Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
smallest value in -0.3, n, 1/6? 1/6 Let u be (21/6)/(1/2). Let v = 1377 - 4129/3. Which is the second smallest value? (a) u (b) 1/3 (c) v (d) 0.4 d Let s be 1614/840 + (-3)/(-12). Let j = s + -18/7. What is the third smallest value in 7, 5, j? 7 Let p(r) = r - 7. Let z = -9 - -14. Suppose 16 = 3j - z. Let a be p(j). What is the biggest value in -2/11, a, 5? 5 Let i(s) = -s2 - 8s + 7. Let p be 2/((-3)/(-12)-1). Let r be i(p). Let g be r/2 + -5 + 2. What is the biggest value in -3, g, 2? 2 Let o = 186.3 + -179. Let g = o - 14. Let c = g - 1.3. What is the second biggest value in -2, 1/7, c? -2 Let f(i) = 12i + 16. Let n be f(-1). What is the third biggest value in -8, n, 1/7, -2? -2 Let x be 4/((90/35)/((-52)/(-28))). What is the biggest value in -4, -6, 1, x? x Suppose 2z = 3z + 2f + 1, -4z - 11 = f. Which is the third biggest value? (a) 0.3 (b) 242 (c) z c Let c = 56.8 - 57. What is the second smallest value in 3, 2/9, c? 2/9 Let y = 929 - 924. Which is the second biggest value? (a) y (b) 4 (c) 2/7 b Suppose -4v - 4 = -h, -3v - 3h + 2 - 5 = 0. Let l(i) be the first derivative of -3i*2 - i - 14. Let y be l(v). What is the smallest value in 1, y, -0.5? -0.5 Let j = -55.49 + 0.49. Let y = -44 - j. Which is the biggest value? (a) 2/7 (b) y (c) 5 b Let a be 1/(3 + -2 + -2). Let n = -103/175 + 4/25. What is the third smallest value in -9, n, a? n Let h = -0.46 - 4.54. Let k = -5.5 - -6. Which is the third biggest value? (a) k (b) -0.5 (c) h c Let y = -11 + 20. Let k(r) = 2r - 18. Let d be k(y). Let i = 1 + -0.8. Which is the second smallest value? (a) d (b) -3 (c) i a Let h be ((-8)/(-28))/((-68)/(-28)). Which is the fourth biggest value? (a) 12 (b) h (c) 1 (d) 1/2 b Let t = -0.57 + 0.7. Let a = 0.03 - t. Let l = 8 - 5. What is the biggest value in l, -1, a? l Let r = -58 + 58.15. Let j = -0.45 + r. Let d = 0.3 - 0.1. Which is the third biggest value? (a) j (b) d (c) 4 a Let m be (-72)/(-54)(2 - -1). Let u be (-1 - m)(-2)/(-35). Let n = -13 + 8. Which is the second biggest value? (a) n (b) u (c) -4 c Let m = 928 - 928. What is the biggest value in -0.4, 3, 6, m? 6 Let i = -189 - -185. Let t = 0.3 - 0.1. Which is the second biggest value? (a) t (b) -3 (c) i b Let v = 0.06 + 3.94. Let i = 385.1 + -385. Let s(m) = -m*3 + 5m*2 - 4m + 1. Let x be s(4). Which is the biggest value? (a) i (b) x (c) v c Let i = -2832 + 2831.7. Let q = 0.4 + -0.45. Which is the second smallest value? (a) -0.5 (b) q (c) i c Let s = -841.98 - -842. Which is the smallest value? (a) 0 (b) 2 (c) s a Let m = -0.04 - 1.96. Let t = 1 + m. Let v = 9/35 + -37/105. Which is the third biggest value? (a) v (b) 1 (c) t c Let f = 2/19 - 48/95. Let g = 25/3 - 9. What is the third biggest value in 0.1, g, f? g Let f = 16.07 + -0.07. Let i = 86 - 101. Let j = i + f. Which is the third smallest value? (a) j (b) 0 (c) 1/6 a Suppose -58w - 3t + 16 = -62w, 5w = 5t - 25. Which is the third biggest value? (a) 3/2 (b) 2.61 (c) w c Let n be (9/(-15))/(((-6)/(-15))/(-2)). Suppose 6u + 18 = -nu. What is the third smallest value in u, 1/3, -4, 7? 1/3 Let x = 11 + -14. Let v = 48 + -195/4. Let m = 12 - 73/6. What is the smallest value in v, x, m? x Let u be ((-3)/(-4))/(2/(-8)). Suppose o + 3o = 8. Suppose 5s = os - 3. Which is the biggest value? (a) 0.03 (b) u (c) s a Let j be ((-6)/63-3)/(126/(-294)). What is the biggest value in -62, j, -2/5, 0.1? 0.1 Let m = -17 - -39. Let a = 552 + -533. Let r = m - a. What is the biggest value in 0.06, r, 2? r Let m = 172 - 171. What is the third biggest value in m, -0.1, 3, 2.3? m Let z = -16 + 22. Let i = -5.7 + z. Let t = 4.94 - -0.06. Which is the third smallest value? (a) i (b) 0 (c) t c Let x = -132 - -114.4. Let m = x - -17.7. Let w = -5/4 - 1/4. Which is the third smallest value? (a) w (b) -2 (c) m c Let x = -54 + 54.051. Let z = x + 1.949. Which is the fourth biggest value? (a) z (b) -1/7 (c) 0.02 (d) 3/5 b Let z = 0.332 + 0.068. What is the fourth smallest value in 5, z, -2/11, 0? 5 Let y = 47/12 + -8/3. Let g = 329 - 334. Which is the second biggest value? (a) g (b) 8 (c) y c Suppose 44 + 49 = 3d + i, -4d + 5i = -105. Let k be (2 - 66/d)2. What is the biggest value in -5, -4, k? k Let t = 208.4 + -208. Let j = -129/5 - -26. Which is the third smallest value? (a) t (b) j (c) 4 c Let i = 0.06 - 0.18. Let g = 5.12 + i. Let x = g - 3. Which is the smallest value? (a) x (b) 1/2 (c) -2/9 c Let l = 4 + -1. Let r = -0.89 - 0.61. What is the biggest value in 4, r, l? 4 Let d = 799 + -792. What is the second smallest value in 0.8, d, 10? d Let s = 8 - 10. Let z = -16.572 + 0.572. Which is the third biggest value? (a) 2/3 (b) z (c) s b Suppose -h + 3z - 2 = 0, -4h - z - 36 = z. Let f be (2/(-4))/(1 + 10/(-6)). Which is the fourth biggest value? (a) h (b) 4 (c) 1/2 (d) f a Let c = 0.09 - 1.09. Let a(x) = -82x + 1. Let d be a(-2). Let s = d - 821/5. What is the smallest value in s, 0.06, c? c Suppose -3o - 140 = -8o. Let z be 8/12 - 16/o. Let r be 6(1 - (-2)/(-4)). Which is the third biggest value? (a) r (b) z (c) -5 c Let o = -0.013 - 34.987. Let a = 34.6 + o. What is the third smallest value in a, 1/12, 3/4? 3/4 Let g = -84.55 - -82. Let f = g - 0.45. Which is the second biggest value? (a) f (b) -1/3 (c) -0.2 b Suppose -2d - 3l - 30 = -5d, 0 = -2d - 4l + 32. Let h be (-6)/230236/d. Let o = -2/23 + h. Which is the third smallest value? (a) o (b) -2/7 (c) 0.3 c Let q be (-16)/(-1 - 1)-1. Let c be (-4 + 3)/((-20)/q). Let h = 8 - 7.2. What is the second biggest value in h, c, -3? c Let g be 91/364 - 1/(-44)13. Let m = 0.2 + -0.3. Let f = m + -2.9. Which is the second biggest value? (a) f (b) g (c) -2 c Let h be (35/49 - 1)-7. Suppose a + 2o + 3o + 1 = 0, 0 = -5a - 3o + 61. What is the biggest value in a, h, 5/6? a Let n = -3 + 1. Suppose -14 = -4g + 10. Let w(t) = -t2 + 8t - 9. Let m be w(g). What is the smallest value in -1, m, n? n Let y = -2.03 - -0.03. Let u = -11 + 13. Let i be 8/10(3 + u). Which is the third smallest value? (a) y (b) i (c) 3 b Let k = 2.9 + -19.9. Let t = k + 22. Let v be 6/(-8) + 29/28. Which is the biggest value? (a) -5 (b) t (c) v b Suppose -17p - 9p = -130. Which is the smallest value? (a) 1.9 (b) -0.01 (c) p b Let i = -395 + 395. Which is the biggest value? (a) i (b) 7/3 (c) -2 (d) -5 b Suppose -9n - 27 = -18n. Let v = -3.2 + 3. Let f = 130 + -908/7. Which is the second biggest value? (a) n (b) f (c) v b Let m = -725.1 + 725. What is the fourth biggest value in 7, -4, -0.05, m? -4 Let h = -2 + 6. Let q = 535 - 533. What is the biggest value in q, 0.3, h? h Let d be 24/(-30) - (-348)/(-15). Let y be (3/6)/((-6)/d). Suppose 4o - p + 6 = 17, o - 1 = yp. Which is the second biggest value? (a) 4/3 (b) o (c) 0.5 a Let m be (-5)/(-2) + -1 + 0. Suppose 8d - 81 = -d. Let h = d + -9. What is the third smallest value in m, -4, h? m Let k = -282 - -287. Let j = -1 + 3. What is the second smallest value in -0.1, -10, k, j? -0.1 Let y = 1033 - 978. Which is the fourth biggest value? (a) 0 (b) 1 (c) 2 (d) y a Let n be (10 - 12)(-2 + 1). Which is the second smallest value? (a) 17 (b) n (c) -0.1 b Let s = 571/2 + -285. Which is the third smallest value? (a) -1/7 (b) 23/2 (c) 2 (d) s c Let t = -16.15 + 15.85. Let w = 0.4 + -2.4. Let l = 4 + -4.4. Which is the biggest value? (a) l (b) t (c) w b Let l = 20 + -25. Let f be 2586/740 + (-1)/1. Let s = 1/185 + f. What is the third biggest value in s, l, -1? l Let i = 0.4 + 0.1. Let l = 16 - 14. Let o be 3(-2 + l + 1). Which is the biggest value? (a) o (b) 1/5 (c) i a Let d = -6 - -8. Let j = -1145 - -1141. What is the second smallest value in d, 1, -2, j? -2 Let i = 7.034 - 0.084. Let p = i - -0.05. Let j = 8 - p. What is the second smallest value in -9, j, -0.2? -0.2 Let c = 0.06 + 0.34. Let p = 6654 + -6656. What is the second biggest value in -3/4, 5, p, c? c Let i = -6.9752 - 0.0248. Let y = 5 - 7. Let t = y - i. Which is the second biggest value? (a) -4 (b) t (c) 1/2 c Suppose 5r + s - 2 = -0s, 3r - 12 = 3s. Which is the second biggest value? (a) r (b) 15 (c) 0.2 a Let h = 266.978 - 262. Let z = h - -0.	{ "pile_set_name": "DM Mathematics" }
? 3 Suppose -3 = -i + 2. Suppose 12 = id + 2. Suppose 0v + 12 = dv. What is the units digit of v? 6 Suppose 0 = 2k - 189 - 399. What is the hundreds digit of k? 2 Suppose 0 = -2y + k + 28, -2y + 76 = 3y - k. Let c be (-30)/3 - 2/2. Let x = c + y. What is the units digit of x? 5 Suppose 0 = -3l + 67 + 86. Let b = -34 + l. What is the tens digit of b? 1 Let i be -4 - 4(-3)/6. What is the units digit of (16/(-72))/(i/18)? 2 Suppose 0 = r - 0r - 2j, -r = -5j. Let v(h) = -h*3 + 14h*2 + 2h - 12. Let s be v(14). Suppose -3a + 5a - s = r. What is the units digit of a? 8 Suppose -2i = -15 - 7. What is the units digit of i? 1 Let m(y) = 3y*2 - 10y - 11. What is the units digit of m(-8)? 1 Let m(r) = -r3 - r2 + r. Let w be m(-1). What is the units digit of (w/2 + 0)-52? 6 What is the hundreds digit of (-3 - -1)/(-3(-2)/(-315))? 1 Suppose -3f = 0, -2a + 5a = f + 96. Suppose -a = 2k + k - 2m, -m = -3k - 28. What is the units digit of (-10)/k(7 - -1)? 0 Suppose t + 29 = m, 0 = -2m + 4t + 19 + 29. What is the units digit of m? 4 What is the tens digit of (-54)/9(-30)/4? 4 Let p be (2/(-4))/((-1)/(-4)). Let r be p((-6)/(-3) - 4). Suppose a + 5d = -3a + 65, -4d + 60 = ra. What is the units digit of a? 0 What is the tens digit of 2/61237? 7 Let r = -2 - -4. Suppose rm - 42 = -5g, 0g + m + 7 = g. What is the units digit of g? 8 Let f(u) = -5u2 + 1. Let d be f(1). Let s = d + 3. What is the units digit of (-2)/((-9)/6 - s)? 4 Suppose -5w = -4k - 33, -w + k + 22 = 3w. Suppose wy = 6y - 19. What is the units digit of y? 9 Suppose -2j - 16 = 2j. Suppose 24 = -8g + 4g. Let m = j - g. What is the units digit of m? 2 Suppose -14 = -2w - 4q, -w - 14 = -3w + 3q. Suppose 48 = wa - 3a. Suppose -5d + 3n = -a - 20, -5d = -n - 24. What is the units digit of d? 4 Let s(y) = y. Let t be s(3). Suppose 4d - 1 = td. Let p(x) = 14x*3. What is the tens digit of p(d)? 1 Suppose -p + 4g + 68 = 0, -9p + 11p - 3g - 136 = 0. What is the units digit of p? 8 Let x = 164 + -103. What is the tens digit of x? 6 Suppose -21k + 16k + 125 = 0. Suppose a + 5d - 4d = k, 3d = -5a + 135. What is the tens digit of a? 3 Suppose 10 = -5x + 4v, 5v - 30 - 3 = -4x. Suppose -16 = -2g + xb - b, 2 = -b. What is the units digit of g? 7 Suppose 18 = -2h + 4o, 1 + 0 = 3h + o. Let x be (h + 0)/(2/(-10)). Let b = 6 - x. What is the units digit of b? 1 Let z(c) be the second derivative of c5/5 - c3/3 - c*2/2 + 5c. What is the units digit of z(2)? 7 Suppose -x + 2b + 6 = 0, -b - 4 = 2x + 3b. Suppose -o - xo + 27 = 0. What is the units digit of o? 9 Suppose 3 = s + 5. What is the units digit of s/(-3)54/4? 9 Let k = 417 - 296. Let j = k + -73. Suppose -5h = -h - j. What is the units digit of h? 2 Let j(u) = -u*2 - 3u + 3. Let m be j(-5). Let s be (-14)/8 - (-2)/(-8). What is the units digit of s/(-4) + m/(-2)? 4 Suppose 29 = d - 16. Suppose 0 = 2x + 3x - d. Suppose -5h - 15 = 0, 2r + r - x = -5h. What is the units digit of r? 8 What is the units digit of (-232)/(-6) + (-6)/9? 8 Let j = 2 - -2. Let t be (6/j)/(3/20). Suppose b + 2 = t. What is the units digit of b? 8 Let r = 7 + -5. Suppose 0 = 3y + y - 4o - 8, 16 = ry - 5o. Let h = y - -5. What is the units digit of h? 3 What is the tens digit of 3166(24/(-9) + 3)? 6 Let x = -3 + 35. Suppose 5k + x = 7k. What is the tens digit of k? 1 Suppose 0 = i + 1 + 1. Let y be 0/1 + i - -4. Suppose 4z - 58 = -z + 4x, -yx + 16 = 2z. What is the units digit of z? 0 Let q(j) = -j2 + 11j + 4. What is the tens digit of q(6)? 3 Let n = -8 + 7. Let u = n + 7. What is the units digit of u? 6 Suppose 5k - 757 = 43. Suppose 3h = -h + k. Let b = 61 - h. What is the tens digit of b? 2 Suppose 5b - 4b - 431 = -3l, 0 = 5b - 10. What is the units digit of l? 3 Suppose g + 3y + 1 = 0, -3g + 3 = -y + 6. What is the units digit of -15 + 21 + (g - -1)? 6 Let z(a) = 2a3 - 7a*2 + 8a - 31. What is the tens digit of z(7)? 6 Let u = -6 + 9. What is the units digit of (-4)/(1/(u/(-6)))? 2 Suppose 3y + y - 16 = 0. Suppose 3o = yt + 60, o + 0o - t - 20 = 0. Let x = o + -14. What is the units digit of x? 6 Let t = -5 - -3. Let c = 23 - 20. What is the units digit of 16/t(-4 + c)? 8 Suppose 4f + 20 = 4s + 8f, -5f + 9 = -3s. Suppose sl = 6l - 20. Suppose 0 = -lg - 1 + 6. What is the units digit of g? 1 Let c = -3 - -4. Suppose 0 = -5y + 26 - c. What is the units digit of y? 5 Let r(m) = 9m3 + 2m + 1. What is the tens digit of r(2)? 7 Let v be -1(0 + -6)/(-1). Let r(f) = 3f*2 + 11f + 5. Let o(i) = -i*2 - i + 1. Let a(z) = -2o(z) - r(z). What is the units digit of a(v)? 1 Let u = -22 - -36. Let o = -9 + u. What is the units digit of o? 5 What is the units digit of (36/14)/(6/56)? 4 Suppose -u = -b + 81, 0 = 5b - 3u + u - 408. What is the tens digit of b? 8 Suppose 4j = 5u - 5, 4 + 1 = 5u + j. Suppose o + u = 21. What is the tens digit of o? 2 Let r be (3 + 1)(-4 + 5). Suppose 3o - 3i - 18 = -6i, 3o = ri + 39. Let g = 13 - o. What is the units digit of g? 4 What is the tens digit of 3 + 12/4-19-1? 6 Let x(f) = -5f*3 + f + 1. Let h be x(-1). Suppose -47 + 2 = -hr. What is the units digit of r? 9 Let r be (-4)/(-2) + (-3 - -2). Let j = r + -3. What is the units digit of j/8 + 20/16? 1 Let n = -11 + 15. Suppose nh - 36 = 2h. Suppose -7l - b + h = -2l, 5l - b = 22. What is the units digit of l? 4 Suppose 2w - 14 = 2q, 8w + 2q - 21 = 3w. Suppose wd - 100 = 5k, k - 2d - 85 = 4k. Let s = k - -37. What is the tens digit of s? 1 What is the units digit of (4 + -1)5/5? 3 Suppose 4f = -5n + 484, -4n + 193 = -2n + f. What is the tens digit of n? 9 Suppose -10w + 8w = -628. What is the tens digit of w? 1 Let q(t) = 14t*2. Let n be (-2)/6(-7 + 10). What is the units digit of q(n)? 4 Let s be 1/(-2) - 98/4. Let f = s - -34. What is the units digit of f? 9 Suppose 4c = c + 21. Let u(z) = -z3 - 6z*2 + 3z + 4. Let t(x) = 2x3 + 5x*2 - 2x - 3. Let i(h) = -2t(h) - 3u(h). What is the units digit of i(c)? 8 Let s = 6 - -39. What is the tens digit of s? 4 Let p be 10/((-1 - 2) + 5). Suppose 14 = -pw + 69. What is the units digit of w? 1 Let v = 81 - 11. What is the tens digit of v? 7 Suppose 0w + w + 5 = n, -3n + 9 = 3w. Suppose 7k = 3k + n, 3l - 22 = 2k. What is the units digit of l? 8 Suppose -g + 28 = 3s - 3g, -2s + 4g + 16 = 0. What is the units digit of s? 0 Suppose 4j + 7 = z, 0z + 2j + 14 = 4z. What is the units digit of z? 3 Let d(i) be the second derivative of -21i5/20 + i3/3 + i2/2 - 3i. What is the units digit of d(-1)? 0 Let x(m) = m + 4. Let n(a) = 3. Let q be 3/(-2)(3 - 1). Let y(d) = qn(d) + 2x(d). What is the units digit of y(3)? 5 Suppose -5b + 52 + 23 = 0. Let u = 5 + b. Suppose 2w - 6w + u = 0. What is the units digit of w? 5 Let w(j) = 6j2 + j. Let k(i) = -i3 - 5i*2 - 3i + 1. Let b be k(-4). Let u be w(b). Suppose 2f - 5f = -u. What is the units digit of f? 7 Let p(t) = t*2 - 13t + 7. Let n be p(9). Let y = 41 + n. Let a = -5 + y. What is the units digit of a? 7 Suppose -p - 4o = -154, -3o - 162 = -p - 5o. What is the hundreds digit of p? 1 Suppose 2w = z + 65, -5w + 0z = -z - 167. What is the tens digit of w? 3 Let d be (-20)/(-6)9 - 1. Let g = d + -24. What is the units digit of g? 5 What is the tens digit of ((-460)/6 + 0)(-12)/10? 9 Suppose -4t + 9t = -20. Let c be (-82)/(-8) + (-6)/24. Let x = c - t. What is the tens digit of x? 1 Let j(c) = 19c - 32. What is the hundreds digit of j(7)? 1 Let m(x) = x3 - 5x*2 + 5x - 4. What is the tens digit of m(6)? 6 Suppose 0 = -2v + 4d - 6d - 80, -4v + 2d - 130 = 0. Let t = 58 + v. What is the tens digit of t? 2 Let j be -4 - -2 - 2-2. Suppose 61 = jo - 11. Suppose -3a - a = -o. What is the units digit of a? 9 Let b be (-1 + 67)(-4)/(-12). Suppose -58 = -q - b. What is the units digit of q? 6 Let k = -15 + 19. Suppose 7i - 3i = -4r - 24, 3r = -4i - 23. What is the units digit of 19/k - r/4? 5 Suppose 9 = 2b + b. Suppose 18 = -bh + 5h. What is the units digit of h? 9 Suppose 2n + 58 = 6n - 3l, 5l = 10. Suppose -4m = -5m + n. What is the tens digit of m? 1 Let t be -1(-2 +	{ "pile_set_name": "DM Mathematics" }
87549z Find the second derivative of -5m*5 + 48959150m*3 - 1314096m wrt m. -100m3 + 293754900m Find the third derivative of -2o3q*3 - 387046191o*3q + 29o2q*3 - 3oq3 + 2612oq wrt o. -12q*3 - 2322277146q Find the third derivative of -29004o5 - 219o*3q*3 - 62o*2q*3 + 125581o*2q*2 wrt o. -1740240o*2 - 1314q*3 What is the second derivative of 33846a*3 - 6506a*2 - 313899391a? 203076a - 13012 Find the second derivative of 1228873740f*2 + 4f + 3142132. 2457747480 Find the third derivative of 54s4y + 404s4 - 25s*3y - 2s3 - 19028251s*2y wrt s. 1296sy + 9696s - 150y - 12 What is the second derivative of -4g3 + 6461075g*2 - 2354235g + 2? -24g + 12922150 Find the first derivative of 2t*3 - 73t*2 - 152557t - 18207541. 6t2 - 146t - 152557 Differentiate 7114278o3 + 7148743 with respect to o. 21342834o*2 Find the third derivative of 33h*6 + 55854h*3 - 1248h*2 + 2h - 607. 3960h3 + 335124 Differentiate -8715183t + 69788452. -8715183 Find the first derivative of -68019766d2 + 13159459. -136039532d What is the derivative of -4728j4 + 2445j*2 - j - 695399702? -18912j*3 + 4890j - 1 What is the derivative of 22r2t*3 + 501715r*2 - 2rt + 13t*3 + 2t*2 - t + 36663 wrt r? 44rt3 + 1003430r - 2t What is the derivative of -1173844853b*2 + 522818773? -2347689706b Find the second derivative of -o*3q*2 + 1504266o*2q*2 + 1445oq + 3o - 2q2 - q wrt o. -6oq2 + 3008532q*2 Find the third derivative of 26p*5 + 209570p*4 + 2p*3 + 1840p*2 + 294p - 9 wrt p. 1560p2 + 5029680p + 12 Differentiate -10gz*2 + 1051318gz + 2g + 3z2 - 37779959 with respect to z. -20gz + 1051318g + 6z Find the third derivative of -2820596b*6 + 21670b*2 + 56b wrt b. -338471520b3 Find the second derivative of 26208381x*2 - 26410020x - 2 wrt x. 52416762 Find the first derivative of -447l3 - 496l - 3619423 wrt l. -1341l2 - 496 What is the third derivative of 5647530m*3 + 31342346m*2? 33885180 Find the second derivative of -15108816m*4 + 119049m + 93. -181305792m2 Find the third derivative of -1232r*4 - 45448r3 + r2 + 4r + 593205 wrt r. -29568r - 272688 What is the first derivative of -b*3w - 5b3 - 6199b*2w - 72b2 + 262bw - 52b - 71 wrt w? -b*3 - 6199b*2 + 262b Find the third derivative of -2rx*4 + 1374rx3 - 105rx2 - 152x*5 - 87x*2 + 211 wrt x. -48rx + 8244r - 9120x2 Find the third derivative of -665081901j*4 - 2j*2 - 187426075. -15961965624j Find the second derivative of -7811h4 - 187h*3 + 3h*2 + 6h + 58007. -93732h2 - 1122h + 6 What is the third derivative of 16128m4r - 1568m3r + 72m2r + 2m2 - 15479mr + 1 wrt m? 387072mr - 9408r What is the second derivative of 236177a2k*3 + 268a*2 - 17ak3 - 15809k wrt k? 1417062a2k - 102ak Differentiate 7310q4 + 433q*3 + 1842306. 29240q*3 + 1299q*2 Differentiate -10m*2u - 6m2 + 40809mu + 21m + 447599302u wrt m. -20mu - 12m + 40809u + 21 What is the second derivative of -17349n*4 + 252n*3 - 21867934n? -208188n2 + 1512n What is the derivative of 7k3 - 74k*2 - 7k - 512415277? 21k2 - 148k - 7 Find the first derivative of 63338j3r + 45602j3 - 5j*2r + 3jr + 949j + 9r wrt r. 63338j3 - 5j*2 + 3j + 9 Find the third derivative of f*5 - 57277f*4h + f4 - f2h + 2f*2 - 1883fh + 48f + 2 wrt f. 60f2 - 1374648fh + 24f Find the third derivative of -41606d3n*2 + 82d*3n + 4d2 + 2050304dn2 wrt d. -249636n*2 + 492n Find the second derivative of 13509745s4 + 162802s - 1 wrt s. 162116940s2 Differentiate 60180002n*4 + 9028351. 240720008n*3 What is the third derivative of -136407b*4v3 + b3v3 - b3 + b2v*3 + 2b*2v - 6v + 5410 wrt b? -3273768bv3 + 6v*3 - 6 Find the second derivative of 6313670t*2 - 2657236t. 12627340 What is the derivative of 221057839k2 + 32757746 wrt k? 442115678k What is the third derivative of -109r5 - 148r*4 + 938r*3 - 5030477r*2 - r - 2 wrt r? -6540r*2 - 3552r + 5628 Find the second derivative of -115135447u3 - 4127401u + 20. -690812682u Differentiate 7m*2 - 2328039m - 267319833 with respect to m. 14m - 2328039 Find the third derivative of -14282235k*6 + 2k*5 + 62998332k*2. -1713868200k*3 + 120k*2 What is the third derivative of -21936q*5 - 48q*4 + 5q*2 + 14207q + 4 wrt q? -1316160q2 - 1152q Find the first derivative of 265364ai*2 + 2a - 148656i2 + i + 5 wrt a. 265364i*2 + 2 Differentiate 16613329f*3y + 9080386f3 - 2 wrt y. 16613329f*3 Differentiate 2k*3l - 3k3 + 103kl - 25k - 7006l + 370 wrt k. 6k*2l - 9k2 + 103l - 25 Find the second derivative of -283769958m2 - 413341239m. -567539916 Find the second derivative of -107m4 - 9m*3 + 184m*2 - 655738m + 91 wrt m. -1284m2 - 54m + 368 Differentiate 2579bl + 1338b + 179669l - 2 wrt b. 2579l + 1338 Find the second derivative of 3169685q*5r - q*3r*3 - 524qr3 + 4qr + 2q + r + 54 wrt q. 63393700q3r - 6qr*3 Find the second derivative of -22172310i*4 - 21173886i wrt i. -266067720i2 What is the third derivative of 21654505i*5 + 2i*4 + 121253124i*2 wrt i? 1299270300i*2 + 48i What is the third derivative of -v*5 + 1265393v*4 + 7953v*2 + 574 wrt v? -60v*2 + 30369432v What is the derivative of -qs - 189182qy - 2s*3y - 81492s2y + 153y wrt s? -q - 6s*2y - 162984sy What is the first derivative of a*2i - 119a2 + 1007513175aiv*3 - 55av3 - 2av2 + 128av - 4v3 - 4 wrt i? a2 + 1007513175av*3 Find the third derivative of -36638645n*6 - 199965n*2 + n - 1. -4396637400n*3 What is the first derivative of -9900540bf + 9b - 4299250 wrt f? -9900540b What is the third derivative of -l3s*3 - 315l*3s - 592l3 - 2l*2s - 971l2 + 85ls3 wrt l? -6s*3 - 1890s - 3552 Find the third derivative of -83cd*5 + 1121741cd4 + 55cd - 3c + 3d2 - 52d - 8 wrt d. -4980cd*2 + 26921784cd Differentiate 3wx2 - 356wx - 5146w - 342746x2 + 158 wrt w. 3x*2 - 356x - 5146 What is the third derivative of 922d3fx4 + d3fx2 - 11d*2fx - 3d*2x + 203d2 + 76749fx3 - 4536x wrt x? 22128d3fx + 460494f Find the second derivative of 3013js*2 + 16js + j - 797s*2 + 2s + 30785 wrt s. 6026j - 1594 Differentiate -2q*2r + 17268029q2z + 3qz*3 - 3rz3 - 2rz2 + r - 5164z*2 - 589z with respect to q. -4qr + 34536058qz + 3z3 Find the third derivative of 2k*3q*2 - 3941711k*3q + 2k2q*2 + 26k*2 + 9kq2 - kq + 21q wrt k. 12q*2 - 23650266q What is the derivative of -38imo - im - 7i + 49634mo - m - 155566o - 3 wrt m? -38io - i + 49634o - 1 What is the third derivative of -336369703as3 + 95912as2 - 4as - 6a - 2s2 wrt s? -2018218218a Differentiate -4mnx + mn - 2mx - 15m - 202nx + 125n - 2x + 2296 with respect to n. -4mx + m - 202x + 125 What is the second derivative of 16089816m5 - 1951m + 247? 321796320m3 What is the third derivative of 39l*3op - 1816l*3o - 3l3p + 13l3 + 173l*2o + l*2p + 198lop - lp + 26op + 2 wrt l? 234op - 10896o - 18p + 78 Find the second derivative of 13528w4 - 6796w*3 - 110475510w. 162336w2 - 40776w Differentiate -248428291y - 778139366 with respect to y. -248428291 Find the first derivative of -19577184s + 17132404 wrt s. -19577184 Differentiate -19733n4 - 87n*2 - 2932660. -78932n*3 - 174n Find the second derivative of 14265728l3z*2 - 113l*3 - 8l*2z*2 - 5lz + 147l + 2z2 + 8z wrt z. 28531456l3 - 16l*2 + 4 Find the first derivative of 74061455hjs*3 - 9hj - 5js3 + js*2 - 13s*3 - 82s*2 - 208s - 2 wrt h. 74061455js*3 - 9j What is the second derivative of -25499j3kv2 + 53j*3kv - 10j*3k + 112j3 + 44j*2kv2 + 476j*2kv wrt v? -50998j*3k + 88j2k What is the second derivative of -21794321u2 + 59643u + 93? -43588642 Differentiate 68389085*y - 71570969 wrt y.	{ "pile_set_name": "DM Mathematics" }
*3. -133s*3 Collect the terms in -8613i*2 + 110i + 8625i2 - 55i - 55i. 12i*2 Collect the terms in 46 + 154 + 153d + 160d - 311d + 26. 2d + 226 Collect the terms in 8 - 5 - s3 + 78s*3. 77s*3 + 3 Collect the terms in 3u*2 + 5u*2 - 12746030u*3 + 12746029u*3 - 8u2. -u3 Collect the terms in 1826n - 4n*2 - 915n - 3n2 - 916n. -7n2 - 5n Collect the terms in 2092r + 5571r + 14202r. 21865r Collect the terms in 248855 - 248855 + 183f2 - 27f*2 - 826f*2. -670f*2 Collect the terms in -15w2 - w2 - 25w2. -41w*2 Collect the terms in 154f - 478f + 160f + 164f - 17f*3. -17f*3 Collect the terms in -26147 + 51v*3 + 26147. 51v*3 Collect the terms in -3p2 - p2 + 131p3 + 10p*2 - 7p*2. 131p3 - p2 Collect the terms in -1359510m + 7m*3 + 1359510m. 7m3 Collect the terms in -1016z*2 + 4 + 496z*2 + 528z*2 - 4. 8z*2 Collect the terms in 10k + 5k2 + 9k + 25k. 5k*2 + 44k Collect the terms in -9x3 + 177x*2 - 177x*2 + 9x*3 + 2x*3. 2x*3 Collect the terms in 3v*2 + 389917435v - 389917435v. 3v*2 Collect the terms in 12w - 79 - 94 + 23w + 2w*3 - 35w. 2w3 - 173 Collect the terms in 5f - 8f - 8f*2 - 5f - f + 6f2. -2f*2 - 9f Collect the terms in 19 - 2v2 - 3 + 3. -2v*2 + 19 Collect the terms in 2207 - 5608 - 6153 - 7w*2. -7w*2 - 9554 Collect the terms in -194 + 9f + 21 + 17f. 26f - 173 Collect the terms in -53a3 + 284a*3 - 141a*3 - 88a*3. 2a*3 Collect the terms in -786a*2 + 315a*2 + 334a*2 + 357a*2. 220a*2 Collect the terms in 1128593u + u*2 + 2u*2 - 1128593u. 3u2 Collect the terms in -169o*2 + o - 6 - 3o + 472o2. 303o*2 - 2o - 6 Collect the terms in 266s2 + 232s*2 + 1137s*2. 1635s*2 Collect the terms in -556 - 560 + 1494 - 378 + 2w*2. 2w*2 Collect the terms in 24g - 44g2 - 2g + 55g - 77g. -44g2 Collect the terms in 75i*3 - 15i*3 + 8i*3. 68i*3 Collect the terms in -419b + 800b - 390b. -9b Collect the terms in -52748t + 158238t - 52744t - 52744t. 2t Collect the terms in 35s + 35s - 99s - 87s - 33s. -149s Collect the terms in 8x3 + 9x*2 - 9x*2 + 2x + 25x3 - 5x. 33x3 - 3x Collect the terms in 9846d - 7d*2 - 2d*2 - 9846d. -9d2 Collect the terms in -2g*3 - 7g*3 - 55g*2 + 13 + 11g*3. 2g*3 - 55g*2 + 13 Collect the terms in -55a + 4 + 18 - 58 - 44. -55a - 80 Collect the terms in 2z*3 + 7180z*2 - 3178z*2 - 4002z*2. 2z*3 Collect the terms in 411 - 198 - 215 - 21d*3 + 0d + 0d. -21d*3 - 2 Collect the terms in -12s - 297s + 11s*2 - 10s. 11s2 - 319s Collect the terms in 589q2 + 0q3 + q3 + q*3. 2q*3 + 589q*2 Collect the terms in -9h*3 + 33h*3 + 12h*3 - 21h*3. 15h*3 Collect the terms in -287v*2 - 127v*2 - 13v - 100v2 + 14v. -514v2 + v Collect the terms in -4l*3 + 329l - 618l + 289l - 3l3. -7l*3 Collect the terms in -7 + 31 - 24 + 7701o. 7701o Collect the terms in -4f - 79f2 + 82f*2 + 2f + 2f. 3f*2 Collect the terms in 73s*3 - 80s*3 - 45 + 45. -7s*3 Collect the terms in 3z*2 + 4z*2 - 4z*2 + 12z*2 - 5z*2. 10z*2 Collect the terms in 12b - 12b - 2b*2 - 332 + 630 - 298. -2b*2 Collect the terms in 3l*2 - 11204 + 21785 - 10581. 3l*2 Collect the terms in 3876 + 10k - 3876 - 55k. -45k Collect the terms in -26m3 + 25m*3 - 5013 + 0m*2 + 5013 + 0m2. -m3 Collect the terms in 38g3 + 26g*3 + 114g*3. 178g*3 Collect the terms in 602w + 461w + 327w + 109w. 1499w Collect the terms in 16q + 4q - 35q - 5q + 14q. -6q Collect the terms in 1939i3 + 379i*3 + 889i*3. 3207i*3 Collect the terms in 3u*3 - 98u*2 - 6u*3 - 126u2 + u3. -2u3 - 224u*2 Collect the terms in -37p + 3p + 9p + 6p + 2p + 12p. -5p Collect the terms in -1812y3 + 3639y*3 - 1816y*3. 11y*3 Collect the terms in 4881o*2 - 1186o*2 - 1225o*2 - 1231o*2 - 1238o2. o2 Collect the terms in -80r2 - 15r*2 + 66r*2. -29r*2 Collect the terms in -33 - 41 - 36 + 181 - 32 - 41 - 7g. -7g - 2 Collect the terms in -64i*2 + 64i*2 - 110i*3 + 109i*3 - 7i. -i*3 - 7i Collect the terms in 21q2 - 40q*2 + 20q2 - 2835. q2 - 2835 Collect the terms in 35 + 36 + 8y + 36 - 148 + 41. 8y Collect the terms in -46w + 12w + 11w - 7 + 16w. -7w - 7 Collect the terms in -176 + 176 - 18a*3 + 4a*3 + 37a*3. 23a*3 Collect the terms in 48m*2 - 65m*2 + 8m*2 + 4m*2. -5m*2 Collect the terms in -1052s3 - s2 + s*2. -1052s*3 Collect the terms in -1631921m + 1 - 1 - 6m2 + 1631921m. -6m2 Collect the terms in -64n*2 - 21329n + 21329n. -64n*2 Collect the terms in 53h - 56h + 190 - 186. -3h + 4 Collect the terms in 3k - 2 + 22k + 28k - 56k + 2. -3k Collect the terms in 23y - 7y3 - 5y - 6y - 8y - y. -7y3 + 3y Collect the terms in -7203f3 + 3606f*3 + 3589f*3. -8f*3 Collect the terms in 2h*2 + 4h - h*2 + 76h + 0h2 + 24h. h*2 + 104h Collect the terms in o - 1107o3 - o + 1564o*3 - 975o*3. -518o*3 Collect the terms in -489825 + 14r*2 + 489825 - 31r*2 + 16r2. -r2 Collect the terms in 377g2 - 1115g*2 - 1265g*2 - 437g*2 + 215g*2. -2225g*2 Collect the terms in -3100h*2 - h + 2h - 5833h2. -8933h*2 + h Collect the terms in 161492q + 1 - 161495q - 1. -3q Collect the terms in -4h3 + 34h - 36h + 478h*2 + 4h*3 - 3h*3. -3h*3 + 478h*2 - 2h Collect the terms in 23567022 - 23567022 + 5h2. 5h*2 Collect the terms in 215 + 19m + 201 - m - 402. 18m + 14 Collect the terms in 23t*3 - 6t3 + t3 - 4t3 - 11t*3. 3t*3 Collect the terms in 3i - 6i + i - 27i*2 - 17i*2 + 36i*2. -8i*2 - 2i Collect the terms in 6 + 51l3 - 4 - 4 + 74l*3. 125l*3 - 2 Collect the terms in -5c*2 + 0c*2 + 9c*2 - 3c*2 - 17c. c*2 - 17c Collect the terms in -l - 3 + 0l + 2 + 0l. -l - 1 Collect the terms in 16 + 18 - 87 + 4w2 + 38 + 15. 4w*2 Collect the terms in -469z*3 - 475z*3 - 16 + 946z*3. 2z3 - 16 Collect the terms in -184410 - u2 - u*2 + 368789 - 184397. -2u*2 - 18 Collect the terms in -3u + 3u - 2u + 57u3 + 267u*3 + 32u*3. 356u*3 - 2u Collect the terms in 7h + 16 - 7h + 19h. 19h + 16 Collect the terms in -104h2 - 121h*2 - 16h + 16h. -225h*2 Collect the terms in -2951g*2 + 754g*2 + 750g*2 + 779g*2 + 742g*2. 74g*2 Collect the terms in -1 + 180q*2 + 120q*2 - 108q*2. 192q*2 - 1 Collect the terms in -5 - 2 + 5 - 5i - 71i2 - i. -71i*2 - 6i - 2 Collect the terms in -23g3 + 32g3 + g3 + 7g3. 17g*3 Collect the terms in 7r - 10r2 - 3r*2 + 2r*2. -11r*2 + 7r Collect the terms in 6179m + 6171m - 20m3 - 12350m. -20m3 Collect the terms in -392203s*2 + 9s - 9s. -392203s*2 Collect the terms in -4p + 5p + 198p*2 + 148p*3 + 153p*3 - 198p*2. 301p*3 + p Collect the terms in -636i*3 - 3i - i - 36i3 - 225i*3. -897i*3 - 4i Collect the terms in 70j + 320j*2 + 7j*3 - 5j*3 - 320j2 + j3. 3j3 + 70j Collect the terms in -11z - 9z + 27z + 34z. 41z Collect the terms in 5i - 18 + 83 - 26 - 24 - 20. 5i - 5 Collect the terms in 3r - 4r + 33r*2 + 22r*2 + r + 10. 55r*2 + 10 Collect the terms in 0 - 2013b + 0 + 1981b. -32b Collect the terms in -536q - 223q + 207q - 327q. -879q Collect the terms in -1641m*3 + 944m*3 + 705m*3. 8m*3 Collect the terms in -18p - 16p + 34p + 54p2 - 435p*2. -381p*2 Collect the terms in -18y*3 + 4y*3 + 2y3 + y3 + 10y3 + 0y3. -y3 Collect the terms in -86f2 + 16478f*3 - 32965f*3 + 86f*2 + 16491f*3. 4f*3 Collect the terms in 865 - 433 - 432 - a - 4a. -5a Collect the terms in -505186w + 252595w - 31w*2 + 252591w. -31w2 Collect the terms in 4f*3 - 12 + 25 - 521f - 13. 4f3 - 521f Collect the terms in -17824529 - 15d2 + 17824529. -15d*2 Collect the terms in -106u + 108u - 11u*2 + 8u*2. -3u*2 + 2u Collect the terms in -1477w2 - 1780w*2 + 3255w*2. -2w*2 Collect the terms in 1890n*2 + 1852n*2 - 764n*2. 2978n**2 Collect	{ "pile_set_name": "DM Mathematics" }
, 46/7, -8/5? -8/5 Which is the third biggest value? (a) 378 (b) -3 (c) 73 (d) -4 (e) -6.9 (f) 4 (g) 3/2 f What is the third biggest value in 3.4, -7/335, 0, 5? 0 What is the second smallest value in -0.1, -1, 5, -0.3, -46654, -0.5? -1 What is the third smallest value in 0, -2, 1/22, 2/13, -611? 0 What is the second biggest value in -2/11, 565, -10, -5, 0.1, 0, -14? 0.1 Which is the seventh biggest value? (a) -2/15 (b) -8 (c) 1/4 (d) -6 (e) 0.3 (f) 2/11 (g) -92 g What is the sixth smallest value in 3, -21973, -2, 11, -0.5, -1/3? 11 Which is the third biggest value? (a) 6 (b) 1212 (c) -5 (d) 1164 a Which is the fourth smallest value? (a) 4/5 (b) -0.2 (c) 0.3 (d) -526938 (e) -1/3 c What is the smallest value in -1/716, 5/4, -13, 0, -33/4? -13 What is the smallest value in 2/3, -0.12, 42/19, 1, -4.09, 0.3, 1/8? -4.09 Which is the fourth biggest value? (a) 7/3 (b) 0.5 (c) 0.1 (d) -2 (e) 2.2 (f) 2/3 b What is the third biggest value in 4, -3074, -2, -1/3, -23/8? -2 Which is the fourth biggest value? (a) 42/109 (b) 5 (c) -6.8 (d) 3/7 c Which is the sixth smallest value? (a) 15 (b) 3.63 (c) 5/3 (d) 2/5 (e) 14 (f) 4 (g) 6 e Which is the sixth smallest value? (a) 1/3 (b) -1/24 (c) 2.4 (d) 3/5 (e) -4 (f) -2 c Which is the fourth smallest value? (a) 19 (b) -61 (c) 0.16 (d) -2/15 (e) 2/7 (f) 4/3 (g) -2 c What is the third biggest value in 1/4, 2536498, 0.1? 0.1 Which is the second biggest value? (a) 0.15 (b) 0.4 (c) 0 (d) -0.4 (e) 4 (f) 0.6 (g) 0.035 f What is the third smallest value in -5, -9, 6/5, 0.02517, 3/4, -2/11? -2/11 Which is the biggest value? (a) 73 (b) 114 (c) 2/5 (d) 2/9 (e) -738 b Which is the smallest value? (a) -354 (b) -2 (c) 4 (d) 5 (e) -1/30 (f) -0.1 a What is the third biggest value in -2/42649, 14/11, 14? -2/42649 What is the smallest value in -2/9, 0, 1/6, 0.1, -7768, 0.4, 1/4? -7768 What is the third biggest value in -21, -271770, 3/23? -271770 Which is the third smallest value? (a) 0.1 (b) 84 (c) -1 (d) -8 (e) -2/7 (f) -2 (g) 13 c What is the smallest value in 6, -1/4, 8, -1, 83, 5? -1 What is the fifth smallest value in 5, 1, 6853, -9, 1/8, 2? 5 What is the third smallest value in 1, 102, -112? 102 What is the seventh biggest value in -2, -5, 4, 82, -113, 2, 1? -113 Which is the sixth biggest value? (a) -29 (b) -5135 (c) 3/5 (d) -23 (e) 2/5 (f) 4 (g) -1/3 a What is the biggest value in -1, 2/27, 0.611, 3, 2/3? 3 What is the third smallest value in 1/3, -3, -275545? 1/3 Which is the fourth smallest value? (a) -3/8 (b) -2.1 (c) 61 (d) 1.9 c Which is the fourth smallest value? (a) -97644 (b) -3 (c) 1/3 (d) 1 (e) -21 (f) -0.2 f What is the third biggest value in -9, 37, 6/17095? -9 Which is the fifth biggest value? (a) -2/11 (b) -2 (c) -504 (d) 1 (e) 159 c What is the third smallest value in -249.4, 8, 619? 619 What is the fourth smallest value in -16, -5, 135/74, -26? 135/74 Which is the fifth smallest value? (a) -1/3 (b) -0.5 (c) -1/5 (d) -6 (e) 1 (f) 3.7 (g) 0 g What is the second biggest value in -184, -4, 26, -5, -5454, 0? 0 Which is the third smallest value? (a) 9/5 (b) 1/3 (c) 2 (d) -20/11 (e) -2/19 (f) -3 e Which is the second biggest value? (a) 3 (b) 2 (c) 0.018 (d) -4 (e) 1/6 (f) 0.21 b Which is the smallest value? (a) 529599 (b) -9 (c) 5 b What is the second biggest value in 12, 67838, -0.2, -0.5, 1? 12 What is the fourth biggest value in -0.456, -6, 4/3, 1, -3, -1/3? -0.456 What is the biggest value in -0.4, 0.0412, 3/1445? 0.0412 Which is the biggest value? (a) 0.0126 (b) 1 (c) -4 (d) 14049 d Which is the second biggest value? (a) 26 (b) -204 (c) -18 c What is the second smallest value in -1035/4, 1/100, -1/4, -5? -5 Which is the second biggest value? (a) 5 (b) 6720 (c) -410.1 a What is the second biggest value in -5, 3, 4, 136, 0, -0.056? 4 Which is the biggest value? (a) -19/4 (b) 8 (c) -4/531 (d) -0.3 b What is the third smallest value in -0.3, 0, -8, -14, 183/8? -0.3 What is the second biggest value in -719650, -11, -1? -11 What is the fourth biggest value in -7/3, 4, 0.05, 2/11, -0.2, -81/5, 6/11? 0.05 Which is the second biggest value? (a) -51.8 (b) -2 (c) -2486 (d) 2/9 (e) -1/2 e Which is the fifth biggest value? (a) -105 (b) -0.16 (c) -0.916 (d) 0.1 (e) 5 a Which is the fourth smallest value? (a) 37 (b) 2 (c) 278 (d) 1 (e) 0.1 (f) 0.5 (g) -0.3 d Which is the second biggest value? (a) -0.09 (b) 0.4 (c) 5 (d) -3 (e) -2/89 (f) 4/7 f Which is the biggest value? (a) -0.0724 (b) -7 (c) -16 (d) 1 (e) -27 (f) 0.05 d What is the fourth biggest value in 5/7, -1/3, 17.49, -5, 2/7? -1/3 Which is the smallest value? (a) -6 (b) -0.4 (c) -0.27 (d) -2/3 (e) 2 (f) 1 (g) 0.02 a What is the second smallest value in -0.2, -481817, -1? -1 What is the fifth smallest value in -3, -5, -1/5, 4, 3.259? 4 What is the fourth biggest value in -3, 4, 0.3, -1/5, -3/67, -0.3, 5? -3/67 Which is the fourth biggest value? (a) -6 (b) -2/15 (c) 0.0635 (d) 166 a What is the second biggest value in -3, 1884, 1/6, 6/107, -0.1? 1/6 Which is the fourth biggest value? (a) 5/7 (b) -10/9 (c) -0.1 (d) -7 (e) -2 (f) 0.5 (g) -300/7 b What is the sixth smallest value in 3, 22, 0.5, 0, 1/6, 0.3, -16/2907? 3 Which is the second biggest value? (a) -17/4 (b) 3/2 (c) 2/11 (d) -639/7 c What is the seventh smallest value in 2, 2/13, 4, -2, 48, 0.4, -33? 48 What is the fourth smallest value in -1/5, 4, 4/5, 24, 2/9, 15, 32? 4 Which is the second biggest value? (a) -4 (b) -215 (c) -23466 b What is the fourth biggest value in 0.45, -8, 6/11, 779? -8 What is the fourth smallest value in 0, 4, -5, 25150645? 25150645 Which is the fourth biggest value? (a) -2.6 (b) 0 (c) -150 (d) 0.22 (e) -0.5 (f) -3 (g) 1/7 e Which is the biggest value? (a) -4 (b) -10 (c) 22174 c What is the third biggest value in -0.0522, -1/12, -2.2, 0.052? -1/12 What is the fifth biggest value in 1, -18, -0.2, -4/79, 0.2, 4? -0.2 What is the seventh smallest value in -2/3, -0.3, 2, -0.2, -2/7, 18, -0.6? 18 What is the fifth smallest value in 7830, 5, 3, -0.5, -1/8? 7830 What is the smallest value in 1/7, -2, 0, 5, 17/7, -0.11, -0.067? -2 Which is the second biggest value? (a) 300 (b) -5/2 (c) 7/5 (d) -2.23 c What is the third smallest value in 2/41, -3, -128, -125/3? -3 Which is the smallest value? (a) -7/239 (b) 19530 (c) 1/8 a Which is the smallest value? (a) 0.063 (b) -1/2 (c) 1 (d) -1.6 (e) -3159 e What is the third smallest value in 20, -0.3, 1.4113595? 20 What is the biggest value in 3, -3, 2, -800, 6/7, 54, -2? 54 What is the fifth biggest value in -2/3, -5/2, -2.4, 4961, 2/15, -0.5? -2.4 Which is the smallest value? (a) 12.1174 (b) -1.5 (c) 1/5 (d) -8 d Which is the biggest value? (a) 15/14 (b) -2 (c) 4 (d) -5 (e) -473 c What is the sixth smallest value in 144, 7/3, -5/4, 3, -0.4, 0.4, 6? 6 Which is the fifth biggest value? (a) 3 (b) 1 (c) -0.4 (d) 3146262 (e) -2/17 c Which is the sixth biggest value? (a) -7 (b) -19 (c) -9/5 (d) -0.2 (e) 3 (f) -5/2 (g) 0 a What is the fifth smallest value in 5, 18, -4247, -5, 0? 18 What is the smallest value in -63871, 2/11, 0.5, 0.219, -3? -63871 What is the smallest value in -2, 96236, -10, -5? -10 Which is the sixth biggest value? (a) -1/2 (b) 1/8 (c) 4/3 (d) 0.4 (e) 4/5 (f) 2/3 (g) 51.7 b Which is the smallest value? (a) -8 (b) 36.58 (c) -1 (d) -5 (e) -2501 e What is the fifth smallest value in 22, -0.358, 4, 22/5, -3? 22 Which is the biggest value? (a) 2.2579 (b) 3/40 (c) 28 c Which is the third smallest value? (a) -1 (b) -0.08 (c) -2/17 (d) 0.3 (e) 17 (f) 0.07 b What is the second biggest value in 17, -15, 0.4, 64, -0.31, 4? 17 Which is the fourth smallest value? (a) 2/7 (b) 4 (c) -2/7 (d) -0.1123 (e) -5 (f) 2.2 a Which is the second smallest value? (a) 2797 (b) 3 (c) 937 c Which is the third biggest value? (a) -0.4 (b) 1/3 (c) -3/8 (d) -2/13 (e) -1/6 (f) 2/65 (g) -0.6 d Which is the biggest value? (a) 8 (b) -4/5 (c) -2/11 (d) 0.3 (e) 25/14 (f) -3 (g) -5 a What is the third smallest value in -31.5, 4, -153, 2/9? 2/9 Which is the third smallest value? (a) -16/45073 (b) 2/13 (c)	{ "pile_set_name": "DM Mathematics" }
te the greatest common divisor of 3731 and 91. 91 What is the greatest common factor of 481 and 26? 13 What is the highest common factor of 258 and 12? 6 Calculate the highest common divisor of 42 and 2758. 14 What is the highest common factor of 18 and 423? 9 What is the highest common divisor of 77 and 133? 7 Calculate the greatest common factor of 6715 and 10. 5 Calculate the greatest common factor of 195 and 39. 39 Calculate the highest common divisor of 130 and 1070. 10 Calculate the greatest common divisor of 39 and 767. 13 Calculate the greatest common factor of 28 and 52. 4 Calculate the greatest common divisor of 195 and 5. 5 Calculate the greatest common factor of 91 and 1589. 7 Calculate the greatest common factor of 850 and 34. 34 Calculate the highest common divisor of 578 and 2. 2 Calculate the highest common factor of 344 and 258. 86 Calculate the highest common divisor of 85 and 5. 5 What is the highest common divisor of 3150 and 950? 50 Calculate the highest common divisor of 90 and 144. 18 What is the greatest common divisor of 3489 and 3? 3 What is the highest common divisor of 84 and 72? 12 What is the highest common divisor of 17020 and 20? 20 What is the highest common factor of 60 and 200? 20 What is the highest common divisor of 710 and 1562? 142 Calculate the greatest common factor of 7016 and 8. 8 What is the greatest common factor of 9 and 3? 3 Calculate the greatest common factor of 1 and 75. 1 What is the highest common divisor of 7 and 119? 7 Calculate the highest common divisor of 60 and 720. 60 What is the highest common factor of 20 and 1110? 10 What is the highest common factor of 114 and 18? 6 What is the greatest common divisor of 824 and 72? 8 Calculate the highest common divisor of 704 and 1024. 64 Calculate the highest common factor of 52 and 676. 52 What is the greatest common divisor of 14 and 112? 14 What is the greatest common divisor of 11241 and 18? 9 Calculate the greatest common factor of 3029 and 13. 13 Calculate the greatest common factor of 20822 and 116. 58 Calculate the greatest common divisor of 902 and 22. 22 What is the greatest common factor of 884 and 364? 52 Calculate the greatest common divisor of 36 and 666. 18 What is the greatest common factor of 64 and 192? 64 What is the highest common factor of 2546 and 323? 19 What is the highest common factor of 136 and 1054? 34 What is the greatest common divisor of 18619 and 215? 43 What is the highest common divisor of 217 and 124? 31 Calculate the highest common factor of 153 and 9. 9 Calculate the highest common divisor of 113 and 3616. 113 Calculate the highest common factor of 91 and 182. 91 Calculate the greatest common divisor of 70 and 448. 14 Calculate the highest common divisor of 130 and 26. 26 What is the highest common divisor of 19 and 361? 19 What is the greatest common divisor of 493 and 29? 29 What is the highest common divisor of 30 and 58500? 30 What is the greatest common factor of 10 and 68880? 10 Calculate the highest common factor of 174 and 17226. 174 Calculate the greatest common factor of 83 and 14027. 83 Calculate the highest common factor of 99 and 165. 33 Calculate the highest common factor of 58 and 4379. 29 Calculate the highest common factor of 405 and 3. 3 Calculate the highest common factor of 176 and 1168. 16 What is the greatest common divisor of 3936 and 574? 82 Calculate the highest common factor of 5053 and 163. 163 What is the greatest common factor of 44 and 16? 4 What is the greatest common divisor of 22 and 10? 2 What is the greatest common divisor of 72 and 9? 9 Calculate the greatest common divisor of 47 and 1504. 47 Calculate the greatest common factor of 327 and 8611. 109 What is the highest common divisor of 1246 and 28? 14 What is the greatest common divisor of 310 and 280? 10 Calculate the highest common divisor of 10 and 1150. 10 What is the greatest common factor of 59 and 531? 59 Calculate the highest common factor of 118 and 1062. 118 What is the highest common divisor of 107163 and 147? 147 What is the greatest common divisor of 270 and 660? 30 What is the greatest common divisor of 345 and 69? 69 Calculate the highest common divisor of 340 and 25. 5 What is the highest common factor of 486 and 72? 18 Calculate the greatest common divisor of 9 and 45. 9 What is the greatest common factor of 21069 and 9? 9 Calculate the greatest common divisor of 107 and 1391. 107 Calculate the greatest common factor of 396 and 48. 12 What is the greatest common divisor of 104 and 130? 26 What is the greatest common factor of 456 and 54? 6 Calculate the greatest common divisor of 134 and 603. 67 Calculate the greatest common divisor of 345 and 184. 23 Calculate the greatest common factor of 12 and 80. 4 What is the greatest common factor of 162 and 2250? 18 Calculate the highest common divisor of 38 and 2546. 38 Calculate the highest common divisor of 440 and 55. 55 What is the highest common factor of 14214 and 138? 138 What is the greatest common divisor of 66 and 627? 33 Calculate the greatest common factor of 770 and 4928. 154 What is the highest common divisor of 427 and 7? 7 Calculate the highest common divisor of 8230 and 5. 5 What is the highest common divisor of 1148 and 8? 4 Calculate the highest common factor of 12 and 3. 3 What is the greatest common factor of 30730 and 70? 70 Calculate the highest common factor of 14 and 378. 14 What is the highest common factor of 506 and 44? 22 What is the highest common factor of 1261 and 26? 13 Calculate the greatest common divisor of 54 and 15930. 54 What is the highest common factor of 3405 and 908? 227 Calculate the highest common divisor of 1308 and 180. 12 Calculate the highest common factor of 2290 and 330. 10 What is the highest common factor of 183 and 671? 61 What is the highest common factor of 77 and 161? 7 Calculate the greatest common divisor of 15326 and 194. 194 What is the highest common factor of 93 and 775? 31 What is the greatest common factor of 517 and 77? 11 Calculate the highest common divisor of 222 and 25308. 222 What is the greatest common divisor of 76 and 95? 19 What is the greatest common divisor of 94 and 235? 47 Calculate the greatest common factor of 7279 and 29. 29 What is the highest common divisor of 57 and 3819? 57 What is the highest common divisor of 96 and 320? 32 Calculate the highest common factor of 42 and 27706. 14 What is the highest common divisor of 31 and 1271? 31 Calculate the highest common factor of 120 and 15. 15 Calculate the greatest common factor of 744 and 72. 24 What is the highest common factor of 5184 and 192? 192 Calculate the greatest common divisor of 3220 and 196. 28 Calculate the greatest common factor of 119 and 63. 7 What is the highest common factor of 18 and 144? 18 Calculate the greatest common divisor of 31 and 217. 31 Calculate the highest common factor of 90 and 405. 45 Calculate the highest common divisor of 234 and 9594. 234 What is the highest common divisor of 15 and 205? 5 Calculate the highest common divisor of 200 and 824. 8 What is the greatest common divisor of 9 and 6? 3 Calculate the highest common factor of 378 and 594. 54 What is the highest common factor of 150 and 3225? 75 What is the highest common factor of 380 and 360? 20 What is the highest common factor of 526 and 1315? 263 Calculate the highest common divisor of 380 and 20. 20 What is the highest common divisor of 20 and 220? 20 What is the highest common factor of 24486 and 693? 231 What is the greatest common divisor of 6 and 1206? 6 Calculate the highest common factor of 30 and 4590. 30 Calculate the greatest common divisor of 34 and 8636. 34 What is the highest common factor of 16 and 20? 4 What is the highest common factor of 404 and 16? 4 What is the highest common divisor of 392 and 216? 8 What is the highest common factor of 117 and 4875? 39 Calculate the greatest common factor of 192 and 448. 64 What is the greatest common divisor of 1024 and 72? 8 What is the highest common factor of 116 and 348? 116 Calculate the highest common divisor of 10 and 655. 5 What is the highest common divisor of 405 and 60? 15 What is the highest common factor of 8878 and 3281? 193 Calculate the highest common factor of 77	{ "pile_set_name": "DM Mathematics" }
t i be (-1)/(-4)o/(-305). Which is bigger: -2/5 or i? i Let z(d) = d2 + 4d + 4. Suppose 3v = -4 - 8. Let q be z(v). Does 2 = q? False Suppose -3l + 4 = l + c, 5l + 2c - 8 = 0. Is -6/13 bigger than l? False Let k be (-1)/3(-12)/16. Let q = k - -1/4. Is q != -1/3? True Let u = 17 + -14. Let t = 0 - 0. Let a be (t + 0)(u + -4). Which is smaller: -1 or a? -1 Let y(g) = g + 1. Let j be y(2). Let m be 2 - -2 - 3 - -1. Which is bigger: m or j? j Let y be -4 - 278/70-1. Is y bigger than 1? False Let m = -1 + 1. Let d = -148 - -1775/12. Does d = m? False Let z = 12 - 11.4. Which is smaller: 2/11 or z? 2/11 Suppose 5b + 31 = 4o, 0o - 3o = 3. Let c = b + 7. Is -2/3 smaller than c? True Let h(o) = 3o*2 - 10o - 9. Let z(a) = a*2 - 5a - 4. Let k(l) = 2h(l) - 5z(l). Let i be k(-2). Which is greater: -2 or i? -2 Let t be 14/(-10) + (-1 - -2). Let i = 55 - 55. Is t bigger than i? False Let x = -96 + 28. Is 0.1 at least as big as x? True Let g = -0.14 - -0.09. Which is bigger: 5/2 or g? 5/2 Let a(q) = q*2 + 3q - 1. Let l be a(-5). Suppose 2 = -u + g, -l - 6 = -3u - 4g. Is 0 at most u? True Let q(i) = 2i2 + 3i - 1. Let j be q(-3). Let o be 22/(-8) - 2/j. Suppose -1 = -5f + 6f. Do o and f have the same value? False Let q = -18.8 + 19. Is q greater than or equal to -0.11? True Suppose 11m - 13 = -2m. Let y be ((-6)/(-32)-2)/(-1). Does y = m? False Suppose 2f - f = 2w + 7, w + 21 = 4f. Let d = 8 - 7. Which is bigger: w or d? d Let n = -26 - -339/13. Is n smaller than -5? False Let s be (-3)/(9/5)-3. Suppose 0 = 3f + 3m - 15, -21 = -sf - 2m - 5. Suppose -c + f = -3v, 2c + 0v - 8 = 2v. Is c >= 4? True Suppose 0 = -2i + 2. Is i < 2/9? False Let l = 5.9 + -4. Let p = -4 - -2. Let i = l + p. Is 0.1 not equal to i? True Suppose -5c + 4 = -4n, 3c + c = -3n - 3. Let y = c - -4. Let q = y - 2. Which is smaller: 0 or q? 0 Let j(a) = -1 - 5 + 9a - a2 + a. Let p be j(9). Suppose -5b - 10 = 2c + 8, -pb - 11 = c. Which is bigger: -2/5 or c? c Let z = 3 + 0. Let h = -46/3 - -16. Is h at least z? False Let u = 107 - 73. Is 35 bigger than u? True Let f(q) = -q*2 - 4q + 4. Let p be ((-9)/(-12))/((-3)/24). Let w be f(p). Do w and -7 have the same value? False Let v = 0.3 + -1.3. Let h = -3.019 + 0.019. Let z = h + v. Is z less than -1? True Suppose 3m + m = 28. Let v = 7 - m. Let g(a) = -a3 + 2a*2 + 1. Let t be g(2). Which is smaller: v or t? v Let i(c) = -2c + 1. Let f be i(0). Suppose -5 = 3t - 0t + 5o, o + 19 = 3t. Suppose a + 3 - 4 = -5k, -tk + 5 = 5a. Is a greater than or equal to f? True Let b(a) = 3a*2 + 7a - 6. Let y(d) = -2d2 - 5d + 4. Let x(k) = 5b(k) + 7y(k). Suppose m + 3m = 8. Let w be x(m). Which is bigger: w or 1/2? w Let r(h) = -h - 1. Let i be r(-1). Let n be (i/(-12))/(-1). Suppose n = -f - 1. Is 1/4 <= f? False Suppose 4y + 13 = 2t - 33, -2y - 2t = 32. Is -13 greater than or equal to y? True Let o = -29/1471 - -57227/291258. Let p = 1/22 + o. Which is greater: p or 0.1? p Let v = 83.88 - 84. Which is bigger: 1 or v? 1 Let k(v) = v*2 + 4v + 2. Let u be k(-3). Let m be (-1)/1u + -13. Let d be (m/(-8))/(6/16). Is 3 >= d? False Let i(s) = -s3 + 5s*2 + 5s + 6. Let v be i(6). Let p = -12 - -11. Is p < v? True Let c = 16.1 - 15. Let q = c - 1. Which is bigger: -0.1 or q? q Let c(y) = y3 + y2 - y + 1. Let v be c(0). Let l(r) = -8r - 3r*3 + 4r*3 - 8r*2 - 4r*2 + 5r*2. Let b be l(8). Are b and v nonequal? True Let s = 4 + -4.2. Let h = 151 + -1061/7. Which is greater: h or s? s Suppose 29 = 6u - 1. Suppose 1 + 14 = uv. Is v smaller than 3? False Suppose -4z - 20 = 5u, -2u + 0z + 3z - 8 = 0. Let p = 0.4 + -0.3. Is u at least p? False Let a(g) = -g - 11. Let o be a(5). Is -17 equal to o? False Let v be 14/18 - 6/(-27). Suppose 5 = 3o - v. Does o = 2? True Let z = 128 - 127. Which is greater: z or -7/19? z Let s = -13.99 + 14. Is s <= -0.2? False Let n be (1 + 2 - 1) + (-2 - -3). Which is greater: n or 1? n Suppose 6s + 53 = -1. Are -9 and s unequal? False Let h be (-3)/9 - 16/6. Let r(a) = -a + 2. Let k be r(h). Let j be 40/(-32)1/k. Which is smaller: 0 or j? j Suppose 10 = 2d, -5h + d + d - 15 = 0. Let p be (-10)/(-6)h + 2. Let b(a) = -2a2 - 7a + 3. Let t be b(-4). Is p > t? True Let f be 1/(-1)1 + -1. Suppose 0 = -g - 5, 2c - 1 = -0g - g. Suppose 5b + 1 = -2q, 5q + 0b + cb + 12 = 0. Which is smaller: f or q? q Let z be -2 + ((-119)/(-4))/7. Are 1 and z unequal? True Let s = 8 - 11. Let i be 9/6(-1 + s). Let n be ((-6)/(-4))/(i/(-8)). Which is bigger: n or 3? 3 Let v = -6.67 + 0.67. Which is bigger: 0.1 or v? 0.1 Suppose v = -s - 12, -5v + 5s = -3v + 24. Is -74/7 less than or equal to v? False Let m be (1/3)/(5/(-15)). Let d be 0 + 2 + (-11)/7. Is d equal to m? False Let r = 7.9 - 12. Let f = r - -4. Which is bigger: f or 0.5? 0.5 Suppose 3y - 5i - 27 = 0, -i - 4i = -4y + 31. Suppose 3j + 0 = -2h + 13, -j + 5h + 10 = 0. Is j bigger than y? True Let z(x) = -x3 + 4x*2 - 2x. Let d(v) = -v*3 + 9v*2 + v - 6. Let k be d(9). Let j be z(k). Suppose m + 4 = -ju, 4m - 5u = -1 + 19. Is 1/2 >= m? False Let h be (6/(-9))/(6/(-27)). Let n(f) = -f*3 + 2f*2 + 4f - 2. Let v be n(h). Suppose v - 5 = 4d. Is d != -1? False Let d = -2/27 + 85/54. Suppose 2p - 11 = -4n + p, -8 = -n - 2p. Is d bigger than n? False Suppose 10h + 4 = 6h. Which is smaller: h or 1? h Suppose -h + 33 = 5l - 0h, -29 = -3l + 4h. Suppose -s + 1 = l. Which is greater: -7 or s? s Let t be (-1 + -3)(-1)/(-2). Which is greater: 6 or t? 6 Suppose 0 = -5u + 4u. Is -2/7 greater than or equal to u? False Let r(y) = y3 - 5y*2 - 6y - 6. Let v = -11 + 17. Let o be r(v). Let z be (3/16)/(o/24). Is 1 greater than or equal to z? True Let f be 2532/(-84) - 2/(-14). Is f < -30? False Let j be (-1)/6 - (1 - 10/8). Which is smaller: j or -1? -1 Let i = 0.5 - 0.4. Let q = 6.1 - i. Which is bigger: q or 0? q Let l = -5 + 5.03. Suppose 42 = 5j - 7j. Let a = j - -43/2. Is a at most as big as l? False Let r be (1/(-1))/((-1)/8). Let l be (0 + -1 + r)/1. Suppose -4k + l - 19 = 0. Does k = -3? True Let r(q) = -q3 - 5q*2 + 6q + 7. Let d be r(-6). Let g = d + -5. Let o = 2 - g. Which is smaller: -3/7 or o? -3/7 Let r = 2 + -4. Let j = 8 - 5. Suppose c = jc. Is c <= r? False Let t = -2.92 + -0.08. Let m = t + 3. Which is smaller: m or 1/3? m Let i = 2 - 3. Suppose -4f + 2f = 2x + 10, -2x - 25 = 5f. Suppose x = -4o - 0 - 4. Are i and o equal? True Let u be ((-4)/12)/((-10)/(-4)). Which is greater: u or 1? 1 Let h be -1 + -3 + 4/1. Which is smaller: -2 or h? -2 Let g be (((-3)/4)/3)/((-1)/4). Which is smaller: g or 3/10? 3/10 Let k(q) = 5q - 4q + 0q*2 + 4q*2 - 3q*2 + 3q*3. Let j be k(-1). Suppose 4i - 2i = -2. Does i = j? False Let f be (-516)/(-2100) - 2/7. Suppose 5v - 2v = 0. Which is greater: f or v? v Suppose 2s - i = -11, -2s - i - 25 = 2s. Let y be ((-2)/s)/(8/48). Which is smaller: y or 3? y Let a(i) = -4i + 4. Let d be a(4). Let h be (d/(-42))/((-4)/(-7)). Is 2 less than or equal to h? False Let a be 2/9 + 4/(-27). Which is greater: 0 or a? a Suppose 0 = 4v - 0r - 4r - 12, -3v = r - 17. Suppose 2 = va + g - 27, 4a = 3g + 8. Which is smaller: a or 1? 1 Let m = -4 + 7. Suppose b + 2 - 4 = 0. Is b > m? False Let c = -62.7 + 66. Let k = 4 - c. Let o = k - -0.3. Which is greater: -2 or o? o Let g be 22/7726/2-1. Is g smaller than -4? False Let i be -703(0 - (-2)/(-10)). Let j = 141 - i. Is -0.1 at most as big as j? True Suppose -a + 2b - 24 = -4a, 5a - 3b - 40 = 0. Let i = 118 + -109. Is a != i? True Let z = -2 - 6.9. Let f = z - 0.1. Which is smaller: 0.2 or f? f Let t = 0.2 + -0.4. Let g = -8.2 + 8. Let c = t - g. Is c at least as big as -1/3? True Let r = 240 + -4319/18. Which is greater: -1 or r? r Let p(k) = -4k*3 + 5k*2 + 3k - 5. Let g(i) = 3i3 - 5i*2 - 2i + 4. Let s(z) = 3g(z) + 2p(z). Let n be s(5). Are 1 and n equal? False Let g(o) = -o*2 + 11o + 9. Let v be g(12). Let a = -16/3 + 6. Which is greater: v or a? a Let z(u) = u*2 - 2u - 4. Let g be z(4). Suppose 3h - gc + 6 = 2*h, 0 = -h + c. Which is bigger: h or 0? h Let c = -15 - 0. Is -15 bigger than c? False Let b = 17 + -16.7. Which is greate	{ "pile_set_name": "DM Mathematics" }
0. -8000 Let r = -22 - -23.8. Let g = r + -1.8. Let q = -1.8 + g. What is q rounded to 0 decimal places? -2 Let q = 83.255 - 83.3. Let m = -0.013 + 0.0642. Let g = q + m. What is g rounded to three dps? 0.006 Let b = 9.3883839696 - -816893.6120260304. Let u = b - 816887. Let x = u + -16. What is x rounded to four dps? 0.0004 Let h = 0.016 + -0.896. Let d = h - 0.12. Let a = -1.000006 - d. What is a rounded to 6 decimal places? -0.000006 Let w(l) = 5l - 5. Let s be w(2). Suppose -2873 = 4i + 2r + 6727, -4i + sr = 9600. Round i to the nearest 100. -2400 Let x = -1600.000003162 - -1600. Round x to seven decimal places. -0.0000032 Let t = -149.955259 - -151.06525973. Let p = -7.7 - -6.59. Let i = p + t. Round i to 7 decimal places. 0.0000007 Let p = -0.63 + 0.1. Let n = 0.384 + p. What is n rounded to 2 dps? -0.15 Let t = -355 - -246. Let w = -110.09 - t. What is w rounded to 0 decimal places? -1 Suppose 36 = -w + 4w. Suppose 4u - 967 = 1601. Suppose -w = -p - u. What is p rounded to the nearest 100? -600 Let n = 8.741 + -3.15. Round n to zero dps. 6 Let p = 45 + -49.5. Let s = p + 1. Round s to the nearest integer. -4 Let n = 82.0512 + -82. Round n to two dps. 0.05 Let k = 7270372.411 + -7131968.5. Let v = k - 138340. Let z = v - 64. Round z to 2 decimal places. -0.09 Let n = -1.6336 - -1.626. Round n to three dps. -0.008 Let k = 142 - 125.8. Let u = k + 28.9. Round u to the nearest ten. 50 Let i = -95 - -83. Let o = i + 11.9999795. What is o rounded to 6 dps? -0.000021 Suppose -364022 = -4z + 75978. Suppose -5s - 5s = z. What is s rounded to the nearest ten thousand? -10000 Let n = 2.54 + 41.74. What is n rounded to zero decimal places? 44 Let s = 0.02 + 5.58. Let b = -0.22 + 2.52. Let f = b - s. What is f rounded to the nearest integer? -3 Let y = -200 - -116. Let z = 84.59 + y. What is z rounded to one decimal place? 0.6 Let n = -496.9368 - -497. What is n rounded to 2 dps? 0.06 Let r = -19 + 13. Let x = -6 - r. Let y = x - 0.0003. What is y rounded to four decimal places? -0.0003 Suppose -z + 19 = -2t - t, -26 = -2z + 2t. Suppose -5s - 4r = -zs + 11753, 4s = -2r + 9392. Let a = s - 919. Round a to the nearest 100. 1400 Let j = -1330.989154 - 0.320846. Let l = 1337 + j. Round l to 1 dp. 5.7 Let w = 178 + -90. Let n = w - 100.5. Round n to the nearest 10. -10 Let d = -17 + 122. Let q = d - 105.000192. What is q rounded to 5 decimal places? -0.00019 Let c = 391.4 + -391.400013932. What is c rounded to 6 dps? -0.000014 Let g = -11.9 + 12. Let l = 0.628347 - 0.52835. Let t = l - g. Round t to 5 decimal places. 0 Let h = -0.009 + -4.391. Let t = -77 - -66.8. Let z = h + t. Round z to zero dps. -15 Let r = 15223071.94402669918474 + 0.05595530081526. Let y = r + -15223058. Let s = y - 14. Round s to 5 dps. -0.00002 Let m = -2.4 - -2.284. Let z = m - 65.884. Let i = z - -66.0000134. Round i to six decimal places. 0.000013 Let k be (-4 - -109)384/14. Let t be k(-3 - (-137)/4). What is t rounded to the nearest ten thousand? 90000 Let n = -39.9 - -5.9. Let y = n + 33.9999902. Round y to 6 decimal places. -0.00001 Let f(c) = 57c - 18. Let r be f(15). Let g = r + -1337. What is g rounded to the nearest one hundred? -500 Let i = 55.6 + -55.5999663. Round i to five decimal places. 0.00003 Let u = 0.1109 + -3.0749. Round u to two decimal places. -2.96 Suppose 0 = x + 3x - 3b - 4779994, -5x + 2b + 5974996 = 0. Round x to the nearest 100000. 1200000 Let q be -2 + 15/((-6)/(-2)). Suppose -3 = -qp + 3. Suppose o + 156 = -po. What is o rounded to the nearest 10? -50 Let i be (-2 - (-262)/6)/((-8)/43584). Round i to the nearest one hundred thousand. -200000 Let u = 2.92000362 - 2.92. What is u rounded to seven decimal places? 0.0000036 Let w = 16.701 + -0.811. Let b = -0.11 - w. Let c = 16.000152 + b. Round c to 5 decimal places. 0.00015 Let h = 256903087.99999984 - 256903069. Let g = 18.56 - -0.44. Let b = h - g. Round b to seven dps. -0.0000002 Let s = -1506 + 2382. Suppose 26m - 24m + s = 0. What is m rounded to the nearest one hundred? -400 Let f be (-8744)/(3 - ((-120)/(-14))/3). Let d = f - -1908. Round d to the nearest ten thousand. -60000 Let y = 120.5011 - 120.4. Round y to 2 decimal places. 0.1 Let i = -266 + 265.9897. Round i to three decimal places. -0.01 Suppose -5a - 3520 = -7a. What is a rounded to the nearest 1000? 2000 Let t = 482 + -1903. Let i = -472 - t. Let g = 229 - i. Round g to the nearest one hundred. -700 Let q = 0.6 - 7.8. Let y = 7.2000606 + q. What is y rounded to six dps? 0.000061 Let z = 2.7 - -1.9. Let l = -1.4299 - -6.0261. Let h = l - z. What is h rounded to 3 decimal places? -0.004 Let a = 17.2 + -17.19999216. Round a to seven dps. 0.0000078 Let g = -114044 + 162044. What is g rounded to the nearest 10000? 50000 Let j = 12788104 + -12788103.87699898. Let i = -0.123 + j. What is i rounded to 7 dps? 0.000001 Let i = -66 + 217. Let d = -150.969 + i. What is d rounded to three decimal places? 0.031 Suppose -7g + 15 = -12g. Let a = -9 - g. Let i(p) = -114p - 14. Let m be i(a). What is m rounded to the nearest one hundred? 700 Let h = -6.26 - 426.74. Let p = h + 434.492. Round p to one decimal place. 1.5 Suppose 22z = 25z + 3474. Round z to the nearest 10. -1160 Let d = 356.572 + -348.4. What is d rounded to one dp? 8.2 Let z = 5.43 + -0.03. Let l = -90 + 105.6. Let y = z - l. Round y to the nearest integer. -10 Let p = 9724.030044 + -9724. Let q = -0.03 + p. Round q to 5 dps. 0.00004 Let v(j) = -j*3 - 5j*2 - 4j + 1. Let x be v(-4). Let z be -14 - -9 - 25395x. Round z to the nearest one thousand. -25000 Let b = -23.2 - -286.2. Let n = 103 - b. Let z = n + 160.000241. Round z to 5 decimal places. 0.00024 Let t = 1174.53 + -1040.3. Let c = t + -133. Round c to 1 dp. 1.2 Let c = 156 + -68. Let n = c + -87.999724. What is n rounded to 5 decimal places? 0.00028 Let d = -594.4 - -530. Let x = d - -71. Round x to zero dps. 7 Let o = -1.4 + 14.4. Let r = o + -13.00000033. Round r to seven dps. -0.0000003 Let v = -278 - -278.0133. What is v rounded to 3 decimal places? 0.013 Let p = 190 + -189.9999705. Round p to six decimal places. 0.00003 Let s = -7 - -14. Suppose f - 19 = -3w, 3w - 3f + f - 7 = 0. Suppose -y + 7 = -0y + 5j, -3j = -wy + s. What is y rounded to the nearest 10? 0 Let l = -13.6 + 13.718. Let o = -5.218 + l. What is o rounded to 0 decimal places? -5 Let m = -921.99928 + 922. What is m rounded to three decimal places? 0.001 Let y = 18931961 + -18931960.53999986. Let b = 0.46 - y. What is b rounded to 7 dps? -0.0000001 Let c = -0.29 + 0.4. Let t = c + 0.17. Let x = t + -0.28054. Round x to 4 decimal places. -0.0005 Let d = -182.4 - -6.4. Let f = d + 176.166. What is f rounded to 2 dps? 0.17 Let r = 89722.30999981 - 89722.1. Let u = -0.083 - -0.293. Let d = r - u. Round d to 7 dps. -0.0000002 Let f = -39.63 - -38. Let k = f - -1.779. What is k rounded to two dps? 0.15 Let j(d) = d - 6. Let z be j(8). Suppose -4t - f + 62 = 0, zt + t + 2f = 49. Let g(p) = 6p - 1. Let v be g(t). What is v rounded to the nearest 10? 90 Let u = -2603 + 2602.998923. What is u rounded to 5 dps? -0.00108 Let y = -136 - -137. Let h = 1.195 - y. What is h rounded to two dps? 0.2 Suppose 4x - 487295 = -3w - 0w, 487291 = 3w + 2x. Let s = -71571 - w. What is s rounded to the nearest 10000? -230000 Let n be -411/22 + (-1 - 80997). What is n rounded to the nearest ten thousand? -80000 Let i be (1018)/(-4)20/(-6). Let o be i/(2/152-1). What is o rounded to the nearest one thousand? -11000 Let z(t) = -10876t + 25. Let n be z(13). Let d = -220253 - n. Let o = -218890 - d. What is o rounded to the nearest 100000? -100000 Let c = -41539550.19000011 + 41539550. Let j = c + 0.19. Round j to seven decimal places. -0.0000001 Let w = 472 - 471.999953. What is w rounded to 5 decimal places? 0.00005 Let u be 4/1 - (4 - 2). Suppose -un + 10607 = -60129. Suppose -4j - 875368 = -n. Round j to the nearest ten thousand. -210000 Let c = 0.168 + -0.22. Let z = c + -43.948. Let f = -43.99954 - z. What is f rounded to 4 decimal places? 0.0005 Suppose 8f = -2c + 5f - 57406, c - 3f = -28694. Round c to the nearest 10000. -30000 Let k(n) = 699999n - 17. Let o(l) = -2. Let v(c) = k(c) - 6o(c). Let x = -2 + -3. Let	{ "pile_set_name": "DM Mathematics" }
de -982080 by -1984. 495 Calculate -16 divided by -76. 4/19 Calculate -2869168 divided by -2. 1434584 What is -4086476 divided by -14389? 284 Divide -419709 by 13539. -31 What is 42939 divided by -3303? -13 What is -53950 divided by -10790? 5 3077600 divided by -384700 -8 Calculate -3 divided by 5082. -1/1694 Calculate -3649 divided by -3. 3649/3 0 divided by 123382 0 -28011 divided by -7 28011/7 -3888499 divided by 6 -3888499/6 What is 18506 divided by -487? -38 382536 divided by -5544 -69 Divide 50312 by 12578. 4 Divide -4 by 28426. -2/14213 Calculate -191631 divided by 3. -63877 What is 448779 divided by 4? 448779/4 Divide 211564 by 227. 932 What is 9600 divided by -64? -150 Calculate 232470 divided by 12915. 18 -24552 divided by 31 -792 What is 1195481 divided by -17843? -67 What is 1160586 divided by 386862? 3 25750 divided by 6 12875/3 What is 711660 divided by 3? 237220 -4517 divided by -7 4517/7 32144 divided by 2 16072 18351 divided by 6117 3 Calculate 4 divided by 221. 4/221 What is -44 divided by -80645? 44/80645 What is -170898 divided by -6? 28483 Calculate 31 divided by 9132. 31/9132 Divide -2 by 223767. -2/223767 Calculate 76331 divided by 37. 2063 What is 472360 divided by -472360? -1 Divide -176778 by 366. -483 Calculate 3 divided by -386100. -1/128700 Calculate -1829430 divided by -60981. 30 117453 divided by 357 329 60888 divided by 344 177 What is 21822 divided by 10911? 2 -8 divided by -15038 4/7519 Divide 26 by 120146. 1/4621 10 divided by 53013 10/53013 What is -547069 divided by 1? -547069 Divide 15 by -21932. -15/21932 Divide -600 by 13. -600/13 Divide -3 by -334. 3/334 Calculate -51306 divided by -3. 17102 What is -198 divided by 3863? -198/3863 Calculate 147901 divided by 11377. 13 What is 207798 divided by -1174? -177 -1561580 divided by 5 -312316 What is 5 divided by -13721? -5/13721 Calculate 6286248 divided by 38804. 162 Divide 478236 by 2. 239118 What is 968351 divided by -1? -968351 Calculate 93122 divided by 1. 93122 What is 20988 divided by 1166? 18 Calculate 2290 divided by -32. -1145/16 36014 divided by 18007 2 What is 560748 divided by -3? -186916 What is 2 divided by -69885? -2/69885 Divide 1228 by -8. -307/2 Calculate 158551 divided by -6. -158551/6 Divide 4 by -113858. -2/56929 Divide -3446 by -1. 3446 What is -66039 divided by -5? 66039/5 Divide -54625 by -2185. 25 Calculate -410 divided by -619. 410/619 -3385 divided by -140 677/28 142548 divided by 6788 21 What is 4 divided by 248806? 2/124403 -202 divided by 327 -202/327 What is 14 divided by -1596? -1/114 Calculate 1794955 divided by 5. 358991 What is 64 divided by -4921? -64/4921 What is -15151 divided by -6? 15151/6 Divide 3 by -10933. -3/10933 45 divided by -1309 -45/1309 Divide -348 by -5195. 348/5195 Divide -71737 by 3119. -23 What is -23679 divided by 23679? -1 Divide 12438 by 3. 4146 28418 divided by -6 -14209/3 Calculate 1 divided by 90960. 1/90960 Calculate 1 divided by -509586. -1/509586 267372 divided by -4 -66843 515242 divided by 26 19817 What is -247962 divided by -578? 429 -709748 divided by -2 354874 What is -2858108 divided by 374? -7642 What is 958080 divided by 47904? 20 3736 divided by -1868 -2 -67524 divided by 1 -67524 What is 24728 divided by -6? -12364/3 What is -1635 divided by -50? 327/10 Calculate -63575 divided by -14. 63575/14 What is -86004 divided by 3? -28668 2109 divided by 294 703/98 Calculate -64253 divided by 67. -959 2738413 divided by 1919 1427 Calculate 2509650 divided by 4563. 550 Divide -56031 by 4. -56031/4 349419 divided by -1 -349419 -18898 divided by -18898 1 Divide 2419690 by 35. 69134 Divide 178912 by -22364. -8 Calculate -4783 divided by -29. 4783/29 What is -2865317 divided by 9583? -299 Divide -9 by -3284. 9/3284 149906 divided by 3 149906/3 -3 divided by 2987 -3/2987 Calculate -685920 divided by -68592. 10 What is -31398 divided by 2? -15699 Divide -76750 by 38375. -2 Calculate 74145 divided by 1. 74145 Calculate 4 divided by 325845. 4/325845 Divide 454144 by -1. -454144 Calculate -12176 divided by -2. 6088 -566 divided by 1 -566 -143497 divided by -6239 23 What is 140718 divided by 3? 46906 What is 16 divided by 132438? 8/66219 Divide 192966 by -3. -64322 What is 4 divided by 452633? 4/452633 739 divided by 918 739/918 3736 divided by 826 1868/413 Divide -8 by -16563. 8/16563 Calculate -10 divided by -159601. 10/159601 What is 22 divided by -42618? -11/21309 Calculate 249021 divided by 9223. 27 Calculate 102399 divided by -2. -102399/2 127794 divided by -114 -1121 Divide -3 by 4157. -3/4157 Calculate -3 divided by 286763. -3/286763 What is -3469295 divided by -693859? 5 Divide 4 by -17997. -4/17997 What is -235074 divided by 386? -609 9088 divided by 4 2272 Divide -8 by 48998. -4/24499 What is -4 divided by -9234? 2/4617 What is 506160 divided by -84360? -6 What is 30 divided by 25? 6/5 What is -15840 divided by -1440? 11 Divide 23046 by -1002. -23 Divide 238812 by -28. -8529 Calculate 635782 divided by -14. -45413 Calculate 477711 divided by 159237. 3 Divide -1168 by 81. -1168/81 Divide -58 by 4876. -29/2438 -78 divided by -5078 39/2539 Divide -220665 by 47. -4695 72745 divided by -14549 -5 Calculate -22256 divided by -22256. 1 Calculate 3 divided by 2125. 3/2125 What is 38955 divided by 159? 245 What is -2152 divided by 24? -269/3 Calculate -24907 divided by 4. -24907/4 What is -99265 divided by -1? 99265 241001 divided by -601 -401 Divide 261297 by -3. -87099 What is 21155 divided by 1? 21155 Divide 10764 by -4. -2691 37334 divided by -11 -3394 Calculate 309795 divided by -3. -103265 -215900 divided by 100 -2159 Divide 536172 by 21. 25532 Calculate -1032565 divided by 206513. -5 Calculate 11358 divided by 1262. 9 What is 3 divided by -56557? -3/56557 Calculate 277675 divided by -5. -55535 What is -107778 divided by -53889? 2 Calculate -10 divided by -5035. 2/1007 -65932 divided by -15 65932/15 -36216 divided by 24 -1509 Divide 105740 by -2. -52870 5 divided by -2976 -5/2976 Divide -4145580 by 4. -1036395 What is -3 divided by 1969? -3/1969 Divide 723290 by 5. 144658 Calculate -54 divided by 348. -9/58 Divide 1437 by 241. 1437/241 What is 1162 divided by -343? -166/49 What is 34 divided by 2543? 34/2543 Calculate 1659 divided by -123. -553/41 What is 1961405 divided by 392281? 5 Divide -227010 by -69. 3290 120 divided by -32 -15/4 Calculate -31240 divided by -6248. 5 -2792 divided by 2 -1396 -3 divided by -3167 3/3167 What is 20916 divided by -1? -20916 Divide 978035 by 215. 4549 What is 11367 divided by 9? 1263 -12158 divided by -2 6079 Divide -7449609 by 1077. -6917 Divide 30890 by 32. 15445/16 What is -310017 divided by 23? -13479 Calculate -784860 divided by 1030. -762 Divide 22410 by 3. 7470 Calculate 5558 divided by 66. 2779/33 269 divided by 55 269/55 Calculate 205712 divided by 3. 205712/3 Divide 16978 by -653. -26 What is -318318 divided by -6? 53053 Divide -78500 by 15700. -5 Calculate 8314 divided by -2. -4157 Calculate -11031 divided by 3. -3677 Divide -297534 by -3. 99178 What is 258528 divided by -16158? -16 Divide 6 by -19580. -3/9790 What is -1254618 divided by -6? 209103 What is 300074 divided by 3? 300074/3 Calculate 1199688 divided by -6216. -193 Calculate 57456 divided by 9. 6384 649650 divided by -6 -108275 Divide 693186 by 6. 115531 Divide 1692639 by 1887. 897 81189 divided by -27063 -3 What is 0 divided by 16596? 0 Divide 0 by -378. 0 Calculate -8880 divided by 2220. -4 What is -6245 divided by 562? -6245/562 3 divided by 204922 3/204922 What is 80640 divided by 1260? 64 What is -1101547 divided by -6? 1101547/6 What is -66788 divided by 4? -16697 What is 10374 divided by -247? -42 What is -580 divided by -16? 145/4 What is -943 divided by -288? 943/288 -76257 divided by 333 -229 Calculate -2123 divided by -1. 2123 8307 divided by 35 8307/35 5239 divided by 59 5239/59 What is 757445 divided by -13? -58265 Calculate 154 divided by 3. 154/3 Divide -1951358 by -563. 3466 What is 13337170 divided by -5? -2667434 Divide 201159 by -217. -927 756 divided by -378 -2 What is 70164 divided by 17541? 4 Divide 40791 by -10. -40791/10 Calculate -5 divided by -308655. 1/61731 -174966 divided by 87483 -2 What is -775452 divided by -4? 193863 Divide 4444 by -2222. -2 39 divided by 14	{ "pile_set_name": "DM Mathematics" }
ound p to four dps. 0.0001 Suppose 0r = 8r + 97504. Let h = 20728 + r. Round h to the nearest ten thousand. 10000 Let x = -1496.87862 + 21.22962. Let g = x + 1477. What is g rounded to 1 dp? 1.4 Let k = 26359 + -26358.997008. What is k rounded to two dps? 0 Let w = -4177 + 4160.87. Round w to the nearest 10. -20 Let q = 7.8 - 1.3. Let j = 87737.5017 + -87744. Let w = q + j. Round w to three decimal places. 0.002 Let l(r) = -814r - 38. Let g be -12(-5)/(-10) + 4 - 15. Let t be l(g). What is t rounded to the nearest 10000? 10000 Let r = 1611 + -1610.999998323. Round r to 7 dps. 0.0000017 Let d = -78658 + 78655.24548. Let g = d - -2.76. What is g rounded to three decimal places? 0.005 Let d = 306.05 + -306. Let j = d - 0.049999. What is j rounded to 4 decimal places? 0 Let j = 116155 - 116102.231. Round j to the nearest 10. 50 Let r = -30 + 37. Let q be (0 - -2) + r + -4. Suppose 0 = -qu - 10, -2u = n + 2u + 74008. What is n rounded to the nearest 10000? -70000 Let t = -6.825 - -7. Let a = -2716.175 + 2712. Let f = t - a. What is f rounded to zero dps? 4 Let y = -91 - -91.41. Let b = y - 0.41975. What is b rounded to 3 dps? -0.01 Let g = 375.47518 + 0.23482. Let o = 380 - g. What is o rounded to one dp? 4.3 Suppose 301720 = -3d - 4y, 2y + 502885 = -5d - y. What is d rounded to the nearest 10000? -100000 Let g = -215471380.99021 - -215472708. Let f = 1327 - g. What is f rounded to 4 decimal places? -0.0098 Let o = -113 - -139.2. Let s = 199.2 + -209. Let g = s + o. Round g to zero dps. 16 Suppose 4l = 5l - 10. Let t be (-190 - l)/((-2)/34). Round t to the nearest 1000. 3000 Let d be 1088053101/297 + 21 - 12/(-22). What is d rounded to the nearest 1000000? 4000000 Let j be 13457004 + -6 + 15 + -13. Round j to the nearest 100000. 13500000 Suppose -3w - 17 + 50 = 0. Let r be w + ((-1)/2)/((-4)/(-24)). Suppose 0 = -rd + 3d - 1750. What is d rounded to the nearest 100? -400 Let m = -17885 + 17899.5. Let g = -1.13 - -69.13. Let c = g - m. Round c to the nearest 10. 50 Suppose 7w = 10w - 27. Suppose wp + 64578 = 262308. Round p to the nearest 1000. 22000 Suppose -32f - 1015323 - 8505221 = 0. Let x = f + -252483. Round x to the nearest ten thousand. -550000 Suppose 0 = -k + 11k - 6639080. Let z be 153908/(-1 + 2 + 0). Suppose o + k = z. What is o rounded to the nearest one hundred thousand? -500000 Let z(k) = -1098027k*3 - 5k*2 - 35k - 66. Let l be z(-2). Round l to the nearest one hundred thousand. 8800000 Let t = 2134 - 2207.55. Let l = t + 68. Let u = l - 1.35. What is u rounded to the nearest integer? -7 Let d = -18 + 46. Let g = d + -27.918. Let l = -1.718 - g. What is l rounded to 0 decimal places? -2 Let n = 173.86 - 173.1351. What is n rounded to one decimal place? 0.7 Let i(r) = -15736r3 - 2r*2 + 30r. Let n be i(-5). What is n rounded to the nearest ten thousand? 1970000 Suppose 0 = 1879z - 1864z + 719250. Round z to the nearest one thousand. -48000 Let c = 54.5 - 37.8. Let b = 184.7 - c. Let m = b + -167.999858. What is m rounded to 5 dps? 0.00014 Let m = 6608860 + 3313059. Let q = 9921907.400126 - m. Let w = -11.6 - q. What is w rounded to four decimal places? -0.0001 Let f(h) = -29h + 126. Let s be f(4). Suppose sy - 25787492 = 13912508. Round y to the nearest one hundred thousand. 4000000 Let d = -5499 + 5451.001. Let q = 48 + d. What is q rounded to three decimal places? 0.001 Let p = -480067 + 1085737. Round p to the nearest ten thousand. 610000 Let w(q) = -4q - 10. Let h be w(-3). Suppose 1333205 = -t + 3a, -t + a - ha = 1333193. Let d = -5773196 - t. Round d to the nearest one hundred thousand. -4400000 Let t = -901 - -10522. Suppose 3g = -t + 2274. Let n = -25951 + g. Round n to the nearest one thousand. -28000 Let d(r) = 1488r3 + 3r*2 + 13r - 4. Let x(f) = -743f3 - f2 - 6f + 2. Let o(g) = -4d(g) - 9x(g). Let m be o(2). Round m to the nearest 1000. 6000 Let o be 1((-56)/8 + 4). Let b be (39618/(-3))/(-2) - 1 - o. What is b rounded to the nearest 1000? 7000 Let g(n) = 9n*2 - 29n + 160. Suppose -41 = -6j - 11. Let o be g(j). What is o rounded to the nearest ten? 240 Suppose 0 = t + 4p + 14, -28 = t - 4t + 2p. Let o(u) = -5 + t - u - 12u2 + 6 - 2. Let n be o(-3). What is n rounded to the nearest 1000? 0 Suppose -156n + 26818107 = -117034979 + 242606. What is n rounded to the nearest 10000? 920000 Let v = 46.8 + 211. Let a = -257.800001667 + v. What is a rounded to 7 dps? -0.0000017 Let q = -808844 + -1046956. What is q rounded to the nearest 100000? -1900000 Let d = -101 + 100.9974. Let f = d + -291.9974. Let c = 292.00117 + f. Round c to four decimal places. 0.0012 Let j = 0.056 + -70.056. Let o = j + 137. Let x = o + -66.99999776. Round x to 7 decimal places. 0.0000022 Let u = 38321.0004162 + -38321. Round u to 5 dps. 0.00042 Let h = -5410.4 + 4675. Let k = -595 - h. What is k rounded to 0 decimal places? 140 Let y be 0-34/12. Suppose -10o - 5o + 39630 = y. What is o rounded to the nearest 100? 2600 Let s = -53 + 53. Suppose 4o = 2m - 24, 7 = m - sm - o. Suppose -4d = -mj + 16, 2j - 3d - 27 = -j. What is j rounded to the nearest 100? 0 Let q = 2475.78249 - 2497.579. Let j = q - -18.616084. Let m = j + 3.18. Round m to 5 decimal places. -0.00043 Suppose -m = 2m - 33. Let z(p) = 4p + 5p - 1345p2 - 1 + 8p - mp. Let j be z(-9). What is j rounded to the nearest ten thousand? -110000 Let v = -10486 + 10438.68. Round v to the nearest ten. -50 Let y = 19.031 + -19.0271004. What is y rounded to three decimal places? 0.004 Let b = 18517.2357 - 18518. What is b rounded to 1 dp? -0.8 Suppose 5u - 1511009 - 2045576 = 0. Suppose -4z - u = -8195269. Let a = 8370988 - z. Round a to the nearest 1000000. 7000000 Let f = 4447.960203 + -4452.74. Let a = 4.78 + f. Round a to five dps. 0.0002 Let x = -722.8496 + -0.1504. Let t = -724.172 - x. What is t rounded to 1 decimal place? -1.2 Suppose 515q - 257q = 260q + 10532000. What is q rounded to the nearest one million? -5000000 Let j = 2595.3 + -2595.453428. Let g = -0.154 - j. What is g rounded to five decimal places? -0.00057 Suppose 3o = 23o - 220. Suppose -4d = c - 60004, -14d + 3 = -od. Suppose -z - z = -4s + 40000, -4s = -3z - c. What is z rounded to the nearest 10000? -20000 Let u be (-3 - (-5 + 9102))/((-1)/(-190)). Round u to the nearest one hundred thousand. -1700000 Let c = -12397 + 12436.516. What is c rounded to the nearest ten? 40 Let a = -0.056 + -57.944. Let n = -58.000158 - a. What is n rounded to four dps? -0.0002 Suppose -4i + 4f + 5586784 = 0, 2f = 62i - 67i + 6983508. What is i rounded to the nearest one million? 1000000 Let g = 9035366 + -9034899.0023. Let l = g - -0.0023. Let r = l + -466.99581. Round r to three dps. 0.004 Let a = 31.419753 - 31.42. What is a rounded to five decimal places? -0.00025 Let g = -0.232 - 0.059. Let c = g - -0.26598. Round c to three decimal places. -0.025 Let n(z) be the third derivative of 5077z4/12 - z3/6 - 7z2. Let a be n(4). Let f = a - 15415. What is f rounded to the nearest 1000? 25000 Let y(p) = -29p*3 + 14p*2 - 3p - 18. Let l(j) = 9j - 10. Let o be l(12). Suppose 0 = -10g - o - 32. Let i be y(g). Round i to the nearest 10000. 70000 Let c(w) = 2w3 + 10w*2 + 7w + 22. Let f = 35 - 44. Let n be c(f). Round n to the nearest ten. -690 Let c = 13 - 156. Let z = 11078526169.999999435 + -11078526313. Let i = z - c. What is i rounded to seven decimal places? -0.0000006 Let t = 146352513.748079758 + 0.251920242. Let u = t - 146352514.76000003. Let o = u + 0.76. What is o rounded to seven dps? 0 Let r(n) = -429999n - 1. Suppose 4j + 4i = 8, 6j - 5i + 3 = 4j. Let o be r(j). What is o rounded to the nearest 100000? -400000 Suppose 0 = -5x + x + 4c - 4, -4c = 5x - 22. Suppose 3r + 4q = 5708980, 1903015 = 3r - xr - 3q. What is r rounded to the nearest one hundred thousand? 1900000 Let z = -152699.42203 - -153459.418. Let l = -760 + z. What is l rounded to 3 dps? -0.004 Let h be (-6 + 7 + -1)/2. Suppose -3k - 2k = 4f + 53395, h = 5f - 4k + 66754. What is f rounded to the nearest one thousand? -13000 Let z = 418 - 472.3. Let m = -8.7 + z. Let b = m + 62.99976. Round b to 5 dps. -0.00024 Let b = 4.31 - -463.69. Let k = b + -	{ "pile_set_name": "DM Mathematics" }
: 1, x: 2, r: 3, z: 4, k: 1}. 1/660 Two letters picked without replacement from wud. Give prob of sequence uw. 1/6 Three letters picked without replacement from xbbxbbxbbxbbxbbbbbb. Give prob of sequence bbb. 364/969 Four letters picked without replacement from ititctihiiiitzh. What is prob of sequence izii? 1/156 What is prob of sequence xux when three letters picked without replacement from zkxuxqucxkxxxxx? 8/195 Four letters picked without replacement from {m: 1, b: 4, p: 4, j: 3, e: 1}. Give prob of sequence pmpj. 3/1430 Two letters picked without replacement from {f: 2, b: 2}. Give prob of sequence bf. 1/3 Calculate prob of sequence qq when two letters picked without replacement from {l: 5, b: 2, q: 2, h: 1, i: 1, m: 2}. 1/78 What is prob of sequence kz when two letters picked without replacement from {h: 2, r: 1, a: 1, z: 5, k: 8}? 5/34 Calculate prob of sequence or when two letters picked without replacement from bxxvvboxvbvbrvb. 1/210 Calculate prob of sequence xi when two letters picked without replacement from {x: 7, c: 1, l: 2, i: 2, a: 1, s: 2}. 1/15 What is prob of sequence rrtk when four letters picked without replacement from kmokkotkrokorioo? 1/4368 Calculate prob of sequence gr when two letters picked without replacement from {b: 3, c: 2, g: 2, r: 9}. 3/40 Three letters picked without replacement from {d: 13, i: 1, k: 2, c: 1}. What is prob of sequence kcd? 13/2040 Calculate prob of sequence gm when two letters picked without replacement from {m: 1, v: 1, g: 2, b: 4, q: 4, y: 2}. 1/91 Four letters picked without replacement from {p: 6, f: 6}. What is prob of sequence ffpp? 5/66 Calculate prob of sequence ml when two letters picked without replacement from {m: 1, o: 12, l: 2, g: 1, k: 1}. 1/136 Four letters picked without replacement from {a: 1, w: 2, f: 1, h: 11}. What is prob of sequence fahw? 11/16380 Calculate prob of sequence wx when two letters picked without replacement from jwjxxjxxwwjjxswjjjwj. 5/76 Two letters picked without replacement from agkqz. Give prob of sequence kz. 1/20 Two letters picked without replacement from {a: 4, r: 14}. What is prob of sequence aa? 2/51 Calculate prob of sequence so when two letters picked without replacement from {v: 5, o: 2, u: 1, g: 1, s: 1, k: 6}. 1/120 What is prob of sequence wp when two letters picked without replacement from {n: 1, t: 1, p: 1, h: 1, w: 4}? 1/14 Calculate prob of sequence nilm when four letters picked without replacement from lliiilmnmlnlnnn. 5/1092 Three letters picked without replacement from aajjc. Give prob of sequence jca. 1/15 Four letters picked without replacement from wwpwwwpjwpwpp. What is prob of sequence pjpp? 1/286 What is prob of sequence vc when two letters picked without replacement from aavvvpmssacpavav? 1/48 Four letters picked without replacement from kkaukkruekiekk. Give prob of sequence uiak. 1/1716 What is prob of sequence dh when two letters picked without replacement from mhqpdme? 1/42 What is prob of sequence mocl when four letters picked without replacement from lomco? 1/60 Two letters picked without replacement from itittiittiittittii. What is prob of sequence ti? 9/34 Two letters picked without replacement from {m: 10, o: 2, a: 3}. What is prob of sequence ao? 1/35 Calculate prob of sequence nd when two letters picked without replacement from njjnkjddtvtn. 1/22 Calculate prob of sequence rttt when four letters picked without replacement from {t: 6, r: 12}. 1/51 Two letters picked without replacement from {j: 9, u: 7}. Give prob of sequence uj. 21/80 Calculate prob of sequence lkp when three letters picked without replacement from {y: 1, l: 1, a: 5, p: 5, k: 3}. 1/182 Four letters picked without replacement from {f: 1, t: 3, u: 2, c: 2, o: 2, z: 2}. What is prob of sequence utto? 1/495 Calculate prob of sequence bb when two letters picked without replacement from {c: 5, b: 9}. 36/91 Three letters picked without replacement from okookoo. What is prob of sequence oko? 4/21 Four letters picked without replacement from {x: 6, j: 6}. Give prob of sequence xjjj. 2/33 Calculate prob of sequence xxxx when four letters picked without replacement from {h: 1, x: 14}. 11/15 Four letters picked without replacement from jjjj. Give prob of sequence jjjj. 1 Three letters picked without replacement from {v: 2, w: 3, f: 1, h: 2, e: 1, o: 8}. What is prob of sequence evh? 1/1020 What is prob of sequence ux when two letters picked without replacement from xuuvtxxxvtv? 4/55 Three letters picked without replacement from {d: 5, z: 2, w: 2}. What is prob of sequence wdz? 5/126 Calculate prob of sequence oo when two letters picked without replacement from {a: 1, o: 12}. 11/13 Two letters picked without replacement from ffmmtzjemjff. Give prob of sequence fj. 2/33 Calculate prob of sequence ggv when three letters picked without replacement from {g: 3, v: 8}. 8/165 Three letters picked without replacement from {l: 6, v: 4, w: 1, p: 2}. Give prob of sequence ppl. 1/143 Three letters picked without replacement from {z: 1, q: 1, y: 2, v: 1, l: 1, j: 1}. What is prob of sequence zyl? 1/105 Two letters picked without replacement from mdyvwmdz. What is prob of sequence mz? 1/28 Two letters picked without replacement from pppppppffpppfppp. What is prob of sequence fp? 13/80 What is prob of sequence sos when three letters picked without replacement from ssaakssosffsfsaf? 1/80 Two letters picked without replacement from xxxjxxkxxxxkxkxxj. What is prob of sequence kx? 9/68 Four letters picked without replacement from bwobytcybyt. What is prob of sequence bowy? 1/880 Calculate prob of sequence qqr when three letters picked without replacement from {r: 2, t: 2, u: 6, a: 1, q: 2, z: 4}. 1/1020 What is prob of sequence eq when two letters picked without replacement from {r: 7, m: 1, e: 4, d: 3, c: 1, q: 2}? 4/153 Calculate prob of sequence eia when three letters picked without replacement from {a: 1, e: 5, q: 1, r: 1, i: 2}. 1/72 Two letters picked without replacement from {h: 2, g: 9}. Give prob of sequence hg. 9/55 Two letters picked without replacement from qqqqqqkq. Give prob of sequence kq. 1/8 Calculate prob of sequence bhb when three letters picked without replacement from {h: 2, b: 7}. 1/6 Calculate prob of sequence fd when two letters picked without replacement from {m: 2, p: 5, u: 2, f: 1, d: 6}. 1/40 Two letters picked without replacement from {y: 3, c: 1, t: 1, b: 2}. What is prob of sequence yy? 1/7 Two letters picked without replacement from {l: 2, f: 1, q: 1, u: 1, z: 1, b: 1}. What is prob of sequence bf? 1/42 Two letters picked without replacement from {k: 3, i: 3, v: 2, j: 3, n: 3}. Give prob of sequence kk. 3/91 What is prob of sequence wusw when four letters picked without replacement from wzuuuwuszuuuuwsz? 1/455 Two letters picked without replacement from {l: 1, z: 2}. Give prob of sequence zz. 1/3 Three letters picked without replacement from {g: 1, a: 1, m: 1, n: 1, o: 1}. Give prob of sequence gga. 0 What is prob of sequence am when two letters picked without replacement from {a: 4, m: 5, o: 1, v: 3}? 5/39 Two letters picked without replacement from {n: 4, y: 2}. What is prob of sequence yn? 4/15 Calculate prob of sequence nb when two letters picked without replacement from {b: 4, c: 8, n: 1}. 1/39 What is prob of sequence ggr when three letters picked without replacement from {g: 9, r: 7}? 3/20 What is prob of sequence hhfh when four letters picked without replacement from hhhhhffhhhf? 7/55 Three letters picked without replacement from qff. Give prob of sequence ffq. 1/3 Three letters picked without replacement from lfwsclccsccffccf. Give prob of sequence cfl. 1/60 Two letters picked without replacement from ljlzjelzlfjjljln. Give prob of sequence ne. 1/240 Calculate prob of sequence djp when three letters picked without replacement from ffdjpjtljtftdd. 3/728 What is prob of sequence uddd when four letters picked without replacement from {l: 5, u: 2, i: 2, d: 8}? 1/85 Four letters picked without replacement from {f: 1, x: 1, g: 3, l: 2, k: 4}. What is prob of sequence fklk? 1/330 Calculate prob of sequence fjjf when four letters picked without replacement from fwfxffxxftjxfjffjxfj. 12/1615 What is prob of sequence eeee when four letters picked w	{ "pile_set_name": "DM Mathematics" }
