Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
5, x: 8}. Give prob of picking 1 x and 1 k. 20/39 What is prob of picking 1 l and 1 h when two letters picked without replacement from rxhlp? 1/10 Calculate prob of picking 1 m and 1 u when two letters picked without replacement from ssmuf. 1/10 What is prob of picking 1 o and 3 q when four letters picked without replacement from {d: 2, k: 1, q: 6, f: 3, o: 2}? 40/1001 What is prob of picking 2 a when two letters picked without replacement from aaaaaaamaamaaammaa? 91/153 Calculate prob of picking 2 r when two letters picked without replacement from {j: 2, r: 4}. 2/5 What is prob of picking 1 w and 1 n when two letters picked without replacement from nnnnnnnnwnnnnwnwnn? 5/17 Four letters picked without replacement from yyyyrr. Give prob of picking 4 y. 1/15 Three letters picked without replacement from fffvffffvvff. What is prob of picking 1 v and 2 f? 27/55 What is prob of picking 1 z and 1 q when two letters picked without replacement from {q: 2, m: 1, o: 9, z: 2}? 4/91 Two letters picked without replacement from {b: 3, z: 3, o: 1, i: 1, s: 2}. Give prob of picking 1 b and 1 o. 1/15 Calculate prob of picking 1 i, 1 g, 1 c, and 1 e when four letters picked without replacement from {i: 1, q: 6, e: 3, u: 6, c: 2, g: 2}. 4/1615 Three letters picked without replacement from cffffcffffffcffffcff. What is prob of picking 3 c? 1/285 Two letters picked without replacement from {i: 3, n: 4, r: 1, g: 5}. What is prob of picking 2 n? 1/13 Three letters picked without replacement from {c: 1, o: 17}. What is prob of picking 1 c and 2 o? 1/6 What is prob of picking 2 s and 1 q when three letters picked without replacement from qqssssssqqssssssqsq? 156/323 What is prob of picking 2 w when two letters picked without replacement from llwwlllllllllw? 3/91 Two letters picked without replacement from {z: 4, t: 7}. What is prob of picking 2 t? 21/55 Three letters picked without replacement from sfksfskfskkkdkfdff. What is prob of picking 2 f and 1 d? 5/136 Three letters picked without replacement from {w: 7, u: 5, q: 1, r: 6}. What is prob of picking 2 w and 1 r? 42/323 What is prob of picking 2 e and 2 b when four letters picked without replacement from egebgbeb? 9/70 Two letters picked without replacement from ybdbf. What is prob of picking 1 f and 1 d? 1/10 What is prob of picking 1 u, 2 y, and 1 g when four letters picked without replacement from {f: 6, g: 3, u: 1, y: 3, q: 1}? 9/1001 Calculate prob of picking 3 s when three letters picked without replacement from sssssppsssps. 21/55 Two letters picked without replacement from {w: 2, p: 1, f: 1, t: 1, u: 1, b: 1}. What is prob of picking 1 t and 1 b? 1/21 Calculate prob of picking 1 g and 1 z when two letters picked without replacement from zzzgg. 3/5 Three letters picked without replacement from {b: 11, e: 2}. Give prob of picking 2 e and 1 b. 1/26 Calculate prob of picking 3 n when three letters picked without replacement from {p: 1, a: 5, k: 1, n: 3, z: 1}. 1/165 Calculate prob of picking 2 l and 1 h when three letters picked without replacement from {l: 7, z: 2, h: 5, j: 3}. 21/136 Three letters picked without replacement from hxwhxlhtxhlhhtlhlhtl. What is prob of picking 1 h, 1 l, and 1 t? 2/19 Calculate prob of picking 2 t when two letters picked without replacement from atwalwtawaawkakaaaa. 1/171 Calculate prob of picking 2 a, 1 h, and 1 g when four letters picked without replacement from {g: 2, a: 3, h: 9, c: 4}. 3/170 What is prob of picking 2 i when two letters picked without replacement from {g: 2, u: 1, a: 1, v: 2, i: 2}? 1/28 Three letters picked without replacement from {h: 4, o: 4, z: 6, k: 4}. Give prob of picking 2 k and 1 z. 3/68 Three letters picked without replacement from {c: 1, y: 1, k: 1, x: 2, n: 2, f: 2}. What is prob of picking 2 x and 1 f? 1/42 What is prob of picking 3 b when three letters picked without replacement from ttttttttbtbttttbtttb? 1/285 Four letters picked without replacement from nnwnnwnnwnnnnnwnwn. What is prob of picking 3 w and 1 n? 13/306 What is prob of picking 1 v, 1 n, and 1 l when three letters picked without replacement from lllpcmlnclvcppv? 2/91 What is prob of picking 1 c and 3 q when four letters picked without replacement from {c: 8, q: 3}? 4/165 Four letters picked without replacement from {v: 2, d: 3}. What is prob of picking 1 v and 3 d? 2/5 Calculate prob of picking 1 r and 1 j when two letters picked without replacement from {r: 2, j: 2, n: 1, t: 1}. 4/15 What is prob of picking 2 q and 2 y when four letters picked without replacement from qybybqyyrybbyyyuyuy? 15/1292 What is prob of picking 1 t and 3 s when four letters picked without replacement from {p: 2, t: 3, s: 4, q: 2}? 2/55 Four letters picked without replacement from cccccccf. Give prob of picking 4 c. 1/2 Three letters picked without replacement from {p: 3, y: 3, h: 1, l: 2, s: 1, q: 1}. Give prob of picking 1 h and 2 y. 1/55 What is prob of picking 1 z and 1 q when two letters picked without replacement from zczzzzcqtzznuzzzczt? 11/171 Two letters picked without replacement from {l: 2, y: 1}. Give prob of picking 1 y and 1 l. 2/3 Calculate prob of picking 1 b and 3 e when four letters picked without replacement from {e: 5, b: 2}. 4/7 Calculate prob of picking 2 t and 2 p when four letters picked without replacement from {e: 4, g: 1, t: 11, p: 2, y: 1}. 55/3876 Three letters picked without replacement from {k: 2, j: 4}. What is prob of picking 2 k and 1 j? 1/5 Two letters picked without replacement from dxdxdddx. Give prob of picking 1 x and 1 d. 15/28 What is prob of picking 3 x when three letters picked without replacement from {a: 1, k: 1, x: 3, m: 1, s: 1}? 1/35 What is prob of picking 1 y, 2 n, and 1 h when four letters picked without replacement from {o: 6, y: 1, h: 2, n: 2, v: 1}? 2/495 What is prob of picking 2 p and 2 g when four letters picked without replacement from {p: 1, h: 2, g: 4, f: 8}? 0 Calculate prob of picking 3 r when three letters picked without replacement from {s: 7, r: 6}. 10/143 Four letters picked without replacement from {y: 10, u: 4, f: 6}. What is prob of picking 2 f and 2 y? 45/323 Two letters picked without replacement from kkudddcddkcd. What is prob of picking 1 u and 1 k? 1/22 Two letters picked without replacement from {k: 2, j: 7}. What is prob of picking 2 j? 7/12 Two letters picked without replacement from {c: 9, r: 2}. Give prob of picking 2 r. 1/55 Calculate prob of picking 4 b when four letters picked without replacement from bbbbbbbbbnbbbnbbbb. 91/153 Calculate prob of picking 2 j and 1 r when three letters picked without replacement from {j: 10, r: 2}. 9/22 Three letters picked without replacement from {d: 6, o: 5, i: 2}. What is prob of picking 3 d? 10/143 What is prob of picking 2 y, 1 x, and 1 c when four letters picked without replacement from yyychcykckjyx? 6/143 Calculate prob of picking 1 i and 3 x when four letters picked without replacement from {i: 2, j: 6, x: 11}. 55/646 What is prob of picking 2 c when two letters picked without replacement from {l: 1, c: 3}? 1/2 What is prob of picking 2 d and 1 m when three letters picked without replacement from {d: 2, x: 9, s: 3, m: 3}? 3/680 What is prob of picking 1 l and 1 o when two letters picked without replacement from locus? 1/10 Calculate prob of picking 2 y when two letters picked without replacement from {y: 4}. 1 What is prob of picking 2 t when two letters picked without replacement from tttt? 1 Two letters picked without replacement from kbbkkkkkkbbkbk. What is prob of picking 2 b? 10/91 Calculate prob of picking 2 g when two letters picked without replacement from {v: 1, g: 2}. 1/3 Four letters picked without replacement from qqqqmqqqqqqqqqqqqq. Give prob of picking 4 q. 7/9 What is prob of picking 1 t and 1 s when two letters picked without replacement from sszzstszzszstss? 16/105 Two letters picked without replacement from {f: 5, e: 5, i: 2}. What is prob of picking 2 e? 5/33 What is prob of picking 1 k, 1 c, and 1 n when three letters picked without replacement from xkzncnhxzcnh? 3/110 Two letters picked without replacement from tvhvjbjhhjff. Give prob of picking 1 t and 1 h. 1/22 Three letters picked without replacement from {y: 2, a: 2, t: 1, j: 1, x: 5, g: 2}. What is prob	{ "pile_set_name": "DM Mathematics" }
2l2 + 9l*3 + 7l*3 - 15l*w - 4l. Give z(p). 13 Let r be ((-10)/(-4))/((-3)/6). Let j be 1 - (-2)/(-4 - r). Let n(t) = 2tj - 783 + 4t*2 + 783. Calculate n(-3). -18 Let c(y) = 93y - 52y - 45y + y2. Let l be c(4). Let h(v) be the first derivative of -v4/4 - 5v - 1. Give h(l). -5 Let p(f) be the first derivative of 11f*4/4 - 76f*3/3 - 4f*2 + 4f + 9454. Give p(7). -3 Let h = 408 + -408. Let j(x) = -x*2 + x - 22. Give j(h). -22 Let q(k) = -8k*3 - 41k*2 + 2k - 13. Let a(z) = -5z3 - 19z*2 + z - 6. Let h(o) = 13a(o) - 6q(o). Give h(1). -17 Let g(z) be the first derivative of 33 + 0z + 1/2z3 - 1/12z*4 + 33/2z2. Let t(q) be the second derivative of g(q). Calculate t(-7). 17 Let i(k) = -k3 - 2k - 3. Let o(r) = 45r - 180. Let g be o(4). Determine i(g). -3 Let d(l) = l*3 - 10l*2 + 0 - 205l + 196l + 8 + 9l*2. Determine d(4). 20 Let y(j) = -3j*2 - 43 - 4j + 4j2 + 36. Let u be y(6). Let o(g) = 2 - ug*2 + 2g*2 + 4g*2 - 3g. What is o(3)? 2 Suppose 0 = 5o - i + 18, 0o - o - 2i - 8 = 0. Let g be (-42)/10 - o - 4/5. Let u(q) = -6q - 1. Calculate u(g). 5 Let y(f) be the second derivative of f*3/3 - 59f*2/2 - 201f - 2. What is y(23)? -13 Let d be (0/(-35))/(-2(3 + 0)). Let o(u) = -7 - u - 148u*2 - 154u*2 + 301u*2. Calculate o(d). -7 Suppose -5c + 2n + 87 = 0, 153 - 46 = 5c + 3n. Let b(i) = i3 - 20i*2 + 23i - 83. What is b(c)? -7 Let o(g) = -g + 2. Let a(t) = t*2 - 13t - 1. Let n(p) = -a(p) + 4o(p). Calculate n(9). 9 Let h(j) = -j2 + 9j + 3. Suppose 0y + 3y - 27 = 0. Let u be h(y). Let s(f) = 3 - 4f - 5 + 2 - 4 + fu + 4f*2. Calculate s(-4). 12 Suppose 0 = 3s - 5 - 13. Let n(q) be the first derivative of -q*4/4 + 2q3 + q2/2 - 8q - 10. Determine n(s). -2 Let k(n) = -35n - 146. Let p = -22768 + 22764. Calculate k(p). -6 Let m(c) = -c*2 + c + 50. Suppose l + 2i - 13 = 0, -3 = 260i - 261i. Give m(l). 8 Let z(d) = 8d2 + 3692d - 1237d + 3 - 1228d - 1229d. Give z(2). 31 Let x(t) = -t3 - 23t*2 + 23t - 22. Let m be x(-24). Let f(u) = -6u2 - 5u*2 + 6u - 17 - u*3 + 6 + 4u*m. Calculate f(-8). 5 Let u = 51 - 36. Suppose i + 32 = -ui. Let b(z) = -6z. Determine b(i). 12 Suppose 0 = 2w - 7w + 15. Let a(g) = 1 + 721g*w + 719g*3 - 1441g*3 + g + 4g*2. Determine a(5). -19 Let i(u) = 8u. Let f be i(3). Suppose -8 = 23l - fl. Let h(w) = w - 2 + 0w + 2 - 4. What is h(l)? 4 Let f be -121/(-28)7. Let y be ((-4)/((-40)/6))/(f/(-15)). Let x(k) = -k2 + 1 + 6k - 2k + 1. What is x(y)? -19 Let g(w) = -2w3 - w2 + 13w + 2. Let z be g(-3). Let x = z - 9. Let i(j) be the first derivative of -10j*3/3 + j + 1. What is i(x)? -9 Let t(l) = 6 + 0 - 3l - 27. Let z(a) = -8a - 60. Let m(p) = -17t(p) + 6z(p). Calculate m(7). 18 Let b be ((-9)/4)/(57/(-76)). Let t(i) = -7 + i2 - b + 0 + 5 - 3i. What is t(7)? 23 Let p(f) = f*3 - 6f*2 + 8f - 7. Let v = 39 + -27. Let l be 1/(v/9)4. Suppose 0 = -3b - l + 18. Calculate p(b). 8 Let k(a) be the first derivative of a*3/3 + 5a*2/2 + 5a + 8301. Let w = 7 - 16. Give k(w). 41 Let l = 6 + -4. Let h(r) be the first derivative of 0r - 11 + 3r + 7r2 - 3r*2 - 5r*l. Determine h(5). -7 Let a(l) = 13l*3 - 10l + 47. Let p(g) = 88g3 - g2 - 72g + 328. Let j(b) = -27a(b) + 4p(b). Give j(6). 7 Suppose -14h - 39h + 3657 = 0. Let d(g) = -142 + h + 10g + 70. What is d(-3)? -33 Let d(x) = -x3 - 6x*2 + 6x - 2. Suppose 64 = -21y + 211. Suppose 0 = 52t - 51t + y. Determine d(t). 5 Let s = 5 - 1. Let z = 33 - 26. Suppose zd + 3 = sd. Let m(j) = j + 1. Calculate m(d). 0 Suppose 3p - 4h = -24, -3p + 72 - 96 = -2h. Let x(g) = g2 + 9g - 2. Give x(p). -10 Let v = -593639/24 + 24735. Let u(c) be the third derivative of -35c2 + 0c - 1/60c5 + 0 + vc*4 + 0c3. What is u(-1)? -2 Let a(z) = z2 - 4z + 7. Let y(p) = 9p*2 + 5p - 3. Let j(r) = -7r2 - 4r + 2. Let f(u) = -5j(u) - 4y(u). Let l(b) = a(b) - 2f(b). Determine l(3). 18 Let y(n) = -7n3 - n2 - n - 1. Let a(b) = -9b + 95. Let o be a(9). Suppose 19r - 21r + o = -4g, 5r = -2g + 23. What is y(g)? 6 Let n = -20 - -22. Suppose 5m - 32 = -n. Let t(z) = -z2 - 6z + 7. Let w(k) = 6k2 + 30k - 34. Let u(d) = 11t(d) + 2w(d). Determine u(m). 9 Let s(g) = g*2 - 5g - 7. Let x(h) = -3h2 - 13h - 17. Let b be x(-5). Let o be -31 + -1 - 0/3. Let r = b - o. What is s(r)? -7 Let z(r) = -r*2. Suppose -n + 11 = 1273a - 1271a, a - 9 = 0. Calculate z(n). -49 Let z(m) = 3m - 21 - m*2 - 24 + 71 + 2m. Calculate z(7). 12 Let n(m) be the second derivative of -m5/20 + m4/2 - 5m3/6 - 3m*2/2 + 520m. Give n(5). -3 Let b(h) = -h*2 + 7h - 3. Let s(p) = 5 + 7 - 26 + 12. Let n(d) = -b(d) + 4s(d). Calculate n(6). -11 Suppose 6u - u - 45 = 0. Let l(d) = -26 - u + 6d2 + 35. Let n = 10 - 11. Determine l(n). 6 Suppose 8o - 119 + 151 = 0. Let g be o/(16/6) + 8/(-16). Let j(h) = -h*3 + 2h + 2. Determine j(g). 6 Let x be 6 + -2 + 3 - 13. Let v(m) = -2m2 - 13m + 8. Calculate v(x). 14 Suppose 2t - 6y = -y + 272, -574 = -4t - 5y. Suppose 7l = t + 496. Let m(f) = 2f - l - 99 + 184. Determine m(6). 6 Let n(o) = -4o3 - o2 - 4o - 5. Let s(p) = 5p3 + 3p*2 + 3p + 6. Suppose -16g + 38 = 118. Let m(a) = gs(a) - 6n(a). Give m(-10). 10 Let b be 32/(-4) + 8 - 2810. Let t be 2/(-23) + b/(-46). Let r(v) = 7v + 3v*2 - 4v*2 - 2v + 1. Determine r(t). -5 Suppose -l = -57l - 1848. Let x(k) = -2k - 58. Calculate x(l). 8 Let l be (195/(-6))/(-13)2. Let j be 2 + -5 + (50/5 - l). Let v(f) = f2 - 3f + 5. Determine v(j). 3 Suppose 379 = -35z + 519. Let i(b) be the first derivative of 8b - 14 + 1/2b2 + 1/4b*z + 2b*3. Calculate i(-6). 2 Let p(i) = -5i - 12 - 4i2 - i2 + 4i*2. Let z(v) = v. Let b(y) = -p(y) + 4z(y). Let x = -3861 + 3853. Calculate b(x). 4 Let o(x) = 5x + 1. Let p(b) = -16b + 12. Let q(i) = 3o(i) + p(i). Determine q(5). 10 Let q(i) = -7i + 3. Let k be q(-6). Suppose -k = 9d - 4d. Let z(f) = 0f - 11f - 13 - 10f2 + 0f*3 - 3f*3 + 2f*3. Give z(d). 5 Let x be 30/50 - -4 - (56/(-20))/7. Let a(l) = 19l - 83. What is a(x)? 12 Let p = -23 - -61. Let x = 39 - p. Suppose 0 = 3t - g + 4 - x, 4t = 3g + 1. Let i(w) = -2w*2 - 2w. Determine i(t). -4 Let y(q) = q*3 + 9q2 - q - 3. Let k be y(-9). Let l(z) be the third derivative of z6/120 - 7z5/60 + z4/8 + z3 + 323z2. What is l(k)? -12 Let g(h) = h3 - 22h2 + 40h + 11. Let u be -14 + ((-48)/(-6) - -26). Give g(u). 11 Let w(m) = -m*3 - 10m*2 - 6m + 13. Suppose 18t = h + 23t - 6, 0 = 5h - 4t + 57. What is w(h)? -14 Let j(r) = r*3 - 2r*2 - 2r - 90. Let z = -18641 - -18641. Give j(z). -90 Let t(w) = -4w - 1. Let l(m) = m3 + 5m*2 - 6m + 7. Let k be l(-6). Suppose -6z = -k - 77. Let x be ((-8)/z)/(90/(-63))-10. What is t(x)? 15 Suppose -11w = -7w - 5i - 7, w = -2i + 18. Let v be (w/10)/(-58/600). Let t(f) = -f2 - 12f + 14. Determine t(v). 14 Let v(t) be the first derivative of 2t3 - 20t*2 - 41t - 3322. Give v(-1). 5 Let s(l) = 6l3 - 7l*2 + 4l + 5. Let m(z) = -5z3 + 4z*2 - 5z - 5. Let g(i) = -5m(i) - 4s(i). Give g(-6). 23 Suppose 559 = -209i - 1322. Let j(z) = z3 + 7z*2 - 18z + 3. Calculate j(i). 3 Let k(z) be the third derivative of -8z - 1/30z*5 + 1/4z*4 + 0z*3 - 4z2 + 0. Give k(4). -8 Let q(v) = -v2 + 33v - 104. Suppose 0 = -5c - 4a + 157, -10c - 2a = -8c - 64. Give q(c). 12 Let h(y) = -3 - 4 + 10 - 3y. Suppose 8g + 12 = 28. What is h(g)? -3 Let i(b) = -3b - 12. Suppose 149d + 9 = -5m + 150d, 0 = 5m - 3d + 7. Calculate i(m). -6 Let p = -68 + 70. Let k(t) = -8tp - 84t - 9 + t*3 + 85t + 9t2. Give k(0). -9 Suppose -8u + 1 = -15. Let p(f) = f*u + 3f*2 + 5f + 10 - 5f2. Determine p(7). -4 Let u be ((-3)/(-6) - 1)0/(-2). Suppose 59k - 53k = u. Let o(m) = -m - 12. Calculate o(k). -12 Let j(k) = 59k + 7. Let n(v) = 172v + 19. Let t(p) = -11j(p) + 4n(p). What is t(-2)? -79 Let q(t) = -515t - 27302. Let z be q(-53). Suppose 0 = 4n - 7 - 5. Let v(g) = g + 2 - n + 3. Calculate v(z). -5 Let r(z) = 3z + 81. Let w be r(-26). Let q(b) = bw + 10b*2 - 25b*2 + 15b - 20 - 17b + 17b.	{ "pile_set_name": "DM Mathematics" }
16? 112095 What is the next term in 13479, 26844, 40209, 53574? 66939 What comes next: -320238, -320240, -320244, -320250, -320258, -320268, -320280? -320294 What is the next term in -6681, -13770, -20859, -27948, -35037, -42126? -49215 What is the next term in 18579, 18783, 18987, 19197, 19419, 19659, 19923, 20217? 20547 What is the next term in 1256716, 2513427, 3770138, 5026849? 6283560 What is the next term in 2336, 4589, 8346, 13607, 20372, 28641? 38414 What is next in 4499, 4517, 4549, 4595, 4655, 4729, 4817? 4919 What is next in -8456, -33734, -75840, -134774, -210536, -303126, -412544? -538790 What is the next term in -153918, -307793, -461668, -615543, -769418? -923293 What is the next term in 201923, 807810, 1817779, 3231956, 5050467, 7273438, 9900995? 12933264 What is next in -10062968, -20125935, -30188902, -40251869, -50314836, -60377803? -70440770 What is the next term in -1424516, -2849032, -4273548, -5698064, -7122580? -8547096 What comes next: -10864117, -10864120, -10864123? -10864126 What is next in 325860, 651708, 977558, 1303410, 1629264, 1955120? 2280978 What is next in -299503, -299507, -299521, -299551, -299603, -299683, -299797, -299951? -300151 What is next in -35120, -140441, -315980, -561737? -877712 What is next in 1481, 6251, 14817, 27683, 45353, 68331, 97121? 132227 What comes next: 43387932, 43387937, 43387942? 43387947 What is the next term in 733544, 1466935, 2200166, 2933231, 3666124, 4398839? 5131370 What is the next term in -3042805, -6085593, -9128379, -12171163, -15213945, -18256725, -21299503? -24342279 What comes next: -11106905, -11106924, -11106955, -11106998, -11107053, -11107120? -11107199 What is the next term in 36812, 36907, 37030, 37187, 37384, 37627, 37922, 38275? 38692 What is next in -2348, -8344, -18332, -32306, -50260? -72188 What is the next term in 2070, 2328, 2710, 3216, 3846, 4600, 5478? 6480 What is the next term in -5617975, -11235949, -16853923, -22471897? -28089871 What comes next: 928876, 1857717, 2786558? 3715399 What is the next term in 109222748, 109222746, 109222744, 109222742? 109222740 What comes next: -33, -27, -163, -543, -1269, -2443, -4167? -6543 What is next in 22274, 89687, 202044, 359345, 561590, 808779, 1100912? 1437989 What is next in 6311150, 6311163, 6311176, 6311189, 6311202? 6311215 What is next in 1254, 1252, -1258, -7530, -18818, -36376? -61458 What is next in -250179, -249755, -249331, -248907? -248483 What comes next: -6651, -14158, -21685, -29232, -36799? -44386 What comes next: 3773, 30282, 102331, 242690, 474129, 819418, 1301327? 1942626 What is the next term in -248670, -497370, -746072, -994776, -1243482, -1492190? -1740900 What is next in -585875, -1171491, -1756839, -2341913, -2926707, -3511215, -4095431, -4679349? -5262963 What comes next: -21758, -21764, -21766, -21764? -21758 What is next in 574, 2094, 4680, 8332, 13050? 18834 What comes next: -937291232, -937291236, -937291252, -937291286, -937291344, -937291432, -937291556? -937291722 What comes next: -30665, -57906, -85147, -112388, -139629? -166870 What is the next term in 231249, 231233, 231217? 231201 What is next in -28929, -58120, -87575, -117294, -147277? -177524 What is the next term in -53415, -107148, -161201, -215568, -270243, -325220? -380493 What comes next: -2446, -2926, -4162, -6532, -10414, -16186? -24226 What comes next: 7623, 2023, -7325, -20433, -37313, -57977, -82437, -110705? -142793 What is the next term in 1504083, 1504113, 1504155, 1504215, 1504299, 1504413? 1504563 What is the next term in -84537, -168495, -252453? -336411 What comes next: -88335, -87658, -86979, -86298, -85615, -84930? -84243 What is the next term in 2362, 1507, 74, -1937? -4526 What is next in 5525, 5191, 4857, 4523, 4189? 3855 What is the next term in 1896, -3678, -18812, -48288, -96888, -169394, -270588? -405252 What is the next term in -275, -542, -665, -560, -143, 670, 1963? 3820 What is the next term in 94692, 190034, 285376, 380718, 476060, 571402? 666744 What comes next: -1474560, -2949107, -4423654, -5898201, -7372748, -8847295? -10321842 What comes next: -12819, -25768, -38845, -52050? -65383 What comes next: -6388, -50997, -172030, -407683, -796152, -1375633, -2184322? -3260415 What is the next term in 2595801, 5191571, 7787343, 10383117, 12978893, 15574671, 18170451? 20766233 What comes next: 24596, 98750, 222334, 395348? 617792 What is the next term in -2157709, -2157331, -2156701, -2155819, -2154685, -2153299? -2151661 What is the next term in -110600501, -221201000, -331801499? -442401998 What is the next term in -37576, -300311, -1013408, -2402035, -4691360, -8106551? -12872776 What is the next term in 7152170, 14304345, 21456520, 28608695, 35760870? 42913045 What is the next term in 658, -9166, -18990, -28814? -38638 What is next in 6885332, 6885383, 6885430, 6885473, 6885512? 6885547 What is next in 11542, 29188, 46834, 64480, 82126, 99772? 117418 What comes next: 164755, 173818, 182881, 191944, 201007? 210070 What is next in 19242, 42594, 65946? 89298 What comes next: 5542070, 11084140, 16626210, 22168280, 27710350, 33252420? 38794490 What is the next term in -6838689, -6838687, -6838685? -6838683 What is the next term in -355, -3049, -10349, -24547, -47935, -82805, -131449, -196159? -279227 What comes next: -34190, -68146, -101882, -135398, -168694, -201770? -234626 What is next in -55282, -55219, -55114, -54967, -54778? -54547 What is next in 11723, 94524, 319229, 756776, 1478103, 2554148, 4055849, 6054144? 8619971 What is next in -20, -178, -552, -1244, -2356, -3990, -6248, -9232? -13044 What comes next: 1243660, 1244018, 1244366, 1244698, 1245008, 1245290, 1245538, 1245746? 1245908 What comes next: 3115009, 12460012, 28035023, 49840048, 77875093, 112140164? 152635267 What is next in -108924, -217836, -326772, -435738, -544740, -653784, -762876, -872022? -981228 What is the next term in -3323296, -6646621, -9969922, -13293187, -16616404, -19939561, -23262646, -26585647? -29908552 What comes next: -631617, -1263257, -1894897? -2526537 What is the next term in 108507, 228836, 349163, 469488, 589811, 710132, 830451? 950768 What comes next: -351817, -351811, -351805, -351799, -351793, -351787? -351781 What is next in -17840, -40632, -63424? -86216 What is next in 213964, 213806, 213566, 213262, 212912, 212534, 212146, 211766? 211412 What is next in 1099190, 2198422, 3297650, 4396874, 5496094, 6595310, 7694522? 8793730 What is next in -21333425, -21333430, -21333445, -21333476, -21333529, -21333610? -21333725 What is next in 12550, 25156, 37758, 50356, 62950, 75540? 88126 What is the next term in -101463, -405942, -913435, -1623942, -2537463, -3653998? -4973547 What is next in 1610195, 1610194, 1610193, 1610192, 1610191, 1610190? 1610189 What is the next term in -492787725, -492787727, -492787729? -492787731 What is the next term in 3324612, 6649222, 9973830, 13298436, 16623040? 19947642 What comes next: -975026, -974987, -974922, -974831, -974714? -974571 What is next in -32635997, -32636008, -32636019, -32636030, -32636041? -32636052 What comes next: -5802487, -5802589, -5802869, -5803417, -5804323, -5805677, -5807569, -5810089? -5813327 What is next in 7417191, 7417189, 7417187, 7417185? 7417183 What comes next: -36653317, -36653313, -36653309, -36653305, -36653301? -36653297 What comes next: -13337, -26675, -40021, -53381, -66761, -80167, -93605? -107081 What is next in -6913, -13875, -20837, -27799, -34761, -41723? -48685 What is next in -121299, -242598, -363895, -485190, -606483, -727774, -849063? -970350 What comes next: -371777, -743629, -1115479, -1487327, -1859173, -2231017? -2602859 What comes next: -4624, -19437, -44074, -78493, -122652, -176509, -240022? -313149 What comes next: 2895, 10338, 22741, 40104, 62427? 89710 What is next in 9673, 12543, 15413, 18283? 21153 What comes next: 4106987, 8213990, 12320993, 16427996, 20534999, 24642002? 28749005 What is next in -21321, -42611, -63915, -85239, -106589? -127971 What comes next: -11641, -22701, -33761, -44821? -55881 What is the next term in -4672484, -4672485, -4672486? -4672487 What is next in 521152, 521210, 521268, 521326, 521384? 521442 What is the next term in 22017, 44832, 68449, 92868, 118089, 144112? 170937 Wha	{ "pile_set_name": "DM Mathematics" }
3097 Calculate the highest common factor of 46788 and 4067. 7 Calculate the greatest common factor of 110 and 154274615. 55 Calculate the greatest common divisor of 40 and 6247328. 8 Calculate the greatest common factor of 6056 and 1936. 8 What is the greatest common factor of 576 and 2954208? 96 What is the greatest common factor of 192 and 241849080? 24 Calculate the greatest common divisor of 16129771 and 7105. 1421 What is the highest common factor of 1313 and 325079913? 101 What is the greatest common divisor of 3567945 and 6045? 465 What is the highest common divisor of 262 and 7232903? 131 Calculate the highest common factor of 14120 and 629360. 40 Calculate the highest common factor of 363116 and 20644. 52 What is the greatest common factor of 1312203 and 93? 3 Calculate the highest common factor of 433096 and 301. 43 Calculate the highest common factor of 8884097 and 33896. 223 What is the greatest common factor of 222505 and 350? 5 Calculate the greatest common divisor of 216 and 1034883. 27 What is the highest common divisor of 98316 and 62898? 6 What is the greatest common factor of 50949 and 4293? 81 Calculate the highest common divisor of 73878989 and 1283. 1283 What is the greatest common factor of 8350688 and 64? 32 Calculate the highest common divisor of 27 and 17309907. 9 What is the highest common factor of 537117 and 777? 21 Calculate the highest common divisor of 23170 and 18144. 14 Calculate the highest common factor of 133 and 23963940. 133 Calculate the highest common factor of 715176 and 1057672. 616 Calculate the highest common divisor of 1184 and 86211184. 592 What is the greatest common divisor of 3724 and 1267545328? 3724 Calculate the greatest common divisor of 89196300 and 345. 345 What is the greatest common divisor of 11 and 575184709? 11 What is the greatest common factor of 191910 and 885? 15 What is the highest common divisor of 23012424 and 1377? 1377 What is the highest common divisor of 6956 and 1172? 4 Calculate the greatest common divisor of 14898719 and 2563. 2563 Calculate the greatest common divisor of 7311396 and 8. 4 Calculate the greatest common divisor of 1187607 and 3634. 79 Calculate the greatest common divisor of 90970 and 247841. 11 What is the highest common factor of 25 and 784115? 5 Calculate the highest common factor of 5502725 and 53. 53 Calculate the highest common factor of 8073440 and 32240. 80 Calculate the highest common divisor of 22608 and 119808. 144 Calculate the greatest common factor of 481 and 44478668. 13 What is the highest common divisor of 180464 and 134192? 16 Calculate the greatest common factor of 2325969 and 6453. 27 What is the greatest common factor of 5973486 and 77653? 1159 Calculate the greatest common factor of 34991 and 17899487. 3181 What is the highest common factor of 305259 and 621576? 291 What is the greatest common factor of 235507 and 221743? 31 What is the greatest common divisor of 125 and 118636975? 25 What is the highest common divisor of 702 and 378715545? 117 What is the highest common factor of 1025516 and 2? 2 Calculate the greatest common divisor of 65590 and 21630. 70 What is the highest common factor of 12616800 and 6600? 600 Calculate the highest common factor of 54 and 28631835. 9 What is the highest common factor of 3332 and 1925046? 34 What is the greatest common divisor of 423901 and 1022807? 3889 Calculate the greatest common factor of 5504 and 153024. 64 What is the highest common divisor of 5808 and 79536? 48 What is the highest common factor of 5451 and 5987889? 69 What is the greatest common factor of 3199 and 6881? 7 What is the greatest common factor of 21743820 and 2520? 1260 Calculate the greatest common factor of 4 and 42602282. 2 What is the highest common divisor of 45028442 and 38? 38 Calculate the greatest common factor of 690039 and 1491. 21 Calculate the greatest common factor of 847242408 and 32. 8 Calculate the greatest common divisor of 2106544 and 1408. 176 Calculate the greatest common factor of 13632 and 146152. 8 What is the greatest common factor of 347234632 and 172? 172 What is the highest common factor of 35223 and 3221400? 177 Calculate the greatest common divisor of 437296 and 656. 16 What is the greatest common factor of 232957712 and 184248? 6824 What is the highest common divisor of 718750 and 782? 46 Calculate the greatest common factor of 122519 and 4250. 17 Calculate the highest common factor of 4071880 and 280. 40 Calculate the greatest common factor of 12749978 and 9694. 74 Calculate the greatest common factor of 328 and 42351073. 41 Calculate the highest common factor of 168552 and 1440. 72 Calculate the greatest common factor of 5980787 and 408. 17 Calculate the highest common factor of 2920131 and 3152. 197 Calculate the greatest common factor of 11148454 and 1994. 1994 Calculate the highest common divisor of 2935 and 108921959. 587 Calculate the highest common factor of 256850 and 4800. 50 What is the greatest common factor of 3360 and 362145? 105 Calculate the highest common divisor of 79524208 and 64. 16 Calculate the highest common divisor of 559 and 562739151. 559 Calculate the highest common factor of 896 and 29119258. 14 What is the highest common divisor of 13857 and 889359? 93 Calculate the highest common factor of 8208 and 10327272. 24 What is the greatest common divisor of 1837813 and 76? 19 Calculate the greatest common divisor of 1785 and 1118955. 15 Calculate the greatest common divisor of 335 and 309808. 67 Calculate the highest common divisor of 16656400 and 400. 400 What is the greatest common divisor of 8762742 and 4374? 162 What is the highest common factor of 21 and 32620? 7 Calculate the greatest common factor of 4983 and 34744798. 1661 Calculate the greatest common divisor of 9792 and 878544. 144 What is the highest common factor of 7944 and 390119248? 2648 What is the greatest common divisor of 150 and 90401760? 30 Calculate the highest common factor of 320 and 34726480. 80 What is the highest common factor of 1664 and 129686752? 416 What is the highest common factor of 1476 and 30625032? 492 What is the highest common divisor of 10131 and 1440483? 33 What is the greatest common factor of 3 and 39482343? 3 What is the greatest common factor of 109089 and 117? 9 Calculate the greatest common divisor of 3081987 and 113661. 657 What is the greatest common factor of 12105588 and 80868? 3516 Calculate the highest common factor of 91574 and 200074. 434 What is the greatest common divisor of 11958813 and 270? 27 Calculate the highest common factor of 2764 and 5504. 4 Calculate the highest common divisor of 585880 and 72944. 776 What is the greatest common factor of 110619 and 18649544? 4097 What is the highest common factor of 4479168 and 59520? 192 Calculate the highest common factor of 69 and 31340467. 23 What is the greatest common factor of 19907489 and 4876? 1219 Calculate the highest common divisor of 66250 and 1491950. 2650 Calculate the highest common divisor of 330 and 3769230. 30 Calculate the highest common divisor of 1038 and 26725386. 1038 What is the greatest common divisor of 90450 and 463350? 150 Calculate the highest common divisor of 31276593 and 9. 9 Calculate the greatest common divisor of 6018 and 19305921. 177 Calculate the highest common divisor of 1601 and 751735141. 1601 Calculate the highest common divisor of 2400 and 84786150. 150 Calculate the greatest common divisor of 191 and 48900011. 191 Calculate the greatest common divisor of 16 and 265352. 8 Calculate the greatest common divisor of 657199 and 217571. 2243 Calculate the highest common divisor of 16227 and 134810310. 1803 What is the highest common factor of 36038736 and 1044? 36 Calculate the greatest common divisor of 970 and 390683990. 970 Calculate the greatest common divisor of 117440 and 385280. 320 Calculate the highest common divisor of 32 and 198692. 4 Calculate the greatest common divisor of 237153494 and 292. 146 What is the highest common divisor of 8482966 and 340? 34 What is the greatest common divisor of 199 and 15691747? 199 Calculate the greatest common factor of 304804 and 31996. 1684 What is the greatest common divisor of 11998 and 7167091? 857 Calculate the greatest common div	{ "pile_set_name": "DM Mathematics" }
(sqrt(15)/(sqrt(5) - (sqrt(5) - sqrt(5)-2)) - (sqrt(243) + sqrt(243)1))-5). 8sqrt(13)/185 Simplify (5 + -5 + 1 + (-4 + (sqrt(1539)1)2 - ((sqrt(1539) - (sqrt(1539) - (sqrt(1539) - (sqrt(1539) - (2 + sqrt(1539)))))) + -2)2))4. -12 Simplify (((1sqrt(4032) + 0)-3 - (sqrt(4032) + (sqrt(4032)-1 + sqrt(4032))4 - (1sqrt(4032) + 5)))2 + -3)6-1. -217860 + 4320sqrt(7) Simplify -4((2(1sqrt(242)2-5 + -6(-1 + sqrt(242)) + (sqrt(242) - (0 + sqrt(242))) + -5))*2 + 1). -991252 + 5632sqrt(2) Simplify (3(1 + ((sqrt(405) - ((sqrt(405)3 - sqrt(405)) + 2)) + sqrt(405) - sqrt(405)) - (sqrt(405) + -4 + sqrt(405) + 1 + sqrt(405) + -1))6)2. -69984sqrt(5) + 2102436 Simplify -5 + (-2sqrt(153) - sqrt(153)) + 1 + -2 + ((sqrt(153)2 + 5 + (sqrt(153) - (-4 + -2sqrt(153))))6)*2 + -3. 9711sqrt(17) + 140607 Simplify (((sqrt(108) - (sqrt(108)-2 + 4))-44 + 1)-1-2)2. -149760sqrt(3) + 1012228 Simplify ((6sqrt(154)/(2sqrt(112) + sqrt(112)))/(sqrt(2) + sqrt(72) + -1sqrt(72) + sqrt(72) + (sqrt(2) - (sqrt(1024) - sqrt(16))/sqrt(8))))2. 11/4 Simplify (sqrt(130)-11 + (sqrt(130) - (sqrt(130) - (sqrt(130)2 + sqrt(130))-2)))/(sqrt(30)/((sqrt(90)/sqrt(5))/sqrt(6)))-5. 35sqrt(13) Simplify 2 + -1 + 5sqrt(55)/sqrt(125) + ((sqrt(275) + 0 - sqrt(275)) + -1)*2. 2 + sqrt(11) Simplify (-6((sqrt(171) - 1sqrt(171))2-4 + ((sqrt(931) - (sqrt(931) + sqrt(931)2 + sqrt(931)))2 - -3(-1 + sqrt(931))) + 1))*2. 3024sqrt(19) + 301788 Simplify 1 + ((sqrt(1573) - (0 + sqrt(1573) + sqrt(1573))) + 0)*2 + -2 - -4(-1 + 1 + sqrt(1573) + -5). 44sqrt(13) + 1552 Simplify 6((sqrt(252) - (sqrt(252) + -5 + sqrt(252) + 0))*2 + 4 + (sqrt(252)1)*2-3 + ((sqrt(252) + -2)*2 + -3 - sqrt(252))) + 2. -540sqrt(7) - 1330 Simplify (2sqrt(13)-5 + 4)*2 + 2 - (sqrt(13)-22 - sqrt(52)-5)4. -104sqrt(13) + 1318 Simplify (sqrt(294) + 5sqrt(294)-1)/((sqrt(54)/sqrt(3))/sqrt(6) + (sqrt(3) + sqrt(3) + sqrt(12))-2). 4sqrt(2) Simplify -4(sqrt(117) - (-1 + sqrt(117) - sqrt(117))2)-3-3 - (-16((sqrt(156) - -3sqrt(156)2 - sqrt(156)) + sqrt(156))/sqrt(12))2. -22896 - 108sqrt(13) Simplify -5 + 0 + ((sqrt(1539) + -2)6)2 + -3 + (sqrt(114)-2-1)/sqrt(6). -1294sqrt(19) + 55540 Simplify (2(sqrt(2) - (1 + sqrt(2))) - sqrt(2) - (sqrt(80)/sqrt(10))/sqrt(4) - (sqrt(18)/(-5sqrt(9)) - (sqrt(72) + -2)))-5. -21sqrt(2) + 20 Simplify (-4(-5(sqrt(297) + (-1sqrt(297) - sqrt(297) - sqrt(297))) - sqrt(297)))/(sqrt(9)/(sqrt(6)/sqrt(2)) + (4sqrt(243) + sqrt(243) - sqrt(243))). -108sqrt(11)/37 Simplify -2(((1 + sqrt(1584))-3 + -4)2 + (2sqrt(1584) + -5 - ((sqrt(1584) + 41sqrt(1584) + sqrt(1584))*2 + sqrt(1584) + sqrt(1584)))). -1008sqrt(11) + 85448 Simplify (5-2sqrt(190) + sqrt(190) - 1(2sqrt(190) - sqrt(190)))/(sqrt(90)/(((sqrt(63) - sqrt(63)-4) + sqrt(63))/sqrt(7) + sqrt(9))). -70sqrt(19) Simplify -6(2 + 1((sqrt(175)-14 - -6(-1 + sqrt(175))) + 2)2). -4308 + 480sqrt(7) Simplify (12(sqrt(189)-1 + sqrt(189)))/(sqrt(108) + 6sqrt(108)1 + sqrt(108) - (sqrt(108) - sqrt(108)2)3). 0 Simplify ((sqrt(315) - (sqrt(315)-1 - sqrt(315))-4)3)/((sqrt(330)/(sqrt(12)/sqrt(2)))/(sqrt(198)/sqrt(2) - sqrt(11))). -126sqrt(7) Simplify (-54(sqrt(15) + sqrt(165)/(sqrt(11)-2)))/(-2sqrt(27)/(sqrt(27)/sqrt(3)1)). 5sqrt(5) Simplify (sqrt(22)/sqrt(2) + 1)5 + 3 + (sqrt(22) - (sqrt(22) - sqrt(198)/sqrt(9))-2)/sqrt(2)-2 + 2. 3sqrt(11) + 10 Simplify (-5 + sqrt(245) + -3 - (sqrt(605) + -1 + (sqrt(605) - -4sqrt(605)) + sqrt(605) - sqrt(605)))*2 + -4. 826sqrt(5) + 17450 Simplify (-62(sqrt(88)-3 + sqrt(88))5)/((sqrt(256)/(sqrt(16)/sqrt(2)))/(sqrt(4) + sqrt(16)/(sqrt(4)1) + sqrt(4))). 360sqrt(11) Simplify (sqrt(24) + sqrt(48)/(2sqrt(2)))/(sqrt(192)3) + -2 + (sqrt(2) + sqrt(18))-6 + 3 + (sqrt(3168) - 2sqrt(3168) - sqrt(22))/sqrt(11). -295sqrt(2)/8 + 1 Simplify (sqrt(143)/sqrt(396) - (sqrt(13) + sqrt(52) + 2)2) + -3((sqrt(1300) + 1 - sqrt(1300)) + -5 + sqrt(13) + 2)*2. -172 + sqrt(13)/6 Simplify 5 + (0 + sqrt(432) + 0 + sqrt(432) + -1 + -4 + 4 + (sqrt(432) + -2sqrt(432) + -1 - sqrt(432)))*2. 9 Simplify ((sqrt(48) - sqrt(240)/sqrt(5))/sqrt(2)63)/((sqrt(48) - (sqrt(48) - sqrt(192)/(sqrt(4)1)))/(sqrt(4) + sqrt(484)1)). 0 Simplify 3(-2 + (-1(-2 + sqrt(162)) - (-4(sqrt(162)-1 - sqrt(162)))2)5)-2. 270sqrt(2) + 310992 Simplify ((sqrt(152)-2 - sqrt(152))2 - (sqrt(152) + (sqrt(152) - sqrt(152)35)))/((sqrt(144)/sqrt(6))/sqrt(3) - ((sqrt(72) - sqrt(72)-1) + sqrt(72))). -7sqrt(19)/8 Simplify (1(sqrt(153) - -4sqrt(153)2))/((sqrt(441) - (-6sqrt(441)4 - sqrt(441))) + sqrt(441)) + -1. -1 + sqrt(17)/21 Simplify (sqrt(588)6 + sqrt(12))/(sqrt(28)/(sqrt(175) + sqrt(7))) + (sqrt(3300)-1)/sqrt(11) + sqrt(432) + (sqrt(432)2 + 0)*2. 260sqrt(3) + 1728 Simplify (-3(sqrt(60) + 1sqrt(420)/sqrt(7)))/(sqrt(72)/sqrt(6)-3 - (sqrt(1200) + sqrt(1200)1 + sqrt(1200))) + -2. -2 + 2sqrt(5)/11 Simplify (-5 + 2 + -1(0 + sqrt(72))-3 + 2 + (sqrt(72) + (sqrt(72) - sqrt(72)-1) + 4)2)2. 756sqrt(2) + 5881 Simplify (sqrt(20)/sqrt(4) + -3 + sqrt(5))*2 + sqrt(40)/(sqrt(8)-3) + -5(1sqrt(245) - sqrt(245))1. -37sqrt(5)/3 + 29 Simplify 4(sqrt(363) + 4(sqrt(363) + sqrt(363)1) - sqrt(27)/(sqrt(900) + 4sqrt(900)))*2. 73477803/625 Simplify (-2 + sqrt(75)-2 - (sqrt(75) - (1sqrt(75) + sqrt(75) + sqrt(75) + sqrt(75))2-6)) + 4 + (0 + sqrt(21)/(sqrt(28)2) + 4)2. -114909/16 - 13sqrt(3) Simplify (sqrt(49) - sqrt(294)/sqrt(6)-4 - sqrt(49)-22)/(sqrt(7) + (sqrt(7) - 3sqrt(343)) + -4sqrt(35)/sqrt(5)). -9sqrt(7)/23 Simplify -6sqrt(49)/(sqrt(175)-2)-5 + (-21sqrt(84) + sqrt(84))/(sqrt(768) + (-1sqrt(768) - sqrt(768) - sqrt(768))). -47sqrt(7)/16 Simplify 3 + ((sqrt(117) - 3(sqrt(117) + 3sqrt(117)))6)/((sqrt(18) - (sqrt(450) - -3sqrt(450)))/sqrt(2)). 3 + 66sqrt(13)/19 Simplify 4(0 + (2 + sqrt(539))-1) + (sqrt(660)/sqrt(108) + sqrt(55))/((sqrt(320) + sqrt(20))/sqrt(4)) + 4. -416sqrt(11)/15 - 4 Simplify 4((-5 + sqrt(3) + (sqrt(120)/sqrt(10) - sqrt(3)))4)2 + 6((sqrt(18)/(sqrt(12)/sqrt(4)))/sqrt(2) + 2). -1274sqrt(3) + 2380 Simplify (-6(sqrt(2600) - 2sqrt(2600)-5 - sqrt(2600)))/(2-1-6sqrt(12)/sqrt(6)). -50sqrt(13) Simplify (-5(-1 + sqrt(8))6)*2 + (1sqrt(450)1)2. -3600sqrt(2) + 8550 Simplify 0 + (sqrt(112)-1-1-4 + (sqrt(112) - -2sqrt(112)) + -5 + (2sqrt(112) - sqrt(112))-3)*2. 160sqrt(7) + 1817 Simplify (4-2sqrt(384))/(sqrt(12)/(1sqrt(294))). -448sqrt(3) Simplify -3 + (4 + ((6sqrt(192)-1 - (1 + (sqrt(192) + 1 - sqrt(192)))) + 4)5)2. -6720sqrt(3) + 172993 Simplify (36(sqrt(95) + sqrt(95)1)5)/((3sqrt(125)-1 - sqrt(125))4). -9sqrt(19)/4 Simplify ((sqrt(39) + sqrt(39)-1)-4 - 1sqrt(39)5)/(2sqrt(75)-2-4). -sqrt(13)/16 Simplify -5 + (2 + (4 + (sqrt(108) - (-1 + sqrt(108))) - -2(sqrt(108) + 1)) - (4 + (sqrt(108) + -1sqrt(108))3 + sqrt(108) + 0))*21. 60sqrt(3) + 128 Simplify (sqrt(540)/sqrt(3))/((sqrt(120) - sqrt(120)2)/sqrt(12)) + 4 + (2(sqrt(36)/sqrt(6) - sqrt(6)))/sqrt(3). -3sqrt(2) + 4 Simplify -5(4 + (((sqrt(78) - (sqrt(78) + 2sqrt(78)))6 + sqrt(78))-5)/(-1sqrt(486)-6)). -20 - 275sqrt(13)/54 Simplify (3sqrt(891) + 3)4 + -4(0 + sqrt(891))*22 + -4. -7120 + 108sqrt(11) Simplify (-1(-3(sqrt(119)-2 + sqrt(119)) + sqrt(119))/(sqrt(343)-2) + sqrt(833) + -4(sqrt(833) + -3 - sqrt(833)) + sqrt(833) + 2 + 0)*2. 400sqrt(17) + 179604/49 Simplify (-2 + -3(-1(sqrt(1216) + 2) + -4 + 0 + sqrt(1216) + 3))*2. 49 Simplify (5((sqrt(104) + -53sqrt(104))/(sqrt(968) + -1sqrt(968) + sqrt(968)) - (-3 + sqrt(637) + 2 + -5sqrt(39)/sqrt(3))))*2. -1800sqrt(13)/11 + 424225/121 Simplify ((-4 + -1 + sqrt(192))-1)21 + ((2 + (0 + sqrt(192))5)6)*2. 5680sqrt(3) + 173161 Simplify ((-4(sqrt(76) + -2))2-1 + (5 + sqrt(304) + 3 + (4sqrt(19) - sqrt(19)))2)-1. -240sqrt(19) + 285 Simplify (1 + -2 + sqrt(1008) + -3)2 + (sqrt(1008) + (sqrt(1008) - (sqrt(1008)23 - sqrt(1008))))2-4. -35264 - 96sqrt(7) Simplify (sqrt(220)/sqrt(250) - sqrt(22))/(sqrt(891) - -3sqrt(891)) - (2 + 4 + sqrt(392)-2)2. -1604 + 15119sqrt(2)/45 Simplify ((-5sqrt(475)2 - (sqrt(475) + 0 + 2))*2 + 4 + sqrt(475)-1 + (sqrt(475) - (-1 + (-1sqrt(475) - sqrt(475))) - sqrt(475))2 + -5)6. 14	{ "pile_set_name": "DM Mathematics" }
t is the ten thousands digit of 33385531? 8 What is the millions digit of 5159085? 5 What is the units digit of 119868955? 5 What is the units digit of 7113978025? 5 What is the hundred millions digit of 586672259? 5 What is the hundred millions digit of 111332572? 1 What is the ten thousands digit of 282185112? 8 What is the tens digit of 2462843121? 2 What is the units digit of 88167302? 2 What is the millions digit of 7198264? 7 What is the tens digit of 47504834? 3 What is the hundred thousands digit of 21656208? 6 What is the tens digit of 159340078? 7 What is the ten thousands digit of 1320147657? 4 What is the thousands digit of 343222143? 2 What is the tens digit of 57443987? 8 What is the tens digit of 4365531229? 2 What is the millions digit of 50943206? 0 What is the tens digit of 169420468? 6 What is the ten thousands digit of 8901828? 0 What is the ten thousands digit of 34505036? 0 What is the hundred millions digit of 1022359729? 0 What is the hundred millions digit of 324593818? 3 What is the hundreds digit of 730163454? 4 What is the tens digit of 186651916? 1 What is the tens digit of 57741572? 7 What is the ten thousands digit of 202814211? 1 What is the ten thousands digit of 77632559? 3 What is the hundred millions digit of 363734074? 3 What is the units digit of 86425699? 9 What is the thousands digit of 1038380618? 0 What is the units digit of 185365334? 4 What is the tens digit of 8391576? 7 What is the thousands digit of 428091620? 1 What is the hundred thousands digit of 37301501? 3 What is the ten thousands digit of 1748366742? 6 What is the millions digit of 81972405? 1 What is the millions digit of 391322903? 1 What is the units digit of 724574731? 1 What is the hundred thousands digit of 243849? 2 What is the ten thousands digit of 2700965358? 6 What is the hundreds digit of 30976370? 3 What is the millions digit of 4002919071? 2 What is the hundred thousands digit of 1175016913? 0 What is the hundred thousands digit of 236474337? 4 What is the millions digit of 16858366? 6 What is the ten thousands digit of 47023942? 2 What is the hundred thousands digit of 310441851? 4 What is the thousands digit of 677862? 7 What is the thousands digit of 226417723? 7 What is the hundred thousands digit of 289792339? 7 What is the ten millions digit of 2570132203? 7 What is the billions digit of 3217657960? 3 What is the hundred thousands digit of 32171421? 1 What is the ten millions digit of 74050521? 7 What is the units digit of 22215744? 4 What is the hundred thousands digit of 3660522844? 5 What is the units digit of 213914655? 5 What is the thousands digit of 229842849? 2 What is the hundred thousands digit of 1090608535? 6 What is the tens digit of 78054391? 9 What is the ten millions digit of 18182196? 1 What is the thousands digit of 636625676? 5 What is the hundred thousands digit of 72538474? 5 What is the hundreds digit of 227387660? 6 What is the ten millions digit of 719522724? 1 What is the tens digit of 1547912289? 8 What is the hundreds digit of 475983423? 4 What is the units digit of 133654277? 7 What is the ten thousands digit of 235977347? 7 What is the tens digit of 163264404? 0 What is the ten millions digit of 3155308549? 5 What is the tens digit of 152635101? 0 What is the thousands digit of 1273993221? 3 What is the hundred thousands digit of 86146150? 1 What is the hundreds digit of 323888266? 2 What is the thousands digit of 5641848303? 8 What is the millions digit of 11227541? 1 What is the tens digit of 645980184? 8 What is the tens digit of 13856719? 1 What is the tens digit of 115929253? 5 What is the hundreds digit of 74664378? 3 What is the thousands digit of 206366259? 6 What is the ten millions digit of 434788899? 3 What is the millions digit of 358253789? 8 What is the hundred millions digit of 403629784? 4 What is the ten thousands digit of 51313551? 1 What is the hundred millions digit of 2098484901? 0 What is the thousands digit of 429894344? 4 What is the hundred thousands digit of 641192993? 1 What is the tens digit of 318346345? 4 What is the tens digit of 525139083? 8 What is the millions digit of 101239331? 1 What is the tens digit of 1225886428? 2 What is the ten millions digit of 5891705714? 9 What is the ten millions digit of 1471424193? 7 What is the units digit of 90159028? 8 What is the units digit of 1194789894? 4 What is the hundred thousands digit of 1481777008? 7 What is the hundred millions digit of 830611885? 8 What is the millions digit of 1059135058? 9 What is the hundred thousands digit of 1090104299? 1 What is the hundred millions digit of 573182966? 5 What is the units digit of 1267576166? 6 What is the units digit of 1431555979? 9 What is the hundred millions digit of 1179864719? 1 What is the millions digit of 144800813? 4 What is the hundreds digit of 148366119? 1 What is the ten millions digit of 150133607? 5 What is the ten thousands digit of 8912117? 1 What is the thousands digit of 460497217? 7 What is the units digit of 121683127? 7 What is the hundred thousands digit of 7418582197? 5 What is the units digit of 26956319? 9 What is the thousands digit of 1963418567? 8 What is the hundreds digit of 199238339? 3 What is the hundred thousands digit of 753029556? 0 What is the hundred thousands digit of 741435058? 4 What is the thousands digit of 169410614? 0 What is the hundred thousands digit of 390378155? 3 What is the ten millions digit of 132405695? 3 What is the tens digit of 93621061? 6 What is the ten thousands digit of 1428775037? 7 What is the millions digit of 787428795? 7 What is the ten millions digit of 312900789? 1 What is the ten millions digit of 148026393? 4 What is the ten millions digit of 1470372183? 7 What is the ten thousands digit of 205801192? 0 What is the millions digit of 650382406? 0 What is the hundreds digit of 1670569388? 3 What is the ten thousands digit of 171208674? 0 What is the tens digit of 94382882? 8 What is the tens digit of 44035332? 3 What is the hundred thousands digit of 7862427195? 4 What is the hundred thousands digit of 1085833203? 8 What is the hundred thousands digit of 7632297590? 2 What is the hundred thousands digit of 85885256? 8 What is the hundred millions digit of 1008404951? 0 What is the tens digit of 46971121? 2 What is the ten millions digit of 1015089599? 1 What is the ten thousands digit of 2211245794? 4 What is the millions digit of 448856520? 8 What is the hundred thousands digit of 61309991? 3 What is the units digit of 877522212? 2 What is the hundreds digit of 394123165? 1 What is the hundred thousands digit of 2827810330? 8 What is the thousands digit of 227320628? 0 What is the hundred millions digit of 2906822335? 9 What is the ten millions digit of 64604029? 6 What is the ten millions digit of 128203025? 2 What is the units digit of 4937810? 0 What is the ten millions digit of 668755021? 6 What is the tens digit of 7905127048? 4 What is the hundred millions digit of 404834103? 4 What is the units digit of 2262175014? 4 What is the ten millions digit of 351498513? 5 What is the ten thousands digit of 39189603? 8 What is the millions digit of 31858759? 1 What is the ten thousands digit of 9293970273? 7 What is the millions digit of 325665166? 5 What is the hundreds digit of 5549871847? 8 What is the tens digit of 1482350367? 6 What is the ten millions digit of 17470359? 1 What is the hundreds digit of 6078887? 8 What is the hundred millions digit of 321506709? 3 What is the ten millions digit of 53100554? 5 What is the units digit of 6011195761? 1 What is the millions digit of 1067606430? 7 What is the millions digit of 100617816? 0 What is the millions digit of 5923703? 5 What is the thousands digit of 2040226663? 6 What is the millions digit of 1811826444? 1 What is the billions digit of 1522913278? 1 What is the hundred thousands digit of 388367275? 3 What is the hundreds digit of 25513346? 3 What is the thousands digit of 146351477? 1 What is the ten millions digit of 1318900341? 1 What is the hundred thousands digit of 212245635? 2 What is the hundred millions digit of 104321877? 1 What is the tens digit of 414054428? 2 What is the units digit of 405507022? 2 What is the thousands digit	{ "pile_set_name": "DM Mathematics" }
a factor of r? True Let q be 0 + (-2)/8 + (-3387)/(-12). Suppose 2m + 5h - 441 = 0, -h - q + 950 = 3m. Does 14 divide m? False Suppose 4 = 4p + 5g, -p + 2p - 18 = 3g. Suppose -w + 5t = 17, -3w + 8w + t = 19. Suppose -pd + 48 = -wd. Does 8 divide d? True Let t(r) = -r*2 - 32r + 84. Is 9 a factor of t(-11)? True Let j = 240 + 596. Does 11 divide j? True Suppose -12 = -3b - 5z, -8 = 3b + 2b - z. Let q be (-77 + -3)2b. Suppose 4y = -0y + q. Is 10 a factor of y? True Suppose -4x + 2p + 3060 = 0, 7x = 2x + 3p + 3825. Is x a multiple of 5? True Suppose -w = -3h - 1, -5 = 4h + 2w + 13. Let f(a) = -4a3 + 3a*2 - 3. Does 13 divide f(h)? False Let t(r) = -79r + 72r + 65r + 6. Is 16 a factor of t(1)? True Suppose -8h = -9h + 12. Does 17 divide 1434/h - (-1)/(-2)? True Let r = 497 + -427. Is 4 a factor of r? False Suppose 4a + 25 = 2r + 3r, 5a = -3r - 22. Let q(u) = -23u + 10. Is q(a) a multiple of 21? False Suppose -576 = -24n + 21n. Is n a multiple of 8? True Let l = 213 - -8. Is l a multiple of 20? False Let r(u) = 3u - 10. Let k be r(4). Suppose -ks + 3s = 4i - 220, 2i = s + 110. Does 17 divide i? False Let z(k) = -k2 + 2k*2 + 8k + 0k2 - 13. Let y be z(-9). Let l(j) = 2j*2 + 2j - 6. Is 14 a factor of l(y)? False Suppose 12 = u + 4p, -3p = -3 - 3. Let y be 1624/10 + 4/(-10). Suppose 2x - 5c - y = 0, 0 = -0c - uc. Is 27 a factor of x? True Is 28 a factor of 14/((-42)/(-6))56? True Let c(q) = q2 - 6q - 21. Let i be c(9). Suppose 0 = -m - m + i. Does 7 divide (2/m)/((-3)/(-63))? True Let t(x) = -3x + 49. Let y(d) = -d + 12. Let j(h) = -2t(h) + 9y(h). Let b be j(5). Let o = 18 + b. Does 9 divide o? False Does 14 divide (-196)/(414/(-364))? True Suppose 0 = 3f + 4d - 5d - 1, 5f - 2d = 0. Suppose fp + 34 = 3p. Is 11 a factor of p? False Let s(a) = 5a - 7. Let d(r) = r + 1. Let w(g) = -6d(g) + s(g). Let j be w(-13). Suppose b + jy = -4y + 64, 5b - 232 = 2y. Does 16 divide b? True Suppose -202 = 4u - 62. Suppose 2d + 236 = 4b, d + 294 = 4b + 60. Let s = b + u. Is s a multiple of 9? False Let j be 105 - ((1 - (-9)/(-3)) + 3). Suppose -t + 3c + j = 0, 5t - 510 = 4c + c. Does 27 divide t? False Let l(r) = 2r + 27. Let v be l(-12). Suppose vi = -i + 116. Is 14 a factor of i? False Let o = -6 + 15. Let g(q) = -q*2 + 9q + 3. Let p be g(o). Suppose -pi - 3f + 0f = -9, 5i = -f + 27. Is i even? True Suppose -3n + 61 = -530. Is 9 a factor of n? False Suppose -9x + 325 = 16x. Is 5 a factor of x? False Suppose 2c = -0c + 22. Let y(z) = -z2 + 11z + 5. Let u be y(c). Suppose 0 = ug + 3q - 230, -2g + q = -49 - 43. Is g a multiple of 23? True Suppose -2j = 2h - 68, 0 = -0j + 2j + 5h - 62. Let w = j - 32. Is 7 a factor of 7(w - (0 + 0))? True Let v(u) = -u3 + 6u*2 + 2u - 9. Let p be v(6). Suppose -ps = 20 + 31. Is (3 + 0)(19 + s) a multiple of 6? True Let f be 0/(-3)3/6. Suppose 105 = -4s + m + 23, f = -2s + m - 42. Let n = s + 72. Is 13 a factor of n? True Let u(q) = -q3 + 18q*2 - 31q + 5. Let l be (4/(-6))/((-17)/408). Is u(l) a multiple of 21? True Let s(r) = r*2 + 5r + 6. Let d(m) = 5m + 4. Let l be d(3). Suppose 0 = -5b - 2z - l, -4b + 0z - 5 = 5z. Is 3 a factor of s(b)? True Suppose -2c - 2c + 30 = 2o, -4c - o + 33 = 0. Does 8 divide 8/(-2)(1332/(-16))/c? False Let h = 384 - 839. Is (4/5)/((-7)/h) a multiple of 26? True Let w(p) = -14p + 154. Does 20 divide w(-9)? True Let d be (6/2)/(7/14). Suppose 0 = dz - z - 20. Suppose t = 5p + 85, -165 - 60 = -zt - 3p. Is t a multiple of 20? True Let k be (2 + (3 - 2))/((-12)/40). Let o(c) be the second derivative of c*5/20 + 3c*4/4 - 7c*3/3 - 11c*2/2 + 2c. Is 6 a factor of o(k)? False Let j be (-162)/(-7) + (-2)/14. Suppose -3t + j = -16. Does 9 divide t? False Is 5 a factor of -4 - (18/3 + -70)? True Let h(p) = 20p + 694. Does 3 divide h(-32)? True Suppose -7h - 112 + 763 = 0. Is h a multiple of 31? True Let w(g) = 11g*2 - 15g - 33. Is 7 a factor of w(-3)? False Let v = 117 - -49. Is 5 a factor of v? False Let k(n) = 179n2 + 7n - 4. Is k(1) a multiple of 13? True Suppose -603c - 4214 = -610c. Is c a multiple of 9? False Let o be (42/5)/((-19)/(-95)). Suppose -5l = -2k - 856, 3k - o + 901 = 5l. Is 34 a factor of l? True Let d(c) be the third derivative of -c5/60 - c4/3 + c*3/2 - 3c*2. Let y be d(-8). Suppose -4 = 6a - 4a, 69 = 5g + ya. Is g a multiple of 4? False Suppose -2p - p = -2u, p = u. Let c(d) = -d3 + d2 + d + 57. Is c(p) a multiple of 19? True Let i = -1016 + 1858. Does 48 divide i? False Let x be (1 + 2)/(3/(-9)). Let f = 14 + x. Suppose -2d = -0d - 10, -fy = -2d - 65. Is y a multiple of 5? True Let h = -196 + 123. Let c = 5 - h. Is 13 a factor of c? True Let g(b) be the third derivative of b6/120 - 7b*5/30 - 5b*4/8 + 10b*3/3 + 12b*2. Does 10 divide g(15)? True Suppose 0 = 31r - 32r - 1040. Is 13 a factor of r/56(2 - (-3 + 12))? True Let o be (4/(-5))/((-16)/40). Let h be o4/(-8)-5. Suppose 5s = -3j + 4j + 172, 0 = 3s + hj - 92. Is 16 a factor of s? False Suppose -3j - 2g = -155 - 33, -g - 203 = -3j. Does 6 divide j? True Let c = -22 + 24. Suppose cl + 6 = -0l. Let o(z) = 6z2 + 2z - 3. Is o(l) a multiple of 9? True Suppose 7n - 485 = 607. Is n a multiple of 26? True Let m(o) = -o - 5. Let w be m(2). Does 8 divide (w - (6 + -10))(0 + -27)? False Let m(b) = -b*3 + 1. Suppose 6 = -4r - 0c + 2c, 0 = 3r + 3c. Let q be m(r). Let i = 2 + q. Is 2 a factor of i? True Let h(x) = -x*3 - 8x*2 - 5x + 8. Suppose 0 = 5u - 2r + 10, 2u - 4r + 3 + 1 = 0. Let d = u - 6. Does 16 divide h(d)? True Let h be (-3)/(-12) + (-1)/4. Suppose -2q = -m - 71, 3m + hm = -q + 32. Suppose -k - 4k = -q. Does 3 divide k? False Let z = -1570 + 2285. Is z a multiple of 20? False Let w(g) = g*3 + 15g*2 + 25g + 16. Let u be w(-13). Suppose o - 68 = u. Is o a multiple of 8? False Is 24 a factor of ((-24)/6 - 20)(-1 - 2)? True Suppose 3m + 700 = -4y + 2335, m + 3y - 550 = 0. Suppose -m = -12z + 1979. Is 35 a factor of z? True Is 10 a factor of ((-270)/(-25))/(24/2000)? True Suppose 1 = -5z + 4z. Let k(a) = -99a3 - a2 - a. Is k(z) a multiple of 13? False Let k = 1264 + -748. Is k a multiple of 81? False Let w = 49 + -32. Suppose wo + 55 = 18o. Does 9 divide o? False Does 33 divide -2 + 21/7404? False Suppose -2h - 8 = 3m, 0 = -0h + 5h + 2m + 9. Let k = h - -9. Is k a multiple of 2? True Let p(a) = 1971a2 + 38a + 39. Is p(-1) a multiple of 35? False Is 5 a factor of -138 + 133 + 566/(-2)-3? False Let p(a) = a - 1. Let m be p(4). Let r be 6/m + 2 + 1. Suppose -g - 49 = ri - 194, i - 45 = 3g. Is i a multiple of 15? True Let l(g) = g3 + 5g*2 + 9g + 82. Does 2 divide l(-5)? False Let p(g) = -g*3 + 8g*2 + 11g - 8. Let m(v) = -v*3 + 6v*2 - 6v + 1. Let o = 10 - 6. Let a be m(o). Is 3 a factor of p(a)? False Let r = 1204 + -93. Is 101 a factor of r? True Suppose -3o - 12 = 0, -3o = -2c - 2o + 68. Suppose 22 + c = -n. Let d = -37 - n. Is 10 a factor of d? False Let x(t) = -3t3 + 2t*2 - 9t - 23. Does 7 divide x(-4)? False Let d(h) = 3h2 + 3h - 2. Let s be d(-7). Let a = s - 28. Is a a multiple of 24? True Let c(a) = 419a + 0 - 473a - 3. Is c(-1) a multiple of 14? False Suppose -4i = -9i - 10. Let q be i(-1)/21. Is 58/(-4)(q - 3) a multiple of 13? False Let x(u) = 24u - 3. Suppose 0 = 3v - 3 - 0. Is x(v) a multiple of 21? True Let g(o) = 43o + 2. Suppose 8 = 6l - 2l. Let q be g(l). Let x = q - 48. Does 10 divide x? True Let u(r) = -r*2 - 2r + 3. Suppose -o + 10 = 4o. Let j be u(o). Is 25 a factor of 72 + (1 - (j - -3))? True Let d = -319 + 533. Suppose d - 19 = u. Is u a multiple of 25? False Suppose -2i + i + 173 = 5z, 5i - 943 = z. Let c = -131 + i. Is c a multiple of 26? False Let o(k) = 2k3 + 40k*2 + 25k - 4. Suppose -7x + 38 = -9x. Does 27 divide o(x)? True Let i = -313 + 621. Is 5 a factor of i? False Suppose -3627 = 33v - 64v. Does 4 divide v? False Let u = 113 - 125. Let o(m) = 2m3 + 25m*2 - 1. Is o(u) a multiple of 11? True Let h = -34 + 39. Suppose 2z + hd = 193, -109 = -z - 9d + 4*d. Is 12 a factor of z? True Let t be 323/	{ "pile_set_name": "DM Mathematics" }
+ 2. Let d(b) = -19b3 + 6b*2 - 8b + 5. Let k(u) = -3d(u) + 8i(u). Determine k(1). 8 Let f(c) = c*2 + 4c - 9. Suppose -119 = -15n + 32n. Calculate f(n). 12 Let q(g) = -g + 42g2 - 2 - 25g*2 - 15g2 + g3. Suppose 2o + 0o = -4. What is q(o)? 0 Let h(r) = -10r + 4. Let c be ((24/18)/2)/(4/24). Give h(c). -36 Let o be 1 + (-36 - -1)/5. Let p be o/440/12. Let g(k) = k + 3. Let x(a) = 3a + 8. Let l(j) = 8g(j) - 3x(j). Calculate l(p). 5 Let w(d) = 6d - 20. Suppose -19 = -5m - 2a, -5m = -51a + 46a - 40. What is w(m)? 10 Suppose -3o = -d + 3d - 15, 2d + 15 = 3o. Let b(v) = v3 - 7v*2 + 6v - 6. What is b(o)? -26 Suppose -23q = -14q + 45. Let m(j) = j*2 + 5j - 7. Determine m(q). -7 Let m(h) = 3h - 3. Let u = -26 + 31. Suppose -1 + 27 = 3t + uw, -5w = -20. Give m(t). 3 Let n(z) = z*2 + 2z + 7. Let a be n(-7). Suppose -7f = a - 0. Let v(y) = y - 1. Determine v(f). -7 Let s(b) = -2b*2 + 17b + 38. Let g be s(-2). Let w(u) = 9u2 + 13u + 2. Let o(q) = 8q2 + 12q + 2. Let t(n) = -7o(n) + 6w(n). Determine t(g). -10 Let v(k) = -5k3 - k2 + 2k - 1. Let i be v(1). Let r = i + 2. Let g(o) be the first derivative of 3o2/2 + 4o - 2705. Calculate g(r). -5 Let y(c) be the second derivative of c*4/24 + 5c*3/6 + 3c*2/2 - 2c. Let v(k) be the first derivative of y(k). Let u = -68 - -68. Calculate v(u). 5 Let q = -599 + 601. Let c(r) = -8r2 - r + 3. Give c(q). -31 Let j(x) be the third derivative of x8/2240 - x6/360 - 5x*4/8 - 33x2. Let c(q) be the second derivative of j(q). Calculate c(2). 20 Let l = 0 + 2. Let x(u) = -2 - u3 + 0 - 2ul + 0u2 + 1. Let m = 4 - 6. What is x(m)? -1 Let v be 2/(-9) + 7/(-9). Let f(m) = -m2 - 11m - 4. Let r(s) = 2s*2 + 14s + 5. Let c(a) = -5f(a) - 4r(a). What is c(v)? -2 Let q(i) = 11i + 6. Let a = 708 + -711. Give q(a). -27 Suppose c + 6 = -c. Let u(f) be the second derivative of -f6/360 - f5/60 - 11f*4/12 - f. Let r(q) be the third derivative of u(q). Calculate r(c). 4 Let l = -2 + 4. Let d(i) = 5i + 1 - 3i - 4i - 2il. Let u(b) = b3 - 11b*2 - 9b - 35. Let y be u(12). Give d(y). -3 Let g(q) = 4q2 - q - 1. Suppose -2u + 49y = 46y - 4, -5u - 2y - 9 = 0. What is g(u)? 4 Let b be (18/(-27))/(8/156). Let v(g) = g + 1. Calculate v(b). -12 Suppose 3v - 15 = 6v. Let j be (-24)/v - (22/(-10) + 2). Let h(p) = -p + 11. Calculate h(j). 6 Let c(f) be the second derivative of -f*3/3 + 3f*2/2 - 83f. Give c(-3). 9 Let r(q) be the first derivative of q*2/2 + 9q + 47. Let w be (0 + -3)(-9)/(-3). Determine r(w). 0 Let d(i) = -6i. Let u(f) = -18f - 1. Let s(a) = 7d(a) - 2u(a). Calculate s(4). -22 Let j(g) be the first derivative of -5g*3/3 - 45. Calculate j(1). -5 Suppose -d - d - 2 = 0. Let g be (2 + 1 - d)-1. Let z = 2 - g. Let h(b) = -b + 6. Give h(z). 0 Let y(w) be the second derivative of -w*5/20 - 5w*4/6 - 4w*3/3 + 2w*2 - 10w. Suppose -5m - 36 = -m. Determine y(m). -5 Let j(v) = -2v - 14. Let i(f) = -1. Suppose 0 = y - 0 + 3. Let a = -7 - y. Let r(m) = ai(m) + j(m). Give r(-7). 4 Suppose -l - j = 4l - 2, 0 = -2l + 2j - 4. Let z(w) = w - 2. Let u(t) = -4 + t + 1 + 0. Let f(m) = 2u(m) - 3z(m). What is f(l)? 0 Let o(j) = -3j + j - 5j - 3 - 7. Let r(m) = -3m - 5. Let w(u) = 2o(u) - 5r(u). Determine w(-4). 1 Let y(d) be the third derivative of d4/12 - 11d*3/6 + 567d2. Calculate y(17). 23 Let s(p) = p - 21. Let k(q) = q2 - 6q - 36. Let y be k(10). Let r(w) = -5w + 3w + w + 20. Let t(b) = yr(b) + 3s(b). What is t(0)? 17 Let n(v) = -6v - 6v2 + 5v*2 + 0v2 - 39 + 34. Give n(-6). -5 Let b(t) = -5 + t + 0 + 2 - 2. Let h be b(7). Let o(l) = l3 - l*2 - 3l + 3. Calculate o(h). 1 Let i = -7 + 5. Let q be (-2)/i - 4/(-1). Let p(d) = 33d - d2 - 10d - 10 - 19d + 3. Calculate p(q). -12 Let w = 2 - -3. Let d(v) = 0 - wv + 1 + 6v. Suppose -4k - 17 - 3 = j, 2j = 3k + 15. Calculate d(j). 1 Let k(f) be the third derivative of -f5/60 - f4/6 + 5f3/6 + 3f*2 + 39. Calculate k(-7). -16 Let m be (-56)/336 - (-11)/(-6). Let g(h) = 12h + 1. Determine g(m). -23 Let g(s) = 186s3 + s + 4s*2 + 4 + 0 + 1 - 185s*3. Let i(z) = -5z + 4z2 + 0z*3 - 6z*3 + 2 + 5z*3. Let q be i(3). What is g(q)? 1 Let m(o) = 2o - 5. Let r(u) = 4u - 9. Let t(z) = 5m(z) - 3r(z). Let w = 4 - 1. Give t(w). -4 Let k(i) = i3 + 8i*2 + 4i - 10. Let b = 188 + -195. Calculate k(b). 11 Let c be (((-40)/(-25))/2)/(2/5). Let m(w) = -4w3 + 1. What is m(c)? -31 Let g(b) = b2 - 17b + 66. Let k be g(5). Let d(q) be the third derivative of 0 + 0q + 0q*4 + kq*2 - 2/15q*5 + 1/6q3. What is d(-1)? -7 Let l(a) be the second derivative of -a5/20 - 5a4/12 + a3 + 3a*2 - 3a - 10. Let b be (-2)/(-4) + (-13)/2. Give l(b). 6 Suppose -3w + 57 + 30 = 0. Suppose 23 = -2z + w. Let l(s) = -2 + 2s2 - 4s*2 + 3s*2 - 2s. Give l(z). 1 Let r(n) = 11n2 - 1. Let x be -7 + 5 + 1 + 2. Suppose 0 = 4q + x - 5. Determine r(q). 10 Let m(y) = -y*2 + 3y*3 - 39 + 38 - 2y*2 + 10y - 11y. Calculate m(2). 9 Let f(i) be the third derivative of i6/120 - 29i*5/60 - 5i4/4 - i3/3 + 3i2 + 1. Determine f(30). -2 Let q(n) be the first derivative of 1/3n*3 + 2n*2 + 4 - 1/4n*4 - 2n. Determine q(3). -8 Let a(n) = 5n - 9. Let m = -1 + 7. Let y(v) = 9 - 5 + 6v - 5 - 5v. Let b(c) = my(c) - a(c). Give b(3). 6 Let j(l) = l*2 + 11l - 16. Let q = -98 + 86. Calculate j(q). -4 Let t(f) = -30f3 - 3f + 3. Let c be t(1). Let w = -25 - c. Let a(y) = -y*3 + 5y*2 - y - 3. Give a(w). -8 Suppose k - f + 3 = 0, -k + 4f = -0k + 15. Let q(c) = -2c*3 + 2c*2 - 2c + 1. Calculate q(k). -1 Let z(g) = g3 - g2. Let d(a) = -a*3 + a. Let h(p) = 3d(p) + 4z(p). Give h(4). 12 Let x(q) = -q - 1. Let s(f) = -2f*2 + 25f - 73. Let u be s(7). Determine x(u). -5 Let r = 162 - -4. Suppose -rq = -163q - 18. Let f(g) be the first derivative of -g*2/2 + 4g - 1. Calculate f(q). -2 Let j = 2 + -4. Let b(t) = -3t + 11. Let c(z) = z - 5. Let n(k) = jb(k) - 5c(k). Let w(g) = -3g*2 - 6g + 4. Let p be w(-3). Give n(p). -2 Let j(d) = 6d2 + 7208d*3 - 7209d*3 + 18 + 4d - 2. Determine j(7). -5 Let k(h) = h*3 - 5h*2 - 15h + 4. Suppose -31a = -46a + 105. Determine k(a). -3 Let k(s) = 6262 + 3s2 - 2s*2 - 6264. Determine k(-2). 2 Let o = -958 - -958. Let n(d) = -2d + 30. Determine n(o). 30 Let q(n) = -n*3 - 6n*2 - 13n + 5. Let b(c) = -2c + 1. Let r(k) = 6b(k) - q(k). Calculate r(-6). -5 Let x(s) = -s3 + s2 + s + 6. Suppose -1 + 71 = 5h. Let b be 24/h + (-2)/(-7). Suppose -bm = m. Calculate x(m). 6 Let m be 13/4 - (-2)/(-8). Suppose -c + 4c = 6, mg - 14 = -c. Suppose 0 = 5r - gw + 12 + 15, -3r - 6 = w. Let z(v) = 2v + 2. What is z(r)? -4 Let l(x) = 3x3 + 12x*2 - 17x - 19. Let s(k) = -k3 + k2 + k - 1. Let v(g) = -l(g) - 4s(g). Let z be v(15). Let m(a) = -a2 - 4a + 10. What is m(z)? -11 Suppose 0n + 2n = -66. Let c = -40 - n. Let u(b) = -b*2 - 7b + 6. What is u(c)? 6 Let y(s) = 4 + 2s - 4s + s. Let p(q) = -q*2 + 3. Let k be p(0). Suppose -5 = kd - 20. Calculate y(d). -1 Suppose 0 = -4y - 50 + 2. Let b be y/(-30) - 84/10. Let v = b - -12. Let s(r) = -r2 + 4r - 3. Calculate s(v). -3 Let v = 152 + -148. Let x(l) = -8 + 258l3 + vl*2 + 2l*2 + 4l - 259l3. Calculate x(6). 16 Let o(n) = n2 - 2n + 1. Let m be o(3). Let a(u) = u - 33. Let w(s) = s - 27. Let g(j) = 4a(j) - 5w(j). What is g(m)? -1 Let f(r) be the third derivative of -r*6/120 - 13r*5/60 - 11r*4/24 + 4r3/3 + r2 - 14r. Calculate f(-12). -4 Let g(b) = 8b. Let y(h) = -h*2 - 4h. Let o be y(-3). Let s be (4/12)/(1/6). Suppose sk + o = 1. What is g(k)? -8 Let h(f) be the first derivative of f5/60 + f4/12 - f3/6 - f2/2 - 16. Let m(p) be the second derivative of h(p). Calculate m(-4). 7 Let v(j) = j2 - 4j*2 - 4j2 + j3 - j + 4. Let q be (9 - 2)/(4 + -3). Determine v(q). -3 Let l(g) = -g*2 - 23g - 19. Let u be l(-22). Let t(d) be the first derivative of 0d + 1/2d*2 + u. Give t(1). 1 Suppose 35v + o = 30v - 15, 5v - 3o + 35 = 0. Let i(r) = -r2 - 7r - 8. What is i(v)? 4 Let p(o) be the second derivative of -1/2o3 + 3o*2 + 60o +	{ "pile_set_name": "DM Mathematics" }
{m: 3, q: 4, i: 7, l: 1, f: 3}. What is prob of picking 1 i and 2 m? 7/272 Two letters picked without replacement from {v: 2, b: 5, h: 3, t: 6, i: 2}. What is prob of picking 1 i and 1 v? 4/153 Calculate prob of picking 1 w and 2 q when three letters picked without replacement from {q: 3, w: 12}. 36/455 Three letters picked without replacement from bhbbbbbbhbbbhhbbhh. Give prob of picking 2 b and 1 h. 33/68 Three letters picked without replacement from rrjrrjjjrrrj. What is prob of picking 3 j? 1/22 Three letters picked without replacement from {v: 2, n: 2, k: 4, x: 1}. Give prob of picking 1 k and 2 v. 1/21 Three letters picked without replacement from {x: 7}. Give prob of picking 3 x. 1 What is prob of picking 1 q and 1 j when two letters picked without replacement from {q: 10, k: 2, j: 6}? 20/51 Calculate prob of picking 2 a and 1 u when three letters picked without replacement from aaaaaauuauaaua. 45/91 Calculate prob of picking 1 t and 1 e when two letters picked without replacement from {e: 1, z: 6, t: 4, p: 4}. 4/105 What is prob of picking 1 l and 1 v when two letters picked without replacement from {v: 6, i: 2, l: 5}? 5/13 Three letters picked without replacement from qqhhqhaaqah. What is prob of picking 3 h? 4/165 Two letters picked without replacement from {e: 1, y: 3, l: 4, j: 2, g: 2, k: 2}. Give prob of picking 1 j and 1 g. 4/91 Three letters picked without replacement from dbppppcxpbdpd. What is prob of picking 1 c, 1 p, and 1 b? 6/143 Four letters picked without replacement from kzkkzk. Give prob of picking 2 z and 2 k. 2/5 What is prob of picking 2 r when two letters picked without replacement from oorror? 1/5 What is prob of picking 1 x and 1 f when two letters picked without replacement from xfff? 1/2 What is prob of picking 4 y when four letters picked without replacement from {w: 2, f: 2, y: 5}? 5/126 Four letters picked without replacement from {y: 1, v: 3, d: 5}. Give prob of picking 3 v and 1 d. 5/126 Calculate prob of picking 3 b and 1 u when four letters picked without replacement from {p: 1, c: 7, u: 1, b: 3}. 1/495 Two letters picked without replacement from {s: 1, n: 4, t: 2, u: 3, v: 1}. What is prob of picking 2 n? 6/55 Four letters picked without replacement from {o: 4, j: 12, p: 1, n: 2}. Give prob of picking 1 n, 1 p, 1 j, and 1 o. 8/323 Calculate prob of picking 1 e, 1 f, and 2 u when four letters picked without replacement from {e: 1, f: 1, y: 6, z: 4, a: 1, u: 3}. 3/1820 Calculate prob of picking 2 y and 1 f when three letters picked without replacement from {f: 9, y: 5}. 45/182 What is prob of picking 2 t and 1 h when three letters picked without replacement from ttsh? 1/4 Two letters picked without replacement from nnnhnhh. What is prob of picking 1 h and 1 n? 4/7 Four letters picked without replacement from onnzqquzqouqzznqzo. What is prob of picking 3 n and 1 u? 1/1530 Calculate prob of picking 2 q, 1 c, and 1 p when four letters picked without replacement from {q: 4, u: 3, c: 2, g: 3, a: 1, p: 4}. 12/595 What is prob of picking 1 j and 1 v when two letters picked without replacement from jjiijvjjjjkjvikjkij? 20/171 What is prob of picking 1 r and 2 l when three letters picked without replacement from rllllrrlrll? 28/55 What is prob of picking 1 i and 1 e when two letters picked without replacement from tiiiciitettittt? 2/35 Two letters picked without replacement from {g: 3, w: 1}. Give prob of picking 1 g and 1 w. 1/2 Three letters picked without replacement from urrrztrrrztzurrrrtzt. What is prob of picking 1 r, 1 t, and 1 u? 4/57 Two letters picked without replacement from covewewsc. Give prob of picking 1 s and 1 w. 1/18 Four letters picked without replacement from rrrrsrrfrrffsrr. Give prob of picking 4 f. 0 Two letters picked without replacement from {v: 9, c: 1, p: 4}. Give prob of picking 1 v and 1 c. 9/91 Three letters picked without replacement from {e: 2, n: 1, h: 1, i: 1, g: 1, k: 1}. What is prob of picking 1 h and 2 e? 1/35 Two letters picked without replacement from veeeev. What is prob of picking 1 e and 1 v? 8/15 What is prob of picking 1 d and 1 j when two letters picked without replacement from {w: 2, b: 2, x: 2, k: 1, d: 1, j: 1}? 1/36 Calculate prob of picking 3 w and 1 j when four letters picked without replacement from {w: 3, i: 4, f: 2, j: 1}. 1/210 Three letters picked without replacement from {f: 7, a: 4, s: 2, n: 4, v: 1, b: 2}. Give prob of picking 1 b, 1 v, and 1 s. 1/285 Four letters picked without replacement from cepcccupcmpuup. What is prob of picking 2 p, 1 c, and 1 u? 90/1001 Two letters picked without replacement from {q: 2, v: 2, w: 1}. Give prob of picking 2 q. 1/10 Four letters picked without replacement from jjhqonzz. Give prob of picking 2 j, 1 n, and 1 h. 1/70 Three letters picked without replacement from {h: 1, f: 1, d: 4, a: 3, m: 2, c: 1}. What is prob of picking 1 a, 1 d, and 1 c? 3/55 Four letters picked without replacement from yvkvkkkkkjzzjkjkkkk. Give prob of picking 1 j, 2 v, and 1 k. 11/1292 Calculate prob of picking 1 m and 2 u when three letters picked without replacement from mmummu. 1/5 Three letters picked without replacement from {s: 4, v: 4, k: 1, t: 6}. What is prob of picking 1 t, 1 s, and 1 v? 96/455 What is prob of picking 1 q, 1 h, and 1 y when three letters picked without replacement from epvhqyp? 1/35 What is prob of picking 1 p and 1 a when two letters picked without replacement from {r: 2, p: 1, h: 1, a: 2, q: 2}? 1/14 Calculate prob of picking 1 d and 1 g when two letters picked without replacement from {d: 5, g: 2}. 10/21 Calculate prob of picking 1 m and 1 e when two letters picked without replacement from vvxmmde. 2/21 Three letters picked without replacement from {u: 4}. Give prob of picking 3 u. 1 Two letters picked without replacement from {r: 1, l: 2}. What is prob of picking 1 l and 1 r? 2/3 Three letters picked without replacement from {f: 8, q: 8, y: 1}. What is prob of picking 2 f and 1 y? 7/170 Two letters picked without replacement from {e: 5, n: 2, z: 8, m: 2, i: 1}. Give prob of picking 2 z. 28/153 Calculate prob of picking 2 i and 2 r when four letters picked without replacement from {t: 8, i: 1, r: 2, v: 5, p: 3}. 0 Calculate prob of picking 4 p when four letters picked without replacement from zzzzzpppzzzzzzzzzpz. 1/3876 Calculate prob of picking 1 a and 1 e when two letters picked without replacement from lwlegeeeaeglelegewe. 1/19 What is prob of picking 1 m and 1 i when two letters picked without replacement from {q: 2, m: 4, i: 2}? 2/7 What is prob of picking 1 v and 1 i when two letters picked without replacement from {v: 9, i: 11}? 99/190 Two letters picked without replacement from {v: 2, h: 6, t: 7}. What is prob of picking 2 v? 1/105 What is prob of picking 2 c, 1 d, and 1 b when four letters picked without replacement from bbscttttcdls? 2/495 Four letters picked without replacement from {l: 2, j: 5, i: 2, x: 2, q: 7}. What is prob of picking 1 q, 1 j, and 2 i? 7/612 Four letters picked without replacement from {j: 2, b: 1, l: 3, x: 2, w: 1, s: 3}. What is prob of picking 1 x, 2 l, and 1 s? 2/55 What is prob of picking 2 s when two letters picked without replacement from ifqsuuqsissu? 1/11 Calculate prob of picking 2 d and 2 l when four letters picked without replacement from {d: 3, k: 3, x: 3, l: 6, v: 2}. 9/476 Two letters picked without replacement from oflflzzqr. Give prob of picking 1 q and 1 f. 1/18 Four letters picked without replacement from {v: 17, h: 2}. Give prob of picking 2 v and 2 h. 2/57 Calculate prob of picking 3 q when three letters picked without replacement from quqqqqqqu. 5/12 Four letters picked without replacement from {v: 5, c: 3}. Give prob of picking 1 v and 3 c. 1/14 Calculate prob of picking 2 e when two letters picked without replacement from eeuebtueubu. 6/55 What is prob of picking 1 e, 1 c, and 1 i when three letters picked without replacement from {c: 2, m: 3, e: 6, v: 1, i: 5}? 3/34 Calculate prob of picking 4 x when four letters picked without replacement from {u: 7, x: 9}. 9/130 Calculate prob of picking 1 b, 1 w, and 1 c when three letters picked without replacement from oocobcgbwbgp. 3/110 Three letters picked without replacement from csxcsb. What is prob of picking 1	{ "pile_set_name": "DM Mathematics" }
ppose 4w - 2r = hw + 3540, -w = -4r - 3530. Round w to the nearest 100. 3600 Let a = 20698 - 20629.74. Round a to one decimal place. 68.3 Let g = -79.42 - 0.58. Let u = 83.4 + g. Let x = u + -7.7. Round x to the nearest integer. -4 Let c = -13655912 - -42908555. Let d = -29252642.82599809 + c. Let k = d - 0.174. What is k rounded to 7 decimal places? 0.0000019 Let n(z) = 13330z - 43. Let h(a) = -3333a + 11. Let r(m) = -22h(m) - 6n(m). Let g be r(4). What is g rounded to the nearest 10000? -30000 Suppose -4z = -4c - 8186040, 7c - 2c + 4093032 = 2z. Let v = 22766506 - z. Round v to the nearest 1000000. 21000000 Let d = 16360339913.99998868 + -16360340306. Let v = d + 392. Round v to 7 dps. -0.0000113 Let f = 45.69 + -46. Let b = f - -9.71. Let v = -8.69 + b. Round v to one decimal place. 0.7 Let i(j) = 39702j + 610. Let g be i(45). What is g rounded to the nearest 10000? 1790000 Let r(g) = 501g + 100. Let f(x) = -501x - 102. Let i(l) = -4f(l) - 3r(l). Let y be i(12). Round y to the nearest one thousand. 6000 Let m = -188553 - -188611.9878. Let s = -0.1122 - m. What is s rounded to the nearest integer? -59 Let n = 66.36 + -1.36. Let m = n + -11. Let l = m - 54.00218. Round l to 4 dps. -0.0022 Let b = 69.3 - 2.8. Let y = -33.259 + -0.741. Let j = b + y. Round j to 0 decimal places. 33 Let x = 10604.8084 - 10611. What is x rounded to the nearest integer? -6 Let q = -2603 + 989. Let c = -1105 - q. Let v = -509.0209 + c. What is v rounded to three dps? -0.021 Suppose 15070157 = -168o - 7280563. What is o rounded to the nearest 10000? -130000 Let q = 129 + -142. Let a(u) = -11480u*2 - 2u + 94. Let x be a(q). What is x rounded to the nearest one hundred thousand? -1900000 Let d = -18 + 19. Let i = 40 + d. Let p = i - 40.57. What is p rounded to one decimal place? 0.4 Let f = 551.749 - 1.349. Let z = f - 3014.4. Let p = -2464.01007 - z. Round p to three dps. -0.01 Suppose 3g + 2n = -15, 2g = 3n - 22 - 1. Let k(l) = 6831l + 17. Let a be k(g). Round a to the nearest 10000. -50000 Let f(o) = -44194o*2 + 54o - 1160. Let s be f(15). What is s rounded to the nearest one million? -10000000 Let m = 30527 + -30527.00000028562. What is m rounded to seven dps? -0.0000003 Let m = -40.629 - 1.241. Let n = 63.849 + m. Let k = 22 - n. Round k to one decimal place. 0 Let k = -168 - -167.883. Let r = -83.883 + k. Let v = 83.9774 + r. Round v to three decimal places. -0.023 Let w = 1255.99984048 + -1256. Round w to 5 dps. -0.00016 Let p = -214.44 - -214.30103. What is p rounded to 3 dps? -0.139 Let b = 191.7888 + -193. Let l = b - -0.2382. Round l to 1 dp. -1 Let a = 370 + -247. Suppose -ab - 795800 = -100b. Round b to the nearest 1000. -35000 Let l = -8.047 + 8.04716495. What is l rounded to six dps? 0.000165 Let z = -68.1 + 62. Let d = 27.9 - z. Let k = -34.000008 + d. Round k to 5 dps. -0.00001 Let c = 8770.19 + -8703. Let b = c + 0.51. What is b rounded to the nearest ten? 70 Let a = 40.797 - 30.9255. Let s = 9.9 - a. Let o = 0.02850227 - s. Round o to 7 dps. 0.0000023 Let y = -2532.7 - -2533.01778. What is y rounded to two dps? 0.32 Let t = -14.405 + 0.815. Let j = 14.7 + t. Let n = j - -0.46. Round n to the nearest integer. 2 Let a = 1351.63146 + -4.45446. Let c = a - 1348. What is c rounded to one dp? -0.8 Let n = -1.045 - 0.259. Let m = -0.12 - n. Round m to one decimal place. 1.2 Let d = 190778578387 + -190778579994.00000993. Let r = 1607 + d. What is r rounded to 7 dps? -0.0000099 Let q = 3650.1042 + -3651. Let s = 0.556 + q. Round s to two decimal places. -0.34 Let r = 696 + -1109. Let a = -413.00000423 - r. What is a rounded to 7 decimal places? -0.0000042 Let f = 99 - 92. Let j = f - 82. Let h = j - -89. Round h to the nearest 10. 10 Let k be 43184703/(-13) + (-666)/(-2886). What is k rounded to the nearest one hundred thousand? -3300000 Suppose 7h + 79817 - 47320 = -150210. Round h to the nearest one hundred. -26100 Let d(m) = 1609683m*2 + 20m - 21. Let n be d(-10). Let j = -91068079 + n. What is j rounded to the nearest 1000000? 70000000 Let k = 103 - 106. Let n = -3.04529 - -0.05409. Let z = k - n. What is z rounded to three dps? -0.009 Let x = -45.5 + 568.5. Let r = -522.99558 + x. What is r rounded to 4 decimal places? 0.0044 Let p(a) = 3a + 1. Let j be p(14). Let k = 46 - j. Suppose 2x - kg + 7800015 = 0, 2g - 25 = -3g. What is x rounded to the nearest one million? -4000000 Suppose 4p - 12 = 8p, -4p - 29540 = -l. What is l rounded to the nearest one hundred? 29500 Let n = 12.28419 - 13.3467. Let f = -1.06 - n. What is f rounded to four decimal places? 0.0025 Let b = -160 + 153.85. Let h = 11.087 + 0.773. Let x = h + b. What is x rounded to the nearest integer? 6 Let c = 15 + -17. Let q = 26 + c. Let w = q + -24.0000182. What is w rounded to six dps? -0.000018 Let b = -0.45 - -0.75. Let k = -40.3 + b. Let v = 40.78 + k. What is v rounded to one dp? 0.8 Let d = -48.925 + -0.075. Let r = -48.83365 + -0.14235. Let c = d - r. Round c to two dps. -0.02 Let k = -153 - 43. Let y = -196.0000035 - k. What is y rounded to seven dps? -0.0000035 Let x(h) = 32h + 12 - 53h - 13h - 44h. Let c be x(-7). Suppose -4q = 2j - j - c, -5q - 3j = -701. Round q to the nearest 100. 100 Suppose o - 3943878 = n, 4o + 5n = 11639981 + 4135522. Suppose -41c - o = -475277. Round c to the nearest ten thousand. -80000 Let n = 0.06299 - 0.0629908. Round n to four dps. 0 Suppose a - 2p = 228292, 2a + 3p + p = 456608. Let m = a - 1383298. Round m to the nearest one hundred thousand. -1200000 Let l(i) = 12i + 31. Let h be l(-8). Let t = h - -1070. Let b = t - 4105. Round b to the nearest 1000. -3000 Let x = 1.94 - -0.46. Let q = x + -2.85. Let b = -0.362 - q. What is b rounded to two dps? 0.09 Let d(t) = 3t - 14. Let y be d(6). Suppose -3m - 20577336 = -2q, -q - 30866026 = -yq - m. Let z = 2988674 - q. Round z to the nearest 1000000. -7000000 Suppose 919880449 = -34i + 6266449. Round i to the nearest one hundred thousand. -26900000 Let i = -399.399968059 - -399.4. Round i to seven dps. 0.0000319 Let g = -36 - -38.4. Let b = -12.4 + g. Let s = b - -10.65. What is s rounded to one decimal place? 0.7 Suppose -p = -5x - 220012, -3x = 5p - p - 880002. Suppose 3o + 550006 = -5u, -14u - p = -12u + o. Round u to the nearest 1000000. 0 Let y be (10/(-8))/(1/(-12)). Let v = -23 + y. Let w(n) = 70n*2 - 3n - 4. Let o be w(v). What is o rounded to the nearest 100? 4500 Let i = -12219 - -12224.7878. What is i rounded to 0 dps? 6 Let o = 1334.907 - 1340.7. What is o rounded to the nearest integer? -6 Suppose -2o + 2x = -20, -13 = 3o - 4x - 46. Suppose -11 - o = -6u. Suppose z = -um - z - 1172998, -1 = -z. Round m to the nearest 100000. -400000 Let h = 502 + -502.0438. Let t = 2.3 - 2.355. Let q = t - h. What is q rounded to 3 decimal places? -0.011 Let d = -106 - -100.5. Let a = d - -6.56. Round a to one decimal place. 1.1 Suppose -9n - 12861 = -8238160 + 60501799. What is n rounded to the nearest 100000? -5800000 Suppose -2t - 8 + 0 = -4z, 2t + 4z = 16. Suppose 0 = -5l - 20, tc + l = -c + 203. Suppose cr + 7600 = 71r. Round r to the nearest one thousand. 4000 Let j = -16 + 733. Let y = j - 717.0000378. Round y to 5 dps. -0.00004 Let o = 366126 - 78184. Suppose -97942 + o = -5l. Round l to the nearest ten thousand. -40000 Let t = 11.899507 + -11.9. Round t to three dps. 0 Let n = -12111 + 12110.94863. What is n rounded to 3 dps? -0.051 Let h = 12140 - 5613. Let r = 9177 - h. What is r rounded to the nearest one hundred? 2700 Let t = -19057 + 19057.0060452. Round t to 3 decimal places. 0.006 Let s = 2150.7424 + -2151. Round s to 1 dp. -0.3 Let z = -3.83 + 2.1. Let r = -0.29 - z. Let b = r + -13.64. What is b rounded to zero dps? -12 Let s(h) = 146161h + 93. Let g = -164 - -151. Let u be s(g). Round u to the nearest 1000000. -2000000 Let f = 1.3159 - 0.1159. Let v = -1333 + 1334.203. Let j = v - f. Round j to 2 dps. 0 Suppose 0 = 12a - 27a + 8625. Let c = 831 - a. What is c rounded to the nearest ten? 260 Suppose -14n + 11n - 38112 = 0. Let a = n + 8460. Let l = a - -6584. Round l to the nearest one thousand. 2000 Let w(k) = -2k + 59 - 24 - k - k. Let v be w(8). Suppose u - vi = 342, 2i + 3 = -5. Round u	{ "pile_set_name": "DM Mathematics" }
113, 104? -4a2 + 43a - 1 What is the m'th term of 12, 34, 52, 60, 52, 22, -36, -128? -m*3 + 4m*2 + 17m - 8 What is the x'th term of -41, -7, 77, 235, 491, 869, 1393, 2087? 4x3 + x2 + 3x - 49 What is the b'th term of 62, 144, 224, 302, 378, 452? -b*2 + 85b - 22 What is the s'th term of -5, 14, 47, 100, 179, 290, 439, 632? s3 + s2 + 9s - 16 What is the u'th term of -18598, -37197, -55796, -74395, -92994, -111593? -18599u + 1 What is the w'th term of -50, -218, -498, -890, -1394, -2010, -2738? -56w2 + 6 What is the x'th term of -32, -31, -22, 1, 44? x3 - 2x*2 - 31 What is the m'th term of -8, -60, -146, -266, -420, -608, -830? -17m*2 - m + 10 What is the j'th term of 836, 831, 822, 809, 792? -2j2 + j + 837 What is the m'th term of -480, -479, -478, -477, -476, -475? m - 481 What is the d'th term of 8539, 8547, 8543, 8521, 8475, 8399? -d3 + 15d + 8525 What is the z'th term of -65, -99, -133? -34z - 31 What is the o'th term of 61, 93, 131, 175, 225? 3o2 + 23o + 35 What is the i'th term of -38, -70, -80, -56, 14, 142, 340? 2i3 - i2 - 43i + 4 What is the v'th term of -116, -165, -232, -317, -420? -9v2 - 22v - 85 What is the n'th term of -3441, -3451, -3473, -3513, -3577, -3671? -n*3 - 3n - 3437 What is the h'th term of -350, -316, -282, -248? 34h - 384 What is the r'th term of -518, -516, -514? 2r - 520 What is the o'th term of -17, -8, 1, 10? 9o - 26 What is the g'th term of 771, 1544, 2317? 773g - 2 What is the s'th term of 17, 84, 247, 554, 1053, 1792, 2819, 4182? 8s3 + 11s - 2 What is the u'th term of -122, -250, -388, -542, -718, -922, -1160, -1438? -u3 + u2 - 124u + 2 What is the s'th term of -1133, -1133, -1135, -1139, -1145, -1153? -s2 + 3s - 1135 What is the g'th term of 38, 69, 96, 119? -2g2 + 37g + 3 What is the l'th term of 28, 36, 44, 52? 8l + 20 What is the g'th term of -371, -1417, -3159, -5597, -8731, -12561, -17087? -348g*2 - 2g - 21 What is the t'th term of -226, -251, -276, -301, -326, -351? -25t - 201 What is the g'th term of -4195, -8397, -12597, -16795, -20991, -25185? g2 - 4205g + 9 What is the w'th term of -3111, -3113, -3117, -3123, -3131, -3141? -w*2 + w - 3111 What is the o'th term of -175, -330, -459, -550, -591, -570, -475? 2o3 + o2 - 172o - 6 What is the d'th term of 223, 897, 2021, 3595, 5619, 8093, 11017? 225d*2 - d - 1 What is the w'th term of 603, 2423, 5457, 9705, 15167, 21843? 607w2 - w - 3 What is the s'th term of 58, 38, 0, -62, -154, -282? -s3 - 3s2 - 4s + 66 What is the z'th term of 40, 80, 120, 160, 200, 240? 40z What is the g'th term of -20, -26, -60, -134, -260, -450? -2g*3 - 2g*2 + 14g - 30 What is the j'th term of 13332, 26662, 39992, 53322? 13330j + 2 What is the u'th term of -1, -12, -23, -34, -45, -56? -11u + 10 What is the n'th term of 1715, 1716, 1717, 1718? n + 1714 What is the q'th term of 1520, 1517, 1514? -3q + 1523 What is the c'th term of -365, -366, -367? -c - 364 What is the m'th term of 11, 48, 87, 128, 171? m2 + 34m - 24 What is the v'th term of -46, -177, -396, -703, -1098, -1581? -44v2 + v - 3 What is the j'th term of -30, -25, -20, -15, -10? 5j - 35 What is the u'th term of 618, 624, 630, 636, 642? 6u + 612 What is the x'th term of -126, -260, -398, -540, -686, -836, -990? -2x*2 - 128x + 4 What is the k'th term of -2696, -2693, -2690, -2687, -2684, -2681? 3k - 2699 What is the c'th term of 273, 291, 321, 363, 417, 483, 561? 6c2 + 267 What is the p'th term of -249, -253, -267, -297, -349, -429, -543, -697? -p3 + p*2 - 249 What is the q'th term of -963, -961, -959, -957, -955, -953? 2q - 965 What is the r'th term of 843, 845, 845, 843, 839, 833, 825? -r*2 + 5r + 839 What is the u'th term of -1, 0, 23, 80, 183, 344? 2u3 - u2 - 10u + 8 What is the g'th term of 1959, 1956, 1951, 1944, 1935? -g2 + 1960 What is the w'th term of -764, -1512, -2262, -3014, -3768? -w2 - 745w - 18 What is the v'th term of 21, -68, -311, -786, -1571? -13v3 + v2 - v + 34 What is the r'th term of -72, -75, -92, -129, -192, -287, -420? -r3 - r2 + 7r - 77 What is the w'th term of -51, -53, -51, -45? 2w*2 - 8w - 45 What is the h'th term of 176, 761, 1736, 3101, 4856? 195h2 - 19 What is the t'th term of 33, 65, 107, 165, 245, 353, 495, 677? t3 - t2 + 28t + 5 What is the a'th term of 13, 31, 57, 91, 133, 183, 241? 4a2 + 6a + 3 What is the w'th term of 13, 126, 421, 988, 1917, 3298? 15w3 + w2 + 5w - 8 What is the x'th term of 3392, 13558, 30500, 54218, 84712, 121982, 166028? 3388x2 + 2x + 2 What is the h'th term of -53, -100, -229, -482, -901, -1528, -2405? -7h3 + h2 - h - 46 What is the a'th term of -355, -357, -355, -349? 2a*2 - 8a - 349 What is the w'th term of -31, -90, -189, -328, -507, -726? -20w2 + w - 12 What is the i'th term of 59, 199, 431, 755, 1171? 46i*2 + 2i + 11 What is the f'th term of 30, 28, 26, 24, 22, 20? -2f + 32 What is the p'th term of -17, -104, -191, -278, -365? -87p + 70 What is the l'th term of 0, -1, -2, -3? -l + 1 What is the h'th term of -11, -86, -209, -374, -575, -806, -1061, -1334? h*3 - 30h*2 + 8h + 10 What is the p'th term of 10, 25, 66, 145, 274, 465? 2p3 + p2 - 2p + 9 What is the d'th term of -4744, -4738, -4732, -4726, -4720, -4714? 6d - 4750 What is the p'th term of 101, 99, 97, 95? -2p + 103 What is the j'th term of 84, 149, 228, 327, 452, 609? j3 + j2 + 55j + 27 What is the n'th term of 1030, 1031, 1032, 1033, 1034, 1035? n + 1029 What is the g'th term of 9, 21, 33, 45, 57? 12g - 3 What is the j'th term of -469, -948, -1427, -1906, -2385, -2864? -479j + 10 What is the j'th term of -14, -30, -46, -62, -78, -94? -16j + 2 What is the y'th term of 34, 71, 138, 241, 386? y*3 + 9y*2 + 3y + 21 What is the i'th term of -285, -414, -541, -666, -789? i*2 - 132i - 154 What is the l'th term of 50, 69, 92, 119, 150, 185, 224? 2l2 + 13l + 35 What is the f'th term of -55, -100, -147, -196? -f*2 - 42f - 12 What is the w'th term of -969, -938, -907? 31w - 1000 What is the x'th term of -90, -290, -614, -1056, -1610, -2270? x3 - 68x*2 - 3x - 20 What is the k'th term of -32, -55, -116, -233, -424, -707, -1100? -3k3 - k2 + k - 29 What is the g'th term of 6, 4, 4, 6, 10, 16? g2 - 5g + 10 What is the j'th term of -242, -240, -236, -230, -222, -212? j*2 - j - 242 What is the r'th term of 119, 120, 121, 122, 123? r + 118 What is the w'th term of -143, -187, -259, -371, -535, -763? -2w*3 - 2w*2 - 24w - 115 What is the v'th term of -1736, -1730, -1712, -1676, -1616? v3 - v - 1736 What is the k'th term of -4, -6, -6, 2, 24, 66, 134? k3 - 5k2 + 6k - 6 What is the f'th term of 69, 94, 135, 192, 265? 8f2 + f + 60 What is the g'th term of 174, 219, 264, 309, 354, 399? 45g + 129 What is the a'th term of 70, 72, 72, 70, 66? -a*2 + 5a + 66 What is the s'th term of 137, 540, 1211, 2150, 3357, 4832, 6575? 134s2 + s + 2 What is the a'th term of 15, 46, 129, 288, 547, 930, 1461, 2164? 4a*3 + 2a*2 - 3a + 12 What is the y'th term of -11, -17, -25, -35, -47? -y*2 - 3y - 7 What is the p'th term of -72, -659, -2246, -5331, -10412, -17987, -28554? -83p3 - 2p*2 + 13 What is the b'th term of -173, -352, -531, -710? -179b + 6 What is the d'th term of 2975, 5954, 8935, 11918, 14903? d*2 + 2976d - 2 What is the h'th term of -11805, -23606, -35407, -47208? -11801h - 4 What is the p'th term of 130, 39, -52, -143, -234? -91p + 221 What is the l'th term of 52, 53, 54, 55, 56, 57? l + 51 What is the u'th term of -317, -309, -297, -281, -261, -237, -209? 2u2 + 2u - 321 What is the a'th term of 347, 341, 339, 341? 2a2 - 12a + 357 What is the d'th term of 214, 216, 218, 220, 222, 224? 2d + 212 What is the f'th term of 299, 588, 865, 1124, 1359, 1564, 1733, 1860? -f3 + 296f + 4 What is the r'th term of -27, -70, -127, -192, -259, -322, -375? r*3 - 13r*2 - 11r - 4 What is the s'th term of 88, 175, 258, 337, 412, 483, 550? -2s2 + 93s - 3 What is the a'th term of 3651, 3650, 3649, 3648, 3647? -a + 3652 What is the o'th term of -271, -270, -269, -268, -267, -266? o - 272 What is the t'th term of -10, -29, -82, -187, -362? -3t3 + t*2 - t - 7 What	{ "pile_set_name": "DM Mathematics" }
mmon factor of 645 and 183180? 645 What is the greatest common factor of 153 and 38913? 51 Calculate the greatest common divisor of 3185 and 21. 7 Calculate the greatest common factor of 2442 and 11275. 11 Calculate the highest common factor of 24 and 23448. 24 What is the highest common factor of 1066 and 15293? 41 Calculate the greatest common divisor of 1642129 and 1043. 149 Calculate the highest common factor of 6747 and 897. 39 What is the greatest common factor of 83851 and 923? 71 What is the greatest common factor of 119 and 39763? 17 What is the highest common divisor of 566892 and 540? 108 What is the greatest common divisor of 938 and 5026? 14 Calculate the highest common divisor of 41 and 81713. 41 What is the highest common divisor of 286 and 8229507? 143 Calculate the highest common divisor of 4040437 and 74. 37 What is the greatest common factor of 26 and 31668? 26 Calculate the greatest common divisor of 1140187 and 73. 73 Calculate the highest common divisor of 75 and 137325. 75 Calculate the highest common divisor of 18 and 45654. 6 Calculate the greatest common factor of 3133 and 30607. 241 What is the greatest common factor of 3680999 and 203? 203 What is the greatest common factor of 129 and 290981? 43 Calculate the highest common divisor of 144 and 8028. 36 What is the greatest common factor of 64 and 1293296? 16 Calculate the greatest common divisor of 37 and 389. 1 Calculate the greatest common factor of 82 and 11398. 82 What is the highest common factor of 450 and 36030? 30 Calculate the highest common divisor of 24 and 572424. 24 What is the highest common divisor of 117594 and 1112? 278 Calculate the greatest common factor of 15072 and 22080. 96 What is the greatest common divisor of 44 and 881254? 22 What is the highest common factor of 152 and 631256? 152 What is the greatest common factor of 5971 and 19614? 7 Calculate the highest common factor of 379960 and 2944. 184 What is the greatest common factor of 9 and 1764594? 9 What is the greatest common factor of 125020 and 30? 10 What is the greatest common factor of 100 and 44220? 20 Calculate the greatest common factor of 315 and 133. 7 What is the greatest common divisor of 20859 and 255? 51 What is the highest common divisor of 39 and 2327013? 39 What is the highest common divisor of 15744055 and 185? 185 What is the highest common divisor of 72800 and 160? 160 Calculate the greatest common divisor of 15 and 71292. 3 What is the highest common factor of 1336 and 2199056? 1336 What is the highest common factor of 189044 and 20659? 283 What is the greatest common divisor of 7038 and 6762? 138 What is the highest common factor of 404280 and 3240? 360 Calculate the highest common divisor of 1208792 and 472. 472 What is the highest common factor of 14286 and 81? 3 Calculate the highest common factor of 2535 and 120. 15 What is the greatest common divisor of 14 and 259? 7 What is the highest common factor of 328 and 178637? 41 Calculate the greatest common divisor of 18853 and 51. 17 What is the highest common factor of 286853 and 49? 7 What is the greatest common divisor of 5409 and 4207? 601 What is the greatest common divisor of 675 and 31275? 225 Calculate the greatest common divisor of 1567874 and 308. 154 Calculate the highest common factor of 19 and 43453. 19 What is the greatest common factor of 568763 and 52? 13 Calculate the highest common divisor of 2320 and 3364. 116 What is the highest common factor of 7424 and 7192? 232 What is the highest common divisor of 2033323 and 21527? 1957 What is the highest common factor of 5417188 and 217? 217 What is the greatest common divisor of 124545 and 360? 15 What is the greatest common divisor of 435479 and 122? 61 What is the greatest common factor of 66250 and 10? 10 Calculate the highest common divisor of 33754 and 1834. 14 Calculate the highest common factor of 260 and 39455. 65 What is the highest common factor of 502815 and 15? 15 Calculate the highest common factor of 143320 and 60. 20 What is the greatest common divisor of 210 and 259203? 21 What is the greatest common factor of 12650 and 116150? 1150 Calculate the greatest common divisor of 1314 and 334413. 657 Calculate the greatest common factor of 23400 and 18. 18 What is the highest common divisor of 11457 and 46113? 57 What is the greatest common factor of 1037 and 1029741? 1037 Calculate the highest common divisor of 48 and 391136. 16 Calculate the highest common factor of 14 and 11494. 14 What is the greatest common factor of 188 and 86856? 188 Calculate the greatest common factor of 3841 and 4342. 167 What is the highest common divisor of 29664 and 36? 36 What is the greatest common factor of 305081 and 2870? 287 Calculate the highest common divisor of 5194424 and 848. 424 What is the highest common divisor of 3663 and 48312? 99 Calculate the highest common factor of 688 and 3116. 4 What is the greatest common factor of 35695 and 472? 59 Calculate the highest common divisor of 161 and 714. 7 What is the greatest common divisor of 32 and 2045864? 8 What is the greatest common divisor of 7854 and 1089? 33 Calculate the highest common factor of 3240 and 2741850. 810 Calculate the highest common factor of 1290 and 50430. 30 Calculate the greatest common factor of 8840 and 355640. 680 Calculate the highest common divisor of 60 and 84480. 60 What is the greatest common factor of 264 and 41481? 33 Calculate the greatest common divisor of 202961 and 44. 11 Calculate the greatest common factor of 2612 and 341519. 653 What is the greatest common factor of 304740 and 1500? 60 Calculate the highest common factor of 55616 and 968. 88 Calculate the greatest common factor of 3116418 and 228. 114 Calculate the greatest common factor of 3015568 and 16. 16 Calculate the greatest common factor of 144 and 732. 12 What is the highest common factor of 37 and 1174787? 37 What is the greatest common factor of 20 and 161380? 20 What is the greatest common divisor of 1953624 and 120? 24 What is the greatest common factor of 571711 and 46? 23 What is the greatest common factor of 19038 and 24549? 501 What is the greatest common factor of 325 and 223775? 25 What is the highest common factor of 215220 and 255? 255 What is the greatest common divisor of 33615575 and 2135? 2135 What is the highest common divisor of 1057 and 7? 7 Calculate the greatest common divisor of 2448 and 32436. 612 What is the highest common divisor of 85 and 858415? 85 What is the highest common divisor of 9315302 and 1492? 746 What is the greatest common factor of 1386 and 3102? 66 Calculate the greatest common divisor of 814065 and 840. 105 Calculate the greatest common divisor of 34338 and 5664. 354 What is the greatest common divisor of 270 and 825210? 90 What is the highest common factor of 732569 and 29? 29 Calculate the highest common divisor of 5891921 and 581. 581 What is the highest common factor of 35812 and 35? 7 What is the greatest common divisor of 261 and 128412? 261 What is the greatest common divisor of 480 and 68385? 15 What is the greatest common divisor of 26 and 56537? 13 What is the greatest common factor of 210 and 965? 5 What is the highest common divisor of 40 and 260? 20 What is the highest common divisor of 7710 and 2190? 30 Calculate the highest common factor of 179277 and 378. 21 Calculate the greatest common factor of 1740 and 118. 2 Calculate the greatest common divisor of 12084 and 24. 12 What is the greatest common divisor of 656 and 71873? 41 What is the greatest common factor of 157380 and 71980? 1220 Calculate the greatest common divisor of 11461 and 1679. 73 What is the greatest common divisor of 2383 and 12? 1 Calculate the highest common factor of 39303 and 10791. 99 Calculate the highest common factor of 19364 and 50948. 188 What is the greatest common divisor of 11284 and 5148? 52 Calculate the highest common factor of 3280 and 79216. 16 Calculate the greatest common divisor of 5004 and 1494. 18 What is the greatest common divisor of 72 and 600144? 24 Calculate the highest common factor of 4316 and 247. 13 What is the greatest common divisor of 3400 and 9320? 40 Calculate the greatest common factor of 571 and 12920017. 571 Calculate the greatest common factor of	{ "pile_set_name": "DM Mathematics" }
