppose 36 = 2d + 42. Let t be (-2)/(-5)(4 + 6). Sort 1/4, t, d in decreasing order. t, 1/4, d Let i = 473 + -478. Sort i, 104, 4 in decreasing order. 104, 4, i Let u be (-10)/(-4 - 9/(-6)). Suppose 0 = -r + 5n + 2, ur + 4n + 9 = -7. Put 2, r, 3, 15 in increasing order. r, 2, 3, 15 Suppose -5n + 2f - 11 = -34, -5f - 17 = n. Let l(t) = t*2 - 23t - 77. Let w be l(26). Sort n, -1, w. -1, w, n Let s be (-1(-1)/(-4))/(285/(-684)). Sort 0.378, s, 2, -0.2 in descending order. 2, s, 0.378, -0.2 Suppose -4m = 3c + 22, -6m - 10 = -8m. Suppose -j + 11 = 14. Sort c, -5, -1, j in decreasing order. -1, j, -5, c Let n be (-2)/(15/254/(-6)). Suppose 2o = 6o - no. Put 4, -1, o, -3 in descending order. 4, o, -1, -3 Suppose 38h = 36h - 2. Let i be 8/12 - 2/3. Put -5, i, 2, h in increasing order. -5, h, i, 2 Let v be ((-24)/10)/((-3)/10). Let d = 6 - v. Let j be (330/(-126))/((-2)/(-14)). Sort -1, d, j in descending order. -1, d, j Let c = 5 + -6. Let o = -195 + 198. Sort -4, c, -3, o. -4, -3, c, o Suppose -5z + 390 = 370. Sort z, -3, 2/83. -3, 2/83, z Let o = 1 + -14. Let j(d) = d3 + 7d*2 + 11d + 8. Let z be j(-4). Let p = o + z. Put 5, p, -4 in increasing order. -4, p, 5 Suppose -3j - 9 = 5l + 21, l + 28 = -5j. Sort 7, -12, l, -2 in decreasing order. 7, -2, l, -12 Let s be -2((-40)/(-12) - 3). Put -359, -5, -0.5, s in descending order. -0.5, s, -5, -359 Let g = -765 + 766. Sort -3/5, g, 3 in decreasing order. 3, g, -3/5 Let w = 0.4 + 0.6. Let l = -5334 - -5333. Put -0.2, l, 0.5, w in ascending order. l, -0.2, 0.5, w Suppose -19q = -26q - 7. Sort q, -1/41, 0, 4 in increasing order. q, -1/41, 0, 4 Let o be (-1)/(13/(-41)) - 3. Let u = 557 + -560. Sort 1, u, o, 2 in descending order. 2, 1, o, u Suppose 7 = -3a - 2q - 0, 2q + 8 = -2a. Let o(i) = -7i3 - 1. Let r be o(-1). Let f = r + -10. Put 2, a, f in ascending order. f, a, 2 Let w(n) = -20n + 942. Let s be w(50). Sort -0.5, s, -1/7 in decreasing order. -1/7, -0.5, s Suppose -4g = 5v - 567, 4v + 169 = 3g - 295. Sort g, 5, 1. 1, 5, g Let n = -23.954 - 0.046. Let i = n + 27. Sort -0.5, 2/3, i in decreasing order. i, 2/3, -0.5 Let g be 5 - (1 + 0 + 3). Let v be g - 64/(-8). Suppose vo - 2w + 3w = 0, -2o - 2w - 6 = 0. Put 4, o, -2 in ascending order. -2, o, 4 Let h be 123/21 + (-426)/497. Put 0, 3, h, 691 in ascending order. 0, 3, h, 691 Let n be 1/4 + (-87)/12. Let m be 30/795 - (-2484)/(-1219). Sort -3, m, n. n, -3, m Suppose -2n + 0n + 4 = 0. Let v be 49/147(-1 + 10). Suppose vq - n = -14. Sort 9, 2/7, q in decreasing order. 9, 2/7, q Let g = -282 + 281. Let a(u) = u*2 + 7u - 3. Let n be a(-6). Sort n, -3, g in decreasing order. g, -3, n Suppose 2w - 3w + 3 = 0. Let h = -26 + 24.7. Let t = -1.4 - h. Sort 0.3, t, w in decreasing order. w, 0.3, t Let m = -44 - -43.942. Let y = m - 0.042. Let g be -3((-2)/4 - -1). Put g, -5, y in descending order. y, g, -5 Let x(s) = -2s + 7. Let o be x(11). Put o, -4, 3, -3 in descending order. 3, -3, -4, o Let r = 87 + -85. Let d be 0/1 - r - 3. Put d, 4, 0, -1 in ascending order. d, -1, 0, 4 Let r = -166.2 + 160.2. Put -1/19, -1, 0.1, r in descending order. 0.1, -1/19, -1, r Suppose 3n + 5l - 9 = 10, 4n + 3 = -l. Let x(c) = -6c*3 - 2c*2 - 2c - 1. Let o be x(-1). Let h = n + o. Sort 1, -4, h in descending order. h, 1, -4 Suppose -2y - 67 + 90 = 5b, -4b - 8 = -5y. Put -7, y, 1, 2 in ascending order. -7, 1, 2, y Suppose 30 = -10d - 20. Let j(r) = -r2 - 5r + 7. Let x be j(-6). Let w be 1 - x - 2/(-2). Put -4, d, w in decreasing order. w, -4, d Let t = -109/230 - 3/115. Sort -66, t, 0 in descending order. 0, t, -66 Suppose -8l + 13 = -11l + u, -4l + u - 16 = 0. Put l, -2, 211 in decreasing order. 211, -2, l Let w = 2821 - 2823. Sort w, -38, 18 in descending order. 18, w, -38 Let l be (-1551)/1914 - (14/12 + -2). Put l, -3, 6 in increasing order. -3, l, 6 Let n = 427 - 429. Sort -4, 2, 225, n in increasing order. -4, n, 2, 225 Suppose 36p + 546 - 1986 = 0. Sort 0, p, -4, -5 in ascending order. -5, -4, 0, p Let h be (7 - 7) + 5/(-1). Suppose 5s - 27 = -c, 3s - c = s + 8. Suppose 3m = s + 7. Sort m, h, 1 in decreasing order. m, 1, h Let g = 39 - 35. Put g, -5, -2 in decreasing order. g, -2, -5 Suppose -3a = 4g - 5 - 4, -a = 1. Suppose -7s - 20 = -gs. Let t = -4 - -2. Put -4, t, s in descending order. t, -4, s Let c = -1181 + 1179. Sort -266, 5, c in decreasing order. 5, c, -266 Suppose 4b - 83 = -19. Let h = b - 16. Sort h, 4, 1. h, 1, 4 Let u = 50.985 + 0.015. Let y = u + -55.02. Let v = y - -0.02. Sort 1/2, v, -5 in descending order. 1/2, v, -5 Let s = -730 + 733. Sort 35, 5, s in descending order. 35, 5, s Let k = 2.17 - 2.07. Sort -2/9, k, -2/11, 0.05 in descending order. k, 0.05, -2/11, -2/9 Let a be (-118)/90 - (-4)/(-18). Let t = a - -1/30. Let g = 110 + -553/5. Sort 4/5, g, t in descending order. 4/5, g, t Let i = 198 + -198.3. Let d = 5.1 - 1.1. Let t = -3.7 + d. Sort i, 5, t in decreasing order. 5, t, i Let f = -7 - -7.6. Let l(a) = -19a2 - 38a + 2. Let v be l(-2). Sort v, 0, f in decreasing order. v, f, 0 Let k = 28 + -147. Let n = k + 119.3. Let y = 0.3 + 0.7. Sort y, n, -2/13 in decreasing order. y, n, -2/13 Let v = 0.4194 - -0.0806. Let q = 92 - 551/6. Put q, v, 5 in decreasing order. 5, v, q Let d be 2/16 + 15/8. Suppose dq - k - 4k = -21, 5q - 5k = -60. Let w = -10 - q. Sort -1, -5, w in increasing order. -5, -1, w Let y be (-18)/15 - (1 + -2). Let p = -5.5 - -8.64. Let l = p + -0.14. Sort 2/3, y, l. y, 2/3, l Let u be (172/(-645))/(4/(-6)). Put u, 6, 1/4, 8 in decreasing order. 8, 6, u, 1/4 Let h be -2 - (0 + 0) - -2. Suppose y - 8 = -4p - 1, -3p = -2y + 3. Let r(w) = w3 - 5w*2 + 6w - 6. Let i be r(4). Put i, p, h in descending order. i, p, h Suppose 534 = -2i + 532. Sort i, 2, 4, -7. -7, i, 2, 4 Suppose -g - 23 = -5g - 3i, g - 4i - 20 = 0. Suppose 0 = -4h - 0h - 4j - g, 4h + 26 = 2j. Sort 0.4, -0.3, 0.2, h in increasing order. h, -0.3, 0.2, 0.4 Let x be ((-1)/(-3))/(-13). Let n = -1389/2 - -4163/6. Sort 7, n, x in decreasing order. 7, x, n Let s(v) = 17v2 + 38v + 3. Let b be s(-2). Put b, 2/51, -4 in ascending order. b, -4, 2/51 Let y = 160 + 81. Let g = -1209/5 + y. Put 1/5, -6, g in decreasing order. 1/5, g, -6 Let f be (-67)/(-13) - (1 - -4). Sort -4/3, 0.1, f in ascending order. -4/3, 0.1, f Suppose -2h - 3q - 2 = -q, 1 = 3h + q. Put h, 0, 3, -14 in descending order. 3, h, 0, -14 Let o be (-3)/12-6 + 20/(-8). Put o, -7, 4, 0.3 in increasing order. -7, o, 0.3, 4 Let k be (-33)/138-8 + -35 + 33. Let m = 0.5 + 1.5. Let u = m + -2.2. Sort k, u, 0.3. u, k, 0.3 Let r = -0.295 - -0.195. Put r, -16, 0.4, -2/7 in descending order. 0.4, r, -2/7, -16 Let t = -1 + -25. Let q = -25 - t. Sort 3, 4, q. q, 3, 4 Let j = -127 + 128. Let p = -2 - -2. Let x be (p - 1)/(1/(-4)). Sort x, 0, j in descending order. x, j, 0 Let t(p) = 3p + 6. Let x be t(-2). Let n be (-2 - x) + -4 + 3. Let f be (n/62)/(-1). Sort -4, f, -6 in descending order. f, -4, -6 Let j(b) = 10b + 1. Let z(d) = -11d. Let r(h) = -7j(h) - 6z(h). Let g be r(-3). Sort g, 2/7, 1/5 in ascending order. 1/5, 2/7, g Let m(z) = 2z +	{ "pile_set_name": "DM Mathematics" }
vided by j. 32 Let m(w) = -8w + 2. Let j(t) = -59t - 4. Let h be j(-1). Calculate the remainder when m(-2) is divided by (42/4)/(-4 + h/10). 4 Let k(o) = o*2 - o - 17. Let v = -432 + 437. What is the remainder when 87 is divided by k(v)? 0 Suppose -1499 - 767 = -11i. Let u = i - 199. What is the remainder when 77 is divided by u? 0 Suppose -2v + 482 = r, 38v + 1958 = 4r + 36v. Calculate the remainder when r is divided by 45. 38 Calculate the remainder when 5827 is divided by (48/(-160))/((-7)/4690). 199 Suppose 2u = -5s + 6s + 213, 2s = u - 99. Let b = -100 + u. Calculate the remainder when 33 is divided by b. 6 Suppose -4b + 4z = -86632, 3b + 5z = 23504 + 41478. What is the remainder when b is divided by 60? 59 Suppose 0 = 2o - 51 - 23. Suppose 0 = 193g - 59 - 12679. What is the remainder when g is divided by o? 29 Suppose -24x = -31x + 2282. Let f = -225 + x. Let o = 40 + -23. What is the remainder when f is divided by o? 16 Suppose 3p = -50 + 323. What is the remainder when p is divided by (4/15)/2 - (-57036)/2205? 13 Let d(v) = v3 + 15v*2 + 5v + 77. Let y be d(-15). Suppose 6p - p + 79 = yo, 0 = p - 5. Let m = 93 + -66. What is the remainder when o is divided by m? 25 Let s(o) = -o*3 - 13o*2 - 78o - 238. Calculate the remainder when 412 is divided by s(-8). 16 Calculate the remainder when (62 - (-11 + 15)) + 16/(-2) is divided by 24. 2 Let j = 21 + -46. Let p = -22 - j. What is the remainder when (9/p - -6) + -3 is divided by 2? 0 Let g(d) = 1198d + 6880. Calculate the remainder when g(-5) is divided by 90. 80 Let i be ((-3)/1)/((12/(-200))/(-1)). Let b = 123 + i. What is the remainder when b is divided by 15? 13 Calculate the remainder when -3 + 78/18 - (-596)/3 is divided by 51. 47 Let z be (-21 + 15)(-1)/(-2). Calculate the remainder when (-1 - z)(-76)/(-8) is divided by 7. 5 Let a(d) = -d2 + 14d - 11. Let i(m) = -m + 41. Let f be i(35). What is the remainder when 102 is divided by a(f)? 28 Suppose z = -a + 1536, -a - 3z + 1112 = -414. Calculate the remainder when a is divided by 172. 165 Calculate the remainder when 260 is divided by (234/42)/(-99/(-567)). 26 Calculate the remainder when -3 - (-3)/2 - 1828/(-8) is divided by (-25)/3(-246)/410. 2 Suppose 313 = -3n + r, -r = -0n - 2n - 208. What is the remainder when (416/40)/((-6)/n) is divided by 31? 27 Let m(a) = -15a + 137. Let y be m(7). Suppose 5q - y = q. What is the remainder when 47 is divided by q? 7 Let r be 4 + 14/(-10) + (-2)/(-5). Calculate the remainder when 1/(r/141)(4 + -3) is divided by 13. 8 Let j be (5/10)/(1/406). Suppose -q - j - 20 = -3c, -2c = q - 147. What is the remainder when c is divided by 27? 20 Let i be (2 + 1)(-3 + 51). Suppose 8x + i = 20x. What is the remainder when x is divided by 7? 5 Let g(b) = 2b3 - 4b*2 + 2b - 3. Let c be g(3). Let y = c - 19. Suppose 0 = 2n + yn - 396. What is the remainder when n is divided by 17? 14 Let l be 2/14 + (-135)/(-35) + -10. Let r(b) = -2b2 - 8b + 10b2 - 9b*2 + 11. Calculate the remainder when r(l) is divided by 8. 7 Let y(g) = 14g*2 + 88g - 113. Calculate the remainder when y(13) is divided by 50. 47 What is the remainder when 498 is divided by 3 + 0 + (-79)/((80/(-10))/8)? 6 Suppose 2z - 4r + 168 = 3490, 3z - 5023 = -4r. Calculate the remainder when z is divided by 153. 139 Suppose 20p - 41p + 149p - 1214720 = 0. What is the remainder when p is divided by 12? 10 Let t(r) = 3r*2 - 11r - 23. What is the remainder when t(10) is divided by (-10)/(2/(2 + -3))? 2 Suppose 30a = 742 + 398. What is the remainder when 2233 is divided by a? 29 Let f be 11/3 + ((-5)/3 - -2). Suppose -fl + 4g = 5g - 161, -2l - 4g = -84. What is the remainder when l is divided by 10 - (-2 + -1 + 2)? 7 Suppose -116g + 198778 - 99378 + 322840 = 0. Calculate the remainder when g is divided by 35. 0 Let o be 437 - -1 - (2 - -1). Let y(v) = -v3 - 5v*2 - 316v - 1231. What is the remainder when (-4)/(-6) + o/9 is divided by y(-4)? 15 Suppose -q = 4x + 2q - 38, 0 = -7x + 4q + 122. Calculate the remainder when 1130 is divided by x. 10 Let i(a) = -10a - 136. Suppose s - 3p - p - 48 = 0, -2p = 2s - 126. Calculate the remainder when s is divided by i(-16). 12 Suppose -139i + 190 = -120i. What is the remainder when ((-67)/(-3))/(7/21) is divided by i? 7 Suppose 709 - 419 = 29v. What is the remainder when 119 is divided by v? 9 Let k be 333/117 + 2/13 + -3. Suppose k = 79y - 70y - 351. Calculate the remainder when y is divided by 14. 11 Let j(f) = 46f*2 + 10f - 44. Let s be j(11). Calculate the remainder when s/(-22)(-1)/2 is divided by 27 - 2(-2)/(-4). 24 Suppose 0 = -45l + 39l + 390. Let j = l + -56. Let x = 31 + -14. Calculate the remainder when x is divided by j. 8 Let i = -8131 - -8158. What is the remainder when 610 is divided by i? 16 Let r = 8 + 8. What is the remainder when 4 + 1 + 3 + (2 - -15 - -31) is divided by r? 8 Suppose 1267 - 8377 - 3858 = -6s. Calculate the remainder when s is divided by 31. 30 Let q(k) = -7k*2 + 42k - 12. What is the remainder when 6332 is divided by q(4)? 40 Let v = -2635 + 2701. What is the remainder when 1249 is divided by v? 61 Suppose 0 = 10r - 5r + 155. Let n = r + 34. Suppose 0 = -na - 4d + 29, a = 4d - 2d + 13. Calculate the remainder when 32 is divided by a. 10 Let y be 68 + (-3 - 12)/3. Suppose yq - 68q = -305. Let p = -12 - -21. What is the remainder when q is divided by p? 7 Let f be 2/(-6) - ((-84)/(-18))/(-14). Let c(z) = -z3 - z2 - 2z + 70. Calculate the remainder when c(f) is divided by 38. 32 Suppose -2g + 0g = 2g. Suppose gj + 249 = s - 3j, 2s = -3j + 498. Calculate the remainder when s is divided by 23. 19 Let m = -153 + 158. Suppose -mn + 3n + 102 = 0. Calculate the remainder when n is divided by 13. 12 Let z(v) = 2v2 - 1. Let k = -123 - -127. What is the remainder when 117 is divided by z(k)? 24 Let j be (-48)/18 + 12/(-9). What is the remainder when 19 is divided by (-16)/(j + 6 + -4)? 3 Suppose 0 = 2l - x + 225, -3l = l + 4x + 468. Let u = -83 - l. Calculate the remainder when 56 is divided by u. 25 Let q(w) = w + 2. Let b be (4 + (-2 - -2))1. What is the remainder when (-6)/9 - (260/3)/(-4) is divided by q(b)? 3 Let q(s) = -s3 - 5s*2 + 154s + 1205. Calculate the remainder when 2000 is divided by q(-9). 141 Suppose -2s - s = 0. Suppose -6r + 156 = -sr. What is the remainder when 9 + (6 - (6 - 91)) is divided by r? 22 Let i(t) = 13t + 1. Let f be i(3). Calculate the remainder when -5 + (11 - 0) + f + 1 is divided by 32. 15 Let c(t) = -7t - 3. Let g = -2389 + 4456. What is the remainder when (g/(-106))/(3/(-14)) is divided by c(-7)? 45 Let w = 959 - 923. What is the remainder when 118 is divided by w? 10 Calculate the remainder when 841 is divided by ((-109)/(-654))/((-1)/(-354)). 15 Suppose -104 = -5u + 2x + 54, 4x = 5u - 156. Let w(h) = -h3 - 2h - 1. Let a be w(2). Let c = a + u. Calculate the remainder when 56 is divided by c. 18 Let m(p) = 18p - 303. Let w(s) = 7s - 2. Let l be w(-7). Let o = l - -80. Calculate the remainder when m(20) is divided by o. 28 Let p(r) = 13r - 7. Let w(g) = 2g*2 - 7g. Let k be w(4). Suppose 0 = -5f - o + 2o + 23, f + 8 = -ko. What is the remainder when p(f) is divided by 20? 5 Suppose -f - 41 = -q, 4q - 145 = 5f + 18. Calculate the remainder when 201 is divided by q. 33 Suppose -2m + 39 = -m + 4o, 4m - 61 = 3o. Let d(t) = 2t + 16. Calculate the remainder when d(m) is divided by 14. 12 Suppose -2n - 64 = -4u, -10u + 4n - 27 = -191. Suppose -6i + 2z = -i - 256, -2z + 194 = 4i. Calculate the remainder when i is divided by u. 14 Let y = 9285 - 8952. What is the remainder when 341 is divided by y? 8 Let w(g) = -g*2 - 9g - 35. Let h be w(-10). Let d = -40 - h. Let o(p) = -p*3 + 4p*2 + 7p. Calculate the remainder when 109 is divided by o(d). 9 Let k be ((-12)/9)/(32/18). What is the remainder when (-64)/(-8) - -17 - k is divided by 272/28 + (-2)/(-7)? 9 Let v = 22 + -13. Calculate the remainder when 55 is divided by -3-314/v. 13 Let q(m) = -m2 - 2m + 8. Let i(n) = -n*3 - 4n*2 + 3n + 11. Let s be i(-2). What is the remainder when 24 is divided by q(s)? 4 Suppose 173 = 3*g - 4	{ "pile_set_name": "DM Mathematics" }
2 + l. Let g(z) = 3p(z) + u(z). Let r = -2559 + 2563. What is the units digit of g(r)? 3 Let m(k) = -1042k - 1. Let b be m(-1). Suppose -1110 = -3r + b. What is the tens digit of r? 1 Let s be (78/(-5))/(6/(-15)). Suppose 28675 = sk - 2k. What is the tens digit of k? 7 Let g(s) be the first derivative of -s2/2 - 15s + 29. Let k be g(-18). What is the units digit of ((-55)/(-15) - k)21? 4 Suppose 98760 = 117a - 105a. What is the units digit of a? 0 Suppose 17 = 60p - 43. Suppose 2a - 12 = m - 5m, 5m = -a + 21. What is the tens digit of p + 75 - (m - (-2 + 4))? 7 Suppose -2o + 42 = -3f - 156, f = -2. Let g = o + 86. What is the tens digit of g? 8 Let o(p) = 12p*2 - 18p + 97. Let m be o(7). Let b = -232 + m. What is the tens digit of b? 2 Let y = 2567 + 4442. What is the tens digit of y? 0 Let t(b) = 8b + 5. Let y be t(7). Let k = y + 123. What is the tens digit of k? 8 Suppose 5h + 153 - 1508 = 0. Let m = 3200 - 3198. Suppose h = ml + 3q, -4q - 134 = -l - 5q. What is the hundreds digit of l? 1 Let l(m) be the second derivative of 0 + 1/2m3 + 17m - 4m2. What is the units digit of l(6)? 0 Let y(f) = f2 + 9 + 1 - 2 + 5f. Let g be y(-4). Suppose -2p + 5u = -57, gu = 2p + p - 75. What is the units digit of p? 1 Let x be (8 + (-6 - 4))-12. Suppose -2520 = -xt + 364. What is the hundreds digit of t? 7 Let s = -164 - -168. Suppose -sd + 1323 = -d. What is the hundreds digit of d? 4 What is the units digit of (-1147)/(12(-21)/9072)? 2 Let z = 32 - -80. Let t = z - -354. What is the tens digit of t? 6 Let h(r) = -236r + 854. What is the hundreds digit of h(-17)? 8 Let o be (4 - 42/9)/((-4)/6). Let z = o - 1. Suppose z = -2l - l - 3d + 81, 0 = 5d - 15. What is the units digit of l? 4 Let y(g) = 89g2 - 87g + 422. What is the units digit of y(11)? 4 Suppose -m + 59315 = 7m + 21099. What is the tens digit of m? 7 Let y(h) = h3 + 6h*2 - 7h + 3. Let x be y(-7). Suppose 21p - 22 = 230. What is the units digit of -2214-1x/p? 7 Let j(v) = -2v2 - 59v - 19. Let u be j(-29). Suppose -um + 15m - 3976 = -3l, -5l = -5m - 6640. What is the thousands digit of l? 1 Let d(h) = h2 + 1020h - 510h + 10 - 2 - 507h. Let g be (-8)/12 + 74/(-6). What is the hundreds digit of d(g)? 1 Let w(b) = -b*3 + 10b*2 - 18b + 16. Let f be w(8). Suppose 5c + 3 = -2, -o + 5c + 473 = f. Suppose 21g + o = 25g. What is the tens digit of g? 1 Let z(n) = -2n3 + 145n*2 - 141n - 9. What is the units digit of z(71)? 3 Let n(l) = l*3 - 5l*2 + 3l + 9. Let v be n(4). Suppose 532 = 2j + 2t, -vj + 1309 = -5t + 3t. What is the tens digit of j? 6 Let f(a) = a2 + 5a - 14. Let o = -39 + 44. Let b be (4/o)/(4/(-60)). What is the units digit of f(b)? 0 What is the units digit of -13 - -1869 - 8 - 13? 5 Let u = 6193 + -2667. What is the hundreds digit of u? 5 Suppose 0 = q - 4q + 12. Let k(v) = v3 + 2v*2 + 2v. Let p(c) = 6c3 + 11c*2 + 10c - 1. Let d(l) = -11k(l) + 2p(l). What is the units digit of d(q)? 4 Let q = -3864 - -10452. What is the units digit of q? 8 Suppose 3b - c - 17 + 0 = 0, -3c + 5 = 5b. Suppose 8j + 2i = 4j + 1738, bj - 1729 = -5i. What is the hundreds digit of j? 4 Let g(h) = 7h - 35. Let l be g(11). Suppose -45z + 252 = -lz. Suppose -2u + z = u. What is the tens digit of u? 2 Suppose 2s - 240 = 346. Suppose 5y = v + 4y + 180, y - 1060 = 6v. Let p = s + v. What is the units digit of p? 7 Suppose 38j = -33j + 522986. What is the units digit of j? 6 Let w(r) = -2r + 47. Let p be w(22). Let g be p + -2 + 1 + -2. What is the tens digit of g + -1 + 110/2? 5 Let y(v) be the first derivative of -2 + 12 + 15v + 3 - 4v2 - 2. What is the units digit of y(-10)? 5 Let s(w) be the first derivative of -w2/2 + 6w + 3. Let p be s(6). Suppose -2q + 8 = -pq. What is the units digit of q? 4 What is the hundreds digit of 441096/87 + 160/(-2320)? 0 Let y(s) = 347 + 294 + 7s - 678. What is the units digit of y(8)? 9 Let s = -3047 + 10649. What is the hundreds digit of s? 6 Let d be ((-24)/60)/(-1(-2)/(-30)). What is the tens digit of (-36)/(-16)160/d? 6 Suppose 2x - x - 4g = 24715, 2x + 3g = 49397. What is the tens digit of x? 0 Suppose -4z + 6 = -2j, 5z + 30j - 33j - 7 = 0. What is the tens digit of 564 + 8 + (-2)/4z? 7 Suppose -8h + 11h + 26128 = 4w, -3w - 5h + 19567 = 0. What is the hundreds digit of w? 5 Let r be ((-20)/(-15))/(2/3). Suppose 0 = 3d + 2z - 26, 0z = -d - 2z + 6. Suppose -rg + 1656 = dg. What is the tens digit of g? 3 Let b(t) = -t*3 + 7t*2 + 8t - 12. Let s be b(8). What is the tens digit of (-27850)/(-30) + (-8)/s? 2 What is the units digit of 614/((-140)/(-46915))? 9 Let z be ((-66)/(-15) - 5)/(1/(-15)). Let f = 21 - z. What is the units digit of f/(-42)((-3)/3 - 6)? 2 Let a = 745 - 349. What is the units digit of a/(-45)(-98 + 3)? 6 Let b(q) = q3 - q2 + 3q - 3. Suppose 2i - 6i + 76 = 0. Suppose i - 3 = 4a. What is the units digit of b(a)? 7 Let o = -886 - -1391. Let k = o - 220. Suppose -c - k = -3j, j - 5 = -5c + 106. What is the tens digit of j? 9 Let s = 55 + -35. Let r = s - -20. Suppose -rb = -37b - 381. What is the tens digit of b? 2 What is the hundreds digit of ((-2358)/(-90))/((-2)/(-10))391? 1 Let y(w) = 7w*2. Let t be y(1). Suppose -2u - 5b + 56 = -2b, -u - 5b = -42. Let q = t + u. What is the tens digit of q? 2 Let a = 30 + -20. Let c(y) = y3 - 9y*2 + 10y - 23. Let s be c(a). Suppose 0 = -2j - 2f - f + s, 0 = -3j + 3f + 243. What is the units digit of j? 4 Suppose 8 + 2 = 2k. Suppose -5 = kp - 30. Suppose pm - 264 - 441 = 0. What is the units digit of m? 1 Let h = 4815 - 256. What is the hundreds digit of h? 5 Suppose 1061u - 875u = 1435734. What is the tens digit of u? 1 Suppose -2l + 2n = 2, 0 = -n - 1 + 4. Suppose 3t - 284 = -5x, 0 = lt + 2t + 2x - 388. What is the units digit of t? 8 Suppose -2k + 3k - 196 = s, -s - 3 = 0. Suppose k = 2a - 55. What is the hundreds digit of a? 1 Let x = 152 - 157. What is the tens digit of x + 325 + 6 + -5? 2 Let w(f) = f3 - 13f*2 - 15f - 103. What is the units digit of w(15)? 2 What is the units digit of 17/(815/77160)? 1 Let i be 217 + (-40)/(-20). Suppose i = 7g - 11g. Let l(s) = s*3 + 12s*2 + 12s - 7. What is the tens digit of l(g)? 2 Let c(a) = -6 - 3 + 101a - 24 - 122a - a*2. Let q be c(-19). Suppose -4w = -qo + 633, 0w = -2o + w + 252. What is the tens digit of o? 2 What is the ten thousands digit of (-16)/2010149300/(-280)? 2 Suppose -4z + 2329 = 3i - 0i, 5z - 758 = -i. Suppose 0 = -8t + i + 1257. What is the units digit of t? 5 Let y = 351 + -342. Suppose 4926 - 525 = yq. What is the units digit of q? 9 Suppose 4l - 331c = -326c + 54650, 40989 = 3l - 3c. What is the ten thousands digit of l? 1 Let d(t) = 742t*2 + 33t - 87. What is the tens digit of d(4)? 1 Suppose -96u + 84u - 60 = 0. Let s(b) = -183b - 99. What is the units digit of s(u)? 6 Let c be (-8 - -10)1/((-2)/(-527)). What is the tens digit of c + (39/(-3) - -8)? 2 Let w(x) = 81x2 - 4x + 16. Let k = -437 + 440. What is the units digit of w(k)? 3 What is the units digit of (86/4)/(399/959196)? 6 Let s be 5 - (2 - -2) - -1. Suppose -h - 8516 = -3v + 3h, -sv + 5700 = 3h. What is the tens digit of v/33 - (-12)/(-66)? 8 Let y(a) = -a*3 - 9a*2 + 12a + 142. What is the hundreds digit of y(-17)? 2 Suppose 42c = -184 - 236. What is the tens digit of 87 - (c + 5/((-5)/(-5)))? 9 Suppose -2q - 10 = 0, 2r - 38q = -39q + 32231. What is the thousands digit of r? 6 Suppose -4g - 360 + 80 = 0. Suppose 2z + 221 = -47. Let l = g - z. What is the units digit of l? 4 Let o(z) = 62z - 50. Let g(p) = -32p + 25. Let b(w) = -5g(w) - 2o(w). What is the hundreds digit of b(10)? 3 Suppose 0f = r - 3f + 12, -11 = -2r - f. Suppose m - 2060 = -rm. Suppose -5v + 1695 - m = 0. What is the units digit of v? 6 Let h = 2 + -17. Let m be (-16)/(-6)h/(-20). Suppose 2o + 4y - 292 = -2o, -mo + 4y + 140 = 0. What is the units digit of o? 2 Let o = -78 + 81. Suppose -oz = j - 163, -2j + 5z + 97 = -207. What is the tens digit of j? 5 Let b(u) = -u3 + 10u*2 - 8u - 5. Let p be b(9). What is the hundreds digit of 6/p + (20482/	{ "pile_set_name": "DM Mathematics" }
e c? True Let s(h) = -h*2 + 8h - 1. Does 15 divide s(4)? True Let k = 9 - -47. Is k a multiple of 19? False Suppose o + 36 = 5o. Let b = o - 4. Suppose bh = 73 + 2. Is 15 a factor of h? True Let b be 1 + 3 - 2/1. Suppose bh = 8 + 4. Does 6 divide 134/h - (-4)/6? False Let d = -9 - -34. Suppose d = 3j - 41. Suppose 3l + 7 - j = 0, -17 = -4b + 3l. Is 5 a factor of b? False Let j = -55 + 82. Let m = -13 + j. Is m a multiple of 6? False Let l = 1 - 1. Suppose -2c + lc = -80. Does 20 divide c? True Suppose -6i - 80 = -422. Does 19 divide i? True Suppose -2x + 21 = 5m, -28 = -0m - 4m + 4x. Let i(c) = c3 - 4c*2 + 4c - 7. Is i(m) a multiple of 19? True Suppose 0 = -5x - 0 - 5. Is 12 a factor of (-300)/(-18) + x/(-3)? False Suppose 4b - 7 - 13 = 0. Let u = b - -31. Suppose k + 2 = -5g, -2k - g = k - u. Does 6 divide k? False Let v be (-5 - -2)2/2. Is (-1 + v + 3)-9 a multiple of 9? True Suppose -2k - k = 0. Suppose 3 - 8 = 5u, -3q - 2u + 16 = k. Suppose -3d = -q - 9. Is 5 a factor of d? True Let o(b) = b3 + 4b*2 + b - 4. Let t be o(-3). Suppose tc = c + 14. Is 7 a factor of c? True Let b(w) = w*2 - w + 4. Let q be b(0). Suppose ql + t - 21 = 2t, -4l = -5t - 41. Suppose -31 = -2u + 2i + 5, 4u + li - 56 = 0. Is u a multiple of 8? True Suppose -2y = y - 3. Suppose o = y + 2. Is 12 a factor of -1 + o/(9/96)? False Let c(r) = 34r + 2. Let f(p) = p + 5. Let y be f(-4). Is 18 a factor of c(y)? True Let o be 6/(2/4 - -1). Let z(h) = h2 - 4h + 2. Let w be z(o). Suppose -wb = v - 51, b - 4 = 2v + 14. Is b a multiple of 12? True Suppose 2d + 3u + 4 + 26 = 0, -4u = -2d - 30. Let l = 31 + d. Is 4 a factor of (3 + -1)l/4? True Suppose 0 = -6l + 12l - 1080. Is 20 a factor of l? True Suppose z + 2k - 7 = 0, 0 = 4z - 0z - 2k - 68. Let p be 66/z + 2/(-5). Suppose 0x - 28 = -px. Is 7 a factor of x? True Let i(p) be the third derivative of -p4/24 - 2p*2. Let h be i(0). Suppose -5q + 45 = -hq. Is 8 a factor of q? False Let a(x) = -x + 9. Suppose -5w + 6 = -29. Let j be a(w). Suppose -2f = 2r - 6, 2r + f - 10 + j = 0. Is 3 a factor of r? False Let o be -6 - (-2)/((-6)/9). Let x = o - -13. Is x a multiple of 2? True Let t(x) = 14x*3. Does 14 divide t(1)? True Suppose -5w + 5r + 35 = 0, 5r - 41 + 13 = -4w. Suppose -3k + 12 = 2z - wk, 36 = 4z - 4k. Is z a multiple of 12? True Is ((-184)/10 - 2)/(24/(-160)) a multiple of 34? True Let a(s) = 3s. Let k(j) = 5j. Let t(c) = -8a(c) + 5k(c). Let q be t(-1). Is ((-56)/(-12))/(q/(-6)) a multiple of 11? False Let s = 129 + -65. Does 16 divide s? True Let r(p) = -4 - 1 - 1 - 8p + 1. Is 27 a factor of r(-5)? False Suppose 1 = 5c - 14. Suppose -cx - 60 = -8x. Is 7 a factor of 200/x + (-1)/(-3)? False Let r be (-2)/(-7) + (-8672)/(-28). Suppose 2f - i - 98 = 0, 5i - 70 = 5f - r. Does 25 divide f? True Suppose -5q - 2v - 1561 = -v, v = 3q + 943. Let b be (-2)/7 + q/7. Let d = b - -92. Is 16 a factor of d? False Let d(b) = -24b - 5. Is 24 a factor of d(-5)? False Let n(c) = 56c*2 - 2c. Is 29 a factor of n(-1)? True Let z(q) = -q*2 - 9q - 9. Let n be z(-7). Suppose 0 = -r - 4d - 9, -r + d + 7 = -3d. Let s = r + n. Does 4 divide s? True Let s = -15 - -71. Does 17 divide s? False Let v = -13 + 10. Let h be (v - 0)/((-9)/6). Suppose 0 = ht - 7t + 305. Does 25 divide t? False Is 14 a factor of -1 + 2 + (-276)/(-4)? True Let m(p) = 2p + 2 - 2p + p. Let u = -18 + 24. Is 8 a factor of m(u)? True Let y(s) = s*3 - 4s*2. Let p be y(4). Suppose 5v - 4g + 18 = -pv, 3g + 33 = -4v. Let d = v - -11. Is d a multiple of 2? False Let j = 110 - 45. Does 13 divide j? True Suppose -5o - 2c + 11 = -5c, -5o - 3c = 1. Let j(a) = 7 + o + a2 + 2a - 4 - 4a. Is j(6) a multiple of 23? False Let q = 178 - 82. Is q a multiple of 16? True Let t be 3/(2 - 291/150). Suppose 3v - t = -2v. Suppose -2u - j + 46 = v, j = u - 12. Does 8 divide u? True Suppose -3z + 44 + 52 = 0. Let i = -28 - -32. Suppose 107 - 17 = 3t + ia, -t - 2a = -z. Is 13 a factor of t? True Let k(q) = 8 + 2q2 + 4 + q2 - q2 + 16q. Is k(-11) a multiple of 22? False Let t(f) be the second derivative of -f5/20 - f4/6 + f*3/3 + 3f*2/2 + f. Let g be t(-4). Suppose -g = -2v + 13. Does 14 divide v? False Is (52 - 0/(-3)) + -4 a multiple of 11? False Suppose 5m - 12 = 18. Suppose 2n = -n - m. Does 14 divide (-1)/n147? False Let r(p) = -p + 4. Let g be r(3). Let q(w) = -1 + 0 + g + 3w. Is 7 a factor of q(7)? True Let g(x) be the second derivative of x4/12 + x3/6 - x2 - 5x. Is 28 a factor of g(-6)? True Let o(m) = 10m2. Does 10 divide o(1)? True Let t(c) = 12c + 1. Is t(1) a multiple of 3? False Let g be ((-95)/2)/(-5)-2. Let h be 4/14 + g/(-7). Suppose 0 = ho - 0o - 15. Is o even? False Let w(a) = -a2 + 0a - 4a - 3 + 2a. Let l be w(-2). Does 13 divide (22/l)/(4/(-12))? False Let j(y) = -y*2 + 7y + 2. Let h be j(7). Let g = -3 + h. Does 13 divide -1 - (g + -42) - 3? True Suppose -3m + 84 = -0r + 3r, r - 4m - 53 = 0. Is 15 a factor of r? False Suppose -d - 5b = -16, 0d + b - 2 = d. Let w be 1(-3 - (d - 1)). Does 18 divide (-1 - w)(-41)/(-2)? False Let t(i) = 39i2 - 1. Does 19 divide t(-1)? True Is (-8)/4 - (-11 + -1) a multiple of 9? False Suppose -4i = -1 + 29. Let p(h) = -h*2 - 10h - 10. Does 6 divide p(i)? False Suppose -4l + 9 + 3 = 0. Suppose 4r - 12 = -0r - z, 0 = -4z + 16. Suppose 0 = -rj + lj - 5. Does 4 divide j? False Suppose -24 = -5m - 4. Suppose -c - mc = -105. Suppose -2t - c = -95. Does 10 divide t? False Let y(m) = -m3 - 7m*2 + 5m - 1. Suppose 4w - 8 - 24 = 0. Suppose -2r - w = 8. Does 6 divide y(r)? False Suppose p = 3u + 6, -16 = -4p - 4u + 8u. Suppose -po + 0o = -63. Is 10 a factor of o? False Suppose 4 = -3l + 2v, -5l + 4v - 2 - 8 = 0. Let z(b) = 3b2 + 2b - 2. Let w be z(l). Suppose -2d + 20 = -w. Is 6 a factor of d? False Let n(j) = 2j - 1. Let f be (18/12)/((-2)/(-4)). Is n(f) even? False Let s = -2 + 21. Let q = -12 + s. Does 7 divide q? True Suppose 0l - l + 136 = 0. Is 13 a factor of (2/(-4))/((-2)/l)? False Let p(c) = 30c. Let r be p(6). Suppose -4m + 4q = -0q - r, -2q = 10. Suppose 4s - m = -s. Is s a multiple of 4? True Suppose 0 = 2w - 0w, -12 = -4a - 4w. Suppose -10 = -av + 8v. Does 5 divide ((-1)/(-2))/(v/(-20))? True Suppose 0z + 3z = 24. Let y = -4 + z. Suppose -2x - j + 84 = j, 4j + 144 = yx. Does 17 divide x? False Suppose -2h - 2d + 98 + 50 = 0, 5d = 20. Does 26 divide h? False Let k(m) be the second derivative of m5/4 - m4/6 + m3/3 - m2/2 - m. Let x be k(1). Suppose 2g + 26 = xg. Does 5 divide g? False Let w(r) = -3r. Let a be w(-2). Let v(z) = z*2 - 7z + 9. Does 2 divide v(a)? False Let k(j) = 4j2. Let v(l) = l + 7. Let x be v(-6). Is 4 a factor of k(x)? True Suppose o + 6 = -4n, -3o - 5n = -4n - 15. Let t(w) = -w3 + 4w*2 - 2w + 4. Let p be t(4). Is o/1 - (-4 - p) a multiple of 5? False Suppose 0 = 11w - 15w + 96. Is w a multiple of 4? True Let h(l) = -l2 - l + 80. Is 18 a factor of h(0)? False Let l(x) = x3 - 6x2 - x + 3. Let j be l(6). Let p be 0 + 0 + 3 - j. Let z = p - -10. Is z a multiple of 16? True Let w(b) = -b3 + b2 + b + 10. Let x be ((-1 - -1)/(-4))/1. Does 5 divide w(x)? True Is 5 a factor of 0 - (-32)/24(-15)/(-2)? True Let v(x) = x*3 - 3x*2 - 11x - 1. Let f(b) = b*3 - 2b*2 - 6b - 1. Let u(o) = 7f(o) - 4v(o). Does 6 divide u(2)? False Suppose -r + 4r - 6 = 0. Suppose -rk = -5g - k + 162, -k = 2. Is 16 a factor of g? True Suppose 5k + 0f - 2f - 15 = 0, -35 = -2k - 5f. Suppose 3v - 26 = -2m, 2m = kv - 48 - 22. Does 12 divide v? True Let o(d) = 2d + 1. Let x be o(-1). Let y be -2 + (0 - x)61. Let g = y + -27. Is g a multiple of 9? False Suppose 0 = 3t + t - 120. Is t a multiple of 10? True Let c(z) = z3 + 7z*2 - z. Is c(-5) a multiple of 23? False Suppose 2a - 3a = -3. Suppose 3v - 13 = -4l, 3v = 7l - al + 5. Is v a multiple of 2? False Suppose -k + 5k = 28. Is k a multiple of 7? True Suppose -6q + 4q = -16. Does 8 divide q? True Let a(y) = -7y - 17. Let b(g) = -3g - 9. Let s(q) = 2a(q) - 5*b(q). Does 6 divide s(-5)? True Let l = 7 - 4. Let x(r) =	{ "pile_set_name": "DM Mathematics" }
rt(132)2-6 - sqrt(132))-6)/(sqrt(72)/(1sqrt(6)) + sqrt(48)/(sqrt(12)/sqrt(3))))*2 + -3. 14253 Simplify (sqrt(1694)-1)/(sqrt(242) + (sqrt(242) - 1sqrt(242))) + 5. -sqrt(7) + 5 Simplify -2(sqrt(25)2)/sqrt(5) - (sqrt(320) + 5 + (0 + sqrt(320))2). -325 - 12sqrt(5) Simplify ((sqrt(132)-4)/sqrt(4))/(sqrt(3) - -3sqrt(192)). -4sqrt(11)/25 Simplify ((-4 + 3sqrt(176))*2 - 6(2 + sqrt(176))) + -5 + 0. -120sqrt(11) + 1583 Simplify -1 + (sqrt(243) + (sqrt(243) - -2-1sqrt(243)) - (sqrt(243) - (3 + sqrt(243)-2)) - (sqrt(243) + (sqrt(243) - (sqrt(243) + -1)))-14)*2. 126sqrt(3) + 291 Simplify 5 + -1 + 0 + 5(sqrt(1216)1 + -5)*2. -400sqrt(19) + 6209 Simplify ((-4 + -3 + sqrt(567) + -2sqrt(567) + sqrt(567) + sqrt(567))6)*2. -4536sqrt(7) + 22176 Simplify -4(-2(-1 + sqrt(3))-4 + 1 + (sqrt(3) - (-1 + sqrt(3))1))*2. -912 + 384sqrt(3) Simplify (1 + sqrt(153))*2 + 0 + -1(sqrt(204)-3)/sqrt(12). 9sqrt(17) + 154 Simplify -5 + 0 + -5(-2(0 + sqrt(200)) + sqrt(200) - sqrt(200))*2. -4005 Simplify (sqrt(114) + sqrt(114) + -5sqrt(114)4 - sqrt(114))/(sqrt(30)/(sqrt(25)/sqrt(5))) + 0. -19sqrt(19) Simplify (-1((1sqrt(220))/sqrt(4))/(-6(sqrt(11) - sqrt(176))))2 + 5 + 1. 1949/324 Simplify ((sqrt(2057) + 1 + -5 + sqrt(2057) - (-4 + (sqrt(2057) - (sqrt(2057) + sqrt(2057) + 1) - sqrt(2057)))) + -4(sqrt(2057) + sqrt(2057)1)-6 + 5)*2. 6864sqrt(17) + 5562164 Simplify 5(((5(sqrt(567) - -2sqrt(567)) + -3)-2)*2 + -4). -16200sqrt(7) + 2551660 Simplify 0 + (-2(2 + 2sqrt(112)))*2. 128sqrt(7) + 1808 Simplify 5(5 + sqrt(17)-3 + 4 + sqrt(425) + 1 + 0)*2. 200sqrt(17) + 840 Simplify (2(1sqrt(35) - sqrt(35) - sqrt(35))-6)/(sqrt(21)/sqrt(3)5 + (sqrt(175) - (sqrt(175) + sqrt(175)-2))). 4sqrt(5)/5 Simplify ((sqrt(3) - (sqrt(6)/sqrt(2) + 0)) + -5 - 5-1sqrt(432))*26. -3600sqrt(3) + 64950 Simplify (-2 + (6(1 + sqrt(68)2) - (-5 + sqrt(68) + 1 + sqrt(68) + -1)))2. 360sqrt(17) + 6881 Simplify ((2sqrt(216)-6)/sqrt(6))/((-1sqrt(300) - sqrt(300) - sqrt(300))4). sqrt(3)/5 Simplify ((-4(4 + sqrt(325) + 1))2 + -2)5. 4000sqrt(13) + 27990 Simplify ((sqrt(110)46)/(sqrt(960)/sqrt(6))6)*2. 14256 Simplify (-1(sqrt(70)-1 + sqrt(70))2)/(-1sqrt(1000)5). 0 Simplify (3(sqrt(539) - (3 + sqrt(539)))-4-6)2. 46656 Simplify ((-5 + (sqrt(60) + sqrt(720)/(-2sqrt(12)))/(-1sqrt(48)/sqrt(4)))2)*2. 20sqrt(5) + 105 Simplify 3 + (((3sqrt(5) - sqrt(5))-1 - (sqrt(45)-3 + sqrt(45))/sqrt(9))4)*2. 3 Simplify -3 + (sqrt(192) + 4 + sqrt(192)-2 - sqrt(192))*2 - (-2sqrt(192)-5-3)*2. -172019 - 128sqrt(3) Simplify ((sqrt(468) + 2sqrt(468)2)/sqrt(9))/(1(6sqrt(4)2 + sqrt(4))). 5sqrt(13)/13 Simplify 2 + (3 + (1sqrt(162)3 + sqrt(162) + sqrt(162))*26)-3. -72907 Simplify (sqrt(209)/(sqrt(891) + (sqrt(891) - 2sqrt(891)) + sqrt(891)))*2 + -4(-1 + sqrt(19))*24. -25901/81 + 32sqrt(19) Simplify -1(1 + 2sqrt(432) - sqrt(24)/(6(sqrt(8) + sqrt(32)/sqrt(4)) - sqrt(8))). -263sqrt(3)/11 - 1 Simplify (sqrt(153)/(sqrt(27)/(sqrt(36)/sqrt(4))))/(sqrt(24)/((sqrt(80)/sqrt(2))/sqrt(5))). sqrt(17) Simplify (612(-2 + sqrt(20) + -4))*2. -3456sqrt(5) + 8064 Simplify (-1(0 + sqrt(17) - sqrt(17)) + (sqrt(17) - (sqrt(17) + (-1sqrt(153) - sqrt(153))/sqrt(9)))*2 + -3)1. 65 Simplify -4(sqrt(11) + (-2 + sqrt(99))2 + sqrt(176) + 0 + -1). -408 + 28sqrt(11) Simplify 12(2(sqrt(1088) + -2)2 + (sqrt(1088)1 + 1)*2 + sqrt(1088)). -80sqrt(17) + 6546 Simplify (-2 + -1(0 + -1 + sqrt(684) + 1)2)3. -2058 Simplify ((sqrt(612) - sqrt(612)4) + 5)6 - (2(sqrt(612) + -1 + sqrt(612) + 2 - sqrt(612)))2. -2422 - 156sqrt(17) Simplify (sqrt(13) - (-1 + sqrt(117)) - (4(sqrt(13) + 0) - sqrt(13)))2 + (sqrt(91) + ((sqrt(91) + sqrt(91)-1)5 - sqrt(91)))/sqrt(7). -10sqrt(13) + 326 Simplify -1 + sqrt(832) + sqrt(832) + sqrt(117)-6 - (0 + (sqrt(26)/sqrt(2))2 + sqrt(52)/sqrt(4) + -4). -3sqrt(13) - 10 Simplify 1 + (sqrt(108) + sqrt(108)3 + sqrt(108))/(sqrt(16) - -4sqrt(16)) + -2. -1 + 3sqrt(3)/2 Simplify (((-1(sqrt(91) - (sqrt(91)-2 - sqrt(91))) - sqrt(91))4)/(sqrt(63)1 + sqrt(343)2))*2. 5200/289 Simplify (1-1sqrt(6480))/(((2sqrt(81) - sqrt(81))3)/sqrt(9)). -4sqrt(5) Simplify ((2(sqrt(104) + sqrt(104)-1))/(2sqrt(32)))2. 0 Simplify (2 + (2-3sqrt(17) - (sqrt(136)-3 + sqrt(136))/sqrt(8))-2)25. 160sqrt(17) + 5460 Simplify ((sqrt(160)2)/sqrt(8))/(sqrt(10) + -6sqrt(810)). -2sqrt(2)/53 Simplify 2 + 3((sqrt(85)/sqrt(5))2 + -2)-3-4 + -4. 538 Simplify (-3 + 3(sqrt(1900) - 4sqrt(1900)) + -3)2. 1080sqrt(19) + 153936 Simplify ((sqrt(3564)1 + sqrt(3564) + sqrt(44) + sqrt(44) + -32sqrt(44))/((sqrt(48)/sqrt(2)3)/sqrt(6)) + -4)*2. -112sqrt(11)/3 + 2300/9 Simplify (-3 + sqrt(6)/sqrt(3) - (sqrt(50)-1)2) + -1 + 0. -54 + sqrt(2) Simplify (-1sqrt(18))/sqrt(9) + sqrt(2) + -2 + (-2sqrt(2) - sqrt(2))2 - (3 + (sqrt(150)/sqrt(3) - sqrt(50))). 13 Simplify -1-3(sqrt(468) + 0 + (sqrt(468) - sqrt(468)-3))*2. 35100 Simplify -1 + (sqrt(720)2)2 - (1 + (sqrt(5) - sqrt(30)/sqrt(6))2 + 2). 2876 Simplify 5((((sqrt(234)-2)/sqrt(9) - sqrt(26))/sqrt(2))*2 - (22sqrt(1872))2). -149175 Simplify (-2sqrt(108))/(2sqrt(144) - sqrt(9)) + ((sqrt(3) + 1)4 - (sqrt(3) - (sqrt(48)-1)2))-1. -52 - 25sqrt(3)/7 Simplify 1 + (sqrt(847) - (-4 + sqrt(847) + sqrt(847) + 0))2 + 5. -88sqrt(7) + 869 Simplify (-1 + sqrt(1800) + 2sqrt(1800))-5-3. -15 + 1350sqrt(2) Simplify sqrt(11)-5 + -4 + (-3 + sqrt(11))2 + 1 + -2. -11sqrt(11) + 15 Simplify (-5 + sqrt(648) + -1 - -22sqrt(32))*2. -408sqrt(2) + 2348 Simplify (6sqrt(110)2 - (sqrt(110) + (6sqrt(110)1 - sqrt(110))))/(sqrt(90) + (-5(sqrt(90)2 - sqrt(90)) - sqrt(90))). -2sqrt(11)/5 Simplify -1(1(sqrt(76)/sqrt(4) + -3))2 - ((2 + sqrt(190)/(sqrt(10)-1))*2 + -4). -47 + 10sqrt(19) Simplify -1 + ((sqrt(128) - (sqrt(128) - (sqrt(128) - (1 + sqrt(128))))3)2 + sqrt(22)/(sqrt(11) - -3sqrt(176)))-5. -2606 - 6245sqrt(2)/13 Simplify (((sqrt(612) + 3)-2 - (2 + sqrt(612) + -4))-2)*2. 576sqrt(17) + 22096 Simplify (-2(3 + (0 + sqrt(11) + 2 - sqrt(22)/sqrt(18))4))*2. 704sqrt(11)/3 + 7172/9 Simplify -3 + ((-5sqrt(143)2)/(-2sqrt(11)-2) + -1)*2 + 5. 5sqrt(13) + 337/4 Simplify (((5sqrt(152) - sqrt(152))3)/(sqrt(8) - (sqrt(8) - sqrt(32)/sqrt(4)-4) - sqrt(8)))2. 2736/25 Simplify (((sqrt(320) + 0)-3 - sqrt(320))-2)2 - ((sqrt(320)1)*2 + sqrt(320) + 3 - (-1 + sqrt(320) + 0)). 20156 Simplify (4(sqrt(76) + sqrt(76) + sqrt(76) + 4sqrt(76)1))/(((sqrt(32)/sqrt(2))/sqrt(2))/sqrt(2)). 28sqrt(19) Simplify 0 + 4 + sqrt(7) + -3 - sqrt(56)/(sqrt(648)6). 1 + 53sqrt(7)/54 Simplify sqrt(9)/(2sqrt(75)) + (-1 + 5(-2 + sqrt(3)))2. -1099sqrt(3)/10 + 196 Simplify -4(sqrt(720) + sqrt(720) + sqrt(720)1 + 3)*26 + -2 + -2. -155740 - 5184sqrt(5) Simplify ((sqrt(168)/(sqrt(112) - sqrt(7)))/sqrt(6))/((sqrt(8) - sqrt(72))/sqrt(4) - (sqrt(128) + sqrt(128) + -1sqrt(128) + sqrt(128) + sqrt(128))). -sqrt(2)/78 Simplify (-2 + -2(sqrt(832) - (sqrt(832) + 1)3))-4. -128sqrt(13) - 16 Simplify -5 + 4((-11sqrt(208))2 - (sqrt(208) + -1)5). -80sqrt(13) + 847 Simplify ((sqrt(308)-1)/sqrt(7))/(6(4sqrt(4) + sqrt(4) + sqrt(4) + sqrt(4))). -sqrt(11)/42 Simplify ((sqrt(76)1 + sqrt(76))1 - -5(sqrt(76) + sqrt(76) + sqrt(76)-2 - sqrt(76)))/(1(sqrt(100) + sqrt(100)-2)) + 5. 3sqrt(19)/5 + 5 Simplify ((sqrt(162) - 1sqrt(162) - (sqrt(2) - (sqrt(24)/sqrt(3))/sqrt(4)))1)2. 0 Simplify 5 + (5 + -3(sqrt(99) + 0))*2. -90sqrt(11) + 921 Simplify -4(-1(2sqrt(1088) + 2)-5)*2. -435600 - 6400sqrt(17) Simplify ((1 + sqrt(1331))-1 - (sqrt(1331) + 0)2)*2. 66sqrt(11) + 11980 Simplify ((-1sqrt(133) + sqrt(133))-5)/sqrt(7) + -5 - (((-4(1sqrt(19) - sqrt(19)))*2 - (1 + sqrt(1216))) + 5). -9 + 8sqrt(19) Simplify -2((62sqrt(315))/(sqrt(720) + -2sqrt(720)-4))2. -14/9 Simplify -2 + (0 + sqrt(1872))4 - (1 + ((sqrt(1872) - 2sqrt(1872)) + sqrt(1872))2 + (sqrt(1872) - (sqrt(1872) + 2sqrt(1872))) + -1). -2 + 72sqrt(13) Simplify -1 + (-4 + 2sqrt(700))*2 + sqrt(56)/(-5(sqrt(8) - sqrt(32))). -799sqrt(7)/5 + 2815 Simplify -3 + 4 + -4(sqrt(1331) + 1 + -3 + 4)*2. -5339 - 176sqrt(11) Simplify -2 + (sqrt(18)/(sqrt(144)-1 - sqrt(9)))*2 + (sqrt(2	{ "pile_set_name": "DM Mathematics" }
2 Let w(s) = 31s + 3. Let d be w(3). Suppose 5f = -r + 3f + 8, f - 10 = -2r. Let b be (4/6)/(r/d). Solve j = -5n + 2n + 7, -5j + b = -4n for n. 1 Let q(t) = t*3 + 2t*2 - 9t + 5. Let y be q(-3). Solve v - y = 5i, 5i - 9 = -4v - 42 for i. -5 Let n be 50(-2 - 95/(-50))-4. Solve 2p + 2 = -0, 5p = -5f + n for f. 5 Suppose -2b + 11 = 3f, 5f - 6b + b - 35 = 0. Solve -3v = -fx + 33 + 7, 4v - 2x + 30 = 0 for v. -5 Suppose -w + 1 + 5 = 0. Let r(u) = -u*2 + 7u. Let x be r(w). Let h be x3/84. Solve -z - 2 = -f, 0 = 3z - 0z + 2f - h for z. 1 Suppose 5c + s - 108 = -3, 0 = -s - 5. Let d = -4 - -7. Solve 2q + dq - 2y = 24, 4q = 3y + c for q. 4 Suppose 2q = 3p - 1, -3q - 2p + 18 = -0. Suppose 2f - 2 = q. Solve -fl = 5d + 30, -5l = -4d - 2l + 3 for d. -3 Suppose 5d - 3u + 10 = 50, -2u - 40 = -5d. Solve 0 = 2p + d, p + p + 11 = -b for b. -3 Let v(u) = -u*2 - 2. Let o be v(4). Let j be (-112)/(-18) + 4/o. Solve -3k + 5h - 1 = -15, 3k = 3h + j for k. -2 Let q = -172 - -104. Let p = -63 - q. Solve -c + pc = 8, 4c - 5 = -b for b. -3 Suppose 0 = -14c + 16c + 4. Let y be c/10 - (-11)/5. Solve -4f + 2 = -yf - 2j, f + 2j = -8 for f. -2 Suppose 4j = -5a - 15, 4 - 7 = a. Suppose -3r = -jr - 27. Solve -2v = -10, rd + 4v = 4d + 35 for d. 3 Let c = -145 - -167. Solve 0 = -5r - d - c, 0d - 21 = 3r - 2d for r. -5 Let y(k) = -k3 - 13k*2 - 24k - 17. Let c be y(-11). Solve -4z + cq + 31 = 0, -2 = -4q - 14 for z. 4 Suppose 0 = -3s + 15, 19y - 16y = -s + 65. Solve u + 4a - y = 0, -5u - 2a + 10 = -0a for u. 0 Let o = 71 + -23. Suppose 3g - 7g = o. Let t = g + 14. Solve -tl + 5j = -17, 7 = 4l - 2j + j for l. 1 Suppose -3h + 4 = 2i, -4h - 3i - 5 = -5h. Solve -ho = -0o + f + 8, 0 = 5o + f + 23 for o. -5 Let l(f) = -f*3 + 7f*2 - 4f - 8. Let n be l(6). Let v = -79 - -91. Solve -nz + 1 = -0z + 5d, v = -4d for z. 4 Let s be (-2 - -2)/((-4)/((-16)/12)). Solve -2f = 3f - 4p - 23, s = 4p + 8 for f. 3 Suppose -2m - a + 1 = 0, 3m - 4 = a + 10. Suppose -8x = -mx - 20. Solve -4w + s - 13 = xs, -6 = -3w + 3s for w. -1 Let s = -402 + 437. Solve 21 + 8 = -j - 5p, 5j + 3p = -s for j. -4 Let h(b) = -b3 - 6b*2 + 3b - 14. Let k be 2 + 2 - (18 - 7). Let l be h(k). Solve l = -3c + o, -3c - 4o + 7o - 12 = 0 for c. -5 Let c(b) = b*3 - 4b*2 + 6b - 2. Let r be c(2). Suppose -g - 30 = -2u, -3u + rg + 9 = -2u. Solve -o - u = -5y, 4o - y - 11 = -o for o. 3 Let k be (1 - 7)/(6/4). Let w be ((-4)/k)/1 - 1. Solve m + 4t - 9 = w, m - 5t + 7 + 2 = 0 for m. 1 Let s = -3 + 7. Let t be 27/1535. Suppose 3u - t = -5y, -s = -4u + 3y + y. Solve 0 = -3m + 2c + 3, 2m - 4m = -uc - 10 for m. -1 Suppose 26 = -3y + 4s, 5y - 4s + 40 = s. Let n(v) = 3v + 20. Let z be n(y). Solve -f + 11 = -zg + 2f, -5f = 4g - 33 for g. 2 Let v be (11 - 11)/(4/(-2)) - -3. Solve -r = -4p + 18, p + 12 = r + vp for r. 2 Suppose 3f = -2t - 3t + 74, 0 = f + 2. Solve -4r - t = -4q, -2q + 12 = 4r + 4 for q. 4 Let p = 57 - 61. Let g = -2 - p. Solve gw + 16 = -4v, -5w - 4 = -3v + v for v. -3 Let v be ((-1)/(-4))/(-1) - 4494/(-856). Solve -k + 4 = -c + 1, -k + vc - 5 = 0 for k. 5 Suppose 10p - 154 = -4p. Solve -4s + 1 = -3x - p, -3s = -3x - 9 for x. 0 Suppose -35 = -f - s, 2f + s + 4s = 73. Let v be -2 + (0 - (-9)/3). Let n be (-10)/(-3 + v - -1). Solve -4o + 5t + 35 = 0, -5o + no - f = 3t for o. 5 Suppose -i - 3i - 2 = -3k, 3k - 6 = 3i. Let f be ((-1)/(-2))/(8/(-32)) - -2. Solve -v - 2l + 11 = f, kl - 20 = 2l for v. 1 Suppose z = 2j + 6, -12 = -0j + 4j. Suppose -2c + 2 = -2f + 8, 3f - 5c - 7 = z. Solve 6 = -2x + f, -22 = 5k + 2x for k. -4 Suppose 2t + 5x = x + 2, -8 = -t + 5x. Let s = -3 - -20. Solve -tm + m = -5o + s, o - m - 4 = 0 for o. 3 Suppose -1 = -h + 3. Let g be (-5 - 1)h/(-12). Suppose -3m - 8 = -w, -gw + 4 = m - 5. Solve -4a - 5 + 4 = -3b, -9 = 4a + wb for a. -1 Let l = -700 + 703. Solve 0 = -2z + lp + 18, -5z + p - 3p + 7 = 0 for z. 3 Let o(d) = -d*2 - 41d + 91. Let t be o(-43). Solve 3l - 1 = 2m - t, -2m + 5l = 0 for m. 5 Suppose 5z = 13 + 12. Suppose v + 2v - 54 = 3w, -w = -5. Let t = v + -21. Solve -3d = -p - 3, -zd = -12 + t for p. 3 Suppose -3z - 4d + 13 = 0, 5z = 7z - 2d - 4. Solve 5l = -3n - 21, zn - 5n - 1 = -l for l. -3 Suppose -2d = -5s + 3d - 20, -10 = -2d. Let h be s/(-3 + 4) + 7. Solve 2w + 2 = -2, -w = 5n - h for n. 2 Suppose -12 = -t - 3. Let g(i) = -i + 17. Let a be g(t). Suppose 2f + 0f = a. Solve 0 = 2m - f, q + 4m - 7 + 1 = 0 for q. -2 Suppose -20 = c - 22. Suppose -d - 5k = -cd + 15, 4k = 5d - 12. Suppose 2z - 13 = 3j, 2j - j = -z - 1. Solve 4 - z = -i + f, -3f + 6 = d for i. 0 Suppose -8t = 4t - 552. Suppose 4d + n = 28, -3n + 2 - t = -4d. Solve 5r = -5l + 6 - 1, 0 = 4l + d for r. 3 Let w(y) = 11y - 1. Suppose 6z + 7 - 25 = 0. Suppose x - 6 = -x + l, -zx - 9 = 3l. Let o be w(x). Solve 4n - 2j = o, -n - 5j + 5 = -3 for n. 3 Let v be ((-12)/(-2))/(18/9). Suppose -5k - 4j + 10 + v = 0, -4j = -3k - 5. Let p be (13 + (2 - 3))k. Solve -2a + p + 9 = 3u, -2a = 4u - 26 for u. 5 Let f(x) = -x*3 - 22x*2 + 50x + 52. Let n be f(-24). Solve -np + 5g + 29 = 8, 1 = -g for p. 4 Let a be 9(2/(-11) - 612/(-1188)). Solve -5m + 4 = -r - 2m, 0 = -ar + m - 12 for r. -4 Let y = -13 + 15. Suppose 0k - 2 = -k + 2s, -2k + s = -4. Suppose r - 6 = i, -22 = r - 2r + 5i. Solve yg - 3g - 5q = -1, rg - kq + 10 = 0 for g. -4 Let z(r) = r*2 - 3r - 1. Let b be (-12)/66 + (-92)/(-22). Let l be z(b). Solve -3y + l = -f - 5, -2f - 5y + 6 = 0 for f. -2 Suppose 2z + 7z = 81. Suppose q + 2u - z = -2u, 5q - 4u = 21. Solve qp + 5a = 25, 0 = -p - 4a + 5 - 0 for p. 5 Suppose 55g = 2t + 50g - 2, 4t - 3g = 4. Solve 5v - 18 = 4s + 14, s - t = -v for v. 4 Let h = -8 - -18. Suppose -h = 9a - 14a. Solve 3c = as + 6 - 22, 5s + 2c = 2 for s. 2 Let u be (-9)/(-15) - (-282)/5. Suppose 0 = -5w + 2w - u. Let v = -13 - w. Solve -2b = -2n, 0b - b + 4n + v = 0 for b. -2 Suppose 1 = 2q - 3. Suppose -qx + 4 = -12. Let d = x - 4. Solve -3z - 4b + d = 0, b = 6z - z - 22 for z. 4 Let p(d) = -d*3 + 4d*2 - 3d. Let h be p(3). Solve 0 = -5j - 5o + 20, -18 = -5j - 3o - ho for j. 3 Suppose -2 + 32 = v. Solve h + 5w - v = 0, 3h + 0h = 2w + 5 for h. 5 Suppose -825 + 745 = -16w. Solve wg = 2l + 35, -3g + g = -10 for l. -5 Suppose -3f = 2f - 5c, -3f + 2c = 0. Let g(u) = -u*2 + 10u - 2. Let z be g(10). Let w = f - z. Solve -wq - h - 3 = -3q, 17 = 3q + 5h for q. 4 Suppose 36l - 69 = 75. Solve -lv = 4p - 4, -p - 30 = -2v + 4p for v. 5 Let v(q) = -q3 - 30q*2 + 29q - 59. Let y be v(-31). Suppose 2u - 3 + 5 = -2g, 2g = -3u - y. Solve a = -3 - 0, g = -3m - 5a for m. 5 Let a be 198/55 - (-1 + (-8)/(-5)). Suppose -ad = 7d - 200. Solve 2r - 10 = -3c - 2c, -c - 4r = -d for c. 0 Let d be (10/6)/((-2)/(-6)). Let v be -1 + -2 + 1 + d. Suppose 2p - 2 = -0, -3s + 7 = -5p. Solve -2 = -w - x, -2w + vw + sx = -7 for w. 5 Let t be (110)/(0 + 2). Let r be (-1848)/(-30) - (-6)/15. Let q = -59 + r. Solve 4o + 3v = q, to - 5v = -0o + 30 for o. 3 Let r(h) = h*3 + 8h*2 - 21h - 9. Suppose 3d - 80 = 11d. Let b be r(d). Let y be (b - (-10)/(-6))-3. Solve 5k + 11 = l + 1, -k - y = -2l for k. -2 Suppose 5j - 16 = -2s, 4s = 8s - 3j - 6. Solve 2t = -sa - 3, -2a + 7a = -t - 12 for t. 3 Let j = 7 - 3. Suppose -3z - z - 4c = -j, 0 = -3z - 5c - 5. Suppose -24 + 3 = k + 5g, -2k + zg = -33. Solve -l - 2 = kl + 3r, -2l = r for l. 2 Let k be (-10)/55 - (2403/33 - -1). Let b = 76 + k. Solve 11 = 5r - 3x, -5 = -bx + 1 for r. 4 Let o(g) be the second derivative of -g3/6 - g2 - 3g. Let r be o(-7). Let c = r - -1. Solve 3y + c = -j + y, 0 = 5j - 2y - 18 for j. 2 Let t(q) = 2q - 5q + 11 + 5q + 7. Let o be t(-9). Suppose on = 2n - 6. Solve nb + 4 = g, 2g + 7 = 3g - 4b for g. -5 Let k = 5 - 0. Solve -7 = r - 2o - 10, -2r + 3o = -k for r. 1 Suppose 4f + 4u - 12 = 0, 5u - 1 = 4. Let r be (f - 1)/(7/(-4) + 2). Solve 3o + 4 = 7o - 3h, -h = -ro + 4 for o. 1 Let u(k) = -k + 14. Suppo	{ "pile_set_name": "DM Mathematics" }
et r be ((-82)/(-3))/(4/6). Does 56 divide 0 + 1002 - r/(205/(-30))? True Suppose 7i = 52257 - 9123. Is i a multiple of 78? True Suppose 13y + 95 = -6y. Let l(c) = -200c + 312. Is 11 a factor of l(y)? False Let y(q) = -q*3 + 4q*2 - 2q - 3. Let z be y(3). Suppose -4j + m = 5m - 196, z = 3m - 9. Is j a multiple of 2? True Suppose -10p = -8p - 8. Does 18 divide 3p/666? False Let d = 7 + 4457. Is 130 a factor of d? False Suppose -48r + 6048 = 96r. Does 7 divide r? True Let q = -191 + 187. Let m(w) = -3w*3 + 4w*2 - 9w - 15. Is 8 a factor of m(q)? False Suppose -16z + 13z = -2w + 2073, 3w - 3152 = -4z. Does 4 divide w? True Suppose 23s - 6s + 38s - 1380500 = 0. Is 27 a factor of s? False Suppose 4t = -y + 319, 0 = -5t + 3y - 0y + 420. Let r = 45 - t. Let i = 76 + r. Is i a multiple of 8? True Let s = 3463 - 1372. Does 17 divide s? True Suppose 18b - 1765 = 23b. Let k be 1/4 + 1706/(-8). Let n = k - b. Is n a multiple of 28? True Let m be 2 + 5000 + 6/2 - -4. Suppose 0 = 22j - 9313 - m. Is j a multiple of 31? True Suppose 2c - 32 = -14. Let q = c + -15. Is 21 a factor of q/(-10) + 52/(-30)-36? True Let z(q) = q3 + 3q*2 - 12q - 4. Let n be z(-5). Suppose -no = 15o - 9996. Does 34 divide o? True Let g = -596 + 264. Let i = g - -372. Is i a multiple of 7? False Suppose 312t - 4985204 + 894884 = 0. Is t a multiple of 15? True Suppose -41f + 133756 + 449920 = 0. Is f a multiple of 14? False Suppose -9842 = -36y + 17y. Suppose 604 = 4i - c - y, -2c = 4. Is i a multiple of 20? True Suppose -2t + 3289 - 408 = r, -2r - t = -5744. Is r a multiple of 19? True Let v be 108/378 + 1/(7/19). Suppose -u + 2 = -vz, -2u - 4z + 2z + 12 = 0. Suppose -3 = -2p + 2j + 1, 2j - 45 = -up. Is p a multiple of 5? False Suppose -104m + 105m = 1. Let p(y) be the first derivative of 141y4/4 - 2y3/3 + y2/2 - y + 2. Is p(m) a multiple of 7? False Does 5 divide (-43 - (-1045)/22)(-10040)/(-6)? True Suppose 0 = 3q - 61b + 56b - 17520, -q + 5840 = -3b. Is q a multiple of 146? True Let p(a) = -66 + 21a + 14 - 1. Let r = -16 - -24. Does 7 divide p(r)? False Suppose -75y + 71y + 114691 = 3b, 5y - 143355 = 5b. Is y a multiple of 25? False Let r(a) = 5a*3 - 20a*2 + 9a - 6. Let d be r(9). Suppose -29l + 38848 = -d. Does 90 divide l? False Let f(b) = 2118b - 14656. Does 40 divide f(12)? True Let v(r) = 6 + r + r*2 - 5 - 6r*3 + 7r*3. Let p be v(-1). Suppose 4c - 306 + 86 = p. Does 11 divide c? True Suppose 2q + 114 = 4q - 4y, 2q = 3y + 113. Suppose q = 4k - 53. Suppose -x - 4p + 5p = -k, 0 = -4x - 2p + 132. Is x a multiple of 3? False Let w = -13583 + 24803. Does 33 divide w? True Let j(l) = -l*3 + 9l*2 - 8l + 50. Suppose -n = 3p - 23, -3p + 2n - 4n = -25. Is 16 a factor of j(p)? False Let a = 6226 - 4007. Let t = a - 1393. Does 7 divide t? True Let g(n) = n*3 - 2n*2 - n + 1. Let p(w) = 93w*3 + 5w + 15. Let f(t) = -g(t) - p(t). Is 51 a factor of f(-2)? False Let k = -60 + -103. Does 15 divide 0(-4)/28 - k? False Suppose 34g - 311459 = -51971. Is 24 a factor of g? True Suppose 0 = -t + 4b + 3839, -3t + 11517 = -b - 4b. Suppose -t = -4i + 161. Is i a multiple of 47? False Suppose -3o - 4b + 722 = 0, -2b = -4o + 87 + 883. Let f = 418 - o. Does 8 divide f? True Let o(v) = 3v - 11v - 3v - 5 + 6v. Let w be o(-3). Suppose 56 = wj - 24. Is 8 a factor of j? True Let x(g) = -g2 - 20g + 20. Let v(s) = 51s3 + 4s*2 + 3s + 6. Let r be v(-3). Let w be r/132 - (-4)/22. Does 6 divide x(w)? True Suppose -4u + 76 = 4p, 0 = -5u - 1 - 9. Let g be 3/(((-8)/p)/(-8)). Let a = g - 46. Does 15 divide a? False Let d(v) = 2v*2 - 12v - 8. Let m be d(7). Suppose -4y = -j + 22, -y = 2j - my - 44. Suppose f + o = 3f - 25, 2f + 2o = j. Is 12 a factor of f? True Suppose -5o = -2o, -a + o = 410. Let b = a + 583. Suppose -306 = -4i + 5u + b, -2u = -2. Does 9 divide i? False Suppose -1462318 + 272662 = -117x. Does 31 divide x? True Let y(b) = 5717b2 - 20b + 1. Does 77 divide y(1)? True Let m = 2630 - 1382. Does 5 divide (m/(-80))/(4/(-10))? False Suppose -a = -4a + 45. Is (-2)/a - (-272)/15 a multiple of 6? True Suppose -9a - 5917 - 536 = -4h, 0 = -4h - 5a + 6495. Is 30 a factor of h? True Suppose 120 = 11p + 43. Suppose 0 = -13q + pq + 4872. Is 14 a factor of q? True Let c = 168 - 357. Let w = -92 - c. Let l = w + 42. Is 20 a factor of l? False Let k = 54 + -49. Suppose k = -2q + 85. Is q a multiple of 4? True Let v = -129 - -198. Suppose 5s - v = 211. Is s a multiple of 7? True Suppose -4 = 2w - 20. Suppose x + 2j - w = 0, x + 5 - 19 = -4j. Is 30 a factor of 1 + -4 - (-91 - x)? True Suppose 26346 = -3x - 8x + 140757. Does 21 divide x? False Suppose 5p + 37 = 4k, p - 1 = 2p. Suppose 3q = -3l + 27, -4q - l + 29 = k. Let w(o) = o3 - 2o*2 - o - 7. Is 3 a factor of w(q)? True Suppose 4s + 2l + 2l = -512, 5l + 10 = 0. Let r = s - -1537. Does 14 divide r? False Suppose 2i + t - 28 = 6t, 12 = i - 2t. Suppose o = -5q - 103, iq + 3o + 0o = -89. Is (-28)/((-2)/(-4) - q/(-8)) a multiple of 7? True Suppose 29a - 14a = 0. Suppose y + 39 = 4f + 4y, -2y + 10 = a. Is f a multiple of 3? True Let w = 209 + -93. Suppose -4q + 3j = w, -q + 2j = -0j + 29. Does 18 divide (-5 - q)(-3)/(-4)? True Let j = 8634 + -5983. Is 5 a factor of j? False Suppose -94c + 91c = -45. Suppose 14q - cq + 840 = 0. Does 30 divide q? True Let f(u) be the first derivative of 31u2/2 - 107u - 15. Does 16 divide f(5)? True Let m(w) = 29 + 2w2 - 19w + 15w2 + 4w - w*2. Let l(q) = -48q*2 + 44q - 86. Let p(j) = -3l(j) - 8m(j). Does 18 divide p(4)? True Let s(j) = -j*2 - 16j - 16. Suppose 41d - 13d + 224 = 0. Does 6 divide s(d)? True Suppose 0 = 5d + 10, -4j + 4d - 2d = -52. Suppose jg = 5g + 14. Suppose 0 = gk + 5z - 125, 2z - 193 = -2k - k. Is k a multiple of 12? False Suppose 0 = 3r - 24 - 147. Let j = r - 52. Suppose -h + 534 = jh. Does 13 divide h? False Let z(b) = -b*3 - 7b*2 - 17b - 268. Does 46 divide z(-9)? False Suppose -13o + 4795 = 440. Suppose 4h + 12z = 17z + 450, -3h = -5z - o. Does 89 divide h? False Suppose -12200 = -30j + 13480. Is 7 a factor of j? False Suppose -4j = -1014 + 1022. Does 34 divide (-89 + -1)/j - (1 - 0)? False Let t(m) = 253m3 + 12m*2 - 21m + 12. Does 42 divide t(3)? True Suppose -17j = -27j + 120. Suppose 5452 = jk + 412. Does 14 divide k? True Let j be 6/33 - 1668/(-22). Let b = 1911 - 1911. Suppose -5h + 202 = -3p + 2p, -2h - 2p + j = b. Is 20 a factor of h? True Suppose -17s + 12s - 300 = 0. Let t = s - -60. Let u = t + 20. Is u a multiple of 2? True Let s(l) = l*2 - 14l + 58. Let t be s(7). Let z(h) = 72h - 48. Is 10 a factor of z(t)? True Let a = -4508 + 9170. Is 18 a factor of a? True Let s = -195 - -208. Suppose -sb = -18b + 405. Does 42 divide b? False Let j = -12645 + 17858. Is 60 a factor of j? False Suppose -12 = -4n, -2n + 7n - 23419 = -4m. Is m a multiple of 7? False Suppose 9j = -3w + 7j, 3j = -2w - 5. Is (-15275)/(-40) - (w - 17/8) a multiple of 12? False Let l(r) = -24r + 555. Is l(0) a multiple of 15? True Let z(t) = 20t*3 - 89t*2 - 30t - 205. Let s(h) = -7h3 + 30h*2 + 10h + 68. Let c(m) = 17s(m) + 6z(m). Does 34 divide c(25)? False Let v be (19 - 1) + -5 - 9. Suppose -3f = -vq + 573, -5q + 0f = -5f - 715. Is 21 a factor of q? False Let i(b) = -b3 - 8b*2 - 3b - 10. Let y(q) be the first derivative of -q*4/4 + 4q3/3 + q2/2 + 12q - 9. Let x be y(5). Is 2 a factor of i(x)? True Suppose 47282 - 256154 = -54h. Does 10 divide h? False Suppose -23v - 1138368 = -62v - 25v. Is v a multiple of 34? False Let u = 0 - -26. Let i(n) = 18n + 1539. Let t be i(-86). Is 14 a factor of 25/15 + (-3)/t + u? True Let k = -276 + 24168. Is k a multiple of 66? True Let r(a) = -3a3 + 94a*2 + 13a - 116. Does 24 divide r(31)? True Let m(h) = 6h + 9. Let p be m(4). Suppose 25 = 3q + 4z, 4q + 0q + 5z - p = 0. Suppose -qw = -3w - 36. Is w a multiple of 9? True Suppose 1138p + 53323 = 5m + 1137p, m - p = 10667. Is 62 a factor of m? True Suppose 1852k = 1857k + 4d - 139336, -k = d - 27869. Does 14 divide k? True Let	{ "pile_set_name": "DM Mathematics" }