t is the smallest value in -70.2, 3, 0.4, -2/13? -70.2 Which is the sixth biggest value? (a) 5 (b) 0 (c) -2/7 (d) -0.4 (e) -0.1 (f) 68 d Which is the second biggest value? (a) 0.4 (b) 27 (c) -27759 (d) -2 (e) 0.5 e What is the third smallest value in -3, -0.14, -0.1, 26121? -0.1 What is the seventh biggest value in 0.2, -1, -3, 3, 22.3, -2/67, -1/6? -3 What is the sixth smallest value in -5, 4/5, 0.2, 17.745, 3/13, 2/11? 17.745 Which is the biggest value? (a) 113/4 (b) 1 (c) -4 (d) 3 (e) -1 (f) 28 a What is the fourth biggest value in 1/9, 2, 0.1, 3/2, -4/5, -2521? 0.1 Which is the fifth smallest value? (a) 1/7 (b) -1 (c) -904/3 (d) 0.6 (e) 5 e What is the third smallest value in 187913, -9, 1? 187913 Which is the second biggest value? (a) 1/18 (b) 14774 (c) -1/6 a Which is the second smallest value? (a) 1/5 (b) 0 (c) -3/5 (d) -1124 (e) 0.237 (f) 1 (g) 0.1 c Which is the smallest value? (a) -0.5 (b) -4 (c) -2/15 (d) -461685 (e) 0.3 d Which is the biggest value? (a) 9.05 (b) -5 (c) 2/15 (d) -0.14 (e) -6 (f) 0.24 a What is the fourth biggest value in 4, -0.169, -1, -5, 1/14, -0.08, -0.26? -0.169 Which is the biggest value? (a) 4 (b) 3 (c) -0.1 (d) -162228 (e) 0.3 (f) 0 (g) 0.2 a Which is the fourth smallest value? (a) -2/5 (b) 56.1 (c) 1 (d) -6011 (e) -5 c What is the second biggest value in -43597, -5, 46? -5 What is the sixth biggest value in -0.3, 2/5, -22, 0, 0.127, -5/2, 2/17? -5/2 What is the third biggest value in 0.10937, -2/21, -2/3, -4, 0.16, 4? 0.10937 Which is the third smallest value? (a) 5 (b) 139.165 (c) 285 c Which is the fourth smallest value? (a) 3/4 (b) 1/3 (c) -897 (d) -0.1 (e) 2/19 (f) -8 e Which is the fifth smallest value? (a) -27 (b) -0.1 (c) 74 (d) 2/7 (e) -89 c Which is the third smallest value? (a) -0.4 (b) 34/29 (c) -23 (d) 0.23 (e) 1/11 (f) 2 e Which is the third biggest value? (a) 0 (b) -1/9 (c) 238/32367 (d) 0.1 a Which is the fourth biggest value? (a) 10 (b) 262 (c) 0.5 (d) 5 (e) 0.2 (f) -0.4 (g) -2.2 c What is the biggest value in -0.2, -236586, -3/8? -0.2 Which is the biggest value? (a) 3 (b) -0.2 (c) -43 (d) -1 (e) -0.01833 a Which is the smallest value? (a) -16 (b) -439 (c) 1/3 (d) -3 (e) 5 b Which is the fourth biggest value? (a) -4 (b) 0.2 (c) -5 (d) 1 (e) 0.611 (f) 2 (g) -33 b Which is the fourth biggest value? (a) 3 (b) 336102 (c) -0.4 (d) 1.4 (e) -15 (f) 1/4 f Which is the biggest value? (a) -62/7 (b) -18 (c) -7.1 (d) 2/11 (e) 44 e Which is the smallest value? (a) 2/13 (b) 5583 (c) 2 (d) -5 (e) -4 (f) -8 f Which is the smallest value? (a) 0.6127 (b) -0.3 (c) 1/3 (d) 0.2 (e) -3/2 (f) 3/5 (g) 5 e Which is the second smallest value? (a) -189/4 (b) -0.15 (c) 80.48 b Which is the third biggest value? (a) 126 (b) -0.07 (c) 2/5 (d) -4 (e) -17 b What is the smallest value in 0.4, 8, -3.9, 0.5, 236? -3.9 Which is the second biggest value? (a) 11/628 (b) -1/5 (c) -2/9 (d) 1/8 a What is the second smallest value in 4/207, -0.1, -8, -279, 11? -8 What is the third smallest value in 19, 72.773, 0.089? 72.773 What is the second biggest value in 19, 2/11, 0.1, 5, -3502, -3? 5 Which is the second smallest value? (a) -44 (b) -6711 (c) 0.141 a Which is the smallest value? (a) -1 (b) -10 (c) -7 (d) -3 (e) -3/2 (f) 7 (g) 0.3 b Which is the fourth biggest value? (a) -0.05 (b) 2 (c) 0 (d) -1 (e) 4 (f) 59712 c What is the second smallest value in 0.3, 6, 9, -121, 2/13, 0.1? 0.1 What is the second smallest value in 1/11850, -3/4, -6/431? -6/431 Which is the third smallest value? (a) 0.2 (b) 1/2 (c) 0.02 (d) 0.26 (e) -2/33 (f) -0.4 (g) -3 e What is the second smallest value in -11, -17.2, 2, -2, 5/58, -0.3? -11 What is the biggest value in 76/15, -3/17, -3/4, 1? 76/15 Which is the second smallest value? (a) -2 (b) -5858 (c) 5 (d) 1/649 a What is the fourth biggest value in -5, 7/3, 0, 3, 406, 1/10, -1/3? 1/10 Which is the third smallest value? (a) 3290431 (b) -5 (c) -1 a Which is the biggest value? (a) 33 (b) -0.36 (c) -0.673 (d) 3/5 (e) -2 a What is the second smallest value in 0.038, -0.2, -2/27, 2.21, -3? -0.2 Which is the second smallest value? (a) -2 (b) -3/4 (c) -3331/4093 c What is the third biggest value in 0.02, -88/15, -0.1, 3/5, -5? -0.1 What is the third biggest value in -193, -0.34, 0.2, -104/37? -104/37 What is the sixth biggest value in 3/86, 1, -1/3, -5/118, 2/11, -0.1? -1/3 What is the smallest value in -0.13413, -5, -2/73, -4? -5 What is the biggest value in 0.112218, -4, 0.4, -0.1, 6? 6 Which is the third biggest value? (a) -2.76 (b) -27 (c) -2 (d) 3 (e) -197 a Which is the biggest value? (a) 11 (b) 70 (c) -0.004297 b What is the smallest value in -22, 0.5, -5, 1/8, -84234? -84234 What is the fourth smallest value in 0, 2/11, 4, -83, 349? 4 What is the sixth biggest value in -4, -3/7, -11.48, -0.4, -2, 128? -11.48 Which is the fifth smallest value? (a) 5 (b) 2.61 (c) 0.0549 (d) 3 (e) -0.1 a What is the second smallest value in -5, 5, -1.69, -69/2, -3/55? -5 What is the biggest value in 1/8, -20, 2.453? 2.453 Which is the biggest value? (a) 1 (b) 0.03 (c) -1338/59 (d) 222 d Which is the seventh biggest value? (a) -66 (b) 1 (c) -4 (d) 3.6 (e) 0 (f) 4/129 (g) -1 a Which is the second biggest value? (a) 5 (b) 11 (c) -186759 (d) -2/19 a Which is the fifth biggest value? (a) -0.3 (b) -2 (c) 0.2 (d) 4 (e) 2/299 (f) 20 (g) -0.4 a What is the biggest value in -15, -4/5, -6, 4, -0.17, -0.2, 72? 72 What is the fourth biggest value in 12.6, -269645, 3, -0.3? -269645 What is the third biggest value in 2505, 0, -0.1, -4.5? -0.1 What is the fourth biggest value in -15, -4, -2/5, 3109, 1? -4 Which is the third smallest value? (a) 24893 (b) -0.5 (c) 30 a Which is the fourth smallest value? (a) -47 (b) -821 (c) -5 (d) -6/25 d What is the second smallest value in 0.4, 2, 13887042.39? 2 What is the third biggest value in -1/7, 1/3, -5/41, -81321? -1/7 Which is the third smallest value? (a) 5087 (b) -5 (c) -4 (d) -1 (e) -1/3 (f) -0.014 d Which is the third smallest value? (a) 1 (b) 0.2009287 (c) 12 c What is the second biggest value in -2/11, 0.4, -1, -2404, 5/12? 0.4 What is the second biggest value in -0.1, -1/5, -2, 0.4, 2/7, 183493? 0.4 Which is the third biggest value? (a) 4 (b) 44/9 (c) -3832 c Which is the smallest value? (a) -3/4 (b) -0.8 (c) 0.4 (d) -3315782 d What is the third smallest value in 0.6, -4875/394, 0.5? 0.6 Which is the smallest value? (a) 79 (b) 1.4 (c) -3 (d) 0.1 (e) 2/13 (f) 4/9 c Which is the fifth biggest value? (a) -0.3 (b) -1 (c) -71 (d) 0.08 (e) -0.1 (f) 9 (g) -631 b What is the second biggest value in 2/9353, 0, 15392? 2/9353 What is the fifth biggest value in -1, 0, -0.538, -2/5, -2/739? -1 What is the second smallest value in 11674, 15, -24? 15 What is the second smallest value in 4, -5, -1/10, -1293318? -5 What is the sixth smallest value in -2636, -0.08, -2/11, -10, 1, 2/7, -0.1? 2/7 What is the third biggest value in -2/1183, 0.2, -1/518, -4, -0.3? -1/518 What is the second smallest value in 3, -1, 0, 90, 1/103? 0 What is the smallest value in -1/17, -0.03, -0.2, 4052? -0.2 Which is the biggest value? (a) 0.2 (b) -9518 (c) 0.19 (d) 2 d Which is the sixth smallest value? (a) -2/979 (b) 14 (c) 0 (d) -1/3 (e) -2/17 (f) -3 (g) -0.095 c What is the fourth biggest value in -16, -0.036, -3, -56, 0.01? -16 Which is the third biggest value? (a) 11 (b) -0.24 (c) 18 (d) -6 (e) 0.1 e What is the second biggest value in -1/6, -2/47, 3, -8688? -2/47 Which is the smallest value? (a) -0.5 (b) -4 (c) 5406155 b What is the third smallest value in 3.1, 1/4, -0.07, 22, 0.107, -2/9? 0.107 What is the third smallest value in 4/7, -6, -8733.67, -1/6, -2/5? -2/5 Which is the third biggest value? (a) -9863/29 (b) -11 (c) 1/3 (d) 5/3 (e) 3/8 c What is the fifth smallest value in -1, 0.3, -4, -10, -16469? 0.3 Which is the second biggest value? (a) 2 (b) -4 (c) 2077902 a Which is the sixth smallest value? (a) 22/5 (b) -2/11 (c) -1 (d) -0.06 (e) 3628 (f) -5/3 e What is the second smallest value in 209/3, -3, 2, -2, 3? -2 What is the smallest val	{ "pile_set_name": "DM Mathematics" }
for x. 0 Suppose -130 = -35q + 9q. Solve 4f + 5p + 20 = 2f, -4f = qp + 20 for f. 0 Let b be (15/6)/((-1)/26). Let q = b - -88. Solve 4m + q = -3t, 3t = -5m - 2t - 30 for m. -5 Let c be 104/78 - 1/3. Let s be 12/c24/72. Solve 3r + 0r + 4 = 4y, 2r - s = -4y for y. 1 Let f(x) = 29x + 29. Let t be f(-1). Solve -3g + 19 = -tp + 2p, 2g = 4p + 2 for g. 5 Let i be 6/(-21) - (-60)/14. Let v(m) = -m*2 + 5m - 1. Let h be v(i). Suppose 2u - y = -hy - 6, 2u = 2y + 14. Solve c + 4q - 5 = q, 5q = uc + 12 for c. -1 Suppose 0 = -5q - 9 + 24. Let p be -3 - 1/(-2)6. Let b = 47 - 45. Solve -9 = -j + ba - pa, -2a = -qj + 11 for j. 1 Suppose y = 6y - 25. Let f be ((-30)/4)/(3/(-4)). Solve -b - 13 = yd - 4b, 0 = 2d - 5b - f for d. -5 Suppose 11w - 50 = 16. Solve -2f + wf + 23 = u, f = 3u - 14 for f. -5 Let j = 372 + -242. Suppose -9i = -4i - j. Let d be ((-32)/12)/(2/6 + -1). Solve 2h + i = df, 2f + 1 = -2h + f for h. -3 Let c = 940 + -940. Solve 3y = 2y + m - 1, 4y - 5m + 1 = c for y. -4 Let c be -4 + -37 + (-4 - -1). Let y be -1 + 5/((-20)/c). Suppose 8 + y = 6p. Solve -3t + u = -2t + 7, t + 15 = pu for t. -3 Let i(h) = -h*3 - 67h*2 + 366h + 444. Let g be i(-72). Suppose -m + 5 = 1. Solve 0f = -ml - 2f + g, 2f = 2l for l. 2 Suppose 0 = -7416m + 7422m - 24. Let x(h) = h3 - 3h*2 + 2h - 1. Let a be x(3). Solve -j - c = m, aj + 0j - 2c - 1 = 0 for j. -1 Suppose 9o - 31o + 66 = 0. Solve 0 = -3c + o, -5v - 8c + 3c - 15 = 0 for v. -4 Let f(v) = -v3 - 9v*2 + 5. Suppose 56 = -2j - 2j + 4k, 4j = -k - 31. Let b be f(j). Solve 4h = 5g - b, 3 + 21 = -3g - 3h for g. -3 Let y(f) be the first derivative of -f3/3 - 3f*2 - 6f - 4. Let d be y(-6). Let u = d - -9. Solve -3l - 3i + 19 - 1 = 0, -5l + ui = -22 for l. 5 Suppose -4g = 8 - 36. Suppose 4h = -2c - 1 - g, c + 4h + 10 = 0. Let p(l) = -l + 2. Let o be p(2). Solve o = 3a + 2y - 3, -2a + cy + 2 = -0y for a. 1 Let l be (45/(-27) + -1)/((-8)/60). Solve 2a + 9c + 2 = 5c, 5a = 5c - l for a. -3 Let j be ((0/18)/(12/3))/3. Solve j = 2v - 2u - 14, -v + 11 = -4u - 11 for v. 2 Suppose -4n + 4z + 80 = 0, -3z = n - 0z. Solve -u = 2i - 5, 0 = -4u + 3u + 2i - n for u. -5 Let i be 1 - 5 - (-330)/10. Let m = i + -25. Solve -5 = -2g + mg - l, g - 5l = 20 for g. -5 Let l = -1498 + 1498. Solve 4t + 5r - 3 - 19 = l, 3r = 6 for t. 3 Let y(n) = n3 + n2 - 1. Let h(k) = 4k*3 + 23k*2 + 19k. Let z(v) = h(v) - 3y(v). Let x be z(-19). Solve w + xp = -w - 8, 3w + 2 = -2p for w. 2 Let k(l) = -l*3 - 12l*2 - 35l - 9. Let x be k(-4). Solve 4n + 3m - 3 = 0, -3n - xm = 2n for n. -3 Let c be 9/3(-4)/(-6). Suppose -h = -i, -2h + 6 + 0 = 0. Suppose 31p - 3 = -35p + 65p. Solve cm = -pm, -y + im = 1 for y. -1 Suppose -25y + 9 = -22y. Let p(f) = -2f*2 - 1 - 5f + f*2 + 0f*2. Let h be p(-4). Solve v + 4 = hd, 4 = -v + 6v - yd for v. 2 Let s(u) = 3u2 - 15u. Let z be s(6). Let n(f) = -f + 22. Let q be n(z). Solve -3 = v, 0 = qp + 5v - 1 for p. 4 Suppose -39 + 47 = 2d. Let i be (-6)/6 + d + (-1 - 0). Solve 2a + 6 = -in, 0a + 2n + 1 = 3a for a. -1 Let t(b) = 10b2 - 4b - 3. Let g be t(-2). Let a = g + -42. Solve ak - 13 = 4i, -3k - 2 = i + 5 for k. -1 Let w = 20 - 58. Let h = w + 56. Let k = h + -16. Solve 0 = -0l - 5l + kc + 2, c - 6 = -l for l. 2 Let r(v) = -v*3 + 6v*2 - 4v + 31. Let m be r(6). Solve -2u + s = 2, -3u - 3 = 2s - ms for u. -1 Suppose j + 3c = 2j - 11, 2c + 107 = 5j. Solve 2g - 3g = p - 1, -2g + 3p = j for g. -4 Let o(f) = -2f3 - 7f*2 - 10f. Let m be o(-1). Solve 2x - 4 = 2l, -5x = ml - 6l - 22 for x. 5 Let m(a) = -2a2 - a3 + 2a + 1 + 0a + 5a2. Let v be m(-2). Let h be (-16)/(-120) + (-56)/(-30). Solve -4z = 3c + v, -4z + 3 - h = -3c for c. -3 Suppose -123 = -37l + 395. Solve -4h + 5f + 18 = -l, -h + 4f = -19 for h. 3 Let g be 112/21 - (-1)/(-3). Suppose gk = 18 - 8. Suppose 14 = -64h + 71h. Solve -kp - 4x - 14 = 0, -9 = hx + x for p. -1 Let y be (-5 + 80/15)15. Solve 0 = 5j + b - 14, j - y = -2j - 4b for j. 3 Let g(n) = n2 - 7n - 7. Let c be g(7). Let z(w) = -w*2 - 7w + 4. Let x be z(c). Solve -a - 6 = 4j, 0a = -xa - j - 9 for a. -2 Let m be 1/(-2 + 54/26). Let d be (0 - -3)(-4)/4. Let y = m + d. Solve 4c - 4r = -r - 20, 2c + r = -y for c. -5 Suppose 6u = 10u. Suppose 7b - 6 - 8 = u. Solve -h = -5c - 0h + b, 0 = 2c + h + 2 for c. 0 Let i(u) = u. Let z be i(3). Suppose 0 = -5l + zq - q + 8, -4l + q = -7. Solve -y - lp = 2p - 15, 0 = 5y - 3p + 40 for y. -5 Let o = 63 + -42. Suppose -5u + o + 9 = 0. Let y be (-8)/(-48) + 47/u. Solve -2a + 14 = -3z + 2, 0 = -2a + 2z + y for a. 0 Let v(b) = 2b + 21. Let c be v(-8). Suppose -5y - h = -5h - 41, y - c = 4h. Suppose 4t = y + 11. Solve -2 = -p + 4z - z, 0 = tp - 3z + 14 for p. -4 Suppose -4g = -7 - 5. Suppose 0 = q - 2s, 4q + s = gq. Solve q = 2w - 3c + 5 + 3, 3w + 12 = -5c for w. -4 Let o(a) = 19a*2 - a - 4. Let v be o(2). Let x = v - 40. Solve r = 4l + 13, 8l + x = 3l + 4r for l. -2 Let m = -452 + 457. Solve -4v - 12 = 4z, -mv - z = -0v + 11 for v. -2 Let d = 5 - 2. Let o(l) = 0 + dl + 5l + 2l - 5. Let n be o(3). Solve 4j + 5y = -0y - n, 3j = -5y - 20 for j. -5 Let x(g) = g3 + 10g*2 + 22g - 8. Let w be x(-4). Solve 2j = 2u + 14, 0 = -3j - 4u - wu for j. 4 Suppose -288 = -3m - 9m. Let x(r) = r3 + 3r - 3. Let o be x(2). Solve -5z + z = 3p + m, -5z - o = -p for p. -4 Suppose -52 = 3o - 232. Suppose -38q = -34q - o. Solve 2a + q = 5, 0 = -3p - a - 8 for p. -1 Suppose -5c + 25 = -5k, -5c + 14 = -k - 15. Suppose 0 = cx - 3x - 6. Let i = 63 + -35. Solve -xw - i = 2d + 3w, 0 = d - 2w - 4 for d. -4 Let s(x) = 5x*2 + 7x + 1. Let z be s(-8). Suppose -z + 43 = -6v. Suppose -vg + 45 = -34g. Solve 0 = -3h - 4a - g, -3a = 4h - a + 20 for h. -5 Suppose -4u - 2x = 4, 2x + x - 6 = -2u. Let l be u/(-9)(0 + 6). Let d be (-5)/((l - 2) + -1). Solve k + 2 = -dn + 22, -2k = -3n + 12 for n. 4 Suppose 5 = -c + 6, -3 = -g + 2c. Solve -5h = 15, 5h = -gs - 4 - 6 for s. 1 Let c(i) = 3i - 19. Let d be c(8). Suppose 4z + 83 = 103. Solve -2 = 3w - zv, 0 = -4w + 3w + dv + 6 for w. -4 Let n(v) = -v*3 + 6v*2 + v - 4. Let g be n(6). Let h = 0 - 0. Solve gr - 1 = -3y, 5y - 5 = -h for r. -1 Suppose -6c + 2t = -3c - 16, 2t - 26 = -4c. Solve -cr = -r + 4z + 5, -r + 5z = -28 for r. 3 Let f(g) = g*2 - 10g + 31. Suppose -p = 3v - 0 + 3, -2p - 3v = 0. Let b be f(p). Solve -4o + 3 - b = q, 2o + 21 = 3q for q. 5 Suppose 131x = 138x - 14. Suppose 25 = -s + 6s. Solve sr = 2b + 23, 4b + r - xr = -1 for b. 1 Let s = 0 + 2. Let j = -69 + 77. Suppose 8 + 8 = jl. Solve 4m = -lh - h - 32, -4h = sm + 26 for m. -5 Suppose 19r - 124 = -12r. Solve -2f = -2o, 2o + r = 3o + f for o. 2 Suppose -2c + l = -140 + 37, c - 2l = 56. Suppose 0 = -47o + co - 30. Solve 0 = 4f + g - 3 - 5, 5f - 5g - o = 0 for f. 2 Let k(s) = 2s*2 - 3s. Let t be k(2). Suppose -2b + 4b = 4a - 22, -23 = -ta + 5b. Solve p + 4 = u, p - au = -4p - 17 for p. -1 Let p be (0 + 1)-35-1. Let f = p + -20. Suppose 3a + 12 = -a, 0 = 4z - a - f. Solve -2v - 15 = -5j, 0j - v = j - z for j. 3 Suppose -5o - 2o - 273 = 0. Let v = o - -44. Solve 0 = 3s - c - 11, -2s + c + 2c + v = 0 for s. 4 Let z = 2728 - 2723. Solve 3f - 6 = 2f + 2p, zp = -4f - 2 for f. 2 Let l(s) = -3s2 + 20s - 20. Let v be l(5). Let z = 2 + 13. Solve 4x = -2i - 2i + 12, z = x + vi for x. 0 Let h = 33 + -29. Suppose -h = -0l - l + c, -c = -4l + 4. Solve 5x = -5j + 5, 2j = -l - 2 for x. 2 Let t(x) = 48x - 93. Let d be t(2). Solve -1 = -4a + dz, -2a + a - 4z + 5 = 0 for a. 1 Suppose 15 = 3h, 0 = 3c - 0h - 3h + 3. Let s be 4/(-6) + (-48)/(-18). Solve -n + 22 = -cz, -2z - 3 = -sn + 11 for n. 2 Let m = -1691 + 1695. Solve -2q = 2b - 8, 5b - 3b - 10 = -mq for q. 1 Let r = -48 + 50. Solve -g = rg - 4m - 20, 0 = -g - 3m - 2 for g. 4 Let g = -1061 + 1065. Solve -gm = -3q - 0q - 24, 0 = -3q - 4m for q. -4 Let s = 14 + -5. Let x be (18/(-8))/((-1)/4). Let t = s - x. Solve -5*	{ "pile_set_name": "DM Mathematics" }
h) in the form m + wh3 + uh + ch2 and give m. 0 Rearrange -2o3 + 66 + o2 - 2o + o + o4 - 120 + 68 to the form yo*4 + zo*3 + l + ho*2 + no and give h. 1 Express -8 - 23t2 - 2 + 24t2 - t3 as w + mt3 + st + nt2 and give w. -10 Rearrange 6788 - 414j - 6788 to the form h + zj and give z. -414 Rearrange ((-1 + 0 - 1)(o + 3 - 3) + 3o + 3o - 3o - 37 + 37 - 14o)(0o3 - o3 + 0o3) to do*4 + i + co + bo3 + po2 and give d. 13 Rearrange j2 - 2j2 - j2 + (2j + j - j)(460 - 21j - 460) - j*2 + 6j*2 + 2j*2 to l + aj + qj2 and give q. -37 Rearrange (-b3 - 3b*3 + 18b*3)(-4 + 2 + 0) + (1 + b*2 - 1)(3b - 5b + 5b) to the form pb + tb3 + rb*2 + i and give t. -25 Rearrange (19z - 37z - 7z)(23z*2 + 22z - 22z) + (-3 + 3 + z3)(4 - 1 - 2) to the form m + az2 + hz*3 + dz and give h. -574 Rearrange (-3 + 3 + 1)(2q*3 + 2q*3 - 7q*3) - 20q*3 + 32q*3 - 21q*3 to the form xq + f + rq3 + dq*2 and give r. -12 Express -209j + 48 + 105j - 2j*2 + 104j in the form gj + lj*2 + k and give l. -2 Express 5 - 5 - 55i*2 - i - 97i*3 + 96i*3 in the form ui*3 + fi*2 + mi + s and give f. -55 Rearrange (-548 + 548 + 42g)(-1392g - 7g*2 + 2g*3 + 1392g) to the form ag + wg*4 + zg*3 + tg*2 + b and give z. -294 Express 6u - u - 10u + (-1 + 2 - 2)(4u - u - 6u) - 1 + 1 - 2u + (-u + 0u + 3u)(2 - 3 - 1) as b + zu and give z. -8 Express (-13z + 5z + 7z + 8)(-62z*2 + 26z*2 - 6 + 31z*2) as nz + uz3 + kz*2 + y and give u. 5 Express (p - 3p + p)((1 - 1 - 1)(-2 + 5 - 2) + 28 - 38 - 30) in the form wp + y and give w. 41 Express -5y*4 + 0y*4 - 9y3 + 0 + y4 + 8y3 - 2 in the form ly*4 + cy + xy3 + w + dy*2 and give x. -1 Express (0 - 2 + 3)(2 + 2 - 3)(-1 + 1 - 3)(1 - 2 + 3 + 6a) in the form la + k and give l. -18 Express 5t - 21t*2 + 5t - 63t2 - 11t - 32t2 in the form gt*2 + b + ot and give o. -1 Rearrange 21 + 4o2 - 2o*3 - 4o*2 - 181 to io*2 + zo + k + ao3 and give a. -2 Express 379s*2 - 543s*2 + 1 - 1 + 5 - 4 as qs*2 + t + ys and give t. 1 Rearrange -1093m + 448m - 174m to the form qm + a and give q. -819 Express (3 + 1 - 12 - 1)(-17 + 17 - 3r) in the form n + sr and give s. 27 Express 344 - i3 - 418 + 0i*3 in the form ni + oi3 + x + wi*2 and give x. -74 Express 117 + 13j*2 + 5j*2 - 113 + 13j*2 in the form q + sj + vj2 and give v. 31 Rearrange (-2 + 2h*2 - 2h2 + h2 - h)(26 + 21 - 56) to the form y + rh + gh2 and give r. 9 Rearrange -176z*3 + 2z*2 + 1 + 2z + 177z3 - z4 - 4z - z*2 to the form az*2 + gz*3 + jz + hz4 + d and give a. 1 Rearrange l2 + 7l*4 + 3l*4 + 1 + 16l*4 + 9l*4 - 30l*4 - 2l to the form z + il4 + wl + vl2 + ql*3 and give v. 1 Express -8a*4 + 0a*3 - 100a*2 - 2a*3 + 19a*2 - 14 + 80a*2 as ra + ia3 + la*4 + w + ma*2 and give m. -1 Rearrange 2z*3 - 4z + 4z - 3z + (-3 + 2 - 1)(74 - 74 - z3) to the form az*3 + oz*2 + kz + s and give k. -3 Rearrange 76 + 91 - 82d + 90 - 245 to the form h + qd and give h. 12 Express (0p - 4p + 2p)(5 - 3 + 0) - 293p + 113p + 106p as w + sp and give s. -78 Rearrange (-2 - w*2 + 4w*2 - 4w*2)(-1 + 4 - 32w + 9w) to p + rw2 + uw*3 + qw and give q. 46 Rearrange (-3 + 0 + 2)(-69i*4 + 146i*4 - 67i*4) to the form pi*2 + yi*4 + ri + ni3 + f and give y. -10 Express 205i + 8 - 104i - 102i + i - 2i + 3i + i - 2i + 3i + i - 2i - i + i - 6i + 3i + (-3 + 2i + 3)(-2 - 2 + 6) + 1 + i - 1 as ti + v and give t. 4 Express (-2o4 + 0 + 0)(-4 + 2 + 3) + o*4 - 15o*2 + 1101o + 1 - 1101o in the form uo*4 + so*3 + fo*2 + v + go and give u. -1 Express (-5 + 4 + 0)(5x - x - 2x)(-3 + 0 + 1) + 24x - 2x + 103x + (3x - 6x + 2x)(-3 + 0 + 1) + x - 2x + 2x in the form h + ux and give u. 132 Express -4l4 + l3 + 9l*4 + 115 + 103l - 118 - 3l4 in the form yl*3 + sl + ql2 + fl*4 + n and give s. 103 Express (-6 - 15 + 7)(-4 + 2 - 14)(-3 + 3 - t) in the form bt + y and give y. 0 Express (2l - 2l + l)(5l*2 - 4l*2 + 9l*2 + (-3l + 6l + 3l)(3l + l - 3l)) in the form b + tl + kl2 + fl*3 and give f. 16 Express 3 - 2h*2 - 3 + (1 - 1 + 4h)(6 + 0 - 2)(7h - 3h + 14 - 6h) as wh + ch2 + y and give y. 0 Express -b + 1 - 1 + (1 + 0 - 3)(-2 + 2b + 2) + 2b + 2b + 3b - 2 + 2 + 9b + (2 - 2 - 1)(6b - 5b - 2b) in the form cb + a and give c. 12 Express -23q + 67 + 21q - 43 + 48 as mq + n and give m. -2 Rearrange 155w*2 + 12w*2 + 698w*2 + 450w*2 to fw + aw2 + j and give a. 1315 Rearrange -9d*2 + 0 + 60d*2 + 236d*2 + 0 to the form b + id + jd2 and give j. 287 Rearrange (1 - 1 - 2v)(0 + 0 - 2v*3) + 0v*4 + 0v4 - v4 + 623v4 - 3v*2 - 91v*4 + 3v*2 to q + cv*2 + tv*3 + sv*4 + uv and give s. 535 Rearrange (-3y3 + y3 + y3)(-1360 - 1646 + 2683)(0 + 2 + 0) to iy*3 + uy + oy2 + l and give i. 646 Rearrange (-242l - 151l + 306l)(0 + 3 - 4) to the form j + yl and give y. 87 Rearrange -49u + 1 - 45u + 82u - 21u to j + lu and give l. -33 Express (-539y*2 - 124y*3 + 76y*3 + 46y*3)(-y + y + y) as ry3 + cy + ky4 + ay*2 + v and give k. -2 Rearrange (-3 - 3 + 3)(2 - n - 2) + n - 2n + 4n - 3n + 0 + 0 to the form m + dn and give d. 3 Express 12738 - 12738 - 229p in the form ip + u and give i. -229 Rearrange q2 + 1 - q4 - 2 + 15q3 + 3q*4 - 17q*3 to sq*2 + cq*3 + a + xq + uq4 and give c. -2 Rearrange -13 + 73j - 3 + 70j - 211j + 70j to the form dj + p and give p. -16 Express 2j4 + j - 78j*3 + 0j*4 - 46795 + 46794 as xj*2 + yj*3 + n + pj*4 + cj and give y. -78 Rearrange (1 + 0 + 2)(u - 2 + 2) - 19u + 112u + 251u to y + iu and give i. 347 Express -2q*2 + 0q*2 - 4q2 - q2 + 4q2 - 203q in the form k + oq + zq*2 and give o. -203 Express -13 - 11 + 9 - 6o3 + o3 - 3o3 in the form lo*2 + fo + g + so3 and give g. -15 Express 1 + 6n*2 + 77n*4 - 3n*2 - 72n*4 in the form tn*4 + fn*3 + gn*2 + pn + v and give t. 5 Rearrange d*3 + 2 + 40 - 50d - 40 to the form ld + g + hd*2 + jd*3 and give g. 2 Rearrange 3p - 3p + 20p*3 + 12p*2 - 6p - 16p2 to the form gp*3 + v + op*2 + kp and give g. 20 Express 4m3 - 3m*3 + 8 + 5m*4 - 4m - 11m4 - m2 + 8m*4 + 5m as im2 + k + xm + zm4 + gm*3 and give x. 1 Rearrange -149c*2 - 51c*2 - 210c*2 + 26c*2 - 113c*2 to mc + l + kc2 and give k. -497 Express (c - 1 - c2 + 4c2 - c2)(-45 - 35c + 45) - 5c2 - 21c + 21c - 4c*3 as ic + z + rc3 + hc*2 and give h. -40 Rearrange 3b*2 + 9652b - 3b3 + b2 - 9654b to the form vb3 + xb + rb2 + m and give m. 0 Rearrange -7k + 6k - 9k + 6k2 - 2k - 3k to uk*2 + dk + p and give u. 6 Express 18 - 9 - 7 + 5j + 2j*2 - 2 in the form lj*2 + y + sj and give l. 2 Express (23k2 + 3 + 4963k - 2480k - 2484k)(0k + 0k + k)((-2 + 2 + 1)(-1 + 6 - 3) + 3 - 2 + 0 + 0 + 2 + 1) as uk*2 + vk + lk3 + f and give u. -6 Rearrange (-2a - 4 + 4)(-2a + 2a + 3a*2)(-10a + 37a + 26a) to the form ya*2 + ta*4 + ha*3 + k + wa and give w. 0 Express -14f3 - 15f*3 - 1 + 121f*3 + 81f*3 as vf*3 + hf + m + sf2 and give s. 0 Rearrange p2 - 766 - 755 - p4 + 3p*3 + 1494 to the form q + np + gp4 + bp*2 + up*3 and give g. -1 Rearrange -4832 + 2417 + 2419 + 9v to mv + f and give m. 9 Rearrange (-5 + 4 - 1)(114 - 1514i + 101 - 215) to the form v + ki and give k. 3028 Rearrange -2y + 2y - 60y2 - 55 - 32 + 62y*2 to the form i + fy*2 + zy and give i. -87 Rearrange -y*3 + 3y*3 + 0y3 - y2 + (0y3 - y3 + 3y*3)(0 - 1 + 2) + 158y2 + 7y*3 - 158y*2 to dy + cy2 + t + ny*3 and give c. -1 Express (-14r*3 + 6r*3 - 12r*3)(12r + 6r + 27r) in the form qr*2 + kr + f + sr3 + lr*4 and give l. -900 Express 23i - 5 + 3 - 1 + 2 as o + pi and give p. 23 Express (0k + 0k + 2k)(1 - 2k*3 - 1) + (9k*2 + 4k*2 - 4k*2)(-5k2 - 4k*2 + 2k*2) as sk**4	{ "pile_set_name": "DM Mathematics" }
e Suppose 0 = -8n + 13n - 10. Suppose 3c + 5v = 69809, 5c - nv - 116307 = -0v. Suppose -m + 8261 = 2p, -5m = -4p - 6706 + c. Is p composite? False Let w(d) = -2d2 + 7d + 6. Let a be w(4). Suppose ac + 4o - 3o = 371, -4o - 760 = -4c. Let z = c + -118. Is z composite? True Suppose 0 = 2o - 0b - 2b + 4970, 0 = 5o - b + 12425. Let d(m) = 2m*3 + 106m*2 - 77m + 66. Let n be d(-54). Let p = n - o. Is p prime? True Suppose 425p - 492p = -22014659. Is p prime? False Suppose 105l = 108l. Suppose 31x - 25x - 56346 = l. Is x prime? True Let z = -675441 - -1003240. Is z prime? True Suppose -4s + 3a + 751466 = 0, -5s + 14a + 939343 = 12a. Is s a prime number? True Let m be (-19)/(-171) - 412/(-18). Let u = 48 - 14. Let v = u - m. Is v composite? False Let p = 74 - 73. Let s(a) = 17a*3 - 2a*2 + 2a - 2. Let d be s(p). Is ((-18)/15)/((-6)/d) - -284 a composite number? True Suppose -2u - 2 = 0, -5u + 59633 = 33a - 31a. Is a a prime number? True Is (17 - (-44 + 50)) + 1940760/2 a composite number? False Is (-380704)/(-16) + 9 + 10 composite? False Suppose 0 = 2b - 0b + 296. Let q be 88/(-9) + 170/45 + -4. Is b17/q + 6/(-10) a composite number? False Suppose -658526 = 47f - 69f. Is f a prime number? False Suppose 62v - 5492 = 54v + 1065636. Is v a prime number? False Let f = 944 + -71. Let i = f - 482. Is i composite? True Is (((-3644)/3)/2)/(54/(-3483)) + -6 a prime number? False Suppose 161x - 166x + 25 = 0. Suppose -o - 1115 = -m, 8m - xo = 4m + 4458. Is m a prime number? True Suppose 0 = -3u, 2b + 9 = -b - 5u. Let x be (-8)/b210/40. Is (x/3)/1(-942)/(-4) prime? False Let y be (10/15)/((-4)/6) + 6. Suppose 107155 = yr + 13970. Is r prime? True Is 177095 - 0/(6/12-1-4) composite? True Let v = 250287 + -86950. Is v a composite number? False Suppose -3b = -4u + 15, 4u = 8b - 3b + 17. Suppose 5f - 4v = 9961, -uf - 1328 = -2v - 7305. Is f prime? True Suppose 3p - 60 = -3j, 5j - 3p + 5p - 94 = 0. Suppose -3m + jm = 130575. Is m a prime number? False Suppose c + 20 = -3q + q, 45 = -2c - 5q. Let u be 1168/2 - (c + 7). Let w = u + 255. Is w a composite number? True Let o(s) = -5103s - 128. Is o(-5) a composite number? True Suppose 4i + 8s - 6948 = 1964, 2s = -10. Suppose w + 0w - 3 = 0. Suppose k = wk - i. Is k a composite number? True Let r(f) = -f - 41. Let i be r(-13). Let d be -2 - 21/(-9) - i/6. Suppose -dv = -z + 2z - 3163, -4z = -4v - 12604. Is z a composite number? True Suppose -33q - 33q + 2326566 = 0. Is q a prime number? True Let h(n) = -4n - 7. Let m be h(-3). Let y(s) = s*3 + 6s*2 - 7s. Let u be y(-7). Suppose 8c - 602 = mc + a, -2c - a + 393 = u. Is c prime? True Suppose -24188166 + 67049560 + 25798732 = 134m. Is m composite? False Let k(w) = -341w + 255. Let s(n) = n2 + 24n + 98. Let u be s(-18). Is k(u) a composite number? True Suppose -2w + a + 27 = 0, 5w = 4w - 2a + 11. Is 7265/w + 30/195 a prime number? False Let k(h) = 47h2 - 4h - 4. Suppose 0 = -6j + j - 5q - 5, 10 = 2q. Let o be k(j). Suppose 0 = -5b + o - 597. Is b a prime number? True Let m = 520 + -1316. Let j = m - -1205. Is j composite? False Let v(u) = -456u + 125. Let b be v(-6). Let l = b + -1672. Is l a prime number? False Is 60/11 - -1(-54)/(-99) - -18001 prime? False Let l = -720 - -1302. Suppose -a + 994 = 2a + i, -4a + 1326 = 2i. Let k = l - a. Is k a composite number? False Let h(w) be the second derivative of 13w*4/12 - 11w3/6 - w2/2 + 1476w. Let t = 5 + -10. Is h(t) a prime number? True Suppose -5g = -2l - 769949, -2g - 322l + 307979 = -323l. Is g prime? True Let r be (-4)/34 + (1440/102 - 9). Is 17r/(25/485) prime? False Let h(s) = 930s - 6313. Is h(85) composite? True Suppose 5c = 3n + 7466 - 124448, 5n = 4c + 194957. Is n prime? False Suppose -5i = 5o - 1039585, 2o + 831644 = 20i - 16i. Is i a prime number? False Let i = -15483 + 23378. Let v be 81/(-1(-2)/146). Suppose f = -3x - f + v, i = 4x - f. Is x a prime number? True Let l(k) = -2k3 + 13k*2 + 8k + 20. Is l(-27) a prime number? True Let h be (-369)/(-15) - 4/(-10). Let g be 4/(3246/(-234) + 3). Let a = h - g. Is a composite? True Let q = -119799 + 168238. Is q a composite number? True Let h be (-4)/6171/(-38). Suppose -218 = -b + 4z, 4b + 0z - 872 = hz. Is b composite? True Let d(t) be the second derivative of t3/6 - t2/2 - 13t. Let m be d(0). Is (8m)/(-2) + 629 a prime number? False Let y = 24340 + -10068. Suppose 0 = -2m + 13942 + y. Is m prime? True Suppose 69x - 24086860 = 61x - 132x. Is x a composite number? False Is (2 + -1 + 0)(0 + 55604 - 1) a composite number? False Let u(j) = 12j - 46. Let z be u(4). Suppose 4f = zt - t - 2283, 0 = t - 5f - 2281. Is t a prime number? False Suppose 57f - 71f = -1289246. Is f a prime number? False Let y(t) = t + 6. Let g = 53 - 65. Let p be y(g). Is p/(-2)(-21126)/(-18) prime? False Let a be (4/2)/(-2 - 30/(-12)). Suppose 3n - 7830 = -4h, -7832 = -4h + 2n - an. Is h a composite number? True Suppose l + 9 = -3f + 4, -3f - 3l - 15 = 0. Suppose -3h + fh = -996. Suppose 0 = k + d - 342, 2k - 3k = -d - h. Is k prime? True Let s be (-6 - -9)(-3681)/(-1). Let d = 15536 - s. Is d composite? False Let x = 109 - 85. Suppose 0 = 28u - xu + 8. Is 3(3715/15 - u) a prime number? False Suppose -3f = -2v + 2, f = -0v + v. Let r be 3 - 101/f. Let l(h) = 20h2 - 13h + 11. Is l(r) composite? False Let o(h) = 123h2 + 16h + 7. Let r(j) = 370j2 + 45j + 19. Let u(d) = -8o(d) + 3r(d). Is u(-2) a composite number? False Let x(o) = 2967o2 - 16o + 98. Is x(-5) a prime number? True Suppose 0 = -3s + 6s - 9. Suppose 7 = sw - 5z, 2z - 3 = -3w - 10. Is 280/(2/1) + 3 + w a prime number? False Let v = -139 + 59. Let j = 78 + v. Is (-1)/(-2)(-909 + j)-2 composite? False Is 23052100/203 + (-2)/14(3 - 2) composite? False Let g(p) = 370p*2 - 118p - 503. Is g(-20) prime? False Is (-1)/17 - 2902174/(-901) composite? False Let r = -94 - -101. Suppose rk - 99 = -1079. Let x = k + 1777. Is x prime? True Let v be 15/6 + (-1)/2. Let j(q) = -3q + 134q2 + 109q*2 + 3 - 29q*2. Is j(v) a composite number? False Let n = 59836 + -31685. Is n a composite number? False Let o(z) = z - 2. Let c be o(14). Let f be (-37348)/14 - c/42. Is 11/33 - f/6 a prime number? False Let r be (-69)/15(-9 - -4). Let q = r + -12. Suppose 0 = qm - 6m - 2065. Is m a prime number? False Suppose -3k = 3y + 4645 - 49912, -3k + 4y + 45281 = 0. Is k a composite number? False Let r(f) = 161f2 - 115f + 1681. Is r(40) a prime number? False Let j = 185 + -70. Let q(w) = -w*3 + 5w*2 + 8w - 35. Let f be q(5). Suppose -fp + j = -370. Is p composite? False Let j(t) = -t3 + 11t*2 + 3t - 10. Let s be j(8). Suppose sf - 212f + 3516 = 0. Is f a prime number? False Let k = 551 - 543. Suppose -6w + 16175 = s - kw, 2s + w - 32370 = 0. Is s a prime number? True Let v(d) = 108d*3 - 2d*2 - 20d + 17. Let k be 4/26 + 200/52. Is v(k) prime? False Suppose -11j - 68 + 134 = 0. Suppose jb - 5n - 24263 = 0, n - 8711 + 626 = -2b. Is b prime? False Suppose 151634 + 54679 = m - 4t, 0 = 5m + 4t - 1031493. Is m prime? False Let z(i) = 587i3 + i2 + i - 3. Let y(f) = -f*3 + f - 1. Let q(j) = y(j) - z(j). Let n be q(-2). Suppose 0 = 4o - 13346 + n. Is o prime? True Let t(a) = -a*3 - 5a*2 - 11a + 20. Let x be 8/14 - (-16)/(-28). Suppose -14c + 7c - 63 = x. Is t(c) composite? False Let d(q) = q*2 - 75q - 25. Let m(y) = 3y2 - 243y - 76. Let r(p) = -7d(p) + 2m(p). Suppose 0 = -5g - 17 + 107. Is r(g) a composite number? False Let i = 86 - 86. Let x(u) = u3 + 84 + iu*2 - 2u - 5u2 - 87. Is x(6) a composite number? True Let i(d) = -96d*2 - 177d + 446. Let j(c) = -34c2 - 59c + 149. Let y(g) = 6i(g) - 17j(g). Is y(46) prime? False Let o be 168/96 - 10/(-8). Is (1/o)/(50/1666950) composite? False Suppose -g = -37g + 963756. Is g prime? False Suppose 5 = -d + 2. Let a = d + 3. Suppose 5h + 4y - 2065 = 0, 4h - 2h + 3y - 833 = a. Is h prime? True Let i(o) = 153o2 + 38o + 10. Is i(3) a composite number? True Let t(a) = 888a + 3005. Is t(18) prime? False Let k(c) = 40c**3 - c	{ "pile_set_name": "DM Mathematics" }
v3x + 206uv*3z - 2uv*2 - 4v*3 - 24x with respect to z. 105uv*3x + 206uv*3 What is the second derivative of 24992k*4 - 13k*2 - 1978311k wrt k? 299904k2 - 26 Find the third derivative of 59hv5 - 71hv4 + hv*3 - 178hv2 + 2h + 4v2 - 13v wrt v. 3540hv*2 - 1704hv + 6h Differentiate -16z3 + 126z*2 + 2z - 22674 wrt z. -48z2 + 252z + 2 What is the second derivative of -1543dv*4 + 63dv + 4d - v4 + v2 - 10 wrt v? -18516dv*2 - 12v*2 + 2 Find the first derivative of 306324c*2u*4 + 368553c*2 - c + 2 wrt u. 1225296c*2u*3 Find the second derivative of 567o*3 - 18o*2 - 78530o. 3402o - 36 Find the third derivative of -31471i*5 + 24i*4 - 307i*2 - 54. -1888260i*2 + 576i Find the second derivative of -29251v3x*3 + 2v*3x + 2vx + 2255 wrt x. -175506v3x What is the first derivative of -189fx*4 + 18fx3 + 2f - 9421 wrt x? -756fx*3 + 54fx2 What is the third derivative of 119f*5u*2 + 257f*5u - f*2u + 343387fu*2 wrt f? 7140f*2u*2 + 15420f*2u What is the derivative of -64776h3 + 2h - 1016259 wrt h? -194328h2 + 2 What is the second derivative of 313285m*2 + 6m + 1088? 626570 Find the third derivative of -26190x5z*3 - 41x*2z + 37z3 wrt x. -1571400x*2z*3 Find the third derivative of -21315n*5 + 12013n*2 - 3n. -1278900n2 What is the second derivative of -640o*2t - 215o2 + 45118ot + 3o + t wrt o? -1280t - 430 Find the second derivative of 1199792o*4 + 46166o - 1. 14397504o2 Find the third derivative of -3y*6 - 5y*5 - 78y*4 + 2y*2 + 240y - 2 wrt y. -360y3 - 300y*2 - 1872y Find the third derivative of 158763d6t + 2d5t - 457d2 - dt - 341d wrt d. 19051560d*3t + 120d2t What is the second derivative of 15x5 + 33x*3 - 3x*2 - 41997x? 300x3 + 198x - 6 What is the first derivative of 89kn*3 + kn - 28ks + 6387n3s - 6n2s wrt k? 89n3 + n - 28s Find the second derivative of -1990688n5 - 1649n + 103 wrt n. -39813760n3 Find the third derivative of -2718985a*3 - 1884a*2 + 89 wrt a. -16313910 Differentiate 5935d*3 - 3d - 66266 with respect to d. 17805d2 - 3 Find the second derivative of -10873s*4 - 7s - 491. -130476s2 Differentiate -4lrv*3 - 8810lv + 53rv3 + 67rv2 + 13v*3 wrt r. -4lv3 + 53v*3 + 67v*2 What is the third derivative of -16099i*3w*3 - 2i*3w*2 + 4i*3w - 406i3 + i2w*3 + 3w*2 wrt w? -96594i*3 + 6i*2 Find the third derivative of 190440hk6y - 14hk*2y*3 - 6hk2y + 3hy*2 - 3k*4y*3 - 3k*2y*2 - ky*2 + 19y wrt k. 22852800hk*3y - 72ky*3 Differentiate -128p*3 - 4935pr - 756r - 831 wrt p. -384p2 - 4935r Find the third derivative of 715374l3r3 - l3r2 + 5l*2r2 + l2r + 7lr - 110r*2 wrt r. 4292244l*3 Differentiate -504143y + 302232. -504143 Differentiate -3q2 - 472q - 29378 with respect to q. -6q - 472 What is the second derivative of -2s*5 - 560s*2 - 328290s? -40s3 - 1120 What is the third derivative of -100799k*3 + 297629k*2? -604794 Find the second derivative of 247951y*5 + 13704y. 4959020y3 Find the third derivative of -434122m*4 - 6m*2 + 48813. -10418928m Find the second derivative of 413879h2 - 369h - 551 wrt h. 827758 Differentiate -8j4 + 31j*3 - 16j*2 + 26j + 2521030 wrt j. -32j3 + 93j*2 - 32j + 26 Find the first derivative of -2560991sv*3 + 137v*3 + 9v*2 - 15v + 1 wrt s. -2560991v3 What is the third derivative of -s5 + 9270s*4 + 2s*3 + 1231s*2 - 2s + 16 wrt s? -60s2 + 222480s + 12 Find the third derivative of -40548u5 - 89u*2 + 82u - 2 wrt u. -2432880u2 Find the third derivative of 5420w*4 - 27702w*2. 130080w Find the second derivative of 2ry*2 + 2ry - r - 1503y*2 + 1082y wrt y. 4r - 3006 What is the second derivative of -2277608z*5 + 1487534z? -45552160z3 What is the third derivative of 3a*3bp - 3a*3b + 33a3p - 283a3 - 4a*2bp + 5a*2b - 2a2 + 103abp + 2ab - 2 wrt a? 18bp - 18b + 198p - 1698 What is the first derivative of -5182ik*2 - 2ikp*2 - 35k*2p*2 + k - 35p*2 - 12 wrt i? -5182k*2 - 2kp2 Find the third derivative of -12c*5 - 1569c*3 - 1023c*2 - 2c - 25 wrt c. -720c2 - 9414 What is the third derivative of 24571d*6 - 149638d*2? 2948520d*3 What is the derivative of 7203835r*3 - 4190055 wrt r? 21611505r2 Find the third derivative of -c4x2 - 1385c*3x*3 - 72104c*2x*3 + 2c*2x - c*2 wrt c. -24cx2 - 8310x*3 Find the second derivative of -3gv2z*3 - 382gv2 + 27101gvz*3 + 10gz - z wrt z. -18gv2z + 162606gvz What is the derivative of 9f*4 + 36f*2 - 893f - 3749125 wrt f? 36f3 + 72f - 893 What is the third derivative of -520517w3 + 617148w*2? -3123102 What is the second derivative of -113gj2t - 1458g + 159j*4t + 10jt wrt j? -226gt + 1908j2t Find the second derivative of 10313bf*2 + bf - 8b - 2f*5 - 5f + 30 wrt f. 20626b - 40f*3 What is the third derivative of 2g*6 + 2g*5 + 3124g*3 + 158g*2 - 137? 240g*3 + 120g*2 + 18744 Find the third derivative of -3g*5 + 35g*4 - 83g*3 - 82g*2 - 99g - 2. -180g2 + 840g - 498 Find the second derivative of -f*3q*2 - 15f*3q + 895f2q*3 - 25485fq3 + 2fq2 wrt f. -6fq2 - 90fq + 1790q3 Differentiate d3q - 3508d*2 + 111d + 2983890q with respect to d. 3d*2q - 7016d + 111 Differentiate -f2t + 244f2 + 22ft2 + 148ft - 28f wrt t. -f*2 + 44ft + 148f Differentiate -13n4 + 7948n*2o*2 + 2o*2 - 2o - 24837 with respect to n. -52n3 + 15896no2 Find the first derivative of 175784m*3 + 112219 wrt m. 527352m*2 Differentiate 2273470f*4m + 2f3m - 6103568m with respect to f. 9093880f*3m + 6f2m What is the first derivative of -186498cq*3 + 2cq2 - 1468280c + 3q wrt q? -559494cq2 + 4cq + 3 Differentiate -4792x*2z - 3x2 - 5xz2 - 769732z*2 wrt x. -9584xz - 6x - 5z2 Find the second derivative of 612448r*5 + 706164r. 12248960r3 Find the second derivative of -17256c*4 + 1223783c. -207072c2 What is the second derivative of -383340s*2 + 3853s + 3? -766680 Find the second derivative of 16j2n*2 - 14j*2n - 3j2 - 13015jn5 - 403jn + j + 2n wrt n. 32j2 - 260300jn3 What is the derivative of -133380d*2u - 5d2 + 2u - 7445 wrt u? -133380d2 + 2 Differentiate 53330ij2 + 132i - j*3 + 106 with respect to j. 106660ij - 3j*2 What is the first derivative of -2j*4 + 3503j*3 - 14j + 339662? -8j3 + 10509j*2 - 14 Differentiate 371390at2 - 6t*2 - 8909t - 3 with respect to a. 371390t2 What is the second derivative of -2232259d*2 - 4d - 58146? -4464518 Find the first derivative of -3d3 + 10d*2 - 157d + 255714. -9d2 + 20d - 157 Find the second derivative of 1852488m3 + 96m + 11290. 11114928m What is the third derivative of -719211c3 - c2 + 8c + 10183 wrt c? -4315266 What is the third derivative of -9639v*2x*3 - 6647v*2x*2 - 4 wrt x? -57834v*2 Find the second derivative of -5351h*2 + 29400h. -10702 What is the derivative of -387105m3 + 73906? -1161315m*2 What is the second derivative of -430ai2 + 35ai - 2a + 3i2 + 2i - 177 wrt i? -860a + 6 Find the third derivative of -483120h*3 - 193988h*2 wrt h. -2898720 Find the second derivative of 9104j*3r*2 - 13j*2r*2 + 12jr2 - 4jr - 192j - 2r2 wrt j. 54624jr2 - 26r*2 Find the second derivative of 153fp5 - 2fp + 6fz - 231p*4z - 3pz - 2z - 57 wrt p. 3060fp3 - 2772p*2z Differentiate 9112b2 - bf*3 + 21f*3 - 578f*2 with respect to b. 18224b - f*3 Find the third derivative of 12622a*3 - 5717a*2 + 12a wrt a. 75732 What is the derivative of 607n4 - n + 558711? 2428n*3 - 1 Find the second derivative of -9q*3 + 1621q*2u + 2qu + 1798q + 3u + 4 wrt q. -54q + 3242u What is the third derivative of -842d4 - 25d*2 + 391 wrt d? -20208d Find the third derivative of -2ku*5 - 19015ku	{ "pile_set_name": "DM Mathematics" }
What is (112 - 209 - -6) + 132? 41 What is 3 + 2 + (17 - (-43 - -26))? 39 What is the value of -26 + (83 - -2 - 27) + 15? 47 What is 63 - (51 - -16 - -66)? -70 Evaluate 12 + (-15 - (17 + -7)) - (-107 - 2) - -8. 104 Evaluate -81 + 7 - 25 - -51. -48 -8 - (0 + 1 + -12 + (-21 - -25) + 7) -8 -3 + 0 + -126 - (-7 - (8 - (-29 + 39))) -124 What is (13 - 17) + -6 + -7 + 100? 83 What is (-40 - -28 - -69 - 45) + (1 - (2 + -54))? 65 What is the value of (24 - (-23 - -66)) + 46 + -52? -25 What is (5 - -110 - 222) + 88? -19 What is the value of 134 + (-40 + 59 - 72)? 81 Calculate -26 - (-10 - 3) - (2 + -9 - 3). -3 What is -46 - (-46 + -30 + 34)? -4 Calculate -110 + 121 + -29 + 53 + -1. 34 Evaluate -3 - (-16 + 31 - 7 - -32). -43 (56 - 15) + -47 + -10 + -2 -18 (3 + 1 - -14 - -72) + (-3 - (0 - 5)) 92 What is (7 - (0 + 3)) + (13 + -56 - 72)? -111 Calculate (-10 - (-7 - 0)) + 33. 30 What is the value of 35 + -45 + 23 + -2 + 3 - -54? 68 What is 0 + (69 - -2) - (0 + -30)? 101 What is the value of 9 + -1 - -1 - (-2 - (-149 + 112))? -26 What is -30 - (-31 + 17) - (2 + -19)? 1 (-7257 - -7304) + -1 + -20 + 2 28 What is the value of (-6 - -4) + -52 + 6 + 55? 7 Calculate (15 - 11 - 4) + (8 - (35 - 11 - 11)). -5 What is the value of (23 - (5 - 20)) + 2 + (-3 + 6 - 1)? 42 What is 56 - 7 - 8 - 31? 10 What is the value of (15 + (-30 - -24) - 24) + 72? 57 Calculate (-116 - 11) + 88 + 163. 124 Calculate -72 - ((-942 - -932) + 14 + -1 + -2). -73 What is the value of 42 + (-99 - (47 - 90)) - -3? -11 What is 1 + (1 - 8) - ((-191 - -41) + 154) - -43? 33 Calculate 10 + 3 + 5 + -17 + -38. -37 What is the value of (7 + -2 - 8 - (5 + -9)) + (15 - -51)? 67 Evaluate 28 - (22 + -19 + -3 + 100). -72 What is (-101 - -88 - 85) + 87? -11 (3 - (0 + 17 + -4 + -12)) + -2 + 77 77 Evaluate 54 + -58 - 16 - -82. 62 Calculate (0 - -6 - -2) + -20 + 21 + -7. 2 Calculate 16 + 6 + 8 + (-45 - -31 - 7). 9 Evaluate -35 + 36 + (1 - -11) + -5 + -55. -47 Evaluate 20 + -20 + -23 - (-8 - 2) - -8. -5 What is the value of 4 + (10 - (-72 + 100 - (-1 + 10))) + 8? 3 Calculate 8 + (-1 - 5) + 4 + (66 + -31 - 0). 41 What is 1 + (-21 - -16) + (5 - (3 - 4) - 11)? -9 What is the value of (56 - 34) + 53 + -45 + (7 - -2)? 39 What is the value of -12 + (-9 - -4) - (-103 + 68)? 18 5 + 3 + -33 + -5 + (9 - 12) -33 83 + -18 + -102 - (41 + 16) -94 Evaluate (0 - 29) + -2653 + 2656 + 129. 103 Calculate 10 + (-8 - (-42 - 7) - 37). 14 Calculate 62 + (-42 - 13) + 56. 63 Calculate -5 - 42 - ((23 - 1) + -26 - (-2 - 5)). -50 71 - ((-89 - -61) + 72) 27 Calculate -22 + (107 + -102 - (22 - 1)) + -79. -117 Evaluate (12 - 0) + -35 - (5 - 9 - -11). -30 -6 + (44 - 14) - (11 + (-5 - -3) + -3) 18 -64 + 31 - (-25 + -26 + 8) 10 Evaluate 31 - ((-9 - -14) + 6) - (5 - 0) - -3. 18 Evaluate (-10 - 3) + (1 - -42) + -12 + -3. 15 Evaluate (-178 + 0 - -104) + -28. -102 What is the value of (-60 - (31 - 75 - 25)) + (-16 - 1)? -8 What is the value of (-30 + 70 - -16) + 4 + (-19 - -12)? 53 What is -3 - -39 - (615 + -581) - (78 - (1 - -1))? -74 Evaluate 1 + -2 - -8 - ((-86 - -43) + 29 - -1). 20 Evaluate 30 + 14 + -29 - (-16 - 10). 41 What is the value of 16 - 68 - ((63 - 32) + -43)? -40 What is the value of -86 - -75 - -95 - (-1 + 1 + 3)? 81 Calculate (-1 - -4 - 13) + -7 - (5 + -3 + -4). -15 What is (0 - -2) + 79 - ((0 - -36) + 566 + -612)? 91 Evaluate 10 + 40 + -58 - (2 + -2 + 0) - 31. -39 Calculate (40 - (0 - -33)) + -28. -21 What is the value of 4 + ((-5 - (-2 + 0)) + -27 - (-26 + 24))? -24 What is 4 + 42 + (10 - (13 - 3)) + -1? 45 Calculate 94 + -44 + -44 - 46. -40 What is -34 - -1 - (-1448 - -1448)? -33 Calculate 35 + (121 - (93 - 18)). 81 Evaluate -59 + -66 + -53 + 201. 23 What is 7 - 47 - (-54 - -16)? -2 Evaluate (-9 + 12 + (-12 - 8) - -1) + -46. -62 (6 - 11) + -1 + 11 - (30 - 37) 12 39 + -12 + -66 + 25 -14 Evaluate 23 - 63 - -14 - -44. 18 What is 257 + -222 + (1 - 0 - 2)? 34 Evaluate (-22 - -8) + 108 - 57. 37 What is -186 - ((-32 - 133) + 32)? -53 What is (-5 - (-2 + -1 - -3 - (-135 + 131))) + 7? -2 What is the value of (1 - -14) + (-6 + 19 + -6 - 8) + 1? 15 What is 1838 + -1835 + (0 - 26)? -23 (22 - 8 - 4) + (-46 - -31) -5 1 + -2 - 2 - (-51 + -5) 53 Evaluate (90 - 41) + -5 + (0 - (2 - -1)) + 0. 41 Calculate 159 + -176 + 34 + -3 + -3. 11 Evaluate -77 - (-6 + -22 + 19 + (-17 - -13)). -64 -2 + 6 - (1394 + -1441) 51 Calculate 14 - (93 - ((22 - 13) + -20)) - -4. -86 What is (7 - (16 + (14 + -3 - 14))) + -61? -67 Evaluate (-14 + 46 - 5) + -23 + -36. -32 -79 + (21 - (1 - 1)) -58 Evaluate -14 + (73 - 38) + -129 - (-2 + (2 - -2)). -110 Evaluate -83 - (-14 - (-50 + 82)). -37 What is (-9 + 3 - -7 - -1) + (-19 + 24 - 8)? -1 What is the value of -3 - (-3 + -56 + 91)? -35 What is 9 + -12 - -1 - 50 - (-3 - (3 + -10))? -56 Calculate (-9 - (-23 + 21) - -27 - 19) + 107. 108 Calculate (-16 - (10 + -44)) + (-28 - 4). -14 Evaluate (-56 + 59 + (3 - 13) - -4) + 61. 58 What is -16 + -4 - (-7 + 5 + 18) - -15? -21 2 + -1 + (0 - 0) + (97 + 92 - 224) -34 Evaluate -1 - -47 - (22 + (3 - 48)). 69 Evaluate 16 + (-8 - (13 + (-5 - 27))). 27 Calculate (-2 + 2 - (-93 + 86) - -5) + 121 - 10. 123 What is -81 + 122 + -38 + -26? -23 -1508 - -1556 - (-4 - 18) 70 (-25 + 29 + -8 - (-24 - 3)) + -15 8 2 + (3 - 3) - (217 - (362 - 151)) -4 Evaluate -15 + 55 + (21 - -1) + -11. 51 What is the value of -94 + (-451 + 490 - (12 + -2))? -65 What is the value of -68 + 6 + 12 + 14? -36 Calculate 104 + (96 - 104) - 167. -71 Calculate -20 + (-4 - 3) + (-102 - -117) - -94. 82 What is -53 + 25 + -27 + (0 - (-1 - 4) - 1)? -51 Evaluate (-3 - 1 - -66) + (-24 - (-20 - (10 - 16))). 52 Calculate -7 - -25 - ((4 - -9) + -45 + 28). 22 Calculate -1929 + 1903 - ((-10 - 1) + 2). -17 Calculate 11 + 25 - (-2 - (17 + -18) - 16). 53 (8 - -21) + (8 + -10 - 6) + 16 37 Calculate 1 + 40 - (-22 - -35 - 4). 32 What is (-11 - -16) + 4 - (59 + 3 + 8 + -21)? -40 What is the value of -2 + 12 + (-33 - -24) + (11 - 2)? 10 -34 - (38 + (-2 - -38)) -108 What is 6 - (22 - -30 - 35)? -11 (4 - -38) + -40 + 53 55 What is the value of 7 - (4 - (-91 - -47))? -41 What is the value of -49 + 2 + 17 + -10 + -4? -44 What is -13 - (-33 - (-18 - 0) - 2)? 4 What is the value of 4 + 19 + -7 + -3 + 19? 32 What is the value of -7 + (-1 - -4) + (-30 + 25 - 18)? -27 What is the value of (40 - 0) + -32 + 22 + -7 + 0 + -1? 22 What is 93 + 1 + (-69 + -3 - -52)? 74 What is -325 + 329 + (-2 - (-1 - -2))? 1 -43 + 84 + -21 + (102 - 3) 119 Evaluate 24 + 3 + (489 - 569). -53 Calculate 105 - (-7 + 23 + 8 + -10 + 5). 86 What is the value of 38 + -8 + 41 + -40 + -150? -119 (49 - 27 - 40) + 38 20 44 - 4 - -12 - (-2 - -28) 26 Evaluate 1 + 87 - ((34 - -13) + (-126 - -58)). 109 Calculate -87 + (13 - (16 + 4)). -94 Evaluate ((-4 - 4) + 43 - 5 - 13) + 12. 29 What is the value of -1 + -4 + (1 - 0) + -44? -48 What is (-91 - -168) + -11 + 22? 88 105 + 5 + -4 - (399 + -368) 75 -15 + -2 + (-37 - -102) + -3 45 -252 + 18 - (131 - 274) -91 Calculate (-7 - -1) + 7 + 26 + -27 + 3 + 69. 72 Evaluate (29 - (-5 - -1)) + 22 + -67. -12 Evaluate 3 - (-3 + 10) - (-23 + (68 - -23)). -72 -165 + 223 + -26 + 17 49 What is (62 - -17 - 68) + 68? 79 Calculate -7 + (-16 - (9 - 17)) + 17 + -4 + 0. -2 What is the value of 56 - (32 + 6 + 8) - -10? 20 What is -11 - ((-7 - -2) + (-59 - -6) + 7)? 40 Calculate (0 - 21) + (93 - -83) + -194. -39 41 - (132 + (3 - 28)) -66 Evaluate -60 + -24 + 112 + (-4 - 99). -75 What is 26 - -7 - 68 - 38? -73 What is -14 + 27 - ((1 + 0 - (-1 - 9)) + 7)? -5 Calculate -4 - -30 - (-23 + 41) - (1 + 33) - -11. -15 What is (-940 - -975) + (1 - (1 + 13))? 22 58 + 11 - 73 - (-32 + 15) 13 Calculate -2 - (10 - 14) - (-34 + -2 + -4). 42 What is -20 - (2 - 2) - (-16 - -2 - (-31 + 8))? -29 1201 + -1239 - (0 - -14 - (6 - 6)) -52 What is -11 + (18 - -20) - (11 + -5 + -10)? 31 -121 - (-8 - 14 - -19 - 6 - (1 + 3)) -108 Evaluate (-946 - -973) + (1 - -60). 88 What is the value of (3 - 8) + (9 + -6 + 10 - (-138 - -104))? 42 Evaluate (1 + 5 + -2 - -1) + -3 - (-49 + 96). -45 Calculate -2 + -2 + 4 + (95 - 148). -53 33 + (40 - 30) - 4 39 -16 + -7 + 18 - (42 + (-6 - -2) + -4) -39 What is the value of -1 + 0 + -7 + -25 + 90 + (-12 - 46)? -1 What is the value of -104 - (10 + -4 + (-36 - -12))? -86 Evaluate -30 + 40 + -42 - (35 - 21). -46 2 + 6 + 20 - (-16 - (-18 + -10) - 4) 20 12 - (-9 + -13 + 14 -	{ "pile_set_name": "DM Mathematics" }
+ 13. Let o = l - h. What is the third smallest value in o, -0.1, -3? o Let l = 1787 + -5363/3. Which is the third smallest value? (a) -10 (b) -1.1 (c) 2 (d) l d Let s = 3543 + -3541. Which is the third smallest value? (a) -1 (b) 2/9 (c) -199 (d) s b Let a be (-240)/(-3740) + 2/(-11). Let i = -117 + 114. What is the fourth biggest value in i, a, 1/2, 0.3? i Let y = 3.38 - 3.38. Which is the smallest value? (a) y (b) 3/2 (c) -0.0875 c Suppose -3l - 5g = -604 - 265, -l + 299 = 4g. What is the biggest value in -2, l, 2/9, 1/7, 0.4? l Let r = -726/17 - -2921/68. Let n = -86 + 86.078. What is the biggest value in -1/6, r, n? r Let y = -5663 - -5666. What is the third biggest value in -244, y, -0.3? -244 Let k be (-4)/(-7) - 4888/(-21385). Which is the fourth smallest value? (a) 1 (b) 29 (c) -2/7 (d) 5 (e) k d Suppose 0 = -2u - 89 + 87. Let v be ((-49)/(-35) + u)/((-8)/5). What is the biggest value in v, -3, -5/21, -0.2? -0.2 Let l = 236/27 + -3014/351. What is the smallest value in 180, 1/4, l, 0.1? 0.1 Suppose -126l = -121l - 165. Let i be -9((-35)/15 + 2). Which is the smallest value? (a) 2 (b) l (c) i (d) 4 a Let y = -2520 - -2526. Let d be 16/(-36)(-3)/6. Which is the second smallest value? (a) -0.3 (b) d (c) y b Suppose 5k = -2v - 15, 3k + 15v - 17v - 7 = 0. Which is the smallest value? (a) 0.2 (b) 4 (c) 10 (d) k (e) -0.5 d Let a = -58 + 29. Let n = -1509 - -1507. What is the second biggest value in 1, n, a? n Let z be (-42)/108-9(-7)/(-147). What is the second biggest value in -8, z, -4? -4 Let k = -21010 - -21015. Let z be ((-20)/6 + 3)6. What is the biggest value in k, z, 3/2? k Suppose -37 = -3c - 3y - 19, 15 = 2c + 5y. What is the third smallest value in -0.5, -9, -23, c, -5? -5 Let n = -1.7 + -0.4. Let z = n + 0.4. Let m = 6.14 + -6.64. What is the second smallest value in z, m, 1? m Suppose 6418y - 276 = 6430y. What is the second smallest value in y, -4, -3, -6/7, -3/5? -4 Let c = -1.2 + 0.2. Let z(b) = 117b - 347. Let v be z(3). Let y = 1709/6 + -284. What is the second smallest value in c, v, y? y Let f be 124/882-87. Let h = f + 245. Let k = 2 + 0. What is the fourth biggest value in h, -2, 3, k? -2 Let x be 4/(-10) - 11/(84700/(-5205)). Let n = x - 2/77. Which is the smallest value? (a) 5 (b) 15/14 (c) -1/3 (d) n c Let x(c) = c3 + 8c*2 + 7c + 2. Let j be x(-8). Let d = j - -54. Let r be 3/3d + 2/(-1). What is the third biggest value in r, 1/7, 2? r Suppose 5w + h = 2, 0 = 173w - 168w - 5h + 40. Which is the fourth smallest value? (a) 2.2 (b) -10 (c) 1 (d) w a Let h = 0.071 - 0.051. Let y be 2/(-16) + 1135/8. Let r = 141 - y. Which is the third smallest value? (a) r (b) 4 (c) h b Let g = -54807 - -54810. Let z = -0.01 - -0.11. Which is the second biggest value? (a) g (b) z (c) 5 (d) 4/7 a Let v = -29/6 + -5/3. Let n = -6 - v. Let i = -434 + 433. Which is the fourth smallest value? (a) -1/2 (b) i (c) -3 (d) n d Let i(b) = 55b + 52. Let c be i(-1). What is the second smallest value in 10/27, c, 0.5? 10/27 Let h = 77 + -84. Let o = 0.1113 + -2.1113. What is the second biggest value in h, 2, o, 1/6? 1/6 Suppose r - 8 + 2 = f, 3f + 2 = -r. What is the third biggest value in f, 5, 0.4, 1/14? 1/14 Let q be 7/(539/8) - 4/14. What is the third smallest value in 2/7, -1/2, 0, 10, q? 0 Let h = -5 - -3. Let x = h + -3. Let t be (36/243)/(1/((-3)/2)). What is the second biggest value in 2/3, t, 1/2, x? 1/2 Suppose 0 = 5h - 5w + 55, 90h = 86h - 5w + 10. What is the fifth smallest value in h, -18/5, -0.3, 2/5, 1/2? 1/2 Let j be (0 - (-6)/24)-2. Suppose -6z + 8z + 28 = 0. Let l be -14 + 16 - (-32)/z. Which is the biggest value? (a) -0.1 (b) -8 (c) j (d) l a Let j = -840.9149 + -0.0851. Let y = -841.5 - j. What is the second smallest value in y, -0.01, 2? -0.01 Let v(f) = f3 + 2f*2 + f + 2. Let d be v(-2). Let s = 9.69 + -9.6. Which is the biggest value? (a) 0.4 (b) s (c) d a Let y = 52.36 - -0.64. Let z = y - 58. Let a be 6/(-2)(-6)/(-99). What is the biggest value in a, z, 1/2? 1/2 Let m = -2754 + 13769/5. Let p = 1.1 + -0.7. Which is the third smallest value? (a) m (b) p (c) 6 (d) -5 b Let i = -2.295 - -1.895. What is the second smallest value in i, -1, 0.4, 0, 4.47? i Let g = -2016 + 2014.902. What is the third biggest value in 0.5, -3, g? -3 Let u = -874 - -873.9. Let s = 170.4 + -172.4. Let a be (-2)/8 - (-18)/8. What is the smallest value in u, a, s? s Let i = 20187429679889/1253577149202 - -1/1738664562. Let o = i + -1734/103. Let t = o - -10/17. What is the third biggest value in t, -2/3, 1? -2/3 Let k = -0.884 + -0.116. Let g = 354 - 179. Let x = g + -2277/13. Which is the second biggest value? (a) 1 (b) k (c) x (d) -0.02 d Let g = -241 - -946. Let s be 47/g + -1 + 8/5. What is the biggest value in 0, -0.4, -11, s? s Let o = -258.05 - -258.55. Which is the third smallest value? (a) o (b) 0.1 (c) -5 (d) -112 (e) -0.4 e Let o = -5282.8 - -5283. Let j = 22/3 + -43/6. Suppose 4t - 15 = m, 4t - 133 = 5m - 10. Which is the fourth smallest value? (a) o (b) j (c) -0.5 (d) m a Let n = 12 + -28. Suppose 0 = f + 141 + 99. Let s be (2/30)/((-72)/f). What is the second smallest value in n, -2/7, s? -2/7 Let v = -11089.7 + 11089. What is the fourth smallest value in v, 0.3, -2/23, 3, 1? 1 Let b = 1357/5 + -271. Let t be -3 + 3 - (2 - 4). What is the third smallest value in 1, -2, b, t? 1 Let x be (5/50)/((-25)/50). What is the third biggest value in -50/7, 0, 2, x? x Suppose 0 = 5f - 764 + 754. Let d be 4/(-25)-153/(-18). Let w be ((-1)/(-6))/((-6)/4). What is the biggest value in d, w, 0, f? f Let f be 1(-2)/(-8) + 1. Let k = -3328.957 + 3334. Let q = -0.043 + k. Which is the smallest value? (a) f (b) q (c) 1 c Let p = -1.107 - 27.593. Let v = p + 28.4. Let i be 10/8(-2)/(-10). Which is the smallest value? (a) v (b) i (c) 2/55 a Let g be (-14)/(-8)(-24)/6. Let h be (-1 - 1)g/22422. Let n = h - 79/40. What is the second smallest value in n, -4, -5? -4 Let t be 247/840 - ((-399)/(-120) + -3). Which is the smallest value? (a) -5 (b) 21 (c) 3 (d) -2/11 (e) t a Let w be 3 - (-29 + -1) - 9/(-3). Let x = -37 + w. What is the second biggest value in 3, x, 2? 2 Suppose 0 = -2o + 5n + 7 + 11, 5n = -20. Let p = -0.1816 - -0.2816. Which is the fourth smallest value? (a) -0.045 (b) -1/8 (c) p (d) o c Let g(i) = -5i + 43. Let a be g(19). Let u be -4 + (-96)/a + 2. Let b = -0.25 - 12.75. What is the second smallest value in b, 3, u? u Suppose 3n + 3v + 23 = 5, -n + 24 = -4v. What is the third biggest value in -1, -0.24, n, -2? -1 Let t = 1 + 3. Let q = 54 - 54. Suppose 0 = -qb + 4b - 12. What is the second biggest value in -3, b, t? b Let z = 27611051/359 - 76911. Let m = -3.05 + 0.05. Which is the second smallest value? (a) m (b) -2/7 (c) z b Let x = -0.09 - -0.09. Let v = -987 + 701. Let r = v - -297. Which is the biggest value? (a) r (b) 1 (c) x a Let x = 80 + -133. Let l = 40 + x. Let d = 13.3 + l. Which is the second smallest value? (a) d (b) -2/9 (c) 0 c Let x = 4149 - 4150.4. Which is the fourth smallest value? (a) -1 (b) 4 (c) -3/4 (d) x (e) 35 b Let q be 11 - ((-70)/(-8))/(573/18 - 31). Suppose -5 = 2p + 3p. Let o(u) = -2u - 2. Let w be o(-5). Which is the biggest value? (a) w (b) q (c) p a Let o = 87.86 - 87.86. Which is the third smallest value? (a) -12 (b) o (c) -0.09 b Suppose 9 = 2q - l - 6, 0 = -q - 2l. Let g = 1066 + -1061. Which is the third biggest value? (a) q (b) 2 (c) 0 (d) g b Let c = 2.8 + -1.8. Let k be (-191)/7 - 110/(-385). Let s be (-33 - k) + (-200)/(-34). What is the second smallest value in s, -5, c, 8? s Let d = 2 - -3. Let w = -133960.0173 - -133967. Let y = 0.0173 + w. What is the second biggest value in -0.5, 0, d, y? d Suppose -2n - 24s + 444 = -28s, 4n + 5s - 888 = 0. Which is the second biggest value? (a) 1/5 (b) -0.3 (c) n a Let t = 5402 - 5396. What is the smallest value in 0.1, -2, -0.92, t? -2 Let n = 8170 + -6674892/817. Let q = -3250/7353 + n. Which is the biggest value? (a) -2 (b) 1.2 (c) q b Suppose 268 = -3b + 5n, -30b + 271 = -33b + 2n. What is the second biggest value in -2, -4/5, b? -2 Let o = 19 + -19.03. Let t = -0	{ "pile_set_name": "DM Mathematics" }
one hundred? -7800 What is -88762674.7 rounded to the nearest ten thousand? -88760000 What is 0.00000546499531 rounded to 7 dps? 0.0000055 Round -4038396.2 to the nearest 10000. -4040000 Round 0.000021580095382 to six decimal places. 0.000022 Round 0.00000080272786 to seven dps. 0.0000008 What is -0.00170778184 rounded to 6 decimal places? -0.001708 What is 0.0011804961 rounded to 2 decimal places? 0 Round 0.502231669 to one decimal place. 0.5 What is 0.319770142 rounded to three decimal places? 0.32 Round 247.73989 to 2 dps. 247.74 What is 640710 rounded to the nearest one hundred? 640700 Round 0.3759633723 to three dps. 0.376 Round -0.0000012781514 to 7 decimal places. -0.0000013 Round 24383.55007 to the nearest one thousand. 24000 What is 2327445800 rounded to the nearest 100000? 2327400000 What is 0.071030297 rounded to 4 decimal places? 0.071 Round -10575.29139 to the nearest one thousand. -11000 Round -12.45681594 to 2 decimal places. -12.46 What is -0.00001190553956 rounded to 6 dps? -0.000012 Round -14.460276 to 0 dps. -14 What is -11805651.49 rounded to the nearest one hundred thousand? -11800000 What is 0.00105648703 rounded to six dps? 0.001056 What is 5219588.16 rounded to the nearest one million? 5000000 What is -217801850 rounded to the nearest one hundred thousand? -217800000 What is -0.078291431 rounded to 4 decimal places? -0.0783 What is -0.00065740139 rounded to 7 decimal places? -0.0006574 Round 0.000016613313 to six decimal places. 0.000017 Round -26493.2509 to the nearest integer. -26493 What is -6269.12767 rounded to the nearest 100? -6300 Round 1.754638958 to 0 dps. 2 Round -0.0906179088 to three dps. -0.091 Round -0.5092061347 to 2 dps. -0.51 What is -7321983.1 rounded to the nearest one thousand? -7322000 What is 0.00454582435 rounded to 7 decimal places? 0.0045458 Round -0.000001421809847 to 7 decimal places. -0.0000014 Round 362.19028 to the nearest integer. 362 Round -23920939 to the nearest one thousand. -23921000 What is 50.46368637 rounded to zero dps? 50 Round -84100447.85 to the nearest 1000. -84100000 What is -52.872401 rounded to two dps? -52.87 What is -0.573309581 rounded to 1 decimal place? -0.6 Round -0.0019122473 to three decimal places. -0.002 What is -1701237608 rounded to the nearest ten thousand? -1701240000 Round -1066.067258 to the nearest ten. -1070 What is 15.66941146 rounded to the nearest ten? 20 Round 0.0000371527228 to 6 decimal places. 0.000037 What is 52312.288 rounded to the nearest 10000? 50000 What is -358414.15 rounded to the nearest one hundred? -358400 What is -10.82131961 rounded to three dps? -10.821 What is -638123950 rounded to the nearest 100000? -638100000 Round -26.7195496 to three decimal places. -26.72 Round 0.00120033113 to 4 decimal places. 0.0012 Round -3.82331344 to zero decimal places. -4 Round 0.531681432 to two decimal places. 0.53 What is 26925642.2 rounded to the nearest 100000? 26900000 What is 99.8968523 rounded to the nearest integer? 100 What is -21871.7427 rounded to the nearest ten? -21870 Round -0.10555104798 to 5 dps. -0.10555 Round -3.4992976 to the nearest 100. 0 Round 0.00048853015 to 6 dps. 0.000489 Round 16138132.05 to the nearest 1000000. 16000000 What is 0.003312046662 rounded to 7 dps? 0.003312 Round 1776886787 to the nearest one million. 1777000000 Round 0.00321646117 to four decimal places. 0.0032 Round 268369.3517 to the nearest ten thousand. 270000 Round 13.6283873 to one decimal place. 13.6 Round -25248.5099 to the nearest 10. -25250 Round 26202.6178 to the nearest 100. 26200 Round -0.070209938 to five dps. -0.07021 What is 0.00004744122885 rounded to six decimal places? 0.000047 Round 22034804 to the nearest 1000000. 22000000 What is 10.64104617 rounded to three dps? 10.641 What is -2321039350 rounded to the nearest one million? -2321000000 Round 0.118210316 to three decimal places. 0.118 What is -0.009161406829 rounded to 4 dps? -0.0092 What is -8342844.68 rounded to the nearest 1000? -8343000 What is 0.000000540323609 rounded to seven decimal places? 0.0000005 What is -3413242805 rounded to the nearest one hundred thousand? -3413200000 What is 3.136343165 rounded to 4 decimal places? 3.1363 Round -1.190729459 to 4 dps. -1.1907 Round -215269.2613 to the nearest one thousand. -215000 What is 276305106 rounded to the nearest 10000? 276310000 Round -22.3101528 to 3 dps. -22.31 Round 32.72433008 to 1 decimal place. 32.7 Round -0.0399014808 to 5 dps. -0.0399 What is -10837.8522 rounded to the nearest 100? -10800 Round 0.63941024 to three dps. 0.639 Round 0.00862787239 to 4 decimal places. 0.0086 Round 294256049 to the nearest 1000000. 294000000 What is 1107.597142 rounded to 1 dp? 1107.6 What is -23.41874372 rounded to 0 decimal places? -23 Round 0.0000588801524 to 7 decimal places. 0.0000589 What is 41466626.7 rounded to the nearest one hundred thousand? 41500000 What is 0.00010000776355 rounded to five decimal places? 0.0001 What is 0.00021623119 rounded to four dps? 0.0002 Round -0.0000168737546 to 6 dps. -0.000017 What is -571.79128 rounded to the nearest ten? -570 Round 8.0116702 to 3 decimal places. 8.012 Round 3170.3722 to the nearest ten. 3170 What is 0.0000118004661 rounded to 7 decimal places? 0.0000118 Round 2668849.19 to the nearest one thousand. 2669000 What is -0.26861459 rounded to 2 dps? -0.27 What is 0.60549291 rounded to 3 decimal places? 0.605 Round 9.767341054 to 3 dps. 9.767 What is 793868.612 rounded to the nearest one hundred thousand? 800000 Round -30.952959 to the nearest 10. -30 What is -0.000079081724 rounded to 7 decimal places? -0.0000791 Round -82137.297 to the nearest one thousand. -82000 Round 0.071700695 to 3 decimal places. 0.072 Round 0.66768074 to two decimal places. 0.67 Round -0.000043065952 to five decimal places. -0.00004 Round -13531.074 to the nearest one hundred. -13500 What is 22073.38687 rounded to the nearest one hundred? 22100 Round 266.7657442 to the nearest ten. 270 Round -37936.9587 to the nearest one hundred. -37900 Round -1592.77669 to the nearest one hundred. -1600 Round -0.07784248 to four dps. -0.0778 What is -0.00303340774 rounded to 4 decimal places? -0.003 What is -61077.0252 rounded to the nearest 100? -61100 What is 0.220238412 rounded to 5 dps? 0.22024 What is 2.086630559 rounded to 0 decimal places? 2 Round 43350.31387 to the nearest 100. 43400 Round -82468.344 to the nearest one hundred thousand. -100000 Round -0.0119408539 to two dps. -0.01 Round -1845236.44 to the nearest 10000. -1850000 What is 0.981327982 rounded to one dp? 1 What is -156.070976 rounded to the nearest one hundred? -200 What is -7869795.95 rounded to the nearest 1000000? -8000000 Round 7401408.58 to the nearest ten thousand. 7400000 What is 0.0004710572318 rounded to six dps? 0.000471 Round -7614267.226 to the nearest 100000. -7600000 Round 2946813851 to the nearest 100000. 2946800000 What is -552.9171 rounded to the nearest 100? -600 Round 59081136300 to the nearest 1000000. 59081000000 Round 4.12229299 to the nearest integer. 4 What is -4013.23597 rounded to the nearest one hundred? -4000 Round 471775.998 to the nearest ten thousand. 470000 Round -1012.994811 to the nearest integer. -1013 What is 1.4032091 rounded to 1 dp? 1.4 What is 0.289940068 rounded to 3 decimal places? 0.29 What is -0.000167856613 rounded to six decimal places? -0.000168 Round 2.98180844 to 1 decimal place. 3 What is 20522.0653 rounded to the nearest 1000? 21000 Round -0.508911367 to four dps. -0.5089 Round 685.79797 to the nearest integer. 686 Round 20115.6364 to the nearest ten. 20120 What is 2592.71073 rounded to the nearest 100? 2600 Round -37697451.52 to the nearest 1000000. -38000000 Round -1.43447671 to 4 decimal places. -1.4345 What is -620438.0293 rounded to the nearest one hundred? -620400 What is 350030.5 rounded to the nearest 10000? 350000 Round 5678972.3 to the nearest one million. 6000000 What is 943967.4 rounded to the nearest 1000? 944000 What is -27377.548 rounded to the nearest one thousand? -27000 Round -0.000002347287233 to seven decimal places. -0.0000023 What is 0.01546587528 rounded to 7 dps? 0.0154659 Round -0.00466799469 to six decimal places. -0.004668 Round -78121.5122 to the nearest one hundred. -78100 What i	{ "pile_set_name": "DM Mathematics" }
2f = -80. Is o a composite number? False Let d be -54 - 4/8-2. Let g = -46 - d. Let u = g + 50. Is u composite? True Let y be (-2 - 0) + 29271 - (7 + -6). Suppose 10i = 7i + y. Suppose 4a = 4h - 0h - i, -h = -4a - 2445. Is h a prime number? True Suppose 0 = -5n + 4i + 41423, -8287 = -4n + 3n + 2i. Suppose -5o + n = -k, -3k = -6k + 6. Is o composite? False Let x(d) = 100d + 112. Let r be x(-1). Suppose 6y = 3y + 1545. Let a = y + r. Is a composite? True Let o = 164 + -74. Let r be o/(-5)-451 + -1. Let c = r - 430. Is c a prime number? True Let d(c) = -4c - 35. Let b be d(-10). Suppose 4h + 4j = -20, -h - j = h + b. Suppose -5w - 2s + 1265 = 0, 0 = -5w - hw - 3s + 1265. Is w composite? True Let c(j) = 4j - 16. Let q be c(2). Is 0 - 2348/q2 prime? True Let v(p) = p3 + 13p*2 + 16p + 90. Let s be v(-8). Suppose sj - 288j + 6054 = 0. Is j composite? False Let i = -23257 - -39434. Let m = 28078 - i. Is m prime? False Let r(s) = 614s + 3687. Let c be r(-6). Let m be -2 + 7 + 0 + -1. Suppose 0 = -6o + mo - cy + 239, y = -5. Is o a composite number? False Let s = 57 + -51. Is (-2 + -5 + s)-745 prime? False Suppose 0 = -4d - p + 1354444, 5p + 2631 = 2671. Is d composite? False Suppose -87i = -33i - 2278314. Is i prime? False Let s = 848 - -7231. Let w be (-28)/(-21) + 94976/12. Suppose -s = -7g + w. Is g prime? False Let y be (-2)/7 + 1/(-14)122. Let l(z) = 8z + 49. Let w be l(y). Let s(a) = -a*2 - 33a + 77. Is s(w) a composite number? False Suppose 5n + 3s = 28, -7n + 2n = -3s - 22. Suppose -nf = -6p + 4p + 2742, 3f + 5456 = 4p. Is p composite? False Let h be 3 + 3 - (18 - 6). Is 20/30 + (-11078)/h composite? False Let u(q) = 401q - 238. Let c be u(7). Suppose -c = l - 15464. Is l a composite number? True Suppose 34d - 33d = -a + 297881, 2a - 595762 = -5d. Is a a prime number? True Let f(v) = 43205v*2 - 43200v*2 + 2 + 3 + 13v. Let j = 7 - 12. Is f(j) composite? True Let p be 176/10 - 154/(-385). Is 23918(p/84 + (-2)/(-7)) composite? False Let w(u) = 14106u*2 + 2u + 2. Let a be w(-1). Suppose 3945 + a = 11s. Is s composite? True Suppose 5a - 3l - 2l - 140 = 0, 5a - 3l - 144 = 0. Suppose 0 = 5w - 5u - a, -3u - 2u = -2w + 24. Suppose -234 = -wj + 20. Is j a composite number? False Is 29264250/390 + (-12)/(-26) prime? True Suppose 181286 + 77687 = 13u. Is u a prime number? False Is (-46 + 47)/((-4)/(-2789764)) a composite number? False Let g be 2(60/5)/(-6). Is (-2999)/(g/621/14) prime? True Suppose -4105 = 2n + 3i, n + 5i = -2n - 6157. Let x = n + 3027. Suppose 5q - 2q = 4v - 1981, 2v - 5q = x. Is v a prime number? True Suppose -349 = -3t - 5r, t - 2r - 82 = 16. Suppose 0 = -p - 1139 + t. Let m = 2212 + p. Is m a prime number? True Suppose -2o = -26574 - 29360. Suppose -4x + 8053 + o = 0. Is x + (2/4)/10 a composite number? True Is 0 + -8 + 341173/7 composite? False Let j = -350 + 355. Is 15722 - (-4 + j - 6) a composite number? False Let c = 62 + -58. Suppose -2n = 5l - 20902, cn = -l - l + 8364. Is (-3 - -1) + l/4 a composite number? True Let u(c) = -3c - 11. Let x be u(-7). Is ((-2)/8)/(x/(-125480)) prime? True Suppose v = -145 + 142. Is ((-2481)/(-2))/v(7 + -13) composite? True Let k = 489 + -487. Suppose 0 = 4x - 270 + 38. Suppose 6z = -w + kz + x, 4w + 2z = 232. Is w composite? True Suppose 4a = -2i + 89514 + 434648, 0 = -4a + 2i + 524150. Is a a prime number? False Suppose 2u - 4m - 465222 = 0, -3u - 2m + 307746 = -390127. Is u prime? True Let t(p) = -74p2 + 8p - 42. Let m(h) = -75h2 + 7h - 43. Let q(b) = 5m(b) - 6t(b). Is q(9) prime? False Suppose 0 = w - 0 - 13. Let h be ((130473/(-9))/7)/((-1)/3). Suppose 0 = wz + h - 20344. Is z a composite number? False Let m be (-20)/152/((-8)/6). Suppose 0 = mp - 0p + 4f - 23374, p - f = 11678. Is p a prime number? True Let m(c) be the third derivative of 391c*4/24 - 263c3/6 + c2 - 14c. Is m(7) composite? True Let q = -341392 + 828199. Is q prime? False Let p = 421126 + -156207. Is p a prime number? True Is (-9)/(-162)99106 composite? True Is ((-11591456)/64)/((-1)/2) a prime number? True Suppose 0 = 4o - 102354 - 34490. Is o a composite number? False Suppose 0 = 11j + 9974 + 37139. Let i = 864 - j. Is i prime? True Let j = 138857 - 39000. Is j a composite number? True Let r(j) = -1 + 2j + 12 + 0j. Let p be r(0). Is (11 - p) + (1 - -126) prime? True Is (1076358/(-16))/((-324)/432)(1 + 1) composite? False Let m(i) = -i*2 - 20i - 51. Let f be m(-18). Is (-105324)/f + (-7 - (-296)/40) a prime number? False Let z(c) be the second derivative of -2/3c3 - 28c + 0 + 293/2c4 - 3/2c*2. Is z(-1) a composite number? False Let h be (2 - -24)-1 + (-5 - -7). Is (-1)/6 + ((-128908)/h)/13 a prime number? False Let b(v) = -1169149v3 + 26v*2 + 60v + 34. Is b(-1) a composite number? False Suppose -2b = 4j - 29365 - 3327, 0 = -4b - 5j + 65390. Let h = -7931 + b. Is h prime? True Suppose -5d + 235 = 20. Let r be 4/18 + d/9. Suppose -k = -rk + 316. Is k prime? True Let f(p) = p*3 - 13p*2 + 24p - 17. Let t be f(7). Let g = t - -309. Is g prime? False Let o = -7585 + 97212. Is o composite? False Let x(h) be the third derivative of -161h4/12 - 79h*3/2 + 3h*2 + 5h. Is x(-37) composite? False Is 4330218(117/54 + -2) a prime number? True Let f(z) = 324z*2 - 5z + 9. Let u = -500 - -504. Is f(u) prime? False Let m(k) = 7k3 + 3k*2 + 8k + 4. Let z be m(-12). Is (z/6)/((-38)/57) a composite number? False Suppose 40002 = 303y - 297y. Is y composite? True Suppose -3 - 32 = 5q - h, 3q + 23 = h. Let g(s) = 521s2 - 9s - 5. Is g(q) a composite number? True Suppose -1282i = -1270i - 4965072. Suppose n - 29n = -i. Is n a prime number? False Suppose -2482u = -2483u + 19417. Is u prime? True Suppose -78 = 8n - 70. Is n/(3/(-30))(-10264)/(-16) composite? True Is (-3)/(-18) - 11770/(-495)7530/8 a prime number? True Suppose -3s + 2s = -2. Suppose p - su = 4, -p + 3u = -5p + 5. Suppose 0 = -4c + pc + 8, -5x - 2c + 4453 = 0. Is x a prime number? False Let v(y) = 25y*3 - 204y*2 + 61y + 15. Is v(23) prime? True Let t(r) = 2947r + 40. Let u be t(4). Suppose 7p - u = 11083. Is p composite? True Let k = 7469 + -5319. Suppose k + 15180 = 10v. Is v a prime number? True Suppose -h + 4o = -5262, -2h - 10o + 10557 = -7o. Suppose -u + 2y + h = -1949, y - 21690 = -3u. Is u a prime number? True Is (-93672)/(-22) + (-38)/(-209) prime? False Let j = 5261 + -3562. Let w = j - -115. Is w a composite number? True Let x = -50 + 58. Let m be -60 + x2/4. Is 4/14 + (-2840)/m a prime number? False Let v be -7 - (-5)/((-10)/(-12)). Let j(q) = 48353q2 - 5q - 5. Is j(v) a prime number? True Let h(b) = b*3 - 6b*2 - b + 1. Suppose 5s = 3q - 1 + 28, -q = -1. Let f be h(s). Let p(j) = -297j - 8. Is p(f) composite? True Is (3 + 3/(-2))(-39210930)/(-297) a prime number? False Suppose 4t + 114 + 30 = 0. Let x = t - -47. Suppose xr + 4772 = 15r. Is r a prime number? True Let i(h) = 2h - 6. Let p be i(4). Suppose -4a - 5c + 1035 = 0, -pa + 2c + 1335 = 3a. Is a a composite number? True Suppose -b + 4f + 16 = 0, 4b - 16 = 3b - 4f. Let h = -15 + b. Is -430/(-8) - h composite? True Let o(u) = -26082u*3 + 2u*2 + 10u + 9. Is o(-1) a composite number? False Let j = 81 - 36. Let s = -41 + j. Is -6s/6 - -131 a prime number? True Let r = -1205 - -3972. Is r a composite number? False Suppose 2j - 2o + 4 = 0, -o = 5j - 3o + 10. Is j/(-4)99732/6 a composite number? False Let x(y) = -y*3 - 16y*2 + 12y - 94. Let o be x(-17). Is (138520/(-12))/(6/o) a prime number? False Let v = 223958 - 89917. Is v a composite number? True Suppose 0q = 2m - q - 28, 2q = -4. Suppose 8116 = mc - 2375. Is c a prime number? False Suppose 2m - 705 + 87 = -4i, i = 3m - 913. Is m a composite number? True Suppose -4997a = -4983a - 3502058. Is a composite? False Let t be -5(12/15)/(-1). Suppose 5c - 40 = 2r, 3c = -c - 4r + t. Is 1 + 543/c - (-1)/(-2) a composite number? True Let q(i) = -2i2 + 22i - 29. Let o be q(9). Suppose 21w = ow + 13678. Is w a prime number? True Let t(z) = 2*z + 38. Let h be t(-13). Is ((-4)/h)/(2/(-3930)) a p	{ "pile_set_name": "DM Mathematics" }
/(mmm/m*(-1/2))))/mm)/(m/m*(-1/2))(m*(2/21)m)/(m/m(3/5)) assuming m is positive. m(-98732/105) Simplify (h*(-6)hh/h(-1/5)h)/((h((hh*4)/hh)/h)/(hh/(h/h(3/2))))(h/(h(-5)/h))/(((h9hh)/h)/h)((h/h(1/8))/h)/h(-4) assuming h is positive. h(-137/40) Simplify (mm/(mmmm(-3/4)m)m(m/m*(-2/5))/m(mm(-3/8)mm)(-3/10))(-2/15) assuming m is positive. m(17/200) Simplify (y5/yy/(yy/y(-3/8))y0/y(-1/8))/((y(-3/7)/y)/(y(-2/27)y))(-29) assuming y is positive. y(-49541/756) Simplify (((p/(p/(p((pp(2/7)/p)/p)/ppp)))/ppp(-32)p)/(p26)20)14 assuming p is positive. p(-7696) Simplify ((l*(-9/5)ll(-4/5))/(l/((l6l)/l))(-34))(-1/5) assuming l is positive. l*(858/25) Simplify ((mm*(-20/3)mm)3/(mm*8(mmm*(2/55)mm)/m))(1/3) assuming m is positive. m(-1267/165) Simplify (((v(-2/19)v)/v)*(1/63)((vv(-1/7))/v)(-5/6))(-1/48) assuming v is positive. v(-281/114912) Simplify ((dd((ddd/(dd*(-2/7))d)/d)/d)1/(d(-5/3)/(ddd/d12)))(1/15) assuming d is positive. d*(-17/63) Simplify ((((ddd(-1)d)16)(-1/58))42)(-1/12) assuming d is positive. d(56/29) Simplify ((u/u2)/u*(4/7))/(uuu0u)*(-7)(u6/u3)/(u5/u(-3/4)) assuming u is positive. u(467/28) Simplify ((y(-1))(2/47)/((y4/y)/(y*(-2/3)yy)))/((y1/y(2/5))/(y/y(2/5))(7/6)) assuming y is positive. y(-2269/1410) Simplify (nn0)(4/9)/(((n/n(2/5))/n)/n)(3/8)(n1/n)(18/7)/((nn(-1/2))/n)(-3) assuming n is positive. n(-191/360) Simplify (o(-2/9)o/o(-1)(o(-1/2))(-2/41))/((oo(-1)o)(2/87)/(o(2/3))(-32/7)) assuming o is positive. o(-95015/74907) Simplify (((r24)(-38))(3/10))33 assuming r is positive. r(-45144/5) Simplify ((h2)*17(h/(((((((h/((h*(-4)h)/hh))/h)/h)/h)/h)/h)/h))/h4)/((h2h)(10/7)/(h(3/4)/(h*4h))) assuming h is positive. h*(685/28) Simplify (((v/(vv*5/v))/v)/(vvv(-5/4)vv)(v/v*(-2/13))/vvv11)(-13) assuming v is positive. v(-229/4) Simplify ((cc(-2))1(c(1/3))(-39))/(c14(c*(-4)c)/c)30 assuming c is positive. c(-314) Simplify (qq(-21)q)/q*(1/6)q*(-4/3)qq/(qq*(-5/13)q) assuming q is positive. q(-523/26) Simplify ((h/(h12/h)h19)/((hh/h*13)/hh(-4/11)))(-21) assuming h is positive. h(-4935/11) Simplify (v6/(vv(-4/3)))30/(vv/(v/(vvvvvvv/(v(vvvv/v*(-1/16))/vv)vv))v/v(-4/5))(4/13) assuming v is positive. v(48861/260) Simplify ((nn/(nn0n))*(-13)(n*(2/7)/nn)/((n/(n*6n))/n))/((n/n*8)/(nn/(nn/(nn(1/4)))))(-1/16) assuming n is positive. n(3033/448) Simplify ((g15)*(-6/23)(g*(-3/4)g)/(ggg(-16)))(-39) assuming g is positive. g*(-37089/92) Simplify ((u/(uu*(2/31))u)/u*31(u*4u)/u(2/37))36 assuming u is positive. u*(-1037196/1147) Simplify (((kk*(-4)k)/k)*(3/25)/(k(k*7k)/k)11)(-16/9) assuming k is positive. k(35344/225) Simplify ((o(-1/8)o/(oo*(-3))o)/(oo0o/o*2oo))/((o0oo(-8))/(o/o0o/o(-1/3))) assuming o is positive. o(269/24) Simplify ((v/((vv/((vv*(-3)/v)/v))/v)v)(1/17)/(v/((((v(1/5)v)/v)/v)/v)v(6/7)))(3/19) assuming v is positive. v*(-6843/11305) Simplify ((nn/(((((n/(n/(n*(4/9)n)))/n)/n)/nn)/n))(-27)(n*(-5/13)n)(-2/11))(-45) assuming n is positive. n(618480/143) Simplify (u/u(-7)u12/u)(-20)((u*7u)/u9)/((u/((u(1/7)u)/u))/(u/(u/(u/(uu(3/4)))))) assuming u is positive. u(-10713/28) Simplify ((y*(2/29)yy/(y0/y)y)/(y15/y)(-22))(-4/7) assuming y is positive. y(-36200/203) Simplify (t(-3/4)/((t/t(-6))/t))(1/2)/(t5t(-1/5)tttt(2/9)t(-4)) assuming t is positive. t(-2663/360) Simplify (q3/q(-6)(q(1/2))(-6/25))/(q(1/4)/qqq(1/4)qq/q1(q/(q(-4/9)/q))/q) assuming q is positive. q(2671/450) Simplify ((u/(u/u(-1)))(3/14)/(u(-1))(2/21))/((u*(-3/5)uu(-3)/u)/(u(-1/3)u/((((u(uu*(1/4)u)/u)/u)/u)/u))) assuming u is positive. u(2057/420) Simplify (j(-2/13)jj/(jjj(2/17)))/((j/j(-2/21))/(jj(-2/7)))(j*(2/13)/j((j/(j/((jj(-11/3))/j)))/j)/j)30 assuming j is positive. j(-909808/4641) Simplify t(-4)/((t(2/13)/t)/tt)tt*(-3/2)t(t/(t/t0))/ttt/t(-3)t*5/t(t(-2/3))(-2/23) assuming t is positive. t(9695/1794) Simplify ((z0)(3/26))(-17/3)/((zzz*(-1)z)*(1/11)z(-1/2)/z(3/10)) assuming z is positive. z(34/55) Simplify (((t(4/15)/(t/((tt(1/23)/tt)/t)))46)(1/41))14 assuming t is positive. t(-6664/615) Simplify ((z*(-13/5)zz)/z)/((z32/z)/z)z*(1/11)/(z(z*(-28)zz)/z) assuming z is positive. z(-303/55) Simplify ((nn/(nn(6/7)))(-24)/(n/(n(-3)/n))(-1/13))(-2/55) assuming n is positive. n(554/5005) Simplify ((cccc/(cc(-3)))(-1/45))(2/7)(c(2/7)/(c/c(-1)c))/(((c0c)/cc)/cc/(cc/(ccc/(cc(-6))))) assuming c is positive. c(-1024/105) Simplify ((b/(b/b5))(-3/19)/(((b*3b)/bb)/b(bb(2/5)b)/b))(1/10) assuming b is positive. b(-493/950) Simplify (y*(-2)yy(-2))(2/141)/(y(1/3)y(-1))48 assuming y is positive. y(1502/47) Simplify ((l0l)19)(-42)((ll/(l/l9)l)/(ll(-1/3)ll))(-3/16) assuming l is positive. l(-12793/16) Simplify (ggg(2/15)g/g(6/11))(-17)/((g*(2/15)g)/(g(-2/5)/g))(-3) assuming g is positive. g*(-1201/33) Simplify (((v/(v/(vvv(-4/9)vv)v))/(v(-1/5)/v))/((v(-1/10)v)/v2))/(v1vv(v*(-3)v)/v)(-14) assuming v is positive. v(437/90) Simplify ((((b*(-2/23)b)/b)/bb/((bb*(-2/5)b)/b))/(b(5/3))28)(-47) assuming b is positive. b(767839/345) Simplify (w*(12/11)w*23/w(w12)(-36/5))(-12/13) assuming w is positive. w(41784/715) Simplify ((h(h1/h)/h)/h)(6/19)/((hh0)/h)(-20)(h(1/8)(h*(-3)/hh)/h)29 assuming h is positive. h(-17129/152) Simplify ((z*(-6)z(-8))/(z(1/4))*0)/(((zz1)/z)(-36)/(zz7zzz1)) assuming z is positive. z33 Simplify ((g/g*6)/(gg*(-1/12))(g(3/7))(-3/13))(-30) assuming g is positive. g(32845/182) Simplify (u*(-4)uuuu/u(-4/3)(u/(uu(1/2))u)*(2/35))/(((u/(uu*(2/5)))/uu)(11/5)/(u3u/((uu/u*7u)/u))) assuming u is positive. u*(5902/525) Simplify (((((s/((ss/(s(s(s*(2/31)/s)/s)/s))/ss))/s)/s(-12/5))(1/50))(-5/3))0 assuming s is positive. 1 Simplify i(3/13)/i(-3/23)(ii/(i5/i))(1/4) assuming i is positive. i(-83/598) Simplify ((c(-9)/c)*42c*(-39)/((cc*31cc)/c))43 assuming c is positive. c(-21156) Simplify b(1/7)((b*(-5)/bb)/b)/b(b(2/11))(-20)(b*(1/22)/(bb10))(5/9) assuming b is positive. b*(-2089/126) Simplify ((uu*(2/7))/(uu*5u))/(u/(uuu*(-1/4)uu)((u*(-4/9)u)/u)/u)(u(-2/5))(-2/13)(u(uu2)/u)(-4/9) assuming u is positive. u(-45727/16380) Simplify (i/(i/(i(2/5)i))i((ii*(-1/7))/i)/ii(-1/8)/i(-2/47))(-2/47) assuming i is positive. i(-15459/309260) Simplify ((q*(-3/7)/q)/(qq/(q*(2/7)q)))/(q(-2)/q(-3/5))(q0)(-4/5)/(q(-7)(qq0/q)/q) assuming q is positive. q(254/35) Simplify ((s0)27/((ss0/s)/s)(-35/3))/(((ss/(s/(s/s(1/3))))/s)35ss3s(7/2)) assuming s is positive. s(-85/2) Simplify ((ff(-4)/ff)/f4)(-5/12)/(f*(-2/15)f*1f*(1/2)f3) assuming f is positive. f(-29/20) Simplify (((x/(x*(-14)x))(-37))27)36 assuming x is positive. x(-503496) Simplify ((w2)0w(6/11)w*(-1/4)w)/((((w/(ww1))/ww)/w)(-1/29))(-3/4) assuming w is positive. w*(1719/1276) Simplify ((hhh(-1))(-47))17/(((h/(hhhh/(hh/h3h)))/hh(-1))/((h/(h(-1)/h))/h)28) assuming h is positive. h(-738) Simplify ((k(13/7)/k11)/((k/(k/(kk*(-19))))/(kkk(1/5))))50 assuming k is positive. k(3870/7) Simplify ((d(1/11)/d)/d(-2/29))32/(((d1d)/d)(5/6)/((d(2/11)/d)/d1)) assuming d is positive. d(-56531/1914) Simplify (((mm(5/6))/m(-21))/((m(mm(m/(m*(-1/14)/m))/mm)/m)/m(-10)))(-1/5) assuming m is positive. m(-184/105) Simplify ((v(18/11)vv/((vv37)/v)vvv)/(vvv(-11)/v)(2/13))(5/8) assuming v is positive. v(-10305/572) Simplify (c	{ "pile_set_name": "DM Mathematics" }
in descending order. p, 3/5, 1/3, -2 Let p(y) = y*2 + 5y + 2. Let r be p(-6). Suppose w + 2d = r, 5w = -2d + 4d + 52. Let f = w + -10. Sort -5, 1, f in ascending order. -5, f, 1 Let l(n) = n + 8n - 10n + 14. Let w be l(11). Sort 9, 6, w in decreasing order. 9, 6, w Let r be -334(-3)/(-12). Let d = r + 29. Let f be 2(3 + 2/(-2)). Put f, d, -5 in decreasing order. f, d, -5 Suppose t = -t - 10, 0 = 3r - 4t - 26. Suppose s - 20 = 5f, -4s + 15 = -rf - 5s. Sort -2, f, 4 in descending order. 4, -2, f Let m(n) = 22n + 49. Let t be m(-2). Put -41, t, -3, 1 in increasing order. -41, -3, 1, t Let t = -3.23 - 912.77. Let b = -940.11 - t. Let z = -24 - b. Sort -0.2, -1/3, z. -1/3, -0.2, z Suppose 0 = -2k - 0 + 8. Suppose -km = 5 - 13. Let p be (0 - (m + 0)) + 4. Sort p, 4, 8. p, 4, 8 Let f be 3((-2)/(-12))/((-20)/(-16)). Let v = 9.6 + 2.4. Sort 2, f, v in decreasing order. v, 2, f Let u be 3 + (-3 + -1 - -19). Put 5, u, -1 in ascending order. -1, 5, u Let n be 8/3 + ((-1)/3)/(-1). Suppose p + 2z - 3 = 0, 2p - 4z = -5z - n. Sort p, 5, -5 in decreasing order. 5, p, -5 Let r be 414/45 + -8 - (-2)/(-10). Sort -0.3, -3, 3, r in increasing order. -3, -0.3, r, 3 Let d = 150 - 144. Put 4, -1, d in decreasing order. d, 4, -1 Let l = -263/2 - -21833/166. Let h = -176/415 + l. Put 5/4, h, 0.5, 17 in decreasing order. 17, 5/4, 0.5, h Let v = -70.9 + 71. Sort v, -2, -0.4, -1/4. -2, -0.4, -1/4, v Let x = -7299 + 4344. Let o be (4/(-18))/(10/x). Let u = o + -65. Sort u, 4, -2 in descending order. 4, u, -2 Suppose -m = -3d - 6m, -4m + 8 = 4d. Suppose -3r - 2y + 1 = -0, -4r + 4y - 32 = 0. Put r, d, 4 in decreasing order. d, 4, r Let s(t) = t - 5. Let u be s(-8). Let a = 27 - 31. Let k be u + (-4 - 12/a). Sort -4, k, -2 in descending order. -2, -4, k Let q = -0.45 + 0.05. Let j = 0 - q. Let c = 28 - 27. Sort c, 3, j in decreasing order. 3, c, j Let d(l) be the second derivative of l4/6 - l3/6 - l2 - 6l. Let z be d(2). Sort -5, z, 3 in ascending order. -5, 3, z Let i = -169 - -167. Sort -21, i, -0.2, -3 in increasing order. -21, -3, i, -0.2 Let m(v) = -2v2 + 6v - 6. Let y be m(1). Let r(f) = f*2 + f + 2. Let u be r(y). Put 1, 5, u, -5 in decreasing order. 5, u, 1, -5 Suppose -7g + 109 = 11. Sort -4, g, -3, 2 in descending order. g, 2, -3, -4 Let v be 5/(-2)(-21 - -4 - -1). Suppose 3l = -5m + v, -l - 5m = -2l - 20. Suppose -y + 0 = -6. Sort 1, y, l in ascending order. 1, l, y Let q(c) = c3 - 7c*2 + 8c - 7. Let r be q(6). Suppose i = 3 - 2. Suppose 0 = 952p - 967p - 75. Sort p, i, r. p, i, r Let f = 61 + -61. Let j = 29 - 34. Put f, 5, j, 4 in descending order. 5, 4, f, j Let i be 51/(-17)1/(-12). Sort -4, i, 178, 2 in increasing order. -4, i, 2, 178 Let n = -1 - 4. Let c = 4 + -3.9. Put c, 5, n in decreasing order. 5, c, n Suppose 39a - 36a + 150 = 0. Let k be ((-24)/a)/4(-5)/(-1). Sort -0.2, k, 5 in descending order. 5, k, -0.2 Let j = 5 + 1. Let x = -3 + -1. Let q(v) = -v*2 + 7v + 102. Let s be q(14). Put j, s, x in decreasing order. j, s, x Suppose 0c + 12 = 4c. Let s be (c/(-12)0)/(-1). Suppose 4m = -0m + 2f + 30, s = 4m + 4f. Sort m, -3, 3. -3, 3, m Let z be (5/(-10))/((-1)/(-16)). Let c = -6 - z. Suppose 0x - x - 8 = 4o, 2x = -co - 10. Sort 3, 4, o in decreasing order. 4, 3, o Let w(s) = -4s - 2. Let p be w(-1). Let q = -243 + 248. Put p, q, 7, 4 in increasing order. p, 4, q, 7 Let b(m) = -m3 - 6m*2 + 7m - 5. Let n be b(-7). Suppose -5 = 3g + 2u, 27u - 1 = -5g + 26u. Sort n, 0, g, -1 in decreasing order. g, 0, -1, n Let j(d) = -2d + 34. Let w be j(14). Let f = -3 - 2. Sort w, -0.4, f, 0.4 in decreasing order. w, 0.4, -0.4, f Let v be 5(-1 - 0 - 0). Suppose -3h = 5y - 22, 0 = y - 22h + 27h - 22. Put -27, v, y in descending order. y, v, -27 Let h = -1106 - -1108. Sort -2, -15, h in descending order. h, -2, -15 Suppose -2r = -2s + 2, 3s - 5r = -2 + 13. Put 2, s, -1, 44 in ascending order. s, -1, 2, 44 Let b be (-15)/(1 + 0). Suppose -2 = 4u + 2. Let g be (-4)/637/(-74). Sort b, u, g in descending order. g, u, b Let p = 13.7 + -13. Let t = 0.2425 + -5.2425. Sort p, t, 3/4 in descending order. 3/4, p, t Let m = 18.79 + -18.59. Put 16, m, -1/4 in decreasing order. 16, m, -1/4 Let c = 1.3 + 2. Let n = -53 - -56. Let g = n - c. Put -1/7, 0, g in increasing order. g, -1/7, 0 Let w = 0.443 - -68.757. Let x = 58 - w. Let p = 11 + x. Sort p, 3, 0.1 in descending order. 3, 0.1, p Let q = 1 + -1.2. Let y be 64/16-6. Let b be 3/y - (-1)/5. Sort q, -4/7, b. -4/7, q, b Let i = 25.5 + -25. Let c = 0 + i. Let n be ((-1)/10)/((-1)/(-2)). Sort n, c, 0.01 in decreasing order. c, 0.01, n Let s = 128 + -128.42. Let f = 0.62 + s. Put -4, f, -2 in increasing order. -4, -2, f Suppose -3y - k + 1 = 0, -y - 2k - 4 = 2y. Sort 40, y, 5. y, 5, 40 Let r = 87.5 - 125. Let f = 37 + r. Let s(b) = b3 - 8b*2 - 10b + 6. Let k be s(9). Sort 0.3, f, k in increasing order. k, f, 0.3 Let c(z) = z + 6. Let x be c(-3). Let n = -399 + 398. Sort n, x, -0.4 in descending order. x, -0.4, n Let v(i) = i*3 + 3i*2 + 2i - 1. Let r be v(-2). Suppose h - 5h = u + 13, 3h + 3u = -3. Suppose -n + 2n - 1 = 0. Sort h, r, n in increasing order. h, r, n Let g = -32/9 + 47/9. Let j = -803 - -806. Let k = 0.5 + -0.3. Sort k, g, j in decreasing order. j, g, k Let b be 1 + (-4 - (2 - 4)) - 4. Suppose -6 = -2q, -1 - 2 = 3k - 3q. Sort -4, b, k. b, -4, k Suppose 4l = -w + 2w + 11, 2w = 10. Let c(p) = -p. Let n be c(0). Suppose n = -0b + 4b. Put l, b, -5 in increasing order. -5, b, l Suppose 4x - 20 = 2o, -o - 4x + 32 = -5o. Let f(n) = n*2 + 8n + 15. Let y be f(o). Sort -1, 4, 0, y in increasing order. -1, 0, y, 4 Let k = 3.56 - 3.48. Sort 2, k, -2/3. -2/3, k, 2 Let s be (-1333)/(-651) - 2/42. Let z be 2/((2 - 1)-2). Put 1, 4, s, z in decreasing order. 4, s, 1, z Let l be (-1)/3 + (-10)/150-5. Sort 2, 4, l, 30 in decreasing order. 30, 4, 2, l Let w = 18 + -21. Let r be w - (-2 - (-2079)/15). Let h = r - -140. Sort 5, h, -1/5. -1/5, h, 5 Suppose 2o + 17 - 5 = 0. Let c = -0.69 - -1.19. Put c, o, 2 in decreasing order. 2, c, o Let j = -1030 + 1023. Let h(s) = -s2 - 2s - 3. Let u be h(-2). Put j, u, -5 in ascending order. j, -5, u Let v(c) = -2c + 1. Let q be v(-1). Suppose 7d + q = 4d. Put d, -2, 1 in descending order. 1, d, -2 Suppose 4x + 2y = -28, 33x - 5y - 10 = 31x. Put 12, -2, x in decreasing order. 12, -2, x Let m = -3.2 - -4. Let a = m + -1. Suppose 0 = -15t + 11t - 16. Sort a, t, 1/2 in decreasing order. 1/2, a, t Suppose -5j + j = -4b, -45 = -5b - 4j. Let t(c) = -c + 1. Let s be t(6). Put 0, s, b in increasing order. s, 0, b Let x = 16/45 - 5/9. Let l be (10/15)/1(2 - 21/9). Sort l, x, -0.06 in increasing order. l, x, -0.06 Let u(q) = -q + 6. Let g be u(-4). Let t(s) be the third derivative of -s4/24 + 13s*3/6 - 2s*2. Let y be t(g). Sort y, 1, 4. 1, y, 4 Let l be (8 - 10)/(9 - 7). Put -4, l, -246 in decreasing order. l, -4, -246 Suppose 5d = -j + 33, 2d + 2j - 6 = -2j. Let o be (-34)/7 - 1/d. Sort 0.5, o, 3, 0.1 in descending order. 3, 0.5, 0.1, o Let i = 386 - 1157/3. Put 1, 2/3, 15, i in decreasing order. 15, 1, 2/3, i Suppose -110 = 15m + 25. Sort m, 1, 4 in descending order. 4, 1, m Let k = 0.09 + -0.29. Let b = 0 + k. Sort b, 2/5, 5 in decreasing order. 5, 2/5, b Suppose 0 = -4c + 31 + 69. Let w be (-10)/c - 77/(-5). Let b be ((-3)/(-10))/(w/(-20)). Sort b, 3/4, -0.3. b, -0.3, 3/4 Let f(n) = n3 - n2 - 2n + 3. Let m be f(2). Let r = 580 + -583. Suppose 0 = 5g - 5 - 5. Sort r, g, m in increasing order. r, g, m Let w = 0.8 + -0.3. Sort w, 3, -4, -2 in ascending order. -4, -2, w, 3 Let f = 624 - 613. Put 16, 3, f in decreasing order. 16, f, 3 Suppose -s = -0s. Suppose 5o - 32 = -2h, 12o = 8o - 3h + 20. Let g be -2(-3)/o - 69/12. Sort -1, s, g in increasing order. g, -1, s Let v = 767 + -770. Let o be (2/(-10))/(6/18). Sort v, o, 5 in increasing order. v, o, 5 Suppose 4l - 361 = -373. Put -5, -2, 3, l in decreasing order. 3, -2, l, -5 Let o(p) = -p. Let u be o(-2). Let r = 61 - 37. Let q = 18 - r. Sort -1, q, u. q, -1, u Let r = -12459/2 - -6097. Let b = r + 133. Put -4, 3, b in descending order. 3, b, -4 Let s(k) = -k2 + 17k + 21. Let p be s(18).	{ "pile_set_name": "DM Mathematics" }
w many minutes are there between 9:18 PM and 3:31 AM? 373 How many minutes are there between 2:52 PM and 10:38 PM? 466 How many minutes are there between 6:25 AM and 5:47 PM? 682 What is 54 minutes after 10:08 PM? 11:02 PM What is 337 minutes after 6:34 AM? 12:11 PM How many minutes are there between 3:29 PM and 7:44 PM? 255 How many minutes are there between 9:56 AM and 10:59 AM? 63 What is 101 minutes before 5:01 AM? 3:20 AM What is 582 minutes before 8:40 AM? 10:58 PM How many minutes are there between 9:12 AM and 5:52 PM? 520 How many minutes are there between 8:03 AM and 8:41 AM? 38 What is 675 minutes before 11:28 PM? 12:13 PM What is 367 minutes after 7:26 PM? 1:33 AM What is 430 minutes after 6:01 PM? 1:11 AM How many minutes are there between 3:45 AM and 1:33 PM? 588 What is 616 minutes before 1:48 PM? 3:32 AM How many minutes are there between 12:25 AM and 11:12 AM? 647 What is 102 minutes before 9:29 PM? 7:47 PM How many minutes are there between 3:20 PM and 10:20 PM? 420 How many minutes are there between 4:59 AM and 1:09 PM? 490 What is 286 minutes before 6:30 AM? 1:44 AM How many minutes are there between 6:57 AM and 12:56 PM? 359 How many minutes are there between 3:30 PM and 2:17 AM? 647 How many minutes are there between 9:15 PM and 12:11 AM? 176 What is 597 minutes after 12:24 PM? 10:21 PM How many minutes are there between 2:39 PM and 2:07 AM? 688 How many minutes are there between 9:37 AM and 1:34 PM? 237 What is 503 minutes before 12:15 PM? 3:52 AM How many minutes are there between 12:38 PM and 9:33 PM? 535 How many minutes are there between 12:38 PM and 8:54 PM? 496 How many minutes are there between 11:58 PM and 1:09 AM? 71 What is 186 minutes after 10:03 PM? 1:09 AM What is 184 minutes before 7:15 PM? 4:11 PM What is 481 minutes after 5:32 PM? 1:33 AM How many minutes are there between 6:39 AM and 8:15 AM? 96 What is 463 minutes before 7:57 PM? 12:14 PM How many minutes are there between 5:05 PM and 12:38 AM? 453 How many minutes are there between 4:22 PM and 1:21 AM? 539 How many minutes are there between 9:56 PM and 1:47 AM? 231 What is 592 minutes before 6:21 AM? 8:29 PM How many minutes are there between 11:34 PM and 2:07 AM? 153 How many minutes are there between 5:52 AM and 5:51 PM? 719 What is 690 minutes before 9:00 AM? 9:30 PM What is 159 minutes after 4:33 PM? 7:12 PM What is 625 minutes before 10:18 PM? 11:53 AM How many minutes are there between 5:47 AM and 2:27 PM? 520 How many minutes are there between 11:01 AM and 1:46 PM? 165 How many minutes are there between 3:04 AM and 3:15 AM? 11 What is 400 minutes after 4:49 AM? 11:29 AM How many minutes are there between 4:33 PM and 12:23 AM? 470 How many minutes are there between 6:55 PM and 7:37 PM? 42 How many minutes are there between 9:58 PM and 10:48 PM? 50 What is 526 minutes after 6:37 PM? 3:23 AM How many minutes are there between 9:47 AM and 9:35 PM? 708 How many minutes are there between 5:34 PM and 12:43 AM? 429 How many minutes are there between 11:43 PM and 6:10 AM? 387 What is 158 minutes after 4:34 PM? 7:12 PM What is 260 minutes after 12:38 AM? 4:58 AM What is 341 minutes before 8:43 PM? 3:02 PM What is 492 minutes before 7:53 PM? 11:41 AM How many minutes are there between 5:50 PM and 10:41 PM? 291 What is 685 minutes before 9:11 AM? 9:46 PM How many minutes are there between 12:00 PM and 7:53 PM? 473 What is 252 minutes after 12:52 AM? 5:04 AM How many minutes are there between 3:41 PM and 1:36 AM? 595 What is 136 minutes after 4:51 AM? 7:07 AM How many minutes are there between 5:36 AM and 5:24 PM? 708 What is 466 minutes after 2:30 PM? 10:16 PM What is 264 minutes before 7:13 PM? 2:49 PM How many minutes are there between 8:35 PM and 6:59 AM? 624 What is 223 minutes before 4:26 AM? 12:43 AM How many minutes are there between 12:05 AM and 9:53 AM? 588 What is 53 minutes before 10:03 PM? 9:10 PM How many minutes are there between 4:27 PM and 4:04 AM? 697 How many minutes are there between 6:16 AM and 10:41 AM? 265 What is 51 minutes after 5:02 PM? 5:53 PM What is 689 minutes after 9:39 AM? 9:08 PM What is 89 minutes after 5:56 PM? 7:25 PM What is 524 minutes before 11:37 AM? 2:53 AM What is 690 minutes after 5:12 AM? 4:42 PM What is 371 minutes before 8:17 AM? 2:06 AM How many minutes are there between 9:03 AM and 5:14 PM? 491 How many minutes are there between 10:00 PM and 6:28 AM? 508 What is 618 minutes before 11:57 PM? 1:39 PM What is 63 minutes before 3:57 PM? 2:54 PM How many minutes are there between 4:23 PM and 2:12 AM? 589 How many minutes are there between 2:18 AM and 8:30 AM? 372 What is 38 minutes before 11:45 AM? 11:07 AM What is 102 minutes before 12:09 PM? 10:27 AM How many minutes are there between 2:10 PM and 10:56 PM? 526 How many minutes are there between 9:54 AM and 3:04 PM? 310 What is 592 minutes before 6:52 PM? 9:00 AM What is 130 minutes before 7:39 AM? 5:29 AM What is 320 minutes before 8:23 AM? 3:03 AM What is 401 minutes after 11:10 PM? 5:51 AM How many minutes are there between 3:20 AM and 11:47 AM? 507 What is 546 minutes before 10:41 AM? 1:35 AM What is 149 minutes before 6:13 AM? 3:44 AM How many minutes are there between 9:54 PM and 10:08 PM? 14 How many minutes are there between 4:03 AM and 10:09 AM? 366 What is 292 minutes after 10:08 AM? 3:00 PM What is 678 minutes after 8:26 PM? 7:44 AM How many minutes are there between 5:43 AM and 8:47 AM? 184 What is 558 minutes before 3:19 PM? 6:01 AM What is 337 minutes after 10:11 PM? 3:48 AM How many minutes are there between 6:58 PM and 1:23 AM? 385 How many minutes are there between 1:00 PM and 10:36 PM? 576 How many minutes are there between 3:26 PM and 10:11 PM? 405 How many minutes are there between 7:16 AM and 9:55 AM? 159 How many minutes are there between 12:19 AM and 7:31 AM? 432 How many minutes are there between 2:13 AM and 4:14 AM? 121 How many minutes are there between 7:28 PM and 5:25 AM? 597 What is 209 minutes before 11:13 AM? 7:44 AM How many minutes are there between 7:26 PM and 12:48 AM? 322 What is 652 minutes after 4:51 AM? 3:43 PM What is 194 minutes after 3:56 PM? 7:10 PM How many minutes are there between 7:06 PM and 8:57 PM? 111 How many minutes are there between 6:31 PM and 4:27 AM? 596 How many minutes are there between 5:49 AM and 5:04 PM? 675 What is 250 minutes after 4:40 PM? 8:50 PM How many minutes are there between 10:11 PM and 7:41 AM? 570 How many minutes are there between 12:16 AM and 10:00 AM? 584 What is 573 minutes before 9:35 AM? 12:02 AM What is 2 minutes before 11:08 PM? 11:06 PM What is 313 minutes before 12:13 PM? 7:00 AM How many minutes are there between 6:11 PM and 6:10 AM? 719 What is 320 minutes after 11:37 PM? 4:57 AM What is 703 minutes after 8:25 AM? 8:08 PM What is 402 minutes after 10:57 PM? 5:39 AM How many minutes are there between 6:01 AM and 12:01 PM? 360 How many minutes are there between 5:42 AM and 3:34 PM? 592 What is 184 minutes after 10:33 PM? 1:37 AM How many minutes are there between 11:17 AM and 7:41 PM? 504 How many minutes are there between 1:19 AM and 8:47 AM? 448 What is 539 minutes before 11:25 AM? 2:26 AM What is 570 minutes after 2:19 PM? 11:49 PM How many minutes are there between 2:09 PM and 1:06 AM? 657 What is 238 minutes after 6:46 PM? 10:44 PM How many minutes are there between 4:08 AM and 12:52 PM? 524 How many minutes are there between 3:18 PM and 6:47 PM? 209 What is 463 minutes before 3:58 AM? 8:15 PM How many minutes are there between 10:45 AM and 2:14 PM? 209 What is 69 minutes after 2:45 AM? 3:54 AM How many minutes are there between 7:15 AM and 11:35 AM? 260 How many minutes are there between 12:37 PM and 12:22 AM? 705 How many minutes are there between 11:00 PM and 4:31 AM? 331 What is 44 minutes after 10:11 PM? 10:55 PM How many minutes are there between 4:46 PM and 2:58 AM? 612 What is 154 minutes after 12:05 AM? 2:39 AM How many minutes are there between 8:57 PM and 2:20 AM? 323 How many minutes are there between 11:15 PM and 8:53 AM? 578 How many minutes are there between 3:05 PM and 5:43 PM? 158 How many minutes are there between 11:34 PM and 3:03 AM? 209 What is 492 minutes after 4:08 PM? 12:20 AM How many minutes are there between 10:56 PM and 6:42 AM? 466 What is 69 mi	{ "pile_set_name": "DM Mathematics" }