at is 2471 minus 0.5? 2470.5 Work out 5 - 51165. -51160 Calculate -1.809104 - 0.5. -2.309104 Add 1604 and 3.07. 1607.07 Work out -2265 + -9.9. -2274.9 -235 + -22 -257 Work out -19355.5 - -2. -19353.5 What is 2384 less than 0.4? -2383.6 Total of -46 and 692. 646 Calculate -3746 + 0.2. -3745.8 Put together 4 and 1195. 1199 What is -4.4 less than 38.4? 42.8 -0.240132 - -26 25.759868 Add -58539 and -2. -58541 Add together 38419.65 and -0.3. 38419.35 Put together 94 and -22. 72 Calculate -78 + -10182. -10260 Work out 39125 + -0.06. 39124.94 61+-61 0 Work out 0.0047 - -0.3. 0.3047 533+-0.047 532.953 What is -0.176347 minus -12? 11.823653 What is 0.1672301 minus -0.5? 0.6672301 Add 319 and 0.692. 319.692 What is -0.04 - -11.14255? 11.10255 Calculate 106 - -1.18. 107.18 Sum 125266 and -11. 125255 -92.469 - 0.3 -92.769 Sum -144674 and -1. -144675 What is the distance between 184.2 and 7.63? 176.57 Calculate -1845.98 - 0.7. -1846.68 Calculate 0.5 + 25077. 25077.5 Total of -174 and 1. -173 What is -219540 plus -0.3? -219540.3 2 - -1319597 1319599 Work out 0.1 - -0.0113. 0.1113 What is the difference between 47 and 3? 44 Subtract -568805 from 6. 568811 Sum -0.3 and 4. 3.7 Subtract 0.07 from -1.01253. -1.08253 What is the distance between -0.9 and 124182? 124182.9 -3 + -0.0915 -3.0915 Add together 1 and -248273. -248272 What is 143.333 + 0.4? 143.733 What is the difference between -519.9 and -0.9? 519 -14 - 2221.6 -2235.6 What is 3555232 - 2? 3555230 Sum -0.2 and -413.516. -413.716 8194.73 - -0.2 8194.93 Calculate 3.54 - -0.06. 3.6 Work out -7788 + 5. -7783 What is 2.7 - -18693? 18695.7 What is the distance between -589026 and -0.4? 589025.6 What is -0.04 - 52? -52.04 What is -4 - -1531? 1527 What is the distance between 54729 and -2? 54731 Subtract 7 from -10025. -10032 Work out -87 - 0.51. -87.51 What is -4711 less than -0.21? 4710.79 What is -1 plus 1240255? 1240254 Work out 2613363 - -1. 2613364 What is -0.196 take away -2.6? 2.404 Calculate 15.0001 - -0.5. 15.5001 -0.11 - 1652.2 -1652.31 Add -5 and 510. 505 Add together -1 and 1297653. 1297652 Calculate 1343.1 + 0.3. 1343.4 What is -625974 minus -13? -625961 What is the distance between 19522 and 0.4? 19521.6 0.2518+-2 -1.7482 Work out -0.00178584 - -1. 0.99821416 What is -7.241 + -1? -8.241 -2.2 + -0.0264 -2.2264 Add together -0.016 and 1.42. 1.404 What is -5 less than -19.63? -14.63 What is the distance between 79 and -0.05? 79.05 Calculate 1.05314 + -0.03. 1.02314 -41.001 - 5 -46.001 Work out 3226.3 + 1. 3227.3 Add together -2 and 4.4989. 2.4989 1 - 5.13 -4.13 -1.2882+5 3.7118 What is the difference between 0.14 and -0.002791? 0.142791 What is -1 + 3371238? 3371237 What is -3.2 minus -610? 606.8 What is 6.226 plus -6? 0.226 What is the difference between 2 and 27967? 27965 What is -5762.4 - -3? -5759.4 What is the difference between -1.9713 and -0.84? 1.1313 6+-637 -631 Subtract 13.6 from 0.0473. -13.5527 What is 0.04255 minus -37? 37.04255 17 + 1707 1724 Add -1180 and -7.42. -1187.42 Calculate 405 - 2. 403 Sum 5595 and -567. 5028 46001.8+-4 45997.8 What is 9.869 plus -0.089? 9.78 What is -187162 + 4? -187158 Subtract -57 from -140. -83 Add together 73 and -824. -751 What is the difference between -5 and 3195? 3200 What is -0.5222 - 347? -347.5222 121009 - -1 121010 What is -0.4 less than -88500? -88499.6 -2056.9+0.136 -2056.764 What is 1 plus 49.8? 50.8 Subtract 272 from 1.5. -270.5 -292.18 - 0.3 -292.48 What is the difference between -201122 and -0.2? 201121.8 What is -14.1 - 0.019? -14.119 -0.048341+4 3.951659 Calculate -0.946683 - 0.2. -1.146683 Calculate 0.1 - 2.63. -2.53 What is -64000 + -0.02? -64000.02 What is -210.6 take away 4? -214.6 What is 2.4 - -174? 176.4 -3805+-9 -3814 -3 - 25.339 -28.339 Add together 35929 and 0.87. 35929.87 Sum 0.5 and -38.3365. -37.8365 Work out 0.2 + 378. 378.2 What is -13008.3 less than 0.16? 13008.46 What is -0.5 minus 5689.22? -5689.72 Total of 274.4 and -0.0636. 274.3364 Calculate 3 + -3963. -3960 Calculate 0.02 + 8.9. 8.92 2.3+-1664 -1661.7 What is -11210 take away -8? -11202 Sum -5603 and 0.1. -5602.9 -0.5+-0.109 -0.609 Work out -9 + -3.08658. -12.08658 What is the difference between -0.067 and 29? 29.067 0.22 + -0.23756 -0.01756 What is the difference between -239540 and 0.3? 239540.3 What is the difference between 10710 and 225? 10485 What is 23.79 take away 192? -168.21 What is -0.0688 less than 4? 4.0688 What is the difference between -0.4 and -166? 165.6 Total of -0.0539 and -90. -90.0539 Total of 0.45 and -25237. -25236.55 What is the distance between -4 and 4.476? 8.476 Subtract 610.2 from 8. -602.2 Work out -0.2 - -3.68. 3.48 Calculate 14 - 47159. -47145 Work out -968 + 47. -921 Total of -0.4 and 94.7533. 94.3533 -3394+0.5 -3393.5 Add 317 and -1483. -1166 What is -4 plus 454? 450 Subtract 0.3925 from -0.3. -0.6925 66413 + 16 66429 Work out 3 - -0.03174. 3.03174 Put together -0.5 and -1784.917. -1785.417 What is -24 less than 0.0064? 24.0064 What is -0.05 + -14662.7? -14662.75 Total of 6994 and 91. 7085 Add together 8366 and -0.4. 8365.6 Calculate -1.50679 + -14. -15.50679 Subtract 116 from 0. -116 What is the difference between 3 and -0.025223? 3.025223 -3041+27.4 -3013.6 What is -54 take away -670.7? 616.7 0.051 + -18 -17.949 Calculate -0.9 - 166. -166.9 What is 60 + 0.4185? 60.4185 -0.5 + -1366 -1366.5 -0.098411 - -15.2 15.101589 Work out -17 + 0.07. -16.93 Sum -0.3 and -886. -886.3 Subtract 544 from -0.09. -544.09 -24004.5 + 4 -24000.5 Calculate -16.373 + 0.1. -16.273 Add together 0.03 and 4369. 4369.03 What is -0.05 minus 2? -2.05 What is the distance between -12 and -169881? 169869 Work out 46 - 597. -551 What is -297 - 2224? -2521 What is -0.5 + 1098028? 1098027.5 Sum -0.022918 and -0.4. -0.422918 What is the distance between 218.4 and 16? 202.4 What is 0.3 minus 0.107208? 0.192792 Calculate -0.182004 - -0.3. 0.117996 What is -106 take away -7? -99 What is 3738 minus -36? 3774 Subtract -159 from 3712. 3871 Calculate -913.28 - -6. -907.28 Subtract -0.1 from -20549. -20548.9 Total of 40.97 and -3. 37.97 What is -0.1323 take away 17.5? -17.6323 -12 - -2.8317 -9.1683 What is -5 - 97185? -97190 What is 24 plus 341? 365 What is 22 less than 0.40374? -21.59626 Add together 628 and -0.213. 627.787 Sum -45422 and 3. -45419 What is -232.55 less than 6? 238.55 Calculate 0.279 + 18. 18.279 Calculate 688136 + 5. 688141 Subtract -364 from -0.5. 363.5 What is 8.91 minus -0.0569? 8.9669 What is -0.0221 minus 165? -165.0221 What is 173 take away -55? 228 What is -0.9 + 0.0449? -0.8551 39 + 0.019 39.019 Put together 0.285 and -0.9. -0.615 What is the difference between 1221.061 and -0.1? 1221.161 Sum -930 and 15. -915 Subtract -5 from -460937. -460932 What is the distance between -52.21 and -0.6? 51.61 What is 0.3 less than -18.48? -18.78 Add together 41757 and -2.5. 41754.5 Work out -667681 + -0.2. -667681.2 Work out -0.044827 + 0. -0.044827 What is the difference between 0.0142 and 0.2? 0.1858 What is -5 minus -0.045838? -4.954162 What is -0.041 less than -26.2? -26.159 Work out -0.04 - 0.0063. -0.0463 Add together -0.13 and -26.786. -26.916 5 + -49668 -49663 -0.5 + 13.012 12.512 What is -0.13697 - 13? -13.13697 What is 5520 minus -0.74? 5520.74 Put together -7032 and 0. -7032 Add together -376950 and -0.7. -376950.7 Subtract 21.64 from -0.0436. -21.6836 What is -3 - -11.118? 8.118 Subtract -342 from -5. 337 Calculate -0.125 - -1.57. 1.445 Work out -0.0507 - -1669. 1668.9493 1128+6.79 1134.79 What is the difference between 0.029 and 35? 34.971 Calculate 0.1 + -2481.09. -2480.99 -195 - -11886 11691 Work out 2798 + -0.1654. 2797.8346 What is 0 plus -275? -275 What is -1006.4 minus -0.3? -1006.1 What is the difference between 0.852 and -2280? 2280.852 What is the distance between 4.7533 and 3? 1.7533 Subtract -0.4 from -45588. -45587.6 Work out -0.08 - -2515.6. 2515.52 What is 2 minus -0.326? 2.326 What is 0.38 less than -0.021264? -0.401264 What is -3927 take away 91? -4018 Work out -0.2 + -337. -337.2 0.5+-4815 -4814.5 What is 0.015 minus 128? -127.985 What is the distance between -0.182 and 3? 3.182 What is 5 take away 36996? -36991 What is 83.21 take away -723? 806.21 Calculate -0.97 + 0.28. -0.69 2.04 - 13 -10.96 Add together -38827 and 4. -38823 What	{ "pile_set_name": "DM Mathematics" }
1). What is the greatest common factor of w and 3? 3 Let s = 76 - -9. What is the greatest common divisor of s and 17? 17 Let z(r) = -r*3 - 8r*2 - 19r - 8. Let h be z(-6). Calculate the greatest common factor of 85 and h. 17 Suppose 0 = -4j + 253 - 53. What is the greatest common divisor of 20 and j? 10 Let o(v) = 2v + 3. Let q be o(-3). Let r = q - -3. Suppose -5j = -rj - 100. What is the greatest common factor of 5 and j? 5 Let o = -57 - -66. Calculate the greatest common factor of o and 144. 9 Let y be 1569/15 - 4/(-10). What is the greatest common factor of 35 and y? 35 Let w be 1(62 + 4) - -4. What is the greatest common factor of w and 14? 14 Suppose -5y = -2y - 5l - 21, -5l = 2y - 39. What is the greatest common factor of y and 6? 6 Let v be (83 - 2) + 4. Calculate the greatest common factor of 65 and v. 13 Let r = -31 - -41. Calculate the greatest common divisor of r and 25. 5 Suppose -3c = 4v - 60, -c - v + 60 = 2c. Let a(n) = -4n + 2. Let f be a(-7). Calculate the greatest common factor of c and f. 10 Suppose 4r - 201 = 3y, -141 = -3r + 2y + 10. Calculate the greatest common divisor of r and 17. 17 Let g = 3 + 1. Let y = 67 + -35. Calculate the highest common factor of g and y. 4 Let w be 613/5 + (-2)/(-5). Calculate the greatest common factor of 82 and w. 41 Let d(k) = -k2 + 8k + 8. Let l = 7 + 1. Let y be d(l). What is the greatest common factor of y and 20? 4 Let a = 10 - 5. Let h(t) = 2t2 - 5t + 5. Let n be h(a). Calculate the greatest common factor of 3 and n. 3 Suppose -18 = -5m + 3g, -3m + 2 + 4 = 3g. Suppose -3z - 5 = -3x - 17, mz = -3. Let u = 0 - x. Calculate the highest common divisor of u and 20. 5 Let j be (-107)/(-4) - (-4)/16. Suppose -q + 2q = j. Calculate the highest common factor of 18 and q. 9 Let w(x) be the first derivative of 3x2/2 + 4x + 2. Let m be w(3). What is the highest common divisor of m and 39? 13 Suppose -9o + 5o = -8. Suppose 2d - 3f - of = 266, 0 = 5d - 4f - 648. Calculate the highest common factor of 16 and d. 16 Let n be 910/4 - (2 + (-10)/4). What is the greatest common factor of 57 and n? 57 Suppose 3 = 2m + f, -4m - 2f = -5f - 21. Let d be 5/m + (-3)/(-9). Suppose -62 = -dl - 2j, 6j = 4j + 6. What is the greatest common factor of l and 42? 14 Let x be 240/40 + (1 + -2)2. What is the highest common factor of x and 28? 4 Suppose 60 = 4s - 3u, -s = -2s - u + 22. Calculate the highest common factor of 72 and s. 18 Suppose 0 = -3d + 5z + 75, 5z = d + 4z - 23. What is the highest common factor of 50 and d? 10 Let n be (10/4)/((-9)/54)-1. What is the greatest common divisor of n and 60? 15 Let i = -11 - -18. Let c be ((-6)/i)/((-2)/14). Suppose -2h + 2j + 12 = 0, 5h - cj - 31 = -2j. What is the greatest common factor of h and 14? 7 Let t = 17 - 17. Suppose t = 3i - 8i + 10. Calculate the highest common factor of 5 and i. 1 Let m be ((-6)/8)/((-5)/1400). Calculate the highest common factor of m and 84. 42 Let d be (2 - 3)(2 - 15). Suppose 3j = -0c + c + 13, 5j - 35 = 5c. Suppose -ja - q = -37, -q - 3q = 8. What is the highest common divisor of d and a? 13 Suppose -5i = 3x - 82, -2i - 4x + 30 = -i. What is the greatest common divisor of i and 21? 7 Suppose -97 = 8w - 577. What is the highest common divisor of 24 and w? 12 Let s = -7 + -63. Let q = s + 98. What is the highest common divisor of 7 and q? 7 Suppose b = 1, 2o - b + 5b - 40 = 0. What is the greatest common divisor of o and 126? 18 Let h(a) = a2 - 9a - 6. Let m be h(10). Suppose 0 = -o + 2 - 4, mw + 3o = 34. What is the greatest common divisor of w and 80? 10 Let f(m) be the first derivative of -45m2/2 + 1. Let a be f(-1). Let c = 10 - -5. What is the greatest common factor of c and a? 15 Let p(a) = -17a - 3 - 4a - 2 + 2a. Let r be p(-2). Calculate the greatest common divisor of r and 33. 33 Suppose -4c = -2d - 16, -4d + 30 = 3c - d. Let m be 23 + -2c/4. Calculate the greatest common divisor of 30 and m. 10 Suppose 4c - 36 + 8 = 0. Let x be 21((-28)/12)/(-7). What is the highest common factor of c and x? 7 Let u(i) = 10i + 15. Let d be u(16). What is the greatest common factor of 25 and d? 25 Suppose 5y + 25 = 10y. Suppose 4t - yv - 33 = -2v, -8 = -t + v. Calculate the greatest common factor of 6 and t. 3 Suppose 6h - 3h + 13 = -q, -2h = 0. Let z = q + 47. What is the greatest common divisor of 17 and z? 17 Suppose s + 4 = p - 3p, -2p = 2s. Suppose 0h = q + 3h - 10, -5q + h + 50 = 0. Calculate the highest common factor of s and q. 2 Suppose 0k + k = 5. Suppose -a = -6a + k. What is the highest common divisor of 8 and a? 1 Let j(u) = -7u - 1. Let z be j(1). Let r = 17 + z. Calculate the highest common factor of 6 and r. 3 Let r = 5 - 1. What is the greatest common factor of r and 32? 4 Suppose -58 = -5z + 3a + a, 5 = z - 3a. Let u be (-6)/(-21) - (-94)/z. Calculate the highest common divisor of u and 77. 7 Let w = 108 + -88. Calculate the highest common factor of 70 and w. 10 Let f = 119 - -43. Suppose 5r + 5g - 90 = 0, g - 15 = -4r + 57. What is the highest common factor of r and f? 18 Let d be 964/10 + 8/(-20). Let f = 607 + d. Suppose 4l - 3o - 918 = 0, o + 4o = -3l + f. What is the greatest common factor of 21 and l? 21 Suppose 3c + c + 28 = 0. Let g(m) = -3m2 - 3 + 2m*2 + 2m*2 + 6m. Let y be g(c). Calculate the greatest common factor of y and 28. 4 Suppose 0q = 2q. Suppose -9 = -s + 2m - 4, 0 = s + m - 5. Suppose 3w - sy = -0w + 16, -w + 3y + 8 = q. Calculate the highest common divisor of 16 and w. 2 Let c(z) = -z2 - 7z + 6. Let d(b) = -b*3 - 5b*2 + b - 2. Let u = -9 - -4. Let m be d(u). Let p be c(m). What is the highest common factor of p and 12? 6 Let o(n) = n + 13. Let d be o(-5). Let z be -3 + -1 + 3 + 65. Calculate the greatest common divisor of d and z. 8 Suppose -2h - 6 = -5h. Suppose -hv + 16 = -14. Let g be 4/(-5)v/(-6). What is the highest common factor of g and 22? 2 Suppose 21g = 22g + 242. Let d be 3/(-6)g + 0. Calculate the greatest common factor of d and 11. 11 Suppose 0 = z + z. Suppose z = -3v + 151 + 74. Calculate the greatest common factor of v and 25. 25 Let n be 1/(-10)-225. Let c be 123/11 - 2/n. Let t(g) = -g3 + 12g*2 - 9g + 6. Let b be t(c). What is the highest common factor of b and 42? 14 Let o(j) = 13j2 - 3j - 2. Let m be o(-2). Let f = 10 - 2. Calculate the greatest common factor of f and m. 8 Suppose 41 = 3j - 1. Let a = j + -8. Suppose 0 = -5g + 3g + 4. Calculate the greatest common factor of a and g. 2 Suppose -5m - 23 = -l - 3l, -3m = l - 27. What is the greatest common factor of l and 18? 6 Let h = -49 - -59. What is the highest common divisor of h and 90? 10 Suppose 0 = 2o + 10 - 34. What is the highest common divisor of o and 6? 6 Suppose 67y - 73y + 90 = 0. Suppose -6r + 4r + 120 = 0. What is the highest common factor of r and y? 15 Suppose j + 924 = 8j. Calculate the greatest common divisor of 12 and j. 12 Suppose 0 = w - 0w - 11. Let o = -68 - -112. What is the greatest common factor of o and w? 11 Let t = 196 + -127. Calculate the greatest common divisor of t and 23. 23 Let a(k) = k2 - 9k + 1. Let w be a(9). What is the highest common divisor of 4 and w? 1 Suppose 0 = -2p - 10, -120 = 4o - 3p + 21. Let g = -21 - o. What is the greatest common factor of g and 72? 18 Suppose x - 5x = -48. Suppose -x = -2y - 2. Let g = 14 - -21. What is the highest common divisor of g and y? 5 Let p = 181 - 111. Suppose 1 = 2t - 1. Let i be t(2 + -3)-28. Calculate the greatest common divisor of i and p. 14 Let d be -1 - 3(-32)/6. Suppose 0 = k + 5, 0 = -4s - s - 2k + 1505. Let n = s - 168. Calculate the greatest common factor of n and d. 15 Let c be (-21)/(-84) + ((-63)/(-4) - 1). What is the highest common factor of c and 45? 15 Let k be (1/(-3))/((-15)/90). Suppose 5g + 5c = 5, 4g - 4c = 2 + k. Let b be -1 - (-6 + (-1 - -1)). Calculate the highest common factor of g and b. 1 Suppose -5m = -5z + 740, -2m = -3z + 3m + 436. Calculate the highest common divisor of z and 19. 19 Suppose 2s + 26 = 3p + 2, 3p + 2s = 24. Let b(l) = l*2 - 2l - 15. Let d be b(-7). What is the greatest common divisor of p and d?	{ "pile_set_name": "DM Mathematics" }
-12g - 2g - 0g. Solve -14 = 2d + n, -4d + gd - 40 = 5n for d. -5 Let m(r) = 6r - 8. Let s(b) = -5b + 7. Let y(w) = 4m(w) + 5s(w). Let d be y(-2). Solve -a - 14 = -0l - dl, -3l = 3a - 12 for l. 3 Let v(y) = -9y*2 - 73y - 2. Let k be v(-8). Solve -3p + ka - a + 8 = 0, 5a + 5 = 0 for p. 1 Let j(q) = q3 + 6q*2 - 10q - 16. Let c be j(-7). Solve 2o = cm + 3 + 3, 4o = -5m + 12 for o. 3 Let d be 3 - (7 + 48/(-8)). Solve -u - 3 = dm, -5u = 2 - 27 for m. -4 Let x be 4/(-14) + 23/7. Let a be 2(3/(-2) - (-4 - -2)). Let f be (-14)/(-5) + a/((-20)/16). Solve 5r - fm = 6r + 13, xm = 4r + 8 for r. -5 Let r(f) = f*2 + 7f + 4. Suppose 3l + 6 = -3t, 0l - 3l + 5t = 46. Let z be r(l). Suppose 3u - 8 = u. Solve -4g = -5n + 7, ug = -zn + n - 15 for g. -3 Suppose -6t = -4t + 124. Let o = t - -64. Solve -of - 9 = -0v + 3v, 4v + 4f + 8 = 0 for v. -5 Let j(s) = 4s*2 - 5s - 5. Let c(l) = -3l2 + 6l + 5. Let q(d) = 5c(d) + 4j(d). Let h be q(-10). Solve 0 = 5r - hk + 5, -5k - 10 = r - 3k for r. -4 Let k(g) = -g*2 - 5g + 3. Suppose 5l = 5v + 85, -3v + 4l + 37 = -4v. Let f = -25 - v. Let i be k(f). Solve -4q + 29 = -3w, -iq + 16 = 3w - 2q for w. -3 Let r be -23/18-3. Let p = r - -3. Let w(f) = f*2 - 5f + 2. Let y be w(0). Solve i + 4 = -o, 4 = po - yi - 4 for o. 0 Let j = -735 + 737. Solve 6z = 4z, 0 = ja + 3z for a. 0 Let j(p) = -p*3 + 2p2 - p + 3. Let l be j(2). Let x(w) = w3 - w*2 + w - 1. Let b be x(l). Solve b = 5i - 0c - 4c, 0 = 3i - 4c for i. 0 Let t be 2 - (-32)/24(-3)/(-2). Solve n = 4k - 4n + 11, tn - 14 = -2k for k. 1 Let u = -16 - -16. Suppose 3q - 4 = -w + 6, u = -2q + 5w + 35. Solve -3n + 21 = 5k, n = 4k + q - 15 for n. 2 Suppose -2y = -0y + y. Solve -14 = -b + 5d, 4b + d - 3d - 20 = y for b. 4 Let j = 1935 - 1920. Solve -3p + j = -2k, p - 6p + 25 = -4k for p. 5 Let s = 143 + -133. Solve -s = 4o + 2b, 5 = 5b - 4b for o. -5 Let c(d) = -d*2 + 6d + 15. Let z be c(8). Let k be (26/13)/(z/(-2)). Solve 4i + 4n - 4 = 0, kn = -5i + 4i + 4 for i. 0 Suppose 4d + 8 = 3p - 12, 3d = p - 10. Solve -pc + 4n = -40, 20 = -5n + n for c. 5 Suppose 9d - 254 + 236 = 0. Solve q - 2q = -dj - 11, 4j - 3q + 27 = 0 for j. -3 Let g(j) = 8 - 4j + 2j - j + 2j. Let k be g(13). Let s be (-16)/40 + (-27)/k. Solve -sa - 20 = -2v, -3v + 7v = 4a + 16 for v. 0 Let o = 23 - 6. Suppose -4x = -o + 1. Suppose -4 = -xd + 5z, 0 = 2d - 4z + 1 - 3. Solve -3q + 9 + 2 = -2c, 4c + d = -q for c. -1 Let w = -69 - -72. Let h = -5 + 5. Solve h = -wy - 3r - 2r + 1, 2y - 3r - 7 = 0 for y. 2 Let a be -10(-7)/((-70)/(-3)). Solve -a = 2s + w - 0w, -3s - 4w + 8 = 0 for s. -4 Let g(k) = -2k + 5. Let p(t) = -t3 - 7t*2 - 8t - 1. Let z be p(-6). Let y be g(z). Let s = y + 17. Solve w - c = s, -4w + 2w - 8 = 2c for w. -2 Let k be (-1)/(-2)56/7. Suppose kt = r - 0t - 18, -5r + t = -52. Solve -4c - r = -5c - 3o, -3o + 5 = -4c for c. 1 Suppose 0 = 5y - 6 - 4. Suppose -k + 7 = -m + 2k, -yk + 10 = 2m. Solve 0 = -4v + mf - 0f - 10, -5v - 17 = -4f for v. -1 Suppose -4h + 31 = h - 2u, 5h - 19 = -2u. Suppose -ho - a = -o - 10, -5a + 12 = o. Solve 14 = 4j + on - n, -4n = -5j + 28 for j. 4 Let w = -1041 - -1042. Solve 12 = -5q - 3f, 2q + f + 6 = w for q. -3 Let l(h) = -h - 2. Suppose -15 - 9 = 5p - 4n, -4n = 5p + 16. Let r be l(p). Suppose 4 = -rs + 3s. Solve -8 = -2v, -sz + z - 5v + 26 = 0 for z. 2 Let b be -2 + 4 - (0 - -2). Suppose b = -8q + 12q - 20. Suppose -9u + 14 = 3v - 4u, 2 = -v + qu. Solve vw - 3m = -3, -m - 6 = 2w - 2m for w. -5 Let g = 87 + -189. Let y = g - -119. Solve h + 5o - y = 5, -2h = 2o - 4 for h. -3 Let d(i) = 2i - 13. Let u be d(5). Let c be 03/(-6) + (u - -8). Solve 0 = 2a - 6, 3o - ca + 2 = -19 for o. -2 Suppose -4c + 14 = -2t, 5c + 7t = 4t + 34. Solve -h + 30 = -cp + 3h, -3p + 3h = 21 for p. -2 Let g = 11 + -5. Suppose go = -a + o - 17, -5o = 5a - 15. Solve -3p + 4 = -3n - p, 4p - a = 2n for n. 0 Suppose 0a - 5a = 0. Suppose a = -3m - 54 + 9. Let h = m + 22. Solve 0 = -s - 4p - h, 2s + 4p = -2 - 8 for s. -3 Let x(f) = f3 + f2 - 4f - 1. Let v = 2 + 0. Let c be x(v). Solve 4o = 2d - 22, -2o - co + 5 = 4d for o. -3 Let u be 2(-1 - 3)/(-4). Suppose -4j - 4s - 10 = -6s, uj + 2 = 2s. Let y = 9 + j. Solve -c - x = -5, -4x = -4c + 3c + y for c. 5 Let b = 405 - 398. Solve 5g - 15 = 5a, -2a - b = -3g - 2 for a. -4 Let m be (-2)/3 + 24/36. Suppose -r + 15 = 2v - 19, -5v + r + 85 = m. Solve v - 3 = -c - 4k, -17 = c + 5k for c. -2 Suppose -5i - 2p = -20, -3i - 83 = -4p - 69. Solve is + 0s - q = 6, -3s = -4q - 14 for s. 2 Let s = 61 + -124. Let c = s + 88. Solve 6w - w = -d + c, -5d - 25 = -5w for w. 5 Suppose 30 = -37g + 52g. Solve 2 = -j - 23n + 24n, -6 = -gn for j. 1 Let g be 64/28 - (-14)/(-49). Solve -z + 3h = 3z + 15, gz + 5h = -1 for z. -3 Suppose -5a + 13a + 104 = 0. Let m = -8 - a. Solve 0 = -4n + mb - 10 - 0, -5n = b - 2 for n. 0 Let o be (-605)/(-209) - 20/(-190). Solve 5u = -oi + 24, -25 + 10 = -5u for i. 3 Let w = 1606 - 1603. Solve 1 = -3m - x - 0, -wx + 6 = 0 for m. -1 Let a(o) = o + 4. Suppose 0 = 4k - 4 + 12. Let p be a(k). Let u = -163 - -166. Solve -5y = -2q - 11, -py - u + 2 = q for y. 1 Let q(v) = -9v - 133. Let w be q(-15). Solve 4n - 5m - 18 = 0, wn - 13 - 1 = 5m for n. 2 Suppose -d + 18 = 2d. Suppose -4j - 3 = -0j + 3b, 3j + b + d = 0. Let l be j/(-2) - 3/(-2). Solve 2v + 2c = c + l, -2c - 12 = -2v for v. 3 Let s(z) = z*3 - 2z*2 + 4. Let n be s(0). Solve nt + 3w = 3t + 2, -5t - 3w = -10 for t. 2 Let z(m) be the second derivative of m5/20 + m3/3 - m*2/2 - 9m. Let f be z(3). Solve f = 5q + 5t + 7, t - 4 = 0 for q. 1 Let o be 14/14(0 + 0). Solve o = 5s + 3j - 10, 0 = s + j + 2j - 2 for s. 2 Suppose -5o + 3g = -105 - 90, -4o + 159 = -3g. Suppose c + 3c = o. Solve -2l + 8 + 5 = 5s, -2l = s - c for l. 4 Suppose 0 = d + 4 - 2. Let a be (1/d)/(2/(-96)). Suppose 3x - 112 = -53x. Solve 2f + 24 = -3u - f, xu + a = -4f for u. -4 Let n(v) be the first derivative of -v*2/2 + 11v + 28. Suppose h = -2h. Let s be n(h). Solve a + g = -2a + 7, -5a - s = -4g for a. 1 Let r = -45 + 94. Let u = r + -46. Solve -ub + 4b = 2l + 8, 0 = b + 3l + 2 for b. 4 Let l = -51 - -21. Let w be 386/30 - 4/l. Let a = -5 + w. Solve q + 2t - 4t = -a, 12 = 4t for q. -2 Let a(y) = -4y - 28. Let c be a(-7). Solve s = c, -3s = 3v - s for v. 0 Let h = -56 - -52. Let s be 41/h(-10 - -5). Solve -4t - 2u - 16 = 0, -5u - 21 = 3t + s for t. -2 Suppose 20k - 18k - 16 = 0. Solve 3z - k + 0 = a, 0 = -4a + 4z for a. 4 Suppose 4o - 2o - l - 9 = 0, o + 5l = -1. Solve 0 = -3w - 6, -os + 5w - w - 4 = 0 for s. -3 Suppose 0 = 4o - w - 3, -o + 9 = -0o - 3w. Let i be (-5 + o)(-4 - -3). Solve -4z = 5r + 23, 3r - iz - 16 = 5r for r. -3 Let w be (2 - 1)/(2/4). Suppose -4o - w = -2l - 6, 0 = 4o + 5l - 4. Let g be o/(((-8)/(-20))/2). Solve gu - 5 = 5q, -4q = q + 10 for u. -1 Suppose -i + 4i = 6. Suppose 9 + 3 = id. Suppose 0 = db - 5b - 4. Solve -3y = k - 0y + 11, -bk + 2y + 26 = 0 for k. 4 Suppose 6 = 3s, -3t = 2t + 3s - 26. Solve -2j = tc + 12, 3c - 6 = 5c - 4j for c. -3 Let f be (-1)/(-2)(2 + 22). Solve 0 = 5c + 4h + f, 4h = -4c + 8h + 12 for c. 0 Let o = -2211 - -2216. Solve 6a = 4g + a - 8, og + 2a = 10 for g. 2 Let f = 732 + -729. Solve j = -3, 4j - 7 = 5g + fj for g. -2 Suppose 0 = 3k - n - 9, k + 24n - 1 = 25n. Solve 0d - 4s = -4d + 12, -ks - 6 = -d for d. 2 Let q be 1/2 - (-15)/2. Let w = 20 + -20. Let t(l) = -l*3 + l + 20. Let i be t(w). Solve 4c - q = -2x + 2, 4x - i = 2c for x. 5 Let w = 638 - 637. Suppose c = -3c. Solve 0 = -k - 4y - w, cy - 2y = -2k + 8 for k. 3 Let x be 1/(3 + 22/(-8)). Suppose 2g - g = x. Suppose -g = -a - 2. Solve y = 5t - 20, at - 5 = -y + 3 for t. 4 Let y be (-2)/((-15 + 5)/5). Let f be 6(3/(-9) + y). Solve -fb - 3j + 8 = 0, 5j - 24 = 2b + 2b for b. -1 Let u = 926 - 921. Solve 6m - m = -5p - 5, 4m + up = -3 for m. -2 Suppose 23x - 155 = -40. Solve 4*t +	{ "pile_set_name": "DM Mathematics" }
cked without replacement from fnfnfcnxcnffnnxnn. What is prob of picking 2 c? 1/136 What is prob of picking 2 k and 1 m when three letters picked without replacement from {h: 1, k: 2, o: 4, y: 6, m: 3}? 3/560 What is prob of picking 1 y, 1 g, and 1 e when three letters picked without replacement from yugueukeeuuu? 3/220 Two letters picked without replacement from bbtltbttlul. What is prob of picking 1 b and 1 l? 9/55 What is prob of picking 1 p, 1 n, and 1 r when three letters picked without replacement from {l: 1, y: 1, p: 6, r: 1, o: 4, n: 3}? 9/280 Calculate prob of picking 1 l and 3 v when four letters picked without replacement from {v: 17, l: 2}. 20/57 What is prob of picking 2 a when two letters picked without replacement from {a: 5, d: 3, f: 4}? 5/33 What is prob of picking 1 b and 1 s when two letters picked without replacement from sbbb? 1/2 Calculate prob of picking 2 d when two letters picked without replacement from {z: 2, m: 6, d: 6, p: 3, s: 1, k: 2}. 3/38 Three letters picked without replacement from {f: 2, m: 4, s: 1, q: 1, h: 1}. Give prob of picking 1 q, 1 f, and 1 s. 1/42 Calculate prob of picking 2 r and 1 v when three letters picked without replacement from osfrvfroodddsrf. 3/455 Two letters picked without replacement from {v: 2, d: 3, z: 1, o: 7, u: 5}. What is prob of picking 2 v? 1/153 What is prob of picking 1 t and 1 c when two letters picked without replacement from {c: 3, l: 1, t: 1}? 3/10 Calculate prob of picking 1 t and 1 v when two letters picked without replacement from obbbbvobooyvatbv. 1/40 Two letters picked without replacement from aaca. Give prob of picking 2 a. 1/2 Two letters picked without replacement from {e: 4, n: 6}. Give prob of picking 1 e and 1 n. 8/15 Two letters picked without replacement from unnuddquuudjouuuo. Give prob of picking 1 n and 1 o. 1/34 Three letters picked without replacement from mdmmoom. What is prob of picking 3 m? 4/35 What is prob of picking 3 o when three letters picked without replacement from {c: 2, o: 6, k: 10}? 5/204 Four letters picked without replacement from {l: 3, e: 3, z: 4, k: 3, w: 3}. What is prob of picking 2 k, 1 l, and 1 e? 27/1820 Calculate prob of picking 1 a, 1 z, and 1 u when three letters picked without replacement from {u: 1, e: 5, h: 2, z: 5, a: 2, n: 2}. 1/68 Four letters picked without replacement from rrrrryrryrayyyrraaa. Give prob of picking 2 a and 2 r. 45/646 Calculate prob of picking 4 y when four letters picked without replacement from xppyrpyyylpp. 1/495 Four letters picked without replacement from adjdc. What is prob of picking 1 d, 1 a, 1 c, and 1 j? 2/5 What is prob of picking 1 e and 3 z when four letters picked without replacement from ezzzxzlzx? 5/63 Four letters picked without replacement from {a: 1, h: 4, e: 1, i: 1, b: 4, o: 1}. Give prob of picking 1 o, 1 i, and 2 b. 2/165 Calculate prob of picking 2 u when two letters picked without replacement from pccpcuup. 1/28 What is prob of picking 2 b and 2 f when four letters picked without replacement from {t: 6, f: 5, b: 4, k: 1}? 3/91 Two letters picked without replacement from ynhyyyvyhyvyvnyh. What is prob of picking 2 h? 1/40 Two letters picked without replacement from mmccc. Give prob of picking 2 m. 1/10 What is prob of picking 1 l and 1 h when two letters picked without replacement from xxxxaxhxalxsaxlxxx? 2/153 What is prob of picking 2 a, 1 v, and 1 j when four letters picked without replacement from yuuavyjea? 1/126 What is prob of picking 1 n and 1 h when two letters picked without replacement from nnnnnnnhhnhhnn? 40/91 Calculate prob of picking 3 h and 1 o when four letters picked without replacement from {h: 5, o: 15}. 10/323 Two letters picked without replacement from {o: 12, l: 4, w: 4}. Give prob of picking 2 l. 3/95 Three letters picked without replacement from riiffjiiiiij. Give prob of picking 1 i and 2 f. 7/220 Two letters picked without replacement from fffffffffufff. Give prob of picking 1 u and 1 f. 2/13 Two letters picked without replacement from dilch. What is prob of picking 1 h and 1 d? 1/10 What is prob of picking 3 p when three letters picked without replacement from bbpbpppp? 5/28 What is prob of picking 1 j and 1 v when two letters picked without replacement from {v: 4, j: 5, w: 1, q: 3, l: 3, h: 1}? 5/34 Four letters picked without replacement from {z: 6, a: 1, g: 8}. Give prob of picking 4 g. 2/39 Two letters picked without replacement from {k: 6, n: 4, b: 1, a: 4}. Give prob of picking 1 a and 1 n. 16/105 What is prob of picking 1 q and 1 f when two letters picked without replacement from qffqqqqfqqqq? 9/22 What is prob of picking 1 d and 1 l when two letters picked without replacement from {f: 1, d: 4, z: 8, p: 2, l: 2, j: 2}? 8/171 Two letters picked without replacement from uugguuyggurugpggr. What is prob of picking 1 u and 1 y? 3/68 Four letters picked without replacement from {s: 1, o: 1, p: 1, z: 1, b: 1}. What is prob of picking 1 p, 2 z, and 1 b? 0 What is prob of picking 2 q when two letters picked without replacement from {z: 3, q: 4, x: 7}? 6/91 Two letters picked without replacement from qktuo. What is prob of picking 1 u and 1 q? 1/10 What is prob of picking 1 x and 1 y when two letters picked without replacement from {o: 1, y: 1, x: 1, q: 2, b: 1, k: 1}? 1/21 Calculate prob of picking 1 l and 1 f when two letters picked without replacement from lvfll. 3/10 Four letters picked without replacement from {g: 15, l: 5}. Give prob of picking 3 l and 1 g. 10/323 What is prob of picking 2 g, 1 q, and 1 n when four letters picked without replacement from {g: 2, n: 1, q: 2, l: 1, f: 2}? 1/35 Calculate prob of picking 1 u and 1 x when two letters picked without replacement from xux. 2/3 Two letters picked without replacement from {b: 1, m: 2, u: 1, g: 3}. Give prob of picking 1 u and 1 m. 2/21 Calculate prob of picking 1 w and 1 s when two letters picked without replacement from {w: 5, s: 4, b: 2}. 4/11 Four letters picked without replacement from {v: 1, u: 4, l: 3, q: 6, i: 1}. What is prob of picking 1 l and 3 q? 4/91 Two letters picked without replacement from {t: 5, d: 2, x: 1, z: 1}. Give prob of picking 1 z and 1 d. 1/18 Calculate prob of picking 2 p when two letters picked without replacement from {z: 3, p: 2, j: 1, u: 7, n: 4}. 1/136 What is prob of picking 3 b when three letters picked without replacement from {b: 4, g: 2}? 1/5 What is prob of picking 1 a and 2 i when three letters picked without replacement from {k: 1, a: 4, z: 8, i: 2}? 4/455 Three letters picked without replacement from {q: 9, h: 7}. Give prob of picking 2 h and 1 q. 27/80 Four letters picked without replacement from pgxexfeeegrxfp. Give prob of picking 2 f and 2 x. 3/1001 Two letters picked without replacement from {p: 5, v: 3, w: 6, t: 3, i: 1}. What is prob of picking 1 w and 1 v? 2/17 Two letters picked without replacement from {o: 1, b: 1, s: 4, n: 1, q: 2}. Give prob of picking 1 o and 1 s. 1/9 What is prob of picking 1 q, 1 j, and 1 e when three letters picked without replacement from {j: 1, w: 9, e: 1, q: 4}? 4/455 What is prob of picking 2 h and 1 k when three letters picked without replacement from {k: 3, n: 3, h: 2}? 3/56 Calculate prob of picking 2 j and 1 i when three letters picked without replacement from lijiriyliydyjdiiyiyj. 7/380 Four letters picked without replacement from bbbssbbbssbbs. Give prob of picking 1 s and 3 b. 56/143 Calculate prob of picking 1 q and 3 y when four letters picked without replacement from {d: 3, y: 3, q: 7}. 7/715 Three letters picked without replacement from {t: 3, i: 1, x: 3, m: 1, q: 2}. Give prob of picking 1 t, 1 i, and 1 q. 1/20 Two letters picked without replacement from {y: 1, j: 5, m: 1, u: 4}. What is prob of picking 1 m and 1 j? 1/11 Three letters picked without replacement from ggkkk. Give prob of picking 1 k and 2 g. 3/10 What is prob of picking 3 d when three letters picked without replacement from {l: 8, x: 1, d: 4, m: 4, y: 2, h: 1}? 1/285 Two letters picked without replacement from tpppmmuapumpp. Give prob of picking 1 u and 1 p. 2/13 Calculate prob of picking 1 m, 1 y, and 1 d when three letters picked without replacement from mydymyyyyymmmmmmmm. 35/408 What is prob of picking 4 j when four letters picked wi	{ "pile_set_name": "DM Mathematics" }
p + 19 = 0. Is l a multiple of 20? False Let k(f) = 11f2 - 31f + 127. Is 20 a factor of k(16)? False Suppose -16 = 4r, 0 = 3v - 6v + 3r + 21. Suppose -i + 15 = -v. Suppose -j - 2j = -i. Does 2 divide j? True Let t(g) = -g3 - 2g*2 + 3g + 2. Let o be (5/(-3))/((-3)/(-9)). Let z be -2 + (-6)/(-2) + o. Is t(z) a multiple of 11? True Suppose 15c - 4766 = -731. Is 13 a factor of c? False Let k = -987 + 1119. Does 12 divide k? True Suppose -3g = -0g - 15. Suppose -gl = -2t + 25, 15 + 57 = 3t + 4l. Does 5 divide t? True Suppose -6j - 84 = -18. Let b = j - 1. Does 7 divide (-264)/(-15) - b/30? False Is (25/(-9) - -3) + 151/9 a multiple of 2? False Does 44 divide ((-280)/(-42))/(2/66)? True Let y be 63/6 + (-2)/4. Is 4 a factor of (16/5)/(y/25)? True Suppose 5u - 800 = -5g, -u - 3g - g + 166 = 0. Does 4 divide u/5 - 18/(-45)? True Suppose -5q + 3883 - 523 = -3y, 2y - 10 = 0. Is 9 a factor of q? True Let s(r) = -r*3 - 6r - 7 - 7r2 + 0r*3 + 17r*2. Let o be s(7). Suppose 4z + 41 = 5g - 94, 3g = -z + o. Does 25 divide g? False Let d(a) = -a*2 + 12a - 14. Let h be d(11). Let t = h + 7. Suppose tc = -0c + 116. Is c a multiple of 5? False Let y be (272/224 + 2/7)2. Suppose -1 - 2 = -i. Suppose -ij - 14 = -yx + 2j, -16 = -2x + 2j. Does 13 divide x? True Suppose -72a = -106a + 34068. Does 15 divide a? False Let r(z) = -22z3 + 4z*2 + 4z + 4. Let t(c) = -65c3 + 12c*2 + 12c + 11. Let q(m) = -8r(m) + 3t(m). Does 20 divide q(-1)? True Let u(m) = m2 + m - 7. Let j = -26 + 36. Let t = j - 3. Is u(t) a multiple of 9? False Let m be 8/(48/90) - 3. Let s(a) be the first derivative of -a4/4 + 13a3/3 - 7a*2/2 + 26a - 3. Is s(m) a multiple of 15? False Let c be (-3)/362 - 1915/30. Let w = c - -109. Is w a multiple of 15? True Let z(y) = 149y*3 - 7y*2 + 5y - 4. Is 26 a factor of z(2)? True Suppose i - 4l = -l + 249, 4l = -4i + 980. Suppose 2a = -2g - 3a + i, g + 5a = 118. Suppose g = 3d + 4j, -4d + 166 = j + 4. Is 20 a factor of d? True Let g = 664 - 274. Does 26 divide g? True Does 4 divide 18/(-72) + (-2)/((-16)/394)? False Let u = -88 - -145. Is u a multiple of 5? False Let j be 14/(-4) - 2/(-4). Let w = 3 - j. Is 4 a factor of (-4)/w(-33)/2? False Let n(s) = s3 - 4s*2 + 2s + 109. Is 36 a factor of n(0)? False Let g = 1686 - 1279. Does 8 divide g? False Suppose -8 = -2n - 0n. Let a = -8 - n. Is 4 a factor of (-8)/a - (-20)/6? True Let l(r) be the third derivative of r5/20 - r4/12 - 13r3/6 + 44r*2. Is 26 a factor of l(5)? True Suppose -4n = 4o - 4, -38 = -n - 2n + 4o. Suppose nx = 5x + 109. Is 14 a factor of x? False Suppose 5p = 2t - 445, -t + 228 = 8p - 5p. Is t a multiple of 25? True Suppose -1127 = -5u - f, -21u = -18u + f - 675. Is 4 a factor of u? False Let v(f) = -f*3 - 15f*2 + 2f + 114. Is v(-18) a multiple of 14? True Does 51 divide (3/(-36))/(7/(-357))252? True Suppose -44f = 7506 - 34434. Is f a multiple of 17? True Suppose -5 = -y - m, -y = 2y + 2m - 19. Is 10 a factor of 0 + (3 + (-42)/y)-45? False Let v(j) = -j + 32. Let y be v(18). Suppose 3z + y + 43 = 0. Does 16 divide (-196)/(-2) + (-20 - z)? False Suppose -4n + 13 = z + 4, -4z = n - 21. Suppose -3s + zt + 30 = -94, 0 = 4t + 20. Does 4 divide s? False Suppose -16870 = -64t + 10202. Is 30 a factor of t? False Let y = 2386 - 2158. Is 38 a factor of y? True Let i be -1 + 2/((-2)/(-11)). Let p = -4 + i. Is 3 a factor of p? True Is 13 a factor of (-300)/(-250) + (41316/5)/4? True Suppose -6h - 11 = 3m - 4h, -h = 2m + 6. Does 3 divide 2/m + 86 + (-10)/5? False Let c = -301 + 431. Is 26 a factor of c? True Let w(h) = h*3 - 19h*2 - 25h - 49. Let c be (2 + (-78)/(-24))4. Does 44 divide w(c)? True Let y(s) = s2 - 28s - 329. Is 12 a factor of y(-13)? True Let k = 77 - 81. Does 3 divide 23(-1 - (2 + k))? False Let s(b) = b2 + 4b + 2. Let p be (-2)/6(-1 + -20). Let o be ((-7)/(-2))/(p/(-14)). Is s(o) a multiple of 6? False Let i = -931 + 3345. Does 17 divide i? True Let w(u) be the first derivative of 6 - 4u - 7/2u2. Is w(-7) a multiple of 12? False Let s(w) = 2w*2 + 5w - 13. Suppose 4 = -k + 13. Is s(k) a multiple of 13? False Let j = 21 - 7. Let i = -11 + j. Suppose -5u = ig - 34, -g + 3u = -47 + 17. Does 9 divide g? True Let u = -12 + 16. Suppose -2a + u = -0a. Is 10 a factor of (13 - 1) + (a - 0)? False Let s = -106 - -104. Is 5 a factor of 2/((-122)/(-30) - (s - -6))? True Let m(p) be the second derivative of 7/6p*3 + 0 - 2p*2 + 7p. Is m(7) a multiple of 9? True Let t(h) be the first derivative of 1 + 2h2 + 5h + 5/3h3 + 1/4h*4. Is t(-4) a multiple of 2? False Let y be 38571/65 + (-4)/10. Let z = y - 351. Does 12 divide z? False Let i(a) = 7a*2 + 19a - 4 - 21a2 + a3 - 3a. Let n(z) = z*3 - 15z*2 + 17z - 3. Let f(c) = -6i(c) + 5n(c). Is f(7) a multiple of 7? False Let v = 431 - 369. Does 7 divide v? False Suppose -5t + 4t = -132. Suppose -x + 4x = 2k - t, -3x = 6. Suppose k = 3q - 4y, 3q - q - 4y = 42. Does 11 divide q? False Suppose 1038 + 114 = 2m. Suppose -3p - 11 - 1 = 0, 5j = -p + m. Does 29 divide j? True Let u(w) = -55w - 107. Is u(-33) a multiple of 61? True Let u(i) = -i3 - 15i*2 - 36i - 12. Is u(-15) a multiple of 13? False Let m(y) = y*3 + 5y*2 - 4y + 2. Let u be m(3). Suppose -b = 1 - u. Is b a multiple of 17? False Let r(m) = -m*2 + 30m + 86. Is 11 a factor of r(21)? True Let y = -754 + 2107. Is 11 a factor of y? True Let x = 13 - 5. Let p be 10(-2 + 4/x). Is 33/5 + 9/p a multiple of 6? True Let l = -77 + 27. Does 15 divide (-1)/4l(-96)/(-10)? True Suppose 3j = -2k - 388, 0k + 4k = j - 790. Let f = k + 302. Does 15 divide f? True Let o = -15 - -23. Let p(y) = y3 - 9y*2 + 17y - 17. Let v be p(7). Let z = o + v. Is z a multiple of 12? True Suppose 18 = 69t - 72t. Let h(d) be the third derivative of -d6/120 - d5/15 - d4/8 + d3 + 3d2. Does 24 divide h(t)? True Suppose 3n - 5 = 1. Suppose -15 = u + 5x, 2x + 32 = -5u + 2u. Does 5 divide n - (u - 3) - 1? False Let y = 15 - 19. Let g be (-26)/y + 1/2. Let u(w) = 13w + 3. Is u(g) a multiple of 30? False Let w be 12/828/6. Suppose -wt + 4t - 57 = 0. Let g = t - -42. Is g a multiple of 6? False Is 14 a factor of (88/(-12))/(-4 - 1113/(-279))? False Let d be 3/(-4 - -1) - -3. Let b be (-4)/(-10) - 219/(-15). Suppose h - b = -dh. Is h a multiple of 4? False Suppose 9r - 10r + 2 = 0. Suppose rm - 148 = 4l - 620, -3l = -m - 352. Does 34 divide l? False Let f = -23 - -25. Suppose 3x + 111 = 4o + 508, -fx = 5o + 525. Is o/(-15) + (-14)/(-105) a multiple of 7? True Let m be (2 - -13)2/(-3). Suppose 9d - 63 = -12d. Let l = d - m. Is l a multiple of 13? True Let n = -615 - -835. Is 10 a factor of n? True Let c(x) = 13x + 2. Let n(m) = m + 9. Let i(v) = -v*3 - v - 6. Let z be i(0). Let j be n(z). Is 18 a factor of c(j)? False Let n be (4 - 3)/(6/558). Suppose 95d - 220 = nd. Does 10 divide d? True Suppose -3m - 3 = 4j, -2j = -3j - 2m - 7. Suppose ju = 192 + 90. Is u a multiple of 12? False Let t = 4 + 5. Suppose -tc = -6c - 168. Let k = c + -27. Is 12 a factor of k? False Let b(t) = -45t - 63. Is b(-7) a multiple of 27? False Suppose -4n + r = 3r - 12, -n - 8 = -5r. Suppose -402 = -nx - 102. Is 23 a factor of x? False Suppose 9l = 399 + 105. Is l a multiple of 14? True Let f(t) = -3t*2 + 4t + 3. Let k be f(11). Let r = -109 - k. Suppose r = 5d + 17. Is 9 a factor of d? False Suppose 2h + 4 = 12, 2o - h - 76 = 0. Suppose -3z + 5z = 5a - 203, z + o = a. Is a a multiple of 21? False Let s = -625 + 1528. Let j = 11 + -7. Does 14 divide j/(-20) - s/(-15)? False Let n be ((-26)/(-5))/(19/190). Let m be -195(-3 + n/20). Suppose -2j = j + 3k - 78, -k - m = -3j. Is 13 a factor of j? True Suppose j - 1 = 1. Suppose 5x - 69 = 2r, 3r = -jx - 2x + 69. Let y = 33 - x. Is y a multiple of 4? False Let v(q) = -24q - 207 + 147 + 2q. Does 45 divide v(-15)? True Let h be -9(-5)/(-75) + 39/15. Let o(v) = v*3 + 8v*2 + 6v - 3. Let z be o(-6). Suppose -2w + m = -hm - z, 3m - 21 = -4w. Is w a multiple of 4? False Let j be (-2 + 2)/((-10)/5). Suppose -l + 26 + 24 = j. Is l a multiple of	{ "pile_set_name": "DM Mathematics" }
2/5 + 58h/15 + 32/5 = 0. -1, 3, 16 Factor 3q*2/7 + 33q/7 + 12. 3(q + 4)(q + 7)/7 Factor 44p2 - 100p + 24. 4(p - 2)(11p - 3) Find b, given that 3b*5/8 - 15b*4/4 + 27b*3/8 + 39b*2/2 + 12b = 0. -1, 0, 4, 8 Determine k so that 50k4 - 62k*3 + 12k*2 = 0. 0, 6/25, 1 Determine u so that -2u*2/5 - 7u/5 = 0. -7/2, 0 Solve r*5/4 + 5r*4/2 + 33r*3/4 + 10r*2 + 4r = 0. -4, -1, 0 Factor -x*3 - 8x*2 + 29x + 180. -(x - 5)(x + 4)(x + 9) Factor 5k2 - 355k - 1500. 5(k - 75)(k + 4) Let 5r4 + 305r*3 + 5985r*2 + 33075r - 92610 = 0. Calculate r. -21, 2 Factor -2u2/15 + 56u/15 - 392/15. -2(u - 14)2/15 Factor -2i*4 - 20i*3 + 2i*2 + 20i. -2i(i - 1)(i + 1)(i + 10) Solve -65g5 - 296g*4 - 473g*3 - 326g*2 - 92g - 8 = 0 for g. -2, -1, -2/5, -2/13 Find c such that 2c2 + 345c/2 + 43 = 0. -86, -1/4 What is g in 4g3 + 268g*2 + 3264g = 0? -51, -16, 0 Find c, given that c*3 + 2331c*2 - c - 2331 = 0. -2331, -1, 1 Suppose -4t*4/9 - 44t*3/9 - 40t*2/9 = 0. Calculate t. -10, -1, 0 Factor 4f*4 - 976f*3 - 2956f*2 - 1976f. 4f(f - 247)(f + 1)(f + 2) Let -6d5 - 111d*4 + 579d*3 - 939d*2 + 615d - 138 = 0. Calculate d. -23, 1/2, 1, 2 Factor -4q4 - 12q*3 + 16q. -4q(q - 1)(q + 2)2 Let -u5/5 + u4/5 + 16u*3/5 + 4u*2 = 0. What is u? -2, 0, 5 Factor 2g*2 - 1076g + 2144. 2(g - 536)(g - 2) Determine u so that -5u2 + 1580u - 124820 = 0. 158 Factor -4d3 + 388d*2 - 384d. -4d(d - 96)(d - 1) Factor 3i*2 + 28572i + 68029932. 3(i + 4762)2 Factor q3 + q2. q2(q + 1) Factor 5d2 + 105d + 190. 5(d + 2)(d + 19) Factor -3k2/2 + 2082k. -3k(k - 1388)/2 Determine b, given that -4b3 - 33b*2 - 8b = 0. -8, -1/4, 0 Find r such that r3/3 - r2/3 = 0. 0, 1 Suppose -2o2 + 3844o = 0. What is o? 0, 1922 Let 3s5/5 - 66s*4/5 - 108s*3 + 13608s2/5 = 0. Calculate s. -14, 0, 18 Factor h2 - 343h - 690. (h - 345)(h + 2) Solve 2q3/5 - 3612q*2/5 + 2174424q/5 - 436334416/5 = 0. 602 Solve 2m2 + 748m + 3690 = 0. -369, -5 What is f in -2f3/7 + 18f*2/7 + 20f/7 = 0? -1, 0, 10 Suppose 3y3 - 99y*2 + 186y = 0. What is y? 0, 2, 31 Factor 2q3 + 122q*2 - 2q - 122. 2(q - 1)(q + 1)(q + 61) Suppose h4/4 - 5h*3/2 + 29h*2/4 - 2h - 12 = 0. What is h? -1, 3, 4 Find q, given that -3q4 + 1374q*3 - 4095q*2 = 0. 0, 3, 455 Factor 4w*3 + 102w*2 + 624w - 338. 2(w + 13)2(2w - 1) Factor 2f*3 + 288f*2 + 11658f + 144652. 2(f + 29)2(f + 86) Factor -2g3 + 158g*2 - 608g + 600. -2(g - 75)(g - 2)*2 Let -2a*4/7 - 11664a*3/7 - 17006112a*2/7 = 0. Calculate a. -2916, 0 Factor -5v*4 - 20v*3 - 15v*2. -5v*2(v + 1)(v + 3) Factor 8a*3/15 - 22a*2/15 - 2a/5. 2a(a - 3)(4a + 1)/15 Let 2m2 - 3968m/5 - 794/5 = 0. Calculate m. -1/5, 397 Let -13s2/4 - 9s + 9/4 = 0. Calculate s. -3, 3/13 Let 5w4 + 150w*3 + 1065w*2 + 2600w + 1680 = 0. What is w? -21, -4, -1 Factor -2t3/19 - 12t*2/19 + 2t + 48/19. -2(t - 3)(t + 1)(t + 8)/19 Factor 338n*2/3 - 728n/3 + 392/3. 2(13n - 14)*2/3 Find y such that -5y*2 - 735y - 730 = 0. -146, -1 Let -12t2/5 + 2056t/5 - 684/5 = 0. What is t? 1/3, 171 Factor 4o3/5 + 132o*2 + 7260o + 133100. 4(o + 55)3/5 Factor 4t*2/3 - 11624t/3 + 8444836/3. 4(t - 1453)2/3 Factor 3a*4 + 63a*3 + 270a*2 - 96a - 1440. 3(a - 2)(a + 4)*2(a + 15) What is j in -j*2/6 + 22j/3 + 15/2 = 0? -1, 45 Factor 3l4 + 9l*3 - 45l*2 + 51l - 18. 3(l - 1)3(l + 6) Factor -2a3/5 + 8a*2/5 + 2a/5 - 8/5. -2(a - 4)(a - 1)(a + 1)/5 Suppose 3l*4/2 - 93l*3 + 2052l*2 - 19440l + 67392 = 0. Calculate l. 12, 26 Solve 4n2 + 384n + 380 = 0 for n. -95, -1 Factor 5c5 - 280c*4 + 5400c*3 - 38880c*2 + 58320c. 5c(c - 18)*3(c - 2) Factor 3c2/5 + 11c - 38/5. (c + 19)(3c - 2)/5 Solve 2t2/3 - 14t/3 - 40 = 0 for t. -5, 12 Let -4s5/5 - 24s*4/5 - 12s*3/5 + 8s*2 = 0. Calculate s. -5, -2, 0, 1 Determine w, given that 6w*4/11 + 2w*3/11 - 78w*2/11 - 98w/11 - 24/11 = 0. -3, -1, -1/3, 4 Let c*3 - 7c*2 - 60c = 0. What is c? -5, 0, 12 Find k, given that k*5/6 + 23k*4/6 + 179k*3/6 + 553k*2/6 + 120k + 54 = 0. -9, -2, -1 Factor -t*2 - 6438t - 10361961. -(t + 3219)2 Suppose -o5 + 5o4 - 2o*3 - 14o*2 + 3o + 9 = 0. Calculate o. -1, 1, 3 Factor -2y3 - 2y*2 + 372y - 720. -2(y - 12)(y - 2)(y + 15) Factor -3i*5 - 6i*4 + 12i*3 + 24i*2. -3i*2(i - 2)(i + 2)2 Find n, given that -7n*5/4 - 5n*4/4 + 18n*3 - 19n*2 + 4n = 0. -4, 0, 2/7, 1, 2 Solve 9g4 - 183g*3 + 924g*2 - 288g = 0 for g. 0, 1/3, 8, 12 Factor u*2/8 - 7u/8 + 3/4. (u - 6)(u - 1)/8 Solve 2w*3/7 - 8w*2/7 - 104w/7 - 160/7 = 0. -4, -2, 10 Determine s so that 2s2/13 - 180s/13 - 14 = 0. -1, 91 Factor -r*2/4 + r/4 + 1/2. -(r - 2)(r + 1)/4 Find q, given that 2q2 - 1362q + 2716 = 0. 2, 679 What is d in -d*3 - 3d*2 + 4 = 0? -2, 1 Determine q so that 16q*4 - 844q*3 + 2124q*2 + 3784q + 800 = 0. -1, -1/4, 4, 50 Factor -x*3 + 71x2. -x2(x - 71) Factor -4k*4 + 4k*3 + 8k*2. -4k*2(k - 2)(k + 1) Factor -75l*3 - 144l*2 + 237l - 18. -3(l - 1)(l + 3)(25l - 2) Suppose v4/5 - v3 + v2 + v - 6/5 = 0. Calculate v. -1, 1, 2, 3 Determine v so that -v4 - 19v3/7 + 6v*2/7 = 0. -3, 0, 2/7 Factor 5p*3 + 335p*2 - 5p - 335. 5(p - 1)(p + 1)(p + 67) What is d in 15d*3 + 243d*2 + 273d + 45 = 0? -15, -1, -1/5 Suppose v*4/10 - 11v*3/5 - 78v*2/5 - 164v/5 - 112/5 = 0. What is v? -2, 28 What is x in -3x4/5 + 33x*3/5 - 81x*2/5 - 33x/5 + 84/5 = 0? -1, 1, 4, 7 Determine j so that 5j4 - 3095j*3 - 6205j*2 - 3105j = 0. -1, 0, 621 Factor p*3 + 92p*2 + 2116p. p(p + 46)2 Factor 4j*5 + 80j*4 - 176j*3 + 8j*2 + 172j - 88. 4(j - 1)3(j + 1)(j + 22) Let 22a*5/9 + 38a*4/3 - 112a*3/9 - 8a*2/3 = 0. Calculate a. -6, -2/11, 0, 1 Find s such that -4s*3/5 - 376s*2/5 + 572s + 3232/5 = 0. -101, -1, 8 Find d such that -2d3/15 - 22d*2/5 - 128d/5 - 104/3 = 0. -26, -5, -2 Let -2k4 - 96k*3 + 2k*2 + 96k = 0. Calculate k. -48, -1, 0, 1 Factor 2m2/3 + 22m/3 + 20/3. 2(m + 1)(m + 10)/3 Solve 2y4/5 + 4y*3 + 64y*2/5 + 64y/5 = 0. -4, -2, 0 Let 21c4 + 27c*3 - 15c*2 - 27c - 6 = 0. Calculate c. -1, -2/7, 1 Solve y*2 + 1078y + 290521 = 0. -539 Factor 60k2 + 14k - 4. 2(5k + 2)(6k - 1) Find n such that n*3/3 - 113n*2/3 - 4n/3 + 452/3 = 0. -2, 2, 113 What is k in 2k2/7 + 4232k/7 + 2238728/7 = 0? -1058 Let 2t5/9 - 44t*4/9 + 70t*3/3 - 32t2 = 0. Calculate t. 0, 3, 16 Suppose -a4/5 - 6a3/5 - 3a*2/5 + 26a/5 + 24/5 = 0. What is a? -4, -3, -1, 2 Determine l, given that 2l2/17 + 2l - 120/17 = 0. -20, 3 Find l, given that -3l4 - 27l*3 - 60l*2 - 36l = 0. -6, -2, -1, 0 Let -3o4 + 105o*3 - 297o*2 + 291o - 96 = 0. Calculate o. 1, 32 Factor -v*2/4 - 12v - 47/4. -(v + 1)(v + 47)/4 Determine g so that 5g*5 + 20g*4 - 130g*3 + 220g*2 - 155g + 40 = 0. -8, 1 Factor -j*3 + 21j*2 + 136j - 156. -(j - 26)(j - 1)(j + 6) Factor 4r5 - 20r*4 - 124r*3 - 172r*2 - 72r. 4r(r - 9)(r + 1)2(r + 2) Factor 5b3 - 735b*2 + 2170b - 1440. 5(b - 144)(b - 2)(b - 1) Factor -20z*2 + 1208z + 2496. -4(z + 2)(5z - 312) Suppose -j3/2 - 167j*2/8 - 61j/4 + 41/8 = 0. What is j? -41, -1, 1/4 Suppose -b*5 - 164b*4 + 499b*3 - 334b*2 = 0. What is b? -167, 0, 1, 2 Factor 2f*3/7 - 78f*2/7 - 48f - 344/7. 2(f - 43)(f + 2)*2/7 Solve -3h*4 + 93h*3 - 90h*2 = 0 for h. 0, 1, 30 Factor -4r*3/9 - 4r*2/3 + 4r/9 + 4/3. -4(r - 1)(r + 1)(r + 3)/9 Factor 2w*3/3 - 4w*2 + 10w/3. 2w(w - 5)(w - 1)/3 Factor 5g*3 + 130g*2 + 460g + 440. 5(g + 2)2(g + 22) Let 2p2 + 154p - 156 = 0. What is p? -78, 1 Find c such that -2c3 + 158c*2 + 324c = 0. -2, 0, 81 Suppose -3x4/5 - 378x*3 - 293871x*2/5 + 239652x - 1205868/5 = 0. What is x? -317, 2 Factor -3p3 + 18p*2 - 33p + 18. -3(p - 3)(p - 2)(p - 1) Factor 3p*4/5 + 186p*3/5 + 4323p*2/5 + 8928p + 34560. 3(p + 15)2(p + 16)*2/5 Determine x so that -5x**2	{ "pile_set_name": "DM Mathematics" }
(16757/60) Simplify (x(2/47)/xx/x1)(-3/41)/(x7/(x(1/4)x))(3/29) assuming x is positive. x(-117303/223532) Simplify (cc*(-10)cc(c(c/(c/(cc*20c)))/cc)/c)/((c/((c/(cc/(c/c*(5/11))cc))/c))/ccc/c5) assuming c is positive. c(160/11) Simplify (((hh*(6/5)h)/h*(-12))/((hh*(-1/6)/h)/((hh*(-1/10))/hh)))(-21) assuming h is positive. h(-1708/5) Simplify (n*(3/4)n/n(-1))8/((((n/n*2)/n)/(nn(-3/4)))/((n/n(-1))/nn(2/13))) assuming n is positive. n(1321/52) Simplify ((z(-1/4)z)*(-48)z/z*(-3/11)z*(-2/11))/(((zz/z2)/z)11/(z*(2/5)z*(-2/15)zzz)) assuming z is positive. z(-3406/165) Simplify (((f/f(-7)f)/f)(-17)/(f(-2/17))(-4/3))(-10/13) assuming f is positive. f(69440/663) Simplify ((j/j(-1/16))/j)(27/5)j*(-49)jj(12/7)/j assuming j is positive. j(-26291/560) Simplify (((b(-1/9)b(3/5)/b)/(b(-6)/((b*3/bb)/b)))36)6 assuming b is positive. b(8088/5) Simplify ((z(-2/7))*(2/61)(z(-2/3))7)/((z(-7)/(((z(-2/7)/z)/z)/z))/(z/z*(2/9)z)(-1/28)) assuming z is positive. z(-3940/3843) Simplify (b*0/(bb*5/bb))/(b(-1/3))(-5/13)(b(4/5)/b(-2/3))/((b(bb(-2/7))/bb)/b6) assuming b is positive. b(-171/455) Simplify ((t3)(-7/6)/(t/t*(5/3)t)(-14/3))(11/4) assuming t is positive. t(-385/72) Simplify (r(3/7)rrr2)/(r/(r(2/7)/r))(-1/15)(r(-1))(16/5)(rr/r*(1/2)r)/r0 assuming r is positive. r(269/70) Simplify ((xx(2/7)xx/(xx*(-1/10)x))/(x/((x/x*(-2/7)x)/x)(xx/(x/x*4)x)/x))/((xx((x*(-8/5)/x)/x)/x)/(xx(-4)))30 assuming x is positive. x(-1073/70) Simplify ((((j/j(2/13)j)/jj)/((j(j/j(-2/19))/j)/j))/(j5/j)(15/2))(2/53) assuming j is positive. j(-13960/13091) Simplify (((w(((w*(3/5)/w)/ww)/w)/ww(1/3))/(ww(1/2))37)(-2/3))(-2/73) assuming w is positive. w*(-3394/3285) Simplify ((k/(kk(-1/11)))/(k/k(2/49)))/(k12)(-3/23) assuming k is positive. k(8640/12397) Simplify (p16pp)(3/7)/((p/(p/(p(-8/7)/p)))/p(-2)) assuming p is positive. p(55/7) Simplify (y*(1/4)yy8(y(-9))5)(-5/6) assuming y is positive. y(715/24) Simplify ((f(-2/3))(1/24)(f(-3)/f)/(f/f19))(-41) assuming f is positive. f(-20623/36) Simplify ((t/(((t24/t)/t)/t)tt(-15))(-1/39))(-2/37) assuming t is positive. t(-68/1443) Simplify ((o1/(o(-2)o))/(o(-1/5)/(o/o(2/9)o)))/((o/o(1/7)((oo5oo)/o)/o)/(o(-2/5)/o)(-2/149)) assuming o is positive. o(-134261/46935) Simplify l/l5ll8l*(2/29)l*0/l(l/(l*12/l)l/l(10/3))(7/6) assuming l is positive. l*(-5387/522) Simplify (l/(((ll(-5/2))/l)/l))/l(-40)(l/(l6/l))(7/2) assuming l is positive. l(61/2) Simplify (q(-1/5)q*7/qq)30/((q(-1))8/(q/q0)25) assuming q is positive. q237 Simplify (((y/((y(-3)/y)/y))16/(yy2y(y(y/y*12)/yyy)/y))(1/4))49 assuming y is positive. y(2499/2) Simplify j/j(-39)j*12jjjj(5/13)j/(jj/j(11/6)) assuming j is positive. j(4385/78) Simplify (x(-4)x(-2/5))/(x(-2/5)x)30((x/(xx6/xxxx))/(x/x(-1)))/(x6x/x(-2/13)) assuming x is positive. x(-2571/65) Simplify (cc(1/6))/c7c/(c(-1/4)c)c(2/11)(c/c*7c/(c/(c/c6)))/(c/c1)(3/32) assuming c is positive. c(-2165/132) Simplify (k/(kk(1/19))(kk8k)/kk((k/k*(-1/4)k)/k)/k(((k(-6)/k)/k)/k)/k)39 assuming k is positive. k(585/76) Simplify ((z/(z(1/11)z)z(1/40)z)/((zz(-3/8))/z)28)(7/9) assuming z is positive. z(3913/440) Simplify (((ww/w*(1/2)w)/(((w*(1/2)w)/w)/w))/((w(4/5)/w)/(w(2/9)w)))/(w(3/4)/(w/(w/(w/w(-4))))(w*1w)/(w*(-1/7)w)) assuming w is positive. w(9487/1260) Simplify z/z(1/41)z/(z/z(-2/9))z*(15/7)zzz(-39) assuming z is positive. z(-88090/2583) Simplify ((a/((a(-1)/a)/a))(2/3))*(2/13)/(((a/((a/(aa*1))/a))/aa)(4/9))28 assuming a is positive. a(-480/13) Simplify (b(-1)b(-1)(b(-1))(-19))/((b(b/(b/(b/((bb*(1/4)b)/b))))/b)/b(-1))29 assuming b is positive. b(-19/4) Simplify (((i/(i/i1))/i)*2((i/(i/(i/i*1i)))/iii)*(-17))/((((i(ii/i2)/i)/i)/(i/i(1/4)))/(i1)(-25)) assuming i is positive. i(-229/4) Simplify (((vv6)/v)/(((v(1/5)v)/v)/v))/(v/v(-1/4)vv3)(vv(2/11)/vv*5)/(vv*(-1/6)vv(2/11)v) assuming v is positive. v*(223/60) Simplify ((t(t/(t/(ttt1)))/t)(-20)/((t*(-3/4)/t)/(t/(tt*6))))/((ttt(-1))/t(-3))(1/33) assuming t is positive. t(-8497/132) Simplify (((k/(kkk/(kk*(2/21)k)kk))/k)/kk2)/(k0k/(k/(k/(k/k*(1/8)))))((kkkk(-2/7))/k(-1/10))9 assuming k is positive. k(19571/840) Simplify ((z/z(-4/3)z*(3/2))/(z(z((z0z)/z)/z)/z)(-3/29))/(z1z2z*(-2/5)(z/(z*(-3)/zz)z)/z) assuming z is positive. z(-83/30) Simplify (v4/(v/(v0/v)v))/(v/((vvv*(2/11))/v)v*(4/7))(((v/(vv/v(-5)v))/v)/v2)/((v/v(-1))/v)43 assuming v is positive. v(-4034/77) Simplify ((k(3/2))(2/9))*(-12)(((k/(k/(kk(2/9))))/kk)(-11))(-6) assuming k is positive. k*(230/3) Simplify ((g(gg0)/g)48)(-22)((g(3/5))(-26/3))(-32/3) assuming g is positive. g(-15008/15) Simplify ((v/(v/v*(-3))(vv(2/11)/v)/v)/((v/v21)/(v/(v/((v/(vv(-8)))/v)))))31 assuming v is positive. v*(7905/11) Simplify ((yy/y*(-1/10)y)/(y*2yy))44/(y(-2/3)/(y/(yy*(-5)yy))(y/(yy(-2/7)/y))(-29)) assuming y is positive. y(142/105) Simplify (((xx(-26))37)(-26))(2/11) assuming x is positive. x*(48100/11) Simplify ((vv(-2/3))(-6/19)v7/v4)/((v/v5((v/((v*(-2/9)vv)/v))/v)/v)/(v(-5)vv7/v)) assuming v is positive. v(1825/171) Simplify (((z2z(1/9))31)23)(-2/15) assuming z is positive. z(-27094/135) Simplify (b(-1/2))*(8/17)b*1b/(b(b(bb(-1/3))/b)/b)((((b*(2/13)b)/b)/b)(-4))(-41) assuming b is positive. b*(-91276/663) Simplify (g/(g(g*(-1/4)g)/g)g(-1)/gg/g*6g(6/11))10 assuming g is positive. g*(-1365/22) Simplify ((ff(-29))/f)(7/11)/(f*(-19/5)fffff/f11) assuming f is positive. f(-476/55) Simplify (r/(r(2/7)/r))47/(r/((r(r/((r/r(-1))/r)r)/rr)/r)r*(2/3)r)(r/(rr*3rr))/((r/r(1/6))/rr)r(3/7)/(r(2/7)r) assuming r is positive. r*(1011/14) Simplify (y(y/y0)/y)(-13/5)((y/y(-1/4)y)/y)*(-1/11)((y(2/3))(5/3))1 assuming y is positive. y(-3173/1980) Simplify n(3/5)/(n/(n/(n(-2/3)n)))n/n*(-2/7)nn(-2)n(nnn(3/5)n*(6/13)/nn)(-23) assuming n is positive. n(-93998/1365) Simplify ((uuu*(7/3)uu(-7)u)/(((uu2/uu)/u)/uu)(1/5))(2/49) assuming u is positive. u(-32/735) Simplify (((zz(z/(z(-2)z))/z)/z)/z*(-4)z*(2/11)z/(z*2zz))/((z(-5)/zz)/z(2/21))(-1/7) assuming z is positive. z(3968/1617) Simplify ((y(-2/27))*(-2/3)(y/((y*(-2/43)/y)/y))/((y/(y/((y(yy(-3/19))/y)/y)))/y))(1/16) assuming y is positive. y(281503/1058832) Simplify (((xx(-1/8))/x(-3)(xx(-2/5))(-3/25))(-6/13))32 assuming x is positive. x*(-91272/1625) Simplify (((xx(-2/7)/x)/x)(-48)(x(x1/x)/x)28)/(x(-4)/x(-4)xx/x*(-1/7)x/(x*(2/13)xx)) assuming x is positive. x(5526/91) Simplify ((k/k(2/51))/k(-6)k/(k/k*(-2/23)k)k(-1/31))4 assuming k is positive. k(849668/36363) Simplify ((c(cc(1/5)/c)/c)/(c(-2/21)/c))(-9/4)((c(-3/8)/c)38)(-32/7) assuming c is positive. c(8258/35) Simplify ((((ss/((s(-2/5)/s)/s))/(s6s))(-44))(1/19))(-8/13) assuming s is positive. s(-352/95) Simplify (((bb/(b(-8)/bb))/b)/((b/(b*7bb)b)/bb))(-2)(((b/(b*(3/2)b))/b)/b)/(b/(bb(-6)/bb))(bb(-2))(-13) assuming b is positive. b*(-57/2) Simplify ((rr/(r/r0))8/(r/r*(-3)r5))/(r/r(1/5)r((r/(r*(-3)/rr)r)/r)/r)(-31) assuming r is positive. r(739/5) Simplify (p8pp/p(-8)p(p(2/7))(3/37))/((pp*(-2/25)/p)/(p/(p/(p/(p/(p/(pp*(-2/15)))))))(p2)(2/111)) assuming p is positive. p*(124323/6475) Simplify ((vv*(-1)/vv)*(1/6)/(vv*(4/5)(v*2/v)/v))/((v(v/(vv5))/vvvv)(2/27))(-45) assuming v is positive. v(-127/15) Simplify ((((v/v(-2/15))/((v/(vv*(-8)))/v))	{ "pile_set_name": "DM Mathematics" }
37v. Let n(c) = -3u(c) + 5z(c). Find the second derivative of n(r) wrt r. 1224r Let k be 1/(-2 + 3) + 4. Find the third derivative of -111vk + 12v*2 + 84v*5 + 52v*5 wrt v. 1500v*2 Suppose -4u = k - 44, -5u = -3k - 62 + 24. What is the second derivative of -8b + 34b - 62b - ub*2 wrt b? -20 Let g be (-103)/((-20)/(-12) + (-4 - -2)). What is the third derivative of -14j*2 - 6j*2 - 8j*5 - gj*3 + 309j*3 wrt j? -480j*2 Find the second derivative of 17s + 53s - s2 + 0s*2 + 20s + 18s3 wrt s. 108s - 2 Let f(j) be the third derivative of 11j5/4 + 7j*4/6 - 50j*2. Find the second derivative of f(p) wrt p. 330 Suppose 4t = -5j + 63, -3j + 4t = t - 27. Differentiate -64u*3 - 2 + 51u*3 - j with respect to u. -39u*2 Let w be (-3)/6160/(-16). Let o(p) be the second derivative of -7/20pw + p3 + 0 + 0p*2 + 0p*4 - 9p. What is the second derivative of o(a) wrt a? -42a Suppose 0 = -3r + 5r + 2u - 4, 10 = 5r + u. Suppose r = i - 1. What is the third derivative of -f2 + if*2 - 4f*5 - 64f*3 + 64f*3 wrt f? -240f*2 Suppose 3h - 16 = -4q, 2h + 1 = -q + 5. Suppose 0k - 2k = h. What is the third derivative of 10f3 - 9f*2 + 0f*3 + 0f*3 + kf*3 wrt f? 60 Suppose 4t = x + 13, 4t - 19 - 14 = 5x. What is the third derivative of 13a2 - 6a*t + 14a*2 - 22a*5 wrt a? -1320a2 Find the third derivative of w3 - 272w5 + 5w*2 + 242w - 128w - 121w wrt w. -16320w2 + 6 What is the third derivative of -11d*2 - 30d*2 + 4d*4 - 19d*2 - 2d*3 wrt d? 96d - 12 Find the first derivative of 47i2 + 51i*2 + 50i*2 + 155i*4 + 523 + 2i*3 - 148i*2 wrt i. 620i*3 + 6i2 Let p(n) be the third derivative of n9/168 - 29n7/210 - 37n*5/20 - 8n*2 + 4. Find the third derivative of p(d) wrt d. 360d*3 - 696d What is the second derivative of 63u4 - 386u*2 - 163u*3 + 163u*3 + 819u - 64u4 wrt u? -12u*2 - 772 Let f(x) be the first derivative of 0x*5 + 0x*6 + 0x*2 + 0x + 12 - 23/3x3 + 0x*4 - 22/7x*7. What is the third derivative of f(q) wrt q? -2640q*3 Let z(w) be the first derivative of 16 + 0w*2 - 3/5w*5 + 0w*3 + 0w*4 - 4w. What is the derivative of z(n) wrt n? -12n3 Let o(i) be the third derivative of i7/42 + i6/12 - 13i*5/30 - 17i*2 + 3i. Find the third derivative of o(z) wrt z. 120z + 60 Find the second derivative of x3 + 34x*4 + 98x - 268x + 120x wrt x. 408x2 + 6x Let f(s) = 856s2 - 9s - 432. Let y(d) = -215d2 + 2d + 108. Let k(g) = 2f(g) + 9y(g). What is the derivative of k(t) wrt t? -446t What is the third derivative of -8b*2 - 303b + 10b2 - 97b - 27b3 wrt b? -162 Suppose 0 = 4z, z + 4 = 2y - 3z. Find the second derivative of -j + 7jy + 13j*2 - 21j*2 wrt j. -2 Let j be -4 + 14 + (5 - 2). Suppose -5u + 7 = -j. Find the third derivative of 13k4 + 0k*2 - 10k*2 - 5k*u wrt k. 192k What is the third derivative of -2s - 110s*2 + 78s*2 - 19s*3 - 41s*3 wrt s? -360 Let x(q) be the first derivative of -57q*4/4 - 47q - 52. Differentiate x(o) with respect to o. -171o2 Let n(a) be the first derivative of 38a*3 - 3 - 37a*3 - 5 + 11a*2. What is the second derivative of n(u) wrt u? 6 Let u(r) = 3r*3 + 2r*2 - 10. Let d = -28 + 21. Let f(m) = -9m*3 - 7m*2 + 31. Let j(w) = du(w) - 2f(w). Differentiate j(b) wrt b. -9b*2 Let g(v) be the first derivative of -55v7/7 - v5 - v*3 - 4v*2 + 3. What is the third derivative of g(t) wrt t? -6600t*3 - 120t Let l be 1 + -1 + 3 + 1. Differentiate -8 - 15 + 0 - 22ul + 6u*4 wrt u. -64u*3 Find the second derivative of 15i*2 + 56i + 67i - 162i*2 wrt i. -294 Let w(l) be the second derivative of -1/4l*8 + 0l*3 + 0l*6 + 0l*2 - 5/6l*4 + 0l*5 + 0l*7 + 11l + 0. Find the third derivative of w(u) wrt u. -1680u3 Let o(r) = -5r - 12. Let w be o(-3). What is the second derivative of -31b3 - 14b*3 + 23b*w - 15b wrt b? -132b Suppose 2y + 21 = t, -18 = -0y + y - 2t. Let u be (-6 - -2)12/y. Differentiate 3 - 6 - 1 - uo*3 + 1 with respect to o. -18o*2 Let v(z) = 26z*2 - 2. Let k(f) = -26f*2 + 3. Let m(y) = 1. Let i(x) = -k(x) + 2m(x). Let p(t) = 5i(t) - 6v(t). What is the derivative of p(h) wrt h? -52h Let h(l) be the third derivative of 83l*6/120 - 11l*3/3 + 127l*2. What is the derivative of h(j) wrt j? 249j*2 Find the second derivative of -66w*3 + 146w*3 + 51w - 52w + 208w*3 + 110 wrt w. 1728w Let m(s) = -4s2 - 25s + 2. Let c(g) = -9g2 - 51g + 5. Let n(b) = -2c(b) + 5m(b). Find the second derivative of n(l) wrt l. -4 Let o(v) be the second derivative of 14v6/15 + 23v*2 + 13v + 2. Differentiate o(p) with respect to p. 112p3 Find the third derivative of 1219336o*4 + 146o*2 + 224o*2 - 1219390o*4 wrt o. -1296o Let p(h) = -18h3 + 23h*2 - 4. Let k(g) = -33g + 7 + 33g - 45g*2 + 35g*3. Let s(i) = -4k(i) - 7p(i). Find the third derivative of s(y) wrt y. -84 Let a(g) = -g2 + 2g + 130. Let i be a(0). Find the first derivative of 4k + ik*2 - 2k - 128k2 - 19 wrt k. 4k + 2 Let s be (168/9)/(-7)(-3)/2. What is the second derivative of 1062 - 9f*s + 10f - 1062 wrt f? -108f2 Let k be (8 + -9)3-1. Find the second derivative of -km*3 + 0m + 14m3 + m + 4m wrt m. 66m Suppose -4u + 3y - y = -236, -3u + 5y = -170. Let r be (-24)/84 - u/(-14). Find the third derivative of 3x*r + 1 - 3 + 2 + 6x*2 wrt x. 72x Let x(b) be the third derivative of -b8/336 - b6/30 + 20b4/3 + 148b*2. Find the second derivative of x(t) wrt t. -20t*3 - 24t Find the third derivative of -102p3 + 41p*5 + 101p*3 - 5p*5 - 116p*2 wrt p. 2160p2 - 6 Let f(n) = n2 + 7n - 4. Let c(s) = 2s + 4. Let h be c(-6). Let j be f(h). Find the first derivative of 7z4 + 0 - 4z*j - 7 wrt z. 12z3 Let j(m) = m3 - 6m2 + 5m + 6. Let f be j(5). What is the second derivative of -7q4 - fq - 4q4 + q - 6q wrt q? -132q2 Let c(m) = -m2 + 2m + 26. Let t be c(6). Find the third derivative of -16f6 + tf*2 - 36f*2 + 12f*6 wrt f. -480f3 Let o(x) = x3 - 2x + 22. Let k be o(0). Let f(b) = -b + 31. Let g be f(k). What is the derivative of -17 + gp + 4p + 2 wrt p? 13 Let q(n) = n2 + 2n - 3. Let f be q(0). Let c be -2 + f - -1 - -9. Find the second derivative of 4bc - 5b - 2b + 4b + 3b5 wrt b. 140b*3 Suppose 5w + 55 = -5n, -2n + 6n + w = -50. Let x = n + 15. Find the first derivative of 5p*2 - 1 - 2 - x wrt p. 10p Suppose 18c = 15c + 18. Let g(x) be the third derivative of 0 - 1/6x3 + 0x*4 + 0x + 7x2 - 1/42x*7 + 0x*5 + 0x*c. Differentiate g(w) wrt w. -20w*3 Let n(q) be the first derivative of -6q + 15q + 3 - 3q*2 - 2q*2 + 4q. What is the first derivative of n(b) wrt b? -10 Suppose -2f - 15 = 1. Let x be f/(-10) + 33/15. What is the derivative of -9j*3 + 5j - 3j - 2j + x wrt j? -27j2 Let d(p) = 2p*2 - 3p + 1. Let s = -1 - 2. Let n be d(s). Find the third derivative of nt6 - 24t*6 + 2t*2 + 2t*2 wrt t. 480t*3 Suppose -3u = 5p - 0u - 22, -p + 3u = -8. Let b = -34 - -82. What is the third derivative of -28z*5 + 10z*2 + bz*5 - 23z*p wrt z? -180z*2 Let y(l) = -2l + 1. Let t(r) = -8r3 + r2 - 2r + 148. Let u(c) = 2t(c) - 2y(c). Find the third derivative of u(o) wrt o. -96 Let r(w) be the first derivative of -w*7/840 - 7w*6/90 + 2w*3/3 + 8. Let p(a) be the third derivative of r(a). Find the third derivative of p(c) wrt c. -6 Suppose -4u = 5c - 39525, -2 - 4 = 2c. Find the third derivative of 3p4 + 14p*4 - 9866p*2 + up*2 wrt p. 408p Find the second derivative of -h - 75h5 - 4h*2 - 9h*5 - 16 - 445h*5 + 4h*2 wrt h. -10580h*3 Let o = 21 - 17. Suppose -7f + 2f + 25 = 0. Find the second derivative of -s + 7s + 7s5 + 0s*f - os wrt s. 140s3 Let z = 73 + -53. Find the first derivative of m2 - 18m*2 + z - 10 wrt m. -34m Let k(j) be the first derivative of 118j5 + 623j + 262. What is the first derivative of k(n) wrt n? 2360n3 Let f(w) = -w2 - w + 2. Let i(o) = 343o*3 - 18o*2 - 10o + 10. Let d(x) = -5*f(x) + i(x). Find the third deri	{ "pile_set_name": "DM Mathematics" }
*3 + qx*2 + yx and give q. 0 Rearrange 53 - 48 + 0v + 0v + 6v2 to zv + ov2 + h and give o. 6 Rearrange (2 + 0 - 1)(-2g + 4g - g) to the form pg + z and give p. 1 Rearrange (2j - 2j + 2j*2)(-7j2 - 4 + 4) + 0j4 - 1 + 3 + j4 to the form c + rj3 + hj*2 + xj*4 + gj and give c. 2 Rearrange (-2g2 + 3g - 3g)(g - g + 3g2) + (-4 + 5g + 4)(0g3 - g3 + 3g3) to tg*2 + ng + fg4 + kg*3 + j and give f. 4 Express -20p + 28p + 61p as o + mp and give m. 69 Express (-10 - 9 - 9 - 4)(z - 5z + z) as r + sz and give s. 96 Express (50 - 12 - 12)(-2v + 2v - 2v) as zv + h and give z. -52 Rearrange 0c*4 + 3c3 + c2 - c*4 - 2c4 + c4 to mc4 + kc*2 + a + uc*3 + jc and give k. 1 Express -s*2 - 6s2 - s2 - 3s - 2s*2 + 3s + (2 + 2s - 2)(-s - 2 + 2) + (s + 3s - 5s)(-2s - s + s) as os2 + bs + r and give o. -10 Express -8n - 3n - 6n + 2n as q + xn and give x. -15 Express 3y - 20 - 5y + 28 as c + wy and give c. 8 Express -52j4 + 52j + 3j4 - 50j + (-2j2 + 4j - 4j)(-2j2 + 1 - 1) as kj*4 + aj*3 + b + wj*2 + yj and give y. 2 Express 6u - 8u - 27u + u as b + fu and give f. -28 Rearrange -16m2 - 31m*3 - 14m*2 + 2m + 30m2 to the form c + gm*3 + ym*2 + tm and give g. -31 Rearrange (1 - 1 - 6)((1 + 1 - 1)(3i + 3i - 4i) - 2 + 9i + 2) to the form s + gi and give g. -66 Express (-9l2 + l2 - 5l2)(4l - l - l) + (l + 2 - 2)(-1 + 1 - 2l2) in the form t + fl*3 + dl + zl2 and give f. -28 Rearrange 4t*2 - 5t*2 + 3t3 - t3 - 4t3 to vt + rt3 + d + st*2 and give s. -1 Express (4 + 1 - 3)(3w + 0w - 6w)(-8 - 4 + 5) as dw + l and give l. 0 Express -16 - 19 - 4y + 61 - 20 as hy + d and give h. -4 Rearrange (-1 + 2 + 3)(-2j - 21j - 30j)(j*3 + 0 + 0) to hj*3 + mj*2 + vj*4 + xj + l and give m. 0 Rearrange (-t*3 - 2t + 2t)(2t + 0 + 0) - 3t4 + t4 - t*4 + (0t2 - t2 - 2t2)(t*2 + 2 - 2) to st*4 + pt + v + ht3 + ut*2 and give s. -8 Express -10k - 20k2 - 19k + 29k in the form t + gk*2 + ik and give g. -20 Rearrange (1 - 2 - c + 2)(15c*2 - 11c*2 + 15c*2) + (2c*2 - 3c2 - c2)(-c + 1 - 1) to dc + mc2 + fc*3 + y and give m. 19 Rearrange 1 - 11q*3 - 652q*2 + 652q*2 - 2q to the form kq2 + vq + fq3 + m and give k. 0 Express -5c*2 - 51c + 51c + (-4c + c + c)(-2 + 2 - 2c) in the form u + tc2 + xc and give t. -1 Rearrange (-1 + 0 - 6)(-4a + 3a + 3a + (-4a + a + 2a)(0 + 0 - 1) + 40a + 53a - 71a) to the form ba + h and give b. -175 Express -189z*4 + 190z*4 - z + 3z2 - z2 in the form wz2 + bz*3 + yz*4 + p + oz and give w. 2 Express 0p + 4p + p - 3p + 3p*4 + 5p*3 + 2p*2 in the form qp + ap4 + vp*3 + zp*2 + t and give v. 5 Rearrange (2 - 4 + 1)(-11 + 4i + 11)(2 - 2 - 3) to the form n + oi and give o. 12 Express 56 - 27 - 3f - 30 as jf + d and give d. -1 Rearrange 6v + 2v4 - 6v - 3v2 - 6v*4 + 2v*4 + 2v*4 + (v - 5v + 2v)(-v + v*3 + v) to qv*3 + m + xv + tv2 + av*4 and give t. -3 Express 2a*4 + 616 - 621 + 4a*2 + 2a*2 - 2a in the form za3 + ba + ja4 + ha*2 + c and give c. -5 Rearrange -25 + 0x2 - x3 - 5x2 - x + 25 to the form vx + yx2 + w + rx*3 and give y. -5 Rearrange 7 + 11g3 + g4 - 4g2 - 6g*3 + 5g*2 to qg*4 + kg + w + pg2 + fg*3 and give w. 7 Rearrange 2w*2 + 65w - 3w3 - 65w to the form i + lw + aw*3 + nw*2 and give n. 2 Rearrange 2n*3 - 6n - 5n2 + 6n to mn3 + bn*2 + x + kn and give k. 0 Express -2i3 + 3i*3 - 5i*3 + (-2i*2 + 4i*2 + 0i*2)(-i - 2i + i) - 2 - 29i*3 - 27i*3 + 20i*3 as qi + yi2 + hi*3 + c and give c. -2 Rearrange -3c*3 - 2c*3 + 6c3 + 7 + c2 + 2c4 to the form lc*2 + mc*4 + b + sc + xc3 and give m. 2 Express (3y - 6y + 2y)(-y3 - y2 + y2) - 4y4 + y4 + 2y4 + (0y + y*3 + 0y)(0y - y + 3y) as wy*3 + gy + ay4 + my2 + s and give a. 2 Express -p + p4 + 7p2 - 2p*3 - 5p*2 + 0p*3 in the form h + dp*4 + tp*2 + kp*3 + fp and give t. 2 Express 7k2 - 6k*2 + 158k - 51k as vk + wk2 + g and give w. 1 Express -v2 + 14 + v - v - 33 as qv + ov2 + m and give o. -1 Rearrange (4 - o3 - 4)(2 - 5 + 1 + (1 - 3 + 3)(2 - 4 + 3) - 3 + 1 + 1)(-4o + 5o - 2o) to bo*3 + ho*4 + s + io + xo2 and give h. -2 Rearrange 11k - 5k + 18k to the form r + ok and give o. 24 Rearrange (-2q + 1 + 0q + 3q)(32 + 29 - 7) to the form oq + c and give c. 54 Express -53h2 + 8352h - 8352h in the form gh*2 + b + kh and give g. -53 Express -v*2 + 12v*3 - 17v*3 + v + 3v*2 as t + rv + mv2 + ov*3 and give o. -5 Express -100m + 2 - 4 + 19m + 0 as c + rm and give c. -2 Rearrange -80 + 42 + 38 - 95z to vz + l and give v. -95 Rearrange (x - 11x + 0x + (-x - 1 + 1)(-1 + 1 - 1))(0 + 0 + 7x2) to the form p + lx + bx3 + sx*2 and give b. -63 Rearrange (3y + 3y - 5y)(4y*2 + 8y - 8y + y3) to wy*4 + by*2 + qy*3 + xy + l and give w. 1 Express (1 - 2 + 0)(1 - 3d - 1 + (23 + 55d - 23)(5 - 1 - 3)) as n + md and give m. -52 Express (5 - 3 + 0)(-3c + c + c)(-1 - 8 + 2) as gc + b and give g. 14 Rearrange 75d - 75d + d2 + 1 - 11d*2 to vd*2 + nd + c and give v. -10 Express -d - 7d3 + 0d + 5d - 5d as f + kd + md*3 + yd*2 and give m. -7 Rearrange 1 - 27j*2 + 2 + 51j*2 + 2 to the form hj + g + vj2 and give g. 5 Express -2d + 2d + d2 + (-4d + 4d + 3d)(0d + 3d - 5d) + (3d + d - 2d)(-5d + 3d + d) in the form kd*2 + x + hd and give k. -7 Express (3y - 3y + 2y3)(2y + 1 - 1) - y + y + y4 + 6y*4 - 4y*4 + 28y*4 in the form vy*2 + ky*4 + p + jy + cy3 and give k. 35 Express -3d*2 - 7 + 4 - 6 + 5d*2 in the form q + ud*2 + hd and give q. -9 Express -26m2 - 55 + 23 + 30 in the form im + k + zm2 and give z. -26 Express -12v + 4v + 5v + v*2 - 3v*3 in the form k + jv*3 + fv*2 + cv and give c. -3 Rearrange (g*2 + 0g*2 - 2g*2)(-6g + 33g - 2g - g + 0g - g + (2 - 3 + 2)(0g - g - g) + g - 2g - g) to the form cg*2 + dg + jg3 + q and give j. -19 Rearrange 5 - 5 + 0 + 71f*2 - 2f to lf + b + yf*2 and give l. -2 Rearrange (-2t*4 - 2t + 2t)(16 + 7 + 6) to pt4 + nt + mt3 + l + gt*2 and give m. 0 Express 47 + 37 + 3k*2 - 114 + 43 in the form ak + mk2 + y and give y. 13 Rearrange 9l + 5l + 14l to o + jl and give o. 0 Express (-2q + 2q + 2q)(62 + 16 + 31) as aq + m and give a. 218 Rearrange (2y3 + 2y*3 + 12y*3)(-2y + 0y + 0y + (-y + y - y)(1 + 2 + 1)) to the form my4 + cy*2 + ly + t + dy3 and give d. 0 Express 2a*3 - 6 + 2 + 2 + 3a*3 - 3a3 - a3 + (a + a + 0a)(-1 + 1 - 2a2) + 1 - a3 - 1 as za*2 + ja + na3 + q and give n. -4 Express -9i - 14i + 1 - 3 + 12i - i*2 in the form bi + y + ti2 and give y. -2 Rearrange -3h - 28h3 + 29h*3 + 4h to the form kh3 + oh + gh2 + v and give o. 1 Rearrange -39b*2 + 39b*2 - b - 10b*3 to the form d + kb + tb2 + sb*3 and give s. -10 Rearrange -10t + 7t + 4 + 2t to the form v + nt and give v. 4 Rearrange i4 + 12 - 3i - 13 - 2i3 + 4i*4 - 3i*4 to the form oi*2 + ni + wi3 + ti*4 + b and give t. 2 Rearrange (3 - 4 - 1)(-o + 4 - 4)(-3o + 4o - 5o) to to2 + wo + u and give t. -8 Rearrange (-1182 - 13o + 78o + 1182)(-o2 + 2o*2 - 2o*2) to the form io + m + do3 + lo*2 and give d. -65 Rearrange -3m*3 - 5m + 5m3 + 35 + m4 - 35 + 2m*2 to im + sm4 + g + fm*2 + hm*3 and give f. 2 Express 8g*2 + 8g*2 + 8g*2 as n + sg*2 + cg and give s. 24 Express 13 - 3q2 + 8 - 26 as jq*2 + i + nq and give i. -5 Rearrange -3 + 62h - 60h + 0 + 7 to m + vh and give v. 2 Rearrange (2 - 1 + 0)(-c + 3c - 4c) + (4 - 4 + 2c)(-2 + 2 - 1) + (-4 + 0 + 2)(4c + 2 - 2) to the form h + yc and give y. -12 Rearrange -i2 + 5i*2 + 0i*2 - i to the form di + q + bi2 and give b. 4 Rearrange -4f + 5f + f2 + 1 + 1 - 1 + f4 - 2f*3 to df + m + bf2 + wf*3 + cf**4 an	{ "pile_set_name": "DM Mathematics" }
for v. -1 Let f(t) = t + 10. Let m be f(-6). Solve 6 = mz - 2 for z. 2 Suppose -4q + 56 = 5i, q + 4i - 20 = 5. Suppose 3p = -0p - q. Let l be (p/((-9)/12))/2. Solve 4 = -0a - la for a. -2 Suppose 4n - 3f - 23 = 0, 3 + 0 = -3f. Solve -a - 4 = -n for a. 1 Let a(s) = -s + 15. Let q be a(11). Solve 0g = 2g + q for g. -2 Let m = -118 - -121. Solve 0 = mv + v - 16 for v. 4 Let n = -92 + 94. Solve -nt = 2t + 12 for t. -3 Suppose -3a - 27 = -4m, -5a - 17 = 4m - 6m. Solve 6 = -4g - m for g. -3 Suppose -b = b + 10. Let y be 17 + (-5)/(b/(-2)). Let o = y - 4. Solve -5a = 1 - o for a. 2 Suppose -33 = -l - 3l + 5z, -5l = z - 5. Solve lf - 8 + 0 = 0 for f. 4 Let j = 16 - 10. Suppose 0s + 5n = s - 13, -2n = 5s - 11. Let x = j - s. Solve -xd + 10 = 1 for d. 3 Let y = -39 - -64. Let u = y + -7. Suppose 3p - 5f = -2f + u, 4p + 1 = -f. Solve -3i - 2 = p for i. -1 Let y(u) = -4u. Let x(v) = 5v - 1. Let l(k) = -5x(k) - 6y(k). Let p be l(5). Solve -5s + 1 - 26 = p for s. -5 Suppose 0 = 3d - 2p + 228 + 124, 4d - 5p = -481. Let g be d/(-9) + (-4)/6. Solve -g = u + 3u for u. -3 Let r be 6/9-1-24. Let n = r + -10. Let p be n/4 - (-3)/(-6). Solve 2w - 1 = p for w. 1 Let j = -13 + 20. Let y = j - 5. Solve o = 2o - y for o. 2 Let u(a) = -a2 + 6a - 6. Let f be u(6). Let b be 17f/(-7). Suppose -2y = -4y + b. Solve j + yj = 0 for j. 0 Suppose -3k = -5k + 10. Let o(q) = -q + 9. Let y be o(k). Solve 8 - y = -4n for n. -1 Let j = -3 + 6. Suppose 0 = 4i - j - 9. Suppose 0 = v - 1 - 1. Solve -vg = ig + 15 for g. -3 Suppose -4h = h - 20. Let p(a) = a*3 + 2a*2 + a + 1. Let n be p(-2). Let t be (-2 + 2)(-1)/n. Solve t = hg + 7 + 9 for g. -4 Let y(i) = i3 + 5i*2 + 4i + 3. Let c be y(-4). Solve cl + 4 = 10 for l. 2 Let t(s) = s2 + 2s - 1. Let p be t(-4). Solve -3h = -22 + p for h. 5 Let u(g) = g3 + 5g*2 + 5g + 6. Let k be u(-4). Let a be -3 - (-6)/3 - -2. Solve -kr - 3 - a = 0 for r. -2 Let y be (-4)/(-24) + 31/(-6). Let j(d) = d - 1. Let a be j(y). Let z be a/(-27) + 50/18. Solve -z = p - 1 for p. -2 Let v = -4 + 22. Suppose 4p = v + 14. Solve -4 = -3i + p for i. 4 Let m(a) = 4 - 3a*2 - a + 0a*2 + 2a*2 + 5a. Let d be m(4). Solve 0 = -3z + z - d for z. -2 Let d(n) = -n2 - 6n - 7. Let p be d(-5). Let s be p/4 + 219/(-6). Let f = -21 - s. Solve -5u = -u + f for u. -4 Suppose 0i + 3i - 34 = -4b, -4b = -i - 10. Let k be (0 + (-15)/i)-2. Suppose 0 = 5h - 3u - 20, -2h - ku - 4 - 19 = 0. Solve -7 = 2s - h for s. -3 Let j be (1/3)/((-2)/(-24)). Suppose -4q + z - 10 - 8 = 0, -4q = -4z + 24. Let o = q + 7. Solve -j = t - o for t. -1 Suppose 2k = -3k + 10. Let b be ((-1)/2)/(k/(-8)). Solve -bw - 3 = w for w. -1 Let d be (3 + (-3 - -2))-2. Let n be (-4 - d)(-1)/2. Suppose -3h + nh = 0. Solve 0 = 3b - hb + 3 for b. -1 Suppose 4a = -8 + 40. Solve -4f = -8f - a for f. -2 Let l be -22/6 + (-385)/(-105). Solve 2j - 5 = l for j. 4 Let m(t) = -t + 10. Let n be m(7). Solve c = nc + 6 for c. -3 Let r = 36 - 36. Let l be 0/(-2) - (2 + -1). Let i(a) = -a3 + 2a*2 + 2a + 1. Let b be i(l). Solve r = -bw + 10 for w. 5 Let c(n) = n3 - 5n*2 - 4n - 7. Let f be c(6). Let s = f + -5. Solve si = -5i for i. 0 Let g = 12 - 7. Let b be 26/7 - 4/(-14). Suppose -4 = -br, r + g - 1 = 5n. Solve -2k + 3 - n = 0 for k. 1 Suppose -2z + 13 = w, 0 = 4z - 15 + 3. Solve -3 = -j - w for j. -4 Suppose 2w + 3n + n - 66 = 0, -3w + 4n + 89 = 0. Suppose 5a = 4o + w, 5a + 0o = -o + 11. Solve -ay = -7 + 1 for y. 2 Let k(f) = f. Let h = -10 + 18. Suppose -h = -2y - 3y - 3s, -s = y - 2. Let b be k(y). Solve b - 9 = -4q for q. 2 Suppose -5a = -3a. Solve aw + 8 = 2w for w. 4 Let r = 3 - 1. Solve a - ra + 4 = 0 for a. 4 Let p = -6 - -10. Let u(o) = o + 10. Let j be u(-9). Let s = p - j. Solve 2d - s = d for d. 3 Let z(b) = 4b - 11. Let h be z(6). Let q = h - 10. Solve -5t = -q + 13 for t. -2 Let m = -2 + 5. Solve mc - 7c = 0 for c. 0 Suppose -3g + 27 - 21 = 0. Solve gj = -8 - 0 for j. -4 Let s(v) = -v*3 + 3v2 - v + 1. Let r(d) = d2 + 3d + 2. Let z be r(-3). Let k be s(z). Solve -m + 4m = k for m. 1 Let l be (-1 + -3 - -16) + -5. Solve -l = 3h - 22 for h. 5 Suppose -5 = 7x - 8x. Solve u = -4u + x for u. 1 Let k be 1/5 - 20/(-25). Solve -4 + k = 3j for j. -1 Suppose 0 = 2o + 2o. Solve 0k - k + 5 = o for k. 5 Let c = 165 - 149. Solve 18f - 2 = cf for f. 1 Let b(z) = -z - 11. Let h be b(-12). Solve -n + 0 = -h for n. 1 Suppose 3k - 25 = -i, -3k + 2k + 4i + 4 = 0. Suppose 0 = w + 4m + 13, 4w = m - 6m - k. Suppose -6 - w = -3x. Solve 0 = -xa + 7a + 20 for a. -5 Let l = -4 - -4. Let w = l - -6. Let d = 3 + 0. Solve w = dc - 0c for c. 2 Suppose f = 6 - 2. Let z = f + -2. Let h be (2 - 2) + 4 - z. Solve -p = -hp for p. 0 Suppose 4m - 6 = -2o + 16, 20 = 5m. Suppose u - 14 = -u + 2k, 0 = -4u + ok + 32. Let j be 2/u - 248/(-88). Solve 0 = w + 2 - j for w. 1 Let s = 2 + -1. Let x = -8 - -1. Let y be (x/(-21))/((-2)/(-18)). Solve yn = 11 + s for n. 4 Suppose 4d + 591 = 603. Solve 8 = db + 2 for b. 2 Let d = -11 + 11. Solve 20 = -ds + 4s for s. 5 Suppose f = 2n - 1, 0 = -2f - 0f + 2n. Suppose -5 = -h + f. Solve 0 = hp - 2p - 4 for p. 1 Suppose 5g = g. Solve 0t + t = g for t. 0 Suppose 5q = 5i, -28 + 10 = -i - 5q. Suppose n + 2m = 2, 0 = -4n - 5m + im + 26. Let x(s) = -5s*3 + 2s + 1. Let f be x(-1). Solve -n = -3b + f for b. 4 Let l be (-2)/(2 - 36/16). Solve y + 3y = l for y. 2 Let a be (-8)/20 - 34/(-10). Let y = 90 - 86. Solve -aw + 2w + y = 0 for w. 4 Suppose -6r + 2r = 0. Suppose rp - 60 = -4p. Solve 0 = 3n + p - 3 for n. -4 Suppose 0 = -3b - 2t - 2t + 16, b - 4t = 0. Solve s - 1 = -b for s. -3 Let g(i) = 2i + 3 - 2i - 3i + 2i2 + i3. Let d be g(-3). Let z = 6 - d. Solve -zu - 3 = -4u for u. 3 Let k = -10 - -15. Suppose 4d = -kj + 22, -5d = 2j - 8 - 11. Solve -jn + 20 = 3n for n. 4 Let v(w) = -w3 + 5w*2 - 4. Let k be v(4). Solve 0 + k = -4r for r. -3 Let r be (-1)/((0 + 4)/(-16)). Let i be (r - 1)15/9. Solve -3h + 7 + i = 0 for h. 4 Let i be (-3 + 2)1 + -2. Let o be ((-2)/i)/((-2)/(-6)). Suppose -3b + 4u = 16, 3b - ou + u = -4. Solve b = -5t - 20 - 0 for t. -4 Suppose a = -5c + 30, -2a + 0a = 5c - 35. Let n = -2 + a. Suppose 3s + 29 = 5y, 3y + 3s - 15 = 4s. Solve y = r + nr for r. 1 Suppose -4g - 28 + 10 = l, 3l - 31 = 5g. Solve 17 - l = 3d for d. 5 Suppose 0 = 5h - 2h - 9. Suppose -4g + 4 = -m - 2m, -hm + 2 = 2g. Suppose 0 = -2v + 9 + 7. Solve m = -0z + 2z + v for z. -4 Let m(f) = f2 - 12f + 14. Let s be m(11). Suppose 0 = -2d + sd - 3. Solve t = -1 - d for t. -4 Suppose 0 = -c - 0c + 5j + 15, 0 = 4c - 3j - 9. Let z(i) = -i3 - i2 + 5. Let s be z(c). Suppose 0 = -st + 4t + 3. Solve p + tp - 4 = 0 for p. 1 Let g(x) be the first derivative of x6/120 - x4/24 + x3/3 - x2/2 + 3. Let t(s) be the second derivative of g(s). Let l be t(0). Solve ld = 4d for d. 0 Suppose 3t + 10 + 5 = s, 3s = -2t + 1. Let p = 0 - -2. Let y be p - (2-1 + 3). Solve y = sh + 13 for h. -4 Let y = 3 - 0. Suppose -l + 7 = -h - 4, yh + 25 = 2l. Suppose -2s = -0s - l. Solve sb + b = 20 for b. 4 Let k be (-40)/(-6) + (-10)/15. Suppose -kg - 84 = -3g. Let i be g/(-6) - (-4)/(-6). Solve -i + 5 = y for y. 1 Let k(u) = -2u - 15. Let l be k(-11). Solve b + 3 = l for b. 4 Let n be 2((-9)/(-2) - -1). Solve 5q = -n - 9 for q. -4 Let x = 46 + -31. Let g = x - 11. Solve 4p - 8 + g = 0 for p. 1 Let l be (-4 - -5) + 1 + 0. Suppose 0 = -z + lz. Solve -2 = -v - zv for v. 2 Let j = -7 + 8. Let b = j + -1. Suppose b = -5z - 5y + 5, 3y + 2 = -z - z. Solve 1 = zs - 19 for s. 4 Let r(l) = 2l*2 + 2l - 2. Suppose -1 = -p - 3. Let m be r(p). Solve -9 = -mz + 5z for z. -3 Let v = 4 - 1. Let g be (2/(-3) - 0)v. Let p = g + 7. Solve -2 = pm + 23 for m. -5 Suppose -5y + 12 = -y. Suppose 8b = yb + 35. Solve -5p + b + 13 = 0 for p. 4 Let a(z) be the first derivative of -z3/3 + z2/2 - 1. Let x be (-2)/(-5) - (-12)/20. Let y be a(x). Solve 0 = -yb - 3b - 3 for b. -1 Suppose 5v = -x + 101, 2v - 3v = 2x - 22. Solve 5z = z - v for z. -5 Suppose -3p + 12 = l	{ "pile_set_name": "DM Mathematics" }
? False Is -78277 < 48? True Which is smaller: 301461 or 301434? 301434 Which is greater: 0 or 6/88363025? 6/88363025 Is 670369 bigger than 31507298/47? True Is 21080461/3 greater than 7026821? False Which is greater: -153345866/7 or -21906551? -21906551 Are -10958648/109 and -100537 unequal? True Is 12380472 smaller than 12380486? True Is -407699171 != -407699171? False Is 10533288 <= 10533286? False Which is greater: -2048048 or -2048043? -2048043 Which is greater: 2693288 or 2693155? 2693288 Which is smaller: -6593949 or -19781849/3? -19781849/3 Is 2/178986833 smaller than -1? False Which is smaller: 35829 or -118? -118 Which is smaller: -17853/395 or 1/6? -17853/395 Is -41979 at least 65? False Is 1 at most 2848/333217? False Is -1459 > 11306? False Are -2221 and 3105 non-equal? True Which is smaller: 32 or 4854188? 32 Is -1 at least 758428123? False Is -37695/668 >= -55? False Is -27393 > -22610? False Which is smaller: 1/483090460 or 1? 1/483090460 Which is smaller: 261 or 173401/664? 261 Is 6/77174471 at most as big as 0? False Is -2924300 at least as big as -14621499/5? False Which is smaller: 884105 or 7956947/9? 884105 Which is greater: 8743 or 8206? 8743 Which is smaller: 34 or 95509/2808? 34 Is -10403071 less than -10403089? False Which is smaller: 5 or 3416212? 5 Is -1445464 bigger than 2/7? False Which is smaller: -140461081/6 or -23410179? -140461081/6 Which is smaller: 16782 or -8/149? -8/149 Which is smaller: 144926/3 or 5? 5 Which is smaller: 97 or -9610? -9610 Is 384660454 <= 384660452? False Which is greater: -4/13509263 or 1? 1 Is 203752/1567 > 130? True Is -48 >= -57/33743? False Which is greater: -45655421 or -45655426? -45655421 Which is smaller: 0 or -276882/43? -276882/43 Which is smaller: 9948814 or 9948816? 9948814 Does 1 = 2/279451571? False Which is smaller: 12566104 or -0.1? -0.1 Is 280323 bigger than 278686? True Is 5351557 bigger than 5351556? True Is -3/10911805 bigger than 0? False Is 27297/5149 != 6? True Is 45831906 greater than or equal to 45831906? True Is 17982 at most as big as 17943? False Is 8 != -0.0197549? True Which is smaller: 14455402/5 or 2891079? 2891079 Which is greater: -0.052442 or 128? 128 Which is smaller: -126310/8929 or -14? -126310/8929 Which is bigger: 67069 or 67070? 67070 Which is smaller: 25/7 or 207.0375? 25/7 Is -52118726 at least -52118727? True Which is smaller: -21713630 or -1/2? -21713630 Is -285798/169 != -1692? True Are 1/2 and 2/17961561 non-equal? True Which is smaller: 528 or 355157? 528 Which is greater: 1/4 or -2083319.5? 1/4 Which is greater: -3255 or -55470? -3255 Which is smaller: -1.4 or 10/238169? -1.4 Is 6577576 at least 6577626? False Which is greater: 24 or 41266/1755? 24 Which is bigger: -158743374 or -158743376? -158743374 Are 108386/2275 and 49 equal? False Which is bigger: 116409 or 1/37? 116409 Is -1120179 at most -1120181? False Is 0 less than or equal to 11/2404854? True Which is smaller: 1125279 or 5626393/5? 5626393/5 Which is bigger: 974 or 183323/188? 183323/188 Which is greater: 25024523 or 25024563? 25024563 Do -1.5 and 469051.1 have different values? True Which is smaller: -2 or 10/5653? -2 Is 4/3336363 equal to -1? False Do 37198605/11 and 3381691 have different values? True Is -12 equal to -9448/11? False Which is bigger: 0 or -751/555630? 0 Which is smaller: -175981.86 or -2? -175981.86 Is -979091 less than or equal to -979088? True Do 1567306 and 1567305 have the same value? False Which is bigger: 733/31142 or 1? 1 Is 8876192 < 8876196? True Which is smaller: -136731637 or -136731638? -136731638 Are -51/101605 and -1 equal? False Are 37774934/7 and 5396420 equal? False Do -69.67615 and 10.5 have the same value? False Which is smaller: -967029 or -45450350/47? -967029 Is -28878 at least -3446? False Is 467010776 smaller than 467010777? True Are -2 and -62095/68 equal? False Which is greater: -201497 or -201113? -201113 Is -16509574 greater than or equal to -16509574? True Does -351088 = -351099? False Which is smaller: 19296 or 5084? 5084 Is -19337341 at least -19337337? False Which is smaller: -12736994 or -12736987? -12736994 Is -1 less than or equal to -488/1051? True Is -201/662 not equal to 0? True Is -45 < -947628? False Is -1444/5 greater than or equal to -19445? True Which is smaller: -0.0704 or 1/12598? -0.0704 Which is smaller: -0.05 or -38994498? -38994498 Is -743349 smaller than -743282? True Are -24526422 and -24526459 nonequal? True Which is smaller: 587990/7 or 83998? 83998 Is -54/1217 at most 0.742? True Is 10/396947857 not equal to 0? True Which is bigger: 2 or -0.27931159? 2 Which is smaller: -274352830 or -274352832? -274352832 Which is smaller: 1 or 1371/45443? 1371/45443 Is -1/30057517 less than 1? True Is 4 greater than -8851975? True Does 1485 = 4/52453? False Which is smaller: -12792/259 or -48? -12792/259 Is -344019 at least as big as -344195? True Is -65 at least -7994/123? False Is 91271644 equal to 0? False Is -1 at least 3/32149265? False Are 52238409/5 and 0.08 equal? False Is 7199921 greater than 7199971? False Is -990862 > -991016? True Is 3/4 <= 581.5271? True Is 54806 less than or equal to 55151? True Is 6/39113213 not equal to 1? True Is 1/265862309 != -1? True Which is bigger: 547700/39 or 14044? 14044 Is -947107 less than -947110? False Is -2096430184 greater than -2096430184? False Which is smaller: -5973919 or -5973920? -5973920 Which is smaller: 1409 or -7544? -7544 Which is greater: 2766007 or 2765971? 2766007 Is 289551421 greater than 289551422? False Is -957737 smaller than -957722? True Is 2952/80347 equal to -1? False Is 1/1503197733 <= -1? False Which is greater: 2725 or 1107? 2725 Which is greater: -2046/24755 or 1? 1 Is 1 != 2207/302659? True Is -6 at most as big as -11708/1601? False Which is greater: -629763889 or 0? 0 Are 9510.253 and 0.01 equal? False Does 17686 = 4863592/275? False Which is smaller: -418784248 or -1? -418784248 Are 153408272 and 153408269 nonequal? True Which is smaller: -7339999 or -7340003? -7340003 Which is bigger: 470930852 or 470930853? 470930853 Which is smaller: -2785594 or -2785477? -2785594 Is -1 smaller than 2350/348953? True Is -730142 at most as big as -730114? True Is -3778/6715 <= -2? False Which is greater: -6769539 or -6769537? -6769537 Is -44.6 greater than or equal to -1493? True Is 31543343 < 31543341? False Are -63588483 and -63588483 unequal? False Which is bigger: 6037439 or -16? 6037439 Which is greater: 2007539 or 2007623? 2007623 Which is bigger: 29390940 or 29390931? 29390940 Do -448 and 22967 have different values? True Are 0.066681 and 3773 equal? False Which is greater: -26267 or -1234548/47? -1234548/47 Which is smaller: 2/31 or -3510/37? -3510/37 Which is smaller: 1911/2053 or -20? -20 Which is smaller: -5629 or 11175? -5629 Is 21019324 < 21019355? True Which is smaller: 314841 or -13? -13 Is -1 at least as big as -13/2884862? False Is -502708156 less than or equal to -502708155? True Is -604 != 1041703? True Which is smaller: 72254655/16 or 4515916? 72254655/16 Is -1714 equal to -80601/47? False Which is smaller: -48353944 or -48353939? -48353944 Does 0 = 18/183014833? False Is -6349022 bigger than -6349020? False Which is bigger: -1 or -158/1681279? -158/1681279 Do 20739271 and 20739326 have the same value? False Are -372575 and -372567 equal? False Is -221103 at least as big as 130? False Do 3848/9 and 17/22 have the same value? False Which is bigger: 3556 or 177819/50? 177819/50 Is -12291 >= -12543? True Which is bigger: 364673/56 or 6513? 6513 Which is bigger: -32148 or -31407? -31407 Which is greater: -237846 or -237961? -237846 Is 103579630 less than 103579629? False Which is smaller: 2/7356239 or 15? 2/7356239 Is -520988 at most as big as -521478? False Which is bigger: -11705770 or -11705769? -11705769 Which is greater: -1536473 or -1536418? -1536418 Is -1087840709 equal to -1087840710? False Which is greater: 73 or 703688? 703688 Which is greater: -2/783859 or 0? 0 Is -10277 not equal to -12700? True Which is smaller: -55715/624 or -90? -90 Is -135378036 greater than -135378037? True Which is smaller: -7017864 or -7017868? -7017868 Is -51/43643 smaller than 5? True Which is bigger: 0.15436 or -26914? 0.15436 Which is greater: -0.56	{ "pile_set_name": "DM Mathematics" }
+ 0z)(-z*2 - 3z*2 - 2z*2) - 4z3 + z3 + z*3 to nz*3 + j + uz + bz2 and give u. 0 Express 182 + 3a*3 - 531 + 156 as sa + ka2 + wa*3 + m and give w. 3 Rearrange -l - 96l*2 + 9 + 9 - 18 to a + cl + kl2 and give c. -1 Rearrange 7n*3 - 12n2 - 1 - n4 + 0n + 0n*3 - 3n*3 - 2n + 14n2 to the form sn*2 + c + tn*4 + jn + wn3 and give w. 4 Express (64320 + u - 33078 - 32503)(-u - 2u + 2u) in the form hu + ku*2 + v and give h. 1261 Rearrange (0 - 4 + 5 + (-3 + 2 - 1)(2 - 2 - 2) + 2 - 6 + 2 + 4 - 1 - 2)(-53 - 95c*2 + 53) to hc*2 + y + ic and give h. -380 Rearrange 17 - 16 + 4 - 12 - 4d to the form pd + h and give h. -7 Rearrange 8 + 0b - 3b - 8b + 6 - b to the form yb + i and give i. 14 Express -38v2 + 19v*2 + 18v*2 + 56 in the form n + rv*2 + av and give n. 56 Rearrange 2x - 5x3 + 37 - 52 + x3 + 4x2 + 43 to the form gx*2 + yx + wx3 + h and give w. -4 Express 29 + 28 + 25 - 2l*2 - 72 - 4l*4 in the form wl*2 + ml*3 + r + fl + nl4 and give n. -4 Express -z3 + 0 + 0 + (2 - 2 - 6z*2)(4z + 8z + z) as oz2 + az + xz3 + t and give x. -79 Express 2y - 110y2 + 32y*2 - 2 + 22y*4 + 27y*2 - 5y*3 + 49y*2 in the form xy*3 + by*4 + ay + hy2 + j and give b. 22 Express 51z*2 + 13 + 0 - 64z*2 as qz*2 + mz + d and give d. 13 Rearrange (2 - 2 + 1)(-2 - 2 + 3 + (1 + 0 + 10)(2 - 3 + 3))(-13s*3 + 4 - 4) to the form hs + d + os3 + us2 and give o. -273 Express -l3 + l*3 + 24l*3 + ((4l - 3l + 0l)(-3 + 3 - 2) - l - 2 + 3 - 2)(l - 2l2 - l) in the form bl*2 + ql*3 + dl + p and give q. 30 Rearrange (-6 + 2 - 1)(70y + 98y - 29y)(4 + 0 - 5 + (-3 - 4 + 4)(0 + 5 - 4)) to ay + u and give u. 0 Rearrange 45 + 52w*2 - 107w*2 + 47w*2 to the form qw + pw2 + l and give p. -8 Express (-5 + 2 + 4 + (-4 + 2 + 3)(5 - 2 - 2) + 7 - 5 + 5)(-22 + 4l + 22) as j + bl and give b. 36 Rearrange (2 - 4 + 0)(5 - 5 - 3r)(-r - 1 + 1) + 2r2 + 454 - 508 - 4r + 7r to the form b + tr*2 + yr and give y. 3 Express 2 + 275k - 3 - 566k + 201k in the form x + qk and give x. -1 Express 4g4 - 17g4 + 7 - g3 + 24 + 12g4 + 5g*2 as tg*2 + fg*3 + xg*4 + og + i and give f. -1 Rearrange 3 - 334y - 2 + 336y - 16y3 + y2 to by + ty3 + qy*2 + p and give b. 2 Rearrange (-3n + 7n - 2n)(-4n + 17n + 6n)(2 + 1 - 1 + n) to the form m + in + vn3 + hn*2 and give v. 38 Rearrange (-5n + 5n - 4n)(3 - 207n*2 + 4n + 400n2 - 205n*2) - 2n*3 + 2n*3 + 2n*3 to x + mn*3 + tn*2 + un and give m. 50 Express 592c3 + 1 - 7c*4 - 593c*3 + 27c*4 in the form mc*4 + oc*3 + uc*2 + kc + l and give l. 1 Rearrange -30t2 + 79t*2 - 47t*2 - 85t to the form z + lt + st*2 and give l. -85 Express (s - 4s + s)(0s + 0s - 2s) + (-s + s + 2s)(29s - 28s - 94s) in the form ls + x + bs2 and give b. -182 Express 14o*2 + 41 - o - 41 + 2 - 2 - 2o*2 + (o + 2o - o)(6 + 2o - 6) as k + do + po*2 and give d. -1 Rearrange 71o + 58o - 47o*2 - 130o to v + ro2 + uo and give u. -1 Express (20 - 20 + t)(3 - 1 + 0)(41 - 26 + 45) in the form ht + z and give h. 120 Express (-26 + 26 + 6p)(-5 + 3 + 4) + (-3 + 5 + 3)(26 - 26 + 6p) as np + y and give n. 42 Express -29t + 5t + 2t2 + 6t*3 + 28t in the form ft3 + vt + xt2 + p and give x. 2 Rearrange 68y*2 - 82y - 37y2 + 32y + 48y + 102y*2 to the form fy + cy2 + u and give f. -2 Express -119587 + 119587 - z2 - 20z + z*3 in the form wz*3 + hz + pz2 + f and give h. -20 Express (0 - 7 - 3)(2m - 3m + 2m)(-1 + 3 - 1 - 2 + 1 - 1 + (-2 - 2 + 6)(3 - 3 - 1) - 4 - 2 - 3) in the form wm + u and give u. 0 Express ((13f2 + 130 - 130)(2 - 5 + 1)(0 + 2 - 5) - f2 + 4f - 4f)(-6 + 5 - 9) in the form if2 + jf + h and give i. -770 Rearrange (21i3 - i3 - i3)(16i - 28i + 8i - 15) to the form ni*4 + ri*2 + li*3 + yi + o and give l. -285 Express 6f - 5f + 0f + (6f - 2f - 2f)(2 + 4 + 2) - f + 4f - 2f - 3 - 2f + 0 + 1 + (-5 + 5 - f)(1 - 1 + 1) - 3f + 2f + 0f as g + rf and give r. 14 Rearrange 13 - 50f - 66f2 + 32f*2 + 31f*2 + f - 15 to the form nf*2 + r + if and give i. -49 Express 2z3 + 2294z - 4591z - 6z*4 + 1 - 4z*2 + 2298z in the form fz4 + az*2 + uz*3 + d + bz and give f. -6 Rearrange 2 - 2 + 9g4 + (-9g - 9 + 10g + 3)(0 + 4 - 2)(-2g3 - g3 + 0g3) to the form pg*3 + vg*2 + mg + c + wg4 and give w. 3 Express -32p*3 - 2p*2 + 15p*3 + p + 2 - 5p2 - p4 + 12p3 in the form yp*4 + gp*2 + tp*3 + xp + a and give g. -7 Rearrange 3195 - 8r - 57r - 3195 to the form cr + h and give c. -65 Rearrange (-37w + 45w + 62w)(-4 + 4 + w + (-2 - 2 + 2)(3w - 2w - 4w)) to the form hw*2 + lw + i and give h. 490 Rearrange (10h + 7h - 4h)(-104 - 23 + 5) to m + vh and give v. -1586 Express 120 + 6h*3 + 116 - 236 + 31h*2 as m + rh + ih2 + zh*3 and give i. 31 Express -32m + 9m + 12m + 2 + 9m - 53m*2 as sm + k + fm2 and give k. 2 Express -444 + 2d + 209 + 221 - 3d4 - d4 - d2 as bd*2 + vd*4 + jd*3 + td + i and give i. -14 Express -p + 20p2 + 9p*2 - 5p2 - p3 + 3p3 + 4 in the form bp*3 + f + jp + sp2 and give f. 4 Rearrange -p - p3 + p + (4p*2 - 4p2 + p3)(221 - 92 + 292) + 6p*3 - 4p*3 - 4p*3 to d + up*2 + cp*3 + sp and give c. 418 Express -3 + 0 + 4l - 6l*3 - 185l*4 + 183l*4 as kl*4 + ol + xl3 + i + ml*2 and give o. 4 Rearrange -145y*2 - 2y - 130y2 - 11y*2 - 172y*2 to f + vy + xy2 and give x. -458 Rearrange (n - 2n + 4n)(-2n + 3n + 3n)(42n2 + 1689 - 3n - 1689) to the form vn3 + bn*2 + in*4 + wn + j and give v. -36 Rearrange -l2 - l3 + 44l4 + 176 - 174 + l2 - 4l + 6l to zl*3 + bl + u + al4 + il*2 and give u. 2 Rearrange 2g*3 - 46g*2 - 19g*2 + g + 20658 + 12g*2 - 20658 to the form qg + xg3 + cg*2 + a and give q. 1 Express (c - 1 + 1)(7c2 - 5c2 + c2) - 3c3 + 3c*3 - 4c*3 + (-3 + 3 + 5c)(-c2 + c2 + c2) as mc + dc3 + kc*2 + y and give d. 4 Express 15181l4 + l2 + 0l3 - 15179l*4 + 26l + 0l - 6l*3 in the form a + nl + cl2 + yl*4 + fl*3 and give f. -6 Express 5v - 5 - 4v + 3 - 4 as x + tv and give x. -6 Rearrange (-24 - 38d + 24)(3d - 7d - d) to fd2 + s + gd and give f. 190 Express (-175h2 + 2220 - 2220)(-2h + 3 - 3) as a + nh*3 + ch*2 + oh and give n. 350 Express -166h + 0 - 1191h - 913h + 0 in the form ih + l and give i. -2270 Express (-1 + 2 + 0)(y - 5y - 3y)(-9 + 1 + 2) in the form sy + p and give s. 42 Rearrange 13 + 157o*3 + 25 + 10 - 4 + 2o*2 - 163o*3 to the form vo*2 + u + ro*3 + wo and give r. -6 Rearrange 2887f + 60f*4 - 2888f + 6f4 - 3f*3 to g + mf + df2 + uf*3 + bf*4 and give m. -1 Express -9p*2 - 38086 + 38086 + 16p in the form jp + dp*2 + u and give d. -9 Rearrange -5l - 1 - 2l + 5l + 4l to m + hl and give m. -1 Rearrange (-x*2 + 2x*2 + 0x*2)(-4 + 4x + 4) + 702 - 701 + 4x*3 - 7x + x*2 - 6x*3 to ux*3 + gx*2 + w + rx and give r. -7 Rearrange (3 - 3 + 7)(39r - 74r + 46r + (3r - r - r)(-2 - 3 + 4) + 6r - 3r - r + 2r + 0r - 4r) to the form h + xr and give h. 0 Rearrange (4p2 - 3p2 + p2)(0 - 2 + 0)(-20p + 20p + 2p2) to the form x + ap*4 + jp + hp2 + qp*3 and give a. -8 Express -4 - x + 4 + (-2 - 1 + 1)(-5x + 4x + 2x) - 3x + 2 - 2 - 5668x + 2861x + 2876x as fx + a and give f. 63 Express 19f - 45 + 45 + (3 - 5 + 3)(-2f + 2f + f) - 6f - 1 + 1 as hf + l and give h. 14 Express (-4j - 6j*2 + 4j)(0 + 2 + 5 + (1 + 2 - 5)(1 + 1 + 0)) in the form h + kj + ij*2 and give i. -18 Express 7 + 3 - 136w - 2 - 10 in the form pw + k and give k. -2 Express -2 + 2u*2 - 11u*2 + 8u*4 - 28u*2 + 2u*3 - 10u*4 as n + fu*3 + bu + ku2 + vu*4 and give n. -2 Express (19r2 - 666 - r3 + 666)(5 + 19 + 21)(r - 2r + 2r) in the form w + sr4 + hr + ar2 + gr*3 and give s. -45 Express (17c + 19c - 17c)(4c - 5c + 0c) + (-4*	{ "pile_set_name": "DM Mathematics" }
13517000 What is 0.00305986238 rounded to 6 dps? 0.00306 Round -74336.331 to the nearest ten thousand. -70000 What is 807.47997 rounded to 1 decimal place? 807.5 Round 85209751800 to the nearest 1000000. 85210000000 Round -0.00000065488867 to 7 dps. -0.0000007 Round -40.3075381 to two decimal places. -40.31 Round -0.0035244525 to 5 dps. -0.00352 What is -0.1634257231 rounded to 6 decimal places? -0.163426 Round -6636557.66 to the nearest 10000. -6640000 Round -623168.41 to the nearest ten thousand. -620000 Round 0.25131239 to 1 dp. 0.3 Round -110225673200 to the nearest 1000000. -110226000000 What is 0.82803579 rounded to one decimal place? 0.8 What is -35469.6055 rounded to the nearest ten? -35470 Round 1.71994051 to 2 decimal places. 1.72 Round -86.724501 to zero decimal places. -87 What is -24441849.6 rounded to the nearest 1000000? -24000000 Round -0.0000340499256 to 6 dps. -0.000034 Round 0.01207062049 to five dps. 0.01207 What is 150176.16 rounded to the nearest 100? 150200 What is 0.4021561585 rounded to 4 decimal places? 0.4022 Round -298921135 to the nearest 10000. -298920000 What is 303.6228897 rounded to 1 dp? 303.6 Round 275607.01 to the nearest one hundred thousand. 300000 What is 15572993.4 rounded to the nearest 10000? 15570000 Round 3822733000 to the nearest 1000000. 3823000000 Round 0.00056881958 to 5 decimal places. 0.00057 What is 0.63525135 rounded to two decimal places? 0.64 What is -3523.477245 rounded to one dp? -3523.5 What is -21294592.65 rounded to the nearest one thousand? -21295000 What is 865016.577 rounded to the nearest one hundred thousand? 900000 Round 5329767478 to the nearest 100000. 5329800000 What is 0.0596070884 rounded to 4 dps? 0.0596 What is 52290.842 rounded to the nearest ten? 52290 What is -254414.5831 rounded to zero decimal places? -254415 Round -0.0335351379 to five decimal places. -0.03354 What is -361.11454 rounded to the nearest 10? -360 What is 0.00722739463 rounded to 3 decimal places? 0.007 Round -0.001023517 to two decimal places. 0 Round -3648.959049 to 1 dp. -3649 What is 271665.48 rounded to the nearest one thousand? 272000 What is 2245402.4521 rounded to the nearest one hundred thousand? 2200000 Round 460357.286 to the nearest ten. 460360 Round -288.8478884 to one dp. -288.8 What is -97145.483 rounded to the nearest 100? -97100 Round -0.000001060231094 to six dps. -0.000001 Round -20.645284 to two decimal places. -20.65 Round -0.00861745788 to 5 dps. -0.00862 Round -2.4879029 to the nearest integer. -2 Round 330.0787825 to the nearest 10. 330 Round -8197970.79 to the nearest 1000000. -8000000 Round 759924.137 to the nearest 1000. 760000 What is -1.461738806 rounded to two decimal places? -1.46 Round 0.000885574416 to seven dps. 0.0008856 What is -21219308.87 rounded to the nearest one million? -21000000 What is 0.1032821605 rounded to 3 dps? 0.103 What is -0.000000902641377 rounded to 7 decimal places? -0.0000009 What is -53371774100 rounded to the nearest 1000000? -53372000000 What is 0.00052810245 rounded to 4 dps? 0.0005 Round 11543.10531 to 0 dps. 11543 What is 145280390 rounded to the nearest one hundred thousand? 145300000 Round -233.0242562 to 2 dps. -233.02 What is 91528284.3 rounded to the nearest one million? 92000000 What is 90234457.39 rounded to the nearest ten thousand? 90230000 What is 0.003472023448 rounded to four decimal places? 0.0035 What is 0.00001356830633 rounded to 7 dps? 0.0000136 What is 0.1955640761 rounded to 2 dps? 0.2 What is -264.4215096 rounded to the nearest 10? -260 What is -1076399279.9 rounded to the nearest 100000? -1076400000 Round -0.0135628395 to 4 dps. -0.0136 What is -0.009431955 rounded to 4 dps? -0.0094 What is -0.0002109420655 rounded to 5 dps? -0.00021 What is 0.00000083002296 rounded to 6 dps? 0.000001 What is -34390640400 rounded to the nearest 1000000? -34391000000 What is -0.000012204431 rounded to six decimal places? -0.000012 Round -0.01606329862 to six decimal places. -0.016063 Round 780485.3795 to the nearest ten. 780490 Round 314159.64 to the nearest 100000. 300000 What is -0.004842901314 rounded to 6 decimal places? -0.004843 What is -133.418354 rounded to the nearest ten? -130 Round 4.12563216 to 3 dps. 4.126 What is 0.000124366723 rounded to six decimal places? 0.000124 What is 3865823.88 rounded to the nearest 1000? 3866000 Round -1.1993817 to 1 decimal place. -1.2 Round -0.00487185959 to 4 decimal places. -0.0049 What is 3.56471 rounded to four decimal places? 3.5647 Round 457343831 to the nearest ten thousand. 457340000 What is 13.8777905 rounded to 2 dps? 13.88 Round 0.0089825035 to six dps. 0.008983 What is 0.000001997121385 rounded to seven decimal places? 0.000002 What is -3050.0351 rounded to the nearest one hundred? -3100 Round 13.4566201 to three decimal places. 13.457 What is 228737.376 rounded to the nearest 10? 228740 What is -1312258.76 rounded to the nearest one hundred thousand? -1300000 What is 4.29505371 rounded to one decimal place? 4.3 What is -69153561290 rounded to the nearest one million? -69154000000 Round 252704491.4 to the nearest one million. 253000000 What is 510601.136 rounded to the nearest one thousand? 511000 Round 3806.276075 to zero dps. 3806 Round 0.1065510248 to four dps. 0.1066 What is 8.54341015 rounded to three decimal places? 8.543 Round -84220890 to the nearest 100000. -84200000 Round 18408179.2 to the nearest 1000. 18408000 Round -1217881070 to the nearest one hundred thousand. -1217900000 Round -28.4407298 to two dps. -28.44 What is 0.666966184 rounded to two decimal places? 0.67 Round -132.631094 to 2 dps. -132.63 What is 0.02050443724 rounded to 5 dps? 0.0205 What is -1907952.15 rounded to the nearest 100000? -1900000 What is 183237.789 rounded to the nearest 1000? 183000 Round -87650.692 to the nearest ten. -87650 Round -59360.41393 to zero decimal places. -59360 What is -0.0694276199 rounded to 4 dps? -0.0694 What is -0.00004835759097 rounded to 7 decimal places? -0.0000484 Round -0.0000345543286 to 6 dps. -0.000035 Round -0.0001239475468 to seven dps. -0.0001239 Round 0.0484485982 to three decimal places. 0.048 Round -0.0220392513 to two dps. -0.02 Round -0.1902653117 to five dps. -0.19027 What is 5.62536519 rounded to one decimal place? 5.6 What is 0.0000262586278 rounded to 5 dps? 0.00003 Round 1152.799556 to 1 dp. 1152.8 What is -2913.94664 rounded to the nearest one hundred? -2900 What is -0.00001194208774 rounded to six decimal places? -0.000012 What is -0.0000064542284 rounded to 6 dps? -0.000006 What is 96460.1079 rounded to the nearest one hundred? 96500 Round 0.000013394047 to seven decimal places. 0.0000134 Round -2.95324064 to 3 decimal places. -2.953 What is 0.0040145611 rounded to 5 decimal places? 0.00401 What is 75035459.41 rounded to the nearest one million? 75000000 What is -222178.93 rounded to the nearest 100? -222200 Round -0.0554294925 to two dps. -0.06 Round -39114393000 to the nearest one million. -39114000000 Round -0.00093536475 to 4 dps. -0.0009 Round -0.00000529331029 to seven decimal places. -0.0000053 Round -350.418627 to 1 decimal place. -350.4 Round 137143380 to the nearest 1000000. 137000000 What is 237716.4311 rounded to the nearest 100000? 200000 Round -0.13106339 to two dps. -0.13 What is 14.62209194 rounded to the nearest integer? 15 Round -1.575040817 to the nearest integer. -2 What is 291.1269 rounded to the nearest ten? 290 What is -6425966.58 rounded to the nearest one hundred thousand? -6400000 Round -2.357650302 to four dps. -2.3577 Round 4.52908641 to four dps. 4.5291 What is 143.0753434 rounded to one decimal place? 143.1 Round 12.5510755 to 3 decimal places. 12.551 Round -230.146698 to two decimal places. -230.15 Round -5384651.97 to the nearest one million. -5000000 What is 6753475.8 rounded to the nearest one hundred thousand? 6800000 What is 1.9356241 rounded to one dp? 1.9 Round -358202.129 to the nearest 100. -358200 Round -0.0001842856827 to 6 dps. -0.000184 Round 2974565490 to the nearest 1000000. 2975000000 Round 274920.0346 to the nearest ten thousand. 270000 Round 27883945.85 to the nearest one million. 28000000 What is 8012467400 rounded to the nearest one million? 8012000000 What is 0.0000249381166 rounded to 6 dps? 0.00	{ "pile_set_name": "DM Mathematics" }
