Split (1)

train · 27.3k rows

text stringlengths 1.4k 8.19k	meta dict
+ 10. Let p(y) = y + 5. Let r be (-2 + 1)/((-8)/(-56)). Let w(k) = rp(k) + 3a(k). Give -3h(n) + 2w(n). -2n + 2 Let z(x) = -8x*2 + 6x + 6. Let y(r) be the second derivative of 7r4/12 - 5r*3/6 - 5r*2/2 + 30r. Calculate 6y(d) + 5z(d). 2d2 Let o(x) = -2. Let m(z) be the third derivative of z5/60 + 5z*3/6 - 3z*2 + 2z. What is -2m(t) - 5o(t)? -2t2 Let t(a) = 14a*2 + 5a + 5. Let v(x) = 27x2 + 9x + 9. Determine -9t(r) + 5v(r). 9r2 Let x(t) = 3t3 - t2 + 2. Let r(f) = 16f3 - 5f*2 + 11. What is -2r(i) + 11x(i)? i3 - i2 Let h(p) = -3p*2 + p - 3. Let x(l) = -13l*2 + 3l - 13. Determine 9h(z) - 2x(z). -z*2 + 3z - 1 Let h(a) = 5a3 - 5a*2 - 5. Let l(t) = -5t*3 + 6t*2 + 6. Give 6h(g) + 5l(g). 5g*3 Let g(m) = -9m - 4. Let v(q) = -10q - 5. Give 7g(h) - 6v(h). -3h + 2 Let i be 6(-2)/12-3. Let o(d) = -5d + 11d*2 - 3 + 1 - 6 - i. Let j(g) = -6g*2 + 5 + 3g + 6 - 5. Determine -7j(f) - 4o(f). -2f2 - f + 2 Let z = 16 + -9. Let a(x) = -zx*3 - 2x*3 - 5 + 2x*3. Let w(t) = -10t*3 + 3t - 7. Let d(v) = -v. Let g(o) = 3d(o) + w(o). Calculate 7a(n) - 5g(n). n3 Let x(g) be the third derivative of -g4/8 + 5g*3/2 - 24g*2. Let k(j) = -2j + 8. Give 9k(o) - 5x(o). -3o - 3 Let c(k) = -5k. Suppose 2a - 3 = 11. Let n(m) = 20m + 8. Let f(x) = 13x + 5. Let l(h) = 8f(h) - 5n(h). Give al(p) + 6c(p). -2p Let a(t) = -5t + 5. Let o = -17 - -14. Let f(d) be the second derivative of d3/3 - d2 - d. What is oa(r) - 7f(r)? r - 1 Let g(n) be the first derivative of 2n*3/3 + 5n*2/2 + n - 1. Let j = 11 - 8. Let b(h) = -5h + h*2 - jh*2 - 1 + 0h + h. What is 3b(c) + 2g(c)? -2c2 - 2c - 1 Let h(c) = c*2 + c - 1. Let n be h(-3). Suppose -4u + 5 = x, -x - n = -u - 5x. Let g(o) = -4o*2 - 4o - 1. Let y(a) = -a*2 - a. Give ug(w) - 6y(w). 2w*2 + 2w - 1 Let n(f) = f*3 - 2f*2 + 2f + 2. Let w(l) = -l*3 - 4l*2 + 6l + 7. Let v be w(-5). Let z(j) = 2j3 - 3j*2 + 2j + 2. Calculate vz(u) - 3n(u). u*3 - 2u - 2 Let f(g) = 2g2 + 5g + 5. Let h(x) = 14x2 - 12x - 4. Let r(y) = 2y2 - y. Let l(j) = -h(j) + 8r(j). Give -4f(b) + 5l(b). 2b2 Suppose c = -2c + 30. Let u(d) = -7d2 - 2d + 5. Let s(j) = 0j2 - 3j2 - j2 - j + 3. Let y(r) = -3r + 6. Let h be y(4). Calculate cs(a) + hu(a). 2a*2 + 2a Let z(x) = -37x2 + 5x - 6. Let c(f) = 38f2 - 4f + 5. Calculate 6c(j) + 5z(j). 43j2 + j Let m(q) = -7q - 2. Let o = -6 - -26. Suppose -o + 0 = 4p. Let k(b) = -4b - 1. Calculate pk(z) + 3m(z). -z - 1 Suppose 5u = w + 22, w = -2w + 5u - 16. Let j(i) = 3i3 - i2 - 2i. Let q(x) = 4x*3 - 2x*2 - 3x + 1. Calculate wj(a) - 2q(a). a3 + a2 - 2 Let r(x) = x2 + x - 2. Let y(w) = -w2 - w + 1. Suppose -10l + 44 = -6. Give ly(c) + 3r(c). -2c*2 - 2c - 1 Suppose 4a + 14 = 58. Let y(h) = -4 - 11 + 11 + 2h*2. Let v(s) = 10 - 9s*2 + 3s*2 + 1. Calculate ay(t) + 4v(t). -2t*2 Let p(m) = -m. Suppose -2q - 3s - 54 = -3q, 5s = -q + 86. Let l be q/24 - 6/8. Let k(x) = -x2 + 2x. What is lp(f) + k(f)? -f2 Let w(q) = -3q*3 - 2q*2. Let h(v) = -6v*3 - 5v*2 - v. Give -2h(l) + 5w(l). -3l*3 + 2l Let h(l) = 8l2 - 6l + 13. Let w(g) = 7g2 - 5g + 12. Determine 6h(n) - 7w(n). -n*2 - n - 6 Let k(f) = -2f*2 - 7f + 3. Let s(a) = -a*2 - 3a + 2. Calculate -2k(j) + 5s(j). -j*2 - j + 4 Let f(j) = -9j*3 - 11j*2 - 7j + 13. Let m(n) be the third derivative of n6/30 + n5/12 + n4/8 - n3 - 7n2. Give 3f(z) + 7m(z). z3 + 2z*2 - 3 Let h(z) be the first derivative of -2z*2 + 5z + 3. Let d be (12/(-10))/(8/(-20)). Let w(l) = -3l + 4. Calculate dw(q) - 2h(q). -q + 2 Let p(d) = -6d*2 + d + 3. Let b(q) = -5q*2 + q + 3. Determine -7b(v) + 6p(v). -v2 - v - 3 Let o(g) = 17g3 - 6. Let x(v) = -v3 - 1. Give o(w) - 6x(w). 23w3 Let b(v) = v2 - v - 1. Let g(x) = 4x2 + 6x + 3. Determine 5b(q) + g(q). 9q2 + q - 2 Let v(c) be the third derivative of c4/12 - 2c2. Let w(d) be the second derivative of -d3/6 + 15d. Let g = 0 - 3. What is gw(h) - v(h)? h Let g = 0 - -2. Let r(l) = 2 + 3 - 4l - 6l2 + 2l2 + lg. Let z(o) be the third derivative of o5/60 + o4/24 - o3/6 - o2. Give -r(x) - 5z(x). -2x*2 - x Let v(n) = 8n - 11. Let i(x) = -7x + 10. Determine 6i(b) + 5v(b). -2b + 5 Suppose 2k - 4k + 3y = -5, 2k + 2y = 20. Let j(w) = -8w*2. Suppose -i - r + 1 = 0, -3i - 2r + 14 = i. Let c(q) = 7q*2. Give ij(s) + kc(s). s2 Let x(n) = -131n. Let m(i) = 33i. Determine -26m(z) - 6x(z). -72z Let b(v) = -v + 1. Let o = -3 - -6. Let x be 4 + (-3 - o/(-3)). Suppose u - 3 = xu. Let y(q) = -q + 1. What is ub(g) + 4y(g)? -g + 1 Let q(w) = 5w*2 + 4w + 4. Let y(x) = -x*2 - 1. What is q(g) + 6y(g)? -g*2 + 4g - 2 Let q(r) = r. Let w(o) = -2o. Calculate 8q(f) + 5w(f). -2f Suppose -2n + t + 27 = 0, -2 = -3t - 17. Let v(f) = -10f + 4f + 3 + 5f - 7. Let o(l) = -6l - 21. Determine nv(p) - 2o(p). p - 2 Let g(m) = -m - 1. Let x(k) = -k + 4. Determine 6g(p) - x(p). -5p - 10 Let v(i) = -i. Let d(p) = -5p - 1. Suppose 3y = 7 + 2. Give yv(j) - d(j). 2j + 1 Let s(n) be the second derivative of -3n5/20 - n4/6 - n3/2 + n. Let w(f) = -16f*3 - 11f*2 - 16f. Calculate 11s(j) - 2w(j). -j*3 - j Let f(g) = -3g*2 - g + 4. Let w(k) = -66 + 73 + 0k*2 - k - 6k*2. Calculate -7f(x) + 4w(x). -3x*2 + 3x Let x(m) = m*2 - m - 1. Let n(v) = -9v*2 - 5v - 5. Determine n(d) - 5x(d). -14d2 Let s(k) = -k2 + 5k2 - 9k*2 - 5 + 5k. Let x(g) = -2g2 - g - 2. Let c(h) = 3h*2 + 2h + 3. Let v(o) = -3c(o) - 5x(o). Calculate s(j) + 3v(j). -2j*2 + 2j - 2 Let f = 11 + 11. Let i(o) = -o*3 + 11o*2 + 11o + 11. Let x(l) = l*2 + l + 1. What is fx(h) - 2i(h)? 2h*3 Let k(q) = -3q2. Let x(j) = -j2. Suppose 7l - 6l + 4 = 3p, 2l = -2p - 8. Determine lk(w) + 11x(w). w2 Let a(n) be the second derivative of -n4/2 + n3/6 + n2/2 - 52n. Let j(f) = -5f2 + 2f*2 + 2f*2. Determine 2a(t) - 11j(t). -t2 + 2t + 2 Let u(y) = -4y3 - 3y*2 + 3y + 2. Let x(p) = -4p3 - 4p*2 + 4p + 2. Give -4u(t) + 3x(t). 4t3 - 2 Let i(d) = d2 - 1. Let g(u) = -4u*3 + 4u*2 - 4. Let m(w) = w - 9. Let v be m(5). Determine vi(b) + g(b). -4b3 Let a(j) = -2j*3 + 3j*2 + j + 2. Suppose 0z - 3z = 9. Let s(h) be the third derivative of -h6/120 + h5/60 + h4/24 - 24h*2. What is zs(l) + a(l)? l*3 - 2l + 2 Let y(l) = -9l + 17. Let i = 9 + -13. Let c be -215 - i/1. Let f(s) = 2s - 4. Determine cf(r) - 6y(r). 2r + 2 Let l(n) = -n3 + n + 3. Let d(b) be the third derivative of b6/60 - b*4/12 - 5b3/6 - b2. Determine -6d(u) - 10l(u). -2u3 + 2u Let s(u) be the first derivative of 8u3/3 + u2/2 - 4u - 14. Let g(q) = 23q2 + 3q - 11. Calculate 6g(k) - 17s(k). 2k2 + k + 2 Let z(r) = r2 - r. Let h(d) = -d3 - 2d*2 - 4d - 4. Let f(p) = -p*3 - 3p*2 - 5p - 5. Let w(b) = 3f(b) - 4h(b). Determine -w(l) - z(l). -l3 - 1 Let r(o) = -o2 - 1. Suppose 17n = 15n + 2. Let x(j) = -2j2 - 7. Give nx(u) - 5r(u). 3u2 - 2 Let g(s) = -s2 + s - 3. Let j be (-32)/12 - ((-20)/(-15) + -2). Let b(x) = 2x2 - 3x + 7. What is jb(p) - 5g(p)? p*2 + p + 1 Let z(i) = -3i + 5. Let u(j) = -2j + 4. Suppose 0 = -16a + 17a + 3. Give az(o) + 4u(o). o + 1 Let d(f) = f2 - f. Let k(r) be the first derivative of -2r*3/3 + 3r*2/2 - 3. What is 3d(n) + k(n)? n*2 Let s(j) = -1. Let y = 19 + -21. Let q(h) = h + 1. Calculate yq(f) - 2s(f). -2f Let j(n) = 4n2 + 1. Let s(w) = w2 + w + 1. Let r(y) = -j(y) + 6s(y). Let c(f) = 4f2 + 11f + 9. Give -6c(d) + 11r(d). -2d2 + 1 Let v(i) = -7i*3 - 2i*2 - 6i + 5. Let w(m) = -3m3 + m - 1 - 5m*3 + 9m*3. Give v(s) + 5w(s). -2s3 - 2s*2 - s Let y(p) be the second derivative of -2p*4 - 7p*3/3 + 7p*2 + 23p. Let x(v) = -5v + 0 + 2v + 3 - 5v2. Calculate 14x(o) - 3y(o). 2o*2 Let d(w) = -6w - 2. Let a(b) = 6b + 3. Calculate 4a(s) + 5d(s). -6s + 2 Let o(y) = 42y. Let i(c) = -c. Let w(b) = -35i(b) - o(b). Suppose -36 = -3f + 9f. Let q(h) = h. Determine f*	{ "pile_set_name": "DM Mathematics" }
he third derivative of 2o7/21 + 3o*6/8 - 13o*5/6 + 15o*4/8 + 10o*3/3 - 74o*2. Let j(y) = 0. Calculate y. -4, -1/4, 1 Determine u so that -3 - 10u*2 + 2u*3 - 23/2u = 0. -1/2, 6 Let l be ((-17)/51)/(11/(-6)). Factor 2t*4 + 16t*3 - 4 - 45t*2 + 16t*l - 5t*4 + 20t. -(t - 2)*2(t - 1)(3t - 1) Factor -5g4 + 5671 + 10g - 25g2 + 20g*3 - 5671. -5g(g - 2)(g - 1)*2 Solve -492 - 1106p*2 + 21p*5 + 288p*4 - 122 + 14 + 1365p*3 + 1260p + 3632p2 = 0. -5, -2, 2/7 Let c be 19 + 189/(-14) + -5. Suppose -5z + 35 = 5o, 0 = -2z - 3z + 2o. What is k in -k*z + 1/2k*4 + 0 + 0k - ck3 = 0? -1, 0, 2 Suppose -3l = -2q - 858, 4l + 6q - 1161 = 3q. Determine i so that 33i2 - li - i*2 - 2i*3 + 160i = 0. 0, 8 Let n(r) be the second derivative of -r7/56 + r6/20 - r*5/40 - 8r*3/3 + 7r. Let v(u) be the second derivative of n(u). Solve v(f) = 0. 0, 1/5, 1 Let p = -274 - -1554. Find r, given that -1288r2 + 28r*4 - 5r + pr2 + 5r - 20r3 = 0. -2/7, 0, 1 Let m = 30 + -89/3. Let y(g) be the first derivative of -g2 + 0g + mg6 + 0g*4 - 4/3g*3 - 3 + 4/5g*5. Factor y(t). 2t(t - 1)(t + 1)3 Let i = 9 + -10. Let s = i + 4. Solve v2 - 13v2 + 8v - 3v + sv*3 + 10v - 6 = 0 for v. 1, 2 Let b(a) be the second derivative of -1/45a5 + 1/135a*6 + 1/54a*4 + 0a*2 + 0 + 16a + 0a3. Factor b(z). 2z*2(z - 1)*2/9 Suppose 0g - 95 = -5f - 5g, 3g = -5f + 93. Suppose -f = -5z - z. Factor -10/7a*z + 6/7a*4 + 0 + 2/7a*2 + 2/7a. 2a(a - 1)*2(3a + 1)/7 Let a(q) = -20q*3 + 65q*2 + 55q - 25. Suppose 3 = -10c + 7c. Let j(m) = -m3 + m2 - m - 1. Let g(y) = ca(y) + 25j(y). Determine h so that g(h) = 0. -4, 0 Let s be ((-9)/(-15))/(3/(-15)). Let f = 6 + s. Factor -52k + 0k*f + 3k*3 + 55k + 6k2. 3k(k + 1)2 Let l = -149 + 166. Suppose -34 = -34y + ly. Determine s so that -11/3s + 1/3s5 - 1/3s*4 - 2s*3 + 1 + 14/3sy = 0. -3, 1 Let x(s) be the third derivative of s7/315 - 2s6/45 - 2s*5/15 + 20s*4/9 + 128s3/9 + s2 - 272s. Factor x(m). 2(m - 8)(m - 4)(m + 2)*2/3 Let j(o) be the second derivative of 2o*4/9 - 11o3/18 + o2/2 + 3o - 1. What is d in j(d) = 0? 3/8, 1 Suppose -5x + x = 0. Suppose x = 2v - 5v + 12. Factor -12q4 + 18q + 2q5 + 8 - vq*2 + 28q*3 - 28q*2 - 12. 2(q - 2)(q - 1)4 Let o(y) be the first derivative of -13y*3 - 48y*2 - 36y - 582. Factor o(t). -3(t + 2)(13t + 6) Let f(s) be the second derivative of -3s5/160 + s4/16 + 9s3/16 - 27s*2/8 + 4s + 18. Solve f(q) = 0 for q. -3, 2, 3 Let f(t) = -t*3 + t + 4. Let p be 0/91/(-2). Let z be f(p). Factor x*5 + 16x*4 - zx*4 - 48x - 48x2 + 4x*5 - 2x*5. 3x(x - 2)(x + 2)*3 Suppose 9u = 7u + 24. Suppose -3y - 8m + 12 = -um, 0 = -2y + m + 8. Find j such that -1/3j*y - 8j - 22/3j2 - 8/3j*3 - 3 = 0. -3, -1 Solve 2/3y + 0 + 2y3 - 2y*2 - 2/3y*4 = 0. 0, 1 Let v(m) = 7m*3 + 45m*2 + 133m + 137. Let q(j) = 190j3 + 1215j*2 + 3590j + 3700. Let z(x) = -2q(x) + 55v(x). What is p in z(p) = 0? -3 Let y(x) be the second derivative of 1/180x6 + 2x*2 + 0 - 4x + 0x4 + 0x*3 + 1/45x*5. Let n(c) be the first derivative of y(c). Factor n(q). 2q*2(q + 2)/3 Let i be ((-2)/(-6))/(-1 - (-217)/126). Find x such that 2/13x5 - 4/13x*2 - 2/13 + 4/13x*3 - 6/13x + ix4 = 0. -1, 1 Let u(j) be the first derivative of 2j*3 - 38j*2/3 + 16j/3 + 19. Determine f, given that u(f) = 0. 2/9, 4 Let a(v) = -3v - 4. Let u be a(-2). Factor ud*2 - 44d*2 + 87d - 119d - 8 - 18d*3. -2(d + 1)(3d + 2)2 Let s(c) = -c3 - 8c2 - 16c - 3. Let q(w) = -w*2 + 2w + 1. Let p(l) = -6q(l) - 2s(l). Factor p(n). 2n(n + 1)(n + 10) Let x(h) be the third derivative of h5/15 + 2h*4/3 - 8h*3 - 4h*2 + 10h. Find i such that x(i) = 0. -6, 2 Let i(c) = 2c2 - 16c + 19. Let t be i(7). Suppose 0 + 0n2 - 7/8n*t + 1/4n*3 + 0n + 5/8n4 = 0. What is n? -2/7, 0, 1 Let v(h) be the third derivative of -5h8/12096 + h6/540 + 13h5/30 + 3h2. Let m(a) be the third derivative of v(a). Suppose m(b) = 0. Calculate b. -2/5, 2/5 Let n(f) be the third derivative of -f7/1120 + f6/288 - f5/240 - f*3/6 - 9f*2. Let g(x) be the first derivative of n(x). Factor g(t). -t(t - 1)(3t - 2)/4 Suppose -k = 4o - 21, -4o + 15 = 6k - 3k. Let n(w) be the third derivative of 0 - 1/330w5 + 0w*3 + 0w + ow2 - 1/132w4. What is b in n(b) = 0? -1, 0 Let l(o) = -o3 + 11o2 - 16o - 21. Let k be l(9). Let r be k/6 - (0 + (-34)/20). Factor 0m2 - 2/5m*3 + rm - 4/5. -2(m - 1)2(m + 2)/5 Factor -318 + 3c + 8c*2 + 194 - 164c - 83c. 4(c - 31)(2c + 1) Suppose 79o = 76o + 2u + 22, -5u = o + 21. Determine r, given that 3/4ro + 15/4r*3 + 3/2 + 27/4r*2 + 21/4r = 0. -2, -1 What is o in 139 - 4o2 + 32o - 206 + 103 = 0? -1, 9 Let l(p) be the second derivative of 1/30p5 + 1/3p*3 + 0p*2 + 5/12p*4 + 0 + 1/900p*6 - 2p. Let m(n) be the second derivative of l(n). Factor m(v). 2(v + 5)2/5 Let y = -54 - -57. Let u be (-2 + 29/15)(-3 - y). Factor ua2 - 2/5 + 0a. 2(a - 1)(a + 1)/5 Factor 0z4 + 0 + 0z + 18/7z3 + 0z*2 - 2/7z*5. -2z*3(z - 3)(z + 3)/7 Let j be (-33)/(-44) + 2/8. Let w be 26 - (3 + -5)j. Factor 12 + 75d2 - 63d - 25d + wd. 3(5d - 2)*2 Let t(d) = -4d*2 - 38d - 202. Suppose 13 = 2f + 9. Let p(w) = 9w*2 + 75w + 405. Let u(z) = fp(z) + 5t(z). Factor u(l). -2(l + 10)2 Let f(d) be the second derivative of d7/7 - 14d*6/15 + 13d*5/10 + 3d*4 - 20d*3/3 - 8d*2 + 3d. Factor f(i). 2(i - 2)3(i + 1)(3i + 1) Let g(z) = -8z3 - 68z*2 - 146z - 34. Let x(s) = -8s3 - 69s*2 - 147s - 35. Let p(c) = -3g(c) + 2x(c). Solve p(h) = 0. -4, -1/4 Let y(u) be the third derivative of -u*8/3360 - 11u*7/2100 - 7u*6/200 - 7u*5/60 - 53u4/240 - u3/4 + 99u2 - 1. Factor y(t). -(t + 1)3(t + 3)(t + 5)/10 Let w(c) be the first derivative of -4 + 1/10c*4 - 8/15c*3 - 4/5c + c*2. Factor w(p). 2(p - 2)(p - 1)2/5 Let p be 3 + (0 - 0)/3. Let 12b + b*3 + 11 - 1 - 2 + 0b*p + 6b*2 = 0. What is b? -2 Let t(q) be the third derivative of 1/108q*6 + 8/27q3 - q2 - 1/135q5 + 0q + 0 - 5/27q4. Factor t(l). 2(l - 2)(l + 2)(5l - 2)/9 Let d(c) be the first derivative of 2c*5/5 + 15c*4/2 - 34c*3 + 53c*2 - 36c - 337. Factor d(f). 2(f - 1)3(f + 18) Let l(m) be the second derivative of -m6/120 + m5/20 - m*4/12 + 4m*2 - 3m. Let u(s) be the first derivative of l(s). Find x, given that u(x) = 0. 0, 1, 2 Let a be 4 + (1 - 1 - (-234)/(-6)). Let s = a + 176/5. Factor -2v2 - 4/5v*3 - sv + v*5 + 8/5v*4 + 2/5. (v - 1)(v + 1)*3(5v - 2)/5 Let p = 2723/20 - 136. Let v = p - 1/20. Factor 9/10o + 27/10o3 - v - 27/10o*2. (3o - 1)*3/10 Suppose 90v = 107v - 51. Factor 2/11t - 2/11tv + 6/11 - 6/11t*2. -2(t - 1)(t + 1)(t + 3)/11 Suppose -18800s2 + 18808s*2 + 73s - 14 - 19s = 0. What is s? -7, 1/4 Let r(w) be the second derivative of 3w*5/20 - 2w4 - w3/2 + 12w2 - 22w - 6. Factor r(j). 3(j - 8)(j - 1)(j + 1) Let d(m) be the second derivative of m5/50 - 43m*4/30 - 136m*3/15 - 92m*2/5 + 28m - 7. Factor d(u). 2(u - 46)(u + 1)(u + 2)/5 Let f = -1541/140 - -223/20. Determine n, given that 9/7 + n2 - 15/7n - fn3 = 0. 1, 3 Suppose 2/13h*2 - 14/13h - 2/13h4 + 0 + 14/13h3 = 0. What is h? -1, 0, 1, 7 Let y(o) be the first derivative of o3/3 + 8o2 + 64o + 594. Solve y(u) = 0. -8 Let f = 1 - -4. Suppose 4g + d = 13, d + d = fg. Solve -2tg - 4/3 - 10/3t = 0 for t. -1, -2/3 Let n(s) be the first derivative of s7/252 - s5/30 - s4/36 + s3/12 + s*2/6 - 2s + 4. Let h(f) be the first derivative of n(f). Factor h(i). (i - 2)(i - 1)(i + 1)*3/6 Solve -26/11i*2 - 2/11i*3 - 52/11i + 80/11 = 0 for i. -10, -4, 1 Let k be (6/12)/((-30)/(-12)) + 0. Factor -4/5w3 - 2/5w - kw4 - w2 + 0. -w(w + 1)*2(w + 2)/5 Let k(h) = 5h + 3. Let o be k(13). Suppose 151s*4 - 38s*4 + 14s*5 + 54s + 20 - 80s2 - os*3 - 53s**4 = 0. What is s? -5, -1, -2/7, 1 Let z = -29 - -33. Suppose 3	{ "pile_set_name": "DM Mathematics" }
680r3 - 600r*2 - 24r Differentiate 323q4 - 2q*2 + 559 wrt q. 1292q*3 - 4q Find the second derivative of -2729p2 + 14p + 51. -5458 Differentiate -58m3 + 4m*2 - 2mu - 128u + 3 with respect to m. -174m2 + 8m - 2u What is the first derivative of 87w*3 - 5w + 797? 261w2 - 5 Find the third derivative of -3a*5p - 38a4p*3 + 4a*2p + 7a2 - 4ap3 wrt a. -180a*2p - 912ap*3 Find the third derivative of -5ay6 + 5ay4 - 4a - y*2 + 2y wrt y. -600ay*3 + 120ay Differentiate 11l*2n - 1411l2 - 46ln4 wrt n. 11l*2 - 184ln3 What is the second derivative of 8f*5 - 3f*2 - 179f? 160f3 - 6 What is the second derivative of 517m*2 - 199m wrt m? 1034 What is the second derivative of 4008w5 + 3696w? 80160w3 What is the first derivative of 51hjm + hj + 51hm2 - h + jm*2 wrt j? 51hm + h + m2 Find the third derivative of -2k6 - k4 + 18681k2 wrt k. -240k*3 - 24k What is the first derivative of 1202a2r*2 - 4a*2 + 274a + 2 wrt r? 2404a2r What is the first derivative of -224f2k - 2k + 22 wrt f? -448fk Differentiate -2d*3 + 543d - 3371. -6d2 + 543 Find the third derivative of 454f*5 + 635f*2. 27240f*2 What is the derivative of 15675g + 9710 wrt g? 15675 What is the derivative of -6d2j*2n + 6d2n - 2d2 - 132dj2 + jn*2 wrt n? -6d*2j*2 + 6d*2 + 2jn Find the second derivative of -6c*2u*2 - 5c*2 + 51cu4 - 15cu - 19c + u*3 wrt u. -12c*2 + 612cu2 + 6u What is the first derivative of 11837l + 9762 wrt l? 11837 Find the third derivative of 4059r*6 + 11557r*2. 487080r3 Find the third derivative of -f4lr - 342f4 - 2f*3lr - 7f*2lr + f2r - 6fr + 5f wrt f. -24flr - 8208f - 12lr Find the second derivative of -10f*2jz3 - 7f*2j + 4f2z*3 + fjz2 + fjz + jz + 3z3 wrt f. -20jz3 - 14j + 8z3 Differentiate 522i*3z - 48i3 + 4i*2 wrt z. 522i*3 Differentiate -537o*2 + 171 with respect to o. -1074o What is the derivative of 14j2l*2w + 18j2lw + 9l*2w + 112w wrt j? 28jl2w + 36jlw What is the first derivative of -7903h*2 - 13314? -15806h Find the second derivative of 7720a3 + 2a + 1800. 46320a Differentiate -3991y*4 - 808 wrt y. -15964y3 What is the derivative of t4x - 121t*3x - 17x + 26 wrt t? 4t*3x - 363t2x What is the third derivative of -2b3p*2 - 45b3 - b2p2 - 209b*2p wrt b? -12p2 - 270 What is the derivative of -195hrw + 4hw - 420h - 7rw wrt r? -195hw - 7w Find the second derivative of -1221x2z*2 + 2x*2 - 832z wrt z. -2442x2 What is the first derivative of 10600v*4 - 25539 wrt v? 42400v*3 Find the third derivative of -2602p3 - p2 + 598p. -15612 What is the second derivative of -3jo2s*5 - 8jo2s + 4jos - 2219js3 - 4o*2s + 4o2 + 2s wrt s? -60jo*2s*3 - 13314js Find the third derivative of -2i*3r*3x*2 - 56i*3rx3 - 25i*2rx3 - 13i*2x - 2ir*3 wrt i. -12r*3x*2 - 336rx3 Find the second derivative of 11gmo*3 - 8gm - 3go3 + g + 2mo3 - 2mo wrt o. 66gmo - 18go + 12mo Differentiate 5n4 - 534n*3 - 6596 wrt n. 20n*3 - 1602n*2 What is the third derivative of -286i*3nz2 - i3z - 7i3 - 10i*2z - 2inz2 - 2nz + 2z*2 wrt i? -1716nz2 - 6z - 42 Find the third derivative of 1608z5 + 506z*2 wrt z. 96480z2 What is the third derivative of h2k3x + 2h2k + h*2 + 20hk2 + hx + 796k3x + 2k3 - kx wrt k? 6h2x + 4776x + 12 What is the second derivative of 5040n*2 - 753n? 10080 What is the first derivative of -ow2 - 3ow + 10o + 2w3 + 4 wrt w? -2ow - 3o + 6w2 What is the first derivative of -kr + 5ks*2 - 3k + 27rs*4 - 13r wrt s? 10ks + 108rs*3 Find the first derivative of 98k*3u*4 - 787k*3 + 2k*2u*4 wrt u. 392k*3u*3 + 8k*2u*3 What is the derivative of 4g*2i + 14g2q2 - g2q + 37giq2 + q2 wrt i? 4g2 + 37gq2 Differentiate 78m3 - m2 + 976. 234m2 - 2m What is the first derivative of -265o3u - o*3 + 2o*2u - 2938u wrt o? -795o*2u - 3o2 + 4ou What is the derivative of -393c*3q*3 + 290c*3 wrt q? -1179c*3q*2 What is the second derivative of 9537b*2 + b + 14364 wrt b? 19074 What is the second derivative of -312z*4 - 26z + 2 wrt z? -3744z2 What is the derivative of -2h*3j - 9h3 - 16h*2 + hj*2 + 902j wrt j? -2h3 + 2hj + 902 Find the second derivative of -249s*4 + 2s - 138 wrt s. -2988s2 Find the second derivative of 1009h*3 - 2h + 384 wrt h. 6054h Differentiate -14n*2q*2 - 3n*2q - 2n2 - nq*2 - 137 with respect to q. -28n*2q - 3n2 - 2nq Find the third derivative of -5fh3 - 2fh2 + 3h5 + h3 + 43h2 wrt h. -30f + 180h2 + 6 Find the third derivative of -3sy3 - 182sy2 - 44y*4 wrt y. -18s - 1056y Find the first derivative of -1544fj - 964j + 2 wrt f. -1544j Find the third derivative of 28j*5 - 7j*3 - 1918j*2 wrt j. 1680j*2 - 42 What is the second derivative of -3795v*5 - 104v + 15 wrt v? -75900v3 Find the third derivative of 1943h3 - h2 + 122 wrt h. 11658 What is the second derivative of b*5j + 116b5 - 2b*2j*3 - 123bj3 + 2j*3 wrt b? 20b*3j + 2320b3 - 4j*3 What is the second derivative of -101q3 + q2w2 + 2qw2 - 2q - 2w2 wrt q? -606q + 2w2 Find the second derivative of 89w*3 - w - 9. 534w Find the third derivative of 11814j6o*2 - 11473j*2o - 2jo*2 wrt j. 1417680j*3o*2 Find the second derivative of 978o*5 - 2371o wrt o. 19560o3 Find the third derivative of 2347o*5 - 2799o*2. 140820o*2 Find the second derivative of 13967z*5 - 1731z + 3 wrt z. 279340z3 Differentiate 7n*2q - 126n2 - 2nq2 - 4q + 2 with respect to q. 7n2 - 4nq - 4 Find the second derivative of -j4 - 303j*2 - 517j. -12j2 - 606 Find the third derivative of -3p*6 + 7p*3 - 291p*2. -360p*3 + 42 Differentiate -176l*2 + 115 wrt l. -352l What is the second derivative of 29c2h*2 - 10c*2h + 7c2x*2 + 36cx2 - 2h*2x*2 - hx - 1 wrt x? 14c2 + 72c - 4h2 Find the second derivative of 67b*5 - 2b*2 + 164b. 1340b3 - 4 What is the first derivative of -129f*2r + 2f2 - 22f - 4r + 6 wrt r? -129f*2 - 4 What is the derivative of 638b*2o*3 + 3b*2o - 16b2 + 12 wrt o? 1914b*2o*2 + 3b*2 Find the second derivative of -4b*3h*3 - 20b*3h + 3b3 - 116b*2h*2 + 7b*2h + h*3 wrt h. -24b*3h - 232b2 + 6h What is the second derivative of -3b3l2 + b3l - 25b*2l*2 + 16b*2l wrt l? -6b3 - 50b*2 Find the third derivative of -3d*6r*2 + 85d*4r*2 - 81d*2r*2 - 9d*2 wrt d. -360d*3r*2 + 2040dr2 What is the third derivative of 3klx*3 - 5klx - 2kl - 2kx*3 - 2kx2 - 4k + 8lx*3 wrt x? 18kl - 12k + 48l What is the third derivative of 68x*3 + 3175x*2 - 2x? 408 What is the second derivative of -192p2 + 544p? -384 Find the second derivative of -d*2n*3 + 101d*2n*2 - 9d*2 - 4dn3 - 2dn2 + 318n*3 wrt d. -2n*3 + 202n*2 - 18 Find the third derivative of 17a*3o*3 + 14a*3 - 15a*2o*4 + 5o*2 wrt o. 102a*3 - 360a*2o Find the third derivative of -10j5 + j4 + 75j*3 + 5j*2 + 755j wrt j. -600j2 + 24j + 450 Find the second derivative of -2f2iy - 974f*2i + 2f + 16iy + y wrt f. -4iy - 1948i Find the second derivative of 5c2p*2t2 + c2p2 + 5c*2 - 2cp2t*2 + cp - 5p2 wrt c. 10p*2t*2 + 2p*2 + 10 Differentiate 5dx3 + 1248d - x*4 + 36x*3 with respect to x. 15dx2 - 4x*3 + 108x*2 What is the second derivative of 4h*2n*2y - h*2ny + 2hn2y - 20hn*2 + 2ny wrt h? 8n*2y - 2ny What is the third derivative of 30g2v*3 + 2g*2v*2 - 10gv2 - 3v*4 - 30v wrt v? 180g2 - 72v What is the derivative of -2cds3 - 49cd + 36cs3 + 7cs2 + 2cy2 - 7dsy*2 + 2s*3y*2 wrt d? -2cs3 - 49c - 7sy**2 What is	{ "pile_set_name": "DM Mathematics" }
l(d) = 3d. Let m(r) = -r2 + r. Let p be (-2)/8 - 2/((-40)/(-55)). Give pm(x) + l(x). 3x2 Let g(v) = -8v*3 + 7v*2 + 7. Let f(t) = 3t. Let y be f(2). Let u(i) = 6 + yi2 - 2i*3 - 7i*3 + 2i*3. Let d = -136 - -143. What is du(m) - 6g(m)? -m3 Let h(y) = y2 - 2y + 10. Let u(j) = j*2 - 2j + 9. Give -4h(n) + 3u(n). -n*2 + 2n - 13 Let u(h) = h*2 + 8h - 1. Let q be u(-7). Let l = 13 + q. Let z(t) = 6t3 + t. Let m(k) = -k3. What is lm(n) + z(n)? n*3 + n Suppose 30m - 37m = 21. Let g(x) = 3x*2 + 4x. Let c be (-1)/(-2) + 18/4. Let k(w) = w*2 - 2w + cw + w2. Calculate mg(d) + 4k(d). -d2 Let h = -6 - -10. Suppose 2k + 3g - 2 = 5, 3g - 9 = 0. Let z(j) = -j - 1. Let m(f) = f*2 - 3f - 2. Determine hz(t) + km(t). -t*2 - t - 2 Let m(w) = -5w + 2. Let k(x) be the first derivative of 3x2/2 - x - 1. Let n = -5 + 13. Give nk(c) + 5m(c). -c + 2 Let j(w) = -3w + 3w + w2. Let p(b) = 6b*2 + b. Let u be -15((-1)/(-3))/1. Let y = 2 - 1. What is uj(t) + yp(t)? t*2 + t Let d(z) = -3z*2. Let r(j) = 4j*2 + j. What is 3d(b) + 2r(b)? -b2 + 2b Let n(d) = -15d2 - 4d - 5. Let k(w) = -w*2 + w + 1. What is 5k(b) + n(b)? -20b2 + b Let g(k) = -k2 + k. Let y(z) = -11z*2 - 5z. Determine -5g(q) - y(q). 16q*2 Let k(z) = -5z + 8. Let c(y) = 7y - 3y - 2 - 3y. Suppose 0 = -0i - 4i + 2a + 18, i = -4a - 18. Give ik(s) + 9c(s). -s - 2 Let i(x) = -12x + 3 + 27x2 - 8x + 6x - 4x*2. Let o(s) = 8s*2 - 5s + 1. Give 6i(m) - 17o(m). 2m2 + m + 1 Let h(k) = -29k*2 + 2k + 2. Let z(r) = 465r2 - 33r - 33. Determine 33h(w) + 2z(w). -27w2 Let d(c) = 4c*2 + c + 4. Suppose -3r + h + 6 = 0, 2r + 2h - 12 = -0h. Let n(z) = 3z + 6 + z*2 + 8z*2 + r. Calculate -5d(o) + 2n(o). -2o*2 + o - 2 Let z(b) = 11b*3 + 4b*2 - 4b - 4. Let g(y) = -133y3 - 49y*2 + 49y + 49. Calculate -4g(s) - 49z(s). -7s3 Let k(i) = 6. Let u(x) = x - 17. Let v = -60 - -77. What is vk(q) + 6u(q)? 6q Let g(n) = -8n2 - 2n*2 + 12n*2 - 2n - 2. Let p(q) = q*2 - 1. Give -g(y) + 3p(y). y*2 + 2y - 1 Let h(i) = -i - 1. Let m(r) be the third derivative of 0r - 1/12r4 - r2 - 5/6r3 + 0. Let o(t) = -t + 9. Let x be o(6). Determine xh(q) - m(q). -q + 2 Let g(n) = n - 7. Let j be g(10). Let m(x) = -3x3 + 4x*3 + 2x3 + xj - 2x - 2. Let k(b) = 9b*3 - 5b - 5. What is 2k(l) - 5m(l)? -2l3 Let c(g) = -g. Let t(l) be the third derivative of l4/6 - l3/6 + 6l*2 + 9l. Let i be (-86)/18 - 4/18. Calculate ic(b) - t(b). b + 1 Let v(z) = 5z - 1. Let p(q) = -16q + 2. Give -3p(s) - 8v(s). 8s + 2 Let n(w) = -3w3 + 5w*2 + 5. Let q(p) = -4p*3 + 6p2 + 6. Let b(t) = -t3 - 30t2 - 56t - 5. Let s be b(-28). Determine sq(h) + 6n(h). 2h3 Suppose 32 = -5i + i. Let z(f) = 6f - 8. Let d = 4 + -2. Let u(l) = -1 - 4l + d + 4. Calculate iu(r) - 5z(r). 2r Let a(m) = 14m + 2. Let t(r) = 1. Give -a(d) - 2t(d). -14d - 4 Let w(r) be the third derivative of 1/3r3 + 0r + 0 + 5r2 - 1/24r*4. Let z(m) = 5m - 8. Give 9w(l) + 2z(l). l + 2 Let q(o) = 4o2 - 3o - 6. Let i(s) = s*2 - s - 1. Calculate 6i(m) - q(m). 2m2 - 3m Let d(f) = 8 + 0f - 2 - 7f. Let g(o) be the second derivative of -13o3/6 + 11o*2/2 - 3o. Let n = -2 - -8. Determine ng(i) - 11d(i). -i Let c(z) = 10z. Let r(s) be the first derivative of -9s*2/2 - 17. Give -3c(d) - 4r(d). 6d Let z(w) = -2w + 1. Suppose -2o = 3o - 35. Let y(j) = -5j + 3. Let t(f) = -3 + 2f - 2f*2 + 2f + f*2. Let c be t(4). Calculate cy(q) + oz(q). q - 2 Let o(s) = 9s*2 - 29s - 5. Let j(q) = 4q2 - 15q - 2. Give -5j(a) + 2o(a). -2a2 + 17a Let m(w) = 14w + 11. Let x(g) = g + 0g - 5g - 4 - g. Calculate 4m(q) + 11x(q). q Let m(y) = -13y - 7. Suppose 2z + 40 = 7z. Let u(v) = 4 + v + 1 + zv. Let i = 16 + -9. Determine iu(o) + 5m(o). -2o Let p(w) = -1. Let q(y) = -5 + 4y + 3y - 4y - 5y. Let o be q(-4). Let k(r) = -r*2 - 2 + 0r*2 + 4. Determine op(s) + k(s). -s2 - 1 Let v(t) = t3 - 2t2 + 3t. Let y(i) = 5i3 - 9i*2 + 13i - 1. Let n(g) = -g*2 - g - 2. Let p be n(-1). Calculate py(s) + 9v(s). -s3 + s + 2 Let h(w) = 5w*3 + 25w*2 - 4w - 4. Let r(v) = v3 + v2 - v - 1. Determine -h(c) + 4r(c). -c3 - 21c*2 Let o(k) = -29k*3 + 6k*2 - 6. Let n(z) = 2205z*3 - 455z*2 + 455. Calculate -6n(s) - 455o(s). -35s*3 Let j(a) be the first derivative of -2a*3/3 - 5a2/2 - a - 3. Let k(t) = t2 + 3t. Give -3j(z) - 5k(z). z2 + 3 Let b(q) = -5q*3 - 5q - 5. Let a(g) = 2g3 + 2g + 2. What is -8a(n) - 3b(n)? -n*3 - n - 1 Let b(n) = -3n*3 + 15n*2 - 15n + 15. Let d(t) = -t*2 + t - 1. Give 3b(j) + 45d(j). -9j3 Let k(f) = -f3 + 5f2 + 5f. Let w(t) = -3t - 3. Let u be w(-3). Let l(i) = 2i*3 - 6i*2 - 6i. Calculate uk(m) + 5l(m). 4m3 Let p = 7 + 3. Let y = p - 6. Let m(r) = -y + 8 - 3. Let f(x) = -x. What is f(s) - 2m(s)? -s - 2 Let x(t) = -13t + 25. Let j(u) = 3u - 6. Determine -9j(k) - 2x(k). -k + 4 Let i(b) = -b*3 + 5b*2 + 2. Let p(z) = -4z*2 - 1. Determine -2i(n) - 3p(n). 2n*3 + 2n*2 - 1 Suppose -5n = -1 + 11. Let z(u) = -4u. Let r(o) be the first derivative of 5o*2/2 + 20. Determine nr(b) - 3z(b). 2b Let y(o) = 5o3 - o2 + 3o + 2. Let g(w) = w*3 - w. Calculate -3g(f) - y(f). -8f3 + f2 - 2 Let t = 12 - 5. Let d(z) = 6z - 4. Let f(q) = 11q - 7. Let s(b) = td(b) - 4f(b). Let a(h) = -h - 1. What is -a(l) + s(l)? -l + 1 Let q(o) = -4o - 2. Let h(u) = -u + 3. Let j(r) = -3r + 7. Let y(x) = 5h(x) - 2j(x). Calculate q(t) + 3y(t). -t + 1 Suppose 13q + 3 = 10q. Let s(v) = -2v3 - 4v*2 - 2v. Let a(p) = -p3 - p2. Give qs(k) + 4a(k). -2k3 + 2k Let v(c) = -4c2 + 5c - 2. Let l(u) = -u - 3u + 2 - 34u*2 + 37u*2. Let a be -1(1-5 - 1). Calculate al(b) + 5v(b). -2b*2 + b + 2 Let o(w) be the third derivative of -7w4/24 - w3/2 - w*2 - 5. Let m(l) = l. What is -6m(y) - o(y)? y + 3 Let c(t) = 6t3 + 5t2 - 5. Let f(g) = -g3 - g*2 + g + 1. What is -c(p) - 5f(p)? -p*3 - 5p Let l(x) = x*2 - x - 1. Let h(v) = 6v*2 - 6v - 4. Determine -h(u) + 4l(u). -2u*2 + 2u Let c(d) = -2d2 - 3d + 3. Let b be (-294)/28 - (-1)/(-2) - 3. Let w(s) = -5s2 - 7s + 7. Determine bc(z) + 6w(z). -2z2 Let r(h) = 18h - 2. Let j(a) = 9a - 1. Calculate -5j(p) + 2r(p). -9p + 1 Let o(z) = -z*2 - 3z - 4. Suppose 2g - 44 = -2g. Suppose 0 = -4x - g - 5. Suppose -2b - 34 + 12 = 0. Let r(u) = 3u2 + 8u + 11. Give bo(j) + xr(j). -j*2 + j Let w = 5 + -2. Suppose 0 = -p + 1, 2v - wp + 24 = -p. Let c = 18 - 12. Let f(a) = 4a - 13. Let t(x) = 2x - 7. Determine cf(d) + vt(d). 2d - 1 Let g(t) = 3t3 + 2t*2 + 9. Let f(l) = 4l*3 + 3l*2 + 10. Determine -2f(h) + 3g(h). h3 + 7 Let b(r) = 4r*3 + 3r*2 - 2r. Let s(h) = 13h + 7h*2 + 9h*3 - 9h - 9h. Suppose -4o = -m - 32 + 8, -2m + 18 = 3o. Determine os(k) - 14b(k). -2k3 - 2k Let f(i) = 0i - 9i + 10i + 5. Suppose 0o = -4o + 12. Let g(j) = 1. Give og(k) - f(k). -k - 2 Let s(n) be the second derivative of n3/6 - n2/2 - 45n. Let x(w) = w + 1. What is -3s(v) - 3x(v)? -6v Let b(u) = -18u3 + 5u*2 + 5u + 5. Let s(c) = -91c3 + 26c*2 + 26c + 26. Give 26b(r) - 5s(r). -13r3 Suppose 6 = v + v. Let b(z) = -2z*2 - 3z - 3. Suppose -4c + 101 = -4k + 41, 2c - 16 = k. Let g(w) = -10w*2 - 14w - 14. Give kb(q) + vg(q). -2q2 Let c(o) = o2 + 39. Let k(h) = -h2 - 1. Calculate -c(b) - 2k(b). b*2 - 37 Let u(j) = -4j + 2. Suppose 3z = 5m + 13 + 4, 2m - 3z + 14 = 0. Let h(c) = c + 1. What is mh(p) + u(p)? -5p + 1 Let g(u) = -10. Let h(k) = k - 51. Calculate 11g(w) - 2h(w). -2w - 8 Let t(a) = -5a. Let n(j) = j*2 - 5j. Let x be n(6). Let s(w) = 6w. What is xs(y) + 7t(y)? y Let d(q) = 36q*3 - 21q*2 - 21q. Let f(w) = -7w3 + 4w*2 + 4w. Calculate -4d(u) - 21f(u). 3u3 Let k(g) = -2g2 + 0 + g2 + g*3 - 1. Let m be -2 - -2(-1)/(-2). Suppose -2w - 2 = 4. Let d(l) = -2l*3 + 3l*2 + 3. Calculate md(f) + wk(f). -f3 Let l(p) = -20p*2 - 17p - 17. Let j(n) = -7n2 - 6n - 13. Let f(o) = 7o	{ "pile_set_name": "DM Mathematics" }
36 - 29c3/6 + c2 - 1. Let h(f) be the first derivative of n(f). Factor h(b). -2(b + 1)(b + 5)/3 Let n(c) = 17c*2 - 136c + 155. Let x be n(7). Solve 0 - 126u2 - 10/3u*5 - 102u*3 - 94/3u*4 - xu = 0. -3, -2/5, 0 Let y(w) = 3w3 + 90w*2 + 667w + 23564. Let u be y(-31). Factor -5/2l - 1/2l*u + 0 + 5/2l*3 + 1/2l*2. -l(l - 5)(l - 1)(l + 1)/2 Let w = -49 + 52. Determine x so that -4x5 - 11x*2 + 4x*w - 75x*4 + 39x*4 + 47x*2 = 0. -9, -1, 0, 1 Factor 8y*4 + 788544 + 5y*4 + 515040y - 6y4 + 0y*4 - 3y*4 + 80548y*2 - 1160y*3. 4(y - 148)*2(y + 3)2 Let p(t) = t3 + 296t - 222. Let a(b) = 3b*3 - 22b*2 + 1182b - 888. Let l(z) = 3a(z) - 11p(z). Factor l(u). -2(u - 3)(u - 1)(u + 37) Let u(i) be the third derivative of i6/300 + 13i*5/75 + 71i*4/60 + 46i*3/15 + 4i*2 + 4i - 18. Factor u(n). 2(n + 1)(n + 2)(n + 23)/5 Suppose 7h + 8 + 246 = 149h - 15h. What is c in -15/4ch - 5/4c*4 + 25/4c*3 + 0c + 0 - 5/4c5 = 0? -3, 0, 1 Solve -1335905u + 667539u - 3240 + 673216u + 15u2 = 0. -324, 2/3 Let u(z) be the second derivative of 25z - 34/5z3 + 1 + 2601/5z*2 + 1/30z*4. Suppose u(k) = 0. Calculate k. 51 Solve -33b + 94 - 9091b3 - 10 - 3b*2 - 11b + 9092b3 + 2b*2 = 0. -7, 2, 6 Suppose -14j = -21j. Let t(l) be the second derivative of -22l + j - 1/90l6 - 1/60l*5 + 0l*3 + 1/36l*4 + 0l*2 + 1/126l7. Factor t(g). g2(g - 1)2(g + 1)/3 Let w(t) be the third derivative of 3t8/896 + t7/140 - 19t6/320 - t5/20 + 3t4/16 + 310t*2. Suppose w(l) = 0. Calculate l. -3, -1, 0, 2/3, 2 Let t(y) be the third derivative of -1/60y*6 + 1/140y*7 + 0y - 30y2 - 1/30y*5 + 0y*3 + 0y*4 + 0. Suppose t(k) = 0. What is k? -2/3, 0, 2 Suppose 0 = -2s + 8, 5s = 4o + 2070 + 1574. Let x = -902 - o. Let 4/9y3 - 8/9 - 40/9y + 14/9yx - 14/3y*2 = 0. Calculate y. -1, -2/7, 2 Let b(c) be the first derivative of 5c*6/6 + 443c*5/3 - 3745c*4/6 + 3010c*3/3 - 4525c*2/6 + 755c/3 - 9801. Determine y so that b(y) = 0. -151, 1/3, 1 Suppose -33u = -30u + 18. Let d be 3 - -212/u. Let m(i) = -i2 + i + 1. Let n(r) = -10r*2 + 6r + 7. Let f(o) = dn(o) + 36m(o). Factor f(p). 4(p + 1)(p + 2) Let w(n) be the first derivative of 2n3/3 - 1462n*2 + 1068722n - 1718. What is v in w(v) = 0? 731 Let p(f) be the third derivative of -f*5/40 + 119f*4/16 - 117f*3/2 + 47f*2 + 2f + 5. Let p(c) = 0. Calculate c. 2, 117 Let m(a) = 4a2 + 58a + 300. Let f(h) = -h*2 + 6h. Let g(l) = 2f(l) + m(l). What is u in g(u) = 0? -30, -5 Factor -1/3a*2 + 641/3 + 640/3a. -(a - 641)(a + 1)/3 Factor -1314/19a + 2620/19 + 2/19a2. 2(a - 655)(a - 2)/19 Factor 24m*2 + 2m*3 - 23831 + 23727 + 8m*2 + 70m. 2(m - 1)(m + 4)(m + 13) Let y(m) be the third derivative of -m7/210 - 29m*6/24 - 1823m*5/20 - 15407m*4/24 - 5041m*3/3 - 695m*2. Factor y(c). -(c + 1)(c + 2)(c + 71)2 Let m(l) be the third derivative of -l5/120 + 2l*4 + 100l*3/3 - 3673l*2. Factor m(r). -(r - 100)(r + 4)/2 Let a be ((-26544)/(-79))/(-4) + 86. Factor -2/7na - 14450/7 - 340/7n. -2(n + 85)2/7 Let 40729d*2 - 150d - 40864d2 - 6d*3 + 280 + 11d*3 = 0. Calculate d. -2, 1, 28 Find n such that 3/4n*3 + 0n + 0 + 3/4n4 - 3/2n*2 = 0. -2, 0, 1 Let b = 665 + -662. Factor -25x - 11x2 + 11x - 12xb - 5x*2 + 14x - 2x4. -2x*2(x + 2)(x + 4) Let u = -306 + 371. Factor 210j*2 - 55 - 50j*3 + 44 - 198j + u. -2(j - 3)(5j - 3)2 Let v(i) be the third derivative of 0i - 9/2i4 + 47i*2 + 0 + 52/3i*3 + 1/15i*5. Factor v(f). 4(f - 26)(f - 1) Let g = 229992 - 459983/2. Find h such that gh*2 - 1/2 - 1/4h + 1/4h3 = 0. -2, -1, 1 Let o be (-1)/(2/(-8) - (-9)/52). Find h such that 4h + o - 13 + h*3 + 2h - 5h2 = 0. 0, 2, 3 Factor -5/4k*2 - 1/4k*3 + 1/2k + 6. -(k - 2)(k + 3)(k + 4)/4 Let o = 9701 - 19401/2. Let z(y) be the first derivative of -oy2 + 2/3y*3 - 1/4y*4 + 0y + 24. Suppose z(l) = 0. What is l? 0, 1 What is d in -3/5d4 + 3036/5d + 138/5d3 - 1452/5 - 1719/5d*2 = 0? 1, 22 Find b such that -192b + 0 + 3/8b5 + 87b*3 - 90b*2 - 117/8b4 = 0. -1, 0, 4, 32 Let t(n) be the third derivative of -n5/70 - 799n4/84 + 178n*3/7 + 2830n*2. Suppose t(c) = 0. Calculate c. -267, 2/3 Let t(j) = 17j - 157. Let s be t(9). Let y be (6/s)/((165/(-22))/15). Factor -4/3c - 8/3c*y + 0 - 2/3c*4 - 10/3c*2. -2c(c + 1)2(c + 2)/3 Factor 14m2 - 2/7m*3 - 1048/7m + 136. -2(m - 34)(m - 14)(m - 1)/7 Let o = 71599 - 71596. Determine s, given that 0 + 1/2s*2 - 2/5s - 1/10so = 0. 0, 1, 4 Let p(d) be the third derivative of -d6/540 - 7d5/135 - d4/108 + 52d3/9 + d2 + 874. Let p(s) = 0. What is s? -13, -4, 3 Let j = -23 - -29. Let h be ((j/9)/((-2)/3))/(-1). Factor -11n*2 - 6 + 15n - 4n2 + h + 5n*3. 5(n - 1)*3 Let d be (-4)/((-2 - (-24 + 17))/(-54/8)). Let 47/5q2 - 59/5q*3 - 3/5q*5 + 5q*4 + 0 - dq = 0. Calculate q. 0, 1/3, 1, 2, 5 Let u(x) = 54x - 1994. Let c be u(37). Let v(i) be the first derivative of -11i*2 + 10 + 32/3i*3 + 4i - 7/2ic. Factor v(j). -2(j - 1)*2(7j - 2) Let q = -15 + 20. Suppose 2 = -f - 5v - 11, -2f = qv + 11. Suppose 46j5 + fj*3 - 49j5 + j3 = 0. What is j? -1, 0, 1 Determine m so that 630 - 89m2 - 112 - 515m*3 + 374m*2 + 284m + 1026m - 10m*4 + 2 = 0. -52, -1, -1/2, 2 Let p be ((-510)/714)/(5/(-2)). Let j(n) be the first derivative of -pn*4 + 0n - 2/35n5 - 2/7n*2 + 7 - 10/21n*3. Factor j(r). -2r(r + 1)2(r + 2)/7 Let v be 77/(1309/(-170)) - ((-148)/12 + -3). What is p in 10/3p5 + 0p*2 - 8/3p*3 + 0 - vp*4 + 0p = 0? -2/5, 0, 2 Let l(f) be the first derivative of f6/210 - f5/105 - 2f4/21 + 8f*3/21 - 23f*2 - 44. Let i(x) be the second derivative of l(x). Factor i(q). 4(q - 2)(q - 1)(q + 2)/7 Factor 3j3 - 2j*5 - 3j*4 + 5j*5 + 15j*4 - 630j*2 + 9j*4 + 549j*2 + 54j. 3j(j - 1)*2(j + 3)(j + 6) Let u be (0 - 3) + (-10)/(-8 - 297/(-44)). Let q(l) be the second derivative of -1/40l*u + 0l4 + 0 + l3 - 4l2 + 34l. Factor q(r). -(r - 2)*2(r + 4)/2 Let i(q) be the third derivative of -q*6/60 + 7q*5/10 - 7q*4/6 - 152q*3 - 86q*2 + 4q + 7. Solve i(p) = 0 for p. -4, 6, 19 Let g(n) be the second derivative of -8 + 38/9n3 - 5/3n*5 + 4n*2 + n + 0n4. Determine y, given that g(y) = 0. -3/5, -2/5, 1 Let x(h) be the first derivative of -h6/33 - 128h5/55 - 668h*4/11 - 6656h*3/11 - 24336h*2/11 - 2597. Let x(k) = 0. Calculate k. -26, -6, 0 Let -1/4x*3 + 12 - 29/4x - 9/2x2 = 0. What is x? -16, -3, 1 Let i be (1 - -1)/(3 + -2). Let s(o) = o - 4. Let u be s(7). Factor -w3 - 1 - 7w - wi - 1 - w2 + 4wu. (w - 2)(w + 1)(3w + 1) Let s be (30/48 + 1184/(-256))12/(-36). Solve -8/9h + sh*2 + 8/9 = 0 for h. 2 Let w(h) = -39h*4 + 303h*3 + 12h*2 - 1158h - 36. Let m(b) = -2b4 + b3 - b - 2. Let s(l) = 18m(l) - w(l). Determine o so that s(o) = 0. -2, 0, 2, 95 Let 8/11o2 + 2232/11o - 2/11o3 + 25920/11 = 0. Calculate o. -18, 40 Let u(p) be the second derivative of 2304/5p*2 + 10/3p*4 + 1/25p*5 + 0 - 266p + 448/5p3. Factor u(n). 4(n + 2)(n + 24)2/5 Suppose -3j + 2 = -16. Find o such that -j - 35o2 + 10423o*3 - 70o - 10428o3 - 34 = 0. -4, -2, -1 Determine x so that 13910/3x + 5/3x2 + 9674405/3 = 0. -1391 Let c(n) = 89 + 3 + 91 - 28 + 24 - 8n. Let f be c(22). Factor 4/5u4 + 0 + 0u*f - 4/5u*2 + 0u. 4u2(u - 1)(u + 1)/5 Let d(r) = -r2 - r - 1. Let m(f) = 10f*3 - 31f - 15f3 + 3f*3 + 94 + 5f. Let v = 29 + -73. Let p(q) = vd(q) - 2m(q). Let p(k) = 0. What is k? -6, 1 Let m(h) = 31h2 - 88h + 471. Let q(g) = 7g2 - 22g + 118. Let b(c) = 8m(c) - 36q(c). Find k, given that b(k) = 0. 10, 12 Let k = 2061 - 2059. Let c(u) be the second derivative of 1/42u7 + 0u*5 + 0 + 0u*4 + 0u*3 + 0u*k - 1/15u*6 + 11u. Let c(g) = 0. Calculate g. 0, 2 Let r(g) = 14g + 80. Let h be r(-5). Find k, given that -2k*3 - hk - 3k2 - 4k*3 + 2k*3 + 5k*3 = 0. -2, 0, 5 What is w in -3/4w*3 - 21/4w + 0 + 6w*2 = 0? 0, 1,	{ "pile_set_name": "DM Mathematics" }
the third derivative of l*6/60 - 11l*5/60 - 11l*4/24 + 15l2. Let n(g) = -g3 + 5g2 + 5g. Determine 9n(x) + 4z(x). -x3 + x2 + x Let i(z) = z*2 - z + 1. Let t(k) = 3k*3 + 4k*2 + 2. Determine 2i(s) - t(s). -3s3 - 2s*2 - 2s Let m(k) = 3k + 8. Let b(j) = j + 1. What is 5b(u) - m(u)? 2u - 3 Let j(h) = 4h + 3h - 6h - 2h. Let f(x) = x3 + x + 1. Give -f(v) - 3j(v). -v*3 + 2v - 1 Let w(r) = 7r. Let t(c) = -11c. Let g be (10/(-8))/(4/(-16)). Give gt(z) + 8w(z). z Let i(h) = 6h - 6. Let p(k) = 5k - 70. Let q be p(15). Let l(t) = -4t + 4. Let v = 5 - -2. Calculate qi(z) + vl(z). 2z - 2 Let y(s) = 2s3 + 0s*3 - 4s - 3s3. Let x(z) = z2 + 2z + 3. Let a be x(-4). Let p(r) = -3r3 - 11r. Let o = 2 + -6. Give ay(q) + op(q). q*3 Let f(w) = -6w*3 + 7w*2 - 7w + 6. Let v(z) be the first derivative of z4/4 - z3/3 + z*2/2 - z - 2. Let u = 45 + -59. What is uv(m) - 2f(m)? -2m*3 + 2 Let z(t) = -3t*2 + 2t + 2. Let i(b) = -5b2 + 5b + 5. Let a(f) = -f*2 - 5f + 29. Let x be a(-8). What is xz(j) - 2i(j)? -5j2 Let g be (14/(-3))/(4/6). Let b = 10 + -4. Let f(x) = 6x + 1. Let t(l) = 5l + 1. Give bf(k) + gt(k). k - 1 Let c(a) = a3 + 2a*2 + 2a. Let b(v) = 3v2 + 3v. Calculate 2b(p) - 3c(p). -3p3 Let q(b) be the third derivative of -b4/24 + b3/2 - b2. Let f(d) = 1. Suppose 0k = -k + 2. Give kq(c) - 5f(c). -2c + 1 Let n be -1 + 2 - 1 - -2. Let b be (0 + -1)-1n. Let c(k) = b - 7 - 1 - 4k. Let a(p) = 3p + 5. Give -5a(s) - 4c(s). s - 1 Let f(h) = 20h + 6. Let x(m) = -7m - 2. Suppose -3l = -2l + 17. What is lx(k) - 6f(k)? -k - 2 Let b(q) = -3q*3 + 4q. Let y = -1 + 0. Let s be 6 + y - 0/(-3). Let n(x) = 4x - sx*3 + 3x + 0x. Calculate 7b(p) - 4n(p). -p3 Let v(b) = b3 + b2 + 2b + 1. Let l be 12/(-10) - 2/(-10). Let y(k) = k*2 + 1. Let h be (1-1)/(0 + -1). Calculate hy(w) + lv(w). -w*3 - 2w Let i(v) = v*3 - v. Let d(j) = 7j*3 - 6j. Determine d(p) - 4i(p). 3p*3 - 2p Let j(c) = -c + 1. Let v(f) = 32f - 4. What is -2j(m) - v(m)? -30m + 2 Suppose 2j - 33 = -5. Let h(m) = 3m2 - m3 - 2m2 - 3 + m2. Let n(y) = 4y3 - 7y*2 + 10. Suppose -5p = -4p - 4. Give jh(s) + pn(s). 2s*3 - 2 Let j(g) = 5g*2 - 4g + 8. Let o(z) = -z*2 + z - 1. Let d = 66 - 33. Let l be (-4)/(-22) + (-39)/d. Determine lj(a) - 6o(a). a2 - 2a - 2 Suppose 4s = 6s - 4. Let v be s/(-12) + 39/18. Let j(h) = -4 + 1 - 3h2 - h3 - hv. Let l(x) = -2x*3 - 6x*2 - 5. Give -8j(q) + 5l(q). -2q*3 + 2q2 - 1 Let b(n) = n2 + 7n - 7. Let h(g) = -1. Calculate b(t) - 6h(t). t*2 + 7t - 1 Let r(m) = m*2 - m + 1. Let f(i) = -13i*2 + 2i - 2. Give -f(g) - 2r(g). 11g2 Let h(f) = -f3 - f2 + f - 3. Let d(g) = -g3 - g*2 + 1. Let j(c) = 3c*3 + 3c*2 + c - 10. Let v(t) = -5d(t) - j(t). Calculate -5h(b) - 3v(b). -b3 - b2 - 2b Let u(t) be the second derivative of -t3 + 5t*2/2 + t. Let h(o) = 2o - 2. Let s(c) = -c + 1. Let x be s(5). Calculate xu(d) - 11h(d). 2d + 2 Let v(u) = u. Let n(f) be the first derivative of -7f - 7 + 1 + 8f. Give 2n(w) + 3v(w). 3w + 2 Let m(j) = -2. Let b(d) = -d - 10. Determine 2b(l) - 11m(l). -2l + 2 Let k(b) = -b. Let r(t) = -4t. Suppose 0l - 4l + 49 = -5m, 4l = -5m - 1. Determine lk(z) - r(z). -2z Let i(w) = w3 - 2w*2 + 2w. Let s be 12/9(-3)/(-1). Suppose -2 - 8 = -3z - sj, 5z - 5 = 5j. Let k(o) = -o3 + o2 - o. Give zk(d) + i(d). -d*3 Let i(d) be the third derivative of -3d*2 + 0 - 5/6d*3 - 1/24d*4 + 0d. Let u(v) = -2v - 9. Determine 7i(z) - 4u(z). z + 1 Let o(r) = 18r*3 + 3r + 12. Let p(n) = 9n3 + 2n + 6. Let i(c) = -4o(c) + 9p(c). Let b(t) = -t*3 - t - 1. What is 6b(d) + i(d)? 3d3 Let w(u) = 3u - 8u + 17u - 7u. Let k(z) = -z. Give -6k(g) - w(g). g Let p(a) = -5a2 - 2a - 1. Let k(d) = -d*2. Suppose -3r + 13 = 5h, 4h + 0 - 8 = 0. Calculate rp(q) - 6k(q). q*2 - 2q - 1 Let k = 13 + -19. Let r(f) be the third derivative of f4/24 + f2. Let b(o) = -8o. What is kr(p) - b(p)? 2p Let j(i) = 4i*2 - i - 1. Suppose 3 = 4v - 5. Let a(m) = -17m2 + 4m + 4. Calculate va(u) + 9j(u). 2u2 - u - 1 Let m(z) = 4z*3 + 7z + 7. Suppose -u + 4 = -0u. Let r(q) = q3 + 2q + 2. Determine um(p) - 14r(p). 2p3 Suppose 0 = -2d + 4d - 2. Let s(m) = -m + 1. Let k(y) = -5y + 5y + 1 - y. What is dk(o) - 2s(o)? o - 1 Let w(n) = 7n - 7n - 5 + 7n*3 - 6n*3. Let p(t) = 2t*3 - 6. What is 5p(m) - 6w(m)? 4m*3 Let j(c) = 2c - 2. Let r(h) be the third derivative of h4/24 - h3/6 - h*2. Let i be r(0). Let f(g) = -2 + 0 + 3. Give ij(s) - f(s). -2s + 1 Suppose -3m + 3n + 6 = 0, 0 = 2m + 3n - 27 + 8. Let b(v) = 9v + 2. Let a(p) = 13p + 3. Determine ma(d) - 7b(d). 2d + 1 Let n(t) = t*2 - t + 1. Let v(r) = 5r*2 - 3r. Give -4n(i) + v(i). i2 + i - 4 Let d = 17 - 14. Suppose -4 = y + dy. Let t(p) = p. Let u(f) = f*2 + f - 1. Give yu(k) + t(k). -k*2 + 1 Let k(b) = 135b + 55. Let q(w) = -5w - 2. Suppose 3 = -2z + 7, -h = -3z + 61. Determine hq(t) - 2k(t). 5t Let o(p) = -24p2 + 6p + 11. Let u(j) = 4j2 - j - 2. What is 6o(m) + 34u(m)? -8m*2 + 2m - 2 Let p(l) = -168l. Let h(d) = 13d. Calculate -77h(t) - 6p(t). 7t Let d(o) be the first derivative of 3o*4/4 - 5o*3/3 + 5o + 14. Let w(f) = -2f3 + 3f*2 - 3. Give -3d(r) - 5w(r). r3 Let m(d) = d2 - 3d - 2. Let v be m(6). Suppose 0 = -3r - s - 19, -2r - 3s = s + v. Let w(p) = 7p*2. Let f(q) = 15q*2. Calculate rf(g) + 13w(g). g2 Let v(i) be the third derivative of i5/30 - 7i*3/6 + 10i2. Let x(p) = -p2 + 4 - 1 + 1. What is 3v(n) + 5x(n)? n*2 - 1 Let i(g) = -19g - 10. Let o(p) = 37p + 19. Calculate -11i(b) - 6o(b). -13b - 4 Let f(v) = 20v - 20. Let c(i) = 7i - 7. Suppose -5t = -4n + 76, 6n - 9n + 26 = 4t. Give nc(u) - 5f(u). -2u + 2 Let z(a) = -63a - 10. Let q(f) = -3434f - 544. What is -5q(s) + 272z(s)? 34s Let x(l) = 7l + 5. Let t(d) = d + 4. Let f(j) = 2j + 4. Let r(w) = 5f(w) - 4t(w). Determine 5r(a) - 4x(a). 2a Let b(m) = 6m + 0m*2 - 9 - 2m*2 + 3m. Suppose -34 = 4y + 2. Let n(f) = -f2 + 4f - 4. Give yn(q) + 4b(q). q*2 Suppose 3q - 7q + 3l = 7, -5q + 4l = 10. Let z(s) = -4s - 1 + s - 1. Let k(p) = -4 + 2 + 9 + 10p. What is qk(d) + 7z(d)? -d Let l(b) = 1 - b + 0b + 0. Let f be 10/2 + 0/4. Let v(h) = -h + h + 7 - 3h - h. Give fl(p) - v(p). -p - 2 Let l(t) = -4t + 94. Let b(i) = 3i - 94. Calculate 6b(k) + 5l(k). -2k - 94 Let p(z) be the first derivative of 5z2/2 + z - 2. Let x(l) = -6l - 1. Let o be -7 - -1(-12)/(-4). Calculate ox(f) - 5p(f). -f - 1 Let j(v) = -5v*3 + 5 - 5v + 3v2 + v3 - 8. Let s(u) be the first derivative of 3u*4/4 - 2u*3/3 + 2u*2 + 2u + 1. Give 2j(o) + 3s(o). o*3 + 2o Let w(x) = -4x - 8. Let s(t) = 2t + 4. Give 7s(g) + 4w(g). -2g - 4 Let g(v) = 112v*2 + 5v. Let j(n) = 280n2 + 12n. Calculate 12g(w) - 5j(w). -56w2 Let j(b) = 5b - 5. Let c(i) = 2i - 2. Let t(f) = 7c(f) - 3j(f). Let z(g) = 3g - 3. Let a be 64/(-6) - 1/3. Give at(l) - 4z(l). -l + 1 Suppose 3 + 8 = b. Let w(r) = 5r3 + 10r*2 + 11r + 10. Let o(f) = -f*3 - 2f*2 - 2f - 2. Give bo(p) + 2w(p). -p*3 - 2p2 - 2 Let l(u) = u3 + 3u2 - 2u - 1. Let g(n) = n*3 + 2n*2 - n. Suppose -5z = f + 10, z + 0f + f - 2 = 0. What is zg(j) + 2l(j)? -j3 - j - 2 Let p(l) = 5l - 7. Let o(i) = 3i - 11. Let t(c) = c + 1. Let n(w) = o(w) + 3t(w). What is -3n(x) + 4p(x)? 2x - 4 Let u(r) = -22r. Let a(q) = 9q. Let v = 3 - -8. Let t = v - 16. Determine tu(s) - 12a(s). 2s Let b(h) = 24h2 + 33. Let d(m) = 3m*2 + 4. What is 4b(i) - 33d(i)? -3i*2 Let z(o) = -4o*2 - 6o - 10. Let k(w) = w*2 + 2w + 3. Let a = -20 - -25. Suppose 2 = al - 8. Determine lz(y) + 7k(y). -y2 + 2y + 1 Let a(n) = 7n + 3. Let j(y) = 10y + 1. Let f(p) = -10p - 2. Let r(s) = -6f(s) - 4j(s). Suppose 0 = -4k + 32 + 24. Give ka(m) - 5r(m). -2m + 2 Let i(a) = 2a + 5. Let d(u) = u*3 + u + 4. What is -5d(y) + 4i(y)? -5y*3 + 3y Let j(x) = x*3 - 4x*2 - x - 1. Let v be j(2). Let n(g) = -5g*2 + 5g.	{ "pile_set_name": "DM Mathematics" }
n2 + 10n + 2. Let i be j(f). Differentiate -106u + 50u + 56u - ui + 23 wrt u. -2u Let k(g) = g*3 + 20g*2 + 19g + 2. Let t be k(-19). What is the third derivative of -26f + f4 + 3f*3 + 4f*3 + 66f*t + 26f wrt f? 24f + 42 Let j(a) = 226a - 899. Let o be j(4). Suppose 5n = -0n + 25. Find the third derivative of -3in - 9i*o + 13i*2 + 0i*5 + 13i*5 wrt i. 60i*2 Let z(u) be the first derivative of 13507u*2/2 + 144u - 12720. Find the first derivative of z(t) wrt t. 13507 Let s(q) = -215q3 - 3q*2 - 1178q - 6. Let t(a) = 428a3 + 7a*2 + 2357a + 13. Let b(f) = -13s(f) - 6t(f). Find the second derivative of b(w) wrt w. 1362w - 6 Find the first derivative of 193s*2 + 7s*2 + 512s*2 - 2028 - 79s*2 + 12s*2 wrt s. 1290s Let b(h) = 4h - 3h - 163 + 202 + h. Let x be b(-18). What is the derivative of 2 + 3 + 10f - 8 - x wrt f? 10 Let u = -58 + 73. Let r be (u + -11)/((-2)/(-1)). Differentiate 4 - 3v - rv - 2v + 6v with respect to v. -1 What is the second derivative of 3998w - 5174w + 140w*3 + 2w*2 + 32w*3 wrt w? 1032w + 4 Let h(z) = 3z - 5. Let t(f) = -6f + 11. Let c(v) = 13h(v) + 6t(v). Let a be c(2). Differentiate 4 + a - 2 - 3 + 20l3 wrt l. 60l*2 What is the third derivative of 213s*3 + 698s*2 + 2s*4 - 4s*4 + 214s*2 - 30s*3 wrt s? -48s + 1098 What is the derivative of -129x - 3676x*4 - 507 + 186x - 57x wrt x? -14704x*3 What is the third derivative of -327a*3 - 129a*2 + 528a*3 + 814a*3 - 921a*2 wrt a? 6090 Let q be 40/6(189/18)/7. Let x be -3(q/(-6) - -3)-4. What is the second derivative of 23s5 - 23 - x + 39 + 8s wrt s? 460s3 Let d(x) be the second derivative of 71x*6/30 + 11x*2/2 - 897x. What is the first derivative of d(r) wrt r? 284r3 Find the third derivative of b5 + 87237b*2 + 2b*4 + 1290b*3 - 2b*4 - 83497b*2 wrt b. 60b*2 + 7740 Let w = 103/30 + -13/5. Let z(u) be the second derivative of 0u*2 + 22u + 0 - wu4 + 10/3u*3. What is the second derivative of z(k) wrt k? -20 Let s(q) = -664q*2 - 38q + 11124. Let x(t) = 330t2 + 18t - 5563. Let h(p) = -4s(p) - 9x(p). Find the first derivative of h(o) wrt o. -628o - 10 Let s be ((-2)/6)/(1021/(-102) - -10). Find the first derivative of 4n - sn - 34n + 56 - 37n wrt n. -101 Suppose 93 = y + 91. What is the derivative of 34o*y - 5o*2 + 54 - 154 wrt o? 58o Find the second derivative of 41 - 6k3 - 2k*3 + 753k*2 - 289k*2 - 333k*2 - 4k wrt k. -48k + 262 Find the second derivative of 54b*2 + 794b*2 + 450 - 450 + 25b - 1541b wrt b. 1696 Let z(b) be the second derivative of 54b + 0 - 155/6b3 - 149/2b*2. What is the first derivative of z(d) wrt d? -155 Let d(v) be the first derivative of 2711v*6/2 - 4545v*2/2 + v - 6586. What is the second derivative of d(y) wrt y? 162660y*3 Let y(r) be the third derivative of 242r5/15 - r4/8 + 65r3/6 - 207r*2 + 2. Find the second derivative of y(g) wrt g. 1936 Let z(x) be the first derivative of 49x*4/6 + 47x*2 - 57x - 16. Let y(f) be the first derivative of z(f). Find the first derivative of y(j) wrt j. 196j Let s(l) = -119l*3 + 148l*2 + 4l + 8. Let t(d) = 119d3 - 147d*2 - 3d - 6. Let k(z) = -3s(z) - 4t(z). What is the third derivative of k(i) wrt i? -714 Let g(i) = i3 + i2 - i - 2. Let b(m) = -308m4 - 2m*3 - 6m*2 + 246m + 4. Let q(y) = b(y) + 2g(y). Find the third derivative of q(f) wrt f. -7392f Let h(q) be the first derivative of q*4/4 + 397q*3/3 + 535q*2/2 - 192. What is the second derivative of h(m) wrt m? 6m + 794 Let k(o) be the third derivative of -5o8/168 + 4o*7/105 + 97o*5/30 - 1163o*2. Find the third derivative of k(n) wrt n. -600n*2 + 192n Let h(m) = 356m - 2070. Let n(u) = 339u - 2072. Let s(k) = 3h(k) - 4n(k). Differentiate s(q) with respect to q. -288 Find the third derivative of -2908 - 691 - b*2 + 8273b*4 + 1419 wrt b. 198552b Let l(k) be the second derivative of -2 + 0k5 + 0k*3 - 3k + 11/2k2 + 0k*4 - 37/30k*6. Differentiate l(t) wrt t. -148t*3 Let p be (-51)/17 - (-25 + 0). Suppose -50 = -4u + 5c, 0c = 4u + c - 62. What is the second derivative of -38a + pa5 + 11a + ua wrt a? 440a*3 Suppose -6q = -4q - 4. Let f be ((-8)/28)/(q/(-14)). Find the third derivative of -336v*2 - 3 + 39v*6 + 3 + 380v*f wrt v. 4680v*3 Let n(j) be the second derivative of 4229j6/10 - j5/10 - 4027j4/12 + 32j + 126. What is the third derivative of n(v) wrt v? 304488v - 12 Let d(p) be the second derivative of 1196p*6/15 - 11p4/12 + p3/2 - 73p2/2 - 14737p. What is the third derivative of d(z) wrt z? 57408z Let l(c) = -c2 + 27c + 47. Let o be l(28). Suppose -2i = -7 - o. Find the second derivative of -y + 49y*2 + i + 3 - 14 + 14 wrt y. 98 Suppose 0 = 5r + 5c - 70, 6r - 2r = 4c + 72. Find the first derivative of 234o3 + 70 + 2o*2 - 119o*3 - 108o*3 - 2o*2 - ro*4 wrt o. -64o*3 + 21o*2 Differentiate 2591 + 94w*2 + 280w*4 - 138w*4 - 95w*2 - 19w - 138w4 wrt w. 16w*3 - 2w - 19 Let t = 12529 - 12529. Let a(z) be the first derivative of 10/3z3 + 0z*4 + 14/5z*5 + 0z*2 - 28 + tz. What is the third derivative of a(p) wrt p? 336p Suppose 8m - 13m + 20 = 0. Let b be 264/28 - m/(-7). What is the third derivative of -5o + 3o4 + bo*4 + 5o - 7o2 wrt o? 312o Let i(j) be the second derivative of 1/10j6 + 7j*3 + 0 + 15j + 0j2 - 13/6j*4 + 0j*5. What is the second derivative of i(u) wrt u? 36u*2 - 52 Let u(j) be the second derivative of 2437j*7/42 + 2243j*4/6 + 3270j. Find the third derivative of u(n) wrt n. 146220n2 What is the third derivative of -1851c*3 - 70 + 9c*2 - 11 + 4c*2 + 703c*3 - 3734c*3 wrt c? -29292 Let i be 104/6 + (-5)/(75/(-10)). Let a be 4/i - (-102)/27. Find the second derivative of 21c*a - 10c*4 - 21c + 3c2 - 3c*2 wrt c. 132c*2 Let f(o) = 9o*2 + 5o + 3. Let v be f(-4). Let i be 7/28-10(1 + -3). What is the third derivative of 127p - 14p*i + 15p*2 - vp wrt p? -840p2 Let c(p) be the third derivative of 307p*5/6 - 235p*3 + 45p*2 - 2. Find the first derivative of c(y) wrt y. 6140y Find the second derivative of -4g4 - 3g*4 - 4g*2 - 8888g - 14g2 + 4g*4 + 8363g wrt g. -36g2 - 36 Let h(l) = -4l - 22. Let v be h(-9). Let s(i) = 2i. Let o be s(2). What is the derivative of -v + 31 - ok + k wrt k? -3 What is the third derivative of 3n - 4n*4 - 2n - 1806n2 + 849n*3 - 880n*3 wrt n? -96n - 186 Let s(v) = 5446v3 + 2v*2 + 37v + 71. Let g(q) = 5447q3 + 3q*2 + 37q + 113. Let m(y) = 2g(y) - 3s(y). What is the second derivative of m(k) wrt k? -32664k Let b = 195 - 193. Find the third derivative of -1 - 3917v*3 + 3838v*3 + 2 - bv*4 - 5v*2 wrt v. -48v - 474 Let t(b) = -3b2 + b + 1. Let h(o) = 7o*2 + 660o - 292. Let v(x) = -h(x) - 3t(x). Differentiate v(r) with respect to r. 4r - 663 Let l(a) be the third derivative of -12a2 - 1/15a*5 - 1/30a*6 + 1/2a*3 + 0a - 2 - 5/12a4. Find the second derivative of l(b) wrt b. -24b - 8 Let x(p) be the first derivative of 1563p4/4 + 3206p + 2182. What is the derivative of x(d) wrt d? 4689d2 Let q(b) be the third derivative of 652b9/63 + b7/105 - b*5/30 - 17b*4/24 + 11b*3/6 + 579b*2 + b + 1. Find the third derivative of q(u) wrt u. 625920u*3 + 48u Let o(k) = -804k + 75. Let f(y) = 804y - 71. Let v(s) = -4f(s) - 3o(s). Differentiate v(h) wrt h. -804 Let g(v) be the first derivative of -43v4 - v3/3 + 3v*2/2 - 6876v + 5435. Find the first derivative of g(w) wrt w. -516w2 - 2w + 3 Let r(g) = 13g2 - 11. Let a(y) = -y2. Let p = -50 + 44. Let z be p/((-35)/(-10) + -2). Let l(f) = za(f) - r(f). Differentiate l(v) with respect to v. -18v Let j(f) = 790f*3 + 38f*2 - 8. Let g(t) = 264t*3 + 13t*2 - 3. Let v(x) = -14g(x) + 4j(x). Find the third derivative of v(c) wrt c. -3216 Let w = -57 - -63. Find the third derivative of -113 + 136 - 20i*6 + 2i*2 - 7i*w wrt i. -3240i*3 Suppose -4d - 5o = -2d - 6, 0 = -o. Suppose 1 + 15 = -4p - 4j, 12 = -dj. What is the derivative of -164 + 141 + 3x*4 + px	{ "pile_set_name": "DM Mathematics" }
Let q = 4 - h. What is qf(k) + 7c(k)? k + 2 Let o(t) = 5t - 6. Let a(y) = 4y - 5. Suppose -4q = -3i - 0q - 19, 5q = -3i - 64. Let f be 4/(-10) + i/5. Determine fo(w) + 4a(w). w - 2 Let t(b) = b3 - 2b*2 - 2b + 4. Let i be t(3). Let l(q) = -13q - 7q*2 + 4 - 1 - 3q*2. Let a(x) = -3x*2 - 4x + 1. What is ia(h) - 2l(h)? -h*2 - 2h + 1 Let k(m) = 6m3 + 3m*2 - 2m + 4. Let g(a) = 4a2 - a2 + 7a*3 - 2a + 0a + a2 + 5. Give -4g(o) + 5k(o). 2o3 - o2 - 2o Let s(c) = c3 - c2 - c + 1. Let q(t) = -6t*3 + 4t*2 + 3t - 3. Suppose -17a + 19a + 6 = 0. Give as(k) - q(k). 3k3 - k2 Let z(s) be the first derivative of 5s4/4 + s3 - 3s*2/2 - 2s - 1. Let v = 4 - 11. Let i(d) = 11d3 + 7d*2 - 7d - 4. Calculate vz(k) + 3i(k). -2k3 + 2 Let l(i) = i3 - 2i*2 + 2i - 2. Let v(z) = z3 - z2 + z - 1. What is -l(f) + 2v(f)? f3 Let a(u) = -3u*2 - 2. Let g(b) = 1. Calculate -a(i) - 2g(i). 3i2 Let p(i) = -2i*2. Let v(x) = 2x*2. Let h be 0/(3/(9/6)). Suppose -5g - 5k + k - 11 = h, -1 = 2g + 5k. Calculate gv(a) - 2p(a). -2a*2 Let z(s) = -23s*3. Let c(v) = -196v*3. Determine -5c(h) + 42z(h). 14h*3 Let n(u) = -14u + 29. Let y(v) = 22v - 44. Give -8n(a) - 5y(a). 2a - 12 Suppose 5 = 4g - 3. Let u be ((-3)/(9/(-12)))/g. Suppose 2 = -5r + 2r + ui, 0 = r - i. Let h(b) = b - 1. Let q(n) = n*2 + n - 1. What is rq(l) + 2h(l)? -2l*2 Let g(q) be the second derivative of -7q3/6 + q2 - 4q. Let m(b) = -20b + 6. What is 14g(u) - 5m(u)? 2u - 2 Let k(r) be the first derivative of -r3/3 - r2 + 3r - 3. Let d(y) be the first derivative of k(y). Let u(o) = 3o + 2. What is 4d(x) + 3u(x)? x - 2 Let w(s) = 1. Let c(v) = 2v*2 - 2v + 4. Suppose -q + 0 + 11 = 0. Let f = q - 10. Give fc(u) - 4w(u). 2u2 - 2u Let u(w) = 2w3 - 3w*2 + 2w. Let g(s) = -4s3 + 7s*2 - 5s. What is -2g(v) - 5u(v)? -2v3 + v2 Let w(l) = -3l*3 - 13l*2 - 3l - 2. Let t(j) = 2j3 + 9j*2 + 2j + 1. Calculate 8t(o) + 5w(o). o*3 + 7o*2 + o - 2 Suppose 3a = -2l - 1, -3l + 1 + 2 = 3a. Suppose 9o = 11o + 2. Let f(y) = -y + 2. Let n(u) = u - 1. Calculate an(i) + of(i). -2i + 1 Let b(i) = -i2 - 5. Let a(y) = -8 - y2 - y + 12y - 11y. Determine -5a(g) + 8b(g). -3g2 Let q(g) = -5g*2 + 2g + 6. Let p be 7/((-7)/(-2)) + -4. Let s be (p - -3)(4 + -3). Let z(b) = b2 - 1. What is sq(j) + 6z(j)? j2 + 2j Let p(q) = -6q - 2. Let w(u) = 17u + 7. Give 7p(v) + 2w(v). -8v Let t(q) = -q2 + 2q - 3. Let g(m) = -m + 1. What is -4g(h) - 2t(h)? 2h2 + 2 Let y(x) = -2x*2 + 5x. Let r be -6 + -4 - -21. Let k(l) = 3l*2 - 8l. Let o be -5(-2 + 3 + 0). Calculate ok(i) + ry(i). i2 Let q(z) = -z. Let d(h) = -2h - 23. What is -2d(v) + 2q(v)? 2v + 46 Let i(z) = -z2 + z - 1. Let w(c) = 32c*2 - 10c + 10. Give 10i(u) + w(u). 22u*2 Let g(m) = -3m*3 + 3m*2 + 6m + 6. Let z(f) = -3f3 + 2f*2 + 5f + 5. Determine 5g(i) - 6z(i). 3i3 + 3i2 Let f(r) = -r3 + r2 - r. Let y(u) = -u3 + 2u + 2. Determine -2f(x) - y(x). 3x3 - 2x*2 - 2 Let s(w) = 9w - 8. Let x(h) = 1. Determine -s(i) - 6x(i). -9i + 2 Let b(r) be the first derivative of r*2 - 6r - 5. Let a(y) = 1. Give 4a(c) + b(c). 2c - 2 Let u(q) = 3q2 - 5q - 5. Let r(f) = 3f2 - 6f - 6. Give 6r(k) - 7u(k). -3k2 - k - 1 Let g(y) = y. Let m(d) = -9d. Let b(s) = -33g(s) - 4m(s). Let a be 2/4(-4 - 0). Let x be 15/(-21) + a/7. Let q(o) = -o. Give xq(u) - b(u). -2u Let z(x) = x - 1. Let r(c) = 3c*2 - 11c + 11. Determine -2r(u) - 22z(u). -6u2 Let j(m) be the third derivative of -m4/4 - 13m*3/6 + 3m*2. Let d(g) = 1. Let b(a) = 3a + 11. Let v(w) = -b(w) + 5d(w). Determine -6j(h) + 13v(h). -3h Let l(g) = -g*2. Let n(k) = -10k*2 + 2k - 1. Let f(i) = 5l(i) - n(i). Let z(c) = -16c*2 + 7c - 3. Give 7f(r) + 2z(r). 3r2 + 1 Let i(u) = 87u*2 - 2u - 2. Let l(h) = -88h2 + 2h + 2. Determine 3i(k) + 2l(k). 85k2 - 2k - 2 Let h(w) be the second derivative of -w3/6 - w2 - 3w. Let f(i) = -i. Give -2f(l) + h(l). l - 2 Let g(o) = 7o2 + o + 3. Let i(a) = -1. Calculate g(c) + i(c). 7c*2 + c + 2 Let n(f) = f - 1. Let u(x) = x - 1. Let r = -50 - -46. Determine ru(b) + 2n(b). -2b + 2 Let a(v) = -v*2 + v. Suppose 12s - 15s - 11 = 2d, 0 = 4s + 2d + 12. Let r = -5 + 7. Let k(p) = 2. Calculate ra(j) + sk(j). -2j2 + 2j - 2 Let i = -3 - -1. Let x be i - (-3 + -1)/2. Suppose x = 2t - 4 - 0. Let k(u) = -u3 - u2 + u - 1. Let z(d) = -4d*3 + 2d - 3. Determine tk(h) - z(h). 2h*3 - 2h*2 + 1 Let n(b) = -2b - 3. Let i(d) be the second derivative of d2/2 - d. Let f(z) = -z2 - 7z + 10. Let t be 2/3(-1 + -11). Let u be f(t). Give ui(o) + n(o). -2o - 1 Let r(l) = l3 + l2 + 1. Let p be 3 - (1 - 1)/(-1). Let b(v) = 8v2 - pv + 4v3 + 3v + v + 6. Let d = -2 - -3. Determine db(g) - 6r(g). -2g3 + 2g*2 + g Let g(q) = -6q*3 + 2q*2 - 6q + 7. Let a(m) = -5m3 + 2m*2 - 7m + 8. Give 6a(r) - 7g(r). 12r3 - 2r2 - 1 Let h(d) = -d3 - 11d2 - 2d - 3. Let v(x) = x3 + x2. Calculate h(j) + 3v(j). 2j*3 - 8j*2 - 2j - 3 Let t(l) = 64l - 17. Let s(i) = 21i - 6. What is -17s(c) + 6t(c)? 27c Let h(z) = 2z*2 - 2z + 2. Let p(y) = y*2 + y - 1. Calculate -2h(t) - 2p(t). -6t*2 + 2t - 2 Let c(i) = i + 2. Let a be 2(4 - 0)/2. Let l(r) = -1. Give al(n) + 2c(n). 2n Let p(c) = 2c - 13. Let y(m) = -m + 1. Let k(u) = -5u + 10. Let i(a) = k(a) - 4y(a). What is -9i(h) - 4p(h)? h - 2 Let l(j) be the first derivative of -7j*3/3 - 7j2/2 + j + 14. Let t(a) = a2 + a. Calculate l(b) + 5t(b). -2b*2 - 2b + 1 Let k(l) = -l*3 - 3l*2 + 2l + 2. Let b(t) = -t*3 - 4t*2 + 2t + 3. Determine -3b(v) + 4k(v). -v*3 + 2v - 1 Let p(c) = 2c - 6. Let l(n) = -7. Let q(h) = 20. Let r(t) = -17l(t) - 6q(t). Suppose -3m - 4k = 6, -4m - 6k - 12 = -2k. Determine mr(o) + p(o). 2o Let z(w) = 4w3 - 4w*2 - 2w. Let v = -141 - -150. Let i(p) = -16p3 + 17p*2 + 9p. What is vz(g) + 2i(g)? 4g3 - 2g2 Let q(j) = -j3 + 5j2 - 5j - 6. Let f(i) = 2i3 - 4i*2 + 4i + 5. Determine -5f(l) - 4q(l). -6l3 - 1 Let f(t) = 4t*3 - 16t*2 + 3t - 5. Let y(m) = -m*3 - m + 1. What is f(h) + 3y(h)? h*3 - 16h*2 - 2 Let t(y) = 3y*2 - 9y. Let w(k) = -4k2 + 3k*2 + 6k - k - k. Calculate -4t(f) - 9w(f). -3f2 Let t(g) = -77g + 5. Let l(j) = -963j + 63. Determine -5l(n) + 63t(n). -36n Let g(b) = 6b2. Let a(v) be the first derivative of -v4/4 + v3/3 - 2. Let s be a(-1). Let r(c) = -4c + sc2 + 4c. Calculate -3g(w) + 8r(w). -2w2 Let m(t) = t3 + t2 + 1. Let v(g) = 2g*2 + 11g + 2. Determine 2m(j) - v(j). 2j*3 - 11j Let t(p) = p*2 - 9p + 7. Let r(x) = -2x2 + 19x - 14. Determine 6r(l) + 13t(l). l*2 - 3l + 7 Let d(x) = -45x2 + 55x. Let j(w) = 5w2 - 6w. Suppose -26q + 28q + 12 = 0. Calculate qd(a) - 55j(a). -5a2 Let j(h) = -h - 4. Let p(n) = 0n - 3 + 3n - 7n + 3n. Give -5j(d) + 7p(d). -2d - 1 Let t(f) = -f3 + f2 + f. Let p(u) = -32u3 + 5u*2 + 3u. What is p(y) - 3t(y)? -29y*3 + 2y2 Let d = -51 + 54. Let q(z) = z2 - z - 1. Let s(w) = -w3 - w2 + w + 1. Calculate ds(g) + 3q(g). -3g3 Let o(j) = 6j*2 - 7. Suppose -2 = -3p + 1. Let g(v) = -v2 - v2 + 7 + p - 6. Calculate -7g(k) - 2o(k). 2k2 Let q(n) = 0 + n2 - 4n*3 + 5 + 5n*2 - 5n. Let s(g) = 4g2 + g2 + 8 - 3g*3 - 4 - 4g. Let x = -3 - 2. Determine xs(j) + 4q(j). -j3 - j2 Let d be 6/(-4)(-2)/(-3). Let h(i) = 7i + 6. Let w(v) = 13v + 11. Let o(q) = 11h(q) - 6w(q). Let g(s) = 3s. Calculate dg(c) - 6o(c). 3c Suppose -7l = -5d - 2l - 45, 3d + 2l + 12 = 0. Let u(p) = -8p2 - 11p - 17. Let w(y) = 2y + y + y + 3y*2 + 6. What is du(q) - 17w(q)? -3q*2 - 2q Let p(l) = -69l2 + 2l + 2. Let b(k) = 35k2 - k - 1. Determine 5b(r) + 3p(r). -32r*2 + r + 1 Let v(s) = 14s*2 + 6s - 4. Let j(i) = 29i2 + 11i - 7. Calculate -4j(l) + 7v(l). -18l2 - 2l Let j(n) = 109n. Let h(a) = -54a. Give 5h(m) + 2j(m). -52m Suppose -13 = -2v + v. Let z(h) = 11h2 + 13h	{ "pile_set_name": "DM Mathematics" }
- 1/8k4 - 1/120k6. Calculate j(6). -6 Let i be (-30)/(-70) - 3224/(-7). Let z(h) = -457 - i + 915 + h3 + 5h2 + h. What is z(-4)? 9 Let j be 8/(-84) + (-774)/(-189). Let k(p) = -25 + 7 + 8 + 7 - 2p + j. Let c be (1/(1/2))/2. What is k(c)? -1 Let j(x) = x*3 - 4x*2 + 3. Let s(w) = 4w - 63. Let y be s(15). Suppose -2m - 3 = -h, 0 = -4m + m + 3h - 12. Let b = m - y. Calculate j(b). 3 Suppose 1 - 5 = -4a. Let p(h) = -732h + 2 + 724h + h*2 + a. Determine p(6). -9 Let x = -12 + 17. Suppose 13 = -2h + 3q, -xq + 3 = -22. Let m(g) be the first derivative of -g*2 - 507. Give m(h). -2 Suppose 2d - 4d + 10 = 0, 32 = -3p + 4d. Let o(b) = -7b*2 + 7b - 2. Let a(m) = -5m2 + 6m - 3. Let i(y) = 4a(y) - 3o(y). Give i(p). -2 Let z(w) = 172w + 115. Let h(o) = -47o - 29. Let k(c) = -22h(c) - 6z(c). Determine k(32). 12 Let f be 5(-2 + 0)/2. Let r(h) = -h + 7. Let b(g) be the first derivative of g - 24. Let m(i) = -4b(i) + r(i). What is m(f)? 8 Let s = -9189 - -9170. Let m(f) = -f*2 - 19f - 40. Give m(s). -40 Let p(t) = t*3 + 20t*2 + 72t - 52. Let w be p(-15). Let q(m) = m*3 + 8m*2 + 7m - 3. Give q(w). -3 Let g = 34 + -39. Let m(h) be the first derivative of -2h + 1/3h3 - 30 + h2. Determine m(g). 13 Let u(j) = -9j + 6. Let f(i) = 6i - 5. Let n(g) = g + 4. Let q be n(3). Let p(d) = qf(d) + 5u(d). Determine p(-5). 10 Let r(j) be the third derivative of -j5/120 - j4/24 - 5j3/6 - 12j*2. Let x(p) be the first derivative of r(p). Let i be (-12)/(-8)(2 - -2). Give x(i). -7 Suppose 295 = -2j + 7j + 3g, 0 = -j - 3g + 59. Let x(b) = b - 55 - j + 105. Let u = -11 - -18. Determine x(u). -2 Let h(q) = -62q2 + 61q - 109. Let j(s) = -23s2 + 20s - 36. Let r(i) = -3h(i) + 8j(i). What is r(10)? 9 Let r(w) = 3w - 32. Suppose -28d - 9d = -19d - 270. Give r(d). 13 Let b be 11 + (-35)/(-15) + 49/(-3). Let w(s) = 2s3 + 2s*2 - 8s + 4. Give w(b). -8 Let d be (-2 + (-2)/6)(-17 + 23). Let a(u) = -13u - 180. What is a(d)? 2 Suppose 15 = 3y + 3. Suppose -yu + 57 = -5t, 0u = u + 2t - 11. Let o(x) = -11 + x + 42 - 14 - u. Calculate o(-7). -3 Suppose 0 = -3w + w + 6. Suppose y - wy + 12 = 0. Let d(p) be the third derivative of -p4/24 - p3/3 - 1149p*2 - p - 5. Determine d(y). -8 Let p(o) = 28o - 72o + 8o*2 - 1 + 41o + o3. Determine p(-9). -55 Let l(b) = b3 - 17b2 + 32b - 35. Suppose 6q + 146 - 461 = -15q. Determine l(q). -5 Let j(m) = m*3 - 12m - 15m2 + 2m - 4m - 22. Suppose h - 2668 = -4w - 2628, -5h + 74 = -w. Determine j(h). 10 Suppose 47v - 20 = 43v. Let p(c) = 6c*2 - 14c2 + c2 + 6c2 + 8c - v. Suppose 8 = f - 4z, f - z = -4z + 8. Determine p(f). -5 Let f(d) = 155d - 17. Let o(a) = 133a - 15. Let l(u) = 6f(u) - 7o(u). Calculate l(10). -7 Suppose -d - 22 = 5a + 2d, 0 = -3d + 3. Let s be 50 + (3/4)/(a/(-20)). Let k(w) = sw - 19w + 3 + w2 - 11w - 16w. Give k(-7). 3 Suppose -211i = -70i + 423. Let y = 21 + -19. Let q(s) = s2 - 108s + 0s2 + y + 111s. Calculate q(i). 2 Let r(v) = 26v - 266. Suppose 176 + 1374 = 74c + 81c. Give r(c). -6 Let n(c) = 4c - 3. Let a(t) = t*2 + 23t - 30. Let s(l) = a(l) - 3n(l). Determine s(-10). -31 Let l(q) = 21q - 83. Let z(h) = -84h + 331. Let y(x) = -9l(x) - 2z(x). Calculate y(4). 1 Suppose -3r - 34330 = -4c - 34336, 0 = -3r + 2c. Let a(p) be the first derivative of p2/2 - 2p + 2. What is a(r)? -4 Let o(h) = 9191 + h*2 - 2h + 2h - 9163 - 8h. Calculate o(5). 13 Let v(s) = -s2 - 4. Let q(k) = -k2 - 1. Let x(p) = -2q(p) + v(p). Let u be (16 + -2 + -2)/1. Let f = -15 + u. Give x(f). 7 Let j(k) be the first derivative of 3/2k*2 - 10 - k. Let r = -38 - -40. Give j(r). 5 Let y(a) = a - 3. Let f(q) = 5q + 8 + 2q + q2 + 5. Suppose 0 = 8z + 77 - 61. Let w be f(z). Calculate y(w). 0 Suppose -6i - 2 = 5h, 3h - 145i + 4 = -150i. Let j(b) be the first derivative of -7 + 1/4b*4 + 3b*h + b - 7/3b3. Calculate j(5). -19 Let r(i) be the third derivative of -i5/60 + i4/3 - i3/3 + 54i2. Let o be (-92)/(-22) - 44/242. Determine r(o). 14 Let d(a) = 2a - 20. Let h be d(11). Let l(j) = -hj2 - 3 + 6 - 4 + 2. Let n(t) = -t3 + 4t*2 + 10t + 14. Let y be n(6). Calculate l(y). -7 Suppose -12o - 15o = -26o - 9. Let m(l) = l2 + 2l - 89. Determine m(o). 10 Suppose -o = 6o - 98. Suppose -2c = 3y - 4c - 14, -o = -4y + 5c. Let u(h) = -h*3 + 6h*2 - 10. Give u(y). -10 Let o(a) = -7a - 178. Let n(q) = -q*2 - 24q + 672. Let w be n(17). Determine o(w). -3 Let h(f) = 16 + 2 + 53f2 - 14f*2 - 40f*2. What is h(-5)? -7 Let v(z) = -12z - 4. Let o(n) = -7n - 5. Let s(w) = -3o(w) + 2v(w). Calculate s(5). -8 Let q(i) = -i2 + 40i + 80. Let r be (4/(-3) + 2)/((-6)/18). Let y be q(r). Let g(v) be the second derivative of 2v3/3 - 3v*2/2 - v. Give g(y). -19 Let u(o) = 242o - 4 - 238o + 3 + 3. Suppose 0f - 2f - 2q + 4 = 0, q = -2f + 6. Suppose -fx + x - 18 = -3r, 3r = -x + 10. Determine u(x). -6 Let u(z) = -4z - 4 - z3 + 3z + 2z2 + 2z*3 - 3z. Let q = -3325 - -3322. What is u(q)? -1 Let p(w) = -w*2 + 18w - 62. Let v be p(4). Let j(o) = -7o + 7. Let i(k) = -20k + 19. Let t(y) = vi(y) + 17j(y). Calculate t(-5). 0 Let b = -12609 - -12641. Let o(a) = -2a2 + 63a + 23. Give o(b). -9 Let k be -7-1(1 + 0). Let d(v) = -v*3 - 30v*2 - 76v + 18. Let n be d(-3). Suppose -11 = -nh + k. Let r(z) = -z3 + 5z*2 + 8z - 7. Calculate r(h). 5 Let o be (-16)/(-8) - (-13 + 14). Let l(d) = 51d3. What is l(o)? 51 Let d(r) = r3 + 5r*2 + r + 2. Let b = -165 - -216. Suppose 25 = -56p + bp. What is d(p)? -3 Let g(n) = -2n*3 + 25n*2 - 36n + 33. Let p be g(11). Let q(b) = -4b + 44. Give q(p). 44 Suppose 13j = 16j + 45. Let x = j - -11. Let q(z) = -z2 - 3z + 4. What is q(x)? 0 Let c(o) = o*2 - o + 3. Let n be (-1)/((3 + (-15)/6)/(-2)). Suppose -nf + 2 = 10. Let l(z) = -z + 3. Let w be l(f). Determine c(w). 23 Let f(d) = 3d + 2. Suppose 7z - 11 = 24. Let w(c) = 2c - 2. Let r be w(11). Suppose -o + zo = r. What is f(o)? 17 Let n = -27 + -2. Let x = -32 - n. Let u(t) be the second derivative of -t5/20 - t4/4 + t3/2 + t2/2 + 4t. Give u(x). -8 Let o(r) be the third derivative of 0 + 1/120r*6 + 1/24r*4 - 98r*2 + 0r + 1/12r5 + 0r*3. Determine o(-4). 12 Let t(d) = -2d + 65. Let h be t(20). Suppose 16m = 9m. Suppose -hw + 21w - 4 = m. Let l(r) = 20r + 1. Determine l(w). -19 Let j(r) = 5r + 12. Suppose -8l - 3l + 66 = 0. Let n(d) = -11d - 26. Let m(y) = ln(y) + 13j(y). Give m(5). -5 Let s(h) = -h - 1. Suppose -177 = 39r + 525. Let q(a) = 8a + 9. Let w be (-12)/7 + 6/(-21). Let v(d) = rs(d) + wq(d). Determine v(-2). -4 Let p(r) = -r3 - 10r*2 - 4r + 2. Let j(g) = -3g2 - 10g*2 - 7g + 5 - 6g2 - 2g*3. Let d = -148 + 152. Let z(y) = dj(y) - 7p(y). Calculate z(-6). 6 Let j(m) = m - 4. Let x be (-8)/3(-33)/22 + -4. Suppose xv = -3a + 4v + 11, a - 3 = 2v. Determine j(a). 1 Let g(v) = 39 + 8v2 - 42 - 5800v*3 + 4v + 5801v3. Suppose -3t - 35 = 2t. Determine g(t). 18 Let w be (4/(-16)-6)/(6/32). Suppose wm = -5m - 13. Let n(v) = -20v3 - v - 1. Determine n(m). 20 Let o(t) = -13t + 1. Suppose -n + 130 = 4n. Suppose -ng + 31g = -25. Let y be -4 + 8 - (0 - g). Give o(y). 14 Let g(m) = 4m - 3. Let r(f) = 5f + 1. Let k be r(2). Let d(b) = 12b - 8. Let j(w) = kg(w) - 4d(w). Let h = -10602 + 10603. What is j(h)? -5 Let g(q) be the second derivative of q*5/10 + 11q*4/12 + 11q*3/6 + 3q*2 - 2q - 686. Determine g(-4). 10 Let d(z) = -z*3 - 1 - 25z + 377104z2 - 377067z*2 - 10z. Determine d(36). 35 Let t(u) = u3 - u2 + u + 1. Let z(f) = -3f3 + 2f + 0f3 - 3f - 2f2. Let o(a) = t(a) - z(a). Suppose -21g - 38 + 29 = 12. Determine o(g). -4 Let f(x) be the third derivative of -x*4/24 + 2x2. Let v be f(6). Let w(p) be the second derivative of -p3/2 - 9p2/2 + 1681p. What is w(v)? 9 Let q(v) = v*3 + 5v*2 - v - 4. Let m be q(-5). Let t(u) = -8u + 20. Let d(z) = 11z - 33. Let g(b) = -3d(b) - 5t(b). What is g(m)? 6 Let g(t) = 6t - t*2 - 33 + 69 - 42. Suppose -2m + 5m = 12. What is g(m)? 2 Let s(v) be the first derivative of -v*3/3	{ "pile_set_name": "DM Mathematics" }
Let s(x) = 0. What is x? -1, 1 Let w(a) be the first derivative of -a*6/9 + 4a*5/15 - 4a3/9 + a2/3 + 4. Suppose w(o) = 0. What is o? -1, 0, 1 Let z(p) be the third derivative of 0 + 1/240p6 + 1/840p*7 - 4p*2 + 0p - 1/96p4 - 1/120p*5 + 1/24p*3 - 1/1344p8. Factor z(g). -(g - 1)3(g + 1)2/4 Suppose 4w*2 + 0w*4 - 1/2w*5 + 0 + 3/2w + 3w3 = 0. Calculate w. -1, 0, 3 Suppose 0 = -2n - 2, -n = -3m - 101. Let g be (-8)/2 - m/8. Suppose gz*2 + 1/2 + 3/4z = 0. Calculate z. -2, -1 Let l(r) = 7r2 - 7r. Let f(d) = -4d2 + 4d. Let u(t) = -11f(t) - 6l(t). Let u(w) = 0. Calculate w. 0, 1 Let o(g) = -12g5 + 15g*4 - 12g*3 + 9g*2. Let z(l) = 3l*5 - 4l*4 + 3l*3 - 2l*2. Let r(m) = 2o(m) + 9z(m). Solve r(h) = 0. 0, 1 Let u(y) be the second derivative of 1/20y*5 - 2/45y*6 + 1/9y*4 + 1/126y*7 + 0y*2 - 2/9y*3 + 0 - 5y. Factor u(k). k(k - 2)2(k - 1)(k + 1)/3 Suppose -2z + 7 = 4k - k, 4z - 2k - 6 = 0. Suppose -2t - 2x + 4 = -z, 3t = 2x + 4. Determine d, given that 0 + 1/2d - 1/2d3 + 0dt = 0. -1, 0, 1 Let c(u) be the second derivative of u7/2520 - u5/120 + u4/4 + 2u. Let h(n) be the third derivative of c(n). Factor h(a). (a - 1)(a + 1) Suppose 0 = -4h - 4h + 40. Suppose -q - 4i = h + 3, 10 = -5i. Factor -1/4v2 + 1/2v + q. -v(v - 2)/4 Let y = 95 - 473/5. Let s(h) be the first derivative of -yh*2 + 3/5h*4 - 2/15h*3 + 0h + 1. Solve s(w) = 0 for w. -1/2, 0, 2/3 Let t(f) be the second derivative of -f*4/20 - 3f*3/10 - 3f*2/5 - 3f. Factor t(d). -3(d + 1)(d + 2)/5 Let v(g) be the first derivative of g8/560 + g7/280 - 8g3/3 + 8. Let o(h) be the third derivative of v(h). What is p in o(p) = 0? -1, 0 Suppose 12 = 2s - 4o, 5o + 15 = -7s + 3s. Determine h so that h*2 + sh - 4/3 + 1/3h3 = 0. -2, 1 Let m(x) be the second derivative of 5x*9/1008 + 3x*8/224 + 3x7/280 - x4/2 + 7x. Let h(j) be the third derivative of m(j). Solve h(i) = 0 for i. -3/5, 0 Let k = -13 + 17. Let v(b) be the third derivative of 1/180b*5 + 0b + 0b3 - 1/360b*6 + 1/72b*4 - kb*2 - 1/630b7 + 0. What is n in v(n) = 0? -1, 0, 1 Let w(l) be the first derivative of -l5/5 + 3l4 - 22l*3/3 - 42l*2 - 49l - 44. Factor w(a). -(a - 7)*2(a + 1)*2 Let d(y) = 3y2 - 3. Let j(r) = -r3 - 2r2 + r + 2. Let b(q) = -4d(q) - 3j(q). Solve b(h) = 0 for h. -1, 1, 2 Let l(n) be the first derivative of -n2 + n + 0n*3 - 1/5n*5 + 1 + 1/2n4. Factor l(a). -(a - 1)3(a + 1) Let l(b) be the first derivative of -b4/8 + b3/3 + 17. What is g in l(g) = 0? 0, 2 Let d be (46 - -3)3/6. Factor 2 + 10f + df*4 - 3/2f*2 - 35f3. (f - 1)2(7f + 2)2/2 Let q(t) be the first derivative of t7/3360 - t6/1440 - t5/240 - t*3/3 - 2. Let s(o) be the third derivative of q(o). Factor s(k). k(k - 2)(k + 1)/4 Let f(y) be the first derivative of 0y + 5 + 0y2 + 1/9y*3 + 1/5y*5 - 1/4y*4 - 1/18y6. Factor f(x). -x2(x - 1)3/3 Let 4 + 2 + 39v + 22v3 + 11v*3 + 10v*5 + 69v*2 - 22v*5 - 15v4 = 0. What is v? -1, -1/4, 2 Let g(n) = n3 - 7n2 - 7n - 6. Let i = 21 - 13. Let s be g(i). Factor 6/7ds - 2/7d - 4/7d3 + 0. -2d(d - 1)(2d - 1)/7 Let q(d) = 2d*2 - 16 + 0d*2 + 7d*2 - 4d2. Let y(w) = -w2 + 3. Let m(f) = -2q(f) - 11y(f). Suppose m(b) = 0. What is b? -1, 1 Let q(g) = g - 1. Let z be q(1). Suppose z = 5h + 4k + k, -2h + 2k = 0. Find y, given that -4/3y + 14/3y*3 + 10/3y2 + h = 0. -1, 0, 2/7 Let p(i) be the third derivative of -i6/480 - i*5/240 + 2i2. Factor p(h). -h2(h + 1)/4 Let l(h) = 4h*2 + 18h - 18. Let g(a) = 14 - 14 - a*2 - 2a + a. Let b(k) = 6g(k) + l(k). Determine m so that b(m) = 0. 3 Factor 0 - 12v*3 + v - 2v*2 + 11v*3 + 2. -(v - 1)(v + 1)(v + 2) Suppose -5k = -3p + p, -4p + 14 = -3k. Let j = 53/84 - -1/28. Solve -2/3h*4 - jh*3 - 2/9h*p + 0h - 2/9h2 + 0 = 0. -1, 0 Let x(c) = -c3 + 3c*2 - 2. Let h be x(2). Suppose -hv = 4r - 6 + 2, v = -4r + 6. Factor -1/4qr - 1 + q. -(q - 2)2/4 Let p(l) be the third derivative of 1/30l*4 - 1/30l*3 - 1/150l*6 + 1/300l*5 + 0l + 0 + 4l2. Suppose p(b) = 0. What is b? -1, 1/4, 1 Let k(f) be the third derivative of 0 - 7/12f*4 - 3f*2 + 1/6f*5 + 2/3f*3 + 0f. Factor k(a). 2(a - 1)(5a - 2) Suppose 4k - 2k = 14. Suppose i3 - i2 + 3i + ki2 - 3i*2 - i = 0. What is i? -2, -1, 0 Let j(m) = 3m2 - 12 + m2 + 2m2 - 12m*3 + 4m - 10m4. Let w(f) = -f4 - f3 + f2 - 1. Let y(v) = j(v) - 12w(v). Let y(u) = 0. Calculate u. -2, 0, 1 Let s = 163 + -160. Solve 2/7 - 2/7p2 + 2/7p - 2/7ps = 0 for p. -1, 1 Let n(p) = -p. Let z(r) = r2 - 8r - 4. Let q(o) = 24n(o) - 3z(o). Factor q(d). -3(d - 2)(d + 2) Let 100x2 - 12722x*4 + 12757x*4 - 4 + 20x + 115x3 + 4 = 0. Calculate x. -2, -1, -2/7, 0 Let d(f) = -3f*2 + 12f - 9. Let q be d(3). Factor qp3 + 0 + 3p*2 - 3/2p - 3p4 + 3/2p*5. 3p(p - 1)3(p + 1)/2 Factor 5w2 - 4416 + 15w + 4416. 5w(w + 3) Let r(c) be the first derivative of -13/10c4 - 7/5c*2 - 2c*3 - 2/5c - 8/25c5 - 2. Factor r(f). -2(f + 1)*3(4f + 1)/5 Suppose -2 = 3q - 3g - 32, 4q - 2g = 36. Solve -1/2n*2 - q + 4n = 0. 4 Let s be 1 + 20 - (-4)/(-4). Factor sk3 - 26k*3 - 2k*2 + 5k*5 - 12k*4 + 15k3. k2(k - 1)2(5k - 2) Let l(r) be the second derivative of 6r*5/5 - 27r*3/4 - 81r*2/8 - 38r. Find y, given that l(y) = 0. -3/4, 3/2 Let s(l) be the first derivative of 3l4/4 + 3l*3 + 9l*2/2 + 3l - 3. What is t in s(t) = 0? -1 Factor 2r + 2 - 12r*3 - r + 17r*3 - 8r2. (r - 1)2(5r + 2) Determine m, given that 0m - 1/3m2 + 4/3 = 0. -2, 2 Let x(m) = m2 - m. Let k(w) = -9w2 + 9w. Let f = 10 - 9. Let b(z) = fk(z) + 12x(z). Factor b(u). 3u(u - 1) Let a(b) = 9b2 + 54b + 98. Let y(d) = 14d + 33 + 5d - 3d + 3d*2 + 2d. Let o(q) = -6a(q) + 17y(q). Determine c, given that o(c) = 0. -3 Let l(s) be the second derivative of s5/50 + s4/15 - 11s. Find b, given that l(b) = 0. -2, 0 Let a(t) be the second derivative of -1/90t*5 - 5/27t*4 + 4/135t*6 + 4/27t*3 + 0 - 1/189t*7 + 8/9t*2 + 4t. Factor a(x). -2(x - 2)3(x + 1)*2/9 Suppose 11u - 14u = -6. Let i(t) be the third derivative of -1/150t5 + tu - 2/15t3 + 0 + 0t + 1/20t4. Let i(q) = 0. Calculate q. 1, 2 Let v(b) be the third derivative of 1/32b*4 + 0b + b*2 - 1/40b*5 + 1/160b*6 + 0 + 0b*3. Find l, given that v(l) = 0. 0, 1 Let f(h) be the first derivative of -2h*5 - 9h*4 - 16h*3 - 14h*2 - 6h - 7. Let f(p) = 0. Calculate p. -1, -3/5 Let p(j) be the third derivative of -j*8/84 + 4j7/105 + j6/15 - 4j5/15 - j4/6 + 4j*3/3 - 15j2. Find t such that p(t) = 0. -1, 1, 2 Let m(x) be the first derivative of -x4/78 - 4x3/39 - 4x2/13 + x + 1. Let l(k) be the first derivative of m(k). Let l(s) = 0. What is s? -2 Let s(x) be the second derivative of x8/2240 - x6/240 - x4/12 + x. Let b(p) be the third derivative of s(p). Factor b(k). 3k(k - 1)(k + 1) Suppose 4u = -2w + 16, 0 = -4u - u + w + 20. Factor 1/3r - 1/3r*3 + 0 + 1/3r*2 - 1/3r*u. -r(r - 1)(r + 1)2/3 Let i be (-99)/(-70) - 225/(-750). Suppose -10/7q*2 - 8/7 - 24/7q + iq3 = 0. What is q? -2/3, -1/2, 2 Let d(z) = z2 + 8z - 29. Let p be d(-11). Let h be ((-3)/3)/(1 - 4). Let -l*3 + l - 1/3 + 2/3l*p - hl*2 = 0. Calculate l. -1, 1/2, 1 Find n such that -375/4n*2 + 75/4n*3 + 625/4n - 5/4n4 + 0 = 0. 0, 5 Let n(s) be the second derivative of s7/2520 - s6/360 + s4/3 + 2s. Let z(c) be the third derivative of n(c). Factor z(m). m(m - 2) Let l be (6/93)/(-1). Let b be l/9 + 30/54. Determine z, given that -1/3z3 + 0z*2 + 0z - bz4 + 0 = 0. -1, 0 Suppose -2b - 2b = g + 12, 2b = 4g - 24. Suppose gt + 0t = 0. Factor 4/11m*2 + 0 + 2/11m*3 + tm. 2m2(m + 2)/11 Factor -5v2 - 748v*3 + 5 + 747v*3 + v + 0v. -(v - 1)(v + 1)(v + 5) Let s be 2(-2)/(-4 + -10). Let -2/7q + 0 + 2/7q4 + 2/7q*3 - sq2 = 0. What is q? -1, 0, 1 Let t(k) be the third derivative of -k2 - 1/6k3 - 1/240k*5 + 0 + 1/24k*4 + 0k. Let	{ "pile_set_name": "DM Mathematics" }
*4/24 + 7i*3/6 + 2i*2. Let w be b(-7). Suppose o = -wo + 33. Is 13 a factor of o? False Suppose 2 = -3f + 8. Suppose 6u = fu + 32. Is u a multiple of 2? True Let m(u) = -u - 17. Let w be m(0). Let o = -6 - w. Is 5 a factor of o? False Is 2 a factor of (((-9)/5)/35)/(-1)? False Let d(b) = 4b3 + 15b*2 - 9b + 9. Let r(o) = o3 + o2. Let q(g) = d(g) - 5r(g). Suppose -4a + 0i - 4i + 36 = 0, 0 = 5i. Is q(a) a multiple of 9? True Let o = 31 + -26. Does 3 divide o? False Let w = 26 + 13. Suppose -2u - 41 = 3v, 5v + w = 2u - 8. Let x = v + 37. Is x a multiple of 9? False Let b(n) be the second derivative of n5/20 - 5n*4/12 + 2n*3/3 + 2n*2 - 2n. Is 6 a factor of b(5)? True Suppose -2r - 2a - 32 = 0, -4a - 19 + 59 = -4r. Let t = r - -30. Is t a multiple of 9? False Let c be 1/(-2) - (-15)/(-6). Is (4/10)/(c/(-30)) even? True Suppose 0 = -0o - o + 5d + 17, 3o - 2d = 12. Is o - -1410/4 a multiple of 13? False Let c = -15 - -7. Let x = 8 + -7. Let r = x - c. Is r a multiple of 6? False Let j = -95 + 294. Is j a multiple of 9? False Let q(s) = -s + 5 - 6 + 10. Let m be q(5). Suppose -md + d = -114. Is 19 a factor of d? True Let z be -2 - -1(1 - -6). Suppose -zn - 8 = -c, 2c - 18 = 2n - 2. Is 8 a factor of c? True Let o = -7 + 6. Let s be ((-26)/(-8))/(o/(-8)). Suppose -j = -0j - s. Is 13 a factor of j? True Let c(b) = -b2 - 13b - 6. Let w(f) = -2 + f - 2 + 3. Let l be w(-5). Is c(l) a multiple of 18? True Suppose -5p = -5d + 355, -d + 2p = -6d + 320. Suppose -d = -5z + 29. Is z a multiple of 12? False Let h(x) = x2 - 8x + 6. Let n be h(8). Let o(k) = 11k - 6. Let g be o(n). Suppose z = 4z - g. Is 6 a factor of z? False Does 16 divide (-4372)/(-14) + -1 + (-120)/420? False Let y(i) = 16i2 + 3i + 3. Is y(3) a multiple of 13? True Let j = 92 - 36. Does 28 divide j? True Let t = 1 - 19. Does 4 divide 1860/108 + 4/t? False Let u(p) = -p*3 + 10p*2 - 8p + 9. Suppose 5w = 3y - 7 - 10, 0 = 5y + w - 47. Is u(y) a multiple of 9? True Let x(i) = -5i2 + 3 + i3 + 3i2 - 6 - i - 1. Let l be x(3). Suppose 8d - 6 = -lr + 4d, -d + 29 = 3r. Is 11 a factor of r? True Suppose 0 = 5g - 4g - 1. Suppose -6v + v = -5s + 60, -g = -v. Is s a multiple of 4? False Suppose -f - 3f + 533 = y, -y + 5f + 515 = 0. Suppose 0 = -x - 0x - y. Is 15 a factor of x/14(-8)/10? True Let h(m) = 6m*2 + m + 2. Suppose p = 2p - 3. Let r(c) = c*3 - 4c*2 + 5c - 4. Let s be r(p). Is 10 a factor of h(s)? False Suppose m = -c - 5 + 22, -2m - 8 = 0. Is 3 a factor of c? True Let b(o) = o3 - o2 - 3o + 1. Let n be (-33)/(-7) - 8/(-28). Suppose -nv + m = -2 - 10, 2v + m - 9 = 0. Is 10 a factor of b(v)? True Let q be -12 - -2 - (2 + 0). Suppose 0 = -3w + 4w + 4i + 9, 9 = -2w - 5i. Is 159/4 - w/q a multiple of 11? False Let q(b) = 12b*3 + b - 1. Suppose -7t = -3t - 5o - 9, 3o = -4t + 1. Is 6 a factor of q(t)? True Let u be (-5)/20 + (-2)/(-8). Let j = 2 - u. Is 2 a factor of j? True Suppose 3v - 8 - 10 = 0. Let c = -2 + v. Is c a multiple of 2? True Let y = 48 - 5. Suppose 0h = h + 3k - y, -66 = -2h + 4k. Is 2/(-8) + h/4 a multiple of 9? True Let h(y) = -y3 - y2 + 2y + 3. Let m be h(-2). Is 7 a factor of 19 + (-6)/m? True Suppose -2q = 3q - 25. Is q a multiple of 5? True Suppose 3n + 1065 = 3m, 1810 = 5m - 2n + 4n. Does 12 divide m? True Let p(d) = 2d2 - 6d + 2. Let r(t) = 2t - 5. Let s be r(5). Does 20 divide p(s)? False Let s = 16 - -50. Is 22 a factor of s? True Let a(z) = -3z3 + z2 - 1. Let j be a(-1). Let s = 36 + 16. Suppose 2r + 3r = 3n + 130, 0 = -2r - jn + s. Is 13 a factor of r? True Let t be 4/10 + 44/(-10). Let a = t - -9. Suppose -4x - 15 - 35 = -3k, -ax = 3k - 86. Is 11 a factor of k? True Let u be (-7 - -6)/(2/(-10)). Suppose 3r - 3s = 45, 7s - u = -3r + 2s. Does 4 divide r? False Let z(i) = -8i2 + 8 + 3i*3 - 3i - 4i3 + 6i. Is 26 a factor of z(-9)? False Suppose 5o = 3o. Suppose -4n + on - 64 = -4z, -5z = -3n - 72. Is z a multiple of 3? True Does 7 divide -3 + 245/2? True Let r = -1 - -3. Suppose 10 = rb - b. Is b a multiple of 5? True Let w(b) = b3 + b - 1. Let h(l) = 7l*3 + 3l*2 - 2l - 9. Let t(r) = -h(r) + 6w(r). Is t(-5) a multiple of 13? True Suppose -3z + 4z = -1. Let w be -4 - -11 - z2. Suppose -10 = 2d, l + 2d - d - w = 0. Is 12 a factor of l? False Suppose 2w + 14 = -0w. Let g(o) = -o*2 - 7o + 6. Is g(w) a multiple of 3? True Suppose -r + 4 + 16 = 0. Let s be 14/5 - (-4)/r. Suppose -25 + 6 = -st + g, -22 = -2t - 4g. Is t a multiple of 7? True Let p(j) = j3 + 3j*2 - 2j - 3. Let c = -3 + 7. Suppose -3y + 1 - 2 = 5d, -cd + y = 11. Does 3 divide p(d)? False Let b = 3 + 14. Suppose 0 = x - b + 7. Does 5 divide (-3)/(-24)x8? True Let f(p) = p3 + 14p*2 - 4p - 3p - 7p*2 + 4 - p. Suppose -3c = -0c + 24. Is f(c) even? True Let o(c) = 7c*2 - 2c. Is o(2) a multiple of 14? False Let d(h) = 2h2 + 12h - 22. Is 52 a factor of d(-16)? False Let k(j) = 2j2 - 6j - 7. Let q be k(5). Suppose 2y + 4u = -16, -2y + 5u - q = y. Does 10 divide (-214)/y + (-4)/6? False Let s(v) = -v*3 - 11v*2 - 12v + 8. Suppose 3g - 2g = -10. Is s(g) a multiple of 13? False Let q = -4 + 3. Is (2/(-6))/(q/81) a multiple of 9? True Let n = 112 + -186. Let l = -52 - n. Is (l - 0)(-2 + 3) a multiple of 8? False Let r = 18 + -16. Suppose q = rq + 5j - 93, 2q - 186 = j. Is q a multiple of 19? False Let d(n) = 5n2 - 7n + 5. Let g = 7 - 3. Let u be d(g). Suppose u = 2r + 3. Is 11 a factor of r? False Let h = 55 + -34. Is h a multiple of 6? False Let a be (-506)/(-7) + (-2)/7. Let u = -40 + a. Is 15 a factor of u? False Suppose -8 = 3f - 32. Suppose 0h = h + f. Is 42(h/(-3) - 2) a multiple of 13? False Let u = 76 + 33. Suppose -4v = -u - 59. Is 21 a factor of v? True Suppose 4f + 74 = d + 9, d - 55 = 2f. Let g = 111 - d. Suppose 3l = g + 33. Is l a multiple of 12? False Let x(b) = -b*3 - 5b*2 - 4b + 4. Let q be x(-4). Suppose qi + 2h = -2h + 72, -4i + 45 = -5h. Suppose 2j = 41 - i. Does 6 divide j? False Let i = 1 - -13. Let o = i + -1. Is 9 a factor of o? False Suppose 31 = -5g - 79. Suppose x - 12 = -3x. Is 10 a factor of -32/x - g? True Let u = -134 - -188. Does 7 divide u? False Let k(x) = 3x - 3 + x*3 - x - 1 + 9x2. Let n(q) = -q3 - 5q2 + 3q + 7. Let u be n(-5). Is 19 a factor of k(u)? False Let b(l) = 2l2 + 6l + 7. Does 15 divide b(-4)? True Let x(i) = -i*3 + 4i*2 - 2. Is x(3) a multiple of 2? False Let w(o) = -o + 8. Let p be w(5). Suppose 4f - 2f = 5q - 1098, 1099 = 5q - f. Suppose -2v + 182 = pz, -3z - z + q = -3v. Is 18 a factor of z? False Suppose 89 = 3v - 127. Does 29 divide v? False Let w = -2 - -7. Suppose q - 2 = k, -wq + 26 = -0k + 3k. Suppose kl - 94 = -4. Is l a multiple of 19? False Let l(q) = 3 + q - 3q + 0 - 6. Does 7 divide l(-10)? False Let f(w) = w3 - w2 + 3w + 1. Let t be f(3). Suppose 0 = -3h + h + t. Is 9 a factor of h? False Suppose -5t = -4l + 501, -5l + 2t = -10l + 618. Does 31 divide l? True Let b(i) = 34i2 + 4i + 2. Is b(-2) a multiple of 13? True Let d(v) = -v*2 - 8v + 6. Let y be d(-8). Let h(c) = -c*3 + 5c*2 + 8c - 5. Is 4 a factor of h(y)? False Suppose -5s - 2l = -46, 3l = -s + 2 + 2. Suppose -5q = -p - 28 - s, -11 = -2q - p. Is q a multiple of 4? False Let f be 40/7 - (-2)/7. Suppose 0 = -2x + 24 - f. Is 9 a factor of x? True Let s = 52 + -15. Does 3 divide s? False Let p(g) = g*2 + 4g + 1. Is 5 a factor of p(-6)? False Let a(r) = -r*2 + 13r + 6. Is a(10) a multiple of 12? True Let q be -2(1 + -2) - 1. Let o be q - (1 + -16 - 1). Is (2 + -1 - 2) + o a multiple of 8? True Let f(q) = 80q*2 - 4q + 5. Is f(1) a multiple of 15? False Let r(s) = -s + 1. Let x(k) = -5k + 9. Let o(a) = -4r(a) + x(a). Suppose -6 - 6 = -4c - 4u, 0 = 4c - 5u + 15. Is o(c) a multiple of 2? False Let d = 0 + 4. Is 15 a factor of (-7 - 3)/((-2)/d)? False Suppose -4f = -56 - 136. Is 13 a factor of f? False Let s(j) = -j3 + 4j*2 + 2. Let q be s(4). Suppose -2o = 4, -2o + 10 = qr - r. Is r a multiple of 14? True Let s(a) be the second derivative of a4/12 - a3/3 - a*2 + 2a. Does 11	{ "pile_set_name": "DM Mathematics" }
2r3 + 0 - 1/160r*6 + 3/80r*5. Determine a, given that o(a) = 0. -1, 2 Factor 0r*2 - 210r + 245r + 5r*2 + 30. 5(r + 1)(r + 6) Suppose -42k - 4 = -44k. Solve -1/5v - 2/5v4 + 2/5v*k + 1/5v*5 + 0v3 + 0 = 0 for v. -1, 0, 1 Let u(h) = -h2 + h + 5. Let m be u(0). Suppose s - 15 = m. Solve 0t3 + 9t2 + t3 + 27t + 7 + s = 0. -3 Let q(g) be the third derivative of 1/105g*7 + 1/60g*4 - 1/100g*6 - 1/150g*5 + 0g + 0g3 - 1/420g*8 - 2g*2 + 0. Factor q(a). -2a(a - 1)3(2a + 1)/5 Suppose -6t + 10 = 2s - 3t, -5s + 16 = 3t. Suppose -s = l - 6. Determine f, given that -6/7f3 + 2/7f*l + 6/7f*2 + 0 - 2/7f = 0. 0, 1 Let u(c) be the second derivative of -c*5/10 - 19c*4/18 - 11c*3/3 - 3c*2 + 13c. Factor u(v). -2(v + 3)2(3v + 1)/3 Let z(p) = 3p*2 - 2p + 2. Let i be z(1). Let f(s) be the second derivative of 0 + 1/6si + 2s + 0s2 - 1/12s*4. Factor f(c). -c(c - 1) Let f(r) be the third derivative of r7/245 - r5/70 + 33r2. Factor f(x). 6x*2(x - 1)(x + 1)/7 Let p be 1 + 4 + 4-1 + 1. Factor 1/3x3 + xp + x + 1/3. (x + 1)3/3 Let u(g) = g5 + g4 + g3 - g2 - g - 1. Let q(j) = 4j5 - j4 - 6j3 + j2 + j + 1. Let i(h) = -q(h) - u(h). Determine b so that i(b) = 0. -1, 0, 1 Let c be (-5 + 66/12)/((-6)/(-20)). Factor -4/3y*2 - cy - 1/3. -(y + 1)(4y + 1)/3 Suppose -2q + 30 = q. Let r(f) = -f3 + 3f*2 - 2f + 3. Let k(j) = 4j3 - 10j*2 + 6j - 10. Let s = 2 - -1. Let l(t) = qr(t) + sk(t). Factor l(a). 2a(a - 1)(a + 1) Suppose 5b - 18 = 12. Let z be 122/b(1 - -5). Factor 22m*4 - 27m*5 - 171m*3 - 12m*2 - 8 - 74m*4 - zm*2 - 56m*4 - 52m. -(m + 1)*2(3m + 2)3 Let z(x) = x + 1. Let d be ((-22)/8 - -3)4. Let i be z(d). Factor 1/3y3 - 1/3y - 1/3y4 + 0 + 1/3y*i. -y(y - 1)*2(y + 1)/3 Suppose 1 = n + 4. Let m = n - -5. Suppose 0l - 3l + 1 + 0l + 3lm - l3 = 0. Calculate l. 1 Suppose 4n - 3n = 2. Determine i, given that 0i3 + 0i + 6i4 + 3i*3 - 3i - 3i4 - 9i*n + 6 = 0. -2, -1, 1 Let u = -140/9 - -148/9. Let y(p) be the first derivative of -1/3p*2 - up3 - p4 - 1/9p6 + 1 - 8/15p*5 + 0p. Factor y(c). -2c(c + 1)*4/3 Let 4/11r + 0 + 2/11r2 = 0. Calculate r. -2, 0 Let l(i) be the first derivative of 2i5/35 - i4/14 - 10i3/21 - 3i2/7 - 2. Solve l(a) = 0. -1, 0, 3 Let d(v) be the second derivative of -v6/360 - v*2 + v. Let r(z) be the first derivative of d(z). Let r(m) = 0. Calculate m. 0 Let o(u) be the first derivative of -4u*3/15 + 2u2/5 + 6. Determine n, given that o(n) = 0. 0, 1 Let u(k) be the third derivative of -k9/30240 - k8/2520 - k7/504 - k6/180 + k5/60 + 3k2. Let x(t) be the third derivative of u(t). Factor x(o). -2(o + 1)*2(o + 2) Let v(c) be the first derivative of c*6/15 + 2c5/25 - c4/5 + 14. Let v(h) = 0. What is h? -2, 0, 1 Let f(a) = -a4 + a2 - a. Let l(b) = 2b4 + 21b*3 - 59b*2 + 65b - 24. Let o(h) = 5f(h) + l(h). Factor o(c). -3(c - 2)*3(c - 1) Factor -5/4 + 1/4z2 - z. (z - 5)(z + 1)/4 Suppose -2c - 2x + x = -11, -5c = -3x - 33. Let y be ((-4)/c)/((-4)/12). Factor -b*3 + 3b + b + 4 - 3by + 0b - b3 + b4. (b - 2)*2(b + 1)*2 Find n such that 6/5n*2 + 4/5 + 1/5n*3 + 9/5n = 0. -4, -1 Let o = 24 + -17. Suppose -3t + o = 1. Factor 1/3k*4 + 0 + 1/3k*3 + 0k*t + 0k. k*3(k + 1)/3 Let g = -3 - -4. Let z = g - -3. Let 3n2 + n + n3 + nz + n3 + n3 = 0. What is n? -1, 0 Let i(u) be the second derivative of -2u + 0 + 1/10u4 + 2/15u*3 + 1/150u*6 + 1/25u*5 + 1/10u2. Factor i(o). (o + 1)4/5 Let g(y) be the third derivative of y*5/20 - 4y*4 + 128y*3 + 24y*2. Factor g(v). 3(v - 16)*2 Let l = -275/2 - -138. Let 1/2s*2 + 0 + ls = 0. Calculate s. -1, 0 Let k(o) = 11o2 + 21o + 1. Let m(n) = -3n2 - 5n. Let f(v) = -v. Let s be f(7). Let r be 0/(-1) - (s - 2). Let z(h) = rm(h) + 2k(h). Factor z(c). -(c + 1)(5c - 2) Suppose 2d = -2d - 2a + 16, -5d + 20 = -4a. Suppose -2b + i - 2 + 4 = 0, 0 = b - 3i + 4. What is u in -1 + bu - 4 + 3u2 - du*2 + 4 = 0? 1 Suppose -4k + 7k = 0. Suppose -3n - n + 2j + 20 = 0, -5j - 20 = k. Factor -5u4 + 2u*4 + 2u*2 - 4u*5 + 3u*5 + 3u - 2un + 0u*5 + 1. -(u - 1)(u + 1)*4 Suppose 2q = 4 + 4. Suppose 4 = -3x + qx. Solve 0wx - w5 + 2 + 2w*4 + 2w*3 - 3w2 - w2 - 3w + 2w = 0. -1, 1, 2 Let u be (-14)/(-11) - 0/3. Factor 16/11i3 - ui*4 - 4/11i - 4/11i2 + 4/11i*5 + 2/11. 2(i - 1)*4(2i + 1)/11 Let a(l) = l2. Let n(i) = -3i*3 - 18i*2 + 3i + 6. Let z(f) = -12a(f) - n(f). Factor z(b). 3(b - 1)(b + 1)(b + 2) Let s = -210/31 + 3489/62. Find m such that sm3 - 75/4m*5 + 15/4m*4 + 0 + 33m*2 + 6m = 0. -1, -2/5, 0, 2 Let v = 22 + -16. Let k(h) = 7h2 + 5. Let t(d) = -4 + 1 - 3d2 - d2. Let u(q) = vk(q) + 10t(q). Determine i so that u(i) = 0. 0 Let i(l) be the first derivative of -l6/120 - l5/20 - l4/12 + l2 - 2. Let q(c) be the second derivative of i(c). Suppose q(n) = 0. What is n? -2, -1, 0 Let k(z) be the first derivative of z*4/28 + 5z3/21 - z2/14 - 5z/7 - 55. Suppose k(x) = 0. Calculate x. -5, -1, 1 Let q = -482/3 + 162. Let h(p) be the first derivative of -4/5p*5 + 0p + qp3 + p2 + 0p*4 - 1/3p*6 - 1. Find b such that h(b) = 0. -1, 0, 1 Let l(p) be the third derivative of -5p8/336 + p6/24 - p*2. Factor l(g). -5g*3(g - 1)(g + 1) Let t(p) = -3p + 1. Let w be t(-1). Factor 2j3 - 2j*w + 2j*3 - 2j*2 + 0j*2. -2j*2(j - 1)*2 Let t be -2((-21)/(-6) - 3). Let s be 1 + 2 + 2 + t. Factor m2 + m2 - 2m5 + m3 + 3m*5 - 2m*s - 2m3. m2(m - 2)(m - 1)(m + 1) Let f(m) be the second derivative of -11/2m*4 - 4m*2 + 0 - 2m + 9/5m5 + 20/3m3. Find z, given that f(z) = 0. 1/2, 2/3 Let k(l) be the second derivative of -l6/900 + l5/75 - l4/15 - 5l3/3 - 3l. Let a(u) be the second derivative of k(u). What is f in a(f) = 0? 2 Suppose 2s + 9 = 5s. Let q(g) = g + 1. Let l be q(s). Factor -o*5 - 4o4 - o4 + 3ol + o4. -o4(o + 1) Let c(f) = -8f3 + 64f*2 - 119f + 9. Let q(u) = -2u3 + 16u*2 - 30u + 2. Let k(p) = 4c(p) - 18q(p). Factor k(y). 4y(y - 4)*2 Find p, given that 9p*3 - 3p - 40p4 + 13p*4 - 9p - 8p2 + 32p*2 = 0. -1, 0, 2/3 Suppose 4y = 5y - 3. Determine o so that yo - 4o2 + 7 - 2 - 10o*3 - 1 + 7o = 0. -1, -2/5, 1 Let z(h) be the second derivative of h5/210 - h3/21 - 3h2/2 + 8h. Let d(a) be the first derivative of z(a). What is u in d(u) = 0? -1, 1 Suppose -15 = 19j - 53. Solve 24/7h*5 + 8/7 + 264/7h*3 + 218/7h*j + 134/7h*4 + 72/7h = 0 for h. -2, -1, -1/3, -1/4 Let h(a) be the first derivative of -2a3/27 - 2a*2/3 - 16a/9 - 28. Factor h(g). -2(g + 2)(g + 4)/9 Let m(z) be the first derivative of -3 + 1/2z2 + 0z - 1/30z4 + 1/150z*5 + 0z*3. Let t(y) be the second derivative of m(y). Solve t(f) = 0 for f. 0, 2 Let t be 3((-14)/6 + -1). Let g = t + 12. Factor -l - 1/2lg - 1/2. -(l + 1)2/2 Let x = -1 + 5. Factor 4s*3 - xs*2 - 2s*3 - 5s*2 - 5s*3. -3s*2(s + 3) Suppose 0 = -t + 5t - 12. Let w = 4 - -2. Determine x so that tx*2 - 4x*3 - 4x*2 - wx*4 + 3x2 = 0. -1, 0, 1/3 Let w(c) be the third derivative of -c7/315 - c*6/54 + 5c4/54 + c3/9 - 4c2. Determine t, given that w(t) = 0. -3, -1, -1/3, 1 Let z = -6 - -13. Suppose 4a + 29 = 5j, 2j = zj + 5a - 20. Factor -2i3 + 2i*4 - 3i*4 + 3i5 + i2 - ij. i2(i - 1)(i + 1)(2i - 1) Let o = 20 + -11. Let m(z) = z*3 - 5z*2 - 6z + 2. Let t(g) = -3g3 + 21g*2 + 24g - 9. Let f(k) = om(k) + 2t(k). Determine x so that f(x) = 0. -1, 0, 2 Let d(h) be the third derivative of 0h + 3/40h*5 + 3h*2 + 3/448h*8 - 1/3h*3 - 23/480h*6 - 1/70h*7 + 0 + 1/8h*4. Suppose d(n) = 0. What is n? -1, 2/3, 2 Solve 66t*3 - 14t*3 + 210t*2 - 705t*4 + 3t*3 + 710t*4 + 200 + 340t = 0 for t. -5, -2 Let o(x) = x*3 - 4x*2 + 3x + 2. Let y be o(3). Let 0 + 0z - 2/3z*y - 2/3z*3 = 0. What is z? -1, 0 Let z be 9/18 - (-10 - 3). Determine o so that 27/2o + 9/2o2 + 1/2o**3 + z = 0. -3 Let h(r	{ "pile_set_name": "DM Mathematics" }