+ v. Is p a prime number? True Is (-262108)/(-16) + 18/(-24)1 a prime number? True Let p be (10/(-4) + 2)(346 + -2). Let l = p - -299. Is l prime? True Let c = -278 - -523. Suppose 0v - v = 0. Suppose 2t = -7g + 3g + 944, g + 5t - c = v. Is g prime? False Suppose -18v + 68950 = -8v. Suppose v = 11g - 4g. Is g a composite number? True Suppose 0 = s - 3h - 196, 3h + 179 = 2s - 216. Suppose 3q - s = 284. Is q prime? False Is 6/2428 - -2472 a prime number? False Let k = 1749 + -222. Let i = -820 + -240. Let d = k + i. Is d composite? False Let x = -293 + 670. Is x a composite number? True Suppose 28k = 92311 + 472141. Is k a prime number? False Suppose 5v = -3d + 40, 5d + 3v = -v + 45. Suppose -277 - 903 = -4y + 2m, dy + 5m - 1505 = 0. Let f = -88 + y. Is f a composite number? True Suppose w + 4q - 3385 = 0, -15q = -w - 13q + 3391. Is w a composite number? False Let c = 1710 + -949. Is c prime? True Suppose -23c + 36079 = 5i - 19c, -3i + 21677 = -5c. Is i prime? True Suppose 15789 = 63q - 100320. Is q composite? True Suppose 3c = 86 + 7591. Suppose -5p + 2p = -c. Is p prime? True Suppose -2k - 5v + 35478 = k, k + 4v = 11833. Is k a prime number? True Let n = 779 - -4554. Is n a prime number? True Let y = -72056 - -127219. Is y a composite number? False Let f(p) = -2p3 - 23p*2 - 20p - 165. Is f(-16) a composite number? False Is (6 + 25/(-4))-18188 prime? True Let g(v) = -273v + 295. Is g(-16) composite? False Suppose -3h - 173 = 4w + 79, -5h = 3w + 178. Let j = w + 23. Let a = 64 + j. Is a composite? True Let l(x) = -2x - 2x*2 - 7x - 4 + x*2 + 2x. Let g be l(-10). Let a = g + 89. Is a a prime number? False Let q = 28 + -32. Is -2 + 5 - 304/q composite? False Let f(c) = 85c2 - 13c + 17. Is f(-9) composite? False Suppose 8l + 4066 = 6l. Let b = -994 - l. Is b a composite number? False Let u = 18 + 4. Is (148/8 - 0)u a composite number? True Is (-3389)/(-2 - (1 - 2)) composite? False Suppose 9p - 14018 = 13963. Is p composite? False Suppose -3s - 6s + 0s = 0. Suppose -3b - 3k + 808 = 2b, s = 5b - 2k - 803. Is b composite? True Suppose -17v - 85 + 2108 = 0. Is v a prime number? False Suppose -y + 187 = -2y. Let t = 553 - 289. Let h = y + t. Is h composite? True Let h(u) = 533u + 21. Suppose -2a - 12 + 20 = 0. Is h(a) prime? True Is 20/(-220) - 325920/(-11) a prime number? True Suppose 2x - 3w - 14 = -0, 4x - 8 = -4w. Suppose xd - 2s - 2s = 452, 4d - 431 = -3s. Is ((-34)/4)/((-11)/d) a prime number? False Is (45/12 + -4)/(4/(-98528)) composite? True Suppose 8 = -2r - 4. Let o = -2 + r. Is 382(-3 - 28/o) composite? False Let d(q) = 4q + 6. Let i be d(-4). Let z = 16 + i. Is (-4)/z(-5667)/2 prime? True Suppose -39l = -26l - 565721. Is l a composite number? False Let p(o) = -223o + 49. Is p(-34) composite? True Let l be (9732/(-30))/((-4)/10). Suppose -2n - 5w + 3388 = l, -5n - 5w + 6450 = 0. Is n composite? False Let y be -6 + (-9)/3 + -1. Let i = 137 + y. Is i a prime number? True Let j = -3464 - -6391. Is j a composite number? False Let u = 19706 - 11872. Is u a prime number? False Suppose -10 = -13r + 18r, 2f = r + 73048. Is f composite? False Let k(h) = -8h*3 + 5h*2 + 12h + 88. Is k(-7) a prime number? False Suppose 4 = -5h + h. Let i be -3 - (h - (-4)/(-1)). Suppose 0 = v - iv + 413. Is v a composite number? True Let j(u) = 570u - 7. Let n(p) = -4p - 5. Let k be n(3). Let a = 19 + k. Is j(a) a composite number? True Let x(c) = 57c2 - 4c - 10. Is x(3) a composite number? False Let v(i) = 2i2 + 4i + 3. Let d be -4((-28)/8 - -3). Let h(m) = -m3 + m2 + m. Let p be h(d). Is v(p) a composite number? False Let f(n) = n2 + 2n + 14633. Is f(0) a composite number? False Let r be 2/(-3 - 2102/(-700)). Suppose 0 = 4o + 5k - 1327, 1997 = 4o - 5k + r. Let b = o + 409. Is b a composite number? True Suppose 61n = 54n + 111013. Is n a prime number? True Let q(r) = r. Let d be q(9). Let p = d - 5. Suppose -py = -82 - 66. Is y a prime number? True Let v(z) = -19z*3 + 5z*2 - 2z + 2. Suppose -x = 3x - 20. Let f(d) = 38d*3 - 9d*2 + 4d - 3. Let p(j) = xv(j) + 3f(j). Is p(2) composite? False Let v(j) = 2j2 - 15j + 19. Suppose -3q = -q - 32. Let t be v(q). Is (t/6)/(5/70) a prime number? False Let n = -1 + 3. Let g = -96 + 207. Suppose -149 = -2j + nh + g, 3 = -h. Is j a composite number? False Suppose 5v - 10162 = 37843. Is v a composite number? False Let i = 37 + -37. Suppose 5a - 1162 = -4b + 3a, i = 3b + a - 874. Is b prime? True Let p(r) = 7r3 + 16r*2 + 9r + 3. Is p(4) composite? False Suppose 6s = 4l - 196088, 13s = 2l + 9s - 98046. Is l composite? False Is 44245/25 + (-32)/40 a composite number? True Suppose -4 - 2 = -2d - 2s, -1 = s. Suppose -d - 1552 = -4x. Is x a prime number? True Let d = 3233 - 1716. Is d a prime number? False Let t(k) = 97k2 + 14k - 51. Let y be t(-16). Suppose 4769 - y = -12r. Is r composite? True Let k = 2856 + -1846. Suppose 0 = -19j + 18j + 1008. Suppose r + 3r = -2m + j, -4r + k = m. Is r composite? True Is ((-5864)/(-44))/((-4)/(-22)) composite? False Let j be (12/(-8))/(6/16). Is (-1614)/j85/60 a composite number? False Let z = -16 + 16. Suppose 3w - 6w + 837 = z. Suppose -q - 5h + 77 = 0, -3h + w = 3q - 0h. Is q composite? False Suppose -4u - 5v + 35 = 0, 4 = -u + 2v + v. Suppose 0 = -uc - 0c. Suppose 3k - 223 - 140 = c. Is k a prime number? False Suppose 2d + 15792 = 5r, -r = 4r - 5d - 15795. Is r composite? True Let n(o) be the first derivative of 1753o3/3 - 3o*2/2 + o - 47. Is n(-1) composite? True Suppose -17u - 13u = -43230. Is u a composite number? True Suppose 9a + 0a = -90. Is (-744)/(-40) - 4/a composite? False Suppose -5t + 4t = -1, -2v + t = -1225. Is v a prime number? True Suppose -2h + 5275 = -0h + a, 5h = 5a + 13195. Is h composite? True Let j(z) = z + 12. Let a be j(-10). Let f = -1 + 1. Suppose -2c - ap = -15 - 21, f = -p - 4. Is c a prime number? False Let w(i) = 4i2 + 21 - 29 + 11i - 3i2. Let c be w(-12). Suppose -t + 105 = 4y, 190 = ct - 2t + 3y. Is t a composite number? False Suppose 6h - 2559 = 975. Is h composite? True Is 1(74106/(-6))/(-3) composite? True Let r = -29 + 29. Suppose a - 2 = r, f = -a - a + 1661. Is f prime? True Let g be 2(45/(-6) + -1). Let z = -13 - g. Let p(d) = 11d2 + 3d - 1. Is p(z) a composite number? True Let m(k) = -k*3 + 12k*2 - 12k - 13. Let s = 31 + -21. Is m(s) a composite number? False Let k = -550 + 1067. Is k composite? True Suppose -614 = -s - 5i, 27s - 3i + 622 = 28s. Is s a prime number? False Let a be 4 - 5 - (3113-1 - 0). Let s = -1961 + a. Is s composite? False Let z(h) = 1083h - 226. Is z(5) a prime number? True Let t = 15 + 1. Suppose 74 + t = -3p. Is 970/4(-24)/p a prime number? False Let z = 667 - -8932. Is z prime? False Suppose 2b + 2 = 2u, -2u = -u - 5b + 7. Suppose ux - 95 = 2x. Is x composite? True Let y(g) = -162g2 + 15g - 5. Let q be y(4). Let s = q - -4686. Is s a prime number? False Let q be 125/30 + 1/(-6). Suppose 5w + o - 14103 = 3o, qo - 14079 = -5w. Is w prime? True Suppose u + i - 21135 = 0, 3u - 42258 = u + 4i. Is u composite? True Let u = 448 - 53. Is u a composite number? True Let q(r) = -9r + 3. Let w be q(2). Let x be 5(-6)/w + -3. Is -1 + x - -3 - -552 prime? False Is ((2 - -4)/6)/(4/3068) a prime number? False Suppose 0 = -2z + 2u + 14614, z = 4u + 3225 + 4082. Is z prime? True Is (-14165)/10(-6)/(-1 + 4) composite? False Let m(w) = -w*2 - 5w + 1. Let x be m(-4). Suppose 3l - 5l = 4o - 990, -1233 = -5o - l. Suppose -q + 111 = 3p - xp, -2q - 2p = -o. Is q composite? True Let j = 2537 - 506. Is j a prime number? False Suppose -5s - 2d = -28339, 0 = 5s - 2s - 2d - 17013. Is s a prime number? True Let q(p) = -125 + 64 + 62 + 37p. Is q(4) a prime number? True Let g = 213 - 151. Suppose -3q + 2c + g + 101 = 0, -41 = -q - 2c. Is q composite? True Let n be 6167/35 - (-1)/(-5). Let f = -33 + n. Is f prime? False Let j be (6/12)/((-1)/(-282)). Suppose 141 = o - 5n, 2n + j = o + 7n. Is o composite? True Is (-1115)/(-3)*(78/(-10) - -9) composite? True Let c be 27/12 + (-21)	{ "pile_set_name": "DM Mathematics" }
ding order. 8, h, 0, -0.3 Let h = -1788 + 1798. Sort h, 0.1, -7. -7, 0.1, h Let h(i) = i*3 + 6i*2 + 5. Let c be h(-6). Suppose 14o + 2o = -48. Sort c, 3, o, 1 in ascending order. o, 1, 3, c Let y = -702 + 5613/8. Put -2, -0.1, y, 2/13 in descending order. 2/13, -0.1, y, -2 Let q be 22/(-3)(16/(-2) + 5). Let y(z) = z*3 - 22z*2 + 3. Let m be y(q). Put m, 9, -1/3, -2/7 in descending order. 9, m, -2/7, -1/3 Let h(x) = x. Let q be h(-1). Let b(d) = 2d + 12. Let v be b(7). Let r = v - 25. Sort q, r, -11. -11, q, r Let n be ((-513)/38)/(15/20). Sort 0, n, -22 in descending order. 0, n, -22 Let i be ((-10)/52)/(3/10). Let r = 4723/13 - 363. Let g = i + r. Sort g, 3/8, -8 in ascending order. -8, g, 3/8 Let g = 43 - 43.24. Let d = 0.16 - g. Sort d, 1/3, -0.5. -0.5, 1/3, d Let v(q) = 7q2 - 2. Let c be v(1). Suppose -4l - 16 = 0, 0 = -0j + 4j + 3l + 12. Suppose 3b + jb = -9. Put 3, b, c in increasing order. b, 3, c Let i = 2272601/17165 + 9/3433. Let u = 133 - i. Let c = 11 - 16. Put u, -0.1, c in descending order. u, -0.1, c Suppose -2j - 2j - 3v = 9, -2j + 13 = 5v. Let u = j + 6. Suppose -3z + 15 = -uz - 3i, 2i = -2z + 30. Sort z, 2, -5 in decreasing order. z, 2, -5 Let m(u) = u3 - 8u2 + u - 6. Let w be m(8). Let p = w + -7. Let j(s) = -s3 - 8s2 - 6s + 6. Let v be j(-7). Put 4, v, p in descending order. 4, v, p Let a = 712.2 + -712. Put 0, a, -40 in decreasing order. a, 0, -40 Let b = 169 + -173. Sort -4/5, 8, b. b, -4/5, 8 Let a = 12 - 9. Suppose aw + 2w = 0. Suppose 0 = h + 5z - z - 11, 3z = -4h - 8. Sort w, h, 2 in increasing order. h, w, 2 Let m = -18 - -20. Let v be (m - 0) + 17 + 0. Let d = v + -16. Sort -4, d, -3 in ascending order. -4, -3, d Let d be ((-2)/(-7))/(15 - 728/49). Sort 3, d, -3 in decreasing order. 3, d, -3 Suppose -15i - 4 = -2j - 17i, -3i - 9 = 0. Put j, 174, 0 in ascending order. 0, j, 174 Let y be 8/(-14) - (-121)/77. Let h = -24 - -14. Let o = -9.3 - -9. Sort o, y, h in descending order. y, o, h Let r(d) be the first derivative of -d3/3 + 6d*2 - 20d + 16. Let g be r(10). Sort -1, 8, g in descending order. 8, g, -1 Let c = -0.0562 + 0.3562. Sort 4, -5, 9, c in descending order. 9, 4, c, -5 Let g = -0.3 + -1.7. Let o = -0.09 + -0.91. Put -0.3, g, o in descending order. -0.3, o, g Let f = -27.9 + 22.9. Sort f, 5, 7 in decreasing order. 7, 5, f Let n be (-1 - 3)/(-4) - -1. Let q be -1 + (2 - n)/3. Put 1, -5, q in increasing order. -5, q, 1 Let s be (4 - 1) + ((-66)/(-36))/(-1). Let n = 23/21 - s. Let v = 3 - 2.9. Put v, -4, n in increasing order. -4, n, v Let q = -8 - -13. Put 0, 4, q in increasing order. 0, 4, q Suppose 76 - 120 = 11x. Sort -1, x, -5, 18 in decreasing order. 18, -1, x, -5 Let p = 1389 + -1386. Suppose 2u - 7r = -3r - 28, 3u - r + 17 = 0. Sort p, 4, u, 5 in ascending order. u, p, 4, 5 Let g = 3251/4 - 812. Let q = -2 + -1. Put q, g, 0.1, -5 in descending order. g, 0.1, q, -5 Let m = -13.7 + 11. Let z = 20.3 - m. Let c = z - 23.1. Put c, -4, -0.4 in ascending order. -4, -0.4, c Suppose 72 = -14m + 114. Put -1, m, 5 in decreasing order. 5, m, -1 Let f(p) = p*2 - 2p - 4. Let s be f(4). Let d(l) = l3 + l2 - l - 2. Let v be (-2 - -3)/(3/(-6)). Let q be d(v). Sort 2/5, s, q. q, 2/5, s Suppose 2 + 8 = 2v. Suppose 2m - r = -2, 1 = -vm + r - 4. Let b = 0.64 - 4.64. Sort -5, b, m in decreasing order. m, b, -5 Suppose 5k + 29 - 9 = 0. Let p(i) = -i*2 + 3i - 6. Let m be p(5). Let u be 19/(-7) - m/(-56). Sort u, 0, k in decreasing order. 0, u, k Let f = 219/7 + -31. Put -1/60, f, 2, 0.3 in descending order. 2, 0.3, f, -1/60 Let u(s) = 2s3 - 8s*2 - 6s - 5. Let p be u(5). Suppose -3j + 0m - p = 2m, -18 = j + 5m. Let a = 4 - 4. Put j, a, 1 in ascending order. j, a, 1 Let d be 35/14(16/(-10) - -2). Let q be (6/2 - d) + 3. Let j be (-2)/(-5) + (-54)/10. Sort q, 2, j in decreasing order. q, 2, j Let k(i) = -47i - 43. Let a be k(-1). Sort 2, -5, a in ascending order. -5, 2, a Suppose -169 = -21d - 1303. Sort 0.2, d, 3/2, -0.4. d, -0.4, 0.2, 3/2 Let p be (-6(-6)/(-12))/(-1). Sort -4, p, 5, 2 in ascending order. -4, 2, p, 5 Let a be (6/(-24))/((-2)/(-4)). Let d = 9 + -10. Sort a, 1/9, d in ascending order. d, a, 1/9 Let q be (490/8 - 2) + -1. Let d = q + -58. Let y = -10.6 + 8.6. Put y, d, -1 in descending order. d, -1, y Let l(k) = k + 11. Let o(q) = 10. Let t(p) = 4l(p) - 5o(p). Let b be t(4). Let m = b + -7. Put -3, m, -1 in decreasing order. m, -1, -3 Let c be ((-4)/(-24))/(2/8). Let x = -107.8 - -108. Sort c, x, 0 in ascending order. 0, x, c Let a be 38/(-34) + (0 - -1). Let l be (6/404)/((-6)/15). Let c = -17 + 12. Put c, l, a in decreasing order. a, l, c Suppose -21 = -6h + 9. Sort 11, -4, h in increasing order. -4, h, 11 Let j = 772 + -778. Put -4, j, 15 in decreasing order. 15, -4, j Let v be -3 - (-3 + 6/1). Let f(u) = u*2 + 5u - 9. Let a be f(v). Sort 3, -1, a. a, -1, 3 Let j = 5 + 3. Let m(b) = -b*3 + 7b*2 + 8b - 2. Let u be m(j). Let x = -2/5 + 0. Put u, x, 0.3 in decreasing order. 0.3, x, u Let u(s) = -s*2 + 5s + 2. Let v be u(5). Let a(z) = -3 - 2z + z - 4z + z*v + z. Let m be a(5). Sort -5, m, 3. -5, m, 3 Suppose 0 = -4a - 5t - 11, -9t + 11 = -3a - 10t. Suppose -2z + 7 + 3 = 0. Sort z, 2, -2, a. a, -2, 2, z Let l be (-1)/(-10 + 1)-3. Let i = 6/95 - 256/1045. Sort l, i, -0.08, -2 in increasing order. -2, l, i, -0.08 Let j be (2 + 0)(-2 - 0). Let n = 4 + j. Put n, -2, -7 in increasing order. -7, -2, n Suppose -2h - 1 = 3s - 5, h - 2 = -2s. Let x be 2 + -1 - -2 - -1. Let l(d) = -d*3 + 4d*2 + 2d - 3. Let a be l(x). Sort 0, h, a. 0, h, a Suppose 20g = 43g + 391. Sort -2, g, -23. -23, g, -2 Let i = -1.4 + 4.4. Suppose -4k + 21 = 29. Sort k, -2/17, i. k, -2/17, i Let b = -1.59 + -0.11. Let v = b - -3. Let f = -0.7 - v. Put -1, f, -1/3 in ascending order. f, -1, -1/3 Let x = 8 + -20. Let q be 6(2 - x/(-9)). Suppose -qj - 33 = 5s, -2s - 15 = 2j - 1. Sort -3, s, 5 in increasing order. s, -3, 5 Let y = -11 - -9. Let i = 14.8 - 17. Let o = y - i. Put -1/4, o, 4 in increasing order. -1/4, o, 4 Let w be (-6)/(-4)(-23 - -25). Let k be (-3 + w + 0)/(-1). Suppose -4c + b - 2b = 17, 3c - 5b + 30 = k. Put 0, c, 4 in descending order. 4, 0, c Let q = -31.1 - -31. Put -19, -4/3, 5, q in decreasing order. 5, q, -4/3, -19 Let a be 0 - 0 - (1 - 4). Let s = -13 + 17. Suppose 4d + 0d = 12, -2v = -2d + s. Put -4, v, a in ascending order. -4, v, a Suppose 3x = -x + 5z - 204, 5z = -20. Let y be 245/x + (-6)/(-16). Sort y, 4, -1, 11 in descending order. 11, 4, -1, y Let o = 163 - 202. Put -2, o, 3 in decreasing order. 3, -2, o Let z be -87-2(-1)/2. Let w = 5676/5 + -1049. Let t = z + w. Put t, 3, 0 in increasing order. t, 0, 3 Suppose 10y - 11y + 5 = 0. Put 1, -15, y in increasing order. -15, 1, y Let t be (52/(-84) - -1) + 4/14. Sort -4, t, -4/13, 2. -4, -4/13, t, 2 Let t(v) = -2v2 + 10v + 71. Let n be t(9). Sort 1, -5, n, -6 in decreasing order. 1, n, -5, -6 Suppose -4x + 12 = -b - x, -21 = 2b - 5x. Put 5, 1, 13, b in ascending order. b, 1, 5, 13 Let g = 7 - 3. Let o be (-3)/15 - ((-576)/20)/9. Put -28, g, o in descending order. g, o, -28 Let t be ((-11)/7161)/(1/3779) + 3. Let c = t + 84/31. Let m be (-7)/(-6) + 3/(-6). Sort 0.5, m, c. c, 0.5, m Let t(h) = 9h + 13. Let o be t(-1). Let l(f) = f*3 - 11f*2 - f + 12. Let j be l(11). Sort o, 5, j. j, o, 5 Suppose t + t - 2a - 36 = 0, 0 = -3t - 4a + 68. Suppose 15v - 20v - t = 0. Let p be -1 + (0/(-1) - 1). Put v, 3, p in increasing order. v, p, 3 Suppose -28l + 6 = -a - 25l, 6 = -5a + 3l. Let d = -29 - -52. Sort d, -3, a in ascending order. -3, a, d Let q be -2 - (35/10)/((-10)/20). Let i = -2 - -2. Sort -4, -5, i, q in decreasing order. q, i, -4, -5 Suppose a - 20 = -a. Suppose 3p - a = -2p. Suppose ph - 5n = -16, 2h - 6 - 2 = -n. Sort h, -5, -2 in decreasing order. h, -2, -5 Suppose 32 - 44 = -12c. Sort 0, c, 3, -1 in descending order. 3, c, 0, -1 Let r be 10/(-95) + (-55)/19. Sort r, 85, 3 in ascending order. r, 3, 85 Suppose 0 = 2b - 16k + 15k - 3, -4b = 3*k + 9. Sort 4, b, -2, 6 in descending order. 6, 4, b, -2 Let q be (75/(-9))/5 + (-5)/15. Let t be (100/(-18))/q - (-2)/9. Sort t, 1, -10 in descending order. t, 1, -10 Let q	{ "pile_set_name": "DM Mathematics" }
(-2)/2) -3/7 Calculate 22/4 - (-42)/(-7). -1/2 (-46)/(-69) - (-5)/(-3) -1 What is (-25)/(-10)36/(-30)? -3 Calculate 61 - 56 - (1 - -9). -5 Evaluate (-7)/((-14)/4)(8 - 6). 4 Evaluate ((-4)/(-2) + 1)/(22 - 19). 1 Evaluate (-45)/(-55) - (-6)/33. 1 What is the value of (-513)/(-63) - 2/14? 8 Calculate -3 - (-15)/6(-12)/(-15). -1 Evaluate (-62)/(-14) - 180/420. 4 Evaluate -1 + -2 + 2 + -4. -5 Calculate -1 - (-64)/(-12) - (-3)/9. -6 What is 4/(-5) + 64/(-20) + 5? 1 What is the value of (28/10)/(130/(-325))? -7 Evaluate -3 + 11/(-7) + 5. 3/7 What is the value of (-21)/(-14)(-16)/(-4) + -1? 5 2/(-9)(5/2 - 1) -1/3 What is -2 + 17/(-4) - 29/(-116)? -6 ((-51)/(-45) + -1)81/(-54) -1/5 Calculate 96/(-189) + (-4)/(-18). -2/7 5/(75/78) + -6 -4/5 What is (-50)/35 + (-18)/(-42)? -1 What is (-6)/15 + 4/(-140)? -3/7 What is the value of (-3)/(-2)-2(-3430)/1470? 7 3/((5 - 3)/(-4) - 7) -2/5 What is the value of (30/12)/((-6)/4)? -5/3 (-24)/141(-35)/10 6 Evaluate 2 - 1 - (-1 - 10/(-3)). -4/3 What is the value of -2 + 1 + (3 - 4)? -2 Calculate 1 + 3 - 04/16. 4 What is (30/(-9))/(0 + 2/3)? -5 What is the value of (-40)/(-56)4/(-10)? -2/7 Calculate 288/(-120)(-5)/3. 4 What is the value of (0 + (-3)/4)/((-18)/72)? 3 3(26/(-3) - -8) -2 ((-38)/42 - 8/(-14)) + 0 -1/3 Evaluate (-8 - 0)(-3 - -2). 8 What is (35/5 + -10)-2? 6 Evaluate -8 + (-7 - (-8 + -4)). -3 72/8 - 335/35 -4/7 What is the value of (-2)/9 + (8 - 496/36)? -6 28/12 + (0 - 1/3) 2 What is (-35)/15 - 684/(-270)? 1/5 What is 3(-4 + 20/6)? -2 Evaluate (-8)/2 + -5 + 10. 1 (15/(-6) + -2)8/(-12) 3 Evaluate 1 + ((-9)/(-12) - 13/(-4)). 5 Evaluate 9/(540/64) - 20/50. 2/3 Evaluate (-8 + (-194)/(-24))/((-2)/(-4)). 1/6 What is the value of 170/(-1071)(-3)/(-5)? -2/21 (2(-3)/18)/((-217)/372) 4/7 What is (-2)/(-3)12/(-24)? -1/3 Evaluate ((-10)/6)/((-15)/12). 4/3 What is the value of 39/6 + (-81)/54? 5 What is 1/(-2) - 1(12 + -13)? 1/2 Calculate ((-1)/(-2))/(3/(-12)) - -3. 1 What is the value of 204/119 - 4/(-14)? 2 -32(-4)/6 4 Evaluate -3 - ((6 - 0) + -7)1. -2 Evaluate -6 - (2/(6/(-9)) + 0). -3 What is the value of 2 - 24/645? 1/8 Evaluate -6 + ((-783)/(-45) - 11). 2/5 What is (-2)/7221/30? -2/5 Calculate (-16)/32 - ((-11)/(-2) - 3). -3 What is the value of 0(-5)/(-25) + -1? -1 Calculate (2 + -1 - 1)/(31 - 32). 0 Evaluate 115/((-45)/(-6)). 2 Calculate (-4 + 3)3(-4)/4. 3 (-74 - -75)/(1/3) 3 What is 2/(-2)(1 + (-4 - -5))? -2 Calculate (6/(-10))/(3(-4)/(-60)). -3 Evaluate (-21)/(-10) + 3 + (-54)/15. 3/2 Evaluate (-20)/(-168) + 10/(-35). -1/6 What is 4/(-10) - (-10)/(600/54)? 1/2 What is ((-6)/(-12))/(3/36)? 6 What is 25/90 - (14/18 + -1)? 1/2 What is -2 + 34/14 + 3915/(-609)? -6 What is ((-1 + 1)3/(-9))/3? 0 What is 2516/80 - (-30)/(-2)? -10 What is 5/(-2) - 425/(-50)? 6 18/(-15) + (-114)/(-95) 0 Evaluate (-36)/24 + 0 + 2. 1/2 ((-190)/(-20) - 9)/(3/(-6)) -1 What is the value of 36/22((-88)/(-24) + -4)? -6/11 Evaluate 464/(-6264) + 40/54. 2/3 What is the value of (-3 - (-5 - 2))/(-1)? -4 ((-66)/55)/(6/(-15)) 3 Evaluate 6 + (-14)/10 + 46/(-10). 0 12(-12)/(-18) + -8 0 What is 3/((-8)/((-96)/(-18))) + 3? 1 5/(1800/64) + 4/(-10) -2/9 Evaluate (-2 - ((-70)/(-4))/(-7))0. 0 What is 3 + (-1 - (-15)/(-7))? -1/7 Evaluate 45/114 + (-3)/6. -2/19 Calculate 1/(3/(-147)-7). 7 What is 5/(-3)(7 - (-4 - -8))? -5 Calculate (7/(14/(-12)) - -4)/(-8). 1/4 Evaluate 4(-4)/6(-147)/(-196). -2 Calculate ((-20)/(-50))/((-3)/15). -2 What is 6/(-21) - (-1)/(7/(-33))? -5 Evaluate (-3)/(-12) - (81/(-60) + 2). -2/5 (26/((-1248)/36))/((-18)/16) 2/3 Calculate (-7)/(-21)(-3 + 3). 0 Evaluate -2(6/(-2) - (-19)/6). -1/3 Evaluate 7/(-21) - (-200)/24. 8 (-325)/390 + (-2)/12 -1 ((-4)/(-140))/(-3 + (-16)/(-5)) 1/7 What is (4/(-40))/(((-8)/(-30))/2)? -3/4 What is (2/(-4))/((-14)/(-56))? -2 What is the value of (4/(-4))/((7/(-3))/(-7))? -3 (3 + (-44)/12)/(24/(-18)) 1/2 What is the value of 2(-2)/(-56) - 966/(-196)? 5 Calculate -5 - (6/(-2) + -7). 5 What is the value of (3/90)/(6 + (-210)/36)? 1/5 Calculate (-2)/(51/(-6) - -11). -4/5 What is 7613/(-3972) - 2(1 + -2)? 1/12 (16/(-84))/(4 + -2) -2/21 (4/3)/((-14)/21) -2 What is 14/(-4 - 3) + (-36)/(-17)? 2/17 What is the value of (4 - -2)(3 + (-87)/30)? 3/5 What is the value of ((-72)/63)/(-3 - 38/(-14))? 4 What is -1 + (12/(-3) - (-3 + -2))? 0 What is (-6)/(3-8)(-24)/(-2)? 3 Calculate 4/(((-2)/(-5))/((-16)/(-40))). 4 What is (6/14)/(-3)(6 + -10)? 4/7 Calculate 45/(-15)(-2 - 26/(-6)). -7 ((-1)/((-19)/(-190)))/(-1 - 3) 5/2 1-1 + 28 + -31 -4 Evaluate (-88)/33(-30)/(-680). -2/17 (2/2)/((-56)/(-168)) 3 What is 176/99 + (-12)/(-54)? 2 Evaluate (1 - (-6 - -3)/(-6))6. 3 Calculate (1 + -2)/(34/(-170)). 5 Evaluate (6 - (-10 + 8 - -9)) + 4. 3 Evaluate -77(440/56 + -8). 11 7 - (-6)/(90/(-87)) 6/5 What is 1 + 0/2 + 70/(-40)? -3/4 Evaluate ((-2)/(-64)-6)/(15/(-10)). 1/8 Calculate (-36)/1805/(-8). 1/8 (585/27)/5 + (1 - 4) 4/3 Calculate (2/(-6))/(0 + (-4)/60). 5 Calculate ((-6)/(-20))/((-10)/140-3). 7/5 Evaluate -1 - 9/14-2. 2/7 Calculate (-1)/(-7) + 6924/(-840) + 8. -1/10 What is the value of ((-6 + 3)/(-30))/((-12)/30)? -1/4 Calculate (3 - -2)(-2 + 56/30). -2/3 (-6)/(-5 - 13) + 2/6 2/3 What is the value of (14/4)/((-12)/24)? -7 What is the value of 54/(-36) - (-1)/(-1 + -5)? -5/3 Evaluate (-3)/(17 - 5) - (-126)/312. 2/13 What is (-6)/(-20) - 231/420? -1/4 What is the value of (46/(-12) + 1/(-6))1? -4 ((-7)/5)/(234/30 - 8) 7 Evaluate 52/16 + -3 + 33/(-484). 2/11 Calculate (-14)/((-224)/12) + 0. 3/4 Calculate (9/(-10))/(510/850). -3/2 Calculate -5(9/10 + 6/(-15)). -5/2 (-21)/12 - 1/(-4) -3/2 What is 14/(84/9) + (-11)/6? -1/3 What is 1/(-5 - -2) - (-65)/15? 4 Calculate (-6)/(-24)(6/3 - 3). -1/4 108/1782 - (-120)/(-891) -2/27 -72/8501/2338 -3/8 What is 21/6 + (-12)/8? 2 Calculate 30/(-14) - (3 + (-5 - 0)). -1/7 Calculate (43/258)/(((-30)/(-63))/(-5)). -7/4 207/(-54) + 0 + 20/24 -3 Calculate (6 - (-18)/(-2))/(-9). 1/3 Evaluate ((-33)/(-77))/(-5 - 136/(-28)). -3 What is 18/(-10)4(-105)/252? 3 Calculate 2/12 - 2 - (-1)/3. -3/2 What is (-420)/(-132) - (2 - (-1 + 0))? 2/11 Evaluate (1/(21/14))/((-1)/3). -2 Calculate ((-18)/54)/(2/6). -1 What is 1(-2)/(16/(-4))-4? -2 What is the value of (85 - 89) + 2 + -4? -6 Evaluate ((6/(-2))/(-36))/((-3)/(-8)). 2/9 Evaluate -6 + (18/10)/(63/105). -3 -5(1 - 0)/1 -5 Evaluate 5/(-36 + 6) - (-15)/(-18). -1 Evaluate 3(5 + -6 + 2). 3 Calculate -5(-6)/75(9 - 4). 2 What is (16 + -15)(-4 - 88/(-20))? 2/5 Evaluate -2 - 3/(-1 - 4/(-3)). -11 What is the value of (-6 + 7 - (-4)/2) + -2? 1 What is ((-256)/240)/((-2)/15)? 8 Calculate ((-188)/(-1410))/(1 - (-2)/10). 1/9 What is the value of (-4 + 7)/18 - 115/(-30)? 4 Calculate (-102)/42 + (-3 - 1 - -6). -3/7 Calculate (4(-3)/9)/((-40)/18). 3/5 What is ((-6)/(-12))/((-6)/(-24))? 2 56/(-196) - ((-37)/7 - -2) 3 Evaluate (-68)/(-12) - ((-28)/(-6))/7. 5 What is 3 + -3 + 1 + -3 + 0? -2 Calculate (3/(-2))/(((-75)/20)/1). 2/5 What is 728/336 + 5/(-3)? 1/2 What is 4/42(-2)/((-54)/63)? 2/9 Calculate ((4 - 10) + 2 + 6)-2. -4 Calculate (-172)/20 - (-288)/32. 2/5 What is the value of 2/(-10)3 - (22 + -22)? -3/5 What is the value of (-23)/7 - (-2)/7? -3 Evaluate ((-6)/(-28))/((-5)/(175/(-10))). 3/4 What is (-1)/((-2 + -3)/20)? 4 What is the value of ((-1)/(-4)5)/(1/4)? 5 ((-5)/153)/(44/(-8)) 2/11 Calculate (-3)/(-1) - (27/2)/3. -3/2 Calculate 7/(-1) - 775/(-100). 3/4 What is (-17 + 5 - -4) + 4? -4 What is ((-27)/(-81))/((-7)/3 - 1)? -1/10 Evaluate -5 + 0 - (2 - -4). -11 What is ((-1248)/(-91) + -14)/((-4)/(-7))? -1/2 Evaluate ((-744)/(-620))/((-6)/(-20)). 4 Calculate (-8)/(-20) + 72/(-80). -1/2 -2 - ((-212)/(-36) - 4/(-36)) -8 Calculate (4/(-32))/(6/8). -1/6 Calculate (2 + -1)/(-1) - 10/(-4). 3/2 Evaluate 6/(-16) + 129/24. 5 Calculate (1 + -1)8/16. 0 What is 10/10(-2)/1? -2 Calculate ((-9)/(-18))/(((-21)/(-18))/7). 3 Calculate ((-24)/56)/1 - 64/14. -5 Evaluate ((-35)/(-7))/(6 - 7). -5 Evaluate 13/(-5) + (-2)/5 + 6. 3 What is the value of ((-2)/(-6))/(32/(-72))? -4 (196/(-96) - -2)/((-1)/3) 1/8 What is the value of 1/((-2)/(-3))12/(-27)? -2/3 What is (-4)/7 + (-1085)/245? -5 4 + 285/(-70) + 0/(-6) -1/14 What is the value of (-43)/868/(-22)? 2/11 What is (13/117)/(-2 + 1)? -1/9 What is 6/16*1 - 169/(-104)	{ "pile_set_name": "DM Mathematics" }
e y = -1 + o. Solve g = -g + y for g. 4 Suppose -7 + 3 = -3q - 4u, 3 = -4q + 3u. Let c be ((-16)/(-12))/(4/18). Suppose cg - 8 - 10 = 0. Solve -gi = -qi - 6 for i. 2 Let l be (-110)/(-5)(2 + 6/(-4)). Suppose 10s - 5s = 0. Suppose 0 = u - 3 - s. Solve l = -4f + u for f. -2 Let x be ((-4)/(-6))/1333/74. Solve 0 = b - 0b + x for b. -3 Let n(v) = v3 + 6v*2 - 7v + 4. Let r(l) = l*3 + 6l*2 + 4l. Let x be r(-4). Let d be -3 - x/41. Let h be n(d). Solve -hm - 25 = -9m for m. 5 Let g(x) = 2x*2 - 3x + 8. Let q be g(0). Suppose -12 - q = -2f. Solve f = -3j - 2j for j. -2 Suppose -9z + 6z + 15 = 0. Suppose -2s - 8 + 6 = -y, -4y + zs + 11 = 0. Solve 0k + 8 = -yk for k. -2 Let u = -25 - -35. Let b(y) = 3y - 21. Let j be b(u). Let a be ((-6)/8)/(j/(-36)). Solve -7 = 5k + a for k. -2 Suppose -l = -j - 1, 4j = 6l - 4l - 2. Solve j = -4x - x + 10 for x. 2 Let o be 7/21(6 + 0). Suppose -op = -6p + 12. Solve -b = -pb + 4 for b. 2 Let z = 18 - 12. Let r be 7/(-77)-2 - (-4)/(-22). Solve n - zn = r for n. 0 Let t(i) = -i + 6. Let n(s) = 2s - 13. Let c(v) = 2n(v) + 5t(v). Let a be c(2). Solve -u + 3u + a = 0 for u. -1 Let g be 26/169 + (-230)/(-26). Suppose -g = -m - 1. Solve 4r = -0r - m for r. -2 Let h = 382 - 382. Solve 11p - 5 + 60 = h for p. -5 Let q = 204 - 110. Suppose -q - 146 = -8t. Solve -4h - t = -10 for h. -5 Let n(s) = -s - 2. Let w be n(-2). Suppose -2h = 3z - wh - 25, 2h + 63 = 5z. Solve 4 = -5g - z for g. -3 Suppose -o + m = 2, -5m = -2o - 8 - 2. Solve 7y + o = 14 for y. 2 Let m be 10 - (-15)/(4 - 9). Suppose mj = 5j + 30. Solve n + j = 4n for n. 5 Suppose 18 = -3g + 18. Suppose -2i = -gi - 10. Solve -8 = ia + 7 for a. -3 Suppose -5z = -4b - 3, 4z + 2 = 5b - 1. Suppose -g = z - 8. Solve f = gf + 12 for f. -3 Suppose 0 = -y - 4o + 2, -5y - o = 2o + 7. Let k(l) = -l3 - 4l*2 + 5l - 1. Let h be k(-5). Let d be (5 + -3)/(h - y). Solve 5x - dx - 9 = 0 for x. 3 Let f = 35 + -102. Let k = -64 - f. Solve -ku + 0u = -12 for u. 4 Suppose 171c - 177c = -60. Solve 0 = -122t + 120t + c for t. 5 Suppose -i = 5i. Let w be (i - 0)(-2)/8. Suppose 2f - 2 - 2 = 0. Solve fx - x = w for x. 0 Suppose -j - 5 = -2p + 24, 2 = -2j. Solve -h - 15 = -p for h. -1 Let b = 41 - 65. Suppose 5k + 8 = 4r - 16, -9 = 2k - r. Let u be (-6)/b - (-1)/k. Solve 0 = -3g + 15 - u for g. 5 Let h(t) = 4t - 6. Let d(g) = 5g - 5. Let f(p) = -5d(p) + 6h(p). Let s be f(-8). Let w be (s - -4)(2 - 1). Solve 2z + w + 3 = 0 for z. -2 Let q = -59 - -61. Suppose -4i + 12 = 4g, 0 = -2g - i + qi. Solve -5c + g = -19 for c. 4 Suppose -3x + 135 = 12x. Suppose 9 = -3l + x. Solve c = -lc for c. 0 Suppose -2l = -3l + 2. Suppose 56 - 52 = 2o. Solve -o = x + l for x. -4 Let d be 3 + -8 + 3 + -4. Let a be (-7 + -5)/(d/4). Solve 3x = -x + a for x. 2 Let f(m) be the second derivative of -m3/3 - 7m*2 + 2m. Let g be f(-8). Suppose gn + n = 21. Solve -2v - n = -1 for v. -3 Let n(m) = m*3 - 4m*2 + 2. Suppose 5j - 3j = 40. Suppose y - j = -2z - 2z, 0 = 2y - 2z. Let q be n(y). Solve -c + qc - 5 = 0 for c. 5 Suppose -4 = -t + 2h, h + 23 = -10t + 14t. Solve tv - 9v + 3 = 0 for v. 1 Suppose 0q - 2q = -5x + 98, -4x - 101 = 3q. Let l = 41 + q. Solve 2n = 2 + l for n. 2 Suppose -3g + 21 = y - 4, -3y + 27 = 3g. Let r be -3 - (-5)/((-10)/g). Let v be r/(-4) - (-15)/(-20). Solve v = -0b + b for b. 1 Let x be 1 + -3(-16)/12. Suppose xr = -3p + 5, -r - 2r + 19 = 5p. Suppose -4 + 21 = 4j + a, -3j + 17 = pa. Solve -u - j = 1 for u. -5 Let m be 12(0 + (-9)/(-12)). Let q be 7 - m/((-9)/4). Suppose -q = 4h - 35. Solve -u + hu = 0 for u. 0 Let v be (-3)/(-12) + 45/12. Suppose -vn - 42 = -n. Let k = 14 + n. Solve y + ky = 1 for y. 1 Let g(y) = 3y. Let b(t) = -4t - 1. Let n(d) = 2b(d) + 3g(d). Let i be n(4). Suppose 7x - 369 = 28x - 537. Solve -ic + 2 + x = 0 for c. 5 Suppose 0 = 3m + 2t - 3 - 8, -m - 1 = 3t. Solve 2f = -7 + m for f. -1 Suppose -360 + 45 = -45a. Solve -ah - 6 = -5h for h. -3 Suppose 2s - 111 - 49 = 0. Suppose 3r = -2r + s. Solve 5h = -6 + r for h. 2 Let k = 14 + -9. Suppose 4i = p - 2, -10 = -p - 0p - 4i. Suppose -ku + p = -9. Solve 4 = -ur + r for r. -2 Let m be 155/(-20)(-12)/3. Let d = m + -31. Suppose d = 3y + 4 - 22. Solve -yo = -2o for o. 0 Let o(z) = z2 + 11z - 15. Let f be o(-7). Let m = f + 43. Solve 3k - k = m for k. 0 Let v = -61 - -96. Let x = 38 - v. Solve xb - 4 = 2b for b. 4 Let x(q) = -q3 - 20q*2 + 43q - 22. Let c be x(-22). Solve c = d + 3d + d for d. 0 Let x = -9 + 36. Let s = x - 46. Let m = -13 - s. Solve m = t + 2 for t. 4 Suppose -136 = -29k + 676. Solve -kx = -6x + 66 for x. -3 Let j = 283 + -250. Solve -37q = -jq + 20 for q. -5 Suppose 3919 - 979 = 42u. Solve -72c + uc = 10 for c. -5 Let y = 12 + -18. Let q = -24 + 34. Let i = y + q. Solve -12 - 4 = ih for h. -4 Suppose -5d - 7k + 180 = -8k, -2k + 130 = 4d. Solve 14w - 35 - d = 0 for w. 5 Suppose -2z - 4p = 40, 5z + 124 = -0p - 2p. Let t = z - -26. Suppose -2g - 2f - 2 = t, 5g - 2f - 40 = 2f. Solve -n + 5 = g for n. 1 Suppose -2f + 3f - 5 = 0. Suppose -5d = -fh - 0 + 5, -5h - d + 17 = 0. Let u be (-4)/(-41)h. Solve -um + 8m - 20 = 0 for m. 4 Suppose -r - 2r + 27 = 0. Let v be 40/220 + 4/(-22). Suppose -5a + ra = v. Solve 2g - g + 5 = a for g. -5 Suppose -7o = -c - 6o, 0 = 2c - 3o. Suppose -10j + 0j = c. Solve jl + 3l = 0 for l. 0 Let a be 48/6 + 16/(-4). Suppose 5x = z + 67, 7x + 2z = ax + 35. Solve -2d = 3 - x for d. 5 Let a be (-8)/(-36) - (-183)/27. Suppose an - 2n = 10. Let o be n/8 + (-1)/4. Solve -3u + 6 = -ou for u. 2 Suppose -32t + 33t = 8. Solve 3f = -2 + t for f. 2 Let u be (-5457)/(-119) + 18/(-21). Solve 3b + 45 - u = 0 for b. 0 Let h(x) = -x*3 - 10x*2 - 18x - 14. Let l be h(-8). Suppose lm + 2 = 8. Let d be 34/10 + (-2)/5. Solve 0i + d = mi for i. 1 Suppose -12f + 40 + 68 = 0. Solve f = 6v - 3 for v. 2 Let t(z) = -z2 + 9z - 12. Let u be t(6). Suppose 3g - 21 = -u. Solve 2 = -gv + 7 for v. 1 Let q(j) = 68j - 671. Let g be q(10). Solve gc = 5c for c. 0 Suppose 7y + 12 = 3y, 5m - y - 23 = 0. Let g be 2/5 + m/(-10). Solve 2o + 0o = g for o. 0 Let w be 2(-4)/12 + (-6)/(-9). Solve w = -2f + 7f + 10 for f. -2 Let o(a) = a2 - 3a + 1. Let k be o(2). Let q = k - -3. Solve qz - 8 = 4z for z. -4 Let c be -1 + 7/5 - (-760)/100. Solve -5i - c = -i for i. -2 Let g = 2984 - 2927. Solve 0 = -6x + 51 - g for x. -1 Let c = 2044 + -2043. Solve x = 3 - c for x. 2 Let i be 4 + -1 - (-8)/(-2). Let c be 188/i(-2)/2. Let f be c/36 + (-2)/9. Solve fo - 12 = 2o for o. 4 Let b(v) = 7v - 2. Let i be b(-4). Let x = -26 - i. Let q be (-7)/(-1) - x - 3. Solve q = -4u - 10 - 6 for u. -4 Suppose -10u - 1435 + 1485 = 0. Solve 11 = -3b + u for b. -2 Suppose -l - 3l + 5s = -84, 5l - 105 = 3s. Solve -ld + 4 = -22d for d. -4 Suppose 5r + 41 = 4o, 0o - 2r + 34 = 2o. Suppose 2m + o = 3j, 4j - 5m = 15 + 6. Suppose b - j = -b. Solve -b = 4t - 5t for t. 2 Let p(q) = 18q + 275. Let j be p(-15). Solve 0 = -jh - 25 + 10 for h. -3 Suppose -c = 4n + 4, 5n + 6 = c - 8. Let q be 2/17 - (-2 + 60/(-68)). Solve o + c = -qo for o. -1 Let k(h) = -2h*2 + 4h - 3. Let w be (-2)/((-2 + -1)/3). Let y be k(w). Let s be (2 + y + 1)/(-1). Solve s = 4q - 0q + 16 for q. -4 Let h = 28 - 15. Suppose h = 2s + 5t, -s - 7t + 2t = -9. Solve 2w + s = 6w for w. 1 Let h be ((-4)/(-6))/((-4)/(-12)). Suppose 0d - hd = -3l - 22, 4d + 5l = 0. Solve -2k + dk = -3 for k. -1 Let u = -1095 - -1105. Solve -6y + uy = 0 for y. 0 Suppose -2i - 2v + 23 = 11, -12 = -3i - 5v. Let n be -3 - (-1 + 0) - -2. Solve n = -7c + 4c + i for c. 3 Suppose 0j - 3j = 0. Suppose 2p + p - 12 = j. Solve o = po for o. 0 Suppose 2s = 5r + 4, s + 3s - 5r - 8 = 0. Suppose 2c + 5w - 4 = -15, 2w + s = -2c. Suppose t + 2 = ct. Solve 0 = -u - tu for u. 0 Let d be 30/45 - 4/6. Let z be (-1)/((3/(-7))/3). Suppose 4v = zv - 6. Solve -2p - v - 4 = d for p. -3 Let i(x) = 3x - 7. Let c be i(3). Suppose -2l - 10 = 0, -r - l = cl + 10. Solve -p = 4p + r for p. -1 Suppose -4*p = -p. Supp	{ "pile_set_name": "DM Mathematics" }
/(c/c*(-3)c) assuming c is positive. c(-41/40) Simplify s(2/33)/s(-22/7) assuming s is positive. s(740/231) Simplify ((((ww/(w0w)www)/ww)/ww)/w)15/((w/w2)/www(w/w1)/w) assuming w is positive. w46 Simplify p/(p*(-7)/p)p/(p/(p/(((pp(-3/8))/pp)/p)p))(pp6)/((ppp(1/13)pp)/p) assuming p is positive. p(1591/104) Simplify k4kk4((k*(-4)k)/k)/(k(k/k6)/k) assuming k is positive. k10 Simplify (g(-3)ggg0)19 assuming g is positive. g*(-19) Simplify (m(m(m(m/m2)/m)/m)/m)/m(2/11)(m/m0)/(m/m(2/5)m) assuming m is positive. m(-98/55) Simplify (((r(-3/4)/r)/r)/r)/r*8rr(1/2)r(-3)/r assuming r is positive. r(-57/4) Simplify (xx(-1)x)(-4/37)/(x(-1/6)x(-1)) assuming x is positive. x(235/222) Simplify (v0/((v/(v(v/(v*5v)v)/vv))/v))(-1/35) assuming v is positive. v(3/35) Simplify b(4/9)/(b/b(-4/7))b(-5/6)b1 assuming b is positive. b(-121/126) Simplify w*(-20)ww4 assuming w is positive. w(-15) Simplify (qq0)(-26)/((qq(-8))/qqq/((qq(3/2))/q)) assuming q is positive. q(-37/2) Simplify a*(1/6)/aa/(a*(-1/9)/a)a((a/(a(-1/3)a))/a)/a(-1/8) assuming a is positive. a(125/72) Simplify (s/(s/((ss(-10/9))/s)))11 assuming s is positive. s(-110/9) Simplify (z1)(-43)/((z/(zz/z(-2/3)))/(z(-1)/zzz)) assuming z is positive. z(-124/3) Simplify (s(1/4)/s(-3/10))(4/29) assuming s is positive. s(11/145) Simplify ((x/x1)/x2)/(x/((x1x)/x))(-2/23) assuming x is positive. x(-2) Simplify (m(2/5)m)(-35)/(m(-3/2)/m7) assuming m is positive. m(-81/2) Simplify (hhh/((h/(hh(-4))h)/h)h/(((((h(3/5)/hh)/h)/h)/h)/h)h)(-38) assuming h is positive. h(-836/5) Simplify (k(-4/5)/k)/((k/(k/k(-4/7)))/k)(k*(-2/5)kk)(3/10) assuming k is positive. k(44/175) Simplify (i/i(1/2))(-16)/(i/(((i/((i1i)/i))/i)/i))4 assuming i is positive. i(-20) Simplify ((n(1/13)/n)/(n4nn))13 assuming n is positive. n(-90) Simplify (y*6yy/(y/(yy*(-1)y)y))(6/5) assuming y is positive. y(42/5) Simplify ((j((jj/(j/j(4/3))j)/jj)/j)/jj(2/7))/(j0j)(7/6) assuming j is positive. j(61/42) Simplify ((i/(ii*(-2/7))i)/((i/((i/(i6/i))/i))/i))/(i(2/7))(5/12) assuming i is positive. i(-23/6) Simplify (rrr/r*(-5))/rrr(-2/65) assuming r is positive. r(518/65) Simplify ((p1pp)/p4)42 assuming p is positive. p(-42) Simplify ((s/(s/(s/(s(-5)/s))))/(s/(s/(ss/(ss(-1/3))))))/(s/((s(-2/3)s)/s)sss5) assuming s is positive. s(-3) Simplify a(-2/55)a(-10) assuming a is positive. a(-552/55) Simplify (w/(w/w2))(-13)/(w*(-1)w)4 assuming w is positive. w(-26) Simplify (l*(-8)l)/((l(l4l)/l)/l)((ll*1l)/l)(-5) assuming l is positive. l(-21) Simplify (v(-24))(16/9) assuming v is positive. v*(-128/3) Simplify (cc*(-5)ccccc)13 assuming c is positive. c13 Simplify (b*(-7)/bb/(b/(bbb*7/b)))/((b/((bb/b*(1/4))/b))/b(b*(-3)bb)/b) assuming b is positive. b(11/4) Simplify (l(ll/(ll*(-2/33)/l))/llll)/(ll(-2/19)) assuming l is positive. l(2612/627) Simplify (ii*16)/((ii7)/i) assuming i is positive. i10 Simplify ((j/((jj(-6))/j))/j(-2/13))/((jj/j*(-1/13)j)/j(-4/3)) assuming j is positive. j(107/39) Simplify ((u*(4/9)u)/(u(uu/(uu3uu)u)/u))/(u*(-2/3)(u/u(3/4))/u) assuming u is positive. u(211/36) Simplify (p(-2/29))(-1/32) assuming p is positive. p(1/464) Simplify (b(-6)/bb(1/8)/b)(-12/11) assuming b is positive. b(189/22) Simplify (o(-2/39)/o(-16))(1/10) assuming o is positive. o(311/195) Simplify (ff0)(-2/15)/(f(-5)/((f0f)/f)) assuming f is positive. f(73/15) Simplify u(u*(11/5)/u)/uuu/((uuu(-3/2))/u) assuming u is positive. u(37/10) Simplify ((qq*(-4)q)(-24))(12/19) assuming q is positive. q*(576/19) Simplify (ss*(-3)s1/s)/(s(-4)s(1/10)/s) assuming s is positive. s(29/10) Simplify ((u/(u/(u/u(-1/4)))u)(6/25))37 assuming u is positive. u(999/50) Simplify ((y3)22)(-2/67) assuming y is positive. y*(-132/67) Simplify (ff0/f)(-23)f/(f/((f/f(-5))/ff))f(-5/2)/f assuming f is positive. f(5/2) Simplify (h/(hh(-2/7)))(-13)/(((hh/h(1/4))/hh)/hh)(-18) assuming h is positive. h(389/14) Simplify ((aaa/(a/((a(-2/25)/a)/a)))/(a(-3/7)/a))/((a/a7)/aa(1/7)/a) assuming a is positive. a(1611/175) Simplify (z*(-1)z(-5))(-1/3) assuming z is positive. z*2 Simplify (y/(yyyy*7y))/yyy/(y*2y)y(y*(1/12)y)/(y(yyy/(y/(y/(y/y(1/7))))yy)/y) assuming y is positive. y(-1181/84) Simplify b(-17)b8 assuming b is positive. b(-9) Simplify (i((i(i/i*(-1))/ii)/i)/i)*39/(((iiii*2i)/i)/i)(-35) assuming i is positive. i218 Simplify (d(-1))(-7)(((d/(d(-4)/d)d)/d)/d)/d(-1/3) assuming d is positive. d(37/3) Simplify v/v*14v/((v/v4)/v) assuming v is positive. v(-8) Simplify (f*(3/4)ff/f(-2))/(((f/(fff/(f(5/3)f)))/f)/f(-2/9)) assuming f is positive. f(175/36) Simplify (d/d*6d(d(d/(d/(d(1/3)/d)))/d)/d)(-2/99) assuming d is positive. d(34/297) Simplify a(23/2)(a/(a(-3/20)/a))/a assuming a is positive. a(253/20) Simplify (x/(xx(x/((x/(xx(-35)))/x))/x))/x(1/3) assuming x is positive. x*(98/3) Simplify ((t/((((tt/((((t*(-2/3)/tt)/t)/t)/t))/t)/t)/t))/(tt/t1))43 assuming t is positive. t(-344/3) Simplify (m2)(-1)/(m/m(-3/8)m2) assuming m is positive. m(-43/8) Simplify (c(-2/9))(-1/35) assuming c is positive. c(2/315) Simplify (((o/(o/o5o))/o)/oo(-9)/o)3 assuming o is positive. o*(-24) Simplify (ll/(l*(8/9)/ll))/(llll/(l(-23)l)) assuming l is positive. l(-224/9) Simplify (t/t0)(-10) assuming t is positive. t(-10) Simplify (i/i*(-2/7)i1)36 assuming i is positive. i(576/7) Simplify (p/p(3/2))(2/5) assuming p is positive. p(-1/5) Simplify (((((j/j*(-1/3))/j)/j)/j)/jjjj(-3/8)/j)/(j(-1))23 assuming j is positive. j(503/24) Simplify (jjj(-5))/(j(-5)/j)(j0)(2/45) assuming j is positive. j3 Simplify ((a/((a(1/5)a)/a))/a1)/(a(-1))(-37) assuming a is positive. a(-186/5) Simplify (h(h/(hh/(hh5)))/h)/(h(1/5)/hh)h(-2/3)/(h(-2)h) assuming h is positive. h*(77/15) Simplify (c/(cc/(c/(c(c5/cc)/c)))c(5/2))(-1/6) assuming c is positive. c(5/12) Simplify (g((g/(ggg/(ggg/(gg(2/25)g)gg)g))/g)/g)/g(-6/19) assuming g is positive. g(-363/475) Simplify (qq*(-10/3)q(-1))(-3) assuming q is positive. q*10 Simplify r/(rr*(-4)r)rr(6/7) assuming r is positive. r(34/7) Simplify (t*3t(((tt*6t)/t)/t)/t)/(tt(1/4)/tttt7) assuming t is positive. t(-1/4) Simplify w(-2/9)/w7(w4ww)/((www(2/11))/ww) assuming w is positive. w(-337/99) Simplify (b2bb)/(b*(3/8)bb)b*(-1/4)b3 assuming b is positive. b(35/8) Simplify (vv(-2/5))(-21)v*(-2/9)vv/(v(2/9)/v) assuming v is positive. v(-452/45) Simplify (d1)15/(d(-1)/(d(-2/9)d)) assuming d is positive. d(151/9) Simplify ((l(-2/5)/l)/((l*(-3/5)/l)/ll))/(ll(-2)ll4) assuming l is positive. l(-19/5) Simplify x(-2/9)/(x/x(-2/43)) assuming x is positive. x(-491/387) Simplify (qq*(-5/3))/(q/(qqq(-5)))(qq/(qq1))(-1/18) assuming q is positive. q(-14/3) Simplify (h/h(-9/7))/(h*(-22)h) assuming h is positive. h(163/7) Simplify (z(12/13))(-5) assuming z is positive. z(-60/13) Simplify (u/(uuu(2/5)))/((u/(u/(u2/u))u)/u)(u/u(-2/7))9 assuming u is positive. u(321/35) Simplify (d23)(-7/2) assuming d is positive. d(-161/2) Simplify x*18x*(-8/5)x assuming x is positive. x(87/5) Simplify (o(-9)o)/(o/(o(-1/35)o)) assuming o is positive. o*(-281/35) Simplify (x(x/(xx(-4)/xx)x)/xx)/(x/(xx(2/75))) assuming x is positive. x(452/75) Simplify j(7/2)jjj/(j(j/(j/(j(-9/7)/j))j)/jj) assuming j is positive. j(95/14) Simplify ((b(-1/16)/b)/bb)/(b*19b) assuming b is positive. b*(-337/16) Simplify ((nn/((n/(n/(n/n*(2/7)nn)n))/n)nn)/n)*(-2/9)(n/(n*(-2/5)n))**(4/19	{ "pile_set_name": "DM Mathematics" }
p + f, i + 2 = -4p. Is i a composite number? True Suppose 60 = -p + 6p. Suppose -5l - p = -177. Is l a composite number? True Let g = 24 - 13. Suppose -3j - 4o - 16 = o, o + g = 2j. Suppose jy = -5f + 120, f = 4y + 2f - 143. Is y a composite number? True Let q(o) = 8o*3 - 4o*2 + 6o - 3. Suppose 0 = -2z + 3g - 2g + 9, 0 = -z - 4g. Is q(z) a prime number? False Let k = 6 + -8. Is k - (-6)/3 - -58 a prime number? False Let k be (-2)/9 - 33/(-27). Suppose 2d = 3 + k. Suppose dl = 4 + 126. Is l a composite number? True Let x = 90 + 4. Is x composite? True Let k = -419 + 798. Is k prime? True Let n(l) = l*2 - 5l + 3. Let j(m) = -m*3 - 4m*2 - 3m + 4. Let k be j(-3). Let z be n(k). Is ((-39)/6 - z)-2 a composite number? False Let p = 16 - 10. Suppose pt - 7t + 93 = 0. Is t prime? False Let o(n) be the third derivative of 9n*4/8 - 13n*3/6 - 4n*2. Is o(6) prime? True Let z(y) = 3y + 85 - 2y - 2y + y*2. Let w be z(0). Let r = w + -48. Is r a prime number? True Let j be 6/(-15) + 189/35. Suppose -2m - 344 = -p, -2 = 2m - 4. Suppose -249 - p = -ji. Is i composite? True Suppose 4p + 5w = 4w + 12394, 3w + 6204 = 2p. Is p a prime number? False Let l(c) be the second derivative of -63c5/10 - c3/3 - c*2/2 - 2c. Let s be 3/(-3) - 0/4. Is l(s) a prime number? True Suppose 0n + 6 = 2n. Suppose -h + 1020 = nh. Suppose 2d - h = -3d. Is d composite? True Suppose -3s + 877 = -2v, -s + 5v + 1174 = 3s. Is s a composite number? True Suppose -o + 6o + 25 = 0. Let x(q) = 2q2 - 2q + 6. Let n be x(-6). Is (-2)/(-1) + o + n a prime number? False Let m be (-1)/(0 + 3/(-6)). Suppose 0 = mt - 282 + 56. Is t a composite number? False Let x(a) = -a3 - 3a*2 - 5a - 7. Let l be ((-6)/(-7))/((-1)/7). Is x(l) a composite number? False Let n(o) = -38o + 1. Is n(-2) prime? False Suppose 0 = -k - 4k + 5. Let p(l) = 11l2 + 0l*2 - 3l + l + 27l2 + 1. Is p(k) prime? True Suppose -3c + 5l + 377 = 0, 3c + 0c + 2l - 391 = 0. Suppose 2j + c = 383. Is j composite? False Is (1908/(-8))/(-9)14 a composite number? True Let p = -9 - -30. Let x = -2 + p. Is x a prime number? True Suppose 2k - 280 = -o, 2o = k + 6o - 133. Is k prime? False Let j(t) = -141t - 2. Let i be j(-12). Let q = i + -939. Is q a composite number? False Let o(b) = -3b3 - 2b*2 - 2b. Let t be o(-2). Suppose -5f + 0f - 5x = -t, 0 = 3x + 3. Suppose -15 + 50 = fa. Is a a prime number? True Suppose 0 = -2i - 0g - 2g, 2g + 12 = 2i. Let f(d) = d - 2. Let c be f(4). Suppose 174 = 3v + 3b, -iv - 49 = -4v + cb. Is v composite? True Suppose 3i = 7i + 12. Let z be ((-18)/8)/(i/12). Is (-231)/(-9) + (-6)/z a prime number? False Let d = 77 + 1022. Is d a composite number? True Let u(b) = -b3 + 30. Let z be u(0). Suppose -7 = -3x + 2x. Let g = z - x. Is g prime? True Let m be (-2 - 6) + 2/2. Is -67(m + 3 + 3) prime? True Is 6/((-6)/(-3109)) - 0 a composite number? False Let z = 47 + 70. Is z/612 a prime number? False Suppose -1958 + 673 = -5g. Is g composite? False Let i(m) = m2 - 5m + 22. Is i(12) a prime number? False Let v = -11 - -15. Suppose -23 = -s - vp, -s - 3s = 4p - 92. Suppose 2a + 9 = s. Is a a composite number? False Let g be (-2)/(-5) - (-1864)/40. Let m = g + 30. Is m a composite number? True Let t(r) = -144r - 21. Let o be t(-6). Suppose 5y - o = 172. Is y a prime number? False Let x(o) = -o*3 + 9o*2 + 3o - 12. Let n be x(9). Suppose 2t - 3t = -n. Is t composite? True Let q = 1 - -3. Suppose -4m + 66 = 2g, 4g - 158 = m + qm. Is g a composite number? False Is (-372)/10(-10)/4 prime? False Let l be (-38)/(-14) + (-4)/(-14). Let s be ((-4)/(-12))/((-3)/(-9)). Let y = l - s. Is y prime? True Let x be (-95)/(-1(2 - 1)). Suppose 0 = 5m - 5j, 0 = 2m + 2m + 2j - 12. Is m(x/(-2))/(-5) a composite number? False Is -1 + (-1)/(3/(-1068)) a prime number? False Let m(i) = -i*2 - 3i - 4. Let c(k) = k + 9. Let a be c(-12). Let w be m(a). Let h(x) = -x*3 - 2x*2 - 6x - 3. Is h(w) prime? True Is 381/(-2)6/(-9) a composite number? False Let y(j) = 6j - 3. Let o be (-1)/(-11/3). Is y(o) composite? True Let l(k) = -5 + 2k + 4 + 4k2 - 8k. Is l(-4) prime? False Let h(d) = -d*3 + 7d*2 - 11d + 6. Let j be h(7). Is (-1)/(143/j - -2) a composite number? False Suppose 0 = -20n + 17n + 4443. Is n prime? True Let j(m) = m*3 - 8m*2 + 5m + 4. Let c be j(4). Let x = 34 - c. Suppose k - x = -5n + 28, 274 = 2k - 4n. Is k prime? True Let m = 1620 + -1109. Is m prime? False Suppose 5d - 1140 - 2455 = 0. Is d a prime number? True Let v(y) = -1 - 5y + y3 + y + 4 - 7y*2. Let s be ((-24)/9)/(2/(-6)). Is v(s) a prime number? False Let u be 2 + -2 - (1 - 207). Let k = u + -45. Is k prime? False Is 2/(-3) + (-5537)/(-3) + -6 a composite number? True Let f be (1/2)/(2/(-220)). Let x = 0 - f. Is x composite? True Let r be 10 + -7 + (-18)/(-2). Let n = r - 10. Suppose b + 2s - 3 - n = 0, -5b = -2s - 61. Is b a prime number? True Suppose 94 + 691 = u. Suppose -n - u = -6n. Is n composite? False Let i(l) = -3l + 3. Let x(m) = -4m + 4. Let t(z) = -5i(z) + 4x(z). Let u be t(-6). Is (-318)/(-14) - (-2)/u composite? False Is 19142/5 - (-6 + 135/25) a composite number? True Suppose -4v + 3 = -4h - 1, -4h - 36 = 4v. Let z = h + 7. Is z/(-3)57/(-2) a prime number? True Let a(w) = -w*3 - 5w*2 + 12w - 2. Let g be a(-11). Suppose g = 4u - 4h, -220 = -5u - 2h + 485. Is u prime? False Suppose 4o - 2463 = o. Is o a prime number? True Let y(v) = 3v + 0 - 4v + 2. Let s be y(-6). Let i = 111 - s. Is i a composite number? False Let l(f) = 6f3 - f2 + 2f - 2. Let j be l(1). Suppose 16 = jh - 19. Is h prime? True Let n(h) = h*2 - h - 8. Let k be n(8). Let q = k + -15. Suppose q = -c + 2c. Is c a prime number? False Suppose a - 1 = 4f, -1 = -3a + 3f + 11. Suppose ap - 456 + 131 = 0. Is p prime? False Let b(k) = -k*3 + 3k*2 + 3k + 4. Let v be b(4). Suppose -30 - 4 = -2s - 4m, 4s - 4m - 20 = v. Is s a composite number? True Suppose -2v = -9v + 2779. Is v a composite number? False Let r(f) = 47f - 12. Is r(5) prime? True Let v = -1083 + 1701. Suppose 2s + v = 5s. Is s prime? False Suppose 0 = -3d + 7d - 424. Is d/8 - 1/4 a composite number? False Let a = -9 - -16. Let p be a/2 + (-2)/(-4). Suppose -pd + 0d = -348. Is d a composite number? True Suppose m - 2k - 61 = 2, 3k + 315 = 5m. Suppose -3y - 2z = -43, -8y + 3y + z = -m. Suppose 5r - y = 92. Is r composite? True Let i = 100 - -19. Is i a prime number? False Let i(b) = -b2 + 6b + 4. Let p be i(4). Let t be (p/(-9))/((-2)/3). Suppose z = -tz + 111. Is z composite? False Let m(x) = 14x - 39. Is m(16) a composite number? True Suppose -3c + 5u = -109 - 58, -5u - 39 = -c. Let z = c - 41. Is z a composite number? False Is (-1)/(-2)6/15655 prime? True Let m = 9 - 6. Let w be 50/15 - 1/m. Is -1w/(3/(-37)) a prime number? True Let t be 1 + (112 - (-2 - -1)). Is (0 + t/15)5 a prime number? False Suppose -11y + 1533 = -1184. Is y prime? False Let o be ((-80)/(-25))/(4/30). Suppose -i + 31 = -o. Is i prime? False Let z(d) = d - 1. Let q be z(-2). Is (3/5)/(q/(-15)) a prime number? True Is ((-4146)/(-18))/(-1)(-1 + -20) a prime number? False Let r(f) = 2f*2 - 2f + 7. Is r(-7) prime? False Let s(j) = j*3 - 9j*2 + 17j - 16. Is s(11) a prime number? False Suppose 4p = -a + 1176, 2a - 3a = p - 297. Is p a prime number? True Let c(l) be the third derivative of -3l4/8 + l3/6 + 6l2. Is c(-13) composite? True Suppose 0 = j + 6h - h - 22, 3j - 26 = -5h. Suppose -jl = -3s - 174, 3l - 261 = -0l - 3s. Is l a composite number? True Is -1(-2)/(-6)-201 a prime number? True Let x = -6 - -8. Suppose k + 0k = -x. Is (-67)/(-6)k-3 a composite number? False Let o(m) = -m*3 - 2m*2 + 12. Is o(-7) a prime number? True Suppose 2v = -4n + 20, -4n + 4v = -v - 20. Suppose -3 - 1 = -2y - 4d, -5d + 35 = ny. Let j = 22 - y. Is j prime? False Let r(l) be the second derivative of 13l*3/3 + 7l*2/2 - 6l. Is r(4) prime? False Suppose -m + 13056 = 4p, -4m = -8 - 8. Is p composite? True Let v(a) = 6a3 + 4a*2 + a - 10. Is v(3) composite? False Let r be (-565 - 0)(-30)/50. Suppose -	{ "pile_set_name": "DM Mathematics" }
)/3 - ((-17845)/903 - -20)? -4/7 (0 - (-4 + 6))(-3 - (-135)/42) -3/7 Evaluate -16 - (15/(-3) + (-260)/(-26) + -8). -13 Calculate (17 - (-3700)/(-160)) + (-36)/(-6). -1/8 Evaluate (-184)/138 - (-6 + (-1400)/(-147)). -34/7 ((-1384)/156 + 9)/(6(-30)/(-648)) 6/13 (24/(-16))/(12/16 + -1) 2 Evaluate (-41)/200 + 596/7450. -1/8 Evaluate 240/(-90)42/28. -4 Evaluate (-5)/(5/(-3)) + ((-2030)/(-28))/(-29). 1/2 (408/170)/((-2)/(-10)) 12 What is the value of (-2397)/(-102) - (-1 - 1/(-2))? 24 ((260/(-30))/2)/(-13) 1/3 Calculate ((-8)/(-44))/(23/759) - -3. 9 Calculate (-3 - (15/(-30))/((-15)/155)) + 9. 5/6 (-18)/75 - (-14036)/(-1100) -13 What is the value of -16 - (5 - 2270/110)? -4/11 (15 - -1 - 8) + 853/(-33) 3/11 Evaluate 5 + ((-56)/(-18) - (-79 + 88)). -8/9 Calculate -28 - 3625/(-100) - 8. 1/4 What is the value of (1388/(-50315))/(-16/15)? 2/29 What is the value of 28/(-7) + -1 - 111/(-24)? -3/8 What is the value of 1407/462 - (-4)/(-88)? 3 What is 4570/(-2625) - ((-8640)/168)/30? -2/75 Evaluate 1379/28959 - 9/(-7). 4/3 Evaluate ((-513)/8892)/((-16)/52). 3/16 What is (-105)/(-35) - (3/(-39) + 3150/(-117))? 30 What is the value of (43 - 49) + (75/18 - (1 + -3))? 1/6 What is 13/(-3) - ((-418)/(-57))/(-22)? -4 What is the value of 15/10 + -1(-17)/(-10)? -1/5 (9/(-108)-12)/((-700)/65 - -11) 13/3 Evaluate (26/(19 - 6))/(-1 + -101). -1/51 Calculate ((-1080)/126)/(75/210). -24 Evaluate (0 + -1 - (-52)/12)3/(-7). -10/7 Calculate -15(50/(-15) + 4). -10 What is 18 - (-21)/(-2)(644/(-42))/(-23)? 11 Calculate 4/(-9)7/(-24)18. 7/3 Calculate (4 - (1 - 4)) + (-97)/13. -6/13 Evaluate ((-22)/(-2))/((6 - 12)/2 + 2). -11 What is 42/(-15)((-44)/(-10) - (-21)/35)? -14 What is (-1443)/(-39) + 1/((-6)/108)? 19 Calculate (4 - (-138)/(-33)) + (-3168)/(-121) + -9. 17 What is the value of (-2 - (5/(-1) + 4))(-48 + 62)? -14 Evaluate (-258)/(-4)(-18)/972 + (-23)/(-276). -10/9 24/858 + 21/((-2730)/(-20)) 2/11 Evaluate ((-5013)/945 - 6/63)(-42 + 37). 27 What is the value of (-65)/78 + (-59)/(-6)? 9 Calculate (12 + -15)-13/(-42). -3/14 (-1)/((-12)/(-16))114/76 -2 Calculate 8/((-36)/(-36)-2). -4 Evaluate ((-4)/(-6))/((-82)/9225-275). 3/11 Calculate ((-12)/378)/((-2587)/234 + 11). 4/7 (-19)/((-1330)/(-40))(-1 + -13) 8 Calculate ((-16)/6)/(-11 - (-186)/18). 4 What is 318/(-22) - (-2955)/197? 6/11 What is ((-6)/(-8) - -1)/(42/8 + -6)? -7/3 Evaluate 810/1512 + 0 + 1/(-4). 2/7 (1/(-3))/(9/243)2/(-21) 6/7 Evaluate 23 + -16 + 23/((-552)/160). 1/3 What is 650/(-100)24/(-13)? 12 What is (16 - (-1 + 21))/((-3)/(-2) - 2)? 8 What is ((-400)/(-88) + -4)/(-5(-3)/165)? 6 20/15 + 75/(-90) 1/2 Calculate ((-275)/(-91) + -3)385/220. 1/26 Calculate -66 - (-1034)/22 - -1. -18 Calculate (65 - 77 - (-126)/(-30))/((-6)/10). 27 What is (-4945)/(-215) - (-1744)/(-76)? 1/19 What is the value of (((-1)/4)/((-65)/4))/(5/25)? 1/13 Evaluate 7/(-42) + 233/198. 2/11 What is the value of (-2513)/71812/(-14)? 3 What is (216/5796)/((-1)/(-13)) + 20/(-35)? -2/23 (10 + 0)(352 + -351) 10 104/(-260) + (-1)/(-5) -1/5 What is the value of 4((-9 - (-153)/18) + -5)? -22 -9 + ((-4784)/(-276))/((-4)/(-3)) 4 What is the value of 3 - 5 - -10(-9)/45? -4 Evaluate (-102)/45 - (-4 - 68/(-20)). -5/3 Evaluate 2/1564432 + (-174)/1131. 22 What is the value of (1 + -4)(2670/2268 + (-14)/12)? -2/63 Calculate (-2)/(((-11)/22)/(-1)). -4 What is 1715/294 + (-2)/(-3)-9? -1/6 What is the value of (-392)/(-126)(-21 - (-996)/48)? -7/9 (-184)/(-24) - 15 - -6 -4/3 Evaluate (-34 - (-7938)/231)1/(-8). -1/22 Evaluate (10/105)/(76/(-114)). -1/7 -3 + -6 - -4(-5 - 24/(-6)) -13 What is the value of 854 - 876 - (-1 + 8)? -29 Evaluate 1519/196 + (-6)/(-24). 8 What is 20/320-52 + (-1000)/(-288)? 2/9 Calculate 276/(-6762) - (-4)/196-243. -5 Evaluate (-5)/(-2)((-165)/440 + (-132)/160). -3 76/22 + 162/297 - (2 - -13) -11 What is the value of (-6 - (3 + -13)) + 1800/(-912) + -2? 1/38 (18 - 3) + 4032/(-406) + -5 2/29 What is the value of (2340/(-5))/36 - 54/(-4)? 1/2 Evaluate (1610/1127)/((-5)/21). -6 What is the value of (10/(-4))/(553/158)-7? 5 255/(-1360)(-2)/6 1/16 Evaluate (-2)/(-29) + 16832/(-1856). -9 Calculate (-393)/524 - 61/(-28). 10/7 What is the value of ((-66)/(-9))/(-7(549/189 + -3))? 11 Calculate 52/(-4) - -3 - (-260)/(-52). -15 1 - (-9 + (-207)/(-72)4) -3/2 (473 - 458)(-4)/3 -20 What is the value of (-12 + (-1575)/(-132))/((-18)/72)? 3/11 What is -1 + 3 + -20 + (-198)/(-11) + -12? -12 What is (-3 - (-156)/22) + 3/(-1)? 12/11 Evaluate (-15 - (-399)/28) + (-35)/(-20). 1 What is 7((-42)/355)/(-9 - 5)? 3 What is the value of ((-144)/(-99))/(-8) + 976/44? 22 (10/45)/(-2 - 200/(-45)) 1/11 (-5)/(-150)-1 - (63/(-7))/27 3/10 520/(-104) - (-1)/(-3)-11 -4/3 Calculate (-1013/(-520))/1. 1/4 Calculate 2(35/50 - 1). -3/5 Calculate 12/20-12030/(-174). 7 (-10)/8 + (1/(-12))/((-305)/(-2745)) -2 What is the value of ((-16)/60)/(3120/(-1150) + (-14)/161)? 2/21 Calculate -3 - -6(-903)/(-1890). -2/15 What is (-1)/6-58 - ((-11)/(-1) - 5)? 11/3 (-500)/7002/(-15) 2/21 (-17)/3 + (-6)/(-9) + (-85)/(-20) -3/4 Calculate (-2)/5215/(-36). 1/3 What is the value of (-4)/74 - (-112216)/(-6253)? -18 (-16 - 867/(-34)) + (-2)/4 9 Calculate (605/(-1331))/(15/(-18)). 6/11 (-1)/278/(-117)-66 + -9 -31 (-103)/154 + 669/1932 -5/11 Evaluate (2/(-20) + 158/(-395))36. -18 (-83 + 17017/182)(-1 - (-1)/(-3)) -14 What is (17200/1280 - 28) + 5/2? -1/16 What is ((-3)/9)/((-237)/(-632) + (-242)/432)? 9/5 What is the value of (28/(-8) - -4)4/13? 2/13 Calculate 126/(-9) + (-78)/(-180)33. 3/10 Evaluate (105/(-70))/((-3)/(-10)). -5 (-820)/504 - (-101)/1818 -11/7 Calculate 204/85(-120)/(-18). 16 What is (3/(-6))/((-24)/(-192)) + (-90)/(-22)? 1/11 Calculate ((-6 + 2)/2 - 3) + 23/5. -2/5 What is 3/(-2) + (-771)/(-514)? 0 What is the value of (-452)/330 + 0 + 28/21? -2/55 What is (-28)/636/16 - (-136)/10608? -2/13 (-4)/11 + 28160/(-7744) -4 Evaluate (-1 + 0)((-6634)/535 + (-24)/(-10)). 10 Evaluate 12/(-360)-10 - ((-580)/(-345))/4. -2/23 What is the value of 0 + -1 + -18 - (-7 - 1)? -11 Evaluate (-1)/(((-1353)/(-627))/41). -19 What is (0 - 1/(-4)) + 2535/(-6760)? -1/8 Calculate 3 + 24/4 + (-702)/72. -3/4 (0 - 1)((-55)/30)/((-13)/(-78)) 11 Calculate (-106)/(-20) + 1 + ((-360)/10)/6. 3/10 Calculate (29-3)/((-41 - 37)/26). 29 Evaluate (-770)/(-462)(82/140 - (-4)/(-8)). 1/7 Evaluate 22 + 9 + -15 + 13. 29 What is the value of 13 - 407/22 - (-27)/(-6)? -10 Calculate (232/60 + (-8)/(-60))1. 4 What is the value of ((-36)/(-90))/((-35)/(-875))? 10 Evaluate ((-378)/(-84) - 7)(-1 - 14/(-10)). -1 Calculate -72 + 6478/474. -1/3 What is (-18)/380 + 136/1360? 1/19 What is (-2 + 74)19/684-12? -24 What is the value of ((-44)/13)/((-8299)/(-559) + -15)? 22 Calculate (2 - (-81)/(-36))/(391/204). -3/23 Calculate 4(-531)/306 - (-2 - -30)/(-4). 1/17 What is 2/(4/7)((44 - 55) + 7)? -14 Calculate (-16)/12 + (-1400)/120. -13 What is ((-3)/(-4)-1)/((-20)/(30400/114))? 10 What is (-11 - -7)(200/(-96) - (-1)/3)? 7 (-915)/65 - (-20)/260 -14 What is the value of (188/(-8) - -26)(-16)/6? -20/3 What is 15(-15)/(-180)(-1 + 4 + 1)? 5 ((-624)/64)/(108/(-288)) 26 Evaluate 42/(-189) + 3136/(-144). -22 What is (18792/(-1740))/((-9)/(-15))? -18 13 + (-1098 + 6)/39 -15 Evaluate ((-34)/1870)/(14/(-140)). 2/11 What is the value of ((-468)/(-18) - -13)/((-3)/(-2)-2)? -13 1(-3)/(-6)(86 + -104) -9 Calculate (-7)/(-2) + (45954/(-12))/(-111). 38 What is the value of (4/(-14) + (-3)/63)/((-68)/(-72))? -6/17 Calculate 195/(-260) + (-38)/(-8) + 5/(-1). -1 Evaluate (3 + -25)/(-334 - -332). 11 Evaluate (-32)/(-55) + 690/(-3795). 2/5 -1 + ((-70)/90)/(-1) -2/9 What is the value of (28/(-3))/(-5((-18)/135 - 0))? -14 Evaluate (108/486)/((-26)/(-18)). 2/13 Calculate 61/30 - 1 - 511/(-438). 11/5 135/(-112) + 1/(176/11) -8/7 What is (135/90 + -71/6)0? 0 (-220)/22 - 114/(36/(-6)) 9 14(-7)/152 - (4 + 1776/(-456)) -3/4 Evaluate (98/210)/(1 - 8/6). -7/5 16/9(-5886)/654 -16 33/(-22) + 406/308 -2/11 Evaluate ((-3192)/190)/(52/65). -21 (-3)/((-270)/1068) + -12 -2/15 Calculate (113/6 - 1) + -18. -1/6 What is (17 - (-22 + 35))/68? 1/17 Evaluate (-8 + 10)((-56)/(-192))/((-4)/16). -7/3 What is the value of 9 - ((-548114)/(-1292))/47? -1/38 What is the value of 3/35188/(-141)(-5)/	{ "pile_set_name": "DM Mathematics" }