Which is the second smallest value? (a) 1373154 (b) 1 (c) -1/3 (d) -5 c What is the second smallest value in -2/15, -22409, -5? -5 What is the second biggest value in -2/3, 5, 245/3, 12/17? 5 Which is the third biggest value? (a) -0.34 (b) 1.23 (c) 0.001 (d) 1 c Which is the biggest value? (a) 347 (b) -1 (c) -1/3 (d) 5 a What is the second smallest value in -3513, -0.29, -0.2? -0.29 Which is the second biggest value? (a) 3/2 (b) -1 (c) -77 (d) -5 (e) 0.2 e What is the biggest value in -4, 4, 1/30, 0.6074, 3? 4 Which is the fourth biggest value? (a) -5 (b) -2/23 (c) 44 (d) 10 (e) 0.04 b What is the third smallest value in 0, 1, 1/5, -0.8, 7, -1/8? 0 What is the smallest value in 24/7, 0, 0.369? 0 What is the third smallest value in 20, -0.3, -5, 1/4, -103/14? -0.3 Which is the fourth smallest value? (a) 0.5 (b) 37/2 (c) -2/11 (d) 6/7 (e) 1.56 e Which is the third biggest value? (a) 0 (b) 1.5 (c) -0.1 (d) -2/11 (e) -0.4 (f) -63 c What is the third smallest value in 3/10, 2, -2, 10512? 2 What is the smallest value in -21.4, -3, -0.1, 2/7? -21.4 Which is the fourth smallest value? (a) 24 (b) -1 (c) -214 (d) -1/3 a Which is the biggest value? (a) -2/5 (b) -0.1 (c) -1 (d) -0.18 b What is the biggest value in 3, 26263, -2, -5? 26263 Which is the second smallest value? (a) 21 (b) 4 (c) -11/5 b What is the third biggest value in -3/14, 3, 1/2, -24? -3/14 Which is the fourth biggest value? (a) -186 (b) -66 (c) 2 (d) -4 a Which is the third biggest value? (a) 5 (b) 2 (c) -7/41 (d) -95 (e) -0.4 c What is the smallest value in 195, -27, 2? -27 What is the fifth biggest value in 0.4, -2/7, -2/19, -43, -75, 3? -43 Which is the second biggest value? (a) -1/3 (b) 210/211 (c) 5 (d) 3 (e) -3 d What is the biggest value in -0.076, 4, 2, 1, 1/9? 4 What is the third smallest value in 0, 65412, 0.2? 65412 Which is the smallest value? (a) 1/4 (b) 0.2 (c) -84 (d) 40.8 c What is the biggest value in -55.9, 5, 531, -0.4? 531 What is the second smallest value in 3, -10, -11124, 1/5? -10 What is the second biggest value in -316, 4, -1? -1 Which is the biggest value? (a) -4644/5 (b) 0.3 (c) 1 c What is the third biggest value in 31.6, 0.16, 3? 0.16 What is the biggest value in -0.0339, 0, 0.9, 3, -1/2? 3 Which is the fourth biggest value? (a) 18 (b) 3938 (c) 0 (d) -6 d What is the fifth biggest value in -1, -6, -0.1, -0.2, 37, -13? -6 What is the second smallest value in 1/4, -4967/7, 0.1? 0.1 Which is the second smallest value? (a) -13 (b) -1/147 (c) -12/11 c What is the third smallest value in -2/9, -0.4, 4/5, 1, 15/49? 15/49 Which is the biggest value? (a) -2/17 (b) 2/7 (c) 166408 c Which is the fourth smallest value? (a) -2 (b) -19 (c) -8 (d) -15 (e) 3/29 a What is the fourth biggest value in 4/7, 1, 0.92, -1/3, -9, 3? 4/7 What is the third biggest value in -3, 18/5, -1/11, -3/2? -3/2 What is the sixth biggest value in 4, -3/5, -1, 0.6, -14/9, 1? -14/9 What is the fifth biggest value in 3, -1, 14, -6/5, 84, 1/12? -1 Which is the fifth biggest value? (a) -2 (b) 1/122 (c) 5 (d) -1 (e) 0.8 (f) -0.1 d What is the biggest value in -2, -21/38, 0.045? 0.045 What is the third biggest value in 10, -3, 45, -2/13, -2? -2/13 What is the second biggest value in -0.343, 2414, 0? 0 Which is the fourth biggest value? (a) -7/3 (b) 2 (c) 0.5 (d) 0.03 (e) -2.5 (f) -7 a Which is the third biggest value? (a) -3791 (b) -1/3 (c) -2/3 (d) 0.4 c What is the second smallest value in -11, 53, -62? -11 What is the fifth biggest value in 23, -0.2, 0.5, -84, -0.3? -84 What is the third smallest value in -4, -5897, 0.1? 0.1 What is the third smallest value in 2/5, -266, -0.7, -2/3? -2/3 What is the second biggest value in -3/5, -0.4, -3, -4, 0.4, 417? 0.4 Which is the third biggest value? (a) 4 (b) 0.01 (c) -1 (d) 7 b Which is the smallest value? (a) 1/6 (b) -26 (c) 1/3 (d) 0.077 b What is the second biggest value in -3/5, 3085, -0.2? -0.2 What is the fourth smallest value in -1/6, -1724, -0.3, -1? -1/6 Which is the second smallest value? (a) -4.3 (b) 4 (c) -243 a Which is the third smallest value? (a) -85 (b) 119 (c) -3/7 (d) -1 c Which is the smallest value? (a) -0.3 (b) -5 (c) 1051 (d) 274 b What is the second biggest value in -1/5, -3356, -5, 3, 1? 1 Which is the smallest value? (a) 579 (b) 2 (c) -0.31 c What is the smallest value in -3/5, -5, -51/265, 0.04? -5 What is the fourth smallest value in -7/16, 17, -3, -1/5? 17 What is the fourth biggest value in 3, 0.6, -100/37, 0? -100/37 Which is the fourth smallest value? (a) -1 (b) -4 (c) 4 (d) 24/43 (e) 449 c What is the second biggest value in 0.3, 2, -132, 4? 2 Which is the fourth biggest value? (a) 0.3 (b) 465 (c) -0.4 (d) 19 (e) 4 a Which is the second smallest value? (a) 113 (b) 13 (c) 15 c What is the sixth biggest value in -6, 2/3, 49, 16, -0.2, -5? -6 Which is the biggest value? (a) -1/4 (b) 1.5 (c) -3 (d) -194 (e) -0.2 b Which is the second smallest value? (a) -0.1 (b) 0.0114 (c) -0.03 (d) 5 c Which is the biggest value? (a) 0 (b) 66/5 (c) 44 c Which is the second smallest value? (a) 0.017 (b) -26.1 (c) 1/3 (d) 4/3 a What is the second smallest value in -5, -9, 9/7, -3/2, -6, 0.5? -6 What is the fourth biggest value in -1, 1, -6/19, -6, -11.5, 5? -1 What is the second biggest value in -11, -2/3, 2/11, -9, 0? 0 What is the smallest value in 6/5, -41, 0.04? -41 Which is the second biggest value? (a) 3 (b) -1 (c) 36/11 (d) -5 (e) -3 (f) -14 a Which is the biggest value? (a) 1 (b) 0.2 (c) -3022 (d) -2 a Which is the third smallest value? (a) 0.5 (b) 0 (c) 58.892 c Which is the smallest value? (a) 3/2 (b) -0.4 (c) 0 (d) 0.3 (e) -569 (f) 23 e What is the fifth biggest value in 2/153, 1/5, 2, -2/9, -31, -1/11? -2/9 What is the biggest value in 8/11, -4, 6/53, 2? 2 What is the third biggest value in 30603/2, -3, -2/111? -3 What is the fourth smallest value in -7, 0.128, 1, 4/7, -0.02? 4/7 What is the fourth biggest value in 4, 1, 360, -0.16, 5, 2/5? 1 What is the second smallest value in 399135, 1/2, -0.5? 1/2 What is the third biggest value in 3, 114, 0, -0.9? 0 Which is the third biggest value? (a) 226 (b) -14 (c) 2 b Which is the second biggest value? (a) 9482 (b) 1/3 (c) 0.5 (d) -0.1 (e) 2/11 c What is the second smallest value in -73712, 2/15, -1? -1 Which is the smallest value? (a) -3/4 (b) 1.2 (c) 33/2 (d) -4 d Which is the third biggest value? (a) -5 (b) 0.1 (c) 5 (d) 3 (e) -5/11 (f) 3643 d Which is the third smallest value? (a) 1/8 (b) -1/148 (c) 7 (d) -4/3 a Which is the second biggest value? (a) 0.5 (b) 4502 (c) 2/7 a Which is the third biggest value? (a) 716 (b) 6/5 (c) -3 (d) -2/3 (e) -5 d Which is the second smallest value? (a) 76/357 (b) 2 (c) 4 b Which is the fourth smallest value? (a) -0.5 (b) 4/149 (c) 0 (d) -4 b What is the fourth biggest value in 0.4, 215, 1/2, -2/7, -4.8? -2/7 What is the second smallest value in -735, 1/2, 1/10? 1/10 Which is the second biggest value? (a) 0.12 (b) 14826 (c) -5 a What is the third biggest value in -97, -5/4, -2? -97 What is the fourth smallest value in 2/21, -0.017, 959, -4? 959 Which is the smallest value? (a) -3/8 (b) -0.09 (c) -8/5 (d) 5 (e) -10 e Which is the fifth biggest value? (a) -3 (b) 11 (c) 0.5 (d) -16 (e) 0.11 d Which is the fifth smallest value? (a) -1/2 (b) -10 (c) -2/637 (d) 3 (e) 1/14 d Which is the third smallest value? (a) -4/19 (b) -0.09 (c) 0.14 c Which is the second biggest value? (a) 0.4 (b) -0.5 (c) -2 (d) 0.9337 a What is the second smallest value in -64/5, -1/772, 0.3? -1/772 Which is the smallest value? (a) 3 (b) -332 (c) 1/2 (d) -3 (e) 2 b What is the third smallest value in 1, 0, -1434? 1 What is the biggest value in 29/6, -0.8, -2/7, -12.8, 0.1? 29/6 Which is the third smallest value? (a) 1/46 (b) -5 (c) -100/19 a What is the smallest value in -3/2, 0.27, 2.6, -0.5, -0.7? -3/2 Which is the third smallest value? (a) 9/5 (b) 0.25 (c) -3/5 (d) -72 b What is the second biggest value in -2698, 5, -3? -3 What is the fourth smallest value in 0.2, -1/4, -50/31, -47? 0.2 Which is the second smallest value? (a) 0.32 (b) -5 (c) 4	{ "pile_set_name": "DM Mathematics" }
Find the third derivative of v(g) wrt g. 331680g2 Let q be ((-3)/3 - 0)/((-4)/12). What is the first derivative of -53 - 59 - 119x*q + 16 - 1 wrt x? -357x*2 Suppose 2b = -i + 2, -4i = b + 3b. Differentiate -40v2 + 979 - 1111 - 45v*b wrt v. -170v Let u be -1 - -2 - (0 - 4). Let v be u/40-2-8. Find the third derivative of -2 + 0w2 + wv + 2 + 9w*4 wrt w. 216w Differentiate 687 - 460k + 2568 - 528k + 389 + k*2 - 3k*2 with respect to k. -4k - 988 Let y(r) be the second derivative of 0r6 + 0r*2 + 0r*3 + 139/56r*8 + 0 + 0r*5 + 0r*7 + 107r - 13/4r4. Find the third derivative of y(c) wrt c. 16680c*3 Let u(j) = 24043j*2 + 10117j + 936. Let r(n) = 4007n2 + 1686n + 144. Let g(c) = 39r(c) - 6u(c). Find the second derivative of g(i) wrt i. 24030 Let y be (-56)/(-20) - (-10)/50. Find the second derivative of 103p - 38p*y + 99p*3 + 84p*3 wrt p. 870p What is the second derivative of 0 + 26 + 8931j4 - 9268j*4 + 9j wrt j? -4044j2 Suppose -44w = -106 + 18. What is the derivative of -10t2 - 266 + 10t*w + 0t*3 - 43t*3 - 2t*3 wrt t? -135t*2 Let s(k) = -2k*3 - 29k*2 + 13k - 27. Let r be s(-15). Find the second derivative of f*3 + 16f*3 + 6f*2 - 19f*r + 148f wrt f. -12f + 12 Let a(k) = 456k*3 - 2k - 260. Let o(g) = 455g3 - g2 - 3g - 262. Let r(w) = 3a(w) - 2o(w). Find the third derivative of r(y) wrt y. 2748 Let f(c) be the first derivative of 213 + 91c3 + 88c*3 - 2c*7 - 178c*3. What is the third derivative of f(o) wrt o? -1680o*3 Let h(t) = 363t*3 - 6t*2 - 9t - 2230. Let j(c) = 1088c3 - 16c*2 - 24c - 6691. Let b(g) = 8h(g) - 3j(g). What is the first derivative of b(z) wrt z? -1080z2 Let k(a) be the first derivative of -656a5/5 - a4/2 + 222a3 - 223. What is the third derivative of k(w) wrt w? -15744w - 12 Let l = 282 - 461. Let f = l - -298. Find the second derivative of 109q5 + q + 0q - fq5 wrt q. -200q*3 Let n(f) be the second derivative of -2417f*5/20 + 3431f*2/2 + 1335f + 1. Differentiate n(t) wrt t. -7251t2 Let d(f) be the second derivative of -2435f*7/42 - 2651f*3/6 - 9f - 3. Find the second derivative of d(p) wrt p. -48700p3 Let d be 558/372 + 1/4. Let c(j) be the second derivative of -14/3j*3 + dj*4 + 0j*2 - 9j + 0. Find the second derivative of c(z) wrt z. 42 Let t be ((-30)/2)/((-6)/8). Let h be ((-46)/3)/(t/(-30)). What is the third derivative of -a*4 + ha*2 + 2a*2 + 3a4 + a4 wrt a? 72a Let a(c) be the third derivative of -4c7/3 - c6/120 + c*5/30 + 73c4/8 + c3/6 + 5483c2. Find the third derivative of a(d) wrt d. -6720d - 6 Let g = -4790 + 4797. Let b(o) be the first derivative of 1/3o3 + 0o - 7/2o4 + 0o2 + g. What is the third derivative of b(d) wrt d? -84 Let g(c) = -c3 + 6c2 - 4c + 2. Let w be g(4). What is the second derivative of 13b - 45b - wb + 33b*4 wrt b? 396b*2 Let u(x) = -59x3 + x2 + x - 1. Let a be u(1). Let s = 76 + a. Find the second derivative of sg5 - 11g*5 + 4g*5 + 10g wrt g. 220g3 Let v(w) be the first derivative of 8w*5/5 - 3w*4/4 - 16w*3/3 - 1164w - 4768. What is the first derivative of v(s) wrt s? 32s3 - 9s*2 - 32s What is the derivative of -6302 + 753p + 92 - 8p*2 + 29p - 394p wrt p? -16p + 388 Let g(w) be the second derivative of 57w5/10 + w4/12 + w3/6 - 3215w*2 - 16w + 10. Differentiate g(t) wrt t. 342t2 + 2t + 1 Find the third derivative of 271z5 - 3 - z4 + 510062z2 - 1 - z3 - 81z - 510063z*2 wrt z. 16260z*2 - 24z - 6 Find the second derivative of 4253j3 - 388j*5 - 2123j*3 + 4j*4 - 2130j*3 - 2489j wrt j. -7760j3 + 48j*2 Let b be (-1 - (-1)/3)(-1464)/16. Suppose -5k - b = -3s, -5s - 5k = -0k - 35. What is the third derivative of -sq*2 + 43q*5 + 3q*5 - 24q*5 wrt q? 1320q*2 Differentiate 0f + 22165638f2 - f + 8310 - 22167146f*2 wrt f. -3016f - 1 Let q(s) = s*3 - 5s*2 + 8s - 14. Let r be q(4). Find the third derivative of 18d2 + 17d*4 + 70d*5 + 71d*5 - 143d*5 + 33d*r wrt d. -120d*2 + 408d Let s(i) = 235i3 + 4i*2 + 4i - 532. Let m(t) = -235t3 - 5t*2 - 4t + 531. Let b(z) = -4m(z) - 5s(z). What is the first derivative of b(o) wrt o? -705o2 - 4 Let s(w) = 301w + 343. Let y(p) = -3p - 4. Let b(j) = 6s(j) + 798y(j). Find the first derivative of b(g) wrt g. -588 Let x(y) be the third derivative of 0y - 61/2y3 + 3/8y*4 + 0 - 1/20y*5 - 70y*2. Differentiate x(z) with respect to z. -6z + 9 Let r(a) = -8866a2 - 9795a. Let d(f) = -f*2 - 15f. Let y(z) = -4d(z) + r(z). What is the second derivative of y(v) wrt v? -17724 Let h(u) = -2u*3 - 20u2 + 16. Let y be h(-10). What is the second derivative of t2 - 44t - 15t*3 - yt*3 - 27t*3 + 21t*3 wrt t? -222t + 2 Suppose -20 = -v - q, 0v - 5q - 44 = -v. Suppose 3w - 4x + x - v = 0, -3w = -4x - 28. What is the first derivative of 7rw + 34 - 11 - 6 + 2 wrt r? 28r*3 Suppose -24k + x = -26k + 7, -2k - 4x - 8 = 0. Find the third derivative of -74n*k - 111n*2 - 125n*6 - 24n*6 wrt n. -26760n*3 What is the derivative of 6010 + 406t*2 - 2996 + t + 2309t*2 - t wrt t? 5430t Let w(o) be the second derivative of -1498o6/15 + 565o*4/12 + 874o + 2. What is the third derivative of w(f) wrt f? -71904f Let s(a) = -286a - 355. Let b(x) = 290x + 354. Let r(j) = -5b(j) - 6s(j). Differentiate r(k) with respect to k. 266 Let u(c) be the second derivative of -232c*6/5 - 7c*4/12 + 5c*3/6 - 15c*2/2 + 5654c. What is the third derivative of u(i) wrt i? -33408i Let x(d) = 1191d + 624. Let t(i) = -13i + 57. Let y be t(6). Let h(q) = 237q + 125. Let a(u) = yh(u) + 4x(u). Differentiate a(n) wrt n. -213 Let f(n) = 773n5 - n3 - n2 + 1307n - 1. Let q(d) = 4d5 + d3 + d2 - d + 1. Let b(i) = -f(i) - q(i). What is the second derivative of b(x) wrt x? -15540x*3 Let j(s) be the second derivative of 11s7/21 - s6/6 - 2158s3/3 - 1230s. What is the second derivative of j(g) wrt g? 440g3 - 60g*2 Let z(g) be the third derivative of 0g + 50g2 - 1/24g*4 + 0g*3 + 0 + 0g*5 + 3/40g*6. Find the second derivative of z(k) wrt k. 54k Differentiate -8673i4 + 9256 + 44006i - 44006i wrt i. -34692i*3 Suppose -88 = -20b - 8. Find the second derivative of 16 + 52g - 5 - 11 + 6gb + g2 wrt g. 72g2 + 2 Let t(v) = 24v*2 + 2v - 9. Let a be t(4). Find the second derivative of -1 - 50i2 - 1 + 360i - ai wrt i. -100 Suppose 566 = -k + 589. What is the third derivative of 140c*2 - kc*5 + 36c*3 - 77c*3 + 0c + 37c3 - 2c + 19c5 wrt c? -240c*2 - 24 Suppose -o = -274 + 269. What is the second derivative of 19k*o - 44k + 20k5 + 7k*5 + 4k*5 wrt k? 1000k*3 Suppose 6o = -2d + 9o + 17, -3d + 3o = -21. What is the second derivative of 633c4 - 2c*2 - 634c*d - 105c - 7c2 wrt c? -12c*2 - 18 Find the second derivative of 6v*2 + 401v*4 - 96725v + 220 + 69v4 + 101 + 96731v + 2v3 wrt v. 5640v*2 + 12v + 12 Let f = 109 - 108. Suppose 4y - 8y = 3h, -3y + f = 2h. Find the third derivative of 7i*2 + 6i*3 - 5i*3 + 4i*y - 10i*2 wrt i. 30 Find the first derivative of 49s*2 - 666s*2 + 84s*2 - 670 - 15s*2 - 938s*2 wrt s. -2972s Differentiate 4426r - 1676r - 1357r - 2136r - 861r - 355 wrt r. -1604 Let g = -129 + 135. Find the second derivative of -gb*3 - 165 + 0b*3 + 3b*2 + 2b - b*3 + 127 wrt b. -42b + 6 Let m(p) = -p*3 + 11p*2 + p - 8. Let t be m(11). Find the first derivative of -4kt - k2 + 19k3 - 10k*3 + 47 + 4k*2 wrt k. 15k*2 + 6k Let m be (-14)/49 - (-2322)/42. What is the first derivative of -50o - mo - 15o + 85 + 19 wrt o? -120 Let h(r) = -180r*2 - 57r - 2. Let q = -944 + 943. Let z(j) = j*2 + 4j. Let d(x) = qh(x) + 6z(x). Find the second derivative of d(c) wrt c. 372 Let r = 4132 + -4132. Let o(v) be the third derivative of 0v4 - 11/6v*3 + 0 + 6v*2 - 7/120v*6 + 0v*5 + rv. Differentiate o(f) with respect to f. -21f2 Let b be (-4)/10 + (-126)/(-15) + -4. Differentiate -38 - 13y*b + 49y*4 + 20y*4 + 0 wrt y. 224y**3 Let p(	{ "pile_set_name": "DM Mathematics" }
in decreasing order. 4, v, -2 Let q(j) = -j*3 + 5j*2 + j - 4. Let l be q(5). Let k be (14 + -4)(-219)/(-438). Sort 2, -3, l, k. -3, l, 2, k Let g = 10.897 - 21.897. Let v be 2 + -1 + 11/(-7). Let z be (9/6)/(2/4). Sort g, v, z. g, v, z Suppose j - 10 = -8. Let g be (2 - (-1 + j)) + (7 - 8). Suppose 4o + 5u = 32, 0 = o - u - gu - 8. Put o, 3, 2, -4 in increasing order. -4, 2, 3, o Let f = -12 - -1. Let p = f + 11.4. Let x = -12278 + 12278.3. Sort x, p, -0.2, -0.4. -0.4, -0.2, x, p Let f = 9910 + -9912. Let y(s) = s - 4. Let r be y(3). Sort r, f, 4. f, r, 4 Let n be ((-32)/(-12))/(-4) - (-34)/42. Let u = -6.612 + 2.612. Sort u, -2/9, -1/7, n in increasing order. u, -2/9, -1/7, n Suppose 0 = -6n + n, 5j + 10 = -n + 3n. Put -5, 0, -25, j in descending order. 0, j, -5, -25 Let r be 2 + -4 + 1 + -4. Let p be -2 - r(3 - 2). Let z be p/5 + (-84)/(-35). Sort -8, 0, -3, z in decreasing order. z, 0, -3, -8 Let n = 138 + -133. Let r = 5.35 + -3.35. Put n, r, -6, 3 in descending order. n, 3, r, -6 Let f = 49/456 + 1/57. Let m = 59 + -58.176. Let u = m - 0.324. Sort 1/3, u, f in decreasing order. u, 1/3, f Let g be 2 - (4 - (-85)/(-40)). Suppose -3h = 5o - 3 + 12, 0 = 2h + 6. Let f be (-4)/30 + (-372)/(-90) - o. Sort -0.1, g, f, 3. -0.1, g, 3, f Suppose -2g = 2g - 40. Suppose -5v - 5 = g. Let l(t) = 4t*2 + 53t - 5. Let i be l(-13). Sort 2, v, i in increasing order. i, v, 2 Let s = 1 - 3. Suppose 0 = p + 3k + 15 - 4, k = -4p - 22. Let h = -2213 - -2226. Put h, s, p in increasing order. p, s, h Let w be 7 + ((-136)/40 - -4)/((-45)/150). Let n be 16/(-1)1/2. Suppose 0 = -2z + z. Put n, z, w in decreasing order. w, z, n Suppose 0 = 3i - 2b - 2, -4 - 1 = 4i + 5b. Suppose i = -10a + 4 - 4. Put 14, 3, a in descending order. 14, 3, a Let j = 7766.9 + -7767. Sort 51, j, -1/4, -0.3, -6. -6, -0.3, -1/4, j, 51 Suppose -20h + 33 = -9h. Suppose 4i - r + 12 = 8i, 20 = 3i - 2r. Put h, i, 62, -5 in descending order. 62, i, h, -5 Let n be (-129 + 89)((-2)/(-2) - 0). Let s = 37 + n. Put 2, s, 25 in decreasing order. 25, 2, s Suppose 72m - 143 = 145. Suppose 8h = 3h + 130. Let f = h - 18. Sort 3, m, f. 3, m, f Let p = -44/9 + 554/117. Let j = -26 + 27. Sort 10.5, p, j. p, j, 10.5 Let l(z) = 3z3 + z2 + z + 1. Let o be l(-1). Let u be (-1464)/122 + 0 + 14. Sort u, -3, o in increasing order. -3, o, u Suppose -884b + 40 = -883b + 4y, 14 = -b + 2y. Let l = 5 + -8. Sort l, -5/3, b in descending order. b, -5/3, l Let q = 186 + -101. Let a = q + -80. Let r be 6/(-14)(13 - 14). Put r, a, -4/5 in decreasing order. a, r, -4/5 Suppose 0 = 10a - a + 36. Let c(u) = 10u + 41. Let r be c(a). Put -10, r, -4 in decreasing order. r, -4, -10 Let l = -0.1943 - 0.3057. Put 2/17, -0.4, -1, l in descending order. 2/17, -0.4, l, -1 Let j = 19 - 19.2. Let a(x) = x2 - 6x + 1. Let g(h) = 2h2 - 6h + 9. Let o be g(2). Let v be a(o). Put j, 5, v, 2 in decreasing order. 5, 2, j, v Let f = 75 + -75. Suppose 2r - r + 2 = 2u, -2u - 2r + 8 = f. Suppose 5c - 10 = 3o, -5c - o - o = 15. Sort u, c, -5. -5, c, u Let i = 64.9 - 11.9. Let o = -49.7 + i. Let s = -7.3 + o. Sort 1/8, -2/9, 1/2, s. s, -2/9, 1/8, 1/2 Let b(j) = -217j - 4337. Let m be b(-20). Put -0.3, m, -1331 in descending order. m, -0.3, -1331 Suppose g + 84 = 4g + 3f, g + 2f - 33 = 0. Let v = 25 - g. Sort v, -9, 0 in decreasing order. v, 0, -9 Let t(w) = -w3 - 3w*2 + 5w + 9. Let o be t(-4). Let r(u) = u*3 - 5u*2 - 3u - 16. Let k be r(6). Sort k, o, -1. -1, k, o Let a = 844 + -1283. Let j = 432 + a. Put 3, 7, j in ascending order. j, 3, 7 Let t be (551/(-870) + (-3)/(-10))27/(-3). Let z = -2.5 - -3. Put z, t, -68 in increasing order. -68, z, t Let k(l) = -23l + 185. Let m(s) = 16s - 123. Let z(y) = -5k(y) - 7m(y). Let a be z(22). Put 6, -4, a in ascending order. -4, a, 6 Let i = 34 - 20. Suppose 2o - 26 = 2n, 6o - n + 2591 = 2624. Sort -3, o, i, 5. -3, o, 5, i Let v be (1 + 32)/((-3)/(-2)). Suppose -4b + 5y = v, -5b + 4y - 19 = 2y. Let h = -383395 - -383395. Sort h, -1, b, 2. b, -1, h, 2 Let u = -7.912 - -7.912. Put 0.4, u, -68, -2/5 in ascending order. -68, -2/5, u, 0.4 Suppose -2 = -b + 3. Let x = -0.022261 + 1.022261. Put b, x, -3, -1/3 in descending order. b, x, -1/3, -3 Let y = 1871.6 - 1869.6. Sort -2, -0.2, 0.7, -28, y in decreasing order. y, 0.7, -0.2, -2, -28 Suppose 56q - 375 = 61q. Let g = q - -79. Suppose 2t = -2t + 20. Sort -4, t, g, -8 in descending order. t, g, -4, -8 Let d = 15.2 - 14.8. Put 2/7, 0, d, 10, 0.5 in decreasing order. 10, 0.5, d, 2/7, 0 Let u = -1.08 + -49.92. Let o = u - -55. Sort -1/4, -5, o in ascending order. -5, -1/4, o Let z = 10343 - 10378. Sort z, 9, 4, 1, 2 in decreasing order. 9, 4, 2, 1, z Let o be 20/(-15)6(-15)/(-40). Sort o, -2, -175, 4 in ascending order. -175, o, -2, 4 Let q = -66 - -66.105. Let c = q - -0.195. Sort c, -24, 4, -3 in increasing order. -24, -3, c, 4 Suppose -80f - 19f - 198 = 0. Put 0, f, -20/3 in ascending order. -20/3, f, 0 Let k(l) = -284l*2 + 44l + 46. Let t be k(-1). Sort t, 1, -1 in increasing order. t, -1, 1 Let w = -325.87 - -326. Let h = w + -0.08. Put h, 2/7, 5, -1/4 in descending order. 5, 2/7, h, -1/4 Let a = 533 - 450. Let d = a - 83.1. Put d, 3, -1, 10 in increasing order. -1, d, 3, 10 Suppose -4a + 2 + 2 = 0. Let j = 119 - 115. Let y(c) = c2 - 4c + 2. Let m be y(j). Sort -1, 5, m, a in increasing order. -1, a, m, 5 Suppose -15 = -4f + 5k, 8f - 4k - 23 = 7f. Let u be 6/8 - 39/36. Put 5, u, 3, f in descending order. 5, 3, u, f Suppose -1 = t - 5a, -202a + 198a = 0. Sort 64, 3, 5, -4, t. -4, t, 3, 5, 64 Let r = -19 + 89.7. Let x = 69.7 - r. Let z = 8 + -4. Sort z, -0.3, x in descending order. z, -0.3, x Let h = 28424/5 - 5685. Sort -3/2, 0.2, h, -0.3. -3/2, -0.3, h, 0.2 Let a(z) = -2z - 15. Suppose 4o - 12 = 3d - 32, 5d - 15 = 3o. Let g be a(o). Let p(s) = -45s + 218. Let r be p(5). Sort 3, -4, r, g. r, g, -4, 3 Suppose 10475w = 10467w + 32. Suppose 10 = -3k + k. Sort k, -3, w in ascending order. k, -3, w Let a(p) = 154p + 621. Let g be a(-4). Suppose w = -2y + 4, y - 2 = 2w + w. Let j be 0y(-2)/8. Put 1, g, j in ascending order. j, 1, g Suppose 0 = 97j - 109j - 48. Put 2, -5, -38, j in descending order. 2, j, -5, -38 Let h = 3 - 6. Suppose -31z + 25z - 184 = -4o, 4z + 4o = -96. Put z, h, -4/5, -0.3 in decreasing order. -0.3, -4/5, h, z Let r be 4/(-24) + (330/36 - -2) + -3. Let k = 7.3 - 7. Sort r, -5, k, 5 in descending order. r, 5, k, -5 Suppose 5k - 92 = 3k. Let r = k - 55. Let d be (-3)/r(-6)/(-8). Sort -4, d, -2/15, 0.3. -4, -2/15, d, 0.3 Let b be -2 - -3(-15)/(-24). Let p = -1.7 - -0.7. Suppose 0 = -9j + 90 - 63. Sort 1, b, p, j in ascending order. p, b, 1, j Suppose 10 = -2g, -4g - 15 - 3 = -2a. Suppose -30u = 16u + 138. Put u, 1, a, 8 in increasing order. u, a, 1, 8 Let w = -1911 + 1874. Sort w, 8/3, -1, 1/9 in decreasing order. 8/3, 1/9, -1, w Let p be 8/36 - 125/(-45). Suppose 0 = pr + r - 4. Suppose -11v - 12 = 21. Put -15, 3, v, r in increasing order. -15, v, r, 3 Let p(v) = -58v + 58. Let a be p(1). Sort -0.4, 1, a, 0.021 in decreasing order. 1, 0.021, a, -0.4 Let l be 3 - 0(-6)/36 - 8. Sort 2, -49, l, 4. -49, l, 2, 4 Suppose -17j - 2j + 76 = 0. Let h be (-45)/21 + -21 + j. Let q = -0.074 - -0.014. Sort h, -0.2, q in decreasing order. q, h, -0.2 Let z be -2 + (-830)/8 + (-1 - -1). Let k = z - -2499/20. Let r = k + -19. Sort -3, r, 1/7. -3, 1/7, r Suppose -b = 4c + 48, 5 = -c + 3b - 7. Put c, 0.3, -1/7, -0.1, -5 in ascending order. c, -5, -1/7, -0.1, 0.3 Suppose -8r + 2 = 42. Let c = 4 + -5. Suppose -4t + 11 = -m, -2m + 36 = 4t + 2m. Sort t, c, r in decreasing order. t, c, r Let p = -51109/5 + 10135. Sort p, 5, 3, -0.5, -0.3 in descending order. 5, 3, -0.3, -0.5, p Let v = 2443 - 791533/324. Let o = v + -211/1620. Put 0.2, 10, -4, o in decreasing order. 10, 0.2, o, -4 Suppose 4s = 2q - 6, -23 = s + s - 5q. Let b be 8/(-18) + s - (-22)/(-99). Put 0.06, b, -5, 3/4 in increasing order. -5, 0.06, b, 3/4 Let c = -6052 - -42361/7. Put -0.4, -3, 4, c, -1/3 in descending order. 4, -1/3, -0.4, c, -3 Let s(i) be the second derivative of -i5/20 - i4/2 + i*3/3 + 9i*2/2 + 10i. Let b be s(-6). Suppose 28*z = -97 -	{ "pile_set_name": "DM Mathematics" }
ate the remainder when k/(-3)6/(-4) is divided by 5. 4 Suppose 1 - 101 = -5b. Calculate the remainder when 2/3 - 115/(-3) is divided by b. 19 What is the remainder when 20 is divided by 4/22 - (-714)/66? 9 Suppose 0 = 2c + 22. Let h = c + 28. Suppose y + 2y = 96. Calculate the remainder when y is divided by h. 15 Let s(f) = -4f + 5. Let n be s(6). Calculate the remainder when -3n/(-6)-4 is divided by 13. 12 Suppose 0 = 4p - 83 + 23. Calculate the remainder when p is divided by 5. 0 Let a = -46 + 117. Calculate the remainder when a is divided by 18. 17 Suppose -5i = -4i - 13. Suppose 0 = 3o + 52 + 107. Let x = -28 - o. What is the remainder when x is divided by i? 12 Let w be (3 - (-4)/(-3))3. Let s = w + 5. What is the remainder when (-2)/8 + 117/4 is divided by s? 9 Suppose -3n = 2n. Suppose 2o - 4y + 34 = 7o, 4y - 4 = n. Suppose -8 = -2a + 24. Calculate the remainder when a is divided by o. 4 Let c(y) = -y3 - 7y*2 - y - 5. Let g be c(-7). Suppose -f = 3f + 3l - 52, gl = -3f + 39. Calculate the remainder when 37 is divided by f. 11 Calculate the remainder when 92 is divided by (57/57)/(1/471). 45 Suppose -3s - 3k + 12 = 0, -7s + 2s + 5k = -70. What is the remainder when (-49)/(-2) + 2/(-4) is divided by s? 6 Let k(s) = -s + 6. Let j(r) = r2 + r - 1. Let o(v) = 5v*2 + 6v - 2. Let t(h) = -4j(h) + o(h). Calculate the remainder when t(-4) is divided by k(2). 2 Suppose -4z - 5w + 84 = 0, 21 = -2z + 3z - 3w. Calculate the remainder when z is divided by 6. 3 Let x be 14/345/(-6). Let a be ((-12)/14)/(5/x). Let q = -4 + a. What is the remainder when q is divided by 1? 0 Suppose 5 = w, -5v = w + w - 30. Suppose t = -0t + v. What is the remainder when 10 is divided by t? 2 Let t(a) = a2 - a + 1. Calculate the remainder when 20 is divided by t(3). 6 Let j(n) = -n2 - 2n - 6. Let c be j(-5). Let q = c - -45. Suppose 10 = 2f, 0 = -5w + 4f - 35 + 245. What is the remainder when w is divided by q? 22 What is the remainder when 29 is divided by ((-5)/((-15)/(-54)))/(9/(-6))? 5 Suppose 4f + 4h = 28, -2f + 3h + 14 = h. Suppose 1 = 4o - f. Let u = -24 + 29. What is the remainder when u is divided by o? 1 What is the remainder when 74 is divided by 6/33 - (-1 + (-652)/44)? 10 Let m = -111 - -118. What is the remainder when m is divided by 5? 2 Let u(z) = z2 - z + 7. Let a be u(0). Let x(v) = -v3 + 2v2 + 4v - 3. Let w be x(3). Let p = a + w. What is the remainder when 13 is divided by p? 6 Let t(z) = -z*2 + 4z - 1. Let g be t(3). Suppose 10 = -4n + k, -gn = -0n - 5k - 4. What is the remainder when (1 + 1/n)24 is divided by 6? 4 Suppose -2s - 40 = -74. Calculate the remainder when 66 is divided by s. 15 Suppose 4s = -0s + 32. Calculate the remainder when 29 is divided by s. 5 Let f(b) = b*3 + 7b*2 - 3b - 8. What is the remainder when f(-7) is divided by 7? 6 Let m(p) = 15p2 - p - 1. What is the remainder when 44 is divided by m(-1)? 14 Suppose 4l + 5 = 21. Let n = -4 + 15. Calculate the remainder when n is divided by l. 3 Calculate the remainder when 124 is divided by (27/6 + -2)10. 24 Suppose -u - 2 = 3, -2u = -k + 10. Suppose k = -4x - 2 + 6. What is the remainder when 37 is divided by ((-19)/3)/(x/(-3))? 18 Let m(x) = -3x - 2. Suppose 3c - 37 = 2c. What is the remainder when c is divided by m(-5)? 11 Suppose 5h = 6h - 13. Calculate the remainder when 36 is divided by h. 10 Let k = 33 - 16. Let s = -17 + 27. Calculate the remainder when k is divided by s. 7 Let d be (-3)/(-2) + (-2)/(-4). What is the remainder when 16 is divided by ((-28)/8 + d)-6? 7 What is the remainder when (116/145)/(2/30) is divided by 7? 5 Let j = 18 - 23. Let a(s) = 2s*2 + 7s - 1. What is the remainder when 67 is divided by a(j)? 11 Let q(g) = -g*3 + 9g*2 - 7g + 13. What is the remainder when 50 is divided by q(8)? 8 Let c = -49 - -75. Let r = c - 15. What is the remainder when r is divided by 4? 3 Suppose -3i + 2i = -11. What is the remainder when 29 is divided by i? 7 Let j = 49 + -29. What is the remainder when j is divided by -1-2(-7)/(-2)? 6 Let u = 44 - 19. Let m = u - 17. Calculate the remainder when m is divided by 3. 2 What is the remainder when -28(0 - (-1)/(-2)) is divided by 8? 6 Let g(w) = 50w*2 + 1. Let j be 212/(-4). Let y be g(j). Suppose 0 = 3z - 3u - y, -4z - u - 101 = -9z. Calculate the remainder when z is divided by 11. 10 Suppose -2y - d = -0y - 185, -d = 5y - 461. Suppose 9g = 5g + y. Calculate the remainder when g is divided by 8. 7 Let t = -34 + 68. Calculate the remainder when t is divided by 12. 10 Let v(g) = -g*3 - g + 3. Let y be v(0). What is the remainder when 5(-1 - 27/(-5)) is divided by -34(-2)/y? 6 Let o(a) = -5a - 10. Let i be -7-1(-3)/3. Let z be o(i). Suppose 0 = 5v - z - 25. What is the remainder when 27 is divided by v? 7 Suppose 0 = -2w + 5c + 20, 0 = -3w - 3c - 6 + 15. Suppose wj = 71 + 44. Let a(y) = -32y - 20. What is the remainder when a(-2) is divided by j? 21 Let o = 174 - 156. Calculate the remainder when o is divided by 7. 4 Let v(a) = 2a2 - 1. Let n be v(1). Let h = n - 17. Calculate the remainder when 70/4 - (-8)/h is divided by 5. 2 Let d(k) = 2k + 6. What is the remainder when 13 is divided by d(-1)? 1 Suppose 0t + 2t = 4. Suppose 3c = -tc + 45. Suppose 2n = 5w - c + 3, 0 = n + 2w - 6. Calculate the remainder when 5 is divided by n. 1 Let f(p) = 3p - 7. Let y be f(5). Let s be y/(2(-1)/(-1)). Suppose 16 + 8 = sr. What is the remainder when 10 is divided by r? 4 Calculate the remainder when 40 is divided by 216/10 - 2/(-5). 18 Let l(u) be the second derivative of u4/12 + u3/6 + 18u2 + 7u. Calculate the remainder when l(0) is divided by 19. 17 Let p = 5 + 61. Calculate the remainder when p is divided by 34. 32 Let o(z) = 9z + 9. Let f(s) = 26s + 26. Let t(y) = 5f(y) - 14o(y). Let g(v) = v*2 + 4v - 2. What is the remainder when t(6) is divided by g(-6)? 8 Let t(g) = -g*3 + 13g*2 - 11g + 11. What is the remainder when 63 is divided by t(12)? 17 What is the remainder when 63 is divided by 2/8 - 630/(-40)? 15 Suppose -3g = -5s + 77, 0g - 4g = -4. Calculate the remainder when 61 is divided by s. 13 Calculate the remainder when 13 + 126 - 12 is divided by 14. 11 Let c = 106 + -217. Let w = -73 - c. Suppose q - 52 = -3q. What is the remainder when w is divided by q? 12 Suppose -2 + 7 = p. Calculate the remainder when 8 is divided by p. 3 Calculate the remainder when 31 is divided by (3 - (-50)/6)/(6/9). 14 Suppose -4g + 188 = 4z, -3z - 44 = -4z - 2g. What is the remainder when z is divided by 17? 16 Suppose 0 = c + 2l + 3, 12 = 5c - c - 4l. Suppose 4z + 3h - 2 = 3z, -5h = -4z + 8. Calculate the remainder when z is divided by c. 0 Suppose -3l = -455 + 44. What is the remainder when l is divided by 35? 32 Let l be (12/3)/(2 - 1). Suppose 8 = -2u, la + 3 = 3u + 31. Suppose -2f = s + s - 12, 2f - 34 = -as. What is the remainder when 21 is divided by s? 10 Let t = -2 - -2. Suppose t = 3w - 7w + 56. Calculate the remainder when 40 is divided by w. 12 Let a(c) = -8c - 2. Let f = 3 - 1. Suppose fv = -6 + 32. What is the remainder when a(-5) is divided by v? 12 Let a(c) = -c*2 + 3c - 3. Let r be a(3). Let v = r + 7. What is the remainder when 10 is divided by v? 2 Let r(n) = 3n2 + 7n - 8. What is the remainder when r(5) is divided by 21? 18 Let i(w) = w*2 + 9w - 6. Let b be i(-10). Suppose bk - 5u = 92, -2k + k - 2u + 23 = 0. Suppose 63 = 5c + 3. What is the remainder when k is divided by c? 11 Let k(s) = -s - 1. What is the remainder when -5(5/1 - 4) - -10 is divided by k(-5)? 1 Suppose 2i = 5w - 171, 3i = 4w - w - 108. What is the remainder when w is divided by 9? 6 Suppose -4k = -18 - 62. Calculate the remainder when k is divided by (-2)/((-15)/(-21) - 1). 6 Suppose 3v = 5v - 2, v - 21 = -q. Suppose 0 = 24o - qo - 16. Calculate the remainder when 19 is divided by o. 3 Let o(h) = -22h + 10. Calculate the remainder when o(-3) is divided by 13. 11 Suppose 3h - 98 = 4. Suppose 0 = 2w - 3w + 4. Suppose wg - 5 = 43. Calculate the remainder when h is divided by g. 10 Let x = 42 + -15. What is the remainder when 49 is divided by x? 22 L	{ "pile_set_name": "DM Mathematics" }
4i2t - 2it + i + 67t wrt i? 20i*3t - 288t What is the second derivative of -18q*3 - 2q*2 + 2q + 47 wrt q? -108q - 4 Find the third derivative of 11m*4v*3 + 2m*4v - m*3v - 2m2v*2 + 2v*3 - 14 wrt m. 264mv3 + 48mv - 6v Differentiate 2q3v*4 - 1100q*3 + 72v*4 with respect to v. 8q*3v*3 + 288v*3 Find the second derivative of 16m*2r*3z + 2m2rz - 57mr3z - 2mr*2 - 5mrz - 2r3z wrt m. 32r3z + 4rz Find the third derivative of -nrs*3 - 11nrs - 2rs*3 - rs*2 + rs + 2r + 10s*3 wrt s. -6nr - 12r + 60 Find the second derivative of -4gp*4v + 7gp*2v - 2gpv - 37gv - 10p*3v + 5v + 2 wrt p. -48gp2v + 14gv - 60pv What is the derivative of -or - 97o - 39r - 2 wrt r? -o - 39 Find the third derivative of -1006m*3 - 7m*2 + 12m. -6036 Find the second derivative of -6f3p + 96f3 - f2p + 9fp - 2f + 34p wrt f. -36fp + 576f - 2p What is the second derivative of 959x2 + 7x + 407? 1918 What is the derivative of 5491r2 + 2249? 10982r What is the derivative of -494f3 - 205? -1482f*2 Find the third derivative of 25d*6 - 7d*5 - 3d*3 + 11d*2 - 2d + 71. 3000d3 - 420d*2 - 18 Find the second derivative of 18h*5 + 11h*4 - 95h wrt h. 360h3 + 132h*2 Differentiate 1990lq2v + 2lq*2 + 2lqv + 4l - 48q*2 wrt v. 1990lq2 + 2lq What is the first derivative of 10b*3 - 38b*2 - 2293? 30b*2 - 76b What is the third derivative of -5153k3p - 585k2p + k*2 wrt k? -30918p Find the third derivative of 8d5r + 12d3r*2 + 16d*3 + 4d*2r2 - d2 - 4dr*2 + 109d wrt d. 480d2r + 72r2 + 96 Find the second derivative of -4j*4 + 13j*3 + 337j wrt j. -48j2 + 78j Find the third derivative of 52cs*6 + cs*4 - 2cs2 - 59cs wrt s. 6240cs3 + 24cs Find the third derivative of -2t*5 + 14t*3 + 157t*2 wrt t. -120t*2 + 84 Find the third derivative of 276w*3 - 303w*2 wrt w. 1656 What is the derivative of 14j*2p - 3jpy + 4jy - 206p - 4y wrt j? 28jp - 3py + 4y What is the third derivative of -10a2m3 + a2m2 - a2m - 238a2 + 23m*3 wrt m? -60a*2 + 138 What is the second derivative of -751u*5 - 6u*4 - 1531u wrt u? -15020u3 - 72u2 Find the third derivative of g6x2 + 1066g*6x - 3g2x*2 + 7g*2 + 8x*2 wrt g. 120g*3x*2 + 127920g*3x Find the second derivative of -1991i4 + i3 + 4464i wrt i. -23892i2 + 6i What is the first derivative of -12i3 + i2 - 241? -36i*2 + 2i What is the derivative of -1631dg*3 - 832d wrt g? -4893dg*2 What is the first derivative of -927g*3 - 2903 wrt g? -2781g*2 Find the second derivative of 2c*4 - 3025c*3 - 2c*2 + 13c + 104 wrt c. 24c2 - 18150c - 4 What is the third derivative of 2j3u*4 - 62j*3 + 8j*2u*2 + 11ju4 - 2u*4 + 2u wrt u? 48j3u + 264ju - 48u What is the second derivative of 45g*2r*4 + 4g*2 - 2gr5 - 18gr wrt r? 540g*2r*2 - 40gr3 What is the derivative of 628j*3 + 997 wrt j? 1884j*2 Differentiate -12d*3q*2 - 9871d*3 - dq*4 + 10q wrt q. -24d3q - 4dq*3 + 10 What is the derivative of -10c*3 + 16c*2 - 66? -30c*2 + 32c What is the third derivative of -h*3r*3 + 2h*3 + 21hr2 + 267r*3 wrt r? -6h*3 + 1602 What is the second derivative of 222l*5 - 3l*3 - 188l - 2 wrt l? 4440l3 - 18l Find the third derivative of 130a3 - 62a*2. 780 Find the third derivative of 11y*6 + 119y5 + y3 + y*2 + 2872y. 1320y3 + 7140y*2 + 6 Find the third derivative of -ak*2r*3 + 3ak2 - akr3 - 35akr*2 + 3ak - 81ar3 wrt r. -6ak2 - 6ak - 486a Find the third derivative of 15ix*6 + ix*3 + ix*2 - 6ix - 28x*5 + 2x*2 - 8x wrt x. 1800ix*3 + 6i - 1680x2 Find the second derivative of -62q*2 - 174q. -124 What is the second derivative of 3fg*3h + fg2h + 10fgh + 10fh - 85g*3 - 7h wrt g? 18fgh + 2fh - 510g Differentiate -3x4 - 104x + 555. -12x3 - 104 What is the third derivative of -2042c*3 - 222c*2 wrt c? -12252 Differentiate 2ou2 + 3ou - 45o - u*2 - 16u - 34 with respect to u. 4ou + 3o - 2u - 16 What is the second derivative of -279o3 - 720o wrt o? -1674o Find the third derivative of -30x*5 - 2x*4 + 24x*3 - 3x*2 - 2x + 445. -1800x2 - 48x + 144 Find the second derivative of -d*5 + 36d*2 - 1087d wrt d. -20d3 + 72 What is the third derivative of -2f*4v + f*3v - f*2v + 2fv + 8f wrt f? -48fv + 6v What is the derivative of 22x2 - 9x - 7? 44x - 9 Find the second derivative of 20z*5 + 6z*3 - 1913z wrt z. 400z3 + 36z What is the first derivative of 5v4 + 52v*3 - 856 wrt v? 20v*3 + 156v*2 What is the second derivative of -47f*3 - 2f*2p*2s + 4f2s*2 + 16fps*2 + 4fs2 - p2s*2 + ps*2 wrt f? -282f - 4p2s + 8s2 What is the second derivative of -5ko2y - 2koy - ky - k + 33o2y + o*2 - 9oy - 7 wrt o? -10ky + 66y + 2 Find the third derivative of 619b5 - 670b*2. 37140b*2 Find the second derivative of 3240q*5 - 2q*2 - 623q - 1 wrt q. 64800q3 - 4 Find the second derivative of 14700c*2 - 8624c wrt c. 29400 Find the second derivative of -9638d5 - 966d. -192760d3 Find the second derivative of -n5 + 77n*4 - 143n. -20n3 + 924n*2 Find the second derivative of -683m*2w*3 + 1542mw3 wrt m. -1366w*3 What is the third derivative of 6283c*6 + 14c*2 + 21c wrt c? 753960c3 What is the second derivative of 1753c*4 + 1010c? 21036c2 What is the second derivative of -5b*2u*2 + 545b*2u + b*2 + bu + 1840u2 wrt b? -10u*2 + 1090u + 2 Find the third derivative of -608s3 + 2s*2 + 64s. -3648 What is the second derivative of 3u4 - 3u*3 - 55u*2 - 5472u? 36u2 - 18u - 110 Find the third derivative of -19019o3 + 5107o2 wrt o. -114114 What is the third derivative of f4t2 + 2f*3t*3 + 80f3 + f2t3 + 122ft wrt f? 24ft2 + 12t*3 + 480 Find the third derivative of -3751y*6 + 2y*2 - 350y - 1 wrt y. -450120y3 Find the third derivative of -23w*3 - 1880w*2. -138 What is the third derivative of 794n*5 + 92n*2? 47640n2 What is the third derivative of m2o3 + m2o - 1227mo*6 - 2o*2 - o wrt o? 6m*2 - 147240mo3 What is the first derivative of 7o*4 + 10o*3 - 175? 28o*3 + 30o*2 Differentiate 2p*2 + 784p - 587 with respect to p. 4p + 784 What is the third derivative of -8l*4 + 31549l*2? -192l What is the second derivative of -61a2f*3o - a*2fo3 - 2af3o - af2o*3 - 2f*3o - 16fo wrt a? -122f3o - 2fo*3 Find the third derivative of -64k*4u*2 + 2k*3u*2 + 7k*2u*2 + 7k*2 wrt k. -1536ku2 + 12u*2 Differentiate -94m*2t*2 + 3202m*2 - m - 7t*4 with respect to t. -188m*2t - 28t3 What is the derivative of -3kr2t - 2kr + r*2t + r*2 - 156 wrt t? -3kr2 + r2 Find the third derivative of -61ck2s*3 + 5ck2s*2 - 6ck2u + 2cs*2 + 3csu - 3k2s*3 + 2s*3u + s*2u wrt s. -366ck*2 - 18k*2 + 12u Find the third derivative of -13b2c*3 - 2b*2ct + 2bc2l*2 + 2bc2 + 2bl2t + 2c3l*2t + 2c3t wrt c. -78b2 + 12l*2t + 12t What is the third derivative of -103i6 + i5 + 72i2 + 2? -12360i*3 + 60i*2 What is the third derivative of -9hq5 - 25hq2 + 7h + 3q5 + 4q*3 wrt q? -540hq2 + 180q*2 + 24 Find the third derivative of 36b3 - b2 - 495 wrt b. 216 What is the first derivative of -969bin - 397b + 5i3n - 8n wrt i? -969bn + 15i*2n Find the third derivative of v*4 - 914v*3 + 451v*2 + 3v + 2. 24v - 5484 Find the second derivative of 2090k*2s*2 + 2k*2 + 4ks4 - 127ks + 2s*2 - 20s - 1 wrt s. 4180k2 + 48ks2 + 4 What is the second derivative of 4159x*2 + 452x - 2? 8318 Find the second derivative of 8x4y*2 + 17x*3y*2 - 6x*2 - 19xy2 - 10x wrt x. 96x2y*2 + 102xy2 - 12 Find the third derivative of u6 - 5u*4 + 46u*3 - 8u*2 + 5u - 7 wrt u.	{ "pile_set_name": "DM Mathematics" }
ve of -x*4/6 - 29x. Let q(s) = 3s2 + s. Give v(q(m)). -18m*4 - 12m*3 - 2m*2 Let q(m) be the second derivative of -m + 0 + 1/6m*3 + 0m*2. Let s(g) = 11g + 8. Let v(t) = -4t - 3. Let r(i) = -3s(i) - 8v(i). What is q(r(k))? -k Let p(o) = 147o*2 - 4. Let z(h) = -3h*2. Determine z(p(k)). -64827k*4 + 3528k*2 - 48 Let a(t) = -3t2. Let m(p) be the second derivative of -p3/2 - 2p. What is a(m(y))? -27y*2 Let k(a) = -9a. Let b(m) = 3253m. What is b(k(h))? -29277h Suppose 3 = -z + 5. Let j(s) = s + 3s - zs. Let l(a) = 2a2 - 2a*2 + 2a*2 - 3a*2. Give j(l(q)). -2q*2 Suppose 0z = 4z. Let r(j) be the third derivative of 0j + 1/12j4 + z + j2 + 0j*3. Let b(i) = -2i*2. Give b(r(q)). -8q*2 Let l(o) = -3o*2 + 7o - 7. Let t(b) = 3b2 - 6b + 6. Let a(h) = 6l(h) + 7t(h). Let z(d) = 2d. Give a(z(g)). 12g*2 Let k(u) = 2u*2 - 41. Let f(g) = 6105 + g - 6105. Determine f(k(y)). 2y2 - 41 Let y(h) be the third derivative of -h5/40 - h*3/2 - 2h*2. Let z(f) be the first derivative of y(f). Let c(r) = -2r*2. Calculate c(z(v)). -18v*2 Suppose -5o - 2m = -9, -3m = -2o + 5o. Let w(p) be the first derivative of 0p + 1/2p*2 + o. Let s(t) = 2t*2. What is w(s(b))? 2b*2 Let k(u) = -2u*2. Let r(b) = -17b*2 - 6b + 6. Let o(p) = 185p2 + 65p - 65. Let a(v) = 6o(v) + 65r(v). Calculate k(a(f)). -50f4 Let y(b) = -7b*2 + 0b*2 + 2b*2. Let q(p) = p - 5. Let d(t) = 1. Let x(j) = 5d(j) + q(j). Determine x(y(n)). -5n2 Let z(g) = 2g - 1187. Let q(c) = 11c2. Determine q(z(v)). 44v*2 - 52228v + 15498659 Let p(m) be the first derivative of 2m3/3 + 2. Let f(y) = -2y*2. Determine p(f(j)). 8j*4 Let t(u) = -3u*2. Let j = 7 + -5. Let k(x) = 16x - 16x - jx*2. What is t(k(i))? -12i*4 Let h(n) = 6n*2 + 8n. Let t(y) = -2y. Calculate h(t(d)). 24d*2 - 16d Let m(s) = 9s2 + 5s + 5. Let h(t) = 4t2 + 2t + 2. Let u(c) = -5h(c) + 2m(c). Let o(d) be the second derivative of -3d3 - 63d. Give o(u(n)). 36n2 Let b(g) = 4g*2. Let p(f) = -2f*2 - f. What is p(b(t))? -32t*4 - 4t*2 Let y(x) = 27x. Let z(n) = 2n. Calculate z(y(t)). 54t Let k(q) = -2q2. Let p(v) = 489v*2. What is k(p(z))? -478242z*4 Let j(a) = 3a + 15a - 4a - 7a. Let t(z) = -5z*2. Give t(j(u)). -245u*2 Let t(r) = 1602 + 0r2 - 1602 - r2. Let k(i) = 11i2 + 14i*2 - 6i*2. What is k(t(q))? 19q*4 Let n(l) = -89l. Let c(x) = -18x + 3. Calculate n(c(m)). 1602m - 267 Let r(i) be the first derivative of 0i2 + 5/3i*3 + 0i - 7. Let x(n) = 2n. Give r(x(q)). 20q*2 Let v(p) = 3p*2. Let a(s) = -27s. Let i(h) = -135h. Let j(t) = -24a(t) + 5i(t). Calculate v(j(k)). 2187k*2 Let b(x) = 99x + 55. Let w(j) = 7j + 4. Let r(l) = -4b(l) + 55w(l). Let d(z) be the first derivative of z2 + 57. Determine r(d(i)). -22i Let h(r) = -4r. Let a(c) = -c. Let f(o) = 6a(o) - h(o). Let m(d) = 0d2 + 2d*2 + 0d*2. Calculate f(m(p)). -4p*2 Let u(a) = -16a2 - a2 - 9a2. Let n(r) = r2. Determine n(u(m)). 676m4 Let n(y) be the second derivative of y4/12 + 5y. Let t(s) = 6s*2. Calculate n(t(z)). 36z4 Let q(t) = t + 4. Let w(r) = -r2 - 5r + 1. Let i be w(-5). Let c(a) = -4 + 5 + 2a - a. Let j(x) = iq(x) - 4c(x). Let y(p) = -2p. What is y(j(s))? 6s Let u(k) be the second derivative of 13k3/6 - 26k. Let c(z) = 2z2. What is c(u(y))? 338y2 Let j(t) be the first derivative of t2/2 + 20. Let o(y) = 22y. Give j(o(v)). 22v Let u = -2 + 6. Let y(w) = 8w - 2w - uw. Let r(d) = -4d. Calculate r(y(x)). -8x Let s(c) = 6c*2. Let b(j) = -5j. Determine b(s(h)). -30h2 Let y(t) = t2. Let q(k) be the second derivative of 0k3 - k3 - 3k + 0k*3. Determine y(q(v)). 36v*2 Let y(j) = j + 1. Let k(l) = -4l + 26. Give y(k(a)). -4a + 27 Let b(r) = 2r*2. Let m(p) = -2p + 3p + p. Let j(s) be the first derivative of 5s*2 + 3. Let h(y) = 3j(y) - 16m(y). Give b(h(o)). 8o2 Let j(b) = -b2. Let q(o) = -o*2 - 8o - 8. Let x be q(-6). Let c(s) = 3 + 1 - x - s. What is j(c(v))? -v*2 Suppose 11 = 5r - 4. Let c(u) be the first derivative of 1/3u3 + 0u - r + 0u2. Let v(a) = -a2. Calculate v(c(m)). -m4 Let f(r) be the third derivative of r6/180 - r3/6 - 3r*2. Let u(v) be the first derivative of f(v). Let g(b) = b. What is u(g(a))? 2a*2 Let s(v) = -2v*2 + 5v. Let z(x) = 2x2 - 6x. Let i(p) = -6s(p) - 5z(p). Let l(t) = 2t2. Calculate l(i(k)). 8k*4 Let w(d) be the first derivative of -2d2 + 75. Let t(u) be the third derivative of u4/24 + u*2. Give w(t(m)). -4m Let p(q) = -54q + 3. Let c(h) = 2h. Give c(p(f)). -108f + 6 Let k(l) = -l. Let p(v) = 15v2 + 20. Let q(r) = -r2 - 1. Suppose 2t + 3 = 1. Let i(o) = tp(o) - 20q(o). Calculate k(i(b)). -5b*2 Let v(k) be the third derivative of -7k*4/12 - 2k*2. Let w(z) = z. Calculate w(v(f)). -14f Let o(j) = j + 2j + 2j. Let x(b) = -b. What is o(x(z))? -5z Let a(l) = l2. Let p(u) = -3085u. What is a(p(w))? 9517225w2 Let g(f) = -18f*2. Let r(v) = 3v*2 - 2v*2 - 3v*2. What is g(r(b))? -72b*4 Let g(u) = -26u. Let h(p) = -22p + 3. Calculate h(g(d)). 572d + 3 Let t(k) = -k. Let l(f) = 5311f. Calculate t(l(v)). -5311v Let d(h) be the first derivative of 1/3h3 - 1/2h*2 + 0h + 2. Let r(l) = l*2 - 2l. Let n(f) = -2d(f) + r(f). Let x(s) = -s2. What is x(n(c))? -c4 Let b(q) = 4q*2. Suppose 2a - a = 2. Let d(k) = -11ka + k - k + 13k*2. What is d(b(f))? 32f*4 Let g(c) = c. Let z(a) = 3a. Let n(w) = -5g(w) + 2z(w). Let d(o) = 2o2. Calculate n(d(f)). 2f*2 Let d(u) = -16u*2. Let t(n) = 22n*2. Give d(t(m)). -7744m*4 Let x(s) = 10s*2 - 7. Let b(h) = 7h*2 - 5. Let n = -5 + -2. Let f(k) = nb(k) + 5x(k). Let c(o) = o2. Determine c(f(i)). i4 Let h(v) be the second derivative of -v3/3 + 3v. Let c(k) = 3k2 - 7k + 7. Let u(j) = j*2 - 3j + 3. Let q(y) = 6c(y) - 14u(y). What is h(q(t))? -8t2 Let v(x) = 12x*2. Let y(o) = -270o. Calculate v(y(m)). 874800m2 Let j(c) = -c. Suppose -12 = -2d - 2d. Let z(a) = 2a - d + 3. What is z(j(v))? -2v Let n(l) = l. Let v(r) = 4r. Let o be 0 + 0 + -1 - 2. Let y(h) = ov(h) + 10n(h). Let b(f) = -4f + f + f. Determine y(b(a)). 4a Let t(k) = -11k - 3. Let c(u) = -u2. Determine t(c(y)). 11y*2 - 3 Let m(f) = 465f. Let l(u) = u*2. What is m(l(z))? 465z*2 Let o(b) = 5b + 4. Let r(j) be the second derivative of j*2/2 - 4j. Let k(p) = o(p) - 4r(p). Let q(t) = -2t. Calculate k(q(c)). -10c Let u(p) = -2p2. Let w(h) = h2 + h + 4. Let i be w(0). Let z(b) = 5 - i - 2. Let j(s) = s + 1. Let y(d) = 4j(d) + 4z(d). What is u(y(f))? -32f2 Let n(r) = 10r. Let f(g) = 15g. Give f(n(a)). 150a Let h(z) be the third derivative of z5/60 + z2. Let m(v) = -15v - 9. Let s(k) = -7k - 4. Let a(g) = 4m(g) - 9s(g). Determine h(a(y)). 9y2 Let x(r) = -5r. Let w(p) = -36p2. What is x(w(m))? 180m2 Let m(u) = -u. Let z(q) = q2 + 5q + 2. Let g be z(-5). Let r(b) = 6b - gb - b - b. Calculate m(r(o)). -2o Let u be ((-6)/2)/(4 + -5). Suppose -t + 12 = -3x, -t - x - 9 = ux. Let p(a) = -3 + t - 14a2 + 15a*2. Let v(s) = 3s. Calculate p(v(m)). 9m2 Let w(u) = 38u*2. Let s(c) = 106c*2. Give w(s(l)). 426968l4 Let b(c) = -c2. Let u(t) = 18t2 + 12t*2 - 14t*2. What is b(u(j))? -256j*4 Let g(r) = -141r*2. Let h(b) = -5b*2. Give h(g(w)). -99405w*4 Let u(t) = 0 + 0t + 5 + t. Let o(m) = m + 4. Let i(w) = 5o(w) - 4u(w). Let k(h) = 1. Let q(n) = -n - 1. Let l(y) = k(y) + q(y). Give i(l(r)). -r Let m(o) = 2o - 2o - 3o2 + 4o*2. Let w(a) = -19a*2. What is m(w(j))? 361j*4 Let b(h) = 14h - 35h + 23h. Let z(n) = -7n - 5. Let j(x) = -8x - 6. Let w(l) = -5j(l) + 6z(l). Calculate w(b(u)). -4u Let m(j) = 407j*2 - 143j + 143. Let f(k) = -17k2 + 6k - 6. Let l(n) = 143f(n) + 6m(n). Let g(b) = -b*2. Give g(l(c)). -121c*4 Let a(n) = -12n*2. Let y(r) = r. Let s(p) = p. Let j(t) = s(t) + y(t). Calculate a(j(w)). -48w*2 Let i(x) = -26x + 3. Let k(y) = 27y - 4. Let m(r) = 4i(r) + 3k(r). Let g(b) = -9b. Let h(c) = -5c. Let j(s) = -4g(s) + 7h(s). Calculate m(j(z)). -23z Let	{ "pile_set_name": "DM Mathematics" }
ltiple of 128 and 736? 2944 Calculate the smallest common multiple of 300 and 1440. 7200 Find the common denominator of -19/444 and -25/2628. 97236 What is the smallest common multiple of 1512 and 11? 16632 What is the least common multiple of 156 and 118? 9204 Calculate the lowest common multiple of 3612 and 420. 18060 Calculate the lowest common multiple of 90 and 90. 90 What is the common denominator of 26/375 and 17/25? 375 What is the smallest common multiple of 42 and 77? 462 Calculate the smallest common multiple of 86 and 6. 258 What is the common denominator of 58/27 and -92/399? 3591 Calculate the common denominator of -137/30 and -62/645. 1290 Find the common denominator of -29/70 and -139/42. 210 Find the common denominator of 71/51 and 71/21. 357 What is the smallest common multiple of 40 and 20? 40 Calculate the least common multiple of 48 and 4088. 24528 Find the common denominator of -49/16 and 37/352. 352 Calculate the smallest common multiple of 430 and 215. 430 Find the common denominator of 101/20 and -61/245. 980 Calculate the lowest common multiple of 192 and 40. 960 What is the smallest common multiple of 370 and 9? 3330 What is the smallest common multiple of 2 and 11? 22 Find the common denominator of -43/3585 and -173/7170. 7170 Calculate the least common multiple of 7404 and 3085. 37020 Find the common denominator of -17/12 and 97/58. 348 Calculate the least common multiple of 3 and 78. 78 What is the lowest common multiple of 276 and 75? 6900 What is the common denominator of 139/3654 and 35/348? 7308 Calculate the common denominator of 137/798 and 95/126. 2394 What is the least common multiple of 388 and 11? 4268 What is the least common multiple of 14 and 8? 56 What is the smallest common multiple of 116 and 28? 812 What is the smallest common multiple of 136 and 44? 1496 Calculate the lowest common multiple of 6 and 43812. 43812 What is the lowest common multiple of 756 and 18? 756 Calculate the common denominator of 67/72 and -77/18. 72 Find the common denominator of 33/8 and 32/17. 136 What is the smallest common multiple of 636 and 152? 24168 Find the common denominator of -2 and -58/111. 111 What is the lowest common multiple of 14 and 1072? 7504 Find the common denominator of 85/1782 and -89/18. 1782 What is the least common multiple of 24 and 3110? 37320 Calculate the common denominator of 21/310 and 53/22. 3410 Calculate the least common multiple of 46 and 70. 1610 What is the common denominator of 86/15 and -34/555? 555 What is the least common multiple of 2 and 6672? 6672 Calculate the least common multiple of 27 and 147. 1323 What is the common denominator of -35/1068 and 107/18? 3204 Calculate the lowest common multiple of 96 and 32. 96 Calculate the common denominator of -5 and 8/9. 9 Calculate the common denominator of 3/28 and 77/108. 756 What is the lowest common multiple of 20 and 1966? 19660 What is the common denominator of -41/12 and 91/2? 12 What is the lowest common multiple of 1 and 2291? 2291 What is the smallest common multiple of 18 and 444? 1332 Find the common denominator of -47/368 and 53/184. 368 Find the common denominator of -29/140 and -1/52. 1820 What is the common denominator of 9/4 and -53/204? 204 Calculate the common denominator of -53/1125 and 41/20. 4500 What is the lowest common multiple of 4 and 271? 1084 What is the common denominator of 179/1080 and 109/450? 5400 What is the lowest common multiple of 7 and 15? 105 Find the common denominator of -101/12 and -107/288. 288 What is the common denominator of -14/243 and -8/45? 1215 Find the common denominator of 79/16 and -23/150. 1200 Find the common denominator of -48/35 and 115/868. 4340 What is the smallest common multiple of 210 and 14? 210 Find the common denominator of 59/740 and -3/740. 740 What is the common denominator of 25/76 and 69/124? 2356 Find the common denominator of 109/294 and 59/462. 3234 Calculate the lowest common multiple of 945 and 420. 3780 Calculate the lowest common multiple of 101 and 5. 505 What is the lowest common multiple of 24 and 612? 1224 Calculate the smallest common multiple of 20 and 28. 140 Calculate the smallest common multiple of 1408 and 2944. 32384 Find the common denominator of -63/248 and 79/14. 1736 What is the common denominator of -41/270 and -49/20? 540 Calculate the smallest common multiple of 18 and 10725. 64350 What is the common denominator of -86/21 and 13/519? 3633 What is the least common multiple of 4 and 1764? 1764 Calculate the least common multiple of 61 and 6. 366 Calculate the common denominator of 101/2072 and 103/140. 10360 What is the smallest common multiple of 580 and 20? 580 What is the common denominator of 111/10 and -3/4? 20 Calculate the lowest common multiple of 200 and 2450. 9800 What is the common denominator of 41/32 and -43/392? 1568 Calculate the lowest common multiple of 32 and 20. 160 Find the common denominator of 71/1035 and -44/105. 7245 What is the least common multiple of 3 and 44? 132 Calculate the common denominator of -2/55 and -103/270. 2970 Calculate the lowest common multiple of 8 and 1820. 3640 What is the lowest common multiple of 150 and 165? 1650 What is the lowest common multiple of 128 and 192? 384 What is the lowest common multiple of 507 and 12? 2028 Calculate the smallest common multiple of 28 and 49. 196 Calculate the common denominator of 29/41 and 47/6. 246 Calculate the smallest common multiple of 168 and 21. 168 What is the common denominator of 47/644 and -31/460? 3220 What is the common denominator of -81/8 and -1/249? 1992 Calculate the least common multiple of 15 and 150. 150 What is the smallest common multiple of 12 and 42? 84 What is the lowest common multiple of 87 and 3? 87 Calculate the smallest common multiple of 35 and 415. 2905 What is the common denominator of -25/2197 and 61/845? 10985 Find the common denominator of -151/6 and 113/17580. 17580 Calculate the lowest common multiple of 288 and 81. 2592 Calculate the least common multiple of 8 and 1530. 6120 Calculate the common denominator of 65/1104 and 31/192. 4416 What is the smallest common multiple of 1938 and 3230? 9690 What is the common denominator of 113/1480 and -21/370? 1480 What is the lowest common multiple of 906 and 7? 6342 What is the common denominator of -149/1284 and 79/10? 6420 What is the smallest common multiple of 1596 and 228? 1596 Find the common denominator of 43/12 and -73/399. 1596 Calculate the common denominator of -2/149 and -127/6. 894 Calculate the smallest common multiple of 1 and 1. 1 Find the common denominator of -7/30 and 35/528. 2640 Find the common denominator of 81/44 and -43/44. 44 What is the least common multiple of 132 and 96? 1056 Find the common denominator of -169/8490 and -173/30. 8490 What is the lowest common multiple of 315 and 24? 2520 What is the least common multiple of 10 and 3? 30 Find the common denominator of -157/180 and -5/6. 180 Calculate the smallest common multiple of 308 and 168. 1848 What is the smallest common multiple of 54 and 18? 54 Calculate the smallest common multiple of 4 and 18. 36 Find the common denominator of 59/10 and -2/25. 50 Calculate the lowest common multiple of 930 and 24. 3720 What is the lowest common multiple of 4 and 1996? 1996 What is the common denominator of -2/21 and -71/132? 924 What is the common denominator of -103/102 and -121/30? 510 Find the common denominator of 58/5 and -68/375. 375 Find the common denominator of -87/4 and 59/2. 4 What is the common denominator of -107/670 and -19/25? 3350 What is the common denominator of -3/8 and 107/348? 696 What is the smallest common multiple of 18 and 123? 738 What is the least common multiple of 8 and 9? 72 What is the common denominator of 38/39 and -23/30? 390 What is the common denominator of -79/548 and 107/20? 2740 What is the least common multiple of 130 and 2? 130 Calculate the least common multiple of 3500 and 500. 3500 Calculate the common denominator of -44/127 and 26/5. 635 Calculate the least common multiple of 48764 and 9. 438876 Calculate the common denominator of -4/29 and 51/2. 58 Calculate the common denominator of 37/300 and -94/525. 2100 Find the common denominator of -125/2124 and -19/156. 27612	{ "pile_set_name": "DM Mathematics" }
135 What is the value of (630/(-8))/((-12)/8) + 177/118 + -1? 53 What is ((-4)/(-10))/(20 + 722(-5)/30)? -1/10 (-988)/(-3648)-1075/(-3250) 1/16 Calculate (-24 - -102) + (-52 - -96). 122 45 - (-77(-20)/220 + (-42)/(5 + -2)) 52 What is the value of 130/(-16)1260/3150? -13/4 What is the value of 3231/(-39) + (5/2)/((-9295)/572)? -83 (0 - 8/3)29939/(-9776)(-12)/21 -14/3 Calculate 3236/(-28315) - (-6448)/70. 92 What is (4 - 1)-1((-8500)/6123 + 3)? 116 Evaluate (520/(-30))/((-104)/(-78)) - 152/(-10). 11/5 What is 57/(8 - (-70)/28)? 38/7 What is the value of (259/(75110/(-16)))/((-4)/(-10))? -4/29 What is the value of 28304/(-671) - (2 + 2) - -6(-4)/(-132)? -46 Calculate (-2)/93 + 1587370/(-2039025). -4/5 Evaluate (930 - 941)(6856/41712 + (-2)/12). 2/79 Calculate (-163)/(-326)(-2 + (-21)/(-6)). 3/4 ((-3656)/(-992) + (-438)/(-6789))40/3 50 Evaluate ((-3)/2)/((-124890)/(-3620)). -1/23 What is the value of 2/(-37)(-22)/((-4268)/291)? -3/37 Calculate (-698)/2094 + (-80)/(-285). -1/19 (-2)/136((-2079)/105 - 760/(-200)) 4/17 What is the value of 5 - ((-17716)/(-2163))/((-2)/(-21))? -81 Evaluate (34/255)/(1311/12870). 12 (20 - 372/18)-44(-21)/561 -11 What is the value of ((-2145)/12870)/((-1)/(-132))? -22 (-32)/(-464) + (-1232)/(-5684) 2/7 What is the value of (-2)/2 - (14 - 50(-2006)/(-1475))? 53 Evaluate (-17)/((-10353)/42) + (-14)/(-638). 1/11 Evaluate 18043 - 17970 - (-129)/(-2). 17/2 Evaluate (-4970)/(-639)(-243)/45. -42 What is (-73)/(-30) - ((-1)/11)/(1164/2134)? 13/5 What is (-142 + 243)/1515 + (-8)/(-20) + 0 + -1? -8/15 Calculate (-24)/(-210)(-3297)/(-2512). 3/20 Evaluate (-84)/2940(-47005)/17. 79 What is the value of 18/(61 - (-7960)/(-130)) - (-21 + -2)? -55 Calculate (-6 - -4) + (-32)/(-24) + (-76)/3. -26 8/1094875/3450 22 What is the value of ((2/56)/(198/396))/(10/7)? 1/20 What is 11/(-20)(-2030)/56 - (-10)/160? 20 ((-5)/2)/((-281105)/15333) 3/22 (300/1560)/(460/1472) 8/13 What is the value of ((-66)/24)/((-14)/(21) - (-1628)/296)? 11/6 Calculate 29130/165 + -77 - 6/11. 99 Calculate -26 - (-7 - 9) - (-260)/25. 2/5 What is 443/(-4873)(-22)/(-16)? -1/8 What is (4520/320 + -16)/(9/(-360))? 75 What is the value of 7/2(-4 - (-170)/42)(-163 + 160)? -1/2 Calculate 440/(-63) + (0 + -42)/(-6). 1/63 Calculate (-7)/5 + 1 - (91104/(-1460) - (3 + -30)). 35 (447/1639 + 26/66)/(4/90) 15 78/112 + (90 - 37492/416) 4/7 (4/1347)/(-41 - (-847)/1266) -2/449 Evaluate (-2)/((-18)/30248 - 158/(-1554)). -37 Calculate (6895/4137((-10)/(-4) + -3))/(2/276). -115 Evaluate ((-486)/(-24) - 20 - (-15)/12)38/3. 19 Evaluate 48/(-60) + (-3243)/(-235) - -12. 25 What is 9/((-450)/(-2920)) - 18/(-180)6? 59 Evaluate ((-1042)/7815 - 416/30)12/(-14). 12 28/42 + (-13310)/1452 -17/2 Calculate (-975240)/(-12420) - (-468)/(-6). 12/23 Evaluate ((-1)/3)/(16755/3719610). -74 What is the value of ((-42273)/1134 - (-6)/(-27))(-8)/4? 75 What is (0 - (-27 - -28))(13 - -3)1? -16 What is 292/126 - ((-91)/((-40131)/(-6573)) + 2 + 13)? 20/9 Evaluate 93/62((-1920)/(-3195))/(-32). -2/71 (-2)/(-4)(11300/(-113) - -146) 23 Evaluate (-6 + 204/30)(920/224)/23. 1/7 Calculate ((-8)/360)/((-216)/(-5832)). -3/5 Calculate 41/56 + 372/(-465) + (-138)/(-35) + -3. 7/8 6/345 - 167/(-835) 5/23 What is the value of (45 - 125426/2790)(1 + 198 + 1)? 80/9 Calculate 1476/(-42) - ((-9)/((-630)/(-1060)) - -16). -36 What is ((-43171)/1877)/(2/4)? -46 What is the value of ((-22504)/970 - (-24 - 0))((-32)/36 - 3)? -28/9 Evaluate ((-36)/2730/540)/(122/30 + -4). -10/9 Calculate (3163/28467)/(2/(-72)). -4 What is 4164/7634 + (-1148)/2145? 2/195 Calculate 615/(-4) - 131355/(-15012). -145 Evaluate 128/(-120)(-66)/1232. 2/35 Evaluate (1/7)/(62 - (-7821)/(-126)). -2 Calculate 60/(-52)1616/(-12120). 2/13 Evaluate (-19 + 124/6)9 - (4 + 2). 9 Evaluate ((-1632)/23868)/((-30)/25 + 1 - (-7)/(-15)). 4/39 What is (3(-2)/(-18))/((21 + -10)/(-165))? -5 What is (1 + (-330)/660)/((-74)/12)? -3/37 Calculate 11 - (221 - 224 - 10/51). 16 Evaluate 76/20 + 51/255 + (-41)/9. -5/9 Calculate ((-518)/(-126) - (0 - -4)) + (0 - (-5320)/(-252)). -21 Evaluate 352/(-4400)95/874. -1/115 What is 522/(-39) - 126/35130/(-39)? -18/13 3332/(-30) + ((-1070)/321 - (-2)/(50/85)) -111 Calculate (2/10)/((-4)/(-390)) - (-221)/(-442). 19 Calculate (-12(-2)/(-15))/((-1809)/(-4824)4/45). -48 Evaluate (-3)/4618/3708. -1/8 What is (-13040)/815 - (0 + -110)? 94 What is the value of (-1 - 2)/(58/29(-111)/(-6))? -3/37 What is (45/(-12))/(2/8) + 631/42? 1/42 What is the value of 10/(-228) - (90/15 - -1 - (-82)/(-12))? -4/19 Calculate 96(-48 + 386/8). 24 Evaluate 3/(-2)(-64)/(-672)((-2850)/(-25))/19. -6/7 14/56 - (12/4)/(10 - 70/(-14)) 1/20 Evaluate (-370)/80 + ((-1)/3)/(37/(-555)). 3/8 Evaluate 2196/(-2106) + (-1336)/(-13026)6/4. -8/9 (-2505438)/(-215946) - 8/124-1 35/3 ((-1575)/13860)/((20/18)/(96/(-72))) 3/22 What is 5 - ((-1088)/16 - (-51)/3)? 56 Calculate -36 - (-43 + (-31 - -60)). -22 Calculate 241 - 239 - (0 + 84/(-1710))/(3/(-120)). 2/57 Evaluate ((-51)/(-119) - (-39)/(-189))/(71/10863). 34 Calculate (18 - 20230/1120)-100. 25/4 (-2)/(-4) + 15/2 + 1989272/31824 25 (-945)/43054/(-36) 1/41 Evaluate ((-92)/7)/(((-16000)/(-700))/(-80)). 46 What is the value of ((-2)/(-9) - 550/585)3480/2320? -14/13 Calculate (-7 + (-460)/(-18) + (-1440)/80)/((-130)/(-45)). 5/26 Evaluate (-172)/(-611) + (-36 - -2 - 531080/(-15691)). 6/47 (-5)/4 - (-25695)/11420 1 Calculate 11040/2576 + (2/(-11) - 14/(-77)). 30/7 What is 1/19930 + 2570/48830? 49 Evaluate (-24)/564 + 24/(-14 - (-136860)/275). 2/283 What is 31 - (-20 + 36 + (-39)/3)? 28 Calculate 91 + (137 - (-10096)/(-44)). -16/11 Calculate (-28)/322 - (24775/(-575) - -27). 16 Calculate (-4356)/(-121) - -1520/(-15). 16 Calculate (-41)/((-902)/(-308)) - (334/(-6) + 5). 110/3 What is (72/300)/(361/9025)? 6 What is 22257564/(-35178)? -72 Evaluate (-2021)/16770 - (-30)/(-900). -2/13 (6493/(-604) - 3/(-4))46/(-20)2 46 4/15-3 - (-98 + 42 - -51) 21/5 Calculate -2 + 19 + 229 + -191. 55 What is the value of (288317/(-5400) - -33) + (-1)/4? 1/25 Calculate (-19 - -25) + (-594)/(0 - -22). -21 24/9(2574/2200 - 9/675-6) 10/3 Calculate (75 - (211 + -173)) + 7322/(-198). 2/99 What is 0 + ((-4514)/222 - 20/(-30))? -59/3 Calculate -14 - 8/(-18)(-16731)/(-338). 8 Calculate ((-15)/23)/((-184385)/147508). 12/23 What is the value of (60/110)/((-2)/7 - (-91739)/306460)? 40 3436/8590-2(-5)/6 2/3 Calculate 2529/4350 + (-4 - 1410/36). -43 29480/(-4620) - 9/68/42 -20/3 Calculate 18(6/(-10))/((-2007)/(-2230)). -12 ((-3)/63-81)/(161/3381) 81 Evaluate 5/(-10)((-37776)/624 - -61). -3/13 What is the value of ((65/(-10))/(25 + -29))/((-36)/(-576))? 26 (20 - 19)(-165 + 97) -68 What is (6 + (-3)/6)(168 - 154)? 77 What is (1510/(-45) + (-22)/(-99))(-45)/60 + -3? 22 (242190/(-1932))/(-65)-28 -54 (13416/166023)/(((-40)/(-18))/(-10)) -4/11 Calculate ((-1880)/658)/(144/(-56)). 10/9 Calculate (-360)/351039-30. 120 Calculate ((-7)/84-6)/((-14)/4(-96)/(-448)). -2/3 What is the value of (2 - -4 - (-434)/(-60)) + 128/(-768)? -7/5 What is ((-123)/(-82) + (-23)/14)/((-63)/294)? 2/3 Calculate -18 - 12(-437)/304. -3/4 Calculate (0 - 0) + (-52)/(-8)-58(-20)/4060. 13/7 What is the value of 6 + (-188)/30 - (14 + 152/(-20))? -20/3 Calculate -27 - ((18 - 15) + 2) - 42. -74 Calculate -53 + 17 + 87 + -34. 17 Calculate (795 - 797)1/((-4)/(-46)). -23 Calculate -22(250/56 + -50 + 45). 15/7 (-12368)/29971 + (-1720)/(-5848) + (-4)/(-82) -3/43 What is the value of (4725/(-560) - 1/16)((-65)/(-45) + -1)? -34/9 Evaluate ((-2222)/909)/((-11)/90). 20 3 - (3/2)/(331793/11858 - 28) 80 Calculate 2/(7 + (-1799)/259) - -24(-8)/(-16). 49 (9254/(-5288))/(-71) - ((-1130)/(-72))/5 -26/9 What is (165/(-1210))/((-24)/(-192))? -12/11 Evaluate (4 + -7)/54 - 67/402 - 1418/18. -79 (-343)/5 - ((-4779)/153 + 31)/((-20)/34) -69 Calculate -2((-4)/(-10))/((-298)/(-2235)). -6 What is the value of -2623/(-2691) + ((-9)/72 - (-878)/(-144))? -6 Evaluate 9 - (2/((-8)/194) - (-3)/186-155). 60 What is (2 - 4) + 155822/32081? 20/7 Calculate (5 + -4 + -151)(-5351)/(-10702). -75 Evaluate 878/(-4)(1214/(-56))/9. 58 4/(-20)(-10)/(-4)(138 - 140) 1 Calculate 66/(-972) + -18 + (-10797)/(-648). -11/8 What is the value of -4(352/11	{ "pile_set_name": "DM Mathematics" }
the common denominator of -55/10388 and 43/16. 41552 Calculate the least common multiple of 152 and 1102. 4408 What is the common denominator of 95/4 and -71/15? 60 Calculate the common denominator of 31/17 and -97/2. 34 Find the common denominator of -10/133 and 63/152. 1064 Calculate the smallest common multiple of 1275 and 165. 14025 Calculate the least common multiple of 27 and 36. 108 What is the common denominator of 107/2124 and 49/162? 19116 What is the common denominator of -115/66 and -163/210? 2310 Calculate the lowest common multiple of 14 and 28. 28 What is the least common multiple of 1239 and 1357? 28497 Calculate the least common multiple of 14 and 82. 574 Calculate the lowest common multiple of 7 and 6. 42 What is the lowest common multiple of 55 and 5? 55 Calculate the smallest common multiple of 705 and 35. 4935 What is the smallest common multiple of 272 and 126? 17136 What is the least common multiple of 485 and 50? 4850 What is the common denominator of -151/102 and 163/90? 1530 Calculate the common denominator of 19/335 and -43/3. 1005 Find the common denominator of 23/1249 and -16/5. 6245 What is the common denominator of -47/91 and 85/806? 5642 What is the common denominator of 13/517 and 54/611? 6721 Find the common denominator of -71/72 and -97/102. 1224 What is the common denominator of -19/16 and 53/148? 592 Find the common denominator of 27/68 and -101/282. 9588 Calculate the least common multiple of 15 and 231. 1155 What is the least common multiple of 75 and 45? 225 What is the smallest common multiple of 4 and 10? 20 What is the common denominator of -107/90 and 67/72? 360 Calculate the common denominator of -83/26 and -37/132. 1716 What is the smallest common multiple of 448 and 560? 2240 Find the common denominator of -31/990 and -161/264. 3960 What is the smallest common multiple of 3 and 416? 1248 What is the common denominator of -31/30 and 109/2094? 10470 What is the smallest common multiple of 27 and 1749? 15741 Calculate the common denominator of 47/108 and 23/24. 216 What is the smallest common multiple of 18 and 2? 18 Calculate the common denominator of -41/1064 and -29/252. 9576 What is the common denominator of -29/45 and -43/60? 180 What is the least common multiple of 9 and 125? 1125 Find the common denominator of 63/52 and 4/65. 260 Find the common denominator of -50/429 and 61/15. 2145 Find the common denominator of 119/18 and 149/228. 684 Calculate the smallest common multiple of 190 and 209. 2090 What is the common denominator of 105/52 and 161/156? 156 Calculate the common denominator of -91/88 and -85/176. 176 Calculate the common denominator of -143/6 and 37/1914. 1914 Calculate the least common multiple of 1170 and 360. 4680 Calculate the common denominator of 131/12 and 95/118. 708 Calculate the common denominator of 31/330 and -11/40. 1320 What is the smallest common multiple of 156 and 12? 156 Calculate the common denominator of -31/40 and -11/768. 3840 What is the smallest common multiple of 704 and 20? 3520 Calculate the common denominator of -49/8 and -27/12238. 48952 Calculate the least common multiple of 1377 and 54. 2754 Calculate the common denominator of 145/498 and 17/913. 5478 Find the common denominator of 105/1156 and -91/340. 5780 What is the common denominator of 55/84 and 83/42? 84 Calculate the common denominator of -103/72 and -31/177. 4248 Calculate the smallest common multiple of 2401 and 35. 12005 What is the smallest common multiple of 233 and 10? 2330 Calculate the smallest common multiple of 4 and 204. 204 Calculate the least common multiple of 865 and 4. 3460 Calculate the least common multiple of 120 and 16. 240 What is the smallest common multiple of 9 and 9237? 27711 Calculate the least common multiple of 7857 and 8730. 78570 Calculate the common denominator of 39/71 and -11. 71 Calculate the lowest common multiple of 4953 and 27. 44577 What is the least common multiple of 28 and 2058? 4116 What is the common denominator of -7/9 and 23/18? 18 Find the common denominator of 67/63 and 43/3. 63 What is the least common multiple of 441 and 735? 2205 What is the common denominator of 115/2548 and 113/1092? 7644 Find the common denominator of -43/88 and 75/26. 1144 Calculate the common denominator of -55/3 and -39/5. 15 What is the lowest common multiple of 135 and 21? 945 What is the smallest common multiple of 30 and 66? 330 Find the common denominator of 69/124 and 87/496. 496 Calculate the common denominator of -12/5773 and -94/3765. 86595 What is the smallest common multiple of 320 and 400? 1600 Find the common denominator of -1/304 and 13/1026. 8208 What is the least common multiple of 11954 and 7? 83678 Find the common denominator of 53/5 and -41/452. 2260 What is the lowest common multiple of 80 and 100? 400 Calculate the smallest common multiple of 2 and 115. 230 What is the lowest common multiple of 1390 and 16? 11120 Calculate the lowest common multiple of 84 and 588. 588 Calculate the lowest common multiple of 476 and 7. 476 Calculate the lowest common multiple of 1768 and 1976. 33592 What is the common denominator of 149/834 and 179/60? 8340 Find the common denominator of -89/4 and 52/81. 324 What is the least common multiple of 258 and 215? 1290 Calculate the common denominator of -55/21 and -25/768. 5376 What is the common denominator of 35/306 and 31/51? 306 Calculate the common denominator of -47/10 and -51/1004. 5020 Calculate the common denominator of 65/183 and 41/1647. 1647 Calculate the common denominator of -19/10738 and 95/3068. 21476 What is the smallest common multiple of 1243 and 1017? 11187 Calculate the common denominator of -24 and 59/10. 10 Calculate the common denominator of 29/114 and -41/111. 4218 What is the least common multiple of 1265 and 920? 10120 Find the common denominator of 36/217 and -61/9. 1953 Find the common denominator of -103/54 and 47/90. 270 Find the common denominator of -69/914 and 41/26. 11882 Find the common denominator of -117/20 and 45/896. 4480 What is the lowest common multiple of 5 and 50? 50 Calculate the smallest common multiple of 148 and 814. 1628 What is the smallest common multiple of 928 and 16? 928 What is the least common multiple of 136 and 72? 1224 What is the common denominator of 83/120 and -149/390? 1560 What is the lowest common multiple of 1254 and 1140? 12540 Calculate the common denominator of -13/258 and 127/90. 3870 Calculate the smallest common multiple of 17432 and 16. 34864 What is the common denominator of 7/366 and -20/671? 4026 What is the common denominator of -65/794 and -55/14? 5558 Calculate the lowest common multiple of 1224 and 3060. 6120 Calculate the common denominator of -31/3036 and -3/2. 3036 Find the common denominator of 47/518 and 53/686. 25382 Find the common denominator of 7/6 and -52/4601. 27606 Calculate the common denominator of -4/7 and -44. 7 What is the common denominator of 73/312 and -71/768? 9984 What is the common denominator of -5/16 and -33/16? 16 What is the smallest common multiple of 150 and 240? 1200 Calculate the common denominator of 107/10 and 23/84. 420 What is the smallest common multiple of 52 and 10? 260 What is the common denominator of 155/348 and -17/6? 348 Calculate the common denominator of 107/72 and -43/112. 1008 What is the smallest common multiple of 46 and 920? 920 Calculate the smallest common multiple of 54 and 51. 918 Calculate the common denominator of 1/2 and -149/108. 108 Calculate the smallest common multiple of 2 and 68. 68 Find the common denominator of 3/14 and -27/352. 2464 What is the smallest common multiple of 216 and 8? 216 What is the least common multiple of 309 and 732? 75396 Calculate the lowest common multiple of 147 and 483. 3381 Calculate the common denominator of 29/707 and -1/92. 65044 What is the lowest common multiple of 5 and 174? 870 Calculate the smallest common multiple of 363 and 165. 1815 Calculate the common denominator of -81/140 and -91/15. 420 What is the lowest common multiple of 24 and 17523? 140184 Calculate the common denominator of 37/14 and 103/870. 6090 What is the lowest common multiple of 3 and 171? 171 Calculate the least common multiple of 727 and 6. 4362 What is the smallest comm	{ "pile_set_name": "DM Mathematics" }
+ -3 prime? False Let b(m) = 585m + 11. Let q(s) = -s3 + 13s*2 - s + 15. Let l be q(13). Is b(l) composite? False Let l = 302 - 298. Suppose 2o + 3w - 17810 = 0, 0 = 5o - lw - 29151 - 15328. Is o prime? False Let q(j) = -3j - 53. Let a be q(-20). Suppose -4o = -ao + 11127. Is o prime? True Suppose -979f + 993f - 49667 - 158219 = 0. Is f a prime number? False Suppose -2v + 29668 = 4b - 46638, -4b = 4v - 152604. Is v composite? False Let s(b) = 70b2 - 10b + 3. Suppose -2z = 2l - 14, 2l + 0l = 2z - 10. Suppose zh - 16h = -20. Is s(h) a composite number? False Suppose -3d - 3 = 0, 3d - 2633 = 2c + 1458. Let o = c - -7986. Is o a composite number? False Let v(i) = -2435i + 59. Suppose 72 = -12w - 0w. Is v(w) composite? False Suppose -10 = 2s, -a - 12 = a + 4s. Suppose 20n + 4o - 1023 = 19n, 2058 = 2n - ao. Is n prime? False Is (-15)/(-90)45768259/14 prime? True Suppose 0 = 2a - 4x - 139506, -5a - 5x + 139542 = -3a. Is a a composite number? False Suppose -5i + 18412 = 10127. Let s = -15 + 23. Suppose sg - 9705 = -i. Is g composite? True Suppose 23904 = 4r - 10r. Let i = r - -8375. Is i composite? False Let u(h) = -h2. Let w(c) = -c3 + 2c*2 - 4c + 989. Let v(b) = u(b) + w(b). Is v(0) composite? True Let s = 2617592 + -1119625. Is s composite? True Let t = 4412 + -2444. Suppose -t = 26m - 7454. Is m a composite number? False Suppose 417g - 415g - 227686 = 0. Is g prime? True Let n(d) = -391848d - 193. Is n(-3) composite? False Suppose 2z - 1435510 = -2q, -4q = -3z + 842889 + 1310376. Is z a composite number? True Is (517/3 - 1)/(560/126840) a composite number? True Suppose 192r - 2749022 - 13174306 = 0. Is r composite? True Let y(n) = -n - 2. Let k be y(0). Let u(l) = 725l*2 + 6l + 9. Is u(k) prime? True Suppose 867 + 38 = -5k + 3z, k + 3z + 163 = 0. Let w = k + 759. Is w a composite number? True Suppose -k + 2723 = -6344 - 1716. Is k a prime number? False Let i = 5921 + 13740. Is i a prime number? True Suppose 0 = -4o + 3g - 12, o - 2g = -g - 4. Suppose -4n + 11835 = 3p, on + 3 = n. Is p a prime number? False Let q = 3 + 0. Suppose -h + 3h = 2g + 510, qg = 6. Suppose -5z + h + 378 = 0. Is z prime? True Let s(d) = 2092d*2 - 4d + 499. Is s(10) prime? True Suppose 5d = 151 - 211. Is 1404 + (-3)/(d/(-20)) a composite number? False Let n = 125588 - 83109. Let p = n + -11118. Is p a composite number? True Let d = -52 - -54. Suppose -4b = -dz - 16, 2z = -4b - z + 36. Suppose 0 = -2g - 2a + 1788, a - 3531 = -4g + ba. Is g a composite number? True Is -172(6957/(-4) + (-500)/(-200)) composite? True Let n be 11/22 + 21/6. Suppose -g + 14973 = -nq + 2q, -59907 = -4g + 5q. Is g a composite number? False Let c = 134606 - -126615. Is c prime? False Let g be -1517/(170/12). Let v(p) = -2p*3 + 24p*2 + 40p + 23. Is v(g) composite? False Let q(l) = l*2 + 16l + 50. Let n be q(-12). Suppose -23 = -4i - w, -5 = -3i - i + 5w. Suppose 0g + nh + 5604 = 4g, 0 = -ih - 20. Is g prime? True Let b = 660566 + 341439. Is b a composite number? True Suppose -7v = -3v + 296. Is ((-1)/((-1)/v))/((-32)/176) a prime number? False Is ((-48)/128 - (-11)/40)-1518410 a composite number? False Let j(c) = 15c2 - 4c - 2. Let q = -42 + 39. Is j(q) a prime number? False Let l be 8 + -1 + -2(-6)/(-4). Let n be -1 + 1 - l - (-60172)/49. Let b = 2059 - n. Is b composite? True Suppose -4o - 2j = -2093196, -o - 41149 + 564442 = -j. Is o a composite number? False Let k(y) be the second derivative of -y3/2 + 7y*2 - 8y. Let h be k(4). Suppose 0c - hc = -322. Is c prime? False Let t = -671 - -10082. Is t a prime number? False Let f = -1130 - -1689. Suppose f = -4l + 3843. Is l composite? False Let p(q) = -9659q + 285. Is p(-8) composite? False Let k be (-3)/(-15)145 - -3. Suppose -3f = -kf + 735469. Is f a composite number? True Suppose r - 5801 + 2222 = 0. Suppose 5129 = 4z - r. Is z composite? True Let q be ((-242)/6 + 1)/((-12)/4194). Suppose 2g = x - q, -4g = 5x - x - 54976. Suppose 0 = -16p + 8607 + x. Is p a prime number? False Suppose -15 = -5a, -8a - 3690 = 4y - 6a. Suppose 2790 = 2s - 0h - 4h, 3s + 3h = 4176. Let t = s + y. Is t a prime number? False Suppose 10o - 24 = 6o. Let f(l) = 3 - 27l + o - 8 - 9. Is f(-10) prime? False Let b be (-2)/3 + (-52791)/(-9). Suppose 0 = -4d - 5p + 3923, 2p - 986 = 5d - b. Is d composite? False Let b = 497 - 237. Suppose -1319 = -5h + 4k, h = 6k - 9k + b. Is h a prime number? True Is ((-505244)/14)/((-470)/1645) composite? False Suppose 2u + 10 = 0, 3i + 3u = 8i. Let z(b) = 38b2 + 5b + 2. Let l(f) = 113f2 + 14f + 5. Let a(v) = 6l(v) - 17z(v). Is a(i) prime? False Let m(g) be the second derivative of 14g3 - 11g*2/2 - 36g. Let f(a) = -a*3 - 6a*2 + 6a + 2. Let r be f(-7). Is m(r) prime? False Let p(z) be the first derivative of 479z2 - 33z - 68. Is p(4) a composite number? True Suppose n - 3v + v + 11 = 0, 4n + 38 = 2v. Is 4/14 - ((-606792)/84 + n) a prime number? False Let o = 592 + -587. Is -31(13188/(-18) + o) composite? True Suppose -18 = -3y + 9. Suppose z = -0f + 3f + 37868, -3z + 50484 = -4f. Is 1 + f/(-9) - 6/y prime? False Let k = 22898 - 6299. Suppose -394d = -397d + k. Is d prime? False Let s(a) = 50a + 172. Let m be s(-8). Is 4/(-38) + 1116/m + 3240 prime? False Let q(w) = 64w*2 - 295w - 120. Is q(-43) a prime number? False Is ((-2)/(-6 - -4))/(5/5710353) a prime number? True Let x = -17588 - -61101. Is x a composite number? True Let g be (41 + -1)84/(-112). Is 12/10g/(-9) - -2211 a prime number? False Suppose 0 = -2a - 4v + 257106, a + 29v - 28v - 128551 = 0. Is a a composite number? False Suppose 3z - 6z + g = 85, -g - 5 = 0. Let r be 5/(z/4) + (-69)/(-9). Suppose 6v = rv - 19. Is v a composite number? False Suppose -l + 196314 = -2t + 6t, 5t - 245399 = 2l. Suppose -6a + 11a + 16351 = j, 2a = 3j - t. Is j prime? True Is 4/(6 + (-2764432)/460744) composite? False Suppose 330 = -21k + 330. Suppose k = 14o - 23o + 5229. Is o composite? True Suppose 3u = -9g + 307947, -20g + 22g - 102655 = -u. Is u composite? False Let b(g) = 77g - 47. Suppose 2t + 5r = 23, -4t + 6t + 2r - 26 = 0. Is b(t) prime? True Let k be (-166605)/(-58) - (-1)/21. Let o = k - 540. Is o prime? True Let a = 2469780 + -1071187. Is a prime? False Let g be ((-9)/(-6))/((-6)/(-40)) - 5. Suppose 0 = gt + 5x - 29870, 8t + 11943 = 10t + x. Is t a composite number? True Let f(o) = -4o*3 - 6o*2 + 11o - 9. Let c be f(-9). Let x = -751 + c. Is x prime? True Let q = 577 + -6209. Let i = q + 11103. Is i a prime number? True Suppose -3y = -p - 394975, 3y - 394955 = 4p - 8p. Is (-3)/((-33)/y) - (-198)/1089 a composite number? False Is 3049914/(-15)55/(-22) a composite number? True Let l(m) = 28846m + 4559. Is l(2) a composite number? True Suppose 87r - 167r = -24720587 + 2292667. Is r prime? False Let p(m) = -6m3 + 49m*2 - 38m + 17. Is p(-26) composite? True Is ((25361 - 5)/12)/(2/142 - 0) prime? False Let d(x) = -2699x - 1911. Is d(-22) a prime number? True Suppose f = -14p + 4p + 780351, -2p + 156075 = 5f. Is p composite? True Let b = -497 + 3077. Let g = b - 421. Is g composite? True Let x(j) = -3 + 18j + 3j + 2. Let g be -1 - (0 - 6)/(6/8). Is x(g) composite? True Suppose 2v = 6, 5n - n - v - 37 = 0. Suppose -278 - 18512 = -nx. Is x a prime number? True Let i = 133568 + -27461. Suppose -28b + i = 11719. Is b a prime number? True Let l(y) = -y3 - 26y*2 + 56. Suppose -4t + 3k - 130 = 0, -t - 21 = -2k + 7k. Is l(t) a prime number? True Suppose -188390 = -3b - 4o + 428743, -3b + 617103 = -o. Is b prime? True Let b be (-12)/(15/20-2). Let y = 2 - b. Let i = y - -163. Is i a composite number? False Let u(f) = -155f*3 - 6f*2 - 71f - 467. Is u(-7) a composite number? False Suppose 0 = k - 2k + 5j - 4, -2k - 8 = 4j. Is 50642(6 + k)/4 composite? False Let g(b) = b2 + 5b - 3. Let n be g(-6). Suppose -2h = -5s, 2h - 31 + 13 = -4s. Suppose y - 523 = -5r, -sr - 1076 = -2y + nr. Is y prime? False Is 1 + 12 - -36028 - 4 prime? True Let l be (4 - 2)/(3/12). Let n be l/14 + (-1)/((-28)/100252). Suppose 4*r =	{ "pile_set_name": "DM Mathematics" }
n + 30. Suppose -b = -3v + 59. What are the prime factors of v? 23 Let c = 224 + -81. List the prime factors of c. 11, 13 Let d = 90 + -57. Suppose -3b + d = 3. List the prime factors of b. 2, 5 Let w = 20 + 10. Let k be 4/(-12) - (-32)/6. Suppose 5r - w = k. List the prime factors of r. 7 Let v(t) = t3 - 6t*2 + 2t - 8. Let p be v(6). Suppose pl + 2c - 14 = 4c, -4c = -4l + 8. What are the prime factors of l? 5 Let a be 3/(-6)1-4. Let y(o) = -o + 8. Let u be y(8). Suppose u = j + aj - 33. What are the prime factors of j? 11 Let s = -8 + 13. Suppose sp = -10, d + 53 = 6d + p. List the prime factors of d. 11 Suppose -2l + 5b = 2b - 207, -3l + 283 = b. List the prime factors of l. 2, 3 Let g(m) be the first derivative of m*2/2 + 6m + 12. Suppose 19 = -x + 3x - 3j, -4j = 5x - 13. List the prime factors of g(x). 11 List the prime factors of 228/4 + 2 - -1. 2, 3, 5 Suppose 3n + 13 - 40 = 0. What are the prime factors of n? 3 Suppose -5c - 77 = 2m, 2m + c = -2m - 181. Let b = -32 - m. What are the prime factors of b? 2, 7 Suppose -6 = -2a - 2. Let j(y) = y*3 - y - 2. Let b be j(2). Suppose -ao + 10 = c - 0c, -c - bo + 12 = 0. List the prime factors of c. 2 Let z(g) = -33g - 15. What are the prime factors of z(-2)? 3, 17 Suppose -15x = -37x + 7986. List the prime factors of x. 3, 11 Let y = 2 + 4. Let o = y + 0. What are the prime factors of o? 2, 3 Let g(c) = 4c - 6. Let w be g(4). Let x = -6 + w. Let k = x - 1. What are the prime factors of k? 3 Let i = 4 + -2. Suppose 0 = -0m - im + 24. List the prime factors of m. 2, 3 Suppose z = -4z + 20. Suppose zn - 12 = -4. What are the prime factors of n? 2 Let u = 68 + -45. List the prime factors of u. 23 Suppose -17s + 5314 = 2203. List the prime factors of s. 3, 61 Suppose 0 = -o - 6x + 2x + 106, -2o + x + 185 = 0. Let y = o - 51. List the prime factors of y. 43 Suppose 0 + 2 = -2j. Let s be -1 + j + (-23)/1. Let q = -15 - s. List the prime factors of q. 2, 5 Let w = 23 - 38. Let t = 38 + w. List the prime factors of t. 23 Let o(d) = -d2 - 6d. Let l(y) = y*3 + 3y*2 - 2. Let f be l(-2). Suppose fn - 6n = 20. List the prime factors of o(n). 5 Let z(q) = -q. Let t be z(-2). Let g be (2 + t)/(-2) + 5. Suppose -3c - 2l = -22, 0 = gc + l + 1 - 18. List the prime factors of c. 2 Let w be ((-3)/(-6))/((-2)/(-20)). Suppose -wc + 55 = -0c. What are the prime factors of c? 11 Let d be ((-12)/3 - -2) + 2. Suppose -5s = 2i + 15, -3i - 2s - 6 = -di. Suppose q - 5j + 11 = i, 3q + j = -q + 19. List the prime factors of q. 2 Let n(j) = j3 + j2 - 1. Let i be n(0). Let k be i/(-2 + 9/5). Suppose -kt - 2z = -41, -3t + 2z + 3z = -37. List the prime factors of t. 3 Let d be -1 + 2 - -41. Suppose 0 = dn + 24 - 94. List the prime factors of n. 2, 7 Suppose -b = -0b. Suppose -36 = 5o + 2z + 10, -5o - 5z - 55 = b. What are the prime factors of (-2)/(26/o - -3)? 2 Let n(o) = 6o*2 - o + 2o3 - o3 + 0 - 3. What are the prime factors of n(-6)? 3 Let b(r) = 2r2 - r. List the prime factors of b(-2). 2, 5 Suppose -13v + 252 = -9v. What are the prime factors of v? 3, 7 Let p be ((-4)/2 - 1)/1. List the prime factors of p((-21)/9 - 1). 2, 5 Suppose 0 = 5j - 6 - 4. Suppose o = -jo + 78. List the prime factors of o. 2, 13 Let f(w) = w*2 + 3w. Let k be f(-3). Suppose -4u + 18 = -kd - d, 5u - 17 = 4d. List the prime factors of d. 2 Let w(s) = s*2 + 7s. Let r be w(-7). Suppose r = 2n - 0n - 4. List the prime factors of n. 2 Let k(q) = q - 8. Let y be k(5). Let d be -1y1 + -1. Suppose 5p = 2c - 0p - 14, -6 = -dc + p. List the prime factors of c. 2 Suppose 6 = -2l + l. Let k = l - -2. What are the prime factors of k/(-6) + (-64)/(-12)? 2, 3 Let q(y) be the second derivative of y5/20 + 5y*4/12 - 5y*3/6 - 3y2 - y. Let n be q(-5). List the prime factors of n - (-4 - -2) - 1. 2, 5 Let g = -13 + 13. Let w(y) = -y2 + 28. What are the prime factors of w(g)? 2, 7 Let j = 124 + -73. What are the prime factors of j? 3, 17 Let w = 2 - 3. Let z be (w/(-1) - -1) + -1. List the prime factors of 5 + -3 + 2 + z. 5 Let v = -128 - -296. List the prime factors of v. 2, 3, 7 Let t(c) = c*3 + 3c*2 - 5c + 3. List the prime factors of t(-4). 7 Suppose 5j = 4b + 270, 0 = -0j - j - 3b + 73. List the prime factors of j. 2, 29 Suppose j + 12 = -3j - m, 0 = 4m. List the prime factors of j(-2)/3 - -11. 13 Let q(c) = -c3 + c2 + 8. Let b(m) = m. Let x be b(-3). Let i be 0(4 + x + 0). What are the prime factors of q(i)? 2 Let v(u) = 20u + 7. Let p be v(-5). Let i = 132 + p. List the prime factors of i. 3, 13 Let v be 8/(2(-3)/(-6)). Suppose -3x = 4w + v - 59, 5w + 5x - 60 = 0. Suppose -5r + 0 = -w. List the prime factors of r. 3 Suppose 31 = i - 132. What are the prime factors of i? 163 Let j(m) = -8m - 2. Let v be j(-2). Suppose -3z + 27 = -3n, -4n - 2 + v = 2z. List the prime factors of z. 2 Let m = -226 + 327. List the prime factors of m. 101 Suppose 5q = q + 16. What are the prime factors of q? 2 Let x be (-5)/((-15)/6) - -1. Suppose 5v + xd = 3v + 55, -5v + 5d = -100. What are the prime factors of v? 23 Suppose -3g + 340 = 5m, -5m = 4g - 273 - 72. List the prime factors of m. 5, 13 Let w = -44 + 17. What are the prime factors of (32/12)/((-6)/w)? 2, 3 List the prime factors of (-142)/(-5) - (-12)/20. 29 Let d = 25 - 20. List the prime factors of 4/20 - (-219)/d. 2, 11 Let u = -99 - -179. What are the prime factors of u? 2, 5 Let v = 132 - 86. What are the prime factors of v? 2, 23 Suppose x - 2d = 4x - 6, 3x + d = 3. List the prime factors of (x - 0 - 1) + 15. 2, 7 Suppose -2q - q + 3p = -312, 3p - 228 = -2q. List the prime factors of q. 2, 3 Suppose 4n - k - 19 = 0, -5k = n - 3k - 16. Let l = -17 + n. Let j(p) = p*3 + 12p*2 + 12p + 13. What are the prime factors of j(l)? 2 Suppose 2r = 38 + 12. Suppose 0 = -4n + 78 + 26. Suppose 0 = -3g + n + r. List the prime factors of g. 17 Let t = 22 + -13. Let j = -5 + t. Suppose -g - 2 = ju + 11, -2g + 2u + 14 = 0. What are the prime factors of g? 3 Let o(b) = b*3 + 27. What are the prime factors of o(0)? 3 Suppose 0 = -2u - 5 + 23. What are the prime factors of u? 3 Let y = 26 + -16. List the prime factors of y. 2, 5 Let h = 3 + -5. Suppose x - 3 = -3t, 4x = -x - 2t + 41. Let p = x - h. List the prime factors of p. 11 Let l be -3 + -1 + 2 + 2. Suppose a = 4v - lv, 4v = -5a + 24. Suppose -2c = 3 + 5, -5o + ac = -51. What are the prime factors of o? 7 Suppose 0 = 6a - a - 20. Suppose 3t = -3o + 21, -ao + o = -2t - 6. Suppose or + 18 - 47 = -3j, -5j + 2r + 83 = 0. What are the prime factors of j? 3, 5 Suppose -96 = -3v - 0v. Let u be (5/(-10))/((-2)/v). List the prime factors of (u/(-10))/(1/(-5)). 2 Suppose 5j - 50 = 215. List the prime factors of j. 53 Suppose 3v = -g + 14, v = -g - 2g + 2. Suppose -44 - 21 = -vd. What are the prime factors of d? 13 Suppose 0 = 4w + 45 - 189. Let a = 52 - w. What are the prime factors of a? 2 Let p(m) = -m - 7. Let o be p(6). Let q = o + 27. What are the prime factors of q? 2, 7 What are the prime factors of (-12)/33/(-6)? 2 Let b(p) = 2p*2 - 4p + 2. Let s be b(3). Let m = s - 5. List the prime factors of m. 3 List the prime factors of -3(2 + (-280)/12)1. 2 Let k = 2 - 0. Let x = -56 + 82. Suppose -x = -kq - 2. List the prime factors of q. 2, 3 Suppose 2h + 4 = 2. What are the prime factors of h + -2 + (2 - -13)? 2, 3 Suppose 24m - 20m = 8. What are the prime factors of m? 2 Suppose 5c = 92 + 53. What are the prime factors of c? 29 Let c(m) = -m3 - 3m*2 - 10m + 4. What are the prime factors of c(-6)? 2, 43 Suppose i - 127 = 111. List the prime factors of i. 2, 7, 17 Suppose 0 = -2x - 3u + 27 - 7, 3u - 32 = -5x. Let t be 21/x + 1/(-4). Suppose tj = -2v + 33, 2v + v - 2j - 2 = 0. List the prime factors of v. 2 Suppose 2g - 2q = -5q + 52, 4g - 4q = 124. Suppose -2n + 15 = 5z - 18, n + 5z = g. List the prime factors of n. 2 Suppose -186 = -4n + 5k - 3k, 3k = 5n - 235. What are the prime factors of n? 2, 11 Suppose 0d - 5d + z + 7 = 0, -4d + z + 6 = 0. What are the prime factors of (1 - d - -3) + 6? 3 Suppose -w + 7 = -18. Suppose -8 - w = -3*a. List	{ "pile_set_name": "DM Mathematics" }
. Let f(t) = -8t - 26. Give 3f(o) - 7h(o). -3o + 13 Suppose 3c - 12 = 0, 1 = -15j + 10j - c. Let r(o) = 2o + 5. Let u(t) = 0 + 4 - 3. Determine jr(g) + 4u(g). -2g - 1 Let t = -33 + 35. Let y(b) = 5 - t + 0 - 1. Let x(r) = -r + 3. Give -2x(d) + 3y(d). 2d Let h(g) = -g*3 - 33g + 419. Let d(t) = 6t - 84. What is -11d(k) - 2h(k)? 2k*3 + 86 Let z(a) = 33a*3 - 70a*2 + a + 1. Let w(f) = 11f*3 - 23f*2. Give -7w(y) + 2z(y). -11y*3 + 21y*2 + 2y + 2 Let v(n) = n*2 + n + 1. Let h(s) = 6s*2 + 6s + 9. Let b = -337 - -332. Determine bv(d) + h(d). d2 + d + 4 Let c(l) = -l + 1. Let z = -16 - -18. Suppose zd = 11 - 13. Let p(k) = -14k + 12. Determine dp(x) + 12c(x). 2x Let k(l) = 11l3 - 7l - 9. Let v(i) be the third derivative of -i6/20 + i4/6 + 5i3/6 - 39i*2 + i. What is -3k(w) - 5v(w)? -3w*3 + w + 2 Let t(y) = -7y*3 + 6y*2 + 3y + 4. Let o(w) = -47w + 230. Let k be o(5). Let d(f) = 8f*3 - 7f*2 - 4f - 5. Determine kt(p) - 4d(p). 3p3 - 2p*2 + p Let q(z) = 1645z*3 - 25z*2 + 25z - 25. Let i(v) = 137v3 - 2v*2 + 2v - 2. Give 50i(o) - 4q(o). 270o3 Let g(s) be the first derivative of 17s*2/2 - 8s - 166. Suppose -6r = -r - 5. Suppose 4b = r + 35. Let h(y) = -4y + 2. Calculate bh(k) + 2g(k). -2k + 2 Let p(d) = 11d - 38. Let y(l) = 5l - 18. Determine 4p(k) - 9y(k). -k + 10 Let j(a) = a*3 + a + 1. Let g(x) = 34x*3 + 153x + 153. Give 2g(u) - 306j(u). -238u3 Let f(b) = -b. Let l(u) = -2u - 1 + 1. Suppose 77 = -5r + 102. What is rf(c) - l(c)? -3c Let r(j) = -6j*2 - 5j - 9. Let l(w) = -3w2 - 3w - 5. Suppose 0 = -14c + 20c - 30. Give cl(n) - 3r(n). 3n2 + 2 Suppose 7h - 15h + 88 = 0. Let r = -35 - -37. Let t(k) = -8k - 2. Let l(j) = 41j + 11. Determine ht(u) + rl(u). -6u Let b(m) = 2m3 + 9m*2 + 3m. Let s(t) be the first derivative of -3t4/4 - 17t*3/3 - 5t*2/2 + 172. Let z = -51 + 48. What is zs(l) - 5b(l)? -l3 + 6l*2 Let l(t) = -16t + 5. Let r(d) = 16d - 4. Let v(p) = 11p - 103. Let w be v(9). Calculate wl(u) - 5r(u). -16u Let k(w) = -4w*3 - 13w*2 - 15w + 17. Let m(r) = 2r3 + 6r*2 + 7r - 8. Suppose -v + 7 = -d, v + 0v = -4d - 23. Give dk(a) - 13m(a). -2a3 - a + 2 Suppose 5i + 13 = -52. Let k = i - 4. Let a(p) = -14p - 3. Let f = -20 + 14. Let u(r) = 5r + 1. Determine fa(o) + ku(o). -o + 1 Let b(o) = -606 + 602 + 5o - 3o. Let f be 0 + 6 + 2 + -2. Let c be (8/f - 1)3. Let y(v) = 1. What is cb(n) + 6y(n)? 2n + 2 Let x(h) = 83h3 - 27h*2 + 16h. Let b(s) = -55s3 + 17s*2 - 11s. What is 8b(f) + 5x(f)? -25f3 + f2 - 8f Let z(y) = -80y2 + 4y - 4. Let n(s) = -81s2 + 5s - 5. Calculate 4n(g) - 5z(g). 76g2 Let c = 241 + -235. Let s(i) = 5i. Let a(o) = 6o - 1. Determine ca(x) - 7s(x). x - 6 Let z(l) = -l + 0l2 - 177381 + 177382 - l2. Let j(o) = -7o2 - 7o + 8. Determine j(v) - 6z(v). -v2 - v + 2 Let g(v) = -135v*2 - 1. Let p(b) = -404b*2 - 3. What is 11g(h) - 4p(h)? 131h*2 + 1 Suppose i = 5i - h - 13, 0 = 2i + 3h - 17. Let x(r) = r. Let a(m) = -4m + 5. Let p(o) = a(o) + 3x(o). Let d(v) = -2v + 6. Give id(t) - 5p(t). -3t - 1 Let p(d) = 5d2 - 2d + 1. Let r(g) = -g*2 + 7g - 9. Let f be r(5). Let h be p(f). Let q(a) = a*2 - 1. Let i(j) = -5j*2 - 2j + 4. Give hq(o) + i(o). -o2 - 2o Let u(s) = -12s2 - 8s + 1. Let l(a) = 25a2 + 18a - 3. Give -4l(f) - 9u(f). 8f2 + 3 Let o(i) = 46i*2 - 5i - 5. Let r(j) = 44j2 - 6j - 6. Calculate -6o(b) + 5r(b). -56b2 Let f(y) = -22y + 5. Let z(l) = l + 1. What is f(v) - 6z(v)? -28v - 1 Let d(g) = 2g2 + g + 1. Let t(j) = -j3 - 2j*2 - j - 15. Determine 4d(y) + 4t(y). -4y*3 - 56 Let t(d) = 9d - 5. Suppose 5r = 0, f = r + 33 - 40. Let j(g) = 14g - 7. What is ft(m) + 5j(m)? 7m Let n(r) = -47r - 9. Suppose 0 = -10l + 2039 - 2059. Let o(d) = 12d + 2. Calculate ln(u) - 9o(u). -14u Let s(k) = -14664k*3 - 282. Let g(a) = 473a*3 + 9. Determine 94g(f) + 3s(f). 470f3 Let i(y) = y2 + y. Let f be (1 + 1)(-3)/(-6). Let g(b) = -b2 - 2b. Let l(q) = q*2 - q - 10. Let o be l(-3). Determine fg(j) + oi(j). j2 Let k(i) = -45i - 6. Let n(d) = 45d + 10. Calculate -3k(j) - 2n(j). 45j - 2 Let d(i) = -i*2 + 97i + 6. Let b(r) = 4r2 - 387r - 26. Give 2b(y) + 9d(y). -y*2 + 99y + 2 Let p(v) = -7v2 - 7v + 7. Let w(t) = -3t2 - 3t + 3. Let d(f) = -6p(f) + 15w(f). Let b(h) = -4h2 - 4h + 4. What is 4b(n) - 6d(n)? 2n2 + 2n - 2 Let y(u) = 2801u3 - 5u - 5. Let z(b) = -785680b3 + 1403b + 1403. Determine 1403y(d) + 5z(d). 1403d3 Let j(f) = -733f + 13. Let s(u) = 364u - 6. What is -4j(t) - 9s(t)? -344t + 2 Suppose -2313o + 10 = -2318o. Let n(x) = -5x3 - 2x*2 + x + 3. Suppose -2l = -3 - 3. Let d(u) = -4u3 - u2 + u + 2. Determine ld(h) + on(h). -2h3 + h2 + h Let j(c) = 34c - 26. Let m(u) = 28u - 25. Determine -2j(n) + 3m(n). 16n - 23 Let n(x) = -25x - 6. Let i(h) = h + 1. Determine 4i(k) + n(k). -21k - 2 Let a(d) = -2d - 1. Let x(w) = 9w - 11. Determine 2a(z) + x(z). 5z - 13 Let j(m) = -m*2 - 1. Let x(d) = -46d*2 - 2d - 56. Let i(h) = -2h2 - h. Let t(r) = -2i(r) + x(r). Determine -56j(z) + t(z). 14z2 Let z(k) = k3 + k*2 - k - 1. Let d be (9/(-6))/((-3)/18) + -2. Suppose dg - 3g = -4. Let y(f) = 2f + 2f - 3f2 + 4 - f - f3. Give gy(c) - 3z(c). -2c3 - 1 Let b(p) = -2p + 1. Let i be (-3)/(-1) - (-1)/(-1). Suppose -i + 10 = 4c. Let h(x) = -7 + 2 + 6. Determine ch(y) - b(y). 2y + 1 Let y(x) = -196x. Let c(m) = -396m - 1. What is -2c(g) + 5y(g)? -188g + 2 Suppose f - 8 = 5f - 4s, -5 = f - 2s. Let g(h) = -h. Let a(l) = -2l + 2. Let i be 26/8 + (-1)/4. Suppose 17y - 14y = -i. Calculate fa(m) + yg(m). -m + 2 Suppose -40r = -35r - 25. Let m(v) = v*2 - v + 2. Let u(h) = 1. Calculate ru(q) - m(q). -q*2 + q + 3 Let p(l) = 15l*2 + 2l + 2. Let y(c) = c*2 - 10. Let v(g) = 73g*2 + 10g + 41. Let r(j) = -v(j) - 3y(j). Calculate -11p(b) - 2r(b). -13b*2 - 2b Let t(c) = -9c3 - 19c + 6. Let x(k) = -8k3 - 19k + 4. Determine -2t(d) + 3x(d). -6d3 - 19d Let x(p) = 12p3 - 7p*2 - 7p. Let z be -14(0 - -1)-1. Let y be (z/(-3))/((-4)/(-6)). Let r(h) = 6h3 - 3h*2 - 3h. What is yr(s) + 3x(s)? -6s3 Let s(t) = 474t*2 + 10. Let m(n) = 45505n*2 + 958. Calculate -5m(l) + 479s(l). -479l2 Let a(m) = -m2 + m. Let v(d) = 2d3 + d2 + 2d + 2. Give -3a(r) + v(r). 2r*3 + 4r*2 - r + 2 Suppose 7u - 7 = y + 4u, -4u = 4y + 28. Let i = 8 + -14. Let l(t) = 11t*3 + 7t - 7. Let m(g) = -10g3 - 6g + 6. Calculate il(p) + ym(p). 4p3 Let t(n) = n - 5. Let f be ((-78)/30 + 2)/(18/60). Let o(k) = 2k - 11. Calculate fo(v) + 5t(v). v - 3 Let j(l) = -l + 4. Let q(p) = -21p + 19. What is -4j(f) + q(f)? -17f + 3 Let p(l) = -1. Let z(r) = -10r + 6. Suppose 0 = -106i + 114i + 48. Determine ip(x) - z(x). 10x Let m(x) be the first derivative of -7x2/2 + 4x + 138. Let v(z) = 29z - 17. What is -9m(b) - 2v(b)? 5b - 2 Let q(u) = u + 0u + 4u. Let g(k) = 38395 - 38395 + k. Calculate 6g(n) - 2q(n). -4n Suppose -36o - 30 = -30o. Let z(s) = -s - 1. Let v(b) be the third derivative of b5/60 + 7b*4/24 + 5b*3/6 + 14b*2. Give oz(g) - v(g). -g*2 - 2g Let y be 1/3(-5 + 17). Let b(g) = 2. Let o(z) be the second derivative of -z3/6 - 5z*2/2 - 5z. Give yb(x) + 2o(x). -2x - 2 Let g(u) = 5u*2. Let i(q) be the second derivative of 5q*4/4 + 278q. What is 10g(o) - 3i(o)? 5o2 Let w(f) = -4f. Let r(o) = 10o. Let h be (-15)/3 + (20 - 12). Suppose -3k + 21 = -b - 0k, -k + 4 = 0. Let x = h - b. Give xw(z) + 5r(z). 2z Let z(g) be the second derivative of 0 - 2g + 1/2g*2. Let p(n) = n - 7. Let u = -129 + 134. Calculate uz(v) + p(v). v - 2 Let d(t) = 5t3 - 9t*2 - 9t + 9. Let i(j) be the first derivative of j*4/4 - 2j3/3 - j2 + 2j + 41. What is 4d(x) - 18i(x)? 2x*3 Let j(z) = 4z*2 + 0 + 7 + 3z - z + z*2. Let i be ((-4)/(-6))/(4/6). Let a(h) = -17h - h*2 + 8h + 3h - 1 + 6h. Determine ij(c) + 6a(c). -c*2 + 2c + 1 Let f(j) = j2 - j - 1. Let n(c) = -c2 - 2*	{ "pile_set_name": "DM Mathematics" }
Let s = -54 + 249. Let y = s + -198. Is y less than -11/9? True Let h be (11 - (-50)/(-5)) + 5/(15/(-4)). Is h equal to -34? False Let d be (1/(-2))/(3 - 5332/1776). Suppose 4z + 183 = -12t + 17t, 5z - 4t = -d. Which is greater: -43 or z? z Let o = -7897 + 686999/87. Which is smaller: o or 1? o Suppose 2d = 2w - 34, -2d = -3w + 65 - 15. Suppose -2t = wt - 5472. Which is greater: t or 303? t Let o = 0.3 + -0.28. Let s be 573/(-5)((-100)/(-2))/(-10). Let q = 577 - s. Which is bigger: o or q? q Let l = -4567 + 4037. Which is greater: l or -528? -528 Let h(l) = 2l3 - 52l*2 - 54l. Let z be h(27). Let i = -51161/34 - -1505. Which is bigger: z or i? i Let v be (-294)/(-63) + 4/(-6). Suppose -181 + 173 = -vs. Suppose 4 = -2n - sp, 4n - 2p = -4p - 4. Which is greater: n or -4/15? n Suppose 327 = 4f + i, -5f + 0i + 390 = -5i. Let s be (-40)/(-165)f/(-6). Which is bigger: s or -3? -3 Let g be 2/5 + 20/(-50) + 2. Let x = 115 + -60. Let v = x + -44. Do v and g have different values? True Suppose 41949k = 41920k + 8758. Which is greater: k or 296? k Let k(a) = -2a*2 - 14a - 56. Let o be k(-5). Let z = -26 - o. Which is bigger: 62/7 or z? z Let j(x) = 24x + 26. Let c(h) = 5h + 5. Let b(a) = 14c(a) - 3j(a). Let s be b(-3). Let d be s/(-3) - 101/12 - 1. Which is greater: -10 or d? d Suppose 2w - r + 206 = 0, -3r - 141 - 363 = 5w. Is w bigger than -2? False Suppose 49p + 309878 = -17p + 25p. Is p less than -7557? True Let k be (-3)/28462/(-132). Which is smaller: k or -760? -760 Let r be 1062/(-4)256/(-288). Suppose 126 = -2q + 596. Which is smaller: q or r? q Suppose 2y = -3w + 704, -y + 350 = -0w + w. Let v = -398 + y. Is -53 > v? False Let s = -1894 + 3196. Are 1302 and s unequal? False Let u be 2/3 + (-244)/(-3). Let d = -288 + 534. Suppose 3v - y = 252, v = -2v - y + d. Is v < u? False Let m = 0.5 - -23.5. Let v(y) = y*3 - 5y*2 + 2y - 10. Let d be v(5). Suppose 0w = 5w - 10, d = 5t - w - 3. Which is greater: m or t? m Suppose 28355 + 65027 = 33o + 8407. Which is greater: 2580 or o? 2580 Suppose -571 = -5i + 3q + q, 5q = -2i + 202. Let z be 1/3i - 2. Let m = z - 30. Are m and -1 equal? False Let v be -13(0 - (-2)/(-6)). Let s(z) = 26z - 2. Let i be s(1). Suppose -27 + i = -u. Is v <= u? False Suppose 95q = -48q - 66 - 77. Is q equal to -2/365? False Let j = 53387/1204 - 1899/43. Let d = 1 + -1.2. Which is bigger: d or j? j Let l = 2.2 + -0.6. Let p = -8352 + 75044/9. Let k = p + 14. Which is smaller: l or k? k Let t be (-4811)/(-623) - 1(2 - -2). Let d = 4519 + -402179/89. Let q = t + d. Is 3 not equal to q? True Let k = 585/795434 - 108551105511/23465303. Let j = k + 4626. Is -1 > j? False Suppose -27o = -32o. Suppose om + 4m = 0. Let b be m/(1 + 0)3/(-9). Is b > 2/27? False Let q be 12/3 + (-214619383)/(-10549). Let u = 20349 - q. Which is greater: u or -1? u Suppose -5k - 424 = -9k. Suppose -5m = f - k, 2m + 3f - f = 36. Let c(v) = -7v - 12. Let j be c(-5). Is m equal to j? False Let w = -2656 - -2495.7. Let g = w + 175. Let b = g - 15. Is b smaller than 0.3? True Suppose 3c + 6 = -5j, -c + 24j = 21j - 12. Let y be c2/12112/(-8). Let v be -3 - 8/(2/2). Which is bigger: y or v? y Let j be (88/(-32) + 3)4. Which is smaller: 19/11 or j? j Let o(b) = -b*3 + 5b*2 - 12b - 39. Let i be o(-6). Let f = -386 + i. Suppose g = 5g + 3w - 168, -42 = -g + 4w. Is g > f? False Let d = -264292 - -264324. Let t = -17165/388 + -1/97. Let a = 44 + t. Which is bigger: a or d? d Let z = -16136.16 + 16571. Let j = -462 + z. Let m = j - -0.16. Is 2/9 < m? False Suppose 6l + 5g = 9l - 3, 0 = -4l - 2g + 30. Suppose -lp + p = -4i + 1781, p = 3. Is i greater than 450? False Suppose -1 - 22 = 17j - 6. Is 10 greater than or equal to j? True Let t be 59/((-944)/(-96))2/(-3069). Which is greater: -1 or t? t Let g = 0.035 + -1.255. Let v = g - -1.78. Let z = 0.66 - v. Which is greater: z or 13? 13 Suppose 2t - 6 = -0. Let m be (-124)/(-12) - (-5 - (-1 - t)). Which is greater: m or 11? m Let p = -1195/7 + 171. Suppose -3 + 7 = -621c + 4. Which is greater: c or p? p Let d = 5.8 - 11.8. Let n(r) = 68r2 - 3. Let w be n(-3). Let s = w + -6705/11. Is s equal to d? False Let i be (-868)/(-294)(-63)/45. Which is smaller: -4 or i? i Suppose -2x - 12 - 22 = 0. Let k be ((-21)/35 - 213/45)-3. Suppose -k - 14 = 2h. Which is greater: x or h? h Let v = -31 - 19. Let t be -31(v/15)/(-10). Let a be (-24)/10 + 1 + 1. Which is greater: t or a? a Let d(r) = -6r - 8. Let m be d(-7). Let f be 271795/209 + 18/33. Suppose 29o + 315 = f. Does o = m? True Suppose 3r - 5l = -94, -55r + 70 = -58r + 2l. Does r = -3/38? False Let v = -30/41 - -248/451. Let w(p) = 10p3 + p2 + 11p + 24. Let c be w(-3). Let n be 2760/c - (29/(-9) + 3). Which is smaller: v or n? n Let d be 2/(-3) - ((-444)/9)/(-4). Let u be ((-6)/(-4))/((-93)/48 + 2). Let t = 13 - u. Which is greater: t or d? t Let n(d) = -d + 77. Let o be n(76). Which is bigger: o or -22/1373? o Let f be 4/(-34) - 24/(-204). Suppose f = 4r + r - 30. Suppose g = -rg. Is g smaller than -1/14? False Suppose 2c - 538 = 2f, -2c - c = -2f - 808. Let j = 209 - c. Which is greater: -63 or j? j Suppose 192 = -6x - 6x. Let k = x - -351/22. Which is smaller: -0.4 or k? -0.4 Let g be -4 + 6 + 7 + -60. Let q be ((-8)/30)/((-17)/g). Suppose -5c - i = 0, 3c - 18 + 0 = 3i. Which is smaller: c or q? q Suppose -500 - 421 = -d. Is d >= 920? True Let o = -3027 - -15158/5. Is o != -0.014? True Let s = 1911 - 1116. Let b = -623 + s. Which is smaller: 171 or b? 171 Let l = -33098/177891 + 58/903. Which is bigger: 1 or l? 1 Let g = -283.497 - -285.5. Let x = g - 0.003. Let h be 2/(-9)(-9)/27. Are h and x non-equal? True Let i be 8/28 + 418/(-1512). Let m = -1.9147 - -0.9147. Is m greater than or equal to i? False Let j = -796885493/915 + 870913. Which is greater: 0 or j? 0 Let c = 7346.4 - 7327. Is c greater than or equal to 8? True Let i(w) = w*3 + 4w*2 - 68w - 69. Let d be i(-10). Is d less than or equal to 44? True Let i be (-2)/((-9)/(16374015/50360)). Let k = 4/1259 - i. Let c = 727/12 + k. Is c greater than -13? True Suppose 5587 = -5d - 4j, 2253 = -130d + 128d + j. Is d smaller than -2243/2? True Let i = 12/163 - -9696/1141. Is i greater than 9? False Let f = -9019 - -9018. Which is smaller: f or 1/9967? f Let u be 3/((-21)/28) - (-5 + (-4 - -4)). Is u smaller than -1081.7? False Let r(z) = -154z + 2847. Let k be r(-39). Is 8855 < k? False Let i be (-116)/203-14 + 11292/(-1414). Is 0 > i? False Suppose 5061 = -155q + 52336. Is 305 at most as big as q? True Suppose 5p - 28 = 8z - 6z, 2z = -8. Suppose 2c = -pg - 86, -3c - 45 - 36 = 4g. Is g at most as big as 6? True Let i(z) = 5z + 37. Suppose 0v - 5v = 0. Let k be i(v). Is k not equal to 42? True Let w(s) = 48s3 - 2s*2 - 2s - 1. Let k be w(-1). Let m = -119623 + 119576. Is m greater than k? True Let h be (18 + -25)/7919/2. Which is smaller: h or -461? -461 Let a(t) = 12t*2 - 26t - 216. Let s be a(-15). Is s != 2874? False Let l = -227 + 111. Let h be (0 + 92)29/l. Which is smaller: 0.3 or h? h Let b(i) = -18i + 103. Let p be b(7). Let l = -1 + 1. Suppose -s = 2c + 19, l = -s - 2s + 4c - 77. Is p not equal to s? False Let d(k) = 40k*2 - 9k - 60. Let x be d(-5). Let o be (1 - -1)/((-3900)/x + 4). Which is greater: o or 49? o Let p = 92 - 82. Let d be p/(-45) - (-5)/(-18). Let f = 0.04 - -0.06. Which is bigger: f or d? f Let u be (-10)/(-130) - 33418/273. Is u smaller than -121? True Suppose o - 4t - 10 = 0, -37o + 5t = -38o + 37. Is o equal to 113/5? False Suppose 172 = -2c - 614. Let v be (-635)/20(-6)/c. Let u = v + -2/131. Is u at least 1/3? False Suppose 0 = 19n + 75 + 80 - 3. Is n greater than or equal to -8? True Suppose 20m = -358 + 338. Which is greater: -4/327 or m? -4/327 Let v be (-2)/(-16) + 7/((-224)/68). Let h(i) = -78i + 58. Let m be h(v). Which is greater: 216 or m? 216 Let j be -1(0 + -2) - (1 - 0). Let t be (j - 10)70/(-462). Is 1 smaller than t? True Let d = 35915 - 35754. Which is smaller: 2108/13 or d? d Let a be 1-94/12. Let w be 21/a - (-23)/3. Which is greater: -5 or w? w Let m be (11120/396)/(28/6). Let g be 0/(-3) + (	{ "pile_set_name": "DM Mathematics" }