*2 + loy2 + 22ly - o4y*2 + 11o*3 wrt o. 42ly2 - 24oy2 + 66 Find the third derivative of -2n*3r*3 + 16n*3r - 2n2r*3 - 95n*2r + n*2 wrt n. -12r*3 + 96r Differentiate 43cil2 - 2cil + 560cl*2 + cl + 4il*2 + il + l wrt i. 43cl*2 - 2cl + 4l*2 + l Find the second derivative of 18v*5 - 50v*3 - 15v - 10 wrt v. 360v3 - 300v What is the third derivative of -6129lp*3 - 2lp2 + 55lp - p2 + 2p wrt p? -36774l Find the third derivative of 5gn6 + gn*5 + 8gn3 - 406gn2 wrt n. 600gn3 + 60gn2 + 48g What is the first derivative of -d*3x*3 + 264dx3 - 5dx - 7774x*3 wrt d? -3d*2x*3 + 264x*3 - 5x Find the third derivative of 396a2d*4 - 2a*2d*3 - 50a*2d*2 + 2a*2d - 2d2 wrt d. 9504a*2d - 12a2 What is the second derivative of -6c*3n*2 - 5c*3n - 14c3 - 11c*2n*5 wrt n? -12c*3 - 220c*2n*3 Differentiate -8n*3 + 734n*2 + 11542 wrt n. -24n*2 + 1468n What is the third derivative of -1080h4 - 2h*2 + 188 wrt h? -25920h Find the second derivative of 1995s4 + 2s*3 + 2243s wrt s. 23940s2 + 12s What is the third derivative of 3c4l - c*3l*3 + 18c*3l + 5c2l*3 + 6c*2 - 2c wrt c? 72cl - 6l3 + 108l Find the second derivative of -254w3 - 115w wrt w. -1524w Find the second derivative of -o4t + 5o4 - 5o*2t*2 - 5ot2 + 2ot - 23o wrt o. -12o2t + 60o2 - 10t*2 What is the derivative of 4bx2 - b + 55x3 - x2 + 45 wrt x? 8bx + 165x2 - 2x Find the second derivative of 244a3 - 1076a. 1464a What is the second derivative of 71m*5 - 2m*4 - 61m? 1420m3 - 24m*2 What is the derivative of 390a - 349 wrt a? 390 What is the third derivative of d*3s*4 - 69d*3s*2 + 2d*3 - 11d*2s*5 wrt s? 24d*3s - 660d2s*2 What is the second derivative of bt*2 - 29bt - 72t*2 - 1 wrt t? 2b - 144 Find the second derivative of a*5k + 2a5 - 41a*2 + 478ak wrt a. 20a*3k + 40a3 - 82 What is the third derivative of o4 + 111o*3 + 24o*2 + 6o? 24o + 666 What is the derivative of -1430k*3 + 4396? -4290k*2 What is the third derivative of -20dg3 - 82dg2 + 4dg - g wrt g? -120d What is the third derivative of -1485q3 + 84q*2? -8910 What is the derivative of 431m + 4853? 431 Find the third derivative of -82k3u*2 + 2k3 + k2u2 + 85k*2u wrt k. -492u2 + 12 Find the third derivative of h2sx4 + 78h*2x + 4184hx*4 + 24sx2 wrt x. 24h*2sx + 100416hx Find the second derivative of -9567r*4 + 9485r. -114804r2 Find the third derivative of 18y*4z + 5y3z*2 - 359y*2z*2 wrt y. 432yz + 30z2 Differentiate i2u + 104i*2v + 2iuv2 - 3iv2 + 31uv2 wrt u. i2 + 2iv2 + 31v*2 Find the third derivative of -70r*2u*4 + 4r*2u*2 + ru*4 - 3u*2 wrt u. -1680r*2u + 24ru What is the second derivative of 65a4 + 2a*2 - a - 453 wrt a? 780a*2 + 4 Find the third derivative of 340a*3 - 2a*2 - 1002a wrt a. 2040 Find the third derivative of 590q3u*3 - 286q*2u + 2qu*3 wrt q. 3540u*3 Find the second derivative of 53nq2 - 2nq - n + 16q*2 - 27q wrt q. 106n + 32 Find the second derivative of -c3 - 2c*2s*2z - 119c2sw2 - 3cs2w - csw*2z + 9cw + 4s2 wrt c. -6c - 4s2z - 238sw*2 Find the second derivative of 3gn2u - 5gn*2 + gn - n*2u - 6nu + 4u wrt n. 6gu - 10g - 2u What is the second derivative of 2fh2in - 2fh2i - 252fi*3n - 199fi + 3fn + 25h2i2 - h2in + 2h2n - i*2 wrt i? -1512fin + 50h2 - 2 Find the first derivative of d3 + 14d*2p + 2dw*2 - 12p + w*2 - 2 wrt d. 3d*2 + 28dp + 2w*2 Find the second derivative of 7m*2x + 7m2 + mx - 180m - 2x wrt m. 14x + 14 Find the first derivative of 208b*4 + 146. 832b*3 What is the derivative of -2b*4 + 47b*2 + bj + 225j wrt b? -8b*3 + 94b + j Differentiate 293k2 + 1790. 586k Find the second derivative of 293f2lt + 5flt + 6l wrt f. 586lt Find the second derivative of -2q*5 + 240q*3 + 362q wrt q. -40q3 + 1440q Differentiate -1064b3 + 493. -3192b*2 What is the derivative of 2j*4k - 2j2k*3 - 24jk2 + 5k*3 - 16k wrt j? 8j3k - 4jk*3 - 24k*2 Find the third derivative of -45h*6x + 3h5x*2 - 2h*2x*2 + 2h*2x + 77h wrt h. -5400h*3x + 180h2x*2 Find the second derivative of 26g*3 - 6g*2 + 20g - 26. 156g - 12 Find the second derivative of -7717i*4 + 166i. -92604i2 What is the derivative of 2765w - 1037 wrt w? 2765 What is the derivative of 3456c3 + 674 wrt c? 10368c*2 Find the third derivative of 15f*2h*4 + 143f*2h + 11h6 + h2 wrt h. 360f*2h + 1320h3 What is the third derivative of 22l*3 + 5l*2 + 16l? 132 What is the third derivative of -190c3k*6m - c*3k*3m - 2c3k*2 + 253c*3k + c*2km wrt k? -22800c*3k*3m - 6c3m Find the first derivative of -v*4 + 4607v*2 - 8560. -4v*3 + 9214v What is the third derivative of 337t6 + 366t*2? 40440t*3 Find the third derivative of 1703dh3p*3 - dh*3 - dh*2p*3 - dhp2 - 16h*2p*2 + 2hp2 + p4 + 13p wrt p. 10218dh*3 - 6dh2 + 24p Differentiate 7l3v + 17l3 - l2 + 707v wrt l. 21l2v + 51l2 - 2l What is the second derivative of 8r2t*3 - 17r*2t + 54rt*3 - 2rt2 wrt r? 16t*3 - 34t What is the third derivative of q*4 + 516q*3 + 9q*2 - q - 23 wrt q? 24q + 3096 Differentiate 7662d4 + 4211 wrt d. 30648d*3 What is the third derivative of -2u*4 + 504u*3 + 2u*2 - 7u + 257? -48u + 3024 What is the second derivative of 3190o*4 - 2o*3 + 3899o wrt o? 38280o2 - 12o What is the derivative of 218s4 - 304? 872s*3 What is the derivative of 4150n*2 - 7802? 8300n What is the derivative of -46h2j*3k3 - h2j - 549hj3 - 3j*2k wrt k? -138h2j*3k*2 - 3j*2 What is the derivative of -79n - 483 wrt n? -79 What is the first derivative of 125kz*2 - 36z*2 wrt k? 125z2 What is the third derivative of -f3m2 + 2f*2m*2 - 33m*2 wrt f? -6m*2 Differentiate -1020l*2u + 8009l2 + 3u*3 wrt u. -1020l*2 + 9u*2 What is the derivative of 27k*2rx2 + 1564k*2r + 2k2 - 4rx2 + 2x*3 wrt x? 54k*2rx - 8rx + 6x*2 What is the third derivative of -12607n*4 - 968n*2 + 6 wrt n? -302568n What is the second derivative of -9f3 - 17f*2 + 14f + 39? -54f - 34 What is the derivative of -928z*4 - 624 wrt z? -3712z*3 What is the first derivative of 3c*4 + 2c*2z - 4cz + 41z + 1 wrt c? 12c*3 + 4cz - 4z Differentiate cd2n*2 + cd*2 - 108cdn*2 - 2d*2n + 2d - 202n2 wrt c. d2n2 + d2 - 108dn2 Find the third derivative of -244j*4 + 3j*3 - 1740j*2. -5856j + 18 What is the derivative of -2j4 - 753j*2 + 1284? -8j*3 - 1506j What is the first derivative of -1006cf*2 - 4c + 4326f2 wrt c? -1006f*2 - 4 Find the second derivative of -8716a*2 - 42a - 49 wrt a. -17432 Differentiate 35m4 + 1439 with respect to m. 140m*3 What is the first derivative of -13dsv*3 - 2dsv - 10d - 23sv3 - 3s + v*3 wrt d? -13sv3 - 2sv - 10 Find the third derivative of -34p*2u*3w*3 - 3p*2u*3w + 3p2w*3 - 4723p*2w*2 - 27w*3 wrt w. -204p*2u*3 + 18p*2 - 162 What is the first derivative of -977n*3u - 38u wrt n? -2931n*2u Find the third derivative of -3g4y*2 + 143g*3y2 - g3y - 28g*2y2 + g2 + 8y2 + 4 wrt g. -72gy2 + 858y*2 - 6y What is the second derivative of 10y5 - 5y*2 - 2y + 15 wrt y? 200y3 - 10 Find the second derivative of 4506p*2u*3 - 12pu3 + 3pu2 + pu - 15u3 wrt p. 9012u*3 What is the third derivative of -1001i*4q*2 - 2i*3q*3 - 2241i*2q*3 wrt i? -24024iq2 - 12q*3 Find the first derivative of -5820k*3 - 1312. -17460k*2 Find the third derivative of -247r*3 + 6r*2 + 2. -1482 What is the second derivative of -459a*5 - 20a + 7 wrt a? -9180a3 Find the first derivative of 124q + 272. 124 F	{ "pile_set_name": "DM Mathematics" }
/7d3 + 0d + n. d*2(d - 3)/7 Let d(m) be the third derivative of 0m + 137m*2 + 17/48m*4 + 0m*3 - 1/240m*5 + 0. Determine a so that d(a) = 0. 0, 34 Let r(p) = 8p*3 + 93p*2 - 101p - 13. Let l(t) = 4t3 + 46t*2 - 50t - 6. Suppose 18g + 152 = 386. Let d(x) = gl(x) - 6r(x). Factor d(o). 4o(o - 1)(o + 11) Let h(a) = -4a2 + 689a + 4282. Let b be h(-6). Factor 0 + 1/4lb + 45/4l*2 - 25/2l - 3l3. l(l - 5)*2(l - 2)/4 Let a(u) be the third derivative of -u*5/210 - 233u*4/84 - 232u*3/21 - 2618u*2. Factor a(j). -2(j + 1)(j + 232)/7 Suppose -3l - i = -15, 9l + 1 = 10l - i. Let j(y) be the third derivative of 1/40y6 + 0 + 0y + 0yl + 0y*3 + 0y*5 + 8y*2. Factor j(g). 3g*3 Let b = -2161/94 + 4369/188. Factor 7/4o*4 - 11/4o + 5/2o3 - 5/4 + bo*5 - 1/2o*2. (o - 1)(o + 1)*3(o + 5)/4 Find y such that 165/4 - 3/8y2 + 51/8y = 0. -5, 22 Find u, given that 1683/2u4 + 546u - 429u3 - 54u*5 - 1377/2u*2 - 90 = 0. -1, 1/4, 2/3, 15 Let s = 3122 + -3118. Let b(h) be the second derivative of 0 + 13/4h5 - h6 + 35/6hs + 5/2h*3 - 23h + 0h2. Suppose b(r) = 0. Calculate r. -1/2, -1/3, 0, 3 Let h(c) be the second derivative of -c5/15 + 11c*4 - 726c*3 - 109c*2 + 44c. Let s(d) be the first derivative of h(d). Factor s(z). -4(z - 33)2 Determine o so that 36o*3 - 2/3o*2 + 0 - 36o + 2/3o4 = 0. -54, -1, 0, 1 Let p(j) be the second derivative of -j5/190 - 22j*4/57 - 41j*3/57 + 86j*2/19 + j + 175. Solve p(t) = 0 for t. -43, -2, 1 Let h = 128 + -125. Determine f, given that -12f*4 + f + 4f*4 - 6f*h + 5f + 0f3 - 2 + 10f2 = 0. -1, 1/4, 1 Let c(y) be the second derivative of -y3 + 7/6y4 - 22y + 1/15y6 + 4 + 0y*2 - 1/2y*5. Factor c(i). 2i(i - 3)(i - 1)*2 Let q(x) be the first derivative of -26/11x*2 - 37/44x*4 - 1/66x*6 - 16/11x - 2/11x5 + 26 - 64/33x*3. Find b, given that q(b) = 0. -4, -2, -1 Find z, given that 35/4z*3 - 37/4z*2 + 9 + 1/4z*4 - 35/4z = 0. -36, -1, 1 Let w(m) be the first derivative of -1/2m4 - 26 - m - 1/10m*5 + 3m*3 - 5m*2. Let i(c) be the first derivative of w(c). Factor i(r). -2(r - 1)*2(r + 5) Let i(x) = -3x + 106. Let t be i(34). Let w be -46/t4/(-66). Solve 0 - 6/11c*2 + wc - 24/11c3 - 14/11c*4 = 0. -1, 0, 2/7 Let x(r) be the second derivative of 841r*7/294 - 377r*6/30 - 1031r*5/20 - 3173r*4/84 + 272r*3/21 - 10r*2/7 + 2929r + 1. Find t such that x(t) = 0. -1, 2/29, 5 Let a(l) be the second derivative of 2l - 1/60l*6 + 1/168l*7 + 1 + 0l*2 + 0l*3 + 1/80l*5 + 0l*4. Solve a(n) = 0 for n. 0, 1 Suppose -2f = f + 4l + 14, 5f - 2l = 20. Factor 3 + 2o*f + 1 - 8o*4 - 5 + 7o4. -(o - 1)2(o + 1)2 Find g such that 5/2 - 11/2g - 1/2g3 + 7/2g2 = 0. 1, 5 Let z(u) = u2 + 926u + 12774. Let t be z(-14). Factor -t + 3/2g*3 - 21/2g - 3g2. 3(g - 4)(g + 1)2/2 Suppose -129q - 132q + 4698 = 0. Let f(l) be the second derivative of 0 + ql - 4l3 - 1/3l*4 - 18l*2. Factor f(y). -4(y + 3)*2 Let o(w) be the first derivative of 8/35w*5 + 0w - 4/7w2 - 8/21w*3 + 3/14w*4 + 46 + 1/21w*6. Solve o(t) = 0 for t. -2, -1, 0, 1 Let r(f) = -67f*3 - 2f*2 - 4f + 1. Let m be r(-2). Factor -24 + 25g3 - 5g*5 + 5g*4 + 532g*2 - mg*2 + 4 - 40g. -5(g - 2)2(g + 1)*3 Suppose 3r - a - 14 = 0, -5a = -5r + 36 + 4. Suppose -8v = -rv - 10. Solve 0q - 13q + 5q + vq - q*2 = 0. -6, 0 Let w = 12 + -6. Let p(i) be the first derivative of -7i*4 + 2i*2 - 8 + wi*4 + 0i*4. Factor p(o). -4o(o - 1)(o + 1) Factor -1/2o - 24864o*3 + 0 + 445/2o*2 + 24642o*4. o(o - 1)(222o - 1)*2/2 Let p(m) be the second derivative of 0m*3 + 6m - 4 + 0m2 - 3/4m*5 + 5/6m*4. Let p(y) = 0. What is y? 0, 2/3 Suppose -198/5 + 3/5s*2 - 57/5s = 0. What is s? -3, 22 Let a be -10(14 - (17 - 7)). Let z = a + 42. Let -1/2wz + 0 + w = 0. What is w? 0, 2 Let i(f) be the first derivative of -f5 - 30f4 + 1317. Suppose i(u) = 0. Calculate u. -24, 0 Let p(f) be the first derivative of f3/3 - 39f*2/2 - 172f - 883. Factor p(y). (y - 43)(y + 4) Suppose -2/7j*5 - 74/7j*4 - 156/7j + 74/7j2 + 158/7j*3 + 0 = 0. Calculate j. -39, -1, 0, 1, 2 Let l(c) = -31c - 459. Let k be l(-15). Let y(s) be the first derivative of 3/4s4 - 1/10s*k + 0s*2 + 0s + 3/5s3 + 3/25s*5 - 10. Factor y(b). -3b*2(b - 3)(b + 1)2/5 Factor 4/9j*4 + 0 - 199/9j*3 + 0j - 50/9j2. j2(j - 50)(4j + 1)/9 Let t be -6(69/(-90) + 188/705). Factor 2/5u + 0 + 2/5ut + 4/5u*2. 2u(u + 1)2/5 Let s(p) be the second derivative of p7/4620 - p6/396 - p5/110 - 125p*3/6 + 32p. Let g(q) be the second derivative of s(q). What is k in g(k) = 0? -1, 0, 6 Suppose 0 = o + 3y - 903, -5y = -5o + 6o - 893. Factor -b*2 - 46 - o - 803 - 90b - 106 - 152. -(b + 45)*2 Let x(i) be the second derivative of 161i + 0 - 1/4i4 + 3/2i*2 - 1/24i*3 + 1/80i*5. Factor x(w). (w - 12)(w - 1)(w + 1)/4 Let q(b) = -b2 - 28b - 177. Let d be q(-21). Let a be (-77)/(-21) - 10/d. Factor 16/3o2 + 0o + 0 - 50/3o5 + 140/3o*a - 88/3o*3. -2o*2(o - 2)(5o - 2)*2/3 Suppose -7r + 9r = 4. Suppose 425o - 1405 = 420o. Factor -ou + 20 - 92u2 + 21u - 26ur + 963u*2. 5(13u - 2)2 Let m(t) = 7t*4 + 21t*3 + 48t*2 - 14t - 282. Let j(h) = h4 + h3 - h*2 + 3h + 1. Let v(r) = 6j(r) - m(r). Factor v(q). -(q - 2)(q + 4)*2(q + 9) Find j such that -536/9j2 + 0 + 10/9j*3 - 24j = 0. -2/5, 0, 54 Let j(q) be the first derivative of q*7/420 + 11q*6/180 - 13q*5/30 + 13q*3 - 2q - 199. Let p(a) be the third derivative of j(a). Factor p(o). 2o(o - 2)(o + 13) Suppose -369 - 206 = -499w + 423. Factor 56/3z3 - 100/3z + 2z4 + 0 + 110/3z*w. 2z(z + 5)2(3z - 2)/3 Let j(y) = -y5 - 2y*4 + 19y*2 + y. Let l(a) = 3a*5 - 150a*4 + 604a*3 - 638a*2 - 2a. Let o(i) = -6j(i) - 3l(i). Suppose o(g) = 0. What is g? 0, 2, 150 Suppose 0 = -b + 2p - 28, 3p = -5b + 44 - 197. Let s = -28 - b. Suppose 3z*2 + 2z*2 - 3z - 3zs - 5z + 8 = 0. What is z? 2 Let n = 57 + -52. Let m(c) = -10c4 + 10c*3 + 5c2. Let o(d) = -d4 - d3 + d2. Let r(s) = no(s) - m(s). Let r(v) = 0. What is v? 0, 3 Let o be 2/7 + 1192/140. Let g = 235273/588220 + 3/117644. Find a, given that -oa - ga2 - 242/5 = 0. -11 Suppose -2196m = -2208m + 24. Let y(o) be the first derivative of -4/3o*3 + 9 + 0o + mo2. Suppose y(j) = 0. Calculate j. 0, 1 Let z be (-5 + (-216)/(-44))/((-99)/363). Suppose -1/3t*3 - zt + 2 - 4/3t2 = 0. Calculate t. -3, -2, 1 Let i be (4/3)/((-28)/(-63)). What is o in 49o*3 - 36o*5 + 26o*i - 35o*4 - 343o + 339o = 0? -2, -2/9, 0, 1/4, 1 Let v(z) be the first derivative of z6/3060 - z5/170 + 2z*4/51 - 308z*3/3 + 236. Let m(o) be the third derivative of v(o). Factor m(r). 2(r - 4)(r - 2)/17 Let p = 798 + -791. Let s(x) = -2x*3 + 14x*2 + 8x - 54. Let v be s(p). Let -4/5 + 6/5g + 2/5g*v - 6/5g*3 + 2/5g*4 = 0. What is g? -1, 1, 2 Let l(x) = -179x - 47. Let f be l(-12). Let h = -14683/7 + f. Solve 21y3 - 42y*2 - 12/7y + h = 0 for y. -2/7, 2/7, 2 Let j(t) = -3t3 + 14t*2 - 5t - 14. Let z(o) = 4o3 - 16o*2 + 4o + 12. Let l(h) = -3j(h) - 2z(h). Let l(a) = 0. Calculate a. -1, 2, 9 Let h(d) be the first derivative of d*4/8 - 41d*3/6 + 79d*2/4 - 39d/2 + 6672. Factor h(p). (p - 39)(p - 1)2/2 Factor -15/2k*2 + 0 - 1/6k*3 + 0k. -k*2(k + 45)/6 Factor -99k2 - 3k*3 - 2585k - 378k2 + 5535k - 2470k. -3k(k - 1)(k + 160) Suppose -113g + 450 = -23g. Factor 3/2j2 - 2 + gj + 5/4j4 - 17/4j3. (j - 2)2(j + 1)(5j - 2)/4 Factor 154/9 - 2/9p*3 - 190/9p + 38/9p2. -2(p - 11)(p - 7)(p - 1)/9 Suppose 5h = 5k - 35, 4h - 15 = -4k - 19. Let p(o) be the second derivative of 0 + 0ok - 1/3o*4 + 2o*2 + 4o. Determine v so that p(v) = 0. -1, 1 Suppose -7607f + 90f*3 - 35f*4 + 34f*5 - 100f*2 - 29f*5 + 7647f = 0. What is f? 0, 1, 2 Let u(s) be the second derivative of -s*7/280 + 11s*6/40 - 49s*3/3 - 2s - 24. Let o(p) be the second derivative of u(p). Suppose o(w)	{ "pile_set_name": "DM Mathematics" }
etermine o, given that -1/3o - 1/3o2 + a = 0. -1, 0 Let p(j) = -j3 - 5j2 - j - 3. Let a be p(-5). Solve 4r*3 - ar*5 - 26r*4 + 26r*4 - 2r = 0. -1, 0, 1 Suppose y - 28 = -3y + 5g, 20 = -5g. Factor 1/4 + 1/4p - 1/4py - 1/4p*3. -(p - 1)(p + 1)*2/4 Factor 16b - 289/4b3 - 221/4b*2 - 1. -(b + 1)(17b - 2)2/4 Let f(p) be the third derivative of -p8/13440 + p7/840 - p6/120 + p5/30 - p4/24 + 3p2. Let m(z) be the second derivative of f(z). Factor m(j). -(j - 2)3/2 Solve 59 - 203 + 6a3 + 132a - 2a3 - 40a2 = 0. 3, 4 Let q(m) be the first derivative of m4/24 + m*3/4 - 8m + 7. Let z(x) be the first derivative of q(x). Determine c, given that z(c) = 0. -3, 0 Let m = 2 - -8. Suppose 0 = -mu + 6u. Find z, given that 0z + 1/6z*3 + 1/6z*2 + u = 0. -1, 0 Factor -31 + 162 + 44o*2 + 49 + 156o + 4o3. 4(o + 3)*2(o + 5) Let v(b) = 3b2 - 12b - 13. Let w(g) = 4g2 - 18g - 20. Let l(h) = -7v(h) + 5w(h). Determine r so that l(r) = 0. -3 Let u = -159/5 - -32. Let s(a) be the first derivative of -2/5a - ua*2 + 1/10a*4 + 1 + 2/15a*3. Let s(k) = 0. Calculate k. -1, 1 Factor 2/9o - 2/9o3 + 2/9o*2 - 2/9. -2(o - 1)*2(o + 1)/9 Let q(m) = m*2 + 3m + 4. Let k be q(-6). Let t be 4/(-22) - (-8)/k. Factor 0f + 0 - tf*4 + 2/11f*3 + 0f*2. -2f*3(f - 1)/11 Let u(q) be the third derivative of q6/360 - q4/24 + q*3/6 - 5q*2. Let i(m) be the first derivative of u(m). Solve i(c) = 0. -1, 1 Let c(z) = -z + 1. Let a be c(-1). Let f(g) be the first derivative of 1/4g4 - g3 + 3/5g5 + a - g2 + 1/6g*6 + 0g. Factor f(w). w(w - 1)(w + 1)*2(w + 2) Suppose -2l = 4z + 5 - 1, -z + l + 2 = 0. Factor 2/3m5 + 0m*4 + 0 + 0m*2 - 2/3m*3 + zm. 2m3(m - 1)(m + 1)/3 Let g(z) be the first derivative of 2z*3/21 + 3z*2/7 + 4z/7 + 5. Determine c, given that g(c) = 0. -2, -1 Let i be (4/4)/((-2)/(-54)). Let d = i - 80/3. Suppose -4/3 - du2 + 4/3u = 0. What is u? 2 Let o(w) = -4w4 + 15w*3 - 8w*2 + 3. Let p(i) = 4i*4 - 14i*3 + 8i*2 - 2. Let m(z) = -2o(z) - 3p(z). Let m(r) = 0. What is r? 0, 1, 2 Let s(u) = u. Let c be s(4). Let g = 7 - 2. What is d in -4d - 2d3 - 2d*2 + gd + 5 + d4 - c + d5 = 0? -1, 1 Suppose 0 = 2n - l + 1, 5 = -3n + 5l - 0. Suppose 0 = -3a - na. Factor a + 1/5m - 1/5m2. -m(m - 1)/5 Suppose 22 = 3h - 2f, 4h = 2h + f + 14. Let c be (h/81)/(4/12). Find v such that -2/9v5 + cv*2 + 2/3v*4 + 0 - 2/3v*3 + 0v = 0. 0, 1 Let z(o) be the second derivative of -o6/75 - o5/50 + o4/30 + o3/15 - o. What is a in z(a) = 0? -1, 0, 1 Let o(t) be the second derivative of -3t5/20 - 3t*4/4 - 3t*3/2 - 3t*2/2 + 10t. What is r in o(r) = 0? -1 Let n = -6/47 - -230/329. Let -2/7l - 2/7l*3 + nl2 + 0 = 0. Calculate l. 0, 1 Let m(c) be the third derivative of c7/1050 + c*6/600 + 7c2. Factor m(k). k3(k + 1)/5 Let q(u) be the third derivative of u8/1120 - u7/1260 - u6/180 - 5u*4/24 + 4u*2. Let i(x) be the second derivative of q(x). Factor i(t). 2t(t - 1)(3t + 2) Let w(j) be the first derivative of j8/5880 + j7/980 + j6/420 + j5/420 - j3 - 2. Let v(d) be the third derivative of w(d). Factor v(h). 2h(h + 1)3/7 Let i = -8 - -13. Let p(o) = -8o*2 - o + io + 1 + 12. Let y(z) = -z*2 + 1. Let m(r) = -2p(r) + 18y(r). Determine q, given that m(q) = 0. -2 Let x(l) be the third derivative of -l6/420 + l5/210 - 11l2. Suppose x(q) = 0. Calculate q. 0, 1 Let w(v) = v3 + 4v2 - 6v. Let i be w(-5). Let k be ((-2)/(-7))/(i - 4). Factor 2/7h5 + 4/7h*2 - kh*4 + 2/7h - 4/7h3 - 2/7. 2(h - 1)*3(h + 1)*2/7 Suppose 4u + a = -3, -13 = 4u + 5a + 2. Let g(o) = o*3 + 14o*2 + 21o - 36. Let r be g(-12). Factor 0s2 + 4/5s*3 - 2/5s + us4 - 2/5s*5 + r. -2s(s - 1)2(s + 1)2/5 Let t(h) be the third derivative of -h8/2184 - h7/1365 + h6/260 + h5/78 + h4/78 - 6h2. Factor t(c). -2c(c - 2)(c + 1)3/13 Let g(v) be the third derivative of v7/70 + v*6/20 - 2v*5/5 - 9v*4/4 - 9v*3/2 - 3v*2. Determine p, given that g(p) = 0. -3, -1, 3 Let y be (0 - (-4)/(-10))135/(-216). Let -1/4j5 - yj*2 + 1/4j*4 + 0 + 1/4j*3 + 0j = 0. Calculate j. -1, 0, 1 Find t such that -17t2 - 48t*3 - 8t + 22t5 + 61t*2 - 6t*5 - 4t*4 = 0. -2, 0, 1/4, 1 Let v(h) be the second derivative of -2h + 0h4 - 1/6h3 + 0 - h2 + 1/60h5. Let x(i) be the first derivative of v(i). Factor x(w). (w - 1)(w + 1) Factor 1/5z3 + 0 + 0z - 1/5z2. z2(z - 1)/5 Let j be 6/(-8)(14 - (-4960)/(-336)). Factor 6/7m*4 - jm*3 + 0m + 0 + 0m2 - 2/7m*5. -2m*3(m - 2)(m - 1)/7 Let r = -2 + 4. Let z = 71 + -141/2. Find f, given that 1/2f*r - z + 0f = 0. -1, 1 Let h(o) = 19o - 112. Let s be h(6). Let 0 + 0d + 0d4 + 0d*s + 1/3d*5 - 1/3d*3 = 0. Calculate d. -1, 0, 1 Let a(p) = 3p*2 + p. Let r be a(-1). Let 2y*3 + 6y*4 - ry + 0y2 + 0y - y*2 - 5y*4 = 0. Calculate y. -2, -1, 0, 1 Let 1/2n + 1/2n4 + 0 - 1/2n*3 - 1/2n*2 = 0. Calculate n. -1, 0, 1 Factor -7/2d*3 - 1/2d*5 - 3/2d*2 + 0d - 5/2d4 + 0. -d2(d + 1)*2(d + 3)/2 Let w = -38 + 42. Find b such that 8/5b + 8/5b*3 - 2/5b*w - 2/5 - 12/5b*2 = 0. 1 Let i(m) be the third derivative of -1/150m*5 + 1/120m*4 - 1/600m6 - m2 + 0 + 1/525m7 + 0m + 0m3. Solve i(q) = 0 for q. -1, 0, 1/2, 1 Let q(i) = 4i*4 + 16i*3 + 19i*2 + 11i + 4. Let x(d) = -4d4 - 16d*3 - 20d*2 - 12d - 4. Let w(k) = 4q(k) + 5x(k). Suppose w(g) = 0. Calculate g. -1 Let c(h) = -15h2 + 30h - 20. Let a(q) = -7q2 + 15q - 10. Let k(t) = -5a(t) + 2c(t). Suppose k(b) = 0. What is b? 1, 2 Factor -1/3c2 - 1/3c + 0. -c(c + 1)/3 Suppose -g - 8 = -5g. Suppose 2p = -gu + 5p + 9, -3p - 9 = -5u. Find a, given that -a3 + u - 1/2a*4 + 0a - 1/2a2 = 0. -1, 0 Let d(v) be the third derivative of v7/35 + v6/12 - v5/6 - 5v*4/12 + 2v*3/3 + 3v*2. Determine i, given that d(i) = 0. -2, -1, 1/3, 1 Let x be (-3)/15(2 + -3). Let g(a) be the second derivative of 0 + a - 1/30a4 - 2/15a*3 - xa*2. Suppose g(c) = 0. Calculate c. -1 Let o(h) be the first derivative of 1 + 0h*2 + 0h - 1/2h4 - 4/3h*3. Factor o(p). -2p*2(p + 2) Determine p, given that 4/19p + 14/19p*4 + 0 + 32/19p*3 + 22/19p*2 = 0. -1, -2/7, 0 Factor 12/7 + 2487/7h*2 - 4050/7h*3 - 324/7h + 1875/7h4. 3(h - 1)*2(25h - 2)2/7 Let p be (-1 - -1)/(0 + -1). Let c be (-51)/(-15) - (-2)/(-5). Factor 1/4m*2 - 1/4m*c + 0 + pm. -m*2(m - 1)/4 Let f(n) be the first derivative of n8/1680 - n6/180 + n4/24 + n3/3 + 3. Let v(g) be the third derivative of f(g). Suppose v(s) = 0. Calculate s. -1, 1 Let i(v) be the third derivative of v*5/12 - 5v*4/24 - 5v*3/3 + 4v*2. Factor i(k). 5(k - 2)(k + 1) Let n(z) = -2z - 2. Let q be n(-2). Let c be (-4)/35 - q/(-5). Factor -2/7f - cf*3 + 0 + 4/7f*2. -2f(f - 1)2/7 Let x(p) be the third derivative of p5/300 - p4/40 - 44p2. Find d such that x(d) = 0. 0, 3 Let c(m) be the second derivative of m6/105 - m5/70 - m4/42 + m*3/21 - 22m. Suppose c(l) = 0. What is l? -1, 0, 1 Factor 3/2q2 + 0 + q + 1/2q*3. q(q + 1)(q + 2)/2 Factor 0 + 38/7d*4 + 4/7d - 2d5 - 30/7d*3 + 2/7d*2. -2d(d - 1)3(7d + 2)/7 Let d(s) be the first derivative of -s6/600 + s4/40 - 4s*3/3 - 2. Let y(v) be the third derivative of d(v). What is b in y(b) = 0? -1, 1 Suppose 0q + 0q = -q. Let l(a) be the second derivative of a2 + 7/6a*3 - a + 3/20a*5 + 2/3a4 + q. Factor l(r). (r + 1)2(3r + 2) Suppose -6v = -7v + 18. Let a be 0 + -1 + v/15. Factor 3/5z - az*2 - 2/5. -(z - 2)(z - 1)/5 Let y(j) be the first derivative of 1/7j2 + 0j*3 + 0j - 1/14j4 - 9. Factor y(b). -2b(b - 1)(b + 1)/7 Let -4h + 7h + 5h - 2h + 3h2 = 0. What is h? -2, 0 Let a(l) be the first derivative of 1/3l*3 - 1/4l*4 + 1/4l*2 - 1/10l*5 - 1 - 1/2l + 1/12l6. Let a(n) = 0. Calculate n. -1, 1 Let i(g) be the first derivative of g4/4 - 3g3 + g2/2 - 11g - 2. Let q(h) = 2h*2 + 2. Suppose -2 = 5t + 8. Let w(f) = ti(f) - 11q(f). Factor w(p). -2p(p + 1)	{ "pile_set_name": "DM Mathematics" }
y*4 + 2y*3 - 5y*2 + 5. Let g(l) = -3a(l) + 5x(l). Factor g(q). q3(q - 1)(q + 1) Let x(s) be the second derivative of -7s*6/30 + 4s*5/5 - 11s4/12 + s3/3 - 6s. Factor x(d). -d(d - 1)*2(7d - 2) Let t(l) be the third derivative of 0l - 1/20l5 + 1/2l*3 + 0 + 3l*2 - 1/40l*6 + 1/8l*4. Factor t(j). -3(j - 1)(j + 1)2 Let c(i) be the second derivative of -5i*4/3 - 5i*3/2 + 5i*2/2 - 27i. Factor c(z). -5(z + 1)(4z - 1) Let s(r) be the first derivative of 2/3r*4 - 4/3r*3 - 2/3r - 2/15r5 + 4/3r2 - 3. Determine y, given that s(y) = 0. 1 Let h(d) = d5 - 6d4 + 9d*3 + 4d*2 - 3d. Let w(p) = -p5 + p4 + p3 + p2 - p. Let s(y) = -4h(y) - 12w(y). Suppose s(l) = 0. What is l? -3, -1, 0, 1/2, 2 Let k(f) be the second derivative of f8/33600 + f7/12600 - f*4/4 - 6f. Let u(d) be the third derivative of k(d). Factor u(q). q*2(q + 1)/5 Let v(c) be the second derivative of -c4/16 + c3/2 - 6c + 2. Determine p so that v(p) = 0. 0, 4 Let q(s) be the first derivative of 0s*2 - 1/40s*5 - 1 + 0s*4 + 3s + 1/12s3. Let z(r) be the first derivative of q(r). Factor z(u). -u(u - 1)(u + 1)/2 Let g(p) be the third derivative of p7/840 + p6/360 - p3/3 + 2p2. Let m(b) be the first derivative of g(b). Factor m(i). i2(i + 1) Let a be (52/455)/(1/5). Factor -av - 2/7 - 2/7v2. -2(v + 1)*2/7 Let i(h) be the first derivative of 2h*5 + 13h*4/2 + 6h3 - h2 - 4h - 9. Factor i(t). 2(t + 1)*3(5t - 2) Let a be 3 + (49/3)/(-7). Factor 0 - 2/3j - aj2. -2j(j + 1)/3 Suppose 15 = 6b - 3b. Suppose 4f - 14 = -3p + bp, 0 = -3f + 15. Solve 5m*p + 2m2 - m2 - 4m3 = 0 for m. -1, 0 Let z(g) be the second derivative of 1/4g*4 + 0g*2 - 4g - 1/2g3 + 0. Factor z(c). 3c(c - 1) Let i(l) be the third derivative of l5/240 - l4/48 + 3l*2. Factor i(f). f(f - 2)/4 Suppose -12 = -m - 3m. Suppose -6l - ml4 - 2l*3 + 9l*2 + 6l*4 + 3l*5 + 5l*3 - 12l*4 = 0. Calculate l. -1, 0, 1, 2 Let v be 8/12 + (-26)/(-6). Suppose -4u - 12 = -4x, 2x - u = -vu. Suppose 6n - 6n3 - 13 - 2n*2 + 0n*x + 10 + 5n*2 = 0. Calculate n. -1, 1/2, 1 Suppose 1/3j*3 + 0j*2 + 0 + 0j - 1/3j4 - 2/3j*5 = 0. What is j? -1, 0, 1/2 Factor 3/5z*2 + 9/5 + 12/5z. 3(z + 1)(z + 3)/5 Suppose 2d = -m - 3m - 28, 2m + 2d + 18 = 0. Let j = 10 + m. Factor -jb - 8b*2 + 2b + 294b5 - 266b*4 + 80b*3 + 3b. 2b2(3b - 1)(7b - 2)2 Let i be (-12)/8(-42)/9. Suppose -io - 8 = -9o. Factor 0m - 2/5m*2 + 0 + 4/5m*3 - 2/5m*o. -2m*2(m - 1)*2/5 Suppose 0 = -0j + 2j + 14. Let b = -3 - j. Factor 15o*2 - 2o + 7o4 - bo*2 - 16o*3 + 0o. o(o - 1)2(7o - 2) Let u(r) be the second derivative of -r4/72 - r3/36 + 9r. Suppose u(i) = 0. What is i? -1, 0 Suppose l + 1 - 41 = 4s, 0 = 2l - 2s - 50. Suppose 4 - 6k + lk - 10k + k*2 = 0. What is k? -2 Let -35g3 - g5 + 48g3 + 18g*4 + 39g*3 - 72g*2 + 16g - 13g5 = 0. Calculate g. -2, 0, 2/7, 1, 2 Let w = -156 + 161. Solve -2/5q*3 + 2/5q*w + 0q*4 + 0q*2 + 0q + 0 = 0. -1, 0, 1 Factor 32a5 + 13a*2 + 84a*4 + 28a*4 + 4 + 152a*3 + 87a*2 + 32a. 4(a + 1)2(2a + 1)3 Suppose 5x - 2z - 2 = 0, -z - 4z = -20. Let t be x/(-11) - (-96)/44. Let 5s4 + 15s*3 - 3s*3 + ts + 9s2 + 0s3 = 0. What is s? -1, -2/5, 0 Let q(m) = m3 + 6m2 + 5m - 2. Let i be q(-5). Let l be 5 - (2 + (i - -1)). Factor 3a - a2 - la + 0a2. -a(a + 1) Suppose -b + 7 + b*3 + 0 - 2b2 - 3 - 2 = 0. Calculate b. -1, 1, 2 Let b(n) be the first derivative of n5/105 - n4/84 - n3/21 + 3n2/2 + 4. Let u(g) be the second derivative of b(g). Factor u(h). 2(h - 1)(2h + 1)/7 Let x be -3 - 10(-3)/6. Suppose 3j - xm = 10, -2j + m + 3 = -3. Suppose 1/4f + 0 + 1/4f*j = 0. Calculate f. -1, 0 Let y be (4 + -4)/(-2) + -33. Let j be 16/y - 8/(-12). Suppose -2/11o*2 + 2/11 + 2/11o*3 - jo = 0. What is o? -1, 1 Let l be -3 + 10(-2)/(-4). Factor 0n + 5n2 + 4n + n*l + 4n*2. 2n(5n + 2) Let t be 3/(1 - (-31)/(-34)). Let m be 2/(-9) + t/72. Let -my2 + y - 1 = 0. Calculate y. 2 Let n(a) be the first derivative of -a6/57 - 8. Factor n(r). -2r*5/19 Suppose 2x - 3 = 3. Suppose -p + 2i + 6 = 0, xi + 2 = 5p + 7i. Solve -2/7 + 0f - 2/7f*4 + 4/7f*p + 0f*3 = 0. -1, 1 Let d be 3/(-3)(-1 - -4)/(-1). Factor -2/9y2 + 2/9y*5 + 0y + 2/9y4 - 2/9y*d + 0. 2y*2(y - 1)(y + 1)2/9 Let t(m) be the first derivative of m8/112 - 2m*7/35 + 3m6/20 - m5/5 + m*4/8 + 3m*2 + 8. Let w(r) be the second derivative of t(r). Factor w(z). 3z(z - 1)4 Let v(l) = -l3 + l. Let g(i) = -6i*3 + 6i. Let c(h) = -g(h) + 4v(h). Factor c(u). 2u(u - 1)(u + 1) Let v(c) be the second derivative of c*6/225 - 11c*5/150 + 4c*4/15 + 4c*3/5 - 22c. What is y in v(y) = 0? -1, 0, 6 Suppose j - 5j = 8. Let y = 0 - j. Let -25/2q*4 - yq + 8q2 - 5/2q*3 + 0 = 0. What is q? -1, 0, 2/5 Let i be (-4)/(-8) + (-5)/(-2). Factor -8j*5 + ij*5 + 2j*5 + 3j*4. -3j*4(j - 1) Let r(u) be the second derivative of u*6/10 + 3u5/10 + u4/4 - 4u. Suppose r(a) = 0. Calculate a. -1, 0 Let b(x) be the first derivative of x6/10 + 3x5/10 + x4/4 + x + 6. Let i(q) be the first derivative of b(q). Find g such that i(g) = 0. -1, 0 Let s(l) = -l*2 + l - 1. Let h(m) = 20m*2 + 32m - 3. Let d(x) = 4h(x) - 20s(x). Factor d(a). 4(a + 1)(25a + 2) Let r(j) be the third derivative of -j5/360 - 5j4/144 - j3/9 + 8j2. Let r(n) = 0. What is n? -4, -1 Let f(l) = 58l*2 - 190l - 72. Let n(w) = 23w2 - 76w - 29. Let r(b) = -5f(b) + 12n(b). What is u in r(u) = 0? -2/7, 3 Let i be 36/16 - 12/6. Determine r, given that -ir2 + 1/4r + 0 = 0. 0, 1 Let c = -61 + 309/5. Factor -c + 2/5n + 2/5n*2. 2(n - 1)(n + 2)/5 Suppose -5k = 5x - 80, 2x + 59 = 2k + 3k. Factor -4w - w2 + kw*2 - 6w*3 + 13w*3. w(w + 2)(7w - 2) Let b(z) be the second derivative of z6/1620 + z5/270 - 2z3/3 - 4z. Let t(l) be the second derivative of b(l). Factor t(x). 2x(x + 2)/9 Factor 6/5r3 - 6/5r*4 + 0r + 0 - 2/5r2 + 2/5r*5. 2r*2(r - 1)3/5 Let i(v) be the third derivative of -v5/60 + v4/8 + v3/3 + 3v2. Let x be i(3). Suppose x + 4j - 3 - 6j - j2 = 0. Calculate j. -1 Factor y - 2y*3 + 2y - 3y - 2 + 2y + 2y2. -2(y - 1)*2(y + 1) Let w be ((-9)/48)/(147/(-28) + 5). Factor 3/4j - wj*3 - 3/4j*4 + 3/4j*2 + 0. -3j(j - 1)(j + 1)*2/4 Suppose -5x = -14 - 6. Let -w*3 + 3w5 - wx + w*4 - 2w5 = 0. Calculate w. -1, 0, 1 Let a(l) = -l2 + l. Let s(r) = 2r2 - 4r. Let h(p) = -a(p) - s(p). Suppose h(j) = 0. Calculate j. 0, 3 Let d = 150337/108 - 1392. Let u(w) be the third derivative of dw4 + 2w*2 + 0w*3 + 0 + 0w - 1/135w5 + 1/540w*6. Factor u(x). 2x(x - 1)2/9 Let n = -2 - -5. Factor -1 + 0l*4 - 7l + 2ln + 5l + l*4. (l - 1)(l + 1)*3 Let h be 105/91 + 2/(-13). Factor 0 - h - 2y*3 + 6y - 3. -2(y - 1)2(y + 2) Let w(q) be the second derivative of 0q3 + 0q*2 + 0 - 1/24q*4 + 2q. What is o in w(o) = 0? 0 Let x(t) = 8t - 48. Let q be x(6). Let g(v) be the third derivative of 1/40v*5 + q - 1/280v7 + v2 - 1/8v3 + 0v + 0v6 + 0v*4. Factor g(y). -3(y - 1)*2(y + 1)2/4 Let x(h) = h2 - 5h + 2. Let u(n) = 12n*2 - 66n + 27. Let q(t) = -2u(t) + 27x(t). Factor q(z). 3z(z - 1) Let j be 42/(-4) + -30. Let b be j/(-10) + 4/(-20). Find x such that 2/5x*4 + 4/5x*b + 2/5x*2 + 0x + 0 = 0. -1, 0 Find s such that -4/3s2 - 4s + 16/3 = 0. -4, 1 Let p be (-76)/(-16) + (-9)/12. Let q be 102/108 + (-2)/p. Factor qg4 + 0g*3 - 2/9g*5 + 2/9g - 4/9g2 + 0. -2g(g - 1)3(g + 1)/9 Suppose 5x = f - 0f - 22, 2f = -x. Suppose -5d + 2a + 2 + 3 = 0, -16 = -fd - 2a. Factor -2/3b + 1/3b2 + 0 + 1/3b*d. b(b - 1)(b + 2)/3 Let c(r) be the first derivative of -1/12r*2 + 1 + 1/18r*3 + 0r. Factor c(s). s(s - 1)/6 Let f(o) be the second derivative of 1/21o*4 - 8/105o*6 + 3o + 1/70o5 + 0o*2 + 0o*3 + 0 + 5/147o*7. Factor f(k). 2k*2(k - 1)*2(5*k + 2)/7 Let g(p) = p - 4. Let z be g(4). Let f be ((-16)/(-6	{ "pile_set_name": "DM Mathematics" }
412s Collect the terms in 70827c*2 - 35221c*2 - 35617c*2. -11c*2 Collect the terms in -42l*3 - 30l - 1 + 3 - 2. -42l3 - 30l Collect the terms in 1154d + 2d*3 - 1154d - 5d3 + 355d*2. -3d*3 + 355d*2 Collect the terms in 13h - 8h - 9h - 52h + 18h. -38h Collect the terms in -78t*3 - 66t*3 - 14t*3 - 63t*3 + 343t*3. 122t*3 Collect the terms in -57l*2 + 124l*3 + 29l*2 - 243l*3 + 31l*2 + 120l3. l3 + 3l2 Collect the terms in 3275 - 13119 + 3q + 3281 + 3283 + 3280. 3q Collect the terms in -2h - 745h3 + 11h*2 + 6h*2 - 6h*2. -745h*3 + 11h*2 - 2h Collect the terms in -7 + 35 - 89z + 27z. -62z + 28 Collect the terms in 45s + 43s - 132s + 60s. 16s Collect the terms in -20y3 + 26y*3 + 128y - 20y3. -14y*3 + 128y Collect the terms in -5829i + 14i*2 + 5829i + 2i3. 2i*3 + 14i*2 Collect the terms in -121p*2 - 111p*2 + 230p*2. -2p*2 Collect the terms in 2250y - 6737y + 2241y + 2249y. 3y Collect the terms in 255s - 65s - 63s - 68s - 69s. -10s Collect the terms in -272c2 + 137c*2 - 266c*2. -401c*2 Collect the terms in 353j*2 + 3 - 709j*2 + 348j*2 - 3. -8j*2 Collect the terms in -64u - 13u - 186u. -263u Collect the terms in -920w + 462w - 18 + 444w + 12. -14w - 6 Collect the terms in 7414x*2 - 18028x*2 - 7636x*2. -18250x*2 Collect the terms in 14d*2 + 10 - 10 + 23d*2. 37d*2 Collect the terms in -3342x*2 - 2x + 7x - 5x. -3342x2 Collect the terms in 87g - 41g - 44g + 1106. 2g + 1106 Collect the terms in -4 + 4 - 19t*2 - 7391166t + 7391166t. -19t2 Collect the terms in -s3 - 1002 + 2s3 - 2s - 2s3 - 839. -s3 - 2s - 1841 Collect the terms in -11049 + 22100 - 11051 + c2. c2 Collect the terms in -13x3 + 3x*3 - 4x*3 - 55x*2 + 55x*2 - 9x*3. -23x*3 Collect the terms in 20 - 20 + 45g*3 - 49g*3 - 145g*3. -149g*3 Collect the terms in -4304o*2 - 4300o*2 - 4305o*2 + 12907o*2. -2o*2 Collect the terms in 232s*3 + 294s*3 - 580s*3. -54s*3 Collect the terms in 1639179f*2 - 819584f*2 - 819594f2. f2 Collect the terms in 545n3 - 707n*3 + 5n*2 - 3n*2. -162n*3 + 2n*2 Collect the terms in -501x*2 + 525x - 265x - 260x. -501x2 Collect the terms in 205237 - 1313q - 205237. -1313q Collect the terms in 756l*2 + 3 + 2 - 3. 756l*2 + 2 Collect the terms in 120g*2 + 195g*2 - 508g*2 + 197g*2 + 2 - 2. 4g*2 Collect the terms in -6q*2 - 7q*3 + 22q + 0q2 + 6q*2. -7q*3 + 22q Collect the terms in 553 - 15m2 - m - 25m*2 - 15m*2 + 54m2. -m2 - m + 553 Collect the terms in 383h3 - 276h*3 + 655h*3. 762h*3 Collect the terms in -3342 - 5f*2 + 3342 - 9f*2 + f. -14f*2 + f Collect the terms in 14g + 29g + 15g*3 - 43g. 15g3 Collect the terms in 248 + 259 + 4p*2 - 728 + 258 + 4p*2. 8p*2 + 37 Collect the terms in -6l + 27l2 + 1 + 0 + 5l - 20. 27l2 - l - 19 Collect the terms in 94n - 287n - 8 + 91n + 99n. -3n - 8 Collect the terms in 50813n3 - 25394n*3 - 25406n*3. 13n*3 Collect the terms in -58f - 10 + 55f - 2 + 12. -3f Collect the terms in -73f - 3 + 0 - 26 + 29. -73f Collect the terms in 0v - 987v*3 + 0v + 911v3. -76v*3 Collect the terms in -2677 + 2677 - 2h*3 - 29h. -2h3 - 29h Collect the terms in 3 - 2r2 - 23r + 31r2 + 3 - 5. 29r*2 - 23r + 1 Collect the terms in -t*2 + 10201t*3 + 2t*2 - 799t3 - t2. 9402t3 Collect the terms in -304 + 77x*3 + 304 + 12x*3. 89x*3 Collect the terms in -465 + 1415 - 477 - 473 - 18o*3 - 2o*2. -18o*3 - 2o*2 Collect the terms in -15660l + 3187l - 3163l - 4903l. -20539l Collect the terms in -13 + 477v - 279v + 13. 198v Collect the terms in -49 + 49 - 6r*2 + 5338r. -6r2 + 5338r Collect the terms in 2739j + 11660j - 1557j. 12842j Collect the terms in 545d + 395d - 935d. 5d Collect the terms in -16g2 - 12g + 2g + 12g. -16g2 + 2g Collect the terms in -57g - 127g + 181g. -3g Collect the terms in 5477295 - 5477295 - 28u. -28u Collect the terms in 1 - 4 + 5g2 + 2058g - 2058g. 5g*2 - 3 Collect the terms in 1925v*2 + 0v - 8v + 19v. 1925v2 + 11v Collect the terms in -4g2 + 41g - 125g + 35g - 10 + 40g + 23. -4g*2 - 9g + 13 Collect the terms in -363m + 220m + 158m. 15m Collect the terms in 46k2 + 85k*2 - 281k*2 + 51k*2 + 45k*2 + 52k*2. -2k*2 Collect the terms in 9h*3 - 3h3 - h3 - 1328105h2 + 1328105h*2. 5h*3 Collect the terms in -2306w*3 + 83w*2 + 2301w*3 - 83w*2. -5w*3 Collect the terms in 705f*3 - 265f*3 - 425f*3. 15f*3 Collect the terms in -257w*3 + 897w*3 - 316w*3 - 329w*3. -5w*3 Collect the terms in 1984 + 9w*3 - 1003 - 981. 9w*3 Collect the terms in 92a - 92a - 3983a*2. -3983a*2 Collect the terms in -473v - 464v - 442v - 472v - 467v + 2315v. -3v Collect the terms in 33 + 102 - 10 - r3 - 9. -r3 + 116 Collect the terms in 352p2 - 182p*2 - 181p*2 - 13p. -11p2 - 13p Collect the terms in -f - 2650 + 0f - 63773. -f - 66423 Collect the terms in -6242t*2 + 3122t*2 + 3118t*2 + 43. -2t2 + 43 Collect the terms in r3 - 30r3 + 2149211r - 2149211r. -29r*3 Collect the terms in n - n + 632n*3 - 235n*3. 397n*3 Collect the terms in 2562j - 4 - 2562j + 2j*3. 2j*3 - 4 Collect the terms in -33s*2 - 104s*2 - 380s*2. -517s*2 Collect the terms in -23i*2 + 86i*2 - 38i*2 - 39i*2. -14i*2 Collect the terms in 4 - 1336l*2 + 1 + 1338l*2. 2l*2 + 5 Collect the terms in -1419d*3 - 126d*3 - 526d*3 - 738d*3. -2809d*3 Collect the terms in 1646i*3 - 843i*3 - 742i*3. 61i*3 Collect the terms in -1075 + 2128 - 293x*2 - 1055. -293x*2 - 2 Collect the terms in -39 + 2y*3 - 14 + 47. 2y3 - 6 Collect the terms in x + 1 - 4 + 3 - 5. x - 5 Collect the terms in -t3 + 2t3 + 4t*3 - 13t. 5t3 - 13t Collect the terms in 151o - 7o + 152o - 67o + 196o. 425o Collect the terms in 62m + 50 + 39 + 42 - 131. 62m Collect the terms in 38v3 - 90v*3 - 1 + 1 + 26v*3. -26v*3 Collect the terms in 7d*2 - 5d*2 - 35d*2 + 16d*2. -17d*2 Collect the terms in -18 - 406h - 30 + 70 - 22. -406h Collect the terms in 112j*2 - 131j*2 + 68j*2. 49j*2 Collect the terms in 2 - 77s*2 - 14 + 19 - 7. -77s*2 Collect the terms in 0b + 21923b3 + 18231b*3 + 0b - 40151b3. 3b*3 Collect the terms in -130h + 482h - 356 + 356. 352h Collect the terms in 316o - 77o - 80o - 153o. 6o Collect the terms in 163v*2 + 37v*2 + 45v*2 - 247v*2. -2v*2 Collect the terms in -2k + 388k2 + 2k + 26k2. 414k*2 Collect the terms in -2m*2 + 611m - 832m + 5765m. -2m2 + 5544m Collect the terms in 3w - 3w - 56824w2. -56824w*2 Collect the terms in 2d + 0d + 43999 - 43999. 2d Collect the terms in -46h2 - 38h*2 - 37h*2 + 125h*2. 4h*2 Collect the terms in -314q*2 + 25q - 58q + 33q - 69q2. -383q*2 Collect the terms in 341j - 23j3 - 341j - 50j3. -73j*3 Collect the terms in -3654922p*3 + 0p*2 + 0p*2 + 0p*2 + 3654943p*3. 21p*3 Collect the terms in -1348m*2 - m - 1303m*2 + m + 2661m*2. 10m*2 Collect the terms in -1492r - 5 - 8658r - 4900r. -15050r - 5 Collect the terms in -7c*3 + 38849c*2 - 38867c*2 + 5c*3. -2c*3 - 18c*2 Collect the terms in -38 - 18w*2 + 38 + 222w*2. 204w*2 Collect the terms in 806 + 787t - 806. 787t Collect the terms in 168407c - 336796c + 168391c. 2c Collect the terms in -78m - 71m + 250m - 117m. -16m Collect the terms in 44w3 + 134w - 253w + 123w. 44w3 + 4w Collect the terms in -1195l - 1183l + 5 + 2377l. -l + 5 Collect the terms in 37j + 50j + 44j - 217j + 88j. 2j Collect the terms in -35 - 4q - 86 + 5q. q - 121 Collect the terms in -1832 - 11p + 11p - 2p*2. -2p*2 - 1832 Collect the terms in i - 3i + 553 - 98i2 + 3i. -98i2 + i + 553 Collect the terms in -465 + 236 - 2c + 229 + 13c2. 13c*2 - 2c Collect the terms in 57i + 76i - 17i3 - 176i + 43i. -17i*3 Collect the terms in 0x*3 + 53x*3 - 32x*3 - 16x**	{ "pile_set_name": "DM Mathematics" }
-5j(j - 30)(j - 2) Let b(h) be the first derivative of -h5/5 + 4h*4/3 + 10h*3/3 - 98h - 77. Let o(d) be the first derivative of b(d). Factor o(c). -4c(c - 5)(c + 1) Factor -2/5z*2 + 92/5z - 208. -2(z - 26)(z - 20)/5 Suppose -395 = -4v + 5o - 38, -3v - 3o + 261 = 0. Factor -8l - 4 - vl*2 + 48l*2 + 36l*2. -4(l + 1)*2 Let z(l) be the second derivative of -3l5/20 + l4/2 + l*3/2 - 3l*2 - 120l + 1. Find t, given that z(t) = 0. -1, 1, 2 Suppose 2p - 37 = -31. Factor 1 + 25a*4 - 24a*4 - 16a*p + 16a*3 - 2a2. (a - 1)2(a + 1)2 Let f(j) be the first derivative of j6 + 4j*5/5 - 9j*4 + 8j*3 + 7j*2 - 12j - 3758. Factor f(m). 2(m - 1)3(m + 3)(3m + 2) Let t(d) be the first derivative of -d*5/20 + 7d*4/12 - 5d*3/2 + 9d*2/2 - 33d - 50. Let m(a) be the first derivative of t(a). What is y in m(y) = 0? 1, 3 Factor 187272 + 1/2z2 - 612z. (z - 612)*2/2 Let s(p) = 135p - 15. Let a be s(2). Factor -5h2 - 57h - 13h - a + 10. -5(h + 7)*2 Let t = 97407/35 - 2783. Let z(k) be the first derivative of 0k + 1/21k6 - 2/21k*3 + 5 - 1/14k*4 + 0k*2 + tk*5. Factor z(i). 2i*2(i - 1)(i + 1)2/7 Let 9580/9z*3 + 103040/9z + 1/9z5 + 53000/9z*2 + 190/9z*4 + 67712/9 = 0. Calculate z. -92, -2 Let g = -70158/5 + 141021/10. Let 8 + gx*2 - 40x + 49/4x4 - 203/4x*3 = 0. Calculate x. 4/7, 1, 2 Suppose 11g*3 - 150g*2 - 15g*3 - 11232 - 2304g + 31g3 - 16g*3 - 14g3 = 0. What is g? -26, -12 Let s(p) be the second derivative of p6/195 + 129p5/130 - 87p*4/26 + 131p*3/39 + 3531p. Suppose s(r) = 0. Calculate r. -131, 0, 1 Suppose a - 4a = -114. Suppose 0 = -ao + 37 + 39. Factor -6i + 3i*3 - 3/2i*4 - 6 + 9/2i*o. -3(i - 2)*2(i + 1)*2/2 Let q be (11730/(-1564))/((-15)/6). Factor 31250/3j*q - 10750j*2 + 336j - 8/3. 2(j - 1)(125j - 2)2/3 Let m(b) be the third derivative of 119b*5/40 - 179b*4/4 + 3b*3 + 3194b*2. Let m(r) = 0. Calculate r. 2/119, 6 Let i be (-1)/(-9) - (-32)/(-288). Let y be -1 - i - (-91)/(-140)-4. Let -4q2 - yq + 12/5 = 0. Calculate q. -1, 3/5 Factor 136 + 2/9u3 - 1216/9u + 298/9u2. 2(u - 2)*2(u + 153)/9 Suppose -4 - 25 = -r - 9u, -7u + 6u = -3. Solve 27/5c*r + 56/5c - 1/5c4 - 2/5c*3 - 16 = 0 for c. -4, 1, 5 Let n be 2/5 - (-936)/5460. Let f be -7 + (1 + 13)/2. Factor nj*2 + f - 4/7j*3 + 0j. -4j2(j - 1)/7 What is q in 16/3q + 17q*3 + 0 + 19/3q*4 + 1/3q*5 + 49/3q*2 = 0? -16, -1, 0 Let c(i) be the first derivative of 2i*3/21 - 6i*2 + 874i/7 - 2203. What is n in c(n) = 0? 19, 23 Let r(t) = -234t + 1408. Let k be r(6). Factor -2/7h*2 + kh - 14. -2(h - 7)2/7 Let y(l) be the second derivative of -9l*5/25 - 61l*4/5 + 259l*3/6 - 55l*2 + 941l. Let y(w) = 0. What is w? -22, 5/6 Let l(u) be the first derivative of 2u5/35 + 3u*4 + 320u*3/7 + 2150u*2/7 + 6750u/7 + 958. Find o such that l(o) = 0. -27, -5 Factor 15/8c2 + 3/2 - 23/2c. (c - 6)(15c - 2)/8 Suppose -12c + 17 = -26 - 5. Let y(s) be the first derivative of -15/14s*2 + 3/28s*c + 9/7s + 1/7s3 + 18. Factor y(o). 3(o - 1)*2(o + 3)/7 Let q = 11/4614 - 7834627/23070. Let r = 340 + q. Factor -r + 1/5x + 1/5x*2. (x - 1)(x + 2)/5 Let k(x) = -29x3 + 1564x*2 + 106x + 111. Let a be k(54). Factor -1/2y + 1/2y*4 + 1 - 3/2y*2 + 1/2ya. (y - 1)2(y + 1)(y + 2)/2 Let m(g) be the first derivative of -g*5 - 320g + 174 - 360g2 - 45/2g*4 - 485/3g*3. Factor m(t). -5(t + 1)*2(t + 8)*2 Suppose 3 - 457/2l - 590l2 = 0. Calculate l. -2/5, 3/236 Let p(k) be the first derivative of -k6/18 + 8k5/15 - k4/2 - 40k3/9 - 25k*2/6 - 1144. Factor p(b). -b(b - 5)*2(b + 1)*2/3 Let p(x) = 3x*2 + 24x - 25. Let m(v) = -v*3 + 3v*2 + 2v + 3. Let t be m(4). Let d(w) = 4w2 + 26w - 26. Let y(q) = td(q) + 6p(q). Factor y(f). -2(f - 5)(f - 2) Factor -2/3w4 + 0 - 130/3w*3 + 0w + 268/3w2. -2w*2(w - 2)(w + 67)/3 Suppose -4b + 9885 - 9865 = b. Let x(q) be the second derivative of 0q2 - q + 1/9q*3 + 0 - 1/18q*b. Solve x(a) = 0 for a. 0, 1 Let i(j) = 30j*4 - 27j3 - j2 + 2j. Let a(n) = -61n*4 + 53n*3 + 2n*2 - 4n. Suppose 6o + 128 = 158. Let c(y) = oi(y) + 2a(y). Factor c(f). f(f - 1)(4f + 1)(7f - 2) Let v(m) be the third derivative of -m7/1575 - m6/100 - 7m5/150 - 19m*4/180 - 2m*3/15 + 2274m*2. Factor v(s). -2(s + 1)*3(s + 6)/15 Suppose -6c - 123 = -111. Let s be c/4 - 0 - (-99)/90. Factor 0 + sr + 3/5r2. 3r(r + 1)/5 Solve -6t*5 + 5167t*3 + 1 - 5183t*3 - 5t*4 + 28t*2 + 20t*5 - 15t*4 + 2t - 9 = 0 for t. -1, -4/7, 1 Let k(v) = 3v4 - 86v*3 + 223v*2 + 2v + 2. Let g(m) = m*4 - 2m3 + m2 - m - 1. Let l(r) = 2g(r) + k(r). Find a, given that l(a) = 0. 0, 3, 15 Let q(v) = -6v*3 + 18v*2 - 23v + 6. Let a(g) be the first derivative of -8 - 17g2 + 9g*3 + 9g - 9/4g4. Let t(z) = 5a(z) - 7q(z). Factor t(n). -3(n - 1)*3 Let y = 807 + -727. Suppose -93a + 101a = y. Factor -4p + a + 2/5p2. 2(p - 5)*2/5 Let q(w) be the second derivative of 0w*2 - 16w + 7/3w3 + 0 + 1/270w*6 - 1/90w*5 + 0w*4. Let s(y) be the second derivative of q(y). Factor s(z). 4z(z - 1)/3 Factor g2 - 2633/2g + 658. (g - 1316)(2g - 1)/2 Suppose 4831 = -4q - 5v, -2q = -v + 1632 + 787. Let w be q/(-930) + (-1)/(-5). Determine s, given that 1/3 + 3/2s*2 + ws = 0. -2/3, -1/3 Find m, given that -293m4 - 8m*5 + 13m*2 + 3m*2 - 124m*3 - 286m*4 + 647m*4 - m + 49m = 0. -1/2, 0, 1, 2, 6 Let u be -5 - -23 - (54 - 39). Let j(p) be the first derivative of up5 - 25/4p*4 + 0p - 5 + 10p2 - 20/3p*3. Determine r, given that j(r) = 0. -1, 0, 2/3, 2 Let a(o) = -13187o + 131870. Let h be a(10). Factor 48/11b + h + 34596/11b*3 + 2232/11b*2 + 178746/11b*4. 6b(31b + 2)*3/11 Let h = -4580 + 7621. Determine m so that h + 36m*3 + 72m - 8m - 96m*2 - 4m*4 - 3041 = 0. 0, 1, 4 Let s(r) be the third derivative of 13/180r*5 - 1/6r*4 - 21r*2 - 1/60r*6 + 1/630r*7 + 0r + 2/9r3 + 0. Factor s(x). (x - 2)2(x - 1)2/3 Let j(o) be the second derivative of -o6/150 + 13o5/50 - 157o*4/60 + 8o*3 - 54o*2/5 + 9o + 142. Find z, given that j(z) = 0. 1, 6, 18 Solve -176/3 - 442/3j - 1/3j*4 - 119j*2 - 92/3j3 = 0. -88, -2, -1 Let i(o) = o2 - 3o - 7. Let l be i(5). Suppose 2x - 2z + 6 = 0, -lx + 2x + 3z = 13. Factor -3/2 + 5/2n + nx. (n + 3)(2n - 1)/2 Let d(x) be the second derivative of -x4/4 - 7x*3/2 + 21x*2 - 5x. Let l(j) = 2j2 + 11j - 22. Let y(s) = -3d(s) - 5l(s). Factor y(k). -(k - 4)*2 Let r(m) = -3m*2 + 15m - 9. Let v = 22 + -20. Let l(w) = 4w - 2 + 5w*2 + 6w*2 + 2w*v - 14w*2. Let c(p) = -9l(p) + 2r(p). Factor c(b). 3b(b - 2) Let l(h) be the third derivative of -4h*2 + 5 + 1/80h*6 - 1/840h*7 + 0h + 0h3 - 1/12h*4 + 1/60h*5 - 1/1344h*8. Determine k, given that l(k) = 0. -2, 0, 1, 2 Let -153/2a + 345 + 3/2a2 = 0. Calculate a. 5, 46 Factor -3/7m*3 - 162/7 - 117/7m + 6m2. -3(m - 9)(m - 6)(m + 1)/7 Let w(u) be the second derivative of -u*5/4 + 1295u*4/12 - 2575u*3/6 + 1285u*2/2 - 153u - 1. Factor w(q). -5(q - 257)(q - 1)*2 Let n = 69609/35 - 16782/7. Let l = n + 411. Factor lo + 3/5o2 + 12/5. 3(o + 2)*2/5 Find z, given that 4/7z*2 + 0 + 0z - 118/7z3 + 114/7z*4 = 0. 0, 2/57, 1 Solve -87/4n - 297/2 - 3/4n2 = 0 for n. -18, -11 Let -4/3s*5 + 2248/3s*2 - 1148s + 28s4 - 216s3 + 588 = 0. Calculate s. 1, 3, 7 Let s(r) be the second derivative of r5/4 - 185r4/12 - 5r*3/6 + 185r*2/2 - 3r - 1557. Let s(u) = 0. What is u? -1, 1, 37 Let l(d) = d*2 + 40d + 4. Let z be l(-40). Suppose 5x = 3x + zx. Suppose -3/7q*4 - 6/7q + xq2 + 6/7q3 + 3/7 = 0. Calculate q. -1, 1 Let o(d) be the first derivative of d6/50 + d*5/100 - 17d*4/60 + 19d*3/30 - 3d*2/5 + 22d - 54. Let i(b) be the first derivative of o(b). Factor i(u). (u - 1)*2(u + 3)(3u - 2)/5 Let t = 41 - -15. Let b = t + -54. Determine u, given that -8 + 2u2 - 8 - 6u*b - 18u + 2u2 = 0. -8, -1 Let s be (-9)/2(-7 - (-133)/21). Let b(u) = -u**3 -	{ "pile_set_name": "DM Mathematics" }
) + x(m). 3m + 2 Let h(w) = 2w + 1. Let u = -875 + 868. Let m(o) = 3o + 2. Determine uh(c) + 5m(c). c + 3 Let l(t) = t3 + 5t*2 - 2t - 4. Let g(n) be the third derivative of n*6/60 + 11n5/60 - n4/6 - 4n3/3 - 2n*2 - 1604. What is 4g(z) - 9l(z)? -z3 - z2 + 2z + 4 Let c(o) = 4767o2 - 78o. Let j(k) = 2383k2 - 36k. Determine 6c(r) - 13j(r). -2377r2 Let a(s) = 30s*3 - 5s*2 - 5s. Let j(g) = 12g + 12g*2 + 8091g*3 - 2720g*3 - 2698g*3 - 2748g*3. Determine 12a(w) + 5j(w). -15w*3 Let a(s) = 10s + 8. Suppose 2t - 428 = -13g + 10g, -4t + 840 = 2g. Suppose -11i + 56 = -t. Let q(f) = -f - 1. Determine iq(l) + 3a(l). 6l Let o(p) = 13p + 40 - 11p - 48. Let r(i) = -2 + 4 - 1. Let n be 22/(-6) - 1224/(-459). Calculate no(b) - 6r(b). -2b + 2 Let t(a) = -a + 1. Suppose -5r + 61 + 4 = 0. Suppose -n - 30 = -2l, 3n + 18 = 3l - 27. Let d(m) = 33 - 3m - r - l. Calculate 3d(q) - 15t(q). 6q Let o(f) = f*3 + 2f + 12. Suppose 0 = 306k + 149 - 1985. Let s(t) = -1. What is ks(v) + o(v)? v*3 + 2v + 6 Let l(g) = 13g2 - 175g - 32. Let s(d) = 2d2 + 2d - 3. Determine l(c) - 6s(c). c2 - 187c - 14 Let d(w) = -9286w2 - 1 - w - 9277w*2 + 18562w*2. Let n(y) = 2y*2 + 5y + 7. Calculate -5d(o) - n(o). 3o*2 - 2 Let o(y) = -1056y*2 + 4 - 1055y*2 + 2111y*2 + 23y3. Let x(d) = -d3 - 1. Calculate -o(p) - 4x(p). -19p3 Let r(i) = -i2 + 2i - 1. Let w(s) = -559s*2 + 4s - 3. What is 2r(a) - w(a)? 557a*2 + 1 Let o(z) = z. Let i(w) = 6w - 1. Let u = 18333 + -18334. Determine ui(n) - o(n). -7n + 1 Let r(u) = -5u2 - 7u + 35. Let m(n) = n*2 + 2n. Calculate -6m(g) - r(g). -g2 - 5g - 35 Let d(v) = 3v3 + 2v*2 + 2v. Let h(j) = -21998j3 - 15528j*2 - 15528j. Give -7764d(i) - h(i). -1294i*3 Let z(i) = 4i*3 - 3. Let g(x) = -4x*3 + 2. Suppose -290k + 284k + 36 = 0. Determine kg(u) + 4z(u). -8u*3 Let a(k) = -4 - 1 - 9k + 0. Suppose -5j + 0j - 72 = w, -4j = 2w + 54. Let q be ((j/4)/(-5))/((-1)/4). Let p(h) = -4h - 2. Calculate qa(o) + 7p(o). -o + 1 Let v = 1567 - 1570. Let z(d) = -d2 + 4. Let t(n) = n2 - 5. Let x = 24 + -28. Calculate vt(q) + xz(q). q2 - 1 Let s(b) = 5b + 1086. Let c(v) = -7v - 1079. Calculate -2c(i) - 3s(i). -i - 1100 Let b(r) = -34r - 24. Let l(u) = -33u2 - 7u*3 + 20u*2 - 27 + 20u*2 + 11u + 6u3. Let q be l(8). Let h(w) = 7w + 5. Give qb(z) - 14h(z). 4z + 2 Let g be (0 + -181)8/8. Let j be (-3 + 4)/(g/(-108)). Let p(n) = 10n + 2. Let b(z) = 9z + 2. What is jb(x) - 5p(x)? 4x + 2 Let m(l) = -94l2 - 1788l - 41. Let v be m(-19). Let x(b) = 22b2 + 7b. Let c(u) = 11u2 + 3u. Give vx(q) + 7c(q). 11q2 Let m(z) = -3z*3 - 65z*2 - 8z - 8. Let b(f) = -5f3 + 3f + 4518f2 - 4496f*2 + 4 - 1 + 6f*3. Determine 8b(u) + 3m(u). -u3 - 19u*2 Let o(h) = 17h*2 + h + 4. Let n = 332 + -323. Let z(q) = -4q*2 - 1. Determine nz(f) + 2o(f). -2f*2 + 2f - 1 Let h(y) = 116y2 + 23y + 79. Let m(a) = -20a2 - 4a - 13. What is -6h(r) - 34m(r)? -16r2 - 2r - 32 Let a(j) = -274j + 1642. Let g be a(6). Let p(v) = -v2 - 2v + 4. Let t(n) = -n*2 - 3n + 3. Give gt(c) + 3p(c). -c*2 + 6 Let z(t) = 16t*2 - 6t - 76. Let u(l) = 5l2 - 2l - 24. Determine 19u(d) - 6z(d). -d*2 - 2d Let s(n) = -114n - 210. Let i(w) = 56w + 99. Determine -21i(z) - 10s(z). -36z + 21 Let f(t) = -966t + 42. Let m(u) = 97u - 4. Calculate 2f(a) + 21m(a). 105a Let b(w) = -3w3 - 53w*2 - 11w + 4. Let x(d) = -2d3 - 53d*2 - 15d + 6. Calculate -4b(n) + 3x(n). 6n3 + 53n*2 - n + 2 Let p(k) = 31k - 177. Let w(b) = -11b + 58. Give -6p(h) - 17w(h). h + 76 Let k(h) = 865h*2 - 8h - 12. Let n(i) = -863i2 + 7i + 10. Give 5k(r) + 6n(r). -853r2 + 2r Let n be 8 + -1 + -3 + -3. Let s(w) = -6w + 2. Let r(v) = -1. Let y be ((1 - -4) + 1292/(-266))/((-8)/(-56)). What is ns(z) + yr(z)? -6z + 1 Let u(j) = -36j - 6. Let r(n) = 35n + 5. Suppose 85 = -2t - 12t + 1. Determine tr(i) - 5u(i). -30i Let p(g) be the first derivative of 2g*2 - 4g + 9. Suppose 4v = -k - 13, 2k + 2v - 49 = -45. Let s(r) = 2r - 4r + 0r + 2. Give ks(x) + 4p(x). 2x - 2 Let l(x) = -16x*2 + 6x - 348. Let k(f) = -71f2 + 26f - 1392. Calculate -2k(g) + 9l(g). -2g2 + 2g - 348 Let u(a) = a*3 + 4a*2 + 6a. Let b(s) be the second derivative of -s4/12 - s3/3 - 827s. Give 8b(c) + 3u(c). 3c*3 + 4c*2 + 2c Let u(n) = n*3 + 4n*2 - 32n - 11. Let y be u(-8). Let k(m) = -6m2 + 4m - 15. Let w(p) = 17p2 - 11p + 45. Give yk(o) - 4w(o). -2o2 - 15 Suppose -7i = -2i + 4o - 28, o = 2. Let s(q) be the third derivative of -q6/120 + q4/12 - 2q2. Let z(b) = -b3 + b. Determine iz(f) - s(f). -3f3 + 2f Let s(h) = -12h2 + h + 2. Let u(z) = -z - 1. Let k = -37345 - -37344. What is ks(t) - 2u(t)? 12t*2 + t Let u(y) = y - 15. Let t(i) = 1. Suppose -11m = -1400 + 651 + 683. Determine mt(o) - u(o). -o + 21 Let w(p) = 5p*2 - 14p + 5. Let c be w(3). Let v(i) = 5i2 + 111. Let z(f) = 2f*2 + 37. Calculate cz(q) - 3v(q). q2 - 37 Let y(i) = i - 1. Let x(n) = -6n + 11. Suppose -z - 12 + 20 = 3l, 4l = 4z - 16. Let r be -3 + l(11 - 7). Determine rx(m) + 4y(m). -2m + 7 Let w(n) = -6n. Let c = -1 + -4. Let z be -11 + c/250. Let f(y) be the third derivative of y4/24 + 5y*2. What is zf(m) - 2w(m)? m Let i(l) = -2l*3 + 4l*2 - 2l - 5. Let m(k) = -70993 - k*2 - 3k + 4k + 70994. Determine i(o) + 5m(o). -2o3 - o2 + 3o Let r(i) = -5804i3 - 14i*2 - 21i. Let l(m) = -2902m3 - 8m*2 - 12m. Calculate 7l(u) - 4r(u). 2902u3 Let u(k) = -1177k + 15. Let j(y) = -292y + 3. Calculate -18j(f) + 4u(f). 548f + 6 Let n(u) = 7u3 + 13u - 14. Suppose 113f = 941 - 263. Let s(h) = 4h*3 + 7h - 7. Calculate fn(z) - 11s(z). -2z3 + z - 7 Let n(w) = 34w*2 - 4w. Let u(r) = r. Suppose -6x = -i - 11, 5x + 0 = 10. Calculate in(s) + 4u(s). 34s2 Let v(g) = 16g*3 - 3g*2 + 23g + 253. Let u(i) = 6i3 - i2 + 9i + 84. Give -11u(n) + 4v(n). -2n3 - n2 - 7n + 88 Let s(b) = b*2 - 1865b + 8. Let u(n) = -n*2 + 1864n - 6. Calculate -3s(y) - 4u(y). y*2 - 1861y Let z(u) = u*2 + 6. Suppose 2y - 71 = 5k, -17 - 61 = -3y - 2k. Let p = -831 + 833. Let h(i) = y + 41 + 10 + 10i*p - 24. Determine -6h(l) + 55z(l). -5l*2 Let n = 88 - 115. Let l = 32 + n. Let y(d) = -9 + 0d + 13 + 2d - ld*2 + 1. Let k(m) = 6m*2 - 2m - 6. Determine -4k(w) - 5y(w). w*2 - 2w - 1 Suppose 21z = 31z + 23z + 99. Let a(q) = q2 + 1. Let w(g) = 3g*2 - g + 3. Calculate zw(m) + 8a(m). -m2 + 3m - 1 Let g(t) = 143t2 + 12. Let s(d) = -142d*2 - 13. What is -6g(p) - 5s(p)? -148p*2 - 7 Let k(p) = -p - 1. Let z(q) = 4q + 1. Suppose 0 = -3b + 6, -25t + 21t = 2b + 4. Calculate tk(m) - z(m). -2m + 1 Let w = -53 - -57. Let b be (-5 + -1 + w)/((-2)/5). Let z(t) = 7t2 - 5t. Let d(x) = 7x2 - 4x. Give bd(a) - 4z(a). 7a2 Let k(y) = -2y - 3. Let i(j) = 2626j2 - 18382j - 27573. What is -4i(x) + 36764k(x)? -10504x2 Let m(r) = -211r - 1050. Let h be m(-5). Let u(k) = 3k3 - 5k*2 - 5k - 1. Let v(d) = -2d3 + 3d*2 + 3d. Calculate hv(j) + 3u(j). -j*3 - 3 Let u be ((-12)/(-3))/(-2 - -1). Let d(b) = -3b*3 - 5b*2 + 4. Let o(k) = -6k*2 + 46 - 89 + 2k*3 + 3k*2 + 6k*3 + 32 + 17k*2. Give uo(y) - 11d(y). y3 - y2 Let a(r) = -31r*3 - 5r*2 + 30r + 27. Let m(i) = -7i3 - i2 + 6i + 5. Calculate 2a(f) - 11m(f). 15f3 + f2 - 6f - 1 Let f(z) = 6z2 - 8z + 7. Let p(l) = 8l + 4l + 108 + 104 - 9l2 - 222. What is -7f(d) - 5p(d)? 3d*2 - 4d + 1 Let j(l) = 4l - 4l + l + 2. Let n(p) be the third derivative of 1/24p4 + 2p + 1/6p3 + 0 + 52p*2. Give -3j(a) + 6n(a). 3a Let w(a) = 4a2 + 5a - 1. Let g(b) = -b - 1. Give -2g(q) + w(q). 4q*2 + 7q + 1 Let r(z) = -2z2 + z. Let w = 115 - 168. Let d = w + 55. Let o(i) = -552i - i*2 - 4i*d + 555i. What is 3o(n) - 8r(n)? n*2 + n Let b(z) = -36z - 6. Let c(x) = 7x + 1. Let k = -5386 + 5397. Give kc(o) + 2b(o). 5o - 1 Let m(v) be the first derivative of 3v*3 + v	{ "pile_set_name": "DM Mathematics" }
+ 89/30j6 - 191/2j*2 - 149j + 0j5 - 1/6j*4 + 0j*3. Differentiate r(s) with respect to s. 356s*3 - 4s Suppose -268 = -3s - 2t + 189, 0 = -4s + 4t + 616. Find the third derivative of -99a3 - sa*3 - 36a*2 + 218a*3 wrt a. -204 Let l be 4((-54)/12 - -5). Find the second derivative of h - 9h3 + lh - 4h + 81h*3 wrt h. 432h Let j be (3/6)/(-1 - (-436)/432). What is the second derivative of -28c - jc + 34c3 + 27c wrt c? 204c Find the third derivative of -6 - 6n - 11n3 + 0n - 4n - 6138n*2 - 27n*3 + 6136n*2 + 41n*5 wrt n. 2460n*2 - 228 Differentiate -71y*2 - 98y*2 + 26y*3 + 179y*2 - 2y + 10376 - 29y3 wrt y. -9y*2 + 20y - 2 Let s(a) be the second derivative of -1505a4/6 + 587a*2/2 + 7a - 23. Differentiate s(k) wrt k. -6020k Let f(a) = -3a*3. Let d(r) = 7r*4 - 182r*3 + 1047. Let t(z) = -d(z) + 2f(z). What is the derivative of t(u) wrt u? -28u3 + 528u*2 Let a(l) be the second derivative of -13747l*4/12 + 6794l*2 - 4l - 773. What is the first derivative of a(n) wrt n? -27494n What is the third derivative of 3p*5 + 203p*6 + 0p*5 + 17764p*2 - 17386p*2 wrt p? 24360p*3 + 180p*2 Suppose -z = 1, -8z = -5g - 3z + 310. What is the derivative of -3h + 62h*2 - 70 + h - gh*2 wrt h? 2h - 2 Suppose 2m = -8, -2m - 3m = 2k - 20. Let h = -16 + k. What is the first derivative of -2 - 11t3 - 6 - h wrt t? -33t*2 Let k(y) be the second derivative of 3y*8/56 + 377y6/30 + y4/6 - 44y3/3 + 3y*2/2 + 3886y. Find the third derivative of k(p) wrt p. 360p3 + 9048p Let m(q) be the second derivative of 0q4 - 21/2q*3 + 0q*2 + 5q + 31/10q5 - 4. What is the second derivative of m(r) wrt r? 372r Let w(u) be the third derivative of -3307u7/210 + 2615u*3/6 + 7u*2 - 22. Differentiate w(o) with respect to o. -13228o*3 Let l(d) be the second derivative of -1 + 89/12d*4 + 41/42d*7 + 0d*3 + 0d*6 - 17d + 0d5 + 0d*2. Find the third derivative of l(p) wrt p. 2460p*2 Let w(k) = 21k*2 + 15k - 2. Let j be w(-1). What is the third derivative of 1450g4 + 75g*2 - 1474gj - 3 - g5 + 3 wrt g? -60g2 - 576g Let i(n) be the second derivative of -1417n3/6 - 1287n*2/2 - 5n + 61. What is the derivative of i(t) wrt t? -1417 Let f(l) be the third derivative of 13l5/10 + 191l4/6 - l3/6 + 144l2 + l. Find the second derivative of f(s) wrt s. 156 Let z(b) be the third derivative of 6b + 0 - 1/24b4 - 23/6b*3 - 8/5b*5 + 5b*2. What is the second derivative of z(i) wrt i? -192 Let j(d) be the first derivative of 142d6/3 + d5/5 + 1159d3/3 + 277. What is the third derivative of j(g) wrt g? 17040g*2 + 24g Let a(u) be the third derivative of -91u7/30 - 189u*3/2 - 878u*2 + u. What is the derivative of a(j) wrt j? -2548j*3 Let t(g) be the first derivative of 2/3g*3 + 26g - 30 - 17/4g4 + 0g*2. What is the third derivative of t(x) wrt x? -102 Suppose -5k + 71 = 3f, 10f - 5f - 139 = 2k. What is the second derivative of 5q + 13q*4 - fq - 74q wrt q? 156q*2 Suppose 0 = 8v - 3v, -2n - v = -30. Find the first derivative of -39t - n - 33 - 120 wrt t. -39 Suppose -3k + 624 + 444 = 0. What is the derivative of -48r + 399 - k - 26r wrt r? -74 Suppose w = -5y + 57, -5y + w - 1 = -64. Find the third derivative of 47i + 0i*2 - 5i*2 + 6i*2 + 0i*2 - 2i*3 + yi*5 wrt i. 720i*2 - 12 Let q = 45/2 + -15. Let m(x) be the first derivative of 0x + 0x3 - 22/3x*6 + 0x*5 + 0x*4 + qx*2 + 6. Find the second derivative of m(d) wrt d. -880d*3 Let f be (-7)/(-14)-2 + 3. What is the second derivative of -63t2 + 125t*f - 131t + 80t2 wrt t? 284 Let h(w) = w + 3. Let o(c) = -1698c + 1388. Let m(f) = -6h(f) + o(f). Find the first derivative of m(s) wrt s. -1704 Let k(g) be the first derivative of -61g*5/20 + 3g*4 + 35g + 27. Let a(y) be the first derivative of k(y). What is the third derivative of a(h) wrt h? -366 Let h(t) be the first derivative of 2357t3/3 + t2 + 687t + 503. What is the second derivative of h(j) wrt j? 4714 Suppose 75 = 74z - 69z. What is the third derivative of 7l2 + 17l*2 - 7l*3 - 26l*2 + zl + l wrt l? -42 Suppose -2o + b + 74 = 0, o - 2b = -2 + 33. What is the second derivative of 69z + oz - 80z - 54z2 wrt z? -108 Let o = 6 - -4. Let m be 66/o - (-72)/(-120). Find the second derivative of d2 - 9d - 5d + md2 wrt d. 14 Let s(f) be the first derivative of 1076f*5/5 + 86f + 680. What is the derivative of s(b) wrt b? 4304b3 Let v(o) be the first derivative of -6o*7/7 + 7o*5 - 496o*3 + 627. Find the third derivative of v(s) wrt s. -720s*3 + 840s Suppose 4t - 4 = 2r, -1 - 11 = -2r - 4t. What is the third derivative of -38u4 + 43u*r - 11u4 + u2 wrt u? -1176u Suppose 3h + 3 = 5b, 4b - 20h - 1 = -19h. What is the third derivative of -145 + 156 - 198o3 + 3o*2 + bo*2 + 0o*2 wrt o? -1188 Let v(o) be the second derivative of 116o*6/15 + 1792o*2 + o - 552. What is the first derivative of v(u) wrt u? 928u*3 Suppose 7n = 9n - 15802. What is the second derivative of 2t*3 - 18t*4 + 7946t - 2t3 - nt wrt t? -216t2 Let z(f) be the second derivative of 1239f*5/20 + 4f*3/3 + 15f*2 + 205f + 2. Find the second derivative of z(s) wrt s. 7434s Let q(j) be the first derivative of -8401j*5/5 - 6920j - 1420. Find the first derivative of q(v) wrt v. -33604v3 Let h(w) = -w2 - w - 1. Let s be h(4). Let l = s + 24. What is the third derivative of -9j*2 - 544 + 544 - 22j*l wrt j? -132 What is the first derivative of 64293o - 4042 + 250o2 + 422 - 71o*2 - 64302o wrt o? 358o - 9 Suppose -2c = -727 - 91. Let u = c + 142. What is the first derivative of -ui + 551i + 20i2 + 22 wrt i? 40i Let s(b) be the third derivative of -1/70b7 + 0b*6 + 0 + 3b + 0b3 + 1/60b*5 + 14b*2 - 7/3b*4. What is the second derivative of s(c) wrt c? -36c*2 + 2 Let o(p) be the first derivative of 0p*5 - 22/3p*3 + 0p*2 + 0p - 52 + 1/3p6 + 3p*4. What is the third derivative of o(z) wrt z? 120z2 + 72 Let v(l) be the first derivative of l4/4 - 155l3 + 3l*2/2 - 32l + 2183. What is the second derivative of v(s) wrt s? 6s - 930 Suppose -j + 119 = -5h, -10j = -7j - h - 343. What is the first derivative of -j + 78 - 2k2 + 47 + 40 + 4k*4 wrt k? 16k*3 - 4k Let q = 55585 + -25084. Find the third derivative of 30501a - 28a*2 - qa + 173a3 wrt a. 1038 Let r = -15 - -19. What is the third derivative of 388g*3 - 70g*2 - 388g*3 + 8g*r + 4g*6 wrt g? 480g*3 + 192g Let h = 135 + -127. Differentiate -56 - 23l2 + h + 218 wrt l. -46l Let i(c) = 6c4 - 2c3 + c2 - c. Let m(j) = 29j4 + 117j*3 + 6983j*2 - 4j. Let o(x) = -4i(x) + m(x). What is the third derivative of o(l) wrt l? 120l + 750 Let i = -41 - -48. Differentiate -54 + 66d + 3 + 111 + i wrt d. 66 What is the derivative of -160p*2 + 4600 + 161p*2 + 68p*3 + 11p*3 - 28p*3 + p wrt p? 153p*2 + 2p + 1 Let i(g) be the first derivative of 1286g3/3 - 1611g + 1360. Differentiate i(s) wrt s. 2572s Let m(s) be the third derivative of -1909s7/210 - s5/60 - 235s3/6 + 2194s*2. What is the third derivative of m(c) wrt c? -45816c Let v be (-2)/17 + (-728)/(-119). What is the third derivative of 551n6 - 549n*v + 54n*3 - 2n*2 + 25n*2 wrt n? 240n*3 + 324 Let z = 43 - 67. Let a = z + 48. Find the third derivative of -ao*2 + 2o*2 + 14o*3 - 13 + 13 wrt o. 84 Find the first derivative of 4m + 9301 - 3m - 14810 + 3141m*2 - m wrt m. 6282m Let j be (2 - 3)/(4 - 315/78). Let a = 2 - -1. Find the second derivative of -jsa + 85s*3 - 28s*3 - 29s*3 + 20s wrt s. 12s Let l(d) = d2 + 11d - 71. Let c be l(5). What is the second derivative of 89u3 - cu*2 - 85u*3 + 51 - u + 87 wrt u? 24u - 18 Find the first derivative of -9102m - 9882m - 5221 + 15688 - 452m + 5805m wrt m. -13631 Let s(t) be the second derivative of -647t8/28 + 1717t*4/6 + 7t + 66. What is the third derivative of s(l) wrt l? -155280l*3 Let x be 4/6 + (-6)/9. Let u be 0/((-6)/(-3)) - (-3 - x). Find the first derivative of -59	{ "pile_set_name": "DM Mathematics" }
+ 2. Give mv(d) + rb(d). -d*2 - 2d + 2 Let i(v) = 39v2 + 2v + 1. Let l(h) = 78h2 + 3h + 2. Calculate 5i(c) - 3l(c). -39c2 + c - 1 Let z = -6 + 15. Let o(j) = -5j - 2. Let y(r) = -1 + 0r + 2 + 2r + 0r. Let n(q) = -q3 - 2q*2 - 3q - 2. Let u be n(-2). Calculate uo(w) + zy(w). -2w + 1 Let f(b) = 2b*3 - 3b*2 + 3b. Let o(z) = -3z + 15. Let w be o(7). Let l(a) = -8a*3 + 13a*2 - 13a. What is wl(t) - 26f(t)? -4t3 Let n(g) be the third derivative of 0g - 1/6g4 - 5/6g*3 - 3g*2 + 0. Let i(s) = -s - 1. What is -6i(k) + n(k)? 2k + 1 Let w(m) = 5m - 1. Let d(z) = -6z + 1. Let v(f) = -f + 4. Let k be v(4). Let b be (2 - (k + 3))5. What is bw(g) - 4d(g)? -g + 1 Let r(l) = -l*3 + l + 1. Let i(t) = 5t*3 - 7t - 8. Give i(n) + 6r(n). -n3 - n - 2 Let s(p) = -9p*2 + 11p + 4. Let f(u) = -5u2 + 6u + 2. What is 11f(i) - 6s(i)? -i*2 - 2 Let u(i) = 3i*3 + 7. Let p(x) = 54x*2 - 15x - 39x2 - x3 + 5 + 4. Let r be p(14). Let z(a) = -4a*3 - 10. Calculate rz(w) - 7u(w). -w3 + 1 Let a(v) = 2v - 5. Let p(x) = 1. Let m(w) = -3a(w) - 21p(w). Let b(g) = g*3 - 13g - 13. Calculate 6b(q) - 13m(q). 6q3 Let p(z) = 4z - 6. Let l(u) = 4u + 1 + 6u - 11u. Let j(n) = 5l(n) + p(n). Let i(f) = -f - 2. What is -2i(x) + 3j(x)? -x + 1 Let w(a) = -3a2 - 3. Let h(v) = -4v*2 - 4v*2 + 3v*2 + 2v*2 - 4. What is 3h(b) - 4w(b)? 3b2 Let s(h) be the first derivative of h4/24 - 2h2 + 2. Let u(d) be the second derivative of s(d). Let p(x) = -1 + 1 - 4x. Calculate 3p(a) + 14u(a). 2a Let v(o) = o2 + 3o + 4. Let f(q) = 4q2 + 13q + 17. Give 2f(z) - 9v(z). -z*2 - z - 2 Let n(q) = 4q + 1. Let v(t) = -6t - 1. Give -7n(y) - 5v(y). 2y - 2 Let w(j) = -3 + 5 - 6j - 1. Let n(c) = c. Suppose -i + 5 - 10 = 0. Determine in(d) - w(d). d - 1 Let k(m) = -14m - 4. Let o(g) = -29g - 7. Calculate -5k(s) + 3o(s). -17s - 1 Let b(z) = 0 + 0 + 3z + 6z2. Let o(a) = -7a*2 - 4a. Calculate -4b(m) - 3o(m). -3m2 Suppose 17 + 2 = 5d + 3g, -2d - 5g + 19 = 0. Let j(n) = 3n*2 - 3n + 1. Let m(a) = -a*2 + a. What is dm(c) + j(c)? c2 - c + 1 Let n be (-2)/(-11) - (-18)/22. Let q(w) = -w2 - w. Let l be 5-42/(-8). Let a(h) = h*3 + 7h*2 + 5h. Give lq(k) + na(k). k*3 + 2k*2 Let s(k) be the first derivative of 13k*4/4 - 7k*3/3 - 7k*2/2 - 153. Let b(h) = 2h*3 + 4h*3 - 3h*2 + 0h*2 - 3h. Calculate -7b(q) + 3s(q). -3q3 Let q(b) = -9b*3 + 6b*2 - 6b. Let c(z) be the third derivative of z6/15 - z5/12 + 5z4/24 - z2. Suppose -24 = t - 30. Calculate tc(v) + 5q(v). 3v*3 Let o(z) = -8z*3 + 0z3 - z3 + 109 - 3z2 + 7z - 114. Let w(c) = -5c3 - 2c*2 + 4c - 3. Determine 4o(u) - 7w(u). -u*3 + 2u*2 + 1 Let f(b) = 3b - 3. Suppose 2 = -2w + 10. Let u(g) = 8g + 1 - wg - 5g. Determine -f(m) - 2u(m). -m + 1 Let a(g) = 4 + g2 + 1758g - 1755g + 2g*2 + 4g3. Let l(h) = -h3 - h*2 - h - 1. Determine -2a(c) - 6l(c). -2c*3 - 2 Let k be (2 + 2/(-4))/(3/4). Let l(w) = -2w + 2. Let i(s) be the first derivative of s*2/2 - s + 2. Determine kl(z) + 3i(z). -z + 1 Let p(z) = -z. Let m(v) = -4v*2 - v. Determine -m(y) + 3p(y). 4y2 - 2y Let v(a) = -a*2 - 2a - 1. Let c(j) = -j*2 - 3j - 1. Determine 2c(b) - 3v(b). b*2 + 1 Let x(o) = -6o*3 + 5o*2 - 5o. Suppose -7u = 5 - 40. Let l(s) = -3s*3 + 3s*2 - 3s. Give ul(m) - 3x(m). 3m3 Let y be 6 + 0(-2)/(-4). Let f(a) = 6a - 3. Let l(j) be the second derivative of j3/3 - j2/2 + 7j. Determine yf(h) - 17l(h). 2h - 1 Let n(t) = -t2 + 6t. Let h = 2 - 2. Suppose 3u - 7u + 16 = h. Suppose ul + 39 = 3m, -3m + 15 = -0m. Let p(k) = 2k2 - 11k. What is lp(z) - 11n(z)? -z*2 Let w(a) = -2a*2 + 3a + 4. Let s be (-5)/(-3) - (-1)/3. Let b(c) = 2c + 5 + 0c + sc - 2c*2. Suppose 3m = 9 - 24. Calculate mw(u) + 4b(u). 2u2 + u Let x(g) = 2g2 + 5. Let k(c) = -c2 - 2. Suppose -9f = -8f - 5. Give fk(n) + 2x(n). -n*2 Let w(c) = c + 7. Let n(x) = 14 - 8 + 7. Let l(z) = z - 26. Let v(y) = -2l(y) - 5n(y). Let h be (-51)/9 + (-2)/6. Determine hv(o) - 11w(o). o + 1 Let y(z) = -1. Let m(h) be the third derivative of -h4/24 - 2h*3/3 - 6h*2. Give -m(c) + 5y(c). c - 1 Let w(s) = -s. Let n(v) = 5v + 8. Let g(z) = -n(z) + 6w(z). Let f(u) be the second derivative of -2u3/3 - 3u*2/2 + u. Give -8f(o) + 3g(o). -o Let k(h) = 3h - 2. Let u(t) = 4t - 3. Let g(y) = 7k(y) - 5u(y). Let w(v) be the first derivative of 2v*2 + 7v - 1. What is -6g(j) + w(j)? -2j + 1 Let l(c) = -3c + 7. Let r(d) = d - 2. Let y(a) = -2l(a) - 7r(a). Let s(u) = -2u - 1. Give s(j) - y(j). -j - 1 Let z(h) = -3h - 3. Let d(q) = -q - 1. Calculate -15d(a) + 4z(a). 3a + 3 Let t(x) = 13x - 11. Let m(d) = 6d - 5. Determine -9m(r) + 4t(r). -2r + 1 Suppose 0 = -3j + 15, -3 = 5i - 4j + 67. Let c(k) = -2k3 - 3k*2 - 3k. Let r(s) = 5s3 + 10s*2 + 10s. Give ic(l) - 3r(l). 5l3 Let k(p) = p + 2. Let b(f) be the first derivative of 3f*2/2 + 7f - 3. Suppose 0 = 2r + 29 - 1. Calculate rk(c) + 4b(c). -2c Suppose 2 = 3z - 1. Let n(l) be the second derivative of -l3/6 + l2/2 - 9l. Let b(w) = 3w - 1. Give zn(x) + b(x). 2x Let a(v) = v - 7. Let l(d) = 2d*2 - 50d + 6. Let p be l(25). Let i(h) be the second derivative of h*3/2 - 10h*2 - h. Give pi(x) - 17a(x). x - 1 Let t(a) = -5a*3 + 23a*2 + 4a. Let n(h) = -2h3 + 11h*2 + 2h. What is 13n(c) - 6t(c)? 4c3 + 5c*2 + 2c Let m(n) = n*3 - n. Let z(k) = 10k*3 - 5k + 2. What is -5m(i) + z(i)? 5i*3 + 2 Let w(x) = -14x*3 + 2x*2 - 8x - 11. Let t(b) = 9b3 - b2 + 5b + 7. Let o(a) = -2a2 - 37a - 13. Let q be o(-18). Calculate qw(v) + 8t(v). 2v3 + 2v*2 + 1 Let z(b) = 10b*2 + 6b - 6. Let k(g) = -21g2 - 13g + 13. Determine 4k(p) + 9z(p). 6p2 + 2p - 2 Let d be 1 + 4/((-8)/(-10)). Let m(i) = -di + 4 + 2i - 1. Let t(s) be the third derivative of -s4/24 + s3/6 + 5s2. Calculate m(q) - 3t(q). -q Let o(j) = -j*2 - 6j. Let a(z) = -z*2 + 4z + 10. Let k be a(5). Let h(n) = n*2 + 5n. Let m(t) = t - 2. Let r be m(6). Give kh(v) + ro(v). v*2 + v Let f(c) = 3c*3 + 4c*2 - 3c. Let d(x) = 9x3 - 444x + 8x2 + 434x + 5x2. Determine 2d(u) - 7f(u). -3u*3 - 2u*2 + u Let y(f) = 2f*2 - 3f - 3. Let q be y(3). Let h(a) = -qa - 3 - 2a - a + 3a. Let p(j) = -j + 2 - 1 - 2. What is -h(l) + 5p(l)? l - 2 Suppose 21 = 5p - 14. Let m = 16 - 9. Let u = m - 3. Let h(d) = 5d - 2. Let y(l) = -9l + 3. Give ph(r) + uy(r). -r - 2 Let d(q) = 4q*3 + 2q*2 - 4q + 3. Let n(f) = 17f3 + 9f*2 - 17f + 13. Suppose -3 + 5 = k. Suppose -6 = -c - kc. Calculate cn(z) - 9d(z). -2z*3 + 2z - 1 Let w(p) = -2p3 - 7p*2 - 6p. Let r(g) = g3 + g2 + g. Give 6r(l) + w(l). 4l3 - l2 Let q(o) = 6o + 7. Let f(j) = -j - 1. Let g(u) = -15u*2 - 2u - 1. Let b be g(-1). Calculate bf(d) - 2q(d). 2d Let f(h) = -h3 + 3h - 3 - 5h + 0h3. Let b(g) = g2 + 5g - 1. Let j be b(-4). Let c(a) = 3a3 + a2 + 5a + 7. Give jf(v) - 2c(v). -v3 - 2v*2 + 1 Let b(o) = -2o + 0o - 15o*2 + 17 + 0o. Let k(h) = -7h2 - h + 8. Suppose -2i - 76 = 16. Let w = -33 - i. What is wk(m) - 6b(m)? -m*2 - m + 2 Let m(p) = -7p*2 - 4p - 6. Let o(d) = 19d2 + 13d + 10. Let y(c) = 10c2 + 7c + 5. Let h(f) = 4o(f) - 7y(f). Determine -6h(t) - 5m(t). -t*2 + 2t Let t(u) = 10u + 16. Let r = 7 - -9. Let n(x) = 2x + 3. Give rn(q) - 3t(q). 2q Let z(u) = 2u + 1. Let f(r) = r*3 - 5r*2 - 5r - 6. Let v be f(6). Suppose -2g = -v - 22. Let j(o) = 10o + 6. Calculate gz(m) - 2j(m). 2m - 1 Let b = 7 + -4. Let i = b + -1. Let t(w) = -6 - 2w*2 + 1 - 2w*i + 2w. Let x(o) = 7o2 - 4o + 9. What is -11t(n) - 6x(n)? 2n2 + 2n + 1 Let t(b) = b + 6. Let w(q) = q - 1. Let j(m) = t(m) + 5w(m). Let s(p) = p + 1. Give j(n) - 3s(n). 3n - 2 Let a(m) = 4m - 7. Let h(c) = 8c - 15. Calculate -7a(p) + 3h(p). -4p + 4 Let g(w) = -55w3 - 44w*2 + 44w - 44. Let h(d) = 6d3 + 5d*2 - 5d + 5. Calculate -5g(l) - 44h(l). 11l3 Let w(t) = 6t*2 + 5. Let f(d) = 77d*2 + 66. Calculate -5f(m)	{ "pile_set_name": "DM Mathematics" }
1)(0 - 4 + 2) + 5i*3 + 0i*3 + 2i*3. 11i*3 Expand (-4l*3 + 2l*3 + 10l*3)(l + l + 3l). 40l*4 Expand -10t*5 + 10t*5 + 14t*5 + (0t - 2t + 0t)(-4t4 - t4 + 3t4) + 2t*5 + 3 - 3. 20t*5 Expand (1 - 1 + 1 - 2u*3)(-3u2 - 6u*2 + 3u*2) + (u + 0 + 0)(-u4 + u4 + 2u4). 14u*5 - 6u*2 Expand (-3k + 2k + 0k)(-4k4 + k4 + 2k4) - 1 + 1 + k5 + 3k*5 - 5k*5 + 3k*5. 3k*5 Expand -2t*3 - 6t*3 + 15t*3 + 0t + 0t - t3 + (2 - t - 2)(-4t2 + t2 + 4t*2). 5t*3 Expand -7g*4 - 279g*3 + 279g3 + (g2 - g2 + g4)(-5 + 1 + 2). -9g*4 Expand (-10 - 2l - l + 8)(0l - l + 0l). 3l*2 + 2l Expand (-62 + 11i + 62)(-i*4 + 2 - 2)(0 + 2 - 4). 22i5 Expand k5 - k + k + (-3 + 3 + 2k*5)(1 - 3 + 0) - 2k5 + 3k*5 - 22k + 8k. -2k*5 - 14k Expand (-9 + 6 - 2)(3y - y - y)(2 - 2 - 2y). 10y2 Expand (1 - 2 - 2)(-6f2 + 11f*2 - 12f*2). 21f*2 Expand -26o - 10o + 21o + (1 + 1 - 1)(2o - o + 0o). -14o Expand 0l4 - l4 + 2l*4 + (2l*2 - 2l2 + l2)(l2 - l2 - 2l*2) + (1 - 3 + 0)(-12l4 - l4 + 3l*4). 19l*4 Expand (-7 + 0 + 1)(2q2 - 2q + 2q + q4). -6q*4 - 12q*2 Expand (-3r*3 + 2r3 - r3)(1 - 3 + 0 - 1 + 2 - 3 + (1 + 0 + 0)(-1 + 5 - 2) + 5 - 4 - 5). 12r3 Expand -5h*5 - 2h*5 + 5h*5 + (2h*4 + 2h*4 - 2h*4)(-h + 2h + h) + h5 - h5 + 4h5 - h2 + h*2 + 2h*5. 8h*5 Expand (0 + 0 + 1)(5 + 0 - 3)(-1 + 1 - y - 2). -2y - 4 Expand (-8m3 + 19m*3 - 9m*3)(-m - 26 + 26). -2m4 Expand (y3 + 0y*3 + 0y*3)(-2y2 + 5y*2 - 4y2) - y5 + y*5 - 8y*5. -9y*5 Expand (3 + b - 3)(b - b + 2b) + 2b*2 - 3b*2 + 3b*2 + 2b*2 + 4b - 4b + (1 - 6 + 3)(-2b2 + 3b*2 - 2b*2) - 2b*2 - 4 + 4. 6b*2 Expand (0x*3 + 0x*3 - 2x*3 + (1 - 4 + 5)(-2x3 + 0x*3 + 0x*3) + 0x*3 - 3x3 + x3 + 6x3 - 12x*3 - 8x*3)(-3x2 - 4x*2 + 4x*2). 66x*5 Expand (2g - g + g)(2g + 4 - 4) + (-2 - 6 + 2)(2g2 - g2 - 2g2) + 3g2 - g2 - 3g2. 9g*2 Expand -2l*3 + 0l3 - l3 + l3 + l3 - 4l3 + (-3 + 3 + l)(-3l2 - 2l*2 + 3l2) + (l2 - l*2 - 5l*2)(-l + 3l + 0l). -17l3 Expand (v - 2v + 3v)(-3v + 6v + 2v). 10v*2 Expand (-2 + 5 - 4)(3i2 - 4i + i2 - i2). -3i2 + 4i Expand (-2n + 8n + 6n)(-1 - 3 + 3). -12n Expand -y5 - 3y*5 + 2y*5 + 48y + 11y5 - 48y + (-4 + 4 + 2)(5y*5 - 4y*5 + 0y*5). 11y*5 Expand (c + 2c + 0c + 2c*3)(-c + 3 - 3). -2c4 - 3c*2 Expand (-3o - o*2 + 3o)(-1 - o2 + 1) - 25 - 6o*4 + 25. -5o*4 Expand (1 - 2 + 7)(-4c - c + c). -24c Expand (5h - 2h + h)(4h - 5h + 2h + (-3 + 5 - 4)(h + 0h + 0h) - 4h + 2h + 4h + 2h + 2 - 2 + (6 + 1 - 5)(-3h + h + h)). 4h*2 Expand 3a*5 + 2 - 2 + (-3 + 3 - 1)(-63a5 - 59a*5 + 98a*5). 27a*5 Expand (-6 + 0 + 4)(-3a + 0a + 0a) + 4a - 4a + 3a. 9a Expand (-5f*2 + 0f*2 + 4f*2)(2 - 5 + 1)(-5f + 5f - 2f*2). -4f*4 Expand (-5 + 1 + 2)(-3w + 3w + 2w)(29w - 34w + 45w). -160w*2 Expand (-16o*2 - 20o + 20o)(-2o3 + 2o3 + o3). -16o5 Expand (5 + 2 - 4)(-3 - 5l2 + 3). -15l*2 Expand (-1 - 2 + 8)(0 - r*2 + 0)(r*3 + 2r*3 + 0r*3). -15r*5 Expand (3 + 2p - 3)(0 + 2p*2 + 0) + 2p*3 - 2p3 + p3 - 2p3 + p3 + 0p*3 + 140p*3 - 26p*3 - 4p*3. 114p*3 Expand (5b - 3b - 3b)(-3b*2 + 2b + 8 - 8 + (-3b + 4b - 2b)(3b + 0b - 2b) + 0b*2 - 2b*2 + 0b*2). 6b*3 - 2b*2 Expand -3k - 3k + 5k + 0k - 2k + 3k + (k - 3k + k)(-1 + 2 - 3) + k - 3k + k - 1 + 1 + 2k + (5 - 7 - 8)(k + 3k - 3k). -7k Expand -2y - 2y + 6y + (-2y + 3y - 2y)(-2 + 3 + 0) - 1 + 1 - 2y + 0y + 3y - 5y - 2y - 1 + 1. -5y Expand a*2 - 2a*2 + 2a*2 + (3a + 2a - 3a)(-a + 3 - 3) - 2a*2 + 0a*2 + 0a*2 + 9a*2 + 0 + 0. 6a*2 Expand (1 - 5d + 4d + 3d)(-2d - 4d + 4d). -4d2 - 2d Expand (u - u - u)(1 + 3 - 1) - 8u - 4u + u. -14u Expand -q2 + q2 + 2q2 + (-q2 - 3 + 3)(-2 + 3 - 2) - q2 + q2 + q*2. 4q*2 Expand ((2 + 2 - 2)(0 + 2 - 3) - 7 + 2 - 4)(0n + n + n). -22n Expand (0r*4 + 2r*4 - 3r*4)(3r + 0r - 4r) + 2r*5 + 2r*5 - 3r*5 + (-2r*3 - 3r*3 + 3r*3)(-2 + 2 - 2r2) + r5 + 2r5 - r5. 8r5 Expand (t + 3t + 4t)(4t + t - t - t - 2t + 2t + (-2 - 2 + 5)(3t + t - 5t)). 16t2 Expand (-5o*3 - 7o + 7o)(3 - o - 3) + 2o4 + o4 - 2o*4. 6o4 Expand (-n2 + 2n2 + 0n*2)((0 - 3 + 6)(-2n + n + 0n) - 101n + 45n + 31n). -28n3 Expand (b + 5b + 2b4 - 2b)(2b + 6b - 5b). 6b5 + 12b*2 Expand 2p*4 + 4p*4 - 4p*4 + (0 - 29 + 3)(5p4 - 3p*4 - 2p2 + p2). -50p4 + 26p*2 Expand 1 - 1 - 7f*3 + 0f + 2f3 + 0f + (f - 4f + f)(-3f2 - f2 + 3f*2) + 0f*3 + 0f*3 + 2f*3 + 4f*3 - 2f*3 + 0f*3 - 2f2. f3 - 2f2 Expand (2b*3 - 2b*3 - 2b*3)(-b*2 + 3b*2 + 0b2) + b5 + 0b5 + b5 + (-1 + b5 + 1)(-3 + 0 - 1). -6b5 Expand (15 - 15 - 4f)(3 + 5 - 4). -16f Expand -q*3 - 3q*3 + 2q*3 - 15q*2 + 5q*3 + 15q2 + (q2 - 3q2 - q2)(-2q - 3q + 3q) + 0q*3 + 3q*3 - 4q3 - q3 + 4q3 - 2q*3. 9q*3 Expand (1 + 2 + 1)(2 + 8o - 4 - 13o). -20o - 8 Expand (k - 2k - k)(5k - 2k - 2k) + (3k + 0k - 2k)(7k + 3k - 4k) - k2 - k2 + k2. 3k*2 Expand 2s + 2s2 - 2s + ((-2 + 2 - 2s)(-4 - 1 + 4) - s + 2 - 2)(-4s + 5s + s). 4s*2 Expand (5 - 3 + 1)(g - g - 7g) + (-4 + 3 - 1)(0 - 2g + 0). -17g Expand (9 + 5 + 1)(r + 3 - 3) - 2r - 5r + 4r. 12r Expand q + 1 - 1 + (0 + 2 + 0)(3q - 2q - 2q) - q - 2q + 0q + (1 + 3 + 1)(-q + q - q). -9q Expand (0o*3 + 0o*3 + 2o*3)(o*2 + 17o2 - o2). 34o5 Expand (1 - 2 + 2)(2 - 7 + 6)(-4 + 3 + 2)(u - 2 + 2). u Expand -4 + 4 + 2a2 - 5a*2 + 2a2 + a2 + 5a2 - 3a*2 + 0a*2 + (0a - 2a + 4a)(-a + 3a - a) + 2a2 - 2a + 2a + a2 - 4a*2 + 7a*2. 10a*2 Expand (2s*2 - 2s*2 + 3s*3)(6 - 3 - 2)((-1 - 2 + 2)(s - 1 + 1) + 0s - s + 0s + 8s - 2s + 0s). 12s*4 Expand (3z*3 - 4z3 - z3)(-2z*2 + 5z*2 - 2z2) + z5 + z*5 - 3z*5 - 2z*5 - 2z*5 + 2z*5 + 2z*5 - 5z*2 - 4z*2 + 0z*5. -3z*5 - 9z*2 Expand (12 - u - 5 + 2u)(0 + 1 + 0) + (2 - 2 + 1)(-1 - 2u + 1) + 0 + 0 - 2u. -3u + 7 Expand (25 + 30 - 45)(-r*3 + 2r*3 - 2r*3). -10r*3 Expand (-3a*2 + 0a2 - a2)(2 + 3a*2 - 2 + 2a)(5a - 4a + 2a). -36a5 - 24a*4 Expand (-6 + 2 + 3)(-2 - 3 + 3)(5q*3 + 2q*5 - 5q*3). 4q*5 Expand z - 4z*5 + z + 7z*5 + 3z*3 + 3z*5 - 3z*3 - 3z*5 + 3z*5 + 2z*5 + (-3z*5 + 4z5 + z5)(1 - 3 + 3) - 2z*4 + 2z*4 - 2z*5. 8z*5 + 2z Expand (0 + 0 - 1)(-4 + 2t + 4) - t - t + 3t + 1 - 1 + t + (0 + t + 0)(2 + 3 - 7). -2t Expand -2a + 3 - 3 + 0 + 0 - a + (-4 + a + 4)(-4 + 4 - 2) + 588 + 42a - 588. 37a Expand (-5p*2 + 47 + 3p*2 + 0p*2 + 2p)(4p - 4p + 2p). -4p3 + 4p*2 + 94p Expand 2b3 - 2b3 + b3 + (3 + 1 + 0)(0 + 1 - 2)(0b3 + b3 - 2b*3). 5b*3 Expand (-5t + 3t + t)(770 - 770 + 46t3). -46t*4 Expand (1 + 1 - 1)(-125k + 4 - 5 + 114k). -11k - 1 Expand 2d*5 - 2d*5 + 3d*5 + (4 - 4 + 2d)(2d*4 - 2d4 + d4) + 0d4 + 0d*4 - 4d5. d5 Expand (3b - 2b + 0b)(3b - 31b - 2b)(0 - 3 + 2 - 2 + 0 + 3 + (-3 + 1 + 4)(0 - 5 + 4) - 6 + 3 + 4 - 4 + 2 + 4 + (-3 + 3 - 2)(-1 + 4 - 1)). 90b2 Expand (4 - 4 + 2z)(-4z - 4z + 17z) + (4 - 4 - 2z)(-2z + 3z - 2z) - 3z*2 + 5z2 + z2. 23z2 Expand (n2 - 2n*2 + 0n*2)(7n + 4n - 8n). -3n*3 Expand (3f*2 + 0f*2 - 5f*2)(-2f + 4f - f)(4 - 4 - 6f). 12f4 Expand q + 2q*4 - q + 4q*4 + 0q*4 - 3q*4 + (q + 2q*2 - q)(q2 + q2 - q*2) + 17q*4 - 12q*4 + 10q*4 + (4 - 4 - 2q)(-q3 - 4q + 4q). 22q*4 Expand (3d*3 - 2d*3 + 0d*3)((4 + 1 - 3)(0 + 0 + 2) - 5 + 3 + 1 + 4 - 2 - 3). 2d3 Expand -j3 + j4 + j3 + (0j3 - 3j3 - j3)(2j - 2 + 2). -7j4 Expand (0 + o2 + 0)(-o + 2o + 0o) - 26o2 + 26o*2 - 6o*3. -5o3 Expand (-z4 + 5z4 - 5z*4)(	{ "pile_set_name": "DM Mathematics" }
2 - 44162981y*2. 52y*2 Collect the terms in -25g*2 - 95g*2 - 41g*2 - 40g*2 - 24g*2 + 9g*2. -216g*2 Collect the terms in -29425z - 22028z + 8321z + 9948z - 21582z. -54766z Collect the terms in 357 - 9v + 352 - 709 - 82v + 41v + 40v. -10v Collect the terms in 19 - 1239559k + 13 - 32. -1239559k Collect the terms in -1103p + 0 + 0 + 676p + 567p. 140p Collect the terms in -21q2 + 68q*3 - 71q*3 + 118q*3 + 14q*2 + 7q*2. 115q*3 Collect the terms in 9901429o - 9901416o - 425575 + 425575. 13o Collect the terms in -1311d + 220d - 1583d + 464d + 68. -2210d + 68 Collect the terms in -6255104n*2 + 9125105n*2 + 10508753n*2. 13378754n*2 Collect the terms in -930 + 36k*2 + 441 + 489. 36k*2 Collect the terms in 8o - 346o2 - 32o + 86o + 348o*2. 2o*2 + 62o Collect the terms in 5872m - 34 + 5883m - 11735m + 34. 20m Collect the terms in 815c + 277 - 2298c + 822c - 38 + 660c + 173. -c + 412 Collect the terms in 48202 + 92618 - 16457 + 5u. 5u + 124363 Collect the terms in -4875w + 1608w - 7365w. -10632w Collect the terms in -33823t + 35150t - 38102t - 86719t. -123494t Collect the terms in 50x + 53x + 103 + 10x + 47x + 49x - 210x. -x + 103 Collect the terms in 2c*3 + 21264504735 - 21264504735. 2c*3 Collect the terms in -422c*2 + 135c*2 - 304c*2. -591c*2 Collect the terms in 64303w - 128665w + 64364w. 2w Collect the terms in 76j + 87j - 46j*3 - 163j + 93j3 - 34j*3. 13j*3 Collect the terms in 212066l*3 + 3l - 3l + 0l - 212050l3. 16l*3 Collect the terms in 1028p*2 - 3151p*2 + 1077p*2 - 306p*3 + 1046p*2. -306p*3 Collect the terms in -146w*2 - 48w*2 + 555w*2 + 38w*2. 399w*2 Collect the terms in 6z - 3z2 + 22394 + 23z*3 - 21z*3 - 2z. 2z3 - 3z*2 + 4z + 22394 Collect the terms in 64 - 35 - 43 + 14 - 120q2. -120q*2 Collect the terms in -1261179f + 2522372f - 48f*2 - 1261192f. -48f2 + f Collect the terms in -155 + 5f - 4 - 6 + 173 - 8. 5f Collect the terms in -44158z + 23034z + 22860z. 1736z Collect the terms in -2t + 2t + 323 + 200 - 2t*2 + 342 - 865. -2t*2 Collect the terms in 27 + 48 + 75 - 147 + 8h*2. 8h*2 + 3 Collect the terms in -31244899 - 3a + 93734698 - 31244896 - 31244903. -3a Collect the terms in x - 285x*3 - 80x*3 + 2x*2 - 310 + 796 + 63x*3. -302x*3 + 2x*2 + x + 486 Collect the terms in 12x - 62 + 12x - 23x - 3x2. -3x*2 + x - 62 Collect the terms in 879i + 11456i + 877i - 13211i. i Collect the terms in -1346p + 455p + 520p + 367p. -4p Collect the terms in -1518413m + 1518413m + 189749m3. 189749m*3 Collect the terms in -1 - 161771702p - 13p2 + 161771702p. -13p2 - 1 Collect the terms in -9543n + 315n + 17887n. 8659n Collect the terms in 4533 + 2b2 - 4038 - b2. b*2 + 495 Collect the terms in -4d - 24d - 154d + 43 - 6d2 + 4d*2 - 54d. -2d2 - 236d + 43 Collect the terms in -16q + 269q*3 - 274q*3 - 179 + 179 - 3q*2. -5q*3 - 3q*2 - 16q Collect the terms in 95q - 331q + 85q + 79q - 168q3 + 72q. -168q3 Collect the terms in 6094x + 12 - 24628x + 6090x + 6092x + 6357x - 12. 5x Collect the terms in -146v*2 + 11v*2 + 8v*2 - 3 - 296v*2 - 65v*2. -488v*2 - 3 Collect the terms in -1 - 795g*3 - 2148g*3 + 575g*3 + 1. -2368g*3 Collect the terms in 324574l + 45837l + 185766l. 556177l Collect the terms in 117 + 1872t*3 - 316t*3 + 3971t*3. 5527t*3 + 117 Collect the terms in -5u*3 + 4u*3 - 19908346397693u + 19908346397693u. -u3 Collect the terms in -282080521g*3 - 2g + 94026840g3 + 94026842g*3 + 94026841g*3 + 2g. 2g3 Collect the terms in 1 - 2 - 377y*2 - 1138y + 4 - 5. -377y2 - 1138y - 2 Collect the terms in -256y + 1 + 113y - 1 + 182y. 39y Collect the terms in -857h3 - 3661h*3 + 11748h*3 + 10680h*3. 17910h*3 Collect the terms in 7562073a*2 - 3781030a*2 - 3781014a*2 - 1. 29a*2 - 1 Collect the terms in -9q - 444q2 + 24q - 12q + 4q - 7q. -444q*2 Collect the terms in -262034p + 131016p + 131005p + 1. -13p + 1 Collect the terms in -5 - 6579v*2 + 13300v*2 + 3 + 2 + 0 - 6722v2. -v2 Collect the terms in 54 + 30y3 - 13y*3 + 17y*2 - 25y + 58 - 19y2. 17y*3 - 2y*2 - 25y + 112 Collect the terms in 73594q + 43914q - 11924q - 8749q + 310q. 97145q Collect the terms in 96k2 - 6k*3 + 10k*2 + 7k3 + 13. k3 + 106k2 + 13 Collect the terms in -36c - 42c + 259766 + 76c - 259813. -2c - 47 Collect the terms in 93074632 - 41t*3 - 93074632. -41t*3 Collect the terms in -3 - 192n*2 - 34n*2 + 5 - 3. -226n*2 - 1 Collect the terms in -2b*3 + 3b*3 - 102 + 102 - 20468b. b*3 - 20468b Collect the terms in 2p + 173 + 194 - 367 + 296p*2 - 1648p*2. -1352p*2 + 2p Collect the terms in -143s - 1 - 141s + 284s - 3780403s*3 + 3780410s*3 + 1. 7s*3 Collect the terms in 471p*2 - 426p*2 + 743p*2 + 238p*2. 1026p*2 Collect the terms in 59r - 59r + 129879r*2 + 3r*3 - 129416r*2. 3r*3 + 463r*2 Collect the terms in -16l*3 - 97032l*2 + 18l*3 - 105409l*2. 2l*3 - 202441l*2 Collect the terms in -259o*2 + 4o + 282o2 + 404 - 9o. 23o2 - 5o + 404 Collect the terms in -61d + 18268d*2 + 25d - d. 18268d2 - 37d Collect the terms in 359i + 13i*2 + 534i - 17 + 16. 13i2 + 893i - 1 Collect the terms in -237306u - 237310u + 711893u - 237307u. -30u Collect the terms in -305n - 248n + 130n + 132n - 429n. -720n Collect the terms in -64z*3 + 512z*3 - 45z*2 - 444z*3. 4z*3 - 45z*2 Collect the terms in -12u - 14u + 38u - 1057 + 1055 - 5u. 7u - 2 Collect the terms in 524x2 + 80 + 26 - 262x*2 - 283x*2 + 4x*3. 4x*3 - 21x*2 + 106 Collect the terms in -542 + 2151 + 880 + 0l - 2l. -2l + 2489 Collect the terms in -484v3 + 174v*3 + 131v*3 + 180v3 + 660 - 660. v3 Collect the terms in -118510x2 + 39503x*2 + 39507x*2 - 10x*3 + 39500x*2. -10x*3 Collect the terms in -63u*2 + 7u*3 - 60u*2 - 65u*2 - 63u*2 + 279u*2 - 26u*2. 7u*3 + 2u*2 Collect the terms in 4572r - 1180r - 1183r - 3r2 - 1033r - 15r2 - 1176r. -18r2 Collect the terms in -935528o*2 + 467794o*2 + 467749o*2. 15o*2 Collect the terms in 59892u + 212197u + 365798u. 637887u Collect the terms in 21763x + 21760x - 65287x + 21762x + 117x*2. 117x*2 - 2x Collect the terms in -5a3 + 92a*2 + 17855 - 2a + 2a - 17853. -5a*3 + 92a*2 + 2 Collect the terms in -14d + 20d + 7d - 23 - 164. 13d - 187 Collect the terms in -2893534x*3 - 2893422x*3 + 5786959x*3. 3x*3 Collect the terms in -236218s*3 - 67 - 49269s*3 - 55 + 122. -285487s*3 Collect the terms in -59633230t + 377t3 + 59633230t. 377t3 Collect the terms in -23496 - 9l*2 + 11771 + 11784. -9l*2 + 59 Collect the terms in 85q + 85q + 99q + 1 + 85q - 369q. -15q + 1 Collect the terms in 21670 - 5135 + 33808 - 10h*2. -10h*2 + 50343 Collect the terms in 4h*3 + 8h*3 - 49 - 13h*3 + 54 + 3792h. -h*3 + 3792h + 5 Collect the terms in 152589v - 76640v - 75951v. -2v Collect the terms in -3743123s3 + 1871581s*3 + 1871554s*3. 12s*3 Collect the terms in 6w2 + w3 + 250w + 18 + 241w - 15 - 192w. w3 + 6w*2 + 299w + 3 Collect the terms in 7640 - 1908 - 1908 - 17s - 1911 - 1913. -17s Collect the terms in -46776u2 + 93836u*2 - 78317u*2. -31257u*2 Collect the terms in -987 - 7o + 2o - 793 + 1773. -5o - 7 Collect the terms in -998l3 + 2l + 22620l2 - 22620l*2. -998l*3 + 2l Collect the terms in 364 + 350 - 714 + 32466s. 32466s Collect the terms in -4151 + 4000 + 10923 + q*3 - 2q. q*3 - 2q + 10772 Collect the terms in -979j2 - 150j*2 - 67j*2 + 0j*2. -1196j*2 Collect the terms in 220g + 184g - 213g + 358g + 259g - 16g. 792g Collect the terms in 22625o2 + 746o*2 + 9442o*2 - 565o*2. 32248o*2 Collect the terms in -8 - 5 - 7 + 32i - 14 + 34. 32i Collect the terms in 357y - 181y + 474y*3 - 176y - 503y3. -29y*3 Collect the terms in 5v - 9v + 8v + 8v - 2v + 61 + v. 11*v + 61 Collect the terms in	{ "pile_set_name": "DM Mathematics" }