6w2 Let r(p) be the second derivative of p4/6 + p3/3 + p2/2 + 2625p + 2. Let j(q) = 1. Calculate -2j(b) - r(b). -2b*2 - 2b - 3 Let g(a) = 14a - 5. Let b = 89 + 34. Let u(n) = n - 68 + b - 56. What is -g(t) + 5u(t)? -9t Let o = 7 - 15. Let x be ((-15)/20)/((-1)/82). Let n(b) = 5b - 1. Let t(k) = -2k - 6k + 22k - 2 + 0k. Give on(u) + xt(u). 2u + 2 Let q(g) = 9g3 + 12g*2 + 5g - 324. Let m(h) = -2h3 - 3h*2 - h + 2. Give -5m(a) - q(a). a*3 + 3a*2 + 314 Let h(d) = 74d*2 - 287d - 35. Let b(a) = -23a2 + 96a + 11. Calculate 19b(q) + 6h(q). 7q2 + 102q - 1 Let k(m) = 77m - 4. Let r(c) = 64c - 6. Let j(q) = -2k(q) + 3r(q). Let b(h) = -15h + 4. Determine -12b(u) - 5j(u). -10u + 2 Let n(h) = -6h - 6. Let i(r) be the third derivative of -7r*4/24 - 5r*3/6 - 4r*2 + r + 496. Calculate -4i(u) + 5n(u). -2u - 10 Let f = 4 + -3. Let z(l) be the second derivative of l4/12 + l2/2 + 8l - 39. Let k(t) = -7t*2 + 3t - 4. What is fk(c) + 5z(c)? -2c2 + 3c + 1 Let u(l) be the first derivative of l*4/4 + 4l - 3991. Let i(s) = 4s3 - s2 + 21. Let g = -4 - -6. What is gi(c) - 11u(c)? -3c*3 - 2c*2 - 2 Let a(t) = 2t*3 - 357t*2 - 2. Let f(y) = -4y*3 + 14y*2 + y + 1. Give -a(v) - 2f(v). 6v3 + 329v*2 - 2v Let n(p) = -p - 2p + 2p + 565p2 - 296p*2 + 1 - 270p*2. Let c(k) = -4k*3 - 3k*2 - 3k - 8. What is -c(w) + 3n(w)? 4w*3 + 11 Let z(i) = -6i*3 + 9i*2 + i. Let u(b) = -24b*3 + 37b*2 + 5b + 3. What is -2u(w) + 9z(w)? -6w3 + 7w*2 - w - 6 Let y(k) = -2k*3 + 135k*2 + 5k + 21. Let z(s) = 5s3 - 406s*2 - 14s - 58. Calculate 11y(v) + 4z(v). -2v3 - 139v*2 - v - 1 Let k(g) = -240g*2 - 2g - 13. Let z(f) = -120f2 - f - 7. Calculate 5k(d) - 9z(d). -120d*2 - d - 2 Let r(b) = -1553b*2 - 4b + 10. Let f(v) = -35720v2 - 94v + 235. Calculate 4f(x) - 94r(x). 3102x2 Let u(l) = -31l*2 + 5. Let a(c) = -1147c*2 + 186. Suppose 5o + 4k - 930 = 0, -372 = -2o + 131k - 136k. Determine ou(f) - 5a(f). -31f2 Let p(m) = m2 + 5m + 5. Suppose 0 = -2v - v - 4z - 7, -2z = -4. Let d(g) = -181g*2 + 4g + 14g2 + 167g2 + g2 + 4. What is vd(h) + 4p(h)? -h*2 Suppose 0 = -32u + 35u - 33. Let q(v) be the first derivative of 2v*2 - 4v - 1343. Let y(j) = j*2 + 11j - 11. Determine uq(s) - 4y(s). -4s2 Let q(k) = -k3 - k2 - k. Let t(a) = 6a*3 + 9a*2 + 4a. Let b be 5 + -17 + 5 + 11. Determine bq(j) + t(j). 2j*3 + 5j*2 Let z(p) = 17p*2 + 85p + 5. Let h be z(-5). Let f(g) be the third derivative of 17g6/120 - 5g*2. Let o(c) = 162c*3. Give ho(i) - 48f(i). -6i*3 Let y(l) = 7l - 1. Let n(g) be the second derivative of g*3/2 + 26g - 10. Let w be ((-1)/(-2))/(1/(-4)). Let p = w + -3. What is pn(v) + 2y(v)? -v - 2 Suppose 7 + 1 = w. Let s(q) = 4q + 2. Let a(j) = j + 13. Let r(n) = 36n + 45n - 11 - 83n. Let u(b) = 4a(b) + 5r(b). What is ws(k) + 5u(k)? 2k + 1 Let y(t) = -78t - 4. Let c(a) = -5a + 1. What is c(f) - y(f)? 73f + 5 Let i be (-21(-16)/(-48))/7. Let t(y) = -y3 - y2 + 1. Let q(m) = 2m*3 + 6m*2 + m - 4. Determine iq(c) - 6t(c). 4c*3 - c - 2 Let v(s) = -5381s*3 + 12s*2 - 6. Let z(r) = -82221678r*3 + 183362r*2 - 91681. What is 91681v(q) - 6z(q)? -5393q*3 Let a(t) = 34 + 30 - 131 + 37 + 31. Let q(h) = 25h*2 - 3. Give -3a(s) - q(s). -25s2 Let p(f) = -11f*3 + 7f*2 + 23f + 24. Let v(d) = 12d3 - 6d*2 - 21d - 20. Give 5p(x) + 6v(x). 17x3 - x2 - 11x Let r(p) = -2p2 - 84p + 570. Let o be r(-48). Let f(k) = 24k + 7. Let a(z) = 25z + 8. Give of(c) + 5a(c). -19c - 2 Let c(t) = -5t*3 + 4t*2 + 3t - 16. Let h(w) = -w3 + w2 + 2w - 5. Determine c(s) - 2h(s). -3s3 + 2s*2 - s - 6 Let w(m) = 106m*2. Let b(d) = -91d*2 - 10d - 10. Let f(l) = -5777l2 - 636l - 636. Let i(t) = -318b(t) + 5f(t). Give 5i(o) - 2w(o). 53o2 Let a(v) = -80v - 4340. Let n(c) = 11c + 620. Calculate -2a(p) - 15n(p). -5p - 620 Let s(h) = -6h3 - 12h2. Let n = -1198 - -1322. Let j = 184 + -121. Let c(q) = -q3 + n - q*2 - 61 - j. What is -12c(b) + s(b)? 6b3 Let q(y) = y3 - 2y2 + 2. Let j(d) = -d3 - 2d2 - d. Let v(l) = 12l*3 + 17l*2 + 10l + 3. Let t(r) = 10j(r) + v(r). Give 10q(s) - 6t(s). -2s*3 - 2s*2 + 2 Let l(w) = -11w*2 + 5w - 7. Let p = -11 + 11. Suppose -2u - 6 + 20 = p. Suppose -25 = -2x + ux. Let t(h) = -5h*2 + 2h - 3. What is xt(s) + 2l(s)? 3s2 + 1 Let k(g) = -20g + 39. Let u(i) = -11i + 27. Calculate -2k(o) + 5u(o). -15o + 57 Let l(x) be the first derivative of x4/2 - x3 - 3x2 - 1392. Let n(d) = -2d*3 + 2d*2 + 6d. Calculate 2l(m) + 3n(m). -2m3 + 6m Let o(u) = 23u - 14. Let s(g) = 2g*2 - 4g + 0 + 4g2 + 1 - 4g*2. Let m be s(4). Let k(n) = 8n - 5. What is mk(y) - 6o(y)? -2y - 1 Let f(m) = -215m*3 + 18m*2 + 8m + 7. Let q(b) = 2b3 - 3b*2 - 1. Determine f(r) + 6q(r). -203r3 + 8r + 1 Let b(m) = m. Let t(k) be the second derivative of -2k3/3 - k. Let r be -1 - -14 - (2 - (6 + 1)). Let j = r + -10. What is jb(h) + t(h)? 4h Let y(b) = 5b*2 + 3b - 1. Let u(v) = -14v2 - 10v + 4. Suppose -16g + 17g - 3w = -13, 5w = g + 23. Calculate gu(n) + 7y(n). 7n2 + n + 1 Let v(n) = -25n - 1. Let c(f) be the second derivative of -25f3/3 - f2 - 66f + 7. Give 2c(p) - 5v(p). 25p + 1 Let j(a) = -53a + 5. Let u = -9457 + 9452. Let m(c) = 54c - 6. Calculate um(f) - 6j(f). 48f Let o(z) = -2z - 4. Let q(k) be the second derivative of k2/2 + 865k. Calculate -o(y) - 2q(y). 2y + 2 Let o(v) = -45v - 34. Let i(s) = -3s - 3. What is 4i(x) + o(x)? -57x - 46 Let y(r) = 10r3 + 117r*2 - 8r + 14. Let f(b) = b*3 - 2b*2 - b + 1. Determine 11f(h) - y(h). h*3 - 139h*2 - 3h - 3 Let z(w) = 3w3 + 11w*2 - 5w - 10. Let l(y) = -y*3 - 5y*2 + 3y + 4. Determine -5l(h) - 2z(h). -h*3 + 3h*2 - 5h Let b(x) = -41x2 - 3x + 5. Let c(n) = -3n2 + 1. Let k(d) = -3b(d) + 24c(d). Let a(i) = -25i*2 - 5i - 5. Give -9a(p) - 5k(p). -30p2 Let o(b) = 5690b*2 - 40b + 7. Let p(y) = -2845y2 + 16y - 3. What is 2o(t) + 5p(t)? -2845t2 - 1 Let m(f) = 2. Let l(s) = -s + 1. Let p(q) = 5q + 22. Let t be p(-12). Let k = 49 + t. Suppose -o - 3x - 6 + k = 0, 2o + 3x = 4. Give om(b) + l(b). -b - 1 Suppose -w = n, 0w - 6 = 5n - w. Let q(k) = 3k3 + 3k + 6. Let x(b) = b*3 + 1. Let y(d) = 2d*3 - 2d*2 + 4d - 10. Let t be y(2). Give nq(z) + tx(z). 3z3 - 3z Let g(y) = -y*2 + 5y - 1. Let w(o) = 698o2 + 25o - 5. Determine 5g(i) - w(i). -703i*2 Let u(r) = -24r*2 - 9r + 4. Let h(l) = -12l2 - 4l + 2. Suppose -256 + 334 = 26f. Give fu(k) - 7h(k). 12k*2 + k - 2 Let r(s) = -110s + 727. Let l(t) = -238t + 1453. Calculate -6l(d) + 13r(d). -2d + 733 Let q(d) = d2 - d - 3. Let g(j) = j2 - j. Let v(s) = 1 - 228s + 231s + 6. Let o be v(0). Suppose a = -oa - 8. What is aq(h) + 3g(h)? 2h*2 - 2h + 3 Let v(b) = 631b + 21. Let c(o) = -3o - 4. Calculate -3c(l) - v(l). -622l - 9 Let l = 5635 - -4469. Let w(t) = 10098t + 9 + 1 - lt. Let x(c) = c. Let z(b) = -2b - 3. Let m(d) = -4x(d) - z(d). Calculate -7m(o) + 2w(o). 2o - 1 Let g(q) be the first derivative of -3q*4 - 2q*3 + 3q*2/2 - 6q + 3551. Let a(s) = 13s3 + 7s*2 - 3s + 7. What is -6a(d) - 7g(d)? 6d3 - 3d Let j(d) = 26d2 + 20d + 5. Let c(a) = 2a + 2. What is -3c(z) + j(z)? 26z2 + 14z - 1 Let v(y) = 13y3 + 8y*2 + 3. Let p(l) = -12l*3 - 6l*2 - 2. Calculate -4p(o) - 3v(o). 9o*3 - 1 Let q(k) = 9k + 4. Let t(n) = -136n - 53. Let p(w) = 2155w + 840. Let u(r) = -6p(r) - 95t(r). Give 3q(m) + 2u(m). 7m + 2 Let k(w) = w - 9. Let o(s) = -144s + 99. Calculate -7k(z) - o(z). 137z - 36 Let r(s) = 1. Suppose 2821 = -5t + 2761. Let v(x) = 48x - 12. Determine tr(k) - v(k). -48k Let q(d) = -d*2. Suppose -13a + 8a - t = 5, 0 = -a - 3t - 1. Let u(j) = 6j2 - 2j + 3. Give au(k) - 4q(k). -2k2 + 2k - 3 Let r(b) = 34b - 2. Let s(m) = -170m + 11. Determine -12r(v) - 3s(v). 102v - 9 Suppose 0 = 5k - 15, 2q - 642k + 639*k + 7 = 0. Let b(t) = 1. Let g(n)	{ "pile_set_name": "DM Mathematics" }
implify ((g/(gg(-1/3)g)g)(-11)/(g1/(gg6)))20 assuming g is positive. g(140/3) Simplify (k(-38)k(5/6))(-2/155) assuming k is positive. k(223/465) Simplify ((n(2/5)n)/n)*24(n(-1)/n)/n(-2/7) assuming n is positive. n(276/35) Simplify (t(2/9))12/(t6)(-18) assuming t is positive. t(332/3) Simplify (f/f*(-4/13))/ff((f/f(-2/9))/fff)/ff*7(fff*13fff)/f assuming f is positive. f(3104/117) Simplify (f(-1/16)f)41f*(2/19)ff(6/17) assuming f is positive. f(206181/5168) Simplify (((oo*(-6/11)oo)/((o(-3/7)/o)/o))/(o/(o/(oo*5))oo(-2)))(13/2) assuming o is positive. o(-117/154) Simplify (((b(-1))(-16))(-1/12))(-17) assuming b is positive. b(68/3) Simplify (((fff/(f(fff/f*(-10/7)ff)/f))/(f/(ff(-5))))(3/11))43 assuming f is positive. f(-7611/77) Simplify (q*(11/2)q(-16))/(q/q(-7))3 assuming q is positive. q(-69/2) Simplify (g/g*(-28)g*3)/(gg*(2/29)/gg/(g*(-29)g)) assuming g is positive. g(85/29) Simplify (n(4/9)/n)*(-5)(n/n(-1/7))(1/10) assuming n is positive. n*(911/315) Simplify ((a/(a/(aa/a*(1/11)a)))/a(-11))/((a(-19)/a)/(a/a(-8/9))) assuming a is positive. a(3544/99) Simplify (i*27i/(((((i/(i(ii*18)/i))/i)/i)/i)/ii))(-8/15) assuming i is positive. i(-392/15) Simplify (p*28p(p/p(-26))/p)(1/39) assuming p is positive. p(55/39) Simplify ((y1/yy)/y)/(y(yy/y*(-5))/yy)((yy/(y/y(1/7)))/y)(2/9) assuming y is positive. y(-502/63) Simplify ((v(-11)v)(-47))(-21) assuming v is positive. v(-9870) Simplify ((z15z)/zz)29z*(-3/5)z/((zz(10/3)z)/z) assuming z is positive. z(6901/15) Simplify ((x/(x13x))/((x(1/7)x)/x))/((x/x(-2/15))/x(-3/13)) assuming x is positive. x(-19802/1365) Simplify (y20y9)/(y(-26)/yy(1/5)) assuming y is positive. y(279/5) Simplify ((r(-2/7))(-3/14))(-10/7) assuming r is positive. r(-30/343) Simplify k(-16)/k(-1/5)k12/(k(2/9)/k) assuming k is positive. k(-136/45) Simplify ((l/((llll/((l*(-2)/l)/l))/l)l)*(2/65)/((l/(ll/(ll7/l)))/(l3/l)))6 assuming l is positive. l(-324/13) Simplify (yy*(-2/29)y)*9y(-1/17)/(y/y(-2/33)) assuming y is positive. y*(264532/16269) Simplify ((z/(zzzz(zz*6)/zz))/z)/(zz(-19))((zz(-4/5)z)/z)/(zz(-12/7)) assuming z is positive. z(277/35) Simplify d(-4/19)/(d/(dd*(1/4)))(d/d(-3/5))/(d(1/30)/d) assuming d is positive. d(2971/1140) Simplify (x(-12))*32/((xxx(-7/5)x)/x)34 assuming x is positive. x(-2022/5) Simplify ((((t/t*(-1/9)t)/t)(1/21))(4/7))(-28) assuming t is positive. t(-160/189) Simplify ((c/(c*(-2/7)c))*(-37)(cc/(cc(-2/5)/c))(-6))(-2/9) assuming c is positive. c(1748/315) Simplify (v(-1/2))(1/13)(v(-2/13)/v)/(v/(v(2/15)v)) assuming v is positive. v*(-413/390) Simplify ((w/((ww(-6))/w))/w(-1/5)(ww(-5/2))/(w/(w(9/5)w)w))(2/3) assuming w is positive. w(13/3) Simplify b*10((b*(2/59)/bb)/bb)/b(b0)(-40) assuming b is positive. b(533/59) Simplify (g(2/11)gg*(-22))/((g(gg(-1/22))/g)/g(-8/9)) assuming g is positive. g(-4487/198) Simplify (u(-30)/u22)/(uu*(-24)uu(21/8)) assuming u is positive. u(-261/8) Simplify (h(-3/7))(-12/17)/(h7((h*(1/2)/h)/hh)/h) assuming h is positive. h(-1237/238) Simplify x(-13)x(-21)(xxxx/(x(-4)/x)x)/(xx/x(-3/7)x) assuming x is positive. x(-192/7) Simplify (i(8/5)/i(2/7))/(i(-18/5)/ii)(-6/11) assuming i is positive. i(-50/77) Simplify ((b/b(1/4))(1/5)(bb/b(1/7))/(b/(bb/b2)))(3/19) assuming b is positive. b(423/2660) Simplify (p9/(p*(-2/3)ppp))/(p(-1/51)/p)(1/3) assuming p is positive. p*(1072/153) Simplify ((g/((g(g/g*(2/9))/g)/g))/(gggg(g/g18)/g))/((g(g(-4)/g)/g)/g(-1/14)) assuming g is positive. g*(2539/126) Simplify (ww*(-22)www((www(-5/9)/www)/w)/ww)/((w/w*9)/ww(4/11)/w) assuming w is positive. w(-685/99) Simplify o*(-12)o*(-8)(((o/(o*4/o))/o)/o)/(ooo/((oo*(-10/9)oo)/o)) assuming o is positive. o(-235/9) Simplify ((t/(t(t/(t/t(-6)))/t))/t(-6)((t6t)/t)/(t(-6)/t))19 assuming t is positive. t*494 Simplify nn/(n*(-3/4)/n)n*(-10)n(n/((n/n8)/n)n)/n(-5/2) assuming n is positive. n(29/4) Simplify (((cc7/c)/c6)/(ccc1c)(19/4))(5/19) assuming c is positive. c*(-90/19) Simplify (b/((bb*9b)/b)b14)/(b(-11))(1/25) assuming b is positive. b(136/25) Simplify (c(-3/2)/c)(-22)/(cccc*3c)(4/11) assuming c is positive. c(577/11) Simplify (((b/b*9b)/b)/b)(2/29)/(b(-2))41 assuming b is positive. b(2360/29) Simplify ((r*(-11)/rr)/(r*(6/7)r))/(rrrr/r(-5)rrr(-4/5)) assuming r is positive. r(-807/35) Simplify (v(-1/3))(-29)(v/(v/v1))/v(-1) assuming v is positive. v(35/3) Simplify (((p/p0p)/(pp(-3/2)))/(p/(pp/(pppp/((((((p/p(2/15))/p)/p)/pp)/p)/p)pppp)p)pp(-11)))(2/21) assuming p is positive. p(101/315) Simplify (k(k/(kk(2/7)))/kk)/(kkk*(-11)kk)(k(kk*1kk)/k)26 assuming k is positive. k(782/7) Simplify ((k9kkk*4k)/((k/k(-2))/k(-8)))(33/5) assuming k is positive. k33 Simplify ((k/k4)/k(4/7))/((k/(k/((kk(-9))/k)))/k(-10)) assuming k is positive. k(-32/7) Simplify z/((z17/z)/z)z*(2/13)zz(zz(-1/3))(-1) assuming z is positive. z(-488/39) Simplify (g/(gg/(g/(g*3g)))g)5(gg/(g/g(-7)))/(g(-9)g) assuming g is positive. g(-13) Simplify (a14a6)/(((a(2/3)aa)/a)/((a/a(-1/13))/a)) assuming a is positive. a(718/39) Simplify (((jj7)/j(-7))(2/111))40 assuming j is positive. j(400/37) Simplify t(-15)/tt4t*(-3/4)/(tt(-4/5)) assuming t is positive. t(-259/20) Simplify aa(aa/((a/(a/(a/(aa*(-7/2)))))/a))/aaaaa/(aa*19)a*(-24)/(aa/((aa(4/11))/a)) assuming a is positive. a(-905/22) Simplify (a/a0aa)4aa5/a(aa(-2/43)a)/aa assuming a is positive. a(815/43) Simplify (y0y(-21)/y)/(y(7/6)yy(4/5)) assuming y is positive. y(-749/30) Simplify ((ppp*(-1/2)p)/pp)(3/14)/(p(-5/3))(-2/9) assuming p is positive. p(125/756) Simplify (vvv(-4)v(vv/(vv/v2)v)/v(vv*(1/6)vv)/(vv(-2/3)))(16/3) assuming v is positive. v(184/9) Simplify ((l4l)/llllll8)(-2) assuming l is positive. l(-32) Simplify (p(-6/7))*(-2/79)p*(-33)p(-9) assuming p is positive. p(-23214/553) Simplify ((x(-2/11))31(xx/(x/(x(xx/x2)/x)))5)(-7) assuming x is positive. x(49/11) Simplify ((y(y(y*(2/5)/y)/yyyyy)/y)31yy2y/(yyy*(-2)y)y)40 assuming y is positive. y4376 Simplify (((((z(-2)z)/z)/z)(-9))30)(-26) assuming z is positive. z(-21060) Simplify (u*(4/7)(u/(uu(-6/7)))/uu)/(uu/((u/(u(-1)/u))/u)u(-4/5)/u) assuming u is positive. u(113/35) Simplify (u(2/73))(-3)u(-2/19)/u(-1) assuming u is positive. u(1127/1387) Simplify (f/(ff*(-3/16)f))/f*(-25)f*(-8)f(-5/6) assuming f is positive. f(737/48) Simplify (g*3gg/g13)/(ggg(-9)/ggg/g(1/3)) assuming g is positive. g(-5/3) Simplify ((nn*14/n)/nn(-19))/(n/(n(-1/9)/n))34 assuming n is positive. n(-700/9) Simplify ((oo/o1)/(oo*(-1/20)oo))(10/9) assuming o is positive. o(-13/6) Simplify (((k(-1/4)/k)/k(-1/4))9)(-2/57) assuming k is positive. k(6/19) Simplify v(-6)v*(1/45)/v((vv(-1/3))/v)(5/11) assuming v is positive. v(-3529/495) Simplify (t/t(-1/10)tttt)(-27)/(t/t16(t/t(5/6))/t) assuming t is positive. t(-1828/15) Simplify ((k*(1/4)(k(k/(k/(k/((k/k0)/k)))k)/k)/k)40)(-35) assuming k is positive. k(-1750) Simplify ((l(-2)l7)/(ll*(-9)l5))(-24) assuming l is positive. l(-192) Simplify ((o(-2/5))*(1/22)/(oo(1/2))(10/9))(-15/8) assuming o is positive. o(139/44) Simplify (p(-13))(-10)(p(-1)/p)(-1/39) assuming p is positive. p(5072/39) Simplify (r(-2/47)/(r/r(1/4)))45 assuming r is positive. r(-6705/188) Simplify ((o(-1/2))(-2/61)/(o(-3))(-4/17))(2/35) assuming o is positive. o*(-286/7259) Simplif	{ "pile_set_name": "DM Mathematics" }
j - 1)*3(9j - 2) Determine o, given that 10/9o*3 + 44/3o*2 + 16/9 - 50/9o*4 + 88/9o = 0. -1, -2/5, 2 Factor -5/2z3 + 0 + 0z + 0z2 - 15/2z*4. -5z*3(3z + 1)/2 Let d(m) be the second derivative of 1/2m*2 - m + 1/12m*4 - 1/3m3 + 0. Let d(x) = 0. Calculate x. 1 Let g(a) be the third derivative of -a7/8820 + a6/840 - a5/210 - a*4/8 + 4a*2. Let m(s) be the second derivative of g(s). Factor m(o). -2(o - 2)(o - 1)/7 Factor 0m*4 + 3/5m*3 + 0m - 1/5m5 - 2/5m2 + 0. -m2(m - 1)2(m + 2)/5 Let w be 2/7 + (-408)/(-42). Suppose -i = -5v + 2, -v + 5i = -6v - w. Suppose 4/9j + 2/9j2 + v = 0. What is j? -2, 0 Let q(y) be the second derivative of 0y*3 + 2y + 1/70y5 + 2/105y*6 + 0y*2 - 1/42y*4 + 0. Factor q(n). 2n*2(n + 1)(2n - 1)/7 Let v(t) be the second derivative of -t7/280 + t6/120 - t*3/2 + 5t. Let o(p) be the second derivative of v(p). Determine i, given that o(i) = 0. 0, 1 Let i(h) be the first derivative of -1 - 1/15h5 + 0h + 0h2 + 0h*4 + 0h*3. Let i(n) = 0. What is n? 0 Let o(n) be the first derivative of 9n*5/10 + 3n*4/2 - 5n*3/6 - 3n*2 - 2n - 9. Factor o(i). (i - 1)(i + 1)(3i + 2)2/2 Let y = 388/3 - 128. Suppose -2/3 + 4/3a*3 + ya*2 - 2/3a*5 - 2/3a - 2/3a4 = 0. What is a? -1, 1 Suppose w + 2w = 2x - 12, 11 = 5x + 2w. Find k such that 1/2k*x + 0k + 0 + 1/2k2 = 0. -1, 0 Let l(x) be the third derivative of x6/10 - 7x5/20 - x4/4 - 7x2. Factor l(g). 3g(g - 2)(4g + 1) What is z in 0z - z*3 + 5/8z*4 + 0 - 1/2z*2 = 0? -2/5, 0, 2 Let j be 4/(144/(-69)) + 2. Let q(u) be the third derivative of ju*4 + 0 + 0u*3 - 1/12u*5 - 2u*2 - 7/120u*6 + 0u. Suppose q(k) = 0. What is k? -1, 0, 2/7 Suppose -2t = -5 + 1. Let x(a) = -a + 10. Let r be x(7). Solve s + rs*2 - 4s*2 - ts = 0. -1, 0 Let w(d) be the third derivative of -d6/360 + d5/180 + d4/72 - d3/18 + 9d2. Factor w(t). -(t - 1)2(t + 1)/3 Suppose 0 = -5y - 2w - 6, 2w = 4y + 2 - 8. Let s(i) be the first derivative of -2 + 1/15i3 + 0i + 0i2 + yi*4 - 1/25i5. Factor s(m). -m2(m - 1)(m + 1)/5 What is t in 2t - 4t*5 + 2t*5 + 13t*4 + 4t*2 - 17t*4 = 0? -1, 0, 1 Suppose 0 = 4z + 3a - 21, 4z + 5 = 5a + 2. Factor -42i + 30i2 + 14i + 8 + 0i3 - 9i*z. -(i - 2)(3i - 2)2 Let r(m) be the first derivative of -3/2m*2 - 1/4m4 - m3 - m - 2. Solve r(c) = 0. -1 Let s be 0((-4)/2)/(-6). Let y(n) be the first derivative of -n2 - 3 + sn - 3/4n4 - 5/3n*3. Factor y(u). -u(u + 1)(3u + 2) Let u be (23 + -23)2/42. Factor -1/2q2 + u - 1/2q4 - q3 + 0q. -q2(q + 1)*2/2 Let 12i*2 + 4i*2 + 2i*3 - 4i*2 + 8i + 2i3 = 0. Calculate i. -2, -1, 0 Let n be 46/(-69)1/(-2). Find j such that 1/3j2 + 1/3j - 1/3j3 - n = 0. -1, 1 Suppose b + 2t = 4, -3b + t - 2 = -b. Suppose 0g - 3g - 12 = 0, -5r - 4g - 6 = b. Factor 2 - 4c*r - 3c*2 - 5c + 0c. -(c + 1)(7c - 2) Factor -2/11 + 2/11s*2 + 2/11s - 2/11s3. -2(s - 1)*2(s + 1)/11 Let c(i) = 11i2 + 8i + 17. Let k(w) = w*2 + w + 1. Let s(v) = -c(v) + 6k(v). Let l(p) = 2p2 + p + 5. Let z(j) = 7l(j) + 3s(j). Factor z(f). -(f - 2)(f + 1) Suppose 5k + 1 = 3u, 3k + 0 = 2u - 2. Suppose 2a3 - ua + 9a - a4 + 1 - 4a = 0. Calculate a. -1, 1 Let u be ((-16)/(-6))/(16/24). Determine i, given that 0 - 9i2 + 0 - 4i*u + 13i*2 = 0. -1, 0, 1 Let w(t) be the second derivative of 3t*4/22 - 2t*3/33 - 22t. Determine p so that w(p) = 0. 0, 2/9 Let k be (-23)/(-10)(-5)/2. Let c = 6 + k. Suppose 1/2p*2 - 1/4p - cp3 + 0 = 0. Calculate p. 0, 1 Suppose -2q + 9 = 2q + 3l, 5l = -q - 2. Factor -r3 - 2 + 4r*3 + qr2 + r + 2 + r4. r(r + 1)3 Let c(n) be the first derivative of -5n*2 + 3 - 3/8n*4 - 7/3n*3 - 4n. Factor c(o). -(o + 2)*2(3o + 2)/2 Let v(a) be the third derivative of -a5/180 + a4/72 - 8a*2. Suppose v(u) = 0. What is u? 0, 1 Let n = 13/12 + -5/6. Let a = 12 - 23/2. Factor -5/4s - ns3 - a - s2. -(s + 1)2(s + 2)/4 Suppose 0t - 15 = -5t. Suppose -6n + tn = 0. Factor n - 2/7o - 2/7o*2. -2o(o + 1)/7 Determine v so that -4/3v - 10/3v2 - 2/3v*4 - 8/3v*3 + 0 = 0. -2, -1, 0 Suppose 1/2m*2 - 1/2m*4 - 1/6m*5 - 1/6m*3 + 0 + 1/3m = 0. What is m? -2, -1, 0, 1 Let z(r) = -r*2 - r + 5. Let a be z(4). Let n = -44/3 - a. What is j in 2/3j + nj2 + 1/3 = 0? -1 Factor -2w*4 - 20w*2 + 50w3 - w4 - 12w4 - 40w. -5w(w - 2)*2(3w + 2) Let k(l) = l2 - 16l + 15. Let p be k(15). Suppose p = -u - 0u. Suppose 0f*2 + u + 0f - 1/4f3 = 0. What is f? 0 Let s = 6 - 4. Suppose 6 = -0f + sf. Solve 2c + 2c2 - c + 4 - fc - 4c = 0. 1, 2 Let l(v) be the first derivative of 8v*3 + 18v + 5/3v4 + 18v*2 + 2/15v5 + 6. Solve l(u) = 0. -3, -1 Let x(f) be the third derivative of f5/330 - f*4/33 + 4f*3/33 + 7f2. Solve x(t) = 0 for t. 2 Let z(b) be the first derivative of -b5/80 + b3/8 + b2/2 + 4. Let j(i) be the second derivative of z(i). Suppose j(f) = 0. Calculate f. -1, 1 Let g(m) = 5m4 + 2m3 + m2 + 4m - 6. Let s(r) = 6r*4 + 2r3 + r2 + 5r - 7. Let x(w) = -7g(w) + 6s(w). Determine k so that x(k) = 0. -1, 0, 1, 2 Let o(g) = g3 + 10g*2 + 3g - 6. Let w be o(-9). Suppose -4n2 + 1 - 1 - 46n*3 + wn*3 + 2n = 0. Calculate n. 0, 1 Let w(r) = -49r3 - 9r*2 + 55r + 9. Let u(o) = 50o3 + 10o*2 - 54o - 10. Let m(k) = -3u(k) - 2w(k). Factor m(z). -4(z - 1)(z + 1)(13z + 3) Let -2/5j4 - 2j + 6/5j2 + 4/5 + 2/5j3 = 0. Calculate j. -2, 1 Let z(l) be the second derivative of l6/225 + 2l5/75 - 13l*4/45 - 4l*3/3 + 15l*2 + 56l. Factor z(q). 2(q - 3)2(q + 5)2/15 Let j(p) be the second derivative of p5/30 + p*4/3 + 3p*2 + 2p. Let w(s) be the first derivative of j(s). Factor w(i). 2i(i + 4) Let r = 6 - 3. Suppose rl - 21 = 5p, -5 = 6l - 4l + 3p. Find g, given that -4g*4 - 2g*3 - lg*3 + 7g3 + g2 = 0. -1/4, 0, 1 Suppose f - 3g + 0g + 9 = 0, 2f - 5g + 14 = 0. Factor -1/5m2 - 2/5m + 1/5mf + 0. m(m - 2)(m + 1)/5 Let l be 4/(-12) - (-2)/6. Suppose 0 = -r - lr + 6. Suppose 2 + 1 + 2v2 + 1 - r = 0. Calculate v. -1, 1 Determine d so that 8 + 4d - d*3 + 4d*4 - 12d*2 + 6d*3 - 9d*3 = 0. -1, 1, 2 Let f(t) be the third derivative of 1/120t*6 + 0t - 2/3t3 - t2 + 0 + 0t*4 + 1/20t*5. Find u such that f(u) = 0. -2, 1 Let m be (((-3)/(-6))/1)/(-14). Let s = m - -2/7. Let 0j - sj3 + 0j*2 + 3/4j4 + 0 + j5 = 0. What is j? -1, 0, 1/4 Solve 1 + 5/2p + 1/2p*3 + 2p2 = 0. -2, -1 Let w(g) be the second derivative of g4/42 + g*3/7 - 5g. Factor w(n). 2n(n + 3)/7 Let a(d) be the third derivative of d7/420 - d6/12 + 5d5/4 - 125d*4/12 + 625d*3/12 - 43d*2. Solve a(v) = 0 for v. 5 Let n(a) = 5a*5 - 5a*4 - 41a*3 - 19a*2 + 6a - 6. Let p(r) = -r5 - r4 + r3 - r2 - r + 1. Let w(b) = n(b) + 6p(b). Factor w(f). -f2(f + 1)(f + 5)2 Let u(z) = 4z*4 - 5z*2 - 4z - 4. Let q(f) = 4f4 - 6f*2 - 5f - 5. Suppose 5o + 9 = -16. Let p(b) = ou(b) + 4q(b). Factor p(x). -x2(2x - 1)(2x + 1) Let j(g) be the third derivative of g7/420 - g5/120 - 11g*2. What is n in j(n) = 0? -1, 0, 1 Suppose 3g - 19 = -0g - 2h, 3g - h - 13 = 0. Suppose -15 = -2y + g. Factor 73w2 + 32 + 7w*2 + 80w + 40w3 + w5 + yw*4 + 0w5. (w + 2)5 Let g be (-630)/(-1176) - 2/7. Factor 1/4u + gu*3 - 1/2u*2 + 0. u(u - 1)*2/4 Let p(r) be the first derivative of 4r5/25 - r4/5 - 4r3/15 + 2r*2/5 - 6. Factor p(v). 4v(v - 1)2(v + 1)/5 Let s(y) = -5y3 - 5y*2 - 10y - 4. Suppose 3n = n - 4. Let l(j) = -4j*3 - 6j*2 - 10j - 4. Let b(q) = ns(q) + 3l(q). Factor b(w). -2(w + 1)2(w + 2) Let m(y) = y4 - y3 + y*2 - y. Let l(s) = 6s*4 - 2s*3 + 8s*2 - 4s. Let j(o) = l(o) - 5m(o). Find f such that j(f) = 0. -1, 0 Let c(l) = -l3 + 2l*2 + 2l - 1. Let b be c(2). Factor 2/5nb + 0n + 0 + 2/5n2 - 2/5n*5 - 2/5n*4. -2n*2(n - 1)(n + 1)2/5 Factor m4 + 1/3m*5 - m - 1/3 + 2/3m*3 - 2/3m*2. (m - 1)(m + 1)*4/3 Let g(i) be the first derivative of -135i*	{ "pile_set_name": "DM Mathematics" }
3 Let z(n) = n*3 + 7n*2 - 6n - 44. Let g be z(-5). Calculate the remainder when 1/6 + (-6)/(g/(-461)) is divided by 13. 12 Let j = 4252 + -4234. Let w = -16 - -57. Calculate the remainder when w is divided by j. 5 Suppose 9h - 4h = -165. Let u = h - -42. Suppose i - 15 = -0i. What is the remainder when i is divided by u? 6 Let a = 2683 + -2191. Suppose 5s - 322 = -4v, 4s - v = 79 + 166. What is the remainder when a is divided by s? 58 Suppose 5u + 3579 = 2x, -3u + 1806 = -8x + 9x. What is the remainder when x is divided by 29? 28 Suppose -4u + 2 = -f - 14, -f + 2u - 6 = 0. Let g = f - -42. What is the remainder when g is divided by 32? 14 Let k(b) = -b2 - 10b - 2. Let l be (3/9 - 15/(-36))-4. What is the remainder when 65 is divided by k(l)? 8 Let x = -1173 - -1640. What is the remainder when x is divided by 446? 21 Suppose -22m + 27m + 4k - 12589 = 0, 3m + 3k - 7554 = 0. What is the remainder when m is divided by 84? 81 Let c(o) = 2o + 4o - 6 - 4. Suppose 5z - 3z = 6. Calculate the remainder when c(z) is divided by 5. 3 Let m = 381 + -346. Suppose -18a + 23a = m. Suppose -15 = -3l, 7l - 4l + 50 = 5x. Calculate the remainder when x is divided by a. 6 Suppose -2i - i = -4l - 676, -l - 4 = 0. Let o be ((-3)/(-5) + (-910)/(-25))/1. Let t = 74 - o. What is the remainder when i is divided by t? 35 Let r(h) = 7h2 + 2h - 3. Let f be r(-3). Let d be 88(3/14 + (-6)/(-21)). Let w = f - d. What is the remainder when 57 is divided by w? 7 Suppose -11d + 67970 + 41357 - 19809 = 0. Calculate the remainder when d is divided by 185. 183 What is the remainder when 0 + (-3 - -1) + 4 + (-2 - -236) is divided by 120? 116 Let s be (1 - 13/4)(-29 - -25). Suppose 3j = 3k - 39, -2j - 3k = 7 + s. Let y(w) = 2w + 39. What is the remainder when 30 is divided by y(j)? 13 Let w be (-41 + 38)(-13)/(-3)-14. Let n(u) = 2u + 6. Let p be n(3). What is the remainder when 18 is divided by (p/(-14))/((-26)/w)? 0 Let u(d) = d3 + 6d*2 + 4d. Let l be u(-5). Suppose 3x = 3s - 21, -lx = -0x - 5. What is the remainder when s is divided by 4? 0 Suppose z + 4 = 19. Let i be 5/(-5) + 0/(-7). Calculate the remainder when ((-27)/5)/(i - 12/(-15)) is divided by z. 12 Let d be 18/4 + -5 - (-93)/6. Calculate the remainder when 8d - (-2 + 8 - 3) is divided by (-2)/(-2)19 + -4. 12 Let z(p) = -p*3 + 7p*2 + p - 2. What is the remainder when 1796 is divided by z(6)? 36 Suppose -3l + 4 = -5. Suppose -lv + 223 = -4m, -2m + 88 = v - 3. What is the remainder when v is divided by 41? 40 Suppose 2a = 5k - 236, 0k - 96 = a + 3k. Let f = -71 - a. What is the remainder when 72 is divided by (-3)/(-6)f + (-15)/(-10)? 12 Suppose 0 = 5d - 25, 3i + 4d + 337 = -2703. Suppose 4f - 140 = -0f - 4o, f - 43 = 3o. Calculate the remainder when ((-4)/5)/(12/i) - -3 is divided by f. 34 Let q = 217 - 314. Let x = -68 - q. Let z = 88 + -33. What is the remainder when z is divided by x? 26 Suppose -o = 5t - 2504, -6o + 3t + 2512 = -5o. Suppose 0 = -21y + 8y + o. What is the remainder when y is divided by 39? 37 Let l = -15967 + 24191. Calculate the remainder when l is divided by 46. 36 Let t(a) = -2. Let l(s) = -s + 21. Let c(b) = 2l(b) + 22t(b). Let o be c(-6). Calculate the remainder when 2/(-12)(o - 8)-57 is divided by 6. 1 Suppose 4n - 27 = -2w + 7, 0 = 5n - 2w - 65. Let v = 45 + n. What is the remainder when 166 is divided by v? 54 Let z be -4883/9(-12)/8. Let h = z + -215. What is the remainder when 81 is divided by h? 23 Suppose 20520 = 5w - 5l, 9w + 262l - 258l = 36832. What is the remainder when w is divided by 372? 4 Let t = 942 + -562. Suppose 12x - 28 = t. Calculate the remainder when 98 is divided by x. 30 Suppose -2w - 168 = 3c, -4c + w - 129 - 106 = 0. What is the remainder when 75 is divided by (-2 + 1 - c) + -34 + 30? 22 Suppose -2b - 54i = -57i - 234, b = -4i + 95. Calculate the remainder when b is divided by 35. 6 Suppose -3r + 107 + 64 = 0. What is the remainder when 54/(6 + 3) + r is divided by 11? 8 Suppose -223s = 60s - 203194. Calculate the remainder when s is divided by 13. 3 Let y(d) = -d3 - 108d*2 + 110d + 148. Calculate the remainder when y(-109) is divided by 38. 1 Let v(h) = 25h - 5. Suppose 0 = -3x - 14281 + 14500. What is the remainder when v(6) is divided by x? 72 Let s(f) = f*2 - 3f - 4. Suppose 3u = -u + 16, u = -2o + 142. Calculate the remainder when o is divided by s(7). 21 Suppose -k + 0k + 40 = -4y, 2 = -2y. Let a(b) = -b2 + 5b - 6. Let t be a(7). Let x = k + t. What is the remainder when 61 is divided by x? 13 Suppose -s + 0q = -4q, -s - 16 = 4q. Let d(f) = -5f - 37. Let r be d(s). What is the remainder when (-1)/(6164/330 - r) is divided by 28? 27 What is the remainder when 170/(-1)(35/(-2) + -1 + 13) is divided by 157? 150 Suppose 15q = 14q + 5p + 4983, 5p - 24825 = -5q. Calculate the remainder when q is divided by 11. 7 Suppose -2m + 3s = -35, 2m + 5s = -48 + 123. Let a(f) = 5f*2 + 21f - 7. Calculate the remainder when m is divided by a(-5). 12 Let c = -22 + 44. Suppose -586 = 8g + 278. Let b = g - -151. What is the remainder when b is divided by c? 21 Let j(n) = 3n*2 - 10n - 10. Suppose 0 = 8q + 15q - 115. What is the remainder when 237 is divided by j(q)? 12 Let k = 4 - 29. Let q be 1/(2 + k/15). Suppose -qd + 60 = 2d. What is the remainder when 44 is divided by d? 8 Suppose -3010i + 2979i + 434 = 0. Suppose 3f = 5f - u - 218, -2f + 4u = -212. Calculate the remainder when f is divided by i. 12 What is the remainder when 746 is divided by (-275)/15(-114)/95? 20 Let v(m) = -2m*2 + 90m + 2409. Calculate the remainder when v(-17) is divided by 143. 15 Let f = -998 + 380. Let h = f + 632. Calculate the remainder when 320 is divided by h. 12 Let k(c) = 266c. Let w(i) = -7i. Let r(b) = 4k(b) + 154w(b). Let d(o) = 2o3 - 93o*2 + 48o + 15. What is the remainder when d(46) is divided by r(-2)? 23 Suppose -41474 = -74f + 50138. Calculate the remainder when f is divided by 255. 218 What is the remainder when 301 is divided by 33/((-71 + 77)/(18))? 37 Suppose 4v = -4r + 480, 5v - 120 = -r + 16. Calculate the remainder when 574 is divided by r. 110 Let d = 74 - 53. Calculate the remainder when (-93)/(1674/1248)6/(-8) is divided by d. 10 Calculate the remainder when (-4815)/(-25) - 3 - (36/(-15) + 3) is divided by 97. 92 Let n(k) = 12k2 + k - 1. Let f be n(3). Let u be (-12545)/325 + (0 - (-9)/15). Let w = u + f. What is the remainder when w is divided by 19? 15 Suppose 9u + 37793 - 276797 = 0. Calculate the remainder when u is divided by 98. 96 Let o(b) = -10b. Let c be o(3). Let g be (-4)/c - (-3592)/60. Suppose 7x - x = g. Calculate the remainder when 16 is divided by x. 6 Let m = -18 - -14. Let u(b) = b*2 - b - 3. Let j be u(m). Suppose 19 = 4x - j. Calculate the remainder when x is divided by 4. 1 Suppose u + v = 4, 3u = v + 11 + 5. Suppose -7z = -19z + 684. Let k = u + z. What is the remainder when k is divided by 18? 8 Let u(c) = 11c*3 + 2c*2 + 2c - 2. Suppose 1027 - 286 = -13h. Let i = h - -77. Calculate the remainder when u(2) is divided by i. 18 Suppose 50m - 46m = -4f + 4972, 5f - 3715 = -3m. What is the remainder when m is divided by 114? 110 Suppose 5k = -227 + 247. Calculate the remainder when (-3)/2-1120/18 is divided by k. 2 Suppose 0 = -8u + 995 - 947. Let v be (-132)/(-55)(-5)/(-2). What is the remainder when (2 + (2 - -14))4/v is divided by u? 0 Suppose -3f + 4h = 1367 - 1613, 328 = 4f - 3h. Calculate the remainder when 308 is divided by f. 62 Let g = -30331 - -30355. Suppose 20 = 2p + 5z - 94, 3z + 213 = 3p. Calculate the remainder when p is divided by g. 19 Let z be 15/(-5) + (-2)/(-1) + 2. Let f(a) = 26a - 2. What is the remainder when 188 is divided by f(z)? 20 Suppose a - w - 2w = 27, 3w + 12 = 0. Suppose a = 5q - 0q. Suppose qj = 4j - 26. Calculate the remainder when j is divided by 14. 12 Let o = 189 - 199. Calculate the remainder when 48 is divided by 21/5 + (1 - (-2)/o). 3 Suppose 295034 + 41491 = 35d. What is the remainder when d is divided by 26? 21 Suppose -34g + 576 = -1090. Suppose -487 = -637o + 636*o. What is the remainder when o	{ "pile_set_name": "DM Mathematics" }
d*2 + 28d + 39. What are the prime factors of x(12)? 3, 7, 11 Let n(v) = v*2 + 7v - 15. Suppose -r + 0u + u - 16 = 0, -5r - 40 = 3u. What are the prime factors of n(r)? 29 List the prime factors of 40/(-12) - (-4492)/3. 2, 3, 83 Let m(j) = 7j - 46. Let h be m(6). List the prime factors of (178/(-4))/(h/8). 89 Suppose 2l - 73 = 25. Let z = -35 + l. Let n = z - 1. What are the prime factors of n? 13 Let p(s) = s2 + 19s + 4. Let z be p(-19). Suppose -3i - zi + 399 = 0. What are the prime factors of i? 3, 19 Suppose -4k - 5f = k + 5, -5k = -f - 13. Suppose kb + 3r + r = 36, -4r = -4b + 108. List the prime factors of b. 2, 3 Suppose -2k = -k - 4. Suppose 4j - 2z + 18 = 5j, -5z = kj - 60. What are the prime factors of j? 2, 5 Suppose 304 = 4j + 4d, 5j - 189 = 4d + 164. Let z = j + 72. List the prime factors of z. 5, 29 Let q be (17 - 14)/((-6)/28). Let r = q + 33. What are the prime factors of r? 19 Suppose 0 = 4z - 3n - 20, -2z + 5n = z - 15. Suppose 0 = -3q + zq. Suppose 3k = -qv - 4v + 35, -v - 4 = 5k. What are the prime factors of v? 11 Let g = 1519 - 919. Suppose -6i = -g + 168. List the prime factors of i. 2, 3 Suppose 0 = -5k + q + 35, 4q - 4 = -3k + 5k. Let c(p) = 9p - 16. List the prime factors of c(k). 2, 7 Let s(r) = -2r - 17. Let y be s(-12). Let z(c) = yc + 3 + 0 - 11 + 2c*2. List the prime factors of z(-8). 2 Suppose 2o - 4 = -0d - 3d, -5o - 13 = -4d. Let c be ((-564)/(-30))/(o/5). List the prime factors of (-8)/(-28) - c/14. 7 Let b(u) = 3u2 - 18u. Let y(o) = -5o2 + 36o. Let c(l) = 7b(l) + 4y(l). List the prime factors of c(-20). 2, 5 Let x(o) = 34o - 1. Let f be (1 + -3)(-3)/6. What are the prime factors of x(f)? 3, 11 Let d = -3 - -18. Let c(f) = -f + 35. Let g be c(d). Suppose 8 + g = 2h. List the prime factors of h. 2, 7 Suppose -7n + 8n = -a + 820, -n = -3a - 816. List the prime factors of n. 3, 7, 13 Let h(p) = -p*3 - 13p*2 + 8p - 10. Let s be h(-12). What are the prime factors of (2/4)/(((-15)/s)/3)? 5 Suppose 0l = 12l. Suppose 2x = -lm + m + 146, -m = 3x - 219. List the prime factors of x. 73 Suppose -48 = 5v - 4s + 9, -60 = 5v - 5s. Let k(i) = -i - 8. Let h(b) = -b + 1. Let u(c) = 4h(c) + k(c). What are the prime factors of u(v)? 41 Suppose -3s - 1317 = -2i + 5109, 0 = -3s. What are the prime factors of i? 3, 7, 17 Suppose -u + 5a + 1353 = 0, 5u + 5a - 6877 = 2a. What are the prime factors of u? 1373 Suppose 28796 = 34b - 11b. List the prime factors of b. 2, 313 Suppose -445 - 716 = -3y. What are the prime factors of y? 3, 43 Suppose -5x = -u - 4468 - 784, 0 = x + 2u - 1057. List the prime factors of x. 1051 Suppose a = -4a - 5. Suppose -3y = 3, 0 = 5x - 3y - y + 16. List the prime factors of 31 - (a - -1)/x. 31 Let x = -31 + 31. Suppose -3d = u - 132, 3u + xu - 4d - 448 = 0. List the prime factors of u. 2, 3 Let s(p) = 22p2 + 3p - 7. What are the prime factors of s(-2)? 3, 5 Suppose 0 = -3g - 4t + 10203, -40g + 45g - 2t = 17031. What are the prime factors of g? 3, 5, 227 Suppose 4b + 20 = 0, -3b - 160 = -2o - 5b. List the prime factors of 728 + o/17. 3, 67 Let h be -9 + 14 - 1/1. Suppose hq = t - 75, -3q = -4t + 111 + 163. List the prime factors of t. 67 Let h = -2705 - -5109. List the prime factors of h. 2, 601 Let c = 299 - -721. What are the prime factors of c? 2, 3, 5, 17 Let u(c) = -c2 - 50c - 44. What are the prime factors of u(-24)? 2, 5, 29 Suppose a - 523 + 65 = 0. Let g be -41 - (0 - a). Suppose -8y = -42 - g. What are the prime factors of y? 2, 31 Let x be (2/4)/(14/(-168)). Let d be x/8(-20)/5. Suppose -da + 41 = 2. List the prime factors of a. 13 Suppose 3s - 10 = -2s, -3s + 29 = j. Suppose -jm + 30m = 2289. What are the prime factors of m? 3, 109 Let t(a) = a2 + 8a + 3. Let n be t(-8). Suppose nq - 2 = d - 7, -1 = -d - q. Suppose dp = 8, -2i + 0p + 28 = -2p. What are the prime factors of i? 2, 3 Suppose 924 + 1092 = 8b. Let q = b - 180. What are the prime factors of q? 2, 3 Suppose -4n - 3256 + 11282 = c, 8034 = 4n - 3c. What are the prime factors of ((-6)/18)/((-3)/n)? 223 Let a(y) = 1 + 1 - 310y + 308y. Suppose -3r + 4 = z + 18, 0 = -3r + 5z - 20. What are the prime factors of a(r)? 2, 3 Let j be (-8)/(-24) - (-64)/6. What are the prime factors of (1 - 7)/((j/4)/(-11))? 2, 3 Suppose 3w + 2g + 14 = 8w, 4w - 3g - 14 = 0. Let c be 13 + -4 - 2-1. Suppose 129 - c = wi. List the prime factors of i. 59 Suppose 17x - 6965 = 3728. What are the prime factors of x? 17, 37 Let s = 376 - -56. List the prime factors of s. 2, 3 Let x = 19 - 15. Let w be x/14 + (-1643)/(-7). Suppose -115 - w = -5t. List the prime factors of t. 2, 5, 7 Let w(l) = 6l*2 - 55l - 15. What are the prime factors of w(18)? 3, 313 Let m = 16 - -87. List the prime factors of m. 103 Suppose 70a = 52a + 15912. What are the prime factors of a? 2, 13, 17 Let n(l) be the third derivative of l5/20 + l4/8 - 4l3/3 + 2l*2. Let f be n(-4). Let j = f + -7. What are the prime factors of j? 3, 7 Let o = 126 + 2. What are the prime factors of o? 2 Let u be 3/(54/(-4)) + 1470/(-189). List the prime factors of ((-6)/u)/(3/(-101))-4. 101 Let a = 2073 - 423. What are the prime factors of a? 2, 3, 5, 11 Let z(b) = -2b2 - 3b + 8. Let j be z(-4). Let u(t) = t*3 + 13t*2 + 10t - 10. List the prime factors of u(j). 2, 7 Let j be (-8)/(-16) - (-10)/4. Suppose -32 = -u + 2g, u + ju - 5g = 113. List the prime factors of 2/42 + u. 23 Let s = 4360 + -2333. List the prime factors of s. 2027 Let n = 283 + -166. Suppose 2p - 4f + n = 5p, 3p - 126 = -f. List the prime factors of p. 43 List the prime factors of (-237)/(-2 + 18/10) + 0. 3, 5, 79 Let z = 47 - 42. Suppose -6 = -3a, -zi + 5a + 30 = -0i. List the prime factors of i. 2 Let s(j) = -2j + 7. Let i(m) = 2m - 6. Let f(v) = 5i(v) + 6s(v). Let q = 51 + -59. List the prime factors of f(q). 2, 7 Suppose 3d + c + 3 = 15, 2d - 2c = 8. Suppose 0 = dp - 2 - 6. Suppose 0 = 3t - 4k - 61, -pt = -t - 3k - 27. List the prime factors of t. 3, 5 Let x(h) = 2h + 9. Suppose -24 = 4b - 4f, -4b = b + 3f + 30. Let s be x(b). List the prime factors of (-7)/(s/(5 + 1)). 2, 7 Suppose -14 + 4 = -5t. Suppose -38 = h - th. Let n = h + -14. List the prime factors of n. 2, 3 Let t = -1 + 3. Suppose -8y + 6y - i + 276 = 0, -5y = 4i - 696. Suppose tg = -2m + y, -g + 3m = -m - 63. What are the prime factors of g? 67 Suppose 0t + 4 = t, 0 = 4y + 2t + 20. Let p be (-240)/9 + 2/3. Let o = y - p. List the prime factors of o. 19 What are the prime factors of 1196 - (-2)/416? 2, 7, 43 Let y = 36 - 21. Let f = 7 - y. Let x = 14 + f. List the prime factors of x. 2, 3 Let y = 94 + -4. List the prime factors of y. 2, 3, 5 Suppose -q - 17 = -211. What are the prime factors of q? 2, 97 Suppose o = 3y + y - 55, -o - 34 = 3y. Suppose -4g + 4c = -15 - 353, -365 = -4g + 5c. Let p = g + o. What are the prime factors of p? 2, 13 Let o = 784 + 1630. What are the prime factors of o? 2, 17, 71 Suppose -11s + 60 = s. Suppose -y + n = 6n - 77, sn = -5y + 465. What are the prime factors of y? 97 Let h(s) = -s*3 + 14s*2 - 14s + 23. What are the prime factors of h(13)? 2, 5 Suppose 727 + 144 = 2j - 3u, -j + 431 = -3u. What are the prime factors of j? 2, 5, 11 Let f = 12 + -39. What are the prime factors of (f/(-3))/((-5)/(20/(-3)))? 2, 3 Let a be (-24)/(-42) + (-34)/(-14). Suppose 2n = -5 - a, -p + 5n = -22. Suppose 0 = -pf + 1 + 39. List the prime factors of f. 2, 5 What are the prime factors of 446/28 + 6/(-1)? 2, 7, 127 Suppose 2c + 4p = -2c + 20, -2p = -5c + 11. Suppose -3v = 2j - 2v + 2, 0 = -2j - cv - 10. What are the prime factors of 7 - (2 - 1/j)? 2, 3 Let q be (-102)/18 + 5 + 159/9. Let w = 4 - -22. Let b = w - q. List the prime factors of b. 3 Let l = -1224 + 1931. What are the prime factors of l? 7, 101 Let n(r) = -r3 + 4r*2 - 5. Let b be n(5). Let k = b - -30. Suppose 5g - g - 100 = k. List the prime factors of g. 5 Suppose -4m - m = 0. Suppose 8 + m = 2f. What are the prime factors of f/6441/14? 3, 7 Suppose g - 6g = 4m - 771, 5m + 4g - 957 = 0. Suppose 4j - 463 = m. List the prime factors of j. 163 Le	{ "pile_set_name": "DM Mathematics" }
ctor 3/7i2 + 0 + di. 3i(i + 1)/7 Suppose y = -0 + 4. Let l(t) = 2t2 + 4t - 2. Let q(o) = -o. Let a(i) = yq(i) + l(i). Solve a(s) = 0. -1, 1 Let t(s) = -s3 + s2 + 1. Let j(r) = 8r*3 + 16r*2 + 48r + 31. Let u(z) = j(z) + 5t(z). Determine f so that u(f) = 0. -3, -2 Let h(c) be the third derivative of -c6/120 + c5/120 + 2c2. Factor h(s). -s2(2s - 1)/2 Suppose 32/3 + 2/3p3 + 16p + 6p2 = 0. Calculate p. -4, -1 Let j(p) be the first derivative of -5p*6/6 - 4p*5 - 25p*4/4 - 10p*3/3 - 1. Factor j(h). -5h*2(h + 1)*2(h + 2) Let u(s) be the first derivative of -4s - 2/3s*3 + 3s*2 - 1. Factor u(n). -2(n - 2)(n - 1) Factor 0 + 2/5k + 2/5k2 - 8/5k*5 + 22/5k*4 - 18/5k*3. -2k(k - 1)3(4k + 1)/5 Let j = 177585 + -1600486/9. Let z = j - -247. Factor -2/9c*2 + 0 - zc*3 + 2/9c*4 + 2/9c. 2c(c - 1)*2(c + 1)/9 Let q(v) = -3v3 - 5v*2 - 7v + 5. Let o(p) = 61p3 + 66p*3 - 129p*3 + 3 - 4p - 3p2. Let t(l) = 5o(l) - 3q(l). Factor t(g). -g(g - 1)(g + 1) Factor 9/2z - 3/4z2 - 27/4. -3(z - 3)*2/4 Let f = -151/4355 + 8/201. Let u(m) be the second derivative of 0 + 0m*3 + 1/130m*5 + 2m - fm6 + 0m*4 + 0m*2. Solve u(l) = 0 for l. 0, 1 Let x(l) = -3l*3 + 13l*2 + 3l. Let m(w) = -w*3 + 6w*2 + 2w. Suppose -s + 25 = -6s. Let p(a) = sm(a) + 2x(a). Find o, given that p(o) = 0. -2, 0 Let w be (-4)/(-2) - ((-882)/56)/(-9). Let i be 0 + 0(-1)/2. Factor 0 + wc3 + 0c*2 + ic. c3/4 Let v(n) = n3 + n*2 + 1. Let f(c) = 5c*4 + 18c*3 + 29c*2 + 20c. Let h(q) = f(q) + 4v(q). Factor h(k). (k + 1)2(k + 2)(5k + 2) Let m(h) be the second derivative of h*6/40 - 3h*5/10 + 3h*4/2 - 4h*3 + 6h*2 - 5h. Factor m(q). 3(q - 2)4/4 Let f(q) be the third derivative of q9/30240 + q8/5760 - q7/5040 - q5/20 + q2. Let l(r) be the third derivative of f(r). Factor l(a). a(a + 2)(4a - 1)/2 Let b(g) = -16g - 1. Let j(s) = 3s. Let w(r) = 2b(r) + 11j(r). Let y be w(6). Find h such that 1/6h5 + 0h + 1/6h3 + 0h*2 + 0 + 1/3h*y = 0. -1, 0 Let a(w) = -35w*4 - 13w*3 + 167w*2 - 155w + 36. Let u(f) = 17f4 + 7f*3 - 83f*2 + 77f - 18. Let y(o) = 2a(o) + 5u(o). Factor y(t). 3(t - 1)2(t + 3)(5t - 2) Let h = 29 - 24. Let x(b) = -b*4 - 4b3 - b2. Let z(s) = 3s4 + 9s*3 + 3s*2. Let u(a) = hx(a) + 2z(a). Factor u(k). k2(k - 1)2 Let p(m) = m4. Let k(v) be the first derivative of -4v5/5 + v4 + 14v*3/3 + 4v*2 - 2. Let n(c) = 2k(c) + 4p(c). Factor n(b). -4b(b - 4)(b + 1)*2 Let p(j) = 8j. Let y be p(1). Suppose 6l - y = 2l. What is f in 6f3 + 0f - 3f4 - lf - f*4 = 0? -1/2, 0, 1 Let j = 2/19 - -24/133. Factor 4/7n + j + 2/7n2. 2(n + 1)*2/7 Let n = -1/224 - 575/224. Let q = 20/7 + n. Find t such that 2/7t*3 + 0t - qt5 + 0 - 2/7t*4 + 2/7t*2 = 0. -1, 0, 1 Let g(r) = -19r*4 - 88r*3 - 43r*2 + 30r - 4. Let h(s) = 18s4 + 87s*3 + 42s*2 - 30s + 3. Let z(x) = 3g(x) + 4h(x). Find t such that z(t) = 0. -5, -1, 0, 2/5 Let m(f) = f - 2. Let n be m(2). Let 1/4p2 + 1/2p + n = 0. What is p? -2, 0 Suppose 2q = 4d - 0d + 22, -29 = 5d - q. Let s be (-1)/(-6) - 35/d. Let -2g2 + 2 + 0g*3 + 2 - sg*3 - 2g*4 + 6g = 0. What is g? -2, -1, 1 Let z(v) be the third derivative of -v7/735 + v6/420 + v5/210 - v4/84 + v*2. Factor z(r). -2r(r - 1)2(r + 1)/7 Let -3r + 2 - r2 - 5 + 1 = 0. What is r? -2, -1 Let c(d) be the second derivative of -d6/120 + d5/16 - d4/16 - 3d*3/8 + 20d. Suppose c(q) = 0. Calculate q. -1, 0, 3 Let r(q) be the second derivative of -1/30q6 + 1/10q*5 - 1/12q*4 + 0q*2 + 0 - 4q + 0q3. Factor r(y). -y2(y - 1)2 Let h(v) = v3 + 3v2 - 3v - 3. Let l be h(-3). Suppose -9s = -ls. Let 0i + 2/7i*5 - 2/7i*4 - 2/7i*3 + 2/7i*2 + s = 0. Calculate i. -1, 0, 1 Let k be 12/92 - 6/(-18). Let q(a) be the third derivative of 0a - 1/3a*k - 1/30a*5 - 1/6a*4 + 0 + 3a*2. Find y such that q(y) = 0. -1 Let d(l) = -4l*3 - 2l*2 + 4 + 3l*3 + 2l3 + l3. Let s(b) = b3 - b2 + 1. Let j(p) = d(p) - 4s(p). Factor j(m). -2m*2(m - 1) Suppose -15 = -4y + 1. Let g(j) = 2j*2 - 6j. Let n be g(y). Factor -24s3 - 10s*2 + 18s*4 + 8s - n + 10s + 6s. 2(s - 1)(s + 1)(3s - 2)*2 Suppose -r = 3t - 25, -3t + 4r + 23 = 3r. Suppose tv - 3v = 0. Factor v + 2/9u*2 + 0u. 2u2/9 Suppose -5g = 5q - 15, 6g - 11 = 2g - 5q. Let p be 0 - (-32)/6 - g. Factor -p - 2/3l + 2/3l*2. 2(l - 2)(l + 1)/3 Suppose 4q = 6q. Suppose -7z + 8z = q. Suppose 4/3f*3 + 0f + 14/3f4 + z + 0f2 = 0. What is f? -2/7, 0 Let i(q) = q3 + 15q2 + 15q + 14. Let m be i(-14). Find d such that -6/5d3 + 2/5d + 4/5d2 + m = 0. -1/3, 0, 1 Let y = -5 - 0. Let t be (5 + y)(-2)/(-4). Find d, given that -1/2d2 + t + 1/2d = 0. 0, 1 Let k be (0 + (3 - 2))(-4)/(-2). Factor -1/2s*2 - 2 - ks. -(s + 2)*2/2 Suppose 3y = -28 - 26. Let z be (y/15)/(-2)1. Solve -2/5 - zc*2 + 7/5c + c*4 - 7/5c*3 = 0. -1, 2/5, 1 Let d be 3/260/135. Solve dp - 2/3 + 2/3p*2 - 2/3p3 = 0. -1, 1 Let b(w) be the third derivative of w7/525 - w6/75 + w5/25 - w4/15 + w3/15 - 25w2. Let b(o) = 0. What is o? 1 Let o(f) be the first derivative of f4/8 + f3/2 + 3f*2/4 - f + 1. Let z(h) be the first derivative of o(h). Factor z(b). 3(b + 1)*2/2 Let f(l) be the first derivative of 4 + 0l*2 + 1/20l*5 + 0l - 1/16l4 - 1/6l*3. Solve f(m) = 0 for m. -1, 0, 2 Factor -9/2d + 6 - 21/2d2. -3(d + 1)(7d - 4)/2 Let m(a) be the third derivative of a9/3024 - a7/840 - 2a3/3 - a2. Let z(q) be the first derivative of m(q). Factor z(d). d3(d - 1)(d + 1) Let d(r) be the third derivative of r7/3360 + r6/720 - r3/6 - 2r*2. Let c(b) be the first derivative of d(b). Solve c(w) = 0. -2, 0 Suppose -m - 4 = 0, -4m - 61 = -i - 4i. Let o be (-8)/(-3) - 6/i. Factor d2 - 2d*o - 2d*3 + 2d + d*2. -2d(d - 1)(d + 1) Let i = 5083/7 - 725. Let q be (-24)/(-14) - (-1 - -1). Let -2/7y4 - iy - 8/7y3 - 2/7 - qy*2 = 0. What is y? -1 Factor 4b*2 + b - 8b - 6b + 12 - 3b. 4(b - 3)(b - 1) Let b be 8/(-10)(-95)/38. Factor 0 - l4 - 2l*b + 5/2l*3 + 1/2l. -l(l - 1)2(2l - 1)/2 Factor 0 - 4u*2 - 2u - 3/2u3. -u(u + 2)(3u + 2)/2 Let m(u) be the first derivative of 3 + 1/20u5 + 5/8u*2 - 1/4u*3 - 1/2u - 1/16u4. Factor m(i). (i - 1)3(i + 2)/4 Suppose -4 = 11c - 59. Let m(f) be the second derivative of -1/35f*7 + 0 - 27/100f*c + 0f*2 + 1/4f*4 + 3f - 1/10f3 + 7/50f*6. Factor m(n). -3n(n - 1)3(2n - 1)/5 Let y = -9 + 12. Determine s, given that -2s*4 - 9s*3 - 3s - 9s2 - ys*4 + 2s*4 = 0. -1, 0 Factor 3/4o - 3/4o3 - 3/4o*4 + 3/4o*2 + 0. -3o(o - 1)(o + 1)*2/4 Suppose -15k = -16k. Find n, given that kn - 2/5n2 + 2/5 = 0. -1, 1 Suppose 4z - o = 6, -2 = -2z + 3o - 2o. Find i, given that i4 + 3i3 + i4 - 3i3 - zi*2 = 0. -1, 0, 1 Let d(f) = -f + 4. Let t be d(6). Let n be t + (-13 + 1)/(-3). Find z such that n + 2z*2 + 0 - 4z2 = 0. -1, 1 Let i(v) be the third derivative of v7/280 - 3v6/160 + v5/80 + 3v4/32 - v3/4 - 18v2. Factor i(s). 3(s - 2)(s - 1)2(s + 1)/4 Let m be 1 - (2/(-8) - (-30)/(-8)). What is j in 8/3j2 - 6j*4 + 0j - 9jm + 0 + 4j*3 = 0? -2/3, 0, 2/3 Let -3/2y + 0y2 + 0 + 0y*4 - 3/2y*5 + 3y*3 = 0. What is y? -1, 0, 1 Let n = -16/5 + 18/5. Find z such that -4/5z*3 - nz*2 - 2/5z*4 + 0z + 0 = 0. -1, 0 Let m(a) = -a3 - a2 - a - 10. Let b be m(0). Let k be -2 + (-1 - b - 2). Suppose -kd - d3 - 2 - 4d2 - d3 + d*3 = 0. What is d? -2, -1 Let z be 74/24 + -6 + 3. Let k(h) be the first derivative of -1/4h + zh3 - 2 + 0h*2. What is n in k(n) = 0? -1, 1 Let q(o) = 2 - 26o - 12 + 23o. Let w be q(-8). Determine g so that 2g + g*5 + 7g*2 - 3g*3 - wg*2 - 5g*4 + 12g*3 = 0. 0, 1, 2 Let a = 5 + 27. Let u be (-19)/(-40) + 4/a. Factor -3/5d*2 - 3/5d*3 + 0 + 3/5d*5 + 0d + ud4. 3d*2(d - 1)(d + 1)2/5 Suppose r = -2r. Let t(g) be the first derivative of 2/15g3 + rg*2 - 2/5g - 2. Determine a so that	{ "pile_set_name": "DM Mathematics" }
= -48a - 38. Let u be b(-1). Solve 5y = u, -4y = 2o + 3 - 13 for o. 1 Let t be ((-1)/2)/((-44)/264). Solve 9p + 27 = 4p + l, -tp - 5l = 5 for p. -5 Let v be (-30)/60 - (-10)/4. Suppose -5i - k = -6, 0 = -i - vk - 3k - 18. Solve -p + i + 2 = -5n, -5n = 2p - 8 for n. 0 Let m be 2-2(-18 - -16). Suppose -m = c - 5c. Suppose 3b + 2i + 19 = 4b, 0 = 5b - 4i - 65. Solve 3z - 1 = -h - 6, 5z + b = -ch for z. -1 Let a = -26 + 39. Let s = a - 12. Let y = -8 - -10. Solve s = -l + yh, 4h - 3 = -l - 10 for l. -3 Let a(s) be the second derivative of -s5/20 + 5s4/12 + s3 + 24s. Let h be a(6). Solve h = q - 1, 3d + 2 + 3 = 2q for d. -1 Let u(x) = x2 - x - 1. Let s(f) = -17f + 35. Let g(c) = s(c) + u(c). Let p be g(16). Solve 3o + 5 = -4j - po, 2j - 2o = -16 for j. -5 Suppose -3u = -5u + 4. Suppose 18g = 5g + 65. Solve 3b - 5m - 1 = g, -4 = -ub + 5m for b. 2 Suppose 5s - s = 96. Let i be ((-42)/63)/((-1)/s). Solve -4h + 3a = -a - i, a + 6 = -h for h. -1 Suppose t = 12 - 11. Let o be (-45)/35 + t - (-60)/14. Solve on + 20 = -4k, -2n + 3n - 20 = 4k for k. -5 Suppose b - 18 + 2 = 0. Suppose 10a - ba + 36 = 0. Solve 0 = -2k - 6, -av + 2v - 24 = 4k for v. -3 Let b(v) = v2 - 28v - 55. Let n be b(30). Solve ng - 19 = p, 2p + g + 4 = -1 for p. -4 Let l = -882 + 887. Let f be (4/(-2) - -2)/(-2). Suppose -5q + 141 = -c - 3c, f = -4q + 2c + 108. Solve q = -4n + k, -ln + n - 35 = -3k for n. -5 Let x(q) = -q2 + 17q + 113. Let f be x(22). Solve -5l = -2h - 2 - 9, -fh + 4l = 6 for h. 2 Let r(l) = 17l - 119. Let v be r(8). Solve 4c + 5h = 4h - 3, c - 3h = -v for c. -2 Suppose -2r + r = 0. Suppose rx + 18 = x. Let c = 31 - x. Solve v - 2 = 5b + c, -v = 5b + 25 for v. -5 Suppose 0 = -3g - 9, -23b = -19b + 3g - 3. Solve 0 = by + 3o + 10 + 2, -2o - 6 = 0 for y. -1 Suppose -5b + 20 = -4b. Solve -4x = b - 8, 3x + 9 = 2d for d. 0 Let r = 108 + -106. Solve -ra - k - 15 = 2a, k = 4a + 17 for a. -4 Let u(c) = -c + 7. Let j be (-15 + 0)/5(-4)/6. Let r be u(j). Solve 0 = 3d - rd, g + 2 = -2d for g. -2 Let f(b) = 3b2 + b - 3. Let m be f(3). Solve -4z - 14 = 3u, 5z = -u + 2u - m for z. -5 Let m = 56 + -51. Suppose 12 = 4k - 5o, 3k - mo = -2o + 9. Solve -3q - 4 = -4q - t, kt = 0 for q. 4 Let y be (-56)/(-24) + (-2 - (-10)/6). Solve 0u = -3u + 2w - 4, -u + yw = 8 for u. 2 Suppose 42 = -14m + 28m. Solve 3b = -3g + 5g - m, -3b = g - 6 for g. 3 Let q(g) = 20g*2 - g - 1. Suppose -11 = 6p - 17. Let x be q(p). Solve 4b - 3f = -f + 20, x = 2b - 3f for b. 3 Suppose -5j - 5b + 25 = 0, 2j - b - 4 = 6. Let x = j - 5. Suppose -4t + v + 12 = 0, v + 20 = t + 5v. Solve x = 3h - 5h + 2, 2h = -ty + 6 for y. 1 Let q be 290/(-15) + (-2)/(-6). Let h = q - -22. Solve -hw - w + 2c = 26, -w + 21 = 5c for w. -4 Let q(u) = -u*2 - 9u + 5. Let s be q(-9). Solve -c - 4c = sw + 5, 3w + 3 = -2c for c. 0 Suppose -52r - 44 + 148 = 0. Solve -ri - 8 = -0c + 4c, 0 = -3i + 3c - 12 for i. -4 Let n = -8 + 3. Let q = -2 - n. Suppose q - 2 = m. Solve -r + m = -2l - 0r, 0 = -l + r - 1 for l. 0 Suppose -4q = -8q. Suppose 0f + f - 2 = q. Solve 5x - fj + 35 = 0, -6 = -x + 4j - 31 for x. -5 Let u = -26 - -19. Let y = 10 + u. Solve 0 = 2v + 4o + 10, -1 = 5v - 5o + yo for v. -1 Let f(j) = -j - 9. Let u be f(-12). Let m(s) = -2 - us*2 - 7s + 2s + s3 + 5s*2. Let i be m(-3). Solve 3k - 4v = -5, v + i + 6 = -3k for k. -3 Suppose 5t + 5 = 0, -k = -0k - 4t - 16. Suppose -3a + 19 = 5q, 3a + 2q - 1 = 4a. Suppose -2s = -a - 5. Solve 4h = z - 4z, 0 = -sh - k for z. 4 Let a = 96 + -50. Let n be -43(-2)/4 - a/92. Solve -f - n = -7o + 3o, -2f - 2 = 0 for o. 5 Let q = 70 + -66. Solve -r - 4s + 11 = 0, q + 7 = 4r + 5s for r. -1 Let a be 1 + ((-4)/32 - 50/(-16)). Solve 4x + a = 4d, 6x + 5d + 45 = x for x. -5 Let s(t) = 2t*3 + 7t*2 + 19t + 57. Let z be s(-3). Solve -3c - 5j - 19 = -zj, c - 2j = -7 for c. -5 Suppose -31 = 2m - 7. Let t = -24 - m. Let f be -6(t/(-8) + -2). Solve -3b - r - f = 0, 2r + 2 = -3b - 1 for b. -1 Let z = -13 + 29. Let m(c) = -z - c + 0c + 8. Let h be m(-12). Solve 2w - 5f + 21 = 0, -3f + 4f = hw + 15 for w. -3 Let n(f) = f2 - 4f + 0f2 - 9f + 11 - 3. Let v be n(15). Let z = 60 - v. Solve 5x - 6 = -w, -3w + 5x - z = -0x for w. -4 Let f(m) be the third derivative of -m6/120 + m4/8 - m*3 + 8m*2. Let x be f(-3). Solve -3h = 5t, -t - 4h - x = -h for t. 3 Suppose -92 = -3s - 62. Solve 2z = 2y - 7y + s, -5y = z - 5 for z. 5 Let l = -38 + 51. Solve 3j = 4x + j + 2, -2x + 5j - l = 0 for x. 1 Suppose -4z = -3z - 2. Let a be -1z(45/(-10) - -3). Let u(d) = -d2 - 5d - 1. Let q be u(-4). Solve qy + 3m = a, 4m + 2 + 4 = y for y. 2 Suppose -g - 5o + 5 = 0, -5o + 10o - 5 = g. Solve 20 = -4w, gw - w = -f + 8 for f. 3 Suppose 0 = v - 9 + 1. Let z(o) be the third derivative of -o*4/24 + 2o*3 - 8o*2. Let k be z(7). Solve -kd = -3t - 9, d + 7 = vt - 3t for t. 2 Let i be 2/(-2(-1)/(-8)). Let q(v) = v*2 + 7v + 1. Let w be q(i). Let u be (1 - 0)(w + -5). Solve -2 = 2t - ur, -3t + r + 4 = 2r for t. 1 Let b(t) = -2t*3 - 45t*2 - 23t - 22. Let u be b(-22). Let j be (-7)/(14/4) - -7. Solve u = n - 5a + 11, 5a - 14 + j = -n for n. -1 Let w(z) = -z3 - z2 - z + 6. Let a = 1 - 1. Let c be w(a). Suppose t - c = -1. Solve -4k = tu - 4, -3u - 5 = 5k + 3 for u. 4 Suppose h + 2 - 11 = -2v, -7h + 27 = 5v. Solve 5d + a = 5a - h, 5a - 11 = 3d for d. 3 Let o(w) = -w3 + 15w*2 + 13w + 17. Let t be o(16). Let c = 31 + t. Solve 0 = 2k - 2 - 4, c = 2d + k - 11 for d. 4 Let i(q) = -q*3 + 3q*2 + 2q + 3. Let f be i(3). Let d be f2(-1)/(-2). Let y be 2/9 + 16/d. Solve -yt - v - 5 = 0, -t - 3 = -2v + 2 for t. -3 Suppose 81p = 68p + 52. Suppose 2c + 0 = -4f + 4, 2c - 4f = 12. Solve -cm = -pj, 2m + 3m = 2j + 15 for j. 5 Let v(y) = 2y*3 - 24y*2 + 37y - 165. Let k be v(11). Let c be ((-6)/(-4))/((-6)/(-8)). Solve 5h - g - 11 = k, -c - 6 = -4h + g for h. 3 Suppose 78l = 81l - 9. Solve -5h = o + l - 4, -h + 5 = -o for h. 1 Let u(b) = b3 - 7b*2 + 42b - 212. Let m be u(6). Solve s - 11 = 5f, 2f - 3s = -ms - 10 for f. -3 Suppose 6g - 2g - 16 = 0. Let h be (2/g)/(5/30). Let d = -108 + 129. Solve -2c + d = ha, -4a - 1 + 24 = c for a. 5 Let a(u) = u3 - 6u*2 + 3. Suppose -2m + 18 = m. Let q be a(m). Let n = -128 + 130. Solve 0 = 2s + o - 3, -qo + 29 = -4s + no for s. -1 Let f(n) = n*2 + 2n - 4. Let i(b) = -b*2 - 16b - 13. Let x be i(-15). Let y be f(x). Solve -4p - 18 = 4l - 54, -yl + 8 = -3p for p. 4 Let u = -50 + 66. Suppose -5v + 4d + 6 = 0, v - 15 + u = 3d. Solve -4b + 3y + 28 = 0, 0 = 4b - vb - y - 12 for b. 4 Let a(y) = -2y - 2. Suppose 0 = 3s + s - 16. Suppose s = 4w + 20. Let d be a(w). Solve -3v - 19 = 5x, -2 = -3v - 2x - d for v. 2 Let a(y) = -50y + 55. Let x be a(1). Solve c + 2t = 1, -10t - x = -5c - 8t for c. 1 Let o = 46 + -6. Let a = 43 - o. Solve 0 = -d - 3f - 5, 0 = ad - 7d - 2f for d. 1 Let y(q) = -19q + 103. Let x be y(5). Solve 0 = 4s - 3s + i - 2, -x = -s + i for s. 5 Let p = -16 - -21. Let c(q) = -2q - 7 - 2q + pq. Let y be c(11). Solve -3h - 2h = -yi - 12, -4i - h = 12 for i. -3 Suppose 7g = 5g + 10. Suppose -n + 55 = 10n. Solve 0z - no = -z + 24, gz = o for z. -1 Let c = 26 - 17. Let x = 11 - c. Suppose 0 - x = -g. Solve -t - gi = t, 2 = -2t - i for t. -2 Let c = 24 - 21. Suppose d - 9 = -o, -cd - 2o + 26 = 4. Solve 4x - 4u - 8 = 0, -du = -2x + u + 16 for x. -2 Suppose -2f = -8n + 7n - 19, -3f = -3n - 21. Solve -2m + 3j - f = 7j, -2m + 3j + 16 = 0 for m. 2 Let a = -2 + 2. Suppose 33w - 249 + 150 = 0. Solve 4x + wp + 9 = a, -5x + 5p - p - 19 = 0 for x. -3 Let f(c) = 16c + 117. Let o be f(-7). Solve -v + 5 = -oy - 1, -24 = 2y + 5v for y. -2 Let k(n) = -n*2 + 8n - 15 - 7n - 10n. Let x be k(-6). Solve 5g - 3f = -8, xg + 7 = -2g + 2f for g. -1 Let p(k) = k2 + 6k + 5. Let n be p(-5). Let t(c) = -23c - 90. Let q be t(-4). Suppose nj = j - q. Solve r - jr = -5g - 12, 4r = 4g + 16 for g. -2 Suppose -47p + 52p - 15	{ "pile_set_name": "DM Mathematics" }