*4 + 312o*3 + 338o*2 Let b(r) be the third derivative of 377r*5/20 + 119r*2 + 3r. Let g(k) = -2k. Calculate g(b(s)). -2262s2 Let r(a) = a2 - 411a. Let v(k) = 60k. Calculate v(r(p)). 60p2 - 24660p Let t(f) = -21f. Let o(v) = -17v + 172. Let u be o(10). Let r(h) be the third derivative of 0 - 1/24h4 - 5h*u + 0h + 0h3. Give r(t(p)). 21p Let x(a) be the first derivative of -2/3a3 - 1 + 0a + 0a2. Let u(i) = -4i + 4i + 12i*2. Calculate x(u(w)). -288w4 Let m(x) be the second derivative of x3/2 - 3x - 18. Let c(w) = -10w*2. Give c(m(y)). -90y*2 Let s(x) = x. Let k be 11 - (-2 - -4)1. Let l(c) = 20c + 4c - kc. Calculate l(s(w)). 15w Let u(b) = b2. Let d(p) be the third derivative of -p8/10080 - 3p5/20 - 4p*2. Let a(n) be the third derivative of d(n). Determine u(a(i)). 4i*4 Let d(f) = 96658f. Let l(c) = 7c. Give d(l(j)). 676606j Let u(d) = -2d2. Let w(j) = 11j*2 - 6j. Let r(b) = -21b2 + 12b. Let p(h) = 4r(h) + 7w(h). Determine u(p(g)). -98g4 + 168g*3 - 72g2 Let h(g) = g2. Let l(f) = 2299f - 4. Give h(l(a)). 5285401a*2 - 18392a + 16 Let i(s) = 8 - 3s + 11s*2 + 7s + 4s. Let g(v) = -5v - 2 - 5v2 - 3 - 2v*2. Let h(t) = -8g(t) - 5i(t). Let u(q) = -8q. Determine h(u(r)). 64r2 Let m(d) = -96d. Let q(u) be the first derivative of -u*3/3 + 57. Determine q(m(z)). -9216z*2 Let v = -93 + 99. Let h(z) = -vz*2 + 2z*2 + 14z*2 - 7z*2. Let p(y) = 2y. Give h(p(b)). 12b2 Let w(f) = f. Let o(t) = -7t + 2. Let d(h) = -h + 1. Let b(y) = 5d(y) - o(y). Let q be b(2). Let s(n) = 2 - 2 - 5n*2 + qn*2. Give w(s(z)). 2z*2 Let w(b) = -b - 41379. Let z(s) = -11s*2. What is w(z(o))? 11o*2 - 41379 Let a(u) be the third derivative of 0 - 16u*2 + 0u + 0u3 + 0u*4 - 1/60u*5. Let k(q) = -12q*2. Calculate k(a(i)). -12i*4 Let p(n) = -1025n*2 - 3n. Let a(d) = 7d2. Calculate p(a(m)). -50225m*4 - 21m*2 Let l(u) = 2u*2 + 12u + 8. Let d be l(-6). Let o(s) = -19s + 11s + ds + 5s*2. Let x(a) = -2a - 3a + 8a. Determine x(o(q)). 15q2 Let h(c) = 934090c2. Let u(i) = -i2. Give u(h(t)). -872524128100t4 Let z(x) = x. Let c(s) = -s3 + 4s*2 + 15s - 15. Let m be c(6). Let l(w) = m - 5 + 2 + 46w. Calculate l(z(t)). 46t Let b(w) = 4w. Let a(j) = -861j*2 + j + 6. Give a(b(l)). -13776l*2 + 4l + 6 Let y(z) = -716z. Let b(j) = 2j*2 + 5. Give y(b(s)). -1432s*2 - 3580 Let l(x) = -8x + 6. Let a(b) = 25b - 15. Give a(l(z)). -200z + 135 Let t(x) = -5x2. Let i(w) be the first derivative of 2 + 0w - 3/2w2. What is i(t(f))? 15f*2 Suppose -38x = -40x + 4. Let z(v) = 327 - 327 + xv. Let h(j) = 2j + j + 0j. Calculate h(z(s)). 6s Let z(l) = -l. Let c = 111 + -108. Let u(v) be the first derivative of 0v + c - 5/2v2. Determine u(z(k)). 5k Let t(q) = -4q2. Suppose -5m = s + 15 + 10, 0 = -5s + m + 5. Suppose 4y + 4 - 8 = s. Let r(g) = 3 - y - 2 + g. Calculate r(t(p)). -4p2 Let r(j) = -280j - 676. Let o(c) = 2c. What is o(r(x))? -560x - 1352 Suppose 0 = -5r - 5i + i + 40, 3i = -3r + 24. Let z(o) = -r + 21 - 13 - 6o. Let n(p) = p. Calculate z(n(j)). -6j Let l(i) = -2i2 - 10i. Let f(h) = 16h2 - 7h. Let t(w) = 7w2 - 3w. Let y(o) = -3f(o) + 7t(o). Give l(y(j)). -2j4 - 10j*2 Let d(o) = 2o*2. Let s = 45 - 11. Suppose 5h - 3h - s = 4t, -2t + 2 = 0. Let m(p) = 4p + 4p - 8p - hp2. Calculate d(m(c)). 722c*4 Let x(l) = l. Let u(i) be the second derivative of -367i*4/12 + 2i - 7. Calculate u(x(r)). -367r2 Let i(v) = -55v - 3. Let w(t) = 45t2 - 2t. Give i(w(f)). -2475f2 + 110f - 3 Let u(l) = 14291 - l - 14291. Let h(c) = 12c2 + 5c. What is h(u(f))? 12f2 - 5f Let v(j) = -423j2 + 17. Let y(o) = 143o*2 - 6. Let z(m) = 6v(m) + 17y(m). Let p(k) = -k. Calculate p(z(c)). 107c*2 Let j(i) = -2i + 1. Let c(s) = 14s - 8. Let p(a) = c(a) + 8j(a). Let g(w) = 41w2 - 4w. Give p(g(r)). -82r2 + 8r Let s(f) = 406f2. Let t(v) = -22v*2 + 4 - 4 + 14v*2 + 10v*2. Calculate t(s(b)). 329672b*4 Let b(g) = -9g - 15g + 3 - 12g + 19g2 + 39g. Let a(w) = 245w2 + 40w + 40. Let q(d) = 3a(d) - 40b(d). Let x(c) = c. What is x(q(f))? -25f2 Let l(k) = k + 4. Let b(z) = z + 2. Let o(x) = -10b(x) + 5l(x). Let c(q) = -1 + 0 + 1 - q. Determine o(c(g)). 5g Suppose -d - 3d + 1 = 5v, 4v = 3d - 24. Let g(y) = -7y + 2y - dy. Let t(z) = 14z. Let b(m) = 8g(m) + 5t(m). Let f(n) = n*2. Calculate f(b(l)). 4l*2 Let j(f) = 22f - 11. Let h(u) = -5u + 3. Let p(l) = -22h(l) - 6j(l). Let a(i) = 3i*2. What is a(p(t))? 1452t*2 Let i(a) = -42a - 1. Let t(m) = 2 - 4 + 2 + m. Determine i(t(f)). -42f - 1 Let d(p) = 2p + 6. Let v(s) = -9s - 30. Let f(z) = -20d(z) - 4v(z). Let y(r) be the third derivative of -r5/12 - r2. Calculate y(f(t)). -80t*2 Let j(t) = 49t*2 - 6. Let n(x) = -3870x*2 + 473. Let g(k) = -473j(k) - 6n(k). Let q(i) = 71i - 149i + 34i + 42i. Determine g(q(o)). 172o*2 Let n(x) = 37x. Let k(i) be the first derivative of 2i2 + 788. Determine k(n(f)). 148f Let v(h) be the third derivative of -5h4/4 + 376h*2. Let l(c) = -34c*2. Calculate l(v(z)). -30600z*2 Suppose 0 = 4f + f. Let k be -1 + (1 + f)3. Let m(v) = v - k - 1 + 3. Let x(t) = t. Determine m(x(s)). s Let c(m) = 2m2. Let g(s) be the second derivative of s5/60 + 8s3/3 + 13s. Let p(h) be the second derivative of g(h). Calculate p(c(l)). 4l2 Let n(u) be the first derivative of 0u + 3/2u2 - 26. Let q(r) = -5r*2. Calculate q(n(v)). -45v*2 Let z(k) = -110k + 33k + 37k + 38k. Let w(s) be the third derivative of -s5/30 - s3/6 - 2s*2. Give w(z(f)). -8f*2 - 1 Let q(x) = -2x*2 + 278x - 136. Let j(n) = n. What is q(j(r))? -2r2 + 278r - 136 Let n(t) = 4t2 + 584t - 584t. Let p(d) = -17d*2. What is n(p(y))? 1156y4 Let r(v) be the third derivative of -v5/30 - 225v2. Let l(c) = 151c + 3. Give r(l(h)). -45602h2 - 1812h - 18 Let h(k) be the first derivative of 7k3/3 - 3k*2/2 - 34. Let w(a) = -76a*2 + 32a. Let s(d) = 32h(d) + 3w(d). Let v(i) = -28i. Give v(s(p)). 112p*2 Let i(c) = -4c. Let g(w) = -14097w. Calculate g(i(p)). 56388p Let i(f) = 3f2. Suppose -16 - 14 = -10v. Let x(p) = -vp + 15p - 7p. Calculate i(x(n)). 75n*2 Let j(y) = -7y*2 + 5y. Let a(r) = 4r2 - 3r. Let o(g) = -5a(g) - 3j(g). Let u(t) = 53t. Determine u(o(l)). 53l*2 Let f(l) = -1093l + 2195l - 1097l. Let r(n) = 5 + 5n - 5. Calculate f(r(j)). 25j Let o(h) be the second derivative of 11h4/8 + 19h*2/2 + 18h. Let v(t) be the first derivative of o(t). Let u(y) = 2y2. What is u(v(b))? 2178b*2 Let i(k) = 27357 + 2k - 27357. Let l(n) = n*2 + 28. Give i(l(b)). 2b*2 + 56 Let j(o) = -6o*2 - 7. Let p(a) = 154a*2. Determine j(p(k)). -142296k*4 - 7 Let s(l) = 11201l. Let v(h) = 3h2. Determine s(v(j)). 33603j*2 Let w(n) = -2n. Let t(d) = 55145d. What is w(t(p))? -110290p Let l(y) = y. Let o(w) = 2w2 - 96692w. Determine l(o(m)). 2m2 - 96692m Let r(x) = 22x. Let v(h) be the first derivative of -6h*2 + 78. What is v(r(a))? -264a Let d(c) = 11 + 5199c + 4 - 5198c. Let l(v) = -v. Calculate d(l(g)). -g + 15 Suppose -102 + 92 = -5d. Let w(k) = -k + dk - k - 2k2. Let q(b) = 21b + 2. Give q(w(p)). -42p2 + 2 Let r(d) be the third derivative of d5/30 + 3d2. Let b(j) be the second derivative of -j4/6 - 3j. Calculate r(b(x)). 8x*4 Let i(c) = -2c*2. Let s(r) = -43481r. Give i(s(f)). -3781194722f2 Let v(p) = -3p + 13. Let y(t) = 4t2 - 5t + 10. Let m(l) = -3l2 + 4l - 8. Let k(u) = -5m(u) - 4y(u). Determine k(v(h)). -9h2 + 78h - 169 Let g(w) = 9w2. Let p(s) = 119619s. Calculate g(p(v)). 128778346449v2 Let u(m) = m. Let z(t) = 774t*2 - 2t + 1. Determine u(z(n)). 774n2 - 2n + 1 Let i(u) be the second derivative of 5u3/6 - 4u + 18. Let d(h) = -4h2. Give i(d(n)). -20n*2 Let t(i) = -12i*2. Let h(a) = 3a*2 - 2640a - 2a2 + 2640a. Calculate t(h(x)). -12x4 Let j(l) = 10l. Let z(k) = -62043k. Calculate z(j(d)). -620430d Let m(d) = -9d2 + 5d - 5d. Let j(c) = -c. Let b(h) = -5h. Suppose 4 = -2*q	{ "pile_set_name": "DM Mathematics" }
s b a composite number? True Let i = -1721 - -3237. Suppose -d + i = -2s - s, 5d = -4s + 7523. Is d a prime number? False Let t(k) = 50k*2 + 4k + 1. Is t(7) a composite number? True Let d = 1063 - 666. Is d composite? False Let a(k) = -9k3 - 5k*2 - 3k + 4. Let f be ((-4)/((-40)/(-6)))/(1/5). Is a(f) a composite number? False Let f = 10065 + -1024. Is f composite? False Suppose 4l + 42181 + 4144 = k, 2l - 6 = 0. Is k composite? False Let y(s) = s + 9. Let a be y(-9). Suppose 0 = -ag - 3g + 18. Suppose -gk = -11 - 379. Is k prime? False Suppose -2o + 3o = 5h - 181965, 5o + 36393 = h. Is (-6)/9h/(-14) prime? True Is 4 - (-2912 + (-9 - 2)) composite? False Let p(z) = -4z2 + 3z. Let u be p(6). Let v = u - -253. Is v a prime number? True Let k(d) = 38d + 12. Let v be k(-6). Let m = v - -401. Is m prime? False Suppose 0 = -5n + 15 + 5. Suppose 4a = g + 33, -ng = -0a + 5a - 36. Suppose -ap = -4p - 316. Is p a prime number? True Suppose -850 = q + q. Let o = q - -660. Let l = o + 16. Is l a prime number? True Suppose 0 = -246v + 271v - 5975. Is v composite? False Let f(o) be the third derivative of -65o4/2 - 7o*3/6 + 37o*2. Is f(-3) a composite number? False Suppose 35 = -5l + 95. Let r(f) = 5f2 - f3 + 15f - 3f2 - 17 + 5f*2 + 4f*2. Is r(l) composite? False Suppose 16 = -4d - 5v, -v - 2 = 2. Suppose d = 2n - 3. Suppose 379 = nz - 51. Is z a composite number? True Let h(l) = 205l - 1127. Is h(24) a prime number? True Suppose 2v = -3o + 15643, 0v - 2o = -4v + 31262. Is v a composite number? False Let s(q) = 19578q - 43. Is s(1) a prime number? False Suppose 5m = 2k + 30585, -4k + 1210 = -4m + 25666. Is m a prime number? False Let f be (1 + -1)4/(-4) - 0. Suppose k - 1510 - 1081 = f. Is k a composite number? False Let z(g) = 21g + 38. Suppose 0 = 7i - 167 - 8. Is z(i) a composite number? False Suppose 2t + j = -2j - 2, 14 = 2t - j. Suppose 182 = 2y - 3f, -126 = -3y - tf + 185. Is y a composite number? False Let u(p) = 103p2 + 6p - 15. Is u(4) composite? False Let t(n) = 4095n3 + 19n*2 - 34n + 3. Is t(2) a prime number? True Let c be -1 - (-40 + (7 + -3)/(-1)). Suppose -cr - 862 = -45r. Is r a composite number? False Let z = 157 - -498. Suppose 3y = 3x + 534, 4y - 62 = -x + z. Is y composite? False Let w(s) = -5331s*3 + 18s + 18. Is w(-1) a composite number? True Let u(r) = r*2 + 2r + 1. Let i be u(-1). Let o = 382 + -380. Suppose -oh + 38 - 8 = i. Is h a composite number? True Suppose 5s + y - 13 = 0, 5s + 3y = 5y + 4. Suppose 1 = -m + 7. Suppose sv = 5v - m. Is v composite? False Suppose 22v - 608999 + 199293 = 0. Is v composite? True Suppose 1170 = -g - d, -2d - 4676 = 4g + 3d. Let m = -801 - g. Is m a prime number? True Let l = 748 + -508. Let g = 643 - l. Is g a prime number? False Let j be 20/(-12)(-54)/15. Let k(r) be the third derivative of 11r4/12 - r3/6 + 3r*2. Is k(j) prime? True Let b(p) = -p + 7. Let t(s) = s - 6. Let q(r) = 5b(r) + 6t(r). Let j(w) = -68w*2 + 4w - 5. Let m(h) = -j(h) + 6q(h). Is m(-2) a composite number? True Let z(f) = 16f*2 + 2 + 18f2 - 3. Let b(h) = -h3 - 22h2 - 23h - 41. Let q be b(-21). Is z(q) composite? True Is (-6 - -4 - -8544) + 1 + -1 prime? False Suppose -3p = 2p - 20. Suppose 4t - p = 8. Is (-2640)/(-7 - -4) - t a composite number? False Is 35/141466/51 composite? False Let j(k) be the first derivative of -k4/4 - 2k*3 + 7k*2 + 10k + 3. Suppose 0 = -4d - 5i - 56, 3d = 3i - 2 - 13. Is j(d) prime? True Is 15/10 + 200156/8 composite? True Suppose -x - g - 14822 = 0, 2x - 3g = 2g - 29644. Is 14/56 + x/(-8) prime? False Let n(i) = 5i*2 + 2i - 2. Let r = 16 + -16. Suppose 0 = -t - 2w - 1, t - 2t + 5w + 20 = r. Is n(t) composite? True Is (3 - -139)/((-18)/(-117)) prime? False Suppose -2c = 4b + c - 31, 4b - 11 = c. Suppose bu + g - 16193 = 0, -3u + 4g + 14128 = 1969. Is u prime? True Let a = -4551 - -7983. Suppose 0 = -y + 5i + a, -792 - 2650 = -y + 3i. Is y a composite number? False Let d be 0/(-64/(-12)). Suppose 3i = -5r + 33 + 17, -3i + 15 = d. Is r a composite number? False Let r(d) = d3 - 6d + 5. Let v(o) = -o*3 + 18o*2 - 16o - 11. Let j be v(17). Is r(j) a composite number? True Let k = 5142 - 2988. Suppose 10m - 4m - k = 0. Is m a composite number? False Let b = 9794 + 417. Is b a prime number? True Let z(n) be the first derivative of 18n2 + 13n - 12. Is z(4) prime? True Let w(q) = -1231q - 12. Is w(-5) a composite number? False Suppose -2k = -q + 7, -q - k = 3k + 11. Let a be (-25070)/(-40) - q/(-4). Suppose 2i - 5i + a = 0. Is i prime? False Let s(q) = q3 - 11q*2 - 12q - 1. Is s(16) composite? False Let s = 71 + -71. Suppose s = 19g - 24g + 6005. Is g composite? False Let f(b) = -181b - 6. Is f(-11) a composite number? True Let u = 56 - 51. Let w(q) be the second derivative of 3q4/4 - q3/6 + 3q2/2 - q. Is w(u) prime? True Let p = 42 - 40. Suppose 0t = pt - 634. Is t a composite number? False Is 48129/(-2)(-20)/30 a prime number? False Let u = 85967 - 41950. Is u composite? False Let r = -3796 - -11163. Is r a prime number? False Let f be (-333)/27 - (-2)/(-3). Let a = f + 18. Suppose -b = m + m - 147, 0 = -ab - m + 780. Is b a prime number? True Is 4/7 + 28026/126 a composite number? False Let y = -2 + -1. Is (185 - (2 + 1)) + y a prime number? True Suppose -5q - 24 = 4z - 0, 0 = 4q + 16. Suppose -3y = -k + 2y - 235, 5y = 4k + 880. Is z + 5 - 8 - k composite? False Let v be (-2)/(-7) - 208/(-56). Let q be v + (-3)/3 - 0. Suppose -2t - 3y = -4 + 12, 4y = -qt - 10. Is t a prime number? True Let d(a) = -38a + 9. Let b be d(-8). Suppose k + 5x = b, -x = -0k + 4k - 1176. Is k a composite number? False Let h(n) = -2n2 - 9n + 10. Let g(m) = -m*2 - 4m + 5. Let k(r) = 11g(r) - 6h(r). Is k(-14) prime? False Let b(c) be the second derivative of -c3/6 + c2/2 - 6c. Let w be b(-1). Suppose o - 4n = 211, 4n - 553 = -wo - o. Is o a prime number? True Suppose -a = -3 - 1. Is 564388/110 + (a/(-5) - -1) a composite number? True Is 40/30 - ((-8444)/3 + -3) a prime number? True Let g = 17 + 68. Let k(y) = 9y + 7. Let l be k(-5). Let j = g + l. Is j a composite number? False Let j(s) = -25s*2 + 6s + 1. Let g = 27 - 34. Let t be j(g). Let f = -635 - t. Is f a composite number? False Let l(a) = 2a + 9a - a*3 + 0a + 6 + 3a2. Let x be l(-8). Let d = x + -291. Is d a composite number? False Suppose -2 = -r - 0. Suppose -rf = f + 27. Is (3/f)/((-1)/45) a composite number? True Suppose -3y + 12 = 0, -3b + 6y = 2y - 8765. Is b a prime number? True Suppose -2p - 2s = -s, -2p - 4s + 12 = 0. Is (-5013)/(-36) - p/(-8) a prime number? True Let f(b) = -3b2 - 9b - 3. Let v = -13 + 14. Let y(d) = d*2 + d - 1. Let j(o) = vf(o) + 4y(o). Is j(-6) a composite number? False Is ((-75275)/125)/((-2)/101) a composite number? False Let u(m) = 41m2 + 31m - 19. Is u(12) a composite number? False Let g be ((-3)/6)/(2/(1984/(-2))). Let u = 637 - g. Is u prime? True Suppose -3l - 15 = 0, -5s - l - 265 = -s. Let m = s + 332. Is m a prime number? False Let s be ((-4)/(-12))/(1/(-3)). Let c(z) = z2 + 1. Let i be c(s). Is (-2661)/(-15) - i/5 prime? False Let t(o) be the third derivative of -o5/10 - 13o4/24 - o3 + 6o*2. Let q(v) be the first derivative of t(v). Is q(-12) prime? True Let j = -10 + 17. Let u be 5(2 - j/5). Suppose uy - 5g - 422 = 0, y + 29 = 4g + 172. Is y a composite number? False Suppose 2h = 4 + 2. Let w be h/7 + 12/(-28). Suppose -2g - 3g + 671 = -2a, g + 2a - 127 = w. Is g composite? True Let o = -22 - -18. Is 955 + 1 + o + 6 a composite number? True Let g = -277 - -528. Is g composite? False Let d = 14 - -425. Is d prime? True Let s be 123/(-2)(3 + -5). Let t = s + 266. Is t prime? True Suppose -m + 4j = 3m - 36, 5j = -20. Suppose -w + mw = 0. Suppose 3y = -d + 3d - 576, 3d + y - 875 = w. Is d a prime number? False Let s(g) = 3g2 - 14g + 26. Let i be s(9). Let b = i + -32. Is b composite? True Let z(b) = -6118b - 201. Is z(-5) prime? True Suppose -5p - y = -5y - 19, 0 = -3p - y + 8. Suppose 6 = -p*z + 12. Is 9/(-6) - (-625)/z a prime nu	{ "pile_set_name": "DM Mathematics" }
+ 3w)(2w - 3w - w) - 28w + 28w - 40w2 - 75w*2. -116w*2 Expand -2r*2 - 3r*2 + 8r*2 + (0r - 6r + 2r)(1 - 2r - 1) + 1 + 2r2 - 1. 13r*2 Expand 340v*3 + v - 653v*3 + 332v*3 + 2v*3 - 3v*3 + 0v*3 + (-1 - 2 + 4)(v*3 - 5v*3 + 3v3) + (13 - 13 + v2)(0v + 5v - 6v). 16v3 + v Expand (0 + 1 - 3 + 2 - 2 + 2 + (-1 + 3 - 1)(4 - 4 - 1) + 2 + 2 + 1)(n - n - 3n) - 3n + 0n + 5n + (-5 + 1 + 2)(-5n + 2n + n). -6n Expand (4 + 0 - 6 + (-2 + 1 + 0)(-2 + 1 - 2))(-9s + 2s3 - 14s + 3s)(-1 - 2 + 1). -4s3 + 40s Expand (-309 + 309 + 28f3)(f + 24 - 24). 28f4 Expand (-5f - 4f + 0f)(-1 + 1 + f)(-2 + 0 + 3). -9f2 Expand (-3m*2 + 3m2 - m2)(-1 + 26m - 2 - 2m3 - 27m). 2m5 + m3 + 3m*2 Expand (1 - 1 + 3x)(42x + 26x + 35x - 37x). 198x*2 Expand (2q*3 + 2q*3 - 5q*3)(1 + 2q - 1)(85 + 32 + 14) - 5q4 + 0q*4 + 3q*4 + (-4q + q + 2q)(-2q3 + q3 + 0q*3) + 3 - 3 - 2q*4. -265q*4 Expand (3o + o - 2o)(12 + 12 + 26) + o - 3o + 3o + (-3 + 7 - 2)(o + 4o - 3o) - 3o - 3o + 4o + 2 - 2 + o. 104o Expand 28p*3 + 19p*3 + 6037 - 6039 + (0p + p - 2p)(-3p + 2p*2 + 3p). 45p3 - 2 Expand 0h*3 + 0h*3 + 3h3 + h3 + h3 + h3 + (8 - 1 - 3)(-h + h - h3). 2h*3 Expand (3 + 3 - 5 + (0 + 2 + 0)(0 + 1 - 3) - 3 + 1 + 1)(20 + 3a - 20) + 5a - 4a + 0a. -11a Expand (2 + 0 + 0)(-2 + 12 + 26)(-2o2 + 3o*2 - 4o*2). -216o*2 Expand ((p + 1 - 1)(-1 + 3 - 4) - 3p - 4 + 4)(-4 + 3 + 3 + (1 + 0 + 0)(-6 + 5 + 3) + 7 - 3 + 11). -95p Expand 0p4 + 2p*4 + 0p*4 - 5p*4 + 3p*4 + 4p*4 + (5 - 1 - 2)(3p4 + 3 - 3) + (-7p*3 + 2p*3 + 0p*3)(-4p + 0p + 0p). 30p*4 Expand (2 + 0 + 2)(4h - h - h) - 24h + 16h + 19h. 19h Expand (-o + o - o)(-14o - 128 + 128) + 2 + o2 + 6o*2 - 5o*2. 16o*2 + 2 Expand (13l - 13l + 4l + 0l - 4l + 5l + (1 - 3 + 1)(-3l + 3l - l))(-101l + 93l + 0 + 2). -48l*2 + 12l Expand (-387c4 + 493c*4 + 459c*4)(-2c + 0c + c). -565c5 Expand (15v*2 + 41v + 14v2 - 44v)(2 + 0 - 1)(-5 + 1 + 1)(1 + 4 - 4). -87v*2 + 9v Expand -4w - 1 - w + 9w*2 - 8w*2 + (6w + 2w - 3w)(-2w - w - 2w). -24w*2 - 5w - 1 Expand 3t2 - t2 - t2 + (-10515 + 10515 - 255t)(t + t - t). -254t*2 Expand (b + b - b - 2b + b + 2b + (0 + 1 + 1)(-4b + 4b + 2b) + 2b - 1 + 1)(667 + 12b - 667)(0b*2 + 3b2 - b2). 192b4 Expand (321 - 24 + 183 + 10)(-6b - 2b + 0b). -3920b Expand (-2p + 2p + p*2)(-10p + 6p - 10p) - 44p*3 - 51p*2 + 51p*2. -58p*3 Expand -2g + g + 3g + (g - 2g + 3g)(4 - 2 + 0) + 7 - 7 + 5g + (-3g - g + 5g)(-4 - 2 + 4). 9g Expand (42 + 2 - 10)(-2l3 + 0l*3 - 2l*3). -136l3 Expand (-1 - k3 + 1)(34k*2 - 5k*2 + 6k*2). -35k*5 Expand -1 + 3 - 1 - 4s + (2 - 1 + 1)(2s - 9s + 4s). -10s + 1 Expand 16c*5 - 6c*5 - 2 - 11c*5 - 3c2 + (-c + c2 + c)(4c*3 - 4c*3 - 6c*3) + 6c*5 - 3c5 - c5. -5c5 - 3c*2 - 2 Expand (333l - 40l + 135l + 50l)(l + l - 3l). -478l*2 Expand (-6a + 6a - 1572a*2 + 37 + 1578a*2)(-3a2 + 3a - 3a). -18a*4 - 111a*2 Expand (5 + 3p*3 - 5)(p2 + 1 - 1) + (-p3 - 5p3 + 4p*3)(-2p2 + 0p*2 + 0p*2) - 4p*5 + 2p*5 + 9p*5. 14p*5 Expand (5j - j - 3j + (j + 2j + 0j)(6 - 1 - 1))(-3 - 1 + 1). -39j Expand (60831b2 + 2b*3 - 60831b*2 - 245)(-2b2 + 2b2 - b2). -2b5 + 245b*2 Expand ((-6l + 0l + 4l)(-3 + 0 + 5) + l - 8l - 3l + 4l - 5l + 4l)(-4 + 4 + 2l + (-1 - 3 + 0)(0l + l + l)). 66l2 Expand (0 - 5 - 1)(-7r - 3r - r)(0 - 2 - 1 + (3 - 5 + 0)(-1 + 5 - 3) + (-1 - 2 + 1)(-3 + 2 - 1) - 2 + 0 + 0). -198r Expand (-2c3 + c3 + 0c*3)(2c + c - 2c) + 0c4 + 0c*4 - 3c*4 + (-2 - 1 - 1)(4c2 - 4c*2 - 6c*4)(0 + 4 - 5). -28c4 Expand (-31 + 31 - 8a)(a - 2a + 2 - 1) - 2a2 + 2a*2 + 2a*2 + (-3a + 3a - 2a*2)(-3 + 2 + 4). 4a2 - 8a Expand (h + 2h2 - h)(5h3 - 5h3 - h3) + h + 3h5 - h + 46h*4 - 22h*4 - 7 - 25h*4 - 3h*5. -2h5 - h4 - 7 Expand (-f*2 - 3f*2 + 5f*2)((-1 - 1 + 0)(-4 + 1 + 5) - 4 - 2 + 4 + 39 + 227 - 48). 212f*2 Expand (15p*2 - 8p*2 + 8p*2)(-p*3 - 3p*3 + 2p*3 - 2p*3). -60p*5 Expand (2u + 0 + 0 + 1)(-45u + 47u - 16 - 2). 4u*2 - 34u - 18 Expand (1 + 0 + 0)((-3v + 0v + v)(-4 - 2 + 2) - 6v + 0v - 7v + (3 - 3 - 3)(-2v + 1 - 1)). v Expand 4c*2 + 2c*3 - 4c*2 + (-4 + 4 - 2c*3)(-3 - 2 + 3) - 5 + 2c3 - 286c*2 + 286c*2 + 4c. 8c3 + 4c - 5 Expand -15s2 + 9s*2 + 3s*2 + (5s - 4s - 2s)(4 + s - 4). -4s*2 Expand -25g + 47g + 52g + 2g + g - 5g + (-3 + 0 + 1)(3g + g - g). 66g Expand (-1 + 2g*3 + 1)(3g - 5g - g) + 433g3 - 433g*3 - 56g*4. -62g4 Expand (-f2 + 4f2 + f2)(f + 2f - f) + 210f + 3f3 - 21f*2 - 208f + 0f3. 11f*3 - 21f*2 + 2f Expand (5 - 4 - 4)(9l + 8l - 27l)(-l - l + 4l). 60l2 Expand (5n*4 + 2n*4 - 2n*4)(5 - 5 - 11n)(-1 + 2 + 1)(-1 - 3 + 2). 220n*5 Expand (1364 + 1114 - 4 + 628)(-5t + 3t + 0t). -6204t Expand (-20 + 0 + 10)(2 + 2 - 3)(3r + 1 - 1). -30r Expand (-3 - 3 + 4)(4 - 1 - 9)(-7 + 3 - 2)(-4z + 2z + z). 72z Expand (3o2 + 6o*2 + 11o*2)(3 + 15o - 6 + 1). 300o*3 - 40o*2 Expand (-1 + 1 + m)(-2m + 15 + 6m - 2m)((2m2 - 3m*2 + 12m*2)(1 - 2 + 0) + 0m2 + 2m*2 - 4m*2). -26m*4 - 195m*3 Expand (2c*4 + 0c + 0c)(2 - c - 2) + (-3c3 + 2c*3 + 8c*3)(-5 + 7c2 + 5). 47c*5 Expand -7u*2 + 67u*2 - 8u2 + u2 + 2u - 2u + (3u + 3u - 4u)(2u - 2u + 2u) + 3 - 3 - 2u*2 + 5u2 - u2 - 2u2. 57u*2 Expand (2 + 0 - 3)(36r + 2r + 374 - 35r)(4r3 + 0r*3 - 2r*3). -6r*4 - 748r*3 Expand -2b*3 + 2b*3 - 3b*4 + (5 - 3 + 6)(3b2 - 3b*2 + 3b*2)(4b2 - b2 - 2b*2). 21b*4 Expand (-2 + 4 - 1)(-4u + 5u + u) + (-2 + 1 + 2)(-13u + 8u + 7u + 8). 4u + 8 Expand (209l - 337 + 337)(-4 - 1 + 3). -418l Expand (0 + 0 - 2n)(2n3 - 2n*3 + 2n*4) + 120n*5 - 250n*5 + 154n*5. 20n*5 Expand -16m*2 + 27m*2 - 4 - 15m*2 + (0m - m - m)(2m - 2 + 2). -8m2 - 4 Expand -3r*2 + 1 - 1 + 0r2 - r2 + 0r2 + (3 + 2r - 3)(-r + r - 2r) - 2r + 2r + 3r2 - 8r*2 + 4r + 5r2 + 2r*2. -6r*2 + 4r Expand (10 + 2f2 - 10)(3f2 - 17 + 17)(0 - 4 + 5) + (f + 0f - 2f)(-13f*2 - 17f*3 + 13f*2). 23f*4 Expand 0i*2 - 2i*3 + 0i2 + i2 - 2i3 - i2 + (3i*3 - 3i3 + i3)(1 - 3 + 3) - 14i*3 + 5 + 2 + 16i3. -i3 + 7 Expand (b + 1 + b - b)(13 - 80 + 0). -67b - 67 Expand (-20 + 51 - 158)(-3s + 0s + s)(-s + 5s - 3s). 254s2 Expand (4 - 4 - 1)(-115 + 130 - 385f + 365f). 20f - 15 Expand (-2 + 3 + 0)(-3 - 1 + 2 - y) - 147y + 295y - 2 + 3. 147y - 1 Expand (12h*3 + 8h3 - h3)(-18 + 18 - 6h)(-1 - 2h + 1). 228h5 Expand (s + 2 - 2)(4s2 + s2 - 4s*2) + 45648s*2 + 496s*3 - 45648s*2. 497s*3 Expand (208 - 208 - 61y)((0 + 1 + 0)(0 + 0 - 1) + 2 - 2 - 1). 122y Expand 709q*5 - 418q*5 - 386q*5 + (0q4 + q4 - 3q4)(2q - q + 0q) - 3q + 3q - q*5. -98q*5 Expand (-12 - 70 - 43)(0 - 3 + 0 + (-1 + 5 - 5)(0 - 1 + 2) - 2 + 3 - 2 - 4 + 1 + 2)(1 - 1 - 2r). -1500r Expand (-y + 2y - y2 - 2y*2)(1 + 1 + 0)(0y - 2y + 0y)(12y - 21y2 - 12y). -252y5 + 84y*4 Expand -5 - 1 + 2 - 2j + 3j + 0j - j + (1 + 3 - 2)(5 - 5 - 2j). -4j - 4 Expand (-1 + 6 - 1)((0z + 0z + 3z)(0 + 2 - 1) + 10z - z - 5z). 28z Expand (-3u*2 - 7u*2 - 14u*2)(4 - 5 + 3) - 2 + 2u2 + 2 + 0u*2 + 0u*2 + 2u*2. -44u*2 Expand (-2211 - 82k*3 + 2211)(3k + k - 6k)(2k - k + 5k). 984k5 Expand (-y2 - 3y + y - 2y*2)(1 + 115 - 10). -318y2 - 212y Expand (-103 - 15l + 103)(9 - 4 + 6). -165l Expand (-u5 - 2u*3 + 2u*3)(-2 + 3 - 3) + u*3 + 3u5 - u3 + (u*3 - 3u4 - u3)(-107 + 107 - 7u) + u*5 + 2u5 - u5. 28u5 Expand (78v - 78v + 267v*2)(v - v - 2v2). -534v*4 Expand (6b + 151b + 5b + 10b)(-1 + 1 - b)(1 + 0 - 3). 344b*2 Expand (64u*3 - 50u + 288u - 63u*3)	{ "pile_set_name": "DM Mathematics" }
e third derivative of p(d) wrt d? 12 Let v(d) be the third derivative of -1/2d3 + 0 + 0d + 0d4 + 0d*5 + 1/40d*6 + 3d*2. Differentiate v(o) wrt o. 9o2 Let t(v) = v3 + v*2 + v. Let y(r) = -2r*4 + 3r*3 - 10r*2 + 3r. Let f(p) = 3t(p) - y(p). Find the third derivative of f(s) wrt s. 48s Suppose -2a + b = -3, -a - 2 - 1 = -5b. What is the third derivative of 4ua + 7u5 + u2 - 3u2 wrt u? 420u*2 Let o(s) be the second derivative of -5s + 3/2s2 + 5/6s*3 + 0. Differentiate o(r) with respect to r. 5 Let y(s) = -6s*3 + 3s*2 + 4. Let k(h) = 5h*3 - 3h*2 - 3. Let l(r) = 4k(r) + 3y(r). What is the third derivative of l(c) wrt c? 12 Let m(y) = -y2 - 7y + 2. Let t be m(-7). What is the third derivative of j2 - j2 + j*2 - 2j*6 - 4j*t wrt j? -240j*3 Let l(f) be the first derivative of -3f*4 - 2f*2 - 10. Find the second derivative of l(p) wrt p. -72p Let j be ((-6)/4)/((-6)/8). Find the third derivative of -2t4 + 3t*4 + 23t*2 - 24t*j wrt t. 24t Let t(f) = f. Let b(o) = -12o3 - 4o - 4. Let p(q) = b(q) + 6t(q). Differentiate p(m) with respect to m. -36m*2 + 2 Find the third derivative of -191r*3 + 0r + 23r2 + 0r + 159r3 wrt r. -192 Suppose 4c + 18 = 2f, 3c - 6c = -2f + 15. What is the third derivative of -3b4 - b + 0b*2 + b + fb*2 wrt b? -72b Let w(f) = -13f4 - 10. Let x(m) = m4 + 1. Let b(k) = -w(k) - 4x(k). Differentiate b(g) wrt g. 36g3 Let x(q) = 2q*3 - 6q*2 - 5q + 5. Let w(g) = -2g3 + 6g*2 + 6g - 6. Let o(s) = 5w(s) + 6x(s). Find the third derivative of o(y) wrt y. 12 What is the derivative of -107p3 + 52p*3 - 7 + 45p*3 wrt p? -30p*2 Let g(r) be the third derivative of 9r*5/20 - 5r*4/3 + 14r*2. Find the second derivative of g(o) wrt o. 54 Find the second derivative of -66x*3 + 107x*3 - 47x - 63x3 wrt x. -132x Let h = 0 - -3. What is the first derivative of -2o3 + 0 + 3o*3 + 2 - h wrt o? 3o2 Let c(l) be the second derivative of -l4/4 + 7l3/6 - 3l. Find the second derivative of c(p) wrt p. -6 Let i(f) = -f + 1. Let p(x) = -12x - 1. Let v(q) = -3i(q) + p(q). Find the first derivative of v(k) wrt k. -9 Let x(f) be the third derivative of -f*5/6 - 3f4/8 + f2. What is the second derivative of x(p) wrt p? -20 Let n = 10 + -7. Differentiate 3v3 - v3 - n - 3v*3 wrt v. -3v2 Let r(p) be the third derivative of -p6/8 - 5p4/6 + 17p*2. Find the second derivative of r(g) wrt g. -90g Let s(w) be the third derivative of 0w3 - 3w*2 - 1/24w*4 + 0w + 0 + 1/40w6 + 0w*5. Find the second derivative of s(d) wrt d. 18d Let a be (2/5)/((-2)/(-10)). What is the second derivative of -6m + 4m + 2 - 2 - am3 wrt m? -12m Let p(r) be the second derivative of 0 + 0r4 + 0r*5 + 1/15r*6 + 0r*2 - 4r + 5/6r3. Find the second derivative of p(m) wrt m. 24m*2 Suppose 6f = 1 + 11. Let q(j) be the third derivative of 0j5 + 0j*3 + 1/60j*6 + 0j - 1/12j4 + jf + 0. What is the second derivative of q(u) wrt u? 12u Let i be -2 + 5/(15/6). Let c(r) = i + 2 - 4 + 4r. Let h(t) = -5t + 2. Let j(s) = 6c(s) + 5h(s). What is the first derivative of j(q) wrt q? -1 Let g(x) = x4 + x3 - x*2. Let v(a) = -3a*3 - 1 + 2 - 2a*4 - 1. Let f(j) = -3g(j) - v(j). Find the third derivative of f(w) wrt w. -24w Let r(s) be the first derivative of 0s*4 - 3/5s*5 - 3s*2 + 0s*3 + 0s - 5. Find the second derivative of r(n) wrt n. -36n2 Let x(h) = 26h*3 - 11h*2. Let g = 9 - 3. Let p(f) = -9f*3 + 4f*2. Let b(m) = gx(m) + 17p(m). Find the third derivative of b(c) wrt c. 18 What is the third derivative of -7d*2 - 30 + 2d*3 + 30 wrt d? 12 Let f = -4 + 7. Find the first derivative of 0j*f + 11j*4 - 3 - 12j*4 + 0j*3 wrt j. -4j*3 Let c(r) = -r - 8. Let f be c(-11). What is the derivative of -2 - f - 12g + 4g wrt g? -8 Let h(g) = 149g*2 + 75g + 11. Let b(t) = -50t2 - 25t - 4. Let j(z) = -11b(z) - 4h(z). Find the second derivative of j(x) wrt x. -92 Suppose 0 = -3p + p + 4. Let q(g) be the second derivative of -gp + g + 0g*3 - 1/6g*4 + 0. Differentiate q(k) wrt k. -4k Let g(v) = -33v2 - 7. Let t(q) = 100q*2 - q + 23. Let i(p) = 7g(p) + 2t(p). What is the second derivative of i(d) wrt d? -62 Let p(a) be the second derivative of -49a*6/30 - 17a*2/2 - a. What is the derivative of p(o) wrt o? -196o*3 Suppose 4l + 61 = 3a, -a - 94 = -5a - l. What is the third derivative of -6c6 + 20c*2 - ac*2 + 2c*6 wrt c? -480c*3 Suppose 2o + 5w - 14 = 0, 4w - 6 = -o + 2w. Let t = -2 - -3. Differentiate 2 - t - g4 - og*4 with respect to g. -12g*3 Let k = -6 + 4. Let n be 8 + k/(-1)-1. What is the third derivative of 4h2 - h2 - h2 + 3h*n wrt h? 360h3 Let c(z) = z3 + 3z2 + z - 2. Let u be c(-2). What is the second derivative of uf - 5f2 - f + 4f + 2f wrt f? -10 Find the second derivative of -20 + 8p + 15p2 + 8p + 20 wrt p. 30 Let z be (-40)/(-22) - (-8)/44. What is the second derivative of -zs + 7s - 4s + 3s*4 wrt s? 36s*2 Let r(f) be the first derivative of 5f*5 + 16f + 14. What is the derivative of r(x) wrt x? 100x3 Find the second derivative of 17s*2 + 7s*2 + 321 - 321 + 4s wrt s. 48 Let r(s) = s*2. Let a(z) = 7z*4 - 13z*2. Let y(b) = a(b) + 4r(b). Find the third derivative of y(v) wrt v. 168v Let a(r) = r2 + 4. Let o(h) = h2 - 5h + 6. Let l be o(7). Let f(v) = -8v2 - 28. Let i(b) = la(b) + 3f(b). What is the first derivative of i(c) wrt c? -8c Let c(s) = 5s5 - 4s*4 + 4s*3 - 23s + 4. Let m(r) = -r5 - r4 + r*3 - r + 1. Let o(p) = c(p) - 4m(p). Find the second derivative of o(v) wrt v. 180v3 Let a(s) be the second derivative of -s6/180 + s4/24 - 5s*3/6 - s. Let t(y) be the second derivative of a(y). What is the derivative of t(l) wrt l? -4l Let y be 2/1(-6)/(-4). Suppose 4g - 7h - 4 = -yh, 6 = 3g - 2h. What is the third derivative of -6j4 + 2jg + j2 + 3j4 wrt j? -24j Suppose -h - 27 = -5m, 5m - 4h = m + 12. Let k = m + 0. Find the third derivative of -a5 + a5 - 2a2 - ak wrt a. -120a3 Let t(v) = -v4 + v3 - v2 + 1. Let h(i) = -14i*4 + 5i*3 - 5i*2 - i + 5. Let j(k) = h(k) - 5t(k). Find the second derivative of j(n) wrt n. -108n2 Let t(k) = -k3 + 7k*2 + 9. Let m be t(7). Suppose -4h = 5l + 12 + 1, -2h + 3l + 21 = 0. Differentiate m - 4 - 3 - 3a*h with respect to a. -9a*2 Let r(j) = 3j - 27. Let h(a) = -2a + 26. Let i(k) = 5h(k) + 4r(k). What is the first derivative of i(g) wrt g? 2 Let x(h) be the second derivative of h9/3780 + h7/420 - h4/4 - 7h. Let f(q) be the third derivative of x(q). What is the third derivative of f(m) wrt m? 96m Find the first derivative of -18w*2 + 5 + 5w*2 + 7w*2 wrt w. -12w Let n be 11/4 - 1/(-4). Find the third derivative of -3a3 + 2a3 + an + a*2 + 5a*6 wrt a. 600a*3 Suppose 0 = 4m - 4p - 4, 0 = -m - 2p + 3 - 2. Let r be (-1)/(-3) - m/3. Find the second derivative of y*4 + y + 2y*4 + ry wrt y. 36y2 Let a(x) be the first derivative of 2/3x*3 + 3 + 0x + 1/4x4 + 0x*2. Find the third derivative of a(l) wrt l. 6 Suppose 0 = 5h - 7h + 4. Let p(o) = -1 - 2 + 2o + 2. Let k(x) = x*2 + 7x - 3. Let g(y) = hk(y) - 7p(y). What is the derivative of g(z) wrt z? 4z Let c = -59/12 + 31/6. Let d(x) be the first derivative of -x + 1 + cx*4 + 0x*2 + 0x*3. Find the first derivative of d(r) wrt r. 3r*2 Suppose -4r = q + 74 + 59, 2q = 3r + 86. Let x be 6/(-21) + r/(-14). What is the second derivative of -xy4 + 4y - y - 4y wrt y? -24y*2 Suppose -12 = -4f + 4g - 0g, f = -3g + 3. Differentiate 1 - fz4 + 0 + 2 - z4 wrt z. -16z3 Let l(b) = b4 + 7b*3 - 7b + 10. Let o = -4 - -6. Let r(j) = 2j - 2j*3 + 1 - 2 - o. Let v(c) = 2l(c) + 7r(c). What is the derivative of v(n) wrt n? 8n*3 Let r(a) = a - 3. Let i be r(5). Suppose x = 3b + 2, -5x + 10 = -2b + 4b. What is the third derivative of 0c*2 + 0cx - ci - 2c3 wrt c? -12 Let x(d) = d2 + 7d + 12. Let l be x(-5). What is the third derivative of -2q5 - 13q*2 + 21q*l - 4q*5 wrt q? -360q**2 Let g(c) be th	{ "pile_set_name": "DM Mathematics" }
o) = -2o3 - 3o - 3. Determine hl(d) + 3y(d). -2d3 Let g(k) = -4k + 0 - 3 - 10k. Let t(x) = -9x - 2. Suppose 0 = -4o + 3p + 20, 4o + p - 48 = -3p. Determine ot(u) - 5g(u). -2u - 1 Let l(n) = -n + 6. Let b(h) be the first derivative of -2h - 11. What is -6b(q) - 2l(q)? 2q Let p(o) = -3o*3 - 5o + 5. Let t(m) = 4m3 + 7m - 7. Let w = -9 + 2. Let c(y) = -6y + 1. Let k be c(1). Let g be (k/(-2))/(2/(-4)). Give gt(l) + wp(l). l3 Let r(c) = -5c - 5. Let z(q) = -2q - 3. Determine -4r(a) + 9z(a). 2a - 7 Let w(t) = -4t - 1. Let y(n) = 3n - 1. Let b(j) = 1. Let r(x) = 2b(x) + y(x). Give -7r(m) - 6w(m). 3m - 1 Let r(q) = q3 + q2 - q - 1. Let t(g) = -5g3 - 9g*2 + 9g + 4. Let d(b) = b*2 - b. Let o(w) = -5d(w) - t(w). Calculate o(x) - 4r(x). x3 Let a(l) = -l3 + l2 + l. Let p(b) = 2b*3 - 3b*2 + b. What is -3a(y) - p(y)? y*3 - 4y Let l(d) = -18d - 9. Let r(x) = 27x + 14. Calculate -8l(u) - 5r(u). 9u + 2 Let v(o) be the first derivative of -2o3/3 + o2/2 + 2o + 34. Let z(f) = 4f2 - f3 - 3f2 - 1 + 0f*2. What is -v(x) - 2z(x)? 2x3 - x Let d(b) = -3b*3 + 5. Let x(c) = 3c*3 - 4c*2 + 4c - 2. Let v(j) = -3j3 + 3j*2 - 3j + 3. Let t(f) = -4v(f) - 3x(f). Give -6d(g) - 5t(g). 3g3 Let v = 9 - 4. Suppose 5b = 3s + b + 27, vs + 19 = -2b. Let m(n) = 2n*2 + 3n. Let f(c) = -2c2 - 4c. Calculate sm(j) - 4f(j). -2j2 + j Let v(d) = 5d - 1. Let r(x) = x + 1. Let o(h) = -3r(h) + v(h). Let l(t) = t - 1. Determine 3l(k) - o(k). k + 1 Let u(a) = a. Let o(l) = 2l2 + 8l - 2. Determine o(n) - 10u(n). 2n*2 - 2n - 2 Let t(r) = -r. Let q(f) = -f*2 + 2f. Give 2q(g) + 7t(g). -2g2 - 3g Let k(w) = 10w3 - 10w + 1. Let v(q) = 7q3 - 7q + 1. Give 5k(j) - 7v(j). j3 - j - 2 Let l(i) = -i2 + 4i + 5. Let m(n) be the third derivative of -n4/12 - n3/3 - 10n*2. Determine 2l(q) + 5m(q). -2q*2 - 2q Suppose -4x = -16 - 4. Let q(a) = 7a*2 - 7a + 5. Let l(j) = 4 - 6j + 9j*2 - 3j*2 + 0j. Determine xl(g) - 4q(g). 2g2 - 2g Suppose 0 = 4h - 1 - 3. Let w(v) = h - 4 + 4 + 9v. Let n(q) be the third derivative of -13q4/24 - q3/6 - q2. Determine 5n(r) + 7w(r). -2r + 2 Let s(q) = 0 + 4q + 0 - 2q*2 + 4. Let z(i) = -5i*2 + 11i + 11. Let p be (10 + 1)/((-7)/7). Calculate ps(b) + 4z(b). 2b2 Let k(j) = j. Suppose 4c - 16 = 4. Let w(t) = -4t3 - 3t + 3t3 + 3 - 1. Calculate ck(y) + w(y). -y*3 + 2y + 2 Let k(b) = 23b + 2. Let o(r) = 8r + 1. Give 6k(c) - 17o(c). 2c - 5 Suppose 0 = -d - 2d - 9. Let b(v) = -1. Let s(h) = -2h - 4. Calculate db(j) + s(j). -2j - 1 Let n(x) = -5x*2 - 11x + 11. Let d(y) = -2y2 - 6y + 6. Calculate 11d(q) - 6n(q). 8q2 Let k(a) be the first derivative of 3a*5/20 + 5a*3/6 + 3a + 3. Let d(i) be the first derivative of k(i). Let c(b) = b*3 + b. Determine -5c(f) + d(f). -2f3 Let z(n) = -6n*2 + 2n - 5. Let u(i) = 5i2 - 2i + 4. Determine 4u(d) + 3z(d). 2d2 - 2d + 1 Let r(z) = -z*3 + 5z*2 - 5z + 7. Let f = -12 - -2. Let y(d) = -2d2 + 2d - 3. What is fy(b) - 4r(b)? 4b3 + 2 Let u(t) = -6t*2 + 1. Let i(x) = 5x*2 - 1. Let f(v) = 3v - 6. Let o be f(5). Let b = o + -2. Give bi(w) + 6u(w). -w2 - 1 Let h(n) = -n3 - 3n2 + 3n + 4. Let u be h(-3). Let k = 7 + u. Let g(s) = s*2 + 2s. Let a(z) = -3z2 + 3z + 0z + 4z*2. What is ka(p) - 3g(p)? -p2 Let t(o) = 4o*3 + 5o*2 - 3. Let c = 162 - 170. Suppose 0 = 4p - 0 - 20. Let f(v) = 6v3 + 8v*2 - 5. Give ct(g) + pf(g). -2g3 - 1 Let n(r) = -r2 + 7r - 2. Let t(u) = u3 + 10u2 - 5. Let q be t(-10). Let i(v) = -v2 + 6v - 2. What is qi(d) + 4n(d)? d2 - 2d + 2 Let z(p) = 7p + 2 + 4p*2 + 7p - 12p. Let y(m) = 9m*2 + 5m + 5. Determine -2y(g) + 5z(g). 2g2 Let v(x) be the first derivative of x2/2 - x + 1. Let r be 0/(4/2) + 5. Let t(a) be the first derivative of -3a*2 + 6a + 34. What is rv(g) + t(g)? -g + 1 Let m = -51 + 53. Let i(g) = -g2 + g. Let f(k) = 12k - 4k2 - 8k + 3 - 3. Calculate mf(u) - 10i(u). 2u2 - 2u Let c(j) = -5j3 - 4j*2 + 4j + 38. Let u(k) = k3 + k2 - k - 1. What is c(b) + 4u(b)? -b3 + 34 Let g(r) = 8r*2 + 6r + 6. Let k(t) = t*2 + t + 1. Suppose -5w = 4z + z - 10, 0 = 5z + 4w - 7. Suppose 33 - 3 = 5x. Give xk(v) + zg(v). -2v2 Let l(a) = 10a*2 - a - 10. Suppose -5 + 3 = -s. Let f(v) = sv - 2 + 8 - v + 1 - 7v2. Calculate -7f(w) - 5l(w). -w2 - 2w + 1 Let t(w) = 4w - 5. Let h(r) = 29r - 12r - 7r - 11r. Determine -3h(q) - t(q). -q + 5 Let h = 77 - 71. Let s(x) = x*2 - x. Suppose -2b = 2b - 4. Let g(z) = -4z*2 + 7z. What is bg(u) + hs(u)? 2u2 + u Let p(r) = -7r*2 + 7r + 1. Let g(n) be the third derivative of -n*5/4 + 5n4/8 + n3/3 + n*2. Give -6g(y) + 13p(y). -y2 + y + 1 Let z(n) = -n2. Let m(q) = -q2 - 3. Let d(o) = o2 + 1. Let c(j) = -6d(j) - 2m(j). Give c(b) + z(b). -5b2 Let w(d) = -d2 + 11d - 14. Let m be w(7). Suppose -2h + 8 = m. Let p(z) = -3z2 - 2z. Let y(v) = v*2 + v. What is hp(j) - 6y(j)? 3j*2 Let z(k) = -12k*3 - 14k - 14. Let d(t) be the first derivative of -t4/4 - t2/2 - t + 15. Give 42d(b) - 3z(b). -6b3 Let y(a) = -2a*2 + 2a - 5. Let w(k) = 13k2 - 8k + 18. Let p(x) = 19x2 - 12x + 27. Let c(i) = -5p(i) + 7w(i). Determine -6c(r) + 11y(r). 2r2 - 2r - 1 Let j(q) be the first derivative of -q*2/2 - q - 2. Let t(z) = -3z - 4. Suppose -2r = -3r - 4. Give rj(s) + t(s). s Suppose 11y - 14y + 24 = 0. Let b(z) = -4z*2 + 8z - 8. Let g(k) = k*2 - k + 1. Determine yg(h) + b(h). 4h2 Let k be (15/9 + -4)-3. Let v(s) = -4s - 1. Let g(y) = -9y - 2. Determine kv(i) - 3g(i). -i - 1 Let h(z) = 15z + 12. Suppose -3 = -q - 4n - 0n, 4q = -5n - 10. Let s(g) = 6g + 5. Calculate qh(k) + 12s(k). -3k Let b(q) = q + 1. Let x(j) = 3j - 5. Determine -4b(v) + x(v). -v - 9 Let x(r) = -4r*2 - 4r + 16. Let t(a) = -2a + 3a - 2a - 4 + 2. Let y be t(-5). Let z(q) = -q2 - q + 5. Determine yx(j) - 10z(j). -2j*2 - 2j - 2 Let k(z) = -71z2 - 284. Let c(y) = -1. What is 284c(w) - k(w)? 71w2 Let v(q) = -q2. Let n(g) = g. Calculate 5n(k) - v(k). k*2 + 5k Suppose -25 = 5m, -3i = 2m - 32 - 0. Let s(r) = ir - 3r3 - 5 + 6 + 8 + 8. Let j(a) = a3 - 5a - 6. Let t be 4/14 + 30/(-7). What is ts(h) - 11j(h)? h*3 - h - 2 Let r = -23 - -40. Let p(c) = 9c*2 - 6c - 6. Let y(n) be the second derivative of -13n4/6 + 17n*3/6 + 17n*2/2 + 10n. Calculate rp(x) + 6y(x). -3x2 Let o(v) = 6v + 1. Let l(t) = t. Suppose -2n = -5f + 21, -4f + 7f + 4n = -3. Suppose 0y = -3y - f. Determine yo(c) + 5l(c). -c - 1 Let c(a) = -6a + 3. Let l(i) = 5i - 4. Calculate 5c(r) + 4l(r). -10r - 1 Let t(k) = 2k2 + 5k + 3. Let a(g) = g*2 - 12g + 16. Let x be a(11). Let w(b) = -2b2 - 6b - 4. Give xw(c) + 6t(c). 2c2 - 2 Let k(y) = 2y3. Let f(i) = i3. Suppose 6j = -3j + 99. Determine jf(n) - 4k(n). 3n3 Suppose 5a = 2v - 0 - 16, -5v - a = -13. Let j(t) = 5 - 4t - 2t*3 - 2t*v - 5t*2 + 2t3. Let f(p) = -p2 - p + 1. Calculate -4f(k) + j(k). -2k3 - k2 + 1 Let q(t) = t*2 + 7t + 3. Let n be q(-7). Suppose 5b = -33 + n. Let d(f) = -8f + 2. Let y(h) = 7h - 2. What is by(w) - 5d(w)? -2w + 2 Let i(m) = -9m2 - 11m. Suppose v - 11 = -0v. Let h(w) = 5w*2 + 6w. Determine vh(d) + 6i(d). d*2 Let u(a) = 2a*2 + 6a + 25. Let f(d) = -d*2 - 4d - 17. Determine 7f(n) + 5u(n). 3n2 + 2n + 6 Let x(u) = 5u - 10. Let h be x(3). Let m(j) = -1. Let i(g) = -g - 3. Determine hm(s) - i(s). s - 2 Let f(d) be the first derivative of -3/2d4 + 2d*2 - 5d + 5/3d3 - 3. Let x(r) = -7r*3 + 6r*2 + 5r - 6. Give -6f(q) + 5x(q). q*3 + q Let i(f) = -4. Suppose -5z - 22 = -2. Let h(v) = v*2 - 11. What is zh(t) + 11i(t)? -4t*2 Suppose 0 = 3l + 2 - 8. Let m(k) = -4k3 - k2. Let z(b) = -b3 - b2. Calculate lz(n) - m(n). 2n3 - n2 Let k = 2 + 15. Let b(u) = 5u - 2. Suppose -6 = -0g - g. Let d(s) = 10s + 3 - 24s + 3. Determine gd(m) + kb(m). m + 2 Let f(q) = 60q*3 - 12q*2. Let r(g) = 24g*3 - 5g**2. Calcu	{ "pile_set_name": "DM Mathematics" }
l) + 6l - 2l - 3l + (l - 4l + 5l)(3 + 1 - 5). -3l Expand (-10v + 4v + 4v)((3v*3 + 3v*3 - 4v*3)(0v + 0v + v) + 0v4 + 3v*4 - 6v*4) - 2v - v*5 + 2v. v*5 Expand (4 - 2f*3 - 4 + (2f*2 + 0f*2 + 0f*2)(-f - 2f + 2f))(2 + 1 - 5) + (-f - f + 3f)(f2 - 3f*2 + 3f*2). 9f*3 Expand -2x*4 + 5x*4 - 5x*4 + (2x + 3 - 3)(2x*3 + x - x) + 0x4 + x4 - 2x4 + x2 - x2 + x4 - 10x*2 + 11x*2 + 4x4 - x4. 5x4 + x2 Expand (3 + 0 + 0)(3n - 3n - 2n) + 0n - 12n - 29 + 30. -18n + 1 Expand 5b3 - 2b*3 - 5b*3 + (-4b + 6b + 2 - 1)(10b2 + 10 - 10). 18b*3 + 10b*2 Expand (64 - 41 - 32)(3a + 0a - 5a). 18a Expand (-3r3 - 3r*3 + 2r*3)(-r + r + 3r2). -12r*5 Expand (13 + 0 + 0)(-3j + 4j + j). 26j Expand -2 - 1 - 4u + 1 + (-2 + 2 - 2u)(-1 + 3 - 3). -2u - 2 Expand -6l*4 + 13l*4 - 9l*4 + (0l*2 - 2l*2 + 0l*2)(l2 + l2 - l*2). -4l*4 Expand (-4l + 2l + 4l)(3 - 6 + 1) - 2l + 2l - 9l. -13l Expand (-4a*2 + 2a2 + a2)(2a*2 + 0a + 0a) - 2a3 + a4 + 2a3 + (-5 + 2 + 2)(-2a4 - a + a) - 3a*4 + 2a*4 - 5a*4. -5a*4 Expand (-5k*2 + 0k*2 + 3k*2)(-2 + 5 - 2k - 1) - 6k*3 - 2k*3 + 2k*3. -2k*3 - 4k*2 Expand (5z - 5z + z3)(0z - 3z + 5z - z - 2z + z + 2z + 2z - 2z + (-z + z - 2z)(-1 + 1 - 2) + 2 - 2 + z)(3z + 3z - 2z). 28z*5 Expand (s + 4s - 3s)(s*2 + 3 - 3)(4s + 3s - 5s). 4s*4 Expand (-1 + 7 - 2)(z - 2z + 2z)(4z - 3z2 - 4z). -12z3 Expand (5x2 + x2 - 2x2)(-5x + 2x - 6x + 2 - 2 - 2x + (0 + 0 - x)(4 - 6 + 1) + 2 - x - 2 - x + 3x + 0x). -36x*3 Expand (40v + 45v - 46v)(1 + v - 1). 39v*2 Expand (y - 3 + 3)(1 + 5 - 5 + (-2 + 4 + 0)(-3 + 1 + 1) + 3 + 1 - 6 + 1 + 0 - 3). -5y Expand (g + g - 4g)(2g + 2 - 2) + 2 + 2g*2 - 2. -2g*2 Expand 3c2 + c2 - 2c2 + (2 - 5 + 0)(-c2 - c2 + 0c2) + 0c*2 + 0c*2 - 2c*2 + 4c - 4c + 2c*2. 8c*2 Expand (0r + 7r + 5r)(4 - 2 + 1 + (-1 - 3 + 6)(5 - 3 + 0)). 84r Expand 28b*4 + 12b*2 - 12b2 + (-b3 + 1 - 1)(2 - 2 - 3b) + (-2b + 6b - 3b)(0b2 + 2b*3 + 0b*2). 33b*4 Expand (1 + 0 - 3)(p*4 - 4p*4 - 4p*4). 14p*4 Expand (0t2 - t4 + 0t2 + (-7t*2 + 45 - 45)(0 + 0 - t*2))(3 + 2 - 4). 6t4 Expand (8i + 2 - 6i + 3i)(-4i*3 + 2i*3 + 0i*3). -10i*4 - 4i*3 Expand (-7l*4 + 55l*4 + 50l*4 + 20l*4)(2l - l + 0l). 118l5 Expand -w4 + 0w*4 + 3w4 - w4 + 0w4 + 2w4 + (-w3 + 3w2 - 3w*2)(5 - 2w - 5) + 47w*4 - 237w + 237w. 52w*4 Expand -104p*4 + 164p*5 + 19p*4 - 163p*5 + 2p*5 - 3p*5 + 3p5 + (-p2 - p*2 + 3p*2)(2p3 - 5p*3 + 2p*3). 2p*5 - 85p*4 Expand 5t - t - 2t + (-4 - t + 4)(-2 + 0 + 1) + (0t + 6t - 4t)(3 + 4 - 1). 15t Expand (5 - 4 + 0)((c - 2c + 2c)(2 - 3 + 0) + 0c - c - 5c + 0 + 0 - c). -8c Expand (-4k - k + 3k - 3 + 3 - 2k + (-1 + 1 - 2)(-k + 2k + k) + k - 1 + 1)(-4 + 4 + 1) + (0 - 1 + 2)(4k - 2k + 0k). -5k Expand -3i + 2i + 3i + (4 + 1 - 3)(0i + i + 2i + (-3i + 0i + 2i)(-4 + 5 + 0)). 6i Expand (-3b4 + 0b + 0b - 2b)(5b - 2b - 4b). 3b5 + 2b*2 Expand 6j + 0j + 0 + 1 + (-3 - 2 + 3)(j - 3j + j) - j + j + 2j. 10j + 1 Expand 3 - 3r*4 - 3 + (2r - 3r3 + 0r*3 + 0r)(4r + 0r - r). -12r*4 + 6r*2 Expand -2s*2 + 2s2 - s2 + (-4s2 + 7s*2 + 4s*2)(-4 + 2 + 0). -15s2 Expand (-3x + 0x + 2x)(0 + 5 - 4)(-4x - 3x + 10x). -3x*2 Expand ((2k - k + 0k)(-1 - 4 + 3) + 0k - k - k + 3k - 1 + 1)(-7k*2 + 2k*2 + 3k*2). 2k*3 Expand (-2 + 2 + 2o*4)(0o + 2o - 4o) + (-2 + o3 + 2)(5o2 + 0o*2 - 4o*2). -3o*5 Expand (-6 - 3b + 6)(3b - 2b - 2b + (3 + 3 - 4)(-4b + b + b) + 5b - 2b - 4b). 18b*2 Expand (1 - d - 1)(7d - 10d - 6d) + 0d*2 + 2d*2 + 0d*2 - 2 + 2 - 2d2 - d2 - 2d2 + d2 - 3 + 3 + d2 + (-2d*2 + 0 + 0)(2 - 3 - 1). 12d2 Expand (-1 - x3 + 1)(-11x2 - x2 + 7x*2). 5x*5 Expand (-2 - 2 + 5)(-2x - 2x*2 + 2x) - 194x2 + 78x*2 + 7x - 7x. -118x*2 Expand (2y + 2y2 - 2y)(-4 + 4 + 2y*2) - 65y*4 - 71y*4 + 147y*4. 15y*4 Expand (-1 - 6i + 14i + 5i)(3 - 2 + 1). 26i - 2 Expand (-2s + 0s + 2 + s)(0 - 4 + 1 + (0 - 4 + 2)(0 + 1 + 1) - 4 + 2 + 0 + 5 + 0 - 4). 8s - 16 Expand -42h*4 - 42h + 42h - 3h*4 + 0h*4 + 2h4 + (0 + 0 + h2)(0 + 0 + 2h*2). -41h*4 Expand (0v - 3v + v)((2 + 1 - 5)(3 - 4 + 0) - 34 - 3 + 9). 52v Expand (-3 + 8 + 0)(0m - m + 2m)(-m - 2m + 5m). 10m2 Expand -26r*5 - 6r*5 + 3r*5 + (-1 - 1 + 4)(-2r3 + 2r3 + r5). -27r5 Expand 12m*2 - 8 + 8 + (3 + 2m*2 - 3)(4 - 2 + 0) + 2m + m2 - 2m. 17m2 Expand (-4x + 0x + x)(1 + 4 + 6). -33x Expand (-119 + 119 + 2c)(-2c*2 + 2c2 - c2). -2c3 Expand -3o*5 + 11o*5 + 6o*5 - 1 + 1 - 2o5 - o + o5 + o + (0o2 + 4o*2 - 6o*2)(-o*3 - 2o3 + o3). 17o5 Expand -3g*2 + 3g2 + g3 + (-4g + 4g + g*2)(5g - 2g - g) - 11g3 - 22g*3 + 2g*3. -28g*3 Expand (4r - 2r - 6r)(3 + r3 + 7r*2 - 7r*2 + 2r*4). -8r*5 - 4r*4 - 12r Expand (2z + 0z*3 + 4z*3 + 4z*3)(1 + 0 - 2). -8z3 - 2z Expand 2h2 - h2 + 0h*2 + (2 + h - 2)(-3h + 2h - 4h). -4h*2 Expand (-3r + 2r + 2r)(1 - 2r - 1) - r + r - r*2 + (2r - r + r)(-r + 0r - r). -7r2 Expand b - b + 2b5 + (-b4 + 3b4 - 4b*4)(-1 - b + 1) + 2b4 - 2b*4 + 2b*5. 6b*5 Expand (-1 + 3 + 0)(k + 5k - 4k) + 0k - 4k + 5k + 4k + 0k + 4 - 2k. 7k + 4 Expand 4g*4 - 2g*5 - 4g*4 + 3g*5 - 5g5 - g5 + (0g3 - g4 + 0g*3)(-g + 8g - 3g). -9g5 Expand (33 - 12 + 5)(0q + 0q - q) + (-q + q - 2q)(-2 + 2 + 2) - 2q - q + 2q. -31q Expand (1 + 5 - 1)(-r - 2 + 2) + (2r + 0r - r)(-4 + 5 - 3). -7r Expand -5r - r + 2r - r - 2r + 2r + 2r + 0r - r + (1 - 4 + 2)(4r + 0r - 2r) + 2 - r - 2 - 12r - 7 + 4r + 8. -15r + 1 Expand (-a + a + 6a)(-5 + 5 - 7a). -42a2 Expand (-1 + 4 + 0)(-4g5 - g5 + 4g5) + g5 - 2 + 2. -2g5 Expand (2p + 15p + 8p)(1 - 3 + 1) - 2p + 1 - 1. -27p Expand 3v*3 + 13v - 13v + (0v + 2v - v)(-9v2 + 3v2 + v2). -2v3 Expand (0r - 3r + 2r)(2r - 3r + r3 + r3). -2r4 + r2 Expand 13z5 - 10z*3 + 10z3 + (0 + 0 + z3)(2z*2 - 2 + 2) - 4z*4 + 4z*4 + 2z*5. 17z*5 Expand -3m*3 + 0m*3 + 2m*3 + (65m - 14m2 - 65m)(-m + 3m - m) + 4m3 + 3m*3 - 5m*3. -13m3 Expand -t2 + 2t2 + 3t*3 - 5t*3 - 1 + (2t*3 + 0t + 0t)(-2 + 0 + 5) + 4t3 - 3t*3 - 2t*3. 3t3 + t2 - 1 Expand -z + 3z + 8z + (-4z + 3z + 3z)(-2 + 0 + 4). 14z Expand (2 + 3 - 4)(0t + 3t - t)(4 + 6 - 4). 12t Expand ((-2 + 0 + 4)(c - 4c + 4c) - 2c + 5c - 2c)(c2 + 3c*2 - 5c*2). -3c*3 Expand (17 - 13 - 7)(-2a3 + 3 + 4a3 - a3). -3a3 - 9 Expand (-2g*3 - 3g*3 + 4g*3)(-12g - 14g + 7g) - g4 + g4 - 2g*4 + (3g*3 - 6g*3 + 4g*3)(5g - 2g - 5g). 15g*4 Expand (-6 - 5 + 9)(9 - 9 + 4m). -8m Expand (-4n2 - 2n*2 + 5n*2 + (-2n*2 - 4n*2 + 7n*2)(0 + 1 - 3))(-1 + 0 + 4). -9n*2 Expand (-2 + 2 + z)(9 - 9 + 6z)(-5z2 + z2 + 2z*2). -12z*4 Expand (0 - 3 - 2)(-2c + 6c + 2c + (-2c + 3c - 2c)(-5 + 1 + 3)). -35c Expand (0 - 2q2 + 0 + 17 + 3q*2 - 17 + (-3q - 3q + 7q)(-2q + 2 - 2))(3 + 0 - 1). -2q*2 Expand -5m*4 + 10m*3 - 10m*3 + (3m*3 - 2m*3 + 0m*3)(-3m + m + 3m). -4m4 Expand 0 - k3 + 0 + (k - 1 + 1)(-2k2 + 3k*2 + 0k*2) - 2 + 2 + 2k3 + k3 - 5k - 2 + 4k + 3k. 3k*3 + 2k - 2 Expand (-3i + 4i - 2i)(4 - 4 - 1)(-8i - 2i - i). -11i*2 Expand (-1 + 1 - b)(9b2 - b2 + 3b*2). -11b*3 Expand (-25l + 12l - 14l)(2l*2 - 1 + 1). -54l*3 Expand -x + 1 + 3x - x + (0 - 5 + 3)(-4x + 5x + 0x). -x + 1 Expand (-4n + 0 + 0 + (-4 + 0 + 5)(-n + 5n - 2n))(-6n + 0n + 4n + (-3 + 6 - 1)(9 - 9 + 2n)). -4n2 Expand (-14w*2 - 6w + 11w2 - 4w)(-5 - w + 5). 3w*3 + 10w*2 Expand (2 + 4 - 4)(-3o + 0o + 5o) - 2 + 2 + 2o + 3o - o + 0o + o + 5 - 2 -	{ "pile_set_name": "DM Mathematics" }
1, l: 2}. 1/10 Calculate prob of picking 3 t when three letters picked without replacement from ilimittlidpiititm. 1/170 Two letters picked without replacement from {n: 4, y: 4, u: 3, s: 4, h: 1, x: 1}. Give prob of picking 1 x and 1 h. 1/136 What is prob of picking 1 n, 1 u, and 1 q when three letters picked without replacement from {n: 7, u: 2, q: 6}? 12/65 Four letters picked without replacement from secommmesmcmmeceee. What is prob of picking 2 c, 1 m, and 1 o? 1/170 Three letters picked without replacement from {t: 3, i: 1, a: 1, s: 5, m: 2}. Give prob of picking 1 m and 2 s. 1/11 Two letters picked without replacement from bttbhohcp. Give prob of picking 1 c and 1 h. 1/18 Calculate prob of picking 2 z, 1 d, and 1 l when four letters picked without replacement from {z: 2, s: 4, d: 1, l: 1, b: 1}. 1/126 Two letters picked without replacement from {l: 3, y: 5, v: 1, b: 3}. Give prob of picking 1 l and 1 b. 3/22 Two letters picked without replacement from muuurwrmurwmuruumm. Give prob of picking 2 u. 7/51 Four letters picked without replacement from rbsrberrrbbrrrr. What is prob of picking 2 b, 1 s, and 1 r? 18/455 Two letters picked without replacement from ooooooeooonoemooo. Give prob of picking 2 o. 39/68 Three letters picked without replacement from jjjjijjiijjjjjj. Give prob of picking 3 j. 44/91 What is prob of picking 1 n and 1 g when two letters picked without replacement from mfffarmffmfgfmfn? 1/120 Calculate prob of picking 1 l and 1 h when two letters picked without replacement from rlhblbcbblclbbbbbl. 5/153 What is prob of picking 1 k and 1 h when two letters picked without replacement from {e: 1, h: 3, m: 5, k: 3}? 3/22 Calculate prob of picking 4 h when four letters picked without replacement from qhhhhqhhqhhhhqhqhhh. 1001/3876 What is prob of picking 1 x and 1 v when two letters picked without replacement from egfggxeggegelegevgxg? 1/95 Calculate prob of picking 3 n and 1 c when four letters picked without replacement from lnlwlnlncllclclcllw. 1/969 Calculate prob of picking 1 h and 3 c when four letters picked without replacement from hhvhbchvvcbbvvcb. 1/455 What is prob of picking 1 y, 2 b, and 1 z when four letters picked without replacement from ddbzjzyjjbzdf? 3/715 Four letters picked without replacement from {s: 2, v: 7, i: 9}. Give prob of picking 4 i. 7/170 Calculate prob of picking 1 i and 1 b when two letters picked without replacement from eiseoieeoeebbgi. 2/35 Calculate prob of picking 2 l and 1 m when three letters picked without replacement from {e: 1, z: 8, u: 1, l: 2, i: 1, m: 3}. 3/560 What is prob of picking 1 o, 1 e, and 1 v when three letters picked without replacement from {o: 2, a: 2, n: 1, v: 2, u: 1, e: 4}? 4/55 What is prob of picking 2 l when two letters picked without replacement from lylrrx? 1/15 Two letters picked without replacement from {l: 2, y: 3, p: 2, q: 2, c: 4}. Give prob of picking 2 q. 1/78 What is prob of picking 2 k when two letters picked without replacement from ktkttkkttt? 2/15 Two letters picked without replacement from {b: 4, q: 7}. What is prob of picking 1 q and 1 b? 28/55 Two letters picked without replacement from {f: 1, x: 7, r: 1}. Give prob of picking 1 x and 1 f. 7/36 Three letters picked without replacement from {v: 1, i: 3}. Give prob of picking 1 i and 2 v. 0 Calculate prob of picking 1 k, 1 p, and 2 q when four letters picked without replacement from qpvfqppppppqkv. 3/143 What is prob of picking 1 b and 1 h when two letters picked without replacement from {h: 8, l: 1, o: 7, b: 4}? 16/95 Calculate prob of picking 2 k, 1 o, and 1 v when four letters picked without replacement from pvvkqqopkvov. 8/495 Three letters picked without replacement from {h: 1, m: 4, z: 3, x: 1, y: 7, l: 2}. Give prob of picking 1 h, 1 x, and 1 m. 1/204 Two letters picked without replacement from bjkjqjbj. Give prob of picking 1 b and 1 k. 1/14 Two letters picked without replacement from wwzzwzwrwz. What is prob of picking 1 w and 1 z? 4/9 What is prob of picking 2 b when two letters picked without replacement from iiibiidibiiiibi? 1/35 Two letters picked without replacement from ytttttytytt. What is prob of picking 1 t and 1 y? 24/55 Three letters picked without replacement from {q: 1, i: 14, y: 1}. What is prob of picking 1 i, 1 y, and 1 q? 1/40 Two letters picked without replacement from {o: 13, t: 3}. Give prob of picking 1 o and 1 t. 13/40 Calculate prob of picking 1 k and 1 m when two letters picked without replacement from kokmkmykrrrryy. 8/91 Calculate prob of picking 1 a and 1 g when two letters picked without replacement from xxxxxpxgxnxgguxaxxx. 1/57 What is prob of picking 1 s, 2 d, and 1 a when four letters picked without replacement from {a: 1, h: 2, v: 3, u: 1, d: 2, s: 3}? 1/165 Two letters picked without replacement from deeeeeeedeedeeeeee. Give prob of picking 2 e. 35/51 What is prob of picking 1 w and 2 g when three letters picked without replacement from gwwwwwwwwg? 1/15 What is prob of picking 1 e, 1 n, 1 c, and 1 j when four letters picked without replacement from {c: 2, e: 6, n: 1, j: 2}? 4/55 Four letters picked without replacement from hhkhkhk. What is prob of picking 3 h and 1 k? 12/35 Two letters picked without replacement from kxkxkxdxxkvxxhd. Give prob of picking 1 x and 1 d. 2/15 Three letters picked without replacement from uusbusubs. What is prob of picking 1 b and 2 u? 1/7 Calculate prob of picking 3 x when three letters picked without replacement from xxxx. 1 Calculate prob of picking 1 b and 1 h when two letters picked without replacement from {e: 1, l: 10, b: 4, h: 5}. 2/19 Calculate prob of picking 1 w and 2 g when three letters picked without replacement from wwwgggwwwgw. 14/55 Two letters picked without replacement from pqpqqqqxpqp. Give prob of picking 2 p. 6/55 Four letters picked without replacement from aasmaam. Give prob of picking 2 m, 1 a, and 1 s. 4/35 Four letters picked without replacement from {p: 3, f: 1, n: 6, y: 1, e: 1}. Give prob of picking 1 p, 2 n, and 1 f. 1/11 What is prob of picking 1 i and 1 g when two letters picked without replacement from mpjippg? 1/21 Two letters picked without replacement from aqaqaa. What is prob of picking 2 a? 2/5 What is prob of picking 2 a when two letters picked without replacement from aqaqant? 1/7 Two letters picked without replacement from {u: 1, x: 1, j: 1, v: 1, m: 1}. Give prob of picking 1 u and 1 v. 1/10 What is prob of picking 1 z and 1 a when two letters picked without replacement from {z: 2, r: 2, w: 1, a: 1, g: 1, x: 1}? 1/14 Three letters picked without replacement from hhcchhhchccnhhhhchc. What is prob of picking 2 c and 1 n? 7/323 What is prob of picking 1 u and 3 t when four letters picked without replacement from {l: 1, t: 3, u: 1, f: 3, g: 6, x: 3}? 1/2380 Four letters picked without replacement from {e: 3, v: 2, f: 7}. Give prob of picking 2 f and 2 v. 7/165 Four letters picked without replacement from ulllgllgaluallul. What is prob of picking 1 g, 1 u, and 2 l? 54/455 What is prob of picking 1 a and 1 e when two letters picked without replacement from eeejajeeaeejjjj? 2/15 Four letters picked without replacement from ddddjdjjjjjjjj. What is prob of picking 4 j? 18/143 What is prob of picking 1 p and 1 s when two letters picked without replacement from ltslxssspltztl? 4/91 What is prob of picking 1 l, 2 c, and 1 y when four letters picked without replacement from {y: 2, c: 2, w: 1, l: 1}? 2/15 Calculate prob of picking 2 b and 2 f when four letters picked without replacement from {f: 2, b: 2, u: 2, t: 4, k: 8, s: 1}. 1/3876 What is prob of picking 2 w, 1 q, and 1 n when four letters picked without replacement from {n: 2, r: 1, j: 2, w: 2, q: 1}? 1/35 Four letters picked without replacement from {f: 3, d: 3}. What is prob of picking 2 d and 2 f? 3/5 What is prob of picking 1 m and 1 n when two letters picked without replacement from {n: 4, i: 9, m: 4}? 2/17 Calculate prob of picking 2 s and 1 f when three letters picked without replacement from ffsfdshshdshmsmsdh. 15/272 What is prob of picking 1 k and 1 p when two letters picked without replacement from {o: 1, i: 2, f: 1, k: 3, p: 3, j: 1}? 9/55 Four letters picked without replacement from {k: 6, m: 1, j: 4, t: 1, p: 1}. Give prob of p	{ "pile_set_name": "DM Mathematics" }
11j + v = 0. Is j composite? True Let y(h) = 178h*2 - 19h + 107. Is y(10) a prime number? False Let k = 20 + -14. Suppose 2f + k = 2r, f - 9 = -3r + 2f. Suppose 0 = -ro + b + 541, 0 = -2o + 5o - 2b - 545. Is o composite? False Suppose 0 = 9r - 0r + 7398. Let z = -587 - r. Is z composite? True Suppose -5v = 5w - 2255, 28 - 924 = -2w - 4v. Let y = w - 251. Is y a composite number? True Let p = 1225 + -348. Is p prime? True Suppose 27k - 29k + 1320 = 0. Suppose -79 = x + 372. Let s = x + k. Is s composite? True Suppose 0 = 2s + 3o - 1 - 2, -4o - 16 = -4s. Suppose 0 = sn + 2n - 1515. Is n a composite number? True Is -7 + 123852/3 prime? True Let q(w) = 54w + 12. Let k be q(-7). Let l = k - -659. Is l a prime number? True Let l = 34902 + -24805. Is l prime? False Let j(r) = 125r2 + 8 + 2r - 6r - 3 + 0r. Is j(-6) a prime number? False Let c(h) = 6h2 - h + 4. Let i = 58 + -64. Is c(i) a prime number? False Let h be (-3876)/(-24)(40 + -2). Suppose 0 = 13i - 6330 - h. Is i composite? True Suppose 0 = -4w - 5z + 37, 3w = 4z + 20 - 0. Suppose 0 = 5v - 5k - 65, -v - v = 4k - w. Suppose -vm = -11m + 10. Is m composite? True Suppose 24p - 22p = -6c + 4430, 4c = -5p + 11097. Is p composite? False Suppose -4t + 1942 = -5g, -3t + 2432 = 2t - 4g. Suppose 5c = 2c + 5k + t, 5c + 5k = 800. Is c prime? False Let r = -17 + 24. Suppose -rq + 3q - 3160 = 0. Let o = 1111 + q. Is o a composite number? True Is (8059(-6 + 4))/(2-1) composite? False Is (-5)/(((-16)/(-4))/(-6332)) a prime number? False Let h = -24 + 26. Suppose y - 3k + 6k = 156, -hy + k + 277 = 0. Let r = y + -8. Is r composite? True Let x(z) = z3 + z2 + z - 1. Let c(h) = -390h3 - 5h*2 + 9. Let i(v) = c(v) + 4x(v). Is i(-1) a prime number? False Suppose -5x + 2p + 45463 = 0, -728 = -x - 5p + 8343. Is x composite? False Let z be -5(-3 - 44/(-20)). Suppose 0 = 5f + zf - 7659. Is f a composite number? True Suppose -3 = -4z - 15. Suppose 0 = -2r - 83 - 137. Is (2 - 3)(r + z) prime? True Let b = -5993 + 13994. Suppose -b = -c - 8c. Is c composite? True Let w = 1047 + -405. Suppose -29j + 26j + w = 0. Suppose -2y = 2d - j, 5y - 198 - 341 = -3d. Is y prime? True Let b(v) = v*3 - 4v*2 + v - 2. Suppose -4a = 8, -2s + 2 = 5a + 4. Let f be b(s). Suppose 3o - fu = -6u + 171, -3u + 9 = 0. Is o composite? False Let m(w) = -2w3 + 11w*2 - 21w + 11. Let o be m(6). Suppose 4n - n = -3y, -2n - 5y = -6. Is (0 + (o - n))/(-1) a composite number? False Suppose 30023 = 3y + j, 20y - 5j + 50045 = 25y. Is y composite? False Let n = 346 + 581. Suppose 0 = -r - 5x + 297, 3r = 2x + x + n. Is r composite? False Let r = -3175 - -4456. Suppose h - 225 = r. Suppose -4p = -10p + h. Is p composite? False Let n be ((-2)/6 - -1)3. Suppose 3t = -nt + 80. Suppose 17o = to + 85. Is o composite? True Suppose -13l + 8607 = -46006. Is l composite? False Let l = 1 + -2. Let i be (2 + (0 - 3))l. Is ((2 - i)-37)/(-1) a prime number? True Let c(o) = 1358o - 19. Let l(t) = -679t + 9. Let x(u) = 6c(u) + 13l(u). Is x(-2) a prime number? True Let k be 99/222/3. Suppose -165 = kc + 159. Let i = c - -191. Is i a prime number? True Let d = 41 - 39. Is d + (-16)/7 - (-43734)/42 composite? True Let m(p) = p3 + 13p*2 + p + 10. Let b be m(-13). Let n be b/((-3)/19 - 0). Is (-41 + 3)/((-2)/n) a composite number? True Let s be (-2)/(-4)(12 - -16). Let a(i) = 4i2 + 5i + 5. Is a(s) composite? False Suppose -7p + 2p - 1955 = -5z, 0 = 5z + p - 1955. Is z composite? True Suppose 5h + 5x + 5 = 0, h = -4x - 17 + 1. Is (-8031)/(-15) + h/(-10) a composite number? True Suppose 0 = i - 10 - 9. Let c = i - 14. Suppose -4a - 583 = -ca. Is a a composite number? True Suppose m = -2m + 15. Suppose n - m = -2. Suppose nd + 2c - 481 = 0, -d + 4d - 476 = -c. Is d prime? True Suppose 194 = 32b - 222. Is b composite? False Suppose 19284 = 4k + 2j, k + 19284 = 5k - 2j. Is k prime? False Suppose 0 = 3h - 1 - 5. Suppose -189 = -4p - 4f + 35, -p = hf - 59. Suppose -p = -2z + 53. Is z a composite number? False Suppose -4u + 20 = -0u. Suppose -x + f = 2, -ux + 3f = -0f. Let s = 148 - x. Is s a prime number? False Let q be ((-19 + 4)/5)/1. Let y = -43 - q. Let x = 123 - y. Is x prime? True Suppose -141999 = -5b - c, 0 = -4c + 21 - 5. Is b composite? True Is 15732/20 + ((-16)/20)/(-2) prime? True Suppose 9 = 6w + 81. Is (20/w + 2)537 a prime number? True Is (51/1)/(-2 - (-2516)/1252) prime? False Let i = 12925 + -3264. Is i prime? True Let h(q) = -34q2 - 10q + 24. Let r be h(2). Let o be (-289)/(-2)(0 - -2). Let w = r + o. Is w a prime number? True Is (-38)/(-209) + (-47230)/(-22) a composite number? True Let s(d) = -203d - 6. Is s(-13) composite? False Let v = 35 - 45. Let q = v - -10. Suppose q = 23b - 19b - 1016. Is b composite? True Let k(i) = 2i2 - i - 15. Let r be k(-6). Suppose 5v - r = 212. Is v composite? True Let i(y) = y - 1. Let g(o) = o*2 + 10o - 6. Let w(s) = -g(s) + 6i(s). Let h be w(-2). Is ((-12)/(-3))/h - -38 composite? True Is (26 + -186382)(-4)/16 a composite number? False Suppose u + 11 = -4d, 3d = 3u - 7u - 5. Let s(a) = 6a3 - a2 - a + 1. Let k be s(u). Suppose 4j - 426 = -2g - 92, kj + 153 = g. Is g prime? True Let a be (3 - 85/15)156. Let z = a - -1197. Is z composite? True Let i(y) = -173y + 2. Let x be 2/(((-6)/(-8))/3). Let d be i(x). Is 1(-3)/(6/d) composite? False Let o(a) = -3a - 5. Let z be o(-3). Suppose r = zh - r - 14, 5r + 11 = 4h. Suppose -3b - 3i + 130 = -296, 3b = -hi + 423. Is b a prime number? False Let b = -3035 + 5868. Is b composite? False Let o = 42 + -46. Is (o + 7)-1141/(-9) a composite number? False Let c(n) = -n + 7. Suppose -8 - 22 = -3q + 5f, 0 = -2q - 4f - 2. Let l be c(q). Suppose -lr - 97 = -3r. Is r a composite number? False Suppose -2 = -2o + 2. Suppose -41 = -ok + 641. Is k composite? True Let h be 1774 - 5/((-10)/4). Is h/322/3 a composite number? False Let z(u) = -59u2 - u + 1. Let w = -16 + 17. Let f be z(w). Is f/(-1 + (-1 - -1)) prime? True Let l(r) = -3903r + 146. Is l(-5) prime? True Let b = -8 - -11. Suppose -3n + 3o - 615 = 0, b = -3o - 0o. Is (n/(-5))/(1/5) composite? True Let r be -6(1 + (2 - 4)). Let c = r + 0. Let n(v) = 31v*2 + 2v - 13. Is n(c) a composite number? True Let j(x) = -2x + 43. Let i be j(19). Suppose -3t = 4h - t - 48, ih = 5t + 90. Is h a composite number? True Suppose -2y + 60214 = -2a - 67822, -320125 = -5y - 2a. Is y a composite number? True Let l be (-964)/(-7) - 2/(-7). Suppose -6 = -4f + 2f. Suppose 4b + 9 = -v + l, fv + 5b = 408. Is v composite? True Let k(d) = -2818d3 - 14d*2 - 15d. Is k(-1) a prime number? True Let r(y) = 7y2 - 93y + 35. Is r(24) a prime number? False Let f(y) = -y*2 - 2y - 4. Let t be f(-5). Suppose -24p + 770 = -598. Let o = t + p. Is o prime? False Suppose 4a + 3c = 5633 + 5098, -3 = -3c. Let j = a - 1639. Is j composite? True Let g(a) be the first derivative of -a*3/3 + 11a*2/2 - 7a - 1. Suppose 5z + 2 = 52. Is g(z) composite? False Let g(f) = 2f3 + f + 1087. Is g(0) composite? False Is (-43596)/(-20) + (-84)/105 prime? True Let g(v) = v - 8. Let h(y) = y3 + 7y2 - 11y - 12. Let d be h(-8). Let s be g(d). Is ((-2)/s)/(1/(-254)) a composite number? False Let o(x) = -54x - 5. Let t(n) = 54n + 5. Let y(v) = 6o(v) + 5t(v). Let l = -20 - -13. Is y(l) a prime number? True Is 6802 + (-5 - -6) a composite number? False Let l = -29 + 11. Let b = 9 + l. Is (6/(-4))/(b/3846) a composite number? False Let y(c) be the first derivative of -37c*2/2 + 11c + 14. Let q be y(-8). Suppose 2v + 3v + 3f - q = 0, -5f + 305 = 5v. Is v a composite number? True Let p(j) = j3 - 27j*2 - 12j + 28. Let i be p(26). Let b = 3762 + -2264. Let l = i + b. Is l composite? True Let j be 20/6-329. Let x = 92 - j. Is x prime? False Let n(h) = h*3 - 19h*2 + 12h + 1. Let a(o) = -4o3 + 58o*2 - 36o - 2. Let s(p) = -2a(p) - 7n(p). Is s(-8) composite? True Let q = 10427 + -1174. Is q a prime number? False Let b(s) = s*2 + 8s - 1. Let x be b(-5). Let f(n) = n + 19. Let i be f(x). Suppose -m + i = -256. Is m	{ "pile_set_name": "DM Mathematics" }
. Let b = 35/2 + z. Which is bigger: r or b? b Suppose -4l + 5u + 38 = 0, l + 6u - 3u = 18. Let h be (-20)/18 - 8/l. Let g = h - -41/18. Are g and 0 nonequal? True Let y = 237.31 + -207.7. Let f = -31.6 + y. Let q = 0.01 - f. Is 1 at least as big as q? False Let a = -25 - -223/9. Let z(w) be the second derivative of -w5/20 - w4/4 + 5w3/6 + 5w*2/2 + w. Let i be z(-4). Are i and a equal? False Suppose 5w + 2r = 98, -w + 40 = 4r + 6. Let j = -9 + 28. Are j and w non-equal? True Suppose -4f = -f - 12. Suppose 3i - 4 + 3 = y, fi = 3y - 2. Suppose -3k + 3 + 2 = 2c, yk - 5c + 22 = 0. Is 2/13 smaller than k? False Let t be 4/(-1)12/80. Let w be (6 - 0)(-2)/4. Let l = -5 - w. Is t at least as big as l? True Let d = 0.03 + -0.43. Let k = -0.99 + 1. Let g = k - -0.09. Is d at least as big as g? False Let q(u) = u*2 + 7u - 9. Let v be q(-9). Let d be (2 - 1)/((-3)/v). Is d less than or equal to -5? False Let i be 2/5 + 0/1. Suppose 0 = -2s + 3r - 37, 0 = -2s - s + 4r - 53. Let k = -11 - s. Which is greater: k or i? i Let x be (-4)/18 - (-17)/9. Let i be -2 + 222/36 - (1 - -2). Let g = x - i. Which is greater: g or 0? g Let f = -4134 + 70320/17. Which is bigger: 3 or f? 3 Suppose 10 = 13s + 23. Which is smaller: -7/3 or s? -7/3 Suppose -3s = 2s. Let f(z) = z + 7. Let j be f(s). Suppose -4b - 5 = j. Are -3/2 and b nonequal? True Let t be 151/(-680) - 7/(-35). Let f = 251/952 - t. Which is smaller: 0 or f? 0 Suppose 0g - 3 = 3g, 2g + 3 = -k. Is 5 less than k? False Suppose 7 = -5z - 3. Let d be z/4 + 87/6. Suppose b + 3a + 14 = -0a, -3b - d = 2a. Which is smaller: b or 1? b Let a be (-1)/(-4) + 2/(-8). Suppose -4i = -c - 63, -c + 0c = 4i - 57. Let q = i + -16. Which is greater: q or a? a Suppose 4x - 2y = -8 - 2, -x = -5y + 25. Let h = x - -3. Let n = -4 + 3. Which is smaller: h or n? n Let w = 6 - 5.96. Let q = w + -0.09. Is -1 at most as big as q? True Let z = -0.96 - 0.04. Which is smaller: 2/57 or z? z Let y = 6 + 6. Is 12 at least y? True Let m be (1/10)/(26/195). Does m = -9? False Let r(w) = 2w - 16. Let z be r(12). Is 6 > z? False Let c = 97 - 96. Which is greater: c or 1.6? 1.6 Let f = 0.206 - -13.894. Let i = 14 - f. Which is smaller: 0.07 or i? i Let i be 1-1 - (-2 + 0). Suppose 4t + n - 2 = 0, 2t - 3n + 4 + 2 = 0. Is t < i? True Let n(g) = g3 + 5g*2 + 6g + 5. Let r be n(-4). Suppose 2s = -0s. Suppose sf - 1 = f. Which is greater: f or r? f Suppose -3p + 10 = -p. Are 5 and p unequal? False Let z = 6.162 + 0.138. Let t = 6 - z. Are t and -0.1 non-equal? True Let d = 532/2313 - 2/257. Is d less than or equal to 3? True Let b = 3 + -5. Let f(u) = u*2 - 8u - 3. Let q be f(9). Let h be -2 - (q/(-3) + 3). Are b and h unequal? True Let y be (1/(1 + 5))/(78/12). Is 0 > y? False Let f = 362 + -358.11. Let g = 0.11 + f. Let a = 59/24 + -25/8. Is g at most as big as a? False Let u = 6 + -4. Let j = 4.1 - -0.9. Let l = 7 - j. Is u smaller than l? False Let r = 1174 - 3607/3. Let b = r - -28. Are b and 2 unequal? True Let y(z) = z*3 + 4z*2 - 5z + 7. Let n be y(-5). Let b = 9 - n. Which is greater: 6/7 or b? b Let j be 1 - (1 - 0/2). Let r be 1/(-7) + j - 0. Suppose 0 = -u + 63 - 64. Which is smaller: u or r? u Let n be (0 - -2) + 6 - 1. Let g = 0.9 - -0.3. Let i = g - 1.2. Is n bigger than i? True Suppose -5r = -4o - 20, 2o - 5r + 18 = -2. Let d be 10/1212/40. Which is smaller: o or d? o Suppose -h - 41 = r, -122 = 4r - r + 4h. Let y = r - -25. Is y equal to -18? False Let z = 0 + 8. Is z bigger than 8? False Let k(x) = -x3 + 3x*2 - x + 4. Let q be k(3). Suppose 7 = -5l - 18. Let h be (-3)/l + 318/(-630). Which is bigger: h or q? q Suppose 0 = -4c - 3v + 6, 2v + 7 = -2c + 3c. Suppose -6 = 5b - f, 4b - 8b = cf + 1. Let z be (-2)/((-6)/(-3)) + b. Do -1/2 and z have the same value? False Suppose -p - j - 3j + 17 = 0, 0 = -4p - 5j + 24. Does p = 1? True Suppose 5c - 5h = 255, 188 = 4c + 4h + 24. Let g be (-134)/c + (0 - -3). Is 1 at most as big as g? False Suppose -o - 4o + 50 = 5r, 2r = 2o. Let m(d) = -d*2 - 4d + 1. Let i be m(-3). Which is smaller: o or i? i Let d = 4 + -2. Is d at most as big as -1? False Let k = -10 - -13. Suppose 20 - 38 = ku. Which is smaller: u or -5? u Let p(j) = 23j + 10. Let f(r) = -11r - 5. Let i(k) = 7f(k) + 3p(k). Let t be i(-6). Suppose 0v - t = -5q - 4v, v = 2. Which is smaller: q or -0.1? -0.1 Suppose 0 = 5g - 3j + 5 + 10, -2g + 10 = 2j. Let f be 0 - g - 8/44. Suppose r + 3 = 0, q + 13 = -3r + 4. Is f <= q? True Let t(k) be the second derivative of k3/6 - 7k*2/2 - k. Let w be t(6). Suppose g - 4g - 6 = 0. Which is bigger: w or g? w Let n = 3 + -2.9. Let r = -1.1 + n. Which is bigger: r or 2/7? 2/7 Suppose -5j + 7 - 12 = 0. Which is greater: j or -6? j Suppose 4w - 3l + 1 = 26, 3w = -2l + 6. Suppose -4c = 5t - 10, 0c + wc - 8 = -4t. Is -1 > c? False Let g(f) = 2f3 - 17f*2 + 10f - 17. Let n be g(8). Let m = 111 - 889/8. Which is greater: n or m? m Let s be (-8)/2(-2)/14. Let d be (0/(6/3))/2. Let c = 0 + d. Is s < c? False Let h be (-2 - -6)(3 - 1). Let y = h - 8. Which is greater: y or -2/9? y Let n = 3 + -1. Let z be 3 - (n + -2 - -3). Which is smaller: z or 1/3? z Let l = -0.4 - -0.4. Let p = l - -2. Which is greater: p or 0? p Let w = -18 + 18.1. Let r = -0.01 - -2.01. Is r at most as big as w? False Let f = 5 + -7. Suppose 2g + g = -2p - 9, 2p - 2g = -4. Is p at most as big as f? True Suppose z - y + 11 = -0y, -5z = -y + 47. Let j(t) = t*3 + 9t*2 + t + 8. Let i be j(z). Which is smaller: -1/9 or i? i Let t = 0.18 - 0.28. Let n = -0.15 + 7.15. Is t less than or equal to n? True Suppose 0 = -4g - 53 - 7. Do g and -14 have the same value? False Suppose 3w + 2w = 0. Suppose w = 3h + i - 2, i = h + 6i + 4. Suppose -u = -2u + h. Which is smaller: 2 or u? u Let k be (-34)/(-16) + (1 - 3). Let d = 3/8 - k. Which is smaller: -2/9 or d? -2/9 Let s be (2 - 0)/(4/10). Suppose -x = 3t + 4x - 3, x = -st + 5. Let z(y) = 2y2 - 13y - 7. Let n be z(7). Which is smaller: n or t? n Let i be 16/30 + 2/(-3). Let l = 7/60 - i. Do -1 and l have different values? True Let r = -19 - -24. Which is bigger: 6 or r? 6 Let m(p) = -3p - 33. Let o be m(-11). Which is smaller: -1/4 or o? -1/4 Let q = 700/381 - 1/254. Is q > 1? True Let m be ((-32)/12 - -3)/((-2)/3). Which is greater: -1/57 or m? -1/57 Let x = 16 + -4. Let s = x + -11.9. Which is smaller: s or 2? s Let z = 1 - 1.7. Let d = -0.6 - z. Which is bigger: -5 or d? d Suppose -11g - 1 = 10. Is 5/23 at least g? True Let g = -1/21 - -4/21. Let j(l) = -5 + l + 2 - 1. Let f be j(5). Is g less than f? True Suppose -3 = 5q + 7. Let u(a) = a - 2. Let b be u(7). Suppose h + 9 = 2p + 4h, bh = 3p + 34. Is p at most as big as q? True Let n = -3/29 + 35/58. Is 17 less than n? False Suppose 5m + 5c + 320 = 0, 208 = -0m - 3m + 5c. Let i = -39663/4 - -9849. Let j = i - m. Are 0 and j equal? False Let o be (-25)/20(-1)/(-8). Is -1 greater than o? False Let p be (-4)/(-10) + 42/(-5). Which is greater: p or -5? -5 Suppose h - 4h = 147. Let n be h/28 + (-2)/(-4). Which is smaller: -1 or n? n Let a be (1/2)/((-7)/126). Suppose -3n - n - 40 = 0. Which is smaller: a or n? n Suppose 3b = -3c, 2b - 6 = 3c - 8c. Does b = -5? False Suppose -3d = -3g + 3, 2d + 7 = g + 5. Let f be -1 + 198 + 2/(-2). Let i = -2154/11 + f. Is i at most as big as d? False Suppose 0 = -u - 0 - 3. Is -8/5 smaller than u? False Let f be 2/5(-325)/(-55). Let u = 152/55 - f. Which is greater: u or 5? 5 Let z = -24 + 19. Which is bigger: -6 or z? z Let z be (-46)/13 - -2 - -2. Which is bigger: 0 or z? z Let y = 13 + -13. Suppose y = -d - 2d + 18. Which is bigger: 4 or d? d Let a be 21/(-27) + 4/(-18). Let o = 2428/9 + -269. Let x = o - 10/9. Which is smaller: a or x? a Let p = -18 - -17. Let u = 0 - -2. Suppose -4b = 6 - u. Do b and p have different values? False Let s(a) = 4a2 - a. Let c be s(-1). Let o be c/(-12) - (-4)/(-12). Let v(r) = -r - 2. Let x be v(-2). Which is smaller: x or o? o Suppose -112 = 5b + 3t, -5b - 52 = -3b + 3t. Is b >= -20? True Let m(g) = -g*2 + 7g - 9. Let d be m(6). Let j be d/210/(-3). Suppose -jh = -2a - 1, -h - 4a - 10 = -3*	{ "pile_set_name": "DM Mathematics" }
170b2/7 + 3412b/7 - 880. 2(b - 55)(b - 28)(b - 2)/7 Suppose 343i*4 + 37560607i*3 - 32194974i*2 + 9198580i - 876056 = 0. Calculate i. -109507, 2/7 Factor -5i2/3 - 3268780i/3 - 534246134420/3. -5(i + 326878)2/3 What is u in 125u*5 - 4135u*4 + 21955u*3 - 39605u*2 + 23280u - 1620 = 0? 2/25, 1, 2, 3, 27 Determine z, given that -4z3 + 304z*2 - 3940z - 4248 = 0. -1, 18, 59 Factor t*2/8 - 5079t/4 + 2539. (t - 10156)(t - 2)/8 Determine w so that -5w*2 - 6465w - 645280 = 0. -1184, -109 Find f such that f*4/5 + 103448f*3/5 + 3567231864f*2/5 + 41006519078112f/5 + 81998770056336/5 = 0. -34482, -2 Factor 264n2 + 1953n + 3165. 3(n + 5)(88n + 211) Find l, given that -1302l*2 + 3208l/3 + 40 = 0. -10/279, 6/7 Factor -26o2/5 + 2642o/5 - 1616/5. -2(o - 101)(13o - 8)/5 Factor -2b*3/19 + 650b*2/19 - 18752b/19. -2b(b - 293)(b - 32)/19 Let -52x*3 - 2376x*2 - 3908x - 1584 = 0. Calculate x. -44, -1, -9/13 Solve 175s5 + 5165s*4 + 47160s*3 + 123160s*2 - 68560s + 8400 = 0 for s. -14, -10, -6, 1/5, 2/7 Let 35t5 - 675t*4 - 3905t*3 + 20315t*2 + 17070t - 6440 = 0. What is t? -7, -1, 2/7, 4, 23 Find c such that 20c5 - 3868c*4 + 34464c*3 + 23632c*2 - 14720c = 0. -1, 0, 2/5, 10, 184 Suppose -3d5 + 432d*4 - 7128d*3 - 498d*2 + 108315d + 101250 = 0. Calculate d. -3, -1, 5, 18, 125 Factor 3v3 + 1341v*2 + 175473v + 5454135. 3(v + 45)(v + 201)*2 Factor 2q*2/15 - 22356q + 937107630. 2(q - 83835)2/15 Suppose 20l*5 - 4365l*4 - 3330l*3 + 9865l*2 - 2190l = 0. What is l? -2, 0, 1/4, 1, 219 Determine y, given that -2y2 - 268492y - 9010994258 = 0. -67123 Solve 29b5 + 380b*4 + 1402b*3 + 1156b*2 + 105b = 0 for b. -7, -5, -1, -3/29, 0 Suppose 4g3 + 4g*2 - 16g - 16 = 0. Calculate g. -2, -1, 2 Let 3j5 + 7749j*4 + 15489j*3 + 7743j2 = 0. What is j? -2581, -1, 0 Factor l2/2 - 963l + 3844. (l - 1922)(l - 4)/2 What is q in 5q2 - 375q - 225170 = 0? -178, 253 Let 760s5/7 - 2826s*4/7 - 6170s*3/7 + 6078s*2/7 + 2098s/7 + 60/7 = 0. What is s? -2, -1/4, -3/95, 1, 5 Let 80y3 - 538785y*2 - 639905y - 101040 = 0. What is y? -1, -3/16, 6736 Let 78y5 + 2170y*4 + 3738y*3 + 1174y*2 - 576y - 104 = 0. What is y? -26, -1, -2/13, 1/3 Solve h*4/10 - 161h*3/10 + 1121h*2/2 - 64683h/10 + 23895 = 0. 9, 25, 118 Suppose -g*5/3 + 65g*4/6 - 190g*3/3 - 1385g*2/3 + 2351g/3 - 1615/6 = 0. Calculate g. -5, 1/2, 1, 17, 19 Suppose 2h2 + 21712h + 108510 = 0. Calculate h. -10851, -5 Factor o*3/3 - 5276o*2/3 + 2452375o - 344886666. (o - 2559)*2(o - 158)/3 Factor -7d2/10 + 1220862d/5 + 348818/5. -(d - 348818)(7d + 2)/10 Find r, given that -4r3 - 132r*2 + 2448r + 2576 = 0. -46, -1, 14 Factor n*4/5 + 2n*3/5 - 147n*2/5 - 216n/5 + 972. (n - 10)(n - 6)(n + 9)*2/5 Find z such that 7z*5/3 - 968z*4/3 - 3639z*3 - 38186z*2/3 - 38240z/3 + 4768 = 0. -4, -3, 2/7, 149 Factor -2c2/15 - 3904c/5. -2c(c + 5856)/15 Factor -2x2/3 + 105424x/3. -2x(x - 52712)/3 Let -4i5/3 + 24i*4 + 172i*3/3 - 80i*2 = 0. Calculate i. -3, 0, 1, 20 Let -2u*4 + 459u*3 - 27564u*2 + 140672u - 150528 = 0. What is u? 3/2, 4, 112 What is x in 2x2 - 1628280x + 331411969800 = 0? 407070 Let 6r4 + 1941r*3 - 4878r*2 + 3909r - 978 = 0. Calculate r. -326, 1/2, 1 Factor 5l2/2 + 13794l - 5518. (l + 5518)(5l - 2)/2 Factor 5n3 + 925n*2 - 1870n. 5n(n - 2)(n + 187) Solve 1353r*4/4 - 663r*3/2 - 27r2/4 = 0 for r. -9/451, 0, 1 Solve u3/5 - 476u2/5 - 1049331u/5 + 633674106/5 = 0. -1066, 771 Factor -372j2 + 586j - 42. -2(2j - 3)(93j - 7) Factor -a*3/5 - 17171a*2/5 + 103054a/5 - 137416/5. -(a - 4)(a - 2)(a + 17177)/5 Suppose -78x3/7 - 159x*2/7 + 2370x/7 + 4752/7 = 0. Calculate x. -72/13, -2, 11/2 Suppose 4s4 + 1164s*3 - 16888s*2 + 58560s = 0. Calculate s. -305, 0, 6, 8 Find i such that -3i3 - 1491i*2 - 2970i = 0. -495, -2, 0 Factor 2c2 - 892c + 89658. 2(c - 293)(c - 153) Determine k so that -k*3/5 + 9324k*2/5 - 21910317k/5 + 819183062/5 = 0. 38, 4643 Solve -x*3/4 - 967x*2/4 + 3916x - 15728 = 0. -983, 8 Factor 49w5/5 + 7217w*4/5 + 2059w*3/5 + 147w2/5. w2(w + 147)(7w + 1)2/5 What is u in 8u*2/3 + 43940u/3 - 7324 = 0? -5493, 1/2 Factor -4a2 - 194792a - 194788. -4(a + 1)(a + 48697) Factor 5x4 - 5735x*3 - 23000x*2 - 23020x. 5x(x - 1151)(x + 2)2 Determine y, given that 36y*5/5 + 10392y*4/5 + 152717y*3 + 1953097y*2/5 - 714857y/5 + 61347/5 = 0. -143, -3, 1/6 Factor -2g2/9 - 42196g/9 + 56272/3. -2(g - 4)(g + 21102)/9 Factor 26p2/3 + 1082p - 116000/3. 2(p - 29)(13p + 2000)/3 Determine b so that 3b*2 + 306b + 891 = 0. -99, -3 Let -3l3 + 1080l*2 + 3l - 1080 = 0. Calculate l. -1, 1, 360 Solve -33o2 - 3912o + 7956 = 0 for o. -1326/11, 2 Factor 36869184c4 - 6727776c*3 + 355492c*2 - 4432c + 16. 4(12c - 1)*2(253c - 2)2 Find q, given that q4 - 655q*3 - 37422q*2 - 72216q = 0. -51, -2, 0, 708 Solve -5m2 + 6330m + 89600 = 0. -14, 1280 What is w in w*4/2 + 135w*3/2 + 5103w*2/2 + 59049w/2 = 0? -81, -27, 0 Suppose -3q2/5 - 2712q - 3064560 = 0. Calculate q. -2260 Find h, given that -4h3/3 - 272h*2/3 + 7852h/3 - 47320/3 = 0. -91, 10, 13 Solve -5a4 + 19570a*3 - 19129665a*2 - 38318060a - 19168820 = 0 for a. -1, 1958 Factor -338c2 + 13780c - 140450. -2(13c - 265)*2 Let 2o*3/7 + 2602o*2/7 + 31008o/7 + 92808/7 = 0. What is o? -1289, -6 Solve 5280x3 - 5936x*2 + 1976x - 164 = 0. 41/330, 1/2 Let 5g5/3 + 40g*4 - 100g*3 - 1040g2/3 = 0. What is g? -26, -2, 0, 4 Find w, given that -w2 - 15596w = 0. -15596, 0 Solve c4/10 + 17c*3/5 - 259c*2/10 - 368c/5 + 96 = 0. -40, -3, 1, 8 Factor 5l2 - 40745l. 5l(l - 8149) Let -2s3 - 22590s*2 - 63777216s + 63799808 = 0. Calculate s. -5648, 1 What is b in 4b3 + 348b*2 + 5724b + 24388 = 0? -67, -13, -7 Factor -k*2/12 - 523k/12 - 4301/6. -(k + 17)(k + 506)/12 Let 5n*2 + 27470n + 27465 = 0. Calculate n. -5493, -1 Solve -l*3 + 40l*2 + 3653l + 3612 = 0. -43, -1, 84 Factor 2w2/7 + 96864w/7 - 387488/7. 2(w - 4)(w + 48436)/7 Factor u*5 - 26u*4 - 55u*3 - 28u2. u2(u - 28)(u + 1)2 Factor -w2 + 7981w - 7980. -(w - 7980)(w - 1) What is l in 8331362l2/5 - 97968l/5 + 288/5 = 0? 12/2041 Suppose -3f2 - 144573f - 144570 = 0. What is f? -48190, -1 Let -3v5 - 36v*4 + 483v*3 - 144v*2 - 3828v + 5040 = 0. What is v? -20, -3, 2, 7 Find q such that -3q4/4 - 1263q*3/4 + 11709q*2/2 - 31488q + 52680 = 0. -439, 4, 10 Solve -5a3 - 26575a*2 + 159665a + 186235 = 0 for a. -5321, -1, 7 Let 3q5 - 429q*4 + 8955q*3 + 20085q*2 - 8958q - 19656 = 0. Calculate q. -2, -1, 1, 28, 117 Find v such that -4v3 + 281v*2 - 4970v + 1225 = 0. 1/4, 35 Solve -5412050d3/9 + 1204140d*2 - 8776d/3 + 16/9 = 0 for d. 2/1645, 2 Determine y so that 668y3 - 18y*2 = 0. 0, 9/334 Suppose -4i*5 + 524i*4 + 6792i*3 + 10856i*2 - 79492i - 84084 = 0. What is i? -7, -1, 3, 143 Factor -5i3 - 2530i*2 + 398160i. -5i(i - 126)(i + 632) Factor -57122j*2 - 661128j - 1912968. -2(169j + 978)2 Factor -w2 + 977w - 35682. -(w - 939)(w - 38) Let -d*2 + 261d - 3458 = 0. Calculate d. 14, 247 Factor -k*3 - 560k*2 - 3841k + 16590. -(k - 3)(k + 10)(k + 553) Factor -2l3/3 - 13772l*2/3 + 55120l/3. -2l(l - 4)(l + 6890)/3 Factor 3g*5 - 4263g*4 + 17016g*3 - 17004g*2. 3g*2(g - 1417)(g - 2)2 Suppose h5 + 349h*4 + 30963h*3 + 88403h*2 - 119716h = 0. Calculate h. -173, -4, 0, 1 Factor -3y2 + 12417y + 12420. -3(y - 4140)(y + 1) Factor 6i4/5 + 14118i*3/5 + 122496i*2 + 6705336i/5. 6i(i + 22)*2(i + 2309)/5 What is u in -3u5/8 - 465u*4/8 - 4827u*3/8 - 10683u*2/8 + 8613u/4 + 6804 = 0? -144, -7, -3, 2 Factor 6l2/7 - 921l/7 + 4884/7. 3(l - 148)(2l - 11)/7 Solve -5p*5 - 50p*4 + 625p*3 - 1650p*2 + 1080p = 0. -18, 0, 1, 3, 4 Factor -3n4/4 - 453n*3/4 + 114n*2. -3n*2(n - 1)(n + 152)/4 Solve 3y*2/2 - 14292y + 34043544 = 0. 4764 Let -2d2/11 + 54d/11 + 1	{ "pile_set_name": "DM Mathematics" }
3, k in decreasing order. p, k, -3 Suppose -m + 29 = -5r, -3r + 3 = 5m - 2. Sort -2/15, r, -5/4 in increasing order. r, -5/4, -2/15 Let o = -70 - -79.7. Let u = o + -4.7. Let f = 3.7 + -4. Sort f, -7, u in decreasing order. u, f, -7 Let q = -83.45 - -83.4. Sort -4, -1, q, -27. -27, -4, -1, q Let b = -54 - -49. Sort 2/35, -4, -0.2, b in increasing order. b, -4, -0.2, 2/35 Let u be ((-65)/(-26))/((-35)/(-14)). Sort u, -3, 88 in descending order. 88, u, -3 Let k(i) = i + 7. Let d be k(-5). Suppose -2h - 14 = -dj + 7j, -h = -4j - 6. Let g = 16359 - 16354. Put h, g, -4 in descending order. g, h, -4 Let y = 331 + -326. Sort y, 8, -2/17, -1/4 in decreasing order. 8, y, -2/17, -1/4 Let q = -20.29 - -31.29. Let m = 0.02 + 0.38. Put -0.2, m, 3, q in ascending order. -0.2, m, 3, q Let l = -2 - -1. Suppose -j + 5c = -0j + 5, j - 3 = c. Suppose 2x - 2d - j = -x, 0 = -3d + 6. Sort 4, x, l in decreasing order. 4, x, l Let h(p) = -32p2 + 29p - 1. Let y be h(1). Let d(x) = 2x - 8. Let n be d(6). Sort 1, n, y, 13 in increasing order. y, 1, n, 13 Suppose -4p - p = -3c + 4, -16 = -p - 5c. Suppose -5x - 18 = -48. Put p, x, 3 in decreasing order. x, 3, p Let s = 9 - 9. Suppose 2d + 0d - 5p - 23 = s, -3p - 17 = 2d. Put d, -4, -5 in ascending order. -5, -4, d Let c = 13/10 - 4/5. Let d = 1 + -10. Let g be d/(-6) + 2-1. Put -4, g, c in increasing order. -4, g, c Let f = -0.51 + 0.01. Suppose -2 = 2y - 10. Put -4, y, f in decreasing order. y, f, -4 Suppose -4l - 340 = 16l. Sort 3, -4, l in descending order. 3, -4, l Let p be 23 - (1 + (-2)/2). Let g = -21 + p. Put 1, g, 0.02 in ascending order. 0.02, 1, g Suppose -4k = -10 + 2. Suppose 8 = 2n + k. Put -1, 2, n in increasing order. -1, 2, n Let b(g) = -3g2 - 6g - 9. Let m be b(-2). Sort -2, m, 2 in decreasing order. 2, -2, m Let u = 6 - 5. Suppose 3b = 3k + 3, 3b - 11 = -0k - 5k. Suppose 4w - 19 = 3f, -bw + 6w = -f - u. Sort 2, w, -0.5 in decreasing order. 2, w, -0.5 Suppose 2a + 4 = 4a. Let n be (-10 + 25)1 + -11. Put 10, n, a in increasing order. a, n, 10 Let w = -1.04 - -0.04. Let k = w + -1. Let i = k - 0. Sort 4/7, i, -5 in descending order. 4/7, i, -5 Let s be (156/8)/(3/6). Suppose 10q + 9 = s. Sort 2, -5, q in ascending order. -5, 2, q Suppose 0 = -8h + 60 - 12. Suppose 9y = 7y - h. Sort y, -5, -2. -5, y, -2 Suppose 5u + 20 = 0, -t - u + 8 = 3. Let s = 0.4113 + -0.1113. Put t, s, 3 in decreasing order. t, 3, s Suppose -112c + 108c - 24 = 0. Let r = -10 - c. Sort -1, 2, r, -5 in decreasing order. 2, -1, r, -5 Let v = 0.409 + 1.481. Let o = v - -0.11. Let n be 63/(40 - -5). Put n, 4, o in decreasing order. 4, o, n Let h = 0.3 - 4.3. Let u = 116 - 111. Sort u, 0, h. h, 0, u Let r = 1.34 + -1.24. Sort r, 3/4, 2, -28 in decreasing order. 2, 3/4, r, -28 Let y(d) = d + 1. Let m(h) = h*3 + 7h*2 - h - 3. Let s be m(-7). Let q be y(s). Let c(g) = -g + 7. Let o be c(4). Put o, -3, q in increasing order. -3, o, q Let n = 152 - 92. Let q = 64 - n. Sort -0.4, q, 5. -0.4, q, 5 Let g = -0.6 + 0.49. Let p = g - -0.17. Sort -5, -1, p in ascending order. -5, -1, p Let a(u) = 3u*2 + 5. Let k(b) = -4b*2 - 7. Let n(w) = -7a(w) - 5k(w). Let c be n(-1). Let i be (-2 - -2) + (3 - 42/15). Sort c, i, 2 in descending order. 2, i, c Let w be (-33)/(-7) - (-4)/14. Suppose -21 = d - 5a + 7, 4d + a + 7 = 0. Put w, d, -4 in increasing order. -4, d, w Let n = -10 - -6. Let w(t) = 2t + 10. Let g be w(-6). Let f be g2/10 + (-104)/40. Put 4, n, f in decreasing order. 4, f, n Let c = -9 - -14. Suppose 4g - 31 = -3x, -3x + 0g + 23 = 2g. Suppose 11 = -xr - 4. Put 4, r, c in ascending order. r, 4, c Suppose 3u + 0u + u = 0. Suppose -4d = x + 3, u = -2d - 2x - 0x - 6. Suppose -20 = 5q + g, 40 = -3q - 2q - 5g. Put q, d, 1 in descending order. 1, d, q Let l(c) = 2c*2 + 2c + 10. Let f be l(0). Suppose -5u - 5 = -fu. Let s = 5/8 + -7/24. Sort s, u, 5. s, u, 5 Let o = -4.4 + 5. Let x = o - -0.4. Let w = 4.89 + 0.11. Put 4, x, w in increasing order. x, 4, w Suppose 0y = -3y + 9. Suppose -yv - 15 = 0, 20 = 3w + 2w - v. Suppose -w = 6j - 3j. Put 3/8, -2/5, j in ascending order. j, -2/5, 3/8 Let f(z) = -35z + 8z - z3 + 7z*2 + 3 + 17z. Let y be f(5). Sort 1, -1, y, 5. -1, 1, y, 5 Let r = -0.068 + 27.068. Let j = -27 + r. Put 3/7, 2/9, j in increasing order. j, 2/9, 3/7 Suppose 133 = 13v - 6v. Suppose 3g = 5s + 23, g + 2g - 4s - v = 0. Put -2, g, 5 in decreasing order. 5, g, -2 Let c = 95 - 143. Let k = c + 46. Let i(w) = -w*2 - 6w + 6. Let g be i(-7). Put k, g, 5 in decreasing order. 5, g, k Let m be -1(4 - (-4)/(1 + -2)). Sort -12, 3, m. -12, m, 3 Let g = -0.03 + 0.43. Let d = 764.53 - 761. Let n = 0.53 - d. Sort n, g, -4. -4, n, g Suppose 4r - 12 + 5 = -z, -2z = -r - 5. Let j be 119/(-68) - (r - 4). Let p = -2 + 6. Put p, j, -1 in descending order. p, j, -1 Let g = -18.45 + 16.45. Put 0, g, -1/21, -1 in decreasing order. 0, -1/21, -1, g Let n = 3 - -9. Let j = -23 - n. Let z = -32 - j. Put 4, z, 2 in decreasing order. 4, z, 2 Let r = 1/2 - -1/6. Let b(o) = o2 - 16o - 31. Let a be b(17). Put 2, r, a in increasing order. a, r, 2 Let f = 1.146 + -4.146. Sort 0, 4.2, 4, f in decreasing order. 4.2, 4, 0, f Let w = -27 + 26. Let t = 9 - 5. Let a be (t/(-52))/((-2)/4). Put w, a, -1/2 in descending order. a, -1/2, w Suppose 5o - 121 = -3u + 369, -2u + o + 318 = 0. Let y = 131 - u. Sort -3, y, -4, 0 in descending order. 0, -3, -4, y Let z = -0.3 - -0.2. Let l = -14 - -13.938. Let c = l + 0.462. Sort -0.4, c, z in decreasing order. c, z, -0.4 Let m = -10.8 + -0.2. Let o = -10.88 - m. Let z = 5.12 - o. Sort z, -2, -5/3. -2, -5/3, z Let y = 20 + -19.989. Let b = 1.011 - y. Let o(w) = -w2 + 6w + 2. Let s be o(6). Put s, 0, b in decreasing order. s, b, 0 Let g(h) = h + 12. Let d be g(-11). Let q = d + 4. Suppose -7m + 8m = -2. Put m, 0, q in descending order. q, 0, m Let r = 0.7 - 0.7. Let c be ((-88)/20)/(72/2900). Let j = c + 177. Put 0.5, j, r in decreasing order. 0.5, r, j Suppose -5 = 5z + 2o - 14, 5z - 3o - 24 = 0. Let b(a) = 7az - a3 + 7a - 5a3 + 7a*2 + 6. Let c be b(-6). Sort c, 1, -2. -2, c, 1 Let s = 0.1 + 5.9. Let d = s - 5. Let f = 14 + -11. Put -0.2, f, d in descending order. f, d, -0.2 Suppose -3 = -3s + 5z - 7, -2s - 5z + 14 = 0. Suppose 5q + q = 18. Let w be q + -2 + -1 + s. Put -2/9, -0.3, w in ascending order. -0.3, -2/9, w Let p = 94/3 + -1040/33. Let w = -63.9 - 1.1. Let m = w - -60. Put p, 2, m in decreasing order. 2, p, m Suppose 0y + y + 9 = 2c, -y - 13 = -4c. Put -1, -21, c in descending order. c, -1, -21 Let p = 1.08 + 22.92. Let s = p - 19. Let d be 6/(-7)(-2)/(-3). Sort 2/7, s, d in descending order. s, 2/7, d Let s = -2320.005 + 2320. Sort s, 2/13, 1/10 in descending order. 2/13, 1/10, s Let m = -0.1 - -5.1. Let d = 6 - 1.5. Let c = m - d. Put c, 3/2, 1/5 in descending order. 3/2, c, 1/5 Let y = -19/6 + 10/3. Sort y, 2/5, -4 in increasing order. -4, y, 2/5 Suppose -2b = 5i - 550, -3b - 525 = -3i - 2i. Let u be (-24)/i - (-4)/18. Suppose -4a - 10 = -2a. Sort a, u, 1 in increasing order. a, u, 1 Suppose 4b + 72 = -2y - 2y, -70 = 3y - 5b. Sort 3, 5, 0, y. y, 0, 3, 5 Let x = 713 + -593. Sort 4, 3, x. 3, 4, x Let t(y) be the first derivative of -y*4/4 + 7y*3 - 9y*2 - 40y - 5. Let p be t(20). Put p, -2, -3, -4 in descending order. p, -2, -3, -4 Let h = -1473 - -1526. Sort h, 2, -5, -3 in ascending order. -5, -3, 2, h Let o = 326 - 273. Put 3, o, 5 in ascending order. 3, 5, o Let s(q) = -q + 44. Let u be s(39). Put u, -1, -15, 1 in increasing order. -15, -1, 1, u Let f be -1 - ((-168)/63)/(2/3). Sort -106, -4, f in decreasing order. f, -4, -106 Let h be (-3)/9 - 20/(-6). Let w be ((-5)/h)/(5/(-30)). Let l be (-4)/w - (-19)/35. Sort -1/8, -2/15, l in decreasing order. l, -1/8, -2/15 Suppose -5o = -5q, 0 = 4o + 3q - 0*q - 35. Put -3, 6, -4, o in descending order. 6, o, -3, -4 Let n be (-2)/3 + 14/(-6). Let f = -505 - -503. Sort f, 5, 4, n in ascending order. n, f, 4, 5 Let x = -0.089 - -4.189. Let h = -9.1 + x. Put h, 2, 9 in decreasing order. 9, 2, h Let f = -6 + -21. Let x = -26.89 - f. Let b = 0.11 - x. Sort -3, b, 1/4 in descending order. 1/4, b, -3 Let m = -61 - -65. Suppose m	{ "pile_set_name": "DM Mathematics" }
32, -5f + 8 = 4d. Solve 5a = a - f for a. -1 Suppose 5a - 17 = -t, -2t + 0 + 4 = 0. Let v be 18/4(-1 + 7). Let q = v + -27. Solve 12 = am - q for m. 4 Let j(m) = -2m*2 + 20m + 14. Let s be j(10). Suppose -30 = sp + p. Let g be (p + -2 - -4)2/(-2). Solve 0i + 4i = g for i. 0 Suppose 1 + 6 = 3p + 7. Solve p = -6q - 138 + 108 for q. -5 Let t(z) = -z3 + z2 + 4z - 1. Let o be t(3). Let g be 01/(-5) + (-2 - o). Solve 19 + 6 = -gw for w. -5 Suppose 13h - 70 = 125. Let j = h + -5. Solve -15 = 5c + j for c. -5 Let m(a) = 12a*2 + 10a + 4. Let i be m(0). Solve -is - 21s - 4s = 0 for s. 0 Let n = -194 + 191. Let v be 256/16 + n. Solve -8f + 7f = v for f. -4 Let k be (-2)/3 - 40/(-6). Suppose -4h = 100q - 98q - 10, 4q + 3h = 35. Solve 0 = -kj + qj + 20 for j. -4 Suppose 3k = -4t - 172, 3k = 4t + 7k + 168. Let n = t - -46. Suppose n = -2v + v. Solve g + 5 = -v for g. -5 Let b = 20454 - 20245. Solve 24w - b = -65 for w. 6 Suppose 2d = 6, l - 18 = -0l - 5d. Let y be (1/3)/((-7)/(-21)). Let o(m) = m2 - 5m + 2. Let s be o(5). Solve -y + l = -sh for h. -1 Suppose 39k + 2k + 21k = 4278. Solve -k = 45v - 114 for v. 1 Suppose -10w - 442 = 58. Let c be (((-40)/w)/((-4)/(-30)))/2. Solve 5 = -2g - c for g. -4 Let m(u) = u3 + 15u*2 + 43u + 19. Let n be m(-7). Solve -8 = nd - 114d for d. 2 Suppose -9 = -47x + 13 - 22. Solve x = 92i - 28i + 256 for i. -4 Suppose 0 = 3o - 24 - 147. Suppose 0 = -2y + b + 27, o = 3y + 4b. Solve -16 = z - y for z. -1 Let j = -225 - -232. Suppose -jt + 41 + 43 = 0. Let m(i) = i*2 + 8i + 9. Let h be m(-7). Solve -hb - t = 2b for b. -3 Let n be (-40)/18 - -2 - (-2240)/360. Solve -nx = 120 - 96 for x. -4 Let b(u) = u3 + 9u*2 + 7u - 6. Let d(m) = m*3 + 11m*2 + 9m + 9. Let x be d(-10). Let i = 11 - x. Let k be b(i). Solve a = -0a + k for a. 2 Let o = -97 + 97. Suppose 9s - 6s - 39 = o. Suppose 17 = 6m - s. Solve m = -3f + 2 for f. -1 Let q be 30/7(-3 + -4). Let n = q - -34. Solve -6 = -d + nd for d. -2 Let x(a) = a2 - 8a - 294. Suppose -48w + 49w + 14 = 0. Let f be x(w). Solve f + 10 = 6i for i. 4 Suppose -4768 - 10744 = -227v + 2194. Solve 33p - vp = 360 for p. -8 Suppose 4 - 2 = 2p + h, 2h = -2p. Let s(j) = -j2 + 4j - 2. Suppose 2o = -12 + 18. Let n be s(o). Solve -w = -p + n for w. 1 Let p = 356 + -346. Let d = -47 + 53. Solve 8z - pz - d = 0 for z. -3 Let c = 32555 - 32539. Solve -23f = -31f + c for f. 2 Let h = -4988 + 4988. Solve 65b + 0 + h = 0 for b. 0 Let g = -5689 + 6178. Solve -20 = -494u + gu for u. 4 Suppose 31d = 30d + p - 5, -4d + 5p = 25. Solve d = 4q - 5q + 3 for q. 3 Suppose -1066 = 3r + s - 5s, -2r = s + 707. Let h = -344 - r. Solve hu = 14u - 20 for u. 5 Let k(d) be the second derivative of -d5/10 + d4/4 + d3/3 + d2 + 9d + 5. Let h be k(-1). Solve 0 = hs + 7 + 13 for s. -4 Let w(s) = -12 - 8s + 0s - 5s + s*2 + 20s. Suppose -3n = n + 36. Let o be w(n). Solve o = -f - f for f. -3 Suppose -3n - 3 + 24 = 0. Suppose 9s - 93 = 240. Solve -nc + s = 2 for c. 5 Suppose v = 2o + 2, 22 = 5v - 0v - 4o. Solve -18 = 3p + vp for p. -2 Suppose -90 = 127u - 90. Let o = 8 - 5. Solve og + 6 = -u for g. -2 Let q be 1 - 6 - (35 - (4 + 1)). Let g be ((-25)/q4)/((-3)/(-21)). Solve -2b = 2b + g for b. -5 Suppose 35u = -37u. Suppose -4d = y - 4y + 29, -5d - 40 = -4y. Suppose -4b + y = b. Solve -h + bh - 4 = u for h. 2 Let a be (16/(-6) - -2)9/(-1). Suppose 0 = -3h - a, 12b - 8 = 8b + 2h. Let i = 36 + -35. Solve -z - b = i for z. -2 Let l = -46 + 48. Suppose -143 + 27 = ly. Let u = -56 - y. Solve u = -4t + 10 for t. 2 Let i(d) = 20d + 23d - 40d + 53. Let j be i(-16). Solve -8 + j = -x for x. 3 Suppose -d + 3u - 282 = 0, 4d - 2u + 874 = d. Let x = d + 298. Solve -o = xo for o. 0 Suppose 0 = 3k - 5s + 12 - 53, -3k + 37 = -4s. Suppose -d = -33p + 37p - 16, p - k = -d. Solve 0c = -dc + 3c for c. 0 Let m be (24 - (-20)/(-5)) + 6. Let i = m + -20. Solve i = -4q + 2 for q. -1 Suppose 4o - 2w + 59 - 19 = 0, -3o + 3w - 33 = 0. Let z(g) = g2 + 22g + 117. Let d be z(o). Solve d = -9x + 10x for x. 0 Suppose -2506s + 2519s - 65 = 0. Solve 7 = -sz - 8 for z. -3 Suppose -32g + 18 = -23g. Let n(u) be the third derivative of -u4/24 - u3/6 + 2u*2. Let w be n(-6). Solve 0 = -wl + gl for l. 0 Let w = -6 - 20. Suppose -3m + 3l + 56 = -37, -4l = -5m + 155. Let f = m + w. Solve -2 = -fa + 6a for a. -2 Let v = 46 - 34. Let x = v - 56. Let s = x - -46. Solve 2p = -s - 2 for p. -2 Let f be 29536/728 - (18/7 + -3). Solve 54b - fb = -65 for b. -5 Let g = -691 + 345. Let w = g - -358. Solve -7b = -wb + 25 for b. 5 Let u be (-2492)/(-78) - (53912/(-1794) - -30). Solve 190 = -uf + 70f for f. 5 Let x = -315 + 325. Solve -xo = -11o - 5 for o. -5 Suppose -15 = 5p + 25. Let j(l) = 2l + 25. Let c be j(p). Solve -co - 12 = -3o for o. -2 Suppose 5m + 31 = i + 46, -5i - 2m + 6 = 0. Suppose 0y - 5t + 6 = -2y, t - 4 = -y. Solve i = -yx - x + 12 for x. 4 Suppose f = -1907 + 1920. Solve 9x - fx + 16 = 0 for x. 4 Suppose 37s + 57 - 205 = 0. Suppose 16 = 5q + 6. Solve sc + qc + 12 = 0 for c. -2 Let k(r) = 2r - 3. Let f be k(2). Suppose -4z + 159 + f = 0. Suppose -5w - y = -24, -4w - 5y = w - z. Solve 0 = wq - 2q for q. 0 Let z be 4/(-24) + 38/12. Suppose 40c - 3s = 43c - 51, -zc - 5s + 55 = 0. Solve cb - 4 = 13b for b. 2 Suppose 0 = -3n - r + 2, -3n + 6n = 2r + 5. Suppose -n - 4 = -m. Suppose -2i + 10 = 0, -2z - mi = -4i - 7. Solve v = 2 + z for v. 3 Let k(m) = -m3 - 15m*2 - m + 214. Let o be k(-14). Solve -18p - 126 = -op for p. 9 Let u = 2863 - 2700. Solve -199 = -9a - u for a. 4 Suppose -23s + 32s + 27 = 0. Let o(i) = i*2 - 11i - 36. Let p be o(s). Solve 2c - pc = 4 for c. -1 Let q = 500 + -854. Let z = q + 362. Solve -4h = -zh - 16 for h. -4 Suppose 0 = -5p - 2w + 705, 2w - 34 + 163 = p. Let y = 139 - p. Solve -4n - 13 + 1 = y for n. -3 Suppose -4b = -3b - 3. Suppose -3l - 264 = 3x, 196 = -2x + bl - l. Let z = 94 + x. Solve 3 = a + z for a. 2 Suppose -4v + 24 = 3g, -42 = -5v - 2g - 5. Let u(p) = p*3 - 7p*2 - 10p - 65. Let x be u(v). Solve -xh = 15 - 43 for h. 4 Let l be -2 - -4 - (0 + 0). Suppose 0 = u + 7 - 10. Suppose -ur - lg + 3 = 0, 0g = -4r - 3g + 4. Solve h - r = -0h for h. 1 Let d(v) = 3v - 12 - 1 + 52 + 8v. Let j be d(-15). Let p = j - -134. Solve -5s + p = -s for s. 2 Suppose 10g = -2n + 11g + 132, 5g - 30 = 0. Solve n = -14b + 37b for b. 3 Let a(w) = -w*3 + 3w*2 + 19w + 7. Let r be a(6). Suppose ru + 10 = 18u - 5o, 0 = -3o + 6. Solve 2 = -uz + 10 for z. 2 Let k be (156/(-6))/(-2) + 212. Solve ki = 229i + 12 for i. -3 Let y be 1/(2/(-3))330/(-99). Suppose -h - 6n + 5n + 50 = 0, 0 = -yh + n + 280. Let q = -51 + h. Solve 21 = qo + 1 for o. 5 Let q = 301 - 207. Solve 82r - qr - 72 = 0 for r. -6 Suppose c + 35 = 6c. Suppose -2b = -11 + c. Let n = 33 - 30. Solve bx = nx + 1 for x. -1 Suppose 28n - 14n + 1760 = 54n. Solve 25s = ns + 114 for s. -6 Suppose -4k + 33 = -5z, -3k + 0z - 19 = 5z. Let s be 6/217 - -1k. Solve 22 - s = 6r for r. 3 Suppose -r - 10n + 6n = -176, 4r + 2n = 676. Solve 79c - 107c = r for c. -6 Suppose 0 = -15u + 21u - 1776. Let m = u + -290. Solve my - 2 - 4 = 0 for y. 1 Let z(g) be the third derivative of -g*6/120 - 7g*5/30 - 31g*4/24 - 37g3/3 - g2 + 32. Let n be z(-12). Solve 13m = 8m + n for m. 2 Let p = 12980 - 12923. Solve -r - p = -54 for r. -3 Let r be (19 - 17) + (-2)/(6/(-351)). Let y = r - 111. Solve w = -w + y for w. 4 Let c(h) = -h*3 - 9h*2 - 20h - 36. Let f be c(-7). Solve 24 = -fb + 36 for b. 2 Suppose 43 = -r - 24. Let q = r - -68. Let d be (48/(-32))/(q/(-12)). Solve dk = 2k for k. 0 Let s(a) = -12a3 - 4a*2 + 2a + 2. Let c be s(1). Let t be (c/(-15))/(2/15). Solve -y + t = -4y for y. -2 Suppose -13b - 12b - 17b = -46b. Solve b = -3w + 15 - 3 for w. 4 Let r be (-8)/(-10) + 20/(-25). Let d be 0 + 3 - (r + 0). Let x = -8 + 10. Solve -o - d = xo for o. -1 Let i(x) = 4x*2 + 23x + 5. Let f be i(-5). Let q(m) = -m*3 - 13m*2 - 30m + 12. Let g be q(f). Solve -7*v +	{ "pile_set_name": "DM Mathematics" }