4 - 10y5 + 6y wrt y? -200y3 Let j = -2/639 + 679/12780. Let x(c) be the second derivative of 0 + 1/4c*4 - jc*5 + 0c*2 + 3c + 0c3. What is the third derivative of x(d) wrt d? -6 Let k(q) = -14q*4 + 9q*3 + 9q*2 - 9q + 7. Let r(i) = 7i4 - 4i*3 - 4i*2 + 4i - 4. Let c(v) = 4k(v) + 9r(v). Differentiate c(p) wrt p. 28p3 Let u(n) be the first derivative of -n7/30 - n4/8 + 3n*2/2 - 1. Let s(i) be the second derivative of u(i). Find the second derivative of s(r) wrt r. -84r*2 Find the second derivative of -32b + 77b - 41b + 5b5 wrt b. 100b3 Let v(k) be the second derivative of k6/360 - k5/30 - k3/2 + 2k. Let a(u) be the second derivative of v(u). What is the second derivative of a(w) wrt w? 2 Suppose -11z + 20 = -6z. What is the second derivative of j5 - zj*5 - 4j - 3j + 2j wrt j? -60j3 Let s(r) = r3 + 4r*2 - 14r. Let n(z) = -4z3 - 11z*2 + 41z. Let a(y) = 4n(y) + 11s(y). What is the second derivative of a(d) wrt d? -30d Find the first derivative of 6 - 100k*2 + 7k*4 + 100k*2 wrt k. 28k*3 What is the third derivative of -7o*6 + 18o*2 + 32o*6 + 10o*2 wrt o? 3000o3 Let w(s) be the second derivative of -s7/210 - s*5/20 - 5s*3/6 + 4s. Let a(h) be the second derivative of w(h). Find the second derivative of a(i) wrt i. -24i Let o(l) = -l3 - 5l*2 - 4l + 3. Let r be o(-4). What is the second derivative of 0wr - w + 5w - 4w3 wrt w? -24w Let g(s) = -3s. Let n(u) = -u2 + 6u. Let h(q) = -q + 1. Let a be h(4). Let l(i) = an(i) - 5g(i). Find the second derivative of l(p) wrt p. 6 Suppose -3l + 3 + 0 = 0. What is the first derivative of -l + 2d - 2d + 2d*2 wrt d? 4d Let p(t) be the third derivative of -t*5/60 - 5t*4/24 + 3t2. What is the second derivative of p(a) wrt a? -2 Let h(q) = q2 - 7q - 3. Let a be h(8). Suppose 2n - ap + 35 = 7n, -4n + 20 = 2p. Find the second derivative of -nf + 20 + f4 - 20 wrt f. 12f*2 Find the third derivative of 10q*3 + 0q*2 - 42q*3 + 7q*2 + 12q*3 wrt q. -120 Find the first derivative of -58 + 38 + 12d*4 + 7d*4 wrt d. 76d*3 Suppose 24 = 4b - 4x, 12 = 3b - 4x + 3x. Find the second derivative of 0j - 3j*b - 2j*3 + 4j*3 + j wrt j. -6j Let b(s) = s*2 - 8s - 12. Let o be b(10). What is the second derivative of -6y + 2y*3 - 2y*3 + 2y*3 + oy wrt y? 12y Suppose -4q + 41 - 97 = 0. Let m be q/(-4) + (-1)/2. What is the second derivative of -4k2 + 0k + k*2 + mk wrt k? -6 What is the second derivative of 64j - 5j*5 - 71j - 2j5 wrt j? -140j*3 Let q(o) be the second derivative of -53o*6/30 + 14o*2 + 3o - 7. What is the derivative of q(u) wrt u? -212u3 Let p = -2 - -5. What is the second derivative of -5h*2 + 3h + ph2 + 0h*2 + 4h2 wrt h? 4 Let v(w) be the third derivative of w7/210 + w*5/60 + 3w*2. What is the third derivative of v(u) wrt u? 24u Let f(u) be the first derivative of 16u6/3 - 6u3 - u2 - 40. What is the third derivative of f(z) wrt z? 1920z2 Let s(u) = -3u*2 - 2. Let c(p) = 1. Let i(l) = 5c(l) - s(l). Differentiate i(b) with respect to b. 6b Find the third derivative of 5v*5 + 4v*5 + 2v*5 + 7v*2 - 2v*2 wrt v. 660v*2 Let r(t) = -11t*4 - 6t3 - t2 - 6. Let n(v) = -v4 - v3 + v*2 - 1. Let y(c) = -6n(c) + r(c). Find the third derivative of y(g) wrt g. -120g Let v(a) be the second derivative of -7a*4/2 - 29a*2 - 3a + 5. Differentiate v(u) with respect to u. -84u Find the third derivative of -6t*4 + 13t*4 + 16t*4 + 18t*2 wrt t. 552t Suppose 4b - c = 9, 0c + 2c = -4b + 6. Suppose 0 = 4x - 8 - 0. What is the first derivative of -bq*x + 4q*2 - 4q*2 + 1 wrt q? -4q Let q be (-3)/(2(-6)/16). Suppose -qk = -4s - 20, 2s - 9 = -5k + 2. What is the first derivative of 1 + 0 + z3 + z3 - 4z*k wrt z? -6z*2 Let r(p) = 1 - 3 + p - 2p2 + 5 - 1. Let n(a) = -a3 - 3a2 + 3. Let t(d) = 2n(d) - 3r(d). Find the second derivative of t(c) wrt c. -12c Let d(n) = -n*2 - 5n + 3. Let s be d(-5). What is the second derivative of -l - 3l2 + sl + 7l2 - 5l wrt l? 8 Let c(r) be the first derivative of -5r6/3 + 7r*3/3 + 13. Find the third derivative of c(g) wrt g. -600g*2 Let p = 24 - 21. Let f(m) be the first derivative of -3m + 0m4 + 0m*p + 3/5m*5 + 3 + 0m*2. What is the derivative of f(d) wrt d? 12d*3 Let p be -6((-14)/(-4) + -4). Let a(u) be the first derivative of 0up - 1 - 1/4u*4 - 1/2u*2 + 0u. Find the second derivative of a(t) wrt t. -6t Let i(h) be the first derivative of 2 - 3h + 1/3h3 + 0h*2. What is the first derivative of i(m) wrt m? 2m Let l(t) = -2 - 8t2 - 9t - 3 + 1 + 6. Let i(o) = -o + 1. Let f(d) = 2i(d) - l(d). What is the second derivative of f(m) wrt m? 16 Let u(o) = o3 + o2 + 1. Let z(x) = 17x*5 - 4x*3 - 11x*2 - 4. Let q(w) = 4u(w) + z(w). What is the third derivative of q(a) wrt a? 1020a2 Suppose -3q = -53 - 1. What is the second derivative of -3u + 21u*4 - u - qu*4 wrt u? 36u*2 Find the third derivative of -4 + 4n*3 - 4n2 - 2 + 6 wrt n. 24 Let h(d) = -d2 - 1. Suppose 4g + 4 = -0g. Let c(p) = -8p2 - 6. Let u(y) = gc(y) + 5h(y). What is the first derivative of u(l) wrt l? 6l Let i(v) be the second derivative of v*4/3 + 4v*2 - 5v. What is the derivative of i(o) wrt o? 8o Let i(a) = -a3 - 6a*2 - 6a. Let z(b) = -6b2 - 5b. Let o(q) = -5i(q) + 6z(q). What is the third derivative of o(u) wrt u? 30 Let k = 3 + -2. Suppose -3b + 5 = -k. Find the third derivative of 0h*5 + 0h*5 - 2h*6 - bh*2 wrt h. -240h*3 Let i be 11/((-11)/(-6))1. What is the first derivative of iq3 + 1 + 4 - 1 wrt q? 18q*2 Let i(l) be the second derivative of 7l4/12 + l3/6 - 7l. What is the second derivative of i(g) wrt g? 14 Let q(a) = 35a*5 - 17a*4 - 2a*2. Let t(d) = -12d*5 + 6d4 + d2. Let f(l) = -6q(l) - 17t(l). Find the third derivative of f(m) wrt m. -360m2 What is the third derivative of 2951 + 2l*2 + 11l*3 - 2995 + 17l*3 wrt l? 168 Find the first derivative of 1 + 4 + 3y*3 + 3 wrt y. 9y2 Let p(r) = -r3 - r*2 + r + 1. Let f(w) = -2w*2 - w + 2w + 9 - 8w3 + 4w - 3w2. Let h(x) = -f(x) + 5p(x). Differentiate h(g) wrt g. 9g2 Let p(x) be the first derivative of 0x*4 + 0x*2 + 1/3x*6 - 1 + 0x + 0x5 + 2/3x*3. Find the third derivative of p(b) wrt b. 120b*2 Let b(z) = -5z2 + z. Let f(u) = -u2. Let p(k) = 2b(k) + 4f(k). What is the second derivative of p(c) wrt c? -28 Let m(x) be the first derivative of -1/2x4 + 0x - 6 - 4/3x3 + 0x*2. Find the third derivative of m(f) wrt f. -12 Differentiate -18 - 11 - 40 + 41 + 11n*4 with respect to n. 44n*3 Find the third derivative of -2b*2 + 0b*6 + 0b*6 - 4b*6 - 2b*6 wrt b. -720b*3 Let x(m) be the second derivative of -2/15m*6 + 0 + 0m*2 + 5m + 2/3m4 + 0m*3 + 0m*5. Find the third derivative of x(s) wrt s. -96s Let r(g) be the first derivative of -4g3/3 - 7g - 18. Find the first derivative of r(t) wrt t. -8t Let l(q) = -q4 - q3 + q2 + q. Let x(h) = -11h*4 - 3h*3 + 3h*2 + 3h + 9. Let o(j) = 3l(j) - x(j). What is the first derivative of o(b) wrt b? 32b*3 Let b = 11 - 9. Let l be 2/8 + 7/4. What is the derivative of 2m*b - 2m*3 + 2 - 2m*l wrt m? -6m*2 Suppose -4h - 14 = -6h. Find the second derivative of 2 + hv*4 - 9 + 3v + 7 wrt v. 84v2 Suppose -6u + 2u - 8 = 0. Let v be u(2 - (-9)/(-2)). Find the second derivative of -s + 2s5 + 2s + s*v wrt s. 60s*3 Suppose 3m - 9 = -3. Suppose -3y = -2t + m, -y + t = -0t + 1. What is the first derivative of i4 + 4 + y - 2 wrt i? 4i*3 Let t(q) = -3q*3 + 2q + 1. Let j(c) = 0 - 4 - 5c + 0c*3 - 4c + 13c3. Let x(f) = 2j(f) + 9t(f). Find the first derivative of x(v) wrt v. -3v*2 Let c(b) be the first derivative of 0b*2 + 5/2b*4 + 9b + 0b3 - 7. What is the first derivative of c(g) wrt g? 30g2 Let h(j) = -j3 + j*2 - j - 1. Let y = -2 + 8. Let i(s) = 3s*3 - 3s*2 + 2s + 2. Let u(o) = yh(o) + 3i(o). What is the third derivative of u(n) wrt n? 18 Let f(o) be the third derivative of 29o5/60 + o*3/3	{ "pile_set_name": "DM Mathematics" }
*2 - 21l Expand 21t3 - 13t*3 + 43t*3 + (1 - 1 - t)(3t2 + 0t*2 - 5t2) - t3 - 4t3 + 3t3 - t2 + t3 + t2. 52t3 Expand (-3w + 2w - w)(-2058 + 2058 - 140w)(0w3 + 2w*3 + 0w*3). 560w*5 Expand (4k + 3k - 5k)(-3 + 3 - 1) + 0k + 0k - 2k + (-9 - 8 - 51)(-2k + 0 + 0). 132k Expand 8 - 8 + x3 + (2x + 6x2 - 2x)(2x - 4x - x). -17x*3 Expand (-10821 + 96n*3 + 10821)(-3n + 2n*2 + n + n). 192n*5 - 96n*4 Expand (18 + 4 - 6)(0 + 0 - v)(1 - 1 + 4v*2)(-2 + 2 - v). 64v4 Expand (0u - 2u + 4u)(-5 + u + 5)(3 - 4 - 3) + (-3u2 + 0 + 0)(0 + 0 - 2) - 9 - 10u2 + 9. -12u*2 Expand (-b - b + 3b)(1 - 709b*2 + 3 - 2 - 2). -709b3 Expand (-w2 - 8w2 + 4w*2)(24w - 54w + 27w). 15w*3 Expand (3 + 2 - 4 - 4a)(-8 + 1 - 3 + (-5 + 2 + 1)(0 + 1 - 2)). 32a - 8 Expand 3 - 3 - 2n + (1 + 0 + 0)(-1 - 8 + 4)(-12n - 4n + n). 73n Expand (8j - 27j - 8j)(-4j + j + 30j). -729j*2 Expand 2b*4 - 2b4 - b4 + (-1 + 4 + 3)(-4b*4 + 3b4 - b4). -13b4 Expand (1 + 0 + 3h - 2h)(-2 - 3h3 - h3 + 6h3) + (h3 - 2h4 - h3)(-6 + 1 - 7). 26h4 + 2h*3 - 2h - 2 Expand (2219 - 2219 + 180z - 4z + 2z + z + (z - z + z)(3 + 0 - 5) + 3z - z - 4z - 4z - z + 3z)(z2 - 2z*2 - 3z*2). -692z*3 Expand (-1 - 2h + 1)(1 + 2h - 1) + 4h2 + 3 - 3 + (3h - h - h)(-2h - 1 + 1) - 3h + 3h + 3h2. h2 Expand ((3j + 3 - 3)(-2j*3 - 2j*3 + 6j*3) + (2j*3 - 4j*3 + 4j*3)(-2j + 4j - 3j))(j + 2j - 2j). 4j5 Expand (-2 - 3 + 4 + (-2 + 6 - 3)(1 - 3 + 1)(-11 - 11 - 4))(-6o + 18o + 17o). 725o Expand (0b + 2b - b)(2b + 0b - 114b - 6b). -118b*2 Expand (0 - 2y*2 + 0)(3 + 1 - 2) + y*2 + 0y + y - 2y + (-3y + 4y - 3y)(10 - 82 - 43)(-2y - 2y + 6y). 457y*2 - y Expand (-1 + 48i*2 - 27i*2 - 4i*2)(3i3 + 4i*3 - 5i*3). 34i*5 - 2i*3 Expand (-4i*2 + 35i*2 + 2i*2)(0i2 + 0i*2 + 2i*2). 66i*4 Expand -5v*5 - 21v*5 + 3v5 + v5 - v5 - v5 + (-4v3 + 2v*3 + 4v*3)(-2v2 + 0v*2 + 0v*2) + 3v + 3v5 - 4v5 - v5. -30v5 + 3v Expand -2a3 + 0a*3 + 5a*3 + 2a*2 - 2a*3 - 2a*2 + (a + 2 - 2)(-2a2 - 3 + 3) - 23 + 24 - a3 + 10a*3. 8a*3 + 1 Expand (15a - 6a + 6a + (-2 + 1 - 1)(-a + 2a + 2a) + a + a - 3a)(4 + 4 - 5). 24a Expand 183 - 76 + 10n - 78 + n + 2 - 2 + (1 - 1 - 1)(-4n + 4n + 2n). 9n + 29 Expand (5m + 4m + 15m)(-m*2 - m - 19 + 19). -24m*3 - 24m*2 Expand (1 - 1 + d)(-d*3 + 415d*2 - 47 + 2d*4 - 415d*2). 2d5 - d4 - 47d Expand (-4w*3 - 4w*2 + 4w*2)(-5w - 3w + 4w) + ((-2 + 2 + w)(0 + 1 + 1) - 3w + 0w + 2w)(-w*3 + 4 - 4). 15w4 Expand (l + l3 - l)(-10l + 12l - 10l) + l*4 - 7l*3 + 0l*3 + 4l*3. -7l*4 - 3l*3 Expand (-44s*3 + 111s*3 + 346s*3)(-3 + 3 - 2)(3 + 2 - 3). -1652s*3 Expand -61j - 56j - 184j + 2 - 2 - j + 2j + 2 - 2 + (j + 4j - 3j)(-6 + 2 + 2) - 3j - 3j + 7j. -303j Expand (-1 - 3r + 1)(3r - r - r)(15 - 2r - 15). 6r*3 Expand (-37 + 91 - 21)(-2a - 1 + 1) - 4a + 2 - 2. -70a Expand (v + 3v - 8v)(0 - 3 - 1)((-2 + 3 - 2)(2 + 0 - 3) - 5 - 1 - 6). -176v Expand (0x*2 + 2x*2 - 4x2 + (-2 + 2 - x2)(-1 - 2 + 4) - 1 + 1 + 2x2 - x + x2 + x + x - x + 4x2)(5x2 - 2x2 - x2). 8x4 Expand (-x + 0x - 3x)(-326 + 16 - 96)(2x*2 - 2x2 - x2)(4x - x - 2x). -1624x*4 Expand 3t*2 - 4t2 - t2 + 4t2 - 3t*2 + 0t*2 + (-4 + 4 - 2t)(t - 4t + t) - 1 + 21t2 - 17t*2 + 0. 7t*2 - 1 Expand (-1 - m + 1)(-144m2 + 144m*2 + 64m*3). -64m*4 Expand (25 - 104 - 28 - 71)(3u4 - u4 + 0u*4). -356u*4 Expand (-3w + 6w + 0w)(35w*3 + 2w*3 + 16w*3) + (-2w + 2w + 2w)(-5w*3 + 5w3 - w3). 157w4 Expand -3 + 3 - 2l + (7 + 3 + 88)(l - 5l + 2l). -198l Expand (-161d3 + 1295d*2 - 1295d*2)((-2 - 1 + 1)(3 - 3 + 2d) - 2d + 1 - 1). 966d*4 Expand (0 + 2 + 1)(3 - 1 - 7)(1 - 4 + 0)((0 + 1 + 0)(5t - 4t + t) - 4t - 2t + 3t). -45t Expand -27w*3 - 33w*3 + 62w*3 + (-2w + 3w - 3w)(-8w*2 - 2w*2 + 6w*2). 10w*3 Expand (2a*2 - 4a + 4a)(2 - 1 - 2) + (4a - 4a - a)(2a + 0a - 3a) - 7a2 - 6a*2 + 30a*2. 16a*2 Expand -4 + 4 - 2g + (-2g - 2 + 2)(2 + 1 - 1) + 2g - 2g + g + (-1 - 1 + 3)(-3 - 2g + 3) + 13g - 4g + 0g. 2g Expand (0z - 2z + 3z)(23 - 36 + 20 + 32). 39z Expand -q + 1217 - 36q - 1213 + (-4 + 3 - 1)(3q + q - 2q). -41q + 4 Expand (-5n + 0n - 13n)(3 - 2 - 2)(8n + 0 + 0). 144n2 Expand (-3 - 1 - 2)((2p - 3p + 2p)(-8 + 3 - 1) + (-1 + 2 + 0)(-p + 2p + 0p)(-1 - 1 + 3)). 30p Expand (-2 + 2 - 2o)(0 - 1 + 10)(-1 + 3 + 0)(-1 + 1 + 2o + (-1 - 5 + 5)(0o - 3o + 0o)). -180o2 Expand (-103 + 103 - 23h)(3 + 3 - 5) + 2h - 2h + 4h + 1 - 1 + h - 3 + 3 + 2h + (-2 + 6 - 3)(-3h + 5h - h) + 2h - 5h + 4h + 4 - 4 + h. -13h Expand (-c - c + 4c + 7 - 7 + c + 0c + c + c + (2 - 2 - 3)(-c - 1 + 1))(0 + 2c + 0). 16c*2 Expand (-4j - 1 + 1)(-7j - j - 3j)(5j2 - 126j + 126j). 220j*4 Expand (2u*5 + 0u*5 + 0u*5)((-4 + 3 + 0)(6 - 3 - 1) + 513 + 96 + 33). 1280u*5 Expand (2 - 4 - 1)(187l - 431l - 2l). 738l Expand (2 - 2 - 1)(-295v + 211v + 309v). -225v Expand (-2d*2 + 3d*2 - 2d*2 + (-3 - 2 + 3)(d*2 + 3d*2 - 5d*2) - 27d + 6d2 + 27d + (-6d2 + 4d*2 + 13d*2)(3 + 1 - 5))(-2 - d + 2). 4d*3 Expand (-2y - y + 10y + 1)(-2y2 + y2 - y2)(5 - 3 + 0)(-1 + 2 + 3). -112y*3 - 16y*2 Expand (1 + 0 + 0)(-3 - 2v + 10 + 1) + (0v - 2v + v)(1 - 4 + 2)(0 + 3 - 5). -4v + 8 Expand k*2 + 4k*2 - 3k*2 + (5k + k - 5k)(-k + 3k + 5k) - 2k2 - 5 + 5. 7k*2 Expand ((-4 + 3 + 2)(3 + 0 - 4) + 2 + 2 - 2)(75v*2 - v + 27v*2 + 17v*2). 119v*2 - v Expand 3 + 5d*4 - 3 + (2d*2 + 2 - 2)(-d*2 + 0d*2 + 3d*2) + 4d*4 - 6d*4 + 6d*4. 13d4 Expand n - n + n3 + (2n - 2n*2 - 2n)(3n - n + 0n) - 3n*3 - 10n*3 - 39n3 + (-1 + 1 + n2)(1 + 2n - 1). -53n3 Expand (35 + 45n - 35)(-23 + 2 + 8). -585n Expand (-1 + 1 + 4 + (-2 - 1 + 1)(2 - 3 - 1))(-8x + 11x - 8x). -40x Expand (-4 - 3 + 6)(2d*2 - 4d2 - d2)(99 + 114 - 280)(-4 + 1 + 2)(d3 + 2d3 - d3). 402d5 Expand (-3 - 2c + 4 + 1)(-2c - c - 2c) - 3c - 3c2 + 3c. 7c2 - 10c Expand (-1 + 1 - 2c2)(-9c + 15c + 1 - 17c). 22c*3 - 2c*2 Expand (-1 + 2 - 2)(0g + 9g - 2g)(-123 + 123 + 80g2). -560g*3 Expand -2m*3 + 3m3 + m3 + (-2m - 5m + 6m)(m*2 + 0m*2 + 0m2) + m3 - 4m3 + 5m*3 + (-2m*2 + 5m*2 + 4m*2)(0m + m + m). 17m*3 Expand (j + 0j + 5j)(-j + 4 - 4) - 2j2 - 2j2 + j2 - 5j2. -14j*2 Expand (3 - l - 3)(964 - 16l - 964) + (-2l - l + 2l)(l - 6l + 4l) + 1 + l*2 - 1 + 5l2 - l2 - 2l2. 20l2 Expand 502 + a3 - 2a4 - 502 + (3a*3 + 3a*3 - 4a*3)(-4a + 3a - 3a). -10a4 + a3 Expand ((13h + 10h - 20h)(-2 - 1 + 1) + h + 2 + 0 - 3h)(-136h + 136h - 12h2)(-2 + 1 + 0). -96h3 + 24h*2 Expand 6v - 4v - v + 2v - 3 + 3 + (0v - 3v + v)(1 - 7 + 4) + (10v + 7v - 7v)(-2 - 1 + 5). 27v Expand -10h4 - 3h*4 + 20h4 + 0 + 0 - h4 + (-5h + 5h + 2h)(-2 - h*3 + 2). 4h*4 Expand (-2d + 2 - 2 + (-4 + 0 + 3)(1 - 1 + d) - 2d + 0d - 2d + 3 + d - 3)(30d - 15d + 33d) + 0d2 - d2 + 0d*2. -289d*2 Expand (3a + 3a4 - 3a)(-84a + 234a - 32a + 1486a). 4812a*5 Expand (-18m + 18m - m3)((2 - 2 - 7)(0m*2 + 5m*2 - 4m2) + m2 - m2 + m2). 6m5 Expand -113v*2 - 39 - 4v3 + 108 - 69 - v3 + v - v + 4v3 - 3v3 + v3 + (-3v2 + 2v*2 + 0v*2)(2v - 4v + v). -2v3 - 113v*2 Expand (-8l*3 - 8l*3 + 7l*3)(1 + 2 - 2) + l - 2l3 - l + (-2l*3 + 3l*3 - 4l*3)(2 + 1 - 1) + 2 - 2l3 - 2. -19l*3 Expand (-19s*2 + 7s*5 + 2s*3 + 19s*2)(1 + 2 + 6 + 3 + 1 - 3 + (-1 + 1 - 2)(-5 + 2 + 1) + 0 - 3 + 1). 84s*5 + 24s*3 Expand (0f + 4f - 5f)(-f + f + f) - 3 + 3 + 3f*2 + (-152f - 286f + 65f)(5f - 5f - 2f). 748f2 Expand 3s + 4s5 - 5s*5 + 0s*5 + (-2s*4 + 3s*2 - 3s*2)	{ "pile_set_name": "DM Mathematics" }
, -5z = -3u - 4. What is the first derivative of 0 - u + 2j4 + 2j*4 wrt j? 16j*3 Suppose -12 = -r - 2r + 3b, 4 = 3r + 5b. Let v be r/(1 + 5)0. What is the first derivative of 3 + vx2 - x2 - 2 wrt x? -2x Suppose -2m - 4 + 10 = 0. Let f be 14/6 + m/(-9). Find the third derivative of -2d*6 + fd2 + d2 + 5d6 wrt d. 360d3 Let y(u) be the second derivative of -u8/560 + u6/72 - u3/6 + u. Let j(p) be the second derivative of y(p). What is the third derivative of j(g) wrt g? -72g What is the third derivative of 17d*2 - 2d + 11d - 9d + 33d5 wrt d? 1980d*2 What is the third derivative of 4k*2 - 6 + 6k6 + 6 - k2 wrt k? 720k3 Let i(m) = 4m*3 + 4m - 11. Let y(b) = 9b3 + 7b - 21. Let p(l) = 7i(l) - 4y(l). What is the derivative of p(g) wrt g? -24g2 Let y = 7 - 12. Let o = y - -10. What is the second derivative of -3a + 0a5 + 2a*o + a wrt a? 40a*3 Suppose 0h = -2h - 18. Let b = -4 - h. Differentiate 5m - 3 - bm - m + 2 with respect to m. -1 Let v(h) be the second derivative of 0h*3 + 3/2h*2 + 1/6h*4 + 2h + 0. What is the first derivative of v(n) wrt n? 4n Suppose -5j = -2c - 16, 0 = 4j - j + 2c. What is the third derivative of 3g*2 - 3g2 - g2 - g*5 + 3g*j wrt g? -60g*2 Let a(q) = -1 + 6 - q + 6 + 0q. Let x be a(9). What is the second derivative of xg3 - g - 3g*3 - 3g + 2g wrt g? -6g Let w be (-1)/(1/5-1). Find the second derivative of 3z - wz - 7z*5 + 5z + 3z5 wrt z. -80z3 Let h(a) be the first derivative of -a4 + 10a - 10. Differentiate h(o) wrt o. -12o*2 Suppose 4g + q + 2q = 10, -5g + 16 = 2q. Let y be 2/(-3)(-18)/g. What is the third derivative of -b*2 + 2b*5 - yb5 - b2 wrt b? -60b2 Let v be (0/(-20))/(-1 - 1). Let t(c) be the first derivative of vc*2 - 3 - 2c + 1/3c3. What is the first derivative of t(h) wrt h? 2h Find the first derivative of 3 - s*3 + 0s3 - s3 wrt s. -6s2 Find the second derivative of 4t + 3t2 + t2 + 4t*2 wrt t. 16 Suppose -9 = -3h + 6. What is the second derivative of -2t - 3t*2 + 2 - h + 3 wrt t? -6 Let j(q) = -2q*3 + 6q*2 + 2q - 6. Let v(k) = -5k3 + 17k*2 + 5k - 17. Let y(a) = 17j(a) - 6v(a). What is the second derivative of y(h) wrt h? -24h Let b = 2 - 4. Let w = b - -5. Find the second derivative of -2k + 5k + wk*4 - k - 5k*4 wrt k. -24k*2 What is the second derivative of 5v + 12v4 - 20v4 + v4 + 5v wrt v? -84v*2 Let i = 3 + -3. Let q = 3 - i. Find the second derivative of -3m*5 + 2m*5 - m + qm*5 wrt m. 40m*3 Let u(p) be the second derivative of -22p*7/21 - 17p*3/6 + 32p + 2. What is the second derivative of u(m) wrt m? -880m3 Let r(f) = 3f*2 + 2f + 1. Let p(q) = 4q2 + 3q + 2. Let h = -3 - -9. Let g = h - 3. Let j(y) = gr(y) - 2p(y). What is the derivative of j(k) wrt k? 2k Suppose 2i - 2 = -0. Differentiate -i - 8h - 3h*3 + 8h wrt h. -9h2 Let q(f) = -f + 7. Let u be q(5). Find the third derivative of -2d*6 + ud4 - d2 + 4d2 - 2d*4 wrt d. -240d*3 Suppose -4 = -k + 2c - 0, -3c = 0. Suppose kv + 2 = 22. Find the third derivative of i2 + i3 - i3 - iv wrt i. -60i2 Let s be (-1 + 0)-1 - -3. Find the second derivative of -6u + u - 2u*5 + su wrt u. -40u3 Let g(f) = -f3 + 17f*2 - 5. Let k(t) = 9t*2 - 3. Let s(r) = 3g(r) - 5k(r). What is the third derivative of s(q) wrt q? -18 Let p(n) = n2 + 2n + 2. Let h be p(-2). What is the second derivative of hg5 + g5 - g + 0g wrt g? 60g3 Let s(p) = -p - 7. Let x be s(-9). What is the third derivative of -3q*x - 13q + 13q + 4q*3 wrt q? 24 Suppose -5u + 18 = -2u. What is the third derivative of 2g*u - 6g*6 - 4g*2 + 5g*4 - 5g*4 wrt g? -480g*3 Let t be 2 - -3 - (-4)/(-2). Suppose 2k - tz + 2 = 0, -6z = -3k - 2z - 2. What is the second derivative of -2ck - 5 - 2c + 5 wrt c? -4 Let c(q) = q*3 - 3q + 4. Suppose 0 = -3i + 4i - 14. Let g(d) = 3d3 - 7d + 9. Let f(z) = ic(z) - 6g(z). Differentiate f(t) with respect to t. -12t2 Let f(b) be the first derivative of -b6/2 + b3/3 - 3. What is the third derivative of f(z) wrt z? -180z*2 What is the derivative of -3 + 3 + 1 - 3 - 2a*2 wrt a? -4a Let v(b) = 2b2 - 3. Let f(j) = -2j*2 + 3. Let c(w) = -2f(w) - 3v(w). What is the first derivative of c(t) wrt t? -4t Let l be (-12)/10(-70)/21. Find the third derivative of 38t*2 - 14t*2 - lt*3 - 18t*2 wrt t. -24 What is the third derivative of 0f*2 + 4f*2 + 6f*3 + 5f2 - f3 wrt f? 30 Let j(p) = 2p3 + 7p2 - 2. Let r(d) = d3 + 8d2 - 3. Let y(k) = 3j(k) - 2r(k). Find the third derivative of y(t) wrt t. 24 Let v be (-1)/((2/4)/(-1)). Let u be v/(-8) - (-27)/12. Find the second derivative of ub*4 + b + b - b wrt b. 24b*2 Let f be ((-6)/1020/(-30))/4. Let u(h) be the second derivative of 0h3 + 2h - fh5 - h2 + 0 + 0h*4. Differentiate u(y) wrt y. -6y2 Let g(n) be the second derivative of n9/15120 - n6/720 + n4/6 - 2n. Let t(d) be the third derivative of g(d). Find the second derivative of t(z) wrt z. 12z*2 Suppose 0z - 4z - 8 = -5x, -6 = -4x + 3z. What is the first derivative of 2 + xt2 - 4 - 2t*2 - 1 wrt t? -4t Let n = 0 + 2. Let u(o) = o*3 - 15o*2 + 15o - 14. Let k be u(14). Find the third derivative of -2g2 + kg*5 + 4g*2 + ng*5 wrt g. 120g2 Let o(y) be the second derivative of y7/2520 + y5/120 - y4/12 - 3y. Let q(z) be the third derivative of o(z). Differentiate q(g) with respect to g. 2g Suppose h - 38 = -5a, 4h - h = 4a - 19. What is the first derivative of 4r*3 + ar4 + 2 - r3 - 3r3 wrt r? 28r3 Let t(g) = -g2. Suppose 3b + b = 4. Let o(d) = -6d*2 + 4d. Let q(h) = bo(h) - 5t(h). What is the second derivative of q(y) wrt y? -2 Let z be -2(-2 + 3/6). Suppose l + zl = 12. What is the third derivative of -4i3 - li*3 + 4i*3 - 14i*2 + 11i*2 wrt i? -18 Let k be (-12)/10(-10)/6. Find the third derivative of 5jk - j4 - 6j*4 + 0j4 + j4 wrt j. -144j Find the second derivative of 560n - 4n5 + 0n*2 - 571n + 0n2 wrt n. -80n*3 Suppose -4w + 3u = 15, 0u = -3w + 2u - 10. What is the second derivative of wh - 11h + h + 4h2 wrt h? 8 Let d(l) be the third derivative of -l5/60 - 8l*3/3 - 43l*2. What is the derivative of d(g) wrt g? -2g Let q be (-1)/(-3) + 15/9. What is the first derivative of m*2 + 3m3 + m2 - 2mq + 1 wrt m? 9m*2 Let t(w) = 2w - 10. Let f be t(7). Suppose 5c = -2a - 4 + 24, -3a - f = -c. What is the third derivative of s4 + 0s2 + sc - s*2 wrt s? 48s Let i(p) = 3p3 + 3p*2 - 3p - 3. Let k(b) = b*2 - b. Let o(z) = -i(z) + 3k(z). What is the derivative of o(t) wrt t? -9t2 Let q(f) = -f3 - f - 1. Let g(c) = -13c*3 + 3c - 16. Let n(s) = -g(s) - 3q(s). What is the derivative of n(l) wrt l? 48l*2 Let p(k) be the second derivative of -4k + 0 + 1/12k4 + 0k*3 + 1/2k*2. What is the first derivative of p(i) wrt i? 2i Let g(y) = -15y4 + 4y*3 - 6y. Let p(l) = 29l4 - 7l*3 + 11l. Let u(n) = 7g(n) + 4p(n). Find the second derivative of u(b) wrt b. 132b2 Let b(l) = l + 1. Let x be b(-1). What is the second derivative of 9f*5 - 10f*5 + xf - 4f wrt f? -20f*3 What is the third derivative of 3c + 5c3 - 3c - 12c2 wrt c? 30 Let l(i) be the first derivative of i7/42 - i3/6 - 3i + 4. Let a(h) be the first derivative of l(h). What is the second derivative of a(f) wrt f? 20f3 Let a be (-5)/20 - 9/(-4). What is the third derivative of 3y2 + y5 + y*5 - 4y*5 - 4y*a wrt y? -120y*2 Let v = -16 + 21. Find the second derivative of -g - 6g + g*2 - vg*2 + 3g*2 wrt g. -2 Suppose c - 4c + 6 = 0. Suppose -3f + c = -4b, 0 = 2f + 6b - b - 9. What is the first derivative of -fx2 + 2x*2 - 3x*2 + 1 wrt x? -6x Let j(r) be the third derivative of r8/840 + r4/12 - r*3/6 - 3r*2. Let q(z) be the first derivative of j(z). What is the derivative of q(d) wrt d? 8d*3 Suppose -2t + 5w + 2 - 7 = 0, 0 = -4t + 4w - 4. Suppose -2c + 4 = -tc. What is the second derivative of 4 + i - 3i**c - 4 wrt i? -6 Let s(z) be the third der	{ "pile_set_name": "DM Mathematics" }
v) = -2v2 - 49v. Let h(c) = 41c2. What is r(h(y))? -3362y*4 - 2009y*2 Let w(y) = -25y. Let l(n) = 195n2. Determine l(w(u)). 121875u*2 Let m(z) = -2z*2. Let f(b) = 10b. Let w(i) = -5i. Let h(s) = -6f(s) - 13w(s). What is m(h(k))? -50k*2 Let l(u) = 2u. Let n(b) be the first derivative of b*3/6 + b - 3. Let m(x) be the first derivative of n(x). Calculate l(m(i)). 2i Let c(v) = 2v2. Let w(z) = -3z*2 - 3079z - 1. Give w(c(u)). -12u4 - 6158u*2 - 1 Suppose 2n - 8 = -2n. Let d = -9 + 13. Let g(f) = -d + fn + 4. Let a(k) = -2k*2. Calculate a(g(w)). -2w*4 Let m(a) = 7a. Let y(q) = 13q. Let c(u) = -11m(u) + 6y(u). Let b(d) = -44d. Determine c(b(x)). -44x Let n(d) be the second derivative of d4/6 - 5d. Suppose 4q - 6q = 0. Let m(x) = qx + 2x - 4x. What is m(n(u))? -4u*2 Let y(d) = 9d. Let q(z) = 16z. Let o(p) = 6q(p) - 15y(p). Let b(i) = -3i. Determine o(b(x)). 117x Let d = -13 - -22. Let t(a) = 19a - 8a - da. Let s(m) = 2m2. Give s(t(b)). 8b*2 Let a(g) = -g. Let q(h) = 13h*2 + 5h + 4. Calculate a(q(k)). -13k2 - 5k - 4 Let t(z) = -35z2. Let j(k) = 90k*2. What is j(t(r))? 110250r*4 Let n(a) = 15a. Let y(d) = -7d. Let g(x) = -6n(x) - 13y(x). Let u(k) = -23k + 17. Let w(o) = -4o + 3. Let t(p) = 6u(p) - 34w(p). What is g(t(f))? -2f Let w(o) = -o. Let n(u) = 18u. Let d(i) = -18i. Let l(q) = 4d(q) + 3n(q). Calculate w(l(t)). 18t Let n be 223/5 + (-3)/5. Let o(i) = 2i*2 - ni + 44i + 2i*2. Let d(v) = 2v*2. Give o(d(w)). 16w*4 Let o(n) = 31n*2. Let p(q) = -q. Let s(a) = -4a. Let z(x) = 3p(x) - s(x). Determine o(z(v)). 31v*2 Let q = -3 + -1. Let h(k) = -6k*2 - 4. Let b(j) = 17j*2 + 11. Let a(f) = qb(f) - 11h(f). Let d(z) = -3z*2. Determine d(a(r)). -12r*4 Let i(m) = 2m*2 + 8m + 8. Let q(z) = z*2 + 5z + 5. Suppose 0w = -w - 8. Let b(y) = wq(y) + 5i(y). Let x(r) = -r - 28 + 28. Calculate x(b(p)). -2p*2 Let h(x) = -2x. Let o(a) = a*2 + a. Let f be o(0). Suppose -2 = -4r + 10. Let n(l) = -rl + l + fl. Calculate n(h(b)). 4b Let v(s) = 4s2 - 3. Let k(l) = l3 - 3l - 1. Let x be k(-2). Let i(j) = 3j*2 - 2. Let h(q) = xi(q) + 2v(q). Let o(f) = -6f*2. Calculate h(o(y)). -36y4 Let u(y) = y. Let g(o) be the first derivative of -o2/2 + 5o + 3. Let r(d) = d - 1. Let s(i) = -g(i) - 5r(i). What is u(s(t))? -4t Let d(j) = -2j2. Let x(a) be the first derivative of a3/3 - 3a2/2 - 3a + 4. Let h(g) = g*2 - 2g - 2. Let y(b) = 6h(b) - 4x(b). Give y(d(z)). 8z4 Let d(p) = -15p2. Let s(g) be the first derivative of g5/60 - 3g2/2 - 9. Let u(i) be the second derivative of s(i). Calculate u(d(c)). 225c4 Let p(f) be the third derivative of f4/4 - 10f2. Let c(b) = -2b*2. Determine c(p(s)). -72s*2 Let o(f) = -1 - 1 + 2 - 3f. Let k(x) = 14x2. Calculate o(k(w)). -42w*2 Let j(p) = -32p*2. Let h(z) = -2z*2. Calculate j(h(m)). -128m*4 Let x(a) = -2a*2. Let t(f) be the first derivative of -4f*3/3 + 6. What is t(x(s))? -16s*4 Let j(i) = -379i. Let b(u) = -2u. Determine b(j(t)). 758t Let m(q) = -2q. Let s(o) = -27o - 1. Calculate m(s(d)). 54d + 2 Let s(a) = -a. Let x(z) = 133z*2. Calculate s(x(m)). -133m2 Let t(c) be the first derivative of -c3/3 - 6. Let k(r) = -r. Give k(t(a)). a*2 Let y = -9 - -10. Let g(v) = 1 - v + 2v - y. Let j(f) = -f. What is j(g(z))? -z Let m(q) = -7q. Let i(z) = -6z. Let u(v) = v + 14. Let f be u(-10). Let l(w) = fm(w) - 5i(w). Let x(h) = -4h + 3h + 0h. Calculate l(x(b)). -2b Suppose -5g = -2p - 9, 3g = 3p - 0p. Let j(w) = -w - 2w + 2w - gw. Let d(i) = i. What is d(j(h))? -4h Let n be (-2)/11 + 290/22. Let p(w) = -3w*2 - 13 + n. Let k(q) = -q. What is k(p(o))? 3o*2 Let d(i) = -2i. Let c(s) = 5s + 89. Give c(d(n)). -10n + 89 Let c(p) = -27p2 - 2p. Let s(d) = 2d - d - 42 + 42. Give c(s(w)). -27w*2 - 2w Let f(m) be the first derivative of 3 + 0m - 1/3m*3 + 0m2. Let j(g) = g. Give f(j(b)). -b2 Let o(x) be the second derivative of 0 + 1/6x3 + 5x + 0x2. Let z(h) = 0 + 8h + 0. Calculate z(o(l)). 8l Let d be 56/30 - 3/15. Let z(b) be the first derivative of 1 + 0b + db3 + 0b*2. Let r(q) = -2q*2. Determine z(r(y)). 20y4 Let a(g) be the third derivative of g4/24 + 3g2. Let z(h) = 5h*2. Determine z(a(j)). 5j*2 Let w(z) = -2z*2 + 29z. Let x(y) = -4y2. What is w(x(d))? -32d*4 - 116d*2 Let r(t) = 2. Suppose 5o + 56 = -3f, -22 = 3o - f - 3f. Let l(k) = -5k + 0k + 4k + 10. Let b(z) = or(z) + 2l(z). Let x(v) = v. Determine x(b(j)). -2j Let o(n) = -2n. Let f(u) = -u - 2u - 6u + 4u. What is f(o(r))? 10r Let x(c) = -2c2 - 4c - 5. Let k(y) = y + 1. Let n(h) = 4k(h) + x(h). Let f(l) be the first derivative of n(l). Let w(p) = -2p*2. What is f(w(g))? 8g*2 Let c(i) = 10i. Let j(o) = 458o2. What is j(c(g))? 45800g*2 Let v(m) = -2m. Let l(o) = o - 2. Let k be l(-2). Let n = k + 7. Let s(c) = -nc + 6c + 2c - 3c. Determine v(s(h)). -4h Let q(s) = 2s. Let p(i) = -i*2 + i - 1. Suppose -2o - 2o = 20. Let m(w) = 2w*2 - w + 1. Let v(c) = op(c) - 5m(c). What is v(q(z))? -20z*2 Let y be 2/4 + (-7)/(-2). Suppose 0 = -2h + 3h - 4. Let g(c) = c - hc + yc. Let o(d) = -d2. Determine o(g(z)). -z2 Let c(p) = 3p. Let f(i) = i. Let t(a) = c(a) - 5f(a). Let x(q) = 3q*2. Determine x(t(y)). 12y*2 Let h(q) = -496q*2. Let l(c) = -15c. What is l(h(m))? 7440m2 Let c(r) = 239r*2. Let q(m) = 11m*2. Determine q(c(d)). 628331d4 Let s(b) be the third derivative of b4/6 - 4b2. Let x(w) = w2 + 2w - 5. Let y be x(-4). Let z(l) = l*2 - y + 3. Determine z(s(m)). 16m*2 Let b(z) = 5 - 4 - 11z - 1. Let k(j) = 2j2. Determine b(k(t)). -22t*2 Let k(b) = 4610b2. Let d(g) = g2. Determine k(d(w)). 4610w4 Let p(w) = 4w*2. Let h = -4 - -6. Let z be 1/(2 + (-15)/9). Let j(t) = 3 - ht - z. Give p(j(n)). 16n2 Suppose -x + 0 = -2. Let l(u) = xu - 2u - 4u. Let b(g) = 2g2. Calculate b(l(y)). 32y2 Let x(u) be the second derivative of -u3/3 - 8u. Let o(t) be the first derivative of 0t*2 + 0t + 1 + 1/3t3. What is x(o(l))? -2l*2 Let d(t) be the second derivative of 0 - 5/12t*4 - 3t + 0t2 + 0t*3. Let o(c) = -c. Determine o(d(w)). 5w*2 Let w(a) = -a + 1. Let l(p) = -53. Let b(q) = -13. Let k(s) = 9b(s) - 2l(s). Let g(c) = -k(c) - 11w(c). Let n(r) = r*2. Determine g(n(u)). 11u*2 Let h(d) = -10d. Let m(o) = -17o. What is h(m(v))? 170v Let y(l) = -3l. Let b(v) = 376v*2. What is y(b(g))? -1128g*2 Let j(y) be the second derivative of 0 - 3y + 1/3y4 + 0y*3 + 0y*2. Let a(o) = -2o. Determine j(a(r)). 16r2 Let d(q) = q + 18 - 18. Let p(z) = -2z*2. What is d(p(w))? -2w*2 Let s(d) = 6d*2 - 5d. Let p(t) = -5t2 + 4t. Let l(v) = 5p(v) + 4s(v). Let k(i) = 13i. What is l(k(q))? -169q2 Let t(b) = -b2. Let r(q) be the third derivative of -1/30q5 + 0q*4 + 0q + 0q3 + 0 + 2q*2. What is r(t(y))? -2y*4 Let m(i) = -23i*2. Let x(y) = 35y*2. Calculate x(m(h)). 18515h*4 Let m(t) be the second derivative of 5t*3/6 + 3t. Let g(d) = 2d2. Calculate g(m(p)). 50p*2 Let l(k) = -5k*2 + 0k*2 + 6k*2. Let m(a) = 5a*2. Let n(s) = -11l(s) + 2m(s). Let u(o) = 2o. Determine n(u(i)). -4i2 Suppose 6t - 3t = 0. Let a(y) be the third derivative of 0y*4 + 0y + 2y2 + 1/30y*5 + 0y*3 + t. Let h(q) = 3q. Determine a(h(k)). 18k2 Let v(p) = 2p + 4p - 3p. Let b(o) = 2o. Let d(a) be the first derivative of -a2/2 - 2. Let l(u) = b(u) + d(u). Give l(v(m)). 3m Let u = -7 + 9. Let k(l) = -l + 6l - ul - 2l. Let q(f) = 7f*2. Determine q(k(n)). 7n*2 Let k(b) be the second derivative of 23b*3/6 - 28b. Let z(l) = -l*2. What is z(k(j))? -529j2 Let x(u) = u3 + 2u - 1. Let p be x(1). Let h be 4((-4)/(-4))/2. Let i(k) = -hk2 + 0k*p + 4k*2. Let w(a) = 4a. Give w(i(g)). 8g2 Let s(i) = 71 - 71 + 2i. Let p(u) = 4u2. Calculate p(s(t)). 16t*2 Let y(l) = 20l - 8l + 8l. Let q(d) = -2d2. Give y(q(m)). -40m*2 Let m(z) = -2z. Let j(l) = 28l2 - 9l + 9. Let b(a) = 7a2 - 2a + 2. Let v(t) = 9b(t) - 2j(t). Determine m(v(n)). -14n*2 Let	{ "pile_set_name": "DM Mathematics" }
(-1/2) assuming h is positive. h Simplify ((k0/kk)(1/24))(-16/5) assuming k is positive. 1 Simplify ((jj2j)/j)(9/5) assuming j is positive. j(27/5) Simplify ((ff(-6)/ff)/f)(16/11) assuming f is positive. f(-96/11) Simplify (cc39)/cc(-3/10) assuming c is positive. c(387/10) Simplify (y*(2/3)y(-2/7))(-11/3) assuming y is positive. y*(-88/63) Simplify ((z(zz1/z)/z)/z)(-21) assuming z is positive. 1 Simplify l(2/3)l(1/9) assuming l is positive. l(7/9) Simplify s(2/19)/(s4/s)(ss*0sss)(7/4) assuming s is positive. s(78/19) Simplify (y(-1/5)/y)/(y(5/4)/y) assuming y is positive. y(-29/20) Simplify ((u(-1))9)(-6/25) assuming u is positive. u*(54/25) Simplify (jjj(2/43))/j34 assuming j is positive. j(-1374/43) Simplify (o/(ooo(3/8)))/(o/o24) assuming o is positive. o(173/8) Simplify ((g/g0)(1/26))(-10/17) assuming g is positive. g(-5/221) Simplify (t/(t/(t/(tt/t*2))t)t(2/9))(1/2) assuming t is positive. t(1/9) Simplify (c/(c/(((cc/(c*(-1)/c))/c)/c)c)c)/(c(2/3)/c) assuming c is positive. c(7/3) Simplify (cc(-9/5))(-9/7) assuming c is positive. c(36/35) Simplify (z0/z)*(25/3)((zz(-3/2))/z)/(z(-1/4)zz) assuming z is positive. z(-139/12) Simplify (y(2/7))34yy(-3)y0 assuming y is positive. y(54/7) Simplify (u8/u(-2/7))/(u0)(-3/7) assuming u is positive. u*(58/7) Simplify (fff3f)*22f(-1/5)/f6 assuming f is positive. f(629/5) Simplify (n/n(1/3))*(3/37)n/n*0n(1/3)/n assuming n is positive. n(43/111) Simplify ((a/a(-2/5))(-3/25))19 assuming a is positive. a(-399/125) Simplify (f*(-2/11)/ff*(-2/9)f)/((ff(-3)/f)/(f/((ff(-3))/f))) assuming f is positive. f(653/99) Simplify (h(-27)/h)/h(-22) assuming h is positive. h*(-6) Simplify (pp(p/(p/(p/(((p/((pp*12p)/p))/p)/p))))/ppp/p1)(-5/8) assuming p is positive. p*(-85/8) Simplify ((oo*(-8)o)/o)/((o/(oo(1/22)))/o) assuming o is positive. o(-131/22) Simplify nnn(9/2)/nn*(-1)n/n*(-2/7)nn(-2/7)nn assuming n is positive. n(17/2) Simplify x(-2/25)x(-31) assuming x is positive. x(-777/25) Simplify h*0h/((h/((h(hh(h/h(-1/5))/h)/h)/h)h)/h)h(-2/19)/(hh(1/3)) assuming h is positive. h(-68/285) Simplify (u(((u/(uuuu*4u))/u)/u)/uu)/(uu*(11/6)uu) assuming u is positive. u(-77/6) Simplify q(20/3)/q(13/4) assuming q is positive. q(41/12) Simplify n(-7)n/(nn(3/4)) assuming n is positive. n(-31/4) Simplify ((jj((j/j(1/3)j)/j)/j)/j(-11/2))(2/3) assuming j is positive. j*(43/9) Simplify mm/(mm(-3))mmmmmm(1/3)/m assuming m is positive. m(25/3) Simplify m(-2/7)mmm*(-4)m*(3/5)m(m(-4/7)/m)/mm assuming m is positive. m(-79/35) Simplify ((m(1/3)m)(-19))(-2/7) assuming m is positive. m(152/21) Simplify (h(-2)h/h*(3/7))/((h/(hh*(-3/10)h)h)/h(-2/9)) assuming h is positive. h(-1229/630) Simplify bb/(b/(bb(7/3)))bbb28 assuming b is positive. b(103/3) Simplify ((l(-1/2))(11/2))41 assuming l is positive. l(-451/4) Simplify (d*(2/3)d)/d(-1/3) assuming d is positive. d2 Simplify (b(-1))(-36)(b/b(2/3))3 assuming b is positive. b37 Simplify a(-1/17)/(a/(a((a/(aa(a/(a*(2/73)aa))/aaaa)a)/a)/aaaaa)) assuming a is positive. a(1202/1241) Simplify (z(-11)/z)/z(-18) assuming z is positive. z6 Simplify ((u(2/3)u)/u)/(u/(uu(1/13))) assuming u is positive. u(29/39) Simplify (((y(-2/5)y)/y)/(y/(y*(-4/7)y)))/((y3/y)/y(-2/13)) assuming y is positive. y(-1422/455) Simplify ((x1/x)/x)*(2/5)/(xx/(x*2/x)x/(x/(x/(x(x(5/3)/x)/x)))x) assuming x is positive. x*(-41/15) Simplify (v/(vv*(-10)vvv))(-28) assuming v is positive. v(-196) Simplify ((h/(hh(-2)))(-32/3))(-19) assuming h is positive. h(1216/3) Simplify (r(-2)r(-2))/(r(-1))0 assuming r is positive. r(-4) Simplify m(-2/7)/((m/(m(-15)m))/mm) assuming m is positive. m*(-107/7) Simplify (mm/(mm26/m))/mmm9 assuming m is positive. m(-15) Simplify b5bb/(bb*(-5)b)b(2/37)/bbbbb(-1/5) assuming b is positive. b(2193/185) Simplify (o(-9)o)(1/20) assuming o is positive. o(-2/5) Simplify (ii(5/2))(2/71) assuming i is positive. i(7/71) Simplify ((((bb10)/b)/b)/b11)(-25) assuming b is positive. b50 Simplify (jjj(-5/3))/j0 assuming j is positive. j(1/3) Simplify ((m(15/7)m)/(m(-6/11)/m))(-9/11) assuming m is positive. m(-3249/847) Simplify (j(11/3)j)/jj(2/27)j assuming j is positive. j*(128/27) Simplify (xxx(-5)xx)/(((x/x(-10))/x)/x) assuming x is positive. x(-10) Simplify ((m/(m/m(-1))m)43)29 assuming m is positive. 1 Simplify ((k/((k/k(-7))/k))/k(-1))(-14) assuming k is positive. k70 Simplify j(-6)/j5 assuming j is positive. j*(-11) Simplify ((ff/f*6)/(f/(ff*10)f))(-36) assuming f is positive. f(-180) Simplify ((n*(-2/15)n)/n)/(n/((nn(-1/7)n)/n))(n(-3/4)/n)/nn0 assuming n is positive. n(-1271/420) Simplify ((c*(2/5)c)/c)*31c*4c(-5/4) assuming c is positive. c(303/20) Simplify (u(-3/5)/u)(-9/7) assuming u is positive. u(72/35) Simplify ((l/(l(-5/3)/l))18)(-25) assuming l is positive. l(-1650) Simplify (o/o(1/2)o(-6)o)(1/2) assuming o is positive. o(-9/4) Simplify (i*(4/9)i(1/9))/(i0)(-10) assuming i is positive. i(5/9) Simplify (gg(-2/9)g(g0/gg)/ggg)/(g/(g/(g/(g/(g*(2/7)g))gg)))(-24) assuming g is positive. g(5143/63) Simplify g/g*21ggg(4/21) assuming g is positive. g(-374/21) Simplify f*(17/4)f26 assuming f is positive. f(121/4) Simplify v*13(v/v*(-9))/vv assuming v is positive. v23 Simplify ((((p/((p(2/5)/p)/p)pp)/p)/p)(-6))(-18) assuming p is positive. p*(1404/5) Simplify (d(d*2/d)/d)/d(dd(6/7)d)/d((d7d)/d)/dd/(dd*(2/9)/dd) assuming d is positive. d(481/63) Simplify x(2/7)/xx6x*(-6)x(-3/2) assuming x is positive. x(-31/14) Simplify l*(2/19)l(-2/9)/l assuming l is positive. l(-191/171) Simplify ((h(4/7))(-5/8))(-26) assuming h is positive. h(65/7) Simplify (t(-1/2)/t1)/((tt(3/4))/(t(-2/3)/t)) assuming t is positive. t(-59/12) Simplify i(-4/17)/i(5/6) assuming i is positive. i(-109/102) Simplify ((t(-3/5))(9/4))(-1) assuming t is positive. t(27/20) Simplify (f(18/5))(8/5) assuming f is positive. f(144/25) Simplify (iii(2/5)iii(-6))/(i1)(-33) assuming i is positive. i(157/5) Simplify ((c/(c/c*(-1))c)(-36))(-5/18) assuming c is positive. 1 Simplify d*(-1/4)/(d/(dd(-12))) assuming d is positive. d(-49/4) Simplify d*(4/7)d/((d/(d*(2/9)d))/d)dddd7/d(-5) assuming d is positive. d*(1121/63) Simplify yy*(1/6)/yy/(yyy(-39)) assuming y is positive. y(229/6) Simplify (rr17rr)/rr/(((r/r*(-6/7))/r)/r)r assuming r is positive. r*(148/7) Simplify ((ss/(s/(s/(ss(1/2)s)))s)/((ss9/s)/s))/(s(2/3))(1/17) assuming s is positive. s(-769/102) Simplify k*(-7)k/(k2/k) assuming k is positive. k(-7) Simplify (a*(1/9)a)/a(-11/4) assuming a is positive. a(139/36) Simplify z/(z/z*(1/2))zz4z(zzzz*(2/5)z)34 assuming z is positive. z(1561/10) Simplify ((v/(v/v(-2/7)))/(v(3/2)/v))(-14) assuming v is positive. v11 Simplify (y(-8)/y(-16))(-7/2) assuming y is positive. y(-28) Simplify s*(-2/19)s/(s/s*(-1/4)s)(s(-1))(-3) assuming s is positive. s(125/76) Simplify ((m/((m(mm(((m/(mm(2/7)mmm)m)/m)/m)/mmm)/m)/m))(-6/23))(2/107) assuming m is positive. m(-12/749) Simplify (q(2/11)q)/q(-14) assuming q is positive. q(167/11) Simplify ((vv(-1)/v)/vvv)50/(vvv(-3)vvv(-1/4)) assuming v is positive. v(-3/4) Simplify (l(l/l(-1))/ll)*3l(-1/7)/l(-2/5) assuming l is positive. l(324/35) Simplify ((s(1/5)/s)/s)/s(-17) assuming s is positive. s(76/5) Simplify k*(1/40)k(14/9) assuming k is positive. k(569/360) Simplify ((a/(a/((a(a(((aa(-2/7)a)/a)/a)/a)/a)/a)))11)(-23) assuming a is positive. a*(2277/7) Simplify ((((m/(m	{ "pile_set_name": "DM Mathematics" }
6u Let f(b) be the third derivative of b7/105 + 2b*3/3 - 2b*2. Differentiate f(s) wrt s. 8s*3 Suppose 0j = -5j. Find the third derivative of 50p*5 + 0p*4 + jp*4 - 49p*5 + 8p*2 wrt p. 60p*2 Let m(g) be the third derivative of 3g7/280 - g4/4 - g*3/2 - 6g*2. Let w(u) be the first derivative of m(u). Differentiate w(p) with respect to p. 27p*2 Let a = -3 - -3. Find the third derivative of -2m*5 + 0m*5 - 3m*2 + am*2 wrt m. -120m2 Let c(x) be the first derivative of x8/112 - x*5/15 - 2x*2 - 1. Let z(u) be the second derivative of c(u). Find the third derivative of z(m) wrt m. 180m*2 Let y(f) be the first derivative of -7f6/120 - f4/24 - 7f2/2 + 3. Let p(d) be the second derivative of y(d). Find the second derivative of p(l) wrt l. -42l Let u(j) = -j - 1. Let s(h) be the second derivative of -h4/6 + h3/6 + h*2 + h. Let b(f) = s(f) + 2u(f). What is the second derivative of b(w) wrt w? -4 Let g(n) be the first derivative of -n*2/2 + 19n + 9. What is the derivative of g(w) wrt w? -1 Suppose 0 = 3u + 2 - 14. What is the third derivative of -5d*2 - 3d*3 - 4d*2 + ud*3 wrt d? 6 Suppose 2z = -0 + 6. What is the derivative of 0 - 4 - r*z + 0 wrt r? -3r*2 Let k = 4 - 0. Find the third derivative of -3x*2 - 2x*6 + 4x*6 + kx*2 wrt x. 240x*3 Let u(n) = 6n*2 + 13n + 2. Let g(d) = 29d2 + 64d + 11. Let b(h) = 2g(h) - 11u(h). What is the second derivative of b(z) wrt z? -16 Find the third derivative of 12d2 + 3d*3 - 4d3 + d3 - 6d3 wrt d. -36 Let c(o) be the third derivative of -o9/30240 + o6/144 - o5/15 + 4o*2. Let p(j) be the third derivative of c(j). Differentiate p(x) wrt x. -6x*2 Suppose -16 = -3m - 5n, 0 = -2m - 3m + 5n. Find the second derivative of -mg3 - 4g*3 + 0g - g + 7g3 wrt g. 6g Let k be -1 + 6 - (13 - 12). Find the first derivative of -4c4 - 2c*k - 14 + 12 wrt c. -24c*3 Find the first derivative of -2l*2 - 7 - 5l*2 + 10 wrt l. -14l Let x(m) be the first derivative of -m7/70 - m5/12 + 5m2/2 + 5. Let v(f) be the second derivative of x(f). What is the third derivative of v(y) wrt y? -72y What is the first derivative of 0r + 4 - 11 - 5r*2 + 0r wrt r? -10r Suppose 6s + 23 = s - r, 4s + 30 = 5r. Let z be ((-4)/6)/(s/60). What is the derivative of -o*4 - z + 3o*4 + 4 wrt o? 8o*3 Suppose -4q - 10 + 34 = 0. Let z be (1 - (0 + 1)) + 3. Find the third derivative of -3lq + 3l*6 - zl2 + l6 + l*6 wrt l. 240l*3 Find the second derivative of -6j + 8j + 13j + 13j4 - 4j*4 wrt j. 108j*2 Let p(z) = 9z - 40. Let u(y) = -44y + 200. Let f(j) = 11p(j) + 2u(j). Find the first derivative of f(q) wrt q. 11 Let y(b) = 13b*2 - 7b + 6. Let n(c) = 12c2 - 6c + 5. Let i = -14 + 9. Let f(r) = iy(r) + 6n(r). What is the second derivative of f(x) wrt x? 14 Let q(z) = -10z2 - 6z - 5. Let f(d) = 20d2 + 13d + 11. Let j(t) = -6f(t) - 13q(t). What is the derivative of j(k) wrt k? 20k Let f(t) = t4 + t3 - t2 + t + 1. Let u(l) = 4l*4 + 6l*3 + 6l + 6. Let h(v) = -6f(v) + u(v). Find the third derivative of h(w) wrt w. -48w Let i(w) be the first derivative of -7w6/6 - 7w*3/3 - 3. Find the third derivative of i(f) wrt f. -420f*2 Let f(p) be the third derivative of -1/56p*8 - 9p*2 + 0p*4 + 0p*7 + 0p*3 + 0 + 0p + 0p6 - 2/15p*5. What is the third derivative of f(i) wrt i? -360i*2 Let i(f) be the third derivative of 3/8f*4 + 0 + 0f*5 - 1/112f8 - f2 + 0f6 + 0f*3 + 0f*7 + 0f. Find the second derivative of i(b) wrt b. -60b3 Let t(n) be the first derivative of n - n2 - 2 + 0n*3 - 1/6n*4. Let z(d) be the first derivative of t(d). Differentiate z(x) wrt x. -4x What is the third derivative of 2s + 0s - 2s + 2s*2 + 3s*6 wrt s? 360s*3 Let w = -9 + 20. What is the second derivative of 1 - 1 + wa - 12a - 2a*3 wrt a? -12a Let v(p) = -7p3 + 2p*2 + 2p + 14. Let r(q) = q*2 + q + 1. Let c(u) = 2r(u) - v(u). What is the derivative of c(z) wrt z? 21z2 Let m(s) be the third derivative of 13s*7/70 + 23s*4/24 + 31s*2. Find the second derivative of m(p) wrt p. 468p2 Let h(x) be the first derivative of x10/1260 + x6/120 - x3/3 + 3. Let i(d) be the third derivative of h(d). What is the third derivative of i(y) wrt y? 480y3 Suppose -6k = -k - 20. What is the second derivative of 4 - 3 - 3nk - 1 - n wrt n? -36n*2 Let c(j) = -6j*3 - 8j*2 - 30j. Let x(r) = 2r3 + 3r*2 + 10r. Let d(n) = 3c(n) + 8x(n). Find the second derivative of d(y) wrt y. -12y Let d = 0 - 0. What is the first derivative of -7 + 2 - 3a*4 + d + 2 wrt a? -12a*3 Let w(x) = 20x - 12. Let f(h) = 19h - 13. Let p(c) = 5f(c) - 4w(c). What is the derivative of p(j) wrt j? 15 Let k(m) be the third derivative of -1/2m*3 + 0m4 - m2 + 0 + 0m5 - 1/40m*6 + 0m. What is the first derivative of k(c) wrt c? -9c2 Suppose 2d + 6 = 3d. Find the third derivative of 0g + 2g6 + 0g + 4g2 + 4g*d wrt g. 720g*3 Let p(n) be the first derivative of 6/5n*5 + 0n + 0n2 + 0n*4 - 4/3n*3 - 6. What is the third derivative of p(i) wrt i? 144i Let k(w) be the second derivative of 0w3 + w + 0 + 0w*6 + 0w*5 + 1/42w*7 + 0w*2 + 1/6w*4. What is the third derivative of k(o) wrt o? 60o*2 Let o(y) = 105y + 72. Let b(s) = 13s + 9. Let c(v) = -33b(v) + 4o(v). Let d(a) = 5a + 5. Let i(r) = 3c(r) + 5d(r). What is the derivative of i(u) wrt u? -2 Suppose -2g - 6 = 2d, -3g + 2 = 2d + 7. What is the derivative of -2 + g - 4t2 - 2 wrt t? -8t Let v(r) be the first derivative of -2r4 + 4r*3/3 + 4. Find the third derivative of v(n) wrt n. -48 Suppose 5m + 3d = 84, 33 = m + m + d. Let g be 2(m/6 - 1). What is the derivative of -2 + 3 - gf - 2 + 0 wrt f? -3 Let x be 1/(4/8) - 0. What is the third derivative of -4g*3 - 3g*2 - 2g*x + 3g*3 wrt g? -6 Find the third derivative of -14d*4 + 136d*2 - 73d*2 - 73d*2 wrt d. -336d Let u(y) be the second derivative of 0y3 + 3y + 0 + 0y5 + 1/4y*4 + 0y*2 + 1/10y*6. Find the third derivative of u(h) wrt h. 72h Let l(f) = f - 5. Let j be l(8). Find the third derivative of 3g2 - 6g*2 + 4g*2 + jg*3 - 6g3 wrt g. -18 Let y(n) be the third derivative of -n5/40 - n4/12 + n3/6 + 3n2. Let h(o) be the first derivative of y(o). Differentiate h(r) wrt r. -3 Let y(f) = -f3 + 5f*2 + 6f - 2. Let x be y(6). Let r = 6 + x. Find the first derivative of 2p2 + 2 - p2 - r wrt p. 2p What is the derivative of -2 - 1 - 5 - 2g4 + 1 wrt g? -8g3 Let j(f) be the first derivative of f4/4 - f3/2 - f - 4. Let o(a) be the first derivative of j(a). Find the second derivative of o(x) wrt x. 6 Let u(c) be the third derivative of c7/840 + c5/24 + c4/3 - 6c2. Let h(v) be the second derivative of u(v). Find the first derivative of h(k) wrt k. 6k Let t(a) = -a*3 + 2a2 + a. Let r be t(-1). What is the third derivative of -l4 - 3l2 + l2 + 0l*r wrt l? -24l Let z(s) be the first derivative of -s*5/5 + 19s4/4 + s2/2 + 3s - 37. What is the second derivative of z(x) wrt x? -12x*2 + 114x Let h(w) be the third derivative of -w5/60 - w4/3 + 11w2. What is the second derivative of h(g) wrt g? -2 Let t(i) be the third derivative of 4i*7/105 - 5i*3/6 - 5i*2. What is the derivative of t(r) wrt r? 32r*3 Suppose 20 = 4b + b. Let t(x) be the third derivative of 0 + 0x5 + 1/60x*6 + 0x*b + 0x - 2x2 + 1/6x*3. Differentiate t(u) with respect to u. 6u*2 Let b(n) be the second derivative of -61n6/30 + n4/6 - 23n3/6 - 10n + 2. What is the third derivative of b(a) wrt a? -1464a Let a be (-1)/4 + (-143)/(-44). Let v(t) be the second derivative of t2 + 0 - 1/3t*a + t. Differentiate v(j) with respect to j. -2 Find the second derivative of 11y*5 + 9y*5 - 2y*5 + 0y*5 + 23y wrt y. 360y3 Let g = 8 - 5. What is the derivative of -5 + 0 - 3d + g wrt d? -3 Let i(f) be the second derivative of f*5/20 - 5f*3/3 + 9f. Find the second derivative of i(h) wrt h. 6h Let f(s) be the second derivative of s9/15120 + s5/40 + s4/6 - 2s. Let w(v) be the third derivative	{ "pile_set_name": "DM Mathematics" }
8o - 29 wrt o. 413590872o*2 What is the first derivative of -2264088j*3x - 90jx*2 + 504457426x*2 wrt j? -6792264j*2x - 90x2 What is the derivative of 2c*3 - 1946488c*2 + 3c - 13609262 wrt c? 6c2 - 3892976c + 3 What is the second derivative of 65d2t*3 + 165d*2t*2 - 5dt3 + 818158t*3 wrt d? 130t*3 + 330t*2 What is the first derivative of -54778857v*3 - 26167646? -164336571v*2 What is the derivative of -2d*3 + 1692319d*2 - 3d + 7639760 wrt d? -6d2 + 3384638d - 3 Differentiate -4f3x - 12f3 - 1440f*2x + 2f2 - 337fx + 1426f + 36 with respect to x. -4f3 - 1440f*2 - 337f What is the third derivative of -152906122u5 - 175235519u*2 wrt u? -9174367320u*2 Find the second derivative of 82411845k*2 + 49709654k. 164823690 What is the second derivative of 37k2v2 - k2v - 82059k*2 - 53kv2 - 3kv - 2k - 5271v2 + 8v wrt k? 74v2 - 2v - 164118 What is the third derivative of -4i6 - 10937874i*4 + 128016195i*2 wrt i? -480i*3 - 262508976i Find the second derivative of -79981078n2t2 - n2 - 183nt - 4n + 2t - 5574 wrt t. -159962156n2 What is the second derivative of -415732743b*3x*2 + 147b*3 + 7b*2 - 423x wrt x? -831465486b3 Find the second derivative of 213a*3b*2 + 7a*3bx + 986a*3b + a*3x + 12a2b*2x - 8a + 4111b*2x + bx + 19b wrt b. 426a3 + 24a*2x + 8222x Find the second derivative of 5274110h*5 - 3h*2k - 80hk - 7h - k + 723 wrt h. 105482200h*3 - 6k Find the third derivative of -132540937f5 + 7078f*2 - 2f - 1599. -7952456220f2 Find the second derivative of 51225899u*5 - 8114u - 1531. 1024517980u3 Differentiate -1699q*2x*2 - 12112q*2 + 33081843x*2 + 1 wrt q. -3398qx2 - 24224q What is the third derivative of m*4r - 10131830m3r + 16m2r + 21m - 13r - 2 wrt m? 24mr - 60790980r What is the third derivative of 2w*4 + 135319522w*3 + 175w*2 + w + 37820 wrt w? 48w + 811917132 Find the third derivative of 88224019jl*3 - jl*2 + 43jl + j + 4l*2 - 6679 wrt l. 529344114j Differentiate -175477650v + 180599719. -175477650 What is the second derivative of 83785867q*4 - 4q*2 - 1563290q + 130? 1005430404q2 - 8 What is the second derivative of -214020169aj2 + 222328053aj wrt j? -428040338a What is the third derivative of -14163009r3 - 1242320r*2 wrt r? -84978054 Differentiate 50800738mv - 413231314m with respect to v. 50800738m What is the first derivative of 23c*3p - 1905c3 - 211c*2 + 1358cp2 + cp - 5c - 17p*2 wrt p? 23c*3 + 2716cp + c - 34p Find the first derivative of -2x3z - 2045090x3 - 157005808x*2z - 3x2 - 4x wrt z. -2x3 - 157005808x*2 Find the third derivative of -87885483z*3 + 2659z*2 + 20z - 1728. -527312898 What is the third derivative of 3b3g*3 + 54b*3g*2 + 918b*3 - 662b*2g*3 + 9b*2g - 39bg*2 wrt b? 18g*3 + 324g2 + 5508 What is the second derivative of -c2m3 - 7782543c*2m2 - c2 - 7036cm - 2309m3 wrt c? -2m*3 - 15565086m*2 - 2 Find the first derivative of -426i*3ry - i3y + 19i2y + 8392iy - 983r2y wrt r. -426i3y - 1966ry Find the third derivative of -19k6 + 9184k*4 - 3365020k*2. -2280k*3 + 220416k Find the first derivative of q*2y - 13189q2 - 14qy - 131q - 4511y wrt y. q2 - 14q - 4511 What is the first derivative of 9990799d2 + 78344214? 19981598d What is the first derivative of -144045702t + 127414040? -144045702 Find the second derivative of 139576679c*2k*2 - 7c*2k + 7c2 - ck + 4c - 97k - 6 wrt k. 279153358c2 What is the derivative of -102550h*4 - 10h*2 + 11303074? -410200h*3 - 20h What is the derivative of -28288596dfn + 34dfs - 57df - 41ds + 10fns + 3fs + 2f - s - 2 wrt n? -28288596df + 10fs What is the second derivative of 205383862n4 - 2n*3 - n - 171693859? 2464606344n*2 - 12n Find the second derivative of -390326fm*2 + 3fm + 5f - 107m3 - 1205726m + 1 wrt m. -780652f - 642m Find the second derivative of 124392588g2 - 81549450g wrt g. 248785176 Find the third derivative of -350461lp*3 + 4050lp2 - lp - 55p3 - p2 + 1341p wrt p. -2102766l - 330 What is the second derivative of 1690z*5 - 9422z*3 + 62261285z wrt z? 33800z3 - 56532z What is the derivative of -3263282o3y*3 - 29y*3 + 26134 wrt o? -9789846o*2y*3 Find the third derivative of -93766287v*6 + 343946975v*2. -11251954440v*3 What is the first derivative of -727406185b - 1075549739? -727406185 Find the second derivative of 1778327z4 + 21383865z. 21339924z2 What is the second derivative of 143113546u*3 - 1853598u - 14? 858681276u What is the first derivative of 859c*2 + 1102cz - 2z + 10291970 wrt c? 1718c + 1102z What is the second derivative of 614l2mx - 2l*2m - 3l2x + 1943l2 - lx + 11530417l + mx wrt l? 1228mx - 4m - 6x + 3886 Find the first derivative of 1871h3z - 1604191h3 - 9h*2z - hz - h - 2z - 2 wrt z. 1871h3 - 9h*2 - h - 2 Differentiate 82682566f + 114284466. 82682566 What is the derivative of h*3 + 365h*2 - 1729h - 1695730 wrt h? 3h2 + 730h - 1729 What is the third derivative of -763bot3 + 6bt4 - bt*2 - 4bt - 8b - 22ot*4 - 3ot2 + 5ot - 3t*2 wrt t? -4578bo + 144bt - 528ot What is the second derivative of 298737h*2j*2 - 31h*2j - hj2 - 4372878hj wrt h? 597474j*2 - 62j What is the second derivative of -2782j2u*2 - 14393j*2 + 2ju2 - 122122j + 7u2 - 2u + 6 wrt j? -5564u2 - 28786 Find the third derivative of 10652l*3q*2 + 2l*3q + 8025l3 - 3l*2q*2 - 26154l*2 + 6lq + 2q*2 wrt l. 63912q*2 + 12q + 48150 Differentiate 384888068s - 141839712 with respect to s. 384888068 Differentiate 116672048h + 206225726 with respect to h. 116672048 What is the third derivative of -37w5 - 2354w*4 + 60w*3 + 1348302920w*2 wrt w? -2220w*2 - 56496w + 360 Find the second derivative of -42443537s5 - 34747452s wrt s. -848870740s3 Differentiate -617f*3 + 254f*2n*2 + 8fn + 48n*2 - 15427 with respect to f. -1851f*2 + 508fn2 + 8n What is the second derivative of -21915159b2 - 633b - 771? -43830318 Differentiate -3990962j2k*3 - 2j*2 - j - 18k*2 + 1639549 with respect to k. -11972886j*2k*2 - 36k What is the second derivative of -110j3l*2 + 186j*3 + 4910j*2l*4 - 12544jl wrt l? -220j*3 + 58920j*2l*2 Differentiate -144869n*2 - 694n - 465399761 wrt n. -289738n - 694 Find the second derivative of -118885630c*2 - 11395c + 4964 wrt c. -237771260 Find the third derivative of -897941395w6 - 6w*2 + 20786w + 813. -107752967400w3 Differentiate 2a*2t*2 - 210at2 - 696a - 31t2 + 1101t - 3 wrt a. 4at*2 - 210t*2 - 696 What is the second derivative of -55n*3 - 87374n*2 - 1085366n + 4 wrt n? -330n - 174748 What is the first derivative of -45m*3 + 353715m*2 + 17233193? -135m*2 + 707430m What is the second derivative of 6477by*3 - 5by2 + by - 3b - 2y*3 + 12y*2 + 105375y - 3 wrt y? 38862by - 10b - 12y + 24 Find the third derivative of 6463548w6 + 5187261w*2 wrt w. 775625760w*3 What is the derivative of -193394p*2x*2 + 7p*2x - 3465p2 + 289p - 2x wrt x? -386788p*2x + 7p2 - 2 Differentiate -3925d*3m + 7d3 + 2d*2m + 39848d2 + 24dm wrt m. -3925d*3 + 2d*2 + 24d What is the second derivative of -11947918j2 - 13662107j wrt j? -23895836 What is the second derivative of 2533347y3 + 4y + 727109? 15200082y Find the first derivative of 3771467k + 15521282. 3771467 What is the first derivative of 10649604f4 - 7f + 85552638? 42598416f3 - 7 What is the first derivative of -3c*3w - 8053836c2 + 443564w + 72 wrt c? -9c2w - 16107672c What is the second derivative of -8287mo3 - 10mo2 - 2mo - 3246m - 14o4 - o - 4 wrt o? -49722mo - 20m - 168o2 What is the second derivative of -3857q*4 - 1444q*3 - 2q*2 - 79686482q? -46284q2 - 8664q - 4 Differentiate -5719526*l - 9050753. -5719526 Different	{ "pile_set_name": "DM Mathematics" }
the third derivative of -353n4 - 109n*2 wrt n? -8472n What is the first derivative of -16489m - 21400 wrt m? -16489 What is the second derivative of -17273k*4 - 18114k? -207276k2 Differentiate -20460p - 2608 with respect to p. -20460 What is the derivative of 190go*2 - 852g + 8o2 wrt o? 380go + 16o What is the derivative of -16i3 - 13i*2 - 4i + 4502? -48i2 - 26i - 4 What is the second derivative of -15hx*4 - 3hx3 + 251hx - x4 wrt x? -180hx2 - 18hx - 12x*2 What is the first derivative of -38j*2 + 19jo3 - 19o*3 - 2o - 13 wrt j? -76j + 19o*3 What is the second derivative of -255o*4 + 421o wrt o? -3060o2 Find the second derivative of -77fh2q*2 - fh*2q + 2fhq2 - 8fq2 - 5f + h*2q*2 wrt h. -154fq2 - 2fq + 2q*2 Find the second derivative of 3a*4b + 483a3b*3 + 109ab3 - b3 - 2b wrt a. 36a2b + 2898ab3 Find the first derivative of t2u2 - 12tu2 + 278u*2 + 1 wrt t. 2tu2 - 12u*2 Find the third derivative of 1349m*3 + 2m*2 + 830m. 8094 Find the third derivative of -1782c5 - 2c*3p - 2c2 + 56cp - 2c - 2p wrt c. -106920c*2 - 12p What is the derivative of 6j4 + 585j*3 + 6943 wrt j? 24j*3 + 1755j*2 Differentiate -11813m*4 + 2m*3 - 11130 wrt m. -47252m*3 + 6m*2 Find the third derivative of 149b*3 - 2b*2 + 93. 894 Find the second derivative of 3i*2o2 + i2oy + 3i2o - io3 - 3io2y - 2o + 3 wrt o. 6i*2 - 6io - 6iy Differentiate 11lq3 - 26l + 589q3 with respect to l. 11q*3 - 26 Find the second derivative of -48n*3y*2 + 90n*3y - 22ny*2 + 20y*2 + 1 wrt n. -288ny2 + 540ny Find the third derivative of -4i*6j + 7i3j*2 + 12i*3 + 5i*2j*2 + 5ij2 + 4ij wrt i. -480i*3j + 42j2 + 72 Find the third derivative of -11d*4m + 3d4 - d3 + 4d*2m - 38dm wrt d. -264dm + 72d - 6 What is the first derivative of -r2y*2 - 213r*2y + 4r2 + 18 wrt y? -2r*2y - 213r2 What is the first derivative of 1632u*4 - 5786? 6528u*3 Find the first derivative of 676v*3 + 140 wrt v. 2028v*2 Find the second derivative of 2a*2h*2r*2 + 54a*2r*2 + 3ah2 - ar*2 - 2h*2 + 21hr wrt a. 4h*2r*2 + 108r*2 Find the third derivative of 10s4 - s3x - s2 + 2sx + 17x wrt s. 240s - 6x Find the first derivative of -149l2 + 15l - 19939. -298l + 15 Find the first derivative of 4048f*2 + 1033 wrt f. 8096f Find the second derivative of -j*4 + 117j*3 + 184j - 1. -12j2 + 702j Find the second derivative of b*5 + 510b*2 - 505b + 1. 20b3 + 1020 What is the third derivative of -117t*4 - 83t*2 - 2 wrt t? -2808t What is the derivative of -36ix - 30i - 2 wrt x? -36i Find the first derivative of -33fh*2m + 12fm + h*4m + 12m wrt h. -66fhm + 4h3m Find the first derivative of -2g4 + 20g*3 - 2g - 6012 wrt g. -8g3 + 60g*2 - 2 What is the first derivative of 56b*3 + 64 wrt b? 168b*2 What is the derivative of 2rz2 + 41r - 24z2 - 3 wrt z? 4rz - 48z What is the second derivative of g*4 + 11g*3 - 616g + 2 wrt g? 12g2 + 66g Find the first derivative of -119b3v - 650b3 + 19v wrt v. -119b3 + 19 Find the third derivative of 485c*6 + 3046c*2. 58200c*3 What is the second derivative of 20k*3p*2 + 29k*3 + 22kp - 12p*2 wrt p? 40k*3 - 24 Find the second derivative of 10a*2s*2 + 13a*2sx + 7a*2x*3 + 2a2 - s3x + 6s*2x*3 wrt s. 20a*2 - 6sx + 12x*3 Find the first derivative of 197c*4 - 1161 wrt c. 788c*3 Find the third derivative of -5fw4 + 6fw3 - 52f - w*3 - 2w*2 wrt w. -120fw + 36f - 6 What is the second derivative of 19b2g3 + b2g2 - 5b*2g - 3bg*3 - 7b - 2g wrt g? 114b*2g + 2b2 - 18bg What is the third derivative of 294m5 + m2 + 41 wrt m? 17640m2 Find the second derivative of 9tu3 - 44tu2 - tu - 36t + 2u3 + u2 - 3 wrt u. 54tu - 88t + 12u + 2 Differentiate cp2wx2 + 10cpx*2 - cwx - 2cw - 4p*2 - 6wx2 - 2w wrt p. 2cpwx*2 + 10cx2 - 8p Find the second derivative of -4c3hv3 - 88c*3hv2 - 53c*3hv + 3c*2hv - c2v wrt v. -24c3hv - 176c*3h What is the first derivative of 193n4 + 17n*3 + n - 14606? 772n*3 + 51n*2 + 1 What is the first derivative of -165a*2 - 112? -330a What is the third derivative of -l*3t*2 - 6l*3x2 + l3x - 11l*2t*2x*2 - 5ltx*2 - 1 wrt l? -6t*2 - 36x*2 + 6x Find the third derivative of 7dl*3 + dl*2 - 901l*3 - 228l*2 - 2l wrt l. 42d - 5406 Differentiate -11a*3jl - 13a3 - a2 + 8aj - l wrt j. -11a3l + 8a What is the third derivative of -2190l*3 + 30l*2 - 5l - 3? -13140 Find the first derivative of 106r4 + 470. 424r*3 What is the second derivative of 35p*3v*2 - 2p*3v + 2p2v*2 - 303pv2 + 1 wrt p? 210pv2 - 12pv + 4v*2 What is the first derivative of 1209jy3z - 3jy*2 - 3jyz + 3jy - 8y3 + 1 wrt z? 1209jy3 - 3jy Differentiate dl*2r + 20dr - 3l4r - 50l2r - 7 wrt l. 2dlr - 12l*3r - 100lr Find the second derivative of -17p2w*4 + 115p*2w - p*2 - 4p - 91w4 wrt w. -204p*2w*2 - 1092w*2 What is the third derivative of -16829j*5 + 29009j*2 wrt j? -1009740j*2 What is the third derivative of 258t*3u*3 + 18t*3u + 2t2u*3 - 4u*2 wrt u? 1548t*3 + 12t*2 What is the third derivative of 27b*3y + 3b3 + 2b*2y + 4by + 17 wrt b? 162y + 18 Find the first derivative of 21f*2r*2 + 4f*2r + 38r2 wrt f. 42fr2 + 8fr What is the third derivative of -1383a*3h + 2a3 + 6a*2 + 3ah + 6h - 5 wrt a? -8298h + 12 What is the first derivative of -8c*3 + 6c - 239 wrt c? -24c2 + 6 Differentiate -2i*2q*3 - 1194i*2 - 125iq3 - 7q with respect to q. -6i2q*2 - 375iq2 - 7 Find the first derivative of 623w + 1240 wrt w. 623 Differentiate 2dr*3 + 38dr2 - 113r*3 wrt d. 2r*3 + 38r*2 What is the second derivative of 45y*5 - 99y wrt y? 900y3 Find the first derivative of -80a*2y*2 - 692a*2 + 6ay4 wrt y. -160a*2y + 24ay*3 Find the second derivative of -46n*5 - 7n*4 + 8n - 898 wrt n. -920n3 - 84n*2 Find the third derivative of -212b*5 - 175b*2 wrt b. -12720b*2 Find the third derivative of -5h*3iy3 - 16h*3y2 - h2iy*3 + 6hiy*3 wrt h. -30iy3 - 96y2 What is the derivative of -i4 + 3i2 - 1866i - 12123? -4i3 + 6i - 1866 Find the first derivative of 12x2 - x + 82. 24x - 1 Find the third derivative of 14j6 - 5j*5s3 - j2s3 + s3 - 5s wrt j. 1680j3 - 300j*2s*3 Differentiate -56j*3m*4 + 5j*3m*3 + 33j3 + j2 with respect to m. -224j3m*3 + 15j*3m2 Find the second derivative of -q3 + 52q2 + 301q + 1. -6q + 104 Find the first derivative of 959k*3u + 13k3 - k wrt u. 959k*3 Find the second derivative of 1584g*5 + 1349g - 2 wrt g. 31680g3 Differentiate 5v*3z + 518v3 + 23v*2z with respect to z. 5v3 + 23v*2 What is the first derivative of -531y*3 + y + 443 wrt y? -1593y*2 + 1 What is the second derivative of -10o*5 + 2o*3 + 24o*2 - 2o - 886? -200o3 + 12o + 48 Find the third derivative of 1655c3p*2 - 2c*3p + c*2p + 49cp*2 wrt c. 9930p*2 - 12p Find the third derivative of -l*6 - 498l*5 - 660l*2 wrt l. -120l*3 - 29880l*2 Find the second derivative of -3i*4 + 117i*2 - 1296i - 1. -36i2 + 234 What is the second derivative of -2426c*3j*2 + 7c*3j - 3c3 - 30c*2j wrt j? -4852c3 What is the third derivative of -405y*3 - 598y*2? -2430 Find the third derivative of -27nx4 + 89nx + 2x*6 + 3x*2 - 2x wrt x. -648nx + 240x3 Find the first derivative of 9h*2q - 10hi + 13iq - 28 wrt h. 18hq - 10i What is the first derivative of -ikmr*2 - 2ikr*2 + ik + 2kmr2 - 5kmr + 52mr wrt i? -kmr*2 - 2kr2 + k Find the second derivative of 245o*5 + 56o + 1 wrt o. 4900o3 Find the third derivative of 8f*5z - f*5 - 45f*2z + 2f*2	{ "pile_set_name": "DM Mathematics" }
5i3 - 9i*2 - 15i + 3. Let o(r) = 13r3 - 27r*2 - 45r + 8. Let t(d) = 3o(d) - 8p(d). Give t(-6). -18 Let q(i) be the third derivative of i5/60 + i4/3 + 2i3 + 1499i2. Give q(-2). 0 Let h(i) = i3 + 12i2 + 17i - 24. Suppose 5t = -5g - 65, 2g = -0g - 3t - 29. Let k be h(g). Let m(n) = 4n + 2. What is m(k)? 26 Let v(u) = -u - 8. Suppose 5c + 15 = 0, 2c + 0c = a + 389. Let s = 380 + a. Calculate v(s). 7 Let d(q) = -2q - 26. Let i be (-163 - -196)/(1 - -2). Calculate d(i). -48 Let i(k) = -259k - 21. Let v(h) = 157h + 10. Let u(z) = 3i(z) + 5v(z). What is u(-8)? -77 Let v(z) = 20z + 7. Let s(a) be the first derivative of -3a*2 - 2a + 35. Let o(r) = 7s(r) + 2v(r). What is o(7)? -14 Let b = 60 - -189. Let x(k) = -b + 494 + 17k - 7k*2 - 251. Let w(l) = -3l*2 + 8l - 3. Let p(c) = 5w(c) - 2x(c). Give p(5). 2 Let w(m) = -m*3 + 3m*2 + m + 9. Let x(c) = -6c - 88. Let r be x(-16). Suppose 0 = -j + 4b - r, 14 - 36 = -4j - 2b. What is w(j)? -3 Let k(t) = -t2 + 17t - 44. Suppose -1232 = 9i - 1331. What is k(i)? 22 Let w(n) = -5n - 2. Suppose 0 = -5t + 3z, -4z = -t + 76 - 59. Let m(u) be the first derivative of 5u*2/2 + u + 1. Let q(r) = tm(r) - 2w(r). Give q(2). -9 Let p = 1 + -3. Let z(l) = 31l*2 - 15l - 6. Let a(h) = -13h2 + 7h + 3. Let j(c) = 7a(c) + 3z(c). Calculate j(p). 3 Suppose -5s = -3t - 65, -3t + 2263 = s + 2304. Let z(v) = 2v - 38. Determine z(t). -68 Let p(j) = -110j - 115j - 109j + 9 + 325j - 11j2. What is p(1)? -11 Let m(w) be the third derivative of -w4/4 + w3/3 - w2. Let o be 1/(2/549). Suppose -h - ot - 7 = 0, -4h + 3t = -16 - 1. Calculate m(h). -10 Let z(c) = -18 + 20 - 14c - 13 - 31. What is z(-3)? 0 Let z be -4(-2)/16-4. Let l(a) = 7a3 - 88a*2 - 5a - 3. Let h(r) = 3r3 - 35r*2 - 2r - 1. Let t(b) = 10h(b) - 4l(b). What is t(z)? -6 Suppose -4b + w + 15 = 0, -2w + 1 = -w. Suppose 2x = bi + 372, -5x - 194 = 2i - 2x. Let r = i + 95. Let n(o) = -20o. Determine n(r). -20 Let i(c) = -c + 37. Suppose -13858 = 129x - 586x + 9906. Give i(x). -15 Let r(b) = -14b - 25. Let q(c) = -28c - 64. Let p(j) = -2q(j) + 5r(j). Determine p(5). -67 Let g(t) = -6t + 18. Let c(o) = 12o - 35. Let q(x) = 25x - 73. Let a(s) = -13c(s) + 6q(s). Let i(w) = -7a(w) + 6g(w). Determine i(2). 1 Let u(j) = -j3 + 3j*2 + 4. Suppose 0 = -4d - 144 + 828. Let x = d - 167. Calculate u(x). -12 Let z(t) = -t*2 - 24t - 55. Let x be z(-22). Let r(w) = 17w - 7. Let d(b) = -33b + 13. Let i(u) = xr(u) - 6d(u). What is i(1)? 10 Let n(u) be the third derivative of -u*2 + 33u + 1/6u3 + 0 - 13/60u*5 - 1/12u4. Calculate n(1). -14 Let b be 0 - -3 - 28/(-4). Let r(m) = m2 - 14m + 11. Calculate r(b). -29 Let h(n) be the second derivative of -1/20n*5 + 0 - 1/360n*6 + 0n*4 + 0n*2 + 13/6n*3 + 10n. Let a(o) be the second derivative of h(o). Give a(-4). 8 Let z(f) = -f*2 + 4f - 6. Let g(m) = -m*3 - 2m*2 + 2m. Let d be g(-2). Let j be (12/d)/((-5)/40). Determine z(j). -6 Let u = -1 + 6. Let i be (-36)/(-44) + 4 + 252/(-66). Suppose -5d = un + 14 + i, 3 = d. Let p(o) = o + 5. What is p(n)? -1 Let n(x) = -2x - 9. Let v be n(-6). Let c(m) = -130m3 - 3m*2 - m + 2. Let b(u) = -97u*3 - 3u*2 - u + 1. Let t(k) = -4b(k) + 3c(k). What is t(v)? -22 Suppose 24 = v - 5v. Let x(r) be the first derivative of 7/2r2 - 5r - 1/4r4 + 84 - 5/3r*3. Give x(v). -11 Let f(b) = 42b*3 + 11b*2 - 27b - 51. Let t(c) = -23c3 - 7c*2 + 14c + 26. Let j(i) = -6f(i) - 11t(i). Calculate j(-11). -68 Let g be (-5)/(-10)(-1 + (-2)/(-2)). Let s(o) = g + 5 - 30o*3 - o + 4o*2 + 29o*3. Calculate s(4). 1 Let d(m) = 2m3 - m2 + m. Let p(g) = 7g3 - 10g*2 - 28g + 20. Let v(a) = -3d(a) + p(a). Determine v(10). 10 Let q be 48/(-12)(-3)/2. Let k(n) be the second derivative of -8 - n + 1/2n*2 + 1/6n*3. Determine k(q). 5 Suppose 0 = 60g - 65g + 25, 0 = -2r - g + 9. Let p be 4 - 0/((-9)/(-3)). Let c(k) = -7k + pk*3 - 3k*3 + 2k*r + 5k*2. Calculate c(-8). -8 Let a(p) = 7p - 152406 + 152314 + 3p. Give a(7). -22 Let x(l) = -l + 12. Let z be x(-5). Suppose 4q = -r - z, -2q + 7q + 35 = -4r. Let i = 2 + q. Let a(h) = -9h. Calculate a(i). 9 Suppose 18y + 20 = 23y. Let q be (-3 + (-21)/(-6))/(y/16). Let v(u) = -u*2 - 5u*2 - qu + 523 - 521. Calculate v(-2). -18 Suppose k = -2k - 9. Let a(x) be the third derivative of x6/120 + x5/30 - x4/12 + 2x*3/3 + 2x*2 - 108x - 52. Determine a(k). 1 Let u(j) = 2 - 6 + 2 + 3 - 3j. Let h(f) = -f. Let d(p) = -17h(p) + 6u(p). Suppose -29q = -23q - 36. Give d(q). 0 Let s = 33 - 28. Suppose -18y + 181 - 55 = 0. Let a(m) = 3 - 4m + 7m - y + s. Give a(3). 10 Let j(b) = 94b3 + b2. Suppose -3c + 4r = 27, -2r - 1286 + 1302 = -4c. Calculate j(c). -93 Let i = 7 - 4. Let p(k) be the first derivative of -k3/3 + 3k*2 - 4k + 5931. Calculate p(i). 5 Let x(h) = 6h2 - 5h*2 + 13h - 21h - 23. Let t be x(11). Suppose -15o + to = 10. Let k(l) = 3l*2 + 2l - 2. Give k(o). 6 Let g(w) = 2w3 + 8w3 - w3 + 2w - 1 + 6w3. Let s = -183 + 184. Give g(s). 16 Let p(o) = -o2 + 3o - 4. Let h(d) = 7d*2 - 13d - 57. Let x(w) = h(w) + 6p(w). What is x(6)? -15 Let v(t) = -t3 - 12t*2 - 11t - 13. Let n be 3/9 + 1768/24 + -1. Let k = n + -84. What is v(k)? -13 Let s(x) = x*3 - 6x*2 - 7x + 6. Suppose -4l - 3y = 7, 2y + 7 + 3 = 0. Let a(h) = -h3 - h2 + h + 1. Let j(p) = la(p) + s(p). What is j(-7)? -6 Let g(z) = -z3 + z2 + z + 2. Let d(n) = -5n2 - 17n + 12. Let q = 518 - 522. Let y be d(q). What is g(y)? 2 Let m = -13 + 16. Let n be ((-4)/(-6))/(16/m + -6). Let y be 10-3n/6. Let q(p) = -2p2 + 8p - 3. What is q(y)? -13 Suppose 4a + 322x - 320x = 28, -5a - 5x + 45 = 0. Let n(b) = -b3 + 4b*2 - b + 8. Determine n(a). -22 Let y(b) = 39b - 7. Let p be y(3). Let j = p - 113. Let q be ((-1)/j)/((-8)/96). Let r(v) = -v - 3. What is r(q)? 1 Let z(a) be the first derivative of 3a2 - a + 4. Suppose 7h + 871 + 214 = 0. Let n = h - -157. Give z(n). 11 Let u(o) = 0o - 2o - 12o. Let l be 6 - (0 - (0 - 1)). Suppose -50p = -45 - l. Determine u(p). -14 Let h(x) = -570x - 1702. Let o be h(-3). Let f(k) = k2 + 11k - 148. What is f(o)? 4 Let s be (-9)/36-20 + -1. Let i(x) = s - x3 + 35x*2 - 36x*2 - 6x + 2x - 6 + 3x. Determine i(-2). 4 Suppose f + d = -118 + 126, -2d = -3f + 49. Let n(s) = s*2 - 21s + 103. Calculate n(f). -1 Let j(t) = -511 + 1019 - 507. Let g(z) = -2z - 1. Let q(u) = g(u) + 2j(u). Calculate q(5). -9 Let l(c) = -c + 3. Let a(y) = -y + 12. Let o be (3/(1(-3)/(-14)))/1. Let q be a(o). What is l(q)? 5 Let j be (-21)/14 - 3300/(-8). Let h = j + -415. Let i(o) = o2 - 4. Calculate i(h). 12 Let z(l) = -3l*2 - 27l - 11. Suppose g - 4o - 122 = -127, 25 = -3g + 2o. Determine z(g). -11 Suppose -2t = 3s - 7s - 190, -5s - 251 = 2t. Let j = 52 + s. Suppose n - 17 = jn + 5v, -5v = 25. Let p(z) = z2 - 3z. Determine p(n). 4 Let s(o) be the third derivative of o*6/120 + 7o*5/30 + 2o4/3 + o3 + 3o2 + 50. What is s(-13)? -33 Let d(b) = -b2 - 5b + 15. Let h(c) = 142c + 6398. Let k be h(-45). What is d(k)? -89 Suppose 0 = 169m - 164m - 15. Let c(y) = 3 - 467y*m - 7y*2 + 4 + 236y*3 + 232y*3. Suppose -14 = -o - o. Determine c(o). 7 Suppose 0 = 7i - 4c + 58, 3c + 794 = 3i + 833. Let z(s) = s3 + 4s*2 - 7s - 9. Let g(h) = 2h2 - 3h - 4. Let l(j) = -9g(j) + 4z(j). Calculate l(i). -38 Let b(l) = -4l2 - 14l - 6. Let w(j) = 3j2 + 12j + 5. Let c = -149 - -55. Let p = 92 + c. Let s(a) = pb(a) - 3w(a). Determine s(-8). -3 Suppose -2t - 6t = 48. Let p(a) be the third derivative of -a5/60 + a4/24 - 19a3/6 - 22a2. Let x(i) be the first derivative of p(i). Determine x(t). 13 Let f(c) = -c3 + 12c2 - 10c + 1. Suppose 0 = -3p - 236 + 269. Give f(p). 12 Let q = -227 - -242. Let t(r) = -2 + 11r + 0r - qr. Give t(8). -34 Let n(p) = -2p2 + 13p - 10. Suppose 17h + 29 = -39. Let c(v) = -v2 + 4v - 3. Let b(i) = hn(i) + 11c(i). Calculate b(-4). -9 Let q(z) = -13z3 - 33z*2 + 46z - 20. Let i(o) = 15o3 + 32o*2 - 40o + 24. Let k	{ "pile_set_name": "DM Mathematics" }
2 + 0y wrt y. 128 Suppose 3h - 75 = w, 254 = -4w + 2h - 46. Let p be 20/(-15) - w/9. Find the third derivative of pv6 + 20v*2 - 9811v + 9811v wrt v. 840v*3 Let t(o) = 47o*5 - 9o*2 - o - 7. Let b(g) = 8g*2 + 0g + 7g5 - 54g*5 + 2g + 6. Let f(k) = -7b(k) - 6t(k). Find the third derivative of f(z) wrt z. 2820z2 Let m(n) = 2n - 3 - n*3 + 14n*2 + 0n + 14n. Let t be m(15). What is the second derivative of 3o - o - to + 17o*4 wrt o? 204o*2 Let w(g) = 17g*3 + 81g*2 + 19g + 7979. Let m(t) = 8t3 + 40t*2 + 9t + 3999. Let q(v) = 9m(v) - 4w(v). What is the derivative of q(i) wrt i? 12i2 + 72i + 5 Let b = -6106 - -6106. Let p(f) be the first derivative of 7 + bf - 15/2f*2 - 22/3f*3. What is the second derivative of p(n) wrt n? -44 Suppose -2 = -5j - o, 2j + 10 = 4o - 8o. Let s = j + 15. Find the second derivative of 16 - s + 24m - 15m5 wrt m. -300m*3 Suppose -q + 7 = -2t, 2q - 7 = 2t + 5. Let l be (5436/(-54))/((-1)/(-3) + t). What is the first derivative of 4 + 151j - 14j*3 + 3 - lj + 2j2 wrt j? -42j*2 + 4j Suppose 0 = 24l - 11l. Find the third derivative of -78a2 - 89a*6 - a + 45a*2 + la + 45a2 wrt a. -10680a*3 Let a(j) be the first derivative of 23j*4/6 + 37j*3/6 - 190j + 34. Let g(k) be the first derivative of a(k). What is the second derivative of g(t) wrt t? 92 What is the third derivative of 1 - 2064z2 + 903z*2 - 2083z*3 - 820z*3 + 227z*3 - 576z*3 wrt z? -19512 Let a = 4455 - 4452. Let w(o) be the second derivative of 0 + ao*3 + 7o + 11/6o4 + 0o2. What is the second derivative of w(p) wrt p? 44 Let r(f) be the first derivative of -f6/3 + 203f5 - f4/2 - 235f*2 + 3f + 1750. What is the second derivative of r(j) wrt j? -40j3 + 12180j*2 - 12j Differentiate -2p2 - 2308 - 28696960p + 28698539p + 2p2 + p2 wrt p. 2p + 1579 Let g(h) = -4788h + 612. Let t(w) = -w - 45. Let y(z) = g(z) - 6t(z). Differentiate y(a) with respect to a. -4782 Let r(i) be the third derivative of -12i*2 + 0i*4 - i + 31/60i*6 + 0 + 0i*5 - 43/3i*3. Differentiate r(t) with respect to t. 186t*2 What is the derivative of -129n + 9 + 2 - 1 + 2 - 3 wrt n? -129 Let z(h) be the third derivative of -355h9/36 - h6/60 + 1933h*5/15 - 8h*2 + 4. What is the third derivative of z(g) wrt g? -596400g*3 - 12 Suppose -5q = -36 + 11. Suppose -4y - qy + 45 = 0. Find the second derivative of 4b5 + 11b*5 - 15b - 56by + 22b*5 wrt b. -380b3 Let r(b) = -b2 - 10b - 14. Let h(g) = g3 - g2 + g - 5. Let s be h(0). Let q be r(s). Find the first derivative of 33y*2 - 11 - 4 + 48 - qy*2 wrt y. 44y Let v(g) = 1009g2 + 710g - 12. Let c(o) = -3021o2 - 2131o + 34. Let q(k) = -6c(k) - 17v(k). Find the second derivative of q(a) wrt a. 1946 Suppose -16 = -3i - 5v, 5i - 8v = -10v + 14. What is the derivative of -g2 + 3g*i - 147g + 147g + 1 wrt g? 4g Let g(a) be the second derivative of 147a3 + 17a*2/2 + 1325a. Find the first derivative of g(c) wrt c. 882 Let a(k) be the second derivative of 76k5/5 + k4/6 + 5k*3/3 + 25k*2/2 - 421k. Find the second derivative of a(z) wrt z. 1824z + 4 Let h(b) = 2b*2 - 3b. Let u be h(2). Let a be (52/39)/(u/6). What is the second derivative of -111xa - 6x + 111x4 - 9x*5 wrt x? -180x*3 Suppose 168 = 5u + 2w, 3u + 3w = 4u - 20. Find the first derivative of 20c + u - 79 + 5c + 10c wrt c. 35 What is the derivative of -19963 - 25t + 39190 + 34t2 - 19646 wrt t? 68t - 25 Let q(u) be the second derivative of u6/30 + u4/6 + 1025u3/2 + u2 - u + 198. What is the second derivative of q(a) wrt a? 12a*2 + 4 What is the derivative of 470 - 180b*2 - 175b*2 - 22 - 126b*2 + 739b*2 wrt b? 516b What is the second derivative of 144x + 1 - 13x*2 - 10x*2 + 23x*2 - 2x*2 + 39x*5 wrt x? 780x*3 - 4 Let x be ((-25)/15)/(10/(-84)). Find the second derivative of -5c*2 + xc*2 + 80c*5 - 82c*5 - 4 + 5c + 16c2 wrt c. -40c*3 + 50 What is the third derivative of 283855t*5 - 282160t*5 + 2t*2 - 33 - 76 wrt t? 101700t*2 Let t(i) be the third derivative of -7027i*6/120 - 8531i*4/24 - 1321i*2. What is the second derivative of t(h) wrt h? -42162h Suppose 69 = -4b + 21. Let a be (-1)/(-3)(-2988)/b. What is the third derivative of -83t4 + at*4 - 9t*6 + 4t*2 + 2t*2 wrt t? -1080t*3 What is the third derivative of 2q + 0q - 1649q*2 + 4009q*6 + 4400q*6 - 11773q*6 + 4847q*6 wrt q? 177960q*3 Let a(j) be the second derivative of -6j + 0j5 - 1/15j*6 - 1/6j*7 + 0j*4 + 0 + 9j*3 + 0j*2. Find the second derivative of a(t) wrt t. -140t*3 - 24t*2 Let n(g) = 3975g*3 - g - 4755. Let z(r) = -15985r*3 + 4r + 19019. Let s(k) = -9n(k) - 2z(k). What is the derivative of s(f) wrt f? -11415f2 + 1 Suppose 4g = -8, 4g - 625 = -t + 227. What is the third derivative of -tk*2 - 3k*5 + 56k*4 + 25k*4 - 879k*2 + 2279k*2 - 890k*2 wrt k? -180k*2 + 1944k Let q(p) be the second derivative of -4 - 197/6p3 - 49p + 157p2. What is the derivative of q(a) wrt a? -197 Suppose -4l = -l - 3o - 6, -3l + 5o = -2. Find the third derivative of 55f + lf4 - 243f*2 + 28f*3 + 244f*2 - 2f*4 wrt f. 48f + 168 Let g(q) = -582q - 999. Let r(h) = -1166h - 1997. Let t(l) = 9g(l) - 4r(l). Find the first derivative of t(n) wrt n. -574 Let l(h) be the third derivative of -h*6/120 + 188h*5/15 + 559h*4/8 - 10h*2 + 76h. Find the second derivative of l(b) wrt b. -6b + 1504 Let p be 4/6 + 100/12. Suppose -2k + 2 = 4z, -pz + 4z - 3k = -1. Find the first derivative of -13 - 308c4 - z + 301c*4 wrt c. -28c*3 Let m(v) be the second derivative of 653v*3/3 - 1391v*2/2 + 5v + 171. Differentiate m(u) wrt u. 1306 Let m(c) be the second derivative of 1/4c4 - 11/2c*2 + 0c*3 + 0 + 7/10c*6 + 0c*5 - 21c. What is the first derivative of m(h) wrt h? 84h3 + 6h Let n(a) be the second derivative of 215a4/4 - a3/6 + 6999a*2/2 + 6912a. What is the first derivative of n(h) wrt h? 1290h - 1 What is the third derivative of 526 + 40i2 - 1044 + i4 + 66i3 + 520 + 19i*4 + 2i*6 + 12i wrt i? 240i3 + 480i + 396 Let i(j) be the second derivative of j5/20 - j4/2 - 13j2/2 - 27j. Let o be i(9). Find the first derivative of -236 + o - d*3 - 3d*3 wrt d. -12d*2 Let j be 270/(-450) + 18/5. What is the first derivative of 3520f*2 - 3520f*2 + 221 + 5f - 4fj wrt f? -12f*2 + 5 Let y(z) be the second derivative of -23z*7/14 - 2z6/3 + z4/12 + 49z3 - 43z + 31. What is the third derivative of y(l) wrt l? -4140l2 - 480l Find the third derivative of 462v3 + 4v - 3029v2 - 1 + 933v*3 + 3073v*2 - 3 wrt v. 8370 Let t(j) be the second derivative of -13j5/20 - j3/3 + 36j2 - j + 21. Let i(p) be the first derivative of t(p). Differentiate i(w) wrt w. -78w Let o(s) be the third derivative of -1193s4/3 - 919s*3 - 3s*2 + 1374s. Differentiate o(x) with respect to x. -9544 What is the derivative of 681j3 + 94j + 803 - 361 - 95j wrt j? 2043j2 - 1 Let t(n) = -n2 - 27n - 70. Let i be t(-24). Find the third derivative of 204h*i + 0h + h - 109h3 - 78h*2 - 77h*2 wrt h. -654 Let r be 42/21 - 1-1. Let m be (-4)/(-6) - r/18-74. What is the third derivative of -ms*2 - 14s - 14s5 + 4s*2 + 14s wrt s? -840s2 Suppose 0 = 3r + 3c - 195, -4r + 266 = c + c. Let v = 73 - r. Find the second derivative of -114p2 + 21p - 4p5 - 17p*v + 114p*2 wrt p. -420p*3 Find the third derivative of -8946z + 8946z + 389z3 - z5 + 1161z2 wrt z. -60z*2 + 2334 Find the second derivative of 10 - 19 - 7287h*5 - 1251h + 1902h5 + 7 wrt h. -107700h*3 Differentiate 6971v*4 + 9528v*4 + 7808v*4 - 18355v*4 - 198 with respect to v. 23808v*3 Suppose -9c + 7c - 3 = g, -5g + 33 = -2c. Find the third derivative of -x2 + 225x*g + 2x*4 + 223x*5 + 2x*2 - 61x - 428x5 wrt x. 1200x*2 + 48x What is the first derivative of 1075 - 153 + 1353t + 3696 + 996t wrt t? 2349 Differentiate -459d + 560 + 1164d + 1112d - 504d + 454d wrt d. 1767 Suppose 7h = -	{ "pile_set_name": "DM Mathematics" }
5 + 1). -18w Expand (10 + 2t - 10)(-4 + 5 - 3). -4t Expand (-5 - 2 - 1)(0v - 5 + 1 + 2v). -16v + 32 Expand (15 - 12m2 - 15)(4 + 2m - 4)(-5 + 1 + 5). -24m3 Expand (9g - 11g - 45g)(-3g*4 + 3g*3 - 3g*3). 141g*5 Expand (16v2 - v2 + 10v2)(-2v + v - v). -50v*3 Expand 81g*2 - 10g*3 - 81g*2 - 2g*3 - 2g*3 + 2g3 + g3 + 0g3 + 0g*3 + (-3g + 5g - 4g)(-2g*2 + 1 - 1). -7g*3 Expand (4j*2 + 2j*2 - 5j*2)(-3 - j + 3) + (-17j3 - 16j*3 + 8j*3)(4 - 3 - 2). 24j3 Expand (2 - 2 - 2n)(1 - 4 + 1) - 2n - 4 + 4 + (0 + 3 - 5)(-2n + 4n + 0n). -2n Expand -g3 + 4g3 - g3 + (-2g + 2g + 2g)(6g2 - 4g*2 - 11g*2). -16g*3 Expand -4w5 - w5 + 6w5 + (1 + 7w*2 - 1)(-w3 + w3 - w*3) + (0w + 2w - w)(-2w4 - 3w*3 + 3w*3). -8w*5 Expand 7 + 2t*2 + 5 - 3 + (0 + 2t + 0)(2t - 1 + 1). 6t2 + 9 Expand (u - u - u)(-9u3 - 12u3 - u3). 22u4 Expand (4p*2 - 3p*2 + 2p*2)(-2p + 3p - 5p)(3 - 2 + 1). -24p3 Expand (-4h*3 + 2h*3 + 0h*3)(-2h - 2h + 6h) - h4 - 19h*4 + 9h*4. -15h4 Expand u2 - 2u2 + 3u*2 + ((-4 + 3 - 1)(-u + u + u) - 3u - u + 3u)(4u - 4 + 2 + 9u). -37u*2 + 6u Expand (5u - 15u - 1 - 6u)(-u + 5 - 5). 16u2 + u Expand (-5 + 4 + 2)(57m3 - 57m*3 + 25m*4). 25m*4 Expand (-16 + 4q*2 + 16)(0q + 0q + 2q2). 8q*4 Expand (-5j + 5j - 3j*3)(5j2 + 2 + 0j2 - j2). -12j5 - 6j*3 Expand (-4o*3 + 0o*3 + 3o*3)(-5 - 3 + 6) + 0o3 - 3o*3 + 8o*3. 7o*3 Expand (y - 4y + 2y)(-26y4 + 14y*4 + 15y*4). -3y*5 Expand (1 - 1 + 2 + (0 + 0 - 1)(-3 + 1 + 1))(0 + 4v*2 + 0). 12v*2 Expand ((3 - 2 - 3)(1 - 3 + 7) + 4 - 1 - 2 + 2 + 2 - 5)(-m + 1 + 3 - 3). 10m - 10 Expand (22 - 22 + 4v)(v + 4v - 3v) + 3 - 3 - 2v2 + (1 + 0 - 2)(2v2 + 0v2 - v2) - 2v2 + 0 + 0 - 3v*2 + 3v*2 + 2v*2. 5v*2 Expand (-3j - 2j + 3j)(18 + j2 - 18) + j2 - j3 - j2 + (-1 + 0 + 0)(2 + 2 - 5)(2j3 + j3 - 2j3). -2j*3 Expand -c - 13c*2 + 4c + 21c2 + (-4c + c + 5c)(1 - 1 + c) - 2c2 + 0c2 + c2. 9c2 + 3c Expand -3r2 + 4r2 + r2 - 2r + (1 - 1 - 3r)(2r - r - 2r). 5r*2 - 2r Expand (2m - m - 2m)(3 - 2 - 4 + (3 - 1 + 0)(-7 + 3 + 2) + 1 + 0 - 2 + 5 + 0 - 4 + 2 + 3 - 6 + 3 - 1 - 4 - 4 + 0 + 3 + 3 - 5 + 4) + 7m - m + 2m. 17m Expand (2z*2 + 521 - 269 - 207)(-2z + 4z - 3z). -2z*3 - 45z Expand 0h2 - 4h*2 + 2h*2 + 3h*2 - 4h2 - h2 + (2 + 2h - 2)(-3 + 2h + 3) - 2h + 2h2 + 2h. 2h2 Expand (8 + 10 + 0)(4u - 5u - u). -36u Expand (0o*2 + 2o2 - o2)(2o - 4o + 3o) + 21o2 - 4o*3 - 21o*2 + (-4o*2 - 3o*2 + 4o*2)(o + 4o - 3o). -9o3 Expand (3 + t - 3)(-10t - 3t3 - t3 + 3t3). -t4 - 10t*2 Expand -3t*2 + 4t2 + t2 - 3t4 + (0t - 3t + 2t)(0t3 + t3 + t*3). -5t*4 + 2t2 Expand 1 - r4 - 1 + (-r*3 + 2r*2 - 2r*2)(1589 - 1589 - 56r). 55r*4 Expand (-1 - 2y + 1 + (-2y + 2y + 3y)(-4 - 2 + 0))(-3y + y*2 - 3 + 3). -20y*3 + 60y*2 Expand (22y - 20y - 19y)(-1 - 2 + 2). 17y Expand (1 - 1 - 2)(3 + 3 - 16i - 2). 32i - 8 Expand (-2 - 3z + 0 + z)(-7z*4 - 99 + 99). 14z*5 + 14z*4 Expand (-2 - 2a + 2)(2a*3 - 10a*3 - 8a*3 - 2a + 2a + a3 - a3 + 3 - 3 + (a + 0a - 3a)(a*2 - 5a*2 + 3a*2)). 28a4 Expand ((-h2 + h2 + h2)(-h + h + h) - 2h*3 + 0h3 - h3)(h2 - 3h*2 + 3h*2). -2h*5 Expand (-4y*4 + 6y*4 + 2y*4)(-6y + 5y - 2y). -12y*5 Expand (-2m*4 + 2m*3 - 2m*3)(m + 0 + 0) - 3m5 + 5m*5 - 4m5 + m2 - 2m5 - m2 + 29m*5 - 3m*5 + 27m*5. 47m*5 Expand (-2m4 - m4 + 5m4)(1 - m - 1) - 17m5 + 3m*5 - 21m*5 + 4m*5. -33m*5 Expand ((-50 + 50 - 20k)(k - 2k + 4k) + 2k*2 - 2k*2 + 2k*2)(0k + 3k - 2k)(4 - 1 - 2)(-4k + 2k + 3k). -58k4 Expand 0m3 - m3 + 2m - 4 + 5 + (4 - 2 - 1)(5m2 - 5m2 - m3). -2m3 + 2m + 1 Expand (-1 - 11k3 + 3 + 10k*3)(-k - 3k + 3k) - 3k4 - 4k*3 + 4k*3. -2k*4 - 2k Expand -5x4 + x4 + 0x*4 + 2x*4 + 0x4 - x4 + (2x4 + 0x4 + x4)(0 + 0 - 2). -9x*4 Expand 3k + k - 5k + (-k - 5k + k)(0 - 1 - 2) + (2k + 2k - 2k)(-3 + 5 - 3). 12k Expand (1 - 2 + 2)(k2 - k2 - k3) + k2 - k3 - k2 + 5k*3 - 6k*3 + k - 3k + 4k3 + 2k3 - k3. 2k3 - 2k Expand (t + 3t - 4t*3 - 3t)(-2t*2 + 1 - 16t + 16t). 8t*5 - 6t*3 + t Expand (-2 - 1 + 1)(-1 - 4 + 4 + 1 - 3 + 3 + (-3 + 4 + 1)(-4 + 1 + 2) - 1 + 1 + 2 - 1 - 1 + 4 - 2 + 4 - 3 + 3 - 4 + 3 + 0 + 2 - 3)(3b - 3b - 5b4). 20b*4 Expand 2o*2 - 10o2 - o2 + (1 - 1 + o)(-1 - 2o + 1). -11o2 Expand (-2r - 2 + 2)(-2 - 2 + 3)(-184r - 173r + 317r). -80r*2 Expand (t - 18 + 20 - 7t)(3t + 4t - 3t). -24t2 + 8t Expand 3d - d - 4d + 0d - 5d + 3d + (4 + 2 - 5)(-3d + 4d - 3d) + 5d - 4d + 0d + 0d - d + 8d. 2d Expand (2k - 4k + 3k)(5k*3 + 63k - 63k). 5k*4 Expand 0t*5 + 7t*5 - 6t*5 + 0t*2 + 0t*2 + 3t*5 + (-1 - 3 + 3)(0t3 + 0t3 - t5) + t*4 - 2t5 - t4. 3t5 Expand (-4v + 3v - 2v)(-1 - 2v + v + 2v). -3v*2 + 3v Expand (2 + 4 - 2)(-3 + 0 + 2)(2c - 3c - c). 8c Expand (3m*2 - 3m2 - m2)(4m - 28m - 10m). 34m3 Expand (x3 - x + x)(15 - 14 - 8). -7x3 Expand (1 - 1 + r)(-4r + 4r - r) + 2 - r*2 - 2 + (-3 + 0 + 2)(r*2 - 2 + 2). -3r2 Expand (-1 + 3 - f2 - 3)(-4f*2 + 0f2 + f2). 3f4 + 3f*2 Expand (-1 - 3t - 5 + 4)(-2 - 2 + 1). 9t + 6 Expand (-2 + 2 - 2)(c3 + 0c*3 + 5c*2 - 3c3 + (2 - c2 - 2)(4c - 2c + 0c) + 0c3 + 4c3 + c3). -2c3 - 10c*2 Expand (-y + 0y - y)(0y - 2y - y) - y2 + 2y*2 - 4y*2. 3y*2 Expand (11 - 3 - 2)(-2l2 - 3l*2 + 7l*2) + 0l*2 + 0l*2 - 2l*2 + (-4l + 5l + l)(2 - 2l - 2). 6l*2 Expand ((1 - 3 + 0)(3s - 3s - 2s3) + 0s*3 + 2s*3 + 0s*3)(5s + 1 - 3s + 0s). 12s*4 + 6s*3 Expand (-3 + 1 + 0)(0 - 1 + 2)(-3w*2 + 3w*2 - 2w*2)(2w - w - 4w). -12w3 Expand (q - q + q)(-2q + 2q + q*2)(0q - 4q + 5q). q4 Expand (-2 - 2b*4 + 2)(b - b + 3b) - 2b*5 + 4b*5 - 5b*5. -9b*5 Expand 0 + 1 + 31w*4 - 27w*4 + (-3w*2 + 3w2 + w2)(-w - w2 + w) + 0w4 + w4 + w*4. 5w*4 + 1 Expand (3 - 1 - 4)(-3z + 0z + z) + 0z + z + z - z - 4z + 3z - z + 4z - 2z + (z - z + 2z)(-2 - 3 + 3) + 7z - 17z - 26z. -35z Expand (3g - g + 0g)(6g + g + 0g + 1). 14g2 + 2g Expand (-3v3 + 2v3 - v3 + 2v4 - 1)(1 - 31 + 1). -58v4 + 58v*3 + 29 Expand ((-3n + 3n - n)(2n + 3 - 3) + 4n*2 + 0n*2 - 5n*2 + 6 - 6 - 6n*2)(-n - n - n). 27n3 Expand (-2 + 0 + 1)(0 - 3 + 1)(5x*2 + 33x*2 + 3x*2 + (-5x + x + 2x)(x + 0x + 0x) + 1 - 1 - 2x2). 74x*2 Expand (48 + 4 + 20)(-o + o - 2o). -144o Expand (3 + 1 - 2)(h + h - 3h)(-6h*3 - 25h*3 + 8h*3). 46h*4 Expand (-118w + 72w + 59w)(3w*2 + 5 - 5). 39w*3 Expand (-27p - 13p + 12p)(2 + 2p - 2) + p*2 - 5p*2 + 3p*2. -57p*2 Expand 5d - d - 2d + (1 - 4 + 2)(-3d + 3d + d)(3 - 5 - 3). 7d Expand (-2 + 2 + 2)(-4h + 0h + 2h) + (-2 + 2h + 2)(-3 - 4 + 6) - 3 + 2h + 3. -4h Expand (-4 + 3 + 2)(-j2 + 3j - 3j) + (2 + 4 - 5)(2j2 - 2j*2 + 2j2). j2 Expand (2w - 2w + 2w4 + 0w4 + w4 - 7w4 + (w3 + 2w*3 - 5w*3)(-w + w + 2w))(-2 + 4 - 1). -8w4 Expand (-4 + 4v + 4)(1 - 4 + 5)(-1 + 4 - 2). 8v Expand (4d - 4d + d4)(d + d + 2d - 2)(-2 - 1 + 0). -12d5 + 6d*4 Expand 0 - 2l3 + 0 + (-l2 - 5 + 5)(-l + 2l + l). -4l3 Expand (0k - 16k - 2k)(2 - k - 2)(4k - 5k + 0k). -18k*3 Expand (2r + 0r + 0r)(1 - 1 + r2) + (r2 + 0 + 0)(-7r + r + 4r) - 2r3 + 2r*2 - 2r2 + r3 + 6r2 - 6r2. -r3 Expand (-50f - 4f*4 + 7f4 - f4)(-3 + 1 + 1). -2f*4 + 50f Expand ((5 + 0 - 4)(1 + 1 - 5) + 1 + 0 - 3)(-3 + 3 - 2f). 10f Expand (-2 + 4 + 5)(-v3 - 2v4 + v3) + v*3 + 2v4 - v3. -12v4 Expand (20 + 17a*4 - 8 - 9)(a - 3a + 4a) + 2a5 - a5 - 3a5 + (a2 - 2a3 - a2)(3*	{ "pile_set_name": "DM Mathematics" }
11s. Let a(j) = -29j. Determine a(l(k)). 29k2 Let z(g) = 4g*2. Let q be (-2)/(-1)(-2)/(-2). Let n(r) = 7 - 2 - 3rq - 5. What is n(z(s))? -48s4 Let o(k) be the second derivative of k3/3 + 6k. Let s(m) = 3m2 + m - 1. Let z(w) = w2 + w - 1. Let i(n) = s(n) - z(n). Calculate i(o(h)). 8h2 Let k(u) = 317u*2. Let z(p) = 42p. Calculate k(z(d)). 559188d2 Let w(m) = -5m. Let l(j) = -180j. Give w(l(r)). 900r Let i(q) = -5q2 - 6. Let u(z) = 6z*2 + 7. Let m(x) = 7i(x) + 6u(x). Let t(c) = -3c*2. Determine t(m(h)). -3h*4 Suppose -2x + 2p - 9 = -3x, -4x - 5p + 27 = 0. Let m(y) be the second derivative of 0 + 2y + 0y*2 - 1/3y*x. Let o(k) = -4k*2. Determine o(m(j)). -16j*2 Let m(f) = -f. Let t(c) = -6c. Let d(n) = -11m(n) + 2t(n). Let l(h) = -h*2. Let j(z) = -3z*2. Let q(g) = -4j(g) + 10l(g). Give q(d(w)). 2w*2 Let o(f) = 14f*2. Let n(d) = -5d*2. Let r(y) = -8n(y) - 3o(y). Let x(a) = 13a. What is r(x(w))? -338w2 Let h(a) = -a. Let v(x) be the second derivative of 8/3x*3 + 0x*2 + 3x + 0. Calculate v(h(u)). -16u Let l(o) = 2o - 1. Let f(j) = 12j2. Determine f(l(k)). 48k*2 - 48k + 12 Let n(i) = i*2. Let v(c) = 33c*2. Calculate n(v(m)). 1089m*4 Suppose 0 = -0m - 2m + 12. Suppose -4f - 4r + 8 = -5r, 6 = 3f + r. Let w(i) = -fi*2 + mi - 6i. Let b(p) = -2p*2. Determine b(w(s)). -8s*4 Let n(z) = -262z*2 + 2. Let t(l) = 15l*2. Give n(t(f)). -58950f*4 + 2 Let r = 0 - -4. Let k(h) = -rh + 3h + 2h - 2h. Let c(b) = -5b. Determine c(k(g)). 5g Let t(w) = w + 3. Let q(h) = 4h + 11. Let i(r) = 6q(r) - 22t(r). Let f(p) = 8p + 11p - 9p. Calculate i(f(g)). 20g Let s(b) = b. Let g(l) be the third derivative of l6/360 - l3/3 + 3l2. Let k(d) be the first derivative of g(d). Determine s(k(o)). o2 Let x(v) be the first derivative of -19v*3/3 - 42. Let m(k) = -2k*2. Calculate x(m(l)). -76l*4 Let m(z) = -17z. Let x(d) = 77d - 2. Give x(m(v)). -1309v - 2 Let k(m) = m + 9. Let a be k(-7). Let c(d) = -2d - 5d*2 + ad. Let q(r) = 2r. What is c(q(n))? -20n*2 Let p(m) = -2m*2. Let l(s) = -113s. Let y(a) = 75a. Let z(i) = -5l(i) - 7y(i). Determine p(z(k)). -3200k*2 Let r(n) = n. Let y(x) be the second derivative of 19x*3/6 - 2x. Determine r(y(j)). 19j Let i(n) be the second derivative of 3n - 1/6n3 + 0 + 0n*2. Let v(j) = 3j*2. Determine v(i(r)). 3r*2 Let t(f) = -2f + 20. Let o(y) = -6y. Calculate t(o(g)). 12g + 20 Let x(d) = -7d. Let h(k) be the first derivative of -10k*3/3 + 41. Determine h(x(w)). -490w*2 Let b(o) = -3o*2 - 35o. Let g(s) = 2s. Calculate b(g(z)). -12z*2 - 70z Let g(u) = u*3 - 10u2 + 1. Let p be g(10). Let z(d) = 2 - 1 - d - p. Let m(i) be the third derivative of i5/15 - i*2. What is z(m(q))? -4q*2 Let c(n) = n. Let q(z) = -86z*2. Determine q(c(l)). -86l*2 Suppose -3j + j = 4n - 14, 5j = 3n + 9. Let c(r) = -3 - rn + 3. Let i(m) be the second derivative of -2m*3/3 - 11m. What is c(i(v))? -16v2 Let k(j) = -2j + 2. Let q(x) = 4x - 5. Let a(d) = 5k(d) + 2q(d). Let n(r) be the second derivative of -11r*4/12 + 8r - 5. Determine n(a(p)). -44p2 Let t(b) = 140b. Let r(k) = -k. Determine r(t(z)). -140z Let g be (-2)/(6/(-9))-1. Let u be 4 - g/((-3)/1). Let m(n) = -un + 3n + 4n - 5n. Let o(y) = 6y2. Determine m(o(w)). -6w*2 Let l(i) = 2i*2. Let o(d) = -10d + 6d - 1 + 9d + 19d. Give o(l(k)). 48k*2 - 1 Let k(z) = 2z. Let l(p) = 34p2 - p - 2p + 13p2 - 30p*2. Give l(k(q)). 68q*2 - 6q Let o(n) be the first derivative of -11n2/2 + 10. Let y(s) = s. Determine y(o(t)). -11t Let t(k) = 25k. Let w(q) = -41q. Determine w(t(v)). -1025v Let b(s) = 4 - 4 + 0 + s. Let x(f) be the second derivative of -5f*3/6 - 7f. Give b(x(i)). -5i Let q(s) = s2. Let b(j) = -7522j + 1. Determine q(b(w)). 56580484w2 - 15044w + 1 Let n(c) be the first derivative of -11c2 + 71. Let b(w) = -4w. Determine b(n(d)). 88d Let v(u) be the first derivative of -5u3/3 - 6. Let r(p) = -p2. Calculate v(r(a)). -5a4 Let o(f) = f2 - 18f. Let t(a) = 4a. What is t(o(s))? 4s*2 - 72s Let g(v) = 16v2. Let a(b) = 6b*2 + 9b. Calculate a(g(n)). 1536n4 + 144n2 Let h(b) be the first derivative of b2 - 72. Let n(m) = 4m. What is h(n(d))? 8d Let f(d) = -4d2. Let h(u) = -9u - 8. Calculate f(h(r)). -324r2 - 576r - 256 Let p(r) = -17r - 3. Let x(j) = 765j + 136. Let h(y) = 136p(y) + 3x(y). Let o(i) = i*2. Determine h(o(c)). -17c*2 Let a(m) = m - 198. Let l(t) = -6t. Give l(a(n)). -6n + 1188 Let u(v) = 7v. Let j(r) = 4r - 3. Let o be j(2). Let i(z) = -8z. Let g(a) = ou(a) + 4i(a). Let x(n) = -2 + n + 0n + 2. Calculate g(x(p)). 3p Let b(u) = -1164u. Let x(h) = 14h. Determine x(b(c)). -16296c Let c(r) = -19r*2. Let l(i) = 27i*2. Determine c(l(g)). -13851g*4 Let x(r) = 121 - 241 + 120 - 2r*2. Suppose -8a + 5 = -3a, -9 = 5u + a. Let j(s) = -3s. Let y(q) = -q2 - 2q. Let p(n) = uj(n) + 3y(n). Give p(x(k)). -12k4 Let t(l) = 33l*2 + 1. Let c(g) = -33g. Calculate t(c(s)). 35937s2 + 1 Let n(m) be the second derivative of -m4/12 + 11m. Let s(t) = -5t2. Give n(s(c)). -25c4 Let k(p) = p2. Let x(j) = 8j2. Let r(s) = -k(s) - x(s). Let m(d) = 2d. Give m(r(y)). -18y2 Let o(q) be the first derivative of q2/2 + 23. Let j(x) = -3x*2 + 5. Calculate o(j(z)). -3z*2 + 5 Let y(r) = -6r*2. Let g(w) = -25w - 2. Calculate y(g(i)). -3750i2 - 600i - 24 Let n(z) = 2z2. Let m(q) = -11q*2 + 9q*2 - 27q*2. Give n(m(s)). 1682s*4 Let r(z) = -5z*2. Let q(d) = 3d. Determine r(q(b)). -45b2 Suppose 4w - 18 = w. Let z(q) = -4q - 6 + w. Let l(x) = 5x - 4x - 3x + 4x. Calculate z(l(h)). -8h Let v(a) = -28a. Let b(z) = -5z. What is v(b(f))? 140f Let n = -5 + 5. Let k(g) = 0g - g*2 + 4g*2 + ng. Let q(w) = w*2. What is k(q(x))? 3x*4 Let u(w) = -w + 12. Let d(f) = f - 10. Let m(k) = -6d(k) - 5u(k). Let r(a) = -8a. Calculate m(r(g)). 8g Suppose 3q - 3s - 9 = 0, 0 = 2s - 6 + 14. Let i = -1 - q. Let f(z) = -z - z + iz. Let m(h) = -2h. Calculate f(m(r)). 4r Let f(o) = -3o*2. Let z(t) = 58t*2. Calculate z(f(d)). 522d*4 Let w(p) be the first derivative of -4p3/3 - 1. Let q(j) be the second derivative of -j4/12 - j. Calculate q(w(d)). -16d4 Let j(l) = 7l*2. Let t(v) = -2v + 43. Calculate t(j(a)). -14a2 + 43 Let a(r) = -r + 3. Let l(w) = -2w. Determine l(a(c)). 2c - 6 Let v(h) = 2h*2. Let z(u) be the second derivative of 2u*3 + u. Let c(j) = -2j. Let b = 24 - 13. Let t(m) = bc(m) + 2z(m). What is v(t(y))? 8y2 Let f(t) = -t. Let c(s) = 3047s. Calculate c(f(z)). -3047z Let s(o) = 5o*2 + 6o - 6. Let c(r) = -10r2 - 13r + 13. Let f be 12(-1 - 6/(-4)). Let m(w) = fc(w) + 13s(w). Let v(d) = d2. What is v(m(q))? 25q*4 Let i(b) = 2b + b + 0b - 2b. Let m(a) = -15 - 4 + 2 - 8a. Let s(q) = q + 2. Let t(v) = -6m(v) - 51s(v). What is t(i(f))? -3f Let i(o) = -12o2. Let b(q) = -7q - 6. Let j(h) = -20h - 17. Let s(n) = 17b(n) - 6j(n). What is s(i(u))? -12u*2 Let d(k) = -5k + 3. Let w(j) = 2j + 3. Let b(m) = -m - 2. Let p(a) = 5b(a) + 3w(a). Let o(f) = d(f) + 3p(f). Let z(i) = -i*2. Give o(z(y)). 2y*2 Let j(f) = -f. Let b(z) = -5343z*2. Determine b(j(x)). -5343x2 Let i(w) be the third derivative of w6/360 - w*4/8 + 3w*2. Let c(q) be the second derivative of i(q). Let v(r) = -5r*2. Calculate c(v(b)). -10b2 Let t(u) = -u. Let h(z) be the first derivative of -z4/24 + z*2 + 3. Let q(m) be the second derivative of h(m). What is t(q(g))? g Let w(x) = -1. Let a(z) = -z - 4. Let k(h) = a(h) - 4w(h). Let s(q) = -4q. Determine k(s(i)). 4i Let x(z) = -198 + 198 - 4z2 + 5z*2. Let n(w) = 63w. Calculate n(x(c)). 63c2 Let y = -13 - -18. Let q(o) = 2o + o - yo. Let g(v) be the third derivative of v5/15 + 2v*2. Determine q(g(d)). -8d2 Let g(i) be the third derivative of -i6/720 - i4/24 - i2. Let f(z) be the second derivative of g(z). Let m(j) = 4j2. Determine m(f(d)). 4d2 Let l(o) be the second derivative of o3/3 + 3o2/2 - 4o. Let y(s) = s + 1. Let z(p) = l(p) - 3*y(p). Let h(b)	{ "pile_set_name": "DM Mathematics" }