3)? False Let k = -16 + 31. Suppose r - 5 = k. Is 6/10 - (-968)/r a multiple of 15? False Let j = 52 + -45. Suppose 0 = jr - 684 - 828. Is r a multiple of 12? True Let q = 86 + 596. Is q a multiple of 62? True Is (3 - 66/42)/(4/5614) a multiple of 34? False Let v(y) = -10y + 224. Does 6 divide v(6)? False Suppose 3771j - 3776j = -1080. Is j a multiple of 18? True Suppose 2746 - 506 = 8g. Does 28 divide g? True Let s be (-6)/(8/(-12)3) + -72. Let d = 108 + s. Does 21 divide d? False Let m(w) = -w*2 - 29w - 94. Let c be m(-25). Let b = -158 + 226. Let j = b - c. Does 21 divide j? False Suppose 6n = 4n - 2. Let m(f) = 3f2 + 2f + 1. Let q be m(n). Suppose qw - 126 = -w. Does 21 divide w? True Let z(d) = 2d + 30. Let o be z(-14). Suppose -oy + 57 = 1. Does 28 divide y? True Let z(y) = y3 - 6y*2 - 2y + 17. Let i be z(6). Suppose -3o + 6o = -2q + 14, q + 45 = io. Is 2 a factor of o? True Let n(a) = -8a - 28. Let x(m) = 25m + 85. Let t(r) = -8n(r) - 3x(r). Does 5 divide t(-6)? True Let w(o) = -o*2 + 19o - 24. Is w(15) even? True Suppose -266 = -10z + 394. Does 11 divide z? True Let m(w) = -60w - 89. Does 9 divide m(-5)? False Let p = 2 + 6. Let x(f) = 3f + 10f*2 - pf*2 + 5f + 2. Is x(-7) a multiple of 11? True Let y = 147 - 144. Suppose yh - 172 = 248. Is h a multiple of 25? False Suppose 0 = -0c + 5c + 1590. Let o = c + 202. Let z = o - -164. Is 13 a factor of z? False Let i = 1474 + -890. Is 8 a factor of i? True Let w = -91 + 131. Is 8 a factor of w? True Let m(h) = 5h*2 - 8h. Suppose x - 12 = 3x. Let q(s) = 9s*2 - 15s. Let t(c) = xq(c) + 11m(c). Is t(-7) a multiple of 11? False Suppose 34t = 37t - 15. Suppose 188 = -w + tw. Is w a multiple of 9? False Let r(b) = -b3 - 8b*2 - 7b + 6. Let y(q) = -q*3 + 2q2 - q + 5. Let k be y(3). Let t be r(k). Is 11 a factor of (-1)/(-3) + 262/t? True Let l(i) = -i3 + 9i2 - 6i + 4. Suppose -10x = -6x - 12. Let h be (-7 + x)/(-16)28. Is l(h) a multiple of 20? True Does 16 divide (-11)/((-330)/7695) + 1/(-2)? True Suppose -k - 4k + 2075 = 5o, 2o = k + 830. Suppose o = 3m - 4t, -t + 143 = m - 0. Is m a multiple of 30? False Let z(l) be the first derivative of l6/360 + l5/12 + 3l4/8 - l3/3 - 5. Let k(y) be the third derivative of z(y). Is 8 a factor of k(-10)? False Let j = 6 + -3. Suppose 0 = -10k + 15k. Suppose q + 0q - j = k. Is 3 a factor of q? True Let j(k) = 5k + 10. Let x be j(-5). Does 11 divide ((-176)/(-10))/((-3)/x)? True Is ((-72)/(-10))/(14/35) a multiple of 2? True Suppose 2x - 4 = 3p + 13, 0 = -2x - 3p + 47. Suppose xq = 11q. Suppose 0 = v - 5h - 1, h + 21 = v - qh. Does 11 divide v? False Let d(l) = -8l + 3. Let s be (-20)/6 + 46/(-69). Is 7 a factor of d(s)? True Let s = -235 - -261. Is s a multiple of 26? True Let i = -11 - -7. Let t(u) = u*2 + u - 2. Let l be t(3). Is 2 a factor of ((-30)/25)/(i/l)? False Let h be (5 - (-3 - -9))(-141 + 0). Suppose 5o = -2b + h, 0 = b + 2o - 60 - 9. Is 21 a factor of b? True Let c(m) = 2m*3 + 20m*2 - 2m + 8. Let z(h) = h*3 + 10h*2 - h + 4. Let x(j) = -6c(j) + 13z(j). Does 15 divide x(-6)? False Does 18 divide (-4)/18 - 16460/(-36)? False Let t be (29/(-3))/((-6)/18). Suppose 4l - t = 39. Is 5 a factor of l? False Does 3 divide ((-5)/20)/((-37)/199652)? False Let i be 1 - (1/(-1) - -2). Suppose -5y + iy = -430. Is 6/27 + y/18 even? False Let k = -1735 - -1122. Let r = k - -906. Suppose 7p = 1 + r. Is 22 a factor of p? False Suppose 4c + 180 = -4i, -i + 2c - 60 = -0i. Let b = i + 62. Is b even? True Suppose -20 = g - 6g. Let c be (g - 1 - -48)-1. Let a = 83 + c. Is 12 a factor of a? False Let l = 55 + -51. Suppose z - 2w - 14 = 0, 0 = 4z - lw + 41 - 113. Is 3 a factor of z? False Let j(n) = -3n + 2. Let i be j(-8). Suppose -l = l + i. Let z = l - -20. Does 4 divide z? False Let w = 397 - 192. Suppose -204z - 26 = -wz. Does 13 divide z? True Let f(x) = x3 - 1 - 5x*2 + 10 - 2x*2 - 5x. Let j be f(8). Is 29 a factor of 963/33 + (-6)/j? True Suppose 6s + 8 - 128 = 0. Suppose 1844 = -sb + 4784. Is b a multiple of 7? True Let o be 4 + (1 + -2)1. Suppose 4x - 5x - 2c = -18, 4c - 44 = -ox. Does 2 divide x? True Is (28/(-56))/((-51322)/(-17108) + -3) a multiple of 28? False Suppose -2w + 6w - 32 = 0. Suppose -105 = wu - 11u. Does 12 divide u? False Suppose 3o - 6 - 3 = 0. Suppose 6g - 51 = og. Suppose g = i - 10. Is i a multiple of 13? False Let b(x) = -2x - 45. Let m be b(-24). Is 0 + 1/m + 624/18 a multiple of 5? True Suppose -3h = -79 + 244. Let x = h - -86. Let s = x - 15. Is 6 a factor of s? False Let q be 44/(-33)(-3)/(-2). Let x be (-2)/(-2)(-119 - q). Is 6 a factor of ((-4)/12)/(3/x)? False Suppose -3g = -6g - 153. Let q = -19 - g. Suppose -c + 12 + 26 = 3a, -3a = -2c - q. Does 12 divide a? True Suppose -21040 = -33h + 13h. Does 55 divide h? False Let s = 12 + -21. Let j = s - -12. Suppose -2h + 74 = 2p, 0 = jp - h - 111 - 16. Does 11 divide p? False Let r = -1524 + 1566. Is r a multiple of 42? True Let a(f) = -163f + 1. Let n be a(-1). Suppose -n = -4t + 260. Does 15 divide t/6(-6)/(-2)? False Suppose -2n + m = -0n + 300, 4m - 445 = 3n. Let c(f) = 10f2 + 4f - 7. Let t be c(5). Let b = n + t. Does 33 divide b? False Let m = -55 + 29. Let d = 0 - m. Does 25 divide d? False Suppose -4j - 2v + 133 = -977, -3j + 2v + 822 = 0. Does 6 divide j? True Let y(j) = -2j3 + 6j2 + 3. Let o be y(3). Let s(h) = h2 + 5h + 4. Let n be s(-4). Suppose 5w - ow - 138 = n. Is w a multiple of 17? False Is (10074/24)/1 - 1/(-4) a multiple of 20? True Suppose -3t + 6 = 2k - 5t, -k + 4t + 18 = 0. Let h be k/(-3)(-30)/20. Is 48/(-16)h11 a multiple of 5? False Suppose 32 - 522 = -3q + 2x, 810 = 5q - 2x. Is q a multiple of 8? True Let k(j) = -99j - 78. Let f(u) = -496u - 392. Let r(y) = -3f(y) + 16k(y). Is 51 a factor of r(-5)? True Suppose 0 = -2g - 4o + 30, -2o + 0 = 6. Suppose 4y + g = 5. Let s(t) = -t*2 - 5t - 1. Is s(y) a multiple of 3? True Let j be -94(3 + 3 + -5)/1. Let s = 156 + j. Is s a multiple of 10? False Let m = -19 - -28. Let y be (4 + (-20)/6)m. Suppose -v + 0v = -y. Is v a multiple of 2? True Let c(u) = 5u - 14. Let l(t) = -2t + 7. Let f(i) = 4c(i) + 9l(i). Let r be f(4). Suppose -4b + 75 - r = 0. Is b a multiple of 12? False Let a(i) = i*2 - 12i - 18. Let b be a(16). Let m = 82 - b. Is 18 a factor of m? True Suppose 3y + 21r - 584 = 16r, y = -4r + 190. Is y a multiple of 6? True Suppose -6l = -9l + 210. Suppose -23f + l = -22f. Let n = 142 - f. Does 18 divide n? True Let k(l) = -2l2 - 24l + 44. Is 5 a factor of k(-12)? False Let x = -7 - -28. Let g(i) = -i*3 - 11i*2 - 12i - 15. Let s be g(-10). Let r = x - s. Is r a multiple of 4? True Let n = -120 + 218. Does 7 divide n? True Suppose 2y - 142 = -0y. Let l = -33 + 143. Let f = l - y. Is 8 a factor of f? False Suppose 78v = 54v + 5808. Is v a multiple of 7? False Let r(n) = -12n - 1. Let x(q) = -11q. Let j(m) = -2r(m) + 3x(m). Let b(k) = 8k - 2. Let d(h) = 6b(h) + 5j(h). Is 6 a factor of d(9)? False Suppose -5i = -3p + 2p + 83, i + 5p + 1 = 0. Let y be (i/28)/(6/(-21)). Is 16 a factor of 0 + 1 + y + 36? False Let f(x) = x2 + 22x - 117. Is f(17) a multiple of 14? True Let g(x) = -189x3 + x + 2. Does 20 divide g(-1)? False Let o(h) = -2h*2 - 8h - 3. Let r be o(-3). Does 8 divide 5/5 + r + 17? False Suppose 0 = u - 4n - 77, -3u + 214 = 3n + 2n. Suppose -5o = -6o + u. Does 25 divide o? False Let t = 208 - 85. Suppose 2j - t - 29 = 0. Does 19 divide j? True Let v = 1223 - 1106. Is 8 a factor of v? False Does 16 divide 1823 + (-1 - -7) + (-45 - -40)? True Let t = 42 - 37. Suppose -tv - 2i + 178 = -112, -115 = -2v - i. Does 5 divide v? True Let y be 2/13 + (-2338)/(-13). Does 4 divide 1 + (y/(-3))/(-3)? False Suppose v + 15 = 2z, 3v + 5z - 1 - 9 = 0. Let a = v - -7. Suppose 4g + 0 = -5w + 8, 4w - 4 = -ag. Does 2 divide g? True Let y = -441 + 752. Is y a multiple of 18? False Let f(z) = -z3 + 6z*2 + 4z - 3. Let w be f(-3). Is 14 a factor of (2 - w/15)-20? False Suppose 48f - 1663 - 4673 = 0. Is 22 a factor of f? True Let y = 48 + -25. Suppose 0l - 3r	{ "pile_set_name": "DM Mathematics" }
Which is the nearest to v? (a) -3/7 (b) 1/8 (c) 3 b Let q be 2/20 - 0/1. Let m = -358/9 + 40. What is the closest to -1 in q, m, 0.2? q Let f = 7 - 8. Let d be 1 - f - (-6)/(-4). Let q = 0 - -4. Which is the nearest to -1? (a) d (b) q (c) -0.5 c Let q = -69 + 45. Let g = q - -22. Let p = -1265/2919 + 2/417. What is the nearest to -2 in p, g, 1? g Let r be 12/28(-2)/(-3). Let v = -6 + 33/5. Which is the closest to r? (a) v (b) -0.02 (c) -4 b Let d = 2562/1595 + -2/319. Let k = 2 - d. Which is the nearest to -2/3? (a) 1 (b) k (c) 2 b Let s = -20/21 + 2/3. Let f = 0.05 - 4.05. Which is the closest to s? (a) -1/4 (b) f (c) -2 a Let d = -0.3 - 0.7. Let u be 1(-15)/(0 + -3). Suppose 25 = -uw - 0w. Which is the closest to 0? (a) d (b) -3 (c) w a Let v = -5/2 - -2. Let o = -1/6 - 1/2. What is the closest to v in -0.5, o, 0.2? -0.5 Let l = 283/4 - 71. What is the nearest to -6 in l, 0, 0.2? l Let f = 14.5 - 14. Which is the nearest to 4? (a) -1/4 (b) -3 (c) f c Let d = 3/208 + -35/208. Which is the nearest to -1? (a) -2 (b) d (c) -1/4 c Let d = 0.02 + 0.08. Let q = -2.9 - d. Which is the nearest to -1? (a) 0.2 (b) q (c) 4 a Let k = -2.17 - -2.1. Let t = k + -0.13. Which is the nearest to 1/4? (a) t (b) 0.3 (c) -2 b Let f = -136.9 - -129. Let d = f - -8. What is the nearest to d in 0.3, 4, -4? 0.3 Let k = 8 + -4. Let i = 2.05 + -0.05. Which is the nearest to 0? (a) k (b) i (c) -0.4 c Let k(l) = l*3 + 12l*2 + 11l + 1. Let m be k(-11). What is the closest to m in 1, -3, -2/9? 1 Let f = 1.21 - 3.21. What is the nearest to -1/3 in -2/7, 1/3, f? -2/7 Let o = 0.9 - -0.1. Suppose -45 = 7g - 4g. Let h(z) = z + 17. Let t be h(g). Which is the closest to 1? (a) o (b) 4 (c) t a Let f be -2(5/12)/(-5). Let z(w) = w2 + w + 1. Let r be z(-2). Suppose h + 29 = 5y, h - rh - 2y = -2. Which is the nearest to 0.1? (a) f (b) h (c) -1/6 a Let z be 3/7-2 - 0. Let r = z + 4/21. Which is the closest to -1? (a) r (b) 4 (c) 3 a Let m = -21 + 25. Which is the closest to -1/4? (a) 5 (b) m (c) 0.1 c Let n be 2 - (1 + 0)/1. Let w be (-7)/(-12) + n/(-3). Which is the closest to 0.1? (a) 2 (b) w (c) 4 b Let q = 1 + -0.6. Let s be 5/((-70)/32) + 2. What is the closest to 2 in -0.4, q, s? q Let t = 30 - 47. Let w = t + 12. What is the closest to 0.2 in w, -6/7, 5/6? 5/6 Let u = -0.36 + 0.06. Let f(y) = y3 - 3y*2 - 5y + 4. Let n be f(4). Which is the nearest to -1? (a) -0.1 (b) n (c) u c Let x be (-5 + 360/66)2/5. Let n = -0.6 - -0.2. What is the nearest to x in -0.1, -1/2, n? -0.1 Let u = -29 - -25. Which is the nearest to -1? (a) -1/3 (b) 0.3 (c) u a Let f = -37 + 36.5. Let m = 1165/7657 - -1/589. Which is the closest to 1? (a) m (b) -4 (c) f a Let h = -74 + 293/4. What is the closest to 0.1 in h, -0.4, 0.3? 0.3 Let l = 0.02 - -0.08. Which is the closest to l? (a) -3 (b) 2 (c) -0.2 c Let i = 3.96 + 0.04. Let k = 0.6 + -0.3. Let t = 0.2 - k. What is the nearest to t in 0.3, 1, i? 0.3 Let p = -5.3 + 5. Let o = -3 - -8. Suppose -5m + 19 = -3v, -m + 4 = ov - 11. What is the closest to 3 in m, p, -2/9? m Let u be (-3 + (-22)/(-6))-3. Let n be (u/36)/1-2. Which is the nearest to 2/3? (a) 2 (b) n (c) -2 b Suppose 4v - 28 = 76. Let r be -2 + 3 + (-30)/v. Which is the nearest to 1? (a) -0.03 (b) 5 (c) r a Let i = -1304/7 + 186. What is the closest to -0.1 in 2, i, -1/10? -1/10 Let g be 34/9 - ((-12)/54 - 0). Which is the nearest to -0.2? (a) g (b) -2 (c) 8 b Let r = 3 - 5. Let n = r + 3. Let k = -11.79 - -11.29. Which is the closest to -2? (a) n (b) k (c) -0.4 b Let l = -41 - -41.1. Which is the closest to l? (a) 2/7 (b) -7 (c) 3 a Let j = 58 + -55. Let v be (-4)/(-6) + 5/(-15). Which is the closest to v? (a) 0.3 (b) 0 (c) j a Let j = 13.7 - 14. What is the nearest to 2/7 in -0.5, 5, j? j Let a be (3/15)/((-8)/10). Let g be (-4 - -2)/(-2)7. Let l be 10/g - (0 - -1). What is the closest to -1 in a, -5, l? a Let o = 89/7 - 13. What is the closest to 1/4 in o, -1/4, -1? -1/4 Suppose -3p + 48 = 12. Suppose 0u - 4u = p, -r + 14 = -4u. Which is the closest to 0.1? (a) r (b) -1/4 (c) 0.4 c Let h be ((-3)/(-10))/(3 + (-5)/2). Which is the closest to 0.1? (a) 4 (b) h (c) 2/3 b Let z = -0.1 + 0.04. Let y = z - -0.06. Let l = 13 - 9. Which is the nearest to y? (a) -3 (b) -5 (c) l a Let a(b) = -b*2 - b + 3. Let p be a(-3). Let v = 0.1 - 0.1. Let l = 0.2 + -0.1. What is the nearest to l in v, -1, p? v Let u = -0.2 - -0.2. Let s = -13 + 9. Let i = -7 - s. What is the nearest to u in 3/2, i, -2/7? -2/7 Suppose -2p + 5m + 3 = 18, 2p + 2m - 6 = 0. Suppose -5x - 10 = -2t + 7, 0 = -5x - 2t - 33. Which is the closest to 1/3? (a) p (b) 0.3 (c) x b Let i = -8.97 - 0.03. Let b = i + 11. Let h = -0.2 - 0.3. What is the nearest to 0.1 in -5, h, b? h Let o = 1.7 + 0.3. Let t = -17 + 16.88. Let z = 0.08 - t. What is the closest to z in o, -3, 2/7? 2/7 Let i = 0.05 + -0.05. Let y = 36 - 32. What is the nearest to i in -0.2, y, 3/5? -0.2 Let q(a) = -23a + 1. Let p be q(7). Let t = p + 1122/7. What is the closest to -0.1 in 0.2, t, 4? 0.2 Let p = 0.74 + 14.26. What is the nearest to -1 in 0.4, -2/7, p? -2/7 Let b = -35 + 31. What is the nearest to -1/3 in 0.3, b, -3/7? -3/7 Let h = -1.9 - -2. Let d(i) = -i2 - i - 138. Let l be d(0). Let t = l - -968/7. Which is the closest to h? (a) t (b) -0.5 (c) 2 a Let z = -54 - -55. Let r(h) = -h2 - 4h - 2. Let j be r(-4). Which is the nearest to -0.2? (a) -4 (b) z (c) j b Let l(r) = 2r*2 - r - 2. Let u be l(-2). Suppose -5z + 33 - u = 0. Let g be (-26)/70 + 5/(-25). What is the closest to -1 in z, -1, g? -1 Let q = 3.05 - 0.05. What is the closest to q in -0.5, 0.2, -0.2? 0.2 Let z = -12 - -12.5. Which is the closest to 2/5? (a) -0.3 (b) z (c) 5 b Let w = 32.2 - 32. What is the closest to w in 0, 0.7, 2? 0 Let m be (4/10)/(1/5). Suppose 0 = -mk - 3k - 25. Let v = 5 + -3. What is the closest to -1 in k, v, -0.4? -0.4 Let i = 0.127 - -0.073. What is the nearest to i in 5, 1/6, -2? 1/6 Let i = 4 - 4.1. Let f = 0.15 + 0.35. Which is the closest to i? (a) 1/9 (b) f (c) -3 a Let m(o) = o + 7. Let t be m(-4). Suppose -1 - t = -f. Let x = 2 + -4. Which is the closest to 2/3? (a) x (b) f (c) -3 a Let t = -21.4 - 4.6. Let y = t + 21. What is the nearest to 3 in 0.03, y, 5? 5 Suppose 3s - 4t - 29 = 0, 0 = -2s + t + 8 + 3. Let y = -0.2 + 0.4. Which is the closest to -0.1? (a) 0.1 (b) s (c) y a Let q = -0.5 + 5.5. Which is the nearest to -1? (a) -0.1 (b) q (c) 3 a Suppose 3s - 25 = q, 0 = -q - q - 2. Let t be 3/(-17)s/(-12). What is the nearest to 2 in 0, t, -0.4? t Let y(z) = z + 8. Let m be y(-6). Let u be (-2 - -1)m/(-2). Let r = -793/5 + 158. What is the nearest to u in -0.5, r, -6/11? -0.5 Let w = 9 - 3. Let q = w + 0. What is the nearest to 1 in q, -2/5, 2/25? 2/25 Let l = 73 - 67. What is the nearest to -1 in 1/3, l, 2/5? 1/3 Let s = -32 - -36. Which is the nearest to -2/7? (a) 0.08 (b) -2/21 (c) s b Let p = -4.02 - -0.02. Let y be 2 + 1/(26/(-56)). Let w = 2 - 1.9. Which is the closest to w? (a) p (b) y (c) 0.4 b Let z be -7 + 7 + (-6)/2. Let j = -1 - z. Let h be j(-22)/(-16) - 3. What is the closest to h in 1/2, -2, 0? 0 Let j = 1088/7 + -156. Which is the closest to -1? (a) 2 (b) j (c) -0.2 b Let u be ((6 + -4)/2)/4. Let o = 9 + -12. What is the closest to u in 2/21, o, 1? 2/21 Let k be (-3)/(-1 - 0/2). Suppose 2x - x = 1. Let p be 4/(-40) - x/(-2). Which is the nearest to p? (a) -5 (b) -0.3 (c) k b Let v = 36 - 182/5. Which is the nearest to v? (a) -1 (b) 4 (c) 1 a Let a = -23958/7 - -3672. Let p = a + -249. What is the closest to 0 in p, -3, 4? p Let f = -4 + 2. Let k be (-710)/24*(-1)/(-35). Let v = k - -5/12. What is the nearest to -1 in f, -3, v? v Let x = -15 + 15. Which is the nearest to 0? (a) -1/3 (b) -0.3 (c) x c Let r = -51/5 + 209/20. Which is the closest to -0.2? (a) r (b) 0.1 (c) -2/15 c Let w = -16 - -50/3. Which is the closest to 2? (a) -1/2 (b) 0.4 (c) w c Let n = -3.8 + 4. Let l = n - -0.8. Let s = l + -5. Which is the closest to -1? (a) -5 (b) -0.2 (c) s b Let u = 76/315 + 2/45. Let t be ((-1)/(-3))/((-16)/6). Which is the nearest to u? (a) t (b) 2/7 (c) 0.2 b Let	{ "pile_set_name": "DM Mathematics" }
s 1/221/84? 1/8 (-54)/(-189)14/(-4) -1 Calculate 4(-2)/(-36) + 1092/189. 6 Calculate 1 + (7/((-7)/4) - 1). -4 (-29)/((-87)/(-18)) + 8 2 (-12)/(-2 - -5)7/7 -4 What is ((-4212)/3744)/((-2)/4 + 1)? -9/4 -32 + (1 - -3) -2 Calculate (-3)/(-12) - (1 - 39/84). -2/7 Evaluate (6 - 8)/(0 + (4 - 9)). 2/5 Calculate (-2)/(-1) - (-39)/(-52). 5/4 Calculate 1 - (3 + (6 + -8 - 0)). 0 What is the value of ((-68)/136)/(-11/(-2))? -1 What is the value of 3(-4)/30(-245)/98? 1 Evaluate (-360)/252 + (-4)/7. -2 Evaluate 3/6-45/8. -5/4 1/((2/20)/((-11)/22)) -5 What is the value of (-572)/10582 + 522/74? 7 What is (((-6)/7)/(-3))/(216/(-504))? -2/3 What is the value of -2 + 2/2 - -1? 0 Calculate 6/(-8) - 26/8. -4 Calculate -8 - -6(-8)/48. -9 Evaluate 16/64(2 - 1). 1/4 4309/(-1529) - (0 + (-2)/(-11)) -3 38/76 + (-6)/4 -1 Calculate (0 + 5 + -8)-1. 3 Evaluate 49/((-91)/13) + 14. 7 What is the value of (-5)/((-25)/10) - (-48)/(-30)? 2/5 Calculate -14 + -43 + 41. -6 What is the value of 180/990 - (1 + 32/(-66))? -1/3 Calculate (-306)/810 - -42/(-36). -3/5 Calculate 115/25 + (-4)/(-10). 5 Calculate (-6)/(-6) - ((-38)/10 - -5). -1/5 (-8)/30(-6)/4 2/5 What is the value of (((-2)/80)/(-4))/1? 0 What is the value of ((-85)/20 + 5)(-5 - -9)? 3 What is the value of (9 + (0 - 5))/(-2) - -2? 0 Calculate (12/(-8))/1 - -1. -1/2 (-1056)/(-240) - (1 - -5) -8/5 -7 - ((-15)/(-18) + 11495/(-1482)) -1/13 Calculate (-20)/(-15)(-3 - (-9)/6). -2 Calculate ((-28)/42)/(7/6). -4/7 Evaluate -8 + 260/30 + (-1)/2. 1/6 What is (2/(-2))/(5/2)? -2/5 (-4)/(-1) - (-798)/(-210) 1/5 Calculate (-24)/(-40) - 34/(-10). 4 Calculate 21/(-84) - 2/(-8). 0 What is the value of (-5)/3(17 - 14)? -5 What is the value of 1 - (270/273 + 2/13)? -1/7 What is -2 + (-1)/22 - 0? -3 Calculate 4/(-14) + (-140)/(-245). 2/7 -1 + (-224)/(-147) + 2/14 2/3 (-231)/(-330) - (-2)/15 5/6 Evaluate -1 + 3 - 128/80. 2/5 -3 - -10 - (-1 - -14) - 2 -8 What is the value of (7 - 2)(-3 - (-3 + -1))? 5 What is (((-42)/(-18) - -4) + -7)1? -2/3 33/(-110) - (-1)/53 3/10 Calculate (3/(-12)0)/(-2). 0 What is the value of (120/(-200))/(8/(-5))? 3/8 Calculate (-3 + 1)/((-8)/(-4)). -1 Evaluate (0 + (-18)/20)150/360. -3/8 Calculate (1 - -5)/(-12)(-1)/(-2). -1/4 What is 1/(-6)(-12)/(-4) - -2? 3/2 (-10)/28(-20)/25 2/7 -10 + (1 + 4 - (6 - 6)) -5 Calculate (-36)/(-198) - 42/(-11). 4 What is the value of (-53 - -45) + 50/6? 1/3 What is the value of (0 - -3) + (-40)/16? 1/2 What is (-4)/48 + (-53)/(-212)? 1/6 -6 + 5/2 + 880/224 3/7 Evaluate 190/32 - (-49)/784. 6 What is (-203)/(-42) + -3 + (2 - 3)? 5/6 ((-62)/(-36) - 2) + 2/(-9) -1/2 What is (-8)/(-6)(-27)/24? -3/2 Calculate 150/42 + 8/(-14) + 0. 3 What is (2 - 2)(65/(-20))/(-13)? 0 2/(-2) - (8 - 5) -4 Evaluate (2 + 10)/(-6(-7)/21). 6 26/2 - (-168)/(-216)9 6 What is 0 - -8 - (23 - 17)? 2 12/2 + (37 - 45) -2 Calculate ((-33215)/(-598))/35 + 2/(-23). 3/2 236/28 + 0 - 15/35 8 What is the value of 37 - 24 - (-144)/(-11)? -1/11 Evaluate 234/2737/3. 2 Calculate (12 - 7)9/(-15). -3 What is the value of (-21)/5 - -6 - 2? -1/5 What is 2 + (-4)/10 + (-126)/(-90)? 3 Evaluate (-9)/2 - (-24)/48. -4 What is the value of -2 + (12/(-15) - -2)? -4/5 Calculate (-30)/24 + 2 + (-28)/16. -1 Calculate (-2)/2 + 1 - (0 + -1). 1 (59/(-177))/(171/(-6)) 2/17 (-63)/(0 - -9) - (-40)/5 1 (2/18)/((-20)/15)-2 1/6 What is -2 + 3 - (9 + -4 + 6)? -10 Evaluate (2 - 5) + 12 + 4 + -8. 5 What is the value of 0/((4/2)/(4 + -5))? 0 Calculate (-88)/(-22) - (4 + -1). 1 What is the value of ((-5)/(-2))/(1/2)? 5 What is the value of 20/12(-90)/(-25)? 6 Evaluate 3-180/60. -4 What is the value of (8 + 294/(-35))(-1)/2? 1/5 What is (-52)/20 + -1 - (-16 - -12)? 2/5 What is the value of 5 + -2 - ((-64)/24 + 6)? -1/3 Evaluate (1/(-6))/(-1 - (-1)/4). 2/9 Evaluate 2/(-6) - 39/(-117). 0 Calculate (-5 + 9/(-36)-13)4. -7 ((-2)/8)/(19/(-532)) 7 1/(-26/84) + 8 1 Calculate -3 + -2 + (-1)/(-1). -4 Evaluate (-3)/(-1) - (4 + 6/(-5)). 1/5 What is -3 + 1 - 2 - (13 - 13)? -4 What is 9 + ((-1824)/300 - 3)? -2/25 What is (-168)/126 + (3 - 14/(-6))? 4 21/33 + 20/55 1 Calculate -2 - -5 - ((0 - 2) + 5). 0 Calculate 3/(-15)(-20)/(-10). -2/5 Calculate ((-8)/(-24))/((-20)/(-24)). 2/5 Calculate (-1 - 2/6)(-72)/(-816). -2/17 What is (-6)/(-16)(-34)/51? -1/4 Calculate (-322)/(-84) - 21/7. 5/6 (-6)/(6-2)12 - 4 2 -41/8-2 1 What is ((-8)/(-16))/((-6)/(-4) + -2)? -1 Calculate ((-2)/18)/((-270)/324). 2/15 Calculate ((15/2)/3 - 2)6. 3 ((-1)/6)/((-30)/40) 2/9 What is -1 + -1 - (-372)/217? -2/7 (-2 - 15/(-6))/(7/56) 4 Calculate 48/4020/(-6). -4 Evaluate (46/72)/((-14)/6). -1/7 What is the value of 1184/2331 + 4/(-18)? 2/7 Calculate (3/5)/((-40)/(-400)) + -1. 5 Evaluate (-15)/(-3 - -6) - -2. -3 12/48(-1 - 3) -1 (-513)/99 - (-3 + -2) -2/11 What is (2/8)/((-3)/6)-4? 2 Calculate (-1)/(11 + (-12 - -6)). -1/5 What is 0 + -3 - (-55)/25? -4/5 Calculate 17 - 21 - (22/3)/(-2). -1/3 Evaluate (-85)/1022/5. -1/3 What is (-30)/(-18)(-9)/135? -1/9 What is 0(-3)/(0 + -3)? 0 Calculate -4 - 1 - 23/(-4). 3/4 Evaluate (-464)/812 + 1/7. -3/7 What is the value of (-10 - -5)2/(-6)? 5/3 Evaluate (-3 - -1)((-21)/27)/(-7). -2/9 What is the value of 160/(-96)2/4? -5/6 Calculate 2/(4/(-3)) + 176/32. 4 Calculate ((-45)/(-45))/(-6 + 0). -1/6 Calculate 1(-4)/3 + 528/72. 6 Evaluate 11/(-4) - 3/12. -3 -5(-9)/(-162)(-16)/20 2/9 Evaluate -8 + 1 - (-28)/(21/3). -3 What is the value of 4/(1 - 26/(-6))? 3/4 What is the value of -2(-1)/(-12)-4 - -1? 5/3 What is the value of (-4)/639/(-26)? 1 Calculate ((-50)/12 - 1) + (-16)/(-96). -5 What is -5(27/18 - 2/4)? -5 What is (-4)/(-3) - (-68)/(-42)? -2/7 What is the value of 1 + (18/(-27) - 0)? 1/3 Evaluate (-2 - -3)(1 + -1). 0 ((-146)/18 - (-8)/(-36)) + 8 -1/3 2/4 + (2 - (-15)/(-10)) 1 What is 2232/(-930)10/(-4)? 6 Evaluate ((-42)/(-280))/((-24)/(-15) + -2). -3/8 -2(2/10 - 16/(-1120)) -3/7 Calculate (60/105)/(44/(-14) - -4). 2/3 What is the value of (-2)/6 + (-544)/(-102)? 5 Calculate 8(30/(-48) + 5/40). -4 What is the value of (-3 - -3)/(9 + (-3 - 3))? 0 (2/(-10))/((-10)/100) 2 What is the value of 4 + (-1 - 1) - (-15)/(-12)? 3/4 Calculate ((-2)/(-7))/(-10(-18)/(-84)). -2/15 -4(5 + 314/(-64)) -3/8 What is (0 - 0)(0 + 4/(-8))? 0 What is 203/232 - (2/1)/2? -1/8 Calculate 0/(5 + (-6 - 0)). 0 What is the value of (-4)/((-2 - -1)/((-1)/(-2)))? 2 What is (-1 + -2)/(-3)-4? -4 What is (-15)/((-19)/((-190)/30))? -5 Calculate (-6)/(-30) - (-12)/140. 2/7 Evaluate -412/(-16)-1. -3 Evaluate 1 + 62/8 - (-4)/16. 9 What is the value of -4 + (-9)/(-6) + 3/(-6)? -3 Evaluate (-44)/105 + 20/150. -2/7 Evaluate (4 - 35/(-30)) + -5. 1/6 Evaluate 1 + (-64)/(-168) + (-10)/15. 5/7 What is (-4 - -1)/(5 + 1 + -7)? 3 What is -5 - 1/((-20)/170)? 7/2 Calculate (-300)/(-80)(36/10 - 2). 6 What is (2/4)/(-12 + 13)? 1/2 2/(-6) - (-6)/846 2/21 What is the value of 122/(-42) - (5 + -8)? 2/21 What is the value of (0 - -3)(-3)/15-5? 3 What is ((-2)/(-3))/((-7)/(-22 + 1))? 2 What is -1 + 7 + 27/(-9)? 3 What is the value of 1(0 - -1) + -6? -5 What is (3/4)/(27/(-90))? -5/2 17/6 - 0 - 3 -1/6 Evaluate ((-55)/297)/((-5)/6). 2/9 What is the value of 2 + (-1 - 0) + -1? 0 (2/(-2) + 5/6)-2 1/3 -5(12/(-18))/((-25)/(-3)) 2/5 (-172)/(-36) - ((-21)/(-27) + -1) 5 2/((7/28)/(2/(-4))) -4 (-1)/(-21/6) 3 What is 14 - (14 + -4)(-16)/(-20)? 6 137/(-24) + 6 - (-6)/(-9) -3/8 96/(-56)2/8 -3/7 What is (4 - (-65)/(-13))/((-2)/8)? 4 What is the value of ((-24)/52)/(41/(-533))? 6 Calculate 51/(-90) - 1/10. -2/3 (-4)/(-6) - ((-310)/(-105) - 2) -2/7 9 + 0 - (2 - 0) 7 Calculate -1 - (14 + -8)-1. 5 1/(-13)-4 - (-12)/(-78) 2/13 Calculate -4 + 13/(-3). -5 What is (-69)/69(-3)/(-4)? -3/4 Calculate (0 + 2)6/(-4). -3 Evaluate (45/(-10) + 6)(-2)/9. -1/3 Calculate (12/(-16))/(285/40 + -3). -2/11 What is (8 - (-1016)/(-128))(5 - 3)? 1/8 Evaluate (1 + 3/(-1))-1. 2 What is the value of -16((-170)/20 - -9)? -3 What is the value of (-2)/845 - 23/138? -2/7 (-28)/(-98) + 1(-48)/21 -2 1 - 4(-133)/84 - 7 1/3 What is the value of ((-2)/(-32))/(3/(-2) + 2)? 1/8 Evaluate 1 + ((-15)/(-3) - 4). 2 What is 1534/(-260) - (-1)/(-10)? -6 Evaluate (-41 - -47) + -9 + 0. -3 What is the value of (-48)/12075/10? -3 Evaluate (-85)/(-34)-8*2/100. -2/5 Calculate -4 + (-305)/(-35	{ "pile_set_name": "DM Mathematics" }
p(-130/3) Simplify d(-1/2)d(dd(4/7)dd)/d((dd19)/d)/dd/d1 assuming d is positive. d(295/14) Simplify (b0)(-5)bb*(-1)/b((bbb1)/b)/b assuming b is positive. 1 Simplify ((f/(f/(f(-2/69)/f)))/f)/f*(-2/43)(f(-3/4))41 assuming f is positive. f(-388469/11868) Simplify t(-11)t(t*(-1/3)tt)/tt*(-6/13)t2 assuming t is positive. t(-304/39) Simplify (rr(-6/11))6/(r(-3/2)/((r/((rr*(-4/7)/r)/rr))/r)) assuming r is positive. r(739/154) Simplify o4/ooo*10(o/(ooo/((o(-1/8)/o)/o)))/(o/(o/o(-4/3))o) assuming o is positive. o(245/24) Simplify (z/z0)(-15/8)(z/((zz(4/3))/zz))(2/15) assuming z is positive. z(-739/360) Simplify (tt5)6(t(-7))(-17) assuming t is positive. t155 Simplify (u(-1/5)/(u*(-3/5)uu))(-8) assuming u is positive. u(64/5) Simplify (w/(w/(w/(((ww*(1/2)/ww)/w)/w))))(1/32)/((w(1/27)/w)/(ww(3/11))) assuming w is positive. w(43387/19008) Simplify t/((((t(-10)t)/tt)/t)/t)t*13/t((((t/t*(-3)t)/t)/t)/t)(-48) assuming t is positive. t(-72) Simplify (dd(-3)d)*(-33)d/(d*5d)d(-1/15) assuming d is positive. d(419/15) Simplify ((v(-2/13)/v)/(vvv7v))/(v*(-8)vv(-2)) assuming v is positive. v(-28/13) Simplify ((b(3/5)/b(1/7))/((b/((b/(bb*(-6)))/bbb))/((b(-2/15)bbb)/b)))17 assuming b is positive. b(14858/105) Simplify ((z/z*(-12/7))/z)/(zz*11/zzz)(zz/(z/(z((zz(-1/9)z)/zz)/zz)))/((z(-19)/z)/z) assuming z is positive. z(857/63) Simplify (p(1/4))(-21)/(pp/(p(-2/9)/p))(-3/8) assuming p is positive. p(-97/24) Simplify (((y/(y(y(y/((y/((((yy*(-2/7))/y)/y)/y))/y)y)/y)/y))(-4))(-2/51))41 assuming y is positive. y(984/119) Simplify (r*(2/7)r)/(rr/r6r)((rr/r*(-2))/rr)(-22) assuming r is positive. r(-586/7) Simplify l*(3/13)l((l(3/14)/l)/lll)/l(ll(-1/30))/(l/(l(-11)/l)l) assuming l is positive. l(-17183/1365) Simplify t(-9)/tt(-23)t*(-1)/(tt(1/9)) assuming t is positive. t(-316/9) Simplify (k(2/19))(2/19)/(kk/(kk*(16/5))k)(-4/19) assuming k is positive. k(-436/1805) Simplify (((cc/((cc/(c/((c/c*(1/21))/c))c)/c)c)/c)/(cc(-31)))(-19/3) assuming c is positive. c(-12388/63) Simplify ((x(-1/7))(-30))40 assuming x is positive. x*(1200/7) Simplify l/((ll*(-6))/l)ll(-13)l0/l4 assuming l is positive. l(-9) Simplify (o/(o/(o(-2/9)o)))/ooo(-21)(o/(o/o*(-3/23))o)/(o/(o/(ooo/(o/(oo7))))) assuming o is positive. o(-6076/207) Simplify (xx*(-8/5)/xxxx)*50/((x/(xx*(1/9)xx))/(x/(x/x(-2/39)))) assuming x is positive. x(8431/117) Simplify (cc*(-18)c)/(c/(c/c*(-1/2)))(c/(ccc(4/3)))(-6/23) assuming c is positive. c(-685/46) Simplify w(-1/7)ww*(-3/7)(w1/w)(-45) assuming w is positive. w*(3/7) Simplify ((rr/(rr(-19)r))/rr/(r/(r(rr/(rr(r/(rr*14r))/r))/rr)))(-34) assuming r is positive. r(-1190) Simplify ((n/(n(2/21)/n))/n)(-6/19)((n(3/14)/n)/n)(-6/7) assuming n is positive. n*(61/49) Simplify (bb*(5/7)b6)/(b/(b/b(8/5))(bb/b*(3/10))/bb) assuming b is positive. b*(309/70) Simplify (((s/(s/(ss(-8/3))))/s)/s)(-2/101)/(ss/(((s(s/((ss(-6/11))/s)s)/s)/ss)/s)ss(-4/3)) assuming s is positive. s(-54/1111) Simplify ((d(2/3))(-44)/(dd/d*6d/(d/(d/(dd9))d)))(-12/11) assuming d is positive. d(184/11) Simplify (b*(-1/6)b*4bb(2/15)bbb(-1/13))(1/4) assuming b is positive. b*(2687/1560) Simplify q/(qq*(-9)q)qq*(3/8)(q(-2/3))(-20/13) assuming q is positive. q*(3245/312) Simplify (u/(u/(uu*17uuu)))/(uu7u)((u/u(-1/9))/u)41 assuming u is positive. u(149/9) Simplify (bb(1/14))(-16/5)((b(-18)bb)/b)/bbb(-6/17) assuming b is positive. b(-2473/119) Simplify p12pp4p/(p*3p)ppp1ppp assuming p is positive. p*20 Simplify (h/((h/(hh*(-1)h))/h))(23/5)/(h(-2/59)/(hh/(hh/h12))) assuming h is positive. h(6264/295) Simplify ((j(-13)/j)/j(-12/7))/((jj/j(-8))/j4) assuming j is positive. j(-128/7) Simplify (y/((y(-14)y)/y))37/(y/y20y(-28)) assuming y is positive. y602 Simplify ((((a/(aa*(-1/4)/a))/a)/aa)/aa)46/(a(-3)/a)(-2/25) assuming a is positive. a(559/50) Simplify ((l/(l/(l/(l(l*(-2)/l)/l))))/l(l*(-3/4)l)/lll*13/ll/(l/l0))(2/3) assuming l is positive. l*(61/6) Simplify vv*(2/7)v*(5/3)v*12vv8 assuming v is positive. v(503/21) Simplify (u(-1/4)(((u*(-36)u)/u)/u)/u)(-21) assuming u is positive. u(3213/4) Simplify (((y/(y/(y*0y)))/yy)(2/77)/(y(-10)/(yyy/y(1/16)yyy)))(-9/10) assuming y is positive. y(-177003/12320) Simplify (((z/(zz11))/z)/z(-8))/((z(z((zz/(z*(6/5)/z))/z)/zzz)/z)/z(4/5)) assuming z is positive. z(-6) Simplify (zz*(1/3)z)(-11/5)/((z/(z/(z/(z/(z/z6)z))))/zz)(6/13) assuming z is positive. z(-461/195) Simplify ((a*(-6/11)a)(4/9))(-1/2) assuming a is positive. a(-10/99) Simplify ((f(2/29)f)/(f(-20)/f))/(ff*(-25)f0/f) assuming f is positive. f(1365/29) Simplify (m/((m/(m/(mmm*(-10)))mmm)/m)m(35/6)/m)36 assuming m is positive. m426 Simplify (((uu/((u/u*(-19))/u))/u)/uu)/uu/(uu*(-10))u/((uuu*10u)/uu)u(9/4) assuming u is positive. u(-75/4) Simplify (gg(1/2))(7/9)/(g3)35 assuming g is positive. g(-623/6) Simplify ((k/(k/(k/(k15/k)k)kkk))(-16))(-43) assuming k is positive. k(-10320) Simplify (((w/w(1/3))/(((w/w(-3/16))/w)/w))/(w(-2)w1))(-5/6) assuming w is positive. w(-595/288) Simplify (s(-1)s(2/21)(s/((s/s(-1))/s))40)(-2/3) assuming s is positive. s(38/63) Simplify (k(-4))(11/6)kk/(k/(kk(-4)))k(k/(((k(k/k*(-2/13))/k)/k)/kk)k)/k assuming k is positive. k(-292/39) Simplify (((qq(3/7))/q(-3))(-1/12))(-15) assuming q is positive. q(155/28) Simplify u(-3)/(u((uu*(-12))/uu)/uuu)(uu*(-3/10))/(uu(2/47)) assuming u is positive. u(2659/470) Simplify ((jj/(j/j(-20)j)j)/j)(-2/13)/(((j(-2/27)/j)/j)/(jj32/j)) assuming j is positive. j(13040/351) Simplify ((c(c/c(-2/53))/cc)/(c*(-3)/c))/(cc*(1/5)c)3 assuming c is positive. c(-149/265) Simplify (f(-36)/((f(-1/27)/ff)/f))/((fff/(f(1/16)f))/(f/(f/f(-35)))) assuming f is positive. f(-31061/432) Simplify j*4j/(j/j*(-1/18))j*15/jjj(2/25) assuming j is positive. j(8561/450) Simplify (v/v(-6))39(v(-2))29 assuming v is positive. v215 Simplify (((g13g)/((g/g10)/gg))(-47))(4/31) assuming g is positive. g*(-4324/31) Simplify ((cc*(2/23)c)/c*10)/(cc/((cc/c(3/2))/cc)(cc(-13))/c) assuming c is positive. c(165/46) Simplify ((x/(xx/x2))/x)(-19/3)/((x2x)/xx)(-41) assuming x is positive. x123 Simplify (t/(t(1/18)t)t9/tt)/(t*(-22)t)(1/3) assuming t is positive. t(287/18) Simplify (l(-5))(-2/3)(l(-3/4))(2/151) assuming l is positive. l(3011/906) Simplify (aa*(2/61)aaaaaa/((a(a/a(2/115))/a)/a))(2/59) assuming a is positive. a(98914/413885) Simplify (o(-13)/oooo(-22)/o)(3/38) assuming o is positive. o(-105/38) Simplify (d(-8))8/((dd(-2/15))/d)46 assuming d is positive. d(-868/15) Simplify (y3y)(2/5)/((y(2/9)y)/(y10/y)) assuming y is positive. y(422/45) Simplify (c(-26)/c(2/7))/(c/(c/(cc5))c/(c/(c*(-24)/c))c) assuming c is positive. c*(-58/7) Simplify kkkk/k*(-2/35)k*(-3)k(-2)/k(-1/2) assuming k is positive. k*(-31/70) Simplify ((o/(oo(-12)))/(o(3/10)/o))/((o/(o/(o/o*(-9)o))o)/(o/(oo*(2/27)o))) assuming o is positive. o(-101/270) Simplify ((d(-2/53)d)/d(1/9))/(d(1/6)/((dd/((d/d*(5/7))/d)d)/d)) assuming d is positive. d(22697/6678) Simplify ((t/((t(-13)t)/t))17)(-3/7) assuming t is positive. t(-102) Simplify (f(-6/5))(17/2)/((f(-9/7)f)/(f/f*(3/7)fff)) assuming f is positive. f(-222/35) Simplify (w(5/3)w/w(-2/23))(6/11) assuming w is positive. w(380/253) Simplify (f/(f/(ff/(f/(ff/(ff/f*1))f)f)))(20/7)(f/f*(-16))/ff17 assuming f is positive. f(271/7) Simplify (kkk/(kk/((k/k*(-1/9	{ "pile_set_name": "DM Mathematics" }
0000 Let a = 1202.4529 + -1149.361. Let l = a - 52.81. Round l to one decimal place. 0.3 Let v(r) = 196 + 134500000r3 + 5r*2 - 5r - r*2 - 195. Let b be v(1). Round b to the nearest one million. 135000000 Let d = -10.5 - 157.94. What is d rounded to the nearest 10? -170 Let p be 0((-10)/15)/2 + 5. Suppose -5c = -pb + 26550000, 5310000 = 5c - 6c - 5b. What is c rounded to the nearest one hundred thousand? -5300000 Let f = -202 + 381. Let c = 174.1 - f. Round c to 0 decimal places. -5 Suppose 10r + 7r - 14221820 = 103r. What is r rounded to the nearest 1000? -165000 Suppose p - 2i - 13264 = 0, 59p + 5i + 26527 = 61p. Round p to the nearest 100. 13300 Let d(u) = -10u3 - 20u*2 - 25u - 1. Let p be d(-14). Suppose 3h = -p - 89831. Round h to the nearest 1000. -38000 Let q = 72 - 68. Let h = q - 4.25. Let a = h - -0.2489. What is a rounded to 3 dps? -0.001 Let h = -25452193 + 60292193. Round h to the nearest one million. 35000000 Let t = 519 - 517. Suppose s = tq - 4s + 6632015, -13263994 = 4q + 2s. Round q to the nearest 100000. -3300000 Let y(m) = 234236m*2 + 9m + 3. Let a be y(-3). Round a to the nearest one hundred thousand. 2100000 Let f(l) = 332l2 - 9l + 4. Let c be f(4). Suppose -c = -10r + 4r. Round r to the nearest 100. 900 Let l = -375 + 374.759. Let j = 1.177 + l. Round j to one dp. 0.9 Let u = 172.21 - 190.045. Round u to the nearest integer. -18 Let h = -5.7 - 0.8. Let t = h - 0.5. Let c = -6.985 - t. Round c to 2 dps. 0.02 Let m = -112.1 + 51.1. Let d = m - -60.8992. What is d rounded to three dps? -0.101 Let h = 108 + -5. Let g = h - 101.766. Round g to one decimal place. 1.2 Let c = 296.48 + -296.47983369. Round c to six dps. 0.000166 Let t = -387 + 387.000008324. Round t to six dps. 0.000008 Let f = -0.5578887 - -0.56075. Round f to 5 decimal places. 0.00286 Let z = 65 + -93. Let p = z + 28.08. Let f = -0.184 + p. What is f rounded to two dps? -0.1 Let b = 115.85 - 115.880005. Let a = -1.03 - -1. Let c = b - a. Round c to 5 decimal places. -0.00001 Let n = 0.146 + 0.006. Let a = 12.052 - n. Let y = -11.89953 + a. What is y rounded to 4 dps? 0.0005 Let t(y) = -y. Let r(v) = -6v + 13. Let a(s) = -2r(s) + 2t(s). Let i be (-1)/(248/(-186) + (-62)/(-42)). Let m be a(i). What is m rounded to the nearest ten? -100 Let a = -204.1 + 204.099965648. What is a rounded to 7 dps? -0.0000344 Let j be 15(15018/(-18) + 9 - -2). Round j to the nearest ten thousand. -10000 Let l = 6759.1847 - -1336.8058. Let n = -8089 + l. Let w = n - 7. What is w rounded to 3 dps? -0.01 Let y = 88229 - 88228.9999942611. What is y rounded to 7 decimal places? 0.0000057 Let p = -3175426532.95522888 - -3175426418. Let l = 0.04774112 - p. Let r = -115 + l. What is r rounded to 4 dps? 0.003 Suppose -4i - 3420 = -3q + 51239, 3q + 21 = 0. Round i to the nearest ten thousand. -10000 Let n be -20 - 24330880/5 - (-8)/(-2). Round n to the nearest 100000. -4900000 Let p = 7967.8 - 7967.26601. What is p rounded to 1 dp? 0.5 Let o = -11.9537656 + 12.0156. Let v = 73.0527344 - o. Let t = v + -73. Round t to three dps. -0.009 Let h = -10104 + 10103.9933521. Let g = -0.0067 - h. What is g rounded to 5 decimal places? -0.00005 Let c = -136271.192 + 135763. Let h = -511 - c. Round h to one decimal place. -2.8 Let n = 69311.17 + -68999. Round n to the nearest ten. 310 Let i = -3610 + 10419. Let d(o) = -8190o*2 - o. Let h be d(1). Let k = h - i. Round k to the nearest 10000. -20000 Let o = 0.335 - 151.335. Let x = -196.5 - o. What is x rounded to zero decimal places? -46 Let k = 0.348 + 17.352. Let f = 17 - k. Let m = f + -0.17. Round m to one dp. -0.9 Let m(z) = 4231z + 61. Let r(c) = 8461c + 123. Let n(y) = 7m(y) - 4r(y). Let f be n(5). Round f to the nearest one thousand. -21000 Suppose -x - 4g = 5 + 7, 0 = x + g + 24. Let o be 1 + 149584/x - (-8)/28. Let c = o - -351. Round c to the nearest one thousand. -5000 Let i = 13.6 - 122.6. Let v = -306.66328687 + 197.6632856. Let w = v - i. Round w to 7 dps. -0.0000013 Let b = -120971321.9 - -6303186.9. Let f = -114668204.0000114 - b. Let t = f - -69. What is t rounded to 6 dps? -0.000011 Let p = -10218.23324 - -10218. Let m = 0.239 + p. What is m rounded to four dps? 0.0058 Let t = 724.29982 - 724.3. What is t rounded to three dps? 0 Let n = -3549.0001257 + 3549. What is n rounded to 4 dps? -0.0001 Let s(h) = h - 2. Let i be s(6). Suppose iv - 5u = -43625, 4v - 13u + 14u = -43643. Round v to the nearest one thousand. -11000 Let g = 1366.3999993269 - 1366.4. What is g rounded to 7 decimal places? -0.0000007 Let n = -632 - -632.0896. Let r = 0.089595634 - n. What is r rounded to 6 dps? -0.000004 Let b(c) = -15c3 - c2 - 2c. Let i be b(-1). Suppose 4d - i = -0. Suppose du + 5941456 = 20741456. Round u to the nearest 1000000. 4000000 Let u be (-2 - 62488/6)(-19296)/12. Let k = 2 + 8. Suppose -5f - u = -kf. Round f to the nearest one hundred thousand. 3400000 Let u(g) = -761g + 13660. Let m be u(62). Round m to the nearest one hundred. -33500 Suppose 5n - 4y = 376474976, -n - 5y + 56239230 = -19055800. What is n rounded to the nearest 1000000? 75000000 Suppose g + 9 = -g - 3d, 2g + d = 1. Let m be (-72)/(-27) - 2/g. Suppose a - 2x + 5x = 541, -2x = ma - 1094. Round a to the nearest one hundred. 600 Let u = -623862908933021.0000024 - -623863115664932. Let o = u - 206732015. Let n = -104 - o. Round n to six decimal places. 0.000002 Let m = -2472.9988041 - -2473. Round m to 5 dps. 0.0012 Let n = 0.017543 + -0.01754205409. Round n to 7 decimal places. 0.0000009 Let p = -0.7043 - -0.761. Let j = p + -0.0568772. What is j rounded to 5 dps? -0.00018 Let u = -0.0205 + 0.2297. Let s = 0 - -0.2. Let c = u - s. Round c to three dps. 0.009 Let n = 391373.9999772033 - 391374. What is n rounded to seven dps? -0.0000228 Let d = -188.417 + 196.83. Let q = -8.409133 + d. Round q to three decimal places. 0.004 Let b = -55567.99897039 - -55568. What is b rounded to four dps? 0.001 Let n be 1/((-3)/6) + 20. Suppose -no - 881000 = -17o. Round o to the nearest 100000. -900000 Let f = 0.085075 - 0.10552. Round f to four dps. -0.0204 Let p = -6928970063.00000218 + 6928969403. Let s = -660 - p. What is s rounded to seven decimal places? 0.0000022 Let v be (-80)/(-4) - (-1 + -1). Let m be 2 + 48/(-22) - (-4)/v. Suppose -3q + 7q + 400000 = m. Round q to the nearest 1000000. 0 Let t = 373 + -206. Let n = t + -166.99837. What is n rounded to four dps? 0.0016 Let j = -24649 - -24656. Let y(s) = 0s2 - 6s*2 + 2s + 3 + 7s. Let g be y(j). What is g rounded to the nearest one hundred? -200 Let f = -20493.000004039 - -20493. Round f to 7 dps. -0.000004 Let g(r) = -152999r3 - r2 - 10r - 8. Suppose 12o - 6 = 15o. Let c be g(o). What is c rounded to the nearest 10000? 1220000 Let o = -268.9 + -46.8. Let g = 31.284 + 298.716. Let p = g + o. What is p rounded to the nearest ten? 10 Suppose -5o = -5t + 8082525, 140o + 4t - 1616520 = 141o. Round o to the nearest 10000. -1620000 Let i = -701.4459094 + 709.27592. Let a = -7.83 + i. What is a rounded to 7 decimal places? 0.0000106 Let q = 723.874 - 724. Let i = q - -0.12599105. Round i to 6 decimal places. -0.000009 Let z = 0.8 + -3.8. Let r = z + 40. Let b = r + -36.999948. What is b rounded to five decimal places? 0.00005 Let g = -48 - -56. Let l be (30400/(-12))/(g/(-48)). Round l to the nearest 1000. 15000 Let m = -9813001707681.2999926 - -9813004016994. Let i = m - 2309315. Let k = i - -2.3. Round k to six dps. 0.000007 Let l(c) = 508319c + 258. Suppose 0 = -2z - m + 35, -4z = -6z + 5m + 41. Let o be l(z). Round o to the nearest one hundred thousand. 9200000 Let r be 8572387/7 + 66/231. Suppose -23b + r = 15392627. What is b rounded to the nearest 100000? -600000 Let r = -32.5 + 32.6952. Let x = -0.1133 + r. What is x rounded to two dps? 0.08 Let h = 59201.1653 - 59204. Round h to one dp. -2.8 Let i = 1575 - -110. Let u = i + -3885. What is u rounded to the nearest 10000? 0 Let w = 13.36 + -1.16. Let b = w - -3.2. Let m = b + -15.59. What is m rounded to one decimal place? -0.2 Let m = -2.71008 - -2.7. Let y = -666.99 + 667. Let v = m + y. Round v to 4 dps. -0.0001 Let w(c) = -308c2 + 47c - 1. Let d be w(-3). Round d to t	{ "pile_set_name": "DM Mathematics" }
t b(p) = -p*2 - p + 3. Let g be b(4). Let x = g - -29. Let h = 16 - x. Calculate the least common multiple of h and 2. 4 Let k = 1231 - 951. What is the least common multiple of 35 and k? 280 Suppose -5w + 10w - 55 = 0. Suppose -3i = -16 + 4. What is the smallest common multiple of i and w? 44 Let f be 6/(-30) - 128656/7170. Let l = f - 11/478. Calculate the common denominator of (-4)/(-32) + 1/(-4) and l. 24 Suppose -2l = k - 14, -40 = -2k - l - 0l. Calculate the lowest common multiple of (-4)/(-1)-21-1 and k. 924 Suppose p - 31 + 10 = -5i, i = -5p + 9. What is the least common multiple of 2 and i? 4 Let x be -121/2-2. Let m = x + -14. Let i = 2 - m. Calculate the least common multiple of 8 and i. 8 Let t(a) = -a3 + 6a*2 - 4a + 4. Let j(r) = -r*2 + 4r + 6. Let o be j(4). Let w(m) = -m + 16. What is the smallest common multiple of w(o) and t(4)? 20 Calculate the common denominator of -29/147 and ((-2)/(-36))/(252/(-621)). 1176 Let c be ((-20)/15)/((-2)/3). Suppose -16 = -ci - 4. Let n = i - -6. What is the smallest common multiple of 2 and n? 12 Let m(g) = 22g + 64. Let r(f) = -7f - 21. Let z(u) = 2m(u) + 7r(u). What is the lowest common multiple of z(-5) and 88? 264 Let p = -52/25 + 691/200. Let h = 47361/7520 - -3/1504. Find the common denominator of h and p. 40 Let q(g) = -9g + 2. Let r be q(2). Calculate the common denominator of 2/4 + r/(-10) and 1/197/(-4)2. 10 Find the common denominator of -37/84 and 770/144 + (2 - 26 - -18). 504 Let d be ((-1491)/6 - -3) + 4. Let u = d - -1719/7. Find the common denominator of 33/26 and u. 182 Let a = -6135/16 + 384. Let g = -38020072/95 - -400206. Let h = 31/38 - g. What is the common denominator of h and a? 80 Let a(c) be the first derivative of c*3/3 - 5c*2/2 + 4c - 1. Let n be a(6). Let b = -2 + n. What is the smallest common multiple of 5 and b? 40 Find the common denominator of -13/12 and (-22)/((-55)/5) - 417/154. 924 Let v(s) = s - 12. Let d(l) be the second derivative of l*3/6 - 6l*2 - 2l. Let x(t) = 7d(t) - 6v(t). What is the lowest common multiple of 18 and x(16)? 36 Suppose 4l + 2k = 6k + 72, -90 = -5l + 2k. Suppose -2 = 3s - 8. Suppose 0v - sv = -12. Calculate the smallest common multiple of l and v. 18 Let c(q) = 65q - 421. What is the smallest common multiple of c(8) and 99? 99 Let a(d) = 3d*2 - 2d. Let s be a(-2). Suppose 5c - s = 4c. Suppose -m = -q - c, -39 = -m - 2q - 11. What is the lowest common multiple of m and 2? 20 Let r = 4/1295 - -145028/3885. Let c = r + -263/6. Find the common denominator of (-21)/4267/(-3) and c. 6 Suppose 529c - 528c = 12. Calculate the lowest common multiple of 21 and c. 84 Let m = -110 - -69. Let a = 57 + m. Calculate the least common multiple of 2 and a. 16 Let i(k) = -3k + 99. What is the least common multiple of i(28) and 579? 2895 Let a(t) = -t2 + 12t - 7. Let r(x) = 3x - 12. Calculate the smallest common multiple of a(11) and r(6). 12 Let i(y) be the second derivative of y3/2 - 4y*2 + y. Let f = 32 + -24. Calculate the smallest common multiple of i(f) and 20. 80 Suppose -22h + 23h = 2. What is the lowest common multiple of 232 and h? 232 Find the common denominator of (-110)/(-30)(-39)/180 and -5/132. 1980 Suppose -2v - 6v = 0. Find the common denominator of (4 + v)(2 + 145/(-110)) and 101/8. 88 Let i = -20 - -14. Let m = 15 + i. Let q(x) = x3 + 12x*2 + 12x + 15. What is the least common multiple of m and q(-11)? 36 Suppose 2q + q = p - 14, 3p - 30 = 3q. Calculate the lowest common multiple of 9 and p. 72 Let p(j) = -32j3 - j2 + 1. Let v be p(1). What is the common denominator of -51/2 and 6/v-58 + 0? 8 Let k = -263 + 343. What is the least common multiple of 50 and k? 400 Calculate the lowest common multiple of 126 and (44/5)/(112/140). 1386 Let c(m) = 4m - 13. Let x be c(4). Suppose 0 = 4w + 2r - 118, -xw - 12 = 2r - 103. Calculate the smallest common multiple of 30 and w. 270 Let i be (-4094)/9618 - (-4 - (-150)/42). Let f = i + 8875/19236. Calculate the common denominator of 23/24 and f. 168 Calculate the common denominator of -11/12 and -1 - ((-9)/(-10))/(231/805). 132 Calculate the least common multiple of 64 and (-1 + 4)/(60/320). 64 Let d(n) = n*3 + 14n2 + 1. Let p(a) = a2 - 1. Let h(r) = d(r) - 5p(r). What is the least common multiple of h(-9) and 10? 30 Let q = -12980/9 + 1444. Let n be (3 + -3737)/(7515/(-17)). Let f = -2/835 + n. Find the common denominator of q and f. 9 Let y(f) = f - 2. Suppose -4k = -k - 27. Let d be y(k). Suppose -5l = -p - d, 3l = -2l + 15. What is the smallest common multiple of 34 and p? 136 Let o(t) = 1686t*2 - 3. Let d be o(2). Suppose f = -5m - 5540, d = -2f + 5m - 4324. Let x = -33301/6 - f. Calculate the common denominator of 1/11 and x. 66 Let z(m) = -m*3 + 7m*2 - 5m - 4. Suppose 0 = 2f - 6 - 26. What is the least common multiple of f and z(6)? 16 Find the common denominator of -111/28 and (-99)/198 + 41/272. 1904 Let d = -59/106 + -251/2120. Find the common denominator of d and 53/12. 120 Let t(u) = -4u*3 + 2u*2. Let m be t(-2). Let r = 126 - 100. Let i = m - r. Calculate the smallest common multiple of i and 10. 70 Let w = 286 + -237. Calculate the least common multiple of w and 2. 98 Let d = -94/921 + 1717/296562. Find the common denominator of d and -13/21. 966 Let q = -901 + 1021. What is the smallest common multiple of q and 45? 360 Let p be -2582202/(-96) + 1. Let o = 12127 - p. What is the common denominator of 470/4415/(-75) and o? 264 Suppose 2v - 3v = 21. Calculate the lowest common multiple of 16 and (0 + v/2)/(33/(-44)). 112 Let c(o) = 2o*3 - 23o*2 - 88o + 2. Let i(b) = -b + 9. Calculate the least common multiple of i(6) and c(-3). 15 Let y = -214 - -234. Calculate the lowest common multiple of 2 and y. 20 Calculate the common denominator of (-2)/(-12)2196/60 and (-459)/124/(-66). 110 Suppose 2r - 5n + 103 = 412, 0 = 4r + 3n - 579. Calculate the smallest common multiple of r and 21. 147 Let w = -1799 - -17869/10. Calculate the common denominator of w and (-25)/(-30)258/20. 20 Let n(p) be the second derivative of 14p*3/3 - p. Let z be n(-1). Let x = -14 - z. Calculate the lowest common multiple of 16 and x. 112 Suppose q - 2 = -0q, 4u = 3q + 24226. Let l = -36215/6 + u. What is the common denominator of 103/20 - (-4)/8 and l? 60 Let c(s) = 9s3 - 2s + 4. Let z be c(3). Suppose -2m + 61 = -3m + f, 0 = -4m + f - z. What is the common denominator of 6/(-36) - (-458)/m and -49? 5 Suppose 9a - 4a + y = -13, -2y - 16 = 5a. Let t = -273769/18 + 15203. Calculate the common denominator of 1313/52(-1)/a and t. 72 Find the common denominator of 1943/116(-4)/9 and -107/450. 450 Let h be (-13 + 9)23/(-4). Let j = h - 7. What is the smallest common multiple of (-12)/(-4)1 - 3 - -20 and j? 80 Let l(s) = 4s2 - s + 6. Let x(u) = u2 - 1. Let c(o) = l(o) - 3x(o). Calculate the smallest common multiple of c(0) and 27. 27 Let m = 39721/16860 - 5/843. Find the common denominator of 41/38 and m. 380 Find the common denominator of (-1713)/(-272) - (-36)/(14 - 20) and 25/128. 2176 Let o = -470713/24 + 56585/3. Let r = 745 + o. What is the common denominator of r and 29/8? 8 Let q = 130 + -87. Find the common denominator of (-897)/135 + 2/(-15) and q/(-5) + 3/3. 45 Let f(w) = -w3 + 6w*2 + 7w + 2. Let n be f(7). Suppose nv - v = 0. What is the common denominator of -81/14 and v - (-2 - 46/12)? 42 Suppose 0 = 2o - 7 - 23. Let x = 8369 - 8360. Calculate the least common multiple of x and o. 45 Let l = 85 + -108. Let g(m) = -m*2 - 21m + 47. What is the smallest common multiple of g(l) and 5? 5 Suppose -2t + 11 = -5. Suppose 6h + 2 = 26. Calculate the smallest common multiple of t and h. 8 Suppose 3d - 24 = 138. Let u = 55 - d. What is the lowest common multiple of u and 11? 11 Let s = 419 - 411. What is the lowest common multiple of s and 29? 232 Let p = -3 + 7. Suppose pi - 2i = 20. What is the lowest common multiple of i and 9 - 0 - (-10)/5? 110 Let j = -6/5363 + -380653/107260. Calculate the common denominator of j and (-213)/(-15)(-10)/4. 20 Let b = 7/704 - -14601/704. Let q = -4/6317 - 840113/75804. Calculate the common denominator of q and b. 12	{ "pile_set_name": "DM Mathematics" }
37)))/n assuming n is positive. n(-125/259) Simplify (d1)(-10)/(d(-1/3)d)28 assuming d is positive. d(-86/3) Simplify (kk(k/(k/k(-1)))/k)(-6/13)/((k/((k/((((k(3/5)k)/kk)/k)/k))/k)k)/k(kk(-4))/k) assuming k is positive. k(17/5) Simplify (oo/o3)3 assuming o is positive. o(-3) Simplify (ii1)(-26/5)i(4/9)i/i(-5/3) assuming i is positive. i(-328/45) Simplify (x(2/11)/((x/(x6x))/xx))/(x(2/9)/x)(7/2) assuming x is positive. x(1763/198) Simplify (k18)(1/4) assuming k is positive. k(9/2) Simplify s*3/ss*(-21)s assuming s is positive. s(-18) Simplify ((x(6/5)/x)/((xx/x16)/x))(-21) assuming x is positive. x(-1596/5) Simplify (i/(i/i6))/i(-1/2)(ii4i)/i(3/2) assuming i is positive. i11 Simplify b*(5/7)/((bb(-6))/b) assuming b is positive. b(47/7) Simplify s/(s/(s*(-9)s))sss(s((s/(s/(s/s(-13)s)))/s)/s)/ss assuming s is positive. s9 Simplify (z(-5)z(-9))/(z(-1))(-1/7) assuming z is positive. z(-99/7) Simplify (kkk*6kk)/kk13 assuming k is positive. k22 Simplify (m(5/6))(-8/13) assuming m is positive. m(-20/39) Simplify ((s(-2)/s)(-1/48))(-10/13) assuming s is positive. s(-5/104) Simplify d(-2)/dd(7/2) assuming d is positive. sqrt(d) Simplify (vv*(-2/7)/vvvvvv(-3))/(v(-1))(-32) assuming v is positive. v(-219/7) Simplify (kk(k/(k/(kk(-1/4)k)))/k)/(kkk*5)(k/(kk(-1)))(2/55) assuming k is positive. k(-927/220) Simplify (r5r3)(-2/157) assuming r is positive. r*(-16/157) Simplify yyyy/(y*(-14)/y)y(6/7) assuming y is positive. y(139/7) Simplify (z(-2/5))(1/14)/((z/(zz(-9)))/z(2/3)) assuming z is positive. z(-878/105) Simplify (o/o(9/5)o(3/11))50 assuming o is positive. o(-290/11) Simplify (y/(y(-2/7)/y))/(y/(yyy/(y/(y/(y*(-1/17)y))))) assuming y is positive. y(398/119) Simplify ((f(1/2))(-26))(11/3) assuming f is positive. f(-143/3) Simplify ((n/(n(-14)nn))/(nn/(nn(-5))))(19/2) assuming n is positive. n(133/2) Simplify v(-4/3)v(11/3) assuming v is positive. v(7/3) Simplify (s13/((s/s(-4/11))/s))16 assuming s is positive. s(2224/11) Simplify (r1)35/((rr/(((r/(rrrr/(r/(r/r5)r)r))/rr)/r))/(rr0rr)) assuming r is positive. r37 Simplify (kk(-2/7))/k4 assuming k is positive. k(-23/7) Simplify (((x0x)/x)34)16 assuming x is positive. 1 Simplify (u(5/7))(-32) assuming u is positive. u(-160/7) Simplify (q/q(-1/5))(-2/47) assuming q is positive. q(-12/235) Simplify ((((jj*14j)/j)/j)/j(-4/7))16 assuming j is positive. j*(1632/7) Simplify (b/(bb/(bbb*(2/25))b)b)/bb/b*(1/5)bb(-2/3)/(b(2/3)b) assuming b is positive. b*(-34/75) Simplify ((ww(-2/5))/w)/w7(w/w(-1/3))/w(-4) assuming w is positive. w(-31/15) Simplify w(-30)/(ww/(ww13)www) assuming w is positive. w(-21) Simplify (h(-6))(2/45) assuming h is positive. h(-4/15) Simplify ((uu7)/(uu*(3/4)u))(-1/10) assuming u is positive. u(-21/40) Simplify ((((a/a2)/a)/a)/a)47a6a*(-1/2)aa assuming a is positive. a(-361/2) Simplify (y/(yy(3/4)))(-30) assuming y is positive. y(45/2) Simplify t34t44 assuming t is positive. t78 Simplify j(-3/26)jjj(-6/19) assuming j is positive. j(775/494) Simplify (ff(-1/16))/(f/f(2/5)) assuming f is positive. f(27/80) Simplify cc*(-6)c(-9/8) assuming c is positive. c(-49/8) Simplify (j*(-8)j7)(1/20) assuming j is positive. j*(-1/20) Simplify f/(ff*(-2/21))f(f/f4)/ff((ff/((f/(f/(f(3/2)/f)))/f))/f)/(f(-7)/ff) assuming f is positive. f(277/42) Simplify (l(-1/6)ll/l(-2/5)l)/(l/l1)36 assuming l is positive. l*(97/30) Simplify ((nn7)/(n(2/7)n))/((nn/(n*(-6)n))/(n(n/((n6n)/n))/n)) assuming n is positive. n(-37/7) Simplify (y/(y/(y(-1/4)/y)))(1/11)/((y0y)/(y/y4)) assuming y is positive. y(-181/44) Simplify (s/(s(-1/19)/s))(-40) assuming s is positive. s(-1560/19) Simplify (xx/x*(1/3))/(x/(xx1)) assuming x is positive. x(8/3) Simplify ((z/(z/z(1/5)))/z(-2))/((z/(z2/z))/z)(1/11) assuming z is positive. z(126/55) Simplify g(3/7)/ggg*(20/3)g assuming g is positive. g*(170/21) Simplify (s/(ss*(-12)/s)sss)/s(1/19) assuming s is positive. s(303/19) Simplify (uu(-17)uu(4/15))2 assuming u is positive. u(-442/15) Simplify ((u/u(-1/8))/(uu/(u*(-1/2)u)))/(u8/u6) assuming u is positive. u(-19/8) Simplify (o(1/11)o)(5/4) assuming o is positive. o(15/11) Simplify (mm/((m/m*(-1))/m)m)*(14/3)(mm(3/4))/mmm(-6)/m assuming m is positive. m(49/12) Simplify (v0v)(-32) assuming v is positive. v(-32) Simplify (((j4/j)/j)/j)/(j(-3/8)jjj)(j/j*(-5))/jj*4j assuming j is positive. j(67/8) Simplify (u(-5/12))(-6/19) assuming u is positive. u(5/38) Simplify (m(-14/9))(5/2) assuming m is positive. m(-35/9) Simplify (r(-7/5)/r)(-1/8) assuming r is positive. r(3/10) Simplify ((i/(iii/(i/i*(-22))i))/ii)(18/11) assuming i is positive. i(360/11) Simplify (f/(f7/f))/ff/(f*(-5/6)/f)f(3/5)/(f/(f/((f/(f/f(3/5)))/f))) assuming f is positive. f*(-13/6) Simplify (ii/(i*(-21)i))/ii/i(-1/38) assuming i is positive. i(837/38) Simplify (((v/(v/(vv/(v(vv/(vvv/((v/(vv/(v/(v(vv(5/3))/vv))vv))/v)v)v)/v))))/v)/(v/(vv(-5))))(-2/17) assuming v is positive. v(-22/51) Simplify b(-15/4)/(b/(bb(2/19))) assuming b is positive. b(-277/76) Simplify (r*(-2/7)r(2/3))(-13/6) assuming r is positive. r(-52/63) Simplify (f1/(f/f3))(-8/9) assuming f is positive. f(-8/3) Simplify z/z24z(-2/7) assuming z is positive. z(-163/7) Simplify b(2/17)bbb/(bb(2/9)b)(bb*(-3/5)bb)/(b((b(2/15)/b)/b)/b) assuming b is positive. b(3949/765) Simplify ((z/z(-3))/((z(-1/17)/z)/zz))(-25) assuming z is positive. z(-2150/17) Simplify ((i/i(4/5)i)/i2)(25/2) assuming i is positive. i(-10) Simplify (y(1/10)/y5)(-18) assuming y is positive. y(441/5) Simplify g(19/5)gg(-36) assuming g is positive. g(-156/5) Simplify ((t/((tt/(t/t(-5/2)t))/t))/t9)(-35) assuming t is positive. t(315/2) Simplify (l(-6)/(l/(l(l/(l/l(-5/2)))/l)))2 assuming l is positive. l(-19) Simplify g(1/5)g*(2/23)gg(2/3)/gg*(-2)g assuming g is positive. g*(-16/345) Simplify (tt(-9/2))/(t(-14)/t) assuming t is positive. t(23/2) Simplify (u(-2/5))*(8/17)/(uu*0uu)(2/13) assuming u is positive. u(-718/1105) Simplify ((d(-2/3)d)/d*(2/23))/(dd(2/7))(30/7) assuming d is positive. d*(-17797/3381) Simplify (s(s(-7/2)/s)/s)(-39) assuming s is positive. s*(351/2) Simplify ((h((h*1/h)/hh)/hh)(-41))(-19) assuming h is positive. h779 Simplify (w12(w/(w*(-1/35)w)w)/ww)(-9/5) assuming w is positive. w(-4104/175) Simplify f(-7)/(f/(f/f(4/7)f))(((ff(1/3))/f)/f)/(f/f(-8)) assuming f is positive. f(-341/21) Simplify (rrr(2/11)r)(-30) assuming r is positive. r(-1050/11) Simplify qqqq(-14)qqq(3/4) assuming q is positive. q(-33/4) Simplify (c(5/3))(-1/45) assuming c is positive. c(-1/27) Simplify ((o(-3/5))(-47))9 assuming o is positive. o(1269/5) Simplify ((k(2/3))(2/125))(-21/5) assuming k is positive. k(-28/625) Simplify (k(-20)k)/(k(8/11)kk) assuming k is positive. k(-239/11) Simplify (hh(-3/16))(-9/4) assuming h is positive. h(-117/64) Simplify (c(-3/8)/c(6/7))/(c9c(-9)c) assuming c is positive. c(-125/56) Simplify m9/(m/(m/(m/m*(-23)))m) assuming m is positive. m*(-16) Simplify ((v/((vvvv(-1/28))/v))/v)/v(-1/4) assuming v is positive. v*(-12/7) Simplify ((t((t*6t)/t)/t)/t(-1/25))(-1/10) assuming t is positive. t(-151/250) Simplify x(-12)/xx(1/13)/x assuming x is positive. x(-181/13) Simplify (((m/m(2/25)m)/mm)(3/4))(-2/77) assuming m is positive. m(-72/1925) Simplify (v(29/3)v)/v(-2/41) assuming v is positive. v(1318/123) Simplify rr/(rr*(8/11))r((rrr(10/7))/rr)/rr assuming r is positive. r*(362/77) Simplify (t	{ "pile_set_name": "DM Mathematics" }