7f2. 9f*2 Collect the terms in 1184f + 2262 + 3463f - 1131 - 1131. 4647f Collect the terms in -30k3 + 2 + 78k - 2 - 132k + 36k*3 + 65k. 6k3 + 11k Collect the terms in 43j3 + 33j*3 + 38j*3 + 32j*3 - 151j*3. -5j*3 Collect the terms in -171n*3 + 439n*3 + 218n*3 + 3693 - 1847 - 1846. 486n*3 Collect the terms in 13y*3 + 185y + 8y3 - 363y - 4y3 + 178y. 17y3 Collect the terms in 14694287005922 - 8b - 14694287005922. -8b Collect the terms in -50152i + 2i2 + 50152i + 5i3. 5i*3 + 2i*2 Collect the terms in 5042i + 10 - 10 - 23024i. -17982i Collect the terms in -34m + 4m*2 - 3m*2 + 38m + 3m2 - 3m*2 - 17m. m*2 - 13m Collect the terms in 26103c2 + 20c + 26126c2 - 52296c2 - c3. -c*3 - 67c*2 + 20c Collect the terms in -11172s - 1 + 1 + 40s*3 + 11172s. 40s3 Collect the terms in -1211j + 3447j - 1599j. 637j Collect the terms in 11198v - 22390v + 1406 + 11193v. v + 1406 Collect the terms in 1085q - 460q + 1523q + 7q*2. 7q*2 + 2148q Collect the terms in 5b + 2b - 573153 - 574205 + 1147358. 7b Collect the terms in 102984l*3 + 4755l*3 - 16586l*3. 91153l*3 Collect the terms in 41b - 151b + 40b + 40b - 12b + 42b + 2b*3. 2b*3 Collect the terms in 6 + 4 + 1 - 8047j*2 - 11 + 10j. -8047j2 + 10j Collect the terms in 189082h3 - 1684 + 1684 + 189086h*3 - 378170h*3. -2h*3 Collect the terms in 2o*2 - 144o + 136o2 + 88o + 114o2 + 56o. 252o2 Collect the terms in -253960k*2 - 253928k*2 + 507891k*2. 3k*2 Collect the terms in 24r - 2 + 248r3 - 132r*3 + 337r*3. 453r*3 + 24r - 2 Collect the terms in -8755i2 - 2320i*2 + 0i + 0i + 3270i*2. -7805i*2 Collect the terms in 13978o*2 + 7056o*2 + 21367o*2 + 2189o*2 + 10583o*2. 55173o*2 Collect the terms in 192089k + 194157k - 386219k - 1. 27k - 1 Collect the terms in -6d - 164 - 122 - d - 147 + 601. -7d + 168 Collect the terms in 330176 - 82536 - 82586 - t2 - 82524 - 82530. -t2 Collect the terms in 4 - 4 - 313085d - 1140784d. -1453869d Collect the terms in 4m - 78695 - 6m - 65217. -2m - 143912 Collect the terms in 150a*2 - 424213 + 61a - 47a2 + 424215. 103a*2 + 61a + 2 Collect the terms in -872x2 + 4645x*2 - 717x*2. 3056x*2 Collect the terms in 288 + 90 + 53571k - 107151k + 53582k. 2k + 378 Collect the terms in -4 - 2415q - 1282q + 4 + 3697q + 25q3. 25q*3 Collect the terms in -147y - 173y + 24280 - 24280 - 176y + 491y. -5y Collect the terms in 520b3 + 20820324 - 20820324. 520b*3 Collect the terms in 0i - 792459 - 1116 - i. -i - 793575 Collect the terms in 0s2 + 2 - 415s*3 - 161s + 416s3 + 6s2 - 2. s3 + 6s2 - 161s Collect the terms in -32989389u + 10 + 32989389u + 4u2. 4u*2 + 10 Collect the terms in 8 + 3009c*3 - 22 + 14 + 3. 3009c*3 + 3 Collect the terms in 48 + 15j - 81 - 101 + 13j. 28j - 134 Collect the terms in 4402s3 - 2216s*3 - 62s*2 + 60s*2 - 2226s*3. -40s*3 - 2s*2 Collect the terms in -11y + 25y + 340 - 18y + 1390. -4y + 1730 Collect the terms in -2703 + 8w - 2699 - 2694 + 13493 - 2699 - 2698. 8w Collect the terms in 329 - 652 - 16k*2 + 321 + 25k*2. 9k*2 - 2 Collect the terms in 142 - 517 - 5f + 110 - 3f + 124 + 140. -8f - 1 Collect the terms in -37444c - 37342c - 37349c + 112107c. -28c Collect the terms in 12d*2 + 12d*2 - 52d*2 - 5 + 24d*2. -4d*2 - 5 Collect the terms in -401327n*2 - 27 + 27. -401327n*2 Collect the terms in -3h - 500h2 - 3h + 6h + 243h*2. -257h*2 Collect the terms in 1340 + 1724 + 2v*2 - 411. 2v*2 + 2653 Collect the terms in 6712 - 6712 - 363286k*2. -363286k*2 Collect the terms in 4s2 + s3 + 15 - 5s2 + 0s*2 + 2s*3 + 3s*2 + 0s*3. 3s*3 + 2s*2 + 15 Collect the terms in -326 + 104 + 631f*3 + 173f*3 + 110 + 112. 804f*3 Collect the terms in 226 - 561o*2 - 41o + 42o + 549o*2. -12o*2 + o + 226 Collect the terms in -67367z - 1087 + 1087. -67367z Collect the terms in 135 + 15b - 131 + 9b - 134 - 161. 24b - 291 Collect the terms in 2979961363i3 + 0 + 0 - 2979961303i*3. 60i*3 Collect the terms in -369v*2 - 1 + 484v*2 + 1 - 560v*2. -445v*2 Collect the terms in -1515567k*2 - 5194509k*2 - 2132828k*2. -8842904k*2 Collect the terms in 3032144049w*2 - 1 + 1 - 3032144049w*2 + 17w*3. 17w*3 Collect the terms in 34198h*3 - 34200h*3 - 745232 + 745232. -2h*3 Collect the terms in -62976h + 1 - 4 - 133733h + 3. -196709h Collect the terms in 116349s - 58174s - 132s3 - 58177s. -132s3 - 2s Collect the terms in -2971h - 2683h + 5670h. 16h Collect the terms in 276r2 + 60r*2 + 202r*2 + 157r*2 - 169r*2. 526r*2 Collect the terms in 11n + 7n + 43067 + 2n - 3n. 17n + 43067 Collect the terms in h + 7328h2 - 21253h*2 + 9644h*2. -4281h*2 + h Collect the terms in 8667 + 8664 - 34666 + 2c + 8660 + 8661. 2c - 14 Collect the terms in 0 + 36c*3 + 0 - 6173c*3 - 998c*3. -7135c*3 Collect the terms in 58436u - 116817u + 58422u. 41u Collect the terms in -74784046 + 1455i*2 + 74784020 - 1453i*2. 2i*2 - 26 Collect the terms in -28x*2 + 166 + 84x*2 - 26x*2 - 487 - 20x*2. 10x*2 - 321 Collect the terms in -2q*2 - 4831q + 1689q + 3q2. q2 - 3142q Collect the terms in 975528 - 975531 - 30r - 28r. -58r - 3 Collect the terms in 253l2 - 144l*2 + 25l*2 - 51l*2 - 3l*3. -3l*3 + 83l*2 Collect the terms in -213l*3 - 188l*3 + 93 + 29 + 82l3 + l2. -319l3 + l2 + 122 Collect the terms in -10131l*2 + 10279l*2 - 2 + 4 - 2. 148l*2 Collect the terms in 846821 + 6z*3 - 3z*3 - 2z*3 + 3z. z*3 + 3z + 846821 Collect the terms in 122h3 - 330h*3 + 14h*3 + 72h*3 + 126h*3. 4h*3 Collect the terms in -72150h*2 + 175938h*2 + 284009h*2 - 8h*3. -8h*3 + 387797h*2 Collect the terms in 62 - 345 - 240 + 17d - 19d - 39. -2d - 562 Collect the terms in 465 + 475 - 1399 - 5275p2 + 459 + 5278p*2. 3p*2 Collect the terms in 347t*2 - 20t + 39t - 172t*2 - 19t - 204t2. -29t*2 Collect the terms in -16v + 293v2 - 12v + 15v - 6v + 17v. 293v*2 - 2v Collect the terms in 109w3 + 1094w*3 + 827w*3 - 359w*3 + 115w*3. 1786w*3 Collect the terms in 5 + 6 - 4198d - 7 - 12. -4198d - 8 Collect the terms in t2 - 343t*3 - 2388t*3 - 6631t*3. -9362t3 + t2 Collect the terms in 96h2 - 370h*2 + 88h*2 + 95h*2 + 226 + 92h2. h2 + 226 Collect the terms in -125424r2 + 20654r*2 - 47010r*2 - 55579r*2. -207359r*2 Collect the terms in 1789m + 1676m + 1706m - 5155m. 16m Collect the terms in -124v2 + 1341v - 61v2 + 41v*2 - 76v*2. -220v*2 + 1341v Collect the terms in -3 + 0 + 13564x + 3 + 9999x. 23563x Collect the terms in -47423v*3 + 6838v*3 + 79v*2 - 79v*2. -40585v*3 Collect the terms in 0m2 + m - m2 - 31242 + 3844 - m2 - m2. -3m2 + m - 27398 Collect the terms in 102v + 80 + 97v - 15. 199v + 65 Collect the terms in -128791u2 + 386422u*2 - 128816u*2 - 128822u*2. -7u*2 Collect the terms in -38a*2 - 26a*2 - 9a*2 - 11a*2 - 17a*2 + 135a*2. 34a*2 Collect the terms in -37c - 126c - 20c - 18c + 150c. -51c Collect the terms in -3221s - 23 + 1 + 25 - 3. -3221s Collect the terms in -1175h + 2748h + 1120h + 703h + 120h + 1356h. 4872h Collect the terms in -19858m - 1110269 + 555129 + 555140 + 19860m. 2m Collect the terms in 6510i + 4867i - 29 - 12863i. -1486i - 29 Collect the terms in -163p*2 + 185p*2 + 280 - 558 + 2p - 2p + 278. 22p*2 Collect the terms in -3610q + 20429q3 - 18 + 18 + 3610q. 20429q3 Collect the terms in 18k + 6k2 + 271045 - 271045. 6k*2 + 18k Collect the terms in 5426q2 + 14149q*2 + 24649q*2 + 13548q*2. 57772q*2 Collect the terms in -14397v*3 - 35503v*3 + 1357v*3 + 3832v*3. -44711v*3 Collect the terms in -81236o*2 + 278o + 162473o2 - 81245o*2. -8o*2 + 278o Collect the terms in -2 - 109375c + 54854c + 54582c. 61c - 2 Collect the terms in 7504p3 - 23102p*3 + 7573p*3 + 7633p*3. -392p**3 Collect the terms	{ "pile_set_name": "DM Mathematics" }
5a + 0 = -4p - 2, -4p - 4 = 4a. Suppose -5g - 3n - 20 + 73 = 0, -ag + 10 = 4n. Calculate the greatest common factor of g and 143. 13 Suppose 298n = 300n - 48. What is the greatest common factor of 680 and n? 8 Let k = 2820 - 785. What is the greatest common factor of k and 220? 55 Let f be 6 + -1 - (-9 + 14). Suppose -n + 5 = 0, f = 2i - 4n - 29 + 13. Suppose ig - 75 = 13g. Calculate the greatest common divisor of 6 and g. 3 Let x(t) = t*2 - 4t - 11 - 5t - 8 + 13. Let q be x(15). What is the highest common factor of q and 21? 21 Let t(v) = 142v - 2246. Let o be t(16). What is the greatest common factor of 4407 and o? 13 Let u be (-32826)/(-18) - (-8)/24. What is the greatest common factor of 570 and u? 114 Suppose 2m = 2g - 20, 3m = 4g - 3g - 20. Let q be 3/1 + -1 + m. Let n be q + 80(-1)/(-10)4. Calculate the highest common divisor of n and 232. 29 Suppose -109 + 5 = -3f + 4i, 146 = 4f + 2i. What is the highest common divisor of f and 2868? 12 Suppose -1035i + 27336 = -1029i. What is the greatest common factor of 68 and i? 68 Suppose 4q + 17q - 16000 = 5q. What is the greatest common divisor of 8 and q? 8 Let j = 154 + -147. Suppose 36 = jh - 3h. Calculate the greatest common factor of h and 39. 3 Suppose -6u + u = -135. Suppose -5p = d - 262, -5d + u = p - 35. Suppose 11w = 21w - 130. What is the greatest common divisor of w and p? 13 Suppose 0 = 7l + l - 232. Let b = -18 + l. Suppose 6p = 101 - b. What is the greatest common divisor of 3 and p? 3 Suppose 0 = -9p + 7p + 4s - 70, 0 = -5p - 4s - 119. Let m be 18/p(-66)/4. What is the highest common divisor of 2 and m? 1 Let g = 231 - 118. Suppose 5d - 5 = 0, 2p = 4p - 3d - g. Calculate the greatest common divisor of 87 and p. 29 Suppose -4b + 10s = 13s - 458, -b + 8s = -132. Suppose 235 = z + 3z + 3y, -4y = -2z + 112. Calculate the greatest common factor of b and z. 58 Suppose 255n = -57n + 918840. What is the highest common divisor of n and 190? 95 Suppose 4i - 5g = 37821, 545 = 5g + 510. What is the highest common factor of i and 224? 56 Let l(m) = -11m + 178. Let p(u) = -20u + 353. Let h(y) = -5l(y) + 3p(y). Let r be h(22). Calculate the greatest common factor of r and 472. 59 Let a be (-2 - 1) + (-2478)/(-17 - -10). Let r = -181 + a. What is the highest common factor of 68 and r? 34 Let x be 2/((-4)/(-30)) + -6 + 5. Suppose 4n = -6 + x. Suppose -nm + h = -38, 3m + 0h + h - 52 = 0. Calculate the greatest common factor of 144 and m. 18 Let c be (-28)/((-30229)/(-25270) - 18/15). What is the highest common factor of c and 168? 56 Let y(d) = -99d - 231. Let p be y(-11). Calculate the highest common factor of 507 and p. 39 Suppose 0h = -2h. Suppose h = 8o - 60 - 356. Calculate the highest common divisor of o and 156. 52 Let w(d) = -d + 10. Let f(c) = 2c - 8. Let h(m) = 4f(m) + 5w(m). Let v be h(4). Calculate the highest common divisor of v and 105. 15 Let g be (6 - -4) + (-62)/3-3. What is the greatest common factor of g and 22104? 72 Let u be 1448/24 + 2/(-6). Let h(r) = -10r3 + 42r*2 + 84r. Let c be h(-2). Calculate the greatest common factor of c and u. 20 Suppose 16n - 705 = -65. Suppose -35p + 45p = n. Calculate the greatest common divisor of 28 and p. 4 Let v = -1697 - -1865. Calculate the greatest common divisor of 448 and v. 56 Suppose -3d = -2t - 402, 9d = 5t - 7t + 1158. What is the greatest common factor of d and 3770? 130 Suppose 111g + 1344 = 127g. Suppose -458 - 326 = -14u. What is the greatest common divisor of g and u? 28 Let t(m) = 2m - 62. Let z be t(-29). Let y be -10 + z/(-12) + 1 + 436. What is the highest common factor of y and 23? 23 Let u be ((-12)/15)/((-10)/575). Suppose k = 2q + 6, 4k + 8 = -3q + 32. Let w be (-18)/k + (1 - -94). Calculate the greatest common factor of w and u. 46 Let y = 896 + -2767. Let u = y + 2651. What is the highest common factor of u and 60? 60 Suppose 4 = -4m + 52. Suppose 16p - 67864 = -52p. Let b = 1001 - p. What is the greatest common divisor of b and m? 3 Suppose 3m - 2f + 6 = 0, -4m + 2f = -5 + 11. Suppose 7a - 3057 - 590 = m. Suppose -6b + a + 343 = 0. Calculate the highest common divisor of 36 and b. 36 Suppose -3y + w + 18 = 2y, y - 10 = -3w. Suppose -6d = -5i - 3d - y, 0 = i + 5d - 16. What is the greatest common factor of 11 and i? 1 Let l(p) = -2p*3 + 5p*2 + p - 2. Let a be l(-1). Suppose -4s = ab - 44, s - 44 = -3s - 5b. Calculate the greatest common divisor of s and 1. 1 Let d be (-3607)/25249 + 365/7 + -1. Suppose 0 = 5l - 354 - 326. What is the greatest common divisor of l and d? 17 Suppose 4a + 2v - 38 = 0, -a - 239v + 14 = -243v. Suppose 0 = z, -2k + 290 + 170 = 5z. Calculate the highest common factor of a and k. 10 Suppose 468w = 1429w - 3844. Let y(d) = d3 - d2 + d + 46. Let n be y(0). What is the highest common divisor of n and w? 2 Let q(h) = h*2 + 9h - 16. Let n(x) = x*3 + 9x*2 - 22x - 13. Let f be n(-11). Let k be q(f). Calculate the highest common divisor of k and 36. 36 Let o(i) = -i*3 + 2i*2 + 2i + 24. Let n be o(-9). Let l = n + -648. What is the highest common factor of l and 3? 3 Let p = 14 - 2. Suppose 34a + 350 = 41a. Suppose 56h - ah = 504. What is the greatest common factor of p and h? 12 Let j = -25 - -37. Let v be (-62)/((-4)/30). Suppose 4n = n + v. What is the greatest common divisor of n and j? 6 Let j be (4/6)/(6/(-936)). Let o = -102 - j. Suppose -ol - 2c = -4l + 32, -2c + 22 = l. What is the highest common factor of 6 and l? 6 Suppose 15 = 3q, -3i - 6q - 1572 = -9q. Let g = i + 578. Calculate the greatest common divisor of 767 and g. 59 Let f = 1929 - -3111. Calculate the greatest common divisor of 16 and f. 16 Suppose -32 = 4a - 52. Suppose as - 156 = -3p, s - 79 = -3p + 65. Let k = -29 + p. Calculate the highest common factor of k and 6. 6 Let j = 404 - 416. Let d be (27/j)/(99/(-264)). Calculate the highest common divisor of d and 282. 6 Let r = 57 - 21. What is the greatest common factor of r and 6084? 36 Suppose -27 = -8v + 21. Let z be ((-3)/1 - (-14)/v)-12. Let m = 2 + z. What is the greatest common factor of 10 and m? 10 Let h = -2508 - -2549. What is the highest common divisor of h and 287? 41 Let k = 258 - 18. Let v be -31 + k/(72/12). What is the greatest common factor of v and 74? 37 Let x(p) = -535p*3 - 43p*2 - 14p. Let i be x(-2). Calculate the greatest common divisor of 44 and i. 44 Let b = -461 + 464. Let w(p) = -20p2 + 2. Let m be w(2). Let r = b - m. What is the greatest common factor of 27 and r? 27 Suppose j + 8m = 13m + 473, -5m - 2305 = -5j. What is the highest common factor of j and 2? 2 Let s = 229 + -154. Suppose -3b = 15, 6x - s = x + 5b. Suppose -xp + 21 = -9p. What is the greatest common factor of p and 63? 21 Let h be (-168)/16(-3 + -1). Suppose 2q + 31 - 346 = -13q. What is the greatest common factor of q and h? 21 Suppose -4 = 2s, 4s + 29 = a - 21. Suppose 20l = -1011 + 1571. Calculate the greatest common divisor of a and l. 14 Let u be 4 - (-65 + -6 + 10). Let n = -991 - -1030. Calculate the greatest common factor of u and n. 13 Suppose -29152 = -119s + 15830. What is the greatest common divisor of 5859 and s? 189 Let n(r) = 80r - 6. Let g(u) = 27u - 2. Let w(d) = 7g(d) - 2n(d). Let p be w(3). Let y = -72 + p. Calculate the highest common factor of y and 143. 13 Suppose 334s + 96s - 624360 = 0. Calculate the greatest common divisor of 54 and s. 6 Let v(w) = w2 - w. Let b be v(2). Let m(a) = 11a*2 + 330a + 34. Let h be m(-30). What is the highest common factor of b and h? 2 Suppose -12j + 8j = 4. Let y(m) = -2m3 - m2 - 2m - 1. Let k be y(j). Let v = -657 + 659. What is the greatest common divisor of v and k? 2 Suppose -c = -3, 3j - 2j + 2c - 22 = 0. Suppose ju - 20u = 256. Let p = 104 - u. Calculate the greatest common divisor of 21 and p. 21 Suppose 3f - 291 = -10k + 173, -2k = -4f - 56. What is the highest common divisor of k and 27764? 44 Suppose 3h - 2h + 3 = -3z, -4z + 5h + 15 = 0. Suppose -y = 3a + 177 - 867, -3y = z. Calculate the highest common factor of a and 46. 46 Let x = 441 - 423. Let w = -18 + 15. Let q be 18*(w/(-3) - -6). Cal	{ "pile_set_name": "DM Mathematics" }
res? 0.0173374 How many seconds are there in one fifteenth of a hour? 240 What is 21/2 of a milligram in micrograms? 10500 What is 77692.4cm in nanometers? 776924000000 What is fourty-nine quarters of a gram in milligrams? 12250 Convert 470.0721l to millilitres. 470072.1 What is 0.55429ml in litres? 0.00055429 What is one fifth of a century in months? 240 What is 21494937.6 microseconds in days? 0.000248784 Convert 14411.56 weeks to days. 100880.92 How many litres are there in 3466.369ml? 3.466369 What is nineteen sevenths of a week in minutes? 27360 What is 3525.274ml in litres? 3.525274 What is three tenths of a century in decades? 3 How many litres are there in 657.1917 millilitres? 0.6571917 How many micrometers are there in twenty-one eighths of a centimeter? 26250 How many years are there in 7.81608 months? 0.65134 How many months are there in four thirds of a decade? 160 What is 27/4 of a gram in milligrams? 6750 Convert 44283.11nm to millimeters. 0.04428311 What is 711748.1mg in kilograms? 0.7117481 How many micrograms are there in 3/25 of a milligram? 120 How many millilitres are there in 18/5 of a litre? 3600 How many micrograms are there in twenty-five eighths of a milligram? 3125 Convert 824739.6 meters to micrometers. 824739600000 What is 13/5 of a litre in millilitres? 2600 How many grams are there in 4128.91kg? 4128910 What is five eighths of a meter in millimeters? 625 What is 3/10 of a decade in months? 36 What is 150211.3 litres in millilitres? 150211300 How many micrometers are there in 2714.98cm? 27149800 What is 15/4 of a litre in millilitres? 3750 How many years are there in thirty-one fifths of a decade? 62 What is twenty-one fifths of a centimeter in millimeters? 42 What is 0.7800727ng in milligrams? 0.0000007800727 Convert 2438.005ng to tonnes. 0.000000000002438005 What is 52/5 of a meter in millimeters? 10400 How many litres are there in 87144.88ml? 87.14488 What is 7/8 of a litre in millilitres? 875 What is four thirds of a minute in milliseconds? 80000 What is 18/5 of a kilogram in grams? 3600 What is 5.93753 micrograms in tonnes? 0.00000000000593753 How many nanometers are there in 3/40 of a millimeter? 75000 What is 30429.7 litres in millilitres? 30429700 What is 1/5 of a kilometer in centimeters? 20000 How many nanometers are there in 3/25 of a micrometer? 120 What is 4/3 of a day in hours? 32 How many micrograms are there in 21/4 of a milligram? 5250 What is 0.5875043 years in decades? 0.05875043 How many meters are there in fourty-six fifths of a kilometer? 9200 How many seconds are there in three fifths of a hour? 2160 What is 7/4 of a kilometer in meters? 1750 Convert 0.301356 decades to years. 3.01356 Convert 54861.04l to millilitres. 54861040 Convert 556.2251mg to micrograms. 556225.1 How many millennia are there in 120363.4 decades? 1203.634 How many days are there in 48.894984 minutes? 0.03395485 What is 0.6555464l in millilitres? 655.5464 What is twenty-six fifths of a microsecond in nanoseconds? 5200 Convert 3.761122 micrometers to centimeters. 0.0003761122 How many seconds are there in 1/27 of a week? 22400 What is 8.418817 seconds in microseconds? 8418817 Convert 0.4331831 tonnes to nanograms. 433183100000000 What is 63596.98 nanometers in kilometers? 0.00000006359698 How many millilitres are there in seven eighths of a litre? 875 Convert 256271.4s to minutes. 4271.19 How many litres are there in 583.4485ml? 0.5834485 How many nanometers are there in 13/5 of a micrometer? 2600 Convert 192.9139ng to grams. 0.0000001929139 Convert 6.56999ns to seconds. 0.00000000656999 How many milliseconds are there in 60356.82 days? 5214829248000 How many months are there in 21/5 of a century? 5040 What is fourty-six fifths of a milligram in micrograms? 9200 Convert 0.5806513 litres to millilitres. 580.6513 Convert 729412.1 milligrams to grams. 729.4121 What is 47/4 of a decade in months? 1410 What is 11/2 of a centimeter in micrometers? 55000 How many months are there in 149744.2 years? 1796930.4 Convert 0.6045396ml to litres. 0.0006045396 What is three eighths of a litre in millilitres? 375 Convert 863001.9 microseconds to milliseconds. 863.0019 How many minutes are there in 52.30857ms? 0.0008718095 What is 1.5441nm in micrometers? 0.0015441 Convert 159.8518um to centimeters. 0.01598518 How many years are there in 1/5 of a millennium? 200 What is 51/4 of a micrometer in nanometers? 12750 How many litres are there in 9.751253ml? 0.009751253 How many months are there in one sixth of a year? 2 How many litres are there in 52099.55 millilitres? 52.09955 What is eighteen fifths of a litre in millilitres? 3600 What is 59292.34 nanometers in meters? 0.00005929234 What is 31/2 of a century in decades? 155 Convert 54875.07 grams to tonnes. 0.05487507 What is 85527.92ug in grams? 0.08552792 Convert 7964.831ng to grams. 0.000007964831 How many years are there in 43/4 of a millennium? 10750 Convert 16258.41 litres to millilitres. 16258410 How many weeks are there in 16.7536173 hours? 0.0997239125 What is 97222.5 days in hours? 2333340 What is 3/8 of a microgram in nanograms? 375 What is 1/20 of a litre in millilitres? 50 How many nanoseconds are there in one twentieth of a microsecond? 50 Convert 1123.567 weeks to hours. 188759.256 What is 67427.26 days in minutes? 97095254.4 How many millilitres are there in 531757.9 litres? 531757900 Convert 0.5305282 centuries to months. 636.63384 What is seventeen halves of a litre in millilitres? 8500 Convert 54.59029 centuries to years. 5459.029 How many nanometers are there in 19/4 of a micrometer? 4750 How many millimeters are there in 11/2 of a meter? 5500 What is 3/25 of a litre in millilitres? 120 What is 21000.9321ms in days? 0.00024306634375 What is one fifth of a gram in milligrams? 200 How many grams are there in 6/5 of a kilogram? 1200 How many millilitres are there in 27/2 of a litre? 13500 How many litres are there in 8.186488 millilitres? 0.008186488 How many litres are there in 820054.5 millilitres? 820.0545 How many minutes are there in thirty-two ninths of a day? 5120 How many months are there in 4/3 of a millennium? 16000 How many millimeters are there in 13/4 of a meter? 3250 Convert 9985.809cm to kilometers. 0.09985809 What is 2.093979 millennia in decades? 209.3979 What is 184.7905ng in milligrams? 0.0001847905 What is 78.85474 litres in millilitres? 78854.74 How many kilograms are there in 81.72828 tonnes? 81728.28 What is 37413.33 weeks in minutes? 377126366.4 How many weeks are there in 98163273.6 milliseconds? 0.162307 Convert 19.95921l to millilitres. 19959.21 What is four thirds of a year in months? 16 How many millilitres are there in 1/4 of a litre? 250 What is 436.4017 weeks in seconds? 263935748.16 Convert 7.429439km to nanometers. 7429439000000 Convert 0.8126582 nanograms to tonnes. 0.0000000000000008126582 Convert 440.333 days to nanoseconds. 38044771200000000 What is fifty-three quarters of a tonne in kilograms? 13250 How many years are there in 51/4 of a millennium? 12750 How many litres are there in 73.50876 millilitres? 0.07350876 How many months are there in 45/2 of a decade? 2700 How many centuries are there in 29/2 of a millennium? 145 What is seven quarters of a millennium in months? 21000 What is 11463.363us in days? 0.0000001326778125 Convert 16641410.31 nanoseconds to weeks. 0.000000027515559375 How many centimeters are there in 871.2745nm? 0.00008712745 What is 3/5 of a minute in milliseconds? 36000 What is twenty-five quarters of a litre in millilitres? 6250 Convert 471387.28 days to weeks. 67341.04 How many millilitres are there in twenty-nine halves of a litre? 14500 What is 0.3877417um in millimeters? 0.0003877417 Convert 99.8055ug to grams. 0.0000998055 What is 711199.3ug in milligrams? 711.1993 How many years are there in 583355.8 millennia? 583355800 Convert 42173.58 weeks to milliseconds. 25506581184000 What is 0.5833806 hours in nanoseconds? 2100170160000 Convert 91936.08ml to litres. 91.93608 What is six fifths of a litre in millilitres? 1200 What is nineteen quarters of a hour in seconds? 17100 What is 32.17727 millilitres in litres? 0.03217727 How many months are there in 8/3 of a year? 32 Convert 852504.9ng to grams. 0.00085250	{ "pile_set_name": "DM Mathematics" }
f g and (-2 - -4) + (-3)/(-2). 20 Let b(p) = p + 10. Let u be b(0). Suppose -2 + u = q. What is the smallest common multiple of q and 3? 24 Suppose 0 = -4p - 6 + 18. Suppose -pl + y = -10, -l + 3l = -2y - 4. Calculate the least common multiple of 138/7 + l/7 and 20. 20 Let z be ((-5)/21)/(14/2268). Let s = -2234/63 - z. Find the common denominator of 22/5 and s. 45 Let j = 865/12 + -6565/84. Find the common denominator of ((-6)/(-30))/((-24)/(-1070)) and j. 84 Let n(g) = -4g + 40. Let y(f) = -f + 13. Let h(l) = -2n(l) + 7y(l). Calculate the smallest common multiple of h(-10) and 10. 10 Let i(w) = w3 + 7. Let k = -36 + 42. What is the lowest common multiple of k and i(0)? 42 Suppose -2h + 10 = -7h. Let g be (-2)/4 - (-3)/h. What is the common denominator of (-26)/24 + (g - -4) and -45/14? 84 Let t = 1001/2 + -3473/7. Let l = 1/1355 + 109751/5420. Find the common denominator of t and l. 28 Let c = 6 - 3. Suppose -42 + 131 = 5w + 3g, g - 51 = -cw. Suppose n - 1 = 1. What is the smallest common multiple of n and w? 16 Suppose -63 = -4o + 17. Calculate the lowest common multiple of o and 32. 160 Suppose -2b - 4 = -18. Calculate the smallest common multiple of 2 and b. 14 Let f(y) = y*3 + 4y*2 + 4y + 4. Let m be f(-4). Let r = m + 44. Let s = r + 15. What is the common denominator of s and 49/10? 10 Let y be 4629/27 - (-1)/(-4). Let q = y - 1426/9. Let a = 7133/4 + -1769. Find the common denominator of q and a. 4 Let n = -2/323 - -3561/1292. Calculate the common denominator of n and ((-118)/((-10)/5))/7. 28 Suppose 0 = -g + 6g - 570. Calculate the common denominator of (2/6)/((-20)/g) and -13/11. 110 Calculate the smallest common multiple of 10/(-30) - (-55)/3 and 1. 18 Let g = 107 + -17. Let d(s) = 4s3 + s2 - s. Let z be d(1). Suppose -zw = w - g. What is the smallest common multiple of 22 and w? 198 Calculate the lowest common multiple of (-6 - -3) + 182 - -3 and 4. 364 Let n(y) = 2y*2 - 5y + 3. Let w be n(5). Let o(g) = g*2 + 10g + 7. Let l be o(-7). Let v = l + w. Calculate the least common multiple of 22 and v. 154 Let c(b) = b + 12. Calculate the lowest common multiple of 4 and c(-10). 4 Suppose -l - 9 = -2d, 6d = 2d - l + 3. Let u be (d/(-6))/(3/(-45)). Suppose uq - 14 = 3q. Calculate the smallest common multiple of q and 2. 14 Suppose -4r + 9 - 1 = 0. Suppose -rv + 98 = -2m, -2v = v - 3. What is the common denominator of m and 25/8? 8 Let h = 4397/10 + -439. Let d be 3 - (-3)/9-3. What is the common denominator of 65/9d/4 and h? 90 Suppose -2g + 6g = 28. Suppose 0s + 16 = 4k - 4s, 2k = 5s - 1. What is the least common multiple of k and g? 7 Let o = -7 - -39. What is the least common multiple of o and 16? 32 What is the common denominator of -1/3 and ((-314)/20)/(210/50)? 42 Let a = -109/5 - -102/5. Suppose -3d + 0d + 9 = 0. Find the common denominator of (d/(-1))/((-21)/(-22)) and a. 35 Let x = -3629/246 + -222/41. Suppose 3w = -5 - 1. Find the common denominator of x and 18/(-15)w/4. 30 Let u = -5/649 - -27343/11033. Calculate the common denominator of u and 31/4. 68 Let p be (-10 - -8)/(1/24). Calculate the least common multiple of (2 + -1)/((-12)/p) and 7. 28 Suppose 0 = -2y - 3 - 5, y - 11 = -3h. Calculate the least common multiple of h and 6. 30 Let g(s) = s + 2. Let i be g(-2). Suppose -2v + 4 = 2v, 2h + 4v - 432 = i. What is the common denominator of h/(-20) - 0/(-4) and -25/6? 30 Let f = -139 - 4. What is the common denominator of 131/6 and f/(-20) + (-3 - 0)? 60 Let i(r) = r*2 + 3r - 5. Let o be i(-5). Suppose u - ol + 3 = -l, -1 = 2u - 3l. Calculate the least common multiple of u and 3. 3 Suppose -2f = -5q + 44, 3q + 5f - 41 = 4. Suppose q = 4n - 22. What is the smallest common multiple of 4 and n? 8 Let q(v) = -3v - 8. Let j be q(3). Suppose h - 3 = -36. Let z = j - h. What is the smallest common multiple of 4 and z? 16 Find the common denominator of 1/1 - (-126)/70 and (-34)/414/10. 10 Let v = -567 - -23803/42. Calculate the common denominator of v and 101/12. 84 Suppose 5s - s + 20 = 0. Let m(h) = -1 - 2 - h + 5. What is the least common multiple of m(s) and 10? 70 Let i = 51/76 - 8/19. What is the common denominator of i and 39/8? 8 Let c be 4/(-6) - 3113669/(-561). Let n = c + -5554. What is the common denominator of (-14)/1611 - -2 and n? 88 Calculate the lowest common multiple of 21 and 30/2 - (-5 + (10 - 2)). 84 Let x be 16/(-58)(22 + 1). Let n = x + 2371/232. What is the common denominator of n and 21 + ((-30)/(-8) - 4)? 8 Let o = -3272 - -585692/179. Let r = o - 8262/1253. What is the common denominator of (-103)/(-4) - (4 - 3) and r? 28 Suppose -2u + 37 = -5. Calculate the smallest common multiple of u and 3. 21 Suppose 4a - 40 - 24 = 0. Suppose 3p = 4s + 7, 2s - p = 2p - 11. Calculate the least common multiple of a and s. 16 Let z = 236/43 + 1/86. Calculate the common denominator of z and 69/8. 8 Let u = 60413/11 - 5488. Let k = -2004 - -9989/5. What is the common denominator of k and u? 55 Let a = 99/65 + 3817/780. Find the common denominator of a and 71/4. 12 Let u = 283 - 199. Calculate the common denominator of (-214)/u - 2/7 and -26/9. 18 Let y = 1716 - 3523/2. Let z be (-42635)/(-18760) + (-2)/7. Let u = 26/67 + z. Calculate the common denominator of u and y. 8 Let b be (-16)/(-80) - (-1214923)/199890. Let o = b + -2/11105. What is the common denominator of o and -85/16? 144 Let m(s) = -s + 14. Calculate the least common multiple of m(7) and 8. 56 Find the common denominator of (-1)/3(-5)/(25/(-355)) and -17/28. 84 Let p = 2 - -14. Find the common denominator of (423/24)/((-6)/(-8)) and 126/p - 12/(-4). 8 Let x = 3089/2 - 1573. Calculate the common denominator of -83/14 and x. 14 Let f(j) = -j*3 - 6j*2 + 9j + 10. Let r be f(-7). Let w be 3/(-12) - 201/r. Calculate the common denominator of -53/2 and 255/w(-14)/(-12). 20 Calculate the lowest common multiple of 5 and (-4 + 2)/(-2)7. 35 Calculate the least common multiple of ((-3)/9)/((-1)/18) and 10. 30 Let a be 593/(-204) + (-2)/2. Let d = -434/51 + a. Find the common denominator of d and -3 - ((-183)/(-60) - 4). 60 Suppose 3y + 0y + 87 = 2d, -4d - 4y = -184. What is the least common multiple of 30 and d? 90 Let s = 20 + -6. Suppose -5p - 4a = -52, 19 = 5p - a - 43. Calculate the least common multiple of p and s. 84 Let a(n) = n*3 + 4n*2 + 5. Let u be a(-5). Suppose 0 = -0b - 4b + 112. Let d = u + b. What is the lowest common multiple of 7 and d? 56 Let k = 12281/11726 - 1/533. Find the common denominator of 15/22 and k. 22 Suppose -2d + 5d + 9 = 0. Let m be (-2 + 3)(-15)/d. Let y(g) = 2g. What is the lowest common multiple of y(m) and 8? 40 Let n(q) = 4q*2 + 0q*2 + 1 - 2q*2 + 1 - 4q. Calculate the lowest common multiple of 2 and n(2). 2 Let c(u) = u*2 + u - 8. What is the smallest common multiple of c(4) and 22? 132 Calculate the common denominator of -1 + 186/14 - 4 and -15/7. 7 Let d be (-9)/(-2) + 4/8. Let a = 8 - d. Suppose 0 = ah + 4v - 46, -8 = -h - 3v - 2v. What is the lowest common multiple of h and 4? 36 Let v = -4204/385 + 40/77. What is the common denominator of v and -41/13? 65 Let k(z) = z2 + 12z - 9. Calculate the smallest common multiple of k(-13) and 11. 44 Let a(p) = 8p2. Let m be (-11)/2 + 1/2. Let q(v) = v2 + 3v + 2. Calculate the lowest common multiple of q(m) and a(-1). 24 Let f = 9/238 - -5795/952. Find the common denominator of -95/14 and f. 56 Let v = 52 + 14. Calculate the lowest common multiple of 10 and v. 330 What is the common denominator of (-40)/3(-60)/(-75) and -29/18? 18 What is the smallest common multiple of 11 and 4/10 - (-69)/15? 55 Suppose -3u = d - 14, 2u + 3d = -0u + 7. Calculate the lowest common multiple of u and (-4 + (-28)/(-8))-2. 5 Let p = -24198/7 + 4517453/1302. Let f = -374/31 - p. Calculate the common denominator of f and -71/6. 6 Suppose 40o = 46o - 12. Let u = 8 - 2. Suppose l - u = -0. What is the lowest common multiple of l and o? 6 Suppose 3 = 3k - 33. Suppose -m + k = -0m. Find the common denominator of 32/7 and ((-2)/10)/(m/(-590)). 42 What is the smallest common multiple of 2/(-8) - ((-106)/8 - -4) and 3? 9 Let l(h) = -h + 9. Calculate the lowest common multiple of l(4	{ "pile_set_name": "DM Mathematics" }
j be f(-3). Suppose -4a - 2z + j = 0, -151 + 1 = -ba + 3z. Does 7 divide a? False Let z(r) = -r*2 - 13r - 10. Let v be z(-11). Let a be 0 + v/(6 + -2). Suppose 0 = ap - 54 - 45. Does 27 divide p? False Let q be (-15)/90 + (-50)/(-12). Is (-2)/q - (-1215)/30 a multiple of 9? False Let t be ((-2)/(-4))/((-8)/(-48)). Suppose -tu = -5u. Does 8 divide (-3)/(u + 6/(-46))? False Let n = 3697 + -826. Is 11 a factor of n? True Suppose -4m - 2m + 2838 = 0. Is 12 a factor of m? False Let h(a) = -a + 1. Let d be h(3). Let c(t) = t2 + 4t + 1. Let r be c(d). Let s(k) = -3k3 - 8k - 3. Is 34 a factor of s(r)? True Suppose -50 + 750 = 5u. Is u a multiple of 46? False Suppose -25i - 3476 = -10151. Does 49 divide i? False Let l be 33/55 + 46/(-10). Is (-386)/l(-1)/(2/(-4)) a multiple of 15? False Suppose -5z + 169 = 29. Is 28 a factor of z/6(-2 - -8)? True Let i = 1211 - 785. Is i a multiple of 53? False Let o = 482 + -227. Is 8 a factor of o? False Suppose -3a - 20 = -5r, -20 = -5r - 4a - 0a. Suppose -y - 6 = -ry. Is 82/6 - y/(-6) a multiple of 7? True Let z(n) = n - 25. Let m be z(15). Is (-1)/((-5)/m) - -36 a multiple of 17? True Let s(z) = -z2 + 26z - 5. Suppose 46 = 25d - 23d. Does 8 divide s(d)? True Let h be (-1)/(-3) - ((-304)/(-12) - -5). Let j = -7 - h. Is j a multiple of 3? False Let t(s) = -6s + 5. Suppose 0f - 2f - 2 = 2h, 26 = -5h + 2f. Is t(h) a multiple of 4? False Suppose -2b + 16 - 66 = 4k, -2k - 3b - 19 = 0. Let q be (8/(-6))/(k/273). Is 8 a factor of q + (-1)/(4/8)? True Let l(v) = -v*2 + 12v - 7. Let j be l(11). Let d be 4592/49 + 2/7. Suppose -36 = -2q - 3k + 7k, 3q - d = -jk. Is 26 a factor of q? True Suppose 0 = -7i + 24i - 510. Is i a multiple of 10? True Is (9/6)/(46/3404) a multiple of 4? False Let h = -40 + 26. Let r be 2/(-2)h/7. Suppose 72 = -0s + rs. Does 11 divide s? False Suppose -4m - 2d - 16 = 0, -2m + 4d - 19 + 1 = 0. Does 31 divide (6/(-10) - (-121)/(-5))m? True Let c be -1772/(-10) + (-4)/10. Does 12 divide (24/(-7))/((-5)/c)? True Let f(d) be the first derivative of -17/2d2 + 5 - 1/3d*3 - 19d. Is f(-15) a multiple of 11? True Let x = -82 - -674. Does 60 divide x? False Let x(v) be the second derivative of -v*5/20 - 11v4/12 - v3/3 - 3v2 + 6v. Let b be x(-10). Let s = b - -132. Is s a multiple of 23? True Is 10 a factor of (0 - 7 - -5) + 2 + 180? True Suppose -41o + 576 = -33o. Is 24 a factor of o? True Suppose 0 = -4h - 4c + 112, -5c + 66 = 2h - 2. Suppose 35 - 92 = -4s + k, 0 = -2s - 4k + h. Is s even? True Let i be (-10)/(-4) - (-11)/(-22). Suppose 0 = -5y + 2w + 3 + i, 0 = -y + 5w - 22. Suppose yf + f = 248. Does 12 divide f? False Let h(a) = -35a3 - a2. Let m be h(-1). Suppose 0 = 3d - m - 14. Let w = d - 0. Is 11 a factor of w? False Let k(b) = b3 + 4b*2 - 3b - 3. Let r(g) = g*2 + 12g + 7. Let d be r(-11). Is k(d) a multiple of 5? False Let z(m) = 6m2 + 4m + 4. Let n be z(-2). Suppose -c + 2c - n = 0. Is 2/(-8) - (-65)/c even? False Let w(o) = o + 1. Let m be w(-5). Suppose -192 = 18k - 498. Let b = k - m. Is 16 a factor of b? False Suppose -4i = 2w - 2, 2i = 5w - i - 44. Let d(a) = -9a + 0 + w + 12a + 10a + 2a*2. Is d(-7) a multiple of 3? False Let o = 634 - 187. Does 35 divide o? False Suppose -75n + 2592 = -69n. Is 24 a factor of n? True Let g(y) = y3 - 5y*2 - 6y + 9. Suppose 8q - 3q - 4d = -32, 2q - 3d + 17 = 0. Let i be (-56)/(-9) + q/18. Is 6 a factor of g(i)? False Suppose 2j + f + 18 = 0, -2j + f - 12 = 5f. Let l be ((-2)/5)/((-2)/j). Is l/(-15) + (-1164)/(-45) a multiple of 7? False Let a(p) = -2p3 - 32p*2 + 14p - 28. Is a(-17) a multiple of 13? True Suppose 4b - 2b = -w + 280, b = 4w - 1120. Suppose 9d = 2d + w. Is d a multiple of 2? True Suppose -5c = -8c. Let j be (65)/(6/28). Suppose c = -5l - 20 + j. Is l a multiple of 17? False Let y be 47 - 312/(-9). Suppose 0o + y = o. Is o a multiple of 15? False Let v = 80 + -75. Let w(l) = -l2 + 14l + 12. Is w(v) a multiple of 13? False Let f = -530 - -839. Does 10 divide f? False Let c be 9/68/3. Suppose -cq = 1 - 5. Suppose -3r + 11 = -q. Is 4 a factor of r? True Suppose -5 = -f + 4d - 2d, -3d = 3f - 33. Suppose fi - 260 = 7i. Is i a multiple of 23? False Let j(r) = -r3 - 12r*2 - 25r + 29. Does 15 divide j(-12)? False Let i(r) = -13r + 12. Let g = -11 - -6. Let j be i(g). Suppose -3a + 0a - 2p = -j, -a + 23 = -2p. Does 21 divide a? False Suppose 2h - 2q - 1006 = 0, 4h - q - 2q = 2010. Does 70 divide h? False Let w = 21 + 42. Let p(h) = 0h + w + h*2 + 0h. Does 23 divide p(0)? False Does 26 divide (7/2 + 4)(1 + 3)? False Let q = -2495 + 6110. Is 15 a factor of q? True Let d(r) = -10r + 2. Let k be d(-3). Suppose -p - 4m = p + 26, -4m = 4p + k. Is 15 a factor of (-2 - 50-1) + p? True Let d(i) = 13i2 + 20i - 173. Is 43 a factor of d(6)? False Let d(k) = 3k - 56. Let h be d(17). Let t(u) = -u3 - 2u*2 + 5u - 4. Is t(h) a multiple of 7? False Is 13 a factor of 247/((-12)/((-96)/2))? True Let x = -220 + 640. Is x a multiple of 9? False Let l(y) = 3y + 28. Suppose m = -4s + s - 6, -4m = -4s + 24. Is 10 a factor of l(m)? True Let c(y) = 35y2 - 5y + 6. Let d be c(2). Suppose -2x + d = 86. Does 5 divide x? True Suppose -4o - 278 = -5t - 2051, 0 = -3t - 3. Suppose 5v - 218 = o. Is 7 a factor of v? False Let y(c) = 10c*2 + 5c - 67. Let g(k) = -3k2 - 2k + 22. Let u(x) = 7g(x) + 2y(x). Is 8 a factor of u(-6)? True Let b be 4/(-12)-3 + -73. Is (129/(-4))/(27/b) a multiple of 13? False Let s = -1758 + 1818. Does 42 divide s? False Let n be ((-6)/(-15))/(1/5) + 352. Suppose -5y = -2y - n. Is y a multiple of 19? False Let n(i) = -3i + 11. Let o be n(-23). Suppose -y = -o + 28. Is 4 a factor of y? True Let j be (24/(-8))/(0 - -1). Suppose 0m - 5m = 20. Is ((-174)/m)/j-2 a multiple of 10? False Let y(c) be the third derivative of -c4/24 - c3 + 3c*2. Let k be (8 - 7)/((-1)/13). Is y(k) a multiple of 2? False Let s(n) = n - 5. Let q be s(10). Suppose 5g + 2 = -2c, 0c + q = -5g - 5c. Suppose 4f + 18 - 122 = g. Is 13 a factor of f? True Let m(f) = -7f + 7. Let v(j) = 20j - 21. Let g(x) = 11m(x) + 4v(x). Let p be g(4). Suppose 5z = -5k + 135, -46 = -4k - pz + 62. Is 9 a factor of k? True Suppose 52i = 54i - 14. Let q(k) be the third derivative of -k6/120 + k5/10 + 3k*4/8 - 7k3/6 - k2. Is 2 a factor of q(i)? False Let b(h) = 15h2 - 11h + 7. Let j(a) = -8a2 + 6a - 4. Let o(t) = 6b(t) + 11j(t). Let n = 13 + -17. Is o(n) a multiple of 15? True Suppose 37r = 6101 + 25941. Is r a multiple of 7? False Let a be (1 - 3)1365/(-6). Suppose -h = 4h - a. Does 17 divide h? False Suppose 5c + 2u = -386, 229 = -5c - 4u - 153. Let l = -38 - c. Is l a multiple of 9? False Is 19 a factor of -1724(-3 + (-26)/(-13))? False Let x = -690 - -822. Is x a multiple of 33? True Suppose 4u - 3n = -14, 5n + 4 = 3n. Does 15 divide (-6)/(-10) - u/((-50)/(-1044))? True Suppose -158u = -166u + 11312. Is u a multiple of 73? False Let g be (10/(-4))/((-105)/84). Let r(w) = -23w + 54w - w*g - 10w - 8. Does 17 divide r(16)? False Suppose 0x = -5x + 75. Suppose -2k = 11k + 13. Does 12 divide x + -1 - (k + 3)? True Suppose -5k - 2 = -22, 624 = 5y - 4k. Let d = y - 100. Is d a multiple of 3? False Suppose 2s + 9 - 1 = 0, 0 = o + 2s - 1. Suppose og + 17 = 8g. Let q = 59 - g. Is q a multiple of 19? True Let o(w) be the second derivative of w4/3 - w3/3 - w2 + 3w. Let x be o(-2). Let l = x + 18. Is l a multiple of 9? True Suppose 4f - 13r - 302 = -15r, -3r - 15 = 0. Is 3 a factor of f? True Let i(x) = 53x2 + 3x - 2. Is 27 a factor of i(2)? True Suppose -r - 2 = -2r, -26 = 2w - r. Let d(i) = -i*3 + 5i*2 - 8i + 10. Let z be d(4). Is (z/1)/(2/w) a multiple of 9? True Suppose 198 = 16m - 19m. Let d = -40 - m. Suppose -d = -7b + 156. Is b a multiple of 13? True Let k = 1042 - 723. Let t = k + -190. Suppose 0 = 3n - j - t, -4n + 215 = n - 4j. Does 14 divide n? False Let k be (-24)/(-5) + 5/25. Suppose -3d - 4q + 2q = 16, kd - 5*q + 60 = 0. Let w = d + 39. Does 11 divide w? False Let f = -926 - -614. Let n = 200 + f	{ "pile_set_name": "DM Mathematics" }
+ 1. Give g(h). 8 Let v(p) be the second derivative of -p*3/6 + 3p*2 - 7p. Calculate v(6). 0 Suppose -21 = -0m - 4m - 3k, 0 = 3m - 3k. Let a(r) = r2 - 4r*2 - 5 + 5r - 8r + rm. Let n be a(4). Let h(z) = 4z3 - z2 - z - 1. Determine h(n). -5 Suppose 0 = 4d - 0t - t + 11, 2t = -d - 5. Let j(c) = 3c - 3. Give j(d). -12 Let o(h) = -10 + 4 - 104h + 105h. What is o(9)? 3 Let r(p) = -2p + 4p + 0p - p + 11. Calculate r(-5). 6 Let y be (4 - 4 - 2) + 3 + -5. Let t(z) = 2z + 2. What is t(y)? -6 Let m(o) = -o*3 - 4o*2 + 2. Let h = -57 - -87. Suppose 5g - 5p = -h, -2g + 27 - 11 = 5p. Let v = -5 - g. Determine m(v). -7 Let k(j) = 6j + 13. Let b(v) = -3v - 7. Let m(s) = -7b(s) - 3k(s). Determine m(-7). -11 Suppose -4z - 12 + 0 = 0. Let t(r) = 5r3 + 2r*2 - 3. Let d(y) = -6y*3 - 3y*2 - y + 4. Let n(g) = zt(g) - 2d(g). Determine n(-1). 2 Let k(p) = -p2 + p + 3. Let v = 5 + -2. Suppose -vo = -5x + 2o + 35, 5x + 5 = -5o. Determine k(x). -3 Suppose -7o = -3o - 4. Let k(g) be the third derivative of 0 + 0g + 0g*5 + 1/120g*6 + 0g*4 - 2g*2 - 1/6g3. What is k(o)? 0 Let t(w) = 5 - 4 - 6 + w. Give t(0). -5 Let j(g) = g3 + 6g2 - g - 5. Let c = 32 - 10. Suppose -5a = c + 8. Determine j(a). 1 Let u(m) be the first derivative of -m*3/3 + 2m + 9. Calculate u(-3). -7 Let z(t) = -t*2 + 5. Suppose -4r = -0r + 2r. Calculate z(r). 5 Let l(g) = g - 10. Let z be l(8). Let f(p) = p*3 + 4p*2 + 2p - 2. Give f(z). 2 Let p(i) = i3 + i2 - i + 13. Let j = 40 + -40. What is p(j)? 13 Let p(t) = 2t + 3. Let r(n) = -n - 1. Let x(s) = p(s) + 4r(s). Determine x(-3). 5 Suppose -23t + 3 = 95. Let c(z) be the third derivative of -z6/120 - z5/15 + z4/24 - 5z3/6 + z2. What is c(t)? -9 Let o be (27/36)/((-3)/(-2)). Let u(i) be the second derivative of -i + oi2 + 0 + 1/6i*3. What is u(-4)? -3 Suppose 3h - 14 + 4 = -2x, -x + 5 = 4h. Let i(d) = -d - 5. Determine i(x). -10 Suppose 2z = -3n + 3, -3z - 5 = -7n + 2n. Let y(u) = 7 - u2 + 0u + zu - 9 - 4u. What is y(-4)? -2 Let u(a) = a3 + a2 - 2a + 1. Let m(i) = 4i - 3i + i2 - 4i - 3. Let k be m(4). Suppose f = -0 + k. Give u(f). 1 Let j(d) = d*3 + 5d*2 - 5d - 3. Let c be j(-6). Let u = 15 + c. Let q(m) be the second derivative of m4/12 - m3 - m*2 + 2m. What is q(u)? -2 Suppose 4y - 9 = -3f, -3f + 19 = -y - 8f. Let w be y1/8-4. Let z(i) = -i*3 - 5i*2 - 2i + 3. Determine z(w). -9 Suppose 5s + 2 = 12. Suppose 2 = -sl - 4. Let i(g) = -g*2 - 2g. Let m be i(l). Let r(v) = -v*2 - 2v + 3. What is r(m)? 0 Let n be (-80)/(-30)(-3)/(-2). Let z = 27 + -7. Suppose -ni - z = i. Let j(h) = h*3 + 5h*2 + 3h - 2. Calculate j(i). 2 Let b(d) be the first derivative of -5d2/2 + 3d - 3. Let t(a) = -26a + 16. Let s(m) = -16b(m) + 3t(m). Calculate s(3). 6 Suppose 36 = 6w - 9w. Let x = w + 12. Let p(s) = s3 + s - 6. Give p(x). -6 Let u be (0 - -2)/(2/2). Let v(h) = -5h - h*2 + uh + 0 + 4 + 0h2. Determine v(-4). 0 Let o(r) = 7r*2 + 10r + 5. Let l(i) = i*2 + i + 1. Let h(y) = -6l(y) + o(y). Let z = 6 + -6. Suppose -2g + zg - 6 = 0. Determine h(g). -4 Let w(h) = -5h + 8h - 9 + 6. Calculate w(3). 6 Let z be (-3)/(-4) + (-6)/8. Let c(i) = -i + 4. Determine c(z). 4 Let v(y) = -3y2 - 1 + 7 - y + y3 - 5. Determine v(3). -2 Let o = 9 - 12. Let u(b) = b2 - b. Determine u(o). 12 Let k(c) = -4c - 6. Let y = 6 + -10. What is k(y)? 10 Let z(r) = 2r2 + 3r + 3. Let a(p) = -7p2 - 8p - 8. Let h = 4 - 15. Let b(d) = hz(d) - 4a(d). Give b(-1). 6 Let l(j) = j - 3 - 1 + 1. Let a = 95 - 90. Calculate l(a). 2 Suppose -2b + 5b = 12. Let r(c) = c. Determine r(b). 4 Let t(z) = z*3 - 2z2 - z - 4. Let h(r) = -r3 - 5r2 - 5r - 1. Let a be h(-4). Give t(a). 2 Let f(s) = s*3 + 6s*2 + 3s - 6. Let a(i) be the third derivative of -i6/120 + i5/5 - 5i4/12 - 8i*3/3 + 3i*2. Let w be a(11). Give f(w). 4 Let a(c) = c - 2. Let x = 3 - 0. Suppose xq + 2q = 0. Suppose -5z + 19 + 6 = q. Calculate a(z). 3 Let t(h) be the second derivative of -1/6h3 + 1/24h*4 + 0 + 3h - 1/60h5 + 3/2h*2. Let z(x) be the first derivative of t(x). What is z(2)? -3 Suppose -6 = -4r - 2u, 30 = 5r + u - 3u. Let n(o) = 2o - ro - 1 + o + 6o3. Calculate n(-1). -6 Let p(k) = k3 + 6k2 + k + 1. Suppose -y = -4y - 18. Determine p(y). -5 Let b(m) be the second derivative of -m*3/6 + 5m*2/2 + m. Let i(f) = -7f + 1. Let q be i(1). Let a = -2 - q. Calculate b(a). 1 Let r(p) = p*2 + 3. Let u(l) = 2l*2 + 4. Let g(h) = -5r(h) + 4u(h). Determine g(1). 4 Suppose -2w = -2f + 10, 5f - 23 = f + 5w. Let r(b) = 0 - fb - 3 + 1. Determine r(-5). 8 Let o(x) = -x + 1. Let w(n) = n - 9. Let c(f) = -2o(f) - w(f). Let l be c(-3). Let v(m) = 3m + m*2 - 5m - 5 - m*3 + lm*2. Determine v(4). 3 Let u(w) be the second derivative of 0 - 2w + 1/2w2 - 1/6w*3. Let s be (3 - (1 - -1)) + -6. Give u(s). 6 Let l be 11/30. Let w(u) = -4u*2 + lu - 4u2 - 1 - u. Determine w(-1). -8 Let a(c) = 3c*2 - 3c - 2. Let m be 1 - 2/3-3. Let k(j) = mj - 2j + 0 + 1 + j2. Let z(y) = a(y) - 2k(y). What is z(5)? -4 Let q(l) = -13l2 + 32l + 32. Let p(j) = 5j2 - 11j - 11. Let o(w) = 8p(w) + 3q(w). What is o(-6)? -4 Let x(m) = 2m3 - 1. Suppose 4b - 7 = -5i, -3i + 4b - 2b = 9. What is x(i)? -3 Let n be (1/1)/((-6)/(-30)). Suppose -1 + 5 = 2y. Let x(q) = q2 + nq*2 + 0q*y. Calculate x(1). 6 Let j be -1 - (1 + -4 + -3). Let y(p) = -4 + jp - p + 2p - 4p. Calculate y(5). 6 Let w(t) be the first derivative of 7t2/2 - t + 64. Give w(-1). -8 Let q(b) = b3 - 3b*2 - 5b + 5. Let i be -211 - -9. Let d = i - 3. Determine q(d). 1 Suppose -d + 4d = -3. Let m be d/(23/30). Let h(a) be the second derivative of a*5/20 + 5a*4/12 + 3a*2/2 + 2a. Determine h(m). 3 Let g(x) be the second derivative of -x4/12 + x3 + 9x. Determine g(5). 5 Let a(s) be the third derivative of -s4/12 + 2s*3/3 + 4s*2. Determine a(7). -10 Let y be (-44)/(-10) - 2/5. Suppose -k - x + 8 = 0, 0 = 4k - 2x - 2 - 12. Let n(i) = i + 3 + k - 5. What is n(y)? 7 Let n(u) = 5u. Let a(h) be the second derivative of -h4/12 + h3/2 + 3h2/2 + 2h. Let p be a(4). Determine n(p). -5 Let x(c) = c + 3. Let p(l) = 5l + 8. Let q(i) = -i + 1. Let z(f) = p(f) + 4q(f). Let s be z(-7). Let j be 3/(-15)-4s. Calculate x(j). 7 Let b(j) = -j - 1. Let s be -53/(4 + -1). Let g(a) = a + 7. Let m be g(s). Let h be b(m). Let i(q) = -3q - 2. Calculate i(h). 7 Suppose 3h = -3a + 24, a = 5h - 16 - 54. Let t(r) = hr*2 - r + 3r - 3r2 - 4r + 1. What is t(1)? 9 Let a(m) = m*2 - 2m - 2. Let z(c) = c*2 - 3c - 6. Let d be z(5). Calculate a(d). 6 Suppose -2a + 8 = -2. Suppose 0 = -ab - 5. Let h(j) be the second derivative of 3j3/2 + 3j. Give h(b). -9 Let u(r) = -r - 2. Suppose f = -5g - 2f + 25, -2g = 5f + 9. Give u(g). -10 Let w(g) = -g*2 - 2g - 2. Let b be (-1)/((4 + -3)/2). Determine w(b). -2 Let t(g) = g*2 - 8g + 10. Let w be t(7). Suppose -5p = -7p. Suppose -3f - wl + 0 + 9 = p, 3f + 4l = 11. Let j(k) = 4k3 + k2. Determine j(f). 5 Let b(o) = -20o*2 + 3o + 3 + 50o2 - 28o2 + o3. Calculate b(-3). -15 Let a(o) = 3o2 + o - 1. Let g(n) = 2n + 4. Let x be g(-3). Calculate a(x). 9 Let d(t) be the first derivative of -3t2/2 + 5. Give d(-5). 15 Suppose 6o + 24 = 2o. Let k = -12 - o. Let m(z) = -z3 - 6z*2 - 2. Determine m(k). -2 Let y(b) = -5b + 9. Let i(k) = 12k - 17. Let a(w) = 2i(w) + 5y(w). Calculate a(8). 3 Let w(u) = -6 + 10u - 16u + 0u2 + u2. What is w(7)? 1 Let b(t) be the second derivative of -t*5/20 - 2t*4/3 - 5t*3/6 + 5t*2 - 19t. Calculate b(-7). -4 Suppose -3p + 2p + 8 = 4f, 5p = -20. Let t(c) = c - 6. Give t(f). -3 Let o be (6/8)/((-11)/(-44)). Let n(c) = -c*3 + 3c*2 + 1. Calculate n(o). 1 Let t = -11 - -15. Suppose -f + tf = 0. Let x(c) = -5 + 5c2 - 2c*2 - 2c*2. Give x(f). -5 Let v(q) = -3q + 3. Suppose 0p + 28 = 4p. Suppose -3l = -pl - 16. Let h(r) = r*3 + 5r*2 + 2r - 4. Let s be h(l). Calculate v(s). -9 Let l be (6/2)/33. Let u(h) = 3h - 2h + l + 2. Suppose 0 = -2o - 4 - 4. What is u(o)? 1 Let q(l) be the	{ "pile_set_name": "DM Mathematics" }
6 = 0, w - 1 = 2s + 9. Suppose i + 0 = 5n - 11, 2n + 2i - w = 0. What is the highest common divisor of n and 18? 2 Let v(u) = 13u2 + 2u - 4. Let y be v(3). Let n = 37 - 56. Let d = -2 - n. Calculate the greatest common factor of d and y. 17 Let b(j) = -6j3 - 2j*2 + 2j + 3. Let r be b(-2). Suppose -4m = -5 - r. Let h = 402 + -281. What is the highest common divisor of h and m? 11 Let g = 11 - 6. Suppose gk - 62 - 23 = 0. What is the highest common factor of k and 119? 17 Let q = -8 - -9. Calculate the greatest common divisor of 11 and q. 1 Let b be 3 + (2 - 0/(-4)). Suppose 2z = -l + 10, l + 2z - 10 = 5z. Calculate the greatest common factor of b and l. 5 Let b(y) = y2 + 5y - 8. Let v be b(-7). Let j(f) = 11f. Let n be j(v). What is the greatest common divisor of 6 and n? 6 Let t be (1 - 2)/((-2)/26). Let q = -9 + 22. Calculate the greatest common divisor of q and t. 13 Let b be 148/(-52) - (-4)/(-26). Let y be 1/b - (-14)/6. Let h be 1/(-3)y-6. Calculate the highest common divisor of h and 8. 4 Let r = 60 - 33. Let o(d) = d2 - 6d + 2. Let a be o(8). Calculate the highest common divisor of r and a. 9 Let y be ((-12)/(-9))/((-2)/(-195)). Let j = 274 - y. Calculate the greatest common divisor of 16 and j. 16 Let r be (0 - 3/3)-4. Suppose -45 = -5m + 5g, m + 0 = 2g + r. Suppose -l + 2q = -4l + 19, -2l - 5q = -9. Calculate the highest common factor of l and m. 7 Let q(f) = -f*3 + 6f*2 + 5f - 2. Suppose -3x + 5 = -4x. Let r be q(x). What is the greatest common factor of r and 31? 31 Suppose 1 = -u + y, -u + 3y = 3u + 1. What is the greatest common factor of 10 and u? 2 Suppose 0 = -d + 5b + 10 + 35, 2d = 4b + 120. Calculate the greatest common divisor of d and 10. 10 Suppose 3n - 3r + 13 = r, -14 = -2n - 3r. Suppose -2z - 3z + 35 = 0. What is the highest common divisor of n and z? 1 Suppose 2y = -3a + 89 + 317, -545 = -4a + y. What is the highest common divisor of a and 34? 34 Let x be (0 + -80)-11. Calculate the greatest common divisor of x and 10. 10 Let r be -3-34/18. Suppose -rb = -5b + 147. What is the highest common divisor of b and 7? 7 Let c = 0 - -18. Suppose m = -2b + 66 + c, 0 = -3m + 5b + 274. Let s(f) = -f2 + 8f + 31. Let i be s(10). What is the highest common factor of i and m? 11 Let s be 1/214-42. Let a be ((-30)/(-35))/((-1)/s). Suppose 987 = 5z + a. Calculate the highest common factor of z and 21. 21 Let r(b) = 9b - 12. Let s be r(2). What is the highest common factor of s and 2? 2 Suppose 3f + 10 + 8 = 0. Let l = -6 - f. Let z be -2 - -1 - (l + -3). What is the highest common factor of 6 and z? 2 Let y = -36 + 53. Suppose 21 = -2s + 123. What is the highest common factor of s and y? 17 Suppose -i + 2w + 305 = 0, -w = i - 0w - 293. What is the highest common divisor of i and 33? 33 Suppose -16n + 21n = 20. Suppose 0 = 3q + 2d + 1 - 19, 0 = -5q - nd + 32. Calculate the greatest common divisor of 32 and q. 4 Suppose 60 = 2d + d. Let r(j) = 4j*2 + j. Let c(a) = -a + 6. Let n be c(5). Let z be r(n). Calculate the greatest common factor of z and d. 5 Let d = -20 + 29. Suppose -z + 3g + 12 + d = 0, -g = 5. Calculate the highest common divisor of 6 and z. 6 Let f(d) = -20d3 + d - 1. Let b be f(1). Let x = -9 - b. Suppose 2i = 2m + 123 - 363, 2m - i = 241. Calculate the highest common factor of m and x. 11 Suppose l + 22 = 3r, 5r + 2l = -0r + 33. Calculate the highest common divisor of 56 and r. 7 Let k = 11 - 3. Let f = 6 - -2. What is the highest common factor of k and f? 8 Let a(b) = 3b + 11. Let k be a(-8). Let u = 9 - k. Calculate the highest common divisor of u and 132. 22 Let w(m) = 3m*2 + 10m - 4. Let u be w(-8). Calculate the highest common divisor of 12 and u. 12 Suppose -4 = s, -3b - 4s - 6 = 1. Suppose bv + 5m = 20, 0 = 4v + m + 2m - 23. What is the greatest common factor of 25 and v? 5 Suppose 0 = -w + 4t - 13, -3w + 7w = 5t - 8. What is the greatest common divisor of w and 2? 1 Let a(y) = y*3 - 6y*2 + 13y - 8. Let d be a(8). Calculate the highest common factor of d and 32. 32 Let m(a) = -a*3 - 8a*2 + 7a - 6. Let r be m(-9). What is the greatest common divisor of r and 132? 12 Let y(s) = s + 6. Let b be y(-4). Suppose bm - 32 = 4p, m = -2m - 4p + 78. What is the highest common divisor of 220 and m? 22 Let u(h) = h*2 + 4h - 9. Let m be u(6). Suppose 4k + 34 = 5k. What is the greatest common divisor of m and k? 17 Let z(x) = -x + 8. Let q be z(0). Suppose 10w - 20 = 5w. Suppose -2m + 19 = 3m - n, wn = -m + 8. What is the highest common divisor of q and m? 4 Suppose -2d + v = -0d - 5, 5d + 4v = 32. Let f(c) = c3 - 4c*2 - 5c + 6. Let o be f(5). Calculate the greatest common divisor of o and d. 2 Let l be 0/1 - -2 - 2. Suppose l = -0z - 5z + 60. Let i be 453/z. Calculate the highest common divisor of 5 and i. 5 Let j be (8/(-7))/(4/(-14)). Suppose -b = -j - 4. What is the greatest common factor of b and 2? 2 Suppose 0a + a = 0. Suppose at + 13 = t. Calculate the highest common factor of t and 117. 13 Let d be 5/(-1 + (-46)/(-44)). Let p be (-60)/(-8) + 6/(-4). Suppose -26 + p = -2q. What is the highest common factor of q and d? 10 Let g = -24 - -48. What is the highest common divisor of 3 and g? 3 Let v be (-1 - -1) + 1/1. Let m(y) = -y2 + 2y + 5. Let x be m(4). Let b = 10 + x. Calculate the highest common factor of b and v. 1 Let d(q) = 2q + 25. Let c be d(-10). Calculate the highest common factor of c and 55. 5 Suppose 0o + 12 = -3o, 3s - 30 = -3o. What is the highest common divisor of 2 and s? 2 Let s = -7 + 23. Suppose 20 = l + 12. Calculate the highest common divisor of l and s. 8 Let y = 26 + -4. What is the highest common factor of y and 66? 22 Suppose -2q = 3q + 25, q = -4s + 7. Suppose -4u - 2 = 2p, -3 = 4u + 5. Let y be (p - -14) + 12/3. What is the greatest common factor of y and s? 3 Suppose -k - 10 = -30. Let j(s) = -29s + 2. Let t be j(-2). What is the greatest common factor of k and t? 20 Suppose 4z = -5k + 30, -k - 3 = 2z - 3z. Calculate the highest common divisor of 2 and k. 2 Let j be -12(84/(-9))/7. What is the highest common divisor of j and 96? 16 Suppose 27 + 153 = 5u. Let n be 164/3 + (-12)/18. Calculate the highest common factor of u and n. 18 Let s(y) = -9y - 10. Let r = -16 + 11. Let w(o) = -5o - 5. Let v(a) = rw(a) + 3s(a). Let i be v(-7). Calculate the highest common divisor of i and 63. 9 Let d = 5 - 2. Suppose -9 - d = -4g. Calculate the highest common factor of 24 and g. 3 Let m = 4 + -1. Suppose 3d - m = 21. Let i = -9 + 17. What is the greatest common divisor of i and d? 8 Let o be (2/(-3))/(5/(-195)). What is the greatest common divisor of o and 143? 13 Let n = -29 - -73. Calculate the greatest common divisor of 11 and n. 11 Suppose -16z + 240 = -11z. Suppose 4v + j = 65, -v = 2v - 5j - 43. Calculate the greatest common factor of v and z. 16 Let n = 26 - 14. Calculate the greatest common factor of n and 4. 4 Suppose 3p = 2p - 3k + 16, k - 5 = 0. Let c = -5 - p. Let a be (-4)/c - (-312)/18. What is the greatest common factor of 144 and a? 18 Let q = -6 - -10. Let n = -5 + 7. Suppose -h - nu = 0, 2h - 38 + 6 = 4u. What is the greatest common factor of h and q? 4 Let t be (3/2)/((-2)/(-4)). Suppose 2f = 4b - 12, tb = -b - f. Calculate the highest common factor of 9 and b. 1 Let g be (36/(-30))/(2/(-60)). What is the highest common factor of 9 and g? 9 Let c be 0 - 2 - 54/(-4 + 2). Calculate the greatest common factor of 10 and c. 5 Suppose m + 2 = 4t - 4, -5m - 8 = 2t. Let l be (-2 + t)/(3/(-15)). Let n be 16/6 - (-8)/(-12). Calculate the highest common factor of n and l. 1 Let t(p) = p3 + 11p*2 - 17p + 10. Let q be t(-12). Calculate the highest common divisor of 10 and q. 10 Suppose 3p = -2 + 32. Suppose 0 = -3i - i + 8. Suppose 0 = if - 2 - 138. What is the highest common divisor of p and f? 10 Let q(v) = -v3 + 6v*2 - v - 4. Let g be q(3). Suppose -6o + o - g = 0. Let d = 7 + o. What is the highest common factor of d and 12? 3 Let h(l) = -l*2 - 6l + 8. Let v be h(-8). Let p = 8 - v. Suppose 3g + 96 = 7g. What is the highest common factor of p and g? 8 Let b be (-1*1)/(1/(-5)). Let r(d) = 2	{ "pile_set_name": "DM Mathematics" }
= -80 + 77. Let h(x) = qb(x) - 2d(x). Determine h(-2). 0 Let r(m) = -4m - 1. Let u(x) = 10x + 9. Let n(z) = 3r(z) + u(z). Give n(-8). 22 Let k(u) = -u2 - 7u - 8. Let a = -1592 - -1582. Calculate k(a). -38 Let h(c) = c*3 + 18c*2 + 16c - 14. Let q be h(-17). Let m be -2 + (q - (-3 - 0)). Let p(b) = -b*3 + 4b*2 - 2b + 5. Calculate p(m). -3 Let z(d) be the first derivative of d*4/4 + 5d*3/3 + 4d*2 + 5d + 85. Calculate z(-5). -35 Let d(s) = 1. Let p(x) be the second derivative of x*3/6 + 7x*2/2 + 26x. Let w(g) = -5d(g) - p(g). Determine w(-11). -1 Let c(x) = 26 - 55 - 6x + 14 + 12. Let m be (5 - 3)5/(-2). Calculate c(m). 27 Let r(j) = j3 - 6j*2 + 6j - 7. Suppose 4 = 2l - 2. Suppose 5o - 66 = lf + 26, 116 = -5f - o. Let u be (-16)/f - 26/(-6). Calculate r(u). -2 Let j(c) = -15c + 6. Let t(k) = -3k + 1. Let q(g) = j(g) - 4t(g). Give q(2). -4 Let i(r) be the third derivative of -r4/24 + 4r*2 + 22r. Determine i(10). -10 Let o(f) = f*2 - 6f - 9. Let v(i) = -1. Let t(d) = o(d) - 3v(d). Let p = -472 - -242. Let u = p + 236. What is t(u)? -6 Let r(h) = -h3 - 7h*2 + 14h - 33. Let y be r(-9). Let k(n) = n*3 - 4n*2 + 5n - 4. Calculate k(y). 2 Suppose 0 = 3j - d - 0d - 10, 5j = -4d + 45. Let s(l) be the second derivative of -5/12l4 + 2l + 1/20l5 + 0 + 3l*2 - 1/2l*3. What is s(j)? -9 Let w(d) = 16d*3 - 1. Let l(u) = 5u - 3. Let z be l(1). Suppose -2 = -3c + 4c + 3y, -z = -c + y. What is w(c)? 15 Let x be (-48)/(-18) + 1/3 + 1. Let y(g) be the second derivative of -g4/12 + g3/3 - g2/2 + 9g. Calculate y(x). -9 Let t(s) = -s*3 + 3s*2 + s - 2. Suppose 5m - 11 = w - 1, -4m + 3w - 3 = 0. Suppose -mj = -5p - 0p + 5, p - 4j = -16. Give t(p). -14 Let p = -11 - -7. Let b(a) = -7a3 - 15a*2 - 14a - 7. Let m(t) = -11t3 - 23t*2 - 21t - 10. Let y(o) = 8b(o) - 5m(o). Give y(p). 6 Let k be -3 + (4 - 14/2). Let m be (3 + 1)/(12/k). Let c(w) = 2w3 + 2w*2 + 1. Give c(m). -7 Let b be 2/(-2)60/20. Let g(k) = -k*2 - 4k - 3. Give g(b). 0 Let z(a) = 7a + 7. Let y(g) = -6g - 5. Let f(r) = 5y(r) + 4z(r). Let v(i) = 2i - 2. Let t be v(3). What is f(t)? -5 Let z be 16/(-10) - (-6)/(-15). Let w(p) = 1 + 1 - 3589p*2 + 3592p2. What is w(z)? 14 Let u(k) be the second derivative of k7/2520 + 7k6/720 - k5/10 + 7k*4/3 + 18k. Let f(j) be the third derivative of u(j). Calculate f(-9). 6 Let q be (-765)/7 + 2/(-21)-3. Let x = q + 113. Let l(r) = -2r + 2. Determine l(x). -6 Let o(l) = l - 1. Let p(h) = -7h3 + 2h*2 - h. Let v be p(1). Let q(g) = 7g - 6. Let a(n) = vo(n) + q(n). Determine a(0). 0 Let o(y) = y + 5. Let n be o(-5). Let c be -7 + 4 + n + 5. Let k(m) = -m + 5m*3 - 2m*c + 6m*2 - 5m2. Calculate k(-1). -5 Let f(d) = -d2 + 2d - 3. Let y(k) = 4k*2 - 3k + 2. Let b be y(1). Suppose -22q + 21q = -b. Suppose -q = -t - 0. Determine f(t). -6 Let i be 4/6 + (-2)/3. Let f(v) be the second derivative of v5/20 - v3/6 + 113v - 6. Give f(i). 0 Let h(x) = -x3 - 15x*2 + 16x + 1. Suppose 4u + 5j + 54 = 0, 5j = 5u + 43 + 47. Give h(u). 1 Suppose 3d - 2d = 0. Let w(s) be the first derivative of 5 + 11s - 1/2s*2 + 0s*3 - 1/4s*4. What is w(d)? 11 Let a(y) = 6y - 94 - 90 + 271 + 2y - 86. What is a(-2)? -15 Let u(n) = -n3 + 1. Let g be u(0). Suppose 5c - 21005 = 5i, -3i = 4c - 6c + 8407. Let z(q) = 4196 - c - 8q. Calculate z(g). -8 Let d(o) = -9o*3 + 2o + o2 + 3 - 2 + o2. Let a(u) = -u*2 - 10u - 6. Let l be a(-9). Let w be (1/2)/(l/(30/(-5))). Give d(w). 10 Let r(o) = -3 + 3 - 2 - 2 + 22o + 5. Determine r(1). 23 Let z(h) be the second derivative of h5/20 + 5h*4/12 - 2h*2 - 104h. Give z(-4). 12 Let l(c) be the third derivative of -c*4/6 + 14c3/3 + c2 + 4. What is l(12)? -20 Suppose -6 = j - 0b - 4b, 6 = -j + b. Let s(n) = n*2 + 6n + 8. Determine s(j). 8 Suppose h - w = 17, -17w = -2h - 20w - 1. Let c(m) = -2m*2 + 18m + 1. Let n(o) = o*2 - 9o. Let p(y) = 4c(y) + 7n(y). Give p(h). -6 Let m(y) = 4y + 11. Let b(z) = 6z + 20. Let i(f) = 3b(f) - 5m(f). Calculate i(0). 5 Suppose 3g = -2y + 5, g = 4y - 2g + 35. Let t(c) = -2c - 3. Let a(b) = 3b + 5. Let r(d) = yt(d) - 3a(d). What is r(8)? 8 Let p = 371 + -377. Let k(b) = -b - 3. Calculate k(p). 3 Suppose 1 = 2q - 3q. Let z be (-14 - -17) + q/(-1). Let h(r) = 5r3 - 5r + 2. Let t(x) = -4x3 - x2 + 5x - 1. Let k(s) = -5h(s) - 6t(s). Give k(z). 8 Suppose -q + 6 = -g, -2q - g - 22 = -7q. Let h(a) = 7a - q + 3 - 3 + 3. What is h(1)? 6 Let l(y) be the third derivative of -5y4/24 - y3/6 - y*2. Let o(i) = 2i*2 + 0 - 10 - 10i - i*2. Let f be o(11). Give l(f). -6 Let u be (-3)/(-1) - (-15 - -11). Suppose 30 + 5 = -ud. Let b(i) = i - 2. What is b(d)? -7 Let r(s) be the first derivative of -s3/3 - s2 + s - 195. Determine r(2). -7 Let c be (2 + 2)/(-4) - -1. Suppose cb = -4b - p + 12, -2p + 6 = 2b. Let d(j) = b - 3 + j + 2. Give d(0). 2 Let f = -264 + 255. Let q(z) = -z*3 - 11z*2 - 17z + 7. Calculate q(f). -2 Let c(j) = 3j. Let q(n) = n2 + 7n + 9. Let z be q(-6). Let k(y) = y2 - 7. Let o be k(z). Determine c(o). 6 Let l(q) = q2 + 4q + 4. Let o be l(0). Let s(x) = ox - 8x + 4x + 3x - 7. Determine s(6). 11 Suppose 2t - 20 = 3k - 6, -32 = 4k + 4t. Let z(s) = -s2 - 12s - 4. Calculate z(k). 32 Let q(a) = -a*2 + 2a + 2. Suppose 3l = -2b + 38, 2l - 50 = -l + 4b. Let r be (9 - 7)l/(-4). Let z = -3 - r. Calculate q(z). -6 Let a(w) = -w3 + 4w*2 - 3. Suppose 66 - 738 = 14d. Let h = 52 + d. What is a(h)? -3 Suppose 30 = 8m - 3m. Let d(t) = 2 + 2t2 + 1854t - 1849t - 3t2 + 1. What is d(m)? -3 Let c(n) be the third derivative of -n8/6720 - n7/840 + n5/120 - 29n4/24 + 43n*2. Let v(t) be the second derivative of c(t). Give v(-3). 1 Let p(i) = 23i*3 - i - 1. Let k(c) = -2c*3 - 4c*2 + 13. Let a be k(-4). Let w = -78 + a. What is p(w)? -23 Suppose 2a - 3y + 6 = 0, 1 = a + y + 4. Let f(m) = -3m*2 - 2m + 3. Determine f(a). -18 Let z(p) = -2p3 + p2 + 13p + 2. Let j(s) = -s*3 + 6s + 1. Let y(l) = -5j(l) + 2z(l). Let w be -44/(-2 + -2). Suppose -wg = -1 + 13. Determine y(g). 2 Let l(g) = 3g. Let r be l(-12). Let n = r + 38. Let m(u) = -u3 + u2 + u - 2. Determine m(n). -4 Let y = 0 - 5. Let o(l) = -2l*2 + 7l + 6. Let n(b) = -b*2 + 6b + 6. Let k(q) = 3n(q) - 2o(q). What is k(y)? 11 Let v(r) = -r*2 + 5r - 5. Let a(x) = -x*3 + 4x*2 - 2x + 3. Let f be a(2). Let s be (-46)/3 - 6/9. Let k be f + (s/4)/4. Calculate v(k). -11 Let l(u) be the second derivative of u5/20 + u4/2 + 5u3/6 - u2/2 + 28u. Determine l(-5). -1 Let k(r) = 4r2. Let o(c) = -c3 + 4c*2 + 3c - 1. Let g be o(-1). Determine k(g). 4 Let a(g) = -g*2 + 6g - 2. Let u = -16 + 25. Suppose 7h + 10 = uh. Give a(h). 3 Let t(x) be the second derivative of x*3/2 + 361x. Calculate t(4). 12 Let y be (-95)/3 + (-1)/3. Let i = 27 + y. Let x(s) = s*3 + 5s*2 + 2s - 1. Give x(i). -11 Let y(u) = -u*3 + 4u2 - 5. Let l = 2 - 1. Let h be (-3 - 1) + (-6 - (-9 + -2)). Let q be l - h - (-40)/10. Determine y(q). -5 Let a(f) be the first derivative of -f4/4 + 4f3/3 + 5f + 29. What is a(4)? 5 Let i(t) be the third derivative of t*5/20 - 5t*4/8 + 7t*3/6 + 178t*2. Determine i(5). 7 Let s(z) be the third derivative of 13z5/60 + z3/6 - 149z2. Determine s(-1). 14 Let v(j) = -5. Let r(d) = -d - 13. Suppose 4g + 36 = -5l, 2g = -4l - 24 - 0. Let x(y) = gr(y) + 11v(y). Determine x(2). 5 Let i(k) = 6k*3 - 7k - 12k3 - 2k*3 + 7k*2 + 7k3 + 3 + k2. Determine i(7). 3 Let f(b) = b3 - b2 - b - 2. Let n = -1528 - -1528. Determine f(n). -2 Let v(h) = 6h + 8. Let l(c) = -5c*2 + 67c - 19. Let j be l(13). Let f(g) = -5g - 7. Suppose 2d + 18 = 5d. Let r(p) = dv(p) + jf(p). Calculate r(2). 1 Let y = 121 + -59. Let g(q) = -55 - y + 110 - 8q - q*2. Give g(-7). 0 Let a(t) = t + 4. Let h be a(-5). Let p be (-1 - (-6)/4)4. Let r(q) = 2 + q - 3 + pq. Give r(h). -4 Suppose z + 4 = 2q, -3z + 3q - 2q = -8. Suppose zn - 2 = 5n. Let b(x) be the second derivative of -x4/12 + x3/6 - x2/2 - 3x. What is b(n)? -7 Let a(c) = -4. Let i(b) = -2*b	{ "pile_set_name": "DM Mathematics" }
Let p be ((-1)/(-2))/((-7)/(-126)). Suppose 0 = ps - 170 - 208. What is the tens digit of s? 4 Suppose v + 2h - 17 = 0, 1 + 7 = 4h. Let x = 13 + v. Suppose 2u = 26 + x. What is the units digit of u? 6 Let t(y) = 2y - 7. Let j be t(6). What is the tens digit of (-20)/(-50) - (-193)/j? 3 Let c = -9 - 63. Let f = c - -94. What is the tens digit of f? 2 Let g = 17 + -15. Suppose gm - 7 = 1. Suppose -ml + l = -78. What is the units digit of l? 6 Suppose 0 = -24i + 15589 - 469. What is the tens digit of i? 3 Let y(w) = 2w2 + w + 2. Let i be y(4). Let j = 73 - i. What is the units digit of j? 5 Let x = 40 + -24. Suppose -4y + x = 4d, 5d - 10 = 2y + d. What is the tens digit of ((-49)/(-5))/(y/5)? 4 Let m = -694 + 725. What is the tens digit of m? 3 Let l(u) = u3 + 6u*2 + 3u + 14. Let z be l(-6). Let b(p) = -33p + 24. What is the hundreds digit of b(z)? 1 Suppose 3g - 7g = -20. Let s(k) be the first derivative of -k3/3 + 5k*2 - 12k - 160. What is the units digit of s(g)? 3 Suppose -5j - 5 = -6j. Suppose 351 = 2g + t, 363 = g + g + jt. What is the units digit of g? 4 Let v be -8 + (8 - 2) + -4. Suppose 2c = 3m - 2m - 9, 4c + 3m - 7 = 0. What is the units digit of (10 + v)c/(-1)? 8 Let z(y) = -4y2 + 7y - 30. Let b be z(13). What is the units digit of b/(-21) - (-10)/(-35)? 9 Let f(y) = -2y2 + 162y - 290. What is the thousands digit of f(66)? 1 Suppose 3g - 559 - 3059 = 0. What is the units digit of g? 6 Suppose -4t - 16 = -4. Let w be 1/(4/(-168)) - t. Let x = w + 68. What is the units digit of x? 9 Let q = -29 - -53. Let z be (q/20)/((-6)/(-20)). Suppose -23 + 119 = zl. What is the tens digit of l? 2 Suppose -3a + 823 = -5z, 0 = 4z - z - 3. Suppose -12 = -3d + a. What is the tens digit of d? 9 Suppose -10r + 3 = 3. What is the units digit of -11 + (r/5 - -2)? 1 Let n be (-4 + 1)2/(-3). Suppose -5f + n = -28. Suppose f = s - 0. What is the units digit of s? 6 Suppose 5s + 2d - 109 = d, -5s = -d - 111. What is the tens digit of (38/(-3))/(s/(-18) + 1)? 5 Let z(t) = 2t2 - 16 - 2t*2 + 2t*2 - 19t + 23t. What is the tens digit of z(-7)? 5 Let f be (-14)/(-91) - (-2)/(-13). Let b be (1 + -1)/(f - 1). Suppose br = -r + 22. What is the tens digit of r? 2 Suppose -194t - 2052 = -212t. What is the units digit of t? 4 Suppose 0 = 2k + 344 + 52. Let r = k - -313. What is the hundreds digit of r? 1 Let o be -100 + 2 + (1 - 4). Let f = -60 - o. What is the units digit of f? 1 Suppose 0 = -9a + 4a + 20. Let t(f) = -f3 + 4f*2 - 3. Let x be t(a). What is the units digit of 21 + 8/(-12)x? 3 Let q(r) = -r*2 - r + 5. Let f be q(-5). Let z = 9 + f. What is the tens digit of 12/(-8)124/z? 3 Suppose 0 = 2s + 2w - 8712, 3s - w - 4957 = 8107. What is the hundreds digit of s? 3 Let k(q) be the first derivative of 5q4/4 - q3/6 + 3q2/2 + 9q - 3. Let f(g) be the first derivative of k(g). What is the units digit of f(2)? 1 Suppose 2c = 4c + 18. Let l be (-4)/(-2) - c/(-9). Suppose 4 = 3u + l. What is the units digit of u? 1 Let x(z) be the first derivative of z5/20 - z4/24 - z3/2 + 5z*2/2 + 2. Let s(g) be the second derivative of x(g). What is the tens digit of s(-2)? 1 What is the units digit of (-2 - 48/(-18)) + (-111)/(-9)? 3 Let p(k) = 2k2 - 6. Let x be p(3). What is the units digit of ((-126)/12)/((-2)/x)? 3 Let y = -26 + 20. Let x(o) = o2 + 6o - 5. Let t be x(y). What is the tens digit of (-5 - 0)/t + 15? 1 Suppose 2j + 30 = 2f, -4f + j + 40 = 2j. What is the tens digit of f/((-22)/(-120)) - -1? 6 Suppose -n + 4 = 2v - 26, 0 = 5n - 2v - 90. Let g = n - 12. Suppose -i + g = -5i, -5d - 5i + 55 = 0. What is the units digit of d? 3 Suppose 0 = c - 3u - 5, -9 = 2u - 5u. Let f(y) = -5 + c - y + 0. What is the units digit of f(7)? 2 Suppose 12288 = -37a + 189888. What is the thousands digit of a? 4 Let p(m) = -m3 + 8m*2 - 11m + 20. Let i be p(5). Let c = 16 + i. What is the tens digit of c? 5 Suppose -3816 = -d + 33k - 34k, -d = -3k - 3800. What is the hundreds digit of d? 8 Let o be -123/((-24)/244). What is the hundreds digit of o/2 + -1 + 2 + -5? 1 Let w(q) = -256q - 25. What is the hundreds digit of w(-3)? 7 Suppose -12 = 5o - 3w, 3w - 10 = -2o + 2. Let h be 11((-4)/(-2) - o). Let i = -1 + h. What is the tens digit of i? 2 Let z(r) = -r + 4. Let u be z(7). What is the units digit of (u/2)/(374/(-124) + 3)? 3 Let j(a) = 2a2 - 4a - 1. Let d(z) = -3z3 + z2 - z - 1. Let g be d(-1). Let x be j(g). What is the units digit of 6/x + (-163)/(-5)? 3 Let d(o) = 57o - 42. What is the tens digit of d(6)? 0 Let k be 112/(4/2) + 20 + -18. Suppose 5h - 3i - 290 = 0, -9i - k = -h - 4i. What is the tens digit of h? 5 Let f be -6 - -4 - -223. Let o be (-48)/(-22) - 8/f. Suppose -2d = -2w + d + 4, od = -2w + 24. What is the units digit of w? 8 Let b(s) = -s2 - 9s - 44. Let n be b(-9). Let h = -13 - n. What is the tens digit of h? 3 Let s(y) = -27y - 8. Let i(v) = -730v - 215. Let j(c) = -2i(c) + 55s(c). What is the units digit of j(-5)? 5 Suppose 0 = -2n, 2n - 12 = -3v - n. Suppose o - vo - r = -62, -81 = -4o - 3r. What is the tens digit of o? 2 Suppose 1820 = 2a - 2i, 4a - 3a - 894 = -3i. What is the units digit of a? 6 Suppose 166u - 164u = 588. Suppose -u + 1102 = 4o. What is the units digit of o? 2 Let l be (-147)/(-12) + (-15)/(-20). What is the tens digit of 522/l - 4/26? 4 Let v(l) = -l3 + l2 + l + 3. Let f be v(0). Suppose -2j + 120 = fu - 70, 2j - 194 = -2u. What is the tens digit of j? 0 Let l(c) = -26c + 10. Suppose 5y = -0 + 5, -j = 2y + 2. What is the hundreds digit of l(j)? 1 Let d(k) = 53k - 159. What is the hundreds digit of d(13)? 5 Let t = 2 + 1. Suppose -2z - 10 = -3k + 18, -2z - 8 = -k. Suppose d + 4a = k, -td + 5a + 33 = -d. What is the units digit of d? 4 Let t be (-1)/3 - (-102)/9. Let a = 12 - t. Let j(b) = 36b3 - b2 - 2b + 2. What is the units digit of j(a)? 5 Let q = -897 - -2809. What is the hundreds digit of q? 9 Suppose 0u - 4775 = -5u. What is the units digit of u? 5 What is the hundreds digit of (25624/(-4))/(-2) + -6? 1 Let k = 495 - 135. What is the tens digit of k? 6 Suppose 95h = 96h - 610. What is the units digit of h? 0 What is the tens digit of ((-10)/40)/(((-5)/(-604))/(-5))? 5 Suppose -41c = -16305 - 79061. What is the thousands digit of c? 2 Let j(v) = -3v - 15. Let u(p) = 7p + 8. Let l be u(-3). What is the tens digit of j(l)? 2 Let u(t) = -4t + 10. Let j be u(-7). Suppose -k - 127 - j = -2g, -4k = 5g - 419. What is the tens digit of g? 8 Let j be (-12)/(-54) - 25/(-9). Suppose -31 = -d + j. What is the units digit of d? 4 Suppose -u + 82 = 2u - q, -u = -2q - 29. Suppose 2o = 3o - u. Suppose -2h = -5h + o. What is the units digit of h? 9 Let j(x) = -x2 + 31x - 61. What is the tens digit of j(20)? 5 Suppose 3y - 7 + 16 = 0. What is the units digit of 1/(-1) + 8 + y? 4 Suppose 0 = 5t + 3a - 4a - 27, -a + 33 = 5t. Suppose 0 = -4x + t + 10. Suppose 181 = 5d - xv, v = -d + 7 + 22. What is the tens digit of d? 3 Let o = 62 + 209. What is the units digit of o? 1 Let l be (-2 + -4)12/(-24). What is the tens digit of l(-5)/30-58? 2 Let m be (25/(-10))/((-1)/(-16)). Let q = m - -213. What is the tens digit of q? 7 Let c(s) = -s3 - 2s*2 - 7s + 3. Let r be c(-4). Suppose -9 = -b + r. What is the tens digit of b? 7 Suppose -k = -5a - 26, -3k + 2k - a = 4. Let b = 29 - k. Suppose c = -4o + 91 - b, -c = 5o - 68. What is the units digit of c? 3 Suppose -5n - 41 = 3l, 5l - 15 = 4n + 3. Let z = 11 + n. Suppose -3m + v = -29, 2m = -2v + zv + 26. What is the units digit of m? 8 Let o(v) = 360v*2 - 9v - 6. What is the units digit of o(2)? 6 Suppose -2t - c = -767, 3c + 112 + 651 = 2t. What is the tens digit of t? 8 Suppose 3s + v - 149 = 0, 0 = 2v + 6 - 4. Suppose -48t + st = 182. What is the units digit of t? 1 Suppose 5181 = 31l - 17573. What is the hundreds digit of l? 7 Let g(d) = d*2 - 20d - 58. Let k be g(24). Let y = -33 + 23. Let a = y + k. What is the tens digit of a? 2 Suppose 0 = -5u + 4u. Suppose 2a - 4a + 50 = u. What is the units digit of a? 5 Let i(p) = p*3 + 4p*2 + 5p + 6. Suppose b = -7	{ "pile_set_name": "DM Mathematics" }
ands digit of 44557574? 7 What is the ten thousands digit of 102099387? 9 What is the units digit of 52709879? 9 What is the hundreds digit of 17562564? 5 What is the millions digit of 2893153952? 3 What is the tens digit of 182900780? 8 What is the units digit of 173178591? 1 What is the millions digit of 53497864? 3 What is the hundreds digit of 947086793? 7 What is the billions digit of 3797890874? 3 What is the hundred millions digit of 2364427993? 3 What is the hundred thousands digit of 7358976? 3 What is the thousands digit of 3271558878? 8 What is the ten thousands digit of 120922279? 2 What is the hundred thousands digit of 1650312930? 3 What is the hundreds digit of 251648765? 7 What is the tens digit of 3621579814? 1 What is the ten thousands digit of 132867436? 6 What is the tens digit of 22468169? 6 What is the hundreds digit of 1342162679? 6 What is the hundred thousands digit of 211113811? 1 What is the ten thousands digit of 11046199? 4 What is the ten thousands digit of 4020531967? 3 What is the thousands digit of 3226898835? 8 What is the hundred thousands digit of 73429939? 4 What is the ten thousands digit of 18143562? 4 What is the units digit of 50452879? 9 What is the millions digit of 770738582? 0 What is the hundred thousands digit of 3768722? 7 What is the hundred millions digit of 485510938? 4 What is the thousands digit of 86721508? 1 What is the millions digit of 34495569? 4 What is the ten thousands digit of 608357918? 5 What is the units digit of 49430370? 0 What is the hundreds digit of 2683714102? 1 What is the hundreds digit of 300788437? 4 What is the ten thousands digit of 3859389741? 8 What is the thousands digit of 295961678? 1 What is the units digit of 34206672? 2 What is the ten millions digit of 30535973? 3 What is the millions digit of 51732349? 1 What is the hundreds digit of 44300717? 7 What is the millions digit of 1924984931? 4 What is the ten thousands digit of 1661149? 6 What is the ten thousands digit of 124477928? 7 What is the units digit of 2994380503? 3 What is the ten thousands digit of 4191187369? 8 What is the ten thousands digit of 424148354? 4 What is the hundreds digit of 2488168849? 8 What is the hundred thousands digit of 5043610407? 6 What is the tens digit of 774557538? 3 What is the tens digit of 772189337? 3 What is the hundred millions digit of 2280544065? 2 What is the ten thousands digit of 43002586? 0 What is the units digit of 468918110? 0 What is the hundred thousands digit of 175285083? 2 What is the tens digit of 174373164? 6 What is the thousands digit of 6742483284? 3 What is the units digit of 69624636? 6 What is the millions digit of 77176871? 7 What is the thousands digit of 657272189? 2 What is the hundreds digit of 1055226077? 0 What is the millions digit of 877188063? 7 What is the thousands digit of 4476131889? 1 What is the billions digit of 3120947149? 3 What is the thousands digit of 31078077? 8 What is the ten thousands digit of 361230655? 3 What is the hundred millions digit of 5933552561? 9 What is the units digit of 41655823? 3 What is the millions digit of 29125091? 9 What is the thousands digit of 756613470? 3 What is the thousands digit of 168816070? 6 What is the ten thousands digit of 407561161? 6 What is the hundreds digit of 297166940? 9 What is the billions digit of 6068360037? 6 What is the thousands digit of 300785903? 5 What is the hundreds digit of 35431319? 3 What is the units digit of 780322591? 1 What is the tens digit of 598875284? 8 What is the millions digit of 1338730391? 8 What is the hundred millions digit of 379915548? 3 What is the millions digit of 553615756? 3 What is the hundreds digit of 23796387? 3 What is the ten millions digit of 10492205? 1 What is the hundred thousands digit of 50576972? 5 What is the millions digit of 2421802842? 1 What is the millions digit of 63084359? 3 What is the ten thousands digit of 26438345? 3 What is the thousands digit of 1400086504? 6 What is the hundred millions digit of 703729111? 7 What is the hundred millions digit of 135176860? 1 What is the billions digit of 1409200435? 1 What is the ten thousands digit of 54439867? 3 What is the hundred millions digit of 427589502? 4 What is the ten thousands digit of 2024655805? 5 What is the hundreds digit of 818031191? 1 What is the hundred millions digit of 457980483? 4 What is the hundreds digit of 862270276? 2 What is the tens digit of 25533407? 0 What is the tens digit of 5180414? 1 What is the hundred millions digit of 784983238? 7 What is the billions digit of 4467890649? 4 What is the millions digit of 92100208? 2 What is the tens digit of 378931764? 6 What is the hundreds digit of 368383739? 7 What is the units digit of 301169502? 2 What is the billions digit of 8629568417? 8 What is the hundred thousands digit of 138347543? 3 What is the hundred thousands digit of 2865402059? 4 What is the ten thousands digit of 27327634? 2 What is the units digit of 4627914? 4 What is the units digit of 1395598171? 1 What is the hundred thousands digit of 97595101? 5 What is the hundred thousands digit of 140725838? 7 What is the hundred millions digit of 176920977? 1 What is the tens digit of 930010446? 4 What is the hundreds digit of 467091313? 3 What is the units digit of 198270449? 9 What is the ten millions digit of 2016361471? 1 What is the tens digit of 24062822? 2 What is the hundred thousands digit of 436736605? 7 What is the units digit of 76961319? 9 What is the hundred millions digit of 394776450? 3 What is the thousands digit of 2465805678? 5 What is the thousands digit of 114162428? 2 What is the hundred millions digit of 1139631449? 1 What is the hundred thousands digit of 28070438? 0 What is the millions digit of 75806045? 5 What is the units digit of 14755318? 8 What is the units digit of 53466097? 7 What is the hundreds digit of 236369514? 5 What is the thousands digit of 153138937? 8 What is the units digit of 167542046? 6 What is the tens digit of 73702762? 6 What is the hundred thousands digit of 33911458? 9 What is the hundred thousands digit of 34860022? 8 What is the tens digit of 4311104881? 8 What is the hundred thousands digit of 229253923? 2 What is the millions digit of 692277671? 2 What is the hundred thousands digit of 107033190? 0 What is the ten thousands digit of 3693924559? 2 What is the ten thousands digit of 127520955? 2 What is the ten millions digit of 1029273889? 2 What is the hundred millions digit of 3000922288? 0 What is the thousands digit of 29869401? 9 What is the units digit of 2253337127? 7 What is the thousands digit of 126439291? 9 What is the units digit of 2924981259? 9 What is the hundreds digit of 501943799? 7 What is the hundred thousands digit of 9035780? 0 What is the hundred thousands digit of 1404386856? 3 What is the hundreds digit of 1036072018? 0 What is the tens digit of 10951980? 8 What is the hundreds digit of 1822990366? 3 What is the millions digit of 126060096? 6 What is the hundred thousands digit of 17532498? 5 What is the ten thousands digit of 1617090409? 9 What is the hundred millions digit of 1535593338? 5 What is the tens digit of 29169399? 9 What is the tens digit of 113672308? 0 What is the tens digit of 1297240079? 7 What is the units digit of 3823971092? 2 What is the ten thousands digit of 4383185489? 8 What is the tens digit of 95908671? 7 What is the hundred thousands digit of 278094018? 0 What is the ten millions digit of 781745074? 8 What is the millions digit of 417041693? 7 What is the thousands digit of 63919476? 9 What is the thousands digit of 289748072? 8 What is the units digit of 1089893617? 7 What is the millions digit of 104406886? 4 What is the thousands digit of 229083957? 3 What is the units digit of 3641714200? 0 What is the hundred thousands digit of 945491379? 4 What is the hundred thousands digit of 115759073? 7 What is the millions digit of 2385008192? 5 What is the hundreds digit of 96104754? 7 What is the hundreds digit of 3470436207? 2 What is the ten millions digit of 104802489? 0 What is the hundred thousands digit of 84370137? 3 What is the thousands digit of 135497334? 7 What is the tens digit of 2194852549? 4 What is the tens digit of 4956383849	{ "pile_set_name": "DM Mathematics" }
27/91 Calculate prob of picking 2 m, 1 s, and 1 n when four letters picked without replacement from {s: 3, n: 2, m: 10, t: 4}. 45/646 Calculate prob of picking 2 k and 2 o when four letters picked without replacement from {k: 3, o: 11}. 15/91 What is prob of picking 1 a and 3 q when four letters picked without replacement from {q: 7, a: 1}? 1/2 Four letters picked without replacement from {l: 2, e: 1, q: 2, b: 1}. What is prob of picking 2 l and 2 q? 1/15 Three letters picked without replacement from {p: 1, s: 3}. Give prob of picking 3 s. 1/4 What is prob of picking 3 n when three letters picked without replacement from {n: 15, l: 5}? 91/228 What is prob of picking 3 y when three letters picked without replacement from {y: 3}? 1 Two letters picked without replacement from {x: 5, q: 3}. What is prob of picking 1 x and 1 q? 15/28 Calculate prob of picking 1 m and 3 f when four letters picked without replacement from mmfmmfmffmmmmmfmmf. 4/51 Three letters picked without replacement from nwkewn. What is prob of picking 1 n, 1 w, and 1 k? 1/5 Calculate prob of picking 1 s and 1 q when two letters picked without replacement from {c: 4, q: 1, s: 6, f: 4}. 2/35 Calculate prob of picking 1 j and 1 b when two letters picked without replacement from bdoddorjrddjrdj. 1/35 Calculate prob of picking 2 e and 1 b when three letters picked without replacement from {b: 9, e: 11}. 33/76 Two letters picked without replacement from wfowqqfwiwoqwfoooqtt. What is prob of picking 1 f and 1 i? 3/190 Calculate prob of picking 1 m and 1 n when two letters picked without replacement from mhhnmkmkkkmmhd. 5/91 Calculate prob of picking 3 k and 1 y when four letters picked without replacement from {l: 1, y: 6, q: 7, k: 4}. 2/255 Three letters picked without replacement from kkhkgkghikhgkkkkhrhk. What is prob of picking 2 k and 1 i? 3/76 Two letters picked without replacement from {t: 5, s: 3, u: 2, x: 1, i: 1}. Give prob of picking 1 u and 1 t. 5/33 Two letters picked without replacement from hprr. Give prob of picking 1 r and 1 p. 1/3 Calculate prob of picking 2 k when two letters picked without replacement from ckkkckkccppkp. 5/26 Two letters picked without replacement from {f: 1, y: 4, z: 2}. What is prob of picking 1 z and 1 f? 2/21 Four letters picked without replacement from {b: 2, t: 10}. What is prob of picking 2 t and 2 b? 1/11 Two letters picked without replacement from {w: 3, j: 1, d: 1, f: 3, k: 11}. What is prob of picking 1 d and 1 w? 1/57 What is prob of picking 1 x and 1 k when two letters picked without replacement from {n: 2, x: 7, k: 1}? 7/45 Two letters picked without replacement from xhxxrhxghxrghlxxihh. Give prob of picking 1 r and 1 l. 2/171 What is prob of picking 1 p, 1 t, and 1 q when three letters picked without replacement from qpiiitt? 2/35 Four letters picked without replacement from {l: 4, d: 4, p: 6, u: 1}. What is prob of picking 3 l and 1 u? 4/1365 Two letters picked without replacement from iaaauaiaananaunn. Give prob of picking 1 n and 1 a. 4/15 Three letters picked without replacement from wupmmmwmmwmm. Give prob of picking 3 m. 7/44 Two letters picked without replacement from {l: 1, y: 3, p: 3, q: 6, a: 2}. What is prob of picking 1 q and 1 l? 2/35 What is prob of picking 1 d and 1 r when two letters picked without replacement from {r: 2, d: 1}? 2/3 Two letters picked without replacement from tsftbbb. What is prob of picking 1 s and 1 b? 1/7 Three letters picked without replacement from {v: 3, r: 11, c: 1}. Give prob of picking 3 r. 33/91 Three letters picked without replacement from yrrrxyxryxyxyyx. What is prob of picking 2 x and 1 r? 8/91 Four letters picked without replacement from xxxxxxxxxddxxxxxxxxd. What is prob of picking 2 x and 2 d? 8/95 Calculate prob of picking 1 d and 1 h when two letters picked without replacement from {d: 4, f: 1, h: 2, i: 6}. 4/39 What is prob of picking 2 w when two letters picked without replacement from {w: 4, e: 2}? 2/5 Four letters picked without replacement from tteeeeeeeee. What is prob of picking 4 e? 21/55 Calculate prob of picking 1 a and 1 l when two letters picked without replacement from {w: 2, a: 2, f: 3, s: 2, n: 1, l: 2}. 2/33 Four letters picked without replacement from dvdddvddmd. Give prob of picking 3 v and 1 m. 0 Four letters picked without replacement from ssqssqssqsq. Give prob of picking 1 q and 3 s. 14/33 Four letters picked without replacement from gddlggldddlllllgl. What is prob of picking 1 l and 3 g? 8/595 What is prob of picking 1 p, 1 s, and 1 l when three letters picked without replacement from {y: 8, l: 1, p: 2, s: 2}? 2/143 What is prob of picking 1 m, 1 w, and 1 x when three letters picked without replacement from mwkkwmmxkkkkkkmk? 1/70 What is prob of picking 3 p and 1 r when four letters picked without replacement from {b: 2, r: 3, d: 2, p: 6, g: 3}? 3/91 Calculate prob of picking 1 h and 1 o when two letters picked without replacement from {o: 7, h: 3}. 7/15 Calculate prob of picking 2 l, 1 m, and 1 s when four letters picked without replacement from {l: 4, m: 1, k: 1, s: 2, v: 1}. 2/21 Four letters picked without replacement from rrzsdsszfz. Give prob of picking 1 f, 2 z, and 1 s. 3/70 Calculate prob of picking 2 e when two letters picked without replacement from {e: 3, c: 1}. 1/2 Calculate prob of picking 1 o, 1 l, and 1 p when three letters picked without replacement from ooploopplil. 12/55 What is prob of picking 1 g and 1 f when two letters picked without replacement from fvgff? 3/10 What is prob of picking 1 n and 1 u when two letters picked without replacement from {u: 9, n: 9}? 9/17 Calculate prob of picking 3 v when three letters picked without replacement from {p: 2, v: 8, q: 4}. 2/13 Two letters picked without replacement from {q: 2, x: 1, c: 1, z: 1, b: 1, g: 2}. What is prob of picking 1 c and 1 z? 1/28 Four letters picked without replacement from {x: 2, h: 2, c: 2, o: 1, e: 1, s: 1}. What is prob of picking 1 h, 2 s, and 1 e? 0 Three letters picked without replacement from mqklgqqttklt. What is prob of picking 1 m, 1 t, and 1 l? 3/110 What is prob of picking 1 n, 1 o, and 1 j when three letters picked without replacement from puujnnuunujmupunouo? 16/969 Four letters picked without replacement from msifrrifivff. Give prob of picking 1 s and 3 r. 0 Three letters picked without replacement from {e: 5, s: 3, j: 4, w: 7}. Give prob of picking 2 s and 1 e. 5/323 Two letters picked without replacement from ttzttttztttettezzete. What is prob of picking 2 e? 3/95 Two letters picked without replacement from {o: 3, s: 3, g: 6, n: 5, c: 1}. Give prob of picking 2 g. 5/51 Calculate prob of picking 2 v and 1 k when three letters picked without replacement from {m: 6, c: 2, k: 1, v: 2, r: 1, e: 6}. 1/816 What is prob of picking 1 s and 2 h when three letters picked without replacement from {h: 5, s: 2}? 4/7 What is prob of picking 1 y and 1 k when two letters picked without replacement from {y: 6, k: 7}? 7/13 Four letters picked without replacement from {p: 7, y: 3, i: 2, m: 3, f: 4}. Give prob of picking 1 y, 1 m, and 2 f. 9/646 What is prob of picking 1 r, 1 d, and 1 t when three letters picked without replacement from dndnndtrtnd? 8/165 What is prob of picking 1 b and 1 f when two letters picked without replacement from ubenpfpe? 1/28 Four letters picked without replacement from diidggdgijg. Give prob of picking 1 d, 1 i, 1 g, and 1 j. 6/55 Two letters picked without replacement from {i: 1, m: 1, q: 3}. Give prob of picking 1 i and 1 m. 1/10 Four letters picked without replacement from {x: 1, y: 2, e: 1}. What is prob of picking 3 x and 1 e? 0 Two letters picked without replacement from {l: 2, b: 1, c: 2, e: 1, q: 5, s: 6}. What is prob of picking 1 b and 1 c? 1/68 What is prob of picking 1 y, 1 m, and 1 b when three letters picked without replacement from cobjycmbcymbm? 9/143 Calculate prob of picking 2 y and 1 v when three letters picked without replacement from yipkypvvkppypkp. 6/455 Calculate prob of picking 2 m and 2 i when four letters picked without replacement from himmhiimmmhmm. 63/715 Calculate prob of picking 4 y when four letters picked without replacement from ydyyydyyyyddyd. 18/143 Four letters picked without replacement from qeqqeep. Give prob	{ "pile_set_name": "DM Mathematics" }
)u)/((uuu2/uuuu)/u))/((uu(-3/5)uu)/u(-1)) assuming u is positive. u(18/5) Simplify ((g1g*(-1/4))/(gg/(ggg/(g((g/(g/(g/(gg/(g/g(-1))))))/g)/g)))(-6))(-11/4) assuming g is positive. g(231/16) Simplify (ss21/ss(s(-6)s)/s)/(sss*19s16) assuming s is positive. s(-21) Simplify (vv7)(-15/7)v/(v*(2/27)vv)(v(((v/((v/v12)/v))/v)/v)/v)/v assuming v is positive. v(-1553/189) Simplify (j1)(1/18)(jj(jj(1/3))/jj)/j(-17) assuming j is positive. j(367/18) Simplify (((s/(s*(2/9)s)s)/(s/(ss*(-2/17)s)))/(s*(-7)ss(1/2)))27 assuming s is positive. s(6573/34) Simplify tt*(-13/6)t*17(((t/(t/(t(-25)/t)))/t)/t)/(t/((t(2/57)t)/t)) assuming t is positive. t(-499/38) Simplify ((a(6/11)/(a((a/(a*(-1/11)a))/a)/a))/((a/(a*(-5)a))/(a(a6a)/aa)))4 assuming a is positive. a(196/11) Simplify ((f/f12((ff(1/3))/ff)/f)(24/11))(11/3) assuming f is positive. f(-256/3) Simplify (l(-8)/l)/(ll7)ll(-10)l(2/13) assuming l is positive. l(-336/13) Simplify ((jj/(j(2/7)/jj)j)(-20)/(j(2/7))24)(-11) assuming j is positive. j(4708/7) Simplify (f(-7/3)/(f/((f(-15)/f)/f)))/((f((((ff/(f(1/7)f))/f)/f)/f)/f)/f)(-13/5) assuming f is positive. f(-2993/105) Simplify (bb(2/5))/((bbb(-16)/b)/b)b*11b3 assuming b is positive. b(157/5) Simplify (m*(6/5)((m/(mm(3/10)))/m)/m)/(m(2/35)m/(((m(mm*(6/7)m)/m)/m)/m)) assuming m is positive. m(-13/10) Simplify (x(5/4))(-20)/(x(-1/14))31 assuming x is positive. x(-319/14) Simplify ((v/(v(vv*2)/v)v)(12/5))(-3/5) assuming v is positive. v(36/25) Simplify (s(4/5))*11/(s/(ss*(8/5)sss)s10) assuming s is positive. s(17/5) Simplify (h(-16)/h)(1/13)/(h/h(-11))(-1/5) assuming h is positive. h(71/65) Simplify ((z(-1/7))28)(-41) assuming z is positive. z164 Simplify (((z/(z/z(-18)))/(zz/z8))4)(-11) assuming z is positive. z528 Simplify (v*27v/v*(-12/13))/((vv*(-3/23))/(v((v/((vv(-5/7))/v))/v)/v)) assuming v is positive. v(60211/2093) Simplify (g(-2/63)gg(2/9))/(gg14)(-5) assuming g is positive. g*(1600/21) Simplify ii*(-30)i*(4/13)((i*11i)/i)(-28) assuming i is positive. i(-4377/13) Simplify ((c/c(-3/2))/c(1/3))/(c*(3/7)((cc(-1/19))/cc)/cc) assuming c is positive. c(631/798) Simplify ((u(1/2))(-1/4)u*(-8/5)u8)(-27) assuming u is positive. u(-6777/40) Simplify ((q/(q/(q(2/37)/q)q))/q)/(q/q(-13))q*(-2/33)q3 assuming q is positive. q(-17102/1221) Simplify (l*(1/12)ll(5/6))/(l/(l/((l/l(-5))/ll))lll/l(-24)) assuming l is positive. l(-373/12) Simplify (((k(2/5))(-36))50)(-2/3) assuming k is positive. k480 Simplify ((m(-1/5)/m)/m)(3/32)m/(m/m*0)m/(m*(6/5)m) assuming m is positive. m*(-45/32) Simplify (j/(jjj(3/5)))/((j/(jj*(-4/3)j))/jj)j*(-3/7)jj/j(-1/2)j assuming j is positive. j*(239/210) Simplify ((n/(n(n/(n2/n))/n))(-2/19)/(((n/(n/(n*(-1/3)/nnn)))/nn)/(n/(n/(n(-5)/n)))))35 assuming n is positive. n*(-13510/57) Simplify ((z/(zz(zz/(z/z*(-1/6)))/zz))/z(-7))/(z(-2/31))(1/18) assuming z is positive. z(2885/558) Simplify (((g(g(g/(g0/g))/g)/g)(1/10))0)(-20) assuming g is positive. 1 Simplify (s(-5/6)/s)(-1/13)(ss*9s)(-2/27) assuming s is positive. s(-473/702) Simplify (((q/(q(-2/5)/q))/(q/q(-8)))/((q*(-1/6)qq)/((q/q(-2/5))/q)))35 assuming q is positive. q(-1687/6) Simplify ((b(2/3)b)/(b*(-10)b)b(-13)(bb2)/b)(6/5) assuming b is positive. b(-2/5) Simplify (c(-4/13)/c(-36))(-44) assuming c is positive. c(-20416/13) Simplify (z15)(1/14)/(z/(zz*26z)z25z) assuming z is positive. z*(29/14) Simplify ((((tt*(2/7)/t)/t)/t)/ttt/(tt*(-2/21))t*(6/5)/ttt(-10)/t)47 assuming t is positive. t(-56353/105) Simplify ((m/m(-1/2))/m)(-10/11)m(-3/7)/(m/(((m/(m(-8)m))/m)/m)) assuming m is positive. m(317/77) Simplify (k(-1/18))(-48)/(k(1/14)/k)(-1/5) assuming k is positive. k(521/210) Simplify c/(c/c(11/4))c*(2/37)(c*(-3/4)c)(16/9) assuming c is positive. c(4327/1332) Simplify (z*24/zzz/z(2/5))/(z(-6)z(z/z(-2/13)z)/z) assuming z is positive. z(1849/65) Simplify q(-3/2)q/(q(-9/2)q)(q(-11)/q)/q(4/15) assuming q is positive. q(-139/15) Simplify (cc*2)/cccc*(13/3)/cc(c/(c/(ccc(ccc(cc/(c/(c(c(-7/5)c)/c))c)/ccc)/c)))22 assuming c is positive. c(2633/15) Simplify t8/t(-9)(tt(1/4)/tt)/t21 assuming t is positive. t(-11/4) Simplify ((uu/(u12/u))/(uu*(-2/25)))/(u/(uu(-1/4)/u))(-21/2) assuming u is positive. u(641/200) Simplify (k(-2/3)kkk/k(-24)k)/(((k(-16)/k)/k)/k)11 assuming k is positive. k*(709/3) Simplify ((bb*7/bb)/b(b/(b/(b(-5)/b)))/bb*(1/2)(bb(2/7)b)/bb)(-11) assuming b is positive. b(-429/14) Simplify (((c/(c/c1))/c(2/13))/(cc*(2/7)cc)(23/4))20 assuming c is positive. c(-32845/91) Simplify (o9o)*(7/4)(o/o*(-4/3)o)19 assuming o is positive. o(485/6) Simplify n*(-5)n*(-6)(n/(nnnn(-10)nn)n)/(nn7/n) assuming n is positive. n(-11) Simplify ((r(2/7))(6/7)/(rrrr*(-3)rr)(-3/10))33 assuming r is positive. r(6831/245) Simplify ((n27)(-39))(-3/35) assuming n is positive. n(3159/35) Simplify ((y(-2/11)yy(-12))/(y4/(y5y)))(2/65) assuming y is positive. y(-202/715) Simplify (o/(o/(oo8)))(-35)(o(-5/2))(1/21) assuming o is positive. o*(-13235/42) Simplify ((n/(n/(n/((nnn(10/7)n)/n)n)))(-1/2))(-4/25) assuming n is positive. n(-4/35) Simplify (r/((r/(r(r/r*(-17))/rr))/rr))28/(rr*(-16/5)r*(2/43)r) assuming r is positive. r(114628/215) Simplify (d/(d/d(2/9)))/d*(6/7)(d(-3)/d)(-12) assuming d is positive. d(2984/63) Simplify (a/a(-10/9)a)(3/2)/(((a/(a(-21)/aaa))/a)/a)(-11/8) assuming a is positive. a(739/24) Simplify ddd(-15)ddd*(1/12)d(dd*17ddd)/(dd(8/7)) assuming d is positive. d(751/84) Simplify (h(-2)h/(hhh/h*(2/7))h)/(h(-2))(-26) assuming h is positive. h(-383/7) Simplify ((j(-1/3)/j)*(-29)j*(5/6)j/(j/((j/(j/(j(j/j(-1/8))/j)))/j)j))6 assuming j is positive. j(927/4) Simplify (c/c*(-1/4)c)/c*(-10)c*(1/5)/(cc/(((cc/c(-13/4))/c)/c)) assuming c is positive. c(137/10) Simplify ((o3)(-2/9)/((oo*(3/13)o)/o7))2 assuming o is positive. o*(320/39) Simplify (xx*(3/2)/xxx(1/2)/x)/(x/(xx*(-10)/x)x/(x*12x)) assuming x is positive. x3 Simplify (r(20/9)rr6)/(r/r(-3))(-1/7) assuming r is positive. r(617/63) Simplify (f(3/4))(2/69)(f(-11/3)f)/(ff(2/7)f) assuming f is positive. f(-4763/966) Simplify v3/((v/((v/(vv/(v/((v(v*(3/2)/v)/v)/v))v))/v))/v)(v/(v/(vv*(3/22))))/(((vv*(1/32))/vv)/v) assuming v is positive. v(917/352) Simplify (v(-21)/vv(1/5)vv)/(((v(v*20v)/vvv)/v)/(vv32)) assuming v is positive. v(-44/5) Simplify (u/u1)(-40)(u(3/2))(6/25) assuming u is positive. u(9/25) Simplify (((h/(h(-3/2)/h))/(hh/(hh/(h/h*(-6))hh)h))/(h*(-1)/(hh*(-2/3)h)))(-12) assuming h is positive. h2 Simplify (((v/(v(-2)/v))(-6))3)22 assuming v is positive. v(-1584) Simplify (i(-1/9)/i(-16/5))/(i(-10)i(-16)/i) assuming i is positive. i(1354/45) Simplify ((ww10)/(w/w0w)w*(-2/37)/(ww1))(-12) assuming w is positive. w(-3084/37) Simplify (t(13/3))(-49)/((t(22/5)t)/tt/(t/((((t/(t/t*(11/6)))/t)/t)/t)t)t) assuming t is positive. t(-6467/30) Simplify (p18/(pp(-2/13)))/(((p/(p0p)pp)/p)/(pp/p(-4))) assuming p is positive. p(288/13) Simplify (pp(1/4)pp)(-35/3)/(p/(p/p(2/17))p12) assuming p is positive. p(-10207/204) Simplify ((o*(-28)o(-9/2))50)(-18) assuming o is positive. o29250 Simplify (q/q3)(-8)(q(q/(q/(qq(-6))))/q)/q(2/11) assuming q is positive. q(119/11) Simplify (((s/(((sss/(s(-9)/s)ss)/sss)/s)s)/((s/s(-1/2))/s))(-50))(-5/16) assuming s is positive. s(-3375/16) Simplify (k*10kk(-1))/(kk*1k**(-10/3)/k) assu	{ "pile_set_name": "DM Mathematics" }