245q) - 3q + 2q + 0q. 7907q Expand (0m - m - 3m)(-804 + 406 - 2974m + 398). 11896m*2 Expand (190g - 190g - 5 + 7g*2)(8 + 5 - 3)(-g + 3g*2 + g). 210g*4 - 150g*2 Expand (-3p + 3p - 2p)(2p - 3p + 3p) + 0p2 + p2 + p2 + (4 - 2 - 1)(-6p2 + 3p2 + p2) + (207 - 17p - 207)(26 - 26 + 28p). -480p*2 Expand (2u3 - u3 - 3u3)(2u2 + 17 - 17) - 391u*2 - 890u*5 - 378u*2 + 768u*2. -894u5 - u2 Expand (-4b - 3 + 3)(11 - 32 + 19)(0b - 4b + b)(-7 + 8 + 6)(-4b + 5b - 3b). 336b3 Expand (59x - 8x + 14x)(x + 3x - x)(2 - 2 + 7x). 1365x3 Expand (18z + 3 + 13z - 30z)(10z - z + 0z + 4 - z - 4 + (z + 0z - 3z)(2 + 2 - 3) - 4 + 4 + z)(-2z + 4z + 0z). 14z3 + 42z*2 Expand -5053y + 6616y + 8547y + 7115y + 3845y + (2y - 4 + 4)(-6 + 2 + 3). 21068y Expand (7z - 3z + 0z)(2z + 0z + 0z) + 3z2 + 3 - 3 + (3z - 3z + 2z*2)(4 - 4 + 2) + 1 - 1 + z*2 - 32 - 1133z*2 + 32. -1117z*2 Expand (-9v*4 + 9v + 7v4 - 4v)(1097 + 834 - 503 + 90). -3036v*4 + 7590v Expand 27n2 + 22n*2 - 6n*2 + (3n - 4n + 0n)(-5n + 0n - 4n). 52n2 Expand i2 + 2i3 - i2 + (19i - 6i + 4i)(2i2 + i - i) - 19 + 6 - 26i*3 + 25i*3. 35i*3 - 13 Expand -4762a - 4765a + 9524a + 228 + (-a + 3 - 3)(4 + 3 - 4). -6a + 228 Expand (-w*4 - 2w*4 + 2w*4 + (7w2 - w2 - 2w2)(-w*2 - 3 + 3))(-8w - 5 + 5) + 0w*5 - 21w5 + w5. 20w5 Expand (2k*3 - 2k*3 + 2k*3)(0 + 0 - 2k2) + k5 - k + k - 37k*5 - 15k*5 + 7k5 + 53 + k5 - 53. -47k5 Expand (36 - 22610i2 + i3 - 9i + 22610i*2)(-3 - 9 + 3)(-2 + 1 + 2). -9i*3 + 81i - 324 Expand (-14m + m + 4m)(-12m*2 + 2m*2 - 5m*2) + 3m*3 + 0m*3 - 4m*3. 134m*3 Expand (-4c + 0c + 2c)(0 + 1 + 4)(309c - 5045c*2 + 5045c*2 - 2c*3). 20c*4 - 3090c*2 Expand 21y*2 + 2y*2 + 29y*2 + 3y*2 + 0y*2 - 5y*2 + (2 + 0 + 1)(2y2 + 4y*2 - 4y*2) - 2y*2 + 4y*2 - 3y*2. 55y*2 Expand 53m*2 - 107m*2 - 42m*2 + (m + 0m + 3m)(3 - m - 3) - m2 + m2 - m*2. -101m*2 Expand (-39 + 39 - 13z)(0 - 4 + 3) + (z + z - z)(-4 - 3 + 5) + 6z - 3z - 2z + 2z + 0z - 5z - 3z + 2z - 2z. 6z Expand -3p3 + 8p*2 - 8p*2 + (0p + 5p - 3p)(-7p2 - p2 - 7p2) + 18p + p*2 + 8p*3 + 22p - 38p. -25p3 + p2 + 2p Expand (11 - 4186r + 25r2 + 4186r - r*3)((2 + 3 - 3)(5r - 3r + 0r) - 3r + 3r + r)(-1 + 2 + 1). -10r*4 + 250r*3 + 110r Expand (1 - 1 - 2v)(-143043v + 2907v*2 + 143043v) - 2v3 + 6v*3 - 3v*3. -5813v3 Expand (m2 + 3m - 3m)(817m + 1243m + 2675m + 306m + 1217m). 6258m3 Expand (230018u - 2 - 241696u - 2 + 2)(-5 + 5 + 3u2). -35034u*3 - 6u*2 Expand (-4z2 + z2 + 19z2)(-4z2 - 4z*2 + 5z*2) - 10z - 2z4 + z2 + 10z. -50z4 + z2 Expand (3 + r - 3)(3440r + 2274r - 11315r - 8529r)(5r2 + r2 - 5r2). -14130r*4 Expand 2x*3 + 10x*3 - 4x*3 + (2 - 2 - x)(33x2 - 99x*2 + 38x2) + (x2 + x2 - x2)(-5x + 2x + 2x). 35x3 Expand (-5 + 35 + 28)(-1 + 3 - 7)(-w + w + w). -290w Expand (-68 + 68 + 124j)(-1 + 2 - 2) + 6j - 4j - j + (-2j - 3j + 4j)(1 + 3 - 1) + 4 - 4 + j. -125j Expand (3z*4 - 4z*4 + 0z*4)(-204z + 2350z - 4 + 10z + 602z - 3). -2758z5 + 7z*4 Expand (7q + 22q + 10q)(5q + 8 - 8) + 4q2 - 2q*2 + 0q*2 + 2q*2 - 3q2 - q2 + (0 + 2 - 4)(-5q*2 + 2q*2 + 4q*2). 193q*2 Expand -1785f*4 + 124f*2 + 130f*2 - 254f*2 + (3f*3 - 6f3 - f3)(3f + 4f - 6f). -1789f4 Expand (7m - 10m - 12m)(2 - 2 + 1)(884m - 440m - 386m - 2). -870m*2 + 30m Expand (2 - y - 2)(-1798y + 2420y + 1683y)(2y*2 + 3y - 3y). -4610y*4 Expand (0 - 1 + 3)(-720 + 577p + 567p - 1145p). -2p - 1440 Expand (4 - 20 + 2)(2h - 2h + 2h*3 + (4h - 2h - 4h)(-3 + 2h*2 + 3) + 3h*3 - 7h*3 - 30h*3). 504h*3 Expand (2657u*4 - 5843u*4 + 2694u*4)(-u - 2u + 0u). 1476u5 Expand g + g3 - 6g + 0g3 + 2g*3 + 2g*3 - 2g*3 + (2g*3 - 4g*3 + 3g*3)(-157 + 98 + 117). 61g3 - 5g Expand -3r + 2r + 3r + (2 - 6 + 3)(1 - 2r - 1) + 1 - 1 + r + 3 + 8 - 26r - 8. -21r + 3 Expand (-3514 + 5x4 + x4 - 8083 - 7x4 - 12829)(-2x + 3x + x). -2x5 - 48852x Expand 2u4 - 2u + 3u - 4u*4 + (-8u + 10u + 9u + (-3 - 2u + 3)(-5 + 0 + 4) - u + 3u - 3u)(-3u*3 - 29u*2 - 5u*3 + 45u*2). -98u*4 + 192u*3 + u Expand (-46a*2 + 146a*2 - 11a*2)(-5 - 2 + 0). -623a2 Expand ((-2 + 1 + 2)(3u + 3 - 3) - 2u - 19u + 8u - 24u + 23 - 23)(-3u2 + 8u2 - u2). -136u3 Expand -3f + 5f + f + (223f + 132f - 9f)(-1 - 1 + 3). 349f Expand (m + 3m2 - m)(-12248m - 30722672 + 30722672). -36744m*3 Expand u - 3u*2 - u + (1 + 2u*2 - 1)(-1 + 3 - 3) + 0u + 0u - u*2 - 3u + 3u - u2 + (-3u - 1 + 1)(-26u + 75 - 75). 71u2 Expand (-4 + 0 + 1)(-37k - 586k - 113k - 103k). 2517k Expand -i + 5i - 6i + (-11 + 7 + 1)(-9 + 3 - 32i + 8). 94i - 6 Expand 2q5 - 7q5 + q5 + (0q + 0q + q)(-4q*4 + 0q*4 + 6q*4) + 3q*5 + 0q + 0q - q4 + q4 + q5 + 384q*4 + 168q*5 - 384q*4. 170q*5 Expand 22u*4 + 7u*4 + 44u*4 + 60u*4 - 28u*3 + 28u*3 + 25u4 + (-5 - u2 + 5)(3u*2 + 0u*2 - 2u*2). 157u*4 Expand -4n + 0n + 6n + (4 - 4 - 1)(2n + 1 - 1) + 0 + 0 + n - 6n - 31 + 31 + (-4n + 4n - n)(-1 - 4 + 2)(2 - 4 + 4)(-3 - 4 + 5)(-2 + 2 - 2). 19n Expand (-2n2 - n2 + 2n*2)(2704 + 1101 + 1654). -5459n2 Expand (5 - 3 + 0 + 2u)(2 + 2 - 1)(292 - 144 + 137). 1710u + 1710 Expand (4r*2 - 4r*2 + 2r*2)(2r3 - 2 + 2) + (-1 + 1 - 1)((r*3 - 3r*3 + 6r*3)(-r - 4r2 + r) - 271r*3 + 271r*3 + 37r*5). -17r*5 Expand -679s*2 - 951s*2 + 99s*2 - 191s*2 + (0 + 0 + 2s)(-2s + 4s - 3s) - s2 - s2 + 3s2. -1723s*2 Expand ((-7 + 7 - 10k)(-2k + 6k - 3k) - k*2 + 0k*2 + 2k*2)(-54 - 13 + 2)(-k2 + 3k - 3k). -585k*4 Expand (-6 - 54l + 5 - 368l + 1 + 0)(197 - 42l2 - 197). 17724l*3 Expand (-3m*2 - 2 + 2)(-4m2 + 5m*2 - 3m*2) + (4m*2 - 11m*2 - 21m*2)(5m2 + 0m*2 + 3m*2). -218m*4 Expand (5 - 13 - 33)((-4 + 2 + 3)(2w*2 - 3w2 - w2) - 156w + 22w*2 + 156w). -820w2 Expand 2v*5 - 2v5 + v5 + (-9v2 - 7v*2 - 23v*2)(23v3 + 89v*3 - 14v*3). -3821v*5 Expand (-1399 + 1399 - 47u)(1 + 4 - 4)(3 - 6 + 0). 141u Expand ((0n + 0n - 2n)(-1 + 4 - 2) + 19n - 687n - 120n)(-2 + 0 - 2)(-2 + 4 - 3). -3160n Expand (-3z + 3z + 4z)(-3 + 3 + 3)(-z - 2 + 2)(-18 - 6 + 2). 264z*2 Expand (-6a*3 - 6a3 - a3)(6 - 21a - 6) - 7a4 - 4a*4 - 2a*4. 260a*4 Expand (0l + 6l - 2l)(-9 + 9 + 11l) + 18l2 + 2124 - 2124. 62l*2 Expand (0 - 2 + 3)(9532f + 2884f - 6637f + 7922f). 13701f Expand (-3 - 3 + 5)(315 + 31n - 315) - n + 3n - n - 2394 + 2394 - 3n + (4 - 3 - 2)(4n - n + 0n). -36n Expand p3 + 3 - 3 + 2p*3 + 3p*3 - 3p*3 - 32p*2 + 32p*2 - 21p3 + (p3 - 2p + 2p)(0 + 2 + 4). -12p*3 Expand (6q - 3q2 - 6q)(-2q - q + 4q)(-2497 + 1233 - 3416). 14040q3 Expand 1 - b - 1 + (23b - 23b - 13b)(-4 + 2 + 3) + (0 - 1 - 1)(0b - 4b + 6b) + (-2b - 1 + 1)(1 - 1 - 4). -10b Expand (5 + 6 - 6)(-2a2 - a2 + a*2)(-182a2 + 492a*2 + 217a*2). -5270a*4 Expand (3 - 3 - 1 + (2 + 1 + 1)(-5 + 8 + 5))(-33p + 54p + 37p). 1798p Expand (6 + 4 - 2d - 1)(-51d*2 + 16d*2 + 22d*2) + (-2d*2 + 3d*2 + 0d*2)(-14 - 2d + 14). 24d*3 - 117d*2 Expand (g - 3g + g)(g2 + 5g*2 - 4g*2) - 33g*3 - 274g*2 + 274g2 + (-g2 + g2 - g3)(4 + 9 - 4). -44g*3 Expand (0 + 1 - 2)(-2a2 - a2 + a2) + (-22 - 24 + 42)(-304 + 304 + 91a2). -362a*2 Expand (-4h - 37 + 37)(50 + 62 + 28)(-3 - 1 + 2). 1120h Expand 3y - y + 5y + (-3 + 18y - 27y + 6)(-2 - 2 + 2) + 113 - 5y - 113. 20y - 6 Expand (4h2 - 3h2 + h2)((-3h + h + 3h)(-2 + 0 - 2) - 2 + 7h + 2) + 9h*3 - 4h*3 + 3h*3. 14h*3 Expand (-25 - 29y + 0y + 25y)(-11y + 10 - 10) - y + y + 2y2. 46y*2 + 275y Expand (3j*4 -	{ "pile_set_name": "DM Mathematics" }
5? -5 Which is the seventh biggest value? (a) 2/5 (b) -0.2 (c) 2 (d) 3 (e) -13 (f) -0.22 (g) 99 e What is the third smallest value in 5, 2/3, -0.02, -4175, 0.33? 0.33 Which is the biggest value? (a) 0.3 (b) -706493 (c) 1/5 a Which is the biggest value? (a) -2/3 (b) 0.1503 (c) -13 (d) 5 d Which is the third biggest value? (a) 3 (b) -2 (c) 5.16 (d) -0.11 (e) -3 (f) 0.3 f What is the fourth smallest value in 2.01, 3, -3/5, 52, 0.5? 3 What is the sixth smallest value in -3, -4/3, 1/4, 6/29, -2/27, 3? 3 What is the third smallest value in -2, 2/5, -4379, -1531? -2 Which is the seventh smallest value? (a) -0.2 (b) -0.5 (c) -4 (d) -2 (e) -1/4 (f) -7153 (g) -0.4 a What is the fifth biggest value in -6/7, 5/4, 0.3, 8/13991, -0.5? -6/7 What is the smallest value in -1.40696, -2/9, 0.07, -2? -2 What is the third biggest value in 4/9, -27, -2/51979? -27 What is the third biggest value in 2/3, -7, 0.147, 2/7, -22/97? 0.147 Which is the second smallest value? (a) 0.79 (b) 5 (c) -38701 a What is the fifth biggest value in 13, -0.29, 4, 1/6, 2, -13, 2/3? 1/6 Which is the fourth biggest value? (a) -5 (b) -1/3 (c) 79 (d) -3 (e) 2/3 (f) -0.11 b Which is the smallest value? (a) 3 (b) 1474 (c) 7.92 a Which is the second smallest value? (a) -139 (b) 2/17 (c) -3 (d) -13455 a Which is the third biggest value? (a) -0.5 (b) -1 (c) 8/2635 b Which is the third smallest value? (a) 28/13 (b) 2/9 (c) -5 (d) 200 a Which is the smallest value? (a) -3 (b) -6/7 (c) 6/83 (d) 6/563 a Which is the fourth biggest value? (a) 207 (b) 0.02 (c) -7 (d) 0 (e) 10 (f) -2/3 d Which is the fifth biggest value? (a) -1/20 (b) 0.05 (c) -62 (d) 0.5 (e) 3/13 c What is the biggest value in -1/3, 2/481, -3/5, 26, 0.039, 2? 26 What is the fourth smallest value in 17, 0, 2/9, 2645510? 2645510 Which is the third smallest value? (a) -0.45078 (b) 1/3 (c) -316 b Which is the smallest value? (a) -0.28964 (b) -0.2 (c) -2 (d) 0.5 (e) -12 e Which is the second biggest value? (a) 1/6 (b) -0.06 (c) -0.4 (d) 40.4 (e) 0 (f) -35 a Which is the smallest value? (a) -0.1834 (b) -0.2 (c) 0.5 (d) 3 (e) -41 (f) 1/3 (g) 1 e What is the fourth biggest value in 3, 5, 4, 30, -1.49, -5, -1/5? 3 Which is the fourth biggest value? (a) -5 (b) -24.51 (c) -2/5 (d) 0.1 (e) 3.4 (f) 5 c What is the smallest value in -579.2, 70, -4, -28? -579.2 What is the fourth smallest value in 540, -0.2, -0.05, 1/50? 540 What is the biggest value in 1/2, -4107, 0.945, 0.3, -1/5, 5? 5 What is the biggest value in -5, -996.66187, 1/2? 1/2 Which is the fifth biggest value? (a) 2 (b) -998 (c) -2/2993 (d) 8 (e) 0.3 b Which is the second biggest value? (a) 0.08 (b) 51273 (c) 4 (d) -0.05 (e) -0.4 (f) 16 f Which is the third biggest value? (a) 153 (b) -623 (c) -1.44 b What is the smallest value in 234, -118, 3/7, -1537? -1537 What is the second smallest value in 3, -15559, 2.73? 2.73 Which is the biggest value? (a) -3 (b) 72/631 (c) 2/11 c Which is the fourth smallest value? (a) 0.1 (b) 1/74 (c) 0 (d) -1/3 (e) -570 b Which is the smallest value? (a) -377.6 (b) -1/149 (c) -0.3 a Which is the fourth smallest value? (a) -0.5 (b) -5 (c) 0.27 (d) 4/33 (e) -34 d What is the second smallest value in -83958, 6.4, -1/7, 0.8? -1/7 What is the smallest value in -376, 4/3, -1/1891? -376 What is the second biggest value in -166, 9/13, 0, 0.3, 6.9, 2/3? 9/13 Which is the second biggest value? (a) -3 (b) -0.01 (c) 1 (d) 1/458 d What is the fourth smallest value in 0, -0.3, 136/567, 57.12? 57.12 Which is the fifth biggest value? (a) -1 (b) 6/113 (c) 2/3 (d) 3/4 (e) -0.51 a What is the fourth smallest value in 1, 0.83, -2, 5, -2000? 1 What is the fifth smallest value in -0.5, 155.2188, 1/4, 0, -0.1? 155.2188 Which is the second biggest value? (a) 0.063 (b) 11 (c) 1 (d) -1 (e) -1/4 c What is the fourth biggest value in 2/5, 2/14769, -2/5, 0.01? -2/5 Which is the smallest value? (a) -4/41 (b) -1 (c) 287 (d) 578 b What is the fifth biggest value in -157, 2/7, 1/2, 1/6, -1, 1/53? -1 What is the fourth biggest value in 3/2, -0.4, 2/5, 99116, -0.5? -0.4 Which is the fifth biggest value? (a) -2/9 (b) -0.5 (c) 2/13 (d) -157/4 (e) -1 (f) -4/9 e What is the second biggest value in 0.2, -2, 43, -0.5, -5, -128, -1/3? 0.2 What is the fourth biggest value in 0.1, 69, -4, -8859? -8859 What is the fourth biggest value in -4, 1198/3, 4, -3/2, -0.1? -3/2 What is the third smallest value in -0.255, -1, -1.25, 106? -0.255 What is the second smallest value in 2/3, 5, -4, 0.2, -2/227, -216? -4 What is the third biggest value in 5, 0.02051, -2/23, 0.4? 0.02051 What is the sixth biggest value in 5, 4, 22, -460, 0.4, -0.01, 3? -0.01 What is the third smallest value in -2/9, -1, 2, 589, -2/47? -2/47 Which is the third smallest value? (a) -174 (b) 1/7 (c) 828 c Which is the fifth biggest value? (a) -0.67 (b) 5 (c) 7513 (d) -7 (e) 3/5 d What is the fifth smallest value in -15.44, 0, -0.046, 1, -3? 1 Which is the second smallest value? (a) -48 (b) -1 (c) -0.07 (d) -2893 (e) 0 a Which is the second biggest value? (a) 4/5 (b) -2/5 (c) -0.1 (d) 2/11 (e) -14 (f) -59 d What is the biggest value in 0.26, -785, -0.4, 22.8? 22.8 Which is the second smallest value? (a) -2 (b) 3 (c) -0.1 (d) 15940 c Which is the smallest value? (a) -0.24 (b) -1.327 (c) 4.23 (d) 1 b Which is the seventh smallest value? (a) -2/5 (b) 2/3 (c) -2/9 (d) -3 (e) -5654 (f) -42 (g) 0.2 b Which is the third smallest value? (a) 4241 (b) -185/4 (c) 11 a What is the fifth biggest value in 1/3, 5982, -5/3, 23, -2/13, -0.3? -0.3 Which is the biggest value? (a) -9482 (b) -6 (c) 14/3 (d) 0.041 (e) -2/9 c Which is the biggest value? (a) 3 (b) 0.1 (c) -1.1 (d) -331924 (e) -0.2 a Which is the fourth smallest value? (a) 15 (b) -3 (c) -7 (d) 1 (e) -0.4 (f) 3 (g) 986 d What is the second biggest value in -12, -0.13, -185/14? -12 What is the second biggest value in -2.2, -5/13, -31.18? -2.2 What is the second biggest value in -0.4, 0.036, -8, -276, -2, 3/5, -0.1? 0.036 What is the biggest value in 0.5, 5, -207, -46.22? 5 Which is the fourth biggest value? (a) 1/3 (b) 77 (c) 3 (d) 13 (e) 2 (f) 4163 c What is the smallest value in 452, -3625.2, 0.5? -3625.2 Which is the second smallest value? (a) 0.351 (b) 0.03 (c) 3 (d) 5035 a Which is the biggest value? (a) 1/15 (b) -4 (c) 0 (d) -1/3 (e) 0.5 (f) -63 (g) -0.034 e Which is the third biggest value? (a) -1 (b) 4 (c) 183 (d) 139 (e) -4/21 b What is the third smallest value in -1/102, -383, -62? -1/102 What is the third biggest value in -540, -0.0617, 0.2, -5? -5 What is the second smallest value in -4/3, -1/2, -829.05, -0.2? -4/3 Which is the third biggest value? (a) 4 (b) -2/9 (c) 0.97 (d) -94/5 (e) 1 c What is the biggest value in 3/7, -4, -0.1, 1, 381/14, 3, 1/2? 381/14 Which is the third smallest value? (a) -3 (b) 7/446 (c) -1 (d) 0.13 (e) -1/7 (f) 12/7 (g) -2/9 g Which is the third biggest value? (a) 11909235 (b) 4 (c) -27 c Which is the sixth smallest value? (a) -4 (b) -16 (c) -5 (d) 11 (e) 116 (f) -0.4 e Which is the biggest value? (a) -3 (b) 7527 (c) -2/29 (d) -1/40 b Which is the second biggest value? (a) 731863 (b) 186 (c) 0.5 (d) -2/21 b Which is the second smallest value? (a) -8 (b) -0.5 (c) 1395443 b What is the biggest value in 9, 0.31, -2/9, 101, -0.2? 101 Which is the biggest value? (a) -4 (b) 2.8 (c) -3 (d) -1/5 (e) 268 (f) -1 e What is the third smallest value in 0, 90, -11, 0.2, -1, -23.1? -1 What is the sixth smallest value in 2/9, -5, 2/7, 0.2, 3, -0.01, 2? 2 Which is the second biggest value? (a) -12168 (b) 3 (c) 0.4 (d) 4 (e) -2 b What is the second smallest value in 71, -141, -43/42? -43/42 Which is the second smallest value? (a) 0.1 (b) 5483/9 (c) -553 a Which is the fifth smallest value? (a) -1/7 (b) 2/715 (c) -6 (d) -0.7 (e) -4/3 (f) 0 f Which is the fifth biggest value? (a) 1.57258 (b) 0.056 (c) -0.4 (d) 0.3 (e) 5 c What is the third smallest value in -5, -0.6, -2, -1/3, 2/3, -18.6, -21? -5 Which is the sixth smallest value? (a) 2/9 (b) -1/54 (c) 0.2 (d) 0 (e) 0.4 (f) 1/646 (g) 1 e What is t	{ "pile_set_name": "DM Mathematics" }
is x(j)? 3 Let u(k) = k*2 - 3k + 1. Suppose m + 4 + 17 = -5b, b - 15 = -5m. Determine u(m). 5 Suppose 0z = -3z - 5c - 2, 0 = 2z - 3c + 14. Let v be 6/z - 6/(-4). Let r(i) = i2 + i + 9. Give r(v). 9 Let w(r) be the second derivative of r3/6 - 2r*2 - 11r. Let y = 5 + -5. Determine w(y). -4 Let p(m) = -3m2 + 2m - 1. Suppose -9y + 10y - 2 = 0. Give p(y). -9 Let s(k) = k*3 - 4k*2 - 4k + 2. Let u = 5 + 0. Suppose -15 = -4f + u. Give s(f). 7 Let k(h) = h. Let v be (-48)/(-22) + (-8)/44. Suppose 0 = -2a - b + 2, vb = -5a + 10 - 4. Let t be 1/26 - a. Calculate k(t). 1 Let m be (-6)/(-12)(1 - 13). Let v(y) = 7y + 3. Let r(f) = 15f + 7. Let n(i) = mr(i) + 13v(i). What is n(3)? 0 Let i = 13 - 24. Let o be 4/22 - 31/i. Let a(q) = -q*3 - 4q + 8q + 2q*o + 2 + 2q*2. What is a(-2)? -6 Let j(q) = -2q*2 + 2. Suppose -2d + 1 = -3. Let o = 2 - d. Let z be (o + 2/(-2))2. Give j(z). -6 Suppose -2p + 29 - 13 = 0. Let b(s) = -s*3 + 9s*2 - 10s + 5. Determine b(p). -11 Suppose -3p + 2 = -4. Let t(k) = -4k - k + pk. Give t(-1). 3 Let q(u) = -u3 + 4u*2 - 4u - 1. Suppose -2 = -5k + 13. Let m be q(k). Let z(v) = -3v2 - v2 - 7v - v3 + 4v - 1 - 3. Give z(m). 8 Let k(m) be the third derivative of m4/24 - m3/6 + m2. Let x(h) = h2 - 3h + 2. Let l be x(3). Let w be 1/(21/l). Give k(w). 0 Suppose 65 = 3a + 50. Let y = 3 + -1. Let l(n) = -5 - 4n*y - 5n + 3n3 + 3n*3 - 5n*3. Determine l(a). -5 Suppose 11f = 20f + 45. Let z(y) be the second derivative of -y5/20 - 5y*4/12 + 2y*2 + y. Give z(f). 4 Let c(n) = -5n. Let h(d) = -4d + 5. Let p be h(-4). Suppose -4q - q = -4k - p, -4q + 22 = 2k. Calculate c(k). -5 Let r be 33/12 - (-1)/4. Let y(z) be the first derivative of -3z*2/2 - 21. Calculate y(r). -9 Let l be (-4)/8 - (-2)/4. Suppose 3p - 18 = 3s, -2s - 2p - 5 - 7 = l. Let t(z) = z2 + 4z - 7. Calculate t(s). 5 Let o = 32 + -32. Let v be (0 - 0) + 3-1. Let p = o - v. Let j(r) = r3 - 4r*2 + 4r + 1. Determine j(p). 4 Let r be -4 + -21(-2)/6 - 3. Let w(g) be the third derivative of rg + 0 - 1/120g6 - 1/8g*4 - 2g*2 - 2/3g*3 - 1/20g5. Give w(-3). 5 Let t(x) = x3 - 12x2 + 11x - 1. Let p(j) = -j*3 - 4j*2 + 3j + 1. Let s be p(-5). Let r be t(s). Let a(b) = 0b - 1 - b - 3b*3 - b. Calculate a(r). 4 Suppose 0o - 13 = -3p + o, -5o + 10 = 0. Suppose u = 4j + 5, 1 + 9 = 5u - pj. Let f(x) = -2x3 - x2. What is f(u)? -3 Suppose 0 = -2c - c + 9. Let t(u) = u2 - u3 + 1 + 2u*c - 3u + 6u - 2u. Let k(p) = 3p2 - 7p - 2. Let y(m) = k(m) + t(m). Give y(-5). 4 Let n(f) = 9f - 3. Let o(z) = 10z - 3. Let p(w) = -6n(w) + 5o(w). What is p(3)? -9 Let r(i) = -3i2. Let k be r(-1). Let a be (6 - 3 - 3)/(-2). Let h(j) = -j2 - 4j + aj + 5j + 4. Give h(k). -8 Let n(l) = -5l - 3. Let z be n(-3). Let p be 27/z + (-1)/4. Let y(d) = -2d*p - 3d - 2 + 3d2 - 3d. Give y(5). -7 Let i(h) = 4h3 + 4h*2 + 6h + 6. Let j(b) = 3b3 + 4b*2 + 5b + 6. Let v(q) = 2i(q) - 3j(q). Let l be ((-8)/6)/((-6)/(-18)). What is v(l)? 6 Let i(s) = s*3 + 7s*2 + s - 3. Let m(y) = 2y*3 + 8y*2 + 2y - 3. Let w(p) = -3i(p) + 2m(p). Let u be 3 + 0 + -2 + 3. What is w(u)? -9 Let x(n) = n*2 + 6n + 3. Suppose -3 = 2i - y + 13, i - 6 = -3y. Give x(i). 3 Let a(c) be the first derivative of -c*2 + 4c - 2/3c3 - 9. Calculate a(-3). -8 Let d(n) be the second derivative of n3/6 + 5n*2/2 + n. Let a be (-49)/(-2) + (-6)/12. Suppose -4p - a = -8. Calculate d(p). 1 Let a = 16 + -10. Let q(w) = 3w + a - 5 - 2w + 3. Determine q(-3). 1 Let s be (-3 - -2) + 3-1. Let r = -4 - s. Let g(j) be the third derivative of j6/120 - j4/24 - j3/3 - j2. Calculate g(r). -2 Let p(n) be the third derivative of -n4/24 + 2n3/3 + n2. Suppose -16 = -5i - 1. Suppose -5q - 2w = -28, -7q + 2q + 8 = -iw. Give p(q). 0 Suppose -2t + x - 13 = -4x, -3x + 9 = -t. Let y = 11 - t. Let k(d) be the second derivative of d5/20 - d4/3 - 7d*3/6 + 2d*2 + 3d. Calculate k(y). -6 Let v(r) = -r*3 + 5r*2 + 6. Let n be v(5). Let s = n + -6. Let p(j) = j + 2. Let l(u) = -3u - 4. Let y(i) = 2l(i) + 5p(i). Give y(s). 2 Let f(g) = -6g2 - 2g*2 - g - 2g + 6g2 - g3. What is f(-2)? 6 Let v(f) = f2 - 5f + 3. Let k be v(5). Let w(j) = 3 + k + 0 - 2j. Determine w(4). -2 Let b(x) be the third derivative of -4x*2 + 5/24x*4 + 0 + 1/120x6 + x3 + 1/12x5 + 0x. Let d = -7 - -3. What is b(d)? 2 Let x(l) be the third derivative of 0 + 0l4 - l2 + 0l + 1/60l5 + 1/6l*3. Let c(o) be the first derivative of x(o). Determine c(1). 2 Suppose 7a + 12 + 2 = 0. Let f(b) = -1 - 2b + 2b3 + b2 - 2b - 2. What is f(a)? -7 Let k(s) = 2s*2 + 2s + 8. Let a(f) = -f*2 - f - 4. Let u(l) = -5a(l) - 2k(l). Give u(0). 4 Let r be 5 + 4 + -2 + -1. Suppose -2u + 5u + r = 0. Let j(h) = -3h + 1. Let c(d) = -3d + 2. Let v(l) = 3c(l) - 4j(l). Calculate v(u). -4 Let b(x) = x2 + 12x + 2. Let s be b(-12). Let h(y) = 2y - y - 1 + 2y - sy. What is h(-4)? -5 Let f(p) = -5p*3 + 5p*2 - 7. Let w(x) = 9x*3 - 10x*2 + 13. Let h(o) = 11f(o) + 6w(o). Determine h(-5). 1 Let n(a) = a2 - a - 1. Let g(l) = -l3 + 9l*2 - 3l - 2. Let o(c) = g(c) - 2n(c). Determine o(7). -7 Let f be 0 + 2 + -2 - 1. Let x(u) be the third derivative of 1/6u3 - u2 + 0u - 1/15u*5 + 0 + 1/24u*4. Calculate x(f). -4 Let t = 13 - 8. Suppose ta = 11 + 19. Let s(f) = -5f + f + 1 + 3f. What is s(a)? -5 Let y(a) = 6a2 - 9a + 3. Let k(u) = 7u2 - 10u + 4. Let i(n) = -5k(n) + 6y(n). Let q be ((-1)/(-2))/((-7)/(-98)). Let w = 12 - q. What is i(w)? 3 Let f(t) be the first derivative of t*2/2 + 9. Suppose -g - 3d + 11 = 0, -g - 4d = -9 - 5. Let p be (-2 - -2) + 4/g. What is f(p)? 2 Suppose -3k + 11 = 2c, -c - 4c + 19 = -k. Let d(t) = -k + 4t2 - 4t2 + t2. Let s be d(0). Let n(x) = 5x - 1. Calculate n(s). -6 Let p(i) = 8i - 2. Let h(m) be the third derivative of m*4/24 - 2m*2. Let y(d) = 18h(d) - 2p(d). Calculate y(-5). -6 Let b(k) be the second derivative of k7/840 - k6/360 + k5/120 - k4/2 - 10k. Let x(o) be the third derivative of b(o). Calculate x(2). 9 Let u(j) = 4j + 3. Let o(d) = -8d - 6. Let p(l) = -6o(l) - 11u(l). Let q(n) = -1. Let b(i) = p(i) + 5q(i). Determine b(2). 6 Let l(q) = 4q*3 + q. Suppose -u - 6 = 5u. Calculate l(u). -5 Let p(b) = 3b3 + b2 + 1. Let k(j) = j - 7. Let z be k(5). Give p(z). -19 Let a(w) be the second derivative of 1/20w*5 - 1/2w*2 - 3w + 0 - 1/12w4 - 1/3w*3. Calculate a(2). -1 Let s(v) = 4v*3 - v - 1. Suppose 4 = -3g + g. Let j(q) = -2q3 - 2q*2. Let l be j(g). Suppose -5i = 3b + l, 5b = -2i - 2i - 9. Give s(b). -4 Let m(h) be the second derivative of -1/6h3 + 1/2h*2 + 0 - 2h - 1/6h4. Let r(d) = -d3 - 5d*2 + 5d - 5. Let t be r(-6). Determine m(t). -2 Let p(t) be the first derivative of t*3/3 + 3t*2 + 4t - 2. Determine p(-6). 4 Let z(p) = -p*3 - 7p*2 - 9p + 4. Let a be z(-5). Let l(o) = -4o - 1. Determine l(a). 3 Suppose -2d + 5n = -23, -d + 3n + 2 = -12. Let j(a) be the third derivative of 0 + a*2 - 1/12a*4 + 1/60a*6 + 0a - 1/6a3 - 1/60a*5. What is j(d)? -2 Suppose -3r - 6 = -q - 2r, 3q = 5r + 18. Let c(j) = 0j - q + 7 - j. Give c(-1). 2 Let g be (-21)/4 + (7 - (-135)/(-20)). Let f(l) = l*2 + 7l - 6. What is f(g)? -16 Let r(s) = -s*2 - 5s - 1. Let v(t) = -2t + 7. Let l be v(6). Let z(g) = g2 + 5g - 3. Let w be z(l). What is r(w)? 5 Let u(g) = -3g + 1. Let r = 4 - 6. Calculate u(r). 7 Suppose -v + 10 = 4a, 10 = 4a - 3a + 4v. Let c(j) = j2 + j + 2. What is c(a)? 8 Let r(d) = -d3 + 2d - 1. Suppose -4 + 3 = g. Let q be g/(-2)0 + 1. Determine r(q). 0 Suppose -4 + 2 = n, p + n - 2 = 0. Suppose m - 10 = -pm. Let o(z) = z*3 - 3 - 2z*2 - 5z2 + zm + 5z. Calculate o(5). -3 Let t(r) be the second derivative of r4/12 + 4r*3/3 + 7r*2/2 + 14r. What is t(-6)? -5 Suppose -62 = 2k - 68. Let x(y) be the first derivative of 3y*2/2 - 4y - 2. Calculate x(k). 5 Let q(c) = -5c2 + c + 0 + 1 + c3 - 1 - 1. Let j be q(5). Let d be ((-3 - -1) + j)/1. Let a(i) = -i2 - 4i + 3. What is a(d)? -9 Let j be	{ "pile_set_name": "DM Mathematics" }
when g is divided by b. 2 Suppose 0 = 2g - 4 - 30. Let b = 89 - 57. What is the remainder when b is divided by g? 15 Suppose -13x = -10x - 51. What is the remainder when x is divided by 8? 1 Suppose 49 = 3s + 1. What is the remainder when 126 is divided by s? 14 Let l be 2 + 376/((-16)/(-4)). Suppose -3c + 3t + l = 0, 89 = 3c - 3t + 7t. Calculate the remainder when c is divided by 17. 14 Let r(o) = -o2 - 18o - 4. Calculate the remainder when r(-15) is divided by -1 + (2 - 4) + 14. 8 Suppose 37 = -d + 5j, -3d + 0d = 3j + 21. Let c = -1 - d. Calculate the remainder when 30 is divided by c. 8 Let h = 4 + 14. Suppose -2 = 2y - 3y. Suppose -yq + 4q = h. Calculate the remainder when q is divided by 5. 4 Let q(o) = -o*3 + 6o*2 + 6o + 3. Let r be q(7). Calculate the remainder when 22 is divided by (r/3)/(5/(-30)). 6 What is the remainder when 26 is divided by (-4 + 4 + 5)3? 11 Let q(c) = -c3 - 4c*2 - 2c + 4. Calculate the remainder when 167 is divided by q(-4). 11 Let z(s) = s + 1. Let c be z(-2). Let k = c - -1. What is the remainder when 19 + (k/2 - -2) is divided by 11? 10 Suppose -2k - 1 = -7. Calculate the remainder when 3 is divided by k. 0 Let o = -1 + -2. Let w = -3 - o. Suppose wa + 4 = 2a. Calculate the remainder when a is divided by 2. 0 Let x(m) = -27m - 4. Let r(y) = 13y + 2. Let k(s) = 9r(s) + 4x(s). Calculate the remainder when k(5) is divided by 12. 11 Suppose 3x - 2q - 2 = 0, q = -3x - x - 12. Calculate the remainder when (35/x)/(3/(-6)) is divided by 12. 11 Suppose 0q + 3z = -5q - 18, 2q = -z - 7. Let u = q - -5. Let a(d) = 3d2 - 3d + 2. Calculate the remainder when a(u) is divided by 5. 3 Suppose 4 + 2 = 3s. Suppose sf = -0a + 4a - 10, -4a = f - 1. What is the remainder when 2 is divided by a? 0 Let k = 2 - -1. Suppose 0 = kt - y - 1, -2y - 4 + 3 = -5t. What is the remainder when ((-4)/6 - 3/(-18))-2 is divided by t? 0 Suppose 19 = 5d - 6. Let r(j) = j - 2 - 5j - 4 + 2. Calculate the remainder when r(-3) is divided by d. 3 Let n(w) be the third derivative of w4/24 + 2w*3/3 + 4w*2. Let y be n(-2). Suppose yz + 0z = 52. Calculate the remainder when z is divided by 9. 8 Let x = 30 - 51. Calculate the remainder when 36 is divided by (-14)/x114/4. 17 Let a = -9 + 10. Calculate the remainder when (-1)/(-2)(3 + 1) is divided by a. 0 Let c = -70 + 109. Calculate the remainder when 193 is divided by c. 37 Suppose -3f = 4j - 74, 0j + 3f = -5j + 91. Calculate the remainder when 115 is divided by j. 13 Suppose 9u - 48 = 5u. What is the remainder when 46 is divided by u? 10 Let m = -4 + 13. Let d(b) = b*2 - 7b - 6. Calculate the remainder when d(m) is divided by 7. 5 Let b(g) = 2g3 - 2g*2 - 4g + 9. What is the remainder when b(3) is divided by 21? 12 Suppose 6m = 2m + 2x - 66, -2m - 48 = 2x. Let w = 4 - m. What is the remainder when w is divided by 12? 11 Let p(m) = -11m + 1. Let d(c) = c*2 + 7c - 6. Let i be d(-7). Calculate the remainder when p(i) is divided by 23. 21 What is the remainder when 127 is divided by (-1890)/(-72) - (-2)/(-8)? 23 Let a be 2/2 + (0 - 24). Let y be (-3 - -2) + (0 - 14). Let u = y - a. What is the remainder when u is divided by 5? 3 Suppose 2q - 126 = -q. Let g = q - 30. What is the remainder when 23 is divided by g? 11 Let p = -20 - -33. What is the remainder when 36 is divided by p? 10 Suppose 4t = f + 9, -3t - 3f = -8f + 6. Let l = t - 3. Suppose -8b + 4b + 20 = l. What is the remainder when 13 is divided by b? 3 Let i = -18 - -36. Calculate the remainder when 35 is divided by i. 17 Calculate the remainder when (15/(45/(-102)))/((-3)/9) is divided by (-2)/((-4)/70) + 0. 32 Suppose 6h - h = 60. Suppose -5i + 99 + 101 = 0. Calculate the remainder when 1865/i + 3/8 is divided by h. 11 Suppose -v - 3v = -144. Suppose 2q = -2q + v. Suppose 0z - u + 39 = 2z, -5z = u - 90. What is the remainder when z is divided by q? 8 Suppose 0 = s - 8 + 4. Let g = 60 + -34. Suppose -sw = -x + g, x + 0x - w - 11 = 0. Calculate the remainder when 10 is divided by x. 4 Suppose 4q - 22 = 2q + 4v, 5q = 5v + 35. Let p(x) = x*3 - 2x*2 + x + 1. Calculate the remainder when p(q) is divided by 5. 3 What is the remainder when ((-2)/3)/(6/(-9)) is divided by 1? 0 Suppose -7g + 24 = -4g. Let j = g + 8. Calculate the remainder when 29 is divided by j. 13 Let m(c) = -5c - 4. Let h(w) = 2w2 - 3w - 14. What is the remainder when h(-6) is divided by m(-6)? 24 Let c(x) = x*3 + 5x*2 - x - 1. Let o be ((-4)/(-2) - 1) + -6. What is the remainder when 13 is divided by c(o)? 1 Let i = -23 - -55. Calculate the remainder when ((-682)/(-33))/((-1)/(-3)) is divided by i. 30 What is the remainder when 36/60 + (-212)/(-5) is divided by 16? 11 Let k(c) = -3c + 1. Let i(u) = -2u - 1. Let p be i(-1). Let z(r) = 21r2 - 1. Calculate the remainder when z(p) is divided by k(-2). 6 Let n(d) = -d3 + 4d2 + 7d + 1. Let g = 22 + -16. What is the remainder when n(5) is divided by g? 5 Let j(w) = w*3 + 7w*2 + 4w - 1. Calculate the remainder when j(-6) is divided by 6. 5 Let t(n) = n*2 - 4n - 7. Calculate the remainder when t(-4) is divided by 13. 12 Let n(k) = -k - 7. Let f be n(-7). Suppose f = c - 3t - 41, -5c + t = 6t - 105. Calculate the remainder when c is divided by 9. 8 Suppose 3y + 3 = 4y. What is the remainder when 46 is divided by ((-18)/7)/(y/(-28))? 22 Suppose 5c - 20 = -5z, 0 + 5 = -5z. Calculate the remainder when 14 is divided by 0(-2)/6 + c. 4 Let z = 7 - 7. Suppose -4w + 34 = -2b, -14 = -zw - 2w + 4b. What is the remainder when 16 is divided by w? 7 Suppose 0 = 3j - 3b + 24 + 27, -b + 59 = -4j. Let m = j + 34. Calculate the remainder when m is divided by 1 + 1/(2/20). 9 Let l(b) = 4b*2 - 2b + 2. Calculate the remainder when l(3) is divided by 11. 10 Let z = 7 - 5. Suppose a + 16 - 1 = 0. Calculate the remainder when z is divided by (-4)/(-14) + a/(-21). 0 Let z(s) = s*2 - 31s + 39. Calculate the remainder when 17 is divided by z(30). 8 Calculate the remainder when 18 is divided by ((-15)/(-2))/(6/8). 8 Suppose 2v = -y - v - 17, -4y - 13 = v. Calculate the remainder when 12 is divided by (-3 - -4)/(y/(-14)). 5 Let d be ((-20)/(-8))/(-5)-44. Suppose t + d = 3t. Calculate the remainder when t is divided by 7. 4 Suppose m + 3t + 8 = 0, 60 = m + 4m - 5t. Calculate the remainder when 26 is divided by m. 5 Let r = 46 + -4. Suppose -y + 3y - 4b = 30, 3b + 17 = y. Calculate the remainder when r is divided by y. 9 Suppose 0 = -3f - 155 + 1475. Calculate the remainder when 39 is divided by f/30 - (-4)/(-6). 11 Suppose -5m - 3l + 124 = l, 3l = -12. What is the remainder when m is divided by 16? 12 Let b be (24/30)/(2/20). Let i be 34/b - (-2)/(-8). Suppose -ic + 20 = -2c. What is the remainder when c is divided by 4? 2 Let s(x) = -3x2 + x - 1. Let l(p) = p2 - p + 1. Suppose -2v + 2 = -3v. Let i(t) = vs(t) - 5l(t). Calculate the remainder when i(-4) is divided by 1. 0 Let l(w) = -w - 6. Let d(v) = -6v - 31. Let o(s) = -2d(s) + 11l(s). Let u(z) = 3z + 1. Let p be u(3). Calculate the remainder when 11 is divided by o(p). 5 Let v(u) = 2u*2 + 6u - 4. Let w be -5 + 1 - (0 + 2). Suppose 33 = 5q - 22. What is the remainder when v(w) is divided by q? 10 Let a(k) = 4k*2 + k - 4. Calculate the remainder when a(-3) is divided by 5. 4 Let n(v) = -2v + 3. Let r be n(4). Suppose 3i - 3d + d = 136, 92 = 2i - d. Let g = i - r. Calculate the remainder when g is divided by 14. 11 Suppose 5y = -5k + 70, 5k + 17 = -3y + 89. What is the remainder when 27 is divided by k? 12 Suppose -4w + 2 = -3w. Let g be -1 + w + 6 + -2. Suppose 0 = -5o + gl - 3 + 33, -3l = 2o - 12. Calculate the remainder when o is divided by 4. 2 Let c = -162 - -245. Let k = -33 + c. What is the remainder when k is divided by 18? 14 Let t = 126 + -52. Let d = 39 + -24. Suppose 0 = 4f + 5g - t + d, 65 = 4f - g. Calculate the remainder when 46 is divided by f. 14 Suppose 0o = 5o - 30. Let l be ((-7)/3)/(1/o). Let u = -1 - l. What is the remainder when 24 is divided by u? 11 Suppose -12*f + 509 + 319 = 0. What is the remainder when f is divided by 35? 34 Calculate the remainder when (-26)/(-91) - 313/(-7) i	{ "pile_set_name": "DM Mathematics" }
-34 - -39. Solve d + 13 = -f - 3s, f = 2s + 7 for f. -3 Let n be (-4)/6 + 6/9. Suppose 8 = w - 2k, -2w - 2k + 10 = -4k. Solve wx + 2 = h + x, n = 5x + 10 for h. 0 Suppose 0a = a + 2. Let x be (1 + -1)/((-2)/a). Let h = 70 - 64. Solve -5c - u - 26 = x, hu = -4c + 2u - 24 for c. -5 Let z be 28/(-10) - 1/5. Let i = z + 0. Let j be 4 + (-2)/i-3. Solve 5g + d - 22 = 0, 4g + jd = -0g + 14 for g. 5 Let o be 450/(-55) + (-4)/(-22). Let w be (4/(-14))/(o/56). Solve -n - 14 = -wj, -j + 2n - 2 = -3j for j. 5 Let x be 297/55 - 4/10. Solve -5g = z, -6g - 2z - x = -g for g. 1 Let b be 1/(-3) - (-4)/12. Suppose b = -c + 2c - 1. Solve 0 = x + 5f + 15, 3x + c + 4 = -5f for x. 5 Suppose 6 = -3a + 2a - 2q, -2a = -5q - 33. Solve 0 = -3n - 2n - ai + 22, -4n = 5i - 23 for n. 2 Let l = -82 + 83. Suppose 2a + 0a - 5j = 47, 0 = a + 3j + 4. Solve 0 = -3i + 2g + a, 4g - l = -i + 2g for i. 3 Suppose -4 = d + 3l, -12 = -2d + 5d + l. Let t = -6 - d. Let b be 30/(-25)5/t. Solve -bn + 2 - 1 = -4z, -2z = -2n + 2 for n. 3 Let c = -1 - 0. Let x be (0(-2)/(-6))/c. Let i be (42/(-9) - x)-3. Solve -4h + y + i = 0, -4y - 8 = 2h - 6h for h. 4 Let p(d) = -5d + 60. Let h be p(11). Solve -h = 5y, 2g + 3 + 2 = -3y for g. -1 Let b be (16/(-12))/(6/(-9)). Solve 0 = -3u - f - 8, 2u + 5f + 7 = -bu for u. -3 Suppose -g = -2g. Solve -x + 4m - 17 = g, 3m - 7 = -5x - 0 for x. -1 Suppose -5f - 38 = -58. Solve 5m = m - f, 0 = -4a - 5m - 13 for a. -2 Let s be 1/(((-3)/(-15))/1). Solve -3i + 22 = 2j, j = -0j + s for i. 4 Let u = 17 - 12. Suppose 0 = m + i - 5, -3m - ui = -3i - 14. Solve -2t - 23 = 5f, -mf - f = t + 24 for f. -5 Let n(x) = -2x*2 + 4x - 2. Let y be n(2). Let d = -4 - y. Let q = 2 - d. Solve -qo + v + 7 = o, 0 = 5o - 2v - 9 for o. 1 Let w be 26/4(0 + 2). Let f(k) = 3k2 + 7k - 3. Let i be f(4). Suppose -w + i = 4v. Solve 5d = 0, 2d - d = 3j - v for j. 5 Let q(n) = -n*3 + 2n*2 + 3n - 3. Let h = 0 - -2. Let b be q(h). Solve 5 = 6l - l + bj, 2j + 26 = 4l for l. 4 Let m(n) = n*2 + 3n. Let a(j) = -2j2 - j + 2. Let r be a(-2). Let z be m(r). Solve 0 = -4g - g - 2c + 14, -zg + 2c = -22 for g. 4 Suppose -3j = -9, -2a - 4j + 5j = -45. Let z = a + -12. Solve 0 = -4o + 4l - 0 - z, -5l = -2o for o. -5 Let a = 6 + -2. Suppose -5c + p = 1, ac + 2p = 6p - 4. Let g be ((-4 - -2) + c)-2. Solve gn - 3w + 10 = -w, -5n + 5 = w for n. 0 Let v be (-2)/((4/(-40))/((-3)/(-12))). Solve -5d + v = -0z - 3z, 0 = -2d - 4z + 2 for d. 1 Let o be -2 + ((-16)/(-12))/(4/30). Solve x - 5f = -10, -o = -3x + x - 4f for x. 0 Let w = 88 + -77. Solve -b - 5h + 11 = -w, 4b - 24 = -4h for b. 2 Let j(f) = -f + 6. Let u be j(6). Suppose 3l - 6 - 6 = u. Solve k + 1 = 5z, -k + 0k - 1 = -lz for z. 0 Suppose -4n - 8 = -5t - 2n, 3t = 5n + 20. Solve 0 = -3w - 2g - 0g, t = -w - 4g - 10 for w. 2 Let f = 16 - 10. Solve 2 = d + d, -2d - f = -2z for z. 4 Let a(x) = 6x - 30. Let t be a(9). Solve -2f = f + 15, 0 = 2c - 4f - t for c. 2 Let x(g) = 3g + 83. Let n be x(-27). Solve -12 = -4o - c, n - 24 = -5o - 3c for o. 2 Let k = 20 + -15. Solve -3o = kx - 2o + 4, -x - 3o = 12 for x. 0 Let h = -12 - -7. Let t(a) = a2 + 4a - 1. Let m be t(h). Suppose -y - 2 = -m. Solve -5x = -5l + 15, -3x - l = y + 7 for x. -3 Let p(j) = j2 - 3j - 13. Let k be p(6). Solve -12 = -kd - 4f, 0 = -9f + 4f - 10 for d. 4 Let p(a) = 2a - 3. Let q = 9 + -5. Let t be p(q). Solve -4r = tf + 5, 5f + 9 + 1 = -3r for f. -5 Suppose y - 5c - 15 = 0, 3y = 2y - c + 27. Let r = y - 18. Solve 2t + i = -2, rt - 3t + 4i = -12 for t. 1 Let g(w) = 7w - 2. Let c be g(1). Solve -3b + 2b - 2 = 0, -3b - 1 = cz for z. 1 Let f be 36/10 + 2/5. Let u(v) = -4v*3 - 8v*2 - 5v - 4. Let k be u(-2). Solve h = fi - 7, -3i + 13 = 2h - k for h. 5 Suppose 4i + 16 = 3b + 2i, -2b + 5i + 29 = 0. Suppose -g = -m + 2g + 17, -3m + 62 = bg. Solve 0 = 4l - 5x + 16 + 4, -5x - m = 4l for l. -5 Let a be (-39)/(-6) - 7/(-14). Solve -5q + 16 = -3s, 0s + s - 2q + a = 0 for s. 3 Let p be (-3)/2(-2)/(-1). Let t be (-2)/2 + p/(-3). Let l be (t - 0) + -1 + 5. Solve r + lr + 3w = 17, -9 = 3r - 3w for r. 1 Let w = 2 - 0. Solve -f = 5m - 28, m - w = f - 0f for f. 3 Let j = 8 - 5. Suppose 0 = 3u - v - 53, -u + 59 = ju + v. Solve 4d - 2 - 2 = -4l, -5l + 2d = u for l. -2 Let o = -68 - -80. Solve 4n = 2v - o, -3n + 0 = 2v + 2 for v. 2 Suppose -6 = -2v - 0. Solve -vx - 2 = -4t - 3, 0 = 2x + 5t - 16 for x. 3 Suppose 3q + 3 = -3d + 30, 0 = -2d - q + 15. Suppose -du + 3u = -6. Solve -3n - 10 = 2h, -un + 4h = h - 2 for n. -2 Suppose 0 = -4x + 7 - 3, 5s - 21 = -x. Solve 0 = -sh + 6h - 8, -22 = 5a - 3h for a. -2 Let l(c) = -6c + 3. Let m be l(2). Let w be (-6)/9m/3. Solve 4n = 2y + 2, 5 = 2y + wy - 5n for y. 5 Suppose 2i + 4r + 24 = 0, 2i = -r - 6 - 6. Let f be i/(-32) - (-23)/8. Solve -4w + 12 = 5x, fx - 5w + 15 = 7x for x. 0 Let s(u) = -u2 + 2u. Let j be s(2). Suppose -t + 1 = -jt. Suppose -2g = 4v, 0 = -g + 5v + 5 + 9. Solve -p + 4i - 2 = t, -gi - 6 = 2p for p. -3 Suppose 0 = 5x + 4f - 2f + 8, 4x = -3f - 5. Let j(i) = i*2 + 1. Let n be j(x). Solve -nt - 32 = 4w, -2w - t = -3t - 2 for w. -3 Let d(s) be the second derivative of -s5/20 - s4/6 + s3 + 3s*2 + 4s. Let h be d(-4). Solve -6a = -2z - 3a - 5, -2a + h = 4z for z. 2 Let j be (6 - 13)(-8)/14. Solve 3k + 9 = z, -z + 10 = -jk - 2 for z. 0 Suppose 2m + 4g - 31 = -11, 0 = 2g - 6. Suppose -5q + 30 = -b + 6b, b - q = -2. Solve -ma + 16 = 5d - ba, 0 = 2d + 2a - 4 for d. 4 Suppose -4f - 3i = -42, -5i - 11 - 24 = -5f. Let u be ((-54)/4)/(f/(-12)). Solve 5v + 0q = q + u, -4v - 3 = 5q for v. 3 Suppose -2p + 0p = 0. Let r be 5 - 2 - (0 - p). Solve 0 = -8m + rm + u - 1, -2m - 5u = 22 for m. -1 Suppose -10 = 9q - 14q. Solve 4d = -n - 12, 0d + qd + 6 = 3n for d. -3 Let t = -43 - -46. Solve 0 = -tr - 4d - 12, 4r = 2d - 16 - 0 for r. -4 Suppose 10 = -2g - 3g. Let i be (-1 - (g - -2))-12. Solve 2t + h + i = 0, -4h = 5t + 25 + 8 for t. -5 Let r be 6(-2)/(-4 + 0). Solve -3 = -3k - rb, 4 = 3k - b + 1 for k. 1 Let u(p) = 4p2 + 2p - 1. Let l be u(1). Solve 2y - lr = 26, 5y - 5r = -0y + 35 for y. 3 Suppose 0 = -z - 3z. Suppose 5t = -3m + 8, -2m = -3t - 2t - 22. Let f be 78/21 - m/(-21). Solve z = -k + fn + 16, -2n = -2k + 6 + 2 for k. 0 Let l = -3 + 8. Let t be 46/l + (-3)/15. Solve 3j - 1 = 5s - 10, -2s = 3j + t for j. -3 Let n(o) = -o*2 - 2o + 4. Let d be n(-3). Let m be 6/5 - 4/20. Let i = m - -1. Solve -5b + 4 = -d, -ir + 6 = 4b for r. 1 Let j = -7 - 14. Let f be 76/14 + 9/j. Solve -15 = -3s - 4p, 5s - 19 = s - fp for s. 1 Suppose l - 2l - 43 = 3j, 14 = -2j + 3l. Let o = j + 15. Suppose 4g - 17 = -y, -4g + 2g + 4 = 2y. Solve -gm + ov + 21 = 0, v = -2m + 5 + 7 for m. 5 Let q(p) = -p*3 + 5p*2 + 16p - 9. Let j be q(7). Solve jc = -n + 1, 0 = -c + 2c + 5n - 5 for c. 0 Let m(h) = -4h + 2h + 1 + 2h*2 + 5h. Let l be m(-2). Solve 0 = -lc + 6c + 2z - 3, -c + 2z = -1 for c. 1 Let d be 9((-2)/(-6))/1. Suppose -6h + 4 = -4h. Suppose 3n - 6c = -dc + 9, 0 = hc + 6. Solve -4b + 5v = -15, -2b - 5v = -nv - 15 for b. 5 Let u be (-1 - (-8 + 0 - -2))1. Let f be ((-8)/(-6))/((-6)/(-9)). Let t be (2/f)/(1/1). Solve -4z + 7 + t = 3b, 0 = z - u for b. -4 Let j = -30 - -37. Solve 2k = -u - 6, 5u - k - 7 = j for u. 2 Let c = 1 - 2. Suppose 0 = 5x - a - 11, -3a = -x - 5a. Let v = x - c. Solve -3l + v = 5h - 0, -5h = -4l - 31 for l. -4 Let h(b) = b*3 - 3b*2. Let v be h(3). Let q be 4/8 - 9/(-6). Suppose -d - q = -7. Solve 2i = v, di = -4y - 14 + 2 for y. -3 Suppose 3n - 4n = 3n. Let g = -10 - -15. Solve 4x + gf - 6f = 17, n = 2x + 4f - 4 for x. 4 Let d(k) = -k*3 - 5k*2 + 7k - 5. Let l be d(-7). Suppose -a = -2a + 2i - 2, l = 3a + 4i. Solve -2f + 3r - 16 = 0, 2r - 24 = -4f + af for f. -5 Suppose -3 = -2x + 1. Let s = x + 2. Solve j + sj - 7 = -4o, -4o = -3j - 15 for j. -1 Let j be (2 + -30)(2 + (-25)/10). Solve 0 = -2t + 3w - 2 - 5, 0 = -t + 5w - j for t.	{ "pile_set_name": "DM Mathematics" }
? 3 Let j = -3716 - -6283. What is the tens digit of j? 6 Let p be -88 + (3 + -4)/(-1). Let h = p + 122. What is the units digit of h? 5 Suppose -1417 = -5y - 422. Suppose 5j = -3w + 217, -3w + 4j + 0j = -y. What is the tens digit of w? 6 Let d(q) = 127q2 + 5q - 16. What is the tens digit of d(2)? 0 Let d(n) be the third derivative of n4/24 + n3/2 - 12n2. Let y be d(-2). Suppose -2t - 7 = -y, -2t = 4g - 6. What is the units digit of g? 3 Suppose -5g = -3m - 415, m = -g - 0g + 75. Suppose -6s = -g + 26. What is the units digit of (-6)/s(0 - 36)? 4 Let p = -897 + 938. What is the units digit of p? 1 Let a(w) = -w2 + 36w - 72. What is the hundreds digit of a(14)? 2 Let p be ((-1)/2)/((-2)/12). Suppose pv + 2v - 10 = 0. Suppose -vu = 3m - 53 + 2, -4m - 31 = -u. What is the units digit of u? 7 What is the units digit of (-837)/36(-1 + (-9)/3)? 3 Let j be 1/(3 + (-26)/8). Let f be 1/j56/(-7). Suppose 5s - 4s - fi = 9, 3i = -3s + 18. What is the units digit of s? 7 Let h(n) = 153n + 2476. What is the thousands digit of h(0)? 2 Suppose -w = 3z - 1468, 2z - 3w - 1454 + 490 = 0. What is the hundreds digit of z? 4 Let t = 32 + -36. Let x(n) = -10n. What is the tens digit of x(t)? 4 Suppose 25 + 3 = 2a. Suppose -2z - 17 = -1. Let d = a + z. What is the units digit of d? 6 Let c(x) be the third derivative of x6/240 + x5/40 - 3x4/8 - x2. Let r(o) be the second derivative of c(o). What is the units digit of r(11)? 6 Let q(j) be the second derivative of j*5/20 - 5j4/6 + j3/2 + j*2 + 4j. Suppose h - u + 2 = 11, 0 = -h + 5u + 5. What is the tens digit of q(h)? 3 Let j be -4 - (-4 + (-30)/(-5)). Let p(u) = -5u - 14. What is the tens digit of p(j)? 1 Suppose -10y + 7080 = -4910. What is the thousands digit of y? 1 Let b(j) = -j2 + 11j + 6. Let g be b(8). Let s = g + -16. Let r = 41 - s. What is the units digit of r? 7 Let z(d) = 3d2 + 3d - 24. Let p(f) = -f*2 + 7f + 35. Let q be p(10). What is the units digit of z(q)? 6 Let k(o) = -37o3 - o2 + o + 6. What is the tens digit of k(-2)? 9 Let b = 361 - -1. What is the tens digit of b? 6 Suppose 0l - 13l = -2847. Let x = 367 - l. What is the units digit of x? 8 Let m be (11 + -23)/(-2 + 0). Let f be (8/m)/((-4)/(-15)). Suppose 0 = -fi - 82 + 257. What is the units digit of i? 5 Let j(b) = -b - 16. Let r be j(0). Let x = r - -46. What is the units digit of 708/x + (-2)/(-5)? 4 Suppose -a + 2c + 14 = 4a, 4 = -2c. Suppose -1 = -aq + 11. What is the units digit of 2/4q + 4? 7 Let w be 8440/64 - 2/(-16). Suppose 8h - w = 6h. What is the tens digit of h? 6 Let w be (-543)/(-4) + 24/96. Suppose 38p - 40p + w = 0. What is the tens digit of p? 6 Suppose -5z = -z - 8. Suppose zm = m + 29. What is the tens digit of m? 2 Let k(s) = s3 + 4s*2 + s - 4. Let n be k(-4). Let t be n/36 - (-2450)/9. What is the units digit of t/2413? 4 Let h be 122/42. Suppose 3w - h = -w. Let c(q) = 2q2 + q - 2. What is the tens digit of c(w)? 1 Suppose 3n + 3t + 264 = -t, -t + 81 = -n. Let g = -40 - n. What is the units digit of g? 4 Suppose -14g - 874 = -15g. What is the units digit of g? 4 What is the hundreds digit of 13308 - (-85 - -75)? 3 Suppose -184 = -4d + 92. Let s = 99 - d. What is the tens digit of s? 3 Let s = 7 - 2. Suppose -5p = 4j - 271 - 552, -349 = -2p + sj. Suppose 0 = -4w + 21 + p. What is the tens digit of w? 4 Let u be -26 + (2 - 2)/(-4 + 6). What is the tens digit of (-2)/(u/327) + (-12)/78? 2 Let m(h) = 4h2 - h - 2 - 5h*2 + 4h*2. Let c be m(-4). Suppose -c = -j + 16. What is the tens digit of j? 6 Suppose z = y + 151 + 284, -y + 445 = z. What is the units digit of z? 0 Let y = 5 - 5. Let v be (-4 - -2)-1 - y. Suppose -a - 22 = 2q - 85, -vq + 81 = -5a. What is the units digit of q? 3 What is the tens digit of 522/957 + 6330/11? 7 Let a(u) = -14 + 12u*2 - 122u*3 + 236u*3 - 12u - 115u3. What is the tens digit of a(7)? 4 Let o(x) = -6x*3 + 4x*2 + 4x - 25. Let b(v) = 5v3 - 4v*2 - 4v + 25. Let l(s) = 5b(s) + 4o(s). What is the hundreds digit of l(8)? 2 What is the tens digit of 3/263046/87? 8 What is the hundreds digit of (10045/861)/(0 + 1/12)? 1 Suppose -11h - 5p = -15h + 7611, 0 = -3h - 2p + 5714. What is the hundreds digit of h? 9 What is the tens digit of (12/15)/(2/(-5)) - -126? 2 Let u(a) = -a*3 - 6a*2 + a + 8. Let r be u(-6). Suppose 4h = h - rt + 60, -t = 2h - 39. Let n = 20 - h. What is the units digit of n? 2 Let x be 0 + (-2 - -18)/4. Suppose xd = 4q - 8q + 304, -3d - 388 = -5q. What is the tens digit of q? 7 Let t(h) = h - 8. Let o be t(13). Suppose ol - 173 = n, -68 = -2l - 0l + n. What is the units digit of l? 5 Let u(c) = 4c - 1. Let s be u(1). Suppose d - sd = -82. What is the units digit of d? 1 Suppose 8d - 3d - 10 = 0. Suppose 9 = dh - 3h. What is the tens digit of (-182)/h + 4/(-18)? 2 What is the tens digit of 67/((-24)/(-6)(-1)/(-4))? 6 Let a(f) = f2 - 9f - 14. What is the units digit of a(-5)? 6 Let g(h) = 3h2 + 4h + 1. Let l be g(3). Let b be l/10 + 2-1. Suppose 3u + 4s = 117, 5u + bs - 181 = -0u. What is the tens digit of u? 3 Suppose -31 + 25 = 3w. What is the tens digit of w((-4)/1)/(-4)-82? 6 Suppose -1638 = -3u + 9k - 12k, 2u + 5k - 1077 = 0. What is the tens digit of u? 5 What is the tens digit of 16/80 - 2958/(-10)? 9 Let q(u) = -u*3 + 4u*2 + 10u + 2. What is the units digit of q(-8)? 0 Let b = 30 + -25. What is the tens digit of (146/b - 2)5? 3 Let d = -188 + 191. Suppose -2g - 14 = -4g. Suppose gc - 252 = dc. What is the tens digit of c? 6 Let c be -1 + (5/7 - (-18)/63). Suppose cl + 4l = 416. What is the tens digit of l? 0 Let f(b) = b3 + 5b*2 - b. Let o be f(-5). Suppose 3 = -ov + 13. Suppose -vj + 5g + 28 = -3, -j = -2g - 15. What is the units digit of j? 3 Suppose -286j + 288j = 2852. What is the tens digit of j? 2 Let c(v) = v3 - 12v*2 - 14v + 15. Let x be c(13). Suppose 3a = a + x. Let l = 2 + a. What is the units digit of l? 3 Let x(q) = -9q*3 - 2q*2 + 9q + 14. What is the units digit of x(-5)? 4 Let k be (-4730)/(-15) - (-3)/(-9). Suppose -k - 205 = 5c. Let p = -60 - c. What is the units digit of p? 4 Suppose 0 = -3k + 12, -4k - 3874 = -4z + 2z. What is the tens digit of z? 4 Let q = -1380 + 2670. Suppose 3h - q = -5u + 2h, 1032 = 4u + 4h. What is the tens digit of u? 5 Suppose 9492 + 27548 = 20k. What is the tens digit of k? 5 Let l(n) = -n - 1. Let x be l(-5). Let o(p) = 27p - 30. What is the units digit of o(x)? 8 Let b be (-3 + 4/(-12))-3. Suppose k - 3 = 2j + 1, 5j - b = 0. What is the units digit of k? 8 Let x(u) = u2 + 2u - 7. Let m be 52/14 + (-12)/(-42). Let p be x(m). Suppose z - 9 = p. What is the tens digit of z? 2 Suppose 4y + 2a - 2685 = y, 0 = -2y + 4a + 1806. Suppose -10c = 107 - y. What is the tens digit of c? 7 Suppose 6t = -6t + 5568. What is the hundreds digit of t? 4 Let v(t) = t3 - 5t*2 + 3t + 3. Let q(z) = -z*2 + 7z + 7. Let y be q(8). Let b(w) = w. Let j(n) = yv(n) + 4b(n). What is the tens digit of j(4)? 1 Let m(o) = 22o2 + o + 12. What is the hundreds digit of m(3)? 2 Suppose -31 = 2n + 31. Let f = n - -58. What is the units digit of f? 7 Let l(k) = k3 + k2 - k - 124. Let j be l(0). Let n = j + 186. What is the units digit of n? 2 Let z(s) = -s*3 - 6s*2 - 7s - 1. Let d(y) = -y*3 + 5y*2 - 2y + 5. Let n be d(5). Let w be z(n). What is the tens digit of 4/12 - (-114)/w? 1 Let z be 18/3 - (0 - -1). Suppose zf = 63 + 167. What is the tens digit of f? 4 Let i(z) = 4z - 8. Let j be i(3). Suppose 6 + j = 5d. Let m(r) = r. What is the units digit of m(d)? 2 Suppose -4q - 19 = -s, -5q + 5s - 17 = 3. What is the units digit of q/(4/(-210))? 5 Suppose -4289 + 1157 = -4r. What is the hundreds digit of r? 7 Suppose -9o + 14820 = -5o + 2t, -4t + 11125 = 3o. What is the thousands digit of o? 3 Suppose 7o - 4o = 3, -2o = -4b + 9326. What is the thousands digit of b? 2 Suppose 0z = -2z - f + 10, 2f = -2z + 14. Let t(i) be the first derivative of i3/3 - i2/2 - 4i + 14. What is the units digit of t(z)? 2 Suppose 8 = 4x - 4. Suppose -4o + 406 = x*o. What is the tens digit of o? 5	{ "pile_set_name": "DM Mathematics" }
ppj? 1/171 Four letters picked without replacement from uoommsmmmumu. What is prob of picking 2 o and 2 u? 1/165 What is prob of picking 4 i when four letters picked without replacement from {i: 6}? 1 Four letters picked without replacement from {o: 1, s: 2, q: 1, b: 2, w: 2}. What is prob of picking 2 w, 1 o, and 1 s? 1/35 What is prob of picking 1 l, 1 v, and 1 t when three letters picked without replacement from {t: 2, n: 6, v: 4, a: 4, c: 2, l: 1}? 8/969 Two letters picked without replacement from bbhhkbshtuk. Give prob of picking 2 t. 0 Calculate prob of picking 1 e and 1 n when two letters picked without replacement from {e: 13, n: 5}. 65/153 Four letters picked without replacement from {d: 5, g: 5, p: 8}. Give prob of picking 1 g, 2 p, and 1 d. 35/153 Three letters picked without replacement from {y: 1, v: 2, x: 2, s: 1, j: 2, r: 5}. Give prob of picking 1 j, 1 v, and 1 x. 4/143 Four letters picked without replacement from {o: 1, d: 4, v: 1, e: 2, x: 1}. Give prob of picking 1 o, 1 v, and 2 e. 1/126 What is prob of picking 4 q when four letters picked without replacement from {h: 3, q: 3, u: 1}? 0 Four letters picked without replacement from {h: 3, i: 7, v: 1, k: 3, l: 3, g: 2}. Give prob of picking 1 v and 3 k. 1/3876 Three letters picked without replacement from zzdqzduzquuuzdqzqz. Give prob of picking 2 z and 1 u. 7/68 What is prob of picking 1 l and 1 q when two letters picked without replacement from {q: 2, e: 3, l: 4, h: 2}? 8/55 What is prob of picking 1 n, 1 f, and 1 r when three letters picked without replacement from fdrdjndddddff? 3/286 Two letters picked without replacement from {p: 1, g: 3, d: 1, b: 1, w: 1}. What is prob of picking 1 g and 1 p? 1/7 Three letters picked without replacement from yyyyyyyyyyyyyyyyygy. Give prob of picking 2 y and 1 g. 3/19 Calculate prob of picking 1 q and 1 g when two letters picked without replacement from {v: 1, q: 4, g: 3, u: 3}. 12/55 Two letters picked without replacement from {g: 2, b: 1, z: 5, a: 8, w: 1, o: 3}. Give prob of picking 1 b and 1 o. 3/190 Two letters picked without replacement from llvllllvllll. Give prob of picking 2 v. 1/66 What is prob of picking 1 p and 3 q when four letters picked without replacement from {c: 9, p: 2, q: 4, f: 3}? 2/765 What is prob of picking 2 i and 1 b when three letters picked without replacement from {b: 3, i: 4}? 18/35 Three letters picked without replacement from {q: 2, x: 1, m: 2, s: 1, t: 1, a: 2}. Give prob of picking 2 q and 1 a. 1/42 What is prob of picking 1 p and 1 c when two letters picked without replacement from cccpoooocpcocpcppc? 40/153 Four letters picked without replacement from {a: 2, d: 5, b: 4}. Give prob of picking 1 d and 3 b. 2/33 Calculate prob of picking 2 a when two letters picked without replacement from ebaabe. 1/15 What is prob of picking 3 t and 1 o when four letters picked without replacement from {o: 2, v: 2, j: 4, t: 8}? 4/65 Two letters picked without replacement from mmmd. Give prob of picking 1 m and 1 d. 1/2 Two letters picked without replacement from zzzopqx. Give prob of picking 1 q and 1 p. 1/21 Three letters picked without replacement from {t: 1, w: 1, j: 1, u: 1, f: 2, l: 1}. What is prob of picking 1 f, 1 l, and 1 w? 2/35 Three letters picked without replacement from bkbbbkbbb. What is prob of picking 1 b and 2 k? 1/12 Four letters picked without replacement from ohgoopdoopyphppyopp. What is prob of picking 1 h, 1 y, and 2 o? 5/323 Calculate prob of picking 1 j and 1 s when two letters picked without replacement from jzsszjzzj. 1/6 Two letters picked without replacement from {o: 4, h: 2, r: 1}. Give prob of picking 1 h and 1 o. 8/21 What is prob of picking 1 o, 1 n, and 1 i when three letters picked without replacement from {n: 2, c: 2, i: 4, m: 2, o: 8, a: 1}? 64/969 Four letters picked without replacement from ggygsgygwygs. Give prob of picking 2 y, 1 s, and 1 w. 2/165 Two letters picked without replacement from klkkkgklgkkk. Give prob of picking 2 g. 1/66 Four letters picked without replacement from {h: 5, b: 1, x: 12}. What is prob of picking 1 x and 3 h? 2/51 Two letters picked without replacement from {r: 2, z: 3, y: 5, d: 9}. Give prob of picking 1 r and 1 z. 2/57 Two letters picked without replacement from epxffzfprpefpfrxp. What is prob of picking 1 f and 1 x? 5/68 Two letters picked without replacement from {u: 2, x: 8, w: 4}. What is prob of picking 1 x and 1 w? 32/91 Two letters picked without replacement from {f: 2, j: 2, h: 2, t: 4, m: 2}. Give prob of picking 1 f and 1 t. 4/33 What is prob of picking 1 y and 1 s when two letters picked without replacement from pyxspx? 1/15 Three letters picked without replacement from {o: 1, e: 2, r: 6, y: 2}. Give prob of picking 2 y and 1 r. 2/55 Four letters picked without replacement from vpppqppppvvvzpplpp. What is prob of picking 1 q, 1 p, and 2 v? 11/510 What is prob of picking 1 h and 1 p when two letters picked without replacement from jphkp? 1/5 Calculate prob of picking 1 c, 1 j, and 1 s when three letters picked without replacement from ssssslsjclc. 4/55 Two letters picked without replacement from {i: 3, q: 3}. What is prob of picking 2 q? 1/5 Three letters picked without replacement from {k: 2, r: 3, n: 2, t: 6}. Give prob of picking 2 n and 1 t. 3/143 What is prob of picking 2 p and 2 j when four letters picked without replacement from jjlpjjlpjljljljjl? 9/595 What is prob of picking 2 q, 1 j, and 1 h when four letters picked without replacement from {h: 1, j: 6, z: 3, a: 4, q: 3, w: 2}? 3/646 Four letters picked without replacement from {b: 5}. Give prob of picking 4 b. 1 What is prob of picking 1 q and 2 j when three letters picked without replacement from {x: 3, p: 3, q: 2, j: 8}? 1/10 Two letters picked without replacement from {y: 1, k: 3}. What is prob of picking 2 k? 1/2 Four letters picked without replacement from {t: 8, x: 7, y: 2, f: 2}. What is prob of picking 1 x, 1 t, and 2 y? 14/969 Two letters picked without replacement from {b: 1, z: 3, t: 1}. Give prob of picking 1 z and 1 t. 3/10 What is prob of picking 2 m, 1 d, and 1 g when four letters picked without replacement from dmmddegd? 2/35 Three letters picked without replacement from rdgrgmmvdrrrrdrdvrg. What is prob of picking 1 d and 2 m? 4/969 What is prob of picking 2 o when two letters picked without replacement from {p: 6, x: 1, h: 2, o: 2, y: 3}? 1/91 Three letters picked without replacement from yvyhkkzkkkkyyhh. What is prob of picking 1 z and 2 y? 6/455 What is prob of picking 1 b and 1 j when two letters picked without replacement from {b: 3, j: 3, g: 4, p: 6, u: 4}? 9/190 What is prob of picking 2 b when two letters picked without replacement from bvvbbv? 1/5 Two letters picked without replacement from ijjij. Give prob of picking 1 j and 1 i. 3/5 Calculate prob of picking 3 k when three letters picked without replacement from kkkwwwkk. 5/28 Three letters picked without replacement from {a: 7, b: 5}. Give prob of picking 1 a and 2 b. 7/22 Calculate prob of picking 1 n and 2 u when three letters picked without replacement from {n: 7, u: 4, e: 3}. 3/26 Calculate prob of picking 1 o and 1 g when two letters picked without replacement from wwooogwwoo. 1/9 Three letters picked without replacement from {k: 2, w: 2, h: 4, m: 4}. Give prob of picking 3 m. 1/55 Calculate prob of picking 1 w and 1 d when two letters picked without replacement from lwwwlld. 1/7 Calculate prob of picking 1 l and 1 g when two letters picked without replacement from {g: 8, m: 1, v: 2, x: 3, l: 1, u: 1}. 1/15 What is prob of picking 1 m and 1 i when two letters picked without replacement from {m: 2, i: 2, h: 1}? 2/5 Calculate prob of picking 3 d and 1 y when four letters picked without replacement from {d: 9, y: 10}. 70/323 Two letters picked without replacement from vcv. What is prob of picking 2 v? 1/3 Calculate prob of picking 1 u, 1 o, and 2 h when four letters picked without replacement from {o: 1, u: 1, k: 3, h: 5}. 1/21 Two letters picked without replacement from {m: 1, w: 1, f: 2, l: 1, i: 1, p: 1}. What is prob of picking 1 f and 1 m? 2/21 Three letters picked without replacement from ppppiiippipi. What is prob of picking 3 p? 7/44 Calculate prob of picking 2 h when two letters picked wi	{ "pile_set_name": "DM Mathematics" }
= -1. Let u be (-294)/s + (14/(-8) - -2). Determine z(u). -1 Let z(h) be the first derivative of h*4/24 + 9h*2/2 - 39. Let r(l) be the second derivative of z(l). Calculate r(6). 6 Suppose 5502w - 5510w - 128 = 0. Let m(f) = 3f + 61. Let s(n) = -n - 20. Let p(l) = -4m(l) - 14s(l). Give p(w). 4 Let f(h) = -11 + 23h3 - 5h + 2 - 25h3 + 13h*2. Give f(6). -3 Let n be (-56)/6-1048/140. Let t(h) = 9h - 283. Determine t(n). 5 Let h(j) be the second derivative of 17j4/12 - j3/6 - j2/2 + j. Let u(s) = -678s - 11527. Let r be u(-17). Calculate h(r). 17 Let b(q) = 23q - 2. Suppose 0 = 49s - 195 + 48. Determine b(s). 67 Let s(m) be the third derivative of -m*5/30 + 7m*4/24 + 6m*3 + 95m*2 + 11. Determine s(7). -13 Let g(h) = 10767 - 10752 + 8h + 51h2 - 53h*2. What is g(-6)? -105 Let s(i) = -24i + 26. Let o be s(1). Let j(p) = 8p2 - 5p - 1 + 7p - 16p*o + 6p*2. What is j(2)? -5 Let w(y) = -37 + 0y*3 + 18y*2 + 19y + 5y3 + 2y*3 + 40 - 8y*3. Calculate w(19). 3 Let b(z) = 53 - 6 - 27 - 26 - 14z. Let o = 8 + -2. Let i(w) = 15w + 7. Let h(f) = ob(f) + 5i(f). Give h(-1). 8 Let x(u) = -33u*3 + u + 1. Suppose -5s = -5o + 35, 0 = -5s - 13o + 9o + 19. Determine x(s). 33 Let p(w) = w*2 + 6w + 3. Let x(f) = -f*2 + 6f + 50. Let c = -473 - -484. Let b be x(c). Determine p(b). -2 Suppose 21u + 45 = 24u. Suppose 0p + 4g - 1 = p, -p + u = 4g. Let k(v) = -572v + 8v2 + 2v*3 + 565v - 3v3 + 6. Determine k(p). 6 Let z(s) = -15s - 1. Let m(x) be the second derivative of 10x - 3x*3 + 31/2x*2 + 0 + 1/12x*4. Let c be m(16). What is z(c)? 14 Let x = 36 + -29. Suppose -4a + 13 = 5b, 5a - b = 3b + 6. Let j(n) = 12n*2 - n - xn - 15 - 13na + 6. Calculate j(-6). 3 Let y(i) = i3 - 7i*2 + 2i + 2. Suppose -223f + 1086 = 99f + 120. What is y(f)? -28 Let g = -18 + 11. Let o(m) = 11m3 - 59m*2 + 16m + 64. Let c(d) = -7d3 + 36d*2 - 10d - 41. Let t(b) = 8c(b) + 5o(b). Determine t(g). -8 Let x(a) = 16a2 - 14a + 21. Let u(v) = 3v2 - 3v + 4. Let n(d) = 11u(d) - 2x(d). Suppose 0 = 10z - 11z + 1, -7 = -3l + 2z. Determine n(l). -4 Suppose -3q + 19 = 4. Let f = -20 + 22. Let s(u) = 5 + u + f - u - 2u. Give s(q). -3 Suppose 2m - 55 = 3v, 2v + 159 = 153. Let s(o) be the first derivative of m + 5o - 1/2o2. What is s(7)? -2 Suppose 118 = 4o - 63o. Let d(j) = -j + 9. Let q(a) = -a + 9. Suppose 2 = 2w - 4. Let r(t) = od(t) + wq(t). Determine r(7). 2 Let s = -1 + 6. Suppose 4i = -2l - 0l - 20, i = -sl - 14. Let m(r) = -6r - 1398. Let y(b) = 5b + 1197. Let q(x) = -6m(x) - 7y(x). What is q(i)? 5 Let l(k) = k*2 - 4k + 3. Let u(y) = 4y3 + y2 + 5y + 2. Let v be u(4). Suppose 17h + v = 11h. Let x = h + 51. Determine l(x). -1 Let f(i) = 3i2 - 2i + 1. Let h be 1((4 - 0/(-3)) + -2). Let c be (1 - h)/(1/3)-1. What is f(c)? 22 Suppose 5u + 0u - 5b = 0, -4u = -b + 12. Let d(q) = 5 + 1 - 7q + 2 + 27q*2 - 13 - 28q2. Give d(u). 7 Let r(f) = f2 - 12f + 30. Let v be r(3). Let b(o) = 4o*2 + 5o + 3 + 8 - 23 - ov + 11. Determine b(5). -1 Let n = 22786 - 22800. Let u(o) = o + 9. Give u(n). -5 Let n(m) = m2 + 7m + 1. Let z(w) = 48w3 - w2 - 3w - 2. Let s be z(-1). Suppose -20 = 4k, 3l - 4k - 188 = -l. Let i = s + l. Give n(i). -5 Let c(t) = -3t - 35. Let u be c(-13). Suppose -3v + 18 = -5k, -4 = -4v - uk - 12. Let p(z) = z + 308z*2 - 3z - 307z2 - v. Calculate p(-1). 2 Suppose 2f = -11c + 9c - 16, -4c - 5 = -5f. Let u(r) = 9r + 29. Determine u(f). 2 Let g(n) = n3 + 3n*2 + 2n + 2. Let h(u) = -4u3 - 10u*2 - 36u - 1. Let s be h(-5). Let t = -431 + s. What is g(t)? 2 Suppose -17 = p - 5m, -p + 3m + 7 = 18. Let k(z) = -4z - 3. Let f be k(p). Let a(t) = t - 5. What is a(f)? 0 Let k(m) = -4 - 13m*3 - 2 + 5 + 2m. Suppose -1 = x - 4n + 6, 2n + 1 = 5x. Determine k(x). -12 Let q(y) = 385y + 378y + 379y + 44 - 1141y. Give q(-37). 7 Let n(c) = 22c*2 - 11c - 9c2 + 6c - 5c2 + 6. Let d(w) = w3 - 15w*2 + 9w - 11. Let f(j) = 6d(j) + 11n(j). Determine f(-1). -7 Let q(g) = -29g - 2. Suppose -62x - 63 = -1. Give q(x). 27 Let w(a) = -4a3 - 7a*2 + 14a + 40. Let z(x) = 9x3 + 15x*2 - 27x - 81. Let b(s) = 7w(s) + 3z(s). Calculate b(-2). -5 Let a(j) = 9j - 1. Let v = 80 + -80. Let x be v + -2 + (19 - 7). Suppose -xk = 15 - 5. Determine a(k). -10 Let f(w) = 11w2 - 2w - 4. Let r = 12473 + -12475. What is f(r)? 44 Let l(s) be the third derivative of -s*4/6 + 19s*3/3 + 3291s*2. Give l(0). 38 Let t(h) = -62h*2 + 4h*2 + 4 + 4h + 16h2 + 17h*2 + 26h2. Let o(k) = k2 + 6k + 1. Let v be o(-5). Calculate t(v). 4 Suppose 5n = 10, -19d + 4n + 16 = -15d. Let o(x) = -2x - 1922 - 2x - dx + 1920. Calculate o(-2). 18 Let g be 22((-12)/3)/4. Let f be (-15)/25 - 26/(-10). Let u(z) = -5 + 0zf - z + 0 + z2. Determine u(g). 15 Let t(q) be the second derivative of q6/360 - q5/40 - q4/12 + 29q*3/6 + 51q. Let f(c) be the second derivative of t(c). Determine f(3). -2 Let f(t) = t*3 - 6t*2 - 3. Suppose 0 = 11s - 12 - 79 + 25. Calculate f(s). -3 Let v(t) = -7t - 5. Let h(j) = -8j - 4. Let p(i) = 5h(i) - 6v(i). Suppose 0 = 5g + 2l + 41, -60g - 8 = -58g - 2l. What is p(g)? -4 Let w(g) = -15g - 43. Let p(c) = 19 + 418c - 813c + 23 + 405c - 14. Let v(o) = -8p(o) - 5w(o). What is v(-7)? 26 Let k(p) = -5p*2 - 8p + 5. Let f(i) = -4i2 - 11i + 3. Let x(l) = -3f(l) + 2k(l). Determine x(-9). 10 Let d(l) be the third derivative of -l*4/24 + 4l*3/3 + 6l*2. Let s be 5/(-1) + (-780)/(-52). Determine d(s). -2 Let v = 44 - 32. Let l be 2/v-30. Let h = 4 + l. Let q(m) = -m2 + m + 1. What is q(h)? -11 Let j = -8058 - -8057. Let u(w) = -13w*3 - 3w*2 - 10w - 8. Calculate u(j). 12 Let d(y) = y*3 - 11y*2 - y + 20. Suppose 4f = 5h + 69, -36f = -40f - 3h + 29. Calculate d(f). 9 Let j(m) = -3m + 54. Suppose -1896r + 1893r + 85 = -4z, -3z = -4r + 97. Give j(r). -3 Let r(c) = 47c + 49c + 51c - 160c - 10. Let d be r(-5). Let z(g) = d - 25 + 3g + g2 - 29. Calculate z(-2). -1 Suppose 14 = 50j - 49j - 2a, j + 5a + 28 = 0. Let o(w) = -24w + 29. Calculate o(j). -19 Let f(p) = -p*3 - 10p*2 - 7p + 7. Let w = 474 + -251. Let r = -232 + w. Give f(r). -11 Let y be 22 + -8 + -1 + 3 + 204/(-6). Let u(n) = -7 - n - 16 + 1. Calculate u(y). -4 Suppose -5n = -4n - 9. Let i(s) be the third derivative of -s*6/120 + 2s5/15 + s4/2 + s*3/6 + 45055s*2. Determine i(n). 28 Let g = 171 - 168. Let j(a) = 3a*2 - 2a - g - 2618a3 + a - 5a + 2619a3. Determine j(-5). -23 Let m(n) = 27n*3 + 2n*2 - 5n + 7. Let r be m(2). Let s = r + -227. Let i(v) = v*3 + 5v*2 - 7v - 6. What is i(s)? 0 Let s(a) be the third derivative of -5a4/24 + 5a*3/3 + 2a*2 - 85a. Let z(c) = 3c - 11. Let f(h) = -2s(h) - 3z(h). Calculate f(-6). 7 Let a(r) = -811r + 815r - 8r2 - 8 - r3 - 23 - 2r2 + 0. Determine a(-11). 46 Let f(o) = -o + 90 - 186 + 88. Let h be (11 + -9)(-6)/4. What is f(h)? -5 Let p(y) = -5y + 26. Suppose 287 - 279 = 2h. Let o(b) = 11b - 57. Let d(w) = ho(w) + 9p(w). Give d(0). 6 Let w be (-22)/331-18. Let m(h) = 2h - 15. Let j be m(w). Let o be (-3)/(-3 - j/(-2)). Let r(i) = i - 1. Give r(o). -3 Let f(w) be the third derivative of -w*5/60 - 29w*4/24 - 2w*3/3 - 80w*2 - 2w. What is f(-29)? -4 Let u(q) = -48q2 + 28 + 9q + 3 + 59q2 - 10q2. Determine u(-6). 13 Let l = 198 - 178. Let r(v) = -l - v3 + v*2 - 27 + 46. What is r(3)? -19 Let z(w) = 3w*2 + 7w - 7. Let v be (-54)/36(-4)/3-2. Determine z(v). 13 Suppose 0 = -2o + m + 9, 1099o - 1100o - 2m = -17. Let v(u) = u*2 - 19u + 84. Determine v(o). 0 Let c(h) = -13 + h*3 + 3h*2 + 7 - 7h*2 + 5h. Suppose 5q - 3i - 3 = 0, 18q - 2i = 17q - 5. Determine c(q). 0 Let r(i) be the third derivative of -37i*4/24 + 74i*3/3 + 3180i2 - 1. What is r(4)? 0 Let u(a) = a2 - 7a. Let l be u(5). Let r(p) be the first derivative of p3/3 + 9p*2/2 - 11p - 86. Determine r(l). -1 Let f(j) = -j + 2. Let a = -176 + 184. Suppose -az = -z + 42. What is f(z)? 8 Let q(y) = y2 - 7y - 9. Let t be ((-21)/77)/(3/(-33)). Suppose 0 = -	{ "pile_set_name": "DM Mathematics" }
und -37925383.8 to the nearest 100000. -37900000 What is 599.35008 rounded to one dp? 599.4 What is 0.0000411190431 rounded to six dps? 0.000041 What is -28623048.1 rounded to the nearest one hundred thousand? -28600000 Round -5422327.446 to the nearest 100. -5422300 Round -0.0636512015 to three decimal places. -0.064 What is 0.01307931912 rounded to 5 decimal places? 0.01308 What is 3812013.034 rounded to the nearest 10000? 3810000 Round -0.0002100904422 to 5 decimal places. -0.00021 Round 19121634.65 to the nearest 10000. 19120000 Round 1064.339282 to the nearest 10. 1060 Round -0.00028704157 to six decimal places. -0.000287 Round -0.1325748823 to five decimal places. -0.13257 Round -1237961675 to the nearest 100000. -1238000000 Round 0.000002662224707 to six dps. 0.000003 What is 46530.09142 rounded to the nearest one hundred? 46500 What is 1.0837362381 rounded to four decimal places? 1.0837 What is 3.209944579 rounded to 4 decimal places? 3.2099 Round -5.025207546 to three dps. -5.025 What is 55149.31349 rounded to the nearest one hundred? 55100 Round -394.05067 to 1 decimal place. -394.1 Round -0.00208286573 to six dps. -0.002083 Round 2.4197933 to two decimal places. 2.42 What is -96917.64814 rounded to the nearest ten thousand? -100000 Round 0.01272201075 to three dps. 0.013 What is -45175.9628 rounded to the nearest 10000? -50000 Round 13.5234369 to one decimal place. 13.5 What is -405.8462 rounded to the nearest 100? -400 What is -1927500.8 rounded to the nearest 1000000? -2000000 Round -0.0002153498951 to 7 dps. -0.0002153 What is 0.00000611030551 rounded to 7 dps? 0.0000061 Round -2.793284054 to two dps. -2.79 What is -440.28344 rounded to one dp? -440.3 What is 593.69787 rounded to the nearest 100? 600 What is -0.000001266391746 rounded to 7 dps? -0.0000013 Round 0.661845524 to 1 decimal place. 0.7 What is -0.101270599 rounded to five decimal places? -0.10127 What is -0.0002019736374 rounded to seven decimal places? -0.000202 Round 1435206591 to the nearest one million. 1435000000 What is -0.000001435881118 rounded to 6 dps? -0.000001 Round -8835462.514 to the nearest one million. -9000000 What is 0.0037881891 rounded to 6 decimal places? 0.003788 Round 0.00034899775 to three dps. 0 Round -153158.392 to the nearest 100. -153200 What is -16.869161331 rounded to 4 dps? -16.8692 What is -5.22767687 rounded to two dps? -5.23 Round -0.00183354694 to 5 dps. -0.00183 What is 414537585 rounded to the nearest 10000? 414540000 Round 15907412.945 to the nearest one hundred thousand. 15900000 Round 2600689.36 to the nearest one hundred thousand. 2600000 Round -887.93139 to the nearest 100. -900 What is 10919.2855 rounded to the nearest integer? 10919 What is -227.9612558 rounded to 2 dps? -227.96 Round 1.17077328 to the nearest 10. 0 Round 0.000042493958 to seven decimal places. 0.0000425 What is -0.293524991 rounded to 2 decimal places? -0.29 Round 6305.020969 to the nearest 1000. 6000 What is 1540681130 rounded to the nearest one million? 1541000000 Round 161862.0529 to the nearest one thousand. 162000 Round 0.0039545139 to four decimal places. 0.004 What is -203551.228 rounded to the nearest 10? -203550 Round -1.4892631 to one decimal place. -1.5 Round 50933.133 to the nearest one hundred. 50900 What is 1387911.2609 rounded to the nearest ten? 1387910 Round 49.42072586 to 1 dp. 49.4 What is -0.00000031956702 rounded to seven decimal places? -0.0000003 Round 542.4503 to the nearest 10. 540 What is 0.000933201562 rounded to four dps? 0.0009 Round -19385.463 to 0 decimal places. -19385 What is -1518074810 rounded to the nearest 1000000? -1518000000 What is -0.01577995766 rounded to 3 decimal places? -0.016 What is -329.334184 rounded to the nearest one thousand? 0 Round -251945675 to the nearest 1000000. -252000000 What is -0.00000198794 rounded to six decimal places? -0.000002 What is -41.433027 rounded to the nearest one hundred? 0 What is -1048.35303 rounded to the nearest one hundred? -1000 What is 278998083.8 rounded to the nearest 100000? 279000000 What is -0.1549263673 rounded to six decimal places? -0.154926 Round 6242854.9 to the nearest one thousand. 6243000 Round 5749.115 to the nearest 100. 5700 Round -21.0258425 to 3 decimal places. -21.026 Round 0.661594069 to 2 decimal places. 0.66 What is -21333179 rounded to the nearest 1000000? -21000000 Round 0.0000124031968 to six dps. 0.000012 Round -0.012225709 to four decimal places. -0.0122 What is -16.71225196 rounded to 3 dps? -16.712 Round 176803.956 to the nearest ten. 176800 What is 469919.24 rounded to the nearest 100? 469900 What is -13182.5047 rounded to the nearest 10000? -10000 What is -15.058727496 rounded to 0 decimal places? -15 What is -0.00099006846 rounded to 4 dps? -0.001 Round -13.34923184 to 1 dp. -13.3 Round 93794662 to the nearest ten thousand. 93790000 What is 0.768413258 rounded to two decimal places? 0.77 Round -0.0726723457 to five dps. -0.07267 Round -30259783.05 to the nearest 100000. -30300000 What is -0.0043179013 rounded to four decimal places? -0.0043 What is 0.0001402683 rounded to 3 decimal places? 0 What is -2.566955796 rounded to 3 decimal places? -2.567 Round -57953.8638 to the nearest 10. -57950 What is 1.126389 rounded to 2 dps? 1.13 What is -33828970900 rounded to the nearest 1000000? -33829000000 What is -7638686500 rounded to the nearest 1000000? -7639000000 What is -0.0367739006 rounded to four dps? -0.0368 Round 0.00091223903 to 7 decimal places. 0.0009122 Round -2674664.594 to the nearest one hundred. -2674700 What is 1149382.182 rounded to the nearest 1000? 1149000 Round 1.175649929 to five decimal places. 1.17565 Round 30738917.2 to the nearest 10000. 30740000 What is -0.0001620501696 rounded to 6 dps? -0.000162 Round -0.001247914594 to 3 decimal places. -0.001 What is -1055198520 rounded to the nearest 1000000? -1055000000 Round 0.7170265026 to 5 decimal places. 0.71703 What is -1123.626666 rounded to the nearest integer? -1124 Round -780.994911 to the nearest one hundred. -800 Round 0.157753761 to 3 dps. 0.158 Round 0.0000034560332 to 7 decimal places. 0.0000035 What is -5.631447729 rounded to 2 decimal places? -5.63 What is -121.17931026 rounded to the nearest 10? -120 Round -233002835.75 to the nearest 1000. -233003000 Round -0.000083142431 to 7 decimal places. -0.0000831 Round -0.00553634109 to 6 decimal places. -0.005536 Round -0.00000049115877 to 7 dps. -0.0000005 Round 14317654.015 to the nearest 1000000. 14000000 Round -576765.35 to the nearest 1000. -577000 What is 1766539.5217 rounded to the nearest 10000? 1770000 Round 9021.850951 to one dp. 9021.9 Round -0.00015102547 to six dps. -0.000151 What is -468.88612 rounded to 1 dp? -468.9 Round -0.00075819218 to six decimal places. -0.000758 What is -0.487542 rounded to four dps? -0.4875 Round -79.4400687 to 0 dps. -79 Round -118698656 to the nearest 100000. -118700000 What is -59.811896 rounded to one dp? -59.8 Round 929588.8 to the nearest 100000. 900000 What is 17953.48 rounded to the nearest 1000? 18000 Round 0.00236213772 to 6 decimal places. 0.002362 Round -11058232.92 to the nearest one million. -11000000 Round 0.1438058586 to five decimal places. 0.14381 What is -6722.182 rounded to the nearest one thousand? -7000 What is -281148.385 rounded to the nearest one hundred? -281100 Round -0.0000430590501 to 6 dps. -0.000043 Round 43.923331 to the nearest integer. 44 What is 523.2648 rounded to the nearest 100? 500 Round 1846.0267469 to the nearest 100. 1800 Round -1566829.05 to the nearest 1000. -1567000 Round 0.00061912244 to seven dps. 0.0006191 What is 72052674 rounded to the nearest one million? 72000000 Round -1168014.06 to the nearest ten thousand. -1170000 What is -4811858.7 rounded to the nearest 100000? -4800000 What is -7000.40987 rounded to zero decimal places? -7000 What is 0.000197753596 rounded to 7 dps? 0.0001978 What is 0.0000663475754 rounded to seven dps? 0.0000663 What is 0.00000346086349 rounded to seven dps? 0.0000035 What is -19405566.44 rounded to the nearest 1000? -19406000 What is -113.2988 rounded to the nearest ten? -110 What is 0.0000321852048 rounded to 7 decimal places? 0.0000322 Round 118484815.6 to the nearest 1000000. 118000000 Round -311869.76	{ "pile_set_name": "DM Mathematics" }
der when ((-25)/10)/(p/(-2)) is divided by 2? 1 Suppose 25 = -5y, -y - 1 = -2n + 12. Suppose 3b + p + 44 = 8b, -nb + 3p + 44 = 0. Suppose 5q = 17 + 98. What is the remainder when q is divided by b? 7 Let z = 97 - 57. Calculate the remainder when z is divided by 21. 19 Let r(q) be the first derivative of -q2 + 3q + 3. Let t be r(6). Let v = t - -13. Calculate the remainder when 14 is divided by v. 2 Suppose -o + 44 = -17. What is the remainder when o is divided by 16? 13 Let y(j) = 4j2 - 2j - 2. What is the remainder when 9 is divided by y(-1)? 1 Suppose -4h - 2d + 42 = 0, 4h = -h - d + 48. What is the remainder when 22 is divided by h? 4 Let v(r) = -2r. Let x be v(-2). Suppose xl - 40 = -l. Calculate the remainder when 21 is divided by l. 5 Let a(u) = u2 + u. Let l be ((-1)/(-4))/((-6)/(-24)). What is the remainder when 7 is divided by a(l)? 1 Calculate the remainder when 82/4 - 6/(-12) is divided by 6. 3 Let r = 71 - 38. Suppose -3n - 3s + 27 = 0, -n + 5s + 0s = -r. Calculate the remainder when (-4)/(-6) + 365/15 is divided by n. 12 Let k(i) = i3 - 15i*2 + 17i - 7. Calculate the remainder when 68 is divided by k(14). 33 Let o(z) = -15z + 4. What is the remainder when o(-3) is divided by 17? 15 Let w = 3 + -28. Let c = 63 + w. Calculate the remainder when c is divided by 10. 8 Suppose 6g - 3g + 6 = q, -2g = -q + 9. Let c be 150/35 + 4/(-14). Suppose 5r = 5w + 25, cr + 3w - 38 = w. What is the remainder when q is divided by r? 7 Suppose 0m + q - 9 = 2m, 3m - q = -15. Calculate the remainder when (14/(-4) + 3)m is divided by 3. 0 Suppose 4v + 25 = 173. Let r be -1 + 1 - (4 - 2). What is the remainder when v is divided by (-20)/(-1) - (-1 - r)? 18 Calculate the remainder when (-8)/(-12)-3 - -18 is divided by 9. 7 Suppose -78 = -3a - 30. Let t = 115 + -68. What is the remainder when t is divided by a? 15 Suppose 4v - 7v - 71 = -4t, 0 = 3t - v - 47. What is the remainder when 13 is divided by (-3)/(2/t-3)? 6 Let z(u) = -u*2 + 11u + 25. Calculate the remainder when z(12) is divided by 4. 1 Let s = -57 + 75. Calculate the remainder when 177 is divided by s. 15 Suppose 2i + i = 18. Let u be ((-3)/i)/(1/(-10)). Suppose l + 2k = 10, -2l = k - 6 - u. What is the remainder when 7 is divided by l? 3 Let l = -2 + 5. Suppose -s = s + 2t - 12, -19 = -ls - 2t. What is the remainder when 13 is divided by s? 6 Let z = -15 - -46. What is the remainder when 92 is divided by z? 30 Let y = -18 + 23. What is the remainder when 8 is divided by y? 3 Let b(x) = -x*2 - 13x + 20. Let j(k) = -k*3 + 4k*2 + 2k + 3. What is the remainder when j(4) is divided by b(-14)? 5 Suppose j + 2 + 8 = 0. Let u = j - -12. What is the remainder when 24 + u + 6/(-2) is divided by 12? 11 Let m be 9/(-6)(1 + -3). Calculate the remainder when 49 is divided by 10/m30/4. 24 Suppose -4z = -4d - 156, -3z + 2d = -2z - 43. Suppose 5v = -q + 88, 0 = -2v - 4q - 7 + z. What is the remainder when v is divided by 10? 8 What is the remainder when (112/10)/((-10)/(-50)) is divided by 29? 27 Suppose -6n - 381 = -45. What is the remainder when 9 is divided by n/(-10) - 22/(-55)? 3 Let t(z) be the third derivative of z5/60 - z4/6 - z3/2 + 2z*2. Let r be t(4). Calculate the remainder when 21 is divided by r/(3/(-11))1. 10 Calculate the remainder when (-4)/30 - 422/(-15) is divided by 10. 8 What is the remainder when 16/(-10)75/(-2) is divided by 21? 18 What is the remainder when (10/4)/(11/66) is divided by 8? 7 Suppose 0h - 5h + 305 = -2s, -5s = 0. What is the remainder when h is divided by 31? 30 Let u be 8/20 - 42/5. Let q be u/123/1. Let h = 17 - q. Calculate the remainder when 36 is divided by h. 17 Suppose a + 2 = -3, 5s - 2a - 80 = 0. What is the remainder when (115)/(-1 + 2) is divided by s? 13 Let t = -85 + 120. Let y = -21 + t. Suppose -2o = i - 9, 2o - i - 2 = 5. Calculate the remainder when y is divided by o. 2 Suppose -2 = 4i - 18. Suppose 75 = 4f + 3j, 5f - 78 = ij + 39. Let l(t) = -t*2 + 8t - 4. What is the remainder when f is divided by l(5)? 10 Suppose 0 = -10p + 7p + 33. Calculate the remainder when 41 is divided by p. 8 Suppose 44 = 3d - 25. Calculate the remainder when 109 is divided by d. 17 Let t(s) = 13s. Let g(z) = z + 7. Let a be g(-6). Calculate the remainder when t(a) is divided by 4. 1 Suppose 3b + 7 - 16 = 0. Calculate the remainder when b is divided by ((-8)/(-14))/((-2)/(-7)). 1 Let l(c) = c3 + 9c*2 - 3c - 14. Suppose 16 = 2h - 2b, -2h + b = 3h - 40. Calculate the remainder when l(-9) is divided by h. 5 Suppose -2 = 5b - 37. Calculate the remainder when b is divided by 5. 2 Suppose 29 = 4t + 9. Suppose 0 = f - 4 + 7, 25 = 5z - tf. Suppose -2d = 5r - 163, r = zr + d - 35. What is the remainder when r is divided by 11? 9 Suppose -64 = -q - q. Calculate the remainder when q is divided by 19. 13 Let l = 8 + -14. Let m = 12 + l. Suppose -m = 3z - 18. Calculate the remainder when 10 is divided by z. 2 Let k = 54 - 11. Let g = -24 - -35. Calculate the remainder when k is divided by g. 10 Let l = -1 + 5. Let g = 0 + -1. Let k(b) = 5b2 - 2b - 1. What is the remainder when k(g) is divided by l? 2 Suppose -5r - 15 = -50. Suppose -5c = 2z + 130, -4c - 2z = -z + 104. Calculate the remainder when r is divided by 2/5 - c/10. 1 Let x(i) = -2i - 9. Let a be x(-6). Suppose h - 12 = -ah. Suppose -hr = -8r + 5d + 20, 5d = 4r - 18. Calculate the remainder when 4 is divided by r. 0 Suppose -4o + 66 = 5j - 20, -40 = -2j - 3o. What is the remainder when 24 is divided by j? 10 Suppose 0 = -2i + 8, 5a + 2i + i - 122 = 0. What is the remainder when a is divided by 12? 10 Let g = 7 - 7. Let l be (1 - g) + 0/3. Let y = 12 - l. What is the remainder when 21 is divided by y? 10 Suppose -34 = 5c + 16. Let s = c - -15. Suppose -4f = -2f - 28. Calculate the remainder when f is divided by s. 4 Let w(p) = p*2 - p + 3. Let m be w(0). Suppose -mu + 5y = -u - 19, -4u = -5y - 33. Calculate the remainder when ((-2)/(-3))/(4/78) is divided by u. 6 Let g = 23 + -21. Suppose i + 24 = gi. Calculate the remainder when 46 is divided by i. 22 Suppose 0 = 2w - 57 - 7. Calculate the remainder when 95 is divided by w. 31 Let v(y) = -3y - 5. Calculate the remainder when 34 is divided by v(-5). 4 Suppose 3t - 2 = 28. What is the remainder when (-92)/(-5) + 4/(-10) is divided by t? 8 Let d(c) = 24c - 1. What is the remainder when d(1) is divided by 13? 10 Let c = 36 + -27. Let z be (-1 - 1)/((-3)/48). Suppose -v = v - 5g - 39, -2g = 2v - z. Calculate the remainder when v is divided by c. 8 Suppose 3o - 11 = 5s, -4 = -3s + 2. Let r = 4 - -16. Calculate the remainder when r is divided by o. 6 Suppose x - 60 = -4o + 5x, 4o + 3x - 74 = 0. Calculate the remainder when 81 is divided by o. 13 Let a = -7 + 12. Suppose 2t = -5y + 2y + 32, -3t + 13 = 2y. What is the remainder when y is divided by a? 4 Calculate the remainder when 35 is divided by 16/(-6)1/(4/(-30)). 15 What is the remainder when 50 is divided by 0 + -3 + 322/3? 12 Suppose 20 = 4p - v - 11, -4v = 5p - 23. What is the remainder when p is divided by (-2 - (-12 - -3)) + -3? 3 Suppose -3y + 11 = -0y + 2h, -3y = -2h - 7. Suppose -t + 5w = -29, -7t + yt + 26 = -2w. Calculate the remainder when t is divided by 3. 1 Suppose -259 = 3n - 5w, w + 190 = -2n - 0w. What is the remainder when n/(-6) - 1/(-2) is divided by 9? 7 Let y(u) = -u2 + 19. Suppose -7j = -3j. Suppose -5z + 2m = -0z - 44, 2m = 2z - 14. What is the remainder when y(j) is divided by z? 9 Let f(b) = -b*3 + 9b*2 + 12b - 9. What is the remainder when 74 is divided by f(10)? 8 Suppose 0n - 4 = -n, 2n = m + 11. Let a(h) = -h*3 - 3h*2 - 4h - 5. Let u(r) = 4r2 - 3r - 1. What is the remainder when u(3) is divided by a(m)? 5 Let t = 8 + -3. Let k(p) = 4p - 5. What is the remainder when 44 is divided by k(t)? 14 Let p = 3 - -1. Suppose y - 8 = -5r, 3y = py + 4r - 11. Calculate the remainder when y is divided by (-105)/(-9) + 2/6. 11 Let t(a) = a - 4. Let y be t(4). Let c be (9/(-90) - (-2)/(-5))-6. Suppose -26 = -u - 4r, 3r + yr + 18 = cu. What is the remainder when u is divided by 3? 1 Let l = -12 - -1	{ "pile_set_name": "DM Mathematics" }
s 3? 25965 -1.229-0.233 0.286357 0.1-7671 -767.1 What is 2.6 times 19982? 51953.2 Product of 33 and 1.609. 53.097 -1 * -5382.15 5382.15 -230 times 5562 -1279260 What is -75808 times 2.4? -181939.2 Work out -106816 * 0.2. -21363.2 What is the product of -2 and 8218? -16436 What is 2 times 225? 450 -6 * 2978 -17868 -1-5336.2 5336.2 What is -0.4 times -0.080436? 0.0321744 What is 22.248 times -7? -155.736 Work out 0.2 12671. 2534.2 What is 1444 times -4? -5776 -0.2 * -274359 54871.8 Product of 736 and 0.04. 29.44 1342.6 times 4 5370.4 Work out 0 * 0.538121. 0 Multiply -26.2 and 1.322. -34.6364 Calculate 0.5-0.8895. -0.44475 -236.6 times -6 1419.6 359-727 -260993 -23095 times -228 5265660 Multiply -4 and 6668. -26672 -1.84127 times 35 -64.44445 -119.79 times 1.85 -221.6115 8.33905.3 32413.99 -3322439 -740487 0.1133-0.201 -0.0227733 Work out 0.1208577 -0.5. -0.06042885 Work out 0.22609 * -16. -3.61744 -1967-1 1967 Work out -10297 23. -236831 Calculate -25438-2. 50876 Multiply -618 and -131. 80958 Calculate -468176. -82368 Work out -13 * -6577. 85501 -0.17330.51 -0.088383 What is -13872 times -64? 887808 -4 -38236 152944 9 * -225.09 -2025.81 What is 1376 times -0.09? -123.84 Multiply 22568 and -1. -22568 Product of 1.2773 and 0. 0 Calculate 1.6-625. -1000 Calculate -953.74-0.2. 190.748 Multiply 1.5 and -1073. -1609.5 What is 57 times -77071? -4393047 427 times 286 122122 Work out 541343 * -0.1. -54134.3 -0.08 times 0.43747 -0.0349976 Multiply -3990 and -0.5. 1995 -14504-1.05 15229.2 Calculate -3684-0.8. 2947.2 -0.21162.2 -34.062 What is 19 times -2.274? -43.206 26.48-0.1247 -3.302056 0.1 times -4.1952 -0.41952 90.425 times 3 271.275 Calculate -0.0340366-0.05. 0.00170183 Work out -10.4 7665. -79716 345.51-0.4 -138.204 Product of -13 and -41.3. 536.9 197.61 0.2 39.522 Product of 27793 and 11. 305723 Work out 0.0512 * 0.372. 0.0190464 166423 times -0.02 -3328.46 Calculate 2752-0.1. -275.2 -2.65694 times 0 0 Multiply 0.02 and -55608. -1112.16 Work out -3313 1.6. -5300.8 What is the product of -4601 and -0.325? 1495.325 Multiply -0.113 and -1107. 125.091 Product of -2518 and 0.2404. -605.3272 50677 times 0.2 10135.4 Calculate -7924.30.1. -792.43 What is the product of -47689.2 and -1? 47689.2 49.2 times 5 246 -19.48183 -58.4454 Work out 6249.3 * -0.1. -624.93 What is the product of 47950 and -0.3? -14385 Product of -282639 and 5. -1413195 Work out 0.3 * 112.817. 33.8451 What is the product of 0.1 and -0.060332? -0.0060332 What is the product of -69 and -1914? 132066 Work out 2501 * -3. -7503 -5-213 1065 -0.084032 times 1 -0.084032 Work out 0.2068 246. 50.8728 91026 9234 -2.3 -4103 9436.9 What is 1801683 times 4? 7206732 Multiply 43.862 and -0.1. -4.3862 Work out -0.06 * -1545.2. 92.712 1490.347 * -5 -7451.735 1.17624-0.4 -0.470496 Calculate 2.87.273. 20.3644 -0.22 times -0.7975 0.17545 Work out -1065 * -4. 4260 0.03 times -338102 -10143.06 Work out 10.7 * -451. -4825.7 1038 times -936 -971568 -275 * 0.584 -160.6 -12.15 * 0.006 -0.0729 Product of 1 and -2680. -2680 853785-0.1 -85378.5 What is the product of 0.6279 and -2? -1.2558 What is the product of -5 and -27251? 136255 -0.042 843 -35.406 Calculate 36.982. 3025.8 0.163149.32 24.33916 What is the product of 0.24 and -4126? -990.24 Multiply -0.208 and -0.2821. 0.0586768 7.77-9 -69.93 Calculate -33820.51. -1724.82 Calculate -45-130. 5850 Product of 206 and -27724. -5711144 Multiply -2302 and 108. -248616 Product of -2 and 14570. -29140 Work out 0.3 0.58981. 0.176943 0.02 times -0.77984 -0.0155968 -1.97-0.21 0.4137 2 -71847 -143694 18 * -4515 -81270 Work out -0.51 * 82. -41.82 Calculate -122352-14. 1712928 -4 times 125.77 -503.08 -0.17 times -1813.2 308.244 -0.4 132766.8 -53106.72 Product of 1.9 and 43.1. 81.89 28 times -7262 -203336 Multiply -25.32 and -0.113. 2.86116 347 times -14780 -5128660 What is the product of -1.3 and 277.4? -360.62 446046 * -0.1 -44604.6 Work out 37 * -0.03741. -1.38417 Calculate 0.1-144.403. -14.4403 What is the product of -3278 and 7.3? -23929.4 Work out -28.82 43. -1239.26 Product of 4 and 63389. 253556 -1380.187 -25.806 What is -0.01 times -368005? 3680.05 Product of 0.2 and 1144.9. 228.98 What is 476 times -359? -170884 0.202 times 11993 2422.586 What is the product of -47120 and -0.5? 23560 Calculate 0-15.5919. 0 Work out 0.06168 * -0.27. -0.0166536 15418 * 0.06 925.08 1.11455.3 5.90685 Multiply -0.4 and -1896. 758.4 Product of 129 and -955. -123195 What is 0.50886 times 33? 16.79238 What is the product of 13.16 and 7? 92.12 What is the product of -0.0301 and 7.4? -0.22274 580 times -26 -15080 79.6 times 1.228 97.7488 Product of -0.24 and -41.95. 10.068 0.02973528 -4 -0.11894112 0.123983 times -1 -0.123983 Multiply -667 and -0.032. 21.344 641 * 222 142302 -4 * 4558 -18232 Multiply 5287 and -4. -21148 2180 times 141 307380 Product of 54288.22 and 1. 54288.22 Multiply -0.07 and -15873. 1111.11 -13.914 * -7 97.398 Calculate 1.89831.1. 2.08813 Multiply 3 and -0.052906. -0.158718 What is the product of -1 and -203591? 203591 5066.348 times 0.5 2533.174 What is -8 times 64791? -518328 What is 465134 times -5? -2325670 Product of 4 and -208912. -835648 Calculate 78.58-4. -314.32 What is the product of -2 and 3.3831? -6.7662 What is -4 times -9.162? 36.648 Work out 0.8 * -59.412. -47.5296 Work out 0.43 * 154. 66.22 229.8 * 0.03 6.894 Work out -8.1271 * -4. 32.5084 What is the product of -0.04 and 27249? -1089.96 2.5021-0.07 -0.175147 -31301 -2.7 84512.7 Work out 16 * 0.48851. 7.81616 Calculate -0.3-123.81. 37.143 Work out 23.3 3664. 85371.2 What is 4 times 1036.32? 4145.28 Multiply -36812 and -4. 147248 7-3.1844 -22.2908 -12572 times 17 -213724 What is the product of 0.0492763 and 3? 0.1478289 What is 1 times -0.80353? -0.80353 10 -4359 -43590 -229 * 2314.6 -530043.4 Work out -0.091 * -12.9. 1.1739 Calculate -0.279623. -0.83886 What is 40.1 times 0.049? 1.9649 -0.97150.281 -0.2729915 What is the product of 0.0836 and -6.22? -0.519992 -0.11 * 35 -3.85 Work out 0.2 * 10237. 2047.4 Product of -5 and 0.1497824. -0.748912 Work out 0.02731 * -23. -0.62813 Multiply 16751 and -4. -67004 Product of -37.549 and 11. -413.039 -2.1 * -247 518.7 Product of -11.5291 and -0.2. 2.30582 Work out 21.193 * -1. -21.193 What is the product of 34 and -86250? -2932500 1 * 0.517152 0.517152 What is the product of -637.9 and -5? 3189.5 1.87 * -33 -61.71 2113.82 times -10 -21138.2 Calculate 23588-0.3. -7076.4 Product of -0.19 and 1.013. -0.19247 Calculate -51.441.7. -87.448 Work out -0.4 * 94.51. -37.804 Calculate -3-16354. 49062 3.1 -3369.3 -10444.83 -9 * -0.11477 1.03293 1.727 times -41 -70.807 Work out -0.2885 * -0.23. 0.066355 Multiply -21 and 978. -20538 -0.08 * -0.9651 0.077208 What is the product of -13.72 and -4.5? 61.74 Product of 7 and 0.4395. 3.0765 Multiply -196 and 4.164. -816.144 11134-0.48 -5344.32 -1 times -21215 21215 1.441 360 518.76 Work out -2 * 20794. -41588 Product of 483.9 and -0.9. -435.51 Multiply -24 and 745.7. -17896.8 -20463 * -7 143241 485.2 * 9 4366.8 -0.2 times 281 -56.2 Product of -4528.8 and -1. 4528.8 What is the product of -4833.7 and 3.8? -18368.06 -0.1-4.754 0.4754 9634.5 times -0.4 -3853.8 Product of -0.1556 and -42. 6.5352 Calculate 0.361-6.4. -2.3104 39328 times 3.6 141580.8 -0.15 * 2622 -393.3 16.8-1178 -19790.4 Calculate -0.03-15.7. 0.471 What is the product of 11 and 1.4343? 15.7773 Multiply 1.27 and -227. -288.29 -0.936-0.2303 0.2155608 Product of 14.19283 and 4. 56.77132 What is -0.1 times 0.221697? -0.0221697 What is 1427865 times -1? -1427865 Multiply -7 and 430.5. -3013.5 4.3 7456 32060.8 Product of 11 and 1720.7. 18927.7 Calculate -1.49-618. 920.82 Product of 127043 and -0.1. -12704.3 Product of -545 and -539. 293755 -4294-0.2 858.8 330 times -7189 -2372370 -135-4673 630855 Work out 5 -10662.5. -53312.5 What is -0.5 times -1568.4? 784.2 80-1103 -88240 1539.6 -14 -21554.4 What is -0.76 times -0.0083? 0.006308 What is the product of 17 and 60204? 1023468 What is the product of -0.1 and -11898? 1189.8 3.574 times 5.76 20.58624 What is the product of 0.2781 and 0.322? 0.0895482 Calculate -6-10199. 61194 Calculate 0.02107898. 0.1686312 Work out 4 * -11965	{ "pile_set_name": "DM Mathematics" }
-1. Find the first derivative of f*q - 3 + 3 - 2 wrt f. 2f Suppose 2p - 2a - 4 = 0, 0a = -2p - 5a + 4. Differentiate -4k*2 + 1 + 0 + 0k*p - 6 wrt k. -8k Let w = 0 - -4. Let b(c) = 3c2 + 1. Let y(t) = -16t*2 - 5. Let s(k) = wy(k) + 22b(k). Differentiate s(r) wrt r. 4r Let k(m) be the first derivative of m7/420 + m6/360 - 2m3/3 + 1. Let d(a) be the third derivative of k(a). Find the third derivative of d(j) wrt j. 12 Let n(g) be the second derivative of -g5/20 + 23g4/12 + g3/6 + 4g2 + 17g. Find the second derivative of n(m) wrt m. -6m + 46 Let i(l) be the third derivative of -l7/42 + l5/12 - 5l*2. Find the third derivative of i(v) wrt v. -120v What is the third derivative of y*5 - 8y2 + y5 + 5y5 wrt y? 420y2 Let s(k) be the second derivative of -k5/4 + 7k3/6 - 5k. Find the second derivative of s(j) wrt j. -30j What is the derivative of 3b*3 + 27 - 78 - 54b*3 wrt b? -153b*2 Suppose -b + 3 = -7. What is the derivative of 0c*2 + 11 + 5c*3 - b + 0c*2 wrt c? 15c*2 Suppose 0 = -5p - 4 + 14. What is the derivative of -mp - 1 - m2 + m*2 - 6m*2 wrt m? -14m Let b(z) be the third derivative of -4z7/105 + z5/15 - 5z*2. Find the third derivative of b(x) wrt x. -192x What is the second derivative of -13t + 2t - 3t2 + t + 10t2 wrt t? 14 Let p(m) be the second derivative of -m10/2520 + m6/36 + m3 - 3m. Let y(b) be the second derivative of p(b). Find the third derivative of y(c) wrt c. -240c3 Let m(d) be the second derivative of -d5/15 - 5d4/24 + d2/2 + d. Let j(g) be the first derivative of m(g). Find the second derivative of j(u) wrt u. -8 Let o(r) be the third derivative of r9/30240 + r7/2520 + r5/60 + r2. Let k(h) be the third derivative of o(h). Find the second derivative of k(c) wrt c. 12c Let g(h) be the second derivative of 1/6h3 + 0h*4 + 1/21h*7 - 2h + 0h2 + 0h*5 + 0 + 0h*6. What is the second derivative of g(n) wrt n? 40n*3 Let b be 2 + 1 + 0/(-5). What is the second derivative of -2x*4 - 2x*2 + bx*4 - 2x + 2x2 wrt x? 12x2 Let l(w) be the second derivative of -w5/10 + w4/4 + w3/3 - 3w. Let r(k) = k2. Let f(j) = -l(j) + 3r(j). Find the second derivative of f(z) wrt z. 12z Let v(g) = g2 - 2g - 5. Let n be v(4). What is the third derivative of 0z2 + zn + 0z*2 + 3z*2 - 3z*3 wrt z? -12 What is the third derivative of 22f5 - 23 - f2 - 44 - 72f5 + 10 wrt f? -3000f2 Let q(b) = -b4 + 4b3 - b + 4. Let a = -3 - -2. Let r(x) = -x3 - 1. Let s(o) = aq(o) - 4r(o). What is the second derivative of s(g) wrt g? 12g2 Let x(c) = -c2 - 10c + 4. Suppose 2j - 1 = -21. Let h be x(j). What is the second derivative of 13i - 3i - 3ih - 6i wrt i? -36i2 Let b(d) = -d3 - 6d*2 + 6. Let q be b(-6). Let g be (1-3)/((-9)/q). What is the second derivative of 0x + 3x*5 + 4x - gx wrt x? 60x*3 Find the third derivative of 0f*4 - 2f*4 + 33f*2 + 10f*4 wrt f. 192f Let z(t) be the third derivative of -13t6/40 - 2t*5/3 - 26t*2. What is the third derivative of z(f) wrt f? -234 Let w(p) = -9p*3 + 3p. Let k(x) = -13x3 + 4x. Let d(q) = -5k(q) + 7w(q). What is the second derivative of d(y) wrt y? 12y Differentiate -564c - 16c3 - 10 + 564c wrt c. -48c2 Let s be (20/8)/(2/4). Suppose sj - 3 = -w, w + 4j + 3 = 2w. Find the first derivative of 2y2 - wy*2 + 3 + 0 + 3y*2 wrt y. 4y Let v be 19/7 - 8/(-28). Suppose -vt + 0 = -6. What is the third derivative of k5 + 3kt + k5 - 6k2 wrt k? 120k2 Let k(x) = x2 + 3x - 4. Let y be k(-4). Suppose -5w - 2u + 2 = 0, -2w + 5u + 18 = -3w. What is the first derivative of -4m + ym + wm - 2 wrt m? -2 Suppose 3u = -u + 12. What is the second derivative of -5w + 2w + 2wu + 0w*3 wrt w? 12w Let m(x) be the third derivative of 7x2 + 0x*6 + 0x + 0x7 + 0x*4 + 2/15x*5 + 0x*3 + 0 - 1/112x*8. What is the third derivative of m(k) wrt k? -180k2 Let f(l) = -l3 - l + 1. Let h(w) = -3w2 + w - 1. Let q(i) = 2f(i) + 2h(i). What is the third derivative of q(t) wrt t? -12 Suppose x + 3x = 8. What is the second derivative of -3s3 - 2s - xs3 - s wrt s? -30s Let t(h) = -5h + 2. Let o(r) = -11r + 5. Let z(n) = 4o(n) - 9t(n). What is the derivative of z(s) wrt s? 1 Let r(m) = -10m5 + 4m*4 + 4m*3 + 5m. Let c(k) = -9k5 + 5k*4 + 5k*3 + 4k. Let v(h) = -4c(h) + 5r(h). Find the second derivative of v(o) wrt o. -280o3 Let c(j) = 2j*2 - 3j - 4. Let o be c(3). Find the second derivative of -6io - 9i - 2i5 + 10i wrt i. -160i3 Let j(u) = -u3 + u2 - 1. Let k(p) = 24p*3 + 4p*2 - 6p - 4. Let c(d) = -4j(d) + k(d). What is the second derivative of c(o) wrt o? 168o Suppose -2j = -10 + 4. Let n be (-1 + 0)(3 + -8). What is the second derivative of -3gn - 2g + g*5 + jg wrt g? -40g3 Find the third derivative of -a5 - 2a*5 + 108a*2 - 89a*2 wrt a. -180a*2 What is the third derivative of -588 + 12p*4 + 18p*2 + 588 wrt p? 288p Let j(m) be the third derivative of -7/6m3 + 0m*6 - 1/105m*7 + 0m + 0m4 + 0 - 3m*2 + 0m*5. Find the first derivative of j(i) wrt i. -8i*3 Let g(d) be the second derivative of -2d*8/7 + 5d*4/4 - 8d. What is the third derivative of g(o) wrt o? -1920o3 Let m(q) be the first derivative of 3/2q*2 + 0q + q*3 - 4. Find the second derivative of m(v) wrt v. 6 What is the third derivative of 5a*2 + 7a - 7a - 4a2 - a3 wrt a? -6 Let y(j) = -63j - 45. Let a(h) = -32h - 23. Let t(g) = 9a(g) - 5y(g). Find the first derivative of t(o) wrt o. 27 Suppose 3s - 11 = 4. Find the third derivative of -3a*2 + 2a*4 - 2 - 3 + s wrt a. 48a Let n(x) = -x*3 + 9x*2 - 7x - 8. Let q be n(8). Differentiate 1 + qo2 + o2 - 4o*2 wrt o. -6o Let k(s) = 2 + 1 - 1 - 3s. Let d(z) = -z2 + 12z - 9. Suppose -2f + 7f = 10. Let p(w) = fd(w) + 9k(w). What is the second derivative of p(m) wrt m? -4 Let k(m) = -14m - 3. Let d = -9 - -3. Let h(l) = -27l - 5. Let q(z) = dh(z) + 11k(z). Find the first derivative of q(w) wrt w. 8 Suppose 2i = n - 10 + 1, -27 = -4n + 5i. Differentiate -2p - 2p - n + 0p with respect to p. -4 Suppose 0 = 5t - 0a - 2a - 27, 4t + 3a - 17 = 0. Suppose 0 = -h + t - 3. Find the third derivative of 4b3 - bh + 2b3 - 3b3 wrt b. 18 Let l(i) = i2 - 4i + 4. Let a be l(4). Find the second derivative of 0n*a + 0n4 - n5 - 2n wrt n. -20n*3 Suppose 0 = 3d - 3 - 6. Let w = -1 + d. What is the derivative of -u*2 - 7 + w + 2 wrt u? -2u Let n(i) be the third derivative of i7/21 - i5/12 + 11i2. Find the third derivative of n(y) wrt y. 240y What is the second derivative of -44q + 50q + q2 - q2 - 25q5 wrt q? -500q*3 Let l(f) = 2f*3 - 5f*2 - 14f - 5. Let n(v) = 2v3 - 6v*2 - 15v - 6. Let b(k) = 6l(k) - 5n(k). Find the second derivative of b(p) wrt p. 12p Let t(u) be the third derivative of -u10/75600 + u6/180 - u5/15 + 3u*2. Let l(c) be the third derivative of t(c). Differentiate l(z) wrt z. -8z*3 Suppose -3z - 2z - 20 = 0, -4x + z = -28. Suppose 5j = 26 - x. What is the second derivative of 0i*2 - 4i*2 + i - ji wrt i? -8 Let c(u) be the first derivative of -2u7/21 + u4/3 + 3u + 3. Let n(i) be the first derivative of c(i). Find the third derivative of n(o) wrt o. -240o2 Suppose -2b = 2b - 16. Find the first derivative of 5 + b - 3 - 1 - 5t*2 wrt t. -10t Let b(p) = -6p3 + 15p*2 + 7p + 7. Let l(t) = -3t3 + 8t*2 + 4t + 4. Let o(h) = 4b(h) - 7l(h). Find the third derivative of o(w) wrt w. -18 Suppose 7f - 3 = 6f. Let n(h) be the second derivative of 2h + 0 - 1/2h*2 - 1/2h*f. Find the first derivative of n(r) wrt r. -3 Let i(j) be the second derivative of 0 + 1/2j3 - j2 + 0j4 + 1/60j*5 - j. Let h(x) be the first derivative of i(x). Differentiate h(z) wrt z. 2z Let g(l) = 2l2 + 5. Let f be (-4)/2(1 + 1). Let t(d) = d*2 + 3. Let m(c) = fg(c) + 7t(c). Differentiate m(o) with respect to o. -2o Differentiate x + 2x + 1 - 5x wrt x. -2 Let m(u) = u3 - u2 - u - 1. Let q(y) = -18y3 + 2y*2 + 11y + 2. Let t(a) =	{ "pile_set_name": "DM Mathematics" }
ter 3:52 PM? 4:06 PM What is 52 minutes after 9:54 AM? 10:46 AM How many minutes are there between 11:22 AM and 9:06 PM? 584 How many minutes are there between 9:52 PM and 2:16 AM? 264 What is 517 minutes after 5:00 AM? 1:37 PM How many minutes are there between 11:16 AM and 4:21 PM? 305 How many minutes are there between 5:52 AM and 9:56 AM? 244 What is 145 minutes after 3:47 AM? 6:12 AM What is 700 minutes after 7:27 AM? 7:07 PM How many minutes are there between 11:59 AM and 7:32 PM? 453 What is 432 minutes after 11:15 PM? 6:27 AM How many minutes are there between 10:30 PM and 10:49 PM? 19 What is 111 minutes before 9:29 PM? 7:38 PM What is 121 minutes after 12:37 AM? 2:38 AM What is 223 minutes after 4:29 PM? 8:12 PM What is 89 minutes after 5:50 PM? 7:19 PM How many minutes are there between 2:01 PM and 5:58 PM? 237 What is 549 minutes before 11:33 AM? 2:24 AM What is 405 minutes after 1:32 AM? 8:17 AM How many minutes are there between 10:50 PM and 11:01 PM? 11 How many minutes are there between 11:47 PM and 4:57 AM? 310 What is 406 minutes before 8:12 PM? 1:26 PM What is 237 minutes after 12:41 PM? 4:38 PM What is 184 minutes before 5:57 PM? 2:53 PM What is 496 minutes after 9:21 AM? 5:37 PM What is 699 minutes after 9:49 PM? 9:28 AM How many minutes are there between 5:12 AM and 12:46 PM? 454 What is 184 minutes before 4:16 AM? 1:12 AM How many minutes are there between 6:45 AM and 5:31 PM? 646 What is 211 minutes after 9:24 PM? 12:55 AM What is 154 minutes after 8:01 AM? 10:35 AM How many minutes are there between 2:43 PM and 2:23 AM? 700 How many minutes are there between 1:35 AM and 2:00 AM? 25 How many minutes are there between 3:24 PM and 10:36 PM? 432 How many minutes are there between 12:48 PM and 2:35 PM? 107 How many minutes are there between 7:59 AM and 8:05 AM? 6 What is 39 minutes after 11:11 PM? 11:50 PM What is 418 minutes before 7:09 AM? 12:11 AM How many minutes are there between 9:09 PM and 8:57 AM? 708 What is 705 minutes before 3:40 AM? 3:55 PM What is 386 minutes before 8:41 AM? 2:15 AM How many minutes are there between 12:02 PM and 9:34 PM? 572 How many minutes are there between 11:18 AM and 3:38 PM? 260 What is 557 minutes after 8:46 AM? 6:03 PM What is 231 minutes after 1:55 PM? 5:46 PM What is 27 minutes before 11:54 PM? 11:27 PM What is 543 minutes after 2:30 AM? 11:33 AM What is 474 minutes before 8:56 AM? 1:02 AM How many minutes are there between 7:50 AM and 10:06 AM? 136 What is 328 minutes after 4:10 PM? 9:38 PM What is 547 minutes before 4:26 PM? 7:19 AM How many minutes are there between 7:08 AM and 3:09 PM? 481 What is 704 minutes before 10:54 PM? 11:10 AM What is 367 minutes before 4:37 AM? 10:30 PM What is 463 minutes after 8:27 AM? 4:10 PM What is 194 minutes after 4:00 AM? 7:14 AM How many minutes are there between 11:13 AM and 8:16 PM? 543 What is 265 minutes before 2:15 AM? 9:50 PM How many minutes are there between 7:22 AM and 1:35 PM? 373 What is 51 minutes before 2:50 AM? 1:59 AM What is 681 minutes before 4:11 AM? 4:50 PM How many minutes are there between 12:43 AM and 8:20 AM? 457 How many minutes are there between 2:16 PM and 5:53 PM? 217 How many minutes are there between 6:54 PM and 11:06 PM? 252 What is 236 minutes before 9:26 AM? 5:30 AM What is 104 minutes before 7:05 PM? 5:21 PM What is 123 minutes before 12:36 AM? 10:33 PM What is 303 minutes after 3:36 PM? 8:39 PM What is 420 minutes before 7:39 AM? 12:39 AM How many minutes are there between 1:19 AM and 12:51 PM? 692 How many minutes are there between 8:22 AM and 6:05 PM? 583 What is 543 minutes after 3:15 PM? 12:18 AM What is 570 minutes after 3:54 AM? 1:24 PM What is 443 minutes after 8:49 AM? 4:12 PM What is 462 minutes after 2:05 PM? 9:47 PM What is 170 minutes after 4:47 AM? 7:37 AM How many minutes are there between 4:51 PM and 8:20 PM? 209 What is 502 minutes after 4:44 PM? 1:06 AM How many minutes are there between 9:03 PM and 2:01 AM? 298 What is 456 minutes before 3:23 AM? 7:47 PM How many minutes are there between 10:49 AM and 9:54 PM? 665 How many minutes are there between 5:45 PM and 11:27 PM? 342 What is 90 minutes before 11:39 PM? 10:09 PM What is 419 minutes before 4:59 AM? 10:00 PM What is 581 minutes after 3:30 AM? 1:11 PM How many minutes are there between 5:57 AM and 2:07 PM? 490 What is 421 minutes after 10:40 AM? 5:41 PM What is 595 minutes after 2:15 PM? 12:10 AM What is 462 minutes after 11:35 AM? 7:17 PM How many minutes are there between 4:28 AM and 7:19 AM? 171 What is 82 minutes before 6:01 PM? 4:39 PM What is 472 minutes before 2:59 AM? 7:07 PM What is 453 minutes after 6:37 AM? 2:10 PM What is 672 minutes before 6:52 PM? 7:40 AM How many minutes are there between 4:45 PM and 6:40 PM? 115 How many minutes are there between 8:50 PM and 2:57 AM? 367 How many minutes are there between 8:11 AM and 8:05 PM? 714 How many minutes are there between 12:31 PM and 7:43 PM? 432 How many minutes are there between 9:11 PM and 6:39 AM? 568 How many minutes are there between 7:30 PM and 7:44 PM? 14 What is 167 minutes after 2:49 AM? 5:36 AM What is 706 minutes before 3:46 PM? 4:00 AM How many minutes are there between 9:24 PM and 10:52 PM? 88 How many minutes are there between 1:45 AM and 4:04 AM? 139 What is 560 minutes before 9:06 PM? 11:46 AM How many minutes are there between 7:08 AM and 10:19 AM? 191 What is 394 minutes before 8:52 PM? 2:18 PM What is 402 minutes before 8:53 AM? 2:11 AM What is 317 minutes after 9:38 PM? 2:55 AM How many minutes are there between 1:07 AM and 7:53 AM? 406 How many minutes are there between 11:59 PM and 6:58 AM? 419 What is 496 minutes before 7:20 PM? 11:04 AM How many minutes are there between 9:47 AM and 10:40 AM? 53 How many minutes are there between 4:53 PM and 1:52 AM? 539 What is 481 minutes after 10:21 PM? 6:22 AM What is 708 minutes before 8:59 PM? 9:11 AM How many minutes are there between 3:50 AM and 2:01 PM? 611 How many minutes are there between 4:41 AM and 1:57 PM? 556 How many minutes are there between 8:23 PM and 11:37 PM? 194 What is 682 minutes before 3:19 PM? 3:57 AM What is 303 minutes after 4:20 AM? 9:23 AM What is 647 minutes after 3:48 PM? 2:35 AM What is 419 minutes before 10:50 PM? 3:51 PM How many minutes are there between 7:59 PM and 5:31 AM? 572 How many minutes are there between 7:18 AM and 2:27 PM? 429 How many minutes are there between 2:14 PM and 8:41 PM? 387 What is 539 minutes after 8:13 AM? 5:12 PM What is 44 minutes before 11:25 AM? 10:41 AM How many minutes are there between 2:35 PM and 4:50 PM? 135 How many minutes are there between 8:44 PM and 5:47 AM? 543 What is 264 minutes after 2:16 AM? 6:40 AM How many minutes are there between 2:15 AM and 10:49 AM? 514 How many minutes are there between 10:48 AM and 12:19 PM? 91 What is 399 minutes before 5:25 AM? 10:46 PM What is 662 minutes after 5:55 PM? 4:57 AM How many minutes are there between 11:41 PM and 5:35 AM? 354 How many minutes are there between 3:09 AM and 7:20 AM? 251 What is 439 minutes before 9:41 PM? 2:22 PM What is 705 minutes before 9:22 AM? 9:37 PM How many minutes are there between 12:49 PM and 7:29 PM? 400 How many minutes are there between 4:34 AM and 7:10 AM? 156 What is 588 minutes after 4:26 AM? 2:14 PM How many minutes are there between 12:13 PM and 5:06 PM? 293 How many minutes are there between 7:50 PM and 7:12 AM? 682 What is 292 minutes before 8:25 PM? 3:33 PM How many minutes are there between 2:17 AM and 2:56 AM? 39 How many minutes are there between 9:38 PM and 10:29 PM? 51 What is 353 minutes before 10:59 AM? 5:06 AM What is 154 minutes before 4:05 PM? 1:31 PM How many minutes are there between 6:43 PM and 4:35 AM? 592 How many minutes are there between 5:51 AM and 2:31 PM? 520 How many minutes are there between 9:36 PM and 3:50 AM? 374 What is 156 minutes before 8:20 AM? 5:44 AM What is 277 minutes before 9:14 PM? 4:37 PM How many minutes are there between 6:32 PM and 11:54 PM? 322 How many minutes are there between 10:09 AM and 1:13 PM? 184 How many minutes are there between 9:16 AM and 9:41 AM? 25 What is 6 minutes after 8:04 PM? 8:10 PM How many minutes are there between 5:16 PM and 8:07 PM? 171 How many minutes are there between 6:20 PM and 5:52 AM? 692 What	{ "pile_set_name": "DM Mathematics" }