/5, -3/5, b Let w be (-24)/(-10) + 0 + -2. Let n = 47.8 + -53. Let y = n + 5. Sort -5/6, y, w in descending order. w, y, -5/6 Let b = 2/7 - 31/84. Put -3, -0.4, b in descending order. b, -0.4, -3 Let x = -1/45405 - 13141/90537570. Let v = x + 173977/2991. Let r = -58 + v. Sort r, 5, 0. 0, r, 5 Suppose 4q + 5w + 10 = 0, -2q - w + 7 = -3q. Let l(t) = -t - 8. Let y be l(-4). Sort q, y, 2. q, y, 2 Let m = 0.07 + -5.07. Let x = 0.082 - 0.082. Sort m, x, 5 in ascending order. m, x, 5 Let i = -25 - -25. Suppose -c - 4c = i. Put c, -5, 4 in descending order. 4, c, -5 Suppose -2u - 7u = -9. Put -2, 9, u in descending order. 9, u, -2 Let v = 85 + -70. Sort 0.4, v, -2/17 in ascending order. -2/17, 0.4, v Let f be (1/(-2))/((-2)/16). Suppose 18 = fc + 2. Sort 2/11, -2, c in increasing order. -2, 2/11, c Let i(j) = -j*3 + 7j*2 - 6j. Let r be i(6). Suppose -3 + r = -s. Put 2, 4, s in descending order. 4, s, 2 Suppose 3f = -2f - 2d - 15, 0 = -2f - 2d - 6. Let g be f/108/6. Let x be -3 + ((-324)/96)/((-2)/2). Sort g, -2, x in decreasing order. x, g, -2 Let k = -2 + -2. Let y = k + 7. Let s be 3 - ((-9)/(-2) + 0). Put s, 1/4, y in descending order. y, 1/4, s Suppose -4u = 4l - 24, -3l - 5u - 12 = -36. Let p be (-5)/l - 5/15. Suppose 4y - 2 = -14. Sort p, -4, y in ascending order. -4, y, p Let j be 66/55(-5)/(-2). Sort 5, 4, j, -7 in increasing order. -7, j, 4, 5 Suppose -3 - 12 = -3u. Sort 4, 0, u, -5 in decreasing order. u, 4, 0, -5 Suppose a = -0a. Let h = 0 - a. Sort 2, h, -5 in decreasing order. 2, h, -5 Let o = -0.7 - 0.3. Let n = -0.17 + -4.83. Let b = n + 7. Put b, o, 2/3 in ascending order. o, 2/3, b Let i = -36 - -110/3. Sort i, 5, 0.2, 0 in increasing order. 0, 0.2, i, 5 Suppose -5h + 2o + 4 = -52, 12 = -4o. Suppose 2a + h = -0a. Put 2, a, -4 in decreasing order. 2, -4, a Let o = 19.1 + -18.6. Put -0.8, o, 4 in decreasing order. 4, o, -0.8 Let j(t) = 3 - 1 + 4t2 + t3 + 0t2. Let d be j(-4). Suppose i = 2f + 7, i - 4i - 4f - 29 = 0. Sort d, i, 0. i, 0, d Let p = -19.9 + 19. Let n = p + 0.5. Sort 0.1, -1/7, n in descending order. 0.1, -1/7, n Let g(z) = -z3 - z2 + 1. Let u = -7 - -8. Let h be g(u). Put -3, h, 3 in decreasing order. 3, h, -3 Let t be 57/(12/(-32)-4). Sort 3, t, 1, 4. 1, 3, 4, t Let r be ((-14)/105)/(-2 - (-23)/10). Put r, -3/7, 1 in descending order. 1, -3/7, r Suppose 2v = 2i, 0v = -v + 3i - 8. Let o be 2/v - (-18)/(-4). Put 4, -3, o in decreasing order. 4, -3, o Let s = -245 - -2207/9. Let v = -544579 + 21236287/39. Let y = -176/3 - v. Sort s, y, 0.3. y, s, 0.3 Let m(i) = i2 - 5i + 2. Let t be m(5). Let v = 11/6 - 2. Sort -0.1, t, v in descending order. t, -0.1, v Let p = 3.9 + -6.9. Sort p, 1, 4, 0.4 in decreasing order. 4, 1, 0.4, p Suppose 9y - 10y + 20 = 0. Suppose -5b + 2f - y - 8 = 0, -b - 3f + 8 = 0. Sort -5, 4, b in increasing order. -5, b, 4 Let g be 5 + -4 - (-2 + -7). Suppose 2r = -3s - g, -2s - 4 = -s + r. Put s, -4, 1 in descending order. 1, s, -4 Let h = -1 + 1. Let z = 9 - 19. Let p = z - -9. Sort h, -2, p in increasing order. -2, p, h Suppose -2z - 14 = 5z. Sort 5, z, -4, -17 in decreasing order. 5, z, -4, -17 Suppose 0t + 3t + 4o + 5 = 0, 47 = -5t + 3o. Let r(p) = p + 9. Let y be r(t). Let m = 10 - 6. Sort m, -2, y. -2, y, m Let p(s) = 13s*2 + 20s - 11. Let i(m) = 7m2 + 10m - 6. Let a(c) = 11i(c) - 6p(c). Let z be a(-10). Put z, 2, -4 in increasing order. -4, z, 2 Let w = 5 - 4. Let r = -5 + w. Sort 0, r, 2 in ascending order. r, 0, 2 Let x(i) = -6i - i2 - 3 + 0i + 0. Let n be x(-4). Let a be -1((-6)/(-21) - 26/(-7)). Sort 0, a, n in descending order. n, 0, a Let q be (-4)/(-6)(-5)/2. Let n be (-106)/(-22) + (-10)/(-55). Sort n, q, 0.1 in descending order. n, 0.1, q Let s be (-2)/6 - 31/(-3). Put 5, -2, s, -5 in descending order. s, 5, -2, -5 Suppose -4l = -g - 3, -4l - l + g = -5. Let u = 0.04 - -0.26. Let f(r) = r*3 - 5r*2 + r - 5. Let x be f(5). Put x, u, l in decreasing order. l, u, x Let f(o) = 2o + 1. Let g be f(2). Suppose -gw + 1 = 2l - 4, 4l - 2w + 26 = 0. Let v(i) = -i - 5. Let u be v(-6). Put l, u, 5 in descending order. 5, u, l Let n = 128 + -1662/13. Let u = 0.1 - 0.5. Let b = -0.06 - -0.06. Put u, n, b in ascending order. u, b, n Suppose -n - 3 = n - 3m, 4n + 2 = 2m. Suppose 2o = 3s - no + 23, s + 5o = 15. Sort 2, s, -1 in increasing order. s, -1, 2 Let p(n) = 2n*3 - 11n*2 + 7n - 6. Let q be p(5). Put 5, -33, q in decreasing order. 5, q, -33 Suppose -2d + 0 - 16 = -2x, 3d + 3x = 0. Let u be 22/4 + 2/d. Let z be 1/(-3) + (-2)/3. Put z, 4, u in increasing order. z, 4, u Let r = 27 - 27.2. Let d = -0.3 - 1.7. Sort d, 4, r in decreasing order. 4, r, d Let t be -3(-2)/(1 - 3). Suppose -p - 6 = 2p. Let m be (-1)/4 - 3/(-4). Sort t, m, p. t, p, m Let g = -47 - -42. Put 0.03, -2, g in ascending order. g, -2, 0.03 Let k = 37 - 35. Sort k, -9, -5 in descending order. k, -5, -9 Suppose -2w = 3w - 20. Suppose -3t + 14 = -h, -4t - 23 = 2h - 9t. Put w, -3, h in descending order. w, h, -3 Let z(t) = 5t. Let m be z(-1). Let q = m + 2. Sort -1/4, q, -2/3 in decreasing order. -1/4, -2/3, q Let d(p) = p. Let k(x) = -4x. Let v(q) = -10d(q) - 2k(q). Let u be v(-1). Put u, -4, 3 in descending order. 3, u, -4 Let q = 1.5 - 2.5. Sort 5/6, q, -5. -5, q, 5/6 Let v = -1.79 - 0.21. Sort v, 5, 6. v, 5, 6 Let r = 3 - 1. Suppose -6t + t + 33 = -rj, 20 = 4t. Suppose 2h - 4 = 4f, f - 1 = -4h - 2. Sort -2, j, f in increasing order. j, -2, f Let b be -3 + 7 + 14/2. Suppose -2u + 2s = s - b, -5s - 40 = -5u. Sort -3, u, 0.04. -3, 0.04, u Let c = -42 + 37. Put -4, 0, c in descending order. 0, -4, c Let a be (-8)/(-12) + (-42)/9. Put 1, -3, 0, a in increasing order. a, -3, 0, 1 Let h(y) = -y*3 - 7y*2 + 10y + 12. Let a(b) = 2b3 + 14b*2 - 20b - 24. Let t(m) = -3a(m) - 5h(m). Let j be t(-8). Put -1, 4, j in increasing order. j, -1, 4 Suppose b = 3k - 3, 5b - 4k + 4 = -0k. Put -4, 3, b in increasing order. -4, b, 3 Suppose 4h + 4 = 4l, 0l + h - 7 = -3l. Let r be (-10)/(-20) - (-2)/(-4). Sort r, 5, l in decreasing order. 5, l, r Let l be (-116)/(-36) - 31. Let y be 1 + 1 - (-7)/(-3). Sort l, -0.2, y. y, -0.2, l Suppose i - 26 = 5j + 4i, -2j - 2i - 12 = 0. Let b be 2/(-4) + 14/44. Put j, -0.3, b in decreasing order. b, -0.3, j Let a = -4 + 5.5. Let b = -1.4 + a. Put b, 2, 0.2 in ascending order. b, 0.2, 2 Let d be 39/33 - 2/2. Let t = 19 + -18. Put -1, t, d in descending order. t, d, -1 Suppose -2m - 7 + 3 = 0. Put -1, 0, m in descending order. 0, -1, m Let d = 3 - 3. Sort d, 2, -2. -2, d, 2 Let a = 83 - 86. Sort 5, a, 34. a, 5, 34 Let o = 0.23 + 1.07. Let x = o + -1.6. Put x, 4/3, -1/4 in increasing order. x, -1/4, 4/3 Let w = 185/8 - 23. Put w, 0.1, 13 in ascending order. 0.1, w, 13 Let d = 566 - 3964/7. Let m = -3/49 + 88/637. Sort d, 0, m in increasing order. d, 0, m Suppose -4y = 4f - 20, 0f + f + 3y - 9 = 0. Sort -5, f, -4, -3. -5, -4, -3, f Let o = 0.05 - -3.95. Let a = 1402 - 2753/2. Let d = a - 26. Sort o, 5, d. d, o, 5 Suppose -2v - 10 = 0, 2i = 5i - 3v - 3. Let p = 14 - -1. Suppose 0 = -0d + 5d - p. Put d, -5, i in increasing order. -5, i, d Suppose -10 = 2w, -5j - 12 + 62 = 4w. Suppose -5y + 6 = -j. Suppose -3a = -3o + 24, a = 8o - yo - 23. Put -2, -3, o in descending order. o, -2, -3 Let v = -491803/42 - -11709. Let p = 3/7 + v. Sort 0, 2/5, p. p, 0, 2/5 Suppose -4d = -2d - 2. Let a = -3 + d. Suppose -1 = -q + 2r, 0q = q + r - 1. Sort -4, a, q in ascending order. -4, a, q Suppose -4 = 6s + 8. Put -5, -3, 5, s in descending order. 5, s, -3, -5 Suppose 0 = y - 6y. Suppose 5x - x - 3u - 29 = 0, y = -5x - u + 22. Put x, -5, -3 in descending order. x, -3, -5 Let w be (35)/((-3)/(-4)). Suppose 0 = -2t + 8. Suppose -j = -4q - 5, j + 3j - w = tq. Sort 4, q, -5 in increasing order. -5, q, 4 Let h(u) = 3u2 + 2u - 2. Let w(d) = -4d2 - d + 3. Let f(q) = 3h(q) + 2w(q). Let b be f(-2). Sort -0.2, b, 4 in decreasing order. 4, -0.2, b Suppose -2s - 5b + 9 = 0, 3b + 1 = 5*s - 6. Suppose -v + s = v. Put v, -4, -2 in descending order. v, -2, -4 Let p = 0.074 + 27.926. Sort -5, p, -0.5 in descending order. p, -0.5, -5 Suppose -2 = n + 2. Suppose -4 + 0	{ "pile_set_name": "DM Mathematics" }
iple of 15? True Let i(d) = 5d2 - 3d - 4. Let b be i(4). Let t = 38 - b. Let j = -10 - t. Is 16 a factor of j? True Let r be ((-18)/(-5))/((-6)/(-60)). Suppose -4i + 4y + r = 0, 5i + 2y + 3 = 69. Is 6 a factor of i? True Suppose 0 = 2y - 0 - 18. Suppose 0q + y = 3d + 3q, -4d + 12 = -5q. Suppose a = -4k + 8, dk - 4k = -4a + 117. Is a a multiple of 15? False Suppose 0 = 3x - 7p + 3p - 33, 4x - 4p - 40 = 0. Suppose -4l + 161 = -x. Does 14 divide l? True Suppose 4 = -5s - 1. Let k be (0/((-1)/s))/2. Suppose k = m - 2m + 20. Is m a multiple of 8? False Let q = 9 + -7. Suppose 117 - 47 = 5o + 2h, -qh - 50 = -5o. Does 4 divide o? True Let c be 1/(-3) + 200/24. Suppose -c + 36 = 2m. Suppose -3o + m = -49. Is 11 a factor of o? False Suppose j - 7 + 2 = 0. Suppose 5t + 45 = 4u - 0t, -jt - 40 = -3u. Is 5 a factor of u? True Suppose j + d = 190, 6j - 938 = j - d. Is 40 a factor of j? False Let h be (1/2)/((-2)/(-8)). Is ((-12)/15 + h)15 a multiple of 16? False Let m = -20 - 20. Let p = -29 - m. Does 3 divide p? False Let a be (1/(-2))/(3/(-744)). Suppose -4r + 0r = -a. Does 15 divide r? False Suppose -3m + 622 = 2v, 5m + 5v = 3v + 1030. Is 22 a factor of m? False Let x be 1 + -1 + 21 - 0. Let k = -9 + x. Is k a multiple of 4? True Suppose -2r = -4k + 3r - 17, 8 = -4k - 4r. Let b be (-488)/(-12) + 2/k. Suppose b = -4f + 104. Does 8 divide f? True Suppose -3h + 5g = 3, -4g = 2h - 2g - 14. Let m be 30/((-2)/h2). Is 3 a factor of -4(3 + m/8)? True Let y = -10 - -52. Let p = y - 59. Let g = p - -30. Is 6 a factor of g? False Let w(m) = m - 4. Let s(d) = 2d - 4. Suppose -4 - 4 = -2q, 2y - q = 2. Let u(f) = yw(f) - 4s(f). Is u(-11) a multiple of 23? False Suppose -3i - 3 = 0, -2n - 2i + 169 = -81. Does 9 divide ((-12)/(-14))/(3/n)? True Is (5/(-2))/(3/(-134 + -4)) a multiple of 19? False Suppose 0r - 2r + 73 = v, -2v + 134 = -2r. Does 12 divide v? False Let z(l) be the first derivative of -l4/4 + 7l*3/3 - 5l*2/2 + 6l - 4. Does 4 divide z(6)? True Let d(a) = 3a2 + 10a - 5. Let j be d(-4). Let i = 6 - 4. Suppose iu = -ju + 75. Is 9 a factor of u? False Let s(u) be the second derivative of u3/3 + u2/2 - 2u. Let r be s(1). Suppose 20 = -q + rq. Does 5 divide q? True Let y(n) = n*3 + 5n + 0 - 5 + 0 - 6n2. Let f be y(5). Does 20 divide f/464/(-2)? True Suppose -6d - 4g - 164 = -9d, 4d = 5g + 219. Is d a multiple of 18? False Let i(o) = -3o*3 - 4o*2 - o + 4. Let q be (1 - 0)/((-2)/(-14)). Let a = -10 + q. Does 17 divide i(a)? False Suppose 0 = 3j - 2z + 3z - 88, 0 = -2j + 3z + 55. Suppose -3s + 0s + 423 = 0. Suppose -j + s = 4o. Is 14 a factor of o? True Suppose -5c + 18 = -2i, 3c + 3i = 2c - 10. Suppose -128 = -cg - 8. Does 19 divide g? False Suppose r - 1 = -l, -2l = -2r - r + 13. Let g(k) = 4k*r + 4k*2 - 5k + 0k - 1 - 3k3 + k2. Is g(-5) a multiple of 12? True Let r(x) = x*3 - x + 2. Does 8 divide r(3)? False Suppose -8p = -4p + 240. Let u = p - -100. Is 16 a factor of u? False Suppose -2 = 3g - 11. Suppose -2z + gq = -169, 0z - 3z - 2q = -273. Is z a multiple of 25? False Let w(n) = n3 - n2 - 1. Let q be w(2). Suppose qr - 51 = -4s + s, -2s = 4. Let c = -10 + r. Is 3 a factor of c? True Let g = 49 + -86. Let h be (183/(-9))/(4/(-12)). Let b = h + g. Is b a multiple of 8? True Suppose 2f - 125 = 5c, 2f - 6c = -3c + 115. Suppose 3l - f = 10. Is l a multiple of 17? False Let j(w) = -6. Let u(b) = -b + 13. Let n(o) = -9j(o) - 4u(o). Let k be n(-3). Is (-23)/(-5) - 4/k a multiple of 3? False Let i(p) = -2p - 9. Let h be i(-6). Let g be (-3 + h)/(4/2). Suppose g = -d - 1 + 32. Is 12 a factor of d? False Is 29 a factor of ((-3255)/6)/(-5) - 2/(-4)? False Suppose 2s - z = -0z - 14, 4z = 2s + 14. Let h(u) = 3 - 4u - 3u - u + 7u. Is h(s) a multiple of 5? True Suppose -4h - 36 = -4b, -h - 5b + 0b = -9. Let k(z) = z*2 + 4z - 8. Let p be k(h). Suppose -f - px = -2f - 10, 2f = -5x + 45. Is 5 a factor of f? True Let b(q) = 6q2 - 5q + 4. Let g be b(3). Suppose 3t - 64 = -i - i, g = t + 5i. Is t a multiple of 8? False Let y(r) = r3 - r2 - r. Let j(p) = 2p3 - 9p*2 + 3p + 8. Suppose 3b = -4c - 15, c + 9 = -5b + 1. Let h(n) = cy(n) + j(n). Is 15 a factor of h(-7)? True Suppose -4c - 3a + 4 = -5a, 13 = 3c + a. Is c a multiple of 2? False Does 9 divide (1 + 2)/(2/12)? True Let n be -3 - (-8)/(-2)-1. Does 17 divide ((-60)/8 - n)-8? True Suppose 3i - 8 = -i. Suppose 0 = -io + y + 3y + 4, -3y + 10 = 5o. Suppose -2s + 53 = 3f, of + 3s + 2 = 44. Is f a multiple of 7? False Does 31 divide (-6)/(-4)(-248)/(-6)? True Suppose 3n - 10 = n. Suppose -q + 10 = z, 5q - nz = -0q. Is q a multiple of 2? False Let u = 112 - 90. Is u a multiple of 6? False Suppose -2x - 4r = -9r + 11, -3r = -2x - 5. Let s be 3/(-12)2x. Does 6 divide 11 + 2/(s - 1)? False Let j be 1 - 21/(12/4). Is j/10 + (-386)/(-10) a multiple of 22? False Let q(f) = f + 31. Does 11 divide q(0)? False Suppose 0 = -0c - 2c + 8. Suppose 3p - 29 = -cb, 0 = 5p + 4b - 17 - 34. Is p a multiple of 4? False Let s be 35/146/5. Suppose sr - r - 14 = -2g, -2g + 3r - 1 = 0. Does 2 divide g? True Let l(t) = -t*3 + 15t*2 - 15t + 20. Does 5 divide l(14)? False Let q be (2 + 0/(-2))/(-2). Let g be 1/(5/6 + q). Let k(u) = -u. Is 5 a factor of k(g)? False Let f(c) = -c + 2. Is f(-10) a multiple of 3? True Let c(r) = -5r - 4r2 - 1 - r2 + 2 - r*3. Let z be c(-4). Suppose 0 = -zy + 97 + 63. Does 20 divide y? False Let w = -333 + 505. Is 15 a factor of w? False Let d = 3 - 1. Suppose 0 = -6l + dl - 132. Let x = l - -61. Is x a multiple of 14? True Suppose -2l + 24 = 2l. Is 29/4 + l/(-24) a multiple of 3? False Let t be (2/2)/(3/(-6)). Let m be 17t(0 - -1). Let a = m - -56. Is a a multiple of 8? False Let v = 73 - 37. Is v a multiple of 9? True Suppose -10k - 60 = -15k. Is k a multiple of 2? True Suppose 8 = f - 3w, 2f + 0w = -2w. Suppose 2l - x = 19, f = -3l + 2x + 33. Is 2 a factor of l? False Let t be 2 + 0 + 2 + -2. Let k(u) = -ut + 4u2 - 1 + 0. Is k(2) a multiple of 11? True Let i(a) = a2 + 12a - 4. Is 15 a factor of i(-15)? False Let x(k) = -30k - 3. Is 9 a factor of x(-1)? True Suppose -285 = -2b + k, 4k = -13b + 9b + 564. Is b a multiple of 56? False Let v(w) = -7w - 40. Is v(-12) a multiple of 8? False Let g(z) = -z3 + 6z*2 + 10z - 7. Is 3 a factor of g(7)? False Suppose 31 + 37 = 4a. Suppose -c + a = -14. Is 12 a factor of c? False Suppose 2p = q + 1, 2q + 0p + 2 = 5p. Let g be 1673/21 - q/3. Suppose -g = -4k - k. Does 8 divide k? True Suppose -22y = -19y - 840. Is 40 a factor of y? True Let l be ((-2)/(-3))/((-6)/(-45)). Suppose lj - 5 = 5v, -4j - 4v + 44 = -0j. Let s(r) = r3 - 5r*2 - r - 2. Does 14 divide s(j)? True Suppose 0 = 9b + 4b - 2028. Is 39 a factor of b? True Let y(z) = -z - 8. Let i be y(-8). Suppose iq - 145 = -5q. Suppose n - b - 20 = 0, q = n - 0n - 4b. Does 7 divide n? False Suppose 2r = -4c + 14, -1 + 7 = 3c + 3r. Is c a multiple of 2? False Let l(o) = o - 2. Let t(s) = s + 1. Let r(c) = 6l(c) + 6t(c). Does 21 divide r(5)? False Let c(f) = 25f + 27. Does 19 divide c(4)? False Let r be 6((-10)/(-4))/5. Suppose -3f + 53 = o, 0 = 3f - 5f + ro + 28. Does 17 divide f? True Let l(a) be the third derivative of 0 - 1/24a*4 + 2a*2 + 0a + 8/3a3. Is l(10) a multiple of 3? True Let w(z) = -z + 20. Suppose 0 = 2x - 3g - 12, -2g = -0g + 8. Does 10 divide w(x)? True Suppose u - 4t = -u - 12, 2u + 4t = 20. Let x(g) = 3g3 - 2g*2 + g + 1. Let p be x(u). Let h = p - 10. Is h a multiple of 9? True Is 18 a factor of 19 + 2111/(-22)? True Suppose -5f = 2i - 59, -2i - 2f = 3i - 200. Is i a multiple of 14? True Let h(b) = 2b2 + 5b + 6. Does 7 divide h(-5)? False Let a be (3 - 4 - -3)-1. Is 2 + (11 - a) + 0 a multiple of 15? True Is 20 - 4 - 12/(-4) a multiple of 2? False Let n(h) = 3h*3 + 3h*2 + 5h - 6. Is n(3) a multiple of 13? True Is 2 a factor of 2/(-36)-94 + (-12)/54? False Let c(d) = -d - 2. Let u be c(-4). Suppose -un - 3n = -30. Suppose nj = 2j + 32. Is j a multiple of 8? True Let h(o) = o*2 + 5	{ "pile_set_name": "DM Mathematics" }
v(-5) and z. 9 Let z(i) = i*3 - 2i. What is the least common multiple of z(2) and 20? 20 Let u(z) = -z + 3. Let i be 2/5 - 8/20. Let w be u(i). Calculate the common denominator of 95/6 and 43/20 - w/(-6). 60 Let n = -4 - -10. Let c = 17 + -1. Calculate the common denominator of 3/2 - 60/c and n. 4 What is the common denominator of (-10)/(94/(-51)) and -89/10? 30 Let l be (9/(-3))/(-3)-282691. Let j = -3107538/11 - l. Let k = j + -187. What is the common denominator of -61/9 and k? 99 Let d = -1004/129 - -67951/4902. Let j = d - -84/19. Calculate the common denominator of 17/7 and j. 14 What is the lowest common multiple of 14 and (-11)/(-22) + (9/2)/3? 14 Let q be ((-6)/9)/(4/(-66)). Suppose 2a - q = 3. Calculate the common denominator of 47/10 and 2 - (a/8 - -2). 40 Let b(g) = 2g - 3g + 1 + 0g. Let j be b(6). Let y(u) = -u - 3. Calculate the lowest common multiple of y(j) and 7. 14 Suppose m - 3 = 1, -9 = -5r + 4m. Suppose 0 = a + 2j + 41 - r, -3j + 46 = -a. Calculate the smallest common multiple of 22 and ((-2)/5)/(1/a). 176 What is the smallest common multiple of 30 and (-6)/((-66)/295) - 2/(-11)? 270 Let q = -9945 - -178891/18. Calculate the common denominator of -93/14 and q. 126 Let r = 250711/20 - 12531. Let n = -1685/728 - 11/182. What is the common denominator of r and n? 40 Suppose 5d + 45 = 2h - 7h, -h + 7 = -d. Let w = -5 + 2. Let s = w - d. Calculate the smallest common multiple of s and 5. 5 Calculate the common denominator of -29/2 and (348/(-8)1)/(-5). 10 Suppose -3c = -4u - 58, 0c + 78 = 4c - 5u. What is the smallest common multiple of 22 and c? 22 Suppose -5n + 61 - 1 = 0. Suppose t + 4t - 5 = 0. Calculate the least common multiple of n and 18 - (0 - 1 - t). 60 Let g(c) = -8c*3 + 2c*2 + 2. Let n be g(3). Let k be ((-18)/7)/(21/n). What is the smallest common multiple of (k/20)/(1/5) and 10? 30 Let q = -305917/7 - -43834. Let o = q - 9371/70. Calculate the common denominator of o and (-1)/(-4) - 2/(-4). 20 Let k be ((-1)/(-2))/((-6)/(-480)). Suppose 0 = -2c + k + 4. Calculate the least common multiple of 8 and c. 88 Let l(z) = z*2 + 7z - 1. Let r be l(-7). Let s = -11003 - -242171/22. Calculate the common denominator of s and (67/(-12)1)/r. 132 Let o(h) = 8h*2 - 11h - 3. Let a be o(8). What is the common denominator of a/(-72) - 24/(-108) and -43/2? 8 Suppose -9 = -l + 11. Calculate the least common multiple of l and 10. 20 Let s = 423/8 + -117/2. Let l = 734 + -2231/3. What is the common denominator of s and l? 24 Let l = 66 - 56. What is the least common multiple of 14 and l? 70 Let w = -16 + 32. What is the common denominator of -61/5 and (3/w)/((-6)/100)? 40 Let o(b) = -12b + 1. Let u be o(-7). Suppose 5v - u = 85. What is the lowest common multiple of v and 6? 102 Let f be (-1 - 33) + (0 - -1). What is the common denominator of (-2)/(-3) - (-64)/f and -31/8? 88 Let z = 1277 + -7693/6. Calculate the common denominator of z and 19/22. 66 What is the lowest common multiple of 45 and (100/(-30))/(1/(-18))? 180 Let h be 6987 + (-4)/(-2) + -1. Let q = -42061/6 + h. Calculate the common denominator of q and (-3)/(-12) - 82/24. 6 Let d be ((8/2)/(-4))/1667. Let u = d + -38323/30006. What is the common denominator of u and (-1)/(-4) - 54/16? 72 Let k be 2/(-4) - 196/(-8). Let f = -14 + k. Let i = f - 5. What is the least common multiple of 9 and i? 45 Calculate the least common multiple of 8 and (-1 + 2)/((-4)/(-44)). 88 Let h(m) = m*3 + 11m*2 + 8m + 7. What is the lowest common multiple of h(-10) and 2? 54 Let r(s) = -2s - 6. What is the smallest common multiple of 20 and r(-10)? 140 Let q be 6/27 - (-248)/18. Calculate the smallest common multiple of ((-2)/4)/(6/(-264)) and q/(-35)-75. 154 Let g = -690769/44 - -15697. What is the common denominator of -23/48 and g? 528 Let w(b) = -2b. Let h be w(-1). Suppose y = 5x + 28, -h = -y - 4x - 19. Let v = y - -7. Calculate the least common multiple of v and 10. 10 Find the common denominator of 1/(6/134) - 16/24 and -41/10. 30 Find the common denominator of (1172/90)/2 + 44/(-110) and -67/16. 144 Let j = 3 - -4. Let m = 9 + -4. Suppose 2p + 7 + 1 = -g, mg + 2p = 0. Calculate the lowest common multiple of g and j. 14 Let k be -1 + 4/((-3360)/9729). Let y = -16/35 - k. What is the common denominator of y and 7/4? 8 Calculate the common denominator of (-590)/50(-10)/(-12) and -17/9. 18 Let s = 4170 + -29142/7. Calculate the common denominator of 20/19 and s. 133 Suppose 2j = j. Suppose j = r + 43 - 400. What is the common denominator of (r/18)/7 + -1 and 117/10? 30 Let d = 38 - 33. What is the least common multiple of 4 and d? 20 Let z = 61 - 39. What is the lowest common multiple of z and 16? 176 Let z(o) = o - 1. Let u(q) = 4q*2 - 17q + 3 + 9q + 5. Let j(x) = u(x) + 8z(x). Calculate the least common multiple of 20 and j(1). 20 Suppose p - 10 = 2a - 0a, -p = -3a - 17. Let q(b) = -b - 4. Let t be q(3). Calculate the smallest common multiple of 1 and a/(t/10) + -2. 8 Suppose -5s - 12782 = -38617. Let p = s + 2372. Let o = p - 150897/20. Find the common denominator of o and 77/20. 20 Let w(l) be the second derivative of -l*3/6 + 11l*2/2 + 4l. Let b be w(-9). Calculate the common denominator of -49(1/b - 0) and 97/2. 20 Let f(n) = n3 - 6n*2 - 9n + 21. Calculate the smallest common multiple of f(7) and 9. 63 Let u = 8 - 6. Suppose 0 = -ur + 2. Suppose g - 2v = 5 - r, 2g + v - 23 = 0. What is the smallest common multiple of 4 and g? 20 Let c(q) = -3q + 2. Let w(r) = -7r + 5. Let p(b) = -5c(b) + 2w(b). Let u be (-2)/(-1)(-3)/(-2). Calculate the smallest common multiple of 11 and p(u). 33 Suppose 0j + j - 36 = -4v, -v = -5. Find the common denominator of 3j/18 + 0 and 73/6. 6 Suppose 113200 = -3d - 2d. Let y = -452921/20 - d. Calculate the common denominator of 2/5 - (-63)/330 and y. 220 Let j(z) = 4z + 2. Let x be j(-2). Calculate the lowest common multiple of 11 and 92/20 + x/10. 44 Let f be (1 - 2)(-3)/3. Let z(p) = p2 + 3p. Let o be z(-3). What is the common denominator of o + 134/(-16) + f and -26? 8 What is the common denominator of (-211)/(-180) + (-16)/72 and -63/10? 20 Let a = -827224/3 + 285744. Let n = a + -332293/33. Let h = n - -11551/176. Calculate the common denominator of h and 133/18. 144 Calculate the smallest common multiple of 20 and (-254)/(-14) + (-11)/77. 180 Let v = -6913 - -41629/6. Let x be 1898/(-5)(-5)/3. Let r = 3947/6 - x. What is the common denominator of r and v? 6 Let f = -6 - -2. Calculate the common denominator of 357/f14/105 and -19/10. 10 Let o be ((-8)/10)/((-2)/(-5)). Let y be ((-6)/(-4))/(o/12). Let j = -1 - y. What is the lowest common multiple of j and 2? 8 Let v = -15649/12 + 2601/2. What is the common denominator of v and -19/20? 60 Suppose 46 = 4z - 4t + t, 5z = -3t + 44. Calculate the least common multiple of 20 and z. 20 Let u = -292 + 2331/8. Calculate the common denominator of u and 113/40. 40 Suppose w = 2w - 44. Find the common denominator of (-12)/(-66) - 679/w and 2/7 - (-393)/70. 20 Let x(a) = -a2 + 8a - 4. Let v(p) be the first derivative of p*2/2 + 17p - 1. Calculate the least common multiple of x(6) and v(-9). 8 Let t be (3/(-9))/(2/(-174)). Let n = 61 - t. Let h = n - 12. What is the smallest common multiple of h and 12? 60 Let o(b) = -2b - 4. Suppose -4s + 3t = 44, s + 4s - t = -44. Calculate the lowest common multiple of 18 and o(s). 36 Let y = -1155/43 + 27. Let k = y + 3987/86. Calculate the common denominator of k and -5. 2 Suppose -6f = -10f + 4. What is the common denominator of 34/(f(-1 - 0)) and -41/3? 3 Suppose 10 = -f + 5f - 3u, -24 = -5f - 2u. Suppose 3 = -3c + 9. Calculate the least common multiple of c and f. 4 Let h = 2784385/107 + -26022. Calculate the common denominator of 77/8 and h. 856 Let o = 17/21 - 107/14. Calculate the common denominator of o and 23/8. 24 Suppose 0 = -o + 3c + 10, -3o - c = -2c - 62. What is the least common multiple of o and 36? 396 What is the least common multiple of 14 and (-207)/(-18) - ((-3)/2 + 1)? 84 Suppose 2r - 5 = r. Suppose ru + 2h = -32924, -u - 32916 = 4u - 2h. Let m = u - -92287/14. What is the common denominator of 37/8 and m? 56 Let x = 9283/42 - 656/3. Find t	{ "pile_set_name": "DM Mathematics" }
Suppose -3o - 4b = b - k, -2o + b = -6. Suppose 0 = -0q - oq + 2235. Is q composite? True Let m(c) = -2383c - 1656. Is m(-11) prime? False Let z = 17087 - 7436. Is z composite? True Suppose 3051650 = 58t + 21t - 2262759. Is t composite? False Let a(g) = g*2 - 5g + 6 - 2g2 - 3 - 17g*3. Let z = -3997 + 3995. Is a(z) a prime number? False Let u = 19 + -23. Let l be 0/(u/123). Suppose -8v + v + 1897 = l. Is v prime? True Suppose 6l - 10l = 64. Let q be l/(-20)(-445)/(-4)46. Suppose 0 = 7f - q - 5139. Is f a composite number? False Suppose -30 = c - 28. Is 108058/97(0 - 11/c) a prime number? False Let b = 20 + -10. Is 269/((16/b)/8) composite? True Let c(i) = -10i*3 - 8i*2 + 32i + 51. Let h be c(-34). Suppose -43n = -h - 520288. Is n prime? True Let n = 67928 + -38449. Is n a composite number? True Let m(g) be the second derivative of g7/504 - 7g*6/720 + 7g*5/120 + 2g*4/3 + 4g. Let y(n) be the third derivative of m(n). Is y(4) a prime number? True Let l be (96543/(-36))/((-1)/(-4)). Let m = l - -15448. Is m a prime number? True Let h = 756 - 1267. Let r = 2948 + h. Is r a prime number? True Is (-22)/(286/11700377)(1 + -2) composite? True Let s = 469395 - 264166. Is s a composite number? True Let m = -683826 + 1069483. Is m composite? False Let h = 97116 + -21589. Is h a composite number? False Let y(q) = -q2 - q + 24. Let n be y(4). Suppose nw + p - 6626 = 0, 2p + p = 3w - 4977. Is w composite? False Let w = 84 - 96. Let n be 51/21 - w/(-28). Suppose 0 = -nh - z + 794, -5h + 4z = -10h + 1985. Is h prime? True Let r be 862 + 8 + 8/(-2). Suppose -3z + 5i + 1027 = 0, 4z + 2i = r + 538. Suppose -33 = 4y - z. Is y a prime number? True Suppose 5n - 4n - 4v = -8, -n - 5v + 10 = 0. Let z(x) = x3 + 70. Let h be z(n). Suppose -h = -2i + 516. Is i a composite number? False Let y be ((-28)/140)/((-2)/170). Suppose 5g = -s + 241750, -3s = -yg + 15g + 96683. Is g a composite number? True Suppose 4h = -5p + 545, -4p - 4h = 183 - 615. Let t = 3090 - p. Is t a composite number? True Let n(z) = 5392z2 + 353z + 1401. Is n(-4) prime? False Let l = 701009 - 352392. Is l prime? True Suppose -11522 = -4w + 5j - 7j, 2j - 14402 = -5w. Suppose -3a = -3t - w, a + 0a = 2t + 965. Is a prime? False Let j be 2/296/(-9). Let n(f) = -9f*3 - 5f. Let h be n(j). Let r = h + -1096. Is r composite? True Let u(s) = 10066s2 - 52s - 37. Is u(6) a prime number? True Suppose 3362 = r - 4y, 7r = 4r + y + 10141. Let a = 7371 - r. Is a a prime number? True Let u(p) = 4p*3 - 6p*2 + p - 1869. Let q(v) = -13v*3 + 21v*2 - 4v + 5609. Let w(f) = -2q(f) - 7u(f). Is w(0) composite? True Let w = 481373 - 318556. Is w composite? True Suppose -6 - 4 = -5z. Suppose zv = 3v + 280. Let i = v - -435. Is i prime? False Suppose -7i + 635 + 5420 = 0. Suppose -5p = 11p - 6528. Let w = i - p. Is w a prime number? True Let f(j) = 32j3 - j2 - j + 1. Let p be f(1). Let q = p - 59. Is -6993/(36/q) composite? True Suppose 6w + 11 - 281 = 0. Let l be (w - -1) + 1 - 4. Let y = -18 + l. Is y composite? True Let h = 422769 - 232406. Is h a composite number? True Let d(w) = 12w*3 + 77w*2 + 88w + 157. Let p(f) = -7f3 - 39f*2 - 44f - 79. Let v(y) = -3d(y) - 5p(y). Is v(-37) a composite number? True Let k = 112727 + 123882. Is k composite? False Suppose 4h = 5o - 5 - 12, -4o + 28 = 4h. Suppose 3j + c = 3065, -hj + j - c + 1021 = 0. Suppose z + x = 1281, x + 251 + j = z. Is z a composite number? False Let j = -196 + 76. Let q = j + 120. Suppose 10v - 14v + 3676 = q. Is v prime? True Let z(w) = -w*3 + 5w*2 - 12. Let j(b) = 3b*3 - 15b*2 + 35. Let d(x) = 6j(x) + 17z(x). Let v be d(5). Suppose -vn + 5n + 145 = 0. Is n composite? True Let h = 1389 + -548. Is h a composite number? True Let c(f) = 13f*3 + 3f*2 + 23f - 22. Let s be (-35)/213-1. Is c(s) a prime number? False Suppose -3k - 2c = -1278197, -c - 3232422 = -5k - 1102124. Is k a composite number? False Let n be (-1 + (-3)/(-6))/(1/(-84)). Suppose 5o - 313 = n. Suppose 4f + o = 5i - 44, 115 = 5i - 2f. Is i prime? True Suppose 5k = -4u + 605896, 138k - 137k = 4u - 605872. Is u prime? False Suppose 0 = 6c + 3c - 27. Suppose -cr - 7 + 31 = 0. Is (2342/8)/(2/r) composite? False Let a = 1785 - -16214. Is a a prime number? False Suppose 15w - 178w + 352582 + 33749137 = 0. Is w a prime number? True Suppose -10g = -14g + 696. Suppose -5i - 3q + 1106 = 0, -i + q + g = -52. Let h = i + 84. Is h a prime number? True Suppose 517u - 520u = 33. Is (8247/3 - 0)/(u/(-33)) composite? True Suppose 40j - 5j = 202720. Let g = j + -2745. Is g a prime number? False Let z be 29/(-6) + 33/(-54). Let h be 184770/z - 4/(-1). Is h/(-18) - 10/(-45) composite? False Is 1268969 + (-14 - -10 - 1 - -7) composite? False Suppose -3n = -3h - 2840724, 0 = -10n + 7n + h + 2840710. Is n a composite number? False Let x = 26 - 21. Suppose -xu = -3u - 6. Is (-1262)/u(-21)/14 a prime number? True Suppose 9m = 11m - 84. Let o be (-15)/(-35) + (-3)/(m/(-20266)). Let p = -1005 + o. Is p prime? True Suppose 14v + 2i = 11v + 753, -4v + 3i + 1021 = 0. Let n = 264 - v. Is n composite? False Is ((-191606)/(-14))/(442/3094) prime? True Suppose 291i - 288i - 82863 = 0. Let s = i - 13030. Is s a prime number? True Let y(p) = p*3 + 39p*2 - 365p + 365. Is y(64) a composite number? True Let d(b) = 29b2 - 76b + 4. Let w be d(-5). Suppose -m + 4036 = w. Is m composite? False Suppose 3i - 100269 + 9681 = 0. Suppose -36c + i + 8288 = 0. Is c composite? False Let j(r) = -1333r + 165. Let c be j(-21). Let i = 42871 - c. Is i composite? False Suppose -4y - 8 = 0, 4i + 5y + 48 - 6 = 0. Let a(c) = 142c2 - 14c + 27. Is a(i) a composite number? False Suppose 28b - 31b - 3p = -190914, -2b + 127278 = 4p. Is b prime? False Suppose -242o = -246o + 16. Suppose -4d = 3z - 8d - 27307, -od + 18238 = 2z. Is z composite? False Let x be 0 + 31 + (-14 - -14). Suppose 5m = -2r + xr - 652, -2r + 1280 = 2m. Let n = -227 + r. Is n prime? False Let a(y) = 11y3 + 3y*2 - 2y + 17. Let o be a(-5). Let t = -556 - o. Let j = t + -380. Is j composite? False Let z = -47 - -49. Let i be z - (11 - 3)/(-2). Let h(t) = t*3 - 4t*2 + 2t + 3. Is h(i) composite? True Let r(c) = -11464c - 5359. Is r(-98) a prime number? True Let c(b) = -4b - 3. Let a be c(-2). Let t = 24694 + -16931. Suppose t = ag - 2372. Is g composite? False Let n(y) = 9631y*2 + 15y - 25. Is n(-3) a prime number? False Let u(w) = 33w2 + 19w - 11. Let c(y) = y + 17. Let h be c(-14). Suppose ha + 23 = -4. Is u(a) prime? False Let a(r) = -4r*2 + 6r - 43. Let o(n) be the third derivative of -3n5/20 + n4/2 - 29n*3/2 + 18n*2. Let s(l) = -5a(l) + 2o(l). Is s(20) composite? True Let f = 291077 + -191116. Is f a composite number? False Let a(l) = -2l*3 + 5l*2 - 2l + 8. Let x be 45/(-15) - (-6 + -1). Suppose -s + 4g - 7 = 0, xs + 3g = -0g - 28. Is a(s) a composite number? False Let y = 4075 - -297. Suppose -704 - 2561 = 3x + 5j, 4x + y = -2j. Let f = x + 1784. Is f a composite number? True Let t(o) = o*2 - o + 8292. Let j be t(0). Let f = 1047 - 1047. Suppose 8r - 20r + j = f. Is r a prime number? True Is (-1516)/(21/(882/(-60))) + (-1)/5 a composite number? False Is 2/10 - (2118580/250)/(4/(-60)) a prime number? False Let y(o) = 4026o*2 - 9o + 58. Is y(7) a composite number? False Let f(p) = -3p - 4 + p + p + 2p. Let u be f(1). Is (4293 - -1)u/(-6) a composite number? True Let u(z) = 44426z*2 - 9z + 4. Let q be u(2). Suppose -14c + 8c = -q. Is c prime? False Suppose 19t + 11 = 68. Let b(x) be the second derivative of 4x4/3 + x3/6 + x*2 + 2x. Is b(t) composite? False Suppose -4r = -2r + 3y + 1789, 0 = r + 3y + 887. Let b = 2115 + r. Is b prime? True Let i(m) = m*2 - 76m + 5228. Is i(63) a composite number? False Let h(p) = 4583p2 - 5p - 179. Is h(-13) composite? True Suppose -d - 5j + 22477 = -5702, -j = -5d + 140791. Is d a composite number? True Suppose 0 = -4o + 2o + 18. Let t(l) = 0l - 6l - 2l + 16 - ol. Is t(-11) prime? False Let t(h) = 2h3 - 9h*2 + 3h + 4. Let u be t(4). Suppose	{ "pile_set_name": "DM Mathematics" }
mplify (sqrt(88)/(6sqrt(44)/sqrt(4)))/((sqrt(4356) + sqrt(4356)-2)/sqrt(9)). -sqrt(2)/66 Simplify -1(-2-6-151sqrt(567))*2. -2041200 Simplify ((1sqrt(19))*2-2 - (sqrt(190)-4)/sqrt(10))3. -114 + 12sqrt(19) Simplify (-6((sqrt(132) - (sqrt(132) + -4sqrt(132))) + sqrt(132))-3)/((sqrt(48)/sqrt(72))/sqrt(2)). 540sqrt(11) Simplify (3 + -5 + sqrt(76) + 1)1. -1 + 2sqrt(19) Simplify -4(3 + (sqrt(1900) - (sqrt(1900) + 5(sqrt(1900) + 2 + sqrt(1900))) - sqrt(1900))2 + (-1sqrt(1900) + 1)*2) + -1. -927617 - 8720sqrt(19) Simplify ((6sqrt(126) + sqrt(14) + (sqrt(14) - -31sqrt(14)))/(sqrt(28)/sqrt(16) - sqrt(7) - sqrt(7) - ((sqrt(7) - (sqrt(28) - sqrt(112))) + sqrt(7))))26. 25392/121 Simplify -36(-3 + 1 + sqrt(1100)). -180sqrt(11) + 36 Simplify ((sqrt(2430) - (sqrt(2430) + sqrt(2430)-3))/(sqrt(6) - sqrt(648)/sqrt(3))-2)2. 2916/5 Simplify -1-2(((sqrt(252)/sqrt(7))/sqrt(12) + -1)2 + -1). -4sqrt(3) + 6 Simplify ((-5 + -4 + sqrt(1331) + -1 + 2)-3)2. -1584sqrt(11) + 12555 Simplify -1(sqrt(612) + -3)2-3 + -5(sqrt(612) - (sqrt(612) + sqrt(612)-4))*2 + 3. -47094 - 108sqrt(17) Simplify ((4(sqrt(190) - -4sqrt(190)))/sqrt(10))*2 - (1 + sqrt(171)4). -12sqrt(19) + 7599 Simplify (sqrt(153)/(-4sqrt(9) + sqrt(9) + sqrt(9)) + sqrt(1088)-1 + 5)2. -85sqrt(17) + 5013/4 Simplify -4(4 + 1sqrt(304) - (sqrt(304) + 1)*26)-5. -36520 - 880sqrt(19) Simplify 6(sqrt(6480) + -1 - 1-1sqrt(45))5. -30 + 1170sqrt(5) Simplify ((2(sqrt(132) + sqrt(132)-1 + sqrt(132) + sqrt(132)))/(-4sqrt(12)4)-6)*2. 99/4 Simplify ((sqrt(132)-1 - sqrt(132))/sqrt(11) - (sqrt(12) + -6(sqrt(12) + sqrt(24)/sqrt(2))))/(sqrt(486)-34). -sqrt(2)/12 Simplify -21sqrt(19) + sqrt(19)-2 + 3 + 5 - (sqrt(95) - (-6sqrt(95)1 - sqrt(95)))/(2(sqrt(45) - sqrt(5))). -6sqrt(19) + 8 Simplify (-2 + 6(-5sqrt(11) - sqrt(11))-1 + 1)2. -72sqrt(11) + 14257 Simplify (6(5-2sqrt(1584) - sqrt(1584) - (sqrt(1584) + 51sqrt(1584))))2-4. -65919744 Simplify -5(0 + 1 + sqrt(396) + (1 + sqrt(396))-5). 20 + 120sqrt(11) Simplify -5 + -3(sqrt(114)/(1sqrt(6)) - ((sqrt(19) - sqrt(95)/sqrt(5)) + 2)). -3sqrt(19) + 1 Simplify (sqrt(512) + 3)*2 + (sqrt(200) + 2)-1. 86sqrt(2) + 519 Simplify (sqrt(192)2 + sqrt(192))-1 + (-2 + -3 + sqrt(192))2. -104sqrt(3) + 217 Simplify (sqrt(1539) + -2 + 0 + 5)-64. -216sqrt(19) - 72 Simplify (5(sqrt(1008)-1 + (sqrt(112) + 0 - sqrt(7) - sqrt(7))))2 - (sqrt(252) - (3 + sqrt(252)) - sqrt(21)/sqrt(3)2). 2sqrt(7) + 17503 Simplify sqrt(7) + sqrt(28)/sqrt(4) + -5 + (sqrt(42) - (sqrt(42) - (sqrt(42)2 - sqrt(42))))/sqrt(6) - ((sqrt(7) - sqrt(28)/sqrt(4))*22 - sqrt(126)/sqrt(2)). -5 + 6sqrt(7) Simplify (sqrt(70)/(sqrt(63)/(sqrt(9)-1)))/(sqrt(8)-1-3). -sqrt(5)/6 Simplify ((sqrt(416) - (sqrt(416) - (sqrt(416)-1 + sqrt(416)))-3)/sqrt(8))/(1sqrt(12)/sqrt(3) + sqrt(24)/(sqrt(18)/sqrt(3))). 2sqrt(13) Simplify (((sqrt(190) + sqrt(190)-3-3 - sqrt(190)) + sqrt(190))/(sqrt(60)/sqrt(6)1))2. 1900 Simplify (sqrt(77) + (sqrt(77) - (sqrt(77) + sqrt(77)4-1)))/sqrt(11) + (sqrt(343) + -2)2 + (sqrt(42)/(sqrt(12)/sqrt(2)))2. -23sqrt(7) + 354 Simplify -1 + ((sqrt(500) - (sqrt(500)1 - sqrt(500)))-6)*2 + (sqrt(500) - (sqrt(500) + (2((-1 + sqrt(500) - sqrt(500)) + sqrt(500)))*2))-4. -320sqrt(5) + 26015 Simplify (sqrt(4598)-24)/(sqrt(6)/(sqrt(12)/sqrt(4)) + sqrt(2) + sqrt(32)-2). 44sqrt(19)/3 Simplify (-1(sqrt(88) + -1(sqrt(88) - sqrt(88)-2)))/(sqrt(96)/(sqrt(12) + (sqrt(24)/sqrt(2)1 - sqrt(12)))). 2sqrt(11) Simplify (sqrt(20)/(sqrt(20)/sqrt(5)) + sqrt(125)-2 + 1)2. -18sqrt(5) + 406 Simplify (sqrt(6292) + 2 + 4)*2-1. -6328 - 264sqrt(13) Simplify ((sqrt(190)/(1sqrt(10)) - sqrt(19) - (-5 + sqrt(19)-1)) + -4 + (1sqrt(209))/sqrt(11))*2. 4sqrt(19) + 77 Simplify 4 + ((-3 + 1 + sqrt(468) + sqrt(468))-5 - (-4 + -2sqrt(468)1))2. -1344sqrt(13) + 30152 Simplify 12-3sqrt(15)/sqrt(147). -6sqrt(5)/7 Simplify (sqrt(42)/(-4sqrt(6)4) - -3(-4 + sqrt(448) - sqrt(448)))4. -48 - sqrt(7)/4 Simplify ((0 + -2sqrt(200))2 - sqrt(200))5 + (4(-2 + (sqrt(200) + 0 - sqrt(200))))2. -50sqrt(2) + 4064 Simplify ((sqrt(350)1)/sqrt(7)6)/(5sqrt(160) + 3sqrt(10)-1). 6sqrt(5)/17 Simplify (sqrt(119) + -2(sqrt(119) + sqrt(119)1 + sqrt(119)) + (2-1sqrt(119) - sqrt(119)))/((sqrt(504)/(sqrt(24)/sqrt(2)))/sqrt(6)). -8sqrt(17) Simplify (1 + sqrt(2057) + sqrt(2057))-3 - sqrt(612)2-4. -18sqrt(17) - 3 Simplify 24(sqrt(13) + 3 + sqrt(52) - (sqrt(13) - (3 + sqrt(13)) - sqrt(13))-3). -48 Simplify sqrt(98) + -2 + 5 - (sqrt(384) + 1sqrt(384))/sqrt(12). -sqrt(2) + 3 Simplify -4(sqrt(1836) - (sqrt(1836) - (sqrt(1836) - (sqrt(1836) + 1sqrt(1836)))))/(sqrt(15)/(sqrt(10)/sqrt(2) + sqrt(5) + sqrt(5))). 72sqrt(17) Simplify ((sqrt(468) - 5-1sqrt(468)) + sqrt(468) + sqrt(468) - (sqrt(468) - -1(sqrt(468) + 0 + sqrt(468))) - -3-3(-3 + sqrt(468)))2. -1296sqrt(13) + 8217 Simplify ((sqrt(26)/sqrt(2)5 - (sqrt(13)-2 + -1)) + (sqrt(1872) - -1sqrt(1872)-6)*2)-4. -187204 - 28sqrt(13) Simplify ((sqrt(160)/sqrt(4))/sqrt(5) - (sqrt(8) + sqrt(8)2)-4)/((sqrt(4) - (-6sqrt(4)-2 + sqrt(4))) + sqrt(64)). -13sqrt(2)/8 Simplify -1 + (sqrt(19) - ((-1 + sqrt(304) + sqrt(304))*2 - sqrt(304))) + (2sqrt(228)-3 + sqrt(228))/sqrt(12). -1218 + 16sqrt(19) Simplify (((sqrt(65) - (sqrt(65) + (sqrt(65) - -2sqrt(65)))3) + sqrt(65))-6)/((-4sqrt(250))/sqrt(2)). -3sqrt(13) Simplify -6(sqrt(28)1 + sqrt(28) - sqrt(28))/sqrt(4) - ((sqrt(98) + sqrt(98) + (sqrt(98) - sqrt(98)-3) + sqrt(98))/sqrt(2))/sqrt(7). -13sqrt(7) Simplify (((sqrt(153) + (sqrt(153) - (sqrt(153) + sqrt(153)-1)) - sqrt(153))-4 - 5(2sqrt(153) + sqrt(153)))/(sqrt(45)/(-2sqrt(80))))*2. 392768 Simplify sqrt(35)/sqrt(45)-1 + sqrt(21)/(1sqrt(12)) + -4. -4 + sqrt(7)/6 Simplify (sqrt(2448) + -1 + -6(sqrt(17) + sqrt(425)))*2 - (3 + (61sqrt(17))2 + sqrt(1377) + -1). 39sqrt(17) + 9179 Simplify (sqrt(5) - (sqrt(5) + sqrt(5) + (sqrt(125) + 0 + sqrt(125))*2) - (0 + sqrt(405))) + (-1sqrt(125) - (1 + sqrt(5) + -5))*2. -304 - 58sqrt(5) Simplify (sqrt(784) + 2sqrt(784) + sqrt(784) + (sqrt(16) - sqrt(32)/sqrt(2)3))/(-1sqrt(968)4). -13sqrt(2)/22 Simplify (sqrt(98)1 - (sqrt(162) - (-1 + sqrt(162))2)) + 1 + (2 + sqrt(2178))2. 112sqrt(2) + 2346 Simplify ((-4 + sqrt(26)/sqrt(2) - (sqrt(65)/sqrt(5) - sqrt(13))-6) + (sqrt(13) - sqrt(65)/sqrt(45))-1)2. -8sqrt(13)/3 + 157/9 Simplify 6(0 + sqrt(171) + (3 + sqrt(171))1 + sqrt(171)). 18 + 54sqrt(19) Simplify (((3sqrt(152))/sqrt(4))/(sqrt(216)/sqrt(12)) + 0)*23. 57 Simplify ((sqrt(171)-53 - sqrt(171) - sqrt(171)) + sqrt(171) + sqrt(171))/(2sqrt(324)). -5sqrt(19)/4 Simplify (-3(sqrt(304) + -4) + 3 + sqrt(304) + 2 + sqrt(304))2. -136sqrt(19) + 593 Simplify (-4 + ((sqrt(96) - (sqrt(96) - (sqrt(96) + (sqrt(96)-2 - sqrt(96)) + sqrt(96) + sqrt(96))) - sqrt(96))6)/sqrt(12) + 5)*2. -24sqrt(2) + 289 Simplify (sqrt(17) - (sqrt(17) - sqrt(136)/sqrt(32)) - (sqrt(136)1)/sqrt(8))21 + -5sqrt(119)/(sqrt(525)/sqrt(3)). -sqrt(17) + 17/4 Simplify 3 + (-2 + (sqrt(25)/sqrt(5) + 1 - sqrt(25)/sqrt(5)-2))*2. -6sqrt(5) + 49 Simplify 5(3 + 3sqrt(5) + sqrt(5) + 3 + -4((sqrt(180))2 - sqrt(5)) + 3). -3555 + 40sqrt(5) Simplify (sqrt(567) + (2 + sqrt(567))-1 + (1(-1 + sqrt(567)) + sqrt(567) - sqrt(567)) + -3)*2. -108sqrt(7) + 603 Simplify 2(sqrt(176) + 1)2-1 - (-1 + (1 + sqrt(176))*2 + sqrt(176))-5. 44sqrt(11) + 526 Simplify ((-3sqrt(931)2 - (sqrt(931)-2 + 1)) + (sqrt(931) + 0 + -5 - sqrt(931)) + sqrt(931) + (sqrt(931) - -1sqrt(931))4)*2. -420sqrt(19) + 23311 Simplify (2sqrt(33)3 + sqrt(33) + sqrt(33))/((1sqrt(3) + sqrt(3))1) + -2. -2 + 4sqrt(11) Simplify (5 + ((1sqrt(504))/sqrt(8) - sqrt(63))/(sqrt(9) - (sqrt(9) - sqrt(54)/(sqrt(24)/sqrt(4)))))-6. -30 Simplify (sqrt(396) + sqrt(396)2)6 + 2 + 4(sqrt(11) + (sqrt(11)4)2). 112sqrt(11) + 706 Simplify (2sqrt(3456))/(1sqrt(24)/sqrt(3)). 24sqrt(3) Simplify 4((sqrt(13) - sqrt(26)/(sqrt(4)/sqrt(2))) + 3)-56. -360 Simplify (-6(sqrt(140) + sqrt(140) + sqrt(140) + sqrt(140)2))/(1sqrt(28)-2). 15sqrt(5) Simplify (sqrt(392) + -5((sqrt(392) - (sqrt(392) - (sqrt(392) + -1 + sqrt(392) + sqrt(392)))) + sqrt(39	{ "pile_set_name": "DM Mathematics" }
5, 3n = 3i - 15. Let p(r) = -6r + nr*2 + 5r - r*2 + 5 - 15. Calculate p(k). -10 Let q be 3/(-1)(-1)/93. Let p(j) = 29j - 3. Give p(q). 26 Let a = 283 - 248. Suppose 0 = -4f - 5k - a, 2k + 26 = 2f - 6f. Let d(p) = p3 + 5p*2 - 2p + 7. Give d(f). 17 Suppose -2u = -5z + 46, -3z - 5u + 14 = -26. Suppose 6a + z = 4a. Let f(x) = 11x + 6x*2 - 48x*3 + 2x - 5 + 49x3 - 5x - 7x. Calculate f(a). 15 Let u(q) be the third derivative of 13q*5/60 + 7q*4/4 + 7q*3/6 - 3q*2 - 4q + 5. Calculate u(-3). -2 Let v be 6(1 + (-4)/6). Let m(u) = 9u + 7. Let r(q) = -11q - 9. Let z(b) = b2 - 40. Let k be z(6). Let n(i) = kr(i) - 5m(i). Determine n(v). -1 Let d(m) = -m - 7. Let k(a) = -2a - 19. Let t(f) = -3f - 36. Let s(c) = -7k(c) + 3t(c). Let r be s(-5). Calculate d(r). -7 Suppose -30 = 3q + 5y + 37, 3q = 2y - 32. Let o(d) = -d3 - 16d*2 - 17d + 34. Give o(q). -120 Let p(g) be the second derivative of g6/360 + g5/24 + 5g4/24 - 5g3/3 + g2/2 - 73g. Let j(z) be the second derivative of p(z). Calculate j(-5). 5 Let h(v) = 4v*2 + 4v*2 - 19v + v2 - 80 + v2 - 11v2. What is h(-5)? -10 Let x be (-2)/(((-4)/(-6))/(-1)). Suppose -34 = 2l - 82. Suppose -4f + 4d = l, 7f - xd + 20 = 3f. Let z(r) = -4r - 2. Calculate z(f). 6 Suppose -341 - 89 = -126p + 40p. Let s(l) = 2l2 - l - 7. Determine s(p). 38 Let z(q) = -14q*2 - 4q - 19. Let m(d) = d*2 + 2d + 13. Let p(g) = 2m(g) + z(g). Give p(3). -101 Let x(p) be the second derivative of p5/20 + 5p4/12 + p3/3 - 3p2/2 + 2p - 797. Suppose -5n + 3i - 6 = 0, 0n + 4i = -n - 15. Determine x(n). 9 Let p(h) = 1008h - 245h - 244h - 183 - 250h - 254h. What is p(12)? -3 Let q(x) = -2x*2 - 6x - 6. Let m be q(-3). Let g(l) = 7l2 + 3l - 2. Let t(a) = a*2 + a. Let h(i) = mt(i) + g(i). Let w = -369 - -371. What is h(w)? -4 Suppose 1003n = 1008n - 15, 15 = 6x - 3n. Let z(y) = 16y - 12. Determine z(x). 52 Let j(g) = 12g - 45. Let r(q) = -q*3 - 26q*2 + 68q + 338. Let k be r(-28). Calculate j(k). -21 Suppose 5z = -392 + 167. Let q = z - -38. Let k(h) = h3 + 8h*2 + 7h. What is k(q)? 0 Let t(b) be the third derivative of b*3 + 1/24b*4 + 0b - 4 - 6b2. Give t(-6). 0 Let q(f) = -f2 + 11f + 82. Let p = 3892 - 3876. Calculate q(p). 2 Let y(k) = -4k - 63. Let b(l) = -l + 21. Let p(i) = 6b(i) + y(i). Give p(6). 3 Suppose 4g - 5h = -24, 4g - 11 = 2h - 35. Let q(b) be the second derivative of 1/2b2 - b + 0 - 1/3b*3. What is q(g)? 13 Let j(l) = -2l*3 - 9l*2 - 10l - 13. Suppose -3g = -4v, v - 22 + 17 = 2g. Let f be j(g). Let k(n) = -3 - 1 - 8 + 2n - n. Give k(f). -1 Let l(t) = -t*3 - 9t*2 - 8t + 13. Let r = -8199 + 8191. Determine l(r). 13 Let r(i) = 54i2 - 9i - 30. Let p(q) = -13q2 + 2q + 7. Let a(v) = -25p(v) - 6r(v). What is a(-6)? 17 Let u(y) = -3y + 17. Let f(a) = 3a + 13. Let m(c) = -c - 2. Let x(v) = -5f(v) - 20m(v). Let b(o) = 8u(o) + 5x(o). Give b(-10). 1 Let a(d) be the first derivative of -10d + 101 - 1/2d*2. Give a(-11). 1 Suppose -128r - 3408 = 156r. Let m(a) = -a2 - 15a - 7. Calculate m(r). 29 Let w(x) = -x*3 - 6x*2 - 2x + 6. Let g be w(-5). Let o(s) = 323s - 45. Let p(y) = -149y + 22. Let n(f) = -6o(f) - 13p(f). Calculate n(g). -7 Let l(b) = b*2 + 5b + 4. Let h be l(-4). Let q(a) = a*2 + 11a - 76. Let j(t) = t*2 + 10t - 68. Let f(n) = -12j(n) + 11q(n). Calculate f(h). -20 Let l(a) = 267a + 25a*3 - 46a*3 - 23a3 + 2 + a2 - 16a3 - 270a. Give l(1). -60 Let x(a) be the third derivative of -a6/120 + a5/30 - a*4/24 - 17a*3/6 - 12992a*2. Calculate x(-2). 1 Let z = 3652 + -3648. Let r(q) = 13q - 39. Give r(z). 13 Suppose p - 13 = -c + 3p, 3c + 16 = -5p. Suppose 0 = 28n - 30n. Let f(x) = x3 + 9 - 2x*2 - 5 + n - 3x. Calculate f(c). 4 Let h(x) = 321x + 7 + 13x*2 - 14x*2 + 318x - 632x. Determine h(5). 17 Let v(h) = 54h + 1475. Let p(g) = -136g - 3686. Let w(i) = 5p(i) + 13v(i). Give w(-34). -3 Let c(w) = 54w + 9. Let y(o) = -19o - 4. Let r(a) = -6c(a) - 17y(a). Let m(p) = p2. Let v be m(3). Calculate r(v). 5 Suppose -28r = -30r + 164. Suppose -r = -4t - 86. Let c be t(1 + 0 + 0). Let l(z) = z2 + 2z + 1. Calculate l(c). 0 Let z be 1/((-959)/161 - -6). Suppose 7 = -zp + 22p. Let t(u) = -3u. Give t(p). 21 Let m(w) = 0w*3 + 94 + 0w*3 - 15w*2 - 55w - 47w + 109w - w*3. Give m(-15). -11 Let u(q) = -4q - 2. Let m be (87/(-116))/((-21)/8)28. Let i be -6(-15)/(-21) + m/28. Give u(i). 14 Let m be -2(-5)/20-4. Let k(y) be the second derivative of -4y3 + 508y + 1. Determine k(m). 48 Let n(c) be the first derivative of c*4/4 - 2c*3 + 3c*2/2 - 6c - 844. Let j = 10 - 6. Let l = j + 2. Determine n(l). 12 Suppose -2w + w + 27 = l, 21 = w + 4l. Suppose -w = 5n - 9. Let m(g) = -g - 1. Determine m(n). 3 Let t(r) = r2 + 5r + 1. Let x be (2/(-4))/((-2)/4). Let l be (2/(-4))/(x/(-12)). Suppose -1 = -b - l. Determine t(b). 1 Let w(m) = -1 + 2 - 6 - 3m. Suppose -92q + 4c - 36 = -88q, -11 = 3q + c. Determine w(q). 10 Let u(t) = -t3 + 2t*2 + 3t + 7. Suppose 36 = 7a - 32a + 111. Determine u(a). 7 Let a(u) = -2u2 - 2u - 1. Let y(v) = -12v - 3 + 3v*2 + 9v + 8 - 4 - 3. Let p(d) = a(d) + y(d). Give p(-3). 21 Let p = 426 - 134. Let t(x) = -x*2 + 301 + 0x + x - p. Give t(-4). -11 Suppose 3i + 5y - 11 = 0, 3 = -2i - 2y + 9. Suppose -6 = -5k + 4m, k = 5k - im - 6. Let z(v) = 0 + 3vk - 2v*3 - 5 + 5. Give z(2). -4 Let s(k) = 455k - 919k + 7 + 469k. Give s(-3). -8 Let z(x) be the second derivative of -x*5/20 - 3x*4/4 - 5x3/3 - x2 + 860x. Calculate z(-7). -30 Let q(d) be the third derivative of 1/120d*5 - 6d*3 + 0 + 0d + 17d2 + 7/12d4. Let i(c) be the first derivative of q(c). Calculate i(-9). 5 Let u(f) be the first derivative of -f4/4 - 4f3/3 + 3f*2 + 7f + 1. Suppose -279b + 2006 - 3401 = 0. Calculate u(b). 2 Let l = -113 + 158. Let n be (-210)/4 + 2/4. Let w = n + l. Let h(s) = s - 9. What is h(w)? -16 Let d(c) = -24c + 8766 + 7c - 8760. Calculate d(-1). 23 Suppose 0 = -k - 1 + 2. Let z be (1 + 2 - k)2. Let y(n) be the third derivative of -n*4/12 + 638n*2. Calculate y(z). -8 Let o(s) = -4s*2 + 82s + 42. Suppose -116 = -4p - 4n, 167n + 60 = 4p + 164n. Give o(p). 0 Let j(o) = o2 + 5o + 0o2 - 6 - 14 + 10o. Let t be (-640)/(-80)(-3 + 4 - 3). Calculate j(t). -4 Let k(o) be the third derivative of -o5/30 + 25o4/24 - o3 - 227o2. Let f(t) = 4t*2 - 46t + 11. Let j(h) = 6f(h) + 11k(h). Give j(-2). 10 Let d(t) = t*3 + 3t*2 + 3t + 5. Suppose -55v + 70v = -60. Calculate d(v). -23 Suppose -t = -2s - 5, -5 = 2t + 2s - 3. Let a(z) be the second derivative of -3z5/10 - z4/12 + z3/6 - z2/2 + z. What is a(t)? -7 Let b(k) = 5k2 - 3k*2 - 3k + 1 - 3k2 - 5. Let q(f) = -f3 - 58f*2 - 4f - 235. Let c be q(-58). Calculate b(c). -4 Let a(q) = 17q3 + 6q*2 - 25q + 44. Let m(t) = 27t3 + 9t*2 - 37t + 67. Let j(u) = 8a(u) - 5m(u). Give j(-6). -1 Let q(a) = a*3 + 10a*2 + 6a - 14. Let v(b) = 5b3 + 42b*2 + 25b - 56. Let k(o) = 9q(o) - 2v(o). What is k(6)? 10 Let z be (-81 + 80)(-42 - (2 + -1)). Let j(m) = 3 + 1 + 3m*2 - zm - 4m2 + 36m. What is j(-8)? -4 Let i(f) = -f*3 - 8f*2 + 2f + 15. Suppose -895u + 923u + 127 = -69. Determine i(u). -48 Suppose -5o = 5r + 35, -r + 9 = -13o - 26. Let j(i) = -3i + 0i + 2i - 3. Calculate j(o). 0 Let k be -1 - (4/(-18) + ((-808)/(-72) - -1)). Let x(c) = 6c + 19. What is x(k)? -59 Let i(w) be the second derivative of w3/3 + 2w*2 - 6w. Let k be ((-4)/14)/((27/63)/(-3)). What is i(k)? 8 Suppose 95g + 407 = -163. Let j(q) = q3 + 5q*2 - 17q - 76. Determine j(g). -10 Let z(x) = -15x + 1. Suppose 3y - 8y + 3l = 30, -y - 2l - 6 = 0. Suppose 0b - 16 = 4b. Let c be (-45)/15b/y. Give z(c). 31 Let t(z) = -z + 8. Let y be t(6). Let m(v) = -2v + 3v*y - 8v*2 + v. Let n be (-6 - (-6 - -1))/(2/4). Give m(n). -18 Suppose -4y - 81 = -109. Let h(a) = 3a2 - 26a + 28. What is h(y)? -7 Let c(j) = j + 1. Let v(i) = 1. Let k(o) = 5c(o) - 4v(o). Let z = 0 + 14. Let q(p) = p*3 - 16p*2 + 28p + 3. Let f be q(z)	{ "pile_set_name": "DM Mathematics" }