sands digit of 43260? 4 What is the millions digit of 11322923? 1 What is the thousands digit of 441430? 1 What is the thousands digit of 952001? 2 What is the hundreds digit of 325100? 1 What is the thousands digit of 585190? 5 What is the tens digit of 27290870? 7 What is the units digit of 21915171? 1 What is the millions digit of 2037243? 2 What is the thousands digit of 257856? 7 What is the thousands digit of 310514? 0 What is the ten thousands digit of 11178458? 7 What is the units digit of 242296? 6 What is the tens digit of 235580? 8 What is the tens digit of 244501? 0 What is the hundred thousands digit of 2651895? 6 What is the hundreds digit of 11947114? 1 What is the ten thousands digit of 332660? 3 What is the thousands digit of 1734719? 4 What is the thousands digit of 179069? 9 What is the tens digit of 974248? 4 What is the units digit of 5225088? 8 What is the hundreds digit of 388444? 4 What is the hundreds digit of 2696794? 7 What is the ten thousands digit of 447532? 4 What is the millions digit of 2052335? 2 What is the hundreds digit of 1326067? 0 What is the units digit of 2701139? 9 What is the hundreds digit of 267010? 0 What is the hundreds digit of 2969691? 6 What is the tens digit of 3394108? 0 What is the tens digit of 120668? 6 What is the hundred thousands digit of 3099653? 0 What is the hundreds digit of 895531? 5 What is the units digit of 1777013? 3 What is the units digit of 152775? 5 What is the thousands digit of 7424044? 4 What is the tens digit of 275832? 3 What is the tens digit of 1190534? 3 What is the units digit of 273964? 4 What is the units digit of 780114? 4 What is the units digit of 137803? 3 What is the ten thousands digit of 17646595? 4 What is the ten thousands digit of 15037133? 3 What is the tens digit of 8535275? 7 What is the thousands digit of 266297? 6 What is the ten thousands digit of 947960? 4 What is the tens digit of 326872? 7 What is the hundred thousands digit of 280045? 2 What is the thousands digit of 9520997? 0 What is the units digit of 458707? 7 What is the hundreds digit of 478582? 5 What is the tens digit of 600938? 3 What is the units digit of 555731? 1 What is the tens digit of 74129? 2 What is the hundreds digit of 146731? 7 What is the ten thousands digit of 82316? 8 What is the units digit of 1449412? 2 What is the tens digit of 1585536? 3 What is the hundred thousands digit of 253864? 2 What is the tens digit of 15719471? 7 What is the units digit of 15627? 7 What is the ten thousands digit of 1915811? 1 What is the hundreds digit of 3878217? 2 What is the ten thousands digit of 5876949? 7 What is the thousands digit of 1086857? 6 What is the ten thousands digit of 1662259? 6 What is the hundreds digit of 3015242? 2 What is the thousands digit of 50116? 0 What is the ten thousands digit of 874678? 7 What is the hundred thousands digit of 5133567? 1 What is the thousands digit of 2207108? 7 What is the ten thousands digit of 1195165? 9 What is the units digit of 508291? 1 What is the hundreds digit of 1356980? 9 What is the units digit of 100030? 0 What is the tens digit of 16103278? 7 What is the thousands digit of 364920? 4 What is the tens digit of 3756440? 4 What is the hundreds digit of 1161670? 6 What is the units digit of 73158? 8 What is the thousands digit of 82997? 2 What is the units digit of 606246? 6 What is the tens digit of 5288333? 3 What is the thousands digit of 406028? 6 What is the thousands digit of 24490456? 0 What is the tens digit of 11368528? 2 What is the ten thousands digit of 14623615? 2 What is the hundred thousands digit of 375924? 3 What is the units digit of 31423? 3 What is the thousands digit of 306304? 6 What is the hundreds digit of 1322083? 0 What is the units digit of 25990623? 3 What is the millions digit of 5465703? 5 What is the units digit of 294772? 2 What is the hundreds digit of 3587909? 9 What is the hundreds digit of 1424146? 1 What is the thousands digit of 22754726? 4 What is the ten thousands digit of 2317316? 1 What is the thousands digit of 1200837? 0 What is the millions digit of 2642198? 2 What is the ten thousands digit of 54455? 5 What is the tens digit of 2260215? 1 What is the units digit of 201589? 9 What is the hundreds digit of 3089821? 8 What is the units digit of 293145? 5 What is the hundred thousands digit of 171532? 1 What is the units digit of 269862? 2 What is the hundreds digit of 5909995? 9 What is the units digit of 124474? 4 What is the tens digit of 8093? 9 What is the hundred thousands digit of 145883? 1 What is the thousands digit of 655961? 5 What is the hundreds digit of 2364221? 2 What is the hundreds digit of 4436475? 4 What is the thousands digit of 15762587? 2 What is the tens digit of 854133? 3 What is the ten thousands digit of 1910141? 1 What is the units digit of 4922799? 9 What is the units digit of 5937875? 5 What is the ten thousands digit of 594383? 9 What is the hundreds digit of 292716? 7 What is the tens digit of 482935? 3 What is the hundreds digit of 142363? 3 What is the hundreds digit of 7158507? 5 What is the ten thousands digit of 264374? 6 What is the hundreds digit of 1760162? 1 What is the ten thousands digit of 1317084? 1 What is the hundred thousands digit of 17118608? 1 What is the units digit of 509730? 0 What is the tens digit of 547353? 5 What is the units digit of 130319? 9 What is the ten thousands digit of 9344370? 4 What is the hundreds digit of 588435? 4 What is the units digit of 85231? 1 What is the units digit of 365001? 1 What is the units digit of 334204? 4 What is the ten thousands digit of 685948? 8 What is the hundreds digit of 536400? 4 What is the hundred thousands digit of 7686537? 6 What is the units digit of 154019? 9 What is the hundreds digit of 5251889? 8 What is the units digit of 1045520? 0 What is the hundred thousands digit of 1851541? 8 What is the thousands digit of 8499517? 9 What is the tens digit of 3279718? 1 What is the ten thousands digit of 164055? 6 What is the hundreds digit of 918598? 5 What is the tens digit of 59089? 8 What is the thousands digit of 2516999? 6 What is the tens digit of 806885? 8 What is the units digit of 416531? 1 What is the hundred thousands digit of 12726201? 7 What is the tens digit of 2395640? 4 What is the units digit of 593890? 0 What is the hundreds digit of 3518439? 4 What is the millions digit of 3930060? 3 What is the hundred thousands digit of 530413? 5 What is the hundred thousands digit of 1172997? 1 What is the ten thousands digit of 8582957? 8 What is the hundred thousands digit of 524339? 5 What is the hundred thousands digit of 5177723? 1 What is the millions digit of 1209103? 1 What is the hundreds digit of 142123? 1 What is the hundred thousands digit of 5474721? 4 What is the tens digit of 91158? 5 What is the hundreds digit of 10424388? 3 What is the hundreds digit of 87614? 6 What is the thousands digit of 14013918? 3 What is the units digit of 5698839? 9 What is the hundreds digit of 18170182? 1 What is the hundreds digit of 5691458? 4 What is the hundreds digit of 223334? 3 What is the units digit of 12141571? 1 What is the ten millions digit of 23124139? 2 What is the ten thousands digit of 721065? 2 What is the tens digit of 68619? 1 What is the units digit of 5506983? 3 What is the thousands digit of 32109956? 9 What is the units digit of 17504396? 6 What is the thousands digit of 554631? 4 What is the units digit of 9489493? 3 What is the thousands digit of 366621? 6 What is the units digit of 326730? 0 What is the tens digit of 60507? 0 What is the thousands digit of 451612? 1 What is the tens digit of 843279? 7 What is the ten thousands digit of 59731? 5 What is the thousands digit of 107776? 7 What is the units digit of 463424? 4 What is the thousands digit of 714923? 4 What is the millions digit of 7145109? 7 What is the hundreds digit of 768617? 6 What is the millions digit of 2632879? 2 What is the ten thousands digit of 266656? 6 What is the units digit of 3191601? 1 What is the thousands digit of 123201? 3 What is the ten thousands digit of 105344? 0 What is the hundreds digit of 8550363? 3 What is the tens digit of 77310? 1 What is the hundred thousands digit of 1	{ "pile_set_name": "DM Mathematics" }
+ (-4 + 1 + 2)(1 - 1 + 3a)(-1 + 3 + 2)(-6 + 2 + 1) in the form j + ka and give j. -1 Rearrange (-1 + 1 + 2)(-1 - 2 - 1)(-1 + 5 - 2)(-85r4 - 51r*3 + 35r*4 + 48r*4) to the form tr*3 + gr*4 + mr + vr2 + z and give t. 816 Express -44 + 182g*2 + 175g*2 + 9 + 36 in the form p + rg + sg2 and give s. 357 Rearrange (-23h*2 + 54h - 54h)(h*2 + 4h - 4h)(3 + 3 - 2) to the form zh + ch*4 + kh*3 + i + uh*2 and give c. -92 Express 9k + 2 + 6k - 2k*2 + k - 16k - 25k3 as r + pk*3 + ok + zk2 and give z. -2 Express 358l*3 + 7 - 3l - 357l3 + 5l in the form al + pl*3 + dl*2 + z and give a. 2 Express 186c - 22c + 40c as oc + u and give o. 204 Express 3x + x*3 + 59x*2 - 16x*2 - x + 0x*3 in the form sx + l + jx2 + ix*3 and give j. 43 Rearrange (0a + 0a - 2a)(24 + 40 + 225) to wa + m and give w. -578 Express 18s - 20s*2 - 5s*2 - 10s - 10s - 2s*3 as f + ms*3 + cs*2 + us and give m. -2 Rearrange 272t2 + 12t - 275t2 - 27t + 13t to k + vt + mt2 and give v. -2 Rearrange -3b + 3b - b + 4577 - 5135 - 2b to ub + k and give k. -558 Express -222p4 + p2 - p*3 - 226p*4 + 447p*4 - 2 in the form fp*2 + up*4 + a + zp + dp3 and give d. -1 Rearrange (5s*2 - 362s + 362s)(s*2 + 2s*2 - 6s*2)(0 + 2 + 0)(-1 + 5 - 3) to ns*4 + f + ms + js2 + xs*3 and give n. -30 Rearrange -116t + 51t - 34t - 208t to the form ot + x and give o. -307 Rearrange -91a + 48a + a*4 + 44a + 22a2 - 5a*3 + 4a*3 to ca*4 + za*3 + f + da*2 + ya and give c. 1 Rearrange -569 + 859m + 286 + 283 to the form v + om and give o. 859 Rearrange (-35u - 334 + 334 - 3u + 5u + u - 3u + 4u - 2u + (0 + 0 + 2)(-2 + u + 2))(2u + 3u - 4u) to tu*2 + mu + l and give l. 0 Express -21 + 16 - 8 + 11o2 as n + so + yo2 and give n. -13 Rearrange (-3 - 2 + 0 + (-3 + 0 + 1)(2 - 1 - 3) + 1 - 1 - 8 + (-3 - 1 + 3)(-1 - 1 + 1))(-5 - 12l + 5) to k + zl and give z. 96 Rearrange (-d - d + 4d)(0 + 678d - 120d + 2) to vd + w + td*2 and give t. 1116 Express 116f*2 + 165f*2 - 3f*2 + (7f*2 + 6f*2 - 2f*2)(-1 + 3 + 0) as v + df + af*2 and give a. 300 Express 7k4 - k3 + 1713 + 2k4 - 838 - 848 as hk + n + ak2 + tk*4 + sk*3 and give t. 9 Rearrange (4 - 4 + j)(0 + 7 + 4)(-30j + 17 + 28j + 6j) to the form f + sj2 + uj and give u. 187 Express 153x2 + 54x*2 + 186x*2 in the form kx + cx2 + r and give c. 393 Rearrange (0b - 3b2 + 0b)(0 + 2b + 0) - 244b3 + 309 - 309 to the form ub + rb2 + mb*3 + g and give m. -250 Express 7747k - 2 + 7762k - 15547k - 4k3 as u + ik*2 + nk + fk3 and give f. -4 Express (2q - 6q + 3q)(0q*2 + 6q2 - q2) - 6q + 4q - 2q3 + q3 as c + wq*2 + zq + sq3 and give z. -2 Rearrange o3 + 3o*3 + 2706o*2 - 3o*3 - 2708o*2 - 42 to the form qo*3 + so*2 + mo + x and give s. -2 Express (4 + 0 - 2)(4s - 3s - 2s)(1638s*2 - 1646s*2 + 4s*3 - 2s*3) as vs*2 + is*3 + ts*4 + o + gs and give t. -4 Express 176o2 + 248o - 491o + 242o as s + po2 + ro and give p. 176 Express (-58y + 51y - 95y)(-y + 4 - 4) + 0y2 - y2 + y + 3y*2 in the form ky*2 + sy + h and give k. 104 Rearrange 6 + 5c2 - 7 + 3c - 9c + 28c to the form t + oc + lc*2 and give o. 22 Express (w - 7 - 3w - 1)(1 - 4 + 2) as s + kw and give k. 2 Rearrange -2c2 + 2c*2 + 2c*3 + (-5c + 4c + 2c)(-382 + 382 + 253c*2) to the form u + nc*3 + gc + rc2 and give n. 255 Rearrange -16 - k + 53 - 15 + 422 to the form h + ak and give h. 444 Express (1 - 1 + 2)(-8p*3 + 4p*3 - 12p*3) - 9p*3 - 5p*3 + 0p*3 in the form cp*3 + bp + tp2 + u and give c. -46 Express (2 - 1 - 2)(1 - 5 + 1)(-b + 2b - 5 - 2b) in the form db + s and give d. -3 Rearrange (-4 - 2 - 2)(3b - 6b + 0b + (20b - 73b - 50b)(-4 + 3 - 1)) to the form d + ib and give i. -1624 Express -10 - 12d*2 + 33 - d - d - 21 in the form s + bd*2 + gd and give b. -12 Express 169u3 + 2u*2 - 2u + 2u - 164u*3 as ru*3 + au*2 + j + bu and give a. 2 Rearrange -t*2 - 3t*4 + 6t + 2t4 - 2 - 2t - 2t3 - 3t to the form o + bt4 + it*3 + at + ft2 and give f. -1 Rearrange (-2u + 0u + 4u)(-23u + 31u + 312u) + 5u2 + 2u*2 - 4u*2 to qu*2 + g + mu and give q. 643 Express 2q2 + q2 - q2 + (0 + 0 - q)(2q + 0q + 2q) - 9q2 - q2 - 2q2 in the form c + aq*2 + lq and give c. 0 Rearrange (-1 - 1 + 3 + 13i)(-2i - 7i + i) to the form ai2 + j + ui and give u. -8 Rearrange (-6j - 8j - j)(-2j + j + 0j) + (22j - 46j + 25j)(-2j - j + j) to the form tj2 + l + dj and give t. 13 Rearrange -83m - 491m*4 - 499m*4 + 987m4 - m2 - 31m to the form am*2 + om*4 + nm + i + sm3 and give a. -1 Express (-4 - z + 4)(1 + 3z - 1) + 0 + 2z*2 + 0 + 2 - 22z - 41z2 - 3 + 43z*2 as sz + g + cz2 and give c. 1 Express (2o*3 - 3o*3 - 5o*3)(4o - 5 - 3o + 13) in the form yo4 + so*3 + qo + fo2 + u and give s. -48 Rearrange -2t*3 - 7196 - 2t + 0t3 + 7205 - t to ut + mt2 + kt*3 + j and give m. 0 Express -2876 - 606a + 2876 in the form j + la and give l. -606 Rearrange -58g*2 + 23g - 50g2 - 14g - 11g to tg*2 + ug + w and give t. -108 Express (-2 - 27 + 7)(-49b - 81b + 37b) as a + xb and give x. 2046 Express -92o*2 + 150o*2 + 141o*2 + 50o*2 in the form so*2 + l + jo and give l. 0 Rearrange 808 + 452 - 3s2 + 4s*2 + 9s - 9s to the form c + ys + qs2 and give q. 1 Rearrange -514t*2 - 461t*2 + 913t*2 to the form pt + qt2 + c and give q. -62 Express (4 - 3 - 2)(p + p - 7p) + 5p + 3p - p in the form y + hp and give h. 12 Express 3n4 + 28n*3 + 125n*2 - 5n - 2 - 124n2 + 6n as pn2 + hn*3 + fn + w + rn4 and give h. 28 Express 6t + 9t - 5t + 3t - 4t + 3t + (-1 + 0 - 1)(17t + 6t - t) in the form st + v and give s. -32 Rearrange -2t*2 - 3 + 4t*3 - 3t3 + 13 + 4 + t3 + t to the form it2 + gt*3 + w + zt and give w. 14 Rearrange (22c - 8c + 1 - 13c)(7c + 0c - 3c)(-2c + 0c + 0c) to the form wc*2 + t + mc + hc3 and give h. -8 Rearrange 94m + 179m - 69m to the form x + km and give k. 204 Rearrange -k3 - 21 - 23k*2 + 5 + 24k*2 to y + bk*2 + jk + tk3 and give j. 0 Rearrange -473j*3 - 14j + 1015j3 - 498j*3 to qj + a + dj2 + yj*3 and give y. 44 Express -26 - 115 + 0q4 - q4 - 3q3 + 31 as zq + uq3 + lq*4 + yq*2 + h and give u. -3 Rearrange -3 - 1976v + 1911v + 3 to the form jv + c and give j. -65 Express 250d3 - 257d*3 + 2d*2 + 2d*2 + 2d*4 + d as o + fd + rd3 + cd*4 + nd2 and give r. -7 Rearrange b2 - b + b + (2b + 0 + 0)(-b - 2b + b) + 3b + 2b2 - 3b + 14b2 - 3b*2 + 0b*2 to the form y + tb*2 + lb and give t. 10 Rearrange g - 7 - 10g + 14g to the form y + bg and give b. 5 Express -2v*2 - 688v + 2v4 + 49 - 684v + 1371v in the form mv*4 + uv*3 + hv + n + xv2 and give m. 2 Express -2y - 2y + 5y + 2y - 3y + 3y + (2y + 3 - 3)(3 - 4 + 2) + y - 6y - 48 + 7y in the form t + jy and give t. -48 Rearrange (-v*2 - 5v*2 + 3v*2)(-2v2 + 4v*2 + 0v*2 + (3v - 3v + 2v)(-10 + 3v + 10)) to the form wv2 + pv*3 + kv + zv4 + j and give z. -24 Express (32z + 102z - 18z)(3z - z - 3z) as vz + a + cz2 and give c. -116 Express l3 - 757 + 382 + 2l + 387 in the form f + cl + kl*3 + hl*2 and give c. 2 Rearrange 36p*3 - 35p*2 + 10 - 35p*2 + 70p*2 + 3p*4 - 8 to the form yp + op3 + r + bp*4 + up*2 and give r. 2 Rearrange -292n + 458n - 309 + 309 + 952n to in + k and give i. 1118 Express 15 + 3u*2 + 22 + 14 - 8 as mu*2 + nu + a and give m. 3 Express 105i2 + 104i*2 + 1 - 192i*2 in the form o + ci*2 + ji and give o. 1 Rearrange (-1 + 1 + w)(3w + 1 - 1 + (-2w + 0w + 3w)(1 + 3 - 5) - 20w - 2 - 24w + 41w) + 2w2 - w2 - 3w2 to rw*2 + dw + x and give d. -2 Rearrange (z*2 - 4z2 + z2)(-z2 - 1 + 1) + 12z*4 - 8z*4 - z + 9z*4 - 4 to sz*2 + pz*3 + oz + qz*4 + f and	{ "pile_set_name": "DM Mathematics" }
ters are there in 76/5 of a micrometer? 15200 What is twenty-one eighths of a litre in millilitres? 2625 What is 53.44365 millennia in years? 53443.65 What is 40566.32 micrometers in nanometers? 40566320 What is 919307.6km in centimeters? 91930760000 How many millilitres are there in three eighths of a litre? 375 How many milliseconds are there in 2.95092 days? 254959488 Convert 9281.54s to milliseconds. 9281540 How many grams are there in 57.88775 milligrams? 0.05788775 How many decades are there in 17/4 of a millennium? 425 What is 227.85417 seconds in hours? 0.063292825 Convert 4.014059mm to centimeters. 0.4014059 How many years are there in thirty-one fifths of a century? 620 What is sixty-one halves of a microsecond in nanoseconds? 30500 How many millilitres are there in 17/4 of a litre? 4250 How many tonnes are there in 25869.55kg? 25.86955 Convert 0.5825213nm to millimeters. 0.0000005825213 How many millilitres are there in eleven halves of a litre? 5500 How many millimeters are there in 0.8061125um? 0.0008061125 What is 2/75 of a millennium in months? 320 What is 26008.35ng in micrograms? 26.00835 Convert 99688673.7us to weeks. 0.00016482915625 Convert 0.5381823 litres to millilitres. 538.1823 What is 0.7595705 micrometers in nanometers? 759.5705 How many micrograms are there in 393.3182t? 393318200000000 How many millilitres are there in 0.3248079 litres? 324.8079 How many millimeters are there in eighteen fifths of a centimeter? 36 What is twenty-five halves of a millennium in decades? 1250 What is 10075.08 weeks in minutes? 101556806.4 What is 0.0493532 millilitres in litres? 0.0000493532 How many minutes are there in 49/5 of a week? 98784 What is 52/5 of a litre in millilitres? 10400 What is 3.637826ml in litres? 0.003637826 What is 3589.055t in nanograms? 3589055000000000000 What is 3/10 of a litre in millilitres? 300 Convert 4671.74 milligrams to kilograms. 0.00467174 How many milligrams are there in 5622.908ug? 5.622908 What is 6/5 of a day in minutes? 1728 How many minutes are there in fourty-two fifths of a week? 84672 What is 878.4062 tonnes in grams? 878406200 How many seconds are there in three fifths of a day? 51840 What is 9946.474 decades in years? 99464.74 How many milliseconds are there in 0.1038586 microseconds? 0.0001038586 Convert 985.556l to millilitres. 985556 How many millilitres are there in seven quarters of a litre? 1750 How many hours are there in five quarters of a week? 210 How many litres are there in 7938.735ml? 7.938735 Convert 3257.398 minutes to seconds. 195443.88 What is 0.4331395ml in litres? 0.0004331395 What is 11/8 of a milligram in micrograms? 1375 How many hours are there in 26/7 of a week? 624 What is 19149.744 microseconds in minutes? 0.0003191624 What is 378.8295 millilitres in litres? 0.3788295 How many micrometers are there in 7/25 of a centimeter? 2800 What is 3/5 of a micrometer in nanometers? 600 How many minutes are there in 4/3 of a day? 1920 How many meters are there in twenty-seven fifths of a kilometer? 5400 Convert 0.70181 days to milliseconds. 60636384 What is 72614.06km in centimeters? 7261406000 What is five quarters of a litre in millilitres? 1250 How many millimeters are there in three tenths of a meter? 300 How many millilitres are there in 185102.2 litres? 185102200 Convert 477.0188 days to microseconds. 41214424320000 What is eleven halves of a millennium in decades? 550 How many grams are there in 11587.59 milligrams? 11.58759 How many kilograms are there in three fifths of a tonne? 600 How many nanoseconds are there in 1/10 of a microsecond? 100 What is 547909.6 meters in millimeters? 547909600 What is 93.85816kg in tonnes? 0.09385816 What is thirty-seven halves of a centimeter in millimeters? 185 How many millilitres are there in one tenth of a litre? 100 What is 41.0094 millimeters in kilometers? 0.0000410094 What is thirteen quarters of a litre in millilitres? 3250 What is 4.824732 years in months? 57.896784 How many centimeters are there in 24.53524 micrometers? 0.002453524 How many micrograms are there in 6/5 of a milligram? 1200 What is 3984.9m in nanometers? 3984900000000 What is 345680.19s in hours? 96.022275 What is 1/30 of a minute in milliseconds? 2000 What is 3.773383 grams in kilograms? 0.003773383 Convert 426.2269 tonnes to micrograms. 426226900000000 How many millimeters are there in 6/25 of a meter? 240 How many hours are there in 252.91641 minutes? 4.2152735 What is twenty-seven fifths of a day in minutes? 7776 What is 916300.7nm in centimeters? 0.09163007 How many months are there in nineteen quarters of a year? 57 Convert 5.3392 millennia to decades. 533.92 Convert 34.92369 nanoseconds to days. 0.000000000000404209375 How many micrograms are there in three fifths of a milligram? 600 How many meters are there in one fifth of a kilometer? 200 How many millilitres are there in 15/4 of a litre? 3750 What is three eighths of a millisecond in microseconds? 375 Convert 2.18667t to nanograms. 2186670000000000 What is 8264.526mg in kilograms? 0.008264526 What is 4.96757 millimeters in meters? 0.00496757 Convert 5.641135ng to grams. 0.000000005641135 Convert 0.0189053 hours to nanoseconds. 68059080000 How many millilitres are there in 31/5 of a litre? 6200 Convert 23.61433 millilitres to litres. 0.02361433 What is 62898.16 milligrams in kilograms? 0.06289816 How many milligrams are there in 7.817956 micrograms? 0.007817956 How many centimeters are there in seventeen quarters of a meter? 425 What is four thirds of a week in minutes? 13440 Convert 65.831886ms to hours. 0.000018286635 How many millennia are there in 2853.3375 months? 0.237778125 How many millilitres are there in one quarter of a litre? 250 Convert 9262.482l to millilitres. 9262482 What is 97599.33ms in nanoseconds? 97599330000 How many millilitres are there in 0.0073033 litres? 7.3033 What is 3/5 of a kilogram in grams? 600 How many decades are there in 61281.32 years? 6128.132 How many hours are there in 7/4 of a week? 294 Convert 376034.1 millilitres to litres. 376.0341 What is twenty-six fifths of a litre in millilitres? 5200 What is fifty-two fifths of a litre in millilitres? 10400 What is eleven quarters of a litre in millilitres? 2750 What is 8.742276 millilitres in litres? 0.008742276 Convert 171200.6 millimeters to micrometers. 171200600 How many hours are there in 4/3 of a day? 32 How many meters are there in twenty-nine fifths of a kilometer? 5800 How many nanoseconds are there in 3.51039s? 3510390000 Convert 52870.97 decades to millennia. 528.7097 What is 84912.51 milligrams in grams? 84.91251 What is 21851.94 grams in tonnes? 0.02185194 How many litres are there in 37391.77 millilitres? 37.39177 How many millimeters are there in 0.6612107cm? 6.612107 How many millilitres are there in 41/2 of a litre? 20500 How many millimeters are there in fifty-four fifths of a centimeter? 108 What is 1/4 of a minute in milliseconds? 15000 What is 79/3 of a hour in seconds? 94800 Convert 0.887267mm to nanometers. 887267 Convert 8649.125 micrograms to grams. 0.008649125 What is seven quarters of a millisecond in microseconds? 1750 How many milligrams are there in 0.675135 nanograms? 0.000000675135 How many months are there in 8/3 of a decade? 320 Convert 2.246542l to millilitres. 2246.542 How many milligrams are there in thirty-seven halves of a gram? 18500 What is 1/24 of a week in minutes? 420 What is 3/5 of a gram in milligrams? 600 What is 552.7782 milligrams in tonnes? 0.0000005527782 How many days are there in 8087249.7 minutes? 5616.145625 How many months are there in eleven halves of a century? 6600 How many milligrams are there in 1/10 of a gram? 100 What is 42/5 of a microsecond in nanoseconds? 8400 Convert 52.81317 millennia to months. 633758.04 What is 714481.2 millennia in months? 8573774400 What is 7/4 of a litre in millilitres? 1750 How many months are there in 52.01308 millennia? 624156.96 What is 1562.142 micrometers in millimeters? 1.562142 What is 36.93976 litres in millilitres? 36939.76 What is 0.0629953km in nanometers? 62995300000 What is 1/10 of a meter in millimeters? 100 How many centimeters are there in 3/10 of a kilometer? 30000 How many weeks are there in 58.3967664 minut	{ "pile_set_name": "DM Mathematics" }
2 + 52z - 116. Let b be j(-28). Give o(b). 38 Let u(v) = -v3 - 20v2 + v + 11. Let a(o) = -o3 + 47o2 - 55o + 394. Let z be a(46). Calculate u(z). -9 Let t be (3/(-1))/((-2)/474). Let l = t + -714. Let o(n) = n3 - n2 + 2. Calculate o(l). -34 Let v(q) = -q*3 - 3. Let j = -20 - -13. Let d = j - -10. Suppose 0 = 2h - dh. Give v(h). -3 Let l(r) = r3 + 18r*2 + 32r + 1. Let s be ((-2808)/(-1755))/((-2)/20). What is l(s)? 1 Let k = -4870 - -4863. Let q(b) = b*2 - 3b - 15. What is q(k)? 55 Let y(f) = -f*3 + 16f + f - 23f - f + 54f - 21f2 + 32. Give y(-23). 9 Let d(x) = -2x*2 + 59x - 24. Let g be d(29). Let h(b) = -gb2 - 7 + 5b*2 + 8b - 3b - b2. Determine h(7). -21 Suppose 4j + j - 2 = 4b, -2j = -3b + 2. Let u(f) = -31f*2 + 11f2 - 1 - f3 - 4f + 5f + 14fj. Let r be 1/(-1) - (6 + -1). Determine u(r). -7 Let s(a) = -1 + 2181a + 2185a - 6554a + 2187a. Let b(l) = 1. Let z(d) = d - 5. Let i(f) = 6b(f) + z(f). Let t(o) = -2i(o) - 3s(o). Give t(5). 6 Let p(j) = -j*2 - 5j + 5. Let w = 64 - 59. Let d(r) = 10r + 5 - wr - 22 - 4r. Let f be d(11). Determine p(f). -1 Let v = -2900 + 2899. Let a(m) = 34m*3 - 3m - 2. Determine a(v). -33 Let m be (2 + -2 + -1)1. Let o(x) = 3x3 + x2 + x - 4. Let i(r) = 18r3 + 9r*2 + 9r - 37. Let z(k) = -i(k) + 9o(k). Calculate z(m). -8 Let n(c) = -c3 + 4c*2 - 3c. Let b be n(2). Suppose 5d = -bd - 35. Let y be (d/20 - 14/8) + 5. Let l(z) = z - 5. Determine l(y). -2 Suppose 698 = -7t + 642. Let a(h) be the second derivative of -h5/20 - 3h*4/4 - 4h*3/3 - 5h*2/2 - 13h + 1. Calculate a(t). -5 Let x(i) = 333i2 + 2i - 1. Let v be x(1). Let s(b) = v - 4b - 671 + 336. What is s(1)? -5 Let b = 8 + -5. Suppose 0 = -5y + bo + 62, -4y + o + 0o = -44. Let x(c) be the third derivative of -c4/12 + 7c*3/3 + 17c*2 + 5c. Determine x(y). -6 Let m be (52/65)/(38/20 + -2). Let x be (m - -7)/(1/(-20)). Suppose -a + x = -11a. Let d(s) = -2s - 3. What is d(a)? 1 Let r(c) = -c*2 - 1 + 3 + 5c*2 - 3. Let p(d) = 2d*2 - 25d - 14. Suppose -2o = -2m + 2o + 10, -m + o = -9. Let u be p(m). Give r(u). 3 Let v = -247 + 601. Let r = -339 + v. Let k(y) = y2 - 16y + 7. Determine k(r). -8 Let v(s) be the second derivative of 113 + 2s + 5/12s*4 + 1/20s*5 + 5/6s*3 + 2s2. Give v(-2). 6 Let k(l) = -l3 + 11l2 - 12. Let x(r) = -12r - 193. Let m be x(-17). Give k(m). -12 Let q(s) be the third derivative of s7/840 - s6/60 - s5/24 - s4/3 + 11s3 - 6s*2. Let c(z) be the first derivative of q(z). Determine c(7). 6 Let b be 1/(-3) + (-24)/36. Let t be (-178)/(-4) + -4b/(-8). Let m be (-8)/t + (2 - (-48)/22). Let z(h) = -h*2 + h + 4. Calculate z(m). -8 Suppose -6642w + 6666w - 48 = 0. Let c(n) = -11n*3 + 3n2 + n - 1. What is c(w)? -75 Let x(k) = -k2 - 6k + 2. Let q(d) = -89d*2 - 536d - 17. Let l be q(-6). Calculate x(l). 7 Suppose -5m + 4u = -47 + 9, 2m - 22 = 5u. Let g(n) = 2n - 28. Give g(m). -16 Let d(i) = -12i - 31. Let a(h) = -165h - 5120. Let v be a(-31). Give d(v). 29 Let r(n) be the first derivative of n4 + n3/3 + n2 + n - 7611. Let c(s) = -s2 - s + 2. Let q be c(-2). Suppose 4 = -4l - q. Give r(l). -4 Let b be (9/6)/(213/568). Let l(f) be the third derivative of -7/40f6 - 21f*2 + 1/60f*5 - 1/24f*b + 0f + 0 + 1/6f3. What is l(1)? -20 Let h(w) be the first derivative of -3w*2 + 173w + 1846. Give h(29). -1 Let x(z) = z*2 - 5z + 8. Let l(v) = v*3 + 5v*2 - 7v - 17. Let j be l(-5). Suppose j = 3n - 3. Calculate x(n). 22 Let a(m) be the third derivative of 6 + 0m + 1/12m4 - 16m*2 - 5/3m*3. Give a(6). 2 Let c(l) = l + 2. Let s(h) = 1. Let r(n) = n + 6. Let z(k) = r(k) - s(k). Let d(q) = 3c(q) - 2z(q). Let v(o) = -o2 + 5o + 6. Let p be v(6). Calculate d(p). -4 Let t(u) = -u*3 - 8u*2 + 7u - 1. Let j be t(-7). Let w = -94 - j. Let r(f) = -2f2 + 0f - 3f2 + wf + 3 + 4f2. Determine r(5). 3 Let z(q) = -53q*2 + 63q2 + q3 + 118 - 128. Give z(-10). -10 Let a(j) be the first derivative of 3j2 + 414j - 913. Determine a(-68). 6 Let x(d) = -d + 11. Let t be -1 + (-6 - -24) + -10. What is x(t)? 4 Let p be 9(-1)/(-2)14/(-21). Let l(o) = -o - 2. Let s be l(p). Let w(u) = s + 14u3 - 2 + u - 31u*3 + 0. Give w(1). -17 Let o(g) = -4 - 2 + 33g - 38g. Let a(y) = -1. Let m(x) = x + 2. Let l(n) = 2a(n) + m(n). Let p(v) = 6l(v) + o(v). Give p(0). -6 Let m be -89486/(-9)(-9)/(-24). Let v(t) = t2 - 11t + t + m - 2226. Determine v(9). 2 Let f(p) = 2p + 5p - 9p + 22p*3 - 4p*2 - 36p*3 + 11p*3 - 8. Give f(-2). 4 Let c(f) = 3f. Suppose 3x + 76 = 4x. Suppose -q = g - 37 + 115, -2g = -4q - 306. Let p = q + x. Determine c(p). -3 Let r(f) be the third derivative of f5/4 + f4/24 - f*3/6 + 4f*2 + 1. Suppose 9p + 4 = -5. What is r(p)? 13 Let i(o) be the second derivative of -7o3/6 + 5o*2/2 - 17o - 7. Give i(-7). 54 Let j(x) = -2 - 6x + 31x*3 - 3 + 440x*2 - 442x*2. Let c(t) = -10t3 + t2 + 2t + 2. Let p(n) = 8c(n) + 3j(n). What is p(1)? 14 Let g be (15864/16)/(3/2). Let p = g + -650. Let i(h) = h2 - 9h - 14. Calculate i(p). 8 Let q(h) = -h + 9. Suppose 277f + 20 = -k + 273f, 0 = 5k - 5f + 100. Determine q(k). 29 Let b(h) = -134h - 2414. Let a be b(-18). Let f(i) be the third derivative of 1/15i*5 + 1/6i*3 + 0 + 0i + i*2 - 1/12i*4. Give f(a). 21 Let n(z) = -13z*2 + 13z + 61. Let w(m) = 10m2 - 14m - 60. Let h(q) = -4n(q) - 5w(q). Calculate h(-6). 20 Let w(f) = 11f3 + 10f*2 + 5f + 60. Let c(b) = -20b3 - 18b*2 - 9b - 110. Let r(q) = -6c(q) - 11w(q). Let g = -4 - -2. Give r(g). 2 Let z = 8620 + -8615. Let h(w) be the first derivative of 14 + zw - 1/2w2. Determine h(-5). 10 Let a(w) = -w3 + 11w2 + 22w + 54. Suppose 7937g - 83 = 7923g + 99. What is a(g)? 2 Suppose g + b + 3 = 0, 4b + 2 + 4 = -g. Let u(q) = -q + 1. Let j(d) = 2d - 1. Let a(s) = 5j(s) + 6u(s). Determine a(g). -7 Let k(w) be the second derivative of 1/2w2 + 1/6w*3 + 0 - 78w. Give k(-9). -8 Let m = -5886 - -5907. Let n(o) = o*2 - 20o - 24. Determine n(m). -3 Let y(b) be the first derivative of -35b2/2 - 211b + 3046. Calculate y(-6). -1 Let z(h) = 4h - 93. Let a be 29824/(-699)(-3)/4 + -7. Calculate z(a). 7 Let b(g) be the second derivative of -g5/60 - g4/6 - 5g3/6 - 26g*2 - 52g + 2. Let z(j) be the first derivative of b(j). Determine z(-4). -5 Let c(a) = 27a3 - 7a*2 - 35a + 128. Let i(n) = -11n3 + 4n*2 + 17n - 63. Let j(r) = -2c(r) - 5i(r). Give j(7). 3 Let n(j) be the first derivative of -j*4/4 - 5j3/3 - j2/2 - 337. Let m = 7 + -5. Suppose -mf - 3 + 29 = -4y, -4y + 4f - 32 = 0. Give n(y). 5 Let k(f) = -f - 245. Let i(j) = -j - 323. Let y(d) = 3i(d) - 4k(d). Let o(l) = -l*2 + 7l - 2. Let b be o(9). Determine y(b). -9 Let x(n) be the third derivative of n5/60 - n4/8 - 5n3/2 + 1473n*2. Calculate x(4). -11 Let v(s) = -30s + 84. Let b = -1748 + 1751. Calculate v(b). -6 Suppose g - 2g = 5r + 12, -2r = 3g + 10. Let y(p) = 6p2 - 2106p + 1. Let h(m) = 7m2 - 2527m + 1. Let t(k) = 5h(k) - 6y(k). What is t(r)? -7 Let u(r) be the third derivative of -7r2 + 0r*3 + 0r + 5/24r4 + 0. Let s(f) = -f3 - 36f*2 + 75f - 39. Let l be s(-38). Determine u(l). -5 Let v(b) be the first derivative of -b*5/120 + 23b*4/24 + 2b*3/3 + 11b2/2 + 72. Let c(q) be the third derivative of v(q). What is c(10)? 13 Let p(f) = f3 - 8f2. Let j be p(8). Suppose j = 2q - 3v - 23, 0q + 5q + 5 = -5v. Let s(i) = 4i - 79i*2 - 81i*2 - q + 159i*2. What is s(3)? -1 Let t(h) = 12h*2 + 175. Let s(g) = 7g*2 + 103. Let a(i) = -5s(i) + 3t(i). Calculate a(-9). 91 Let w(l) = -l3 - 2l*2 + 4l + 6. Let r be w(-3). Let h be 3 + 3 + r + -3 + -4. Let o(n) = 0 + 9n2 - 4n*h - 3n*2 + 2n - n*3 + 1. What is o(-1)? 2 Let y = 71 - 74. Suppose 0i + 2i - 10 = -2k, -2k + 14 = 3i. Let a(b) = -4b2 - i + 4b*2 - 6b + 5b + b2. Determine a(y). 8 Let m(z) be the third derivative of -1/2z*3 + 11z + 0 + 4z2 + 5/24z*4. Give m(-3). -18 Let z be ((-736)/368)/(-2(-1)/(-5)). Let i(k) = k*3 - 5k*2 - 2k - 6. Give i(z). -16 Let n(a) =	{ "pile_set_name": "DM Mathematics" }
is 11 - 302030? -302013 In base 10, what is 4 + -57? -53 In base 15, what is -2 + -e? -11 In base 5, what is -104 + -2? -111 In base 7, what is -21 + 5? -13 In base 12, what is -21 - 3? -24 In base 16, what is 18 + -23? -b In base 16, what is 8 - 27e? -276 In base 7, what is 123 - -2? 125 In base 9, what is 2 + 100? 102 In base 9, what is -40 + 43? 3 In base 2, what is -110 + -1000? -1110 In base 7, what is -346 - 3? -352 In base 4, what is -11 + -3032? -3103 In base 6, what is -5351 - 3? -5354 In base 8, what is 0 + 34? 34 In base 8, what is -364 + -2? -366 In base 4, what is 13233 + 200? 20033 In base 12, what is 123 + 2? 125 In base 11, what is -81a + -3? -822 In base 5, what is 122 + -10? 112 In base 10, what is 34 - -12? 46 In base 6, what is 1343 + -10? 1333 In base 5, what is 201 + -4? 142 In base 3, what is 2 - 12001? -11222 In base 15, what is -5 + -71a? -720 In base 5, what is -4 - 311? -320 In base 4, what is 3 + 2011? 2020 In base 4, what is -10210 + 3? -10201 In base 14, what is 2 - b? -9 In base 6, what is 301 + 4? 305 In base 6, what is -44322 - 5? -44331 In base 7, what is 136 + 20? 156 In base 6, what is -110 - 0? -110 In base 6, what is -1 - 20433? -20434 In base 2, what is -101010011 - -10? -101010001 In base 8, what is -6 - -1? -5 In base 2, what is 1010 - 10100000? -10010110 In base 15, what is -63 - -1? -62 In base 13, what is 3 - -10a? 110 In base 15, what is 1 - -18b4? 18b5 In base 11, what is 2 + 583? 585 In base 15, what is -94 - 5? -99 In base 14, what is -12 + -34a? -35c In base 13, what is -2 + -21? -23 In base 2, what is 100111110000 - -101? 100111110101 In base 2, what is -11 - 100110101? -100111000 In base 12, what is 67a - -a? 688 In base 16, what is 13 + 90? a3 In base 14, what is -5 - -ab? a6 In base 6, what is 304 + 4? 312 In base 9, what is -1 + 138? 137 In base 8, what is -175 + 135? -40 In base 13, what is 2c - 1? 2b In base 6, what is 5 - 13052? -13043 In base 16, what is 5 - -529? 52e In base 9, what is 5 - -16? 22 In base 4, what is 202 + 11202? 12010 In base 3, what is 22 - -120? 212 In base 3, what is -11201 - 120? -12021 In base 11, what is 1 - 2156? -2155 In base 16, what is -1 + -36? -37 In base 6, what is -221 - 152? -413 In base 5, what is -111 + -1024? -1140 In base 3, what is 1001020 + 10? 1001100 In base 8, what is 141 - -4? 145 In base 7, what is 5 + 420? 425 In base 15, what is 4 - 54? -50 In base 3, what is -1 + -11? -12 In base 10, what is -2 - 54? -56 In base 4, what is 223 - 11? 212 In base 5, what is 1200 + 3? 1203 In base 2, what is 111 - -1101? 10100 In base 6, what is -4 - -1211? 1203 In base 16, what is -21 - -4? -1d In base 9, what is -10 - -2? -7 In base 6, what is 13 + 22? 35 In base 6, what is 3 - -2333? 2340 In base 9, what is 118 - -5? 124 In base 12, what is 33 - 20? 13 In base 11, what is 2 + 59? 60 In base 6, what is -3 - 2253? -2300 In base 5, what is -31 + -120? -201 In base 14, what is -2 - -d8? d6 In base 11, what is -382 - 8? -38a In base 10, what is -26 + 52? 26 In base 16, what is 4 + 37? 3b In base 15, what is 350 - -2? 352 In base 3, what is -10 - -11011? 11001 In base 15, what is -84 + -4? -88 In base 14, what is -3 + d8? d5 In base 4, what is -2323 + -300? -3223 In base 5, what is 10 + -2210? -2200 In base 11, what is 4269 + -1? 4268 In base 11, what is -49 + 9? -40 In base 9, what is -383 + -10? -403 In base 11, what is -16 - -13? -3 In base 15, what is 8 - 7? 1 In base 4, what is 11 - -3020? 3031 In base 10, what is 0 + 5? 5 In base 12, what is 2057 + 3? 205a In base 15, what is -11 + -38? -49 In base 5, what is -30 - 3104? -3134 In base 5, what is -2 - 1130? -1132 In base 6, what is -202 - 12? -214 In base 5, what is 32 - -203? 240 In base 14, what is 1 + -1344? -1343 In base 8, what is 22 + 20? 42 In base 5, what is -31040 - 10? -31100 In base 13, what is 23b + -1? 23a In base 6, what is 113 - -3? 120 In base 2, what is -10 + -11011110? -11100000 In base 15, what is -59b + -3? -59e In base 10, what is 845 - 10? 835 In base 8, what is -126 - 26? -154 In base 14, what is 37 + -3? 34 In base 11, what is -a22 - 4? -a26 In base 5, what is -240 - 3? -243 In base 6, what is 50 - 2? 44 In base 7, what is 23 + 15? 41 In base 4, what is 322 + -2? 320 In base 15, what is 3 + -18a? -187 In base 6, what is -5 + -12002? -12011 In base 12, what is -4 - 82? -86 In base 9, what is 130 + 1? 131 In base 15, what is -39 + -6? -40 In base 15, what is -391 - 0? -391 In base 14, what is -1c7 - -2? -1c5 In base 5, what is -403 - -224? -124 In base 3, what is -1011 - 222? -2010 In base 8, what is -1 - 163? -164 In base 15, what is -1 - -7? 6 In base 13, what is -25 - 8? -30 In base 6, what is 221 - -10? 231 In base 13, what is 5 + -bc7? -bc2 In base 9, what is -10 - 6? -16 In base 10, what is -5 - -439? 434 In base 6, what is 22 - 50? -24 In base 11, what is 2 - 58? -56 In base 8, what is -36 + -446? -504 In base 11, what is 29 + 3? 31 In base 10, what is 6040 + 4? 6044 In base 13, what is -3 - -b1a? b17 In base 14, what is 4 - -1986? 198a In base 14, what is 43 - -1d5? 238 In base 9, what is 17 + 147? 165 In base 12, what is 1 + 692? 693 In base 3, what is -111 - 1202? -2020 In base 8, what is 11 + -26? -15 In base 2, what is -101 - -1101100110? 1101100001 In base 2, what is -1000001111 - 0? -1000001111 In base 14, what is -19d8 - 5? -19dd In base 8, what is 1351 + 1? 1352 In base 14, what is -803 - -2? -801 In base 14, what is -489b + 4? -4897 In base 13, what is -3 - 386? -389 In base 12, what is -4 - -33? 2b In base 5, what is 1 - 200? -144 In base 14, what is -77 - 3? -7a In base 15, what is 7 + 14? 1b In base 14, what is -5 + -16? -1b In base 12, what is 1a3 + -2? 1a1 In base 3, what is -20201111 + -1? -20201112 In base 3, what is 10 - 1022020? -1022010 In base 12, what is 6249 - 4? 6245 In base 8, what is -11 + -12? -23 In base 13, what is -313 - -2? -311 In base 8, what is 15 + -16? -1 In base 8, what is 0 + 0? 0 In base 11, what is 1a + -32? -13 In base 10, what is -968 - -2? -966 In base 9, what is 155 - -45? 211 In base 3, what is 112 + -2221? -2102 In base 7, what is -3 - -5? 2 In base 8, what is 4 + 4177? 4203 In base 5, what is 230 - -101? 331 In base 11, what is -57 - -46? -11 In base 15, what is -3 - 14a4? -14a7 In base 7, what is -236 + -3? -242 In base 6, what is -131 - 5? -140 In base 9, what is 1186 - 4? 1182 In base 10, what is -342 + -1? -343 In base 4, what is 2 - 11? -3 In base 2, what is -1011 + -10100100? -10101111 In base 11, what is -5 - 158? -162 In base 5, what is 43404 + 1? 43410 In base 10, what is 13 - -20? 33 In base 14, what is bb + -26? 95 In base 2, what is 1100101000 - 1? 1100100111 In base 6, what is -3 - 240? -243 In base 8, what is 23237 + 1? 23240 In base 4, what is 20100 - 1? 20033 In base 11, what is 48 - 2? 46 In base 14, what is 0 + 27? 27 In base 6, what is 141 + -3? 134 In base 11, what is -3 + -541? -544 In base 13, what is -4 - -88? 84 In base 8, what is -1 - -20? 17 In base 4, what is 32 + -11? 21 In base 2, what is 1010110 - -10? 1011000 In base 6, what is -3 + -11? -14 In base 11, what is -78 + -26? -a3 In base 14, what is -a - -4? -6 In base 3, what is 10 + -10002? -2222 In base 2, what is 1010101 - 101011? 101010 In base 16, what is -1a - -3c8? 3ae In base 5, what is -34 + -344? -433 In base 2, what is -11 + -11? -110 In base 15, what is -5 + -67? -6c In base 11, what is -3601 + 3? -35a9 In base 4, what is -303 + 23? -220 In base 3, what is 2210 + 12? 2222 In base 5, what is -2430 - 21? -3001 In base 2, what is -11 - 11100110111? -11100111010 In base 11, what is -223 + 3? -220 In base 15, what is 8 + a? 13 In base 8, what is -14 + 5? -7 In base 5, what is 10 + -131? -121 In base 3, what is -22 + 222? 200 In base 11, what is -3 + -19? -21 In base 8, what is 573 + 5? 600 In base 6, what is 3 - -4044? 4051 In base 10, what is 228 - 3? 225 In base 13, what is -2387a + -2? -2387c In base 11, what is -16 - -4? -12 In base 12, what is 3 + -147? -144 In base 7, what is -2 + 314? 312 In base 16, what is -b2 - 1? -b3 In base 5, what is 11 + 3? 14 In base 8, what is 7476 - 0? 7476 In base 8, what is 5 - 1? 4 In base 14, what is -55 + -4? -59 In base 13, what is 3 - 3c32? -3c2c In base 12, what is 3 - -48? 4b In base 9, what is -6 - -6	{ "pile_set_name": "DM Mathematics" }
10 Product of 4 and 16. 64 Product of -1086 and -8. 8688 Calculate 120.211. 2.532 What is the product of -39.2 and 2? -78.4 -0.41105 -43.05 What is -160 times 9? -1440 Product of 30 and -0.1. -3 -995 * -4 3980 What is the product of -1287 and -2? 2574 What is 0.2 times 50.6? 10.12 Work out -13 * 0.03. -0.39 What is the product of -0.5 and -20? 10 -0.03 times 4823 -144.69 Calculate 0.21.08. 0.216 1 -25 -25 What is -1.7 times 0.2? -0.34 What is the product of 19 and 198? 3762 Product of -4 and -4207. 16828 0.4 times 1 0.4 -40 * -30 1200 Calculate 0.190. 9 Calculate -36.80.5. -18.4 -13-8.4 109.2 Product of -3 and -0.046. 0.138 What is the product of 0.4 and -0.03? -0.012 Multiply -136 and -18. 2448 What is the product of 1.24 and -0.5? -0.62 What is the product of -0.039 and -14? 0.546 -81.5 5 -407.5 -0.12 times -164 19.68 Multiply -40 and -158. 6320 Calculate -59-8. 472 What is the product of -1.899 and -0.3? 0.5697 What is the product of -6 and -203? 1218 What is the product of -5 and -1? 5 What is the product of -159 and -0.9? 143.1 What is 0.018 times 3? 0.054 What is 63 times 0.3? 18.9 What is the product of -123 and -10? 1230 0.38810 3.88 Work out 1.3 * 0.208. 0.2704 Work out 0 * -5.96. 0 What is -0.0633 times 0.1? -0.00633 Multiply -0.09 and 8.57. -0.7713 Multiply 1202 and 4. 4808 -300.01 -0.3 Product of 4 and 706. 2824 What is -40.6 times -0.5? 20.3 Work out 2 0.29. 0.58 4 times -144 -576 Product of 17318 and 0.1. 1731.8 Calculate -669-0.5. 334.5 Calculate -41.98. -7.92 -0.4427 -170.8 Multiply -0.5 and 515. -257.5 Calculate -70.3. -2.1 Calculate -0.0396. -0.234 Work out -104 -5. 520 Product of 163 and 0.3. 48.9 What is the product of -29.1 and -5? 145.5 Product of -16 and -4. 64 6.28 * 1 6.28 Multiply 2 and -52.7. -105.4 Multiply -2688 and 0.2. -537.6 Calculate 0.0230. 0 What is the product of -0.5 and -0.2? 0.1 What is 4 times 0.0822? 0.3288 Product of -0.2 and -0.072. 0.0144 Product of 59 and -0.5. -29.5 Multiply 5 and 110. 550 0.042-0.3 -0.0126 Product of -5 and -50. 250 2559 * -2 -5118 Product of -5 and -41. 205 -0.56 times 0.45 -0.252 0.01121.3 1.213 -110.2-4 440.8 -0.20.44 -0.088 Calculate 791. 79 Calculate 3370. 0 Calculate -50460.4. -2018.4 Calculate 0.261.1. 0.286 Work out -1881 -0.2. 376.2 -0.68 times -12.6 8.568 Calculate 17955. 16235 -1244 -496 Calculate -7.070.1. -0.707 4 -0.599 -2.396 What is -51 times -30? 1530 What is -1.1 times 69? -75.9 -0.5 times 1450 -725 What is 0.2 times -0.3976? -0.07952 What is the product of 2.46 and -0.7? -1.722 -0.4 times -7.9 3.16 -2274 times 0 0 -8447 times -4 33788 34870 0 23.83 71.4 What is the product of 135 and -0.1? -13.5 Product of 0.3 and 0.753. 0.2259 1.487-0.1 -0.1487 What is -0.12 times -363? 43.56 Product of 0.4 and -159. -63.6 -20.6 times 59 -1215.4 Calculate 1-0.08. -0.08 Calculate 2512. 300 Product of -53 and -0.6. 31.8 Work out -467 5. -2335 What is the product of 0.08 and 2.299? 0.18392 Multiply 0.1 and -15. -1.5 Calculate -4-333. 1332 Multiply -446 and 4. -1784 84115 12615 What is 0.17 times 30.5? 5.185 Product of 1.8 and 0.12. 0.216 0.051761 88.05 Product of -0.34 and -0.134. 0.04556 Product of -0.046 and -0.5. 0.023 Multiply 20.08 and -3. -60.24 Work out 1 0.84. 0.84 What is 0.02 times -173? -3.46 Multiply 75 and 26. 1950 Work out 1916 * -1. -1916 Product of 3037 and -0.2. -607.4 Calculate -1.13-5. 5.65 Multiply 1.23 and -7. -8.61 -4277 -1108 Product of -1 and 1330. -1330 60940 24360 Calculate 6.6-31. -204.6 Product of 5 and 0.139. 0.695 Multiply 875 and -5. -4375 Work out -3 * -0.04. 0.12 Product of 398 and 2. 796 What is the product of 0.011 and -4.9? -0.0539 Calculate -43-75. 3225 Product of 0.015 and -5. -0.075 97 63 What is the product of 1.1 and 194? 213.4 What is -7 times 2.02? -14.14 Calculate 0.363-0.21. -0.07623 Multiply 34 and 1.6. 54.4 Work out 0.093 1.6. 0.1488 0.2109 times -0.6 -0.12654 Product of 1.69 and 0.93. 1.5717 Product of -4 and 0.117. -0.468 Work out 2 * -0.133. -0.266 What is 0.3 times 0.432? 0.1296 -4 times 1175 -4700 What is 0.4 times -117? -46.8 What is -1168 times -0.1? 116.8 -0.1 * 0.526 -0.0526 Work out -0.4 * -0.06. 0.024 Calculate -0.1-8. 0.8 5 times -53 -265 Product of -103 and 111. -11433 What is -0.9 times -63? 56.7 0.3 -0.064 -0.0192 Multiply -0.563 and -6. 3.378 -0.51474 -737 What is -7 times 11.9? -83.3 What is the product of -3 and 2971? -8913 Calculate -1-1.14. 1.14 2.973 * 0.4 1.1892 -25.5 * 0.9 -22.95 What is -2.8 times -5? 14 Calculate -0.109-0.027. 0.002943 Multiply 13 and 0.78. 10.14 Multiply 2 and -0.005. -0.01 292 times 0.1 29.2 Work out -0.7 9. -6.3 3 * 180 540 What is 0.3 times -0.0177? -0.00531 What is -1 times -0.03? 0.03 Work out 0 * 11. 0 -136 times 1 -136 -0.3420.7 -0.2394 Work out 0.63 1.3. 0.819 Product of -378 and 0.2. -75.6 What is -0.176 times 86? -15.136 Multiply -34 and -6. 204 What is the product of -174 and 0.1? -17.4 What is 0.2 times 0.727? 0.1454 What is -79 times 0.8? -63.2 What is 7 times -208.6? -1460.2 Product of 10.7 and -0.039. -0.4173 Calculate -2138. -276 -144 -0.1 14.4 Multiply 24467 and -3. -73401 1146-0.1 -114.6 Work out -5 -1.9. 9.5 Calculate 152645. 76320 Product of -0.13 and -2.5. 0.325 What is 2.34 times 6? 14.04 Calculate 0.3-0.3. -0.09 Multiply -0.058 and 14.8. -0.8584 0.02 * 5.3 0.106 -1504 times -0.2 300.8 Work out 8.69 * 0.3. 2.607 What is the product of 21 and 1? 21 Product of -0.0613 and -0.5. 0.03065 7 * 515 3605 -5 times 34 -170 Calculate -0.3-1.9. 0.57 What is the product of -827 and 2? -1654 Multiply 0.47 and -0.9. -0.423 Work out -339 0. 0 -0.2560.5 -0.128 Calculate -2092-0.4. 836.8 Product of 0.3 and -51.28. -15.384 What is the product of 0.94 and -9? -8.46 -25.6 * -0.4 10.24 -88.6 times 1 -88.6 What is 0.04 times -0.96? -0.0384 -0.17 * 0.09 -0.0153 What is -3 times -39.6? 118.8 -249 * -0.3 74.7 What is -0.2 times 44? -8.8 What is -1 times 1.95? -1.95 Calculate -0.150.03. -0.0045 -184 -0.1 18.4 -0.1 * 60 -6 What is 2.6 times 2.6? 6.76 -1.25 times 4 -5 Work out 60 * 5. 300 Product of 0.4 and 922. 368.8 6215 930 What is 0.16 times -0.7? -0.112 Multiply 5 and 224. 1120 Calculate -553. -265 Calculate -5.3-109. 577.7 Work out -10605 -0.2. 2121 21-0.06 -1.26 104 9 936 What is 23 times 0.17? 3.91 1.1 * 0.5 0.55 -2 * -0.0322 0.0644 What is 692 times 3? 2076 -3.04 times -4 12.16 What is the product of 21 and -5.3? -111.3 Calculate 31.330.3. 9.399 What is the product of 0.02283 and -5? -0.11415 7-1.178 -8.246 Calculate 4.3-39. -167.7 Calculate -179. -153 Calculate 0.2-0.94. -0.188 0.02-0.123 -0.00246 0.8 times -15 -12 Product of 2 and 33. 66 What is the product of 0.6 and -0.67? -0.402 Product of 0.8 and 25. 20 What is the product of 41 and 322? 13202 Work out 67 * 6. 402 Work out -33 * 13. -429 -5.6 times 2 -11.2 Product of -0.01 and -79. 0.79 Multiply 1005 and -0.4. -402 -0.04 times -148 5.92 -0.2 times -1649 329.8 What is 11 times 25? 275 Work out 1 * 5427. 5427 Work out 3 * 873. 2619 -580.12 -6.96 Multiply 581 and -0.8. -464.8 Product of 4 and -1.98. -7.92 Work out -0.8 43. -34.4 What is the product of 151 and -5? -755 31 * 0.6 18.6 -2 times 1062 -2124 0.66724 2.6688 0.35.88 1.764 -0.3 * -56 16.8 Work out 1.7 * 140. 238 4 * -10 -40 Calculate -22.843. -5.686 -1649 -2 3298 What is the product of 0.27 and 0.042? 0.01134 Multiply -4.39 and 3. -13.17 What is 0.04 times 14? 0.56 Calculate 74-5. -370 -7 52 -364 0.5 * 46 23 157 times -9 -1413 Product of 4.75 and -0.2. -0.95 Multiply 3699 and 0.2. 739.8 0.3 * 0.032 0.0096 -0.7 * 0.034 -0.0238 -81 * 0.14 -11.34 Multiply 0.1 and -0.0205. -0.00205 Multiply -3 and 1.14. -3.42 What is the product of -12.3 and -0.5? 6.15 Multiply -1 and -14.4. 14.4 What is -21.2 times -0.1? 2.12 Multiply 3 and 7.707. 23.121 -0.4 * 436 -174.4 Multiply 12 and 214. 2568 Calculate 0.090.0678. 0.006102 -20.240.3 -6.072 -127 times -33 4191 -5 times -0.47 2.35 0.117.9 1.79 Work out -0.2 8.2. -1.64 2.05 * -5 -10.25 Calculate -0.428.46. -11.384 Multiply -3 and -0.0001. 0.0003 -305.4 -162 Work out 0.897 * 2. 1.794 Calculate 0.7940.15. 0.1191 Calculate -60840.2. -1216.8 -1 times 19 -19 Product of -288 and 0.9. -259.2 Work out -4 * -1.6. 6.4 Multiply 2709 and	{ "pile_set_name": "DM Mathematics" }
h. Find r, given that p(r) = 0. -1, 1, 211 Let m(q) = 35 - 3q + 6q - 48. Let y be m(6). Factor 12c*y + 38c*5 + 60c*2 - 64c*4 + 204c*4 - 4c*2 + 138c*3 + 8c. 2c(c + 1)*2(5c + 2)2 Suppose -8s = -36s + 112. Let h(p) be the third derivative of 1/120p*5 + 0 + 0p + 4p2 - 1/3p*3 + 1/16p*s. Solve h(y) = 0 for y. -4, 1 Factor 2/5s*2 - 47/5s - 44. (s + 4)(2s - 55)/5 Suppose -68 = -s - s - 5q, 4s + q - 118 = 0. Factor 47j + 24j*2 + 86j + 26j2 - sj - 52j2 - 1352. -2(j - 26)*2 Let s(m) be the second derivative of 91/2m*4 - 1352/3m*3 + 0 + 1/30m*6 - 43m - 2m5 + 2197/2m*2. Find n such that s(n) = 0. 1, 13 Suppose -3i = i - 12. Let u(k) = -k*3 + 15k*2 - 6k + 93. Let f be u(15). Let 4 - 2 - 34j3 - fj + 35ji + 0j = 0. Calculate j. -2, 1 Let i(f) be the first derivative of 0f + 40/3f3 + 26 - f5 + 5/4f4 - 30f*2. Determine t, given that i(t) = 0. -3, 0, 2 Let r(h) = 10h*2 - 1778h - 3. Let y(w) = -52w2 + 8888w + 16. Let d(t) = 16r(t) + 3y(t). Find p, given that d(p) = 0. 0, 446 Let d(j) be the first derivative of 2j3/21 - 12j*2/7 - 26j/7 + 996. Let d(g) = 0. What is g? -1, 13 Suppose 8i + 5p = 3i, 10 = 2i - 3p. Let g(a) be the first derivative of 4/3a + 21 - 5/9a6 - 11/3a*4 - 12/5a5 + ai - 16/9a3. Factor g(l). -2(l + 1)*4(5l - 2)/3 Let t(v) be the first derivative of v6/150 + 4v5/75 + v4/30 - 4v3/5 + 45v*2/2 + 31. Let i(u) be the second derivative of t(u). Factor i(j). 4(j - 1)(j + 2)(j + 3)/5 Let n(d) = d*3 + 11d*2 + 26d - 20. Let v be n(-6). Let r(w) be the second derivative of 0 - 5/12wv + 0w*3 + 10w2 - w. Find b such that r(b) = 0. -2, 2 Let b(s) = s3 - s + 1. Let f(j) be the third derivative of j*6/60 - 3j*5/10 - 5j*4/6 + 5j*3/6 + 2j*2 + 39j. Let n(a) = -5b(a) + f(a). Factor n(i). -3i(i + 1)(i + 5) Let c(v) be the second derivative of 2v7/21 - 23v*5/5 + 22v*4 - 136v*3/3 + 48v*2 - 821v. Suppose c(g) = 0. Calculate g. -6, 1, 2 Let n(u) be the first derivative of 1/2u2 - 4u + 3/2u3 - 1/10u*5 + 54 - 1/4u*4. Let n(r) = 0. What is r? -4, -1, 1, 2 What is j in -16/5j*3 + 0 - 10j*2 - 34/5j = 0? -17/8, -1, 0 Let m = -4259 + 4270. Let t(n) be the first derivative of -2/39n3 - m - 1/13n*2 + 0n. Suppose t(z) = 0. Calculate z. -1, 0 Let k(p) be the first derivative of 44p3/3 + 122p*2 + 120p + 9302. Suppose k(t) = 0. Calculate t. -5, -6/11 Let i be 2/42 + 10/35. Suppose -4 = 2m - 3s, 0 = -4m + 3s + 4 - 6. Find n, given that -m + 2/3n + in*2 = 0. -3, 1 Let 21/2p + 5/2p5 + 0 + 24p*4 + 51p*3 + 40p*2 = 0. Calculate p. -7, -1, -3/5, 0 Suppose 2w - 264 = 5w. Let d = 93 + w. Factor 40b*3 + 5b*5 - 3b*5 + 3b*d - 20b*2 + 3b*4 - 28b*4. 5b*2(b - 2)*2(b - 1) Let l(m) be the second derivative of -m*6/90 + 11m*5/60 - 5m*4/18 - 4m*3 + 1396m + 2. What is c in l(c) = 0? -2, 0, 4, 9 Let t(j) be the second derivative of 7/27j4 - 1/9j*5 + 0j*2 + 2/135j*6 + 4j + 0 - 2/9j3. Let t(f) = 0. What is f? 0, 1, 3 Let l = 58806 - 176416/3. Find k such that lk*2 - 2/3 - 1/3k*3 + 1/3k = 0. -1, 1, 2 Let 80 - 588778j2 + 643067j*2 + 1 + 1171j - 5365j = 0. What is j? 9/233 Let a(x) = 7x*3 - 2x*2 - x. Suppose 39i + 19 = -20. Let h(c) = -3c3 + c2. Let u(l) = ia(l) - 2h(l). Suppose u(j) = 0. Calculate j. -1, 0, 1 Let z(n) be the third derivative of -2n*7/105 - 89n*6/15 - 10021n*5/15 - 31150n*4 - 735000n*3 + 2n*2 - 18. Factor z(g). -4(g + 14)*2(g + 75)*2 Suppose f = 3f - 8. Find t such that 62t - 27t + ft2 + 484 + 53t = 0. -11 Let j = 6623 + -6620. Let x(z) be the first derivative of 1/5z4 - 19 + 11/10z*2 - 13/15z*j - 2/5z. Suppose x(g) = 0. What is g? 1/4, 1, 2 Let w(l) be the third derivative of -l*5/20 - 1155l*4/4 - 2309l*3/2 + 11841l*2. Suppose w(r) = 0. Calculate r. -2309, -1 Let c(m) be the second derivative of 9/10m*2 + 7/10m*3 - 156m + 0 + 3/100m5 + 1/4m*4. What is f in c(f) = 0? -3, -1 Let d be 5 + (55/(-15) - 6/(-9))/1. Let p(o) be the first derivative of 5 + 0o*d + 1/6o*6 + 0o + 1/8o4 - 3/10o*5 + 0o3. Factor p(g). g3(g - 1)(2g - 1)/2 Let i(s) = s2 + 5s - 25. Let g(h) = -2h2 - 8h + 40. Let q = 341 - 336. Let t(n) = qg(n) + 8i(n). Let t(x) = 0. Calculate x. 0 Let x(f) = 8f3 - 123f*2 + 393f - 263. Let i(q) = 9q3 - 120q*2 + 393q - 264. Let r(t) = 5i(t) - 6x(t). Factor r(h). -3(h - 43)(h - 2)(h - 1) Factor 0 - 2/7s*2 + 782/7s. -2s(s - 391)/7 Determine a so that 262a - 255 - 784 - 108a*2 - 221 + 106a*2 = 0. 5, 126 Let t(v) = -2v*2 + 62v + 58. Let d(y) = y - 35. Let h(k) = 4d(k) - 2t(k). Solve h(s) = 0 for s. -2, 32 Let x(q) be the third derivative of -7q2 - 11q*6 + 242/105q*7 - 20q*4 + 0 - 2q + 313/15q5 + 32/3q*3. Factor x(y). 4(y - 1)*2(11y - 4)2 Suppose 4m + 184 = -4t, -7m = -5t - 9m - 236. Let n be 3 - (10 - 5 - t/(-21)). Suppose no2 - 2/7o + 0 = 0. Calculate o. 0, 1 Let a(l) = 105l2 - 520l - 625. Let k(v) = 8v2 - 40v - 48. Let p be (-1044)/(-26) - 16/(-104)-1. Let m(y) = pk(y) - 3a(y). Solve m(i) = 0 for i. -1, 9 Let w(h) = -2h*3 - 47h*2 - 116h - 3. Let i(f) = f3 + f2 + 3f - 1. Suppose 2g - 1462 = -1464. Let y(l) = gw(l) + 3i(l). Factor y(x). 5x(x + 5)*2 Solve 1863/2 - 1/2t*2 + 309t = 0. -3, 621 Let -9213/7 + 9216/7p - 3/7p*2 = 0. What is p? 1, 3071 Suppose 2 - 26 = -6m. Let r = 25 + -14. Let -24g4 + 100g - 10g3 + 105g*2 + m - rg*4 + 16 = 0. Calculate g. -1, -2/7, 2 Let c be (-26)/(-65) - -41 - (-216)/(-540). Suppose -5u + 11 = -4. Factor ud*2 - 1/2d*c - 5/2d*3 + 0 + 0d. -d*2(d - 1)(d + 6)/2 Suppose 10k - 1064 = 29k. Let s be (k/16)/(-7) + (-3)/(-2). Factor -1/3q*4 - 1 + 10/3q + sq3 - 4q*2. -(q - 3)(q - 1)*3/3 Let 25464h3 - h4 - 50921h3 + 9h*2 - 8 + 25459h*3 - 2h = 0. What is h? -2, -1, 1, 4 Let u(x) = 220x - 34. Let i be u(17). Let t be i/8 + (-36)/(-48). Let -463w*2 + 0w + tw2 + 2w = 0. What is w? -2, 0 Let b(i) be the third derivative of i11/299376 + i10/680400 - 143i5/60 + 133i*2. Let d(u) be the third derivative of b(u). Solve d(k) = 0. -1/5, 0 Suppose -38 - 16 + 18q - 15q2 + 8q*2 + 33q = 0. What is q? 9/7, 6 Factor -4z4 + 158z + 195z - 373z + 20z3 + 4z*2. -4z(z - 5)(z - 1)(z + 1) Let z(r) be the second derivative of 5r*7/42 - 2r*6/3 - 16r*5 + 380r*4/3 + 200r*3 - 2880r*2 - 1637r. Determine w, given that z(w) = 0. -8, -2, 2, 6 Suppose -39z = -36z - 3, -l + 5 = 2z. Solve 2w*4 + 0w*4 + 8w*3 - 9w*3 + 13w*l + 21w2 + w2 + 12w = 0. -3, -2, -1, 0 Let i(y) = -34y*3 + y + 3. Let p be i(-1). Let q be p/(-12)(-2)/8. Factor -1/4m3 + 0 - 1/2m*2 + qm. -m(m - 1)(m + 3)/4 Let m(j) be the second derivative of -13/12j4 + 0 + 1/20j*5 + 8/3j*3 + 96j*2 + 74j. Suppose m(i) = 0. What is i? -3, 8 Let k(n) = -156n - 622. Let m be k(-4). Determine c so that 2/11c*2 - mc - 24/11 = 0. -1, 12 Let g = 41518 + -1328575/32. Let o(a) be the second derivative of -147/4a2 - ga*4 + 0 + 7/4a*3 + 47a. Suppose o(u) = 0. What is u? 14 Let p(x) = 1744x + 228466. Let a be p(-131). Factor 2/9v*a - 4/9v + 0. 2v(v - 2)/9 Let w(a) be the third derivative of -8/3a3 - 65a*2 + 0 + 0a - 5/3a4 - 1/12a*6 - 11/20a*5 - 1/210a7. Factor w(b). -(b + 1)2(b + 4)2 Let l = 350056 + -1050164/3. Factor -2/3 + 1/6g*3 + lg - 5/6g2. (g - 2)2(g - 1)/6 Let 0 + d*3 - 4/3d*2 - 1/3d*5 + 2/3d*4 - 4/3d = 0. What is d? -1, 0, 2 Let c(x) be the second derivative of x*5/190 + 11x*4/57 - 100x*3/57 + 104x*2/19 - 720x - 1. Factor c(f). 2(f - 2)2(f + 26)/19 Let d(o) be the second derivative of o*4/66 - 83o*3/33 + 82o*2/11 + 449o - 2. What is p in d(p) = 0? 1, 82 Let u(m) = -m*4 - 18m*3 - 108m*2 + 442m - 442. Let x(p) = p*4 + 2p*3 - 2p + 2. Let b(r) = -u(r) - 5x(r). What is y in b(y) = 0? -6, 2, 3 Let a(r) = -8r + 32. Suppose 3k = -2m + 17, -5m + 32 = 6k - 2k. Let o be a(m). Factor 0 - 1/7s*2 + 0s*3 + os + 1/7s4. s2(s - 1)(s + 1)/7 Suppose 378h = 363*h - 4440. Let b = -294 - h.	{ "pile_set_name": "DM Mathematics" }
281, 2803 What are the prime factors of 74282330? 2, 5, 71, 104623 What are the prime factors of 633791358? 2, 3, 23, 510299 What are the prime factors of 128928374? 2, 17, 29, 229, 571 What are the prime factors of 46381806? 2, 3, 2576767 List the prime factors of 1507661210. 2, 5, 11, 19, 65579 List the prime factors of 187598631. 3, 11, 1987, 2861 List the prime factors of 6624341. 599, 11059 What are the prime factors of 323337893? 6133, 52721 What are the prime factors of 43914965? 5, 139, 179, 353 List the prime factors of 38853137. 31, 1253327 What are the prime factors of 6291404421? 3, 17, 123360871 What are the prime factors of 55904510? 2, 5, 101, 55351 What are the prime factors of 546405571? 227, 2407073 What are the prime factors of 256994862? 2, 3, 563, 76079 What are the prime factors of 1079569967? 7, 7687, 20063 What are the prime factors of 799309522? 2, 11, 36332251 List the prime factors of 4656308858. 2, 3313, 702733 List the prime factors of 636940346. 2, 7, 241, 188779 What are the prime factors of 1802905061? 193, 2791, 3347 What are the prime factors of 1019379526? 2, 11, 19, 37, 3469 What are the prime factors of 141236517? 3, 47078839 What are the prime factors of 108535620? 2, 3, 5, 23, 78649 List the prime factors of 80278286. 2, 11, 233, 15661 List the prime factors of 776235163. 11, 311, 226903 List the prime factors of 1191764765. 5, 11393, 20921 List the prime factors of 112326198. 2, 3, 18721033 What are the prime factors of 193462091? 17, 669419 List the prime factors of 2473532782. 2, 7, 176680913 What are the prime factors of 51830419? 31, 61, 27409 What are the prime factors of 61299808? 2, 1915619 List the prime factors of 33778792. 2, 2029, 2081 What are the prime factors of 1079103480? 2, 3, 5, 7, 13, 19, 743 What are the prime factors of 30591551? 17, 1799503 List the prime factors of 825538822. 2, 7079, 58309 What are the prime factors of 680596800? 2, 3, 5, 13, 839 List the prime factors of 228005849. 3863, 59023 What are the prime factors of 2351916567? 3, 7, 11, 13, 293 List the prime factors of 5862438117. 3, 17, 31, 72707 List the prime factors of 6349134. 2, 3, 11, 96199 List the prime factors of 366043834. 2, 13, 3673, 3833 What are the prime factors of 20029823? 11, 487, 3739 What are the prime factors of 58200584? 2, 13, 653, 857 What are the prime factors of 47585636? 2, 7, 29, 58603 List the prime factors of 47679631. 47679631 List the prime factors of 157879595. 5, 17, 1857407 What are the prime factors of 5638355651? 103, 54741317 List the prime factors of 182194183. 59, 653, 4729 What are the prime factors of 253535512? 2, 941, 33679 What are the prime factors of 560730760? 2, 5, 41, 181, 1889 List the prime factors of 6375799. 17, 113, 3319 List the prime factors of 116338560. 2, 3, 5, 13, 59, 79 What are the prime factors of 871785506? 2, 435892753 List the prime factors of 64091747. 64091747 What are the prime factors of 6211563? 3, 31, 66791 List the prime factors of 619940901. 3, 10337, 19991 List the prime factors of 5058307175. 5, 10723, 18869 What are the prime factors of 307890483? 3, 353, 290737 List the prime factors of 392839518. 2, 3, 65473253 List the prime factors of 71100604. 2, 17775151 What are the prime factors of 845564? 2, 137, 1543 What are the prime factors of 51476594? 2, 13, 971, 2039 List the prime factors of 1130027461. 17837, 63353 What are the prime factors of 162036511? 7, 13, 751, 2371 What are the prime factors of 33669414? 2, 3, 139, 13457 List the prime factors of 3816796590. 2, 3, 5, 53, 163, 4909 What are the prime factors of 876589942? 2, 438294971 What are the prime factors of 3148117? 7, 167, 2693 What are the prime factors of 1726202038? 2, 11, 751, 104479 List the prime factors of 44883217. 1459, 30763 List the prime factors of 57691819. 1093, 52783 List the prime factors of 198174190. 2, 5, 19817419 List the prime factors of 1122771578. 2, 31, 311, 58229 List the prime factors of 943704419. 7, 9127, 14771 List the prime factors of 84140424. 2, 3, 389539 What are the prime factors of 29296874? 2, 1487, 9851 What are the prime factors of 2501427363? 3, 833809121 What are the prime factors of 381459660? 2, 3, 5, 6357661 What are the prime factors of 1132741572? 2, 3, 94395131 What are the prime factors of 172157343? 3, 1103, 52027 List the prime factors of 226266151. 5641, 40111 List the prime factors of 1695308465. 5, 339061693 List the prime factors of 33996626. 2, 41, 59, 7027 List the prime factors of 1854267954. 2, 3, 7, 11, 4013567 What are the prime factors of 504254540? 2, 5, 47, 536441 List the prime factors of 26863722. 2, 3, 701, 2129 What are the prime factors of 142086977? 1669, 85133 What are the prime factors of 189629352? 2, 3, 11, 239431 What are the prime factors of 5385188565? 3, 5, 4673, 25609 What are the prime factors of 14052057? 3, 23, 203653 List the prime factors of 2722924777. 18401, 147977 What are the prime factors of 366932910? 2, 3, 5, 353, 34649 What are the prime factors of 302522042? 2, 443, 341447 List the prime factors of 1823440045. 5, 7, 1613, 32299 List the prime factors of 538126059. 3, 29, 6185357 List the prime factors of 4231427710. 2, 5, 423142771 What are the prime factors of 698097727? 3851, 181277 What are the prime factors of 45710485? 5, 19, 131, 3673 What are the prime factors of 12095896? 2, 263, 5749 What are the prime factors of 460945885? 5, 167, 552031 What are the prime factors of 332065408? 2, 89, 103, 283 What are the prime factors of 1336992940? 2, 5, 66849647 List the prime factors of 647553747. 3, 269, 802421 What are the prime factors of 495616840? 2, 5, 31, 399691 List the prime factors of 111421328. 2, 1213, 5741 List the prime factors of 55961517. 3, 19, 397, 2473 What are the prime factors of 67872031? 67872031 List the prime factors of 1995118. 2, 263, 3793 What are the prime factors of 2397069791? 29, 113, 731483 What are the prime factors of 585521728? 2, 11, 831707 What are the prime factors of 39937579? 11, 31, 117119 List the prime factors of 368672938. 2, 2243, 82183 List the prime factors of 56261144. 2, 311, 22613 What are the prime factors of 2408762753? 19, 6672473 What are the prime factors of 175594787? 175594787 List the prime factors of 1093393. 7, 19, 8221 What are the prime factors of 647682889? 7, 47, 1968641 List the prime factors of 150747725. 5, 911, 6619 List the prime factors of 947843596. 2, 7, 33851557 What are the prime factors of 69580365? 3, 5, 4638691 List the prime factors of 19300693. 31, 622603 List the prime factors of 3043968896. 2, 23781007 List the prime factors of 8493506841. 3, 2831168947 What are the prime factors of 33890542? 2, 7, 73, 33161 List the prime factors of 506110694. 2, 461, 548927 List the prime factors of 81913088. 2, 319973 List the prime factors of 31890703. 13, 503, 4877 List the prime factors of 5553045489. 3, 103, 17971021 List the prime factors of 21300290. 2, 5, 11, 83, 2333 List the prime factors of 60182221. 11, 29, 83, 2273 List the prime factors of 1322172859. 7, 188881837 What are the prime factors of 25934491? 11, 73, 32297 What are the prime factors of 163187056? 2, 157, 167, 389 What are the prime factors of 723857581? 21589, 33529 List the prime factors of 258394790. 2, 5, 25839479 What are the prime factors of 38341481? 97, 395273 List the prime factors of 19201753. 19201753 What are the prime factors of 1602020156? 2, 11, 59, 56101 List the prime factors of 498799326. 2, 3, 613, 135617 List the prime factors of 1901929622. 2, 950964811 What are the prime factors of 17270439? 3, 947, 6079 What are the prime factors of 260899729? 260899729 What are the prime factors of 862808942? 2, 53, 8139707 What are the prime factors of 493866749? 493866749 List the prime factors of 703899604. 2, 175974901 List the prime factors of 10743402. 2, 3, 389, 4603 List the prime factors of 657357668. 2, 11, 19, 71483 List the prime factors of 29704783. 2543, 11681 List the prime factors of 24683397. 3, 8227799 What are the prime factors of 80738764? 2, 20184691 List the prime factors of 40360290. 2, 3, 5, 1345343 List the prime factors of 56954836. 2, 14238709 What are the prime factors of 280638091? 17, 769, 21467 List the prime	{ "pile_set_name": "DM Mathematics" }
g w is positive. w(-1811/315) Simplify (((x/x(-21/5)xx)/x)/x)/(x(-14)/x) assuming x is positive. x(101/5) Simplify ((f(2/15)/f)/f(-1))(-18/11) assuming f is positive. f(-12/55) Simplify n/n*(-1)n/(n*3/n)(n1/n)(-13) assuming n is positive. n Simplify (yy/(y/(y(-3)/y))yyyyy*(1/4)y)/(y*(-2/9)y*(2/7)y) assuming y is positive. y*(299/252) Simplify (pp(1/35)/p)/p16 assuming p is positive. p(-559/35) Simplify ((b/b(-2))/(b/(b*(-2)b)))(-12) assuming b is positive. b(-12) Simplify (aa/(a(1/3)/a))17 assuming a is positive. a(136/3) Simplify ((a(a/(a/(a/a*(-26))))/aa)/a)/(aa(-2/17)) assuming a is positive. a(444/17) Simplify (s(3/2)s(-2/3))(-29) assuming s is positive. s(-145/6) Simplify b(-4)/((bbb/(b/b*2b))/b)(b1)(-31) assuming b is positive. b(-37) Simplify (rr(2/9))(-23)(r(3/2)/r)/rr(-1/17) assuming r is positive. r(-8773/306) Simplify (f*(3/8)/(f/(ff(-1))))(-13/4) assuming f is positive. f(65/32) Simplify (l6/l)(2/5) assuming l is positive. l2 Simplify (b(-5/4)/(((b(-2)/b)/b)/bb))/(b/b7b(-1)) assuming b is positive. b(39/4) Simplify (n(1/2))(-43)/((n(n(-9)n)/n)/(n*3n)) assuming n is positive. n(-19/2) Simplify (o7oo)(-40/7) assuming o is positive. o(-360/7) Simplify (b*2b)(-1/3)/((b/(b/b(-2/3)))/b(5/4)) assuming b is positive. b(11/12) Simplify v(1/6)/v16 assuming v is positive. v(-95/6) Simplify (b(22/9))22 assuming b is positive. b(484/9) Simplify (b/((((bb7)/b)/b)/b)b(-2/3))/((b/b2b)/(b/b(-1/6))) assuming b is positive. b(-7/2) Simplify (d(-3/8)d(6/7))(-17) assuming d is positive. d(-459/56) Simplify (k/(k/(((k/(k/k3)k)/k)/k)))49 assuming k is positive. k98 Simplify (v(-1/7)/(v(5/6)v))/((v(v/v(2/9)vvv)/vv)/(v(-2/5)/v)) assuming v is positive. v(-5137/630) Simplify (l/l0)/ll*(1/6)l(l(l/(l/((l/((l*0l)/l)l)/l)))/l)(-7/4) assuming l is positive. l(-7/12) Simplify (q(2/11))(-18/11)(qqq(1/3))/(q/q2) assuming q is positive. q*(1102/363) Simplify (ss*3s/s4)/(s(2/3)s5) assuming s is positive. s(-14/3) Simplify r(-2/5)r*(2/5)/r(rr(-1))15 assuming r is positive. 1/r Simplify ((r3)(16/9))23 assuming r is positive. r(368/3) Simplify (c/c(1/4))/c(-3) assuming c is positive. c(15/4) Simplify ((v/v(-17/5))/v)18 assuming v is positive. v(306/5) Simplify (a/(a/(a/(a(-2/35)a)))aaaa)/(a*(-11)a) assuming a is positive. a(492/35) Simplify (s(-1/9)s(3/11)s)/(s*(-11)/(s/((ss*(-3))/s)s)) assuming s is positive. s(1699/99) Simplify ((f(-11)f)/f)/(f(fff/f(-7/4))/f) assuming f is positive. f(-63/4) Simplify (r/(r/(r/(r/r*(-6))))r*3/rr)(-26) assuming r is positive. r78 Simplify (((t(tt*(-1)t)/t)/t)(-34))(-47) assuming t is positive. 1 Simplify (y*6yy)/yy*(-4)y*(1/3)/(y/(yy*2y)) assuming y is positive. y(19/3) Simplify n/(n(2/45)/n)n(6/7)/n assuming n is positive. n(571/315) Simplify (yy/y*(2/17)y)/(y/(y*(-2/29)/y)y) assuming y is positive. y(-92/493) Simplify (o(-3)o(3/8))(1/8) assuming o is positive. o(-21/64) Simplify l(2/15)/(lll(-22)) assuming l is positive. l(302/15) Simplify u(-3/2)u*(-1/5)u*3/(u/(uuu(-5))) assuming u is positive. u(-27/10) Simplify (g(-4)/(g6/g))/(((gg/(gg/(g(-8)/g))g)/gg)/g(-5)) assuming g is positive. g(-6) Simplify ((ll*1lll)/(l/((l*(-3)l)/l)))/(l*(-7)/lll(-1/2)) assuming l is positive. l(17/2) Simplify dd*(2/17)dd(-4/9) assuming d is positive. d(256/153) Simplify (s2)(14/3) assuming s is positive. s(28/3) Simplify ((c(-19)c)/c)/cccc/(c/(c/((c/(ccc((c*(3/4)/c)/c)/cc)c)/c))c)c assuming c is positive. c(-65/4) Simplify z(1/3)/z3(z/(z(-1/2)/z))(-23) assuming z is positive. z(-361/6) Simplify ((f/f(-9))/((fff/(fff*(-1))f)/f))/(f*(-4/7)f(-2/23)) assuming f is positive. f(1394/161) Simplify (hh4)/((h/((hh(-12))/h))/h) assuming h is positive. h(-7) Simplify (d*(-2/3)d(1/13))(1/44) assuming d is positive. d(-23/1716) Simplify (k(1/5)/k)/(k/k*0k)(k/k(-4)k)/(k/(k*(-2/17)k)) assuming k is positive. k(262/85) Simplify (((v(4/7)vv)/v)/v(v/(v10/v))/vv)19 assuming v is positive. v(-988/7) Simplify (l/((ll(-4/3))/l)ll(-7))33 assuming l is positive. l(-121) Simplify (u(u/u*(-2/5)u)/u)(-6/29) assuming u is positive. u(-72/145) Simplify (u/(u/((u/u*(-14))/uuu)uu))(2/49) assuming u is positive. u(4/7) Simplify j(-20/3)/jjjj2/j assuming j is positive. j(-14/3) Simplify k(1/4)/k(-1/3)kk/k*(-1/6)k/(k*(2/11)k) assuming k is positive. k(113/44) Simplify ((w/(w/(w(-1)w)))/ww)*(10/3)(ww(1/2)w)(-1/4) assuming w is positive. w(-5/8) Simplify l/(l/l*(-7))l*(7/4)l assuming l is positive. l*(-17/4) Simplify (g((g*(3/5)/gg)/g)/g)/(ggggg(g(-45)g)/gg) assuming g is positive. g(193/5) Simplify (k1)21/((k/k(2/15))/(k6/k)) assuming k is positive. k(377/15) Simplify t(2/9)t(-1/4) assuming t is positive. t(-1/36) Simplify b*(2/15)b*1bb assuming b is positive. b(47/15) Simplify (jj*(-1/6)/jjjj)(-6) assuming j is positive. j(-17) Simplify (a2)(-32/7)/(a1)(-2/37) assuming a is positive. a*(-2354/259) Simplify u((u*7u)/u)/uu(2/21)(u1/u)(3/19) assuming u is positive. u(149/21) Simplify (p(1/19)pp*4p)(2/25) assuming p is positive. p(46/95) Simplify ((x/(xxx(-1)/x))/x)(1/16)xx*(-4)xxxxx*6x assuming x is positive. x*8 Simplify ((o/(oo(o/((o(1/19)/o)/o))/oo))/o)/(oo(1/11)) assuming o is positive. o(-1262/209) Simplify (g0/g)(-36)(g(-1))(-1) assuming g is positive. g37 Simplify (j(-9))45 assuming j is positive. j(-405) Simplify j*(9/4)jj(-5) assuming j is positive. j(-7/4) Simplify (q(4/9)q(3/4))(17/3) assuming q is positive. q(731/108) Simplify b(-1/6)/(b(b(6/5)/bb)/b)b(1/2)/b9 assuming b is positive. b(-148/15) Simplify (((b6/bb)/b)/b(-5))/((b(-10)/b)/(b/(b/(b/(b/(b/b*(1/10)))))b)) assuming b is positive. b(229/10) Simplify (o/o(-11/5))(-20/11) assuming o is positive. o(-64/11) Simplify ((r/r(1/5))(-8/7))(-47) assuming r is positive. r(1504/35) Simplify (dd(-6)/d)(-1) assuming d is positive. d6 Simplify (g/(g/(ggggg(g/g*(-1/3))/gggg)))/((g*(-15)g)/g) assuming g is positive. g(70/3) Simplify a(-1/17)a/a22 assuming a is positive. a(-358/17) Simplify (a/(a/(a/(a/a(-2/7)))a))*41aa/a(-5)a(-5/6) assuming a is positive. a(-1955/42) Simplify (l*(1/5)ll)/(l(-4)/l)(ll(-4))/l3 assuming l is positive. l(6/5) Simplify ((c1/cc)(1/9))(-24) assuming c is positive. c*(-8/3) Simplify (hh*(3/29))/hhhh/h(7/2) assuming h is positive. h(-23/58) Simplify ((l*4/ll)/(l*(4/5)l))(10/11) assuming l is positive. l2 Simplify (f(1/3)/f)(-2/41)/(f*(1/5)ff4) assuming f is positive. f(-3178/615) Simplify (p/(p/((p/(p(-1/2)/p))/p)p))(-1/98)/((p/(p/(p/((p/(p/(p(-4/7)p)p)p)/p)))p)/p(-2/5)) assuming p is positive. p(-2917/980) Simplify (ss/(s/(s/(s/(s(-14)/ss)ssss)))s(6/11)/sss)20 assuming s is positive. s(-3400/11) Simplify (b(-7))(-17/4) assuming b is positive. b(119/4) Simplify ((x/(x(3/10)/x))/xx(-2/3))/((x(2/17)/xx)/(xx/x*(1/6)x)) assuming x is positive. x(701/255) Simplify ((d(-2/7))30)(-10) assuming d is positive. d(600/7) Simplify ((i(-9)/i)(25/3))(-1) assuming i is positive. i(250/3) Simplify (h(-2/5))*19(h/((h/(h(h/(h/(hh*(-1)h)))/h)hh)/h))(-12/19) assuming h is positive. h(-38/5) Simplify (b(-5/6))(-10) assuming b is positive. b(25/3) Simplify (t(-2/7)/t)48 assuming t is positive. t(-432/7) Simplify (x/x(1/4))45/(x/(x((x2/x)/xx)/x)xxx(2/5)x) assuming x is positive. x*(607/20) Simplify cc*3/cc/c*2c2/(c(-1)/c) assuming c is positive. c*6 Simplify (ss(-4/11))/s(-6)(s(1/2))19 assuming s is positive. s(355/22) Simplify (i(-4)i/i(-21))5 assuming i is positiv	{ "pile_set_name": "DM Mathematics" }
029/13950) Simplify ((j5/j(3/2)j(-4/7)/jj*4j)(-2/39))4 assuming j is positive. j(-388/273) Simplify (((i/i(-17))/i)*(-9/2)(ii17/i)(-10))39 assuming i is positive. i(-19227/2) Simplify (s/(sss/s(1/4)ss)s/((s/(s/s*5))/s)s3/s(2/7))(2/9) assuming s is positive. s(-113/126) Simplify (((yy/((yy/y*(2/19))/yyy))/y0)/(y(-5/3)/(yyyy*(1/4)y)))/((yy10/y)/((y/(y(-6)/y))/yy))(-42) assuming y is positive. y(20297/228) Simplify (z46)(-39)((zz*17z)/z)(-1/5) assuming z is positive. z(-8988/5) Simplify ((((nn((n*0n)/n)/nn)/nn(-1/7))(4/3))(-23))(-3/14) assuming n is positive. n(276/49) Simplify ((m5m)/(mm(-3)))(-45/7)/(((m*5mmm)/(((m*(5/4)m)/mm)/m))/(m(2/13)/((m/(mm(-2)/m))/m))) assuming m is positive. m(-21849/364) Simplify ((vv/(v(-6)v)v(-6))/(v1)(-43))/(v(-8)v/(vvvv(v/(vv/v(3/4)))/v))(-38) assuming v is positive. v(-653/2) Simplify ((l/(l0ll)l19)/(l4l)43)(1/8) assuming l is positive. l(-197/8) Simplify ss*0s*(-2/7)(s1)34(s((ss(-1/4))/s)/s)(-1/13)(s/(s/(sss/s*(-1/4)s)))(4/23) assuming s is positive. s(296977/8372) Simplify ((f/f*(-4/25))/(ff/f*(-1/47)f)f(-6/7)(f/f13)/f)(-12/5) assuming f is positive. f(1551408/41125) Simplify ((j(1/2)/j)(5/12))(-42)(jj*(-4))/(j/(jj*(-2/11)))j*(-6)j/j(-1/4) assuming j is positive. j(9/11) Simplify (m/(mm(-24/11)/mm)m)32/(m/(m/((m/(mm/m*(-36)))/m))m(-21)) assuming m is positive. m(1769/11) Simplify ((d/d(-2))(-39))*(1/10)d*(2/11)/ddd(2/13)(d/(d*5d))/((d/(d((d(2/9)/d)/d)/d))/d) assuming d is positive. d(-233489/12870) Simplify ((jj*48jj/j(-16/11))/(j/(jj/j*(4/9)j))38)(-22) assuming j is positive. j(-22090/9) Simplify ((i(-2/85)i)/(i/i(-1/10))ii26iii44)(8/9) assuming i is positive. i(49556/765) Simplify (((a(-40)/a)/(a/(aaa15)))/(a(-2/31))(-14))(-20) assuming a is positive. a(16060/31) Simplify ((j0jj7)/(j(-1/2)/jj)(-22/5))/((j(-1/3))(-46)/(j(2/17)j/(j/(j1/j)))) assuming j is positive. j(-2401/255) Simplify (t(-3/2)/t(-2/19)(tt/(tt1/t))/((tt/t*(-5)t)/t))/((t/(t/(t/t(-1))))/t(-2/5)((tt(1/2))/t)(-39)) assuming t is positive. t(922/95) Simplify (o(-2)/(o/(o/(oo/(o(o/(o/o*6))/oo))))o(-3)oo(o*2o)/oo)/(o5/(o/o(-1/4))(o(-2/3))(2/77)) assuming o is positive. o*(1171/924) Simplify ((ww*(-28)w)/w)(19/2)/(w(-2/3)w(-9)) assuming w is positive. w(-1481/6) Simplify ((t(-2)t*(-4/7)/ttt/(t(ttt*(-4/9)/tt)/t)t1)43)(-20/7) assuming t is positive. t(115240/441) Simplify (((x8/x)/x)/x(-8))/((x(-4)x)/(xx(-6)))(xx(11/3)x(2/45))47 assuming x is positive. x*(10504/45) Simplify (((ll33)/l(-13/4))/(l/l(-24))(-26/9))(-32) assuming l is positive. l(-31528/9) Simplify ((h*(2/3)/hhh)(-36))(-6)(h/(h/(hh(-10)/h))(h/(hh(-1/10)))/h)(-1/23) assuming h is positive. h(82909/230) Simplify (k(-1/5)k*2/k)/((k/(k(((k/k(-2/15))/k)/k)/k))/k(-3/8))((kk*(1/8)k)/k(2/11))(-27) assuming k is positive. k(-35579/660) Simplify (j(-4)/(j/(j/((j/j*29j)/j))))/(((j/(j*(-26)j))/j)/(j/j(-25))) assuming j is positive. j25 Simplify o(-1/4)/(o(2/3)/o)o(4/7)/o5(o*(2/11)/oo*(-2/15))/(((o/((o/(oo*(-1/2)/o))/o))/o)/oo)(-3/23) assuming o is positive. o(-189921/35420) Simplify ((nnnn(-2/7))/nnn)(-48)/(n(2/7))20n*(-6)nnn*(1/4)(n/n1)(-2/17) assuming n is positive. n(-751/4) Simplify ((u/u0)(-1/7))(-16)/(u*(-1/2)(u(-3/2)/u)/u)(-1/9) assuming u is positive. u(116/63) Simplify (((l/l2)/(l/l*(-2/3)))/((ll*(2/7)/l)/((l/(l/(ll*(-4))))/ll)))/((l/l1)24(l/l(-1/9))/l2) assuming l is positive. l(-319/63) Simplify pp*47pp(5/12)pp(4/5)(p/p*39p)/p assuming p is positive. p*(793/60) Simplify ((qq*(-4/3))/(((qq4)/q)/q))(3/32)(qq2/q)/(q(1/4)/qq)(qq(q/(qqq1))/q)(-5) assuming q is positive. q(103/16) Simplify ((l12ll(-33))(-26))(-27/7) assuming l is positive. l(-14040/7) Simplify (((f*(2/11)/((ff(f/(f16/f)f)/f)/f))(-5/16))(1/9))(-1/3) assuming f is positive. f(725/4752) Simplify (((yy(4/21))/(y/((y/y(-4/9))/y)))/(y14/yy/(yy1)))(3/8) assuming y is positive. y(-179/42) Simplify ((gg*6/gg)/(g/g*5g)(g/(g/g1))(-36))/((g0gg)(-1/5)(g/((g/g(2/5))/g))(-4/7)) assuming g is positive. g(-124/5) Simplify (j(2/77))*3/(jjj(36/5)jjjj(13/4)j) assuming j is positive. j(-25213/1540) Simplify (t(-2)t(-3))14((t/t(2/7))/t)(15/7)t(4/7)t(4/5) assuming t is positive. t(-16964/245) Simplify (zz(-1/3))43(z1/z)(-44)(z/(z/z(1/2)z))*(-37)(zz/((z(-1/6)z)/z))/(z/((zz3z)/z)) assuming z is positive. z*(157/3) Simplify ((vvv(2/13)/v)/(v/(v/((v((v/((vv(-3/7)v)/v))/v)/v)/vv))))/((v/v(-5))/v(-1))(v*(-5)v5)/(v(-2/17)v(-3)) assuming v is positive. v(-3337/1547) Simplify ((v(-14))(-1/15)(v/v*(-19))/(vvv/((vv/(vv(1/30)/vv))/v)))(-39) assuming v is positive. v(-6981/10) Simplify ((z0)3)*12((z*(2/11)z)(-9))(-13/6) assuming z is positive. z(507/22) Simplify (a/a(-3))/a*0(a(2/7))(-1/7)(a(-5)aa4)(2/53) assuming a is positive. a(194/49) Simplify ((ll*6)/llll/l*6(l(1/5))19)/(l*(-3/2)lll*4lll(-2/3)/(l(3/7)/ll)) assuming l is positive. l(293/210) Simplify (((uu/(uu/u(-4/7)))/u)46/(((uuu(-10)/uu)/u)/u(1/60)))(-15) assuming u is positive. u(26573/28) Simplify (j/(j(-5)j))/(j/j4)j*(-2/13)j*0j(j(-2)/j)/j(-6)j*(-2/7)/(j/(j(j/((j/j(1/4))/j))/j)) assuming j is positive. j(4299/364) Simplify (kkkk19kk/(k(-4/5)/k)(kkk/((k/k4)/k))/((k8k)/k))(-39) assuming k is positive. k(-4836/5) Simplify (((ss*16ss)/ss/(s/(ss/(sss(-1)s))))/(s(-8/7)/(s/(s/((s(2/41)/s)/ssss)))))43 assuming s is positive. s(249185/287) Simplify ((nn/n*(-24)nn)/n)/(n(-5/2)/n)n*(22/5)/((n/(nnn(1/2)))/n) assuming n is positive. n(187/5) Simplify ((v(2/7)vvv(-2/17))/(v(-1)/(v/(v(-4)/v))))/((v(2/5)v)/((v1/v)/v))(-37) assuming v is positive. v(58291/595) Simplify ((w/(w(1/2)w))(2/41)/(w(3/5)ww/(w*(5/4)/w)w))/((w(2/5))(-1/6))(2/3) assuming w is positive. w(-4915/1476) Simplify (f*2f/(((f/f*4)/f)/f))/((ff*(-2/7)f)/(f*(-2/19)/f))((ff/(f/(f(-5)/ffff)f))/(ff/f(-3/10)))(15/8) assuming f is positive. f(-10123/2128) Simplify (w(-2)ww/(w/w(-1/3)))21(ww*(-2/3)w)(1/5)/(w(2/9)/(w/w(-1/8))) assuming w is positive. w(-9659/360) Simplify (xx38)(1/16)/(x(1/14)xx/x(-27)x) assuming x is positive. x(-3095/112) Simplify (g(-11/6)g)(-11)(gg(-42))(1/5) assuming g is positive. g(29/30) Simplify (d(-2/11)/(d/d(-6/5)))12(d*(-7/2)d(-6))(-2/3) assuming d is positive. d(-3671/165) Simplify ((k/(k(-2/7)k))/(k/(k11k)))*(-20)(((k*(-2)/kk)/k)/kk/k7)/(k1)(-2/23) assuming k is positive. k(-37936/161) Simplify (m(-40)/(m(-27/2)m))/(m/(m/m(-29)))(-38) assuming m is positive. m(-2259/2) Simplify (w(-2/93)w(-8/5)w(-15)/(w4w))44 assuming w is positive. w(-442376/465) Simplify ((qq/(q/q*(-16))q/q*(2/5))/(qq*(-7)qqq(-2/5)/q))(-18) assuming q is positive. q162 Simplify (f/(f1fff)f*(-2/7))/(ff(f/(ff*0))/ff)*(-18)((f/(f/f(-1/3)))18)(-49) assuming f is positive. f(2287/7) Simplify ((z(-2))(-32)/(z/z*(-21)(z(-16/5)/z)/z))(-6/11) assuming z is positive. z(-1416/55) Simplify ((x(-5/3)/x)/x(x/((x/(x/x(-2/9))x)/xx))/x((x*(2/13)x)/x)(-24/13))32 assuming x is positive. x*(-230144/1521) Simplify (((q(((q*(2/5)/q)/q)/q)/q)/qqq)(-8/17)/((q(-7)/qq)/q(2/3)))(-7) assuming q is positive. q(-15029/255) Simplify (s(-5)/s*(-2/33)(s/(s/(s/(s/(ss(-4))))))/(s(-9)/s))/((s8ss)/s(4/7))(-3/2) assuming s is positive. s(3743/231) Simplify ((o(-2/3)ooo*(5/2)oo)/(o(-5)/oo*(-4/5)))/(((oo/(o/(ooo*3ooo)	{ "pile_set_name": "DM Mathematics" }
be (-5)/((-45)/2) + 207208/(-34146). Let m = f + -3/271. Calculate the common denominator of -4(-1)/(8/(-76)) and m. 7 Suppose -2o - 24 = -5i, -2o = -3o - 3i + 21. Let u(h) = -h*3 - 10h*2 + 9h - 13. What is the lowest common multiple of u(-11) and o? 9 Let n(v) = -2v3 + 2v. Let c(z) = 9z3 - 4z*2 - 18z + 10. Let x(r) = -c(r) - 4n(r). What is the least common multiple of x(5) and 51(-2)/(-2)? 15 Suppose -4d + 51 = -25. Let m = -38 - d. Let y = m - -63. Calculate the lowest common multiple of 86 and y. 258 Let s = 588720105 - 5291416318961/8988. Let k = -64/321 + s. Find the common denominator of k and -59/12. 84 Suppose 94w - 92w - 7n = 356, -2w + 396 = 3n. What is the smallest common multiple of w and 32? 192 Let o(j) = -j3 - 5j*2 - 3j - 7. Let r be o(-6). What is the common denominator of -13/20 and (r/25)/((112/(-35))/4)? 20 Let l = -30769 + 32025. What is the least common multiple of 2512 and l? 2512 Let h(u) = -1263u + 64. Let g be h(-7). What is the common denominator of 3 + (-196)/68 - g/5610 and -103/36? 396 Suppose 3u = -15l + 12l + 150, 2u - 5l = 58. Calculate the lowest common multiple of u and 1688. 18568 Suppose 0 = 2w + 20w - 528. Suppose -3v - w = -6v - 3c, -3c = -3v + 48. Calculate the lowest common multiple of 30 and v. 60 What is the common denominator of ((-374)/(-495)-1)/(18/(-5)) and (-142)/(-24) + ((-20)/2)/(-10)? 324 Let n = -10013 - -10082. What is the smallest common multiple of n and 552? 552 Let b = 1428 - 975. Let p = b - 713. Find the common denominator of 91/8 and (p/75)/((-2)/(-12)2). 40 Let l be (443 - 0) + (-80)/16. Let k = 553/4 - 4499/32. Find the common denominator of 1/5 + l/160 and k. 32 Suppose -99 = 8p + 13. Let a be -32(5/10 + 0). Let x = p - a. What is the smallest common multiple of x and 18? 18 What is the common denominator of (-302)/(-48)(-18)/(-99) and 18/(-24)164/54? 396 Let g = -11398 + 1128361/99. What is the common denominator of g and 7198/(-1952)6/33? 792 Let j(l) = l*2 - 22l + 103. Let r(x) = x*2 + 31x + 36. Let p be r(-30). Suppose 5g - 27 = 2g. Calculate the least common multiple of j(p) and g. 63 Let n(a) = -71a - 16. Let w(f) = 71f + 14. Let j(i) = -4n(i) - 3w(i). What is the lowest common multiple of 4 and j(2)? 164 Let n(o) = 82o3 + 6o*2 - 3o + 4. Let j be n(4). Suppose -h - 3h - j = 0. Find the common denominator of 23/3 and (-6)/(-15) + h/360. 36 Let m = -45 - 25. Let j = -71 - m. Calculate the common denominator of -58/5 and j/((-12)/27)46/(-12). 40 Let c be ((-6)/(-5))/(5/(-125)). Calculate the common denominator of 0 + -1 + (-71)/c and -4 + (-142)/(-16) + -3 - -3. 120 Let k be 33/419791290/(-15750). Let m = k - 22613/175. Let d = m - -10502. Calculate the common denominator of -5/22 and d. 132 Suppose -60a + 49057 + 5663 = 0. Calculate the lowest common multiple of a and 34. 15504 Suppose 11z + 11z = -220. What is the lowest common multiple of (13(0 - 2))/(z/20) and 6? 156 Let g(u) be the third derivative of -u4/24 + 2u*3/3 + 109u*2. Let r = -3 - -3. What is the lowest common multiple of g(r) and 9? 36 Suppose 29r + 36 = 32r. Let c = -72 + 100. What is the smallest common multiple of c and r? 84 Suppose 0 = -10f - 14f + 12960. What is the smallest common multiple of f and 60? 540 Suppose 37d - 597 = 2d - 177. What is the least common multiple of 40 and d? 120 Suppose 4a = y + 4621 + 162, -3y + 4787 = 4a. What is the lowest common multiple of a and 16? 4784 Let q(i) = 308i2 + 9i + 106. Let y be q(-6). Let w = y - 133763/12. Calculate the common denominator of w and 15/8. 24 Let j = 32938 + -92061704/2795. Find the common denominator of -37/20 and j. 11180 Let f = 259 - 103. Suppose -f = -20u - 6u. What is the smallest common multiple of -2 + 19 + -1 and u? 6 Let m(x) = x2 + 4x - 9. Suppose -20g + 105 = -95. Calculate the smallest common multiple of m(-7) and g. 60 Let t be (-30374)/(-12) + 16/(-4). Let j = 2534 - t. Calculate the common denominator of (-3 - 0)/((-22)/(-26)) and j. 66 Suppose 0 = -3a + 5 - 2. Let n be -12 - (0 + 2 + 174/(-29)). Find the common denominator of a/(-3n/93) and 23/11. 88 Suppose j + 5v = -96 + 32, 63 = -2j + 3v. Let r = 42 + j. Calculate the smallest common multiple of 27 and r. 27 Let t = -89/565 - -14122/55935. What is the common denominator of -38/81 and t? 4455 Suppose -196b = -203b + 1078. Find the common denominator of (-24)/4 - (-875)/b and -50/3. 66 Let q be ((-55450)/312)/(-25) + (-2)/(-3). Let y = q - 113/13. Find the common denominator of 63/2 and y. 12 Let j = 32797 - 96833/3. Let u = 738 - 223. Let v = j - u. Find the common denominator of v and -32/9. 9 What is the least common multiple of 225 and ((-5)/(-6))/(142/5964)? 1575 Suppose 2i = 3i. Let a = 6347 + -50713/8. Find the common denominator of -1 - 55/8 - i and a. 8 Calculate the common denominator of (-18)/643511/((-66)/300) and 23/312. 3432 Let b be (-1)/(-2) + (1215/18)/(-9). What is the smallest common multiple of (72 + 4)(-6 - b) and 11? 836 Let k be (2 + -1)/(-1 + (-177)/(-174)). Suppose 3f + f = 5i + k, i + 38 = 3f. Let g = 2 - 0. What is the smallest common multiple of g and f? 12 Suppose 165 + 555 = -6b. Let t be 2/(-20)-5b/(-2). Calculate the common denominator of 65/46 and (-1 - -2)/(40/t). 92 Let s be 4 - (-12)/93 - 4. Suppose 0 = sn + 5p - 425, -4n + 433 + 16 = -3p. Calculate the least common multiple of n and 40. 440 Suppose -42o - 32o + 63o + 539 = 0. What is the smallest common multiple of o and 15? 735 Let h(l) = -13l + 414. Let y be h(22). Suppose 3v - y = -5v. What is the least common multiple of v and 88? 176 Suppose 3l + 624 = 16l. Suppose -6d - 2d = -l. What is the lowest common multiple of ((-50)/(-15) - (-4)/d)2 and 6? 24 Let g be (-10)/(-60)54966/8. Let y(q) = 142q - 17. Let f be y(-8). Let t = f + g. What is the common denominator of t and 38? 8 Suppose -5x = 4j - 37, 3x + 696j - 697j = 12. Calculate the least common multiple of 1407 and x. 7035 Calculate the common denominator of 115/742 and (-36)/(-33) + 7 + -9. 8162 Let m = -1724599/21878428 + 33/43238. Find the common denominator of m and 117/644. 7084 Let g = -24646 - -1084453/44. Calculate the common denominator of g and 59/92. 1012 Suppose 2k = -3n + 24, -5k - 5n - 71 + 121 = 0. Suppose -33 - 5 = -2y. Calculate the lowest common multiple of k and y + 3 + (-2 - -2). 66 Suppose -90 = -110n + 1010. Calculate the least common multiple of n and 1010. 1010 Let c = -678 + 964. Let k = 619/2 - c. What is the common denominator of k and -35/16? 16 Let v = 32 - -15. Let l = v - 43. What is the common denominator of -34/33 and (-11)/(-54) - l(-1)/(-8)? 297 Suppose 3h + 122 = 4y, 3y = -3h + 2h - 32. Suppose 2p = 0, -2n - 51 = -2p + 73. Let r = h - n. Calculate the smallest common multiple of r and 10. 120 Let i = 98 + 80. What is the common denominator of 22 + -22 - i/4 and -57/20? 20 Let r = -12314 - -344893/28. What is the common denominator of r and 85/208? 1456 Find the common denominator of 26/73 and 104/1456 - 1293/(-126). 219 Calculate the smallest common multiple of ((-248)/(-24) + -17)/((-2)/3) and 250/20(-16)/(-10). 20 Let c be (-2)/8 + (-15422774)/8. Let t = 11538385/6 + c. Let y = 4801 + t. What is the common denominator of 8 and y? 6 Let y be (3 - 0/3) + (114 - 3). What is the common denominator of -49/33 and 24/(-6) + 580/y? 627 Let d = -28315 + 283109/10. What is the common denominator of d and (-4)/(-20) - (-519)/(-1970)? 1970 Let w = 78860173/40296 + -45012/23. What is the common denominator of -99/164 and w? 71832 Let a(y) = 4y*2 + 1. Let u(b) = b - 1. Let l(d) = -4d + 5. Let x(c) = -l(c) - 3u(c). What is the lowest common multiple of a(1) and x(9)? 35 Let p = -15497 + 16080. What is the smallest common multiple of 2120 and p? 23320 Suppose -u + 20s = 21s - 8, -8 = -4s. Let m be (1 - (-1 + 1))*62. Let a = -23 + m. What is the least common multiple of u and a? 78 Let k = -239 + 296. Let v = -24 + k. What is the lowest common multiple of v and 15? 165 Let y be (-12)/(-60) + (-50012)/1260. Let q = y + 334/7. Calculate the common denominator of q and -53/46. 414 Let n = -25646/11 + 3078851/1320. Find the common denominator of -61/680 a	{ "pile_set_name": "DM Mathematics" }