16)/3 Factor 2i5 - 236i*4 - 964i*3 - 1456i*2 - 974i - 244. 2(i - 122)(i + 1)4 Factor b4/2 + 7b3 - 515b*2/2 - 534b - 270. (b - 18)(b + 1)2(b + 30)/2 Find w such that 4w5 + 788w*4 - 1588w*3 + 796w*2 = 0. -199, 0, 1 Factor -5s*2/6 - 2690s - 2170830. -5(s + 1614)2/6 Factor u4/3 - 166u*3 + 61501u*2/3 + 41500u + 62500/3. (u - 250)*2(u + 1)*2/3 Factor 2l*3/7 - 12l*2/7 + 18l/7 - 8/7. 2(l - 4)(l - 1)*2/7 Factor 7q*4/8 - 5q*3/2 - 37q*2/8 + 7q/4 + 3. (q - 4)(q + 1)2(7q - 6)/8 Suppose -3h*2/5 + 1941h/5 - 1938/5 = 0. Calculate h. 1, 646 Determine r, given that 4r5 - 252r*4 - 524r*3 + 252r*2 + 520r = 0. -2, -1, 0, 1, 65 Factor 3y2 - 228y + 4257. 3(y - 43)(y - 33) Suppose -3b2 - 39b - 90 = 0. What is b? -10, -3 Factor -p*3/3 + 13p/3 + 4. -(p - 4)(p + 1)(p + 3)/3 Solve 14h4 + 23h*3 - 11h*2 - 23h - 3 = 0 for h. -3/2, -1, -1/7, 1 Factor 20o3 + 72o*2 - 32o. 4o(o + 4)(5o - 2) Find m, given that 2m4 - 6838m*3/5 + 1558152m*2/5 - 118211616m/5 - 23704704/5 = 0. -1/5, 228 Factor -6g2 - 3255g + 1629. -3(g + 543)(2g - 1) Factor a5 - 7a*4 + 15a*3 - 9a2. a2(a - 3)2(a - 1) Factor 3d3 - 18d*2 + 24d. 3d(d - 4)(d - 2) Let -n4/5 - 11n*3/5 - 2n*2 = 0. What is n? -10, -1, 0 Factor 2f*4/3 + 50f*3 - 788f*2/3 + 320f. 2f(f - 3)(f - 2)(f + 80)/3 Factor d*2 + 11d - 126. (d - 7)(d + 18) Factor -2g*2/11 - 60g/11 - 450/11. -2(g + 15)2/11 What is w in w4/5 + 7w*3/5 + 12w*2/5 - 4w/5 - 16/5 = 0? -4, -2, 1 Factor -s*5 - 8s*4 + 33s3. -s3(s - 3)(s + 11) Factor -2c3 + 32c*2 + 70c + 36. -2(c - 18)(c + 1)*2 Suppose -8z*5/3 - 34z*4/3 + 8z*3 + 136z*2/3 + 32z/3 = 0. Calculate z. -4, -2, -1/4, 0, 2 Factor 5s3 - 60s*2 + 55s. 5s(s - 11)(s - 1) Factor 5i*5 + 120i*4 + 920i*3 + 2400i*2 + 2000i. 5i(i + 2)*2(i + 10)*2 Factor 2q*3 + 706q*2 - 712q - 1416. 2(q - 2)(q + 1)(q + 354) Let -s5 + 81s*4 - 1427s*3 - 8561s*2 - 14448s - 7396 = 0. What is s? -2, -1, 43 What is c in -2c4 - 25c*3/3 - 7c2 + c/3 + 1 = 0? -3, -1, -1/2, 1/3 Factor -u5 - 70u4 - 1225u3. -u3(u + 35)2 Factor -4s*3/7 + 132s*2/7 - 36s + 124/7. -4(s - 31)(s - 1)2/7 Factor h2 - 722h/3 - 241/3. (h - 241)(3h + 1)/3 Determine q, given that -5q*5 - 110q*4 - 90q*3 + 320q*2 + 95q - 210 = 0. -21, -2, -1, 1 Factor 5n4 - 90n*3 + 180n*2 + 2090n + 1815. 5(n - 11)2(n + 1)(n + 3) Solve 2k*4 + 2k*3 - 26k*2 - 50k - 24 = 0. -3, -1, 4 What is l in l*2/3 + 7l/3 - 10 = 0? -10, 3 Determine r so that 2r3 + 26r*2 + 24r = 0. -12, -1, 0 Find b, given that -b*2/2 - 11b/2 = 0. -11, 0 Factor 2j3/11 - 32j*2/11 + 142j/11 - 112/11. 2(j - 8)(j - 7)(j - 1)/11 Determine o, given that 27o*5 - 87o*4 + 18o*3 = 0. 0, 2/9, 3 Factor 2a*5 - 32a*4 + 156a*3 - 224a*2 + 98a. 2a(a - 7)*2(a - 1)*2 Factor 3a*4/5 - 84a*3 + 4410a*2 - 102900a + 900375. 3(a - 35)4/5 Factor -2q*4 - 178q*3 + 934q*2 - 582q - 1692. -2(q - 3)2(q + 1)(q + 94) Determine o, given that 4o*5/3 + 184o*4/3 + 2432o*3/3 + 6872o*2/3 - 812o - 2352 = 0. -21, -4, -1, 1 Solve 2f2 + 8f - 10 = 0. -5, 1 Factor 2y2/23 + 3242y/23. 2y(y + 1621)/23 Factor -5t4 + 30t*3 - 25t*2. -5t*2(t - 5)(t - 1) Suppose -i5 + 89i*4 - 2023i*3 + 1847i*2 + 2024i - 1936 = 0. Calculate i. -1, 1, 44 Find i such that 4i5 + 156i*4 + 1260i*3 - 5292i2 = 0. -21, 0, 3 Let -z2/2 - 223z/2 - 651 = 0. What is z? -217, -6 Let -3h*4 - 30h*3 + 81h*2 + 108h = 0. Calculate h. -12, -1, 0, 3 Factor y*2/3 - 124y + 11532. (y - 186)2/3 Find k, given that k4 + 23k3/2 + 39k*2 + 55k/2 - 25 = 0. -5, -2, 1/2 Find g such that -3g5/2 - 717g*4/2 - 28431g*3 - 737040g*2 + 940800g + 4608000 = 0. -80, -2, 3 Suppose 3j5/2 + 5j*4 - 161j*3/6 - 41j*2/3 + 22j + 12 = 0. Calculate j. -6, -2/3, 1, 3 Factor 5l3 + 380l*2 + 365l - 750. 5(l - 1)(l + 2)(l + 75) Find z such that -45z*3 - 1450z*2 - 320z = 0. -32, -2/9, 0 Factor 5w3 - 1460w*2 - 1465w. 5w(w - 293)(w + 1) Solve r2 - 4660r + 4659 = 0 for r. 1, 4659 Factor 3z5/8 + 39z*4/8 + 63z*3/4 + 87z*2/4 + 111z/8 + 27/8. 3(z + 1)4(z + 9)/8 Suppose 4i5 - 26i*4 + 22i*3 + 46i*2 - 26i - 20 = 0. What is i? -1, -1/2, 1, 2, 5 Suppose 2u2/7 - 24564u/7 + 75423762/7 = 0. Calculate u. 6141 Factor 4q4 - 4q*3 - 24q*2 + 16q + 32. 4(q - 2)2(q + 1)(q + 2) Find t, given that -2t*2/19 - 4874t/19 + 9756/19 = 0. -2439, 2 Determine d, given that 4d5 + 220d*4 + 4288d*3 + 35968d*2 + 133120d + 179200 = 0. -20, -7, -4 Find l, given that 2l3/13 - 36l*2/13 + 154l/13 - 120/13 = 0. 1, 5, 12 Solve 4g2 + 1796g - 5424 = 0. -452, 3 Factor 2x4/3 - 22x*2/3 + 12x - 16/3. 2(x - 2)(x - 1)*2(x + 4)/3 Factor 13w4 + 11w*3 - 2w2. w2(w + 1)(13w - 2) Determine m, given that -10m*3/3 - 56m*2/3 + 98m - 36 = 0. -9, 2/5, 3 Suppose -q*2/4 + 2q - 15/4 = 0. What is q? 3, 5 What is x in x*3 - 43x*2 + 42x = 0? 0, 1, 42 What is t in 4t5 - 12t*4 - 88t*3 + 296t*2 - 300t + 100 = 0? -5, 1, 5 Factor -o*3/5 + 47o*2/5 - 671o/5 + 605. -(o - 25)(o - 11)2/5 Find y, given that 4y*5 - 44y*4 - 12y*3 + 1148y*2 - 1960y = 0. -5, 0, 2, 7 Find t such that -t*3 - 33t*2 - 200t = 0. -25, -8, 0 Factor 12o3 + 76o*2 + 460o/3 + 100. 4(o + 3)(3o + 5)2/3 Suppose -3i*4/4 - 105i*3/4 - 276i*2 - 813i - 720 = 0. What is i? -16, -15, -2 Factor -j*3/10 + 136j*2/5 - 1794j - 38088/5. -(j - 138)*2(j + 4)/10 Factor d*2/3 + 172d/3 + 169. (d + 3)(d + 169)/3 Find t such that -2t*5/5 + 14t*4/5 - 18t*3/5 - 14t*2/5 + 4t = 0. -1, 0, 1, 2, 5 Let n*5/4 - 19n*4/4 - 21n*3/4 + 19n*2/4 + 5n = 0. What is n? -1, 0, 1, 20 Find a such that 18a5 - 176a*4 + 392a*3 + 276a*2 - 410a - 100 = 0. -1, -2/9, 1, 5 Find b, given that b*5 + 10b*4 + 27b*3 + 14b*2 - 28b - 24 = 0. -6, -2, -1, 1 Find p such that -3p3/8 - 3p*2 + 57p/8 - 15/4 = 0. -10, 1 Factor 3y3/2 - 21y*2 - 3y/2 + 21. 3(y - 14)(y - 1)(y + 1)/2 Factor 3u*2/7 - 1716u/7. 3u(u - 572)/7 Let 8t3 + 28t*2 + 28t + 8 = 0. Calculate t. -2, -1, -1/2 Suppose -w*5/6 + 393w*4 - 1571w*3/2 + 1178w*2/3 = 0. Calculate w. 0, 1, 2356 Factor -9x*3/4 - 3x*2/2 + 5x - 2. -(x + 2)(3x - 2)*2/4 Suppose 6b*3/11 - 126b*2/11 + 648b/11 = 0. Calculate b. 0, 9, 12 Suppose i*2 + 71i - 146 = 0. What is i? -73, 2 Factor -w*5/10 - 47w*4/5 - 1238w*3/5 - 1268w*2 - 11968w/5 - 7744/5. -(w + 2)*3(w + 44)*2/10 Factor 8j*3 + 34j*2 - 84j. 2j(j + 6)(4j - 7) Factor 3a4/7 - 228a*3/7 + 4332a*2/7. 3a*2(a - 38)*2/7 Factor 2d*5/5 - 4d*3 + 8d*2 - 6d + 8/5. 2(d - 1)4(d + 4)/5 Determine n so that -2n4/9 + 4n*3 + 86n*2/9 - 40n/3 = 0. -3, 0, 1, 20 Factor 2g3 - 502g*2. 2g*2(g - 251) Factor 220g3 + 665g*2/3 + 5g/3. 5g(g + 1)(132g + 1)/3 Factor 4b5/3 - 32b*4/3 + 32b*3 - 128b*2/3 + 64b/3. 4b(b - 2)*4/3 Find g, given that 2g*3/11 + 56g*2/11 - 194g/11 - 248/11 = 0. -31, -1, 4 Let -26t2 - 138t - 40 = 0. Calculate t. -5, -4/13 Suppose -4w3 - 4w*2 + 144w + 144 = 0. Calculate w. -6, -1, 6 Factor 3j2 + 3j. 3j(j + 1) Find z, given that 5z2 + 110z - 375 = 0. -25, 3 Let 3o4/7 + 318o*3 + 417351o*2/7 + 234684o + 1633932/7 = 0. What is o? -369, -2 Determine r so that -15r5/4 - 4191r*4/4 - 9117r*3/2 - 5781r*2 - 1650r = 0. -275, -2, -2/5, 0 Factor -2v2/7 - 2668v/7 - 889778/7. -2(v + 667)2/7 Suppose m4/5 + 11m*3/5 - 12m*2 = 0. What is m? -15, 0, 4 Factor 2a*3/15 - 578a*2/15 + 572a/5. 2a(a - 286)(a - 3)/15 Let 2b*4 - 30b*3/7 - 108b*2/7 + 16b/7 = 0. Calculate b. -2, 0, 1/7, 4 Let -3w2 - 75w + 162 = 0. Calculate w. -27, 2 Factor -447t2 - 1338t + 9. -3(t + 3)(149t - 1) Suppose 3w*3/5 - 54w*2/5 - 3w/5 + 54/5 = 0. Calculate w. -1, 1, 18 Determine u so that -315u4 - 785u*3 - 170u*2 + 260u - 40 = 0. -2, -1, 2/9, 2/7 Factor -4a3 + 16a*2 + 124a - 280. -4(a - 7)(a - 2)(a + 5) Solve -2p**2/7 + 265	{ "pile_set_name": "DM Mathematics" }
*2 - 8459o + 1. Give b(y(j)). -20j2 + 42295j - 5 Let u(n) = n*2. Let i(c) be the third derivative of -13c7/560 + c6/720 + 7c5/20 + 101c*2. Let q(h) be the third derivative of i(h). Give q(u(s)). -117s*2 + 1 Let x be 1 - (-4 + 1 + 0 + 1). Suppose -3 - 17 = -4n + 2o, -4n = -xo - 20. Let y(s) = -4s*2 - ns*2 + 3s2 + s2. Let r(t) = 6t. What is y(r(j))? -180j*2 Let m(p) = p + 2. Let i(b) = 2b + 104. Let c(t) = i(t) - 4m(t). Let r(o) be the second derivative of -o4/12 + 35o. Give c(r(y)). 2y2 + 96 Let f(j) = -206j + 10. Let u(n) = -237n + 269n + n*2 - 32n. Give u(f(z)). 42436z2 - 4120z + 100 Let a(b) be the first derivative of 2b3 + 1. Let c(n) = 1. Suppose 253t = 259t + 36. Let r(y) = -3y - 6. Let d(o) = tc(o) - r(o). What is a(d(v))? 54v*2 Let t(q) = 5q*2 + 9q. Let n(b) = 4 - 27 + 15 + 25b + 11. Give t(n(z)). 3125z*2 + 975z + 72 Let n(z) = -21z. Let q(i) be the second derivative of i5/60 - i3/3 + 119i*2/2 + 107i. Let t(o) be the second derivative of q(o). Determine t(n(w)). -42w Let z(v) be the third derivative of 0v*4 - 40v*2 + 0v + 4/15v5 + 0 + 0v*3. Let c(x) = 5 - 5 + x. Give c(z(n)). 16n*2 Let x(c) = 183c*2. Let u(l) = 2032598l + 1 - 1 - 2032600l. What is x(u(m))? 732m*2 Let s(y) = -y - 13. Let x(m) = -19m + 494. Let v(a) = -38s(a) - x(a). Let r(w) = 5w. Give v(r(f)). 285f Suppose 4s - 22 = -14. Let q(f) = -4 + 4 - 3fs. Let k(d) = 17d*2. Calculate q(k(x)). -867x4 Let c(k) = k2. Let i(v) be the second derivative of 2v2 + 0v*3 - 15v - 1/8v4 + 0. Let x(s) be the first derivative of i(s). What is x(c(h))? -3h*2 Let m(s) = -102 - s + 45 + 57. Let j(g) = -3g*2 + 229g. What is j(m(w))? -3w2 - 229w Let s(p) = 105p2. Let h(l) be the third derivative of 14l*5/15 + 1372l*2. Determine h(s(q)). 617400q*4 Let a(i) = -46i + 22. Let x(b) = -2b + 1. Let l(z) = -3a(z) + 66x(z). Let o(s) = -44s - 6. Determine o(l(r)). -264r - 6 Let w(g) = 3g*2. Let f(q) = 15. Let l(y) = -5y + 59. Let u(d) = -18f(d) + 4l(d). Calculate w(u(a)). 1200a2 + 4080a + 3468 Let b(d) = -2d2. Let g(m) = 922m - 3756 + 3758 + 4390m. Give b(g(a)). -56434688a*2 - 42496a - 8 Let j(c) = -91c. Let o(b) = 1315177b*2. Give j(o(a)). -119681107a2 Let b(a) be the third derivative of a4/12 - 3a2. Let j(m) = -2725m*2 - 2580m*2 + 7585m*2 - 2628m*2. Calculate b(j(d)). -696d*2 Let r(f) = 714f. Let g(l) = -12l - 15. Let t(v) = 7v + 9. Let n(d) = 3g(d) + 5t(d). What is n(r(o))? -714o Let x(s) = 14s + 2. Let z(w) = -w + 1. Let d = -64 - -65. Let u(i) = dx(i) - 4z(i). Let p(k) = 3k. What is p(u(m))? 54m - 6 Let b(d) = 22d. Let h = -172 - -167. Let z(t) = 14t. Let r(y) = hb(y) + 8z(y). Let v(c) = 2c - 41. What is r(v(a))? 4a - 82 Let f(c) = -c + 1. Let y(s) = -9s + 6. Let w(l) = 6f(l) - y(l). Let g = -8 - -14. Let v(k) = 242 - gk - 242. What is v(w(m))? -18m Let l(o) = -3 - 72o + 131o + 144o2 - 59o + 565o2. Let r(y) = 2y. What is r(l(d))? 1418d2 - 6 Let t(d) = -d2. Let z(b) = -355268b + 15. Calculate z(t(r)). 355268r2 + 15 Let n(z) = 5z*2 - 48. Let o(h) = -5h*2 + 36. Let a(k) = 3n(k) + 4o(k). Let u(b) = -7b*2 - 3b. What is u(a(j))? -175j4 + 15j*2 Let m(s) = 3s. Let l(n) = -54935454n2. Give l(m(w)). -494419086w*2 Let k(w) = 12w2 - 32. Let j(f) = -f2 - 14f + 203. Calculate j(k(a)). -144a*4 + 600a*2 - 373 Let i(u) = 2u. Let h(a) be the third derivative of 19a5/15 + 54a*2 + 2. Determine i(h(s)). 152s*2 Let a(b) be the third derivative of -11b*5/30 + 392b*2 - 2b. Let d(f) = -141f2 + 1. Calculate a(d(v)). -437382v*4 + 6204v*2 - 22 Let j(p) be the first derivative of 346p*3 - 2p - 969. Let g(k) = -k*2. Calculate g(j(b)). -1077444b*4 + 4152b*2 - 4 Let n(m) = -12m*2. Let k(x) = -11x + 2. Let i be k(0). Let s(q) = 3q2 - 721q + 721q + 4q*i. Determine s(n(j)). 1008j*4 Let f = 657 + -657. Let u(j) = fj + 0 - 9j - 6j + 0. Let s(a) = 3a + 4. Let z(t) = -t - 1. Let r(h) = 3s(h) + 12z(h). Calculate u(r(q)). 45q Let n(c) = 48c2. Let y(k) = 39142k. Calculate y(n(z)). 1878816z2 Let m(o) = -13 - 8 + 4 + 6o - 2 + 19. Let q(x) be the first derivative of 2x3/3 - 11x*2/2 + 2. Determine q(m(z)). 72z*2 - 66z Let l(h) = -15619h - 4. Let z(q) = 10q. Give l(z(m)). -156190m - 4 Let m(t) = t2 + 2t. Let a(w) = -9w2 - 8w*2 - 21w*2 + 24w*2. What is m(a(s))? 196s*4 - 28s*2 Let s(t) = -1227t*2. Let h(d) = 3d*2 - 10d - 11. Determine h(s(u)). 4516587u4 + 12270u*2 - 11 Let q(v) = 15v. Let l(o) = 51o + 515. Give q(l(y)). 765y + 7725 Let j(k) = -357638k2. Let g(t) = 11t*2. Determine g(j(n)). 1406954329484n*4 Let z(i) be the first derivative of -227i*3/3 + 2365. Let a(c) = -2c*2. Give z(a(u)). -908u*4 Let u(v) = 14v*2 + 3v. Let c(t) = 2923t + 1422. Let j(x) = 136x + 66. Let s(l) = -11c(l) + 237j(l). Give u(s(i)). 87374i2 + 237i Let q(h) = 8h2. Let o(j) = -571997j*2. Calculate o(q(s)). -36607808s*4 Let l(r) = 15r. Let b(y) = -76964y - 9. Calculate l(b(o)). -1154460o - 135 Let d(k) = 0k + k + 0k + 2k. Let y(w) be the first derivative of 0w - 78 + 1/2w2. Calculate d(y(o)). 3o Let q(i) = -94i + 2. Let s(n) be the first derivative of -n5/60 + 31n*2/2 - 73. Let r(k) be the second derivative of s(k). What is q(r(z))? 94z2 + 2 Let d(q) be the third derivative of q8/10080 + 11q5/30 + q3/6 + 52q*2. Let l(z) be the third derivative of d(z). Let m(c) = -103c. Determine l(m(s)). 21218s2 Let x(o) = -2o. Let j(y) = -147y + 58360. Determine j(x(p)). 294p + 58360 Let l(z) be the second derivative of z4/3 - z2 + 16z. Let v(s) be the second derivative of s3/3 + 110s. Calculate l(v(i)). 16i2 - 2 Let o(i) = 19i. Let a(c) = -3c2 + 8c - 20c - 29c*2. Let j be (-44)/20-5 - 6. Let w(y) = 13y2 + 5y. Let b(n) = ja(n) + 12w(n). Determine b(o(m)). -1444m2 Let v(o) = 2o*3 - 5o*2 + 8o - 12. Let k be v(4). Let l(x) = -5x2 + k - 137 + 69. Let g(m) = 5m. Calculate g(l(n)). -25n2 Let p(z) = -2z. Let i = -6173 - -10248. Suppose -2n + 2k + i = 3n, 2n - 3k - 1630 = 0. Let u(y) = -18y - 815 + n. Calculate u(p(c)). 36c Let u(s) = 3s2. Let v(j) be the first derivative of -j2 - 15j + 66. Give u(v(i)). 12i*2 + 180i + 675 Let x(d) = -5d2 - 7648 + 3820 + 3828 - 20d2. Let t(l) be the first derivative of l2 - 2. What is x(t(m))? -100m2 Let z(j) = -2j*2 + 54j. Let f(d) be the first derivative of 2d3/3 - 1040. Calculate z(f(t)). -8t*4 + 108t*2 Let u(s) = 7s*2. Let j(c) = 9445c*2. Give u(j(k)). 624456175k*4 Let u(p) = 2p. Let c(s) = -141s + 388463. Determine u(c(h)). -282h + 776926 Let h(g) = 302g. Let y(o) = -11707o. What is y(h(l))? -3535514l Let f(d) = d2 - 20d. Let z(i) = 4i - 52541. What is z(f(b))? 4b*2 - 80b - 52541 Let x(m) = 3m. Suppose q - 83 = 277. Let u = q + -196. Let h(d) = -ud + 78d + 86d + 45d2. What is x(h(v))? 135v*2 Let i(n) = n + 27. Let r(l) = -8723l. Determine i(r(q)). -8723q + 27 Let r(n) = -2n. Let t(a) = 340 + 314 - 958 - 26a2 + 9a + 304. Determine t(r(g)). -104g2 - 18g Let d(i) = 165i2. Let h(t) be the first derivative of -t3/6 + 194t + 147. Let s(p) be the first derivative of h(p). What is s(d(k))? -165k2 Let y(g) = 33g*2. Let a(o) = -o - 1 + 6o - 5o + 2o*2. Let v(f) = -11f*2 + 5. Let i(t) = -5a(t) - v(t). What is y(i(d))? 33d4 Let w(i) = 19i + 72. Let l(h) = 7h + 27. Let q(u) = -8l(u) + 3w(u). Let f(x) = 395x. What is q(f(z))? 395z Let q(b) = 342b*2. Let s(w) be the first derivative of 2w*3/3 - 615. Calculate q(s(x)). 1368x*4 Let i(x) = 35x*2. Let s be (-28)/(-7)((-94)/(-8) + 0). Suppose -44g + sg = 1530. Let d(l) = -l*2 + gl - 510l. Determine i(d(q)). 35q*4 Let i(s) be the third derivative of 0 + 1/30s*5 + 0s*4 - 9s + 0s3 - 4s*2. Let g(j) = 19j. Give i(g(b)). 722b2 Let s(i) = 25i2 + 2. Let x(o) be the second derivative of o5/20 + 65o2 + 28o - 4. Let p(d) be the first derivative of x(d). What is s(p(b))? 225b4 + 2 Let r(y) = 3211y + 3230y - 6414y. Let w be -1 + 4 - (3 + -2). Let z(s	{ "pile_set_name": "DM Mathematics" }
70j + 3 + 73j - 2 - 1. 3j Collect the terms in 108z*3 - 12z*3 + 33z*3. 129z*3 Collect the terms in 506d - 1 + 2 + 2151d + 1. 2657d + 2 Collect the terms in -1 - 8827g2 - 17051g*2 + 1. -25878g*2 Collect the terms in 21779m - 108865m + 21772m + 21768m + 21774m + 21774m. 2m Collect the terms in -18h2 + 56h*2 - 2 - 23h*2 - 16h2 + 0. -h2 - 2 Collect the terms in -10w + 124w*3 + 10w + 371w3. 495w*3 Collect the terms in -408w + 230w + 206w. 28w Collect the terms in 66n*2 + 48n*2 - 16n*2. 98n*2 Collect the terms in -79z - 79z - 11z*2 - 79z + 237z. -11z*2 Collect the terms in 41 - 41 + 496c*2. 496c*2 Collect the terms in 213 - 564d + 552d - 213. -12d Collect the terms in 170t - 43t - 43t - 43t - 40t. t Collect the terms in 76i*3 - 267i*3 + 107i*3. -84i*3 Collect the terms in 10567x*2 - 2 + 2. 10567x*2 Collect the terms in -10q*2 + 21q*2 + 29q*2 + 34q*2 - 32q*2. 42q*2 Collect the terms in 83u + 3u3 - 4u3 - u3 + 1897u2. -2u*3 + 1897u*2 + 83u Collect the terms in -225y3 + 1126y*3 - 225y*3 - 223y*3 - 230y*3 - 221y*3. 2y*3 Collect the terms in 6v*2 - 6v + 4v + 32 + 8v + 0v - 10. 6v*2 + 6v + 22 Collect the terms in -460623 + 460623 + 30r. 30r Collect the terms in -56230z - 26079z - 24883z. -107192z Collect the terms in -1168638 - 32v2 + 1168638. -32v*2 Collect the terms in -94j*2 + 2j + 203j2 - j. 109j*2 + j Collect the terms in -80r*2 - 80r*2 - 1 - 86r*2 + 244r*2. -2r*2 - 1 Collect the terms in 537z*3 + 528z*3 + 545z*3 - 1609z3. z3 Collect the terms in -20 - 263 + 27 - 5a - 17. -5a - 273 Collect the terms in 4 + 7l2 - 7l*2 - 2 + 5 - 4l*2. -4l*2 + 7 Collect the terms in 19n*3 - 613854 + 613854 - 24n*3. -5n*3 Collect the terms in 628q*2 + 52q*3 - 30q*3 - 24q*3 + 2215q*2. -2q*3 + 2843q*2 Collect the terms in -2v + 70 - 68 - 141. -2v - 139 Collect the terms in -667 + 271 + 3d + 396. 3d Collect the terms in 3602233o - 3602233o - 134o*2 + 129o*2. -5o*2 Collect the terms in -15086984s*2 - 2s*3 + 15086984s*2. -2s*3 Collect the terms in 2h*2 + 5779146504 - 5779146504. 2h*2 Collect the terms in 69n + 169n - 94n. 144n Collect the terms in -1332413466b*2 + 2b*3 + 1332413466b*2. 2b*3 Collect the terms in 50i + 4 + 0 + 78i + 50i. 178i + 4 Collect the terms in 339w*3 + 79 - 41 - 38 + 137w*3. 476w*3 Collect the terms in -98l*3 + 167l*3 - 73l*3 - 6l*2 + 6l*2. -4l*3 Collect the terms in 1846i*2 + 1846i*2 - 3690i*2 + 5i. 2i2 + 5i Collect the terms in 56b - 22b + 52b. 86b Collect the terms in -231z3 - 3z*2 - 10z*2 + 12z*2 - 4z*2. -231z*3 - 5z*2 Collect the terms in -17215l*2 + 34413l*2 - 17203l*2. -5l*2 Collect the terms in -5z + 6 - 27 - z. -6z - 21 Collect the terms in -2z*2 + 1545z - 493z + 599z. -2z2 + 1651z Collect the terms in -107o - 110o - 125o + 573o - 115o - 115o. o Collect the terms in -1664505 - 29k2 + 1664505. -29k*2 Collect the terms in -1130c + 2 + 1130c - 28c*3. -28c*3 + 2 Collect the terms in -a - 1 + 6 + 11 - 16. -a Collect the terms in 170 - 2223d - 170. -2223d Collect the terms in 0 - 2 + 10t*3 + 0 - 11t3. -t3 - 2 Collect the terms in 34z - 18z - 23z. -7z Collect the terms in r*2 - 18464r*3 + 3r*2 - 711r*3 - 9r*2. -19175r*3 - 5r*2 Collect the terms in 19822950l - 19822950l + 12l*2. 12l*2 Collect the terms in 8l - 7031587 + 7031587. 8l Collect the terms in 102g*3 + 2496873g - 2496873g. 102g*3 Collect the terms in -5d - 35 - 5d - 10d + 67 + 22d. 2d + 32 Collect the terms in -89y2 - 96y + 155y2 - 68y*2. -2y*2 - 96y Collect the terms in 28 - 789p2 - 759p*2 + 1551p*2 - 40 + 12. 3p*2 Collect the terms in -5029 + 2g - g2 - g2 + 2g. -2g*2 + 4g - 5029 Collect the terms in 94j + 104j + 101j3 - 309j + 111j. 101j*3 Collect the terms in -10632u + 5408u + 5467u. 243u Collect the terms in 2953i - 2920i - i2 - 3i*2. -4i*2 + 33i Collect the terms in -19 - 12 - 2584198b2 + 2584196b*2. -2b*2 - 31 Collect the terms in 166 + 166 - 501 + 33b + 169. 33b Collect the terms in 15x*2 + 19x*2 + 17x*2 - 80x*2 + 13x*2 - 4x*2. -20x*2 Collect the terms in 175780t*2 + 10173t*2 + 87131t*2. 273084t*2 Collect the terms in 9b*2 - 1700b + 424b + 430b + 428b + 418b. 9b2 Collect the terms in -1 - 1 + 92r - 338r + 214r. -32r - 2 Collect the terms in 1780 - 32z*2 - 3593 + 1813. -32z*2 Collect the terms in -231 + 382 + 20i + 321 + 395. 20i + 867 Collect the terms in -31s - 11s - 2s + 44s + 80s*2. 80s*2 Collect the terms in 666h - 156h + 2 + 0 + 3. 510h + 5 Collect the terms in -14593 - 499b2 + 14593. -499b*2 Collect the terms in -2458l*2 - 1159l*2 + 183l*2. -3434l*2 Collect the terms in 184937o*3 - 92404o*3 - 92535o*3. -2o*3 Collect the terms in -6a - 3a + 7a + 682. -2a + 682 Collect the terms in -167s*3 + 79s*3 - 78s*3 - 364s*3 + 57s*3. -473s*3 Collect the terms in 3k*2 + 1 - 1 - 29k + 49k - 22k. 3k2 - 2k Collect the terms in -42z2 + 13z*2 + 6z - 29z - 33z*2 + 21z. -62z2 - 2z Collect the terms in 21348g2 - 24733g*2 - 52877g*2. -56262g*2 Collect the terms in -652 - 19b*3 + 652 - 7b*3. -26b*3 Collect the terms in 13c*3 - 7019c*3 - 7643c*3. -14649c*3 Collect the terms in -63w*2 - 49w*2 + 10w*2. -102w*2 Collect the terms in -16r*2 + 91 - 91 + 33r - r*2. -17r*2 + 33r Collect the terms in 309m3 + 4m*2 - 37m - 312m3 - 4m*2 - 126m. -3m3 - 163m Collect the terms in -10918904d - 34d*2 + 10918904d. -34d2 Collect the terms in -73164312733g*2 + 4g*3 + 73164312733g*2. 4g*3 Collect the terms in 27v2 + v3 + 24v2 + 11v*2 - 62v2. v3 Collect the terms in -7v3 - 39020 + 39020. -7v*3 Collect the terms in d + 73419 - d - 16d*2 - 73419. -16d*2 Collect the terms in 4 - 1 - 40x*3 - 3x*3. -43x*3 + 3 Collect the terms in 133 - 38 - 19 + 0p + 2p - 5. 2p + 71 Collect the terms in 19 + 7 + 3m2 - 43 + 9. 3m*2 - 8 Collect the terms in -52s - 956 + 51s + 956. -s Collect the terms in 25k*2 - 2k*3 - 37k*2 - 17k*2 - 32k*2. -2k*3 - 61k*2 Collect the terms in -39895337 + 39895337 + 23x*2. 23x*2 Collect the terms in -98l - 143l - 125l. -366l Collect the terms in -3297 + 3297 - 20p. -20p Collect the terms in 103k*2 + 98k*2 - 213k*2. -12k*2 Collect the terms in 16993 - 15013 + t + 0t - 33563. t - 31583 Collect the terms in 5m - 5m + 2 - 42m2 + 53m*2 - 48m*2. -37m*2 + 2 Collect the terms in -5357m*3 - 5347m*3 + 10713m*3. 9m*3 Collect the terms in 2 + 2 - 36m*2 + 189m*2 - 7. 153m*2 - 3 Collect the terms in 25773 - 20f*3 - 12901 - 12872. -20f*3 Collect the terms in -9i*2 + 936396 - 936396. -9i*2 Collect the terms in 105z*2 + 11z*2 + 9z - 9z. 116z*2 Collect the terms in -1975c - 2c3 + 1975c - 237. -2c3 - 237 Collect the terms in -55737t*3 + 27855t*3 + 27877t*3. -5t*3 Collect the terms in -3y*2 + 3y*2 + 20y*2 - 8y*2 + 4y*2. 16y*2 Collect the terms in 13k - 6k - 227 + 8k - 17k. -2k - 227 Collect the terms in 204280q + 25q*2 - 204280q. 25q2 Collect the terms in 16187k*2 - 32331k*2 + 16585k*2. 441k*2 Collect the terms in r - 4r + 6r2 - 1 + 3r. 6r2 - 1 Collect the terms in 287045 - 287045 - 22r*3. -22r*3 Collect the terms in -90 + 90 + 4g + 0g + 10g - 21g. -7g Collect the terms in -147n - 4n2 - n2 + 3n2 + 147n + 0n2. -2n*2 Collect the terms in -7j*2 + 26j - 4 - 26j + 55j*2. 48j*2 - 4 Collect the terms in 3297s - 3297s - 807s*2. -807s*2 Collect the terms in -w + w - 58w*2 - 7w*2 - 69w*2. -134w*2 Collect the terms in -219485 + 219485 - 39a. -39a Collect the terms in -8n + 391 + 13n + 389 + 389 - 1169. 5n Collect the terms in 76r - 42r + 0r3 - r3 - 43r. -r*3 - 9r Collect the terms in 832c2 + 3910c - 3910c. 832c*2 Collect the terms in 381924 - 9j - 381924. -9j Collect the terms in 42s + 48*s +	{ "pile_set_name": "DM Mathematics" }
wrt y? 480y Let g be 9 + (-2 - -2 - 2). Find the first derivative of -g + 6 - 8k*3 - 10 wrt k. -24k*2 Let j(z) be the third derivative of -124z*7/105 - 115z*3/6 - 184z*2. What is the first derivative of j(h) wrt h? -992h*3 Find the second derivative of -45n - 7n2 + 111n - 67n wrt n. -14 Let q(w) be the first derivative of -26 - 13w - 43/3w3 + 0w*2. What is the first derivative of q(m) wrt m? -86m Let s(a) be the first derivative of 0a + 0a*3 + 15/4a*4 - 17/2a*2 + 23. What is the second derivative of s(o) wrt o? 90o Let p(y) = -y*2 + 6y + 4. Let l be p(6). What is the second derivative of -16v + lv + 0v3 - 3v*3 wrt v? -18v Let b(s) be the first derivative of 37s4/12 + 7s*3/6 - 15s - 29. Let h(c) be the first derivative of b(c). What is the second derivative of h(g) wrt g? 74 Suppose -12g + 15 = -9g. Suppose -5a - 15 = -go, 0o - 5a = -4o + 12. What is the third derivative of -4l*2 + 3l*3 + 4l*4 - 2l*4 - ol*3 wrt l? 48l Let y be 17 - ((5 - 5) + -1). Let q(d) = -d*3 - 9d + 67. Let o(h) = -2h + 17. Let g(l) = yo(l) - 4q(l). Differentiate g(i) with respect to i. 12i*2 What is the first derivative of 2d*2 - 27d*3 + 11d*3 + 43 + 15d*3 wrt d? -3d*2 + 4d Let k = 75 + -51. Suppose 4w + x = -0x + 18, k = 4w + 4x. Find the third derivative of 6y2 + 5y*2 + 4y*w - 5y*2 - 9y*4 wrt y. -120y Let o(m) = -1 - 3 + 7 + m. Let j(t) be the second derivative of t*3/6 - 9t. Let w(z) = 3j(z) + o(z). Differentiate w(v) with respect to v. 4 Let o(x) be the first derivative of 32x*6/3 + 2x*3/3 - 3x*2/2 - 3x + 30. What is the second derivative of o(h) wrt h? 1280h3 + 4 Let s(p) be the first derivative of p3/3 + 61p*2/2 + 441p - 519. Differentiate s(i) wrt i. 2i + 61 Let s = -20 + 22. What is the second derivative of -sn + n - 4n + 9n2 + n wrt n? 18 Let h(y) = y2 + 7y - 3. Let s be h(3). What is the first derivative of -20k*3 + 17k*3 - 8k*3 + s wrt k? -33k*2 What is the third derivative of 4a4 - 20 - a3 - 2339a2 + 2341a*2 - 11a*3 wrt a? 96a - 72 Let c(m) = m*3 + 4m*2 - 11m + 8. Let t be c(-6). What is the derivative of -t - 13j2 + 0 + 15 + 10 wrt j? -26j Let h be (-12)/18 + 14/3. Let c = h + -1. Find the third derivative of -3j2 - 5j*3 - 2j*c + 2j*2 + 2j*3 wrt j. -30 Let y(h) = -105h*3 - 15h*2 + 15h - 84. Let f(g) = 15 + 2 - 5 - 2g + 2g*2 + 15g*3. Let k(m) = 15f(m) + 2y(m). What is the derivative of k(d) wrt d? 45d*2 Suppose 4x - q + 0q = 25, 5 = 2x + q. What is the third derivative of -434ox - 15o*6 + 36o*2 + 434o*5 wrt o? -1800o*3 Suppose 3b = -6, 1 - 2 = -c - b. Differentiate -4f + 2f - c + f - 2 wrt f. -1 Let y(g) = -85g3 + 2g*2 + 1. Let t(u) = -171u*3 + 5u*2 + 3. Let m(c) = -2t(c) + 5y(c). What is the first derivative of m(b) wrt b? -249b*2 Let q(j) = 8j - 4. Let z be q(2). Let d(k) = -k*2 + 12k + 2. Let r be d(z). Differentiate 52 - 44 - 2m2 - 2m*r wrt m. -8m Let m(f) = -4f3 - 4f*2 - 35. Let l(y) = -13y*3 - 12y*2 - 105. Let x(s) = -3l(s) + 10m(s). Find the first derivative of x(w) wrt w. -3w*2 - 8w Let r(o) = -18o2 - 4o + 98. Let p(x) = 17x2 + 3x - 98. Let b(u) = 5p(u) + 4r(u). Differentiate b(j) wrt j. 26j - 1 Find the third derivative of -d2 - 3d - d*3 + 10d*3 - 5d + 13d3 wrt d. 132 Find the first derivative of -164j*2 + 360 + 38j*2 + 119 - 177j*2 + 52 wrt j. -606j Suppose -4d + s = -3, 2s - 25 = -3s. Suppose -2b + 8 = 4i, -4i - 4 = -3b - 12. Find the second derivative of 4v*d - v - 3v*2 + 0v + v*i wrt v. 4 Let l be 65/15 - ((-5)/3)/(-5). What is the second derivative of -4d + 17d - 4d*4 - 12d*l wrt d? -192d*2 What is the derivative of 395 + 144 - 8v*4 + 0v*4 - 10 wrt v? -32v*3 Let d be -9 + (48/4)/4. Let t be (d/(-10))/((-33)/(-110)). Find the third derivative of 0u*t + 2u*2 + 2u*2 + 7u*5 wrt u. 420u*2 Let t(b) be the first derivative of -8b*3/3 + 25b*2/2 + 471b - 314. Differentiate t(x) with respect to x. -16x + 25 Let c be 20 - 20 - (1 + -1). Suppose 3z - 1 = -l - c, -16 = 4z. What is the second derivative of -3m*2 - lm - 3m2 + 5m*2 wrt m? -2 What is the second derivative of -42d*2 + 8d - 5d + 8d - 2 + 6 wrt d? -84 Let l(k) be the second derivative of 173k5/20 - 43k*4/3 - 10k - 3. What is the third derivative of l(q) wrt q? 1038 What is the second derivative of -41 + 71 - 146f5 - 34 - 2f wrt f? -2920f3 Let t be 1/1 + -1 + 5. Let i(k) = 3k - 5. Let h be ((-3)/(-9)-4)/(1/3). Let g(o) = 4o - 5. Let d(v) = hg(v) + ti(v). Differentiate d(x) wrt x. -1 Find the first derivative of 111y - 277 + 80y - 68y + 58 - 135 wrt y. 123 Let j(g) = 13g*2 + 4g + 19. Suppose -6 = 6t + 18. Let w(k) = 13k*2 + 5k + 18. Let p(h) = tw(h) + 5j(h). Differentiate p(n) wrt n. 26n Let c(t) = t + 0t + 11t2 - 2t - 2t + 5. Let i(g) = -34g*2 + 8g - 15. Let w(x) = -8c(x) - 3i(x). What is the first derivative of w(s) wrt s? 28s Let i(z) be the first derivative of 4z*5 + 90z - 41. What is the first derivative of i(v) wrt v? 80v3 Let b(u) be the second derivative of -11u9/504 - u5/6 + 3u2 + u. Let c(j) be the first derivative of b(j). Find the third derivative of c(h) wrt h. -1320h*3 Let a(d) = -269d*3 + 2726d*2 - 11d. Let k(r) = 90r3 - 909r*2 + 4r. Let y(v) = 4a(v) + 11k(v). What is the third derivative of y(h) wrt h? -516 What is the second derivative of 389d2 - 35 - 45 - 29d + 76 wrt d? 778 Let q(z) = 443z4 - 3z*3 - 3z*2 - 3z + 297. Let c(v) = -v4 + v3 + v*2 + v - 2. Let s(h) = -3c(h) - q(h). Differentiate s(d) with respect to d. -1760d3 Let i(q) = -58q5 - q4 + 160q + 3. Let a(n) = 59n*5 - 161n - 2. Let p(k) = -3a(k) - 2i(k). Find the second derivative of p(g) wrt g. -1220g3 + 24g*2 Let j(o) be the first derivative of -6 + 8o - 5/2o2. What is the first derivative of j(t) wrt t? -5 Let o(b) be the first derivative of 488b*3/3 - 55b + 216. What is the derivative of o(f) wrt f? 976f Let d = -53 + 58. What is the third derivative of 32v*2 - 4v*3 + 4v*3 - 15v*5 - 19v*d wrt v? -2040v*2 Let j = -170 + 221. Differentiate 42u - 42u - 49 + ju*4 wrt u. 204u*3 Suppose 5k + 4o - 9o + 15 = 0, -k = 2o - 12. Suppose -5g + 49 = -g - 5d, 3g - 28 = kd. Find the first derivative of gx + 0x - 2x - 4 wrt x. 4 Let n(l) be the third derivative of 0l3 + 0l*4 + 1/112l*8 + 0 + 0l*7 + 1/20l*5 + 0l*6 - 11l*2 + 0l. What is the third derivative of n(a) wrt a? 180a2 Suppose 5w + 20 = -5k, 0 = 5w - 4w - 2k - 11. Let t be w + 5 + -4 + 2. Find the second derivative of 23ut - 19u*4 + 3u - u2 + u2 wrt u. 48u2 Let n = 55/6 + -9. Let u(o) be the second derivative of no*3 + 3o + 0 - 2o2. Differentiate u(x) with respect to x. 1 Let m(q) = 154q + 287. Let j be (42/(-2))/(21/56). Let h(d) = -14d - 26. Let u(t) = jh(t) - 5m(t). Find the first derivative of u(k) wrt k. 14 Let d = 2679/4 - 669. Let w(x) be the first derivative of 0x*2 + 2/3x*3 - dx*4 + 0x + 1. What is the third derivative of w(s) wrt s? -18 Let o(m) be the second derivative of m*7/21 + 13m*6/10 + 77m*3/2 + 274m. Find the second derivative of o(l) wrt l. 40l3 + 468l*2 Let w = -36 - -52. Differentiate 23v - 23 + 24v - wv + 26 wrt v. 31 Let s be (-10)/(3 + (-21)/6). Let r = s + -3. Differentiate 20q - rq + 3 - 11 wrt q. 3 Let f be ((-10)/3)/(5/(-45)). What is the second derivative of 30 + 50n - 7n - f - 51n3 wrt n? -306n Let o(x) = 2x4 - 46x*3 - 4x*2 + 27x. Let a(j) = 4j4 - 91j*3 - 9j*2 + 55j. Let p(u) = 2a(u) - 5o(u). Find the third derivative of p(k) wrt k. -48k + 288 What is the third derivative of 2p*4 - 205p*5 + 20p - 5p2 - p - 2p*4 - 6p wrt p? -12300p2 Suppose z - 5s + 6 = 0, 1 = 4z - 5s - 5. Find the first derivative of -v*4 + 7v*z - 1 + 27 wrt v. 24v*3 Let h(q) = -243q*3 + 162q*2 + 5q + 10. Let t(b) = 242b3 - 165b*2 - 4b - 8. Let p(k) = -4h(k) - 5t(k). Find the third derivative of p(c) wrt c. -1428 Suppose 2i = 4l - 7 - 25, -3i = 5l - 51. Find the second derivative of -6 - 6a	{ "pile_set_name": "DM Mathematics" }
)/iii)/i)(-4/5))(9/5) assuming i is positive. i(-74/25) Simplify (((q(1/3)q)/qq)(11/5)/((q(2/5)qq)/(q/(qq(2/9)))))/((q/q(-1/4))/(qq*(-1))q*(-1/4)q*(-2)q) assuming q is positive. q*(14/45) Simplify ((c/(cc*(1/5)c))/c)/cc(c*(1/9)c)/c(cc(1/5))30((c(-1/10)c)/((c*4/c)/c))/((c/((c/(c/(cc*4))c)/cc)c)/c7) assuming c is positive. c(3943/90) Simplify ((l0)(2/29)l7l(-1/2))/(l(-4/9)ll(-1/5))(-45) assuming l is positive. l*(45/2) Simplify (uu*1u)*(3/2)(uu(-2/9))(-40) assuming u is positive. u(-479/18) Simplify (((a(1/4))(-4/17)(a/(a/(aa/a(1/4)))a)/aa(-1/9))(-37))36 assuming a is positive. a(-35779/17) Simplify ((q6/q(-5))/(q(2/27)/(qqq(2/25))))/((q(-5)q*(1/10))/((qq(-3/8))/q0)) assuming q is positive. q*(100067/5400) Simplify ((ss*(-3/8)ss)(3/5)/((ss*(-9)s)/((sssss*(-3/14)s)/s)))(1/6) assuming s is positive. s(3461/1680) Simplify (ll/l(-4/9)lll*(2/3))/(ll*(2/5)/ll/l*(3/4)ll)l*(-1)l*(-2)(l/(l*5/l))/(l/(l/(ll/(ll(-7)ll)))) assuming l is positive. l(-1717/180) Simplify (((o(-1))(-12)oo/(o/((o((o*(-2/15)/o)/o)/oo)/o))ooo16)(-2/145))(-2/33) assuming o is positive. o(1732/71775) Simplify (((m/m(-2/5))16/(mmm1)(1/74))(1/31))(-19) assuming m is positive. m(-157187/11470) Simplify (k(6/7))(-32)/(k(-27)/(k/(k/(kk/k*(-35))kk))) assuming k is positive. k(242/7) Simplify (((g/g(-5/4)g10)(8/15))(-21))(2/7) assuming g is positive. g*(-196/5) Simplify (kk/(k*3k)k(1/2))(2/71)/((kk/k1)(-2/5)/(k*(-1/3)(k/(k/(k*(1/6)k)))/k)) assuming k is positive. k(407/2130) Simplify (k6/(kkk(7/4)))(-2/49)/((k/k(-3))(-31/2))(-7/6) assuming k is positive. k(-21293/294) Simplify ((c3/c)(-8/5))9/((c(8/7)c)/cc/((c*(-1/2)c)/cc))(2/45) assuming c is positive. c(-1819/63) Simplify ((t(1/2)/t)(-31/3))(-4/11)(t/(t/t*(-2/17))t)/t*0t*(-1/5)/(t(t(2/11)/t)/t) assuming t is positive. t(-1061/2805) Simplify ((r*11r(r(-4)r)/r(r(1/7))(4/17))(-17))(-4) assuming r is positive. r(3824/7) Simplify (pp*(3/2)/ppp(p*(-11/2)p)/p)/(p/(p/(((p/(p*(2/51)/p))/ppp)/p)))(-21) assuming p is positive. p(666/17) Simplify (((r(-1/7))(-50))(1/89))(-6/25) assuming r is positive. r(-12/623) Simplify ((((b(2/7)b)/b)/b*(-3/5))/((b(b*0/bb)/b)/bbb)9)/((b0b)3)41 assuming b is positive. b(-4589/35) Simplify (k(-6/11)/((kkk(-4))/k))/((k(1/2)k)/((kkk*(-1/5)k)/k))(k(-2/3)/k)15(kkk(2/3))/(k/k(-4)) assuming k is positive. k(-8111/330) Simplify ((a(2/11))(-21))17(aa*(1/3)a(-7))/(a/a(1/2))(-17/2) assuming a is positive. a(-8755/132) Simplify ((a(1/3))(-22))*38(a(1/2)/a)(-11/4)a/(aa/a*(-5)a)a/(a/(aaaa/(a/(aa/(a/a(-3))a))a)) assuming a is positive. a(-6751/24) Simplify (i/((i/i(5/3))/ii)ii*(1/4)(ii(-6))/i(i/i*(-3)i)/i)/(ii8ii4(i*(-1/6)i)/i9) assuming i is positive. i(-59/12) Simplify (w*2/((w/((w/(w/(w/(ww/w*(-2/15)w))))/w))/w))*(-2/13)/(((ww*(4/5))/wwww)/w*6(ww1/w)(-18)) assuming w is positive. w(3973/195) Simplify (v(2/41))(-8/11)(vv/v(-10))22 assuming v is positive. v(119048/451) Simplify ((x(2/13)/xx)/(xx(-18))xx34xx(2/5))(-4/9) assuming x is positive. x(-13924/585) Simplify ((u12(u/(u/(((u*23/u)/u)/uu)))/u)/(((u/(uu/(u(u(u(2/27)/u)/u)/uu)))/u)/uuu/(u(10/9)/u)))(1/4) assuming u is positive. u(223/27) Simplify (b1/b)*40(bbbb/b(-3))/(b/(b/(b1b)))(b(-1/3)bb4)/((b(-1/2)b)/(b2/b)) assuming b is positive. b(61/6) Simplify ((o/o*(-12))/(oo/(o*(3/2)/o)o)o(2/49)o(oo*(2/11)oo)/oo)(2/17) assuming o is positive. o(15871/9163) Simplify (n*1nn(3/2)n)/(n(2/5))(-32)n/(((n/(n(3/5)/n))/n)/n)n*(-2)n*(-5)nn/(n0n)n assuming n is positive. n(139/10) Simplify (ll*(-5)l(-6))34/((l/l*5l)/l*(-2/5)(l/(l/(lll*(-7))))/ll(-3)) assuming l is positive. l(-1642/5) Simplify (g*(-3)gg(3/2))/(g(-2/7))15(gg/g0)(-44)(gggg(-1/3))17 assuming g is positive. g(-1633/42) Simplify (((h/(h(-10)/h))/h)(2/63)/((h/(h/(hh/(h*(12/7)/h))))/(hh(-2/5)/h)))(1/17) assuming h is positive. h*(-421/5355) Simplify (ss*(1/2)s)*(4/21)s(1/6)/(s/s(-2))(ss*(2/17)ss/s(3/4)s)/(s*(-2/9)s0) assuming s is positive. s(5281/4284) Simplify ((g(-32)/g(-2/7))(-32))(-44) assuming g is positive. g(-312576/7) Simplify ((x2/(x*(2/5)x))/(x(2/5))26)/((((x/x*5)/xx)/x)/xxx2)31 assuming x is positive. x(416/5) Simplify ((y2)*(2/51)(y/y*(-17))/yy*(-2)/yy)(-2/15) assuming y is positive. y(-1538/765) Simplify (c(cccc*21/c)/c(c/(c/c*(2/17)))/cc/(c/(c*6c))cccc10)(2/53) assuming c is positive. c(1432/901) Simplify (((b(1/3)(b/(bb/b(-1/2)))/b)(18/11))4)13 assuming b is positive. b(-2028/11) Simplify (d(-2/5)/d)/d*(1/5)d*(-1/6)d*(-2/11)dd(ddd*(2/7)dd(-1/3))(7/4) assuming d is positive. d(287/55) Simplify ((j/j(-1))/((j/(j/j(-6)j))/j)jj*5/jj(j/(j6/j))/j)/((jj/(jj(2/9))j(-4/3))/((j(-1/5)/j)/j5)) assuming j is positive. j(241/45) Simplify ((l(2/7)/l)(7/9))(7/2)/((l(-1))*(-4/15)/(ll(1/3))(1/12)) assuming l is positive. l(-21/10) Simplify ((d(-12)dd/(ddd*(-5))d)/(d(-3/5))(-3/25))43 assuming d is positive. d(-32637/125) Simplify ((g*(-1)g0)/(g4g/g(-5)))/((g1)(1/4)/(g0/g(-1/8))) assuming g is positive. g(-89/8) Simplify (u(-5)/u(-2))(-12)(u/u(-1/5))/(u(-1/10)u)(u(-2/7))(-6/5) assuming u is positive. u(513/14) Simplify (p(-1))(-37)/(p(-30))(-46/5) assuming p is positive. p(-239) Simplify l*(-2/3)lll*(-3/2)(ll2l)/((((ll(-2/9))/l)/l)/l)(l(-2/7))(-4)(l/l(2/9))(-1/63) assuming l is positive. l(8149/1134) Simplify ((((o/o(3/7)o)/o(o/(oo/o*1oo))/oo)/(o(2/27)/o(-1/5)))32)10 assuming o is positive. o*(-102976/189) Simplify (ff*43f(-3/7))/(f/(f(4/17)f))(-13/3) assuming f is positive. f(15191/357) Simplify ((j(jj(-7))/j)/jj3)/(j(-2/7)/j*(-4))jj(1/3)j(jj*(-1/4))/jj(-1/3)/(j(-2/5)j) assuming j is positive. j(-919/140) Simplify ((k34kk(4/17))/(k(1/2)((k*(-2/13)kk)/k)/k))(-44) assuming k is positive. k(-339262/221) Simplify (((g6)(-4))(1/2))8 assuming g is positive. g(-96) Simplify ((b/b(1/4))(-22))(1/14)(b((b(2/13)/b)/bbb)/bb(2/5))(-2/53) assuming b is positive. b*(-115701/96460) Simplify (llll*(-9)l*(29/5)/ll)/((l/l*33l)/ll)40 assuming l is positive. l(6199/5) Simplify ((n(-9))(1/9)nn/(nn*(1/5)nn)(n*(6/17)n)/n)(-28/3) assuming n is positive. n(4396/255) Simplify ((nn(-5))/n(-2)(n(n(-15)/n)/n)/n(-3/2))(-1/5) assuming n is positive. n(33/10) Simplify (z1)(-46)(z*(2/3)zz)(-48)(z*3/zzz(-3))(-22) assuming z is positive. z(-174) Simplify (j/((jj1)/j))(12/7)(j1/j)(-15)((jj(2/7))/jj)/jj(-1/4)/jjj5/((jj*(-2)jj)/j) assuming j is positive. j(141/28) Simplify ((ii1)(-49)i(2/9)i(9/7)/i)33 assuming i is positive. i*(-67562/21) Simplify ((v/(vv(v(v*(23/4)v)/v)/vv)vv45)/((v/((v/(v/v(-42)))/v))/v(20/9)))(-1/6) assuming v is positive. v(127/216) Simplify (t/(t/t3))/tt/(tt(-8))(tt(2/3))49(t*5t*(-2)tt)/(t(-8)/(tt/(tt(1/6)/t))) assuming t is positive. t(213/2) Simplify (pp3)/((p/(((p/(p/(p/p(-3/7))))/p)/p))/p)p0/p(-6/7)(p*(-5)(pp0)/p)/(p/((p(p*5/p)/pp)/p)p3) assuming p is positive. p(-5/7) Simplify ((x/((x(-2/3)/x)/x)x)*(-13)(x/x*1)/((xx*(-1/4)/x)/xx))/(x*(-1/3)x(xxxx/x*(-7)x)/xx2/x(x*(-8)/xx)/x) assuming x is positive. x*(-769/12) Simplify (o/(oo(2/9)))/o(-2/5)(oo/(o*(-1/3)/o)o)*(18/11)((oo(1/8))/o3)(-28) assuming o is positive. o(59171/990) Simplify (m(-1/14)/m(m(-17)/m)/m)/(m(1/36)m(4/7)) assuming m is positive. m(-5209/252) Simplify (((a/(a/(a/(a/a*(	{ "pile_set_name": "DM Mathematics" }
3100t2 - 11532t = 0? -3, 0, 31 Factor -2x3/11 + 36x*2/11 + 80x/11. -2x(x - 20)(x + 2)/11 Factor 6f*4 - 21f*3 + 6f*2 + 9f. 3f(f - 3)(f - 1)(2f + 1) Suppose -5c*2 - 720c - 25920 = 0. What is c? -72 Factor -2w3 - 24w*2 - 34w + 180. -2(w - 2)(w + 5)(w + 9) Determine a, given that -a4 - 11a*3 + 14a*2 + 24a = 0. -12, -1, 0, 2 Suppose 5x4 - 575x*3 + 3315x*2 - 4925x + 2180 = 0. Calculate x. 1, 4, 109 Factor -g*3 - 509g*2/7 + 146g/7. -g(g + 73)(7g - 2)/7 Solve -22f*5/3 + 92f*4/3 + 226f*3/3 + 88f*2/3 - 8f = 0 for f. -1, 0, 2/11, 6 Factor 2x3/5 - 22x*2/5 + 6x + 54/5. 2(x - 9)(x - 3)(x + 1)/5 Determine q so that 2q*4 + 324q*3 - 6q*2 - 968q + 648 = 0. -162, -2, 1 What is s in -3s2 + 225s - 438 = 0? 2, 73 Factor j*2/4 + 5j + 19/4. (j + 1)(j + 19)/4 Factor -2w*4/13 - 12w*3/13 - 24w*2/13 - 20w/13 - 6/13. -2(w + 1)3(w + 3)/13 Suppose 2w5 + 208w*4 + 1202w*3 + 2572w*2 + 2360w + 784 = 0. What is w? -98, -2, -1 Factor 2l3/5 + 2l*2/5 - 16l/5 - 24/5. 2(l - 3)(l + 2)*2/5 Find r such that 2r*2 - 5830r + 5828 = 0. 1, 2914 Suppose -5t3 + 55t*2 - 200t + 240 = 0. Calculate t. 3, 4 Factor c*3 - 11c*2 + 19c - 9. (c - 9)(c - 1)2 Factor 4q*3 - 1200q*2 + 87552q + 369664. 4(q - 152)2(q + 4) Determine f, given that -2f2/9 - 10f/3 - 8 = 0. -12, -3 Factor -2y4/5 + 6y*3/5 + 26y*2/5 - 6y. -2y(y - 5)(y - 1)(y + 3)/5 Factor 3b5 - 6b*4 + 6b*2 - 3b. 3b(b - 1)*3(b + 1) Find c such that 27c5 - 18c*4 - 465c*3 - 564c*2 - 180c = 0. -3, -2/3, 0, 5 What is t in -3t3 - 921t*2 = 0? -307, 0 Let -5i*3 - 180i*2 - 1425i + 3610 = 0. What is i? -19, 2 Let 6a5 + 16a*4 + 12a*3 - 2a = 0. Calculate a. -1, 0, 1/3 Suppose 12w5 - 20w*4 - 64w*3 + 48w2 = 0. What is w? -2, 0, 2/3, 3 Factor -j3/4 - 11613j2/4 - 44953923j/4 - 58005545311/4. -(j + 3871)*3/4 Suppose -64o*4/7 - 6560o*3/7 - 9732o*2/7 - 520o - 404/7 = 0. Calculate o. -101, -1, -1/4 Factor -s*5/3 + 892s*4/9 - 9834s*3 + 326700s*2 - 107811s. -s(s - 99)3(3s - 1)/9 Solve -2j*5/19 - 8j*4/19 + 100j*3/19 + 616j*2/19 + 910j/19 + 400/19 = 0. -5, -1, 8 Factor -3h4 - 51h*3 - 48h*2. -3h*2(h + 1)(h + 16) Determine l so that -l5/3 - l4/3 + l3/3 + l2/3 = 0. -1, 0, 1 Factor c2 - 2796c + 1954404. (c - 1398)2 Factor -t2 - 54t + 112. -(t - 2)(t + 56) Determine v, given that -v*2/3 + 4v - 35/3 = 0. 5, 7 Determine y so that -10y5/17 + 416y*4/17 - 3802y*3/17 - 10828y*2/17 - 8536y/17 - 1936/17 = 0. -1, -2/5, 22 Solve -4d5 - 8d*4 + 4d*3 + 8d2 = 0 for d. -2, -1, 0, 1 Factor b4 - 63b3 - 621b*2 - 1917b - 1944. (b - 72)(b + 3)3 Solve a2/2 - 293a/2 + 146 = 0. 1, 292 Suppose -3q5 - 6q*4 + 63q*3 - 66q*2 - 60q + 72 = 0. Calculate q. -6, -1, 1, 2 Factor -k*3 + 36k*2 - 131k + 96. -(k - 32)(k - 3)(k - 1) Suppose 3l2 - 15l = 0. Calculate l. 0, 5 Factor 3j3 - 9j*2 - 12j. 3j(j - 4)(j + 1) Find n, given that -6n*5/5 + 26n*4/5 + 62n*3 - 266n*2 - 1104n/5 + 504/5 = 0. -7, -1, 1/3, 6 Factor -4m2/3 - 2m - 2/3. -2(m + 1)(2m + 1)/3 Factor -3o*4 + 9o*3 + 126o*2 + 300o + 216. -3(o - 9)(o + 2)3 Suppose f3/2 + 77f2/2 - 119f + 80 = 0. What is f? -80, 1, 2 Suppose -d*2/5 + 57d/5 + 118/5 = 0. What is d? -2, 59 Solve 3j5/2 - 153j*4 + 11835j*3/2 - 106638j*2 + 878472j - 2667168 = 0 for j. 9, 28 What is n in -3n5 - 249n*4 + 771n*3 - 267n*2 - 768n + 516 = 0? -86, -1, 1, 2 Factor -j*3/6 - 19j*2/3 - 107j/6 - 35/3. -(j + 1)(j + 2)(j + 35)/6 Suppose -3j4/5 + 42j*3/5 - 36j*2 + 30j + 75 = 0. What is j? -1, 5 Solve -58i5/9 - 76i*4/3 + 74i*3/9 + 76i*2/3 - 16i/9 = 0. -4, -1, 0, 2/29, 1 Solve 4f3 + 280f*2 + 4608f - 10368 = 0. -36, 2 Suppose -2a5 - 128a*4 - 1912a*3 + 4484a*2 + 1914a - 4356 = 0. Calculate a. -33, -1, 1, 2 Let 14z5/5 - 438z*4/5 + 124z*3/5 = 0. Calculate z. 0, 2/7, 31 Determine c, given that 2c*4/5 + 136c*3 = 0. -340, 0 Let 192l*4 - 5208l*3 + 45225l*2 - 860625l/8 - 1265625/8 = 0. What is l? -1, 75/8 Suppose -5m3 - 60m*2 - 105m - 50 = 0. Calculate m. -10, -1 Find o such that -2o3 + 262o*2 - 8710o + 8450 = 0. 1, 65 Find x, given that -2x4/3 + 16x*3 - 286x*2/3 - 16x + 96 = 0. -1, 1, 12 Factor -25k3/2 - 205k*2 + 1011k/8 - 153/8. -(k + 17)(10k - 3)*2/8 Suppose 2j*2 + 19j/2 - 5/2 = 0. What is j? -5, 1/4 Factor -3h3/2 - 3h*2 + 21h/2 - 6. -3(h - 1)2(h + 4)/2 Determine c, given that -c*2 + 15c - 36 = 0. 3, 12 Factor -2p4/3 - 760p*3/3 - 31744p*2 - 3801088p/3 + 16777216/3. -2(p - 4)(p + 128)3/3 Suppose b2/2 - 261b + 68121/2 = 0. What is b? 261 Factor -2d*2 + 1314d + 1316. -2(d - 658)(d + 1) Factor -2v2/15 + 14v/15 + 12/5. -2(v - 9)(v + 2)/15 Factor 5j2 + 70j - 475. 5(j - 5)(j + 19) Factor p*2/8 - 177p/8 + 22. (p - 176)(p - 1)/8 What is r in r2/10 + 9r/10 + 4/5 = 0? -8, -1 Factor -2s3/9 + 10s*2/9. -2s*2(s - 5)/9 Factor 3v4 + 33v*3 + 72v*2 - 12v - 96. 3(v - 1)(v + 2)*2(v + 8) Suppose 2z3 - 2z2 = 0. Calculate z. 0, 1 Suppose -c3/2 - 5c2 + 69c/2 - 45 = 0. What is c? -15, 2, 3 Factor -4u3/5 + 16u*2/5. -4u*2(u - 4)/5 Let 2g5/3 + 4g*4/3 - 4g*3/3 - 16g*2/3 - 14g/3 - 4/3 = 0. What is g? -1, 2 Factor c*2 - 442c + 48841. (c - 221)*2 Suppose 8x*5/9 - 10x*4/3 - 16x*3/9 + 10x*2/3 + 8x/9 = 0. What is x? -1, -1/4, 0, 1, 4 Factor z*3/10 - 11z*2/10 - 7z/5 + 12/5. (z - 12)(z - 1)(z + 2)/10 Let 4w2 + 304w - 308 = 0. Calculate w. -77, 1 Factor 6p4 + 220p*3 + 2088p*2 + 1296p. 2p(p + 18)*2(3p + 2) Find k such that -6k*3 + 9k*2 + 933k - 468 = 0. -12, 1/2, 13 Suppose 4g5 - 224g*4 + 2904g*3 + 6496g*2 + 3364g = 0. What is g? -1, 0, 29 What is y in y*3 + 2y*2 - 15y = 0? -5, 0, 3 Factor g*5 + 16g*4 - 97g*3 + 164g*2 - 84g. g(g - 2)2(g - 1)(g + 21) Factor -2t*5 - 28t*4 - 114t*3 - 144t*2. -2t*2(t + 3)*2(t + 8) Suppose -2r5/3 + 20r*4/3 - 10r*3/3 - 80r*2/3 + 24r = 0. What is r? -2, 0, 1, 2, 9 What is t in t*2 + 11t - 276 = 0? -23, 12 Factor -2d2 - 1034d + 1036. -2(d - 1)(d + 518) Determine k, given that -2k2/7 + 312k/7 + 314/7 = 0. -1, 157 Factor -3o3 + 315o*2 - 11025o + 128625. -3(o - 35)3 Factor 2p*4/7 - 8p*3 + 50p*2/7 + 108p/7. 2p(p - 27)(p - 2)(p + 1)/7 Factor -2s2/7 - 8s - 54/7. -2(s + 1)(s + 27)/7 Determine o, given that -4o2 + 1844o + 3704 = 0. -2, 463 What is h in 2h2 + 68h = 0? -34, 0 Solve 3x3/7 - 12x*2/7 - 33x/7 - 18/7 = 0 for x. -1, 6 Let -14s4 - 179s*3 - 638s*2 - 420s - 72 = 0. What is s? -6, -1/2, -2/7 Solve h*3/5 - 31h*2/5 - 4h/5 + 124/5 = 0 for h. -2, 2, 31 Suppose -3n2 + 60n - 192 = 0. What is n? 4, 16 Solve -2g4/5 - 54g*3/5 + 58g*2/5 + 54g/5 - 56/5 = 0 for g. -28, -1, 1 Find v such that 4v3/3 - 40v*2/3 = 0. 0, 10 Factor -13v*2/4 - 1965v/4 - 151/2. -(v + 151)(13v + 2)/4 Factor 5g5 + 135g*4 - 140g*3. 5g*3(g - 1)(g + 28) Determine u so that -2u*5/3 + 206u*4 + 1868u*3/3 + 416u*2 = 0. -2, -1, 0, 312 Suppose 3x*3 - 6x*2 - 12x + 24 = 0. What is x? -2, 2 Suppose h*2/5 + 48h/5 + 47/5 = 0. Calculate h. -47, -1 Factor 7s5 - 100s*4 - 308s*3 - 254s*2 - 19s + 34. (s - 17)(s + 1)3(7s - 2) What is d in 3d*4 + 39d*3 - 306d*2 + 660d - 456 = 0? -19, 2 Factor f*4 + 2f*3 - 3f*2 - 4f + 4. (f - 1)*2(f + 2)*2 Factor -2a*2 - 2196a - 4384. -2(a + 2)(a + 1096) What is o in -2o4/7 - 270o*3/7 + 2836o*2/7 - 9216o/7 + 9280/7 = 0? -145, 2, 4 Factor -i*2/8 - 181i/2 - 32761/2. -(i + 362)*2/8 Factor 2t*4/3 - 16t*3/3 - 35t*2/6 - 3t/2. t(t - 9)(2t + 1)2/6 Solve -4j*2/7 - 2616j/7 = 0 for j. -654, 0 Factor 21w4 + 372w*3 + 249w*2 - 102w. 3w(w + 1)(w + 17)(7w - 2) Suppose 2f*2/9 + 2060f/3 + 530450 = 0. What is f? -1545 Find h, given that h*5/2 - 5h*4 + 12h*3 - 11h*2 + 7h/2 = 0. 0, 1, 7 Determine x, given that -3x2 + 543x + 546 = 0. -1, 182 Factor 3q3 - 1308q*2 + 142572q. 3q(q - 218)*2 Let -3k**4 +	{ "pile_set_name": "DM Mathematics" }
/5 + 10m4 + 56m*3/3 + 16m*2 - 975m. Factor p(n). 4(n + 2)3(2n + 1) Suppose -y + a + 40 = 0, -2y + a = 2a - 68. Let j be (y/27)/((-3)/(-18)). Factor -jx*2 + 8x + 1 - 9 + 17x2 - 11x*2. -2(x - 2)*2 Let u be 39/12 - (8 + 189/(-28)). Suppose 5m = -4s - 10, 3s - 10 = -us + 5m. Factor s - 5/4f2 + 0f. -5f2/4 Factor -3/7w*4 + 24/7 - 12/7w - 18/7w2 + 15/7w*3. -3(w - 2)*3(w + 1)/7 Let k(h) = h*3 - 4h*2 - 6h - 15. Let j be k(5). Let w(u) = -u*4. Let t(v) = -15v*4 - 35v*2 - 30v. Let r(m) = jw(m) + t(m). Let r(y) = 0. Calculate y. -2, -1, 0, 3 Let f(a) be the third derivative of -1 - 5/16a*4 + 18a*2 - 1/5a*5 - 1/80a*6 + 0a + 25/2a3. Determine i, given that f(i) = 0. -5, 2 Let s be ((-205)/10)/(-23/12). Suppose -31u - 60 = -su. What is q in 16/7q2 - 8/7q - 2q5 + 0 + uq*3 + 4/7q*4 = 0? -1, 0, 2/7, 2 Let a(v) be the first derivative of 32 + 2/5v + 2/5v3 - 1/10v*4 - 3/5v*2. Factor a(u). -2(u - 1)*3/5 Let p = -4610 - -4614. Let n(z) be the first derivative of pz*2 - 2/3z*3 - 8z - 13. Factor n(q). -2(q - 2)2 Let m(v) be the third derivative of -5v*6/72 - 19v*5/24 + 5v*4/6 - 59v3/2 + v2 - 3. Let i(n) be the first derivative of m(n). Factor i(x). -5(x + 4)(5x - 1) Determine k so that 264k*2 - 224/3k*3 + 120 + 0k*4 - 932/3k + 4/3k5 = 0. -9, 1, 2, 5 Determine m so that -245m*3 - 4m*5 - 218m*3 - 4m*4 + 487m*3 = 0. -3, 0, 2 Suppose -1652 = -20o + 6o. Let g = -116 + o. Factor 43a*g + 4a3 + a2 + 0a3. 4a*2(a + 11) Let w(o) = -53 + o*2 - 41o + 3 + 50o. Let d be w(-13). Factor 1/3j + 1/3j3 - 4/3j*d + 2. (j - 3)(j - 2)(j + 1)/3 Let m(s) be the second derivative of -s4/18 + 16s*2/3 - 2072s. Factor m(w). -2(w - 4)(w + 4)/3 Determine u, given that -16/9 + 2/9u4 + 14/9u*2 + 22/9u*3 - 2/9u*5 - 20/9u = 0. -2, -1, 1, 4 Let i(r) = -3r - 21. Let s be i(-9). Suppose 14 = 5v - s. Factor -79c4 + 33c*2 + 36c - 6c3 + 76c*v - 99 - 9. -3(c - 2)*2(c + 3)*2 Let t(b) be the first derivative of -3b*4/4 + 9b*3 - 12b*2 + 4546. Factor t(f). -3f(f - 8)(f - 1) Let t(l) be the third derivative of -l*6/600 + 7l*5/75 + 91l*4/120 + 31l*3/15 + 9l*2 - 11l - 4. Suppose t(i) = 0. Calculate i. -2, -1, 31 Let v(t) be the third derivative of t*5/90 - 37t*4/36 + 160t*3/9 - 220t*2. Factor v(f). 2(f - 32)(f - 5)/3 Let i(h) be the first derivative of -h4/16 + 43h*3/12 - 49h*2/2 + 57h + 5116. Find z, given that i(z) = 0. 2, 3, 38 Let 27/4m3 - 1875/4 + 1425/4m + 423/4m2 = 0. What is m? -25/3, 1 Let g(h) be the second derivative of -5h*4/12 + 655h*3/6 + 665h*2 - 15h - 2. Factor g(s). -5(s - 133)(s + 2) Let k(j) be the first derivative of j*3/4 - 18j*2 - 75j + 316. Find q such that k(q) = 0. -2, 50 Suppose 60 = 4i + 8i. Suppose -5 = r + x, ir - 2x - 15 + 5 = 0. Factor -5/2y2 + r + 1/2y*4 - 1/2y*3 - 3/2y. y(y - 3)(y + 1)*2/2 Let s(u) be the first derivative of 25/2u*3 + 1/20u*5 - 15/2u*2 + 5/4u*4 + 0u - 4. Let f(t) be the second derivative of s(t). Factor f(d). 3(d + 5)2 Suppose -166 = 6r + 2. Let t be r/42(-4)/6. What is f in 2/9f*2 + 2/9f - t = 0? -2, 1 Let x = -3276 + 36038/11. Factor -16/11r4 + xr*5 + 12/11r*3 + 0 + 80/11r*2 + 50/11r. 2r(r - 5)*2(r + 1)*2/11 Suppose 0 = -4a - 4p + 16, -27a - 5p = -29a - 20. Suppose -f + 1 + 2 = a. Suppose 0v2 + 0 - 2/3v*5 - 4/3v*f + 0v + 2v4 = 0. Calculate v. 0, 1, 2 Let n(u) = 8u*2 + 825u - 1410. Let q(i) = -i*2 - 102i + 176. Let l(o) = 2n(o) + 17q(o). Determine r, given that l(r) = 0. -86, 2 Let s(l) be the first derivative of l*7/168 + 25l*6/72 + 47l*5/24 + 115l*4/24 - 31l*3 + 85. Let m(b) be the third derivative of s(b). Factor m(d). 5(d + 1)*2(d + 23) Let p be (-11 + 5)/((-3)/2). Suppose -8 = 2j + 2a, 8j + 16 = 3j - pa. Factor 11o*3 + 3o*3 + 3o5 + o3 + 12o4 + 6o*2 + jo*5. 3o*2(o + 1)*2(o + 2) Suppose 130 - 138 = -2m. Solve -4x*3 - 78x*2 - 18 - 51x + 6xm - 17x*3 - 18x = 0 for x. -1, -1/2, 6 Suppose 259q = 257q + 26. Determine u, given that 5u - 21u + 7u2 + q - 3u*2 + 3 = 0. 2 Let s be (2 + 0)-10 - (-51168)/2184. Factor 6/7l2 - s + 10/7l. 2(l + 3)(3l - 4)/7 Suppose -172o = -170o - 72. Let b be (-2)/12 + 18/o. Factor 0 + 1/3s*4 + 0s + bs2 - 2/3s3. s2(s - 1)2/3 Suppose m - 3c + 12 = 2, -3c = 2m - 16. Let v be (-152)/190(10/(-4))/1. Factor 10 + 0 + 0i*m - 11i - i + vi2. 2(i - 5)(i - 1) Suppose 2h + 18 - 2 = 2s, -2h - 22 = s. Let g be (h/4)/((-25)/20). Solve 2qg - 12 - 10q + q*2 - 5q - 6q2 = 0. -4, -1 Suppose 33 = a - 3d, 3a = -2a + 3d + 105. Let h be a/8(-4)/(-3). Factor -2p + 8 - 6p + 22p3 - 6p*2 + 0 - 14p*h - 2p*4. -2(p - 2)*2(p - 1)(p + 1) Let v = 480 - 614. Let p be v/(-56) - -1513/(-780). Determine i, given that pi2 - 36/7i + 12/7 = 0. 2/5, 2 Let p(z) be the first derivative of -4z3/7 + 9z*2/14 + 3z/7 - 314. Factor p(g). -3(g - 1)(4g + 1)/7 Let u(v) = v2 + 3v - 1. Let g(y) = -y*3 + 15y*2 - 9y + 21. Let d(p) = g(p) - 6u(p). Factor d(x). -(x - 3)3 Let m = 52 + -48. Suppose 6d - 3d + 4w + 2 = 0, -4w - 16 = -md. Factor 2/13c3 + 30/13c - 18/13cd + 50/13. 2(c - 5)*2(c + 1)/13 Factor -1192/7n - 2/7n*2 - 177608/7. -2(n + 298)2/7 Let p(r) be the second derivative of r7/2100 - r6/450 - r3/3 + 23r2/2 + 63r. Let v(q) be the second derivative of p(q). Find j, given that v(j) = 0. 0, 2 Let p(d) be the first derivative of d*6/40 + 3d*5/10 + 3d*4/8 - 5d*3 - 77d*2/2 - d + 141. Let n(z) be the second derivative of p(z). Factor n(h). 3(h - 1)(h + 2)(h + 5) Let p(r) be the second derivative of -2 + 1/72r4 - 6r + 11/12r3 + 0r*2. Factor p(x). x(x + 33)/6 Let t(p) = p*2 - 39p - 13. Let q be t(39). Let m be 4q/(-4) - 9. Let 1/2c*2 + 0 - c - 1/2cm + c3 = 0. What is c? -1, 0, 1, 2 Suppose 0 = 430p - 438p + 64. Let r be (-29 + 29)2/(p/(-2)). Suppose rb - 3/5b2 + 0 - 3/5b*5 + 3/5b*3 + 3/5b*4 = 0. What is b? -1, 0, 1 Let i = -19122 - -19122. Let t(l) be the second derivative of -1/2l*3 + 0 - 3/20l*5 - 1/2l*4 + il*2 - 43l. What is x in t(x) = 0? -1, 0 Let y = 5142303/13 - 395561. Factor 48/13 - 4/13o - yo*2 + 2/13o*3. 2(o - 4)(o - 3)(o + 2)/13 Let g(j) be the first derivative of 2j5/5 + 23j*4/2 + 126j*3 + 637j*2 + 1372j + 1437. Factor g(s). 2(s + 2)(s + 7)*3 Let m(d) be the third derivative of 0d + 9/4d4 + 2 - 19/840d*7 - 27/20d*5 + 1/1344d*8 + 0d*3 + 21/80d*6 - 17d*2. Solve m(n) = 0 for n. 0, 1, 6 Let o = -423175/3 + 141059. Factor -44/3a - oa2 - 242/3. -2(a + 11)2/3 Let k(t) be the third derivative of t5/90 + 31t4/36 - 22t*3/3 - 2576t*2. Factor k(j). 2(j - 2)(j + 33)/3 Determine s so that 8s*4 - 6s*3 - 187854s*2 - 12s + 22s3 + 187846s*2 - 4s5 = 0. -1, 0, 1, 3 Let w(j) be the first derivative of j6/150 + 2j5/25 + j4/10 - 4j*3/3 - 15j*2/2 + j + 42. Let r(q) be the second derivative of w(q). Factor r(l). 4(l - 1)(l + 2)(l + 5)/5 Let h(w) be the second derivative of 1/18w4 + 841/3w*2 - 31 + 2w - 58/9w3. Factor h(j). 2(j - 29)*2/3 Let t = 119 - 114. Suppose -10 = -tu + 5. Factor 3g4 + 4 + 76g*2 + 12g + 0 - 63g2 + 6g*u - 2g4. (g + 1)2(g + 2)2 Let t(m) be the first derivative of m7/3780 + m6/135 - 2m*3/3 + 3m + 60. Let q(v) be the third derivative of t(v). Factor q(b). 2b2(b + 12)/9 Let d(a) be the third derivative of a*8/728 - 2a*7/195 - 43a*6/780 + 53a*5/195 + 5a*4/13 - 24a*3/13 - 1795a2. Solve d(c) = 0 for c. -3, -1, 2/3, 2, 6 Let l(u) be the first derivative of -u3/3 + 15u2/2 + 154u - 1236. Factor l(v). -(v - 22)(v + 7) Let q be -24((-118082)/8 + 9 - 11). What is p in -q - 2/3p4 + 72p*3 - 2916p*2 + 52488p = 0? 27 Let x = 1146 - 8007/7. Let i = 4432/1729 - -2/247. Factor x + 3/7b2 - ib. 3(b - 5)(b - 1)/7 Let v be -4 + (13/(-12))/(3/(-12)). Let x be 4/12 + (-1)/6. Factor xt3 + 0 - vt - 1/6t2. t(t - 2)(t + 1)/6 Factor 133/2y*2 - 133/2 + 1/2y - 1/2y3. -(y - 133)(y - 1)*(y + 1)/2 Let l	{ "pile_set_name": "DM Mathematics" }
= -d*2 + 9d + 12. Let y be o(10). Suppose 0 = 3s - 20 + y. Suppose -f2 + sf*2 - 6f*2 + 2f*2 = 0. What is f? 0 Let z(x) = 6x + 2. Let h be z(2). Let u = 17 - h. Factor 32 - 30vu + 48v*2 + 0v + 49v + 12v*3 + 39v. -2(v - 4)(3v + 2)2 Find a such that a5 + 957 + 4a*2 - 4a3 - 957 - a4 = 0. -2, 0, 1, 2 Factor -442 + 11x3 + 3x*3 + 286 - 394x + 536x2. 2(x - 1)(x + 39)(7x + 2) Let j = -75 - -80. Let b(k) be the third derivative of 0k*j + 0k*3 + 0k*4 - 5k*2 - 1/175k*7 - 1/300k*6 + 0 + 0k. Factor b(w). -2w3(3w + 1)/5 Factor 10/7k*3 + 0 + 24k - 286/7k2. 2k(k - 28)(5k - 3)/7 Let f = 27230/5571 - -2/1857. Let v = -167/36 + f. Find x such that -vx*2 - 1/4x + 0 = 0. -1, 0 Let y be 2/(-12) + (-157)/(-942). Let x(u) be the third derivative of -1/44u4 + 0u - 1/660u6 + 1/110u*5 + 5u*2 + y + 1/33u*3. Factor x(l). -2(l - 1)*3/11 Let y(f) = -11f - 657. Let o be y(-60). Factor 1/5j2 + 1/5j*o - 1/5j*4 - 1/5j + 0. -j(j - 1)2(j + 1)/5 What is f in -878f + 1 + 0f*2 + 880f + f*4 - 3f3 - f2 + f*5 - 1 = 0? -2, -1, 0, 1 Let z be (419/(-95))/((-2)/5). Factor 0 + 8/3u3 + 2/3u*4 - 8/3u - 2/3uz. 2u(u - 1)(u + 1)(u + 4)/3 Let y = 588/5 - 117. Let i(x) = -x2 + 8x - 15. Let w be i(5). Solve -9/5c2 + 0 - 6/5c + wc3 + yc*4 = 0 for c. -1, 0, 2 Solve -32z*3 + 20z*4 - 8z*4 - 16z + 756z2 - 816z2 = 0. -1, -1/3, 0, 4 Let k(r) = r2 - 2r - 2. Let n be k(4). Let m be (-14)/(-7)n/4. Solve 2sm + 6 - 2s*3 - 3s*3 + 9s = 0. -1, 2 Let c(p) be the second derivative of -p6/720 + p5/80 - p*4/24 - 3p*3/2 + 3p. Let z(y) be the second derivative of c(y). Factor z(k). -(k - 2)(k - 1)/2 Let r = 34 + -42. Let i be 1/(2 + (-3 - 20/r)). Factor -2/3h - ih2 + 0. -2h(h + 1)/3 Let w = 103 - 64. Factor 76i + 27i2 - 56i*2 - 8 - wi*2. -4(i - 1)(17i - 2) Suppose 0 = 4y + 10y - 28. Let -6n3 - 18 + 0 - 31n + 687ny - 26n - 732n2 = 0. Calculate n. -6, -1, -1/2 Let n(t) be the second derivative of -t4/18 + t3/3 - 2t*2/3 + 8t + 1. Factor n(u). -2(u - 2)(u - 1)/3 Determine v, given that -25v3 - 453v + 473v - 2v*5 + 7v*5 = 0. -2, -1, 0, 1, 2 Let f = 5 - 3. Let q = -103 + 105. Suppose -15y*3 + 9y*4 + 12y*2 - 4y*q - 2y*f = 0. Calculate y. 0, 2/3, 1 Let a(j) be the first derivative of -2/7j - 2/21j3 + 8 + 2/7j*2. Suppose a(s) = 0. What is s? 1 Let y(t) = -3t3 + t2 + t. Let z be (45/(-35))/1 + (-4)/(-14). Let n be y(z). Determine x so that -2/3 - x + 0x2 + 1/3x*n = 0. -1, 2 Suppose -n = -5n - 4. Let m be n(0 + -1) - 0. Let b(d) = -d - 1. Let k(o) = 2o*3 + 2o*2 + 3o + 3. Let v(s) = mk(s) + 3b(s). Factor v(f). 2f2(f + 1) Let g = -374 + 378. Let b(y) be the second derivative of -y + 0y2 + 0 - 4/9y*3 - 1/3y*g - 1/15y*5. Factor b(p). -4p(p + 1)(p + 2)/3 Let y(a) be the first derivative of -a6/24 + a5/6 + 5a4/6 + 38a*3/3 + 45. Let c(r) be the third derivative of y(r). Let c(z) = 0. What is z? -2/3, 2 Let h = -1 + 1. Let x be h + 3/610. Determine w so that 37w2 - 37w*2 - 5w*5 + 11w*4 + 3w3 + wx = 0. -1/4, 0, 3 Suppose -4x + 24 = -32. Suppose -7t - 14t - 48 - xt*3 - 3t + 11t3 + 21t*2 = 0. Calculate t. -1, 4 Let j = 56 + -47. Solve -j + 108g*3 + 30g + 33g2 + 12 - 132g*2 - 6 = 0. 1/4, 1/3 Let o(w) be the third derivative of 0w - 5/42w7 - 1/6w6 - w2 + 0 - 1/15w5 + 0w*3 + 0w4. Factor o(p). -p2(5p + 2)*2 Let k(o) be the second derivative of 1/3o3 + o2 - 1/6o4 - 1/10o*5 + 0 - 8o. Find c such that k(c) = 0. -1, 1 Suppose 21j - 1194 = 66. Suppose 22x - j = 10x. Solve 21/4s + 3/2s3 + 21/2s*2 - 27/4s*x - 45/4s*4 + 3/4 = 0. -1, -1/3, 1 Let c be (-6)/(-8) - ((-67)/16 - -4)-4. Suppose -2/7h2 + 4/7h + c - 2/7h3 = 0. What is h? -2, 0, 1 Let h be 2 + 24/(-10) - 1397/(-55). Solve 17y + 5y4 - 18y - 11y3 - 9y*3 + hy*2 - 9y = 0. 0, 1, 2 Let r = 70754/41265 - 2/5895. Factor -6/7i3 + 0 + 18/7i*2 - ri. -6i(i - 2)(i - 1)/7 Let h be 10/((-90)/9)(-6 + 3 + 3). Let -6/19l2 + 2/19l*3 + h + 4/19l = 0. What is l? 0, 1, 2 Let -4f5 + 1386f*2 - 14 - 1258f*2 + 140f - 16f4 + 9 + 24f*3 + 53 = 0. What is f? -4, -1, 3 Suppose -2a + 0j - 25 = 5j, -j - 5 = a. Let -10x3 - 6x + 14x2 + ax + 0x + 10x*4 - 8x*4 = 0. What is x? 0, 1, 3 Factor -13g + 2g2 - 4g + 6g + 18 - g2. (g - 9)(g - 2) Let 82/17h - 12/17h*2 + 14/17 = 0. What is h? -1/6, 7 Let m be (-6)/40-1 - 2/(-8). Let d(x) be the first derivative of 4/5x3 - 4/5x*2 + 3 + 2/5x + 2/25x5 - mx*4. Solve d(j) = 0 for j. 1 What is h in 0 + 4/7h*3 - 16/7h*2 + 2/7h*4 + 0h = 0? -4, 0, 2 Let v(g) be the third derivative of 0g - 1/15g*5 + 1/168g*8 + 1/36g*4 + 0 + 0g*3 + 1/15g*6 - 8g*2 - 2/63g*7. Factor v(k). 2k(k - 1)3(3k - 1)/3 Let n(l) be the third derivative of -l8/560 + l7/35 - 3l*6/20 + 27l*4/8 + 3l*3/2 + 20l*2. Let p(s) be the first derivative of n(s). Factor p(o). -3(o - 3)*3(o + 1) Suppose -5 = y, -3w - 2y + 10 = -y. Suppose -4x + 35 = 5j, -2j - 3j + 2x + w = 0. Solve 11r*3 + 12r - 4rj - 10r*3 = 0 for r. -2, 0, 2 Let s(u) be the first derivative of -2/3u*3 + 4 + 4u + u*2. Suppose s(g) = 0. What is g? -1, 2 Let r be (-14)/(-56) - (-12854)/40. Let d = 322 - r. Find i such that 4/5i - 2/5 - di2 = 0. 1 Let d(f) = f2 + f + 1. Let u(n) = 6n - 12. Let o be u(3). Let z(t) = -6t3 - 3t*2 - 3t - 6. Let b(j) = od(j) + z(j). Factor b(c). -3c(c - 1)(2c + 1) Suppose -f2 + 8/5 - 1/5f*3 - 2/5f = 0. Calculate f. -4, -2, 1 Let m(y) = y*3 - 3y*2 - 9y. Let n be m(5). Factor 5f3 - 5f + 24f4 - nf*2 - 9f*4 - 10f*4. 5f(f - 1)(f + 1)*2 Let d be (10/30)/((-1)/3). Let t be (-13 - -39)/(3 + d). Factor 3v*3 + tv + 3v4 - 9v*2 - 25v - 3v2. 3v(v - 2)(v + 1)(v + 2) Let y be 6/(-15) + (-112)/(-5). Suppose -c + 25 - y = 0. Determine u, given that 2/3u*c + 0u*2 + 0 - 2/3u*5 + 0u*4 + 0u = 0. -1, 0, 1 Let m(c) be the third derivative of 1/2c4 + 0 - 1/30c*5 - 6c*2 + 0c - 3c3. Factor m(w). -2(w - 3)*2 Suppose 0 = -73d + 16d. Factor -2/3t*4 + dt*2 + 4/3t*3 + 0t + 0. -2t3(t - 2)/3 Let x(y) be the second derivative of -y*2/2 + 55y. Let z(n) = 3n2 + 1 + 2n + 0 + 4n. Let i(a) = 2x(a) - z(a). Factor i(d). -3(d + 1)2 Solve -160/3l + 0 + 4/3l2 = 0. 0, 40 Let q(t) be the first derivative of -t5/60 - t4/4 - 3t*3/2 - 17t*2/2 - 2t - 40. Let m(a) be the second derivative of q(a). Factor m(k). -(k + 3)*2 Solve -125a*2 + 122a*2 + 78a + 66a - 1728 = 0. 24 Suppose 18 = -a + 5a + 2x, 0 = -a + 5x - 23. Let l be 288/28 + (-4)/14. Factor l + 2k - 10 - 2k*a. -2k(k - 1) Let p(n) be the first derivative of n3/6 + 135n*2/2 + 18225n/2 - 443. Factor p(i). (i + 135)2/2 Let m(v) = -v2 - 2v. Let o(b) = 9b*2 - 32b + 12. Let k(j) = -2m(j) + o(j). Find x, given that k(x) = 0. 6/11, 2 Let u = 72 + -67. Suppose -3w = 2i - 12, -uw + 4 = -i - 3. Factor 1/5cw + 3/5c + 0. c(c + 3)/5 Factor -2h*2 + 32h - h*3 + 31h - 5h2 + 30h - 99h. -h(h + 1)(h + 6) Let i(d) be the first derivative of d6/10 + 5d*5/3 + 28d*4/3 + 32d*3/3 - 2d*2 - 13. Let w(r) be the second derivative of i(r). Factor w(x). 4(x + 4)*2(3x + 1) Let l(g) = -g + 12. Let r be l(15). Let p = 7 + r. Factor 16a*p - 5a*2 + 2 - 12a*4 + 3a*3 - 1 - 3a. (a - 1)(a + 1)2(4a - 1) Let l(o) be the third derivative of 0o + 1/672o8 + 0o*6 + 0o*4 + 1/420o*7 + 0 - 11o*2 + 0o*3 + 0o*5. Determine j so that l(j) = 0. -1, 0 Let w be (-23)/(-4) - 1/(-4). Suppose -2g - 5h = -8h + 11, -3g = -4h + 14. Factor 3yg - y4 + wy*3 - 6y + 0y4 - 2y*4. -3y(y - 2)(y - 1)(y + 1) Let y be (1 + -6)44/(-110). Factor -2/11zy - 2/11z + 2/11z4 + 2/11z*3 + 0. 2z(z - 1)(z + 1)*2/11 Let d be (25/(-300))/((-12)/192). Suppose dc - 49/3c2 - 49/3c*3 + 4/3 = 0. What is c? -1, -2/7, 2/7 Let g(x) = 23x - 72. Let u be g(7). Let t = 268/3 - u. Let -f*2 + 1/3f*4 + 5/3f - tf*3 - 2/3 = 0. Calculate f. -2, 1 Let o be (-12)/(-2 - 0) - 4. Suppos	{ "pile_set_name": "DM Mathematics" }
j3/21 + j2/7 + 3j. Factor b(m). 2(m + 1)*2/7 Let 28d*3 + 60d*2 + 108/7 - 468/7d = 0. What is d? -3, 3/7 Let x = 16 - 10. Let u(o) be the third derivative of 1/12o5 + 2/3o*3 + 0 + 3o*2 + 0o + 1/3o4 + 1/120o*x. Factor u(n). (n + 1)(n + 2)*2 Let a = 3 + 0. Solve 3c*3 + 3c - 3 + 3c2 + ca + 4 - 3c*3 = 0. -1 Let x(q) = 49q*3 + 31q*2 - 104q + 20. Let y(j) = -97j3 - 63j*2 + 207j - 40. Let n(a) = -7x(a) - 4y(a). Solve n(p) = 0 for p. -2, 2/9, 1 Suppose 4u + 1 = -3. Let b be 1 - u - (-6)/(-9). Solve -13/3j*4 - 2/3j*2 + 11/3j*3 + bj*5 + 0j + 0 = 0. 0, 1/4, 1, 2 Factor 2j - 16/9 - 2/9j*2. -2(j - 8)(j - 1)/9 Factor 20z*2 - 5z*3 - 12z - 90 + 10z3 - 3z. 5(z - 2)(z + 3)*2 What is h in 0 + 14/15h - 2/15h2 = 0? 0, 7 Let w be (8/6)/(6/9). Let t be 4 + -3 + w + -1. Factor 1/5y + 1/5yt + 0. y(y + 1)/5 Let g(i) be the third derivative of i6/40 - i5/20 - 4i2. Factor g(p). 3p*2(p - 1) Let b(z) = 6z5 + 13z*4 - 13z*3 - 13z*2. Let a(u) = -4u*5 - 9u*4 + 9u*3 + 9u*2. Let s(t) = 7a(t) + 5b(t). Factor s(v). 2v*2(v - 1)(v + 1)2 Let h(k) be the third derivative of k8/840 - 2k7/525 - k6/300 + k*5/75 + 31k*2. Determine v, given that h(v) = 0. -1, 0, 1, 2 Let b(x) be the third derivative of -1/24x*4 + 0x + 2x2 - 1/120x*5 + 0 + 0x3. Determine j, given that b(j) = 0. -2, 0 Let x(w) be the second derivative of w5/150 + w*4/9 + 28w*3/45 + 8w*2/5 - 10w. Suppose x(n) = 0. What is n? -6, -2 Let i be (8/(-168))/(-1 + 0). Let q(z) be the second derivative of -1/35z5 - 1/7z*2 + 1/35z*6 + 0 + 2z - iz4 + 1/7z*3 - 1/147z*7. Factor q(l). -2(l - 1)*4(l + 1)/7 Suppose -5k = -2s - 16, 4s + 4k + 0k = 24. Let p(g) be the first derivative of 2 - 1/2g*4 + 0g*s - 1/5g*5 - 1/3g*3 + 0g. Factor p(l). -l*2(l + 1)2 Let t(i) be the second derivative of i7/7560 - i6/1080 - i5/120 - i*4/3 - 5i. Let z(f) be the third derivative of t(f). Let z(d) = 0. Calculate d. -1, 3 Factor -2/7z4 + 6/7z - 6/7z3 + 0 + 2/7z*2. -2z(z - 1)(z + 1)(z + 3)/7 Let u(x) be the first derivative of -x4/24 + 2x*3/9 - 5x*2/12 + x/3 + 4. Factor u(q). -(q - 2)(q - 1)*2/6 Let a(n) be the second derivative of 0 - 3n + 0n5 - 1/120n*6 + 0n*3 + 0n*2 + 1/48n4. Factor a(p). -p2(p - 1)(p + 1)/4 Let f = -55 + 221/4. Determine s so that 0s - f + 1/4s*2 = 0. -1, 1 Let i(h) be the second derivative of -20h*7/21 + 62h*6/15 - 26h5/5 - h4/3 + 4h3 - 19h. Solve i(w) = 0 for w. -2/5, 0, 1, 3/2 Let a = -3/91 + 100/273. Let v = 34 + -101/3. Factor 1/3 - vt2 + 1/3t - at3. -(t - 1)(t + 1)*2/3 Let n = 9 + -4. Determine r, given that -4r*4 + 4r*2 + 12r*4 - 10r*3 - 2r*5 + 0r*n = 0. 0, 1, 2 Let a(g) = -g + 13. Let o be a(9). Let oj*4 - 7j*5 - 2j*4 + 9j*5 - 2j*2 - 2j3 = 0. Calculate j. -1, 0, 1 Let o(r) be the third derivative of -r9/60480 + r8/10080 - r5/30 - 2r2. Let t(w) be the third derivative of o(w). What is m in t(m) = 0? 0, 2 Let q = 66 - 62. Suppose -c = -t, 2t - 10 = -3c - 0c. Let -6/5d + 4/5 - 2/5d*c - 2/5d*q + 6/5d3 = 0. Calculate d. -1, 1, 2 Let j(w) = -w2 - 5w - 3. Let b be j(-3). Let h(o) = o - 6. Let s be h(10). Factor 0z*2 + 2z*b - 2z*4 + sz*4 - 2z*2 - 2z*5. -2z*2(z - 1)*2(z + 1) Let u be -3 + (0/(-3))/(-3). Let j be 4 - (6-1)/u. Let 0z + 0 + 2/11zj = 0. Calculate z. 0 Let l(x) = -3x + 2. Let b be l(-2). Suppose 0 = -bd + 6d. Determine j so that -1/4j2 + d + 0j = 0. 0 Let z(s) = -s*3 - 8s*2 - 8s - 7. Let k be z(-4). Let a = 119/3 + k. Factor -6 - 4j - aj*2. -2(j + 3)*2/3 Let j be 0/(39/45 + 22/165). Let y = 21 + -83/4. Factor jt*2 - 1/4t*3 + yt + 0. -t(t - 1)(t + 1)/4 Let x be (-469)/(-91) + -1 - 4/26. Let s(p) be the first derivative of 0px - 1/5p - 2 + 0p2 - 1/25p*5 + 2/15p*3. Determine l, given that s(l) = 0. -1, 1 Let r(f) = -2f*2 - 37f - 18. Let m be r(-18). Factor m + 1/4k - 1/4k*2. -k(k - 1)/4 Suppose 0 = 2o + r + 26, -51 = 3o - 2r - 12. Let m be 12/(-30) + o/(-20). Factor 1/2 + 1/4t - mt2. -(t - 2)(t + 1)/4 Let h(m) be the second derivative of -m*7/27 + 19m*6/135 + 2m*5/9 - 40m*4/27 + 32m*3/27 + 16m*2/9 - 15m. Solve h(y) = 0. -2, -2/7, 1, 2 Let v(f) be the first derivative of -16/7f + 8/7f*2 + 3 - 4/21f*3. Factor v(u). -4(u - 2)2/7 Let i(c) be the third derivative of c8/1680 + 2c7/525 + c6/120 + c5/150 - 9c2. Suppose i(m) = 0. What is m? -2, -1, 0 Let i = 1438/165 + -90/11. Let b = i + -1/5. Factor 1/3 + t2 - bt3 - t. -(t - 1)3/3 Let m = 5 + -5. Let o be ((-3)/9)/(8/(-6)). Factor -1/4b*3 + m + ob*2 + 0b. -b*2(b - 1)/4 Factor 0 + 17/2l2 + 3l + 5/2l3. l(l + 3)(5l + 2)/2 Suppose 0 = -0b + 3b. Let r(z) be the third derivative of -2/3z3 + 0 - 1/60z*5 + 1/6z*4 + bz + z*2. Suppose r(l) = 0. Calculate l. 2 Let i(o) be the first derivative of -3o*4/4 - 16o*3/3 - 15o*2/2 + 18o + 31. Determine a so that i(a) = 0. -3, 2/3 Suppose 5q + 2 = -8. Let b = q + 2. Factor 6/5l + bl2 - 2/5l*3 - 4/5. -2(l - 1)*2(l + 2)/5 Let f be (4/(-6))/((-10)/12). Let h(x) be the first derivative of 0x3 - 2 - 1/10x*4 - fx + 3/5x2. Factor h(t). -2(t - 1)*2(t + 2)/5 Suppose 4 = 2p, 0 = 2f - 4f - 4p + 16. Let c(t) be the first derivative of 0t3 + 1/12t*f + 0t + 0t2 + 3. Factor c(n). n3/3 Let a = 50 - 16. Let p be a/(-51)(-9)/2. Let 2/11c4 + 0 - 4/11c*2 + 0c + 2/11cp = 0. Calculate c. -2, 0, 1 Let j(a) be the second derivative of -a5/90 + 2a*4/27 - 11a. Factor j(m). -2m2(m - 4)/9 Let o = -5 + 7. Factor -4 + 2k3 - 2k + 5 + k*4 - o. (k - 1)(k + 1)3 Let q(w) = w2 + 2w. Suppose 4 = -3m - 2. Let x be q(m). Suppose x - 2 + 6v2 - 4v*2 = 0. Calculate v. -1, 1 Let r(g) = 2g + 4. Let l be r(0). Let q(n) be the third derivative of -2n2 + 1/2n*5 - 4/3n*3 + 0n + 0 + n*l + 1/15n*6. Determine f so that q(f) = 0. -2, 1/4 Let u(h) be the first derivative of -8h*3/15 + 2h*2 - 8h/5 + 14. Factor u(m). -4(m - 2)(2m - 1)/5 Let m(i) = i3 - 3i + 4. Let k be 0 + -7 + (-1 - -2). Let r(j) = -j*2 + j. Let g(f) = kr(f) - 2m(f). Let g(s) = 0. What is s? -1, 2 Let r(w) be the first derivative of 4/5w - 1/10w4 + 1/5w*2 - 4/15w*3 - 9. Factor r(s). -2(s - 1)(s + 1)(s + 2)/5 Let f(l) be the first derivative of 3 - 2/3l2 + 1/9l*3 + 4/3l. Factor f(t). (t - 2)*2/3 Let p(y) = -8y*4 - 6y*3 + 4y*2 - 6y - 2. Let g(m) = 6m + m3 - 2m + 0m4 + m4 - 3m. Let l(o) = 6g(o) + p(o). Factor l(r). -2(r - 1)*2(r + 1)2 Let z(t) be the third derivative of t7/210 - t*5/60 - 13t*2. Determine k, given that z(k) = 0. -1, 0, 1 Let v = 38 - 113/3. Let q(n) be the second derivative of 4n + 1/12n4 + 0 + vn*3 + 1/2n2. Factor q(c). (c + 1)2 Let v be ((-2)/(-10))/(6/10)1. Let 4/3d*2 + v - 5/3d = 0. What is d? 1/4, 1 Let z(a) be the second derivative of a*7/21 + 2a6/15 - a5/10 - a*4/3 + 2a. Solve z(f) = 0 for f. -2, -1, 0, 1 Let w(v) = 2v2 + 6v - 3. Let s(l) = -9l2 - 24l + 12. Let f(r) = 5s(r) + 21w(r). Let f(u) = 0. What is u? 1 Let o be 26/20(92 - -6). Let a = -127 + o. Suppose -1/5y*2 - 3/5y*3 - 1/5y*4 + a + 3/5y = 0. What is y? -2, -1, 1 Let a(j) be the first derivative of 35j4/24 - 5j*3/9 + 16. Factor a(t). 5t*2(7t - 2)/6 Let g = 1681/48 - 35. Let t(i) be the second derivative of -1/168i*7 + 1/80i*5 + 0i*3 + gi*4 + 0i*2 - 2i + 0 - 1/120i6. Factor t(k). -k2(k - 1)(k + 1)2/4 Factor 2/13y + 2/13 - 4/13y4 - 10/13y*3 - 6/13y*2. -2(y + 1)*3(2y - 1)/13 Factor 1/4y*2 + 1/2y*4 + 3/4y*3 + 0 + 0y. y*2(y + 1)(2y + 1)/4 Suppose 11g - 26 + 4 = 0. Suppose 0 - 1/5d*g + 1/5d = 0. What is d? 0, 1 Let l(j) be the third derivative of j5/60 - j3/6 - 7j2 - 2. Factor l(g). (g - 1)(g + 1) Factor 0i + 0 - 1/10i2. -i2/10 Let z(j) be the third derivative of 1/15j5 + 0j - 1/24j4 - 3/112j*8 + 1/60j*6 + 0 - 2/35j*7 + 3j*2 + 0j*3. Factor z(f). -f(f + 1)*2(3f - 1)2 Suppose 20 = c + 4c. Let p(w) be the second derivative of 2w - 1/9w*3 + 1/6w*c + 0w	{ "pile_set_name": "DM Mathematics" }
44877952 = 0. Calculate z. -9639, -584 Factor 6s2/7 + 297098s/21 + 132040/21. 2(s + 16505)(9s + 4)/21 Suppose -10v*5/13 - 2954v*4/13 + 51720v*3/13 - 22840v*2/13 - 117440v/13 - 3072 = 0. Calculate v. -312, -1, -2/5, 2, 16 Factor -2v2/3 + 6374684v/3 - 5079574512482/3. -2(v - 1593671)2/3 Find q such that 27q*3/7 + 1484199q*2/7 + 1978896q/7 + 659628/7 = 0. -54969, -2/3 Factor -5t2 - 132950t - 4514520. -5(t + 34)(t + 26556) What is f in -f*5/5 - 37f*4 - 665f*3 + 13473f*2 + 391266f/5 + 64152 = 0? -162, -33, -4, -1, 15 Suppose -3t2 - 352506t + 36339945 = 0. Calculate t. -117605, 103 Let -2z4/5 + 62z*3/5 + 86580z*2 = 0. Calculate z. -450, 0, 481 Factor 2h*3/9 + 1542h*2 + 9251536h/3 + 12233314912/9. 2(h + 611)(h + 3164)2/9 Find f, given that -f5 + 69947f4 + 979394f*3 + 4197610f*2 + 3498175f - 8745125 = 0. -5, 1, 69961 Factor i*3 + 491i*2 - 6639574i - 13281104. (i - 2344)(i + 2)(i + 2833) Solve -2x3/9 - 121106x*2/9 - 1835813056x/9 - 75064893952/9 = 0. -30256, -41 Suppose 4i2 - 45881560i + 131569846752100 = 0. What is i? 5735195 Determine z so that -4z3 + 99728z*2 - 99724z = 0. 0, 1, 24931 Factor 2d3/5 - 57012d*2/5 + 407433858d/5 - 3241252624. 2(d - 14233)2(d - 40)/5 Solve -5c3 - 1457825c*2 - 5831235c - 4373415 = 0 for c. -291561, -3, -1 Let 5w5 + 1810w*4 + 217400w*3 + 8776800w*2 + 15016320w - 66908160 = 0. What is w? -132, -96, -4, 2 Let -2l3/9 + 26420l*2/9 - 1999256l/9 + 12643664/3 = 0. Calculate l. 38, 13134 Factor 3b2/2 - 825747b/2 - 4128885. 3(b - 275259)(b + 10)/2 Solve -3n2 - 24074220n - 72222633 = 0 for n. -8024737, -3 Factor 2i2/5 - 46484i/5 - 127242768/5. 2(i - 25716)(i + 2474)/5 Find k such that k*2 + 52031489k = 0. -52031489, 0 What is u in 3u4/4 + 71339223u*3/4 - 214017687u*2/4 + 214017693u/4 - 17834808 = 0? -23779744, 1 Factor -369x2 - 4857558x + 3238536. -3(3x - 2)(41x + 539756) Factor 353y2/5 + 13394234y/5 + 75888/5. (y + 37944)(353y + 2)/5 Suppose -2g5/7 + 8384g*4/7 + 75576g*3/7 + 176444g*2/7 - 8342g/7 - 252060/7 = 0. Calculate g. -5, -3, -2, 1, 4201 Factor -3l3/4 - 76368l*2 - 9460983l - 293201100. -3(l + 62)2(l + 101700)/4 Solve -5s5 + 17580s*4 + 158755s*3 - 458070s*2 - 634940s + 1551000 = 0. -11, -2, 2, 3525 Factor -2k2/5 + 416406k/5 - 24782276. -2(k - 207905)(k - 298)/5 Suppose 8r3/3 - 6979612r*2/9 + 507444838384r/9 + 422875545620/9 = 0. What is r? -5/6, 145409 Let -l*2/5 - 656l - 595791/5 = 0. What is l? -3087, -193 Find s, given that 2s2 - 10475156s = 0. 0, 5237578 Let -2p3/11 + 766670p*2/11 - 2299996p/11 + 1533328/11 = 0. Calculate p. 1, 2, 383332 Suppose 2o2/3 + 4055o/6 + 52066 = 0. Calculate o. -3719/4, -84 Let m*5/2 - 2132m*4 + 2980346m*3 - 1292481080m*2 - 102809715616m + 210765546880 = 0. What is m? -70, 2, 1444 What is o in -25o4 + 302485o*3 + 1997559o*2 - 835321o + 84742 = 0? -7, 1/5, 12106 Factor g*2/4 + 19395g/2 - 1048059/4. (g - 27)(g + 38817)/4 Solve -j2 - 252079j/5 + 756282/5 = 0. -252094/5, 3 Suppose -l*4/2 - 73l*3/2 - 267l*2/2 + 657l/2 + 1242 = 0. What is l? -69, -4, -3, 3 Let 18u5/5 + 25522u*4/5 + 24888u*3 + 135552u*2/5 - 135808u/5 - 45216 = 0. Calculate u. -1413, -2, 10/9 Factor 3l2/2 + 682555143l/4 - 341277573/4. 3(l + 113759191)(2l - 1)/4 Suppose -2s*3/9 + 132301024s*2/9 + 264602054s/9 + 132301028/9 = 0. Calculate s. -1, 66150514 What is m in m*4/2 - 730385m*3/2 + 177819775551m*2/2 - 14430371144465419m/2 - 28862164870507694 = 0? -4, 243463 Suppose -i*2 + 18473i - 3473770 = 0. What is i? 190, 18283 Let -10y5 - 616y*4/3 - 1148y*3/3 + 10600y*2/3 - 8806y/3 = 0. What is y? -17, -7, 0, 1, 37/15 Factor q*2/4 + 24968q + 1098471/4. (q + 11)(q + 99861)/4 Solve 3p*5/4 + 1083p*4 + 89763p*3/4 + 81111p*2/2 = 0 for p. -1423, -19, -2, 0 What is r in -1185r*5 + 37970r*4 + 76610r*3 - 6108420r*2 - 30458785r + 1296050 = 0? -7, 10/237, 23 Suppose m*3 + 408797m*2 + 6949260m = 0. Calculate m. -408780, -17, 0 Factor 5x2 - 7535x + 2141300. 5(x - 1127)(x - 380) Let -3t3/5 + 25116t*2/5 - 3043509t/5 - 3068628/5 = 0. Calculate t. -1, 124, 8249 Find h, given that h*2/6 + 10977h + 724361/6 = 0. -65851, -11 Factor -2w2/11 - 2551192w - 8949298353688. -2(w + 7015778)2/11 Factor -2o*2/5 - 554652o/5 - 29390938/5. -2(o + 53)(o + 277273)/5 Determine k, given that 24k5 + 1776972k*4 - 297079221k*3/2 + 724261467k*2/2 - 153325251k + 18012132 = 0. -74124, 1/4, 2, 81 Factor -d*3/3 - 129596d*2/3 + 2592820d - 38896800. -(d - 30)*2(d + 129656)/3 Let x*2/10 - 355903x/5 - 711808/5 = 0. What is x? -2, 711808 Solve 25s4 + 832060s*3 + 1164835s*2 = 0 for s. -33281, -7/5, 0 Factor -3g*2/4 - 5500167g + 22000671/4. -3(g - 1)(g + 7333557)/4 Determine u, given that 4u2/3 + 311432u/3 = 0. -77858, 0 Suppose 4h3 + 7348h*2 - 2955000h + 34394976 = 0. What is h? -2178, 12, 329 Determine b so that -5b3 + 300260b*2 + 1801775b - 2102030 = 0. -7, 1, 60058 Let -3l4 - 6012l*3 + 3317595l*2 - 9874476l - 13198080 = 0. What is l? -2455, -1, 4, 448 Let p*2/6 - 168764689p/3 + 28481520253266721/6 = 0. Calculate p. 168764689 Determine m, given that m*5/4 + 12081097m*4/4 + 36488268464655m*3/4 + 255417287279175m2/4 = 0. -6040545, -7, 0 Find o such that o5/3 + 592o4/3 - 14337o*3 - 678682o*2/3 - 3268120o/3 - 1705600 = 0. -656, -5, -4, 78 Factor v*3 + 4956v*2 - 154597v. v(v - 31)(v + 4987) Factor -5i3 - 2530540i*2 - 320267655600i - 21766500936000. -5(i + 68)(i + 253020)*2 Suppose -5a*3/3 + 4550a*2 - 3150375a + 183602500/3 = 0. What is a? 20, 1355 Suppose -4w5 - 3704w*4 - 178072w*3 + 3231680w*2 - 17096900w + 29279000 = 0. Calculate w. -874, -67, 5 Determine b, given that -22b4/13 + 20552b*3/13 + 1517088b*2/13 + 25218432b/13 - 62456832/13 = 0. -36, 24/11, 1004 Find x, given that 147x4 + 87801x*3 + 7706520x*2 + 17271744x + 9804288 = 0. -491, -104, -8/7 Factor d*3 + 8211d*2 - 29218896d + 22071332444. (d - 1414)*2(d + 11039) Determine k, given that -k*3/6 - 43853k*2/3 - 467685k/2 - 219225 = 0. -87690, -15, -1 Solve 7l5/5 + 9011l*4/5 - 525562l*3/5 - 2407136l*2/5 - 128928l = 0. -1343, -4, -2/7, 0, 60 Solve 2t4 + 5294t*3 - 63998t*2 - 483734t + 542436 = 0 for t. -2659, -6, 1, 17 Factor -2z2 - 1424042756z - 253487221364509442. -2(z + 356010689)2 Suppose -d4/11 + 30401d*3/11 - 231131184d*2/11 + 1154896020d/11 = 0. Calculate d. 0, 5, 15198 Solve 3k5/4 + 117k*4/4 - 2991k*3 - 118611k*2 - 1074060k = 0. -68, -18, 0, 65 Factor 2d4 + 15532d*3 - 5225494d*2. 2d*2(d - 323)(d + 8089) Factor -k3/2 + 72967k*2 + 2043223k/2 + 3575726. -(k - 145948)(k + 7)2/2 Factor -2c*2/15 + 196434824c/15 - 4823330009988872/15. -2(c - 49108706)2/15 Factor -3j*4 - 903j*3 + 2748j*2 + 3648j. -3j(j - 4)(j + 1)(j + 304) Suppose -3v2 - 9055020v - 6832782266700 = 0. Calculate v. -1509170 Factor 3p3 - 1954761p*2 - 13683498p + 15638256. 3(p - 651594)(p - 1)(p + 8) Factor -3i*3 + 531i*2 + 125172i + 370656. -3(i - 312)(i + 3)(i + 132) Find v, given that v3 + 418687v*2 = 0. -418687, 0 Find b, given that 4b*5 - 1980b*4 - 149132b*3 - 832788b*2 - 685640b = 0. -61, -5, -1, 0, 562 Find d, given that d*3/3 + 1625d*2/3 - 3367d - 171255 = 0. -1631, -15, 21 Let 2r4/9 - 32r*3/3 - 18926r*2/9 - 10220r = 0. What is r? -73, -5, 0, 126 Factor -z*2/3 + 15191z/3 - 191938. -(z - 15153)(z - 38)/3 Find g such that -g3 + 2078g*2 - 937851g + 2794878 = 0. 3, 657, 1418 Factor -t*4/4 + 7036t*3 - 28143t2/4. -t2(t - 28143)(t - 1)/4 Suppose 2d4/9 - 44054d*3/9 + 80930794d*2/3 - 2179275586d/9 - 12604600424/9 = 0. Calculate d. -4, 13, 11009 Find d such that -5d2 + 1927230d - 25053145 = 0. 13, 385433 Suppose 9c5 - 21309c*4 + 99303c*3 - 134703c*2 + 28344c + 28356 = 0. Calculate c. -1/3, 1, 2, 2363 Factor 2633d2/9 - 4222d/9. d(2633d - 4222)/9 Factor 2m2 + 2898m + 445900. 2(m + 175)(m + 1274) Solve f*3/2 + 107f*2 - 16396f - 2163840 = 0. -2	{ "pile_set_name": "DM Mathematics" }
w2 + 20014w/11 + 10006/11 = 0. -5003, -1 Factor -81x4/4 + 3405x*3/2 - 126x*2. -3x*2(x - 84)(27x - 2)/4 Find q such that -2q4/9 + 36950q*3/9 - 25284748q*2 + 467262118408q/9 - 467034592624/9 = 0. 1, 6158 Factor 3i2/7 - 6489948i/7 + 3509952086892/7. 3(i - 1081658)2/7 Solve 2q*5 - 340q*4 - 3544q*3 - 10032q*2 - 8640q = 0. -6, -2, 0, 180 Solve -2i3/15 + 1318i*2 = 0 for i. 0, 9885 Factor -3s*3/8 - 21831s*2/8 + 494235s/4. -3s(s - 45)(s + 7322)/8 Determine i, given that i3/5 - 5909i*2/5 + 2363i - 5907/5 = 0. 1, 5907 Suppose d*5/5 + 44d*4/5 - 487d*3/5 - 106d*2 = 0. What is d? -53, -1, 0, 10 Factor 5k*2 - 380k + 375. 5(k - 75)(k - 1) Let -3f4/4 + 429f*3 - 75519f*2 + 3810792f - 7322928 = 0. Calculate f. 2, 82, 244 Factor n*3/4 - 1251n*2/2 + 14969n/4 + 4368. (n - 2496)(n - 7)(n + 1)/4 Determine g, given that 6g5 - 458g*4 + 7274g*3 - 25174g*2 + 23728g - 5376 = 0. 1/3, 1, 3, 16, 56 Factor -3r2 - 173979r - 521910. -3(r + 3)(r + 57990) Factor l*3/7 - 99l*2 + 14666l - 202560/7. (l - 480)(l - 211)(l - 2)/7 What is n in 3n3 - 567n*2 - 14070n + 30384 = 0? -24, 2, 211 Factor 2p3/7 + 52p*2/7 - 338p + 17576/7. 2(p - 13)2(p + 52)/7 Determine n, given that n*3 + 105n*2 - 8641n - 8745 = 0. -159, -1, 55 Let -4p4 - 1152p*3 + 22048p*2 + 4608p - 88128 = 0. Calculate p. -306, -2, 2, 18 Solve -4i4/7 + 152i*3/7 - 800i*2/7 - 1448i - 9180/7 = 0 for i. -5, -1, 17, 27 Suppose 2q3 - 1590q*2 - 63554q + 204918 = 0. What is q? -41, 3, 833 Let -196q5 - 28896q*4 - 971476q*3 - 2146104q*2 + 1466960q - 221088 = 0. Calculate q. -98, -47, -3, 2/7 Let 4h2 + 392h + 3204 = 0. Calculate h. -89, -9 Factor 4l3 + 5288l*2 - 260736l + 3156480. 4(l - 24)2(l + 1370) Find o such that -o*5/5 + 28o*4 - 272o*3/5 - 554o*2/5 + 273o/5 + 414/5 = 0. -1, 1, 3, 138 Find b such that -b*5/2 + 91b*4/2 - 2245b*3/2 + 22729b*2/2 - 50519b + 80948 = 0. 4, 7, 14, 59 Let -14u2/3 + 11002u + 4716 = 0. What is u? -3/7, 2358 Find x such that 3x2/4 - 1503x/4 + 72705/2 = 0. 131, 370 Find p such that 2p4/5 + 76p*3 + 2912p*2/5 = 0. -182, -8, 0 Determine s so that 2s*4/9 - 530s*3/9 + 14564s*2/9 - 4328s/3 - 3120 = 0. -1, 2, 30, 234 Factor -2n2 + 25756n + 645150. -2(n - 12903)(n + 25) Let -4w2 - 288w + 900 = 0. What is w? -75, 3 Solve v*3/4 + 121v*2/2 + 10229v/4 - 2618 = 0. -187, -56, 1 Suppose 5l5 - 2380l*4 + 34620l*3 - 20410l*2 - 154225l - 96810 = 0. What is l? -1, 3, 14, 461 Suppose -f*5/8 - 11f*4/4 - 39f*3/8 + 437f*2/4 - 497f/2 + 147 = 0. What is f? -14, 1, 2, 3 Determine y so that -4y2/7 - 144y/7 + 1840/7 = 0. -46, 10 Factor -b*2/2 + 17237b - 297114169/2. -(b - 17237)*2/2 What is b in 4b*2/5 + 4268b/5 = 0? -1067, 0 Suppose -v*4 + 182v*3 + 3155v*2 + 2604v - 5940 = 0. Calculate v. -15, -2, 1, 198 Suppose 2q5 + 160q*4 + 274q*3 - 2908q*2 + 4344q - 1872 = 0. What is q? -78, -6, 1, 2 What is f in -3f3 + 1170f*2 + 11973f + 10800 = 0? -9, -1, 400 Factor -5d2 - 1660d + 15345. -5(d - 9)(d + 341) Suppose -2t2/15 + 184t/15 - 1298/5 = 0. Calculate t. 33, 59 Factor 2v5 + 316v*4 - 640v*3 + 4v*2 + 638v - 320. 2(v - 1)3(v + 1)(v + 160) Factor 4a*2 + 966376a + 58367660836. 4(a + 120797)2 Let 3w*4/4 + 241w*3/2 - 1169w*2/4 - 1133w + 1304 = 0. What is w? -163, -8/3, 1, 4 Find f, given that -2f4/9 - 38f*3/3 - 68f*2 + 64f/9 + 1088/3 = 0. -51, -4, 2 Determine t, given that -3t2/2 - 255453t - 21752078403/2 = 0. -85151 Factor 2f2/9 - 350f/9 - 200. 2(f - 180)(f + 5)/9 What is o in 2o5/7 + 90o*4/7 + 178o*3/7 - 3498o*2/7 - 2412o - 3024 = 0? -42, -4, -3, 7 Determine l, given that -3l3 - 2679l*2 + 8076l + 10752 = 0. -896, -1, 4 Suppose 2n3/3 + 442n*2/3 + 4108n/3 - 23632/3 = 0. Calculate n. -211, -14, 4 Let -y*2/11 - 233y - 5122/11 = 0. Calculate y. -2561, -2 Solve g*3/11 + 117317g*2/11 - 117320g/11 - 234636/11 = 0. -117318, -1, 2 Factor -3u2 - 1797u - 3582. -3(u + 2)(u + 597) Suppose -3f4/2 + 327f*3 - 1284f*2 = 0. Calculate f. 0, 4, 214 Factor -22m*3/7 - 90m*2 - 5226m/7 - 9802/7. -2(m + 13)2(11m + 29)/7 Factor -n4 - 67n*3 - 912n2. -n2(n + 19)(n + 48) Solve 3s3 - 29856s*2 + 328053s = 0 for s. 0, 11, 9941 Find i, given that 2i4/7 - 12262i*3/7 + 18800710i*2/7 - 18788450i/7 = 0. 0, 1, 3065 Factor -4n3 + 236n*2 - 4480n + 27648. -4(n - 27)(n - 16)*2 Determine a so that -5a*3 - 35845a*2 - 64261120a - 64225280 = 0. -3584, -1 Let 5d2 - 348290d + 6065296205 = 0. What is d? 34829 Find v, given that -3v4/7 + 1581v*3/7 + 3v*2 - 11049v/7 - 9486/7 = 0. -2, -1, 3, 527 Find u, given that -2u4/7 + 146u*3/7 - 1364u*2/7 = 0. 0, 11, 62 Determine g, given that -3g*4 - 222g*3 - 1437g*2 - 2010g = 0. -67, -5, -2, 0 Factor 5x2 - 917700x. 5x(x - 183540) Determine i so that -5i5 - 130i*4 - 925i*3 - 1340i*2 + 2400i = 0. -15, -8, -4, 0, 1 Factor 2c2 - 75288c + 708535368. 2(c - 18822)2 Factor 2v*3 + 278v*2 + 6478v - 237158. 2(v - 19)(v + 79)2 Determine g, given that g4 + 509g3 - 1022g*2 = 0. -511, 0, 2 Factor -4u*2/3 + 248u - 12692/3. -4(u - 167)(u - 19)/3 Let 4b2 + 1952b + 168448 = 0. Calculate b. -376, -112 Factor r*4/5 - 253r*3/5 + 6966r*2/5 - 18648r/5. r(r - 222)(r - 28)(r - 3)/5 Factor -5h*4 + 42h*3 - 44h*2 - 168h + 256. -(h - 2)*2(h + 2)(5h - 32) Determine p so that -5p4 - 3610p*3 - 7185p*2 + 10800p = 0. -720, -3, 0, 1 Determine k, given that k*2 + 10440k + 27248400 = 0. -5220 Suppose -c*4/6 - 30c*3 - 59c*2/2 + 179c/3 = 0. What is c? -179, -2, 0, 1 Determine h, given that 4h3 + 19344h*2 - 38700h + 19352 = 0. -4838, 1 Factor -2w3 - 950w*2 - 17396w - 31008. -2(w + 2)(w + 17)(w + 456) Factor 5l*3 - 135l*2 + 655l - 525. 5(l - 21)(l - 5)(l - 1) Let 3m*2 + 8718m + 711144 = 0. What is m? -2822, -84 Let -6a5 - 555a*4 - 12633a*3 + 8688a*2 + 50628a - 25872 = 0. What is a? -49, -44, -2, 1/2, 2 Factor m*5/2 + 3m*4/2 - 2m2. m2(m - 1)(m + 2)*2/2 Factor 2p*4 - 44154p*3 - 132474p*2 - 132478p - 44160. 2(p - 22080)(p + 1)*3 Let -4y*4/7 + 44y*3 - 7964y*2/7 + 75052y/7 - 161472/7 = 0. Calculate y. 3, 16, 29 Factor 3b2 + 18123b + 54342. 3(b + 3)(b + 6038) Find n such that n*5/3 - 47530n*4/3 + 564870268n*3/3 - 752827682n*2 - 941133615n = 0. -1, 0, 5, 23763 Find o, given that -2o4 + 4254o*3 - 4234o*2 - 38286o + 38268 = 0. -3, 1, 3, 2126 Factor 4o3 - 452o*2 - 3808o - 7744. 4(o - 121)(o + 4)*2 Suppose -7v*5 - 1285v*4/9 + 9767v*3/9 + 5167v*2/3 + 4876v/9 + 364/9 = 0. What is v? -26, -1, -2/7, -1/9, 7 Factor 28p2/5 - 8012p - 11448/5. 4(p - 1431)(7p + 2)/5 Factor 430t*3 - 15875t*2 + 121685t + 10010. 5(t - 26)(t - 11)(86t + 7) Factor 10r3 + 12194r*2 + 4870r - 7314. 2(r + 1)(r + 1219)(5r - 3) Suppose 5j5 - 183j*4 - 97j*3 + 843j*2 + 308j - 444 = 0. What is j? -2, -1, 3/5, 2, 37 Find j such that j*5/5 - 12798j*4/5 - 25599j*3/5 - 2560j2 = 0. -1, 0, 12800 Factor c2/4 - 4383c. c(c - 17532)/4 Solve 3s2 + 323196s + 8704637868 = 0. -53866 Factor 4m3 - 576m*2 + 12636m. 4m(m - 117)(m - 27) Factor -4h*2/3 - 107056h - 2148935088. -4(h + 40146)2/3 Suppose 15z*4 + 189z*3 + 432z*2 - 60z - 576 = 0. What is z? -48/5, -2, 1 Factor -2p3/15 - 104p*2 - 101918p/5 - 605284/15. -2(p + 2)(p + 389)*2/15 Find k such that -2k*5 - 8878k*4 - 221132k*3 - 1908256k*2 - 6215936k - 4519936 = 0. -4414, -8, -1 Suppose 2u2/9 - 1966u/3 + 11788/9 = 0. What is u? 2, 2947 Determine x so that 26x5 - 1804x*4 + 2198x*3 + 16892x*2 + 7424x - 5440 = 0. -2, -1, 5/13, 4, 68 Find j such that -j*5 - 27j*4 + 1491j*3 - 2773j*2 - 4290j = 0. -55, -1, 0, 3, 26 Find m, given that 2m3 + 238044m*2 + 476082m + 238040 = 0. -119020, -1 Determine g so that -2g5 - 1385g*4/2 - 80213g*3 - 3141110g*2 - 3822025g - 1520875/2 = 0. -115, -1, -1/4 Find h, given that 238h2/3 + 922h/3 - 40 = 0. -4, 15/119 Factor -2s2/5 - 5212s	{ "pile_set_name": "DM Mathematics" }
third derivative of p(g) wrt g. -240g3 Let u(a) be the second derivative of -7a*3 + 8a*2 + 32a - 1. Differentiate u(o) wrt o. -42 Find the third derivative of 370q - 2q*2 - 4q*4 - 362q + 4q3 - 2q*3 wrt q. -96q + 12 Suppose -10 = -3x - x - 3c, -x + 3c - 5 = 0. Let l be 32/10 - x/5. Find the second derivative of -v - vl - 3v*3 + 3v wrt v. -24v Let m(c) be the first derivative of -9c*4/4 + 11c*2/2 + 8. Find the second derivative of m(n) wrt n. -54n Suppose -2x - 14 = -0i - 2i, -6 = 2i + 3x. What is the second derivative of -ti - 2t*3 + 37t - 32t wrt t? -18t Let z(g) = 2g - 4. Let r be z(2). Let t(v) be the third derivative of -1/20v*5 + 0v + 0 + v*2 + rv*4 - 1/3v*3. Differentiate t(a) with respect to a. -6a Suppose -6 - 5 = -x. Suppose -3 = 2a - x. Find the third derivative of 4y + 4y2 - 2y - 2y + 4y*a wrt y. 96y Let w(z) be the third derivative of -8z7/105 - z5/15 + 5z*2. What is the third derivative of w(r) wrt r? -384r Let h(f) = -13f3 + 5f*2 - 9. Let x(s) = 13s*3 - 6s*2 + 10. Let d(y) = -6h(y) - 5x(y). Differentiate d(k) with respect to k. 39k*2 Suppose -6s + 2 = -10. What is the second derivative of f*2 + f + 0f - 9f + 4f*s wrt f? 10 Let y(w) be the second derivative of 17w*4/12 - 2w*3/3 - 6w*2 + w - 33. What is the second derivative of y(n) wrt n? 34 Let g(r) = r - 5. Let o be g(14). What is the derivative of 1 - 7a*3 + 9a*3 + 3a*3 - o wrt a? 15a*2 Let d(m) = -3m2 - m. Let h(n) = -n2 - n + 1. Let g be (-1 + 2)8/(-4). Let r(t) = gh(t) + 2d(t). Differentiate r(j) with respect to j. -8j Let n = 6 - 3. Let o be n/216/(-3). Let y(c) = 7c*2 + 13c. Let f(j) = 11j2 + 20j. Let q(r) = oy(r) + 5f(r). Find the second derivative of q(k) wrt k. -2 Let p(i) = i*3 + 4i*2 - 2i - 5. Let a be p(-4). Find the third derivative of 6l3 - 3l*3 - al*2 + 4l2 + l2 wrt l. 18 Find the first derivative of 22 + 30 + 31 - 21k - 55 wrt k. -21 Let f(d) = 9d*4 - 5d - 7. Let w(u) = -5u4 + 3u + 4. Let x(z) = -3f(z) - 5w(z). What is the first derivative of x(b) wrt b? -8b3 Let v(l) = l3 - 6l*2 + l - 4. Let y be v(6). Suppose -x = x - 4. Find the third derivative of -2t*3 - 2 + yt*2 + 2 - xt*3 wrt t. -24 Let i be (-1 - -1)/(2 + 1). What is the second derivative of iy*4 + 3y - 3y4 + 0y*4 wrt y? -36y2 Let k(r) be the first derivative of r6/3 + 5r2 - 2. What is the second derivative of k(f) wrt f? 40f*3 Let w = -11 + 15. What is the third derivative of -2pw - p2 - 3p4 - p4 wrt p? -144p Let b(x) be the second derivative of -x*5/20 + 5x*3/6 - 7x. Find the second derivative of b(n) wrt n. -6n Suppose -7 - 8 = -5l. Let b(o) = -o*3 - 3o*2 + 5o + 7. Let j be b(-4). Find the third derivative of -5zj + 5z*3 - 3z*3 + lz*2 wrt z. -18 What is the third derivative of 8n*2 + 9n*4 + 5n*2 - 5n*2 + 3n*4 wrt n? 288n Let k be 2 + (-2)/8 + (-6)/(-24). Let f(a) be the first derivative of k + 3a - 1/2a2. What is the derivative of f(z) wrt z? -1 Let p(x) be the second derivative of x9/5040 + x7/2520 + x4/12 - x. Let o(u) be the third derivative of p(u). Find the third derivative of o(b) wrt b. 72b Let f(t) be the second derivative of -5t*3/6 + 11t*2/2 + 8t. What is the derivative of f(p) wrt p? -5 Suppose 0 = -w + 5w. Let c(r) be the first derivative of 0r*3 - 1/2r*2 + 1/2r*4 + wr - 2. Find the second derivative of c(k) wrt k. 12k What is the third derivative of 4q*4 - 3q*4 + 2q*2 - 5q*4 - 6q*2 wrt q? -96q Suppose -2j = 3j. Let k be (-4 - -7) + 1 + j. Differentiate -2 + 1 - 3ck + 5c*4 with respect to c. 8c*3 Let b(y) be the third derivative of 0 + 1/6y*4 + 1/2y*3 + 0y + 3y2. Differentiate b(t) with respect to t. 4 Let k be (3 - 0)2/2. Suppose -2x + k = 6a - 3a, -4a + 2x + 18 = 0. Find the second derivative of 2f*5 - 4f*3 + 4f*a + 2f wrt f. 40f3 Let j(r) = -15r*2 - 11r + 2. Let m(i) = -150i2 - 111i + 21. Let u(q) = 21j(q) - 2m(q). Find the second derivative of u(n) wrt n. -30 What is the second derivative of -2c5 + c - 8c*5 - 6c wrt c? -200c3 Let t = -24 - -28. Suppose 5f - 4d - 9 = 0, -d - 4 = -6f + 3f. Find the third derivative of -1 + f - j2 + jt wrt j. 24j Let t(f) = 4f2 + 23f - 130. Let y(b) = -2b2 - 11b + 66. Let l(g) = -3t(g) - 5y(g). Differentiate l(z) wrt z. -4z - 14 What is the second derivative of -10l - 7l + 12l - l2 wrt l? -2 Let x(o) be the first derivative of o4 - o*3/3 - 1. Find the third derivative of x(f) wrt f. 24 Suppose 4l - 39 = -11. Let x = -4 + l. Find the second derivative of -2ux + 2u + u*3 - 3u wrt u. -6u Suppose -7s + 12 = -3s. Find the third derivative of 0n*3 + 1 + sn2 - 1 - n3 wrt n. -6 Let j(m) be the second derivative of -16m6/15 - 13m*3/6 + 29m. Find the second derivative of j(y) wrt y. -384y2 Let n be (1/1)/111. Let z(p) = 16p2 + p4 + 11 - p + p. Let u(f) = -3f*2 - 2. Let q(j) = nu(j) + 2z(j). What is the third derivative of q(v) wrt v? 48v What is the third derivative of -617l - 14l*3 + 4l*2 + 617l wrt l? -84 Let w(l) be the first derivative of -9l4/4 + 2l*3/3 - 3. Find the third derivative of w(r) wrt r. -54 Let a(u) = -31u*3 + 4u*2 - 4u + 41. Let r(c) = 62c3 - 7c*2 + 7c - 83. Let y(m) = 7a(m) + 4r(m). Differentiate y(d) with respect to d. 93d2 What is the third derivative of -36j*5 - 27j*5 - 14j*2 + 56j*5 wrt j? -420j*2 Let d(o) = 4o*3 + 4o*2 + 6. Let f(r) = -8r*3 - 9r*2 - 13. Let l(j) = 9d(j) + 4f(j). Differentiate l(y) wrt y. 12y*2 Suppose -w = 2a - 5w - 12, -4a + 4w + 16 = 0. Find the second derivative of 0j - aj + 2j3 + j3 wrt j. 18j Let y be (-51)/(-12) + 2/(-8). Find the third derivative of 0w2 - w4 - 3w2 + w4 + 2w*y wrt w. 48w What is the second derivative of 8d + 0d*2 - 2 + 3d2 + 2 wrt d? 6 Let q(n) = n4 - n*3 - n - 1. Let w(r) = 16r*4 - 5r*3 - 4r*2 - 5r - 5. Let c(h) = 10q(h) - 2w(h). Find the third derivative of c(a) wrt a. -528a Let x(f) = f + 6. Let y be x(-4). Let i be (8/y)/(-2) - -6. What is the third derivative of -4c*i + 3c*4 + 2c4 - c2 wrt c? 24c Find the first derivative of 350k*2 + 7 + 9 - 361k*2 wrt k. -22k Let j(o) be the third derivative of -6o2 + 0o*3 - 1/112o*8 + 0o*7 - 7/24o*4 + 0o*6 + 0 + 0o*5 + 0o. What is the second derivative of j(v) wrt v? -60v3 Let j(d) = 2d*3 - 6d*2 - 5d + 6. Let k(u) = 5u3 - 17u*2 - 15u + 17. Let y(v) = 17j(v) - 6k(v). Find the second derivative of y(x) wrt x. 24x Suppose 1 = 5f - 4. Let j(m) = 1. Let n(x) = 2x + 7. Let k(p) = fn(p) - 6j(p). Find the first derivative of k(l) wrt l. 2 Let i(r) = -97r*4 - 17r*3 - 17r*2 + 17r - 1. Let v(f) = 16f4 + 3f*3 + 3f*2 - 3f. Let j(l) = -6i(l) - 34v(l). Differentiate j(x) wrt x. 152x3 Let t(n) be the first derivative of -3n*5/5 - 11n - 11. Differentiate t(o) wrt o. -12o3 What is the second derivative of 3w*3 - 7w*3 + 12w*3 + 3w*3 - 21w wrt w? 66w Suppose -a + 5 = -0a. Let b(r) = -r*3 - 6r*2 - 5r + 2. Let j be b(-5). What is the third derivative of -al2 + 4l*4 - jl*4 + 7l*2 wrt l? 48l What is the first derivative of 2 + 6 + 2v4 - 2 + 10v*4 wrt v? 48v*3 What is the third derivative of 8i + 8i - 21i*2 - 16i - 2i4 wrt i? -48i Let b(v) be the second derivative of -v8/840 - v7/315 - 5v4/12 - 7v. Let d(y) be the third derivative of b(y). Find the third derivative of d(n) wrt n. -48 Let o(f) = 2. Let t(r) = -4r - 29. Let x(v) = 4o(v) + 2t(v). What is the first derivative of x(s) wrt s? -8 Let f(u) be the second derivative of 1/6u*4 + 0u*3 + 0u*5 + 1/7u*7 + 0 + 0u*2 + 0u*6 - 4u. What is the third derivative of f(x) wrt x? 360x2 Let d(t) be the second derivative of -t5/20 - t2/2 - 4t. Let y(u) = 3u3. Let h = -8 + 6. Let f(x) = hd(x) - y(x). Differentiate f(i) with respect to i. -3i2 Let u(z) be the first derivative of -2 + 0z + 0z2 - 3/7z*7 + 0z*4 + 0z*5 + 0z*6 + 5/3z*3. What is the third derivative of u(o) wrt o? -360o**3 Let o be ((-12)/(-14))/(1/7). Wh	{ "pile_set_name": "DM Mathematics" }