t h be (u/10)/((-2)/(-5)). Solve hb - 3 - 3 = 0 for b. 3 Suppose 3s + 5v - v = -76, s - 4v = -4. Let f = s - -25. Suppose 4r - fr = 0. Solve c + c + 10 = r for c. -5 Suppose -4q + 11 = -5c - 10, 4c = -20. Let j be q/3-21 - -1. Solve -2o - 2 = -j for o. 3 Let h(a) = 3a*3 + 22a*2 - 23a - 30. Let n be h(-7). Solve 2q + 28q = -n for q. -6 Suppose -9 = -4j - 5b, -3j = -0j - 3b - 27. Suppose -jg - g - 672 = 0. Let y = g - -98. Solve -yp = 2p - 20 for p. 5 Let w(h) = -5h2 - 72h - 58. Let p be w(-17). Let b = p - -318. Solve br - 44r = -5 for r. 1 Let t(c) = -2c2 + 25c + 15. Let z be t(13). Suppose -zu - 2 = -8. Suppose -2i + 2 = 2s, 3 = -2i + i + us. Solve w + 0w = i for w. 0 Suppose -4x - 4288a + 184 = -4300a, -2x + 3a + 56 = 0. Let u(t) = t + 4. Let s be u(6). Solve xj - s = -60 for j. -5 Let p(g) = g*3 - 47g*2 + 397g - 986. Let d be p(37). Let w = -20 + 32. Solve wc - dc = 2 for c. -2 Suppose 2s = k - 621, 3k = 3s + 8k + 951. Let n be (-18)/63 - s/14. Solve n - 2 = 4y for y. 5 Let z(b) = -b + 28. Let f be z(3). Suppose 8a + f - 49 = 0. Solve aq - 3 + 12 = 0 for q. -3 Let z(y) = -y2 - 86y - 1520. Let x be z(-61). Solve -81 = xg - 56 for g. -5 Let p(n) = n3 + 2n*2 - 14n - 3. Let h be p(3). Let m be 1-3 - (63 - -9). Let i = m + 77. Solve ig + 9 + 1 = h for g. -5 Let x = -2713 + 3337. Solve 4z = -604 + x for z. 5 Let s be 67(176/11 + -15). Solve -4c - 51 = -s for c. 4 Suppose -x + 34 = -3o, -40x + 44x - 70 = o. Solve -xt - 10 = -11t for t. -2 Suppose 0 = -6x + 3x + 6. Suppose -5b - xf - 4 + 0 = 0, -4f = 2b + 8. Solve 3 = -bh - h for h. -3 Let k be ((174/24)/(-29))/((-1)/1532). Solve kj - 32 = 391j for j. -4 Suppose 5a - 851 = 2c - 853, -4c - 5a + 94 = 0. Solve -20x - 144 = c for x. -8 Let p(g) = 6g + 43. Let t be p(9). Let c = -95 + t. Solve cd - 7d - 25 = 0 for d. -5 Let m = -15251 - -15251. Solve m = 3b - 453 + 459 for b. -2 Let i = 4979 + -4977. Let b be (0/1)/(2/(-2)). Solve bf = -if + 6 for f. 3 Suppose 4z = 725 - 713. Solve 18k = -51 - z for k. -3 Let z = -740 - -755. Solve -zy + 145 = 14y for y. 5 Suppose -500r = -620r + 480. Let p(q) = -q*3 + 0q*3 - 1 + 4q*2 - 5q*2 - q. Let u be p(-2). Solve m + r = um for m. 1 Let d = 131 - 123. Suppose dp = 9p + 6p. Solve 0 = -pc + 3c - 15 for c. 5 Suppose 0 = 5h - 5j + 140, h + 2j = -4h - 161. Let s = -7 + h. Let w = -36 - s. Solve 0 = q - w - 0 for q. 2 Suppose 0o + 2o - 4c + 10 = 0, 0 = o + 5c - 30. Suppose -2 = -4s - 2w, 0s = -2s + w - o. Let l be (13/(-65))/(s/5). Solve -l = 2x + 1 for x. -1 Let l(s) = 8s - 27. Let p(k) = -7k + 24. Let i(f) = 4l(f) + 3p(f). Let n be i(5). Solve -10 = -3q - n for q. -3 Suppose 51 = -v + 2k - 49, 3v + 2k = -260. Suppose -390 + 132 = 3n. Let w = n - v. Solve -9 + 1 = -wi for i. 2 Let p be 0/((-7 - -2)/1). Suppose 20j - 22j - 1 = u, 4u - 2j - 16 = p. Solve -u = -t - 2t for t. 1 Suppose 0y - 8 = -3r + y, -r + 4 = y. Suppose -4l = -rl + 2q - 2, -4q = l + 6. Let v be (-1)/((-26)/(-52)(-8)/12). Solve -vj - 2j - l = 0 for j. -2 Let q be (-113)/226(-7 - 1) + 53. Solve 20o - 4 = qo for o. 4 Let o be (18/126 + 1(-5)/35)/1. Solve o = -26g + 37g + 22 for g. -2 Let j(b) = 2b*2 - b + 39. Let k be j(0). Suppose 4l + k = 5u + 742, -4u - 569 = -l. Let x be 4/(-26) - 308/u. Solve -2n = -0 + x for n. -1 Let i be 15/15 + 0(-2)/4. Suppose 4t = -88 + 436. Suppose -2d = 4y - 40, -4d + 2y + t = 27. Solve 3r = -d + i for r. -5 Let v be (-5)/(((-5)/1)/5) + -12. Let z be v + (-670)/(-45) - 2/(-18). Solve -2w + zw + 12 = 0 for w. -2 Let v(s) = s - 2. Let y be v(2). Let a = -1225 - -1230. Solve at + y = -15 for t. -3 Suppose 5 = 12o - 7o + 3x, 2o + 2x - 6 = 0. Let a be -1 + -3 + o + 11. Solve -ak = -7k - 8 for k. -4 Let u(x) = -x*3 - 8x*2 + x + 10. Let n be u(-8). Suppose nw + 7w = 18. Solve -3 = d + wd for d. -1 Let w = -1 - -5. Suppose 56 = 14h - 10h. Suppose 0 = -4v - s + h, -24 + 6 = -2v + 5s. Solve v = -wk + 3k for k. -4 Let l(m) = -118m + 11365. Let c be l(96). Solve -34k + c - 275 = 0 for k. -7 Let a(k) = -k2 + 7k + 3. Let s be a(6). Suppose 89 = 2z - 1. Let r be (1458/z)/6 - 3/(-5). Solve -r = f - s for f. 3 Let t(r) = 3r*2 + 28r - 365. Let c be t(-18). Solve 109x = cx + 36 for x. 6 Suppose -4 + 19 = -2o - 3, q + 3o + 22 = 0. Suppose 6d - 25 = d. Solve -d = -2l + q for l. 5 Suppose 224i + 216i - 407i - 14058 = 0. Solve 427c = ic - 3 for c. -3 Suppose d + 5s + 0 + 32 = 0, 0 = -5d - 4s - 76. Let h(c) = -c - 10. Let y be h(d). Suppose yj + j = 6. Solve -ji = i + 3 for i. -1 Suppose 9 = 4x - 3k, x + k + k - 5 = 0. Let g be 80/30 + (-13)/(-39). Let u(i) = i*3 + 4i*2 - 2i + 4. Let d be u(-4). Solve -d = gp - x for p. -3 Suppose -21 = -3c - k, 3c + 3k = 38 - 11. Let m(p) = -6p3 + 26p*2 - 6p - 5. Let z be m(4). Solve c + 6 = zq for q. 4 Suppose 2t + 9 = 17. Suppose p = -p + 5o + 13, 0 = -tp + o + 35. Let i be -12 + p + 7 + (1 - 1). Solve -2u - 6 - i = 0 for u. -5 Suppose 46f = -46f + 7f + 3655. Solve -25z - f = 32 for z. -3 Let g = -16449 + 16485. Solve 24 = -20a - g for a. -3 Let y(a) = -2a2 + 8a - 52. Let t be y(8). Let d = -116 - t. Solve -w + 2w + 3 = d for w. -3 Let p(o) = 12o - 9. Let a be p(4). Let i(s) = -38s2 + as*2 + 21 + 11 - 4 - 15s. Let w be i(13). Solve m + 5 = wm for m. 5 Suppose -96q + 3220 = -4q. Solve 8l = ql for l. 0 Let h = 9590 - 9565. Solve -h = -4y - y for y. 5 Let x be 6 - (-52 - (5 - 7)). Solve 70 = 42d - x for d. 3 Let a(y) = y3 - 4y*2 - 19y + 75. Let m be a(3). Solve -mc - 231 = -42c for c. 7 Let w(n) = -8n2 - 3n + 4. Let q be w(-4). Let t = 127 + q. Suppose 0d + 165 = td. Solve 0 = -2h - d + 3 for h. -4 Suppose 36v = 32v - 1292. Let z = -320 - v. Solve -5 = -zb - 2 for b. 1 Let l(b) = 1611b - 7960. Let g be l(5). Solve -g = 156m - 175m for m. 5 Let z = 10870 + -10831. Solve -7p - z = -11 for p. -4 Let p = 61 + -53. Suppose -w + 5l + 30 = 0, pl - 11l - 62 = -5w. Let n be w + 1/((-5)/25). Solve -3t + 4 + n = 0 for t. 3 Suppose 223l - 317l = -11280. Solve -9p - 156 = -l for p. -4 Let d(o) = 18o2 + 78o + 84. Let x be d(-3). Solve 44 = xr - r for r. 4 Let n be 63/9 + 16/(-4). Suppose nh - 18 + 9 = 0. Solve 3t + 0 = h for t. 1 Suppose 0 = 11s - 7s - 144. Suppose 19q - s = 10q. Solve -2 = -2n + q for n. 3 Suppose -2b + 3q + 11 = 2q, 2b + 14 = -4q. Let x = 55 + -52. Suppose xj = 0, f + 8j - 2 = 7j. Solve 0 = bs + 5 - f for s. -1 Let j(g) = g3 - 88g*2 - 12g + 1065. Let r be j(88). Solve rw - 47 - 7 = 0 for w. 6 Suppose 4x - 336 = -3v, -3v = 3x - 6x - 294. Solve -57u - 67 = v for u. -3 Let u be (-14)/42 - (-26)/6. Let h(j) = j + j - uj + 14 + j. Let t be h(8). Solve 3x = -3 - t for x. -3 Let m(l) = -l - 83. Let z be m(-11). Let t = -72 - z. Solve ti - 6 = 3i for i. -2 Let m = -15 + 58. Suppose h - 41 = 4y - 8, h + y = m. Let b = h + -36. Solve -12 = -bk + 8 for k. 4 Let w(j) = j2 - 20j + 95. Let n be w(10). Let t(x) = -2x3 - 4x*2 + 29x + 1. Let a be t(n). Solve 0 = 2p + p + a for p. -2 Let l = -4 - -4. Suppose l = -71p + 64p. Solve p = -0v - 2v + 8 for v. 4 Let q be (-4)/18 + (-44857)/279. Let n = q + 164. Solve -ng + 1 = -5 for g. 2 Let m = 31 - 11. Let y = m - 15. Suppose 0 = 4s - 5h - 25, 4s + 5h = -20 - 5. Solve sr = yr for r. 0 Let g(f) = -3f - 6f - 9 + 5f + 0f. Let d be g(-11). Let p = d + -32. Solve -px + 5x = 10 for x. 5 Suppose 5a + 23a - 2024 = 6a. Solve 0 = 14g + 78 - a for g. 1 Let r = 324 - 739. Let g = r - -430. Solve -gk + 17k - 2 = 0 for k. 1 Let o be (7/(-6)952/833)/((-2)/192). Solve -71q + 39q - o = 0 for q. -4 Let s(y) = 109y - 951. Let x(h) = -22h + 192. Let j(n) = -2s(n) - 11x(n). Let d be j(9). Solve -2p = -dp - 8 for p. -2 Suppose -54 = -2n + 5k, -2n - k = -8 - 34. Solve -19a - 16 = n for a. -2 Let k be 17/(-2)(-4)/17. Let t be 0/(3(-3)/(-9)). Suppose 3n + d = 18, t = -4n + 4d + 10 + 30. Solve nw = kw for w. 0 Let r be (-6)/(-12) - 138/(-4). Suppose -30g + 95 = r. Solve 2z - g - 2 = 0 for z. 2 Suppose 0 = -r - 3y + 56, 96y + 7 = -r + 102y. Solve 0 = rg - 26*g - 9 for	{ "pile_set_name": "DM Mathematics" }
3i + q = -5i for i. -4 Let s(q) = -7q + 117. Let y be s(16). Solve 19 - 9 = -ya for a. -2 Suppose -4h + 14 = 3o, 1 = 4o + 5h - 18. Solve -3v + 6v - o = 0 for v. 2 Let o be 3 - 0 - (-12)/1. Suppose -10v + ov = 60. Solve w - 5w = v for w. -3 Let m = 31 - 19. Suppose 0 = 2t + 2t + 4q + m, 0 = t + 2q + 6. Suppose -3s = -2z + 4, 0 = -tz - 2z + 4s + 2. Solve 3h - z = -2h for h. 1 Suppose 22q = 22 + 22. Solve -qp = 16 - 10 for p. -3 Suppose -2h = t - 11, 0 = h + 2h + 3t - 24. Suppose -ho = -166 + 154. Solve -3 = -op + 13 for p. 4 Suppose 0 = 2j + 2v - 5v - 20, 2j - 4 = -5v. Let d be (-4)/(-8)-8 + j. Solve dx - 20 = -2x for x. 4 Let m(s) = -6s + 6. Let u be m(-11). Let z be (2/12)/(4/u). Solve zk + 2k = 15 for k. 3 Let z = -7 + 11. Suppose zj + 8 = -2f, -5f + 5j - 2 + 12 = 0. Let r be (296/111)/(4/3). Solve fm - 2 = -rm for m. 1 Suppose 0 = j - 4 - 1. Suppose -6b = -jb. Suppose -y = -by. Solve y = c + 3c for c. 0 Suppose 2k = 5g + 105, 21k - 17k + 3g - 145 = 0. Solve 6u + 14u = -k for u. -2 Let t(o) = -o3 - 25o*2 - 2o - 40. Let i be t(-25). Solve 6 = -2j + i for j. 2 Suppose -o - 11 = -24. Solve 33 = 5n + o for n. 4 Let d(g) be the first derivative of -g*2 - 2. Let i be d(0). Suppose 0 = 16j - 13j - 12. Solve ir = r + j for r. -4 Let w(u) = 7u - 1. Let p be 2/1 + (1 - -3). Let b be w(p). Let z = b + -21. Solve 3n = -n + z for n. 5 Suppose -9i = -7i - 38. Suppose ip + 13 = 20p. Suppose 5f - 20 = 3t + 2, 2f - p = -3t. Solve -t = -r - 3 for r. -2 Suppose q = c - 2c + 21, 4c - 9 = -q. Let j = 40 - q. Solve 0 = 2g + 5 - j for g. 5 Suppose 3f + 21 = 5q, -4q + 6f = 11f - 39. Solve 9o + q = 7o for o. -3 Let m(u) be the second derivative of -u*5/20 - 7u*4/12 - 5u*3/6 + 5u*2 + 19u. Let x be m(-6). Suppose p = -2p + 21. Solve -xb - p - 9 = 0 for b. -4 Let h(p) = -p*3 - 6p*2 - p - 4. Let o be h(-6). Solve -c + 0 = o for c. -2 Let c be 2 + (-5 - 92/(-12))6. Solve -ct - 27 = -9t for t. -3 Suppose -g + 3n + 22 = 0, g = -2g - 2n + 11. Suppose 2a + f - g = 0, -f - 2f = a - 11. Let s be 5 - 3 - (1 - -1). Solve s = b + 3 - a for b. -1 Suppose -2j + 4j - 8 = 0. Suppose 5l - 9 - 11 = -k, 0 = l - k - 10. Suppose -2o - 4z = -20, 3z - 31 - 47 = -lo. Solve -jd + o = -2 for d. 5 Let t(h) = 8h - 31. Let b be t(6). Let s = -15 + b. Solve sg = -g for g. 0 Let k(w) = -3w + 13. Let p be k(5). Let h be (3 - 8)p1. Solve 3t - 1 = -h for t. -3 Let b(w) = w2 - 21w + 71. Let t be b(17). Solve -c - tc = 4 for c. -1 Suppose -10z - 28 + 108 = 0. Solve -10l = -zl - 4 for l. 2 Suppose 2m = 0, -17q = -16q - 3m. Solve qp - 11p - p = 0 for p. 0 Suppose 2h + k = -2h + 15, 4k = -5h + 16. Solve hn + 16 = -4 for n. -5 Suppose 0 = 5q + 10, 4p + 0q + 338 = q. Let x = p - -89. Solve -2l - 2l + x = 0 for l. 1 Let d(l) = -l*2 + 16l + 7. Let v be d(12). Suppose 3o = 3n + 10 + 11, n = 5o - v. Let p = 12 - o. Solve p = -2f + 3f + 2 for f. -2 Suppose z = -3k + 6z + 21, k - 7 = 2z. Suppose 5 + k = 4q. Suppose d = -5, -4g - qd + 25 = -0g. Solve g = c + 4c for c. 2 Let t = 753 + -751. Solve 9z + t = -25 for z. -3 Let k(d) = 2d2 - 27d + 18. Suppose 5g - 2u - 63 = 0, 0 = -2g - g - 2u + 41. Let o be k(g). Solve 6q - 1 = oq for q. 1 Suppose y - 3f + 11 = 0, 12 = 2y + 2y + 2f. Let u = -115 - -114. Let s be (-5 + y + -1)/u. Solve 5 = sa + 25 for a. -4 Let j = 49 - 136. Let a = j + 93. Solve 0 = 15z - 12z + a for z. -2 Suppose -22 + 162 = 35o. Solve oz - 6z = -0z for z. 0 Let b = -254 + 258. Solve -s = bs for s. 0 Let f be ((-684)/(-209))/(-18) + 57/11. Solve -42q - f = -43q for q. 5 Suppose 0 = -4i + 2y + 10, -2y - 15 = 5i + y. Solve -17g + 3g = i for g. 0 Let n = 7 + -5. Suppose -b - 6o = -2o + 12, 8 = 4b + no. Solve -c = -bc for c. 0 Suppose -l + 6 = -30. Suppose -t = 2t - l. Suppose -p - 2p + t = 0. Solve 4 = -pk + 8 for k. 1 Suppose -156 = 2c + 4. Let j = 84 + c. Solve jq - 11 = 1 for q. 3 Let p = -300 + 305. Solve -8y - 19 - p = 0 for y. -3 Let r(z) = 10z - 33. Let h be r(4). Let c be 2/(-3) - 44/(-3). Let p be 4/c - (-5)/h. Solve -2x - p = 3 for x. -2 Suppose -5 = 5q, -3u - 3q = -2q - 8. Solve ut - 2 = 1 for t. 1 Let m be ((4 - 3) + 1)/((-1)/(-4)). Solve -mu - 4u = -12 for u. 1 Let m(y) = -y*3 + 9y*2 - 5y - 15. Let p be m(8). Suppose h = 4z - 2 - 5, -3h + p = 3z. Solve z = -g - 1 for g. -3 Suppose 17y - 208 = -72. Solve -32 = -yi - 0 for i. 4 Suppose 35k - 135 - 215 = 0. Solve h + kh = -22 for h. -2 Let i(s) = s - 3. Let o be i(3). Let g(r) = 4r3 + r2 - 3r + 1. Let c be g(1). Suppose 0 = 5d + cy - 54, -2d + y + 17 = 2. Solve -3n + d = -on for n. 3 Suppose -13t = 2t. Solve q + q - 4 = t for q. 2 Let v(i) = -i*3 - 25i*2 + i + 34. Let x be v(-25). Let u be (-2)/((6/x)/(2/(-3))). Solve m = -1 + u for m. 1 Suppose -3g = -5g. Suppose -5h = -3n + 5, -2n + 10 = 5h + 15. Solve -2c + nc + 6 = g for c. 3 Suppose -5g = -25, 13 = 18j - 20j + 5g. Solve jp + 50 = 20 for p. -5 Let d be (-7 + 4)(-5)/3. Suppose 0 = -3o + o - c + 39, 5c = -2o + 59. Let z be 0 - 3/(-3)o. Solve -4l = z - d for l. -3 Let k = 1 - -1. Suppose 0m = 2m + 3w - 13, -km = 4w - 16. Solve -8 = -ma - 2a for a. 2 Let l = 1333 + -1326. Solve -n = -ln + 24 for n. 4 Suppose 16 = 4j - 4. Let a = 7 - j. Suppose 0 = 3t - 7 - a. Solve th = h for h. 0 Let z = -91 + 95. Suppose -2i + 3i - 19 = 0. Suppose 4b - i = 41. Solve zj + 3 = b for j. 3 Suppose -13s = 22s - 630. Solve -s + 14 = -2j for j. 2 Let x(o) = 3o - 1. Let f be x(1). Suppose -4k + 3g = -f, 9 + 1 = k + 4g. Solve 0u - ku = -2 for u. 1 Suppose 454 + 586 = 52w. Solve 8y + w = -12y for y. -1 Let m = -1959 - -1990. Solve -4j - m + 19 = 0 for j. -3 Suppose 15 = -3d + 8d. Let u be 15/(-12) - (-27)/(-36). Let g be ((-3)/u)/(12/32). Solve 2a - da - g = 0 for a. -4 Suppose -t + i + 13 = 0, 2t + 6i - 16 = 3i. Solve -4b - t - 9 = 0 for b. -5 Let i(q) = -6q - 31. Let p be i(-13). Solve po + 8 = 43o for o. -2 Let c(v) = v3 - 5v*2 + 5v - 21. Let b be c(5). Solve bh + 27 = 7 for h. -5 Let d be 2-2(-3)/4. Let z(v) = 2v*2 - 4v + 3. Let a be z(d). Solve 0j = -3j + a for j. 3 Let k = 354 + -354. Solve kt + 2t = 6 for t. 3 Let m(n) = -n*2 - 13n + 0n2 - 24 - 2n. Let o be m(-13). Solve of - 1 = 5 for f. 3 Suppose 3p - 7p = 20. Let y = 5 + p. Solve -2 = -yu - u for u. 2 Let r be ((-3)/2)/(18/(-192)). Let z = -9 + r. Let k = z + -5. Solve 0 = kp + 8 - 4 for p. -2 Suppose 4h - 8h - 12 = 0, -4t = -4h - 44. Suppose 4r = 5u - 32, 2 = 2r + t. Solve 0 = -0o + uo + 16 for o. -4 Suppose -5h = -h - 8. Suppose -5b - 4y = -0b + 18, -2y - 4 = 0. Let v be 4 - (-1 - 6/b). Solve 4q - h = v for q. 1 Let j be 56/6(-6)/4. Let m = j + 18. Suppose i + 9 = mi. Solve -it + 2t = -2 for t. 2 Let t = -124 - -133. Suppose -30 = -4c - c. Solve -t = -5r + c for r. 3 Suppose 11o + 1 = 1167. Solve oa = 111a for a. 0 Let w be -2 + (-44 + -2)-1. Suppose 5d - 149 = -w. Let l = -433 + 433. Solve -5m + d - 6 = l for m. 3 Let l = -12 - -47. Suppose 5 = -3x + l. Let t be (24/x)/((-2)/(-5)). Solve 3q + t = -0 for q. -2 Suppose t - 13 = -w + 22, 2t + 50 = 2w. Suppose wx + 12 = 32x. Suppose x = g + 1. Solve g = -3m + 14 for m. 3 Let m(u) = u3 - 7u*2 + u - 5. Suppose 2w - 21 = -3p, p + 4w - 14 = -p. Let r be m(p). Solve -2 = ri - i for i. -2 Suppose -16 = -3n + 2k, 6n = 2n + 5k + 26. Solve 76r - 72r + n = 0 for r. -1 Let f(j) = 6j - 18. Let a be f(7). Suppose 2x + x - 8 = -5m, a = 3m - 3x. Solve 3 = h - mh for h. -1 Let t = 9 - 30. Let o = t + 41. Solve o = -v + 5v for v. 5 Let j = -3143 - -3149. Solve ja = a for a. 0 Suppose 4a + 4t - 41 = -9, -28 = -3a - 4t. Solve -ao + 4 = 4 for o. 0 Let c(o) = -19o3 + o2 - 1. Let a be c(-1). Solve 4j + 7 = a for j. 3 Suppose -5r - 10j = -8j - 23, 6 = -6j. Solve 0 = rb - 6b for b. 0 Let n = 171 + -171. Let g = -2 - -14. Suppose t - 4t - 3a = g, -4a - 20 = 0. Solve z + n + t = 0 for z. -1 Let j(s) = 208s - 821. Let u be j(4). Solve -16w = 53 + u for w. -4 Suppose 221 = 11n + 34. Solve n = 3u + 11 for u. 2 Suppose 3*d = -j + 16 - 2, -	{ "pile_set_name": "DM Mathematics" }
t z(b) be the first derivative of 1/3b3 - 2 + 3b + qb2. Determine z(-4). 7 Let b be 2 - (-3)/((-9)/(-3)). Let z be b17/(-3). Let s(d) = -7d + 14. Let g(p) = -2p + 1. Let w(y) = -4g(y) + s(y). What is w(z)? 3 Let a(z) = -z + 23. Let n(r) = r*2 + 28r + 45. Let v be n(-27). Calculate a(v). 5 Let x(r) = -2 - 5 - r - 1. Let y(o) = -2o - 2. Let f be y(-6). Let k be (54/(-45))/(2/f). Determine x(k). -2 Let m be ((-1)/(12/20) - -2)3. Let y be m4(-6)/4. Let l(s) = -2s - 6. Determine l(y). 6 Let q(r) = -r3 + 7r*2 - 7r + 1. Suppose 0 = 5d + 2j - 31, -2d - 4j + 29 = 7. What is q(d)? 16 Let c be -2(-1 - (-15)/10). Let b be (3c)/((-5)/(-5)). Let j(q) be the first derivative of -q*4/4 - 4q3/3 - q2/2 + q + 3. What is j(b)? -5 Suppose 5c + c - 6 = 0. Let p(z) = -z - c - 8 + 1 + 1. Suppose -12 = -0b + 2b. What is p(b)? -1 Suppose 37 + 44 = -27u. Let w(t) = -t*3 - 5t*2 - 2t - 1. What is w(u)? -13 Let k(b) = -4b. Let j be -55/(-50)(2 - 4). Let m be j - (-5 + -1)/(32/16). Determine k(m). -8 Suppose 9 + 19 = 5y - x, 0 = -3y + 3x + 24. Let f(l) = 0 + 4l3 - 6l*2 + 5 - 8 + 3l - 3l3. Determine f(y). -13 Let p(r) = r3 + r2 + 10. Let w be p(0). Suppose -u = u - w. Let x(s) = -20s + 6s2 - s3 - 7s + 5 + 35s - 13s. What is x(u)? 5 Let y(s) be the first derivative of 2s3/3 + 11s*2/2 + 10s + 118. Determine y(-7). 31 Let n be 4/1 - 7 - -8. Let v(i) = -i*3 + 3i*2 + 14i - 11. Calculate v(n). 9 Let x(r) = r*2 + 17r + 6. Let u(j) = 2j2 + 29j + 11. Let t(d) = -3u(d) + 5x(d). Calculate t(-3). -6 Let z = -1809 - -1803. Let p(m) = -m*2 + 2m + 2. What is p(z)? -46 Let i(j) be the first derivative of -j*4/4 - 20j*3/3 - 19j*2/2 - 5j - 134. Calculate i(-19). -5 Let p(n) = -n*3 - 4n*2 + 4n - 10. Suppose -75h - 389 = -14. Give p(h). -5 Let r(c) = 5c*3 + 20c*2 - 4c - 16. Let n(f) = f*3 + 4f*2 - f - 3. Let q(j) = 11n(j) - 2r(j). What is q(-5)? -11 Let o = 326 + -316. Let n(m) = 2m - 22. Calculate n(o). -2 Suppose -5n - 21 = -12n. Let c be ((-8)/12)/(-1)n. Let o(u) = u3 - u2 - u. Determine o(c). 2 Let q(y) = -y2 - 7y + 91. Let c be q(-13). Let j(p) = p*3 - 12p*2 - 14p + 17. What is j(c)? 4 Let x(k) be the first derivative of 3k2 - 14k - 11. Let v be x(3). Let r(d) = -d + 1. Determine r(v). -3 Let f(s) = 1 - 45s2 - 41s*2 + 2s + 85s2. Calculate f(2). 1 Let o(n) = n + 48. Let b(p) = -p2 - 6p + 40. Let s be b(-10). Calculate o(s). 48 Suppose 5k = 3i - 17, -4k + 4i = 6i - 4. Let s(f) be the first derivative of f2 - f + 117. Calculate s(k). -3 Let h(k) = -k - 1. Let q = 217 - 209. What is h(q)? -9 Suppose 4u - 4d + 32 = 0, -34u = -35u - 2d + 1. Let v(s) = -s*2 + 5s + 6. Determine v(u). -44 Let b(x) = -32x2 + x + 2. Let o(i) = 3i*2 + 24i - 28. Let c be o(-9). What is b(c)? -31 Let d(y) = 2y + 29. Let p(n) = n + 14. Let m(i) = -2d(i) + 5p(i). Suppose 19 + 30 = -7q. Determine m(q). 5 Let k(o) be the third derivative of o6/120 + o4/8 - o*3/2 + 275o2. Determine k(2). 11 Let c(v) = v + 22. Let f(o) = -o3 - 13o2 + 16o + 11. Let t be f(-14). Give c(t). 5 Let x(v) be the first derivative of -v*3/3 + 11v*2/2 - 2v + 15. Calculate x(10). 8 Let s(h) be the first derivative of 5/3h3 - 2h - 1/4h4 - 9 + h2. Determine s(5). 8 Let y(v) = -v2 + 4v - 1. Let z be y(2). Let t(o) = -2o - 5o*2 + 2o2 + 1 - oz + 4o2. Suppose 19 = -n - 4d, 5n = -2d - 2 - 3. Calculate t(n). -1 Let m(h) = h*3 + 5h*2 + 6h + 5. Let y be m(-3). Let t(x) = 8 - 4 - x*2 - yx - 4. Determine t(-5). 0 Let c(p) = 2p - 4. Let a(b) = 5b - 13. Let h(x) = -3a(x) + 8c(x). Suppose 0j + 2j = -36. Let v = j + 15. Calculate h(v). 4 Let r = -1 + 4. Let w(j) be the first derivative of j*4/4 - 2j3/3 + j2 - 3j + 1. What is w(r)? 12 Let z(w) be the third derivative of -w6/120 + w5/15 + w4/12 + w3/6 + 3w*2. Determine z(4). 9 Let r(w) be the first derivative of -10w3/3 + w2/2 + w - 27. Let x = 1 + -2. Give r(x). -10 Suppose 5y - 64 = 9y. Let p = y - -20. Suppose p = -4i - 16. Let l(r) = r2 + 3r + 2. Give l(i). 12 Let u(i) = -i*2 + 2i. Suppose 3f + k + 10 = 0, 0f + 3k + 16 = -2f. What is u(f)? -8 Suppose -4u + 2 + 2 = 0, -4y - 5u = -13. Let q(p) = 0 + p3 - 4p*2 + 3 + 4p*2 - 3p. What is q(y)? 5 Let a(b) = -4b + 2. Let x(h) = 3h - 1. Let s(v) = 2a(v) + 3x(v). Let f(w) = 5w + 11. Let y(k) = f(k) - 4s(k). What is y(-7)? 0 Let z(t) be the third derivative of -t6/120 + t5/60 + t*4/6 - 462t*2. Determine z(2). 4 Let h(b) = 2b - 7. Let t(z) = -z + 4. Let d(w) = -6h(w) - 10t(w). Let l = 33 - 35. Let k = 7 + l. Calculate d(k). -8 Let h(r) be the second derivative of -r*3/2 - 11r*2/2 - 30r - 3. Give h(-9). 16 Suppose -2v + 2 = -8. Suppose -4h + v = 5r - 7, 5h = 4r - 26. Let i(p) = p3 - 2p*2 - 2p - 3. Give i(r). 21 Let f = -50 + 41. Let w(c) = -2c3 - 25c*2 - 11c - 23. Let j(h) = h*3 + 12h*2 + 5h + 11. Let a(u) = fj(u) - 4w(u). What is a(-8)? 1 Suppose -5q = 4 - 19. Suppose -qh - h = -12. Let c(m) = 3m + 8m2 - 17 + 21 - mh - 11m. Calculate c(7). -3 Let v be (2 - 0)3-1. Let x be 4/(-8)v + 2. Let a(k) = -1 + 0k + k2 + 2k - xk2. Determine a(1). -3 Let f(k) be the third derivative of 13k*4/24 - 15k*2 - 3k. What is f(-1)? -13 Let s be (0 + -3)/((-6)/14). Let d(b) = 1 - sb + 6b + b + 9b. Calculate d(-1). -8 Let b(u) = -10u3 - u2 + u + 1. Let g = -4 + 15. Suppose g - 31 = -4j. Suppose jc - 15 = -5h, -3h + 1 = -c + 8. Determine b(h). 9 Suppose h + 41 = 5g, 3g + 5h = 75 - 28. Let q(v) = v2 - 5v - 10. Determine q(g). 26 Let g(p) = -4p3 + 48p*2 + 21p - 29. Let z(m) = -m*3 + 16m*2 + 8m - 10. Let h(f) = 2g(f) - 7z(f). What is h(-15)? -3 Let o(m) = -6m2 - 4 - 15m + 5m + 7m*2. Determine o(8). -20 Let k(x) be the second derivative of 0x*4 - x + 0x*3 + 0 - 11/60x*5 - 5/2x*2. Let t(h) be the first derivative of k(h). Give t(1). -11 Let l(s) = 3s - 5s + 3s + 7 + 0. Determine l(-9). -2 Let s(y) = 32y3 - 2y*2 + y. Suppose -3 = 3t - 3l, 5t - 3l - 13 = -7l. Determine s(t). 31 Let o(y) = -y*2 + 3y + 4. Let k be -1 + -38 + 6 + -3. Let t = -33 - k. Give o(t). 4 Let b = -1969 - -1950. Let p(n) = n*3 + 20n*2 + 16n - 49. Give p(b). 8 Let v(w) = w*3 + 2w*2 - 2. Suppose 17 = 4j - 11. Suppose 0 = -5k + j + 3. Give v(k). 14 Let r(p) be the second derivative of p4/6 + p3/3 + 7p*2 - 710p. What is r(0)? 14 Suppose -5z - 26 = 4. Let b = 10 + z. Suppose 3m - 5m + 8 = -4n, -bn - 4m - 20 = 0. Let q(j) = j3 + j2 - 2j - 3. Give q(n). -15 Let m(n) be the third derivative of -n4/24 - n3/3 + 14n*2. Suppose -3l = -4 + 28. What is m(l)? 6 Let t be (-12)/(-2 + 7/((-35)/(-20))). Let p(i) = -i*2 - 7i - 7. Give p(t). -1 Let y(m) be the second derivative of 2m2 - 3m + 0 + 1/6m3. What is y(-3)? 1 Let h = 53 + -100. Let b = h + 41. Let d(z) = z + 6. Give d(b). 0 Let r = -221 + 217. Let z(g) = -3g*2 - 12g - 10. Calculate z(r). -10 Let r(n) be the second derivative of -n*3/6 - 12n*2 + 7n + 29. What is r(-9)? -15 Let g(q) be the first derivative of q*4/4 + 2q*3 + 7q*2/2 - 2q + 35. Give g(-5). -12 Suppose -2i - 2i + 4q = -20, 0 = -i - 2q + 5. Suppose -iu = -c + 34, c + 19 = -3u + 3c. Let s(g) = g3 + 6g*2 - 6g + 8. Calculate s(u). 1 Let o(n) be the third derivative of -n*5/60 - 5n*4/24 - 5n*3/6 - 14n2. What is o(-3)? 1 Let k(w) = w3 + 5w2 + 3w - 5. Suppose -10 = -2q + q. Suppose 0 = -14a + qa - 16. Determine k(a). -1 Let f(m) = 6m*3 - 9m*2 - 8m + 9. Let l(z) = -5z3 + 8z*2 + 7z - 8. Let b(s) = 4f(s) + 5l(s). Suppose 16 = v + 4q, 3q - 2q + 9 = 3v. Give b(v). 8 Let w(b) = b + 7. Suppose 4s = -12, 4s = -5a - 2 - 0. Suppose -az - 2 = -12. What is w(z)? 12 Let b(j) = -j*3 - 6j*2 - 3j + 3. Suppose -6 - 34 = 8s. Determine b(s). -7 Suppose 20 = -10z + 30. Let a(q) = -18q3 - q2 - q + 1. What is a(z)? -19 Let u(y) = y2 - 12y + 20. Suppose -4j = x - 32, 4j + 60x - 61x = 40. Calculate u(j). -7 Let d = 32 + -34. Let n be (3 + -2)d/(-2)-1. Let k(t) = 2t + 10t*2 - 3t - 3t2. What is k(n)? 8 Let b(t) = t3 - 4t*2 + 3t + 2. Let s(g) be	{ "pile_set_name": "DM Mathematics" }
180 - m*5/120 - 9m4/8 + m3/6 - 8m. Let d(c) be the second derivative of h(c). What is the tens digit of d(8)? 9 Suppose 5h + 121 = -104. Let c be 18/h - 734/(-10). Let i = -50 + c. What is the tens digit of i? 2 Suppose 32v - 65040 = 2v. What is the units digit of v? 8 What is the tens digit of 1/((-4)/8) + 5/((-15)/(-35961))? 8 Let w(p) be the third derivative of 17p4/6 + 4p*3/3 - 18p2. Let m(r) = r3 - 11r2 - 2r + 24. Let u be m(11). What is the hundreds digit of w(u)? 1 Let r be (-2)/(-8) + (-1761)/(-12). Let h be (-304)/16(-20 + 1) + (-6 - -6). Suppose c + y + h = 6c, -2c + r = -3y. What is the tens digit of c? 7 Suppose -d + p + 13 = 4, 40 = 5d - 4p. Suppose 5b = 4t + 31, -9 = db - 3t - 34. Suppose -bw = -100 - 5. What is the units digit of w? 5 Suppose 0 = 2j - 10g + 8g - 5630, 4j - 11270 = 2g. What is the thousands digit of (7 + 180/(-24))/((-1)/j)? 1 What is the units digit of (1 - (-3)/(-2))(-2 + 20206)-1? 2 Let o be (5 - 2)-11 + (6 - 9). Let f = o + 286. What is the units digit of f? 0 Let m(r) = 2r*2 - 50r + 69. Let c(l) = 25l + 159. Let s be c(-5). What is the hundreds digit of m(s)? 6 Let g = 40 + 74. Let b = g - 6. Suppose 3n - 3z = b, 2z - 25 = -3z. What is the units digit of n? 1 Let j = -647 + 204. Let k = j + 870. What is the tens digit of k? 2 Let x(i) = -5i + 9. Let j be x(-9). Let c = 368 - 368. Suppose 0 = 3n - cn - j. What is the units digit of n? 8 Suppose -20083 = -4k + 16n - 13n, -5n + 20107 = 4k. What is the tens digit of k? 2 What is the thousands digit of 20361/(-6)(-7 + 1 + 3 + 1)? 6 Suppose 264g - 274g = -21480. What is the tens digit of g? 4 Suppose 1596l - 1593l = 3a + 55020, 0 = l - 2a - 18342. What is the tens digit of l? 3 Suppose 0 = -h + 2h + h. Suppose -4j + 4s - 9s + 2021 = h, -5j - 4s + 2524 = 0. What is the hundreds digit of j? 5 Let w be 4926/34 + 34/289. Let h = w + 269. What is the tens digit of h? 1 Let h(k) = -8k3 + k2 - 2k + 2. Let g be h(1). Let l be g/(((-15)/24)/5). Let q = -29 + l. What is the units digit of q? 7 Suppose 3m = 5p + 237, -61 - 54 = 3p + 5m. Let n = 1240 + p. What is the units digit of n? 5 Suppose -4g + 24186 = -2i - 3626, 4i - 6980 = -g. What is the tens digit of g? 5 Let h(a) = -2a*2 - 5a - 2. Let r be h(-3). Let b(p) be the first derivative of -p*4/2 - 7p*3/3 - 5p*2/2 + 4p + 1696. What is the tens digit of b(r)? 0 Suppose 254k - 80638 = 231k. What is the units digit of k? 6 Suppose 26 = 4o + r, -o + 4r + 36 = 3o. Suppose 0 = -5u - 5c + 55, -4u + 2u + o = -3c. What is the tens digit of 144 + (-14)/56 + (-30)/u? 4 Suppose 2x = 3q + 12640, -3q - 41 = -47. What is the thousands digit of x? 6 Let h = 23792 + -11894. What is the hundreds digit of h? 8 Let h(f) = f3 - 6f*2 - 6f - 38. Let v be h(10). Suppose vy + 40 = 297y. What is the units digit of y/(-12)138 + 2 + -4? 0 Let r(o) = -o - 12. Let h be r(-14). Let q(w) = h - 1 + 57w + 96w - 16w. What is the units digit of q(1)? 8 Let f(g) be the third derivative of -1/120g6 + 0 - 21g*2 + 0g - 1/24g4 - 1/30g*5 - 1/6g*3. What is the units digit of f(-2)? 1 Let m be 9 + -1(17 + -8). Suppose m = 5g + f - 1045, -2f + 836 = 4g - 7f. What is the hundreds digit of g? 2 Suppose m = 2h + 3m - 616, h - m = 318. Suppose r - 4u - h = 0, 15r - 4u - 1517 = 10r. What is the tens digit of r? 0 Let v(n) = n*2 + 2n + 15. Suppose -8 = 11x - 13x. Let o = -11 + x. What is the tens digit of v(o)? 5 Let h be (-3)/(-8)4(-14928)/(-36). Let n = h - 215. What is the units digit of n? 7 Let z be (-2)/(-8) - (-14)/8. Suppose -20 = -zy - 2y. Suppose yo + 24 - 69 = 0. What is the units digit of o? 9 Let r = 2255 - 748. Suppose m - 4n = r, 2m + n - 2978 = -0m. What is the tens digit of m? 9 Let n(i) = -i*3 - 11i*2 + 17i - 55. Let t be n(-14). Suppose 126x - 130x = 28. What is the tens digit of x + 5 - (3 - t)? 9 Let u(s) = 17422s2 - 23s + 24. What is the hundreds digit of u(1)? 4 Let w(d) = 3d3 - 23d*2 + 38d - 237. What is the ten thousands digit of w(31)? 6 Suppose -14l + 8l - 12 = 0. Let u be 4/l((-36)/8 - -3). Suppose -5x = -3o + 290, 0x = -uo + 3x + 282. What is the tens digit of o? 9 Suppose 7o + 40 = 5v + 2o, 9 = -3o. Suppose 2t + 5 = vy + 4t, 2y + 22 = 4t. What is the tens digit of 178y/5(-20)/8? 8 Suppose 4p + d = 179994, 22p = 20p - 7d + 89984. What is the ten thousands digit of p? 4 Let w(l) be the first derivative of 7l*2/2 - 5l + 81. Let x(a) = 2a2 - 4a + 3. Let u be x(2). What is the tens digit of w(u)? 1 Let k(q) = -q*2 - 2q + 1. Let y be k(-3). Let n be 135/21 + (-2)/(-6). What is the units digit of n/(y/5 + 148/360)? 0 Let v(n) = -2n*2 + 24n - 5. Let x be v(12). Let c(i) = -61i + 17. What is the units digit of c(x)? 2 What is the tens digit of (42/5)/((-7)/(-3710))? 5 Let i = 191 - 762. Let l = 1000 + i. What is the units digit of l? 9 Suppose -s = 4f - 41, -s + 1 - 4 = 0. What is the units digit of 2/(-11) - (-19945)/f? 3 Let s(t) = 2t3 - t + 1. Let o(z) = 37z*3 + 4z*2 - 4z + 8. Let d(g) = -o(g) + 4s(g). What is the units digit of d(-3)? 3 Suppose -5m = -3b - 812, 4m - 3b = 92 + 560. Suppose -3j + 200 + m = 0. What is the tens digit of j? 2 Let v(q) = -q - 2. Let t be v(-2). Let y be 6/(36/110) - (7/3 + -2). Suppose t = a - 14 - y. What is the units digit of a? 2 Let y = 11425 - -4124. What is the tens digit of y? 4 Let q(j) = -6j - 7. Let t be q(-4). Let y = t - 17. Suppose h + yp = -3p + 22, 4h + 5p = 123. What is the units digit of h? 7 Let c(i) be the second derivative of i3/6 + 111i*2/2 + 4i. Let j = 202 - 202. What is the hundreds digit of c(j)? 1 Let i = 424 - -6788. What is the units digit of i? 2 Let a = -2322 + 3264. Suppose -11n + 5n + a = 0. What is the tens digit of n? 5 Let i be (-22)/(-121) - (90/11 + -2). Let x be ((-879)/i)/(2/(-4)). Let g = 479 + x. What is the units digit of g? 6 Suppose m = -h + 3661, -7h = -8h + m + 3669. What is the thousands digit of h? 3 Let h = 546 - 545. Let p(m) = -m*3 + 5m*2 + 3m - 9. Let f be p(6). What is the tens digit of (-1)/(h/4) - f? 2 Let z(y) = -5y2 - 265y + 411. Let b(u) = u*2 + 53u - 82. Let x(v) = -11b(v) - 2z(v). What is the tens digit of x(-32)? 5 Suppose -7h - 606 = -4h. Let p = -136 - h. What is the units digit of p? 6 Suppose -30 + 18 = 4z, -2a - 2z + 9164 = 0. What is the thousands digit of a? 4 Suppose 6v - 79 + 43 = 0. What is the units digit of 11630/20 + v/(-4)? 0 Suppose -2762x + 2581800 = -2662x. What is the ten thousands digit of x? 2 Let o = -88024 + 127495. What is the thousands digit of o? 9 Suppose -10q = -5q + 5h + 20, -h + 10 = -q. What is the units digit of (-189)/((-49)/q)94/(-2)? 9 Suppose 2860 = -67n + 72n. Let g = 109 + n. What is the hundreds digit of g? 6 What is the tens digit of -6817(4/(-6))/(228/18 + -12)? 1 Suppose 31q - 3264376 = -32q - 43q. What is the tens digit of q? 9 Let t(c) = -3c + 9. Let d be t(10). Let u = d + 26. Suppose ur - 100 = 5. What is the units digit of r? 1 Let d(a) = -281a - 1910. What is the thousands digit of d(-73)? 8 Let w = -492 - -495. Suppose r = wu - 3293, 3r = -u + 1120 - 39. What is the thousands digit of u? 1 Let p(s) = -s2 - 3s - 2. Let o(a) = a*2 + 8a + 10. Let c be o(-6). Let w be p(c). Suppose -3x + 6 = 18, w = -g - 5x + 28. What is the tens digit of g? 4 Suppose 0 = -5h - 28i + 25i + 125006, 5h - i - 124998 = 0. What is the ten thousands digit of h? 2 Suppose 0 = -5i + 449 - 89. Suppose i = 2q + 7q. Suppose -qj = -3j - 475. What is the units digit of j? 5 Let a = 592 + -216. What is the hundreds digit of a + (-2 + 3)/(-11)? 3 Let t = -41 - -43. Suppose -10m = -tm - 72. What is the units digit of 9912/m + 4? 6 Let y = 157 + -79. Suppose -5n + y = -22. What is the hundreds digit of (-16)/4(-725)/n? 1 What is the thousands digit of 100302/16 + 1161/72 + -16? 6 Let j = 432 - 438. What is the hundreds digit of (-23 - -38)(-64)/j? 1 Let c = 3650 + -1594. What is the units digit of c? 6 Let f(d) = 4190d2 + 54d + 86. What is the units digit of f(4)? 2 Let m = -53 - -46. Let b(n) = 9n2 - 6n - 4. What is the units digit of b(m)? 9 Let s	{ "pile_set_name": "DM Mathematics" }
t g(n) = -n*3 + 6n*2 + 7n + 3. Let u(h) = 17 + h*3 - 4h*3 + 11h*2 + 11h - 2h3 + 6h*3. Let q be u(-10). What is g(q)? 3 Let y be 4/(-1) - (3 - 10). Let h be y/(-9) + (-80)/(-15). Suppose -2p + 2 = v - 2, 2p = -hv + 4. Let a(s) = 6s2 - 2s - 1. Determine a(p). 19 Let m(p) = -3p - 6. Let o(g) = -10g - 17. Let f(b) = -8m(b) + 3o(b). Let a(s) = 8s - 130. Let l be a(16). Determine f(l). 9 Suppose -527b + 531b - 20 = 0. Let x(j) = 3j - 1. Calculate x(b). 14 Let i(r) = 11r2 + r - 5. Let b(q) = 11q*2 + q - 7. Let u be 2/(-3)(-4 - (2 + 0)). Let v(x) = ui(x) - 3b(x). Give v(-1). 11 Let s(h) = h*3 - 14h*2 + 13h - 1. Let j = -333 - -346. Calculate s(j). -1 Suppose 3b - 4b + 4g = -10, -4g - 4 = -4b. Let t(z) = 10z - 1. Let y(x) = -7x + 1. Let j(k) = 5t(k) + 7y(k). Calculate j(b). 0 Let b(x) = x3 - 5 + 4x*2 - 4x - 4x + x. Suppose 5i + 3z = 18, 4i - z - 17 = -6. Suppose 0 = 3r - im + 6, 2r + 2 - 7 = 5m. Determine b(r). 5 Let u(m) = 4 + 2m + 0 + 7. Let l = -2141 + 2133. Calculate u(l). -5 Let z(j) = -132 - 6j + 2j - j2 + 0j*2 + 59 + 79. Give z(-6). -6 Let q(l) be the first derivative of 1/3l*3 - 3l - 3 + l*2. Let k be 3/(-2)8/(-6). Calculate q(k). 5 Let l(p) = 12p2 + 3p + 0p - 11p*2 - 7p - 3. Let z(b) = 2b2 - 9b + 14. Let j be z(2). Determine l(j). -3 Let l(g) = -10g - 18. Let j(r) = -13r - 22. Let f(n) = -4j(n) + 5l(n). Let q = 8 + -3. Determine f(q). 8 Let f(k) = k + 17. Let u(j) = 3j3 - 25j*2 - 18j - 12. Let y be u(9). Determine f(y). 5 Let q(z) be the third derivative of -z5/60 + z4/4 + 5z3/6 - 3z*2. Let g = -9 - -12. Suppose 21 = -0c + gc. Determine q(c). -2 Let f(t) = -t2 + t. Suppose 0 = -2k + 6k - 56. Let w be (4/(-6))/(k/(-21)). Let c(z) = z3 + z2 + z - 4. Let b(u) = wc(u) - 4f(u). Calculate b(-5). 11 Let b = -20 - -22. Let q = 10 - b. Let d(k) = -k2 + 7k + 7. Give d(q). -1 Let i be ((-4)/3)/(2/(-6)). Suppose -iv - 38 = 5z, -5v + z - 64 = -z. Let a be (-57)/(-18) - (-2)/v. Let y(g) = -2g*2 + 4g. What is y(a)? -6 Let p(w) = -w*2 + 5w + 7. Let r be p(6). Let b(v) = 1 - 5v2 + r + v + 7v*2 - 3v*2. Give b(4). -10 Let w = -8 - -12. Let o(p) = -2 + 4p - 7p + wp - 3p2 + 3 + p3. Let d be ((-28)/(-21))/(2/3). Calculate o(d). -1 Let t(z) = 3z*2 + 9z - 2. Let y be t(-4). Suppose -o = 3v + 11, o = 2v + y + 4. Let c(p) = -p*3 + 3p*2 + 4p + 5. Give c(o). 5 Let m(i) be the first derivative of i5/20 + i4/4 - i*3/6 - 2i - 1. Let t(b) be the first derivative of m(b). Suppose 31j = -5 - 88. Calculate t(j). 3 Suppose -14q - 13q - 270 = 0. Let d(u) = u3 + 9u*2 - 11u - 11. Calculate d(q). -1 Let j(t) = -t*2 - 13t - 38. Let p be j(-4). Let y(l) = -l*2 - 2l. What is y(p)? 0 Let w(z) = z*2. Let c be (-5 + 0)(-6)/15. Let b be (c + 0)/2(-72)/(-24). Calculate w(b). 9 Suppose 4b = -g, 44g - b + 15 = 48g. Let s(p) be the second derivative of p4/12 - p3 + 2p2 - p. Determine s(g). -4 Let r(a) = 2a. Let n(p) = p*3 - 28p*2 + 23. Let i be n(28). Suppose 5m = -2 - i. Give r(m). -10 Let y(m) = -13m - 70. Let r(t) = 48t + 279. Let g(b) = 4r(b) + 15y(b). Give g(20). 6 Suppose 3s - 36 = 5q, 0s - q = s - 4. Let y(n) = -7n*2 + 36n - 26. Let v(k) = 4k2 - 20k + 14. Let b(t) = 5v(t) + 3y(t). Determine b(s). -1 Let g = -4 + 5. Suppose -5a + g + 4 = 0. Let m(p) = 0 + 5p - p + 0 - a. Determine m(1). 3 Suppose 3w = 5w - 12. Let v(l) = -l*2 - 12l - 9. Let g(n) = -269n2 + 4 + 138n*2 + 13n + 5 + 132n2. Let b(t) = wv(t) + 5g(t). Calculate b(-6). -3 Let b be (-2)/(-5) + (-1696)/40. Let k be (-1)/(-7) + 342/b. Let y(i) = i + 11. What is y(k)? 3 Let l(c) = 3c*2 - 5c. Let p(b) = 2b2. Let a(u) = l(u) - 2p(u). Give a(-5). 0 Let g(y) = -y3 + y2 + y + 2. Let j(w) = -24w2 + 6w - 7. Let h be j(2). Let x = 91 + h. Determine g(x). 2 Let y(f) = -f*3 + 10f*2 + f - 8. Let r be y(10). Let o(t) = rt*2 - 4t*3 + 16t + 2 + 5t3 - 13t. Give o(-2). -4 Suppose 3r + 2r + 5 = 0, -g = r + 5. Let a(o) = -o*3 - 4o*2 - 4o - 5. Let n(x) = -2x3 - 9x*2 - 9x - 10. Let l(j) = gn(j) + 7a(j). Determine l(-7). -2 Let g = -64 + 103. Let f = 40 - g. Let o(a) = -10a3 + a - 1. Determine o(f). -10 Suppose -38o - 56 = -52o. Let n(u) = -4u + 12. What is n(o)? -4 Suppose 7 = -26t + 27t. Let w(k) = 0k2 + 13 + t - 19 - k + 2k*2. What is w(-2)? 11 Suppose 14 = -4r - 6. Let d(o) = -7o2 - 12o - 7. Let j(s) = 15s2 + 25s + 15. Let p(x) = -13d(x) - 6j(x). Determine p(r). -4 Let y(g) be the first derivative of -3/8g4 + 0g + 9 + 3g2 + 1/60g*5 + 4/3g*3. Let b(z) be the second derivative of y(z). Calculate b(6). -10 Let r be -1 - (-2 - -2 - 11). Suppose 2 = -2z + r. Let p(u) = 4u2 + 10u - 8. Let a(l) = 5l2 + 11l - 10. Let s(d) = 5a(d) - 6p(d). Determine s(z). -6 Let f be (-1)/(58/10 + -6). Let z(c) be the second derivative of -5/12c4 - 12c + 1/20cf + 1/2c*2 + 0 + 1/6c*3. Give z(5). 6 Let u = 57 - 56. Let n(z) = -3 + z + u + 2 + 2. Calculate n(-6). -4 Let m(s) = 7s - 1. Let j(i) = i + 37. Let y be j(-18). Suppose -y = 14d + 5d. Calculate m(d). -8 Let m(x) = -3x + 1. Let w be (-3 + 7)/2 - -2. Suppose 4t - 4 = -4i, wt + 4 = -3i + 6. Let k be i + 2 + -7 + 0. What is m(k)? 10 Let h(a) = -a2 - 6a. Suppose -7u - 8 = -5u. What is h(u)? 8 Let a(m) be the third derivative of m8/3360 + m7/2520 + m*4/6 + 4m*3/3 + 2m*2 - 8m. Let v(z) be the second derivative of a(z). Give v(1). 3 Let f(s) be the second derivative of -5s3/6 + 14s*2 + 195s. What is f(5)? 3 Let j = -284 - -178. Let l = 102 + j. Let o(h) be the third derivative of h5/60 + h4/12 - h3/2 - h2. Calculate o(l). 5 Let i(l) be the second derivative of -l*4/12 + 2l3/3 + l2 - 14l - 3. Suppose 2o - 17 = -7. What is i(o)? -3 Let b(m) = -6m2 - 3m*2 + m + 7m2. Let v(n) = n3 - 3n2 - 3n. Let i be v(4). Suppose -5u = ij - 6, -5u - 4j + 7j = -13. Determine b(u). -6 Let t = -59 + 53. Let k(x) = 3x + 11. Let r(b) = 2b + 10. Let i(w) = 3k(w) - 4r(w). Let n(f) = 6. Let z(y) = -2i(y) - 3n(y). Give z(t). 8 Let h(l) = l - 2. Suppose 15 + 75 = 5f. Suppose -2r = f - 14. What is h(r)? -4 Suppose 0 = -0b + 5b + 5. Let l = -6 - b. Let n(g) = -g2 - 2g + 1. Let p(c) = -c*3 - 9c*2 - 10c + 1. Let d(h) = -3n(h) + p(h). Calculate d(l). -7 Let m(c) be the second derivative of c3/6 - 2c*2 - 220c. Determine m(-4). -8 Suppose 2f - f = -1. Let n(i) = 15i3 - i2 + 3 + 8 - 10. Determine n(f). -15 Suppose -1101j + 1096j = 5. Let d(p) be the second derivative of p4/4 - p3/6 - p. Calculate d(j). 4 Let o(p) = 11p + 28. Let a(v) = -18v - 43. Let t(h) = -5a(h) - 8o(h). Give t(7). 5 Let k be 1 + (11 - (-245)/(-21)). Let y(p) be the third derivative of 1/4p4 - 1/60p*5 - kp3 - p2 + 0 + 0p. Give y(3). 7 Let x be 3/(-1) + 7 - 14. Let b be x-31/6. Let m(s) = s2 - 6s + 6. Give m(b). 1 Let m(y) = y*3 + 17y*2 + 18y + 17. Suppose -30p + 33p - u + 52 = 0, 0 = -p + 3u - 28. Calculate m(p). -15 Let b(l) = -l2 - 7l - 8. Let m(k) = 2k2 + 12k + 12. Let x(i) = 8b(i) + 5m(i). Calculate x(-4). 12 Let r = 23 + -61. Let w = r + 41. Let d(n) = -2n - 4. What is d(w)? -10 Let z(q) = -2q*2 + 4q - 5. Let r(n) = -6n - 50. Let i be r(-9). Calculate z(i). -21 Let m(p) = -p2 - 2. Let b = -112 - -112. Calculate m(b). -2 Let w(g) = 6g*2 - 12g + 17. Let o(z) = 7z2 - 14z + 20. Let s(l) = 5o(l) - 6w(l). Determine s(5). -17 Let a(z) = -14z + 2. Let d(t) = -4t. Let v(w) = a(w) - 3d(w). Give v(-5). 12 Suppose k + 3h = -0k + 9, -5k + h - 19 = 0. Let z(q) be the third derivative of -q4/12 - q3/3 + 76q2. What is z(k)? 4 Let d = -215519/120 - -1796. Let q(z) be the third derivative of -1/3z*4 + 8z*2 + 1/10z*5 + 2/3z*3 - dz*6 + 0 + 0z. Give q(5). -11 Let v(h) = h*3 - 6h*2 - 7h - 8. Let j(u) = -2u2 - 7u + 37. Let d be j(-6). Give v(d). -8 Suppose 3n - 6 = -0. Suppose 2k - 2 = -g, 3k = 5k + 2g - n. Let b(h) be the second derivative of h5/20 - h4/12 + h2/2 + 71h. Give b(k). 1 Let u(o) = 4o2 - 2o - 1. Let a be u(2). Suppose -2g - 5v + 6 = -a, g = -4v + 13. Let i(f) = 8f3 + f2 - 1. Wh	{ "pile_set_name": "DM Mathematics" }
ive n(m). -2 Let q(w) = -w*2 + 6w - 6. Let y = -53 - -57. Determine q(y). 2 Suppose -5v = 0, v - 4v + 20 = 4n. Let w = -37 + 38. Let j(o) = -o3. Let u(y) = -5y*3 - 4y*2 - 4y - 1. Let k(m) = wu(m) - 6j(m). Give k(n). 4 Let b be (-2)/(-4) + (-10)/4. Let q be b/(-4) - 17/(-2). Suppose 4v + q = -7. Let f(w) = -w3 - 3w*2 + 4w - 5. What is f(v)? -5 Let a(z) be the first derivative of 0z2 + 12 + z + 1/3z3. Calculate a(1). 2 Let y(l) = l2 + 3l. Let d(o) = o2 + 7o - 2. Let q be (-2)/3 + 224/(-24). Let t be d(q). Suppose -6v = v + t. Give y(v). 4 Let s(i) = 3i*3 - 7i*2 + 16i - 10. Let j(k) = -10k3 + 20k*2 - 49k + 31. Let q(w) = 2j(w) + 7s(w). Calculate q(7). -8 Let a(o) = o*2 - 10o - 4. Let d be (72/(-144))/((-1)/26). Calculate a(d). 35 Let d(w) = w*3 + 8w*2 + 6w - 6. Let q be 35(3 - 6/3). Suppose 3a + j - 18 - 77 = 0, 0 = a + 2j - q. Suppose -a = 5r + 4. Determine d(r). 1 Let i(a) = a - 1. Suppose 0 = x - 2x + 15. Let m(w) = -x + 6 + w + 9. Let p(c) = -i(c) - m(c). Calculate p(2). -3 Let s(l) = -l + 1. Suppose 0j = j - 4. Suppose jx - 16 = 8x. Let v be 0(-1 - 0) + x. Determine s(v). 5 Suppose 4y + 0 = 2l - 2, -2y + 11 = -5l. Let q(u) = -5u*2 - 4u. Give q(l). -33 Let u(h) = -2h - 8. Suppose 2a = 0, -a + 2 = -t + 4. Suppose 5k - 8 = -2v, tk = -k + 3v + 9. Suppose -p - 2l = 7 + 5, -18 = 2p + kl. Determine u(p). 4 Let t(p) = -4p - 5. Let u(r) = r*2 - 65r + 811. Let x be u(48). What is t(x)? 15 Suppose -q + 2 = -0. Let o(m) = -3m3 - m3 - 2m*q + 3m*3 + 1 + 3m - 4. Let r = 380 - 383. Determine o(r). -3 Let i(v) = -21v - 2 - 3 + 4. Suppose -563m = -3d - 567m + 5, 2d - m + 4 = 0. Give i(d). 20 Let y(b) be the third derivative of b5/60 - b4/12 - b3/6 + b2. Let n be y(2). Let s(a) = 4189a - 4191a - 4a*2 + 4a*3 - 1 + 2a*2. Determine s(n). -5 Let s(m) = -12m + 1. Let w(b) = b. Let n(c) = 2s(c) + 22w(c). Let d(p) = p. Let z(o) = -3d(o) - n(o). Let f be (-3)/1 - (-2 + -3). Calculate z(f). -4 Let s(w) = -5. Let f(t) = -2. Let r(b) = 7f(b) - 3s(b). Let u(p) = p - 8. Let i(x) = -4r(x) - u(x). Give i(0). 4 Suppose 4l = -0l - 32. Let a(z) = -9 - 4z - 2z3 - z2 - 10z - 14z + 26z. Let x(g) = -g3 - g2 - g - 6. Let y(k) = lx(k) + 5a(k). Calculate y(2). -5 Let c(v) = -2 + 2 + 129v - 127v + 4. Give c(-10). -16 Let u(x) be the second derivative of -x5/20 + 5x4/12 + x3/6 - 7x2/2 - 12x + 9. What is u(6)? -37 Let j(r) = r*3 - 2r*2 + 4r - 2. Let n = 26 + -22. Suppose 7u - 30 = 2u. Suppose -np + u = -2. Determine j(p). 6 Let o = 86 + -82. Suppose oz = -5s - 8, 5s - 3z - 2z + 35 = 0. Let i(w) = -w*2 - 5w - 5. What is i(s)? -1 Let y(m) be the second derivative of 9m + 13/2m*2 - 1/6m*3 + 0. What is y(6)? 7 Let a(y) = 2y*2 - 37y + 17. Let d(v) = -v*2 + 17v - 7. Let f(m) = 4a(m) + 9d(m). Suppose -11 = -3j - 4c, -2j - 4c = -6j + 24. Give f(j). 5 Suppose -5g = -22 + 2. Let f be -3(g + -3 + -2). Let a(l) be the first derivative of -l4/4 + 4l3/3 + l2 + l + 2. Give a(f). 16 Suppose -28b + 248 = -59b. Let w(p) = -p*2 - 6p + 7. Determine w(b). -9 Let s(p) = 3p + 1. Let q = -10 - -13. Suppose 0 = -3t - 2i + 11, -t + 8 = qt - 4i. Determine s(t). 10 Let r(v) = -v2 + 11v - 24. Let m = -991 - -998. What is r(m)? 4 Let w(n) = -2n + 3. Let d be ((-20)/5 + -3)/(-1). Let h(g) = g + 9. Let p be h(-4). Suppose -d = -4x + p. What is w(x)? -3 Let z(l) = -8l + 9. Let n(f) = 33f - 42. Let r(g) = 2n(g) + 9z(g). What is r(0)? -3 Let q be -2 + (2 - 0) - -1. Let v(a) = 4a - 1. Let w be 1/6 + -334/(-72). Let u(t) = -t - 1. Let r(f) = wu(f) - v(f). What is r(q)? -7 Let r(t) = -t3 + 2t*2 + 9t*2 + t - 2t - 6t2. Give r(2). 10 Let s(r) be the first derivative of -r4/4 - 2r3 + r2/2 + 5r - 129. Calculate s(-4). -31 Let g(j) = 3j - 32. Let z(s) = 2s2 + 25s - 5. Let v be z(-13). Calculate g(v). -8 Let j be 24/4 - 3 - -11. Suppose -4t - o = -0o - 9, j = 5t + 4o. Let z(p) = 2p + 3p - 2p. Give z(t). 6 Suppose 105 + 165 = -9r. Let f be 3/(-3(-5)/r). Let q(c) = -c3 - 8c*2 - 9c - 1. Give q(f). -19 Let l(y) be the third derivative of y*4/24 + 5y*3/6 - 6y2. Let t = 55 + -59. Give l(t). 1 Let o(y) be the second derivative of y7/840 + y5/120 + y4/12 - 4y3/3 + 11y. Let g(b) be the second derivative of o(b). Determine g(2). 12 Suppose -5n + 2n + 5j - 1 = 0, 4j = -3n - 37. Let d(g) = g + 4. Give d(n). -3 Let l be -4 + (-15)/(1 - 4). Let q(s) = -21s*2 - 1. Give q(l). -22 Let l(b) = -39 + 19 - 34 - b + 42. Let n = 0 + -5. What is l(n)? -7 Let t be 4(30/(-4) + 7). Let p(a) = a*2 + 4a + 4. Give p(t). 0 Let h(o) = 2o2 + 19o - 28. Let m be h(-11). Let t(n) = n*3 - 6n*2 + 7n - 2. Calculate t(m). 8 Let x(p) = -p*3 - 5p*2 - 4p - 4. Let i = -1 + 11. Let l be ((-3)/(-5))/((-2)/i). Determine x(l). -10 Let h be 4/(-6) - (-336)/18. Let q = 20 - h. Let w(l) = l*2 - 3l. Give w(q). -2 Let t(w) = w*3 + 24w*2 - 53w - 22. Let k be t(-26). Let m(c) be the third derivative of c*5/60 - 5c4/24 - c3/2 + 3c2. Give m(k). -7 Let i(o) = 2o*2 - o - 11. Let g(b) = 4b*2 - b - 20. Let l(h) = 4g(h) - 7i(h). Determine l(2). 11 Let g(a) = -2a - 4. Let w(u) = -u*2 + 12u + 3. Let c be w(12). Suppose 4 = 2n - 2. Suppose nq + c = -6. What is g(q)? 2 Let l = -26 - -73. Suppose 1 = -8v - l. Let n(y) = -y - 5. Determine n(v). 1 Let k be (-6)/(-21)(-7)/(-4)0. Suppose y + 5f + 30 = 0, k = -y + 4f - 0 + 15. Let x(a) = a3 + 4a*2 - 3a + 4. What is x(y)? -6 Let d(q) = 4q - 15. Let h be d(7). Suppose 4z = g + h, -z - 2z = -3g - 12. Let x(b) = -b - 4 - b2 + z + b. Determine x(-2). -5 Let w(o) = o2 + 4o - 12. Let a be w(-6). Suppose 5v + av - 10 = 0. Suppose -vj + 3h + 24 = 0, 2 = j + h - 0. Let b(k) = -k2 + 7k + 8. Give b(j). 14 Let s(z) = 3 + 6z - 13z + z*2 - 5 + 6. Determine s(7). 4 Let x be 2 - (2/(-6))/((-3)/(-117)). Suppose -6w = -xw - 18. Let q(a) = -4a. Give q(w). 8 Let c(a) = 11a + 3 + 6242a*3 - 3a*2 - 6243a*3 + 10a. Calculate c(-6). -15 Let d(t) be the first derivative of t*4/12 + 2t3/3 - t2/2 + 3t + 12. Let o(n) be the first derivative of d(n). Calculate o(-3). -4 Let n(l) be the third derivative of -l6/60 - l5/60 - l3/2 - 33l*2. Determine n(-2). 9 Let u be (3 + -4)/(9/45). Let v(t) = -7t - 32. What is v(u)? 3 Let p(a) = -4a - 16. Let h(d) = -8d - 27. Let j(k) = 3h(k) - 5p(k). Determine j(-4). 15 Suppose 2c = h + 12, -3h + c = 6c + 80. Let k = h + 22. Let o(y) = 2 - 7y + 2y3 + 4y3 + y3 - 5yk - 6y*3. What is o(6)? -4 Let z(g) = 17g - 17. Let i(p) = 13p - 17. Let q(v) = -5i(v) + 4z(v). Give q(-6). -1 Let s(u) = u3 + 5u*2 + 3u. Let y be -3 + (30/(-27) - (-4)/36). Give s(y). 4 Let r be (-4)/8-26 - 8. Let v(l) be the second derivative of l5/20 - 5l4/12 + l3/2 - 5l2/2 + l. What is v(r)? 10 Suppose 43 - 13 = -5h. Let n = -56 + 63. Let y(p) = -2p + 0p + 4p - 6p*2 + 0p + n - p3. Calculate y(h). -5 Let j = -128 - -123. Let g(y) = -y2 - 7y + 3. What is g(j)? 13 Let m = 1145 - 1153. Let r(o) = 2o*2 + 10o - 2. Determine r(m). 46 Let i(m) = -24m + 3. Let u(s) = 11s - 2. Let c(a) = 6i(a) + 13u(a). What is c(-4)? -4 Suppose 2m + 0 = -4v + 26, -m + 2v - 3 = 0. Let g(y) = -268 + 136 - my + 132. What is g(1)? -5 Let k(d) = 4d3 + d2 - 5d + 1. Let h(c) = 3c3 + 2c*2 - 5c + 1. Let j(x) = -5h(x) + 4k(x). Suppose -429r = -432r + 15. Calculate j(r). -1 Let y = -35 - -11. Let f be 2 + 0 + 1 + y. Let n be (-70)/f3/(-2). Let i(r) = 2r - 6. Calculate i(n). -16 Let o(q) = q3 - q2 + q - 1. Let d(b) = b*2 - b + 1. Suppose -4w + 3 = -1. Let m(l) = wo(l) - d(l). Calculate m(3). 13 Suppose -9 = -5n + 2v + 9, 4n + 5v + 12 = 0. Let o(g) = 10g - 2. What is o(n)? 18 Let q(y) = -y*2 + 6y - 2. Let c(o) = o*2 - 7o + 2. Let f(l) = -2c(l) - 3q(l). Let j(z) = 2z - 3. Let t be j(3). Give f(t). -1 Let m(s) = -s. Suppose -3q - 3a - 7 = 5, -a = -q. Let t be m(q). Suppose -21 = -td - d. Let o(z) = -z + 2. What is o(d)? -5 Let u be (-9)/7 - 4/(-14). Let j(x) be the first derivative of -x*2 - 4 + 2x + 4x - 5x - 7. Give j(u). 3 Let v(c) = -4c - 2 - c3 + 0c	{ "pile_set_name": "DM Mathematics" }
. Let s = 0 + j. Put s, -0.1, d in descending order. -0.1, s, d Let d(r) = -2r2 + r - 9. Let z be d(0). Let n(m) = m2 + 9m - 1. Let p be n(z). Put p, 3, -4, 2 in ascending order. -4, p, 2, 3 Let g = -18 - -22. Let q = 15 - g. Let s(f) = f*2 + 7f + 4. Let m be s(-7). Put q, m, -2 in decreasing order. q, m, -2 Let m be 60/8((-136)/(-24) - 5). Let r(l) = 6l + l*2 - 4 + 7 - 2. Let d be r(-5). Sort m, 0, d in increasing order. d, 0, m Let o = -20.7 - -52.7. Put -4, 5, o, -5 in increasing order. -5, -4, 5, o Suppose -4l - 5 = -5n, 2n = -6l + 8l + 2. Suppose -2 = -k - l. Let r = 1 - -2. Put 4, r, k in decreasing order. 4, r, k Let d = 91/3 + -30. Put 5, -1/4, d, 1/2 in decreasing order. 5, 1/2, d, -1/4 Let y(b) = b*2 - 3b + 2. Let f(n) = -2n + 31. Let i be f(13). Let r be y(i). Sort -4, r, 0 in decreasing order. r, 0, -4 Suppose -3t + 3d - 6d = 0, -2t = -3d - 20. Put 0, 3, t in increasing order. 0, 3, t Let p be (-60)/(-12) + (-3 - 1). Sort p, -1, 5 in ascending order. -1, p, 5 Let z = -2.04 - -8. Let w = -6 + z. Let c = 1.04 + w. Put -0.3, 9, c in ascending order. -0.3, c, 9 Let t(b) = -b*3 - 7b*2 + 3b + 7. Let w(g) = -2g3 - 13g*2 + 6g + 13. Let x(q) = -11t(q) + 6w(q). Let h be x(-3). Sort 0, 0.5, h. 0, 0.5, h Let m be (-6 + 0)/(2/4 - -1). Let r = 12 - 7. Sort r, 0.3, m. m, 0.3, r Let c be (-1)/1513 - (-58)/290. Sort c, -21, 6. -21, c, 6 Let b(v) = -8v - 84. Let w be b(-11). Sort 0, -86, w, -5 in descending order. w, 0, -5, -86 Let v(w) = 15w - 2. Let o be v(0). Sort o, -4, 3, 2. -4, o, 2, 3 Let i be 35/(-20) + (-3)/(-4). Let d be (-10 - -6) + (-4)/i. Sort 4, 3, 5, d in descending order. 5, 4, 3, d Let a = 30 + -26. Suppose 5z - 4s - 31 = 0, -23 = -z - 3z + 5s. Let u = z - 9. Put a, -5, u in descending order. a, u, -5 Let h(v) = 2v + 3v2 - 3v + 2v2. Let w be h(1). Put 5, w, -18 in descending order. 5, w, -18 Let d be -8 - (-28 - 9)/(-1). Sort d, -3, 2. d, -3, 2 Suppose -3l - 7 = n, -4 = -5l + l - 4n. Suppose -5r - 1 = -4u, 4r - 1 = 4u + 3. Let z = -4 - u. Put 1, z, l in ascending order. l, 1, z Let r(t) = -2t + 10. Let p be r(7). Let m be 4 + (-5)/3 - (9 + 69/(-9)). Sort -3, m, -1, p in descending order. m, -1, -3, p Let q be (-5)/3 - 3381/(-2277). Put 5, -46, q in decreasing order. 5, q, -46 Let l = 2.7 - -0.4. Let m = l + -2.9. Put m, -0.3, 4/5 in ascending order. -0.3, m, 4/5 Let h(i) = i3 - 5i*2 - 8i + 14. Let v be h(6). Let r be 1/v - (-75)/30. Put 5, -5, r in decreasing order. 5, r, -5 Let q(a) = -5a3 - 20a*2 - 16a - 37. Let z be q(-3). Put -1, z, -5 in decreasing order. -1, -5, z Let m(v) = v*2 - 15v - 122. Let c be m(-6). Put -159, 2, c in descending order. c, 2, -159 Let g = 1244 + -1244.4. Let r = 1/66 + -35/132. Sort 0, g, -0.1, r. g, r, -0.1, 0 Let h = -1.9669 + -0.0331. Put 3/4, -13.1, h in decreasing order. 3/4, h, -13.1 Suppose -2u - 60 = 3r, 2r = 2u - r + 72. Let l = u - -33. Sort -1, l, -3 in ascending order. -3, -1, l Suppose 13v - 12v - 3 = 0. Sort 16, 1, v. 1, v, 16 Let d = -55 + -4. Let o = 57 + d. Put 0, o, -5, -1 in decreasing order. 0, -1, o, -5 Let u = 6.17 - 1.93. Let k = 0.24 - u. Put 0.02, k, -2 in decreasing order. 0.02, -2, k Let o be (24/180)/((-24)/(-30)). Put -0.8, o, -2 in decreasing order. o, -0.8, -2 Let b = 26 + -35. Let p = -8 - b. Let y = p - 1.2. Sort y, -1/6, 1 in descending order. 1, -1/6, y Let z = -1401 - -1400.5. Put 6, z, -4 in ascending order. -4, z, 6 Let a = 13.3 - 22.6. Let d = a - 0.7. Let v = -7 - d. Put v, 2/15, -1 in decreasing order. v, 2/15, -1 Let c(p) = 57p - 455. Let r be c(8). Put -2, 9, r, -1 in decreasing order. 9, r, -1, -2 Let z(t) = -2t + 5. Let a be (-4)/18 + (-10)/(-45). Let i be z(a). Let c be (2/(-4))/(2/(-12)). Sort c, i, 4 in descending order. i, 4, c Suppose r - 2m - 1 = 0, -13 = -6r + r + 2m. Suppose q + 2 = 2v - 0, 0 = rv - 3q - 3. Put -5, v, 5, 4 in ascending order. -5, v, 4, 5 Let o(q) = 6q + 29. Let k be o(-5). Sort 18, k, 1 in decreasing order. 18, 1, k Let y = -203 + 204. Sort 2/9, -7, y in decreasing order. y, 2/9, -7 Suppose -3n + 0r - 10 = -4r, -4r - 2 = 3n. Let h(j) = -j*2 + 6j + 31. Let q be h(9). Sort n, q, 0. n, 0, q Let j = -3 + 5. Let o = j + 4. Let d be (-1)/o(-12 + 10). Sort d, -2/9, 2/3 in decreasing order. 2/3, d, -2/9 Suppose 0y = -4y + 24. Suppose 0 = a - 0a - y. Put a, -2, -3 in ascending order. -3, -2, a Suppose 0 = -11s + 14s - 108. Let y be -6(4/s)/((-1)/(-6)). Sort y, 0, -1 in increasing order. y, -1, 0 Let b = 271/516 - 14/129. Let a = 1/4 - b. Suppose 0n - 5n = -35. Put n, 4, a in decreasing order. n, 4, a Suppose 10u + 27 = u. Let i(b) = b*3 + 12b*2 + b + 8. Let c be i(-12). Suppose -6y + y - 10 = 0. Put y, c, u in decreasing order. y, u, c Suppose 5r + 3k = 4k - 15, 5r + 15 = -3k. Let t = 35 + -31. Sort -1, t, r. r, -1, t Suppose 442 = 8w + 434. Suppose 52 = -6l + 2l. Sort w, l, 5 in ascending order. l, w, 5 Let l = 1/16 + -37/80. Let j = -248 + 253.08. Let y = j + -0.08. Sort l, -2, y. -2, l, y Let k(s) = -s - 12. Let w be k(-9). Let i = -27 + 29. Put -4, i, 0, w in decreasing order. i, 0, w, -4 Let a be (-48)/(-160)5/9. Put a, -1/7, -2/11, 3 in ascending order. -2/11, -1/7, a, 3 Let i = -146 + 1165/8. Sort 9/2, i, -4 in ascending order. -4, i, 9/2 Let z = 236.9 - 237. Sort -5, z, -1/6, -2 in decreasing order. z, -1/6, -2, -5 Suppose 2u = -5k + 13, -3k = 2u - 0u - 11. Let f be (1 + -2)/(2/6). Let o be -6 - (-6 + -12) - 7. Sort o, k, f. f, k, o Let l = 65.23 + -8.23. Sort l, 0, 4/7 in increasing order. 0, 4/7, l Let m = 2 + -2. Suppose s - 2 + 6 = m. Suppose -4f - 3 - 7 = 2a, 5a = 2f - 13. Sort 1, s, a in descending order. 1, a, s Let w(p) = 2p + 9. Let s be (-4)/18-3 - (-84)/(-18). Let x be w(s). Sort x, 4, 0, -2. -2, 0, x, 4 Let d be (27/6 - 5)-1. Put 3, d, 0, -5 in decreasing order. 3, d, 0, -5 Suppose -4k + 129k + 375 = 0. Suppose -n - 3i = 9, 3i = -12 + 3. Suppose b + 4o + 25 = n, -2o = -3b - 5 - 0. Sort 3, k, b in increasing order. b, k, 3 Let b = -433 + 432. Put -7, 0, 5, b in increasing order. -7, b, 0, 5 Let i = 3.1 + -3.6. Let w = -3.5 + i. Sort 1/5, 4, w in increasing order. w, 1/5, 4 Let i be -11 + (8 - (-1184)/392). Put -3, -0.02, i in decreasing order. i, -0.02, -3 Let z = -387 + 2711/7. Sort -1/7, 4, z in ascending order. -1/7, z, 4 Let r = 0.32 + 15.68. Let y = r - 16.03. Let g = y + 0.03. Put 7, g, -0.4 in descending order. 7, g, -0.4 Let s be -14/8-2. Let i = s - 3. Put 5, 3, i in descending order. 5, 3, i Let g be ((-10)/(-8))/(89 - 84). Suppose -2y + y - 2s - 3 = 0, 0 = -4y + 2s + 8. Let j be (-4)/8 + y/(-4). Sort j, 7, g in increasing order. j, g, 7 Let c(g) = g*3 + 12g*2 + 19g - 10. Let t be c(-10). Sort -5, t, 10 in increasing order. -5, t, 10 Suppose -6 = 3w - 12. Let b = -0.04 - -0.44. Sort 3/10, w, b. 3/10, b, w Let h be -1 + 9/54 + 25/(-6). Put 0, -4, h, 1 in increasing order. h, -4, 0, 1 Let j be (28/(-16))/((-2)/120). Let l be j/(-200) + 2/16. Let x(n) = 2n - 9. Let q be x(7). Put q, l, -0.1 in increasing order. l, -0.1, q Suppose -84 = 2o - 92. Sort o, 9, 5, 1 in increasing order. 1, o, 5, 9 Suppose 0 = -3o - 3c - 9, -2c = -11o + 8o + 11. Suppose -2t = 7 - 1. Put t, o, 3 in descending order. 3, o, t Let t = -17 - -19. Suppose -2n = 2x + x - 10, 0 = x + tn - 10. Suppose 4q + q - 10 = x. Sort 4/3, -3/2, q in decreasing order. q, 4/3, -3/2 Suppose 17 = -2d - 171. Let c be d/(-10) + 4/(-10). Let k = c + -6. Sort -2, 5, k in descending order. 5, k, -2 Suppose 5j - 3j - 26 = -4v, 5j = -v + 29. Let o(n) = 4n - 5. Let f be o(1). Sort 5, f, v. f, v, 5 Suppose -4b = 3h + 49, -3h + 31 = -4b - 0b. Let x be (-8)/315/b. Suppose -24 = -4d - x. Sort d, 2, -3 in descending order. d, 2, -3 Suppose 3d + 0 - 6 = 0. Suppose db = 5 - 11. Let x = -100 + 95. Sort 5, b, x in decreasing order. 5, b, x Let n be -4 - (-16)/(5 + -5 + 2). Put 0, -1, -5, n in increasing order. -5, -1, 0, n Let y = -2.826 - -4.826. Let n = -4 + -1. Put -1.2, -4, y, n in decreasing order. y, -1.2, -4, n Suppose 0 = 4f - 3f - 3. Suppose -2t = -3j + 32, 0 = 7j - 2j - 4t - 50. Sort -4, f, j, -5 in increasing order. -5, -4, f, j Let a(u) = -4u - 27. Let b be a(-5). Let w = 2 - 5. Sort b,	{ "pile_set_name": "DM Mathematics" }