m(-4/17)m((m/(mm*8/m))/mm)/mm) assuming m is positive. m(-74/119) Simplify (g(20/7))(-1/12)/(g/(g(-3/10)g))(-28/5) assuming g is positive. g(757/525) Simplify k*24kkk(kk*(-11))/k(kk(-21)k)(-1/59) assuming k is positive. k(963/59) Simplify (((f/(((f/((f/(f/f(-9/2)))/f))/f)/f))/(f(-1/3)f))38)(-1/29) assuming f is positive. f(475/87) Simplify (hh*2h)/h*(-4/9)(h*(-17)h)/(h(1/31)/h) assuming h is positive. h(-2954/279) Simplify ((n/(nn0n)n)/n)(1/32)/(n/n7nn/n(2/5)) assuming n is positive. n(699/160) Simplify ww*(2/11)w*(5/7)/w(w/(ww(6/5)))/w(w/((ww/(w/(w5/w)w))/w))/w assuming w is positive. w(-1657/385) Simplify (t9t(t/(tt(-8)))/t)/((((t(-1/8)t)/t)/t)/tt)(2/25) assuming t is positive. t(1709/100) Simplify (j/((j(j/j*(3/13)j)/j)/j))/(jj(-3/4))(j*(4/9)/jj)/jj/j10 assuming j is positive. j(-4481/468) Simplify r(8/11)r*8/r(r(-3/2))(-36) assuming r is positive. r*(679/11) Simplify (kkk2)(-2/17)/(k(-1))13 assuming k is positive. k(213/17) Simplify ((nn(n(1/7)n)/nn)/(nn*(-2/11)))/((nn*(-1/6)n)/(n/n*(-1/8)nn)) assuming n is positive. n(6683/1848) Simplify (s(-1/6)s/(s(s/((s/((ss/((s*(-1/5)s)/s))/s))/ss))/s)(s3)(-27))(-2/81) assuming s is positive. s(2441/1215) Simplify ((((iii(3/4))/i)/i)/i(9/7))13 assuming i is positive. i(-195/28) Simplify n(-7/4)/n7(n(2/9))(-11/6) assuming n is positive. n(-989/108) Simplify (yy*7yyyyy)*(-5/13)/(yy*(-1/5)/yy)34 assuming y is positive. y(-161/5) Simplify s(-1/14)/(s11s)(s/(s/(ss(ss(-1/4)/s)/s)s)s)/s15 assuming s is positive. s(-737/28) Simplify (d(1/6)/d)(-23)(dd(-5)d)47 assuming d is positive. d(-731/6) Simplify i6/(i19/i)i(-7)/((i(-1/2)/i)/i) assuming i is positive. i(-33/2) Simplify (t2ttt*(-3/4)ttt(t/(t/((t(tt(-2/3))/tt)/t)))/tt(2/9))(3/10) assuming t is positive. t(209/120) Simplify (n/((n/n16)/n))(-6/17)/((n(n*(-1/24)/n)/n)/nn/(nn17n)n) assuming n is positive. n(313/24) Simplify (x/x10)(-16/7)/(x(3/8)x)(2/19) assuming x is positive. x(10867/532) Simplify ((tt6/t)/ttttt/(t/t6))31 assuming t is positive. t434 Simplify (mm(-9/7))/(m(-22)m)m(10/9)/(m/((m(-2/21)m)/m)) assuming m is positive. m(1306/63) Simplify ((ll*(23/3)l)/ll(-1))/(l(-2/77)l(4/15)/l) assuming l is positive. l(3244/385) Simplify p*(4/7)p/p*6(p/(pp(-9)/p))(3/20) assuming p is positive. p(-41/14) Simplify ((a/a(-2/7))(-27)/(a(4/7)a(-1/4)))36 assuming a is positive. a*(-8829/7) Simplify (nn*22nn/(n23/n))/(nn(19/4))(1/5) assuming n is positive. n*(37/20) Simplify (aaa(-14))/aa*(11/3)(a/((a*(-2/5)aa)/a))(11/5) assuming a is positive. a(-634/75) Simplify f32/ffff*(4/9)f(f/(f(2/13)/ff))/(f(f(f*(-7)f)/f)/f) assuming f is positive. f(4831/117) Simplify (q(-4/9)q(-1/4))/(q27q*13q) assuming q is positive. q(-1501/36) Simplify (r(2/45))*(2/67)/((r/(rr/(r/(r(rr/r(-1/14))/r))))/(r/r1)) assuming r is positive. r(87491/42210) Simplify (x/((x32x)/xx)x/(((((x/((xx/((x/x*(-12/13)x)/x))/x))/x)/x)/xx)/x))(3/8) assuming x is positive. x(-1167/104) Simplify ((t/t(-1/5))/tt*19/tt)/((ttt*(-3/4)t)/tt)(2/13) assuming t is positive. t(2451/130) Simplify ((m/(m/(mm*(23/2)mm)))(1/5))(15/4) assuming m is positive. m(87/8) Simplify (h(-4/13)/(h(-21/4)/h))/((h/h(-6/11))/(((h/((h/(h(-7)hhh))/h))/h)/h)) assuming h is positive. h*(-345/572) Simplify ((pp*(2/5))/p(ppp(1/3))/p)/((p/(p/p(-11)p))/((p(-1/30)pp)/p)) assuming p is positive. p(147/10) Simplify (g12/g7)/(gggg(1/2))(1/10) assuming g is positive. g(93/20) Simplify ((r(-2/95)r)/rrrr*28rr)(-11/3) assuming r is positive. r(-33418/285) Simplify z16/z(-7)z(-3/13)/((z/z(-9/4))/z) assuming z is positive. z(1067/52) Simplify ((k(-3/4)k((k/(k(-1)/k))/k)/k)/(k(-8)/k(-2/5)))(-10) assuming k is positive. k*(-177/2) Simplify ((aa*(2/7)a)(-10)/(a/(a/a0))5)30 assuming a is positive. a(-4800/7) Simplify ((w(-6)/w)/(w/(w/((w(-3/2)/w)/w))))/((w(5/4)/www)/((w/(w(2/9)/w))/w)) assuming w is positive. w(-179/36) Simplify m*(1/10)mm(1/28)mm(-3/2)/mm(((m/m(1/19))/m)/m)/m assuming m is positive. m(-3769/2660) Simplify (p/(p(-1/16)p))(4/7)/(p(2/21))(2/59) assuming p is positive. p(23/708) Simplify (n*(1/4)/(((nnn/(n(-5)n))/nn)/n)n/n*(-1)n/(nn3))(-2/49) assuming n is positive. n(27/98) Simplify (c(2/3)c(2/9))/((c/c(2/11))/((cc((cc9)/c)/cc)/c)) assuming c is positive. c(997/99) Simplify (r14/(r/((r*(-1/33)/r)/r)))/(rr/(r/r*(-2))r)(11/3) assuming r is positive. r(362/33) Simplify ((qq(-4/3)q/(q/q(-2/19)))(-2/119))(-12) assuming q is positive. q(-200/2261) Simplify (cc/(c/c(-3/7)c))(-3/10)/(c(1/9)ccc6c) assuming c is positive. c(-5659/630) Simplify ((j(4/7)j/(j/(((j/(j(-5)/j))/j)/j)))(-9/8))(25/4) assuming j is positive. j(-8775/224) Simplify o(-23)o((oo*4)/o)/o(oo16)(-1/2) assuming o is positive. o(-55/2) Simplify (g/(g(-9)/g)g(-1/12))/(g(-3)/gggg9g) assuming g is positive. g(35/12) Simplify ((k/k(1/4))/k)(4/3)/((((k1/k)/k)/kk)/k)(-9/7) assuming k is positive. k(-61/21) Simplify (t(-1)/t)(-31)t/t*(5/2)t(15/2) assuming t is positive. t68 Simplify a/(aa/a(-13/2))aa(18/11)a/(aa(-2/11)aaa)((aa/(a*(10/11)a))/a)/a assuming a is positive. a*(-211/22) Simplify (xx*(-2)/xxx(-3)x)/((x(-9)/x)/x6) assuming x is positive. x13 Simplify (s/s(1/9)s/(s/s(11/5)))/(s(2/5)s(2/7)) assuming s is positive. s(757/315) Simplify r/(rr(-7/6))r/r*11(r/(r/r(2/5)))(-3/31) assuming r is positive. r(-8251/930) Simplify (y/y(-36)y(4/19))(-48) assuming y is positive. y(-33936/19) Simplify (m(-3))(-37)/(m(-1/2)m/(m/(m/((m(m(2/31)mm)/m)/m)))) assuming m is positive. m(6917/62) Simplify (p(1/27)/ppp)/(p25p)(p(2/61))(6/11) assuming p is positive. p(-451930/18117) Simplify (x(-2/13))25(x(5/2)/x)/(x(-2/33)x) assuming x is positive. x(-2819/858) Simplify (f0/(ff*(1/11)))/((f(f*(-18)f)/f)/f12) assuming f is positive. f(307/11) Simplify ((((bb/(b/b(-6/11)bb))/b)/bb)/b*(-7))/(bbb/(b/(bbbb(-4))))(13/6) assuming b is positive. b(151/66) Simplify ((c/c2)*(-18)(ccc(-4))/((c(2/13)/ccc)/c))(17/5) assuming c is positive. c(3502/65) Simplify (u*(-8)uu(2/75))/(u/(uu*(-17))uu(u/(u/(u(-16/3)/u)))/u) assuming u is positive. u(-466/25) Simplify (aa(2/3)a/((aa6)/a)a*(1/2)aaa/(aaa/a*0a)a)(2/5) assuming a is positive. a(-17/15) Simplify (n3)(-38)(nn(-1)n)(-24/7) assuming n is positive. n(-822/7) Simplify (w*(5/4)w/(w*(-4/3)w)(w(-1/3))(-1/21))(1/42) assuming w is positive. w(655/10584) Simplify (qq/(q*7/q)qq(-12))/((q(-20)/q)/((qq(-13))/q)) assuming q is positive. q(-7) Simplify (ii/(i(-16/9)i)i)/(ii*(1/22))i*(2/75)i(-1/11)/i assuming i is positive. i(8257/4950) Simplify (x(-17))(-7)/((x*(-36)/xx)/x(-17)) assuming x is positive. x138 Simplify ((pp(1/2)p)/p)*(-4)((pppp(1/6))/p)(-8/7) assuming p is positive. p(-178/21) Simplify (c(2/87)/(c(-11)/cc))/(c(3/8))(6/5) assuming c is positive. c*(18397/1740) Simplify (ll/((ll/(l/l9))/l)l(2/15))/(((l/(l(-5/4)/l))/ll)/ll)(-7/10) assuming l is positive. l(-551/120) Simplify (x/(xx(1/2))x/x*(-2/5)(x/x(-9))/(x/(x/(x/(x/x(-9/5))))))(-10) assuming x is positive. x(-127) Simplify (dd/((dd(-3))/d))(-26)(d0)(4/3) assuming d is positive. d(-130) Simplify ((t/(t(t/t(17/5))/t))/t)/((t(2/15)/t)/t)t/t(-1/10)(ttt*(19/3)t)/t assuming t is positive. t*(137/10) Simplify ((ooo(-24)o)/o*(-35))/(oo*(-4)o(3/14)) assuming o is positive. o(235/14) Simplify ((d/((ddd*(-6)/dd)/d)d)/(d/(d(-2/9)/d))d*3(d*(2/5)/d)/dd)**39 assuming d is positive	{ "pile_set_name": "DM Mathematics" }
nder when 861 is divided by 15. 6 Calculate the remainder when 8507 is divided by 185. 182 Calculate the remainder when 538 is divided by 111. 94 What is the remainder when 52 is divided by 31? 21 What is the remainder when 29 is divided by 16? 13 What is the remainder when 1490 is divided by 436? 182 What is the remainder when 370 is divided by 312? 58 What is the remainder when 875 is divided by 12? 11 Calculate the remainder when 2735 is divided by 114. 113 Calculate the remainder when 177 is divided by 56. 9 What is the remainder when 25 is divided by 10? 5 What is the remainder when 123 is divided by 7? 4 Calculate the remainder when 2134 is divided by 24. 22 Calculate the remainder when 1765 is divided by 104. 101 Calculate the remainder when 20 is divided by 12. 8 What is the remainder when 107 is divided by 27? 26 What is the remainder when 94 is divided by 93? 1 What is the remainder when 4307 is divided by 4? 3 Calculate the remainder when 794 is divided by 49. 10 What is the remainder when 868 is divided by 30? 28 Calculate the remainder when 74 is divided by 26. 22 Calculate the remainder when 3983 is divided by 75. 8 Calculate the remainder when 42954 is divided by 129. 126 What is the remainder when 382 is divided by 55? 52 What is the remainder when 66 is divided by 24? 18 What is the remainder when 248 is divided by 65? 53 What is the remainder when 888 is divided by 186? 144 Calculate the remainder when 74 is divided by 35. 4 What is the remainder when 197 is divided by 22? 21 Calculate the remainder when 45 is divided by 25. 20 Calculate the remainder when 59 is divided by 20. 19 Calculate the remainder when 740 is divided by 68. 60 What is the remainder when 3201 is divided by 1066? 3 What is the remainder when 179 is divided by 23? 18 What is the remainder when 599 is divided by 61? 50 Calculate the remainder when 173 is divided by 63. 47 What is the remainder when 1297 is divided by 372? 181 What is the remainder when 338 is divided by 10? 8 Calculate the remainder when 262 is divided by 65. 2 What is the remainder when 3238 is divided by 18? 16 Calculate the remainder when 411 is divided by 221. 190 What is the remainder when 18238 is divided by 76? 74 What is the remainder when 262 is divided by 22? 20 What is the remainder when 1889 is divided by 173? 159 What is the remainder when 7133 is divided by 2370? 23 Calculate the remainder when 203 is divided by 55. 38 What is the remainder when 357 is divided by 118? 3 Calculate the remainder when 1384 is divided by 232. 224 What is the remainder when 1368 is divided by 151? 9 What is the remainder when 23710 is divided by 76? 74 Calculate the remainder when 2145 is divided by 10. 5 Calculate the remainder when 177 is divided by 15. 12 Calculate the remainder when 644 is divided by 19. 17 What is the remainder when 4687 is divided by 34? 29 Calculate the remainder when 21 is divided by 10. 1 Calculate the remainder when 1518 is divided by 8. 6 What is the remainder when 3659 is divided by 39? 32 Calculate the remainder when 296 is divided by 42. 2 Calculate the remainder when 459 is divided by 66. 63 What is the remainder when 1131 is divided by 18? 15 Calculate the remainder when 527 is divided by 282. 245 Calculate the remainder when 227 is divided by 195. 32 Calculate the remainder when 268 is divided by 109. 50 Calculate the remainder when 930 is divided by 450. 30 Calculate the remainder when 137 is divided by 31. 13 Calculate the remainder when 1189 is divided by 594. 1 What is the remainder when 151 is divided by 17? 15 Calculate the remainder when 385 is divided by 43. 41 What is the remainder when 571 is divided by 41? 38 What is the remainder when 1210 is divided by 138? 106 What is the remainder when 372 is divided by 74? 2 What is the remainder when 312 is divided by 21? 18 Calculate the remainder when 4499 is divided by 31. 4 Calculate the remainder when 950 is divided by 87. 80 Calculate the remainder when 5271 is divided by 15. 6 Calculate the remainder when 353 is divided by 73. 61 Calculate the remainder when 52 is divided by 8. 4 What is the remainder when 192 is divided by 101? 91 What is the remainder when 150 is divided by 9? 6 What is the remainder when 863 is divided by 18? 17 What is the remainder when 97 is divided by 17? 12 Calculate the remainder when 560 is divided by 253. 54 Calculate the remainder when 1100 is divided by 544. 12 What is the remainder when 1112 is divided by 21? 20 What is the remainder when 64 is divided by 62? 2 What is the remainder when 267 is divided by 101? 65 Calculate the remainder when 1690 is divided by 188. 186 Calculate the remainder when 157 is divided by 63. 31 Calculate the remainder when 45 is divided by 41. 4 What is the remainder when 221 is divided by 8? 5 What is the remainder when 361 is divided by 180? 1 What is the remainder when 873 is divided by 51? 6 Calculate the remainder when 2979 is divided by 45. 9 Calculate the remainder when 185 is divided by 36. 5 Calculate the remainder when 561 is divided by 21. 15 Calculate the remainder when 221 is divided by 15. 11 What is the remainder when 75 is divided by 39? 36 What is the remainder when 46470 is divided by 21? 18 Calculate the remainder when 71 is divided by 34. 3 Calculate the remainder when 526 is divided by 174. 4 What is the remainder when 78 is divided by 14? 8 What is the remainder when 9391 is divided by 101? 99 Calculate the remainder when 49 is divided by 29. 20 Calculate the remainder when 530 is divided by 512. 18 What is the remainder when 378 is divided by 108? 54 What is the remainder when 997 is divided by 23? 8 What is the remainder when 114 is divided by 47? 20 What is the remainder when 85 is divided by 27? 4 What is the remainder when 5037 is divided by 126? 123 What is the remainder when 257 is divided by 16? 1 What is the remainder when 2231 is divided by 573? 512 What is the remainder when 230 is divided by 78? 74 What is the remainder when 754 is divided by 54? 52 What is the remainder when 132 is divided by 17? 13 What is the remainder when 104 is divided by 15? 14 Calculate the remainder when 1348 is divided by 45. 43 Calculate the remainder when 387 is divided by 36. 27 Calculate the remainder when 4183 is divided by 46. 43 Calculate the remainder when 49 is divided by 41. 8 What is the remainder when 479 is divided by 23? 19 Calculate the remainder when 6761 is divided by 104. 1 What is the remainder when 992 is divided by 991? 1 Calculate the remainder when 93 is divided by 48. 45 Calculate the remainder when 221 is divided by 41. 16 What is the remainder when 424 is divided by 56? 32 What is the remainder when 437 is divided by 10? 7 What is the remainder when 700 is divided by 117? 115 What is the remainder when 33 is divided by 15? 3 What is the remainder when 4029 is divided by 31? 30 What is the remainder when 202 is divided by 102? 100 What is the remainder when 99 is divided by 74? 25 What is the remainder when 722 is divided by 232? 26 What is the remainder when 580 is divided by 35? 20 Calculate the remainder when 720 is divided by 46. 30 What is the remainder when 41 is divided by 4? 1 What is the remainder when 5045 is divided by 58? 57 What is the remainder when 3831 is divided by 27? 24 Calculate the remainder when 1012 is divided by 14. 4 Calculate the remainder when 647 is divided by 21. 17 Calculate the remainder when 1109 is divided by 184. 5 Calculate the remainder when 471 is divided by 221. 29 Calculate the remainder when 125 is divided by 12. 5 What is the remainder when 8638 is divided by 216? 214 What is the remainder when 1343 is divided by 80? 63 Calculate the remainder when 1941 is divided by 162. 159 Calculate the remainder when 793 is divided by 29. 10 What is the remainder when 195 is divided by 159? 36 What is the remainder when 34 is divided by 23? 11 What is the remainder when 52 is divided by 31? 21 Calculate the remainder when 343 is divided by 113. 4 Calculate the remainder when 61 is divided by 57. 4 Calculate the remainder when 499 is divided by 63. 58 Calculate the remainder when 212 is divided by 36. 32 Calculate the remainder when 780 is divided by 61. 48 What is the remainder when	{ "pile_set_name": "DM Mathematics" }
ppose 5m - 16 = -3m. What is the least common multiple of m and n? 2 Suppose 0 = -5b + 3k + 72, 3b - 52 = 5k + 4. What is the lowest common multiple of b and 12? 12 Let r = 4878 - 53612/11. What is the common denominator of r and 2/11 - (-1842)/(-88)? 44 Find the common denominator of (4/144107)/((-1)/(-2)) and -79/10. 90 Let h(m) = m2 - 7m + 2. Suppose 0 = -x - 5, -4j - 4x = -8j + 44. Let o be h(j). What is the common denominator of -25/8 and (-1 + o5)/4? 8 Let x(j) = -335j2 - 6j - 1. Let g be x(-4). Let i = g + 3174. Let d = -8727/4 - i. Calculate the common denominator of d and 107/10. 20 Let g(a) = -3a - 16. What is the smallest common multiple of g(-9) and 9? 99 Let p = 11294/55 + -2013/10. Let i = 9 + -16. Calculate the common denominator of (-5240)/896 + (-2)/i and p. 176 Let g(u) = -126u + 2. Let n be g(5). Let f = n + 3109/5. Calculate the common denominator of 31/6 and f. 30 Let x be ((-40)/(-6))/(5/(-15)). What is the common denominator of 1/(x/(-158)) - 2 and ((-3)/(-66))/(1/(-30))? 110 Let s = -788205413/5859 + 134529. Let k = -80065/23436 + s. What is the common denominator of -67/16 and k? 48 Calculate the smallest common multiple of 1 - ((-16)/7 - (-20)/70) and 4. 12 Let d = -42/235 - -54176/705. Let m = -97 + d. Find the common denominator of m and -1/2. 6 Suppose v - 17 - 3 = 0. Suppose -6j + v = -j. Let i = -10 + 19. Calculate the least common multiple of j and i. 36 Let v = 73/72 - 43/18. What is the common denominator of -25/18 and v? 72 Let t(z) = z3 - 6z*2 + 7z - 7. Calculate the least common multiple of ((-2)/(1/(-1)))/2 and t(5). 3 Suppose -y + c = -9, 2c = 4y + c - 45. Let l = -2 - -4. What is the least common multiple of l + 0 + -3 - -13 and y? 12 Let n = -2/595 + 25593/2380. Find the common denominator of (-4)/6(-63)/22 and n. 44 Let h be (823282/(-20))/((-4)/2). Suppose -7x - 82352 = -3x. Let p = h + x. What is the common denominator of 125/12 and p? 60 Calculate the common denominator of (66/(-63))/(8/54) and -95/6. 42 Let z = 221561/18 - 12312. Let o be 191/588(-374)/3. Let a = o - 2/441. What is the common denominator of a and z? 18 Let t = 4 - 3. Calculate the common denominator of -21 - (-201)/27 and t - 150/21 - -2. 63 Let k = 9711/4 - 2442. Calculate the common denominator of k and 49/11. 44 Let f = -3 - -23. Calculate the lowest common multiple of 26 and f. 260 What is the least common multiple of -1 + (-658)/(-12) - 2/(-12) and 8? 216 Let f = -356348 + 8554441/24. Let n = 487/6 - f. Find the common denominator of n and 83/18. 72 Let z = -52 - -62. Calculate the least common multiple of z and 6. 30 Let u = 4 - 8. Let f(t) = t3 + 3t*2 - 5t - 1. Calculate the lowest common multiple of 4 and f(u). 12 Let q = -25/13 + 314/143. Let z = -595573/6 - -98909. Let o = 355 + z. Find the common denominator of o and q. 66 Let r be (5 - -2) + -3 - -21. Let b = 35 - r. Suppose -d = -0 - 20. Calculate the smallest common multiple of b and d. 20 Let c(r) = -3r2 - 2r + 2. Let s be c(-2). Let y = 7 + s. What is the least common multiple of 5 and y? 5 Let k(l) = l*2 - 3l - 3. Let d = -3 + 3. Suppose dp - 2p + 22 = 0. Calculate the least common multiple of p and k(4). 11 Let y = 4655/4 - 1180. Calculate the common denominator of y and (13 - -1)/(6/4). 12 Let k = -24 + 30. Suppose -2x + 2 = 0, 26 = 4h - h - 4x. What is the least common multiple of h and k? 30 Let c be 4682/(-5)25/7608. Let s = c + -2/317. What is the common denominator of -77/4 and s? 12 Let d(i) = -i - 2. Let a be d(-2). What is the common denominator of 1(-14)/(-44)(-8)/4 and 1/8 - a - 0? 88 Let t = -6 + 0. What is the lowest common multiple of (-2)/(-9) - (-79)/9 and 36/t1/(-2)? 9 Let x = 13 + 5. Let f be 4/x - 68/(-18). Suppose fh - 5 = 19. Calculate the smallest common multiple of h and 11. 66 Let x be 911/(-1830) + (-12)/(-18). Let q = -252/61 - x. What is the common denominator of 25/9 and q? 90 Let q = -3870 - -15555/4. Find the common denominator of q and -87/50. 100 Let v = 17 - 3. What is the lowest common multiple of 3 and v? 42 What is the common denominator of (25/4)/((-9)/(-2)) and (-12 + 25)/(-52) - (-3)/4? 18 Let s be 8/36 - (-68)/18. Calculate the common denominator of (-117)/s(-2)/6 and 18/100110/4. 20 Suppose 3y - 160 = -2y. Let c = 8 - y. What is the common denominator of -26 and c? 1 Let b = 24 + -10. Suppose 2v - 4 = 4. What is the least common multiple of v and b? 28 Let l(q) = -5 + 0 - 3q - 3 + 1. What is the lowest common multiple of l(-3) and 2? 2 Let i(g) = 2g2 - 6g + 24. Let k = -5/18 - 7/18. Find the common denominator of i(4) and k. 3 Suppose -2q + 19902 = q. Let o be q/(-14) + -4 + 5. Let i = o + 470. Calculate the common denominator of 121/10 and i. 70 Let p(b) = -b2 - 9b + 2. Let q(s) = s*2 - 3s + 4. What is the least common multiple of q(5) and p(-4)? 154 Let o(r) = -r*2 + 9r - 7. Let f be o(8). Let m = 1 + f. Calculate the least common multiple of m and 3. 6 Let f = 41968 - 1762783/42. What is the common denominator of f and 63/2? 42 Let q(p) = -6p3 + 56p*2 - 11p - 21. Let n(c) = c*3 - 11c*2 + 2c + 4. Let m(f) = 11n(f) + 2q(f). Calculate the least common multiple of m(-9) and 9. 18 Let j be 16/(-3252)35309/16. Let h = j + -16/271. Let k = 34587/1628 + 2/407. Find the common denominator of k and h. 12 Suppose 2f = m - 14, m - f - 8 = 3f. Suppose -99 = -3k + 69. Let n = k + -40. Calculate the smallest common multiple of m and n. 80 Let i = 18669/3652 + -7/332. Let z(h) = -h*2 - 33. Let y be z(0). Let l = 1 + y. Find the common denominator of l and i. 11 Calculate the common denominator of -1 - -2(-53)/(-28) and 2/(-4) - (-1863)/(-270). 70 Let r(u) = -u*2 + 6u + 8. Let t be r(7). Let f = t - -7. What is the least common multiple of f and 16? 16 Let f(o) = -2o2 + 1. Let p be f(1). Suppose x = -0 + 2. Calculate the lowest common multiple of (p/(-1))/(x/8) and 6. 12 Suppose 5 = -2b - 1. Let o be (-105518)/(-24) + b/(-2). Let u = o - 4395. Calculate the common denominator of u and -41/6. 12 Let p = -1201/84 - -91/12. What is the common denominator of p and -38/5? 35 Find the common denominator of 97/16 and (38/(-4))/(14/(-10)). 112 Suppose -4m = -0m + 20. Find the common denominator of (-1)/(-4) + 28/m and 15/(-12)34/55. 220 Calculate the lowest common multiple of 7 and 0/((-4)/(-4)) - -10. 70 What is the least common multiple of -3 + (-28)/(-4) - 1 and 8? 24 Suppose -i = 2w - 3i + 28, -w = 4i + 4. Let r = 7 + w. Let v = 5/18 + -196/9. What is the common denominator of v and r? 2 Let b(j) = 57j - 1. Let v be b(-3). Let n = -2407/14 - v. Find the common denominator of n and -91/16. 112 Let a = 3271/790 + 60/79. Let u = 3524 + -21191/6. What is the common denominator of a and u? 30 Suppose -4b + p = -54, -4p = 2b - 0p - 36. What is the lowest common multiple of b and 46? 322 Calculate the lowest common multiple of 6 and 1 - 4 - 28/(-4). 12 Let i = -116 + 138. Let m = -22 - -38. Calculate the least common multiple of m and i. 176 Suppose 3v - 4c - 13 = 0, -5v + 23 = 5c - 57. What is the lowest common multiple of v and 6? 66 Let c = -147485/12 - -12301. What is the common denominator of c and 167/30? 60 Let q = -11051/2 - -5008. Let v = q + 535. Let n = 181/6 - 35. Find the common denominator of v and n. 6 Suppose -45x - 55 = -50x. Suppose 3o - 2v - 1 = 0, o + 4v - 4 = v. Calculate the smallest common multiple of x and o. 11 Let w = -36594 + 1829761/50. Find the common denominator of 7/6 and w. 150 Let x(w) = 3w3 - 9w*2 - 7w + 16. What is the least common multiple of 54 and x(4)? 108 Let o be 4/(-3) - (-176)/33. Find the common denominator of (-1)/o536/8 and 8/3. 12 What is the common denominator of 37/14 and ((-214)/(-12))/(7/(-3))? 14 Let s = -8680 + 928770/107. Let p = 4775/428 + s. Find the common denominator of -53/7 and p. 28 Suppose 2a + a + 3o - 54 = 0, 2o = -4a + 76. Calculate the lowest common multiple of a and (-2)/(-5 + (-24)/(-5)). 20 Let s(x) = x2 + 10x + 3. Let g be (-4)/(-625) - (0 + 0). Let y = 20597/4375 + g. Find the common denominator of y and s(-6). 7 Suppose p - 317 = -118. Suppose 2*j = j - p. Calculate the common denominator of -5/14 and j/(-6) - 4/6. 14 Find the common denominator	{ "pile_set_name": "DM Mathematics" }
ermine x(1). 2 Let q(p) = p*3 + 11p*2 + 12p - 12. Determine q(-10). -32 Let c(z) = -2z2 + 9z + 24. What is c(11)? -119 Let n(s) = 2s - 27. Determine n(6). -15 Let o(i) = -i3 + 7i*2 - 8i - 8. Calculate o(6). -20 Let o(w) = -w*2 + 2w + 9. Determine o(4). 1 Let r(b) = b*2 - 9b - 26. What is r(11)? -4 Let s(f) = -2f - 21. Calculate s(-10). -1 Let v(a) = 2a*2 + 7a + 26. Give v(-9). 125 Let m(h) = h*2 + h + 18. Determine m(0). 18 Let g(k) = 61k + 15. Give g(2). 137 Let u(l) = 3l3 + 3l*2 - 2l + 3. Determine u(2). 35 Let v(l) = l*3 + 3l*2 + 3l + 2. Calculate v(-3). -7 Let x(o) = 42o + 457. Give x(-11). -5 Let d(o) = -283o + 1126. Determine d(4). -6 Let c(f) = f - 12. Give c(-10). -22 Let d(p) = 2p3 - 6p*2 + 11p - 7. Calculate d(2). 7 Let k(y) = 3y + 18. Calculate k(-8). -6 Let v(q) = -q3 - 14q*2 - 12q - 2. Determine v(-13). -15 Let a(x) = -x + 10. What is a(-6)? 16 Let v(j) = -2j + 8. Give v(9). -10 Let t(o) = o2 - 17o - 23. Determine t(18). -5 Let j(c) = -c*3 + 12c - 18. Determine j(2). -2 Let i(u) = -14u3 - 28u - 29. Give i(-1). 13 Let y(j) = j*3 - 6j*2 - 5j + 6. What is y(7)? 20 Let x(j) = 2j3 + 23j*2 - 14j - 29. Determine x(-12). -5 Let i(j) = -j*2 + 6j + 347. What is i(-16)? -5 Let o(w) = 6w2 + w + 2. What is o(3)? 59 Let w(z) = -z2 + 29z + 20. Give w(30). -10 Let t(s) = s - 12. Calculate t(6). -6 Let a(j) = -j*3 - 10j*2 + 57j + 10. Calculate a(-14). -4 Let q(p) = 9p2 + 3p + 1. What is q(-2)? 31 Let d(g) = 3g2 - 5g. Calculate d(1). -2 Let l(r) = -10r2 - 3r + 2. What is l(1)? -11 Let u(x) = 21x - 1888. Give u(90). 2 Let v(h) = 2h*2 + 3h. Determine v(-3). 9 Let c(q) = q*2 + 16q - 45. Give c(-18). -9 Let j(k) = k*3 + 10k*2 - 23k + 7. Give j(-12). -5 Let z(g) = -2g - 22. Calculate z(-9). -4 Let w(a) = -a2 + a. Give w(4). -12 Let r(n) = n3 + 5n*2 - 5n + 6. What is r(-6)? 0 Let j(l) = l*2 - 48l + 5. Calculate j(48). 5 Let t(w) = 2w2 + 33w + 33. Calculate t(-16). 17 Let v(w) = -w*3 + 4w*2 - 6w + 6. Give v(3). -3 Let j(q) = -q*3 + 2q*2. Calculate j(-2). 16 Let c(x) = -3x*2 - 9x + 54. Give c(-6). 0 Let i(l) = -27l - 3. Give i(2). -57 Let c(g) = -2g + 16. Determine c(6). 4 Let p(h) = -h3 + h2 - 40. Give p(0). -40 Let l(r) = -r*3 + 7r*2 + 1. Determine l(8). -63 Let q(j) = -39j - 233. Calculate q(-6). 1 Let p(w) = 5w2 + 8w + 2. What is p(3)? 71 Let c(j) = 5j + 15. What is c(-7)? -20 Let x(g) = 2g2 - 3. What is x(3)? 15 Let a(b) = -b2 + 11b - 4. Determine a(10). 6 Let h(l) = l3 - 20l*2 + 13l + 121. Calculate h(19). 7 Let j(d) = -d*2 - 9d - 26. What is j(-7)? -12 Let w(f) = -f*3 - 11f2 - 14. Calculate w(-11). -14 Let y(k) = -k2 - 11k + 8. What is y(-9)? 26 Let t(o) = o3 - 10o*2 + 18o - 9. What is t(8)? 7 Let h(s) = s*2 - 17s + 20. Calculate h(6). -46 Let r(h) = -45h + 1. What is r(-1)? 46 Let i(z) = z2 - 4z - 7. What is i(-2)? 5 Let k(a) = 10a2 - 2. Determine k(-1). 8 Let k(v) = -2v*3 - 2v*2 + 3v + 1. Give k(2). -17 Let s(z) = -z*2 + 6z + 67. What is s(-6)? -5 Let i(c) = c*3 + 4c*2 - 2c - 9. What is i(-4)? -1 Let t(q) = 72q2 - q - 1. Give t(-1). 72 Let z(w) = w2 - 55w - 724. Calculate z(-11). 2 Let a(b) = b*3 + 8b*2 + 7b + 12. Determine a(-7). 12 Let n(i) = -i*2 - 2i + 1. Calculate n(-3). -2 Let i(r) = -2r - 16. Give i(-7). -2 Let b(u) = u3 + 10u*2 - 15u - 26. Determine b(-11). 18 Let r(t) = 2t - 51. What is r(23)? -5 Let t(a) = a3 + 16a*2 - 38a - 40. Calculate t(-18). -4 Let u(y) = -y*3 - 16y*2 - 8y - 128. Determine u(-16). 0 Let q(m) = -m*2 + 14m + 18. Calculate q(9). 63 Let x(g) = -159g - 149. What is x(-1)? 10 Let x(q) = q3 - 9q*2 + 7q - 54. What is x(9)? 9 Let g(r) = -7r - 29. Calculate g(-12). 55 Let f(s) = -s2 - 15s - 9. Determine f(-12). 27 Let s(u) = -3u2 - 9u + 20. Calculate s(5). -100 Let l(i) = i + 9. Calculate l(-4). 5 Let s(b) = 27b - 1. Calculate s(1). 26 Let j(v) = 2v*2 - 20v - 7. Determine j(10). -7 Let g(b) = -b*2 - 13b + 3. What is g(-15)? -27 Let z(h) = -5h + 2. Calculate z(-1). 7 Let f(c) = -5c*2 - 2c + 2. What is f(1)? -5 Let j(n) = n*3 + 20n*2 + 7n + 5. What is j(-20)? -135 Let q(z) = -5z2 + 12z - 1. Give q(6). -109 Let o(v) = -6v - 107. Determine o(-16). -11 Let i(o) = -o3 - 9o*2 - 6o + 10. Calculate i(-8). -6 Let w(u) = u*2 - 30u + 30. What is w(29)? 1 Let x(c) = c*3 - 7c*2 - 9c - 3. What is x(8)? -11 Let a(h) = -h*2 + 44h - 6. What is a(44)? -6 Let w(n) = n*2 - 16n + 7. Determine w(13). -32 Let f(w) = -5w2 - 2w - 50. Calculate f(0). -50 Let n(l) = -14l + 110. Determine n(9). -16 Let p(d) = d2 - 2d + 5. Give p(6). 29 Let n(s) = s*2 + 4s + 3. Determine n(-1). 0 Let s(w) = -w*3 - 6w*2 - 3w - 7. Calculate s(-6). 11 Let z(k) = k*3 - 8k*2 - 50k + 37. What is z(12)? 13 Let h(i) = -i - 5. Give h(3). -8 Let h(f) = f*3 - 3f*2 - 2f + 5. What is h(2)? -3 Let f(q) = -2q3 + 6q*2 + q + 9. Calculate f(0). 9 Let y(u) = -14u - 9. Calculate y(-3). 33 Let i(v) = 4v - 81. Calculate i(23). 11 Let b(w) = w3 - w2 + 12w - 24. What is b(2)? 4 Let p(d) = 2d2 + 28d - 35. Give p(-15). -5 Let t(k) = -k3 + k - 3. Determine t(2). -9 Let s(y) = -y3 + 18y2 + 22y - 62. What is s(19)? -5 Let k(b) = b*2 - 15b + 16. Determine k(13). -10 Let x(b) = 6b3 - 23b*2 - 4b + 1. Determine x(4). 1 Let p(d) = 2d. Determine p(-5). -10 Let b(s) = 2s2 - 1. Give b(-5). 49 Let f(j) = -j3 + 11j2 - 8j - 8. Calculate f(10). 12 Let c(k) = 6k + 17. Determine c(-1). 11 Let k(t) = -t2 + 10t + 3. Determine k(9). 12 Let b(m) = -m*2 - 3m + 10. Give b(-5). 0 Let s(t) = -2t2 - 12t - 51. Determine s(0). -51 Let t(y) = y*2 + 1. Give t(1). 2 Let q(y) = 3y*2 + 18y - 3. Give q(-5). -18 Let l(n) = -5n + 61. Give l(9). 16 Let a(h) = -9h + 12. Determine a(3). -15 Let x(n) = -n*3 - 7n2 + n - 16. What is x(-8)? 40 Let j(s) = s2 - 3s - 9. Give j(7). 19 Let r(m) = 2m*2 - 25m + 40. Give r(11). 7 Let d(k) = -k*2 + 2k + 96. Give d(-9). -3 Let l(f) = -121f - 113. Calculate l(-1). 8 Let n(k) = 4k - 34. Give n(10). 6 Let j(q) = q*3 + 4q*2 + 3q + 5. Calculate j(-4). -7 Let b(i) = -4i + 26. Calculate b(7). -2 Let g(c) = -5c*2 + 6c - 1. Determine g(4). -57 Let z(f) = -f*2 + 11f - 22. What is z(7)? 6 Let g(b) = -11b2 + 3. What is g(2)? -41 Let m(v) = -v3 - 8v*2 - 8v + 4. What is m(-6)? -20 Let x(q) = -7q + 16. Give x(-6). 58 Let j(t) = t2 - 12t - 35. Give j(-3). 10 Let u(t) = -t*3 - 3t - 2. Calculate u(-2). 12 Let f(a) = -3a - 117. What is f(-38)? -3 Let l(h) = h3 + 4h2 - h + 8. Determine l(-5). -12 Let a(i) = i2 + 13i + 11. What is a(-9)? -25 Let r(k) = -35k*2 + 3k + 3. Give r(-1). -35 Let u(w) = -66w + 1779. What is u(27)? -3 Let d(j) = j + 5. Give d(-5). 0 Let h(k) = -k3 - 2k*2 + 2k + 3. Calculate h(3). -36 Let m(u) = u*3 - 11u*2 - 24u - 32. Determine m(13). -6 Let p(g) = -9g + 4. Calculate p(4). -32 Let h(d) = -25d*2 + 6d + 3. Determine h(-2). -109 Let s(d) = 2d3 - 16d*2 - 3d + 19. Give s(8). -5 Let d(c) = 5c2 - 8c - 2. What is d(1)? -5 Let b(n) = n*3 - 18n*2 + 11n + 23. Calculate b(17). -79 Let a(i) = -i*2 - 17i. Give a(-17). 0 Let r(i) = i*3 - 5i*2 - 4i + 5. Give r(5). -15 Let a(t) = t*3 + 8t*2 - 2t - 2. Calculate a(-8). 14 Let g(a) = -9a + 15. What is g(6)? -39 Let n(t) = t2 - 5. Determine n(3). 4 Let i(k) = k2 - 17k + 17. Give i(16). 1 Let o(z) = z*3 - 11z*2 + 10z + 8. Give o(10). 8 Let o(a) = -a*2 + 17a + 14. Calculate o(18). -4 Let l(x) = -x*3 - 4x*2 - 4x - 4. What is l(-4)? 12 Let r(j) = j*2 + 33j + 142. Calculate r(-5). 2 Let u(d) = -2d3 - 20d*2 + 14d + 11. Give u(-11). 99 Let b(x) = -11x3 + x2 + 7x + 6. Give b(-1). 11 Let s(b) = b + 22. Calculate s(-9). 13 Let q(w) = 5w + 8. What is q(6)? 38 Let d(q) = -19q3 + q2 + 16q + 16. What is d(-1)? 20 Let x(r) = 19r - 5. Calculate x(2). 33 Let k(n) = -10n - 2. What is k(-2)? 18 Let t(v) = -v3 - v2 + 18v + 12. Calculate t(-5). 22 Let c(m) = -m*3 - 17m*2 + 2m + 19. Determine c(-17). -15 Let b(i) = -i*2 - 26i + 94. Determine b(-29). 7 Let x(f) = -f*3 - 11f**2 - 15. Determine x(-11). -15 Let	{ "pile_set_name": "DM Mathematics" }
x + 9x - 34x + 11x. What is m(b)? 10 Let w(n) be the third derivative of -n*5/30 - 5n4/24 - n3 + 2n2 - 1351n + 2. Suppose -5t = 1 + 4, 0 = u - 2t + 1. Calculate w(u). -9 Let b(u) = u - 2. Let x be b(0). Let o = 138 - 134. Let a(l) = 1346 + 2l3 + 3l - 674 - 671 + ol2. Give a(x). -5 Suppose 4p = -4p + 128. Suppose -12q = -pq - 32. Let w be 4(28/q)/(-7) - 0. Let n(k) = k*3 - 2k. Determine n(w). 4 Suppose -23342g + 23362g = -200. Let b(l) = -99l - 987. Calculate b(g). 3 Let d(x) = -4 + 2 - 2x + x. Suppose -2r - 4m = 14, 21r - 24r - 2m = 1. Suppose 3a = y - 7, r - 2 = -2y + a. What is d(y)? 0 Let l(p) = -4p*3 - 15p*2 - 30p + 7. Let j be l(-4). Let i be (-26)/j - 8/(-44). Let t(d) = -d*3 + 2d*2 + 3d + 1. Calculate t(i). 1 Let g be (4 + -9 + -2 + 4)(-14)/6. Let o(k) = k2 - 2k - 2. Calculate o(g). 33 Let b(m) = m*3 + 26m*2 + 22m - 23. Suppose -25a = -9373 + 9998. Calculate b(a). 52 Let o(q) be the third derivative of 3q*2 - 19/60q*5 + 0 + 1/6q*3 + 0q + 1/12q4. Let n = -65293 - -65292. Calculate o(n). -20 Let t(f) = 38 - 88 - 50 - 78 + 9 - 24f. Calculate t(-7). -1 Let x = -122 - -126. Let k(f) = f - 7 - x - 4 + 17. Let w be 8/(-5) + (-4)/10. What is k(w)? 0 Let r(t) = -36t + 14. Let b(j) = -j2 - 26j - 1. Let m(n) = b(n) - r(n). Determine m(6). 9 Let i(j) = -2j2 + 61 - 22j + 52 - 20 - 119. Calculate i(-12). -50 Let u(f) be the second derivative of -f*5/20 - 5f*4/12 + 7f*2/2 + 301f. Calculate u(-5). 7 Let z(c) = 905673c - 905712c + 17 - 12 - c*3 + 52 + 20c*2. Give z(18). 3 Suppose -967v = -557v - 2870. Suppose 2b - 5b + 9 = 0. Let d(i) = 1 + i3 + 1 + bi*2 - 10i*2. Calculate d(v). 2 Let n(u) = 207u + 807. Let i be n(-4). Let k(r) = -r*3 - 21r*2 + 8. Calculate k(i). 8 Suppose h + 29 = -3t - 2t, 4h = -3t - 31. Let q(c) = 5c*2 - 3c - 7. Let o(u) = 6u2 - 3u - 8. Let i(a) = ho(a) + 5q(a). What is i(5)? 7 Let w(q) = -67q + 160. Let v(r) = -152r + 316. Let m(b) = 4v(b) - 9w(b). What is m(-34)? -6 Suppose 202j = 222j - 20. Let f(k) = -91k + 86. Calculate f(j). -5 Let z be -3 + (-485)/(-20) - 1/4. Let d be (2/2)/(z/63). Suppose -x - 3t + 23 = x, -3x = -dt + 3. Let l(j) = j*2 - 5j - 5. Determine l(x). -9 Let u(y) = 10y + 11. Let x(b) = 23b + 23. Let r(h) = -24h - 23. Let a(i) = -5r(i) - 6x(i). Let m(q) = -6a(q) - 11u(q). Determine m(5). 7 Let v(t) = -t3 - 7t*2 + 5t + 12. Let r(d) = d*3 + 8d*2 - 4d - 11. Let g(i) = 2r(i) + 3v(i). What is g(-6)? 8 Let k(n) = 9n2 - 9n + 27. Let x(c) = 5c2 - 4c + 13. Let p(b) = 4k(b) - 7x(b). Let j be (21/(-30))/(26/52)-5. Calculate p(j). 10 Let q(u) = -18u + 49. Let v(i) = -103i + 244. Let x(f) = 11q(f) - 2v(f). Give x(-5). 11 Let m(f) = -2f + 3 - 25 + 9 + 10 + 0f - 4f*2. Suppose -5u = -3x - 38, u - 2x - 2 = -0. Suppose 4v + u - 2 = 0. Give m(v). -15 Let l(w) = 3w*3 + 8w*2 + 47w + 8. Let c(m) = -2m3 - 8m*2 - 36m - 8. Let t(d) = 4c(d) + 3l(d). Determine t(0). -8 Let u(k) = -33419 + 32766 - 60k - 6k + 6k. Give u(-11). 7 Let n(v) = -v2 + 7v + 171. Let j(g) = -g*2 + 236g + 734. Let y be j(-3). Give n(y). 1 Suppose -3120 = -46v + 299v - 13v. Let t(n) = 2n*2 + 30n + 34. Calculate t(v). -18 Let i(p) be the second derivative of -11p3/6 - 26p*2 - 3201p. What is i(-9)? 47 Let u(g) be the second derivative of g7/2520 - g6/180 + g*5/60 - 43g4/12 + g2/2 - 3g - 6. Let c(o) be the third derivative of u(o). Determine c(5). 7 Let o be (-24)/186/(-4). Let x(y) = -4y2 + 2y*o - 4y - 3y2 + 6y2. Calculate x(3). -3 Let n(r) = r2 + 12r + 11. Let i be 4 + 476/(-126) + 2/(-9). Let h(j) = j3 - 2j*2 + j - 8. Let b be h(i). Give n(b). -21 Suppose -22q + 175 = -111. Suppose 12 = -9t + qt. Let p(m) be the second derivative of m3/3 - m2/2 - m. Give p(t). 5 Let c(b) = -3907b2 + 4938b2 - b3 - 1027b2 + 2b - 6. Let h = -4 + 8. Calculate c(h). 2 Suppose 9 = -r - 3l, 2r = l + 3l + 22. Let q(k) = 0k - rk + 85k*2 + 8 + 4k - 84k2. Suppose -y = 4t + y + 10, -t - 4y = 20. Give q(t). 8 Let y(s) be the first derivative of 1185 + 2s4 - s - s4 - 1152. Let c be (-3)/(-7) + (-28)/(-49). Give y(c). 3 Suppose 0 = -24m - 36 + 324. Let k(x) = -x3 + 11x*2 + 15x + 27. Determine k(m). 63 Let m(x) = -4x - 26. Let w be (-144)/2715/10. Calculate m(w). 6 Let d = -720 + 725. Suppose dl - 3v = 14, -4l - 81 = -v - 95. Let m(b) = 3b - 4. What is m(l)? 8 Let j(v) = -6v + 98. Let m = -20473 + 20488. Determine j(m). 8 Let z(g) = -5 + 1 + 0 - 5g. Let v = -1463 - -1671. Suppose -4c - 3b = 13, vb - 207b = 1. Determine z(c). 16 Suppose -10 = -4d - 8d + 2d. Let q(w) = 12w*3 - 2w2 - w + 2. Calculate q(d). 11 Let c(x) = x2 + 9x + 7. Let u(j) = 3j*2 + 3j - 8. Let d = 25 - 30. Let h be u(d). Let s = 46 - h. Give c(s). -11 Let k(a) = 7a + 2. Let t(u) = 20u + 4. Suppose 4y + 23 = 11, -b = 3y + 3. Let l(p) = bt(p) - 17k(p). What is l(0)? -10 Let t(x) = -6x2 - 2x + 10. Let d(o) = -o*2. Let j(p) = 5d(p) - t(p). Let w = -72740 + 72740. What is j(w)? -10 Let q(s) be the second derivative of 3/2s3 + 1/20s*5 + 0 + 3s*2 - 36s - 11/12s4. Calculate q(10). -4 Let u(f) = -2f*2 + 55f - 148. Let d be u(25). Let j(m) = -3m - 51. Determine j(d). 18 Let t(r) = -1115r - r*3 - 1106r - 1119r - 19 + 3326r - 13r2. Calculate t(-12). 5 Let n(d) = -d3 - 10d*2 - d - 7. Suppose -4 - 16 = 2s. Let j be n(s). Let c(p) = -3p3 - 1 - 7p*j + 7p*3 + 0. Determine c(1). -4 Let d(t) be the third derivative of 0t - 1/24t4 - 13t*2 + 0 - 1/3t3. What is d(5)? -7 Let d = 2665 + -2665. Let s(f) = -f2 + 2f + 8. Give s(d). 8 Let m(o) = 4o2 - o + 7. Let w be m(9). Let u = 314 - w. Let x(c) = -c2 - 9c - 6. Determine x(u). 2 Suppose -z + 4 = 3z. Let t(a) = -3a2 + 44a - 21. Let u be t(14). Let b(v) = -u + 6 + 0 + 4v3 + 2v2. Determine b(z). 5 Let g(f) = -f2 - 8f + 262. Let q(w) = -9w + 321. Let o(h) = -5g(h) + 4q(h). Give o(-6). 130 Let s(a) = 3a + 6. Suppose 1338 = 5j - 192. Let o = j + -310. What is s(o)? -6 Let h(a) be the second derivative of a*5/20 + 7a*4/12 + 4a*2 + 1372a. What is h(-7)? 8 Let r(n) = 9n3 - 22n*2 + 30n - 9. Let c(k) = 5k3 - 10k*2 + 18k - 4. Let i(a) = -5c(a) + 3r(a). Determine i(8). -7 Let i(y) = y + 4. Suppose 4c - 239 = -5g, 104 = 2g - 3c + 13. Let f = -49 + g. Let u be (6 - 6)/(f/(-1)). Give i(u). 4 Suppose -3604 = d - 3605. Let t(i) = -4i2 + 27i - 29. Calculate t(d). -6 Let u(b) = b + 6. Let r(m) = 3m2 - 9m + 9. Let f be r(1). Let c be ((-4)/36f)/(2/42). Determine u(c). -1 Let m(c) = -2c + 1. Let d(l) = -6l - 45. Let j(n) = -d(n) + 2m(n). Calculate j(-20). 7 Suppose -5s - 2d = -6, s + 5d - 1 = -9. Let k(o) = 4o - 2 + 9 - s. Determine k(6). 29 Let g(y) = y*3 + 11y*2 + 19y - 21. Suppose 6x + 12d - 8d + 78 = 0, 2d + 3 = x. Determine g(x). -30 Suppose -y + 6 = 4m, 24y = 2m + 21y + 4. Let h(s) = -7s2 - 6s - 7. Let b(x) = -2 - 36x2 + 37x*2 + x + 3. Let a(v) = 6b(v) + h(v). What is a(m)? -2 Let p(k) = 0k - 38 - 8k*2 - k + 2k*3 + 7k + 8k - 4k. Let o be p(4). Let v(n) be the second derivative of n*3/2 - 3n*2/2 + n. Calculate v(o). 3 Suppose 2x - 17 = 5c, x = 5c - 7c - 5. Let a(s) = 6s*2 + 4s*2 + 2s*2 - 3s*2 - 4s*2 + 4s + x. Determine a(-3). 34 Let d be (-210)/90 + 7/3. Suppose -91w + 74w = d. Let h(g) = g3 - g2 - 22. Give h(w). -22 Let o(w) = 2w2 - 6w + 3. Let g(b) = 14b2 - 2b + 12. Let m(u) = u*2 - u. Let n(t) = g(t) - 12m(t). Let v be n(-4). Determine o(v). 11 Let w(c) be the second derivative of c6/30 - c5/120 + c*3/2 + 5c*2/2 - 2c - 3. Let t(i) be the second derivative of w(i). Determine t(1). 11 Let g = 7280 + -7276. Let h(z) = -9z - 2. Calculate h(g). -38 Let p = 8 + -14. Let w = -17 + 52. Let v(a) = -34a*2 - 17a + 20a + wa2 - 4. Determine v(p). 14 Let t(w) = w3 + 20w2 + 98w - 14. Let n be t(-10). Let v(b) = -b*2 + 7b - 8. What is v(n)? -2 Let n(m) be the first derivative of -m3/3 - m2 - m - 2. Let f(w) = w*3 + 6w*2 - 3w - 3. Let q be f(-6). Suppose -9b + 4b - q = 0. Calculate n(b). -4 Let o(v) = v*3 + 5v**2 + v. Let	{ "pile_set_name": "DM Mathematics" }
sqrt(11) + 0 - sqrt(11))1 + (sqrt(11) - 2sqrt(11)-5) + -3. 2 + 11sqrt(11) Simplify (((sqrt(750) - (2sqrt(750)3 + sqrt(750)))6)/(sqrt(24)/sqrt(144) + (sqrt(24)-2)/sqrt(4)))*2. 5832000/121 Simplify (3((sqrt(49) - sqrt(294)/(sqrt(54) + sqrt(6))) + (-3sqrt(147)/sqrt(3) - sqrt(49))))/((sqrt(7)1-2 - sqrt(7)) + 1sqrt(28)). 39sqrt(7)/4 Simplify ((sqrt(48)/sqrt(150))/(sqrt(36) - sqrt(36)-2) - ((sqrt(288) + -5sqrt(288))2 - (sqrt(16)/sqrt(2))2))3. -13800 + sqrt(2)/15 Simplify ((4 + sqrt(136)/(sqrt(8)-1-3) - -4(sqrt(425) - ((sqrt(425) - (1 + sqrt(425)))-6 - sqrt(425))))-6)2. -58080sqrt(17) + 1009988 Simplify -5 + 1((sqrt(1900)-2 + 1 - sqrt(1900))*2 + ((sqrt(1900) - (sqrt(1900)1 - sqrt(1900))) + -2)*2). -100sqrt(19) + 19000 Simplify (1(sqrt(65) - sqrt(65)-4) + (sqrt(65) - ((sqrt(65)-3 + sqrt(65))-5 + sqrt(65))))/((sqrt(75)/sqrt(5))/sqrt(3) - sqrt(180)-3). -5sqrt(13)/19 Simplify (-2 + (-3(sqrt(170) - (sqrt(170) - sqrt(170)-1)) - sqrt(170) - sqrt(170))/sqrt(10) - -5(sqrt(17) + (1sqrt(153))/sqrt(9))5)2. -204sqrt(17) + 44221 Simplify (((sqrt(30)-2 + sqrt(30))/sqrt(10) + sqrt(3)-12)-1 - (sqrt(15)/sqrt(5) + -5 + sqrt(3) + -4 + sqrt(12)/sqrt(4))2)2. -108sqrt(3) + 351 Simplify 0 + ((-5sqrt(256))/(sqrt(32)/(sqrt(20)/sqrt(5))) - (sqrt(24)/(1sqrt(12)) - (sqrt(18) + 1)*2)6-5). -570 - 170sqrt(2) Simplify -4(sqrt(11) + -2 + sqrt(11)) + 3 + 1 + (-24(sqrt(11) + 0 + -2))2. -264sqrt(11) + 972 Simplify (((-1sqrt(352)2 - sqrt(352)) + 1sqrt(352)2)/(sqrt(288)-1 - 1sqrt(288)) + 3)*2. sqrt(11) + 335/36 Simplify ((1 + 1 + (sqrt(405) - (sqrt(405) + 0)3))*2 - ((5((2sqrt(405))2 + sqrt(405) + sqrt(405)) - sqrt(405)) + -4 + 1))2. -12946 - 306sqrt(5) Simplify (-2sqrt(30)/(sqrt(20)/sqrt(2)-6) - (-1sqrt(243) + sqrt(27) + 1))-3. -19sqrt(3) + 3 Simplify 1 + 6(sqrt(68)/(sqrt(12)/(sqrt(3) - 2sqrt(3))) + (2sqrt(85)-1 - sqrt(85))/sqrt(5) + 2). -24sqrt(17) + 13 Simplify -3 + (3 + -2sqrt(19) + 0)*2 + -1 + (-1sqrt(2736))*2 + -1 + -3 + -1. -12sqrt(19) + 2812 Simplify -1(sqrt(3072)4)*2 - ((-1(sqrt(3) + -1))2 + (sqrt(3) - (-2 + sqrt(243))2)). -48909 - 35sqrt(3) Simplify 2(-3 + (sqrt(17) + -1)*2 + 4 + -4) + (5 + (2(sqrt(68) + (sqrt(68) - -1sqrt(68))) + sqrt(68))/sqrt(4) + -4)2. 10sqrt(17) + 864 Simplify ((4 + sqrt(448) + (sqrt(448) - (0 + sqrt(448) + 2 + sqrt(448))) + sqrt(448) + sqrt(448) + (sqrt(448) - -6(-1 + sqrt(448))))6-4 + -2)2. -324864sqrt(7) + 20910724 Simplify -1(sqrt(102)/(sqrt(242) + (1sqrt(242) - sqrt(242))))/(-3sqrt(15)/sqrt(5)1). sqrt(17)/33 Simplify ((sqrt(720) - 3sqrt(720)-6) + sqrt(720) + 1 + -2)*2 - (4(sqrt(720) + -1 + 1)-6)2. -126719 - 480sqrt(5) Simplify (5((-1 + sqrt(396) - (0 + sqrt(1584) - sqrt(11))) + 0 + (sqrt(132)2 - sqrt(132))/sqrt(3) + sqrt(44))4)2. 800sqrt(11) + 4800 Simplify (2(sqrt(132)-1 + sqrt(132) + sqrt(132))4)/((6(sqrt(192)-2 - sqrt(192)) - sqrt(192)) + (sqrt(192) - (sqrt(192) - sqrt(192)-26))). -2sqrt(11)/31 Simplify ((sqrt(34) + sqrt(102)/sqrt(3)1)/(-2sqrt(2)5) + 0 - (sqrt(204)1-6 + sqrt(204))/((sqrt(12) - sqrt(12)-2)5))2. 68/225 Simplify (6(3 + sqrt(363) + 1 + sqrt(363) + sqrt(363) + 3 + (sqrt(363) + 1)4 + sqrt(363) + 0)2-25)*2. 27878400sqrt(3) + 336283200 Simplify (-6(-2 + 5 + (1 + -6sqrt(176))2))2. -17280sqrt(11) + 913284 Simplify (5 + (sqrt(832) + -1 - sqrt(832))*23 + 2(sqrt(832) + -1) + -3 + 1)-2. -32sqrt(13) - 8 Simplify (4(sqrt(170)1 + sqrt(170)) - 1(sqrt(170) + (sqrt(170)2 - sqrt(170))))/(-1(sqrt(240)/sqrt(8)-3)/sqrt(3)). 2sqrt(17) Simplify (sqrt(264)/(sqrt(12)3) + (-3sqrt(352) - sqrt(22)))/(-2(sqrt(88) + 2sqrt(88)1)/sqrt(8)) + 2. 2 + 19sqrt(2)/9 Simplify ((sqrt(102) + sqrt(102) + (sqrt(102) - -4sqrt(102) - sqrt(102)))-3 - (sqrt(102)4-1 + sqrt(102)))/((sqrt(1350)3 - sqrt(54))/(3sqrt(9)-1)). 45sqrt(17)/14 Simplify (3((sqrt(162) + -2 + 4)2 - (3sqrt(162) + sqrt(162))-5-4))2-4-4. -808704sqrt(2) + 141929856 Simplify (sqrt(320) - (sqrt(320) - (2sqrt(320) + 0)2) - (2(-3 + sqrt(320)) - sqrt(320))*2) + (-6(-1sqrt(320) + -3 + sqrt(320) + 1 + 3 + sqrt(320)))2. 672sqrt(5) + 12480 Simplify (((1sqrt(4374))/sqrt(2))/(sqrt(18)/sqrt(32) + (sqrt(9) - sqrt(18)/(sqrt(2) - sqrt(32)))))2. 34992/361 Simplify -4 + (4-2sqrt(384))/(1sqrt(8)5) + 1. -32sqrt(3)/5 - 3 Simplify -6(sqrt(57)3)/sqrt(3)-5 - (1(1sqrt(38) + sqrt(38)))/(1sqrt(128)). 359sqrt(19)/4 Simplify -3-3sqrt(98)3 + 4 + 1 + (sqrt(30)/sqrt(48))/((sqrt(10) - (sqrt(10) + sqrt(10)-1))/sqrt(2)). 5 + 757sqrt(2)/4 Simplify 2-2((sqrt(425) - (sqrt(425) + -1sqrt(425))) + sqrt(425))-2 + -3(2 + (-5 + sqrt(1700) + -2sqrt(1700))*2). -5181 - 220sqrt(17) Simplify (-1sqrt(5616)-6 + sqrt(5616) + 1sqrt(5616)-1)/(-3(sqrt(972)3)/sqrt(4)). -8sqrt(13)/9 Simplify (0 + 1(sqrt(1900) - (sqrt(1900) - (sqrt(1900) + 0 - sqrt(1900))) - sqrt(1900))*2 + (4 + sqrt(1900)-3 + 5)*2)-2. -38162 + 1080sqrt(19) Simplify 3 + (sqrt(9)-2-2 - (sqrt(9) + 4sqrt(144)))/(-1sqrt(75) + (sqrt(3) - 1sqrt(147))). 13sqrt(3)/11 + 3 Simplify (3((sqrt(3) - (sqrt(27) + -1 - sqrt(3)))3 - ((0 + sqrt(3))-4 + 2))6)2 + 2. 648sqrt(3) + 1298 Simplify (4 + (sqrt(2) - sqrt(242)1 - sqrt(6)/(sqrt(6)/sqrt(2) + sqrt(3))) - ((sqrt(98) - (-1 + sqrt(98) + sqrt(98)))-5 + 5))*2. -364sqrt(2) + 8313/2 Simplify (-5(-2sqrt(2904) + (sqrt(24) - (sqrt(192) + sqrt(192)1 + sqrt(192))/sqrt(8))))/(sqrt(48)/sqrt(96) - (sqrt(64)/(sqrt(40)/sqrt(5)) - sqrt(8))). 480sqrt(3) Simplify 3(((sqrt(242) - (sqrt(242) + (2 + sqrt(242) - sqrt(242))2))3)2 + (1 + 1(sqrt(242) + 6sqrt(242)))2). 462sqrt(2) + 36009 Simplify (sqrt(110)/sqrt(1000) - 5sqrt(66)/sqrt(6))2 + ((sqrt(891) + -1)-6 + -3sqrt(891)-1)*2 + -2. -324sqrt(11) + 831711/100 Simplify ((5(-5(3 + sqrt(147)) + sqrt(147)4-6) + 0)1)2. 152250sqrt(3) + 3096300 Simplify (-5sqrt(147)2 - (2 + 2sqrt(147)))2 - (sqrt(54)/(sqrt(54)/sqrt(6)))/(sqrt(8)/(-3sqrt(4))). 339sqrt(3) + 21172 Simplify (-5sqrt(1800)1 + 2sqrt(1800)2 + sqrt(1800))/((sqrt(81) - -4sqrt(81)) + (sqrt(72) + (sqrt(72) - 2sqrt(72)))/sqrt(8)). 0 Simplify 3 + (-4 + 3sqrt(176)-2 - (-1sqrt(176) + -5)3)2. -264sqrt(11) + 1708 Simplify ((-2sqrt(5700) - sqrt(57) - sqrt(57)) + sqrt(4617)2)/(-4(sqrt(300) - 2sqrt(300) - ((sqrt(72)/sqrt(2) - sqrt(36))/sqrt(12) - sqrt(3)))). -sqrt(19)/9 Simplify ((sqrt(240) - (sqrt(240) + -4(-1sqrt(240) - sqrt(240) - sqrt(240))) - sqrt(240))/(sqrt(64)/(-1sqrt(8))))/((sqrt(1440) + sqrt(1440)2-6)-2). 13sqrt(3)/264 Simplify (5(((sqrt(320) - 3sqrt(320))4 - (-2sqrt(320) + sqrt(320))-2) + 1))*2-4. -3200100 + 16000sqrt(5) Simplify ((sqrt(70) + sqrt(70)1)-4)/((sqrt(70)-2)/sqrt(7)) - (sqrt(112)-2 + sqrt(1008) + 1sqrt(1008) + sqrt(1008) + sqrt(1008))-4. 164sqrt(7) Simplify (3 + (sqrt(1216) + 2sqrt(1216) + sqrt(1216) + -1)-3 + 2 + -1 + (sqrt(1216) + -2sqrt(1216))-3)*2. -1008sqrt(19) + 98545 Simplify (2 + -1 + (sqrt(243) + (-2 + sqrt(243))-1 - sqrt(243)) + -6((sqrt(243) + 0 + -5 - sqrt(243)) + sqrt(243)) + 1)*2. -4284sqrt(3) + 13063 Simplify ((sqrt(5500)3)/(sqrt(176) + -2sqrt(176) + sqrt(176) + sqrt(176)) + (2sqrt(160)3)/(-1sqrt(8)4 - sqrt(8)))*2. 2601/20 Simplify ((2 + sqrt(800) + -2 + sqrt(800) - sqrt(800) - (sqrt(800) - (sqrt(800) + -2 - sqrt(800))-1)) + 5(1 + sqrt(392)-1) + 1)*2. -1120sqrt(2) + 9864 Simplify -6((-2sqrt(320)5 + -2)2 + 5(sqrt(320) + 0 + 1 - sqrt(320))*2). -192054 - 1920sqrt(5) Simplify ((1sqrt(91))/sqrt(7) - ((sqrt(468))2 + 3) - (-4 + -2 + (sqrt(143)-2)/sqrt(11))) + -1. -466 + 3sqrt(13) Simplify 0 + (sqrt(76) - (sqrt(76) - -5(sqrt(76) + -1))) + (sqrt(76)-1-5)*2 + ((sqrt(76) - (6sqrt(76) + 4))2 - (-3 + (-5 + sqrt(76))2)). 90sqrt(19) + 3723 Simplify (-1 + -2(sqrt(1053) + sqrt(1053) + -1 + sqrt(1053) + 3 + sqrt(1053)) + 2)*2 + 1 + 3. 432sqrt(13) + 67405 Simplify (sqrt(187)2)/sqrt(11) + sqrt(1377)3 + (3sqrt(17)-1 - (sqrt(136)/sqrt(288))*2) + 0. -17/36 + 26sqrt(17) Simplify sqrt(49)/(sqrt(7) + sqrt(49)/sqrt(7)) + -1sqrt(175) + 4-3sqrt(7) + (sqrt(112) + sqrt(112) + 1)2. -sqrt(7)/2 + 449 Simplify -4(-5 + (1 + (5 + sqrt(1377)3)-1 + 2)*2 + 1). -49572 - 432sqrt(17) Simplify (sqrt(9)/sq	{ "pile_set_name": "DM Mathematics" }
108s + 387)(-3 + 1 + 1). -216s Expand (-3g - 2g - 2g)(g2 - g2 + 4g*2)(-3g2 + 1 - 1 + (-3 + 0 + 0)(3g + g2 - 3g)). 168g5 Expand (993 - 993 - 40x)(10x + 12 + 13 - 24). -400x2 - 40x Expand (-2 - 1 + 1)(q3 - q3 + 2q*3) + 5q*3 + 0q*3 - 2q*3 - 14q*3 + 78q*3 - 10q*3. 53q*3 Expand (0 + 7a*2 + 0)(-9a - 10a + 15a). -28a*3 Expand -33r + 40 + 61r - 32r + (3r + 0r - 4r)(0 - 2 + 0). -2r + 40 Expand (23c - 23c - 6c*2)(8c - 4c + 5c)(-6c2 + 2c2 + c2). 162c5 Expand (1 + 4 - 3)((1 - 1 + 2p)(3p2 - 2p*2 + 0p*2) + (7 + 3p - 7)(-3p*2 + 3p*2 - 12p*2)). -68p*3 Expand (-2k - k + 4k)(221k2 - 118k*2 - 103 + k - 100k*2). 3k3 + k2 - 103k Expand 1 + o - 1 - 20 + 20 - o + o + 5o - 4o + (4 - 1 - 2)(o + 2o - o) - 2 + 2 + o - 16 + 16 + 15o + 2o - o - 2o. 19o Expand -8x*3 + 2x3 - x3 + (2x3 + 2x*3 + 0x*3)(-2 + 2 - 2). -15x3 Expand (-30 - 9m*2 + 30)(-4 + 3 - 3 - 2m). 18m*3 + 36m*2 Expand (8v - 15v2 - 8v)(2v + v - 5v + (v - 2 + 2)(1 - 2 + 2))(5 - 5 - 4v)((0 - 3 + 1)(2v - 5v + 2v) + 0v + 6v + 0v). -480v5 Expand 0i2 - i3 + 0i2 - 4i - i*3 + 4i + (2i - 4i + 0i)(2i2 - 3i*2 + 0i*2) - 9i*3 + 20i*3 - 46i*3. -35i*3 Expand (-1 + 1 - 3v)(5v - 4v - 3v) - 11v2 + 5026v - 5026v + (0 + 0 - 1)(-5v - v2 + 5v) - 3v + 3v + v*2. -3v*2 Expand (-412 + 412 + 3b)(-1 - 3 + 1)(2 + 0 - 4). 18b Expand (2y + y - 4y)(4 - 4 - y) + (2y + 1 - 1)(0 + 0 - 2)(147y + 18y - 14y) + 0 + y*2 + 0. -602y*2 Expand (-2z - 2z + 7z)(13 - 11 - 97) + 4z - z - 2z. -284z Expand (4c + 1 - 1)(-8c + 0c + 1 - 8c + (c - 3c + 0c)(-3 + 5 + 0) + 2c - 4c + 0c). -88c*2 + 4c Expand (75z + 202z + 31z)(-7z + 3z + 2z + 2). -616z*2 + 616z Expand (-8x - 12x + 19x)(1 - 4 + 7)(-1 + 3 + 0). -8x Expand (-2d3 + 6d3 - d3 - 2d4)(24 - 8 - 12) - 4d4 + 2d*4 + 0d*4 + (3 - 5 + 4)(2d4 - d4 + d4). -6d*4 + 12d*3 Expand -3o*5 + 2o*5 + 2o*5 + (4o*4 - 5o*4 + 3o*4)(-2 - 2o + 2) - 3 + o5 + 3 + 0o*5 - 3o*5 + 2o*5 + 274o*5 + 130o*5 - 124o*5. 277o*5 Expand (-4r + 3r - 2r)(-50r + 87r - 263 - 35r). -6r2 + 789r Expand (-6 + 2 + 6)(-31c + 9c + 0c)(2 - 9 + 14). -308c Expand -s - 1 + 1 + (-2 - 5 + 6)(0s - s - 4s + (s - 3s + s)(1 - 2 - 1))(-5 + 3 + 0). -7s Expand -q - q + 3q + (0 - 1 - 1)(0q - 3q + 2q) + 4 - q - 4 + 4 - 13q - 4 + (-2 + 5 - 5)(-3 - 1 + 1)(-1 + 1 + 2q). q Expand (0u2 + 0u2 - u2)(111 - 111 + 168u + 191u). -359u*3 Expand (-2r3 + r3 - r*3)(-r*2 + 3r*2 - 17r*2) + (-4r*4 + 3r*4 + 4r*4)(r + 3 - 3). 33r5 Expand (-u3 - 2u3 + u3)(0 - 2 + 0 - 4 + 6 - 3 + (-4 + 3 - 8)(1 + 1 + 1)). 60u3 Expand 3 - 3 - 7i + (-2 + 1 - 1)(-22i + 114 - 114). 37i Expand ((m - 2m - m)(1 - 4 + 5) + 1 - 1 + 2m)(610 - 80m*4 - 610). 160m5 Expand f5 + f3 - f3 + 5f5 + 3f*5 - 3f*5 + (-4f*4 + 5f4 + f4)(100f + 587 - 587). 206f5 Expand (61q - 113q - 119q)(q + 0q - 3q)(0q + q - 3q). -684q3 Expand (-1 - 1 - 9)(-4g + 4g - g)(g + g + 4g)(0 + g + 0). 66g*3 Expand (3p*4 + 0p*3 + 0p*3)(-2p + 6p - 3p)(-2 + 0 + 5)(-2 + 2 - 2)(2 + 1 - 2). -18p5 Expand -u2 + 13u*4 - 5u*4 + 0u2 + u4 + u3 - u3 + (-2 - 2u2 + 2)(2u2 - 4u*2 - 2u2) - 1 + u4 + 1 - 2u4 + 4u*2 - 4u*2. 16u4 - u2 Expand (-3q + 3q + 4q2)(-q - q + q)(3 + 1 - 1)(2 + 1 - 4)(q - 2 + 2). 12q*4 Expand (-2f + 3 - 3)(5f - f - f + 0f - 3f + f + (-2 + 4 - 1)(2f + 0 + 0) - 2f - 8f + 3f + f + 2f - f). 4f2 Expand -22b + 54b + 43b + (-3 + 2b + 3)(3 - 2 + 0). 77b Expand (-2r + 2r - 3r)(2 - 3 + 2)(4 - 1 + 3). -18r Expand (-53u + 44u + 90u)(4u - 2u - 3u)(-2 + 2 + 2u + 3). -162u3 - 243u*2 Expand 84 - 84 + 27r*2 + (-2r*2 - r + r)(-2 - 1 + 1) - 3r2 + 7r*2 - 3r*2 + (2r + r - r)(-2r - 4r + 5r). 30r2 Expand (2i*2 + 2i2 - i2)(0i + 2i - i) + 2i3 + i3 - 2i3 - 2i*2 - 2i*3 + 2i*2 + (2i + 2i - 2i)(10i*2 - 85 + 85). 22i*3 Expand 2z*3 - 2z3 - z3 + (4z - z - 2z)(3z - 2z2 - 3z) + 15z2 - 11 - 16z2 - z3 + 26. -4z3 - z2 + 15 Expand (12g - 3g3 - 9g + 7g3)(-3g - g - g)(5g + 11g + g). -340g5 - 255g3 Expand (p4 - p4 - p5)((1 + 1 + 0)(-2 + 3 + 0) - 28 + 19 - 36). 43p5 Expand (26 - 26 + w)(-2 + 2 - 2w2 + 2w - w*2 - 2w + (-3 - 2 + 4)(0w*2 + 3w2 - w2) + 5 - 5 + w2 - w2 + 0w2 - w2 + 0 + w2 + 0). -5w*3 Expand (2 + 3 - 3)(-2n2 + n2 + 5n*2) - 83 + 7n*2 + 83. 15n*2 Expand (-59 - 133 - 162 - 134)(-i2 - i2 + i*2). 488i*2 Expand 4632 - 4632 + 318d*2 + (-2 + 1 - 1)(0d2 + d2 - 3d*2) + 2d*2 - d + d. 324d*2 Expand (135l - 33l + 147l)(2l3 - l2 + l*2). 498l*4 Expand (-3i + 3i + i)(-i - 2i + 5i) + (-3 - 1 - 3)(-8i*2 + 193i*2 - 34i*2). -1055i*2 Expand 3i + i*5 - 2i + 0i + (2i*4 - 7i*4 + 26i*4)(-2i + 6i - 2i) + 4i*5 + 11i*5 - 9i*5. 49i*5 + i Expand (-q - 3q + 2q)(-2q3 - 1 + 1) + (-3 + 2 + 3)(36q4 + 132q*2 - 132q*2). 76q*4 Expand 0 + 2m + 0 + (-m - m + m)(3 - 6 + 0) + 0m + 1 - m - 5. 4m - 4 Expand (2d4 + d4 - d*4)(1 - 85d + 81d + 296d). 584d*5 + 2d*4 Expand -2o*4 + 0o4 + o4 + (-2o3 - o3 + 5o*3)(76734 + 334o - 76734) + 2 - 2 - 2o*4. 665o*4 Expand (0 - 3w + 0)(2 + 3 - 10). 15w Expand (0z3 - z3 + 2z*3)(4z + z - z) + 3z*4 - 2z*4 + 5z*4. 10z4 Expand (-t3 - 2t + 2t)(-3 + 2 + 2) - 46t*3 + 129t*3 + 5t*2 - 3t*2. 82t*3 + 2t*2 Expand 12t*2 - 5t*2 + 3t*2 + (-2 - 4t + 2)(-4t - t + 6t). 6t*2 Expand (-1843g + 1843g + 91g*2)(-2g - g + 2g)(-3 + 1 + 3). -91g*3 Expand (-3r*2 - 2r*2 + 3r*2)(2 + 0 + 4)(-4r + 6r + 6r). -96r3 Expand (1 - 2n - 1)(0 - 3n + 0) + (0 + 0 + 2)(2 - 2 - n2) + n2 + 6n*2 - 2n*2. 9n*2 Expand (1 - 1 - 2w*4)(-2 - 3 - 5 + (-2 - 2 + 5)(-3 + 4 - 2) + 2 + 2 - 2). 18w*4 Expand -1 + 2b*4 + 1 + (2b + 1 - 1)(845 - 845 + 301b*3). 604b*4 Expand (3 - 3 - 2i)(3 - 1 - 3 + (-1 + 4 - 1)(0 + 1 - 2) + (363 + 607 - 431)(1 - 3 + 0)). 2162i Expand -64r - r3 + 64r + 41r4 + (1 - 2r*2 - 1)(-4r2 + 4r*2 + 2r*2). 37r4 - r3 Expand (-4s + 11 - 11)(3 + 1 - 5)(-36 + 37 - 7s*2 + s + 18s*2). 44s*3 + 4s*2 + 4s Expand 2n - n + n + 2n + 0 + 0 + (-2n - 4n + 4n)(1 + 1 - 4) + 5n + 6n - 15n + 0n - n + 3n - 2n + n + 4n. 9n Expand (3l2 - 6l*2 + 2l*2)(10 - 25 - 14)(-l + 0l + 0l). -29l*3 Expand (0 + 0 - 2t*2 + (2 - 3 + 3)(3t2 - 6t2 + t2))(9t*3 - 6t*3 - 4t*3) + 0t5 + t5 - 2t5. 5t*5 Expand (5b*2 + 2b*4 - 5b*2)(-4 + 4 + b) + 3b5 - 5b*5 + 4b*5 + (0b4 + b4 - 3b4)(5 - 13b - 6 + 0). 30b*5 + 2b*4 Expand (1071j*2 - 2 - 2159j*2 + 1080j*2)(j - j + 2j3). -16j*5 - 4j*3 Expand (-1 + 2 - 3)(2q2 + 2q*2 - 6q*2) + (4 + 4 - 2)(-3q2 - q2 - 2q*2). -32q*2 Expand (0 - 2 + 3)(-v - v + 4v) + (37 + 38 - 72)(2v - 2v - v). -v Expand -114 + 114 - 8s5 + (s2 + 0s*2 - 2s*2)(2s3 + 0s3 + s3) - 4s5 + 7s*5 + 2s5 + s2 - 2s3 - s4 + s5 + 0s*4 - 2s*2. -5s5 - s4 - 2s3 - s2 Expand 3a*2 - 4a*2 - 2a*2 + 2a*2 + 0a*2 - 3a*2 + (3 - 4 - 1)(0a2 + a2 + a2) + (2a*2 - 12a*2 - 8a*2)(-3 + 1 + 4)(4 - 2 - 3). 28a*2 Expand ((-2 - 3n + 2)(7n*2 - 3n2 + n2) + 4n2 - 4n2 + n3)(0n + 4n + 6n). -140n4 Expand (2p - 1 + 1)(19 + 16 + 4)((1 + 0 - 2)(2 + 0 - 1) + (-4 + 2 + 3)(-4 + 1 + 1)). -234p Expand (-p - 194 + 153 + 2p)(p + 2 - 2). p2 - 41p Expand (-11k5 - 6k + 6k)(-14 - 41 + 6). 539k5 Expand ((4b - b - b)(-3 + 7 - 2) + 3b - 2b + b + 0b - 2b - b)(8 + 2b2 - 8). 6b*3 Expand (-1 + 58 + 6)(-2 - 5 + 3)(-3 + 3 - r). 252r Expand o3 - o3 + o*5 + (-28o*4 + 3o*4 - 2o*4)(2o + 3 - 1 + 4o). -161o5 - 54o*4 Expand (-4k + 0k + 2k)(-k2 + 0 + 0) - 2864k + 2865k - 12k*3 - 8k**3	{ "pile_set_name": "DM Mathematics" }
e? False Is 167168257 a prime number? False Is 278612683 a composite number? False Is 2906129 a prime number? True Is 132930179 prime? False Is 1491041 prime? True Is 59655719 prime? False Is 6605647 composite? True Is 38349113 a composite number? True Is 12451423 prime? False Is 296579 prime? True Is 410658199 a prime number? False Is 24316421 a prime number? True Is 12462809 a composite number? False Is 6167159 composite? True Is 5805979 a composite number? True Is 76720661 a composite number? False Is 3034747 a composite number? True Is 155106397 composite? True Is 274067 a prime number? False Is 331964207 a prime number? True Is 74751517 a composite number? True Is 36588739 a composite number? True Is 593837 prime? False Is 1926521 a prime number? True Is 5841357 composite? True Is 13903087 a composite number? True Is 1166287 a prime number? True Is 179261773 prime? False Is 18330603 composite? True Is 8095111 prime? False Is 10725187 composite? True Is 16599823 a prime number? True Is 446608991 a composite number? False Is 171895431 a composite number? True Is 701047 a composite number? False Is 1698239 a composite number? True Is 9663281 prime? False Is 287887 a prime number? True Is 21158231 prime? True Is 1875217 composite? True Is 5060569 composite? True Is 10534051 composite? True Is 18830761 a composite number? True Is 3100501 composite? False Is 10711387 composite? False Is 2936023 a prime number? True Is 441971 a prime number? True Is 692751577 a composite number? True Is 969083 prime? True Is 63764377 a composite number? False Is 101984821 composite? False Is 40141711 a prime number? False Is 347938391 a prime number? False Is 24252913 a prime number? False Is 1841039 a composite number? False Is 2881699 composite? False Is 7665833 prime? False Is 1388437 prime? False Is 126239647 a composite number? True Is 2343277 prime? False Is 10133 composite? False Is 6541247 a prime number? True Is 2313481 prime? False Is 67807931 a prime number? False Is 13825157 a composite number? False Is 44735773 a prime number? False Is 75761579 prime? True Is 9067699 a composite number? True Is 107980897 a prime number? False Is 23972422 a composite number? True Is 6865931 prime? True Is 5262691 a composite number? True Is 3133027 a composite number? False Is 2243587 composite? False Is 30299459 composite? False Is 52146869 prime? True Is 1051021 composite? True Is 11377937 prime? True Is 7264087 a composite number? True Is 2807753 a composite number? True Is 4789403 composite? True Is 7512007 composite? True Is 3764899 a composite number? False Is 228354079 a composite number? True Is 688097 a prime number? True Is 2923159 prime? False Is 18702217 prime? True Is 135252371 composite? False Is 1061268679 a composite number? False Is 47002759 composite? True Is 16167377 a prime number? True Is 494466727 a composite number? False Is 1054517 a composite number? False Is 1021855 prime? False Is 16480487 a composite number? False Is 2228047 composite? True Is 6642793 composite? False Is 20279647 composite? False Is 719317 prime? False Is 645961 a prime number? False Is 10800847 prime? False Is 3042719 a prime number? True Is 5636021 composite? True Is 376542713 prime? False Is 6717947 a composite number? False Is 482844077 a composite number? True Is 49456103 a composite number? False Is 14748059 a composite number? True Is 16105339 a prime number? True Is 56958199 a prime number? False Is 327899483 a prime number? False Is 68798153 prime? True Is 8250329 a prime number? True Is 1318579 a prime number? True Is 9002593 prime? False Is 467640757 a prime number? True Is 56180333 a prime number? False Is 749129 composite? False Is 431256667 prime? True Is 73119109 composite? True Is 78011673 composite? True Is 8903 prime? False Is 2739089 prime? True Is 3382229 a composite number? False Is 978599 composite? False Is 7918411 a composite number? False Is 9959251 a prime number? True Is 40001291 composite? True Is 12051941 a composite number? True Is 376665077 prime? False Is 10652413 composite? False Is 37949101 composite? True Is 53995537 a composite number? False Is 373019 composite? False Is 5774039 composite? True Is 5585 a composite number? True Is 671911 a composite number? False Is 12081791 prime? True Is 7126109 a prime number? True Is 9547269 a composite number? True Is 33527929 a prime number? True Is 6596269 a prime number? False Is 473573 composite? True Is 98270803 a prime number? False Is 17147023 prime? True Is 1524469 a composite number? False Is 3722083 composite? False Is 5694499 prime? True Is 26710889 a composite number? True Is 342615563 a prime number? True Is 186456797 prime? True Is 21910157 a prime number? True Is 13351589 a composite number? False Is 47448614 a composite number? True Is 9287587 prime? False Is 6915967 a composite number? False Is 1167277 composite? False Is 10593421 a composite number? False Is 8474189 a prime number? False Is 1103929 composite? True Is 99931099 a composite number? False Is 3084173 composite? False Is 6187799 a composite number? False Is 33452017 composite? False Is 557369363 a prime number? True Is 12312533 composite? True Is 170591347 composite? False Is 115861751 prime? True Is 7661327 a prime number? False Is 18745823 a composite number? True Is 13716149 prime? True Is 914701 a composite number? False Is 159531299 prime? True Is 588077 a prime number? False Is 1345973 prime? True Is 436253 prime? True Is 2660909 a composite number? True Is 7689691 a prime number? False Is 570373 a composite number? False Is 12793093 a composite number? False Is 2645453 a composite number? False Is 27318497 a composite number? False Is 464431 prime? False Is 4329993 composite? True Is 18545101 composite? True Is 3730967 composite? False Is 48444581 composite? True Is 28631969 a prime number? False Is 3250409 prime? False Is 11720867 composite? True Is 39174999 a prime number? False Is 27723107 a composite number? True Is 81807263 composite? False Is 860181533 composite? False Is 26750077 a prime number? False Is 24317813 a composite number? True Is 9908033 a composite number? False Is 110161 composite? False Is 2645639 a prime number? True Is 41855779 a prime number? False Is 203806489 a composite number? True Is 37312703 prime? True Is 196266251 composite? True Is 42307973 prime? False Is 53115383 a prime number? True Is 409307 composite? True Is 1122209 a composite number? True Is 9486283 composite? False Is 17031449 prime? True Is 93499141 a composite number? False Is 377059 prime? True Is 876071783 a composite number? False Is 333991771 a prime number? True Is 11360383 a prime number? True Is 87640513 prime? True Is 238047289 a composite number? True Is 1045001 a prime number? False Is 34209377 prime? True Is 251159539 a prime number? True Is 3771067 a prime number? True Is 401825717 composite? False Is 2654263 a composite number? False Is 13860211 prime? True Is 313817141 composite? True Is 61949 a prime number? True Is 1233971 composite? True Is 11779891 prime? True Is 2631763 a composite number? True Is 566054347 composite? False Is 24607003 a prime number? True Is 236167783 a composite number? True Is 1993031 composite? False Is 34382393 a composite number? False Is 15523309 prime? False Is 75605 prime? False Is 1426409 prime? False Is 3972643 prime? True Is 1538182 composite? True Is 28177447 a composite number? True Is 1034869 composite? True Is 5845793 prime? True Is 20132549 composite? True Is 53812489 a composite number? False Is 37095574 a composite number? True Is 1450367 prime? True Is 10793605 a composite number? True Is 15557089 prime? True Is 58081181 a prime number? True Is 78703 a composite number? True Is 29168813 a prime number? True Is 55624903 a prime number? False Is 529467 a prime number? False Is 23631659 a prime number? True Is 125661257 prime? True Is 5947351 a prime number? True Is 26659707 a prime number? False Is 37578317 a composite number? True Is 5590699 composite? False Is 2698079 a composite number? False Is 76633049 a composite number? True Is 83729 prime? False Is 526367 prime? True Is 1345207 composite? False Is 4054409 prime? False Is 27494057 a prime number? False Is 1	{ "pile_set_name": "DM Mathematics" }
est ten. -50 What is 0.00324516078 rounded to 3 dps? 0.003 What is 0.00698704341 rounded to six decimal places? 0.006987 Round 184.432748 to the nearest one hundred. 200 Round 0.000275645424 to five decimal places. 0.00028 Round -9396083.8 to the nearest one hundred. -9396100 What is -175099.2218 rounded to the nearest one thousand? -175000 What is 131.230209 rounded to 0 decimal places? 131 What is -0.00507705709 rounded to 6 decimal places? -0.005077 What is 0.401946938 rounded to 3 decimal places? 0.402 Round 1.83584502 to 2 dps. 1.84 What is 130.44271 rounded to the nearest 100? 100 What is -2294.4532 rounded to the nearest 1000? -2000 Round -11686482050 to the nearest 1000000. -11686000000 Round 6897105.8 to the nearest 100000. 6900000 What is -234.560309 rounded to the nearest 10? -230 What is 0.0073673674 rounded to 6 dps? 0.007367 Round 0.76998071 to one dp. 0.8 What is -76.173132 rounded to the nearest ten? -80 What is 5.154006389 rounded to 2 dps? 5.15 What is -5750403 rounded to the nearest one million? -6000000 What is -0.1727455903 rounded to five dps? -0.17275 Round 33723.24416 to the nearest 10000. 30000 Round -0.04756321968 to two decimal places. -0.05 What is 0.9049152751 rounded to 4 decimal places? 0.9049 Round 0.005792355 to two dps. 0.01 Round 229745543.4 to the nearest ten thousand. 229750000 Round 3896660000 to the nearest 1000000. 3897000000 Round 60890.41117 to the nearest ten thousand. 60000 What is -0.10046793 rounded to three dps? -0.1 What is 0.0100087362 rounded to four dps? 0.01 Round 0.02680235225 to 4 dps. 0.0268 Round -0.401354403 to one dp. -0.4 Round -0.1315503 to 4 dps. -0.1316 What is 0.576820333 rounded to 2 dps? 0.58 What is -147.560476 rounded to the nearest integer? -148 Round -135534.06052 to the nearest 10. -135530 Round -0.03087198171 to 4 decimal places. -0.0309 What is 196.9815017 rounded to 0 decimal places? 197 Round -3.5747353 to one decimal place. -3.6 Round -0.0061194276 to 5 decimal places. -0.00612 What is 0.00272992011 rounded to 5 decimal places? 0.00273 Round 6261.26507 to 0 decimal places. 6261 Round -1172.3545396 to one dp. -1172.4 What is 0.0272175858 rounded to 6 decimal places? 0.027218 What is 99.0200723 rounded to 1 decimal place? 99 Round 95.9680215 to 3 dps. 95.968 Round 516541.519 to the nearest one hundred thousand. 500000 Round 0.00136176834 to 4 dps. 0.0014 What is -341653619 rounded to the nearest one hundred thousand? -341700000 What is 633652.8484 rounded to the nearest one hundred? 633700 What is -240.96636 rounded to zero dps? -241 What is -11756.8545 rounded to the nearest integer? -11757 Round 24970.00217 to the nearest 100. 25000 Round 0.28353884 to one decimal place. 0.3 Round 20.5324246 to one decimal place. 20.5 Round 0.00013222081809 to seven decimal places. 0.0001322 Round 0.04313361803 to two dps. 0.04 What is 74846055500 rounded to the nearest one million? 74846000000 What is 1599751000 rounded to the nearest 1000000? 1600000000 Round -44874.6651 to the nearest one thousand. -45000 Round -11883.75384 to the nearest ten. -11880 Round -5217.554471 to 1 decimal place. -5217.6 Round 0.172909824 to 2 dps. 0.17 Round -0.0000836022878 to 6 dps. -0.000084 What is 0.0015976343 rounded to three decimal places? 0.002 Round 49738404 to the nearest 1000000. 50000000 Round 280.8719529 to the nearest integer. 281 What is -29043105.1 rounded to the nearest ten thousand? -29040000 What is -0.000007185983619 rounded to six dps? -0.000007 What is 0.000041423832 rounded to 7 decimal places? 0.0000414 What is -17077664 rounded to the nearest 1000? -17078000 What is -697.3808 rounded to the nearest integer? -697 What is -0.0003660985911 rounded to four dps? -0.0004 Round -0.00000290205476 to seven decimal places. -0.0000029 What is 1733478.12 rounded to the nearest one hundred thousand? 1700000 What is 0.2657952214 rounded to one decimal place? 0.3 Round -0.0000820824868 to seven dps. -0.0000821 What is -0.02088414348 rounded to 6 decimal places? -0.020884 Round -94562999 to the nearest 10000. -94560000 What is 0.011857625 rounded to three decimal places? 0.012 What is -0.000709537481 rounded to 3 dps? -0.001 What is -0.5157183549 rounded to 3 dps? -0.516 Round 661901346 to the nearest one million. 662000000 What is -0.000010586296795 rounded to six dps? -0.000011 What is -0.1071260188 rounded to two dps? -0.11 What is 0.068994858 rounded to 5 dps? 0.06899 Round -0.004547812165 to 6 dps. -0.004548 What is 0.4224904196 rounded to 3 dps? 0.422 What is -0.000080237569 rounded to six decimal places? -0.00008 What is 652.725678 rounded to one decimal place? 652.7 Round 0.000160040815 to seven dps. 0.00016 Round 0.000061958702 to five decimal places. 0.00006 What is 1794699.6704 rounded to the nearest 100? 1794700 What is 227669390 rounded to the nearest 100000? 227700000 What is 26538194 rounded to the nearest one hundred thousand? 26500000 What is 488044784.6 rounded to the nearest 10000? 488040000 Round -0.024944462 to 3 dps. -0.025 Round -20584710.8 to the nearest 1000. -20585000 Round -0.157730152 to 3 decimal places. -0.158 Round 36251448.5 to the nearest 1000. 36251000 Round -3.497887165 to 1 dp. -3.5 Round 95396966 to the nearest 10000. 95400000 Round -140841.414 to the nearest 10000. -140000 Round -0.00040687857 to 6 decimal places. -0.000407 What is -1005231.269 rounded to the nearest one hundred thousand? -1000000 What is -3.8069184 rounded to three decimal places? -3.807 Round 1618627230 to the nearest 1000000. 1619000000 What is -170.69799 rounded to 0 decimal places? -171 What is 1510.125243 rounded to the nearest 10? 1510 Round 0.626101 to one dp. 0.6 Round 3154.67927 to 1 dp. 3154.7 What is 2439951870 rounded to the nearest 100000? 2440000000 What is -1694264.58 rounded to the nearest one thousand? -1694000 What is 151448203.8 rounded to the nearest one hundred thousand? 151400000 Round -927002649 to the nearest one hundred thousand. -927000000 Round 841.39507 to one dp. 841.4 What is 0.04844311903 rounded to 5 decimal places? 0.04844 Round 0.00039330938 to four decimal places. 0.0004 What is 4740.20052 rounded to 0 decimal places? 4740 Round 328.36281 to the nearest one hundred. 300 What is 0.1072296757 rounded to four dps? 0.1072 What is -41286.0389 rounded to 0 decimal places? -41286 What is 0.05083440323 rounded to 2 dps? 0.05 Round 0.0136833351 to 4 decimal places. 0.0137 Round 7848172.41 to the nearest 100. 7848200 What is 0.00044317229 rounded to six dps? 0.000443 Round -2246.1156864 to the nearest integer. -2246 Round 12093.83766 to the nearest integer. 12094 Round -0.0000103632564 to seven decimal places. -0.0000104 What is -19290.716961 rounded to 1 dp? -19290.7 Round -15137.6561 to the nearest ten. -15140 What is -31288786.74 rounded to the nearest one thousand? -31289000 Round -48756.1458 to the nearest integer. -48756 What is -26.9421647 rounded to the nearest integer? -27 Round 59691.028 to the nearest ten. 59690 Round -0.0001994400935 to 7 dps. -0.0001994 What is -507.796447 rounded to the nearest 100? -500 What is 0.845052857 rounded to three decimal places? 0.845 Round -3796568.01 to the nearest one hundred thousand. -3800000 What is -987876.38 rounded to the nearest 1000? -988000 Round 44.00386593 to 3 decimal places. 44.004 Round -0.000001804355195 to seven dps. -0.0000018 Round -0.0393129216 to five dps. -0.03931 What is -510.62017 rounded to the nearest integer? -511 What is 0.000092413097 rounded to five dps? 0.00009 Round -799.56519 to the nearest ten. -800 Round -0.00127824798 to 5 dps. -0.00128 Round 0.25784925 to two decimal places. 0.26 Round -79040.344 to the nearest 10000. -80000 What is 0.01074297747 rounded to 7 decimal places? 0.010743 What is 3000.52307 rounded to the nearest one hundred? 3000 What is 16586.88887 rounded to the nearest ten? 16590 What is 2202.7078 rounded to the nearest 10? 2200 Round 0.0000018627896 to 6 dps. 0.000002 What is 16745.13546 rounded to 0 decimal places? 16745 What is -0.00380532848 rounded to 7 dps? -0.0038053 What is 0.000183254551 rounded to seven dps? 0.0001833 Round 1487.0372 to the nearest 1000. 1000 What is 78484153.76 rounded to the nearest ten thousand? 78480000 What is 0.00000356481151 rounded t	{ "pile_set_name": "DM Mathematics" }
t b be (-4 - -5)-4 - -9. Suppose 0m = -bm + 1150. Round m to the nearest one hundred. 200 Let p = 165 + -165.000421. What is p rounded to 4 dps? -0.0004 Let j = 11.16 + -11. Let f = j - 0.15955. Round f to 4 decimal places. 0.0005 Let u = -25.64273 - -64.8986. Let x = -0.74321 - u. Let s = -40 - x. Round s to four decimal places. -0.0009 Let y = 2 + 17. Suppose 11b = yb - 23200000. Round b to the nearest 1000000. 3000000 Let j = 1104.998361 - 1105. What is j rounded to 4 dps? -0.0016 Suppose 4v - 8 = 2o + 6v, -2o = -3v + 18. Let t be (-8)/(-24) - 4/o - 7501. What is t rounded to the nearest one thousand? -8000 Let i = 4825.0004394 - 4825. Round i to five dps. 0.00044 Let k(b) = b*3 + 8b*2 - 2b + 10. Let f be k(-8). Suppose 2g - 35 + 83 = 2a, f = -g + 2a. Round g to the nearest 10. -20 Let k = 1.6 - 8. Let a = -7 - k. Let n = a - -0.64. Round n to two decimal places. 0.04 Let d = -12920.9 - -12889.9022. Let u = d + 31. What is u rounded to 4 dps? 0.0022 Let v = 15.05 + -15. Let d = 0.45 - v. Let z = d - 0.08. What is z rounded to 1 dp? 0.3 Let p = -238.6153294 - -248.81532789. Let y = 0.6 - 10.8. Let r = p + y. What is r rounded to 7 dps? -0.0000015 Suppose 175200 = 12f - 4f. Round f to the nearest 1000. 22000 Let y = -0.117 - -0.126633. What is y rounded to three decimal places? 0.01 Let j = 339.82 + -344. Let m = j - -4. What is m rounded to 1 dp? -0.2 Let j(b) = b2 - 5b + 7. Let l be j(5). Let z = l + -2. Suppose -4g + 34508 = zt, 0t - 5t - 5g = -34510. Round t to the nearest 1000. 7000 Suppose -v - 4v - 530000 = 0. Round v to the nearest 10000. -110000 Suppose -10m = -7m - 36. Let f(i) = 68i - 43. Let k be f(m). What is k rounded to the nearest 100? 800 Suppose 0 = -49x + 36x - 1950. Round x to the nearest 1000. 0 Suppose -399y = -394y + 2l + 612008, 0 = -3l - 12. Round y to the nearest 1000. -122000 Suppose -3g = 3g - 48. Let r(b) = 2b*2 - 8b - 18. Let d be r(g). Let v = 91 - d. What is v rounded to the nearest 10? 50 Let g = -0.002 + 0. Let t = -8.7 + 8.7. Let a = g + t. What is a rounded to two decimal places? 0 Let r = -85.2157 - 0.0843. Let i = -93 - r. Round i to zero dps. -8 Suppose 2x - 16 + 12 = 0. Let b be (-3 + x/1)-109. What is b rounded to the nearest 10? 110 Let o = -0.058 - -0.438. What is o rounded to zero dps? 0 Let k = -0.86 - -0.86000254. What is k rounded to 7 decimal places? 0.0000025 Let d = 2476121 + -4623121. What is d rounded to the nearest one hundred thousand? -2100000 Let m be (2291375/(-69))/(2/481). What is m rounded to the nearest one hundred thousand? -800000 Let p(i) = -6637i + 6. Suppose q = 5l + 11, -7q + 8q + 7 = -4l. Let y be p(l). Round y to the nearest one thousand. 13000 Suppose 3m = 7m - 88. Let d be (-4)/m - (-8870)/22. Suppose 4w = 5g - 504, w - d = -4g + 4w. Round g to the nearest one thousand. 0 Let i(l) = l*3 - 19l*2 - 19l - 25. Let b be i(20). Let g(k) = -2k2 + 2k + 8. Let x be g(b). Round x to the nearest 10. -50 Let i = -272 - -272.00000287. What is i rounded to 6 dps? 0.000003 Let i = -7 + 6.47. Let g = i - 0.23. Round g to one dp. -0.8 Let p = 3547269 + 1522731. What is p rounded to the nearest one hundred thousand? 5100000 Let a = 0.04 + 2.96. Let s = -1259.9888 - -1257. Let g = a + s. What is g rounded to three decimal places? 0.011 Let m = -1240 + 114. Round m to the nearest 10. -1130 Let h = 3466019 - 1896019. What is h rounded to the nearest one million? 2000000 Let q = -9.03 - -0.03. Let p = 4820843 + -4820852.0000032. Let c = p - q. What is c rounded to 6 dps? -0.000003 Let a = 11675 - 11674.4521. What is a rounded to two decimal places? 0.55 Let z = 58 - 44.7. Let i = 0.242087 - -13.064213. Let d = i - z. What is d rounded to 3 dps? 0.006 Let s(l) = -4l3 + 6l*2 - 3. Let g be s(-5). Round g to the nearest 10. 650 Let u(o) = -40334o + 4. Let j be (-35)/10(-12)/7. Let c be u(j). Round c to the nearest 10000. -240000 Let q = -0.54 + 0.540533. What is q rounded to 5 decimal places? 0.00053 Let y = -101.27 - -24.25. Round y to the nearest integer. -77 Let o = 21333848 - 21333872.999969. Let x = o - -25. What is x rounded to 5 decimal places? 0.00003 Suppose 0 = 4s + 2f + 3626, 0 = 3s - 33f + 36f + 2727. What is s rounded to the nearest 10? -900 Suppose 4x + 4l + 10 = 2, 2l + 1 = -5x. Let f be (-2834910)/(-315) - (x - 18/14). What is f rounded to the nearest one thousand? 9000 Let u = 14553.09589 - 39273.075912. Let p = 24720.2 + u. Let t = p - 0.22. Round t to 5 decimal places. -0.00002 Let w = 147 - 146.999999306. What is w rounded to 7 dps? 0.0000007 Let r = -8619.9993062 + 8620. Round r to 5 dps. 0.00069 Suppose -d + 110006 = 3a, 6 = -7a + 10a. Round d to the nearest 100000. 100000 Let n = 319.0451 + -319. Round n to two decimal places. 0.05 Let c = 0.035 + 4.565. Let t = c + -5. Let o = t + 0.18. What is o rounded to one decimal place? -0.2 Let p = 25.68 - 0.88. Let y = 27 - p. Let v = y - 1.987. Round v to two decimal places. 0.21 Let q = -0.065 + 0.495. Let k = q + -0.517. Round k to 2 dps. -0.09 Let k = 169.502 + -165.00274. Let v = -4.5 + k. Round v to 4 dps. -0.0007 Let b = 1543.04505 + -1543. Let k = 0.045 - b. Round k to three decimal places. 0 Let l(x) = 10104x + 112. Let i be l(-3). Round i to the nearest ten thousand. -30000 Let s = -0.1652 - -0.1662103. Round s to four dps. 0.001 Let f = 0.445 - 4.385. Round f to zero decimal places. -4 Let g(d) = -d*2 - 7d + 3. Let t be g(-7). Suppose ts = -1184 + 3881. Suppose -7f + 37999 = s. What is f rounded to the nearest 1000? 5000 Let n = 263.3 - 377. Let a = 112 + -219. Let f = n - a. Round f to zero dps. -7 Let z be (-4)/(-30) + ((-4829997305)/75)/(-7). Let u be z + 3/(6/10). Round u to the nearest one million. 9000000 Let s = -423.403 + 424. Let g = s - 3.552. Let u = 3 + g. What is u rounded to 2 decimal places? 0.05 Let p = 24.1 + -23.97008. Let q = p + -0.13. Round q to 5 decimal places. -0.00008 Let a be (1 + (-27)/(-6))/(3/6). Suppose -822000 = -8f + af. What is f rounded to the nearest one hundred thousand? -300000 Let g = 320.385 - 314. Let s = g - 0.085. What is s rounded to the nearest integer? 6 Let s = -1862.37 - -1870. Let a = 3.618 - -0.032. Let v = s - a. Round v to one dp. 4 Let f = 4.36 - 5.69. What is f rounded to one decimal place? -1.3 Suppose 0z = z. Suppose t = -x + 5718490 - 1100075, 5x + t - 23092059 = z. Suppose 3m = 7681589 + x. What is m rounded to the nearest one million? 4000000 Let w be 0 + (45000/(-21))/((-13)/(-35854)). What is w rounded to the nearest one hundred thousand? -5900000 Let r(j) = -4 + 13 - 2 + 3 + 38107j. Let h be r(5). Suppose -y = -26545 + h. What is y rounded to the nearest ten thousand? -160000 Let m = -0.11 - -0.144. Let y = -73.95 - -66.316. Let p = m + y. Round p to the nearest integer. -8 Let i = -54.052 - -17.448. Let o = -0.104 - i. What is o rounded to the nearest integer? 37 Let w = 136 + -131. Suppose -wk = 15m - 11m - 265012, -2k - 5m + 106015 = 0. What is k rounded to the nearest 10000? 50000 Let h = -0.84 - -0.48. Round h to one dp. -0.4 Let i = 8008 + 7994.2. Let p = -16003.60007 + i. Let w = p - -1.4. Round w to 4 dps. -0.0001 Let y = -148.6 - -167. Let s = y - 5.9. Round s to the nearest integer. 13 Let k = -11.34 + 11. Let j = 34 + -34.19. Let h = k - j. Round h to one decimal place. -0.2 Let y = 1.382 + 0.088. Let v = y - -0.03. Let o = v + -1.49944. Round o to four dps. 0.0006 Suppose r + 8 = 3. Let s = -9 - r. Let c be 1620012/(1 - 4) - s. What is c rounded to the nearest 100000? -500000 Let o = 2289338272.99999924 - 2289338220. Let m = o + -53. Round m to seven dps. -0.0000008 Let b(s) = -3s - 8s2 + s2 + 15 + 2s + s*3 - 23. Let n be b(-8). Round n to the nearest one hundred. -1000 Suppose 5m + m = -24. Let u = 7 + m. Let q be 124209/(-54) + u/18. What is q rounded to the nearest one thousand? -2000 Let r = 37.25 + -37. Let q = r - 6.75. What is q rounded to the nearest integer? -7 Let p = -561303.1007 - -561844.2. Let q = 541 - p. Round q to two decimal places. -0.1 Let l = 2.51 - -4.23. What is l rounded to the nearest integer? 7 Let u(y) = -22569y2 + 5y + 9. Let r be u(-7). Let w = 1992319 + r. Suppose 4*s - 473588 = w. What is s rounded to the	{ "pile_set_name": "DM Mathematics" }
i for b. 7 Solve 0 = -3d - p + 25, -251d - 18 = -254d + 6p for d. 8 Solve 25d = y - 71, 168 = -2d - 5y + 142 for d. -3 Solve 0 = -4a - 1794p + 1789p + 14, -5p = -a - 34 for a. -4 Solve -2w + 36 = -2q, 183715q - 183716q + 21 = 2w for w. 13 Solve -125k - 3u = -127k + 17, 4k = 3u + 31 for k. 7 Solve 4v + 11 = -s, s = -20v + 17v - 7 for s. 5 Solve -2n = 4l - 12, -1363l + 1360l + 6 = 3n for n. -2 Solve 1581g - 1576g - 5 = n, g = 3n + 15 for g. 0 Solve -3 = -2s - 0s + 3t, t + 21 - 16 = 0 for s. -6 Solve 11r - 5y = 16r + 10, 0 = -12r + 2y - 52 for r. -4 Solve -6 = 101a - 98a - 2x, -3a - 4x - 6 = 0 for a. -2 Solve 61g - 62g + 4i - 3 = 0, -4g = 5i - 9 for g. 1 Solve 6b + 23 = -u, 0 = 5u + 5 - 10 for b. -4 Solve 5p + 3s + 35 = 0, 0 = -5p - 36s + 35s - 35 for p. -7 Solve 0 = -18h + 17h + r + 10, -2h - 2r = 0 for h. 5 Solve 22 = -2r - 4d, 2r - 3716d - 2 = -3714d for r. -3 Solve 4j + 4v + 12 = 0, -580v = j - 604v - 97 for j. 1 Solve 4d = 2t - 36, 3t - 44 = -367d + 371d for t. 8 Solve -3k - 3s + 24 = 69, 5k + 62 = -4s for k. -2 Solve -16y - 23a + 24a = 71, 79 = -11y + 2a for y. -3 Solve 12253u - 12254u - 5 = c, -3c - 11 = 2u for u. -4 Solve -s - 5f - 1 = 0, 78027s - 4f - 24 = 78022s for s. 4 Solve -13 = -5x - m, 4x - 4m = -729 + 749 for x. 3 Solve -4p = -3w - 28, 35p + w = 33p + 4 for p. 4 Solve a - 4b + 139 = 137, a - b - 1 = 0 for a. 2 Solve 0 = -2y - 13j - 28, 51 = 5y + 3j + 3 for y. 12 Solve -3c - 3s + 68 = 65, 5c - 3s - 37 = 0 for c. 5 Solve 0 = -x + 4s + 12, 8x + 2s = 7x - 18 for x. -8 Solve 102n - 105n = -9, 2p + 3n + 11 = 0 for p. -10 Solve 3a + 4y = -402 + 385, -2 = -2a + 4y for a. -3 Solve 5p = 3x - 8, 64x - 69x = -5p - 30 for x. 11 Solve 494s - 498s + 8 = 0, -2r + 3s + 2 = 0 for r. 4 Solve 0 = 2d + 261t - 256t - 20, -3t + 12 = d for d. 0 Solve 11843u + 2r = 11848u + 14, 4r = -u - 16 for u. -4 Solve p + 8 = -182j + 180j, -17 = 3j + 4p for j. -3 Solve 12z + 7 = 15z + s, -2z + 13 = -s for z. 4 Solve 47b - 43b + 5x = -20, b + 2x + 11 = 0 for b. 5 Solve 0 = -k - 5v + 21, 0 = -3930k + 3925k + 5v - 15 for k. 1 Solve 4m - 4f - 122 = -106, -20 = -12m - 2f for m. 2 Solve -498d + 256d - 24 = -246d - 3w, d + 8 = w for d. 0 Solve -2j - 14y = -16y - 42, 5j - 36 = 2y for j. -2 Solve -285u - 7i - 30 = -286u, 3i = -4u + 27 for u. 9 Solve 103w - 105w = -2q - 20, 0 = 2w - q - 15 for w. 5 Solve 1350w - 1352w - 4d = -4, d + 9 = 2w for w. 4 Solve d + 8 = 366v - 368v, -5v + 2 = -3d for v. -2 Solve -2n - 4z = -12, -14 + 26 = -n + 7z for n. 2 Solve 0 = -y - 3d - 1, 587y - 586y - 4d = 6 for y. 2 Solve -3w + 3c = -6w + 6, -w - 13 = 4c for w. 7 Solve -j = 3, 0 = -z + 1033j - 1030j + 12 for z. 3 Solve 0 = -3j - j - 0j + 12, 0 = -743q + 746q - 11j + 27 for q. 2 Solve -g = 11t - 493 + 535, -5t = -4g + 28 for t. -4 Solve 5p + 5n - 10 = 0, -14040p = -14033p + 2n - 4 for p. 0 Solve k = 5z + 25, -3z = 4k + 41 - 49 for z. -4 Solve -4h = -2g - 2, -3h + 2g - 314280 = -314279 for h. 3 Solve 3t = 4h - 1, 121t = h + 125t + 14 for h. -2 Solve -5s + w - 29 + 15 = 0, 48 = -3s + 5w for s. -1 Solve -1659w = -u - 1660w, 2w = 4u + 18 for u. -3 Solve 0 = 3s - 2f + 6 + 2, 2s + 1000f = 1001f - 5 for s. -2 Solve 0 = 2a - 2y + 6, 3y + 2082 - 2099 = -5a for a. 1 Solve 78u - 76u + 48 = -2x, -u + x + 28 = 0 for u. 2 Solve 0z + z - 10 + 12 = -y, -25 = 5z for y. 3 Solve -3z = -4f - 32, -1212z + 1216z - 52 = 3f for f. 4 Solve -67n + 133n = 61n + 2t + 4, 2t = -4 for n. 0 Solve 0 = 4l + 5t + 44, 1148l - 1153l = 5t + 50 for l. -6 Solve n - 21 = -2m, -206n + 209n = -2m + 31 for n. 5 Solve -3a + 3f = -3, -2599f = -2600f - 1 for a. 0 Solve -5g - 18 = -74k + 73k, -3g - 28 = 8k for g. -4 Solve -3t + 10 = 2n, 31t = 14n + 32t - 150 for n. 11 Solve -27w + 18 = -23w + 3x, 1 = -2x - 3 for w. 6 Solve l + 1 = k, 4k = 30l - 32l - 8 for l. -2 Solve -16b - 16 = -12b - q, -4q + 13 = b for b. -3 Solve 23 = -3d + 4s, -155d - 7s - 22 = -157d - 9s for d. 3 Solve 16r - 14r = -4w + 2, 2w = -2r - 6 for w. 4 Solve -2d = -2s + 6, 43d = 47d - 3s + 11 for d. -2 Solve f - a = 4, -20 = -2174f + 2171f + 5a for f. 0 Solve 1882m = -3u + 1880m + 12, 8u - 30 = -5m for u. 0 Solve 2j + 24 = 5s, -4 = 5s + 1484j - 1472j for s. 4 Solve 4c = 4y, -5c + 1392y - 1389y - 2 + 2 = 0 for c. 0 Solve -242y + 237y - 6 = -2h, 0 = -h + 2y + 3 for h. 3 Solve 4g + 76 = -2o, 4g = 5o - 271 + 223 for o. -4 Solve -21357j + 3b + 4 = -21358j, -3j - 4b = 12 for j. -4 Solve b = -2n + 7, -5n = 4042b - 4038b - 25 for b. 5 Solve 0 = -g - 5x + 5, 21 - 16 = g + 3x for g. 5 Solve 251861j - 52 = 251874j + 2y, j - 4y + 4 = 0 for j. -4 Solve 2f + m + 4378 = 4377, 5m - 8 = 3f for f. -1 Solve -544u = -540u + 2n + 18, 0 = 2u + 10n + 18 for u. -4 Solve -169j = 4r - 164j - 13, 3j - 5 = 5r + 5j for r. -3 Solve -80 = -o + 5c - 56, 57o - 55o = -c - c for o. 4 Solve 6r - 7r = v + 9, -v - 11r - 99 = 0 for v. 0 Solve -33k - 12 = 3z - 36k, z = 5k - 8 for z. -3 Solve -28 = -3c - 2m, -c - 13m = -0m - 108 for c. 4 Solve 4o - 12 = 4u - u, -o + 5o = 24 for u. 4 Solve -5w + 45j - 47j - 4 = 0, -2w = -3j - 6 for w. 0 Solve -23b + 392q = 396q - 518, -2q - 60 = -3b for b. 22 Solve 3 = 3u - 4u, d - 4u + 125 = 142 for d. 5 Solve -2s = 118z - 120z - 6, -s = 3z + 13 for z. -4 Solve 27 = 4s - 5197k + 5192k, -2k + 42 = 5s for s. 8 Solve -17g = -14g - 3u + 3, 5 = -3g + 4u for g. 1 Solve -3o - 22 = 5f - 34, -3o + 3 = 2f for o. -1 Solve 3a - 278i + 281i = 15, 3i = -4a + 18 for a. 3 Solve 99b = 100b + 2f, 0 = 4b - f for b. 0 Solve 1545o + i + 18 = 1540o, 3i + 14 = -5o for o. -4 Solve -5n = 2k - 25, 39 - 31 = -4n + 4k for n. 3 Solve -5l - 152 = 2s - 154, 5l = 2s + 18 for s. -4 Solve -3q = -2r + 5, 153q - 7 = 158q - 3r for q. 1 Solve -7v = 4a - a - 53, -45 = 2v - 102 + 41 for a. -1 Solve 0 = 3q - 4l + 6, -1722q = -1727q + 3l - 21 for q. -6 Solve i - 10 = -3y, -139i = -134i + 14y - 46 for i. -2 Solve 5h + 3b + 174 - 176 = 0, 5b = -3h - 18 for h. 4 Solve -5l = 11d + 65, -2885l + 2881l + 7 = -3d for d. -5 Solve 0 = -z + 5k - 13, -3z - 111k + 113k - 13 = 0 for z. -3 Solve f + 231 = l + 239, -4f - 4l - 48 = 0 for f. -2 Solve -4f - 5k + 20361 = 20337, 3f - 15 = -3k for f. 1 Solve 66o - 16 = 64o - 2c, 3o - 5c = 0 for o. 5 Solve -2r + 9 = -5l, -5r - 349 = 353 - 712 for l. -1 Solve -m = -4, -y + 23 - 27 = m for y. -8 Solve -26 = -4u + t, 0 = 5t - 34 + 64 for u. 5 Solve 35 = -4i + 2i + 5w, -7w = -37 + 2 for i. -5 Solve 3v + 7k + 685 = 686, k - 5 = 2v for v. -2 Solve -11 = 225k - 231k + g, 3k + 4g + 17 = 0 for k. 1 Solve 3k - 29 = 5p, -3p + 41 = 3k + 44 for k. 3 Solve l = -n - 5, 663n - 666n = -4l - 6 for l. -3 Solve 5q - 4k + 9 = 0, 56q - 2k - 33 = 61q for q. -5 Solve 5u + 15 = -5t - 35, -u - 22 = 5t for u. -7 Solve -2f = 2z + 2, -34f + 2z + 1 = -37f for f. 1 Solve 75 = 3w + 3r, 5r + 130 = 2w + 227 for w. 4 Solve -5k - 4j = 19, 0 = -5k + 2k + 4j - 5 for k. -3 Solve 2 = -557r + 555r, 5 = -2j - r for j. -2 Solve 11m + 50 = 16m - 3f, m - 5f - 32 = 0 for m. 7 Solve -3x = -142k + 139k - 12, -5x + 40 = 5k for k. 2 Solve 0 = -4a - 10c - 112, 16a - 14 = 15a + c for a. 2 Solve 3v + 1881 = -4z + 1894, -z - 4v = -13 for z. 1 Solve 2m + 245v = 247v, -4m + v = 6 for m. -2 Solve -219s = -221s - 2 - 6, s - 32 = -4y for y. 9 Solve -4l = -184z + 179z - 6, 0 = -5z - l + 14 for z. 2 Solve 5i + 2u = 0, 12i + 4u + 1 + 3 = 0 for i. -2 Solve 5c - 11 = 13q + 10, -5q - 9 = -c for c. -1 Solve -14 = 2i + 3u, 5u = -4i - 210 + 184 for i. -4 Solve 1373 = 2f - 2m + 1379, 4m = -3f - 23 for f. -5 Solve -931o = -934o - 3n + 81, 0 = -5o + 4n + 90 for o. 22 Solve 4m = 5p + 6, 4m = -13 + 29 for p. 2 Solve 20 = -h - 3v, 4h + 42 - 32 = 2v for h. -5 Solve 0 = -i - 2, -3k - 841i + 844i + 15 = 0 for k. 3 Solve -2f + 32 = -4g, 8 - 67 = -5g - 2f for g. 3 Solve -37 = 8p - 5r, -20786r - 4 = -207	{ "pile_set_name": "DM Mathematics" }
any millilitres are there in three tenths of a litre? 300 How many centimeters are there in 582.7325mm? 58.27325 How many hours are there in 4/7 of a week? 96 How many centimeters are there in thirteen fifths of a meter? 260 What is 75.72512 litres in millilitres? 75725.12 How many centuries are there in 9621.692 millennia? 96216.92 What is 31.11051ml in litres? 0.03111051 What is 9548.03 kilograms in tonnes? 9.54803 How many grams are there in 76962.25 milligrams? 76.96225 What is 7382.281l in millilitres? 7382281 How many days are there in 26.7337341 nanoseconds? 0.00000000000030941821875 What is eleven sevenths of a week in hours? 264 Convert 668.4771um to kilometers. 0.0000006684771 What is 142.4423 nanometers in kilometers? 0.0000000001424423 How many micrometers are there in 9576.345 millimeters? 9576345 How many kilometers are there in 424.2448nm? 0.0000000004242448 What is seven eighths of a meter in millimeters? 875 What is 5/8 of a meter in millimeters? 625 How many millimeters are there in 21/5 of a centimeter? 42 Convert 93759.24ug to tonnes. 0.00000009375924 What is 5/8 of a decade in months? 75 How many micrometers are there in one sixteenth of a centimeter? 625 How many meters are there in eighteen fifths of a kilometer? 3600 What is 11/4 of a millennium in months? 33000 Convert 595.1719kg to micrograms. 595171900000 How many minutes are there in 21/5 of a day? 6048 Convert 142.26411 months to millennia. 0.0118553425 What is 0.6478113 meters in kilometers? 0.0006478113 How many micrograms are there in 998958.7g? 998958700000 Convert 33679.36 grams to nanograms. 33679360000000 What is 4.480602m in micrometers? 4480602 How many micrograms are there in seven halves of a milligram? 3500 How many millilitres are there in twenty-seven fifths of a litre? 5400 What is 37/2 of a millimeter in micrometers? 18500 How many seconds are there in 2/75 of a hour? 96 How many milligrams are there in five eighths of a gram? 625 What is three tenths of a decade in months? 36 What is eighteen fifths of a century in years? 360 What is 34/5 of a millennium in years? 6800 How many microseconds are there in 39063.99 seconds? 39063990000 What is 0.819194 tonnes in micrograms? 819194000000 What is 316846.5g in nanograms? 316846500000000 What is 25/2 of a litre in millilitres? 12500 How many grams are there in 0.1423816mg? 0.0001423816 How many decades are there in 31/2 of a millennium? 1550 What is 25/2 of a litre in millilitres? 12500 How many litres are there in 32047.1 millilitres? 32.0471 What is 5/8 of a kilometer in meters? 625 What is 0.6962696l in millilitres? 696.2696 What is 550.8885 millilitres in litres? 0.5508885 How many micrometers are there in 875235.9cm? 8752359000 How many nanometers are there in 95/2 of a micrometer? 47500 What is 4.379759km in millimeters? 4379759 What is 52/5 of a kilometer in meters? 10400 How many kilograms are there in 112.4866 nanograms? 0.0000000001124866 How many millilitres are there in 4198.183 litres? 4198183 What is eleven quarters of a gram in milligrams? 2750 What is 6/5 of a century in years? 120 What is 0.1322751ml in litres? 0.0001322751 Convert 0.4222544 minutes to microseconds. 25335264 What is 17/4 of a week in minutes? 42840 What is 3/25 of a gram in milligrams? 120 How many years are there in 9/10 of a millennium? 900 What is thirty-one halves of a decade in years? 155 Convert 841.467ml to litres. 0.841467 How many years are there in 26.43187 decades? 264.3187 How many millilitres are there in 526.9562 litres? 526956.2 Convert 9623.454 kilograms to tonnes. 9.623454 Convert 8853.69 kilograms to micrograms. 8853690000000 How many micrograms are there in 3/40 of a milligram? 75 Convert 702.5116 millilitres to litres. 0.7025116 Convert 5.265362 years to millennia. 0.005265362 How many millilitres are there in 5/4 of a litre? 1250 How many nanometers are there in three fifths of a micrometer? 600 How many minutes are there in twenty-nine thirds of a day? 13920 Convert 7747.566ml to litres. 7.747566 Convert 8133.439l to millilitres. 8133439 What is 7/4 of a litre in millilitres? 1750 Convert 15309.531ns to minutes. 0.00000025515885 How many millilitres are there in 17/2 of a litre? 8500 Convert 839.7981 centuries to decades. 8397.981 What is 67/4 of a litre in millilitres? 16750 What is 9424.23s in microseconds? 9424230000 What is 2864.382 millilitres in litres? 2.864382 How many centimeters are there in one tenth of a meter? 10 Convert 791037.8 centimeters to nanometers. 7910378000000 How many minutes are there in 7/2 of a week? 35280 How many seconds are there in 4.724523 weeks? 2857391.5104 What is 78227.58 litres in millilitres? 78227580 How many micrometers are there in 59106.16 centimeters? 591061600 Convert 71.60175 months to millennia. 0.0059668125 What is seventy-five halves of a meter in millimeters? 37500 What is 11/2 of a microgram in nanograms? 5500 Convert 114.2946 millennia to centuries. 1142.946 What is 33.86988 millennia in years? 33869.88 How many decades are there in 0.1648799 centuries? 1.648799 What is 1/30 of a century in months? 40 Convert 3713.807 milligrams to nanograms. 3713807000 How many micrograms are there in 19/4 of a milligram? 4750 What is 6/5 of a millisecond in microseconds? 1200 How many seconds are there in 1/10 of a minute? 6 Convert 197918.5 decades to years. 1979185 What is 22/9 of a day in minutes? 3520 What is 5/4 of a kilogram in grams? 1250 How many years are there in 271384.5 millennia? 271384500 Convert 6185263.5ns to hours. 0.00000171812875 What is 3/50 of a kilogram in milligrams? 60000 What is 1/4 of a micrometer in nanometers? 250 How many millilitres are there in fourty-six fifths of a litre? 9200 How many centimeters are there in 17/4 of a meter? 425 How many hours are there in 11/4 of a week? 462 What is 3/50 of a kilogram in milligrams? 60000 How many meters are there in 6622.677cm? 66.22677 What is 3/8 of a kilogram in grams? 375 What is 1/4 of a litre in millilitres? 250 How many nanometers are there in 1366.095cm? 13660950000 How many hours are there in 52100.87 days? 1250420.88 Convert 78.325407 milliseconds to days. 0.0000009065440625 What is twenty-five halves of a litre in millilitres? 12500 How many millimeters are there in 3/40 of a kilometer? 75000 What is 11/4 of a litre in millilitres? 2750 How many centuries are there in thirty-four fifths of a millennium? 68 What is seven eighths of a hour in seconds? 3150 Convert 38.69813 meters to nanometers. 38698130000 What is 17/2 of a second in milliseconds? 8500 What is 47/4 of a microgram in nanograms? 11750 What is 6/25 of a kilogram in grams? 240 How many grams are there in thirty-seven fifths of a kilogram? 7400 How many milliseconds are there in 52/5 of a second? 10400 How many months are there in 27/2 of a century? 16200 How many milliseconds are there in 5/4 of a second? 1250 Convert 111166.7 millilitres to litres. 111.1667 How many millilitres are there in 13/4 of a litre? 3250 Convert 9.191712 weeks to milliseconds. 5559147417.6 What is seventeen halves of a litre in millilitres? 8500 What is twenty-one quarters of a week in minutes? 52920 What is 0.7204893l in millilitres? 720.4893 What is 1/10 of a decade in months? 12 What is 29/6 of a hour in seconds? 17400 How many micrograms are there in 1/20 of a milligram? 50 What is seven halves of a year in months? 42 What is 477176.5 millilitres in litres? 477.1765 How many hours are there in 2/21 of a week? 16 What is 2/125 of a tonne in grams? 16000 What is 313618.3g in kilograms? 313.6183 Convert 870860.3 kilograms to micrograms. 870860300000000 How many milligrams are there in 87492.7t? 87492700000000 Convert 2414.503 micrograms to kilograms. 0.000002414503 Convert 531153.8 centuries to decades. 5311538 How many milliseconds are there in 3/10 of a minute? 18000 Convert 5697.419t to nanograms. 5697419000000000000 What is 324.1086 tonnes in kilograms? 324108.6 What is twenty-nine fifths of a millennium in centuries? 58 What is 87.17267 litres in millilitres? 87172.67 What is 7299.329 micrograms in tonnes? 0.000000007299329 How many seconds are there in seven fifteenths of a minute? 28 What is 33.50788 tonnes in kilograms? 33507.88 What	{ "pile_set_name": "DM Mathematics" }