3h. -2h Collect the terms in -57m + 41m + 52m. 36m Collect the terms in 896q2 - 1775q*2 + 893q*2. 14q*2 Collect the terms in 3c - c + 0c - c. c Collect the terms in -2q*3 + 6q*3 - 5q*3 + 0q3. -q3 Collect the terms in -90a2 + 190a*2 - 107a*2. -7a*2 Collect the terms in -9x*3 + 4x*3 + 17x*3 + 2x*3. 14x*3 Collect the terms in -2m + 3m - 4m + 8m. 5m Collect the terms in -15r + 10r + 9r + 3r + 4r. 11r Collect the terms in -15y + 13y + 4y3 + 2y. 4y3 Collect the terms in -25h - 26h + 52h. h Collect the terms in -c + 2c2 - 4c*2 + 8c. -2c2 + 7c Collect the terms in 32k + 43k + 14k. 89k Collect the terms in 3l - 4l + 6l. 5l Collect the terms in -198r - 2r*2 + 257r + r2. -r2 + 59r Collect the terms in 60 - 60 + 20i. 20i Collect the terms in -2 - 28s + 5 - 22s. -50s + 3 Collect the terms in 4f3 + 20f*3 - 7f*3. 17f3 Collect the terms in -y2 - 1 + 6y2 + 1. 5y*2 Collect the terms in -1002791 - 2q + 1002791. -2q Collect the terms in 35q*2 - 64q*2 + 34q*2. 5q*2 Collect the terms in -28783b + 13443b - 19143b. -34483b Collect the terms in -244z*3 + 468z*3 - 228z*3. -4z*3 Collect the terms in -103 - 63d*2 + 211 - 108. -63d*2 Collect the terms in 261 - 8z + 263 - 524. -8z Collect the terms in -63t*2 - 130t*2 + 2 + 0. -193t*2 + 2 Collect the terms in -4x - 11x - 9x. -24x Collect the terms in 5o*3 + 18o*3 - 21o*3. 2o*3 Collect the terms in -36q*3 + 48q*3 - 25q*3. -13q*3 Collect the terms in 3068 + 51j - 3068. 51j Collect the terms in 6s*3 + 7s*3 + 39s*3 - 5s*3. 47s*3 Collect the terms in 7 + 17j*2 - 14j*2 - 7. 3j*2 Collect the terms in 38g*2 + 33g*2 - 104g*2 + 25g*2. -8g*2 Collect the terms in 4w + 7w + w - 23w + 6w. -5w Collect the terms in -131g2 + 244g*2 - 112g2. g2 Collect the terms in 28x2 - 2x + 33x2 + 26x*2. 87x*2 - 2x Collect the terms in -2636 + 2636 - x3. -x3 Collect the terms in -2h2 - 2h*2 - 3h*2 + 5h*2. -2h*2 Collect the terms in -792n*2 - 789n*2 + 1585n*2. 4n*2 Collect the terms in 1234g*2 + 1233g*2 + 1241g*2 - 3707g2. g2 Collect the terms in -213b - 663 + 663. -213b Collect the terms in b3 - b3 - 9b3 + 14b*3. 5b*3 Collect the terms in -263v + 243v - 5 + 5. -20v Collect the terms in 11n2 - 6n*2 - 13n*2 - 12n*2. -20n*2 Collect the terms in -9 + 31w*3 + 9. 31w*3 Collect the terms in 3o*3 - 5o*3 - 12o*3 + 6o*3. -8o*3 Collect the terms in -d + 151d*3 + d. 151d*3 Collect the terms in 7r - 3r - 13r - 7r. -16r Collect the terms in 9p + 4p - 20p. -7p Collect the terms in -151g3 - 13g*2 + 13g*2. -151g*3 Collect the terms in 279d - 137d - 148d. -6d Collect the terms in 2i*3 - 2i*3 - 7i*3. -7i*3 Collect the terms in -7t*2 + 11 - 11. -7t*2 Collect the terms in -37 + 37p - 103p + 37. -66p Collect the terms in 3 - 537v3 - 3 + 529v*3. -8v*3 Collect the terms in 0k3 - k3 + k2 - k3. -2k3 + k2 Collect the terms in -9f + 29f - 9f - 12f. -f Collect the terms in -2n*3 + 5n*3 + 0n*3. 3n*3 Collect the terms in 56l + 11l - 17l + 42l. 92l Collect the terms in 4c3 + c2 + 8c*2 - 9c*2 + 0c*3. 4c*3 Collect the terms in -3 - 4 + 7 - 26j. -26j Collect the terms in -1395b*2 + 693b*2 + 699b*2. -3b*2 Collect the terms in 4u*2 - 2u*2 + 22u*2 - 7u*2. 17u*2 Collect the terms in -14 + 7v*3 + 34 - 20. 7v*3 Collect the terms in -1097f*2 + 2191f*2 - 1096f*2. -2f*2 Collect the terms in -5 + 5 + 9g - 20g. -11g Collect the terms in 147d2 - 2 + 2. 147d*2 Collect the terms in -190m + 68m + 64m + 60m. 2m Collect the terms in -67 - 4l + 4l*3 + 67. 4l*3 - 4l Collect the terms in -12w + w + 9w. -2w Collect the terms in 0r + 414r3 - 438r*3 + 0r. -24r3 Collect the terms in y3 + 9 + 18 - 27 + y3. 2y*3 Collect the terms in -509t*2 + 102t*2 - 988t*2. -1395t*2 Collect the terms in 5o*3 + 6o3 - o3. 10o3 Collect the terms in -17 - 4l2 + l3 - 6 + 4l2. l3 - 23 Collect the terms in -2s*2 - 3s*2 - 4s*2 + 2s*2. -7s*2 Collect the terms in -316y - 1111y - 126y. -1553y Collect the terms in 3 + 70v - 3 - 36v - 35v. -v Collect the terms in -12t3 - 9t*3 + 19t*3. -2t*3 Collect the terms in -25s*2 - 17s*2 + 59s*2 - 21s*2. -4s*2 Collect the terms in 10m*2 + 2579 - 2579. 10m*2 Collect the terms in 73d*2 - 73d*2 + 27d*3 - 26d3. d3 Collect the terms in 9 - 8k + 10 - 19. -8k Collect the terms in -250n3 + 2 + 0 - 2 + 242n*3. -8n*3 Collect the terms in -384y*2 - 331y*2 + 716y2. y2 Collect the terms in 21b3 - 9b*3 + 13b*3. 25b*3 Collect the terms in -2s*2 - 123302s + 123302s. -2s*2 Collect the terms in 32f - 30f + 13f. 15f Collect the terms in 77p*2 - 24p*2 - 24p*2 - 27p*2. 2p*2 Collect the terms in -2b - 12b2 + 5b*2 + 2b. -7b2 Collect the terms in 37b2 - b2 + 3b2. 39b2 Collect the terms in -r2 + 3r - 7r + 4r. -r2 Collect the terms in 3h*3 + 2h*3 + 2h*3 - 4h3 + h3. 4h3 Collect the terms in -17f*2 + 0f*2 + 15f*2. -2f*2 Collect the terms in z + 2 - 2 + 0z + 4z. 5z Collect the terms in -28r3 + 15r*3 + 33r*3. 20r3 Collect the terms in b3 + 725293 - 725293. b*3 Collect the terms in -11s - 14s3 + 0s + 4s + 7s. -14s3 Collect the terms in 794c*3 - 994c*3 + 4396c*3. 4196c*3 Collect the terms in -2159r + 2159r - 4r*2. -4r*2 Collect the terms in -316i + i*2 + 316i. i2 Collect the terms in -z2 + 11 - 7z2 - 3 + 0z*2. -8z*2 + 8 Collect the terms in -6 + 6 - 59g + 69g. 10g Collect the terms in g + 8874 - 8874. g Collect the terms in -34y3 + 70y*3 - 37y3. -y3 Collect the terms in 400j - 129j - 138j - 127j. 6j Collect the terms in -4l*3 - 2l*3 + 470l*2 - 470l*2. -6l*3 Collect the terms in -30g - 15g + 6g. -39g Collect the terms in -2l - 3 - 11 + l. -l - 14 Collect the terms in 1 + 9h - 3 - 2 + 4. 9h Collect the terms in -346o - 13 + 13. -346o Collect the terms in -2k - 12k - 9k + 26k. 3k Collect the terms in 4i*3 - 5i3 + i3 - i*3 + 118i. -i*3 + 118i Collect the terms in 67c3 - 23c*3 - 20c*3 - 21c*3. 3c*3 Collect the terms in -l - l - 51 + 5l. 3l - 51 Collect the terms in -10g*3 + 245g + 2g3 - 246g. -8g3 - g Collect the terms in -30k + 25k + 17k. 12k Collect the terms in -31w*2 + 48w*2 - 16w2. w2 Collect the terms in -27s2 + 3s + 1 - 3s. -27s*2 + 1 Collect the terms in 18i*2 - 269i*2 + 29i*2. -222i*2 Collect the terms in 11a*3 - 13a*3 - 18a*3. -20a*3 Collect the terms in -101j*3 + 49j*3 + 56j*3. 4j*3 Collect the terms in 130t - 243t + 117t. 4t Collect the terms in -7 - g - g - 8 + 0. -2g - 15 Collect the terms in 68 - 12r + 58 - 126. -12r Collect the terms in -h - 1598h2 - h + 2h. -1598h2 Collect the terms in -339t*2 + 158t*2 - 512t*2. -693t*2 Collect the terms in -32v - 1200 + 1200. -32v Collect the terms in -40p - 31p - 54p + 3p2 - 2p. 3p2 - 127p Collect the terms in -39a2 + 45a*3 + 39a*2. 45a*3 Collect the terms in 59d + 58d - 121d. -4d Collect the terms in -3 - 21x*2 - 7x*2 + 26x*2. -2x*2 - 3 Collect the terms in -18764 + 18764 - 192v*3. -192v*3 Collect the terms in 107 + 5w*2 - 11w*2 - 4w*2 + 8w*2. -2w*2 + 107 Collect the terms in 153y*2 + 2 - 2. 153y*2 Collect the terms in 43q*2 + q + 0q - 27q2. 16q*2 + q Collect the terms in 0d + 0d + 15d*2 + 18d*2. 33d*2 Collect the terms in 54995u - 1 - 54995u - 8u*3 + 1. -8u*3 Collect the terms in 7n*2 + 11n*2 - 17n2. n2 Collect the terms in 18m3 - 8m*3 + 12m*3 + 6m*3. 28m*3 Collect the terms in -1 + 648z*2 - 633z*2 + 1. 15z*2 Collect the terms in -3u*3 - 57u - 59u + 165u - 49u. -3u*3 Collect the terms in 607s*2 - 607s*2 - 3s*3. -3s*3 Collect the terms in -1 - 29a*3 + 13a*3 + 17a3. a3 - 1 Collect the terms in 186t2 - 377t*2 + 186t*2. -5t**2 Collect	{ "pile_set_name": "DM Mathematics" }
s + jq and give j. -413 Rearrange (3 - 5 + 4)(-159q2 + 173 + 298q*2 - 135q*2) to the form iq + d + gq2 and give g. 8 Express (0 + 75r*2 - 107r*2 + 2)(-5 + 1 + 5 + (3 + 3 - 5)(-4 + 3 + 3) - 3 + 0 + 4 - 3 + 1 + 0 - 1 - 2 + 4) in the form qr*2 + or + m and give m. 6 Express -19s - 1792s*2 + 1796s*2 + 6s in the form a + gs2 + cs and give a. 0 Express 12q - 1 - 6q + 8q + q as fq + w and give w. -1 Rearrange (-4z2 + 2z*2 + 4z*2)(0z - 3z + 0z) + (-5z2 + z2 - 47z2)(-2z - z + 2z) to wz2 + x + jz + lz3 and give l. 45 Express -11h*3 - 10h - 9h + 26h - 2h - 1 - h2 - 9h as bh2 + jh + kh3 + x and give x. -1 Express 3v*4 - 3v*4 - 2v*4 + (-2v - 6v4 + 2v)(100 - 46 - 43) as nv + kv3 + j + gv*2 + fv*4 and give k. 0 Express 2m + 9 + 29 + 12m + 2m*3 - 15m in the form y + cm2 + am*3 + pm and give a. 2 Express (2 + 0 - 4)(-4 + 4 + 2i)(-457i*2 + 0i + 4i + 452i*2 + (2i*2 + i - i)(-1 + 0 + 2)) as pi3 + r + wi*2 + ji and give p. 12 Rearrange -163g2 + 33g*2 + 74g*2 - 2g*3 - 4 to the form q + vg*3 + hg*2 + lg and give v. -2 Rearrange (2i - 2i - i)(0i - 2i + i)(85i - 97i + 64i) to the form gi + d + mi3 + li*2 and give m. 52 Rearrange -2i*3 - 25i*3 + 55i*3 + 5i*3 - 3i3 - i3 + (0i + 0i - i)(3i2 + i2 - 5i2) to the form li*3 + h + vi*2 + oi and give l. 30 Rearrange 7y - 10y2 + y4 + 32y3 + 17y*3 + 30y*3 - 76y*3 + 1 to the form by*4 + r + cy*3 + zy + jy2 and give b. 1 Rearrange (-5p*2 - 14p + 14p)(-97 + 13p2 + 97 + (1 - 1 - p)(p - p + 2p)) to the form lp*3 + kp*4 + ip*2 + r + vp and give k. -55 Rearrange -2 + 1 + 9b4 - b2 + 7b*4 - 17b4 - b3 - 5b to the form ob*2 + s + lb*3 + nb*4 + fb and give n. -1 Rearrange -n*3 - 8n + 3 + 15n4 - 2 - 3n*4 + 10n to the form wn3 + sn + l + vn4 + rn*2 and give w. -1 Express 169c*3 + 188c*3 - 374c*3 + 4c*2 in the form fc + sc3 + bc*2 + r and give b. 4 Rearrange (43525v*3 + 4v*2 - 6v*2 - 43510v*3)(4v + v - 3v) to s + nv4 + hv*2 + mv*3 + uv and give m. -4 Express (-18w2 + 25w - 25w)(-2 - 1 + 2)(-4w2 + w2 + w*2) + (-9 + 9 + 2w)(-4 + 2w*3 + 4) as mw*2 + ow*3 + pw*4 + bw + c and give p. -32 Rearrange -57u - 3u*2 + 71u + 28u - 6u*2 to y + xu + nu2 and give x. 42 Express -1861 - c + 1861 as g + dc and give d. -1 Rearrange 327n4 + 323n4 + n3 - 652n4 + 1 + 0 + 2n to the form ln + gn*4 + bn*2 + yn*3 + o and give l. 2 Express 197969q*2 + 10q*4 + 8q - 197967q2 + 14q + 2q3 in the form tq*4 + lq*3 + fq*2 + mq + b and give m. 22 Rearrange 5w - 5w*4 - 5w + (5 - w*3 - 5)(171 - 171 + 28w) to qw*4 + zw*2 + xw*3 + b + pw and give q. -33 Rearrange -218l2 - 15l + 14l + 61l*2 to tl*2 + bl + f and give t. -157 Rearrange b*2 - 2 - 3b*3 + 6b*4 + 5b - 2b4 + b2 - 5b*4 to wb + qb3 + v + xb*4 + hb*2 and give x. -1 Express -7 - 7 - 161b + 2 + 13 as w + ib and give w. 1 Rearrange (323h + 647h + 743h + 568h)(-2 + 4 - 1) to the form j + mh and give m. 2281 Express 69 + 6z + 71 + 5z2 - 208 + 67 + z4 + 2z*4 as jz*4 + r + vz*2 + dz + kz3 and give r. -1 Rearrange (3 - 8 - 1)(45l + 8l + 19l) to p + wl and give w. -432 Rearrange 104b + 1140 - 1140 to the form h + fb and give f. 104 Rearrange -2985t + 2985t + 2t3 - 5t*2 + (t - 3t + t)(2 - 2 - 2t*2) to the form w + ct + it3 + xt2 and give x. -5 Express y2 - 2 - y*3 + 7y*2 - 9y*4 + 8y*4 + 3 in the form ay*4 + wy*2 + oy*3 + k + uy and give o. -1 Express -424z3 - 60z + 3 + 217z3 + 209z*3 as k + tz + mz3 + vz*2 and give k. 3 Rearrange -50a*2 - 126a*2 + 21a*2 + (2a + 0a - 4a)((2a - 4a + 4a)(-4 + 6 + 0) - 2 + 2 - 2a) to the form oa + fa*2 + u and give f. -159 Rearrange 47 - q + 182q*2 - 180q*2 + q to oq + g + sq2 and give s. 2 Rearrange -1 + 4 + 1 - 9 + 14c*2 to the form oc*2 + ac + s and give s. -5 Express -2g3 - 4g*3 - g + 5g*3 + (-5g*3 - 8g*2 + 8g*2)(13 + 40 - 24) in the form qg + tg*2 + ag*3 + i and give a. -146 Express 3w*3 - 4w*3 + 2w*3 + (-3w + 0w + 0w)(-67w*2 - 68w*2 + 144w*2) as i + aw*2 + kw*3 + pw and give k. -26 Rearrange 467o2 + 972o*2 + 30o*2 + 572o*2 + 453o*2 + (-2 + o + 2)(-1 + 1 - o) to the form p + go + fo*2 and give f. 2493 Rearrange (-33815c + 34208c - 4 + 4)(2 - 4 + 1 + (4 - 3 - 2)(2 + 1 - 1)) to the form yc + x and give y. -1179 Express 133v - 249v + 125v - 5 in the form j + nv and give j. -5 Rearrange (-10 - 59 - 209)(-2w*2 + 2w*2 + 2w*4) to the form kw*2 + hw*4 + yw + i + fw3 and give y. 0 Express -3v - 492v2 - 30v*3 - 490v*2 + 980v*2 as nv*2 + cv + zv3 + a and give c. -3 Rearrange (-5j + 103 - 103)(-28j*2 + 32j*2 - 3j + 0j) to yj + kj2 + h + uj*3 and give u. -20 Express (-2215463 - 2376b + 2215463)(2b*2 - 2b*3 - 2b*2) as n + yb*2 + lb*4 + wb + ab3 and give l. 4752 Express -6 + 4h + 2h + 4h + 13h - 52h in the form wh + f and give w. -29 Express -h4 - 5h*2 + 20h*2 + 2h3 - 2 + h3 - 9h - 16h*2 as yh + ih3 + fh*4 + q + dh*2 and give f. -1 Rearrange (6 + 0 - 2)(5l3 - 11 + 11)(4 + 1 - 4) + 1 + 7l3 + 585l*2 - 585l*2 to the form gl*3 + ol + il2 + k and give k. 1 Rearrange -63c*2 + 10c - 54c2 + 3 - 10c + 41c2 to a + lc + tc2 and give t. -76 Express (4m - 25m - 6m)(-1 - 5 + 1)(0 + 0 + 2) as a + ym and give y. 270 Rearrange 359c*2 + 31 - 348c*2 - 17 to the form dc*2 + oc + t and give t. 14 Rearrange (-2f3 + f3 + 2f*3)(2f + f - 5f) - 338f2 + 3f*3 + 8f*4 + 338f*2 to kf*4 + af*2 + c + df*3 + uf and give k. 6 Express 115 + 19 + 2a - a - 2a in the form wa + u and give u. 134 Rearrange 65 - 64 - 6c*2 + 0c3 + c + c3 to the form xc2 + lc + y + dc3 and give d. 1 Rearrange 89 + 97 - 136c - 186 to tc + l and give t. -136 Rearrange 5p - 64p2 + 11 + 62p*2 - p + p to gp + mp2 + a and give m. -2 Express 3 - 3 + 312a - 1 in the form t + ma and give t. -1 Rearrange -410d*2 + 198d*2 + 210d*2 - 208d*3 to od + cd2 + g + jd*3 and give j. -208 Express (3f - 4 + 4)(7f - 7f - 9f) + 5f2 - 3f*2 + 0f*2 + (-5f + 4f + 2f)(0f - 3f + 6f) in the form lf2 + w + sf and give l. -22 Rearrange 28n2 - 3 - 1 + 3 - 104n*2 to the form x + an*2 + wn and give x. -1 Express h*4 - 2h4 - h4 - 1 + 1 + h*4 + (0 - 1 + 3)(2h + 2h*4 - 2h) - h*4 + 3h*4 + 0h*4 as s + xh*3 + fh*4 + gh*2 + kh and give f. 5 Rearrange 13b3 - 2b*2 + 2 - 6b*2 + 9b*2 to the form pb*2 + mb + r + db3 and give r. 2 Express 1 + 24j*3 - 5j + 2j4 + 2j - 8j3 + 13j*2 - 10j*2 as xj*4 + tj*2 + ij + wj3 + b and give x. 2 Rearrange (-2 - 2w - 5w + 1)(74w + 12w + 30w) to vw + sw2 + q and give v. -116 Rearrange (-1 - 5 + 2)(-61g2 + 264 - 264) to the form tg*2 + jg + b and give t. 244 Express -2 + 2 - 2h3 + (30h + 17h - 98h)(3h - 3h - h2) + 6h*3 - 2h*3 + 4h*3 in the form sh + ph2 + t + nh*3 and give n. 57 Rearrange (-15b + 6b - 8b)(20b - 116 + 116) to the form a + zb + ub*2 and give u. -340 Rearrange 205w*2 + 21w - 26w + 5w to the form hw + b + pw*2 and give p. 205 Express 77960z - 7 + 41z2 - 77960z in the form mz2 + u + az and give u. -7 Express -11238l4 + l3 + 11236l4 + 1 + l2 + 2l - 2l*3 as sl + r + pl4 + xl*3 + cl*2 and give c. 1 Rearrange 158f*2 + 27f*2 + 5f - 5f + 10f*2 to uf + kf2 + x and give k. 195 Express 0z + 0z + 0z3 + z2 + 2z3 + 9z*3 in the form iz*3 + nz + k + tz2 and give t. 1 Express (-v + 0 + 0)(66v - 64v + 23v)(-1 + 1 + 3) as p + av2 + fv and give a. -75 Rearrange -h2 + h2 - 2h2 - 2h*2 - 40h - 16h to t + ph + xh2 and give x. -4 Rearrange k + 0k + 9k - 5k + 0k + 4k - 1 + 2k + 1 + (3k - k - 4k)(-1 + 3 + 0) to wk + i and give w. 7 Express (16c - 5c + 6c)*(2 - 6 + 2) + (c + 44 - 44	{ "pile_set_name": "DM Mathematics" }
(-14)? False Let y be ((-70)/4)/(6 - 292/48). Suppose 12 - y = -3w. Does 11 divide w? True Suppose 104 = 2q - 5l, 4l + 32 = q - 26. Suppose b - 3x + 30 + 5 = 0, -5b + 3x - 151 = 0. Let k = b + q. Is 13 a factor of k? True Let z(x) = -8 + 4x*2 - 3x*2 + 0x*2 - 2x2 - x3. Is 8 a factor of z(-4)? True Let a(r) = r*3 - 4r*2 + 5r + 4. Let n be a(6). Let x = n - 44. Does 22 divide x? False Let j be (-5)/30 + (3549/(-18))/(-7). Let r = j + 20. Is 4 a factor of r? True Let z(p) = 3p2 - 18p + 66. Is z(7) a multiple of 12? False Suppose -2j + 504 = 10j. Is j a multiple of 6? True Suppose 0 = -26o - 26o + 64584. Is o a multiple of 9? True Let q be (-24)/(-8) + 1 + -1. Suppose 0d - 4y = qd - 63, 81 = 3d - 2y. Is d a multiple of 11? False Suppose -3h + m + 118 = 12, -5h - 2m + 162 = 0. Suppose -n - h = -3n - 4s, -4n + 4s + 20 = 0. Is n a multiple of 5? False Let y = 1856 + 954. Does 29 divide y? False Let n(x) = -4x + 16. Let h be n(3). Does 17 divide 68/(-8)(3 + -1 - h)? True Let o(u) = 24u + 428. Does 13 divide o(17)? False Let w(d) be the second derivative of d3/3 - 23d*2/2 - 15d - 2. Is 2 a factor of w(13)? False Suppose -4c - 9 - 27 = 0. Let x = c - -19. Is x a multiple of 10? True Suppose 0s = -3n + s + 38, 35 = 3n - 4s. Does 3 divide n? False Let x be 286/77 + (10/(-14) - -1). Suppose xp - 170 - 18 = 0. Is p a multiple of 10? False Suppose -17u + 5r = -13u - 9000, r = 4u - 9000. Is u a multiple of 75? True Does 34 divide (10 - 648/60)/((-4)/850)? True Suppose 2j - 13 = -3. Suppose 0m = 3m - 3y - 21, 39 = jm - y. Is 8 a factor of m? True Let p = -14 + 16. Suppose 5o - 312 = 3b, -2b = -po + b + 132. Suppose -6 = -3q + o. Is q a multiple of 11? True Let c = 484 + -279. Is c a multiple of 50? False Suppose -3d + 32 - 20 = 0. Is 2(-106)/d(0 + -1) a multiple of 9? False Let l = -421 + 711. Is l a multiple of 29? True Does 43 divide (6/(-18))/(5/(-1230))? False Let i be 8 + 3 + -7 - 2. Suppose -l + 3y - y = 164, -4l - iy - 646 = 0. Is (-1)/2 - l/4 a multiple of 8? True Suppose -6g = -2g. Suppose g = -5r + 457 + 3. Does 17 divide r? False Let z = -881 + 1268. Does 20 divide z? False Let j(a) = -2a*3 + 23a*2 - 30a - 8. Let c be j(10). Let t be 4/(-18) + (-184)/(-18). Let o = t - c. Is 9 a factor of o? True Let n(x) be the second derivative of -x5/20 + x4/6 - x*3/3 + 13x*2/2 + 3x. Is 13 a factor of n(0)? True Suppose -5t = -g - 848, 2g - 5g + 856 = 5t. Is 17 a factor of t? True Does 118 divide 1 + -12 + 34 + 3871? True Suppose -i - 5f = -807, -5i + 822 = -4i + 2f. Does 8 divide i? True Let y(d) = 10d2 + 5d + 5. Let i be y(-6). Suppose -r + 3l = -85, 5r + 3l - i = -0l. Does 14 divide r? True Suppose 13f = 51f - 17328. Is f a multiple of 57? True Let p be ((-2)/4)/(2/(-164)). Let c(b) = b*3 + 4b*2 + 3b + 3. Let r be c(-2). Suppose rt - p = -1. Is 8 a factor of t? True Let d be (0 + -2 + 8)2/4. Let r(a) = a - 4. Let j be r(7). Does 8 divide (84/d)/(j - 2)? False Suppose 228 - 4155 = -11q. Is 17 a factor of q? True Let m be 3(4 + (-24)/9). Let o(j) = j*2 + 2j + 3. Is o(m) a multiple of 9? True Let h = -97 + 244. Is 3 a factor of h? True Let m(x) = -2x2 - 20x + 2. Let k be m(-10). Suppose -3a + kq + 88 = 0, 4a = 5q + 45 + 63. Is a a multiple of 8? True Let p(a) be the third derivative of a*5/30 - 5a*4/24 - 4a*3/3 + 3a*2. Is 44 a factor of p(12)? True Let c(a) = -99a + 150. Is c(-5) a multiple of 54? False Let z(x) = -x*3 + 14x*2 + 11x - 27. Is 57 a factor of z(13)? True Let v(t) = 12t2 + 56t + 9. Does 6 divide v(-5)? False Let h(q) = -166q + 587. Is h(-10) a multiple of 23? False Let u = 119 - 112. Suppose 0 = -5t, 4g = ug - 4t - 585. Does 35 divide g? False Let y(f) = 10f*2 + 18f + 27. Does 9 divide y(9)? True Suppose 16222 = -59p + 138706. Is 20 a factor of p? False Suppose 4f = -146 + 26. Let j = 33 - f. Is j a multiple of 11? False Suppose -3i + 138 = 5o, 3o + 7i = 3i + 85. Suppose 53 = 5r - o. Is 8 a factor of r? True Let h(p) = -2p3 - 7p*2 + 4p - 9. Does 32 divide h(-7)? False Suppose 0 = 2n - 2v - 178, -3n - 52v + 271 = -51v. Is n a multiple of 6? True Suppose 0b + 3 = b. Let k be (6/(-5))/(-1)1110/333. Suppose 0 = bo + 2 + 1, -5o = kq - 63. Is q a multiple of 9? False Let v(x) = x*2 - 4 + 7x + 14x - 20x. Let f be v(2). Let c = f + 1. Is c a multiple of 3? True Let w(l) = 157l + 4. Let s be w(-1). Let h be 34/s - 155/(-9). Let t = h - 10. Is t a multiple of 2? False Let u = 121 - 108. Is u even? False Let j(z) = -z3 - 6z*2 - 2z - 8. Let v be j(-6). Let k be ((-5)/v)/(1/(-8)). Is (-6)/(-10) + 744/k a multiple of 14? False Let t = 21 - 15. Suppose -46 = tq - 370. Let l = q + -36. Is 10 a factor of l? False Let u = -5 + 19. Let p(v) = -4v + 5v - 13 + uv. Is p(6) a multiple of 10? False Let m(p) = -p*3 + 2p*2 - 2p - 4. Is m(-3) a multiple of 2? False Let z = -1055 + 1542. Is z a multiple of 14? False Suppose -57w + 48w + 468 = 0. Does 7 divide w? False Let s be -3 - (-39)/15 - 96/10. Let i(x) = -7x - 12. Is 29 a factor of i(s)? True Suppose 15c = 11c. Let h be c + (-1)/(-1) - 1. Suppose hr - 2r = -2k - 46, 3k + 6 = 0. Does 21 divide r? True Suppose 3i - 4r = -11, i = r + 4r - 22. Suppose -4p + 5o + 62 = -83, ip = 2o + 107. Is p a multiple of 2? False Suppose -4f - r + 1175 = 0, -4f - 3r + 575 = -2f. Suppose 0 = 2a - 2d + 59 - f, -d = 5. Does 19 divide a? False Let v = -181 + 285. Does 8 divide v? True Let o be ((-6)/(-3) - 5)/(-3). Suppose -5l + 2q + 1 = -o, 12 = 2l + 2q. Is 11 a factor of ((3 - l) + -2)-11? True Let p be 30/40 - (-1)/4. Let s(d) = -2d3 + d2 - 2d + 1. Let y be s(p). Does 12 divide y - 1 - 67/(-1)? False Suppose 0 = 4w - 0w + 5z + 4, w - 2z + 1 = 0. Let k(h) = -h + 1. Let v(d) = 6d - 32. Let p(c) = wv(c) - 5k(c). Is p(-12) a multiple of 13? True Suppose -7b = -4k - 2b + 143, 0 = 2k - 5b - 69. Is k a multiple of 24? False Suppose 1058 = -15i + 12818. Does 53 divide i? False Suppose 18q = -28q + 63066. Is 59 a factor of q? False Suppose 6290 = 5k - 15440. Does 41 divide k? True Suppose 15q + 3633 = 18q. Suppose q = 8c - 37. Does 26 divide c? True Let k(l) = -140l3 - l2 + 2l + 2. Is k(-1) a multiple of 8? False Suppose -1 = 4w - 5c - 2, 3w = -2c + 18. Suppose 0 = 3o - wy - 176, 5o - 3o - 144 = -4y. Suppose -4r + 16 = -o. Is r a multiple of 9? False Let c(f) = -4f. Let s be c(-1). Suppose sa = 6a - 8. Suppose 0 = ap - 366 + 38. Is 15 a factor of p? False Does 20 divide (-99750)/(-84) + 1/(-2)? False Suppose 30 = -2s - 4r, 0 = 4s + 3r + 30 + 10. Let h = s + -23. Let b = 82 + h. Is b a multiple of 13? True Let l(x) = 40x2 + 43x - 191. Does 84 divide l(6)? False Let m(x) = 10x + 569x*2 + 3x*3 + 6 - 4x*3 - 570x*2. Is m(-5) a multiple of 10? False Is (99/(-4))/((-11)/88) a multiple of 11? True Let g(r) = -3r*3 + 4r*2 + 16r + 27. Does 5 divide g(-6)? False Let v = -23 - -22. Is 40 a factor of v + 5 - 196/(-1)? True Is 95984/128 + (-4 - 132/(-32)) a multiple of 15? True Suppose 0x - 5x + 5o - 290 = 0, -294 = 5x - o. Let k = -35 - x. Is k a multiple of 5? False Suppose 29l = 906 + 544. Is l a multiple of 6? False Let c = 27 + -44. Let t = c + -7. Let g = -12 - t. Is g a multiple of 4? True Let m be (2/6)/(1/3). Let w = -3 - m. Is 16 a factor of w/22 - (-1600)/88? False Let r(p) = -p3 + 3p*2 + 5p - 3. Let q be r(3). Suppose -2n = -q - 8. Suppose -3w = -5w + n. Is w even? False Let a(k) = -k2 + 3k + 252. Is 42 a factor of a(0)? True Let m = -124 + 126. Suppose k = 0, 171 = 2q - mk + 17. Is 7 a factor of q? True Suppose -5880 = -14z + 6706. Is 17 a factor of z? False Let q be (42 + -2)/(-5) - 0. Let u = 34 - q. Does 13 divide u? False Let o = 398 - 357. Does 13 divide o? False Suppose 5q = 3j - 470, -q + 4j = q + 202. Let d = q - -160. Is d a multiple of 15? False Suppose -12w + 14w - 76 = 0. Suppose -z - w = -k - 159, k + 475 = 4z. Let t = z - 66. Does 20 divide t? False Let w(r) = 4r + 2. Suppose -3 = -5j - 3x, 0j - 3x = 2j + 6. Is 3 a factor of w(j)? False Is (-132)/154(-6)/349 a multiple of 12? True Let c be (-32)/(-3)*2. Is 20 a factor	{ "pile_set_name": "DM Mathematics" }
o the form yq2 + c + lq + xq3 and give x. -2 Rearrange 4 - 18 + 4u*2 - 223u + 223u to au*2 + hu + o and give a. 4 Express -4g3 + 0g*2 + 176g4 + g2 - 1 - 175g4 in the form ig*3 + dg*2 + b + rg*4 + ng and give b. -1 Express (3w - 3w - 2w2)(0w - 3w + 2w) - 3w*3 + 14w3 + w3 - 10w3 + 35w*3 - 17w*3 as x + zw*3 + dw*2 + kw and give z. 22 Express -11 + 19b3 - 30b*3 - 22 - 2b + 10b3 in the form qb + l + ob3 + wb*2 and give l. -33 Rearrange -68i*2 - 187i*2 - 36i*2 to the form mi + zi2 + t and give m. 0 Rearrange 124 - 28x - 241 + 4x2 + 117 to the form j + rx + ix2 and give r. -28 Rearrange 0 - 1 + 2k*2 - 115k*3 + 36k*3 + 27k*3 to tk + hk2 + wk*3 + z and give z. -1 Rearrange -4h - 450 + 2h + 320 to zh + n and give z. -2 Express -9 + 52u + 1 + 10u + 1 in the form q + xu and give x. 62 Express 15o*4 - 10o*2 + 25o*4 - 2o*3 - 41o*4 - 2o*3 + 2o as l + fo3 + go*4 + ro*2 + ho and give r. -10 Express -84 - 69 + 153 - 2166y2 as by*2 + ly + f and give b. -2166 Rearrange 12b + 0b + 33b - 5b*2 to the form m + sb*2 + vb and give v. 45 Express -13s3 - 17s*3 - s + 9s*3 - 2 - 6s*3 in the form ds + qs3 + ls*2 + w and give q. -27 Rearrange (18 - 5 - 15)(-4p + 2p + 105 - 132) to the form z + cp and give z. 54 Express (-4 + 5d + 4)(2 - 4 + 1)(232d - 189d - 117d) in the form sd + ad2 + i and give a. 370 Express (2 + 2 - 2)(5s2 + 2s*2 - 6s*2)(-3 - s + 3) - 2s3 + 10s*3 - 3s*3 as ws*2 + zs + q + is3 and give i. 3 Rearrange -129l - 1017l2 - 64l + 1015l2 to the form il*2 + ol + s and give o. -193 Rearrange (-2q2 + 0q*2 + 0q*2)(0q2 + 10q*2 - 2q*2) + 19q*4 - 63 + 63 to the form wq*4 + xq + bq2 + s + cq*3 and give w. 3 Express 12 + 2g*4 - 5 + 6 - 3g*3 - 7 + 5g*2 - 4 as tg*3 + n + kg*4 + yg*2 + ug and give y. 5 Express -2z2 - 8z*2 + 0z*2 + (z - 5 + 5)(1 - 1 - 4z) + z2 - 2z*2 - 2z*2 in the form wz + r + xz2 and give x. -17 Express (14d + 7d + 199d)(-6d + 2d - 8d) in the form b + cd + pd*2 and give p. -2640 Rearrange 2u - 2 - 11 + 12 - 4u + 57 to p + ku and give k. -2 Rearrange (-17z2 - 14z*2 + 62z*2)(4z + 4z + 1 - z) to the form mz3 + o + sz + kz2 and give m. 217 Express (42 - 49r - 20 - 24)(1049 - 1049 + 30r) as vr + gr*2 + p and give v. -60 Express (30 - 17 - 7 + 27k*3)(k - 4k + 3 + 4k) as vk2 + yk*4 + qk + l + bk3 and give y. 27 Express (7i + 0 - 4 + 3)(-i - 13 + 10 + 25i*2 + 5) in the form fi*2 + gi*3 + t + mi and give g. 175 Rearrange 58 - 3g2 + 3g*4 - 26 + 2g*3 - 27 to ug*2 + kg + z + cg4 + og3 and give c. 3 Express s2 + 5s + s3 - 2s*4 + 12 - 2s - 10 in the form ms4 + ks*2 + v + ds + ps3 and give k. 1 Express -34 - 11h + 33 + 50h4 + 8h in the form lh + mh*3 + th*4 + ah*2 + v and give l. -3 Express (-11d*2 - 3d*2 + 11d*2)((-1 + 1 - 1)(-3 + 3 + 2) + 2 + 0 - 3 + (-3 + 0 + 0)(4 - 1 - 1) + 3 - 2 + 0) in the form k + jd + ld*2 and give l. 24 Rearrange -77c*2 + 77c*2 + 5c*3 + (-7c*2 - 8 + 8)(-7c - 5c + 5c) to mc + jc3 + lc2 + w and give j. 54 Rearrange -2 - t3 - 256t2 + 504t*2 - 56t - 245t2 to qt*3 + ht + xt2 + j and give q. -1 Express 3j*2 + 9j*3 + 10j - 1 - 50j + 42j in the form ij2 + b + nj + aj3 and give i. 3 Express -10u*3 + 14u*3 + 2u*4 + u + 7u*2 - 9u*2 - 3u*3 - 1 as pu*2 + k + hu*3 + xu*4 + ou and give k. -1 Express 2q4 - 2q*3 - 2q*3 + 3 + 3q*3 + 2q*3 as iq + xq3 + lq*2 + dq*4 + z and give x. 1 Express -24 - 23 + 49 - 76g as x + kg and give k. -76 Express 148i - 25i + 31i + 20i in the form v + zi and give v. 0 Express -33o + 95o*3 + 2 - 40o*3 - 57o*3 + 2o*2 in the form uo*2 + po*3 + b + do and give b. 2 Express (-2i2 + 0 + 0)(1 - 2 + 3) - 4i2 + 0i2 + i2 + (-2 + 3i + 2)(-61 - 10i + 61) as ri*2 + b + yi and give r. -37 Rearrange (0w + 3w - 2w - 2w - 6w - 3w + (1 - 1 + 2w)(0 + 1 - 3))(19w*2 - 227w + 227w) to the form jw*2 + t + uw*3 + gw and give u. -266 Rearrange 22i2 - 4i*2 + 8i*2 + 1 + 0 + 3i*3 + 0i*2 to the form ui*3 + ji + g + yi2 and give j. 0 Express (4c + 2c - 4c)(-2 + 5 - 1)(180 + 168 + 212)(1 - 1 + 1) in the form fc + z and give f. 2240 Express 79c + 60c + 9c + 94c - 25c in the form k + qc and give q. 217 Rearrange -12r3 - 5 - 8 + 37 - 14 - r2 - 15 to cr*3 + pr*2 + m + wr and give c. -12 Express (2 - 1 - 3)(1174q - 973q + 1491q) as x + gq and give g. -3384 Express 178f*2 + 9f*2 - 3f*3 + 173f*2 + 5f*3 - 1 - 90f*2 as wf*2 + cf + j + af3 and give w. 270 Rearrange (-5j*4 - 7j*4 + 0j*4)(0 + 4 - 3) + 0 - 2 + 8j - 7j - 2j4 to h + aj*3 + lj*4 + uj*2 + vj and give v. 1 Rearrange (1 - 1 + 2z4)(45 + 51 - 240) to the form iz + az*2 + k + tz*4 + vz*3 and give t. -288 Express -1 - 2o*3 + 1 - 3o - 40 + 4o3 + o3 as ko + no2 + x + io*3 and give k. -3 Express (-103 - 8 + 18)(2t + 1 - 1) - 33 - 4t + 33 in the form yt + w and give y. -190 Express 16219 - 208o - 16219 in the form do + a and give a. 0 Rearrange -112w - 120w - 76w + 109w to zw + l and give z. -199 Rearrange (3 + y - 3 + 3y + 4y - 6y + (0y - 2y + 0y)(0 - 3 + 1) + 3 + 2y - 3)(11 + 19 - 8) to m + ly and give l. 176 Express (-37 + 17 + 54)(0w + 3w - 7w + 7w - 3w - 2w + (3 + 1 - 2)(-w + 3w + 0w) + w + 0w + 0w) in the form n + iw and give i. 102 Rearrange (2h + 0h - 4h)(-3 - 1 + 2) + 2h + 0h - h + 8h + 50h + 76h to n + bh and give b. 139 Express 2 + 28i + 8i3 + 5i*2 - 3 - 30i + 0 as wi + k + li*3 + bi*2 and give k. -1 Rearrange 2 - 16 + 8 + 125x*3 - 9x*3 to the form g + ax*2 + mx + sx3 and give s. 116 Rearrange -15220s*2 + 15220s*2 - 493s*3 - s to the form f + us*2 + as + gs3 and give g. -493 Express (82 - 50 + 97)(-2x - 2x + 7x) as s + cx and give c. 387 Rearrange 19y2 - 38y*2 - 83y*3 + 20y*2 to the form dy + vy3 + t + ky*2 and give v. -83 Express ((0 + 2p + 0)(3 - 5 + 1) - p - p + p + 0p + 4p - 5p - 8 - 8p + 8)(1 - 5 + 2) as gp + u and give g. 24 Rearrange ((3 + 2 - 3)(0 + 0 - z) + z + 0z - 3z)(-2z*2 - 155 - 8z*3 + 154 - 6z*3) to oz + wz4 + q + hz*3 + jz*2 and give o. 4 Rearrange 62b + 5b2 - 62b - 38b3 + 3b*3 to x + zb*3 + db + lb2 and give z. -35 Rearrange 2t - 1 + 1 + (-418t - 235t + 86t)(-1 + 6 - 3) + (-1 + 1 + t)(-1 + 3 + 0) to mt + x and give m. -1130 Rearrange 7 + 0f3 - 35f*3 - 6 + (2f*2 + 0f*2 - 4f*2)(2f - 6f - 3f) to cf*2 + tf + h + rf3 and give h. 1 Rearrange -2 + 3x + 2 + (1 + 0 + 2)(-14 + 19 + 17)(2x - 2x - 2x) to z + gx and give g. -129 Rearrange 143n + 8n*3 - 13n*2 - 6n*3 + 13n*2 to the form wn*2 + tn + jn3 + v and give v. 0 Rearrange 479h*2 + 6 - 32 - 478h*2 + 3 to the form ph + d + nh2 and give n. 1 Express (o + 3o - 2o)(-o*2 + 0o2 - o2) + 3o3 - o3 - 4o*3 + 12o*3 + 2o*2 + 3o3 - o2 as b + ko3 + qo + lo2 and give k. 9 Rearrange 49f + 110f + 479f + 546f to the form a + qf and give q. 1184 Express -3n + 2 + 143n*3 - 62n*3 - 92n*3 in the form x + mn + bn3 + yn*2 and give x. 2 Rearrange (0x - 2x + 3x)(291 + 260 + 2884 + 339 + 4415) to the form px + i and give i. 0 Rearrange -3 + s + s - 3s - 61 + 2s + 61 + (0s + s + 0s)(-2 - 1 + 5) - 14 + 14 + 11s to as + u and give u. -3 Express -1026n + 1262n + 1641n + 459n as f + jn and give j. 2336 Express (1047 - 668 + s - 996)(-4s + 4s + 2s*2) as ws*3 + l + vs*2 + ys and give w. 2 Rearrange -2 - 2n + 86n*2 - 3n + 5n + n3 - 3n*4 - 91n*2 to the form vn + y + bn3 + mn*2 + fn*4 and give b. 1 Express 18x*4 + 2 - 46x*4 + 18x*4 - 44x - x*3 + 12x*4 in the form cx + nx4 + ox*3 + hx*2 + j and give n. 2 Express 11w*4 - 4w*4 - 4w*4 + (-3w + 4w - 2w)(w2 - w2 + w2)(57w - 129w + 43w) as nw*4 + f + gw + bw2 + cw**3 and give n. 32 Expres	{ "pile_set_name": "DM Mathematics" }
35s(k). What is x in v(x) = 0? -1, 12 Let a = -74 + 73. Let r be (a - 123/(-24)) + -4. Factor -1/8o*3 + 0 + ro - 1/8o2 + 1/8o*4. o(o - 1)*2(o + 1)/8 Factor 6k - 2k - 17k - 11k + 3k2 - 6k. 3k(k - 10) Suppose 0 = 5z + 4a + 65, -3a + 30 = -5z - 0z. Let r = z - -14. Factor 5c*r - 4c*5 - 2c3 + c5. 2c3(c - 1)(c + 1) Let t(c) be the second derivative of -c6/30 - 11c*5/20 + 13c*4/12 + 11c*3/6 - 6c*2 + 99c. Factor t(w). -(w - 1)*2(w + 1)(w + 12) Let w(q) = -q3 - 5q*2 + 7q - 1. Let p be w(-5). Let o = p + 38. Solve -k*4 + 5k*3 - ok*3 + 3k*4 - 3k*4 = 0 for k. 0, 3 Let x(i) = -i - 20. Let a be x(-7). Let g = -11 - a. Factor 2y - 8y2 + 5 + gy*3 - 6y*3 - 2y*3 - 1. -2(y + 1)*2(3y - 2) Let j(h) be the third derivative of -h6/96 - 3h*5/16 - 5h*4/4 - 10h*3/3 + 2h*2 - 146h. Determine d, given that j(d) = 0. -4, -1 Let x(f) = 6f5 - f4 + 3f*3 + 3f*2 - 6f - 6. Let i(l) = l5 + l4 + l3 + l2 - 2l - 2. Let s(j) = 3i(j) - x(j). Factor s(k). -k*4(3k - 4) Let p be 4 - (-1)/1 - -1. Solve 2h4 - h2 - 3h4 - 4h*2 + ph*4 = 0. -1, 0, 1 Let d be (4/5 + 0)/((-12)/(-20)). Factor -d + 4/3t - 1/3t2. -(t - 2)2/3 Factor 0 - 14/5p*3 + 0p*2 - 2/5p*4 + 0p. -2p3(p + 7)/5 Let z be -1377/(-33). Factor -14h3 - h2 + 6h*4 + zh*2 + 7h*2 - 9h*2. 2h*2(h - 2)(3h - 1) Let v(r) = r2 + 1. Let i(m) = 0 + 33 - m2 - 6m2 + 12m + 5m2. Let g(b) = -i(b) - 3v(b). Factor g(d). -(d + 6)*2 Find n, given that -21n*2 + 3n*4 + 110n*3 - 299n*3 + 97n*3 + 110n*3 = 0. -7, 0, 1 Let f(u) = -2u3 - u2 + u - 1. Let k(x) = -45x3 - 70x*2 + 140x - 100. Let j(s) = -25f(s) + k(s). Factor j(l). 5(l - 5)(l - 3)(l - 1) Suppose -17 = -4x + 3. Let m(k) = 2k*3 - 2k*2 - 2k - 2. Let y(a) = -2a3 + 3a*2 + 2a + 2. Let f(p) = xm(p) + 4y(p). Let f(z) = 0. Calculate z. -1, 1 Suppose 133z = 145z. Let v(y) be the first derivative of -3/4y4 + 2y*3 + zy - 1 + 9/2y2. Factor v(d). -3d(d - 3)(d + 1) Let j be 37/((-148)/(-24)) + (1 + 1 - 5). Factor -2b - 7/2b*4 - 23/2b*j + 0 - 10b*2. -b(b + 1)(b + 2)(7b + 2)/2 Let k = 2 - 0. Factor -2r*k - 15r*4 + 4r*3 + 5r*3 + 0r*2 + 8r*2. -3r*2(r - 1)(5r + 2) Suppose 181v = 192v. Factor 0b + 2/13b*4 + v + 0b*3 - 2/13b*2. 2b*2(b - 1)(b + 1)/13 What is w in 18w*5 - 9w*5 - 16w*3 - 11w*5 - 14w*3 + 16w*4 = 0? 0, 3, 5 Let 112/11f + 0 + 680/11f2 + 636/11f*3 - 1330/11f*4 - 98/11f5 = 0. Calculate f. -14, -2/7, 0, 1 Let x(v) be the third derivative of -v7/42 - v*6/3 - 11v*5/12 + 25v*4/6 - 27v*2 + 5v. Factor x(g). -5g(g - 1)(g + 4)(g + 5) Let x be (-721)/105 + (-2)/15. Let q be -3(182/6)/x. Solve 8v + qv4 + 10v*4 + 28v*2 - 3v*4 + 4v*5 + 36v*3 = 0. -2, -1, 0 Find m, given that -48m*2 - 3/2m*3 - 1176 - 462m = 0. -14, -4 Suppose -306q3 - 3q*5 + 481q*3 - 33q*4 - 42q*2 + 105q + 75 - 277q3 = 0. What is q? -5, -1, 1 Let i be (-2246)/(-50) - 6/(-75). Let c = i + -42. Factor -6/5 + 21/5t - ct2. -3(t - 1)(5t - 2)/5 Let p(b) = -11b4 - 79b*3 - 449b*2 - 741b. Let h(q) = -10q4 - 80q*3 - 450q*2 - 740q. Let t(m) = -6h(m) + 5p(m). Factor t(a). 5a(a + 3)(a + 7)2 Let s(g) be the first derivative of 4/15g*3 + 8/5g + 6/5g2 + 21. Suppose s(f) = 0. What is f? -2, -1 Let s = -4889 + 14671/3. Factor 4/3 - sl + 1/3l2. (l - 2)2/3 Let a = 258 - 231. Suppose -2d + d = ad. Find i such that di*2 - 4/7i*3 + 0i + 0 + 2/7i4 = 0. 0, 2 Suppose 2 = 3p + 2a - 3a, -4p = -3a + 4. Suppose -pm + 12 = -54. Factor -mq*3 + 2 - 1 + 2 - 2q - 12q4 - q - 27q*2. -3(q + 1)*3(4q - 1) Let w(y) be the first derivative of -4y*3/3 + 44y*2 - 84y + 448. Determine q, given that w(q) = 0. 1, 21 Let g(m) be the third derivative of -1/36m6 + 0m + 5/36m4 - 1/9m*3 - 21m*2 + 0 - 1/30m*5 + 4/315m7. What is x in g(x) = 0? -1, 1/4, 1 Let f(b) = b5 + 4b4 + 2b*3 - 3b*2 - 3b - 1. Let w be 4(20/(-4) + 4). Let n(r) = r4 + r3 - r - 1. Let s(v) = wn(v) + 4f(v). Factor s(l). 4l(l - 1)(l + 1)*2(l + 2) Factor 6q + 5q*3 - 3q*3 + 2 - 91q*2 + 97q*2. 2(q + 1)3 Let q(s) be the second derivative of -s8/420 + s7/210 + s6/90 - s*5/30 + 16s*3/3 + 21s. Let f(j) be the second derivative of q(j). Factor f(g). -4g(g - 1)*2(g + 1) Let r be ((-207)/(-345))/((-8)/(-10)). Factor -3/4m + 1/4m*4 - 1/2 + rm*3 + 1/4m*2. (m - 1)(m + 1)*2(m + 2)/4 Let o = 4 - -5. Let a(s) = -s*2 + 8s + 12. Let u be a(o). What is q in uq + 0 + 3/2q*3 + 9/2q*2 = 0? -2, -1, 0 Factor 7/2d - 2 + d*2. (d + 4)(2d - 1)/2 Factor -1/3 - 350/3p - 349/3p2. -(p + 1)(349p + 1)/3 Let u = 2559/190 + 3/95. Let s be (-63)/3530/(-4). What is r in 3r2 + ur*3 - sr - 3 = 0? -1, -2/9, 1 What is g in 0 - 64g - 236/3g*3 - 28/3g*4 - 544/3g2 = 0? -4, -3/7, 0 Let o(l) be the first derivative of l6/42 - 2l5/35 - 5l*4/14 + 8l*3/21 + 33l*2/14 + 18l/7 + 293. Find r such that o(r) = 0. -2, -1, 3 Let t(n) be the first derivative of -2n3/21 - 26n*2/7 - 338n/7 - 66. Factor t(j). -2(j + 13)2/7 Factor 8d*3 - 11d*3 + 5d2 - d4 + 3d + 4d*3. -d(d - 3)(d + 1)2 Let f(u) be the third derivative of u6/630 - u5/105 + u4/42 - 2u*3 - 15u2. Let x(t) be the first derivative of f(t). Solve x(d) = 0 for d. 1 Let s(j) be the third derivative of j8/50400 + j*7/12600 + 17j*5/60 - 11j*2. Let d(a) be the third derivative of s(a). Factor d(h). 2h(h + 1)/5 Let c(k) be the first derivative of 40k + 10k2 - 25/4k*4 + 17 - 10k3 - k5. What is g in c(g) = 0? -2, 1 Let 2/3q4 + 0q + 0 + 2q3 - 8/3q2 = 0. Calculate q. -4, 0, 1 Let p(s) be the first derivative of s4/14 - 10s3/21 - 6s*2/7 - 207. What is v in p(v) = 0? -1, 0, 6 Solve -4/3s + 2/5s2 - 16/15 + 8/15s*3 - 2/15s*4 = 0 for s. -1, 2, 4 Let p = 55 - 50. Let 60a + 4a2 - 30a - 4 - 34a - pa*2 = 0. What is a? -2 Let v(z) be the first derivative of 0z + 2/9z3 + 3z*2 + 1/30z*5 - 1/4z*4 + 6 + 1/45z*6. Let d(l) be the second derivative of v(l). Factor d(w). 2(w - 1)(w + 2)(4w - 1)/3 Let z(c) be the first derivative of 2/45c*5 + 0c - 8/27c3 - 24 + 1/18c*4 - 4/9c*2. Factor z(g). 2g(g - 2)(g + 1)(g + 2)/9 Let g(d) be the third derivative of d8/6720 - d7/280 + 3d*6/80 + 17d*5/30 + 12d*2. Let n(l) be the third derivative of g(l). Factor n(v). 3(v - 3)*2 Let y(s) = -3s*2 + 9s - 1. Let m(k) = -k*2 + 4k - 1. Suppose 0 = -5q + 4c + 16, -2c + 6 = -4q + 5q. Let a(w) = qy(w) - 10m(w). Factor a(x). -2(x - 1)(x + 3) Let s = 52 - 51. Let x(a) = 5a3 - a2 - 5a + 1. Let o(w) = -w3 + w. Let d(j) = sx(j) + 4o(j). What is p in d(p) = 0? -1, 1 Let m(c) be the first derivative of 1/4c - 1/8c4 + 1/6c*3 - 1/24c*6 - 3/20c*5 + 9 + 3/8c*2. Factor m(o). -(o - 1)(o + 1)*4/4 Let o(p) = -11p*4 - 14p*3 + 60p*2 + 48p + 5. Let z(y) = 5y4 + 5y*3 - 30y*2 - 24y - 2. Let j(r) = -2o(r) - 5z(r). Suppose j(x) = 0. What is x? -2, -1, 0, 4 Factor -d*2 - 1/4d*3 - 3/4d + 0. -d(d + 1)(d + 3)/4 Let i(s) be the first derivative of s*5/5 + 27s*4/5 - 44s*3/15 - 593. Suppose i(f) = 0. What is f? -22, 0, 2/5 Let s = -34177 + 68355/2. Factor -7/2k + sk2 + 0. k(k - 7)/2 Let t(z) be the first derivative of -z6/15 + z5/5 + z*4/2 - 4z*3/3 - 4z*2 - 38z + 23. Let q(b) be the first derivative of t(b). Factor q(l). -2(l - 2)2(l + 1)*2 Let n(s) be the third derivative of 13/12s*5 + 5/2s*4 + 0 + 1/4s*6 + 0s + 10/3s3 + 1/42s*7 - 14s*2. What is h in n(h) = 0? -2, -1 Let u be ((-3)/27)/(164/(-3198)). What is r in 2r - 1/6r4 - ur2 - 2/3 + r3 = 0? 1, 2 Factor 0 + 0 + k*2 + 292k - 275k + 0. k(k + 17) Let l = -440 + 442. Let c(g) be the second derivative of -5g + 1/4g*4 - 1/2g*3 + 0gl + 0. What is i in c(i) = 0? 0, 1 Let h(k) be the second derivative of -k6/25 + 31k5/100 + 31k4/60 - k3/5 - 75k + 1. What is q in h(q) = 0? -1, 0, 1/6, 6 Let x(b) = 8b*3 - 8b*2 - 12b + 17. Let u = -4 + 0. Let z(g) = -7g3 + 7g*2 + 12g - 16. Let a(p) =	{ "pile_set_name": "DM Mathematics" }
+ 14. Let r be b(-5). What is the first derivative of 359 + 3h4 + 3h - 6h4 - 7h*r - 375 wrt h? -40h*3 + 3 Find the first derivative of -73k*2 + 106 - 2486k + 2486k + 3k*3 wrt k. 9k*2 - 146k Let o = 32 - 53. Let g be ((-1)/3)/(o/315). Find the second derivative of -16vg + 39v*5 - 10v*5 - 2v wrt v. 260v3 Let j(d) = -d3 - 13d*2 - 17d - 2. Let a be j(-12). Differentiate 39k4 + 6k*2 - a - 44k*4 - 6k*2 wrt k. -20k*3 Differentiate -9m*4 - 864 + 372m*2 - 176m*2 - 172m*2 wrt m. -36m*3 + 48m Let t = 482 - 480. What is the second derivative of -29wt + w - 131202 - 2w*5 - 13w*2 + 131142 wrt w? -40w*3 - 84 Let l(o) = -2o*3 + 2o*2 + o + 2. Let v(w) = -1655w*3 - 6w*2 + 92. Let j(g) = -3l(g) - v(g). What is the second derivative of j(x) wrt x? 9966x Let p(g) = 37g - 144. Let l be p(4). Differentiate -44q + 0q*4 + 65q*l + 43q + 44 wrt q. 260q3 - 1 Let u = -17 - -19. Find the third derivative of 146v*u + 33v*4 + 36v*4 + 2 + 52v*4 - 3v*4 wrt v. 2832v Suppose 509k - 344 = 337k. Let t(m) be the first derivative of 33m + 0m*k + 0m*3 - 5/4m*4 - 16. Differentiate t(d) with respect to d. -15d*2 Suppose 4z + z + 110 = 0. Let y = z + 26. Find the third derivative of -10d2 + 4d*4 - 7d*y - 6d*4 wrt d. -216d Let s(n) = 10n3 + 17n + 1054. Let q(b) = 30b3 + 49b + 3163. Let f(z) = 2q(z) - 7s(z). Differentiate f(k) wrt k. -30k2 - 21 Let m be (-21)/105 - (-1)/5. Suppose m = 3u + 4i - 73, u + u - 87 = 5i. Find the third derivative of 20b3 + 17b*3 - ub*3 - 13b*2 wrt b. 36 Let z be (-2093)/(-5 + -2) - -1. What is the third derivative of -26o*6 + 19 + 150o*2 + 152o*2 - 9o*6 - zo*2 wrt o? -4200o*3 Suppose -2b - 5u + 4u - 14431 = 0, 3b + 21650 = -5u. Let d = -4813 - b. Differentiate d - 5j2 - j - 2398 + j wrt j. -10j Let o(m) be the first derivative of -m*2/2 + 29m + 26. Let i be o(27). Find the third derivative of 2 - i + 6l2 + 11046l*3 - 11053l*3 wrt l. -42 Suppose -3u + 6u - 9 = 0. Suppose 2h + 164 = 84h. Find the third derivative of 14k*h + 45ku - k2 - 30k3 wrt k. 90 Let d = 231 + -231. What is the second derivative of -j + dj - 12045 + 3j2 - 19j*3 + 12147 wrt j? -114j + 6 Suppose 2c + 2054 = 2058. Suppose -4a - 4k + 2k = -34, -5 = -5a + 5k. What is the second derivative of -2r3 - 6r*c + ar*2 + 21r wrt r? -12r Let g be -10 - (-1455)/135 - 2/(-9). Let a(t) = 76t2 + 76. Let o(q) = -q2. Let d(m) = ga(m) + 5o(m). Differentiate d(s) with respect to s. 142s Let i(j) = -56j*2 + 5. Let w = 9 - 3. Let q = -5 + 0. Let b(h) = -57h*2 + 4. Let s(n) = qb(n) + wi(n). Differentiate s(g) with respect to g. -102g Let x(u) = 15u3 + 118u*2 - 14u + 1697. Let j(w) = 14w3 + 119w*2 - 12w + 1699. Let h(z) = -7j(z) + 6x(z). Differentiate h(b) wrt b. -24b2 - 250b Let m(k) = -1020k5 + 2077k - 17. Let g(d) = 339d5 - 692d + 6. Let x(s) = -17g(s) - 6m(s). What is the second derivative of x(y) wrt y? 7140y3 Find the second derivative of -1503k + 2707k + 12k*2 + 2486k + k*5 + 146k*2 wrt k. 20k*3 + 316 Suppose -4c - 4g - 194 = -3g, 2c + 104 = 3g. Let x = c - -51. Find the first derivative of -31fx - 36 + 0f*2 + 2f*2 wrt f. -58f What is the third derivative of -6258b - 4b*2 - 123b*5 - 8382b*5 + 6000b wrt b? -510300b2 Suppose 8d - 1256 - 712 = 0. Differentiate 307 - 54 - 153a2 + 246a - da wrt a. -306a Let p be (-30)/824/(-9). What is the second derivative of pa*4 - 11a*4 - 2a*3 + 4a*3 + 13 + 7a - 8a wrt a? -12a*2 + 12a Let w be 1((-6)/(-21))/((-15)/(-210)). Find the third derivative of -w + 2 - 45b*3 + 6b*2 - 54b*2 - 1 + 18b*2 wrt b. -270 Let n be 11/(-44) + (135/12 - 6). Let r be 0 + (2 - -81). What is the third derivative of -9d2 + 0d*2 - 2d*2 + rd*n + 8d*5 wrt d? 1080d*2 Let p(j) = 18j*4 - 19j*3 + 31j*2 - 2j + 82. Let y(o) = -o4 + o3 + o - 28. Let z(x) = -p(x) - 2y(x). What is the third derivative of z(f) wrt f? -384f + 102 What is the second derivative of -438s5 - 22s + 1294s4 - 658s*4 - 7 - 334s*5 - 636s*4 wrt s? -15440s*3 Suppose 20n - 1294 - 166 = 0. Find the first derivative of 19u - 32u - 64 + n wrt u. -13 Let h(s) be the second derivative of -41s5/5 + 9s*4 + 3s*3/2 - s - 927. What is the third derivative of h(i) wrt i? -984 Let v(b) be the second derivative of -3b*6/10 - 7b*4/12 + 1746b*2 + 1509b. Find the first derivative of v(f) wrt f. -36f3 - 14f Let p(q) be the first derivative of -3889q4/4 - 19q3/3 - q2 - q - 1848. What is the third derivative of p(d) wrt d? -23334 Let q(l) be the first derivative of l*4/2 + 5335l*3/3 - 7019l*2 + 2125. What is the second derivative of q(u) wrt u? 12u + 10670 Let h(r) be the second derivative of 0r5 + 0 + 34/15r*6 + 0r*2 + 1/6r*3 + 1/3r*4 + 72r. Find the third derivative of h(w) wrt w. 1632w Let f(h) be the first derivative of 1495h*6/6 + 23h*2/2 + 149h - 274. Find the second derivative of f(i) wrt i. 29900i3 Suppose -j = 2j + 4z - 1, 3j - 2z = -23. Let c be (3/j - 6/(-10)) + 3. What is the first derivative of 23mc - 22 + m3 + 10m3 wrt m? 102m2 Let k(d) be the second derivative of -d7/14 + d*5/20 - 331d*4/12 + 1153d*3 + 11119d. Find the second derivative of k(q) wrt q. -60q3 + 6q - 662 Find the first derivative of 251j + 2356 - 474j - 17j2 + 176j wrt j. -34j - 47 Let z(g) be the third derivative of -g8/84 - 137g7/30 - g5/10 - 13g4/8 - g3/2 + 6g*2 - 564. Find the third derivative of z(w) wrt w. -240w*2 - 23016w Let y be ((-5)/(-80)8)/(2/4). Let c(w) = 234w. Let s(l) = l + 2. Let n(f) = yc(f) + 65s(f). Find the first derivative of n(g) wrt g. 299 Let i(p) be the second derivative of -1857p4/4 - 1175p*3 - 191p + 3. What is the second derivative of i(d) wrt d? -11142 Let k be (-16)/6-1 - (-23)/69. What is the third derivative of k + 34q*3 - 65q*2 + 24q*2 - 3 wrt q? 204 Suppose -4h - 84 = -4s, 8s - 9s - 4h + 36 = 0. Find the second derivative of 14k - sk + 5 - 40k2 - 9 wrt k. -80 Find the first derivative of 1492 - 32 + 152n + 1093 - 1584n wrt n. -1432 Find the third derivative of 111y*2 + 174y*2 + 19y - 77y2 - 19y - 876y4 wrt y. -21024y Differentiate 715b2 - 85 - 160 - 145 with respect to b. 1430b What is the third derivative of -3n4 + n3 + 368774n2 - n3 - 370176n2 wrt n? -72n Suppose -211 = -5y + z, -5y = -3z + 4z - 219. Differentiate -147o2 - y + 6o - 6o + 147o*2 - 216o*3 with respect to o. -648o*2 Suppose 0 = -6b + 13 - 1. Suppose 0 = bw + 1 - 5. What is the third derivative of -7r*w - 65r - 17r3 + 65r wrt r? -102 Find the second derivative of 675z2 + 1075z*2 + 493z*2 + 379z*2 + 1774z wrt z. 5244 Let s(i) = -390i - 481. Let g(m) = 129m + 161. Let v(a) = -11g(a) - 4s(a). What is the first derivative of v(u) wrt u? 141 What is the third derivative of 4j + 1011j*4 + 12j*6 - 66j*6 + 52j*6 + 2 + 34j*2 wrt j? -240j*3 + 24264j What is the second derivative of 7j3 - 2400j - 1040j + 704j*2 - 3048j + 727j2 - 1790j*2 wrt j? 42j - 718 Suppose c + 2 = t - 3c, -5c = -t + 2. Suppose 0 = -4y + tw + 2, w = -4w + 25. Differentiate y - 18q*4 + 32q*4 + 7 with respect to q. 56q*3 Let v(i) = -25i*2 - 19i - 5. Let a(u) = u*2 + u + 1. Let m = 83 + -17. Let d = m - 61. Let l(q) = da(q) + v(q). Find the second derivative of l(n) wrt n. -40 Let j(u) be the third derivative of 113u6/15 + u5/15 + 1253u*4/12 + 3u*2 + 2u + 8. Find the second derivative of j(c) wrt c. 5424c + 8 Let q(y) be the third derivative of 0y*3 - 1/105y*7 - 17y*2 - 3/5y*5 + 0 - 17/24y*4 + 0y + 0y6. Find the second derivative of q(m) wrt m. -24m*2 - 72 Let l = 216 + -213. What is the second derivative of 15j*l + 71j*3 + 63j*3 - 81j*3 - 3j wrt j? 408j Let x(w) = -w2 - 14w - 20. Let v be x(-12). Find the first derivative of -35 + 2o + 0 + 13o*v + 13 wrt o. 52o*3 + 2 What is the third derivative of 1485o - 186o2 - 753o - 741o + 72o*4 wrt o? 1728o Let w(h) be the second der	{ "pile_set_name": "DM Mathematics" }
*2 - p Collect the terms in -28202w*3 + 94128w*3 - 2w*2 + 0w*2. 65926w*3 - 2w*2 Collect the terms in -8770010167253 + 8770010167253 - 4p. -4p Collect the terms in -303m*2 + 14m + 895m2 - 293m*2 - 295m*2 - 9m. 4m2 + 5m Collect the terms in -128n + 29n + 33n + 19n + 20n + 26n + 8n2. 8n*2 - n Collect the terms in -4086516q + 2 - 11q2 + 4086516q. -11q2 + 2 Collect the terms in 2071t + 168t + 206t - 2432t. 13t Collect the terms in 15v3 - 3v*3 + 5746v - 8v3 - 2v*3. 2v*3 + 5746v Collect the terms in -32794j + 26j*2 - 197 - 28j*2 + 197. -2j*2 - 32794j Collect the terms in 151937m3 - 117m - 151935m3 + 13m + 624m. 2m*3 + 520m Collect the terms in -227i2 - 63i*2 + 18546 - 8919 - 9627 + 33i*2. -257i*2 Collect the terms in 54698u*2 + 2u*3 + 55261u*2 + 55262u*2 - 165221u*2. 2u*3 Collect the terms in 1065w*2 - 17w - 529w2 - 527w*2 + 348w. 9w2 + 331w Collect the terms in -2o - 3o - 23o2 - 19o*2 - 18o*2 + 78o*2 - 7o*2. 11o*2 - 5o Collect the terms in -651l - 399l - 400l + 2125l - 275l - 399l. l Collect the terms in -5w2 + 179 + 298w - 362 + 205w + 180. -5w*2 + 503w - 3 Collect the terms in -27341y3 - y2 + 372y*3 + 838y3 + y2. -26131y3 Collect the terms in 160007z - 3 - 4 + 2. 160007z - 5 Collect the terms in 148y - 192y + 117y - 84y. -11y Collect the terms in -7821 + 31054 - 7826 - 3y - 7588 - 7819. -3y Collect the terms in 941664098924o - 941664098924o + o2. o2 Collect the terms in -5726i2 + 6i + 5726i2 - 4 - 226i*3. -226i*3 + 6i - 4 Collect the terms in 0 + 2785u2 - 2984u*2 + 1 + 31u*3 - 1 + 199u*2. 31u*3 Collect the terms in -80596747m*2 + 40298387m*2 + 40298378m*2. 18m*2 Collect the terms in -441h*2 - 687h*2 + 11h + 7h - h. -1128h*2 + 17h Collect the terms in 308z - 434z*3 - 389z + 116 + 436z3. 2z*3 - 81z + 116 Collect the terms in -3061189z3 - 3061210z*3 + 6122384z*3. -15z*3 Collect the terms in -2d*2 - 49d*2 - 6d*3 - 20d*2. -6d*3 - 71d2 Collect the terms in -37930 - 37926 - 37932 - i2 + 113788. -i*2 Collect the terms in 7124a - 7727a + 571a. -32a Collect the terms in -650l + 24 - 56 + 40 - 8. -650l Collect the terms in -1786o*2 - 1787o*2 - 3o*3 + 6991o*2 - 1630o*2 - 1788o*2. -3o*3 Collect the terms in -554a*2 + 92a*2 + 385a*2 + 28 - 28. -77a*2 Collect the terms in -1270m - 155758470 + 155758470. -1270m Collect the terms in -12457a*2 - 12430a*2 + 36760a*2 - 13107a*2. -1234a*2 Collect the terms in -401z*2 - 1718z*2 + 2120z2. z2 Collect the terms in 1193u2 + 1205u*2 + 1221u*2 - 4767u*2 + 1286u*2. 138u*2 Collect the terms in -13k*2 + 16k*2 + 630 + 6k*2. 9k*2 + 630 Collect the terms in 14689 - 29371 - 30r - 5r + 5r + 14682. -30r Collect the terms in 3 + 2698b - 2b3 - 2 - 3126b. -2b3 - 428b + 1 Collect the terms in y - 3y2 + 128y*3 - 12y*3 - 32y*3 - 47y*3 + 0y. 37y3 - 3y*2 + y Collect the terms in 51i*3 - 4i*2 - 208i3 + i3 + 0i2 + 4i*2. -156i*3 Collect the terms in 13283 - 13273 + 65f - 220f - 22f. -177f + 10 Collect the terms in 46782r - 9362r - 9357r - 9360r - 9365r - 9355r. -17r Collect the terms in -3 - 15x2 + 211629187x + 3 + 5x2 - 211629187x. -10x2 Collect the terms in -3453 + 3o*3 + 1119 - 7o*3 + 1117 + 1217. -4o*3 Collect the terms in -638 + 638 - 5p2 + p2 + 1509p3. 1509p*3 - 4p*2 Collect the terms in 484014 + 534i*2 - 484014. 534i*2 Collect the terms in -17o + 20o + 19o - 13 - 45o + 18o. -5o - 13 Collect the terms in -26 + 189r*2 - 74 - 61r*2. 128r*2 - 100 Collect the terms in 3843 - 3843 - 1034069g + 1034330g. 261g Collect the terms in 6 + 29655603472g3 - 29655603469g*3 - 6 - 2g. 3g3 - 2g Collect the terms in -9d - 227d*3 - 1 + 1 - 672d*3 - 128d*3. -1027d*3 - 9d Collect the terms in 1128754314l3 - 2257508641l*3 + 1128754330l*3. 3l*3 Collect the terms in 8 - 184 + 2u + 10 + 135 + 0 + 31. 2u Collect the terms in -281465081339357z*2 - 2z*3 + 281465081339357z*2. -2z*3 Collect the terms in -3929 - t + 3t*2 + 3928 - 4t*2 + 4t*2. 3t*2 - t - 1 Collect the terms in -83 + 1059n*3 - 362n*3 + 83 - 353n*3 - 355n*3. -11n*3 Collect the terms in 62n + 0n2 - 17n + 20n2 + 62n - 112n. 20n*2 - 5n Collect the terms in 816h2 - 895h*2 - 9 - 142. -79h*2 - 151 Collect the terms in 1181k - 2189 - 2234 - 20k + 4423. 1161k Collect the terms in 4100g3 - 2 - 3648g*3 - 502g*3. -50g*3 - 2 Collect the terms in -10 + 3786m*3 + 41 - 31. 3786m*3 Collect the terms in 98k + 101k - 385k + 85k + 101k + 1368k3. 1368k*3 Collect the terms in 9064t - 29138t + 9618t + 9797t - 2. -659t - 2 Collect the terms in -125 - 4c - 97 - 58 - 102 + 122. -4c - 260 Collect the terms in 16651 - 33278 - 4a3 + 16627 + 9a*3 - 4a3. a3 Collect the terms in 1 + 5767g - 215g*2 - 1 + 6296g - 12063g. -215g*2 Collect the terms in 88j*2 + 155j*2 + 0j - 299j2 + 196j*2 + 0j. 140j2 Collect the terms in -2690224p + 8070681p - 2690223p - 2690242p. -8p Collect the terms in 7g + 12 - 16 + 12 + 15 + 30 - 12. 7g + 41 Collect the terms in 393n2 + 392n*2 - 13n*3 - 348n*2 - 437n*2. -13n*3 Collect the terms in -14644c*2 + 7485c*2 + 7159c*2 - 23c*3. -23c*3 Collect the terms in -1173a - 8a3 - 38a*3 - 1210a + 2383a. -46a*3 Collect the terms in 1400 - 3154n*3 + 1399 - 3010n*3 - 2799. -6164n*3 Collect the terms in 11293g + 11293g - 34587g + 11270g. -731g Collect the terms in 1681o3 + 956o*2 + 959o*2 - 2870o*2 - 469o*3 + 955o*2. 1212o*3 Collect the terms in -171 - 360 - 177 + 631 + k + 77. k Collect the terms in -1751v + v*2 + 9633v + 8535v. v2 + 16417v Collect the terms in 25u - u2 - 4 + 4 - 2 + 1 - 6u. -u*2 + 19u - 1 Collect the terms in -2n - 9n + 10n + 3n + 322n3 - 131n*3. 191n*3 + 2n Collect the terms in 112t3 + 2090t*3 + 504t*3 + 1389t*3 + 3t*2 - 2t*2. 4095t3 + t2 Collect the terms in -164614 + 164614 - 623a2 + 221a*2 + 322a*2. -80a*2 Collect the terms in 52810568u + 952u2 - 52810568u. 952u2 Collect the terms in 3260 + 7109v - 2185v - 3260. 4924v Collect the terms in -365i + 43i*3 - 360i - 236i2 + 725i. 43i3 - 236i*2 Collect the terms in -2 + 1403x*2 - 1074x*2 - 166x*2 - 164x2 - 5. -x2 - 7 Collect the terms in 5187808 - 3v + v - 1636306. -2v + 3551502 Collect the terms in -610t - 871t + 3307t - 606t - 610t - 607t. 3t Collect the terms in 47a*3 + 28324085a*2 + 85a*3 - 28324085a*2 - 5a. 132a3 - 5a Collect the terms in 7b + 2b + 1174 - 2335 - 3b + 1161. 6b Collect the terms in 244763j2 - 200983j*2 + 398896j*2. 442676j*2 Collect the terms in 4n - 182 + 16n + 3890 - 181 - 3527. 20n Collect the terms in 7m + 19m + 11m - 260 + 256 + 12m*2 - 14m*2. -2m*2 + 37m - 4 Collect the terms in 2o2 + 0o*2 - 3844o - 1063o3 + 3842o. -1063o3 + 2o*2 - 2o Collect the terms in -10u2 + 3u*3 - 1107u + 13u2 - 108u - 2u2. 3u3 + u2 - 1215u Collect the terms in 1208783m*3 - 2417586m*3 + 1208796m*3. -7m*3 Collect the terms in -2091 + 2091 - 1144y*2 - 562y*2 + y - y. -1706y*2 Collect the terms in 336246159 - 336246159 - 8i. -8i Collect the terms in -3b + 1530989 + 3b - 179120b*2 - 1531194 + 179122b*2. 2b*2 - 205 Collect the terms in 155688r*3 - 535704r*3 - 140062r*3. -520078r*3 Collect the terms in 67 + 0c + 23 - c + 41 - 41. -c + 90 Collect the terms in -22661d2 + 7709d*2 + 7443d*2 + 7459d*2. -50d*2 Collect the terms in 31n*3 - 30n*3 + 0 - 1 + 170715n. n*3 + 170715n - 1 Collect the terms in 6p + 1848924 - 1848813 - 3p*3 + 6p*3. 3p*3 + 6p + 111 Collect the terms in -155a2 - 5a*3 - 350 - 363 + 713 - 3a. -5a3 - 155a*2 - 3a Collect the terms in -15233 + 36788 + 31652 + 50655 - c. -c + 103862 Collect the terms in -2g - 306g*3 + 10g - 28g - 26g + 63g3. -243g*3 - 46g Collect the terms in -5	{ "pile_set_name": "DM Mathematics" }
3 - 14i2 + i + 6. Give -q(w) + 6u(w). w*3 + 20w*2 - w Let i(x) = -3x*2 - 5x - 5. Let d(t) be the third derivative of -t5/20 - t4/4 - t*3 - 8t*2. What is -5d(v) + 6i(v)? -3v*2 Let t(u) = -u + 83. Let a be t(0). Let r = 57 - a. Let i(f) = -2f*2 - 2. Let h(b) = -9b*2 - 9. Calculate ri(p) + 6h(p). -2p*2 - 2 Let t(a) = 4a*2 + 8. Let q(u) = -5u*2 - u - 9. What is -2q(n) - 3t(n)? -2n*2 + 2n - 6 Let c(u) = u*3 + u - 1. Let z(a) = -2a3 + a2 - 5a + 4. What is 4c(m) + z(m)? 2m3 + m2 - m Let i(j) = -4j - 3. Suppose -13 = -3s + 20. Let g(r) = -7r - 6. Calculate si(h) - 6g(h). -2h + 3 Let s(h) = -2h*2 - 2h - 7. Let o(b) = -b*2 - 3b - 7. What is 2o(d) - 3s(d)? 4d2 + 7 Let v(t) = t - 4. Let p(g) = -1. Let x(u) = u - 1. Let k(a) = -6p(a) - x(a). What is 3k(i) + 5v(i)? 2i + 1 Let h(s) = s3 + s - 1. Let o(r) = 3r*3 + 6r. What is -6h(z) + o(z)? -3z*3 + 6 Let f(t) = -4t - 4. Let g(o) = o + 1. Calculate 2f(n) + 9g(n). n + 1 Let w(p) = -5p3 - p. Let q(s) = -s3. Suppose 5f + 3 + 2 = 0. Let k = f + 5. What is kq(u) - w(u)? u3 + u Let v(f) = 2f*3 - 3f*2 - f. Let x(y) = 5y*3 - 8y*2 - 3y. Let k(c) = 8c - 8. Let j be k(6). Suppose 9w + j = 4w. Determine wv(p) + 3x(p). -p3 - p Let t(q) = -8q*3 + 2q*2 - 7q + 7. Let x(d) = -7d3 + 2d*2 - 6d + 6. Calculate 6t(u) - 7x(u). u*3 - 2u*2 Let r(i) = 343i*3 + 77i*2 - 77. Let l(a) = 9a*3 + 2a*2 - 2. Calculate -77l(t) + 2r(t). -7t*3 Let u(c) = 17c + 11. Let k(t) = 6t + 2. Let v(x) = 13x + 4. Let g(h) = 14k(h) - 6v(h). Suppose 3j = 5j - 22. Determine jg(q) - 4u(q). -2q Let r(u) = -7u*2 - 4u - 1. Let l(a) = -a*2 - a. Suppose -v + 2v = -2i - 7, 3i = 3v - 24. Give il(f) + r(f). -2f2 + f - 1 Let y(w) = w. Let c(z) = 17z + 2. Give c(r) + 6y(r). 23r + 2 Let c(w) = 6w3 - 8w*2 - 6w - 8. Let y(f) = -f*3 - 15f*2 - 16f - 20. Let m be y(-14). Let j(u) = 4u3 - 5u*2 - 4u - 5. Give mj(h) - 5c(h). 2h3 - 2h Let w(n) = 7n3 - 8n*2 - 8. Suppose 0 = 6f - 4f + 10. Let x(g) = -g3 + g2 + 1. What is fw(b) - 40x(b)? 5b*3 Let x(p) = -3p*2 + p + 2. Let b(m) = 13m*2 - 3m - 9. What is 2b(k) + 9x(k)? -k*2 + 3k Let r(z) = 2 - 1 + 0. Let a(g) = -5g - 26. Let h be a(-5). Let n(s) = -s2 - 4. What is hn(q) - 2r(q)? q2 + 2 Let c(i) = 52i - 5. Let h(m) = 26m - 2. Give -3c(o) + 7h(o). 26o + 1 Let y(x) = -3x2 - 5x + 6. Let f(t) = -t. Calculate -4f(p) + y(p). -3p2 - p + 6 Let v(c) be the second derivative of c5/20 + 16c. Let y(g) = -10g*3. Calculate 6v(l) + y(l). -4l3 Let w(y) = -6y - 10. Let h(a) = 2a + 3. Suppose 2u - 5o = -15, 0 = o + o + 2. Determine uh(p) - 3w(p). -2p Let s(y) = -3 - 1 + 0y + 5y*2 + 2y*2 + y. Suppose 3 + 9 = 3c. Let g be (0 - -4)(-5)/(-4). Let o(q) = -6q*2 - q + 3. Calculate cs(n) + go(n). -2n*2 - n - 1 Let j(n) = -13n + n + 22 - 4 + 21n2 - 6n. Let o(w) = w*2 - w + 1. Determine j(z) - 18o(z). 3z2 Let t(w) = 4w*3 + 4w*2. Let c(b) = -5b2 - b3 - 4b2 + 3b*2 + 5b*2. What is 6c(i) + t(i)? -2i3 - 2i2 Let k(i) = i2 - i + 4. Let a(r) = 1. Suppose 0z - 20 = -4z. Suppose -z + 35 = -5c. Give ca(p) + 2k(p). 2p*2 - 2p + 2 Let o(y) = 0y2 - 1 + 2y2 - y3 - y*2. Let p be 4/4-3 + 5. Let z(j) = j*2 - 1. Give po(t) - 2z(t). -2t*3 Let t(r) = -2r + 13. Let l(j) = -2j + 14. Give 4l(h) - 5t(h). 2h - 9 Let u(f) be the second derivative of -f*5/10 + 11f*4/12 + 11f*3/6 + 2f*2 - 40f. Let h(g) = -g*3 + 6g*2 + 6g + 2. Calculate 11h(y) - 6u(y). y*3 - 2 Let a(d) be the first derivative of 7d*2 - 14d + 11. Let u(x) = -35x + 55. Let l(f) = -5f + 8. Let w(b) = 20l(b) - 3u(b). What is -6a(v) + 17w(v)? v - 1 Let q(o) = -o*2 + o + 1. Let n(h) = 3h*2 + 3h + 3. Give n(a) - 3q(a). 6a*2 Let x(a) = 2a*2 - 7a + 11. Let q(f) = -f*2 + 3f - 5. Calculate 7q(i) + 3x(i). -i2 - 2 Let c(v) = v2 - v + 1. Let t(a) = a*2 + 3a + 2. Let m be t(-3). Let h = m + -4. Let f(p) = 10p2 - 9p + 9. Calculate hf(j) + 18c(j). -2j2 Let o(k) be the first derivative of -7k*2/2 - k - 1. Let m(r) = -20r - 3. Suppose 3s + 2n + 53 = 0, -80 = 5s - 0s - 5n. What is so(p) + 6m(p)? -p - 1 Let g(j) = -j - 7j + 6 + 3j. Let u(r) = -9r + 11. Calculate 11g(c) - 6u(c). -c Let v(s) = -2s2 + 6s + 3. Let o(l) = -l + 1. Determine -2o(h) + v(h). -2h*2 + 8h + 1 Let k(z) = 30z + 27. Let c(s) = s + 1. Calculate 54c(o) - 2k(o). -6o Let v(x) be the second derivative of x2/2 - x. Let f(b) be the second derivative of b3/6 - 17b. Determine -2f(o) - v(o). -2o - 1 Let n(a) = -5a*3 - 2a*2 + 4a + 3. Let b(r) = -r*2 + r + 1. Determine -4b(m) + n(m). -5m3 + 2m*2 - 1 Let p(x) = -x. Let m(l) = l. Let w be 1 + 2 + -2 + 8. Suppose -5j + 11 = -w. Determine jm(b) + 5p(b). -b Let t(k) = 1. Suppose -4d = 1 + 19. Let h(c) = 9c + 1. Let a(y) = -4y. Let n(z) = da(z) - 2h(z). What is n(r) + 4t(r)? 2r + 2 Let y(h) = 53. Let f(j) = -33. Let g(m) = 8f(m) + 5y(m). Suppose 4x = -4v - 28, -7v = -2v + 20. Let b = 4 + x. Let c(a) = 2a + 4. Give bc(w) - 4g(w). 2w Let n(a) = 6a*3 - 8a - 17. Let b(p) = -10p3 + 2p*3 + 6p*3 + 3p + 6. Let u(q) = -4 - 5q + 1 + 2. Let j be u(-1). Give jn(i) + 11b(i). 2i*3 + i - 2 Let k(m) = -67m*3 + 13m*2 - 13m. Let r(o) = 33o3 - 6o*2 + 6o. Give 6k(f) + 13r(f). 27f3 Let u(h) = -7h*2 - 6h + 1. Let z(l) = -20l2 - 17l + 2. Let t(a) = 17u(a) - 6z(a). Let c(x) = -1. What is 15c(y) + 3t(y)? 3y2 Let v(i) = 11i + 11. Let y(z) = -2z - 6 + 1 - 3z. Suppose -5n + 290 = -5m, 3n = -m - n - 38. Let a be ((-4)/12)/(2/m). Determine ay(t) + 4v(t). -t - 1 Let w(u) = 14u. Let f(s) = -13s. Determine 7f(r) + 6w(r). -7r Let v(a) = -3a2 - 15a - 21. Let n(y) = y*2 + 4y. Let k(t) = -9n(t) - v(t). Let u(c) = c2 + 4c - 4. Suppose 4 + 29 = -3l. Determine lu(i) - 2k(i). i2 - 2i + 2 Let k = 18 - 10. Let x(n) = -6n + 2. Let v = 5 + -4. Let r(i) = i. Give kr(c) + vx(c). 2c + 2 Let m(t) = 2t + 4. Let o(l) = -3l - 7. Let y(r) = -5m(r) - 3o(r). Let p(s) be the second derivative of 4s3/3 - 3s*2 - 12s. What is p(b) + 6y(b)? 2b Let t = -21 - -35. Let i(j) = -5j3 + 7j*2 - 2j - 7. Let c(w) = -4w2 + 25w - 3 - 2w3 - 26w + 7w2. Calculate tc(s) - 6i(s). 2s*3 - 2s Let w(h) = -18h - 2. Let y(r) = 6r + 1. What is -3w(j) - 8y(j)? 6j - 2 Let p(o) = -o3 - o + 1. Let z = -5 - 1. Let h(r) = r3 + r. Let j(x) = 11x*3 + 2x*2 + 11x - 6. Let q(m) = 6h(m) - j(m). What is zp(f) + q(f)? f*3 - 2f*2 + f Let q(h) = -3 + 6h + 5 - 5h. Let r(j) = 3j + 5. Let c be (-4)/6 + (-16)/12. What is cr(l) + 5q(l)? -l Let g(t) = 5t + 3. Let p(s) = -36s - 20. Give -40g(y) - 6p(y). 16y Let z be 13 + (-30)/(-10). Let x(p) = -7p3 - 4p*2 - 11p. Let u(d) = -2d3 - d2 - 3d. Calculate zx(o) - 22u(o). 2o3 - 2o*2 Let n(i) = i - i - 5i + i. Let g(r) = 3r. Let q(s) = -2s. Let j(a) = -3g(a) - 5q(a). Give -7j(b) - 2n(b). b Suppose -u + 2u = 2. Suppose m - 24 = -m - 4g, -6 = um - 2g. Let i(w) = w*2. Let y(d) = 1. Determine mi(o) - y(o). 2o2 - 1 Let a(t) = 12t*2 + 3. Let y(h) = -60h*2 - 16. Let u(z) = 16a(z) + 3y(z). Let c(j) = -j2. Give -20c(i) - 2u(i). -4i2 Let q(b) be the second derivative of b4/6 - 7b2/2 - b. Let f = 10 - 9. Let l(v) = -f - 2v*2 + 0v*2 + 7. Calculate -7l(t) - 6q(t). 2t*2 Let n(q) = 7q3 - q2 - 6q. Let k(f) = -2f2 - f + 1. Let b(v) = -v3 - 6v2 - 2v + 3. Let y(w) = b(w) - 3k(w). What is n(g) + 6y(g)? g3 - g2 Let s = 53 - 56. Let l(m) be the first derivative of m*3/3 + 3m - 3. Let p(n) = -1. What is sp(x) - l(x)? -x2 Let k(w) = -w. Let v(r) be the first derivative of -r2/2 + 2. Calculate k(l) + v(l). -2l Suppose 0 = -0n - 5n + 15. Suppose -1 = np + 3t - 4t, p - 4t + 15 = 0. Let i(r) = r*2 + r. Let f(v) = -6v*2 - 6v - 1. What is pf(z) + 4i(z)? -2z2 - 2z - 1 Let k(d) = 10d - 6. Let o(i) = 5i - 3. Calculate 2k(y) - 5o(y). -5y + 3 Let v(a) = -a2. Let t(r) = -2r*2. Suppose d = -3d - 12. Determine dv(h) + 2t(h). -h*2 Let g(q) = 6q*3 + 3q**2 -	{ "pile_set_name": "DM Mathematics" }
ng p is positive. p(-186867/55) Simplify ((l(-2/13)/l0)45)(-9) assuming l is positive. l(810/13) Simplify ((uu/(u/u(-1/6))u)/uu/u(-3/7)(u(-1/7)/u)/((((u/u12)/u)/uu)/u))(3/10) assuming u is positive. u(593/140) Simplify (((m(-3)m)/m)/m)*(3/7)/(mm0)11 assuming m is positive. m*(-89/7) Simplify (dd(-14))38/(d(-1/2))(-10/3) assuming d is positive. d*(-1487/3) Simplify (pp*(-1/2)pp/((pp*(-1/3)pp)/pp)pp)/(p/((p(ppp/(p(-10)/p)p)/p)/p)pp(-7)) assuming p is positive. p(125/6) Simplify ((a(-1/9)/(a(1/7)a))(9/4))(-40/3) assuming a is positive. a(790/21) Simplify ((s/s(2/35)ssss)/s(4/3))/(s(sssss*(-1/8)s)/s)(2/107) assuming s is positive. s(158117/44940) Simplify (f2)(11/3)(f(f/f*2ff)/f)(2/15) assuming f is positive. f(112/15) Simplify ((i17ii)/i)/(i(7/5)i)(ii*4i)(4/13) assuming i is positive. i(1134/65) Simplify ((i(-23))2)(-38) assuming i is positive. i1748 Simplify (y*13yy(-3/4))/(y4/(y/y(-2/5))) assuming y is positive. y(213/20) Simplify ((o(3/2)/(o0/o))/((ooo/(o(o/(o/o*(-2/5)))/o)o)/o)(1/34))(14/9) assuming o is positive. o(56/15) Simplify ((a/(a(-14)a)a)/(a(a/a(-1/7))/a))/((aaa(2/7)a)/a)(-8/9) assuming a is positive. a(143/9) Simplify ((((p*(3/8)p)/p)/(p(-3)/p))/(p/(p/((p(-2)p)/p))p(-4)))(1/22) assuming p is positive. p*(83/176) Simplify ((y/((yyy/(yy/y*(6/7)))/yy)y(5/8)y)(8/3))(7/4) assuming y is positive. y*(43/12) Simplify (y((y/y*2)/y)/yy/y8)/(y(-2/23)yy(-7)/y) assuming y is positive. y(-44/23) Simplify ((mm(-5))/m(3/8)m(-3)/m(-1/11))(-20) assuming m is positive. m(3205/22) Simplify h*(-10)/hh*(-10)h*(-5)h8 assuming h is positive. h(-18) Simplify l11/((l4/l)/l)l(1/7)l/(l(l/(ll/l(4/17)))/l) assuming l is positive. l(1298/119) Simplify s*32s/s*(-1)(s/s(-5))(-34/7) assuming s is positive. s(34/7) Simplify b/(b(-5/3)/b)bb*(-29)b(b(-7/5)bb)/bb(b/(b((b(7/9)/b)/b)/b))/b assuming b is positive. b(-968/45) Simplify (u13)22(u(-3))(-1/6) assuming u is positive. u(573/2) Simplify ((aa/a1)/a)36(a4)(-6/5) assuming a is positive. a(-24/5) Simplify ((z(-1)z/(z/z*8)z)(2/9))(-1/2) assuming z is positive. z*(-8/9) Simplify (s(ss(1/23))/ss)/ss/s6((((s(sss/(s/(s(-4/7)/s)))/sss)/s)/ssss)/s)/(ss6/s) assuming s is positive. s(-1212/161) Simplify g(-1/13)g*(16/3)/gg(-17)/(g(4/13)/g) assuming g is positive. g*(-470/39) Simplify (((aaa(-2)/a)/(a/(a(-3/4)/a)))/((a/((a(-3/2)/aaa)/aa))/a(-2/13)))(-7/4) assuming a is positive. a(1967/208) Simplify (i/(i7/i)i)(-15/8)/(iiiii/(ii/i*(-2/11))i)(-38) assuming i is positive. i(3357/22) Simplify ((h4/h)/h)/(h(4/3)/h)(hhh(2/13)hh)/(h(h(h10h)/hh)/h) assuming h is positive. h(-241/39) Simplify ((l(-1/10)l)/l)/(ll((l*(-31)/l)/ll)/ll)(l(9/8))(-4) assuming l is positive. l(127/5) Simplify (t13t(7/4))/(t(-2))(-44) assuming t is positive. t(-293/4) Simplify ((ttt(-8)t/(tt(t/(tt8tt))/tt))(-21/2))25 assuming t is positive. t*(-1575/2) Simplify (y(y*(-36)y)/y)/yy5(y*(-13)y)/(yy(-36)) assuming y is positive. y(-8) Simplify k(-3/7)kkkk/(kk*11)kk(-3)k*(-1)k assuming k is positive. k*(-73/7) Simplify (((a/(aa/(aaa*(-19))))/((a/((((aaa/a(-7))/aa)/a)/a))/a))(-9))(2/3) assuming a is positive. a60 Simplify (j/(j19j))(-9)/(j(-1/9)j(-29)) assuming j is positive. j(1801/9) Simplify m/(m/m*17)mm13m3/m(-1/6) assuming m is positive. m(205/6) Simplify ((z0)*(-12)z*1z(3/7))19 assuming z is positive. z*(190/7) Simplify ((((kk/(k/(k/k*(3/2))))/k)/(kk(2/7)))(-6))18 assuming k is positive. k(1350/7) Simplify a/(aa/(a/a4))aaa*(9/2)(a/a(1/10))/a(-11) assuming a is positive. a(72/5) Simplify (w(-2/7)/w(-4/7))/((w2/w)/(w/w(1/3))) assuming w is positive. w(-1/21) Simplify (vvv*8v*(-6/11)v)/(vvv/(v/(v*1/vv))vv)(-2/13) assuming v is positive. v(1605/143) Simplify (u/(u/(u*(-18)/u))uu11u)/((u/u*31u)/u(-1/32)) assuming u is positive. u(735/32) Simplify (((dd13/d)/d)/d(-11))/(d9)(-18) assuming d is positive. d185 Simplify (s/(s/(s/s(2/13))))/s(-5/6)(s(2/29))(-34) assuming s is positive. s*(-1505/2262) Simplify (rr/(r/r*(-1))r18)/(r(-13)r(-1)) assuming r is positive. r32 Simplify (y(4/11)y)/(yy/((y10/y)/y)yy)(y*(3/11)y)/(yy(7/2)y) assuming y is positive. y(25/22) Simplify (m/((m(-2)/m)/m))*(-5)(mm6)/m(-14) assuming m is positive. m(-4) Simplify (m/(mm/m*(-5)mm))(-3/53)m*(-18)m((m/m(-17))/m)/mm assuming m is positive. m*(24/53) Simplify ((ii*(-1/5)i*3)/((i/(ii*(-4)i))/i(4/11)))(-1/13) assuming i is positive. i(-64/715) Simplify (m(2/13)/(m/(m11/m)))/(m(6/11)/(m/m(-3/4))) assuming m is positive. m(5925/572) Simplify ((q(-2/9)/q(2/7))/((qq(-2)qqqq)/(q(-2)/q)))(-2/33) assuming q is positive. q(820/2079) Simplify (((aa(aa*(3/2)/a)/aa)/(a*8/a))/((a/(aaa(-5)))/aaa(1/13)))(-15) assuming a is positive. a(2955/26) Simplify z(-10/9)/z(-9)(z(2/5))(-34) assuming z is positive. z(-257/45) Simplify ((n7(n(-10)n)/n)49)(2/25) assuming n is positive. n(-294/25) Simplify (w(-6/7)w19/w)/((w18/w)/(www9w)) assuming w is positive. w(85/7) Simplify ((z(-3/7)/(zz/z(2/15)z))/(z*(-9)/(zz(-2))))45 assuming z is positive. z(1482/7) Simplify (((f(-1)/fff)(-19/5))(-2/15))11 assuming f is positive. 1 Simplify ((c(-9)cc)/(c/c27))(-2/3) assuming c is positive. c(-38/3) Simplify (u(-2/5)/((((u/u*2)/u)/u)/u)(uuu*(-2/51)/uu)/(u(uu*(2/7)uu)/u))50 assuming u is positive. u(40610/357) Simplify (nn/(n/n*(3/2))n/(nn(-8)))/(n2/n)(-13/6) assuming n is positive. n(38/3) Simplify ((zzz/(z/(z0z)))/zzz)1/(z(1/6)/(z/(zzz(7/2)))) assuming z is positive. z(-2/3) Simplify ((((m*5m)/mm)/(m(9/4)m))(5/2))(-48) assuming m is positive. m*(-330) Simplify (qqq/((((qq*(1/5)/q)/q)/q)/q)q13)(-2/13) assuming q is positive. q(-188/65) Simplify (g16)(-1/10)/(g(-20)g/(g/(gggg/((gg(17/4)/g)/gg)))) assuming g is positive. g(373/20) Simplify (c(4/5))*(1/2)cc(-1)/ccc(-7) assuming c is positive. c(-33/5) Simplify ((g/g(-3/7))/(ggg(3/13)/g))/(g7g(-2/37)) assuming g is positive. g(-22721/3367) Simplify (y(-1/2)/y)45/((yyy*8y)/(yy/(yy*9y))) assuming y is positive. y(-175/2) Simplify f(2/19)f(-26)f/(ff/(fff/f(-8/11)fff)f)ff(-3/2) assuming f is positive. f(-9057/418) Simplify u(uu/u(-7/3))/uu*(-5)(u(2/3))(-46) assuming u is positive. u(-94/3) Simplify d(-19)/d*(1/12)dd(6/17)(d/(d/d(1/7)))/d assuming d is positive. d(-26543/1428) Simplify ((k/k(1/6))34)(-26) assuming k is positive. k(-2210/3) Simplify (d(3/4)/(d/d6))/((d(d/(dd/(dd16dd)))/d)/(d/(dd(-3)))) assuming d is positive. d(-37/4) Simplify (v/(v/(vv(v(v5v)/vv)/vv))vv/((v/(vv(-2/53)/v)v)/v))/(v*(-1/16)/vvvv(((v(3/22)/vv)/v)/v)/vv) assuming v is positive. v(92239/9328) Simplify (((k(k*(4/9)/kk)/kk)/k)(3/31))34 assuming k is positive. k(136/93) Simplify (qq/((qq3q)/q)q(-8/5))/(qqqq/(q(q/(q26/q))/q)qqq(-16/9)) assuming q is positive. q(-1432/45) Simplify (ww(-8))(-20)/((ww/w*(6/7)w)/w)12 assuming w is positive. w(884/7) Simplify (fff1)(4/9)(ff(f(-3/10)/f)/ff)/ff/(ff13) assuming f is positive. f(-359/30) Simplify gg(3/19)g/(gg6)(g(-2/5))(-1/16) assuming g is positive. g(-3661/760) Simplify (j(-27)jj(-2/61))(1/9) assuming j is positive. j(-1588/549) Simplify (a11)(-1/14)/(a/a(-3/4)aaa(5/12)) assuming a is positive. a(-104/21) Simplify (m(1/3))(1/12)/((mm/(mm(-3/11))m)/(m2/m)) assuming m is positive. m(-493/396) Simplify (ff0/f)(1/3)f/(f/f*12)ff/(ff**(2/15)) assuming f is positive.	{ "pile_set_name": "DM Mathematics" }
m*4 + 3/2m*n. -m(m - 1)*3/2 Let c be 62/4840/63. Suppose 8r + 0 = c. Factor -3s3 + 3/4s*r + 3/2s*2 + 0s*4 + 9/4s - 3/2. 3(s - 1)3(s + 1)(s + 2)/4 Let d(u) = -2u*2 - 1. Let z(h) = 17h*2 + 206h - 10600. Let n(c) = 36d(c) + 4z(c). Let n(w) = 0. What is w? 103 Let c = 7/221 + 628/1105. Factor -3/5n + cn*2 - 6/5. 3(n - 2)(n + 1)/5 Let z(p) be the first derivative of -p3/3 + 245p*2 - 60025p + 400. Suppose z(j) = 0. Calculate j. 245 Let z(q) be the first derivative of 2q + 3/2q*2 + 20 + 1/3q*3. Suppose z(b) = 0. Calculate b. -2, -1 Suppose m - 6p - 13 = -5p, -5m = -2p - 62. Suppose 16b*2 - 5b*2 - mb2 - b3 = 0. Calculate b. -1, 0 Suppose 0 = -3c - 4t + 48, 5c - t = 2t + 51. Suppose 0 = -4u + c - 4. Let -2/9r*4 + 0 - 8/9r*u - 8/9r*3 + 0r = 0. Calculate r. -2, 0 Let s be (108/462)/(-9)-28. Let d be 2 - 3 - (-13)/11. Factor 10/11a*3 + da + 4/11a4 + 0 + sa*2. 2a(a + 1)2(2a + 1)/11 Let m = -408/7 + 2227/28. Let y = m + -19. Factor 0l + 3/4l5 + 0l*4 + 3/2l*2 + 0 - yl*3. 3l*2(l - 1)*2(l + 2)/4 Factor 34/3w - 35/3 + 1/3w*2. (w - 1)(w + 35)/3 Let k(u) be the third derivative of 0u + 0u*3 + 0 - 14u*2 + 1/30u*6 + 1/6u*4 + 2/15u*5. Solve k(o) = 0. -1, 0 What is t in -99t*5 + 3183624 - 93633t*3 - 3182706t*2 + 84226t - 918t4 + 35t*5 + 30t*5 + 31t*5 + 9410t = 0? -102, -1, 1 Suppose -132m + 127m = -15. Let r(v) be the third derivative of 0v + 1/18v*m - 1/72v*4 + 2v*2 + 0 - 1/180v*5 + 1/360v6. Factor r(l). (l - 1)2(l + 1)/3 Suppose -9y - 60 = -6y - 18y. Determine k so that 160/7k + 160/7k*2 + 2/7k*5 + 64/7 + 80/7k*3 + 20/7k*y = 0. -2 Let h = 3793 - 3790. Solve 2/5i*h + 0 + 0i*2 - 2/5i = 0 for i. -1, 0, 1 Let m(b) be the third derivative of 3b6/160 - b5/10 + 7b4/32 - b3/4 - b*2 - 31b. Determine p, given that m(p) = 0. 2/3, 1 Let w(y) = y*2 - 1. Let j(v) = 2v*2 + 816v + 10 - 804v + 0v*2. Let p(c) = j(c) + 2w(c). Solve p(t) = 0 for t. -2, -1 Find n, given that 1 + 13n3 + 4n*2 + 6n*2 - 31n*3 - 17 - 4n + 16n3 = 0. -1, 2, 4 Let j(g) = 0g - 1 + 2g - 6. Let a be j(5). Let -5 + aq + 0 + 5 + q2 = 0. Calculate q. -3, 0 Let d(q) be the third derivative of -q6/24 - q*5/2 + 5q*4/6 + 20q*3 - 32q*2 + 5. Factor d(h). -5(h - 2)(h + 2)(h + 6) Let j(u) be the second derivative of -u*7/630 + 2u5/15 - u4/6 + 2u. Let v(i) be the third derivative of j(i). Factor v(x). -4(x - 2)(x + 2) What is d in 2d*2 + 2/3d - 2 - 2/3d3 = 0? -1, 1, 3 Let w(i) be the first derivative of -3i*4 + 68i*3/3 + 64i*2 - 112i + 132. Factor w(m). -4(m - 7)(m + 2)(3m - 2) Let l be 236/58 + 386/(-5597). Solve -1/8vl + 0v*3 + 1/8v*2 + 0v + 0 = 0 for v. -1, 0, 1 Let d(r) be the first derivative of -r*3/7 - 3r*2/14 + 24r + 242. What is j in d(j) = 0? -8, 7 Let j = -1004 - -2009/2. Let 1 + 3/2z2 - 5/2z - jz4 + 1/2z*3 = 0. What is z? -2, 1 Let z(s) = 8s*4 - 17s3 - s2 - 4s - 7. Let a(x) = -7x*4 + 15x3 + x2 + 3x + 6. Let h(d) = 7a(d) + 6z(d). Let h(i) = 0. Calculate i. -1, 0, 1, 3 Suppose 9i - 16 = 7i. Suppose -2 = 2s, 3s - i = -5j + 9. What is y in -14/9y2 + 0 - 8/9y*5 - 26/9y*j - 2/9y - 10/3y3 = 0? -1, -1/4, 0 Find q, given that -6q*2 - 5q - 3q3 - 1/2q4 - 3/2 = 0. -3, -1 Let n = 231 - 349. Let k = n - -118. Let x2 + 1/2x3 + kx + 0 - 1/2x4 = 0. Calculate x. -1, 0, 2 Let h = 18 + -15. Suppose -hk = x + 3, -4x + x + k = -11. Factor 4b*x + b - 7b*4 + 8b*2 - b + 3b*4. -4b*2(b - 2)(b + 1) Let w be (-33)/(-6) - (-70)/(-15 + 1). Factor 1/2t*2 - 2 + wt*3 - 2t. (t - 2)(t + 1)(t + 2)/2 Let b(w) be the first derivative of 25 - 1/5w3 - 6/5w - 9/10w2. Factor b(u). -3(u + 1)(u + 2)/5 Let k(g) be the first derivative of -4/3g*3 + 6 + 2g + 1/2g2 + 2/5g*5 + 1/6g*6 - 1/2g*4. Suppose k(q) = 0. What is q? -2, -1, 1 Let w(q) be the third derivative of -18q*2 + 0q + 4/15q3 - 1/300q*7 - 1/15q*4 + 1/3360q*8 + 0 - 1/75q*5 + 1/75q*6. Determine k so that w(k) = 0. -1, 2 Let d(i) = -2i*2 + i - 1. Let s(w) = 59w*2 + 44w - 11. Let o(n) = d(n) + s(n). Factor o(q). 3(q + 1)(19q - 4) Let j(v) be the third derivative of -v8/560 + v7/35 + 3v6/25 + v5/50 - 23v4/40 - 6v*3/5 + 135v*2. Solve j(s) = 0. -1, 1, 12 Suppose -4w = -4z - 0w - 12, -4w = -3z - 11. Let p be z/5 - (-64)/20. Let -3tp + 2t*2 + 3t*2 - 8t*2 = 0. Calculate t. -1, 0 Factor -6 + 3j*2 + 36j - 12j2 - j2 - 12. -2(j - 3)(5j - 3) Let t(v) be the second derivative of v*6/330 + 3v5/110 + v4/33 - v*3/11 - 5v*2/22 - 111v. Factor t(f). (f - 1)(f + 1)2(f + 5)/11 Suppose 617 = -10w + 617. Let r(v) be the third derivative of -1/36v*4 + 1/90v*5 + 8v*2 + 0 + 0v + wv3. Factor r(z). 2z(z - 1)/3 Let f be (3/6)/((-2)/233). Let q = f + 59. Factor 0r + r*4 + qr*3 + 0 - 1/4r2. r2(r + 1)(4r - 1)/4 Let g = -16 - -16. Let n = 1353/2 + -9431/14. Factor 50/7i*3 + g + 2/7i + ni2. 2i(5i + 1)*2/7 Let f be 548/330 + 24/(-396). Let t(y) be the first derivative of -2y2 - 9 + y4 - 4y3 + fy*5 + 4y. Determine j, given that t(j) = 0. -1, 1/2, 1 Let l(z) be the first derivative of 0z2 - 6 + 0z + 1/18z3. Suppose l(h) = 0. Calculate h. 0 Let b be (-9 - -6)-3 - (-114)/(-19). Factor 3/2yb - 3/2y + 1/2y2 - 1 + 1/2y*4. (y - 1)(y + 1)*2(y + 2)/2 Let a = 23/42 + 11/14. Suppose -263 = 9q - 281. Solve 10/3u + 4/3 + auq = 0. -2, -1/2 Suppose 8c + 58 = 10c + 5z, 32 = -2c + 4z. Factor 0p + 0 - 6/5p*3 - 1/5p*c - 9/5p2. -p2(p + 3)2/5 Let x be (-2232)/992((-4)/(-66))/(-1). Let w(p) be the first derivative of -xp4 + 0p - 3 + 0p2 + 2/55p*5 + 4/33p*3. Solve w(j) = 0. 0, 1, 2 Let b(n) be the first derivative of 2n*5/15 + 2n*4/3 - 10n*3/9 + 186. Factor b(w). 2w*2(w - 1)(w + 5)/3 Let i(x) be the third derivative of -x6/40 - x5/20 + x4/4 + 58x*2 + 2. Factor i(l). -3l(l - 1)(l + 2) Let q = -50 + 63. Solve -5o3 - 8o*4 - 5 - 8o*4 + 5o - 7o4 + qo*4 + 15o*2 = 0. -1, 1/2, 1 Suppose 0 = -39i - 17i + 560. Let u(d) be the first derivative of -2/3d*5 - i - 8/9d*3 + 1/9d*6 + 4/3d*4 + 0d*2 + 0d. Solve u(f) = 0. 0, 1, 2 Let w(i) be the first derivative of -3i5/20 + 9i4/8 - i3/4 - 9i2 - 12i - 121. Factor w(o). -3(o - 4)2(o + 1)*2/4 Find r, given that -4r*5 - 24 + 147r*3 + 17r*4 - 56r*2 + 9r - 147r3 - r4 + 59r = 0. -2, 1, 3 Let x(u) be the first derivative of u7/70 - u6/90 - u*5/15 + 3u*3 - 9. Let a(f) be the third derivative of x(f). Factor a(k). 4k(k - 1)(3k + 2) Let c be 6/24-4 - 7/(-2). Let z(m) be the second derivative of 25/27m6 + 5/2m*4 + 0 - 4m + 0m2 - cm5 - m3. Determine x so that z(x) = 0. 0, 3/5 Let w(v) = 2v3 - 10v*2 - 12v + 28. Let t = -2 - 2. Let m(k) = -5k3 + 19k*2 + 23k - 55. Let d(a) = tm(a) - 9w(a). Factor d(j). 2(j - 1)(j + 4)2 Let j(g) be the second derivative of g4/66 - 21g3/11 - 2g + 144. Factor j(n). 2n(n - 63)/11 Let w(b) = b*3 + 16b*2 + 21b + 92. Let j be w(-15). Suppose 2c + j + 1/2c2 = 0. Calculate c. -2 Let f(t) = t4 - t3 + t2 - t - 1. Let w(h) = 6h5 - 19h*4 - 29h*3 + 9h*2 + 45h - 1. Let i(j) = -22f(j) - 2w(j). Determine r so that i(r) = 0. -2, -1, 1/3, 1, 3 Let w(x) be the third derivative of -x*7/315 + 2x6/45 - x5/10 - x*4/2 + 206x*2. Factor w(t). -2t(t - 6)(t - 3)(t + 1)/3 Let k(o) = o3 - 13o*2 - 15o + 9. Let n be k(14). Let s = n - -7. Factor 0f4 + 4f*2 - 6fs + f - f5 + 0f5 + 2f*4. -f(f - 1)*3(f + 1) Let w(a) = -a*3 - 4a*2 - 3a + 4. Let q be w(-3). Suppose -4 = -2b - qr - 2, 4b = 2r + 14. Suppose 6n2 - 2n*b - 8 + 6n*3 - 2n*3 = 0. What is n? -2, 1 Suppose -4y = 2n - 7n - 33, n + 5 = 0. Factor 3v + 4v + yv2 + 3v + 8. 2(v + 1)(v + 4) Factor 0 + 14/11n + 16/11n*2 + 2/11n*3. 2n(n + 1)(n + 7)/11 Let a(i) be the first derivative of i6/180 + i5/30 + i*4/12 + 4i*3/3 + 5. Let j(w) be the third derivative of a(w). Factor j(x). 2(x + 1)*2 Let o(h) be the third derivative of -3h**7/140	{ "pile_set_name": "DM Mathematics" }
*2 + 4q - 2. Suppose 21m + 84 = 9m + 24. Determine mv(y) - k(y). 9y*2 + y + 2 Let i(q) = 8q*3 - 53q*2 - 42q + 12. Let h(a) = 2a3 - 13a*2 - 11a + 3. What is 9h(v) - 2i(v)? 2v3 - 11v*2 - 15v + 3 Let a(j) = 3j2 - j - 1. Let w(l) be the first derivative of 7l3/3 - l2 - 3l - 1845. Let d be (-4 + -1 + 0)-1. Give da(m) - 2w(m). m*2 - m + 1 Let t(n) = -8n*3 + 9n*2 - 4n + 26. Let i(q) = 9q3 - 10q*2 + 4q - 30. Determine 6i(r) + 7t(r). -2r3 + 3r*2 - 4r + 2 Let q(g) = 5g2 + 9g + 7. Let y(d) = -11d2 - 19d - 16. What is 7q(l) + 3y(l)? 2l2 + 6l + 1 Let c(m) = 18m2 + 2m + 2. Let x = -9863 + 9865. Let f(q) = q*2 + q + 1. Calculate xc(j) - 4f(j). 32j*2 Let o(w) = 21w - 9. Let b(a) = -10a + 4. Let s be (-1008)/280(-10)/(-4). What is sb(m) - 4o(m)? 6m Let g(k) = 18945k + 33. Let z(o) = -3791o - 6. Calculate -4g(d) - 22z(d). 7622d Let p(a) = 16a2 + 94a - 36. Let h(s) = -s*2 - 4s + 2. Determine -36h(c) - 2p(c). 4c2 - 44c Let i(s) = -s*2 + 73s - 1178. Let j be i(24). Let h(f) = -3f2 - 35f. Let k(t) = 4t2 + 36t. What is jk(x) - 3h(x)? x*2 + 33x Let m = -4 - -3. Let j(b) = 5b3 - 468 - 3b - 505 + 979. Let v be 34/10 - 6/15. Let s(i) = i*3 - i + 1. Determine mj(w) + vs(w). -2w*3 - 3 Let a(w) = w. Let d(i) = 13i - 1. Let o(p) = p*2 + 9p - 629. Let s be o(21). Give sd(u) - 3a(u). 10u - 1 Let f(t) = -964815t*3 + 1964t*2 - 1964t - 1964. Let c(g) = 1473g3 - 3g*2 + 3g + 3. What is -1964c(k) - 3f(k)? 1473k3 Let j(z) = 25z*3 - 4z*2 + 5. Let y(b) = 13b*3 - 2b*2 + 2. Let k be 12/64 - 2555/1168. What is kj(g) + 5y(g)? 15g*3 - 2g*2 Let j(q) = 4q*3 - 5q*2 + 236q + 4. Let d(s) = 9s3 - 12s*2 + 469s + 9. What is 2d(w) - 5j(w)? -2w3 + w2 - 242w - 2 Let k(r) = -r*2 + 1. Let a(s) = -3s*2 + 2s + 5. Let h(m) = 22m - 45. Let n(z) = -21z + 45. Let q(x) = 4h(x) + 5n(x). Let v be q(3). Give vk(y) + a(y). 3y*2 + 2y - 1 Let a(t) = t - 1. Let m(o) = -10o2 - 11o + 8. Let c(d) = 41d2 + 46d - 33. Let f(k) = -6c(k) - 26m(k). Determine -20a(y) + 2f(y). 28y2 Let g(t) = 89t - 3. Let x(w) = 133w - 5. Suppose -33 = 5k - u, -k + u - 14 + 1 = 0. Calculate kx(v) + 8g(v). 47v + 1 Let z(k) = 3k*3 + 9k*2 + 9k + 9. Let f be (-26 - -28)/(4/18 + 0). Let m(r) be the first derivative of r3/3 + r2/2 + r - 39. Give fm(g) - z(g). -3g*3 Let j(z) = 320z + 124. Let o(g) = -g - 5. Determine j(k) + 24o(k). 296k + 4 Let t(o) = 297o3. Let b(n) = -12n*3 - 9n*3 - 9n*3 + 30n*3 - 11n*3. Let u be 3/(-2) - 0 - (-33)/(-66). Calculate ut(f) - 55b(f). 11f*3 Let k(t) = -31t*2 + 473t + 8. Let g(w) = -10w2 + 163w + 3. Give 11g(f) - 4k(f). 14f2 - 99f + 1 Let p(k) = -154k2 - 55. Suppose 24x = 7x + 51. Let h(u) = -3 - x - 15u*2 - 6u*2 + 4u*2. Calculate -55h(s) + 6p(s). 11s*2 Let y(a) be the first derivative of -5a*4/4 + 3a*2 + 5a - 8190. Let t(k) = -k*3 + k. What is -3t(i) + y(i)? -2i3 + 3i + 5 Let a(j) = -j3 + j2 + j + 1. Let c(h) = 4h3 + h2 - 5h - 7. Suppose 12u = -0 - 1 + 13. Give uc(l) + 5a(l). -l3 + 6l*2 - 2 Let i(w) = 2w*2 - 768w - 25. Let b(d) = -d*2 + 256d + 9. Calculate -8b(s) - 3i(s). 2s2 + 256s + 3 Let b(l) = -3250l2 + 25l + 16. Let f(k) = 1081k2 - 8k - 5. What is 6b(m) + 19f(m)? 1039m2 - 2m + 1 Let h(z) = z*2 + 2z - 6. Let n(k) = -19k2 - 12k + 30. What is 6h(r) + n(r)? -13r*2 - 6 Let c(m) = -7m*2 + 5m - 4. Let z be c(1). Let a(q) = 4q + 1. Suppose 0 = -3w + 1 + 5. Let d(n) = -1 + 2 + 2n + 3n - wn. Calculate zd(s) + 5a(s). 2s - 1 Let d(o) = o*2 - o + 1. Let i(f) = -294f*2 + 10f + 20. Determine -10d(q) - i(q). 284q*2 - 30 Let h(t) = 1. Let i(z) = 18z + 178. Let u be i(-7). Let b(m) = -m*2 - 29 + u - 28. What is -b(k) - 5h(k)? k*2 Let a(b) = -2b*2 - 1. Let n(u) = 3u*2 + 2. Let t(z) = -6a(z) - 5n(z). Suppose 3g = 449 - 197. Let x(p) = 83 - 168 + g. Determine -t(f) + 4x(f). 3f*2 Let f be (1/(-2))/(10/(-40)). Let p(v) = -172v*2 - 1 + 91v*2 + 82v*f. Let o(b) be the first derivative of 3b4/4 + b3/3 - b + 1. What is o(g) - p(g)? 3g3 Let j(b) = -2b*3 + 3b*2 + b - 315. Let m(h) = 3h*3 - 7h*2 - 3h + 657. What is 7j(d) + 3m(d)? -5d3 - 2d - 234 Let m(g) = -g + 3. Let b(c) = 3c - 5c + c - 4 + 3c. Let v(t) = -t + 14. Let r = 61 + -50. Let f be v(r). Calculate fb(s) + 4m(s). 2s Let i(t) = -99t + 46. Let d(m) = -94m + 46. Determine 11d(o) - 10i(o). -44o + 46 Let z(h) = -267h*3 + 17h*2 - 18h + 13. Let y(d) = -70d3 + 4d*2 - 4d + 3. What is -26y(w) + 6z(w)? 218w3 - 2w*2 - 4w Let s(l) = -2l - 8. Let j(q) = 21q - 11. Let y(t) = -75t + 34. Let m(f) = -7j(f) - 2y(f). Calculate 5m(o) + 6s(o). 3o - 3 Let k(h) = -6h2 - 4. Let i = 39 + -37. Suppose -4z - 3w + 3 = 0, -iw = z + 2w - 17. Let c(b) = 3b*2 + 2. Determine zk(q) - 7c(q). -3q*2 - 2 Let v(o) = 35o - 85. Let w(m) = -3m + 7. Let f be (5/35-6)/(3/(-21)) - 8. Calculate fv(h) - 25w(h). 5h - 5 Let t(k) = -3 + 4 + k3 + 18114234k - 18114234k. Let y(f) = -34f*3 + 34. Give 34t(s) - y(s). 68s3 Let q(h) be the second derivative of h5/4 - h4/4 + h3/2 - 3h*2/2 - 8452h. Let a(g) = 9g3 - 6g*2 + 6g - 5. Calculate 3a(l) - 5q(l). 2l3 - 3l*2 + 3l Let i(c) be the first derivative of -c*2/2 - 9. Let k(b) = b + 1. Suppose -o = -3f - 35, -5f = -3o - 21 + 118. Let p = -28 + o. Calculate pi(w) - k(w). -2w - 1 Suppose 34o + 89o = 172 + 320. Let w(f) = 2f + 2. Let j(b) = b3 - 7b - 7. Give oj(l) + 14w(l). 4l3 Let t(y) = 10y*3 + 5y*2 + 5y + 5. Suppose -814 + 2534 = -10u. Let s = 173 + u. Let l(x) = x3 + x2 + x + 1. Determine st(w) - 5l(w). 5w*3 Let v(t) = 19t + 6. Let q(d) = -233d - 3. Let u(l) = -559l - 7. Let a(z) = 12q(z) - 5u(z). Give 6a(c) + v(c). 13c Let q(w) = w3 - w2 - 3w. Let n(i) = -896i*3 + 196i*2 + 588i. What is 2n(f) + 392q(f)? -1400f3 Let v = 10 - 16. Suppose 5w + 10 = 5d, -9 = -5d - 3w + 1. Let y be d/(0 + 4/2) + 0. Let q(u) = u2 + 1. Let t(f) = 5f*2 + f + 6. What is vq(r) + yt(r)? -r2 + r Let w(t) = -14t + 4. Let o(b) = -1. Let s = -118 + 122. Determine so(i) + w(i). -14i Let o(l) = -10l3 + 6l*2 + 10l - 16. Let g(w) = -6w2 - 188w - 46. Let t be g(-31). Let x(z) = 3z3 - 2z*2 - 3z + 5. Determine tx(r) + 5o(r). -2r3 - 2r*2 + 2r Let c(v) = -23v - 2. Let r(z) = 72z - 262. Give -3c(i) - r(i). -3i + 268 Let k(i) be the second derivative of 7i3/6 + i2/2 - 10297i. Let x(a) = 2a. Give -2k(t) + 6x(t). -2t - 2 Let g(o) = 156o + 1391. Let c(p) = -19p. What is 8c(l) + g(l)? 4l + 1391 Let c(s) = -2s3 - 2s*2 - s + 1. Let n = -15995 + 15991. Let w(f) = -3f*3 - 3f*2 - f + 2. Determine nc(v) + 3w(v). -v3 - v2 + v + 2 Let h(p) be the second derivative of p3/6 + 31p*2/2 + 5053p. Let w(c) = 15. Give -3h(j) + 5w(j). -3j - 18 Let t be (9/63)/(3/(-21)). Let z(q) = q. Let w be (-4)/26 - 300/78. Let f(v) = -v2 - 2v - 2. Give tf(h) + wz(h). h*2 - 2h + 2 Let q(o) = -81o - 21. Let x(c) = 79c + 17. Calculate -4q(y) - 5x(y). -71y - 1 Let f(x) = -4x + 5. Let r be f(-1). Let y be (-6)/r + 0 + (-350)/(-21). Let d(k) = -yk + 7k + 8k. Let t(z) = 2z + 1. Determine 5d(p) + 3t(p). p + 3 Let n = 21 + -21. Let x(f) = 4 + 2 + 5f - 2 + nf. Let g be (0 - -12)/(60/(-40)). Let m(l) = 14l + 11. Determine gx(q) + 3m(q). 2q + 1 Suppose 27 - 17 = 3h - 4n, -2 = 5h - 2n. Let m(w) = 2w. Let s(q) = -q + 1. Let f(y) = hs(y) + 4m(y). Let a(c) = c. Give -12a(b) + f(b). -2b - 2 Let i(x) = -4x*2 + 3. Let u(k) = 10k - 25. Suppose -4s + 31 = 4l + 3, 0 = 5l - 5s + 5. Let t be u(l). Let c(g) = -3g2 + 3. What is tc(b) - 4i(b)? b2 + 3 Let u(k) = -8k - 196. Let z be u(-25). Let i(a) = -za2 + 3a*2 + 6671a*3 - 6670a*3 - 1. Let s(f) = -9f*3 + 6f*2 - 3f + 6. Give -6i(q) - s(q). 3q*3 + 3q Let y(o) = -106o2 - 1628o + 10. Let i(c) = 21c2 + 324c - 2. Give 16i(h) + 3y(h). 18h2 + 300h - 2 Let a(u) = -u*2 - 1. Let p be 56/(-16)(-88)/154. Let i(j) = -6j2 - 11. Calculate pi(b) - 18a(b). 6b**2	{ "pile_set_name": "DM Mathematics" }