-40)/12(-12)/10. What is the remainder when 41 is divided by ((-14)/s)/((-5)/30)? 20 Let i(s) be the first derivative of 1/4s4 - s2 + 2 - 2/3s3 - 3s. What is the remainder when i(4) is divided by 12? 9 Suppose -p + 3 = 6. Let v(q) = -q*3 - 2q*2 + q - 1. Let o be v(p). Let f = o + 57. Calculate the remainder when f is divided by 16. 14 Let o(c) = -5c - 4. Let v be 12/(-54) - 25/9. Let u(p) = 3p2 - 3p - 4. Calculate the remainder when u(v) is divided by o(-3). 10 Let q = 7 + -4. Suppose qs - 6s = -6. Let x = s - -1. What is the remainder when 7 is divided by x? 1 Suppose -d = q + 28, 6d = 2q + d + 21. Let c(p) = -p*2 - 6p - 1. Let r be c(5). Let b = q - r. Calculate the remainder when b is divided by 9. 6 Suppose 4y = -2v + 62, -4y - 204 + 32 = -4v. What is the remainder when v is divided by 2((-18)/(-2) - 2)? 11 Let x(q) = 2q - 7. Let c be x(5). Suppose 8 = 2f, 0f = -4w - cf + 140. Calculate the remainder when w is divided by 11. 10 Suppose -6o = -o. Suppose 2p - 17 = -m, o = 3m - 6m - 3p + 57. What is the remainder when 60 is divided by m? 18 Let l = 69 + -45. Calculate the remainder when l is divided by 13. 11 Let q = -36 - -61. Calculate the remainder when q is divided by 13. 12 Let s = -66 - -111. Suppose p = -2p + s. Suppose -2k = -10, -2y = -y - k - 23. What is the remainder when y is divided by p? 13 Let o = 21 + -13. Let q(n) = n*2 - n + 5. Calculate the remainder when o is divided by q(0). 3 Let p = -246 - -271. Let f = 0 - 1. Calculate the remainder when p is divided by f + 3(-20)/(-6). 7 Calculate the remainder when (93/9)/(44/48) is divided by 16. 15 Let r = -6 + 19. What is the remainder when 24 is divided by r? 11 Let s = -16 + 18. Suppose o = -4w + 26, -3o = -w - 2w - 3. Calculate the remainder when o is divided by s. 0 Let b = 11 - 9. Let o = 9 - b. Let l = 13 + 7. Calculate the remainder when l is divided by o. 6 Let j be 2 - (2 - (0 - -2)). Suppose jf = 0, 5f = -2p + 82 - 12. What is the remainder when p is divided by 18? 17 Suppose 43 = 5j + 8. Let y = 13 - 9. Calculate the remainder when j is divided by y. 3 Let z(j) = j*2 + 8j + 10. Calculate the remainder when 56 is divided by z(-9). 18 Let w = -4 + 39. Suppose -2z + z = -12. What is the remainder when w is divided by z? 11 Let j be (-6)/(-5)40/6. Suppose 70 = jh - h. Calculate the remainder when h is divided by 7. 3 Let n = 34 - 17. Let j be 93(3 - 2). What is the remainder when n is divided by j/2(-4)/(-6)? 8 Suppose -3x + 0z = -5z - 24, -3x - 5z = -24. Calculate the remainder when -31(-1 - (3 + -3))/1 is divided by x. 7 Let z = -70 + 76. Calculate the remainder when 33 is divided by z. 3 Let l = 19 - -145. What is the remainder when l is divided by 33? 32 Let t = 13 + -3. Suppose 2d + 2 + 0 = 0. Calculate the remainder when d/(-5) - 376/(-20) is divided by t. 9 Let m be (6/(-4))/(15/(-40)). Suppose 2v - mv = -8. What is the remainder when 11 is divided by v? 3 Let t = 1 - -4. Suppose -2l - tm = 9, -5l + m = 4m - 6. Calculate the remainder when 11 is divided by l. 2 Suppose -4i = -3o - 5i + 12, 5o - 20 = 2i. Calculate the remainder when 9 is divided by o. 1 Let d = 27 + -8. What is the remainder when d is divided by 10? 9 Suppose -1 = -5d + 29. What is the remainder when d is divided by 2? 0 Calculate the remainder when 550/33 - (-4)/(-6) is divided by 10. 6 Suppose -162 = -5l + 3h, -5h + 50 = 3l - 54. Suppose -3d - 10 = -64. What is the remainder when l is divided by d? 15 Suppose -4f - 8 = -72. Suppose -5l - 5i - 19 = -4l, l + 13 = -3i. Let g(u) = -9u - 6. What is the remainder when g(l) is divided by f? 14 Let z(h) = 0 + 5 - h + 3. Let l be z(6). Suppose 4 = lq - 6. What is the remainder when 8 is divided by q? 3 Suppose -4k - 2b = -6, 6 = -2k + 3b - 3. Let i(c) = 3 + 7c + 7c2 + 0 + c3 + kc. Calculate the remainder when 34 is divided by i(-5). 16 Let f(k) = k*3 + 4k*2 + 3k + 6. Let b be 1/((-2)/4) + -1. Calculate the remainder when 10 is divided by f(b). 4 Let t(l) = l*3 - 2l*2 - 4l + 3. Let d be t(3). Suppose -3p + dp + 114 = 3a, -3p = 4a - 148. Calculate the remainder when a is divided by 18. 16 Let s(x) = -1. Let v(i) = i - 4. Let k(p) = -5s(p) - v(p). Let g(y) = y - 4. Let m be g(4). What is the remainder when 26 is divided by k(m)? 8 Suppose -4s + 5 = 3f + 17, f + 4 = -3s. Suppose m - 3 = -sm. What is the remainder when 8 is divided by m? 2 Let j(o) = o*3 + 5o*2 + 4o + 3. Let u be j(-3). Suppose 4s - us + 140 = 0. What is the remainder when s is divided by 15? 13 Suppose -6k = -9k + 96. Suppose 3f + 3x - 63 = 0, -4f + 26 = -2f - 2x. Calculate the remainder when k is divided by f. 15 Let d = 5 - 4. Suppose -2s - d = -7. Calculate the remainder when 5 is divided by s. 2 Let v = -37 - -43. Calculate the remainder when 20 is divided by v. 2 Let y = -8 + 12. Suppose -3j + 169 = 2c, -yc - c = 20. What is the remainder when j is divided by 30? 29 Let q be 23/(3 + 0). Let s(g) = 1 - 6g + 3g*q + 0 - 5. Calculate the remainder when s(5) is divided by 14. 13 Suppose 7d + 5o = 4d + 205, 4d + 2o = 292. Let q = 97 + d. Suppose y - 5y = 4f - q, 4f - 137 = 3y. What is the remainder when f is divided by 13? 12 Let y(o) = -o + 34. What is the remainder when 55 is divided by y(6)? 27 Suppose 2h = -8h + 70. Let d be (14 - 4)2/4. Suppose df - f = 44. What is the remainder when f is divided by h? 4 Let b(u) be the first derivative of u*3 - 5u*2/2 - 7u - 4. What is the remainder when b(5) is divided by 15? 13 Suppose 6s - 24 - 12 = 0. What is the remainder when 9 is divided by s? 3 Suppose 4q + 620 = 5m, 6m = m - 5q + 665. What is the remainder when m is divided by 13? 11 Suppose 3a - 132 = -a. Let z(y) = -y2 + y + 9. What is the remainder when a is divided by z(0)? 6 Let t(f) = f3 - 12f2 - 10f - 12. What is the remainder when t(13) is divided by 14? 13 Let r = 64 + -57. What is the remainder when 76 is divided by r? 6 Let u be (-296)/(-12)13. Let j = -51 + u. Calculate the remainder when j is divided by 12. 11 Let i(c) = -c - 6. Let k(z) = 4z + 2. Let u be k(-2). Let q be i(u). Calculate the remainder when 25 is divided by (-1)/(q + (-3)/39). 12 Let j(w) = -107w - 1. Let c be j(-1). Let x be (-4)/(-6) + 2/6. Calculate the remainder when 35 is divided by c/6 + x/3. 17 Let l(i) = -i*2. Let m(a) = 4a*2 - 5a + 1. Let p(n) = -3l(n) - m(n). Calculate the remainder when p(3) is divided by 3. 2 Let b(i) = 2i3 + i2 - 2i + 1. Let v be b(1). Suppose vh = -2h + 4. Calculate the remainder when 50 is divided by (-52)/(-1)h/2. 24 Let z be 2/((-248)/122 + 2). Let q = 95 + z. Calculate the remainder when q is divided by (-2 - -4)/((-1)/(-6)). 10 Suppose -23 = -5f - 8. Suppose -2s = 3q - 70, 0 = 2s - fs + 5. Suppose -w + 33 = 2w. What is the remainder when q is divided by w? 9 Let r = -48 - -68. Calculate the remainder when 77 is divided by r. 17 Let g = 3 + -1. Suppose 0 = l + 5o + 8, o = go + 3. What is the remainder when 12 is divided by l? 5 Suppose 3l - 88 = 2. What is the remainder when 117 is divided by l? 27 Let k(z) = 3z*2 + 33z + 27. Let r(f) = f*2 + 11f + 9. Let p(b) = -6k(b) + 17r(b). Calculate the remainder when p(-4) is divided by 10. 9 Suppose -v = -2p + 3p - 66, 3v - 3p = 228. Let r = v + -43. What is the remainder when r is divided by 10? 8 Suppose -f = f + 10. Let j(o) = o + 8. Let h be j(f). Suppose -2 + 3 = d + hr, 3d - 3 = -r. What is the remainder when d is divided by 1? 0 Suppose 4 + 4 = -4g. What is the remainder when 16 is divided by g/((-22)/18 - -1)? 7 Suppose -4u - 3j - 23 = 0, -u = -0u + 4j + 22. What is the remainder when 29 is divided by 10/(u/(-3)1)? 14 Suppose 0 = -i + 4k + 15, 2k - 42 = -4i - 0k. What is the remainder when 54 is divided by i? 10 Suppose 2f - 3f - 7 = 0. Let h(a) be the first derivative of -3a2/2 + 7a + 1. What is the remainder when h(f) is divided by 10? 8 Let n be ((1 - -3)3)/2. Suppose nl = l + 85. Calculate the remainder when 48 is divided by l. 14 Suppose -3w - 24 = -4b - 2w, -2b = 2w - 22. Suppose 33 = 2s - 19. Calculate the remainder when s is divided by b. 5 Let y(b) = 4b2 + 50b - 9. What is the remainder	{ "pile_set_name": "DM Mathematics" }
-4/13) Simplify ((u(u(-7)u)/u)/(u/(u/(u/((u*(5/6)u)/u)))))14 assuming u is positive. u(-259/3) Simplify ((v(-1))(6/17))28 assuming v is positive. v(-168/17) Simplify (m*(-1/18)/m)/((m/(mm*(1/13)))/m)(m/m8)/m(-2/25) assuming m is positive. m*(-40357/5850) Simplify (qq*(-2/3)qq)(2/7)/(q(-3)/q(-2/17)) assuming q is positive. q(181/51) Simplify (m/(mm(-3)))/(m(12/11)/m) assuming m is positive. m(32/11) Simplify (l0ll)*(17/3)/(l(l*(-2)l)/ll/l(-5)l) assuming l is positive. l(16/3) Simplify l/(l(7/6)/l)(lll(1/27)/l)/l assuming l is positive. l(47/54) Simplify (q/q0q)(-43)/(q/(q/(q(-2)q)))29 assuming q is positive. q(-57) Simplify w(-3)/(w4w) assuming w is positive. w(-8) Simplify (j/j17)/j(-2) assuming j is positive. j(-14) Simplify f*(2/13)(ff(-1/2))/f(f3)(-4/7) assuming f is positive. f(-375/182) Simplify (w/w29)/(w/(w/(w/w*23w))) assuming w is positive. w*(-7) Simplify (z/((zzzz*5/zzzzzzz)/z)z/(z/(z/((z/z(1/9))/z))))/(z/(z/z1))(-28) assuming z is positive. z(163/9) Simplify n*1n*(-4)/n((nn0)/nn)(-2/25) assuming n is positive. n(-102/25) Simplify (y*14/(((yy(10/3))/y)/y))17 assuming y is positive. y(595/3) Simplify c(-3/7)c(-6/7) assuming c is positive. c(-9/7) Simplify (y6/y(-1/5))/(y(1/2))(-30) assuming y is positive. y(106/5) Simplify (c/c(-2/5))(1/2)/(c/(c(2/7)/c))(-27) assuming c is positive. c(3289/70) Simplify (oo*24)/oo/o(1/14) assuming o is positive. o(349/14) Simplify ((gg/(gg*(-3)g))/(g/(g(-5)/g)))(13/8) assuming g is positive. g*(-13/2) Simplify bbb(2/7)b*(4/9)(bb(-10))/(b(9/4)b) assuming b is positive. b(-2399/252) Simplify ((q(-10)/q)/q)/(q/q22) assuming q is positive. q9 Simplify ((w9/w)/w)(2/141) assuming w is positive. w(14/141) Simplify (c11cc/(c*(-5/3)/c)c)/((cc(c/(((c*1/c)/c)/c))/cccc)/cc(1/5)) assuming c is positive. c(157/15) Simplify nn*5nn(6/7) assuming n is positive. n(55/7) Simplify (qq(-1))34/(q*(-6)q(-2/9)) assuming q is positive. q(56/9) Simplify ((mm(-11)m)/mmm)(1/12) assuming m is positive. m(-2/3) Simplify (y(-3))(1/32) assuming y is positive. y(-3/32) Simplify (q/(q/(q1/q)))(1/15)/(q/(q5qq)q/(qqq/(qq*(-7/4)qq))) assuming q is positive. q(27/4) Simplify (d(3/7)/d)/d(6/5) assuming d is positive. d(-62/35) Simplify (z(31/2)/z)/(z33/zz) assuming z is positive. z*(-37/2) Simplify ((yy*(-2/7)/yy)8)3 assuming y is positive. y(120/7) Simplify l(-4/13)(l/(l(l*8l)/l))/l assuming l is positive. l*(-121/13) Simplify (((j/(j/((((jj13/j)/j)/j)/j)))/j)/j(2/23))18 assuming j is positive. j(3690/23) Simplify g(3/8)/(g(-1/11)/g) assuming g is positive. g(129/88) Simplify ((q/((q/(q/q(-3/7)))/qq))/(q/((q(q/((qq/(q/(qqq4qqqq)))/q))/q)/q)))/(q(2/3)q/(q*(-5)q)) assuming q is positive. q(-320/21) Simplify ((f(2/17)/f)/ff(-1))(2/23) assuming f is positive. f(-98/391) Simplify g(-9)gg/(g9g)g(-4/9)/((gg(g(-1/3)/g)/g)/g) assuming g is positive. g(-145/9) Simplify (s(3/5)/sss(-1/8))(-46) assuming s is positive. s(-437/20) Simplify (d(-7))(-12) assuming d is positive. d84 Simplify (l/l(6/5))(-15/2) assuming l is positive. l(3/2) Simplify (p(-15)pp/(p/p(6/7)))(2/31) assuming p is positive. p(-184/217) Simplify (h1)(14/3) assuming h is positive. h(14/3) Simplify (hh*0hh)(-2/25)(hh(-3/4))/h(-3) assuming h is positive. h(301/100) Simplify (((o(-1)/o)/o)(8/7))(-31) assuming o is positive. o(744/7) Simplify (o0oo)(-45)/((oo*(-6/13))/(o/(oo*(4/13)o)oo)) assuming o is positive. o(-1168/13) Simplify (o/(((o(-16)o)/o)/o))/ooo(oo/(o/(o(-4/17)o))oo)/o assuming o is positive. o(370/17) Simplify (b(3/5)b9)/(b/(b(2/3)/b)b/b(-4/9)) assuming b is positive. b(307/45) Simplify x*(-11)xx(-17) assuming x is positive. x(-27) Simplify z/(z(z*1/z)/zzz)z*(-2)((z/((z*6z)/z))/z)/((z/z(-2/17))/z) assuming z is positive. z(-155/17) Simplify ((y*4y)/y(-3))(3/7) assuming y is positive. y*(24/7) Simplify ((ii*8)/((ii*5i)/i))/(i(i/(i/(i5i)))/ii(3/2)/i) assuming i is positive. i(-7/2) Simplify i(-6/7)i*2(i(i/i3)/i)/(i/((i6/i)/iii)) assuming i is positive. i(29/7) Simplify ((((n(-2)/n)/n)/nn)(-4/9))(1/34) assuming n is positive. n(8/153) Simplify (c(-7)/(c/((cc/(c(-2/19)cc))/c)))/((cc(-2))/(c(-5/3)c)) assuming c is positive. c(-488/57) Simplify (q14)6 assuming q is positive. q84 Simplify (u0)(-34)/(u/u(-2/7)u)(1/40) assuming u is positive. u(-2/35) Simplify (i/i0)(30/11)/((i/i4)/(i/i(-5))) assuming i is positive. i(129/11) Simplify (t(-11)/t)/(t(((tt*20t)/t)/t)/t) assuming t is positive. t(-32) Simplify (s(-8)/ss)(8/11) assuming s is positive. s(-64/11) Simplify ((q/(((q/q(-7))/q)/qq))/qq(q*(2/7)q)/q)/(q/(q*(-1/11)/q)q/q(-3/7)) assuming q is positive. q(-711/77) Simplify (f(-1))(2/5)(ff(1/3)/f)45 assuming f is positive. f(73/5) Simplify n(-11)/nn/(n/n(-31))n assuming n is positive. n(-42) Simplify (h(-1)h)(-25/2)(h*1h)(-28/5) assuming h is positive. h(-56/5) Simplify (y(-3/2))(-25)yy*(2/15)((yy(-6))/y)/y assuming y is positive. y(949/30) Simplify ((z(-1/5)/z)/((z/(z(-11)z))/z))7 assuming z is positive. z(-392/5) Simplify ((qq0)(-25/2))(1/21) assuming q is positive. q(-25/42) Simplify (t/(tt0))0(t(-2/7))(9/11) assuming t is positive. t(-18/77) Simplify ((i/i(-2)i)/ii)14(ii(-1)i)(-10/3) assuming i is positive. i(158/3) Simplify ((mm(mm(-6))/mm)/m)(-44) assuming m is positive. m176 Simplify ((f/(f*(-3)/f))/fff/(f/f(1/2)))/(f4/(((f/(f/f(1/14)))/f)/f)) assuming f is positive. f(-3/7) Simplify yy/(y*(1/8)/y)(y/y*(1/5))/yy/(yy(7/2)y)yy(-4) assuming y is positive. y(-193/40) Simplify (d/(dd/d(-2)))/(d/(d(2/5)/d))(d(d0d)/d)(-4/5) assuming d is positive. d(-27/5) Simplify (aa(-7/5))/aa*(-24)/aaa assuming a is positive. a(-122/5) Simplify (f4ff/(f/f1))/((f/f(-1/5))/f(f*(2/19)ff)/ff) assuming f is positive. f(351/95) Simplify (k(-7/3)kk(-3))(-7/12) assuming k is positive. k(91/36) Simplify (u(-1)/u(-5))37 assuming u is positive. u148 Simplify t20/t(2/13) assuming t is positive. t(258/13) Simplify (((ll/(l/(l(4/5)/l)))/l)(-25/6))(-14/5) assuming l is positive. l(-7/3) Simplify v11/(v(-2/5)/v)v*(1/4)vv((vvv/v*(3/2))/vv)/v assuming v is positive. v*(303/20) Simplify (pp*10)/pp(-3/17)/p assuming p is positive. p(150/17) Simplify ((i(-2/13))(-2/9))(1/33) assuming i is positive. i(4/3861) Simplify (q/(q0/q))(-40)(q1q)/(q/q*4q) assuming q is positive. q(-76) Simplify j/j16jj*9jj assuming j is positive. j(-3) Simplify w/(w(2/47)w)w(3/5)w assuming w is positive. w*(366/235) Simplify (oo/(o(o(-6)/o)/oo))/(o/(o*(-2/19)o))(o/o(2/9))/ooo5 assuming o is positive. o(2338/171) Simplify ((q/(qq(-4/5)))/(q(-2/11)q))/(q(2/7)q/q1) assuming q is positive. q(-117/385) Simplify w*(-12/11)ww/w17 assuming w is positive. w(-177/11) Simplify ((qq1)/q)6q(-2)qq(-3/4) assuming q is positive. q(17/4) Simplify (w(-4/7))(13/2) assuming w is positive. w(-26/7) Simplify (rr*(4/19))/rr(-35)/r assuming r is positive. r(-680/19) Simplify (dddd/(d(-5)/dd)dd/(d/(dd(4/9)d)))(-27) assuming d is positive. d(-336) Simplify (q*(-3/2)q)/(q*(-18)q) assuming q is positive. q(33/2) Simplify (v/(v/(v20v))v)(-25/3) assuming v is positive. v(-550/3) Simplify ((q/q(1/2))(-48))(-42) assuming q is positive. q1008 Simplify ((r/(r/(r/(r*(8/7)/rrr))))/r)(-25) assuming r is positive. r(375/7) Simplify c(-3/7)ccc/((cc(-15)c)/c) assuming c is positive. c(116/7) Simplify (((m/m2m)/m)(-8))(-17) assuming m is positive. m(-136) Simplify x/((x/x(-2/9))/x)x*1x*(-2)xx	{ "pile_set_name": "DM Mathematics" }
24z Let r(c) = -c2 + 2c - 2. Let u(p) = 3p2 - 5p + 5. Let x(w) = -5r(w) - 2u(w). Let f(n) be the first derivative of n*2 + 1. Determine x(f(g)). -4g*2 Let o be (((-6)/(-9))/(-2))/(-10). Let y(n) be the third derivative of 0n*4 + 0n*3 + 0 + 0n - 2n2 + on*5. Let z(c) = c. Determine z(y(s)). 2s*2 Let y(i) = 2i. Let h(q) = -602q2. What is y(h(x))? -1204x*2 Let l(m) = 4m*2. Let i(q) = 1011q. Determine i(l(p)). 4044p2 Let f be (-3 - -1)/(10/(-20)). Let d(p) = fp*2 + 2p*2 - 5p*2 + 0p*2. Let b(y) = 3y*2 - 5y*2 + 0y*2. Give b(d(v)). -2v*4 Let s = -18 + 18. Let c(a) be the third derivative of 0 + 0a*4 + 2a*2 + 0a + sa3 - 1/20a*5. Let n(q) = 2q*2. Give c(n(f)). -12f*4 Let z(j) = -j. Let b(k) = 27k + 15. Determine z(b(p)). -27p - 15 Let r(p) be the first derivative of -p2 - 1. Let o(g) be the third derivative of g4/12 + 5g*2. Determine r(o(y)). -4y Let h(t) = 15t. Let q(v) = -v + 2188 - 2188. Determine q(h(w)). -15w Let z(k) = k*2. Let t(o) = -18o*2 + 2. Give z(t(v)). 324v*4 - 72v*2 + 4 Let k(j) = -5j + 4. Let z(n) = n - 1. Let p(d) = -k(d) - 4z(d). Let b(f) = -3f*2. Calculate p(b(y)). -3y*2 Suppose -3s + 4 + 5 = 0. Let t(m) = s - 3 - m + 2m. Let b(x) = -1. Let h(r) = -r + 1. Let q(u) = 4b(u) + 4h(u). Calculate q(t(f)). -4f Let p(m) = -2m. Suppose 0 = -k + 7 - 5. Let b(z) = kz + 0z - 6z. Calculate p(b(r)). 8r Let g(u) be the third derivative of u5/60 - 21u*2. Let c(d) = -17d*2. Determine g(c(q)). 289q4 Let o(k) = k2. Let b(t) = 2t - 7t - 3t + 11t. What is b(o(h))? 3h2 Let d(k) be the third derivative of -k5/60 - 7k*2. Let b(x) be the second derivative of 2x*3/3 + x. What is b(d(f))? -4f*2 Suppose -3 + 15 = -2g. Let a be (-4)/g(-7 + 10). Let j(r) = -3r*a + 7r*2 - 2r*2. Let y(x) = -4x*2. What is y(j(p))? -16p*4 Let r(n) = 2n. Let u(s) = -2s. Let p(t) = 2t - 4. Let f be p(4). Let j(q) = fu(q) + 5r(q). Let v(l) = -2l. Calculate j(v(w)). -4w Let w(h) = 2h. Let t(r) = -r. Let j(o) = 2o. Let k(y) = j(y) + 4t(y). Calculate k(w(b)). -4b Let z(k) = -892k. Let m(d) = d2. What is m(z(l))? 795664l*2 Let x(s) be the first derivative of 2s*3/3 + 1. Let b(l) be the third derivative of 0 - 1/12l*4 + 0l - 2l2 + 0l*3. Calculate b(x(r)). -4r*2 Let w(l) = -7l - 6. Let v(j) = j + 1. Let d(a) = -6v(a) - w(a). Suppose -q - 2b = 0, 7 = -q + 2q - 5b. Let i(t) = -qt2 - 2 + 2 + 0. Give i(d(k)). -2k*2 Let f(v) = 43v*2. Let k(m) = -5m*2. What is f(k(x))? 1075x*4 Let g(l) be the second derivative of -5l*4/12 + 25l. Let r(i) be the second derivative of -i*4/12 + 2i. Calculate r(g(v)). -25v4 Let a(f) be the third derivative of f5/60 + 15f*2. Let y(t) = 28t. What is a(y(i))? 784i2 Let a(z) = -4z - 5. Let q(y) = -15y - 21. Let g(w) = 21a(w) - 5q(w). Let h(u) = -2u. Calculate g(h(i)). 18i Let y(a) = a2 - 34a. Let h(o) = -o. Give h(y(g)). -g*2 + 34g Let l(s) = -s - 3. Let f be l(-5). Let r(k) = k*2 - 2k + fk. Let a(h) be the third derivative of -h5/60 + 10h2. Determine r(a(d)). d4 Let f(q) = -3q2. Suppose 2j + 10 = -2u + 6u, -4u - j - 5 = 0. Let r(o) = 5o - o + uo. Give f(r(k)). -48k*2 Let z(a) = 2a*2. Let h(b) = 18b*2 + 2b. Calculate z(h(n)). 648n4 + 144n*3 + 8n2 Let c(j) be the third derivative of -j4/8 - 27j2. Let p(x) be the second derivative of -x3/3 + x. Give c(p(f)). 6f Let u(x) = -61x - 2. Let l(n) = 2n*2. Determine l(u(a)). 7442a*2 + 488a + 8 Let x(j) be the third derivative of 2j5/15 - j2. Let g(i) = -16i + 22. Let w(d) = -3d + 4. Let m(p) = 6g(p) - 33w(p). Calculate x(m(k)). 72k*2 Let h(v) = -1069v. Let k(g) = 2g2. Determine h(k(u)). -2138u2 Let c(n) = n. Let m(i) be the first derivative of i2/2 - 10. Give c(m(k)). k Let o(v) = -2v. Let s(r) = -12290r*2. What is s(o(f))? -49160f*2 Let o(l) = -3l + 4. Let z(i) = i + 6. Calculate o(z(a)). -3a - 14 Let n(g) = 2g*2. Let f(u) = -984u - 1. Determine f(n(r)). -1968r2 - 1 Let l(o) = 4o*2. Let f = -25 - -17. Let r = f - -11. Let a(m) = 6m2 + m2 - 3m2 - rm*2. What is a(l(h))? 16h*4 Let a(i) = -7i + 5i - i. Let p(c) = -6c*2. Determine a(p(o)). 18o2 Let z(l) = l2 + 2l2 - 2l*2. Let n = 5 - 2. Let d(h) = -nh + 6h - 2h. Give d(z(u)). u*2 Let m(n) = 1. Let g be (-1)/((-1)/3) - 0. Let l(s) = s + 3. Let w(x) = gm(x) - l(x). Let t(q) = 7 + 2q2 - 7 - 3q2. Calculate w(t(r)). r2 Let n(g) = g*2 - 3g - 7. Let i be n(5). Let d(f) = if - 6f + 0f. Let l(h) = -6h*2 + 5h. Let s(q) = -q*2 + q. Let w(o) = -l(o) + 5s(o). Give d(w(b)). -3b2 Let h(k) = -6k*2. Let i(x) = -394x*2 + 2. Calculate h(i(f)). -931416f*4 + 9456f*2 - 24 Let s(m) = 6m. Let d(p) = 2p2 - 153p + 153p. Give d(s(h)). 72h*2 Let b(x) = -x. Let p(r) = -r + 2r + 2r - 5r. Calculate b(p(g)). 2g Let j(t) be the first derivative of -t5/60 + t2 - 1. Let l(o) be the second derivative of j(o). Let x(z) = -z. Calculate x(l(b)). b2 Let f(w) = -w2. Let o(i) = i - 5. Let d be o(7). Let c(a) = -a2 + 4 + d - 6. What is f(c(m))? -m4 Let c(o) = 85o. Let i(a) = -18a2 + 2a. Calculate i(c(p)). -130050p2 + 170p Suppose 0 = -5d + 2g - 5g + 4, 2d + 8 = 2g. Let l = 5 + d. Let s(c) = -l + 4 - 3c*2. Let a(b) = -2b*2. Calculate a(s(i)). -18i*4 Let d be 2/(-11) - 24/(-11). Let n(c) = 5c*2 - 6c*d + 4c*2. Let u(i) = 3i. What is n(u(h))? 27h2 Let z(u) = -7u. Let j(h) be the third derivative of -h*5/60 + 8h*2. Give j(z(f)). -49f*2 Let y(u) = -4u2. Let q(o) be the second derivative of o5/120 + o*3/2 + o. Let k(l) be the second derivative of q(l). Calculate y(k(c)). -4c*2 Suppose -2u = -u. Let k(s) = us - s - 9s + 6s. Let v(d) = -4d. Calculate k(v(w)). 16w Let h(l) = 6l. Let n(u) = -2 - 2 + 4 - u. Let y be n(-1). Let q(p) = 1 - 2 + y + p. What is h(q(i))? 6i Let q(l) = 4l*2. Let k(s) = 2926s*2. Give k(q(w)). 46816w*4 Let u(k) = -4028k. Let z(o) = -2o2. What is z(u(t))? -32449568t2 Let r(u) be the third derivative of -u6/720 - u*4/24 + 2u2. Let v(q) be the second derivative of r(q). Let y(x) = x2. Give v(y(t)). -t*2 Let v(h) be the first derivative of 2h2 + 1. Let x(k) be the first derivative of k3/3 - 2. Calculate x(v(g)). 16g2 Let u(g) = 7g + 5. Let q(b) be the third derivative of 1/3b3 + 0b + 0 + 3b2 + 1/8b*4. Let r(p) = 5q(p) - 2u(p). Let n(c) = 6c. Calculate r(n(l)). 6l Let f(s) be the first derivative of -2s*3/3 + 1. Let a(v) be the second derivative of -2v*4/3 - 6v. Calculate a(f(k)). -32k4 Let d(s) = 2s. Let h(t) = 2206t. Give h(d(c)). 4412c Let a(c) = 2c2. Let h(u) = 2u - 655. Determine h(a(f)). 4f2 - 655 Let o(b) = -2b - 9. Let z(v) = -15v2. What is z(o(t))? -60t*2 - 540t - 1215 Let a(g) = -4g2 + 5g2 + g2. Let p = 3 + -10. Let w(z) = 4z - 7. Let j(y) = 2y - 3. Let q(u) = pj(u) + 3w(u). Give a(q(m)). 8m2 Let j(k) = -4k*2. Let u be ((-14)/6 + 3)/1. Let g(h) be the first derivative of 1 - uh*3 + 0h*2 + 0h. Give j(g(z)). -16z4 Let j(s) = -4s*2. Let l(b) = -80b*2 + 2. Give l(j(i)). -1280i*4 + 2 Let n(k) = 30k2. Let q(b) be the second derivative of b4/12 - b + 1. Determine n(q(c)). 30c4 Let v(h) = -2h. Let d(b) be the first derivative of b5/30 + b3 - 4. Let c(t) be the third derivative of d(t). Determine c(v(l)). -8l Let t(n) = -3n - 2 + 2 + n. Let w(d) be the second derivative of d*3/6 + d. What is w(t(a))? -2a Let a(o) be the first derivative of o*3/6 + 2o - 5. Let t(m) be the first derivative of a(m). Let l(x) = 6x. Determine t(l(p)). 6p Let v(o) = -2o2 + 12o + 6. Let i(f) = 2f + 1. Let j(y) = -6i(y) + v(y). Let d(k) = 26k. Calculate j(d(a)). -1352a*2 Let f(l) = 4l*2 + 24. Let u(q) = 31q. Give u(f(k)). 124k2 + 744 Let h(l) = 2l. Let u(d) = -3930d - 2. Determine u(h(z)). -7860z - 2 Let j(q) = -37q + 33q + 1 - 1. Let f(k) be the first derivative of -2k3/3 + 1. Calculate f(j(x)). -32x*2 Let n(s) = -2s - 2. Let f(o) = -2. Let q(a) = -2f(a) + 2n(a). Let v(b) = 7b2. Let j(i) = i2. Let x(p) = -5j(p) + v(p). Calculate x(q(k)). 32k2 Let j(v) = 21v**2 +	{ "pile_set_name": "DM Mathematics" }
8234 = j. What is the tens digit of x? 5 Let y(x) = x*3 - 9x*2 + 12x - 20. Let w be y(8). Let a be 3/(13/w + (-7)/21). Suppose 0 = -3v - 0v + 5p + 568, a = 4p. What is the tens digit of v? 9 Let i(h) = -h*3 - 15h*2 - 21 + 17h - 7h2 + 9h*2. Let n be i(-14). What is the tens digit of (n/12 - -4)-28? 3 Suppose -36o = -1480 - 83552. Let z = -1184 + o. What is the units digit of z? 8 What is the tens digit of ((-239226)/(-18))/(17(-3)/(-153))? 7 Let h = 2483 + -1869. What is the tens digit of h? 1 Let y(r) = 2r3 - 3r*2 - 8r + 51. Let s be (-1)/(-7 + (-192)/(-28)). What is the units digit of y(s)? 4 Suppose -x = 40x - 158629. What is the thousands digit of x? 3 Let b(h) = h3 + 44h*2 - 53h - 29. Let a = -356 + 311. What is the hundreds digit of b(a)? 3 Let g(o) = -4o3 + 3o*2 + 20o + 11. What is the units digit of g(-12)? 5 Suppose -833930 + 4605387 = 59f. What is the tens digit of f? 2 Let d = -450 + 153. What is the tens digit of (-4)/18 - 11/(d/3624)? 3 Suppose -20118 = -3y + 2j, -3j + 26841 = 4y - 0y. What is the thousands digit of y? 6 Let m = 96 - 31. Suppose 5o + 20 = m. Suppose os = 222 + 1830. What is the units digit of s? 8 Let n be 38/10 + (-1)/(-5) + 1814. Suppose -32g + n = -29g. Suppose g + 490 = 4l. What is the hundreds digit of l? 2 Let z = 266 + -262. What is the tens digit of 10120/(-11)-1 + (z - 0)? 2 Suppose -j - 4x = -4326, -2877 = -j + 5x + 1485. What is the thousands digit of j? 4 Let q = -89 - -8013. Suppose 3z - 17z = -q. What is the hundreds digit of z? 5 Let k(u) = u*3 - 6u*2 - 22 + 7 + 136u - 133u. Let j be k(6). Let h(v) = 8v*3 - 2v*2 - 6v. What is the units digit of h(j)? 0 Let i = 19815 - 5123. What is the units digit of i? 2 Let l(p) = -p*3 - 7p*2 - 10p - 8. Let h be l(-9). Let z = 326 - h. What is the tens digit of z? 8 Suppose 58i + 260623 = 708847. What is the thousands digit of i? 7 Suppose 3g - 85 = 5k, 4k - 3g = -8g - 68. Let l be 9/(-21) - k/7. Suppose -30 - 40 = -lj. What is the units digit of j? 5 Let c(q) = q + 0 + 127q*2 + 4 + 0 - 3. What is the hundreds digit of c(1)? 1 Suppose 4u + 12 = 8u. Let b be (-12)/(-7) - 8/(-28). Suppose l = -bx - 3, -ul = -2l + 4x + 7. What is the units digit of l? 1 Suppose 2c - 3190 = -5m, 0 = -c + 2m + 1953 - 358. What is the thousands digit of c? 1 Suppose -10651 - 2373 = -c - 325. What is the units digit of c? 9 Let u(i) be the second derivative of -59/3i3 - 5i*2 + 0 - 11i. What is the tens digit of u(-2)? 2 Let j be 84/(-36) + (0 + 1)/3. What is the units digit of (j18/(-16))/(2/304)? 2 Let k be (-107)/7 - 34/(-119). What is the units digit of (-11)/55 + (-3)/k276? 5 Suppose -2g + 5m = -10996, -27439 = -38g + 33g + 4m. What is the tens digit of g? 8 Suppose 0 = 5q - 5s - 70, 4q + 2s - s = 36. Suppose -2968 = -qu + 3132. What is the tens digit of u? 1 Suppose 134044 - 447840 = -145x + 2022589. What is the hundreds digit of x? 1 Let g(l) = -529l + 1030. What is the units digit of g(-9)? 1 Suppose -8l + 117752 = 4o, 5o + 73634 = 5l + o. What is the hundreds digit of l? 7 Let r(p) = -p*3 - 3p*2 - 5p - 4. Let w be (-16)/9 - 4/18. Let c be r(w). Suppose -cm + 47 = -0m + x, 4x + 137 = 5m. What is the units digit of m? 5 Let m be 1(18 + 1) + (-20 - -22). Suppose 5w = -m + 141. What is the hundreds digit of 16/w + 1064/6? 1 Let w(f) = -f*2 + 11f + 39. Let o be w(12). Suppose -2d + os + 134 = 23s, 5d + 5s = 335. What is the units digit of d? 7 Suppose -96 = -3z - 5r, 2z - 2r = 41 + 39. Let s = 35 - z. What is the tens digit of (-103)/s + (-51)/(-34)? 5 Let v = 78424 - 45647. What is the ten thousands digit of v? 3 Let l = -15413 - -26691. What is the units digit of l? 8 What is the thousands digit of 3/13 - 1695780/(-585)? 2 Let t be (1 + -2)(-5 + 0). Suppose 5a = 6w - 30, -127 = -4a - 151. Suppose wb - 170 = -tb. What is the tens digit of b? 3 Suppose 3u - 12886 = -m - 4u, -5u = -4m + 51676. What is the units digit of m? 4 Suppose 11d + 505 = 6d. Let l = -99 - d. Suppose -93 = -f + 2v + 2v, -lv = -3f + 269. What is the units digit of f? 9 Suppose -4v - 17 = 3j, -13 = 2j + 5v + 10. What is the units digit of j + (10 - 4) - -1? 8 Suppose 0 = -3m - 3u + 4760 + 4465, m - 3081 = -4u. Let p = m + -1314. What is the tens digit of p? 5 What is the hundreds digit of 4145 - ((-3)/((-9)/1))/(34/(-204))? 1 Suppose 2h = 4v - 36528, 13468 + 13938 = 3v - 4h. What is the hundreds digit of v? 1 Suppose 5f - 56 - 184 = 0. Suppose 16x = 17x - f. Let u = 114 - x. What is the units digit of u? 6 Let f(d) = -10d*2 + 4d + 83. Let p be f(-7). What is the hundreds digit of (51/(-17))/(3/p)? 4 Suppose 0 = 142i - 16i + 55i - 5374252. What is the thousands digit of i? 9 Suppose -10l = -2l + 2056. Let g = 1029 + l. What is the tens digit of g? 7 What is the hundreds digit of 155/(-124) - 1061140/(-16)? 3 Let b be (-72)/1087/((-7)/120). Let q = -73 + b. What is the units digit of q? 7 Let h(b) = -b*2 + 15b - 5. Let c be h(12). Let n(r) = r*2 - 17r - 19. What is the tens digit of n(c)? 1 Suppose 2q = u - 3u + 6008, -9007 = -3q + 2u. What is the hundreds digit of q? 0 What is the units digit of (-3(-7)/(-14))/(9/(-2400))? 0 Let r(d) be the third derivative of d5/60 - d4/24 - d3 - 34d*2. Let b be r(-3). Suppose 10g - b = 7g. What is the units digit of g? 2 What is the units digit of 3/(-81)-3 - (-17 - (-1394090)/(-90))? 7 Suppose -13120 + 55038 = 14g - 60142. What is the hundreds digit of g? 2 Let y = 30 + -18. Let r be (1 + -1)/(4/(y/3)). Suppose ra + 2a - 5g - 279 = 0, a - 135 = g. What is the hundreds digit of a? 1 Let k(j) = -7j + 20 + j - 6 + 11 + 9j*2. Let q be k(-7). Suppose 9u - 5u = q. What is the tens digit of u? 2 Let w(v) = 199v + 51. Let i be w(4). Suppose 23x = 34x - i. What is the units digit of x? 7 Suppose -d + 11 = 6. Suppose 2c - 2395 = -dz, -3c + 5978 = 2c + 3z. Suppose q = 6q - c. What is the tens digit of q? 3 Suppose 9p - 77987 = 147524 - 24181. What is the hundreds digit of p? 3 Let s be 1(5 + -4 + 3 + -1). Suppose 418 = -f - h, -f + sh - 401 + 3 = 0. Let l = f + 690. What is the tens digit of l? 7 Suppose -5m + 9346 = -15974. What is the units digit of m? 4 Let z(m) = -675m - 401. What is the tens digit of z(-24)? 9 Let b = -76 - -80. Suppose bz = -5c + 4c + 287, -607 = -2c + 3z. What is the units digit of c? 9 Suppose -4b = 4p - 14164, 0p - 7076 = -2b - 4p. Let m be b/68 + 2/(-17). Suppose 15k + m = 487. What is the tens digit of k? 2 Suppose y - 3l + 6 = 0, 3y + 5l - 10 = -0l. Suppose 84 = n - yn. Suppose 18 = -u + n. What is the units digit of u? 6 Suppose 0z - 5 = 3r - 2z, 3r + 5z - 23 = 0. What is the tens digit of -1(r/3)/((-13)/14313)? 6 Let r be (-14)/8 + 2 + (-629)/148. What is the units digit of (166(-1)/r)/(5/10)? 3 Suppose 3h - 1 - 5 = -3z, -5z - 60 = -5h. Let g = h + 145. What is the tens digit of g? 5 Let u be (-55)/15 - 4/(-6). Let y be 84/(-147)(21/2)/u. Suppose 172 + 198 = yr. What is the units digit of r? 5 Let l = 13366 - 3669. What is the thousands digit of l? 9 Suppose 0 = 201n - 138673 - 1893327 + 342193. What is the hundreds digit of n? 4 Suppose 10g = -g - 2695. Let v = 443 + g. Let n = v + -96. What is the tens digit of n? 0 Let a(x) = 198x3 + 3x*2 + 5x - 21. What is the thousands digit of a(2)? 1 Let t = -49 - -51. Suppose -td = -3d + 4. Suppose 0 = i + 5r - 93, 0r + 334 = di + r. What is the tens digit of i? 8 Suppose 15r - 469314 = -2t, -9t = -4r - 14t + 125137. What is the units digit of r? 8 Let j = -5687 - -8509. What is the hundreds digit of j? 8 Suppose 0 = 50p - 16p + 22p - 1361136. What is the units digit of p? 6 Let b = -2732 - -5487. Suppose 5z = -5u + b, -70z + 69z - 5u + 551 = 0. What is the tens digit of z? 5 Let o(s) = 54s - 50. Let m be o(-3). Let f = m + 1246. What is the thousands digit of f? 1 Suppose 3u + 15h = 19h + 1477, 3u = 3h + 1473. Suppose 0 = -2b + 10, 6b - 9b - u = -2l. What is the units digit of l? 1 Let i = -10107 - -11256. What is the hundreds digit of i? 1 Suppose 0 = 2u + 4x - 6, -2u + 3 = x - 6. Suppose uf + 5k - 1130 = 0, 6f = 4*f - k + 450. What i	{ "pile_set_name": "DM Mathematics" }
4)/n)/n(-1/6) assuming n is positive. n(14207/120) Simplify ((l/l*(-2/7))/(ll/(l/l*2)l))/(((l(-2/15)/l)/l)/(l6/l))(l(-1/8)l(-4)/l)/((l/l(-2))/(ll/(ll/(l(-2/3)/l)))) assuming l is positive. l(-4513/840) Simplify (l*(2/5)/l)/(lll/(ll*1l))l2llll(1/2)lll*(-2)lll*(-3)l*(2/3)/llll(-5) assuming l is positive. l(17/30) Simplify (((vv(-4/5)v)/v)/v(-1/4))(1/13)/(vv(-2/7)vvvvv*(-6)/vvv/(v(1/9)vvvv)vv/(v(v*(1/10)v)/v)) assuming v is positive. v(11569/3276) Simplify (j(-2/21)jj(9/5))(-50)(j(-5)j(-2))/(j(-2/17)j(1/5)j) assuming j is positive. j(-255827/1785) Simplify o(4/5)/o*(-4)o/o*(-6/5)o/o*(-1)((((o(o/(o(-1/3)/o))/o)/oo)/o)/o(1/10))(-31) assuming o is positive. o(-877/30) Simplify (w(-6/11)/wwwww*3)/((w(w/w*(-1))/w)/www(-7)/ww)w(-1)w/(w*(3/7)w)w7/(w(-2)w) assuming w is positive. w(1234/77) Simplify (w(-1))*(-2/13)(w*(-3/2)w)/w(w/(ww*(3/5)/w))/w(w/w*(3/7)w(-2/9))(-8) assuming w is positive. w(-38819/8190) Simplify q5q(1/4)/q((qq(2/19))/q)/q(-6/5)((q0/q)/q)25/(((q*(1/6)q)/q)/q((q/(qqq/q4qqq))/qq)/q) assuming q is positive. q(-47437/1140) Simplify (rr*(-4)rr/(r/(rr/(r(1/2)/r))))(-35)(r(1/7)rr(-2/7))(2/25) assuming r is positive. r(-6101/350) Simplify ((ss*12/ss)/(s/s(7/2)))47(s/s0s)(1/41)/(s(-2/7)/s)(2/17) assuming s is positive. s(7110655/9758) Simplify (j*12/jj(-13)/j)(3/26)/((j2)28/(((j/(((j*4j)/jj)/j))/j)/j(-2/13))) assuming j is positive. j(-1565/26) Simplify (((v/(v(vv(-3)/v)/v))/v)/(v(-5)/v))19/((v/(v/(vv/v*(2/3)v)))*23v*(-8)v7) assuming v is positive. v(355/3) Simplify (t/(t/t*(2/5))t(-2/7))(-19)(t/t1t/(t/(t/(t/(t/t*7)))))/((t/(t(tt5t)/t))/t(1/12)) assuming t is positive. t(-877/420) Simplify (yy/y(3/8)y(-1))36((y(-6)/y)/(y/(y/((y/((y(1/8)y)/y))/y))))9 assuming y is positive. y(-315/8) Simplify ((n(1/4))0/(n*9n*(-1/4)))/(((nn*3)/n)/((nn/((nn(1/6)/n)/n))/n)(n*(-5)n)/n(-4/5)) assuming n is positive. n(-403/60) Simplify (((q*(-1)q)/q)29/(q(-1/2))(1/8))/(q(3/7)q(-3)(q/q(-1))(-11)) assuming q is positive. q*(-489/112) Simplify ((y/(y(y/(yy1)y)/y))/(y(-2/7)/y))33(yy*1y)*(1/24)/(yy(y/y5)/yy(-4)) assuming y is positive. y(4623/56) Simplify ((g/(g(g(-29/2)gg)/g))/(g(6/17)/g)g*(-41)g(1/50))(4/3) assuming g is positive. g(-45616/1275) Simplify ((n(-12)/nn)(-16/5)n(1/6)/n(-1/3))21 assuming n is positive. n(8169/10) Simplify ((rrrr(-15)r)/r)*(4/11)(rr(-3/4)/r)/r(10/3) assuming r is positive. r(-1115/132) Simplify (((x/((x(x/(x/x*(5/6)x))/x)/x))/x(-1/22))/(x(-3/7)x/(xx(2/11))))(-20) assuming x is positive. x(-13040/231) Simplify ((w1)(-21))18/((w*(-3)ww)/(ww(ww*5)/www)w/(w(w(w*(-2/3)/w)/w)/w)w/(w*7/ww)) assuming w is positive. w(-1094/3) Simplify (((l(-5/3)l)/l)/ll*(-4)l/(ll(-5))ll/(l(5/2)/ll))/((ll(-1/2))43)(6/17) assuming l is positive. l(-995/102) Simplify (((hhh(-12))/h)/h)(-35)/(h/h(3/5)h/(hhh*46/hh)) assuming h is positive. h(2333/5) Simplify ((c(-26)c(-1/6))/(ccc(4/5)c)25)(-17/2) assuming c is positive. c*(12359/12) Simplify (cc/c*(-9)cc/(cccc/c*(1/3)c)c)/((c(-1/4)/c)/c(3/7))((c*0c)(-4/3))(2/7) assuming c is positive. c(893/84) Simplify (s(-1/4)s(-2/3))32/((s(-1/8)/s)/ss*(-2/11)s)(-19/3) assuming s is positive. s(-9929/264) Simplify (f*(1/26)/(f/(f/(ff*(-13/3)f)))f(-27)f28)(1/6) assuming f is positive. f(263/468) Simplify (((g(-1))*(-2/9)g(gg*5/g)/gg(4/3)/g)20)(-4/19) assuming g is positive. g(-4000/171) Simplify ((r*0r)22/(r(-1/4)/(r*(-3)r)))/(r*1/rr*6rr3/rr*1rr) assuming r is positive. r(33/4) Simplify (k7k*17/kkk(-3/5)kkk/(k*17/kk))8 assuming k is positive. k(376/5) Simplify ((a9/(a(-3/2)/a))/(((aa(-1/4)/a)/a)/a(-3/5)))/((a(1/3))(-1/6))(6/25) assuming a is positive. a(3649/300) Simplify (mm/m*(-5/8)m*(-1/8)(mmmm(2/5)/mmm)(-1/2))(-9/4) assuming m is positive. m(-27/40) Simplify ((z(-19)zz)(-5)z*(-42)z19)(-8) assuming z is positive. z(-496) Simplify (w(-5/6)/(w/w(-11)))(1/19)((w(4/9)w)/w(2/9))(-29) assuming w is positive. w(-12353/342) Simplify ((u(-2)/u*(-6/11))/(uu*6uu/u2))/((u(1/2))(-15)/(u1)(-23)) assuming u is positive. u(-527/22) Simplify (((o/(oo*0)oo(-1/6))/(o0/(((o(2/3)/o)/oo)/o)))(-44))49 assuming o is positive. o1078 Simplify ((p11p)/p(-1/7))(-2/59)/((p(-2/19)p*(-2/9)p)/(((((p*6pp)/pp)/p)/p)/(p(p/((pp/(p/(p/(pp2)p)))/p)pp)/p))) assuming p is positive. p*(64681/70623) Simplify (pp*(-6)ppp*0p*(-2/3)p/(p(p(1/4)/p)/pp))/((pp/(p/(p/(p(2/9)/p))))/(p/((p(-2/7)/p)/p)))(-4/19) assuming p is positive. p(-14477/4788) Simplify (p6p)/(pp/(((p(pp(-3/5))/p)/p)/p))p(-5)/(p/p(3/8))p/p(-1/6)p*(2/7)/p(p(-1/4))(-30) assuming p is positive. p(4811/840) Simplify ((w3w/w(-1/10))/((w/(w/w(-2/5)))/w4))24 assuming w is positive. w204 Simplify (c(-1)ccc3)(-29)((c(4/5)/c)/(c/(c/(((c(-1/2)/c)/c)/c))))(-1/11) assuming c is positive. c(-1163/10) Simplify (jj*5j/(j(5/4)/j))(-6)/(j/j*7j(-1/6))(-20) assuming j is positive. j*(-983/6) Simplify (((vv*13)/vvv)/vv(-10/7))(-38)(v/(vv(-2)))(-1)vv*3v(-8) assuming v is positive. v(-3386/7) Simplify (n(-8))(-2/9)/(nn(-19)nn1n) assuming n is positive. n(151/9) Simplify ((z/((z3z)/z))/zz/(z*(2/25)z))/(z(4/5)/z(1/7))(z(2/5)/(zzzz/z(-1)))/(z(4/5)/z(-4)) assuming z is positive. z(-2299/175) Simplify (i/i*(3/4)i*(1/4)(i/(i/(i/i(-5))))/(i/i6))/((i/(i/i(3/4)))/i(-2))41 assuming i is positive. i(-405/4) Simplify (y*30((yy/(y6/y))/y)/yy/((yy(-2/29))/y)yy(-1/2))(-12/11) assuming y is positive. y(-9246/319) Simplify ((r(-1)/r)23/((r/(rrrr*5/rr)r)/(r(-1/3)r)))/((r*(3/4)rr(-2))/(r/r(-1/2))(-1/9)) assuming r is positive. r(-157/4) Simplify (z12zz(-18)/zzzz(11/4)/z18)1 assuming z is positive. z(-77/4) Simplify ((y12)(-7/3)(y/((y/y(-18))/y))(-45))(1/12) assuming y is positive. y(737/12) Simplify ((g(-20)g)/(g*(1/13)/g))/(g/(g/((gg*(1/12)gg)/g))(g*(-43)gg)/gg) assuming g is positive. g*(3251/156) Simplify (qq*(3/5)/qq/((q/(q(q/q(-10)q)/qq))/q)qq25qqqq11)(3/7) assuming q is positive. q(117/5) Simplify (((v/v(-3))/v(v/v(1/4))/v)/((v(7/6)/v)/(v(-2/11)/v)))40 assuming v is positive. v(1850/33) Simplify ((n(2/7))(-16/3))(-6)/((nn6n(-2))/(n(3/8)/((n/(nn1))/n))) assuming n is positive. n(365/56) Simplify (g(2/3))(-43)(g(1/4))(-13/5)((g(1/3)/g)(-25))(2/37) assuming g is positive. g(-63083/2220) Simplify (d(-39)d)*(-28)(dd23)(-1) assuming d is positive. d1040 Simplify ((q/(q/(qq/q(-6))))/q(4/7)(q/(qq((q(2/7)q)/q)/q))(12/5))/((q2/q*(-3/4))/((qq*3)/((q/(qq*(2/15))q)/q))) assuming q is positive. q*(3413/420) Simplify (((h/(h((h*(-1/3)h)/h)/h))/h)*7(h*(-1/3)hh)(-9/8))(-1) assuming h is positive. h(-11/24) Simplify ((n1)(-36)n*7nn(2/7))/((n(-2/21)n)/n*0(n0)(-42)) assuming n is positive. n(-601/21) Simplify (y(2/9)y(-1)y)*(-37)(((y/y*(-1))/y)/(yy*(2/9)y))/(y/((y(y(-2)/y)/yy)/y))(1/47) assuming y is positive. y(-4031/423) Simplify (((q/q*12)/qqq17)/(q(-1/3))(4/3))21 assuming q is positive. q(406/3) Simplify (t/(t/(t/(t(-2/7)/t)))tt5)(-1/35)((t/(t/(tt/(t(-2/7)t))))/t)(-24)/(t0/t(-1/3)) assuming t is positive. t(-5459/735) Simplify ((d(3/7))33/(d(dd/(d*1/d)d)/d)(-44))(-21) assuming d is positive. d*(-3069) Simplify (((mm/((mm(-1/17))/m))/m)(-47)/(m(-2/5)/m)(-21/5))(-1/6) assuming m is positive. m(7883/850) Simplify ((n/n(2/11)nn(8/5)n(1/19)/(((n(1/3)*n	{ "pile_set_name": "DM Mathematics" }
Simplify (-2sqrt(180) - sqrt(180))2 + ((3sqrt(220))/sqrt(11))*2 + sqrt(20) - (-5 + -5((1 + sqrt(320))-3)2). 722sqrt(5) + 16250 Simplify -3(sqrt(175) - sqrt(175)4-1) + (2-5((sqrt(175) - sqrt(175)3) + sqrt(175)))*2 + 4. -75sqrt(7) + 17504 Simplify (((sqrt(330)-1 + sqrt(330))-4 - sqrt(330))/(-4sqrt(40)))/((sqrt(22) + (sqrt(22) - (-2sqrt(110))/sqrt(5)))/(1sqrt(2)3)). 3sqrt(3)/32 Simplify -6-2(-2 + (sqrt(363) - (sqrt(363) - (sqrt(363) - -3sqrt(363)))) + 5(0 + sqrt(3) + 4)). 216 + 588sqrt(3) Simplify (546(sqrt(1782) - sqrt(1782)1))/(((sqrt(264)1)/sqrt(11))/sqrt(12) + -2(sqrt(10)/(sqrt(20)/sqrt(4)) - sqrt(2))). 0 Simplify (sqrt(18) - 1sqrt(36)/sqrt(2))/(sqrt(600) + (sqrt(600) - 1sqrt(600))) - (sqrt(33)/(sqrt(11) + sqrt(99)) + 4 + sqrt(21)/(sqrt(700)2)). -4 - 3sqrt(3)/10 Simplify ((sqrt(76)3 + sqrt(76))2-2 + -4 + ((sqrt(76) + 0)*2 + 0 - 4(1 + sqrt(76))))-1. 8sqrt(19) + 2364 Simplify (-4(-2 + sqrt(44)/sqrt(4) - (-4 + sqrt(11) + -1)) + 4(sqrt(99) - (-5 + sqrt(99) + 0 + sqrt(99))))*2. -192sqrt(11) + 1648 Simplify ((sqrt(4320) - -2sqrt(4320)4)-5)/(2(sqrt(4840) + sqrt(4840) + -1sqrt(4840))). -135sqrt(3)/11 Simplify (6(-1 + 2(2 + -2sqrt(1216) + sqrt(1216) - sqrt(1216)) + -2sqrt(1216)-1-5))*25. -120960sqrt(19) + 42902100 Simplify -1 + 2 + 1 + -3 + ((sqrt(3400)2 - sqrt(34))/sqrt(2))*2 + 2. 6138 Simplify (3 + (sqrt(26) - (sqrt(1274) + sqrt(1274)-2))/(sqrt(2) + -1sqrt(128)) + 3 + -5)2. -16sqrt(13)/7 + 881/49 Simplify (51sqrt(110)-1-4)/((2sqrt(320))/(((sqrt(72) - sqrt(8)) + sqrt(8))/sqrt(4))). 15sqrt(11)/2 Simplify -4((1 + sqrt(1331) + 1)2 - ((-2 + sqrt(1331) + 2)2 + sqrt(1331) - sqrt(1331))) + 2 + 0. -176sqrt(11) - 14 Simplify (sqrt(84)/sqrt(768) + (sqrt(77)-5 + sqrt(77))/sqrt(11) + sqrt(7) + (sqrt(112) - sqrt(7)) + 1 + 3sqrt(7)2)2. 49sqrt(7)/4 + 16871/64 Simplify (5(sqrt(2448) + -2 + 0 + sqrt(2448)) + -4-2sqrt(2448) + sqrt(2448) + sqrt(2448) + -5 + sqrt(2448)-2 + sqrt(2448))*2-32. -5303718 + 41040sqrt(17) Simplify 5(sqrt(450) + (2(0 + sqrt(450)) - sqrt(450)) + 5 - ((sqrt(150)/sqrt(12) - sqrt(50))2 + (sqrt(200) - (sqrt(200) + -1)2))). 1935/2 Simplify 1(1sqrt(1872) + 2 + sqrt(1872))*2 - (sqrt(52)/sqrt(4) + -5 - -4(sqrt(91)/sqrt(7) + sqrt(13) + sqrt(13)))*2. 226sqrt(13) + 5270 Simplify 3 + (1 + ((-5sqrt(325) + sqrt(325))2 - sqrt(325)) - (-5sqrt(325)2)2) + 4. -27292 - 5sqrt(13) Simplify 1 + -3(-5 + 0 + (-4sqrt(297)/sqrt(9))/(sqrt(162)/sqrt(6))). 4sqrt(11) + 16 Simplify (-2 + 0 + (-1 + sqrt(180) - sqrt(180)) + -5 + (sqrt(385)/sqrt(112))/(sqrt(121)/sqrt(176)))2. -16sqrt(5) + 69 Simplify 0 + ((sqrt(768) + 5(4 + sqrt(768)) - ((sqrt(768) + 0)3 + sqrt(768))) + 1)*2. 1344sqrt(3) + 3513 Simplify (4((sqrt(1274) - (sqrt(1274) - sqrt(1274)-35)) + sqrt(1274)))/((sqrt(900)-2)/sqrt(2)). 196sqrt(13)/15 Simplify ((((sqrt(252)-1 + 2)5 - (-1 + (sqrt(252) + 0 - sqrt(252))1)) + -5)3)2. -3240sqrt(7) + 57024 Simplify 2(5((2 + 5sqrt(128)-1 + -4)-2 + 0))2. 32000sqrt(2) + 640800 Simplify ((sqrt(396)-4)/(sqrt(324)/sqrt(9)) + (6sqrt(198))/((-1sqrt(10) - sqrt(10))/sqrt(5)))2. 1859 Simplify (sqrt(30)/(sqrt(27) - sqrt(3)))/(sqrt(6)/(sqrt(9)/sqrt(3))) - (sqrt(15)/(sqrt(108) - (sqrt(108) - -1sqrt(108)) - sqrt(108))1)2. -5/144 + sqrt(5)/2 Simplify (sqrt(156) + 1sqrt(156)2 - ((-1sqrt(156) + sqrt(156))6 - sqrt(156)))/(sqrt(144)/(sqrt(432)-5 + sqrt(12) - sqrt(12))). -120sqrt(13) Simplify ((-1sqrt(132)-3 + sqrt(132))/((-2sqrt(33))/sqrt(3)))/((-1sqrt(384) + (sqrt(6) - sqrt(6)-1-5))-2). -sqrt(2)/12 Simplify 4(4(-1 + 1sqrt(11)) + (sqrt(77) - 3(sqrt(77) + sqrt(77)1 + sqrt(77) + sqrt(77)))/sqrt(7))66. -1008sqrt(11) - 576 Simplify (-2(4 + sqrt(22)/sqrt(2)-6) - -2((sqrt(44))25 + -2)) + -1. 12sqrt(11) + 427 Simplify ((-551sqrt(150))/(1sqrt(300)6 + sqrt(300) + sqrt(300) + -5-2sqrt(300)) + 0)*2. 625/648 Simplify ((((sqrt(264) + 31sqrt(264) - sqrt(264)) + sqrt(264))/(sqrt(8) + (4sqrt(72) - sqrt(8) - sqrt(8))))/(-62sqrt(1100)))*2. 1/36300 Simplify ((3sqrt(750) - 3(sqrt(30) + sqrt(750)))/(2sqrt(150) - 2sqrt(24)))2 + 2. 13/4 Simplify ((sqrt(357) - (sqrt(357) + sqrt(357)-2)4)/(-1sqrt(7)-4))/(11sqrt(3) + 3sqrt(432)). 5sqrt(17)/148 Simplify (2sqrt(3168)-2 + sqrt(3168) - sqrt(3168))/((sqrt(216)/sqrt(12) - sqrt(2)) + 3(sqrt(2) + sqrt(4)/sqrt(2) + sqrt(2))) + -4 + 4. -48sqrt(11)/11 Simplify ((-1 + ((sqrt(99) - (sqrt(99) + (sqrt(99) - (sqrt(99) + -1) - sqrt(99))))-2 + sqrt(99) + sqrt(99) - (1 + sqrt(44) - (sqrt(11) + 1 + 2))))-2)2 + 1. -24sqrt(11) + 81 Simplify (sqrt(1715) - (sqrt(1715) - sqrt(1715)1-2) - -43sqrt(35)-1)/(sqrt(567)3 + (sqrt(56)/(sqrt(16)/sqrt(2)) - 3sqrt(28))). -13sqrt(5)/11 Simplify ((sqrt(7) + sqrt(70)/sqrt(40) - (5 + 2sqrt(7)))2 + (-2sqrt(112)3)2)2. 10sqrt(7) + 16235/2 Simplify -6(-4 + sqrt(20) + ((sqrt(500))*2 - sqrt(20)) - sqrt(20)) - 4sqrt(30)/(-2sqrt(6))-1. -2976 + 10sqrt(5) Simplify ((-4 + -3sqrt(288)-1 - (3 + (-1 + sqrt(288) - sqrt(288)) + 4))6)*2. -25920sqrt(2) + 96912 Simplify 3((sqrt(1575)1)/(-6sqrt(45)/sqrt(5)) - ((sqrt(154)/sqrt(11))/sqrt(2) + sqrt(7) - ((sqrt(28))2 + sqrt(7) + -3))). -11sqrt(7)/2 + 75 Simplify -4 + (4-1sqrt(34) + sqrt(102)/sqrt(12))/(sqrt(18)/(sqrt(9)2 + sqrt(9)) - sqrt(10)/(-1sqrt(5))). -21sqrt(17)/8 - 4 Simplify -2(sqrt(240)/sqrt(4)1 - sqrt(60))/sqrt(12)-3 + (-5(-1(sqrt(320) + sqrt(320)1) + 1 + sqrt(320) + 1))2. -800sqrt(5) + 8100 Simplify ((sqrt(120) - (sqrt(120) - sqrt(120)-1-5))/(1sqrt(4)3))/(-52sqrt(360)-5). sqrt(3)/180 Simplify (-12sqrt(70)36)/((sqrt(90) - (-1(sqrt(90) + sqrt(90) + sqrt(90)2) - sqrt(90)))/(sqrt(576) - sqrt(9))). -42sqrt(7) Simplify (3(3 + sqrt(612) + (sqrt(612) + -1)5 + 2) + 5)4. 20 + 432sqrt(17) Simplify 3 + -5(24(sqrt(1008) + 1 + sqrt(1008) + -5) + 2 + -3sqrt(1008) + sqrt(1008) + 6(-2 + sqrt(1008)))2. -2024817 + 100800sqrt(7) Simplify (sqrt(80)/sqrt(4)-4 - (sqrt(20) - 1sqrt(20)4 - sqrt(20)))/((sqrt(144) - sqrt(144)2) + 1(sqrt(4) - sqrt(40)/sqrt(10))). 0 Simplify (-4(sqrt(121) + -2sqrt(121))-2)/(-3(sqrt(99) - sqrt(99)3))-6. 8sqrt(11)/3 Simplify ((4(sqrt(85) + (-2sqrt(85) - sqrt(85))) - sqrt(85))-51)/(sqrt(45)/sqrt(144) + -5(sqrt(5) - sqrt(35)/sqrt(7))). 180sqrt(17) Simplify (-3 + -3 + (-4 + 0 + sqrt(300) - (3 + sqrt(300)-1)) + 5)2 + 5. -320sqrt(3) + 1269 Simplify ((sqrt(1980) + sqrt(1980) + sqrt(1980)-2 + sqrt(1980))4)/(sqrt(99) - 6sqrt(99)-5 - sqrt(99)). 4sqrt(5)/15 Simplify ((sqrt(242)3 - sqrt(242))35 + sqrt(16)/(sqrt(8) + 4sqrt(88)/sqrt(11) + sqrt(8)) + -5)2 + -1. -9905sqrt(2)/3 + 3924793/18 Simplify (-3 + 3(5(sqrt(432) + 1) + 2 - (sqrt(300) + (sqrt(300)-2 + 1 - sqrt(300)) + 0)))2. 7200sqrt(3) + 173025 Simplify 5 + -5 + (3 + 5-2sqrt(50) + (sqrt(800) - (sqrt(800) + sqrt(800) + sqrt(800)2 + sqrt(800) - sqrt(800) - sqrt(800))))2. -540sqrt(2) + 16209 Simplify ((1sqrt(75)3-5 + (-5 + sqrt(3)1 - (1 + sqrt(192))))-5)2. 24600sqrt(3) + 505200 Simplify (0 + sqrt(500) + -2)3 - ((sqrt(1280) + sqrt(20))2 + sqrt(35)/(sqrt(343) - sqrt(7))). -1626 + 179sqrt(5)/6 Simplify (-4(sqrt(99) - sqrt(99)5) - sqrt(99) - 5sqrt(99)5)/((sqrt(90) + -2sqrt(90)-5)/(sqrt(10) + (-1sqrt(10) - sqrt(10))3)). 50sqrt(11)/11 Simplify (-3 + 2 + (-4(sqrt(264) - (sqrt(264)-5 - sqrt(264))))/(sqrt(6) + (sqrt(6) - (sqrt(54)/sqrt(9)6 + sqrt(6) - sqrt(6)))))*2. -28sqrt(11) + 2157 Simplify ((sqrt(17) - (3 + sqrt(17))) + 2 - sqrt(102)/sqrt(6)6)1 + 3 + -2sqrt(2448) + -5 + sqrt(612). -24sqrt(17) - 3 Simplify (0 + -4(-6(5 + sqrt(475)) + sqrt(475) + 2)-6)2. 806400sqrt(19) + 7291584 Simplify ((sqrt(2448) - ((sqrt(2448)-3 - sqrt(2448)) + sqrt(2448) + sqrt(2448)))-3 + 3sqrt(2448)-1)*2 - ((sqrt(2448) - (3 + -2sqrt(2448))*2) + 3 + 5). -156sqrt(17) + 362305 Simplify (-4(sqrt(720) + (sqrt(720) - 2(1sqrt(720) + sqrt(720)))))/((3sqrt(8640) + sqrt(8640) + sqrt(8640))/(sqrt(150)3)). 12sqrt(2) Simplify (sqrt(2816)-1 + sqrt(132)/sqrt(3)1)/(32sqrt(400)2). -7sqrt(11)/120 Simplify 3(-4((sqrt(567) + -4)5 - 4sqrt(567)-3))2-1. -7884624 + 293760sqrt(7) Simplify (sqrt(1666) + (sqrt(1666) - 4sqrt(1666) - sqrt(1666)	{ "pile_set_name": "DM Mathematics" }
)/(-1)10/m. Suppose -6a + 3a + 2v + 30 = 0, -2v - 50 = -5a. What is the greatest common factor of r and a? 10 Suppose 2d + 0c + 3c = 12, -17 = -d + 4c. Let y = -4 + 9. Suppose yv - 405 = 3x, -4x + 324 = 3v + v. What is the highest common factor of d and v? 9 Let s(m) = -m*3 + 15m*2 + 12m - 24. Let l be s(15). Calculate the highest common factor of 12 and l. 12 Suppose -27m + 2z + 16 = -25m, -4m + 2z = -28. Calculate the highest common factor of m and 678. 6 Suppose -3l + 29 = 5. Let m be l/(-20) + 27/5. What is the highest common divisor of 45 and m? 5 Let s(y) be the first derivative of y*3/3 + 4y*2 + 14y + 1. Let q be s(-6). Let p be (1/(-3))/(q/(-6)). What is the greatest common factor of p and 3? 1 Let d be (-94)/(-7) + -6 + (-39)/(-7). Suppose x + 348 = dx. What is the highest common divisor of x and 116? 29 Suppose 4p + 541 = 4o + 3p, 4o - 5p = 529. Calculate the highest common factor of o and 238. 34 Let x be 4/(-2) + 1 - -29. Suppose -4a = -2d + 3d - 59, -3a = d - 45. What is the greatest common factor of a and x? 14 Suppose -12 = -4l, 0 = -2p + 3p + 3l - 75. What is the greatest common factor of 726 and p? 66 Let l(t) = t*3 - 6t*2 + 5t + 10. Let q(x) = -x*3 - 6x*2 + 5x - 9. Let r be q(-7). Let i be l(r). Calculate the highest common divisor of 15 and i. 5 Suppose l = -4p + 24, -2l + 21p - 23p + 66 = 0. What is the highest common factor of l and 288? 36 Suppose 1489 = 3d + 1225. What is the highest common divisor of d and 616? 88 Suppose 9 + 2 = d. Suppose 3k = -23 + 386. Calculate the highest common divisor of d and k. 11 Suppose -4z = -4h - 100, -99 = -23z + 19z + 3h. Calculate the highest common factor of z and 184. 8 Let u(c) = -15c + 395. Let k be u(10). What is the highest common divisor of k and 35? 35 Suppose -35 = -s + u - 6, 0 = -5s - u + 121. What is the highest common divisor of s and 325? 25 Let t be (53 - 2) + (6 - 8). Let a = 74 - t. What is the highest common divisor of a and 50? 25 Let h be 2 - -7((-2064)/(-14))/4. Suppose -8k = 12k - h. What is the greatest common factor of 286 and k? 13 Let j(d) = d*2 + 15d - 20. Let u be j(-16). Let z be (-6 - (0 - u))18/(-15). What is the greatest common factor of z and 20? 4 Suppose -2p + 104 = 4k - 5p, 0 = -2k + 5p + 38. Suppose -3j - 24 = 27. Let s = k + j. What is the highest common divisor of 18 and s? 6 Let r(v) = v3 + 6v*2 + 5v - 2. Let w be r(-5). Let a = 0 - w. Suppose -ab + 50 = -b. Calculate the greatest common divisor of 10 and b. 10 Suppose 5g - 105 = -5b, -3g + 95 = 3b + 2b. Let a(x) = x + 8. Let w be a(-6). What is the highest common factor of w and b? 2 Let k be 4/(8/4)16. Let f = k - 23. What is the highest common factor of 99 and f? 9 Let d be ((-18)/24)/((-2)/(-16)). Let s(h) = h2 + 4h + 2. Let c be s(d). What is the greatest common factor of c and 14? 14 Let x(h) = h*3 + 16h*2 - 15h + 49. Let l be x(-17). Suppose -19 = 5s - 169. What is the greatest common factor of l and s? 15 Let z = 263 - 214. What is the greatest common factor of z and 7? 7 Let m = -99 + 358. Calculate the greatest common divisor of m and 7. 7 Let d(m) = m2 + 2m - 4. Let i be d(-3). Let y = i + 7. Suppose 4s - 47 = z, -2s + 22 = -yz + 4z. What is the greatest common factor of s and 12? 12 Suppose 0 = 2j + 34s - 31s - 783, 0 = 5j + s - 1925. What is the greatest common factor of j and 6? 6 Let x = 1 + -2. Let a be x - (-1)/(2 - 177/89). What is the greatest common divisor of 11 and a? 11 Suppose 25g = 16g + 216. Let t(m) = -3m + 6. Let l be t(-6). What is the greatest common divisor of l and g? 24 Let o = -12 + 32. Let y = -9 + o. Let l = -103 - -136. Calculate the greatest common divisor of l and y. 11 Let o(i) = -4i*2 + 2i*3 - 3i3 + i2. Let d be o(-3). Suppose -t - 4 + 79 = d. Calculate the highest common factor of t and 50. 25 Suppose -51u - 2499 = -58u. Calculate the highest common factor of u and 21. 21 Suppose 0 = 3z - a - 44, -2z = -13a + 9a - 36. What is the greatest common divisor of z and 14? 14 Suppose 2r - 3 = 5. Suppose 4h - 3y = -0y, h = 5y. Let f = h + r. Calculate the highest common divisor of f and 20. 4 Suppose 0 = -30g + 37g - 294. Calculate the greatest common factor of g and 266. 14 Suppose -1074 = -34j + 3516. Calculate the greatest common factor of j and 81. 27 Let r be 6/211. Let b(c) = -4 - 1 - 2c + cr + 4c*2 + 0c*3 + 2c2. Let l be b(-6). Calculate the highest common factor of l and 21. 7 Let q(w) = -w3 - 4w2 - 2w - 6. Let i be q(-4). Suppose -iu - 4 = -4u. Let f be u + 15 - (-2 - -1). What is the greatest common divisor of 72 and f? 18 Suppose 0 = -2g + 21 + 49. Let n be 357/(-34)2/(-3). Calculate the greatest common divisor of g and n. 7 Let x(m) = -m*3 - 17m*2 - 49m - 13. Let u be x(-14). Calculate the greatest common factor of u and 17. 17 Let m = -4 + 10. Let x be (-12)/(-36) + 214/m. Let i be ((-1)/(-2))/(1/x). What is the highest common divisor of i and 2? 2 Let q = 25 - 25. Suppose 0 = -qz + 4z - 12. Suppose -zg + 364 = 34. Calculate the greatest common divisor of g and 44. 22 Let l be 408/9 - 24/72. What is the greatest common divisor of 81 and l? 9 Suppose 3a - 5c - 235 = 0, -2a - a = 5c - 215. Suppose 0 = 3k - 160 - 8. Let w = k - 26. Calculate the greatest common factor of a and w. 15 Let c = 96 - -8. Calculate the highest common divisor of c and 13. 13 Let k = 129 - 72. Let a = k + -52. Let n = 50 - 35. Calculate the greatest common divisor of a and n. 5 Let u(l) = 2l2 + 10l + 21. Let t be u(-5). What is the highest common divisor of 30 and t? 3 Let z(l) = l*3 + 12l*2 - 5l - 17. Let u be z(-12). Suppose 3y - u + 10 = 0. Let t = 28 - 6. What is the highest common factor of t and y? 11 Let h = -206 + 582. Suppose 2z - 3z + 84 = -2m, -5z - m + h = 0. What is the greatest common factor of z and 19? 19 Let l = -156 - -170. What is the highest common divisor of 301 and l? 7 Let a be 21/(-28) - 5/4. Let u be (a + 2 - 0) + 8. Let r(h) = h3 - 2h*2 + 2h - 3. Let n be r(2). Calculate the greatest common factor of u and n. 1 Let q be (0/2 - 1)2. Let w = -2 - q. Suppose 3y - 551 + 23 = w. Calculate the highest common factor of y and 16. 16 Let s(c) be the second derivative of -10c3 + 6c*2 + 42c - 2. Let w = -7 - -3. Let f be s(w). Calculate the highest common divisor of 36 and f. 36 Let b = -1028 - -1055. What is the greatest common divisor of 117 and b? 9 Suppose 45c - 55c + 7680 = 0. What is the highest common factor of 36 and c? 12 Suppose 2s = 2z - 3z - 116, 2s - z = -116. Suppose -g = 2, c - 4g - 43 = -3g. Let w = c - s. Calculate the highest common divisor of 9 and w. 9 Let w be (-604)/(-24) + (-13)/78. Calculate the highest common divisor of 625 and w. 25 Suppose 34 = -2k + 66. Suppose 5g - d - k = 2, d = -5g + 22. What is the highest common divisor of 4 and g? 4 Let w = 469 - 466. Calculate the highest common factor of 753 and w. 3 Let m = -275 + 295. Calculate the highest common divisor of 100 and m. 20 Suppose -7 + 26 = s - 5u, -2s + 4u + 26 = 0. Suppose m - 3 = v - s, 0 = -4v + m + 30. Calculate the greatest common divisor of 32 and v. 8 Let a = 178 - 148. Calculate the greatest common divisor of 25 and a. 5 Let t be 3 - (-4 + -23 - -3). Let h = t - 21. Suppose -7w + hw + 102 = 0. Calculate the highest common divisor of 34 and w. 34 Let s(f) be the second derivative of -7/2f*2 - 3f + 0 - 4/3f3. Let y be s(-2). What is the highest common factor of y and 6? 3 Let h(s) = 3 - 4s*3 - 2s*3 + 0s*3 + 5s*3. Let m be h(4). Let p = 99 + m. Calculate the highest common divisor of p and 57. 19 Suppose 4m + 5g - 9 = 155, -5m = -4g - 164. Let h = 22 - 18. What is the highest common factor of m and h? 4 Let m = -106 + 214. Calculate the highest common factor of 162 and m. 54 Suppose 5b + 5a = 225, 2b + 5a - 49 = 56. What is the highest common divisor of 8 and b? 8 Let z be (-7715)/(-7) + (-15)/105. Calculate the greatest common factor of z and 19. 19 Let o be ((-5)/(10/(-6)))/(-1) - -6. Calculate the greatest common divisor of o and 31. 1 Suppose 4p - 456 - 1404 = 0. Calculate the highest common factor of 45 and p. 15 Suppose 0 = -6i + 22	{ "pile_set_name": "DM Mathematics" }