28 Let n(w) = 1809w - 27143. Determine n(15). -8 Let o(t) = 47t - 363. Give o(8). 13 Let u(i) = -i*3 + 36i*2 - 34i - 6. Calculate u(35). 29 Let v(z) = -550z - 3281. Give v(-6). 19 Let n(r) = -283r + 2833. Determine n(10). 3 Let m(a) = 26a2 + 79a + 160. Determine m(-2). 106 Let s(k) = -47k - 114. Determine s(5). -349 Let p(z) = -z3 - 8z*2 - 31z - 83. Calculate p(-4). -23 Let t(y) = -211y - 10746. What is t(-51)? 15 Let j(r) = -6r*2 + 53r + 37. Determine j(10). -33 Let p(b) = -2b3 + 298b2 + 5. Calculate p(149). 5 Let g(d) = d3 - 22d2 + 13d + 87. Give g(18). -975 Let t(a) = a*3 + 12a*2 - 12a + 69. Calculate t(-14). -155 Let t(s) = 8s - 344. Calculate t(42). -8 Let k(s) = s2 - 1321s + 11833. Calculate k(9). 25 Let i(t) = 2t2 - 322t + 4371. Calculate i(15). -9 Let q(c) = 64c2 - 1347c + 44. Calculate q(21). -19 Let c(y) = 4y - 40. Determine c(-20). -120 Let f(w) = -2w*2 - 68w + 213. Calculate f(-37). -9 Let y(v) = 2v3 - 88v*2 - 2v + 84. What is y(44)? -4 Let q(r) = -14r2 - 37r + 159. What is q(4)? -213 Let i(x) = -909x - 243. Calculate i(-1). 666 Let y(a) = a3 + 30a*2 - 25a - 2259. Calculate y(-28). 9 Let u(r) = r*3 + 14r*2 + 12r + 27. Give u(-13). 40 Let p(k) = k*2 + 7k + 5. Calculate p(8). 125 Let f(t) = -118t - 49. What is f(2)? -285 Let a(q) = -484q - 4716. Determine a(-10). 124 Let y(t) = 449t + 67. Calculate y(0). 67 Let m(b) = -b2 + 27b - 106. Calculate m(18). 56 Let y(w) = 14w - 131. Give y(23). 191 Let y(q) = -225q - 892. What is y(-5)? 233 Let n(u) = -146u - 1450. What is n(-10)? 10 Let g(x) = -x3 + 85x*2 - 1106x + 7. Give g(16). -25 Let z(i) = 3i2 + i - 21. Give z(6). 93 Let u(j) = 230j + 1041. What is u(-5)? -109 Let p(f) = f*3 + 47f*2 - 53f - 248. Determine p(-48). -8 Let a(y) = y*3 + 62y*2 - 266y - 145. What is a(-66)? -13 Let w(g) = 4099g - 57379. Determine w(14). 7 Let w(p) = 107p + 10194. Calculate w(-95). 29 Let h(i) = -i*3 - 6i*2 - i - 10. Calculate h(-6). -4 Let g(a) = 18a - 293. Calculate g(18). 31 Let m(r) = 2r3 + 59r*2 + 259r - 37. Calculate m(-24). 83 Let c(y) = -122y - 29395. Calculate c(-241). 7 Let g(f) = 125f - 747. Calculate g(6). 3 Let u(x) = -3x2 - 326x - 974. What is u(-3)? -23 Let n(m) = 6m2 + 450m + 13. Calculate n(-75). 13 Let x(w) = 38w3 - 6w*2 - 6w + 15. Determine x(2). 283 Let n(i) = -2i2 + 47i - 260. Calculate n(9). 1 Let a(l) = 55l - 848. Determine a(29). 747 Let g(j) = -669j - 650. What is g(-1)? 19 Let y(g) = g*2 - 47g + 137. What is y(31)? -359 Let j(p) = p*2 - 22p + 26. Determine j(21). 5 Let a(v) = v*3 + 23v*2 - 16v - 165. Give a(-22). 671 Let j(s) = -2s3 + 52s*2 - 11s + 295. Determine j(26). 9 Let b(d) = -9d3 + 168d*2 + 43d + 261. Calculate b(19). -5 Let q(g) = -22g - 37. What is q(0)? -37 Let x(s) = 15s - 62. Determine x(5). 13 Let p(k) = 42k + 1105. Give p(-26). 13 Let q(x) = 93x*2 + 97x - 1. Give q(-1). -5 Let x(r) = -10r3 + 65r*2 + 39r - 37. Calculate x(7). -9 Let s(k) = k*3 - 17k*2 + 12. Give s(17). 12 Let j(l) = 113l + 9766. Calculate j(-86). 48 Let w(y) = y*2 + 24y - 188. Determine w(-30). -8 Let n(r) = -17r2 + 29r + 95. What is n(-3)? -145 Let k(u) = -244u - 91. What is k(-1)? 153 Let v(f) = -50f + 467. Give v(14). -233 Let i(y) = -79y + 93. What is i(13)? -934 Let t(v) = -541v + 556. Calculate t(1). 15 Let z(u) = 21u - 8. What is z(-2)? -50 Let s(f) = f2 + 21f - 527. Calculate s(-38). 119 Let b(j) = 5j2 + 32j - 10. Give b(-6). -22 Let n(w) = -2w + 260. Give n(0). 260 Let c(b) = -2b*2 + 159b - 772. Give c(5). -27 Let n(m) = -18m + 581. Determine n(31). 23 Let g(w) = 90w + 48. Give g(-1). -42 Let k(c) = -10c2 - 42c - 59. What is k(-5)? -99 Let r(d) = 53d - 305. Determine r(7). 66 Let y(k) = k2 + 93k + 267. Give y(-90). -3 Let f(b) = -b*3 - 93b*2 + 498b + 779. What is f(-98)? -5 Let a(x) = -2x2 - 135x - 678. Calculate a(-62). 4 Let j(k) = 35k3 + 14k*2 - 21k - 4. What is j(2)? 290 Let z(i) = i*3 + 4i*2 + 7i + 1. Calculate z(-3). -11 Let z(i) = 10i2 + 66i + 121. Determine z(-3). 13 Let j(h) = h*3 - 52h*2 + 56h - 243. Give j(51). 12 Let l(a) = -3a3 + 24a*2 - 17a - 19. Give l(7). 9 Let r(k) = 10k3 - 101k*2 + 3k + 72. Determine r(10). 2 Let w(g) = g*2 + 12g - 94. Calculate w(5). -9 Let n(h) = h*3 - 59h*2 - 1990h - 179. Give n(83). -13 Let f(c) = c*3 + 162c*2 - 6c - 988. Calculate f(-162). -16 Let z(i) = -10i2 + 172i - 169. Give z(1). -7 Let a(q) = -q*2 - 47360q + 189460. Calculate a(4). 4 Let x(g) = 14g2 + 3377g + 722. What is x(-241)? -1 Let y(f) = 19f3 - f2 - 10f + 15. Give y(2). 143 Let o(m) = m*3 + 27m*2 + 35m + 35. Give o(-26). -199 Let k(w) = 256w - 80127. Give k(313). 1 Let m(c) = -29c + 25. Give m(-5). 170 Let v(f) = f*3 + 52f*2 - 136f + 1589. What is v(-55)? -6 Let d(a) = -a*3 + 345a*2 + 683a + 3818. Give d(347). 1 Let z(c) = -c*2 - 45c + 1460. Determine z(22). -14 Let t(n) = 3n2 - 5n + 7. Give t(-6). 145 Let m(f) = 2f3 - 64f*2 + 507f + 25. Calculate m(15). -20 Let k(y) = -273y2 - 3y - 1. Determine k(-1). -271 Let x(z) = 118z - 299. What is x(3)? 55 Let b(a) = -2a*2 - 184a - 185. Give b(-91). -3 Let s(k) = -26k2 - k - 1. What is s(2)? -107 Let o(a) = -51a + 1722. Determine o(34). -12 Let q(u) = 2u3 - 99u*2 - 151u - 119. What is q(51)? -17 Let k(r) = -r*3 - 48r*2 + 91r + 2048. Determine k(-49). -10 Let x(b) = -134b + 1203. What is x(9)? -3 Let v(m) = -m2 + 72m - 1197. Determine v(46). -1 Let k(z) = z*3 - 17z*2 - 57z - 23. Determine k(20). 37 Let i(f) = 14f3 - 195f*2 - 22f - 3. Determine i(14). -115 Let m(o) = 12o3 + 4o*2 - o - 3. What is m(-3)? -288 Let t(g) = -4g*2 - 305g - 226. Give t(-74). 440 Let f(n) = -6n + 198. Determine f(35). -12 Let n(u) = u2 + 48u + 144. What is n(-3)? 9 Let x(c) = -2c2 - 4c + 28. Give x(8). -132 Let d(x) = 444x - 1784. Determine d(4). -8 Let m(f) = -4f*3 - 3f*2 + 91f + 19. Determine m(-5). -11 Let b(m) = -184m + 4308. What is b(23)? 76 Let c(g) = -15g + 225. What is c(12)? 45 Let b(f) = -314f + 705. Calculate b(2). 77 Let l(j) = 18j*3 - 3j*2 - 3j + 4. What is l(2)? 130 Let j(b) = 1122b - 16841. Give j(15). -11 Let g(h) = 15h - 104. Determine g(5). -29 Let z(s) = 105s3 + 4s*2 - 5. Give z(1). 104 Let s(i) = -3i*2 - 403i + 2916. Give s(7). -52 Let b(w) = -2w2 + 66w - 203. Give b(28). 77 Let b(u) = 27u + 9. Give b(0). 9 Let l(d) = -d3 + 6d*2 + 41d - 14. Determine l(10). -4 Let y(p) = -p*3 + 23p*2 - 95p + 83. Give y(18). -7 Let i(p) = 87p + 14. Calculate i(-13). -1117 Let a(f) = 7f - 192. Give a(41). 95 Let s(w) = w*2 + 45w + 262. Calculate s(-37). -34 Let p(f) = 9f2 - 2f - 7. Give p(1). 0 Let b(w) = 187w - 18706. Calculate b(100). -6 Let v(i) = 2i*2 + 168i - 1643. Determine v(9). 31 Let q(o) = -o*3 - 22o*2 + 373o + 331. Determine q(-33). 1 Let l(j) = 43j + 463. What is l(-11)? -10 Let f(r) = -44r - 905. Calculate f(-18). -113 Let d(z) = 2z2 - 532z - 2162. Determine d(-4). -2 Let w(y) = 2y2 + 48y + 278. What is w(-12)? -10 Let v(c) = -41c2 - 13c - 14. What is v(-1)? -42 Let t(m) = m3 - m2 + 22m - 51. What is t(3)? 33 Let f(r) = 5r*3 + 13r*2 + 5. Give f(-2). 17 Let k(o) = 18o*2 + 1276o - 141. Give k(-71). 1 Let u(i) = 7i3 + 2i2 - 261. Give u(0). -261 Let w(n) = -n3 - 15n2 + 24n + 52. What is w(-10)? -688 Let m(w) = w*2 + 16w + 72. Determine m(-15). 57 Let l(t) = t*3 - 28t*2 + 33t + 43. Determine l(26). -451 Let j(r) = -r*2 - 57r - 24. Determine j(-6). 282 Let w(f) = 9f - 16. Give w(0). -16 Let a(r) = 3r*3 + 46r*2 + 20r + 17. What is a(-15)? -58 Let b(f) = 2f2 - 119f - 416. What is b(64)? 160 Let t(h) = 3h3 - 16h*2 - 505h - 34. Give t(16). 78 Let m(v) = 2v3 - 25v*2 + 9v + 17. Give m(12). -19 Let f(j) = -108j + 529. What is f(17)? -1307 Let d(q) = -4q*2 + 81q + 127. Give d(21). 64 Let f(o) = 14o2 + 280o - 51. What is f(-21)? 243 Let t(d) = -2d3 - 95d*2 - 51d - 261. Calculate t(-47). -73 Let a(o) = -25o - 143. What is a(-21)? 382 Let n(q) = -q2 + 144q - 1927. Calculate n(15). 8 Let o(x) = 156*x	{ "pile_set_name": "DM Mathematics" }
of w? 5 Suppose -5o = 2b - 4o - 39, -4o + 102 = 5b. Suppose -5k + b = 3. What is the units digit of (-10)/(-1) + k/(-1)? 7 Suppose b + 14 = 4t, -b + 3t = b + 13. Suppose -16a + 56 = -12a. What is the tens digit of ((a - -2) + b)2? 2 Suppose -5i - 3093 = 8q - 10q, -q - 4i = -1514. What is the tens digit of q? 3 Let l(a) be the third derivative of -2a*2 + 0 + 0a - 7/24a4 - 1/60a*5 + 1/2a*3. What is the units digit of l(-5)? 3 Suppose 2h = -h - 1062. What is the units digit of (h/(-8))/(6 - 93/16)? 6 Let w(v) = 9v2 + 267v + 27. What is the units digit of w(-37)? 9 What is the units digit of -5 - (-27)/(243/8442)? 3 Let h(t) = -7t3 + 7t*2 + 7t + 39. What is the tens digit of h(-5)? 5 Suppose -47p + 10262 + 53564 = 0. What is the units digit of p? 8 Let b = 163 + -75. Suppose -94 = -4s + r + 6, -b = -4s - 2r. What is the units digit of s? 4 Let g be (4/2)/((-6)/6). Let o = g - -68. What is the tens digit of o? 6 Let c(k) = 5k2 + 15k + 3. Let x(n) = n*2 + n + 1. Let v(o) = c(o) - 4x(o). Let p be v(-5). Let w = 28 - p. What is the tens digit of w? 5 Let p be (218/8)/(16/64). Let u = -31 + p. Let a = u + -51. What is the units digit of a? 7 Let l be (-2 - -5)(-6)/(-18). Let u(h) = h2 - h + 2. Let j be u(l). Suppose -jx = 8, 6g - 5x = g + 145. What is the units digit of g? 5 Let p be (10(-44)/(-32))/(2/8). Let o = -34 + p. What is the units digit of o? 1 Let o(u) = 334u - 150. What is the tens digit of o(3)? 5 Let m(j) = j*3 - 5j*2 + j + 5. Let k be m(0). Suppose 5x = -u + 52, -3u - 2u - 3x = -150. Let g = u + k. What is the units digit of g? 2 Suppose 3o + 5s + 6 + 3 = 0, -4s - 18 = -3o. Let n be (-5)/20 - o/(-8). Suppose -2g + 8 = -ng + m, 3g - 2m - 26 = 0. What is the units digit of g? 6 Let l(u) = 223u*2 - 26u + 100. What is the thousands digit of l(3)? 2 Let p = 3547 - 2394. What is the hundreds digit of p? 1 Let j = -186 - -279. Let p = j - -23. What is the units digit of p? 6 Let v(p) = p*2 - 6p + 2. Let w be v(6). Suppose -4l = -10 - w. What is the units digit of l? 3 Suppose -t - 580 = -3t. What is the tens digit of t? 9 What is the hundreds digit of (-593550)/(-400) + (-2)/(-16) + 1? 4 Let g be (-2(-2)/8)/(7/28). Suppose -144 - 162 = -gn. What is the hundreds digit of n? 1 Let d(x) = -2x2 + 3x + 21. Let o be d(-9). Let n = o - -322. What is the units digit of n? 4 Let h = 43 + -7. What is the tens digit of h? 3 Let r(m) = -4m - 5. Let a be r(-7). Suppose -3k - 15 - 21 = 0. Let f = a + k. What is the tens digit of f? 1 Let w(x) = 27x + 60. What is the tens digit of w(9)? 0 Let z(r) be the first derivative of -r3/3 + 17r*2/2 - 8. Let j be z(15). Suppose -4q + j = -q. What is the tens digit of q? 1 Let a = -103 - -66. Let h = 10 - a. What is the units digit of h? 7 Let j(z) = 2z2 - 36z - 179. What is the tens digit of j(-23)? 0 Suppose -32m = 39m - 111967. What is the tens digit of m? 7 Suppose 6w - 20 = 11w, u - 4w = 3068. What is the hundreds digit of u? 0 Let t = 888 + -854. What is the tens digit of t? 3 Let b = -14 + -11. What is the tens digit of (396 + -2)(3 + b/10)? 9 Let g be 13/(-13) + 721. Suppose -25 + g = q. Suppose -4p - 19 = 3c - 131, -5p + q = -c. What is the tens digit of p? 2 What is the hundreds digit of 525/301818/15? 1 Let s be (-217)/(-42) + (-2)/12. Suppose 0 = -3n + 2v + 23, -4n + 2v = -18 - 10. Suppose 3w - sf = 79, -w - w + nf = -51. What is the tens digit of w? 2 Suppose -6g = -2g - 92. Let c = 40 - g. What is the tens digit of c? 1 Let h = -537 + 2130. What is the thousands digit of h? 1 Suppose 1 = 2f + 7. Suppose -6k = -8k + 36. What is the tens digit of (k + f)(1 + 0)? 1 Let i = -16 - -28. Suppose -l + 3l = i. Suppose 2k + 4 + l = 0, k + 125 = 5z. What is the units digit of z? 4 Let z(r) = 448r + 2. Let s be z(1). Suppose 0 = 32u - 29u - s. What is the hundreds digit of u? 1 Let h(j) = -j*3 + 8j*2 + 11j - 16. Let y be h(9). What is the tens digit of (1/y)/((-7)/(-14)) - -185? 8 Let v(a) = -19a + 6. Let x be v(-3). Suppose x - 327 = -2r. What is the units digit of r? 2 Suppose 3j + 3t = 1680, 2201 = 5j + 3t - 589. What is the units digit of j? 5 Let f = 78 - 90. What is the units digit of ((-44)/f)/((-3)/(-72)2)? 4 Let i be 79 - (0 - -2 - 4). What is the units digit of (-4)/18 - (-1071)/i? 3 Suppose -51 = -2o - 19. Suppose -4g + o = -4z, 0 = 2z + 2 - 0. What is the units digit of g? 3 Suppose 4p + 5z = 1996, -4z = -2p + 709 + 263. What is the units digit of p? 4 Let s = 5110 - 3557. Suppose 9p - s = 571. What is the units digit of p? 6 Let u = 5830 + -2076. What is the hundreds digit of u? 7 Suppose -7420 = -19o + 5o. What is the units digit of o? 0 What is the units digit of (-858)/421/(378/(-60))? 5 Suppose -724 = -5h + 4m, 4m + 580 = 4h + m. What is the units digit of h? 8 Let i be (-2)/6(-68 - -5). Suppose -3v - i = -2s, -31 = -2s - 0v + 5v. Suppose -sb + 82 = b - 2u, -3u = 2b - 37. What is the tens digit of b? 2 Let n(s) = -15s*3 + 2s + 2. Let u(q) = -q - 1. Let p(y) = n(y) - 2u(y). What is the tens digit of p(-2)? 1 Suppose -5l - 15 = -5v, 3l - 3 = -0l. Suppose y - 5r = 5y - 381, -3y = vr - 287. What is the tens digit of y? 8 Let b = -228 - -231. Let i be 2/(-6) + (-1)/(-3). Suppose 5n = bs - is - 34, 3n = 3. What is the tens digit of s? 1 Let m(u) = -48u3 + u2 + 3u + 2. Let d be 2 - 6/84. What is the tens digit of m(d)? 4 Let g(m) = 11m2 + 2m - 1. Let y be g(1). Let w be 2/(-5) - y/(-5). Suppose -a - w = -3a. What is the units digit of a? 1 Suppose 23 = i + m, 5i = -0i + 5m + 125. What is the tens digit of (-296)/(-6) + 16/i? 5 Let p(x) = -4x + 1. Let d be p(-1). Suppose -u + du = 24. Suppose 150 = uy - y. What is the tens digit of y? 3 Let l be (-1 + -23)(-12)/8. Suppose -n + 13 = 5z, 5z - 4n + 0 + 2 = 0. Suppose 2f - l = -zt, 4t - 2f = -0f + 84. What is the tens digit of t? 2 Suppose -3c + 4 + 20 = 2u, -2u = 5c - 36. Suppose -4x = 0, -4x + c = -y - 6x. Let l(k) = k3 + 6k*2 - 5k - 2. What is the tens digit of l(y)? 2 Suppose -3g + 5g - 72 = 0. Let h = g - 32. What is the units digit of h? 4 Let w be ((1197/(-28))/(-9))/(1/(-4)). Let f = w - -118. What is the units digit of f? 9 Let s be (-3450)/27 + (-3)/((-54)/(-4)). Let v = 48 - s. What is the hundreds digit of v? 1 Suppose -7 = 3o + 4o. Let c = 220 + o. What is the units digit of c? 9 Suppose 12n - 10n - 2 = 0. Let l(s) = -17s3 + 9s*3 - n + 9s3 + s2. What is the units digit of l(2)? 1 Suppose 20 = -0z + 5z. Let s(w) = w*2 + 6w - 31. Let g be s(-13). Suppose 0 = -zo + 5m - g + 219, 2o - 107 = -3m. What is the tens digit of o? 4 Suppose -4 = r - 3r. Let i(c) = 15c*3 + 4c*2 - 3c. What is the units digit of i(r)? 0 Let p(q) = 0q + 8q + 1 - 2q - 4 - q2. Let h be p(4). Suppose -hu + 9u = 72. What is the units digit of u? 8 Let q(n) = -2n - 2. Let i be q(-2). Let j(b) = b - 3b + 0b*i - 2b*2 + 3b*2. What is the tens digit of j(6)? 2 What is the hundreds digit of (-8)/28 - (-8763)/21? 4 Let j be (-5965)/102-12. Suppose 14q - j = 1100. What is the units digit of q? 9 What is the units digit of (-4)/(-3) + (-27336)/(-18) + 6? 6 Suppose 11h - 6284 = -762. What is the hundreds digit of h? 5 Suppose -4f - 27 = -7f. Suppose 0n = 4n - 36. What is the units digit of 219/f + 6/n? 5 Suppose -6z = -z + 5. Let n = z - 0. What is the units digit of 37/2(-2)/n? 7 Let i(a) = 0a - 3a - 380 + 382. What is the tens digit of i(-5)? 1 Suppose 3j - j = 0. Let s be 1 - (-5 + j + 2). Suppose -39 = -2t - sh + h, 18 = t + 3h. What is the tens digit of t? 2 Suppose -4a + 185 = -175. What is the tens digit of a? 9 Suppose -q - 1054 = -c, 5q - 3022 = -4c + 1194. What is the thousands digit of c? 1 Let s = -12 + 13. Let v = s - 4. What is the tens digit of v - (1 - (38 - -3))? 3 What is the units digit of (-23 + 5)/3 + 304? 8 Suppose -2 = -2r + 2. Let n be 5(-3)/(-6)r. Suppose 0 = 2h - 7o + 4o - 13, -nh = -o - 65. What is the units digit of h? 4 Suppose -3d + j = -8, -2j - 3j + 14 = 3d. Suppose 3 = -2i + r - 42, -di - 60 = r. Let v = i + 42. What is the tens digit of v? 2 Let u = -24 + 38. What is	{ "pile_set_name": "DM Mathematics" }
124n3/3 - 6316n*2/3 - 136n = 0. Calculate n. -2/31, 0, 51 Factor -125n2 - 26400n - 1393920. -5(5n + 528)*2 Factor -2x*2 + 254x + 256. -2(x - 128)(x + 1) Factor 5g5 + 32g*4 + 72g*3 + 74g*2 + 35g + 6. (g + 1)*3(g + 3)(5g + 2) Factor -v*5 + 60v*4 - 116v3. -v3(v - 58)(v - 2) Factor -x3/6 - x2/3 + 79x/6 - 110/3. -(x - 5)(x - 4)(x + 11)/6 Suppose x3 - 109x*2/5 + 83x/5 + 21/5 = 0. Calculate x. -1/5, 1, 21 Factor 2s2/5 - 982s/5 + 1956/5. 2(s - 489)(s - 2)/5 Suppose 2i2/5 + 192i/5 + 4608/5 = 0. What is i? -48 Suppose -f*3/3 - 16f*2/3 - 5f = 0. Calculate f. -15, -1, 0 Factor 2p2/7 - 22p/7 - 52/7. 2(p - 13)(p + 2)/7 Factor 5s4 + 200s*3 + 190s*2 - 200s - 195. 5(s - 1)(s + 1)*2(s + 39) Factor -4l5 + 24l*4 - 36l*3. -4l*3(l - 3)*2 Factor 4s*2 + 4s. 4s(s + 1) Factor 50b3 + 260b*2 + 258b + 72. 2(b + 4)(5b + 3)2 Factor -2c*3/5 + 1950c*2 - 3168750c + 1716406250. -2(c - 1625)3/5 Factor 5a*4/4 - 195a*3/4 + 1035a*2/4 - 1485a/4. 5a(a - 33)(a - 3)2/4 Factor v3/5 + 622v*2/5 + 248v. v(v + 2)(v + 620)/5 Factor 3l3/5 + 846l*2/5 + 2511l/5. 3l(l + 3)(l + 279)/5 Let 4h*2 - 4936h + 4932 = 0. What is h? 1, 1233 Factor -21w3 - 11502w*2 + 3288w. -3w(w + 548)(7w - 2) What is x in -x*5 + 1207x*4/4 - 44227x*3/2 - 391837x*2/4 - 116739x - 23409 = 0? -2, -1/4, 153 Solve 32s2 - 116s - 48 = 0 for s. -3/8, 4 Let 2j3/11 - 104j*2/11 + 1450j/11 - 2500/11 = 0. Calculate j. 2, 25 Suppose 55o3 - 100o*2 - 185o - 30 = 0. Calculate o. -1, -2/11, 3 Factor -5x3/3 + 15x*2 + 740x/3 + 420. -5(x - 18)(x + 2)(x + 7)/3 Factor -29z*3/3 - 143z*2/3 - 106z/3 + 8/3. -(z + 1)(z + 4)(29z - 2)/3 Factor 8g*3/9 - 604g*2/3 + 11248g + 17328. 4(g - 114)2(2g + 3)/9 Find s such that 4s*3 + 1728s*2 + 186624s = 0. -216, 0 Find t such that -4t2 - 1652t - 3288 = 0. -411, -2 Determine i so that -24i2 - 4i + 4/3 = 0. -1/3, 1/6 Factor -2t2/7 + 8t/7 - 8/7. -2(t - 2)2/7 Suppose -y4/10 - 9y*3/10 + 21y*2/10 - 11y/10 = 0. What is y? -11, 0, 1 Determine s so that -18s5/5 + 18s*4/5 + 26s*3/5 - 26s*2/5 - 8s/5 + 8/5 = 0. -1, -2/3, 2/3, 1 Factor 2v5 - 10v*4 + 2v*3 + 42v*2 - 36v. 2v(v - 3)*2(v - 1)(v + 2) Solve y3/2 - 7y*2/2 - 22y = 0 for y. -4, 0, 11 Suppose -5t3 + 780t*2 - 29625t - 62410 = 0. Calculate t. -2, 79 Factor -3n2 - 255n + 258. -3(n - 1)(n + 86) Find c, given that c*2 - 20576c + 105842944 = 0. 10288 Factor -5f2/3 + 10f/3 - 5/3. -5(f - 1)2/3 Solve 2y*2/3 - 490y/3 - 988/3 = 0. -2, 247 Solve 4i3 + 1240i*2 + 2468i + 1232 = 0. -308, -1 Factor 2b3 + 28b*2 + 98b + 72. 2(b + 1)(b + 4)(b + 9) Let 2u*3/3 - 2u*2 = 0. What is u? 0, 3 Find a, given that -2a*4 + 126a*3 - 482a*2 + 594a - 236 = 0. 1, 2, 59 Factor 5t3 + 115t*2 - 130t - 240. 5(t - 2)(t + 1)(t + 24) Factor 2b*2/11 - 144b/11 + 1792/11. 2(b - 56)(b - 16)/11 Let -4f5 - 32f*4 - 20f*3 + 200f*2 = 0. Calculate f. -5, 0, 2 Determine m so that -2m*4 - 286m*3 = 0. -143, 0 Factor 5a*4 + 35a*3 - 600a*2 + 1840a - 1280. 5(a - 4)2(a - 1)(a + 16) Solve -6i*5/5 - 18i*4/5 - 6i*3/5 + 18i*2/5 + 12i/5 = 0. -2, -1, 0, 1 What is o in 2o2/7 - 598o/7 = 0? 0, 299 Solve -2y5 - 43y*4/3 - 103y*3/3 - 88y*2/3 - 4y = 0. -3, -2, -1/6, 0 Factor -5929d4 + 4928d*3 - 1024d2. -d2(77d - 32)*2 Let -160w*5 + 34w*4 + 492w*3 + 218w*2 - 104w - 24 = 0. Calculate w. -1, -3/16, 2/5, 2 Suppose 2g3 + 118g*2 - 496g + 504 = 0. Calculate g. -63, 2 Factor -2d2/3 + 2004d. -2d(d - 3006)/3 Factor -2m3/7 + 10m*2/7 + 4m. -2m(m - 7)(m + 2)/7 Find p, given that 6p*5/5 + 34p*4/5 + 38p*3/5 - 42p*2/5 - 36p/5 = 0. -3, -2/3, 0, 1 Factor 5w2/3 - 3115w/3 + 3110/3. 5(w - 622)(w - 1)/3 Factor -5v2 + 19880v - 19760720. -5(v - 1988)2 Find z, given that 21z*5 + 913z*4/3 + 1225z*3/3 - 5371z*2 + 2628z - 324 = 0. -9, 2/9, 2/7, 3 Find k, given that 2k4/21 + 6k*3/7 + 46k*2/21 + 10k/7 = 0. -5, -3, -1, 0 Factor 2h2/15 - 188h/15 + 4418/15. 2(h - 47)2/15 Find p, given that -5p*5 - 30p*4 + 5p*3 + 30p*2 = 0. -6, -1, 0, 1 Factor -2i*2/9 - 206i/9 + 208/9. -2(i - 1)(i + 104)/9 Factor 2n2/9 - 14n/9 - 16/9. 2(n - 8)(n + 1)/9 Factor -y*4 - 7y*3 - 12y2. -y2(y + 3)(y + 4) Factor 3x2/4 - 33x/4 - 9. 3(x - 12)(x + 1)/4 Suppose -2n4/7 - 276n*3/7 - 270n*2/7 + 548n/7 = 0. What is n? -137, -2, 0, 1 Find p such that 25p4 + 37530p*3 + 82480p*2 + 52470p + 7495 = 0. -1499, -1, -1/5 Find w such that 5w2 - 6080w + 1848320 = 0. 608 Factor 2h3/7 + 30h*2 - 426h/7 + 214/7. 2(h - 1)2(h + 107)/7 Let q*2/3 + 14q - 43/3 = 0. What is q? -43, 1 Suppose 5j2 + 1140j - 3465 = 0. Calculate j. -231, 3 What is q in -5q2 - 60q = 0? -12, 0 Let -j*5/4 + 5j*4/2 - 3j*3 - 17j*2/2 + 13j/4 + 6 = 0. What is j? -1, 1, 3, 8 Determine c, given that 4c4 + 8c*3 - 20c*2 - 24c = 0. -3, -1, 0, 2 Let l*5/5 - 6l*4/5 - 3l*3/5 + 56l*2/5 - 12l/5 - 144/5 = 0. Calculate l. -2, 3, 4 Factor 5m5/4 + 5m*4 - 25m*3/4. 5m*3(m - 1)(m + 5)/4 Factor -2p*4/3 - 26p*3/3 - 70p*2/3 + 98p/3. -2p(p - 1)(p + 7)2/3 Factor -2c*4/9 + 76c*3/9 - 112c*2 + 5684c/9 - 11662/9. -2(c - 17)(c - 7)3/9 Determine d so that -d2/5 - 11d + 56/5 = 0. -56, 1 Solve -50f*5/9 + 2420f*4/9 + 9238f*3/9 + 6416f*2/9 - 3752f/9 + 416/9 = 0. -2, 1/5, 52 Solve 2k2/25 + 36k/25 + 18/5 = 0 for k. -15, -3 Find s such that -s*3 + 94s*2 - 185s + 92 = 0. 1, 92 Factor -4k5/5 + 8k*3/5 - 4k/5. -4k(k - 1)*2(k + 1)*2/5 Factor -3x*3 - 345x*2 + 1056x - 708. -3(x - 2)(x - 1)(x + 118) Factor -q5/3 - 218q*4 - 160064q*3/3 - 17321024q*2/3 - 229369088q + 1446789632/3. -(q - 2)(q + 164)4/3 Factor 20u*3 + 152u*2 + 84u. 4u(u + 7)(5u + 3) Determine q so that -5q4/3 + 650q*3/3 - 640q*2 + 1910q/3 - 635/3 = 0. 1, 127 Factor -2k2 - 82k - 156. -2(k + 2)(k + 39) Factor -4w2/17 - 642w/17 + 322/17. -2(w + 161)(2w - 1)/17 Factor 2g*2 - 2184g + 596232. 2(g - 546)2 Factor -5r*2 + 105r - 190. -5(r - 19)(r - 2) Factor -t*2/7 + 250t/7 - 15625/7. -(t - 125)*2/7 Factor 20h*4 + 52h*3 - 204h*2 + 172h - 40. 4(h - 1)2(h + 5)(5h - 2) Find i, given that i*2 + 57i + 602 = 0. -43, -14 Factor -o*2/4 + 7o - 27/4. -(o - 27)(o - 1)/4 Factor -5b*3/3 - 70b*2/3 - 325b/3 - 500/3. -5(b + 4)(b + 5)2/3 Find n such that -n2/8 - 31n/8 - 23 = 0. -23, -8 Factor 6s*2/7 - 72s/7 - 24. 6(s - 14)(s + 2)/7 Let 4l4/3 - 58l*3/3 + 206l*2/3 - 62l/3 - 30 = 0. Calculate l. -1/2, 1, 5, 9 Factor -4c4 + 16c*3 - 12c*2. -4c*2(c - 3)(c - 1) Suppose 4v*3 - 728v*2 + 33840v - 64800 = 0. Calculate v. 2, 90 Suppose -2p3 + 112p*2 + 728p + 992 = 0. Calculate p. -4, -2, 62 Factor -5b4 - 315b*3 - 4800b*2 + 5120b. -5b(b - 1)(b + 32)2 Find c such that c3/3 - c2/3 - 101c/3 - 33 = 0. -9, -1, 11 Find a, given that a*4/2 + 8a*3/3 + 29a*2/6 + 10a/3 + 2/3 = 0. -2, -1, -1/3 Determine b, given that -3b2 + 1659b - 1656 = 0. 1, 552 Factor -4p3 + 156p*2 - 572p + 420. -4(p - 35)(p - 3)(p - 1) Factor o4/7 + 51o*3/7 + 722o*2/7 + 1824o/7 + 1152/7. (o + 1)(o + 2)(o + 24)2/7 Factor -d5 + d*4 + 4d*3 - 4d2. -d2(d - 2)(d - 1)(d + 2) Factor 2g*5/15 + 2g*4/15 - 2g*3/15 - 2g*2/15. 2g*2(g - 1)(g + 1)2/15 Let a3 - 34a*2 + 300a - 792 = 0. Calculate a. 6, 22 Solve 2q4 - 386q*3 + 24960q*2 - 548864q + 524288 = 0. 1, 64 Suppose -2i2/15 + 52i/5 - 1014/5 = 0. Calculate i. 39 Factor 3s3 - 162s*2 + 2907s - 17340. 3(s - 20)(s - 17)*2 What is v in 2v*2 + 76v - 160 = 0? -40, 2 Let -4d4 + 48d*3 - 132d*2 + 8d + 192 = 0. What is d? -1, 2, 3, 8 Factor 125a3 - 19900a*2 - 56455a - 39690. 5(a - 162)(5a + 7)2 Factor 4q*2 + 1968q + 242064. 4(q + 246)2 Factor 2d*4 + 38d*3 + 130d*2 + 154d + 60. 2(d + 1)2(d + 2)(d + 15) Let 2c*4/15 + 22c*3/15 - 122c*2/15 - 22c/15 + 8 = 0. What is c? -15, -1, 1, 4 Factor 4	{ "pile_set_name": "DM Mathematics" }
he nearest integer? 13029 What is 11620907 to the power of 1/2, to the nearest integer? 3409 What is 198951938 to the power of 1/2, to the nearest integer? 14105 What is the cube root of 825248833 to the nearest integer? 938 What is 32769400 to the power of 1/2, to the nearest integer? 5724 What is the tenth root of 2190105590 to the nearest integer? 9 What is 723147325 to the power of 1/3, to the nearest integer? 898 What is the sixth root of 120947873 to the nearest integer? 22 What is 77915390 to the power of 1/2, to the nearest integer? 8827 What is 35696816 to the power of 1/3, to the nearest integer? 329 What is the eighth root of 167084528 to the nearest integer? 11 What is the square root of 27047296 to the nearest integer? 5201 What is 146815055 to the power of 1/3, to the nearest integer? 528 What is 23379333 to the power of 1/9, to the nearest integer? 7 What is the third root of 245286523 to the nearest integer? 626 What is the ninth root of 3331706091 to the nearest integer? 11 What is 51871470 to the power of 1/2, to the nearest integer? 7202 What is the tenth root of 3117908094 to the nearest integer? 9 What is the square root of 24970133 to the nearest integer? 4997 What is 1424698147 to the power of 1/3, to the nearest integer? 1125 What is 1672990919 to the power of 1/2, to the nearest integer? 40902 What is 231604594 to the power of 1/5, to the nearest integer? 47 What is the sixth root of 2240948025 to the nearest integer? 36 What is the tenth root of 50030911 to the nearest integer? 6 What is 1955393207 to the power of 1/2, to the nearest integer? 44220 What is the square root of 972112739 to the nearest integer? 31179 What is the fourth root of 80322713 to the nearest integer? 95 What is the square root of 1029799748 to the nearest integer? 32090 What is the square root of 587607877 to the nearest integer? 24241 What is the square root of 69751536 to the nearest integer? 8352 What is 185761917 to the power of 1/3, to the nearest integer? 571 What is the square root of 2024218261 to the nearest integer? 44991 What is 17420741 to the power of 1/2, to the nearest integer? 4174 What is the tenth root of 50817636 to the nearest integer? 6 What is the cube root of 338375947 to the nearest integer? 697 What is the square root of 117515102 to the nearest integer? 10840 What is the third root of 21087605 to the nearest integer? 276 What is 47806040 to the power of 1/2, to the nearest integer? 6914 What is 82692101 to the power of 1/10, to the nearest integer? 6 What is the third root of 591368651 to the nearest integer? 839 What is 1698007667 to the power of 1/3, to the nearest integer? 1193 What is the third root of 184550849 to the nearest integer? 569 What is 2286779656 to the power of 1/3, to the nearest integer? 1317 What is the square root of 2088638230 to the nearest integer? 45702 What is 47416563 to the power of 1/3, to the nearest integer? 362 What is the cube root of 109878926 to the nearest integer? 479 What is 236148042 to the power of 1/3, to the nearest integer? 618 What is the tenth root of 3598659184 to the nearest integer? 9 What is 547390043 to the power of 1/2, to the nearest integer? 23396 What is 422269905 to the power of 1/3, to the nearest integer? 750 What is 149105583 to the power of 1/2, to the nearest integer? 12211 What is the sixth root of 670922700 to the nearest integer? 30 What is the square root of 56982076 to the nearest integer? 7549 What is 4771977282 to the power of 1/2, to the nearest integer? 69079 What is the square root of 32986643 to the nearest integer? 5743 What is 45757259 to the power of 1/2, to the nearest integer? 6764 What is 14431403 to the power of 1/2, to the nearest integer? 3799 What is the square root of 1480635911 to the nearest integer? 38479 What is 60878433 to the power of 1/3, to the nearest integer? 393 What is 3865342589 to the power of 1/2, to the nearest integer? 62172 What is the third root of 149810958 to the nearest integer? 531 What is 5126798924 to the power of 1/7, to the nearest integer? 24 What is the cube root of 5254675309 to the nearest integer? 1739 What is the seventh root of 1193947892 to the nearest integer? 20 What is 8937063578 to the power of 1/2, to the nearest integer? 94536 What is the fifth root of 257372996 to the nearest integer? 48 What is 131575558 to the power of 1/6, to the nearest integer? 23 What is the third root of 466160444 to the nearest integer? 775 What is 177331683 to the power of 1/10, to the nearest integer? 7 What is the square root of 306916707 to the nearest integer? 17519 What is 342220979 to the power of 1/2, to the nearest integer? 18499 What is 91645309 to the power of 1/2, to the nearest integer? 9573 What is 925969351 to the power of 1/10, to the nearest integer? 8 What is the fifth root of 41374519 to the nearest integer? 33 What is 17146531 to the power of 1/9, to the nearest integer? 6 What is 20027713 to the power of 1/2, to the nearest integer? 4475 What is the cube root of 3073281299 to the nearest integer? 1454 What is 707060 to the power of 1/4, to the nearest integer? 29 What is 3904184273 to the power of 1/5, to the nearest integer? 83 What is the sixth root of 307353016 to the nearest integer? 26 What is 672587538 to the power of 1/6, to the nearest integer? 30 What is 239270629 to the power of 1/2, to the nearest integer? 15468 What is the eighth root of 938588440 to the nearest integer? 13 What is the tenth root of 7720728934 to the nearest integer? 10 What is 2797136903 to the power of 1/2, to the nearest integer? 52888 What is 45634135 to the power of 1/3, to the nearest integer? 357 What is the cube root of 684294411 to the nearest integer? 881 What is 416226673 to the power of 1/2, to the nearest integer? 20402 What is the third root of 241774644 to the nearest integer? 623 What is 2716054410 to the power of 1/2, to the nearest integer? 52116 What is 3832396206 to the power of 1/10, to the nearest integer? 9 What is 2980778504 to the power of 1/7, to the nearest integer? 23 What is 25674876 to the power of 1/6, to the nearest integer? 17 What is the square root of 45410003 to the nearest integer? 6739 What is 595709367 to the power of 1/5, to the nearest integer? 57 What is the third root of 257892656 to the nearest integer? 637 What is 5370662 to the power of 1/9, to the nearest integer? 6 What is 56319400 to the power of 1/3, to the nearest integer? 383 What is 2356399686 to the power of 1/9, to the nearest integer? 11 What is the eighth root of 21316123 to the nearest integer? 8 What is the tenth root of 368157267 to the nearest integer? 7 What is the square root of 2796443115 to the nearest integer? 52881 What is 50445358 to the power of 1/2, to the nearest integer? 7102 What is 91222549 to the power of 1/8, to the nearest integer? 10 What is the seventh root of 203521808 to the nearest integer? 15 What is the eighth root of 387724734 to the nearest integer? 12 What is 129451082 to the power of 1/5, to the nearest integer? 42 What is 6534032 to the power of 1/7, to the nearest integer? 9 What is the square root of 161394210 to the nearest integer? 12704 What is the seventh root of 232600250 to the nearest integer? 16 What is the square root of 314502235 to the nearest integer? 17734 What is the cube root of 14449183 to the nearest integer? 244 What is 420622771 to the power of 1/5, to the nearest integer? 53 What is the eighth root of 3078167 to the nearest integer? 6 What is 62434793 to the power of 1/9, to the nearest integer? 7 What is the third root of 702901902 to the nearest integer? 889 What is the square root of 1420480304 to the nearest integer? 37689 What is the cube root of 4698686583 to the nearest integer? 1675 What is the cube root of 21389571 to the nearest integer? 278 What is 219531463 to the power of 1/3, to the nearest integer? 603 What is the third root of 59183610 to the nearest integer? 390 What is 2534932844 to the power of 1/2, to the nearest integer? 50348 What is 180310595 to the power of 1/5, to the nearest integer? 45 What is 15796433 to the power of 1/2, to the nearest integer? 3974 What is 5411552 to the power of 1/5, to the nearest integer? 22 What is the fourth r	{ "pile_set_name": "DM Mathematics" }
/138209 Divide -766 by -45. 766/45 What is -293560 divided by 205? -1432 Calculate 3254 divided by 29. 3254/29 Calculate -21691 divided by 2. -21691/2 What is 821050 divided by 164210? 5 Divide -71399 by -8. 71399/8 What is 826 divided by 5? 826/5 Divide 3 by -56452. -3/56452 What is 4103 divided by 12? 4103/12 Calculate -4681650 divided by 6. -780275 Calculate -212400 divided by -14160. 15 1097 divided by -6 -1097/6 Divide -41925 by 13. -3225 -49 divided by -612 49/612 What is 314041 divided by -10829? -29 What is -18430 divided by 485? -38 Calculate -837470 divided by -5. 167494 Calculate -6365 divided by -6365. 1 Calculate -6619 divided by 4. -6619/4 What is -1 divided by -68569? 1/68569 7 divided by 39386 7/39386 What is 17942 divided by 261? 17942/261 Divide 149366 by 1589. 94 Divide 3 by -30391. -3/30391 Calculate -111672 divided by -6. 18612 Calculate -3 divided by 12395. -3/12395 6043096 divided by 1510774 4 Calculate -3 divided by -9456. 1/3152 Divide 4 by 710120. 1/177530 Divide -49 by 1719. -49/1719 Divide -3097 by 38. -163/2 Divide 11369826 by 2. 5684913 Calculate 52 divided by -1650. -26/825 What is -857774 divided by 5? -857774/5 Calculate -121254 divided by -3. 40418 What is -8 divided by 400? -1/50 4012 divided by 321 4012/321 What is -163921 divided by -7127? 23 Divide -2216829 by 8241. -269 Calculate -3113500 divided by -778375. 4 -1992 divided by -332 6 14671 divided by 27 14671/27 Calculate -36801 divided by 16. -36801/16 Divide -14163 by 20. -14163/20 What is -119192 divided by 94? -1268 Divide -337 by -111. 337/111 Divide -123723 by 9. -13747 Calculate 4 divided by -731640. -1/182910 Divide 1942 by 173. 1942/173 Calculate -33248 divided by 6. -16624/3 Divide 0 by 38619. 0 Divide 196326 by -234. -839 Divide 37 by -265. -37/265 Divide 108432 by -6777. -16 What is -189456 divided by -63152? 3 Divide -5 by 817. -5/817 What is 295999 divided by 5? 295999/5 -501454 divided by 5 -501454/5 Calculate 32 divided by -2227. -32/2227 79016 divided by 2324 34 What is 4 divided by -5168? -1/1292 172805 divided by -10165 -17 Divide -105444 by 1. -105444 What is -6633 divided by 6633? -1 What is -18 divided by 27332? -9/13666 68517 divided by 22839 3 Divide 59140 by 4. 14785 -332835 divided by 5 -66567 21712 divided by 59 368 What is 1833 divided by 23? 1833/23 664 divided by 10 332/5 Divide 62724 by 12. 5227 Divide -2183619 by 6. -727873/2 14970 divided by 998 15 Divide 15 by 13121. 15/13121 Calculate 88515 divided by -4215. -21 Calculate 1923136 divided by 4. 480784 38900 divided by 13 38900/13 8532 divided by -237 -36 1 divided by 29465 1/29465 -477 divided by -2066 477/2066 What is 124510 divided by 5? 24902 What is 5 divided by -5143? -5/5143 What is -83684 divided by -20921? 4 What is 2771484 divided by -291? -9524 What is -1665 divided by 63? -185/7 446992 divided by -1 -446992 Divide 679 by -1972. -679/1972 Calculate -150 divided by -399. 50/133 Calculate -20161 divided by -6. 20161/6 Divide -590007 by 3. -196669 Calculate 52418 divided by -1. -52418 747618 divided by 3 249206 -402372 divided by 100593 -4 Calculate -1445840 divided by 440. -3286 Divide 48780 by -3252. -15 What is -9208 divided by -40? 1151/5 Calculate -4 divided by -16393. 4/16393 Calculate 2222880 divided by -20208. -110 -481 divided by -232 481/232 -27145 divided by -3 27145/3 Divide 44400 by 20. 2220 Divide 40934 by 9. 40934/9 Calculate 809834 divided by 59. 13726 2253172 divided by -563293 -4 46 divided by -9068 -23/4534 What is -2211 divided by 872? -2211/872 Divide -323802 by -1. 323802 -569112 divided by -46 12372 Divide -353428 by 2372. -149 Divide 51942 by 2361. 22 Divide 4 by 514905. 4/514905 What is 2103789 divided by -1671? -1259 Calculate 113753 divided by -6. -113753/6 Divide -459805 by -3. 459805/3 What is -115 divided by -247? 115/247 Divide 1373008 by -322. -4264 Calculate 374022 divided by -20779. -18 Divide -639234 by -71026. 9 -349 divided by -1485 349/1485 4 divided by 12814 2/6407 -90738 divided by -18 5041 Divide -6009700 by -4. 1502425 3 divided by 191335 3/191335 -3706 divided by -6 1853/3 What is -1 divided by -545929? 1/545929 836780 divided by -3892 -215 Divide -16641 by -1. 16641 Calculate 546612 divided by -5412. -101 Divide -2274524 by 568631. -4 What is 2954028 divided by -140668? -21 32179 divided by 8 32179/8 Calculate 12466 divided by 1. 12466 Divide -167778 by -9321. 18 Calculate 54 divided by 9298. 27/4649 Calculate -7209 divided by -2403. 3 What is 2976 divided by 16? 186 263181 divided by 2 263181/2 What is 1 divided by -70906? -1/70906 What is 16534 divided by 7? 2362 Calculate 16 divided by -10543. -16/10543 Calculate 7632 divided by -16. -477 1897483 divided by 3 1897483/3 Calculate 280961 divided by 4. 280961/4 What is -37 divided by 2252? -37/2252 Divide 0 by 634054. 0 What is -383680 divided by 4360? -88 Calculate 55 divided by 11983. 55/11983 392 divided by 473 392/473 -2028 divided by -39 52 What is -16002 divided by -7? 2286 What is 47 divided by -251? -47/251 Calculate 148806 divided by 8267. 18 What is 26532 divided by -11? -2412 Calculate 14839 divided by 7. 14839/7 Calculate 1519 divided by 19. 1519/19 Calculate -13862 divided by -1. 13862 What is 5 divided by -103669? -5/103669 Divide 11193 by 3731. 3 What is -5754 divided by 1? -5754 What is -1103292 divided by 6? -183882 140224 divided by 4382 32 What is 32634 divided by -1813? -18 What is 174 divided by 407? 174/407 Divide 19 by -36991. -19/36991 Divide 828089 by 97. 8537 What is -36510 divided by 2434? -15 What is -2279242 divided by 1139621? -2 Divide 11750 by -194. -5875/97 What is -42588 divided by 1092? -39 273 divided by -1 -273 Divide -60341 by 6. -60341/6 Calculate -34 divided by -95348. 17/47674 Divide 78 by -4621. -78/4621 -281250 divided by 90 -3125 What is -61386 divided by -78? 787 Calculate -43874 divided by -15. 43874/15 427182 divided by 3 142394 Divide -734532 by 734532. -1 Calculate -74 divided by -611. 74/611 -85928 divided by 467 -184 Calculate -5902721 divided by -4. 5902721/4 What is -201 divided by 43? -201/43 -11121 divided by -337 33 Calculate 243814 divided by 14342. 17 What is 4144440 divided by -69074? -60 -435690 divided by 24205 -18 Divide 3 by 1615. 3/1615 Divide 3276 by -15. -1092/5 Divide -13040 by 3260. -4 Divide 44988 by -652. -69 Calculate 0 divided by -4068. 0 -224403 divided by 571 -393 What is -5 divided by 81026? -5/81026 Divide -33267 by 39. -853 5783040 divided by 6 963840 Divide 194951 by -4. -194951/4 Divide 0 by 1263086. 0 -54648 divided by -69 792 What is -124110 divided by -24822? 5 What is 414 divided by -302? -207/151 Divide -6190 by -3. 6190/3 What is 1928768 divided by -964384? -2 2 divided by -403473 -2/403473 What is 2 divided by -51120? -1/25560 What is 29 divided by -3470? -29/3470 What is -135 divided by -1912? 135/1912 Calculate -5512 divided by 3. -5512/3 -974988 divided by -2 487494 Calculate 1479 divided by 63. 493/21 What is 892 divided by -232? -223/58 What is -2594480 divided by -4? 648620 -2821 divided by 1 -2821 Divide 941400 by -360. -2615 -375 divided by -100 15/4 What is 5184 divided by -1296? -4 -2 divided by 67926 -1/33963 -16036 divided by -16036 1 Divide -45344 by 5668. -8 What is -4 divided by 6427? -4/6427 Divide 812228 by -203057. -4 -552580 divided by -110516 5 What is -9 divided by 1202? -9/1202 What is 1626858 divided by -813429? -2 Calculate 15862 divided by -1133. -14 Divide 2547748 by -28. -90991 Divide 27444 by -5. -27444/5 What is 1802 divided by 3? 1802/3 Calculate 154724 divided by -6. -77362/3 Divide -4 by 40880. -1/10220 What is 9725 divided by -389? -25 Calculate -5767 divided by 14. -5767/14 -13 divided by 3084 -13/3084 Calculate 519495 divided by 59. 8805 Calculate -92115 divided by -5. 18423 What is -131016 divided by -65508? 2 -2808 divided by -312 9 What is 79002 divided by 7182? 11 Calculate -2069 divided by 128. -2069/128 -2 divided by 173643 -2/173643 What is -54978 divided by 6? -9163 Calculate -82 divided by 21. -82/21 What is -248125 divided by -397? 625 What is 4 divided by 1209? 4/1209 -377070 divided by -10 37707 1 divided by -66873 -1/66873 What is 3513934 divided by -9707? -362 Calculate 6 divided by 330586. 3/165293 What is -556182 divided by 198? -28	{ "pile_set_name": "DM Mathematics" }
n 100 is divided by 13. 9 Calculate the remainder when 334 is divided by 86. 76 What is the remainder when 1173 is divided by 205? 148 Calculate the remainder when 196 is divided by 20. 16 Calculate the remainder when 222 is divided by 21. 12 What is the remainder when 181 is divided by 21? 13 Calculate the remainder when 1160 is divided by 372. 44 What is the remainder when 1779 is divided by 10? 9 What is the remainder when 164 is divided by 15? 14 Calculate the remainder when 17 is divided by 16. 1 Calculate the remainder when 462 is divided by 116. 114 What is the remainder when 71 is divided by 18? 17 Calculate the remainder when 181 is divided by 152. 29 Calculate the remainder when 143 is divided by 48. 47 Calculate the remainder when 69 is divided by 15. 9 What is the remainder when 9708 is divided by 133? 132 What is the remainder when 29 is divided by 29? 0 What is the remainder when 227 is divided by 38? 37 What is the remainder when 72 is divided by 24? 0 What is the remainder when 25 is divided by 9? 7 Calculate the remainder when 483 is divided by 241. 1 What is the remainder when 989 is divided by 6? 5 Calculate the remainder when 89 is divided by 10. 9 What is the remainder when 107 is divided by 55? 52 What is the remainder when 174 is divided by 12? 6 Calculate the remainder when 148 is divided by 46. 10 Calculate the remainder when 878 is divided by 22. 20 What is the remainder when 92 is divided by 61? 31 What is the remainder when 218 is divided by 14? 8 Calculate the remainder when 50 is divided by 19. 12 What is the remainder when 1390 is divided by 155? 150 Calculate the remainder when 636 is divided by 22. 20 Calculate the remainder when 209 is divided by 113. 96 Calculate the remainder when 258 is divided by 44. 38 What is the remainder when 127 is divided by 10? 7 Calculate the remainder when 2321 is divided by 3. 2 Calculate the remainder when 1396 is divided by 13. 5 Calculate the remainder when 82 is divided by 22. 16 What is the remainder when 210 is divided by 49? 14 What is the remainder when 133 is divided by 66? 1 What is the remainder when 327 is divided by 324? 3 Calculate the remainder when 3059 is divided by 102. 101 What is the remainder when 15418 is divided by 22? 18 What is the remainder when 242 is divided by 2? 0 What is the remainder when 524 is divided by 31? 28 What is the remainder when 691 is divided by 25? 16 Calculate the remainder when 115 is divided by 49. 17 Calculate the remainder when 754 is divided by 10. 4 What is the remainder when 4873 is divided by 122? 115 What is the remainder when 7152 is divided by 14? 12 What is the remainder when 659 is divided by 110? 109 What is the remainder when 893 is divided by 4? 1 Calculate the remainder when 2626 is divided by 24. 10 Calculate the remainder when 2263 is divided by 748. 19 What is the remainder when 204 is divided by 199? 5 Calculate the remainder when 237 is divided by 12. 9 Calculate the remainder when 431 is divided by 12. 11 What is the remainder when 1608 is divided by 115? 113 Calculate the remainder when 542 is divided by 32. 30 Calculate the remainder when 284 is divided by 72. 68 Calculate the remainder when 12 is divided by 4. 0 Calculate the remainder when 478 is divided by 108. 46 What is the remainder when 1059 is divided by 14? 9 What is the remainder when 242 is divided by 41? 37 What is the remainder when 171 is divided by 6? 3 What is the remainder when 136 is divided by 44? 4 Calculate the remainder when 1121 is divided by 81. 68 What is the remainder when 264 is divided by 42? 12 Calculate the remainder when 203 is divided by 55. 38 Calculate the remainder when 95 is divided by 48. 47 What is the remainder when 81 is divided by 66? 15 Calculate the remainder when 714 is divided by 34. 0 Calculate the remainder when 166 is divided by 4. 2 What is the remainder when 2750 is divided by 32? 30 Calculate the remainder when 326 is divided by 46. 4 What is the remainder when 3474 is divided by 74? 70 What is the remainder when 1288 is divided by 425? 13 What is the remainder when 112 is divided by 38? 36 What is the remainder when 13437 is divided by 105? 102 Calculate the remainder when 640 is divided by 307. 26 Calculate the remainder when 538 is divided by 6. 4 What is the remainder when 263 is divided by 14? 11 What is the remainder when 675 is divided by 78? 51 Calculate the remainder when 205 is divided by 187. 18 What is the remainder when 451 is divided by 57? 52 What is the remainder when 277 is divided by 110? 57 What is the remainder when 60 is divided by 14? 4 What is the remainder when 7314 is divided by 95? 94 Calculate the remainder when 95 is divided by 25. 20 Calculate the remainder when 7588 is divided by 10. 8 Calculate the remainder when 44 is divided by 5. 4 Calculate the remainder when 475 is divided by 240. 235 Calculate the remainder when 1640 is divided by 53. 50 Calculate the remainder when 910 is divided by 16. 14 What is the remainder when 2203 is divided by 19? 18 Calculate the remainder when 64 is divided by 10. 4 What is the remainder when 1402 is divided by 342? 34 Calculate the remainder when 1510 is divided by 9. 7 Calculate the remainder when 386 is divided by 144. 98 Calculate the remainder when 199 is divided by 45. 19 What is the remainder when 256 is divided by 250? 6 Calculate the remainder when 1063 is divided by 133. 132 What is the remainder when 42 is divided by 30? 12 Calculate the remainder when 523 is divided by 43. 7 Calculate the remainder when 45 is divided by 7. 3 What is the remainder when 141 is divided by 46? 3 Calculate the remainder when 9555 is divided by 165. 150 Calculate the remainder when 220 is divided by 59. 43 Calculate the remainder when 28708 is divided by 58. 56 Calculate the remainder when 71 is divided by 26. 19 What is the remainder when 267 is divided by 21? 15 Calculate the remainder when 504 is divided by 148. 60 What is the remainder when 1926 is divided by 129? 120 Calculate the remainder when 149 is divided by 111. 38 What is the remainder when 947 is divided by 191? 183 Calculate the remainder when 182 is divided by 23. 21 Calculate the remainder when 1629 is divided by 338. 277 Calculate the remainder when 128 is divided by 26. 24 Calculate the remainder when 284 is divided by 167. 117 What is the remainder when 178 is divided by 31? 23 Calculate the remainder when 350 is divided by 32. 30 What is the remainder when 12989 is divided by 18? 11 Calculate the remainder when 636 is divided by 136. 92 What is the remainder when 1205 is divided by 78? 35 What is the remainder when 2203 is divided by 45? 43 Calculate the remainder when 275 is divided by 251. 24 Calculate the remainder when 239 is divided by 10. 9 Calculate the remainder when 2199 is divided by 100. 99 What is the remainder when 656 is divided by 101? 50 Calculate the remainder when 90 is divided by 83. 7 What is the remainder when 1820 is divided by 346? 90 What is the remainder when 731 is divided by 62? 49 Calculate the remainder when 6830 is divided by 23. 22 Calculate the remainder when 1849 is divided by 116. 109 What is the remainder when 344 is divided by 35? 29 Calculate the remainder when 1466 is divided by 30. 26 Calculate the remainder when 5597 is divided by 28. 25 Calculate the remainder when 474 is divided by 28. 26 Calculate the remainder when 7783 is divided by 3890. 3 What is the remainder when 3721 is divided by 133? 130 Calculate the remainder when 98 is divided by 21. 14 What is the remainder when 3521 is divided by 65? 11 Calculate the remainder when 368 is divided by 177. 14 Calculate the remainder when 16 is divided by 11. 5 What is the remainder when 3981 is divided by 166? 163 Calculate the remainder when 194 is divided by 2. 0 Calculate the remainder when 302 is divided by 17. 13 What is the remainder when 8124 is divided by 43? 40 What is the remainder when 987 is divided by 110? 107 Calculate the remainder when 5725 is divided by 15. 10 What is the remainder when 450 is divided by 29? 15 What is the remainder when 11 is divided by 8? 3 What is the remainder when 1145 is divided by 195? 170 Calculate the remainder when 130 is divided by 59. 12 Calculate th	{ "pile_set_name": "DM Mathematics" }
tween 6:50 PM and 9:46 PM? 176 What is 679 minutes before 5:32 PM? 6:13 AM What is 325 minutes before 9:02 PM? 3:37 PM What is 552 minutes after 5:28 PM? 2:40 AM What is 532 minutes after 12:08 AM? 9:00 AM What is 252 minutes before 1:31 AM? 9:19 PM How many minutes are there between 12:17 PM and 10:00 PM? 583 What is 254 minutes before 7:02 AM? 2:48 AM How many minutes are there between 11:29 AM and 1:53 PM? 144 What is 473 minutes after 1:58 AM? 9:51 AM What is 253 minutes after 12:27 AM? 4:40 AM How many minutes are there between 4:29 AM and 6:05 AM? 96 How many minutes are there between 11:31 PM and 4:55 AM? 324 What is 91 minutes before 6:54 AM? 5:23 AM What is 466 minutes after 3:37 PM? 11:23 PM What is 76 minutes before 11:59 AM? 10:43 AM What is 62 minutes before 11:46 AM? 10:44 AM What is 318 minutes before 4:38 PM? 11:20 AM What is 159 minutes before 11:10 AM? 8:31 AM What is 419 minutes after 11:56 AM? 6:55 PM How many minutes are there between 3:26 AM and 10:08 AM? 402 What is 704 minutes after 5:07 PM? 4:51 AM What is 111 minutes after 10:39 PM? 12:30 AM What is 639 minutes before 7:30 AM? 8:51 PM What is 493 minutes after 2:08 PM? 10:21 PM What is 135 minutes before 7:54 PM? 5:39 PM What is 171 minutes after 6:17 PM? 9:08 PM What is 176 minutes after 1:19 AM? 4:15 AM What is 401 minutes after 2:20 AM? 9:01 AM How many minutes are there between 2:34 PM and 9:12 PM? 398 How many minutes are there between 7:23 AM and 3:47 PM? 504 What is 430 minutes before 6:17 PM? 11:07 AM What is 195 minutes after 3:06 AM? 6:21 AM How many minutes are there between 4:27 PM and 11:06 PM? 399 How many minutes are there between 12:46 PM and 7:34 PM? 408 How many minutes are there between 5:55 AM and 6:06 AM? 11 What is 155 minutes before 6:57 PM? 4:22 PM How many minutes are there between 10:42 AM and 1:21 PM? 159 How many minutes are there between 7:56 AM and 8:31 AM? 35 What is 414 minutes before 4:24 AM? 9:30 PM How many minutes are there between 5:19 AM and 9:43 AM? 264 What is 303 minutes before 2:48 PM? 9:45 AM How many minutes are there between 10:07 AM and 6:41 PM? 514 How many minutes are there between 11:09 AM and 12:09 PM? 60 What is 149 minutes before 3:38 AM? 1:09 AM What is 304 minutes before 3:07 AM? 10:03 PM What is 526 minutes before 8:51 PM? 12:05 PM What is 406 minutes after 2:29 AM? 9:15 AM What is 36 minutes before 3:27 PM? 2:51 PM How many minutes are there between 1:52 PM and 1:56 PM? 4 How many minutes are there between 10:49 PM and 10:36 AM? 707 How many minutes are there between 2:45 AM and 5:20 AM? 155 How many minutes are there between 12:56 PM and 10:52 PM? 596 What is 710 minutes before 2:53 PM? 3:03 AM How many minutes are there between 6:16 AM and 7:12 AM? 56 How many minutes are there between 8:20 AM and 1:22 PM? 302 What is 20 minutes before 5:17 AM? 4:57 AM How many minutes are there between 11:36 AM and 11:04 PM? 688 What is 238 minutes before 4:55 PM? 12:57 PM What is 300 minutes before 2:25 AM? 9:25 PM What is 62 minutes after 3:42 PM? 4:44 PM What is 254 minutes after 1:42 AM? 5:56 AM What is 647 minutes before 11:30 PM? 12:43 PM What is 159 minutes before 10:31 AM? 7:52 AM What is 48 minutes before 8:22 AM? 7:34 AM What is 264 minutes before 4:15 AM? 11:51 PM What is 667 minutes before 4:22 AM? 5:15 PM What is 52 minutes before 2:51 PM? 1:59 PM What is 631 minutes after 5:36 PM? 4:07 AM How many minutes are there between 2:48 AM and 9:34 AM? 406 What is 679 minutes after 5:41 AM? 5:00 PM What is 63 minutes after 11:35 PM? 12:38 AM How many minutes are there between 11:49 AM and 4:41 PM? 292 How many minutes are there between 11:18 AM and 10:46 PM? 688 What is 90 minutes after 7:54 AM? 9:24 AM What is 355 minutes after 2:16 AM? 8:11 AM How many minutes are there between 12:05 AM and 7:55 AM? 470 How many minutes are there between 4:56 PM and 10:28 PM? 332 What is 459 minutes after 7:39 AM? 3:18 PM What is 587 minutes after 1:40 PM? 11:27 PM What is 391 minutes before 8:26 PM? 1:55 PM What is 127 minutes before 3:05 PM? 12:58 PM What is 317 minutes after 3:47 AM? 9:04 AM How many minutes are there between 4:33 AM and 9:29 AM? 296 What is 373 minutes after 3:36 PM? 9:49 PM What is 360 minutes before 2:32 PM? 8:32 AM What is 707 minutes before 3:49 PM? 4:02 AM What is 404 minutes before 10:25 PM? 3:41 PM What is 657 minutes before 9:10 AM? 10:13 PM How many minutes are there between 2:16 AM and 9:04 AM? 408 How many minutes are there between 5:17 PM and 4:12 AM? 655 What is 9 minutes after 6:18 PM? 6:27 PM What is 251 minutes before 5:57 AM? 1:46 AM How many minutes are there between 2:14 PM and 6:48 PM? 274 How many minutes are there between 1:26 PM and 12:05 AM? 639 How many minutes are there between 1:00 AM and 8:46 AM? 466 How many minutes are there between 5:44 AM and 9:56 AM? 252 What is 646 minutes before 9:58 AM? 11:12 PM How many minutes are there between 12:41 AM and 2:25 AM? 104 What is 90 minutes before 5:08 PM? 3:38 PM How many minutes are there between 9:20 PM and 6:48 AM? 568 How many minutes are there between 1:26 PM and 12:00 AM? 634 How many minutes are there between 7:28 PM and 9:31 PM? 123 How many minutes are there between 10:18 AM and 7:51 PM? 573 What is 588 minutes after 3:55 PM? 1:43 AM How many minutes are there between 6:55 PM and 8:23 PM? 88 How many minutes are there between 5:57 AM and 5:42 PM? 705 What is 482 minutes before 8:47 AM? 12:45 AM What is 538 minutes after 11:16 PM? 8:14 AM How many minutes are there between 7:53 PM and 10:44 PM? 171 How many minutes are there between 2:19 PM and 12:07 AM? 588 How many minutes are there between 10:16 PM and 9:19 AM? 663 What is 152 minutes after 5:12 PM? 7:44 PM How many minutes are there between 5:21 PM and 6:52 PM? 91 What is 69 minutes before 7:23 AM? 6:14 AM What is 82 minutes before 8:11 PM? 6:49 PM What is 203 minutes before 12:34 PM? 9:11 AM How many minutes are there between 7:26 PM and 6:13 AM? 647 What is 96 minutes after 9:27 AM? 11:03 AM What is 474 minutes before 7:05 PM? 11:11 AM What is 207 minutes before 4:08 AM? 12:41 AM How many minutes are there between 1:23 PM and 1:09 AM? 706 How many minutes are there between 9:09 AM and 5:34 PM? 505 What is 185 minutes before 11:12 PM? 8:07 PM How many minutes are there between 9:56 PM and 10:46 PM? 50 What is 611 minutes after 7:07 AM? 5:18 PM How many minutes are there between 4:18 AM and 6:43 AM? 145 What is 491 minutes before 9:13 AM? 1:02 AM What is 41 minutes after 5:21 AM? 6:02 AM What is 289 minutes before 12:15 PM? 7:26 AM What is 181 minutes before 10:06 AM? 7:05 AM What is 560 minutes before 6:17 AM? 8:57 PM What is 665 minutes after 7:35 PM? 6:40 AM How many minutes are there between 2:09 PM and 4:19 PM? 130 How many minutes are there between 4:59 AM and 11:41 AM? 402 How many minutes are there between 12:06 PM and 6:01 PM? 355 How many minutes are there between 6:18 AM and 2:28 PM? 490 What is 283 minutes after 6:28 PM? 11:11 PM What is 468 minutes before 8:49 PM? 1:01 PM How many minutes are there between 6:22 AM and 7:29 AM? 67 How many minutes are there between 10:33 PM and 10:58 PM? 25 How many minutes are there between 11:02 AM and 7:03 PM? 481 How many minutes are there between 4:42 AM and 8:51 AM? 249 How many minutes are there between 3:05 AM and 1:10 PM? 605 What is 92 minutes after 12:10 PM? 1:42 PM What is 132 minutes after 4:42 PM? 6:54 PM What is 702 minutes after 6:18 AM? 6:00 PM What is 685 minutes after 7:37 AM? 7:02 PM What is 672 minutes before 12:05 AM? 12:53 PM How many minutes are there between 9:54 AM and 3:21 PM? 327 What is 679 minutes before 12:31 AM? 1:12 PM What is 430 minutes before 11:36 AM? 4:26 AM How many minutes are there between 11:32 AM and 7:18 PM? 466 How many minutes are there between 11:59 PM and 11:46 AM? 707 How many minutes are there between 7:19 PM and 6:16 AM? 657 How many minutes are there between 1:22 PM and 3:04 PM? 102 What is 173 minutes after 10:01 AM? 12:54 PM What is 52 minutes before 9:28 PM? 8:36 PM How many minutes are there between 6:56 AM and 9:06 AM? 130 What is 265 minutes before 3:15 AM? 10:50 PM How many minutes are there between 9:02 AM and 12:31 PM? 209 How many minutes are there between 1:02 AM and 8:11	{ "pile_set_name": "DM Mathematics" }
- -1. Let r = t - 2. Let c = 1865 - 1861. Is r less than c? True Let o(a) = a*2 - 3a - 5. Let p be o(4). Let z = 179 - 182. Which is smaller: z or p? z Let k be (-6 + 396/63)(-7)/(-3). Let u = 1 + -0.9. Are k and u equal? False Let q be 3/12 + 79/(-284). Let v be (3 - 24/(-3))/(-1 + 0). Let a = v - -10. Does a = q? False Let q = -126 - -126.1. Is q at least as big as 1/32? True Let v = 2 - 3. Let t be 1(5 + (-27)/6)-60. Which is bigger: v or t? v Let c be (-1 - -5)/(0 + 2). Let t be (-11 - 8) + (0 + 0 - -1). Let b be (-4(-4)/12)/((-33)/t). Which is smaller: c or b? b Let y = 492 + -507. Which is smaller: y or -7? y Let f = 41.2 + 7.8. Let k = -24.939 + -0.061. Let y = f + k. Which is smaller: y or 2/5? 2/5 Suppose -19 + 49 = 5z. Let f = -3433/5 + 692. Which is bigger: z or f? z Let p = 525/4 + -2633/20. Which is greater: -0.0723 or p? -0.0723 Let a = 8.887 - -0.213. Let k = a - 9. Let s = -0.3 + k. Is s at most as big as 2/9? True Let j be ((-2)/17)/(0 - (0 - 1)). Let f be (4/5)/(4/10). Let o = f + -2. Which is smaller: j or o? j Let n = -788 - -786. Is n at least as big as 8? False Let x(w) = 60w - 24. Let j be x(-2). Do -144 and j have different values? False Suppose 1225 = -3r + 5h - 444, 5r - 4h + 2773 = 0. Which is greater: -552 or r? -552 Let i = 5 + 1. Let c = 24 - i. Suppose 7q - 2q + c = -2g, -4q + 4 = -3g. Which is smaller: -5 or g? -5 Let n = 0.223 + -2.223. Does 0.212 = n? False Let o = 76 + -74.8. Let m = 3.2 - o. Is m smaller than 3.2? True Let t = -62 + 64. Is 2.2 smaller than t? False Suppose 25 = -j - 3. Let u be -4(j/(-16) + -2). Is u less than or equal to -3/11? False Suppose -12 = -14s - 96. Let t be (18/30)/(1/(-5)). Which is bigger: t or s? t Let t = -1 - -2. Suppose -21 - t = 4d - 2f, 2f = 2d + 10. Let q be (3/(-3) - 5)2/3. Which is smaller: d or q? d Let f = -1.3 - 4.7. Let u be (-13)/482 + 4/6. Which is bigger: u or f? u Suppose 0 = -20l + l - 3971. Is -209 <= l? True Let b be (70/(-66) - 2) + 3. Let c(q) = 3q + 79. Let s be c(-26). Which is greater: s or b? s Let m(q) = 7q*2 - 20q + 10. Let w be m(6). Is 143 at most as big as w? False Let g be 6/(-22) + (-960)/1320. Which is greater: 6 or g? 6 Let p = -860 + 860.2. Which is bigger: 0.36 or p? 0.36 Suppose -z = z + 2. Let m be 0 + (-372)/(-11) + z. Let j = m + -33. Is -1/2 at most j? True Suppose -3j = -p - 3p + 20, -2j = -p + 10. Suppose 0h + 20 = -ph. Let a be (4/h)/(7/5). Which is smaller: 1 or a? a Let j = 303.06 + -303. Is -0.034 >= j? False Let i = -3 + 43. Let l be (0 - (-4)/i)-4. Which is bigger: -0.2 or l? -0.2 Let p = 2/8519 + 10921/136304. Which is smaller: p or -0.1? -0.1 Let d(l) = l*2 + l - 1. Suppose -u + 5a - 2a = 2, -3u - 2a + 5 = 0. Let v(z) = 5z + 10. Let x(b) = uv(b) + d(b). Let i be x(-4). Are i and -2/11 equal? False Suppose -5v + 343 = n, -3v - 2n = -0v - 203. Which is smaller: 71 or v? v Let m = 125 - 125.44. Let p = -0.12 - -0.26. Let w = m + p. Which is smaller: w or 0.2? w Let p be ((-3)/(-7))/((-5128)/16 - 5). Which is smaller: p or -1? -1 Let g(y) = -2y + 6. Let x be g(-5). Suppose -2h = -6 - 10. Let f = h - x. Is f > -2? False Let f = -411 - -411.16. Let s = 3 - 2.9. Which is smaller: s or f? s Let g = -16 - -73. Suppose 5h - l - g = 69, -5h + 114 = -4l. Suppose z + 3i + h = 0, 5i = -z - z - 47. Which is smaller: z or -12? -12 Let q(y) = y*2 - 6y + 3. Let n be q(4). Let j = n + 3. Let k be 6/2481/(-1). Are k and j equal? True Let u = -103 - -85.2. Let t = u - 0.2. Do -1 and t have the same value? False Let c be (12/(-24))/(6/(-4) - -2). Which is smaller: 1/1174 or c? c Let g = -9 + 5.4. Let h = -0.4 + g. Which is smaller: 1 or h? h Let a be ((-9)/(-165))/(3/2). Let x(q) = 2q - 12. Let j be x(-5). Let n = -23 - j. Which is greater: n or a? a Let m(o) = -57o + 285. Let b be m(18). Which is bigger: b or -743? b Let n = 1481 + -7373/5. Let p be (-420)/(-40)(-2)/(-12)4. Which is bigger: p or n? p Suppose -1218b + 1225b + 77 = 0. Is b at least as big as -110/9? True Let b be 3((-28)/6 + 8). Is 43/5 not equal to b? True Suppose 0 = 5i - 5z - 100, -44 = -2i - 2z + 6z. Which is bigger: i or 14? i Let g be (3/(-9))/(1/6). Let l be (-160)/1232 - g/11. Is 1 at least as big as l? True Let z = 1221 + -1213.97. Let d = 0.03 - z. Let o = -13.2 + 13. Does o = d? False Let f(d) = -2d3 - 2d*2. Let t be f(-2). Let r be 10/(-20)t/(-1). Is 4 < r? False Suppose 18v + 5 = 43v + 5. Let w be 4(13/6 - 2). Which is bigger: w or v? w Let y(k) = -4 - 9 + 3k + 0k - 2k. Suppose 2i - 5 - 15 = 0. Let l be y(i). Which is greater: -4 or l? l Let w be (-193)/(-115) + -21/10. Which is smaller: w or 2? w Let i = -5 - -1. Let l be 3 - 6/93. Let k be 1/i + l/4. Which is smaller: 3/5 or k? k Let i = -1.71 - -0.3. Let t = 13.61 + i. Let h = -12 + t. Does h = 1/5? True Let x = 117 - 93. Suppose -5h = -2a - 3a + 120, -3 = -3h. Is x <= a? True Let g = -24 + 26. Suppose -3b - 3 = -d + 15, -21 = -2d + 3b. Suppose 3q - 14 = 4c, -gc - dq - 11 = -c. Which is smaller: c or -11/3? c Let r = -59 + 71. Suppose 8y - 72 = ry. Is 0 not equal to y? True Let y = 1040 + -1113. Which is smaller: -67 or y? y Let t = -2483 - -2484.017. Let u = t + -0.017. Which is smaller: u or -5? -5 Suppose -60 = -3v + 6v. Let k be 5/v + 7/12. Let d = -4/35 - -191/140. Is k at most as big as d? True Let n be 112/54 - (1 - -1). Let k = 308 - 308. Is n at most as big as k? False Suppose -c + 2x + 7 = 0, -7 - 10 = -3c + 5x. Is c smaller than 6/43? True Let o(a) = a3 - 5a*2 - a. Let b be o(-4). Let i = -703/5 - b. Do 0.2 and i have the same value? False Suppose 0 = 3d - 5d. Let m be (-11)/(-63) + (99/21 - 5). Which is smaller: d or m? m Let s be (-2 - 20)(-1)/(-2). Let u(h) = 6h2 + 36h + 16. Let o(d) = -d*2 - 7d - 3. Let f(g) = so(g) - 2u(g). Let r be f(5). Which is bigger: -1 or r? r Let a = 4.47 + -4.27. Which is smaller: 30 or a? a Let r = 20 + -26. Let y = 4 - 2. Let a = y + r. Is -4 < a? False Suppose -2l - 40 = -2s, -l - 4 = -0l - 5s. Let p = 27 + l. Suppose 5h - 4 = k - 2k, -4k + 85 = -ph. Which is greater: k or -2/5? k Suppose -m = m + 2p - 92, 0 = 3m + 5p - 136. Suppose 0 = -6f + m + 49. Suppose -i - 2 = i. Which is bigger: i or f? f Let n = 43114639500/1939 - 22235502. Let o = n + -2/277. Let g(b) = b + 8. Let k be g(-6). Is k >= o? True Suppose 2b + 3b = 70. Let j be (-17)/(-51) + b/(-15). Which is smaller: -10 or j? -10 Suppose -12z - z - 4433 = 0. Is z at least as big as -339? False Let b = 0 + -1. Suppose a = -3p - p - 16, -3p - 12 = 4a. Suppose -5z - 2z = a. Which is greater: z or b? z Suppose 2 = -2a - 2. Let v be a/6 + (-183174)/(-8118). Let s = 244/11 - v. Which is greater: s or 0? 0 Let m = -75 - -52. Let r = -26 - m. Which is smaller: -2 or r? r Suppose -83g = -80g - 1215. Suppose -16z = -7z + g. Is -45 at most z? True Let l = 1.9 - 2. Let q be ((2/(-5))/1)/((-154)/35). Which is smaller: l or q? l Suppose i = -2i. Let o(d) = d*3 - 6d*2 - d + 3. Let g be o(6). Let f be (-2 + (-10)/(-6))/(g/(-9)). Are f and i nonequal? True Let c(z) = 13z + 26. Let m be c(5). Let x = m - 119. Which is bigger: x or -27? -27 Let n = -96 + 177/2. Suppose -4j + j - 21 = 0. Which is greater: j or n? j Let o(j) = -j3 - 9j*2 + 10j - 27. Let q be o(-11). Let y = 106 - q. Which is smaller: 3 or y? y Let s(o) = o*3 + 2o*2 + 4. Let g be s(-3). Let m = -50/3 + 73/6. Is g smaller than m? True Let k be (-70)/(-8) - ((-260)/(-80) + -3). Which is greater: k or -5? k Suppose 3l - 9 = -3s, 5l - 11 = -2s - s. Is 22/21 less than s? True Let f be (-10)/(-15) - 38/(-6). Suppose 2h = 4s - 4, -h + 4s + 1 = f. Let g = 0.0824 + -0.1824. Which is greater: g or h? h Let f be (-9 + 11)(4 - (-484)/(-120)). Which is bigger: 1 or f? 1 Let u be (8/(-20))/(72/(-160)). Let t(p) = p + 7. Let x = 8 + -13. Let c be t(x). Which is greater: c or u? c Suppose -5k = -2c - 11, 8c - 7c + 5 = 2k. Is 2/879 smaller than k? True Suppose 5v + 4q + 18 - 47 = 0, 0 = -2v - 2q + 10. Let d(g) = g*2 - 8g - 6. Let t be d(v). Suppose 2z + 1 - 11 = 5c, 3c + 15 = tz. Is 2 at least z? False Let j(w) = w - 5. Let z be j(10). Suppose -b + z*b = 0. Let q be 0/(3 - 1 - b). Which is bigger: q or -7? q	{ "pile_set_name": "DM Mathematics" }
5731.95708005 Subtract 35.321091889 from 1. -34.321091889 What is -30.6980205864 less than -5? 25.6980205864 Calculate 2.2 + -24358385997. -24358385994.8 Subtract -270766305 from -4572. 270761733 What is -55470.721 - -8309? -47161.721 Work out -0.3 + -3.339213921543. -3.639213921543 -4740.9468 + 11372.7 6631.7532 212835 + -14865227.46 -14652392.46 Sum -22474760 and 110842. -22363918 120407 - -18.42 120425.42 Sum -255396 and 1615.677. -253780.323 Sum 1998 and -12789251.15. -12787253.15 Sum 5412.49 and 1.7818674. 5414.2718674 Calculate -0.17 - 3324558506517. -3324558506517.17 Work out 1 + 88943450969. 88943450970 Add -18543539574.9 and -35. -18543539609.9 What is -9 take away 3541841666932? -3541841666941 What is -3909 - -324245448? 324241539 Add 28766.1955 and 1.6618. 28767.8573 What is -165564 less than -3932897? -3767333 Put together -8454 and -42785119. -42793573 What is -1740.2329 - 4527? -6267.2329 What is -0.17 + 28830579521? 28830579520.83 Work out -144.08 - -13649.6687. 13505.5887 Add together 1752782885097 and -0.2. 1752782885096.8 Add -1817573 and -2045389. -3862962 What is 0.03 minus 2696706108840? -2696706108839.97 -0.208270596621 - 0.6 -0.808270596621 What is the distance between 27247 and -1427057928? 1427085175 Calculate -14.7777388501263 + 0.4. -14.3777388501263 What is 6.451 - 561506.65? -561500.199 What is the difference between -78433 and -0.7255221? 78432.2744779 What is -2214.08291 take away 19947? -22161.08291 Calculate 15104 - 11688961738. -11688946634 Subtract -37.0267 from 4210634. 4210671.0267 Add -16.5015258578 and 1.5. -15.0015258578 Work out 7821060.9371 + 239. 7821299.9371 -3486.033 - -1364474 1360987.967 What is 1727233858 take away -4002? 1727237860 What is 16 + 17654986603535? 17654986603551 What is -12.0061066495 take away -7? -5.0061066495 Calculate 1009.3412376 - -48.76. 1058.1012376 What is -42768845949693 + -9? -42768845949702 1687848460+-0.4488 1687848459.5512 3 - -3.59876685981 6.59876685981 721921055 + -171 721920884 What is -3851 + 5041679878? 5041676027 Subtract 4226480504520 from -0.15. -4226480504520.15 Work out -93666286 + 184312.5. -93481973.5 Subtract 655487.5943 from -1.2768. -655488.8711 Put together -19 and 8875240.947. 8875221.947 What is 7373633.371 minus -559.96? 7374193.331 What is -1004 take away 13.2999307719? -1017.2999307719 Total of 0.15397493075 and -0.332. -0.17802506925 Work out -13976506.51 - 30248. -14006754.51 What is the difference between 31 and -547.4206405511? 578.4206405511 Put together -14 and 185651997097. 185651997083 Calculate 936869511275 - 1. 936869511274 What is -0.014174 + 6.24185? 6.227676 Calculate -5 - -803879760456. 803879760451 Calculate -0.10309815 - 0.025425. -0.12852315 50 - 479315468574 -479315468524 Total of 616 and 2333582439. 2333583055 Add together 59733073877 and -0.1. 59733073876.9 Put together 1.27 and 47.31451175. 48.58451175 Put together 4465573 and -24849. 4440724 Work out 283.270752 - -63276. 63559.270752 0.0818335 + 52208059 52208059.0818335 What is -206990536 take away 0.338? -206990536.338 Add together -92631677.7 and 10389. -92621288.7 434.224962 - 12716 -12281.775038 Work out -0.06 + -60307818.4. -60307818.46 What is the distance between -0.17180231135137 and 2? 2.17180231135137 Sum 3.056059183 and 557. 560.056059183 Calculate 333 - -451281.4895. 451614.4895 Work out 38622188333 + 5. 38622188338 What is -1557.5629 plus 644003? 642445.4371 Add together 0.232867949458 and -0.11. 0.122867949458 Calculate 4.28 - 1259927881. -1259927876.72 Put together -0.081859507 and -2.019. -2.100859507 95473276238920+0 95473276238920 What is -68597308.296 take away -13? -68597295.296 Put together 1730.513998 and -0.155879. 1730.358119 What is -143 minus -59806359.859? 59806216.859 Total of 240235245 and 0.258795. 240235245.258795 Calculate -494297889 + 321. -494297568 What is 105057906425 minus -191.4? 105057906616.4 Calculate 1646654083966 + -33. 1646654083933 Put together 1087906349.8 and 5. 1087906354.8 What is 8158155827 - -17? 8158155844 Calculate -1184244 + 76142. -1108102 1479 + 424390186 424391665 What is the distance between -10204178 and -6615072? 3589106 Subtract 7223560491099 from 1. -7223560491098 What is 820950 - -30.65847? 820980.65847 596.49089112343+-2 594.49089112343 Work out -0.03663457200605 + -0.51. -0.54663457200605 120228769 + 550 120229319 Work out 1696963469.2727 - -2. 1696963471.2727 Total of -442829.8401231 and -5. -442834.8401231 What is -0.07421 plus 131266.9894? 131266.91519 Sum -1758327122.644 and 165. -1758326957.644 Total of -71620901072 and 2. -71620901070 Work out 0.01 + 149.173939776. 149.183939776 What is 23.01 minus -0.0244059998619? 23.0344059998619 -31 - -27639113763 27639113732 Work out 0.7591237874 + 0.02. 0.7791237874 Put together 28.46 and 161950.797315. 161979.257315 Total of 71283 and -251.606274. 71031.393726 What is the distance between 19.8224030178 and -0.2? 20.0224030178 What is 0.0684508703 + -346? -345.9315491297 What is 0.1 take away -183363279647208? 183363279647208.1 Put together 1279.1451 and 56606. 57885.1451 What is the distance between 5000804862778 and 2? 5000804862776 Add together 4494 and -1.492665883. 4492.507334117 Add -6428018095 and 0.11. -6428018094.89 What is the distance between 4 and 14737638961? 14737638957 28667.03 - 1255337 -1226669.97 Work out 93439.0668 - 1.7. 93437.3668 Total of 0.0372319906353 and -0.3. -0.2627680093647 What is -21880 - -0.184823398? -21879.815176602 What is the distance between -1767461525.9926 and -1? 1767461524.9926 -15833264 + -37794.3 -15871058.3 Calculate -862863 - -93686. -769177 Add -6654 and 276302832. 276296178 What is -2333.5715 less than 13292753? 13295086.5715 Subtract -0.3 from 49474142343. 49474142343.3 Subtract -1055223709672 from -3. 1055223709669 Sum 5006984326 and 3.5. 5006984329.5 Subtract 454282761458.1 from 4. -454282761454.1 What is -47178188 less than 4536.8? 47182724.8 What is 982336176 plus 1.7? 982336177.7 Work out 5561057.348 + -1355. 5559702.348 What is 1 take away 5924435567.12? -5924435566.12 Add together 0.1 and -10921067739. -10921067738.9 What is 3 - -1192388966.9? 1192388969.9 Put together 0.343388 and 2786024. 2786024.343388 What is the difference between 990774.31 and 427699? 563075.31 Subtract -414.90252778 from 259. 673.90252778 Work out -0.2 - -4342990.2429. 4342990.0429 Subtract -4511847 from 44741. 4556588 Work out -1235.49157 - -467485. 466249.50843 Work out -7830 + -3945.393. -11775.393 Subtract -2862727 from 0.2651. 2862727.2651 Work out -761.36674 - -0.1. -761.26674 Total of -7.061 and 26067639990. 26067639982.939 Add together -394459800605 and 0.5. -394459800604.5 What is -1848 take away 232489.4549? -234337.4549 Add 3290.148 and 4.864858. 3295.012858 Add together -9140058 and 9173. -9130885 Calculate -3 - 14851.0452212172. -14854.0452212172 What is 1292518405 less than -56? -1292518461 -0.051067619116 - 86 -86.051067619116 Work out 46879 + -12911.18151. 33967.81849 -0.13 + 7117545516 7117545515.87 Calculate -3666872901822 - -32. -3666872901790 Total of 1.4 and 2409.79528719. 2411.19528719 Subtract 0.7 from -2.3804557856. -3.0804557856 What is 524623598141 less than 18? -524623598123 What is -1822259002.9 - -2? -1822259000.9 Subtract -2562011 from -0.015623. 2562010.984377 Add -0.2606019 and 63126877. 63126876.7393981 Sum -1361752067633 and 50. -1361752067583 Total of 1.658545218826 and 75. 76.658545218826 Work out 19.74956569 + -15015. -14995.25043431 Calculate 27650495557007 - -42. 27650495557049 97.2+-4.88911919262 92.31088080738 14778639521+-74 14778639447 Work out -13940037 + 2174015. -11766022 What is 49.55989716913 plus -1? 48.55989716913 Subtract -2 from -108925973000. -108925972998 Calculate -1423874971 - -5323. -1423869648 Total of -0.094934728 and -1.3318. -1.426734728 Work out -1356130402 - 130.31. -1356130532.31 What is -18944635 take away 53.18? -18944688.18 129414.696 + -17103 112311.696 Subtract 230.42 from -876063.28. -876293.7 What is -1 less than 7346183749.5037? 7346183750.5037 Total of 32397 and -0.1705152. 32396.8294848 Add together 9132 and -568458883. -568449751 What is 4 minus -0.026476485140969? 4.026476485140969 Add together 0.14 and 86662860470.1. 86662860470.24 Work out -7246207965966 -	{ "pile_set_name": "DM Mathematics" }
(c) -0.08 (d) 0.2 b What is the nearest to -2 in 21, 5, 2? 2 Which is the nearest to 0? (a) 2 (b) -5 (c) -0.04 (d) 10 c Which is the closest to -1? (a) 2 (b) -2 (c) 0.2 (d) -7 b What is the closest to 2/17 in 1/4, -2/23, 1? 1/4 What is the closest to -2/7 in 0, -2/5, 5, 0.1? -2/5 Which is the nearest to 12? (a) 1 (b) -2 (c) -10.8 (d) 0.1 a Which is the closest to -3? (a) 0.4 (b) 1 (c) -5/2 (d) -3 d What is the nearest to -0.1 in -0.1, -12, 10? -0.1 What is the nearest to 37 in -5, 3, -0.6? 3 What is the nearest to -0.1 in -0.5, 0.00537, -5? 0.00537 Which is the nearest to -1/4? (a) 4 (b) 1 (c) -4/3 c Which is the closest to -1? (a) 3 (b) 0.3 (c) 1 (d) -2 d Which is the nearest to -1? (a) 3 (b) -0.3 (c) 0.278 b What is the nearest to -1/9 in 4, 4/7, -1, 27? 4/7 What is the closest to -4/3 in -2/13, 9, 8, 2? -2/13 What is the closest to 1/2 in -144, 1, -2? 1 Which is the closest to -0.1? (a) 0.2 (b) 0.4 (c) 2 (d) -1/517 d What is the closest to 1/2 in -8, -31, -0.1, -4? -0.1 Which is the closest to -2/5? (a) 1 (b) -5 (c) -14 (d) 0.02 d Which is the closest to 0.1? (a) 2/13 (b) -4/3 (c) -2/9 (d) 2 a Which is the nearest to -1/3? (a) 0.4 (b) 0.45 (c) 0.2 (d) -1 c Which is the closest to 0.03? (a) 1/3 (b) -2 (c) 0.4 (d) 0.19 d What is the nearest to 111 in -2, 0, 0.3? 0.3 What is the nearest to -12 in -0.3, -0.1, 2/5, 0.08? -0.3 Which is the closest to 0? (a) -2.2 (b) 6 (c) -3 a What is the nearest to -1 in -3, -2, -6/5? -6/5 Which is the closest to -2/7? (a) -24 (b) 0 (c) -0.1 (d) 0.4 c What is the closest to 1 in 4, 6, 7, -1/2? -1/2 What is the closest to -1/4 in 0.12, 0.2, -4/9, 3? -4/9 What is the closest to 44/9 in 2, 1/10, -6? 2 What is the closest to -4 in 3/4, 1, -3, 3/2? -3 What is the closest to -10 in 0.5, -9, -3/5? -9 Which is the nearest to -1? (a) 2 (b) 2/15 (c) 1/4 (d) 42 b What is the closest to -3/4 in -42, -15/8, 2/9, -0.1? -0.1 What is the closest to 0 in -8, -12, 0.4? 0.4 Which is the nearest to 0? (a) 1/4 (b) -4 (c) 41 a Which is the closest to 2? (a) 0.1 (b) -1/5 (c) -14.1 a What is the nearest to 1 in 0.4, 5, 0.04, -1/45? 0.4 What is the closest to -2 in -5, 2/3, 3, -63? 2/3 What is the closest to 8 in 1, 2/13, -3, 5? 5 What is the nearest to -0.06 in 0.09, -1, -2/9, -3? 0.09 Which is the nearest to 1.7? (a) 4 (b) -9 (c) -4 a What is the closest to -1 in 0.04, -0.3, 5, 0.1? -0.3 Which is the closest to 2/9? (a) 0.3 (b) -1/6 (c) -252 (d) -4 a What is the closest to -4 in 4, 0.02, -2/5? -2/5 Which is the nearest to -0.1? (a) 0.3 (b) -2 (c) -0.06 (d) 2 c Which is the nearest to 0.2? (a) 0.5 (b) 5 (c) -0.4 (d) -43 a Which is the nearest to -2/7? (a) 3 (b) -3 (c) -2 (d) -1 d Which is the closest to -0.1? (a) 4/7 (b) -4 (c) 90 a Which is the closest to 0.11? (a) 1 (b) 1/4 (c) -0.1 b What is the closest to 0.1 in -0.3, -3/19, -2/3? -3/19 Which is the closest to -1? (a) -13 (b) -4 (c) 5 (d) -26 b What is the nearest to 3/11 in -177, -0.1, -1? -0.1 Which is the closest to 1? (a) 1 (b) -0.5 (c) 0 a What is the nearest to -3 in -1, -1/2, -12/7, 0? -12/7 Which is the nearest to -1? (a) -0.1 (b) 0.4 (c) 1/5 (d) 5 a Which is the nearest to 19? (a) 14 (b) 0 (c) -2/7 a Which is the nearest to 1/4? (a) 6 (b) -4/3 (c) 15 (d) 4 b Which is the nearest to -13? (a) -0.1 (b) 2/15 (c) -1 (d) 0.4 c What is the nearest to -1 in -21, -0.5, -4, 0.3? -0.5 What is the closest to 1.1 in 0.5, -1/7, 0.1, 0.3? 0.5 Which is the nearest to 1? (a) 0.2 (b) 5 (c) -4/9 (d) 11 a Which is the nearest to 0.1? (a) -4 (b) 2/7 (c) 1/4 (d) -1/10 c What is the closest to 1 in -4, -0.82, -5, -1? -0.82 What is the nearest to -3/2 in -2, -2/127, 12? -2 What is the closest to -1 in -2/3, 5/8, -2/5? -2/3 What is the nearest to -9 in 0.17, 1, -3/5, 4? -3/5 Which is the nearest to -1/2? (a) 2/7 (b) 18 (c) -1/7 (d) 0.5 c What is the closest to 1/2 in -5, 152, 2? 2 What is the nearest to 0 in -2/13, 2/5, 1.87? -2/13 Which is the closest to 1/10? (a) -3 (b) 0.5 (c) 3 b Which is the nearest to 1? (a) 4 (b) 5 (c) -1 c What is the closest to -107 in 2, 0.1, -1? -1 Which is the nearest to -0.6? (a) -2/3 (b) -2/19 (c) 5 (d) 0 a What is the closest to -0.01 in 2/11, 3, 2/13? 2/13 What is the closest to 1/3 in -6, 1, 0.06? 0.06 Which is the nearest to -1? (a) -9 (b) 2 (c) 5 b Which is the closest to -2? (a) -2/3 (b) 1 (c) -0.1 (d) -2/51 a What is the closest to -6/5 in -1/2, 5, -8, -4? -1/2 Which is the closest to 0.01? (a) -5 (b) 10 (c) 4 (d) -4 c What is the closest to -0.1 in 0, 0.082, 2? 0 What is the nearest to 1 in -5, 14, -44, -0.1? -0.1 What is the closest to -1/4 in -0.4, 609, 2, 1/4? -0.4 Which is the closest to -1.024? (a) -0.5 (b) 0 (c) -3 a Which is the closest to -2? (a) 0 (b) 225 (c) -2/3 (d) 4 c Which is the nearest to -4/9? (a) -2 (b) 4 (c) 0.3 (d) 1 c Which is the nearest to -0.015? (a) 3 (b) 4/5 (c) 3/7 (d) -0.1 d What is the closest to -55 in 0.1, -0.1, -0.3? -0.3 Which is the closest to 0? (a) -21 (b) -4 (c) 7 b What is the closest to -1 in -387, -4, 0.1? 0.1 Which is the closest to 4? (a) 0.2 (b) 4 (c) 2/3 (d) -1 b What is the nearest to 0.1 in -0.05, -7, 14? -0.05 Which is the closest to 2/5? (a) 1/3 (b) -15 (c) -2/3 a Which is the nearest to -207? (a) -0.5 (b) 3 (c) -3/5 c What is the nearest to 3/19 in -2/9, 1, 3? -2/9 What is the nearest to -2 in -5, 2, 5/3? -5 Which is the closest to -0.3? (a) -1.4 (b) -2 (c) 4 a Which is the nearest to 0.1? (a) -0.2501 (b) -1 (c) -1/5 c What is the closest to 47 in -2, -0.5, -4, 0? 0 What is the closest to -34 in -0.3, 2/5, -3, -0.5? -3 Which is the nearest to 2/3? (a) 0.2 (b) -2 (c) -1/2 (d) 2 a Which is the closest to 2? (a) -0.31 (b) -1 (c) 1/4 c Which is the closest to 3? (a) 5.1 (b) 0.5 (c) -2/11 a What is the closest to 1 in -16, 4/3, -19? 4/3 Which is the nearest to 0? (a) 4/9 (b) -0.05 (c) 16 b What is the closest to -1/40 in 1/6, -3/7, -3/2? 1/6 Which is the nearest to 0.1? (a) -1/4 (b) -6/73 (c) -1 b What is the closest to -0.05 in -4, 1/3, -0.4, -1/3? -1/3 Which is the nearest to 0.1? (a) -1/9 (b) -4 (c) -0.1 c What is the nearest to 2 in -5, -0.2, -0.5? -0.2 Which is the closest to -0.45? (a) -3 (b) 0.2 (c) -2/5 (d) -2/11 c What is the nearest to 0.3 in -5, 2, 5, 0.2? 0.2 Which is the nearest to -1? (a) 0.4 (b) -11/4 (c) 3/2 a Which is the nearest to 1? (a) -2/17 (b) 1 (c) 5 (d) 1/16 b What is the closest to -1/3 in -4, -0.3, 378? -0.3 What is the closest to 2/7 in 5, -0.9, 2, 3? -0.9 What is the nearest to -2 in -0.02, 3, -15, -0.1? -0.1 What is the closest to -5/17 in 0, -0.3, 0.4? -0.3 Which is the closest to -4.4? (a) 0.2 (b) 5/3 (c) 1/6 (d) -0.4 d Which is the nearest to -5? (a) -3/2 (b) 2/7 (c) 4 (d) 1 a Which is the nearest to 0.1? (a) 143 (b) -2 (c) 0.08 c Which is the closest to 1? (a) -0.4 (b) -1 (c) -2/15 (d) -52 c Which is the closest to 1/4? (a) 1/6 (b) 2 (c) 3/4 (d) -2 a What is the closest to 2 in 2/15, -4, 1, -0.5? 1 Which is the nearest to -126? (a) 2 (b) -3 (c) 2/13 b Which is the nearest to -0.2? (a) -3/5 (b) 4 (c) -0.2 c Which is the nearest to -1/4? (a) -5 (b) 0.2 (c) 3/8 (d) 8 b What is the closest to 1 in -6/17, 0.5, -0.6, 0.2? 0.5 Which is the closest to 0? (a) -4 (b) 1 (c) -1/10 (d) 9 c Which is the nearest to 1/208? (a) -6/7 (b) 0.3 (c) -3 b Which is the nearest to 1? (a) -2/7 (b) -4 (c) -85 (d) 0.2 d Which is the nearest to 0.05? (a) 2/7 (b) 0.3 (c) 1/10 (d) 0.17 c Which is the nearest to 0.3? (a) 5/4 (b) 2/3 (c) -0.4 (d) 3 b What is the nearest to 1 in -0.1, -1/6, 1, -3/4? 1 Which is the nearest to -5/2? (a) -4/27 (b) 1/9 (c) 4 a Which is the nearest to 1? (a) 5 (b) -2 (c) 1/7 c What is the nearest to 1 in -0.4, 1/3, 1.3, 2/13? 1.3 Which is the nearest to -0.1? (a) 3/4 (b) 0.8 (c) 1 a What is the closest to -2/5 in 0.2, 2/19, 0, 1/2? 0 What is the closest to 0 in -3/4, -1/3, 0.2, 19? 0.2 Which is the nearest to 0? (a) 3 (b) -2/5 (c) 0 (d) 1 c Which is the nearest to -2/7? (a) -3/7 (b) 5 (c) 1.2 a Which is the closest to 10? (a) -2.7 (b) -5 (c) 0.3 (d) -1/3 c What is the closest to 2 in -305, 2, 3? 2 What is the n	{ "pile_set_name": "DM Mathematics" }
5/26 What is prob of picking 1 l and 1 t when two letters picked without replacement from {y: 1, t: 1, n: 1, d: 1, p: 2, l: 1}? 1/21 Two letters picked without replacement from {o: 1, r: 1, t: 2}. What is prob of picking 1 t and 1 r? 1/3 Four letters picked without replacement from {r: 1, e: 1, z: 2, n: 4, t: 3, m: 4}. What is prob of picking 3 t and 1 m? 4/1365 What is prob of picking 2 a and 2 h when four letters picked without replacement from {i: 1, a: 4, h: 5, l: 1}? 2/11 Calculate prob of picking 1 u and 2 l when three letters picked without replacement from uuldl. 1/5 Calculate prob of picking 4 m when four letters picked without replacement from vmmfmmvvmmmvm. 14/143 Four letters picked without replacement from oyyyyyoyyyoy. What is prob of picking 4 y? 14/55 Four letters picked without replacement from vpvppppvppv. Give prob of picking 3 v and 1 p. 14/165 Three letters picked without replacement from {q: 7, e: 4, l: 2, d: 1}. Give prob of picking 2 q and 1 e. 3/13 Two letters picked without replacement from {v: 1, d: 2, a: 1}. What is prob of picking 2 d? 1/6 Calculate prob of picking 1 u and 1 s when two letters picked without replacement from suucucsscuc. 12/55 What is prob of picking 2 u, 1 z, and 1 v when four letters picked without replacement from zyuvuyywvuwvyu? 18/1001 Three letters picked without replacement from {t: 17, h: 3}. What is prob of picking 1 h and 2 t? 34/95 What is prob of picking 2 p and 1 i when three letters picked without replacement from ipiippipiipiiipiippp? 33/95 Four letters picked without replacement from qyyqyy. Give prob of picking 2 q and 2 y. 2/5 What is prob of picking 1 r and 1 v when two letters picked without replacement from eevxeerxrxkkrkrk? 1/30 What is prob of picking 3 x when three letters picked without replacement from {e: 9, x: 3}? 1/220 Three letters picked without replacement from {p: 3, v: 1, i: 3, n: 2, y: 1, m: 2}. What is prob of picking 1 m and 2 n? 1/110 Two letters picked without replacement from ppppdpppppppp. Give prob of picking 1 d and 1 p. 2/13 What is prob of picking 4 v when four letters picked without replacement from jvjvvvvvjvvv? 14/55 Four letters picked without replacement from hbbbbybybbbyybyh. Give prob of picking 3 b and 1 h. 6/65 What is prob of picking 3 c when three letters picked without replacement from jjjjjcjccjjcjcjjjjj? 10/969 Two letters picked without replacement from {i: 2, h: 2, p: 2}. Give prob of picking 2 i. 1/15 What is prob of picking 2 c when two letters picked without replacement from sssenccccsccn? 5/26 Four letters picked without replacement from {n: 1, f: 7, m: 4, b: 1, p: 4, u: 1}. Give prob of picking 1 n, 1 p, 1 m, and 1 b. 4/765 Calculate prob of picking 1 u and 1 z when two letters picked without replacement from {z: 2, f: 4, a: 1, u: 10}. 5/34 Calculate prob of picking 1 g and 1 n when two letters picked without replacement from {n: 3, c: 1, g: 5}. 5/12 What is prob of picking 1 c and 1 t when two letters picked without replacement from {r: 5, c: 1, t: 7}? 7/78 Calculate prob of picking 2 c when two letters picked without replacement from cqcq. 1/6 Calculate prob of picking 1 i and 2 z when three letters picked without replacement from zjziizfiiiiiifzii. 3/34 What is prob of picking 2 w when two letters picked without replacement from wiwwwiiwwwwwwww? 22/35 What is prob of picking 1 k, 2 r, and 1 v when four letters picked without replacement from {r: 2, v: 2, k: 1, c: 1}? 2/15 Two letters picked without replacement from nfnntntnfnnnffnn. What is prob of picking 1 n and 1 f? 1/3 What is prob of picking 3 f when three letters picked without replacement from {k: 6, f: 6}? 1/11 What is prob of picking 2 e and 1 j when three letters picked without replacement from {i: 2, j: 5, e: 12}? 110/323 Three letters picked without replacement from yeemmmmmeme. What is prob of picking 3 e? 4/165 What is prob of picking 4 g when four letters picked without replacement from ggggggggggygggg? 11/15 What is prob of picking 1 k, 1 t, and 2 w when four letters picked without replacement from ttwtwwtwwwkwww? 144/1001 Two letters picked without replacement from kkkkkkknkkkkkkkkkkkk. Give prob of picking 1 k and 1 n. 1/10 Two letters picked without replacement from xhxxxooxlxxh. What is prob of picking 2 h? 1/66 Two letters picked without replacement from bbjdjkdbkdjdkdbkbjkk. Give prob of picking 2 k. 3/38 Four letters picked without replacement from eeebebeeeebeebbbee. Give prob of picking 2 b and 2 e. 11/34 Three letters picked without replacement from qqvpvc. What is prob of picking 1 v, 1 q, and 1 c? 1/5 What is prob of picking 1 o and 1 s when two letters picked without replacement from {y: 1, b: 1, h: 2, j: 1, o: 1, s: 1}? 1/21 Four letters picked without replacement from {d: 4, e: 8, y: 5, o: 2}. What is prob of picking 2 o and 2 y? 5/1938 Calculate prob of picking 2 w when two letters picked without replacement from vvvwvzw. 1/21 Calculate prob of picking 2 g when two letters picked without replacement from gggjtdgggdjjjd. 15/91 Three letters picked without replacement from {n: 7, y: 6}. Give prob of picking 3 y. 10/143 Two letters picked without replacement from cvuvvvivvcuvuvuucvu. Give prob of picking 2 v. 4/19 Two letters picked without replacement from {j: 4, p: 5, g: 1}. What is prob of picking 1 g and 1 j? 4/45 Two letters picked without replacement from {p: 1, k: 2, r: 2, j: 1}. What is prob of picking 1 r and 1 p? 2/15 Calculate prob of picking 1 v and 1 d when two letters picked without replacement from {q: 3, v: 4, j: 1, t: 3, a: 3, d: 1}. 4/105 Two letters picked without replacement from {z: 1, q: 1, g: 1}. What is prob of picking 1 q and 1 z? 1/3 What is prob of picking 1 v and 3 y when four letters picked without replacement from nnnyvynvnnvnnnvy? 1/455 Calculate prob of picking 1 r and 3 s when four letters picked without replacement from sssrsssssrrwssrsswr. 275/969 Three letters picked without replacement from mmmlh. Give prob of picking 1 l, 1 h, and 1 m. 3/10 What is prob of picking 3 x and 1 s when four letters picked without replacement from mxgxxmgsgxxgxsgomgx? 35/1938 Three letters picked without replacement from {q: 3, a: 5}. What is prob of picking 1 a and 2 q? 15/56 Three letters picked without replacement from ffuvfvvvfvhffqvhfq. Give prob of picking 1 f, 1 q, and 1 h. 7/204 Calculate prob of picking 1 p, 2 t, and 1 i when four letters picked without replacement from ttitttpiiipipttt. 3/13 Two letters picked without replacement from zvzvvvzvzvzvz. What is prob of picking 2 z? 5/26 Three letters picked without replacement from gzxxggxxzxzg. Give prob of picking 2 z and 1 x. 3/44 What is prob of picking 2 f and 1 c when three letters picked without replacement from qpqqppqffqbfqc? 3/364 What is prob of picking 3 n when three letters picked without replacement from {l: 4, z: 1, n: 8}? 28/143 Two letters picked without replacement from {i: 5, c: 3, t: 1}. Give prob of picking 2 i. 5/18 What is prob of picking 1 c, 1 e, and 1 m when three letters picked without replacement from {q: 1, j: 2, e: 1, f: 1, m: 1, c: 1}? 1/35 Three letters picked without replacement from {u: 6, w: 4, m: 1, k: 3, y: 2, j: 4}. Give prob of picking 1 k, 1 y, and 1 m. 1/190 Three letters picked without replacement from {z: 1, m: 4, q: 4, s: 6}. What is prob of picking 1 s, 1 m, and 1 z? 24/455 Four letters picked without replacement from mlfkkmmlllfz. What is prob of picking 1 z, 2 k, and 1 f? 2/495 What is prob of picking 2 f when two letters picked without replacement from fcfccfff? 5/14 What is prob of picking 1 k and 1 g when two letters picked without replacement from {g: 6, k: 10, p: 1}? 15/34 Three letters picked without replacement from {q: 1, z: 1, t: 4, n: 3, p: 7}. Give prob of picking 2 p and 1 t. 3/20 Two letters picked without replacement from {s: 4, q: 1, n: 2}. Give prob of picking 2 s. 2/7 Calculate prob of picking 1 y and 1 f when two letters picked without replacement from fofooyooofoyoooffof. 4/57 Calculate prob of picking 2 e when two letters picked without replacement from {m: 2, k: 4, e: 4}. 2/15 Calculate prob of picking 2 g when two letters picked without replacement from {c: 2, y: 1, l: 2, j: 5, s: 2, g: 5}. 5/68 Calculate pr	{ "pile_set_name": "DM Mathematics" }
52 Divide -400 by 80. -5 What is -4 divided by -256? 1/64 Divide -14241 by -101. 141 Divide 10625 by 625. 17 What is -54 divided by -6? 9 -7999 divided by 6 -7999/6 Divide -3353 by -3353. 1 Calculate 250 divided by -25. -10 Divide -4 by -55. 4/55 Divide -1190 by -5. 238 867 divided by 13 867/13 What is -10 divided by 37? -10/37 What is -4 divided by 872? -1/218 Divide 2 by 267. 2/267 Divide 796 by 1. 796 What is 5465 divided by -5? -1093 Divide 29556 by 2463. 12 Divide 8888 by 1111. 8 0 divided by -226 0 Calculate -332 divided by -5. 332/5 -1436 divided by -4 359 Divide -5 by -15. 1/3 What is 4 divided by 203? 4/203 Calculate 78 divided by -61. -78/61 What is -1089 divided by -2? 1089/2 -59 divided by 4 -59/4 Calculate 990 divided by -3. -330 Calculate 1022 divided by 7. 146 Calculate -1196 divided by -2. 598 What is 324 divided by -5? -324/5 Divide -2197 by -13. 169 What is -19 divided by 215? -19/215 Divide -25704 by 8568. -3 -1225 divided by -175 7 3328 divided by -64 -52 -4 divided by 254 -2/127 Divide 24 by -12. -2 Calculate -76 divided by -38. 2 Divide -6 by -19. 6/19 What is -98 divided by -5? 98/5 Divide -178 by 89. -2 Divide -12299 by -49. 251 Calculate 0 divided by -522. 0 Divide 316 by 2. 158 What is -258 divided by -1? 258 Divide -20510 by 14. -1465 Calculate -620 divided by -4. 155 Divide -1092 by -6. 182 Calculate -195 divided by -3. 65 167 divided by 3 167/3 1376 divided by -8 -172 -3684 divided by 2 -1842 What is 1815 divided by 55? 33 Divide -8820 by 7. -1260 Calculate -11 divided by 11. -1 Divide -2 by 1. -2 What is -216 divided by 3? -72 Divide -6 by 2261. -6/2261 What is -44 divided by -3? 44/3 Calculate 27 divided by -189. -1/7 What is 4 divided by -480? -1/120 2596 divided by -2 -1298 -748 divided by 3 -748/3 Calculate -5148 divided by -6. 858 Divide 2204 by 29. 76 Divide 1 by -62. -1/62 Calculate -25 divided by -348. 25/348 Divide -7147 by 4. -7147/4 What is 3 divided by -65? -3/65 What is 145 divided by 29? 5 What is -25 divided by 32? -25/32 What is -3 divided by 74? -3/74 Divide 1173 by 17. 69 Calculate 338 divided by -26. -13 Calculate -4 divided by 371. -4/371 Calculate -355 divided by -4. 355/4 Divide 1 by 766. 1/766 Divide 0 by -14. 0 Calculate 213 divided by -2. -213/2 Divide 476 by -28. -17 Divide -162 by -3. 54 Divide -15 by -249. 5/83 147 divided by -7 -21 Divide 0 by -1303. 0 What is 1104 divided by 2? 552 Calculate -17372 divided by 202. -86 Calculate -35 divided by 7. -5 Divide 9 by 1174. 9/1174 Calculate -9 divided by 7. -9/7 Calculate -361 divided by 6. -361/6 Calculate -900 divided by -18. 50 -22 divided by -98 11/49 28 divided by 400 7/100 9635 divided by 5 1927 Divide -666 by -2. 333 Calculate -1463 divided by -2. 1463/2 656 divided by -41 -16 What is -4 divided by -139? 4/139 Divide -6446 by 3223. -2 Calculate 111 divided by 5. 111/5 What is -2 divided by -10? 1/5 780 divided by 60 13 Divide -10 by -1. 10 What is -11 divided by -332? 11/332 -190 divided by -10 19 What is -8940 divided by -6? 1490 What is -6 divided by -34? 3/17 Divide -3 by 2981. -3/2981 -1310 divided by -262 5 Divide 155 by -59. -155/59 What is -3 divided by 68? -3/68 -504 divided by -5 504/5 What is -33930 divided by 13? -2610 What is 3096 divided by 24? 129 Calculate 10 divided by -207. -10/207 Divide 4 by 4223. 4/4223 Divide 25 by -2. -25/2 What is -9 divided by -169? 9/169 Calculate 1268 divided by -317. -4 What is 78 divided by 13? 6 0 divided by 36 0 -2700 divided by -150 18 Calculate -57316 divided by -2. 28658 Calculate 75 divided by 139. 75/139 210 divided by -5 -42 -18 divided by 79 -18/79 Calculate 3 divided by 17. 3/17 -640 divided by 7 -640/7 -3 divided by -943 3/943 19 divided by -8 -19/8 -1 divided by -183 1/183 What is -1444 divided by -4? 361 140 divided by -28 -5 -82 divided by -32 41/16 76 divided by 19 4 What is -1118 divided by 3? -1118/3 What is -27 divided by 6? -9/2 What is -17 divided by 43? -17/43 -5460 divided by 6 -910 What is 115 divided by 3? 115/3 What is 5 divided by -31? -5/31 What is 13 divided by 29? 13/29 What is -3 divided by 2? -3/2 Calculate 322 divided by -7. -46 Divide 3427 by 149. 23 39630 divided by 5 7926 What is 26559 divided by -8853? -3 What is 5 divided by -66? -5/66 What is -72 divided by -36? 2 Calculate 6077 divided by -6. -6077/6 17592 divided by 6 2932 Divide -222 by 3. -74 Divide 18 by 330. 3/55 What is 30 divided by 280? 3/28 Calculate 3768 divided by -3. -1256 -1285 divided by 5 -257 Divide -13 by 751. -13/751 2829 divided by 6 943/2 Divide 2066 by 2. 1033 -38 divided by -2 19 What is -1181 divided by 1? -1181 -2700 divided by 3 -900 Divide 4088 by 5. 4088/5 What is -519 divided by 3? -173 Calculate -91 divided by 4. -91/4 Calculate 16 divided by 2. 8 Divide 71 by -2. -71/2 10 divided by -131 -10/131 Calculate 6 divided by -943. -6/943 Calculate -19860 divided by -2. 9930 Calculate 3011 divided by 5. 3011/5 Divide -5484 by 4. -1371 -9 divided by -5 9/5 -749 divided by -749 1 Divide 16 by -444. -4/111 What is -40 divided by 3? -40/3 13 divided by -19 -13/19 -3 divided by 587 -3/587 What is 4 divided by -80? -1/20 Divide 4527 by -6. -1509/2 What is -7 divided by -15? 7/15 What is 64 divided by 16? 4 54 divided by -65 -54/65 Calculate -784 divided by 28. -28 Divide -172 by -4. 43 Divide 828 by 828. 1 What is -216 divided by -18? 12 4249 divided by -1 -4249 15320 divided by -4 -3830 What is -1688 divided by 4? -422 Divide -123 by -123. 1 3 divided by -149 -3/149 What is 0 divided by 43? 0 What is -295 divided by -59? 5 What is -12 divided by 31? -12/31 Divide -10 by -76. 5/38 Divide 39 by -3. -13 Divide -216 by 8. -27 Divide -4730 by 2. -2365 Divide 5 by 272. 5/272 Divide 904 by -113. -8 Calculate -222 divided by 1. -222 36 divided by 18 2 What is 1 divided by -172? -1/172 Calculate -37 divided by -2. 37/2 -4715 divided by -23 205 What is -14 divided by 2382? -7/1191 -37 divided by 16 -37/16 What is 2 divided by 3123? 2/3123 Calculate 2908 divided by -2. -1454 Divide -1751 by -17. 103 Calculate 14292 divided by 6. 2382 Divide -50 by 3. -50/3 Calculate -2 divided by 334. -1/167 -6416 divided by 5 -6416/5 -56 divided by 2 -28 What is -83 divided by -26? 83/26 -106 divided by -2 53 What is 6337 divided by 4? 6337/4 What is 12052 divided by -4? -3013 Divide -28 by -24. 7/6 Divide -5040 by 168. -30 Calculate -595 divided by 7. -85 Calculate -1240 divided by 8. -155 -15376 divided by -4 3844 -416 divided by 26 -16 What is 10410 divided by -2? -5205 What is 3308 divided by 4? 827 2331 divided by -111 -21 What is -686 divided by -98? 7 Calculate 590 divided by -6. -295/3 Calculate 630 divided by 6. 105 Divide -306 by 306. -1 Divide 1631 by 233. 7 What is -1891 divided by -8? 1891/8 What is 77 divided by 7? 11 Divide -1180 by -590. 2 Calculate -91775 divided by -5. 18355 -153 divided by 3 -51 -5 divided by 1431 -5/1431 Divide -394 by 2. -197 What is -5 divided by 2714? -5/2714 Calculate -3050 divided by 1525. -2 Calculate -1044 divided by -4. 261 Divide -4038 by 673. -6 Divide -1 by -433. 1/433 Calculate -597 divided by 4. -597/4 What is -2072 divided by 7? -296 Divide -2 by -565. 2/565 What is 1344 divided by 2? 672 Divide -120 by -40. 3 What is 2 divided by -229? -2/229 What is 11256 divided by 469? 24 What is 144 divided by -72? -2 Divide 11480 by 1. 11480 What is 474 divided by 3? 158 2 divided by 51 2/51 Calculate -8 divided by 197. -8/197 What is 8 divided by -8? -1 Divide -324 by -6. 54 Divide 24141 by -8047. -3 What is 5365 divided by -1? -5365 What is -449 divided by 449? -1 What is -3944 divided by 986? -4 Calculate 96 divided by 48. 2 Calculate -107 divided by 2. -107/2 -5 divided by -3906 5/3906 Divide 14790 by -1. -14790 Divide 12 by 90. 2/15 -1938 divided by 57 -34 57 divided by -1 -57 Calculate 18 divided by -2. -9 Calculate -1416 divided by -8. 177 20684 divided by 4 5171 What is -2576 divided by -2? 1288 What is 522 divided by -3? -174 What is -76 divided by -4? 19 What is -9 divided by 35? -9/35 Divide 45 by 21. 15/7 303 divided by -12 -101/4 Divide -4 by -175. 4/175 Calculate -5652 divided by 1884. -3 2 divided by 67 2/67 Calculate -259 divided by 37. -7 Calculate 3048 divided by 3. 1016 What is -467 divided by -3? 467/3 -8188 divided by -4 2047 Calculate 3 divided by	{ "pile_set_name": "DM Mathematics" }
uppose -2m = 4j - 40, m = -4j - 4m + 52. Calculate the remainder when n is divided by j. 5 Let o be (-24)/40 - (-18)/5. Suppose -j + 3j + 2f = 78, 122 = oj + 2f. Calculate the remainder when j is divided by 16. 12 Let a(h) = -2h + 70. Let f be a(0). Let d = -40 + f. What is the remainder when 58 is divided by d? 28 Let k(v) = -v + 2. Let w be k(2). Let r(j) = -j3 + j2 + j + 444. Let m be r(w). What is the remainder when m/18 + 1/3 is divided by 7? 4 Let v(w) = 2w*2 + 7w - 20. Calculate the remainder when v(6) is divided by -60-34/30. 22 Suppose 110t - 105t - 10 = 0. Suppose 0 = -4y + tw + 96 - 14, -3y = 4w - 67. Let u = 71 - 31. Calculate the remainder when u is divided by y. 19 Suppose 0 = 11f - 3f - 144. What is the remainder when 32 is divided by f? 14 Suppose -4m + 5z = -121, z = m - z - 31. Suppose -6g = 5 - m. Calculate the remainder when g is divided by 4. 0 Calculate the remainder when 2112/3 is divided by (0 - 8/(-18))/(14/63). 0 Suppose 788 = 7b - 339. What is the remainder when b is divided by 156? 5 Suppose -10s - 226 = -606. Calculate the remainder when 72 is divided by s. 34 Suppose 0 = 8h - 6h - 4. Suppose 0 = -4q - 5g - 16, 5q + 11 = hg - 6g. What is the remainder when 1 is divided by q? 0 Calculate the remainder when 5 - (-190)/63 is divided by 8. 4 Suppose 3r = -f + 6r + 14, 4r = 4. Calculate the remainder when 55 is divided by f. 4 Suppose 10w = 2285 - 545. Calculate the remainder when w is divided by 25. 24 Suppose 32l - 120 = 1288. What is the remainder when l is divided by 23? 21 Suppose 305f = 318f - 1157. What is the remainder when f is divided by 33? 23 Let g = 5 + 20. Calculate the remainder when (-3441)/1248/(-3) is divided by g. 24 Let t(x) be the third derivative of -x6/120 + x5/12 + x4/3 + 5x3/6 - x2. Calculate the remainder when 48 is divided by t(6). 14 Let r be -4 + 5 + 0 - 0 - 9. Let l be (-2)/3133. What is the remainder when 38 is divided by (l/r - 0)4? 5 Let c be (-2)/8 + 38/(-8). Let g = c - -35. Suppose 3z + v - 8 = g, -v - 58 = -5z. What is the remainder when 33 is divided by z? 9 Suppose 3k + 113 = 749. Calculate the remainder when k is divided by 54. 50 Suppose -o - 2o - 1605 = -3s, -4s = 3o - 2112. Calculate the remainder when s is divided by 19. 18 Let u = 4052 + -4026. What is the remainder when u is divided by (-4)/10 - (-204)/10? 6 Let t = 142 + -110. What is the remainder when t is divided by 12? 8 Let p(h) be the third derivative of h*5/30 + 3h*4/8 - 3h*3 + 13h2. What is the remainder when p(5) is divided by 13? 12 Let m = -8 - -15. Let j(b) = b3 + 16b2 + 27b - 11. Calculate the remainder when m is divided by j(-14). 1 Let j(s) = -15s3 - 4s*2 - s - 22. What is the remainder when j(-4) is divided by 22? 20 Let l(k) = 2k3 - k2 - 6k - 10. Calculate the remainder when 67 is divided by l(3). 16 Let t(n) = n + 1. Let y(i) = 51i - 3. Let k(c) = -4t(c) + y(c). What is the remainder when k(3) is divided by (-2)/(-3 + 5) - -35? 32 Let s = -2807 - -2827. Calculate the remainder when 173 is divided by s. 13 Suppose -2u = 4y - 124, -u + 2y - 43 = -125. Suppose 28 = 4j - u. What is the remainder when j is divided by ((-2)/(-4))/((-4)/(-72))? 7 Let b = 134 + -125. Calculate the remainder when b is divided by 5. 4 Let i = -79 - -188. What is the remainder when i is divided by 24? 13 What is the remainder when 2/(-7) + 933/7 is divided by ((-768)/896)/(4/(-126))? 25 Suppose -3v - 154 = -5t, 44t - 41t - 3v = 96. Calculate the remainder when 288 is divided by t. 27 Let i(r) = r*2 + 13r + 47. Calculate the remainder when 222 is divided by i(-11). 22 What is the remainder when 151 is divided by (-8)/28 + 20(-25)/(-35)? 11 Let l be ((-15)/25)/((-1)/5). Suppose 3g + p - 3p = 21, lg + 5p - 42 = 0. Calculate the remainder when 24 is divided by g. 6 What is the remainder when ((-11178)/115)/(2/(-5)) is divided by 89? 65 Let w = 34 + -24. Let o = w + 3. Let i(h) = -h3 + 6h*2 + h + 1. Calculate the remainder when o is divided by i(6). 6 Let c(o) = 5o*2 - 68o - 14. Calculate the remainder when 1173 is divided by c(14). 11 Let d(f) = f. Let p be d(3). Let g = p - 1. Suppose 0 = -gz + 3 + 19. Calculate the remainder when 31 is divided by z. 9 Let i(f) = f3 + 20f*2 + 18f - 16. Suppose -3z - 67 = 4a, -z + 3z - 6 = 0. Suppose m - 44 = -3m. What is the remainder when m is divided by i(a)? 2 Suppose 3t + l - 21 = 10, -3t + 26 = 2l. Let c(n) = -6n - 17 - 6n + 12n2 + n3 + 0n3 - 5n. Calculate the remainder when c(-13) is divided by t. 11 Let s = -346 + 388. What is the remainder when 209 is divided by s? 41 Suppose 2z - 92 = -3s, s - 7 = 4z + 19. Suppose -5f - 4j + 63 = -s, -3j = f - 23. Suppose -4v = -0v - 36. What is the remainder when f is divided by v? 8 Let c(p) = 34p - 7. Let f be c(-2). Let y = 139 - f. What is the remainder when y is divided by 31? 28 Let d(a) = -4a + 241. Calculate the remainder when d(16) is divided by 27. 15 Suppose -4s - 3j + 67 = 0, -5j - 7 = 2s - 30. What is the remainder when s is divided by 8? 3 Let j be 496 - (1 + 0 + -1)1. What is the remainder when 92 is divided by (j/48)/(2/6)? 30 Let j = 46 - 23. Let p = 730 + -724. What is the remainder when j is divided by p? 5 Suppose -75m = -90m + 3060. Calculate the remainder when m is divided by 54. 42 Let t(g) = 11g*2 + g. What is the remainder when t(1) is divided by 8? 4 Suppose -d = 2d - 126. Suppose 3n - 3a = 2n + 35, -a + 166 = 4n. Suppose -3f = 8 - n. What is the remainder when d is divided by f? 9 Let h(i) = -4i*2 - 49i. What is the remainder when 62 is divided by h(-12)? 2 Suppose 0 = -5w - 0w + 20. Suppose 0f + 2f - u = 56, -wf + 4u + 112 = 0. What is the remainder when 108 is divided by f? 24 Suppose -11c + 1561 = -4c. Suppose w + 37 = 5l - c, 5w = -2l + 104. Suppose -3z = -z - l. What is the remainder when 101 is divided by z? 23 Let w(x) = x*3 + 12x*2 + 5x - 20. Let p(z) = 2z3 + 24z*2 + 11z - 41. Let i(h) = 4p(h) - 9w(h). Calculate the remainder when i(-12) is divided by 15. 13 Calculate the remainder when (31/1)/(2/8) is divided by 119. 5 Calculate the remainder when 87 is divided by (62/14 - 3)7. 7 Let x = -127 - -130. Suppose 3c = -5g + 49, 0 = -xg + 3c + 26 + 13. What is the remainder when 2/4(1 + 81) is divided by g? 8 Suppose 3o - 4s = 20 + 13, s = o - 10. Calculate the remainder when 180 is divided by o. 5 Let b be -5 + 3 - (-200)/(-2). Let r be b/(-18) + (-2)/3. What is the remainder when r/10 - 181/(-2) is divided by 23? 22 Let k(n) = -2n3 - 17n*2 - 33n + 16. What is the remainder when k(-7) is divided by 63? 37 Let m(l) = -l*2 + 17l - 14. Let k be (-5 + 2 + -12)-15. Suppose -4u = -6n + 5n - 441, 2u = 5n + k. Calculate the remainder when u is divided by m(14). 26 Suppose 0 = -2a - 4z + 182, 4a - 583 + 159 = 4z. What is the remainder when a is divided by 21? 17 Suppose 18 = 13t - 7t. Calculate the remainder when 5 is divided by t. 2 Let y(d) = 16d - 298. What is the remainder when 59 is divided by y(19)? 5 Suppose 3t = 6t - 189. Let m = -54 - -70. Calculate the remainder when t is divided by m. 15 Let q(x) = x3 + 15x*2 + 15x + 17. Let l be q(-14). Let f(c) = 4c3 - 4c*2 + c - 1. What is the remainder when f(l) is divided by 15? 14 Calculate the remainder when 728 is divided by 28/3 + (-112)/(-42). 8 Let p(h) be the first derivative of -3 - 13/2h*2 - h. What is the remainder when 21 is divided by p(-1)? 9 Let v(f) = -7f - f + 3f3 - 5 - 2f*3 + 7f*2 + 0. What is the remainder when v(-5) is divided by (-2)/(2 - (-92)/(-44))? 19 Suppose 8z - 11z + 4w + 264 = 0, -377 = -4z - 3w. What is the remainder when z is divided by 24? 20 Let i be 6 - (-3 - (-3 - 4)). Suppose 2h - 190 = -ig - 38, h = -4g + 295. Calculate the remainder when g is divided by 19. 16 Suppose 136t - 84 = 130t. Let y = -89 - -186. What is the remainder when y is divided by t? 13 Let p(c) = 11c*2 + 17c + 27. Calculate the remainder when p(-4) is divided by 47. 41 Let m = -1636 + 2227. What is the remainder when m is divided by 23? 16 Suppose -2s = -s - 3. Suppose -c = q - s, 4c - 3q = 3c - 9. Suppose c = -a - 0*a +	{ "pile_set_name": "DM Mathematics" }