xz + iz*2 and give m. 3 Express -3i*4 + 31i*2 - 63i*2 + 5i*4 + 45 + 40i2 - i4 as gi4 + ti*2 + bi + w + ji3 and give b. 0 Express (2z - 2z - 4z)(431z + 81z - 4639z + 477z - 1770z - 4110z) as hz + jz2 + b and give h. 0 Rearrange -2516h*2 - 1404h*2 - 389h*2 to the form vh*2 + l + fh and give v. -4309 Rearrange ((2 + 0 + 3)(-1 + 2k + 1) + 3k - k + 0k)(-279 + 682 + 685) to z + lk and give z. 0 Express (2n2 + 0n*2 - 2n + n*2)(-1931n + 4140n - 1635n) in the form un + in2 + a + hn*3 and give h. 1722 Express 2u*2 - 3 - 2 - 55u*4 - 196u + 389u + 6u*3 - 195u in the form m + au3 + hu + fu2 + tu*4 and give f. 2 Rearrange (-2 - 2 + 6)(235 - 170 + 242)(2l + 10 - 10) - 1 + 1 - l + (l - 5l + 3l)(-3 + 2 + 3) to the form n + tl and give t. 1225 Rearrange (-75g2 + 303g*2 - 165g*2 + 50)(0 + 4 - 1) to j + sg + ug*2 and give u. 189 Rearrange (0u + 2u + 0u)(68 - 141 + 19 - 42342u + 54) to m + pu + du*2 and give d. -84684 Rearrange (2 + 3 - 1)(12684 - 1887 + 3456)(4y - 2y - 3y) to ty + j and give t. -57012 Rearrange (n2 + n2 + n2)(-4265 + 2276 - 2413) to the form r + kn2 + hn and give k. -13206 Express -568 + 185g2 + 1136 - 567 - g + 14g in the form l + zg2 + dg and give d. 13 Express 2c + 3c*2 + 5472 - 10950 - 2c*2 - 3c + 5468 + 5c3 as bc + v + lc3 + wc*2 and give l. 5 Rearrange 27m - 8848 + 5311 - 29m to km + a and give a. -3537 Rearrange (-3 - 2l + 3)(2l2 + l2 - 2l*2) + 896l*3 - 1427l*3 - 4076l*3 to jl*3 + sl + p + ol2 and give j. -4609 Express -1 + 70633s - 22s3 - 4 - 70644s in the form bs + rs*3 + p + vs*2 and give r. -22 Rearrange (-2 - 2 - 3)(1 + 2 - 1)(-b + 3 - 3)(3062b - 191 + 86 + 105) to sb + xb2 + l and give x. 42868 Rearrange 94472545 - 94472545 + 29145x to the form rx + f and give r. 29145 Express -52v*2 + 4v + 16v3 - 2v*4 + 76 - 70 + 49v*2 in the form wv + gv3 + kv*4 + av*2 + f and give f. 6 Express 14837 + 3909t - 14837 + 2t3 in the form yt*3 + ct + d + ot2 and give o. 0 Rearrange 12n + 8n2 - 14n - 2n2 - 4n*2 - n - 11 to g + rn*2 + xn and give x. -3 Rearrange 12 + 156d + 8 - 154d + (7d + 6d - 6d)(4 - 2 - 3) + 1 - 1 + 2d to the form a + hd and give a. 20 Rearrange -25112g - 67g*3 - 5 - 5g*2 + 7g*2 + 25104g to cg3 + t + sg + zg2 and give t. -5 Rearrange -2r2 + r2 - r*2 + (348 - 100 - 165)(4r2 + 4r*2 - 17r*2) - r - 3 + 3r*2 + 0r2 - r2 to pr2 + dr + b and give b. -3 Rearrange -18r + 6r*2 - 253r*3 + 543r*3 + 3r*4 - 289r*3 to the form s + cr + hr2 + ir*4 + zr*3 and give h. 6 Express 9b*2 - 28b + 81b3 + 30b + 2b4 - 70b*3 + 13 in the form pb*4 + m + xb + yb3 + ub*2 and give u. 9 Express 4u - 43u2 + 72u*2 - 14u*2 + 3u - 12u2 - 163u*4 in the form g + ku*4 + hu + du3 + yu*2 and give k. -163 Express (-248m + 41m2 + 247m - 35m2)(-15m + 7m - 22m) in the form gm + rm3 + bm*2 + o and give r. -180 Rearrange -516h - 191h2 + 38 - 28 + 512h to ph2 + l + mh and give p. -191 Rearrange -456 + 907 + 14703v - 222 - 229 to the form uv + a and give u. 14703 Rearrange -342p + 642p + 1492p + 1981p + 2520p to op + k and give o. 6293 Rearrange (233 + 752 - 21 + (0 + 0 - 2)(3 + 0 - 2))(-2q + 5q - 4q) to the form u + iq and give i. -962 Express v*2 - 125v*4 - 18v*4 + 2v*3 - 2v - 112 + 141v4 as lv*2 + xv + c + nv4 + sv*3 and give x. -2 Express 598m + 3064m - 857m + 631m in the form x + am and give a. 3436 Express (20p + 27p - 51p - 3p*2)(12p2 + 16 - 16) as t + kp*2 + vp*3 + ap*4 + sp and give v. -48 Express (-8p + 2p + 2p + (0p - p + 4p)(-4 + 4 + 4))(4 + 1 + 20) as np + r and give n. 200 Express 2 + y*2 + y + y - 5y - 4y + 4y as ly2 + vy + r and give v. -3 Rearrange -3436 - 7a + 1074 + 1503 + 792 + 1573 to ma + k and give m. -7 Rearrange -4l3 + 5l*3 + 98 - 4161l - 98 + 121l to y + ql*2 + rl + bl3 and give y. 0 Express 2o - 2o - 2o*3 + (-1 + 3 - 4)(-2o3 + 3o*3 - 3o*3) - 2840o*3 - 32180249o + 32180249o in the form co*3 + fo*2 + uo + r and give f. 0 Rearrange (-1 - 5 + 17)(-3p + 3p + 2p*2) + (1 + 0 - 2)(2p + 3 - 3)(4p - 2p - 3p) - 4p*2 - 9p*2 - 2p*2 to the form np*2 + up + h and give n. 9 Rearrange (10t2 + 29t - 2 - 29t)((0t - t + 0t)(-3 - 1 + 5) + 10t - 19 + 19) to pt2 + rt + jt3 + l and give r. -18 Rearrange (-4w + w + 11w)(2w2 - w2 - 2w*2 + (-2w + 3w - 2w)(28w - 133 + 133)) to the form gw2 + bw*3 + f + sw and give b. -232 Express (377 - 2185 - 3520)((-1 + 3 + 0)(-3u + 2u - 2u + (u - 4 + 4)(-1 + 2 - 2)) + u - 2u + 2u) as nu + g and give n. 37296 Express -55 + 17u + 36 + 18u4 + 17 - 2u*3 in the form ku*2 + iu*3 + q + cu*4 + ru and give k. 0 Express (-20o + 20o + 9o2)(-36 + 18 + 26 + (-2 + 3 + 0)(-1 + 4 - 4) + 1 - 2 + 4) in the form g + mo*2 + qo and give m. 90 Rearrange (-135c2 - 140c*2 - 234c*2)(16c + 57 - 57) to the form dc*3 + yc*2 + kc + t and give t. 0 Rearrange (6g2 + 8g*2 - 3g*2)(-1229g + 537g + 518g) to the form s + xg + hg3 + og*2 and give s. 0 Rearrange 973i*2 - 1902i*2 + 0 - i + 932i*2 + 182i*3 - 2 to the form n + oi + ti3 + ri*2 and give t. 182 Express (-3 - 11 + 23)(-158 - 109g + 158)(3 - 3 + 3g) as zg*2 + v + sg and give z. -2943 Express -20343y + 50y*2 - 4 + 76y*2 + 20345y + 152y2 in the form x + iy + gy2 and give x. -4 Express (-20b - 14b + 39b*2 + 34b)(9172 + 472b*2 - 9172) as a + vb*2 + ib*3 + fb*4 + hb and give f. 18408 Rearrange (-4f + 1 - 1)(-434706 + 434706 + 163f + (0 - 2f + 0)(1 - 3 + 1))(-2f + 4f + 0f) to b + mf*2 + of + kf3 and give k. -1320 Rearrange 11 + 12 - 230s*3 + 157s*3 + 123s*3 to the form xs*2 + us*3 + t + zs and give u. 50 Rearrange (-585p3 - 18648p*2 + 1 + 18648p*2 - p)(-3p + p - p) to the form op*3 + sp*2 + u + yp + mp4 and give s. 3 Rearrange z3 - 11z*4 - 723z*2 + 702z*2 + 12z - 14z to the form u + rz*2 + xz + az4 + iz*3 and give a. -11 Rearrange -10q*3 + 3508q*2 + 13q*3 - 2323q*2 to tq + xq3 + l + rq*2 and give x. 3 Express 9u - u*2 + 17u + 35u - 43u as c + tu2 + ku and give t. -1 Express -15517b3 - 15520b*3 + 31060b*3 + 7b in the form jb + ab*2 + f + zb*3 and give j. 7 Express (5 - 14 - 12)(-10h + 2h - h) + 4h - h + 5h as ph + w and give p. 197 Express (2j + 5j2 + j - 3j*2 - 1)(-5j - 2j + 3j + 42) in the form t + mj*3 + sj + rj2 and give s. 130 Express 418x + 5 + 16 - 79x3 - 23 + 78x*3 in the form hx*2 + lx + n + gx3 and give n. -2 Express (m - m - m)(-564 - 275 - 107)(-60m - 205m + 37m) as gm2 + v + sm and give g. -215688 Rearrange (1 - 2 - 3)(-126m - 85m - 660m - 335m) + 3m - m + 0m to the form j + um and give u. 4826 Express 0 + 13 - 8f + 238498f*3 - 238504f*3 as qf*2 + kf + n + sf3 and give n. 13 Express -2450j - 205 + 1764j - 2393j + 207 as wj + p and give w. -3079 Rearrange 79i - 1161 - 1128 + 2298 to the form d + ni and give d. 9 Rearrange (-1 + 1 + 3a + (-2 + 3 - 3)(2a + a - a) + (-5 - 4 - 12 + 4a)(-4 - 3 + 4))(3a*2 + 3a - 3a) to the form wa*2 + n + ra*3 + ta and give r. -39 Rearrange -638d2 + 2d*3 + 6 + 0d - 429d2 - d4 + d + 1064d*2 to the form bd*2 + zd*4 + wd*3 + x + nd and give x. 6 Rearrange -2m2 - 2m*4 + 2m*3 - 33m - 8 - 12 + 19 - 6m to the form sm*3 + lm + xm2 + um*4 + c and give c. -1 Express 129n*3 + 9 + 8n + 46n3 + 21n*2 - 173n*3 as sn + in3 + xn*2 + d and give s. 8 Rearrange 1601w*2 - 607w*2 + 3319w*2 - 491w*2 + 5653w*2 to dw + z + xw2 and give z. 0 Rearrange (15d - 3d + d)(-4 + 2 + 0)(4 - 4 - 2) - 2 + 2 + 5d + (64 + 39d - 64)(-1 + 2 + 1) to the form wd + m and give w. 135 Express ((2p - 4p + 4p)(4p - p - 4p) + (1 + 0 - 2)(-44p + 119p + 32p)(-2p + p + 3p))(-2p + 3 - 3) as sp2 + op + n + ip*3 and give i. 432 Rearr	{ "pile_set_name": "DM Mathematics" }
alculate the greatest common divisor of 1666662 and 210222. 1374 Calculate the highest common factor of 840 and 4661720. 280 Calculate the highest common factor of 476354 and 2888052. 2494 Calculate the greatest common factor of 1799442158 and 1577. 1577 What is the highest common divisor of 22946 and 252483? 77 What is the greatest common factor of 21970 and 845290? 10 Calculate the highest common factor of 2140 and 15846807. 107 Calculate the highest common divisor of 209841351 and 38801. 5543 What is the greatest common factor of 225722 and 266? 14 What is the highest common divisor of 27 and 61236918? 27 What is the greatest common factor of 29864245 and 5975? 1195 Calculate the greatest common factor of 1377 and 26602722. 459 Calculate the highest common divisor of 342 and 1576740. 6 Calculate the greatest common divisor of 468 and 7423221. 39 Calculate the greatest common factor of 13558630 and 10. 10 Calculate the greatest common factor of 4731823 and 785. 157 Calculate the greatest common factor of 4824 and 18277344. 72 What is the highest common factor of 240644496 and 6? 6 What is the greatest common divisor of 5985159 and 19897? 101 Calculate the highest common divisor of 6 and 28313640. 6 What is the greatest common divisor of 738 and 17987274? 738 What is the greatest common factor of 1893242 and 182? 26 What is the greatest common factor of 38902 and 4346? 106 Calculate the greatest common divisor of 180476268 and 6. 6 What is the highest common factor of 55 and 2709654640? 55 Calculate the highest common divisor of 1867835 and 35. 5 Calculate the highest common divisor of 31545 and 1375155. 45 Calculate the highest common factor of 36278 and 50966. 34 Calculate the greatest common factor of 12485083 and 117. 13 Calculate the greatest common factor of 114744415 and 1765. 1765 Calculate the greatest common factor of 2081449 and 64459. 73 Calculate the greatest common factor of 1108588 and 52. 52 Calculate the greatest common factor of 64944556 and 36891. 4099 Calculate the highest common factor of 4399290 and 6390. 90 Calculate the greatest common divisor of 1477 and 2604518. 7 What is the greatest common factor of 10329 and 3329381? 3443 What is the greatest common factor of 585 and 4761783? 117 Calculate the highest common divisor of 784 and 5356484. 196 Calculate the greatest common divisor of 79973404 and 4585. 917 What is the greatest common divisor of 832775 and 19325? 25 What is the greatest common divisor of 817133 and 377? 29 What is the greatest common factor of 87 and 8860851777? 87 Calculate the greatest common divisor of 93104 and 372592. 176 Calculate the greatest common divisor of 13433490 and 6300. 630 Calculate the highest common divisor of 2636 and 914033. 659 What is the greatest common factor of 3599875 and 12077? 929 What is the greatest common factor of 36593415 and 6046? 3023 What is the highest common divisor of 40692260 and 2100? 140 Calculate the greatest common factor of 749250 and 2106. 162 What is the highest common divisor of 214056 and 394418? 1982 What is the greatest common factor of 520 and 213986760? 520 What is the highest common divisor of 14685 and 153552234? 2937 What is the highest common divisor of 16192012 and 618? 206 Calculate the greatest common divisor of 2561780 and 9440. 1180 Calculate the greatest common factor of 174 and 3639786. 6 Calculate the greatest common factor of 2599753 and 104. 13 Calculate the greatest common divisor of 6234 and 470103862. 2078 Calculate the greatest common divisor of 6862 and 4211881. 73 Calculate the highest common divisor of 414 and 44787026. 46 What is the greatest common divisor of 2394 and 104319747? 1197 Calculate the highest common divisor of 5654 and 164934. 22 Calculate the highest common factor of 1409 and 36083081. 1409 Calculate the greatest common factor of 908222 and 1218. 406 Calculate the highest common divisor of 4065 and 578415. 15 What is the highest common factor of 299437968 and 144? 48 What is the greatest common divisor of 7 and 2093609539? 7 Calculate the greatest common factor of 7491974 and 371. 371 Calculate the highest common factor of 21275 and 89120. 5 What is the highest common divisor of 161200 and 156650? 650 Calculate the greatest common divisor of 4560 and 3777690. 30 What is the greatest common divisor of 309060 and 956250? 1530 Calculate the highest common factor of 756442 and 567638. 1226 What is the highest common factor of 9107568 and 720? 144 Calculate the greatest common factor of 779893096 and 16. 8 What is the greatest common factor of 9910 and 18590? 10 Calculate the highest common divisor of 18 and 325277982. 18 Calculate the greatest common divisor of 2016 and 8320464. 144 Calculate the highest common divisor of 733649 and 323183. 2359 What is the greatest common factor of 348 and 127394796? 348 Calculate the highest common divisor of 5284 and 193551599. 1321 What is the greatest common divisor of 17248 and 3016244? 2156 Calculate the greatest common divisor of 9394 and 3199084. 854 Calculate the greatest common factor of 922477 and 55169. 1283 What is the greatest common factor of 3880962 and 6? 6 Calculate the greatest common divisor of 14131497 and 1236. 309 What is the greatest common divisor of 23744 and 834326? 106 Calculate the greatest common divisor of 1796554292 and 10933. 10933 What is the greatest common factor of 5064 and 1702137? 633 What is the highest common divisor of 555296 and 9632? 224 Calculate the highest common divisor of 48485 and 433320142. 9697 What is the highest common divisor of 156 and 214739668? 52 Calculate the highest common factor of 3008 and 8582408. 8 Calculate the greatest common divisor of 1356 and 88848171. 339 What is the greatest common factor of 109374544 and 464? 464 What is the highest common divisor of 2859300 and 14100? 300 What is the greatest common factor of 11237 and 4017967? 17 Calculate the greatest common divisor of 358913 and 147431. 379 What is the highest common factor of 6930 and 151935? 105 Calculate the greatest common factor of 8840 and 9502480. 520 Calculate the highest common divisor of 79 and 55440383. 79 What is the greatest common divisor of 1427 and 65475? 1 Calculate the highest common factor of 161468220 and 1884. 1884 Calculate the greatest common divisor of 557346 and 12768. 114 What is the greatest common divisor of 6885200 and 16800? 2800 What is the highest common factor of 100209655 and 10220? 2555 What is the greatest common factor of 27990 and 43963893? 2799 What is the greatest common divisor of 547822 and 1209604? 814 What is the greatest common factor of 6152348 and 28? 4 What is the highest common factor of 6665548 and 804? 4 Calculate the highest common divisor of 3892008 and 28527. 771 Calculate the greatest common factor of 38027 and 2288. 11 Calculate the greatest common divisor of 62384 and 7373566. 1114 Calculate the highest common divisor of 33 and 17167799. 11 What is the greatest common factor of 1055 and 2498354995? 1055 What is the highest common factor of 61240048 and 2512? 2512 Calculate the highest common factor of 4214371 and 133. 133 Calculate the highest common factor of 3432 and 13751232. 264 What is the greatest common factor of 86 and 6720599? 43 What is the greatest common divisor of 212553 and 92321? 2147 What is the greatest common factor of 14412532 and 1020? 68 Calculate the greatest common divisor of 89028 and 29628. 36 What is the greatest common factor of 364 and 9438940? 28 Calculate the highest common divisor of 1161202245 and 490. 245 Calculate the greatest common divisor of 1258110 and 156030. 210 What is the highest common factor of 40 and 90060970? 10 Calculate the highest common divisor of 29486949 and 516. 129 Calculate the highest common divisor of 3051162 and 108. 54 What is the greatest common factor of 84 and 27397916? 28 Calculate the highest common factor of 444 and 1035384172. 148 Calculate the highest common divisor of 733480 and 5560. 40 What is the greatest common divisor of 114699 and 1862691? 519 Calculate the highest common factor of 89769889 and 209. 209 What is the highest common factor of 656 and 534872? 8 What is the highest common divisor of 266063 and 1674386? 1393 Calc	{ "pile_set_name": "DM Mathematics" }
- 7z2. Determine k(w(s)). 12s*4 Let z(t) = -2t*2. Let f(a) be the second derivative of 3a*4/2 + 18a. Calculate z(f(g)). -648g4 Let z(k) = 2k*2. Suppose 4s - 1 = 11. Let g(h) = 2h2 + s - 1 - 2. Give z(g(y)). 8y*4 Suppose -2n = n. Let d(k) = k + k + nk. Let o(p) = -p2 - 4p*2 + 6p*2. What is d(o(l))? 2l*2 Let l(z) = 15z + 13. Suppose 5r = 3r - 12. Let o(h) = 7h + 6. Let x(j) = rl(j) + 13o(j). Let p(v) = 3v. Calculate p(x(d)). 3d Let m(w) = -3w - 28. Let k(v) = -v. Give k(m(r)). 3r + 28 Let z(h) = -53h2 - 1. Let c(s) = -s2. Give c(z(k)). -2809k4 - 106k*2 - 1 Let w(m) = -14m. Let j(k) = k + 0k - 6k. Let u(l) = -17j(l) + 6w(l). Let b(a) = 4a2. Give u(b(s)). 4s*2 Let s(q) = -q + 525 - 525. Let u(r) = 21r*2. Determine s(u(i)). -21i*2 Let x be 0 + (0/(-1) - -2). Let z(d) = 3dx - d2 + d*2. Let k(a) = -2a. What is k(z(y))? -6y2 Let r(p) = -9p*2. Let k be (-15)/(-10)(-4)/(-3). Let l(j) = 4j - 7j + kj. Determine r(l(o)). -9o2 Let k(y) be the first derivative of y2/2 - 3. Let d(m) = -27 + 12 - 3m + 15. Determine k(d(i)). -3i Let p(o) = o*3 + 3o*2 - 3o - 3. Let u be p(-4). Let k(v) = -v - 4. Let x be k(u). Let b(z) = -4z + 3z + xz. Let f(c) = c. Give f(b(g)). 2g Let w(x) = -8x2. Let j(o) = 480o. Calculate w(j(g)). -1843200g2 Let r(h) be the first derivative of -3h*2 - 7. Let z(x) = -x. Give z(r(i)). 6i Let b(h) = -4h2. Let t(s) be the first derivative of s3/3 + 6. Give t(b(p)). 16p*4 Let x(s) = -2s*2. Let w(z) = -10z - 106. Give w(x(g)). 20g2 - 106 Let f(a) = a2. Suppose -2g - 78 = -5g. Let l(q) = -q2 - 13q - 13. Let h(j) = 3j + 3. Let r(t) = gh(t) + 6l(t). Give f(r(s)). 36s*4 Let h(a) = -28a. Let d(u) = 1061u. Determine h(d(t)). -29708t Let c(i) be the first derivative of -i5/60 + i3 - 7. Let y(q) be the third derivative of c(q). Let n(b) = 2b2. Give n(y(m)). 8m*2 Let a(t) = 3t + 3. Let n(p) = 6p + 5. Let h(z) = -5a(z) + 3n(z). Let m(k) = 1 - 1 + 461k*2 - 453k*2. Calculate m(h(y)). 72y*2 Let i(t) = -7t2. Let c(r) be the third derivative of r7/2520 + 5r4/24 - r2. Let b(l) be the second derivative of c(l). Determine b(i(z)). 49z4 Let k(y) be the second derivative of -y4/4 - 4y. Let o(z) = -5z. Determine o(k(l)). 15l2 Let s(w) be the second derivative of w3/6 + 2w. Let q(j) be the first derivative of -j*2 - 1. Calculate q(s(z)). -2z Let c(n) = 105n2. Let g(p) = -18p + 2. Give g(c(k)). -1890k2 + 2 Let p(w) = -w. Let v(s) be the third derivative of s7/840 + s4/8 - 2s*2. Let j(r) be the second derivative of v(r). What is j(p(b))? 3b*2 Let m(f) = -3f. Let k(a) be the first derivative of -4a3/3 + 24. Determine m(k(j)). 12j*2 Let z(t) = 18t*2 + 10t*2 - 23t*2. Let f(m) = -6m + 4. Let w be 8/2 + -2 + -1. Let o(k) = -k + 1. Let d(x) = wf(x) - 4o(x). What is z(d(a))? 20a2 Let l(d) = -d + 4. Let k be l(2). Let b(a) = 3 + 0a*2 + 3a*k - 3. Let i(o) = -3o. Give i(b(r)). -9r2 Let i(y) = -5y*2. Let u(h) = -2h*2 - 33. Calculate u(i(f)). -50f*4 - 33 Let h(g) = -2g. Let o = 2 + -4. Let x = -1 - o. Let j(f) = -2f2 + 0 - x + 1. Give j(h(w)). -8w*2 Let h(s) = s. Let n(t) = 0 + 4 - 3t*2 + 4t - 3t - 5t. Let w(u) = 14u2 + 21u - 21. Let m(q) = -21n(q) - 4w(q). Calculate h(m(o)). 7o2 Let r(t) = -2t. Let y(s) = -13s - 5. Let j(k) = -8k + 4 + 4 + 28k. Let h(c) = 2c + 5. Let z be h(-5). Let f(x) = zj(x) - 8y(x). Calculate r(f(i)). -8i Let x(p) = -p. Let w(b) = -9b + 24. Give x(w(s)). 9s - 24 Let a(w) = 2w*2 - 15. Let s(k) = -k. Give s(a(u)). -2u*2 + 15 Let s(o) = -2o. Let w(c) = 4c2 - 268c + 1. Determine s(w(f)). -8f2 + 536f - 2 Let m(a) be the second derivative of 5a4/6 + 9a2/2 - a. Let g(l) = l2 + 1. Let t(j) = -18g(j) + 2m(j). Let u(v) = 4v - 4v - 3v. Give t(u(y)). 18y*2 Let p(l) = -4l*2. Let y(m) = 79m. What is y(p(x))? -316x2 Let n(o) = -o. Let m(q) = q2 - 5q + 2. Let l be (9/3 + 2)1. Let b be m(l). Let u(a) = 0a + ba - 3a. Determine n(u(p)). p Let u(i) = 48i + 44. Let d(h) = -h - 1. Let z(m) = -88d(m) - 2u(m). Let f(n) = n. Determine f(z(k)). -8k Let o(i) = i*2 - 1. Let f(g) = 5g*2 - 4. Let d(s) = f(s) - 4o(s). Let q(h) be the third derivative of -3h4/8 + 2h*2. Give q(d(c)). -9c*2 Let d(q) = 8q2. Let t(g) be the third derivative of -g6/720 - g*4/24 - 4g*2. Let f(l) be the second derivative of t(l). Determine d(f(r)). 8r*2 Let y(c) = 3c. Let p be -6180/(-15). Let r(m) = pm - 32m + m*2. Determine y(r(q)). 3q*2 Let a(y) = -5y - 13. Let c(o) = 2o. What is a(c(q))? -10q - 13 Let i(d) = 11d + 11. Let u(z) = -1. Let j(f) = -i(f) - 11u(f). Let c(a) = 2a + 6a + a - 7a. Determine c(j(p)). -22p Let n(o) = -4o + 0 + 4 - 4. Let k(a) be the third derivative of a5/60 + a2. Calculate k(n(f)). 16f*2 Let r(z) = 16z*2. Let j(h) = 663h. Determine j(r(c)). 10608c2 Let a(o) be the third derivative of -o4/6 + 16o*2. Let d(q) = -2q*2. What is d(a(z))? -32z*2 Let r(i) = 2i + 0i + 4i. Let u(g) = -g*2. Let f = 5 - 7. Let t(c) = 3c*2. Let h(p) = fu(p) - t(p). Determine r(h(s)). -6s2 Let d(o) = -2o*2. Let p(i) = -17i + 7. Determine d(p(x)). -578x2 + 476x - 98 Let k(h) = -16h + 1. Let v(f) = -f. What is k(v(r))? 16r + 1 Let f(n) = n. Let q(z) be the second derivative of -17z3/3 - 15z. What is q(f(j))? -34j Let a(z) = -2z*2. Let j be ((-6)/(-2))/((-6)/(-10)). Suppose 0 = ji - 13 + 3. Let q(y) = -iy + 0y + 4y. What is q(a(d))? -4d*2 Let f(v) = 11v. Let x(l) = l. Let w(k) = -10k. Let o(b) = -w(b) - 8x(b). Determine o(f(q)). 22q Let s(z) = z2. Let p(u) = u2 + u. Let t(y) be the second derivative of y4/3 + y3 + 7y. Let h(k) = -6p(k) + t(k). Calculate h(s(d)). -2d*4 Let u(w) = 9w*2 + 2w + 2. Let i(c) = -19c2 - 5c - 5. Let d(v) = -2i(v) - 5u(v). Let x(b) = -b*2. Determine x(d(s)). -49s*4 Let a(g) = 424 - 7g*2 - 424. Let z(s) = 2s. What is z(a(v))? -14v2 Let b(q) = 2q. Let i(k) = -76k + 36. Let v(s) = 2s - 1. Let n(h) = -2i(h) - 72v(h). What is b(n(u))? 16u Let h(b) = -77b*2 - 5b. Let m(j) = j. What is h(m(g))? -77g2 - 5g Let r(l) = 744l2. Let h(q) = q. Determine h(r(z)). 744z*2 Let t(a) = -1 + 2a + 1. Let j(h) be the second derivative of -h6/720 + h4/12 + 3h. Let o(n) be the third derivative of j(n). What is t(o(g))? -2g Let b(m) = 8m2 + 14. Let n(y) = -y2 - 2. Let u(p) = 5b(p) + 35n(p). Let i(o) be the first derivative of -4o*3/3 - 2. Determine i(u(d)). -100d*4 Let a(v) = -2. Let s(l) = l + 9. Let b(k) = -18a(k) - 4s(k). Let x = -5 - -15. Let q(i) = 3i - 11i2 + xi*2 - 3i. Calculate b(q(f)). 4f2 Let w(n) = -2n*2. Let x(q) = -59q. Determine x(w(y)). 118y2 Let j(f) = 28f2. Let h(p) = p2. Give h(j(z)). 784z4 Suppose -5h - l = -10, 3h - 6h - l = -6. Let t = 2 + 0. Let r(x) = -6x2 - 3x*2 + 0x*t + 2xh. Let y(d) = d2. Give y(r(w)). 49w4 Let l(v) = -v2. Let t(k) = -6k*2 - 6 + 1 + 5. Give t(l(w)). -6w*4 Let x(h) = 27h*2. Let q(n) = -2n + n + 5n - n. What is q(x(r))? 81r2 Let w(j) be the first derivative of j3 - 116. Let x(l) = 5l2 + 2. Let r(m) = 16m*2 + 7. Let g(q) = 2r(q) - 7x(q). Determine w(g(v)). 27v*4 Let c = 4 + -1. Let k be 9/c7/1. Let l(t) = -t*2 + kt - 21t. Let q(z) = -2z. Give q(l(r)). 2r2 Let u(i) = 1 + 6i + 0 + i*2 - 7 - 5i*2. Let m(c) = -5c*2 + 7c - 7. Let k(w) = 6m(w) - 7u(w). Let f(q) = 9q. What is k(f(t))? -162t*2 Let k = -4 - -11. Let t(b) = -9b + kb - 4b. Let s(i) = 3 - i + 4 - 7. What is t(s(u))? 6u Let d(u) be the first derivative of 1/2u*2 + 0u - 3. Let q(n) = -2n. Give q(d(w)). -2w Let z(q) = -2q. Let t(m) = -m3 - 5m*2 + 6m + 2. Let h be t(-6). Let w(a) = -4ah + 0a*2 + 2a*2 + 0a*2. What is w(z(r))? -8r2 Let i(y) be the first derivative of -y3/3 - y - 3. Let j(l) be the first derivative of i(l). Let b(t) = t. Calculate j(b(v)). -2v Let w(n) = -19n*2. Let l(k) = 10k*2 - 6k - 6. Let a(g) = -29g2 + 17g + 17. Let i(d) = -6a(d) - 17l(d). Determine i(w(b)). 1444b4 Let s(l) = 276l. Let p(z) = z*2. Determine s(p(i)). 276i**2	{ "pile_set_name": "DM Mathematics" }
/13)xx/x*(-3/11))(xx(2/11)xx)/x(3/4)xx(-2/3)xx(2/3) assuming x is positive. x(48623/572) Simplify (y1)(-9/7)(yy1)/yy/y*(-4)((y(-2))(-42))(-3/29) assuming y is positive. y(-807/203) Simplify ((uuu*0/uuu)/(u/u(3/4)u))*(-24)((u*(-3/8)/u)/uuu6)(-18/11) assuming u is positive. u(-2181/44) Simplify ((k(kk/(((kkk/k(-3/17))/k)/kk))/k)/(k/k*(-20/3)k)k(-27)kkk(5/2))(-5/7) assuming k is positive. k*(15985/714) Simplify ((w/(ww/(www*(2/5))w)w/(w(w/((www*(1/5)ww)/w))/w))/(w7w(1/5)))/(w(-3)/w(-7))(-20/3) assuming w is positive. w(346/15) Simplify ((a(1/3)(a/(a/(a/(a4/a)))a)/a)/((a/((a/a*1)/aa))/a)*(-35))/((aa*(2/9)/aa(-6))/(a(3/5)/((a/a(-1))/a))) assuming a is positive. a(167/45) Simplify ((nn(-8/3))(1/3)/(((n/(n/(nn*(-3)/n)n))/nn)/((n/n0)/nn)))(4/27) assuming n is positive. n(160/243) Simplify (s*0/(ss*(6/7)s))*(-8)((s(2/3)/s)(-46))46 assuming s is positive. s(15292/21) Simplify (((h*(-38)h)/(h/(((h/((h/(h/(hh(3/2))))/h))/h)/h)))/(h/((hh/h*(-32))/h)h)(-5/11))(-45) assuming h is positive. h*(54045/22) Simplify ((vv/(v/(vvv*(-6)v)))/vv(-3))/((v/v(2/9)v)/v*1)v*(-4)v*6(v/v(1/12))/((v(-1)/v)/v) assuming v is positive. v*(-31/36) Simplify (((t/(t/(tt/t*(1/2))))/(tt*(2/9)))/(t/(t(t/(t/(tt0)))/t))(17/5))/((ttt/t(-2))(1/11))(1/15) assuming t is positive. t(49/198) Simplify x(-31)x*(-16/7)x(xx/((((x/(x/(x*32/xx)))/x)/x)/x))(-27) assuming x is positive. x(4877/7) Simplify (a*(-1/2)/aaa(-3)(aa(1/4)/a)/a7)/((aa*(-4/5)aa)/aa*(5/6)(aa(-3))/a(-1/3)) assuming a is positive. a(-637/60) Simplify ((vv/(vv/v0vv))47)(-9/2)/(v(1/2)v*(-5/4)(((vv0vvv)/v)/v)(1/7)) assuming v is positive. v(11857/28) Simplify (u6/u2)*(-24)u*0u*(-2/7)u2/(u/u1) assuming u is positive. u(-660/7) Simplify k(-2)kk/(k/(kk3k)k)k0/k(-1/2)((k/(((k/(k(k/(((kkk*(-2/3)k)/k)/k)kk)/kk))/kk)/k))18)(14/11) assuming k is positive. k*(2429/22) Simplify ((o/(oo(-1)))10)*(-5/2)(o/(o/(o/o*(2/5))))/(oo/o*(5/4))o*(-5)/oo(-1/9) assuming o is positive. o(-5627/180) Simplify (t*7/(tt/(t/(t/(tt(-1/9)))t)t))/(t/t(-3/7)t(t(2/7)t)/t)(t(-2/23)/tt(-8))/(t/(t/t(2/3)))29 assuming t is positive. t(-36581/1449) Simplify (((f/(f/(f(1/3)/f)))/f)(1/37)fff6ffff(-1/9))/(fff(-12)f/(fff/f*(10/9)fff)ff)(-1) assuming f is positive. f(-116/111) Simplify (v*(12/7)vv(-2)v)/(v*(2/63)v11) assuming v is positive. v(-587/63) Simplify ((vvv(-5)/v)(1/90)/((v*(1/16)/v)/(vvv(-29)v)))(-7/6) assuming v is positive. v(126539/4320) Simplify (u*(-4/3)u/(uuuu(3/5)u)(u(1/7))(-49))42 assuming u is positive. u(-2506/5) Simplify (a(-9)a*(1/3)(a(-1)/a)/(a(-5)a))34 assuming a is positive. a(-680/3) Simplify ((((l/l(-4))/(l/(ll/(l/(l/l*(3/4))))l))/(((ll(-1/2))/l)/l)(18/5))(-5/7))(-38) assuming l is positive. l(3667/14) Simplify ((r(4/7)r)/((rr(-5))/r))35(r0)25r(-3)rr3/r assuming r is positive. r230 Simplify ((gg*(1/5)/gg)/((g/(ggg*(-1/8)g))/gg))/(g(-1/3))(-1/36)((g1)20)25 assuming g is positive. g(543311/1080) Simplify (d*(2/15)/ddddd(2/3)dd)(3/7)(dd(1/4)d)/dd2ddd*(-3)(d/d*(-1))/ddd assuming d is positive. d(1023/140) Simplify ((g11g*(2/7))/((g/(g/(gggg/(g/g*(-4/7)))))/gg(2/9)))(-35) assuming g is positive. g(-3035/9) Simplify (((h1/h)*(3/38)/(h(h/h*(-9))/hh/h*(-2)h))(-46))(12/11) assuming h is positive. h(7728/11) Simplify (v(-1))25/(v1)*37((v/v*(-1/2))/vvv)32/((((vv(2/13))/v)/v)/v4) assuming v is positive. v(297/13) Simplify (q(-1/3))*(-36)(q*(1/3)q)/((q/q*(2/21))/q)(((q*(1/2)q)/q)/(q*(-2/7)/qq))/((q(-1/3)/q)/q)(-1/18) assuming q is positive. q(2662/189) Simplify (w(1/5)w/w4((w/w*3)/w)/www2/ww)/((w(1/2))(-34)(w(1/3)/w)18) assuming w is positive. w(126/5) Simplify (hh8/h)/(h/h(-15))(h/(h/(h/(h/h(2/13)h)hh))h)(1/21) assuming h is positive. h(-308/39) Simplify ((s/((s/(s(-1)s))/s))7)(-1/11)((s/s2)(6/25))(-40) assuming s is positive. s(493/55) Simplify ((m7(m/m(1/12))/m)/(m(-2/11)/((m/(m/m*(1/2)))/mm)))/(((mm1mm)/(m/(mm(4/7))))/((m/(m1/m))/mm2m)) assuming m is positive. m(5569/924) Simplify (n0)*36n/n*(-1)(nn(-5)n)/n(n(1/5)/(n/(nn*6)))/((nn*(-2/5)nn)/(n(1/5)n)) assuming n is positive. n(14/5) Simplify (z14)*(-43)(z/z*(1/16))/zz(-4/21) assuming z is positive. z(-202357/336) Simplify (t/t*(2/7)tt(1/3))34(t*(1/4)tt0)(-1/2) assuming t is positive. t(11591/168) Simplify ((s/s(-6))/s5(ss(-1)sss)*(-29))/(ss*(2/17)/sss(-2/15))(1/14) assuming s is positive. s(-303701/3570) Simplify ((r(-2/3))(-36))(8/5)r*(-1/4)rr/r(-4)((r/(rr(-2/13)rr))/r)/r(-6) assuming r is positive. r(12299/260) Simplify (((g/(g(-1/8)/g))/gg*(1/6))/((gg(-2/15))/g)29)(5/9) assuming g is positive. g(619/216) Simplify (((h/(h/((h*(14/3)/h)/h)))/((hh/h*(3/20))/h))/((h/(hh*(-2/3))hhh)/hh(1/6)/h))(-26) assuming h is positive. h(13/30) Simplify (c/(c(-1/3)c))*(-2/111)(c*(1/4)c)/cc(-1)/c((c*(-2)c)(-37))16 assuming c is positive. c*(786205/1332) Simplify ((oo/(o/(oo/(((oo*(-13))/o)/o)))o*(2/13)o)/(o*(2/27)o(14/3)/o))(-38) assuming o is positive. o(-192242/351) Simplify i(-1/2)/(i*(2/19)ii)((ii/i(-4/5))/i)/(i/(i/((i/(ii*(2/5)))/i)))ii(2/15)iii/i*(-1)i*(1/2)i/(iiii(-3)) assuming i is positive. i(412/57) Simplify ((yy(-2/7))/(y/(y/(y(-6)/yy))))(-34/3)/(yy((y(-1)y)/y)/yy(yy(-2/3))/y(y1)(-1/6)) assuming y is positive. y(-3203/42) Simplify (((h(2/13)/h)/h)/h)/h*(-3)(h(2/3))(2/145)(h(-9)h11)31 assuming h is positive. h(351532/5655) Simplify ((x1)*(-3/4)/(xx(1/2))(-37))/((x*(2/3)x)42)(2/119) assuming x is positive. x*(3643/68) Simplify (((pp/((pp(7/5))/p)p(2/9))(-10/7))46)8 assuming p is positive. p(-27232/63) Simplify (o(-8)ooo(-11)o*(-19)/(oo/(o/(o/(oo(-2/3)o)))))2 assuming o is positive. o(-220/3) Simplify ((o(-1/2))30/(o*8/(oo/o4)))/(o(1/11)o/o8(o0)(6/17)) assuming o is positive. o*(-199/11) Simplify ((n(n/((((n*(-4/5)n)/n)/n)/n)n)/nn)/(nn/(nn(4/11))))/((n0/n)/(n*(-40)nnn)) assuming n is positive. n(-1696/55) Simplify ((w8/w)/ww(-6/11)ww6w*(2/7))/((www(-14))/w(-1/3))(-2/15) assuming w is positive. w(7751/693) Simplify ((o0)18)(-39)/((((oo*2)/oo)/o)(16/3))(3/11) assuming o is positive. o(-32/11) Simplify ((w(3/2)ww*(3/5)w*9/ww(4/7))(-23/3))(4/35) assuming w is positive. w(-37582/3675) Simplify ((i(i/i(3/8))/i)/ii*(-4)/ii(1/2)/(i/i(-5)i))/((i/(i(-2)i))(-11))(7/6) assuming i is positive. i*(331/24) Simplify ((zz(4/5))/(z7z))(5/11)(z*10zzz/z8)5 assuming z is positive. z(244/11) Simplify (c(-1))*(-3/5)/(cc/((c/(c/((cc/c(-1))/cc)))/cc))(-14)(c(1/3)/((c/(c(-3)/c))/c))/(cc(-2/23)cc/c5) assuming c is positive. c(-5168/345) Simplify ((qq/q(-2/9))(4/7)/(q(-2/21)/q)(-31))39 assuming q is positive. q(-26767/21) Simplify ((g*14/(gg3))/(g24/((g/(g/(ggg/(g/((g*6g)/gg)g))))/g)))(23/4) assuming g is positive. g(-161/4) Simplify ((g4/(g/g(-6)))/(((g*(1/2)/gg)/g)/g)*(-1/23))/(((g/(gggg(2/11)))/g)9)(-19) assuming g is positive. g(-276861/506) Simplify (((j*(-2/11)j*(2/33)j)(-50))(1/37))(-21/4) assuming j is positive. j(5075/814) Simplify (((y/(y/(y/(yy6y)))y/((yy(-6))/y))(-3/5))8)(-2/23) assuming y is positive. 1 Simplify g*1g*(-1/2)g(g/(g/((g/g(-1))/g)))(2/51)(g(-1))43/(g*(1/4)ggg*(6/11)g) assuming g is positive. g*(-101555/2244) Simplify ((t/(t(ttt/t*18t)/t)tt)/(tt/t17)((t/t*(-1/13)t)/t)/tt(10/9))(12/7) assuming t is positive. t*(15	{ "pile_set_name": "DM Mathematics" }
What are the prime factors of 1421936? 2, 181, 491 List the prime factors of 13862881. 13862881 What are the prime factors of 818712? 2, 3, 83, 137 What are the prime factors of 19243058? 2, 1091, 8819 What are the prime factors of 1187222? 2, 277, 2143 What are the prime factors of 3675196? 2, 7, 17, 1103 What are the prime factors of 3207341? 3207341 What are the prime factors of 12784883? 101, 126583 What are the prime factors of 194696? 2, 24337 List the prime factors of 11655467. 11655467 List the prime factors of 14471063. 17, 851239 List the prime factors of 146607. 3, 48869 List the prime factors of 913896. 2, 3, 4231 List the prime factors of 261913. 43, 6091 List the prime factors of 521476. 2, 130369 What are the prime factors of 1661676? 2, 3, 59, 2347 What are the prime factors of 4460756? 2, 1115189 What are the prime factors of 28126816? 2, 43, 20441 List the prime factors of 7721606. 2, 23, 167861 What are the prime factors of 29913078? 2, 3, 13, 31, 89, 139 List the prime factors of 754883. 23, 1427 List the prime factors of 405388. 2, 101347 List the prime factors of 4220748. 2, 3, 7, 1861 What are the prime factors of 1575637? 7, 31, 53, 137 List the prime factors of 102353. 19, 5387 What are the prime factors of 1750170? 2, 3, 5, 227, 257 What are the prime factors of 1253960? 2, 5, 23, 29, 47 List the prime factors of 18719639. 3637, 5147 List the prime factors of 305062. 2, 152531 List the prime factors of 5264657. 5264657 What are the prime factors of 246895? 5, 11, 67 What are the prime factors of 1010413? 23, 197, 223 What are the prime factors of 3396455? 5, 47, 97, 149 What are the prime factors of 198398? 2, 19, 23, 227 List the prime factors of 28098169. 11, 19, 233, 577 What are the prime factors of 3232370? 2, 5, 31, 10427 List the prime factors of 356085. 3, 5, 41, 193 What are the prime factors of 3364185? 3, 5, 11, 20389 List the prime factors of 24209610. 2, 3, 5, 19, 42473 List the prime factors of 170407. 23, 31, 239 What are the prime factors of 301477? 11, 27407 What are the prime factors of 1786722? 2, 3, 7, 19, 2239 What are the prime factors of 378113? 103, 3671 What are the prime factors of 242286? 2, 3, 11, 3671 What are the prime factors of 782455? 5, 156491 List the prime factors of 7280431. 1013, 7187 What are the prime factors of 997015? 5, 199403 What are the prime factors of 804898? 2, 37, 73, 149 List the prime factors of 157723. 109, 1447 What are the prime factors of 514828? 2, 17, 67, 113 List the prime factors of 150306. 2, 3, 13, 41, 47 List the prime factors of 2742764. 2, 19, 151, 239 List the prime factors of 1049501. 43, 24407 List the prime factors of 641797. 13, 49369 List the prime factors of 2666511. 3, 296279 List the prime factors of 5068261. 11, 17, 27103 List the prime factors of 1226789. 1226789 List the prime factors of 3724864. 2, 11, 13, 37 What are the prime factors of 108478? 2, 73, 743 List the prime factors of 24162. 2, 3, 4027 What are the prime factors of 7911753? 3, 2637251 What are the prime factors of 275350? 2, 5, 5507 What are the prime factors of 1987946? 2, 17, 59, 991 List the prime factors of 2247978. 2, 3, 17, 22039 What are the prime factors of 29693? 23, 1291 What are the prime factors of 8051862? 2, 3, 7, 13, 14747 List the prime factors of 165575. 5, 37, 179 List the prime factors of 436883. 17, 31, 829 List the prime factors of 129945. 3, 5, 8663 List the prime factors of 21426015. 3, 5, 13, 19, 5783 What are the prime factors of 7505382? 2, 3, 587, 2131 List the prime factors of 12016721. 19, 632459 List the prime factors of 2096472. 2, 3, 7, 12479 List the prime factors of 340152. 2, 3, 14173 What are the prime factors of 358700? 2, 5, 17, 211 List the prime factors of 5168157. 3, 1722719 List the prime factors of 21695616. 2, 3, 37, 509 What are the prime factors of 3414986? 2, 991, 1723 List the prime factors of 4036. 2, 1009 What are the prime factors of 188417? 188417 List the prime factors of 183974. 2, 7, 17, 773 List the prime factors of 114476. 2, 28619 List the prime factors of 4989840. 2, 3, 5, 17, 1223 List the prime factors of 4197611. 11, 113, 307 What are the prime factors of 712671? 3, 19, 12503 List the prime factors of 2745855. 3, 5, 7, 23, 379 List the prime factors of 17518850. 2, 5, 350377 List the prime factors of 4491114. 2, 3, 29, 53, 487 What are the prime factors of 80881? 29, 2789 List the prime factors of 13348344. 2, 3, 556181 List the prime factors of 22021680. 2, 3, 5, 91757 List the prime factors of 3219809. 181, 17789 What are the prime factors of 1422684? 2, 3, 4391 What are the prime factors of 1755546? 2, 3, 13, 71, 317 What are the prime factors of 337971? 3, 112657 List the prime factors of 72117. 3, 2671 What are the prime factors of 830338? 2, 19, 21851 What are the prime factors of 594299? 594299 List the prime factors of 535303. 535303 List the prime factors of 76474. 2, 38237 List the prime factors of 26609. 11, 41, 59 What are the prime factors of 873201? 3, 7, 43, 967 What are the prime factors of 387898? 2, 7, 103, 269 List the prime factors of 19390983. 3, 6463661 List the prime factors of 1453491. 3, 13, 41, 101 What are the prime factors of 495817? 7, 193, 367 List the prime factors of 92177. 92177 List the prime factors of 25157201. 271, 92831 List the prime factors of 5541. 3, 1847 List the prime factors of 5215372. 2, 37, 131, 269 List the prime factors of 2755598. 2, 17, 81047 List the prime factors of 142220. 2, 5, 13, 547 What are the prime factors of 158826? 2, 3, 103, 257 What are the prime factors of 581676? 2, 3, 48473 List the prime factors of 1591158. 2, 3, 265193 What are the prime factors of 901921? 283, 3187 List the prime factors of 14367210. 2, 3, 5, 11, 13, 17, 197 List the prime factors of 161761. 161761 What are the prime factors of 3431964? 2, 3, 285997 What are the prime factors of 759255? 3, 5, 7, 1033 What are the prime factors of 23498254? 2, 13, 373, 2423 List the prime factors of 147209. 147209 List the prime factors of 174316. 2, 43579 List the prime factors of 8858493. 3, 7, 140611 List the prime factors of 133358. 2, 131, 509 List the prime factors of 288510. 2, 3, 5, 59, 163 List the prime factors of 23353555. 5, 29, 161059 List the prime factors of 863878. 2, 59, 7321 List the prime factors of 32429135. 5, 109, 157, 379 What are the prime factors of 283611? 3, 17, 67, 83 List the prime factors of 1441844. 2, 360461 List the prime factors of 2142469. 7, 421, 727 List the prime factors of 58128. 2, 3, 7, 173 What are the prime factors of 1561858? 2, 17, 71, 647 List the prime factors of 5027060. 2, 5, 251353 What are the prime factors of 1670830? 2, 5, 7, 23869 What are the prime factors of 74612? 2, 23, 811 What are the prime factors of 822496? 2, 25703 List the prime factors of 4455156. 2, 3, 17, 21839 What are the prime factors of 13663847? 113, 120919 What are the prime factors of 13964991? 3, 421, 11057 List the prime factors of 636206. 2, 318103 List the prime factors of 1292337. 3, 143593 List the prime factors of 1209748. 2, 167, 1811 List the prime factors of 1440539. 31, 1499 What are the prime factors of 500813? 131, 3823 List the prime factors of 1021908. 2, 3, 85159 What are the prime factors of 80695? 5, 16139 List the prime factors of 13643373. 3, 4547791 List the prime factors of 1290175. 5, 51607 List the prime factors of 2273821. 11, 421, 491 List the prime factors of 856699. 856699 What are the prime factors of 210144? 2, 3, 11, 199 List the prime factors of 1931854. 2, 965927 List the prime factors of 1486720. 2, 5, 23, 101 List the prime factors of 1560894. 2, 3, 157, 1657 List the prime factors of 7948690. 2, 5, 17, 46757 List the prime factors of 1711910. 2, 5, 193, 887 List the prime factors of 806781. 3, 268927 What are the prime factors of 311372? 2, 17, 19, 241 List the prime factors of 239465. 5, 47, 1019 List the prime factors of 84355. 5, 16871 What are the prime factors of 202578? 2, 3, 19, 1777 What are the prime factors of 164201? 164201 What are the prime factors of 205660? 2, 5, 7, 13, 113 What are the prime factors of 2175826? 2, 401, 2713 What are the prime factors of 1429774? 2, 714887 List the prime factors of 3548432. 2, 463, 47	{ "pile_set_name": "DM Mathematics" }
alculate the remainder when 108 is divided by a/(-286) - i/(-13). 34 Suppose 0 = -3m + 3a + 1092, -3m - 6a = -7a - 1104. Calculate the remainder when m is divided by 56. 34 Suppose -16v + 1269 + 587 = 0. What is the remainder when 118 is divided by v? 2 Let m = 18 + -9. Calculate the remainder when 81 + (2 + 1 + -2)8/(-4) is divided by m. 7 Let n = -19 - -23. Suppose 5r - 2l - 565 = -34, 12 = -nl. Suppose r = -2a + 7a. What is the remainder when 60 is divided by a? 18 Suppose 60i = -11i + 34151 + 14839. What is the remainder when i is divided by 3? 0 Suppose 13s - 102 = 457. Calculate the remainder when 2450 is divided by s. 42 Let r = -79 + 50. Let l = -10 + r. Let y = l + 44. Calculate the remainder when 16 is divided by y. 1 Let z = -9640 - -10415. Calculate the remainder when z is divided by 11. 5 Let y = -205 + 211. Let l(w) = w2 - 17. Calculate the remainder when 59 is divided by l(y). 2 Let l = -5 + 9. What is the remainder when (14/l)/(-3 - (-230)/76) is divided by 9? 7 Let u(t) = -14t + 127. What is the remainder when 65 is divided by u(8)? 5 Suppose x + 16p - 17p - 2644 = 0, -4p - 5288 = -2x. What is the remainder when x is divided by 27? 25 Suppose 2n + 7 = v + 3, -2n = -5v + 60. Let g = v + -12. Suppose 0 = -d - gd + 84. Calculate the remainder when d is divided by 10. 8 Let w = -43 - -31. Let l be 8/w + (-4)/(36/93). Let p = 23 + l. Calculate the remainder when 44 is divided by p. 8 Let a = -20 - -20. Suppose 2o - 2 + 4 = a. Let y(k) = k3 + 3k*2 + k. What is the remainder when 1 is divided by y(o)? 0 Let x(g) = -43 + 14 - 53g + 7 + 11. Suppose -2m + 96 = 2m. What is the remainder when x(-2) is divided by m? 23 Let n be 54916/(-36)3. Let f be 12/(-42) - n/14. Let g = f - 34. Calculate the remainder when g is divided by 10. 8 Calculate the remainder when ((-5454)/216)/((-1)/82) is divided by -10(4 - 264/60). 1 Let m(s) = -s*3 + 8s*2 + 5s + 7. Let h be m(8). Suppose 0 = hl - 45l - 16. What is the remainder when (41/2)/(4/l) is divided by 6? 5 Let r(b) = 178b - 7. Let u be r(2). Let l be 6/27 - (u/(-9) + -1). Let o = -27 + l. What is the remainder when 22 is divided by o? 9 Let z(k) = 3k*2 - 29k + 47. Let x(b) = -b*2 + 15b - 23. Let m(u) = -5x(u) - 2z(u). Calculate the remainder when m(-15) is divided by 11. 7 Calculate the remainder when 1/(-5) + (2 + 56084/60)3 is divided by 148. 146 Let m = -151 + 291. Let k(b) = b3 - 7b*2 - 38b + 276. Calculate the remainder when m is divided by k(8). 32 Let x be (1242/(-9))/(-6) - (1 + 1). Suppose xu + 528 = 33u. Calculate the remainder when 262 is divided by u. 42 Suppose 0 = 3v + 5p - 1683, -242 = -2v - 2p + 884. What is the remainder when v is divided by 192? 182 Let s(x) = 2x2 - 68x + 3. Let k be s(35). Suppose -3q - 2r + r + k = 0, 100 = 4q + 2r. Calculate the remainder when q is divided by 10. 3 Suppose b + 9m - 41 = 5m, -3b + 63 = -3m. Suppose 2551 = bz - 5024. Calculate the remainder when z is divided by 79. 66 Let i = -17 - -20. Suppose 0 = -7c + 9c - 44. What is the remainder when 136/c + (-10)/55 is divided by i? 0 Let p(v) = -v3 - 4v*2 + 20v - 31. What is the remainder when p(-13) is divided by 44? 42 Suppose -692 = -10h + 88. Let y = h + -74. Suppose 3s + 6r - 2r = 267, 0 = -ys - 4r + 352. Calculate the remainder when s is divided by 11. 8 Suppose 2p - 4i = -10, -4i + 13 = -22p + 21p. What is the remainder when 218 is divided by p - (-96 - 1 - 6/3)? 14 Suppose 252o - 28239 - 2757 = 0. Calculate the remainder when 3071 is divided by o. 119 Let n = 10714 + -10611. Calculate the remainder when n is divided by 44. 15 Suppose 0 = -204b - 86b + 64739 - 8769. Calculate the remainder when b is divided by 33. 28 Let b = 17 - 7. Suppose -5i = -4n - 134, -i - 2n - 54 = -3i. Suppose g - c - 9 = 0, i = 2g - 2c - 2c. What is the remainder when b is divided by g? 0 Let p(g) = 151g*3 + 2g*2 + 6g - 9. Calculate the remainder when p(2) is divided by 75. 19 Suppose 3d - c = 165, -275 = -d - 4d - 3c. Suppose 67f - 7938 = 4f. What is the remainder when f is divided by d? 16 Calculate the remainder when (14 + 7/(-21)51)2316/(-2) is divided by 19. 16 Suppose 0 = -4l + 3z - 7z + 1048, 0 = 4l + 2z - 1046. What is the remainder when l is divided by 76? 33 Suppose 12 = 2x - 2. Let l be 2016/(-1)(-1)/6-4. Calculate the remainder when l/(-132) - 4/22 is divided by x. 3 Let x be 1 + 555 - 0/((-10)/(-5)). Let p be (x/(-6))/(10/6 + -1). Let l = -92 - p. Calculate the remainder when l is divided by 12. 11 Let h(z) be the first derivative of -z4/4 + 2z*3 - 3z*2/2 + 7z + 5. Suppose 4g + 3657 = 27g. Calculate the remainder when g is divided by h(4). 24 Let j = 252 + -362. Let t = -89 - j. Calculate the remainder when 50 is divided by t. 8 Suppose 0 = 2268g - 2264g - 12468. What is the remainder when g is divided by 78? 75 Calculate the remainder when (-299 + -4)/((-4)/(5 + -1)) is divided by 74. 7 Let n = 1635 - 1462. Calculate the remainder when 860 is divided by n. 168 Let u(j) = 3j3 - 5j*2 + 7j - 1. Let t be u(3). Suppose -2f + 25 - 1 = 2w, -4w + t = -4f. Calculate the remainder when 127 is divided by w. 10 Suppose -17x = -14x - 168. Let v = 7 - 6. What is the remainder when x is divided by 1 + (-11)/(-1)v? 8 Let z(h) = -4h + 3. Let i be z(-10). Suppose -7y - i = -8y. Let w(m) = 6m3 + 10m*2 - 27m. Calculate the remainder when w(3) is divided by y. 42 Let o = -5510 + 5568. What is the remainder when 263 is divided by o? 31 Let p(j) = j*3 + 6j*2 - 10j - 13. Let v be p(-8). Let r = -55 - v. Calculate the remainder when (0 - 3) + 408/r is divided by 11. 10 Let i(y) = 27y - 1189. Let v(k) = -9k + 396. Let g(f) = -4i(f) - 11v(f). Suppose -l + 3l = 556. What is the remainder when l is divided by g(40)? 38 Let h be 129/12/6. Suppose -15q = -7q - 120. Suppose y - l = h, q + 22 = y - 4l. What is the remainder when y is divided by 16? 13 Let h = 81 - 55. Let d = h - 23. Suppose l + m - 1 = 20, -2m = -dl + 58. What is the remainder when 78 is divided by l? 18 Let d(h) = 34h + 3. Let c be d(1). Let j be (c/31)/((-3)/(-9)). Suppose -j - 43 = -2o. Calculate the remainder when o is divided by 11. 7 Let g = -4025 + 4044. What is the remainder when 59 is divided by g? 2 Let d = 1052 - -2723. What is the remainder when d is divided by 16? 15 Suppose -23d = -43551 - 8620 - 62760. What is the remainder when d is divided by 25? 22 Let a(t) = 4t*3 - 27t*2 + 3t + 12. Calculate the remainder when 895 is divided by a(7). 75 Let v = -21289 + 22818. Calculate the remainder when v is divided by 219. 215 Suppose -241c = -243c + 56. Calculate the remainder when (-3)/(-1) + (203 - 12) is divided by c. 26 Suppose 5f - 6f + 718 = -3g, -4f - 2g = -2900. Let k = f - 663. Calculate the remainder when 119 is divided by k. 58 Let w = 274 + -579. Let a = -289 - w. What is the remainder when 138 is divided by a? 10 Let f be (6/(-8))/(((-49)/(-896))/(-7)). What is the remainder when 39/(-1 + 4/(f/42)) is divided by 6? 4 Let v = 2484 - 2421. Calculate the remainder when 285 is divided by v. 33 Calculate the remainder when 247 is divided by 99 + 5/((-20)/(-16)) - (15 - 18). 35 Let s(x) = -21x3 - x2 + 2x + 8. Let t(l) = -22l3 - l2 + 2l + 7. Let r(o) = -3s(o) + 4t(o). Calculate the remainder when 109 is divided by r(-1). 5 Suppose -5x + 4h = -1319, -35 + 37 = -2h. Suppose y - 2w - 59 + 5 = 0, -y = w - 39. Calculate the remainder when x is divided by y. 43 Let l = -1 + -10. Let b = 8 - l. Suppose -12a = -558 - 78. Calculate the remainder when a is divided by b. 15 Let d = -4005 + 4102. Calculate the remainder when 269 is divided by d. 75 Suppose -2j + 9j = 511. Suppose -199 = 2b + 2b - 3r, -196 = 4b - 4r. Let o = b + j. Calculate the remainder when o is divided by 5. 1 Let u(x) = 2x*2 + 16x - 9. Calculate the remainder when (-14)/63 - 2137/(-18) is divided by u(-9). 6 Suppose 4m + 16985 = 17341. What is the remainder when m is divided by (2 - (-6)/(-4))74? 15 Let f = -8 + 10. Suppose 0 = w - 0 - f. Suppose 12 = a + 2s, wa + 5s + 4 - 25 = 0. What is the remainder when 62 is divided by a? 8 Let y(f) be the second derivative of 7f*3/6 - 7	{ "pile_set_name": "DM Mathematics" }
2 - 1. Let d be ((-6)/2)/(11 + -14). Give y(d). 6 Let v(d) be the third derivative of d5/12 + d4/24 - d*3/6 - 8d*2 - 18d. Let z be -1 + -1 - (3 + -9). Suppose 3c + c = z. Give v(c). 5 Let o(n) = 11n*3 - 21n*2 + 27n - 22. Let i(d) = 3d3 - 7d*2 + 9d - 7. Let s(g) = -7i(g) + 2o(g). Give s(-8). 13 Let k(b) = 16b2 + 8b + 5. Let h(j) = -32j2 - 17j - 11. Let w(g) = 6h(g) + 13k(g). Give w(1). 17 Let b(p) = -3p - 4. Let v = -338 - -333. Determine b(v). 11 Let s(d) be the second derivative of -2d*3 + 3d + d*3 + 2d*3. Suppose k + 9 = 10k. What is s(k)? 6 Let o be 6/10 + 304/(-40). Let v(h) = h*2 + 7h. Calculate v(o). 0 Let l(a) = -a*2 + 4a - 3. Let r be 100/(-125) - 418/(-10). Let k = -39 + r. Give l(k). 1 Let o(f) be the second derivative of f8/6720 - f7/2520 - f6/360 + f5/40 - 7f4/6 - 23f. Let y(l) be the third derivative of o(l). Determine y(2). 3 Suppose -18z + 112 = -122. Let w(s) = s - 18. Determine w(z). -5 Let j(f) = f2 - 7f + 1. Let q(d) = d*2 - 7d + 1. Let i(l) = -4j(l) + 3q(l). Suppose -5y + 5m = -65, 103m - 33 = 3y + 109m. Calculate i(y). 9 Let m(b) = 3b + 4. Let n be 2((-84)/(-8) + -8). Determine m(n). 19 Let g(w) = -5w - w*2 + 0w*2 + 7w*2 - 5w*2 - 7 - 6. Calculate g(6). -7 Let g(q) = 4q*2 - 5q + 5. Let a(d) = d*2 + 2. Let j(x) = -2a(x) + g(x). Calculate j(2). -1 Suppose -43 = 18h + 5 + 24. Let w(i) = 4i*2 + 2i + 3. Let c(v) = -3v2 - 2v - 3. Let t(k) = -3c(k) - 2w(k). Determine t(h). 11 Let b(v) = 4v - 12v + 12 - 2 + 6v. Suppose -5l + 35 = 3y, 2y + 28 = 4l + 5y. What is b(l)? -4 Let j(q) be the third derivative of q6/120 + q5/10 - 5q4/24 - 2q*3/3 - 6q*2. Let n(m) = -6m + 23. Let o be n(5). Calculate j(o). -18 Let a(b) be the second derivative of -1/3b3 + b2 + 0 + 17b - 1/3b4. Calculate a(-2). -10 Let h(i) = -2i*2 - 2 - 1 - 5i + i*2. Suppose 22 = 3w + w - m, -2w - 4m = -20. Suppose 21o - w = 24o. Calculate h(o). 3 Let z(c) = -c + 4. Suppose 3f + 3 = 12. Calculate z(f). 1 Let p be (-70)/(-49) + -2 - 48/14. Let z(o) = o2 + 2o + 4. Determine z(p). 12 Let g(a) = -a*2 + a + 2. Suppose 3t - 15 = -2d, 4d + 12t = 16t. What is g(d)? -4 Let g(m) = 8m - 1. Let h(u) = -u3 + 25u*2 - 25u + 22. Let y be h(24). What is g(y)? -17 Let a(z) = z*3 + 9z*2 + 7z. Let b(t) = -t*2 - 7t - 18. Let q be b(-2). Give a(q). 8 Let i(g) = -14g3 - 8g*2 - 7g + 10. Let n(y) = 3y3 + y2 - 1. Let o(q) = i(q) + 5n(q). Give o(4). -7 Suppose 0k = 2k - 4. Let w(d) = -46d - 36. Let v(m) = -16m - 13. Let g(b) = 14v(b) - 5w(b). What is g(k)? 10 Let c(t) = -1972 + 3928 - t - 1976. Give c(-11). -9 Suppose -5b + 9b - 3r + 41 = 0, -2b = 5r + 27. Let u(m) = m2 + 12m - 11. What is u(b)? -22 Let t(u) be the first derivative of u*2/2 - 2u - 89. Calculate t(-5). -7 Let h(t) = 13t - 1. Let y(o) = -50 + 4o - 2o + 50. Let p(v) = h(v) - 6y(v). Let w = -1 - 0. Calculate p(w). -2 Suppose 0 = -5z - 7 - 13. Let h be (-282)/(-26) - z/26. Let w = h + -8. Let u(v) = v2 - v + 2. What is u(w)? 8 Suppose 0 = -5k + s + s + 111, 27 = k + 2s. Let r = 27 - k. Let t(g) = -g2 + 3g - 3. What is t(r)? -7 Let y(m) = m*2 + 7m. Let r be (15/(-9))/((-7)/21). Suppose 2t - 2 = 8. Suppose tq - r = -35. Determine y(q). -6 Let q(m) = -m*2 - 2m - 3. Suppose 166 = 5d - 184. Let o be (6/(-4))/((-5)/d). Let f be (-56)/o + 2/3. Calculate q(f). -3 Let j(w) = 5w + 48. Let g be j(-9). Let x(v) = -v + 5. Let f(s) = s - 6. Let r(l) = 5f(l) + 6x(l). Determine r(g). -3 Let g(h) be the first derivative of 2h3/3 + h2 + h - 25. Let n = 1 + -2. Let u(z) = -z3 + z. Let d(j) = ng(j) + 2u(j). What is d(-2)? 7 Let x(h) be the first derivative of h2/2 + 11h - 143. Suppose 24 = 3w + c, -16 = -2w - 2c - 2c. Let i = w + -14. Calculate x(i). 5 Let q(w) be the third derivative of -w7/420 - w6/360 + w5/120 + w4/24 - 5w3/2 - 6w2. Let o(x) be the first derivative of q(x). Determine o(2). -17 Let n(g) be the third derivative of -g5/60 + 2g4/3 - g3/2 - 10g*2. Let c be n(15). Let t(u) = 7u + 10u + 5 - 23u + cu. Determine t(-4). -19 Let j(q) = -q2 - 10q. Let u be ((-4)/(-1))/(((-72)/(-45))/(-4)). Calculate j(u). 0 Let j(y) = -y2 - 1. Let b be j(-1). Let m be 18/72 + b/8. Let u(v) be the second derivative of v4/12 - v*3/6 - 7v*2 - 2v. Determine u(m). -14 Let r be (11/(33/2))/((-2)/(-24)). Let z(j) = -r - 4 + 5 - 5 + j. Determine z(6). -6 Let o(i) = -7i + 1. Let v = -18 + 18. Suppose v = 6t + 6 + 6. Determine o(t). 15 Suppose -f + 5 = 4f. Let o(q) be the second derivative of 9/20q*5 + 0q*2 + 10q + 1/12q4 + 0 - 1/6q*3. What is o(f)? 9 Let t be 2/(-5) - (-17)/5. Let g(k) = -2k*2 + 5k - 2. Give g(t). -5 Let b = 24 - 20. Let h(a) = 3a + 1 - b + 0 - 5a. Calculate h(6). -15 Let n(y) be the second derivative of y*5/10 + 5y*4/12 + 2y*3/3 + 2y2 - y + 5. What is n(-3)? -17 Let x(t) = -t2 + 4t + 8. Let c be x(5). Suppose 3z - 30 = -3l - 2l, -5l + cz = -30. Let y(r) = r*2 - 5r - 5. Determine y(l). 1 Let s(i) = -i*2 - 3i + 6. Let p(g) = g*2 + 4g - 7. Let v(w) = 5p(w) + 6s(w). Let u be 4/24 - 130/60. Give v(u). -7 Let h(k) = -2k2 - 5k + 9. Let o = -758 + 751. What is h(o)? -54 Let q(m) = 2m + 1 - m2 + 3m*2 + m. Let z be 1/(-2)11/(33/(-60)). Suppose 10 = -2x, 0 = -0r + 5r - 4x - z. Calculate q(r). 3 Let h be 2/(-54/30). Let t(l) = 4 + 15l + 16l - 5l2 + l3 - 34l - 2l*3. Give t(h). -5 Suppose -2k = 3 - 7. Suppose 0f + x + 26 = kf, 4f - 40 = -x. Suppose -3p = f - 2. Let j(o) = 2o2 + 4o. What is j(p)? 6 Let t be (-5)/6-152. Let f = t - 16. Let z(b) = 2 - 1 - 2 - b + fb. What is z(-1)? -9 Let n(z) be the second derivative of -z4/12 + 3z*3/2 + 5z*2 - 114z. What is n(10)? 0 Let x(b) = -b*3 + 5b*2 - 4b + 1. Let q be (-5)/40 - 17/(-8). Give x(q). 5 Let k(q) = -2q3 + 1 + 16q3 + q2 + 336q - 335q. Calculate k(-1). -13 Let k(m) = m*2 - 11m - 3. Let i be k(8). Let t = 25 + i. Let l(v) be the third derivative of -v6/120 - v3/3 + v*2. Calculate l(t). 6 Let w be 1/(-4) - 55/(-44). Let b = w - -14. Let r(t) = b + 3t - 14 - 7t. Give r(1). -3 Let m(r) be the third derivative of r5/60 - 5r*4/24 + 11r*3/6 + 525r2. What is m(4)? 7 Let k(l) = l2 + 5l - 3. Let i be (-2)/(-13) + ((-575)/(-65) - 1). Suppose -in + 7n + 3w = 9, 3 = -n - 3w. What is k(n)? 3 Let c = -47 + 68. Suppose 5m = c - 6. Let y(s) be the second derivative of -s*3/6 + 3s*2/2 + 206s. Determine y(m). 0 Let b(w) be the first derivative of -37w2/2 - w + 12. Give b(1). -38 Let l = -34 - -36. Let i(m) = 1 - ml - 16m + 19m - m2. Calculate i(3). -8 Let g(q) = -6q. Let a be 2/(-10) + (-602)/215. Give g(a). 18 Let x(a) = 54a + 12. Let q(y) = 19y + 4. Let c(m) = -17q(m) + 6x(m). Give c(-7). -3 Let w(k) = k*2 - 2k + 1. Let j(p) = -15p2 - 2p + 1. Let d(g) = -j(g) + 2w(g). What is d(1)? 16 Let z(d) = -d + 3. Let f(a) = -2a + 20. Let o be f(0). Suppose -2p - p = -h - o, -2h - 25 = -3p. What is z(h)? 8 Let x(n) = 3n*2 - 2n*2 + 7n*3 + 2n + 1 - 12n3. Suppose 0 = 5l + 4 + 1. Calculate x(l). 5 Let k(z) = 15z. Let g(i) = i + 19 + 15i*2 + 7i - 29i2 + 13i2. Let s be g(10). What is k(s)? -15 Let b(j) be the first derivative of j2/2 + 13j - 291. Give b(-14). -1 Let n = 62 - 50. Let g(a) = -na + 46 - 18 - 18 - 12. Determine g(-3). 34 Suppose 0 = -5t + 2d - 5, -4d = t - 27 + 6. Let y = -90 - -84. Let i(w) = 11w + 7. Let b(z) = -12z - 8. Let n(h) = yb(h) - 7i(h). What is n(t)? -6 Let o(u) = u2 - 6u - 4. Let a(t) = 2t2 - 10t - 6. Suppose -5x = -40 + 10. Let f be a(x). Calculate o(f). -4 Suppose -5k = 0, -5l + 2k + 17 = -63. Let u(d) = d*3 - 15d*2 - 15d + 14. What is u(l)? 30 Let j(r) be the first derivative of -r*4/4 + 2r*3 + 5r*2 - 9r + 46. Calculate j(7). 12 Let w(p) be the third derivative of p5/60 - p4/2 + 11p3/3 - 10p2 + 6. Give w(9). -5 Let b = -181 + 170. Let m(q) = q3 + 11q2 + q - 3. Determine m(b). -14 Let j(d) = 6d - 30. Let a be j(5). Let l(t) = -3t - 6. Determine l(a). -6 Let c = 13 + -14. Let n(y) be the first derivative of -7y**2 - y - 5. Determine n(c). 13 Let j(i) =	{ "pile_set_name": "DM Mathematics" }
d - 372 = -3t, -2t + 222 = -8d + 11d. Solve ds + 55 + 335 = 0 for s. -5 Suppose 556n - 555n - 122 = -5j, -5j + 162 = -4n. Solve 0 = 6x + 4x + jx for x. 0 Let o(h) = h*2 - 5h + 11. Let b be o(13). Let i = 162 - b. Let l = i - 35. Solve l = -f - 2f for f. -4 Let c = -26 + 20. Let f(p) = -p2 - 5p + 10. Let v be f(c). Solve -vq - 14 = 6 for q. -5 Suppose 14m - 45 = 2 - 5. Solve mi + 4 - 10 = 0 for i. 2 Let s(j) = j3 - 19j*2 + 18j + 2. Suppose 9y - 155 = 7. Let q be s(y). Solve -c + 6 = q for c. 4 Let g(x) = 2x + 32. Suppose 5n - 2t = -104 - 46, -4n + t = 117. Let b = n - -13. Let m be g(b). Solve -mu + 0 = -8 for u. 4 Suppose -5o + 22 + 8 = 0. Let g be ((-4)/o)/(2/(-9)). Let t = 30050 + -30048. Solve ty = -gy for y. 0 Let i be ((131260)/(-14))/(2 - (7 - 3)). Solve -iv = -579v + 30 for v. -5 Let p(a) = -52a - 121. Let s be p(-6). Let u = s + -191. Suppose 6 = m - 0. Solve u = 3z - m + 3 for z. 1 Let g be 17/3 + 5 + 3/9. Suppose 316 = gv + 118. Solve 14b - vb - 4 = 0 for b. -1 Let b = 22509 + -22481. Solve -b = 5f - 13 for f. -3 Let h = -576 - -891. Solve -16q = -h + 315 for q. 0 Let x = -13198 + 13238. Solve -153m + 161m = x for m. 5 Suppose -27z + 3f - 31 = -28z, f + 59 = 4z. Solve -15g = -zg + 1 for g. 1 Suppose 27r + 9486 = 120r. Solve -11g - r = -45g for g. 3 Let o(w) = -2w*3 - 5w*2 - 7w - 7. Let s be o(-3). Let u = 39 - s. Suppose 0 = -7h + 3h + u. Solve hg - 6 = 14 for g. 5 Suppose 0 = 4p + g - 17, 4p + g - 11 = 6g. Let o(k) = 135 - 270 + 126 + 5k2 + 4k. Let y be o(2). Solve -y = 3s - p for s. -5 Suppose 0 = 396z + 57z. Suppose 2q + 1 = 3q. Solve l + zl = q for l. 1 Suppose c + 13 = -5g + 2g, -2c = -3g - 19. Suppose 4h + 0w - 16 = 2w, cw + 10 = 3h. Let x be 2 - (0 + 0)1/2. Solve xs + 4 = -h for s. -5 Let f(z) = 18z*2 - 15z*2 + 9z - 8 - 12z. Let u(p) = -4p*2 + 2p + 9. Let s(o) = -3f(o) - 2u(o). Let c be s(6). Solve cn + 5n = 15 for n. 3 Let r be 8514/108 + (-1)/(-6). Let v = -77 + r. Solve v = -s - 0 for s. -2 Let w(g) = -g*2 + 36g + 8. Let h be w(36). Let o be (-2 - h)1/(-4)4. Solve -3 = -7s + os for s. -1 Let x(g) = -g - 8. Let n be x(-13). Suppose -s + ns = 12. Solve -v = sv for v. 0 Let a(j) = 5j2 + 92j + 624. Let i be a(-6). Solve -28w + i - 140 = 0 for w. 4 Suppose -246 = -2w - 4x, -2x + 466 + 38 = 4w. Let p = 143 - w. Solve ps = 19s for s. 0 Let f = 8259 + -8245. Solve -23i = -fi - 36 for i. 4 Let c(g) = -2g*3 - 66g*2 - 87g - 698. Let u be c(-32). Solve uk = 69k + 93 for k. -3 Suppose 2w = 5p - 4p - 1527, 2p - 3057 = w. Solve -p = 5v - 1559 for v. 6 Suppose 5m - 3w = 0, -3w - 26 = -7w - 6. Let s be (11/3)/(1/3). Suppose -z - 2 = 4l - ml, -3l - 4z = s. Solve t - 2t + l = 0 for t. 3 Let n be (129/8)/3 - (-87)/(-232). Solve 11 = -3c + n for c. -2 Let h(g) = -g3 + 11 + 26 + 10g*2 - 6 - 3g. Let y be h(10). Solve -1 - y = -2t for t. 1 Let o = -5309 - -5329. Let f = 3 - -4. Let v = f + 1. Solve -3s = -vs + o for s. 4 Let v(r) = r2 - 289r - 9449. Let m be v(-39). Solve m = -7h + 3315 for h. -4 Let m = -629 - -716. Suppose -96 = mq - 95q. Solve -48 = -9r - q for r. 4 Let l(d) = -d*2 - 337d - 6636. Let a be l(-21). Solve a = 16r + 117 - 149 for r. 2 Let b be ((-13230)/12)/(-49)(10/3 + -2). Solve -bq + 8q - 6q = 0 for q. 0 Suppose 0 = -q - 6p + 12, -26p = -27p + 2. Solve q = -66z + 453 + 75 for z. 8 Let o = 3189 + -3159. Solve ol + 12 = -18 for l. -1 Let d(a) = 6a2 + 6a - 1. Let r be d(-5). Let b be (-6)/(-8) + r/28. Let n(h) = -h*3 + 63h*2 - 122h + 9. Let y be n(61). Solve bg + 11 = -y for g. -4 Let g be (20/25)/((-8)/(-20)) + -2 + 5. Solve -4r - gr = -27 for r. 3 Let a(w) = w3 + 4w*2 - 11w + 8. Let d be a(-6). Suppose 13 = y - 5o, y - 3o = 7 + d. Solve yu - 6 = 5u for u. -3 Let m = 144 + -144. Suppose y + 29 = 5x - my, 4x = -3y + 8. Solve -8v + 3 = -xv for v. 1 Suppose -2b + 37 = -3x, -2b + 5x = -34 - 1. Suppose u - 5a = -4u + 175, -2a = u - b. Solve -u = -2y + 8y for y. -5 Let t = -165 + 253. Let c = t - 129. Let u = -39 - c. Solve -s = us for s. 0 Let z(b) = -7b + 4. Let g be z(-10). Let d = g + -74. Suppose -i + 2 = i - 2k, i + k - 5 = d. Solve -j = ij for j. 0 Let l(v) = v + 12. Suppose -2o - 12 - 12 = 0. Let i be l(o). Suppose 5n + 13 - 28 = i. Solve nx + 5 = 20 for x. 5 Let c(t) = -3t2 + 93t - 494. Let u be c(24). Solve -33a = -38a - u for a. -2 Let d = -286 - 84. Let k = -361 - d. Solve -4 = r - k for r. 5 Let b(r) = r*3 - 9r*2 - 27r + 217. Let d be b(10). Solve 63 = -8s + d for s. -2 Suppose -2y - 5y + 7 = 0. Let u = 603 + -600. Solve -2z - y = -u for z. 1 Let y(s) = 2s2 + 41s + 146. Let v be y(-16). Let w be (-1)/3 + (-57)/(-9). Suppose b = wb. Solve vp + 0p = b for p. 0 Let p(j) = -j2 - 17j + 47. Let k be p(-19). Suppose 2a - ka = -14. Solve -h = -ah for h. 0 Let o = -438281 + 438284. Let s(w) = w + 2. Let v be s(3). Solve 0 = -ou + vu for u. 0 Suppose 4k + 4s = 0, 3s = k + 6s + 4. Suppose -2w - 299 = 2w + 3z, -146 = kw - 2z. Let t = w - -83. Solve -tf = -12f for f. 0 Let p(o) = o*3 + 17o*2 + 21o + 7. Let j be p(-13). Suppose 3u + j = -2u. Let x = u - -86. Solve x - 13 = 3k for k. -3 Let n be -16(-15)/(-10) - 3. Let w(o) = o*3 + 30o*2 + 82o + 29. Let p be w(n). Solve 3s - ps = 2 for s. 2 Let w be -3 - (-3 + -1) - -1 - -2. Suppose -26c + 24c = -w. Suppose 0 = -4f + cf - 2a + 8, 0 = a. Solve -f = -0u - u for u. 4 Let x(o) = o*3 - 17o*2 - 20o + 24. Let c be x(18). Let f be c/(-2)(6 + 217/(-42)). Suppose -3l = -j + 18, -l = -fj - 2l + 42. Solve t = -2t - j for t. -3 Let k be (12/5)/(120/13000). Solve 59o + k = 7o for o. -5 Suppose 9i + 38 = 200. Let u be 220/i - 2/9. Solve 6m = 6 + u for m. 3 Suppose 6u + 48 = 12u. Suppose 4p + 5s = -u + 38, -3p + 23 = 4s. Solve py = y + 4 for y. 1 Suppose 216c - 2475 = -9c. Solve -83 = cf - 116 for f. 3 Suppose -2b - g = -39, -b - 5g - 46 = -34. Solve ba - 32a - 45 = 0 for a. -5 Let g(p) be the first derivative of p4/12 - 5p*3/3 + 29p*2/2 + 15p + 22. Let m(u) be the first derivative of g(u). Let j be m(6). Solve 4 - j = s for s. -1 Suppose 12t = 13t - 44. Let k be (t - 48)1(-1 - 0). Let u be ((-114)/k)/((-6)/4). Solve -11 + u = -2l for l. -4 Suppose -4f = -10 + 2, 5f + 45 = 5n. Let x(r) = 12r - 127. Let d be x(n). Suppose 0 = -q - 0q - 3b + 15, -2q - 2b + 10 = 0. Solve q = ds + 2 - 7 for s. 1 Let c(d) = -2d3 + 12d*2 + 17d - 14. Suppose 0 = -24g - 0g + 168. Let x be c(g). Solve 0 = -xj + 3j for j. 0 Let w = 8061 + -7993. Solve -62x + 18 = -wx for x. -3 Suppose -5q = a + 20, -4a + a + 16 = -4q. Suppose -51 = -3g - 3x, -3g - x + 40 + 13 = a. Let v = g - 13. Solve 0 = -2n - 3 - v for n. -4 Let z(t) = 2t*3 + 4t*2 + 22t - 4. Let n(d) = d*3 + 4d*2 + 19d - 4. Let x(p) = 3n(p) - 2z(p). Let i be x(6). Solve 0 = a + ia - 15 for a. 5 Let c(g) = -4g - 14. Let j be c(-4). Suppose s = -4s + jl - 37, -s - 13 = l. Let u be 76/18 - (-2)/s. Solve -2 - 2 = ut for t. -1 Suppose -80 = -3p + 2t, 3p - 77 = -5t + 4t. Solve -8 = -pl + 18l for l. 1 Suppose -17 = -w - 2h, -h - 5 = -w + 6. Let m(p) = -p2 - p + 186. Let n be m(w). Solve -2r = -nr - 6 for r. -3 Let x(s) = -7s*3 - 6s*2 + 4s + 23. Let d(t) = -t*3 - t + 1. Let u(h) = 6d(h) - x(h). Let w be u(-7). Solve -7n + w - 11 = 0 for n. -1 Let h be (-5)/(50/(-55)) - 6/4. Suppose -9 = l - h. Let v be -182l/30. Solve -5f = -v + 1 for f. 1 Let k(j) = j*3 + 26j*2 - 38j + 12. Let r be k(-27). Let p = -303 + r. Solve 0x - p = -3x for x. 2 Let k(c) be the first derivative of -c*3/3 - 31c*2/2 - 144c + 48. Let v be k(-25). Solve -vl + 5 = 5 for l. 0 Let s(g) = -g2 + 7g - 5. Let m be s(4). Suppose 3211q = 3172q. Solve -mx + x = q for x. 0 Let l be 3/(-2)(-4 - 12 - -8). Solve -12r - 48 = l for r. -5 Let f = -75 - -82. Let o = -4 - -12. Let a = o - f. Solve 0 = -0u + u + a for u. -1 Let x = -17340 + 17348. Solve -132 = -20h + x for h. 7 Let u(i) = 2i*2 - 3 - i - 5i + 6. Let w be u(4). Let l = 13 - w. Solve lz + 7 - 3 = 0 for z. -2 Let h(r) = -2r + 111. Suppose -4g - 5z + 152 = 0, -4*g -	{ "pile_set_name": "DM Mathematics" }
7. Suppose os - 44 = 32s. Solve 6n - s = -5 for n. 1 Let p be ((-4)/3)/((-14)/(-21)). Let s(q) = 8q + 27. Let t be s(-4). Let b = p - t. Solve -bf = f - 4 for f. 1 Let l = 332 + -332. Suppose 59t - 48t - 132 = l. Solve -9p + t = -5p for p. 3 Let a(z) = z2 + z - 75. Let v be a(-12). Let s = v + -54. Solve -8 = w - s for w. -5 Let c(n) = -n2 - 16n - 12. Let z be c(-15). Let f(q) = q*2 + 3q - 14. Let r be f(z). Solve 0 = -w - 8 + r for w. -4 Let p = -2959 - -2967. Solve 2 + 6 = px for x. 1 Let r(d) = -d3 - 20d*2 - 88d + 24. Let t be r(-7). Suppose 4a + 0a = 308. Solve -as - t = -76s for s. -3 Let v(c) = 207c2 - 87c - 87. Let k be v(-1). Solve 217 - k = 5t for t. 2 Suppose -22 = -4k - 7k. Let x be (3 - 209/k) + (-3)/6. Let q = x - -112. Solve p + q = 5 for p. -5 Suppose -56a - 4 = -54a. Let t be (a/(-2) + 5)/((-4)/(-6)). Suppose 13u - t = 4u. Solve -4i + 13 - u = 0 for i. 3 Let d = 1116 + -1651. Let n = d + 569. Solve n = -6c + 4 for c. -5 Let v = -1226 - -2213. Suppose 767 = -11a + v. Solve 0p - 4p = a for p. -5 Suppose 0 = -5p + 171 + 159. Let c = 64 - p. Let w be (0 - c/(-11)) + (-6)/(-33). Solve w + 2 = 2z for z. 1 Let f = 39 - 23. Suppose a + 5j + 23 = 0, 5a - 2j - f = 2a. Suppose 4p - 5p = -a. Solve -n = pn - 9 for n. 3 Let x be 0/(-36/9). Suppose 4u = 2v + 6u - 14, -2u + 10 = x. Solve -vr - 1 = -r for r. -1 Suppose 4m + 3i - 70 = -m, -i = -4m + 73. Let q = -11 + m. Suppose 0 = 29d - 22d + 47d. Solve -qu + 4u + 6 = d for u. 3 Let o be 11403/724 - (10/(-5) - 7/(-4)). Solve -210m = -202m - o for m. 2 Let q(k) = -6264k + 404. Let w be q(-1). Solve 4j = -6672 + w for j. -1 Let v be 39 + (-12)/(-3 + 0). Suppose 46b - vb = 15. Solve 3 + b = 4i for i. 2 Let o(d) = 133d - 5. Let s be o(1). Let i = s - 125. Solve j = i - 2 for j. 1 Suppose 841 = 77t + 71. Solve ty + 90 - 50 = 0 for y. -4 Let w = 98 + -59. Suppose 3t - 57 = -w. Solve 10 = -4b + tb for b. 5 Let y be 1(16 - 160/(-10)). Solve 0 = -yf - 26f - 464 for f. -8 Let g be -27 - (-581)/21 - (10/(-3) + 2). Solve gk + 32 - 16 = 0 for k. -8 Suppose 4l - 5k = 2 + 24, -k + 38 = 4l. Suppose -36y - l = -39y. Let a = 3 - 2. Solve y = -h - a for h. -4 Suppose 28050 = -78d + 248d. Solve dj - 168j = -6 for j. 2 Let j be (-4)/(-2)(36/(-4) + 10). Suppose jb + 6b - 16 = 0. Solve -p = b - 1 for p. -1 Let r = 331 - 209. Suppose 0 = 2b - 2m - 34, 5b - 3m + 31 = r. Solve -l + b = -5l for l. -5 Let q = -1 - -4. Suppose 640 - 472 = 28u. Solve qt = ut for t. 0 Let d = -150 + 78. Let x = d - -76. Let y be (-8 + 0)(-7)/28. Solve y + x = -2z for z. -3 Let g be (-6)/(-2)((-477)/9 - 6). Let y = -177 - g. Solve 3j = -yj for j. 0 Let o = -31 + 76. Let l be (-6)/(-15) + (-18)/o. Suppose 0 = -3g - 15, -2f + lg + 5 = -g. Solve -q + 3 = -fq for q. 3 Let h = -2450 + 2482. Solve q + 31 = hq for q. 1 Let t = 14 - 1. Suppose -3j = -t - 14. Suppose 10k - j - 31 = 0. Solve -m + k = m for m. 2 Let w(s) = s*3 + 21s*2 - 25s - 46. Let o be w(-22). Suppose 0m - 3m + 3 = 0, -3q + 4m = -20. Suppose -qa = -oa. Solve a = -2p + 9 - 1 for p. 4 Let v(r) = -r2 + 8r + 43. Let q be v(10). Suppose 24 = -11n + qn. Solve -8 = -nt - 2t for t. 2 Let v be (452/6)/1 - 68/51. Let b = 106 - v. Let w be ((-3)/2)/((-12)/b). Solve h = -wh - 10 for h. -2 Let s(q) = -3q - 38. Suppose 33b - 42b - 126 = 0. Let a be s(b). Suppose 3m + 10 = ay - 11, 0 = 3y + 4m + 3. Solve -y = -3k + 3 for k. 2 Let d(b) be the second derivative of b5/20 + b4/3 - b3/6 + 7b*2/2 - 5b. Let r be d(-4). Let f = r - -6. Solve -f = 4g + 3 for g. -5 Let u = 57 + -47. Suppose -2y + u + 8 = 0. Let v be (0 - 1)/(-10 + y). Solve -4m - v = 3 for m. -1 Let t(i) = -i2 + 24i - 127. Suppose 5d - 4d = -3m + 35, m - 21 = 2d. Let h be t(m). Solve -hb - 14 = 18 for b. -2 Suppose -5j - 2j = 0. Let c be j - -4 - (10 - 0). Let u be c/(-4)192/36. Solve -2h - u = -2 for h. -3 Let y be ((-6)/(-4))/(27/36) + (4 - 0). Solve 132 = yc - 28c for c. -6 Let l = -834 - -835. Let y be 2/(-12) - ((-30)/36)/5. Solve -i + l + 2 = y for i. 3 Let l(o) be the second derivative of o5/20 - o4/3 + 3o*3/2 - 17o*2/2 - 40o + 2. Let z be l(3). Solve z = -2g + 5 for g. 2 Let r be (188/(-235))/((-231)/1502 - -3). Solve 5n = -rn + 90 for n. 6 Suppose 70 = 10t + 190. Let v = -8 - t. Solve 2r = 9r + vr for r. 0 Suppose 0 = -5q + 2v + 83, -4q + 10v + 66 = 8v. Suppose -6i - 11 = -q. Solve 2p + 3 = i for p. -1 Let h be (176/(-4))/((-63)/(-57) - 1). Let x = h - -426. Solve 8z = 4z + x for z. 2 Let k(s) = -102s + 4429. Let u be k(43). Solve 48i = -293 - u for i. -7 Let z = -61 + 172. Suppose 33r - z + 12 = 0. Solve 6q = rq for q. 0 Let m = 666 + -660. Suppose i = -3b, -i - b = -mi. Solve -j + 4 - 1 = i for j. 3 Let l be (2 + (-14)/5)10/(-4). Suppose 3r + r = lk - 26, 4k - r = 24. Solve -km + 24 = m for m. 4 Suppose -u + 4x = 86, -3u = x - 6x + 265. Let f be u/(-23) + (-38)/(-437). Solve -5w - fw + 36 = 0 for w. 4 Suppose -263j = -289j + 22230. Solve -11q - 800 = -j for q. 5 Let z(j) = -56j*2 - 897j - 5. Let m be z(-16). Solve -mi + 40 = -i for i. 4 Suppose 0 = 2h - 5x + 15, -3h - 4x + 12 = h. Let y be h/(1(0 + -2) + 0). Solve y = -p - p for p. 0 Suppose -25l + 95 = -22l - c, l - 4c - 50 = 0. Solve -72v + 82v = l for v. 3 Suppose 68s - 73s = 0. Let i(j) = -3j. Let o be i(s). Suppose -4 - 2 = -2n. Solve 0 = a - oa - n for a. 3 Let c = 9641 + -9616. Let j(m) = -m + 2. Let a be j(-4). Solve i - ai = -c for i. 5 Suppose -5g - 5 = 0, -g = 2n - 3g + 2. Let w be (0/(-3))/((-4)/n - 1). Solve -p + 5p - 8 = w for p. 2 Suppose 0 = 4r - 5u + 278 - 243, 5r = -3u + 21. Let c = -30 + 37. Solve -9p + 2p + c = r for p. 1 Let o be 18/(-27) - (-51)/(-9)-1. Solve -o + 17 = -3s for s. -4 Let x(j) = 4j + 62. Let g(t) = -2. Let q(r) = -2g(r) + x(r). Let h be q(-16). Solve 0 = -hs - 0s - 8 for s. -4 Let c = -373 + 394. Suppose 15t = ct - 24. Solve 0 = n - 0n - t for n. 4 Let o = -39898 - -39900. Solve 909 - 891 = or for r. 9 Let i(u) = u2 - 16u - 25. Let x(p) = -p*2 - 19p + 18. Let n = -117 + 98. Let a be x(n). Let f be i(a). Solve -8m + fm - 9 = 0 for m. 3 Suppose 51w + 104 = 59w. Suppose -42 = -5u - 4q, -5u = -2q - 37 + w. Solve 2h = -0h - u for h. -3 Let w be (0/(-2 - 1))/(-2). Let o be 2 - (-3 - -4)w. Solve 0 = 3h + o - 17 for h. 5 Suppose 9v - 7v = 8. Suppose 4h = -vh. Solve 0 = -7t - 7 - h for t. -1 Let d be (-1 - 1/3)/((-44)/297). Suppose -2i = -5v - d, 4v - 36 = -3i - 11. Solve 0 = -h + 8h - i for h. 1 Suppose -8r + 434 = 410. Let h(y) = -5y + 6 - 16y2 + 17y*2 + 10y. Let l be h(-4). Solve -5v + rv - l = 0 for v. -1 Let l be (-3)/(-2)(-21 - -11). Let z = -13 - l. Suppose -6 = zi - 2c, i - 3c = -0c - 9. Solve 0 = -4r + 4 - i for r. 1 Suppose -i - 5w = -2i + 34, 114 = 4i + 2w. Let d = i + -27. Let z be d/(3/2 - 1). Solve -z = -5y + 21 for y. 5 Let x(k) = -k2 - 20k + 1464. Let t be x(29). Solve 63v - 100 = tv for v. 5 Suppose -3 - 7 = -2c. Suppose -3m - 394 = 7r - 3r, -4m - 515 = -cr. Let y = m + 130. Solve -z = -yz + 3 for z. -3 Let j = -2804 - -3169. Solve 358d = jd + 35 for d. -5 Let m(j) = -j3 - 4j*2 - j + 4. Let f be m(-4). Suppose -fc + 32 + 0 = 0. Suppose 0 = -5i - b + 10, 22 = i + i + cb. Solve 4h - 11 = i for h. 3 Let v = 5758 - 5566. Solve -v = 9g - 219 for g. 3 Let g(a) = 61a - 34. Let y be g(12). Let c = y + -694. Solve 2 = cq - 6q for q. -1 Let d be 3/9 - 25/(-15). Suppose 15 = dv - 51. Suppose -2t = 3w - 27, -2w - v - 25 = -5t. Solve p - t = -2p for p. 4 Suppose 8u = 14u - 12. Suppose u - 1 = c. Suppose 2l + 1 + c = -5j, 8 = -4j. Solve -la - 3 = 9 for a. -3 Suppose 3r - 32 = k, r - 20 = 7k - 2k. Suppose 4 = 5q - 4o, -5q + 5o - 40 = -rq. Solve -qi = -2i + 2 for i. -1 Suppose 4w = -5a + 89, -a = -2w + 2a + 17. Suppose 0 = 12h - 10h - w. Solve 0 = 10m - hm for m. 0 Suppose -3 = -g - 6. Let n be (g/2 - (-3)/6)2. Let d(o) = o + 5. Let r be d(n). Solve rp = -p - 8 for p. -2 Let f(h) = -h3 + 8h*2 + 22h - 15. Let c be f(10). Suppose 2v + 0v = -3a + 20, ca + 18 = 4v. Solve 18 = -vt + t for	{ "pile_set_name": "DM Mathematics" }
he next term in 1, -3, -19, -47, -87? -139 What is the next term in 79, 181, 349, 583? 883 What is next in 59973, 119893, 179813? 239733 What is next in -140904, -140905, -140906? -140907 What comes next: 364, 720, 1072, 1420, 1764, 2104, 2440? 2772 What comes next: 16, 128, 424, 988, 1904, 3256, 5128, 7604? 10768 What is the next term in 4329, 8668, 13007, 17346, 21685, 26024? 30363 What is the next term in 229, 869, 1509? 2149 What comes next: 9858, 19670, 29478, 39288, 49106, 58938, 68790, 78668? 88578 What comes next: -10849, -10847, -10845, -10843? -10841 What comes next: -40273, -40284, -40307, -40348, -40413, -40508, -40639? -40812 What comes next: 535, 532, 529, 526, 523, 520? 517 What is the next term in -648, -893, -1126, -1341, -1532? -1693 What comes next: -23170, -46334, -69482, -92602, -115682, -138710? -161674 What is the next term in -823, -3312, -7461, -13270? -20739 What comes next: 337656, 675314, 1012972? 1350630 What is the next term in 150, 275, 404, 537, 674, 815? 960 What is the next term in -5965, -47706, -161013, -381670, -745461, -1288170, -2045581, -3053478? -4347645 What is next in -1970, -4029, -6330, -8993, -12138, -15885, -20354, -25665? -31938 What is the next term in -60, -402, -1310, -3060, -5928, -10190, -16122? -24000 What is the next term in -9074, -72522, -244746, -580136, -1133082, -1957974, -3109202? -4641156 What is next in -10665, -21310, -31955, -42600, -53245, -63890? -74535 What is the next term in 4479, 8968, 13455, 17940? 22423 What is the next term in 31792, 31844, 31896? 31948 What is next in 22, -94, -290, -566? -922 What comes next: -477126, -477128, -477130, -477132, -477134, -477136? -477138 What is next in -908, -1795, -2660, -3503, -4324, -5123? -5900 What comes next: -105, -105, -85, -39, 39, 155? 315 What is the next term in 51, 40, 55, 96, 163, 256, 375? 520 What comes next: -76, -318, -718, -1276, -1992, -2866, -3898? -5088 What is the next term in 793, 2843, 6263, 11053, 17213? 24743 What comes next: 2, -602, -2738, -7330, -15302, -27578? -45082 What comes next: -703, -1395, -2087? -2779 What is next in 1813, 3357, 4901, 6445, 7989? 9533 What is next in 7120, 7121, 7122? 7123 What is next in -1828, -7315, -16460, -29263, -45724, -65843, -89620? -117055 What is next in 1185, 2295, 3403, 4509? 5613 What comes next: -1739, -6946, -15611, -27728, -43291, -62294, -84731, -110596? -139883 What is the next term in 411, 549, 687, 825, 963, 1101? 1239 What comes next: -2201, -2287, -2407, -2579, -2821, -3151, -3587? -4147 What is next in -3198, -3178, -3158, -3138, -3118? -3098 What comes next: -187, -378, -673, -1072, -1575? -2182 What is next in 2058271, 2058268, 2058265? 2058262 What is the next term in -398, -78, 244, 568? 894 What is the next term in 1021, 1424, 1813, 2182, 2525, 2836? 3109 What comes next: 16, 321, 626, 931, 1236, 1541? 1846 What is next in -2523, -2602, -2681? -2760 What comes next: -272, -1089, -2458, -4385, -6876, -9937? -13574 What is next in 1251, 1135, 923, 609, 187, -349? -1005 What is the next term in -382544, -382541, -382538, -382535, -382532? -382529 What comes next: 376, 565, 590, 451? 148 What comes next: -1381, -1337, -1303, -1285, -1289? -1321 What is the next term in -196, -367, -538, -709, -880? -1051 What is next in 1380, 1359, 1330, 1293, 1248, 1195? 1134 What comes next: 917, 793, 669, 545, 421, 297? 173 What comes next: 2000, 2047, 2108, 2189, 2296, 2435? 2612 What comes next: 28513, 28540, 28569, 28600, 28633? 28668 What comes next: 151, 583, 1313, 2347, 3691, 5351, 7333? 9643 What comes next: -129, -330, -531, -732, -933? -1134 What is the next term in -132264, -264525, -396784, -529041, -661296, -793549? -925800 What is the next term in 2952, 2984, 3014, 3042? 3068 What is next in -57, -80, -109, -144, -185? -232 What is next in 315, 2499, 8429, 19977, 39015, 67415, 107049? 159789 What comes next: 19927, 19901, 19875, 19849, 19823? 19797 What is next in -34732, -34694, -34632, -34546, -34436, -34302? -34144 What is next in 308, 1081, 2370, 4175? 6496 What comes next: -661, -604, -549, -496, -445, -396, -349? -304 What comes next: -83, -188, -341, -542? -791 What is next in -1091609, -2183214, -3274819, -4366424, -5458029? -6549634 What is the next term in 4430, 8931, 13432, 17933, 22434? 26935 What is the next term in 4556, 9102, 13648? 18194 What comes next: -95518, -95512, -95506, -95500, -95494, -95488? -95482 What is the next term in -193, -295, -471, -721, -1045, -1443, -1915? -2461 What comes next: 19, 103, 245, 445, 703, 1019, 1393? 1825 What is the next term in 3346, 3250, 3158, 3070? 2986 What is next in -1195, -1282, -1499, -1906, -2563, -3530? -4867 What is the next term in -22, -35, -46, -61, -86? -127 What comes next: -7529, -7875, -8221, -8567, -8913? -9259 What is next in 56994, 56990, 56986? 56982 What is the next term in -16728, -16640, -16492, -16284, -16016, -15688, -15300? -14852 What is next in -531878, -1063753, -1595628, -2127503, -2659378, -3191253? -3723128 What comes next: 1409, 6906, 16059, 28862, 45309? 65394 What comes next: -3818, -15390, -34680, -61694, -96438, -138918, -189140, -247110? -312834 What is next in 923173, 923169, 923165, 923161, 923157, 923153? 923149 What is next in 1586, 2326, 3066, 3806, 4546? 5286 What is next in 689, 1235, 1781, 2327, 2873? 3419 What is the next term in -2625, -2573, -2423, -2127, -1637? -905 What is the next term in -36, -400, -1448, -3528, -6988, -12176? -19440 What is next in -97, -105, -117, -133, -153, -177? -205 What is the next term in -22447, -44900, -67353? -89806 What is the next term in 146494, 146486, 146478, 146470, 146462, 146454? 146446 What is next in -837590, -837587, -837582, -837575, -837566, -837555, -837542? -837527 What is the next term in 12046, 12313, 12764, 13405, 14242, 15281? 16528 What is the next term in -4075, -16354, -36817, -65458, -102271, -147250, -200389? -261682 What comes next: 23988, 47975, 71964, 95955, 119948, 143943, 167940? 191939 What comes next: -2175, -2257, -2339, -2421? -2503 What comes next: 413369, 413367, 413365, 413363? 413361 What is next in 946, 3588, 7992, 14158? 22086 What comes next: 2653, 2607, 2479, 2227, 1809, 1183, 307, -861? -2363 What is next in -10509, -18393, -26279, -34167? -42057 What is next in 198566, 198567, 198568, 198569, 198570, 198571? 198572 What comes next: -43497, -43464, -43411, -43332, -43221, -43072? -42879 What is next in -21910, -22081, -22542, -23437, -24910, -27105? -30166 What is the next term in 52992, 105985, 158978, 211971? 264964 What is next in -26212, -26203, -26194? -26185 What is the next term in 256, 447, 638, 829? 1020 What is next in -118249, -236479, -354709, -472939, -591169? -709399 What is next in 842, 960, 1152, 1412, 1734, 2112, 2540, 3012? 3522 What is the next term in 8419, 16882, 25389, 33940? 42535 What comes next: 46, 22, -68, -254, -566, -1034, -1688? -2558 What comes next: 50, 242, 606, 1178, 1994, 3090, 4502? 6266 What comes next: 1830, 1892, 1956, 2022, 2090, 2160, 2232? 2306 What is next in -4088, -8192, -12296, -16400, -20504? -24608 What is next in -27, -129, -297, -531, -831, -1197, -1629? -2127 What comes next: -1337, -2883, -4441, -6017, -7617, -9247, -10913, -12621? -14377 What comes next: 33118, 33092, 33048, 32986? 32906 What comes next: -3407, -6758, -10055, -13298, -16487? -19622 What comes next: 4832, 4819, 4806, 4793, 4780, 4767? 4754 What is next in -491, -956, -1413, -1862, -2303, -2736? -3161 What is the next term in -4276, -4278, -4280, -4282, -4284, -4286? -4288 What is next in -238, -69, 102, 275, 450, 627? 806 What is the next term in 472, -924, -3252, -6512, -10704? -15828 What is the next term in 9001, 9007, 9023, 9055, 9109, 9191, 9307, 9463? 9665 What is next in -1378, -5510, -12394, -22030? -34418 What is next in 4052, 4046, 4028, 3992, 3932, 3842, 3716, 3548? 3332 What is next in 62247, 124469, 186691, 248913? 311135 What is next in 676, 2868, 5062, 7258, 9456? 11656 What comes next: 1931, 1936, 1941? 1946 What is the next term in -104, 112, 626, 1588, 3148, 5456, 8662? 12916 What is next in 479, 833, 1199, 1583, 1991, 2429? 2903 What is the next term in -1726, -1600, -1474, -1348, -1222? -1096 What is the next term in 384, 738, 1092? 1446 Wh	{ "pile_set_name": "DM Mathematics" }
7060i3 Collect the terms in 58498i - 29247i - 27i*2 - 29251i. -27i2 Collect the terms in 60t + 133t + 156t - 18t + 26t*3. 26t*3 + 331t Collect the terms in 29f + 103f - 1289 + 47198 - 25f. 107f + 45909 Collect the terms in 5343t - 4388t + 1043t + 2166t. 4164t Collect the terms in 82830w*2 - 41376w*2 - 41511w*2. -57w*2 Collect the terms in 1054o*2 + 50o*2 - 1104o*2 - 16o*3. -16o*3 Collect the terms in 2 - 14825u - 8171u - 4765u. -27761u + 2 Collect the terms in 12239q - 5770q + 4479q + 4939q. 15887q Collect the terms in 13285v + 250v*2 - 13285v + 7351 - 7351. 250v2 Collect the terms in -201011 + 201033 + 0y*2 - 3y*2. -3y*2 + 22 Collect the terms in 2h - 3h - 105321h*2 + 30209h*2 - 206863h*2 - 3. -281975h*2 - h - 3 Collect the terms in -2319l - 7127l - 7484l + 4613l - 7369l. -19686l Collect the terms in 522675v - v*2 + 3 - 84062v + 20869v. -v2 + 459482v + 3 Collect the terms in -11435u2 - 1642u - 1961u2 + 3288u - 1646u. -13396u*2 Collect the terms in 1784v*2 - 251v*2 + 1023 - 1023. 1533v*2 Collect the terms in 10079y*2 - 10644y*2 + 18y - 57y. -565y*2 - 39y Collect the terms in -902432 - 17701s3 + 902432 + 17700s*3 - 13s. -s*3 - 13s Collect the terms in -35354k3 - 35348k*3 + 108532k*3 - 37832k*3. -2k*3 Collect the terms in 611p*2 + 5p + 530p2 - 188p*3 - 1141p*2. -188p*3 + 5p Collect the terms in 210u - 14u*2 - 699u + 286u + 203u - 15u2. -29u*2 Collect the terms in -97u*2 + 131u*2 + 87u*2 + 40u*2 + 52u*2 - 21u*2 - 4u*2. 188u*2 Collect the terms in -1118v + 199v - 1497v. -2416v Collect the terms in -31y*2 + 80376 + 2y - 40416 - 39960. -31y2 + 2y Collect the terms in -2k3 + 130815k2 + k3 - 17k + 130814k*2 - 261629k2. -k3 - 17k Collect the terms in -2k + 1097254211090 - 1097254211090. -2k Collect the terms in 1767 - 823o*3 - 580 - 590 - 597. -823o*3 Collect the terms in 6 + 226g - 69g2 - 67g*2 - 63g*2 + 196g*2. -3g*2 + 226g + 6 Collect the terms in -101512 + 203470 + f - 101738. f + 220 Collect the terms in 4585m3 - 1066m*3 - 1128m*3 - 1106m*3 - 1140m*3. 145m*3 Collect the terms in 136499x - 273348x + 136655x. -194x Collect the terms in -240g - 33g + 65g + 390g. 182g Collect the terms in -18224444v + 54v*2 + 18224444v. 54v2 Collect the terms in 4n*2 + 148 + 4n + 2n - 8n + 80. 4n2 - 2n + 228 Collect the terms in -3917c2 + 15660c*2 - 3912c*2 - 3914c*2 - 3915c*2 - 8. 2c*2 - 8 Collect the terms in -2x*3 + 105026x - 105026x + 292. -2x*3 + 292 Collect the terms in -70 + 22 + 21 - 54h + 32 + 57h. 3h + 5 Collect the terms in -270j - 321j - 1686j - 557j. -2834j Collect the terms in 4403g3 + g2 + 8758g3 + 11329 - 11329 - 3603g*3. 9558g3 + g2 Collect the terms in -393h3 - 430h*3 - 441h*3 + 96h*3 + 28h*3. -1140h*3 Collect the terms in 71z*3 - 2949 + 2914 - 76z*3. -5z*3 - 35 Collect the terms in -169i - 300i - 170i - 163i + 783i. -19i Collect the terms in -3582p - 8 + 10945p + 7806p + 9 + 1104p. 16273p + 1 Collect the terms in -2 + 9 - 16x + 13 - 93. -16x - 73 Collect the terms in 7k + k - 13k - 122 - 16k. -21k - 122 Collect the terms in 23k + 11 + 11k - 23 - 26 - 43k - 2. -9k - 40 Collect the terms in 5 - 187f3 - 2 + 1 + 8f*2 + 38f*3. -149f*3 + 8f*2 + 4 Collect the terms in 17110f*3 - 3 - 4384f*3 + 5205f*3 + 6. 17931f*3 + 3 Collect the terms in -3g*3 + 0g*2 + 2g*2 - 589 + 593. -3g*3 + 2g2 + 4 Collect the terms in 3 + 17 - x3 + 48 + 2x2 - 158. -x3 + 2x*2 - 90 Collect the terms in -15693 + 3166791i + 26i3 + 15693 - 3166793i. 26i3 - 2i Collect the terms in -287 + 5754h + 805 - 261 - 268. 5754h - 11 Collect the terms in -728 - 728 - 1157 + 2613 + 304h2. 304h*2 Collect the terms in 731 - 731 + 999820i*3. 999820i*3 Collect the terms in 23731227 - 2j*3 - 11865405 - 11865822. -2j*3 Collect the terms in 14 - 19p*2 - 14 + 20p*2 - 14949p*3 + 14968p*3. 19p3 + p2 Collect the terms in 908 - 21q - 911 + 9q*2 + 5q + 43q2 - 57q. 52q2 - 73q - 3 Collect the terms in -465439p3 + 683446p*3 - 218006p3. p3 Collect the terms in 0 - 77506u + 8 + 77532u. 26u + 8 Collect the terms in -11 + 131a*2 - 624a*2 + 125a*2 + 114a*2 + 120a*2 + 136a*2. 2a*2 - 11 Collect the terms in -13f + 847776 + 847777 - 2543325 + 847772. -13f Collect the terms in 78z - 41z - 33z + 2058. 4z + 2058 Collect the terms in 29 - 71 + 367t*2 - 1519t*2. -1152t*2 - 42 Collect the terms in -21106f + 7034f + 7036f + 7035f - 2 + 9. -f + 7 Collect the terms in 16 + 9 - 3 + 94q + 10 - 176 + 144 - 97q. -3q Collect the terms in -5i3 - 7i*3 + 13i + 25i - 86 + 10i*3 + 86. -2i*3 + 38i Collect the terms in 18n2 - 59n*2 + 28n*2 + 12n*2 + 152n - 2. -n*2 + 152n - 2 Collect the terms in 149 + 2399s - 1197s - 149 + 15s2 - 1202s. 15s2 Collect the terms in 245w + 8w - 308w. -55w Collect the terms in -703b*2 - 747b*2 + 2344b*2 - 165b*2. 729b*2 Collect the terms in -3468m + 35330 - 11780 - 11769 - 11781. -3468m Collect the terms in -1 - 190923j + 381896j + 1 - 190996j. -23j Collect the terms in 224s - 7s2 + 463s - 687s - s2. -8s*2 Collect the terms in 10z2 + z2 + 0z + 0z + 783 - 16z2 - 783. -5z*2 Collect the terms in 44269956o*2 - 3 - 44430315o*2 + 3. -160359o*2 Collect the terms in 45i + 31i + 40i + 4i + 2 - 45i. 75i + 2 Collect the terms in 47q + 14q + 53q - 30q + 23q. 107q Collect the terms in 159733w*3 - 79841w*3 - 79898w*3. -6w*3 Collect the terms in -21585596a + 221a2 + 21585596a - 3. 221a2 - 3 Collect the terms in 1021f*2 - 3 + 109f - 1028f2 + 2 + 1. -7f*2 + 109f Collect the terms in -448977 - 448980 + 6j + 1346938 - 448979. 6j + 2 Collect the terms in -3200528h3 + 1600269h*3 + 1600255h*3. -4h*3 Collect the terms in 5d*2 - 11442d - 3d2 + 935d. 2d2 - 10507d Collect the terms in -10704x + 40083x - 10490x. 18889x Collect the terms in 28g + 35g - 113g + 31g + 31g - 5g. 7g Collect the terms in -3 + 308u - 1002u + 481u. -213u - 3 Collect the terms in 8449a - 33192225 + 33192225. 8449a Collect the terms in -437 - 604 + 3u - 559u2 - 3u + 1654 - 614. -559u2 - 1 Collect the terms in -7 + 7 + 188068k*3 + 118567k*3. 306635k*3 Collect the terms in -50 - 2j*2 + 47955558j - 47955558j. -2j*2 - 50 Collect the terms in 62k*2 - 71k*2 + 1196k*2 + 1269k*2. 2456k*2 Collect the terms in -196 - 196 - 199 + 591 + 251349x*2 - 251375x*2. -26x*2 Collect the terms in 36120z + 36334z - 72656z. -202z Collect the terms in -17y*2 - 74059204989 + 74059204989 + 14y*2. -3y*2 Collect the terms in -1187t - 12 - 18 - 2838t + 30. -4025t Collect the terms in 111850w2 - 335541w*2 + 111848w*2 + 111847w*2. 4w*2 Collect the terms in 421 - 421 - 37458866x*2 + 37458873x*2. 7x*2 Collect the terms in -18w + 23w2 - 13w - 3w + 4w + 25w. 23w*2 - 5w Collect the terms in -32 + 2201t - 27 + 59. 2201t Collect the terms in 714304b - 357133b - 357148b. 23b Collect the terms in 3o2 - 113o*2 + 9o*2 + 10o + o*3 - o - 2o2. o3 - 103o2 + 9o Collect the terms in 3221 - 3p - 9679 + 3225 + 134p + 3223. 131p - 10 Collect the terms in -50 - 36x*2 + 65x*2 + 1104x - 31x2. -2x*2 + 1104x - 50 Collect the terms in 6t + 26t*2 + 18 + 116 + 19t*2 - 82t*2. -37t*2 + 6t + 134 Collect the terms in 0l3 + 468971825l - 937943652l - 3l*3 + 468971827l. -3l3 Collect the terms in -21128n*2 - 12160n*2 + 13007n*2 - 27016n*2. -47297n*2 Collect the terms in 706h - 3134h + 976h + 724h + 727h. -h Collect the terms in 4815d - 153 + 153 - 30062d. -25247d Collect the terms in -90807 + 90817 + 127x*2 - 164x*2. -37x*2 + 10 Collect the terms in -3k + 27 - 95 - 4k + 36 + 8 + 24. -7k Collect the terms in 38 - 30 + 6 - 6m - 14. -6m Collect the terms in 3793714u - 1896845u - 1896863u. 6u Collect the terms in r*2 - 10r + r*2 + 2r*2 - 4r**	{ "pile_set_name": "DM Mathematics" }
i(-3). Let y be 1/4 + 6/8. List the prime factors of (0 + f + 13)y. 11 Suppose 2y - 5a = -4a, 0 = -4y - 2a. Suppose yf + 2f + 19 = -s, 3s - 15 = 2f. Let h = 21 + f. List the prime factors of h. 2, 3 Suppose 0 = -2x + 3f + 75, 2x - 165 = -2x + 3f. Suppose x = -4t - 27. Let w = 26 + t. List the prime factors of w. 2 Let t(m) = 3m + 5m*2 + 79 - 4m - 80. Let u = 3 - 1. What are the prime factors of t(u)? 17 Suppose -2 = -2y, -3s + y - 2 - 2 = 0. Let b be s - (2/(-1) + -1). Suppose -bl + 2x + 14 = 0, -l + 4x - 2x + 4 = 0. What are the prime factors of l? 2, 5 Let p(g) = 2g + 1. Let d be p(-5). Let i(z) = -3z - 2. List the prime factors of i(d). 5 Suppose 2d + 0d - 8 = 0. Let g be -24 + 1/2d. What are the prime factors of g((-2)/(-4) + -1)? 11 Let v = 13 + -3. What are the prime factors of v? 2, 5 Let s(n) = -4. Let y(o) = o + 3. Let d(j) = 2s(j) + 3y(j). Let p be d(2). Let i = p + -2. What are the prime factors of i? 5 Let j be (1 + 1)(-2 + -3). Let l = j - -16. List the prime factors of l. 2, 3 Suppose 4j = -5x + 3j + 40, -8 = -x - 4j. Let w(b) be the first derivative of b2 - 11b - 1. List the prime factors of w(x). 5 Let r(a) be the second derivative of a4/12 + a3/3 - 2a. Let m be -3 - ((-2 - 0) + 3). List the prime factors of r(m). 2 Let h be (-218)/(-4) - (-3)/(-6). Suppose -5c + h = 2d, 6d = 4d + 2c + 26. List the prime factors of d. 17 Suppose s = -5o + 95, -3o - 2s - 62 = -7o. List the prime factors of o. 2, 3 Suppose a = j - 24, -56 - 12 = -4j - 3a. List the prime factors of j. 2, 5 Suppose -3s - 3 = 0, 0a - 70 = -3a + 4s. What are the prime factors of a? 2, 11 Suppose -34u - 882 = -37u. List the prime factors of u. 2, 3, 7 List the prime factors of 53 + (-1 - (3 + -3 + 1)). 3, 17 Let o(a) = 5a2 + 2a - 2. Let i be o(2). Suppose i = w - f, 2w + 6 = f + 46. List the prime factors of w. 2, 3 Suppose 0 = 3q - 2t - 353, -3q + 0q + 343 = -4t. List the prime factors of q. 11 Suppose w - 432 = 3b, w - 859 = -w + b. List the prime factors of w. 3, 11, 13 Suppose 0g = -g - 4p + 8, -5p + 44 = -3g. List the prime factors of -11 - (g + 3). 2 Let o(f) = 4f2 + f + 14. List the prime factors of o(5). 7, 17 Let m = 0 + 4. Suppose -2k + 5 = 3z - 11, mz - k - 14 = 0. Suppose 3x = 2 + z. List the prime factors of x. 2 Let p(s) = 8s - 2. Let w be p(3). Let q = -7 - 5. Let v = q + w. List the prime factors of v. 2, 5 Suppose 0f - 54 = -2f. What are the prime factors of f? 3 Let c be 4/(-3)(-15)/10. Let p be (-51)/(-2) - c/(-4). Let t = -15 + p. List the prime factors of t. 11 Suppose 3a - b - 107 = 0, 4a - 5b - 175 = -a. Let z(h) = -h*2 - 5h + 8. Let v be z(-6). Suppose d + 2d - a = -n, d - v = 3n. List the prime factors of d. 11 Let q(m) = m*3 + 9m*2 + 7m - 6. What are the prime factors of q(-8)? 2 Suppose 0 = -2f + 2h - 4, -h + 7 + 1 = f. List the prime factors of 49/f + (-4)/12. 2 Suppose -189 = -4m + 3. What are the prime factors of m? 2, 3 Suppose -5p = -3y - 63, y + 2p = 2y + 21. What are the prime factors of (56/y)/(1/(-3))? 2 Suppose 0 = -6u + 2u + 8, 0 = 5t - 4u - 817. List the prime factors of t. 3, 5, 11 Let f(v) be the first derivative of -v4/4 - 2v*3 + 7v*2/2 + 5v + 5. Let s = -1 - 6. List the prime factors of f(s). 5 Let u = -16 + 15. List the prime factors of (0 - -9)u/(-3). 3 Suppose -11r = 4r - 3135. List the prime factors of r. 11, 19 Let w(a) = a - 1. Let j be w(3). Suppose 0i + 16 = 4i. Suppose -3l = -3u - 51, ju + 2 = -il + 40. What are the prime factors of l? 2, 3 Suppose -3s - 15 = -3w, -3s - 15 = 4w - 3w. Let y(u) = u. Let g be y(w). List the prime factors of (g - -3 - 1) + 0. 2 Suppose -14u - 544 = -31u. What are the prime factors of u? 2 List the prime factors of (-8)/(-44) + 933/11. 5, 17 Let g(t) = -t3 + t2 + t + 8. Let c be g(0). What are the prime factors of 20/6 + c/12? 2 Suppose -40 = -3x + 62. Suppose -o = o - x. Suppose 2w - 5 = o. What are the prime factors of w? 11 Let c(i) = -14i3 - 2i*2 - 2i - 1. What are the prime factors of c(-1)? 13 Suppose -i - 9 + 29 = 0. Suppose 0 = 5b - 0 + i. What are the prime factors of (2 + b)13/(-2)? 13 Suppose i = 4i. Let p(o) = o - 5o2 + 10 + o2 + 3o2. List the prime factors of p(i). 2, 5 Let c = 156 + -25. List the prime factors of c. 131 Suppose 96 = 3m - 132. What are the prime factors of m? 2, 19 Let c be 395/45 + (-4)/(-18). Let d(l) = l*2 - 9l. Let s be d(c). Suppose 5r = -sr + 20. List the prime factors of r. 2 Let b be (-2 + 0)-2 - -2. Suppose 0 = -k + 3k + b, k + 17 = c. List the prime factors of c. 2, 7 Suppose 0 = -0i - 2i + 10. Suppose -5s + 60 = 5r, 0 = s - r + ir - 27. Suppose -4u + su - 12 = 0. List the prime factors of u. 2 Let x = 6 - -15. Let j = -3 + 6. Suppose -4i = -jm + x, 4m + 5i - 32 = -4. List the prime factors of m. 7 Let o be -2 - ((-6)/(-3))/(-2). Let p(r) = -6r. What are the prime factors of p(o)? 2, 3 Let l(x) = -x + 4. Let u be l(0). Suppose 13 = 5a + 5p - 7, ua - 4p = 0. List the prime factors of a. 2 Suppose -r = -3r - 26. Let b = r - -23. Suppose 10 = 4k - b. What are the prime factors of k? 5 Let h = -4 + 8. Let y(m) = m*2 + 6m + 7. Let q be y(-6). Let v = q + h. List the prime factors of v. 11 Let b(a) = -3a3 - 3a*2 + a + 4. Let d be b(-2). What are the prime factors of (0 - -2)/(2/d)? 2, 7 List the prime factors of (1 + -8)(-20)/14. 2, 5 Let n = -11 - -34. What are the prime factors of n? 23 Let a(o) = -2o. Let y be a(9). List the prime factors of 1 - (-1 + 3) - y. 17 Suppose -4c + q + 70 = 0, -3c + 2q = -2q - 46. List the prime factors of c. 2, 3 Let j be 2/8 - 38/(-8). Let y(v) = v3 - 4v*2 - 6v + 4. Let d be y(j). What are the prime factors of 7 - (-2 - (-1 + d))? 7 Let v(w) = -5w + 2. Let u be v(-2). Let g = u + -5. Let h = 4 + g. What are the prime factors of h? 11 Suppose -5x + 3u = -217, 2u + 2u = -5x + 189. List the prime factors of x. 41 Let g(f) = 4f2 + 2f. Let r(d) = -3d2 - 2d - 1. Let h(s) = -2g(s) - 3r(s). List the prime factors of h(-5). 2, 3 Suppose 0 = 3k + 2k. Suppose -7 - 8 = 5l. List the prime factors of k + 0 - (l - 2). 5 Let c(o) be the first derivative of -o3/3 + 4o*2 - 5o + 1. Let r be c(7). Suppose -rz + 4p - 5p = -22, 7 = -z - 5p. List the prime factors of z. 13 Let c(j) be the second derivative of -3j3/2 + j2/2 - 2j. Let y be c(1). Let f = 18 + y. What are the prime factors of f? 2, 5 Let y = 9 - 5. Let i = 6 - y. Suppose 0 = -4m + o + 70, 5m - 81 = -io + 13. List the prime factors of m. 2, 3 Let z(d) = d - 3 - 7 + 4 + 2d. List the prime factors of z(8). 2, 3 Suppose 5j - 29 = -2t + 183, -3j + 4t = -122. What are the prime factors of j? 2, 3, 7 Let s be (-238)/56 + (-2)/(-8). Let o(w) be the third derivative of -w4/12 - w3/2 - w*2. List the prime factors of o(s). 5 Let k(z) = -8z + 6. What are the prime factors of k(-1)? 2, 7 Suppose 11m - 6m - 60 = 0. List the prime factors of m. 2, 3 Suppose -c + 4t = -2, -3c + 34 = -0t + 2t. What are the prime factors of 15/(-6)-1c? 5 Let d(o) = o*3 + 7o*2 - o + 2. Suppose 4y + y - 35 = -5a, 5a = 25. Suppose -14 = -0c + yc. List the prime factors of d(c). 3 Let r(w) = w*2 + 3w - 7. Let a = -4 - 1. Let n be r(a). Suppose 6 = np - p. List the prime factors of p. 3 What are the prime factors of (8/(-3) - (-1)/(-3)) + 23? 2, 5 Let v = -6 + 0. Let t = v - -4. List the prime factors of (t1)/((-1)/2). 2 Suppose -2r = 2 - 12. Suppose -2t = -r - 5. Suppose -4 = x + 3g, -25 = -x - x + tg. List the prime factors of x. 5 Let w be 1 + (-12)/3 + 37. Let u = -16 + w. What are the prime factors of u? 2, 3 Let g(j) = -j. Let i(f) = -f*2 - 13f - 9. Let c(q) = -5g(q) + i(q). Let l = -4 + -2. List the prime factors of c(l). 3 Let p(j) = j3 + 4j*2 - 6j - 3. Let d be p(-5). Suppose 3q - 7 = dq. What are the prime factors of q? 7 Let o be 2/5 + 24/(-10). Let u be (-141)/(-27) + o/9. Suppose 0 = -2k - t + 23, -uk + 2t = -4k - 24. What are the prime factors of k? 2, 7 Suppose 10*j - 649 - 891 = 0. What are the prime factors of j? 2, 7, 11 Let t = 72 + 40. What are the prime factors of t? 2, 7 Let p be -1 - -3 - (-1 - -1). Let t(j) = -	{ "pile_set_name": "DM Mathematics" }