prime factors of q. 7, 29 Suppose 2m = -2i + 21100, -3m + 9516 = 4i - 32679. What are the prime factors of i? 3, 5, 19, 37 Suppose 2r - 14 = -f, -11r = -3f - 6r - 13. List the prime factors of (4 - 6)/(f/(-302)). 151 Let i = 44 + -53. Let r = -7 - i. Suppose -4h = -f + 47, 0f + h - 130 = -rf. List the prime factors of f. 3, 7 Suppose 5x = -3f + 19, 3 = 4x + 3f - 11. Suppose 3l = l + xv + 1730, -5l + 4v = -4291. List the prime factors of l. 3, 5, 19 Suppose 88021 + 340094 = -595t + 610t. What are the prime factors of t? 28541 Let n(q) = -q3 - q2 - 71q + 244. List the prime factors of n(-32). 2, 3, 5, 571 Let f(g) = -31g + 44. Let s = 250 + -256. List the prime factors of f(s). 2, 5, 23 Let m(g) = 101g - 5405. List the prime factors of m(70). 3, 5, 37 Let q = 109 + -89. Suppose 6v - qv = -1260. What are the prime factors of v? 2, 3, 5 Let c(m) = -2489m3 - 2m*2 - 73m - 142. What are the prime factors of c(-2)? 2, 3, 7, 79 Let b(l) = -13l - 18. Let a be b(-3). Let z be (a/6)/7412. Let k = -119 + z. What are the prime factors of k? 3, 29 Let y = 268 + -273. Let x(g) = -3g2 - 22g. List the prime factors of x(y). 5, 7 Suppose u - 84 = -u. Let s = -39 + u. Suppose sk + 16 = 4k. What are the prime factors of k? 2 Let a = 47 - 49. Let f be -14390 + 16/(-7 + 3). List the prime factors of f/(-52) + a/4. 2, 3, 7 Let u(p) = 6p*2 - 54p + 33. What are the prime factors of u(-11)? 3, 11, 41 Let r(p) = p*3 - 16p*2 + 26p + 17. Let n = 20 - 5. Let g be r(n). Suppose -5y + 3y + g = 0. What are the prime factors of y? 7, 13 Suppose 5k - 2160 = -21j + 19j, -2j = 2k - 858. Let m = k + 100. What are the prime factors of m? 2, 3, 89 Suppose -2w - 836g + 838g + 14614 = 0, 0 = 2w - g - 14618. What are the prime factors of w? 3, 2437 Let h be (3/4)/((-10)/(-120)). Let l(n) = -53 - n + hn + 2n. What are the prime factors of l(6)? 7 Let j(i) = 7 - 6 - 22 + 5i. Let w be j(5). Suppose 10 = -2v - 0v, v = wn - 385. What are the prime factors of n? 5, 19 What are the prime factors of -14272/(-357)(74250/(-8))/(-5)? 2, 3, 5, 11 Let n be -48((-4)/22 - (-39)/33). Suppose 5s + 5f = 55, 2s - f - f = 18. Let h = s - n. What are the prime factors of h? 2, 29 Let w(l) = -35l*3 - 2l*2 + 34l + 82. What are the prime factors of w(-3)? 907 Let y = -368 - -1478. Suppose 3d - 2x - y = 0, 2d + 3x + 0x = 753. List the prime factors of d. 2, 3, 31 Suppose -2q = 5j - 10, 0 = -2q + 3j - 6. Let r be 2/2-1q. Suppose 2a + 32 + 23 = 5k, r = 3a - 15. List the prime factors of k. 13 Suppose -20840 + 170202 = 23h. List the prime factors of h. 2, 17, 191 Let n = -13523 - -19466. What are the prime factors of n? 3, 7, 283 Suppose -r = -4j - 13433, -5j = 39 - 34. List the prime factors of r. 13, 1033 Let y = 231 - 227. Suppose yk = k + 2454. What are the prime factors of k? 2, 409 Let m(z) = -520z - 1592. What are the prime factors of m(-64)? 2, 17, 233 Let z(v) = -v3 - 12v*2 + 2v - 5. Let k be z(-9). Let w be 3/(2/49/(-21)). List the prime factors of k/w14. 2, 19 Let x(a) be the first derivative of -a4/4 - a3/3 + a2 + 7a + 64. What are the prime factors of x(-2)? 7 Suppose -5d + 10 = -0. Let n(h) = -h3 - 16 + 89h*d - 20h + 93h2 - 192h2. What are the prime factors of n(-10)? 2, 23 Let u(c) be the second derivative of c5/20 + 5c4/6 + 13c*3/6 + 11c*2 + 8c. Let l be u(-9). List the prime factors of l/(-21)474/4. 79 Let y be (8/((-32)/(-6)))/((-6)/(-556)). Suppose 1693 = 2t + y. Suppose t = 4r + 181. What are the prime factors of r? 149 Suppose -41x = -31x - 1220. Suppose -f = -253 - x. What are the prime factors of f? 3, 5 Suppose 5p + 714 = -5h - 481, -2p = -h - 242. Let y = h + 344. What are the prime factors of y? 2, 13 Let x(b) = -32b - 16 - 45b + 91b - 37b. List the prime factors of x(-30). 2, 337 Suppose -12 = -2f - 4o, 4f + 0 = 3o + 2. Suppose -320 = g - 3g + fk, -4g + 638 = -5k. Suppose 9w = 10w - g. What are the prime factors of w? 2, 3 Let m(r) = -33r + 56. Let s be (-2)/10-4 - (-6216)/(-370). What are the prime factors of m(s)? 2, 73 Let r = 294 - 162. Let q = r + -124. What are the prime factors of q? 2 Let v(s) = 94s3 - 6s*2 - 5s + 7. Let d be v(3). Suppose -1460 = -3r + d. List the prime factors of r. 2, 41 Suppose 5p - 4o = 44, -8o = p - 11o. Suppose 2y = -py + 16156. List the prime factors of y. 2, 577 Suppose 4w - 13 + 967 = 3g, 4g + 8w = 1192. What are the prime factors of g? 2, 5, 31 Let q = -2354 + 13060. List the prime factors of q. 2, 53, 101 Suppose -254 = 8y + 258. Let d = y - -104. What are the prime factors of d? 2, 5 Suppose 5w = 5d + 55, 0w - 5d = -w + 7. Let n(h) = 2 + 1 + 13h + 4 - w. What are the prime factors of n(12)? 151 Suppose -11y = -10y - 4b - 5104, 5y = 3b + 25384. List the prime factors of y. 2, 317 Suppose -2t - 33950 = -k, -2k + 2t + 27824 + 40076 = 0. List the prime factors of k. 2, 5, 7, 97 Let u(h) = h2 + 7h - 37. Suppose -2d = -0 - 10. Let y be -15-5((-16)/d + 3). List the prime factors of u(y). 83 Suppose 3t - 9t = 13t. Suppose -17j - 3510 = -21j + 2m, -4j - 4m + 3504 = t. What are the prime factors of j? 877 Let f(s) = s3 + 9s*2 + 3s - 5. Let c = -6 - 2. Let b be f(c). Suppose 2p = x - 2p + 1, x = -5p + b. List the prime factors of x. 3, 5 Let z(y) be the first derivative of y2/2 - y + 26. Let h be z(3). Suppose 11i = hi + 2250. List the prime factors of i. 2, 5 Suppose -3z + 2q = 8, -2z + 3q - 5q = -8. Suppose -7g + 588 = -3g. Suppose z = -5j + 23 + g. List the prime factors of j. 2, 17 Let q(u) = -4u - 15. Let m be q(-5). Suppose 0 = mk + 4n + 1701, -3k - 1031 = -0k + 5n. Let x = -202 - k. List the prime factors of x. 3, 5 Let p = 99 - -43. Let t = -130 + p. Suppose -5s - 4q = -167, -ts + 2q + 144 = -8s. What are the prime factors of s? 5, 7 Let l(n) = 2n3 - 7n*2 - 8n. Let o be l(6). Let j(c) = 5c2 + 148c + 353. Let u be j(-27). Suppose -ug + 50 = -o. List the prime factors of g. 7, 13 Let p(b) = 131 - 33b - 26b - b3 + b2 + 58b. What are the prime factors of p(0)? 131 Let w = 10586 + -3700. What are the prime factors of w? 2, 11, 313 Let q(i) = 68i - 272. Suppose 5b + 3u - 126 = 0, -2b - 3u = -2u - 50. List the prime factors of q(b). 2, 5, 17 Let n be 3(4 - (-7)/(-3)). Suppose -ns - k = -0s - 825, -3s + k + 503 = 0. Suppose 3l - s = -5f, -3l = -3f - 221 + 47. List the prime factors of l. 3, 19 Let l(z) = 280z - 1105. List the prime factors of l(14). 5, 563 Let q be 1748/(-23)2/(-4). Suppose 0 = 12l - ql + 2704. List the prime factors of l. 2, 13 Let x be (-14)/84 - 10009(-2)/12. Suppose 0 = -27w + 33w - x. What are the prime factors of w? 2, 139 Let m = 127 + -124. Suppose 2c - mv - 8 = 0, 9 = c + 5v - 4v. Let w(s) = 6s*2 - 6s + 18. List the prime factors of w(c). 2, 3, 5 Let l(x) = -4x2 + 2x - 8. Let d be l(-2). List the prime factors of -216(77/d - -1). 2, 3, 7 Let n(z) = 82z*2 + 13z - 210. List the prime factors of n(7). 7, 557 Suppose 5k - 28 = -3. Let i(a) = 2a*3 - 8a*2 + 5a - 10. Let n be i(k). Suppose -p + b + n = 0, -2p + b - 29 + 158 = 0. What are the prime factors of p? 2 Let s = 8105 + 1838. List the prime factors of s. 61, 163 Suppose 102724 = 4r - 32k + 7k, -5k = -2r + 51332. What are the prime factors of r? 2, 3, 1069 Suppose -y - 4 = -5o + 27, o - 4y = 10. Let k(z) = -9z + 10. Let t be k(o). Let s = 79 + t. List the prime factors of s. 5, 7 Let f(w) = -16w - 8. Let j be f(-4). Let l = j - 54. Let t(v) = 22v2 - 6v + 3. List the prime factors of t(l). 79 Suppose -w = -8w - 56. Let f be (-2)/12148/w. Suppose 3x = f + 234. What are the prime factors of x? 257 Let u(q) = 29q + 290. Let k be u(-10). Suppose c - 3y + 12 = k, 15c + 4y - 23 = 14c. List the prime factors of c. 3 Let c = 16141 - 9199. What are the prime factors of c? 2, 3, 13, 89 Let c(o) = -5o2 + 3o*3 - 4o*3 + 11 + 0o + 4o + 3o. Let a be c(-6). List the prime factors of 1/a - 164/(-5). 3, 11 Let t = 330 - 164. Let b = t - 157. What are the prime factors of b? 3 Let s = 384 - -151. Let a = 342 + s. What are the prime factors of a? 877 Suppose 3*u = -u + 152. Suppo	{ "pile_set_name": "DM Mathematics" }
60))/((4 - 2)/20). Suppose -fl + 25 + 479 = 0. What is the remainder when 277 is divided by l? 25 Let i(z) = -z3 + 6z*2 - 10z + 8. Let n be i(3). Suppose 2l - ny = 49, 3y = 3l - 50 - 10. What is the remainder when 67 is divided by l? 16 Let y = 60 + 126. Calculate the remainder when y is divided by 39 + 13/(39/24). 45 Let b = 31 + -63. Calculate the remainder when 21 + -24 - (b + 1) is divided by (-2 + -1)/(14/((-1694)/33)). 6 Suppose -51a + 90a + 59a = 2156. Calculate the remainder when 4001 is divided by a. 19 Let y = -119 - -307. Let d = y + -155. Calculate the remainder when 261 is divided by d. 30 Let u(a) = 2a*3 - 3a*2 + 2a + 405. Let q be u(0). Let v = -385 + q. Calculate the remainder when v is divided by 4/18 + 212/18. 8 Let q(t) = -t*2 + 6t + 32. Let y = 45 + -21. Suppose -5g = 5m - 20, -2m + 5 + y = -5g. What is the remainder when q(7) is divided by m? 4 Suppose 3b + 205j = 201j + 1159, -8 = 4j. Calculate the remainder when b is divided by 76. 9 Suppose -35615 = -43s - 75s + 33s. What is the remainder when s is divided by 97? 31 Let h = -357 + -37. Let w = h + 437. Calculate the remainder when 147 is divided by w. 18 What is the remainder when 568 is divided by 14/665-5 + (-3120)/(-38)? 76 Suppose 538a = 519a + 418. Calculate the remainder when 2/(-1 + 3) + 100 is divided by a. 13 Suppose 3336b - 3328b - 152 = 0. Suppose -n - n = 2x - 120, 4x - n - 225 = 0. Calculate the remainder when x is divided by b. 0 Let m(q) = 113q - 3. Suppose c - 1 = 6c + 2x, -3x = 3c + 6. Let h be m(c). Suppose 2w - 456 = -h. Calculate the remainder when w is divided by 25. 23 Suppose -4q = -2f + 4f + 88, -5q - 3f = 108. Let g = q + 104. Calculate the remainder when g is divided by 23. 11 Let y(u) = -u2 + 31u + 31. Suppose 19v + 122 = 21v. What is the remainder when y(25) is divided by v? 59 Suppose -1376 = -5t - 3t. Calculate the remainder when t is divided by (-6)/(-10) + (-11176)/(-440). 16 Let k(s) be the first derivative of s*3 + 15s*2/2 + 10s + 69. What is the remainder when 28 is divided by k(-5)? 8 Let p be 10((-2)/(-4) - (-15 + 15)). Suppose pc = 188 - 68. Suppose -h = h - c. Calculate the remainder when 31 is divided by h. 7 Let d = 15 + -9. Suppose -2c = 3s + 35, c + 14 + d = -4s. What is the remainder when 57 is divided by (c/(-10))/(12/90)? 9 Let g be (0 - -4)(-5)/(-4). Suppose 0 = -0m - gm, 5m - 351 = -3h. Suppose -54i - 2561 = -397i + 11159. Calculate the remainder when h is divided by i. 37 What is the remainder when (-2)/11 + ((-12519)/52)/((-121)/176) is divided by 8? 6 Let j = -1084 + 1110. What is the remainder when 309 is divided by j? 23 Let c = 15828 - 10397. What is the remainder when c is divided by 22? 19 Suppose 0 = 2c - 12 + 6, -5t = -c - 22. What is the remainder when 6157 is divided by t? 2 Suppose -6y + 2z + 14 = -4y, 2y - 3z - 10 = 0. Let s(u) = 27u - 2. Calculate the remainder when s(2) is divided by y. 8 Let w(c) = 18c + 8. Let a = -7 - -9. Let d be w(a). Suppose -t + d = -44. Calculate the remainder when t is divided by 18. 16 Let o = -91 + 96. Suppose -4h + 252 = oh. Calculate the remainder when 80 is divided by h. 24 Suppose -5o = 2n + 2n - 20, 3n = -3o + 15. Suppose 0 = 2q - 5i - 103, 19 = q - ni - 45. What is the remainder when q is divided by 14? 11 Suppose 12 = -9p + 3p. Suppose 5x - 41 = 54. Calculate the remainder when (111/p)/(-3)2 is divided by x. 18 Let x = -24 - -22. Let s(u) = -5u - 10. Let r be s(x). Suppose -2b = -5y - 48, 5b = y - ry + 166. Calculate the remainder when 129 is divided by b. 27 Let a(z) = 8z + 2. Suppose w + 3j + 12 = 3, 2w = -2j - 14. Calculate the remainder when (-4 - -11 - 4)(-200)/w is divided by a(4). 32 Let n(m) = 65m + 2700. What is the remainder when 3008 is divided by n(-41)? 33 Let f = -11 - -8. Let l = -56 + 52. Calculate the remainder when 8/f(l - 205/20) is divided by 21. 17 Let v = 12460 - 12298. What is the remainder when v is divided by 59? 44 Let t(d) = d2 + 3d - 718. What is the remainder when 322 is divided by t(-31)? 22 Let m(l) = -l*2 + 3l + 18. Let i be m(5). Suppose h + 553 = ih. Let t = 32 - 23. Calculate the remainder when h is divided by t. 7 Let s be (15/(-10))/(((-21)/30)/(-7)). Let v(j) = -j3 - 17j*2 - 32j - 18. Suppose -3d - 2d + 35 = 0. What is the remainder when v(s) is divided by d? 5 Calculate the remainder when (-18328)/(-237) + 22/6 is divided by 8. 1 Let v(o) = 3o3 - 136o*2 - 223o + 16. What is the remainder when v(47) is divided by 188? 16 Calculate the remainder when 873 is divided by -9 + -5 + 228/4 + 8. 6 Let t(o) = -7o3 + o2 - 100o - 100. What is the remainder when t(-1) is divided by (2 - -3) + 3-1? 0 Suppose -3j - 2p - 50 = 0, 18 + 74 = -5j + p. What is the remainder when 26((-22)/(-14) + (-3)/(-7)) is divided by j/(2 - (8 + -4))? 7 Suppose 51 + 5 = -8r. Suppose -n - 4j = -44, 5j - j = 12. What is the remainder when 38(2 - (r/2 - -3)) is divided by n? 31 Let h(q) = -5q - 7. Suppose -29v + 41 + 2540 = 0. Calculate the remainder when v is divided by h(-6). 20 Suppose 3t + 48c - 44c + 80 = 0, -5t + 5c = 110. Let r be (-33)/4 + (-1)/(-4). Let q = r - t. Calculate the remainder when 41 is divided by q. 9 Let d(x) = 37x2 + 215x + 1. Suppose 0 = 4y - 3z + 6 + 9, y - 20 = -4z. Let n = 16 - y. Calculate the remainder when d(-6) is divided by n. 11 Suppose 0 = 4d + 2v - 62, 5d + 86 - 163 = -3v. Suppose -23t + 1088 = -1672. Calculate the remainder when t is divided by d. 8 Let i be (14/(-28))/((-3)/24). Suppose 0 = 5r - id - 43, 3r + 5d = 3d + 39. What is the remainder when r is divided by ((-4)/6)/(6/(-45))? 1 Suppose -p + 5y + 375 = -499, -25 = -5y. What is the remainder when p is divided by 22? 19 Let j(x) = -141x*3 + 9x*2 - 23x - 30. What is the remainder when j(-1) is divided by 38? 29 Suppose 124 = 3f + m, -37f + 39f + 5m = 87. Calculate the remainder when 4877 is divided by f. 39 Let i(g) = -927g2 - 7439g - 14. Calculate the remainder when 172 is divided by i(-8). 2 Suppose -j + 5s + 1219 = 0, 5s - 129 + 2537 = 2j. Calculate the remainder when j is divided by 590. 9 Let v(s) be the second derivative of -41s - 1/6s3 + 4s*2 + 0. What is the remainder when v(-4) is divided by 8? 4 Let c(f) be the second derivative of 1/12f*4 + 0 + 1/6f*3 + 5f*2 - 14f. Calculate the remainder when c(-8) is divided by 35. 31 Suppose 4452 = 36g - 31g - t, -3g - 4t + 2685 = 0. Calculate the remainder when g is divided by 296. 3 Let l(i) = 5i + 345. Let y(v) = -v + 29. What is the remainder when y(0) is divided by l(-65)? 9 Let o = 41 + -95. Let q = 30 + o. Let n = 49 + q. What is the remainder when 48 is divided by n? 23 Let m(f) = -28f. What is the remainder when m(-6) is divided by ((-2034)/(-72) - 7)/((-10)/(-16))? 32 Let n(m) = 2m2 - 487m - 5419. Suppose -d - 248 = -5d. Calculate the remainder when n(-11) is divided by d. 56 Suppose 5y = 4s + 161, 5y - 24s - 165 = -19s. What is the remainder when y is divided by 13? 3 Suppose -4p - 5s + 1396 = -1693, -p = 4s - 786. Suppose 6d = 794 + p. What is the remainder when d is divided by 11? 7 Let p be 3((-10)/(-15))/(4/6). Suppose r + pf + 3 - 2 = 0, -2r + 14 = -2f. Suppose rv = 217 + 13. What is the remainder when v is divided by 12? 10 Let t(s) = -8s + 331. Calculate the remainder when 6369 is divided by t(30). 90 Let o be 1 + (7/14)/((-4)/16). Calculate the remainder when (o - 4) + -4 + 4 + 347 is divided by 49. 48 Suppose -3a = 2a + 3d - 50, 3a - 30 = 5d. Suppose 0 = -2k - 44 + a. Let g = 27 + k. What is the remainder when g is divided by 5? 0 Suppose -t - 2u = -122, -3u + 129 = t - 0u. Calculate the remainder when 108 is divided by t. 0 Let x be (-16)/(-3) - 12/9. Suppose 2q = -0q + x. Suppose -2i = -3s - 53, qi - 2s + s - 43 = 0. What is the remainder when i is divided by 10? 9 Suppose 0 = 4t - 71 - 73. Suppose -3121 = -28b + 1492 + 1351. Calculate the remainder when b is divided by t. 33 Let y(f) = -23f - 678. What is the remainder when 124 is divided by y(-30)? 4 Let u be 146/(-30) + 5 + 17/(-15). Calculate the remainder when 461 is divided by u(1 - -7)(54 + -56). 13 Suppose -6*c	{ "pile_set_name": "DM Mathematics" }
94)/(-14) + 1695/(-2373)? 6 What is (-19)/(1520/(-110)) + 6/(-16)? 1 3/(-4)120/(-54)6 10 What is 2355/(-1413)6/(-7)? 10/7 Evaluate (2/(-6) + -4)/((-6)/(-18)). -13 What is (3 + 40/(-2))(-1 - 0)? 17 Calculate 950/1575 - (-40)/(-45). -2/7 Evaluate (2/126)/(26/674) - (-4257)/(-9933). -2/117 Calculate 4/(-7) + (-71550)/(-9450). 7 What is 1302/(-1674)(-3)/35? 1/15 Evaluate ((-23850)/(-10335))/(14/13). 15/7 Evaluate ((-45)/(-54))/(17/102). 5 What is the value of -115/55161? -16 What is the value of 1/(-13) + (-9108)/(-203918)? -1/31 Evaluate (13/4)/(1/(-8) - (-173)/(-1384)). -13 (-264)/(-154)(-7)/22 -6/11 What is -142115/(-4410) - 7? -2/7 What is the value of (-7 - 660/(-90))/(-1 - 23/(-36))? -12/13 Evaluate -48 - (-816)/18 - 22/3. -10 Calculate (619837/(-380))/(-101) + -16. 3/20 Evaluate (-28)/(-49) + (16/21 - 0). 4/3 Evaluate 52896/38570(-3)/(36/(-15)). 12/7 What is the value of ((-2493)/1385)/((-27)/(-5))? -1/3 2/42 - (6/(-4) - (-2616)/2016) 1/4 Calculate (0 - -1)/((-21)/84). -4 What is the value of (3/18)/((-23)/(-92))? 2/3 What is ((-6)/(-3))/(((-1152)/162)/32)? -9 (1120/62 - 8) + (-10)/155 10 What is the value of (12/(-792))/(-7 + (-58)/(-8))? -2/33 ((-104)/520)/(-3 + (-1022)/(-340)) -34 What is the value of (-104004)/(-130005)((-66)/(-184) + 2/(-8))? 2/23 Evaluate 24/(-4) + 366/60. 1/10 Evaluate (-610)/61(-8)/(-112). -5/7 Calculate ((-21)/518)/(9 - 390/40). 2/37 Calculate -6(10 + (-392)/48 - 1). -5 What is the value of ((-9)/1305)/(26/(-455))16/(-28)? -2/29 Evaluate (-30)/(-6) - (-5 + 14)-1. 14 What is the value of (24/(-18))/((-4)/18) - (-2145)/(-351)? -1/9 What is the value of 16895/(-59950) + 2/20? -2/11 What is the value of (7/(-18))/(311/(-1866))? 7/3 ((4/35)/((171/90)/(-19)))/(-2) 4/7 Evaluate -5(0 - -1)(-13 + 14). -5 Evaluate 12/(-8) - (-14)/(1680/225). 3/8 Calculate (-2 + -3 + 11 + -4)/((-26)/(-4)). 4/13 Evaluate 2 - (-3 - (10 - (6 - 4))). 13 Evaluate 2/62(-42 + 2185/38). 1/2 Calculate (-171)/(4788/(-224))(4 + 1). 40 8(18 + (-4 - 15)) -8 Calculate -29 - -26 - (636/36 - (-3)/9). -21 250/(-225)144/(-32) 5 What is (3 - (-912)/(-312))2? 2/13 -8 + 976/(-36)(-15)/50 2/15 What is the value of (-1050)/(-50) - (-5 - (5 - 15))? 16 Calculate 8/(-12) + -3403/(-234). 9/2 (-88)/330(2 - (-116)/(-16)) 7/5 (-37 - -36) + ((-4)/2 - -2) -1 What is the value of (-1)/4(1176 + -1175)? -1/4 (-2 + 4)/2 + (-460)/38 + 11 -2/19 What is (-756)/(-324) - (-68)/(-6)? -9 Evaluate 38/252 - (-34)/(-153). -1/14 What is the value of -12(-5)/(-70)(-196)/252? 2/3 (-484)/(-32) - (15 - 18) - (-3)/(-24) 18 What is the value of 58 + -16 + (-2691)/65? 3/5 Evaluate (-81)/12 + 195/(-104)30/(-75). -6 What is (-12)/((198/12)/11)? -8 What is 20/6 + 4 - (2 + (7 - 3))? 4/3 What is the value of (220/(-99))/(-10) - (275/(-99) - -1)? 2 (-1 + 25/5)(63/36)/(-1) -7 Calculate (-606)/909 - 31/(-24). 5/8 (-1057)/5256 + -6 + 18 -2/25 Calculate (34/419919)/(-2 + 6). 1/26 What is (-1 - -1) + (2485/1540 - 4/11)? 5/4 What is the value of -6 + 0 - (13 - 25)? 6 What is -46 + 34 + (8 - (-40)/12)? -2/3 1090/(-327)(-24)/(-10) -8 What is 242/4295538/284? 11 What is 2012/(-20) + (-8)/4? -14 Calculate ((-600)/80)/(1 - (-14)/(-24)). -18 What is the value of (15/(-4))/((1 + 49)/200)? -15 Evaluate (-1 + -11)/(6/(-33) - (-336)/154). -6 Calculate (110/(-25) - -5)/(-167 + 182). 1/25 Evaluate 31 + -41 - (-2 - 96/14). -8/7 What is 22 + 11 + -18 + -26? -11 What is -14 + 64/(-352) + (-1184)/(-99)? -20/9 Calculate 3 - 475/136 - (540/96 + -6). -2/17 What is (-2)/14(18/(-2) - 0/26)? 9/7 What is the value of ((-6)/(-33))/(4 + 1 + 1 + -9)? -2/33 20 + (-26 - 23)/7 13 Evaluate -33 - (-73488)/2184 - (75/21 - 3). 1/13 What is the value of ((-180)/2970)/(112/44)? -1/42 Evaluate ((-1)/(75/6))/(4 + 16/(-5)). -1/10 What is ((-52)/8)/(((-1260)/(-24))/15)? -13/7 2 - 5(-6)/(-15) - 912/48 -19 What is (-9)/(-5)1/15(-1625)/(-260)? 3/4 What is (-42)/35(31/93 - (-38)/6)? -8 Evaluate 858/(-77) + (-2 - -13). -1/7 Calculate (48/(-56))/(152/(-266)). 3/2 52/39022/(-24) -1/45 What is the value of (36 - 10192/168)/((-4)/(-6))? -37 What is the value of (-2)/(-10)(91 - 90)(-1 + -3)? -4/5 Evaluate (13/((-1872)/80)-3)/((-2)/(-6)). 5 Evaluate -11 - 660/99((-88)/(-16) - 4). -21 37/((-6216)/(-16))(4 - 1) 2/7 47 - 1 - (34 - 55 - -36) 31 What is the value of 4816/368 - (2/(-8) + (-1519)/(-4508))? 13 What is the value of ((-7)/10)/7(10 + 8/(-1))? -1/5 Calculate (-135)/216 + 6/16. -1/4 What is the value of (-6)/(-9)(10 - 1892/188)? -2/47 17/1758/(-1131) -2/39 What is the value of -16(-10)/(-40)-1? 4 What is the value of 637/(-98) - (-230)/40? -3/4 What is (68/(-15 - 2))/50? -2/25 What is ((-6)/(-16) - (-854)/112)(16 - 13)? 24 Calculate (12/(-3) + (-32)/(-7))(-25)/150. -2/21 Evaluate 10/(-35) + 338/(-105) + 6. 16/5 Calculate 405/(-243) - 2156/(-66). 31 1438/1212 + 3396/(-171498) 7/6 Calculate 7/(-49)21/(-12). 1/4 Calculate (-253)/(-12539/588). 23 (68/(-136))/(1098/156 - 7) -13 What is 4 - 1 - (-34)/(-136)-64? 19 What is (-1128)/235 - 2047/(-115)? 13 What is the value of (96/(-1216))/((8 - 4)/16)? -6/19 What is the value of (54378/288)/19 + (-2)/(-32)? 10 Calculate (-12338)/(-1990) - (-57)/(-15). 12/5 What is (-20280)/(-10647)48/(-20)? -32/7 What is the value of (-42)/(-10) + ((-574)/70)/41? 4 Calculate (((-1)/(-8))/(26/52))/(3/(-36)). -3 Calculate 63/153(45/(-140))/(-9)8. 2/17 What is the value of (-10)/(-4)4/3417? 5 ((-9)/((-351)/(-39)))/((1/3)/1) -3 What is the value of (52/20 - 4)(5 - 80/4)? 21 What is the value of (-1)/(-5) - 186/(-45) - 4/12? 4 What is ((-175)/400)/(14/224)? -7 Evaluate (22 - (-917)/(-42))/((-1)/5) + 1. 1/6 Evaluate (1/1)/(95/437(-12)/(-60)). 23 What is (-8)/4 - 240/(-110)? 2/11 What is the value of 1312/(-32) - (-72)/3? -17 What is (132/(-198))/((-1010)/255 - -4)? -17 Evaluate ((836/20)/(-11) + 4)/(2/80). 8 -130 + 120 + (10 - 5) -5 What is (-36)/(-13)-5 + (4 - 162/39)? -14 Evaluate (8/2)/(1574/(-5509)). -14 What is the value of (-9)/12(45 + -35 + -8)? -3/2 What is the value of (0 - 10/2)/(-4 - -7)? -5/3 What is (-30 - -28)9/6? -3 3681/(-4908)64/6 -8 What is (-54)/6 - (-25 - 35/(-5))? 9 What is (66/24 + -2)19/(152/96)? 9 Calculate (0 + -54)/((-4)/26 - (-4648)/2158). -27 What is the value of (-8)/301580/(-474)? 8/9 (-11)/(-616)-126 + (-11 - -3) -1/4 Evaluate 6/3367 - ((-426)/48 + 3). 6 What is ((-3)/(-7) - 3)/(96/448)? -12 Calculate 1349/(-1045) - (2 - (-128)/(-40)). -1/11 What is 59/7 - (-280)/(-196) - (-2 - -7)? 2 Evaluate 74/(-27) - (-4)/(-36)-24. -2/27 Evaluate (-5)/(-4) + (3388/(-112) - -14). -15 Calculate (-3)/(-4) + (-968)/1376. 2/43 What is (2392/897)/(20/6)? 4/5 Calculate (8/(-10))/((-5)/75). 12 Evaluate (72/(-2754)17)/(2/(-45)). 10 What is the value of 30562/(-2065) + 1/(-5)? -15 What is 12/2 + 12934/(-2007)? -4/9 11(-516)/132 + 10 -33 (8 - 10/(-10)) + (1 - -3) 13 What is 3/((-27)/(-6) - 32/(-64))? 3/5 Calculate (79/316)/((-1)/(2 - 142)). 35 What is (20 - -1)(-13 + 12)? -21 Evaluate (-1 - (-63)/77) + 1190/(-1925). -4/5 What is 8/(-20) - (-10 + (-6276)/(-660))? 1/11 (49/(-28))/(4/(-16)) 7 What is the value of (-2092)/2615 + (-18)/(-10)? 1 (-4)/62(102 + 18655/(-182)) 1/31 Calculate ((7/791)/((-9)/27))/(12/8). -2/113 What is (-2)/49 + (-1944)/392 + -9? -14 Calculate -4(-1 + 0) + -13 + -3 + 13. 1 (2/((-78)/30 + 3))/((-92)/460) -25 ((-2)/(-5))/((-6)/(-5)) + (-339)/791 -2/21 Evaluate ((-3)/(-4))/((-4800)/(-1280)). 1/5 What is ((-1440)/84)/(-5) - 6? -18/7 Evaluate -6 - (56/(-24))/(-34/36). -13 Calculate ((-470)/(-40) - 9)/((-45)/36). -11/5 Calculate ((-28)/(-2))/(-2) - 3/18-22. -10/3 Evaluate (-8)/3-31400/(-400). -28 What is 2/(-6) - (-11)/(264/80)? 3 What is (5 - -6) + 57/(-6) + 10/(-4)? -1 What is (-434)/620(-9)/21? 3/10 What is 1527/1215 - 13/3? -4 What is 16/(-3)(-132)/(-836)38? -32 What is the value of -3 + 4640/665 + (-4)/(-14)? 1/19 Calculate (9/((-567)/(-6)))/((-77)/21 - -4). 2/7 What is the value of 204/(-30) + (21 - 13 - 2)? -4/5 Calculate (6/8)/((-981)/872)(-30)/(-4). -5 What is -3 + 1 - (-2 + 0) - 134/(-1675)? 2/25 Evaluate ((-3)/(-15))/(506/(-33) + 15). -3/5 What is the value of 334/26 + 390/2535? 13 (-21302)/266275 - (2/7 - 7128/350) 20 Calculate (0 - 8/(-68)) + 2075/42330. 1/6 11((10/1 - 3) + -6) 11 (-27)/(-18) + 17 - 4/8	{ "pile_set_name": "DM Mathematics" }
+ co + 6 = 0. List the prime factors of (-4 - o)/((-1)/5). 5 Let y(u) = 13u + 25. List the prime factors of y(11). 2, 3, 7 Let f be 14 - (2/(-2) + 1). Suppose m + 2p - f = -3p, 0 = -p. List the prime factors of m. 2, 7 Let s(k) = 2k2 + 4k + 3. Let o be s(-2). Suppose 5b + c + oc - 75 = 0, 1 = -b - 4c. What are the prime factors of b? 19 Let w = 46 - 13. What are the prime factors of w? 3, 11 Let o(k) = -k3 + 4k*2 + 4k + 3. Let z be o(6). List the prime factors of 345/27 - 10/z. 13 What are the prime factors of 5/15(-234)/(-3)? 2, 13 Suppose 0z - 12 = -3z. Let b be (8 - 2)/(6/z). Suppose 3g + 3o - 32 = o, bo + 46 = 5g. What are the prime factors of g? 2, 5 Suppose g = -3t + 6, -t = 3g + 2g + 12. What are the prime factors of (-1 + t)/(4/76)? 2, 19 Let l = 1 - -2. Suppose lb = -b. Suppose -3h = 5f + 2h, b = -5h - 15. List the prime factors of f. 3 What are the prime factors of 0 + 4/(-2 - -4)? 2 Suppose f = 2f - 16. Suppose 5w = 5l, 0w - 4w + f = 4l. List the prime factors of w/(-7) - 90/(-21). 2 Let y be (20/(-25))/((-2)/5). Suppose 2n = 14 + y. List the prime factors of n. 2 Suppose y + 34 = 5g + 4y, -g = -4y + 7. Suppose 5p - 250 - g = 0. Suppose 4n - p = 1. What are the prime factors of n? 13 Let h(g) = -5g - 3. What are the prime factors of h(-6)? 3 Let l(h) = -16h2 - 16h + 26. Let f(y) = -3y2 - 3y + 5. Let d(v) = -11f(v) + 2l(v). What are the prime factors of d(-5)? 17 Let h = -3 - -4. Let t be -3(h - 15/9). Suppose 4q = -ty + 42, -1 = -q + 2y + 7. List the prime factors of q. 2, 5 Suppose -2z = -t + 5t - 278, t + 3z - 57 = 0. What are the prime factors of t? 2, 3 Let z be (0 + 174/2)1. Suppose 37 = 2v - 5y, -2v + 5y = -4v + z. What are the prime factors of v? 31 Let d(u) = u2 + 13u + 14. Let s be d(-12). Let i(j) = -5js - 3j*3 - 5j - 2j3 + 1 + 6j*3 + 1. List the prime factors of i(6). 2 Let p(a) = -a + 6. Let s(g) = -g + 5. Let i be s(10). What are the prime factors of p(i)? 11 Suppose -2g = 3g - 75. Suppose 3u = 4u + 4a - 10, 0 = -u + 5a - 26. Let i = u + g. List the prime factors of i. 3 Let x(z) = z2 - 8z - 1. Let j be x(8). Let i(v) = -26v3 + 2v + 2. List the prime factors of i(j). 2, 13 List the prime factors of 0 + (-404)/(-8) + 2/(-4). 2, 5 Let b(k) = k*2 - 4k - 2. Let m be -1 + -1 - (1 - 6). Let z be b(m). List the prime factors of z/((0 + 1)/(-1)). 5 Let y = 20 + -11. Let k = y + 8. List the prime factors of k. 17 Let w = 8 - 3. Let a(z) = -wz - 3z + 11 + 10z2 - 3z + z*3 + 0z. What are the prime factors of a(-11)? 11 Suppose 3o + 4 - 13 = 0. Suppose -oi + 6 = -21. What are the prime factors of i? 3 Suppose 12 = -2h - 5i, -2i - 3i - 28 = -2h. Let y(k) = 0 - k3 + k + 5k*2 - 2 - 2k. What are the prime factors of y(h)? 2, 5 Let q(d) = -d*2 + 6d - 4. Let j be (3/2)/((-5)/(-10)). List the prime factors of q(j). 5 Let v = -7 - -10. Suppose -35 = -vy - 2y. Let j = 17 - y. List the prime factors of j. 2, 5 Let h be -2 - (0 + -1 - -1). Let k be 32/2 - (h + 4). Let d = k - 4. What are the prime factors of d? 2, 5 Let v = -29 + 17. Suppose 0o = 2o. Let y = o - v. What are the prime factors of y? 2, 3 Let m = -72 + 110. What are the prime factors of m? 2, 19 Suppose j + 1 - 5 = 0. Suppose 21 + 39 = jf. What are the prime factors of f? 3, 5 Let v(w) be the first derivative of w4/2 - 2w*3/3 - 3w*2/2 - 4w + 2. Let c be v(3). Let t = -13 + c. What are the prime factors of t? 2, 5 Let v(t) = -t*3 - 4t*2 - 2t. Let s be v(-5). Let x = -19 + s. What are the prime factors of x? 2 List the prime factors of 3/9 - (-2276)/12. 2, 5, 19 Let u = -207 - -350. List the prime factors of u. 11, 13 List the prime factors of (-116)/(-6)9/6. 29 Let c(h) = 8h*2 - 2h2 + h2 + 3h - 1. Let g be c(2). Suppose q + 0o = -o + 12, 5q - g = 4o. List the prime factors of q. 3 Let g = 6 - 11. Let h = -2 - g. Suppose -hf - 7 = -52. What are the prime factors of f? 3, 5 Let b(y) = -9y. Let i be b(-2). List the prime factors of i/63 + (-192)/(-14). 2, 7 Let b(z) = -z*3 + 6z*2 - 6z + 3. Let d be b(5). Let f = 0 + d. List the prime factors of f/(0 + 1 + -2). 2 Suppose 32 + 31 = l. Suppose -5b + 72 = -l. What are the prime factors of b? 3 Let p be 5 - 6/(2 - 0). Suppose 3x - f + pf = 52, 4x - 61 = -3f. What are the prime factors of x? 19 Suppose 0 = -4g + 502 + 614. List the prime factors of g. 3, 31 Suppose 45 = v + 5d, 4v - 92 = -5d + 73. Suppose -5 - v = 3b. What are the prime factors of (b/10)/((-3)/32)? 2 Let y be (-1)/(-2)-6 - 6. Let v = y - -15. What are the prime factors of v? 2, 3 Suppose -4u - p + 68 = -0p, -40 = -3u + 2p. Suppose -r + u = -34. Suppose 0f = -5f + r. What are the prime factors of f? 2, 5 Let j = -33 + 58. What are the prime factors of j? 5 Suppose a + 1 - 35 = 0. List the prime factors of a. 2, 17 Let w(o) = -5o - 4. Let s be w(-4). Suppose 3k + 4 = 2u, 0 = 2k - 4u - 0u + s. List the prime factors of k. 2 List the prime factors of (-772)/(-16) + (-1)/4. 2, 3 Suppose 0 = -4j - 4m - m + 194, -4j + 5m + 214 = 0. What are the prime factors of j? 3, 17 Suppose 0 = -2z - 21 + 115. What are the prime factors of z? 47 Let b be (2 + (-2 - -1))0. Suppose b = d - 4 - 10. What are the prime factors of d/6 + (-6)/(-9)? 3 Let c be 82/(-1 - 4/4). Let q = 68 + c. List the prime factors of q. 3 Let p = 112 + 109. List the prime factors of p. 13, 17 What are the prime factors of 123 + 20 - (-1 - (-2 - -3))? 5, 29 Suppose 13 = 3m + 55. Let b = -6 - m. Suppose -5q + b = -3q. List the prime factors of q. 2 Suppose -19 = -2l + 5. List the prime factors of l. 2, 3 Let p(z) be the third derivative of 5z*4/3 + 3z*2. Let f(g) = 13g. Let j(s) = -7f(s) + 2p(s). List the prime factors of j(-1). 11 Let t = 17 - 13. Suppose -to + 17 = -43. List the prime factors of o. 3, 5 Let s be 1 - (-37)/(-2)-2. Let l = s + -26. What are the prime factors of l? 2, 3 Let m(p) = 8p2 + 5p - 1. List the prime factors of m(2). 41 Let k(v) = -11v. Suppose 0 = 2f + 5w - 18, -w = -3 + 1. Suppose 0 = 4j + 8 - f. What are the prime factors of k(j)? 11 Let j = 8 - 8. Suppose 0 = -ja - 4a + 164. Let g = a - 29. What are the prime factors of g? 2, 3 Let n = 7 + 29. Let p be ((-2)/(-2) - 1)/(-2). Suppose 0 = 3x, 2s + ps - 4x = n. List the prime factors of s. 2, 3 Let w(t) = t*3 - 7t*2 - 1. Let r be w(7). List the prime factors of 3/((-1)/(r/1)). 3 Let j = -81 - -154. Let x = j - 51. List the prime factors of x. 2, 11 Let p be (4/(-2))/(-2 + 1). Let b = 3 - p. Suppose b - 24 = -w - 5f, -2f - 22 = -2w. What are the prime factors of w? 13 Suppose -2i + 4 = 5h, h + 3h + 8 = 4i. Suppose -k + 5k + 12 = h. Let t = 20 + k. What are the prime factors of t? 17 List the prime factors of -1((-8)/(-4 + 8) + -193). 3, 5, 13 Let y = -14 + 0. Let o = 28 + y. List the prime factors of o. 2, 7 Let i = 3 + -1. Let w = 7 + i. What are the prime factors of w? 3 Let w be 4 - (0 - (0 - 1)). Let x(g) = 4g3 - 3g*w + 2g*2 + 5g*2 + 9 + 4g. List the prime factors of x(-6). 3, 7 Let c(v) = -3v + 9 + 0v + 4v + 0v. Suppose 0a - 5h = a - 21, 0 = -2a + 2h - 18. What are the prime factors of c(a)? 5 Let r(v) = 8v + 14. List the prime factors of r(16). 2, 71 List the prime factors of ((-18)/(-8))/((-4)/(-32)). 2, 3 Let u = 64 + 293. What are the prime factors of u? 3, 7, 17 Let m(w) = w3 - w + 5. Let k be m(0). Suppose -ka - 5c + c + 22 = 0, -a - 3c = 0. Let v = a - 3. What are the prime factors of v? 3 Suppose 3d + 4i - 220 = -0i, 4i = -4d + 292. What are the prime factors of d? 2, 3 Suppose 1 + 35 = 3n. Suppose z + n = 3z. List the prime factors of z. 2, 3 Suppose -2m = -4m. Suppose m = 3w + 6 + 3. Let d = w + 23. What are the prime factors of d? 2, 5 What are the prime factors of (-1)/2-367 - 1/2? 3, 61 Suppose 3d - 43 = 17. Suppose 0 = u + 3u - d. Suppose 5k + 25 = h, -5h + 35 = -2h - uk. What are the prime factors of h? 5 Suppose -4w = -2y + 82, -2w - 53 = 5y + 6. Let a = 36 + w. What are the prime factors of a? 2, 7 Let u = -4 + 1. List the prime factors of (1 - (7 + u))-2. 2, 3 Let o be (-6)/21 - 205/(-7). Let s be -43/(-12)o. Let d = 43 - s. What are the prime factors of	{ "pile_set_name": "DM Mathematics" }
et j(k) = 5k2 - 3k + 0 + k*2 - 3 - 4k*3. Let c(y) = rj(y) + 3v(y). Factor c(t). -t2(t - 3) Let r be 128 + (-5 - (-30)/2). Let y be r/(-23) + (6 - 0). Factor 0 + yp - 2/3p*4 - 2p*2 - 8/3p*3. -2p*2(p + 1)(p + 3)/3 Let d(v) be the second derivative of -v6/15 + 6v*5/5 - 25v*4/3 + 28v*3 - 45v*2 - v + 1605. Factor d(l). -2(l - 5)(l - 3)2(l - 1) Let i(m) = -m*3 + 11m*2 + 18m - 68. Let z be i(12). Suppose 300v2 + 350v*2 + 50v*3 - 785v*2 - 5v*z + 90v = 0. What is v? 0, 1, 3, 6 Let x(u) = -60u2 + 43208u - 38880008. Let n(l) = 22l2 - 14403l + 12960003. Let r(s) = 8n(s) + 3x(s). Factor r(c). -4(c - 1800)2 Let y(x) = 7x*3 - 45x*2 - 7x. Let k(v) = 20v3 - 134v*2 - 28v. Let m(s) = -5k(s) + 14y(s). Find r such that m(r) = 0. -1, 0, 21 Suppose -u + 3 = k + 2, -2k + 2 = 3u. Let w be (29 + -1)1k. Let 696x5 + 4x*2 - 716x*5 - 10x - 12x4 + 8x*2 + 2x + wx3 = 0. What is x? -1, 0, 2/5, 1 Let z(n) be the second derivative of -n4/18 - 17n*3/9 - 52n*2/3 - 2114n. Determine y, given that z(y) = 0. -13, -4 Let h be 3/(-6)(90/(-36) + 1). Let j(k) be the second derivative of -hk*2 - 21k - 5/24k3 + 0 + 1/80k*5 + 1/24k*4. Factor j(i). (i - 2)(i + 1)(i + 3)/4 Suppose -2s = 2c + 2, 7c - 2c - 2s - 2 = 0. Let t(p) be the first derivative of -3/25p5 - 13 + cp + 1/5p3 + 3/10p*2 - 3/20p*4. Factor t(g). -3g(g - 1)(g + 1)*2/5 Let z(b) be the first derivative of 0b*2 + 4/51b*3 - 2/17b - 186 + 0b4 - 2/85b5. What is m in z(m) = 0? -1, 1 Let p(r) be the first derivative of r4/8 + 16r3/3 + 285r*2/4 + 225r - 10979. What is d in p(d) = 0? -15, -2 Let d(h) be the second derivative of 0h2 - 2h*3 - 27h - 17/16h4 + 0 - 3/80h*5. Determine a so that d(a) = 0. -16, -1, 0 Let u(w) = 14w*3 - 93w*2 + 366w - 607. Let h(f) = -15f3 + 95f*2 - 365f + 605. Let i(x) = -9h(x) - 10u(x). Factor i(n). -5(n - 5)3 Let y(i) be the first derivative of -9i*4/4 - 233i*3/2 - 1767i*2 - 5415i/2 - 22. What is k in y(k) = 0? -19, -5/6 Let z(h) = -h3 - h2 + h. Let l be (-6)/822/(-33)-12. Let b(k) = 7k3 + 21k*2 - 6k. Let u(y) = lz(y) - b(y). Factor u(f). -f2(f + 15) Suppose 0 = 2957o - 2938o - 57. Let 1/5po + 2/5 + p + 4/5p*2 = 0. Calculate p. -2, -1 Suppose -74 + 1024 = 2z. Let v = -471 + z. Find q such that 5/3q2 - 7/3q*5 - 5/3q*v + 0 - 2/3q + 3q3 = 0. -1, 0, 2/7, 1 Let y(o) be the second derivative of -o5/30 + 21o*4/2 - 2813o*3/3 - 47045o*2/3 + 3871o. Factor y(l). -2(l - 97)2(l + 5)/3 Let d be ((-250)/(-200))/(90/96). Factor 10/3v2 + 8/3v*3 - dv - 2. 2(v + 1)2(4v - 3)/3 Let y be 21/(-16) + (796898/3344 + -28 - 24). Factor -2/11p2 - y - 128/11p. -2(p + 32)2/11 Let s(r) be the second derivative of -7/10r*4 - 144/5r*2 - 162r + 3/100r5 + 0 + 32/5r*3. Determine i, given that s(i) = 0. 4, 6 Let w be (-38285)/57 + (15/(-9))/5. Let c = 4724/7 + w. Factor -8/7 + cy + 12/7y2. 4(y + 2)(3y - 1)/7 Let b(t) be the second derivative of t*5/5 + 25t*4/3 + 8t*3 - 576t*2 + t + 453. Let b(i) = 0. Calculate i. -24, -4, 3 Let n(y) = 5y*2 - 1183y + 59537. Let p be n(164). Let l = -32 - -65/2. Factor -2k + 0 - lk*p - 3k*4 - 6k*2 - 13/2k*3. -k(k + 1)*2(k + 2)*2/2 Factor -43q*2 - 54q*2 + 544 - 110 + 99q*2 - 436q. 2(q - 217)(q - 1) Let z(g) be the second derivative of -g*6/90 - 13g*5/15 - 92g*4/9 - 352g*3/9 - 69g + 5. Suppose z(t) = 0. Calculate t. -44, -4, 0 Let d be (((-1275)/12)/(-25))/((-10)/(10400/(-110))). What is t in -50/11t3 + 282/11t*2 + 2/11t*4 - 676/11 + dt = 0? -2, 1, 13 Suppose -18 + 282 = 4t. Suppose 25j - t = -8j. Suppose -2/15i*4 + 0 + 0i*3 + 2/15i*j + 0i = 0. Calculate i. -1, 0, 1 Let u = 7578/413 + -1032/59. Let x be (-1)/(1/4-2). What is k in -uk*4 - 16/7k*3 - 2k*x - 4/7k + 0 = 0? -1, -2/3, 0 Let k be 2/(3522/(-1764) + 2). Factor -k - 13h3 + 29h*3 + 672h - 87h2 - 13h*3. 3(h - 14)*2(h - 1) Let n(q) be the third derivative of q*6/40 + 11q*5/20 + 5q*4/2 - 16q*3 + 1347q*2. Suppose n(i) = 0. Calculate i. -8, -4, 1 Suppose -2x = 5 - 11. Suppose -15 = -3m + 2g, 6 = -2m + xg + 21. Factor 3/4q - 1/2 + 0q*2 - 1/4qm. -(q - 1)2(q + 2)/4 Suppose -13 = 4c - 21. Factor 3z5 - 25z + 13z + 5z + 10z - 12z*c - 12z*4 + 18z*3. 3z(z - 1)4 Let u be (91/(-77))/(128/(-176)). Let r(n) be the first derivative of -un*2 + 3/2n - 1/16n4 + 2/3n*3 - 24. Factor r(v). -(v - 6)(v - 1)*2/4 Suppose 5b = -2j - 1453, 5j + 3374 + 299 = b. Let i = j - -738. Factor -2p2 - i - 1/4p*3 - 5p. -(p + 2)*2(p + 4)/4 Let u(i) be the first derivative of 14/13i2 + 2/39i*3 + 0i + 35. Find l, given that u(l) = 0. -14, 0 Let u(p) be the second derivative of p7/1890 - p6/30 + 17p5/90 + 23p*4/12 + 60p. Let y(x) be the third derivative of u(x). Factor y(m). 4(m - 17)(m - 1)/3 Let a be 41 - -66/9. Let n = a + -30. Factor 4h + 4h2 - 7h - 2 - 14 + nh. 4(h - 1)(h + 4) Let t(a) = -a. Let l(d) = 5d*2 - 6d - 20. Let y(v) = -v*2 + 3v + 44. Let q be y(0). Suppose -4s = q - 68. Let i(h) = st(h) - l(h). Factor i(g). -5(g - 2)(g + 2) Determine w so that 38829w + 40373w - 1050w3 + 1052w*3 - 796w*2 = 0. 0, 199 Let q be 12/4214/602. Let i(z) be the second derivative of -11z + 2/15z3 + 0z*2 + 0 + 33/100z*5 + 1/3z*4 + qz*6 + 2/105z*7. Factor i(p). p(p + 2)*2(2p + 1)2/5 Let n = -46 - -50. Factor -2x*4 + 57x*5 + 0x*n - 55x*5. 2x*4(x - 1) Suppose 882d2 - 4310d + 2/5d4 + 7100 - 314/5d*3 = 0. Calculate d. 5, 142 Let z(c) be the first derivative of -1/8c*4 - 4/9c*3 - 7/12c*2 - 1/3c - 20. Factor z(v). -(v + 1)*2(3v + 2)/6 Let a be (8265/(-60610))/(8/(-66)). Find i such that -87/8i*2 + 57/8i + 39/8i3 - a = 0. 3/13, 1 Let j(d) be the second derivative of 88d + 0 + 5/48d4 - 1/20d*5 - 1/12d*3 + 1/120d*6 + 0d*2. Suppose j(c) = 0. What is c? 0, 1, 2 Factor 13k - 18k2 - 20k + 3k. -2k(9k + 2) Let g = -387119/30 - -12904. Let b(a) be the second derivative of 4/9a4 + 13/9a*3 + ga*5 - 7a + 0 + 2a2. Factor b(m). 2(m + 1)*2(m + 6)/3 Let o(j) be the second derivative of -j6/200 - j5/20 - 3j4/20 + 29j*2 + 126j. Let c(n) be the first derivative of o(n). Factor c(h). -3h(h + 2)(h + 3)/5 Suppose -16u + 17u - 194 = 0. Suppose u = -r + 204. Factor 5/2i*2 + 10 + ri. 5(i + 2)2/2 Let j be (2/(-2))/((-14)/4). Let w = 2018139 + -2018136. Factor -2/7a*2 + 0a - 2/7aw + 0 + ja*4 + 2/7a*5. 2a*2(a - 1)(a + 1)2/7 Factor 3i*3 - 25i*2 - 252666 + 252666 + 66i - 44i2. 3i(i - 22)(i - 1) Factor -102g2 - 7g*3 - 22g*2 + 29g*2 - 545g*2 + 2g*3 - 1875g. -5g(g + 3)(g + 125) Let c(a) be the second derivative of a4/96 + 23a*3/24 - 1071a*2/16 + 9582a. Let c(t) = 0. What is t? -63, 17 What is m in 117/7m + 34 - 1/7m*2 = 0? -2, 119 Find x such that -54x*2 - 3/4x*5 + 1/2x*4 + 81/4x*3 + 0 + 27x = 0. -6, 0, 2/3, 3 Let x be (-17172)/306 + (-4)/(-34). Let s be (60/45)/((x/12)/(-1)). Let -10/7o + 8/7 + so*2 = 0. What is o? 1, 4 Solve 5/2m + 0 + 3m2 + 1/2m3 = 0. -5, -1, 0 Let c(p) be the second derivative of p6/6 - 21p5 + 415p*4/12 + 9243p. What is l in c(l) = 0? 0, 1, 83 Let f be (4/8)/(-25 + 46). Let t(o) be the second derivative of 5/21o3 + 0 + 6/7o*2 + 19o - fo4. Let t(h) = 0. What is h? -1, 6 Let q be ((-300)/24 - -13)8. Let v(y) be the second derivative of -5/12yq + 5/6y*3 + 0 - 13y + 5y2. Factor v(i). -5(i - 2)(i + 1) Let x(d) be the second derivative of d4/66 - 256d*3/33 + 255d*2/11 - 1551d. Factor x(q). 2(q - 255)(q - 1)/11 Suppose -40s - 45s + 44s = 0. Let a(m) be the second derivative of sm*2 + 0 - 1/3m*3 + 1/3m*4 - 1/40m*5 + 21m - 1/20m6. Factor a(k). -k(k - 1)(k + 2)(3k - 2)/2 Let k(x) be the first derivative of 9x*4/4 + 628x*3/3 + 481x*2/2 - 138x - 352. Solve k(y) = 0 for y. -69, -1, 2/9 Determine m, given that -21m2 - 96 - 3/4m*3 + 93m = 0. -32, 2 Determine x, given that -1/4x4 - 1/2x*3 + 0x*2 + 1/4 + 1/2x = 0. -1, 1 Suppose 9*l - 4	{ "pile_set_name": "DM Mathematics" }
2 - o*3 - 4o*2 + 2o*2 + 4. Does 8 divide i(-7)? False Suppose 0 = -u + 2. Let q be (u/(-2))/((-1)/79). Let o = q - 55. Is 15 a factor of o? False Let f = -43 - -89. Is f a multiple of 8? False Let a = -62 + 36. Let c = 40 + a. Is c a multiple of 9? False Is 30 a factor of ((-2)/(-9) - 176/(-18))12? True Let o = -6 + 4. Let u = 9 + o. Does 4 divide u? False Suppose -5j = -11 - 4. Suppose -5q = -jr - 16, 6r + 14 = 2q + r. Suppose 3l = -7 - q, 4l = 5n - 82. Is 5 a factor of n? False Suppose 4x - 6x + 104 = 0. Is x a multiple of 13? True Let u(y) = -y*3 + 9y*2 + 9y + 12. Let v be u(10). Suppose -12 = -2k - 2g, k + vk - g = 10. Is k a multiple of 2? True Suppose -4k + 2p - p = -14, -3k + 2 = -5p. Let r(j) = -2j + 6j2 - j3 - 2 - 4 + 1. Does 14 divide r(k)? False Let d(l) = 5l*2 - 2l - 3. Let c be d(3). Let j be (3/(-6))/(2/c). Is 9/(-4)(j - -1) a multiple of 12? False Let b(n) = 23n*2 - 2n + 1. Let s = -4 - -5. Does 11 divide b(s)? True Let i be 04/16 - -3. Suppose -2y + iy = -5c + 17, y + 2c - 11 = 0. Is 7 a factor of y? True Is 4/(4/41) + 3 a multiple of 11? True Let h be (-7)/2 + 3/(-6). Does 7 divide ((-10)/(-3))/(h/(-18))? False Is (0 - 5)8856/(-120) a multiple of 41? True Suppose 2c = 5l - 96, -4l + 0 = 3c - 63. Is l a multiple of 6? True Suppose 2h = -4x + 16, h - x - 8 = 2x. Let l = h + 20. Is l a multiple of 28? True Let m(c) = -c3 - 3. Let s be m(0). Let b = s + 10. Is b a multiple of 7? True Suppose -7 = -c + 41. Suppose 4i - 2d + c = -4d, 0 = -4d - 16. Is ((-4)/i)/(6/120) a multiple of 8? True Suppose -u = -0u. Let c(j) = j + 21. Is c(u) a multiple of 7? True Let s(o) = -o - 4. Let f be s(-2). Does 5 divide (10/(-6))/(f/6)? True Let j be 22/1 - 2. Let c be 1(34 + j + -1). Suppose -73 = -4y + c. Is y a multiple of 14? False Let q = -97 - -173. Is q a multiple of 5? False Suppose -i + 3b = -1, 4 = 3i + 5b - 13. Suppose -8 = 3l + i. Let u = 12 - l. Does 8 divide u? True Let h be -2 + 5 + 39/(-1). Let w = h + 52. Does 8 divide w? True Let d(i) = -9i - 28. Does 4 divide d(-8)? True Let h = -8 + 18. Let l(n) = -6n + 0n + hn + 2 - 8n. Is l(-2) a multiple of 10? True Let g(i) = 102i2 + 2i - 1. Does 23 divide g(1)? False Let y be (-3)/(((-12)/(-5))/(-4)). Suppose 5o + 87 = 5v - 108, 39 = v - yo. Does 13 divide v? True Let h be (2/3)/(4/(-42)). Let o(m) = -m2 + m + 1. Let b(q) = -2q*2 - 4q - 2. Let t(r) = -b(r) + o(r). Is 9 a factor of t(h)? False Is 5 a factor of 128/13 + (-2)/(-13)? True Let d(a) = a*3 - 8a*2 + 12a + 5. Is 8 a factor of d(7)? True Let f(c) be the first derivative of 11c2/2 - c - 4. Suppose -o + 4o - 3 = 0. Is 10 a factor of f(o)? True Suppose 4l - 3p = 2l + 58, 38 = l + 3p. Let s = l + -4. Is 7 a factor of s? True Suppose 5s - 9 = 6. Suppose -2c - 3k = -7c, sc = -3k + 24. Is c a multiple of 3? True Let y be 1/(-2)2 - -3. Suppose -39 = -4u + 5p, u = yp - p + 9. Is 5 a factor of u? False Let p = -7 - 4. Let v = p + 18. Is v a multiple of 3? False Let i be 2/7 - (-38)/14. Suppose -m + i = -1, -4u + 264 = 2m. Is 6 a factor of (9/(-6))/((-6)/u)? False Suppose 2v + 3z = 4 + 65, 2v - 2z = 84. Is 9 a factor of v? False Let d be 93 - (3 + 0 + 0). Suppose 5z - 3b = -6b + d, 5b = -z + 40. Does 6 divide z? False Suppose -4x + 16 = 4p - 48, 3p = 2x - 37. Suppose 2i - 13 - x = 0. Is i a multiple of 5? True Let p = 352 - 214. Suppose 4w - p - 42 = 0. Is 18 a factor of w? False Let h = 11 - -19. Is 10 a factor of h? True Suppose 0m + 5 = m. Suppose mc - 220 - 162 = -2t, 2t = 3c - 226. Is c a multiple of 19? True Suppose -5c + c - 22 = -i, -15 = 5i + 5c. Suppose 0 = -is + 6s - 108. Is 8 a factor of s? False Suppose -19t + 432 = -15t. Does 18 divide t? True Suppose 760 = 4s - 600. Suppose -s = -7h + 2h. Suppose -w + 23 = -i, -5w - 2i = -w - h. Does 19 divide w? True Let x be (-2 + (-15)/(-6))46. Let d(t) = -t*3 - 5t*2 + 3. Let z be d(-3). Let c = x + z. Does 5 divide c? False Let n = 10 + -5. Let t be (n/(-15))/((-2)/(-6)). Is t((-33)/3 - -2) a multiple of 5? False Suppose 2q + 2q + 2x = 30, 5x = -3q + 5. Suppose -q - 10 = 5y + 5d, -3d = 4y + 13. Is 3/(-6)-74 + y a multiple of 18? True Let w = 71 + -33. Suppose 5f + 13 = 3j + w, -2j = f - 5. Suppose d = -j + 2. Is d a multiple of 2? True Let p(s) = -2s - 1. Let r be p(1). Is 8 - 2(r - -2) a multiple of 4? False Let g = 70 - 26. Is g/(7/((-7)/(-2))) a multiple of 10? False Let u(f) = 2f*2 + 7f. Let o = 9 - 14. Is 15 a factor of u(o)? True Suppose -5t - 12 = 4v + 5, -v - t = 3. Suppose -vr + 270 = 3r. Does 18 divide r? True Let x(j) = 2j + 8. Let z be x(11). Let r = -47 + z. Let b = 4 - r. Is b a multiple of 11? False Let c(i) = -3 + 2i*2 + 2 - 4i*2 - 2i. Let l be c(3). Let r = 56 + l. Does 12 divide r? False Let x(r) = 2r3 - 4r*2 + 3r - 6. Is x(3) a multiple of 21? True Let y = 2 - 0. Suppose -yv = v. Let z = v + 13. Is z a multiple of 9? False Let q be ((-33)/(-6))/((-4)/(-8)). Suppose -q = -5x + 34. Is x a multiple of 7? False Let y(t) = 6t3 - 3t2 + t. Is y(2) a multiple of 38? True Let g = -32 - -123. Let m = g + -31. Is 20 a factor of m? True Let v(p) = -p2 + 5p + 6. Let d be v(6). Suppose d = 4z + 8, -z + 4 - 1 = j. Suppose j = -a, 3a - 2 - 1 = -2w. Does 9 divide w? True Let t(c) = c*3 - 2c*2 + c + 7. Let h be t(5). Suppose -r + h = 2r. Suppose u = -3s + r, -2s = -2u + 59 - 9. Is 13 a factor of u? True Let y = 0 - -8. Let x = 18 - y. Is 4 a factor of x? False Let x be (-4)/(1-21). Suppose 0 = 3g - xg + 4i - 83, 4g - 257 = -i. Let t = -29 + g. Is 12 a factor of t? False Let u = 43 + -21. Let w = 37 - u. Is 9 a factor of w? False Suppose -m + 2 + 34 = 0. Is 9 a factor of m? True Suppose 3h - 28 = 2h. Does 7 divide h? True Let o = 6 - 8. Let u(w) = 3w*2 + 5w - 1. Let y(n) = -n*2 - n. Let j(c) = -u(c) - 5y(c). Is j(o) a multiple of 5? False Let v(a) = a*2 - 5a - 16. Is 38 a factor of v(14)? False Let b = 52 + -12. Does 10 divide b? True Let h(t) = t - 1. Let z be h(6). Suppose 2k + za - 52 = 31, 47 = k - 3a. Is k a multiple of 13? False Let w be -4 + 1 + (4 - 1). Does 9 divide 3 + (-33)/(-3 - w)? False Let n = 29 - 42. Let c(j) = -4j*2 - 3j - 1. Let o be c(-3). Let x = n - o. Is x a multiple of 15? True Let y be 4(-5 + 1 + 0). Suppose -30 = -3t - 4p + 56, -5p - 94 = -4t. Let m = y + t. Is 5 a factor of m? True Is (2 - 8/2 - -6) + 15 a multiple of 19? True Let q(l) = -3l*3 + 4l*2 + 2. Let w be q(3). Suppose 0 = v + 29 - 9. Let n = v - w. Is 12 a factor of n? False Suppose -3n = -2l - 11, 4n - 5n - 4l - 1 = 0. Does 3 divide (7/2)/(n/6)? False Let k(t) = -t*3 + 6t*2 - 4t - 2. Let o be k(5). Let v = o + 0. Does 13 divide 80/v - 6/9? True Is ((-132)/16)/3-8 a multiple of 7? False Let r(w) = -w + 2. Let u be r(2). Suppose -3d = -p - p + 9, 0 = 4p - 2d - 6. Suppose uk - 2k + 26 = p. Is 9 a factor of k? False Let u = 2 - 10. Is ((-45)/12)/(2/u) a multiple of 9? False Let r be 7 + (-2 - (1 + -1)). Suppose -3 = 2l - rl. Does 5 divide -1 + (l - -1) - -15? False Suppose 2c - 3c + 5 = 0. Suppose -ca + 30 = -2a. Is 3 a factor of a? False Let o = -34 - -54. Does 12 divide o? False Let f = -5 - -8. Suppose 0 = fa - 32 - 19. Is 16 a factor of a? False Suppose -3d - 4o - 164 = -8d, 0 = 2o + 2. Does 8 divide d? True Let v = 7 + 12. Suppose z + 5 = 0, -3o + v = -o - z. Is 7 a factor of o? True Let d(w) = w*3 + 8w*2 + 6w. Is 18 a factor of d(-6)? True Is 90/75(-130)/(-4) a multiple of 13? True Suppose -284 = -5d + 166. Suppose 3m - d = -2m. Is m a multiple of 13? False Suppose 48 = -4p + 156. Is 2 a factor of p? False Let z be (-3)/(-4)(-96)/(-6). Let d = z + -5. Does 7 divide d? True Suppose -x = -9 + 5. Is 2 a factor of x? True Is 6 a factor of (-5)/2(-4)/1? False Let m(v) be the first derivative of -6v - 3/2v2 - 3. Is m(-7) a multiple of 5? True Let z = -40 - -22. Let a = z + 24. Is 6 a factor of a? True Suppose 56 = 4t - 5c, -2c + c + 4 = 0. Is 11 a factor of t? False Let a(o) = o*2 + 5o - 12. Does 12 divide a(-9)? True Let u = 11 + 15. Let r = u - 18. Is r even? True Let j(n) = n*3 - 8n*2 + 10n - 3. Let p be j(7). Let m = 66 - p. Is	{ "pile_set_name": "DM Mathematics" }
= -v - 2. What is the tens digit of h(v)? 1 Let p(z) = -z*2 - 6z - 5. Let s be p(-5). Let c be 3(-1 + 2) + 0. Suppose -4d + 29 + c = s. What is the units digit of d? 8 Suppose 5m - 28 - 17 = 0. Suppose 13f - mf - 208 = 0. What is the tens digit of f? 5 Let z(o) = -1 + 1 - o. What is the units digit of z(-7)? 7 Let n = -64 + 109. What is the tens digit of n? 4 Let p = -4 - 1. What is the units digit of (15/p)/((-1)/9)? 7 Let n(b) = 5b*2 + 3b. Let l(j) = 4j. Let m(u) = 3u - 1. Let q(x) = 2l(x) - 3m(x). Let z be q(5). What is the units digit of n(z)? 4 Let z(i) = i*2 + 3i - 1. Let b be z(4). Let t be 23b/(-6). Let c = -19 - t. What is the units digit of c? 8 Suppose 2d - 4d = 0. Suppose -5q + 80 = -dt + 2t, -2t + 10 = 0. What is the tens digit of q? 1 Let z = -75 + 126. What is the tens digit of z? 5 Suppose -4u + 2b = -2b - 172, -3u = 4b - 101. What is the tens digit of u? 3 Let o(g) = g3 + g + 1. Let y(b) = 6b*3 - 9b*2 + 11b - 1. Let i(m) = 5o(m) - y(m). Let s be i(8). Suppose s - 6 = 4t. What is the units digit of t? 4 What is the tens digit of 12 - (2 + -4 - -3)? 1 Let s(u) = -3u2 - 9u - 4. Let f be s(-7). Let q = -52 - f. What is the tens digit of q? 3 Suppose -18 = -2f - 3c, 0c = 2f - 3c + 6. What is the units digit of f? 3 Let o(s) = 7s - 1. Let d be o(1). Let r(u) = -u*3 + 6u*2 + 2u - 5. Let b be r(d). Suppose 0 = -bc + 2c + 45. What is the units digit of c? 9 Let n(g) = g*3 - 5g*2 + 8g - 5. Suppose 3s - 30 = 3q, -5q = -2s - 0s + 35. What is the units digit of n(s)? 5 Suppose -2v = -7v - 15. Let t be (v2)/(6/(-9)). Suppose -3k - 3 + t = 0. What is the units digit of k? 2 Let s = 140 + -78. What is the units digit of s? 2 Let y(s) = s3 - 5s*2 - 4s - 4. Let l = 13 + -9. Suppose 32 = 5f - w, -14 = -lf + 4w - 9w. What is the units digit of y(f)? 8 Suppose n - 5p + 2p + 31 = 0, 2p + 71 = -3n. Let g = 35 + n. What is the tens digit of g? 1 Let c = -17 - -48. What is the tens digit of c? 3 Let m(a) = -a*2 + 6a + 1. Let p be m(3). What is the tens digit of 476/20 - (-2)/p? 2 Let x = 15 - 12. What is the tens digit of 0 + (20 - -3) - x? 2 Suppose 0 = -2n + 6, 0n - n - 481 = -4w. What is the tens digit of w? 2 Suppose 3m - 477 = -4d + 481, 2m - 4 = 0. What is the hundreds digit of d? 2 Let r = 19 - 5. What is the tens digit of r? 1 Suppose -4u = -7 - 21. Suppose ud = 2d + 145. Let m = d - 16. What is the units digit of m? 3 Suppose -5y + 21 - 6 = 0. Suppose 0 - y = -x. Suppose 0 = xc - 0c - 30. What is the tens digit of c? 1 Let u = -11 - -14. Suppose -2k = -uk + 5. Suppose -2x - 11 - 15 = -4t, kx = 5t - 40. What is the units digit of t? 5 Suppose 0 = 5y, -6 = -n + 4y + 185. What is the tens digit of n? 9 Let u be (5 + -11)(-2)/4. Suppose 126 = -un + 21. What is the units digit of n/(-20) - (-2)/8? 2 Suppose 321 + 94 = 5t. What is the tens digit of t? 8 Let p(h) = 5h - 2h2 + 4h*2 + 2 + 2. Let t be p(-6). Suppose 4a - 2 - t = 0. What is the tens digit of a? 1 Suppose -200 = -4a + 4o, 2o = o - 4. What is the tens digit of a? 4 Let m(c) = 7c*2 + 3c - 5. What is the units digit of m(2)? 9 Let g be (-1)/(-4) + 63/4. Suppose -2z + 2 - g = 0. What is the units digit of 4/(-14) - 37/z? 5 Suppose 6 = 2c - 4i, -c - 4i = -5i - 4. Let l(v) = v + 6. What is the units digit of l(c)? 1 Suppose 3v - 7 = h + 4h, 23 = 5v + 3h. Suppose -j - vt - 32 = -2j, -j = -5t - 28. What is the units digit of j? 8 Let r(j) = 6j3 - j2 + j - 1. Let h = 3 - 9. Let q be ((-3)/((-9)/h))/(-2). What is the units digit of r(q)? 5 Suppose h + 34 = 3k + 3h, 5k - 55 = -5h. Suppose 0 = y - j - 2j - k, -4y + j + 26 = 0. What is the units digit of y? 6 Let t = -24 + 14. What is the units digit of ((-4)/t)/(11/1265)? 6 Let r(u) = u - 7. Let j be r(0). Suppose 0 = 2t - 4b + 16, -5b - 13 = 5t - 6b. Let a = t - j. What is the units digit of a? 5 Let s(h) = 8h + 1 - h2 + 15 + 4h - 1. What is the units digit of s(11)? 6 Suppose 0f = -4f + 192. Suppose 5 - 53 = 4g - y, 3y + f = -4g. Let o = g - -25. What is the tens digit of o? 1 Suppose -16l + 12l + 284 = 0. What is the tens digit of l? 7 What is the tens digit of 268/8 + (-1)/(-2)? 3 Let u(a) = 3a + 3. Let k be u(5). Suppose -c - 5f = k, c + 4f + 13 = -0f. What is the units digit of c? 7 Suppose 0 = 3g + 3 - 0. Let j be 6(1 + (-3 - g)). What is the tens digit of (9/j)/(3/(-20))? 1 What is the units digit of (29 - 6)-2(-1 + -3)? 4 Let i = -22 + 45. Suppose -i = -2d + 5c, -3c = 2d + 3 - 2. Suppose -5t - dl - 3 + 1 = 0, 5l = -2t - 11. What is the units digit of t? 2 Suppose -11 = -3u + 34. Suppose 8z - 3z = u. What is the units digit of z? 3 Suppose -2d + 28 + 28 = 0. What is the tens digit of d? 2 Suppose 1 = -2y + 7, 2s - 303 = -5y. What is the tens digit of s? 4 Suppose 39 + 381 = 6c. What is the units digit of c? 0 Let m(c) = -6c + 8c - 1 + 16. What is the units digit of m(11)? 7 Let u be ((-4)/(-10))/((-7)/(-35)). Suppose -45 = -3s + 15. Suppose -ul = 3w - 7, 5w = -l + 4l - s. What is the units digit of l? 5 Let n(j) = -j3 + j2 + j. Let k be n(2). Let o be (k/4)/((-2)/44). Suppose 2x - o = -5y, 3x = 2y + 4x - 5. What is the units digit of y? 1 Let g(f) = -4f - 3 + 6 - 1 - 4. What is the tens digit of g(-4)? 1 Suppose q = -3p + 49, 5p - 50 = -3q + 77. Let o = -25 + 5. Let g = q + o. What is the units digit of g? 4 Let s = 0 - -2. Suppose o - 1 = s. What is the units digit of o? 3 Suppose h - 4h + 132 = 0. What is the tens digit of h? 4 Let x(l) = l*3 + 8l*2 - 5l - 4. Let f be x(-8). Suppose -5n + f = -3n. What is the tens digit of n? 1 Suppose j - 2l - 1 = 4, -4l = j + 1. Suppose 9 = 2s + j. Suppose 0f = -sf + 12. What is the units digit of f? 4 Let s(k) = -405k*3 + 2k + 2. What is the hundreds digit of s(-1)? 4 Let v = 3 + 9. What is the tens digit of v? 1 Let n = 50 - 31. Suppose -5r + n + 166 = 0. What is the tens digit of r? 3 Let i = -146 - -260. What is the tens digit of i? 1 What is the hundreds digit of -4 + 22/(4/((-28)/(-1)))? 1 Let c(b) = 2b*3 - 5b*2 + b + 7. Let j be c(5). Suppose -3s - 14 = -j. Suppose -2i = -10, -4i + 9i = -2a + s. What is the units digit of a? 8 Suppose 0 = 5a + 4x - 72, 90 - 12 = 5a + x. What is the units digit of a? 6 What is the tens digit of 4/22 + (-7130)/(-110)? 6 Let a = 3 + -4. Let o be -2 + 5 + (a - 0). What is the units digit of (-2 + -1 + o)-1? 1 Let o = 14 - 13. What is the units digit of 48/2 + 3o? 7 Let b(s) = 7s3 - s2 + s - 1. Let m be 2 - (-1 - -4) - -4. Let n = m + -2. What is the units digit of b(n)? 6 Let q(v) = 13v2 - v - 2. What is the units digit of q(-2)? 2 Let y be 8/8 - 1-1. Suppose 2l + 4g = 20, yg + g = l + 15. Let f = 9 - l. What is the units digit of f? 9 Let w(z) = -7z - z2 + 13 - 14 + z. What is the units digit of w(-5)? 4 Let v(d) = d2 + 3d + 6. Let g be v(-3). Suppose -4b + 84 = -5y + y, b + 2y = g. What is the units digit of b? 6 Let m = 16 + -7. Let n be (-25)/(-3) + (-3)/m. Suppose 4k - 5s - n = -s, -5k = -3s - 12. What is the units digit of k? 3 Suppose -3d - 28 = -5c, -d - c = 2 + 2. Let o(w) = -2w - 9. What is the units digit of o(d)? 3 Let w(k) = 6k*2 - 4k - 11. What is the tens digit of w(7)? 5 Let v be (18/(-3))/(2/(-3)). What is the units digit of 2/v - (-122)/18? 7 What is the units digit of (-164)/(-6) + (7 - (-114)/(-18))? 8 Let f(v) = v + 21. What is the units digit of f(16)? 7 Suppose -3 = -2z + 3. What is the units digit of z? 3 Let z = -117 + 81. Suppose -580 = 2i + 3i. What is the units digit of i/z + (-2)/9? 3 Let v = 0 + 13. Suppose -4c + 3g = -2g - v, -5 = 5g. Suppose -l + 7 = -0l - 3p, 0 = -cp. What is the units digit of l? 7 Let y(v) = -2v3 - v2 + v + 1. Let k be y(-1). Let o be -1 + (k - -2) + 1. What is the units digit of 8/12 + 28/o? 0 Suppose c + 29 = 316. What is the units digit of c? 7 Suppose -8d + 4d + 4s = -244, -5s - 15 = 0. What is the tens digit of d? 5 Let v(i) = -i2 - 17i - 13. What is the tens digit of v(-14)? 2 Suppose 4b - 20 = 16. Let y be (1 + 1)/40. Let k = b - y. What is the units digit of k? 9 Let z = -9 - -17. Let c = 6 - z. What is the units digit of	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.