ositive. f*(4095/2) Simplify ((gg3)/(g/g(-9)))*42((gg1g)(-4/27))(6/5) assuming g is positive. g*(-3788/15) Simplify ((lll1l)*39/(l(l/(ll/(lll(3/2)lll)))/ll(-2/5)))/(l(-2/19)ll(5/2)l(1/3)/(l(-7)/l)) assuming l is positive. l(39664/285) Simplify (d/(d6d)d)/d((d/(d(2/7)/d))/d)/dd*(-2)/d(d/(d*(-1)d))/ddd*1/(d/(dddd*(-1/7)))d*0/(dd/(d/(dd7d))d) assuming d is positive. d(-115/7) Simplify (j(-2))(-31)/(j2j)*(-29/5)j/(jj(1/4)j)j(2/15)(j(2/3))(-2/33) assuming j is positive. j*(154921/1980) Simplify ((((bb(-2/5)/b)/b)(-33)(bb(1/2))6)32)34 assuming b is positive. b(300288/5) Simplify ((j/j(-2))/j(-3))(-45)(j6(j*(2/5)j)/jj)11 assuming j is positive. j(-943/5) Simplify ((u(2/11)uu(-14)/u)/((u/(u(1/4)/uu))/u)(1/44))(2/113) assuming u is positive. u(-221/904) Simplify ((m(6/11)/m(m/(m/(m(4/5)mm)))/m)/(m2/mmm(2/11)m))(-24/5) assuming m is positive. m(2424/275) Simplify ((n(nn*2n)/n)(-1/5))(-39)(n(-6)nn)/(n5nn)(n(nn*(1/3))/nn)/(((n/(((nnnnn*(2/3)nn)/n)/n)nn)/n)/n) assuming n is positive. n(131/5) Simplify (r/r1)(-1/51)/(rr/r*(-1/2)r/r*(1/4))((rr6r)/(rr3))/(r(1/4)/(r/(r(-1/3)/rr))) assuming r is positive. r(11/6) Simplify ((b4)28)31/((bbb*(-1/3)bb4)/(b/(bb/b0))(6/7)) assuming b is positive. b(72754/21) Simplify ((u(-2/9))(-14))13/(u*(-1/5)/uu/u*5u*(-3)u/(u/u1)) assuming u is positive. u(2144/45) Simplify (((w/(w/(ww(-1))))8/((www/(w/(ww*(-1)))ww)/w)(7/5))(21/5))(12/7) assuming w is positive. w(-756/25) Simplify (t23/(tt*(-2/7)t))/(((tt(14/9))/t)/t)(2/5) assuming t is positive. t(1327/63) Simplify ((l(-16)/(ll*(6/5)l))/(lll*(5/2)l)(-2))6 assuming l is positive. l*(-246/5) Simplify (yy*(1/3)yy1((y*1/yy)/y)*(-13))/((yy/y*(-8)y)/(y/y(-2/9)))(-18) assuming y is positive. y(538/3) Simplify ((z0)43)(2/33)(z/z(1/3)z)(1/25)/(z(1/11)z1) assuming z is positive. z(-169/165) Simplify (((r/r1)/r)(-13)r*4r/(r*2r))/(r*(-8)rrr*2(r(-1/2)/r)(1/42)) assuming r is positive. r(533/28) Simplify (c/c1c(3/2)cc)(-10)(c/(c(cc*(-5))/c)c/(c/(c/c(1/10))))38 assuming c is positive. c(946/5) Simplify g/g33gg(((g/(g/g15))/g)/g)/gg*(7/3)g(gg/(gggg21))/g assuming g is positive. g(-113/3) Simplify (((ww/w*(-2/11))/(((w/(ww*(-4/7)w))/w)/w))/((ww(-3/5))/(w5w)))(-50) assuming w is positive. w(-39310/77) Simplify (q*(2/19)qqq(-1/3))(2/5)((q/q(2/21))/(qqq(-10)qq))(1/65) assuming q is positive. q(21137/25935) Simplify (((t0)42((t*(-2/21)/tt)/t)/((tt(tt(5/3))/t)/t))3)(-2/13) assuming t is positive. t(158/91) Simplify (v(-2)v*(-7)(vv/(vv*(1/4)))/(vv(2/5)))/(((v(-4)/vv)/v)/vvvvv(-2/7))46 assuming v is positive. v(19809/140) Simplify (b(1/2))(-1/53)/(bb*(-3)b/(b*(1/6)b))b(2/7)b*(5/2)(b*(5/2)b)/bb/b(-7)b assuming b is positive. b(18301/1113) Simplify (((n0)*(1/27)n*6nnn(-5))(-37/3))(-37) assuming n is positive. n1369 Simplify (((i39/i)/(i/(i8i)ii))/(i22)(-3/11))(-32) assuming i is positive. i(-1600) Simplify (n/(n0/n))16/(n(-2/9)/nnnn/n*(-4/11))((nn/((n(1/2)/n)/n))/n(1/16))/(n1/nn)(-17) assuming n is positive. n(79669/1584) Simplify (u*3u2)/(u0/(uuu*2))((uuu(-1/3))30)(-3/2) assuming u is positive. u(-66) Simplify ((b*(1/2)b)(-23))(-49)/(b*5b(-7))18 assuming b is positive. b(3453/2) Simplify (((n(-2/19)/n*1)/((nn/n*8)/nn(2/7)))(-5))11 assuming n is positive. n(-41030/133) Simplify (ccc/((cc(1/14))/c)c*(-2)/c(c/((c(1/9)/c)/c))(1/14))(2/57) assuming c is positive. c(17/3591) Simplify ((cc(-1/9))39(cc/(ccc/(c/c(-4/3)))c)/cc(-3/20))(-1/15) assuming c is positive. c(-239/100) Simplify (((r/(r(rr/r(-11)r)/r))/r)/r*(-3/13)(rrr/((rrr*(-4/11))/r)r)/(r/(r(r0r)/r)))(2/41) assuming r is positive. r(-2976/5863) Simplify (((s*(-5)s)/s)/s*(3/7))/(s(((s*(-5)/s)/s)/s)/ss/s*4)(((s*(3/5)s)/ss)/s)/(s/s5)(s1)(-10/9) assuming s is positive. s(2854/315) Simplify (w(2/7)w/(w/(((ww*(-3))/w)/w))(w(-1/2))(-3))/((w(2/5))33/(w/(w*0ww))(-30)) assuming w is positive. w(1021/70) Simplify (((rr*(-31))/rr/((rr(-2/29))/r)r)/(r*34rr(-27)/r))45 assuming r is positive. r(-46890/29) Simplify (u(-4)uu(-28)(u*(-7/4)uu)(2/85))(3/8) assuming u is positive. u(-15807/1360) Simplify ((u/(u/(uu(uuuuu/(uu/(u/(u/u*(-6)u)))u)/u)u))*(2/107)/((uu(-2/5))/u)(-37))(-1/11) assuming u is positive. u(7948/5885) Simplify ((lll/((ll/(l(l*(6/7)/l)/ll))/l))*(-2/175)(ll(4/23))/(ll/l*(-2/51)l))(12/7) assuming l is positive. l(-2181776/670565) Simplify ((f4)(-14/11))*50/(((((f/(ff(-1/5)))/f)/f)/(f9/f))/(f(-1)/f(1/7))) assuming f is positive. f(-94667/385) Simplify ((v2v)/(v(-5)v)v(5/4)v(2/27))/((v(2/3))47)(-46) assuming v is positive. v(156563/108) Simplify ((((d10d)/dd)/(d*0/dd))/(d/((((d/(d/(d/(dd(2/5)/d))))/d)/d)/d))42)17 assuming d is positive. d(-11203/5) Simplify (((m5/m)/m)/(m/m(-3/4))mm(-2)/mmm(-1)m)/((((m/(m/(m*4/m)m)m)/m)/m)/mm*(2/17)(mm(-2/3))(2/9)) assuming m is positive. m(107/1836) Simplify (kk*(-11)(k/(k/k*2))/kkk)(3/16)/((k/(k/k(-2/7)))26/(k(-2/7))(1/2)) assuming k is positive. k(669/112) Simplify ((k0)(-3/10))(-5)/((k/(k0kk))(43/4)/((k/k(-1/2))/k(-3/2))) assuming k is positive. k(55/4) Simplify ((m10/m)/m(-5))(-31)(m*(-3/5)m1)/((m/((m(2/13)/m)/m))/(mmmm2)) assuming m is positive. m(-28044/65) Simplify (n(-28)/n)(-4/5)/(n(-16)/(n/(n35n))) assuming n is positive. n(21/5) Simplify (w(7/4)w/(w/(w(8/7)/w))(w*4ww)/wwww6)(1/2) assuming w is positive. w*(417/56) Simplify ((kk*1)/kk/k(1/5))(-33)/((k*(-1/3)k)/k(-2))(-1/10) assuming k is positive. k*(-887/15) Simplify (jj/(jj(-7)))/j(1/5)j/(j/(j/(jjj*(4/3)))j)j/j(2/9)(j/j*(-2/5)jj1)/(j(2/15)/((jj/(j*0/jj)j)/jjj)) assuming j is positive. j(563/45) Simplify (((i/((i/(i/(i(i*(1/37)i)/i)i))/i))/(i/(i/(i(1/4)/i))))/((i/i(-1/11))/(((i/(i(-2/3)i))/i)/i)))(1/36) assuming i is positive. i(1459/175824) Simplify ((p*18(p*(13/4)p)/p)/(p6/p)(-14))(-5/8) assuming p is positive. p(-1825/32) Simplify ((q*(-18)/qq*(-5))/((qqq1)/q)(2/139))(-7) assuming q is positive. q(23380/139) Simplify ((uu(-4/7))/(u/u(-4))u2u/(uu10uuu))15 assuming u is positive. u(-1635/7) Simplify ((q*(3/5)/(qq*(2/7)/qq))/(q*2/q(q(-4)/q)/q))/((q1)(-3/13))(4/9) assuming q is positive. q(6029/1365) Simplify ((z1zz*(-4)(z/z*(-1/4)zz)(5/18))(-5/3))(-2) assuming z is positive. z(-395/108) Simplify ((m(2/7)m)*33/((mm*(-3)m)/(m/m*(-2/3))))/(mm*(3/14)mm11m)(2/5) assuming m is positive. m(4138/105) Simplify (((j/j*(1/2)j)/(jj(-2/21)))/((j/j20)/((j6/j)/j)))(-4/7) assuming j is positive. j(-1982/147) Simplify ((o/(o/o(1/3))o(-1/3))/(o(-1/2)/o3))/((o(1/2)oo/o*6oo)/(o/(o(-1/4)o))(-25)) assuming o is positive. o(-5/4) Simplify (o*1o((oo(-1/6))/o)/o)(-2/39)/((o((oo/(oo/(ooo2oo)oo))/o)/o)/(((oo/(oo(o*(2/9)/o)/oo)o)/o)/o))(-9) assuming o is positive. o(3388/117) Simplify ((o/(o/(o(-2/7)o)))/o(-4/7))29(oo*(-1/4)o)*(-5/9)o*(-3/2)/ooo/(ooo(-3/4)) assuming o is positive. o(4355/126) Simplify (s16/(ss/((sss*(-20)ss)/s))(s/s(2/7))(-2/51))(-7/4) assuming s is positive. s(1081/204) Simplify ((x*(-6/7)/xx/x22)(-2/59))(2/191) assuming x is positive. x(640/78883) Simplify ((l(-3))(-2/61))*(-4/9)(l*13/(l/(ll(-2/11))))(-25) assuming l is positive. l(-645163/2013) Simplify (((s/s14)/(ss(s*10/sss)/ssss))/((s*3s)/(s(s(3/2)ss)/sss)))(-48) assuming s is positive. s*1272 Simplif	{ "pile_set_name": "DM Mathematics" }
3k4)(-5 + 3 + 1). -6k5 + 2k*4 Expand (a - a + 2a)(22a*3 - 2a*4 - 22a*3) + (1 - 1 + 1)(a3 - a3 - 2a5) - 2a*5 - 3a*5 + 4a*5. -7a5 Expand (u2 + 0 + 0)(5u*2 + 9u2 + u2). 15u4 Expand (1 + 0 + a - 2)(25a - 25a + 9a4). 9a*5 - 9a*4 Expand (14x*3 + 9x*3 - 21x*3 + 10x*2)(-x + 4x - 2x). 2x4 + 10x*3 Expand -6w*3 + 2w*3 + 2w3 + (w2 - 4w2 + w2)(2w + 0 + 0) + 0w*3 + 3w3 - w3. -4w3 Expand (l2 + 2l*2 - 4l*2)(l + 0l - 3l + 2l - l + 0l + (1 + 1 + 0)(l + 0l + l) - 2l + 0l + 0l). -l3 Expand (1 - z - 1 + 2)(z - z + 2z - z2). z3 - 4z*2 + 4z Expand -3x2 + 3x*2 - 2x*4 + 4x*4 + 3x*4 + 0x*4 + (-2 - 2x + 2)(-4x3 + x3 + 2x3). 7x4 Expand -k + k + k2 + (k + k - k)(2k - k + 0k) + (3k - 4k - k)(33 + 8k + 2k - 8k). -2k*2 - 66k Expand -46q2 + 25q*2 + 17q*2 + (2q2 - q2 - 2q2)(1 - 5 + 3) - 4q + 4q - 2q2 + (-3q + 2q + 0q)(-2 + 2 + 2q). -7q2 Expand (0u - u + 3u)(-4 + 2 - 2 + (-1 - 1 + 4)(0 + 3 - 5) + 2 + 2 - 7). -22u Expand (3 - 5 - 2)(16k + 15 - 5 - 9). -64k - 4 Expand -w2 + w2 + 2w5 + w3 + 2w5 - w3 + 1 - 2w5 - 1 + (0 + w2 + 0)(-w3 + w3 + w3) + (4 - 4 - w2)(5 - 4w3 - 5). 7w*5 Expand (a - 2 + 2 - 3a - a + 2a + (-6a + a + 4a)(-1 + 3 + 0) - a + 5a - 5a)(0 - 2 + 0)(-5a + 0a + 6a). 8a*2 Expand (3 - 10b - 3)(-3b + 5b - 2 - 1). -20b*2 + 30b Expand (-4y + 4y - 2y)(y4 + y4 + 0y4) + 23y*5 - 9y*5 - 9y*5 + (0 + 0 - 2y)(-2y*2 + 2y*2 - 2y*4). 5y*5 Expand (3m + m - 3m)(-2m + 2m - 3m) + m2 + 1 - 1 + (-5 + 5 + 2m)(-4m - m + 4m). -4m*2 Expand (-1 - 24c + 11c2 + 24c + (2c + c - 4c)(-c - c + c) + 3c*2 + 0c*2 - 2c*2)(c3 - c3 + 2c3). 26c*5 - 2c*3 Expand 2j*2 - 4j*2 - 4j*2 + (-2j + 5j - 4j)(-3j + 2j - 2j) + (5j + 0j - 4j)(3 + j - 3) + j*2 - 3j*2 + 3j2. -j2 Expand (0v - v - 2v)(-12v - 77 + 77). 36v2 Expand (-3 - 1 + 2)(-m*3 + 4m*3 - 5m*3) + 0m3 - m3 - m*3. 2m*3 Expand ((-w - 2 + 2)(-1 + 3 + 0) + w + 0w - 2w)(-4w*2 - 8 + 8). 12w*3 Expand (2b3 + b3 - 2b3)(-b + 2b + b) - 132b*3 + 132b*3 + 17b*4. 19b4 Expand (-r3 + r*3 - 4r*3)(2r + 0r + 2r). -16r*4 Expand (48d3 + d2 - 48d3 - 4d*5)(3 + 6 - 4). -20d5 + 5d*2 Expand (-1 + 1 - 4o)(-o2 + o2 + 4o*3) - 5o4 + o4 + 3o4. -17o*4 Expand (-4j + 6j - 3j)(2j + 2j - 10j). 6j2 Expand h + 0 + 0 + 0h + 4h - 5h + (4 + 0 - 5)(2h + 2h - 2h) + 2h + 0h + 3h - 2h - h + 5h. 5h Expand (-3 - 1 + 16)(-3l3 + l3 - l*3)(-l + 0l - l). 72l*4 Expand (-2 + 1 + 3)(s*2 - 4s4 - s2 - 2s2). -8s*4 - 4s*2 Expand -3y4 - y4 + y*4 + (-2y*3 - 2y*2 + 2y*2)(0y + y + y) + y4 - 3y + 3y. -6y*4 Expand (3k - 2k + 0k)(3k - 3k - 3k*2)(2 - 2k - 2 + (-k - 2 + 2)(2 - 7 + 1)). -6k4 Expand (16x*2 - 9x + 19x - 11x)(2 - 1 + 0). 16x*2 - x Expand (-3 + 5 + 4)(5h5 + 2h5 - h5). 36h5 Expand ((-g - g + g)(3g2 + 0g2 - g2) + 0g3 - 3g*3 + 0g*3 + 0g*3 - 2g*3 + 0g*3)(2g + 4g - 5g). -7g*4 Expand 2 + 9q - 2 + (0q + 2q - q)(-1 + 7 - 4). 11q Expand (-m2 - m2 + 0m2)(-7 - m + 7) + 4m3 - m3 - m3 + (0m*3 - 5m*3 + 3m*3)(5 - 3 - 3). 6m3 Expand ((-5 + 2 + 1)(-4 + 1 + 1) - 2 - 4 + 4)(-3n + 1 - 1)(-3n + 2n + 0n). 6n2 Expand (2h - 2h + 2h)(-2h + 2h + 3h) + (2h - 2h - h)(2h + 0h - h) + 7h*2 + 13h*2 - 5h*2. 20h*2 Expand 0o*4 + 2o*4 + 3o - o + (3o - o - 4o)(o3 + 3o*3 - 3o*3) + 0o*4 - 3o4 + o4 + o*4 + 14o*4 - 5o*4. 8o*4 + 2o Expand (8c - 4c + 9c)(4 + 2 - 4)(c - c2 - c). -26c*3 Expand (-2q*2 + 0q*2 - 5q*2)(q*2 - 5q*2 + 5q*2). -7q*4 Expand (-q - 4q + 4q)(-57q4 + 35q*4 + 39q*4). -17q*5 Expand (-4v*3 + 0v3 - v3)(3v*2 + 4v*2 - 5v*2) + (2v + 2v - 2v)(-2v*2 - 2v*4 + 2v*2). -14v*5 Expand ((x - 2 + 2)(2x - 3x + 0x) - 4x2 + x2 + x*2)((3 - 4 + 2)(-2x + 1 - 1) - x - 4x + 3x). 12x3 Expand (3l + 2l2 - 3l + (l + 3l - 2l)(-2l - 2l + 2l) - 4l2 + 2l*2 + 0l*2 - 3l2 - l2 + 7l2)(1 + 0l + 2l + 2l). -4l3 - l2 Expand (3n2 - 5 + 5)(-2 - 1 - 2). -15n2 Expand (2 - 4 + 3)(-4 - 2 + 4)(10l - l - 7l). -4l Expand -o + 0o + 2o + (2o - o - 3o)(1 + 1 - 4) + (2 - 2 + o)(-1 - 4 + 2). 2o Expand -2u*3 + 2u3 + u3 + (-5 + 3 + 3)(-3u3 - u3 + 5u3). 2u*3 Expand (3r - r - 3r)(-2r + 2r*2 + 2r)(23 + 44 + 17). -168r*3 Expand (-3w*2 + 5w*2 + 0w*2)(-1 - 10 + 4). -14w2 Expand (-4n + 3n - n)(-5n + 0n + 3n) - 5n*2 + 5n*2 + 3n*2 + (0n - n - n)(-1 + 1 - n). 9n2 Expand (-y3 - 4y2 + 4y*2)(1 + 4 - 3) - 23y + 21y*3 + 23y + 2. 19y3 + 2 Expand -4d*3 - 413d + 413d + (-4d*2 + 3d*2 + 2d*2)(5d - 3d - d). -3d3 Expand 20d*2 + 10d - 10d + (4d - 5d - 2d)(2d + 3d - 4d + 0d + 0d - d + (-1 + 5 - 6)(d - 2d + 3d) + 2d - 5d + 2d - d + 3 - 3). 38d2 Expand (3f + f - 2f)(2f2 - 4f*2 + 0f*2)(7 + 9f - 7). -36f*4 Expand (2 - 3 + 0)(-2d - 2d + 5d) + (-2 + 4 + 0)(-3d + d + 0d) - 2d + 4d - 4d. -7d Expand (-3 + 0 + 0)(3 + 3 - 3)(3t3 + 3t*3 - 5t*3). -9t*3 Expand (0f*3 + 0f*3 - 10f*3)(-1 + 5 - 3). -10f3 Expand -2y2 - y2 + 0y2 - y2 - 3y*2 + 3y2 + (-y2 + 0 + 0)(2 + 0 + 0) + 5y*2 - 3y*2 - 3y*2. -7y*2 Expand (-23 + 2 - 3)(-6q + 3q - 4q). 168q Expand (0 + 3 - 1)(0o*4 - 2o4 + o4) + o*4 + 3o*4 - 6o*4 + 2o*3. -4o*4 + 2o*3 Expand 0y*2 - 3y2 + y2 + (-2y + 3y - 3y)(-2y + 0y - y) - 1 + 2y2 + 1 - 3y*2 - 1 + 1. 3y*2 Expand (2 - 3j*2 - 4 - j + 6j*2)(0j + 0j + j). 3j3 - j2 - 2j Expand -4f + 0f - 4f + (2f + 0f - 4f)(-4 + 6 + 1). -14f Expand ((0 + 0 - 2)(1 + 2 - 1) - 6 + 0 + 2)(h*3 + 3h*3 - 3h*3). -8h*3 Expand (5 + 0 - 3)(8w2 - 7w*2 + 3w*2) + 3w*2 - 2w2 + w2 + w*2 - 4w*2 + 2w*2 + (-w + 5w - 2w)(0w - w - w) + 3w*2 - 4w*2 + 0w*2. 4w*2 Expand (2w - 2w + 2w)(-1 - 2 - 1)(-5w - w3 + 5w). 8w4 Expand (-q - 5q*2 + q)((0 - 3 + 2)(-2 + 1 + 0) - 1 + 2 + 3). -25q*2 Expand 9z*2 + 47z - 47z + (z - z - z)(4z - z + 0z). 6z2 Expand (o2 - o2 - 2o*2)(3 - 22 - 25). 88o2 Expand y5 + 6y3 - 2 + 2 - y3 + y5 + y3 + (3y4 + 0y + 0y)(-2y + y - y). -4y*5 + 6y*3 Expand (-2 - 2 + 3)(-3f + 8f + 0f)(-6 + 3 + 1). 10f Expand (0 + 0 - 1)(1 - 1 - 6r). 6r Expand (3 + 0 + 0)(-3s + 2s - 2s). -9s Expand (-x + 3x + 0x)(5x3 - 3x*3 - 4x*3) - 4x*4 + 0x*4 + 7x*4 + 0x*2 + 2x*4 + 0x2. x4 Expand -2a + a + 0a + 0 + 2a + 0 - 5a + 2a + 2a + (-a + 0a - a)(5 - 1 - 2) + 1 - 1 - 2 + 2a. -2a - 2 Expand -7 + 3g + 2 + 6 + (1 + 2 - 2)(-2g - 2g + 5g). 4g + 1 Expand 2y + 4y + 3y + (-4y + 4y - y)(-1 - 1 + 3) + y - 6y + 3y - y - 2y + 2y. 5y Expand (1 + 1 + 0x - 2x)(-11x + 19x + 14x). -44x*2 + 44x Expand (2m - 2m - 2m)(-5 - 1 + 4)(1 + 3 - 3). 4m Expand (-s + s + s*2)(3s2 + s2 - 3s*2) + (0 + 1 + 2)(-2s4 - 2s*3 + 2s*3) + 2s*4 + 2s*4 - 2s*4. -3s*4 Expand 3w*2 - 5w*2 + 0w*2 + 4 - 3w*2 - 4 + (0 - w + 0)(3w + 4w - 5w) + 3w2 - w2 - w*2 + (-w - 2 + 2)(0 + 0 + 2w) - 2w*2 + 2w*2 + 3w*2. -5w*2 Expand m - 3m + 5m + (3m + 3 - 6 - m)((-2 + 3 - 2)(-1 - 1 + 0) + 6 - 1 - 2). 13m - 15 Expand (-z - z - 3z)(13z*4 + 19z*3 - 19z*3). -65z*5 Expand (11w + 0w + 6w)(-5 + 4 + 3 + (2 - 3 + 3)(-3 + 3 + 1) - 1 - 4 + 3). 34w Expand -3c*3 + 3c*3 + 2c4 + (c - c - c3)(1 + c - 1) - 107c - 182c4 + 107c. -181c4 Expand 2n2 - n2 + 3n2 + 1 + n2 - 1 + n2 + 4n*2 - 3n*2 + (n - 5n + 2n)(3n + n - 2n) - 4 - 2n2 + 4. n2 Expand (-88t*3 - 88t*3 - 4t - t*2 - 2 + 173t*3)(-1 + 2 + 1). -6t3 - 2t*2 - 8t - 4 Expand (-7c - 13c + 5c)(2 - 1 + 0) + c - 3c - c. -18c Expand ((-3 + 4 + 1)(4a*2 - 4a2 - a5) - 4a + a5 + 4a)*(2 -	{ "pile_set_name": "DM Mathematics" }
+ 1)*2(h + 2)(h + 5) Let l(s) be the second derivative of -s6/1260 - 11s*5/420 + 13s*4/42 - 55s*3/2 - 2s - 4. Let c(i) be the second derivative of l(i). Factor c(y). -2(y - 2)(y + 13)/7 Let b(m) = -m*3 + 15m*2 - 14m. Let k be b(14). Suppose k = 13d - 5d - 96. Factor dv3 + 21v*5 - 14v*5 - 11v*5 + 8v*2. -4v*2(v - 2)(v + 1)2 Let y(t) be the first derivative of 2t*6 - 9t*5 + 27t*4/2 - 7t*3 - 468. Factor y(k). 3k*2(k - 1)*2(4k - 7) Let o(x) be the second derivative of x4/6 + 197x*3/3 - 2687x + 2. Determine b, given that o(b) = 0. -197, 0 Let r(n) = -346n + 106n - 766n2 + 769n*2 + 2880. Let f(q) = 35q*2 - 2880q + 34560. Let k(b) = -2f(b) + 25r(b). Factor k(s). 5(s - 24)2 Suppose 0r - 5r + 15 = 0. Let g be (-1687806)/(-1271) + 2/31. Determine d so that -1769d + 105d4 - 123d*4 - 471d - gd2 + 336d*r - 800 = 0. -2/3, 10 Let d = -1836531/5 + 367316. Solve 0 + 23/5r*3 + 1/5r*4 - dr*2 + 5r = 0 for r. -25, 0, 1 Determine n so that -1/3n3 - 8/3 - 17/3n - 10/3n2 = 0. -8, -1 Suppose 24y + 5y4 + 20y + 21y3 - 74y - 24 - 1 + 9y3 + 20y*2 = 0. Calculate y. -5, -1, 1 Let g be (8/(-42))/(2662/(-308) - -8)(-21)/(-28). Let -32/9s2 + 0 + 14/9s*3 - gs*4 + 8/3s = 0. What is s? 0, 2, 3 Let b = 796 + -796. Let t(z) be the second derivative of -2/15z6 + b + 2/21z*7 + 0z*3 + 13z + 0z2 + 1/3z*4 - 1/5z*5. Factor t(x). 4x*2(x - 1)*2(x + 1) Suppose -1734 = -160q + 1306. Let m(l) be the first derivative of 2l2 - q + l4 + 4l3 + 0l - 4/3l6 - 12/5l*5. Let m(h) = 0. Calculate h. -1, -1/2, 0, 1 Let y be (4/10)/((-8)/(-40)). Suppose -4i = 3u - 7, -2i - 2u + 4 = y. Find s, given that -12s*3 + 4s*2 + 2s*5 + 9s*3 + 13s*3 + 8s*i = 0. -2, -1, 0 Let d(l) be the first derivative of -14l*3/15 + 201l*2/5 + 992l/5 - 6529. Factor d(a). -2(a - 31)(7a + 16)/5 What is n in 1/8n*2 - 1873/2n + 3508129/2 = 0? 3746 Let v = 1718794/54849 + -64/18283. Solve 49/3b5 - 49b*4 - 8/3b + 0 + vb3 + 4b*2 = 0 for b. -2/7, 0, 2/7, 1, 2 Let c = -636 + 654. Let n be (-8)/(-35)(135/c - 4). Solve ng3 - 2/5g*5 + 6/5 - 2/5g + 6/5g4 - 12/5g*2 = 0. -1, 1, 3 Let y(a) be the second derivative of -a - 17/9a*3 - 2a*2 - 1/45a*6 + 19 - 7/30a*5 - 17/18a*4. Find s such that y(s) = 0. -3, -2, -1 Let m be (-64)/(-24) + (2/(-3))/1. Factor -12o*4 + 22o*3 - 43o*3 + 6o*3 - 4o*m + 4o5. o2(o - 4)(2o + 1)2 Let c(f) be the first derivative of -f3/7 + 75f*2/7 - 1683f/7 - 9159. Find l such that c(l) = 0. 17, 33 Let w(y) be the second derivative of 2y6/15 + 22y*5/5 + 68y*4/3 - 1196y*3/3 + 1014y*2 - 4261y. Factor w(f). 4(f - 3)(f - 1)(f + 13)2 Suppose -8n = -10n - 2l + 12, -5l + 29 = 4n. Let q be 162/(-27) + (n - -7). Factor 0 - 2/3j5 + 2/3j*4 - 2/3j*q + 2/3j*3 + 0j. -2j2(j - 1)*2(j + 1)/3 Let v(c) be the second derivative of -5c4/12 + 5975c*3/6 - 2985c*2 - 2168c. Factor v(t). -5(t - 1194)(t - 1) Let l = -13339/3 - -4449. Let r(p) be the first derivative of -5p2 + 14 + 2p + lp3. Factor r(x). 2(x - 1)(4x - 1) Suppose -34b + 16 = -188. Let k be 81/b - (20 + -11). Find o such that -3/2o*4 + ko*2 + 3o*3 + 0 + 0o = 0. -1, 0, 3 Find j such that -13742j2 - 32 + 13740j*2 + 258j + 215 + 379 - 38 = 0. -2, 131 Find z such that -342/7z3 - 3/7z*4 - 9039/7z*2 - 41772/7 + 40356/7z = 0. -59, 2 Let s(l) be the second derivative of l*5/12 + 10l*4 + 235l*3/6 - 88l*2 - 64l. Let b(y) be the first derivative of s(y). Let b(k) = 0. What is k? -47, -1 Let w(p) be the third derivative of -1/60p5 + 0p*3 + 1/80p*6 - 1/672p*8 + 44p*2 + 0p*7 + 0p*4 + 0p + 0. Find q, given that w(q) = 0. -2, 0, 1 Solve 7305/2q2 - 513q*3 - 3/2q*4 - 4212q - 8376 = 0 for q. -349, -1, 4 Let i(o) be the third derivative of o8/420 - o7/42 - 7o6/90 + o5/6 + o4 - 2o*3 + 51o*2. Let x(q) be the first derivative of i(q). Factor x(p). 4(p - 6)(p - 1)(p + 1)*2 Let s(y) be the first derivative of -5y*3/12 + 375y*2/8 - 1485y/2 + 10868. Factor s(m). -5(m - 66)(m - 9)/4 Let k = 20 + -3. What is z in -6z3 + kz*3 + 0z*4 - 9z*3 - 2z*4 = 0? 0, 1 Let p = 273158 - 169357799/620. Let x = p + -3/310. Suppose 1 + 5/4d + xd2 = 0. What is d? -4, -1 Let m be (-12)/(-10)(13 - 98/6). Let k be m + ((-33)/(-55) - -4). Factor -1/5t2 + k + 2/5t. -(t - 3)(t + 1)/5 Suppose -w + 5x + 7 = 0, 7 = 5x + 12. Find q such that 1 + 838q*w - 833q*2 - 1 + 40q = 0. -8, 0 Suppose 565a - 572 + 1776 = 608a. Let x(m) be the first derivative of -a - 5m + 0m*2 + 5/3m*3. Factor x(o). 5(o - 1)(o + 1) Let o = -10790999/450 + 23980. Let g(i) be the third derivative of oi*5 + 44i*2 + 2/45i*3 + 0i + 0 - 1/60i4. Let g(q) = 0. What is q? 1, 2 Factor 1/5u*3 - 17/5u*2 - 12 + 76/5u. (u - 10)(u - 6)(u - 1)/5 Let l = 975 - 921. Let p(t) = 3t - 14. Let r be p(6). Factor 2k*3 + 7k*3 - 30k*2 + lk*2 + 3k*r - 27k*2 - 9k. 3k(k - 1)(k + 1)(k + 3) Factor -1/6z2 + 4/3z + 10/3. -(z - 10)(z + 2)/6 Let q = 81/628 + 19/157. Let n(t) be the third derivative of -qt*3 + 0t - 29/160t5 - 3/8t*4 - 23t*2 - 9/320t*6 + 0. Solve n(k) = 0. -2, -1, -2/9 Let a(q) = -5967q + 537032. Let w be a(90). Find l such that -1280/3 - 15820/3lw + 8980/3l + 245/3l3 = 0. 2/7, 64 Let r(n) = -3n*4 + 84n*3 - 432n2 + 24. Let q(c) = -c3 - 2. Let o be ((-18)/4)/(135/(-360)). Let x(g) = oq(g) + r(g). Let x(l) = 0. Calculate l. 0, 12 Let w be (-1 - 0)(28 - -9). Let o = w + 39. Solve 8/17m + 0 + 2/17m*o = 0. -4, 0 Let 195/4 - 3/8z*2 - 189/8z = 0. Calculate z. -65, 2 Suppose -4y = -3m - 10, -2m - 5y + 8 = -16. Factor -144z - 1736 - 39z - 5zm + 13z + 291. -5(z + 17)2 Let p be -222(-11)/(-3)(-1)/2. Let j = p + -2019/5. Determine n, given that jn + 2/5n4 + 0 + 12/5n*3 + 24/5n2 = 0. -2, 0 Let h(m) be the second derivative of -m7/168 + 11m6/60 - 41m*5/80 + 5m*4/12 + 25m - 2. What is g in h(g) = 0? 0, 1, 20 Let i be (-35 + (-36)/(-9))(-134)/10. Let l = i - 413. Factor 0 + lq - 2/5q2. -2q(q - 6)/5 Factor 3/2w*2 + 116427/2 + 591w. 3(w + 197)2/2 Let v(n) be the first derivative of 112n*3/15 + 331n*2/5 + 36n - 294. Factor v(w). 2(7w + 2)(8w + 45)/5 What is i in 3/2 - 13/4i - 11i*2 - 25/4i*3 = 0? -1, 6/25 Let j(s) be the first derivative of 45 - 1/4s*4 + 0s - s3 - s2. What is v in j(v) = 0? -2, -1, 0 Let v be 25/(-5) + (411 - -10). Let d be (v/(-1196))/(0 - 2). Suppose 0f + 0 + 10/23f*3 + 2/23f*5 - df*2 - 8/23f*4 = 0. What is f? 0, 1, 2 Let g be (9 - (-2530)/(-264))76/(-14) + -3. Let w(s) be the second derivative of 1/2s5 + 0s*3 + gs*6 + 33s + 5/12s4 + 0 + 0s*2. Factor w(z). 5z*2(z + 1)*2 Suppose 95 = 74i - 55i. Let m(q) be the first derivative of 8/5q*5 + 16/3q*3 + iq*4 + 2q*2 + 0q - 37. Factor m(l). 4l(l + 1)*2(2l + 1) Let u = -71 - -125. Suppose 0 = -6z + 4z + u. Factor -z - 16k - 10k - k2 - 51 - 91. -(k + 13)2 Let b(f) = f2 - 82f + 38. Let l be b(12). Let h = l - -5622/7. Suppose hi3 + 2/7i*4 - 8/7 - 8/7i + 6/7i2 = 0. What is i? -2, -1, 1 Determine v, given that -37 - 1/2v*2 + 75/2v = 0. 1, 74 Suppose q - 32 + 6 = 0. Let j = -23 + q. Determine c so that -15c2 - 5c*j - 6c*2 - 6c - 10c3 = 0. -1, -2/5, 0 Let v be 21/6 + -2 - ((-189)/(-18) + -11). Let y(a) be the second derivative of 16/21a*3 - 64/7a*v + 0 - 1/42a*4 + 41a. Factor y(p). -2(p - 8)2/7 Let q(l) be the first derivative of -16l*5/5 + 23l*4 - 56l*3 + 40l*2 + 32l + 8635. Factor q(y). -4(y - 2)3(4y + 1) Suppose -3z = -21 + 6. Suppose -5w = -4a + 7, 3a + w + 5 = za. Find f, given that 2/5f4 + 8f + 14/5fa + 16/5 + 36/5f*2 = 0. -2, -1 Solve -58/23l*4 + 0 + 568/23l*2 + 178/23l*3 - 40/23l = 0 for l. -2, 0, 2/29, 5 Let v(a) be the first derivative of a*5/10 - 33a*4/8 + 121a*3/2 - 1495a*2/4 + 1014a + 3907. Factor v(l). (l - 13)*2(l - 4)(l - 3)/2 Suppose 4g - 76 = -12. Factor -y*4 - 22y + gy + 2y*2 + 3y*4 + 6y*3 - 4y*4. -2y(y - 3)(y - 1)*(y + 1) Let s = 677 + -677.	{ "pile_set_name": "DM Mathematics" }
16 = -2d + 3d. Let r(h) = 15 - l + h3 - h2. What is r(-1)? -2 Let b(z) = 4 - 3 + z - 11z3 - 3z + z*2. What is b(1)? -11 Let c(v) = -4v - 3v + 3v + 5v - v2 + 1. Let a be (0/(-2))/1 + 2. Give c(a). -1 Let a(l) = 9l2 - l2 + 0l + l - 2l2. Let q(m) = -m3 - 4m2 - 2m + 2. Let n = -8 + 5. Let g be q(n). Calculate a(g). 5 Suppose -4s + 8 = 4w, 4w + 28 = -0s + 5s. Suppose sy = -2q - 4, 6 = q - 3y + y. Let a(z) = z*2 + z - 2. Calculate a(q). 4 Let t(u) = 3u - 11. Let r be t(5). Let v(j) = -3j + 2. Give v(r). -10 Let g = 26 + -16. Let v = g - 14. Let x(u) = -u - 4. Calculate x(v). 0 Let m(h) = h2 + 7h - 5. Let v be m(-8). Suppose 0 = -2f + f - v. Let s(q) = q3 + 3q2 - q + 3. Give s(f). 6 Let v(u) be the first derivative of u2/2 - u - 1. Let a be 3(-4)/1214. Let z be a/4 - 2/(-4). Give v(z). -4 Let u be 1 + (1 - 2) - 0. Let y(i) = -i*3 + i + 1. Suppose -6 = d - 4. Let f(s) = 3s*3 - 3s - 3. Let k(v) = df(v) - 5y(v). Determine k(u). 1 Let o(u) = -3u - 7. Let x(j) = -j - 1. Let h(g) = o(g) - x(g). Suppose -d + 3n + 51 = -6d, -12 = -4n. Let y be (-1)/6 - (-58)/d. What is h(y)? 4 Let g(k) = -2k + 5 + 2k - 6 - k*2 + 4k. What is g(2)? 3 Let n(a) = -a*2 - a - 7. Let t(i) = 1. Let f(r) = -n(r) - 6t(r). Determine f(3). 13 Let y = 0 + 3. Let i(a) = 2a - 7. Let s be i(5). Let h(c) = -8c + s - 1 + yc. Calculate h(2). -8 Let n(p) = 2p - 3p + 0p - 10. What is n(-6)? -4 Let c(g) = -2g2 - g3 + 5g - 2g2 + 0g*2 - 3g. Let j be 12/10(-10)/3. What is c(j)? -8 Let r(q) = 4q + 5. Suppose -3y + 12 = 0, 0 = 3n + 2y + y + 3. Determine r(n). -15 Let c(b) = b2 + 5b + 5. Let p(w) = -3w2 + 5w + w + 4 + 4w2. Let q(z) = -6z + 8. Let g be q(2). Let u be p(g). Determine c(u). 1 Let z(c) = 4c2 + c - 1. Let u = 9 + -8. What is z(u)? 4 Let n(x) = x2 + x - 6. Let u be n(-4). Let p(j) = -2j + 2j - 12 + j. What is p(u)? -6 Let p = -2 - -7. Let h(t) = 3t*2 + 0t2 + t3 + 18 - 22 - pt. What is h(-4)? 0 Let u = 15 - 9. Let p be (-5)/(2 - (u - 3)). Let r = 8 - p. Let s(y) = y3 - 4y*2 + 2y + 2. Give s(r). -1 Suppose 4n = -4, 1 = 2m - 5n - 12. Let l(i) = -1 + 2i*2 - 5i*3 + mi*3 - 4i*2 - 2i. Give l(-1). 0 Let m be 1/(-2) - (-2)/(-4). Let b(q) be the second derivative of q5/60 + q4/24 - q*2/2 + 3q. Let c(x) be the first derivative of b(x). Calculate c(m). 0 Let v(z) be the first derivative of z*4/4 - 3z*3 + 5z*2 + 27. Determine v(8). 16 Let j(u) = 6u + 1. Let m(f) = -6f. Let s(w) = -4j(w) - 3m(w). Determine s(-4). 20 Let y(g) = 3g*3 + 17g*2 + 5g - 16. Let i(w) = 5w3 + 26w*2 + 8w - 24. Let m(n) = 5i(n) - 8y(n). What is m(6)? 8 Suppose -22 = -4c + 2. Let l(u) = -5u + 7. Determine l(c). -23 Let v(a) = -3a + 1. Let x be (0 + -2)/2 - -3. Let u(w) = 0w*2 + 4w - x - 3w2 + 4w2. Let n be u(-4). Determine v(n). 7 Let w(h) be the second derivative of h4/6 + 2h3/3 + 3h*2/2 - 14h - 1. Suppose 4a = 5r - 3r - 14, 5a + 18 = 3r. Determine w(a). 9 Let d be (0 + -1)/((-3)/(-18)). Let b(y) = y2 + 6y + 2. Determine b(d). 2 Let f be (-77)/(-11) + (1 - -1). Let d(n) = -n + 13. Calculate d(f). 4 Let r be (-14)/3 + 8/12. Let q(h) = -h + 4. Determine q(r). 8 Suppose 0 = 4t - 12, -2t + 22 = 3g - 2. Let c(o) = -o2 + 8o - 6. Calculate c(g). 6 Let t(h) = h*2 - 10h. Suppose 2b = 8b - 54. Calculate t(b). -9 Let x be (2 + (2 - 4))/1. Let c(z) = 0z2 - 2z + z + xz - z2 - 3z*3. Let j be 0 + 1/(-2)2. What is c(j)? 3 Let v(b) = -b. Let q be v(-3). Let a(y) = 1 + 5y3 - 2 + 2y*2 - 5y*q - 6y*3. Calculate a(-1). 7 Let x(p) = 3p - 1. Let t(i) = 8i - 3. Let j(h) = -4t(h) + 11x(h). Give j(0). 1 Let a(n) be the first derivative of -1/24n*4 + 0n + 2 + 0n2 - 2/3n*3 - 1/20n5. Let z(l) be the third derivative of a(l). What is z(1)? -7 Let g(v) be the first derivative of -v2/2 - 10v + 2. Let z be 2/(-3) - (-64)/(-12). What is g(z)? -4 Suppose 2f = 3s - 7, s - 2s + 5f = -24. Let a(m) = 11m*2 - m. Determine a(s). 12 Let w(c) = -22 + 11 + 6 + 7 + c. Let r = -7 - -12. Determine w(r). 7 Let l = -5 + 8. Suppose -2g = -0 - 6. Let z(n) = -1 - 2 + 35n3 - 34n*3 + 6n - 3n2 - gn. Determine z(l). 6 Suppose 0 = 5f + 20, -3w + f = -29 + 10. Let a(g) be the first derivative of g*2/2 - 6g - 122. What is a(w)? -1 Let f(d) be the second derivative of 0d2 + 4d + 5/24d4 - 2/3d*3 + 1/360d*6 + 1/20d*5 + 0. Let u(o) be the second derivative of f(o). Give u(-5). 0 Let i(z) = -z - 16. Let q be i(-12). Let b(c) = 3c + 6. Determine b(q). -6 Let v(k) = 1 - 6k + 3k + 4k. What is v(-4)? -3 Let b be 3/(-5) + (-13)/(65/(-28)). Let u(n) = -n + 7. Give u(b). 2 Let i(z) = z2 - 2z. Suppose -5r + 9r = 5w + 30, 3w = 5r - 31. Let f be 2/3(-3)/w. What is i(f)? -1 Suppose 0 = n + n - 4. Let g(u) = -3u. Let f be g(n). Let q(p) be the second derivative of p4/12 + 5p*3/6 - 7p*2/2 - 40p. Give q(f). -1 Let t(c) = c + 1. Let j(b) be the first derivative of b*4/4 - 7b3/3 + b2/2 - 2b - 3. Let r be j(7). Give t(r). 6 Let m be 21 - -1(1 - -2). Suppose -4g = -0 + m. Let z(j) = -j2 - 5j. What is z(g)? -6 Let v(k) = k*2 + 15 + 9 + 9 + 4k - 27. Determine v(-5). 11 Let u(v) = 5v - 7. Let d(c) = c3 + c2 - c + 4. Let b be d(0). Let k(y) = -y. Let w(o) = bk(o) + u(o). Give w(0). -7 Let v(q) = -14q2 - 18q + 14. Let z(k) = -5k2 - 6k + 5. Let l(g) = 6v(g) - 17z(g). Let x = 8 + -2. Determine l(x). -1 Let z = 62 + -63. Let g(x) = -8x + 1. Determine g(z). 9 Let j be 1/(-4) - (-27)/12. Let u(z) = -z3 + z2 - z + 2. Calculate u(j). -4 Let k(u) be the third derivative of 0u*3 + 1/60u*5 - 3u*2 + 0u - 7/24u4 + 0. Calculate k(7). 0 Let k(u) = 2u3 - u2 - 2u + 1. Suppose w - 6w + 15 = 0. Let h be 4/(-1 + 0 + w). Calculate k(h). 9 Suppose 10m = 9m - 4. Let d(g) = 4g - 2. Determine d(m). -18 Let i(g) = -5g + 6. Let j(p) = 5p - 26. Let w be j(6). Calculate i(w). -14 Let d(b) = -b + 1. Let w(x) = 10x - 8. Let i(p) = 8d(p) + w(p). Let f(n) = -n3 + 7n*2 + 7n + 7. Let v be f(8). Calculate i(v). -2 Let x(k) be the first derivative of k7/840 + k6/72 + k5/40 + k4/8 + 2k3/3 - 2. Let f(m) be the third derivative of x(m). Calculate f(-3). 12 Let x(c) = -2c + 7. Let d(f) = -f + 1. Let y(k) = -d(k) + x(k). Let v be (0 - -1)/15. Suppose 0t = -vt. Calculate y(t). 6 Let t(a) be the third derivative of -a6/120 - a5/12 + a3/3 - 4a*2 + 6a. Calculate t(-5). 2 Let i(z) = 2z2 - 2z + 1. Let t(w) = w*3 + 6w*2 - 7w - 2. Let k be t(-6). Suppose 2l = l, -5f = 4l - k. Let o be 6/f + 1/4. Give i(o). 1 Let a be (-2 - 0)/(-4)-4. Suppose 0 = -5p + 1 + 4. Let i(z) = 2z + p + 2z + 0. What is i(a)? -7 Let b = -49 - -28. Let a be 1/2 - b/(-6). Let t(m) = m + 1. Determine t(a). -2 Let h = -11 - -26. Let g be h/5 - 8/(-2). Let o(q) = q - 11. What is o(g)? -4 Let r(y) = 2y*2 + 6y + 5. Let v(a) = a*2 + 3a + 2. Let p(q) = -4r(q) + 9v(q). Let o = -14 + 16. What is p(o)? 8 Let t(o) be the first derivative of -3 + 3/2o2 + 3o. What is t(-3)? -6 Let i(v) = 5v3 + v2 - 4v - 1. Let k(z) = -9z3 - z2 + 8z + 1. Let x(t) = -7i(t) - 4k(t). What is x(3)? -9 Let c(h) = 2 - h + 3h - h2 - 2 + 4. Give c(3). 1 Let o be 2/((-40)/(-15) - 2). Let d(t) = -t3 + 3t*2 - 4t + 1. Give d(o). -11 Let j(v) = 7 + 321v3 - 322v*3 + 5v*2 - 4. Determine j(4). 19 Let x = -14 - -18. Let f(d) = 3d + 5. Let q(o) = -o. Let t(b) = xq(b) + f(b). Let i(s) = -s3 - 5s*2 + 4. Let c be i(-5). Give t(c). 1 Let j(z) = 3z*2 + 2 - 2 - 1. Let g be j(-1). Let i(r) = -4r + 2r2 + 2r*g - 5r2 + 1. What is i(-3)? 4 Let x(q) = q3 + q*2 - 2q + 2. Let r(o) = -o*2. Let j(h) = -5r(h) - x(h). Calculate j(3). 13 Let u(c) = -7 + 0 + 248c - 250c. Let o = -8 + 2. Give u(o). 5 Let k(n) = -8n3 - 29n*2 - 10n - 15. Let i(q) = -3q3 - 10q*2 - 3q - 5. Let d(h) = -11i(h) + 4k(h). Give d(7). -5 Let a(z) be the second derivative of -z8/3360 - z7/2520 + z6/720 + z5/120 + 5z4/12 - 3z. Let m(p) be the third derivative of a(p). Calculate m(-1). 1 Let x(i) = -4i3 + i - 2i - i*2 - 5 + 5i3. Let b(j) = -j3 - 3j2 + 5j + 4. Let o be b(-4). Suppose o = -4*d + d	{ "pile_set_name": "DM Mathematics" }
xpand (2 + 1 - 4)(0 - 1 + 2)(1 + o - 1 + (-2 - 2 + 3)(1 + 3o - 1) - o - o + 0o). 4o Expand u3 + u3 - u*3 + (-2 + 2 + 3u)(-3 + 4 + 2)(-3 + 3 + u*2). 10u*3 Expand (0 - 3 + 1)((0d - 2d + d)(2d2 + 1 - 1) + d - d + d3 + 0d - 6d*3 + 0d). 14d3 Expand (-2n*2 + 3n2 + n2)(-n2 - 6 + 6) + 5n*4 - 4n*4 + 0n*4 + 5n*3 - 5n3 - n4. -2n4 Expand (t4 - 3t2 + t2 + 6t2)(1 + 5 - 5). t*4 + 4t*2 Expand -4a*3 + 2a*3 + 4a*3 + (a + 2a - 4a)(3a2 + 3a + 2a2 - 2a2). -a3 - 3a2 Expand (4 - c - 4)(2 - 2 + 2c)(-4 - 21 + 2). 46c2 Expand (3l - 4l - l)(8l - 8l - 4l) - 3 + 3 - l2. 7l*2 Expand (0x - 3x + x)(1 - 1 + 3x)(-3x - 3x + 5x). 6x3 Expand (2 - 2 - x2)(-x2 + x3 + x2) + (-x2 + 4x2 - x2)(9x*3 + 10x*3 + 6x*3). 49x*5 Expand d + 13 - 1 - 5 + (d - 3d + 0d)(2 - 1 + 1). -3d + 7 Expand (-y + 0y - y)(2y - 1 + 1)((-y + y + 2y)(-y - y + 0y) + 3y2 + 6y*2 - 3y*2). -8y*4 Expand 17t - t5 - t2 - 17t + (-t2 + 2 - 2)(t2 - t2 + 2t3). -3t5 - t2 Expand ((-1 + 0 + 0)(-4 + 1 + 2) + 0 + 0 - 2 + 0 + 1 - 5 + 4 + 0 - 2)(6y3 - 2y*3 - 2y*3). -6y*3 Expand (-q + 5q - 2q)(q*2 + 0q2 + q2)(1 + 4 - 1 + 4 - 1 - 5 + 4 - 3 + 0 + 1 - 3 + 0 + (-1 + 5 - 2)(0 + 0 + 1) + 0 - 4 + 2). 4q3 Expand -5y*4 + 0y4 + y4 + (-3y2 - y + y)(-2y2 + y2 - y2). 2y*4 Expand (-2m*2 + 3m2 + m2)(-m + 0m - 3m + (2 + 2 - 3)(m + 0m - 2m)). -10m3 Expand i4 - 6i*4 - 4i4 - i4 + 0i + 0i + (i + 2i - i)(2i3 - 2i*3 + 2i*3) - 4i*3 + 3i*4 + 4i*3. -3i*4 Expand (2 + 5 - 5)(-2v2 + 0v*2 + 4v*2)(12v + 20 - 20). 48v*3 Expand (-4u + 3u - u)(2 - 1 + 0) - u - 3u + 2u + (0u + u + 0u)(1 + 5 - 5) + 4u - 21u + 5u + (0u + u - 2u)(0 - 1 + 0). -14u Expand (2n2 + n2 - n2)(n - 2n + 3n) + (n + 4n + 5n)(5n*2 - 4n2 + n2). 24n3 Expand ((3 - 1 + 0)(33 - 5f - 33) + 4f - 6f + 9f)(-2 - 2f*2 + 2). 6f*3 Expand 1646s + 50s3 - 1646s + (-s*3 + 0s + 0s)(-5 + 3 + 0). 52s3 Expand -5w*3 - 6w*3 + 0w*3 + (-4w - 3w2 + 4w)(w - 1 + 1). -14w*3 Expand (3 - 2 + 0)(3a - 2a*3 - 3a) - 2a3 + 3 - 3 - a3 + a - a + (0a + 0a - a2)(3a + a - 3a) - 3a3 + 2a3 - a3. -8a3 Expand (1 + 2i - 1)(0i - 2i + i) + 54 - 13i*2 - 54. -15i*2 Expand (-2s - 1 + 1)(3s4 + s4 + s*4). -10s*5 Expand 3c*5 + 0c5 - c5 + (2c3 + 5c*3 - 3c*3)(0c + 2c*2 - 2c - 3c2). -2c*5 - 8c*4 Expand 2k - 2k + 2k5 + (k2 + 3k2 - 3k*2)(11k3 + 8k*3 - 3k*3). 18k*5 Expand 3o*2 - 4o2 - o2 + (5o - 4o - 5o)(-4o + 0o + 3o) + o2 - 2o*2 + 0o*2 + (2o + 2 - 2)(-4o + 4o + o) + o2 - o2 + 2o*2. 5o*2 Expand ((-3h + 3h + 2h)(2h*4 - 2h + 2h) - 36h*2 + 36h*2 + 14h*5)(-2 + 1 - 1). -36h5 Expand (-q - 5q + 5q)(2q3 - 5q3 - q3) - 2q4 + 2q*4 - 3q4. q4 Expand ((-1 + 4 - 2)(1 + 0 - 2) + 3 - 1 - 4)(-n - 2n + 0n). 9n Expand (1 - 1 - 1)(8 - 8 + 5w5). -5w*5 Expand (-d + 3d - 11d)(2 + 0 + 3). -45d Expand (3s2 + s2 - 5s2 + (s + 5s - 4s)(-2s - 3s + 7s) + 4s*2 - 2s*2 - 3s*2 + 2s*2 + s - s)(-3 + 3 - 3s). -12s*3 Expand 2r5 - r4 + r*4 - 13r*5 + 13r*5 - 9r5 + (r3 - 5r3 + 2r*3)(-2r2 + 6r*2 - 3r*2). -9r*5 Expand (6w - 3w - 4w)(-w2 - 2w*2 + 8w*2)(5w - 4w + 0w). -5w*4 Expand (2s - 4 + 4)((-1 + 2 + 1)(4 - 4 - 2) + 1 + 4 - 6 + 2 - 4 + 3)(7 - 4s - 7). 32s2 Expand 0k + 5k - 3k - k + 1 - 1 + k + 0 + 0 + (-3 + 2k + 3)(-4 - 2 + 5) - 4 + 4 - 2k + 0k + k - 7k. -8k Expand 13o2 - 9o*2 - 46o*2 + (4o + o - 3o)(4o - 4o + 2o) + o2 - 2o*2 + 2o*2. -37o*2 Expand 3m*5 + 32m*4 + 3m*4 - 2m*5 + 2m*5 + 0m + 0m + (-3m + m + 3m)(4m4 - 2m4 - m4). 4m5 + 35m*4 Expand (-1 - 1 + 1)(-15z4 - 2z*3 - z + 6z*5 + 15z*4). -6z*5 + 2z*3 + z Expand (2n*2 - 4n*2 + 4n*2)(2 - 2n2 - 2) - 4n4 + n4 + 2n4 + n4 + 0n*2 + 0n*2 + (-1 - 2n*2 + 1)(0n + 0n + n*2). -6n*4 Expand -2 - 13b*2 - 273b + 273b + 0b*2 + 3b*2 - 2b*2 + (-2b*2 + 4b*2 + 0b*2)(-1 + 2 - 2). -14b2 - 2 Expand 3 + 3u*2 - 3 + (-u + u + u)(0 + 0 + 2u) - 2u + 2u + u2 + 4u2 - u2 - u*2 + 2. 8u*2 + 2 Expand (-q - q + 3q)(-q - 2q + 4q) + 4q - 4q + 2q*2 + (2q - 3q + 4q)(2q + 1 - 1) + (2q - 2q - 4q)(0q + 0q + q). 5q2 Expand (-4l2 + l2 + 5l2)(-4 + 5 - 17). -32l2 Expand (-5r*2 + 4r*2 + 4r*2)(3 - 4 - 1) + (0 - 4 + 2)(-r2 - 2r2 - r2) - 3r2 + 3r*2 + 2r2 + (-r2 - 3r2 + 2r*2)(-2 - 3 + 3). 8r2 Expand (1 - 1 - 2)(0h3 - 3h*3 + 2h*3) + (-100h - 20h2 + 100h)(-3h + 5h - h). -18h*3 Expand -4v - 13v + 4v + (1 - 1 + v)(2 - 6 + 5). -12v Expand (-2x + 4x + 0x)(-3 + 3 - 2) + (0x + x - 2x)(1 - 3 + 5) + 2x - 3x + 4x. -4x Expand 0x*3 - 2x*3 + 0x*3 + 3x3 + x3 + 0x3 - 3x + 3x + 2x*3 + (3 - 4 + 2)(3x3 + x3 - 3x*3). 5x*3 Expand (-3 - 3 + 4)(0 + 1 - 3)(-2b2 - b2 + 0b2). -12b*2 Expand (2v*3 - 3v + 3v)((-v + 4 - 4)(5 + 5 - 8)(0 + 1 + 2) + (2v + 2 - 2)(-3 + 1 + 4)). -4v4 Expand (3 - 7 + 2m + 3)(-1 - 1 + 0) + 2m + 4 - 4 + (-1 + 2 + 0)(0m - 4m + 2m) + 1 - 1 - 2m. -6m + 2 Expand (-2 + 5 - 1)(3n + 0n - 2n)(-5 - 5 + 4). -12n Expand (0 + 0 - 10)(-8 + 8 + 2i). -20i Expand -n + 7n + n + (4n - 3n + 0n)(-1 + 3 - 1) - 5n + 3n + n + (1 + 1 + 0)(0 + n + 0). 9n Expand (-5o + 4o - o)(4o*3 + 0o*3 - 5o*3) - 15o*4 - 25o*2 + 23o*2 - 2o*4. -15o*4 - 2o*2 Expand (-4z - 9 + 9)(1 - 1 - z + (1 + 2z - 1)(-3 - 1 + 3)). 12z2 Expand -m3 - m3 + m3 - 9m3 + 122m - 122m + (-2 + 2 - 2m)(-m2 + 2m*2 + 0m*2). -12m*3 Expand 3s + 0s + 0s + (-1 - 1 + 4)(3s - 2s + s) + s + s - 3s + 0 + 2s + 0. 8s Expand (0 + 0 - a)(0 + a3 + 0) + 5a*4 + 16a*4 - 7a*4. 13a*4 Expand (2h2 - h2 - 5h3 - 5h*2)(-1 - 4h + 4h + h). -5h4 + h3 + 4h2 Expand (r3 - 14r + 13r + 2r3)(-4r - r + 4r). -3r4 + r2 Expand (-5 - 5 + 2v*2 + 0)(-2v + 0v + 3v) + v3 + 3v*3 - 2v*3. 4v*3 - 10v Expand -10o3 + 38 - 38 + (2o*2 + 0o + 0o)(-4o + 2o + 0o). -14o*3 Expand 13 + 2s*2 - 13 - 2s + s*2 + 2s + 2s2 + 0s*2 + 0s2 + (-s2 + 2s2 - 2s*2)(-1 - 4 + 4) + 2s2 + 4s - 4s. 8s*2 Expand (5 + 3 - 5)(0 - 13j + 2 + 10j). -9j + 6 Expand (8f - 3f + 0f)((2 + 2 - 3)(f + 2f - f) - 3f + 4f + 0f). 15f2 Expand (4 - 2 + 0)(0h + 0h + 2h) - 2h + 4h - 3h - 3h + 2h + 3h - 13h - 18 + 18. -8h Expand (3h - h + h)(2h + 5h2 - 4h - 4h2). 3h*3 - 6h*2 Expand (-11f*3 - 1 + 1)(-1 + 3 - 4) + 0f3 - 3f*3 + 8f*3. 27f*3 Expand (3k*3 + 0k*3 - 4k*3 - 2k*2)(0k2 - 10k*2 - 3k*2). 13k*5 + 26k*4 Expand (4 - 1 - 1)(1 - 6 + 7l + 1). 14l - 8 Expand (o*2 - 4o2 + o2)(2 - 2 + 6o*3 + (o + 5o - 4o)(5o2 - o2 - 3o*2)). -16o5 Expand -v3 - v*3 + 0v*3 + (-10 + 3v + 10)(4v - 4v2 - 4v). -14v3 Expand (7v + v - 2v)(1 + 1 + 0)(3 - 2 + 0) - v + 0v + 2v. 13v Expand ((-2z2 + 2z*2 + 2z*2)(z + 2z - z) + 2z3 + z3 + 0z3)(-2z + 5z - z) + (0z + z + z)(-5z3 - 2 + 2). 4z*4 Expand 7u*5 + 11 + 2u*5 - 7u*5 + (2 - 2 - 2)(u5 + u5 - 4u5) - 2u5 - u3 + u*3. 4u*5 + 11 Expand (0 + 0 - f)((5f - 4f + f)(-2 + 3 - 3) + f - 2f + 2f). 3f*2 Expand (-11j + 5j3 + 11j)(-3 + 3 + 1)(0j - 2j + 4j)(-j - 3j + 2j). -20j5 Expand (2 - 3 + 3)(0c + c - 4c)(3c - 3c + c2 + (0 - 2 + 0)(2c2 - 4c2 + c2)). -18c3 Expand (2n*3 + 2n*3 - 2n*3)(0n + 0n + 4n). 8n4 Expand w3 - 2w3 + 2w*3 + (3w - w*3 - 3w)(0 - 1 - 1) - 4w*2 + 3 - 1 - 295w*3 + 294w*3. 2w*3 - 4w*2 + 2 Expand (-2 + 3 - 2)(-17w + 17w + 30w)(-6 - 1 + 4). 90w Expand (5 - 2 - 6)(2p + 0 + 0) + 0p + 0 + 2 - 2p. -8p + 2 Expand (0 - 2 + 1)(-1 - 1 - 2)((3 + 2o - 3)(-4o3 + o3 + 2o*3) - 2o*4 + 0 + 0 - 3 - 2o**4 + 3). -	{ "pile_set_name": "DM Mathematics" }
s positive. i*(-1837/45) Simplify ((kk*(-5/6)kk)/k(-10))/((k/(kk*(-1/6)k))/(k/(kk/k20))) assuming k is positive. k32 Simplify (ggg12g/(g13/g))/(g/g5g)47 assuming g is positive. g144 Simplify ((gg*(-1/7))/(gg((g(1/10)/ggg)/g)/ggg))/(g(5/4)g3/g) assuming g is positive. g(-769/140) Simplify (aa(-2/5))(-47)/(a(4/3))8 assuming a is positive. a(-583/15) Simplify s(9/7)/s(-3/8)s*(-3)s(-4/3) assuming s is positive. s(-449/168) Simplify (n(6/17))(-2/43)/(nn(7/8)n/n*(2/5)n) assuming n is positive. n*(-102089/29240) Simplify ((bb(bb*19bbb)/b)/bb/(b8b))/((b/(b/((b/(b/(b*(2/3)/b)))/b))bb)/b(1/7)) assuming b is positive. b(304/21) Simplify (t(-4/3))44/(t/t(-2/11))(2/127) assuming t is positive. t(-245950/4191) Simplify (v/(((vv/(v*4v))/v)/v))10/(v10/((vv(-3))/v)) assuming v is positive. v47 Simplify ((v(-2)v/(v/(v/(v6/v))))37)*0 assuming v is positive. 1 Simplify (ppp(-18)p(-8/5))(3/5) assuming p is positive. p(-264/25) Simplify w(-20)/(w*(2/9)w)w20/(ww(-1/43)) assuming w is positive. w(-851/387) Simplify ((cc(-5))/c0)(-6) assuming c is positive. c24 Simplify ((u(-14/5))(-4/15))(2/9) assuming u is positive. u(112/675) Simplify (w13w(4/9)/w)/(w(-21))6 assuming w is positive. w(1246/9) Simplify ((a(aaa/(aa*(-1/2)aa))/a)40/((a/a(-2/3))/aaaa/a(-5)))(-37) assuming a is positive. a(-1258/3) Simplify (n/n(1/2)nn)(-3/4)/((n24/n)/nn/(nn(10/3))) assuming n is positive. n(-493/24) Simplify u(-5)/u(1/23)u(-22)u(-2/27) assuming u is positive. u(-16840/621) Simplify ((l/(l*(-9/5)l))/(l/(l*(12/11)l)))(-5/2) assuming l is positive. l(-159/22) Simplify (f/(f/(f(1/2)/f)))(-46)(fffff/(fff/(f/(f/(ff/((f*(13/5)/ff)/f)f)))f)fff)(-5/19) assuming f is positive. f(410/19) Simplify ((n(2/11)nn)/n)(-46)(n(nn/n*26)/n)/nnn(23/4) assuming n is positive. n(-3195/44) Simplify a28/aa*(-24)(a/(aa(-9/2)))/a(-27) assuming a is positive. a(69/2) Simplify (((((o/(o/(o/(oo0))))/o)/o)/(o/(o/o(2/5))))/((oo/(o1/o))/(o/(ooo/o(1/5)))))(28/9) assuming o is positive. o(-868/45) Simplify (r(11/4)/r)/((r/(r13/r))/r)(r(r/(rr*(1/2)))/rrrr)/(r/r29) assuming r is positive. r(177/4) Simplify (((((s/(s*(1/7)/ss))/s)/s)/s)/(s/((ss6)/s))(s/s*(1/3))/ss/s(3/5))(-1/46) assuming s is positive. s(-307/4830) Simplify (k12)(2/13)/(k24k/k5k) assuming k is positive. k(-249/13) Simplify ((z/z(-2))(-18/5)/(z2/(z*(-8)z)))32 assuming z is positive. z(-3168/5) Simplify ((j*(-8)/j)/jjj(-1/55)/j)/(j(8/3))39 assuming j is positive. j(-6271/55) Simplify (c1)(2/3)cc((ccc*(-8)/c)/c)/cc/((c*(-2/3)/cc)/c) assuming c is positive. c(-11/3) Simplify ((r/(r(-3/17)/r))/(r/(rr20rr)rr))/(rr*(-17)rr(-5/2)) assuming r is positive. r(1349/34) Simplify (ii/(ii(-1/11)i)i/(ii*(-1/6))(i*(3/5)/ii)/(i*(2/21)/ii))(-2/55) assuming i is positive. i(-587/21175) Simplify (ww/w0w)25/(w(-3)/(w*(-2/7)w)) assuming w is positive. w(551/7) Simplify (l(-2/9)l(10/9))(-14) assuming l is positive. l(-112/9) Simplify ((ss*(1/2))/(ss*(-6)s))/(s3/(s/s(-1))) assuming s is positive. s*(9/2) Simplify (ww*(-2/59)/wwww/((w/(w/w*(-3/17))w)/w))/(w/w(19/2))(-1) assuming w is positive. w*(-10747/2006) Simplify (m/(mm/((mm(1/4))/m)mm))/m(-6)m*9/(mmm(-2/3)mmm) assuming m is positive. m(95/12) Simplify (y(-2/9)/y*2y/(y/y*(4/7))yy(-6))(6/25) assuming y is positive. y(-838/525) Simplify j(-2/3)/(j/j(-1/2))(j/(j*1j))(3/2) assuming j is positive. j(-11/3) Simplify (l(-5))2l(2/15)l(-4/3) assuming l is positive. l(-56/5) Simplify (g*(-5)g/(g/g8))(-7/3) assuming g is positive. g(-7) Simplify ((c(1/2)/ccc)/c*3c1/c(-4/5))(-34) assuming c is positive. c(-51/5) Simplify ((qq/(qq*(-3/5)))/qq)/((q*(-3/5)qq)/q)(q*(-13)q)/q6 assuming q is positive. q(-84/5) Simplify ((((uu(-11/2))/u)/u)/u(-6/29))/(u(-1/2)u)(-1/34) assuming u is positive. u(-12381/1972) Simplify ((u*(2/5)u)(-11)/(u/u(-2))(6/17))(-13) assuming u is positive. u*(18187/85) Simplify ((bb(3/4))/b(2/23))/(bb(-1/7))(-1/29) assuming b is positive. b(31611/18676) Simplify (i(-9)/((i/i18)/iii))/(i(-2/29))32 assuming i is positive. i(267/29) Simplify (j(-10/7)/(j(1/4)/j))21 assuming j is positive. j(-57/4) Simplify ((g/g(15/4))/g)/g(1/24)((gg/(ggg27ggg)g)/g)/gg18/g assuming g is positive. g(-427/24) Simplify ((w(-1/3)/w)(-29)/((w/w(1/8))/(w/(w8/w))))(1/19) assuming w is positive. w(763/456) Simplify ((u*1(uuu/(u/(u/(u/((u*(-2)u)/u)u))))/u)(4/3))8 assuming u is positive. u(-32/3) Simplify (tt3)(-26/9)((t/(tt2))/t)36 assuming t is positive. t(-1076/9) Simplify (p/p(3/5))*16(p/(p*(-1/3)p))(-25) assuming p is positive. p(-29/15) Simplify (a*0a)(4/21)/(a18/(a*(-14)aa)) assuming a is positive. a(-626/21) Simplify (t(tt(3/2))/tttt)/(t(t/((t(-1/3)t)/t)t)/t)(t/(ttt/t*7t))/(t*(-2)t) assuming t is positive. t(49/6) Simplify s(-9)ss*(2/7)(ss(2/7)/ss)(21/5) assuming s is positive. s(-81/35) Simplify (ss(-3/23)s23)/(s(-21))(-19) assuming s is positive. s(-8628/23) Simplify (o/(ooo*(-3)/oo))(-1/22)/((o/o9oo)/oo/(oo10)) assuming o is positive. o(186/11) Simplify z*(-1/9)z*(1/19)(z6)(-3/20) assuming z is positive. z*(-1639/1710) Simplify (((ccc(1/4))/c(-2))/(cc/c*(-5)c(-2/15)))28 assuming c is positive. c(-1099/15) Simplify ((y(-2/19)y)/y(3/7))/(((y/(y/y(8/7)y))/yyyy)/y10) assuming y is positive. y(1107/133) Simplify (g/g(-7/4))37(g*(-1/28)g)/((g/g*26g)/ggg) assuming g is positive. g*(880/7) Simplify ((((j(j(j/(j/(((jj(-1/6))/j)/j)))/j)/j)/j)/j)25)45 assuming j is positive. j(-7125/2) Simplify (mm/(mm/(m/((m*(-2/3)m)/m)))m)(-3/10)m*(-2/9)(m/(mmm(-2)))/m assuming m is positive. m(-46/45) Simplify (((l/(l(llll/(l*(-5/4)l)ll)/ll))/l4)/((ll(1/3))/(l/(l/l2))))(1/40) assuming l is positive. l(-23/96) Simplify (d/d*5d)*38(d/d*(-20))/(((dd(-12))/d)/d) assuming d is positive. d(-80) Simplify u*(-11/3)uu37(u(-26))(-18) assuming u is positive. u(1507/3) Simplify ((g2)(-9)/(g7/(ggg*(-3/8)g)))(1/45) assuming g is positive. g(-179/360) Simplify (y*(-11)/yyy18)/(y/(y(yy(-13/5)/yy)/y)yy(3/5)) assuming y is positive. y(14/5) Simplify (hh(3/8)hh(-19))/(h(-24/5)/(h/h31)) assuming h is positive. h(-1673/40) Simplify (x/(x(-1/2)/x))(-21/8)/((x(-4/3)/x)/x)(19/3) assuming x is positive. x(2095/144) Simplify n(-3/5)nn/(((n/(n(n*(-1)nn)/nnn))/n)/n)(n/(nn(-1))n)/n(2/43) assuming n is positive. n(1581/215) Simplify ((g(-12))(2/53))(-37) assuming g is positive. g(888/53) Simplify (y(-6/5))(4/19)/(yy(-1/22))(-41) assuming y is positive. y(81267/2090) Simplify (((c/(c(1/16)c))/c)/c*14)/((cc*(-3))/((c/((c/(cc/((c/(cccc24/cc))/c)))/c))/cc)) assuming c is positive. c(271/16) Simplify (w(-1/14)/w(2/5))/(w8ww/((wwww/w*(-23)ww)/w)w) assuming w is positive. w(1157/70) Simplify ((z(-1)zz*(-4)/z)/((zzz(-2/5))/((z(zz(1/6))/z)/z)))(-18) assuming z is positive. z(579/5) Simplify (v/(v/v2))/(v/((v(1/6)/vv)/v))v(-15)v(2/17)/v assuming v is positive. v(-1603/102) Simplify ((z/(z/(z(-1/4)/z)))(-12/7)/(z(-7)/(z/z(2/5))))(4/27) assuming z is positive. z(1364/945) Simplify (q/(q/q*(3/5))qq(2/7)/q(q/(q*0q))(6/35))(-12) assuming q is positive. q(-372/35) Simplify (t/t(-1/5)t/(t/t(7/6)))/(t(-2/7))9 assuming t is positive. t(1037/210) Simplify d(-1/6)d*15d*(-12)/ddd(-1/14) assuming d is positive. d(58/21) Simplify (x18/(x/(xx*(-1/2)xx)))/(x(-6)xx5/x) assuming x is positive. x(41/2) Simplify (o(6/11)o*(-30))/((ooo25)/o)*15 assuming o is	{ "pile_set_name": "DM Mathematics" }
alculate l(19). 19 Let o(v) = v*2 + 129v + 2526. What is o(-24)? 6 Let w(p) = -4p2 + 192p - 1441. What is w(38)? 79 Let a(t) = -t*2 - 76t - 981. Calculate a(-12). -213 Let p(f) = -f*2 + 60f - 461. Calculate p(20). 339 Let b(z) = 10z2 - 95z - 93. Calculate b(-1). 12 Let z(p) = -p*3 + 32p*2 - 65p + 141. Give z(30). -9 Let h(d) = -2d + 13. What is h(-6)? 25 Let i(o) = -o2 - 22o - 29. Determine i(-20). 11 Let q(n) = -21n - 680. Determine q(-29). -71 Let s(b) = -3b*3 + 191b*2 + 63b + 92. Calculate s(64). 28 Let p(g) = 314g + 33291. Calculate p(-106). 7 Let m(i) = i3 + 3i*2 + 6i - 5. What is m(3)? 67 Let h(f) = 942f + 3757. Determine h(-4). -11 Let n(d) = 38d + 71. What is n(8)? 375 Let c(n) = n*3 + 58n*2 - 140n - 1217. Determine c(-60). -17 Let m(s) = 7s2 + 2067s + 2066. Give m(-1). 6 Let l(b) = b*2 + 110b + 390. What is l(-4)? -34 Let m(j) = j*3 + 46j*2 + 110j + 2927. Calculate m(-45). 2 Let w(d) = -62d + 1059. What is w(18)? -57 Let f(b) = b3 - 6b*2 - 62b - 29. Determine f(12). 91 Let h(f) = f*3 - 63f*2 - 130f + 7. Give h(65). 7 Let i(c) = -c3 + c2 + 70c + 101. Give i(-7). 3 Let r(b) = -4b*3 - 271b*2 - 199b + 114. Give r(-67). -20 Let g(m) = m*3 - 3m*2 - 12. Give g(-3). -66 Let k(d) = -2d*3 + 13d*2 + 64d - 405. Determine k(5). -10 Let b(c) = -3c3 + 210c*2 - 211c + 332. What is b(69)? 56 Let d(a) = -a*3 + 12a*2 - 6a - 5. Give d(6). 175 Let d(i) = -139i + 1371. What is d(10)? -19 Let d(m) = -9m*3 + 1359m*2 - 14. Give d(151). -14 Let x(b) = -1513b - 15130. Calculate x(-10). 0 Let z(g) = -32g + 29. What is z(-7)? 253 Let o(z) = -3z*2 + 113z - 117. Give o(37). -43 Let w(f) = -2807f - 16824. What is w(-6)? 18 Let y(n) = 49n + 2664. Give y(-55). -31 Let x(c) = -42c + 1003. What is x(27)? -131 Let y(w) = 36w - 221. Calculate y(6). -5 Let m(r) = -67r + 1183. Calculate m(18). -23 Let c(b) = 2b*2 + 188b + 3897. Calculate c(-63). -9 Let r(f) = -7f2 - 18f + 5. What is r(4)? -179 Let r(j) = -j*2 - 375j - 35151. Give r(-186). 3 Let b(a) = -258a + 45932. What is b(178)? 8 Let c(b) = -328b + 6219. Calculate c(19). -13 Let j(o) = -17o2 + 75o. Give j(5). -50 Let m(o) = o*3 + 25o*2 - 58o - 102. Give m(-26). 730 Let b(q) = 151q + 17597. Give b(-117). -70 Let u(i) = i3 - 2i*2 + 13i - 87. Calculate u(4). -3 Let s(l) = l*3 + 17l*2 + 2l + 71. What is s(-17)? 37 Let h(x) = -7x3 - 182x*2 - 4x - 159. Calculate h(-26). -55 Let w(j) = -7j - 232. Calculate w(-35). 13 Let p(k) = -k3 + 109k*2 + 121k - 1213. Calculate p(110). -3 Let d(h) = -3h + 10. Calculate d(-10). 40 Let l(k) = -k3 + 2k*2 - 6k - 55. Calculate l(0). -55 Let a(m) = 81m + 28. Calculate a(-1). -53 Let y(i) = -4i - 37. What is y(-16)? 27 Let v(k) = 189k - 1934. Calculate v(10). -44 Let x(u) = 51u - 616. Determine x(10). -106 Let m(n) = 77n - 5469. Give m(71). -2 Let h(y) = y3 - 16y*2 + 60y - 1. Determine h(10). -1 Let l(m) = -2m3 + 14m*2 - 143m + 999. Give l(7). -2 Let r(v) = 831v - 8316. Determine r(10). -6 Let b(n) = -51n*3 + 1480n*2 - 21n - 237. Give b(29). -5 Let b(a) = a*3 + 20a*2 + 224a + 1047. Calculate b(-8). 23 Let i(h) = 3h2 - 41h + 73. Determine i(3). -23 Let j(s) = 55s + 881. Determine j(-16). 1 Let b(l) = l3 + 31l*2 + 106l - 87. Determine b(-27). -33 Let r(j) = 380j - 8722. Give r(23). 18 Let d(h) = -3h*2 + 734h - 5672. Determine d(8). 8 Let p(n) = -52n - 154. Calculate p(-3). 2 Let i(f) = 3f*3 + 2f*2 - 9f - 5. Calculate i(2). 9 Let d(t) = -8t2 - 68t - 265. Give d(-11). -485 Let z(t) = 482t + 3455. Calculate z(-7). 81 Let f(v) = -v3 + 3v*2 + 11v - 40. Give f(6). -82 Let k(s) = -2778s + 5492. Determine k(2). -64 Let q(u) = 28u*2 + 168u - 9. Calculate q(-6). -9 Let a(z) = 2z3 - 139z*2 + 59z + 265. Give a(69). -425 Let y(u) = -68u - 6931. What is y(-102)? 5 Let g(i) = -i2 + 114i + 849. Give g(-7). 2 Let s(u) = -u*2 + 127u + 535. What is s(-4)? 11 Let v(x) = 37x2 + 1003x - 920. Determine v(-28). 4 Let r(p) = p*3 - 76p*2 - 3887p + 223. Calculate r(111). 1 Let d(r) = r*3 + 10r*2 + 7r + 95. Give d(-11). -103 Let v(x) = 7x2 - 1058x - 39306. Determine v(182). 6 Let w(l) = -37l - 2521. Determine w(-68). -5 Let f(k) = -2k*2 + 261k - 1664. Give f(124). -52 Let j(g) = 741g - 4203. Determine j(6). 243 Let z(a) = -a3 - 6a*2 - 30a - 174. Give z(-6). 6 Let t(o) = -6102o + 30462. What is t(5)? -48 Let n(g) = -g3 - 73g*2 - 68g + 4. Calculate n(-72). -284 Let z(y) = 19y2 - 1867y + 498. What is z(98)? 8 Let o(x) = -4x2 - 161x + 1700. Determine o(-49). -15 Let d(t) = 9t3 - 3t*2 + 13t - 6. Calculate d(2). 80 Let h(w) = -217w - 27549. Determine h(-127). 10 Let k(q) = -q2 - 14q - 19. What is k(-21)? -166 Let y(w) = 2w3 + 139w*2 + 68w - 67. Calculate y(-69). 2 Let d(y) = -y*3 + 10y*2 - 8y + 68. Give d(9). 77 Let g(n) = -n*3 + 35n*2 + 30n - 10. Determine g(36). -226 Let y(j) = -j*3 - 9j*2 - 21j - 22. Determine y(-2). -8 Let t(o) = -o*3 + 51o*2 - 149o + 13. What is t(3)? -2 Let v(k) = 8k2 - 212k + 329. Determine v(25). 29 Let d(u) = 2u3 - u2 + 9u - 49. Give d(0). -49 Let v(n) = 131n - 165. Give v(2). 97 Let d(z) = -z3 + 11z*2 - 174z + 3521. Calculate d(15). 11 Let z(m) = -4m2 - 244m - 1122. What is z(-5)? -2 Let k(w) = -w*2 + 81w - 1328. Calculate k(58). 6 Let y(b) = 88b - 56. Calculate y(5). 384 Let r(q) = 5q*3 - 3q*2 - 4q. Determine r(-2). -44 Let q(f) = -f*2 - 4f - 48. Determine q(-9). -93 Let c(t) = -143t + 10288. Determine c(72). -8 Let o(u) = -5u*3 + 186u*2 - 40u + 103. Give o(37). -8 Let i(p) = 216p + 1794. What is i(-8)? 66 Let b(z) = -729z - 7280. Calculate b(-10). 10 Let u(o) = 2o3 + o2 - 4o + 5. What is u(0)? 5 Let g(i) = -45i - 3. What is g(-4)? 177 Let p(b) = 263b + 4706. Give p(-18). -28 Let m(o) = 152o2 - 6o - 1. What is m(-1)? 157 Let s(t) = 14t2 + 880t - 3499. Give s(4). 245 Let s(u) = -u*3 - 11u*2 + 9u + 97. What is s(-11)? -2 Let w(p) = 374p - 362. Determine w(1). 12 Let f(o) = -11o*2 + 16o + 35. Determine f(-2). -41 Let w(v) = v*3 - 84v*2 + 1569v - 29. Give w(28). -1 Let p(g) = 2g3 + 100g*2 + 90g - 401. Calculate p(-49). -9 Let z(w) = -6w2 + 2w + 1. Determine z(-2). -27 Let y(o) = -o*2 - 51o + 1529. Calculate y(-72). 17 Let a(h) = -2h2 - 3h + 118. Calculate a(9). -71 Let v(u) = -u*3 + 2u*2 + 20u + 5. What is v(0)? 5 Let o(q) = -q*2 + 7q + 364. Calculate o(-17). -44 Let q(t) = -454t + 10438. Determine q(23). -4 Let o(f) = 3f*2 - 1686f + 3363. What is o(2)? 3 Let v(s) = s*2 + 10s - 559. Give v(21). 92 Let k(a) = 7a3 - 3a*2 - 6a - 4. What is k(4)? 372 Let h(j) = 20j2 - 116j - 8. Calculate h(7). 160 Let q(w) = w*3 - 6w*2 - 8w + 36. Determine q(8). 100 Let p(m) = -5m2 - 173m - 5. Calculate p(0). -5 Let m(r) = -8r2 + 176r - 640. What is m(5)? 40 Let l(h) = -67h - 2342. What is l(-35)? 3 Let d(t) = t3 + 2t*2 - 36t + 155. Determine d(5). 150 Let s(y) = -19y + 33. Give s(-1). 52 Let n(v) = -63v - 114. Give n(-2). 12 Let a(j) = 3j3 - 17j*2 + 4j + 41. Calculate a(5). 11 Let k(r) = 2r3 - 7r*2 + r - 5. What is k(3)? -11 Let c(r) = -2r*3 - 23r*2 - 3r + 19. Calculate c(-1). 1 Let n(b) = -2b3 - 41b*2 - 21b + 5. Calculate n(-20). 25 Let m(b) = -149b - 2821. What is m(-19)? 10 Let d(z) = -z3 - 27z*2 - 79z - 179. What is d(-24)? -11 Let c(g) = g*2 - 99g + 2455. Calculate c(49). 5 Let b(t) = 2t + 66. Determine b(-34). -2 Let n(q) = 2q*3 + 28q*2 - 22q - 311. Determine n(-14). -3 Let x(f) = -f*3 + 6f*2 + 67f + 65. Determine x(12). 5 Let u(w) = 33w - 2264. Calculate u(67). -53 Let y(b) = 5b + 122. Determine y(-19). 27 Let s(d) = -638d + 3889. What is s(6)? 61 Let o(k) = -19k*3 - 2k*2 + 29k + 30. Determine o(-1). 18 Let h(x) = -1254x - 5036. Calculate h(-4). -20 Let d(i) = i2 - 3045i + 18236. Calculate d(6). 2 Let u(d) = d*3 - 11d*2 + 14d - 133. Give u(9). -169 Let u(t) = 449t + 18378. What is u(-41)? -31 Let v(h) = 41h - 2162. What is v(46)? -276 Let m(u) = -u*2 + 472u + 17751. Calculate m(-35). 6 Let i(g) = -3g3 - 2g*2 - 9g + 31. Calculate i(-3). 121 L	{ "pile_set_name": "DM Mathematics" }
r = -28 + 35. Let v(o) = 4o2 + 4. Let x(n) = -9n*2 - 9. Give fx(z) + rv(z). z2 + 1 Let y(m) = -2m*2 - 34m - 1. Let u be y(-17). Let x(b) = 3b2 + b - 1. Let f(p) = -p2 + p - 1. What is uf(i) + x(i)? 4i2 Let j be (4/5)/((-20)/(-50)). Let q(m) = 2 - m + 3m*3 - jm3 - m2 + 2m - 1. Let f(t) = 6t*3 - 5t*2 + 4t + 2. Give -f(y) + 4q(y). -2y3 + y2 + 2 Let v(w) = 10w3 - 3w. Let f(a) = -9a3 + 2a. Give -3f(b) - 2v(b). 7b3 Suppose 4l + 2 = -2. Let n = 4 + l. Let g(x) be the third derivative of -x*4/12 - 2x3/3 - x2. Let b(v) = -v - 3. Calculate ng(m) - 4b(m). -2m Let w(b) = b2 + b. Let c(n) = -n3 + 6n*2 - 5n - 1. Let q be c(5). Let s(i) = 112i2 - 106i*2 - 1 + 2 + 3i. Calculate qs(h) + 4w(h). -2h2 + h - 1 Let t be 6/12 - (-1)/2. Let o(p) = 4p + 1. Let x be o(t). Let u(s) = -7 - 6s + 0s2 + 1 - s2. Let k(c) = c*2 + 5c + 5. Give xu(g) + 6k(g). g*2 Let u(j) = 7j + 3. Let k(r) = -r*3 - 3r*2 + 7r + 5. Let h be k(-4). Let n(c) = c*3 - 3c - 3. Let m be n(-2). Let w(q) = -10q - 4. Give hu(o) + mw(o). o - 1 Let r(b) = 8b + 5. Let d(i) = -1. Calculate -4d(y) - r(y). -8y - 1 Let u(l) = -9l2 + 6l + 1. Let m(v) = -19v2 + 13v + 2. Calculate 4m(f) - 9u(f). 5f2 - 2f - 1 Let v(o) = -2o + 1. Let t be v(2). Let b(p) = -5p. Let j(k) = 2k2 + 11k + 20. Let n be j(-4). Let g(c) = -2c. What is ng(z) + tb(z)? -z Suppose b - 5 = 1. Let g(l) = bl - 4l2 + 2l + 0 - 3l - 5. Let i(u) = 2u*2 - 2u + 2. Let a be 0 + 2/410. What is ai(p) + 2g(p)? 2p*2 Let r(q) = -q - 5q - q + 13q2. Let d(a) = -9a*2 + 5a. Suppose -4l + 136 = -0l. Suppose 3f = 5j + l + 1, -2j - 23 = -3f. Calculate fr(t) + 7d(t). 2t2 Let u(i) = -i3 + 5i*2 - 5i + 5. Let x(h) = -h*2 + h - 1. Calculate 2u(n) + 10x(n). -2n*3 Let g(z) = -2z*2 - z - 4. Let h(w) = -3w*2 - w - 5. Give 6g(d) - 5h(d). 3d*2 - d + 1 Let j(s) = 5s*3 + 4s*2 - 10s + 7. Let y(f) = 9f3 + 7f*2 - 19f + 14. Let r(m) = -7j(m) + 4y(m). Let t(c) = c + 3 - 1 + 0 - 3. What is r(d) + 6t(d)? d3 + 1 Let x(w) = -2w*2 + 5 - 2 + 3w*3 + 3w - w*2 - 4w3. Let q(t) = t3 + 2t2 - 2t - 2. What is 3q(h) + 2x(h)? h*3 Let u(y) = -58298y - 1133. Let v(c) = 103c + 2. Calculate 2u(w) + 1133v(w). 103w Let u(q) = 10q + 8. Let x(r) = 3r + 3. Calculate -4u(d) + 14x(d). 2d + 10 Let p(s) = 5s - 5. Let g(h) = 9h - 10. Let v(d) = -6g(d) + 11p(d). Let i(u) = -2u - 6. Calculate -5i(j) - 6v(j). 4j Let a(w) = -2w - 5. Let x(c) = 7c - 5. Let v(g) = -20g + 14. Let o(d) = 6v(d) + 17x(d). Determine a(s) - 3o(s). s - 2 Let a(q) = 5q*2 - 4q + 4. Let w(v) = -9v2 + 7v - 8. Give -5a(p) - 3w(p). 2p2 - p + 4 Let z(y) = 2y - 3. Let l be z(0). Let b(x) = x*2 - 5x - 5. Let a(q) = 3q + 3. Give lb(c) - 5a(c). -3c*2 Let l(q) = -8q*3 - 2q*2 + 2q - 5. Let v(z) = 8z3 + 3z*2 - 2z + 6. Give -6l(d) - 5v(d). 8d3 - 3d*2 - 2d Let f(l) = 5l - 5. Let i(c) = -6c + 6. Let v(t) = 5f(t) + 4i(t). Let g(k) = 8k - 8k - k. Give -g(r) + v(r). 2r - 1 Let v(w) = -4w*2 + 4w - 5. Let a(d) = -3d2 + 3d - 4. Give -6a(g) + 4v(g). 2g2 - 2g + 4 Let u(y) = 3y + 0y + 2y2 - 1 - y + 2y. Let p(a) = a*2 + a. Give -4p(c) + u(c). -2c2 - 1 Let k(b) = 41b*3 - 11b*2 - 6b - 11. Let w(c) = 8c3 - 2c*2 - c - 2. What is -2k(h) + 11w(h)? 6h*3 + h Let v(l) = 5l*3 + 8l*2 + 5l - 8. Let b be 27/5 - (-16)/(-40). Let h(u) = 3u3 + 5u*2 + 3u - 5. Determine bv(r) - 8h(r). r3 + r Let z be 4 - ((-2 - 2) + 6). Let w be (6/(-4))/((-4)/24). Let c(o) = -o3 - 2o2 + 1. Let i(s) = 5s*3 + 9s*2 - 4. Calculate wc(b) + zi(b). b3 + 1 Let s(c) = -1. Let m(t) = 3t + 1. Calculate 5m(q) + 5s(q). 15q Suppose -3 = y - 2y. Let m(w) = -3 - yw + 2 - 4. Let j be 88/(-56) - (-3)/(-7). Let x(z) = z + 2. What is jm(g) - 5x(g)? g Let r(v) = -v3 - v2 - 5v + 3. Let i(l) = -2 - 2l3 + 2l + 3l3 + 2l + l*2. Calculate -3i(k) - 2r(k). -k3 - k2 - 2k Let t(i) = -i. Let w(k) = 5k - 1. What is -6t(b) - w(b)? b + 1 Let z(w) = -w + 1 - 1 + 2w - 1. Let x(n) be the third derivative of n2 + 1/24n*4 - 1/3n*3 + 0n + 0. Determine -x(o) + 2z(o). o Let r(j) = 4j - 13. Let o(q) = -6q + 19. Determine -5o(g) - 8r(g). -2g + 9 Let y(k) = 4k2 - k - 1. Let j(t) = t2 - t - 1. Let n be (6/12)/((-2)/(-4)). What is ny(d) - j(d)? 3d2 Suppose c = -c + 12. Let y(j) = -4j - cj + 11 - 8j + 4j. Let x(r) = -5r + 4. Calculate -11x(z) + 4y(z). -z Let v(z) = 3z2 + 12z + 2. Let f(y) = y*2 + 4y + 1. Give 7f(b) - 2v(b). b*2 + 4b + 3 Let m be (1 - (-126)/3) + 3. Let c(p) = -3p - 47p*2 + mp*2 + 2p. Let r(o) = o*2. Calculate 2c(t) + 3r(t). t2 - 2t Let i(y) = 2y + y3 + 4y2 - y3 + 5y3 - 8y + 5. Let j(h) = -14h3 - 11h*2 + 17h - 14. Determine -11i(a) - 4j(a). a*3 - 2a + 1 Let q be (-10)/(-4) + (-9)/(-6). Let l(c) = -11c + 11. Let s(j) = -5j + 5. What is ql(k) - 9s(k)? k - 1 Let n(p) = 2p3 - 3p*2 + 2p - 1. Let u(j) = j*2 - j. Determine n(v) + 2u(v). 2v3 - v2 - 1 Let k(p) = p3 - 4p2 + 11. Let m(b) be the third derivative of b5/60 - b*3/3 - 7b*2. Determine -2k(d) - 11m(d). -2d*3 - 3d*2 Let u(p) = -11p - 5. Let q(v) = 4v - 8 + 24 - 14. What is -8q(j) - 3u(j)? j - 1 Suppose -2r = -3r + 4. Let w(a) = -17a*2 + 0a*2 - ra - 5a. Let z(x) be the second derivative of x4/3 + x3/3 + 111x. Determine 2w(k) + 9z(k). 2k2 Suppose 12 = -3s, 0s = 4h - s. Let o = -6 + h. Let i(y) = 2y + 3. Let p(x) = -x - 1. Let g(q) = -q2 - q - 3. Let b be g(0). Give bi(r) + op(r). r - 2 Let l be 41 + (-1)/(2/4). Suppose -l = 4x + g, 10 + 2 = -x - g. Let o(k) = 2k. Let b(n) = n2 - 8n - 1. Determine xo(t) - 2b(t). -2t2 - 2t + 2 Let u(l) = 3l + 6. Let v(i) = -i - 1. Suppose -3f - 2f = 5. Give fu(w) - 5v(w). 2w - 1 Let n(h) = -5h2 + h + 1. Suppose 5k + 3 - 33 = 0. Let c be (-2)/6 + 38/6. Let i(z) = -3 + 0 - cz2 + 20z*2 - 3z. Calculate ki(p) + 17n(p). -p2 - p - 1 Let x(g) = -g2 - 33g3 + 3g*2 - 2g - 2 + 29g3. Let a(c) = -13c*3 + 7c*2 - 7c - 7. Calculate -4a(y) + 14x(y). -4y3 Let g(t) = -3t - t*2 + 3t*2 - 4t*2. Suppose y - 4 - 6 = 0. Let o(a) be the first derivative of 2a*3 + 5a*2 - 2. Determine yg(z) + 3o(z). -2z2 Let n(d) be the third derivative of d4/24 - d3/6 - d2. Let s(k) = k - 4. Let r = 351 + -350. What is rs(a) - 4n(a)? -3a Let w(g) = 6g. Let b(y) = y*3 + 33y. Determine 6b(i) - 33w(i). 6i3 Let z(f) be the second derivative of -f3/2 + 2f*2 - f. Let i = 21 + -14. Let w(u) = 4u - 6. Determine iz(k) + 5w(k). -k - 2 Let x(i) = 2162i2 + 47i - 47. Let h(n) = 94n2 + 2n - 2. Calculate 47h(p) - 2x(p). 94p2 Suppose 9i + 112 = 2i. Let g(w) = -10w. Let m(k) = 2k. What is im(y) - 3g(y)? -2y Let s(h) = 5h2 - 3h - h*2 + 2h*2 - 2 - 3h*2. Let n(b) = -13b*2 + 13b + 9. Let q be -191 - -2 - 1. Give qs(y) - 4n(y). -2y*2 + 2y Let h(z) = -2z + 1. Let l(f) = f3 - 3f*2 + 2f - 4. Let v be l(3). Let s(c) = -c. Give vh(k) - 3s(k). -k + 2 Let p(j) = 3j - 8j - 1 + 11j. Let c(n) = -n. Give 5c(m) + p(m). m - 1 Let b(i) = 25i2 - 2. Let p(s) = s2 - 1. Give -b(f) + 2p(f). -23f2 Let u(f) = 131f*2 - 5f + 5. Let g(j) = -196j2 + 7j - 7. What is 5g(p) + 7u(p)? -63p2 Let i(w) = -4w3 + w2 + 2w. Let m(z) = z3 + z. Give i(y) + 3m(y). -y3 + y2 + 5y Let f(c) = -36c*3 + 20c*2 - 20c - 20. Let o(p) = -p3 + p2 - p - 1. Calculate -f(s) + 20o(s). 16s*3 Let k(a) = 6a - 4. Let w(r) = r*2 - 19r + 11. What is -8k(j) - 3w(j)? -3j2 + 9j - 1 Let k(t) = -t + 23. Let x(u) = -u + 34. Give 8k(p) - 5x(p). -3p + 14 Let s(g) = 6g*3 - 4g*2 - 6g - 3. Let q(b) = -13b3 + 9b*2 + 13b + 7. Let w = 16 + -12. Suppose -3v = -5v + 18. Determine vs(t) + wq(t). 2t3 - 2t + 1 Let w(o) = o - 1. Let i(n) = -16n - 8. What is i(j) - 8w(j)? -24j Let v(a) = -a2 - 4a. Let x(s) = -5s + 6. Let c(w) be the second derivative of -7w*3/3 + 17w*2/2 - 2w. Let h(k) = 6c(k) - 17x(k). Give 4h(r) + v(r). -r2 Let u(l) = 9l*2 - 19l - 15. Let	{ "pile_set_name": "DM Mathematics" }
29661d - 17 + 29661d wrt d? 66d Differentiate 13k*3 + 98k*3 - 42 + 65k*3 + 19k*3 wrt k. 585k*2 Suppose -2v + 5v = 0. Let q = 22 + v. Find the second derivative of 25d*4 - qd*4 + 4d - 2d2 + 2d*2 wrt d. 36d2 Let b(z) be the second derivative of -z5/6 + 5z4/12 - 5z*2 + 15z. Let p(r) be the first derivative of b(r). What is the second derivative of p(m) wrt m? -20 Find the third derivative of -668 + 0g2 - 67g3 + 677 + g2 - 3g2 wrt g. -402 Find the second derivative of -8b*2 + 16b - 7b2 + 2b*2 + 38b + 21b2 + 20b*4 wrt b. 240b2 + 16 Let g(n) = n2 - 2n - 49. Let h be g(16). What is the second derivative of 24f - 63f3 + hf*3 - 79f*3 wrt f? 198f Let h = 1 + 3. Let u be (-6h/4)/2. Let x(z) = -8z*3 - 3z + 7. Let l(p) = 15p3 + 5p - 14. Let d(f) = ul(f) - 5x(f). Differentiate d(v) wrt v. -15v2 Let k(s) be the second derivative of -43s*6/30 - 7s*2 + 3s + 13. Differentiate k(y) with respect to y. -172y3 Find the third derivative of -76o*5 + 14o*2 - 2o*2 - 12o - 4o2 - 4o*2 wrt o. -4560o*2 Let b(n) be the first derivative of 11n*6/30 - 27n*2/2 - 17n + 11. Let h(i) be the first derivative of b(i). Differentiate h(g) wrt g. 44g3 Let d = -159 + 198. Find the first derivative of -6y*4 + d - 19 - 22y*4 wrt y. -112y*3 Suppose -13i - 18 = -14i. Find the second derivative of ia - 5a + 8a*2 - 5a wrt a. 16 Let r(p) be the second derivative of -13p7/21 + 97p*3/3 + 2p + 4. Find the second derivative of r(s) wrt s. -520s3 Let w be 10/(1 + 0 + 1). Let z be -2 - (-6 - -1)/(-22 + 23). Find the first derivative of 98t*z + w + 2 - 102t*3 wrt t. -12t*2 Let w = 1 + 1. Find the third derivative of 6i*5 - 10i*2 + 3i*2 + wi - 2i wrt i. 360i2 Let y(s) be the third derivative of s8/168 + s*7/70 - 6s*5/5 - 13s*2 + 6s. Find the third derivative of y(i) wrt i. 120i2 + 72i Find the second derivative of 52x2 - 539x - 116x2 + 69x*2 + 26x*4 wrt x. 312x2 + 10 Let c(b) = -b2 + 7b + 5. Let a be 4/10 - (-330)/50. Let q be c(a). Find the second derivative of -5z + 4z + qz + 4z - 2z*3 wrt z. -12z Let q(m) be the second derivative of 0m2 + 0m*3 + 0m*6 + 0 - 1/12m*4 + 1/14m*8 + 0m*5 + 0m*7 - 10m. Find the third derivative of q(a) wrt a. 480a3 Let z be (24/30)/(4/10). Find the third derivative of 2h*3 + 16h*2 + 7h*2 - 18h*z wrt h. 12 Let j(y) = -y. Let a be j(-2). Let b = 8 - 5. What is the second derivative of 79r*b + 7r - ar - 78r*3 wrt r? 6r Suppose -2o = -7 + 5. What is the first derivative of -o + 3 + d - 9 wrt d? 1 Let a(i) = 255i*3 + 8i*2 + 70. Let p(b) = -1019b*3 - 36b*2 - 281. Let y(u) = -9a(u) - 2p(u). Differentiate y(w) with respect to w. -771w*2 Let h be (-3)/(-4) - 85/(-20). What is the third derivative of -83t*3 - 83t3 - t2 + 166t3 - 14t*h wrt t? -840t*2 Let z(x) be the first derivative of -13/3x*3 + 0x*2 + 5/2x*4 + 2 + 0x. What is the third derivative of z(f) wrt f? 60 Let r(q) = -q*3 + 301q*2 - 12q - 111. Let f(y) = -151y2 + 5y + 56. Let a(d) = -5f(d) - 2r(d). What is the second derivative of a(k) wrt k? 12k + 306 Suppose 12 = -4z + 44. Find the third derivative of -zf2 + 4f*4 + 15f*2 + 4f*2 + 19f*4 wrt f. 552f Let i(k) = -k*3 - 8k*2 + 9k + 3. Let c be i(-9). Differentiate 1 - 5v3 - 43 + 14v*c with respect to v. 27v*2 Let g be (-1)/2-1(-40)/(-5). Differentiate 2k + 24k4 + 2k - 14 - gk wrt k. 96k3 Let h = 1 - -3. What is the second derivative of -th + 632 + 3t - 632 wrt t? -12t*2 Let n(j) be the second derivative of 7/15j*6 + 0j*3 - 5/2j*2 + 0j*5 + 0j*4 - 2j + 0. What is the derivative of n(a) wrt a? 56a3 Let t(i) be the first derivative of i5/5 - i3 + 185i - 48. Find the first derivative of t(j) wrt j. 4j3 - 6j Let h(d) be the second derivative of -2/3d4 + 47d - 13/20d5 + 0d*3 - 1/15d*6 + 2d*2 + 0. What is the third derivative of h(l) wrt l? -48l - 78 Suppose 0 = -f + 5z + 22, 3f + 0f - 2 = -z. Suppose o = -fo. Find the second derivative of 0t4 - t + 5t*4 + ot wrt t. 60t2 Let k(c) be the second derivative of c5/10 - 29c*4/24 + 5c*3/3 + 15c. Let g(n) be the second derivative of k(n). What is the derivative of g(j) wrt j? 12 Let q(v) = -v - 12. Let k be q(-14). Find the second derivative of 7n3 - 60n*2 + 33n + 34n2 - 1 + 26n*k wrt n. 42n Let s = -823/2 + 413. Let p(q) be the second derivative of 0q3 + 1/30q*6 + 0 + 0q*5 - sq*2 + 4q + 0q4. Differentiate p(u) wrt u. 4u*3 Suppose 2d + 12 = -2i, -d = -0d + 2i + 9. Let n = d + 6. What is the second derivative of 4c + 6cn + 0c - c*3 wrt c? 30c Let m(u) be the first derivative of -2u8/7 + u4/3 - 8u + 5. Let q(b) be the first derivative of m(b). Find the third derivative of q(h) wrt h. -1920h3 Suppose 0 = -2c + 3i + 1 + 10, -1 = c + 5i. What is the first derivative of 12 + c - 30 - 4s - 20 wrt s? -4 Find the third derivative of 7l*5 + 2l*5 - 34l*2 + 8l*5 - 50l*2 - 9l*5 wrt l. 480l*2 Find the second derivative of 6l*5 + 566l - 37l2 - 83l*2 + 156l*2 - 85l*2 - 2l*5 wrt l. 80l*3 - 98 What is the derivative of w + w - 7w + 88 + 57 + 0w wrt w? -5 Let k = -63 + 64. Let b(w) = 3w*2 + 5w - 33. Let i(r) = -1. Let n(z) = ki(z) - b(z). Differentiate n(f) with respect to f. -6f - 5 Let d(b) be the second derivative of 1/6b3 - 7b + 0b5 + 0b*4 + 0 - 4/15b*6 + 0b*2. Find the second derivative of d(j) wrt j. -96j*2 Let i be 6 + 16/(-24) - 5. Let v(q) be the second derivative of -3q*2 - 4q + iq3 + 0. Differentiate v(a) with respect to a. 2 Suppose 0 = 28d - 183 + 71. Let j(c) be the second derivative of 0c2 - 11/6c*3 + 0 + 5c + 3/4cd. Find the second derivative of j(t) wrt t. 18 Let s(v) be the second derivative of -25/6v*3 + 0v*2 + 0 - 7/4v*4 - 26v. What is the second derivative of s(u) wrt u? -42 Let r be -21 - (-60)/4. Suppose 5m - 22 = r. Find the third derivative of -2l3 + 7l*2 + 5l*3 - 3l*3 + ml*3 wrt l. 42 Let i(a) = 161a*3 - 6a*2 - 137a - 3. Let o(b) = 1932b3 - 70b*2 - 1645b - 35. Let m(k) = 35i(k) - 3o(k). Find the second derivative of m(z) wrt z. -966z Let b be ((17 - 4) + -3)/(12). Find the third derivative of 31t2 + 5t*b + 15t*5 - 28t*2 wrt t. 1200t*2 Differentiate 0 - 19 - 5k + 8 + 5 + k wrt k. -4 Let r(q) = -q3 + q2 + q + 2. Let t be r(0). Find the third derivative of y*t - 4y*6 - 3y*2 + 6y*6 wrt y. 240y*3 Let h(k) be the first derivative of -2k*3 + 5 - 3k*3 + 7k*3 - 2k*6. What is the third derivative of h(o) wrt o? -720o*2 Let h(v) be the first derivative of 13 - 7/2v*2 + 0v + 0v4 + 0v*3 + 0v*5 - 3/2v*6. Find the second derivative of h(n) wrt n. -180n*3 Let y(j) be the first derivative of 181j*4/4 - 894j - 148. Find the first derivative of y(r) wrt r. 543r2 Let l(z) be the second derivative of -107z*3/6 - 33z*2 - 18z - 4. What is the derivative of l(s) wrt s? -107 Let r be 0 + (1 - 1) + 10. Let w = r - 8. Differentiate 4 - 5 + wc - 2c + 3c4 wrt c. 12c3 Let b(g) be the third derivative of g4/12 - g*3 - 4g*2. Let z be b(4). Find the third derivative of -3a*4 - 2a*2 + 3a*2 - 3a*2 - 3a*z wrt a. -72a Let m(t) be the first derivative of 29/2t2 + 0t*3 + 0t*4 + 0t + 24 - 5t5. What is the second derivative of m(u) wrt u? -300u*2 Let g = -260 - -395. What is the derivative of -21 + gq*3 - 7 - 150q*3 wrt q? -45q*2 Let v(g) be the second derivative of -122g*6/15 - 7g*3/6 - 3g*2/2 - 180g. What is the second derivative of v(w) wrt w? -2928w2 Let k = -25 - -36. Suppose z + 4a - 22 = 0, -2z + a + k + 6 = 0. What is the third derivative of -6x*3 + zx2 + x2 + 3x2 - x2 wrt x? -36 Let k be 4 + -310/15. Differentiate 7 + 14n + k - 8n wrt n. 6 Let d be (-28 - 0)/2 - -2. Let l(m) = -m*2 - 13m + 5. Let s be l(d). What is the second derivative of -4f - 16f*5 + sf*5 - 6f wrt f? 20f3 What is the third derivative of -2y - 11y2 + 151y*2 + 2y - 102y5 wrt y? -6120y*2 Suppose 5 = 2i - 3. Suppose k = -2*q + 3,	{ "pile_set_name": "DM Mathematics" }
be the first derivative of -x4/3 + x2 - 9x - 51. Let d(y) be the second derivative of t(y). Determine d(o(b)). 8b*2 Let s(v) be the first derivative of 44v*3 + 52 - 18v*3 - 22v*3. Let w(n) = 4n. Calculate s(w(f)). 192f2 Let u(p) = -14p. Let h(s) be the second derivative of -10s3/3 + 5s*2/2 + 6302s. Give h(u(j)). 280j + 5 Let w(b) = b2 - 7b - 2. Let l be w(7). Let v be (-3 - (-3 + l))/1. Let k(r) = 2rv - 5r2 + r2 + 0r2. Let n(m) = -7m. Determine k(n(u)). -98u2 Let p(d) = -6d. Let h(m) = -499443 + 353m + 499443. Calculate h(p(w)). -2118w Let p(g) = -2g2. Let x(v) = 240 - 4282v*2 + 316v - 240 - 316v. Determine p(x(z)). -36671048z*4 Let m(p) = 99p + 10. Let r(f) = 188f + 19. Let v(u) = -19m(u) + 10r(u). Let w(y) = 616y*2. Determine v(w(t)). -616t*2 Suppose -6a + a + 4w + 96 = 0, -3w + 36 = 3a. Let y(t) = 16t - at + 31t. Let x(h) be the second derivative of h*4/12 - 2h + 40. Give x(y(j)). 961j2 Let l(b) = 13b*2 + 8807b. Let w(h) = 4h + 239. Give w(l(q)). 52q*2 + 35228q + 239 Let r(f) be the third derivative of 3f5/10 - 2f3/3 - f2. Let k(q) be the second derivative of -q*4/12 + 37q + 783. Determine k(r(s)). -324s4 + 144s*2 - 16 Let n(d) = -55d*2. Let i be 13/(-2) - (-50 + 43). Let y(o) be the first derivative of 0o - 27 + io2. What is n(y(c))? -55c*2 Let u(d) be the first derivative of 63d*2 - 5824. Let p(w) = -2w - 4. What is p(u(t))? -252t - 4 Let v(d) = d2. Let y(l) be the third derivative of -l4/24 - 989l*3/2 + 2652l2 + l. Calculate v(y(h)). h2 + 5934h + 8803089 Let j(h) be the second derivative of 73h*4/4 - 664h. Let u(i) be the third derivative of -i*5/60 - 45i*2. Calculate j(u(w)). 219w*4 Let w(u) = 19u - 130 + 130 + 38u - 12u. Let g(q) = 13q - 7. Let h(p) = 9p - 5. Let d(o) = 5g(o) - 7h(o). Determine w(d(s)). 90s Let t(j) = 53j - 6113. Let m(w) = 7w. What is m(t(a))? 371a - 42791 Let g be 4 - (-4 - (1 + -41)). Let d = -29 - g. Let s(v) = v*2 - 3. Let r(b) = 2b*2 - 8. Let m(j) = dr(j) - 8s(j). Let i(n) = 19n. What is m(i(o))? -722o2 Let p(i) = i2. Let g(l) be the second derivative of -7l*7/360 - 19l*4/12 + 71l. Let u(q) be the third derivative of g(q). What is p(u(z))? 2401z4 Let n(w) be the second derivative of w5/24 + w4/12 + 43w3/6 - w2/2 - 45w. Let d(r) be the second derivative of n(r). Let p(o) = o. Calculate p(d(g)). 5g + 2 Let p(u) = -16924u - 16924u + 50776u - 16930u. Let x(b) be the first derivative of -6b3 + 1. What is p(x(v))? 36v*2 Let x(u) = -3u*2 + 6u*2 - 30u*2 + 36u*2. Let v(z) = -z - 3z - z + 0z. What is x(v(y))? 225y2 Let v(x) = x2. Suppose 164m = 167m - 32958. Let j(l) = 99l2 + 10986 - m. Calculate j(v(s)). 99s*4 Let y(o) be the third derivative of 4o*5/15 - 19o*2. Let c(s) be the first derivative of -2s*2 - 71. What is c(y(l))? -64l2 Let d(p) = p3 - 2p2 - 12p - 15. Let a be d(5). Let b(v) = 5v - 7v + av. Let u(n) = 5n. Determine b(u(q)). -10q Let p(c) = 26c*2. Let l(i) be the first derivative of -19i*2 - 12500. Give p(l(f)). 37544f*2 Let m(y) = 4y. Let j(i) = -9600i2 + 133i - 19. Let d(b) = -3201b2 + 42b - 6. Let s(t) = 19d(t) - 6j(t). What is m(s(o))? -12876o2 Let r(o) = -112o. Let u(f) be the first derivative of 8f3/3 + 288. Calculate u(r(p)). 100352p*2 Let i(t) = -1222t. Let o(m) be the first derivative of -2m2 + 790. Determine i(o(n)). 4888n Let m(z) be the second derivative of -8z3/3 + 22z. Let g(k) be the first derivative of k*2 + 63. Give g(m(h)). -32h Let l(v) = -354v2. Let g(q) = -903q + 28. Let f(h) = 290h - 9. Let c(a) = 28f(a) + 9g(a). Calculate c(l(o)). 2478o*2 Suppose 0 = i - 4, 3x - 8x = 5i - 315. Let s(q) = -48q + 52q + 28q + xq. Let c(b) = -2b2. Determine c(s(o)). -16562o*2 Let i(g) = 79g + 1641. Let d(n) = -4n + 2. Calculate i(d(s)). -316s + 1799 Let v = -3969 + 3969. Let l(k) be the second derivative of 0 - 13/6k4 + 0k*3 + vk*2 + 10k. Let w(p) = p. Calculate w(l(n)). -26n2 Let o(p) = -p - 1. Let s(g) = 103g*2 + 1856g - 3. Calculate s(o(v)). 103v2 - 1650v - 1756 Let l(i) = 36i2. Let g(m) be the second derivative of m5/120 - 17m*3/6 + 95m. Let z(r) be the second derivative of g(r). Determine z(l(h)). 36h2 Let q(h) = -46h*2. Let i = -552 + 581. Let c(z) = 6z + 5z + 20z - iz. What is q(c(x))? -184x*2 Let g(x) = -4x. Suppose w = -3h - 5, -h - 25 = 2h + 5w. Suppose hu = -4u. Let v(f) = 5f + uf - f. What is g(v(z))? -16z Let j(o) = 8o - 2. Let a(c) = 28c + 22c + 13c - 11c - 3c. Calculate j(a(m)). 392m - 2 Let h(r) = 20r - 28. Let k(p) = 10p2 + 13p - 51. Determine k(h(a)). 4000a2 - 10940a + 7425 Let d(o) be the first derivative of -171o3 - 126. Let j(q) = 4q. Give j(d(a)). -2052a2 Let r(m) = -m. Let x(v) = 20504230v. Determine r(x(o)). -20504230o Let j(g) = 4g. Let h(v) = -2v2 + 2784735. Calculate j(h(i)). -8i*2 + 11138940 Let h(j) = -46j*2 - 2j - 1305. Let k(a) = -a + 1. Give k(h(m)). 46m2 + 2m + 1306 Let q(b) = b + 1. Let d(l) = -108l - 135. Let y(a) = -3d(a) - 405q(a). Let h(u) be the third derivative of -u4/24 - 4085u*2. What is h(y(j))? 81j Suppose 2j = -q + 6, 0 = -j + 4j - 6. Let c(t) = -4t2 + 119t*q + 105t*2. Let y(f) = 2f*2. Calculate y(c(l)). 96800l*4 Let p(m) = 8m*2 + m. Let s(k) = -2k - 6. Let h(z) = 96z + 60. Let a(x) = h(x) + 10s(x). Calculate a(p(g)). 608g2 + 76g Let r be 0 + 1 + 171/17. Let m(q) = -q2 + 2q*r + 0q*2. Let x(n) = -257n. Give m(x(t)). 66049t2 Let k(c) = -4c. Let m(p) = 6p2 + 2. Let n be m(-2). Let z = 84 - n. Let w(j) = -49j + zj - 2 + 2. What is w(k(u))? -36u Let g(r) = 245r2. Let t(v) = 14v + 5. Let o be t(0). Let y(z) = oz - 3z + 3z - 6z. What is g(y(u))? 245u2 Let h(g) = -6401536g*2. Let x(y) = -3y*2. Give x(h(t)). -122938989477888t*4 Let u(b) = -29b + 0b + 9b + 15b - 3b + 10b. Let o(g) = 27g + 37g + 54g. Determine o(u(j)). 236j Let b(d) = 348d. Let i(k) = 149k. Let j(r) = 6b(r) - 14i(r). Let z(o) be the second derivative of 3o*4 + o. Calculate j(z(a)). 72a*2 Suppose 2o = -0o + 10. Let n be -1 + 3/(o - 4). Let t(y) = -6y*2 - 3y*2 + ny*2 + 4y*2. Let v(d) = 2d*2. Give t(v(x)). -12x*4 Let n(i) = -3224i*2 + 70i + 1002i2 - 144i + 74i. Let p(m) = 3m*2. Determine p(n(c)). 14811852c*4 Let h(u) = 4u*2 + 12u. Let c(j) = 5j2 + 20j. Let a(w) = -3c(w) + 5h(w). Let g(v) = -23v. Calculate g(a(f)). -115f2 Let h(z) = z2. Let t(o) be the first derivative of o*2/2 + 2299o - 1927. Calculate t(h(d)). d*2 + 2299 Let v(w) = -w - 124. Let k(q) be the second derivative of 2q*4/3 + 4845q - 2. Determine k(v(j)). 8j2 + 1984j + 123008 Let d(q) = -3q + 0q + 2q. Let f be (144/12)/(3/1004). Let n(v) = -f - v + 4016. Determine d(n(h)). h Let p(b) = 2b. Let i(z) = -21470743z2. Give p(i(k)). -42941486k*2 Suppose -5a + 42 = 9a. Let s(m) = m2. Let c(x) = -x2. Let h(d) = ac(d) + 2s(d). Let y(p) = -7p*2 + 7p. Give h(y(w)). -49w4 + 98w*3 - 49w*2 Let o(y) = -7y. Let a(f) = 3f2 - f + 4. Let x(g) = -3686g*2 + 1164g - 4656. Let t(c) = -1164a(c) - x(c). Determine o(t(s)). -1358s*2 Let s(d) = 112d - 1. Let l(y) = 14y2 - 694. Determine l(s(k)). 175616k*2 - 3136k - 680 Let l(n) = n. Let m(p) = -274p - 19. Let r(v) = -67v - 5. Let t(o) = 6m(o) - 25r(o). Determine l(t(u)). 31u + 11 Let t(w) = -11w. Let c(u) = -85979 + 85979 + 1592u2. What is c(t(i))? 192632i*2 Let o(t) = -5t*2 - 35t - 5. Let z(l) = -7l - 1. Let c(n) = o(n) - 5z(n). Let y(h) = -132h. Give y(c(f)). 660f*2 Let d(m) = -363m*2. Let a(q) = -310038q. Give d(a(b)). -34892852804172b2 Let a(l) = 2l. Let t(q) = 3q2 - 6q + 2. Let z be t(2). Suppose 4n = 4i - 64, -n = zi - 0i - 17. Let v(o) = -25o + 14o + io + 21o*2. Give a(v(h)). 42h*2 Let l(m) = -12m + 32. Let s(v) be the first derivative of -v*3/3 - 4450. Give l(s(d)). 12d*2 + 32 Let t(k) = 30k*2. Let f(m) = 48m*2 - 12355 + 24716 - 12361. What is t(f(v))? 69120v*4 Let u(b) = 27b*2. Let i = -395 + 451. Let x(z) = -54z + 160z - iz	{ "pile_set_name": "DM Mathematics" }
. 5 Let v = -29 - -24. Let d be (2 - -2)(-10)/v. Suppose -h - 21 = -dh. Let s(o) = -2o2 + 4o - 1. Give s(h). -7 Let k(b) = -5b2 - 2b - 4. Let v(u) = u*2 - u. Let f(r) = -8r*2 - 8r - 7. Let j(q) = f(q) - 3v(q). Let t(i) = -6j(i) + 13k(i). Give t(-7). 11 Let m be 12/(-4)-1-16. Let s be (-4)/(-12)m/(-2). Let i(w) = 3w2 + sw*2 - 10w*2. Give i(2). 4 Let u(l) = -3l - 4. Suppose -4z - 34 = 4x - 2, 4x + 36 = -2z. Let a = x - -6. Determine u(a). 8 Let y(t) = -4t - 2. Let m(g) = 7g*2 + 7g + 4. Let o(x) = -m(x) - 2y(x). Suppose 3z - 4 = -1. Determine o(z). -6 Let d(q) be the first derivative of 3/2q2 + 0q - 2/3q3 - 1/2q4 - 2. Let k(p) = p3 - p*2. Let g(u) = d(u) + 3k(u). Give g(4). -4 Let t(o) be the second derivative of 0o2 - 16o + 0 + 13/12o4 + 0o*3. Give t(-1). 13 Let s(d) = -3d*3 + 24d*2 - 27d + 12. Let l(f) = 2f2 - f + 3. Let q be l(0). Let t(m) = -m3 + 8m*2 - 9m + 4. Let r(v) = qs(v) - 8t(v). Give r(7). -10 Let t(x) be the first derivative of x*2/2 - 14x + 78. Determine t(10). -4 Let l(k) = k + 10. Let x = -37 - -41. Suppose 5h - xs + 50 = 0, -3h + 2s - 6s = 30. Determine l(h). 0 Suppose 3s - 3 = 27. Suppose -20 = -5d + s. Let o(z) = z3 - 6z2 + z - 8. Calculate o(d). -2 Let r(g) = -g3 + 5g2 + 3g2 - g2 - 4 + 0g2. Let p = -22 - -15. Let i(s) = -s. Let n be i(p). Determine r(n). -4 Let m(w) = -w - 6. Let c(x) = -x2 - 3x - 2. Let p be c(-1). Suppose pn - 4n = n. Calculate m(n). -6 Let p = 8 + -4. Suppose 0 = 3f - 16 + 1. Suppose 5y = -pk + 3, -k + fk + y + 9 = 0. Let s(i) = -3i - 3. Determine s(k). 6 Let s be 1 - (-1 - (-4)/4). Let d(z) = -11z*2 + 2z - 1. Determine d(s). -10 Let y(h) = -h - 1. Let q(x) = -1. Let f(o) = q(o) - y(o). Let g(n) = 3n2 - 5n. Let u(v) = 4f(v) + g(v). Calculate u(-1). 4 Let n(d) = d2 + 1. Suppose 2v + 8 = 12. Let u = v - -8. Suppose 2a - 3c + c = 12, 0 = -5a + c + u. Determine n(a). 2 Suppose -3u = u + 3o - 40, -3u = -o - 17. Let t(h) = -h + 2h - 2 - 6. Determine t(u). -1 Let l(k) be the first derivative of -5k*2/2 + 16k - 519. Calculate l(12). -44 Let b(m) = -4m3 + 2m*2 - 3m + 3. Let o = 59 - 47. Let z(j) = j*2 - 10j - 22. Let t be z(o). What is b(t)? -27 Let l(k) be the second derivative of 10k + 0k*3 - 1/12k*4 + 0 - 2k*2. Let b(w) be the first derivative of l(w). Calculate b(2). -4 Suppose 2u - 3v = -10, 4u - 3v + 20 = v. Let x(b) = -b + 1. Let o(g) = -3g. Let m(s) = o(s) - x(s). Give m(u). 9 Suppose 41 = 3h - 5x, -46 = -h - 3h - 2x. Let l(o) = o*3 - 11o*2 - 13o + 13. Let z be l(h). Let r(c) = c*2 + 0c - 6c2 - c - 2c*2. What is r(z)? -8 Let g = 16 - 10. Let x(i) = -3i - 8 - 5i + 5i. Let s(t) = -t. Let n(f) = gs(f) - x(f). Determine n(6). -10 Let c(x) be the third derivative of x5/60 - x4/8 - 5x*3/6 + 2x*2 - 36x. Determine c(6). 13 Let v(a) = -5a - 8 - 4 - 390a*3 + 2a*2 + 397a*3. Let u(i) = 4i3 + i2 - 3i - 6. Let q(y) = -5u(y) + 3v(y). Calculate q(0). -6 Let y(k) be the second derivative of k3/6 + 5k*2/2 - 5k. Let w = 78 - 72. What is y(w)? 11 Let p(t) be the third derivative of t5/60 + t4/8 - 3t3/2 + 2t*2 - 37t. Determine p(3). 9 Let j(q) = 6q2 + 7q*2 - 26q*2 - 1 + 5q*2 + 8q + 7q2. Calculate j(6). 11 Suppose -16 - 32 = 6k. Let i(a) = a*2 + 12a + 24. Give i(k). -8 Let y(s) = s*2 - 33s + 13. Let t be y(33). Let d(r) = r*3 - 14r*2 + 13r. Give d(t). 0 Suppose 168 = -26w - 248. Let c(x) = x2 + 20x + 16. Calculate c(w). -48 Suppose -3n = t + 5, t = -3n - t - 1. Let j be -3 - -1 - n - 2. Let k(u) = 5u - 4. Let i(p) = 6p - 3. Let q(y) = -3i(y) + 2k(y). Determine q(j). 9 Let s be 4/(1 + -3) - -2. Let z(p) = -p*2 + 2p + 6. Let g(n) = -n3 + n2 - n + 5. Let a(k) = g(k) + z(k). Calculate a(s). 11 Suppose -5j - 5o = -15, 2j - 3j - 2o = -3. Suppose -21 + 0 = -jg. Let d(f) = 2f - 8. Calculate d(g). 6 Let d(a) = -4a*2 - a. Suppose -2k + 19 = -k. Suppose -157 + 137 = n. Let x = n + k. What is d(x)? -3 Suppose -3d = -12, -r - r - 2d = -32. Suppose rs - 1 - 11 = 0. Let t(y) = -4y + 1. Determine t(s). -3 Let a be (-8)/(-16) + (-6)/(-4). Suppose u = -3t - 3, -u + a + 3 = t. Let z(y) = y - 6. Calculate z(u). 3 Let w(v) = -2v - 3. Suppose -11c = -17c - 270. Let u be 33(-40)/c. Calculate w(u). -19 Suppose 4n + 7 = -m, 35 = -5m - 0m + 5n. Let q(b) = -b*2 - 2b + 5. What is q(m)? -30 Let b(j) = 14j3 - j2 + j. Suppose p + 5m - 1 = 0, -2p + 2 = -6m + 9m. What is b(p)? 14 Let i(f) = 9f - 9. Let x(d) = -8d + 8. Let w(l) = -4i(l) - 5x(l). Let z = -7099 - -7103. Give w(z). 12 Let i(u) = 572u*2 - 271u*2 - 277u*2 - 1 - 2u. Give i(-1). 25 Suppose -2i - 2i = 0. Suppose -r - r - p + 6 = i, -5r = 2p - 13. Let u(m) = -3m3 + 2m*2 - 7m*3 + m - 3m*2 + 5 - 6. Give u(r). -11 Let k(v) = 4v + 6. Let q = -181 + 181. Determine k(q). 6 Let t be 40/32-212/(-5). Let f(v) = -v*3 + 5v*2 + 9v - 6. Calculate f(t). 12 Let d(b) be the second derivative of -b3/3 - b2 + b. Suppose -65j = -68j + 15. Determine d(j). -12 Let w(h) be the third derivative of h*5/30 - 7h*4/8 - 2h*3/3 + 161h*2 + 3h. Determine w(11). 7 Let z(c) = 620c - 1246c - 1 + 617c. Give z(4). -37 Let b(f) = f2 + f - 1. Let v(p) = -3p*2 + 10p + 2. Let a(u) = -4b(u) - v(u). Give a(-14). 2 Let y be (100 - 107) + (5 + -1)/(-2). Let u(t) = t + 13. Calculate u(y). 4 Let i(k) = 2k*2 + k + 1. Let g(v) = -2v*2 - 1. Let q(x) = g(x) + 2i(x). Suppose 4p = 4 - 12. What is q(p)? 5 Let i be (-6)/(1 - 0/1). Let x(z) = z3 + 18z2 - z - 16. Let s be x(-18). Let b(w) = -ws + 1 - 7w + w - 7. Calculate b(i). -6 Let s(r) = -r2 - 5r - 3. Suppose 0 = 2p + 2p + 56. Let g = p + 11. Determine s(g). 3 Let d(p) = 4p + 7. Let g = 403 - 407. What is d(g)? -9 Let n(c) = 16c - 1. Let d(b) = -b*2 - 9b + 1. Let t be d(-9). Let h(i) = -i*2 + 4i - 4. Let g be h(t). Give n(g). -17 Let i(f) = -39f - 9. Let k(r) = -21r - 4. Let a(p) = 6i(p) - 11k(p). Give a(-4). 2 Let w be -4 + (0 - -2) - 4. Let v(o) = -o*3 - 6o*2 - 6o - 2. What is v(w)? 34 Suppose -535h + 542h + 28 = 0. Let f(m) be the second derivative of m*3/6 - 3m*2/2 + 2m. Give f(h). -7 Let z(i) = -i*3 - 5i2 + i - 1. Let r(s) = s2 - 2s - 2. Let j be r(-2). Let v(t) = 13 - 4t + jt + t - t. Let y be v(-9). Calculate z(y). -6 Let p(t) = -t3 + 13t*2 + 14t. Let c be p(14). Let y be 1 - (-6)/(-9)-3. Let k(n) = n3 + 33n + 13 - 32n - 2n*y. What is k(c)? 13 Let h(k) = 16k + 9k + 10k*2 + 0 - 11k*2 - 1 - 24k. Suppose -3y = -y + 4. What is h(y)? -7 Suppose -r + 12 = 2g, 2g + 3r = 5r. Let d(s) = -4s*2 + 2s - 5. Give d(g). -61 Let r be (-6 - 1) + -106 + 118. Let x(o) be the third derivative of -10o2 + 2/3o*3 + 0 + 0o - 5/24o4 - 1/60or. Determine x(-5). 4 Let j(n) = -n3 + n*2 - n. Let d = 6 - -3. Suppose 10z - 1 = dz. Calculate j(z). -1 Let h(o) = o + 3o - 3o + 0o - 1. Let a be 40/159/4. Give h(a). 5 Let b(f) = 17f*3 - f + 2. Let g be b(1). Suppose -gk + 23k - 15 = 0. Let n(w) = -w + 3. What is n(k)? 0 Let a(i) = -i3 - 6i2 - 3. Let u(n) be the third derivative of n6/120 - n5/20 - n4/24 - n*3/2 - 4n*2. Let q be u(3). Calculate a(q). -3 Suppose -r - l = 1, -15 = 5r - 2l - 3. Let o(a) = a + 3 + 0 + 7a*2 - 1. Let f(s) = 1. Let x(t) = rf(t) + o(t). What is x(-1)? 6 Let x(s) = 5s - 5. Let a(o) = 4o - 8. Let g(t) = t + 1. Let j(f) = a(f) + 2g(f). Let k(y) = -4j(y) + 5x(y). Let u(c) = c - 1. Let p be u(-2). Give k(p). -4 Let z(i) be the second derivative of i5/20 + 5i*4/12 - 4i*3/3 + 2i*2 + 18i. Calculate z(-6). 16 Let l(k) be the second derivative of -k3/2 + k2/2 - 2k. Let p = -24 - -24. Suppose -4w - 12 + 4 = p. Determine l(w). 7 Let b(u) be the second derivative of -u5/20 + u4/3 - u*3/3 + 3u*2 - 295u. What is b(5)? -29 Suppose 30a + 2 = 29a. Let x(d) = 3d2 - d. Let k(h) = h2 - h. Let z(g) = ak(g) + x(g). Let n(p) = p*2 - 3p. Let f be n(3). Give z(f). 0 Let v be (-2)/1214 + (-6)/9. Let i(q) = 12q - 1. Give i(v). -37 Suppose -19 + 91 = -12i. Let u(q) = q2. Let y(x) = 5x + 4. Let k(m) = -2u(m) - 2y(m). Calculate k(i). -20 Let g	{ "pile_set_name": "DM Mathematics" }
- 41x2 + 169x - 52x2 + 133x*2 to the form dx + ox2 + p and give o. 4 Rearrange (7d - 3d - 2d)(-22d + 7d - 40 + 12d) to yd2 + x + wd and give w. -80 Express ((0 - 4 + 3)(3n + n - 3n) + 3n - 4n + 0n)(1 + 4 - 2 + (0 - 6 + 4)(3 + 0 - 2))(5 - 2 + 1) in the form t + on and give o. -8 Express (-2 + 14 + 23)(s - 4 + 4)(0 + 3 - 1 + (2 + 2 - 3)(-3 + 1 + 3) + 4 + 0 - 2 + 3 - 3 - 3 - 1 + 1 - 9) as ws + r and give w. -245 Express (2 + 6 - 2)(4 + 3 - 4)(-8 - 5x + 8)(-4x + 0x + 3x) as vx + gx2 + h and give g. 90 Rearrange -22t + 1077t2 - 2 - 1077t*2 - 3t*3 to the form yt*2 + nt + w + gt3 and give n. -22 Express -21 - 19m + 46 + 148m - 27 as ym + x and give x. -2 Express 12 + 14 + y*4 + 3y - 20 + 4y2 as vy*3 + b + hy + gy4 + cy*2 and give h. 3 Express 2h + 143h2 + 10h4 - h3 - h*4 - 71h*2 - 71h*2 - 11h*3 in the form vh*4 + jh*3 + mh + t + zh2 and give v. 9 Rearrange (4c*2 + 9c*2 - 10c*2)(-5c - 3c + 3c) + 3c*3 + 3c*3 - 2c*3 to the form x + mc*2 + uc + dc3 and give d. -11 Rearrange -23 - p3 + 3p*2 - 18p - 3p2 + 24p + 27 to o + sp2 + jp + np3 and give s. 0 Express (-11 + 19 + 5)(26 + 20l - 26) in the form b + hl and give h. 260 Rearrange (-2v + 3v - 3v)(5 - 25 - 78) to the form yv + o and give y. 196 Express 6c*3 + 6c*2 + 0c*2 + 1 + 2c2 - c2 - 18c3 in the form t + ac*2 + hc*3 + dc and give t. 1 Rearrange (0 + 0 - i)(-5i + 4i + 2i) + (0 + 0 + 1)(55i*2 - 43i*2 - 137i*2) to ci*2 + b + ui and give c. -126 Rearrange 44l3 - 25l*3 - 17l*3 - 176l*2 to the form wl*2 + ml + r + nl3 and give n. 2 Express (-4 + 4 - 4 + 5)(-k*2 + 0k*2 + 0k*2)(-108k - 5k - 35k) as yk + fk2 + g + sk*3 and give s. 148 Express 2631c + 5c2 - 2617c + 7c2 in the form ic*2 + sc + b and give i. 12 Express -2902c2 - 12c*4 + c + 2906c*2 - c + 3 as qc*3 + jc + f + ac4 + dc*2 and give j. 0 Express 2i*2 + 2i*2 - 3i*2 + (-1 - 2i + 1)(-4i + 2i + i) - i2 + 5i*2 - 2i*2 + 65i*2 - 75i*2 + 404i*2 as mi + ti2 + b and give t. 399 Rearrange -7f*4 - 4 + 8 - 2 - 4f4 - f2 + 21f + 9f*4 to the form cf*4 + uf*2 + jf + o + rf3 and give c. -2 Express (-1 - 3 - 4)(-3k + 4k + 2k) - 140 + 140 - 180k in the form h + fk and give f. -204 Rearrange -2b*2 + 0b*2 + 0b*2 + (3b - 3b - 2b*2)(-1 + 0 + 3) + 2b2 - b2 + 8b2 - b + b2 + 2 - 3 - 2 to the form fb + j + db*2 and give f. -1 Express -358 + 761 + w + 162 in the form s + cw and give c. 1 Rearrange 3i2 - 6i2 + i2 + (-5 - i + 5)(11i - i - 7i) to u + di*2 + pi and give d. -5 Express -7n2 + 0n*2 + 13n + n*2 + 11n + 8n2 in the form cn + hn2 + l and give h. 2 Rearrange -2z - 67 + 1 - 21 + 0z to the form n + gz and give g. -2 Rearrange 3x2 - 3x*3 - x + 5x*3 + 4x*4 + 1 + 4x*3 to u + yx*3 + tx*2 + nx + bx4 and give n. -1 Express -574v*2 - 777v*2 + 1681v*2 as wv + jv2 + q and give j. 330 Rearrange 1 + 4b*3 + 0 + 11b*3 + 4 to jb*2 + qb + db3 + x and give d. 15 Express -j - 5 + 5 + (-25 - 17 + 55)(-27 + 27 + 20j) as rj + b and give b. 0 Express (13 - 13 + 4o3)(-87 - 97 + 194 - 23o) as po + vo3 + go*4 + b + so2 and give v. 40 Express -j3 + 6j4 - 5j + 4j - 6j*2 + 3 + 9j*2 + 0j in the form zj + uj*2 + h + nj*4 + dj*3 and give u. 3 Rearrange 0y*2 + 316y*3 - 1 - 2y*4 - 4y*2 - 245y*3 + 2y*2 + 0 to hy*4 + ay*3 + l + zy*2 + ry and give z. -2 Rearrange y + 2y - 4y + (-1 - y + 1)(-1 + 3 - 1) - 8y + y + 2y + (-76 + 11y + 76)(-1 + 2 + 2) to gy + s and give g. 26 Express -32s2 + 32s*2 + 59s*2 + 37s*2 in the form ts + m + us2 and give u. 96 Express -3231c*2 + 3226c*2 + 137 + 7c - 7c - 2c*3 as nc + ac3 + j + xc*2 and give a. -2 Express (-2i - 3 + 3)(413i*3 + 103i - 412i3 - 13i) as gi2 + pi*3 + bi + ti4 + z and give g. -180 Express (1289s - 893s - 876s)(s + 2s - s) in the form ns + ls*2 + y and give l. -960 Express (-1 - 4 + 2)(536 - 804w - 536) as c + uw and give u. 2412 Rearrange 7x + 3x + 22x3 - 2x*4 - 7x + 0x + 2x*2 to the form ix + dx4 + sx*3 + ox*2 + j and give o. 2 Express 440b*3 + 3b*2 + 445b*3 + 178b - 887b3 - 15b in the form sb2 + fb*3 + ab + k and give a. 163 Rearrange -36z - 35z + 47z to the form i + bz and give b. -24 Express -7g2 + 12 + 0 - 16 + 7 in the form cg*2 + r + ig and give r. 3 Express (-1 + 2u + 1 + (2 + 1 - 4)(4 - 4 - 2u) + 2u + 0 + 0)(5 + 4 + 1) + (4 - 4 + 1)(6u - 2u - 2u) - u + 5u - u in the form z + au and give a. 65 Express 51522b*3 - 2b - 51521b3 + b + b4 in the form db*4 + n + ub + lb2 + sb*3 and give l. 0 Express (70 + 27b - 70)(-6 - 22 + 3) as z + rb and give z. 0 Express -15t - 6t + 87 - 7t + 35t in the form pt + c and give c. 87 Express (8 - 8 - 6o)(-3 - 1 + 2)(-3 + 3 + 1) in the form q + no and give n. 12 Rearrange (t + t - 4t)(51t + 58t - 112t + 160) to the form st2 + v + lt and give v. 0 Rearrange -8a3 + 14a*2 - 62 + 2a*3 + 62 + 9a*3 - a to the form t + ga*2 + ma + ia3 and give m. -1 Rearrange 29g*3 + 15g*2 + 38g*3 - 3 - 2g*4 - 66g*3 to the form v + jg + dg4 + xg*2 + zg*3 and give v. -3 Express 22 + 18 + 17x*2 - 15x*2 + 3 as kx + v + wx2 and give w. 2 Rearrange 53o*3 - 4o*2 - o - 2 + o - 15o*4 - 52o*3 to uo*4 + h + yo*3 + vo*2 + bo and give y. 1 Express (2a2 + 3a*3 - 2a*2)(-2 + 1 - 1)(-1727a + 864a - 7 + 866a) as la4 + n + sa*3 + ra + ja2 and give l. -18 Rearrange (1 - 1 + 2c)(-24 - 8 - 6) + (-2c - 3c + 7c)(6 - 3 - 2) - 3c - 4c + 6c to the form v + yc and give y. -75 Express (2h*3 + 0h*3 + 4h*2 - 2h*2)(-184h + 25308 - 25308) as rh*2 + n + mh*4 + sh*3 + ch and give c. 0 Express 3 - 2y2 + 63y*4 - 27y*4 - 5 - 105y - 35y4 as cy*2 + p + ly + ry4 + ky*3 and give c. -2 Rearrange -21 + 8 - 263d + 10 to the form y + sd and give s. -263 Rearrange 15m - 734 + 734 to the form om + z and give z. 0 Rearrange -2t*4 - 3t - 11t4 + 5t - t*2 + 12t*4 + 2t*3 + 26 to x + bt*4 + vt + at3 + gt*2 and give v. 2 Rearrange (23n + 32n - 13n + 2n - 4n + 0n + (5 - 2 - 1)(-2n + n - n) + 0n - 2n + 0n)(-2 + 2 - 1) to the form d + gn and give g. -34 Rearrange 32436s - 32436s - 131s2 to the form i + ws + ts2 and give t. -131 Rearrange (-4f - 4f + f)(-f*2 + 1643 - 1643 + 40f) to c + jf2 + if*3 + gf and give j. -280 Rearrange (4g - 4g + 4g)(31 + 16 + 1)(g - 3g + 0g) to q + yg + xg2 and give x. -384 Express (i + 0i - 3i)(-2i + 2i + 3i) + 0 + 0 + i2 + (2 - 2 + 2i)(0i + 11i - 14i) in the form ti2 + ki + f and give t. -11 Express 2p - 2p - 815 - p + 2p + p as qp + x and give x. -815 Rearrange -r*4 - 475r + 67r2 - 473r + 0r4 + 949r to cr2 + br*3 + vr*4 + o + fr and give o. 0 Express (-2 - 1 + 2 - 2 - 4 + 2 - 2 - 1 + 4 - 2 + 0 + 4 + 3 - 2 - 3 + (-4 + 1 + 1)(-1 + 2 + 1) - 1 + 2 + 0)(-48j + 27j + 29j) as q + zj and give z. -56 Rearrange -62k2 - 6k*2 - 2 - 55k*2 to i + rk*2 + xk and give x. 0 Rearrange 8v - 8v + v*2 + 3v + 18v3 - v to yv*2 + n + sv*3 + ov and give s. 18 Express (c + 1 - 1)(275c + 1 + 164c - 1) in the form vc + g + sc2 and give s. 439 Rearrange (-3 - 1 - 2)(3l2 + 0l2 - l2) - 14l + 14l - 31l2 to zl + vl2 + q and give v. -43 Rearrange (-y3 + 0y + 0y)(4y - 3y + 3y) - 44y*4 + 38589y*3 - 38589y*3 + 202y*4 to the form k + hy*4 + ny*2 + py + zy3 and give h. 154 Express 340f*3 - 7 - 2f*2 - 332f*3 + 2f*2 as gf + n + kf3 + af*2 and give n. -7 Rearrange (69 + 119 + 160y - 161y)(0y3 + 2y*3 - 3y*3) to the form qy*2 + gy*3 + oy + ay4 + j and give a. 1 Rearrange -6o3 - 5 + o2 - 2o + 5 + 6o to the form ko + u + do*2 + go3 and give d. 1 Rearrange -j3 + 3j2 - 2 + j2 - 3j*2 - 3j2 - j3 to tj2 + fj*3 + yj + v and give t. -2 Rearrange -3715 + 2363 + 12t - 14t to th	{ "pile_set_name": "DM Mathematics" }