? 45185712 What is the least common multiple of 672 and 1152? 8064 What is the common denominator of 23/106353 and 71/4434102? 57643326 What is the lowest common multiple of 265086080 and 24851820? 795258240 Find the common denominator of -2/33183 and 37/2569839. 23128551 Calculate the least common multiple of 1536 and 840801. 430490112 What is the least common multiple of 70383 and 120541? 10487067 Calculate the common denominator of -67/2304010 and 41/13227728. 1124356880 Find the common denominator of 115/6 and 113/6801456. 6801456 What is the least common multiple of 24235463 and 76168598? 533180186 What is the common denominator of 27/253 and 18/2292065? 25212715 What is the least common multiple of 1440 and 1524556? 548840160 Calculate the common denominator of -91/562402 and -14/39339. 15184854 What is the common denominator of -97/168882 and -67/11564? 139496532 Calculate the smallest common multiple of 1706242 and 82. 69955922 What is the lowest common multiple of 98472 and 2511036? 5022072 Calculate the common denominator of 89/624285 and 139/1248570. 1248570 Find the common denominator of -58/4343457 and -35/47994. 8686914 Calculate the common denominator of -11/541470 and -4/8817. 1591380330 Calculate the common denominator of -55/13433 and 36/2062925. 14440475 Calculate the smallest common multiple of 1512 and 5741280. 40188960 What is the common denominator of -76/23844729 and -36/45907? 691497141 Find the common denominator of 73/52148430 and -101/156445290. 156445290 Calculate the common denominator of 65/4734 and 25/169372. 1524348 Find the common denominator of 51/557579 and 8/4207187. 46279057 What is the common denominator of 61/90 and -73/95488785? 190977570 What is the lowest common multiple of 90788490 and 1073150? 453942450 What is the common denominator of -91/12452 and -49/71558248? 787140728 Find the common denominator of 47/561786 and 85/5154. 561786 Calculate the common denominator of 47/42160 and -42/8215. 2234480 Calculate the common denominator of 77/6285 and -44/83442593. 1251638895 What is the lowest common multiple of 13788042 and 132? 303336924 What is the lowest common multiple of 8 and 6771267? 54170136 What is the least common multiple of 37314 and 27037448? 730011096 Find the common denominator of 45/3982 and -39/36368692. 400055612 Find the common denominator of -31/44903000 and 91/4. 44903000 Calculate the lowest common multiple of 7 and 34326434. 240285038 What is the common denominator of -47/18 and 31/8122602? 24367806 Calculate the lowest common multiple of 1360 and 176858480. 176858480 Calculate the smallest common multiple of 63 and 23256. 162792 Find the common denominator of 16/150453663 and -67/6. 300907326 Calculate the lowest common multiple of 28859901 and 3980676. 115439604 What is the common denominator of 103/261434000 and -71/8? 261434000 What is the least common multiple of 58234648 and 859552? 232938592 Find the common denominator of -8/39 and -9/18200429. 54601287 What is the common denominator of -19/368 and 35/20029918? 160239344 Calculate the lowest common multiple of 73296 and 8251908. 99022896 Calculate the lowest common multiple of 811249 and 77791. 5678743 What is the least common multiple of 11301362 and 73458853? 146917706 Calculate the smallest common multiple of 1277244 and 54921492. 54921492 What is the common denominator of 25/10206 and 163/1547910? 4643730 Find the common denominator of -6/226469 and 121/48. 10870512 Find the common denominator of 1/3474 and -19/90131. 1622358 Calculate the common denominator of -121/14250 and -97/642882. 1526844750 Find the common denominator of -87/1581604 and 37/37334. 17397644 Calculate the lowest common multiple of 786287 and 234837. 686428551 Calculate the common denominator of -53/2838 and -31/48056. 68191464 Calculate the smallest common multiple of 27050 and 443620. 2218100 What is the smallest common multiple of 2972 and 8388? 6232284 Calculate the least common multiple of 230 and 6680143. 66801430 What is the smallest common multiple of 183 and 19845081? 1210549941 What is the lowest common multiple of 27153 and 8469? 25550973 Calculate the common denominator of -37/117626744 and -7/161736773. 1293894184 Find the common denominator of -73/2125000 and 16/11875. 40375000 What is the common denominator of 10 and 64/6550533? 6550533 What is the smallest common multiple of 11172 and 2857980? 140041020 Calculate the common denominator of -61/484 and -9/40473928. 445213208 What is the common denominator of 97/30384 and -151/36? 30384 Calculate the common denominator of 5/718147 and -9/55. 39498085 Calculate the common denominator of 113/36 and 63/10493348. 94440132 What is the least common multiple of 833625 and 76637925? 1149568875 Find the common denominator of 82/11512809 and -65/27. 34538427 Calculate the common denominator of -19/171972 and -47/14034. 402242508 Calculate the common denominator of -19/1155825 and 8/1133. 119049975 Calculate the common denominator of 29/26083155 and -19/945. 234748395 Calculate the least common multiple of 278308 and 1768274. 144998468 Calculate the smallest common multiple of 10 and 173627372. 868136860 Calculate the least common multiple of 924 and 38127705. 152510820 What is the least common multiple of 498054 and 747081? 1494162 Calculate the least common multiple of 62552209 and 515. 312761045 What is the common denominator of -71/18900 and -47/321300? 321300 What is the common denominator of -69/56438 and -1/39? 2201082 Find the common denominator of -89/5675480 and -123/246760. 5675480 Calculate the common denominator of -115/2936136 and -41/210. 14680680 What is the common denominator of 27/188917124 and -107/223265692? 2455922612 What is the smallest common multiple of 777329 and 104308? 276729124 Calculate the common denominator of 119/18980 and 5/3575832. 17879160 What is the common denominator of 31/1369 and 73/6372695? 6372695 What is the common denominator of 2/28311893 and -89/1432? 226495144 What is the smallest common multiple of 134571 and 589? 2556849 Calculate the common denominator of 67/2684 and -147/228140. 228140 What is the smallest common multiple of 14 and 26795636? 26795636 What is the least common multiple of 292188 and 522? 25420356 Find the common denominator of 101/69956446 and -101/126. 629608014 What is the least common multiple of 264180 and 6364? 11359740 Calculate the least common multiple of 3932 and 14576. 14328208 Calculate the common denominator of -16/35 and 67/317729475. 317729475 What is the lowest common multiple of 3467520 and 18576? 10402560 What is the common denominator of 77/47487904 and -23/52? 617342752 Calculate the smallest common multiple of 2746539 and 181890. 27465390 Calculate the smallest common multiple of 5085740 and 129177796. 645888980 Calculate the common denominator of 91/4727070 and -161/29730. 4727070 What is the common denominator of -33/1901660 and 143/2852490? 5704980 Calculate the common denominator of -97/10314 and -11/411024. 706550256 What is the smallest common multiple of 10607643 and 513? 31822929 What is the least common multiple of 77 and 625549045? 4378843315 Calculate the smallest common multiple of 11301620 and 220. 11301620 Find the common denominator of -109/16698 and 7/445038. 10235874 What is the common denominator of 17/797 and 52/51997? 41441609 Calculate the common denominator of 37/12790 and -40/4874269. 48742690 What is the smallest common multiple of 12653629 and 6? 75921774 Calculate the least common multiple of 51790 and 121140. 627384060 Calculate the lowest common multiple of 479440 and 3595800. 7191600 Calculate the lowest common multiple of 1416 and 41979444. 83958888 Find the common denominator of -11/12959726 and -75/15704. 51838904 Calculate the least common multiple of 1018600 and 56. 7130200 Calculate the common denominator of -47/4 and -41/4780264. 4780264 What is the least common multiple of 343 and 13602547? 95217829 Calculate the lowest common multiple of 221755 and 3985. 176738735 Calculate the common denominator of 29/87800 and 1/14100. 12379800 What is the smallest common multiple of 34721271 and 1872? 555540336 Calculate the least common multiple of 31853233 and 1. 31853233 Find the	{ "pile_set_name": "DM Mathematics" }
- 3p. Determine y(q(g)). 12g + 3 Let f(c) be the third derivative of -c5/60 - c2. Let x(l) be the third derivative of -l*4/12 - 2l*2. What is x(f(u))? 2u*2 Let h(z) = 9z. Let j(y) = -5y. Let k(a) = 3h(a) + 5j(a). Let m(p) = -42 - 34 - p + 76. Determine k(m(r)). -2r Let s(o) = 0 + 2o2 + 0. Let p(m) be the first derivative of -m5/24 - 7m*3/3 - 5. Let r(f) be the third derivative of p(f). Determine s(r(g)). 50g2 Let u(b) = -b2 + b - 1. Let n(v) = -v*2 + 6v - 6. Let i(z) = -n(z) + 6u(z). Let s(w) = 3w. Give i(s(x)). -45x2 Let y(h) = -h2 + 5h + 2. Let g be y(5). Let v(b) = -gb2 + 9 - 9. Let s(i) = -i2. Calculate s(v(j)). -4j*4 Let g(j) = -218j*2 - 1. Let w(d) = -79d. Calculate w(g(t)). 17222t2 + 79 Let d(s) be the first derivative of 1/3s*3 + 0s + 0s2 + 1. Let h(c) be the first derivative of -c3/3 + 21. Give h(d(z)). -z4 Let h(m) = -7m2. Let c(x) = -x2 - 166 + 166. What is h(c(g))? -7g4 Let i(z) be the first derivative of z3/3 + 39. Let g(f) = 2f. Give g(i(r)). 2r2 Let k(t) = 14t + 2. Let j(n) = 10n2. Calculate k(j(y)). 140y*2 + 2 Let i(t) = -120t*2 + 36. Let h(c) = -17c*2 + 5. Let a(y) = 36h(y) - 5i(y). Let m(w) = -8w. Give m(a(f)). 96f2 Let i(u) = -u - 2. Let k be i(-9). Let n(w) = -kw + 4w + w. Let p(q) = 6q*2 - 5q - 5. Let f(v) = v*2 - v - 1. Let s(m) = 5f(m) - p(m). What is s(n(d))? -4d2 Let i(z) be the third derivative of 1/24z4 - z2 + 0 + 0z + 0z*3. Let a(x) = -2x. Determine a(i(m)). -2m Let i(a) = -a + 13. Let f be i(8). Let t(q) = q2 + 4q*2 - fq*2 - 2q2. Let y(j) = -j2. Calculate y(t(c)). -4c4 Let n(i) = -2i*2. Let g(h) = -24h*2. Calculate g(n(v)). -96v*4 Let y(l) = -5l. Let m(f) be the third derivative of f8/5040 - f5/15 - f*2. Let a(z) be the third derivative of m(z). What is y(a(i))? -20i2 Let n(r) be the first derivative of -r5/60 - r*3 + 4. Let m(l) be the third derivative of n(l). Let j(x) = -4x*2. Give m(j(a)). 8a*2 Let v(y) = 14y*2. Let j(f) = -4f + 16. What is j(v(a))? -56a2 + 16 Let i(k) = 3k + 6. Let y(x) = -3x + 5x + 0x. What is i(y(s))? 6s + 6 Let z(w) = -6w2. Let i(g) = g. Let a(x) = 3x. Let v(q) = -4a(q) + 10i(q). Determine v(z(r)). 12r2 Let f(c) = 80c*2 - 24c. Let g(d) = -16d2 + 5d. Let m(y) = 5f(y) + 24g(y). Let l(s) = -2s. Determine m(l(r)). 64r2 Let r(o) = -o. Let d(k) be the first derivative of -k6/72 - 4k3/3 + 1. Let j(h) be the third derivative of d(h). Determine j(r(y)). -5y*2 Let t(q) = 8q*2. Suppose 53a = 45a. Let g(k) be the second derivative of 0k*2 + 0 + 1/6k*4 - k + ak*3. What is g(t(w))? 128w4 Let x(s) = s2 + s2 - s2 + 3s2. Let u(c) be the second derivative of -c + 0c*2 - 1/6c*3 + 0. Give u(x(w)). -4w*2 Let w(u) = 6u. Let n(x) = 1135x2 + 2. What is w(n(a))? 6810a*2 + 12 Let w(t) = -2t. Let x(a) = 23 - 13 - 10 - 3a. Determine x(w(l)). 6l Let h(y) = 255y2. Let m(a) = -a. What is h(m(r))? 255r*2 Let w(d) = 2d*2. Let c(j) = 301j. Determine c(w(v)). 602v2 Let z(l) = -l. Let o(i) = -11415i*2. Determine o(z(u)). -11415u2 Let s(v) = v2. Let p(b) = b + 1. Let d(z) = -10z2 + 20z + 20. Let i(k) = d(k) - 20p(k). Determine i(s(m)). -10m4 Let w(d) be the third derivative of d4/12 + 16d2. Let g(z) = -4z. Calculate w(g(f)). -8f Suppose 5q - 3y = -6y + 36, 0 = 5q - 4y - 57. Let s(z) = -2z - 8z + qz. Let o(f) = -f + 5. Let k(p) = 1. Let c(t) = 5k(t) - o(t). Determine c(s(r)). -r Let j(b) = -9b. Let n(i) = 326i*2. Give n(j(q)). 26406q*2 Let v(u) = 0u2 + u2 - 3u2 - 5 + 3u*2. Let q(h) = 4h*2 - 16. Let j(m) = -5q(m) + 16v(m). Let a(g) = g. What is j(a(f))? -4f*2 Let r(m) = 1. Let w(c) = -c + 1. Let k(n) = r(n) - w(n). Let a(z) = -66 + 66 + 5z*2. What is a(k(v))? 5v2 Let w(x) be the second derivative of x4/12 - x*3/2 - 3x*2/2 + x. Let f(d) = -d - 1. Let p(b) = 15f(b) - 5w(b). Let m(r) = -3r. Determine m(p(q)). 15q2 Let n(d) = -15d. Let c(q) = 17q2 - 13q - 13. Let b(y) = 8y2 - 6y - 6. Let m(f) = 13b(f) - 6c(f). Give m(n(r)). 450r2 Let v(r) = -r. Let w(d) be the second derivative of d3/6 - 7d. Give v(w(t)). -t Let f(j) = 4j2. Let o(n) be the first derivative of 0n*2 - 1 - 2n2 + n2. Calculate f(o(i)). 16i2 Let u(m) = 0 + 0 + m. Let v(b) be the third derivative of -b5/20 + 3b*2. Give u(v(s)). -3s*2 Let p(d) = -2d*2. Let k(v) = -494v*2. Calculate k(p(b)). -1976b4 Let t(h) be the second derivative of h4/3 - 22h. Let x(s) = -s - 2s + s. Determine x(t(j)). -8j2 Suppose -3n = -2z - 9, -12 = -4n - 3z + 4z. Let t(g) be the first derivative of 2/3gn + 0g + 0g2 + 1. Let q(r) = -2r*2. What is q(t(s))? -8s*4 Let p(w) = 4w*2 - 4w + 4w. Let a(s) = -s. What is a(p(i))? -4i*2 Let f(v) = -3v*2. Let g(x) = -53x*2 + 35x*2 + 31x*2. Calculate g(f(m)). 117m*4 Let v(t) = -362t + 0 + 372t + 0. Let c(b) = b2. Determine c(v(f)). 100f*2 Let k(g) = -41g*2 - g. Let o(v) = -12v*2. Give k(o(f)). -5904f*4 + 12f*2 Let u(w) = -4w + 4. Let a(c) = -c*2 + 9c - 9. Let i(v) = -4a(v) - 9u(v). Let k(x) = 5x2 + 2x*2 - 4x*2. Calculate i(k(z)). 36z*4 Let b(o) = o. Let v(j) = 9j*2 + 10j. Let u(c) = -c*2 - 2c. Let w(z) = 5u(z) + v(z). Determine b(w(a)). 4a*2 Let b(c) = -5c + 4c + 2c. Let u(s) = 83s. Give u(b(k)). 83k Let v(u) = -2u - 29. Let f(r) = -16r*2. What is v(f(m))? 32m2 - 29 Let w(c) = c. Let d(l) = -l2 + 6l + 1. Let q(j) = d(j) - 6w(j). Let v(b) be the first derivative of q(b). Let p(n) = n + 614 - 614. Calculate p(v(i)). -2i Let j = -4 + 6. Let u(b) = -2b*2 - jb*2 + 2b2 - b2. Let x(g) be the third derivative of -g4/24 - g2. What is x(u(w))? 3w2 Let v(j) = -28j*2 + 2j. Let y(n) = -5n. What is y(v(c))? 140c*2 - 10c Let u(z) = -3z2. Let g(y) = -4y*2 + 14. Give u(g(t)). -48t*4 + 336t*2 - 588 Let m(i) = 525i*2. Let p(l) = -2l. Determine m(p(j)). 2100j2 Let k(w) = -w2. Let c(u) = u + 6. Let v(j) be the second derivative of j2/2 + j. Let z(a) = -c(a) + 6v(a). Determine k(z(t)). -t*2 Let w(s) = s. Let o(r) = 63r + 5. Let z(x) = 1102x + 87. Let c(b) = 87o(b) - 5z(b). Calculate c(w(n)). -29n Let b(z) = -3z2 + 3z - 3. Suppose -20 = 7t - 2t. Let x(v) = -2 - 4 + 4v + 2 - 3v*2. Let n(u) = tb(u) + 3x(u). Let h(r) = -2r*2. Determine n(h(s)). 12s*4 Let s(z) = 9z. Let i(u) = 236u. What is i(s(y))? 2124y Let m(k) = -2676k2. Let f(v) = -2v. Calculate f(m(p)). 5352p2 Let v(s) = s2. Let l(d) = -3686d. Determine v(l(f)). 13586596f2 Let a(q) = -q2. Let g(z) = 340z. Calculate a(g(k)). -115600k2 Let x(g) be the first derivative of 156g*2 - 32g - 2. Let q(w) = 48w - 5. Let m(v) = -32q(v) + 5x(v). Let d(r) = r. Determine d(m(k)). 24k Let t(c) = -c. Let z(f) = -f. Let i(u) = -5t(u) + 4z(u). Let x(p) = -23p2. Determine i(x(r)). -23r*2 Let b(y) be the first derivative of 22y*2 - 4. Let v(p) = 9p. Let t(u) = -5b(u) + 24v(u). Let n(a) = -2a. Calculate n(t(j)). 8j Let g(r) = 11r2 + 2r*2 + 3r*2 - 4r*2. Let o(p) = -3p*2 + 3p*2 - 2p*2. Give g(o(s)). 48s*4 Suppose 35 = 4r + 175. Let u be (-1)/((-2)/4 + 0). Let f(j) = -120j - 35. Let w(l) = -7l - 2. Let i(d) = rw(d) + uf(d). Let k(g) = 2g. Calculate k(i(s)). 10s Let y(k) = k + 70. Let j(r) = 10r. Determine y(j(g)). 10g + 70 Let p(o) = 117o. Let b(t) = -7t*2. Give b(p(y)). -95823y*2 Let t(s) = -1 - s + 1. Let o(p) be the second derivative of p + 0p*2 - 1/3p*3 + 0. Determine o(t(x)). 2x Let q(z) = z. Let f(m) = 1187m + 1. Determine q(f(b)). 1187b + 1 Let j(a) = -6912a. Let r(d) = -2d*2. Determine r(j(h)). -95551488h*2 Let t(y) = 6y. Let n(i) = 26i2. What is t(n(c))? 156c*2 Let f(j) = 2j. Let c(t) = -7t2. Give c(f(r)). -28r*2 Let o(s) = 2s. Let h(g) be the first derivative of 0g + 3/2g*2 - 1. Give h(o(f)). 6f Let b(j) = 3j2 + 2. Let t = 9 - 16. Let p(k) = 10k*2 + 7. Let m(o) = tb(o) + 2p(o). Let a(h) = 3h - 4h - h. Give m(a(i)). -4i*2 Let x(j) = 7j + 11. Let o = 4 + -15. Let m(q) = -4q - 6. Let k(l) = om(l) - 6x(l). Let r(s) = -4s**2. What is k(r(i	{ "pile_set_name": "DM Mathematics" }
847 and 284977. 3134747 Find the common denominator of -53/168 and 83/756. 1512 Calculate the least common multiple of 35 and 106585. 746095 Calculate the common denominator of -79/567 and -143/2268. 2268 What is the smallest common multiple of 66 and 1000032? 1000032 Find the common denominator of -139/18096 and -1/5278. 126672 What is the common denominator of 39/4265 and 28/3? 12795 Find the common denominator of -27/2996 and 111/10486. 20972 What is the smallest common multiple of 40 and 17375? 139000 What is the common denominator of -83/12 and -101/127696? 383088 Calculate the smallest common multiple of 417 and 834. 834 Calculate the common denominator of -54/3619 and 54/329. 3619 What is the lowest common multiple of 61659 and 459? 184977 Find the common denominator of 40/4011 and -55/51. 68187 Calculate the common denominator of -79/28380 and 81/836. 539220 Find the common denominator of 95/3346 and 95/3346. 3346 What is the common denominator of -93/292006 and 8/33? 876018 Calculate the smallest common multiple of 342 and 3024. 57456 Calculate the least common multiple of 204 and 3564. 60588 What is the smallest common multiple of 30 and 1209756? 6048780 Calculate the common denominator of -35/4896 and -41/2295. 73440 What is the least common multiple of 8022 and 354? 473298 What is the lowest common multiple of 844 and 86? 36292 What is the common denominator of 57/176 and -5/20944? 20944 What is the common denominator of 127/342 and 13/184072? 1656648 What is the smallest common multiple of 16 and 581318? 4650544 Find the common denominator of -31/1602 and -23/16020. 16020 Calculate the least common multiple of 3248 and 370. 600880 Calculate the common denominator of -85/1434 and -99/136. 97512 Calculate the lowest common multiple of 260688 and 12. 260688 Find the common denominator of -65/8 and -31/73316. 146632 Calculate the lowest common multiple of 7191 and 423. 7191 Calculate the least common multiple of 4410 and 5. 4410 Find the common denominator of 48/12869 and -67/19682. 334594 Find the common denominator of -7/1595 and -3/4814. 264770 What is the common denominator of -23/6720 and -23/240? 6720 What is the smallest common multiple of 1870 and 638? 54230 What is the common denominator of -19/20428 and 89/168? 857976 Calculate the common denominator of -79/1119498 and 44/21. 7836486 Find the common denominator of 143/1264662 and -151/1987326. 13911282 What is the least common multiple of 762 and 102? 12954 What is the smallest common multiple of 5928 and 572? 65208 What is the smallest common multiple of 336 and 17682? 141456 What is the common denominator of -79/19238 and 63/2? 19238 What is the common denominator of 93/4 and -28/1255507? 5022028 What is the common denominator of -91/144 and 107/180? 720 What is the least common multiple of 1360 and 320? 5440 What is the lowest common multiple of 455690 and 91138? 455690 Calculate the common denominator of 121/6858 and 37/73152. 219456 What is the least common multiple of 1020 and 221? 13260 Calculate the lowest common multiple of 55152 and 63. 386064 Calculate the smallest common multiple of 57846 and 10. 289230 Calculate the common denominator of -81/460 and 193/52800. 1214400 What is the smallest common multiple of 101500 and 45500? 1319500 Find the common denominator of 47/215688 and 61/19608. 215688 Calculate the smallest common multiple of 12908 and 384. 1239168 What is the least common multiple of 2070 and 18? 2070 What is the lowest common multiple of 2034 and 143736? 431208 Find the common denominator of 73/33 and -19/8757. 96327 What is the common denominator of 5/2108591 and 37/3? 6325773 Calculate the smallest common multiple of 189 and 7308. 21924 Find the common denominator of 91/1744 and -83/68. 29648 Calculate the common denominator of -89/14274 and 41/216. 171288 What is the common denominator of 3/3592 and 33/56? 25144 What is the common denominator of 89/688260 and -47/84? 4817820 What is the common denominator of -36/431 and 2/11621? 5008651 What is the least common multiple of 12272 and 248? 380432 Calculate the smallest common multiple of 66852 and 2. 66852 Calculate the least common multiple of 4 and 2892139. 11568556 What is the lowest common multiple of 45936 and 5104? 45936 Find the common denominator of -51/1078 and -69/25676. 282436 Calculate the least common multiple of 14751 and 1827. 2994453 Calculate the lowest common multiple of 347355 and 5976. 2778840 Calculate the common denominator of 34/10685 and 31/85480. 85480 Find the common denominator of 37/162512 and 55/487536. 487536 Calculate the least common multiple of 54635 and 1338. 327810 Calculate the common denominator of -125/528 and 131/6600. 13200 What is the lowest common multiple of 4356 and 2088? 252648 Calculate the lowest common multiple of 81432 and 1044. 81432 Calculate the smallest common multiple of 17370 and 5018. 225810 Calculate the lowest common multiple of 734720 and 19680. 2204160 Find the common denominator of -101/888 and 29/11100. 22200 Calculate the common denominator of 79/45 and -2/13805. 124245 Calculate the least common multiple of 90 and 966. 14490 Find the common denominator of -43/6 and 119/1624040. 4872120 Calculate the least common multiple of 30 and 81340. 244020 What is the common denominator of -179/1848 and 1/2268? 49896 Calculate the smallest common multiple of 106008 and 10096. 212016 What is the common denominator of -59/64 and -25/101664? 203328 Find the common denominator of 161/66 and 13/118878. 1307658 Find the common denominator of 83/6680 and -58/69. 460920 Calculate the common denominator of -25/1064 and 33/75278. 301112 Find the common denominator of -20/113343 and -49/3. 113343 Calculate the lowest common multiple of 41240 and 56705. 453640 What is the common denominator of -113/2800 and 106/105? 8400 What is the common denominator of 53/181357 and -47/16487? 181357 What is the least common multiple of 6 and 1473879? 2947758 What is the common denominator of 169/30600 and 137/459000? 459000 Calculate the common denominator of 17/1722 and -91/246. 1722 What is the common denominator of 63/20 and -3/388? 1940 What is the lowest common multiple of 108 and 917? 99036 Calculate the least common multiple of 15660 and 6264. 31320 What is the common denominator of 31/213890 and -179/6570? 1925010 What is the least common multiple of 62696 and 47022? 188088 What is the common denominator of -65/2446 and 17/310? 379130 Find the common denominator of -67/28222 and -7/7398. 761994 What is the smallest common multiple of 36516 and 17184? 292128 Calculate the least common multiple of 1350 and 1728. 43200 Calculate the common denominator of -51/318796 and 67/2. 318796 Calculate the least common multiple of 93 and 77748. 77748 What is the common denominator of 167/132360 and -115/52944? 264720 Calculate the smallest common multiple of 2 and 781040. 781040 Calculate the least common multiple of 63260 and 11. 695860 Calculate the common denominator of -85/84 and 95/458136. 458136 What is the least common multiple of 160512 and 1482? 2086656 What is the common denominator of -87/46102 and -19/18? 414918 Calculate the lowest common multiple of 27 and 79875. 239625 What is the least common multiple of 122 and 6466? 6466 What is the lowest common multiple of 67536 and 1? 67536 Calculate the least common multiple of 17376 and 420. 608160 Calculate the lowest common multiple of 24013 and 370. 240130 Calculate the lowest common multiple of 10 and 65275. 130550 What is the common denominator of -5/21991 and -47/7? 153937 Calculate the smallest common multiple of 15204 and 12670. 76020 What is the least common multiple of 552 and 1794? 7176 Calculate the lowest common multiple of 387 and 21070. 189630 Calculate the common denominator of 107/7960 and -53/256. 254720 Calculate the lowest common multiple of 1925 and 63000. 693000 Calculate the common denominator of -1/183 and -2/1113. 67893 What is the smallest common multiple of 3350 and 36180? 180900 Calculate the common denominator of -37/1392 and -97/73602. 588816 Find the common denominator of -181/300 and -71/3900. 3900 Calculate the common denominator of 47/7300 and 7/276. 503700 Find the common denominator	{ "pile_set_name": "DM Mathematics" }
the common denominator of 19/112 and 1/206. 11536 Calculate the lowest common multiple of 166518 and 5. 832590 What is the lowest common multiple of 165 and 132? 660 Find the common denominator of -109/15435 and 16. 15435 Calculate the lowest common multiple of 4761 and 1587. 4761 What is the smallest common multiple of 729342 and 450? 18233550 What is the smallest common multiple of 127008 and 28512? 1397088 Find the common denominator of -101/695884 and 99/40. 6958840 Find the common denominator of -61/26 and 87/27718. 360334 What is the common denominator of -45/328 and -87/19516? 39032 Calculate the common denominator of 79/262710 and -119/540. 525420 What is the lowest common multiple of 1914960 and 24? 1914960 What is the least common multiple of 48 and 16869? 269904 Find the common denominator of -11/1460 and 83/292. 1460 Calculate the lowest common multiple of 1848 and 142296. 142296 Calculate the lowest common multiple of 20 and 26236696. 131183480 What is the common denominator of 83/2 and 23/133346? 133346 Calculate the common denominator of 55/12 and -29/576153. 2304612 What is the least common multiple of 291720 and 1989? 875160 What is the common denominator of -83/588 and -23/882? 1764 Calculate the common denominator of 33/108500 and 69/22. 1193500 What is the smallest common multiple of 171 and 374544? 7116336 What is the common denominator of -113/9366 and 121/846? 1320606 What is the least common multiple of 15330 and 1785? 260610 Calculate the common denominator of 131/12 and -55/61236. 61236 Calculate the lowest common multiple of 272 and 384880. 384880 Calculate the smallest common multiple of 6344 and 1040. 63440 Calculate the common denominator of -25/6 and -95/119556. 119556 Calculate the common denominator of -53/6981 and 41/81445. 244335 Find the common denominator of -38/971025 and 37/349569. 8739225 Find the common denominator of -49/516 and 75/64. 8256 What is the least common multiple of 8360 and 4180? 8360 What is the smallest common multiple of 14 and 34846? 34846 What is the least common multiple of 155214 and 25869? 155214 Calculate the common denominator of 97/372294 and -35/330928. 2978352 What is the least common multiple of 6 and 725478? 725478 Calculate the least common multiple of 82 and 227222. 227222 Calculate the lowest common multiple of 132 and 92103. 368412 Find the common denominator of 103/5634 and -121/7512. 22536 What is the common denominator of -121/100 and 3/8950? 17900 Calculate the common denominator of -83/15057 and 2/63. 15057 Calculate the common denominator of 19/40 and 101/269120. 269120 What is the smallest common multiple of 26 and 7586? 98618 Find the common denominator of -37/16688 and -31/56. 16688 Find the common denominator of 133/18 and -143/153396. 153396 Calculate the smallest common multiple of 50056 and 275308. 550616 What is the least common multiple of 39 and 66090? 859170 What is the lowest common multiple of 2033 and 5? 10165 What is the common denominator of 4/4527 and 74/27? 13581 Find the common denominator of -62/18285 and -123/20. 73140 Calculate the lowest common multiple of 41261 and 10527. 3589707 Calculate the least common multiple of 20 and 1672700. 1672700 What is the common denominator of 145/2814 and -67/198? 92862 Find the common denominator of 97/396 and 115/2568. 84744 Find the common denominator of -19/132 and 8/33231. 132924 What is the common denominator of -77/244 and 17/373564? 373564 Calculate the smallest common multiple of 6360 and 256. 203520 Calculate the common denominator of -19/28912 and -55/28912. 28912 Find the common denominator of 57/8 and -67/254936. 254936 Calculate the least common multiple of 8335 and 220. 366740 Calculate the common denominator of -45/88 and -101/169120. 1860320 What is the common denominator of 83/148382 and -89/2? 148382 Find the common denominator of -25/1581088 and -61/395272. 1581088 Find the common denominator of 11/50778 and -94/42315. 253890 What is the common denominator of 20/937 and 26/205? 192085 What is the smallest common multiple of 20770 and 775? 103850 What is the smallest common multiple of 7055 and 11985? 994755 What is the lowest common multiple of 5994 and 1036? 83916 What is the lowest common multiple of 747 and 14148? 1174284 Find the common denominator of -89/58784 and -5/4676. 411488 Calculate the common denominator of 111/130 and 63/358. 23270 Calculate the common denominator of 87/98294 and 45/106967. 3636878 Calculate the least common multiple of 39188 and 203. 7955164 Calculate the common denominator of 107/204 and -7/1320. 22440 What is the least common multiple of 66 and 24420? 24420 What is the common denominator of 33/556 and 81/4996? 694444 What is the least common multiple of 344354 and 1033062? 1033062 Find the common denominator of -91/161682 and -17/4. 323364 Calculate the lowest common multiple of 20566 and 565. 102830 Find the common denominator of 101/1078 and -163/151410. 1665510 Calculate the common denominator of -23/1833 and 71/78819. 78819 Calculate the common denominator of -157/30 and 11/49295. 295770 What is the smallest common multiple of 52060 and 21920? 416480 Calculate the lowest common multiple of 15 and 928038. 4640190 Find the common denominator of 79/243992 and 57/196. 1707944 What is the common denominator of -41/594 and 127/45252? 497772 Find the common denominator of -143/239604 and 5/12. 239604 Find the common denominator of -79/734994 and 26/33. 8084934 What is the smallest common multiple of 188 and 132? 6204 Calculate the common denominator of -32/19 and 113/20710. 20710 Calculate the smallest common multiple of 5721 and 320376. 320376 What is the common denominator of 41/1029 and 43/4347? 213003 What is the lowest common multiple of 11432 and 1170? 6687720 Calculate the smallest common multiple of 2535 and 234. 15210 Calculate the common denominator of -81/22715 and 19/7139. 249865 Calculate the least common multiple of 7100 and 28. 49700 What is the common denominator of -9/4280 and 73/1605? 12840 What is the smallest common multiple of 99465 and 390? 2586090 What is the smallest common multiple of 576 and 64? 576 Calculate the common denominator of 46/203135 and -43/35. 1421945 What is the lowest common multiple of 29718 and 180? 297180 Find the common denominator of -97/56160 and 59/8640. 112320 What is the common denominator of 19/17563 and -20/82797? 579579 Calculate the least common multiple of 9 and 223392. 670176 Calculate the smallest common multiple of 349440 and 384384. 3843840 Find the common denominator of 29/12717 and -119/6. 25434 Find the common denominator of -47/2001 and 28/18009. 18009 Calculate the common denominator of 63/4 and -23/1756712. 1756712 What is the common denominator of 119/66 and 83/72? 792 Calculate the common denominator of -1/117 and 7/5192. 607464 Calculate the lowest common multiple of 886298 and 1392754. 9749278 What is the common denominator of 119/22026 and 38/11? 242286 What is the lowest common multiple of 54225 and 105? 379575 Calculate the common denominator of 49/44424 and -91/32. 177696 Calculate the common denominator of 33/1118 and 97/148. 82732 Calculate the least common multiple of 35739 and 684. 142956 What is the smallest common multiple of 8298 and 468? 215748 What is the common denominator of -73/63756 and -65/13524? 446292 What is the least common multiple of 111834 and 99408? 894672 Calculate the lowest common multiple of 65442 and 327210. 327210 Find the common denominator of -19/2940 and 38/315. 8820 What is the common denominator of 43/139568 and -45/143? 139568 Calculate the lowest common multiple of 137925 and 250. 1379250 What is the common denominator of 1/148815 and 13/6614? 297630 What is the least common multiple of 172 and 1564? 67252 What is the smallest common multiple of 102562 and 8? 410248 What is the least common multiple of 44709 and 14903? 44709 Find the common denominator of -61/56685 and 25/41569. 623535 Calculate the common denominator of 43/160 and 89/42528. 212640 Calculate the lowest common multiple of 2352 and 198352. 595056 Find the common denominator of -38/273 and -107/990. 90090 What is the common denominator of -23/76608 and 61/10? 383040 What is the smalles	{ "pile_set_name": "DM Mathematics" }
100? -94n2 + 199n + 90 What is the b'th term of 10004859, 10004857, 10004855, 10004853, 10004851, 10004849? -2b + 10004861 What is the o'th term of -97994, -196426, -294858, -393290, -491722, -590154? -98432o + 438 What is the w'th term of 258265, 516551, 774861, 1033195? 12w2 + 258250w + 3 What is the b'th term of -155, -958, -2419, -4538, -7315? -329b2 + 184b - 10 What is the v'th term of 82044, 164492, 246940, 329388, 411836, 494284? 82448v - 404 What is the v'th term of 3505, 4481, 5467, 6463, 7469, 8485? 5v*2 + 961v + 2539 What is the j'th term of -764, -5478, -17740, -41156, -79332, -135874, -214388? -601j3 - 168j*2 - 3j + 8 What is the w'th term of -55865, -55884, -55915, -55958, -56013? -6w2 - w - 55858 What is the a'th term of -25383, -96892, -216077, -382938, -597475, -859688? -23838a*2 + 5a - 1550 What is the x'th term of 14429, 28747, 43065, 57383, 71701, 86019? 14318x + 111 What is the x'th term of -1026, -4366, -9906, -17628, -27514? 3x*3 - 1118x*2 - 7x + 96 What is the u'th term of 3103668, 6207336, 9311016, 12414714, 15518436? u*3 + 3103661u + 6 What is the y'th term of -5922, -5776, -5630, -5484, -5338? 146y - 6068 What is the w'th term of -848, -3730, -8556, -15326? -972w*2 + 34w + 90 What is the f'th term of 33925, 33929, 33933? 4f + 33921 What is the d'th term of -8703, -16986, -25259, -33522, -41775, -50018, -58251? 5d*2 - 8298d - 410 What is the i'th term of -11835, -11769, -11703, -11637, -11571? 66i - 11901 What is the r'th term of 48789, 48777, 48765, 48753, 48741? -12r + 48801 What is the n'th term of 1334229, 1333736, 1333241, 1332744, 1332245, 1331744? -n*2 - 490n + 1334720 What is the r'th term of 3067, 6277, 9487, 12697, 15907? 3210r - 143 What is the s'th term of 22047, 54984, 87921? 32937s - 10890 What is the p'th term of -423255, -423284, -423313, -423342, -423371, -423400? -29p - 423226 What is the t'th term of 9203, 9218, 9231, 9242, 9251, 9258? -t2 + 18t + 9186 What is the s'th term of -80907, -80731, -80555, -80379, -80203? 176s - 81083 What is the k'th term of -91195642, -182391287, -273586932? -91195645k + 3 What is the c'th term of 7603, 7639, 7713, 7837, 8023, 8283, 8629, 9073? 2c3 + 7c*2 + c + 7593 What is the a'th term of -85792376, -85792375, -85792374, -85792373, -85792372, -85792371? a - 85792377 What is the q'th term of 772935, 1545542, 2318149, 3090756, 3863363? 772607q + 328 What is the y'th term of -165462, -330939, -496440, -661977, -827562, -993207, -1158924? -2y3 - 165463y + 3 What is the c'th term of -1145196, -2290351, -3435506, -4580661, -5725816, -6870971? -1145155c - 41 What is the x'th term of 39745, 161416, 364209, 648130, 1013185, 1459380? x3 + 40555x*2 - x - 810 What is the o'th term of 1636, 13617, 46152, 109519, 213996, 369861, 587392? 1713o3 - o2 - 7o - 69 What is the j'th term of 4294, 18444, 42454, 76324, 120054, 173644, 237094? 4930j*2 - 640j + 4 What is the o'th term of -3067, -11830, -26273, -46390, -72175, -103622? o*3 - 2846o*2 - 232o + 10 What is the r'th term of -8806, -35214, -79228, -140842, -220050? r*3 - 8809r*2 + 12r - 10 What is the q'th term of -408039, -407975, -407911, -407847, -407783? 64q - 408103 What is the l'th term of -3549606, -7099208, -10648810? -3549602l - 4 What is the r'th term of -19699, -80803, -182643, -325219? -20368r2 + 669 What is the v'th term of -33635435, -67270857, -100906279, -134541701, -168177123? -33635422v - 13 What is the f'th term of 432, 1936, 4410, 7860, 12292, 17712, 24126, 31540? f*3 + 479f*2 + 60f - 108 What is the a'th term of 636, 2353, 5146, 9015, 13960, 19981, 27078? 538a2 + 103a - 5 What is the q'th term of -5472, -7854, -11830, -17406, -24588, -33382, -43794, -55830? -q*3 - 791q*2 - 2q - 4678 What is the l'th term of 349331, 1397322, 3143983, 5589320, 8733339, 12576046, 17117447, 22357548? l*3 + 349329l*2 - 3l + 4 What is the s'th term of -83261609, -83261612, -83261615, -83261618, -83261621, -83261624? -3s - 83261606 What is the x'th term of 779200816, 779200814, 779200812, 779200810, 779200808, 779200806? -2x + 779200818 What is the j'th term of -2257845, -4515748, -6773651, -9031554, -11289457, -13547360? -2257903j + 58 What is the a'th term of -1732, -5509, -11204, -18817, -28348? -959a*2 - 900a + 127 What is the c'th term of 58176, 117154, 176132, 235110? 58978c - 802 What is the d'th term of 12734, 52377, 118930, 212393, 332766? 13455d*2 - 722d + 1 What is the p'th term of -6164, -6314, -6462, -6608, -6752, -6894? p*2 - 153p - 6012 What is the f'th term of 2063, 16744, 56581, 134150, 262027, 452788? 2096f3 + 2f*2 + 3f - 38 What is the x'th term of -129, -370, -1029, -2316, -4441, -7614? -35x3 + x2 + x - 96 What is the v'th term of 95396, 190895, 286394, 381893, 477392, 572891? 95499v - 103 What is the f'th term of 32577, 67259, 101941, 136623? 34682f - 2105 What is the c'th term of -13039126, -26078259, -39117392, -52156525, -65195658? -13039133c + 7 What is the l'th term of -72264, -101469, -130674, -159879, -189084? -29205l - 43059 What is the o'th term of -300728612, -300728610, -300728608, -300728606? 2o - 300728614 What is the d'th term of -6634, -5926, -4734, -3058, -898, 1746? 242d2 - 18d - 6858 What is the d'th term of 14497, 13250, 11979, 10672, 9317? -2d3 - 1233d + 15732 What is the b'th term of 1217, 4932, 8647, 12362, 16077, 19792? 3715b - 2498 What is the n'th term of -8421, -17613, -26809, -36009, -45213, -54421, -63633? -2n*2 - 9186n + 767 What is the y'th term of 390684, 390519, 390242, 389853, 389352, 388739, 388014? -56y2 + 3y + 390737 What is the j'th term of 40124500, 160497987, 361120466, 641991937, 1003112400, 1444481855, 1966100302? 40124496j2 - j + 5 What is the j'th term of -7570559, -15141123, -22711687, -30282251, -37852815? -7570564j + 5 What is the j'th term of -5046, -2946, -854, 1230, 3306? -4j2 + 2112j - 7154 What is the v'th term of -66796, -69480, -72164? -2684v - 64112 What is the k'th term of -71612, -141337, -211074, -280829, -350608, -420417? -k3 - 69718k - 1893 What is the m'th term of 104621, 104652, 104683, 104714, 104745? 31m + 104590 What is the n'th term of -7428101, -7428116, -7428131, -7428146, -7428161, -7428176? -15n - 7428086 What is the a'th term of 2211, 5893, 11055, 17691, 25795, 35361, 46383? -a*3 + 746a*2 + 1451a + 15 What is the r'th term of 12427, 11832, 11237, 10642, 10047, 9452? -595r + 13022 What is the r'th term of 87359, 174723, 262087, 349451, 436815, 524179? 87364r - 5 What is the u'th term of 310026, 620247, 930468, 1240689? 310221u - 195 What is the r'th term of -32965, -65610, -98255, -130900, -163545? -32645r - 320 What is the r'th term of 318, 10574, 38158, 91734, 179966, 311518? 1444r3 + 148r - 1274 What is the c'th term of 63647639, 63647641, 63647643? 2c + 63647637 What is the q'th term of 9415145, 9415147, 9415149, 9415151, 9415153, 9415155? 2q + 9415143 What is the g'th term of 47086, 51121, 55154, 59185, 63214, 67241, 71266? -g*2 + 4038g + 43049 What is the x'th term of -56337889, -56337888, -56337887, -56337886, -56337885, -56337884? x - 56337890 What is the l'th term of -183658, -734623, -1652898, -2938483? -183655l2 - 3 What is the n'th term of -589, -1226, -2285, -3760, -5645, -7934, -10621, -13700? n3 - 217n*2 + 7n - 380 What is the l'th term of 879346, 879336, 879326? -10l + 879356 What is the d'th term of 9847352, 19694762, 29542230, 39389762, 49237364, 59085042? d3 + 23d*2 + 9847334d - 6 What is the r'th term of -74422, -74408, -74410, -74428? -8r2 + 38r - 74452 What is the o'th term of -28970222, -28970220, -28970218, -28970216, -28970214, -28970212? 2o - 28970224 What is the k'th term of 71265, 141272, 211281, 281292? k2 + 70004k + 1260 What is the a'th term of 6800, 9758, 12716, 15674, 18632? 2958a + 3842 What is the n'th term of -145924089, -291848179, -437772269? -145924090n + 1 What is the x'th term of -8792, -8747, -8696, -8639, -8576? 3x2 + 36x - 8831 What is the g'th term of 54623, 108328, 161113, 212978, 263923, 313948? -460g2 + 55085g - 2 What is the i'th term of 266676886, 266676884, 266676882, 266676880,	{ "pile_set_name": "DM Mathematics" }
s is divided by k? 12 Suppose -556 = 2n + 1810. Let y = -556 - n. What is the remainder when y is divided by 105? 102 Let o = -237670 - -237691. Let a = -441 - -619. Suppose a = 3p - 197. Calculate the remainder when p is divided by o. 20 Suppose 3l - 1 - 11 = 0. Let k(o) = 100o - 18. What is the remainder when k(l) is divided by 48? 46 Suppose 19 = m - z, -5 = z - 3. What is the remainder when m is divided by 155/31 + 14? 8 Let k(m) = -9m + 3. Let v be k(3). Let p(o) = -o*3 + 2o*2 - o - 5. Let l be p(3). Let y = l - v. What is the remainder when y is divided by 3? 1 Let t be (112/(-20))/(2/(-5)). Suppose 5j + 86 = 2c, 0j = -4c - 5j + 202. What is the remainder when c is divided by 8/t - 462/(-49)? 8 Suppose -105p + 29448 = -147792. What is the remainder when p is divided by 840? 8 Suppose 6x = 3x + 81. Let k(o) = -o3 + 37o*2 + 176o - 149. Calculate the remainder when x is divided by k(-5). 6 Suppose -o - 2s + 3 = 0, o - 9 = 2s - 2. Suppose ow - h = 788, -619 = -3w - w - 3h. Calculate the remainder when w is divided by 41. 34 Let k(g) = g + 51. Let n = -62 - -80. Calculate the remainder when k(0) is divided by (-3)/(((-1)/(-8))/(n/(-24))). 15 Suppose -5r + 746 = 726. Let u(x) be the second derivative of -x*4/6 + 3x3/2 - x2/2 - 2x. What is the remainder when 19 is divided by u(r)? 1 Let r(g) = -3g*3 + 21g*2 + 2g - 16. Let w be r(7). What is the remainder when 72 is divided by (4/(-12))/(((-4)/(-174))/w)? 14 Calculate the remainder when 0 + 263/3 + (-4)/(-12) is divided by 125 + (-22)/11. 19 Let i(r) = r2 + 20r - 34. Let c be i(-14). Let b = -114 - c. Suppose -bk + 318 = -2k. What is the remainder when k is divided by 40? 39 Let b(i) = i*3 - 22i*2 + 27i - 44. What is the remainder when 5980/39 - (-3)/(-9) is divided by b(21)? 71 Calculate the remainder when 1075 is divided by ((-6)/2)/((575/250)/(-23)). 25 Suppose 2c + 12 = -4m + 58, 5c - 155 = -2m. Calculate the remainder when 1616 is divided by c. 32 Let a(s) = -103s - 3481. What is the remainder when 18370 is divided by a(-34)? 16 Suppose -8m + 152 = 3m - 1025. What is the remainder when 125 is divided by m? 18 Let l = 19 + -14. Suppose 3z - 379 = lr, -z + 125 = -2r - 3. What is the remainder when z is divided by 24? 22 Suppose 13t + 8 = 21t. Calculate the remainder when (6/4)/t - (-1419)/6 is divided by 30. 28 Let s be -2 + (-3 + 4)-1. What is the remainder when (2/4)/(7/658) is divided by (s + 19/(-2))-2? 22 Let g = 39 + -21. Let a(m) = 7m - 28. Let h be a(g). Let u = 49 + h. What is the remainder when u is divided by 37? 36 Suppose -18u + 28 + 26 = 0. Suppose ui - 224 = -155. Calculate the remainder when i is divided by 8. 7 What is the remainder when 202 is divided by 5 + 88 + (64 - 77)? 42 Let r(g) = -g2 - 8g + 7. What is the remainder when (-208)/8-2 - -2 is divided by r(-7)? 12 Let k(t) = t3 + 32t*2 + 6t - 6. Let x be k(-31). Let l = -747 + x. Suppose 0 = 3n - 181 - 74. What is the remainder when n is divided by l? 19 Let o(n) = -748n - 1487. Suppose 5a + 415 = -2q, -3q + 332 = -4a - 0q. Let v = a - -152. What is the remainder when v is divided by o(-2)? 6 Suppose -30y + 2456 = 22y - 3160. What is the remainder when y is divided by 15? 3 Suppose 0 = -43x - 4x + 47. What is the remainder when 57 is divided by (2/(4/54))/x? 3 Suppose -3h + 26 = -5d, 31h = 32h + 3d - 4. Calculate the remainder when 162 is divided by h. 1 Let i be (-1)/8-90 + (-2)/8. Suppose -6o + 58 = 3h - io, 0 = 5h - o - 60. What is the remainder when 27 is divided by h? 5 Let p = -27803 + 27811. Let a(u) = u2 + 6u + 7. Let k be a(-6). Let t = 28 - k. What is the remainder when t is divided by p? 5 Suppose s - 7 = -4k + 11, 0 = 5k + 10. Let b = -90 - -93. Suppose -4z = -2v - 57 + 11, -bv - 24 = -z. What is the remainder when s is divided by z? 8 Let j(z) = 9z*2 - 22z + 5. Let t be j(3). Suppose 10x = -tx + 1290. What is the remainder when 257 is divided by x? 42 Let s be 1010 - ((-30)/(2 + 4) + 4). Suppose 59b + 8 = s. What is the remainder when 44 is divided by b? 10 Let i = 128 - 123. Suppose -2y - 4 = 0, -2y - 28 = -iv + 2y. What is the remainder when (-4)/6 - (177/(-9) - v) is divided by 7? 2 Let n = 758 - 760. Calculate the remainder when 155 is divided by (-103)/n + (-15)/(-30). 51 Suppose -3i + 2k = -5i + 2048, -5i + 5126 = -k. What is the remainder when i is divided by 18? 17 Let j be (-3)/2 + (-217)/14. What is the remainder when (j - -1413)2/8 is divided by 21? 13 Let g = 26 - 19. Suppose gf - 2x = 2f + 530, 2f = 2x + 212. What is the remainder when f is divided by 2/((-55)/30 + 2)? 10 Suppose -9h + 40 = -41. Suppose 7d - hd = 50. Let y = d + 67. What is the remainder when 165 is divided by y? 39 Suppose 62366 - 51918 = 666a - 139402. What is the remainder when a is divided by 68? 21 Suppose p - 697 = 6x - 2x, 0 = -4x + 4p - 712. Let g = x - -193. What is the remainder when g is divided by 8? 4 Let r(d) = -6d*2 + 424d - 1055. Suppose -k + 5v = v - 22, 0 = 2v - 10. Suppose k = 4i - 34. Calculate the remainder when r(68) is divided by i. 14 Let b = 4522 + -3859. Calculate the remainder when b is divided by 29. 25 Suppose 27 = 6f + 3s, 5f - 4s = 7 + 35. Calculate the remainder when 400 is divided by f. 4 Suppose -247 = -23l + 29. Calculate the remainder when 16/l426/4 is divided by 21. 16 Let x(v) = 2v3 - v3 + 1 - 2v3 + 7v*2 - 4v - 3v. Calculate the remainder when (-6)/(-2) - (-100)/(24/6) is divided by x(3). 12 Let k = -3265 - -3664. What is the remainder when k is divided by 78? 9 Suppose 7n + 203n = 73290. Calculate the remainder when n is divided by 11. 8 Suppose -9c + 65 + 34 = 0. Let y = -247 + 317. Calculate the remainder when y is divided by c. 4 Let m be 70/4(-24)/(-30). Let j = -4 + m. Suppose 9920x - 324 = 9908x. What is the remainder when x is divided by j? 7 Let h be 131 + (1 - (0 - 2))-1. Suppose -40 = 2l - h. Suppose 0 = -37q + 41q - 688. What is the remainder when q is divided by l? 40 Suppose 133v - 120v = 28756. Calculate the remainder when v is divided by 6. 4 Suppose -3n + 1304 - 35 = 24n. What is the remainder when 769 is divided by n? 17 Suppose 140 = 5u - 3n, -5u - 5n + 84 = -2u. Let b = -3292 - -3515. What is the remainder when b is divided by u? 27 Suppose 0 = -2t - 0t + 156. Suppose -213r + 16r + 5319 = 0. What is the remainder when t is divided by r? 24 Suppose 20 = -4h + 52. Suppose -q + hq + 700 = 0. What is the remainder when q3/(-6) - -4 is divided by 14? 12 Let n = -28531 + 28545. Calculate the remainder when 23910 is divided by n. 12 Suppose -3u + 82 = u + 3b, -5b + 78 = 4u. Suppose 16060 + 64439 + 37995 = 454v. Calculate the remainder when v is divided by u. 19 Let v = 511 + -772. Let i = v - -394. Suppose -2b = 3c - 137, 2c + c = -b + i. Calculate the remainder when 169 is divided by c. 40 Suppose -7w + w = -18. Let n(u) = 5u - 8u*2 - 2u*w + 4 - 2u*3 + 6u*3. What is the remainder when n(5) is divided by 41? 38 Suppose -4q = -15q + 861 + 448. What is the remainder when 6306 is divided by q? 118 Let c(p) = -605p - 319. What is the remainder when c(-1) is divided by 41? 40 Let w be (-2)/10 - (845/25 - -2). Let g = w - -4. Let c = g - -54. Calculate the remainder when 65 is divided by c. 21 Let h(y) = -5744y + 203. What is the remainder when h(-1) is divided by 50? 47 Let p(x) = x2 + 76x + 924. Calculate the remainder when 1168 is divided by p(-61). 7 Suppose -676q - 23868 = -728q. What is the remainder when q is divided by 6? 3 Let a = 86 - 66. Suppose -3n + 12 = -0n, 4c + 3n = 24. Calculate the remainder when -572/(-5 + c) is divided by a. 17 Suppose 6g - 1533 + 399 = -48g. Calculate the remainder when 4702 is divided by g. 19 Suppose -2h - 39 = -195. Suppose -13v - 874 = -51v. What is the remainder when h is divided by v? 9 Let d(f) be the third derivative of f6/120 - f5/20 - f4/12 - f2 - 5. Let g(l) = -l + 22. What is the remainder when g(-7) is divided by d(4)? 5 Let o = 58 - 93. Let r = o + 64. What is the remainder when r is divided by 17? 12 Let b(i) = -i*3 + 67i*2 - 193i + 90. Suppose 2*w = -w + 465. What is the remainder when w is divided	{ "pile_set_name": "DM Mathematics" }
without replacement from {c: 5, s: 1, p: 2, q: 3, b: 1}. 5/44 Two letters picked without replacement from spfru. What is prob of sequence ff? 0 What is prob of sequence ix when two letters picked without replacement from xjiaaiy? 1/21 Three letters picked without replacement from {j: 2, t: 2, a: 1}. What is prob of sequence ttj? 1/15 What is prob of sequence mi when two letters picked without replacement from {l: 5, m: 8, i: 2}? 8/105 Three letters picked without replacement from jlxjcqqlljjh. What is prob of sequence jql? 1/55 Calculate prob of sequence kigi when four letters picked without replacement from {x: 6, i: 3, g: 3, k: 6}. 1/680 Calculate prob of sequence ch when two letters picked without replacement from kkcyyekhhvyhckkkk. 3/136 Three letters picked without replacement from ddhbwehdbnwwddbwdn. Give prob of sequence ehw. 1/612 Two letters picked without replacement from hdehhehg. What is prob of sequence gd? 1/56 Two letters picked without replacement from kkkpbii. What is prob of sequence ki? 1/7 Calculate prob of sequence aal when three letters picked without replacement from laaaalal. 5/28 Four letters picked without replacement from {r: 4, i: 1, l: 3}. What is prob of sequence lllr? 1/70 What is prob of sequence nbk when three letters picked without replacement from ybxbbnkbbbxxb? 7/1716 What is prob of sequence ii when two letters picked without replacement from iwiai? 3/10 Three letters picked without replacement from eveeeveeevv. Give prob of sequence evv. 14/165 Two letters picked without replacement from ftvtttfttytzofyytt. What is prob of sequence ft? 3/34 Three letters picked without replacement from pmmppmppmpppppppmp. What is prob of sequence mmm? 5/408 Three letters picked without replacement from {i: 7, c: 1}. Give prob of sequence cii. 1/8 What is prob of sequence dw when two letters picked without replacement from dwwzddvtddtddddd? 1/12 What is prob of sequence yyh when three letters picked without replacement from {y: 1, h: 3}? 0 Four letters picked without replacement from {h: 3, l: 5, p: 1}. Give prob of sequence hplh. 5/504 What is prob of sequence tg when two letters picked without replacement from tgxtx? 1/10 Calculate prob of sequence ww when two letters picked without replacement from {a: 4, f: 3, w: 11}. 55/153 Calculate prob of sequence xbsb when four letters picked without replacement from xxxsxbssxxsssssbsss. 11/7752 Four letters picked without replacement from {v: 1, r: 3, k: 2, i: 1, u: 3, m: 2}. What is prob of sequence rmik? 1/990 What is prob of sequence tj when two letters picked without replacement from ttjt? 1/4 What is prob of sequence vvl when three letters picked without replacement from {l: 8, v: 2}? 1/45 Three letters picked without replacement from ccxoxcxoxhcooxo. Give prob of sequence oxx. 10/273 Four letters picked without replacement from zzuzoobuooooz. Give prob of sequence uozb. 2/715 Four letters picked without replacement from {c: 5}. What is prob of sequence cccc? 1 Calculate prob of sequence nm when two letters picked without replacement from nclma. 1/20 Two letters picked without replacement from jxtjxjj. Give prob of sequence tx. 1/21 What is prob of sequence iftf when four letters picked without replacement from jitjjvffifjjj? 1/1430 Three letters picked without replacement from jjjfjfjfjffffj. What is prob of sequence jfj? 7/52 Four letters picked without replacement from nqnqvqqiinnqqnqfnnvn. What is prob of sequence qifi? 7/58140 What is prob of sequence ee when two letters picked without replacement from {e: 3, w: 7}? 1/15 Two letters picked without replacement from ggglgssrlslllllllll. What is prob of sequence lg? 22/171 What is prob of sequence ddd when three letters picked without replacement from cddcdcccdddccdcc? 1/16 Two letters picked without replacement from tqn. What is prob of sequence qt? 1/6 Three letters picked without replacement from {r: 5, w: 1, c: 5}. Give prob of sequence wcc. 2/99 Three letters picked without replacement from {n: 3, y: 1}. What is prob of sequence nnn? 1/4 Calculate prob of sequence nf when two letters picked without replacement from {i: 3, f: 2, n: 3, p: 1, y: 1}. 1/15 Calculate prob of sequence plol when four letters picked without replacement from lolllwpppww. 1/220 Calculate prob of sequence oo when two letters picked without replacement from {c: 3, o: 4, b: 1}. 3/14 Three letters picked without replacement from {r: 3, l: 7, f: 2}. Give prob of sequence rlr. 7/220 Calculate prob of sequence zkm when three letters picked without replacement from vmpzffk. 1/210 Calculate prob of sequence ttt when three letters picked without replacement from {o: 1, t: 3, j: 3}. 1/35 Four letters picked without replacement from wwqwwqqtqqtqqwq. Give prob of sequence tqqw. 2/117 Three letters picked without replacement from xrd. What is prob of sequence drx? 1/6 What is prob of sequence aagg when four letters picked without replacement from {g: 8, a: 5}? 28/429 Three letters picked without replacement from xxheheuehhuhxuhhuxhe. What is prob of sequence eeh? 4/285 Calculate prob of sequence gax when three letters picked without replacement from {a: 1, s: 1, x: 1, h: 1, g: 1, i: 2}. 1/210 Two letters picked without replacement from amawumj. What is prob of sequence mj? 1/21 Two letters picked without replacement from {k: 8, j: 3, m: 2, x: 4}. What is prob of sequence jm? 3/136 Three letters picked without replacement from mmamhxaakmxxhaaska. What is prob of sequence ams? 1/204 Three letters picked without replacement from {w: 3, r: 4, e: 5}. Give prob of sequence wwe. 1/44 Calculate prob of sequence cy when two letters picked without replacement from jcidy. 1/20 Three letters picked without replacement from ozzzozzzzzoz. Give prob of sequence zzz. 21/55 What is prob of sequence voo when three letters picked without replacement from {o: 2, x: 2, s: 2, v: 7, q: 7}? 7/3420 Two letters picked without replacement from {b: 4, a: 2, e: 2, q: 1, c: 6}. What is prob of sequence cb? 4/35 Calculate prob of sequence qncg when four letters picked without replacement from {g: 2, c: 1, q: 1, n: 1}. 1/60 What is prob of sequence paap when four letters picked without replacement from ppaapapapa? 5/63 Calculate prob of sequence nn when two letters picked without replacement from nlnlnnnlnl. 1/3 What is prob of sequence am when two letters picked without replacement from {a: 1, j: 1, m: 3, y: 2}? 1/14 What is prob of sequence gqgg when four letters picked without replacement from {q: 4, g: 16}? 112/969 Two letters picked without replacement from {s: 4}. Give prob of sequence ss. 1 What is prob of sequence ea when two letters picked without replacement from {e: 1, w: 1, a: 2}? 1/6 Four letters picked without replacement from xxssxsxysxasssssssy. What is prob of sequence sxss? 275/5168 Calculate prob of sequence tp when two letters picked without replacement from {p: 2, k: 1, a: 1, s: 2, t: 2}. 1/14 Three letters picked without replacement from {o: 5, e: 3, t: 3, c: 6}. What is prob of sequence cce? 3/136 Three letters picked without replacement from ouuzunuuzunnunuuuun. Give prob of sequence non. 10/2907 Calculate prob of sequence ffff when four letters picked without replacement from ffff. 1 Four letters picked without replacement from {v: 2, l: 3, i: 2, a: 2, w: 1, h: 2}. What is prob of sequence lhal? 1/495 Two letters picked without replacement from hhhddjhjd. Give prob of sequence dd. 1/12 What is prob of sequence ez when two letters picked without replacement from {b: 2, z: 1, s: 6, g: 5, e: 3}? 3/272 Two letters picked without replacement from {s: 4, w: 2}. What is prob of sequence ss? 2/5 Two letters picked without replacement from {g: 3, e: 1, a: 1, t: 5, k: 4}. Give prob of sequence ka. 2/91 Three letters picked without replacement from ryyrrryrrrrr. What is prob of sequence ryy? 9/220 What is prob of sequence qei when three letters picked without replacement from {t: 1, d: 2, i: 2, q: 2, e: 1, o: 1}? 1/126 What is prob of sequence juuj when four letters picked without replacement from {u: 7, j: 2}? 1/36 Calculate prob of sequence llfl when four letters picked without replacement from llffblfb. 3/280 Two letters picked without replacement from srs. What is prob	{ "pile_set_name": "DM Mathematics" }
Is 3 a factor of 481? False Is 23 a factor of 1473? False Is 6 a factor of 244? False Does 4 divide 392? True Is 641 a multiple of 14? False Is 13 a factor of 397? False Does 12 divide 1188? True Is 302 a factor of 27170? False Does 22 divide 1470? False Is 109 a factor of 29648? True Is 14 a factor of 1787? False Does 28 divide 53476? False Is 12843 a multiple of 46? False Is 27 a factor of 5032? False Does 20 divide 625? False Is 13995 a multiple of 15? True Does 11 divide 44? True Does 53 divide 2499? False Is 62 a factor of 5394? True Is 22 a factor of 880? True Does 6 divide 188? False Is 91299 a multiple of 23? False Does 15 divide 14025? True Does 55 divide 18535? True Does 55 divide 25198? False Is 19 a factor of 158575? False Is 22 a factor of 440? True Is 26 a factor of 10920? True Is 13 a factor of 806? True Is 49036 a multiple of 126? False Is 17 a factor of 25657? False Does 48 divide 3168? True Is 676 a multiple of 13? True Does 2 divide 56? True Is 19760 a multiple of 152? True Is 85 a factor of 111095? True Is 23 a factor of 184? True Is 665 a multiple of 26? False Is 600 a multiple of 6? True Is 9367 a multiple of 67? False Is 34 a factor of 13226? True Does 6 divide 146? False Is 12720 a multiple of 41? False Is 12 a factor of 282? False Does 86 divide 6343? False Does 27 divide 35704? False Is 35 a factor of 368? False Is 24032 a multiple of 6? False Is 90 a factor of 8227? False Does 16 divide 3012? False Is 380 a multiple of 10? True Does 11 divide 165? True Is 92 a factor of 4876? True Is 1696 a multiple of 16? True Is 18 a factor of 4050? True Is 183 a factor of 6874? False Is 450 a multiple of 30? True Is 25593 a multiple of 344? False Is 5 a factor of 19822? False Does 18 divide 378? True Is 710 a multiple of 9? False Is 37541 a multiple of 173? True Is 83 a factor of 1532? False Is 33 a factor of 9636? True Does 34 divide 1224? True Is 34 a factor of 68? True Is 86 a multiple of 10? False Does 18 divide 162? True Is 138 a multiple of 2? True Is 8 a factor of 539? False Is 306 a factor of 59670? True Is 9 a factor of 2115? True Is 6 a factor of 7577? False Is 37 a multiple of 4? False Is 28 a factor of 261? False Is 8262 a multiple of 17? True Is 25 a factor of 1270? False Does 75 divide 7906? False Is 228 a multiple of 12? True Is 854 a multiple of 7? True Is 9 a factor of 11155? False Is 8 a factor of 2056? True Is 117 a multiple of 13? True Is 8 a factor of 288? True Is 99 a factor of 126158? False Does 17 divide 41158? False Is 13368 a multiple of 193? False Does 2 divide 3699? False Is 83 a factor of 10438? False Does 16 divide 195? False Is 13994 a multiple of 32? False Is 95 a factor of 1425? True Is 322 a multiple of 2? True Is 8183 a multiple of 11? False Is 349 a multiple of 7? False Is 54 a factor of 5194? False Is 3478 a multiple of 94? True Does 116 divide 4292? True Is 78 even? True Does 5 divide 11870? True Is 262 a factor of 1572? True Is 2964 a multiple of 39? True Is 46 a factor of 25300? True Does 11 divide 1180? False Does 47 divide 21308? False Is 16 a factor of 224? True Is 3 a factor of 327? True Is 220 a factor of 11551? False Does 58 divide 5336? True Does 12 divide 2388? True Is 28842 a multiple of 53? False Does 61 divide 4514? True Does 22 divide 17524? False Is 40 a factor of 56297? False Is 36 a factor of 22874? False Does 13 divide 49959? True Is 58 a multiple of 29? True Is 75 a factor of 5422? False Does 69 divide 2705? False Is 87804 a multiple of 108? True Is 211 a multiple of 10? False Is 1685 a multiple of 68? False Is 272 a multiple of 3? False Is 130 a multiple of 26? True Is 40 a factor of 160? True Is 2 a factor of 90? True Is 10 a factor of 919? False Is 5 a factor of 200? True Is 10 a factor of 521? False Is 21 a factor of 4699? False Is 603 a multiple of 52? False Does 15 divide 57765? True Is 3321 a multiple of 39? False Is 47 a factor of 1870? False Does 58 divide 554? False Does 28 divide 3220? True Is 30 a factor of 2312? False Does 24 divide 3600? True Is 28 a factor of 3598? False Is 12 a factor of 9033? False Is 7 a factor of 368? False Is 124 a factor of 6114? False Is 597 a multiple of 2? False Is 3705 a multiple of 16? False Is 735 a multiple of 43? False Is 10 a factor of 458? False Does 8 divide 398? False Is 1239 a multiple of 19? False Is 7434 a multiple of 21? True Is 22 a factor of 19382? True Is 69 a multiple of 13? False Is 111 a factor of 43623? True Is 6408 a multiple of 10? False Is 3 a factor of 1174? False Is 21 a factor of 1562? False Is 17934 a multiple of 42? True Is 6 a factor of 1050? True Is 2453 a multiple of 30? False Is 21398 a multiple of 26? True Does 15 divide 3435? True Does 3 divide 6? True Is 3022 a multiple of 52? False Is 12 a factor of 2609? False Is 16 a factor of 3360? True Is 32 a factor of 1120? True Is 2 a factor of 195? False Is 7 a factor of 159? False Does 13 divide 1365? True Is 2618 a multiple of 11? True Does 33 divide 396? True Is 54 a factor of 57510? True Is 19 a factor of 1919? True Does 15 divide 150? True Does 6 divide 486? True Is 17 a factor of 28314? False Is 959 a multiple of 16? False Is 29 a factor of 1540? False Is 7084 a multiple of 11? True Is 10 a factor of 733? False Is 25520 a multiple of 20? True Is 6630 a multiple of 102? True Is 126 a factor of 35142? False Is 59303 a multiple of 52? False Does 30 divide 530? False Is 40980 a multiple of 10? True Is 540 a multiple of 27? True Is 41 a factor of 3547? False Does 2 divide 242? True Is 482 a multiple of 9? False Does 11 divide 180? False Is 98 a factor of 1026? False Is 5 a factor of 537? False Is 10653 a multiple of 67? True Does 6 divide 54? True Is 12 a factor of 35992? False Is 1346 a multiple of 31? False Is 5164 a multiple of 7? False Is 56 a factor of 72968? True Does 36 divide 51008? False Is 420 a multiple of 15? True Is 23 a factor of 14493? False Is 438 a multiple of 23? False Does 12 divide 3600? True Is 4 a factor of 2288? True Is 53482 a multiple of 10? False Is 8002 a multiple of 52? False Is 32 a factor of 1490? False Is 49 a factor of 3357? False Is 4620 a multiple of 14? True Does 22 divide 1188? True Is 40 a factor of 2920? True Is 5 a factor of 140? True Is 2640 a multiple of 24? True Is 12 a factor of 72? True Is 7462 a multiple of 7? True Does 65 divide 910? True Does 3 divide 55? False Does 67 divide 24601? False Is 35 a factor of 105826? False Does 2 divide 342? True Does 66 divide 40753? False Is 19 a factor of 1191? False Is 434 a multiple of 62? True Does 4 divide 643? False Is 20 a factor of 41360? True Does 118 divide 5123? False Is 23897 a multiple of 55? False Does 18 divide 630? True Is 4575 a multiple of 15? True Does 83 divide 145009? False Is 570 a multiple of 15? True Does 4 divide 15106? False Is 3530 a multiple of 10? True Is 32 a factor of 416? True Is 50 a factor of 121859? False Is 19248 a multiple of 213? False Does 24 divide 1425? False Is 62 a factor of 44740? False Does 39 divide 2576? False Does 2 divide 2887? False Is 5936 a multiple of 16? True Does 16 divide 712? False Is 34 a factor of 59272? False Is 96 a factor of 24384? True Does 71 divide 11147? True Is 13 a factor of 65? True Is 28 a factor of 1372? True Does 5 divide 937? False Is 1239 a multiple of 21? True Is 24510 a multiple of 15? True Is 41375 a multiple of 331? True Is 6045 a multiple of 115? False Is 320 a multiple of 32? True Does 24 divide 9192? True Is 10 a factor of 26810? True Does 41 divide 943? True Is 196 a multiple of 49? True Is 68 a factor of 10554? False Is 5 a factor of 6935? True Is 3 a factor of 8761? False Does 29 divide 899? True Is 12 a factor of 852? True Is 7440 a multiple of 11? False Is 407 a multiple of 13? False Is 2049 a multiple of 66? False Does 43 divide 215? True Is 27 a factor of 8640? True Does 3 divide 88? False Is 16080 a multiple of 20? True Is 102 a factor of 8516? False Does 44 divide 1042? False Does 9 divide 189? True Is 11 a factor of 257? False Is 16 a factor of 120? False Is 39 a factor of 16792? False Is 370 a multiple of 37? True Is 45049 a multiple of 19? True Does 9 divide 214? False Is 1198 a multiple of 4? False Is 229 a factor of 4252? False Does 14 divide 378? True Does 28 divide 544? False Do	{ "pile_set_name": "DM Mathematics" }
and 15? 105 Let w(k) = -102k2 - 3k. Let g be w(4). Calculate the common denominator of g/(-16)(-4)/18 and -77/2. 6 Let o = 35 + 19. Find the common denominator of (-449)/360 + 12/o and -43/10. 40 Let z = 6 + 2. Let j = -3 + 14. What is the lowest common multiple of j and z? 88 Let c be ((-24)/9)/((-427)/3). Let x = 15671/6832 + c. What is the common denominator of 115/6 and x? 48 Let j = 10 + -19. Let i be (-30)/j(-18)/4. What is the common denominator of ((-27)/i - -2)1 and 13/6? 30 Let f(c) = c3 - 6c2 + 6. Let n be f(6). What is the smallest common multiple of 22 and 170/15 - (-4)/n? 132 Let r(g) = g2 + 22g + 43. Let k = -3244/981 + -15/109. Find the common denominator of r(-21) and k. 9 Suppose -x - 4 + 5 = 0. Let a(w) be the second derivative of 11w3/6 - w. Calculate the smallest common multiple of a(x) and 11. 11 Let o be (-74)/(-10) + (-2)/5. Let y(l) be the second derivative of l3/6 + 3l2/2 - 6l. What is the smallest common multiple of y(o) and 12? 60 Let u = 746/3 + -241. Suppose 4g + 26 = 2x, -x - 5g - 10 = 12. What is the common denominator of u and ((-1946)/252)/(1/x)? 6 Let u(k) = k2 + 6k - 3. Let z be u(-6). Find the common denominator of (1/z)/(1/(-74)) and -18. 3 Let c = -5 + 15. Let i(v) = 2v + 3. Let a be i(-3). What is the least common multiple of 2/a(-6)/2 and c? 10 Let z = -1 - -1. Suppose z = -4g - 3p - 2p + 35, 5g - 55 = -4p. Suppose b - g = -5. What is the least common multiple of b and 10? 10 Let x(t) = -t2 + 5t + 13. What is the least common multiple of x(6) and 6? 42 Let v be (-14775)/(-24) - (0 - -2). Let j = 623 - v. Find the common denominator of j and -71/9. 72 Find the common denominator of -17/33 and 393/90-1 + 0/4. 330 Let p = -12801/2170 + -1/1085. What is the common denominator of 7/11 and p? 110 Let c(m) = m3 - 5m*2 + 5m + 1. Let a be c(4). Suppose 2y + 15 = -a. What is the least common multiple of 6 and (-8)/y50/4? 30 Let o = -1/1428 + -5393/2380. Find the common denominator of o and 16/7. 105 Let q = -2 - -4. Suppose -4 + 0 = 2m. What is the lowest common multiple of q and (0 + -2)/(m/10)? 10 Suppose 0 = -7z + 85 - 15. Calculate the least common multiple of z and 170. 170 Suppose 36 = 4q - q. Calculate the smallest common multiple of q and 1. 12 Suppose -2n + 4n - u - 15 = 0, -n - u = -9. Calculate the lowest common multiple of (2/(-4))/((-1)/4) and n. 8 Let u be (284/8)/(2/(-524)). Let y = u + 55939/6. Find the common denominator of -29/3 and y. 6 Suppose 3q = 37 - 13. Calculate the lowest common multiple of q and 8. 8 Let l = -2/35673 - -3817031/356730. Find the common denominator of l and 73/9. 90 Let r(t) = 101t3 + 6t*2 + 3t - 5. Let a be r(-4). Let w = a - -102253/16. Let m = -25645/8 - -3196. Find the common denominator of w and m. 16 What is the common denominator of -23/12 and 115/4(-21)/(-175)? 60 Let u = -11 - -21. Let m(z) = -5z*3 + 24z*2 - 11z + 6. What is the lowest common multiple of m(4) and u? 130 Let l(q) = -q*2 + 8q + 1. Suppose 0 = 4n - 1 - 27. Calculate the least common multiple of l(n) and 0 + 1/2 + 6/4. 8 Suppose 3u + 5 = 17. Suppose 7 = -2p + q, -p + 2q - 4 - 7 = 0. Let j = 8 - p. What is the lowest common multiple of j and u? 36 Let h = -20 + 31. Suppose 2x + 31 = -x - 2d, 6 = 2x - 4d. What is the lowest common multiple of h and (-1 + 3)x/(-2)? 77 Let q = -274/7 + 1383/28. Calculate the common denominator of 9/16 and q. 16 Suppose 3t - 7t + 4 = 0. Suppose f = 2 - t. What is the smallest common multiple of f and (-2)/6 - (-112)/12? 9 Let d = 53699 - 1933297/36. Find the common denominator of d and -41/4. 36 Let t(a) = -a3 + 4a*2 - 6a - 5. Let f be t(5). Find the common denominator of 6/8850/3 and (-2)/(-6) + 595/f. 132 Let n = 3445 + -62159/18. Let t be -2 + 0 + (-6)/3. Calculate the common denominator of t/10 + 1043/(-630) and n. 18 Let z(n) be the first derivative of n3/3 - 3n*2/2 - 10n - 1. Calculate the lowest common multiple of 22 and z(7). 198 Let q(r) = -2r - 1. Let c be q(-8). Let g be (-4)/10 + 6/c. Suppose 3o + 3z + 9 = g, -2o - 3z = -8z - 22. Calculate the least common multiple of o and 5. 5 What is the lowest common multiple of -262/8-4 and 8? 104 Let k = 1209/44 - 96/11. What is the common denominator of 77/8 and k? 8 Let q(m) = -m*3 - 2m*2 + 7. Calculate the least common multiple of q(0) and 18. 126 Suppose x = -2x - 2v + 17, -4x - v = -21. Let s(k) = k*2 - 5k + 1. What is the lowest common multiple of s(5) and x? 5 Let y be (-2 - -3)/((-1)/(-3)). Suppose -4q + 25 = -yq + 3o, 0 = -2o + 10. Suppose 16 = 2t + 2t. What is the smallest common multiple of t and q? 20 Let b = 27539/21 - 1315. Find the common denominator of 92/15 and b. 105 Find the common denominator of -97/10 and ((-1666)/252)/((-2)/(-6)). 30 Let j = 2 - -2. What is the lowest common multiple of 50 and j? 100 Suppose 4h - 2b = 0, 3h - 2b - 18 = -5b. Calculate the lowest common multiple of h + -1(-1 - -2) and 10(-1)/(-3 + 2). 10 Let f(a) = -26a + 4. Let w(d) = -d*2 - 2d + 3. Let k be w(-4). Let y be f(k). Calculate the common denominator of y/(-4) - (-6 + 5) and -149/6. 6 Let j(a) = 3a3 - 6a*2 - 5a*3 + 3a*3 + 5a + 3. Let q(f) = f*2 + 3f + 1. Let d be q(-4). Calculate the smallest common multiple of j(d) and 8. 24 Let a(q) = -q - 5q + 0q3 + 22 - q3 + 5q. What is the smallest common multiple of a(0) and 20? 220 Suppose -6 = -p - 3. Suppose -2t + 0t = 12. Calculate the common denominator of -28/11 and 5 + t - (-2)/p. 33 Let h(o) = o - 11. Let w(r) = r2 + 5r + 5. Let t be w(-5). Calculate the lowest common multiple of h(13) and 4/(-2)t-2. 20 Let b = 125359373178568/12313 - 10181058483. Let n = -1/1759 - b. Calculate the common denominator of -25/11 and n. 77 Let r = -6 - -12. Suppose y = -m - 0m - r, -2y + 4 = -2m. Let b = y + -1/6. Find the common denominator of -53/6 and b. 6 Suppose 30 = 5v - 0. Let s = 34 + -18. What is the smallest common multiple of v and s? 48 Let m = 2418/365 - -1/2920. Find the common denominator of m and 52/11. 88 Let f be (-2)/7 - (-24)/(-14). Let s = 3 - f. Calculate the smallest common multiple of 9 and s. 45 Let s = -330839/456 + 5815/8. Find the common denominator of s and -61/9. 171 Let q = 43 - 51. Find the common denominator of 50 and q. 1 Suppose 2k + 4 = k. Let y be k/(-4) + 91/(-2). Let b = y + 39. Find the common denominator of b and -13/9. 18 Let o = 531506/2346059 - 88/389. Let k = -633299/132682 + o. Calculate the common denominator of -127/6 and k. 66 Let s = 46/3 - 89/6. Let h = 1798 - 10891/6. Calculate the common denominator of h and s. 6 Let o = -399/8 + 1381/24. Find the common denominator of o and 46/13. 39 Let c = -31549/8 + 3955. Find the common denominator of c and -33/8. 8 Suppose -5u + 118 = 3h + h, 0 = -h + 2. Calculate the smallest common multiple of u and 24. 264 Let k = -2067/2 - -1037. Let c = 896/3 - 629/2. Calculate the common denominator of k and c. 6 Suppose 4f + f - 405 = 0. Suppose 5t = 5w + 110, -4t - 1 + f = -2w. Calculate the common denominator of -39/14 and ((-321)/t)/(0 + 1). 42 Suppose 0 = 2a - 4 - 20. Calculate the least common multiple of 22 and 0 + a - 10/5. 110 Suppose 5b = -735 + 60. Find the common denominator of 0 - 2 - b/198 and -151/12. 132 Let m = 4 - -1. Let o be 5 - m - (-1 - 3). Suppose -18 - o = -s. What is the least common multiple of s and 4? 44 Calculate the smallest common multiple of (0 - -3) + (3 - 2) - 3 and 29. 29 Let o(l) = l*2 - 4. Let i be o(-3). Suppose 3j + 18 = ik, -3k + 14 = 2j - 12. What is the smallest common multiple of k and 3? 6 Let l = -12 - -24. Let z = 4 + 8. What is the lowest common multiple of z and l? 12 Let i = -2 - -22. Calculate the smallest common multiple of i and 48. 240 Let p be (-1545)/20 + (-2)/(-8). Let x = 6/199 - -9305/1592. What is the common denominator of (p/24)/(1/3) and x? 8 Let l be (-4)/(-10) - (-122)/(-5). What is the least common multiple of (-4)/4 + (-22)/(-2) and 38/8 + (-6)/l? 10 Find the common denominator of 71/26 and (1/(-12))/((-16)/1044). 208 Let o = -30 - -42. Calculate the common denominator of -67/8 and ((-2)/(-3))/(o/(-429)). 24 Let y be 24/(-14) + 2/(-7). What is the common denominator of -4((-302)/	{ "pile_set_name": "DM Mathematics" }
at is the closest to 1 in -2, 3, 6, -1/8? -1/8 What is the nearest to -0.1 in 0.3, -0.3, -5, 15? -0.3 What is the closest to -1/5 in -2, 2/9, 0, -0.3? -0.3 What is the nearest to -1/4 in 0.2, 10, 3, -16? 0.2 What is the nearest to -5 in 4, 2/7, 0.3? 2/7 Which is the closest to 0.2? (a) -1/7 (b) 5 (c) 169 a What is the nearest to -2 in -21.9, 3/2, -1/3, -4? -1/3 Which is the closest to 5? (a) 8 (b) -2/9 (c) 2/13 a Which is the nearest to -2/7? (a) 0.5 (b) -0.2 (c) 39 b Which is the nearest to 1/3? (a) 0.1 (b) -1026/13 (c) 5 a Which is the closest to 2? (a) -5 (b) 0 (c) 0.76 (d) 5 c What is the nearest to -1 in -1.3, 1/5, -47? -1.3 Which is the nearest to -0.1? (a) 4 (b) 0.1 (c) -2 (d) 15/7 b What is the closest to -0.06 in 59, -0.2, 0.3, -0.4? -0.2 Which is the nearest to 1? (a) -0.1 (b) -0.204 (c) -1/7 (d) -0.2 a What is the nearest to 6 in -4/3, -0.09, -1/2? -0.09 Which is the closest to -11/5? (a) -4 (b) 0.2 (c) 5/2 (d) -2/11 a What is the nearest to 2 in 2/5, 0.3, 0.5? 0.5 Which is the nearest to -0.14? (a) 1/7 (b) 1/8 (c) 0 (d) 1 c What is the closest to -1 in -3/8, -4, -0.1? -3/8 What is the closest to -1/4 in 0.4, -8, -2? 0.4 Which is the closest to 0.04? (a) 0.5 (b) 12 (c) -4/5 a Which is the nearest to -1/3? (a) -0.5 (b) -188 (c) 2 a Which is the nearest to 3? (a) 0.09 (b) 1 (c) -5 b Which is the nearest to 0.1? (a) -70 (b) -0.2 (c) -0.4 b Which is the nearest to 1? (a) -465 (b) -2/7 (c) -4 b Which is the nearest to 1? (a) 5 (b) 0.03 (c) 0.6 c Which is the nearest to -3/4? (a) 51/4 (b) 2 (c) 4/3 c What is the nearest to 0.04 in 4/3, -5, -2? 4/3 What is the nearest to 16 in 4/3, 0.3, -0.3, -2/5? 4/3 Which is the nearest to 1? (a) 1 (b) -13 (c) 3/8 a Which is the nearest to 1? (a) 0.1156 (b) 1 (c) -0.06 b Which is the closest to 2/53? (a) 0.5 (b) 1/8 (c) -5 (d) 0.1 d Which is the closest to -2? (a) 2 (b) 49 (c) 0.6 c What is the nearest to -1/4 in 0.1, 78/11, 4/3? 0.1 What is the closest to 0 in -0.02, -1/3, -0.1, -6? -0.02 What is the closest to 0.4 in 4, -2/15, 25, -0.4? -2/15 Which is the closest to 0? (a) -0.5 (b) -0.7 (c) -1/5 (d) 0.3 c Which is the nearest to -0.21? (a) 0 (b) -0.2 (c) -0.4 b What is the nearest to -0.43 in -2, 4, -1? -1 What is the closest to 0 in -1, 17, -0.2? -0.2 Which is the closest to -1? (a) 2/9 (b) -3 (c) 2 a Which is the closest to -0.2? (a) -4/9 (b) -460 (c) -3/2 (d) -3 a What is the nearest to -17 in -2/27, 2, 0.3? -2/27 What is the closest to -1/12 in -32, -1/6, -5? -1/6 Which is the nearest to -0.1? (a) -0.06 (b) 2 (c) 3 (d) -0.1 d What is the nearest to 0.1 in -26, 3, 5/4? 5/4 Which is the closest to 49? (a) 3 (b) -0.2 (c) -4/7 (d) -3/8 a What is the nearest to -1/52 in -3, 0, -0.2, -1? 0 What is the nearest to -2/5 in -2, -5, 4, 0.8? 0.8 What is the closest to 2/5 in 13, -3, 5, 3? 3 What is the closest to 0.8 in -5, -16, 1? 1 Which is the nearest to -2/3? (a) 2 (b) 7/4 (c) 14 b What is the closest to -1 in -10/9, -0.34, 3? -10/9 What is the nearest to 3/5 in -5, -7, -4? -4 What is the closest to 2 in -803, 0, -0.2? 0 Which is the nearest to -0.1? (a) -190 (b) 4 (c) 2 c Which is the nearest to 3? (a) 3 (b) 0 (c) -2 (d) -6 a What is the nearest to 7/8 in 0.6, 0, -2/3, -2? 0.6 Which is the closest to 2? (a) 0.4 (b) -2/19 (c) 2/7 (d) -1/5 a Which is the nearest to -176? (a) -4 (b) 1 (c) -1 a What is the nearest to -0.2 in 3/5, 15, -0.4, -4? -0.4 What is the closest to 0.1 in 251/5, -1/5, -2/9, -0.5? -1/5 Which is the nearest to 0.02? (a) 2 (b) 4/7 (c) -1/2 c Which is the nearest to -1/4? (a) -3 (b) 0.5 (c) 2/59 c Which is the closest to 3/4? (a) 5 (b) 4.4 (c) 0.4 (d) 0 c What is the closest to 0.2 in -411, -0.4, -0.5? -0.4 Which is the nearest to 0? (a) 5 (b) 0.13 (c) 1 (d) -0.1 d Which is the closest to 1? (a) -5 (b) -4/79 (c) -2/13 b Which is the closest to 1/3? (a) 4 (b) -5 (c) -14 a Which is the nearest to -0.1? (a) 0.1 (b) -3/7 (c) -1/4 (d) 1 c What is the nearest to -3/2 in 2, 2/15, 2/5, -29? 2/15 Which is the closest to 5? (a) -0.1 (b) -1/2 (c) -1/3 (d) 3 d What is the closest to -22 in 2, -2, 5? -2 Which is the nearest to 4/3? (a) 1/3 (b) 0.5 (c) -0.2 (d) 1/574 b Which is the closest to -1? (a) -0.17 (b) 6/17 (c) 3/4 (d) 1/2 a What is the closest to 1 in -4/7, -1/5, -2? -1/5 Which is the nearest to -27? (a) -3 (b) -0.5 (c) 0.01 a What is the nearest to -0.7 in 1/20, -4, 2/5? 1/20 What is the nearest to 2/7 in -1/7, -2/15, -2, -1/2? -2/15 Which is the closest to 2/13? (a) -9 (b) 0.8 (c) -1 b What is the nearest to -1 in 2/15, -1/6, 2/3? -1/6 What is the nearest to -0.1 in 5, 58, -12, -0.5? -0.5 What is the closest to 10 in 1, 1/9, 2? 2 What is the nearest to -1/2 in -4, -1/2, -5, 15.7? -1/2 What is the nearest to -0.244 in 1, -4/9, -3? -4/9 Which is the nearest to 0.1? (a) 5 (b) -0.5 (c) -26 b Which is the closest to -3? (a) 3 (b) -3/2 (c) -1.4 (d) 0.1 b What is the closest to -3 in 1/3, 3, 4, -0.4? -0.4 Which is the nearest to 0.1? (a) -52 (b) -0.3 (c) 3 b Which is the nearest to 1? (a) 2/19 (b) 52 (c) 3 (d) -3 a Which is the closest to 1/29? (a) 0 (b) -1/3 (c) -2/5 (d) 0.2 a What is the nearest to -1/34 in 2, 2/11, -0.1? -0.1 Which is the closest to -3? (a) -1 (b) 42 (c) -2 c What is the closest to 0.7 in -5, 4, -3? 4 What is the nearest to 0.03 in 2/9, 23, 0, -3? 0 Which is the nearest to -1? (a) 4 (b) 2/7 (c) -8.4 b What is the nearest to 0.1 in 2/5, -1/4, -37/2, -3/5? 2/5 Which is the closest to 1/2? (a) -47 (b) 0 (c) -1 (d) -0.3 b Which is the nearest to 2? (a) -1 (b) -0.4 (c) 1194 (d) 2/9 d Which is the closest to 4/11? (a) -2 (b) -0.5 (c) 0.1 c What is the closest to -1 in 64, -4/3, 0.5? -4/3 Which is the nearest to 4? (a) -15 (b) 0.4 (c) 2 c What is the closest to -0.03 in 6/5, 3/5, -0.3, 5? -0.3 Which is the closest to -5? (a) -18 (b) -1/4 (c) 4 b Which is the closest to 2/9? (a) 2/7 (b) 0.1 (c) 0 (d) 2/77 a What is the nearest to 1/18 in 5, -25, 0.3? 0.3 Which is the closest to -0.1? (a) -1 (b) 1.4 (c) -1/2 (d) -0.3 d Which is the nearest to 2/3? (a) -0.3 (b) -1.7 (c) 5 a Which is the closest to 1? (a) -1 (b) -7.7 (c) 4 (d) -0.1 d What is the nearest to -2/17 in -1/5, 2/29, -0.3? -1/5 Which is the nearest to 0.2? (a) -0.08 (b) 3/4 (c) -3 (d) 2 a What is the closest to 0.3 in 3/8, -0.2, -4, 0.6? 3/8 Which is the closest to -3? (a) 0.07 (b) 2/9 (c) 1/3 (d) -0.6 d Which is the closest to 5? (a) 2/9 (b) 3.32 (c) -1/3 b What is the closest to 21/2 in 4, 2, -6? 4 What is the nearest to -2/3 in -5, 77, -4/5, 4/7? -4/5 What is the closest to 0.04 in 3, -2/5, -4, 53? -2/5 What is the nearest to -0.1 in -3, 0.2, -2/17, 1? -2/17 Which is the closest to -2? (a) 3 (b) -3/4 (c) 1/3 b What is the closest to -2/43 in 0.5, 1/9, 0.1, 5? 0.1 Which is the nearest to -2? (a) -1 (b) 1/3 (c) -11/5 c What is the nearest to -0.03 in 4, -0.3, 9, 1/5? 1/5 Which is the closest to -1? (a) -0.3 (b) -0.12 (c) -2/9 (d) 1 a What is the closest to -135 in 1/2, 1/3, 1/4, 1? 1/4 What is the closest to 1/4 in -2/65, 6, 3? -2/65 What is the nearest to -14 in -2/5, 1, 1/6, 4/3? -2/5 Which is the nearest to -0.04? (a) 4 (b) 15 (c) 0.3 (d) 1 c Which is the nearest to 3/167? (a) -0.2 (b) 2/3 (c) 1 (d) -1 a Which is the nearest to 0? (a) -2/9 (b) 48 (c) 3/5 (d) -17 a Which is the nearest to -1? (a) 0 (b) -1/3 (c) -24 (d) 0.5 b Which is the closest to 0.09? (a) -7 (b) 0.1 (c) 4 (d) -41 b What is the closest to -6 in -0.4, -1/5, 2/19? -0.4 What is the nearest to 0.1 in -2, -1/3, 0.04? 0.04 Which is the nearest to 1/2? (a) -11/21 (b) -0.3 (c) 0.1 (d) -1/12 c Which is the closest to -0.6? (a) 5 (b) -5 (c) 2/35 c Which is the closest to -2/3? (a) -2/15 (b) -4 (c) 1/28 a Which is the closest to 1? (a) 34 (b) 2/9 (c) -1/7 b Which is the nearest to 0? (a) -1 (b) -0.298 (c) -4 b What is the closest to 3 in 0.3, 12, -5? 0.3 Which is the nearest to -4? (a) 22.5 (b) 0 (c) -2/15 c Which is the closest to -2? (a) 0.052 (b) 0.2 (c) 2/15 a Which is the closest to 1? (a) -19 (b) 2/7 (c) 28 b What is the nearest to -3 in 3/7, 50, -1? -1 What is the closest to -1 in 12, 0, -41? 0	{ "pile_set_name": "DM Mathematics" }
5 What is the value of 8/(0 - (-3)/((-9)/(-6)))? 4 100/15(-6)/(-8) 5 What is the value of (-7 - (-93)/15)/(156/(-10))? 2/39 4150/(-80)(-4)/(-5) -6 Evaluate (-144)/1188(-6)/4. 2/11 Evaluate 2/5 + (-24)/90. 2/15 What is the value of 3 + (-23)/(-21) + (-100)/25? 2/21 Calculate (61/183)/(1/(-6) - 0). -2 (3 - -1) + -4(-7)/(-28) 3 What is 42/357 + 36/(-17)? -2 Calculate 2/6(15 + 0). 5 What is (-86)/(-22)-1 + 1 + 3? 1/11 What is ((-3)/6)/(4 - (-14)/(-4))? -1 Calculate ((1 - 0)-1)/((-12)/(-48)). -4 Evaluate 58/12 - (4 + 100/(-24)). 5 What is the value of (1 + 0)/(17/85)? 5 Evaluate 10/(-20)(0 - -2). -1 What is the value of ((-21)/(-63))/((-2)/3)? -1/2 What is 1/1-1 + -1? -2 What is (2/(-12)-4)/(20/6)? 1/5 Calculate (-344)/64 + (-6)/(18/(-15)). -3/8 What is 4/(-18) - (4/(-18) + -6)? 6 Calculate 0 - (-7)/(35/(-5)). -1 34/(-68)(-3 + 1) 1 ((-3)/(12/(-10)))/((-20)/(-24)) 3 What is -3(140/15 + -8)? -4 Evaluate (-171 + 170)/(0 - -1 - 0). -1 Calculate 3 + (-2 - (-6)/(-3)). -1 Evaluate 961/217 - (-6)/(-14). 4 Calculate (-24)/360 - (-172)/(-120). -3/2 Evaluate (2/4)/(11/(-44)). -2 What is the value of 3(6/5)/((-116)/290)? -9 What is (8/(-10))/(264/20 - 13)? -4 Calculate (10/14)/(17/(-119)). -5 Evaluate 3/(-9) - 1(-4)/12. 0 What is (-2)/(-4)(-4)/612? -4 Evaluate (-1)/(5/10-2). 1 -26/(-48)4 1 Evaluate (-3)/2 - (1620/(-24))/27. 1 (-4 - (-5 - -1))/1 0 ((-96)/10)/(-3) - 10/50 3 Calculate 70/(-17) - -5(-12)/(-510). -4 Evaluate 2/(3 - 1) + (-2)/10. 4/5 Calculate 150/1100(-8)/(-6). 2/11 Calculate 1(-6)/4 - 341/(-310). -2/5 What is 4 + (-70)/15 + (-20)/6? -4 Calculate 20/(-14) - (855/63 + -13). -2 Evaluate 98/(-28) + 20/6. -1/6 What is the value of (((-2)/(-42))/((-8)/(-24)))/(-1)? -1/7 4/30 + 56/30 + -2 0 What is the value of 287 + -281 - (34/6)/1? 1/3 Calculate (-6)/10((5 - 1) + -9). 3 Calculate 3 - (2/(-3))/(12/18). 4 Calculate 3/9 - (-8)/(-15). -1/5 4/(-10) + 17/5 3 Calculate -265(-16)/600 + (-7)/1. 1/15 Evaluate (-4 + 24)/46/10. 3 Evaluate 1-4 - -8(-3)/(-6). 0 16/(-6)(74/(-24) + 3) 2/9 Calculate (3/(-16))/(((-90)/12)/(-5)). -1/8 ((-1)/(-26))/(2 + (-36)/16) -2/13 Evaluate 3 + 5 + (-10)/2. 3 ((-7)/(-21))/(1/3)-1 -1 What is the value of (-2)/(-6)-310/(-2)? 5 What is the value of 0 + (-1 + (-18)/12)2? -5 Calculate (-39 - -41)/(-2 - (-2 + 1)). -2 What is (-4)/(-3)(-36)/16? -3 What is the value of (5/(-10))/(-2 - (-14)/2)? -1/10 What is (-44)/662/6-1? 2/9 What is 16/(-9)5/30? -1/9 What is 2-1 - (-8)/((-520)/(-169))? 3/5 What is the value of 80/(-24)6/(-4)? 5 -4(-5)/10-1 -2 Calculate 6/12 - 10/28. 1/7 What is (-6)/48-2 - 13/20? -2/5 Evaluate 12/(0 + 24)16. 3 What is the value of (-90)/120(-8)/3? 2 Calculate 3 + 9 + 0 + -12. 0 (-4)/(-2)(-24)/(-12) 4 Evaluate (1/7)/(3/6). 2/7 Evaluate 2/12 + 141(-4)/(-72). 8 Calculate 95/(-15) + 6/18. -6 Evaluate ((-8)/(-14)(24 + -3))/(-2). -6 What is (-3 + 6 - -2)/1? 5 0((-2)/12)/(14/(-42)) 0 (-1)/(-2) - 4/24 1/3 What is 495/(-66)8/(-30)? 2 What is the value of 46/(-10) + 44/(-110)? -5 What is the value of 19/((-266)/(-20)) - 24/16? -1/14 Calculate (-17)/136(0 - (-12)/(-4)). 3/8 What is the value of 14/(-119)1 - 96/51? -2 What is (-2)/(-10) + -1 + (-1311)/(-345)? 3 (-60)/(-25) + -1(-3 + 5) 2/5 Calculate 1325/954(-3)/(-5). 5/6 What is ((16/(-18))/2)/(28 + -26)? -2/9 Calculate (0 + (-6)/(-11))/(42 - 40). 3/11 What is the value of 2/(20/(-38)) - (-7 + 2)? 6/5 Evaluate (-7 + (-296)/(-32))/((-3)/(-8)). 6 (-12)/(-476) - 32/224 -2/17 What is -14/18 - 0? -2/9 What is the value of (-3)/(-15) + (-8)/(-10)? 1 Evaluate (4/12)/(5/3). 1/5 Calculate (-726)/1722-7 + -3. -2/41 (0(-2)/(-12))/(1-3) 0 Evaluate 1(6 + 4)/(-2)1. -5 What is 1/(-4) + (-1 - 1)/(-8)? 0 (-248)/1302(-7)/(-10) -2/15 1/(-6)(-12)/(-9) -2/9 Calculate 2 - ((-100)/(-36) + 3/(-3)). 2/9 Calculate (-9)/(-5)120/(-36). -6 Calculate (75/(-50))/((-9)/2). 1/3 0 - 18/(-4)5/30 3/4 What is (-140)/(-55) - 18/33? 2 What is 2/3 - (-4)/12? 1 What is ((-119)/(-21) - 6)/(-3)? 1/9 What is the value of 92(-2)/6 - -2? -4 What is ((-4)/(-28)0)/(-4)? 0 Calculate ((-7)/(-840)10)/((-9)/(-48)). 4/9 What is the value of -8 + -5(-1494)/945? -2/21 What is (-8)/36 - 14/(-63)? 0 What is -6(-5 + (-39)/(-9))? 4 Calculate (-4)/(-5)(-3)/6. -2/5 Evaluate 172/(-28) + (-72)/(-63). -5 What is the value of 11 + -2 + -4 + -1? 4 What is -32((-28)/32)/(-7)? -3/4 Evaluate ((-602)/129)/(4/6). -7 Calculate (-1 - -2)(50/25 - 0). 2 What is 3/215/908? 2 (-4 - 94/(-24))/(7/14) -1/6 Calculate (-10 - 718/(-72))/(2/(-9)). 1/8 What is the value of 2 - (1 - -1 - 3)1? 3 (4/3)/(78/117) 2 What is (-4)/(8/(-18))(-4)/(-24)? 3/2 (-3)/(2/(-8)(3 - -1)) 3 What is the value of (14/(-7) + 6/4)6? -3 What is the value of 12((-32)/(-84))/8? 4/7 What is the value of 9 - 4 - 4 - 3? -2 What is 0/(-6 - -8)-1 + -2? -2 Calculate (-5)/(-20)-24/(-18). 1/9 Evaluate -4 + (-6)/6 + 2. -3 What is (-4)/2 + (-18)/45-5? 0 Calculate (33/9 - 5)/((-1)/(-3)). -4 What is the value of 780/(-400) + (-6)/(-8)? -6/5 What is 1/(88/26) - (-39)/156? 6/11 Calculate 2/(-5) + (-2737)/595. -5 12/36 - (-4)/(-12) 0 What is the value of 2((315/(-10))/(-7) - 4)? 1 What is (-23)/(-21) + (-2)/3? 3/7 Calculate (-9)/3 + (-2)/(88/(-140)). 2/11 What is the value of ((-1)/(-12))/((-3)/(-12))? 1/3 Calculate ((-9)/(-12))/(18/24). 1 Evaluate -2 - -2 - 9/((-9)/2). 2 Calculate 448/720 + (-4)/18. 2/5 What is (24/(-20))/(12/(-10) + 2)? -3/2 Evaluate (-1)/24-4 - (-14)/(-12). -1 -3(-5)/(-60)(-8)/(-9) -2/9 Calculate 3 + -4 - (-1 + (-2)/9). 2/9 Evaluate (-32)/(-18) - (2 + 0). -2/9 Evaluate ((-9)/(-6))/(-3) - (-125)/350. -1/7 What is the value of -28/240(-1 - -4)? -1/5 Evaluate 4/160 - -1. 1 What is (3/(-6))/((-21)/(-12))? -2/7 What is the value of (-1)/(3/(-9))(-4 - -5)? 3 (-3 - (-51)/21)/(54/(-63)) 2/3 22/77 + 72/(-154) -2/11 Evaluate (2016/88)/6 + -4. -2/11 What is the value of (1 + 0 - (5 - 3))-1? 1 Calculate (4/(-12))/(8/(-24)). 1 What is the value of (-4 + 4)(-7)/(-14)? 0 Calculate 9/(-18)(27/(-21) + 1). 1/7 Evaluate (-4)/(-8)(0 - 10). -5 Evaluate -3 + (-3 - 222/(-36)). 1/6 What is the value of -6 - (-3 - 63/28)? -3/4 What is (-2 + (-51)/(-12))(63 + -59)? 9 Calculate 6 - (-8 - -16) - -81. 6 Calculate 28/8 - 36/24. 2 What is the value of 11 + -8 + 58/(-20)? 1/10 What is the value of ((-12)/(-128))/(51/34)? 1/16 (22/(-308))/((-6)/(-21)) -1/4 Calculate 75/30(-2)/(-1 + -39). 1/8 2(-2)/6(-114)/(-304) -1/4 What is the value of 3/(-12)(14/6 + -3)? 1/6 (-1)/(3-1 - (-1)/1) 1/2 ((-16)/12)/(-4)-2 -2/3 (-1)/7 - 7/((-196)/(-192)) -7 What is ((-85)/(-25) + -4)10/4? -3/2 (-104)/(-260) + (48/(-10))/3 -6/5 Calculate ((-2)/(-5))/(2/(40/(-12))). -2/3 What is ((-5)/(-2) + (-111)/(-222))/(-5)? -3/5 What is (-140)/105 - (32/(-6) - 2)? 6 440/150 - -7 - 10 -1/15 Calculate -2 - ((-6)/(-5))/((-84)/160). 2/7 What is (-171)/(-228) + (-66)/56? -3/7 What is the value of 4 + -8 + -1 - (-32)/6? 1/3 (-2)/3(-1863)/378 - 3 2/7 Evaluate (-3)/(-1)-1 + 54/21. -3/7 Evaluate -127 + 130 - (0 + 1 - 5). 7 (6/36)/(7/6) 1/7 What is the value of 9/1232/48? 1/2 Evaluate (4 - -2) + 5 + -11. 0 What is 67/(-1206)(-53)/1? 5/6 Calculate 52/(-117) - (195/(-54) - -4). -5/6 What is the value of 8/(-6)1/(-4)? 1/3 Evaluate (20/(-4) - -3)/((-45)/10). 4/9 ((-2)/(-5))/((-126)/35) -1/9 Calculate ((1 - 3)/(-4))/(7/(-14)). -1 Evaluate 15/(-36) - ((-225)/(-36) - 7). 1/3 What is the value of 8/(-64) - 6/80? -1/5 Evaluate (4/(-6)-1)/((-96)/(-1008)). 7 What is the value of (-8)/44 + -7 + 7? -2/11 Evaluate 165/(-105) - 6/14. -2 What is the value of (7/3)/((17/(-3))/17)? -7 What is 18/24 + (-21)/(-4) + -3? 3 What is (-1 + -31)/(20 + -18)? -2 Calculate 65/182(-6)/(-15). 1/7 What is (-40)/10 + (-155)/(-35)? 3/7 What is the value of (11/(-3))/(15/135)? -3 (-2 - 12/7) + (-18)/63 -4 ((-14)/(-16))/((-11)/22) -7/4 Evaluate -32/8(-2)/6. 1/4 What is the value of 19/5 - (-1 + 5)? -1/5 Evaluate ((-98)/21)/14 - (-1)/(-6). -1/2 Calculate 2/(-8)(3 - 9 - -8). -1/2 6/18 + (-8)/(-3) 3 What is -2 - ((-3)/(-6) + 10/4)? -5 What is the value of (-8)/(-16) - 3/(6/7)? -3 Evaluate (12 - (-490)/(-40))-36. 9 What is the value of (-24)/3 - (19 + -23)? -4 What is the value of (-1)/11 + (-414)/(-198)? 2 Calculate 31/114 + (-4 - (-23)/6). 2/19 Calculate 4/168(-28)/(-8). 1/12 Wh	{ "pile_set_name": "DM Mathematics" }