acement from {b: 1, z: 9, t: 5, i: 5}. What is prob of sequence bii? 1/342 Two letters picked without replacement from dmdddmdddm. What is prob of sequence md? 7/30 Calculate prob of sequence xz when two letters picked without replacement from {z: 6, x: 12}. 4/17 What is prob of sequence nw when two letters picked without replacement from {j: 5, k: 2, w: 3, n: 2}? 1/22 What is prob of sequence jffj when four letters picked without replacement from {f: 10, j: 9}? 45/646 Calculate prob of sequence ll when two letters picked without replacement from {v: 4, i: 1, g: 1, b: 2, l: 3}. 3/55 Calculate prob of sequence sn when two letters picked without replacement from gnnnnnnnnnsnglnllnsn. 13/190 Calculate prob of sequence mtj when three letters picked without replacement from jmjtptjjmtjjjjpj. 9/560 Two letters picked without replacement from xxxzxxzxxxxxzxxzzzx. What is prob of sequence zz? 5/57 Four letters picked without replacement from ofoffyfoffffof. Give prob of sequence yffo. 12/1001 What is prob of sequence vv when two letters picked without replacement from vavs? 1/6 Calculate prob of sequence st when two letters picked without replacement from vnsvntzw. 1/56 Two letters picked without replacement from sswsswwwwswwwwwwwwww. Give prob of sequence ws. 15/76 What is prob of sequence wv when two letters picked without replacement from tvwiititviittatii? 1/136 Calculate prob of sequence cn when two letters picked without replacement from tcctccnccccnccccnccc. 9/76 What is prob of sequence xgwg when four letters picked without replacement from jjwggcggcx? 1/420 Two letters picked without replacement from {p: 2, d: 1, q: 1}. What is prob of sequence pq? 1/6 What is prob of sequence acqa when four letters picked without replacement from qaqqqqcaqcqqqqqcaqq? 13/5168 Two letters picked without replacement from rrrmmm. Give prob of sequence mr. 3/10 What is prob of sequence pia when three letters picked without replacement from aqapipqqiipapa? 2/91 Four letters picked without replacement from {j: 1, u: 4, y: 2}. What is prob of sequence jyuy? 1/105 Two letters picked without replacement from bbbebebbbebeebbb. Give prob of sequence bb. 11/24 Calculate prob of sequence fta when three letters picked without replacement from {a: 4, r: 1, f: 2, t: 4}. 16/495 Two letters picked without replacement from irraaaaaaapiaaiiraa. Give prob of sequence ra. 11/114 Two letters picked without replacement from ehuhuhhhz. What is prob of sequence uh? 5/36 Calculate prob of sequence uuff when four letters picked without replacement from fuuffff. 1/21 What is prob of sequence uuc when three letters picked without replacement from ucccuuccuuucu? 21/143 What is prob of sequence tg when two letters picked without replacement from httgthtatathth? 1/26 What is prob of sequence rr when two letters picked without replacement from {r: 7, n: 1}? 3/4 Three letters picked without replacement from yppp. Give prob of sequence ppy. 1/4 What is prob of sequence eece when four letters picked without replacement from {c: 2, e: 5}? 1/7 Two letters picked without replacement from jjtcltt. What is prob of sequence lj? 1/21 Three letters picked without replacement from {i: 3, t: 2, s: 4, j: 2, c: 2}. What is prob of sequence ssj? 2/143 Three letters picked without replacement from wuemuhuwmwuwwcwu. Give prob of sequence cww. 1/112 Calculate prob of sequence jz when two letters picked without replacement from aizjgjiaaij. 3/110 Calculate prob of sequence pv when two letters picked without replacement from vpvvvvvvpvvvvvpv. 13/80 Two letters picked without replacement from demedmaam. What is prob of sequence em? 1/12 Two letters picked without replacement from {t: 10, s: 2}. Give prob of sequence ss. 1/66 What is prob of sequence lkpl when four letters picked without replacement from lkpplppkppplppps? 1/364 What is prob of sequence sn when two letters picked without replacement from {s: 2, y: 1, n: 1, p: 1}? 1/10 Three letters picked without replacement from {f: 3, s: 4, j: 4}. Give prob of sequence jff. 4/165 Three letters picked without replacement from {k: 4, w: 4, v: 1, g: 3, m: 1}. What is prob of sequence vwg? 1/143 Four letters picked without replacement from {y: 2, i: 1, p: 1, c: 1, j: 2, l: 2}. What is prob of sequence plil? 1/1512 What is prob of sequence ettt when four letters picked without replacement from {e: 4, g: 4, t: 4, v: 2}? 4/1001 Two letters picked without replacement from hihhzshih. Give prob of sequence si. 1/36 Two letters picked without replacement from onfbbku. What is prob of sequence ku? 1/42 Two letters picked without replacement from hevmliel. Give prob of sequence vm. 1/56 Two letters picked without replacement from gzzgggzzzzzzgzzggzgg. What is prob of sequence zg? 99/380 Three letters picked without replacement from aaaaaaaann. What is prob of sequence ana? 7/45 Two letters picked without replacement from {v: 1, l: 1, e: 1, f: 1, q: 1}. What is prob of sequence lv? 1/20 Two letters picked without replacement from {s: 2, u: 1}. What is prob of sequence ss? 1/3 Four letters picked without replacement from ffffzfzzfz. Give prob of sequence zzfz. 1/35 Three letters picked without replacement from vnrym. Give prob of sequence vmy. 1/60 Two letters picked without replacement from zzeezzzbuuzzuzzzbzzu. What is prob of sequence eb? 1/95 Calculate prob of sequence zl when two letters picked without replacement from {z: 1, l: 1, s: 1}. 1/6 Three letters picked without replacement from phxppwvxwvyv. What is prob of sequence pvh? 3/440 Calculate prob of sequence ccc when three letters picked without replacement from cxcxxxcxxxccccxxxxx. 35/969 Two letters picked without replacement from {i: 2, c: 5, l: 3}. What is prob of sequence lc? 1/6 Four letters picked without replacement from hzycczeqy. Give prob of sequence ezyq. 1/756 Calculate prob of sequence uyn when three letters picked without replacement from {n: 2, y: 1, u: 1}. 1/12 Two letters picked without replacement from nhntnnbhht. What is prob of sequence th? 1/15 Three letters picked without replacement from {h: 3, j: 6, c: 2, q: 1, m: 3}. Give prob of sequence qch. 1/455 What is prob of sequence voov when four letters picked without replacement from {v: 2, o: 3}? 1/10 Calculate prob of sequence sz when two letters picked without replacement from {s: 1, b: 7, z: 11}. 11/342 Calculate prob of sequence drr when three letters picked without replacement from vmredddvddmvmrredr. 1/68 Calculate prob of sequence nrnh when four letters picked without replacement from {n: 3, r: 4, h: 2}. 1/63 What is prob of sequence chhh when four letters picked without replacement from hdccph? 0 Calculate prob of sequence ny when two letters picked without replacement from yoewoyyoyyyeowwnw. 3/136 Four letters picked without replacement from nxxqnqnxnnnxnnnn. Give prob of sequence qxnq. 1/546 Three letters picked without replacement from yvxuyuuylxxlwyl. Give prob of sequence wvl. 1/910 What is prob of sequence sq when two letters picked without replacement from qcsaqassqccaacsswa? 5/102 Four letters picked without replacement from {e: 7, k: 5, i: 3, b: 2, s: 2, f: 1}. What is prob of sequence iksi? 1/1938 Two letters picked without replacement from bqekqmkz. Give prob of sequence mk. 1/28 What is prob of sequence ffvm when four letters picked without replacement from {h: 1, v: 2, m: 1, g: 2, f: 2}? 1/420 Four letters picked without replacement from {h: 1, w: 7, o: 2, v: 1, g: 2, p: 1}. Give prob of sequence vohp. 1/12012 Calculate prob of sequence aa when two letters picked without replacement from {j: 4, a: 7, d: 5}. 7/40 Calculate prob of sequence hpph when four letters picked without replacement from pphppipppphhphphp. 55/1428 Four letters picked without replacement from {o: 3, m: 4, a: 3, u: 2, b: 4}. What is prob of sequence muao? 3/1820 Two letters picked without replacement from ttttioi. What is prob of sequence tt? 2/7 What is prob of sequence dn when two letters picked without replacement from dudpuddnpp? 2/45 What is prob of sequence di when two letters picked without replacement from idxddxiixii? 3/22 What is prob of sequence ban when three letters picked without replacement from balobllanolnooblb? 1/255 Calculate prob of	{ "pile_set_name": "DM Mathematics" }
se Is 12966186757 composite? False Is 10550699 composite? False Is 17930997323 a prime number? True Is 87296603 a prime number? False Is 5253642737 a composite number? True Is 5564094409 a composite number? True Is 68960985187 prime? False Is 2135890147 a prime number? False Is 1059870353 a composite number? False Is 84517926299 prime? True Is 34305091547 prime? False Is 619487257 composite? False Is 5180499959 a composite number? False Is 12113335747 prime? False Is 1834665801 composite? True Is 56646061 composite? True Is 138754633981 prime? False Is 4714535461 composite? False Is 7711101079 a prime number? False Is 5793269998 a prime number? False Is 5013844169 prime? True Is 140473937 prime? True Is 645014069 a composite number? True Is 49109240837 a composite number? True Is 3942647417 a composite number? False Is 7475257759 prime? False Is 65402247419 prime? False Is 4057662451 a composite number? True Is 2461399963 prime? False Is 200241583513 a prime number? True Is 1793256851 a composite number? True Is 1094968262 composite? True Is 39071160757 prime? True Is 19748464387 composite? False Is 23098354091 prime? False Is 27792674527 prime? False Is 7870491661 a composite number? True Is 520452931 composite? True Is 13247660215 prime? False Is 10073576867 prime? False Is 3781085459 prime? True Is 5166091637 a prime number? False Is 205114482467 composite? False Is 49371593723 prime? True Is 701940499 prime? False Is 8182114483 composite? False Is 311281811 prime? False Is 19759185857 a composite number? False Is 338000777 composite? False Is 27076553747 a composite number? False Is 188793610799 a composite number? False Is 8937414835 composite? True Is 3107279191 prime? False Is 351802603 a prime number? True Is 122455016213 a prime number? False Is 5852486911 a prime number? True Is 68445586141 prime? True Is 97903633 a prime number? True Is 2924936774 prime? False Is 409253959 a prime number? True Is 351384035 composite? True Is 643853289 a prime number? False Is 7237558547 composite? True Is 9611233637 prime? True Is 274000841 composite? True Is 14469469159 a composite number? True Is 744619279 a prime number? True Is 2910699749 composite? True Is 1407802211 a composite number? False Is 61923978811 composite? False Is 78977080955 a prime number? False Is 6171010799 composite? False Is 485226197 composite? True Is 2349306371 prime? True Is 109684451 composite? False Is 4452878839 prime? True Is 5916390001 a prime number? True Is 18435180653 a prime number? True Is 9673763713 prime? True Is 94388377 prime? False Is 9311004589 composite? True Is 1954076083 a composite number? True Is 349680539 a composite number? True Is 304547158 a prime number? False Is 13117474147 a prime number? False Is 1916605687 prime? False Is 13818834941 composite? True Is 68785255843 composite? False Is 6051296827 prime? False Is 1291764277 a prime number? False Is 385488553 a prime number? True Is 33375101801 composite? False Is 5790335743 prime? True Is 20018123513 a composite number? True Is 105768110881 a composite number? False Is 48773333443 a prime number? False Is 1370324867 a composite number? False Is 2712942983 a composite number? False Is 4821917197 composite? True Is 66631280923 composite? True Is 4134317641 a composite number? False Is 206644423 a prime number? True Is 38138647 composite? False Is 9292863479 composite? True Is 4506377747 prime? True Is 5509227109 a prime number? True Is 30880561 a composite number? True Is 2190157441 composite? False Is 4110889469 a prime number? True Is 54870387619 a prime number? True Is 618326563 prime? False Is 6438364589 a prime number? False Is 116312971046 prime? False Is 735779273 a prime number? False Is 569202839 composite? False Is 56484366767 prime? True Is 3533098531 composite? False Is 639119939 prime? True Is 88281245231 prime? False Is 89790507251 prime? True Is 3522460969 prime? True Is 3846513367 prime? True Is 483769813 prime? True Is 1855713913 prime? True Is 1357689637 a composite number? False Is 9415966855 prime? False Is 1258581013 prime? True Is 77172852143 prime? True Is 29092012351 prime? False Is 29614478111 composite? False Is 11130808309 prime? False Is 4858589287 prime? False Is 605111959 prime? True Is 3613587791 prime? False Is 98886693581 a composite number? True Is 203666891 a composite number? False Is 108729181007 a composite number? False Is 11019845143 a prime number? False Is 546863741 a prime number? False Is 9442445911 a prime number? True Is 552029659 prime? True Is 1369736233 prime? False Is 6051937233 a composite number? True Is 4727411197 a composite number? False Is 698887573 a prime number? True Is 62798291 a prime number? True Is 4267607 prime? False Is 30166605257 prime? False Is 3236515193 a prime number? True Is 616199443 prime? False Is 841177489 a composite number? True Is 65455371217 prime? True Is 3391190533 a composite number? True Is 16672308997 prime? True Is 8335677551 prime? False Is 84159113 a prime number? False Is 14607678523 prime? False Is 3654246013 a prime number? False Is 2162525713 a composite number? True Is 2979511523 prime? False Is 9317075147 prime? True Is 1558977811 composite? False Is 12864247009 prime? False Is 250849163 a composite number? True Is 10520920073 composite? False Is 2363252503 a composite number? True Is 115533846589 prime? False Is 1752157577 composite? False Is 4992322337 a prime number? True Is 11684025929 a composite number? False Is 2215075613 composite? True Is 3532523497 prime? True Is 633824137 a composite number? False Is 57722989321 composite? False Is 165036625031 a composite number? True Is 11234964109 a composite number? False Is 4740077729 prime? True Is 197304109 prime? True Is 526725097 composite? True Is 7542789 a prime number? False Is 78441533374 prime? False Is 466256837 a composite number? True Is 8218837283 a prime number? True Is 223061003609 a composite number? False Is 5102250763 a composite number? False Is 11362862999 a prime number? False Is 15533633 a composite number? False Is 893942791 composite? True Is 583342633 prime? True Is 9695031721 a prime number? True Is 1031839537 composite? True Is 4886870551 prime? True Is 18627790921 prime? False Is 137089332311 a prime number? True Is 1947685541 prime? False Is 8666584279 a prime number? False Is 8890348331 composite? False Is 124631711 composite? True Is 32643480151 a composite number? False Is 968862781 composite? False Is 7081663 a composite number? False Is 35664415711 composite? False Is 617143811 prime? True Is 162090893 composite? True Is 5693763161 a prime number? True Is 166773419 prime? True Is 137047956709 composite? False Is 244414991 prime? True Is 2293510279 a prime number? True Is 52705940921 a prime number? False Is 2916583309 prime? False Is 2614956431 prime? True Is 4426534067 a prime number? True Is 65041623329 a prime number? False Is 8190542779 a composite number? True Is 11464178351 a prime number? False Is 1665074767 a prime number? False Is 247854559 a prime number? True Is 4907918293 a prime number? True Is 5170101226 a prime number? False Is 1586766761 a prime number? True Is 17087029027 a prime number? False Is 1078931927 composite? False Is 9162214547 prime? True Is 167642426623 composite? True Is 807242117 a prime number? False Is 24628681421 composite? True Is 240621799 a prime number? False Is 1022090581 a composite number? False Is 124841417 composite? False Is 756712241 a composite number? False Is 16183651609 a prime number? True Is 26034403139 a composite number? False Is 7431012703 composite? False Is 15356444757 a prime number? False Is 11333000969 prime? False Is 1390053163 a prime number? True Is 288615077 a prime number? True Is 2441177177 composite? False Is 41385451 prime? True Is 1228730617 a prime number? False Is 3204997933 a composite number? False Is 33776303009 a composite number? True Is 303119 a composite number? False Is 11624592026 a composite number? True Is 1326587099 composite? False Is 2788646893 a prime number? False Is 50372632253 a prime number? True Is 7506399947 composite? True Is 46297117423 a prime number? True Is 25409359697 a prime number? True Is 384258357011 prime? True Is 443	{ "pile_set_name": "DM Mathematics" }
when four letters picked without replacement from aaaa. 1 Two letters picked without replacement from {a: 1, w: 2, n: 2, x: 1, v: 1, e: 1}. Give prob of sequence wn. 1/14 Calculate prob of sequence iu when two letters picked without replacement from {u: 3, i: 3, w: 2}. 9/56 Three letters picked without replacement from kjiykjkkkqiqiqiijkqj. What is prob of sequence jyq? 2/855 Two letters picked without replacement from bttqqqtqhtqqqqq. Give prob of sequence tq. 6/35 What is prob of sequence vq when two letters picked without replacement from vgqksvkq? 1/14 Three letters picked without replacement from sfnjpfjn. What is prob of sequence psn? 1/168 Four letters picked without replacement from lllnlllnllnlll. What is prob of sequence llnl? 45/364 What is prob of sequence jxjj when four letters picked without replacement from {t: 1, j: 3, g: 2, s: 8, m: 1, x: 3}? 1/4080 Calculate prob of sequence we when two letters picked without replacement from {e: 2, n: 5, w: 4, j: 8}. 4/171 Three letters picked without replacement from {e: 1, f: 1, u: 4, q: 3, y: 1, x: 2}. What is prob of sequence qxx? 1/220 Two letters picked without replacement from {s: 1, n: 5, h: 1, p: 4, v: 1}. Give prob of sequence sv. 1/132 Three letters picked without replacement from mxnxfxxxmmmmmmmm. What is prob of sequence mfn? 3/1120 Four letters picked without replacement from {a: 10, d: 9}. Give prob of sequence addd. 35/646 What is prob of sequence yzf when three letters picked without replacement from {y: 2, e: 2, z: 2, f: 1, r: 1}? 1/84 What is prob of sequence vg when two letters picked without replacement from {v: 1, f: 5, g: 5}? 1/22 Calculate prob of sequence fryf when four letters picked without replacement from rffbyfrplpfy. 2/495 Two letters picked without replacement from eeqqqq. Give prob of sequence ee. 1/15 What is prob of sequence sbbs when four letters picked without replacement from bbbbbbbsbsbb? 1/66 Two letters picked without replacement from kkzzkzkzkkzzzzzkkzk. What is prob of sequence zz? 5/19 Three letters picked without replacement from {b: 4, i: 10}. Give prob of sequence ibb. 5/91 What is prob of sequence xxbx when four letters picked without replacement from bbbbbbbxxbbx? 1/220 Three letters picked without replacement from {r: 2, z: 2, f: 1, a: 1, k: 1, t: 1}. What is prob of sequence trt? 0 Calculate prob of sequence kaw when three letters picked without replacement from {w: 2, k: 4, x: 1, a: 1}. 1/42 Calculate prob of sequence tppt when four letters picked without replacement from tpppttptppptp. 28/429 Two letters picked without replacement from {g: 9, c: 2}. Give prob of sequence cg. 9/55 What is prob of sequence mmme when four letters picked without replacement from eemamemmem? 1/21 Calculate prob of sequence sccb when four letters picked without replacement from {i: 1, b: 1, s: 1, l: 5, c: 6, j: 3}. 1/1904 Calculate prob of sequence zf when two letters picked without replacement from ffttz. 1/10 Two letters picked without replacement from eeeeeeeeeqee. What is prob of sequence qe? 1/12 Three letters picked without replacement from cccqccqccccc. Give prob of sequence qcq. 1/66 Four letters picked without replacement from {w: 1, p: 1, u: 2, l: 1, m: 1, b: 1}. What is prob of sequence lumb? 1/420 What is prob of sequence fl when two letters picked without replacement from {n: 1, l: 1, h: 3, f: 3, o: 2, j: 1}? 3/110 Three letters picked without replacement from {x: 1, d: 6, j: 1, s: 1}. What is prob of sequence xsd? 1/84 Three letters picked without replacement from {f: 2, t: 2, j: 2}. What is prob of sequence fjf? 1/30 What is prob of sequence owkt when four letters picked without replacement from {w: 2, o: 1, i: 3, k: 4, t: 1, g: 1}? 1/1485 Calculate prob of sequence hhhh when four letters picked without replacement from hhhhhhh. 1 Three letters picked without replacement from {y: 1, f: 1, s: 5, v: 3, r: 1}. Give prob of sequence rfv. 1/330 Two letters picked without replacement from ffbf. What is prob of sequence bf? 1/4 Four letters picked without replacement from mssmmsmc. Give prob of sequence ssmc. 1/70 Four letters picked without replacement from vvnvnnznvvvvnvnnn. What is prob of sequence nnvz? 2/255 Four letters picked without replacement from {y: 6}. Give prob of sequence yyyy. 1 Two letters picked without replacement from ixiiibxxiqxx. Give prob of sequence bx. 5/132 Two letters picked without replacement from {b: 2, s: 4, u: 5, t: 2}. What is prob of sequence ut? 5/78 Calculate prob of sequence viv when three letters picked without replacement from viiiyvviiyyiv. 6/143 Two letters picked without replacement from {r: 1, s: 1, h: 4, j: 4}. Give prob of sequence jh. 8/45 What is prob of sequence rttr when four letters picked without replacement from rrttrtttrttwrrrtwrt? 14/323 Four letters picked without replacement from {t: 6}. Give prob of sequence tttt. 1 Four letters picked without replacement from nnnbnnnjmnbnn. Give prob of sequence njmb. 3/2860 Calculate prob of sequence by when two letters picked without replacement from bybbyy. 3/10 Calculate prob of sequence jwyy when four letters picked without replacement from {y: 3, j: 1, w: 1}. 1/20 What is prob of sequence pjwj when four letters picked without replacement from {w: 10, p: 1, j: 8}? 35/5814 What is prob of sequence ag when two letters picked without replacement from {g: 2, a: 1, f: 3, w: 1}? 1/21 Calculate prob of sequence lb when two letters picked without replacement from {l: 1, d: 3, z: 2, x: 5, b: 6}. 3/136 Calculate prob of sequence mmmm when four letters picked without replacement from {m: 5, b: 2}. 1/7 What is prob of sequence uuu when three letters picked without replacement from wwuuuuuwf? 5/42 Four letters picked without replacement from jsjsss. Give prob of sequence sssj. 2/15 Three letters picked without replacement from {c: 7, w: 4}. Give prob of sequence cwc. 28/165 What is prob of sequence kkr when three letters picked without replacement from kkkrkkkkkkkkrkkkrrk? 140/969 Calculate prob of sequence cccp when four letters picked without replacement from {h: 1, x: 6, c: 8, d: 2, p: 1}. 7/1530 What is prob of sequence ttc when three letters picked without replacement from {c: 3, t: 13, x: 2}? 13/136 Two letters picked without replacement from iiifooi. What is prob of sequence oo? 1/21 Calculate prob of sequence rc when two letters picked without replacement from crrcrcrrrrrrrrrcrcr. 35/171 Four letters picked without replacement from {v: 7, z: 9, r: 2}. Give prob of sequence vvzr. 7/680 What is prob of sequence maah when four letters picked without replacement from aahahahaahm? 1/66 Calculate prob of sequence ssi when three letters picked without replacement from sisssisiissofmofsss. 20/323 Three letters picked without replacement from {f: 3, k: 7, e: 1, l: 3, q: 1, z: 3}. Give prob of sequence lqe. 1/1632 Three letters picked without replacement from iiiiiyiiwiwiiyyy. What is prob of sequence wwy? 1/420 What is prob of sequence rcq when three letters picked without replacement from eejcqccnjcjrrececq? 1/204 Calculate prob of sequence ajf when three letters picked without replacement from pfapmjjjjjppzjzjpjjp. 1/760 Calculate prob of sequence gr when two letters picked without replacement from {g: 1, a: 4, l: 3, r: 2}. 1/45 What is prob of sequence sdsv when four letters picked without replacement from {d: 2, v: 1, s: 4, g: 2}? 1/126 Two letters picked without replacement from {w: 4, f: 8, j: 1}. What is prob of sequence wj? 1/39 Four letters picked without replacement from eacsmysmssssyym. Give prob of sequence cyss. 1/364 What is prob of sequence fffd when four letters picked without replacement from {f: 7, d: 4}? 7/66 What is prob of sequence inn when three letters picked without replacement from {q: 1, i: 2, b: 1, j: 2, n: 4}? 1/30 What is prob of sequence awo when three letters picked without replacement from wookookwaooak? 2/143 What is prob of sequence uu when two letters picked without replacement from ujuj? 1/6 What is prob of sequence cdac when four letters picked without replacement from cdaacacdggaagctac? 1/238 Calculate prob of sequence yssy when four letters picked without replacement from yuusuysyusuxuxx. 1/910 What is prob of sequence fxo when t	{ "pile_set_name": "DM Mathematics" }
l(d) = -9d3 - 5d*2 + d - 4. Let f(o) = 52o*3 + 28o*2 - 5o + 25. Calculate 6f(z) + 34l(z). 6z3 - 2z*2 + 4z + 14 Let f(v) = -2v2 + 6v + 9. Let t(m) = -4758m + 4757m + 68 - 68. Give -f(r) - 5t(r). 2r*2 - r - 9 Let u(o) = 8o*2 - 3o. Let g be ((-1)/6)/((-1)/210). Let c(a) = 95a2 - 35a. Calculate gu(w) - 3c(w). -5w2 Let y(b) be the third derivative of 5b*4/8 - 11b3/6 + b2. Suppose -19t - 21t + 2240 = 0. Let j(a) = -17 + t - 3a - 19 - 18. What is -11j(v) - 2y(v)? 3v Let m(k) = -2 - 1 + k*3 - 21207k + 3k2 + 21212k. Let c(w) = w3 + w2 + w. Determine -3c(n) + m(n). -2n*3 + 2n - 3 Let o(f) = 3f - 2. Let w(i) = -i3 - 70i*2 - 82i - 893. Let n be w(-69). Let l(y) = 2y - 2. Calculate nl(m) - 3o(m). -m - 2 Let b(a) be the first derivative of 16a*3/3 - 11a*2/2 - 5a + 2. Let t(p) = 230p - 657p - 3p2 + 203p + 1 + 226p. Determine 4b(w) + 22t(w). -2w*2 + 2 Let l(v) = -2v*2 - 1. Let u = -209 - -207. Let p(c) = -8c*2 - 9c + 31. Let g(o) = -4o2 - 5o + 17. Let z(y) = 11g(y) - 6p(y). Give uz(q) - 5l(q). 2q2 + 2q + 3 Let q(i) = -4i2 + 14i + 1. Let g(f) = -7f2 + 28f + 2. Suppose -39c + 45 + 36 = -12c. Give cg(z) - 5q(z). -z*2 + 14z + 1 Let b(x) = -9x2 - 610x - 95. Let n(a) = -6a2 - 406a - 68. Give -5b(u) + 7n(u). 3u2 + 208u - 1 Let p(a) = 23a2 - 17a + 11. Let o(g) = -3g2 - 3g. Give -6o(t) + p(t). 41t*2 + t + 11 Let r(k) = 257k - 20. Let l(x) = 258x - 14. What is 5l(f) - 4r(f)? 262f + 10 Let m(p) = -2p + 23. Let y(f) = f - 1. Calculate -3m(h) - 21y(h). -15h - 48 Let c = -19 + 13. Let f(i) be the third derivative of -5i4/24 - 4i*3/3 + 2296i*2. Let x(y) = -y - 1. Calculate cx(j) + f(j). j - 2 Let i = 55 - 55. Suppose i = 4q + 20, -2q + 10 = 5l + q. Let o(y) = 7y - 4. Let v(t) = -11t + 6. Give lv(h) + 7o(h). -6h + 2 Suppose 150y + 868 = 118. Let a(f) = -f3 + f2 - 1. Let o(p) = 4p*3 + 6p*2 - 6. Determine ya(l) + o(l). 9l3 + l2 - 1 Let p(c) = -7c*3 - 10c*2 - 26. Let z(g) = 3g*3 + 6g*2 + 13. Give 3p(q) + 5z(q). -6q*3 - 13 Let g be 4 + (-13)/((-182)/28). Let u(o) = -3o*2 + 8o - 7. Let z(a) = 9a2 - 23a + 20. What is gz(x) + 17u(x)? 3x2 - 2x + 1 Let f(u) = -284u2 - 15. Let r(s) = -284s*2 - 3s - 20. What is 4f(v) - 3r(v)? -284v2 + 9v Let m(i) = -3i - 15. Let u = 681 + -426. Suppose 15 = -254k + uk. Let v(h) = -1. What is kv(t) - m(t)? 3t Let z(u) = -13u*3 + 18u*2 - 18u - 5679. Let d(y) = 37y3 - 51y*2 + 51y + 17038. Give -6d(f) - 17z(f). -f*3 - 5685 Let b(w) = 36w + 75. Let d(l) = 7l + 24. Give 4b(f) - 13d(f). 53f - 12 Let n(z) = -17z + 544. Let r(y) = -14y + 541. Determine 7n(o) - 8r(o). -7o - 520 Let z(a) = -a. Let f = -4479 + 4480. Let d(n) = -6n*3 - 2n. What is fd(k) - 2z(k)? -6k3 Let f(d) = -d2 - 2d + 94. Let k be f(-11). Let y(q) = -29q2 - 6q - 10. Let x(p) = 19p2 + 4p + 7. Calculate ky(s) - 7x(s). 12s2 + 2s + 1 Let s(n) = n - 99. Let k(l) = -l + 50. Give -5k(v) - 3s(v). 2v + 47 Let w(v) = 4v*3 + 13v*2 + 13v + 13. Let n(p) = -p2 - p - 1. Let m(l) = -l2 + 12l - 105. Let s be m(9). What is sn(q) - 6w(q)? -24q*3 Let f(h) = 919h - 1. Let d(v) = 2284v - 2. Calculate 5d(t) - 12f(t). 392t + 2 Let d(i) = -6i2 + 4i + 699. Let z(j) = 14j2 - 10j - 1398. Determine 5d(b) + 2z(b). -2b2 + 699 Let b(v) = 3039v*2 - 61v - 32. Let u(l) = 608l2 - 11l - 6. Calculate -2b(w) + 11u(w). 610w2 + w - 2 Let g = -7 - -14. Let t(h) be the third derivative of -h4/6 + 5h*3/6 + 3h*2. Let a(r) = 95 + 9r - 29 - 29 - 23 - 25. What is gt(x) + 3a(x)? -x + 2 Let v(h) = -3 - 4 + 11h - 15h + 9. Suppose 3z - 23 = 3f - 2z, 0 = -2f - z - 11. Let d(p) = 3p - 3. What is fv(s) - 4d(s)? 12s Let x(f) = 208f3 + 13f. Let z(v) = 52v3 + 3v. Suppose 77n - 60 = 146n - 89n. Calculate nx(c) - 13z(c). -52c*3 Let d(x) = -3x - 4. Let f(y) = -51y + 122. Let m be f(-8). Let t(l) = -m + 532 + 0l + 2l. Let u = -8 + 3. What is ut(v) - 3d(v)? -v + 2 Let j(u) = 4u*2 - u - 5. Let h(d) = -11d*2 + 3d + 14. Let g be (-6)/10(0 - (-2190)/(-6)). Let r = 236 - g. Give rj(o) + 6h(o). 2o*2 + o - 1 Let k(z) = 1390z*3 + 46z*2 - 72z. Let l(j) = 155j3 + 5j*2 - 8j. Determine 3k(f) - 28l(f). -170f3 - 2f*2 + 8f Let a(d) = -9d3 - 10d*2 + 11d - 33. Let o(b) = 3b3 - b2 + 2b - 5. Calculate -a(p) + 6o(p). 27p*3 + 4p*2 + p + 3 Let u(k) = 4k*3 - 11k*2 + 6k. Let b(g) = 5g2 - 3g + 28g3 - 57g*3 + 27g*3. What is -5b(o) - 2u(o)? 2o*3 - 3o*2 + 3o Let r(f) = f*3 - 3f*2 - 36f + 48. Let d be r(7). Let i(j) = j*3 + 1. Let y(t) = -2t - 8. Calculate di(n) - y(n). -8n*3 + 2n Let p(y) = -22y3 + 38y*2 - 232y + 4. Let s(g) = -7g3 + 12g*2 - 77g + 1. Calculate -6p(h) + 19s(h). -h*3 - 71h - 5 Let o(k) = k2 - 1. Let t(l) = -l3 + 4l2 - 4. Let b(c) = 13c*2 - c + 7. Let r be b(-3). Let f = r - 128. What is ft(d) + 4o(d)? d3 Let h(u) = -3u + 0u2 + 29u*3 + 7u*2 + 26u*3 + 37u*3 - 91u3. Let t(x) = -x2 - x. Determine h(b) - 3t(b). b3 + 10b*2 Let d(x) = -40x*2 - 3. Let t(l) = 118l + 2955. Let o be t(-25). Let k(u) = 20u2 + 2. Calculate ok(i) + 3d(i). -20i*2 + 1 Let k(j) = 8j*3 - 3j - 1. Let p be (-1)/2 - 1265/(-230) - 2. Let z(n) = -n*3 + n + 1. Give pz(a) + k(a). 5a3 + 2 Let v(j) = -3j - 6. Let u be v(-4). Let f(n) = -un + 4 + 10n - 2n. Let k(d) = -d - 1. Suppose 0 = -l - 5m + 6, -5l + 4 + 2 = m. What is lf(h) + 3k(h)? -h + 1 Let r(v) = -10v + 5v - 2v + 1 + 6v + v2. Let l(t) = 2t*2 + 3t - 1. Let p(c) = -l(c) - 3r(c). Let o(k) = 11k*2 + 5. Give 4o(d) + 10p(d). -6d*2 Let a(t) = -65t*3 - 265t*2 + 55. Let c(b) = -9b*3 - 37b*2 + 8. Calculate 4a(n) - 29c(n). n3 + 13n2 - 12 Let q(k) = -k3 + 6k2 + 1. Let w(n) = 5n*3 - 24n*2 - 4. Suppose -15d - 78d = 837. Determine dq(x) - 2w(x). -x3 - 6x2 - 1 Let g(i) = i2. Let a be 9 - (7 + -13)-2. Let z(v) = v2. What is ag(l) + 15z(l)? 12l*2 Let k(r) = -16r*3 + 20r*2 + 20. Let w be (-2)/(-4)16. Suppose wm + 12 - 9 = 0. Let h(u) = -u3 + u2 + 1. Calculate mk(c) + 20h(c). -4c3 Let r be 4 - ((-429)/(-117) - 2/3). Let w(o) = -1 + r - 10 - 42o*2 + 44o*2. Let i(j) be the first derivative of j - 1. Calculate -8i(g) - w(g). -2g2 + 2 Let g be (-29)/4 - 2/(-8). Let l(o) = 9o + 15. Let t(c) = 9c + 1. Let w(v) = 23v + 10. Let q(u) = -2t(u) + w(u). Calculate gq(i) + 4l(i). i + 4 Let k(r) = -3r + 1. Let p(i) = -3i + 2. Suppose 0 = 16y - 12y - 8. Suppose -2j = yl - 0l + 14, 4l + 16 = 0. Let s = 0 - j. Determine sp(h) - 4k(h). 3h + 2 Let w(r) = -1321r3 + 2642r*2 + 1321r - 1321. Let u(p) = 2p2 + p - 1. Calculate -6605u(d) + 5w(d). -6605d*3 Let k(w) = -261w - 72. Let j(v) be the first derivative of -9v2 - 5v - 1400. Determine -72j(g) + 5k(g). -9g Let b(h) = -14600h*2 + 17520h - 52560. Let q(p) = p*2 - p + 3. Calculate -b(m) - 17520q(m). -2920m2 Let x(a) = 2a*3 + 57a*2 - 111a*2 - 2 - 7a*3 + 59a*2 - 3a. Let r(f) = -14f3 + 14f*2 - 8f - 5. Let u = 390 - 387. Calculate ur(b) - 8x(b). -2b3 + 2b2 + 1 Let f(n) be the first derivative of -n2 - 61. Let g(m) = -4m + 1. Let o = 59 - 64. Calculate of(d) + 2g(d). 2d + 2 Let b(g) = -2g3 - 11g*2 + 5g + 7. Let o(u) = -u*3 - 6u*2 + 3u + 4. Let p be 6358/(-18) + (-2)/(-9). Let t = -348 - p. Calculate to(r) - 3b(r). r*3 + 3r*2 - 1 Let b(d) = 1. Let q(k) = -k - 1. Suppose -4r + 5n - 12 = 0, 5r = 2n + 2n - 24. Let l be 5 + -3 + 11 + r. Calculate lb(f) + 5q(f). -5f Let c(s) = -6s*2 + 2s - 12. Suppose 43 = 12r + 31r. Let h(g) = -g*2 - 1. Give rc(p) - 5h(p). -p2 + 2p - 7 Let p(t) = -t + 2. Let r be p(-2). Let s(i) = -i*2 - 2. Let z(q) = -4q2 - 11. Let h(b) = -b2 + 14b - 35. Let l be h(13). Determine ls(f) + rz(f). 6f2 Let k = -7 - -13. Let a(o) = -o2 - 340o + 6086. Let j be a(17). Let g(c) = -3c*3 + c - 2. Let s(w) = 8w*3 - 3w + 6. Give jg(n) + ks(n). -3n3 - n + 2 Let d(q) = -2q*2. Let z(y) be the second derivative of 0 - 97y	{ "pile_set_name": "DM Mathematics" }
41w + 6. Let p be o(-6). Solve -6c + pc + 12 = 0 for c. 2 Let r(i) = 400i + 3612. Let f be r(-9). Solve 1312d - 1314d = -f for d. 6 Suppose 2a - 203 = 46b - 47b, -943 = -5b + 2a. Solve 188w - 12 = bw for w. -4 Suppose -14f = 2f - f. Suppose v = -4u + 2u + 11, u - 3 = f. Solve -6 = vc - 16 for c. 2 Let d = -863 + 874. Solve dr = -31 - 24 for r. -5 Suppose -g - 54w + 20 = -53w, 4 = 4w. Solve 0 = gs - 27s + 32 for s. 4 Suppose j - 223 = 9r - 8r, 2j + 4r - 452 = 0. Solve -j = -446b + 414b for b. 7 Suppose -h + 0l - 2l - 3 = 0, l = -2h + 3. Suppose -3c - hc = 54. Let q be (-4)/6(c - 3). Solve -3x + q = 23 for x. -5 Let o(l) = 14l - 476. Let y be o(34). Solve -26p + 71 + 7 = y for p. 3 Let x be 6/((4 - 1)(-6)/(-12)). Suppose -2 = 2s + 2a - 4, 3s = xa - 18. Let r = s - -6. Solve q = 7 - r for q. 3 Let a be (-217)/2 + ((-6)/4)/3. Let s = 120 + a. Suppose z + z + 3c = 17, s = 2z + c. Solve 0t = zt for t. 0 Let m be 2/((-3768)/(-1886) + 0 + -2). Let r = m - -949. Solve 18 = rw - 0w for w. 3 Let q(b) = -2b2 - 3b - 2. Let l be q(-2). Let j(n) = -2n + 4. Let g(a) = 3a - 8. Let z(m) = -3g(m) - 5j(m). Let u be z(l). Solve uc = -c + 2 for c. 2 Suppose 3m - 16 = -5c, -2m + 6 = -c + 2c. Suppose my + 8 = 6y. Solve 20 = -7b + yb for b. -4 Let z(y) be the third derivative of -y4/4 + 7y*3 + 36y*2. Let a be z(11). Let n be (-1)/8 + (-75)/a. Solve 8h - nh = 0 for h. 0 Let f = 15 - 12. Let d(q) = q2 + 13q - 27. Let j be d(-15). Suppose -2a = -5v + 78, v + 3v + ja - 67 = 0. Solve fn - v = -n for n. 4 Suppose -61f + 45f + 194f = 5340. Solve f - 47 = -17p for p. 1 Suppose -5i - 22 = -16i. Suppose u = 3s + 3, 4u + u - 15 = is. Solve 1 = 2r + u for r. -1 Let u(m) = -2m*2 - 3m + 3. Let b be u(-3). Let i be ((-2)/6)/(b/(-54)) - 1. Let d be 0/((0 + i/(-10))5). Solve dt = t for t. 0 Let f be -1 + 33/9. Let a be (-8)/36 - ((-752)/(-18))/(-8). Suppose 29 = 4q - 3g, 4q - 35 = -fq + ag. Solve o - qo = 0 for o. 0 Let j(u) = -120u - 50. Let k(a) = 7a + 3. Let n(f) = -2j(f) - 35k(f). Let v be n(-3). Suppose -vr = -19r. Solve r = -4d - 9 - 7 for d. -4 Suppose 1259s + 594 = 1277s. Solve 39 = 6i + s for i. 1 Let t = -49 + -11. Let k = -57 - t. Let y be 0 + (-16)/((-12)/k). Solve s = -ys + 20 for s. 4 Suppose -514s + 470s + 2992 = 0. Solve 44 = -6w + s for w. 4 Suppose -106 = -3o - 5l, -22l - 56 = -2o - 18l. Solve -3v = o - 26 for v. -2 Suppose -385a + 193 = -382a + 2r, -142 = -2a + 2r. Solve -75i + ai = -48 for i. 6 Suppose 0 = 146g - 139g + 5q - 598, 88 = g + 2q. Solve gk = 63k for k. 0 Suppose 2i - 141 = -131. Suppose -2s - 14 = -ic, -5s - 8 = -4c + 10. Solve 2 - c = -h for h. 0 Let k = -1607 - -2400. Solve 773 = 4f + k for f. -5 Let x(u) = -4u3 - 2u*2 + 6u + 7. Let n be x(-1). Suppose -3o = 3t + n, -5t + 3o = -2o - 5. Solve -4p - 8 = -tp for p. -2 Let q be 0 + (-2 - (-7 + -1)). Let u(h) = -h3 - 10h*2 + 7h - 5. Let p be u(-4). Let b = 145 + p. Solve 2m - q = -b for m. -5 Let u = -1003 + 1005. Suppose -3 = h - 2h. Suppose -4w + hw = 0. Solve c + 3 + u = w for c. -5 Let u = -47 - -56. Suppose q + 41 = 3y, -y - 7q + uq + 12 = 0. Solve -y = -8r - 46 for r. -4 Suppose -4i = -u - 376, 0 = -3u - 5i - 204 - 1009. Let x = -392 - u. Solve -m - x + 2 = 0 for m. -2 Let p be (3/(-2))/((-2)/(-4)). Let k(i) = 11i - 3. Let w(s) = -2s + 1. Let u(v) = -k(v) - 5w(v). Let j be u(p). Solve 10 = -3y + j for y. -3 Let q(o) = 230o + 1150. Let r be q(-5). Solve r = -42y + 18y for y. 0 Suppose -5f + 1 = 3n, 0 = 2f + 4n - 698 + 706. Solve 0 = fb + 12 - 10 for b. -1 Let l = 7 - 1. Suppose -2y = -l, 2u - 5y + 8 = -y. Let h(n) = n*3 - 32n*2 - 22n - 359. Let o be h(33). Solve -ur + or = -2 for r. -1 Let q = -50 - -70. Suppose 0 = -2a + 5a. Suppose 0s - 5f = s + 13, 4s - 4f - q = a. Solve 2 = d - s for d. 4 Let u = -443 - -453. Suppose -20n + un = 23n. Solve n = 4s + 16 - 8 for s. -2 Let v(g) = 29g2 + 103g + 14. Let l be v(-4). Solve 0 = 45s - 34s + l for s. -6 Suppose z = -2z, -5z - 20 = -l. Suppose o + l = 5o. Let j be o + -3 - 3/(6/(-4)). Solve -jf + 0 - 4 = 0 for f. -1 Let v = 9 + 68. Suppose -2c - w = 12, 5w - v + 17 = 5c. Let p be c - -9 - (-1 + 1 + -1). Solve 0 = -r + 2r + p for r. -2 Let v(f) = -f*3 + 3f*2 - 5f + 2. Let i be v(3). Let x(c) = -5c - 10. Let t be x(i). Suppose -75 = 52g - tg. Solve -y = 4y - g for y. 5 Let a(h) = 1. Let n(b) = 14b - 71. Let x(i) = -5a(i) + n(i). Let d be x(6). Solve 3 = 5c + d for c. -1 Suppose 8p - 23p = -8p - p. Solve -23c + 93 + 45 = p for c. 6 Let z(q) be the second derivative of -q4/12 - 4q*3/3 - 15q*2/2 - 96q. Let c be z(-5). Solve -h + ch = -2 for h. 2 Suppose -5c = 2j - 0j - 15, 5j + 6 = 2c. Suppose 2n - 5t + 7 = 26, j = t + 3. Suppose r = nq + q - 9, 0 = -2q + r + 5. Solve m = qm for m. 0 Let u = 17406 + -17242. Solve -156 = -8t - u for t. -1 Suppose k + 46 = 3l, -l - 68k = -69k - 14. Solve -18 = -lv + 25v for v. -2 Suppose 5v - 9v - 10 = -2q, -8 = 2v - 4q. Let k be (-2 - -2)v/(-8). Solve k = -8d + 7d for d. 0 Suppose 6u + 309 = 1431. Let m = u + -182. Solve -mq + 8q = -6 for q. -2 Let i = -6 + 8. Suppose -90v + 93v + 6 = 0. Let z be (-8 + 48/8)/(v + 0). Solve il = -5 + z for l. -2 Let s = 2 + 3. Suppose -4n = r - 9, 2r - 2 = 8. Suppose 0 = -2c - n + 3. Solve 0 = 2f + s + c for f. -3 Let t = 80 - -110. Suppose 0 = 4b - t - 2. Let a be 63/8 - (-6)/b. Solve a = 3h - 1 for h. 3 Let c be 1314/10 - 54/(-90). Let m = c + -132. Solve 2a + 0a + 10 = m for a. -5 Let o(u) = u3 - u2 - 17u - 1. Let c be o(5). Suppose 4x - c = 4n - 6n, 2x = n - 7. Solve -4z = -nz for z. 0 Let s(v) = -v*2 + 17v - 58. Let x be s(10). Suppose 36o = xo + 840. Solve -7z = -0z - o for z. 5 Let s = -10835 - -10892. Solve -109 = 13b - s for b. -4 Let m(o) = o3 - 7o*2 + o - 7. Let u be m(8). Let a be u/7 + ((-16)/(-14))/(-4). Solve -12p + 15p + a = 0 for p. -3 Let o be 18/(-8)-56627/66. Solve 1199u - ou = -14 for u. -7 Suppose -325 = -22m + 71. Solve -mv + 29 = -25 for v. 3 Let w(x) = -150x - 291. Let l be w(-2). Let t = -11 + 15. Suppose 0 = ta - la + 15. Solve a = -m - 2 for m. -5 Suppose 4f - 34 = 35u - 32u, 0 = f + 2u - 3. Suppose f = 3j - 2. Solve -w + 0w = -j for w. 3 Let q(u) be the second derivative of u*3/6 - 27u*2/2 + 175u. Let z be q(29). Solve -zm + 8m = 12 for m. 2 Suppose 23 = s + 3j - 25, -2j = -6. Suppose -38q = -sq + 1. Solve -4 - q = 5p for p. -1 Let u be 9/(-15)(-55 - 0). Let f = u + -29. Suppose 63 = fb + 3. Solve -2r = r - b for r. 5 Let h be 4(3 - (-8)/(-4)). Suppose -u - 2z = -6u + 20, 0 = hu + z - 3. Suppose j - 8 = 4n + n, un - 1 = -j. Solve js - 6s + 15 = 0 for s. 5 Suppose -6 = -5p - g, 5p = -2g + 69 - 67. Solve 0 = n + 3 + p for n. -5 Suppose 0 = 2q - w + 313, -34w = -3q - 32w - 471. Let p = q - -157. Solve 9 = py + 1 for y. 4 Let b(x) = -13x2 + 133x - 30. Let v be b(10). Solve v = -5t - 30t + 35 for t. 1 Suppose 5l = 4m - 65, 3m + 121 - 176 = 5l. Solve 1630 = mf + 1610 for f. 2 Let n(d) = -d2 - 44d - 250. Let r be n(-37). Suppose 21k = rk + 48. Let w be (1/1)/1 - -1. Solve -2i = wi + k for i. -1 Let g(a) = -5a2 + 17a + 6. Let w be g(4). Let d(z) = 5z2 + 32z + 15. Let q be d(w). Solve -28 = 5v - q for v. -5 Suppose -7v - 3 = 4. Let h be ((-4)/4)/(v/5). Suppose -5m - b + 23 = -2, -m + h = b. Solve -11 = mj + 9 for j. -4 Let i be 313/3 - ((-1)/(-3))/1. Solve 22p - i = 9p for p. 8 Let p(q) = -7q2 - 11q + 30. Let u be p(-3). Solve u = -6g - 755 + 749 for g. -1 Let w = -4113 + 4196. Solve wc = 85c + 8 for c. -4 Suppose l = -2t + 11, 9l = t + 5l + 8. Suppose 3o = -5v + 42, -tv - 28 = -5o + 42. Solve 0 = 12q - oq - 2 for q. -1 Let r(m) = -4m3 - 24m*2 + 24m - 9. Let u(w) = -3w3 - 22w*2 + 24w - 8. Let t(g) = 4r(g) - 5u(g). Let c be t(12). Solve ch - 3h + 2 = 0 for h. -2 Let h(l) = l + 9. Suppose 20 = -5k - 0k. Let z be h(k). Let o be -1 + 0 + -2 - 35/(-5). Solve 3s + z = -o for s. -3 Let t(o) = -2o - 12. Let h be t(-6). Suppose h = 4u - 3u - 5. Solve 2 = u*a - 3 for a. 1 Su	{ "pile_set_name": "DM Mathematics" }
in milliseconds? 12000 How many microseconds are there in 2.352646ms? 2352.646 What is 1/80 of a millennium in months? 150 How many centimeters are there in 0.8343583nm? 0.00000008343583 How many milligrams are there in 0.7492561 tonnes? 749256100 How many litres are there in 0.4237081 millilitres? 0.0004237081 What is one twentieth of a millisecond in microseconds? 50 How many grams are there in 0.980238kg? 980.238 How many months are there in thirteen eighths of a century? 1950 How many days are there in 748.1751 hours? 31.1739625 Convert 7685.1 minutes to days. 5.336875 How many litres are there in 4.309435ml? 0.004309435 What is 5.398952 kilograms in tonnes? 0.005398952 Convert 4.80155 weeks to microseconds. 2903977440000 What is 27/5 of a milligram in micrograms? 5400 What is 1/20 of a milligram in micrograms? 50 What is 60665.25 months in millennia? 5.0554375 What is twenty-nine halves of a year in months? 174 What is 0.4465218kg in milligrams? 446521.8 Convert 2.8185852 months to millennia. 0.0002348821 How many centuries are there in 119727.3 months? 99.77275 Convert 86.99157t to kilograms. 86991.57 What is 1458.046 kilometers in micrometers? 1458046000000 How many micrometers are there in sixty-one halves of a millimeter? 30500 How many hours are there in 3/7 of a week? 72 What is 37/5 of a milligram in micrograms? 7400 How many years are there in 5/4 of a millennium? 1250 What is three fifths of a day in seconds? 51840 What is one twentieth of a milligram in micrograms? 50 How many minutes are there in twenty-one halves of a hour? 630 Convert 85887.66 years to millennia. 85.88766 What is 6309.964g in nanograms? 6309964000000 Convert 0.9136282 millennia to months. 10963.5384 What is 4.23786 weeks in days? 29.66502 How many nanometers are there in 560.4639 meters? 560463900000 How many months are there in three sixteenths of a millennium? 2250 What is 1.191929 weeks in days? 8.343503 How many minutes are there in 1/4 of a week? 2520 What is 95.01576um in meters? 0.00009501576 Convert 5743.873 centimeters to nanometers. 57438730000 What is 18/5 of a millennium in centuries? 36 How many micrograms are there in 15/4 of a milligram? 3750 What is 0.9186462 micrograms in tonnes? 0.0000000000009186462 How many millilitres are there in three fifths of a litre? 600 What is seven halves of a litre in millilitres? 3500 How many minutes are there in 9.646837 hours? 578.81022 Convert 2894984.4 months to centuries. 2412.487 Convert 7.78166 litres to millilitres. 7781.66 What is 0.0893838 millilitres in litres? 0.0000893838 What is fourty-one halves of a centimeter in millimeters? 205 How many years are there in 17/2 of a decade? 85 What is 1/10 of a micrometer in nanometers? 100 What is 6/5 of a kilometer in meters? 1200 Convert 0.8851573 millilitres to litres. 0.0008851573 What is 21/5 of a century in years? 420 How many millilitres are there in five quarters of a litre? 1250 Convert 5.905958s to microseconds. 5905958 Convert 0.1186392 milligrams to nanograms. 118639.2 Convert 937899.4 days to nanoseconds. 81034508160000000000 How many nanograms are there in five eighths of a microgram? 625 How many micrometers are there in 966.3112km? 966311200000 What is 114312.7 weeks in minutes? 1152272016 Convert 74.79212kg to milligrams. 74792120 Convert 30250.01 litres to millilitres. 30250010 How many months are there in 11/4 of a year? 33 Convert 851.7162um to millimeters. 0.8517162 What is 0.0343525 kilograms in nanograms? 34352500000 What is 769548.3us in milliseconds? 769.5483 What is seven halves of a century in years? 350 How many micrograms are there in 37/5 of a milligram? 7400 Convert 1180019.988 seconds to weeks. 1.95109125 Convert 290.0922g to micrograms. 290092200 What is twenty-seven halves of a litre in millilitres? 13500 What is 25/2 of a gram in milligrams? 12500 How many minutes are there in 31/5 of a week? 62496 How many days are there in 14440650.3 seconds? 167.13715625 What is 21/2 of a litre in millilitres? 10500 How many months are there in 9098.751 centuries? 10918501.2 What is 695300.8ns in microseconds? 695.3008 What is twenty-one quarters of a millennium in months? 63000 What is seven sixths of a year in months? 14 What is 9.524927ml in litres? 0.009524927 Convert 811.632 hours to nanoseconds. 2921875200000000 Convert 8.63288 milliseconds to nanoseconds. 8632880 How many millilitres are there in 71/4 of a litre? 17750 What is 26/5 of a litre in millilitres? 5200 How many millimeters are there in 6.435139cm? 64.35139 What is 0.1968046 millilitres in litres? 0.0001968046 Convert 834806.9ml to litres. 834.8069 What is 31698002.7us in weeks? 0.00005241071875 What is twenty-seven fifths of a litre in millilitres? 5400 What is 5861.07 centuries in decades? 58610.7 How many months are there in 3/8 of a decade? 45 What is three eighths of a litre in millilitres? 375 How many milliseconds are there in 7/25 of a minute? 16800 What is five sixths of a week in hours? 140 What is 54/5 of a centimeter in millimeters? 108 What is eleven eighths of a micrometer in nanometers? 1375 What is 0.880808 litres in millilitres? 880.808 What is 1061.81 centuries in months? 1274172 What is 941628.7 decades in years? 9416287 How many litres are there in 58384.72ml? 58.38472 What is 11/2 of a microgram in nanograms? 5500 How many litres are there in 4122.887ml? 4.122887 How many kilograms are there in 4491.08t? 4491080 How many millilitres are there in 4338.392 litres? 4338392 What is three fifths of a milligram in micrograms? 600 Convert 3.456861ml to litres. 0.003456861 How many micrometers are there in 7/2 of a centimeter? 35000 Convert 7.521158 centuries to years. 752.1158 What is thirteen quarters of a millennium in years? 3250 What is 1/4 of a kilometer in meters? 250 What is 0.652183 nanometers in meters? 0.000000000652183 How many litres are there in 7099.913ml? 7.099913 What is 0.0298398 decades in millennia? 0.000298398 Convert 76702.27t to grams. 76702270000 How many years are there in twenty-five quarters of a millennium? 6250 What is 0.3161723 millilitres in litres? 0.0003161723 Convert 50080.37 tonnes to grams. 50080370000 How many kilograms are there in 79.39355ng? 0.00000000007939355 How many hours are there in 29/3 of a week? 1624 Convert 92.74745ng to kilograms. 0.00000000009274745 How many litres are there in 247.4338 millilitres? 0.2474338 How many millilitres are there in five eighths of a litre? 625 How many millimeters are there in 3/40 of a kilometer? 75000 What is 21/8 of a litre in millilitres? 2625 Convert 18456.44913s to weeks. 0.030516615625 How many millilitres are there in twenty-one quarters of a litre? 5250 Convert 741144.1 grams to nanograms. 741144100000000 What is 933516.4cm in meters? 9335.164 Convert 87558.17 micrograms to kilograms. 0.00008755817 How many nanoseconds are there in 3/40 of a microsecond? 75 What is 3.900357 millennia in centuries? 39.00357 Convert 0.636747 days to milliseconds. 55014940.8 How many microseconds are there in 572.0035ns? 0.5720035 Convert 0.735317kg to tonnes. 0.000735317 How many centuries are there in 4.75183 millennia? 47.5183 Convert 90.69747 weeks to nanoseconds. 54853829856000000 Convert 56948.1 nanograms to milligrams. 0.0569481 How many weeks are there in 1594.096119 seconds? 0.0026357409375 How many nanometers are there in 7214.256 millimeters? 7214256000 How many grams are there in 9/10 of a kilogram? 900 How many nanometers are there in 3/32 of a millimeter? 93750 What is 0.5062558 litres in millilitres? 506.2558 What is 1/20 of a gram in milligrams? 50 What is 955.5029mg in kilograms? 0.0009555029 Convert 144366.4404 microseconds to weeks. 0.000000238701125 Convert 62512.16 meters to nanometers. 62512160000000 How many minutes are there in two ninths of a day? 320 What is 5/6 of a day in hours? 20 Convert 11.03437 years to months. 132.41244 What is 20.604336 minutes in hours? 0.3434056 How many millimeters are there in twenty-one fifths of a meter? 4200 How many millimeters are there in 682.203 micrometers? 0.682203 How many decades are there in 5171.239 centuries? 51712.39 What is eleven eighths of a litre in millilitres? 1375 Convert 70.73689 decades to months. 8488.4268 Ho	{ "pile_set_name": "DM Mathematics" }
0.055 - -0.275. What is the third smallest value in -4, 0.4, i? 0.4 Let h = -37.5 + 36. Let d = h - -3.5. Let z be 40/(-12) + 2/6. Which is the third smallest value? (a) d (b) z (c) 0.2 a Let z = -5001/7 + 723. Let g = -167348 + 15227874/91. Let m = g + z. Which is the third biggest value? (a) m (b) 1 (c) -0.3 c Let h be 3/2 + 65/(-10). Let p be 17/((-833)/(-14))2-3. Which is the biggest value? (a) p (b) 0.2 (c) h b Let p = -345 - -345.5. Let i = -4.8 + -0.2. What is the third smallest value in -0.03, i, p? p Let p = 67 - 64. Let i = 4 + -7. Let t = i - -4. What is the second biggest value in p, -0.5, t? t Let k = -304 - -307. Which is the third biggest value? (a) 9 (b) 5/4 (c) k (d) 5 c Let c = 0.536 - -0.264. Let r = 14 + -3. Let v = -8 + r. What is the smallest value in -1/7, c, v? -1/7 Suppose -336 = -15y + 18y. Let q = y + 80. Which is the smallest value? (a) 1 (b) q (c) -2/3 b Let a = -371.6 + 372. What is the third biggest value in 3, a, 1, 5? 1 Suppose -3 = -r - 2w, -2r = r - 2w + 7. Let x be (-42)/68 + r/(-2). Which is the second biggest value? (a) 1 (b) 3 (c) 3/7 (d) x a Let x = -359.9 + 360. Which is the smallest value? (a) -2/9 (b) 3 (c) x (d) 0.09 a Let d be 42/70 - (-156)/(-235). Let a = d - 129/188. What is the smallest value in 0, a, 1/4? a Let u = -19 - -41. Let z = 20 - u. Which is the biggest value? (a) 1/7 (b) z (c) 3/2 c Let b = -16.9 + -31. Let g = 48 + b. What is the third smallest value in g, -5, -4, 3/2? g Let s = 2.1 - 2.5. Let r = -19.4 - s. Let l = 14 + r. Which is the second biggest value? (a) l (b) -0.2 (c) 5 b Let h = 117.8 - 117. What is the third smallest value in -1, -0.5, h? h Let w = 38 + -38.1. Let z = 141 - 143. What is the second smallest value in 0.9, -3, z, w? z Let m = -0.2 - 2.1. Let p = 2.7 - m. What is the smallest value in p, 1, -2/13? -2/13 Let g = 0.35 - 0.14. Let d = g + -0.39. Let l = -0.18 - d. What is the smallest value in -2, 3, l? -2 Let q = -2250 - -2247. Which is the third biggest value? (a) q (b) -2 (c) 0 (d) -17 a Let b(o) = -o2 - 3 - 8 - 98o + 90o. Let t be b(-5). What is the second smallest value in 11, 1, t? t Let p = 0.9 - 0.8. Let n = 0.43 + -0.36. Which is the second smallest value? (a) n (b) -0.2 (c) p a Let k = 10.8 - 7.1. Let v = k + -0.3. Let g = 3 - v. What is the third smallest value in 5, g, 0.7? 5 Let j be 0 + 2 + -32 + 30. Let s = 4 + -4.1. What is the smallest value in 23, j, s? s Let g = -18 + 17. Let i = 28 - 31. Which is the second smallest value? (a) g (b) 2 (c) 4 (d) i a Let v(n) = 56n + 669. Let y be v(-12). Let i = -15 + 10. Which is the third biggest value? (a) y (b) i (c) -4 (d) -0.3 c Suppose 0 = -735i + 738i. What is the second biggest value in 3, i, 59? 3 Let w be 0 + 43/24. Let t be 8/63 - 15. Let m = t + 6. Which is the third smallest value? (a) m (b) -0.2 (c) w c Let j = 43 + -52. Let z(m) = -m*2 - 11m - 13. Let s be z(j). Which is the third smallest value? (a) s (b) 0 (c) -5 a Let t = -58 + 65.14. Let j = -0.36 - t. Let v = 7 + j. Which is the third biggest value? (a) v (b) 3 (c) 4 a Let x be (-3 + 7/2)0. Suppose -8 = -2k - xk. Which is the third smallest value? (a) 0.1 (b) -2/9 (c) k c Let o = 12 + -11. Let w = 67 + -69. Which is the third smallest value? (a) o (b) -2/3 (c) w a Suppose -10y - 9 = -7y, -u = 5y + 10. What is the second smallest value in -0.1, u, 4/3? 4/3 Let r = 0.1381 - -0.0619. What is the biggest value in -26, 1/2, r? 1/2 Let h be ((-6)/12)/((-14)/340). Let z = -13 + h. What is the smallest value in -2/3, z, -2, 0.3? -2 Let r = 1041 + -1040.97. Which is the biggest value? (a) r (b) -0.09 (c) 4 c Let l be 2/40 - 2/8. Let z = -0.0422 - 4.9578. Which is the smallest value? (a) z (b) l (c) 0 a Let o = -0.4 + -0.6. Let i = -28 - -28.4. Let q = i - 0.7. Which is the third biggest value? (a) q (b) o (c) 0 b Let j = 26.05 - 0.05. Let s = j - 16. What is the third biggest value in -0.1, s, -1? -1 Suppose z - 3z + 8 = 0. Let h = -205.7 + 206. Let k be 1 - (-2)/(3 + -1). Which is the second biggest value? (a) z (b) h (c) k c Let j = -6/61 - 178/671. What is the third biggest value in j, -3, 2, 3/4? j Let i = 2 + -1.6. Let r = -311 - -621/2. Which is the third biggest value? (a) 2/21 (b) r (c) 2/3 (d) i a Suppose -843 = 3n - 858. Let p = -18 - -4. Let z be ((-12)/p)/2 - 0. What is the third biggest value in n, z, 3? z Let g = 163 + -649/4. Which is the biggest value? (a) 1/4 (b) -4 (c) g c Let c = -10 + -3. Let f = c + 12. What is the third biggest value in 3/8, -2, f? -2 Let p = 29 + -29.2. Let j = p - -0.1. What is the third biggest value in -0.02, 1/7, j, -1/3? j Let s = 128 - 1410/11. Let t be ((-9)/12)/(54/96). Which is the biggest value? (a) t (b) -0.4 (c) s c Let w = 0.16 - 0.16. Let z be 3/12 + (-3)/(-6). What is the third biggest value in -0.04, w, z? -0.04 Let l = 1.4 - -3.6. Suppose 9 = -5r - 2z - 12, 4z = -r + 3. Let n = 2 - 1. What is the third smallest value in n, l, r? l Let h = 7.31 - 7.71. Which is the third biggest value? (a) -0.3 (b) -0.05 (c) -8 (d) h d Let m(v) = -v - 4. Let l be m(1). Let j = 4 + 9. Let z be 5 + -3 + j/l. What is the third biggest value in 0.1, z, 3/5? z Let u = 1514 + -3027/2. Let j = 0 - 0.1. Which is the third biggest value? (a) u (b) j (c) 7 b Let s = -121 - -114. Let x = -2 + -1. What is the third smallest value in x, s, 1/4? 1/4 Let w be 78 + -81 - 1-5. Suppose 3v - 3b + 3 = 0, 5v - 2b - b + 5 = 0. What is the fourth smallest value in w, -5, 0, v? w Suppose -8 = 2h - m - 3, 12 = 4m. Let q be ((-4)/9)/(h/((-7)/(-14))). Which is the fourth biggest value? (a) 0 (b) 0.4 (c) 4 (d) q a Let u = 0.448 - 0.303. Which is the biggest value? (a) 0.2 (b) u (c) -1 a Let g = 249/7 + -1017/28. Which is the third smallest value? (a) -58 (b) g (c) -2/15 c Let t be ((-2)/7 + 0)1127/(-644). Which is the fourth smallest value? (a) -4/3 (b) -4 (c) -0.03 (d) t d Let t = -347 - -344. What is the fourth smallest value in 1/4, 28, -0.2, t? 28 Let c = -2.9 - -0.9. Let h be ((-2)/21)/(0 - 3/(-7)). What is the biggest value in h, c, 1? 1 Let v be (-3 - -12)/36(7 - 0). Let s = 13 - 10. Which is the fourth smallest value? (a) s (b) v (c) -2/11 (d) 2/9 a Let g = -34 + 22. Let l be (-1)/(((-3)/g)/1). Let v be (-2)/66/(-18). Which is the biggest value? (a) l (b) v (c) -2 b Let y = 3.6 + 12.4. Let t = -2/515 + -499/4120. Which is the fourth smallest value? (a) -3 (b) t (c) -5 (d) y d Let r be 330/(-40) + 3/2. Let p = r - -6. Which is the fourth smallest value? (a) 0 (b) p (c) 4 (d) 3/5 c Let d = -2628599/56098 + 1/8014. Let j = d + 47. Let h = -540.4 + 540.8. What is the second biggest value in j, h, -3? j Let n = -358 - -215.2. Let i = n - -143. Which is the biggest value? (a) i (b) -1/2 (c) -2/73 (d) 1/3 d Let h be ((-10)/50 - 0) + -1. Which is the biggest value? (a) -0.1 (b) h (c) -0.4 (d) 1/2 d Let z = -0.6 - 1.4. Let q = -2.5 - z. Let n = 108.4 + -109.4. Which is the biggest value? (a) n (b) -4 (c) q c Let k be 53/636(-2 - 0). Which is the second smallest value? (a) k (b) -41.8 (c) -2 c Let k = 3.53 - 3.492. What is the second biggest value in -5, -2/3, k? -2/3 Suppose -5u - 2 = 3o - 0u, -2u = 2o. Let y = -6 + 6.5. Which is the second biggest value? (a) 0.1 (b) y (c) 4/7 (d) o c Suppose -r = -2r - 2v - 5, 4r = -5v - 8. Let q = -2 + r. Let u = 223/21 + -31/3. Which is the smallest value? (a) u (b) 0.2 (c) q b Let o be (-10 - 591/(-63)) + 1/3. Let q = 7 + -1. Let x = -4 + q. Which is the third smallest value? (a) -2/9 (b) x (c) o b Suppose -4s = 4o + 12 - 36, -2o - 9 = -5s. What is the fourth smallest value in o, -13, 2, -3? o Let g be 1/(-6)(-27)/18. Let z = 11.6 - 13. Let w = z + 0.7. What is the second biggest value in -2, g, w? w Let k be 4/14 + (-32)/14. Let r be -4k/180-3. Let s = -21 + 20.7. Which is the second smallest value? (a) r (b) -1/3 (c) s c Let w = 12.06 - 10.26. Which is the fourth smallest value? (a) 0.4 (b) 0.1 (c) w (d) -5 c Let h be 3(16/32 + 6/(-8)). Let g = 26 - 26.1. Suppose -4x + 36 = 8. What is the biggest value in h, x, g? x Let g be 1/(-3)*-1 - 143/455. Which is the second biggest value? (a) -5 (b)	{ "pile_set_name": "DM Mathematics" }
root of 119453 to the nearest integer? 346 What is 529415 to the power of 1/3, to the nearest integer? 81 What is the cube root of 352819 to the nearest integer? 71 What is the cube root of 593447 to the nearest integer? 84 What is the fifth root of 204918 to the nearest integer? 12 What is 5928241 to the power of 1/3, to the nearest integer? 181 What is 265559 to the power of 1/3, to the nearest integer? 64 What is the cube root of 542214 to the nearest integer? 82 What is the seventh root of 114268 to the nearest integer? 5 What is the ninth root of 8504799 to the nearest integer? 6 What is the fourth root of 22113964 to the nearest integer? 69 What is the third root of 55003 to the nearest integer? 38 What is the square root of 5653233 to the nearest integer? 2378 What is 98553 to the power of 1/2, to the nearest integer? 314 What is the third root of 391640 to the nearest integer? 73 What is 439107 to the power of 1/2, to the nearest integer? 663 What is the cube root of 1561029 to the nearest integer? 116 What is the cube root of 1458737 to the nearest integer? 113 What is 3998462 to the power of 1/2, to the nearest integer? 2000 What is the square root of 6305651 to the nearest integer? 2511 What is the fifth root of 4727722 to the nearest integer? 22 What is 296092 to the power of 1/3, to the nearest integer? 67 What is the square root of 218001 to the nearest integer? 467 What is 2784644 to the power of 1/2, to the nearest integer? 1669 What is the fifth root of 11882384 to the nearest integer? 26 What is 863188 to the power of 1/8, to the nearest integer? 6 What is the sixth root of 4275486 to the nearest integer? 13 What is 657101 to the power of 1/5, to the nearest integer? 15 What is 10366976 to the power of 1/3, to the nearest integer? 218 What is the third root of 12525226 to the nearest integer? 232 What is 4813388 to the power of 1/6, to the nearest integer? 13 What is the third root of 1611437 to the nearest integer? 117 What is the cube root of 2373030 to the nearest integer? 133 What is the ninth root of 3487536 to the nearest integer? 5 What is the cube root of 283660 to the nearest integer? 66 What is the cube root of 1274553 to the nearest integer? 108 What is the square root of 38305 to the nearest integer? 196 What is the third root of 11489857 to the nearest integer? 226 What is 112082 to the power of 1/2, to the nearest integer? 335 What is the square root of 176238 to the nearest integer? 420 What is 312639 to the power of 1/4, to the nearest integer? 24 What is 6675934 to the power of 1/2, to the nearest integer? 2584 What is 18035507 to the power of 1/3, to the nearest integer? 262 What is 5707965 to the power of 1/9, to the nearest integer? 6 What is 3385651 to the power of 1/2, to the nearest integer? 1840 What is 609659 to the power of 1/2, to the nearest integer? 781 What is 622230 to the power of 1/3, to the nearest integer? 85 What is 317396 to the power of 1/10, to the nearest integer? 4 What is the cube root of 109197 to the nearest integer? 48 What is the sixth root of 333264 to the nearest integer? 8 What is 298560 to the power of 1/8, to the nearest integer? 5 What is the cube root of 56554 to the nearest integer? 38 What is the sixth root of 1663581 to the nearest integer? 11 What is 1189634 to the power of 1/6, to the nearest integer? 10 What is 5267994 to the power of 1/2, to the nearest integer? 2295 What is 1920897 to the power of 1/3, to the nearest integer? 124 What is the cube root of 2974590 to the nearest integer? 144 What is 47146 to the power of 1/2, to the nearest integer? 217 What is the fifth root of 2405703 to the nearest integer? 19 What is the cube root of 321719 to the nearest integer? 69 What is 1675109 to the power of 1/3, to the nearest integer? 119 What is 3728450 to the power of 1/3, to the nearest integer? 155 What is 970769 to the power of 1/3, to the nearest integer? 99 What is the square root of 1451580 to the nearest integer? 1205 What is the fifth root of 745671 to the nearest integer? 15 What is the square root of 14113595 to the nearest integer? 3757 What is the square root of 3336992 to the nearest integer? 1827 What is the fifth root of 61932 to the nearest integer? 9 What is the square root of 9190352 to the nearest integer? 3032 What is 14887756 to the power of 1/9, to the nearest integer? 6 What is 659005 to the power of 1/3, to the nearest integer? 87 What is 608218 to the power of 1/3, to the nearest integer? 85 What is 102755 to the power of 1/2, to the nearest integer? 321 What is 4283347 to the power of 1/2, to the nearest integer? 2070 What is the fourth root of 10915787 to the nearest integer? 57 What is 6664982 to the power of 1/6, to the nearest integer? 14 What is the square root of 7258762 to the nearest integer? 2694 What is 4601685 to the power of 1/5, to the nearest integer? 22 What is 7431619 to the power of 1/9, to the nearest integer? 6 What is the third root of 690237 to the nearest integer? 88 What is the eighth root of 1125323 to the nearest integer? 6 What is the square root of 121844 to the nearest integer? 349 What is 1142184 to the power of 1/6, to the nearest integer? 10 What is 4935858 to the power of 1/5, to the nearest integer? 22 What is 2016959 to the power of 1/5, to the nearest integer? 18 What is 1892451 to the power of 1/3, to the nearest integer? 124 What is 355976 to the power of 1/2, to the nearest integer? 597 What is the third root of 616739 to the nearest integer? 85 What is 17500745 to the power of 1/2, to the nearest integer? 4183 What is the ninth root of 13200009 to the nearest integer? 6 What is 3323644 to the power of 1/2, to the nearest integer? 1823 What is 33911594 to the power of 1/2, to the nearest integer? 5823 What is the ninth root of 23313337 to the nearest integer? 7 What is 25603299 to the power of 1/2, to the nearest integer? 5060 What is the seventh root of 239977 to the nearest integer? 6 What is 291654 to the power of 1/6, to the nearest integer? 8 What is the ninth root of 254715 to the nearest integer? 4 What is the cube root of 1357773 to the nearest integer? 111 What is the sixth root of 1887573 to the nearest integer? 11 What is 363942 to the power of 1/4, to the nearest integer? 25 What is the cube root of 86190 to the nearest integer? 44 What is the third root of 31732 to the nearest integer? 32 What is the fifth root of 10259597 to the nearest integer? 25 What is the cube root of 27839423 to the nearest integer? 303 What is the cube root of 2552127 to the nearest integer? 137 What is 3030606 to the power of 1/5, to the nearest integer? 20 What is the square root of 390588 to the nearest integer? 625 What is 8661214 to the power of 1/3, to the nearest integer? 205 What is the ninth root of 15655864 to the nearest integer? 6 What is the seventh root of 108606 to the nearest integer? 5 What is the square root of 6372929 to the nearest integer? 2524 What is 8564579 to the power of 1/7, to the nearest integer? 10 What is the eighth root of 230180 to the nearest integer? 5 What is the cube root of 19765551 to the nearest integer? 270 What is the third root of 4533502 to the nearest integer? 166 What is 157606 to the power of 1/3, to the nearest integer? 54 What is the cube root of 4504550 to the nearest integer? 165 What is 6654394 to the power of 1/2, to the nearest integer? 2580 What is the cube root of 216343 to the nearest integer? 60 What is the fifth root of 8348326 to the nearest integer? 24 What is the ninth root of 323497 to the nearest integer? 4 What is 681963 to the power of 1/2, to the nearest integer? 826 What is 553358 to the power of 1/2, to the nearest integer? 744 What is the cube root of 3666334 to the nearest integer? 154 What is 318053 to the power of 1/3, to the nearest integer? 68 What is the square root of 26254129 to the nearest integer? 5124 What is 806085 to the power of 1/2, to the nearest integer? 898 What is the third root of 672711 to the nearest integer? 88 What is the third root of 1492391 to the nearest integer? 114 What is 201292 to the power of 1/5, to the nearest integer? 12 What is the cube root of 154907 to the nearest integer? 54 What is the ninth root of 31633	{ "pile_set_name": "DM Mathematics" }
6 and -244? 278.7439955606 What is 379 + 28851.09874? 29230.09874 -1651499+-160.471 -1651659.471 -155580327655+6 -155580327649 1216185679160 + -10 1216185679150 4396348115118+-1.5 4396348115116.5 Put together 0.4 and 549351.270373. 549351.670373 Calculate -307 - 987378501. -987378808 Put together 316902 and 33.4642. 316935.4642 Calculate 0.3 + 238282997817. 238282997817.3 What is the difference between -25808930.5 and -0.04699? 25808930.45301 2.66 - 229.90825475 -227.24825475 Work out 0 + -3504577030076. -3504577030076 Calculate -1684808454 + -31. -1684808485 What is 1.3829 less than -40855677? -40855678.3829 What is 1500470 minus 147465870? -145965400 What is 43263602009327 + -4? 43263602009323 Calculate 0.061 + 4577335320.1. 4577335320.161 Calculate -43338231714 + -34. -43338231748 Subtract -759566726286 from 0.504. 759566726286.504 What is -0.4274 take away 488272.09569? -488272.52309 What is 18.1480970327 less than 0.06? -18.0880970327 Work out 8986757 + -1264. 8985493 What is 25953342775471 plus 0.04? 25953342775471.04 What is the difference between -103261277.3228 and -5? 103261272.3228 Sum -24986 and -204408035. -204433021 Calculate -647.4 + 3886024.443. 3885377.043 What is -1623522187958 - -0.036? -1623522187957.964 233567 + 89259 322826 What is -2617931300 less than -282056? 2617649244 What is 18332369166 plus 2? 18332369168 Work out -813171100105 - 59. -813171100164 Work out -1 + -96695781292.1. -96695781293.1 What is the difference between 166594.6 and -1901047? 2067641.6 Subtract -1389592 from 54604.8. 1444196.8 7629 + 0.139896972744 7629.139896972744 Work out -82783.9 - -1035952. 953168.1 What is 29263 less than -1029475? -1058738 What is 209418552479 take away 11? 209418552468 What is -200418 plus -0.09050965? -200418.09050965 Total of 0.17799 and 3599352.89. 3599353.06799 Sum -8815426120 and 1413. -8815424707 Put together -0.03015 and 2813225. 2813224.96985 Put together -66698653 and 582337. -66116316 What is 20102134701 less than -10.6? -20102134711.6 What is 3 plus -1817770673.45? -1817770670.45 What is -2 minus 14315.5834287? -14317.5834287 What is 48 plus -72.85326457? -24.85326457 What is the difference between -459232494.978 and 0? 459232494.978 What is -0.03 + 6219754436? 6219754435.97 Subtract -2321 from -6454692785. -6454690464 Add together -684.5 and 1962565381. 1962564696.5 What is the difference between 69576561 and 1.09605? 69576559.90395 Sum -2.5 and -1973515125607. -1973515125609.5 Subtract -702842556 from 0.710858. 702842556.710858 Work out 0.0449 + 13.9893288. 14.0342288 641698760974+-1 641698760973 Total of 33679.6 and -0.565969. 33679.034031 Work out -335764 - -258.837. -335505.163 -604783 + 377707282 377102499 What is -1368056317 take away 0.025? -1368056317.025 10.8665+12379933 12379943.8665 Calculate -18837 - -911416886. 911398049 Work out -998630361 - -0.046731. -998630360.953269 What is -40.75 minus 12755223.43? -12755264.18 21999+-20260.14141 1738.85859 What is the distance between 0.03 and 12982835256697? 12982835256696.97 What is 0 plus 216588104062.636? 216588104062.636 -872465324019+-4.98 -872465324023.98 Put together -30 and 476498836. 476498806 What is 4971064149 + 0.8718? 4971064149.8718 What is 1 take away -7182586145727? 7182586145728 Add 71807927759 and 1026. 71807928785 What is -86799155 plus -11.053? -86799166.053 Calculate -1439255895 + -1.2. -1439255896.2 What is the difference between -0.004 and -85145.036441? 85145.032441 -0.24 - 20571219874 -20571219874.24 Calculate -68.61 + 0.28435805. -68.32564195 What is 62.303583 + -203723? -203660.696417 Calculate 0.06501137196 + -0.07. -0.00498862804 Add 57.608724033 and 6858. 6915.608724033 What is -0.0512546 - 304.214? -304.2652546 Add -47785449 and 31077. -47754372 Subtract 42711.34998 from -8612. -51323.34998 What is the distance between 52409600684 and -0.8? 52409600684.8 What is -38882953191302.9 + 0.3? -38882953191302.6 Calculate -7908.6283524736 - -0.4. -7908.2283524736 What is the difference between -0.945 and -1.4275645882? 0.4825645882 What is 3137664472 - 8642? 3137655830 84047 - 1326612313 -1326528266 Subtract -105441 from 4366.69. 109807.69 Subtract -11124 from 5390564123. 5390575247 What is -880.65169008308 plus -0.2? -880.85169008308 What is -0.09 less than -17868352088666? -17868352088665.91 What is -3.083 + -20992854? -20992857.083 Work out -0.19603441 + -1041292. -1041292.19603441 What is 51178525557 less than -1876? -51178527433 -37 - 25781179513 -25781179550 What is 8 - -70562683258? 70562683266 Add 6 and -0.000987809784. 5.999012190216 Add -278716 and 27.67404. -278688.32596 What is -0.0925 plus -3497473078? -3497473078.0925 What is 596956 less than 33.33763? -596922.66237 What is the difference between 4414 and -0.5916661734? 4414.5916661734 What is 0.5673659 less than -0.04861? -0.6159759 What is 19145046163163 less than -0.2? -19145046163163.2 What is 172282 take away -31592375? 31764657 Work out 52033042 + -0.3562. 52033041.6438 What is the difference between 2.81451 and -1234240333? 1234240335.81451 What is -0.5 take away 14442002.8636? -14442003.3636 Subtract 3.4 from -12050254826. -12050254829.4 What is -0.134256594821 - 21.8? -21.934256594821 What is 1221551 less than -2738590? -3960141 What is 1.734187 plus 0.7375659? 2.4717529 What is 446956.279 take away -1821808? 2268764.279 Subtract 3220256559300 from 3. -3220256559297 What is -5 less than -2572898912530? -2572898912525 Sum -6362467574.9419 and -0.5. -6362467575.4419 Subtract -48 from -7561839758.6. -7561839710.6 Calculate -1726.299739064 + -13. -1739.299739064 Sum 0.088354 and -87201. -87200.911646 -122240416394 - -0.3 -122240416393.7 Calculate -738615483403 - 0.27. -738615483403.27 Add -28402931 and 191534. -28211397 0.3714814 - 1402 -1401.6285186 What is 232992.21626005 take away 1? 232991.21626005 What is the difference between -24697246 and 0.15663? 24697246.15663 -65.313046639 - -0.4 -64.913046639 Calculate -0.4 - -4611867342.08. 4611867341.68 What is 269 plus -2162.673495? -1893.673495 393 + -24023586727 -24023586334 1164939 - 1495316 -330377 What is -135 plus -42985.1409? -43120.1409 Calculate 437 - -0.1384957456. 437.1384957456 126214266241 + 58.5 126214266299.5 What is the distance between 161891 and -24030.9? 185921.9 What is 409 plus 7977504320? 7977504729 What is the distance between 51085 and 39490425? 39439340 Add 0.158534503 and -562520. -562519.841465497 Calculate -0.5 + -23794485271.09. -23794485271.59 What is -19151424447 plus 0.3? -19151424446.7 Add -64093.1 and -506949. -571042.1 What is 0.4 + -4985848830095? -4985848830094.6 Put together 1670731 and -111875247. -110204516 What is 609969 take away -2861.0342? 612830.0342 What is -38686.8493166 - 142? -38828.8493166 4749.9137477357 + 0 4749.9137477357 Total of 551124968 and -40.3. 551124927.7 Subtract 266.09 from -509960086. -509960352.09 What is 0.53118761061 - -8? 8.53118761061 What is -9006768239 minus -5? -9006768234 Put together 4 and -45126427592733. -45126427592729 Work out -73.927 - -400262. 400188.073 What is 571619653 - -38.86? 571619691.86 What is -79.6 minus 11643827216? -11643827295.6 Subtract -77.162798 from -12816.48. -12739.317202 Total of -50.4 and -2890819031. -2890819081.4 What is -10526227 plus 1160956? -9365271 3231831 + -1165174 2066657 -0.05546425 + -0.109604 -0.16506825 Total of 2101815269720 and 1.5. 2101815269721.5 What is the distance between -45973.55040134 and -0.2? 45973.35040134 Work out 293803.942927 + -5.4. 293798.542927 What is the distance between -0.5 and 780923155539? 780923155539.5 What is -271 plus 10.643943907? -260.356056093 What is -4 - -0.480281119483? -3.519718880517 3123641163+1.659 3123641164.659 Calculate -497.9 + -14046244. -14046741.9 -40.3+585707087 585707046.7 -38864.0615+-3898 -42762.0615 What is 1136 + 33157312543? 33157313679 -0.0664+-8916790.82298 -8916790.88938 Sum -5180538201791 and 24. -5180538201767 Sum 1718787200 and 0.1. 1718787200.1 Calculate -38.3 - 2162.1437333. -2200.4437333 Work out 781.865471 + 15. 796.865471 What is 98108764663 minus -0.6? 98108764663.6 Work out 830 - -6535291.728. 6536121.728 Calculate -555.98 + 819672. 819116.02 Add together -0.3 and 591676.3962. 591676.0962 -255271663 - -6994 -255264669 Subtract -3.0041	{ "pile_set_name": "DM Mathematics" }
6 Let g(k) = 8k. Let n(v) = -57v. Let y(b) = 15g(b) + 2n(b). Let j(r) = -2r2. Give j(y(q)). -72q*2 Let c(p) = 2p2. Let y(i) be the third derivative of -i4 - 12i2. What is y(c(u))? -48u*2 Let d(q) = 10q*2. Let k(n) = -2n + 1. What is d(k(l))? 40l2 - 40l + 10 Let o(p) = -2p2. Suppose -3h = 2u + 6, -4u + 23 = -5h - 3u. Let k(t) = 25t + 9. Let i(m) = -12m - 4. Let f(q) = hk(q) - 9i(q). Calculate f(o(w)). -16w2 Let d(t) = -t + 11. Let p(j) = -5j. What is d(p(c))? 5c + 11 Let f(o) = 8o - 6. Let d(x) = 14x - 11. Let t(w) = -6d(w) + 11f(w). Let n(i) = -11i*2. Determine t(n(b)). -44b*2 Let b(r) = -2r - 2. Let w(v) be the third derivative of -v*4/12 - 45v*2. Determine b(w(j)). 4j - 2 Let o(q) = 80q. Let t(j) = -8j*2. What is t(o(c))? -51200c*2 Let v(d) = -4d + 3d + 0d - 4d. Let o(j) = -j2. What is o(v(q))? -25q*2 Let a(p) = 2p*2 + 3p*2 + 7p - 7p. Let n(y) = 4y*2. What is a(n(s))? 80s*4 Let i(w) = -3w*2 + 1 - 1. Let b(c) = 13c - 9. Let s(v) = -6v + 4. Let t(p) = 4b(p) + 9s(p). Determine i(t(u)). -12u*2 Let o(k) = 44k. Let v(q) = 6q + 1. Give v(o(x)). 264x + 1 Let s(i) = i*2. Let k(o) = -17o*2 + 4o - 4. Let z(c) = -c + 1. Let q(d) = -3k(d) - 12z(d). Determine q(s(t)). 51t4 Let j(q) = -q2. Suppose 6d = 2d. Let l(u) = -u2 - 6u - 2. Let a be l(-5). Let z(v) = av + v2 - 3v + dv2. What is z(j(n))? n4 Let d(h) = -8h*2 + 3h. Let n(t) = 7t2 - 4t. Let z(b) = 4d(b) + 3n(b). Let w(x) = x*2. Determine w(z(s)). 121s*4 Let y(c) = -8c. Let l(k) = -k*2 + k + 1. Let o(w) = -4w*2 + 3w + 3. Let p(m) = 6l(m) - 2o(m). Calculate p(y(t)). 128t2 Let j(f) = 2f*2. Let b(c) = 2c + 384. Calculate j(b(v)). 8v2 + 3072v + 294912 Let s(u) = 3u. Suppose -3d + d + 2 = 0, 2d = -5p + 17. Let o(k) = pk - 3k + 11k2 - 10k*2. Give s(o(w)). 3w2 Let l(d) be the second derivative of d4/12 + 16d. Suppose 0 = -2t + 8 + 4. Let o(a) = -a + 4a + ta. Give l(o(u)). 81u2 Let h(a) = 2a. Let k(z) = 14z - 5. Let b(v) = -22v + 8. Let j(n) = 5b(n) + 8k(n). Give j(h(o)). 4o Let b(m) = 77m. Let w(f) = 5f + 7. Let r(s) = -2s - 3. Let d(k) = -14r(k) - 6w(k). What is b(d(z))? -154z Let l(w) be the third derivative of -w5/60 + 4w*2. Let r(m) = -9m*2 + 11m. Let b(o) = -5o2 + 6o. Let x(c) = 11b(c) - 6r(c). Determine x(l(t)). -t*4 Let c(p) = -4p. Let o(r) = -2r2 + 373r. Give c(o(v)). 8v2 - 1492v Let z(b) = 37b. Let i(t) = -6t. Give i(z(n)). -222n Let s(r) = 30r*2. Let y(j) = -12j*2 - 1. Calculate s(y(a)). 4320a*4 + 720a*2 + 30 Suppose -5n + 30 = 5a, 2a - 2 = -0. Let j(w) = -2w + 3. Let g(z) = 5z - 5. Let t(x) = nj(x) + 3g(x). Let r(c) = 2c. Determine r(t(l)). 10l Let d(t) = -5t2 + t2 + 2t*2. Let x(n) = -14 + 5n*2 + 14 - 19n*2. What is d(x(m))? -392m*4 Let z(g) = 7g*2. Let m(a) = -11a*2. Calculate z(m(i)). 847i*4 Let x(y) = 10y - 10y - 5y*2 + 8y*2. Let m(s) = 10s. What is m(x(h))? 30h2 Let w(x) = -2x*2. Let c(r) = -2r - 65. Give c(w(k)). 4k2 - 65 Let y(c) = -2c. Let a(m) = -12m + 3. Let q(o) = -17o + 5. Let z(w) = 33w - 10. Let i(r) = -13q(r) - 6z(r). Let s(n) = 5a(n) + 3i(n). Calculate s(y(j)). -18j Let g(h) = -4h2 + 6. Let i(l) = 3l*2 - 5. Let k(p) = 5g(p) + 6i(p). Let y(z) = 29z*2. Calculate k(y(v)). -1682v4 Let q(t) = -t2. Let y(d) = -12d + 27d - 10d. Determine q(y(w)). -25w*2 Let s(p) = p - 4. Let n(l) = -33l. What is s(n(a))? -33a - 4 Let n(t) = 13t. Let c(k) = 7k + 5. What is c(n(l))? 91l + 5 Let x(u) be the second derivative of u*3/6 + 12u. Let n(k) = -k - k + k + 0. Determine n(x(j)). -j Let a(b) = -7b2 - 6b. Let g(i) = i*2 + i. Let m(x) = a(x) + 6g(x). Let k(p) = 6p2 - 3p*2 + 2p*2. Determine k(m(h)). 5h*4 Let t(i) = -9i*2 - 11i + 11. Let u(x) = -3x2 - 4x + 4. Let r(p) = 4t(p) - 11u(p). Let w(d) = 2d. Give r(w(o)). -12o*2 Let y(c) = -c. Let x(i) = -2i - 15876. What is y(x(b))? 2b + 15876 Let i(m) be the first derivative of m4/12 - 5m*2/2 - 1. Let q(j) be the second derivative of i(j). Let d(p) = 0p - 2p + 7p. Determine d(q(s)). 10s Let t(z) = -z - 1. Let m(v) = 4v. What is m(t(w))? -4w - 4 Let q(f) = 18f*2. Let k(d) = -8d*2. What is k(q(z))? -2592z*4 Let b(w) = -1531w. Let j(r) = 2r. What is b(j(s))? -3062s Let d(h) = -13h. Let p(x) = -4x*2 + 18x. Calculate d(p(i)). 52i2 - 234i Let p(z) = 8z. Let x(d) = -15d*2 + 11d + 11. Let c(g) = 8g2 - 6g - 6. Let w(t) = -11c(t) - 6x(t). Determine p(w(r)). 16r2 Let k(j) be the third derivative of -j4/24 + j2. Let x = 54 - -49. Let l(d) = 103 - x + d2. Determine l(k(y)). y2 Let i(d) = -3 - 67d + 3 + 63d. Let h(v) = v2. Calculate i(h(x)). -4x*2 Let h(i) = 4i. Let v(b) = 2b2 - 15. Calculate v(h(y)). 32y*2 - 15 Let b(r) = 6r*2. Let i be (-412)/(-10)(-15)/(-6). Let m(l) = i - l - 103. What is b(m(w))? 6w2 Let d(r) = 113r - 7. Let b(j) = 38j - 2. Let n(z) = -7b(z) + 2d(z). Let g(k) = -2k. Give n(g(p)). 80p Let m(s) = -2s*2 + 2s. Let p(j) = 4j2 - 5j. Let k(u) = -5m(u) - 2p(u). Let d(v) = 85v - 32v - 30v - 27v. Give d(k(t)). -8t2 Let z(o) = -25o. Let v(l) = 173l. Calculate v(z(s)). -4325s Let q(n) = -2n2. Let y(f) = 1521f. Calculate q(y(z)). -4626882z2 Let y(u) = 7u - 23u - 17u. Let v(x) = 2x2. Determine v(y(d)). 2178d2 Let s(x) be the first derivative of -x2 - 3. Let w(u) be the first derivative of u*2 - 4. What is s(w(g))? -4g Let b(s) be the second derivative of -s*3/3 - 2s. Let x(p) = 0p - p - 2p + 5p. Calculate x(b(m)). -4m Let k(f) be the first derivative of -f*2/2 + 2. Let d(h) = 2h*2. Give k(d(t)). -2t*2 Let k(w) be the second derivative of -5w*3/6 + 2w. Let i(q) = -3 + 5q + 3 - 4q. Give k(i(n)). -5n Let j(u) = -u. Let y(p) = 8p. Let o(l) = 30j(l) + 5y(l). Let g(z) = -2z. Give g(o(s)). -20s Let q(s) = -40s. Let i(t) = -184t. What is q(i(a))? 7360a Let p(j) = -2j*2. Let f(d) = -5d - 12. What is p(f(c))? -50c2 - 240c - 288 Let r(v) = 53v. Let c(y) = -36y*2. Give c(r(i)). -101124i2 Let o(k) = -k2. Let a(d) = 15d - 27. What is o(a(p))? -225p*2 + 810p - 729 Let k(p) = -p*2. Let r(q) = -q + 1. Let g(o) = 7o - 4. Let y(w) = 3g(w) + 12r(w). What is k(y(i))? -81i2 Let p(h) = -785h. Let n(t) = 2t. What is n(p(s))? -1570s Let r(x) be the third derivative of x*5/20 - 30x*2. Let f(a) = -3a*2. Determine r(f(v)). 27v*4 Let l(a) = -a - 4a + 2a. Let u(r) be the second derivative of r4/12 - 9r. Determine l(u(k)). -3k2 Let r(c) = -c2. Let i = 13 + -55. Let o be i/(4/(-2) - -1). Let g(p) = p + o - 42 + 3p. What is r(g(x))? -16x2 Let t(g) be the first derivative of -5g*3/3 + 1. Suppose w + 0 - 4 = 0. Let u(k) = -wk*2 + 3k*2 + 3k*2 + 0k*2. Give u(t(m)). 50m*4 Let b(p) = p. Let u(i) = -2116i*2. What is b(u(r))? -2116r*2 Let t(y) = 2y*2. Let g(w) = -814w. Calculate g(t(n)). -1628n2 Let u(n) = n2. Let l(p) = -p2 + 2p + 2. Let j(f) = 2f2 - 7f - 6 + f*2 - 1. Let z(y) = 2j(y) + 7l(y). Calculate u(z(g)). g4 Let a(t) = -21t*2 + 18t - 36. Let q(y) = -y*2 + y - 2. Let d(j) = a(j) - 18q(j). Let i(c) = 23c. Determine d(i(h)). -1587h2 Let i(l) be the first derivative of -l2/2 - 2l + 1. Let p(s) = -s - 5. Let b(x) = 5i(x) - 2p(x). Let k(u) = 3u*2 - 9u + 9u. Calculate k(b(y)). 27y*2 Let x(q) = -21q. Let r(s) = -s*2. What is r(x(a))? -441a*2 Let d(q) = 57q*2 - q. Let l(m) = 20m. Determine l(d(a)). 1140a2 - 20a Let s(p) be the second derivative of -8p4/3 - 17p. Let x(o) = 3o2. Calculate x(s(m)). 3072m*4 Let n(c) be the first derivative of -5 + 0c*2 + 0c - 2/3c3. Let x(l) = 2l*2. Determine n(x(d)). -8d*4 Let g(q) = q + 20. Let d(p) = 36p*2. Determine g(d(a)). 36a*2 + 20 Let i(v) be the third derivative of 0v*4 + 0v + 0v3 + 0 - v2 - 1/30v*5. Let r(m) = -5m*2. Give r(i(h)). -20h*4 Let p(o) be the third derivative of 0o + 0o3 - 2o*2 + 0 - 1/30o*5 + 0o4. Let h(s) be the third derivative of -s5/60 + 3s2. What is p(h(x))? -2x*4 Let r(d) = 3d. Let c(s) = -45s. Calculate c(r(l)). -135l Let n(h) =	{ "pile_set_name": "DM Mathematics" }
m {m: 2, a: 2, p: 3, v: 2}. What is prob of picking 1 v, 1 m, and 1 p? 1/7 Three letters picked without replacement from urorrrorrorrou. What is prob of picking 1 r and 2 u? 2/91 Calculate prob of picking 1 r and 1 e when two letters picked without replacement from vvrppervrvp. 3/55 Calculate prob of picking 2 i when two letters picked without replacement from {i: 4}. 1 What is prob of picking 3 f when three letters picked without replacement from {f: 7, a: 1, g: 3, v: 3}? 5/52 What is prob of picking 1 h and 2 v when three letters picked without replacement from {h: 11, m: 2, v: 2}? 11/455 Four letters picked without replacement from {y: 1, o: 4, t: 7, n: 4, z: 3}. What is prob of picking 1 y, 1 n, and 2 z? 1/323 What is prob of picking 2 a when two letters picked without replacement from vavawvvvvaawvvav? 1/12 Two letters picked without replacement from {h: 1, u: 2}. Give prob of picking 2 u. 1/3 Calculate prob of picking 3 d when three letters picked without replacement from ddddddkkdkddddd. 44/91 Calculate prob of picking 1 z and 3 i when four letters picked without replacement from vnizzllnlzvzzzlzlnzm. 0 What is prob of picking 1 g, 1 b, and 1 h when three letters picked without replacement from ggigiignzzhgiibnggi? 7/969 Calculate prob of picking 2 r, 1 s, and 1 q when four letters picked without replacement from ooorhrvrhsq. 1/110 What is prob of picking 3 c and 1 v when four letters picked without replacement from vvcccvcc? 3/7 Three letters picked without replacement from mmyqygmomgymgmwomg. What is prob of picking 2 y and 1 q? 1/272 Four letters picked without replacement from eeaaaee. Give prob of picking 3 a and 1 e. 4/35 Two letters picked without replacement from glggggelkggk. What is prob of picking 1 l and 1 e? 1/33 Calculate prob of picking 2 v when two letters picked without replacement from vvvvvvvvvvvvvvpvvvv. 17/19 Four letters picked without replacement from {h: 3, u: 7, a: 3}. Give prob of picking 2 a, 1 u, and 1 h. 63/715 Calculate prob of picking 1 w, 2 c, and 1 m when four letters picked without replacement from {m: 2, r: 1, c: 10, w: 1}. 90/1001 Calculate prob of picking 1 s, 1 x, and 1 t when three letters picked without replacement from txxzxxst. 1/7 What is prob of picking 1 a and 1 e when two letters picked without replacement from {d: 5, j: 4, a: 7, e: 2}? 14/153 Four letters picked without replacement from {d: 5}. What is prob of picking 4 d? 1 Three letters picked without replacement from ezllezze. Give prob of picking 3 e. 1/56 Four letters picked without replacement from {r: 2, v: 1, c: 10, j: 1, b: 2, d: 2}. What is prob of picking 1 r, 1 c, 1 j, and 1 b? 2/153 Three letters picked without replacement from oooagooaanaaooao. What is prob of picking 1 g and 2 o? 1/20 Calculate prob of picking 1 n and 1 z when two letters picked without replacement from {n: 1, s: 2, j: 1, z: 1}. 1/10 Two letters picked without replacement from ddqddq. Give prob of picking 1 d and 1 q. 8/15 Four letters picked without replacement from gggggggggggwwgwgwggg. Give prob of picking 1 g and 3 w. 64/4845 What is prob of picking 1 i and 3 s when four letters picked without replacement from {i: 7, w: 3, z: 4, s: 4}? 7/765 Four letters picked without replacement from {s: 2, v: 3, e: 4, x: 1}. What is prob of picking 3 e and 1 x? 2/105 Four letters picked without replacement from zzzzzzzczckczzccz. What is prob of picking 1 k and 3 z? 33/476 Three letters picked without replacement from {q: 2, i: 1, v: 6, z: 1, h: 2}. Give prob of picking 2 v and 1 q. 3/22 What is prob of picking 3 k when three letters picked without replacement from kkkkkkkkkk? 1 Calculate prob of picking 3 g and 1 t when four letters picked without replacement from {o: 4, c: 1, t: 2, b: 1, f: 2, g: 5}. 4/273 What is prob of picking 3 u when three letters picked without replacement from {u: 2, j: 2}? 0 Four letters picked without replacement from utggt. What is prob of picking 2 g and 2 t? 1/5 What is prob of picking 1 v and 2 g when three letters picked without replacement from {g: 2, v: 5}? 1/7 Two letters picked without replacement from {i: 3, p: 5}. Give prob of picking 1 i and 1 p. 15/28 Calculate prob of picking 1 q and 2 j when three letters picked without replacement from {j: 6, q: 1, u: 1, c: 2, r: 3}. 15/286 Calculate prob of picking 2 x and 1 q when three letters picked without replacement from {q: 13, x: 6}. 65/323 What is prob of picking 1 o, 1 d, 1 u, and 1 m when four letters picked without replacement from momtudeo? 2/35 Calculate prob of picking 1 x, 1 k, and 2 n when four letters picked without replacement from hxhhkfnhhhqhnh. 1/1001 Four letters picked without replacement from {c: 1, u: 1, n: 1, j: 1, m: 1}. What is prob of picking 2 u and 2 m? 0 Three letters picked without replacement from {h: 1, v: 4, p: 5, k: 1, r: 1}. What is prob of picking 1 v and 2 p? 2/11 Calculate prob of picking 1 s and 1 o when two letters picked without replacement from cottshs. 2/21 Three letters picked without replacement from mmmmmmmmmm. What is prob of picking 3 m? 1 Calculate prob of picking 1 g, 1 p, and 1 k when three letters picked without replacement from ppkjkjejjlekpjjge. 9/680 Three letters picked without replacement from {q: 1, c: 1, x: 2, p: 4, g: 3}. What is prob of picking 2 c and 1 q? 0 Calculate prob of picking 1 k and 1 i when two letters picked without replacement from kiiiiiikikiiii. 33/91 Two letters picked without replacement from {x: 1, b: 1, a: 2, d: 1}. What is prob of picking 1 d and 1 b? 1/10 What is prob of picking 2 q when two letters picked without replacement from {v: 1, q: 12}? 11/13 Four letters picked without replacement from {j: 6, w: 4, a: 2}. What is prob of picking 4 w? 1/495 What is prob of picking 1 y and 1 b when two letters picked without replacement from {b: 3, f: 4, y: 2}? 1/6 Four letters picked without replacement from jqjjqqmqixxbjxjj. What is prob of picking 3 j and 1 x? 3/91 What is prob of picking 2 j when two letters picked without replacement from vvjsjjssvjjvjj? 3/13 Calculate prob of picking 1 j and 3 r when four letters picked without replacement from {j: 10, r: 9}. 70/323 What is prob of picking 2 u, 1 v, and 1 k when four letters picked without replacement from {k: 1, v: 2, u: 7, b: 2}? 14/165 Two letters picked without replacement from vbbqbzbmqbqzzmozmomb. Give prob of picking 1 z and 1 m. 8/95 Calculate prob of picking 1 b and 1 f when two letters picked without replacement from fbvfbbffvfbbvv. 25/91 Four letters picked without replacement from {i: 1, s: 2, k: 11}. Give prob of picking 1 s and 3 k. 30/91 Three letters picked without replacement from xlddeljlljxx. Give prob of picking 1 d and 2 x. 3/110 What is prob of picking 2 u and 1 l when three letters picked without replacement from uunnllluuuul? 3/11 What is prob of picking 1 b, 1 e, and 2 s when four letters picked without replacement from {a: 2, b: 1, e: 1, s: 1, g: 1, j: 1}? 0 Calculate prob of picking 2 y when two letters picked without replacement from {y: 7, h: 5, a: 1}. 7/26 Two letters picked without replacement from {i: 2, m: 3, p: 4, o: 1}. Give prob of picking 2 m. 1/15 Calculate prob of picking 1 i and 2 g when three letters picked without replacement from mgmimiiiigmiiiimgmg. 18/323 Four letters picked without replacement from zmmmczczmzmczcczmcz. Give prob of picking 1 z and 3 c. 35/969 Three letters picked without replacement from {e: 1, b: 2, w: 4}. What is prob of picking 1 e and 2 b? 1/35 Three letters picked without replacement from {w: 2, h: 3}. Give prob of picking 1 h and 2 w. 3/10 Two letters picked without replacement from {j: 1, o: 2, d: 1, f: 3}. Give prob of picking 2 o. 1/21 What is prob of picking 1 w and 1 j when two letters picked without replacement from jjgwggwggwowwowwjj? 28/153 Calculate prob of picking 1 z and 3 l when four letters picked without replacement from {t: 2, z: 3, m: 2, j: 2, p: 2, l: 5}. 3/182 What is prob of picking 2 t and 1 r when three letters picked without replacement from dtdhddhrdadaaadt? 1/560 What is prob of picking 1 z and 1 g when two letters picked without replacement from zyzmzzpgyzgzznzzzz? 22/153 What is prob of picking 1 r and 3 f when four letters picked without replacement from {r: 7,	{ "pile_set_name": "DM Mathematics" }
7 - 59412. -92h3 Collect the terms in 7305p - 21 - 3522p - 3781p. 2p - 21 Collect the terms in 194f*3 + 223f*3 + 183f*3 - 624f*3. -24f*3 Collect the terms in -16 + 3 - 51p*3 + 13 + 17p*2 - 42p*3 - 6p*2 + 90p*3. -3p*3 + 11p*2 Collect the terms in 0 - 35577711o + 0 + 4304672o. -31273039o Collect the terms in 8g - 8g + 9g + 0g - 19g + 10. -10g + 10 Collect the terms in -91j2 - 241 + 3j*3 + 307j - 307j + 241. 3j*3 - 91j*2 Collect the terms in 9293328k*2 + 50k - 50k + 5564804k*2. 14858132k2 Collect the terms in -77 - t3 - 1177 + 4t3 - 631 - 292. 3t*3 - 2177 Collect the terms in 42i*2 - 104i*2 + 46i*2 - 73i*2 - 175i*2 + 606i*2. 342i*2 Collect the terms in -398v*3 - 181v*3 - 1988 + 3970 - 1982. -579v*3 Collect the terms in 67r + 1026r2 - 848r*2 - 67r. 178r2 Collect the terms in -23 - 1051s*2 + 8 + 8. -1051s*2 - 7 Collect the terms in -20o*2 - 43o*2 - 18o*2 - 31o*2 + 109o*2 - 13o*2. -16o*2 Collect the terms in 203342b - 6027b + 495956b + 1 + 0. 693271b + 1 Collect the terms in 77v*2 - 77v*2 - 88329v*3 + 89010v*3. 681v*3 Collect the terms in -1 + 59264j - 59264j + 120j*2 + 2 + 814j*2. 934j*2 + 1 Collect the terms in -661 + 18p + 332 + 333 - 53p + 34p. -p + 4 Collect the terms in -18j + 5j*3 - 19696j*2 + 35j + 1 - 15j. 5j*3 - 19696j*2 + 2j + 1 Collect the terms in -3n + 47202423501 - 47202423501. -3n Collect the terms in -7456 + 46l2 + 7456 - 54l*2. -8l*2 Collect the terms in -35794g*2 - 6g + 229284g2 + 5g. 193490g2 - g Collect the terms in -96 - 13f + 12 - 56 + 204 - 64. -13f Collect the terms in -162858a*3 + 23565a*3 - 100457a*3 - 75150a*3 - 36462a*3. -351362a*3 Collect the terms in 1271w*3 - 2526w*3 + 1270w*3. 15w*3 Collect the terms in 1533 + 27k + 1535 + 3889 - 6957 - 30k. -3k Collect the terms in 7421o + 3 - 501o + 3. 6920o + 6 Collect the terms in -1857n + 203n3 + 933n + 924n - 1 + 6. 203n*3 + 5 Collect the terms in 17158 - 5608 - 5627 - 5923 + 3n. 3n Collect the terms in -930y + 1059y - 660y. -531y Collect the terms in 803k*2 + 783k*2 - 969k*2 - 4k + 4k - 640k*2. -23k*2 Collect the terms in -580 + 1050735b*2 + 580. 1050735b*2 Collect the terms in 202o - 26088 + 239o + 26088. 441o Collect the terms in -10407l2 + 31115l*2 + 0 + 0 - 10295l*2 - 10216l*2. 197l*2 Collect the terms in 486082t - 310158t + 1187766t. 1363690t Collect the terms in 1291b*2 + 20546b*2 + 16502b*2. 38339b*2 Collect the terms in 85206s*2 + 19s - 85215s2 - 19s. -9s2 Collect the terms in -302c*2 + 461c*2 + 18245c - 79c2 - 76c*2 - 18245c. 4c2 Collect the terms in 96t + 211t + 105t - 112t. 300t Collect the terms in -1186y + 232y*2 - 2y*3 + 3519y - 1147y - 1186y. -2y3 + 232y*2 Collect the terms in 18140t*2 + t - t - 10978t*2. 7162t*2 Collect the terms in -242p*2 - 268p*2 - 449p*2 + 405p*2. -554p*2 Collect the terms in 159997w*2 + 159997w*2 + 159992w*2 - 479984w*2. 2w*2 Collect the terms in 2260u + 1969u + 941u - 1667u. 3503u Collect the terms in 2794g - g3 - 10 + 3947g - 6741g + 10. -g3 Collect the terms in -401l + 122l3 + 401l - 62l3 + 4l*2 + 51l*3. 111l*3 + 4l*2 Collect the terms in -315485f - 65 + 157731f + 157756f. 2f - 65 Collect the terms in -445x*3 - 1802x*3 - 8 + 12 - 4. -2247x*3 Collect the terms in 0a - 133a2 - 137a*2 + 546a*2 + 3a - 76a2 - 143a*2. 57a*2 + 3a Collect the terms in 4 - 9v2 + 57 - 87. -9v*2 - 26 Collect the terms in 1736k + 1721k - 19 + 1729k - 6914k - 21 + 1727k. -k - 40 Collect the terms in 808l2 + 390457l - 106l2 - 390457l + 573l2. 1275l*2 Collect the terms in 30o - 1 + 0 - 20o - 8o + 1. 2o Collect the terms in 6z*3 + 2367379z*2 - 2 - 4z3 + 2 + z3 - 2367379z2. 3z*3 Collect the terms in -5770015g - 5770020g + 11540036g - g2. -g2 + g Collect the terms in -52765j2 - 48201j*2 + 100968j*2. 2j*2 Collect the terms in 39 + 89n*2 + 8 - 1 - 82n*2 - 46. 7n*2 Collect the terms in 429v*2 - v + 118v*2 + 304v*2 - 849v*2 - 2v + 3v. 2v*2 Collect the terms in 1639408u - 3278840u + 1639410u. -22u Collect the terms in -21257358 - i + 21257321 - 30i*3 - 5i + 4i. -30i*3 - 2i - 37 Collect the terms in 20106r + 910r + 4376r + 21136r + 5781r. 52309r Collect the terms in 689s2 - 2587s*2 + 624s*2 + 693s*2 + 686s*2. 105s*2 Collect the terms in -2271q*3 + 680848q - 340442q - 340406q. -2271q3 Collect the terms in 3003q*2 + 2 + 6497q*2 - 2. 9500q*2 Collect the terms in 442v + 1162v - 215 - 458 - 318v. 1286v - 673 Collect the terms in 24667f - 6 - 8310f + 6 - 8489f - 8437f. -569f Collect the terms in -100d + 102d - 293 + 565 - 317. 2d - 45 Collect the terms in -120g*2 + 67g*3 - 35g*3 - 17g*3 - 21g*3. -6g*3 - 120g*2 Collect the terms in -279597t*3 + 559770t*3 - 279402t*3. 771t*3 Collect the terms in 5096m + 4015m - 9134m. -23m Collect the terms in 17t*2 - t - 40 + 194 - 46 + 4t*2 - 61 - 6t*2. 15t*2 - t + 47 Collect the terms in 32i*3 + 15032i - 15042i + 3 - 1. 32i*3 - 10i + 2 Collect the terms in -2448z - 1327z - 1684z + 3785z. -1674z Collect the terms in -166a*3 + 6391a*2 - 2672a*2 - 3719a*2. -166a*3 Collect the terms in -1509812p - 6p2 - 38p*2 - 12p*3 + 1509792p. -12p3 - 44p*2 - 20p Collect the terms in -567u + 256 - 258 - 3u + 37u. -533u - 2 Collect the terms in 160597759436g2 + 18g*3 - 160597759436g*2. 18g*3 Collect the terms in -2271g*3 - 2878g*3 + 10051g*3 - 3050g*3 - 3318g*3. -1466g*3 Collect the terms in 3683h*3 + 3595h*3 - 7249h*3 + 31. 29h*3 + 31 Collect the terms in 603798f*2 - 179519f*3 - 603798f*2 + 3f + 179516f3. -3f*3 + 3f Collect the terms in 1758u3 + 1521100u*2 - 1521095u*2 - 1759u3. -u3 + 5u2 Collect the terms in -375w - 372w + 321w*3 - 343w*3 + 1131w - 384w. -22w*3 Collect the terms in -123i - 48878083240 + 122i + 48878083240. -i Collect the terms in 14135 + 29z + 23286 - 37421. 29z Collect the terms in 42459i - 81099i + 38627i. -13i Collect the terms in 2s - 123859 + 247781 - 123901. 2s + 21 Collect the terms in 1600549u - 21u3 - 1600549u. -21u3 Collect the terms in 3d + 4708d2 + 1667 - 1667. 4708d*2 + 3d Collect the terms in 402l2 - 18 + 35l - 35l + 1287l*2. 1689l*2 - 18 Collect the terms in -2029f + 661f + 694f - 3 + 656f. -18f - 3 Collect the terms in -28511w2 + 81118w*2 + 75955w*2. 128562w*2 Collect the terms in 5775j + 5717j - 23113j + 5736j + 5740j. -145j Collect the terms in -10136n*2 + 4325n*2 + 4357n*2. -1454n*2 Collect the terms in 4286h*2 + 9 - 4575h*2 + 308h*2. 19h*2 + 9 Collect the terms in -1674v*2 - 1678v*2 - 294v*3 + 3352v*2. -294v*3 Collect the terms in 382 - 144 - 113 - s + 3s. 2s + 125 Collect the terms in -106u*3 - 511u*3 + 39834u*2 + 294u*3 - 39834u*2. -323u*3 Collect the terms in 61f*3 - 33999f*2 + 17005f*2 + 16994f*2. 61f*3 Collect the terms in -1995698296 + 14n + 1995698296. 14n Collect the terms in 344t*2 + 1460t*2 + 3567t*2 - 876t*2 + 2198t*2. 6693t*2 Collect the terms in -31c + 7 - 123c2 - 36 - 114c*2 + 450c*2 - 108c*2 - 104c2. c2 - 31c - 29 Collect the terms in -19487r*3 - 9965r*2 + 9965r*2. -19487r*3 Collect the terms in 103o + 854o2 - 231o + 128o + 7o*3 + 2o*3. 9o*3 + 854o*2 Collect the terms in -23831s*2 + 9087s*2 + 291926s*2. 277182s*2 Collect the terms in 4952q - 10028q + 5 + 5061q. -15q + 5 Collect the terms in 28 + 4197147h + 17h2 - 8394296h - 28 + 4197149h - 13h*2. 4h*2 Collect the terms in -1402b*2 + 670b*2 - 138b*2 - 519b*2 - 863b*2. -2252b*2 Collect the terms in 2509 + 2n - 940 - 941 + 317 - 945. 2n Collect the terms in -49307 + 49307 - 153u. -153u Collect the terms in -107w*3 - 118w*3 + 172w*3. -53w*3 Collect the terms in -2o*2 + 2o + 10553734o3 - 2o - 4o2. 10553734o*3 - 6o**	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.