ify ((((dd/(d/(d(3/7)/dd))d)/d)/d(-6))32)(-1/28) assuming d is positive. d(-416/49) Simplify ((i(i/i(-30))/i)(-3/5))(-3/28) assuming i is positive. i(279/140) Simplify s*29ssss(-22)ss(s*(-4/5)s)/(s/(((s/(ss30s))/s)/s)) assuming s is positive. s(-109/5) Simplify (s(2/13)s/(ss*(-1))s*(-3/7)((ss(2/3))/ss)/s)(-20/9) assuming s is positive. s(-7600/2457) Simplify (q/((qq(5/6))/q)qq/(q/(qq1)))/(q/(((q/q4q)/q)/q)q*(-15)qq) assuming q is positive. q(67/6) Simplify ((a(11/3))13)(-13) assuming a is positive. a(-1859/3) Simplify (n(-16)n11)/(n(-9/4)/n)19 assuming n is positive. n(227/4) Simplify (w/w(1/3))(5/8)/(w*(-9/7)(w/(w/(ww(1/5))))/w) assuming w is positive. w(631/420) Simplify (h(11/3)(hh(1/12))/hh)/(h*10h(2/33)/h) assuming h is positive. h(-569/132) Simplify (((x/(x/x(-2/3)))/(x/x(-2/7)))/(xxxx(2/3))(-49))(31/3) assuming x is positive. x(38564/21) Simplify ((d(-18))(-2/9))(-4/17) assuming d is positive. d(-16/17) Simplify (uu(-1/4))27(u/(u(-7)/u))/(u/u11) assuming u is positive. u(157/4) Simplify s16/s(-14)s/s*(5/8)s(8/5)/s assuming s is positive. s(1239/40) Simplify rr(2/51)r*(-15)r*(1/4)rr(4/3) assuming r is positive. r(-2321/204) Simplify ((gg*4)/ggg4g(g/g(-1)g)/gg(-3))14 assuming g is positive. g126 Simplify (b/b0b)35/((b/(b(-2)/b))/((b/b*8b)/b)) assuming b is positive. b59 Simplify ((z10z/(((z/z(-23))/z)/z))(-1/7))(-30) assuming z is positive. z(-330/7) Simplify (a/a(-7))7((a/(a*(-9)/a))/a)/(aa*16a) assuming a is positive. a*48 Simplify ((k/((k/(kkk/k(-21/5)))/k)k)/k(-5/9))10 assuming k is positive. k(878/9) Simplify m(2/55)/(mm(-15)/mm)(m(-2/31)/m)(-5/12) assuming m is positive. m(98753/6820) Simplify (pp*(4/13)p)(-33)/(p(-1/8))42 assuming p is positive. p(-3687/52) Simplify (dd(-5/7))(2/23)(d(4/3))49 assuming d is positive. d(31568/483) Simplify (x1/x(-10))/(x(-1))(-21) assuming x is positive. x(-10) Simplify (d*(-4)d)(-5/14)/(d(-3)d)(-12) assuming d is positive. d(-321/14) Simplify ((t19/t)/tt)49/(t(-34)(t2t)/t) assuming t is positive. t914 Simplify v20vv*(1/7)(vvv*15)/(vv(-18)) assuming v is positive. v(386/7) Simplify (u(-5/7))(-20/9)u(4/3)uu/(u16u)u assuming u is positive. u(-698/63) Simplify (((q(-21)/q)/q)/(q/q26))5 assuming q is positive. q10 Simplify (((x(-6)xx)/((x(3/5)xxxx)/x))(-39))(4/15) assuming x is positive. x(1976/25) Simplify (k(-1))(-1/37)(k(3/8))(-13) assuming k is positive. k(-1435/296) Simplify ((z(-1/6))*(3/10)z*(2/17)z/(z*(-2/5)/z)z)27 assuming z is positive. z(31833/340) Simplify (v/(v*(-1/3)/vv))(-2/27)/(v(-2/49)v/v(-1/14)) assuming v is positive. v(-8965/7938) Simplify (d(-1))(-12/19)/(d0)(-2/9) assuming d is positive. d(12/19) Simplify ((n(1/35))(-1/17))(-11) assuming n is positive. n(11/595) Simplify (m/((m/((m(-1/6)/m)/m))/mmm)m/(mmm(-3/7)))/(m(1/10)/m(-1/8)) assuming m is positive. m(-3329/840) Simplify z*5(z/(zz/z(-2)z))/zz/(zz*2)z/z19 assuming z is positive. z(-20) Simplify ((g*(-13)gg/(gg*(-1/24))g)(-2/33))(1/40) assuming g is positive. g(263/15840) Simplify (w(3/17))*14(w/w16)(1/7) assuming w is positive. w*(39/119) Simplify (i/(ii*(-3/11)))/ii*(2/49)ii((i/i*(-4/5))/i)/(ii/((ii(-2/19)i)/i)) assuming i is positive. i*(51629/51205) Simplify ((qq/(q*(-1/18)qqq))20)3 assuming q is positive. q*(-170/3) Simplify ((sss(-2)ss)/s)(-1/15)(s(-1/2))(-17/5) assuming s is positive. s(49/30) Simplify ((d(-2/25)d)/d(-19))(-47) assuming d is positive. d(-23406/25) Simplify (s3)33s*8s/s(2/23) assuming s is positive. s(2482/23) Simplify ((w(-2))(-28)(w(2/11)w)8)(11/5) assuming w is positive. w144 Simplify ((m(2/5)mm8)24)(8/13) assuming m is positive. m(9024/65) Simplify (v*2v(1/20))/((v14v)/v)(-49) assuming v is positive. v(13761/20) Simplify ((aaaa1)(-1/87))(-50) assuming a is positive. a(200/87) Simplify (v/(vv/(vv/v*(-2/3)v)v)(vv(-17))/v)(-25) assuming v is positive. v(1150/3) Simplify (g/(gg1))3/((gg12)/g25) assuming g is positive. g9 Simplify ((b(-1)/b)(12/7)(b(2/5))(7/6))(-6/7) assuming b is positive. b(622/245) Simplify ((a(-7)/(a/(a/a(1/6))))/((a((a/((a/a0)/a))/a)/a)/(aa/a(-5))))(-1/32) assuming a is positive. a(1/192) Simplify ((d/d(-1)d(-3))/(d3d6))(-6/23) assuming d is positive. d(60/23) Simplify (t(-6)/tt)/(t(t/(t(t/((t(4/7)/tt)/tt))/tt))/t)(t/t(-1))(-32) assuming t is positive. t(-487/7) Simplify (h9h/h*(-4/11))/((hh(1/2))/h(-1/3)) assuming h is positive. h*(563/66) Simplify (mm/((m*(-16)m)/m))/(mm(-12))(m/(m/(m(-4/7)/m)))/m(-1/2) assuming m is positive. m(391/14) Simplify ((j/j(2/13)j(2/3)j)/((jj(-2/7))/(j(1/2)j)))(-14/11) assuming j is positive. j(-1801/429) Simplify (i(-3/8))(17/2)ii*(-1/40)/ii(-20) assuming i is positive. i(-1857/80) Simplify (h(-2))(-30)/((h/(hh(-1/6)h))/h(-5)) assuming h is positive. h(335/6) Simplify (((l/l*(1/9)ll)/l)/(l(2/5)l))/((l(-20)/l)/l(10/13)) assuming l is positive. l*(13021/585) Simplify (qq(q(1/5)/q)/q)(2/3)q*(-15)/(q/(qq*(6/11)q)) assuming q is positive. q(-2198/165) Simplify ((u(2/7))(-2/17))(-20) assuming u is positive. u*(80/119) Simplify (hh*3h)/(hh(-10)h)((h/(((h/(h/(hh*0)h))/h)/h)h)/h)5 assuming h is positive. h28 Simplify (((dd(-20))/d(3/7))(19/4))0 assuming d is positive. 1 Simplify (aaa/(aa(-3/2))a/(a/(aa((a/(a/a*(-2/19)))/aa)/a))a)/(a/(aa(-1/6)))14 assuming a is positive. a(349/114) Simplify (x(8/7)(((xx*(16/7)x)/xxx)/x)/x)/(x(-2/3)/x0) assuming x is positive. x(107/21) Simplify (v(-28/9)/v*(1/13))/(v/(((vv*(-2/55)v)/v)/v)v(-2/23)) assuming v is positive. v(-612362/148005) Simplify ((q/(q(1/5)/q))0/((q(-5)/q)/(q/((qq*(3/11)q)/q)q)))(-35) assuming q is positive. q(-2590/11) Simplify ((s/(s((s*(1/2)s)/s)/s)s(ss/s6)/s)/(ss*(-1/3)s*(-2/3)ss))4 assuming s is positive. s(-22) Simplify ((ii(2/11))/i11)/(ii(-14))(1/7) assuming i is positive. i(-613/77) Simplify (i(1/4))(-1/14)(i/((i(i(2/5)/i)/ii)/i))(2/13) assuming i is positive. i(831/3640) Simplify ((gg(-1/11)/gg)/g7)/(g(-1/3)gg/(g/(g((g(1/14)gg)/g)/g))) assuming g is positive. g(-3617/462) Simplify (q/q(1/11)q)/q*(-9)q/(q*(-2)/q)qq(-6) assuming q is positive. q(109/11) Simplify a(-10/9)a/(a*(-22)aa)(a(-6/5))(7/10) assuming a is positive. a(4286/225) Simplify ((d(-3)/d)/((d/(d*(-7)dd))/d)d(-1/3)/d(1/10))(3/11) assuming d is positive. d(-283/110) Simplify (r(2/5)/r(-3/5)r(2/11)rr(-5)/rr)29 assuming r is positive. r(-899/11) Simplify i*(1/29)ii(2/17)/ii(ii26)/i(7/4) assuming i is positive. i*(52065/1972) Simplify ww*(-3/2)ww(-23)(wwww(-2/23)w)/(w/w13) assuming w is positive. w(-303/46) Simplify (x/x(-1/4))4/(x/((x/x2)/x))(-4/7) assuming x is positive. x(47/7) Simplify (x(1/6)(x(-9)/x)/x)/(x(2/5)/(xx/x*(1/11)x)) assuming x is positive. x(-2747/330) Simplify ((((m6/m)/mm)/m)/(((m((((m/((m*27m)/m))/m)/m)/mm)/m)/m)/m))/(m(-11)/(m9/mm)) assuming m is positive. m54 Simplify (c38/((ccc*(3/19))/c))/((((ccc/(cc*(8/5)/cc))/c)/c)/c)(-19/4) assuming c is positive. c(9307/380) Simplify w*(-5/2)wwww/w6www/w*(-1/13)w(-16) assuming w is positive. w(-453/26) Simplify ((p/(p/(p/(pp/(p/(p(-2/3)/p))))))/(p/p(-6/11)))/((p/(p((pp/p(-1/2))/p)/p))/(p(1/4)/p)) assuming p is positive. p(-17/132) Simplify (n(-2/15)/(n6/n))/((n/(nnnnn11/nnnnn))/n(-8/3)) assuming n is positive. n(46/5) Simplify (h(2/3)h)/hh0(h*15/h)/hh10 assuming h is positive. h(71/3) Simplify ((ggg*1g*(-2)g)*2)	{ "pile_set_name": "DM Mathematics" }
Let s(f) = -6f - 8. Determine s(-2). 4 Let r(y) = y2 - 9y - 9. What is r(13)? 43 Let c(u) = -u*2 + 10u - 20. Calculate c(9). -11 Let w(u) = 4u2 - 12u - 6. Calculate w(6). 66 Let q(o) = -4o + 103. Give q(23). 11 Let u(f) = -f3 + 7f*2 + 8f - 14. Give u(8). -14 Let f(d) = 5d2 + 3d + 1. Give f(-2). 15 Let w(h) = h*2 + 19h + 8. What is w(-15)? -52 Let y(o) = -o*2 + 6o - 6. Determine y(3). 3 Let d(r) = 21r + 5. What is d(3)? 68 Let j(y) = 2y*2 + y + 6. Give j(-3). 21 Let b(c) = -2c*3 - 2c*2 - 4c - 3. Give b(-2). 13 Let n(k) = -4k2 + 38k + 33. Calculate n(10). 13 Let f(i) = 7i + 2. What is f(-4)? -26 Let m(c) = -c2 + 12c - 24. What is m(11)? -13 Let l(g) = 6g + 132. Calculate l(-22). 0 Let r(m) = -102m - 397. Calculate r(-4). 11 Let c(s) = -2s2 + 18s - 13. Calculate c(7). 15 Let v(x) = x*2 - 14x + 61. Determine v(6). 13 Let h(v) = -v*2 + 30v - 31. Determine h(29). -2 Let t(z) = -8z - 8. Determine t(-2). 8 Let m(f) = -f - 15. Determine m(-6). -9 Let h(j) = 2j - 11. Calculate h(-2). -15 Let f(b) = -b*2 - 17b - 20. Calculate f(-9). 52 Let j(u) = -5u + 43. What is j(9)? -2 Let o(g) = -2g*3 - 2g*2 + 3g - 3. What is o(1)? -4 Let l(n) = 2n2 + 29n + 21. Determine l(-14). 7 Let c(f) = 2f + 28. Determine c(-10). 8 Let q(v) = -3v*2 - 6v. Calculate q(-4). -24 Let f(w) = w*2 + 6w - 83. Determine f(0). -83 Let h(p) = -p*2 + 14p - 6. Calculate h(14). -6 Let a(h) = -h*2 - 6h - 2. Determine a(-5). 3 Let r(p) = -4p - 46. What is r(-5)? -26 Let i(s) = -s - 7. Calculate i(4). -11 Let d(z) = -z3 + 11z*2 - 19z + 1. Calculate d(9). -8 Let h(f) = f*3 - 12f*2 - 11f + 16. What is h(13)? 42 Let t(b) = 48b + 797. What is t(-17)? -19 Let d(c) = -c3 - 15c*2 + 36c + 44. Calculate d(-17). 10 Let x(d) = -d*3 - 35d*2 + 36d + 1. Calculate x(-36). 1 Let o(p) = -p*2 + 7p - 1. What is o(5)? 9 Let s(z) = -8z - 2. Calculate s(-1). 6 Let r(z) = 3z*2 + 4z - 5. Give r(0). -5 Let a(x) = x*3 + 4x*2 + 4. Give a(-3). 13 Let s(c) = c - 4. Calculate s(-7). -11 Let u(k) = 12k - 9. Calculate u(1). 3 Let k(v) = -v*2 + 10v - 11. Give k(8). 5 Let l(h) = 6h + 75. What is l(-13)? -3 Let n(w) = w2 - 12w - 11. Determine n(9). -38 Let h(v) = 6v + 112. What is h(-25)? -38 Let w(v) = -3v - 13. Give w(9). -40 Let h(j) = 4j + 63. Give h(-17). -5 Let a(y) = -y3 + 8y*2 - 8y + 4. Calculate a(7). -3 Let l(u) = u - 20. What is l(15)? -5 Let j(d) = -3d2 + 2d + 5. Calculate j(3). -16 Let q(k) = k*2 + 5k + 6. Determine q(8). 110 Let v(l) = 7l3. Calculate v(-1). -7 Let z(l) = -l2 + 4l - 6. Determine z(2). -2 Let u(t) = t*3 + 3t + 5. Determine u(0). 5 Let x(u) = u*3 - 16u*2 + 14u + 13. Calculate x(15). -2 Let l(c) = c*2 - 30c + 87. Calculate l(27). 6 Let t(i) = -i*2 - 8i + 13. Determine t(-10). -7 Let q(g) = -g*2 + 7g + 9. Calculate q(11). -35 Let c(m) = 6m2 + 25m. What is c(-4)? -4 Let v(i) = -3i + 17. Give v(-5). 32 Let u(r) = -r3 + 14r*2 + 22r - 42. Determine u(15). 63 Let r(c) = c*3 - 8c*2 - 10c - 3. Calculate r(9). -12 Let f(t) = -t*3 + 13t*2 - 9t + 32. Calculate f(10). 242 Let z(q) = q*3 + 8q*2 + 5q + 47. Determine z(-8). 7 Let v(s) = 42s + 132. Determine v(-3). 6 Let w(m) = -m2 - 18m + 3. What is w(-19)? -16 Let b(q) = q*3 + 2q*2 - 72q - 221. Give b(-3). -14 Let r(m) = 16m + 3. Give r(-3). -45 Let s(d) = -8d - 39. Calculate s(-3). -15 Let t(h) = 5h3 + h2 + 2h + 1. What is t(2)? 49 Let b(i) = i*3 + 8i*2 + 4i + 7. Give b(-8). -25 Let l(w) = -5w2 - 15w + 1. Calculate l(-3). 1 Let l(a) = -2a2 + 13a - 10. Give l(6). -4 Let h(z) = 7z - 93. Give h(11). -16 Let l(y) = -y - 2. Calculate l(-11). 9 Let w(i) = -i3 - 7i*2 + 9i + 8. Calculate w(-8). 0 Let j(g) = -g*3 + 8g*2 - 4g - 16. Give j(7). 5 Let j(w) = 3w2 + 5w - 1. Give j(-3). 11 Let l(b) = 5b2 - 5b. Give l(4). 60 Let f(b) = -b*2 + 7b - 3. Determine f(7). -3 Let x(s) = 5s - 34. Calculate x(6). -4 Let x(z) = 14z - 46. Determine x(10). 94 Let k(n) = -22n + 968. What is k(44)? 0 Let k(f) = f3 - 9f*2 + 23f + 6. Give k(4). 18 Let o(s) = 3s - 134. Give o(30). -44 Let a(b) = b3 - 34b*2 + 64b - 1. Give a(32). -1 Let n(v) = 3v2 + 20v + 2. What is n(-7)? 9 Let a(g) = 2g - 19. What is a(9)? -1 Let s(t) = -3t3 - t2 + 4t + 5. Give s(-2). 17 Let g(s) = s3 - 13s*2 + 21s + 7. Give g(11). -4 Let x(y) = y*3 - 9y*2 - 52y - 5. Determine x(13). -5 Let n(z) = z*3 - 2z*2 - 4z - 2. What is n(5)? 53 Let s(c) = 31c - 36. Calculate s(1). -5 Let f(w) = 3w + 12. Determine f(-13). -27 Let t(u) = u + 16. What is t(-10)? 6 Let v(m) = -2m - 10. Determine v(0). -10 Let c(d) = -d3 + 7d*2 - 11d + 20. Give c(6). -10 Let y(v) = -2v3 - 2v2 - v - 2. What is y(-2)? 8 Let n(r) = -r3 - 2r2 + 2r. Determine n(-3). 3 Let b(j) = -j*3 - 27j*2 - 3j - 75. Give b(-27). 6 Let k(y) = y + 6. Calculate k(-11). -5 Let c(q) = 9q2 - 3. Calculate c(-2). 33 Let j(f) = -f2 - 52f + 346. Calculate j(6). -2 Let w(r) = -r*3 - 7r2 - 1. Calculate w(-7). -1 Let h(v) = -v3 + 11v2 + 17v - 52. Calculate h(12). 8 Let i(x) = x*2 - 28x + 51. What is i(25)? -24 Let x(q) = q*2 - 12q + 16. Determine x(7). -19 Let v(b) = b*3 - 22b*2 - 23b + 8. What is v(23)? 8 Let i(r) = -r*3 + 15r*2 + 17r - 27. Determine i(16). -11 Let j(r) = r*3 + 8r*2 + 11r - 4. What is j(-6)? 2 Let d(m) = m*3 - 9m*2 + 7m - 5. What is d(9)? 58 Let x(d) = -d*2 + 22d - 13. Calculate x(13). 104 Let i(j) = -2j - 22. Calculate i(3). -28 Let n(k) = k3 + 10k*2 + 15k - 9. Give n(-8). -1 Let a(o) = 7o2 - 168o - 169. Give a(-1). 6 Let q(g) = g*3 - 9g2 - g - 5. Calculate q(9). -14 Let q(g) = -g2 + 8g + 14. What is q(9)? 5 Let k(t) = -21t - 195. Give k(-10). 15 Let v(o) = 11o + 4. Determine v(-2). -18 Let c(s) = -81s3 - s2 + 2s - 2. Give c(1). -82 Let a(n) = 4n*2 + 8n - 9. Determine a(-5). 51 Let o(h) = -h*3 + 11h*2 + h - 2. Give o(11). 9 Let r(k) = 7k - 8. Determine r(6). 34 Let x(w) = -3w2 + 27w - 58. Give x(5). 2 Let a(c) = -2c2 - 58c + 119. Give a(-31). -5 Let x(w) = w*2 - 4w - 44. Determine x(8). -12 Let r(j) = -4j - 3. Calculate r(-5). 17 Let c(b) = -19b - 26. What is c(-1)? -7 Let x(a) = a*3 - 5a*2 + 6a - 2. What is x(4)? 6 Let l(i) = -4i + 85. Calculate l(20). 5 Let r(p) = -p3 + 8p*2 - 7p + 5. Calculate r(7). 5 Let j(v) = -v*3 - 35v*2 - 34v - 5. Calculate j(-34). -5 Let i(u) = -u*3 - 17u*2 + 21u + 48. Calculate i(-18). -6 Let y(c) = c*2 + 23c - 10. What is y(-23)? -10 Let d(k) = 2k2 + k - 3. What is d(3)? 18 Let v(y) = y3 + 23y*2 - 25y - 37. Calculate v(-24). -13 Let p(c) = 17c + 17. Calculate p(-7). -102 Let f(k) = 3k - 26. Calculate f(7). -5 Let j(d) = 13d + 165. Give j(-13). -4 Let s(m) = -37m - 147. Give s(-4). 1 Let p(w) = 6w - 9. Calculate p(-7). -51 Let u(f) = f3 - f + 4. Calculate u(2). 10 Let g(j) = 2j*3 + 9j*2 - 28j - 136. Determine g(-4). -8 Let i(b) = b*2 + 5. Determine i(11). 126 Let m(j) = -2j - 13. Determine m(-5). -3 Let x(p) = 2p2 - p - 8. Determine x(0). -8 Let p(j) = 5j + 10. Calculate p(-8). -30 Let k(j) = -19j + 73. Give k(4). -3 Let d(u) = -5u + 7. Calculate d(1). 2 Let y(h) = -8h + 15. What is y(7)? -41 Let v(c) = c2 - c + 7. Determine v(0). 7 Let n(s) = -17s + 363. Give n(21). 6 Let u(j) = j*3 - 35j*2 + 285j + 25. Determine u(22). 3 Let u(a) = -6a - 20. What is u(-4)? 4 Let w(z) = -z2 - 8z + 33. Determine w(-10). 13 Let p(l) = l - 27. Determine p(17). -10 Let r(o) = 2o + 3. What is r(-12)? -21 Let f(z) = -z2 - 33z + 38. What is f(-34)? 4 Let u(i) = 4i2 - 8i + 4. What is u(1)? 0 Let k(t) = 26t - 11. Calculate k(-5). -141 Let q(j) = 3j*3 - 2j2 + j + 2. Determine q(-1). -4 Let v(t) = -t2 + 4t + 3. Calculate v(6). -9 Let c(g) = -g2 - g + 41. What is c(6)? -1 Let c(g) = -g3 - 7g2 - g - 10. Give c(-7). -3 Let v(j) = j3 - 6j2 - 3j + 9. Determine v(5). -31 Let h(d) = -d*3 + 5d*2 + 18d - 4. Give h(7). 24 Let l(a) = -a*2 + 8a + 20. Determine l(-5). -45 Let u(m) = m*2 + 11m - 8. Determine u(-12). 4 Let l(u) = -39u. Calculate l(2). -78 Let b(f) = 3f + 27. What is b(-9)? 0 Let f(a) = a**2 - a - 4. Give f(4). 8 Let a(q)	{ "pile_set_name": "DM Mathematics" }
) = 47b2 - 34b + 11. Let w(a) = jt(a) + 11n(a). What is the second derivative of w(g) wrt g? -36 Let b(r) = -12r3 + 10r*2 - 3r + 2. Let c(s) = -12s3 + 11s*2 - 4s + 3. Let k(j) = 4b(j) - 3c(j). Find the third derivative of k(v) wrt v. -72 Let j(d) be the second derivative of -1/3d3 + 0d*5 - 3d + 0d6 + 5/21d*7 + 0d*2 + 0d*4 + 0. Find the second derivative of j(p) wrt p. 200p3 Let n(z) = -z2 + 15z - 51. Let x be n(6). Find the second derivative of -17j + 35jx - 67j*3 + 32j*3 - 35j*4 wrt j. -420j2 Let x(b) be the second derivative of -b6/5 - 9b5/20 + b3/3 + 26b*2 + 2b - 163. Find the second derivative of x(l) wrt l. -72l2 - 54l Let h = 39 + -35. Find the third derivative of 727bh - 744b*4 + 20b*2 + 4b - 4b wrt b. -408b Let f(y) be the first derivative of -y5/10 - y3/2 + 5y - 6. Let d(r) be the first derivative of f(r). What is the second derivative of d(w) wrt w? -12w Let c(j) = j - 1. Let s be c(3). Suppose -3k - 18 = -sd + 2k, 2d + 2k - 18 = 0. Differentiate 23 - 10 - dq*4 - 4 with respect to q. -36q3 Let j(c) = -c2 - 5c + 1. Let l(o) = -8o*2 + 156o + 640. Let w(s) = -6j(s) + l(s). Find the first derivative of w(n) wrt n. -4n + 186 Find the third derivative of 1669j3 + 19j*2 + 17j*2 - 1748j*3 + 4j wrt j. -474 Find the second derivative of -17c - 7c*4 + 70c*4 + 26c*4 wrt c. 1068c*2 Let f(x) be the second derivative of 13x*2 - 9x + 16/3x3 + 0. Find the first derivative of f(s) wrt s. 32 Let z(b) = 131b*3 - 9b*2 + 15. Let s(u) = 65u*3 - 4u*2 + 9. Let w(a) = 13s(a) - 6z(a). What is the derivative of w(d) wrt d? 177d*2 + 4d Let c(i) = 15i + 4. Let y(l) = 4 + 1 - 3 + 0l + 8l. Let k(x) = -3c(x) + 7y(x). Find the first derivative of k(d) wrt d. 11 Let d(c) be the first derivative of c3 + c2 + 3c - 403. Let y(f) = f. Let v = 3 - 0. Let b(l) = vd(l) - 6y(l). Differentiate b(i) wrt i. 18i Let k(i) = 5i*4 + 4i*3 + 2i*2 + i - 8. Let g(s) = -2s4 - s3 - s*2 - s. Let j(t) = 2g(t) + k(t). Find the second derivative of j(b) wrt b. 12b2 + 12b Let j(l) = -23l3 - 4l*2 + 7l + 1. Let q(v) = 48v3 + 7v*2 - 13v - 1. Let a(s) = -7j(s) - 4q(s). What is the second derivative of a(c) wrt c? -186c Let a(z) = -11z*3 - 137z*2 + 822z - 4. Let i(b) = 3b3 - 2b*2 - b + 1. Let s(w) = -a(w) - 4i(w). What is the second derivative of s(p) wrt p? -6p + 290 What is the third derivative of 13h*3 + 25h*4 - 28h*2 + 12h*3 - 23h4 - h2 wrt h? 48h + 150 Let t(y) = -26y4 + y3 - 6y2 - y + 422. Let u(r) = r3 + r2 - r. Let s(c) = t(c) - u(c). Differentiate s(l) wrt l. -104l*3 - 14l Let m(p) be the third derivative of 0p3 + 4p*2 + 0 - 1/15p*5 - 7/24p*4 + 0p. Find the second derivative of m(y) wrt y. -8 Let y(q) = -6q6 - 8q*5 - 8q*3 - 319q*2 + 8q. Let d(n) = -2n3 + n2 + 2n. Let z(h) = -4d(h) + y(h). Find the third derivative of z(x) wrt x. -720x*3 - 480x*2 Let u(k) be the second derivative of 0k*3 + 0 + 0k*5 + 0k*2 - 1/2k*4 - 13/30k*6 - 2k. Find the third derivative of u(g) wrt g. -312g Let y(k) = k2 - 2k - 5. Let u be y(4). Let f(q) be the first derivative of -q*4 - 2q*u + 5q + 2q3 + 1 - 3. Differentiate f(h) with respect to h. -12h*2 What is the second derivative of -296r + 30r2 + 33r*2 + 145r*2 wrt r? 416 Let m(g) = -g + 12. Let t be m(0). Suppose -2j - j + t = 0. Find the second derivative of -5h3 + jh*3 + 5h5 + h3 - 4h wrt h. 100h*3 Let i(l) be the third derivative of 19l*6/15 - 77l*3/6 - 2l*2 + 10l. Differentiate i(h) wrt h. 456h2 What is the second derivative of -26i - 94i5 - 107i*5 - 81i*5 - 49i wrt i? -5640i3 What is the second derivative of 13d*2 - 4d - 31 - 25d2 + 12d*2 + 2d + 114d3 wrt d? 684d Let b(h) be the third derivative of 11h7/70 + h4/24 - 17h*3/6 + 100h*2. What is the first derivative of b(w) wrt w? 132w*3 + 1 What is the first derivative of -44a + a - 11 - 139 + 48a - 87a wrt a? -82 Find the second derivative of 271y + 68y*4 - 387y4 + y4 wrt y. -3816y2 Let y = 53 - 47. What is the second derivative of -ya3 - a3 + 0a + 12a wrt a? -42a Let t = 20 - 11. Let i = -43 - -47. What is the first derivative of ty*3 + 5 - 13y*i - 9y*3 + 5 wrt y? -52y*3 Let w(x) be the first derivative of 77x*6/3 - 2x*3/3 + 47x + 118. What is the third derivative of w(h) wrt h? 9240h2 Let t(i) = i3 + 13i*2 - i - 9. Let g be t(-13). Find the second derivative of 14b - 4b + 11b - 22bg wrt b. -264b*2 Suppose 0 = 4k - 3 + 15. Let x be k/5 + 46/10. What is the second derivative of 20z - 6z + 8z4 - 4z*4 - 5z*x wrt z? -12z*2 Let z(k) = -2k + 23. Let m be z(-9). Find the third derivative of -mw2 - 2133w + 2133w - 37w*4 wrt w. -888w Suppose 5w - 54 = -19. What is the third derivative of -10u*2 - 34u*5 - 2u*6 + 34u*5 - wu*2 wrt u? -240u*3 Let p(f) = 2f*2 - 5f + 3. Let j be p(3). Suppose -96s = -97s. What is the derivative of v*2 + 0v*2 - jv*2 + s - 6 wrt v? -10v Suppose -56 = -b - 56. Let y(h) be the first derivative of 0h5 + 3 + bh*2 + 4/3h*3 - 1/2h*6 + 0h*4 + 0h. Find the third derivative of y(s) wrt s. -180s2 Let z(y) be the second derivative of 0 - 10/3y*4 + 16y - 6/5y5 + 0y*3 + 0y*2. What is the third derivative of z(f) wrt f? -144 Find the first derivative of -11t*4 - 14t*4 + 23t*4 - 118t + 35 + 15t + 117 wrt t. -8t*3 - 103 What is the third derivative of 297b*2 + 23b*2 + 4b*4 + 74b*2 + 14b*5 wrt b? 840b*2 + 96b Let x(d) be the first derivative of -5d6/6 - 33d*2/2 + 3d - 668. Find the second derivative of x(u) wrt u. -100u3 Suppose -3i + 9i = 18. Differentiate 165 - 149 + 10m3 + mi with respect to m. 33m2 Suppose 63 = 2k + 7k. What is the third derivative of -kt*2 + 0t*2 + 2t*4 - 13t*4 - 6t*4 wrt t? -408t Let r(a) = 1417a3 - a2 - 1586a - 7. Let h(x) = 472x3 - 529x - 2. Let p(k) = 7h(k) - 2r(k). Find the third derivative of p(m) wrt m. 2820 Let j(n) = -107n + 56. Let b(a) = 53a - 28. Let f(p) = 21b(p) + 9j(p). Differentiate f(g) wrt g. 150 Let n(k) be the first derivative of -1 + 2k + 19/3k*3 + 3k*2. What is the second derivative of n(h) wrt h? 38 Let i(v) be the first derivative of -26 + 0v*5 + 8/7v*7 + 0v*4 + 0v*6 + 0v*2 - 13/3v*3 + 0v. What is the third derivative of i(r) wrt r? 960r3 Suppose -2q = m - 2, 6m - m = 4q + 38. What is the second derivative of -4s4 + 7s*4 + ms - 10s4 - 3s*4 wrt s? -120s*2 Let t(c) = 4c*4 + 11c*3 - 3c2 - 106. Let r(f) = -f3 - f*2 + 1. Let z(m) = 3r(m) - t(m). Differentiate z(l) wrt l. -16l3 - 42l*2 Let v(w) be the third derivative of -34w*6/15 - 46w*5/3 - 3w*2 + 183w. What is the third derivative of v(q) wrt q? -1632 Let q(c) be the first derivative of 0c + 0c*3 - 7/2c*2 - 1 + 7/2c*4. What is the second derivative of q(p) wrt p? 84p Let h(p) be the second derivative of -79p3/6 - 38p*2 + 75p - 1. What is the first derivative of h(l) wrt l? -79 Let f(l) = 101l2 - 5l - 141. Let x(a) = -a*2 - a - 6. Let p(i) = f(i) - 4x(i). Find the second derivative of p(d) wrt d. 210 Suppose 3p - 13 = -1. Let q be 5/((-35)/(-12)) + (-2)/(-7). Find the third derivative of pr*5 + 3r5 - r2 - 6r2 - rq wrt r. 420r*2 What is the second derivative of 21m + 4 - 99m + 753m*2 + 322m - 4 wrt m? 1506 Let a(r) be the third derivative of -7/3r3 + 0 + 0r + 3/8r4 - 15r2. What is the first derivative of a(m) wrt m? 9 Let l(k) = -k4 + k*3 - k. Let r(j) = -3j*4 + 5j*3 - 4j + 16. Let c(b) = -5l(b) + r(b). Differentiate c(w) with respect to w. 8w*3 + 1 Let i(g) be the third derivative of 1/6g*5 - 4g*2 + 0 + 0g*4 - 7/6g*3 + 0g. What is the first derivative of i(v) wrt v? 20v Find the third derivative of 43d*5 + 24d*2 + 11d + 3d3 - 14d - 11d5 wrt d. 1920d*2 + 18 Let y(u) be the first derivative of -353u*3/3 + 212u*2 + 206. What is the second derivative of y(p) wrt p? -706 Let v(n) = -607n*2 + 229n + 21. Let r(g) = -607g2 + 229g + 18. Le	{ "pile_set_name": "DM Mathematics" }
-2, 312 Solve -o*3/4 - 2011o*2/4 + 23119o - 22616 = 0 for o. -2056, 1, 44 Factor -5m4 - 260m*3 + 3295m*2 + 12090m. -5m(m - 13)(m + 3)(m + 62) Factor -5r3 - 170r*2 + 1435r. -5r(r - 7)(r + 41) Find b such that -b5/3 + 44b*4 + 45b*3 - 266b*2/3 = 0. -2, 0, 1, 133 Determine f, given that -5f*4 + 165f*3 + 4470f*2 + 6760f - 32640 = 0. -16, -4, 2, 51 Factor 21l3 + 12909l*2 + 110844l - 32724. 3(l + 9)(l + 606)(7l - 2) Factor -4z2/5 + 73z/5 + 356/5. -(z + 4)(4z - 89)/5 Let r*4/3 + 121r*3/3 - 56r*2 - 5692r/3 - 9760/3 = 0. What is r? -122, -5, -2, 8 Factor -3z2/7 - 3015z/7 - 29850/7. -3(z + 10)(z + 995)/7 Determine x, given that 2x4/9 - 34x*3 + 4780x*2/9 + 1200x = 0. -2, 0, 20, 135 Find i, given that i*2/8 - 17i/4 - 287/8 = 0. -7, 41 Determine z, given that 4z2 + 3098z - 1550 = 0. -775, 1/2 Factor 3y2/2 + 1281y/2 + 40014. 3(y + 76)(y + 351)/2 Solve -2d2/9 - 153482d/9 - 306940/3 = 0. -76735, -6 Factor 57i2 + 72270i - 7608. 3(i + 1268)(19i - 2) Factor -3j*2 + 131520j - 1441459200. -3(j - 21920)2 Suppose 2w*5/9 + 10w*4/9 - 1036w*3/3 - 66088w*2/9 - 311696w/9 = 0. Calculate w. -22, -7, 0, 46 Factor 2u3 + 16u*2 - 3746u - 3760. 2(u - 40)(u + 1)(u + 47) Factor -2k*2/17 - 2266k/17 + 181200/17. -2(k - 75)(k + 1208)/17 Factor -2j2/11 - 356j/11 - 15834/11. -2(j + 87)(j + 91)/11 Factor -17h3 - 2459h*2 - 2442h. -h(h + 1)(17h + 2442) Suppose 3u*4 - 2919u*3 + 737067u*2 - 13066461u + 23207958 = 0. Calculate u. 2, 17, 477 Suppose n*4/4 - 163n*3/4 + 477n*2/2 - 473n + 314 = 0. What is n? 2, 157 Factor 4l3/7 + 816l*2/7 + 788l/7 - 696. 4(l - 2)(l + 3)(l + 203)/7 Factor -a3 - 8281a*2 + 33140a. -a(a - 4)(a + 8285) Factor v*3/4 - 51v*2/2 + 188v. v(v - 94)(v - 8)/4 Solve 12c5 - 1592c*4/7 - 5036c*3/7 + 31712c*2/7 - 38608c/7 + 1920 = 0 for c. -40/7, 2/3, 1, 2, 21 Factor -3k2 - 1204248k. -3k(k + 401416) Let 2g4 + 310g*3 - 28430g*2 - 87430g - 58692 = 0. What is g? -219, -2, -1, 67 Let -4j2 + 3384j - 33440 = 0. Calculate j. 10, 836 Let -4d4/3 - 192022d*3/9 - 53336d*2/3 + 32002d/9 = 0. What is d? -16001, -1, 0, 1/6 Suppose -q*3/4 - 138q*2 - 545q/4 + 1653/2 = 0. Calculate q. -551, -3, 2 Determine h so that -3249h3 - 1325364h*2 + 93020h - 1632 = 0. -408, 2/57 Find t such that 2t2/7 - 145442t/7 + 145440/7 = 0. 1, 72720 Factor 3r5 + 51r*4 + 180r*3 - 768r*2 - 3840r. 3r(r - 4)(r + 5)(r + 8)2 What is x in x4/3 - 202x3 + 95372x*2/3 - 359766x + 1029105 = 0? 5, 7, 297 Determine x, given that -2x2/9 - 468x + 1406 = 0. -2109, 3 Suppose -2a4 + 20284a*3 - 51450362a*2 + 102839880a - 51409800 = 0. Calculate a. 1, 5070 Suppose -w*4/4 + 1395w*3/4 - 582963w*2/4 + 63504961w/4 = 0. What is w? 0, 169, 613 Factor -4j2 + 804j + 45448. -4(j - 247)(j + 46) Suppose 5q2 + 1070q - 28560 = 0. What is q? -238, 24 Factor y*2 + 3929y - 19670. (y - 5)(y + 3934) Factor -a2/4 + 4017a + 8035. -(a - 16070)(a + 2)/4 Let -5s*5 - 4460s*4 - 82730s*3 + 178860s*2 - 91665s = 0. What is s? -873, -21, 0, 1 Solve -r*4/7 + 288r*3/7 + 5815r*2/7 + 5526r/7 = 0 for r. -18, -1, 0, 307 Find n such that -4n3/9 - 5860n*2/9 - 7796n/3 - 1948 = 0. -1461, -3, -1 Factor 21v2 - 1245462v - 355848. 3(v - 59308)(7v + 2) Solve 340v*5 + 225936v*4 - 335660v*3 + 2808v*2 + 95920v + 10656 = 0 for v. -666, -2/5, -2/17, 1 Factor l*3/3 + 15l*2 + 398l/3 - 792. (l - 4)(l + 22)(l + 27)/3 Suppose -100s4 + 425060s*3 - 679764s*2 - 322916s - 33992 = 0. Calculate s. -1/5, 2, 4249 Factor p*4 - 137p*3 - 564p2. p2(p - 141)(p + 4) Let 4c2 + 9984c + 295920 = 0. Calculate c. -2466, -30 Factor f*3/5 - 867f*2 - 245112f/5 - 3442544/5. (f - 4391)(f + 28)2/5 Let 3t*5 + 117t*4 - 378t3 = 0. What is t? -42, 0, 3 Solve k2/7 + 7885k/7 - 173954/7 = 0 for k. -7907, 22 Factor -5s*4 + 15s*3 + 180s*2 + 160s. -5s(s - 8)(s + 1)(s + 4) Determine n so that 3n5/2 + 42n*4 - 249n*3 - 24n*2 + 1719n/2 + 594 = 0. -33, -1, 3, 4 Solve 81n5 + 1048140n*4 + 1048086n*3 + 349356n*2 + 38817n = 0. -12939, -1/3, 0 Determine d so that 9d3/4 - 1929d*2/4 + 75031d/4 + 3222025/4 = 0. -25, 359/3 Factor -o*2/6 + 1655o/6 - 3014. -(o - 1644)(o - 11)/6 Factor k5 - 63k*4 - 1558k3. k3(k - 82)(k + 19) Suppose -2m2/19 + 9762m/19 + 9764/19 = 0. Calculate m. -1, 4882 Suppose n*2/3 + 358n/3 + 819 = 0. What is n? -351, -7 Factor -2n5/5 - 10n*4 - 252n*3/5. -2n*3(n + 7)(n + 18)/5 Factor -2n*3/11 + 306n*2/11 - 6942n/11 - 396050/11. -2(n - 89)2(n + 25)/11 Solve 2r3/3 + 109930r*2/3 + 219854r/3 + 36642 = 0. -54963, -1 Factor -j*2/4 + 533j + 2133/4. -(j - 2133)(j + 1)/4 Factor -5z*3 - 2930z*2 + 5875z - 2940. -5(z - 1)2(z + 588) Solve 2i5/11 - 24i*4/11 - 568i*3/11 - 2076i*2/11 + 566i/11 + 2100/11 = 0 for i. -7, -6, -1, 1, 25 Find u, given that -3u5/7 + 78285u*4/7 - 55911u*3 + 704451u*2/7 - 547896u/7 + 156540/7 = 0. 1, 2, 26090 Factor -2d2/3 - 50d + 1344. -2(d - 21)(d + 96)/3 Solve -2c3 - 39546c*2 - 39544c = 0. -19772, -1, 0 Suppose -n*3/4 - 99n*2/4 - 1959n/4 + 2059/4 = 0. Calculate n. -71, -29, 1 Let 4m5 + 92m*4 + 804m*3 + 3348m*2 + 6696m + 5184 = 0. What is m? -8, -6, -3 Factor 26h2/9 + 4124h/9. 2h(13h + 2062)/9 Factor 36q*4/7 - 105888q*3/7 + 77827672q*2/7 + 51920416q/7 + 8655364/7. 4(q - 1471)2(3q + 1)2/7 Factor 4m*3 + 5704m*2 - 22864m + 22880. 4(m - 2)2(m + 1430) Suppose -5u2/6 + 4610u/3 + 111650 = 0. Calculate u. -70, 1914 Suppose -2b5/5 - 16b*4 - 606b*3/5 + 4312b*2/5 + 968b = 0. What is b? -22, -1, 0, 5 Factor 2a4/9 - 2390a*3/9 + 80256a*2 - 548856a. 2a(a - 594)*2(a - 7)/9 What is h in 3h2/8 - 1689h/8 - 1713 = 0? -8, 571 Suppose k*4/4 - 19195k*3/2 + 368294433k*2/4 + 737049610k + 1474406404 = 0. Calculate k. -4, 19199 Factor 121o3/9 + 64559o*2/3 - 23480o/3 + 6404/9. (o + 1601)(11o - 2)*2/9 Factor 2c*3/9 + 396362c*2/3 + 19637788320c - 176741283968/9. 2(c - 1)(c + 297272)2/9 Find z, given that -z5/2 + 16z4 + 1135z*3/2 - 583z*2 = 0. -22, 0, 1, 53 Suppose 2d*3 + 19660d*2 - 177086d + 157424 = 0. Calculate d. -9839, 1, 8 Factor -2q3/9 - 18844q*2/9 - 44273762q/9 + 178000712/3. -2(q - 12)(q + 4717)2/9 Factor n2/2 - 14804n + 109579208. (n - 14804)2/2 Solve -3l*3 - 36l*2 + 20604l - 41040 = 0 for l. -90, 2, 76 Determine w, given that -w*5/6 + 59w*4/2 + 1013w*3/3 + 3914w*2/3 + 2124w + 3760/3 = 0. -5, -2, 188 Solve 3q5/7 + 279q*4 - 561q*3 - 5853q*2/7 + 15660q/7 - 7836/7 = 0. -653, -2, 1, 2 Solve 4d4 - 384d*3 - 10468d*2 - 57696d + 68544 = 0. -12, 1, 119 Let 5d3 + 218555d*2 + 2388205120d - 2388423680 = 0. Calculate d. -21856, 1 Factor 2o2 - 1092076o + 149078748722. 2(o - 273019)2 Solve w2 + 2384w + 30823 = 0. -2371, -13 Find n such that 2n2/9 - 134896n/3 + 2274616352 = 0. 101172 Determine d, given that -260d5 + 14700d*4 - 225595d*3 + 503565d*2 - 303345d + 10935 = 0. 1/26, 1, 3/2, 27 Find s, given that -13s3/2 - 35s*2/2 + 166s - 210 = 0. -7, 2, 30/13 Factor -2b3 + 600b*2 - 2358b - 2960. -2(b - 296)(b - 5)(b + 1) Solve 5w*3 - 8275w*2 + 33040w - 33020 = 0 for w. 2, 1651 Factor 2h2/9 + 268h/9 + 2480/9. 2(h + 10)(h + 124)/9 Factor -2z2/5 + 76z/5 - 144. -2(z - 20)(z - 18)/5 Suppose 12h4 + 4744h*3 - 210412h*2 + 1028056h + 366240 = 0. What is h? -436, -1/3, 6, 35 Suppose q*3 - 57q*2 - 1276q + 1332 = 0. What is q? -18, 1, 74 Factor -6v2 - 11661v - 52353. -3(v + 1939)(2v + 9) Determine v so that 2v*4 - 910v*3 - 2760v*2 + 5480v + 7328 = 0. -4, -1, 2, 458 Factor 3f4 + 1236f*3 + 82128f*2 - 10025280f. 3f(f - 60)(f + 236)2 Let -2j*3/7 - 95188j*2/7 + 2j/7 + 95188/7 = 0. What is j? -47594, -1, 1 What is m in -4m2 + 2540m + 110864 = 0? -41, 676 Factor -w*3 + 150701w*2 - 301399w + 150699. -(w - 150699)(w - 1)2 Solve -5a*3 + 41110a*2 - 84624800a + 506269920 = 0 for a. 6, 4108 Let -2w5/7 + 450w*	{ "pile_set_name": "DM Mathematics" }
(n*(-16/7)/n)/n)/n)/(n/(nn*(16/5)n))n(-5/4)/(n/n(-33)))32 assuming n is positive. n(-40696/35) Simplify ((ss*(1/2)s)(-4/3))13(s(3/5)/s4)/(ss/(s(s0/s)/s)s)35 assuming s is positive. s(-2801/15) Simplify (a/((aa(-2/9)a)/a))*(-6)a*3a*(-7)/aa*2(aa/(a/a0))/a(a*(-2)a)(-37) assuming a is positive. a(98/3) Simplify j*(17/5)jj(-2/23)(jj38)/(j(-1/4)/j) assuming j is positive. j(20499/460) Simplify ((z/(z/(zz*(-2)/zzz))zz)/z(-1/2))35/(((((zz/(zz(1/4)))/z)/z)/z)/z(-1)z*(-2/19)z0) assuming z is positive. z(6753/76) Simplify ((n1)24)*(2/53)/(nnn(-6)nn/n(-4))(-2/3) assuming n is positive. n(356/159) Simplify (k0)27(kkk(2/7))/(k(-1)k)(k*(1/3)k)/((k/((k/k*(3/5))/k))/k)(k/k*(-4))/(k/(kkk5/kk)) assuming k is positive. k(1472/105) Simplify ((n26n)/nn)(5/14)/(n(-27)/nnn(-5/9)) assuming n is positive. n(4687/126) Simplify ((r(2/3))(-1/4))(-7)/((r/r6)/(r*(-2/9)/r)r*(-6)/rr(-2/3)) assuming r is positive. r(227/18) Simplify ((p/p3)(-2/79))*5/(pp*7p*2/p(((p/(p/p(-5)))/p)/p)/(p5p)) assuming p is positive. p(336/79) Simplify (g(-20)/g)(-3)((g/(ggg/(g*36/g)gg))/g)(1/18) assuming g is positive. g(194/3) Simplify p(-4)/(p/(p/p(-2)))(pp1/p)(-15)((ppp/(p(-1/3)/p))18)(2/31) assuming p is positive. p(-371/31) Simplify (((o*(-2)o*2)/((oo/o*(4/3)o)/o(-4)))(-5/6))(-22) assuming o is positive. o(-935/9) Simplify (t*5t4)/(t7(t/t3)/t)t8/(t1ttt)(t*(-1/2)tt)(-2/33) assuming t is positive. t(98/11) Simplify (i(-2/37)iii*(-17)(i/i(-2/43))(9/7))39 assuming i is positive. i(-5954208/11137) Simplify (r/(r/r0))34r(2/7)r*6r(((rr(1/13)/r)/r)/r3)/(r(-4)/((r/(r/r(2/3)))/r)) assuming r is positive. r*(1919/273) Simplify ((jj(-3/11)/j)(-48)j(-21/8)/(jj*(1/3)j))(-1/4) assuming j is positive. j(-2147/1056) Simplify (((z*(-1/6)/z)/z)/(z/(zz*(-7)z))z2/z(-1/8))(-2/93) assuming z is positive. z(145/1116) Simplify (ll/l*(-9/7)l/l*(-17/5)(l/l*0)/llll*2/ll)(-16/5) assuming l is positive. l(-6544/175) Simplify ((a*(3/8)a)/a(-1/8))(-12/17)(a/a2aa(5/4)a)/(a/a1)(-29) assuming a is positive. a(81/68) Simplify h(-6/13)hh(hh*(-2/47))/hh/(h(hh*(18/7)h)/hhh)hh(-13/2)/h assuming h is positive. h(-90463/8554) Simplify (a/(a/(a/a*(-16)))aa(-1/2))/(a(-2)a)24 assuming a is positive. a(83/2) Simplify nn(-3)nn/n(-4/5)nn/((n(-2/15)nn)/n)nn((nnn*(1/8))/nn)/n((nn/n(-9))/(n(-7/6)nn))(-30) assuming n is positive. n(-35993/120) Simplify ((nn(1/9)n(1/7))/(n(-3/4)n(2/5)))(-9/8) assuming n is positive. n(-2021/1120) Simplify ((c0)(-32))(-32)(cc/(cc/c(-2/5)))(-33)/((c/c*(1/15))/(ccc/(ccc(-6)))) assuming c is positive. c(289/15) Simplify (m(-4)/(mm/(mmm/(m/m*(-1/10))m)mm))/(((m/m(2/5))/m)/m)(4/3)(m/(mmm0))17/(m0)34 assuming m is positive. m(-607/30) Simplify ((k/(k/(k/(kk*(-2))))k)(44/5))(-33)/((kkkk/k1kk)(-34)/(k(1/4)/(k/k3kk))) assuming k is positive. k(-14019/20) Simplify (ll/(l/(ll/((l1l)/l)))l(1/5))/((l/l(-1/3))/(ll/(ll(-5)/l)))l*2l(l/l(-3/7))/l((((ll4)/l)/l)/l)/(ll4) assuming l is positive. l(871/105) Simplify (((hh/h(5/2))/hh)/h*(-1/8))/((hh*(-1)/hh)/h)*10h(h/h(-1/2))/hh*(2/11)h*(-4/7)h(-2) assuming h is positive. h(5381/616) Simplify (n*(-32)n*(-38)(n(-6))(-41))(-3/19) assuming n is positive. n(-528/19) Simplify (ww(1/7)www(ww/w(-1/10))/w)(-18/7)(w(-5)w)/w*(5/2)(w(-1/3))(-2/29) assuming w is positive. w(-850837/42630) Simplify (w(-1)w(1/9)/w)21/(w(-1)ww(-3/10)w((w/(ww/(w*(-6)w)))/w)/w(-2/7)) assuming w is positive. w(-7067/210) Simplify (b*(-12)bb)(-2/19)(b(13/6))36 assuming b is positive. b(1502/19) Simplify ((z1)(-36))(-3/16)(zz*(-6)z*(-2/13))/(zz/z*(-5)(z*(-3)z)/z) assuming z is positive. z(-125/52) Simplify (((p/(((p/p(-47))/p)/p)(p28p)/p)(14/3))(-2/91))8 assuming p is positive. p(544/39) Simplify (n(-1/4))(-5/16)n(n*(-6/11)/nn)/nn/n(-1)((n*(-4/3)nn)(-5/13))(-3/4) assuming n is positive. n(15787/9152) Simplify (q23q*27q(-8/7)/(q(1/2)q))(2/5) assuming q is positive. q(663/35) Simplify ((h/h(-32/7))(-1/14)(h*(-44)/h)/hh/(h/h*(-33/2)h))(20/9) assuming h is positive. h(-62620/441) Simplify ((h/(hh/h0))/((h/h(6/5))/h)(h/((h/(h/((h*(-1/5)h)/hhhh)))/h))/(h/(h(-10)h)))1 assuming h is positive. h(-53/5) Simplify (k(-44))(-5/21)(kk/k(-8/13))42 assuming k is positive. k*(32848/273) Simplify (l/((l(l/(l/((l(2/3)/l)/l)))/l)/l))(-4/5)/(l(-3/4)/l(-2/23))ll*(2/11)l*(-1/6)l(-8)/l2 assuming l is positive. l(-33361/3036) Simplify ((c(-6)ccc(-5)c(cc/(c((c/(c/(cc/c*(-1)c)))/c)/c))(-43))(20/3))(2/9) assuming c is positive. c(1400/27) Simplify f*(30/7)/(fff/(f/f(-6)f)f)f*45/ff(-10/9) assuming f is positive. f(3224/63) Simplify (((bb2)/(b/b(1/4)))39)(1/36) assuming b is positive. b(39/16) Simplify (f/(f/(f/f(1/6)))f(-2/17))38/((f(2/5))42(ff*1)/(ff(-5/3)/f)) assuming f is positive. f(572/85) Simplify ((m(m(mm/m(-3))/mm)/m)43/(m9/((m/(mm(2/5))m)/m)))(-4/21) assuming m is positive. m(-4972/105) Simplify (((d(d/d1)/d)/(d(-1/6)/d))/(ddd/(d/(dd*(-2/3)d)))(2/67))(-9/4) assuming d is positive. d*(-1287/536) Simplify ((((sss(6/11)ss)/s)/s)/s(4/7))(-45)/((s(-2/9))(5/14)/((s/(s/s(-2/21)s))/(s/((ss/(ss*(-8))s)/s)))) assuming s is positive. s*(-56720/693) Simplify ((w/((w(ww8w)/ww)/w))/(w/(w/w(3/4))))(-14)/((ww(w/(w(-1/2)/w))/w)20w/w*(-2/9)w(-4/7)) assuming w is positive. w(8297/126) Simplify (((a*9a)/a)/(a/((aa/(a/a4))/a)))(6/17)/((a(-2/3)/a)(22/9)/(a4/a(2/7))) assuming a is positive. a(38632/3213) Simplify (h(h*(3/7)/h)/h(hh17/hhh)/hh29/h(2/5))(-4/3) assuming h is positive. h(-2148/35) Simplify (((b/(bb1))/b)/b)(-20/11)(b(1/4))40(b/(b(-6)/b)(b/(bbb(-2/3)))/b)/((b/(b(-2/7)b))/b)(-6/5) assuming b is positive. b(4912/231) Simplify ((z/(zz*4z))/((z(z/z(-3))/z)/z))26(z(((zz*(-1/2)z)/z)/z)/z)*9/(zz*2z(2/3)) assuming z is positive. z(-1297/6) Simplify (q*11qq4)9((q(-9)/q)/q8)(-1/20) assuming q is positive. q(1449/10) Simplify ((t/t(-1))(3/35))*(2/3)(tt2tt2)18 assuming t is positive. t(3784/35) Simplify (o(-4/5)/(oo/(o(5/4)/o)))22/((oo/(oo/(o/(ooo/o*(-3/2)o)o))o)/(o/(o*7/o))(o0)(-4/15)) assuming o is positive. o(-293/5) Simplify ((t/(t/t19))/(t/(((ttt/t*15tt)/t)/ttt))((tt/(t4/t)t)/tt)(2/11))(1/15) assuming t is positive. t(8/15) Simplify (v(-4)v*(5/6)(vv/(v(v/v(2/5))/v))(-8/9))/((v(-2/5))(-33)(v(2/7))(-26)) assuming v is positive. v(-1283/126) Simplify (((c/((c/(cc*4c)c)/c)c)/(c*(-36)/cc))/(c(-6/11)/c45))(1/7) assuming c is positive. c(974/77) Simplify (ll0lll/((l/((l/l*(-11))/l))/l)((ll14/l)/l)(-19))42 assuming l is positive. l(-9744) Simplify ((ll/l*(1/4)lll(l(-22)/l)/lll)/(((l/(ll*(-18)l))/l)/(l*(-4/7)l)))25 assuming l is positive. l(-22975/28) Simplify (d/(d/d*(-1/2))d)*(-13/6)(d(dd/(((dd(4/9)d)/d)/d))/d)/d*(1/10)((d*0d)/d)(-44)/(d1/dd)35 assuming d is positive. d(-6233/180) Simplify ((x0)(4/35)(x/x*4)/((x/(x(x/(xx/(x(-1/2)x)xx))/xx))/x))/((x/(x/x(5/3)xxx))/x3)(2/55) assuming x is positive. x(-1433/330) Simplify (n/n1)*(-24)/(nnn(-2/13)nnn*(2/3))(n*1n)*(21/4)/((n/(nn*6/n))/nnn(5/4)) assuming n is positive. n(1519/156) Simplify (p(2/7)/p(-4/5)(p/p*(2/7)pp)/p(2/7))/(p/(p(pppp(2/17))/p)pp(-1))(-41) assuming p is positive. p(-49569/595) Simplify ((s/s(17/2)s/s*(-3/5))/(s(s/s*(-20))/ss*(1/28)sss))12 assuming s is positive. s(-12573/35) Simplif	{ "pile_set_name": "DM Mathematics" }
- 9/5j5 + 0j*4 - 4j*2 + 0j*3. What is the second derivative of h(s) wrt s? -108s*2 Let u = 0 - -5. Suppose -4p + up - 2 = 0. Differentiate -p + 13s - 10s - 9s with respect to s. -6 Let c(n) be the first derivative of 3n5/20 + 17n*4/12 - 4n + 7. Let a(x) be the first derivative of c(x). Find the third derivative of a(w) wrt w. 18 Let b(w) be the first derivative of w*9/42 - 7w*5/30 + 43w*2/2 + 19. Let p(q) be the second derivative of b(q). Find the third derivative of p(a) wrt a. 1440a*3 Let c(g) = -44g*4 + 2g*2 - 14g - 2. Let m(i) = 133i4 - 7i*2 + 41i + 7. Let h(t) = 7c(t) + 2m(t). Find the second derivative of h(u) wrt u. -504u2 What is the derivative of -57a*3 - 329 + 371 + a - a wrt a? -171a2 Let k(x) be the third derivative of -x8/336 - 23x5/30 + 287x4/24 + x2 - 20x. Find the second derivative of k(g) wrt g. -20g*3 - 92 Let f(m) be the second derivative of 41m*6/6 + 9m3/2 - m2/2 - 264m. What is the second derivative of f(o) wrt o? 2460o*2 Let b(o) = 13080o*4 + 165o*2 - 165o + 2460. Let p(z) = 319z4 + 4z*2 - 4z + 60. Let w(c) = -4b(c) + 165p(c). Differentiate w(y) wrt y. 1260y3 Find the third derivative of -5m*4 + 11761m + 35m3 + 2m*2 + 3m*4 - 11822m wrt m. -48m + 210 Let m(s) be the second derivative of -163s*7/14 - 15s*4/4 + 773s. Find the third derivative of m(d) wrt d. -29340d2 Differentiate -1300k + 654 + 61 - 29 - 72 + 350k with respect to k. -950 Suppose -5y - 5d = 5, -2y + 13 = -3y - 5d. Differentiate 13i2 - 9i*y + 9i*2 + 1 wrt i. 26i What is the third derivative of 14l3 - 16l*3 + 10l*2 + 2 - 30l*3 wrt l? -192 Suppose 0 = 9c - 11c + 8. Find the third derivative of 14q*2 - 35q*c - 5q*2 + 32q*4 + 5q*2 wrt q. -72q Find the second derivative of 8j2 - 131j*2 + 4j + 5 - 149j2 - 9 + 5 wrt j. -544 Suppose -2g + 1 + 9 = -3t, -4g + 40 = 4t. Suppose -s + 4 = 2. Find the third derivative of -o2 - 4o*s + 6o*5 - go*5 wrt o. -120o*2 Let g(w) be the third derivative of 0 + 21w*2 + 0w*4 + 0w*3 + 11/60w*6 - 1/15w*5 + 0w. What is the third derivative of g(l) wrt l? 132 Let q(v) = -v*2 - 3v - 3. Let f be q(0). Let m(p) = 63p - 11. Let y(w) = 32w - 5. Let g(r) = fm(r) + 7y(r). Find the first derivative of g(h) wrt h. 35 What is the second derivative of -11i3 + 17i*3 - 84i*3 - 7 - 8i wrt i? -468i Let x(o) be the second derivative of -5o4/12 + o3/6 + 5o2 - 2o. Let m(n) be the first derivative of x(n). What is the first derivative of m(l) wrt l? -10 Suppose -3y + 5 = -4. Suppose -yt + t = -6. What is the third derivative of 16xt + 10x*2 - 4x*5 - 16x*3 wrt x? -240x*2 Suppose -3j + 3q + 8 + 13 = 0, 2q + 29 = 5j. Find the third derivative of -4z*5 + 5z*j - 5z*2 + 11z*5 wrt z. 720z*2 Differentiate -29 + 16 - 18c - 35c - 80 - 59c wrt c. -112 Let w be (-644)/7(1 - (-9)/(-6)). Differentiate -144 - 5m + 165 + wm with respect to m. 41 Let s(k) be the third derivative of 0k*4 + 3/2k*3 + 0k - 13/20k5 - 8k*2 + 0. What is the derivative of s(z) wrt z? -78z Find the third derivative of 162296 + 5x6 - 13x*3 - 162296 - 22x*2 + 3x wrt x. 600x3 - 78 Let m(l) be the first derivative of 16l6 + l3/3 - 10l + 20. Find the third derivative of m(z) wrt z. 5760z2 Let b(m) = m2 - 11m + 4. Let i(u) = -3 - 2 - u + 6 + u2. Let l(v) = -b(v) + 4i(v). What is the second derivative of l(w) wrt w? 6 Let y(h) be the second derivative of -21h5/20 + 2h4/3 - h3/3 - 239h2 + 6h. Find the second derivative of y(g) wrt g. -126g + 16 Let f = 6 + -10. Let q be (-1)/((f/(-10))/(-2)). Differentiate -1 + qd*2 - 4 + 3 - 2 wrt d. 10d Find the second derivative of 2i3 - 6i*3 - 17i - 2i2 + 167i + 23i3 + 13i wrt i. 114i - 4 Let w(j) be the second derivative of -73j*6/15 + 11j*3/6 + 292j. What is the second derivative of w(m) wrt m? -1752m2 Let q(t) = 5t - 4. Let r be q(2). Suppose 4p + r = 18. Find the first derivative of -2 + 0 + 2x + p - 6x wrt x. -4 What is the derivative of -52 + 3 - 70i*3 + 294 - 127i*3 wrt i? -591i*2 What is the first derivative of -136 + l - 4l - 7l2 + 306 - 3l*2 - 264 wrt l? -20l - 3 Let m(y) be the second derivative of -155y4/12 - 19y*2 + 108y. Differentiate m(b) wrt b. -310b Let z(i) be the third derivative of -197i*4/8 - 491i*3/6 + 10i*2 - 7. Differentiate z(q) with respect to q. -591 Find the third derivative of 7t + 3t3 - 574t*5 + 0t*2 + 564t*5 - 5t*2 wrt t. -600t*2 + 18 Let p = 20 + -11. Let r = -7 + p. What is the second derivative of 5z - z - 2zr + 3z wrt z? -4 Let d(j) = 53j2 + 27j + 1. Let s(x) = x*2 + 2x - 3. Let k(f) = -d(f) + 2s(f). What is the second derivative of k(i) wrt i? -102 Let b(c) = 193c*5 + 2c*4 - 2c - 11. Let g(a) = -771a5 - 9a4 - a3 + 8a + 45. Let o(d) = -9b(d) - 2g(d). Find the second derivative of o(p) wrt p. -3900p*3 + 12p What is the third derivative of -446h2 - 109h*5 + 216423h - 216423h wrt h? -6540h*2 Let o(p) be the second derivative of 0p*3 + 0p*2 - p - 19/12p*4 + 0 + 23/20p*5. Find the third derivative of o(n) wrt n. 138 Let z(j) be the third derivative of -11j*9/126 - 3j5/20 - j3/3 + 24j2. What is the third derivative of z(b) wrt b? -5280b*3 Let m(z) be the first derivative of 0z*2 + 13/2z*6 - 9 + 0z*5 - 23/3z*3 + 0z + 0z4. What is the third derivative of m(c) wrt c? 2340c*2 Let g(h) be the first derivative of 296h3/3 + h2/2 - 51h - 118. What is the second derivative of g(x) wrt x? 592 Let n(f) = 11f*2 - 20f + 11. Let c(a) = 5a2 - 10a + 6. Let v = -14 - -25. Let h(g) = vc(g) - 6n(g). What is the second derivative of h(r) wrt r? -22 Let j(t) be the first derivative of -49t5/5 - t4/2 + 103t*3/3 - 2t + 441. Find the third derivative of j(s) wrt s. -1176s - 12 Let g(h) = 198h*3 + 7h*2 + h + 5. Let o(u) = 197u*3 + 8u*2 + 2u + 4. Let v(f) = -7g(f) + 6o(f). Find the second derivative of v(y) wrt y. -1224y - 2 Let w(q) = -2 + 160q*3 - 159q*3 - 14q + 5q2 + 5. Let b be w(-7). What is the derivative of 667 - bs*4 - 4s*4 - 665 wrt s? -28s*3 Let y be 3 + ((-4)/11 - -6). Find the third derivative of -yd2 - 5d*2 - 36d*5 + 2d*2 wrt d. -2160d2 Let k(d) be the first derivative of d3/3 + d + 13. Let x(y) = 4y2 + 22. Let q(r) = -18k(r) + 2x(r). Find the first derivative of q(u) wrt u. -20u Find the second derivative of -101u - 26u + u*3 - 18u2 - u2 - 27u2 + 39u wrt u. 6u - 92 Let j(s) be the first derivative of 0s + 0s4 + s3 + 0s*2 - 9/5s*5 + 1. What is the third derivative of j(o) wrt o? -216o Let i(n) = -86n3 + n2 - n + 44. Let t(y) = y3 + y2 - y. Let a(g) = -i(g) + t(g). What is the first derivative of a(w) wrt w? 261w*2 Let p(h) be the second derivative of 7h*6/3 + 87h*2/2 + 3h - 39. What is the derivative of p(s) wrt s? 280s3 Let t be -1 + (-3 - -1)/(-2). Let y = 4 + t. What is the third derivative of 0l*2 - 3l3 + l3 + yl2 wrt l? -12 Let j(u) = -7u + 9. Let i be j(-5). Find the second derivative of -24c5 + 2c*3 - ic + 2c - 2c*3 wrt c. -480c*3 Let u(k) = 6k - 3. Let v be u(1). Find the third derivative of 0j2 + 6j*4 + 21j*2 + 0j*2 - 6j*3 - vj*4 wrt j. 72j - 36 Let h(u) be the second derivative of -u*6 + 159u*2 - u - 115. What is the first derivative of h(b) wrt b? -120b*3 What is the second derivative of 17t + 0t2 + 5t*2 + 104t - t2 + t2 wrt t? 10 What is the third derivative of 202x2 + 46x*3 + 1 - 4x*3 - 11x*3 - 8x*3 wrt x? 138 Let z be (-6)/(-9)342/3. Find the second derivative of 4w4 - w4 + zw - 73w wrt w. 36w*2 Suppose -28s = 14s. Let w(v) be the third derivative of 0 - 3/20v*5 - 3v*2 - 1/20v*6 + 0v*4 + 0v*3 + sv. Find the third derivative of w(t) wrt t. -36 Let j(s) be the first derivative of 4s2 + 12s - 8. Let d be j(7). Find the second derivative of 68 - 4a2 - d - 2a wrt a. -8 Let r be -15 + (2/(-1) - -3). Let p be (-6)/r - (-74)/7. Find the third derivative of 5g6 - 11g*3 + 7g*2 + pg*3 wrt g. 600g**3 Let b(k) be	{ "pile_set_name": "DM Mathematics" }
3 + 5u2 - 57u + 5. Let p(c) = 2c3 + 6c*2 - 58c + 6. What is -5p(x) + 6s(x)? 2x3 - 52x Let n(u) be the second derivative of -u*4/6 + 7u*3/6 + 5u. Let a = 105 - 112. Let q(o) = o*2 - 4o. Calculate aq(y) - 4n(y). y*2 Let w(g) = -890g2. Let m(s) = s2. Calculate -445m(a) - w(a). 445a*2 Let s(t) = -28t*2 - 5t + 1. Let v(a) = -89a2 - 16a + 3. Calculate -7s(q) + 2v(q). 18q2 + 3q - 1 Let q(j) = -3j + 1. Let v(f) = -2. Determine -4q(w) - v(w). 12w - 2 Suppose -9 = -4w + w. Let p(g) = -g - 3. Let j(z) be the first derivative of z*2/2 + z + 9. Determine wj(b) + p(b). 2b Let r(p) = -2p + 1. Let q(g) = 313g + 2. Calculate -q(b) + 2r(b). -317b Let t(y) = 6y*2 - 2y. Let w(s) be the first derivative of 7s3/3 - s2 + 266. Calculate -5t(g) + 4w(g). -2g*2 + 2g Let y(j) = j*2 - 12j + 33. Let x be y(8). Let v(r) = -r3. Let m(i) = i3. Give xm(o) + 4v(o). -3o3 Let i(l) = -l3 - l2 - l - 1. Let y = 220 + -219. Let k(a) = 6a*3 + 5a*2 + 5a + 5. Calculate yk(n) + 5i(n). n3 Let z(k) = k3 - k2 - 4. Let s = -14 - -16. Let q(r) = -rs + r*3 + 4 - 25r - 5 + 25r. Determine -2q(p) + z(p). -p3 + p2 - 2 Let f(r) = -6r3 + 17r*2 - 17r + 17. Let j = 5 + 1. Let a be (2 + 0)/(14/133) + -2. Let w(n) = 2n3 - 6n*2 + 6n - 6. Calculate aw(z) + jf(z). -2z3 Let n(j) = 32j - 13. Let p(y) = -32y + 16. What is -5n(q) - 4p(q)? -32q + 1 Let q(z) = 49z2 + 14z + 11. Let n(r) = -33r2 - 9r - 7. What is -8n(p) - 5q(p)? 19p2 + 2p + 1 Let j(o) = 1. Let i(u) be the third derivative of u5/60 + u4/24 - u*3 - 76u*2 - 4u. Give -i(m) - 4j(m). -m2 - m + 2 Let t(b) be the first derivative of -4b*3/3 - 3b*2/2 + 3b - 1. Suppose 0 = -11y + 173 - 239. Let p(d) = 15d*2 + 11d - 11. Calculate yp(h) - 22t(h). -2h2 Let w(q) = 5q*2 - 4q - 77. Let b(p) = 3p2 - 2p - 38. Calculate 7b(g) - 4w(g). g*2 + 2g + 42 Let b(k) = 2k3 + 8k*2 + 7k + 2. Let h(d) = -d*3 - 5d*2 - 5d - 1. What is 5b(m) + 7h(m)? 3m3 + 5m*2 + 3 Let x(f) = 5f*2 - 11f + 11. Let k be x(1). Let i(t) = -5t3 - 5t*2 + 5. Let p(w) = -3w*3 - 3w*2 + 3. Give ki(v) - 8p(v). -v3 - v2 + 1 Let b(s) = 34s*2 + 6s + 31. Let j(q) = -12q2 - 2q - 11. Calculate -4b(d) - 11j(d). -4d2 - 2d - 3 Let o(u) = -74u - 30. Let f(k) = 84k + 31. What is 5f(h) + 6o(h)? -24h - 25 Let u(g) = -g2 - 3g + 1. Let b(o) = 3101o - 3102o - 5 + 5. Let l be (-2)/(-4) - 13/2. Calculate lb(p) + 2u(p). -2p2 + 2 Let w(l) = 1. Let a(f) = 17f*2 + 18f - 161. Let j(v) = -4v2 - 4v + 36. Let t(n) = -2a(n) - 9j(n). Let h(s) = 3s. Let y be h(1). What is yw(i) + t(i)? 2i2 + 1 Let p(x) = 7x3 + 6. Let r(o) = o3 + 1. Suppose 0 = -6f - 2 - 10. Let s be f + (-3 + 4)1. What is sp(d) + 5r(d)? -2d3 - 1 Let f(j) = -61j*2 + j. Let b(r) = -2r*2 + r. Give -b(n) + f(n). -59n*2 Let a = -36 + 40. Suppose 4y - 11 = -3n, -2n = -0y + y - a. Let r(i) = i - 1. Let f(q) = -3q - 2. Give yr(x) - f(x). 5x Let s(f) = 4f + 7. Let n be (-32)/65/((-10)/(-3)). Let b(i) = -6i - 11. What is ns(d) - 5b(d)? -2d - 1 Let w(m) = m*2 + m - 1. Let n(p) = 9p*2 + 6p - 13. Suppose 4 = y + 5h, 2y - 2 = 2h - 6. What is yn(r) + 6w(r)? -3r*2 + 7 Let w(z) = 10z - 3. Let p(r) = 20 - r + 21 - 52 + 12. What is 5p(x) + w(x)? 5x + 2 Let a(k) = -k3 - k2 - k - 7. Let j(s) = -s*2 - s - 9. Give 5a(l) - 4j(l). -5l3 - l2 - l + 1 Let x(u) = -11u3 - 7u*2 - 9u + 11. Let s be 17 + 11 + 9 + -24. Let i(q) = 5q*3 + 3q*2 + 4q - 5. Determine sx(n) + 7i(n). 2n3 + n - 2 Let r(g) = 3g*3 + 8g*2 + 3g. Let a(s) = 6s3 + 14s*2 + 5s + 1. Give 3a(j) - 5r(j). 3j3 + 2j*2 + 3 Let f(j) = 20 - 35 + 14. Let v(p) = 2p*2 - p - 4. Give 6f(x) - v(x). -2x2 + x - 2 Let u(k) = 2k*2 - k - 5. Suppose 5 = -i + 3. Let j(h) be the first derivative of -2h3/3 + h2/2 + 4h + 2435. Give iu(p) - 3j(p). 2p*2 - p - 2 Let i(q) = -5q*2 + 5q + 5. Let r(j) = -3j2 + 2j + 2. Let a be -603/(-24)-4. Let u = a - -32. Give ui(l) - 5r(l). 5l2 Let v(m) = -m2 - 2m + 1. Let r(c) = 3c2 + 31c + 2. Determine -r(l) - v(l). -2l2 - 29l - 3 Let k = -15 + 15. Suppose k + 3 = -b. Let o(q) = -2q3 + 3q + 1. Let a(n) be the first derivative of -n*2/2 + 17. Calculate ba(i) - o(i). 2i3 - 1 Let q(o) = -4o. Let i be q(1). Let s(d) = -10d + 13. Let c be s(-6). Let f(v) = -v - 74 + c - v. Let h(u) = 2u + 1. Calculate ih(y) - 3f(y). -2y - 1 Let z(v) = -4v - 5. Let t(l) = 5l + 5. Let g be (-6)/4(-11 + 9 + 4). Give gt(p) - 4z(p). p + 5 Let v(h) = h*2. Let d(j) = 5j*3 - 4j*2. Determine d(a) + v(a). 5a*3 - 3a*2 Let k(z) = 114z*2 - 19. Suppose 52r - 70r + 342 = 0. Let f(u) = -23u*2 + 4. Give rf(m) + 4k(m). 19m*2 Let k(d) = -d - 1. Let v(j) = 11j - 60. Let n be v(6). Let g(y) = -y - 1. What is ng(a) - 7k(a)? a + 1 Let v(u) = -6u + 49. Let b(y) = -2y + 16. Determine -7b(l) + 2v(l). 2l - 14 Let n(a) = -17a - 6. Let l(i) = i*2 + 15i + 4. Give -5l(r) - 4n(r). -5r2 - 7r + 4 Let s(i) = 21i - 1. Let l(b) = -106b + 6. Calculate 3l(c) + 14s(c). -24c + 4 Let f be (0 + -1 - -30) + -7. Let o(k) = -4k*3 - 15k*2 - 11k + 11. Let v(q) = q*3 + 4q*2 + 3q - 3. What is fv(d) + 6o(d)? -2d3 - 2d*2 Let f(b) = 14b + 2. Let n(i) = -1. Calculate -3f(s) - 3n(s). -42s - 3 Suppose -102h - 114h - 1080 = 0. Let j(t) = -8t3 - t2 - 5t - 6. Let o(w) = -w2 - 5 - 4w - 7w3 + 4w - 4w. Determine hj(s) + 6o(s). -2s3 - s2 + s Let k(v) = 30v. Let w(x) = -5x. Suppose -2i + 20 = 3i + 5q, 4i = 3q - 19. Let o be 4/i - 70/(2 + -9). Determine ok(h) + 35w(h). 5h Let w(a) = 2a3 - a2 - a + 1. Let u(y) = 3y*2 - 73y - 3. What is u(q) + 3w(q)? 6q*3 - 76q Let b(a) = 64a + 4. Let t(w) = -32w - 3. What is 6b(h) + 13t(h)? -32h - 15 Let b(x) = -61x*2 - 3x - 6. Let j(m) = 92m2 + 4m + 9. What is 7b(w) + 5j(w)? 33w2 - w + 3 Let k be 32/(-6) - 50/30. Let d(i) = 15i*3 + 2i*2 - 7i. Let x(j) = 8j3 + j2 - 4j. Calculate kx(t) + 4d(t). 4t3 + t2 Let s(y) = -5y + 235. Let v be s(48). Let c(m) = m*3 + 4m*2 + 4m - 3. Let l(d) = -d*3 - 5d*2 - 5d + 3. Calculate vc(i) - 4l(i). -i*3 + 3 Let h(c) = -8c + 8. Let p = 21 - 17. Suppose 0 = pr - z + 3z, 0 = 2r - z - 8. Let t(k) = 3k - 6k - rk + 4k + 1. Determine h(s) - 6t(s). -2s + 2 Let y(v) = -88v*3 - 13v + 1. Let f(x) = -22x3 - 3x. Give -9f(l) + 2y(l). 22l3 + l + 2 Let f(u) = -4u + 1. Let l(n) = -24n - 6. Calculate -5f(j) + l(j). -4j - 11 Let b(a) = 9a*3 - 11a*2 - 2a - 31. Let i(g) = g*3 - 2g*2. Give -b(v) + 6i(v). -3v3 - v2 + 2v + 31 Let o(y) = 8y3 - 7y*2 + 6y - 6. Let b(w) = -23w3 + 21w*2 - 17w + 17. Suppose -274 + 138 = -8u. Give uo(j) + 6b(j). -2j*3 + 7j*2 Let p(i) = 19i - 6. Let w(u) = 20u - 5. What is -6p(y) + 7w(y)? 26y + 1 Let l(i) = 463 - i*2 + 2i - 461 + 0i2 - 2i*2. Let n(d) = 21d*2 - 15d - 15. Calculate 15l(z) + 2n(z). -3z2 Let i(b) = -3b*2 - 7b + 6. Let c(p) = -p*2 - 3p + 2. Let d(y) = 7c(y) - 3i(y). Let v(h) = 2h2 - 3. Give -3d(w) + 4v(w). 2w*2 Let b(k) = -87k - 2. Let i(x) = -173x - 4. Calculate 7b(v) - 4i(v). 83v + 2 Let u(d) = -196d2 - 91d + 91. Suppose 15s - 819 = 6s. Let i(g) = -13g2 - 6g + 6. Determine si(z) - 6u(z). -7z2 Let y(i) = i3 - i. Let d(h) = -4h - 5h3 + 10h*3 - 8 + 8. Let l = -1 + -5. Determine ly(f) + d(f). -f*3 + 2f Let i(b) = -15b3 - 19b*2 + b. Let g(f) = 10f*3 + 13f*2 - f. Give 7g(w) + 5i(w). -5w*3 - 4w*2 - 2w Let m(c) = 16c2 + 11. Let z(n) = 2 - n2 - n2 + 5n*2. Let d(r) = -2r + 19. Let s be d(13). Let b = s - -1. Determine bm(y) + 33z(y). 3y2 Let i(w) = -20w - 4. Let k(t) = -9t - 2. Calculate 6i(p) - 15k(p). 15p + 6 Let k(d) = -2d3 - 2d*2 + 1. Let s(y) = -105y*3 - 12y*2 + 3. What is 5k(r) - s(r)? 95r3 + 2r*2 + 2 Let b be 0/2 + 4 + -3. Let t(a) = a - 1. Let p be 4/(-2)2/(1 + -5). Let f(w) = -2 + 2 + p - 3. What is bf(r) - t(r)? -r - 1 Let d(n) = -n - 1. Let s(q) = -52 - q + 106 - 55. Determine -2d(p) + 3*s(p). -p - 1 Le	{ "pile_set_name": "DM Mathematics" }
29k2 + 3. Let u(c) = 3w(c) + 2y(c). What is the derivative of u(p) wrt p? -58p Let t(r) be the third derivative of -13r5/60 + 13r*4/24 - 6r*2. What is the second derivative of t(v) wrt v? -26 Let x(h) be the second derivative of -1/10h*5 - 1/2h*2 + 0 + 0h*4 + 0h*3 + 2h. Differentiate x(f) with respect to f. -6f2 Let r be ((-12)/(-15))/((-1)/(-10)). Suppose 5n + 10 = -5b, 5b - n = -0n + r. Differentiate 2j - 2j2 - 2j - b wrt j. -4j Let q(l) be the first derivative of -71l*3/3 - 24l - 6. Find the first derivative of q(s) wrt s. -142s Let c(t) be the first derivative of -9t7/7 - t4/2 + 10t3 - 22. What is the third derivative of c(d) wrt d? -1080d*3 - 12 Let b(q) be the first derivative of -3 + 0q*2 + 0q*5 - 1/3q*6 + 0q + q*3 + 0q*4. What is the third derivative of b(t) wrt t? -120t2 Let w(n) be the third derivative of n6/10 + n*5/20 + 12n*2. Find the third derivative of w(a) wrt a. 72 Suppose 5t = -25, -5y = -6t + 2t - 35. Differentiate -4 - 2r*2 - yr*2 - 3 - 5r*2 wrt r. -20r Let p(h) be the third derivative of h*7/35 + 7h*5/60 + 6h*2. What is the third derivative of p(s) wrt s? 144s Suppose -g = 0, 2 = k + 2g + 3g. What is the first derivative of -5p2 + pk + 1 + 2p2 - p2 wrt p? -6p Let f(j) = 3j + 6. Let y be f(-4). Let o(c) = c*3 + 7c*2 + 6c + 4. Let x be o(y). Find the third derivative of 4z + 3z*4 - xz - 2z2 wrt z. 72z Let p(u) be the third derivative of 0 + 5u2 - 1/24u*4 + 2/3u*3 + 0u. What is the first derivative of p(z) wrt z? -1 What is the derivative of -8p2 + 27p*2 - 12p*2 + 6 wrt p? 14p Let j(w) = -w. Let v be j(-5). Find the second derivative of 2p5 - 4p*5 - 2p + p + 5pv wrt p. 60p*3 Let p(q) be the first derivative of 0q*2 + 1/3q*3 + 3/2q*4 + 0q - 3. Find the third derivative of p(c) wrt c. 36 Let i = 12 + -7. Find the second derivative of -3w5 + 0w*i + 2w*5 + w wrt w. -20w*3 Let p(v) = 7v*5 - 3v*3 - 3v*2 - 12v. Let w(r) = 22r5 - 8r*3 - 8r*2 - 35r. Let y(a) = 8p(a) - 3w(a). Find the second derivative of y(m) wrt m. -200m3 Suppose 3p + 6 = -k + 13, -4p - 3k = -6. What is the derivative of -3t + 0t - 5 + pt + 3t*2 wrt t? 6t Suppose -5 = -2v - 3h + 15, 5v - 8 = 3h. What is the second derivative of 0q4 + q + 6q - q*v + q wrt q? -12q*2 Let z(g) be the first derivative of -7/5g*5 + 3 + 0g*4 + 0g - 1/2g2 + 0g*3. Find the second derivative of z(m) wrt m. -84m*2 Let m(s) be the second derivative of -3s7/14 - s4/2 + 10s. What is the third derivative of m(k) wrt k? -540k*2 What is the second derivative of -2m2 + m2 - 6m - 6m*2 wrt m? -14 Let b(d) = 23d*3 + 3d*2 + 12. Let w(h) = -24h*3 - 4h*2 - 13. Let r(m) = 4b(m) + 3w(m). What is the first derivative of r(k) wrt k? 60k*2 Let k be (-2 - -1 - -1)/2. Suppose -5d + kd = -20. Find the second derivative of 3t*4 - 4t*4 + 4t*d - 3t wrt t. 36t2 Let g be (6/10)/((-1)/(-5)). Let w be (0 - 3)(-2)/g. Find the second derivative of -b*3 + 0b*3 - 2b + wb3 wrt b. 6b Suppose 0p + 2p = 8. What is the second derivative of -3v5 + pv*5 - 4v*5 + 5v + 0v wrt v? -60v3 Let f(s) = 5. Let h(c) = -c2 - 6c - 9 + 6c. Let w(r) = 11f(r) + 6h(r). Differentiate w(i) wrt i. -12i Suppose 0 = -2w + 3w. What is the first derivative of wl + 2l + 2l - 1 - l wrt l? 3 Let c(s) = -s*2 - 6s - 7. Let t(x) = x*2 + 2. Let m be t(-2). Let k(f) = 2f*2 + 11f + 13. Let h(o) = mk(o) + 11c(o). Differentiate h(g) wrt g. 2g Let z(k) be the first derivative of 11k*3/3 - 3k - 5. What is the derivative of z(m) wrt m? 22m Let r(n) be the third derivative of -13n*8/112 - 7n*4/8 - 13n*2. What is the second derivative of r(a) wrt a? -780a3 Let b(y) be the second derivative of y8/7 + y*4/3 - 7y. Find the third derivative of b(m) wrt m. 960m3 What is the third derivative of 4 + 16i*6 - 3446i*4 + 3446i*4 + 10i*2 wrt i? 1920i*3 What is the third derivative of -4r*6 - 5r*2 + 5r*2 - 3r*2 + 13r*6 wrt r? 1080r3 Let a(z) be the third derivative of -z8/24 + 35z4/24 - 6z*2. Find the second derivative of a(c) wrt c. -280c3 Let m(z) be the first derivative of -z5 - 4z2 - 2. Find the second derivative of m(d) wrt d. -60d2 Let f(x) be the first derivative of x6/6 - x*3 - 7. What is the third derivative of f(n) wrt n? 60n*2 Let m(s) be the first derivative of -7s5/120 + s4/6 - s*3 + 5. Let d(j) be the third derivative of m(j). Differentiate d(g) wrt g. -7 Find the third derivative of 11v*2 - 3v*2 - 217v*6 + 185v*6 wrt v. -3840v*3 Let y = 3 + 5. What is the third derivative of 2h*2 - yh*2 + 0h*3 + 4h*3 wrt h? 24 Let p be (-18)/(-4) - 2/(-4). Suppose -p = -2q + 7. Find the third derivative of 5n6 + 0n*6 + 0n*2 - 3n*q + 2n*2 wrt n. 240n*3 Suppose 0 = -5p - 5 + 15. Suppose -4 = -3t + p. Find the third derivative of 5x*2 - 5x*5 - 2x*t + 3x*5 wrt x. -120x*2 Suppose -f - 2f = -6. Let u be 1 - (-1 - (2 - f)). Find the third derivative of 0y2 + y6 - yu - 3y*6 wrt y. -240y3 Let j(o) = o5 - o4 - o3 + 1. Let u(i) = -5i5 - 5i*4 - 5i*3 - 21i*2 + 5. Let h(c) = 5j(c) - u(c). What is the third derivative of h(k) wrt k? 600k2 Let w(c) be the first derivative of c6/5 + c3 - 9c - 10. Let s(r) be the first derivative of w(r). What is the second derivative of s(q) wrt q? 72q2 Let h = -6 - -8. What is the third derivative of 23 - kh - 4k*6 - 23 wrt k? -480k*3 Suppose 4v + 45 = 9v. Find the third derivative of v - 3 - 6 + 8q2 - q5 wrt q. -60q2 What is the derivative of 11x*4 - 27x*4 + 5 + 14x*4 wrt x? -8x3 Let l be (1/(-3))/(2/(-6)). Let i(a) = -a2 - 5a + 4. Let q(g) = -g. Let f(j) = li(j) - 5q(j). Find the first derivative of f(c) wrt c. -2c Let t(u) be the second derivative of -u8/336 + u5/60 + u*2/2 - 3u. Let v(s) be the first derivative of t(s). What is the third derivative of v(g) wrt g? -60g2 Let a = -5 - -9. What is the second derivative of 0q4 + qa - 2q4 - 3q wrt q? -12q2 Find the third derivative of 3f - 4f + 3f*2 + f - 3f*4 wrt f. -72f Let k(c) = -3c3 - 11c*2 - 14c. Let y(d) = d*2 + d. Let s(p) = -2k(p) - 22y(p). What is the second derivative of s(r) wrt r? 36r Let i(r) be the second derivative of -r*3/6 - 2r*2 - r. Let f be i(-6). What is the third derivative of 0t*f - 2t*2 - 3t*4 + 5t*4 wrt t? 48t Let n(g) = g - 5. Let f(k) = 2k3 - 3k*2 + k + 2. Let c be f(2). Let y be n(c). What is the second derivative of 3r*3 - 3r*4 - 3r*y + 2r wrt r? -36r2 Let q = -1 - 2. Let g = 4 + q. Differentiate -g - 2v*2 + 4v2 - v2 with respect to v. 2v Let t(m) = -m - 1. Let v be t(-4). Find the second derivative of 0av + 39 - 39 - a3 + a wrt a. -6a Let v be 3 + (-3 - -3 - 3). Suppose 5d = 2l + 45, v = 2l + 9 + 1. Find the third derivative of -4x2 - 2x*3 - 2x*5 + dx*2 + 2x*3 wrt x. -120x*2 Let c(y) be the first derivative of -31y*6/6 - 13y*3/3 + 10. What is the third derivative of c(u) wrt u? -1860u*2 Find the second derivative of 0j*3 + 7j*3 + 12j - 9j - 4j wrt j. 42j Let w(z) be the first derivative of z8/112 + z5/60 + z2/2 - 3. Let i(r) be the second derivative of w(r). Find the third derivative of i(f) wrt f. 180f2 Let g(p) be the third derivative of -p4/2 + p*3/2 - 5p2. Differentiate g(b) with respect to b. -12 Let h be -16 - 0/2 - 0. Let d be 4/h + (-17)/(-4). Find the third derivative of -i5 - 9i3 + di*5 + 9i*3 - 3i*2 wrt i. 180i*2 Find the third derivative of -8s*5 + 66s*2 - 114s*2 + 73s*2 wrt s. -480s*2 Suppose 7i + 4 = 8i. Find the second derivative of -4f*4 - 2f + 9fi - 2f wrt f. 60f2 Let d(u) be the third derivative of 1/12u*4 + 0 + 0u - 4u2 - 1/3u*3. Differentiate d(z) wrt z. 2 Find the second derivative of -5p - 3p + 12p*5 - 7p*5 wrt p. 100p*3 Find the third derivative of 0s*2 - 5s*2 + 71s + 25s5 - 71s wrt s. 1500s2 Let p(q) be the third derivative of q8/280 - q4/6 - q3 + 4q**2. Let x(b) be the first derivative of p(b). Different	{ "pile_set_name": "DM Mathematics" }
3t - 4t + (-2t - 5 + 5)(3 + 1 - 2) + 2t - t + t. 21t Expand (1 - 3 + 0)(30x*4 - 25x*2 + 46x*2 - 23x*2). -60x*4 + 4x*2 Expand (-2l + 8 + 0 - 6)(-l3 + 2l - 3l + 0l). 2l4 - 2l*3 + 2l*2 - 2l Expand 2i2 - i2 + 0i*2 + (-i + 4i + 9i)(3i - i - 4i). -23i2 Expand (3 - 3 + 4)(2l + 3 - 3)(5l + 0l - 3l)(3 - 2 + 4). 80l2 Expand (0 - 2 + 1)(23m - 18m - 6m). m Expand (2x - 4x + x)(10 - 36 - 12)(2x - 4x + x). -38x*2 Expand ((4 - 4 - 1)(0 - 2 + 1) + 2 + 3 + 4)((3n + 2n - 6n)(3n3 - n3 - 3n3) + 1 + 2n*4 - 1). 30n*4 Expand (-688d*3 - 36d*4 + 688d*3)(0 - 3 + 4)(0 - 1 - 2). 108d*4 Expand (4 - 5 + 4)(a*2 - 7a*2 + 3a*2)(-4a + 0a - a + (7a - a - 4a)(-4 + 6 - 4)). 81a3 Expand (-3 + 3 + v2)(-3v - 3v + 5v) - 2v3 + 0v*3 + 0v3 + v3 + 2v3 + 22v - 2v3. -2v*3 + 22v Expand (-3h2 + 3h*2 + 6h*2)(-3h + 2h - h + (3 - 6 + 1)(2h + 0 + 0) + 5h - h - 5h). -42h3 Expand (10q - 4q - 8q)(3q*2 + 2q*2 - 4q*2)(12q2 - 228q + 228q). -24q*5 Expand 6m*5 - 3m*5 + 382m*3 - 431m*3 + (0m*2 + 5m*2 - 4m*2)(m*3 - 5m*3 + 3m*3). 2m*5 - 49m*3 Expand (-509 + 1015 - 506 - 69w)(3w*2 + 0w*2 - 2w*2). -69w*3 Expand ((-2 - 2 + 2)(0x + 2x - 5x) + 5x - 3x + 0x)(0 + 0 + 6). 48x Expand (b + 3 - 3)(-1 + 2 + 1) - 84b + 658b - 279b. 297b Expand (4 - 4 + 4 + (5 - 2 - 1)(17 - 12 + 11))(-2q3 + q3 + 0q3). -36q*3 Expand 128h*2 + 2 + 2 - 5 + 0h + 0h + h2 + 0 + 0 - 2h*2 + 2h*2 - 4h2 + h2 + (-3h - h + 6h)(h - h + 2h) + 1 - 1 + 2h2. 132h*2 - 1 Expand (-2w*2 - 2w*2 + 2w*2)(-42w2 - 2878w + 2876w - 23w*2). 130w*4 + 4w*3 Expand (4 - 2 + 0)(2 + 5 + 0)(3 - 3 - 4d)(1 + 0 + 1)(-3 + 1 + 1)(0 + 0 + 4). 448d Expand (-1 - 2 + 7)(-3p*2 + 3p2 - p4) + 0p3 + 0p*3 - 4p4 + (p2 + 2p - 2p)(p2 + 2p2 - p2) + 2p4 - p4 + 3p*4. -2p*4 Expand (-q - 5q + 27q)(5 + 4 - 12 - 4). -147q Expand (3j + j - 7j)(2 + 0 - 1)(-1 + 2 + 2). -9j Expand (5v4 - 2v*4 + 4v*4)(-3v + 7v + 6 - 3v). 7v*5 + 42v*4 Expand -2x3 + x3 + 0x3 + (-12 + 5 - 11x + 9x)(-x + x + 4x2). -9x*3 - 28x*2 Expand (1 + 0 - 5)((-31 + 31 - 3w)(-5w4 + 3w*4 + 4w*4) + 0w*5 + 3w5 - w5 + 1 - w*5 - 1 + (2w*3 - 3w*3 + 2w*3)(-2w2 + w - w)). 28w*5 Expand (526 + 2266h*2 - 269 - 255)(-h - h + 4h). 4532h*3 + 4h Expand (0 + 0 - z*2)(3z + 2z - 4z + (-2z + 7z - 3z)(4 - 1 - 1))(6z2 - 15z*2 + 8z*2 + 19). 5z*5 - 95z3 Expand 0 + 0 - l4 + (0l - l - l)(3l3 + l3 - 7l*3) - 15l*4 - 5l*4 - 3l*4. -18l*4 Expand 2a*3 - 2a*4 + 3a - 3a + (2a*3 - 2a*3 - 2a*3)(2a - a - 3a) - 63a3 + 63a*3 - 7a*4. -5a*4 + 2a3 Expand c5 - 2c2 + 2c*2 + 10c*5 + 14c*5 + 9c*5 - 2 + 2 + 3c5 + (c2 - 4c2 + c2)(-c3 + c3 + c*3). 35c*5 Expand 19l + 31l - 14l + 2l + 2l - 5l - 4l + 5l - 2l + (-2l + 0l + l)(2 - 1 + 1) + 2l + l - l. 34l Expand (2s*3 + 11s*3 + 0s*3)(15 + s - 15). 13s4 Expand -a - 2a + 2a + 0 + a + 0 + (-3 + 5 - 4)(1 - 1 + 2a) - 2a - 5a + 4a + (161 + 159 - 365)(0a - 3a + 5a). -97a Expand (4h - 5h - 2h - 3h + 4h + h + 6h - 3h - h - 3h - h + 6h + (-3h + 3h + 2h)(-1 + 4 - 2) + 2 - 2h - 2 + 1 + h - 1)(11h - 107h - 30h). -504h2 Expand -q5 + q*5 + 5q*5 + (-2q5 - q5 + q*5)(-1 - 3 + 6) + 3q - 21q + 11q + 11q*5. 12q*5 - 7q Expand (0 + 0 + 2u)(-154u + 156u + 132 + 192). 4u2 + 648u Expand 226o + 224o - 455o + (0 + 0 - 2o)(-1 - 4 + 3). -o Expand 3 + 1 + 3v*3 - 2 + 3v*3 - 4v3 - v3 + (0 + 2 + 0)(-3650v*2 + 3650v*2 + 34v*3). 69v*3 + 2 Expand ((3u + 7u - 5u)(0u - 3u + 4u) + 7 + 4u2 - 7 + (0u*2 - 3u*2 + 4u*2)(1 + 0 + 1))(0 - 3u + 0). -33u3 Expand (-g + 55 - 11g + 14g)((-4 + 5 - 3)(4 - 2 + 0) - 5 + 3 + 4). -4g - 110 Expand ((-p - 3 + 3)(-9 + 9 - 7p) + 3p2 - p2 - 5p*2)(-p + 0p - 2p)(-p - 2p + 2p). 12p*4 Expand (4x - 2 + 4x3 - 4x)(209 - 209 + 145x). 580x4 - 290x Expand -11y3 + 3 - 3 + (2 - 2 - 3)(-3y3 + 5y*3 - 4y*3) - 659y - 2y3 + 659y + 3. -7y3 + 3 Expand -4h + h + 2h + (0h + 0h + 2h)(-2 + 3 - 3) + 16h - 26 - 10 - 18h + 0h + 0h + 2h + 0h + 0h - 2h + (-1 + 3 - 4)(3h - 3h + 2h). -11h - 36 Expand 98 - 81 - 3y + 0y + (0 + 2 - 3)(-1 + 3 + 0)(4y - 3y - 2y). -y + 17 Expand (-2c + 5c - 2c)(36 - 9c*3 + 4c*3 - 51). -5c*4 - 15c Expand (8y - 16y - 9y + 1 - 1 + 3y + (-1 + 1 + 2y)(-1 - 4 + 3) + y - 5y + 3y - 4 + 4 - y)(-6 + 6 - 4y). 80y2 Expand -12m4 - m3 - 13m4 + 0m*3 + (1 - 1 + 2)(2m4 - 3m*2 + 3m*2) - 2m*4 - 3m*4 + 19m*4. -7m4 - m3 Expand (-1 + 3 + 1)(-g - g + 0g)(39g*3 + 25g3 + g3). -390g4 Expand 85m*3 - 31m*3 + 2 - 66m*2 - 56m*3 + (2m*3 - 2m3 - m3)(-3 - 2 + 3) + m3 + m3 + 0m*3. 2m*3 - 66m*2 + 2 Expand (-7x*3 - 5x*3 + 3x*3)(-18 - 15 - 109 - 6 + 2). 1314x3 Expand (2w*2 + 217w*4 - 214w*4 + 0w*2)(4 - 1 - 2)(5 - 3 + 0). 6w*4 + 4w*2 Expand -3r5 - r5 + 5r5 + (4r - 4r + 5r*2)(-4 + 0 + 0)(-r3 - 3r*3 + 5r*3). -19r*5 Expand (2x + 2x - 6x)(-4x + 5x - 3x) - 2x2 - 3x*2 + 3x*2 - 6x*2 - 6x*2 + 18x*2 + 0x2 + x2 - 4x2. 5x*2 Expand (-6l*2 + 4l*2 + 3l*2 + (0l - l + 5l)(3 - 2l - 3))(8 - 4 + 4)(-1 - 4 + 0). 280l2 Expand (0 + u2 + 0)(0u + u + 13u)(-1 - 1 + 1). -14u3 Expand -2 + 2 - 2j5 - j4 + j4 - j5 + (-j + 1 - 1)(-1 + 1 + j4) + 3j*3 - 3j3 - j5 + (-329j5 + 180j*5 + 39j*5)(0 + 1 + 1). -225j5 Expand (-6t - 7 + 7)(-12 + 2 + 1). 54t Expand (9 - 2 + 12)(-10d + 10d - 1 - 4d*2). -76d*2 - 19 Expand -3z*2 + 2z*5 + 2z*2 - 3z*5 + (-44 - 19 - 5)(0z + 3z*5 + 0z). -205z5 - z2 Expand (0h*3 + 3h3 + h3 + 0h3 + 5h*3 - 3h*3 + (h + 0h + 0h)(-16h2 - 17 + 17))(2h - h + h - 1). -20h*4 + 10h*3 Expand -4r + 0r + 5r + (8 + 0 - 3 + (-2 - 1 + 5)(2 + 0 + 0))(-2 - 2r + 2). -17r Expand (-4 + h + 4)(0h + 5h + 0h + (-2h + 0h + h)(-3 + 0 + 4) + 2h + h - h) + 4220 - 4220 + 45h2. 51h*2 Expand (3 - 4 - 6o + 3)(-2o*2 - 9o*3 - 3 + 3o*3 - 3). 36o*4 - 4o*2 + 36o - 12 Expand -y2 + y2 + 4y2 - 2y*2 + 5y - 5y + 1 + y2 - 1 + (-1 - 2 + 4)(2y2 - y + y) + (8 - 2 + 13)(1 - 1 - y*2). -14y*2 Expand (20 + 9 - 11)(1 - 1 - 3)(-3f + f + 0f) + 3f + 0f - 5f + (1 + 2 - 5)(-2f + 3f + 0f). 104f Expand (-2u - 3 + 3 + 0u + u + 0u + (-6 + 2 + 5)(-2u + 3u + u))(43u - 43u - 10u2). -10u*3 Expand -2h + 7h + 12h + 4h + 40h + 20h + (h - 5h + 2h)(-1 + 2 + 1). 77h Expand (1 - 11 - 3)(-60o + 96o - 53o)(-4 + 5 - 3 - 1 - 4 + 4 + (1 + 0 - 3)(-2 - 3 + 3) - 1 - 3 + 5 + 2 - 2 + 2). 884o Expand (-2r + 2r - r)(0r*3 + 2r*3 - 4r*3) + (-3r*2 + 4r*2 + 0r*2)(-5r2 + 4r*2 + 15r*2). 16r*4 Expand (4c*3 - 2c*3 + 4c*3)(-3c2 - c2 + 2c*2) + (-3c - c + 5c)(0c4 - 2c4 - c4). -15c5 Expand (-3j2 - j2 + j*2)(-4 + 4 - j) + 7j3 - 1592j + 1592j + (3j - j - j)(2j2 - j2 + j*2). 12j3 Expand (i4 - i4 - i4)(-28 + 19i + 28)(4 + 0 + 0) + (0i*4 + 3i4 - i4)(0 + i + 0). -74i*5 Expand (-14b - 21b + 11b)(-1 - 19 - 1)(-4 + 0 + 2). -1008b Expand (-2f + 56f + 20f)(-31f - 4f2 + 31f) + (-f - 5f + 4f)(f2 + 2f2 - f2). -300f3 Expand (2x4 - x4 + 0x4)(316 - 9 + 1). 308x4 Expand -18o*2 + 16o*2 + 3o*2 + 3o*3 - 1 - 3o + (3o - 1 + 1)(-2o2 - 2o*2 + 2o*2). -3o3 + o2 - 3o - 1 Expand r - r5 - r + 4r - 4r + r5 + (4r*4 - 3r*4 + 0r*4)(-r + 0r + 3r) - r*5 + 3r5 - r5 + 4r5 + 0 + 0 - 77r*3 + 77r*3 + 13r*5. 20r*5 Expand (14 - 11u*2 - 14)(16u2 - 8u*2 - 7u*2 + 6). -11u*4 - 66u*2 Expand ((-m - m + m)(-2m + m + 3m) + 0m2 + 3m2 + m2 - 3m2 + 5 - 5)(-5m + 4m + 2m)((0m + 2m + 2m)(3 - 4 + 2) + 2m - 6m + 2m). -2m*4 Expand (5l + 0l - 4l)*(-3 + 7 + 0 + (40	{ "pile_set_name": "DM Mathematics" }
c3 + 495c*3 - 215c*3 - 1 to oc + jc2 + qc*3 + r and give r. -4 Express (-302 + 356 - 175)(2s + 2s - 5s)(s + 2s - 6s) - s*2 + 3s2 - s2 as b + fs2 + os and give f. -362 Express (0 - 2 + 4)(-x - 2x + 0x) - 69 + 514x + 69 in the form fx + i and give i. 0 Rearrange -872t*2 - 406t*2 - 105t*2 - 181t*2 to the form gt + m + at2 and give a. -1564 Rearrange 5j*3 + 2j - 5j4 - 5 - 2j + 0j - 4j*3 - 3j to tj3 + z + sj*4 + xj + rj2 and give x. -3 Rearrange (-1 - 7j + 1 + 4j + 0j - 2j + (-2j - j + 4j)(-2 + 2 - 1) + 39 - 39 - 32j + 0j - j + 2j)(5 - 3 + 2) to the form o + gj and give g. -148 Rearrange 1 - 25 + 3 + 5 + 3g + 17g to the form h + yg and give h. -16 Rearrange (-2 + 3 + 2)(-220b - 115b - 172b + 3b - 2b - 3b + (2 + 1 - 1)(0b - 3b + 2b) - 2b - b + b) to yb + o and give y. -1539 Express -2a*2 - 3a*3 + 6a*3 - 2a*3 - 3 - 13a + 16a in the form y + ba + va3 + ta2 and give b. 3 Rearrange j3 + 2j - 2317j*2 - 2 + 2317j*2 to the form ij + yj3 + kj*2 + r and give r. -2 Express -55q + 48q - 9 - 3 as l + uq and give l. -12 Rearrange 10o + 5o + 9o + 2o*3 to the form po*3 + l + no + to2 and give t. 0 Express -2w*3 - 54 + 10w*4 - 2w + 3w3 + 55 in the form qw*3 + g + pw*4 + tw*2 + jw and give g. 1 Rearrange 2x3 - x - 90x*2 - 5 + 89x*2 - 2x - 1 to nx3 + w + fx*2 + kx and give k. -3 Express (-31v + 11v - 17v)(2v + 2v + 5v) as kv + h + uv2 and give u. -333 Rearrange (5i - 5i - i)(-3i + 0i + 4i) + 2i*2 + 2i*2 - 2i*2 - 99i*2 + 61 - 61 to m + vi*2 + oi and give v. -98 Express -4y2 - 2y*4 + 14y + 0y - 2y - 3y + 1 + 5y*2 in the form ry*4 + fy*2 + i + ay*3 + ny and give r. -2 Express (1 + 1 - 1)(-10 + 10 - 10b)(0 + 22 - 1) as l + vb and give v. -210 Rearrange -3f2 - 2f*2 + 1 - 4f*2 - 25 + 6f*2 to hf + v + of2 and give v. -24 Rearrange 13o*2 - o + 27o*2 - 18o*2 - 3o - 2o to s + qo*2 + mo and give m. -6 Rearrange -9767 - 118n2 + 9767 - 7n to xn + hn*2 + w and give x. -7 Rearrange 121r*2 - 1 - 306r*2 - 1531r + 1530r to pr + l + tr2 and give t. -185 Express -40t*2 + 64t*2 + 118t*2 + 114t*2 as s + wt + at2 and give a. 256 Rearrange (3w - 5w + 3w)(33w - 5w + 2w) to tw + h + aw*2 and give a. 30 Express (-4a + 3a + 3a)(12 - 185 - 102) as o + ga and give g. -550 Express -18 - 5l2 + 4l*2 + 12 - 7l*2 - 5 in the form u + wl + ml2 and give m. -8 Rearrange 10 + 18 + 17f - 38 + 14 to z + xf and give z. 4 Rearrange 38 - 23 + 254x*2 - 15 + 195x*2 to the form mx + qx2 + a and give q. 449 Express 1318k3 - 2 - k2 - k*2 + 1 - 1319k*3 in the form j + dk + wk2 + zk*3 and give w. -2 Rearrange 7z*3 + 16 + 11z + 52z - 18 - 6z*3 - 2z*2 to y + qz*2 + hz*3 + sz and give s. 63 Express (-43g - 1074 + 1074)(22 + 5 - 3) + 6g - 3g - 2g - 1 - g + 1 + (0 - 4 + 2)(0g + 0g - 2g) in the form lg + y and give l. -1028 Rearrange (3m2 - m2 - m2 + (2m*2 - 2m2 + m2)(3 - 5 + 3))(-5m - 5m + 3m) + 0 + 9m*3 - 2 + 0 to sm + am2 + y + tm3 and give t. -5 Express (j2 - 1 + 2j2 - j2)((-83 - 12 - 48)(-1 + 1 - 2) + 0 - 1 + 0) in the form zj + v + kj2 and give v. -285 Express (-3i + 3i + 3i*3)(3 - 4 + 2) + 3 - i*2 + 2i + 31i3 - i2 - 25i*3 in the form ni + w + si2 + vi*3 and give v. 9 Rearrange (-3v*2 + 4v*2 + 0v*2)(44 + 32v + 17v - 48v) to mv + bv3 + lv*2 + w and give l. 44 Express 126i3 + i2 + 1 - 54i4 - 270i*3 + 143i*3 + 5i in the form di3 + bi + qi4 + p + vi*2 and give p. 1 Rearrange (-5w - w + 3w)(11 - 72 - 49 + 23) to x + vw and give v. 261 Rearrange -2553q + 1264q + q2 - 3q*2 to the form sq + v + tq2 and give s. -1289 Express (-1 + 2 + 0)(3p2 - 3p*2 + 3p*4) - 84p*2 + 78p*2 - 2p*4 - 181p*2 in the form jp + tp4 + ap*2 + gp*3 + d and give g. 0 Express (5s + 0 + 0)(4 - 2 + 0) - 8 + 5 - 5s - 3 in the form ds + a and give d. 5 Rearrange 2u + 8u - 25u - 15u + (-3 + 3 - 2)(5 - 5 - 3u) + 0u - 3u + u to ou + q and give o. -26 Express 3y - 14y2 + y2 + 0y + 10y*2 - 2y - 116 as hy + p + vy2 and give v. -3 Express (q2 - 5q2 - q2)(-3q2 - 2q2 + q2) + 27 + 35q4 - 27 + q4 - q4 + 2q*4 in the form zq*2 + pq + rq3 + l + iq*4 and give l. 0 Express 696n - 696n - 269n*2 as fn + hn2 + u and give h. -269 Express 177 + 171 - 348 - 145m as i + vm and give v. -145 Rearrange ((1 + 3 - 2)(-5n + 3n + 3n) + 4n - n - n)(568 - 373n - 21n - 566) to p + on*2 + rn and give o. -1576 Express (2v + 3 - 6 + 1)(-4 - 65 + 281) in the form j + xv and give x. 424 Express -147p - 314p - 160p + 95p - 437p as dp + o and give d. -963 Express -15197y + 30331y + 1 - 15266y in the form o + ty and give o. 1 Express (-6 + 11 + 7)(-5 + 3 - 2)(-2 + 2 + 4d) as hd + l and give h. -192 Rearrange (a + a + a)(0 - 2 + 1 - 3 + 4 + 0 + (4 - 2 - 1)(2 - 1 + 1) - 5 + 1 + 3 + 2 - 2 + 1) to the form p + ja and give j. 6 Rearrange 17d2 + 0d*2 + 4 + 2839d - 2839d to md + w + qd2 and give q. 17 Express -p3 - 7p*2 - 2p*2 - 6p*2 + 3p*2 in the form hp + dp3 + wp*2 + m and give w. -12 Rearrange -64p - 87p + 5p - 40p - 102p to the form t + dp and give d. -288 Rearrange 3z*2 - 27z - 7z3 + 25z - z*4 - 4z*2 + 2 to tz*2 + i + oz*4 + nz*3 + az and give i. 2 Express -2x + 1 + 16x*3 - 1 - 405x*4 + 376x*4 in the form px*4 + lx*2 + mx + g + yx3 and give y. 16 Rearrange (-569 - 855 - 504 + 55)(-3l + 3l - 2l) to the form z + ol and give o. 3746 Express (218 + 161p2 - 32p*2 + 192p*2 - 218)(p2 + p2 - 4p2) as yp + zp2 + j + hp*3 + rp*4 and give r. -642 Rearrange (-3v - v + 2v)(-71v - 47v + 26v) to cv + b + kv2 and give k. 184 Rearrange 14w + 38w - 89 + 89 to the form k + hw and give h. 52 Rearrange (-4a + 10a - 19a)(a - a - 4a2) to the form ua*3 + b + qa + ma2 and give u. 52 Rearrange 173y - 5 + 2 + 1 - 486y to k + sy and give s. -313 Express (7 - 4f - 7)(-2 - 3 + 3) - 10f + 3f + 4f as b + af and give a. 5 Express -72o3 - 46o - 16o2 + 45o + 18o2 as yo + wo3 + jo*2 + p and give y. -1 Express 189p*3 - 2p + 10 - 10 + 1 in the form yp + fp*3 + tp*2 + c and give c. 1 Express (2 - 6 + 3)(-u2 - u2 - 3u2)(-1 + 5 - 3)(3u + 0 + 0 + (-3 + 2 + 9)(-1 - u + 1) + 2 + u - 2) in the form nu + du3 + h + vu*2 and give d. -20 Rearrange 4g*2 - 279g - 5g2 + 281g + 6g3 + 2g*2 to vg*3 + l + wg + og2 and give l. 0 Express 6i + 2 - 15i + 22i + 19i as q + oi and give o. 32 Rearrange 832u3 + 15u - 21u - 803u*3 to au + o + cu3 + nu*2 and give o. 0 Express 3 - 3 - 415r - 50r + (-2r + 5 - 5)(-1 - 4 + 3) + r + 2r - 5r - 6r + 3r + 2r - r + 0 + 0 + (-3 - 4 + 5)(1 - 1 - r) as jr + t and give j. -463 Rearrange 4q2 + 3q*2 - 5q*2 + (q - 2q - 3q)(-373q - 404q - 228q) to hq + w + kq2 and give k. 4022 Rearrange (-j - 2j + 4j)(3j - 2j + 0j) + 2 + 7j*2 - 2 + (3j - j + j)(-10 + j + 10) + 5j*2 - 2j2 - j2 to the form p + aj + kj*2 and give k. 13 Express -24n - 92n - 153n + 65n in the form vn + p and give v. -204 Express -176 + 50 + 3w + 53 as dw + o and give d. 3 Express (-3b2 - 5b*2 - 3b*2)(-8b + 6b - 24b)(-4 + 2b + 4) as nb*3 + jb*2 + f + lb*4 + ab and give l. 572 Rearrange (2 - 5 + 1)(z - z - z) + (z - 5z + 26z)(-13 + 0 - 7) + 1 - 1 + 2z to the form y + oz and give y. 0 Rearrange (-p*2 + 0p*2 + 2p*2)(2p - 3p + 0p) + 2p*3 - 343p + 385p + p3 to np*2 + yp + up3 + z and give u. 2 Express (z + 1 - 1 - 2z + 3z + z - 5z + 5z - z + (5 + 0 - 2)(0z + 0z - z) - 1 - 2z + 1 + 3z + 3z - 7z)(0 + 0 + 3z) as oz + hz*2 + s and give h. -12 Express (46z - 66z - 68z)(4 - 6 + 1)(-4z - 2z + 4z) as uz + l + sz2 and give s. -176 Rearrange 1 + 17 + 4n - 5n - 1 to bn + s and give b. -1 Express v*3 - 4 + 4v - 2v - 2v2 + v4 + 12v + 0v*3 + 3v*2 in the form gv*4 + h	{ "pile_set_name": "DM Mathematics" }
3, 0 Let n = 80 - 76. Determine g, given that 27/5g3 - 21/5g*2 - 3g*n + 6/5g + 0 + 3/5g5 = 0. 0, 1, 2 Let n = 71223/12035 + -213/83. Let t = -16/29 + n. Find r such that 0 + 4/5r*2 - 18/5r*3 + tr*4 + 0r = 0. 0, 2/7, 1 Factor -5h4 - h + 16h*3 - 2h + 8h + 5h*2 - 21h*3. -5h(h - 1)(h + 1)*2 Let d be (-91)/(-52)(-3)/(-7). Solve -di3 + 3/2i*2 + 0 - 3/4i = 0. 0, 1 Determine g so that 0 + 16/7g - 4/7g*2 = 0. 0, 4 Suppose 2i = -h + 8, 0i = 3h + 5i - 23. Factor 0g + 4g3 + 3g - hg - g3. 3g(g - 1)(g + 1) Let n(c) be the first derivative of -7 + 1/2c4 + 0c + 2/3c3 + 0c*2. Factor n(i). 2i*2(i + 1) Suppose -4 = -2v - 0v. Find n such that 2n4 - nv - 7n - n - 5n2 + 8 + 4n3 = 0. -2, 1 Let p(i) be the third derivative of -i7/70 - i6/10 - i5/4 - i4/4 - i2. Factor p(f). -3f(f + 1)*2(f + 2) Let k(b) = -b*2 + 12b + 4. Let a be k(12). Suppose ao - 1 = -3w + 2o, 2w = 5o + 26. Factor 3n4 - n4 + 4n3 + n5 - 3nw. n3(n + 1)2 Let y be ((-20)/(-16))/((-20)/(-8)). Factor 1/4v - y + 1/4v2. (v - 1)(v + 2)/4 Let f(b) be the third derivative of -1/30b6 + 1/12b*4 - 1/5b*5 + 0b + b*3 - 7b*2 + 1/168b*8 + 1/35b*7 + 0. Solve f(a) = 0. -3, -1, 1 Let q be (-3 - (-4 + 2))/(-1). Let z be (-3)/(-6)(1 + q). Suppose z - 3s + s2 + 0s + s = 0. What is s? 1 Let h(w) = -w*3 + 21w*2 - 19w - 17. Let o be h(20). Suppose 2z + 4z*2 + 7/2z*4 - 19/2z*o + 0 = 0. Calculate z. -2/7, 0, 1, 2 Let h be 2-1 + 84/21. Factor 0x + 1/3x*5 + 0x*h + 0 + 1/3x*4 + 0x3. x4(x + 1)/3 Let -15m*2 - 12m*3 + m - 12m*2 - 7m = 0. Calculate m. -2, -1/4, 0 Let v(i) = 12i2 - 11i - 1. Let h(w) = 13w2 - 11w - 2. Let f(q) = 3h(q) - 4v(q). Factor f(d). -(d - 1)(9d - 2) Let n be (3/(-5))/(12/(-40)). Let o(y) be the first derivative of 0y3 - n - 1/2y4 + y2 + y - 1/5y5. Factor o(s). -(s - 1)(s + 1)*3 Let 2/3v*2 - 10/3v + 8/3 = 0. What is v? 1, 4 Let v(w) be the third derivative of w6/120 - w5/15 + w*4/12 + 2w*3/3 + 11w*2. Let x be v(3). Solve 1/2z + 1/2z2 - x = 0 for z. -2, 1 Let l(t) be the second derivative of -t5/20 + t4/4 + 3t*2/2 + 12t. Let p be l(3). Find q, given that 8/5q + 0 + 6/5q*4 - 16/5q*2 + 2/5q*p = 0. -2, 0, 2/3, 1 Suppose -4r - 9 = -3r. Let k be (-51)/r - (-4)/(-6). Let -11g*3 - 7g*2 - kg3 - g - g2 = 0. Calculate g. -1/4, 0 Factor 64 + 144b + 39b*2 - 10b*3 - 36b*3 - 3b*4 - 198b*2. -(b - 1)(b + 8)*2(3b + 1) Let m(r) be the third derivative of 2r7/525 + r6/200 - r5/60 - r4/40 + r*3/30 - 61r*2. Factor m(y). (y - 1)(y + 1)*2(4y - 1)/5 Solve 3/2h + 0 - 9/4h2 - 3/4h*5 - 3/4h*3 + 9/4h*4 = 0 for h. -1, 0, 1, 2 Factor -5/2q*3 - 25/2q - 5 - 10q2. -5(q + 1)*2(q + 2)/2 Suppose 3z4 - 8z*4 + 21z - 6z2 + 12z*4 + 7z + 8 - 19z3 = 0. Calculate z. -1, -2/7, 2 What is x in 6 + 27x - 47x + 25x - x*2 = 0? -1, 6 Let p(j) = 3j*3 + 4j*2 + 4j + 4. Let m(n) = -4n3 - 5n*2 - 5n - 5. Let y(u) = 4m(u) + 5p(u). Factor y(w). -w*3 Suppose 2 = -4u - 22. Let h(n) = n*2 + 4n - 7. Let g be h(u). Solve 4cg - 3c*3 - 3c*2 + 0c2 - c5 + 3c4 = 0 for c. -1, 0, 1 Let m(v) = -2v - 5. Let i be m(-4). Suppose -4g2 - 3g*i + 3g*2 + 4g*2 + 6g3 = 0. Calculate g. -1, 0 Let c(n) be the third derivative of -n7/1155 - n6/660 + n5/330 + n*4/132 + 3n*2. Factor c(s). -2s(s - 1)(s + 1)*2/11 Let y(k) be the second derivative of -k - 1/8k*3 - 3/8k*2 - 1/40k*6 + 3/40k*5 + 0 + 1/8k*4 - 1/56k*7. Factor y(h). -3(h - 1)*2(h + 1)*3/4 Let s = 344 - 1016/3. Let c(r) be the first derivative of -sr*3 + 4r - 5/2r4 - r2 + 1. Factor c(t). -2(t + 1)*2(5t - 2) Let r(h) = -h2 + 5h - 3. Let l be r(7). Let z = l + 35/2. Factor 0 + zo2 + 0o - 1/2o3 - 1/2o*4 + 1/2o5. o2(o - 1)2(o + 1)/2 Let n(i) = -2i - 8. Let b be n(-6). Let s(f) be the first derivative of 1/6f*2 + 0f + 0f3 + 2 - 1/12fb. Determine r so that s(r) = 0. -1, 0, 1 Suppose m4 + 4m3 + 0m*3 + 0m*3 + 3m2 = 0. What is m? -3, -1, 0 Let h(x) = -x3 - 5x2 - 8x - 3. Let n be h(-3). Solve 2/7dn - 2/7d + 0 - 2/7d2 + 2/7d*4 = 0 for d. -1, 0, 1 Let o = 1/94 - -87/658. Factor 1/7q*2 + o + 2/7q. (q + 1)2/7 Let r(t) be the second derivative of -t5/35 - t*4/7 - 2t*3/7 - 2t*2/7 + 10t. What is f in r(f) = 0? -1 Factor -3v2 + 7v + v + 15v2. 4v(3v + 2) Let s = 289/3 + -865/9. Let k(o) = -3o. Let w be k(-1). Factor -2/9i*2 + 2/9i*w + s - 2/9i. 2(i - 1)2(i + 1)/9 Let i be 28/72 + -4(-5)/180. Suppose 1/4 + ix*2 - 1/2x*3 - 3/4x*4 - 1/4x*5 + 3/4x = 0. Calculate x. -1, 1 Let z(p) be the second derivative of -p5/100 - p4/60 + p*3/15 - p. Factor z(w). -w(w - 1)(w + 2)/5 Let w = -183 - -554/3. Factor 2/3 - a - wa*2. -(a + 1)(5a - 2)/3 Factor -8/3v - 2/3v2 + 10/3. -2(v - 1)(v + 5)/3 Suppose 3b + 0b - 12 = 0. Suppose 0 = h + 4, -g + bh + 22 - 4 = 0. Factor -6d3 - 6d*5 + 3d4 - d4 + 7d - 2d*g - 3d + 8d5. 2d(d - 1)2(d + 1)(d + 2) Let l = -101 + 101. Determine v so that lv + 0v4 + 2/3v*5 - 2/3v*3 + 0 + 0v*2 = 0. -1, 0, 1 Suppose 3k - 6 + 3 = 0. Let g be (-57)/(-18) - k/6. Factor 0 - 2/5i4 - 4/5i*g - 2/5i*2 + 0i. -2i2(i + 1)*2/5 Find r, given that 5/4r + 5/4r5 + 5/2r*2 - 5/2r*3 - 5/4r4 - 5/4 = 0. -1, 1 Let m(w) be the second derivative of w4/42 + w3/21 + w. Determine t, given that m(t) = 0. -1, 0 Let v(p) be the first derivative of p4/42 + p*3/21 - 2p - 3. Let q(b) be the first derivative of v(b). What is s in q(s) = 0? -1, 0 Let j(q) be the second derivative of -q*5/30 + 23q*4/84 - 2q*3/7 - 2q*2 - 7q. Let o(b) be the first derivative of j(b). Suppose o(y) = 0. What is y? 2/7, 3 Let l(m) be the third derivative of -7m6/60 + 2m5/5 + m4/3 + m*2. Factor l(b). -2b(b - 2)(7b + 2) Let u(g) = 3g*2 - 4g - 2. Let v(x) = 13x2 - 15x - 8. Let m(z) = -9u(z) + 2v(z). Let i be m(6). Determine q so that -2q2 + iq + 1 + 6 - 3 = 0. -1, 2 Let c(a) = a*2 - a. Let b(h) = -4h*2 + 5h. Let r(j) = 6b(j) + 22c(j). Suppose r(z) = 0. What is z? 0, 4 Let t(s) = -s*3 + 28s*2 - 52s + 2. Let u be t(26). Let 57/8hu + 21h*4 - 171/8h*3 - 6h*5 + 0 - 3/4h = 0. Calculate h. 0, 1/4, 1, 2 Let p(k) be the first derivative of k*6/3 + 18k*5/35 - 5k*4/14 - 6k*3/7 - 2k*2/7 + 4. Let p(l) = 0. What is l? -1, -2/7, 0, 1 Let x(d) be the second derivative of 0d*2 + 0d*4 + 0 + 1/720d*6 - d + 1/240d*5 + 1/6d*3. Let z(a) be the second derivative of x(a). Factor z(t). t(t + 1)/2 Let j(u) = -u*3 + 5u*2 - 3u - 1. Let p be j(4). Factor 3wp - 8w + 5w - 6 - 2w*2 + 8w*2. 3(w - 1)(w + 1)(w + 2) Suppose -24 = 4h - 8h. Let d be 8/3(-24)/(-16). Find w, given that 2w*2 - hw + d - 2 + 2w = 0. 1 Let v(k) be the second derivative of -1/6k*4 + 3/20k*5 + 0k*2 + 0k*6 - 1/42k*7 + 0k*3 + 0 + 9k. Suppose v(s) = 0. Calculate s. -2, 0, 1 Suppose 0 = -3a + 3, i + 2a = -2a + 8. Let g(o) be the second derivative of 0o*2 + 1/20o*i + 1/50o*5 + 1/30o*3 + 0 + o. Factor g(y). y(y + 1)(2y + 1)/5 Let z(f) be the first derivative of 2f3/3 + f2 - 9. Factor z(v). 2v(v + 1) Let u = 5363/5 - 1069. Determine w, given that -12/5w - 2/5w2 - u = 0. -3 Let i(u) be the first derivative of -u5/20 - u4/8 - u3/12 - 8. Solve i(t) = 0 for t. -1, 0 Let b be 18/6 - 4/2. Let o be (-2)/b + 60/25. What is f in -of*4 + 4/5f*3 - 4/5f + 2/5 + 0f2 = 0? -1, 1 Let g(b) be the first derivative of -3 + 0b*2 + 0b + 1/18b3 + 1/12b*4 + 1/30b*5. Let g(f) = 0. What is f? -1, 0 Suppose -2d - 2 = -d. Let z = d + 6. Factor 4v4 - 3vz + v4. 2v4 Let n(b) = -15b*4 + 15b*3 - 3b*2 - 24b + 9. Let u(w) = -7w4 + 8w*3 - 2w*2 - 12w + 5. Let i(l) = -4n(l) + 9u(l). Factor i(d). -3(d - 3)(d - 1)*2(d + 1) Let q(l) = l*5 - 2l*4 + 3l*3 - 2l*2 - 2. Let p(i) = -5i*5 + 10i*4 - 16i*3 + 11i*2 + 11. Let r(y) = 4p(y) + 22q(y). Factor r(n). 2n*3(n - 1)*2 Let x = 11 - 8. Suppose 21 = 2n + xj, -2n - 4 = -4j + 10. Let -2/9o**4 +	{ "pile_set_name": "DM Mathematics" }
- 70m2 - m - 13. Suppose z(p) = 0. Calculate p. -16/3, -3, -1 Let w be 18/(-27)36/(-4). Factor -5 - 15 - 8q + 5q2 + 15q*w + 10 + 5q*4 - 7q. 5(q - 1)(q + 1)*2(q + 2) Let m = 2199 + -24188/11. Let z(s) be the first derivative of -1/33s6 + 7/11s*2 + 16/33s*3 + ms*4 - 4/55s*5 + 4/11s + 15. Factor z(r). -2(r - 2)(r + 1)4/11 Let n(w) be the third derivative of w7/4200 - w6/900 + w5/600 - 11w3 - 49w*2. Let r(c) be the first derivative of n(c). Factor r(l). l(l - 1)*2/5 Determine z so that -41/2z - 1681/4 - 1/4z2 = 0. -41 Let w be (-147)/273(3 + (-19)/2). Factor -wt - 2 - t2 + 1/2t*3. (t - 4)(t + 1)2/2 Let z(s) be the first derivative of s4/3 + 2060s3/9 - 2s*2/3 - 2060s/3 + 264. Solve z(l) = 0 for l. -515, -1, 1 Let 999m2 + 231m*3 + 234 - 979 - 13m*4 + 840m + 469 + m*4 = 0. What is m? -2, 1/4, 23 Let h be -10 + (3/(-2))/(6/(-20)). Let i be (-3 + (0 - -3))/(10/h). What is y in -1/2y*5 + 32y*2 + 6y*4 + 0 - 24y*3 + iy = 0? 0, 4 Let -8/9d - 4/9d*3 + 14/9d*2 - 2/9d*4 + 0 = 0. What is d? -4, 0, 1 Suppose 0 = 3472b - 3480b + 75072. Let o be (-1)/6 + 2668/b. Factor 10/17l - 14/17l2 + 6/17l*3 - o. 2(l - 1)*2(3l - 1)/17 Let u(g) be the first derivative of 2g*6/3 - 32g*5/5 + 17g*4 - 40g*3/3 + 879. Suppose u(c) = 0. Calculate c. 0, 1, 2, 5 Let d be 29-1 - (-34)/(-17). Let f = d - -34. Factor 27x2 + 1 + f - 15x*2 + 6x - 10x2. 2(x + 1)(x + 2) Solve 18l*2 + 2l*2 + 3055 + 5l + 10l - 3060 = 0. -1, 1/4 Let b be ((-32)/(-40)-2)/(21/(-20)). Let h = b + -76/105. Factor hy5 - 6/5y*4 + 0y + 0y3 + 2/5y*2 + 0. 2y*2(y - 1)*2(2y + 1)/5 Factor -8a*2 + 251a*2 + 926a + 22a2 + 2 + 4 + 43a*2. 2(a + 3)(154a + 1) Let t(p) = -3p3 - 9p*2 - 14p + 34. Let m(v) = -38v3 - 109v*2 - 175v + 407. Let f(g) = 2m(g) - 25t(g). Factor f(d). -(d - 6)(d - 3)(d + 2) Let f(o) be the first derivative of 0o + 95 - 75/4o*2 - 5o*3 - 3/8o*4. Solve f(r) = 0. -5, 0 Let j(r) be the second derivative of -16r*7/189 + 8r*6/135 + 47r*5/90 - 28r*4/27 + 19r*3/27 - 2r*2/9 - 1527r. Solve j(s) = 0 for s. -2, 1/4, 1 Let f = -212 - -167. Let z be -236/f. Find h, given that 2/5h3 - 6/5h + 0 - zh2 = 0. -1, 0, 3 Let y(v) = v3 + 2v*2 + 3v + 1. Let r be y(0). Factor 5h + 9 + r - 3 + 7 - h2. -(h - 7)(h + 2) Let s = 21713/48852 - 1/48852. Factor 4/9u2 - 4/9u - su4 + 4/9u*3 + 0. -4u(u - 1)2(u + 1)/9 Let n be ((-1)/(-27) - (-52 + 166687/3348)) + (-42)/(-8). Suppose -3/2b4 + 6 - 9/2b*2 + 15/2b*3 - nb = 0. What is b? -1, 1, 4 Suppose -4l + 2d = -10, -4l - 3d + 11679 = 11654. Let 0 - 32/9n2 - 1058/9n*l - 368/9n*3 + 0n = 0. Calculate n. -4/23, 0 Let x(d) = -3d2 + d + 6. Let t(r) = -18r*2 + 152r - 1554. Let q(n) = -t(n) + 5x(n). Solve q(w) = 0 for w. 16, 33 Factor -i4 + 6434i*2 - 90i + 405 + 90i3 - 4i*4 - 6834i*2. -5(i - 9)*2(i - 1)(i + 1) Suppose 0d = -14d + 70. Factor ld + 2165l*4 - 2162l*4 - 3l2 - l2. l*2(l - 1)(l + 2)2 Let u be (-4)/(-18) - ((-962)/(-117) + -8). Let h be 14/(-3)30/(-35) - u. Solve -33/7b2 - 10/7b*3 - 1/7b*h - 16/7 - 40/7b = 0. -4, -1 Let x(z) = z*2 - z. Let h(b) = 2b*2 + 5b. Let p(c) = 10c + 62. Let u be p(-6). Let k(q) = uh(q) - 6x(q). Factor k(i). -2i(i - 8) Let j(n) = -n3 - 205n*2 + 3n + 206. Let h(p) = p3 + p2 + p. Let z(b) = -h(b) + j(b). Suppose z(g) = 0. Calculate g. -103, -1, 1 Factor 577f - 30911 + 117f - 136f + 30215 + 1060f + 14f2. 2(f + 116)(7f - 3) Let z = 632 + -655. Let l(r) = 15r + 345. Let m be l(z). Solve 4/7p*5 - 4/7p*2 + 10/7p*4 + 0 + mp + 2/7p3 = 0. -2, -1, 0, 1/2 Let s(m) be the first derivative of -m6/10 + m4/4 - 89m - 41. Let p(w) be the first derivative of s(w). Factor p(o). -3o2(o - 1)(o + 1) Let l(m) = 2m + 13. Let k(u) = u + 4. Let c(g) = 7k(g) - 2l(g). Let j be c(0). Factor -16w2 + w + 0w + 15wj. -w(w - 1) Suppose 0 = -25s - 47 + 97. Let q(g) be the first derivative of 14 + 1/3g*3 + 5g - 3gs. Find k, given that q(k) = 0. 1, 5 Let x(d) = 2d*2 + d. Let j(p) = -3p*2 - 26 + 9p + 17p2 - p3 + 26. Let l(q) = 2j(q) - 18x(q). Let l(a) = 0. Calculate a. -4, 0 Let s(h) = -7h*2 - 142h - 15. Let z(t) = -8t2 - 142t - 18. Let d(q) = -6s(q) + 5z(q). Factor d(b). 2b(b + 71) Suppose -5u + 29u + 36 = 84. Let l(m) be the second derivative of 0 - 37m + 1/6m*3 + 0m*5 - 1/60m*6 + 1/8m*4 + 0m*u. Factor l(s). -s(s - 2)(s + 1)2/2 Suppose -74/15c - 52/5 - 2/15c3 + 16/3c2 = 0. Calculate c. -1, 2, 39 Let f(c) be the third derivative of -c6/480 - 481c5/60 - 231361c*4/24 + 29c*2 - c + 5. Solve f(r) = 0 for r. -962, 0 Factor -1211i - 18i2 + 363i + 257i + 99. -3(i + 33)(6i - 1) Factor 22/3 + 21/2q2 + 1/6q*4 + 8/3q*3 + 46/3q. (q + 1)(q + 2)2(q + 11)/6 Suppose 2u + 10 = 4s, 4s - 19u = -16u + 7. Let a(d) be the first derivative of 1/15d*5 - 1/6d*s + 1/3d*2 + 21 + 0d*3 - 1/3d. Factor a(t). (t - 1)*3(t + 1)/3 Factor 5/2 + 11/4p + 1/4p*2. (p + 1)(p + 10)/4 Suppose 0 = -5n + 20, 0 = -4r - 0r - 4n - 264. Let s be (-12)/(-56) - 20/r. Factor -4u3 - 11/4u*2 + 0 - su - 7/4u4. -u(u + 1)*2(7u + 2)/4 Let s = -20/73 + 644/219. Let n be -11 + 3197/207 - (-1 + 5). Factor -nh*2 + s + 4/9h. -4(h - 3)(h + 2)/9 Let p(i) be the second derivative of -1/130i5 - 1/195i*6 + 0 + 0i*2 + 1/39i*3 + 52i + 1/78i4. Factor p(n). -2n(n - 1)(n + 1)*2/13 Let 0o + 2/7o4 + 0 - 412/7o*2 - 410/7o*3 = 0. What is o? -1, 0, 206 Let i(g) be the first derivative of 4g*5/5 - 42g*4 - 4g*3/3 + 84g*2 + 73. What is m in i(m) = 0? -1, 0, 1, 42 Let y(n) be the first derivative of -5n*4/16 + 15n*3/4 - 5n*2 + 628. What is g in y(g) = 0? 0, 1, 8 Let m be 8/(-32) + 1771743/2604. Solve -mp + 36501/7 - 3/7p3 + 207/7p*2 = 0 for p. 23 Suppose -y + l + 151 = 147, 0 = 5y + 4l - 2. Factor 4/5x + 6/5 - 2/5xy. -2(x - 3)(x + 1)/5 Let h(x) be the second derivative of -x4/36 - 127x*3/18 - 296x. Determine w, given that h(w) = 0. -127, 0 Suppose -2v5 - 5092611 + 1268v*3 - 618v*3 - 11508589 + 136v*4 + 1364v*3 - 130228v*2 - 2953720v = 0. Calculate v. -14, 55 Let p(x) be the first derivative of -x5/30 + x4/6 - 27x2 + 37. Let s(d) be the second derivative of p(d). Factor s(m). -2m(m - 2) Suppose 34d - 14 = 27d. Determine r, given that -87r - 4r + 0r2 + 1352 - rd + 3r2 - 13r = 0. 26 Let m(h) be the first derivative of 2h3/21 + 292h*2/7 + 42632h/7 + 1416. Let m(j) = 0. Calculate j. -146 Let z(t) be the first derivative of t*4/24 - 3t*3/2 + 47t*2/12 + 25t/2 + 8553. Find q, given that z(q) = 0. -1, 3, 25 Factor -5m4 - 154258 + 2m*3 - 80m + 154338 + 18m3. -5(m - 2)*3(m + 2) Let v(m) be the second derivative of 15552m5/25 - 72m4/5 + m3/10 - 4055m. Factor v(x). 3x(144x - 1)*2/5 Suppose 0 = -5n - c + 6c - 10, 4c - 12 = 0. Suppose n = -2q + 3q, -8 = -d - 5q. Factor 301y - 8yd + 23y*3 - 5 + 25y*2 - 296y. 5(y + 1)2(3y - 1) Let d = 386381/2360628 + -21/11404. Let n = d - -13/46. Factor n + 4/3r*2 + 26/9r. 2(r + 2)(6r + 1)/9 Suppose 0 = 12o - 56o + 9o + 24o. Let 4/5t*3 + 8/5t - 18/5t2 + o = 0. Calculate t. 0, 1/2, 4 Let a = -18/7225 + 5834/21675. Solve -ar*3 + 2/5r*4 + 0 + 0r*2 + 0r = 0 for r. 0, 2/3 Suppose 26a - 65 - 49 = -36. Factor 1/2h*a + 13/2h + 3 + 4h2. (h + 1)2(h + 6)/2 Let v(x) be the first derivative of -x*6/51 - 4744x*5/85 - 1877041x*4/34 - 993571940x*3/51 - 987950300x*2/17 - 986078000x/17 + 795. Factor v(t). -2(t + 1)2(t + 790)*3/17 Let s(p) = 56p - 3p3 + 57p + 2p2 - 94p - 13 - p*2. Let j(a) = -6a*3 + 3a*2 + 39a - 27. Let o(h) = 4j(h) - 9s(h). Solve o(u) = 0. -3, 1 Let w = 3/34474 + 103401/241318. Suppose -5b = -2b - 9. Factor -3/7h4 + 0 + 1/7h*b + 1/7h*5 - 2/7h + wh2. h(h - 2)(h - 1)2(h + 1)/7 Let j = -10/671 + 2171/100650. Let h(f) be the third derivative of 0f3 + 0f - 1/1050f7 - jf*6 - 11f*2 - 1/60f*5 - 1/60f*4 + 0. Factor h(k). -k(k + 1)*2(k + 2)/5 Let h(y) = -	{ "pile_set_name": "DM Mathematics" }