12? 6 Calculate the remainder when 140 is divided by 67. 6 Calculate the remainder when 155 is divided by 34. 19 What is the remainder when 137 is divided by 24? 17 What is the remainder when 51 is divided by 12? 3 What is the remainder when 198 is divided by 68? 62 Calculate the remainder when 66 is divided by 22. 0 Calculate the remainder when 210 is divided by 77. 56 Calculate the remainder when 1113 is divided by 1086. 27 Calculate the remainder when 1103 is divided by 79. 76 What is the remainder when 286 is divided by 18? 16 Calculate the remainder when 285 is divided by 91. 12 Calculate the remainder when 538 is divided by 110. 98 Calculate the remainder when 433 is divided by 428. 5 Calculate the remainder when 3273 is divided by 14. 11 Calculate the remainder when 25143 is divided by 381. 378 What is the remainder when 730 is divided by 40? 10 What is the remainder when 249 is divided by 40? 9 What is the remainder when 430 is divided by 80? 30 Calculate the remainder when 1544 is divided by 32. 8 Calculate the remainder when 10 is divided by 5. 0 Calculate the remainder when 3 is divided by 1. 0 What is the remainder when 1500 is divided by 108? 96 Calculate the remainder when 626 is divided by 132. 98 What is the remainder when 1186 is divided by 99? 97 Calculate the remainder when 55 is divided by 24. 7 What is the remainder when 497 is divided by 50? 47 Calculate the remainder when 896 is divided by 72. 32 Calculate the remainder when 376 is divided by 23. 8 What is the remainder when 417 is divided by 37? 10 Calculate the remainder when 81 is divided by 20. 1 Calculate the remainder when 14 is divided by 11. 3 What is the remainder when 302 is divided by 61? 58 Calculate the remainder when 330 is divided by 148. 34 What is the remainder when 3423 is divided by 312? 303 Calculate the remainder when 7479 is divided by 174. 171 What is the remainder when 141 is divided by 30? 21 Calculate the remainder when 338 is divided by 35. 23 Calculate the remainder when 5818 is divided by 97. 95 Calculate the remainder when 636 is divided by 221. 194 Calculate the remainder when 597 is divided by 40. 37 Calculate the remainder when 401 is divided by 95. 21 What is the remainder when 1173 is divided by 49? 46 Calculate the remainder when 107 is divided by 61. 46 Calculate the remainder when 147 is divided by 30. 27 Calculate the remainder when 148 is divided by 40. 28 Calculate the remainder when 404 is divided by 134. 2 Calculate the remainder when 2844 is divided by 710. 4 What is the remainder when 223 is divided by 93? 37 Calculate the remainder when 534 is divided by 107. 106 What is the remainder when 2960 is divided by 52? 48 Calculate the remainder when 1901 is divided by 21. 11 What is the remainder when 168 is divided by 29? 23 Calculate the remainder when 5545 is divided by 146. 143 Calculate the remainder when 1975 is divided by 38. 37 Calculate the remainder when 1174 is divided by 47. 46 What is the remainder when 52876 is divided by 23? 22 Calculate the remainder when 11833 is divided by 15. 13 Calculate the remainder when 93 is divided by 19. 17 What is the remainder when 176 is divided by 45? 41 What is the remainder when 174 is divided by 59? 56 Calculate the remainder when 639 is divided by 19. 12 What is the remainder when 124 is divided by 57? 10 What is the remainder when 545 is divided by 21? 20 Calculate the remainder when 55 is divided by 12. 7 Calculate the remainder when 27104 is divided by 54. 50 What is the remainder when 40 is divided by 15? 10 What is the remainder when 96 is divided by 51? 45 Calculate the remainder when 75 is divided by 48. 27 Calculate the remainder when 152 is divided by 18. 8 Calculate the remainder when 196 is divided by 66. 64 Calculate the remainder when 3040 is divided by 179. 176 Calculate the remainder when 371 is divided by 310. 61 What is the remainder when 868 is divided by 44? 32 What is the remainder when 5039 is divided by 6? 5 Calculate the remainder when 1338 is divided by 97. 77 Calculate the remainder when 177 is divided by 81. 15 What is the remainder when 156 is divided by 55? 46 Calculate the remainder when 272 is divided by 68. 0 What is the remainder when 280 is divided by 265? 15 What is the remainder when 1151 is divided by 64? 63 What is the remainder when 66 is divided by 32? 2 Calculate the remainder when 373 is divided by 22. 21 What is the remainder when 228 is divided by 8? 4 What is the remainder when 75 is divided by 45? 30 What is the remainder when 26 is divided by 1? 0 Calculate the remainder when 1413 is divided by 71. 64 What is the remainder when 268 is divided by 100? 68 Calculate the remainder when 34 is divided by 31. 3 Calculate the remainder when 7033 is divided by 21. 19 What is the remainder when 192 is divided by 87? 18 Calculate the remainder when 480 is divided by 69. 66 What is the remainder when 644 is divided by 112? 84 Calculate the remainder when 72 is divided by 39. 33 What is the remainder when 571 is divided by 26? 25 What is the remainder when 231 is divided by 57? 3 Calculate the remainder when 657 is divided by 12. 9 What is the remainder when 318 is divided by 17? 12 What is the remainder when 227 is divided by 33? 29 What is the remainder when 299 is divided by 75? 74 Calculate the remainder when 176 is divided by 9. 5 What is the remainder when 10019 is divided by 218? 209 Calculate the remainder when 87 is divided by 18. 15 What is the remainder when 1399 is divided by 7? 6 Calculate the remainder when 629 is divided by 7. 6 What is the remainder when 300 is divided by 105? 90 What is the remainder when 134 is divided by 36? 26 Calculate the remainder when 527 is divided by 5. 2 What is the remainder when 337 is divided by 116? 105 What is the remainder when 492 is divided by 13? 11 Calculate the remainder when 128 is divided by 10. 8 Calculate the remainder when 288 is divided by 104. 80 What is the remainder when 71 is divided by 18? 17 What is the remainder when 310 is divided by 159? 151 What is the remainder when 44 is divided by 5? 4 What is the remainder when 253 is divided by 64? 61 Calculate the remainder when 135 is divided by 39. 18 Calculate the remainder when 88 is divided by 31. 26 Calculate the remainder when 335 is divided by 80. 15 Calculate the remainder when 704 is divided by 13. 2 Calculate the remainder when 990 is divided by 113. 86 Calculate the remainder when 751 is divided by 16. 15 Calculate the remainder when 783 is divided by 218. 129 What is the remainder when 163 is divided by 85? 78 What is the remainder when 143 is divided by 19? 10 Calculate the remainder when 2748 is divided by 14. 4 What is the remainder when 203 is divided by 54? 41 What is the remainder when 3174 is divided by 18? 6 Calculate the remainder when 1494 is divided by 17. 15 What is the remainder when 868 is divided by 433? 2 What is the remainder when 159 is divided by 81? 78 What is the remainder when 811 is divided by 28? 27 Calculate the remainder when 1115 is divided by 552. 11 Calculate the remainder when 94 is divided by 21. 10 What is the remainder when 118 is divided by 28? 6 Calculate the remainder when 796 is divided by 63. 40 Calculate the remainder when 402 is divided by 381. 21 Calculate the remainder when 162 is divided by 58. 46 Calculate the remainder when 1161 is divided by 97. 94 Calculate the remainder when 210 is divided by 53. 51 What is the remainder when 893 is divided by 133? 95 Calculate the remainder when 467 is divided by 94. 91 What is the remainder when 655 is divided by 73? 71 What is the remainder when 78 is divided by 53? 25 Calculate the remainder when 17 is divided by 6. 5 Calculate the remainder when 66 is divided by 19. 9 Calculate the remainder when 1915 is divided by 383. 0 Calculate the remainder when 378 is divided by 51. 21 Calculate the remainder when 97 is divided by 68. 29 Calculate the remainder when 449 is divided by 118. 95 Calculate the remainder when 202 is divided by 34. 32 What is the remainder when 1377 is divided by 69? 66 What is the remainder when 415 is divided by 106? 97 Calculate the remainder when 144 is divided by 38. 30 Calculate the remainder when 194 is divided by	{ "pile_set_name": "DM Mathematics" }
5x2 - 5x - 2. Suppose -5q + 11 = -19. Let r be a(q). Give v(r). -3 Let y(j) = j + 8. Suppose -7v = -9v - 12. Give y(v). 2 Let w(z) be the second derivative of 3z + 0 - 1/6z4 + 0z*2 + 1/2z*3. What is w(3)? -9 Suppose 3b + 18 = -2d, -3d + 7 = -4b - 0b. Let f(n) = -n*3 - 3n*2 - 4. Determine f(b). 12 Let p = -5 + 7. Let s(c) = -pc - c + 0 - c - 2. Determine s(-3). 10 Suppose 5i + 22 = 4n, 2n - 2 = -i + 2. Let l(t) = t2 - 3t + 3. Determine l(n). 3 Let l(a) = -a*3 + 4a*2 + 2a - 4. Let t(q) = q - 10. Let m be t(14). What is l(m)? 4 Let c(k) = k*3 + 4k*2 - 4k - 1. Let g(q) = -q*2 - 7q - 6. Let t be g(-6). Let p = 5 + t. Suppose -4f - a - 3a - 16 = 0, pf + 29 = 4a. Determine c(f). -6 Suppose -5j + 9 = -2j. Let f be (-2 - (-10)/15)-3. Let p(y) = 2 + 5y - 9 + f + 0. What is p(j)? 12 Let b(u) = 5 - 6 + 0u - u + 2u. What is b(-3)? -4 Let h(b) = 14 + 0b - 14 + 2b. Let y = -6 - -3. Calculate h(y). -6 Suppose 3a - 8a + 20 = 0, 5a = 2x + 8. Let k(f) = -1 + 0f2 + 3 + xf + f*2. Let q be (2/5)/((-1)/10). Determine k(q). -6 Let h = 4 - 3. Let o be (4 - 1)/h-1. Let p(l) = -4l3 + 7l*2 - 5l - 1. Let a(v) = -v3 + v2 - v - 1. Let x(c) = -5a(c) + p(c). Determine x(o). -5 Let v(s) be the first derivative of -7 + 2s*3 - 7/2s*2 + 5s + 1/4s4. Determine v(-7). 5 Let p = 0 + 0. Let i(g) = -g - 7. Calculate i(p). -7 Let p be 1/((-2)/(-4) - 1). Let v be (-14)/(-5) - 4/(-20). Let a(z) = -2 + 2z*2 + 3z*2 - z - vz*3 - 4z*2 + 4z*3. Determine a(p). -4 Let c(f) be the first derivative of -5f*2/2 - 11. What is c(1)? -5 Suppose 3 - 21 = 3z. Let p(l) = -9 + 6l2 - 4l*3 + 3 + 5l3 - l. Calculate p(z). 0 Let t(a) = a2 + a - 5. Let v(c) = -2c - 10. Let u be v(-7). Suppose j - 1 = -u. Let b = j - -3. What is t(b)? -5 Suppose -5m + 4v = -7, -8v + 3v + 10 = 0. Let h(a) be the second derivative of 1/2a*2 + 1/6a*3 + 0 - ma. Give h(-1). 0 Let l(n) = -n2 - n - 11. Let m(j) = j2 + j + 12. Let y(c) = -7l(c) - 6m(c). What is y(0)? 5 Suppose -l = 5i - 29, 3l = l - 3i + 23. Let r(u) be the second derivative of u5/20 - 5u4/12 + u3/3 - 3u2/2 + 2u. Determine r(l). -11 Let f(g) = -g*2 + 2g + 3. Let p(r) = -3r - 68. Let q be p(-24). Determine f(q). -5 Let u = 11 - 3. Let t(o) = -u + 2o + 3 + o - 4. Determine t(6). 9 Let q(n) = -n*3 + 2n2 + n + 2. Let o = 10 - 7. Calculate q(o). -4 Let f(i) be the third derivative of -i4/24 - i*3/2 - 27i*2. Give f(7). -10 Let g(q) be the first derivative of 5q4/4 - q3/3 - q*2 - q - 2. Let m = -90 + 89. Calculate g(m). -5 Let i(g) = -4g - 4. Suppose 5b + 8 = -7. What is i(b)? 8 Let f(b) be the first derivative of -b3/3 + 6. Determine f(3). -9 Suppose -4t = 8 - 0. Let h be ((-1)/t)/(4/16). Let y(f) = -f*3 + 2f*2 + 2f - 3. Calculate y(h). 1 Suppose -2o - 3g = 8 + 1, 0 = 4o - 4g - 12. Let m(a) = -2 + 5a + oa - 8a + 2a. Determine m(3). -5 Suppose 0 = -3r - 0r + 24. Let x(t) = -t*3 + 0 + 2t*3 + 7t - 4 - rt2 + 2t*2. Give x(5). 6 Let t = 2 - 5. Let i = 9 + -7. Let v(y) = 3 - 1 - iy*2 - 5y - 5. Determine v(t). -6 Let k(z) be the first derivative of -z*5/60 - 7z*4/24 - 5z3/6 + z2 - 2. Let v(f) be the second derivative of k(f). Give v(-5). 5 Let d be 2/(-4)32. Suppose -2g = 2g - 8. Let q(c) = -4 + 3cg + 3 + 4c + 0c - 2c*2. Give q(d). -4 Let g = -13 + 23. Let l = g - 6. Let d(n) = n. Determine d(l). 4 Let d = 83 + -81. Let b(t) = 2t + 6t - 3 - 3t. Give b(d). 7 Let r(d) = d + 0d - d2 + 5d*3 - 2d. Let f(z) = z + 4. Suppose -4i - 11 = 9. Let s be f(i). Determine r(s). -5 Let q(w) be the first derivative of -w6/360 - w5/30 - w4/12 + w3 - 1. Let d(g) be the third derivative of q(g). What is d(-4)? -2 Let u be (44/(-12) + 3)6. Let y(o) = -o*2 - 3o + 3. Determine y(u). -1 Let j(z) be the first derivative of -z4/4 - z3/3 + 7z - 3. Determine j(0). 7 Let j(x) be the first derivative of 0x - 1/6x3 - 1/6x*4 - 1/60x*5 - 2x*2 - 4. Let r(v) be the second derivative of j(v). Calculate r(-3). 2 Let n be 1/2(-5 + 3). Let t(g) = -2g3 - 1. Calculate t(n). 1 Let r(a) be the third derivative of a6/360 - a5/60 + 5a*4/24 + 3a2. Let h(v) be the second derivative of r(v). Give h(2). 2 Let i(j) = j + 3. Let x(g) = -g3 - 3g2 - 6g - 3. Suppose -5m - 2 = -q + 4, 0 = 5m - 4q - 6. Let l be x(m). What is i(l)? 8 Let f(c) = -14 + 2c + 28 - 13. Calculate f(-1). -1 Let q(d) = -d + 3. Suppose -17 = 4j - h, 2j + 7 = -2j - h. Calculate q(j). 6 Suppose -2p + 2z = -0 - 4, 0 = -3p + z + 10. Let n(s) = -s*3 + 4s*2 - 3s + 4. Give n(p). -8 Let z(s) = s*3 + 3s*2 + 5s - 2. Let n(v) = -3v3 - 6v*2 - 11v + 5. Let w(h) = -2n(h) - 5z(h). Suppose 16 = 9y - 5y. Determine w(y). 4 Let c be 16/56 + (-5)/42. Let p(b) be the second derivative of -2b + cb*3 + 0 - 1/2b2. Calculate p(1). 0 Let u(q) = q2 - 2q - 1. Let f be u(2). Let r be 5 + 0 + -2 + 0. Let h(i) = 3 - 1 - 4 + r + 13i. What is h(f)? -12 Let v(b) be the third derivative of -b5/30 - b4/24 - b*3/6 - 13b2 + 2. Let g = -1 - 3. Let r = g + 3. Determine v(r). -2 Let p(f) = -f2 - f + 3. Let m(r) = 2r - 3. Let z(s) = -2m(s) - 3p(s). What is z(3)? 21 Let b(m) be the first derivative of 5m*2/2 - 2m + 1. Let r = 190 + -192. Give b(r). -12 Let o(z) = z*3 + 5z*2 - 2. Suppose -2a + 7 = 5y, 0a - 3a = y - 17. Suppose 2 - a = -2s. Suppose -sw = 2 + 8. Give o(w). -2 Suppose -4z + 13 = -7. Let c(m) = -m*3 + 5m*2 + 2m - 6. What is c(z)? 4 Let o be (3/64)/2. Let u be (o - 0)(-1 - 0). Let z(j) = 0j + 1 - 3j - 4j. Determine z(u). 8 Let w = -2 - -4. Let s be (5 + w + -5)-2. Let a(q) = -q*3 - 5q*2 - 3q - 2. Determine a(s). -6 Let m(y) = y*2 - y. Suppose 18 = 12p - 6p. Calculate m(p). 6 Let z(w) = w2 + 5w - 3. Let p be (20/(-8))/((-3)/(-6)). Give z(p). -3 Let c(f) = 0f3 + 2f*2 - 1 - 2f*3 + 0. Let q be c(-1). Let d(x) = 4x - 2x + 2 - q. Calculate d(-4). -9 Let r(c) = 7c*2 + 1. Suppose -2 = -2a - 4. Determine r(a). 8 Suppose 4y + 5x + 50 = -y, -30 = 5y + x. Suppose 3l - 15 = -0l. Let f(r) = 3r - lr + 2r + r. Give f(y). -5 Let f(j) = j*3 + 4j*2 + j - 4. Suppose 9 = 3u - 0u. Suppose ub - 13 + 31 = -5d, b = -5d - 16. Calculate f(d). 2 Let u(v) = -v*2 - 5v. Suppose -2i + 5x - 8 - 1 = 0, 2i = x + 11. Let t be 1 - i/63. Let b be u(t). Let c(d) = -d*2 + 5d. Calculate c(b). -6 Let y be (-2)/2 - (2 - -3). Let l(s) = 1315s2 - 1310s2 + s3 + 2 - 6s - 2 + 1. Calculate l(y). 1 Let b(q) = -q2 - 8q + 3. Let i(v) = -2v2 - 9v + 3. Let s(w) = -3b(w) + 2i(w). Calculate s(3). 6 Let d(y) = 2y2 - 3y + 2. Let m(k) = k - 5. Let p(i) = -i*2 + 8i. Let v be p(7). Let r be m(v). Calculate d(r). 4 Let i be (33/22)/((-6)/(-20)). Let w(j) be the third derivative of 0 + 0j - 1/6j*4 - 1/6j*3 + 1/30ji + j2. What is w(3)? 5 Let j(s) be the third derivative of s*4/24 - 2s*3 + 2s*2. Let o = -18 + 24. Give j(o). -6 Let k(o) = -2o*2 + 14o - 6o + 2 - 8o. Calculate k(-3). -16 Let s = -21 + 15. Let k(f) = 14f2 - 5f. Let q(h) = h*2 - h. Let x(l) = sq(l) + k(l). Calculate x(-1). 7 Let z = -7 - -2. Let x(h) = 2h2 + 13h - 14. Let a(o) = -6o2 - 38o + 40. Let q(s) = 6a(s) + 17x(s). Determine q(z). -13 Let p be 5/(-10)(0 - 6). Suppose 0 = 4c - pj + 7 + 16, 0 = -5c - 4j - 21. Let f(q) be the first derivative of -q3/3 - 3q*2 - 5q - 1. Give f(c). 0 Let j(y) = -y*2 - 10y - 3. Let s be j(-9). Let h = s + -4. Let t(x) = 2x + 2. Give t(h). 6 Let b be 1 - 6/2 - -5. Let z(f) be the first derivative of -f - 4 - 2f + 2 - 1 + 2f2. Determine z(b). 9 Let q(w) be the first derivative of w6/20 + w5/60 + w4/24 + w3/6 - 3w2 + 6. Let z(r) be the second derivative of q(r). Calculate z(-1). -5 Let p(b) = b2 + 2b - 1. Let v be p(1). Let i(t) = -2t3 + 3 + t - t3 + t + 2t3 - 2t*v. Give i(-2). -1 Let l(i) = -6i + 2. Let s(k) = -2k + 3 - 7k + 2k. Let g(r) = 6l(r) - 5s(r). Give g(-6). 3 Let x(v) = v3 - v2 - 3v - 3. Let p = 82 - 84. Determine x(p). -9 Let w(f) = f*2 + 4f - 4. Let x(v) = v*2 - 5v - 7. Let t be x(6). Let q be (-11 - t)1/2. Determine w(q). 1 Let t(o) = -9o - 5 - 1 + o**2 + 15. Determ	{ "pile_set_name": "DM Mathematics" }
11m + 6m2 - 6 - m3. What is the units digit of v(y)? 2 Let u(z) = -33z + 3. What is the tens digit of u(-1)? 3 Suppose -10 = -5i - 0. Suppose is + 3r + 0r = 31, 71 = 4s + 3r. What is the units digit of s? 0 Suppose -23 + 105 = 2r. Suppose 6 = 5b + r. Let t(p) = -p3 - 7p2 - p - 6. What is the units digit of t(b)? 1 What is the tens digit of (-4944)/(-60) + 4/(-10)? 8 Let t(f) = f3 - 7f2 + 6f. Let x be t(6). Suppose r + 3 = x, b - 10 - 14 = 4r. What is the tens digit of b? 1 Let k(b) = b3 + 3b*2 - 5b + 1. Let w be k(-4). Suppose -4p = -wv - 149, -4p - 2v + 135 = 21. What is the tens digit of p? 3 Let j be (-10)/4(-92)/5. Let d = j + -26. What is the tens digit of d? 2 Suppose -2j = -255 - 289. What is the tens digit of (j/(-24))/(2/(-3))? 1 Let v(c) = -5c3 + 2c*2 - c - 1. What is the tens digit of v(-2)? 4 Let t = -1 + 5. Let b(d) = -1 + d + td - 4d. What is the units digit of b(7)? 6 Suppose -2 = -3j - 32. Let d = 14 + j. What is the units digit of d? 4 Let w(m) = -15m - 3. Let l be w(-3). Suppose i - l = -5d - 7, 4i + 3d - 191 = 0. What is the units digit of i? 0 What is the units digit of 20/15 + (-338)/9-3? 4 What is the tens digit of (-6 - 1)(-8 - -3)? 3 Let g(x) = 11x - 33. What is the units digit of g(6)? 3 Let i be -19 + 2/(-4)-2. Let w = i + 29. Suppose -3g + 33 = 3n, -5n + 0n + w = g. What is the tens digit of g? 1 Let y(l) = l*2 + 4l + 2. Let b be y(-5). Let i(z) = -z*2 - 5z - 4. Let d be i(-5). Let f = b + d. What is the units digit of f? 3 Suppose 2 = -4c - 26. Let r(z) = -z3 - 5z*2 + 10z + 6. What is the tens digit of r(c)? 3 What is the units digit of 1/(3(-5)/(-1635))? 9 Let y = 2 + -20. What is the units digit of y(3 + (-7 - -3))? 8 Let b(k) = -k. Let v be b(-4). Suppose 0 = 5w + 10, -3a - 2w = -va + 8. Suppose 0 = -as - 0s + 20. What is the units digit of s? 5 Let r = 258 - 165. What is the tens digit of r? 9 Suppose 0 = 3y - 6y + 9. Suppose -yj = j - 32. What is the units digit of j? 8 Suppose y - 280 = -4x, -2x + y + 131 + 3 = 0. Suppose -15 = 3v - x. What is the units digit of v? 8 Let r = 136 + -74. What is the tens digit of r? 6 Suppose 2u + 65 = 7u + q, 5u = -2q + 70. Suppose 4 = -4a + u. What is the units digit of a? 2 Let x be (2 - 3)(2 - 1). What is the units digit of (x - 5)(-8)/6? 8 What is the units digit of (3 + -2)268/4? 7 Let y(f) = -9f3 - f3 - 1 + 0f3. What is the units digit of y(-1)? 9 Let n(h) = -h3 - 12h2 + 3. Let w be n(-12). Suppose -wq + 5q + 3d = 84, 0 = 4q + d - 178. What is the units digit of q? 5 Let b(q) = 3q. What is the units digit of b(2)? 6 Suppose 6z - 14 - 10 = 0. Let k(y) = 5y + 6. Let d be k(-4). What is the units digit of (d/3)/(z/(-6))? 7 Let w = 6 - 3. Suppose -4 = -s - w. What is the units digit of s? 1 Let t = -11 - -53. What is the units digit of t? 2 Let m be 0/(-32/(-3)). Suppose m = 4j - 5 - 3. Suppose 5a + j = 2g - 0, 5g = -4a + 71. What is the tens digit of g? 1 Let j be 1 - -1 - (-5 - 2). Suppose -3d + 31 = -4k, -3 = 3k + j. Suppose -45 = -4n - n - dy, -y = 2n - 17. What is the units digit of n? 8 Let u(i) = -i*3 + 3i + 2i3 + 3 - 8i*2 - 2i. Suppose -2o + x + 14 = 1, 49 = 5o + 3x. What is the units digit of u(o)? 1 Let v = -5 - -7. Suppose p = v + 5. Suppose 2r - r = p. What is the units digit of r? 7 Let v(r) = r*3 - 8r*2 - 9r + 6. Let k be v(9). Suppose 8d = kd + 60. What is the units digit of d? 0 Suppose 0 = 3s + 2s. Let a = 10 - s. What is the units digit of a? 0 Let u = -10 + 10. Suppose l = 4j - 112, ul + 112 = 4j + 2l. What is the tens digit of j? 2 Let m = 5 - 3. What is the units digit of 11 + (2 - (3 + m))? 8 Let r(h) = 3h - 8. What is the units digit of r(10)? 2 Suppose 1 = 2o + 3. What is the units digit of 1/(o/(-2)) + 3? 5 Let g(v) = 44v2 + 2v + 1. What is the units digit of g(-1)? 3 What is the tens digit of -1(1-24 - 3)? 2 Suppose g - 42 = 5d - 212, -3d = 5g + 738. Let r be g/(-14) - 10/(-35). Suppose -t = 3l - r, t - 4 = 2l - 4t. What is the units digit of l? 3 Suppose 0 = -2p - 1 + 9, 4p = 4z - 16. Let v = z + -7. What is the units digit of v? 1 Let n(f) be the first derivative of f3/3 - f2/2 - f + 2. What is the units digit of n(5)? 9 Suppose 0 = -4b - 3w - 24, -2b - 4w - 10 = -3w. Let u be (-4)/(-14) - (-10)/14. What is the units digit of (1/b)/(u/(-3))? 1 Let q = 21 - 18. Suppose 0l = ql - 75. What is the tens digit of l? 2 Suppose 52 + 1 = v - 5u, 4v = -u + 149. What is the tens digit of v? 3 Suppose 7 = 5q + 2. Suppose -2w + 12 = -4r, r - q = 2r. Suppose wx - 17 = -5s, 4s = 6x - x - 11. What is the units digit of s? 1 Suppose 6s - 2s = 0. Suppose -3n + 0n + 114 = s. Suppose 5l - n = 22. What is the units digit of l? 2 Suppose 4o + 30 = -o. Let u = 16 + o. What is the units digit of u? 0 Suppose 5d - 747 = -4c, -880 = -5d - 5c - 135. What is the hundreds digit of d? 1 Let o(f) = -f*2 + 9f + 1. Suppose b - 2j = 16 - 2, -4b = 2j - 16. What is the units digit of o(b)? 9 Let s(n) = 4n - 51. What is the units digit of s(29)? 5 Let f(k) = k*3 + 4k*2 + 2k - 3. Let w be f(-3). Suppose -4d = -2s + 8, -2d + 4s - 14 = -4. Let t = w - d. What is the units digit of t? 1 Let q = -28 + 40. Let o(j) = 20 + 12j - j2 - 38 + 2j. What is the units digit of o(q)? 6 Let a(l) = l*3 + 4l*2 - 2l - 5. Let o be a(-4). Let k = 9 + o. What is the tens digit of k? 1 Let k be (0 + -1)/((-4)/(-24)). What is the tens digit of 3 + (-14)/4k? 2 Let j be -1((-3)/(-3) - 5). Let q = j - -2. What is the units digit of q? 6 Let n be ((-138)/(-15))/((-1)/5). Let x = n - -82. What is the tens digit of x? 3 Let i be (6/10)/((-2)/10). What is the units digit of 1/(4i/(-60))? 5 Let j = 71 + -51. What is the tens digit of j? 2 Suppose -3n + 274 = 3g + 2g, 5n - 4g = 432. What is the tens digit of n? 8 Let m(p) = -p - 8. Let f be m(-11). Let u(l) = 4l2. Let y(t) = -5t*2. Let d(a) = fu(a) + 2y(a). What is the units digit of d(-2)? 8 Let w(z) = 9z*3 - 2z*2 + z + 1. Let b(k) = -8k*3 + 3k*2 - k - 2. Let c(j) = 3b(j) + 4w(j). What is the tens digit of c(1)? 1 Let m = 21 + -2. What is the units digit of m? 9 Let d(b) = -20b3 + b2. Let q be d(-1). Suppose -y + 2y + 3h = 9, -q = 3y - 3h. Let u(z) = -z + 2. What is the units digit of u(y)? 5 Suppose 4o = 3p - 14, p - 2o = -3p + 22. Suppose 2j = 20 + p. What is the units digit of j? 3 Let v be (0 - 0)(0 + -1). Let p be (-3 + v)1/3. Let a(d) = 8d*2 + d. What is the units digit of a(p)? 7 Suppose 0 = -0g + 4g. Suppose f + 48 = 4v - 3f, g = f - 3. What is the tens digit of v? 1 Let a = -9 - -17. What is the units digit of a? 8 Let i(q) = -2q + 6. Let l(s) = s*2 + 17s + 16. Let g be l(-16). What is the units digit of i(g)? 6 Suppose -5f + 5 = -4f. What is the units digit of f? 5 Let n be (-2)/8 - (-3)/12. Suppose 5s - 507 + 147 = n. Suppose -3w + s = w. What is the tens digit of w? 1 Suppose 0i = -6i + 516. What is the tens digit of i? 8 Let n(j) = -j - 7. Let p be n(-7). Suppose v - 5t - 23 - 8 = 0, p = -2t - 4. What is the units digit of v? 1 Let z be 3/(-9) + (-8)/(-6). Suppose -2f = z - 9. Let w(h) = -h3 + 6h*2 - 7h + 4. What is the units digit of w(f)? 8 Suppose 0a - 1 = -a. What is the units digit of 0 + (2 + -1)a? 1 Let n(t) = t*3 + 9t*2 + 3. Let c = 17 + -26. Let j be n(c). Let g = j - 2. What is the units digit of g? 1 Suppose 0s + 18 = 3s. Suppose 0 = 2l + 2f + 4, l + f = sl - 14. Suppose 3 = -li + 5. What is the units digit of i? 1 What is the units digit of ((-4)/(-2))/(-2)-1? 1 Let t(r) = 5r3 + 23r*2 - 6r + 11. Let s(x) = 2x3 + 8x*2 - 2x + 4. Let q(j) = 8s(j) - 3t(j). What is the units digit of q(5)? 9 Suppose -3t + 2x - 37 = 0, 0x - 47 = 3t - 4x. Let w = t - -14. What is the units digit of w? 5 Let i(r) = -2r - 4. Let w be (5 - 2)/(1-1). Let f be i(w). Let j(l) = l3 - 2l*2 + l. What is the units digit of j(f)? 2 Suppose 4t - 37 = 2o - 7, -2t = -4o. Let m(j) = 2j + 3. What is the tens digit of m(t)? 2 Suppose 2f - 4x = 4f - 206, 5f + 5x - 490 = 0. What is the tens digit of f? 9 Suppose 33 = m + 4t, -3t + 125 = 5m + 11. What is th	{ "pile_set_name": "DM Mathematics" }
utes are there between 2:46 PM and 4:28 PM? 102 How many minutes are there between 2:34 PM and 9:30 PM? 416 How many minutes are there between 12:28 AM and 7:56 AM? 448 How many minutes are there between 9:48 AM and 7:00 PM? 552 How many minutes are there between 5:11 AM and 5:59 AM? 48 How many minutes are there between 10:52 PM and 12:36 AM? 104 What is 121 minutes after 9:17 AM? 11:18 AM What is 38 minutes after 2:09 PM? 2:47 PM How many minutes are there between 11:49 AM and 9:59 PM? 610 What is 693 minutes after 6:01 AM? 5:34 PM How many minutes are there between 6:58 PM and 7:04 PM? 6 How many minutes are there between 6:05 PM and 2:16 AM? 491 What is 63 minutes before 3:39 AM? 2:36 AM What is 655 minutes after 5:49 AM? 4:44 PM How many minutes are there between 3:28 PM and 11:30 PM? 482 What is 283 minutes before 5:49 AM? 1:06 AM What is 171 minutes before 7:28 AM? 4:37 AM How many minutes are there between 3:34 PM and 5:16 PM? 102 How many minutes are there between 8:10 AM and 6:49 PM? 639 What is 709 minutes before 6:15 PM? 6:26 AM What is 408 minutes after 2:20 AM? 9:08 AM What is 52 minutes before 1:31 PM? 12:39 PM How many minutes are there between 3:48 AM and 4:39 AM? 51 How many minutes are there between 2:41 PM and 8:40 PM? 359 What is 102 minutes before 11:51 AM? 10:09 AM What is 274 minutes after 11:09 PM? 3:43 AM How many minutes are there between 7:56 AM and 12:20 PM? 264 How many minutes are there between 10:37 PM and 5:27 AM? 410 What is 172 minutes before 7:45 PM? 4:53 PM How many minutes are there between 9:44 PM and 8:56 AM? 672 What is 91 minutes after 12:30 PM? 2:01 PM What is 664 minutes after 9:14 AM? 8:18 PM What is 386 minutes after 5:03 AM? 11:29 AM What is 355 minutes before 11:30 AM? 5:35 AM How many minutes are there between 8:06 AM and 2:45 PM? 399 What is 445 minutes before 7:52 AM? 12:27 AM What is 97 minutes after 11:20 PM? 12:57 AM How many minutes are there between 6:06 PM and 2:50 AM? 524 How many minutes are there between 4:03 AM and 4:17 AM? 14 What is 56 minutes after 10:30 PM? 11:26 PM What is 538 minutes before 6:19 PM? 9:21 AM What is 646 minutes after 10:02 AM? 8:48 PM What is 136 minutes after 12:28 AM? 2:44 AM What is 700 minutes before 10:16 AM? 10:36 PM How many minutes are there between 12:18 PM and 6:25 PM? 367 How many minutes are there between 5:47 AM and 12:41 PM? 414 How many minutes are there between 8:41 AM and 10:31 AM? 110 How many minutes are there between 1:16 PM and 6:05 PM? 289 What is 386 minutes before 7:58 PM? 1:32 PM How many minutes are there between 5:03 AM and 11:59 AM? 416 How many minutes are there between 4:52 PM and 9:38 PM? 286 How many minutes are there between 5:24 PM and 2:31 AM? 547 How many minutes are there between 1:12 PM and 3:07 PM? 115 How many minutes are there between 11:25 AM and 3:37 PM? 252 How many minutes are there between 3:22 AM and 2:50 PM? 688 What is 597 minutes before 12:24 PM? 2:27 AM How many minutes are there between 10:11 PM and 12:56 AM? 165 How many minutes are there between 12:32 AM and 10:41 AM? 609 What is 504 minutes after 5:23 AM? 1:47 PM What is 337 minutes before 11:30 AM? 5:53 AM How many minutes are there between 7:43 AM and 6:13 PM? 630 How many minutes are there between 4:09 PM and 5:05 PM? 56 How many minutes are there between 7:04 AM and 10:59 AM? 235 What is 353 minutes after 8:43 AM? 2:36 PM How many minutes are there between 12:57 PM and 7:22 PM? 385 What is 98 minutes after 6:51 AM? 8:29 AM What is 4 minutes before 4:14 AM? 4:10 AM How many minutes are there between 6:13 AM and 3:56 PM? 583 How many minutes are there between 7:51 AM and 2:30 PM? 399 How many minutes are there between 7:23 PM and 2:46 AM? 443 What is 165 minutes after 4:43 PM? 7:28 PM How many minutes are there between 3:45 AM and 8:43 AM? 298 What is 243 minutes after 12:22 PM? 4:25 PM What is 679 minutes after 1:40 PM? 12:59 AM What is 520 minutes after 9:13 AM? 5:53 PM What is 492 minutes before 5:37 AM? 9:25 PM How many minutes are there between 11:27 AM and 11:09 PM? 702 What is 92 minutes after 5:37 PM? 7:09 PM How many minutes are there between 4:34 PM and 7:48 PM? 194 What is 405 minutes before 7:58 PM? 1:13 PM What is 88 minutes before 2:51 PM? 1:23 PM What is 706 minutes before 8:31 PM? 8:45 AM How many minutes are there between 6:36 AM and 9:12 AM? 156 What is 264 minutes after 10:39 PM? 3:03 AM What is 184 minutes before 11:06 PM? 8:02 PM What is 82 minutes before 9:31 PM? 8:09 PM How many minutes are there between 6:20 AM and 6:02 PM? 702 How many minutes are there between 9:51 PM and 12:20 AM? 149 What is 355 minutes after 5:28 PM? 11:23 PM What is 584 minutes after 1:14 PM? 10:58 PM What is 559 minutes after 1:25 PM? 10:44 PM What is 148 minutes before 2:29 PM? 12:01 PM What is 36 minutes after 7:55 AM? 8:31 AM How many minutes are there between 7:45 PM and 1:05 AM? 320 What is 558 minutes after 11:13 PM? 8:31 AM What is 646 minutes before 10:03 PM? 11:17 AM What is 92 minutes before 4:43 AM? 3:11 AM What is 443 minutes after 6:10 AM? 1:33 PM How many minutes are there between 11:06 AM and 3:59 PM? 293 What is 315 minutes before 8:32 AM? 3:17 AM What is 508 minutes before 6:52 AM? 10:24 PM How many minutes are there between 3:25 AM and 3:31 AM? 6 How many minutes are there between 10:15 AM and 8:51 PM? 636 How many minutes are there between 12:28 PM and 3:57 PM? 209 What is 398 minutes after 10:56 AM? 5:34 PM How many minutes are there between 7:49 AM and 6:53 PM? 664 How many minutes are there between 2:24 AM and 10:07 AM? 463 How many minutes are there between 12:13 PM and 12:51 PM? 38 What is 289 minutes after 6:50 PM? 11:39 PM What is 52 minutes after 5:18 AM? 6:10 AM What is 456 minutes after 1:42 PM? 9:18 PM What is 253 minutes after 12:46 PM? 4:59 PM What is 320 minutes before 4:37 PM? 11:17 AM What is 493 minutes before 10:17 PM? 2:04 PM How many minutes are there between 11:29 PM and 8:21 AM? 532 What is 473 minutes before 5:53 PM? 10:00 AM What is 373 minutes after 1:59 PM? 8:12 PM What is 401 minutes after 8:07 AM? 2:48 PM What is 9 minutes before 12:12 AM? 12:03 AM How many minutes are there between 9:14 PM and 9:23 PM? 9 What is 681 minutes after 8:22 AM? 7:43 PM What is 709 minutes after 6:13 AM? 6:02 PM How many minutes are there between 1:55 PM and 10:45 PM? 530 What is 374 minutes before 2:13 AM? 7:59 PM How many minutes are there between 1:44 PM and 11:56 PM? 612 What is 371 minutes after 3:56 AM? 10:07 AM What is 445 minutes before 5:32 PM? 10:07 AM How many minutes are there between 3:38 PM and 11:38 PM? 480 How many minutes are there between 9:14 PM and 2:36 AM? 322 What is 558 minutes after 8:53 PM? 6:11 AM How many minutes are there between 11:29 PM and 10:29 AM? 660 What is 394 minutes before 2:11 PM? 7:37 AM How many minutes are there between 11:03 AM and 7:15 PM? 492 What is 302 minutes after 10:44 PM? 3:46 AM How many minutes are there between 10:39 AM and 9:07 PM? 628 What is 321 minutes after 4:52 PM? 10:13 PM How many minutes are there between 10:46 AM and 1:32 PM? 166 How many minutes are there between 1:08 PM and 1:33 PM? 25 How many minutes are there between 4:18 PM and 4:04 AM? 706 How many minutes are there between 7:44 PM and 3:22 AM? 458 How many minutes are there between 10:40 PM and 6:13 AM? 453 How many minutes are there between 1:25 AM and 12:01 PM? 636 What is 664 minutes after 9:34 PM? 8:38 AM How many minutes are there between 3:23 AM and 6:03 AM? 160 How many minutes are there between 11:04 AM and 1:40 PM? 156 What is 406 minutes before 11:21 AM? 4:35 AM How many minutes are there between 2:43 PM and 2:08 AM? 685 How many minutes are there between 2:49 PM and 2:31 AM? 702 How many minutes are there between 11:31 PM and 3:35 AM? 244 What is 11 minutes after 6:55 AM? 7:06 AM What is 265 minutes after 9:06 AM? 1:31 PM What is 264 minutes after 11:57 PM? 4:21 AM How many minutes are there between 5:29 PM and 5:01 AM? 692 How many minutes are there between 5:51 AM and 12:51 PM? 420 How many minutes are there between 10:43 AM and 6:55 PM? 492 What is 132 minutes before 6:34 PM? 4:22 PM What is 643 minutes before 2:58 AM? 4:15 PM What is 130 minutes before 12:14 PM? 10:04 AM What is 123 minutes afte	{ "pile_set_name": "DM Mathematics" }
closest to -58? (a) 2/13 (b) 0.2 (c) m c Let h(b) = -2b - 46. Let x be h(-25). What is the closest to -0.2 in x, -3/4, -9/4? -3/4 Let g be 2358/(-7995) - 2/13. Let p = 2/41 + g. What is the closest to p in -3, -4, -5? -3 Let z = 3.08 - 0.08. Let m = 11 + -13. What is the closest to 2/9 in -1, z, m? -1 Let u = 4.3 - 9.3. Let h = -8 - -13. What is the nearest to 0.1 in h, 1, u? 1 Let s = -2.02 - -0.02. Suppose 1 = -2x + 3p, -4x - 1 = 4p - 9. Which is the nearest to x? (a) 1/3 (b) 2 (c) s a Suppose 11 = f - 0f. Let n be (f/3 + -2)-3. Let d(g) = -g3 + 11g*2 + 24g + 28. Let o be d(13). What is the nearest to 1/2 in 0, n, o? 0 Let p be 40/(-30)(-2)/(-2)3. Let w = 1195/7 - 171. What is the closest to -1/3 in -3/4, w, p? w Let d = -46.5 + 47. What is the nearest to -1 in -3, -1/4, d? -1/4 Let r = -2.4 + 2.4. Which is the closest to 2/7? (a) -1/3 (b) 4 (c) r c Let c be 196/(3 - 7) + 1. Let j be ((-8)/c)/(1/(-4)). What is the closest to j in -0.3, 1/2, 3? -0.3 Let o be 3 - ((-58)/(-18) + 0). Which is the closest to 5/7? (a) -1/7 (b) -1 (c) o a Let j be (30/200)/(3/(-2)). Which is the nearest to 0? (a) -1/3 (b) j (c) -0.5 b Suppose -2r = -2s + 20, 0 = -3r + 7r + 4s. Let g be (-2)/(0 + 1) + r. Let t be (-2)/2 - 10/g. Which is the closest to -1? (a) -1/5 (b) t (c) -2/3 c Let a = 0.1 - 0.3. Let d = -0.3 - a. Suppose -4k + k + 2w - 19 = 0, -2k - 2w + 4 = 0. What is the closest to d in -1/2, 2/5, k? -1/2 Let p = -15.6 + 16. Which is the nearest to -3/7? (a) p (b) -1/2 (c) 2/13 b Let x = -0.7 + 0.66. Let d = x - -3.04. Which is the closest to -1? (a) 0.1 (b) d (c) -2 c Let m be (-9)/(-42)(-4)/(-3). Which is the nearest to 1/2? (a) m (b) 2 (c) -3 a Let g be (2/(-4))/((-1)/4). Let d = 0.2 + -0.1. What is the closest to 1/3 in g, 2/13, d? 2/13 Let v = 0.122 + 0.178. What is the closest to v in -2, -3, 4/11? 4/11 Let j = 10.7 + -22. Let x = -11 - j. Suppose -2q = -6, o - 2q = 2o - 7. Which is the nearest to o? (a) x (b) 0.4 (c) 0 b Suppose 4o + 13 = q, -2o + o = 5q - 2. What is the closest to -1 in q, 2, 7/5? q Let i(d) = -d - 8. Let m be i(-6). Let j be -2 + (m - (-27)/6). Which is the closest to j? (a) 0.5 (b) 0 (c) -2/3 a Suppose -2h - m + 4 = 8, 5m + 20 = 0. What is the nearest to h in -4, 0.3, 2? 0.3 Let d = 235/1353 - -1/123. What is the nearest to 7 in 3/5, 1/4, d? 3/5 Let y = -28 + 33. What is the nearest to -0.1 in y, -0.4, 3/7? -0.4 Let h = 27 - 26.94. Which is the closest to -1? (a) -2 (b) 0.2 (c) h a Let t be (10/(-1))/5 - 40/(-18). What is the nearest to -0.2 in t, 1, 0.2? 0.2 Let f be (-4)/(-18) + 72/405. Which is the nearest to f? (a) -2 (b) 1 (c) 1/9 c Suppose 2x + 2i - 20 = 0, -x - 2i + 18 = -3i. Suppose r + 1 = -x. Let h be (-11)/r + 2/(-6). Which is the nearest to h? (a) -0.1 (b) 1/2 (c) 3/2 b Let y = 2 + 1. Let k(d) = -d*3 - 3d*2 + 3d - 2. Let u be k(-4). Which is the closest to -0.2? (a) y (b) 0.3 (c) u b Let j = 7.94 - 8. Let i = 0.36 + j. What is the nearest to -0.1 in 2/3, 2, i? i Suppose -3d + 5d = 10. Suppose -dk + 2 = -3. Which is the closest to 0.2? (a) -4 (b) k (c) 3 b Suppose -4o - 4 = -5o. Suppose -m + 5 + 0 = 0, -op = 2m - 2. Let r be (p/(-4))/((-3)/(-3)). Which is the nearest to r? (a) 5 (b) 0 (c) -5 b Let z = 1.1 - 1.2. Which is the nearest to z? (a) 1/4 (b) 0 (c) -0.3 b Suppose -10v + 11v + 2 = 0. What is the nearest to -8 in 0.3, v, -5? -5 Let q = 10 + -7. Let m = -426 + 426.4. What is the nearest to 1/4 in q, -1/3, m? m Let m = 133/3 + -45. Let p = 64 + -321/5. What is the closest to p in -4, -5, m? m Let d = -19.4 - -16. Let o = d + 3. Let u = 3/22 - -1/22. What is the nearest to -0.1 in u, -0.5, o? u Let t be 18/7 + 54/126. Which is the closest to -0.1? (a) 0 (b) t (c) 1/6 a Suppose 8w + 10 = 3w. Let c be (-8)/(-6) - (w - -3). What is the closest to -2/7 in -1/7, -2/11, c? -2/11 Let p = 16 + -16.1. Suppose -2y + 4 = -3y. Which is the closest to p? (a) y (b) -3/5 (c) 3 b Let n = -43 - -48. Let w = 0.9 + -1. Let q = w - 0.2. Which is the closest to -1? (a) q (b) n (c) 0.2 a Let u = 8.86 + 0.14. Let m = u + -12. What is the closest to -0.1 in m, 1, -4? 1 Let x = 7 - 7.3. What is the nearest to -3 in 4, x, -3/5? -3/5 Let c = 0.09 + -0.19. What is the nearest to 0.1 in -1, c, -2? c Let q = 0.01 + -0.01. Let s = 0 - q. Which is the nearest to -2? (a) 0.5 (b) s (c) 2/11 b Suppose 0 = s - 3u - 11, 13 = 6s - s - u. Suppose 5t - 25 = -sp, p - 17 = -0t - 4t. Let y = 3 + -2.9. What is the closest to y in 0, t, 2? 0 Let w = 0.1 - 0.2. Suppose 12s - 5s - 168 = 0. Suppose -4 = -2r - u, 2r - r = 5u + s. What is the closest to w in r, -2/5, 3? -2/5 Let q = 0.37 - 0.3. Let r = q - 5.07. Let s = -0.09 + 0.59. What is the closest to 0.1 in r, s, -0.4? s Let w = 3 + -2. Let c = -0.09 - 5.91. Let k = c + 5.7. What is the closest to 0 in -0.5, k, w? k Let f = 0.3 + -0.4. Let u = 0.7 - -0.3. Let g = 4 - u. What is the nearest to 2 in g, 2, f? 2 Let r = 7.4 + -3.4. Let q = 1.95 + -2. What is the closest to 0 in 1, r, q? q Let p = -119 + 121. Let n = 10 - 5. Which is the closest to -0.1? (a) -2/7 (b) p (c) n a Let l be ((-12)/(-93))/(9 + -11). Which is the nearest to -0.1? (a) 1 (b) 0.3 (c) l c Let r = -0.33 - -0.33. Which is the nearest to r? (a) -1 (b) 0.1 (c) 3 b Let c = -1 + 1.4. Let v = c - 0.3. Let f = -104 + 104.1. What is the closest to v in f, 0.5, 5? f Let q = 8/5 + -6/5. Which is the closest to q? (a) 0.2 (b) -0.2 (c) 0 a Let t = -0.1 - -0.2. Let z = -15.8 + 12.8. What is the nearest to t in -0.03, z, 3? -0.03 Let h = 17 + -16. What is the closest to -1/2 in h, -0.4, -8? -0.4 Let k = -161 - -1130/7. Which is the closest to 2/3? (a) k (b) 0.4 (c) 3 a Let z = 6.7 - 7. What is the nearest to 1 in 0.4, z, -2? 0.4 Let q be (-1 + (-14)/(-12))-8. Let l = -8 - -7. What is the closest to 0.1 in -2/7, q, l? -2/7 Let g = 50 + -249/5. Which is the closest to g? (a) -0.5 (b) -0.9 (c) -4 a Let p be 1/((14/(-2))/(-1)). Let u = 3138622/65 + -48289. Let g = 30/13 + u. Which is the nearest to g? (a) -0.4 (b) -5 (c) p a Let y be (-44)/16 + -1 + 4. Let s = 0.4 + -0.4. What is the nearest to s in 2, y, -4? y Let a = -0.341 - -0.041. What is the nearest to 2 in 0, a, 5? 0 Let r(y) = -y + 2. Let u be r(0). Let a be 2/4-1-10. Suppose p + 3 = 4n - 5, -5n = ap + 15. What is the nearest to n in -2, u, -1? u Let m = 3 + -3. Let s = 3 + -13. Let c = s - -10.4. What is the closest to -2 in m, -3, c? -3 Let g be (2/(-20))/((-6)/24). What is the nearest to 2 in g, -4, 3? 3 Let o = 93 - 97.3. Let p = -0.25 - 0.05. Let i = o - p. What is the closest to -2/5 in i, 2, -5? 2 Suppose 3c + 7 = -2. Let s = 51 - 155/3. Let y = -27/8 + 77/24. What is the nearest to s in 3, y, c? y Let j = -183/865 - -2/173. Let y = 0.11 - -3.89. Let p = y - 3. Which is the nearest to p? (a) 2/5 (b) -4 (c) j a Suppose 5m = -17 + 2. Which is the closest to 0? (a) m (b) 0.2 (c) -1 b Let p = -307/217 - -35/31. Let h = -0.2 + -0.2. Which is the nearest to p? (a) -0.5 (b) 3/8 (c) h c Let x(o) = o + 8. Let y be x(-6). Suppose -3m - 2k = -2m + 5, -4k - 8 = 0. Let l = m + y. Which is the nearest to l? (a) -5 (b) 2/3 (c) 0.1 b Let u be (-836)/(-35) - (-5 + 5). Let s = u + -118/5. Let g = 2.3 - 2. What is the closest to s in -2/3, -2, g? g Let z = -3.4 + 3. Let j = 0.43 - 0.13. Which is the closest to 1? (a) 1 (b) z (c) j a Let w = 4.4 - -0.6. Which is the closest to 2? (a) 0 (b) 3 (c) w b Let q(t) = -t*3 - 5t*2 + 5t - 8. Let y be q(-6). Let v be y + (-1)/(0 + 1). Which is the nearest to 0.1? (a) 0.1 (b) -1/3 (c) v a Let f be 2/(-10) - (-2)/10. Let p be (-6)/(-75)(f + -1). Let m = 1.9 - -0.1. Which is the closest to 0.1? (a) p (b) m (c) -2/5 a Let f(p) = -p3 - 6p*2 + 2. Let v be f(-6). Suppose -z - v + 4 = 0. What is the closest to 5 in z, -1, -5? z Let o = -0.076 + -7.924. Which is the closest to 0.2? (a) -3 (b) 1 (c) o b Let f = -1767/7 - -252. Let m = -1 - -1. Suppose -2 = -2o + 4. Which is the nearest to m? (a) f (b) 4 (c) o a Let p = -0.1 + 2.1. What is the closest to 2 in -5/3, -3/5, p? p Let s = -179/9 - -20. Let p = 0.5 - 0.8. Which is the nearest to 0.1? (a) p (b) -2/3 (c) s c Let v = -1.3 - -	{ "pile_set_name": "DM Mathematics" }
9326 for t. 55 Solve -2548g + 17039 = -19490 - 27171 for g. 25 Solve 775p - 3003 + 464 = -1530 + 14491 for p. 20 Solve -168r + 414r - 687r = 547r - 37544 for r. 38 Solve -285k = 393k + 330k - 915 + 8979 for k. -8 Solve -718a - 505a - 110168 = 120a - 171a for a. -94 Solve 35805 = 139g + 40670 for g. -35 Solve 323t + 366t + 8247 = -76881 + 9338 for t. -110 Solve -440c + 3013 + 3766 = 83c + 503 for c. 12 Solve -65329 - 48055 - 46808 = -2503k for k. 64 Solve 73x + 568 = -6030 + 28 for x. -90 Solve 183l + 55080 = 735l + 258l for l. 68 Solve 540 = -6231o + 6186o for o. -12 Solve -41n - 399 = 48n - 7n - 6631 for n. 76 Solve -1041w + 17480 + 1036 = -1263 for w. 19 Solve 19w + 84w - 32 = -547 for w. -5 Solve -6197j + 94848 = -4373j for j. 52 Solve -3818n - 57866 = 190304 for n. -65 Solve -16s - 2537 = 29s - 4s - 405 for s. -52 Solve -2427s + 5001s + 4455s - 193560 = -2649s for s. 20 Solve 1322u = -54177 - 12593 - 5824 - 26556 for u. -75 Solve 7976 + 1459 = 111i for i. 85 Solve 1185f + 1130f + 4617 = 2144f for f. -27 Solve 53937 - 51695 = -118n for n. -19 Solve -1431k - 709k = -471k - 75105 for k. 45 Solve 1585 + 1056 = 565r - 2677 - 2027 for r. 13 Solve 9040p - 141245 - 520527 = -92252 for p. 63 Solve -31l - 26l + 46l + 441 - 1167 = 0 for l. -66 Solve 822q + 17415 + 1595 = 205q - 12457 for q. -51 Solve 28c + 1646c = 26784 for c. 16 Solve -5667 = 418t - 14777 - 6356 for t. 37 Solve -503b + 258b - 367 = 122b for b. -1 Solve -442m - 800m + 229557 = 168699 for m. 49 Solve -859z + 989z + 6370 = 0 for z. -49 Solve -315m + 44906 + 26956 = 369m + 13038 for m. 86 Solve -295p + 12122 - 4157 = 0 for p. 27 Solve -213x = -1527x - 3645 + 11853 + 58806 for x. 51 Solve -163w - 2045 + 419 = 4242 for w. -36 Solve -3308 = -599o - 7812 - 8075 for o. -21 Solve -363x + 5110 - 56 = 368 - 15642 for x. 56 Solve 5227c - 2584c = 2600c - 860 for c. -20 Solve 2720 = -82o + 4360 for o. 20 Solve -211t = -365t + 657t + 854t - 115345 for t. 85 Solve 76v = 37v + 228v + 165v + 7434 for v. -21 Solve -22p - 98p + 2291 = 731 for p. 13 Solve -154y + 248y = 143y - 931 for y. 19 Solve 128u - 180 = 40u + 2u + 26u for u. 3 Solve -2260v + 42992 - 14283 = -122711 for v. 67 Solve 765r + 9051 + 3136 = -520r - 14798 for r. -21 Solve 357r - 1107r + 330r - 710 = -349r for r. -10 Solve 1073g - 8g + 287g = -1817g - 326407 for g. -103 Solve 1682g - 14726 - 34931 + 2764 - 33843 = 0 for g. 48 Solve -629w - 8554 = -811w for w. 47 Solve 0 = 355x + 3762598 - 3737038 for x. -72 Solve 5401i - 3685i + 36036 = 0 for i. -21 Solve 640 = -94b + 15b + 1576 - 5834 for b. -62 Solve -1432c - 123773 - 110847 = 628c - 90420 for c. -70 Solve -159v + 37v = -5002 for v. 41 Solve -153o - 689 - 55 = -29o for o. -6 Solve -31p = 69p + 75p + 12p - 2805 for p. 15 Solve -14o = -147o - 119o - 6552 for o. -26 Solve 101f - 1057 = -0f - 0f - 3784 for f. -27 Solve 663b + 561b + 645b = -2560 + 691 for b. -1 Solve -89r = -9r + 2960 + 3398 - 2118 for r. -53 Solve 49r + 82r + 47r = -0r - 16376 for r. -92 Solve 201z + 15330 - 44240 = -44z for z. 118 Solve -161c + 920c - 275 - 605 = 638 for c. 2 Solve -1398n + 22028 = 77948 for n. -40 Solve -4365 - 4139 = -651y + 35113 for y. 67 Solve 2026 + 2220 = 142f + 980 for f. 23 Solve -261 - 86 = -36q + 373 for q. 20 Solve -659j - 76j - 16575 = 540j for j. -13 Solve 0 = 27429k - 27309k - 3480 for k. 29 Solve -43h + 122h + 15714 = -115h for h. -81 Solve 11747i + 813977 = -2950 + 153504 - 945916 for i. -137 Solve 27599 = 1343u + 419u - 45883 - 18142 for u. 52 Solve -5133 = -2428v + 146426 - 15591 for v. 56 Solve -587z + 328z - 8800 = -369z for z. 80 Solve -11975 + 154 = 776h + 30859 for h. -55 Solve 70n + 6986 = -159n - 4693 for n. -51 Solve -44a = -134a - 29a - 4522 for a. -38 Solve -79j = -263897 + 266978 for j. -39 Solve -359923f - 14256 = -360055f for f. 108 Solve -53614 + 52504 = 74j for j. -15 Solve 40j + 2151977 - 2154417 = 0 for j. 61 Solve -206a + 90a + 31a - 18 = 322 for a. -4 Solve 0 = 7404241d - 7404162d for d. 0 Solve -1389p - 48 = -1403p + 372 for p. 30 Solve 346c = 384 + 5498 for c. 17 Solve 29796 - 49840 - 57265 = 2851i + 5370 for i. -29 Solve -98318c = -99990c + 173888 for c. 104 Solve -53p + 3241 = -628p - 5384 for p. -15 Solve 229341i - 228374i + 71558 = 0 for i. -74 Solve -5423648g + 5423383g + 6685 + 3650 = 0 for g. 39 Solve -31722 = -t - 31783 for t. -61 Solve -309b + 5124 = -456b + 208b for b. 84 Solve 10g + 275 = -52 - 63 for g. -39 Solve -10a + 4a - 40 = -30 + 44 for a. -9 Solve 12n = -20n - 15n + 899 - 3014 for n. -45 Solve 52305 = 15955d - 15218d + 150326 for d. -133 Solve -12950i + 12811i = 2363 for i. -17 Solve -68466 = 101i - 60184 for i. -82 Solve 9872r - 9774r - 2548 = 0 for r. 26 Solve 12278 - 23675 = 1644r + 27741 + 6894 for r. -28 Solve 0 = -123u - 649 + 855 - 2543 for u. -19 Solve 43327824j - 26980 = 43327540j for j. 95 Solve -27117 - 19169 - 17920 = 522b for b. -123 Solve 122p + 2456 + 2546 = 0 for p. -41 Solve 0z + 8z - 457 + 175 = 14z for z. -47 Solve -20u + 398 + 1681 = -78u - 19u for u. -27 Solve -1318l + 371l - 12051 = 33405 for l. -48 Solve -582b - 41001 + 72429 = 0 for b. 54 Solve 8004 + 2099 + 7223 = -153p - 2411 for p. -129 Solve 0 = -2496t + 7482t - 229356 for t. 46 Solve -34660v + 34858v - 1188 = 0 for v. 6 Solve -105g - 745 + 2571 + 2664 = 710 for g. 36 Solve 2259i + 51224 - 12917 = 180i - 57327 for i. -46 Solve 860h + 17432 + 11808 = 0 for h. -34 Solve -101m + 9483 = 4534 for m. 49 Solve 0 = -1094t - 7525 - 75619 for t. -76 Solve 40721 = -4686u + 1450u - 39368 - 7283 for u. -27 Solve -168v - 623v = -88v + 71003 for v. -101 Solve 0 = -6v - 2v - 3v + 5v + 354 for v. 59 Solve 167617o = 167544o - 146 for o. -2 Solve 132j - 1007 + 552 = 4033 for j. 34 Solve 261z + 7381 = -682z + 46469 - 2311 for z. 39 Solve -218a - 2313 - 1903 = 141a - 235a for a. -34 Solve 88i - 3120 - 2480 = 8i for i. 70 Solve 1924s = -60245 + 8297 for s. -27 Solve 390w + 131w - 65940 + 41974 = 0 for w. 46 Solve -243t + 964 - 4211 - 20753 = 257t for t. -48 Solve 500q + 33q - 47629 = 65q + 14147 for q. 132 Solve 17897o - 4771o = -118277 - 91739 for o. -16 Solve 15488o - 12893o = 57090 for o. 22 Solve 545v + 72624 + 24921 = -257v + 1305 for v. -120 Solve 1882n - 13280 = -670n + 21071 + 14137 for n. 19 Solve 126i = 328i + 318i + 30680 for i. -59 Solve 0 = 284p - 404p + 286p - 1328 for p. 8 Solve -1937 = 31f - 11f - 997 for f. -47 Solve 322t - 245t = -144t - 5304 for t. -24 Solve -76q + 1683 = 4720 + 2055 for q. -67 Solve -161c - 1560 - 1004 - 3144 = 732 for c. -40 Solve 20613c = 21659c + 60668 for c. -58 Solve -76n + 360 + 1473 = 16n - 1663 for n. 38 Solve 27151 + 24945 = 1184a for a. 44 Solve -1897b + 102473 = -11347 for b. 60 Solve 52711f - 52721f - 610 = 0 for f. -61 Solve -286p - 37380 = 231p + 17p for p. -70 Solve 116y = -4451 - 1582 + 1277 for y. -41 Solve -269z = 113863 - 121395 for z. 28 Solve 524a + 2008 - 4040 = 13164 for a. 29 Solve -2795u + 5595u - 177 = 2797u for u. 59 Solve 1479v + 101790 = 643v - 2028v - 2791v for v. -18 Solve 179u - 6u = 37u + 2584 for u. 19 Solve 686 = 181u - 86u + 5151 for u. -47 Solve -13l - 912 = -15l - 115l + 3l for l. 8 Solve 431s + 336s - 1562 = 3040 for s. 6 Solve 0 = -190c + 1042c - 64752 for c. 76 Solve -3096 = -4926l + 5055l for l. -24 Solve 87487 - 3629 = 303l + 413l + 11542 for l. 101 Solve -81x - 21032 = -31x + 101x + 88x for x. -88 Solve -10608 = 1369612v - 1369748v for v. 78 Solve 754 = 27f + 916 for f. -6 Solve -889l + 346l - 26940 = 1702l for l. -12 Solve -68 + 263 = 6l - 45l for l. -5 Solve 2849241h - 2849469h = -19152 for h. 84 Solve -2464n + 751n + 36975 = 1084n + 235562 for n. -71 Solve 20j + 364j + 2881 = -6719 for j. -25 Solve -28839 - 72770 = -2363d for d. 43 Solve -230919y + 230775y = -7056 for y. 49 Solve -2331u - 22851 = 17924 + 10507 for u. -22 Solve -787f - 447f - 4112 + 24952 = 850f for f. 10 Solve -947c - 870c + 40584 = -64802 for c. 58 Solve -39t - 162 + 1970 = -491*t for t. -4 Solve	{ "pile_set_name": "DM Mathematics" }
s the z'th term of -2918, -4154, -6218, -9104, -12806, -17318, -22634, -28748? z*3 - 420z*2 + 17z - 2516 What is the g'th term of 34, -141, -658, -1685, -3390, -5941, -9506, -14253? -28g3 - 3g*2 + 30g + 35 What is the f'th term of -1167, -4164, -7165, -10170? -2f2 - 2991f + 1826 What is the j'th term of 616124180, 1232248360, 1848372540? 616124180j What is the i'th term of 1267, 2178, 2941, 3556, 4023? -74i*2 + 1133i + 208 What is the a'th term of -3566404, -3566391, -3566378, -3566365, -3566352, -3566339? 13a - 3566417 What is the i'th term of -2714933, -5429909, -8144887, -10859867, -13574849, -16289833, -19004819? -i2 - 2714973i + 41 What is the d'th term of 1159, 2489, 3999, 5695, 7583, 9669, 11959, 14459? d*3 + 84d*2 + 1071d + 3 What is the z'th term of -5935, -47287, -159481, -377941, -738091? -5904z3 + 3z*2 - 33z - 1 What is the i'th term of 9226582, 18453176, 27679770, 36906364, 46132958, 55359552? 9226594i - 12 What is the a'th term of 1663253, 1663251, 1663249? -2a + 1663255 What is the k'th term of 1012749549, 1012749550, 1012749551? k + 1012749548 What is the a'th term of 24718002, 49436005, 74154008, 98872011? 24718003a - 1 What is the t'th term of 166085, 166021, 165959, 165899, 165841, 165785, 165731? t2 - 67t + 166151 What is the h'th term of 1575, 5868, 13013, 23004, 35835, 51500, 69993? -h*3 + 1432h*2 + 4h + 140 What is the a'th term of 5081975, 20327901, 45737779, 81311609? 5081976a2 - 2a + 1 What is the h'th term of 17438, 69739, 156892, 278897, 435754? 17426h2 + 23h - 11 What is the l'th term of 1005464, 1005467, 1005470, 1005473, 1005476? 3l + 1005461 What is the x'th term of -89822, -182659, -275496, -368333? -92837x + 3015 What is the x'th term of -3281267, -3281245, -3281223, -3281201, -3281179? 22x - 3281289 What is the k'th term of -2920, -4199, -7664, -14407, -25520, -42095, -65224, -95999? -182k3 - k2 - 2k - 2735 What is the r'th term of 5212, 5140, 4944, 4618, 4156, 3552, 2800, 1894? -r3 - 56r*2 + 103r + 5166 What is the u'th term of -490, -1327, -2516, -4051, -5926, -8135? u*3 - 182u*2 - 298u - 11 What is the k'th term of 26983, 25756, 24517, 23260, 21979? -k*3 - 1220k + 28204 What is the a'th term of -154021, -154006, -153991? 15a - 154036 What is the r'th term of 509324351, 1018648705, 1527973059, 2037297413, 2546621767? 509324354r - 3 What is the q'th term of -15228, -14787, -14340, -13887? 3q2 + 432q - 15663 What is the j'th term of -17048, -68196, -153438, -272774, -426204, -613728? -17047j2 - 7j + 6 What is the a'th term of -29706, -118979, -267768, -476073? -29758a2 + a + 51 What is the w'th term of 30968, 61853, 92738? 30885w + 83 What is the p'th term of -208168, -208238, -208314, -208396, -208484, -208578? -3p2 - 61p - 208104 What is the i'th term of -2697, -5542, -8391, -11244? -2i2 - 2839i + 144 What is the o'th term of -20757737, -20757740, -20757743, -20757746? -3o - 20757734 What is the x'th term of 18823, 37708, 56667, 75700? 37x*2 + 18774x + 12 What is the v'th term of 64822, 518488, 1749872, 4147834, 8101234, 13998932, 22229788, 33182662? 64810v3 - v2 - v + 14 What is the y'th term of -10832, -21768, -32680, -43562, -54408? y3 + 6y*2 - 10961y + 122 What is the p'th term of -7822040, -62576333, -211195120, -500610647, -977755160, -1689560905, -2682960128? -7822041p3 - p2 - 3p + 5 What is the f'th term of 17222, 17106, 16946, 16736, 16470, 16142, 15746? -f*3 - 16f*2 - 61f + 17300 What is the l'th term of 25297406, 50594807, 75892206, 101189603, 126486998, 151784391? -l*2 + 25297404l + 3 What is the d'th term of 189914, 189839, 189730, 189587? -17d2 - 24d + 189955 What is the i'th term of -2463205, -4926415, -7389625, -9852835? -2463210i + 5 What is the z'th term of 28635, 28682, 28719, 28746? -5z*2 + 62z + 28578 What is the l'th term of 180567016, 180567017, 180567018, 180567019? l + 180567015 What is the c'th term of -7178, -14310, -21440, -28568, -35694, -42818? c*2 - 7135c - 44 What is the m'th term of -61546238, -61546240, -61546242? -2m - 61546236 What is the o'th term of -6409, -8682, -10955, -13228? -2273o - 4136 What is the u'th term of -37744, -75459, -113174, -150889? -37715u - 29 What is the h'th term of 3027, 6158, 9359, 12630, 15971? 35h*2 + 3026h - 34 What is the g'th term of -554224, -554343, -554462, -554581, -554700? -119g - 554105 What is the w'th term of 16529, 18900, 21271, 23642, 26013? 2371w + 14158 What is the n'th term of 583469689, 583469688, 583469687, 583469686? -n + 583469690 What is the q'th term of 217, 1744, 6005, 14404, 28345, 49232? 234q3 - 37q*2 + 20 What is the c'th term of 170599, 340470, 510341, 680212? 169871c + 728 What is the c'th term of -55601, -110411, -165209, -219995, -274769? 6c2 - 54828c - 779 What is the w'th term of 6457329, 6457218, 6457107, 6456996? -111w + 6457440 What is the p'th term of -31450, -37919, -44378, -50821, -57242, -63635, -69994? p3 - p2 - 6473p - 24977 What is the l'th term of 51211, 102397, 153547, 204661, 255739, 306781, 357787? -18l2 + 51240l - 11 What is the g'th term of -836192, -1672370, -2508556, -3344750, -4180952, -5017162, -5853380? -4g2 - 836166g - 22 What is the y'th term of -513080, -2052302, -4617666, -8209172, -12826820? -513071y2 - 9y What is the d'th term of 418, 1810, 4158, 7462, 11722, 16938, 23110? 478d2 - 42d - 18 What is the r'th term of 253, 183, 55, -143, -423? -2r3 - 17r*2 - 5r + 277 What is the c'th term of -4775, -4775, -4761, -4733, -4691, -4635, -4565? 7c2 - 21c - 4761 What is the k'th term of 11895, 10926, 9957, 8988? -969k + 12864 What is the l'th term of -535, 1734, 4003? 2269l - 2804 What is the w'th term of 2308, 3942, 5550, 7120, 8640, 10098, 11482? -2w3 - w2 + 1651w + 660 What is the k'th term of 13732, 27467, 41208, 54955? 3k2 + 13726k + 3 What is the h'th term of -34, -421, -794, -1147, -1474? h3 + h2 - 397h + 361 What is the l'th term of 31859, 63753, 95621, 127457, 159255? -l3 - 7l*2 + 31922l - 55 What is the z'th term of -51941, -104462, -156981, -209498, -262013, -314526, -367037? z*2 - 52524z + 582 What is the x'th term of 174570, 349200, 523830? 174630x - 60 What is the a'th term of 5730245, 11460490, 17190739, 22920992, 28651249? 2a*2 + 5730239a + 4 What is the o'th term of 8887, 8880, 8857, 8812, 8739? -o*3 - 2o*2 + 6o + 8884 What is the i'th term of -14882, -41822, -68762, -95702, -122642? -26940i + 12058 What is the a'th term of -55280, -54981, -54492, -53819, -52968? -a3 + 101a*2 + 3a - 55383 What is the c'th term of 371465, 371436, 371407, 371378, 371349, 371320? -29c + 371494 What is the f'th term of -1147327, -2294449, -3441559, -4588651, -5735719, -6882757? f3 - 1147129f - 199 What is the w'th term of 3230, 14531, 33360, 59717, 93602? 3764w2 + 9w - 543 What is the z'th term of -14492021, -28984042, -43476065, -57968090? -z*2 - 14492018z - 2 What is the b'th term of 117496, 235026, 352558, 470092? b*2 + 117527b - 32 What is the j'th term of 348165, 696346, 1044529, 1392714, 1740901? j*2 + 348178j - 14 What is the g'th term of 2785, 5701, 8635, 11587, 14557? 9g2 + 2889g - 113 What is the l'th term of 11799, 7012, 2225? -4787l + 16586 What is the d'th term of 721043, 1442175, 2163307, 2884439, 3605571, 4326703? 721132d - 89 What is the i'th term of -5650422, -5650433, -5650446, -5650461? -i*2 - 8i - 5650413 What is the k'th term of 149, -3745, -15729, -39847, -80143, -140661, -225445? -674k3 - k2 + 827k - 3 What is the z'th term of -262980, -525947, -788914, -1051881? -262967z - 13 What is the m'th term of 1872758, 1872756, 1872754, 1872752, 1872750? -2m + 1872760 What is the n'th term of 34527, 68914, 103167, 137286? -67n2 + 34588n + 6 What is the f'th term of -6417451, -6417474, -6417497? -23f - 6417428 What is the r'th term of 278682, 556625, 834568, 1112511, 1390454, 1668397? 277943r + 739 What is the x'th term of -5694, -11973, -18252, -24531, -30810? -6279x + 585 What is the s'th term of -38310, -37158, -36006? 1152s - 39462 What is the f'th term of 226166, 904799, 2035868, 3619373, 5655314, 8143691? 226218f2 - 21f - 3	{ "pile_set_name": "DM Mathematics" }
Collect the terms in -3444p - 398p*2 + 6894p - 5 + 5 - 3450p. -398p*2 Collect the terms in 865 + 334 - 15499a - 60 + 15501a. 2a + 1139 Collect the terms in -3390h - 3904h - 3 + 3 + 6714h. -580h Collect the terms in 2129l - 21l*2 + 2135l - 4264l + 1203l*3. 1203l*3 - 21l*2 Collect the terms in -4m + 3474 + 4m + 3468 - 10738 + 3796 - 62m*2. -62m*2 Collect the terms in -971k + 695k - 8 + 8 + 272k. -4k Collect the terms in -28g + 13g - g + 6g + 15g + 5g. 10g Collect the terms in 3514x*2 - 25 - 10558x*2 + 3519x*2 - 17 + 3522x*2. -3x*2 - 42 Collect the terms in -141524i*2 + 71903i*2 + 69619i*2. -2i*2 Collect the terms in 23r - 281r - 172 - 3402r. -3660r - 172 Collect the terms in -3n*3 - 15n*3 + 3n*3 - 21n*3 - 21n*3 - 2n*3. -59n*3 Collect the terms in -18 + 33u - 5u + 3u. 31u - 18 Collect the terms in -4 + 21 - 20 - 2s*2 - 49s*3. -49s*3 - 2s*2 - 3 Collect the terms in 99511f - 298911f + 99884f + 99546f. 30f Collect the terms in -184 + 363 - 244l - 164. -244l + 15 Collect the terms in -278b2 - 280b*2 - 293b*2 - 326b*2 + 1097b*2. -80b*2 Collect the terms in 4p + 3p + 2787 - 5p + 2894 - 3p. -p + 5681 Collect the terms in -1 - 376574954141b*2 - 1 + 376574954148b*2 + 8. 7b*2 + 6 Collect the terms in -8p + 39365 - 78701 - 2p2 + 37897. -2p*2 - 8p - 1439 Collect the terms in -5g - 8g - 4g - 24g + 5g - 10g - 5. -46g - 5 Collect the terms in -29889o + 3 - 1 - 10 + 29892o - 6. 3o - 14 Collect the terms in -66n3 + 1246n*3 - 338n*3 - 4n + 1835n3 + 3. 2677n*3 - 4n + 3 Collect the terms in 133671 + 5w - 5w + 30w3 - 133673. 30w*3 - 2 Collect the terms in -27l + 1855l2 + 448l*2 + 952l*2 + 4l + 4l. 3255l*2 - 19l Collect the terms in n - 790951143 + 790951143. n Collect the terms in 23s - 23s - 166507s3 + 39730s*3. -126777s*3 Collect the terms in -423j*3 + 2 + j - 2j + 5j. -423j*3 + 4j + 2 Collect the terms in 24606n2 - n3 + n + 447588 - 24606n2. -n3 + n + 447588 Collect the terms in 29f2 - 321f - 318f + 639f + 0f2. 29f*2 Collect the terms in -207v + 16727 - 33446 + 16719. -207v Collect the terms in -25431749v*3 - 25431455v*3 + 76294952v*3 - 25431746v*3. 2v*3 Collect the terms in -538a*3 + 86260666 - 86260666. -538a*3 Collect the terms in -771y*2 + 1568y*2 - 767y*2. 30y*2 Collect the terms in 461l - 243l - 2l*2 - 4150 - 218l. -2l2 - 4150 Collect the terms in 18450r + 15559r + 7396r + 18097r + 5395r. 64897r Collect the terms in 1313374k*2 + 1313379k*2 + 1313371k*2 + 1313371k*2 - 7880243k*2 + 1313377k*2 + 1313378k*2. 7k*2 Collect the terms in 88i - 89i + 12i + 107i + 129i + 1 + 0. 247i + 1 Collect the terms in -30568 + 30568 + 5497j*3. 5497j*3 Collect the terms in -2q - 2q - 2q*2 + 12711q*3 - 13732q*3 + 0q*2. -1021q*3 - 2q*2 - 4q Collect the terms in 212 + 366192t - 212 + 366193t - 732329t. 56t Collect the terms in 72k + 43k + 33k + 61k. 209k Collect the terms in 14400f - 43185f + 139 + 14395f + 14393f. 3f + 139 Collect the terms in 3711t + 6567t + 4718t - 5051t. 9945t Collect the terms in -227z*2 - 758z + 758z - 20 + 9 + 7. -227z*2 - 4 Collect the terms in -10 - 477g*2 - 37g - 22 + 480g2 + 5g*3 - 3. 5g*3 + 3g*2 - 37g - 35 Collect the terms in -162773a3 + 19637a - 19637a. -162773a*3 Collect the terms in -104 + 27 - 4201s*2 + 77 + 12406s*2. 8205s*2 Collect the terms in 1 + 220v*2 + 2v + 217v2 - 645v*2 - 86v*3 + 208v*2. -86v*3 + 2v + 1 Collect the terms in 8105j2 - 2047j*2 - 2028j*2 - 2036j*2 - 2026j*2. -32j*2 Collect the terms in -948g*2 + 1 + 473g*2 + 473g*2 + 16609g. -2g2 + 16609g + 1 Collect the terms in 1091c3 + 1172c*3 - 5787c*3. -3524c*3 Collect the terms in -643 + 33g - 33g - 639 - 27g*3 + 1282 + 7g*3. -20g*3 Collect the terms in 144l - 190l - 3 + 2943l*2 + 45l. 2943l2 - l - 3 Collect the terms in 1662 + 1648 + 1658 - 84o - 6615 + 1647. -84o Collect the terms in -62a*3 + 441a*3 - 471a*3 - 6a*3. -98a*3 Collect the terms in 15572173k*3 - 15571966k*3 - 2k + 2k. 207k*3 Collect the terms in -769 - 17f*2 + 752 + 16f2. -f2 - 17 Collect the terms in -2417p + 751p - 1338p - 570p. -3574p Collect the terms in -659u*2 - 2u + 4u - 527u*2 + 1009u*2. -177u*2 + 2u Collect the terms in -9907q + 24345q - 14453q + q3. q3 - 15q Collect the terms in -38l - 77l - 101l + 13l. -203l Collect the terms in 2104y*2 - 3664y*2 - 1165y*2 - 2438y*2. -5163y*2 Collect the terms in -7655w + 4292w + 2 - 14225w - 15568w. -33156w + 2 Collect the terms in 2 - 2u + 381u*2 + 112u*2 - 79u*2 + 1700u*2. 2114u*2 - 2u + 2 Collect the terms in -92288w3 - 8950w + 8950w. -92288w*3 Collect the terms in 4486d + 1272d + 3039d + 3168d - 2023d. 9942d Collect the terms in 554552b - 1107483b + 553600b. 669b Collect the terms in 121l*2 + 66072490425l - 66072490425l. 121l*2 Collect the terms in s + 1 - 14528s*3 + 9 - 12. -14528s*3 + s - 2 Collect the terms in -51g - 808g + 597g - 2305g - 1073g. -3640g Collect the terms in -24m + 155m3 + 24m - 127m3 + 247m*3. 275m*3 Collect the terms in -19p*3 - 16p*3 - 13p*3 - 9266 + 46p*3. -2p*3 - 9266 Collect the terms in 5 - 185y*2 + 25y*2 + 53y*2 + 51y*2 + 54y*2 - 5. -2y*2 Collect the terms in 7t*2 + 11t*2 - 2t*3 - 124t*2 + 446t*2 - 340t*2. -2t*3 Collect the terms in 51a*2 + 6a*3 + 62a*2 + 17a + 64a2. 6a*3 + 177a*2 + 17a Collect the terms in 36363y - 36363y - 37008y2 + 74020y*2 - 12y*3 - 37012y*2. -12y*3 Collect the terms in -10900629122 + 10900629122 - 39q + 9q. -30q Collect the terms in -244n3 - 99n*3 + 496n*3 + 1286n*3. 1439n*3 Collect the terms in 1581l*2 - 2382l*2 - 1615l*2 - 3110l*2 - 3508l*2. -9034l*2 Collect the terms in -44r + 2107551 - 2107551. -44r Collect the terms in 7393x - 3819x + 23933x. 27507x Collect the terms in 1838a*3 + 1677a*3 - 3785a*3. -270a*3 Collect the terms in 8380b*3 + 7958b*3 - 16685b*3. -347b*3 Collect the terms in 140184 - 70142 + l - 70042. l Collect the terms in -835w + 7w3 + 2013w - 8w3 - 502w. -w*3 + 676w Collect the terms in -42p3 - 4p*3 - 147p + 44p3. -2p*3 - 147p Collect the terms in 416 + 181o + 388 - 179o + 385 - 1189. 2o Collect the terms in 246b + 2023b + 2836b + 373b. 5478b Collect the terms in -w + 6487 - w + 6495 + 6460 - 19442. -2w Collect the terms in 13090z + 2 - 3983z + 2935z. 12042z + 2 Collect the terms in 286448o - 573650o + 286826o. -376o Collect the terms in -13553u - 53u2 + 2 + 27119u - 13551u. -53u*2 + 15u + 2 Collect the terms in 248 + 392 - 53 - 7h + 2h - 55. -5h + 532 Collect the terms in -36f - 149f + 9 + 223f - 39f. -f + 9 Collect the terms in 135254v*3 - 270530v*3 + 134971v*3. -305v*3 Collect the terms in 32u + 68 + 93 - 67 + 139 - 39u. -7u + 233 Collect the terms in -2525w3 - 2 + 6 - 17576w*3 - 4. -20101w*3 Collect the terms in -9x*3 - 5057x*2 - 5054x*2 + 15148x*2 - 5046x*2. -9x*3 - 9x*2 Collect the terms in 216s + 1778s - 2183s. -189s Collect the terms in 3220355r*2 - 1073460r*2 - 1073431r*2 - 1073463r2. r2 Collect the terms in -37a - 2a*2 + 88636042 - 88636042. -2a*2 - 37a Collect the terms in 8 + 100269x2 + 85987x*2 - 4 - 4. 186256x*2 Collect the terms in 3954g*3 - 63935g*3 + 3071g*2 - 6143g*2 + 3071g*2 + 145g*3. -59836g3 - g2 Collect the terms in 3 - 4f2 - 2f*2 + 19 + 4350f + 4f2. -2f*2 + 4350f + 22 Collect the terms in -153z2 + 151z*2 + 558z - 463z + 1409z + 2886z. -2z*2 + 4390z Collect the terms in 5m + 9m - 26m + 6m - 383875 + 5m. -m - 383875 Collect the terms in 3199232 + 3199245 - 8v - 6398477. -8v Collect the terms in -17855j + 5995j + 5980j + 5878j. -2j Collect the terms in 1759a3 + 65a*3 - 656a*3. 1168a*3 Collect the terms in -730274n*3 + 365089n*3 + 365177n*3. -8n*3 Collect the terms in 73315	{ "pile_set_name": "DM Mathematics" }
24/(-5). Suppose x = 14q + 6q. Solve -7 = 2w - 6m + m, -qw - 2m = -22 for w. 4 Suppose 8t - 70 - 90 = 0. Let j be ((-4)/5)/((-4)/10). Solve 4a = -jq + t, a - 8 = q - 3a for q. 4 Let u(l) = 96l - 3835. Let i be u(40). Let k = -1 - -4. Solve -c + 1 = 0, kp + ic - 2 = -0p for p. -1 Suppose -70v + 192 = -22v. Solve 3y + 3 = vh, 0 = -h + 2h + 4y + 4 for h. 0 Let x = -322 - -322. Solve 0 = -r + 5w + 2 - 14, x = 4r - 4w for r. 3 Suppose -3o + 13 = -3v - v, -5v + 4o = 15. Let y be ((-36)/14)/(v/49). Let b be (-840)/(-108) - (-4)/y. Solve -2 = n + 5i, 2n + 2n + 5i + b = 0 for n. -2 Let x = 473 + -473. Solve 5f + 2c - 7 = 6f, -3c + 15 = x for f. 3 Let w(c) = -c*2 + 8c + 13. Let h(s) = 2s2 - 5s + 2. Let k be h(3). Let n be w(k). Solve m = 4f + 14 + 2, 4f + n = 4m for f. -3 Let o(m) = -m2 - 8m - 1. Let f(a) = 2a2 + 24a + 2. Let v(u) = -3f(u) - 8o(u). Let b be v(4). Solve 5q - bc = -13, 7 = -q + 2q + 2c for q. -1 Let h = -694 - -698. Solve 0 = 4s + 4u - 28, hs + s - u = 11 for s. 3 Let t be 4 + 1 + -2 + (-1 - -2). Let u be (-2)/6 - 12/(-9). Suppose 3d + u = td. Solve 9 = -3z, -p + 0z = -z - d for p. -2 Let h(y) = 3y - 2. Let b be h(2). Suppose -m - 2m = -2f + 2, 0 = -2m + 2f - b. Solve -5l + 2 = -2t, 2l + 0l - mt - 2 = 0 for l. 0 Suppose -2m = -8m. Suppose m = 57b - 53b - 8. Let t be (-2)/6 - (-26)/6. Solve 1 = 2i + q - 4q, -bq = -ti - 10 for i. -4 Let u(s) = 2s*2 - 55s - 23. Let o be u(28). Solve -4d + 8 = -b + 5b, ob - d + 2 = 0 for b. 0 Suppose -9y - 99 = -12y. Let j = -31 + y. Solve -2k - 13 = u + jk, 3u + 12 = -3k for u. -1 Let o = -27 - -144. Let s = o + -57. Solve 5z + 33 = 2m, 5m - s + 25 = 3z for m. 4 Let h be (-2 + 3)/(1/10). Suppose 15 = hr - 5r. Solve -3n + 5g = -8n, 4n + rg + 5 = 0 for n. -5 Let c = -30 + 2. Let x = c + 30. Solve 3s = 3q + 15, x - 1 = -q - 3s for q. -4 Let d = 103 - 43. Suppose -2i - 32 = -2z, -6z + d = -4z + 5i. Solve -10 = 3f - 5q, z = 2f + 5q - 15 for f. 5 Let u = 264 - 261. Solve 4d - 5r = -r + 20, r = -ud + 15 for d. 5 Let t = 73 + -68. Solve d = -2n - 12, 6n - 3n = -td - 32 for n. -4 Suppose 3v = 4o + 29, -5v + 3o = -2v - 24. Solve -vw - 7 = 4q, 2w - 5w = 3q + 6 for q. -1 Let z = -19 + 22. Solve -3q = 4a - 5, 7 = za + 3q + 1 for a. -1 Let d = -2 - -5. Suppose -5i = -2q + 42 + 4, 0 = 4i + dq + 23. Let k be ((-2)/(-4))/((-2)/i). Solve 4c - 8 = z + 8, -5c = -kz - 23 for c. 3 Suppose -7 + 55 = 3j. Suppose -4b + 0b = -3m + 12, j = 3b + 4m. Suppose 6 = 4z + 2l - 4, 4l - 4 = b. Solve -5a = -q + 10, -4 = zq - q + 2a for q. 0 Let x be 3 + 10 + -5 - (5 - -1). Solve f - 5 = -a + xa, 4f - a = 5 for f. 0 Let a(v) = v + 14. Let y be a(-10). Suppose -124 = -4b - yn + 2n, b - 20 = 5n. Let h be (-6)/b - (-22)/10. Solve -20 = 2u + 3q - q, -15 = u + hq for u. -5 Let l(j) = 7j*2. Suppose -x - 1 = -2. Let y be l(x). Let q(d) = 3d + 4. Let r be q(6). Solve -r = -z + 2n - yn, 3z - 3n + 24 = 0 for z. -3 Suppose 12h + 2 = 11h - 3u, -2h = 2u - 16. Solve -h = 5v + g, v + 8 = 3v - 4g for v. -2 Let n = -311 + 314. Solve 4h + 16 = -s, 0 = -h - 0s + ns + 9 for h. -3 Suppose -16v + 11v = 715. Let c be 2/3 - v/33. Solve -2n = -cm - 0m + 15, -9 = 3n - 3m for n. 0 Let g = 2219 - 2215. Solve gt + r - 13 = -0t, 3t = -r + 10 for t. 3 Suppose 12f + 73 = 181. Solve -4n + 43 = 4d + 15, 0 = -3d + f for n. 4 Suppose 0 = -5b - h - 3h - 12, -h - 3 = -4b. Let c = 220 - 224. Let s be 6 + (c - (b + -1)). Solve s = v, 3v = 2j + v - 4 for j. 5 Let z be 12 + 12/((-3)/1) + -8. Solve z = -3v - 14o + 10o, -4v - 3o - 7 = 0 for v. -4 Let a = 24 + -20. Suppose -4y + 21 = -m, -am - 7y = -2y. Let v = m + 5. Solve j = -3g + 13, vj + 5g = j + 11 for j. 4 Suppose -4l = -4m, -4l + 5 = -14m + 11m. Solve 0 = -5y + z - m, -2y + z - 2 = 3 for y. 0 Let w be -1 - (-4)/(-4)-4. Solve 0 = 4a + 3y + 2y - 16, wa - 2y = -11 for a. -1 Let k = -22 - -31. Solve -3u - 2d = -k, -u + 4d = 3 - 20 for u. 5 Let k = -500 - -502. Solve -c + k = 4, c = -5w + 8 for w. 2 Let x be (-8)/18/(128/(-6)). Let c be 42/8 - 7/28. Solve 7o + 3z = 4o, xo = -cz - 8 for o. 4 Suppose -9 = 7s - 6s + 3k, -s - 5 = 2k. Solve 0 = 2w - 3q + 12, 0q + 12 = -5w + sq for w. 0 Let b be (-1)/(4/6) - (-33)/(-2). Let a be ((-7)/3)/(-1) - b/27. Solve -v = -3y + 5, -v + 4y = av + 20 for v. -5 Suppose -z + 144 = 142. Solve 8 + 6 = 5v + zd, -d = -v for v. 2 Let g = 102 - 98. Solve -5a + 25 = -4a + 5p, ga - 32 = -3p for a. 5 Suppose 3 = -7v + 10v. Suppose -5 + v = -4s. Solve -5r + 3q + 0 = s, 2q = -6 for r. -2 Suppose 94 = 5d - 6. Solve -2a + 3l = 2a - 12, 5a + 5l = -d for a. 0 Let w(u) = u*3 - 5u*2 + u - 1. Let z be w(5). Suppose 0 = -i - 2m + 6, 2i - z = -3m + 6. Solve 5f - ih = -16, 3 = -4f + h - 8 for f. -2 Let v be ((-60)/50)/(3/(-10)). Suppose -vk = -33 + 17. Solve -kp = -3p + 4c + 6, 0 = p + 3c + 4 for p. 2 Let v be 4/(-6)((-38)/4 + 5). Let j = 15 - 13. Solve 3l - jg = l + 10, 0 = 5l - vg - 21 for l. 3 Let z(d) = d3 + 2d*2 + 3d + 23. Let c be z(-3). Solve -3f - 1 = -4f - 2u, -2u + 19 = -cf for f. -3 Let r = 39 - 24. Let q be 56/r + 3/(-3). Solve o - 8 = 4l - q, -l - 5o - 28 = 0 for l. -3 Let g be ((-2)/(-10) - 105/(-225))3. Let n = 5 - 3. Suppose -4o - 7 = -3k - 0k, 3k = -5o - n. Solve b + 3 - k = 0, 8 = -2v - gb for v. -2 Suppose -28 = -10r + 22. Solve -z = j - 4j + 8, rz - 14 = -3j for j. 3 Suppose -152a - 15 = -157a. Solve -23 = aw - 4p, -27p + 4 = -25p for w. -5 Suppose -4n + 0v - 88 = 5v, -n = v + 21. Let w = 17 + n. Solve 5b + wb - 1 = -3l, b = -2l + 3 for b. -1 Let h = -111 + 119. Let o = 28 - h. Solve 0 = 3f - 3m, -3f - m - o = -0 for f. -5 Let a = -943 - -945. Solve 2i = -3z + 7, i - a = -0i for z. 1 Let i(k) = k2 - 3k + 6. Let p be i(5). Suppose 23h + p = 27h. Solve -hm - 19 = v - 9m, 3m = -4v - 7 for v. -4 Suppose -4c = 2k - 40, 18 = -3c - k + 49. Let d = 16 - c. Solve 3j = -du + 9, j - 3 = -2u - 0 for u. 0 Let h(l) = l*3 - 16l*2 - 17l + 2. Suppose 3z - 30 = 21. Let w be h(z). Solve -wr - 4 = 2o, 5o + 0r - r - 20 = 0 for o. 3 Let g be ((-1)/(-2))/(510/500). Solve -5c = 3m - 15, -gm + 20 = -m + c for m. 5 Suppose -o = 2 - 5. Suppose 0 = 5g - oz - 97, 2g - 3z - 37 = -0g. Solve 0 = 2d + 4i + g + 2, -i - 6 = d for d. -1 Suppose -56 = -5a + 4k, -3k = 3a + 2k - 4. Let r = -9 - -9. Suppose a = 4v - r. Solve 4y = -j - 4j - 15, 0 = -y + vj - 7 for y. -5 Let p(n) = 6n*2 + n. Let i be p(1). Let k be (-130)/(-40) - -22/(-16). Let x = k + 1. Solve 0 = -xy - 2u + 6, iu = -3y + 2u + 1 for y. 2 Let k = -346 + 353. Solve z - 11 = x - 3x, z + x - k = 0 for z. 3 Suppose 2k - 5j + 29 = 0, 2k - 3j + 4 + 27 = 0. Let n = k + 23. Let d = 9 - n. Solve -p - 3l - 7 - d = 0, -4p + 40 = -4l for p. 5 Suppose 28 = 3j - 4r - 0r, 0 = 5r + 20. Solve 0 = -4g - j, -15 = 3a + a + 3g for a. -3 Suppose 3k + 21 = b - 0b, 3k = -2b - 12. Suppose 2r + 12 = 2x, 3r = x + 7r - 26. Let t = x + k. Solve -y - 2 = o, 0 = 3y - y + to + 14 for y. 3 Suppose 20s = 226 - 186. Solve -3y - 4w = -2, -3y + sw = -5y for y. -2 Let w be (8/6)/((-16)/(-24)). Let v(x) = -w + 0 - 8x + 2x*2 + 6x + 4x. Let u be v(-2). Solve 2b + 2n = -u + 6, -5n = -10 for b. 0 Let a = -3 - -12. Suppose -am = -98 - 145. Solve 0 = -2s - 2l - 12, -1 = 3s + 5l + m for s. -1 Let i = -1805 + 1809. Solve -2f + 3 = -ir + 31, 5r = 4f + 41 for r. 5 Let b = -344 + 349. Solve -2c + 2r = 0, -bc - 3r + 19 = -5 for c. 3 Let z(a) = -a3 - 3a*2 + 2. Let r be z(-3). Suppose 5b = 3q + 10, rq + b - 20 = -q. Solve 4i - qj = -6 - 29, 0 = -3j + 9 for i. -5 Let a be 1/(-5) + (-42)/(-10). Suppose -50 = az - 166. Suppose z = 4n + 5f, -5n + 4f = -f + 20. Solve -p - 4x + 11 = -n, 4p - x - 14 = 0 for p. 4 Let s = 4898 + -4883. Suppose 2y + 14 = 4i - 0y, -y = -1. Solve iu + 18 = 2a, -5u - 4a = a - s for u. -2 Let a(i) = 2i*2 + 3i + 1. Let o(w) = w + 7. Let k be o(-9). Let c be a(k). Let h = 2 + c. Solve -33 = -3x + hq - 13, -18 = -3x + 3q for x. 5 Let h(s) = -3*s - 4. Let	{ "pile_set_name": "DM Mathematics" }
3 + 8k3 - 7k - 6 + 0. Calculate b(-4). 7 Let i(c) = c2 - c - 1. Let w be i(3). Let s(u) = u - 7. Let p be s(w). Let h(k) = k3 - 2k. Determine h(p). -4 Suppose 4m - 4f = -m + 7, 4f = -5m + 23. Let a(s) = -s3 + 3s*2 + 1. Determine a(m). 1 Suppose 0 = -2p + 19 - 23. Let b(i) = 4i2 - 1. What is b(p)? 15 Let k(u) = 1. Let z(j) = -16j*3 - 2j*2 + 7. Let s(m) = -6k(m) + z(m). Calculate s(1). -17 Let a(j) = -2j2. Let s(v) be the third derivative of 7/6v*3 - 2v*2 + 0v + 0 - 1/6v4 - 1/60v*5. Let h be s(-5). Calculate a(h). -8 Suppose 0 = 5i + 14 - 4. Let n(w) = -w3 - w2 + w. Let a(r) = 8r3 - 3r*2 + 4r - 1. Let c(f) = in(f) + a(f). Suppose 2g = 4 - 2. Determine c(g). 10 Let y(p) = -p + 7. Let w be (-1 - 4)/(2/10). Let u be (w/(-15))/(4/12). What is y(u)? 2 Let n(b) = b*2 + 10b - 1. Let z(g) = g*2 + 5g. Let p(d) = -3n(d) + 5z(d). Give p(4). 15 Suppose 2i + 0i - 6 = 0. Let h(u) = -u + i - 5 + 5. Let o(a) = -a*3 + 2a*2 - a - 2. Let r be o(2). Determine h(r). 7 Let b(x) = 5x*2 - 3 - 35x - x*3 + 0x*3 + 16x + 18x. Let h = 5 - 0. Calculate b(h). -8 Let l(u) be the third derivative of u5/60 - u4/24 - u3/3 + u2. Let q = 64 - 62. Calculate l(q). 0 Suppose 2u + 2t = -14, -3u + 3t - 15 + 0 = 0. Let z(m) = -4 + 0 - m + 0. Determine z(u). 2 Let b(j) = -j + 7. Let u(g) = -15g + 16. Let x(n) = 7n - 8. Let o(k) = -6u(k) - 13x(k). Let l(t) = -4b(t) + 3o(t). What is l(0)? -4 Let i(q) = q - 7. Suppose -5a - 45 = 5g, 0 = 4g + 2a + 27 - 1. Let u(k) = -k + 6. Let n(z) = gi(z) - 5u(z). Let b be (-2)/(-4)(5 - -1). Give n(b). 1 Let r(i) = i - 8. Let p be r(7). Let b = p - -3. Let w(u) = 2 - bu - 2u + 1. Determine w(2). -5 Let g(c) = 2c2 - 5c - 3. Let r be ((-2)/(-2))/((-1)/(-4)). Give g(r). 9 Let v = -17 + 8. Let o = 13 + v. Let b(g) = -g*2 + 5g - 1. What is b(o)? 3 Let p(s) = -s3 + s2 + s. Let n(b) = 3b3 - 8b*2 - b - 1. Let l(f) = -n(f) - 4p(f). What is l(-3)? 19 Let d be (10/4 - 0)44/55. Let l(q) = q2 - 3q + 3. Determine l(d). 1 Let j(h) = -2h2 + 5h + 4. Suppose 5b - 2p - 3 = 21, -5b + p = -22. Give j(b). -8 Let w(i) be the second derivative of -i3/6 - i2/2 + 2i. Give w(-7). 6 Let h be (-6)/(-5)15/6. Suppose -hg = -g + 8. Let j(y) be the first derivative of -y*2 - 2y + 3. Give j(g). 6 Let j(c) be the third derivative of 1/8c4 - 5c*2 + 0 - 1/6c*3 + 0c. Determine j(-3). -10 Suppose 34 = 4s + 5c, -3s + 3c + 26 = 7c. Let g(f) = f3 - 7f*2 + 4f + 3. Determine g(s). -9 Let t(h) = h*3 + 5h*2 - 2h - 5. Suppose 0o = -4u - 3o - 35, 5u - o = -20. What is t(u)? 5 Let l(p) = 2p + 6. Let r = -8 - -8. Suppose -22i + 25i + 18 = r. Calculate l(i). -6 Let v(j) = 2j*2 - 3j - 3. Suppose 2n = -3n + 4r - 2, n + 5r = 17. Suppose 6 = -k - nk. Calculate v(k). 11 Let r(x) = -3x + 5x2 + 6x*3 - 5x*3 + 3 + 0x*3. What is r(-6)? -15 Let g(h) be the second derivative of 1/20h*5 - 2h*2 - h + 0 + 0h*3 - 5/12h4. Let y = -3 - -8. Calculate g(y). -4 Let b(i) be the first derivative of i2 + 8i + 4. Calculate b(-6). -4 Let h(q) = q - 5. Let f(c) = -c + 6. Let x(v) = 6f(v) + 5h(v). What is x(8)? 3 Let q(d) = -16d*2 + 6d*2 + 2d*2 + 3d*2 + 5d - d*3. What is q(-6)? 6 Let r(t) be the third derivative of 0t + 1/12t5 + 0 + 1/3t*3 - 1/120t*6 + 1/3t*4 - 9t2. What is r(6)? 14 Let h = 0 - 4. Let c(q) be the first derivative of q2 - 2q - 4. Give c(h). -10 Let m(i) = i3 - 3i*3 - 7i*3. Suppose 5 = -2b + t, 0 = 3b + 2t - 1 - 2. Calculate m(b). 9 Let y(c) = c*2 + 0c + 2c + 6 + 6c - 2c. Give y(-6). 6 Let k(g) = -2g*2 + g - 5. Let b(a) = 5a*2 - 2a + 15. Let n(f) = -3b(f) - 8k(f). Suppose 0 = 2c + 3c - 10. Suppose -c = -5x + 18. Calculate n(x). 3 Let r = 1 + -6. Let k(x) = 2 - x3 + 3x3 - x3 + 7x2 - 3x*2 - 4x. Calculate k(r). -3 Suppose -5q + 2 = -o - 15, 3q + 2o = 5. Suppose 3h + 3k - 9 = 0, 0 = -3h + k - 0k + 1. Let d(m) = -1 - h + 2m + 0m - 1. Determine d(q). 3 Let r(k) = 5k*3 - 6k*2 + 4k - 8. Let v(w) = 9w3 - 12w*2 + 7w - 16. Let u(f) = -11r(f) + 6v(f). Determine u(-6). 4 Let i = -93 - -87. Let k(y) = y + 8. What is k(i)? 2 Suppose -4 = 6h - 28. Let a(p) be the first derivative of -hp + 3 - 1/2p2. What is a(0)? -4 Let l = 13 - 12. Let r(d) = 5d*2 - 3 + l + 1 - 14d*2. Determine r(-1). -10 Let c(b) = 2b - 7. Let f be c(7). Let i(o) = -f + o*2 - o - o - 2o + 5o. Determine i(0). -7 Let z be 2/(-2 - (-3)/2). Let k = -3 - -5. Let h(q) = 4q - 4q2 - kq + 0 + 0q + 3 - q3. Determine h(z). -5 Let n(b) be the first derivative of -b4/4 + 4b3/3 - b2/2 + 2b - 10. Give n(2). 8 Let w(j) = j2 + j + 1. Suppose 7p - 3p - 28 = 0. Let c(d) be the first derivative of d2/2 - 8d + 45. Let t be c(p). Calculate w(t). 1 Let g be (11 + (2 - 1))/(-1). Let s be (-3)/g - (-1)/(-4). Suppose 3o + 9 = -so. Let i(z) = -z*3 - 5z*2 - 2z + 3. Calculate i(o). -9 Let j(q) = 22q2 - 1 - 2q - 12q2 - 13q*2. Determine j(-1). -2 Let t(i) = -4i2 - i - 1. Let q be t(-1). Let g(c) = c2 + 6c + 3. Calculate g(q). -5 Suppose 0 = -3h - 2 - 4. Let p(y) be the first derivative of y - 4y - 2 - 3y*2 + 4. Determine p(h). 9 Suppose -5 = -2r - 1. Let c(s) = s - 2s2 + 4 + 2sr + s2 + 3s. Give c(-4). 4 Let c be 5 + -9 - (0 - 6). Let k(g) = 0 + 3 - cg - 1. Give k(2). -2 Let o(w) be the first derivative of -w*2 - 2 + 5 + 0. Calculate o(-2). 4 Suppose -4a + 4 = -2b, -5b + 2a - 5a = -16. Let z(c) be the third derivative of c6/120 - c5/60 + c4/12 + c3/6 - c*2. Determine z(b). 9 Let g(w) = 3w - 1. Suppose 8n + 10 = 13n. Calculate g(n). 5 Suppose r - 2r + 4 = 0. Suppose -j + ro = -o - 30, 6 = -3o. Suppose -2t = -7t + j. Let x(y) = y3 - 3y*2 - 3y - 2. Give x(t). 2 Let o(g) be the first derivative of -2 - 5/3g3 - 1/4g*4 - 6g - 3/2g2. Calculate o(-5). 9 Let v(h) be the third derivative of -h4/4 + h3/6 - 6h2. Let g = 5 + -4. Determine v(g). -5 Let x(l) = -l3 - 3l2 + 2l + 4. Let w be x(-3). Let j(p) = 2p + 2. Calculate j(w). -2 Let f(l) = l2 + 3l + 3. Let w(y) = -2y3 - y2 + y - 1. Let x be w(-2). Let p = x + -13. Give f(p). 7 Let x(f) = 2f*2 - f. Let v(p) = -2p2 + p3 - p3 - p3 + 2. Let b be v(-2). Determine x(b). 6 Let q(m) = -m*2 + 5m + 7. Suppose -40 = -3s + 3c - 2c, 5s + 4c = 44. Let a = s + -7. Calculate q(a). 7 Let y = 2 + 1. Let w(c) = -c2 + 3c + 2. Calculate w(y). 2 Suppose 5q + 5 = -5t, -2q + 39 + 1 = -5t. Let o(k) = k + 1. What is o(t)? -5 Suppose -2j - 1 = -7. Let z = -3 + j. Let y(p) = p3 - p - 3. Calculate y(z). -3 Suppose 2k - 11 = k + 3j, -10 = -2k + 2j. Suppose 2s = 3s - k. Let w(l) = -l2 - 2l. Give w(s). -8 Let z(g) = -g3 - 1. Let m be 1/(-3) + 0 - (-4)/(-6). Calculate z(m). 0 Let r be (-12)/(-16) + (-15)/4. Let k = 4 + -4. Let s(t) = -t3 - t - 4t2 - 1 + k - 2. Calculate s(r). -9 Let a(o) = -o2 - 24o + 25. Let h be a(-25). Let t(r) be the third derivative of h - 1/12r4 - 1/6r*3 + 0r - 2r2 - 1/15r*5. Give t(-1). -3 Let j(d) = 4d - 3. Let w be 5/(0 - -5) + 2. Give j(w). 9 Let p(g) = -2g + 5. Let o(v) = -v3 - 14v*2 - 2v - 21. Let q be o(-14). Give p(q). -9 Suppose -3s + 4s - 5 = 0. Let r(w) = 4 - 46w2 + 7w + 45w2 - 7. Give r(s). 7 Let v be (-1 + 1)4/(-8). Let h(i) = -3i3 + v - 1 - 5i + 5i2 + 2i*3. Suppose 4b - 4c - 28 = 0, -3b + 3c = -b - 17. Determine h(b). -5 Let h(j) be the first derivative of -3 + 6j - 3/2j2. Calculate h(5). -9 Let l(b) = 6b + 0b2 - 3 + 0b2 - b2. Give l(4). 5 Let i(j) = j*3 - j + 6. Let d be 6/(-60)-5 + (-2)/4. Calculate i(d). 6 Let b(w) be the third derivative of 0 + 7w2 - 3/2w*3 + 3/8w*4 - 1/60w*5 + 0w. Calculate b(6). 9 Suppose t + 16 = 3t - 2x, 3 = 3t + 4x. Let n be (12)/((-6)/(-12)). Suppose -7 - t = nw. Let k(d) = -2d - 2. Calculate k(w). 4 Let u(a) = -3a - 1. Let y be u(-1). Let t(w) = 0w2 - w2 + yw + 2w. Suppose 3q = -s - 0q + 3, 0 = 3s + 4q - 9. Give t(s). 3 Let u(h) be the first derivative of h2/2 + 3h + 23. Give u(0). 3 Let r(t) be the first derivative of -t4/2 + t3/3 - t + 1. Suppose 3v = -4l - 3 + 11, -l + 4*v + 2 =	{ "pile_set_name": "DM Mathematics" }
). Let d = t - 237. What is the hundreds digit of d? 2 Suppose 14p - 18p = -20. Suppose -7n + p = -6n. Suppose -4j + 16 = 0, -nv - j + 396 = 3j. What is the units digit of v? 6 Let g be (1(-6)/15)/((-3)/(-90)). What is the hundreds digit of (-24)/(-144) + (-5302)/g? 4 Suppose -12c + 65744 + 97492 = 0. What is the units digit of c? 3 Let p(a) = 4a + 14. Let j be p(-3). Let f be 3 + (6 - j) + 0. Suppose -q = -fq + 180. What is the tens digit of q? 3 Let h = -107 + 109. Let f(g) = -g2 - 6g + 2. Let i be f(-6). Suppose 72 = iv + 4w, v + w - 21 = hw. What is the tens digit of v? 2 Let b(n) = 46n - 31. Let t be 1(2 - (-3 - -1)). Suppose s - 2y - 24 = 2y, -4s - t = 4y. What is the units digit of b(s)? 3 Let y(q) = q3 + 18q*2 + 8q + 170. What is the units digit of y(-15)? 5 Let o = 44061 - 23825. What is the ten thousands digit of o? 2 Suppose -7l = 166 - 570 - 1304. What is the hundreds digit of l? 2 Suppose 0 = 8y + 22y + 3360. Let s = y - -498. What is the hundreds digit of s? 3 What is the ten thousands digit of (-12)/8(-104860)/3? 5 Let x(j) be the second derivative of j*3/6 + 4j*2 + 27j. Let a be x(4). Suppose -an - 312 = -14n. What is the hundreds digit of n? 1 Let t = 14412 + -970. What is the thousands digit of t? 3 Let x(h) = 999h3 + 2h*2 + h - 7. What is the units digit of x(2)? 5 What is the units digit of 1/(1 + 6664/(-6666))? 3 Let i be (43 - (-20)/(-5))(-1)/(-3). Let h(j) = -12j + 9j*2 - i + 17 + 0j. What is the units digit of h(6)? 6 Suppose 0 = -35t - 93960 + 483895. What is the ten thousands digit of t? 1 Let b(o) = o3 - 2o*2 + o + 3118. Let j be b(0). Suppose -8z - 2g + j = -5z, 4z = -g + 4164. What is the units digit of z? 2 Suppose 8r + 55r = 126. Suppose -4c - rj = -2328, j - 275 = -c + 309. What is the units digit of c? 0 Suppose 35t = 38t + 1821. Let s = t + 879. Let j = s + -160. What is the tens digit of j? 1 Let h(m) = 6 + 1 - 5 + 12m. Let x be h(3). Let c = -33 + x. What is the units digit of c? 5 Let h be 9/3 - 1 - 4. Let s = h - 28. What is the units digit of (-18)/s-2(-110)/3? 4 Suppose 3z = -4t + 39113, 319z + 3t + 39162 = 322z. What is the units digit of z? 7 Let l(g) = -g2 - 17g - 32. Let a be l(-15). What is the hundreds digit of (a - 14/(-4))668/3? 3 Let q = -6705 + 15601. What is the units digit of q? 6 Let l = -41568 + 128649. What is the ten thousands digit of l? 8 Let r(q) = 222q*2 - 164q + 925. What is the tens digit of r(17)? 9 Let f = -5332 + 7528. What is the tens digit of f? 9 Let i(x) = x*3 - 16x*2 + 11x + 17. Let q be i(17). Suppose g + 5a - q = 0, -38g + 39g - 481 = -a. What is the units digit of g? 8 What is the tens digit of 4929 + -4 - (-9 - -18)? 1 What is the hundreds digit of 10(-1 + 3861/6)? 4 Suppose 250l = 212l + 320454. What is the hundreds digit of l? 4 Let o(i) = 2i3 + 22i*2 + 11i - 3. Suppose 15d + 29 + 136 = 0. Let n be o(d). Let z = 20 - n. What is the units digit of z? 4 Let v = 11 + 2. Suppose 5x - v + 18 = 0. What is the units digit of (-33)/(-1) - (x - -1)? 3 Suppose -h = w - 38776, h - 7w - 38770 = -10w. What is the ten thousands digit of h? 3 Suppose -12c + 4836 = 2d - 14c, 0 = 3d - 2c - 7249. What is the hundreds digit of d? 4 Let s(j) = j + 44. Let z be 0 + 15 + 0 + 4. Let d be s(z). Suppose 2u - 299 = -d. What is the hundreds digit of u? 1 Suppose -2l = -59 + 53. Suppose -2c - 5o = 4 - 3, 0 = c - 4o - 6. Suppose 0 = lk + ct - 331, -3k + 4t = 2k - 515. What is the units digit of k? 7 Let q = 4514 - 501. What is the thousands digit of q? 4 Let w be 0 - (-1)/((-4)/2156). Let n = 988 + w. What is the units digit of n? 9 Let p = 1602 - -739. What is the units digit of p? 1 Let z(t) = 2 + 206t*2 - 198t*2 - 17 - 3t. What is the hundreds digit of z(-6)? 2 Suppose -11c + 16922 = 1797. What is the units digit of c? 5 Let o(z) = z3 - 16z*2 + 9z + 25. Suppose -51 = -5r + 34. What is the hundreds digit of o(r)? 4 Let t = -109 - -112. Suppose -h - 6 = -2, 8 = 4k - th. What is the hundreds digit of 223 + 1 + k(8 - 10)? 2 Suppose 34s = -31s - 15274 + 283659. What is the units digit of s? 9 Suppose 173c - 1317561 = 27c + 131197. What is the thousands digit of c? 9 Let s be (-16)/(-10) + 60/150. Suppose a - 532 - 764 = -3x, -sx - a = -865. What is the units digit of x? 1 Suppose -2 - 2 = -5x + 4l, l = 2x - 4. Suppose 4 = 2h, xg - 7h - 1106 = -6h. What is the hundreds digit of g? 2 Let l = 712 + 4758. What is the units digit of l? 0 Let d(p) = 4p*2 + 171p - 725. What is the tens digit of d(-135)? 9 Suppose 0 = -5j - 3l - l + 37, -j = -3l - 15. Suppose -21976 = -4d - 5g + 133, 5g - 5 = 0. What is the units digit of j/7 + -1 - d/(-63)? 8 Suppose 8y = y + 14. Let l(g) = -6g*2 - g - 1. Let u be l(-1). What is the tens digit of 1/(-3) - 310y/u? 0 Suppose -5w + 822 = 2y - w, 1173 = 3y - 4w. What is the hundreds digit of y? 3 Suppose -5f + c = -4f + 341, 2f + 702 = -2c. Let t(v) = -246v3 - v2. Let w be t(1). Let k = w - f. What is the units digit of k? 9 Let i be 4 + 2 + (5 - 2). Suppose 4a - i = 3. Suppose -3t - ax = -x - 176, -2t - 2x = -114. What is the tens digit of t? 6 Let p(y) = y*2 - 2y + 2. Let j = 46 + -44. Let t be p(j). Suppose -5s - 135 = -4w + 60, 2w = ts + 98. What is the units digit of w? 0 Let y be (-699)/(-9) + 8/(-12). Let v be (-14)/y - 805/(-11). Suppose 0 = -2n + 335 + v. What is the hundreds digit of n? 2 Let i(c) = -688c - 1224. What is the ten thousands digit of i(-19)? 1 Let m = -598 - -979. Let j be -6 + 3 + m/(-3). Let r = -82 - j. What is the tens digit of r? 4 Let a = 19112 + -10405. Suppose 29n - 2i - a = 24n, -5233 = -3n - i. What is the hundreds digit of n? 7 Let o = -66 + 66. Suppose o = 4g, -4g - 21 = -h - 2g. Suppose 19a = ha - 304. What is the units digit of a? 2 Suppose -a + 2a = 9a. Suppose a = 4u - 6u + 5v + 2320, -u + 1162 = -2v. What is the units digit of u? 0 Suppose -3k = -4w + 156204, 218589 = 4w + 4k + 62385. What is the tens digit of w? 5 Suppose 5a + 125j - 129j - 35282 = 0, 0 = 3a + 3j - 21153. What is the thousands digit of a? 7 Let s = 54 - 273. What is the tens digit of (s/15 + -1)/((-2)/35)? 7 Suppose 227778 = 2l + 29l - 95180. What is the ten thousands digit of l? 1 Suppose 39q = 48q - 27. Suppose -g + 481 = -2y, 1473 = qg - 0y + 4y. What is the hundreds digit of g? 4 Let j = -39 - -46. Suppose 3v - j = -1. Suppose vp = 3q - 271 + 24, 4q - 2p = 330. What is the tens digit of q? 8 What is the hundreds digit of 32/10(-562585)/(-148)? 1 Let r = 637 - 215. Let v(a) = a*2 + 3a - 6. Let p be v(-5). Suppose -r = -ps - 98. What is the tens digit of s? 8 Let g(l) = -2l*3 - 6l*2 + 19l + 6. Let n be g(-10). Let k = n - 820. What is the tens digit of k? 9 Suppose 62351 = 20v - 118918 - 171411. What is the thousands digit of v? 7 Suppose -4k + 11 + 15 = -c, 5k - 3c = 36. Suppose ky - 5r + 1734 = 8y, y = 2r + 876. What is the units digit of y? 2 Let p be -3 + 5 + (-4 - 637). Let b = p + 1053. Let q = b - 212. What is the units digit of q? 2 Let d(s) = -5s2 + 587 - s + s3 + 598 - 18s - 1201. What is the hundreds digit of d(9)? 1 Suppose 128m - 115m = 46228. Let p = m + -1881. What is the units digit of p? 5 Let n = 8445 + -2974. What is the units digit of n? 1 Let z(f) = 3f2 + 3f + 14. Let b(g) = g - 5. Let h be b(-7). What is the units digit of z(h)? 0 Suppose -3j + 26 + 29 = -o, -5o = 3j - 67. Suppose 34 = 3r + j. What is the units digit of r + 0 - (-20 - 13)? 8 Let t be 32 + 1 + 2/(-3)3. Suppose 5a - t = 2x, -4a + 38 = -2x + 12. Suppose -o - ao = -378. What is the tens digit of o? 6 Suppose -14k + 12k + 28 = 0. Suppose 28 = -6z - k. Let r(m) = -m2 - 18m - 15. What is the units digit of r(z)? 2 What is the units digit of 2/(-8) + (-90132)/(-464)? 4 Let x = -823 + 1668. Suppose -5l - x = 6r - r, 3r = 4l + 676. Let z = -27 - l. What is the tens digit of z? 4 Let q = -10077 + 94352. What is the units digit of q? 5 Let o(u) = u*2 + 15u + 61. Let z be o(-8). Suppose -2h = -d + 55, zd = -4h + 3h + 330. What is the units digit of d? 5 Let j = 145688 - 59499. What is the thousands digit of j? 6 Let w(g	{ "pile_set_name": "DM Mathematics" }
ivative of p*3/3 - 2p*2 + 4p - 1. Let t be f(5). Let k(q) = q + 34. Calculate the remainder when 124 is divided by k(t). 38 Suppose 3z + 63 - 205 = -k, -2k = -3z - 302. What is the remainder when 454 is divided by k? 10 What is the remainder when 5656 is divided by 2/(-11) - 12245520/(-10835)? 6 Let v = 2886 - -360. Calculate the remainder when v is divided by 58. 56 Let l(s) = 6s + 0s2 + 4s2 - s3 + 2s3 + 8 + 3s*2. Let z = -1350 + 1381. What is the remainder when z is divided by l(-6)? 7 Suppose -3x + 195 + 177 = 0. Suppose -4s + x = -3v - 23, -v - 37 = -s. Calculate the remainder when s is divided by 19. 17 Suppose -1293d - 908 = -1295d. Suppose 4u = 2h - 106, 4u + 207 + 13 = 4h. Calculate the remainder when d is divided by h. 55 Suppose 0 = 3w - w + 2. Let q(y) be the first derivative of -104y*2 - 7y - 4. What is the remainder when q(w) is divided by 51? 48 Let o(d) be the second derivative of -5d3/2 + 3d*2 - 32d. Let l be o(-2). Suppose -3x + 21 = -l. Calculate the remainder when 75 is divided by x. 18 Suppose -3k - 15 = -6. Let i = 15 - 8. What is the remainder when ((-18)/k - 3)3 is divided by i? 2 Suppose -296 = -2d + 4a, -2d - 232a = -233a - 305. What is the remainder when 2612 is divided by d? 148 Let d = 1302 + -1128. Calculate the remainder when 1911 is divided by d. 171 Suppose 0 = -3l - 3794 + 761. Let k = l - -547. Calculate the remainder when 22/(-77) + k/(-7) is divided by 17. 15 Suppose 2j = 2h - 880, -48h - 1313 = -51h + 4j. Calculate the remainder when 449 is divided by h. 2 Let d = -28 - -15. Let c(t) = 5t2 - 55t - 101. Let h(b) = -b*2 + 14b + 25. Let k(w) = -2c(w) - 9h(w). Calculate the remainder when k(d) is divided by 9. 7 Let g be (138 - 2)3/12. Suppose 3360 - 640 = gl. What is the remainder when 170 is divided by l? 10 Let a(o) = -6o - 215. Let t be -1 - (2 + -4) - 27. Let w = t + 38. What is the remainder when w is divided by a(-36)? 0 Let u(y) = 63y + 41. Let t be u(2). What is the remainder when t + (-9 - (-8 - 1)) is divided by 89? 78 Calculate the remainder when (-1)/((-2)/12) + 397 + (-9 - -31) is divided by 20. 5 Let t(h) = -35h3 - h2. Let r be (2/14)/(18/126) - 243. What is the remainder when (-30)/5 + (-1 - r) is divided by t(-1)? 31 Suppose -4n + 384 = 4g, -2n - 3g + 188 = -2g. Suppose 3b + 62 = -2f, 2f + n = -f - 5b. Let m = -7 - f. What is the remainder when 79 is divided by m? 25 Let n(q) be the third derivative of -q6/60 - q5/30 - q*4/8 + 2q*3/3 - 3q*2. What is the remainder when (240 - -1) + 7 + -3 + -3 is divided by n(-3)? 46 Suppose 0 = 5d + 3h - 951, 2d + 5h = 3h + 382. What is the remainder when d is divided by (-17)/(374/(-220)) - (-18)/2? 18 Suppose -5y - 6 = 9. Let w = 2 + 9. Calculate the remainder when w is divided by 1((-2)/80 - y). 2 Suppose 0 = -p - 3l + 9, 2p + p - 39 = -5l. Suppose pu - 375 = 13u. Calculate the remainder when 293 is divided by u. 68 Let k = 387683 - 387656. Suppose -90 + 24 = -3v. What is the remainder when k is divided by v? 5 Let b = 2197 - 2111. Let p be (-14)/2(-18)/21. Suppose -4d - 2i = -174, -75 = -pd + 4d - 5i. Calculate the remainder when b is divided by d. 41 Let b = -43 + 12. Let h = -29 - b. What is the remainder when (3 - 21/6) + 93/h is divided by 17? 12 Let g = -21802 + 23009. What is the remainder when g is divided by 33? 19 Let c be 72((-609)/(-99) - (-26)/143). Let p = c + -383. Calculate the remainder when 289 is divided by p. 70 Let m(q) = -8q - 54. Let x be m(-7). Suppose -x = -4h - 18. What is the remainder when (h - (-34)/8)148 is divided by 10? 7 Let x(z) = z3 + 3z*2 + 2z - 17. Calculate the remainder when x(6) is divided by 26. 7 Suppose 2a = q + 67, 2a + 200 = -5q - 171. What is the remainder when (q/3)/((117/(-135))/13) is divided by 16? 13 Suppose 0 = -2q - o + 16 + 36, q - 26 = 2o. Let m(p) = -p3 + 18p*2 + 49p - 834. What is the remainder when m(18) is divided by q? 22 Suppose 1096 = -44k + 112k - 604. What is the remainder when 2773 is divided by k? 23 Suppose -4x + 171 - 33 = 10. What is the remainder when 1050 is divided by x? 26 Suppose 18z = -4z - 44. Let k = 8 - -9. What is the remainder when (z - (-2 + (5 - 9))) + 28 is divided by k? 15 What is the remainder when (-244)/(-6) + (-3)/27-3 is divided by (400/150)/(0 - (-2)/12)? 9 Suppose 16w - 14w - 8 = 0. Suppose m - wk + 40 = -2m, -2k = -5m - 48. What is the remainder when (-668)/(-16) + (-10)/m is divided by 5? 3 Let g be 53 - (-13 - 7)/(-4). Suppose 5r + u = 131, -45u - 96 = -4r - gu. Let t = -8 + 18. What is the remainder when r is divided by t? 7 Let g(m) = 9m2 - 23m + 77. Let h = 17 + -14. Calculate the remainder when 440 is divided by g(h). 84 Let c be -2 + 23 + (-18)/2. Suppose -98l + 96l = -c. Calculate the remainder when 107 is divided by l. 5 What is the remainder when ((8 - 7)(-4)/12)/(1/(-1413)) is divided by 95? 91 Suppose 2s - 460 = 18. Let l = 284 - s. Calculate the remainder when l is divided by 24. 21 Suppose 2d - 47 = -3t, 4d - 2t - 75 - 43 = 0. Let n(p) = 19p - 74. Calculate the remainder when n(17) is divided by d. 25 Let x(l) = -10l*2 - 3l - 2. Let k be x(-1). Let c be ((-25)/15)/5k. Suppose 0 = 5z - 32 - c. What is the remainder when 54 is divided by z? 5 Suppose 14 = -5d + 2b + b, -3d - 9 = -2b. Calculate the remainder when 147/6 + d/(-2) is divided by (1248/(-36))/13(-4)/(80/105). 11 Suppose -160f + 111045 + 115471 = 94996. What is the remainder when f is divided by 164? 2 Let m = -8410 - -8519. What is the remainder when m is divided by 94? 15 Suppose 0 = -3q + 14q - 253. Suppose 4n - 240 = -2w, w = -2w - 12. Calculate the remainder when n is divided by q. 16 Calculate the remainder when 6/(36/10)(-217821)/(-85) is divided by 89. 88 Let f(c) = 16c + 36. Let a be f(4). Suppose 8w - a = 4w. Calculate the remainder when w is divided by 7. 4 Let p(q) = -5q - 15. Let r be p(6). Let k = r - -172. Suppose k - 655 = -12g. What is the remainder when g is divided by 12? 8 Let s be (12/(-14))/((-3)/(-756)6). Let y = s - -40. Suppose 176 = yd + 40. Calculate the remainder when 101 is divided by d. 33 Suppose 39m - 1569m = 601m - 652086. Suppose 5x = 496 - 101. What is the remainder when m is divided by x? 69 Let p be (-130)/(-3) + (-64)/48. Suppose 2n = -5j + 10j + 28, p = 3n - 2j. What is the remainder when 335 is divided by n? 13 Let z = 72 - 13. Suppose 0s + 4s + 2w = 62, -3s - w + 46 = 0. Calculate the remainder when z is divided by s. 14 Let s(v) = -2v3 - 102v*2 - 7v - 73. What is the remainder when s(-51) is divided by 117? 50 Suppose v - 6 = 2v. Let f(q) = -q3 - 3q*2 + 4q + 11. Calculate the remainder when f(v) is divided by 50. 45 Suppose 6k = 4k + 5n + 35, k + 5n = 25. Suppose -1190 + k = -5i + 5m, -710 = -3i + 5m. What is the remainder when i is divided by 58? 56 Suppose -2s + 33 + 11 = 0. Let g(f) = -2f - 51. Let a be g(17). Let w = a - -236. What is the remainder when w is divided by s? 19 Let f = 1513 - 1385. Suppose 95 = 5y + 35. What is the remainder when f is divided by y? 8 Let l(g) = 201g*2 + 229g - 2. What is the remainder when l(3) is divided by 827? 13 Suppose 3q = -q - 5i + 47, 31 = 2q + 5i. Let l be 4/(6(-3 + 20/6)). Suppose 5o - 10 = lx - 5, -x = o - q. What is the remainder when 5 is divided by o? 2 Calculate the remainder when 4285 is divided by ((1130/(-9))/5)/(26/(-234)). 217 Suppose i = 3l + 52, -5i = 3l - 120 - 86. Suppose -d = 11 - i. Let a(f) = -50f - 9. Calculate the remainder when a(-4) is divided by d. 31 Suppose -2y + 4i + 1170 = 0, 3y - 909 = -2i + 854. Calculate the remainder when y is divided by 31. 29 Suppose -3v + 53 = -x, 2x + 90 = 5v - 0x. Let o = 21 - v. Suppose 5q = 175 - o. What is the remainder when q is divided by 6? 4 What is the remainder when 64 - 71 - ((-1 - 2) + -357) is divided by 56? 17 Suppose 9n - 13n + 8 = 0. Suppose 4 = -h + nh. Suppose 218 = hi + 2v, -2i + 3v = -0i - 89. Calculate the remainder when i is divided by 27. 25 Suppose -3d = -2d - 337. Let y = d - 304. What is the remainder when 230 is divided by y? 32 Let x = 2758 - 2564. Calculate the remainder when x is d	{ "pile_set_name": "DM Mathematics" }