te n(t(c)). 4c4 Let x(a) = -2a*2. Suppose -4r + 97 = -39. Let p = r + -27. Let i(k) = -pk2 - 17k2 - k2. Give i(x(s)). -100s4 Let w(a) = a + 1. Let r be w(0). Let m(o) = -1 + 4o + 2 - r. Let u(x) be the third derivative of -x*4/6 - 27x*2. Determine u(m(q)). -16q Let r(a) = 11a. Let d(c) be the first derivative of -c4/6 - 3c*2 + 29. Let m(g) be the second derivative of d(g). What is r(m(q))? -44q Let z(f) be the third derivative of -7f4/24 - f2 + 86f. Let o(b) = -17b2. Give z(o(t)). 119t*2 Let h(z) = 300z*2 - 547z*2 - 2z + 300z2. Let n(r) = -2r. What is h(n(p))? 212p2 + 4p Let q(m) = 14m2. Let b(o) = 4o + 2. Let g(f) be the third derivative of f4/24 + f3/6 + 17f2. Let d(p) = -b(p) + 2g(p). Calculate d(q(z)). -28z2 Let d(s) = 8s*2. Let h(o) = -2o + 4. Let i be h(0). Let j(r) = r - 3r + ir. What is d(j(n))? 32n2 Let q(r) be the first derivative of 59r*3/3 - 2r - 498. Let y(d) = 3d2. Determine q(y(g)). 531g*4 - 2 Let u(m) = 13m - 3. Let v(h) = -11h2 + 40. Give v(u(c)). -1859c*2 + 858c - 59 Let v(r) = 2r. Let t(j) = 2397j*2 - 11j. Give v(t(z)). 4794z2 - 22z Let h(o) = o. Let d(w) = -w + 5. Let p(i) = 36i + 540. Let q(c) = -108d(c) + p(c). Give h(q(m)). 144m Let a(q) = -167842q2. Let n(o) = -o2. Calculate n(a(g)). -28170936964g4 Let o(y) = 2y*2. Let q(h) = 199h*2 + 12h + 3. Let i(a) = -26866a2 - 1616a - 404. Let x(c) = 3i(c) + 404q(c). Give x(o(g)). -808g4 Let i(d) be the second derivative of -d3/6 - 569d. Let z(w) = -5w + 2w + 7w. What is z(i(u))? -4u Let m(y) = -24y2 + y + 50. Let j(l) = l2. Determine m(j(x)). -24x4 + x2 + 50 Let r(s) = 177553 - 2s - 177553. Let w(j) = -6j. Determine w(r(d)). 12d Let k(c) = 22c*2 + 2. Let b(o) = 734o*2. Determine k(b(u)). 11852632u*4 + 2 Let f(t) = -75t. Let r(n) be the first derivative of n*3 + 298. Determine r(f(k)). 16875k*2 Let q(y) = 3y2 + 5. Let z(m) = m2 + 2. Let c(o) = -2o + 10. Let w be c(6). Let p(d) = wq(d) + 5z(d). Let x(s) = -9s + 3. Calculate p(x(h)). -81h2 + 54h - 9 Let l(g) = -g*2. Let a(r) = -171 + 88 - 40r - 212r + 82. Give a(l(x)). 252x*2 - 1 Let p be ((-2)/6)/(-1) + 32/12. Let f(s) be the second derivative of 0s*2 - s - 1/3s*p + 0. Let i(c) = -4c. Give f(i(g)). 8g Let v(r) = 10r - 24. Let z(s) = -60s2. Give z(v(n)). -6000n*2 + 28800n - 34560 Let y(a) be the first derivative of -a*2/2 + 486. Let v(n) = 91n + 4. Calculate y(v(m)). -91m - 4 Let n(j) = 13j. Let x(v) be the second derivative of -v*6/360 + 3v*4/2 - 7v. Let f(w) be the third derivative of x(w). Give n(f(l)). -26l Let h(k) = 2k. Let v(u) be the first derivative of -2u3/3 + 16u*2 - 251. Calculate v(h(n)). -8n*2 + 64n Suppose 0 = 7p + 7p - 14. Let j(t) = 3t + p - 3 + 2. Let x(y) = -2y*2. Give x(j(c)). -18c*2 Let p(i) = 266i + 1. Let t(y) = -y*2 - 22. Give p(t(o)). -266o*2 - 5851 Let r(q) = -4q*2 + 10q + 10. Let y(o) = o*2 - 3o - 3. Suppose 0 = 8g - 15g - 70. Let k(i) = gy(i) - 3r(i). Let s(b) = -6b. Give k(s(u)). 72u*2 Let r(n) = -2n. Let h(l) = l. Let o(p) = -4h(p) - r(p). Let d be ((-6)/7)/(-3)7. Let v(w) = 0w2 - 4w2 + wd. What is o(v(g))? 6g2 Let m(j) = 331j*2. Let f(p) = 77p. Determine m(f(z)). 1962499z2 Let d(i) = 5i*2. Let b(s) = 0 - 903s*2 + 0 + 196s*2 + 457s*2. Calculate b(d(j)). -6250j*4 Let l(d) = 9d + 134. Let i(n) = 13n. Give l(i(y)). 117y + 134 Let s(t) = 4t. Let k(r) be the second derivative of -r4/6 - r3/2 + 151r. Determine s(k(g)). -8g2 - 12g Let j(l) = l. Suppose 5i + 2q = -3q + 10, 4 = 2i - 3q. Suppose -4 = -v + k, -v - ik + 12 = -7k. Let z(o) = -2o*v + 8o*2 + 2 - 2. Determine z(j(s)). 6s*2 Let n = 37 + -33. Let p(q) = -q - 6. Let b(v) = -8. Let a(l) = np(l) - 3b(l). Let x(d) = -7d*2. Calculate a(x(u)). 28u*2 Let y(p) = -4p*2. Let u(n) be the third derivative of 49n*5/60 - 2n*2 + 6. Give u(y(i)). 784i*4 Let j(i) = -5i - 9i - 12i - 12i + 31i. Let a(v) = 4v2 + 1. Determine j(a(o)). -28o*2 - 7 Let n(s) = 5s - 2. Let m(g) = -24g + 9. Let t(j) = -4m(j) - 18n(j). Let h(d) = d + 5. Calculate t(h(y)). 6y + 30 Let y(w) = 3w2. Let g(x) = 1716x*2 + x. Give g(y(h)). 15444h*4 + 3h*2 Let y(o) = -92o. Let s(i) = -4i + 7i + i - 3i. Calculate y(s(j)). -92j Let p(o) = 18o2. Let w(x) = 2x - 8. Let y(z) = z - 3. Let b(q) = q + 2. Let f be b(1). Let d(s) = fw(s) - 8y(s). Calculate p(d(u)). 72u2 Let x(g) = 17g. Suppose -5v + 2v = -9. Let q(h) = 26h2 - 16h - 16. Let n(w) = -5w2 + 3w + 3. Let l(t) = vq(t) + 16n(t). Determine l(x(o)). -578o2 Let k(s) = 2s*2. Suppose -21 = -0d - 3d + 3f, -d = -5f + 1. Let p(t) = -13t - dt + 19t. Give p(k(g)). -6g2 Let k(n) = 92n. Let i(r) = -948r2. Give i(k(d)). -8023872d*2 Let b(n) be the second derivative of -11n*3/6 - 127n. Let y(w) = -12w. What is b(y(s))? 132s Let i(v) = -8v + 20. Let y(a) = 10a - 24. Let w(d) = -6i(d) - 5y(d). Let s(n) = 175n2. Give s(w(c)). 700c*2 Let k(h) = -30h*2. Let t(n) = -86n + 12n2 + 200n - 114n. Determine k(t(b)). -4320b*4 Suppose -5s = j - 3j - 20, -3j - 19 = -2s. Let b(t) = st - 5t + 0t. Let o(v) = -10v2. Give b(o(z)). 30z*2 Let x(j) = -2j*2. Let o = 11 - 4. Let b(p) = -468 - 469 - op + 937. What is x(b(y))? -98y2 Let r(g) = -8g*2. Let z(f) = 3 - 9f + 6 + 7f. Calculate r(z(m)). -32m*2 + 288m - 648 Let g(p) = -656p2 - 6p. Let c(v) = -10v. Calculate c(g(w)). 6560w*2 + 60w Let q(w) = w. Let k(p) = 37p2 + 8p - 12. Let a(s) = -73s2 - 14s + 22. Let x(u) = -4a(u) - 7k(u). Give x(q(j)). 33j2 - 4 Let y(z) be the first derivative of 8z*3/3 - 1. Let j(g) be the second derivative of 0g*2 - g + 0g*3 - 1/12g*4 - 19. Calculate y(j(b)). 8b*4 Let z(s) = 2s*2 + 123087. Let v(d) = -12d. Calculate v(z(l)). -24l2 - 1477044 Let n(s) = s. Let m(g) be the second derivative of 23g*3/6 + 5g*2/2 + 60g + 1. Determine n(m(l)). 23l + 5 Let w(q) = -7q. Let b(y) = -4y. Let x = -7 + 12. Let d(l) = xb(l) - 3w(l). Let u(z) = 139z + 143z - 281z. Calculate u(d(c)). c Let d = -1129 - -1138. Let g(s) be the second derivative of 0s2 + 0 - ds + 0s3 - 1/12s*4. Let o(m) = -2m. What is g(o(a))? -4a2 Let a(x) = 2x*2 + 2041 - 1020 - 1023. Let m(v) = 2v. Determine a(m(k)). 8k2 - 2 Let m(a) = -347a*2. Let d(o) = 7o*2. Let u(j) = -36j*2. Let g(x) = 21d(x) + 4u(x). Give m(g(t)). -3123t*4 Let o(c) = 2c + 3. Let h(k) = 4k + 7. Let d(m) = 3h(m) - 7o(m). Let l(x) be the second derivative of 5x*4/12 + 82x. Calculate d(l(u)). -10u2 Let h(p) = -20p*2. Suppose 8f = 3f - 2g + 2, 0 = -3f + 2g + 14. Suppose -2 = 2k - 6. Let i(n) = 5 + fn*k - 3 - 2. Determine i(h(v)). 800v4 Let m(j) be the third derivative of j4/8 + 57j2. Let n(i) be the second derivative of -i + 0i*3 - 1/6i*4 + 0i*2 + 0. Determine n(m(f)). -18f*2 Let n(y) = -4y. Let i(d) = -12384d2. What is n(i(o))? 49536o*2 Let s(a) = 2 - 126a + 128a - 1 - 1. Let f(w) = 195w*2. Determine f(s(p)). 780p*2 Let w(v) = -9320v. Let i(k) = -36k2. What is i(w(u))? -3127046400u*2 Let d be (-20)/6(-3)/2. Let c be 8/(-10)d/(-2). Let i(f) = 3f*2 - 2f*c - 2f*2 - 3f*2. Let k(w) = -2w*2. Calculate i(k(l)). -16l*4 Let z be ((7 - 2) + -1)2. Let u(w) = -15 - zw + 27 - 12. Let v(t) = 5t + 4t - 6t. Give u(v(x)). -24x Let a(h) = h2 + h. Let y = -49 + 44. Let p(v) = 6v*2 + 5v. Let j(z) = ya(z) + p(z). Let c(l) = -2l + 10. Calculate c(j(b)). -2b2 + 10 Let g(l) = -2l*2 - 16l - 3. Let i(b) = -13b. Calculate g(i(p)). -338p*2 + 208p - 3 Let t(k) = -28735k. Let j(g) = -18g. Calculate j(t(y)). 517230y Suppose -121 = -5g - 2u, 2g + 3g + 3u = 124. Let h(j) = 23j - 6j*2 - gj. Let r(w) = 3w2. Give h(r(n)). -54n*4 Let w(s) = 2s - 1. Let t(u) = -u - 900 + 900. What is t(w(g))? -2g + 1 Let c(i) = 2i. Let n(r) be the second derivative of 12r + 0r*3 - 11/6r*4 + 0 + 0r*2. Determine c(n(j)). -44j*2 Let f(l) = 1. Let c(a) = -a + 6. Let g(x) = -c(x) + 6f(x). Let v(n) be the third derivative of 2n5/15 - 753n**2. What	{ "pile_set_name": "DM Mathematics" }
/sqrt(3))2). 8sqrt(17) Simplify 3 + 5(2 + 1(sqrt(704) + -4))*2. -160sqrt(11) + 3543 Simplify (sqrt(204)/((sqrt(72)-1)/sqrt(6)))2 + sqrt(153)/(sqrt(9) + (sqrt(729) - (sqrt(729) - sqrt(729)1))). sqrt(17)/10 + 17 Simplify (sqrt(1539) - (sqrt(1539) + sqrt(1539)-4 + -2))2 + 4(sqrt(2299) + -2)*2. -32sqrt(19) + 33840 Simplify (sqrt(416)/(sqrt(8) + sqrt(32)/sqrt(4)) + sqrt(104)/(-1sqrt(2)))/(-6(sqrt(100)2 - sqrt(4) - sqrt(4))). sqrt(13)/96 Simplify ((sqrt(350) - (2sqrt(350) + sqrt(350)) - sqrt(350))/sqrt(10))/(sqrt(10)/sqrt(50)). -15sqrt(7) Simplify (-4(1sqrt(187) - sqrt(187))4)/((sqrt(33) - (sqrt(33) - sqrt(99)/sqrt(3)1))/sqrt(3)). 0 Simplify (sqrt(5445)2)/(-1sqrt(324)) - (sqrt(1815) - (sqrt(1815) + -2sqrt(1815) - sqrt(1815)))/(sqrt(27)1). -44sqrt(5)/3 Simplify -5 + 3(4(sqrt(320) - (-2 + sqrt(320))) + 2)*2 + -5. 290 Simplify sqrt(66)/(sqrt(6) + (1sqrt(726) - sqrt(6))) - (-1sqrt(1584)1)*2. -1584 + sqrt(11)/11 Simplify 2((sqrt(5) + sqrt(405))5 + ((sqrt(60) - (sqrt(60) - sqrt(60)-2)) + sqrt(60))/sqrt(12) + sqrt(5)). 100sqrt(5) Simplify ((sqrt(117) - ((sqrt(117) - 3sqrt(117))4 + sqrt(117)))-4)/(sqrt(45)/(5(sqrt(5) - sqrt(180)))). 800sqrt(13) Simplify (sqrt(180)/(sqrt(40)/sqrt(4)))/(sqrt(9) + sqrt(63)/sqrt(63) + sqrt(9) + sqrt(9) - sqrt(9))6. 18sqrt(2)/7 Simplify (sqrt(10) - sqrt(60)/(sqrt(24)/sqrt(4)) - -5sqrt(10)2)/((sqrt(35) + sqrt(4235) + sqrt(4235)3)/sqrt(7)). 2sqrt(2)/9 Simplify (-3 + ((sqrt(143) + sqrt(143)2)-6)/sqrt(11))3. -54sqrt(13) - 9 Simplify (sqrt(152) - -5sqrt(152)1 - sqrt(152)-2-5)/(((-2sqrt(72))/sqrt(3))/sqrt(3)). 2sqrt(19) Simplify (2 + sqrt(6912)2 + sqrt(6912) + sqrt(6912) - 2(-1 + sqrt(9)/sqrt(3))-3)2. -1584sqrt(3) + 117628 Simplify -2((-6(sqrt(88)1 - sqrt(88)) - sqrt(88))/(2sqrt(8)2)-3 + 2). -3sqrt(11)/2 - 4 Simplify ((-5 + (sqrt(171) - (sqrt(171) + -1)))2 - (0 + -3 + sqrt(171))2) + 2. -162 + 18sqrt(19) Simplify (-1sqrt(1408)-3)/(-4sqrt(99)2). -sqrt(2) Simplify (-5 + -1 + -3 + (-2 + sqrt(80) - sqrt(80)) + -4 + (-1sqrt(80) + sqrt(80))-1)*2. 225 Simplify (4(sqrt(56)/sqrt(2))/sqrt(4) + -1 - (sqrt(7) + -2 + -2sqrt(7))5-4)2. 1312sqrt(7) + 3473 Simplify -1(sqrt(98) + -1) + 1(sqrt(98)1)2 - ((5-1sqrt(98) - sqrt(98) - sqrt(98))2 - ((1 + sqrt(98) + -1)2 - sqrt(98))). -4605 - 14sqrt(2) Simplify -3 + ((3sqrt(1700)-1)2 - sqrt(1700)) + (2 + (sqrt(1700) - (sqrt(1700) + (sqrt(1700) + 1 - sqrt(1700)) + sqrt(1700))) - sqrt(1700))2. -50sqrt(17) + 22098 Simplify -2((sqrt(231) + (sqrt(231) - (sqrt(231) + 3(sqrt(231) + 1sqrt(231)))) + sqrt(231))/sqrt(11))/(-1((sqrt(3) + sqrt(12))-4 + sqrt(3) + sqrt(3))). 4sqrt(7)/5 Simplify ((sqrt(176) - ((sqrt(176) - (sqrt(176) + 3 + sqrt(176) - sqrt(176))) + sqrt(176))1) + -1(2 + sqrt(176)) + -1)2. 176 Simplify (sqrt(12)/(sqrt(600)1))*2 + 5 + 4. 451/50 Simplify (4sqrt(171) + sqrt(19) - sqrt(19))-1 + (1 + -1 + sqrt(171))2. -12sqrt(19) + 171 Simplify (sqrt(130)/(sqrt(20)/sqrt(4))-6)/((sqrt(144) + sqrt(144)2 + sqrt(144))/sqrt(2)). -sqrt(13)/4 Simplify ((1sqrt(396) + sqrt(396))-2 + -3 - (3 + 1(sqrt(396) - (-2 + sqrt(396)) - sqrt(396))))2. 288sqrt(11) + 3628 Simplify (1 + sqrt(19) + 0 + -1 - (sqrt(76) - (sqrt(76)14)*2)) + 1. -sqrt(19) + 1217 Simplify 4(sqrt(208) + 3 + sqrt(208)) - (sqrt(26)/sqrt(2) + -3 + sqrt(13) + (sqrt(13) - (sqrt(1573) + sqrt(1573) + -2 + sqrt(1573))*2)). -103sqrt(13) + 14176 Simplify 0 + (2 + 1 + -6(-3 + sqrt(1331)))2. -2772sqrt(11) + 48357 Simplify -2(4 + sqrt(98) + (sqrt(98)1 - sqrt(98)) + sqrt(98)-2 + -1). -6 + 14sqrt(2) Simplify (-2 + (2 + sqrt(448))*2 - (-1 + -2sqrt(448) + sqrt(448))) + 5. 40sqrt(7) + 456 Simplify (sqrt(704) + 3 + -3sqrt(44))*2 + 2. 12sqrt(11) + 55 Simplify -1(-3(-5 + -3(1 + -2sqrt(700))))*2. -227376 + 8640sqrt(7) Simplify 6-1(-5 + (sqrt(125) + (sqrt(125) + (sqrt(125) - (sqrt(125) + 1))-5)2 - sqrt(125))). -870 - 300sqrt(5) Simplify (((sqrt(81)3 + sqrt(81))/sqrt(3) - sqrt(27)4-3) + 0 + 2)2. 192sqrt(3) + 6916 Simplify ((2sqrt(153)2)/sqrt(9) + sqrt(833) + (sqrt(833) + 2 + -5)*2)3. -93sqrt(17) + 2526 Simplify sqrt(171)/((sqrt(180)/sqrt(4))/sqrt(5)) - (-2 + 1sqrt(1900))*2. -1904 + 41sqrt(19) Simplify ((sqrt(11) + (sqrt(11) - (1sqrt(11) - sqrt(11))) + -2 - (-3 + 0 + sqrt(11))) + 2)2. 6sqrt(11) + 20 Simplify ((sqrt(6292) + (-2sqrt(6292) - sqrt(6292)) + (sqrt(520) - sqrt(520)1)/sqrt(10))/(-2sqrt(256)-5 - sqrt(256) - sqrt(256)))*2. 1573/1024 Simplify ((sqrt(95)-1 + sqrt(95))3)/(1sqrt(20)) + (((-1-1sqrt(152) - sqrt(152)) + sqrt(152))/(6(-1sqrt(8) + sqrt(8)) - sqrt(8)))*2. 19 Simplify (5-2sqrt(190)6)/((-2sqrt(90)-2)/sqrt(9)). -15sqrt(19) Simplify (-4 + sqrt(108) + sqrt(12) - (5 + sqrt(3)-3-1))2. -90sqrt(3) + 156 Simplify (2 + ((sqrt(243) - (sqrt(243) + -2sqrt(243) + 1)) + ((sqrt(243) - 1sqrt(243)) + sqrt(243))-4 + 5)2)-2. -1980 + 288sqrt(3) Simplify ((6(sqrt(1000) - (sqrt(1000)-1 + sqrt(1000))))/(-6sqrt(800)-1))2. 5/4 Simplify (sqrt(60)/(sqrt(35)/sqrt(7)))/(sqrt(28)/sqrt(7)3) + 5. sqrt(3)/3 + 5 Simplify 5 + (5 + sqrt(17) + 1 - (sqrt(136)/(sqrt(24)/sqrt(3)) + sqrt(17)) - ((1sqrt(425))2 - (-4 + sqrt(68)))). -418 + sqrt(17) Simplify (-1(sqrt(300) + 1))*2 + (-4 + sqrt(300)2)*2 + 1. -140sqrt(3) + 1518 Simplify (-4 + (2 + sqrt(2299) + 0 + -1)-3 + 2)2. 330sqrt(19) + 20716 Simplify -31sqrt(22)/((-1sqrt(55))/sqrt(5))6. 18sqrt(2) Simplify ((2 + 3 + sqrt(325) - -23sqrt(325))2 + 0)6. 2100sqrt(13) + 95700 Simplify -4 + ((sqrt(396) - ((sqrt(396) - (5 + 2 + sqrt(396))) + sqrt(396)))2 - (sqrt(396) - 4sqrt(396)2)) + -2. 43 + 42sqrt(11) Simplify (-5sqrt(24)-22)/(sqrt(12) + (sqrt(60) + sqrt(540) + sqrt(60))/sqrt(5) - -6sqrt(24)/sqrt(2)). 5sqrt(2)/3 Simplify (sqrt(252)/(sqrt(63)/sqrt(9)))/(-5sqrt(12)1). -sqrt(3)/5 Simplify (-4sqrt(77)1)/(sqrt(63)/(sqrt(9)-1)) + -1 + -3. -4 + 4sqrt(11) Simplify (sqrt(3900) + (sqrt(3900) - sqrt(3900)-1))/(sqrt(33)/sqrt(176)) + -2. -2 + 120sqrt(13) Simplify ((sqrt(24) + sqrt(864))/sqrt(12) - sqrt(32)-6) + ((sqrt(400) - ((sqrt(400) - sqrt(400)1) + sqrt(400)) - sqrt(16))/(sqrt(8) - sqrt(56)/sqrt(63)))2. 9/2 + 31sqrt(2) Simplify (2 + sqrt(98) + -4 + 3 + -5 + 5)*2. 14sqrt(2) + 99 Simplify -4(sqrt(42)/sqrt(2)-4)/(sqrt(3) - (sqrt(3) - sqrt(12)-2)). -4sqrt(7) Simplify (-2sqrt(245) + 0 + sqrt(245) + 1)-2-6. -84sqrt(5) + 12 Simplify -1((0 + sqrt(8)/sqrt(4) + -3)2 + -5). -6 + 6sqrt(2) Simplify 1 + (-6((sqrt(156) + sqrt(156) + -2sqrt(156))-6 + sqrt(156))/((-1sqrt(84))/sqrt(7)))*2 + -5. 464 Simplify (sqrt(190)-2-1)/(1sqrt(160) + sqrt(160)). sqrt(19)/4 Simplify (sqrt(1573) + (-1 + sqrt(1573) - sqrt(1573))-2 + -2 + (sqrt(1573)-2 + -2)5 + 5)2. 990sqrt(13) + 127438 Simplify -5(sqrt(27) + 1) - (5 + sqrt(363) + 1). -26sqrt(3) - 11 Simplify (sqrt(10) - (sqrt(50)/sqrt(5) - sqrt(10))-5)/sqrt(5) + (-6(sqrt(162) + 1))*2. 649sqrt(2) + 5868 Simplify (-5 + 4(-3 + -2sqrt(432) + sqrt(432)))1. -48sqrt(3) - 17 Simplify (-3sqrt(480)6)/((sqrt(726)2 - sqrt(726)) + sqrt(864)-2 + sqrt(6)). 6sqrt(5) Simplify (sqrt(102)-1-2 - (sqrt(102) - 2(sqrt(102) + sqrt(102)1 + sqrt(102))))/((sqrt(6) - (sqrt(486) - sqrt(486)1))-2). -7sqrt(17)/2 Simplify sqrt(13) + -5sqrt(52)/sqrt(4) + (sqrt(13) + 0 + 0)2 - (2 + 1sqrt(13) + 4). -5sqrt(13) + 7 Simplify 4(sqrt(48)-3)2 - (sqrt(3) + -1 + sqrt(300))2-6. -132sqrt(3) + 3912 Simplify ((sqrt(405) - -62sqrt(405)) + sqrt(405) + 5(sqrt(405) + 1) + -4 + -2 + (sqrt(405) + -2 + sqrt(405) + sqrt(405) - sqrt(405)))*2. -1134sqrt(5) + 178614 Simplify 1((2sqrt(75) - (1 + sqrt(108)))*2 - sqrt(81)/(-1sqrt(3))). -5sqrt(3) + 49 Simplify (-2sqrt(833)1-2 - (-2 + (sqrt(833) + sqrt(833) + sqrt(833)2 - sqrt(833)) - (3 + sqrt(833) + 1 + sqrt(833))))2. 252sqrt(17) + 7533 Simplify (5 + (-2-2sqrt(5500))/((-1sqrt(77)-2)/sqrt(7)))*2. 200sqrt(5) + 2025 Simplify 2 + -1 + sqrt(343)-1 - ((sqrt(98) - (sqrt(98) + (sqrt(98) - 1sqrt(98))))/sqrt(7))/(sqrt(128)-2). -7sqrt(7) + 1 Simplify (-2 + sqrt(242) + -4 - 1(2sqrt(242) - sqrt(242)) - (-5(sqrt(242) + sqrt(242)-1 - sqrt(242)) + sqrt(242) + ((-1 + sqrt(242))-3 - sqrt(242))))2. 396sqrt(2) + 1049 Simplify ((sq	{ "pile_set_name": "DM Mathematics" }
s*4 + 4s*4 - 5s + 9 to the form ys + fs*2 + q + vs*3 + rs*4 and give r. 1 Rearrange 10 - 1628p*2 + 4877p*2 - 1622p*2 - 1622p*2 - 14p4 - p - p4 to the form zp + j + xp*3 + hp*4 + tp*2 and give j. 10 Rearrange (0 - 45 - 7)(2w - 3w - w) - 29 + 68 - 18 - 85w - 26 to gw + n and give n. -5 Rearrange (-4 - 3 - 1)(3 + 4 + 6)(0l - 6l - 2l) to the form nl + c and give n. 832 Rearrange -18422i - 4490i + 1 - 9176i to l + oi and give o. -32088 Rearrange 102638g2 - 2g*4 - 205277g*2 - 17g + g*3 - 2 + 102606g*2 to mg + fg3 + w + qg*4 + cg2 and give f. 1 Rearrange -k3 - k + k + (13 - 5 - 5)(14 - 10 - 7)(-1 + 1 - 4)(4k + 0k - 3k)(4k*2 + 2k*2 - 5k*2) to the form uk*3 + pk + v + sk2 and give u. 35 Rearrange 4r + 10r - 20 + 21 + 3r - 48 to xr + v and give v. -47 Rearrange 4700u - 5033u + 5 - 5 + 8049u to the form b + ju and give j. 7716 Express 5k + 8 - 11k2 - 1 + 5k*3 - 7k*4 - 8k*3 - 6 + 4k*3 in the form yk*2 + jk + a + wk3 + tk*4 and give j. 5 Rearrange 2585l + l*2 - 2l*2 - 663l + 958l + 2547l to the form z + vl + ul*2 and give u. -1 Rearrange 5939i*2 - 27i*3 - 5868i*2 + 5i*3 to the form ui*3 + hi + gi2 + m and give g. 71 Express -739g*2 + 1002g*2 + 2816g*2 as m + vg + xg2 and give x. 3079 Express -2v*2 - 10723 - 10481 - 8v + 21471 in the form c + nv + fv*2 and give n. -8 Rearrange (-40a - 57a - 55a)(-8 + 15 + 42) + (a - 1 + 1)(1 - 2 + 2) to the form ia + c and give i. -7447 Rearrange -7339b - 224 + 653 - 429 to y + hb and give h. -7339 Express s + 249s*2 - 90 + 252s*2 + 254s*2 - 756s*2 as y + zs*2 + ls and give z. -1 Express -359z3 + z2 + 578z*3 + 4 + 1 - 302z*3 in the form m + qz*3 + jz + wz2 and give j. 0 Rearrange -22 - 2o + 22 + (-4 + 3 + 2)(4o + 4o - 6o) + 248o - 3828 + 3828 + (-1 + 1 + 1)(3o + 4o - 5o) to the form co + x and give c. 250 Rearrange -10 - 6 - 8p2 + 7 - 16p*2 + 21p to the form ip + r + wp*2 and give r. -9 Express -28993 + 2385z*2 + 57987 - 28994 as sz*2 + h + mz and give s. 2385 Rearrange 135k4 - 24k*3 - 7k*2 + 3k*2 - 153k - 1 + 6k2 + 155k to d + ak4 + xk*2 + uk*3 + gk and give u. -24 Express 1708 - 3424 + 4342p + 1716 - 21132p in the form tp + g and give t. -16790 Express 59r - 21r - 159 - 35r + (3 - 6 + 1)(r - 4r + r) + 0r + r - 3r in the form u + wr and give w. 5 Express (-3108030 + 3108030 - 7105v)(0v + v*3 + 0v) in the form gv2 + nv + x + zv4 + hv*3 and give z. -7105 Express 6340q*2 - 1 + 2968q + 0 - 3173q2 - 3168q*2 in the form jq*2 + v + yq and give j. -1 Express 1046v2 + 1033v*2 + 35 - 3068v*2 + 1043v*2 in the form sv*2 + fv + c and give f. 0 Express (-6 + 1 + 2)(-5 + 2 + 4)(-1 + 1 - 1)(4g - g - 2g)(-9 - 2g + 9)(-1 + 5 - 3) as p + zg + lg*2 and give l. -6 Rearrange 5566a*2 - 973a*2 + 6a - 6a to the form pa + na2 + u and give n. 4593 Express -41 + 7 + 2289t + 5 + 28 in the form qt + i and give q. 2289 Express 0 - 546345a - 2a4 + 546347a + 4a2 + 2 as w + ha + ra2 + sa*4 + la*3 and give h. 2 Rearrange 40832q - 124418 + 248839 - 124421 to the form d + tq and give t. 40832 Express (2 - 2 - 2y)(2 + 1 - 2)(-3 + 2 + 0)((2 + 2 - 2)(-322 - 104 + 99) - 1 - 3 + 3) in the form b + oy and give o. -1310 Express -2s - 3s + 3s + s - s + s - s + 5 - 5 + (-1 - 2s + 1)(-2 + 2 + 2) - 3840s - 3310s + 4347s in the form hs + y and give h. -2809 Express 2p4 + 0p*4 - 4p*4 - 38 + 4p*4 - 4224p*3 + 36 in the form wp*2 + hp*3 + f + sp*4 + op and give f. -2 Rearrange (-2562 + 2562 - 63v)(6v - 2 - 3v + 0) + v*2 + 4v*2 + 0v*2 to the form av + pv2 + h and give a. 126 Express -1293q - 642q - 1035q in the form p + vq and give v. -2970 Express 7c2 - c3 - 4525c4 - 811c*4 + 39 - 5c*2 - 41 as xc*3 + qc + fc4 + i + vc*2 and give q. 0 Express -30b*2 - 2 + 13b*2 - 2b*3 - 217b*4 - 29b*2 - 3b*2 + 216b*4 as jb + qb3 + w + tb*4 + sb*2 and give s. -49 Rearrange (6 - 3x - 6 + 0 - x + 0 + (-3 + 1 + 0)(2x - 4x + 3x) + 2 - 2 - 3x)(-1521 + 763 + 791)(2x - 2x - 2x) to tx + rx*2 + p and give r. 594 Rearrange 66g - 28 - 45 - 63g - 2 to vg + u and give u. -75 Rearrange ((0 + 0 + 2h)(-50 + 10h + 50) - 2h*2 + 0h*2 + 4h*2)(9h + 10h - 25h)(41 - 2h - 41) to vh*3 + uh*4 + zh*2 + ch + w and give u. 264 Express -71 + 26i4 + 71 + (11 + 4 + 2)(3i + 2 - 2)(-2i3 - 4i*2 + 4i*2) in the form yi*3 + zi*4 + fi*2 + m + di and give z. -76 Rearrange 3 - 82j2 + 159j*2 + 22j - 1 - 13j2 - 3 to the form v + pj + nj2 and give v. -1 Express -148y + 20 - 148y - 137y + 435y as j + by and give j. 20 Rearrange (-c*3 + 0c*3 + 13c*3)(-29c - 71c + 17c)(-1 - 1 + 3) to the form mc2 + k + fc + rc3 + hc*4 and give h. -996 Rearrange (-63u + 278u - 48u)((1 + 2u - 1)(2 - 2 + 2u) + 0u2 - 2u*2 + 3u*2 + 0 + 4u*2 + 0) to hu*3 + bu*2 + d + yu and give d. 0 Rearrange (4017u2 - 12479u + 24945u - 12466u)(1 - 3 + 0) to the form f + su + ku2 and give k. -8034 Rearrange 84 - 5l - 220l2 + 80 + 97l*2 + 120l*2 to the form ol + v + gl2 and give v. 164 Rearrange (3 + d - 3)(-2 - 2 + 6) + 5d + d - 3d + 2d + 2d + 4d + (-2 + 5 + 4)(0d - 4d + 3d) to g + rd and give r. 6 Rearrange -33 + 4f + 16 - 1 + 59 to the form gf + m and give g. 4 Rearrange (4z2 - 2z2 + z2)(2 + 1 - 5) + 1780394 - 835z - 1780399 - z*2 + 109z to the form b + kz2 + sz and give s. -726 Rearrange 21a3 - 29a*3 - 26a + 19a - 82a*3 - 32a*3 + 1 to ma*3 + ga*2 + j + ca and give m. -122 Rearrange 4k + 0k - 5k - 1257k*3 - k + 1282k*3 to the form uk + xk3 + mk*2 + j and give j. 0 Express (127 - 127 + 15y)(3y - 6y + y) + (-2y - y - y + (0y + 0y - 3y)(-1 - 5 + 1))(7y + 0y - 4y) in the form a + wy + ty*2 and give t. 3 Rearrange (25 + 15 - 57 - 3922k + 19)(-2k3 + k3 - k*3) to tk*3 + d + hk + vk2 + ck*4 and give c. 7844 Rearrange (2 + 3 - 3)(-1005991 + 3t2 + 6899t + 2011987 - 1005996) to the form nt + a + ht*2 and give n. 13798 Express 2336q - 1484q - 8828q in the form aq + x and give a. -7976 Rearrange -24s*3 - 105s*3 - 3s*2 + 4s*2 - 248s*3 + 52s*3 to zs*3 + fs*2 + gs + i and give f. 1 Express 4a2 + 1100061a*3 - 3 + a + 1 - 1100106a*3 as ja + h + ba2 + qa*3 and give j. 1 Express 567t*4 - 279t*4 - 318t4 + t3 + 22 in the form nt4 + f + bt*2 + zt + ct3 and give n. -30 Express 9 - 46 - 22k + 15k + 33k - 23 in the form xk + p and give p. -60 Rearrange 5 - r3 + 900r*2 + 742r*2 - 1653r*2 - r to or*3 + n + kr + cr2 and give k. -1 Express 47438n + 44552n + 1 - 106114n as pn + w and give p. -14124 Rearrange -y2 - 67y + 283y3 + 185y - 2 - 58y - 67y*3 - 58y to j + ky + gy*2 + ly3 and give g. -1 Rearrange 9 - o2 - o*3 + 7o*4 - 6o2 - 2 - 14 + o2 to y + to3 + mo + so2 + po*4 and give y. -7 Express -320y*4 + 4y*4 - 3y*3 + 2y*2 + 1 - 8y*3 + 10y3 - y3 as f + ay4 + sy + xy2 + uy*3 and give f. 1 Rearrange (0 - 8v + 0)(-21v*2 + 5v*2 - 42v + 19v2) to nv*3 + p + iv + dv2 and give d. 336 Rearrange v - 73 + 351 - 91 - 122 + 3v to g + uv and give g. 65 Express -7q*3 - 3694q*2 + 2 + 1883q*2 + 2q*4 + 1923q*2 as j + yq*2 + oq*3 + kq + hq4 and give o. -7 Rearrange -30346g*3 + 15173g*3 + 8g + 15170g3 - 5g*2 to o + bg + tg3 + dg*2 and give d. -5 Rearrange (3 - 2o*3 - 3)(1 + 0 + 0) - 937o3 - 2455o*3 - 994o*3 to qo*2 + go + k + co3 and give c. -4388 Rearrange 345d + 3916d - 522d + 1628d + (4d + 0d - 2d)(-1 + 1 + 1) to the form i + kd and give k. 5369 Express (0 + 7 - 1)(-3z + 2z - z)(-1810z3 + 882z*3 + 891z*3) in the form qz*2 + az + lz3 + tz*4 + f and give t. 444 Express 63i + 2i + 4i*3 - 405i*2 - 4i - 3i3 - 59i in the form ki3 + wi*2 + li + f and give l. 2 Rearrange -178p + 7p + 2p + 7p*3 + 3 to np*2 + fp*3 + s + vp and give v.	{ "pile_set_name": "DM Mathematics" }
)/(y(2/3))3) assuming y is positive. y(-34/33) Simplify (a(-2/7))*(-13)((a/(a/a(-6)))/a)/a(-5)((a(-2/17)a)/a(6/7))(17/7) assuming a is positive. a*(87/49) Simplify ((tt(1/8))/t(-3/8))/(((ttt(3/4))/t)/((t/t(-1/3))/t))((((t(-1)/t)/tt)/t)(-8/9))(2/31) assuming t is positive. t*(95/372) Simplify ((ss(s(1/2)s)/s)/(sss*(-6)s))*(-20/3)/((ss*(-6/5)(ss/((s/((s(3/8)/s)/s)s)/s))/s)/(s*(-1/9)/ss*(-3)s)) assuming s is positive. s(-13663/360) Simplify (l/(l(-34)/l)l(-28/3))/(l(6/13)l(3/19)) assuming l is positive. l(19301/741) Simplify (l0)22/(l(1/4))38(ll(2/3))24/(l/(l(l(l*(-1/2)/l)/l)/ll))(2/13) assuming l is positive. l(787/26) Simplify (f*(2/51)ff9(f(-1))(-3/17))(-31) assuming f is positive. f(-16151/51) Simplify (t11/(t/(t(12/17)/t))t(2/63)/(t3/t))(-29) assuming t is positive. t(-240323/1071) Simplify (x(xx0)/xxx)(-1/5)x/(x(x/x2)/x)xx(4/9)(xx(2/7))(-1/9)(x(x(x(-2)/x)/x)/x)(2/63) assuming x is positive. x*(821/315) Simplify (m/(m/(mm*(-6)))m2/m)/(m(-1/2)(m(-1/7)/m)/m)(m*(2/15)/(mm(2/7)))34 assuming m is positive. m(-8513/210) Simplify ((d/d(-1/5))(-33))(-27)((dd(-8)/d)/d(2/13))(-9) assuming d is positive. d(74268/65) Simplify z(-2/15)/(z/(((z/((z(-2/11)z)/z))/z)/z))z(-6/35)/z(2/93) assuming z is positive. z*(-25594/11935) Simplify (mmmm*2mmmm(-4/3))/(mm0)(-1/5)(((m(-1)m)/m)/mm)16(m(m6/m)/m)/(mm(1/6)) assuming m is positive. m(-53/10) Simplify ((d*11(dd(-23))/dd)/((d/(d/(dd(-5/6)d)d)d)/d)(-12))20 assuming d is positive. d(-180) Simplify (((z/z(2/3)z)13(zzz(2/3))(2/19))(29/3))(1/3) assuming z is positive. z(29116/513) Simplify ((n(-2/5))4)18n(n*1n)/nnn/(n*(-7)n)n(-6/11)/n(-1/11) assuming n is positive. n(-1059/55) Simplify ((ff/(f(f((ff6)/f)/f)/f))/ff*14((ff/(f6/f))/f)(-2/81))5 assuming f is positive. f(3685/81) Simplify ((r(rr(rr(-6))/r)/r(rr(2/15)r)/r)/(r0)47)/((rr(-3)r(-1/6))/(r(-5)/(r*(-3)r))) assuming r is positive. r(-37/10) Simplify ((p(-10/3))*6p*30pp23/p)(-26) assuming p is positive. p(-858) Simplify (y(5/2)yy(yy(-38)yyyy)/y)/(((yyy(-1/9)yy)/y)/y)26 assuming y is positive. y(-1415/18) Simplify (((hh*(2/5)h)/h(-6))/(h(-3/2))(-10/9))(1/30) assuming h is positive. h*(101/450) Simplify (oo*(5/2)ooo/o*(4/3)oo)/(o(-4/7)/(o/(o/(o(3/5)/o))))(o(-2/3)/((o/(o/(o(-7)oo)))/o))/(o1)(-24/11) assuming o is positive. o(11437/770) Simplify (t(-1/3)/tt/(t/((t/(t3/t))/t)))/(t3t*6)(((tt(-1/2)tt)/tt)/t*5)/(t/(ttt/(t(2/5)t)))30 assuming t is positive. t(19/6) Simplify ((f(-2/5)/f(-1/5))/(f*(-2)/ff(2/5)))/(((f(-2)f)/f)(-42))19 assuming f is positive. f(-7968/5) Simplify ((nn(-1))(-3)(n(-1)/n)(-46))/((n/(nn*1n))*(26/7)n*3nn(-2/7)) assuming n is positive. n(670/7) Simplify (o5/o(-1))/((o/(((o/(o2o))/o)/o)o)/o(-2/7))(o*(-4)/oo(1/3))/(o/(o/o(2/3))oo(2/3)/o) assuming o is positive. o(-44/7) Simplify (l/l(-1))45(l/(ll(-5)))/(l/l(1/4)l)(l/(l0/l))(-10/9)ll*(-3)lll(-6) assuming l is positive. l(3061/36) Simplify (ss/s(-2/15)ss(3/4))35/((ss/s*0s)*(2/13)(s*(-1)ss)(5/2)) assuming s is positive. s(20741/156) Simplify ((k/k(1/4))24)(-4/3)/((k4/(k(kk/(k/(k1k)))/k))/(k*3kkk*(-1/4)k)) assuming k is positive. k(-77/4) Simplify ((q/(((q0/q)/qq)/q))(-14))(-40)(qqq*(-2/15)qq/(q4/q)q)/(((q*(2/5)/q)/q)/(qq(qq(-1/4))/q)) assuming q is positive. q(101113/60) Simplify (m*4mm(3/4)m*(-5)mm(-2/17))/(((mm0)/m)31/((m(-2/11)/m)/m5)) assuming m is positive. m(-3403/748) Simplify (k/(k(-15/11)/k)kk)/(kkk/(k/k*18)kk)(k(-29))(-2/61) assuming k is positive. k(-10525/671) Simplify p(-2/73)/(p*(-24)p)(p(-1/17))(-7/9) assuming p is positive. p(257092/11169) Simplify ((v17/v(-7))/(v(-3))(-15))(-9) assuming v is positive. v189 Simplify (y/(y/((yyyy/(yy(2/9)))/y)))32/(y/(y/((y/y2)/yyy))(y/(y/(y/y*0y)))/y)(((yyy3)/y)/(y/y(1/6)))(-40) assuming y is positive. y(-637/9) Simplify (jjj(2/5)jj(1/11))/(j(-2/3))(-3/8)(j/j(-1/2))17/(j1)(4/5) assuming j is positive. j(6147/220) Simplify ((d(-11))(-27)/((d(2/5)d)/dd/(dd/(d(2/5)/d)dd)))(-27) assuming d is positive. d(-40527/5) Simplify (q(-1/31)/(q/(q(q/q*25)/qqq)))/(q(2/49))(1/8) assuming q is positive. q(-139975/6076) Simplify (zz(2/9))24(z/z4z)/(z/((z*(4/5)z)/z))((z5z)/((zz/(zz/z*(1/2)z))/z))/(zz(-1/3)/z((z/z*(-1))/zz)/z) assuming z is positive. z(1019/30) Simplify n7/n*2(n(1/2))21(n(1/14)n/(n*(6/5)/nn))/(n0/n)(7/3) assuming n is positive. n*(1859/105) Simplify ((iii/(ii*(-11/5))i)/(ii31))/(i(-2/55)i(ii(1/11))/i) assuming i is positive. i(-1532/55) Simplify ((j*2j(-10/9))/(j9)(-42))0 assuming j is positive. 1 Simplify (v*(3/4)v/v*(1/5)v(v/(vv(-4/3)))/v(1/26))(-48) assuming v is positive. v(-11996/65) Simplify (r*(2/11)(r*4/r)/r)/(rr*5rr(2/19))((r/(r/r3))/(r/r(3/4)))(-19) assuming r is positive. r(-47797/836) Simplify (ii(-6)i)/i*(-7)i*(-8)i/i*(2/11)(i(-3/7)/i)/i(-4/3)(i(-1/2)i)(-17) assuming i is positive. i(-5903/462) Simplify (((q/q(2/3))/q)(-42))*(-25)/(((q(qq(1/3))/q)/q)/(qqqq(qq*(-8)/qq)/qqq))(4/15) assuming q is positive. q(-31528/45) Simplify (uu(3/7))/u(-2/131)(u/(uu(-30))u)/(uu(-19)) assuming u is positive. u(46257/917) Simplify ((m/(m2m))/m8)(-1/6)(m(-1))(-40/3)/(m(2/7))(-47) assuming m is positive. m(199/7) Simplify j/(jjj(-1/19))j*(4/3)/jj*(-22/5)j(-1/33) assuming j is positive. j(-15814/3135) Simplify (q(1/2)/q)(-42)(q/q(-1/3)qq)(-2/9)(qq(-8/3)q7/q)(-3/7) assuming q is positive. q(3478/189) Simplify (p(-8/5)p(2/3))(-42)(p(-1/2))(-6/7)/((p*(-4)/pp)/(p/(pp(-2/7)p)p)) assuming p is positive. p(1537/35) Simplify ((m(-12))(2/73)m*(-32)m(-32))(-2/109) assuming m is positive. m*(9392/7957) Simplify ((n/((nn/n*(-1/4))/n))/n(nn(-1/2)n)/n)(-20)/((n/n(1/2))*(3/35)(n0)(2/17)) assuming n is positive. n(1047/70) Simplify j(-3/8)j(-2/25)j/(jj6j)jj/((j*(-46)j)/jj) assuming j is positive. j(7909/200) Simplify ((rr*1)/rr)*(-27/2)(r/r*0r)/r*(1/2)((r*(-5)/r)/(r/(r/(rrr/r3r))))/(r*5/rrrrr0) assuming r is positive. r(-79/2) Simplify (y/(y/(yy*(-4)))y/(y/(((((y/(yy(-3/5)))/y)/y)/y)/y))(y1)(2/15))/(y(-1/4)/y0y(-4)/(yy*(2/17)y)) assuming y is positive. y(103/1020) Simplify ((n(-2/29)n(-1/2))/((n/(n/(n(-3/2)n)))/nn(n/(n*(6/5)n))/n))/((n(-2/9)/n)13n(-1)/nnn(-8)) assuming n is positive. n(35261/1305) Simplify ((u1u(5/6))/(u(2/7)uuu(1/12)))/((u/u(-5))/(u/u7))(4/33) assuming u is positive. u(-613/308) Simplify (((zz*(1/5)zz)/(zz(3/4)))/(z1)(-45))/((z(-3)z(-2))/(z(-2/7))(-46)) assuming z is positive. z(9043/140) Simplify (q(-12)q*(1/2)qq)/((q/(qq*(-40))qq)/(q/(q(12/13)q))) assuming q is positive. q(-1363/26) Simplify ((k(3/10)k/(k(1/6)k))/(k/((k/k*(2/9))/k)k)27)(2/5) assuming k is positive. k(-1796/75) Simplify ((x(8/7)/x14)/(x(2/15)/xx(-26)/x))(-16) assuming x is positive. x(-25216/105) Simplify ((w/w(-3/4)ww/w5)/(w(-2/3)/w(-8)))/((w(-3))(-29))(5/3) assuming w is positive. w(-1843/12) Simplify (((yy*1y)/((y*24y)/y))/(y*3yyy/y(2/23)))(3/41) assuming y is positive. y(-1857/943) Simplify (t(-2)/(t/(t/(t*6t))))/(t(-3/5)/t(-7))(t(-2)t*0t)/(ttt*4tt6) assuming t is positive. t(-147/5) Simplify ((r(-34)r)*(-2/39)r/(rr26rr)r25)(-1/35) assuming r is positive. r(17/455) Simplify ((u(4/7)uu*(-2/3))/(uu(-3/7))(-35))(-5) assuming u is positive. u(-2195/21) Simplify	{ "pile_set_name": "DM Mathematics" }
is the h'th term of -726, -730, -738, -750, -766, -786, -810? -2h2 + 2h - 726 What is the d'th term of -191, -411, -617, -803, -963? d3 + d2 - 230d + 37 What is the q'th term of 3, 59, 151, 297, 515? 3q*3 + 35q - 35 What is the g'th term of 60, 217, 486, 873, 1384? g*3 + 50g*2 + 9 What is the g'th term of -4549, -9101, -13653, -18205, -22757, -27309? -4552g + 3 What is the z'th term of 61, 70, 89, 124, 181, 266? z3 - z2 + 5z + 56 What is the q'th term of 2362, 2357, 2338, 2299, 2234, 2137? -q3 - q2 + 5q + 2359 What is the g'th term of -184, -192, -200, -208? -8g - 176 What is the i'th term of -8, 18, 60, 124, 216, 342, 508, 720? i3 + 2i*2 + 13i - 24 What is the k'th term of 2843, 2847, 2851? 4k + 2839 What is the p'th term of -144, -141, -138, -135? 3p - 147 What is the y'th term of -133, -129, -125? 4y - 137 What is the l'th term of -9765, -9764, -9763, -9762, -9761? l - 9766 What is the l'th term of -1361, -1353, -1345? 8l - 1369 What is the a'th term of -164, -168, -176, -188, -204, -224, -248? -2a2 + 2a - 164 What is the u'th term of 10710, 10708, 10706, 10704, 10702, 10700? -2u + 10712 What is the y'th term of -33, -86, -175, -300, -461, -658, -891? -18y*2 + y - 16 What is the n'th term of 12, -33, -164, -423, -852, -1493, -2388? -7n3 - n2 + 7n + 13 What is the y'th term of 74, 153, 234, 317? y2 + 76y - 3 What is the k'th term of -223, -430, -641, -856, -1075, -1298? -2k2 - 201k - 20 What is the w'th term of 578, 584, 600, 632, 686, 768, 884? w3 - w2 + 2w + 576 What is the u'th term of 63, 100, 137, 174? 37u + 26 What is the f'th term of 43, 39, 33, 25, 15, 3? -f*2 - f + 45 What is the f'th term of -2110, -4218, -6326? -2108f - 2 What is the x'th term of -65, -134, -203, -272? -69x + 4 What is the z'th term of 88, 89, 90? z + 87 What is the m'th term of 145, 221, 311, 421, 557, 725, 931, 1181? m3 + m2 + 66m + 77 What is the o'th term of -36, -65, -94, -123, -152, -181? -29o - 7 What is the x'th term of -22, -163, -400, -733, -1162, -1687, -2308? -48x*2 + 3x + 23 What is the q'th term of -58, -50, -52, -70, -110, -178, -280, -422? -q3 + q2 + 12q - 70 What is the i'th term of 167, 164, 161? -3i + 170 What is the o'th term of 411, 808, 1193, 1560, 1903, 2216, 2493? -o*3 + 404o + 8 What is the i'th term of 222, 233, 258, 303, 374, 477, 618, 803? i3 + i2 + i + 219 What is the v'th term of 241, 206, 171, 136? -35v + 276 What is the u'th term of 21, 27, 31, 27, 9, -29, -93? -u3 + 5u*2 - 2u + 19 What is the b'th term of -4, -14, -36, -76, -140, -234, -364, -536? -b*3 - 3b What is the f'th term of 2, -2, -12, -28, -50, -78, -112? -3f2 + 5f What is the m'th term of -37, -70, -107, -148? -2m2 - 27m - 8 What is the p'th term of 232, 274, 316? 42p + 190 What is the a'th term of -107, -101, -85, -53, 1, 83, 199? a3 - a2 + 2a - 109 What is the u'th term of 70, 71, 72, 73, 74? u + 69 What is the p'th term of 153, 152, 151, 150, 149? -p + 154 What is the z'th term of 91, 104, 117, 130? 13z + 78 What is the h'th term of -83, -90, -103, -122, -147, -178, -215? -3h*2 + 2h - 82 What is the l'th term of 510, 511, 512, 513? l + 509 What is the x'th term of 81, 214, 401, 642, 937, 1286, 1689? 27x2 + 52x + 2 What is the k'th term of -26, -18, -4, 16, 42, 74, 112? 3k2 - k - 28 What is the j'th term of -36, -61, -78, -87, -88? 4j*2 - 37j - 3 What is the b'th term of 726, 725, 724, 723, 722? -b + 727 What is the k'th term of -40, -100, -206, -364, -580, -860, -1210, -1636? -k*3 - 17k*2 - 2k - 20 What is the r'th term of -31, -19, 17, 89, 209, 389? 2r3 - 2r - 31 What is the l'th term of 12, 40, 82, 138, 208? 7l2 + 7l - 2 What is the b'th term of -19, -24, -29, -34, -39, -44? -5b - 14 What is the z'th term of 1511, 1504, 1493, 1478, 1459? -2z2 - z + 1514 What is the y'th term of 22, 107, 256, 475, 770? y3 + 26y2 - 5 What is the r'th term of -3, -21, -49, -87? -5r*2 - 3r + 5 What is the j'th term of -40, -64, -76, -70, -40, 20? j*3 - 31j - 10 What is the z'th term of 79, 215, 449, 787, 1235, 1799, 2485? z*3 + 43z2 + 35 What is the n'th term of -84, -73, -46, 3, 80, 191? n3 + 2n2 - 2n - 85 What is the b'th term of 65, -22, -119, -232, -367, -530? -b3 + b2 - 83b + 148 What is the j'th term of 101, 187, 273, 359, 445, 531? 86j + 15 What is the k'th term of 109, 231, 353, 475, 597? 122k - 13 What is the z'th term of -75, -68, -61, -54, -47, -40? 7z - 82 What is the u'th term of -901, -1801, -2699, -3595, -4489, -5381, -6271? u*2 - 903u + 1 What is the q'th term of 4087, 8178, 12283, 16408, 20559, 24742? q3 + q2 + 4081q + 4 What is the p'th term of 1431, 5707, 12825, 22779, 35563, 51171, 69597? -p3 + 1427p*2 + 2p + 3 What is the c'th term of 66, 90, 114, 138, 162? 24c + 42 What is the n'th term of 761, 1528, 2303, 3092, 3901, 4736, 5603? n3 - 2n*2 + 766n - 4 What is the y'th term of -531, -1064, -1597, -2130, -2663? -533y + 2 What is the c'th term of 8750, 17498, 26234, 34952, 43646, 52310, 60938? -c3 + 8755c - 4 What is the i'th term of 90, 180, 272, 366, 462? i*2 + 87i + 2 What is the k'th term of -10, -104, -198? -94k + 84 What is the i'th term of 273, 291, 309, 327? 18i + 255 What is the o'th term of 375, 365, 333, 267, 155, -15, -255, -577? -2o3 + o2 + o + 375 What is the b'th term of 19602, 19600, 19598, 19596, 19594? -2b + 19604 What is the n'th term of -23, -27, -27, -23, -15? 2n2 - 10n - 15 What is the t'th term of -634, -1265, -1896, -2527, -3158, -3789? -631t - 3 What is the h'th term of 2624, 2622, 2620, 2618, 2616? -2h + 2626 What is the j'th term of 60, 228, 508, 900, 1404, 2020? 56j2 + 4 What is the z'th term of -298, -303, -320, -355, -414, -503? -z3 + 2z - 299 What is the k'th term of -18, -28, -38, -48, -58, -68? -10k - 8 What is the z'th term of -36, -28, -8, 30, 92, 184, 312, 482? z3 + z - 38 What is the h'th term of -32, -50, -86, -146, -236, -362? -h3 - 3h*2 - 2h - 26 What is the a'th term of 696, 697, 698, 699, 700, 701? a + 695 What is the l'th term of -10, -29, -60, -103, -158? -6l2 - l - 3 What is the z'th term of -700, -693, -682, -667? 2z2 + z - 703 What is the f'th term of 164, 179, 182, 167, 128, 59, -46? -f3 + 22f + 143 What is the w'th term of 2, 57, 218, 539, 1074, 1877, 3002? 9w3 - w2 - 5w - 1 What is the j'th term of -59, -114, -169? -55j - 4 What is the d'th term of 10, 51, 120, 217, 342, 495, 676? 14d2 - d - 3 What is the t'th term of -707, -704, -699, -692, -683, -672, -659? t2 - 708 What is the n'th term of 0, 9, 26, 57, 108? n3 - 2n*2 + 8n - 7 What is the m'th term of -11, -10, 1, 28, 77, 154, 265, 416? m3 - m2 - 3m - 8 What is the m'th term of 5329, 5330, 5333, 5338, 5345? m2 - 2m + 5330 What is the d'th term of -22, -62, -140, -274, -482, -782, -1192? -3d3 - d2 - 16d - 2 What is the j'th term of 104, 318, 676, 1178, 1824, 2614, 3548? 72j2 - 2j + 34 What is the q'th term of -185, -188, -185, -170, -137? q*3 - 3q*2 - q - 182 What is the c'th term of 337, 363, 389, 415, 441, 467? 26c + 311 What is the k'th term of 13, 54, 87, 106, 105, 78, 19, -78? -k*3 + 2k*2 + 42k - 30 What is the x'th term of 1356, 2710, 4064? 1354x + 2 What is the w'th term of -276, -282, -290, -300, -312? -w2 - 3w - 272 What is the g'th term of 287, 284, 257, 194, 83, -88, -331? -2g3 + 11g + 278 What is the q'th term of -75, -153, -231, -309, -387? -78q + 3 What is the i'th term of 1974, 3945, 5918, 7893, 9870? i2 + 1968i + 5 What is the u'th term of -2603, -5202, -7797, -10388? 2u2 - 2605u What is the b'th term of -24, -45, -74, -111, -156, -209, -270? -4b2 - 9b - 11 What is the c'th term of 4384, 4390, 4398, 4408, 4420, 4434, 4450? c*2 + 3c + 4380 What is the d'th term of -19, -68, -149, -268, -431, -644, -913? -d*3 - 10d*2 - 12d + 4 What is the b'th term of 18, 61, 124, 213, 334, 493, 696? b*3 + 4b*2 + 24b - 11 What is the s'th term of 27, 56, 85, 114? 29s - 2 What is the k'th term of -3778, -7526, -11260, -14974, -18662, -22318, -25936? k3 + k2 - 3758k - 22 What is the y'th term of -55, -138, -223, -310, -399, -490, -583? -y*2 - 80y + 26 What is the z't	{ "pile_set_name": "DM Mathematics" }
4 Let u(n) be the third derivative of 4/27n3 - 5/108n*4 + 0n + 0 + 1/540n5 + 1/1080n*6 + 22n*2. Factor u(r). (r - 2)(r - 1)(r + 4)/9 Let p = 42 + -38. Factor -8i*5 + 0i*3 + 2i*p - 11i*5 + 20i5 + i3. i*3(i + 1)*2 Let f = -161/6081 - -6403/12162. Suppose 3/5 + 1/10m*2 + fm = 0. Calculate m. -3, -2 Let d(l) be the third derivative of -l*8/210 - 3l7/175 + l6/30 + l*5/50 - 245l2 - 2. Find z, given that d(z) = 0. -3, -1/4, 0, 1 Let d(p) be the third derivative of -p6/660 - 53p5/165 + 107p*4/132 + 8070p*2. Factor d(h). -2h(h - 1)(h + 107)/11 Let t(j) be the second derivative of -7j6/10 - 57j*5/10 + 3j*4/4 + 41j*3 - 60j*2 - 1620j. Solve t(a) = 0. -5, -2, 4/7, 1 Let q(y) = y*2 - y. Suppose -f = -11f + 7f. Let u be q(f). Factor u + 2/3k + 1/3k2. k(k + 2)/3 Let z = 550709/157342 + -6/78671. Let 19c2 - 5/2c*4 + 12 + zc*3 - 38c = 0. Calculate c. -3, 2/5, 2 Factor 32/3f3 + 8f*4 + 0 + 4/3f*5 + 0f + 0f2. 4f*3(f + 2)(f + 4)/3 Let q(g) = -20g*3 - 97g*2 - 45g + 20. Let x(k) = 16k3 + 95k*2 + 45k - 21. Let f(h) = 3q(h) + 2x(h). Suppose f(j) = 0. What is j? -3, -6/7, 1/4 Suppose 9q5 + q4 + 17q*3 + 46q - 20 + 63q - 20q*2 - 77q*4 + 177q*3 - 196q2 = 0. What is q? 4/9, 1, 5 Let s(o) be the first derivative of o3/3 - 11o2/2 + 1637. Factor s(v). v(v - 11) Factor 34l + 80 - 5l*2 + 11l - 61l + l2 - l2 + l3. (l - 5)(l - 4)(l + 4) Let w(i) = i3 - 16i*2 + 14i + 14. Let a be w(15). Let u(p) = -6p2 + 116p + 122. Let g(z) = 2z2 + 2z. Let h(j) = au(j) - 4g(j). Solve h(y) = 0. -61, -1 Suppose -189504m - 5m*3 + 63729 + 34545 + 1945m*2 - 616m - 12627 + 102533 = 0. Calculate m. 1, 194 Let p(q) be the first derivative of 91 + 26/3q4 + 0q + 6/5q5 + 46/3q*3 - 6q*2. Find b, given that p(b) = 0. -3, 0, 2/9 Suppose 0l + 219/5l3 + 3/5l*5 + 0l*2 + 0 + 222/5l*4 = 0. What is l? -73, -1, 0 Let 109b - b*3 - 4b*2 + 54b*2 - 10b*2 + 84 - 16b*2 = 0. Calculate b. -3, -1, 28 Suppose -f + 1 = 0, 3y = 2f + 8 - 4. Let x = -19273 - -77167/4. Factor -3/4d*y - x + 15/2d. -3(d - 5)2/4 Factor 15i*3 - 112i*2 + 225/2 - 1/2i*4 - 15i. -(i - 15)*2(i - 1)(i + 1)/2 Let v(n) = 29n3 + n2 + 2n - 3. Let y be v(1). Let s = -9 + y. Solve -35w*2 + 9 - 5w*3 + 15w*4 - 34w*5 + 19w*5 + 11 + sw*5 = 0 for w. -2, -1, 1 Suppose 0 = x + a - 10, 6x - 3a - 47 = 2x. Suppose x = 4z + 3. Factor -44j*2 + 45jz + j + 1 + j. (j + 1)2 Let k(z) be the second derivative of -z*4/4 - 17z*3 - 803z + 2. Factor k(c). -3c(c + 34) Let r(a) = a*3 + 13a*2 - a - 10. Let t be r(-13). Let y be ((-5)/(-15))/((-1)/(-6)). Factor -4py + p2 - 3 + 9p2 - tp. 3(p - 1)(2p + 1) Factor -598y - 60575 + 57503 - 3y2 - 518y - 426y. -3(y + 2)(y + 512) Let y = -706242 - -6356192/9. Let x(h) = h2 - 2h - 3. Let t be x(3). Factor 4/3o + yo*3 + t - 46/9o*2. 2o(o - 3)(7o - 2)/9 Let n(w) be the second derivative of -35w - 5/12w4 + 0w*2 + 10/3w*3 + 0. Factor n(z). -5z(z - 4) Let k(p) be the third derivative of -5/48p*8 - 1/21p*7 + 37/3p*5 - 3p + 77/24p6 + 24p*2 + 40/3p*3 + 115/6p*4 + 0. Find o, given that k(o) = 0. -2, -1, -2/7, 4 Factor -4 + 2u*4 + 33u - 1300u3 + 1296u*3 - 29u + 3u2 - u4. (u - 2)2(u - 1)(u + 1) Let p(m) = -5m*3 - 6m*2 - 4. Suppose -71 = -5b - 56. Let f(x) = -x3 + x2 - 1. Let c(g) = bp(g) - 12f(g). Factor c(v). -3v2(v + 10) Let w(k) = -9k - 177. Let z be w(-20). Factor 189a*4 + 3a*3 - 3a - 190a4 + za*2 - 2a*2. -a(a - 3)(a - 1)(a + 1) Suppose 0 = -45o + 49o - 156. Let r be -31 + o/528. Factor 0 - 8/5h + 6/5h*2 + 2/5h*r. 2h(h - 1)(h + 4)/5 Let m be (40(-44)/7480)/(2/(-17)). Suppose 648/5f*m + 3888/5 - 2592/5f - 72/5f3 + 3/5f*4 = 0. Calculate f. 6 Let i(n) = 110n*4 + 3235n*3 + 30010n*2 + 91610n + 90. Let k(d) = 5d4 + 147d*3 + 1364d*2 + 4164d + 4. Let t(o) = -2i(o) + 45k(o). Factor t(s). 5s(s + 8)*2(s + 13) Let j(k) be the second derivative of -k*7/1260 + 5k*6/36 - 125k*5/12 - 11k*4/4 - k - 78. Let q(f) be the third derivative of j(f). Factor q(n). -2(n - 25)*2 Let z be (-3 - 5/(-15))6/(-4). Suppose 8 + 10 = zp - 2q, 0 = 3p + 5q - 7. Determine w, given that 5 - 1 - 2w2 + 2w4 - p = 0. -1, 0, 1 Let x(t) be the third derivative of -t6/120 - t*5/60 - 5t*4/24 + 7t3/6 + t2 - 16. Let v be x(1). Factor 2/19o2 + v + 0o. 2o2/19 What is c in -304 - 10644c - 953 - 871 - 20c2 = 0? -532, -1/5 Let h = -67 + 69. Find g such that -45g*3 + 2g*4 + 37g*h + 6 + 3g*4 + 45g - 76 + 28g2 = 0. -1, 1, 2, 7 Let s(k) = -60k*3 + 54k*2 + 84k - 30. Let m(q) = 12q3 - 1908q + 1891q + 3 + 3 - 11q*2. Let z(d) = -21m(d) - 4s(d). Factor z(p). -3(p - 2)(p + 1)(4p - 1) Factor -462 + 17a*4 - 18a*3 - 824 - 15a*4 + 102a*3 + 404 - 84a + 880a2. 2(a - 1)(a + 1)(a + 21)*2 Let o(j) = -10j*2 - 8j - 8. Let k(z) = -5z2 + 8 - 19z*2 + 8z + 36z2. Let p(w) = 4k(w) + 5o(w). Factor p(q). -2(q + 2)*2 Let b(f) be the third derivative of -19/30f*3 - 1/300f*5 + 2f + 0 + 1/6f4 - 62f*2. Find u such that b(u) = 0. 1, 19 Factor 4/5t*2 + 51380224/5 - 28672/5t. 4(t - 3584)2/5 Let t be (-100)/((-1300)/39) - (-2)/2. Suppose -3a*3 - 1/2a*t + 0 + 16a + 0a2 = 0. What is a? -4, 0, 2 Let z(k) be the first derivative of -12k*2 - 35 + 28/3k*3 + 19k + 7/6k4 - 1/2k*5. Let g(h) be the first derivative of z(h). Factor g(t). -2(t - 3)(t + 2)(5t - 2) Let x(v) = 3v*2 + 129v - 1979. Let g be x(12). Let q(s) be the first derivative of g + 96/7s - 24/7s*2 + 2/7s*3. Factor q(a). 6(a - 4)2/7 Let g be (12 - 16 - 120)/(2/(-110)). Let b(h) = h2 + 4h + 4. Let q be b(-6). Factor 6820a*2 + qa - ga2 - 4a*3. -4a(a - 2)(a + 2) Let d(v) be the second derivative of v8/13440 + v7/1120 + v*6/320 + 49v*3/6 + 3v - 9. Let k(q) be the second derivative of d(q). Factor k(z). z*2(z + 3)*2/8 Factor -2/19g*2 - 16119842/19 - 11356/19g. -2(g + 2839)2/19 Let x be 24/14 + 27/21 + -1. Factor -16o + 3 + 2o3 + 29o*x + 4o*4 - 12o*3 - 11o3 + o3. (o - 3)(o - 1)(2o - 1)2 Let h be (11685/(-1640))/((-9)/(-4)) - -4. Suppose hg*2 - 25/2g + 35/3 = 0. Calculate g. 1, 14 Let i be ((0 - 2)/(-6))/(7 + -6). Suppose -86s + 94s = 24. Find z such that -iz2 - s + 2z = 0. 3 Let k(g) be the first derivative of -g*4 - 196g*3/3 + 104g*2 + 400g - 55. Factor k(r). -4(r - 2)(r + 1)(r + 50) Let t(o) be the first derivative of 800o - 320o2 + 2/5o*5 + 8o*4 + 16o*3 - 68. Factor t(m). 2(m - 2)*2(m + 10)*2 Factor 862/3s + 1/6s2 + 371522/3. (s + 862)2/6 Determine a, given that -5/3a*2 - 26096415 + 13190a = 0. 3957 Let o(d) = -880d3 - 325d*2 + 920d + 685. Let m(l) = -8l4 + l2 - l - 2. Let j(c) = -40m(c) - o(c). What is h in j(h) = 0? -11/8, -1, 1 Let g(b) be the first derivative of -b*5/15 - 31b*4/4 - 617b*3/9 - 433b*2/2 - 258b - 4518. Factor g(p). -(p + 1)(p + 3)2(p + 86)/3 Let w(h) = 53h + 389. Let v be w(-5). Let k be (-2(-2)/(-42))/(v/(-868)). Factor -2/3n2 - 7/3n*4 - 8/3n*3 + 1/3 + kn - 2/3n5. -(n + 1)4(2n - 1)/3 Let b(t) be the second derivative of t7/21 - 4t*6/15 + 3t*5/10 + 2t*4/3 - 4t*3/3 - 348t. Suppose b(y) = 0. What is y? -1, 0, 1, 2 Determine z, given that 22/7z - 15 - 1/7z*2 = 0. 7, 15 Let c(x) be the first derivative of -1/15x*3 + 106 + 18/5x + 3/10x2. What is t in c(t) = 0? -3, 6 Let l be -3 + 10 + 1/(5/(-15)). Factor -lm + 10 - 5m2 + 11m - 2m. -5(m - 2)(m + 1) Let -1365a*2 + 1551a*2 - 3191a + 3146a + 34a*3 + 5a*3 = 0. What is a? -5, 0, 3/13 Let n(z) be the first derivative of 1/6z*6 - 1/2z*5 + 0z*4 - 5/2z*2 - 35z - 20 + 5/3z3. Let w(a) be the first derivative of n(a). Factor w(r). 5(r - 1)*3(r + 1) Let a(w) be the second derivative of -4/3w3 - 5/6w*4 - 43/2w*2 - 40w + 7/15w5 + 0. Let s(r) be the first derivative of a(r). Factor s(z). 4(z - 1)(7z + 2) Suppose 127 + 240d + 193 - 188769d*5 + 188774d*5 - 80d*3 - 80d**2 = 0. What is d? -2, 2,	{ "pile_set_name": "DM Mathematics" }
2, 17 Suppose j + 2k = 2j + 213, 2k + 402 = -2j. Let a = 321 + j. List the prime factors of a. 2, 29 Suppose 0 = 11y - 53806 + 13711. What are the prime factors of y? 3, 5 Let p(t) = t3 + 4 - t2 - 3 + 5t2. Let c be p(-4). What are the prime factors of ((-35)/(-3))/(c/3)? 5, 7 Let m(a) = -a3 + 9a2 - 14a - 11. Let p be m(7). Let k = p + 41. List the prime factors of k. 2, 3, 5 Let u(n) = -4n3 - n2 - 21n - 31. List the prime factors of u(-6). 13, 71 Let s(i) = 4i3 + 8i*2 - 2i - 13. Let k(x) = -3x3 - 8x*2 + 2x + 12. Let n(q) = 5k(q) + 4s(q). Let z = 58 - 50. List the prime factors of n(z). 2, 3 Suppose 0 = -f + 3f. Suppose fl - 2l = 24. Let d = -3 - l. What are the prime factors of d? 3 Let x(f) = 5f - 6. Suppose 3h - 18 = -3u, 2u = 2h - 5h + 14. What are the prime factors of x(u)? 2, 7 Suppose 4w - 44 = -3v, -15 = -4w + 5v - 3. Suppose 4f + 0 = w. List the prime factors of f/(-10) - (-61)/5. 2, 3 Let a(r) = -3r + 13 + 0r - r. Suppose -5z + 230 = 265. List the prime factors of a(z). 41 Let l = 99 - 94. Suppose -lr + 116 + 694 = 0. What are the prime factors of r? 2, 3 Let d(z) = z*3 + 7z*2 + z + 8. Suppose 32 = -4j - 4i, 4j - i = j - 16. Let c be d(j). Let q = -21 + c. List the prime factors of q. 17 What are the prime factors of (-4)/(-10) - (-94458)/130? 727 Suppose 0 = x - 12 + 8, 2x = 2t - 1048. What are the prime factors of t? 2, 3, 11 Suppose 0 = -5v + 4m + 2348, -5m - 1298 = -5v + 1052. Suppose 17c + v = 20c. What are the prime factors of c? 2, 3, 13 Suppose b + 0b - 968 = -5o, -5o = -5b - 950. Suppose -32 = f - o. List the prime factors of f. 7, 23 Let k(t) = -2t2 - 28t + 7. Let p be k(-15). Let m = 151 + p. What are the prime factors of m? 2 Let f(y) = y + 2. Let k be (1 + -2)/(1/2). Let w be f(k). Suppose w = 5l - 117 - 173. What are the prime factors of l? 2, 29 Let l be (-114)/(-21) - (-3)/(-7). Suppose 3h - h - lt = 3, 5h + 5t = 25. Suppose -h + 26 = 2y. List the prime factors of y. 11 Suppose 0 = l - 4, -2l + 434 - 2686 = -2x. List the prime factors of x. 2, 5, 113 Let c(f) = -4 - 2 - 3f - 1 + 3. List the prime factors of c(-5). 11 Let y(f) = 4f + 2. Let r = 7 + -10. Let k be y(r). What are the prime factors of (-104)/10k/4? 2, 13 Suppose -162 + 1774 = a. Suppose -a = 9v - 22v. What are the prime factors of v? 2, 31 Let a(h) = -h2 - 9h - 4. Let i be a(-8). Suppose -4q - 244 = -g + 2g, -iq = 3g + 252. Let x = q - -88. What are the prime factors of x? 2, 7 Suppose 2819 - 13180 = -13d. List the prime factors of d. 797 Suppose -25z + 47z = 13112. What are the prime factors of z? 2, 149 Let o(h) = -h - 5 + 9h2 - h2 + 9. Let r be o(-4). Let v = -80 + r. What are the prime factors of v? 2, 7 Suppose 1448 = 4y - 300. What are the prime factors of y? 19, 23 Let d(s) = -41s*2 + 5s - 5. Let n be d(2). Let r = n - -287. List the prime factors of r. 2 Let n be 2 + ((-1)/2)/(1/(-2)). Suppose -69 = -nc + 138. What are the prime factors of c? 3, 23 Suppose 4i - 10081 = 2i + 5r, 0 = 4r - 20. List the prime factors of i. 31, 163 What are the prime factors of (-2409)/(-6) - (-154)/(-44)? 2, 199 Suppose -3x + 5l = 30 + 1912, -1924 = 3x + 4l. List the prime factors of 0 + 0 + x/(-7). 2, 23 Let q(l) = 18l + 24. What are the prime factors of q(22)? 2, 3, 5, 7 Let l be (-77)/(-11) - (1 + -2 - -3). Suppose -t = -3s - 6, 3s + s = -lt + 11. List the prime factors of t. 3 Suppose f - 3 + 6 = 0. Let o be (-1 - -1)/(-2) - f. What are the prime factors of 22/2 - (o + 0)? 2 Let c(g) = -6g*2 - 265g - 18. List the prime factors of c(-38). 2, 347 Let d = -5750 + 8576. What are the prime factors of d? 2, 3, 157 Let n(p) = 150p2 + 4p + 7. List the prime factors of n(4). 2423 Let k = -2936 - -5261. List the prime factors of k. 3, 5, 31 Let f(n) = -234n - 44. List the prime factors of f(-3). 2, 7, 47 Suppose -14k = -25k + 9504. List the prime factors of k. 2, 3 Let c = -11 - -18. Let d(a) = -a2 + 9a - 11. Let q be d(c). Suppose -2t + 72 - 16 = -5m, -m = qt - 50. List the prime factors of t. 2, 3 Let c(o) = 1 + 0 - 31o - 11 - 3. What are the prime factors of c(-6)? 173 Suppose -29856 = -27k + 3k. What are the prime factors of k? 2, 311 Let c(w) = -w*2 + 6w - 8. Let r be c(4). Let h(n) = 83n + 2. Let d be h(2). Suppose k + 3k - d = r. List the prime factors of k. 2, 3, 7 Suppose 321 = -4g - 3t, 3g + 2t - 7t + 219 = 0. Let j = -27 - g. What are the prime factors of j? 3, 17 Let h be (25/10)/(4/8). Suppose 3m - z = 503, 0 = -2m - 0m - hz + 341. List the prime factors of m. 2, 3, 7 Let i(s) = 35s + 145. List the prime factors of i(4). 3, 5, 19 Let q(z) = -z*3 + 5. Let x be q(0). Suppose 6c - 5r - x = c, -4r + 8 = 2c. Suppose -3p - 4f = -161, p - cp + f = -49. What are the prime factors of p? 3, 17 Suppose -5m - 2b + 14 = -3, -8 = 2b. Suppose mk + 3z = -28 + 220, 3k = 2z + 100. List the prime factors of k. 2, 3 Let f(s) = 4s + 7. Let w(q) = -q*2 + 11q - 10. Let k be w(8). Suppose -5x + 9 + k = 4a, x = -2a + 1. List the prime factors of f(x). 5, 7 Let f = 11 + 7. Let t = f + -12. Suppose -30 = -3l + t. What are the prime factors of l? 2, 3 Let n(o) = -o - 2o + 1 + 4o*2 + o + 4o. Let v be n(-1). Suppose -vd = -20 - 19. List the prime factors of d. 13 Suppose 2s - 3s = 0. Suppose 15 = 9c - 6c. Suppose s = -cp + 3r - 8r + 80, r = -4. What are the prime factors of p? 2, 5 Suppose 0 = -60g + 103g - 130505. What are the prime factors of g? 5, 607 Suppose 2r + 27 = 5y + 7, -3r + y - 4 = 0. Suppose 4m - 374 = -ri - 5i, 0 = i - 4m - 94. List the prime factors of i. 2, 3, 13 Suppose 0q + 3c = 5q - 26, -8 = -q + 2c. Suppose i + 2x = 13 - 1, -5i + 32 = -qx. Suppose 76 = ij - 4j. What are the prime factors of j? 19 Let i be 0/(-1) - (1 - 1). Suppose -3p - 3k = -30, -p + 3p + 3k - 23 = 0. List the prime factors of i + -2 + 42/p. 2 Let m(x) = 18x + 37. Let v be m(-12). Let w = v + 298. List the prime factors of w. 7, 17 Let h be -2 + 1 + 13/((-39)/6). List the prime factors of 0 + h - (-63 - (-4)/4). 59 Let w = 35 + -15. Suppose 2u = 5v + u + w, -4v - 16 = -4u. List the prime factors of 9/(18/20) - v. 2, 7 Suppose -4g = 5i - 3223, -11g + 9g - 3211 = -5i. List the prime factors of i. 643 What are the prime factors of -2 + 2 + (-18)/(-3) + -4? 2 Let o(s) = 2s2 + 3s + 2. Let n be o(-8). Suppose 4l - n = 14. List the prime factors of l. 2, 3, 5 Let i be (-47)/(1/27-3). Suppose -2d + i = -169. List the prime factors of d. 2, 37 Let s(x) = x2 + x + 10. Suppose 5i - n + 5 = -0i, 5i = -3n + 15. List the prime factors of s(i). 2, 5 Let x(l) be the first derivative of l3/3 - 5l*2/2 - 4l - 11. List the prime factors of x(6). 2 Let x be 43 - (2 + -1 - 2). Let r = 3 + -1. Suppose 4l = 3t + x, -rt = -7t - 20. List the prime factors of l. 2 What are the prime factors of (-6)/(-5)(54915/(-6))/(-7)? 3, 523 Let m(s) be the second derivative of 2s*3/3 + 27s. What are the prime factors of m(9)? 2, 3 Suppose 0 = -8f + 3f + 10. Suppose 8z - 630 = fz. What are the prime factors of z? 3, 5, 7 Let u be (-2)/(1 + (-14)/12). Let h(p) = 3p + 9. What are the prime factors of h(u)? 3, 5 Suppose -79t + 75t = 1516. Let x = t - -655. List the prime factors of x. 2, 3, 23 Suppose 16i - 11i - 645 = 0. Let f = -79 + i. What are the prime factors of f? 2, 5 Suppose -4t + 2n + 3n = -85, t - 24 = 4n. Let v = 36 - t. Suppose 3i + 2j + 1 = 0, -i - v = 2i + 5j. What are the prime factors of i? 3 Let x = 37 + -84. What are the prime factors of (1 - (0 + -1))/((-2)/x)? 47 What are the prime factors of -58(5 - 75/10)? 5, 29 Let v = 10 + -41. Let t be -1 + (-1)/(1/v). Let a = t + 0. List the prime factors of a. 2, 3, 5 Let s(d) be the second derivative of -d*3/3 - 10d*2 - 2d. Let z be s(-10). Suppose 3m + 4b = 148, -2m + 96 = -zm + 2b. List the prime factors of m. 2, 11 Suppose -2n + 953 = -5b + 246, 4n + 5b = 1399. List the prime factors of n. 3, 13 Let g(x) = -21x - 8. List the prime factors of g(-5). 97 Let a = 14 - 14. Suppose 2n - 3p = -43, 0 = 3p - ap - 15. Let q = n - -40. What are the prime factors of q? 2, 13 Let c = 22 + -10. Suppose -n = 4*g -	{ "pile_set_name": "DM Mathematics" }
first derivative of f(q). What is the derivative of b(w) wrt w? -18w2 Let j(t) be the second derivative of -43t*8/56 + 13t*4/6 + 56t. Find the third derivative of j(i) wrt i. -5160i3 Suppose c = -0c - 5. Suppose 2 - 8 = -t. Let q(y) = 3y - 5. Let b(p) = 3p - 4. Let n(z) = cq(z) + tb(z). Differentiate n(g) wrt g. 3 Find the third derivative of 15i2 - 19i*4 - 14i*2 - 2i*4 wrt i. -504i Let m be (-4)/(-14) + (-48)/(-28). What is the third derivative of -4pm + 3p*2 + 4p*2 - 2p3 + p3 wrt p? -6 Let k be (1 - 0)(-1 - -3). Find the second derivative of 2n + 4n + kn*5 - 6n + 6n wrt n. 40n*3 Let p(x) be the first derivative of -8 + 0x - 8/3x3 - 2x*2. Find the second derivative of p(l) wrt l. -16 Suppose 5w + 25 = 2j + 3j, 0 = 3w + 6. What is the second derivative of -28k*j + 5k + 28k3 - 8k*4 wrt k? -96k*2 Let m(f) = 35f - 4. Let v(n) = -n. Let s(r) = m(r) - 3v(r). What is the first derivative of s(q) wrt q? 38 Differentiate -2 + 3w - 5w - 3w - 4 with respect to w. -5 Let i(p) be the second derivative of -2p4/3 - 3p*2/2 + 3p. Find the first derivative of i(n) wrt n. -16n What is the third derivative of 0j + 0j - 4j*6 - 23j*2 + 20j*2 wrt j? -480j*3 Suppose -5f = 2a + 4, -4f = -7f - 6. What is the derivative of -2j - 4ja - 2 - j + 3j wrt j? -12j2 Let u be ((-2)/6)/(1/(-27)). Let w be ((-33)/u)/((-2)/6). What is the third derivative of 11g - g*2 - wg + 2g6 wrt g? 240g*3 Suppose 0 = -3n + 21 - 15. Let t(j) be the second derivative of 1/6j4 + 0j*3 + 1/10j*5 + 0 + 0j*n + 2j. What is the third derivative of t(q) wrt q? 12 Suppose 8 = -2r + r. Let c = r + 11. Differentiate -1 + 2 - c - 2f*4 with respect to f. -8f*3 Let v(i) be the first derivative of 2 + 5/2i*2 + 3i. Let s(f) = -6f - 4. Let m(q) = -2s(q) - 3v(q). Differentiate m(b) wrt b. -3 Suppose z = -4g - 11, -2g - 2 = z - g. Suppose 3t + 5m = -t + 23, 0 = t + m - 5. Differentiate -k - z + 3k*t + k wrt k. 6k Let t = -8 - -12. Suppose 2d - 24 = -tv, -2d + 7v - 3v - 16 = 0. What is the second derivative of k2 + k - 2k*d + k wrt k? -2 Suppose -2a + 1 = -3. Differentiate -a + 1 + p + p - 3p with respect to p. -1 Find the third derivative of -4c*2 + 4c*5 + 5 + 7c*5 - 5 wrt c. 660c*2 Let m(r) be the first derivative of -25r*6/6 + 8r*3/3 + 20. Find the third derivative of m(v) wrt v. -1500v*2 What is the derivative of -21z - 7 - 12 + 36 wrt z? -21 Let a(y) = -y*3 + 8y*2 - 8y + 8. Let u be a(7). Find the first derivative of 0 + 2 - u - 3 - 2g2 wrt g. -4g Let n(f) be the second derivative of -f*6/30 - 3f5/20 - f4/3 + 3f2/2 - 2f + 7. Find the third derivative of n(p) wrt p. -24p - 18 Let k be 3 - (-3 - -2)1. Suppose -ks = -3d + 4 + 16, -5d + 14 = 3s. Find the second derivative of -2r4 - 2r*d + 2r + 3r4 wrt r. -12r*2 Differentiate -4 + 9j - 2j + 2 wrt j. 7 Let y(u) = 6u - 1. Suppose 3h = 0, -4w + 5w - 5h - 1 = 0. Let n be y(w). Find the third derivative of 2m3 + 2m2 + mn - 2m3 wrt m. 60m*2 Find the second derivative of 50c*5 - 3c - 14c - 5c - 26c5 wrt c. 480c*3 Let v(d) = d. Let k(l) = 4l - 5. Suppose -3r = -5i - 6, -i - 2r = 3i + 18. Let t(y) = iv(y) - k(y). What is the derivative of t(z) wrt z? -7 What is the second derivative of -25d*3 + 53d*3 + 3d - 25d3 wrt d? 18d Let t(n) be the first derivative of -29n5/5 - 4n - 34. Find the first derivative of t(b) wrt b. -116b3 Let z = 3 + 10. What is the derivative of -2x - 9 + z - 2x - 5x wrt x? -9 Let z(h) = 14h4 - 6h*3 + 6h*2 - 6h + 7. Let v(b) = -b4 - b3 + b*2 - b + 1. Let r(x) = 6v(x) - z(x). What is the first derivative of r(t) wrt t? -80t3 Suppose -4t + 6 + 6 = 0. Suppose -5g = -tg - 6. Find the third derivative of -2l2 + l2 - l2 - lg wrt l. -6 Suppose 0 = -5k + z + 9, -4k + 6 = -3z + z. What is the first derivative of x*k + 15x + 1 - 15x wrt x? 2x Let f(n) be the first derivative of -n7/70 - n3/2 + 2n2 - 5. Let g(t) be the second derivative of f(t). What is the first derivative of g(c) wrt c? -12c*3 Let i be (-1925)/(-14)12/15. Find the second derivative of if4 - 4f*5 - 110f*4 - 2f wrt f. -80f3 Let n(h) = -18h*2 - 13h - 25. Let m(z) be the first derivative of 3z3 + 3z*2 + 12z - 4. Let p(s) = 13m(s) + 6n(s). Differentiate p(k) wrt k. 18k Find the second derivative of 7u*5 - 36u - 2u5 + 30u wrt u. 100u3 Let p(b) be the second derivative of 4b*6/15 + 4b*2 + 3b. What is the derivative of p(u) wrt u? 32u3 Let w = 3 - 3. Let f(k) be the second derivative of -3/2k*2 + wk*4 - k + 0k*3 + 1/20k*5 + 0. What is the first derivative of f(o) wrt o? 3o*2 Let j(v) be the second derivative of 4/3v*3 + 0v*2 - 3/10v*5 + 0v*4 + 5v + 0. What is the second derivative of j(u) wrt u? -36u Find the first derivative of -7 + 2g*2 + 9g*2 + 6 wrt g. 22g Suppose 8w - 3w = 4d - 6, 0 = -3w + 6. Find the first derivative of 10 + 2c3 - 2c3 + cd wrt c. 4c3 Let w(c) = -c5 - c4 + c2. Let y(k) = -15k*5 - 5k*4 + 20k*2. Let s(o) = -5w(o) + y(o). Find the third derivative of s(p) wrt p. -600p2 Find the third derivative of 31i*2 + 6i*5 - 77i*2 + 37i*2 wrt i. 360i2 Let w(v) = v2 - v + 1. Let s(x) = 5x2 + 4x - 17. Let h(t) = -s(t) - 4w(t). Find the first derivative of h(d) wrt d. -18d Let f(q) be the first derivative of -19q4/2 + 31q + 37. What is the derivative of f(x) wrt x? -114x2 Let t(b) = b3 + 4b*2 - 4b + 6. Let i be t(-5). What is the first derivative of -i - 2 - 2u + u + 2u wrt u? 1 Let a = -3 + 3. Find the third derivative of -s*4 + 2s*4 - 3s*2 + as*2 wrt s. 24s Let u(i) be the third derivative of i*8/56 + 3i*4/4 + 21i*2. What is the second derivative of u(w) wrt w? 120w*3 Let q(z) = -189z*3 + 9. Let r(n) = 19n*3 - 1. Let u(y) = 2q(y) + 21r(y). Differentiate u(p) with respect to p. 63p2 Let p(h) be the third derivative of h7/30 + 2h3/3 - 6h*2. Differentiate p(z) with respect to z. 28z3 Let b(u) be the first derivative of u7/420 - u*5/120 + 2u*3/3 - 3. Let c(m) be the third derivative of b(m). Find the second derivative of c(n) wrt n. 12n Let s = -83/10 - -49/5. Let t(l) be the second derivative of 0 - 1/10l5 + 0l*4 + 0l*3 + 4l + sl2. What is the first derivative of t(a) wrt a? -6a*2 Let q(x) be the first derivative of -5x7/42 + x3/3 - 4x + 3. Let t(s) be the first derivative of q(s). Find the second derivative of t(o) wrt o. -100o3 Let z(k) be the second derivative of k5/5 - k*3/2 + 5k. What is the second derivative of z(d) wrt d? 24d Let f be -1((-14)/4 + 3). Let s(g) be the first derivative of -1 - g - fg2. What is the derivative of s(u) wrt u? -1 Let z(y) be the third derivative of y6/40 - y5/10 - 5y*2. Find the third derivative of z(s) wrt s. 18 Let n(q) = 17q*5 - 11q*2 + 24q - 11. Let g(d) = -9d5 + 6d*2 - 12d + 6. Let i(w) = -11g(w) - 6n(w). What is the second derivative of i(u) wrt u? -60u3 Let q(a) be the second derivative of a6/60 + 5a*4/24 + 3a*2/2 - 5a. Let y(m) be the first derivative of q(m). Find the second derivative of y(g) wrt g. 12g Find the second derivative of 475l + 59l3 - l2 + l2 - 524l wrt l. 354l Suppose 0 = -5a + 5q, 3a + 0a = -3q + 24. Find the third derivative of -p*4 + 7pa - p2 - 3p4 + 4p*2 wrt p. 72p Suppose -5p = -2r - 7 - 20, 3p - 17 = 2r. Let c be -4-2(-3)/(-12). What is the third derivative of f*p + 3f*c - 3f2 + f2 wrt f? 60f2 Let i(c) = -c + 1. Let q be i(-1). What is the third derivative of s5 - sq + 2s*2 + 2s*4 - 2s*4 wrt s? 60s2 Let m(b) be the second derivative of -b7/420 + b4/24 - b3/6 + b. Let l(u) be the second derivative of m(u). Differentiate l(y) wrt y. -6y2 Let u(r) = 2r - 4. Let f be u(3). Let d(i) = i*3 + 4i*2 - i - 2. Let x be d(-4). Find the second derivative of 2w*2 + 2 + xw - f wrt w. 4 Let i = -32 + 38. Let j(f) be the second derivative of 0f2 + 0f*5 + f + 0 - 1/3f*3 + 1/15f*i + 0f*4. What is the second derivative of j(h) wrt h? 24h**2 Let o(l)	{ "pile_set_name": "DM Mathematics" }
+ 77 + 4 = -k, 0 = 5t + 4k - 126. Let i(w) be the first derivative of w*4/4 - 6w3 - w2/2 + 24w - 3. Give i(t). 6 Let v(u) = -11u - 8u2 - 189 + 179 + 9u*2. Calculate v(12). 2 Let y(m) = 7m - 4. Let j(s) = 31s - 134. Let i be j(5). Suppose -it = -19t - 6. Calculate y(t). 17 Let c(i) = 35i*2 + 9i + 12. Let o(h) = 122h2 + 27h + 37. Let f(g) = -14c(g) + 4o(g). Give f(-8). -4 Suppose -39n + 210 = -34n. Let t be (-22)/(-8) - (-1)/4. Let l(d) = 4 + 44d - nd - t - 7d2. What is l(-1)? -8 Suppose l + 3 = -5f, -l = -3f - 6 + 1. Let q(d) = -4d*2 - 48 - 4d*2 - 8 + 62 - 5. Determine q(l). -31 Let r(a) be the second derivative of 7a*3/6 - 13a*2/2 + 489a. What is r(-13)? -104 Let p(n) = n*2 + 14n + 14. Let d be p(-13). Let g(a) = 21a2 + 6. Let f(b) = -4b*2 - b + 1. Let k(m) = dg(m) + 5f(m). Give k(6). 17 Let k(u) = -u3 - 10u*2 - 16u + 8. Let r be ((-32)/3)/2(-222)/(-148). Calculate k(r). 8 Let i(x) = -x3 + 7x*2 - 3x + 16. Suppose -3g = g + g. Suppose g = 3m + 2f - 23, 2m + 36 = 7m + f. Determine i(m). -5 Let m(k) = -15k - 43. Let t(j) = 5j + 17. Let l(o) = -3m(o) - 8t(o). Give l(7). 28 Let y(v) = 4v + 3v2 - 6v*3 - 159 - 8v*3 + 30v*3 - 12v*3 + 157. What is y(-2)? -30 Let k(d) = 2d*2 - 28d + 48. Suppose 60b + 240 = 80b. Give k(b). 0 Let t(z) = z - 2. Let i = -3352 - -3355. Calculate t(i). 1 Let l = 178 - 167. Let s(k) = -7k3 - 5k*2 + 10k + 9. Let g(r) = 13r3 + 10r*2 - 19r - 17. Let z(b) = ls(b) + 6g(b). What is z(-6)? -15 Let n = -65 - -91. Suppose l + 0 = -3b - 6, -5l - b = -n. Let p(z) be the second derivative of z3/6 - z2 + 13z. Give p(l). 4 Let h = -84 + 94. Let l(v) = -2 - 10v - hv + 18v. Determine l(2). -6 Let r be 2/(-1)(-12)/6. Let i(h) be the first derivative of -4/3h*3 + 1/4h4 + h2 - 48 + 0h. Determine i(r). 8 Let w(l) be the third derivative of -168l*2 - 7/24l*4 + 0 + 0l - 1/3l3. What is w(-4)? 26 Let i(j) be the third derivative of -j6/120 - j5/30 - j4/24 + j3 - 63j*2 - 2j - 9. What is i(-4)? 42 Let k(u) be the first derivative of 2u3/3 - 6u*2 + 4u + 1519. Calculate k(7). 18 Let p(w) = -w*2 + 7w - 14. Let z(t) = t*3 - 12t*2 + 27t + 5. Let a be z(9). Calculate p(a). -4 Suppose 0 = 4i + 5w - 3w + 48, -27 = 5i - 3w. Let t(u) be the first derivative of -u3/3 - 5u*2 - 5u - 25. Give t(i). 4 Let j = -143 - -148. Suppose -jw + 4s = 0, 0 = -6w + 4w - s. Let i(v) be the third derivative of -v5/60 - v4/24 - v*3/6 - 9v*2. Calculate i(w). -1 Suppose v - 2l - 542 = 3v, -4l - 1354 = 5v. Let z = 274 + v. Let t(d) = d - 1. Let k(p) = -p2 + 9p - 5. Let w(o) = -k(o) + 6t(o). Calculate w(z). 3 Let g(a) = 2a. Suppose 4c = 3u - 348, -4c - 2u + 197 = 565. Let k = 97 + c. Suppose -3p = -p - 3f + k, f + 15 = 5p. Calculate g(p). 8 Let f(h) = -6h + 4. Let o(p) = p + 9. Let z be o(-9). Let g be f(z). Let b(i) = i + 4. What is b(g)? 8 Let u(k) = k*2 + 5k - 7. Let h(p) = p*2 - 15p + 28. Let j be h(13). Suppose 0 = 3w - 6, j = -i + 4i - 2w. What is u(i)? 7 Let i(n) = -3n - 3. Let t be i(1). Let g(a) = -10a3 + a2 - 10a - 10. Let m be g(-1). Let s(l) = ml - 5 + 6l - 28l + 10l. Determine s(t). 1 Let l(w) = 3w3 - 4w*2 + 8w - 52. Let a(g) = -g*3 + 3g*2 - 3g + 16. Let v(b) = 7a(b) + 2l(b). Determine v(13). -57 Let m(u) = u - 4. Let w = 98 + -101. Let x be 10/(-15)1w. What is m(x)? -2 Let k(r) = -4r2 + 49r - 20. Let n be (-3 - 14/(-4))10. Suppose nv - 10 = -55. Let b(w) = -w*2 + 12w - 5. Let i(q) = vb(q) + 2k(q). Determine i(7). -16 Let p(k) = -k - 1670. Let h(u) = 239. Let s(w) = -7h(w) - p(w). Let b(d) = d2 - 2d + 3. Let m be b(3). Determine s(m). 3 Let h(j) be the second derivative of j*4/12 + 17j*3/6 + 7j*2/2 + 177j. Let s(t) = -2t2 - 32t - 14. Let l(z) = 5h(z) + 3s(z). What is l(-10)? 3 Suppose -3a + 2 = i, -4a = -2a - 4i + 8. Let u be (-2)/((-16)/(-4 + a))-6. Suppose 51s = 52s - u. Let h(l) = -l2 - l + 2. What is h(s)? -10 Let s(o) = -6o + 13. Let a be ((13/26)/((-1)/(-28)))/(-2). What is s(a)? 55 Suppose -19x - 21x = 0. Suppose -6b - 24 = -xb. Let w(l) = l*2 + 0l - 2l + 6l - 5. Determine w(b). -5 Let t(f) = -34f3 - 22f*2 - 46f - 32. Let i(d) = -45d3 - 23d*2 - 45d - 32. Let x(o) = 3i(o) - 4t(o). Determine x(-16). 16 Let x = -231 - -233. Let q(r) = -r + 8 + 1 - x. Let l be 6 - ((-2 - -3) + 0). What is q(l)? 2 Let f(q) be the third derivative of 7q6/30 + q5/60 + q4/24 - q3/6 - q2. Let u be ((-70)/4 - -17)-2. Calculate f(u). 29 Let o = -388 + 382. Let z(y) = -6y2 - 33y + 6. Let u be z(o). Let s(d) = 2d + 4. Give s(u). -20 Let k(f) = -f3 - 2f + 5. Let c(g) = -5g2 - 5g - 11. Let a(m) = -c(m) + k(m). Determine a(6). -2 Let g(x) be the first derivative of x*3/3 - 3x*2 + 3x + 4. Suppose 134v - 34 = 132v. Let w = 22 - v. Calculate g(w). -2 Let g = -21532 - -21528. Let m(s) = -s*2 - 93s - 356. Give m(g). 0 Let c be (-896)/(-14) + 5-1. Let l(q) = -3q + q*2 - c + 18 + 29. Calculate l(6). 6 Suppose -3b + 15 = -12. Let g(t) = 7t3 - 20t*2 + 30t + 21. Let z(p) = 3p3 - 10p*2 + 14p + 10. Let l(k) = 2g(k) - 5z(k). Calculate l(b). -17 Let c(l) = -l*2 - l + 3. Let h be 1 + ((-7)/1 - -3) - -80. Let g = 85 - h. Let r be (6 + -6 - g)2/4. What is c(r)? -9 Let a be ((-120)/(-100))/((-2)/(-55)) + -1. Let b be (a/4)/((-2 + 0)1). Let u(g) = g2 - 3g + 4. Give u(b). 32 Let b(d) be the third derivative of d6/180 + d5/40 + 3d4/8 + 5d2. Let x(r) be the second derivative of b(r). Let c be (0 - 1)/(23/46). Calculate x(c). -5 Let i(o) = -o3 + 5o2 + 8o - 4. Let t be 36/(-9)((-3)/2 + 1). Suppose -17 = -3s + tr + 3, 2s + 2r = 10. Calculate i(s). 8 Let o(m) be the second derivative of -m4/12 - m3/2 - m2 + 4306m - 1. Let q = 1 - 2. Give o(q). 0 Let h(o) = -3o3 + o2 + 2o + 2. Let x(g) = -2354g + 16480. Let l be x(7). Give h(l). -14 Let s(d) = -d3 + 5d*2 + 4d - 5. Let l(w) = 14 - w - 13 + 3w + 6w*2. Let m be l(-1). Suppose 4z - 27 = -3r, 0 = -4z + z + mr + 13. Determine s(z). -17 Let n(s) be the third derivative of s5/10 + 9s*4/8 - 7s*3/3 + 59s*2. Let m(h) = 4h*2 + 18h - 9. Let u(f) = -8m(f) + 5n(f). Determine u(-4). 6 Let p be 1/3 - (-2)/(-6). Suppose 4n - n + b + 21 = p, -4b = -12. Let k(z) = 2z + 16. Let r(o) = 1. Let v(t) = -k(t) + 10r(t). Give v(n). 10 Let t be (837 - 0)/((-2)/3). Let r = t + 449. Let z(h) = -h2 + 7h - 4. Calculate z(r). 6 Let w(d) be the third derivative of d*6/120 + 3d5/20 + d4/6 - 5d3/6 + 6732d*2. Give w(-7). 65 Let f(t) = -13712 - 10t - 2t + 13720. Determine f(2). -16 Suppose 477p - 448 = 445p. Let q(x) be the first derivative of -x3/3 + 7x*2 - 2x - 1. Determine q(p). -2 Suppose -49 = -z + 2q, 0q - 5q + 169 = 3z. Suppose 5j + z = 93. Suppose -j + 23 = 3d. Let i(l) = -l*2 + 4l - 6. Calculate i(d). -11 Suppose h - 12 = -3s, -3 = 3s - 3h - h. Let x(z) = -2z2 + z3 - sz2 - 3z2 - 7 + z2. Determine x(6). -43 Let b(t) = t*3 - 20t*2 + 7t - 140. Let l(o) = -o*3 + 14o*2 + 21o - 2. Let v be l(-2). Determine b(v). 0 Let g = -106 - 54. Let f = 156 + g. Let x(s) = s*3 + 3s*2 - 6s - 1. Calculate x(f). 7 Let o(g) = -8g2 - 8g - 3. Let z(l) = 5l2 + 10l + 3. Let k(x) = -4o(x) - 5z(x). Determine k(3). 6 Let v(g) = g*3 + 7g*2 + 6g + 6. Let j = 391 - 558. Let k = -173 - j. Calculate v(k). 6 Let q(r) = 2r2 + 3r - 2. Let g be (-1)/(3/(-30)2). Suppose 2s + 6 = 3y - s, 0 = gy + 2s + 25. Give q(y). 7 Let z(b) = b2 + 16b + 61. Let k be z(-6). Let o(w) = -w + 13. Let x(m) = 2. Let c(l) = ko(l) - 5x(l). Let p = 7 - 5. Give c(p). 1 Let x(t) be the third derivative of -t5/15 + t3/6 + t*2. Suppose 4m + 4z = -172, 0m + m - 4z + 68 = 0. Let f be (-32)/m9/(-6). Give x(f). -3 Let c(s) = s*3 + 5s*2 - 21s - 14. Let q(n) = 18n2 - 394n - 52. Let g be q(22). Give c(g). -38 Let s(d) = -3d3 - d + 1. Let z(a) = 17a*3 + 6a*2 + 18. Let m(q) = -6s(q) - z(q). Calculate m(6). 12 Let b(o) be the first derivative of 11o4/4 + o3 - 4o + 7953. Determine b(-2). -80 Let j(c) be the first derivative of 4c*3 - c + 24. Let w be 112/18 -	{ "pile_set_name": "DM Mathematics" }
- 1096. Give s(-18). 8 Let o(y) be the first derivative of 45y2/2 - 525y - 7085. Determine o(12). 15 Let w(j) be the first derivative of -2j3/3 + 5j*2 - 9j + 7. Suppose 50b = 52b - u - 11, -2 = -2u. Calculate w(b). -21 Let t = -28 - -31. Suppose -r - 1 + t = 0. Let m be (-95)/(-15) - r/6. Let k(p) = p3 - 5p*2 - 5p. What is k(m)? 6 Let o be -12((-18)/(-24))/(-3). Let z(m) = -1 + m2 - o + 5 + 2m. Give z(-2). 1 Suppose -11x + 26 - 4 = 0. Let w be x/(4/(-11)) + (-5)/10. Let g(r) = 2r + 10. Determine g(w). -2 Let t(m) be the first derivative of -m*3/3 - 8m*2 - 43m + 2279. Determine t(-10). 17 Let h(g) = -g*3 - 11g*2 + 14g + 12. Let i(m) = 2m3 - 13m - 43. Let z be i(-6). Let l = z - -385. Give h(l). -12 Let j(x) = -2987 - 6x + 2959 - 3x. What is j(-6)? 26 Let d(x) = -x*3 - 7x*2 + 9x - 11. Let g(m) = m*3 - 10m2 + m + 11. Let r be g(5). Let z = r + 101. Calculate d(z). -19 Let a(r) = -r3 + 2r2 + 3r - 4. Let o be a(2). Suppose -5u + 10 = -os, -s - 46 = 5u - 41. Let p(k) = -k + 2. What is p(s)? 7 Let o(s) be the first derivative of s2/2 - 40s + 6294. Give o(-11). -51 Let s(n) = 60n2 + 3n + 13. Let u be s(21). Let z(b) = -u + b*3 + 26535 + 2b*2 + 7b3. What is z(1)? 9 Let p(w) = -w2 + 6w - 6. Let b = 250 + -243. Suppose 0 = -33c - bc + 240. Calculate p(c). -6 Suppose 0 = 3r - 3f - 132, -5 = 3f + 2f. Let c(m) = -r + 15 + 25 + 3m. Let g(u) = -2u + 1. Let z(y) = -3c(y) - 5g(y). What is z(7)? 11 Suppose -90u = 1090 - 370. Let r(d) = 17d + 15. Calculate r(u). -121 Let m = 9648 + -9653. Let h(l) be the first derivative of l3/6 + 3l*2 + 5l + 3. Let k(s) be the first derivative of h(s). Give k(m). 1 Let h(p) = -34 + 12 + 10 + 10. Let v(q) = 4q + 26. Let u(r) = 12h(r) + v(r). Give u(-1). -2 Let c(r) = r2 - r + 2. Let o be c(2). Let i(j) = -6 + 4 - j3 - 47j2 + j + 8j*2 + 3j + 42j2. Give i(o). -2 Suppose -134 = -2o - 118. Let j(u) = 7 + 42u - 21u - 22u - 5 + 15. What is j(o)? 9 Let h(o) = o2 - 10o - 55. Suppose -3u - 49n + 52n + 27 = 0, 2u - 23 = n. What is h(u)? 1 Let b(u) = 844u - 25. Let a(x) = 67x - 2. Let p(h) = 74a(h) - 6b(h). What is p(-1)? 108 Let i(v) = -3v2 - 55v + 2 + 50v + 0. Let r be (168/(-4))/(-7) - 8. Determine i(r). 0 Let w(f) = 13f*3 - 7f - 14f3 + 7 - 5f*2 - 4f*2. Suppose -99m + 101m = l - 21, 0 = 2l - 10. Give w(m). -1 Let k(l) = 157l + 1256. Let s be k(-8). Let c(f) = f2 + 2f + 6. Determine c(s). 6 Let u(m) = -10m3 - m2 + 3m - 2. Suppose 5o + f = 1 - 0, -3o - 5f = 17. Give u(o). -10 Let q(t) = -16t*2 - 5t. Let i be 10/(-5) - (-4 - -1). Let h be q(i). Let u(w) = -w*3 - 21w*2 - w - 16. Calculate u(h). 5 Let v be 7 + (-25)/4 - (-45)/20. Let t(w) = -17w - 27. Calculate t(v). -78 Let g be (12/(-32))/((-132)/704). Let f(d) be the second derivative of 1/3d3 + dg + 13d + 0 - 1/6d4. Give f(2). -2 Let d(t) = t3 - 7t*2 - 7t - 5. Suppose 0 = -5g + 2b + 35 + 53, 3g - 58 = -4b. Let i be -4g/(-24) - -5. Calculate d(i). 3 Let i(l) be the first derivative of -105 + 1/2l*2 + 2l. Calculate i(-4). -2 Suppose -9b = -6b - 12. Suppose 0 = bv - 20. Suppose 6 = 2r - vp, r + 3p = -0r + 3. Let h(z) = 2z + 1. Determine h(r). 7 Suppose -d = 9 - 6. Let y be (d/(-2))/116/6. Suppose 0 = -ys - 5s - 9. Let q(g) = 12g3 - g2 - g. Give q(s). -12 Let j be (-167 + -2)9(-5)/15. Let y = j + -510. Let v(p) = 6p + 1. Calculate v(y). -17 Let o(j) = -13526 - 2j*2 + 36j + 27060 - 13523. What is o(18)? 11 Suppose -6l - 21 + 153 = 0. Let y(g) = 2g - 10 - 7g2 - lg*3 + 6 + 21g3. What is y(-7)? -18 Let b(u) = -u2 + 6u - 5. Let p(z) = -2z - 6. Let v = -41 + 41. Suppose v = r - 7r - 36. Let m be p(r). Give b(m). -5 Let c = 20 + -26. Let w(v) = -3v*2 - 7v - 1. Let f(y) = y*2 + 2. Let m(i) = 2f(i) + w(i). What is m(c)? 9 Suppose -6h = -2h - 4, -2h = -4o + 22. Let g(b) be the second derivative of -5/2b2 - 1/12b*4 + 2/3b*3 + 5 - 6b. What is g(o)? -17 Let k(h) = -h - 1 - 3h + 3h. Let j be (252/(-63))/(4/(-5)-1). Determine k(j). 4 Let w(j) = -28j*2 + 15j + 25. Let k(v) = -33v2 + 15v + 26. Let n(m) = -6k(m) + 7w(m). What is n(-6)? 1 Let n(r) = r*2 - 1. Let i(v) = 3v*2 + 3v - 5. Let z = 57 - 61. Let t(f) = zn(f) + i(f). Suppose 5 + 1 = 3a. Give t(a). 1 Let p(g) = -8g2 + 9g + 3. Let i(u) = 25u2 - 31u - 10. Let l(v) = 2i(v) + 7p(v). Let k be 3/(-7)(1 + -8). Suppose -n + 2 = -kn. What is l(n)? -6 Let d(l) = -14l - 14. Let u = 11579 - 11579. What is d(u)? -14 Let k(x) = 27x*3 + 108x*2 - 111x - 94. Let g(z) = 5z3 + 21z*2 - 22z - 19. Let f(i) = 11g(i) - 2k(i). What is f(-16)? 43 Let n(f) = f + 7. Let d be (-1 + 10/4)(370 + -368). Determine n(d). 10 Let y(v) = 77v*3 + 4v*2 + 2v - 1. Let x be y(-1). Let d = 73 + x. Let m(o) = -o*3 - 2o*2 - 3o - 3. Give m(d). 15 Let j(f) = -f*2 - 4f. Suppose 5q + 3q = -40. Let x(h) = 7h + 20. Let n be x(q). Let w = 10 + n. Calculate j(w). -5 Suppose 0 = -5s - 3d - 9, 2s + 5d = -0s - 15. Suppose -14f + 0f + 84 = s. Let t(r) = -6r + 8. Give t(f). -28 Suppose -22o - 240 = -12o. Let h be 4 + (-248)/o + 1/(-3). Let v(y) = -y3 + 15y*2 - 15y + 17. Calculate v(h). 3 Let r(a) = -5a3 + 6a*2 + 8a + 24. Let c(x) = 9x3 - 12x*2 - 16x - 43. Let d(j) = -4c(j) - 7r(j). Let z = 793 + -786. Determine d(z). 11 Let p(f) = -5f2 + 8f + 3. Let r(v) = -4v2 + 9v - 5. Let a(l) = 3p(l) - 4r(l). Give a(5). -6 Let z(j) = 0 - 687j + 684j - 5. Suppose -5a - 18 = 2h, a + 4a + 26 = -4h. What is z(a)? 1 Suppose -5n = -2w - 3w + 20, 5w - 5 = 0. Let l be 39/(-9) - (-2)/n. Let s(r) = 78r + 61r + 82r + 81r - 304r - 3. Determine s(l). 7 Let p be ((-20)/(-18))/((-84)/(-378)). Let g(x) = -5x - 1 - 2x2 + 2x + 0x - 14x*3 + px + 4x3. What is g(1)? -11 Let y(l) = 3l - 2. Suppose -76 = -w - 235. Let t be (-38)/209 + w/33. Give y(t). -17 Let q = -651 - -636. Let a(p) = -p*2 - 12p + 3. Calculate a(q). -42 Let s(u) = -u*3 - 8u*2 - 10u + 12. Let k be s(-6). Let p(n) = kn - 517 + n + 512. Determine p(5). 0 Suppose k - 3 = 0, 72k + 21 = 3c + 73k. Let o(s) = -10s - 38. What is o(c)? -98 Let n(i) be the second derivative of -7i*3/6 + 3i*2/2 + 10034i. Let d = -1 + 4. What is n(d)? -18 Let i(l) be the second derivative of l*4/6 - 3l*2/2 + 173l + 1. Determine i(-6). 69 Let n(y) = -y*3 - 2y*2 + 8y + 43. Let m be n(-4). Let o(u) = m - 93 - u*2 - 7u + 38. What is o(-5)? -2 Let j be (-7)/(-14)(0 + 10). Let k(x) = 5 + 6x - 2 - 14x - x2 + 1 + 3x*2. Calculate k(j). 14 Suppose 0 = -4y - 1 + 5. Let u(t) = 3t2 - 6t - 2. Let l(n) = 3n3 + 64n*2 - 128n - 41. Let h(a) = -l(a) + 21u(a). Calculate h(y). -3 Let f(z) = z2 + 9z + 14. Let j be f(-8). Suppose -8l + j = -82. Suppose lh + 70 = 26. Let n(s) = -3s - 3. Calculate n(h). 9 Let p(u) = -60u - 306. Suppose -237z + 226z - 55 = 0. What is p(z)? -6 Let s(o) = o*3 - 6o*2 + 4o. Suppose -269 = -33j - 104. Calculate s(j). -5 Let z(p) = p3 + 91p*2 - 136p*2 - 129 + 28p*2 - 31p. Determine z(19). 4 Let v(t) = -t*3 - 6t*2 + 19t + 11. Suppose 22q + 488 = 312. Determine v(q). -13 Let z(y) = 2y*2 + 2y*2 + 3 - 2. Suppose 2u + 18 = 5c - 66, c - 22 = 3u. Let s be 5 + (-26)/8 + 4/c. What is z(s)? 17 Let o = 85 - 76. Let c(m) = 6 - 5m + om - 1 + m*2 + 4m. Give c(-8). 5 Let d(n) = -2n - 4. Let f(m) = -m - 4. Let x = 312 + -308. Let o(u) = xf(u) - 3d(u). Calculate o(-1). -6 Let w(j) = -2j + 1. Let z(d) = 7d - 16. Let g(c) = 2w(c) + z(c). Let l be (-376)/(-376)-3(-3 + 1). What is g(l)? 4 Let a(m) be the first derivative of -17m2/2 - 221m - 6979. Calculate a(-12). -17 Let x(j) = -3j - j2 + 121 + 114 - 225. Give x(-9). -44 Let x = 44 - 42. Let p(i) = -i + 3 + 4i2 + ix - 5i - 4i2. Let d(w) = -w2 + 5w - 2. Let n(g) = -3d(g) - 2p(g). What is n(3)? 0 Let v(m) = m2 - 11m + 14. Suppose 90j + 1158 = 139j + 144j. Calculate v(j). -16 Let l(k) = -8k*2 + 43k - 13. Let i be l(5). Let z(j) = 3j3 + j2 - 9j + 3. What is z(i)? 13 Let x(q) = -738q - 1471. Let u be x(-2). Let p(a) = a2 - 13a + 31. Determine p(u). -9 Let s = -12509 + 12510. Let l(q) = -q. Let	{ "pile_set_name": "DM Mathematics" }
3 + 9g*2 + 6g - 7. Let j(r) = -7r3 + 9r*2 + 5r - 8. Let k(s) = 5j(s) - 6z(s). Calculate k(10). -8 Let c(d) = 5d - 49. Let h(p) = p - 12. Let f(t) = -2c(t) + 9h(t). Determine f(0). -10 Suppose 3d = 4f - 22, -10d = -14d - 4f + 8. Let z(a) = -a*3 + 2a*2 - 3a - 3. Give z(d). 19 Let f(s) = -s*2 + 2s + 2. Let j(k) be the second derivative of -5k4/12 + 3k*3/2 + 9k*2/2 + 3k. Let w(b) = 9f(b) - 2j(b). Calculate w(-2). 4 Let b(o) be the third derivative of o4/24 - o3/2 - o2. Let c(n) = n2 - 3n - 23. Let i be c(7). Give b(i). 2 Let k be (0 - 1)(0 - 0). Suppose k = -7j + 2j - 30. Let h(n) = -2n - 7. Calculate h(j). 5 Let k(c) = c3 - c2 - 2c + 2. Let t be k(2). Let m = t - 1. Suppose 2w - 1 = 3b, -m = -4w - 5b - 10. Let r(n) = n*2 + n + 1. Determine r(w). 1 Let f(r) be the first derivative of -7r + 7r + 0 - 2 + r2. Determine f(2). 4 Suppose -4y - 13 = u, -5y + 6 - 1 = -3u. Let l = 0 + 0. Let h(q) = l - 3q2 - q + 0q - 2q - 3. What is h(y)? -9 Let c be 6(-3 + 2)-1. Let b(l) = -5l*3 - 6l - 13. Let a(q) = 11q3 - q2 + 13q + 27. Let n(h) = -6a(h) - 13b(h). What is n(c)? 7 Let l(v) = 57v - 28v - 1 + v*2 - 28v. Determine l(-2). 1 Let a(l) be the first derivative of -11l3/3 - l - 11. Calculate a(-1). -12 Suppose 0 = -2i - c + 1, -2i - 2i + 17 = 5c. Let q(t) = -2t*2 - t - 1. Determine q(i). -7 Suppose 3u - 4 = 8. Suppose 3c - 9 = 0, 7c = -uz + 2c + 27. Let s(d) = -d*3 + 2d2 + 4. Calculate s(z). -5 Let p(w) = w + w3 - 4w2 - 153 + 153. Calculate p(3). -6 Let r = -16 + 22. Let o(f) = f3 - 6f2 + f - 8. Calculate o(r). -2 Let t(n) be the third derivative of n5/120 + n4/4 + n3 - 5n2. Let m(o) be the first derivative of t(o). Determine m(-6). 0 Let q(n) = n + 5. Let m be q(0). Let y(o) = -5 - o3 + mo*2 - 2o - 5o2 + 5o*2. Suppose 89 - 85 = h. What is y(h)? 3 Let y(z) = -5z - 2. Let n = 7 - 2. Let j(p) = -1 + np - 4p + 2 - 2p. Let s(q) = 2j(q) + y(q). What is s(-1)? 7 Let z be 4/6 + 174/9. Suppose -2h = -2n - 52, z = -0h + h - 4n. Let x be (-4)/(-6) + h/(-6). Let b(y) = -y - 3. Calculate b(x). 1 Let z(r) = -r + 1. Let i = 10 + -15. Let m = i + 5. Calculate z(m). 1 Let x = 4 - 4. Let y(c) be the second derivative of 0 + 11/2c2 - 1/6c3 - c. Determine y(x). 11 Let o(j) be the third derivative of -j4/12 - 2j3/3 - 2j*2. What is o(-5)? 6 Suppose -o = 2o + 33. Let p = -7 - o. Suppose -2b - 26 = pw, -4w - 3b - 33 = -2. Let d(r) = -r*3 - 4r*2 - 2r - 6. Give d(w). 2 Suppose r - 2r = -5o, 4r = 5o. Let f = 0 - o. Let v(b) = -b + f + 0 - 1. Calculate v(2). -3 Let b(v) = 3v - 3. Suppose 4w - 16 = 2w + 3f, -3f = -5w + 22. Suppose 3z + 3 = -2j, 0 = j - 4j + wz - 11. Give b(j). -12 Let j(i) be the third derivative of i5/15 + i4/12 - i*2. Let o be (5 - (2 - -1))-1. Determine j(o). 12 Let w = -6 + 8. Let z(g) = 4 + 0g - wg + 1. What is z(4)? -3 Let u(f) = -4f + f2 + 3f*2 - 5 - 3f2. Let m(b) = -b3 + 6b2 - 3b - 6. Let j be m(5). What is u(j)? -5 Let v be 2/(-4) - 18/4. Let s be 12/2(-2)/(-6). Let p(u) = -3 + u3 + 3u*s + 9u - 8u + 2u2. What is p(v)? -8 Let h(c) = -c3 - 6c2 - 6c - 2. Suppose 19q = 15q - 20. Determine h(q). 3 Let n(r) be the second derivative of r*3/6 + 7r*2/2 + 125r. Let a = -2 - -3. Let g = -1 + a. Give n(g). 7 Let v(q) = 49q - 25q - 26q + 1 - 2. What is v(5)? -11 Let c(d) be the third derivative of d5/20 + d4/24 - d2. Let u(j) = j - 4. Let l be u(5). Let g be l(-1 - -4) + -2. What is c(g)? 4 Let j(h) = -5 - 2h - 11h + 10h. Give j(-4). 7 Let b(q) be the second derivative of q4/6 - q3/3 + 3q*2/2 - 11q. What is b(2)? 7 Let h(u) = 14u + 8. Let f(a) = -5a - 3. Let s(r) = -11f(r) - 4h(r). Let z = -6 + 17. Let v(k) = -k*3 + 10k*2 + 12k - 16. Let n be v(z). Calculate s(n). 6 Let w be (5/(-30)2)/((-1)/9). Let y(p) be the third derivative of -p4/12 + p3/6 - p2. Determine y(w). -5 Let d(o) = o3 + 3o*2 + 2o + 1. Let j be d(-3). Let b = 1 + j. Let v(h) = -h*3 - 4h*2 + 2h - 2. Give v(b). -10 Let s = -4 - -7. Let t(m) be the third derivative of -1/8m4 + 0m*s + 0m + 1/15m5 + m2 + 0 - 1/120m*6. Give t(3). 0 Let d be (-10)/4(-20)/25. Let z(a) = da2 - 1 - 4a*2 - 3a + a2. Give z(-4). -5 Let u(x) = -x2 + 8x - 9. Let s be u(7). Let k(n) = 8n + 6. Let f(z) = z*2 - z - 1. Let c(p) = -4f(p) - k(p). Calculate c(s). -10 Let x(d) = -d*2 + d + 1. Let u(j) = 2j3 - j2 - 4j + 3. Let t be u(2). Let m = t - 12. Let v be 1/5 + (-9)/m. Give x(v). -1 Let d(o) = -o3 - 4o*2 + o - 5. Suppose 0 = h, -6h - 12 = 4m - h. Let q be -6 + -1 + (0 - m). What is d(q)? -9 Suppose -2o + 2 = 2r - 2, -2 = -o + 4r. Suppose q - 5q + oa = -6, 2a - 10 = 0. Let d(x) = -x + 4. Calculate d(q). 0 Let r(i) = i3 + 1. Let f(z) = z3 + 2z*2 - 1. Let b(v) = -f(v) + 2r(v). What is b(3)? 12 Let n(a) be the second derivative of -a*3/6 - 4a*2 + a. Suppose 5b + 11 = -19. What is n(b)? -2 Let r(i) = 2i - i + 1 + 1. Let a be r(3). Let u(s) = 3s - 7. Let o(k) = 6k - 14. Let f(b) = -3o(b) + 7u(b). What is f(a)? 8 Let w(g) = g2 - 7g + 5. Suppose 0 = -0u + 4u. Let d = -26 + 46. Suppose 7o = 3o + 3h + 25, u = 2o - 4h - d. Calculate w(o). -7 Suppose 9 = 5w - 1. Let n(c) = -2c2 + 3c*3 - c - wc3 + c2. Let r(l) = 3l3 - 8l*2 - 5l + 2. Let y(f) = -5n(f) + r(f). Calculate y(-2). 6 Let s be (-6)/((-57)/66 - -1). Let z be 4/(-6) - s/(-6). Let x = -6 - z. Let g(d) = -2d + 3. Determine g(x). -1 Let a(u) = -4u2. Suppose -10q - 24 = -6q. Let w be -2(-6)/(-4) - 2. Let o = w - q. Calculate a(o). -4 Let r(h) = -6h2 + 7h + 4. Let p(m) = m*2 - m - 1. Let a(j) = -5p(j) - r(j). Calculate a(1). 0 Let y(q) be the second derivative of q6/72 + q5/120 + q*3/2 - 4q. Let z(i) be the second derivative of y(i). What is z(1)? 6 Let q = 6 + -7. Let a be (-6)/4 + (-6)/(-4). Let t(w) = 0w + 1 - w + 3w + aw. Determine t(q). -1 Let t = 0 - -5. Suppose -d = -0 - t. Let n(g) = -g2 + 4g. Give n(d). -5 Let p(r) be the third derivative of r4/2 - r3/6 - r*2. Calculate p(1). 11 Let l(q) = 5q3 + q2 - 6q + 2. Let w(h) = 9h*3 + 3h*2 - 12h + 3. Let f(k) = -11l(k) + 6w(k). What is f(5)? 16 Let j(l) = -4l - 1. Let p(n) = -n3 - 4n*2 + 12n + 7. Let d be p(-6). Suppose -r + d - 5 = 0. Calculate j(r). -9 Let a(p) be the first derivative of p*4/4 + 2p3/3 + p2/2 + p + 1. Let m = 6 - 8. What is a(m)? -1 Suppose 0 = -2j + 5f + 30, -j = -2j - f + 1. Let n(w) = jw + 4 - 3w - 3w - w. Calculate n(5). -6 Let b(z) = -6z2 - 4 + 0 - z + 5z*2. Calculate b(0). -4 Let h(j) be the first derivative of -3j*4/4 - 4j*3 + 5j*2 + 6j + 3. Let k(b) = b*3 + 6b*2 - 5b - 3. Let n(t) = 2h(t) + 5k(t). Determine n(5). -3 Let v be 20(3 - 10/4). Let u = -15 + v. Let r be (6/u)/(2/5). Let q(k) = k3 + 5k*2 + 3k - 4. Calculate q(r). 5 Let k(m) = 19m - 36. Let q(w) = 7w - 12. Let x(d) = -3k(d) + 8q(d). Determine x(6). 6 Let f = 8 + 4. Suppose f = 2p + 2. Let t(x) = -4x*2 - 3x - x*2 + 2x*2 + 2x2 + p. What is t(-5)? -5 Let a(g) be the second derivative of -g5/20 - 2g4/3 - 3g*3/2 - 4g*2 + 17g. Determine a(-7). 6 Let k(o) = -3o - 1. Let j(x) = x3 + 5x*2 + 4x - 3. Let m be j(-4). Let w be (-10)/30 + (-7)/m. What is k(w)? -7 Let r(j) = 3j - 2j*2 + 0j - 4j - 6j*3 - 4j*3. Give r(-1). 9 Let r be 14 + (4 - (-2)/(-1)). Suppose 0 = 4c + r. Let q(x) = -x*3 - 5x*2 - 6x. Give q(c). 8 Let m be 1 - -4 - (0 - 0). Let h(c) = 5c3 - 6 + 5 + 5c*2 - 6c*3. Give h(m). -1 Let b be ((-28)/(-2))/((-6)/(-3)). Let g = -2 + b. Let d(z) = -1 - g + 1 + z. Calculate d(5). 0 Let u be (-3)/6-42. Suppose -ul + 10 = l. Let k(m) = m*3 - 2m2 - m + 1. Determine k(l). -1 Let v(b) = -b2 - 3b - 1. Let d = -11 - -9. What is v(d)? 1 Let r(w) = -w2 - 6w. Suppose 0 = -t + 3t + 12. Let d be r(t). Let j(g) = 3g*2 - 8 - 4g2 - g3 - g + 0g2. Determine j(d). -8 Let h be 0/(1 - 4 - -4). Let r(q) = -q - 10. Suppose -2z - 21 = -7. Let n(c) = c + 11. Let t(p) = zr(p) - 6n(p). Give t(h). 4 Let v(g) = -5g3 - 2g*2 + 1. Let a = 3 - 5. Let l be -1 + a6/3. Let j(b) = -b*2 - 6b - 4.	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.