Express 1462y - 8650 - 8654 + 17304 as qy + z and give q. 1462 Express (5l - 4 - 7 - 3)((-8 + 3 + 2)(-5l*2 - 2l*2 + 5l*2) + (-2l + 2l + 2l)(-7l + 2l + 3l)) as k + tl3 + wl + ql2 and give q. -28 Express -1051h*2 + 3410h*2 - 2h*3 - 2h + 7159h2 + 2305h*2 as bh*2 + oh*3 + k + zh and give z. -2 Express 1 - 34j2 + 101j*2 - 56j*2 + (0j - j + 0j)(5j - 3j - 5j) in the form kj + u + xj2 and give u. 1 Rearrange -166c*3 + 9c*2 - 7c*2 + 174c*3 + 24c + 8c2 to w + uc*2 + jc*3 + dc and give j. 8 Express -79a2 + 2a*4 + 2a - 271a3 - a - a4 + 269a*3 + 610a*2 in the form ya + ja4 + ma*2 + na3 + r and give y. 1 Express -g3 - 452835 + 217g4 + 452836 + 390g*4 + 3g*2 as fg*3 + hg + v + sg4 + mg*2 and give m. 3 Express -12d - 3256 + 1628 + 12d - 204d*2 + 1633 in the form gd + z + qd2 and give z. 5 Rearrange (190v*3 - 203v + 204v + 151v*3)(v + 0 + 0) to the form w + iv3 + cv*4 + sv*2 + rv and give s. 1 Express -4x2 + 3x*2 + 2x*2 + (1 + 2 - 4)(0x2 + x2 + 0x*2) + 0 + 0 + 2x*2 + 569 - 213 - 213 - 143 + 40463x*2 as zx + m + fx2 and give f. 40465 Rearrange (-13n + 2n - n)(-158 - 6n + 287 - 141) to the form qn*2 + yn + u and give y. 144 Rearrange (17 - 17 - 9g)(-771g - 529g + 142g) to pg*2 + k + fg and give p. 10422 Express 3 - 3 + p*4 + (515 - 586 - 1149)(-11p2 + 11p*3 + 13p*4 - 10p*3 - 15p*4) as cp*4 + mp*3 + op + v + fp2 and give c. 2441 Rearrange -1390 - 3a*2 + 3a2 - a2 - 761a - 760a + 1524a to the form y + ta + ua2 and give y. -1390 Rearrange -4q + q - 8q + (-57q - 48q + 2q)(4 - 3 + 0) to the form r + tq and give t. -114 Rearrange -26697v4 + 2v - 2v2 + 80086v*4 - 26695v*4 + 31 - 26695v*4 to lv*4 + mv*2 + uv*3 + tv + z and give t. 2 Express 24045a - 3967a + 1498a + 2926a as la + b and give l. 24502 Express (-58r*2 - 82r*2 + 50r*2)(3 + r - 3 + (0 + 0 - 2)(-19r - 22r + 2r)) in the form kr3 + lr*2 + o + zr and give k. -7110 Express 575 + 141h + 5h*2 - 397h + 148h + 109h - 2h4 - h3 in the form c + yh*3 + gh*4 + wh + sh2 and give c. 575 Rearrange -1157f + 8913f + 8392f - 3705f + (0 + 0 - 2)(2f - f + f) to the form nf + y and give n. 12439 Express 211 + 154 - 365 + 9583s as zs + m and give m. 0 Rearrange (200l - 155l + 332l)(2l - 16 + 16) to wl*2 + cl + x and give w. 754 Express 1731t - 21769t + 366 - 175 - 191 as ht + u and give h. -20038 Rearrange -3308g - 3866g + 60 - 60 to q + ng and give n. -7174 Express -24800 + 12401 - 7j3 + 5j + 12398 - j*2 in the form vj*2 + dj + oj3 + c and give v. -1 Rearrange -1538z + 2237z - 4255z - 2209z to the form f + wz and give w. -5765 Express (-4026v2 + 980v*2 - 3361v*2)(-2v2 + 4v2 - v2) as l + tv + bv*4 + fv*3 + av*2 and give b. -6407 Express -241 - 20g - 237 + 496 - g*2 as h + lg*2 + ag and give l. -1 Rearrange -c*3 + 49c + 5 + 34c4 + 2035c*2 - 50c - 2037c2 + 0c*3 to the form vc + s + dc3 + jc*2 + gc*4 and give s. 5 Express 4082n*2 + 4438574n - 4438574n in the form mn*2 + cn + v and give m. 4082 Rearrange (562b2 + 742b*2 - 887b*2)(2b2 - 2b*2 + 3b*2) to jb*4 + gb*2 + tb + mb3 + z and give t. 0 Express (-757t + 91t3 + 757t)(216 + 297 - 392) in the form i + kt*3 + ot + xt2 and give k. 11011 Rearrange -4396 - 4401 + 8797 - 2417d to the form z + yd and give y. -2417 Express -n - 3n + 3n + (-2 + n + 2)(578 - 486 + 1124) as l + kn and give k. 1215 Rearrange -18h + 18h + 6h*3 + (0 + 4 - 2)(2469h2 - 280h*3 - 2469h*2) to lh*3 + ph*2 + jh + s and give l. -554 Rearrange 11w3 + 82w*2 + 630w - 82w2 - 2329w - 9w3 to bw*2 + gw*3 + u + sw and give g. 2 Express 2m + 3 - 3 + (-3 - 1 + 2)(-3 - 2m + 3) + 2m - 2m - 7m - 48m + 207m + 595m as a + im and give i. 753 Express (-1488 + 1099 + 1519 + 5 - 4 - 2 + (0 + 2 - 4)(0 + 1 - 2) + 2 - 3 + 2)(-n + 0n - 2n) as on + f and give o. -3396 Express (0k + 0k + 2k)(-3k - k + 5k) - 20k + 20k - 2k*2 + (0k + 3k - k)(k + 1 - 1) + k2 - k2 - 3k2 as m + uk + yk2 and give y. -1 Express 63 - 62d + d*4 + 8d*2 - 2d*2 - 96d + 181d + 2d*3 - 5d*2 as md*3 + fd*4 + qd + yd2 + x and give f. 1 Rearrange 5m + 1618m2 - 16m + 11m - 3346 + 3342 to x + bm*2 + rm and give r. 0 Rearrange (-1 + 1 - 1)(62 + 3 - 1)((1 - 4 + 2)(0y - y + 0y) - 19y + 8y + 22y) to the form iy + r and give r. 0 Express -442g*2 - 2 - 1184g + 2 - 439g2 + 882g*2 as r + ug + hg2 and give u. -1184 Rearrange 2x*4 + 2x*2 - 2x*2 + (-1089x*3 + 186x*3 - 1143x*3)(x + 3x - 2x) to the form tx2 + px + q + ux4 + lx*3 and give p. 0 Express (52x*2 + 19x*2 + 41x*2)(3 - 3 - 3)(1 + 2 - 6)(-5 + 5 + 1)(13x + 1 + 0 - 11x) in the form ox*2 + lx + fx3 + h and give f. 2016 Express (18488m*2 - 18488m*2 + 501m*3)(13 + 21 + 49) as am + jm*3 + p + fm*2 and give j. 41583 Rearrange 61o*2 + 62 + 21o - 69o2 - 21o to the form f + co2 + no and give f. 62 Express 142f - 4125f*2 + 618f + 4124f2 in the form bf + pf2 + o and give b. 760 Rearrange -3288n*3 + 262n*3 - 2033n*3 + (3n - 5n + 3n)(4n2 + n2 - 2n2) to the form y + tn + an3 + fn*2 and give a. -5056 Express 4k - 16k + 284k*2 + 9k - 4k - 964k*2 as m + dk*2 + nk and give n. -7 Express -q*4 - 739q + 650q2 - 26q*3 + 26q*3 + 210q*2 + 741q as nq4 + lq*2 + b + xq*3 + vq and give v. 2 Express 1 - 672g + 540g - 2g2 + 931g in the form rg + n + mg*2 and give n. 1 Rearrange (438 - 640 + 444)(-4d - 4d + 4d) to td + y and give t. -968 Rearrange -2x3 + 106x*2 - 9x*3 - 75x2 + x3 to the form gx2 + i + cx + ux3 and give g. 31 Rearrange -13i - 5i2 + 78i - 83i to fi*2 + ti + q and give t. -18 Express -2773 + z - 156 + 925 in the form f + dz and give f. -2004 Express 12x - 1199 - 1213 + 2410 + (-4x + 2x + 3x)(7 - 2 + 0) in the form dx + w and give d. 17 Rearrange -3g + 3g + g + 2g - 4g + 0g + (-3g + 2g - g)(1 - 2 + 3) + (3 + 2 - 3)(-g + 0g - g) + 62g - 229g - 96g to pg + u and give p. -272 Rearrange 3011g*2 + 3018g*2 - 9013g*2 + 2999g*2 - 12g*3 + 5 to ig*2 + f + bg + sg3 and give i. 15 Rearrange (-10 + 8 + 15w + 1)(-17 - 1 + 7) + (3 - 3 + 2)(0 + 0 - w) + 4 - 4 - 2w + w - 2w + 0w to mw + u and give m. -170 Express 902 - 822 - 15y + 6y + 2y + 0y + y + (4y - 2y - 4y)(-4 + 2 + 3) + 3y - 5y + 0y as i + my and give i. 80 Rearrange 77c + 38 - 72 + 33 + 468c + 98c to n + lc and give n. -1 Rearrange -657l2 + 1310l*2 - 650l*2 - 563l - l*3 to kl + nl3 + i + yl*2 and give k. -563 Express -104923b - 10793 + 209858b - 104933b in the form i + wb and give w. 2 Express -2 - 2091c + 1 + 0 - 8c - 52c as yc + h and give h. -1 Rearrange -132m + 3m3 + 8 + 9m*4 - 18m*2 - 5m*3 + 132m - 10m4 to the form tm*4 + f + nm + xm3 + cm*2 and give t. -1 Express 22q*2 + 84q*2 - q - 114q*2 + 177 as s + kq + xq2 and give x. -8 Express 21t*2 + 10t - 56t2 + 29t + 299t3 + 7 - 301t*3 - 9 as ut*2 + lt*3 + it + q and give q. -2 Rearrange (632v2 - 233v*2 + 807v*2 - 213v*2)(3v2 - 3v + 3v) to qv*4 + av*2 + h + kv + zv3 and give q. 2979 Express -7x*3 + 23x*3 + 101 - 4x*3 + 19 + x as ax*2 + zx + w + qx3 and give q. 12 Rearrange 759s + 2171s - 1426s to ws + p and give p. 0 Rearrange 3 - 3 - 2s + 5s - 3s + 0s + (2 - 2 + 1)(-s - 3 + 3) + (-4 - 2 + 0)(-s + 4s - 5s) + 4s + 8s - 36 + 37 to y + qs and give y. 1 Rearrange 2727 - 6314i3 + 13i*2 + 6312i*3 - 13i*2 to w + yi*3 + ni*2 + ri and give y. -2 Express -6s2 + 2264s - 13s2 - 2264s - 10 in the form is2 + gs + w and give w. -10 Express -94v + 5 - 10 - 182v + 8 as dv + h and give h. 3 Rearrange -19o*2 - 15o*2 + 49o*2 - 28 - 39 to ro + to2 + l and give t. 15 Rearrange (o2 - o2 + 2o*2)(52831 - 5930 + 41405 + 8090 + 26990 - 20423) to m + po + bo**2 a	{ "pile_set_name": "DM Mathematics" }
95). Solve -4m = -5m + pd + 27, 5d = -m - 23 for m. 2 Suppose 0 = 2y + y - 54. Let s = -2 + y. Solve -h = -4q + 2q - 8, h + s = -4q for q. -4 Let o = 1 + 4. Let b(y) = y - 3. Let d be b(o). Solve dm = s - 2, -3s - 6m = -4m - 6 for s. 2 Let a(h) = h + 7. Let o be a(-5). Suppose -r = -3t - 77, t + 32 - 8 = or. Let y = -16 - t. Solve -5 = 2p + 3u, -2p + 3u = u - y for p. 2 Suppose -n + 7 = c, 0 = -n + c - 0 - 3. Let s be (-64)/10(-40)/16. Solve 6 = -f + 2h, n - s = -3f - 2h for f. 2 Let i(w) = w*2 - 5w + 2. Let m be i(5). Suppose 2 + m = 4x. Solve -v = n, -3n = 4v + x - 0 for v. -1 Let w be -7(0 + 18/21). Let g = 9 + w. Solve -h - 28 = -5d, 7d - 2d = -gh + 16 for d. 5 Suppose 10 = -0s + 2s. Suppose -w = -sw - 8. Let u be 5/(-2)1w. Solve -h + 14 - 4 = -5g, -10 = -uh + 5g for h. 0 Let b(t) = -t*3 - 6t*2 + 6. Let y be b(-6). Let j be y/414/3. Solve 3v = 2w + j - 2, 3v = w + 10 for v. 5 Let v = 55 + -51. Solve vi - 14 = 2j, 4j = -i - j + 20 for i. 5 Let b(h) = h*2. Suppose 2t = 5n, -4n + 0t - 2t = 18. Let u be b(n). Solve -5y + uo = -37, -2y - 3o - 5 = 2o for y. 5 Suppose 4z + 9 - 25 = 0. Solve -zc + 2 = 2u, 0 = 5c + 6u - 2u + 2 for c. 2 Let n be 12/(-7) - (-10)/(-35). Let s be (6 - 6)n/4. Solve s = 4z + 2h - 28, -4z + 3h = -6z + 22 for z. 5 Suppose -3t - 280 = 2t. Let f = -34 - t. Solve 4z = -2a + f, -4a = 5z - 3a - 20 for z. 3 Let c(d) = -d*2 + 31d - 31d + 5d*3. Let t be c(1). Solve 3k = tz - 16, -2k + z = -2z + 12 for k. 0 Let j(h) = -4h - 12. Let z be j(-4). Solve 2k = zg - 6, -3g + 18 = 2k + g for k. 3 Suppose 2r = o + 7, 6 + 2 = -4o + 4r. Suppose 5 = -2z - a + 4, -2a = -oz - 19. Let p = z - -6. Solve 3m = -12, 5t - pm - 28 + 6 = 0 for t. 2 Let u(k) = 2k - 8. Let v be u(5). Suppose 3c - 4q = -3q + 6, -2q = -c + v. Solve -cz + 8 + 0 = 2b, 0 = b + 4z - 7 for b. 3 Suppose 0 = 6i - 3i - 12. Solve -w + h = 2, -iw = -0h - 3h + 8 for w. -2 Let f(j) = j*2 + j - 1. Let q be f(-3). Suppose -4r + 5 = -3. Let k be r/6 - 16/(-6). Solve -qp = -5s - 10, p - 3p - ks = 11 for p. -1 Let i = -32 - -34. Solve -2n = 4j + 18, in - 4j = -n + 3 for n. -3 Let v(w) = w*2 - w. Let u be v(1). Let g = -3 + 6. Suppose 3i = -4x + 28, gi - 6i + 3x = 0. Solve n = -3c + i, -5c + un = -3n - 16 for c. 2 Suppose -2n + s + 8 = 0, 4s + 11 = 4n + 3. Suppose -7 = -8v + 9. Solve 0 = -f - 4k + 3, vk = nk - 8 for f. -5 Let f be (-3)/(15/80-2). Let s be 16-2(-1)/2. Solve -k = -3b - s, b + 2b = -k - f for k. 4 Suppose -2p + 13 - 3 = 0. Solve -pg - 1 + 5 = -4y, 2y = 5g - 12 for g. 4 Let b(z) = z - 1. Let a be b(3). Solve -2 = -af, k + 2k + 7 = -5f for k. -4 Suppose 3u = -u. Solve -12 + 37 = 5w, 4c + 2w - 14 = u for c. 1 Suppose 3z - 5z - 12 = -2y, -y + 11 = -2z. Let g = 8 + z. Suppose 3d = 10 - 1. Solve 0 = -dx - 2p - g, 3p - 8 = 3x + 10 for x. -3 Let d = 7 - 5. Let o = d - -12. Solve r = -4m - r + o, 0 = -4m + 4r + 20 for m. 4 Suppose 22 = 5n + 4p, n - 5p - 3 = 13. Let a be (-3)/(9/n) - -5. Solve -4 = 4l + 5f, 2l - 3l - af = 1 for l. -1 Let x(p) = p*2 + 5p + 5. Let g be x(-5). Let k be 52/(-6)(-2 + -1). Let s be 0/(-4 + 3) + 33. Solve k - 1 = 5f + i, -2f = gi - s for f. 4 Let i be 9/3 - 6 - -3. Suppose -15 = 5b, ia - 3a = 2b. Let n be (-1)/((-18)/(-10) - 2). Solve -4z + 12 = 2q - nz, 0 = -aq - z + 4 for q. 4 Let i = 20 + 3. Solve x + 10 = -4x - 4r, i = 4x - 3r for x. 2 Let i = 14 + -11. Solve -n - 5s = n, -1 = n + is for n. 5 Let o be (12/(-10))/(3/10). Let w(f) = -2f - 4. Let y be w(o). Solve -1 = -k - 0, 2k - 14 = yv for v. -3 Let j(t) = 2t*2 + 5t + 7. Let l be j(-2). Solve y - 4b - l = 0, 0b - 5b = -3y + 15 for y. 5 Suppose 0 = 4g + 2k - 52, -4g = k + 4k - 46. Let h = 14 - g. Solve hs - 5l - 20 = -s, 4l + 12 = 0 for s. 5 Let f(d) = -d3 - 4d*2 - d - 4. Let z be f(-4). Solve 4y + y - 17 = -3w, y - w - 5 = z for y. 4 Let m be 3 - (2 - (-1)/(-1)). Suppose -6 = -2n, -2i - 1 = mi - 3n. Solve -g = -3o - 13, 0o - 14 = -io - 5g for o. -3 Let n be (-1)/3-224. Solve -2i + 2 = -3j, j - 4i + 0i - n = 0 for j. -4 Let z = -17 - -22. Solve u + zq = -20, -u = 4u + 2q + 31 for u. -5 Suppose -3u + 22 = -u. Solve 4a - 2a + 3h + u = 0, 4h + 14 = -2a for a. -1 Let x be (-16)/(-12)6/4. Let v(p) = -3p - 1. Let m be v(-2). Let n = -1 - -7. Solve -q - m = xf, -4f - n = -2f for q. 1 Let o(a) = -a2 - 6a + 3a - 2a + 0 + 4. Let m be o(-5). Solve 2f - f = 5g + 21, -8 = mg - 3f for g. -5 Let y(p) = -p*2 - 9p - 7. Let j be y(-8). Solve 5s + 0 = -2o - j, 2o + 3s = 1 for o. 2 Let x be (15/30)/(2/20). Solve xc - 5f = -10, 23 = c - 0c + 4f for c. 3 Let d(p) = -p*3 - 5p*2 - 2p - 6. Let w(u) = -3u3 - 3u*2 + 2u - 1. Let m be w(1). Let g be d(m). Solve -31 = -4a + 4r - 7, 5a - gr - 25 = 0 for a. 1 Let g(w) = -w*3 - 4w*2 - 3w - 5. Let t be g(-4). Suppose 32x - 3c = 31x - 12, 14 = -2x + 4c. Solve -5y = -20, -2i - y + t = -xi for i. -3 Let a(p) = p. Let o be a(13). Suppose 3 + o = 4v. Let r be 0/(1-2)1. Solve -vj = b + 3b, 2b + 5j + 12 = r for b. 4 Let n = 2 - 0. Solve 18 = -3w - q - nq, 4w = -5q - 27 for w. -3 Let k = -6 - -1. Let s = k + 8. Let g(l) = -l2 - 5l + 1. Let d be g(-3). Solve -sx = -3p - 9, -2x + 5p + d = x for x. 4 Let f be ((-12)/5)/((-33)/(-110)). Let p be (-119)/(-9) + f/36. Solve -o + 9 = -s + 1, 4o + p = -5s for s. -5 Let v be (-20)/(-15)3/2. Solve -3g - 15 = 2r, -4r + vr + 5g = -9 for r. -3 Suppose 2y - 35 + 1 = 0. Solve 2v - 2w = 14, -y = 3w - 5 for v. 3 Let v(c) = c + 11. Suppose 3u = -5b - 37, -b - 2 - 8 = -2u. Let r be v(b). Solve -5f - 40 = -5g, 2g - 24 = rf + f for f. -4 Let b(w) be the second derivative of w4/12 - 4w*3/3 - 5w*2/2 - 2w. Let u be b(9). Solve 2a - 4 = -3c + 3, c - 9 = -ua for a. 2 Suppose 4k + 0k = 16. Suppose m = -km. Solve -3r = -4n - 13, mn - 2n + r = 7 for n. -4 Let g be 6/(-15) - 22/(-5). Suppose gy - 6y = -8. Let i(r) = 2r - 9. Let z be i(6). Solve 5q - zq = -yf, 0 = q - f - 3 for q. 2 Suppose -2r + 60 = 5y, 10y - 9y = 2r + 12. Solve 0 = 2i + 2i - y, -p + i = 7 for p. -4 Let n = 6 - 1. Suppose -5y - 3 = j - 34, -5j - 4y + 71 = 0. Let b = -8 + j. Solve 0 = -7o + bo - nk + 2, -2k = 2o for o. -2 Let a = 29 - 43. Let t = a + 18. Solve tg = -2q + 2g - 10, -5 = 5q + g for q. 0 Suppose -4d + 5r = -30, 4r - 21 - 37 = -5d. Let y be 76/20 + 3/15. Solve 3w + 2 = 4l, -3w = yl - 0w + d for l. -1 Suppose -5j = -f - j - 6, -2f - 3j = -21. Let u(a) = -fa + 2a + 4 + 3a - 2. Let q be u(-5). Solve 4z = -27 + q, 0 = -5h - 4z - 40 for h. -4 Let q(b) = -b3 - 4b*2 + 6b + 7. Let k be q(-5). Suppose ko - 20 = 42. Solve v = -3l + 16, -3v - 3l - 7 = -o for v. 4 Let s(t) = -t*3 + 3t*2. Let l be s(2). Suppose -6i = -li. Solve i = 4o - 12, o + 26 = -4r + 3o for r. -5 Suppose 0 = -0s - 2s. Suppose -4u = -su - 28. Suppose 0 = -10o + uo. Solve -v = 3v - 3f - 13, -2v - 5f + 13 = o for v. 4 Suppose 4t + 0 - 12 = 0. Suppose tb = -5o + 66 - 16, -5o + 80 = 5b. Solve b = -4v - l, 2l - 4 = v + 2 for v. -4 Let w = -10 - -22. Let r(k) = k3 + 7k*2 - 7k + 11. Let x be r(-8). Solve -a - 12 = -0y + xy, w = -5a + y for a. -3 Let q = 85 - 82. Solve -2g = s - 6s + 8, 0 = -qs + 6 for g. 1 Let p = -25 + 29. Solve 3m - b = pb + 4, -m + 5 = 2b for m. 3 Let x be ((-3)/(-5))/(1/5). Suppose xj + j = 4f + 20, -2j = 2f - 10. Solve 0 = -5l + r + 19, l - 1 + f = 3r for l. 4 Suppose -c - 4c - 21 = 2b, 0 = b + 2c + 8. Suppose 4o = 5w - 28, bw = -0w - 4o. Solve -2s = wj + 12, -2s + 1 = -j + 3 for s. -2 Suppose 13 = 2r + 1. Let k(v) = v3 - 5v*2 - 4v - 4. Let s be k(r). Solve -4w - 2y = -s, -2w + 5 = 4y + 13 for w. 4 Let c be 10/4 - (-4)/8. Suppose -7 = -cj + 8. Suppose 3p + 2 - 3 = 2z, 3p - 29 = -jz. Solve -4t + 13 = -pm, 0 = 2m + 4t + 6 - 24 for m. 1 Let r be -1 + 2 + (1 - -15). Suppose -2w - 2q = -q + 21, 0 = -5w + 5q - 15. Let h be ((-4)/w)/((-2)/(-8)). Solve -4d + r = -p, hd + 0p + p - 1 = 0 for d. 3 Let c(b) = 2b - 1. Let k be c(3). Suppose -k = -5z + 20. Suppo	{ "pile_set_name": "DM Mathematics" }
(-18(-4)/216)/(-1)? 26 What is the value of 44025/(-7044)(-12)/(-45)? -5/3 What is (15 - (-1258)/(-85)) + (-68)/(-6) + 363/(-33)? 8/15 What is ((-8)/567 - (-12)/2) + 18156/(-3672)? 1/18 (136/1978897)/(6/(-1215)-3) 45 Calculate ((-658)/42 - -16)/(39/(-54)-2). 3/13 (59/(-25))/(-1479119/(-30345)) + (-1)/(-5) -6/29 Calculate (-237)/1422(-72)/(-10) + -1. -11/5 What is the value of (123 + -19303)/140 + 210? 73 Calculate (-1543 + 1235)6/168. -11 What is the value of (-5)/7(-4538)/6807? 10/21 (-2 + ((-18753)/(-126))/(-19))6 -59 What is 2 - -1 - (-5 - 127/(-20) - (-300)/240)? 2/5 Calculate 39 + 19 + 22 + -129. -49 (100/150)/(3/(-18)) + (99/15 - 2) 3/5 What is (2772/315(-5)/(-2))/(11/(-22))? -44 What is (16/(-64))/(257/51400)? -50 What is the value of (8/6 - 93/63)(-6370)/(-140)? -13/2 Calculate (3 - 118/40)/(123/(-246))16. -8/5 Calculate (-7485)/90 + 1020/(-360). -86 45720/(-306) - (-3072)/2176 -148 What is -34 + (44/(528/36) - (-5 + 20))? -46 Evaluate -3 + 2 + 0 - (190/(-266) + (-891)/(-189)). -5 Evaluate ((-273)/(-27846)-68)/(608/(-306) + 2). -51 Evaluate ((-2772)/35)/11 + -54 + 68. 34/5 (-3)/((-240)/(-1430)) + (784/128)/(-49) -18 Calculate (138/(-1541))/(1002/(-22378)). 2 Calculate -375(-52)/780 - 7292/292. 2/73 (-135)/81147/98 -5/2 Calculate (-22)/(-1056)16 + (-11)/(-66). 1/2 What is the value of -65/(17 + 3) - 750/60? -14 Evaluate 08/(-56) - (-81)/18 - 11. -13/2 Evaluate 1 - ((-3)/81 - 65572/(-45630)). -2/5 Calculate (90375/(-1250) + 71)/(26/(-12)). 3/5 What is (-5 + 187/21)8? 8 Evaluate (6/(288/(-176)))/(34/(-72)). 22 (487 + -481)/((-24)/(-104)) 26 What is the value of ((-48)/(-100))/(-2)(51 + 130/(-18))? 8/15 Evaluate (-145 - -120) + 1235/15. 16 What is (840/49)/(64/(-27552)-82)? 90 Calculate 24640/2480 + -21 + 11. -2/31 What is the value of (1186/240 - (-1152)/(-17280))8? 39 What is the value of 35/((-2625)/90) + (-108)/12-1? 39/5 Calculate 18/(-4)(-56584)/57870. 22/5 ((-14)/2)/((-11123)/131887) 83 What is the value of (408 - 390)(-18)/270? -6/5 What is the value of 2 + ((-132)/(-48) - 0 - 474/24)? -15 Evaluate (-552)/1196 + (6 + 0 - (-3752)/(-546)). -4/3 What is 54805/1356 - (19 + 21)? 5/12 Calculate ((-32)/10)/((-92)/(-506)) + (-4 - -14). -38/5 What is (145 - 123) + (-29 - 0)? -7 What is ((-3 + (-2)/(-2))/(10/(-4)))/(1704/(-8520))? -4 Evaluate 399/(-570) - 28630/(-4900). 36/7 What is the value of (-6336)/1276 + 24 - 19? 1/29 What is the value of ((-1)/9)/((-1)/3)2/(16/(-28))? -7/6 Calculate 205/2255 + (-70)/154. -4/11 (-103140)/429750 + 2(-9876)/200 -99 What is the value of (6890/(-14469) - (-8)/14) + -29(-19)/21? 79/3 What is the value of (44/231)/(3796/6132)? 4/13 Evaluate 10((-3261232)/29380 - -111). -2/113 What is the value of ((12 - -41)4/(-10))/(2/(-10))-1? -106 What is the value of (-1)/((-4)/36) + (-7260)/726? -1 Evaluate ((-162)/351)/((16800/(-260))/21). 3/20 Evaluate (-76)/(-133) - 129/(-7) - 3330/450. 58/5 What is ((-54)/(-180) - (-232)/(-240))/(32/5952)? -124 Evaluate (138/(-260))/(2798/(-6995)) + (-2)/8. 14/13 What is the value of -3 + 3 - -8 - (-3 + (-1384)/(-88) + -5)? 3/11 (-95)/3(2 - 4)1887/1258 95 6(-146 - (-47926)/372) -103 (-2 + (-33)/(-13))(900/210)/15 2/13 Calculate (9/812/(-9))/((66/(-48))/(-11)). -12 What is 547/2188 + (-1268)/16 - (-10)/1? -69 What is the value of 4/3(-3)/(-2)(1638/84 - 5)? 29 (-8)/(-7 + 8)14348/(-3168) 52/3 Evaluate -40 - (37 - (-27 - -43)). -61 (-9)/39616110/(-4) - -41 51 What is 27 + (-959)/21 - (-9 + -11)? 4/3 -4((-135)/(43605/(-34)) + (2030/(-152) - -1)) 49 (-2)/(-325)(-1386 + 1412) 4/25 What is ((-378)/10)/27 - 6/(-45)21/7? -1 ((-5082)/(-8316))/(11/(-3)) -1/6 (512/576 + (-302)/36)/(5995/(-436)) 6/11 Calculate (-241)/42 + 8949/2826. -18/7 Evaluate 168/(-216) + 14464/41184 + 6/39. -3/11 Calculate (-1)/10 - ((-108090)/900 + 82). 38 What is ((-15)/(-65) - (-658)/(-1274)) + 57(-20)/(-315)? 10/3 2/4 + (-48)/(480/85) - (-100)/1 92 What is 54835/107250 + (-2)/(-50) - (-4 + 25/6)? 5/13 15171/73521 + 3 + 2/(9/(1107/(-84))) 5/18 What is the value of ((-495)/(-465) - 4/62)/(-3) + 3250/7995? 3/41 What is the value of -33(-27)/(891/(-44)) + 9? -35 Calculate (3320/(-300))/(-83) - (7053/3285 + -2). -1/73 Calculate (-17)/3(-26 + (-29)/(1334/(-989))). 51/2 Calculate (-58)/(-667)(-294354)/(-948). 27 Calculate -8958 + 8959 + -26(1 - 6/4). 14 Calculate (-1)/((-95)/7895) - 17/((-8721)/(-54)). 83 What is 1105/(-663)(-3)/52? 2 What is the value of (2/(-6) + 38/1425100)6? 14 Calculate ((0 - 6)/1 + 1076/269)(-350)/(-20). -35 Calculate 15(-8)/16011/((-4257)/(-48)). -4/43 What is -44 + 304(-6 + (-679)/(-112))? -25 Calculate 7 + -2 + -2 + (-1624)/(-580)64/(-56). -1/5 143/616 - 480/(-768) 6/7 What is the value of (6 - 11)(-962)/(-65)3/6-1? 37 What is (-106995)/1911 + 47 - 4/((-12)/27)? 1/91 Evaluate (9 - (-103)/2)(26 - 6800/275). 77 Evaluate ((-12)/2 + (-109053)/(-18165))(-190)/(-114). 1/173 What is 147/1435108/(-5502)? -67 What is the value of (12/(-14)(-11928)/2272)/(0 + (-4)/(-8))? 9 What is -28 + 447580/5635 + 8/14? 52 Calculate ((-2)/(-4))/(837/(-42) - -20) + 30690/(-4278). -4/23 Evaluate 2605(-1)/(-65) + (-14)/(-21)6/(-52). 40 Evaluate (6/45)/(8/1100(-280)/112). -22/3 Calculate 7965/(-351) - (-2266)/1339. -21 (-30)/(-220)(-20)/((-5220)/319) 1/6 Evaluate (-6)/10 + ((-4654)/585 - 195/(-39)). -32/9 16/(480/(-190)) + 270/(-81)(-24)/10 5/3 (-80 - 649/(-8)) + (-110)/(-16) 8 What is the value of 1824/5200 - ((-24)/(-32))/(221/68)? 3/25 Evaluate ((-1148)/26)/(-1) + 5872/(-38168). 44 What is the value of (-104 + 8)/(-8) + (-3328)/260? -4/5 What is the value of 39(-4 + 1649/408)/(3/(-12)3)? -13/6 What is the value of (-301)/(-8) + ((-19720)/(-290) - 107)? -11/8 (5 - 43/9) + 840/(-6750)5 -2/5 Evaluate (-6)/(-4)(-298)/(-447)-37. -37 Evaluate (-155)/((-912950)/(-372))(-4 - ((-136)/12)/2). -2/19 What is the value of (-3242)/9726 - (-140)/6? 23 (20/(-130)-30)/(-18 - (-471)/26) 40 Calculate 35/(-20) - 52479/12348. -6 Calculate (-76 - (-66 - 8)) + 3/(-12) + -1 + -2. -21/4 What is (-1 - (-28)/(-2)) + 4984 + -4989? -20 Calculate ((-315)/2940)/((-31)/62). 3/14 20 - (4/20 + (-87555)/(-975)) -70 What is ((-4403)/(-518))/((-1)/2)? -17 Evaluate 1046/20 + (242 + -228 - (-715)/100-2). 52 Evaluate (-1001)/38038((-363)/153 - -2). 1/102 Evaluate 3422/(-177) - (-108987)/5661. -3/37 What is (-52/4)/(-205 + 254 + (-4557)/28)? 2/91 (-856)/(-4922)11799/38 54 Evaluate 37 - (-1872)/(2808/(-72)). -11 Evaluate ((-3)/42)/(3/(-666)) + 414/49. 17 Calculate ((-3)/(-99))/(((-10)/72)/5)-11. 12 Evaluate 7520/4136 + (-12096)/264. -44 Evaluate 27 - ((9 - 4) + (194 - 90)). -82 What is the value of ((-7125)/4756/(-1305) - 1104/29) + -10? -48 What is (-57)/(2223/(-3588)) - 53? 39 What is the value of (-4 - 91)/5 + (-116350)/(-6110)? 2/47 -14 - (-478)/(-180)-5 - (-8)/12 -1/18 Calculate -9 + (-1635)/(-195) + (-3090)/(-5655). -2/29 Calculate (-43 - -24) + (-20 - 35203/(-893)). 8/19 What is the value of ((-60)/(-960)376)/((-5)/(10/1))? -47 What is the value of (-120)/(-188)400440/3408? 75 -28 - (-41 - 3) - (1 + 143) -128 Calculate -12 - (152/13601)/((-2)/215). 1/68 Calculate (-34)/24 - (286/2145)/(-5(-15)/(-1500)). 5/4 Evaluate (74 - 69) + ((-288)/(-60) - 6)(-25)/(-2). -10 What is the value of (117/((-45045)/(-110)))/((-44)/1834) - -11? -10/11 (1 - 3 - 4) + (-22)/3(-2481)/(-1654) -17 Calculate (-22)/8(-32 + (9 - 1400/(-40))). -33 What is the value of ((-263627)/(-5005) + -53)40/(-4)? 36/11 What is 25(-10)/(-4)(-114)/950? -15/2 What is the value of (-2770)/(-1385) - (-17)/(-5)? -7/5 (-7)/(135/72-163/(-18)) -7/5 What is ((-2)/(-245))/((-290)/406)? -2/175 Calculate 170/44265 + -55. -30 What is the value of 493/9 + (240 - 295)? -2/9 What is 5/4 - ((-150)/100 - (0 + 1 - 3))? 3/4 What is ((-192348)/364)/27 + (20 - 2)? -11/7 Calculate 53 - (-9 + (45 - 5)). 22 Calculate ((-1074)/84 + 13)7(-31 - -15). -24 Calculate (-3 + 4 + 2)372/36. 31 What is (55/275)/(3 - (-1308)/(-435))? -29 Calculate ((-333)/(-27) + -17)/(-4)1/98. 1/84 Evaluate (3/(-8)*2)/((27/54)/(12/(-42))). 3/7 Calculate (((-248)/(-1248))/31)/((-2)/(-33) + (-10865)/34980). -1/39 What is 220/(-24640) + (-1220)/(-638400)? -2/285 (-176)/(-99) + (-11372)/1962 - -4 -2/109 Calculate (52/104)/(((-1302)/(-4140))/(-7)	{ "pile_set_name": "DM Mathematics" }
mainder when 12446 is divided by 249. 245 Calculate the remainder when 66184 is divided by 33010. 164 What is the remainder when 7939 is divided by 991? 11 What is the remainder when 4972 is divided by 568? 428 Calculate the remainder when 54622 is divided by 241. 156 What is the remainder when 3110 is divided by 278? 52 Calculate the remainder when 226475 is divided by 24. 11 Calculate the remainder when 1576 is divided by 736. 104 What is the remainder when 3304135 is divided by 867? 865 What is the remainder when 233269 is divided by 446? 11 Calculate the remainder when 1160857 is divided by 327. 7 Calculate the remainder when 735 is divided by 163. 83 What is the remainder when 1537 is divided by 591? 355 Calculate the remainder when 1394147 is divided by 12. 11 Calculate the remainder when 509270 is divided by 96. 86 Calculate the remainder when 1998 is divided by 1971. 27 What is the remainder when 3491 is divided by 9? 8 What is the remainder when 249183 is divided by 416? 415 Calculate the remainder when 140945 is divided by 211. 208 What is the remainder when 577664 is divided by 115532? 4 What is the remainder when 99534 is divided by 24881? 10 Calculate the remainder when 185585 is divided by 294. 71 What is the remainder when 1993 is divided by 643? 64 What is the remainder when 37829 is divided by 62? 9 What is the remainder when 244863 is divided by 16? 15 Calculate the remainder when 149726 is divided by 3482. 0 Calculate the remainder when 1870 is divided by 577. 139 Calculate the remainder when 12541 is divided by 143. 100 What is the remainder when 85142 is divided by 198? 2 What is the remainder when 46008 is divided by 37? 17 Calculate the remainder when 4836 is divided by 41. 39 What is the remainder when 10760 is divided by 1765? 170 What is the remainder when 21375 is divided by 167? 166 What is the remainder when 6093 is divided by 3014? 65 What is the remainder when 4466 is divided by 236? 218 Calculate the remainder when 17357 is divided by 100. 57 Calculate the remainder when 46122 is divided by 1397. 21 What is the remainder when 84950 is divided by 33? 8 What is the remainder when 1220 is divided by 426? 368 What is the remainder when 8318 is divided by 181? 173 What is the remainder when 7120 is divided by 890? 0 Calculate the remainder when 3175387 is divided by 951. 949 What is the remainder when 1487 is divided by 159? 56 What is the remainder when 256699 is divided by 85564? 7 What is the remainder when 15956 is divided by 5? 1 Calculate the remainder when 548 is divided by 236. 76 What is the remainder when 445188 is divided by 91? 16 What is the remainder when 174601 is divided by 860? 21 Calculate the remainder when 1244 is divided by 325. 269 Calculate the remainder when 3863 is divided by 8. 7 What is the remainder when 1900 is divided by 156? 28 Calculate the remainder when 107897 is divided by 41. 26 What is the remainder when 10455 is divided by 783? 276 What is the remainder when 590665 is divided by 2? 1 What is the remainder when 64866 is divided by 113? 4 What is the remainder when 3726 is divided by 123? 36 Calculate the remainder when 46320 is divided by 842. 10 Calculate the remainder when 4213 is divided by 304. 261 Calculate the remainder when 193450 is divided by 28. 26 Calculate the remainder when 17251 is divided by 63. 52 Calculate the remainder when 3668 is divided by 1660. 348 Calculate the remainder when 1870 is divided by 132. 22 Calculate the remainder when 5745 is divided by 230. 225 Calculate the remainder when 21580 is divided by 21516. 64 What is the remainder when 371 is divided by 156? 59 What is the remainder when 169499 is divided by 226? 225 What is the remainder when 6239 is divided by 11? 2 Calculate the remainder when 4082 is divided by 26. 0 What is the remainder when 4314 is divided by 206? 194 What is the remainder when 235694 is divided by 241? 237 What is the remainder when 2644 is divided by 1585? 1059 Calculate the remainder when 8119 is divided by 5. 4 What is the remainder when 4308 is divided by 26? 18 Calculate the remainder when 22093 is divided by 156. 97 Calculate the remainder when 21126 is divided by 91. 14 What is the remainder when 4234 is divided by 2112? 10 Calculate the remainder when 20165 is divided by 243. 239 Calculate the remainder when 2808 is divided by 523. 193 What is the remainder when 1456 is divided by 393? 277 Calculate the remainder when 157551 is divided by 3352. 7 What is the remainder when 8874 is divided by 8747? 127 What is the remainder when 7151 is divided by 325? 1 What is the remainder when 46090 is divided by 11520? 10 Calculate the remainder when 19838 is divided by 2614. 1540 Calculate the remainder when 147628 is divided by 285. 283 Calculate the remainder when 65820 is divided by 147. 111 What is the remainder when 36922 is divided by 18459? 4 What is the remainder when 197744 is divided by 221? 170 What is the remainder when 4324 is divided by 139? 15 What is the remainder when 134833 is divided by 153? 40 Calculate the remainder when 47444 is divided by 205. 89 Calculate the remainder when 424 is divided by 181. 62 What is the remainder when 26784 is divided by 136? 128 Calculate the remainder when 1203 is divided by 55. 48 Calculate the remainder when 675083 is divided by 209. 13 Calculate the remainder when 3484 is divided by 91. 26 Calculate the remainder when 147327 is divided by 679. 663 What is the remainder when 4967 is divided by 2444? 79 Calculate the remainder when 116156 is divided by 14502. 140 What is the remainder when 22941 is divided by 191? 21 What is the remainder when 5376 is divided by 1048? 136 What is the remainder when 1572 is divided by 1535? 37 Calculate the remainder when 1961533 is divided by 16. 13 What is the remainder when 78993 is divided by 15780? 93 Calculate the remainder when 79100 is divided by 11. 10 What is the remainder when 19473 is divided by 6487? 12 Calculate the remainder when 2563 is divided by 209. 55 What is the remainder when 153636 is divided by 668? 664 What is the remainder when 200083 is divided by 63? 58 Calculate the remainder when 23729 is divided by 20. 9 Calculate the remainder when 11941 is divided by 1985. 31 Calculate the remainder when 135299 is divided by 492. 491 What is the remainder when 945 is divided by 211? 101 What is the remainder when 3268984 is divided by 76? 72 Calculate the remainder when 3475 is divided by 487. 66 Calculate the remainder when 41056 is divided by 875. 806 What is the remainder when 75922 is divided by 18975? 22 What is the remainder when 438305 is divided by 687? 686 What is the remainder when 835559 is divided by 137? 133 Calculate the remainder when 56257 is divided by 5. 2 Calculate the remainder when 1857498 is divided by 34. 10 Calculate the remainder when 69144 is divided by 117. 114 Calculate the remainder when 4927 is divided by 12. 7 Calculate the remainder when 726805 is divided by 57. 55 What is the remainder when 495 is divided by 67? 26 What is the remainder when 396708 is divided by 10? 8 Calculate the remainder when 81587 is divided by 13. 12 Calculate the remainder when 587357 is divided by 34550. 7 What is the remainder when 5693 is divided by 2792? 109 What is the remainder when 2966 is divided by 2? 0 Calculate the remainder when 2266 is divided by 137. 74 What is the remainder when 21576 is divided by 273? 9 What is the remainder when 279 is divided by 49? 34 Calculate the remainder when 9973 is divided by 377. 171 What is the remainder when 11784 is divided by 437? 422 What is the remainder when 1145662 is divided by 216? 214 Calculate the remainder when 7346 is divided by 21. 17 Calculate the remainder when 74428 is divided by 18. 16 Calculate the remainder when 1141 is divided by 233. 209 What is the remainder when 815 is divided by 24? 23 Calculate the remainder when 2308 is divided by 1096. 116 Calculate the remainder when 563 is divided by 94. 93 Calculate the remainder when 1561 is divided by 560. 441 Calculate the remainder when 1211400 is divided by 449. 447 What is the remainder when 1177 is divided by 212? 117 Calculate the remainder when 22146 is divided by 84. 54 Calculate the remainder when 1278	{ "pile_set_name": "DM Mathematics" }
69 Sort -11, 3, -3, -20, 96, 5, 0. -20, -11, -3, 0, 3, 5, 96 Sort -7, 715, 584, 2, -4, 5, 1 in ascending order. -7, -4, 1, 2, 5, 584, 715 Put 28, 4/9, 3, 0.3, -2/11, 10 in increasing order. -2/11, 0.3, 4/9, 3, 10, 28 Sort 1, -2/649, 15, 2, -1, 2.6 in ascending order. -1, -2/649, 1, 2, 2.6, 15 Sort 5, -13, -1, 712, 4, -405, 1. -405, -13, -1, 1, 4, 5, 712 Put -1/2, 197/4, -0.03, -2, -6672 in decreasing order. 197/4, -0.03, -1/2, -2, -6672 Put -60695/3, -1/4, 143 in increasing order. -60695/3, -1/4, 143 Sort 79, -142, 2, 0.1, 3, 27, -1/3. -142, -1/3, 0.1, 2, 3, 27, 79 Sort -0.4, 0.34, -2/7807, 0.3. -0.4, -2/7807, 0.3, 0.34 Put -8, 2, 34127, -4, 4 in decreasing order. 34127, 4, 2, -4, -8 Sort -194, 8, 5, -5552, 4 in increasing order. -5552, -194, 4, 5, 8 Put 65, 1/10, 101, -0.06 in increasing order. -0.06, 1/10, 65, 101 Put 1, -4, 0, -683014 in descending order. 1, 0, -4, -683014 Sort 0.5, -3, -25, -0.052, 4711 in descending order. 4711, 0.5, -0.052, -3, -25 Sort -201/1297, -0.2, 18 in decreasing order. 18, -201/1297, -0.2 Sort 0, -413, -4715, 6 in increasing order. -4715, -413, 0, 6 Sort 2/15, 53, -3, 2, 2574, 1. -3, 2/15, 1, 2, 53, 2574 Put 13, -386, 4405 in ascending order. -386, 13, 4405 Put -0.4, -1, -267, -208, 2/15 in descending order. 2/15, -0.4, -1, -208, -267 Sort 0, 179, 31894 in ascending order. 0, 179, 31894 Sort -4, -0.2, 90, 2, -17, 0.3. -17, -4, -0.2, 0.3, 2, 90 Sort 3476, 11, 20/11, 3, -0.09 in decreasing order. 3476, 11, 3, 20/11, -0.09 Put -24, 0, -11071 in ascending order. -11071, -24, 0 Sort 2, 5, 3, 0, -2240, 11 in descending order. 11, 5, 3, 2, 0, -2240 Sort 54, -24125, 22 in decreasing order. 54, 22, -24125 Put 141, 1, 0, -1, -136659, -5 in decreasing order. 141, 1, 0, -1, -5, -136659 Sort 24/661, 2/15, -18, -0.01, -2 in descending order. 2/15, 24/661, -0.01, -2, -18 Put -46176, 0, -32 in ascending order. -46176, -32, 0 Put 1/8, -115, -2/11, 48, -1 in decreasing order. 48, 1/8, -2/11, -1, -115 Sort -2, 0.3, -1/3, 0, -4/3, -799 in ascending order. -799, -2, -4/3, -1/3, 0, 0.3 Put 5/8, 5, 2.81, -0.6, -2 in decreasing order. 5, 2.81, 5/8, -0.6, -2 Sort 0.0267, 0.18, 3, 0, 2/29, 29 in decreasing order. 29, 3, 0.18, 2/29, 0.0267, 0 Put -1, 50, 25, -161 in descending order. 50, 25, -1, -161 Sort 764, -0.2, 14/17, 0, 88 in ascending order. -0.2, 0, 14/17, 88, 764 Sort -0.25, 61235, 13 in decreasing order. 61235, 13, -0.25 Sort 3, -51820409, -3, 0 in descending order. 3, 0, -3, -51820409 Sort -2065, 849, 0.5 in descending order. 849, 0.5, -2065 Put 2, -514, -0.5, 1, -117, -1 in ascending order. -514, -117, -1, -0.5, 1, 2 Put 133, -4, -5500 in decreasing order. 133, -4, -5500 Put 2/3, -4530, -0.4, -47 in ascending order. -4530, -47, -0.4, 2/3 Sort -0.436, 222/11, 0.1, 0.3. -0.436, 0.1, 0.3, 222/11 Put 0.3, -129, -289.2, 1 in decreasing order. 1, 0.3, -129, -289.2 Sort -25, 522, 107 in decreasing order. 522, 107, -25 Sort -12616, 0, 36. -12616, 0, 36 Sort -2, 15, 148, -393, 8 in increasing order. -393, -2, 8, 15, 148 Sort 3, -6922, 1513 in ascending order. -6922, 3, 1513 Sort 55, 1, -70, -4, -7, 5. -70, -7, -4, 1, 5, 55 Put -3, -9.03192, 384 in descending order. 384, -3, -9.03192 Sort -65, 1, 62, 23, 11. -65, 1, 11, 23, 62 Sort 1/8, -1/3, 88/12267 in ascending order. -1/3, 88/12267, 1/8 Sort -7, 3, 1525, 46 in ascending order. -7, 3, 46, 1525 Put 9, 4, -2, 112045, -4 in descending order. 112045, 9, 4, -2, -4 Sort -3, -3742, -4, 4, 67 in decreasing order. 67, 4, -3, -4, -3742 Sort 237, 1, 2, 0.184, -9 in descending order. 237, 2, 1, 0.184, -9 Put 15, -3, 30, -1, 1, -8, 2 in decreasing order. 30, 15, 2, 1, -1, -3, -8 Sort 1, 46, -6, 2032, 2 in increasing order. -6, 1, 2, 46, 2032 Sort -3183/913, -0.5, 1.4 in increasing order. -3183/913, -0.5, 1.4 Put -332/97, 1209, -0.1 in ascending order. -332/97, -0.1, 1209 Sort -0.1, 7647, 3/544, 6 in decreasing order. 7647, 6, 3/544, -0.1 Put 4, -2, -6, 0, 2, 4637, 1 in ascending order. -6, -2, 0, 1, 2, 4, 4637 Sort -2, -145, 59, -72 in descending order. 59, -2, -72, -145 Sort -77, -3, -76, 35, -135. -135, -77, -76, -3, 35 Put 13, -4, 3, 238469, -5 in increasing order. -5, -4, 3, 13, 238469 Put -1, 4, 3, -29, -329, 1 in increasing order. -329, -29, -1, 1, 3, 4 Sort -315, 5, -28, -4, 18, -21 in decreasing order. 18, 5, -4, -21, -28, -315 Sort 229, 3, 1/3, 89273. 1/3, 3, 229, 89273 Sort 476, -4, 14, 0, -62, -1 in descending order. 476, 14, 0, -1, -4, -62 Put -4, 23, -2, 19, -1, 223, -113 in decreasing order. 223, 23, 19, -1, -2, -4, -113 Put 4, 19, 1444, -100, 7 in descending order. 1444, 19, 7, 4, -100 Sort 2/11, -187, -981 in descending order. 2/11, -187, -981 Sort 8, 0, -115, -9631, 5. -9631, -115, 0, 5, 8 Sort -2062, -5, 955 in descending order. 955, -5, -2062 Put 816, 0.2, 1/98, -4/11 in descending order. 816, 0.2, 1/98, -4/11 Put -7123918, 5, -2 in decreasing order. 5, -2, -7123918 Sort 3, -179, 7, 9, -333 in decreasing order. 9, 7, 3, -179, -333 Sort -2/55, 1, -1, 2/5, -42603. -42603, -1, -2/55, 2/5, 1 Sort 406, 5798, -3 in decreasing order. 5798, 406, -3 Put -15, 4, 3, 112, -38, -2, 2 in increasing order. -38, -15, -2, 2, 3, 4, 112 Sort -8, 2, 7, -2147, 0.1, 52/3. -2147, -8, 0.1, 2, 7, 52/3 Sort -9, -1, 29, -4970, 3 in increasing order. -4970, -9, -1, 3, 29 Sort 3866, -1/4, -4, -0.7, -6. -6, -4, -0.7, -1/4, 3866 Sort -10, 11, -4, -10.8, 5/4, -27.8 in descending order. 11, 5/4, -4, -10, -10.8, -27.8 Sort -1, 2, 163453 in increasing order. -1, 2, 163453 Put -54, -4, -1641, -15 in decreasing order. -4, -15, -54, -1641 Sort -44, 0, -3, -2, -241 in increasing order. -241, -44, -3, -2, 0 Sort -49, 6, -5, -133, -3, 1 in descending order. 6, 1, -3, -5, -49, -133 Sort -1, -25, 26, -2, -1014, 4. -1014, -25, -2, -1, 4, 26 Put 1/5, 4, 3/16, 2651.85, -3/2 in ascending order. -3/2, 3/16, 1/5, 4, 2651.85 Put -4/9, -1, -0.5, -15, 1, 0.46 in descending order. 1, 0.46, -4/9, -0.5, -1, -15 Put 1, 22, 4, -4, -2, -42 in increasing order. -42, -4, -2, 1, 4, 22 Sort -25, 5, -1/12, 2.03, 1 in descending order. 5, 2.03, 1, -1/12, -25 Sort 1, 5, 3036, 191 in decreasing order. 3036, 191, 5, 1 Put 9, -3/5, -3, -0.076907 in descending order. 9, -0.076907, -3/5, -3 Put 4, -4, 98, 5, 2, 10037 in decreasing order. 10037, 98, 5, 4, 2, -4 Put 982, -5, 4, 612 in increasing order. -5, 4, 612, 982 Put 4, -45, -3, -187, -5, -4, 5 in increasing order. -187, -45, -5, -4, -3, 4, 5 Put -25700, 1, 4, 2, 18 in descending order. 18, 4, 2, 1, -25700 Sort -1, -102148, -41, 0, -2 in ascending order. -102148, -41, -2, -1, 0 Sort -243, 287577, -4 in descending order. 287577, -4, -243 Put 1, 16, 20320 in increasing order. 1, 16, 20320 Sort -1, -62/453, 0.3, -0.3, -0.019 in decreasing order. 0.3, -0.019, -62/453, -0.3, -1 Sort 0, -3, 14654468, 3 in increasing order. -3, 0, 3, 14654468 Sort -3, -4, 7, -5, 695709. -5, -4, -3, 7, 695709 Sort 5, 540, -0.4, -27. -27, -0.4, 5, 540 Sort -13, 1/59, 22/9, 1 in ascending order. -13, 1/59, 1, 22/9 Put -2, 51, 5, 3, 0, 90, -18 in ascending order. -18, -2, 0, 3, 5, 51, 90 Put 0.1, -9/41182, -0.1 in ascending order. -0.1, -9/41182, 0.1 Sort -4, 5, 16626, 3, 26 in increasing order. -4, 3, 5, 26, 16626 Sort 6, -232, -4, 11, -2 in decreasing order. 11, 6, -2, -4, -232 Put -12, -3, 2, 1/2, -0.014, 144 in descending order. 144, 2, 1/2, -0.014, -3, -12 Sort -4, -3, 22, 2, -27, -5. -27, -5, -4, -3, 2, 22 Sort 3, -163, 7, 0, 4, 145 in decreasing order. 145, 7, 4, 3, 0, -163 Sort -2, -27, -359, 16, -4, 3, 1 in decreasing order. 16, 3, 1, -2, -4, -27, -359 Sort 384, -21/5, -0.057, 0 in decreasing order. 384, 0, -0.057, -21/5 Sort 8, -4, 283408, 5, -2 in descending order. 283408, 8, 5, -2, -4 Sort 2, -9300, 3, -514 in increasing order. -9300, -514, 2, 3 Sort 2, -2, -4, 60, 13, -1, 5 in ascending order. -4, -2, -1, 2, 5, 13, 60 Sort 66479, -6/25, 5, 4/5, -3 in descending order. 66479, 5, 4/5, -6/25, -3 Sort 115, 123, -8, 5, -4, -1. -8, -4, -1, 5, 115, 123 Put 3, -10868/239, 0.01, 0.06 in descending order. 3, 0.06, 0.01, -10868/239 Sort -80, 6, 5, 321, -43, 1 in ascending order. -80, -43, 1, 5, 6, 321 Put 2, 56396, -46 in decreasing order. 56396, 2, -46 Sort -5, -1481, 11, 761, 0. -1481, -5, 0, 11, 761 Sort -6, -12, -9, 0, -4, 7, -2 in descending order. 7, 0, -2, -4, -6, -9, -12 Put -4, 2, 30, -1, 14, 0, 68 in incr	{ "pile_set_name": "DM Mathematics" }
e form lc2 + pc + rc3 + s and give l. 1 Express (-3 + 3 - 4n)(52 - 544 + 165 - 190 - 147) in the form tn + l and give l. 0 Express -59s4 + s + 1 - 26s*2 + 27s*2 - s + 10s*3 + 64s*4 as vs*3 + zs*4 + k + ys*2 + fs and give v. 10 Express 327r4 - 6r + 2r - 3 - 335r4 - r3 in the form b + ar2 + lr + or3 + yr*4 and give b. -3 Rearrange 0b - b + 2b + (0 + 3 - 1)(-2b + 2b - 2b) - 3b - 2b + 4b + 2b - 3b - 2b + 168b + 878b + 764b + 1693b + 784b to f + db and give d. 4280 Rearrange (0r - 2r + 5r)(-967 - 76r + 967) to yr + ur*2 + o and give u. -228 Rearrange (582 + 744r - 582)(2 + 2 - 5 + (3 + 1 - 3)(-2 + 3 - 2)) to p + or and give o. -1488 Rearrange -3w*4 + w + 158w*3 - 2w - 143w3 + 3w*2 to tw + bw4 + sw*3 + xw*2 + k and give b. -3 Rearrange (2g + g*2 - 2g)(2 + 0 + 4)((10g - 7 + 7)(0 - 1 + 0) - 9 + 9 - 4g) to the form pg*2 + tg*3 + s + lg and give t. -84 Rearrange 605d + 79d - 29d + 578d to the form rd + p and give r. 1233 Rearrange -200s - 199s - 196s - 39 + 589s to m + xs and give x. -6 Express -580p2 - 1129p*2 + 0 + 0 as dp*2 + lp + b and give d. -1709 Express 5w2 + 19w*2 + 122 - 156 in the form xw + z + ow2 and give z. -34 Express -44k + 3k + 11k in the form y + uk and give y. 0 Express 245m*2 + 210m - 210m in the form vm*2 + q + km and give v. 245 Express d3 - d3 - d*3 + ((-d - 4 + 4)(3d - d - d) - 7 + 7 + 3d*2)(-4d + 5d - 3d) in the form i + od*3 + vd*2 + zd and give o. -5 Rearrange (0 - 3 + 5)(-4 + p + 4) - 3p - 2p + 2p - 1 + 1 - 5p + (3 + 2 - 4)(p - 2p - p) - 5p - p - 2p to up + b and give u. -16 Express g*2 - 6 + 2 + 2g + 12g4 + 6g*4 - 10g*4 as f + dg*2 + lg*3 + zg + bg4 and give b. 8 Express -3556 + 2p*3 + 3649 - 2p + p*3 as xp + fp3 + y + rp*2 and give y. 93 Rearrange -52z*2 - 140z - 47z2 - 49z*2 + 200z*2 + 1 - 50z*2 to the form qz*2 + bz + v and give b. -140 Rearrange (-538z + 286902 - 286902)(-z + 2z - 2z) - 2z2 + 6z*2 - 3z*2 to the form i + fz + wz2 and give w. 539 Express -12i + 27 + 42 - 53 + 2i as ki + w and give k. -10 Rearrange (-207r2 + 36r*2 - 498r*2)(-2 - 2 - 2)(-2r + 0r + 0r) to wr3 + mr + yr2 + u and give w. -8028 Express -10d*2 - 2d*3 - 953d - 78 + 953d + 9d*2 as id*2 + t + zd*3 + ld and give z. -2 Rearrange (-6884 + 40v + 6884)(-1 + 2 + 1)(-2 - 2 + 2) to cv + g and give c. -160 Express (4u2 - 396u + 210u + 258u)(4u*2 - 2u*2 - 3u*2) in the form h + yu*3 + au*4 + ru + fu2 and give a. -4 Rearrange ((-h - 2 + 2)(1 - 5 + 2) + 3 + 3h - 3)(-4 + 2 - 4) + (-h + 2 - 2)(-3 - 5 + 0) to the form t + zh and give z. -22 Rearrange 113p + 19p + 52p + 161p + 109p to b + wp and give w. 454 Express (-1 - 3 + 3)(-3q - q + 6q)((2 + 2 - 1)(-9 + 0 + 0) + 2 - 8 + 11) as l + xq and give x. 44 Rearrange -29976 + 412u + 29976 to nu + w and give n. 412 Rearrange (-w*2 - 3w*2 + 3w*2)(-327w - 1439 + 1439 + (-2w + 0 + 0)(0 - 1 + 0)) to b + nw*2 + iw*3 + yw and give y. 0 Rearrange 7l2 - 21l*2 + 2 + 20l*2 - 4 - 54l*3 to jl*2 + p + bl + vl3 and give j. 6 Rearrange -16t - 104t - 130t to the form n + yt and give y. -250 Express 11r*3 - 1 + 6r*4 - 5r*3 - r - 8r*4 - 7r*2 - 7r*3 in the form dr*4 + h + ir*3 + sr + jr2 and give i. -1 Rearrange (g - g - 3g*3)(-g + g + 2g) + (-4 + 4 - 2)(-3g + g + 10g)(-3g*3 - 6g*3 - 5g*3) to ug*3 + l + bg*4 + hg*2 + og and give b. 218 Rearrange -652z + 30 - 25 - 5 to l + az and give a. -652 Rearrange -3 - f*2 - 12 + 0f*2 + 0f*2 + 3f to hf2 + pf + d and give h. -1 Rearrange ((0 + 1 + 1)(-4g - 4g + 6g) - 3g - 3g + 5g + 2g - 1 + 1 - 2g + 3g + 0g + g + 2g - 4g)(1 - 3 + 0) to a + xg and give x. 6 Rearrange u2 + u + 11u*3 - 5u*4 - 5u*2 - 2 + 7u*2 - 9u*3 - 5u*2 to o + tu + fu4 + gu*2 + bu*3 and give b. 2 Express 2 - 6338y - y*4 + 2y*4 + 6362y in the form ry + hy*3 + wy*4 + v + sy*2 and give w. 1 Rearrange -3t3 + t3 + 27863t + 18t*4 - 27868t - t*2 to zt*2 + qt*4 + f + ht + kt3 and give h. -5 Express (g3 - 5g*3 + 2g*3)(-1673 + 3151 + 1278) as x + fg3 + zg*2 + ug and give f. -5512 Express -85u - 5u*2 + 3u2 + u4 + 135u + 4 - 53u as v + gu4 + su*3 + tu*2 + ku and give g. 1 Express 102 + 36 - 84 + 6q2 - 7q*2 as sq*2 + wq + f and give s. -1 Express 2b4 - 2b - b + 8 - 8 - 2 - 2b3 as nb*2 + p + lb*3 + rb + xb4 and give p. -2 Rearrange 7a*2 - 3a*2 - 4a3 + a2 - a*4 - 4a*2 + 6a*3 + 3 to n + ia*4 + la*3 + ta + ha2 and give l. 2 Express -128x*3 + 11x*3 - 150x*3 + (1 + 2x - 1)(5x*2 - 4x*2 - 3x*2) in the form y + sx + zx2 + kx*3 and give k. -271 Express (15d*2 - 253d - 68d2 + 251d)(2d - d*2 - 2d) as od + qd*4 + u + jd*3 + cd*2 and give q. 53 Express -3 + 45l + 3 + 98l - 61l in the form a + ul and give u. 82 Express 167w*2 - 339w*2 + 172w*2 - 2w*3 + 94 in the form t + jw*3 + fw*2 + nw and give j. -2 Express -1241s + 981s + 636s - s3 in the form ps*3 + u + ls + ks2 and give p. -1 Express -10k*4 + 44k*3 + 4k*4 - 33k*2 - 2 - 23k*3 - 19k*3 in the form hk*2 + i + bk*3 + rk*4 + vk and give r. -6 Express -1 - 3s3 - 2840s*2 + 3s + 2s4 + s3 + 2841s*2 in the form m + ts + ns2 + zs*4 + ws*3 and give z. 2 Express -88x - 136x - 34x + 38x in the form i + kx and give k. -220 Express (-5r - 12r + 2r)(0 - 1 - 1) + 5r + 2r + 5r in the form x + dr and give d. 42 Express 29 - 12q - 13 + 3q*4 + 10q*2 - 12 - 4 in the form hq*3 + m + pq*2 + lq*4 + uq and give p. 10 Express 34f + 193f + 139f - 83f + 141f + 0f + 2f - 4f + (4 - 3 - 3)(-3f + 2f + 4f) in the form t + cf and give c. 416 Rearrange 18 - 4g*2 - 57 + 2g*2 to the form j + pg*2 + vg and give p. -2 Express t4 + t2 + 1451t - 12 - 726t - 3t4 - 730t in the form xt3 + ot + it4 + q + ht*2 and give h. 1 Express -5722k - 142k2 + 2860k + 2862k as gk*2 + j + mk and give g. -142 Express -41s4 + 19 - 17 + 43s*4 + s - 2s*3 in the form x + ns*3 + ks*2 + us + cs4 and give u. 1 Express 0z*4 + 0z - 4z - 3z + 66z3 - 1 - 3z*4 + 5z in the form tz4 + nz*2 + hz*3 + qz + b and give t. -3 Express (q*2 - 6q*2 + 7q*2)(0q - 2q + q + 2q2) + 4q4 + q4 + 4q4 in the form fq*3 + y + vq*2 + pq*4 + mq and give p. 13 Express (3r - 4r - 2r)(-r + 0r + 3r + (6 + 4 - 3)(2r + 3r - 2r)) in the form mr + br*2 + s and give s. 0 Express -2 - 9j*2 + 7j*2 + 6 + 15j*3 + 0 in the form s + cj + xj2 + wj*3 and give s. 4 Rearrange -y - 2 + 197y*2 - 226y*2 + y - 297y*2 to the form dy*2 + b + jy and give d. -326 Express 450g3 - 227g3 - g2 - 6 - 226g3 as ag + cg2 + kg3 + h and give k. -3 Rearrange -p3 - 2 - 4 - 9 - p*3 + 18 - 17p2 - p4 to gp3 + t + up*2 + yp + mp4 and give m. -1 Rearrange 2k*4 - 2k*2 - 599k + 5 + 302k + 3k*2 + 300k to the form ok4 + vk + mk2 + fk*3 + d and give d. 5 Express 5k - 3k + k + (1 - 2 + 4)(0k + 3k - 2k) in the form nk + j and give n. 6 Rearrange -73 + 2108b - 65 + 138 to the form w + ob and give o. 2108 Rearrange -14m - 18m + 4m2 - 11m - m*3 + 10m*4 + 43m to dm2 + qm*4 + nm*3 + f + xm and give n. -1 Express (6d - d + 7d)(0 - 4 + 3) - d - 4d + 9d as m + nd and give n. -8 Express ((4 - 3 + 1)(-12 + 11 - 7) - 1 + 2 + 8)(0i2 + 5i*2 - 4i*2)(-i + 3i + i) as oi*3 + hi*2 + b + si and give o. -21 Express (3 - 2 + 2)(-90 - 68 + 3 - 131)(-2v + 2v - 2v) in the form ov + r and give o. 1716 Rearrange 4p + 2p*4 - 4p + 203p2 - 2p - 201p2 - p3 to sp*3 + fp*4 + ip + dp2 + j and give i. -2 Rearrange (-2f + 23 + 10 - 28)(8 + 0 - 2 + 1 + 1 - 1 + 0 - 1 + 3 + (-4 + 3 + 2)(-3 + 3 - 2) - 4 + 2 + 4) - 3f - f + 2f to a + if and give a. 45 Express (-2v*3 + 2v*3 - 2v*3)(1 + 0 + 3)(2 - 18 + 4)(v + 4v - 3v) + 10v4 + 6v - 6v in the form y	{ "pile_set_name": "DM Mathematics" }
y + 15981 What is the d'th term of -147, -565, -1243, -2193, -3427, -4957, -6795, -8953? -2d3 - 118d*2 - 50d + 23 What is the w'th term of -147587969, -147587967, -147587965, -147587963? 2w - 147587971 What is the n'th term of 106663, 213140, 319617, 426094? 106477n + 186 What is the i'th term of 26240, 104763, 235612, 418793, 654312? i*3 + 26157i*2 + 45i + 37 What is the r'th term of -274813833, -549627667, -824441501, -1099255335, -1374069169? -274813834r + 1 What is the a'th term of 9970, 9479, 8988, 8497, 8006, 7515? -491a + 10461 What is the y'th term of -279938, -559905, -839872, -1119839, -1399806? -279967y + 29 What is the n'th term of -16618, -66656, -150044, -266776, -416846? n3 - 16681n*2 - 2n + 64 What is the r'th term of 399587, 798007, 1196427, 1594847, 1993267? 398420r + 1167 What is the w'th term of -625031, -1249662, -1874293, -2498924? -624631w - 400 What is the h'th term of 41724, 49528, 57342, 65172, 73024? h3 - h2 + 7800h + 33924 What is the z'th term of -156850838, -156850836, -156850834, -156850832, -156850830? 2z - 156850840 What is the a'th term of -2634024, -5268037, -7902050, -10536063? -2634013a - 11 What is the b'th term of 6960, 7449, 7938, 8427? 489b + 6471 What is the y'th term of 4495182, 17980736, 40456664, 71922966, 112379642, 161826692, 220264116? 4495187y2 - 7y + 2 What is the h'th term of 140636, 136577, 132518, 128459, 124400, 120341? -4059h + 144695 What is the y'th term of 9461295, 18922586, 28383877, 37845168, 47306459, 56767750? 9461291y + 4 What is the t'th term of -3083628, -6167263, -9250886, -12334491, -15418072? t*3 - 3083642t + 13 What is the m'th term of 8140, 26951, 45774, 64615, 83480? m*3 + 18804m - 10665 What is the h'th term of 284996091, 284996089, 284996087, 284996085, 284996083, 284996081? -2h + 284996093 What is the a'th term of 3181, 6241, 9149, 11911, 14533, 17021, 19381, 21619? a3 - 82a*2 + 3299a - 37 What is the m'th term of -3243286, -3243367, -3243454, -3243541, -3243622, -3243691, -3243742? m*3 - 9m*2 - 61m - 3243217 What is the w'th term of 55439, 110891, 166361, 221849, 277355, 332879? 9w2 + 55425w + 5 What is the u'th term of -214392, -214397, -214402? -5u - 214387 What is the y'th term of 272938, 272915, 272894, 272875? y2 - 26y + 272963 What is the g'th term of 381318, 381356, 381394, 381432, 381470, 381508? 38g + 381280 What is the s'th term of -9610891, -19221848, -28832805? -9610957s + 66 What is the j'th term of -11661, -26178, -40689, -55188, -69669, -84126, -98553? j*3 - 3j*2 - 14515j + 2856 What is the t'th term of -54469, -54611, -54729, -54823? 12t2 - 178t - 54303 What is the w'th term of -5050, -40456, -136558, -323704, -632242, -1092520? -5058w3 + 8 What is the x'th term of 308, 906, 2132, 4316, 7788? 55x*3 - 16x*2 + 261x + 8 What is the q'th term of 24788, 99665, 224460, 399173? 24959q2 - 171 What is the n'th term of -427575231, -427575230, -427575229, -427575228? n - 427575232 What is the m'th term of 7054207, 7054290, 7054373, 7054456, 7054539, 7054622? 83m + 7054124 What is the j'th term of 1012, 11530, 40068, 95632, 187228, 323862, 514540, 768268? 1501j3 + 4j*2 - j - 492 What is the l'th term of -2904, -12181, -27630, -49239, -76996, -110889? 2l*3 - 3098l*2 + 3l + 189 What is the s'th term of -6834698, -6834709, -6834720, -6834731, -6834742? -11s - 6834687 What is the r'th term of -136, -423, -1054, -2197, -4020, -6691? -28r*3 - 4r*2 - 79r - 25 What is the g'th term of 143, 635, 1413, 2477? 143g2 + 63g - 63 What is the t'th term of 14688062, 29376129, 44064196, 58752263, 73440330, 88128397? 14688067t - 5 What is the i'th term of -2505, -2829, -3701, -5391, -8169, -12305? -45i*3 - 4i*2 + 3i - 2459 What is the y'th term of -154166338, -308332675, -462499012, -616665349, -770831686, -924998023? -154166337y - 1 What is the p'th term of -929322, -929323, -929324, -929325, -929326, -929327? -p - 929321 What is the q'th term of 1774, 14427, 48862, 115975, 226662, 391819? 1816q*3 - 5q*2 - 44q + 7 What is the p'th term of 138800, 277534, 416162, 554630, 692884? -9p3 + p2 + 138794p + 14 What is the q'th term of 616782, 616426, 616068, 615708, 615346, 614982? -q*2 - 353q + 617136 What is the q'th term of -155, 9783, 36759, 89293, 175905, 305115? 1420q3 - q2 + q - 1575 What is the j'th term of 182931, 182944, 182965, 183000, 183055, 183136, 183249? j3 - 2j*2 + 12j + 182920 What is the f'th term of -1759, -356, 1071, 2534, 4045, 5616, 7259, 8986? 2f3 + 1389f - 3150 What is the w'th term of -1505693, -3011370, -4517047, -6022724, -7528401, -9034078? -1505677w - 16 What is the b'th term of -155900, -155911, -155948, -156023, -156148, -156335, -156596? -2b3 - b2 + 6b - 155903 What is the f'th term of 2272823, 4546155, 6819487? 2273332f - 509 What is the o'th term of -32220, -37024, -41828, -46632, -51436? -4804o - 27416 What is the w'th term of -1811407, -3622810, -5434215, -7245622, -9057031? -w2 - 1811400w - 6 What is the i'th term of -95558, -95852, -96146, -96440? -294i - 95264 What is the b'th term of 7400, 14658, 21764, 28718, 35520, 42170, 48668? -76b*2 + 7486b - 10 What is the f'th term of -579993, -2319961, -5219907, -9279831, -14499733? -579989f2 - f - 3 What is the b'th term of -77370004, -154740018, -232110032? -77370014b + 10 What is the o'th term of 960, 3882, 8720, 15474? 958o2 + 48o - 46 What is the t'th term of 101646, 200363, 299080? 98717t + 2929 What is the l'th term of -65278, -130522, -195766, -261010? -65244l - 34 What is the s'th term of -733, -672, -513, -214, 267? 7s3 + 7s*2 - 9s - 738 What is the a'th term of -16966, -34063, -51148, -68215, -85258, -102271, -119248, -136183? a*3 - 17104a + 137 What is the j'th term of -603, -1280, -1989, -2730, -3503, -4308? -16j2 - 629j + 42 What is the b'th term of -106526, -209244, -311962? -102718b - 3808 What is the m'th term of 1870, 8904, 20628, 37042, 58146, 83940? 2345m*2 - m - 474 What is the f'th term of -15683518, -31367021, -47050500, -62733943, -78417338? 2f*3 - 15683517f - 3 What is the g'th term of 40889933, 81779870, 122669807? 40889937g - 4 What is the d'th term of 20843, 20896, 21037, 21308, 21751, 22408, 23321, 24532? 7d*3 + 2d*2 - 2d + 20836 What is the f'th term of 12673, 12447, 12213, 11971, 11721? -4f2 - 214f + 12891 What is the c'th term of -14191, 2724, 48643, 138068, 285501? 2417c3 - 4c - 16604 What is the b'th term of -12832, -26304, -39776, -53248, -66720, -80192? -13472b + 640 What is the h'th term of -441623, -441630, -441637? -7h - 441616 What is the s'th term of -52937, -105872, -158807? -52935s - 2 What is the r'th term of -6526, -25032, -55520, -97990, -152442, -218876? -5991r*2 - 533r - 2 What is the k'th term of 108139411, 216278822, 324418233, 432557644, 540697055? 108139411k What is the n'th term of -376336, -1505340, -3387014, -6021358? -376335n2 + n - 2 What is the s'th term of 240, 316, 382, 444, 508? s3 - 11s2 + 102s + 148 What is the h'th term of 59928, 59965, 60048, 60195, 60424, 60753, 61200, 61783? 3h3 + 5h*2 + h + 59919 What is the y'th term of -2712, -2955, -3388, -4035, -4920, -6067, -7500, -9243? -4y*3 - 71y*2 - 2y - 2635 What is the t'th term of -2693, -2162, -1267, -14, 1591, 3542? -t*3 + 188t*2 - 26t - 2854 What is the t'th term of -6255, -25202, -56781, -100992, -157835, -227310? -6316t2 + t + 60 What is the l'th term of 607016, 1214115, 1821212, 2428307? -l2 + 607102l - 85 What is the a'th term of -256214, -257447, -258680? -1233a - 254981 What is the w'th term of -3576, -2269, -962? 1307w - 4883 What is the u'th term of 1122982, 4491831, 10106572, 17967199, 28073706, 40426087, 55024336? -u*3 + 1122952u*2 + 31 What is the r'th term of -47258, -189121, -425572, -756611? -47294r*2 + 19r + 17 What is the t'th term of -148, -242, -560, -1102? -112t2 + 242t - 278 What is the o'th term of 31806, 31802, 31770, 31716, 31646, 31566, 31482? o*3 - 20o*2 + 49o + 31776 What is the a'th term of -64576, -127855, -191134, -254413, -317692, -380971? -63279*a - 1297 What is the w'th term of 125902, 135791, 145680, 155569, 165458, 17	{ "pile_set_name": "DM Mathematics" }
4. Let j be v(-4). Is (j/12)/((-1)/(-75)) a prime number? False Let r(s) = s*2 - 2s - 4. Let x be r(3). Let p = 3 + x. Is p composite? False Suppose 4o + 5u = 7, 0u = -3o - 2u + 7. Let q = o + 16. Is q composite? False Suppose 5s = 2l - 8203, 7l - 2s - 16430 = 3l. Is l prime? False Suppose 3p - 271 = -5x + 2062, 5p = -5x + 2325. Is x composite? True Let s be 0 + (-1)/((-3)/6). Suppose 0 = 2z - 2h - 768, -3z + sh - 7h = -1112. Is z a composite number? False Suppose l + 2l - 4604 = 5o, 4l = 4o + 6152. Is l a prime number? True Let i(j) = 2j - 2. Let l be i(-3). Is l(-69)/242 composite? True Suppose 0 = -3c + 6c - 3297. Is c composite? True Suppose -3p + 19 = -x + 2p, -19 = -3x - 4p. Is 10/(-10) - (x + -391) a composite number? False Let i(w) = 3w - 1. Let m be i(5). Suppose -3s + m = 4k, 33 = 3k + 2k - 4s. Suppose -5p + 89 = a, 12 = 4a - kp - 244. Is a prime? False Is (-586)/(-10) + (-3)/5 a prime number? False Let z(j) = j3 - 4j*2 - 5j - 3. Let o be z(5). Is o((-177)/9 + 2) a prime number? True Let f be (-42)/(-9) - (-2)/6. Suppose -11 = 2i - f, 0 = -x - 5i - 14. Is (94 - x)3/9 a composite number? False Let p(x) = 63x + 61. Is p(16) prime? True Is (4/12)/((-2)/(-2286)) prime? False Let g(b) = 73b - 10. Let y(c) = -72c + 11. Let x(a) = 4g(a) + 5y(a). Is x(-7) composite? False Suppose -2 = 3z + 4. Let b(r) = -30r - 2. Is b(z) prime? False Let v be ((-2)/(-5))/((-2)/110). Let f = 110 + v. Suppose -c - 5o = 2c - f, 0 = -5o - 5. Is c composite? False Let j(v) = v*3 + 8v*2 + 5v - 7. Let d(r) = -r - 4. Let x be d(-6). Suppose 3 = -xm - 11. Is j(m) a prime number? True Suppose x + 3 = 8. Let f = 10 - x. Suppose -fy - 5w + 130 = 0, -3y + 8y = -4w + 126. Is y prime? False Let v = 36 + -12. Let u be 3 + 1 - 3/3. Is v - -2u/6 composite? True Is (30/(-20))/((-6)/2132) prime? False Is (-1)/((-4167)/1041 - -4) prime? True Suppose 4t + 2s = 12, 5s - 3 - 22 = -5t. Let r(g) = 97g*2 - g + 1. Is r(t) prime? True Let p(b) = -2b*3 - 6b*2 - 7b - 7. Is p(-4) a prime number? True Let f(y) = -3 - 1 + y + 3y2 + 5y*3 - 5y. Let t(z) = 11z3 + 7z*2 - 9z - 9. Let k(u) = -7f(u) + 3t(u). Is k(-2) a prime number? False Suppose 0 = 2m + 2m - 24. Let i(u) = u*2 + 4u. Let w be i(m). Suppose -4y + 64 + w = 0. Is y prime? True Let w(m) = m2 + 2m - 2. Let y = 8 + -4. Let u be w(y). Suppose -4c + 34 = -u. Is c a composite number? True Suppose g - 3g + 5o + 164 = 0, -2o - 4 = 0. Is g prime? False Suppose 4q - 2 = 2. Let s be q(0 + 2) + -11. Let n = 32 + s. Is n composite? False Suppose 0 = -k - 4b + 19, 0 = 2k - 4b + 6 + 4. Suppose f = -kp + 36 - 2, 5p = -3f + 102. Is f prime? False Let t(x) = 7x - 3. Let u be t(5). Suppose 0 = -2s + u + 42. Is s a prime number? True Let p(w) = -4w + 3. Let v be p(2). Let u be -3 - v - (2 + 0). Suppose 4f + f - 175 = u. Is f a prime number? False Let k(s) = -s + 1. Let z be k(-6). Let a = z - 7. Suppose am + 5m = -2f + 543, -792 = -3f - 3m. Is f prime? False Let f = 39 + -10. Suppose -4m = -1 + f. Is 2 - m - 1/(-1) prime? False Let p be (16/12)/(2/3). Let d be ((-142)/(-4) + 0)p. Let i = d - 34. Is i a composite number? False Let g(k) = -k2 + 3k - 3. Suppose o - 7 = -o - x, -3x = 5o - 18. Let h be g(o). Is (-3 - 35)/(h + 1) a prime number? True Let l = 478 + -27. Is l prime? False Suppose 8816 = 5p + 1701. Is p composite? False Is 1 - ((-2 - -3) + 98)-4 a composite number? False Suppose -3f + 2 + 7 = 0. Suppose fp - 84 - 33 = 0. Is p composite? True Suppose 5o = 2o - 294. Let h = -102 + 87. Let f = h - o. Is f composite? False Let k be -2 + 2 + (-1 - -4). Suppose -3q + 3u - 12 = 0, 0 = -u - k. Let y = 3 - q. Is y composite? True Suppose 0 = o - 0o - 239. Suppose -4h = -12, 2h = -5u + 4h + o. Is u a prime number? False Is (2/(-5 - -3))/(5/(-1945)) a prime number? True Let m(s) = 2s + 19. Let g be m(-10). Let z be ((-6)/(-4))/30. Is g(2 - (13 + z)) composite? False Let g(a) be the third derivative of a*5/60 + 5a*4/24 + 5a3/6 - a2. Let m = 28 - 21. Is g(m) prime? True Suppose 5c - r = r + 387, -241 = -3c - r. Is c composite? False Suppose -4c + 5c - 3m - 644 = 0, -3c + 4m = -1957. Is c composite? False Let k(u) = 9 - 6u + u*2 - 5u2 - u3 - 4u2. Let m be k(-7). Suppose 4t + 50 = 3z, -mt + 9 = 5z - 57. Is z a composite number? True Suppose -o - 5i + 626 = 0, -3o - 3i - 1291 = -5o. Is o prime? True Suppose u = -2u + 741. Is u a prime number? False Let z = -1010 + 1421. Suppose -3f + 2f - 250 = 0. Let v = f + z. Is v composite? True Let a(d) = 68d + 6. Is a(5) prime? False Suppose -815 = 4g + 5h, -606 = 5g - 2g + 2h. Let x = 440 - 119. Let n = g + x. Is n a prime number? False Let r(d) = d + 7. Let l be r(7). Suppose 2z - 68 + l = 0. Suppose -z + 122 = 5c. Is c a composite number? False Suppose 353 = 4y + 3w, -4w - 632 = -5y - 183. Let m = y - -38. Is m a composite number? False Suppose 0 = -f - n - 490, 2n = 5f + 6n + 2445. Suppose 6x = x - 10. Is f/(-15) - x/3 a composite number? True Is 6214/4 + 0 a prime number? False Let y(p) = p3 + 4p*2 + 2. Let n be y(-3). Let g be ((-4)/(-6))/((-2)/(-12)). Let x = n - g. Is x a composite number? False Let p be (2 - 4)/(0 + -1). Suppose 4w - 96 = -4t, -4w + t + pt + 75 = 0. Is w a prime number? False Let s be 0 + (1 - 1)/3. Let l(w) = w3 - w2 - w + 5. Let t be l(s). Suppose 5f - tn = -n + 47, -5f - 3n = -61. Is f composite? False Let x be (2 - (2 - 1)) + 19. Let b(a) = -2a*3 + 3a*2 + a - 2. Let g be b(2). Is (-5)/x - 173/g a prime number? True Suppose 2f - p - 7 = 0, p + 1 = 2f + 2p. Suppose 9 - 3 = -5m - fa, -2 = -a. Is (145/(-20))/(m/40) a prime number? False Is (-59)/((-3)/(-174)(-7 + 5)) a prime number? False Suppose 0r + 5r = 245. Is r prime? False Let b be (2 + -1)-4 + 0. Let l(o) = -2o - 4. Let h be l(-3). Is h - (b2 + 0) a composite number? True Suppose -r + 3 = 0, 0 = 3h - r + 338 - 1454. Is h prime? True Let m be (3 + 21/(-6))(-16)/(-8). Let c(w) = -w*2 - 2w + 2. Let q be c(-4). Is (m/3)/(q/882) composite? True Let v(h) = 2h2 - 2h*2 + 10h - 11h + 34h*3. Is v(1) composite? True Suppose -5 - 13 = 3y. Let d = -2 - y. Suppose -do + 57 = a, 5a - o - 2o = 239. Is a a composite number? True Let l(d) = 2d. Let m be l(2). Suppose -j - 14 = r + 3j, -10 = -5r - mj. Is (-7)/((15/r)/(-5)) prime? False Let v(m) be the second derivative of m4/6 + 5m3/6 - m2/2 + 5m. Is v(-4) composite? False Let x(i) = 9i*2 - 6i + i3 - i - 18 + 16. Is x(-5) a composite number? True Let o(v) be the third derivative of -v4 - v*3/2 - 7v*2. Is o(-3) prime? False Suppose -4f = -9f + 15. Is (8 - 2)/f - -369 composite? True Suppose 6q = 11q - 4495. Is q composite? True Let a(j) = -2j - 6. Let c be a(-4). Is 1/c + (-169)/(-2) composite? True Let g(h) = -h*2 + 5h - 2. Let k be g(3). Let u = 4 - 7. Let s = k - u. Is s a composite number? False Suppose 3j - 508 - 227 = -5f, 0 = -4f - 2j + 588. Let s = -29 - -253. Let r = s - f. Is r composite? True Let w = -797 + 1591. Is w a prime number? False Let h be 14(3/(-6))/(-1). Suppose hx - 4x - 387 = 0. Is x composite? True Let o(b) = -b3 + 2b*2 - b + 3b*2 + 0b*2 + 3. Let x be o(5). Is 4(-6)/(-3) - x composite? True Let x(d) = 50d + 8. Let g be x(4). Let w = g + -119. Is w a prime number? True Suppose -2v - 5m = 2, -2v - 2v + 3m = 56. Is (-387)/v - 10/55 composite? True Suppose -2 = -2f - 0, -3c + 5f = -421. Is c composite? True Is 10/(-4)(-11462)/55 prime? True Is (-20)/((-5)/1) + 537 a composite number? False Suppose -2r = -2u + 1003 + 1151, 2u + 2r = 2154. Is u a composite number? True Let l be (-7 - -6) + 22. Suppose -3v + 2x + 404 = 0, -lx - 535 = -4v - 4x. Is v a prime number? False Let f = 0 + 5. Let z = f + -2. Is ((-21)/3)/((-1)/z) composite? True Let s = 218 - 129. Is s a prime number? True Let k = 15 + 3. Suppose -399 = -kt + 15t. Is t prime? False Let k be (60/50)/(1/(-5)). Is (879/k)/((-1)/2) a composite number? False Let s(j) = 3029j + 2. Is s(1) composite? True Suppose -74d + 73*d + 485 = 0. Is d prime? False Is (-386)/(-4) - 2/(-4) composite? False Is (-4)/(80/(-43468)) - 2/5	{ "pile_set_name": "DM Mathematics" }
-39 (d) 1/6 (e) -0.3 b What is the fourth biggest value in -5, 323, -12, -7/5? -12 Which is the fifth smallest value? (a) -2 (b) 0.6 (c) -2/19 (d) -5 (e) -0.05 (f) -5/14 e What is the second smallest value in -0.8, -8792, 1/8? -0.8 Which is the smallest value? (a) 15 (b) 17 (c) 0.07 c What is the biggest value in 5, 1/4, -189, -4? 5 Which is the fifth smallest value? (a) 471/7 (b) -7 (c) 0.4 (d) 1/7 (e) -1/5 (f) 1/2 f Which is the fourth smallest value? (a) 0 (b) 2.7 (c) 53 (d) -0.5 (e) -0.6 (f) -1 a What is the smallest value in 4, 284, -0.058, 2? -0.058 Which is the third biggest value? (a) 0.2 (b) -2/3 (c) -2.68 (d) 0.16 (e) 0.4 d Which is the fourth smallest value? (a) -45 (b) 3 (c) -21 (d) -5 (e) 3/2 (f) 1 f What is the third biggest value in -1/3, 1/5, 53/71? -1/3 Which is the fourth smallest value? (a) 21 (b) 3 (c) -4 (d) 101 d Which is the third biggest value? (a) 0.5 (b) 3/8 (c) 606 (d) 2/5 d What is the fifth smallest value in -2/7, 1, 3, -2, 413.1? 413.1 What is the fourth smallest value in 0.1, 5/2, -657.6, -1? 5/2 Which is the fourth smallest value? (a) -4 (b) 2/7 (c) 7/269 (d) 0.37 d What is the second biggest value in -3/7, 1/2, -16722? -3/7 What is the fourth smallest value in -3, 4.8, -2/15, 5? 5 What is the fifth biggest value in -0.4, -421, -229, -2/9, 4? -421 What is the fourth smallest value in -0.3, 3, 1/17, 34.9, 1/2? 3 Which is the second biggest value? (a) -0.1 (b) 2 (c) 9 (d) 0.1 (e) -3 b Which is the second smallest value? (a) 3/8 (b) 0 (c) -0.014 (d) -3 c Which is the fourth smallest value? (a) -4 (b) -3.2 (c) -1 (d) -1.4 (e) 30 c What is the third smallest value in -19, 8, 3, 0.05, -5, 0.3? 0.05 What is the fifth biggest value in 0.013, -4, 4, 3, -0.007, 2/27? -0.007 Which is the second smallest value? (a) 3 (b) 0.5 (c) -3 (d) 2/21 (e) 2.8 (f) -0.037 f Which is the biggest value? (a) -2 (b) 15 (c) 1 (d) 4 (e) -28 b What is the second biggest value in 1/9, 138, 0.05, 1/2, 26, -5? 26 What is the smallest value in -4, 312595, 4, -3? -4 What is the third biggest value in 154184, -8/3, -4? -4 What is the biggest value in -2, -0.2, -2/11, -2/949? -2/949 What is the third biggest value in 4/7, -2, -1/4, -3, 388? -1/4 Which is the biggest value? (a) 0.362 (b) 0.03 (c) -5/3 (d) 0.66 d Which is the second biggest value? (a) 5 (b) -9 (c) -0.1 (d) 3 d Which is the fifth biggest value? (a) -3/8 (b) 1/2 (c) 0.09 (d) -8729 (e) 0.1 d Which is the fourth biggest value? (a) -36 (b) 2/9 (c) -2 (d) 2/17 a What is the smallest value in -1, 0.3, 3662? -1 Which is the fifth smallest value? (a) -0.5 (b) 0.5 (c) -9 (d) 0.3 (e) 6385 e Which is the third biggest value? (a) 8 (b) -2/13 (c) 4.5 b Which is the third biggest value? (a) -1/184 (b) 1.3 (c) -1 c Which is the third smallest value? (a) -0.24 (b) -0.3 (c) 19/10 c Which is the fourth smallest value? (a) -1 (b) 7/3 (c) 4 (d) 2/3 (e) 10 (f) -4 b What is the second biggest value in 1917, -3/5, 1.8? 1.8 Which is the smallest value? (a) -1/8 (b) 1 (c) -5 (d) -125/3 d What is the third smallest value in -5, 145, 23, 1/3, 5? 5 Which is the third smallest value? (a) -3/13 (b) 9/13 (c) -4 (d) -2/15 (e) 6/11 d What is the fifth smallest value in -1/6, -2, -1.54, 0.3, -5? 0.3 Which is the second biggest value? (a) -17 (b) -0.1 (c) 3 (d) 4/3 (e) -2/19 d What is the biggest value in 2/123, 0.5, 1, 8? 8 Which is the smallest value? (a) 12 (b) 0 (c) -444 c Which is the second biggest value? (a) 2 (b) 0.02 (c) 2/31 (d) 13 (e) 0 a What is the fourth smallest value in 2542, 5, -0.2, 1? 2542 What is the fifth biggest value in 119, -2, 0.1, 4, 11? -2 Which is the third smallest value? (a) 0.2 (b) -2/9 (c) 79 (d) 4/7 (e) 6 d Which is the second biggest value? (a) 1/55 (b) -0.5 (c) -42 b Which is the second biggest value? (a) -0.2 (b) -0.53 (c) -1.3 b Which is the third smallest value? (a) 256 (b) 1 (c) 42/5 a What is the third smallest value in 409, -6.1, 7/2? 409 What is the second smallest value in -89/5, -0.7, -22? -89/5 Which is the third biggest value? (a) -3 (b) 27 (c) 21 (d) -6.6 a What is the second biggest value in -4, 0.4, -54, 0.029, -3? 0.029 Which is the fourth biggest value? (a) 71 (b) -5 (c) -1/9 (d) -22 (e) -0.3 b What is the second biggest value in 3, -5, 12, -0.1, 5, -3? 5 What is the third biggest value in 25178, -0.2, 113? -0.2 What is the second biggest value in -4/7, 1, 0, -92/5, -4, 1/3? 1/3 Which is the second biggest value? (a) -5 (b) -4/3 (c) 298 (d) -4 (e) -8 (f) 6 f Which is the second biggest value? (a) 14 (b) -1 (c) -0.2 (d) -3 (e) 3 e What is the sixth smallest value in 0.1, -14, 1, 1.8, 0.2, -37? 1.8 What is the smallest value in -6, 1.3, 1/7, 53? -6 What is the fourth biggest value in 4/11, -2/11, 0.2, 72315? -2/11 What is the second smallest value in 3, -1/72, -95, 5? -1/72 Which is the second smallest value? (a) -1/2 (b) -5/4 (c) -89 (d) -1 b Which is the fourth smallest value? (a) -1/3 (b) 0.08 (c) 50 (d) -5 (e) 0 b What is the smallest value in 1/3, -0.1, 177, 1/5, -2? -2 What is the biggest value in 0.1, 1, 14351, 0? 14351 What is the second smallest value in -1, -5, 0, 5, 14? -1 What is the sixth smallest value in 0, 0.5, 2/15, -120, -1, 0.4? 0.5 What is the second smallest value in 1/4, -0.0497, -0.05, -0.1, -0.8? -0.1 What is the second biggest value in -3/2, -9/2, -0.5, 11/4? -0.5 What is the smallest value in 4/9, -0.142, -1, 2/3? -1 Which is the biggest value? (a) -1/2 (b) 2/5 (c) -5 (d) 87 (e) 0.09 (f) 1 d What is the smallest value in 3, -148, 50, 1/2? -148 Which is the second smallest value? (a) 0.9 (b) 5 (c) 2/3 (d) -1105 (e) 8/3 c What is the second smallest value in -2, 12, 2/63, -6, 8, -4/7? -2 Which is the second biggest value? (a) -0.01 (b) -1 (c) -1.3 (d) -0.4 (e) 0.5 a Which is the third biggest value? (a) -0.5 (b) 79 (c) 18 a What is the fourth smallest value in -2/7, -5, 1, -0.016? 1 Which is the smallest value? (a) 160 (b) -2246 (c) 2/5 (d) -2 b Which is the third smallest value? (a) -0.1 (b) -0.01 (c) -2/11 (d) -1 (e) 2 a What is the third biggest value in -5, 93, 2, -1/6, 1107? 2 What is the second smallest value in -10/9, 30.3, 1, 0.1, -2, 2/21? -10/9 Which is the fourth biggest value? (a) -1/4 (b) 0 (c) -41 (d) 124 c What is the sixth smallest value in -2/3, 2, -353, -0.01, 0.1, 1/19? 2 Which is the fourth biggest value? (a) 5/3 (b) 1 (c) 1/5 (d) 2893 (e) -0.2 c What is the second smallest value in 0.4, -2, -5, -3, -2/565? -3 What is the third smallest value in -1978, -3, 1.9, 0.5? 0.5 What is the biggest value in -0.1, -35.7, 2/7, -2.13? 2/7 Which is the second smallest value? (a) 79 (b) 16/7 (c) 3/2 (d) -6 c What is the third biggest value in 5/4, 2/19, 1/5, -2/31, -4, 1? 1/5 What is the third smallest value in -2/5, 1/3, -5, 5, -4, -3/14? -2/5 Which is the smallest value? (a) -7 (b) 3 (c) -0.5 (d) 1/593 (e) -0.1 a What is the second biggest value in 6, -140, 0.01? 0.01 What is the second smallest value in -993, -5, -26? -26 Which is the biggest value? (a) -3.82 (b) -2 (c) 0 c What is the second smallest value in 3, -4, 2/19, -3869.8, -0.1? -4 What is the second smallest value in 0.02, 0.5, 105.1, 0.3? 0.3 Which is the third smallest value? (a) -3 (b) -3359 (c) -39 a What is the second biggest value in 0, 18, -6/5, 4, -8/3, 3? 4 What is the fourth biggest value in 0.03974, 0.4, -0.05, -0.2? -0.2 Which is the third biggest value? (a) -18 (b) 3/4 (c) 277 (d) 1/3 (e) 0.2 d What is the smallest value in 660, 1/4, -0.4, -4? -4 Which is the smallest value? (a) 2/473 (b) -2/5 (c) -7/18 (d) -3 d Which is the second biggest value? (a) 0.5 (b) -0.9 (c) -11/581 c What is the smallest value in -2/15, -2.41, -0.1, -1.66? -2.41 Which is the second biggest value? (a) 581 (b) 9 (c) 0.3 (d) 2/9 b Which is the second biggest value? (a) 2/11 (b) -0.03 (c) -64 (d) 0.07 (e) 10 a Which is the biggest value? (a) -0.7 (b) 0 (c) -0.5 (d) -17 (e) 4/3 e What is the sixth smallest value in 4, 2/11, -13, -8, -0.5, 3? 4 Which is the smallest value? (a) -4 (b) -306883 (c) -2/11 (d) 4 b Which is the second smallest valu	{ "pile_set_name": "DM Mathematics" }
6.85 Convert 4944.764 tonnes to kilograms. 4944764 How many meters are there in twenty-one fifths of a kilometer? 4200 What is 8360.755km in meters? 8360755 Convert 121130.58ns to minutes. 0.000002018843 How many millilitres are there in fifteen quarters of a litre? 3750 How many micrometers are there in 52/5 of a millimeter? 10400 Convert 84.15353 grams to nanograms. 84153530000 Convert 27.9084ug to milligrams. 0.0279084 How many millennia are there in 0.9284056 centuries? 0.09284056 How many kilograms are there in seven eighths of a tonne? 875 Convert 2.931928 millennia to centuries. 29.31928 What is three fifths of a milligram in micrograms? 600 What is fifty-one fifths of a millimeter in micrometers? 10200 How many nanometers are there in 3/40 of a micrometer? 75 Convert 232.4926ng to kilograms. 0.0000000002324926 Convert 0.7061936g to tonnes. 0.0000007061936 What is 0.5612544l in millilitres? 561.2544 What is 25/2 of a litre in millilitres? 12500 What is 6.493583kg in tonnes? 0.006493583 What is 11/4 of a litre in millilitres? 2750 How many months are there in 3/10 of a century? 360 What is 72.53429km in nanometers? 72534290000000 What is 582.4692 minutes in hours? 9.70782 Convert 1.701001 years to decades. 0.1701001 Convert 5.803655l to millilitres. 5803.655 How many millennia are there in 7011.48 centuries? 701.148 How many nanograms are there in twenty-one halves of a microgram? 10500 Convert 96.01225 millennia to years. 96012.25 Convert 394.7481 years to decades. 39.47481 How many kilograms are there in 282278.3ug? 0.0002822783 How many microseconds are there in 0.1359062ms? 135.9062 Convert 39625.28 nanograms to kilograms. 0.00000003962528 How many litres are there in 256069.7 millilitres? 256.0697 How many millilitres are there in 59/4 of a litre? 14750 What is 48/5 of a millennium in decades? 960 How many millilitres are there in 31194.58 litres? 31194580 What is 9.179434ml in litres? 0.009179434 What is 678471.6mg in tonnes? 0.0006784716 How many grams are there in 3/10 of a kilogram? 300 What is 42/5 of a kilometer in meters? 8400 What is twenty-one quarters of a millennium in decades? 525 How many millilitres are there in 3/10 of a litre? 300 What is 3/25 of a centimeter in micrometers? 1200 Convert 91251.8 tonnes to milligrams. 91251800000000 What is 928685.4ns in seconds? 0.0009286854 How many milligrams are there in three fifths of a gram? 600 How many nanometers are there in thirty-three fifths of a micrometer? 6600 Convert 12389.98mg to tonnes. 0.00001238998 What is 1/80 of a centimeter in micrometers? 125 How many micrometers are there in 3/25 of a centimeter? 1200 Convert 0.4894854 millilitres to litres. 0.0004894854 What is 1/16 of a tonne in grams? 62500 What is fifteen quarters of a centimeter in micrometers? 37500 How many kilograms are there in 3/25 of a tonne? 120 What is 7/16 of a centimeter in micrometers? 4375 What is 77/5 of a millimeter in micrometers? 15400 How many meters are there in 3/5 of a kilometer? 600 What is five eighths of a micrometer in nanometers? 625 How many micrograms are there in 7601.121kg? 7601121000000 Convert 0.77651 centimeters to meters. 0.0077651 What is twenty-one fifths of a millennium in decades? 420 What is 25/2 of a minute in seconds? 750 What is 36838.78l in millilitres? 36838780 What is three tenths of a litre in millilitres? 300 How many nanometers are there in three tenths of a micrometer? 300 How many months are there in twenty-five halves of a year? 150 What is 41.26597g in milligrams? 41265.97 How many millilitres are there in 9.058755l? 9058.755 How many decades are there in 2877.4872 months? 23.97906 Convert 1.81194 years to months. 21.74328 What is 6/5 of a second in milliseconds? 1200 What is 57/5 of a meter in millimeters? 11400 How many milligrams are there in five eighths of a gram? 625 Convert 108.9678ml to litres. 0.1089678 How many seconds are there in 4/3 of a hour? 4800 Convert 40023.48m to centimeters. 4002348 What is 728.5336 nanometers in meters? 0.0000007285336 What is 13/8 of a millennium in months? 19500 How many micrograms are there in 3/32 of a gram? 93750 Convert 117.3912 millennia to decades. 11739.12 How many years are there in 800234.7 centuries? 80023470 What is 3/7 of a week in days? 3 How many days are there in four sevenths of a week? 4 How many millilitres are there in thirty-one halves of a litre? 15500 Convert 0.8559693 months to millennia. 0.000071330775 What is 596227.2 nanometers in millimeters? 0.5962272 Convert 39.47494ml to litres. 0.03947494 What is 9/10 of a kilometer in meters? 900 How many centuries are there in 139012.5 decades? 13901.25 Convert 6711.858 weeks to milliseconds. 4059331718400 What is 0.502668 micrograms in tonnes? 0.000000000000502668 What is eleven tenths of a milligram in micrograms? 1100 How many seconds are there in 96071.55 microseconds? 0.09607155 What is 17/2 of a centimeter in millimeters? 85 How many meters are there in 0.9320023 centimeters? 0.009320023 How many nanometers are there in 5/4 of a micrometer? 1250 What is fifty-one fifths of a millennium in centuries? 102 What is 6/25 of a litre in millilitres? 240 Convert 23.128 millilitres to litres. 0.023128 How many kilometers are there in 158981.6 micrometers? 0.0001589816 How many grams are there in 9.86753kg? 9867.53 How many months are there in 8174.63 decades? 980955.6 How many litres are there in 262146.7ml? 262.1467 What is 951856.92 milliseconds in days? 0.0110168625 How many milligrams are there in twenty-five halves of a gram? 12500 How many grams are there in 3/25 of a kilogram? 120 How many weeks are there in 3419.33634 minutes? 0.339219875 How many litres are there in 49889.38 millilitres? 49.88938 What is 9.424978cm in millimeters? 94.24978 Convert 8967.978 decades to millennia. 89.67978 How many millimeters are there in 3/5 of a centimeter? 6 How many nanograms are there in 11/2 of a microgram? 5500 What is twenty-six fifths of a litre in millilitres? 5200 How many days are there in 14.9652 minutes? 0.0103925 What is 3/10 of a microgram in nanograms? 300 How many weeks are there in 7867.90935ns? 0.000000000013009109375 How many micrograms are there in one tenth of a gram? 100000 How many grams are there in 527.3635ug? 0.0005273635 What is thirty-one fifths of a gram in milligrams? 6200 What is 0.7783331 litres in millilitres? 778.3331 How many millilitres are there in 6636.27l? 6636270 Convert 4.24931ml to litres. 0.00424931 What is 42/5 of a litre in millilitres? 8400 How many kilograms are there in fifty-one quarters of a tonne? 12750 How many litres are there in 0.3575652 millilitres? 0.0003575652 What is 646744.7 millilitres in litres? 646.7447 How many millilitres are there in 11/8 of a litre? 1375 What is 84705.32um in kilometers? 0.00008470532 How many days are there in 756480.06 microseconds? 0.00000875555625 What is 3/8 of a centimeter in micrometers? 3750 How many centimeters are there in 3/50 of a kilometer? 6000 How many millimeters are there in 6.484875um? 0.006484875 Convert 95.917m to kilometers. 0.095917 How many minutes are there in 73/3 of a day? 35040 How many months are there in twenty-one quarters of a decade? 630 Convert 4047.118kg to milligrams. 4047118000 What is 3.575208 grams in kilograms? 0.003575208 How many nanoseconds are there in 417.7065 minutes? 25062390000000 Convert 680.1027 millilitres to litres. 0.6801027 What is 6/25 of a meter in millimeters? 240 Convert 657514.5 millennia to years. 657514500 How many millimeters are there in 46/5 of a meter? 9200 What is five eighths of a centimeter in micrometers? 6250 What is 3901.21 tonnes in micrograms? 3901210000000000 Convert 6.715107 centuries to millennia. 0.6715107 What is 41324.31 micrograms in tonnes? 0.00000004132431 How many nanoseconds are there in 512058.5us? 512058500 How many millilitres are there in 42/5 of a litre? 8400 Convert 14.97555g to micrograms. 14975550 What is 1/28 of a week in minutes? 360 What is 22.84156 centuries in decades? 228.4156 How many milligrams are there in sixty-one quarters of a gram? 15250 What is sixty-one halves of a millennium in years? 30500 What is 0.6471637mm in micrometers? 647.1637 What is 7/4 of a millimeter in mi	{ "pile_set_name": "DM Mathematics" }
. Let p = s + l. Calculate the remainder when p is divided by 14. 7 Let k = 13262 - 11422. What is the remainder when k is divided by 905? 30 Suppose -8d = -11d + 12. Suppose -96 = -ds - u - 8, -3u + 96 = 4s. Suppose 9k = 3k + 228. Calculate the remainder when k is divided by s. 17 Let r(i) be the second derivative of -3i5/10 + i4/6 + i*3/6 + 6i. Let d(l) = l*2 + 23l + 94. What is the remainder when r(-1) is divided by d(-18)? 3 Let f be 3/(-8) + 6/16. Suppose f = 4g - 11 + 7. Let x(o) = 31o - 8. What is the remainder when 43 is divided by x(g)? 20 Let w = -3819 - -3903. Calculate the remainder when w is divided by 61. 23 Suppose 2u - 14 + 8 = 0. Suppose -4t - uv + 70 = 0, 2t - 48 = 4v + v. Calculate the remainder when 2/2(35 - 1) is divided by t. 15 Let a = 108 - 37. Let x(y) = y*3 - 3y*2. Let z be x(3). Suppose -32i + 78i - 1104 = z. What is the remainder when a is divided by i? 23 Suppose -4h + 3o + 3519 = 0, -2h - 105 = -2o - 1867. Calculate the remainder when h is divided by 34. 26 Suppose 0 = -t - t - 5i - 20, -5t = -3i - 12. Suppose t = w - q, -2q = 2w - 3q. What is the remainder when (-3)/((-6)/40) + w is divided by 14? 6 Let f = 17 - -1. Let g be ((-12)/(-10))/(f/45). Suppose -gs - 18 + 6 = 0, 5p = -s + 531. Calculate the remainder when p is divided by 18. 17 Let k = 25 + 0. Suppose 0 = -kh + 967 + 58. What is the remainder when 200 is divided by h? 36 Let r(i) be the first derivative of -5i2/2 + 67i + 39. What is the remainder when 203 is divided by r(11)? 11 What is the remainder when 4/30 - ((-1525920)/6000)/(6/10) is divided by 16? 8 Let v = -11227 + 13080. Calculate the remainder when v is divided by 116. 113 Let w = -519 + 537. Let b = -71 - -49. Let o = b + 27. Calculate the remainder when w is divided by o. 3 Suppose 0 = 3z - 3x - 24957, -9z + 13z - 33272 = 2x. What is the remainder when z is divided by 141? 139 Suppose 337 = -4u - 139. Let q = 148 + u. Suppose 28t + 26 = qt. Calculate the remainder when t is divided by 7. 5 Let w(x) = 2x2 - 42x + 124. What is the remainder when w(0) is divided by (-152)/(-12)(1 - -2)? 10 Suppose u = 4f + f + 14, 0 = -3f - 6. Suppose 0 = -2r - ux + 34 + 32, -3r + 114 = 3x. What is the remainder when r is divided by 9? 7 Let u(z) = -z3 + 99z*2 + 293z + 1512. What is the remainder when 291 is divided by u(102)? 105 Suppose 21p = 20p + 79. What is the remainder when p/(((-10)/70)/(8/(-14))) is divided by 64? 60 Let j = -16 - -14. Let p be 0 - 1 - (-39 + j + 2). Suppose -w + 1 + 3 = 5o, 4w = 2o + p. What is the remainder when 15 is divided by w? 6 Let z(y) = -9y*2 - 5y + 9. Let a be z(2). Let u(v) = 2v + 110. What is the remainder when u(a) is divided by 33? 3 Let o be (96/(-15))/((-8)/(-40)). Let l = -30 - o. Suppose -3q - 24 = -2n, 0n - 3q + 12 = ln. What is the remainder when n is divided by 2? 1 Let o(y) = 8y - 5 - 14y + 20 + 5y. Let q be o(10). Suppose -qx = -15 - 15. Calculate the remainder when 15 is divided by x. 3 Let b(k) = k*3 - 22k*2 - 44k - 54. Let x be b(24). What is the remainder when 151 is divided by 22/(-4)x/(-21)? 8 Let k = 4638 + -4607. What is the remainder when 155 is divided by k? 0 Let r = 245 - 182. What is the remainder when 1446 is divided by r? 60 Suppose -66g + 54989 = 11454 - 37183. What is the remainder when 4908 is divided by g? 16 Calculate the remainder when 74 is divided by (4-1)/((-684)/4959). 16 Suppose 3q + 4z - 392 = 0, 5z + 29 + 566 = 5q. Calculate the remainder when 229 is divided by q. 105 Let x(f) = f2 + 45f + 490. What is the remainder when x(-35) is divided by 114? 26 Suppose -2o = -4m + 174, -4m + 32 = 2o + 174. Let k = o - -116. What is the remainder when 367 is divided by k? 34 Suppose -4p + g + 1535 = 0, 0 = 23g - 22g - 1. Calculate the remainder when p is divided by 37. 14 Let l(m) = m3 + 4m*2 - 5m + 3. Suppose 0 = -10r - 13 - 27. Suppose -25h + 785 = -1490. What is the remainder when h is divided by l(r)? 22 Suppose 0 = -5m + 3m + 28. Suppose -4b - 3v + 45 = 0, 3v - 58 = -2b - 37. What is the remainder when m is divided by -7 + 2/((b + -6)/36)? 4 Suppose -11t + 1043 + 13 = 0. Suppose 3n - 678 = -5o, -2o + 4n + 196 = -t. Calculate the remainder when o is divided by 14. 12 Let y = 197 - 197. Suppose yk = 5k - 1340. What is the remainder when k is divided by 17? 13 Suppose -w = -2s - 158, 2s - 10 = -4. What is the remainder when w is divided by 26? 8 Let y = 1248 + -1233. Calculate the remainder when (-236)/(-16) - (-3)/12 is divided by y. 0 Let q(m) = 2m + 28. Let y be q(-12). Suppose -yi - 5f + 263 = 92, -183 = -5i + 4f. Calculate the remainder when (117 - 7) + (3 - 0) is divided by i. 35 Let w(t) = -2t2 - 101t - 309. Calculate the remainder when 497 is divided by w(-47). 17 Let h = 39 - -104. Suppose 0 = 186p - 198p + 144. What is the remainder when h is divided by p? 11 Suppose 0 = 4f - 32 + 16. Let l be f + (-2 - -3) - (4 + -2). Suppose 4y - 2g - 92 = -3g, 0 = ly + 3g - 69. What is the remainder when 90 is divided by y? 21 Suppose 0 = -13t + 157t - 15330 - 20670. What is the remainder when t is divided by 15/1 + 0 + -1? 12 Let d(t) be the third derivative of t*5/60 - 5t*4/12 + 11t*3/6 + 2t*2. Let s = -405 - -414. What is the remainder when 3 is divided by d(s)? 1 Suppose 48k + 16k - 3060 = -4k. Let b(t) = -2t2 + 0t + 7t3 + 0t2 + t. What is the remainder when k is divided by b(1)? 3 Let x(l) = 24 - l + 79 + l2 - 19l. What is the remainder when 49 is divided by x(6)? 11 Let v be -2 + 93/7 + (-10)/35. Suppose 18l - 735 = vl. Suppose -9i - 6i + l = 0. Calculate the remainder when 10 is divided by i. 3 Let n(c) = c2 - 4c - 3. Let w be n(-1). Suppose x - wr + 58 = 5x, 0 = -2r + 10. Calculate the remainder when 58 is divided by ((-32)/x)/((-6)/45). 18 Let c = -6682 - -6798. Calculate the remainder when 312 is divided by c. 80 Let p = 2943 - 930. What is the remainder when p is divided by 101? 94 Let r = 299 + -145. Suppose r = -4c + 6c. Let i = 108 - c. Calculate the remainder when i is divided by 8. 7 Let f = 25 - 8. Suppose -4v + 1931 = 387. Suppose -5r + v = 4o - 28, r = -5o + 87. What is the remainder when r is divided by f? 14 Let r(x) = 160x - 1395. What is the remainder when 6117 is divided by r(9)? 42 Let l(o) = -3o3 - 6o*2 + 14o + 3. Let h be l(-6). Let q = h - 276. What is the remainder when 139 is divided by q? 64 Let t be 2/38(-9)/(-2). What is the remainder when (-1139)/(-4) + (246/t - 10) is divided by 72? 69 Let x = -236 - -239. Suppose 9a + 892 = 5k + 7a, -xa + 912 = 5k. What is the remainder when k is divided by 14? 12 Suppose -8u - 286 = -3v - 7u, -3v = 5u - 244. Calculate the remainder when 312 is divided by v. 33 Suppose 623r = -137r + 1346720. Calculate the remainder when 5342 is divided by r. 26 Let j be (470/(-4))/(-1) + (-3)/(-6). Let m = j - 60. Calculate the remainder when m + (4 + -3)-2 is divided by 30. 26 Let z = 2450 + -1338. What is the remainder when z is divided by 62? 58 Let z = -7 + 10. Let u = 189 - 179. Let f = u - z. What is the remainder when 23 is divided by f? 2 Let b(y) = -y2 - 10y + 148. Let o(t) = 8t - 147. Let d(f) = -2b(f) - 3o(f). Suppose 37 = 2w - w. What is the remainder when d(0) is divided by w? 34 Suppose 12j - 13j - 40 = 0. Let f = -4 + 13. Calculate the remainder when f is divided by (-15)/j + -21(-1)/8. 0 Let j(s) = -3s*3 - 23s*2 - 11s + 81. What is the remainder when 285 is divided by j(-7)? 45 Let b = 8064 - 7331. Calculate the remainder when 752 is divided by b. 19 Let a be (-6)/(-1)(-7)/(-14). Suppose n - 7 = 2h + 7, n + ah = 9. What is the remainder when 56 is divided by n? 8 Suppose -73 = s - 89. What is the remainder when 140 is divided by 31 - (-8)/(s/14)? 26 Let v(a) be the second derivative of 89a*3/6 - 95a*2 - 35a + 1. Calculate the remainder when v(4) is divided by 58. 50 Suppose -z = 8y - 3y - 1143, -1167 = -5y - 4z. What is the remainder when 451 is divided by y? 224 Let t(s) be the first derivative of -6s2 - 17s - 36. Suppose -2*x + 172 + 10 = 0. What is the remainder when x is divided by t(-4)? 29 Let v = 139 + 174. Let z = v + 140. What is	{ "pile_set_name": "DM Mathematics" }
{h: 2, j: 10, p: 1, m: 5, s: 2}. 1/684 Two letters picked without replacement from kyvbvyliykkk. What is prob of sequence vy? 1/22 Four letters picked without replacement from {k: 3, p: 1, z: 12}. What is prob of sequence kkpk? 1/7280 Four letters picked without replacement from caaaacmcaaavaaccc. Give prob of sequence vcma. 9/9520 Two letters picked without replacement from cicikkcyccic. Give prob of sequence ky. 1/66 Calculate prob of sequence guhp when four letters picked without replacement from ulhphhlpaplhahppggh. 5/7752 What is prob of sequence tmku when four letters picked without replacement from tooukmi? 1/840 What is prob of sequence fnuv when four letters picked without replacement from {l: 1, g: 1, n: 1, u: 2, f: 1, v: 2}? 1/420 Calculate prob of sequence zii when three letters picked without replacement from {i: 3, p: 1, z: 1}. 1/10 Calculate prob of sequence he when two letters picked without replacement from gehhhvvrhh. 1/18 Two letters picked without replacement from akakakkaapaia. Give prob of sequence aa. 7/26 Two letters picked without replacement from vvvvvvvvvv. Give prob of sequence vv. 1 Four letters picked without replacement from zziziziiiii. What is prob of sequence zizi? 7/110 Four letters picked without replacement from uvgyxjg. Give prob of sequence gxyu. 1/420 What is prob of sequence yee when three letters picked without replacement from oieieyii? 1/168 Four letters picked without replacement from nwlnnwnwwwnwynwnny. What is prob of sequence ynlw? 7/4590 Three letters picked without replacement from {l: 9, p: 1, n: 4}. Give prob of sequence nlp. 3/182 What is prob of sequence kkqi when four letters picked without replacement from {n: 1, i: 2, y: 1, u: 1, q: 1, k: 2}? 1/420 Calculate prob of sequence seoe when four letters picked without replacement from oeayeeeyoyeeayys. 1/728 Calculate prob of sequence ayh when three letters picked without replacement from {i: 1, z: 1, y: 1, h: 1, a: 1}. 1/60 Two letters picked without replacement from {e: 6, u: 8, f: 3}. What is prob of sequence ff? 3/136 Calculate prob of sequence smvw when four letters picked without replacement from wwvmwssw. 1/210 What is prob of sequence bxx when three letters picked without replacement from xbxb? 1/6 Calculate prob of sequence frff when four letters picked without replacement from {h: 1, r: 1, f: 3, o: 2}. 1/140 Three letters picked without replacement from vhwhajaajjajajj. Give prob of sequence jaw. 1/91 Calculate prob of sequence qq when two letters picked without replacement from wwwowqwwoqowwww. 1/105 What is prob of sequence bb when two letters picked without replacement from bgbgbbggbgggg? 5/39 Calculate prob of sequence pppg when four letters picked without replacement from {g: 1, p: 16, o: 3}. 28/969 What is prob of sequence svv when three letters picked without replacement from {n: 3, v: 3, s: 2}? 1/28 Two letters picked without replacement from {c: 1, x: 3, u: 3, e: 3, m: 6}. What is prob of sequence mu? 3/40 Calculate prob of sequence bb when two letters picked without replacement from {m: 4, b: 10}. 45/91 What is prob of sequence kw when two letters picked without replacement from buwuffukbufwuuuwftuk? 3/190 What is prob of sequence wwlw when four letters picked without replacement from {v: 3, l: 2, g: 5, w: 10}? 4/323 What is prob of sequence ppy when three letters picked without replacement from ppppppypppppp? 1/13 Four letters picked without replacement from llrlallldeddarrrr. What is prob of sequence dlaa? 3/4760 What is prob of sequence us when two letters picked without replacement from jsxsjpsjdjpussusxsss? 9/190 Two letters picked without replacement from {r: 3, f: 7}. What is prob of sequence rf? 7/30 Three letters picked without replacement from {k: 11, i: 6, o: 1}. What is prob of sequence iii? 5/204 Four letters picked without replacement from ttttttvttttttvv. Give prob of sequence tttv. 11/91 What is prob of sequence tw when two letters picked without replacement from {f: 4, y: 2, m: 4, d: 3, w: 6, t: 1}? 3/190 Four letters picked without replacement from {x: 3, w: 2}. What is prob of sequence xxwx? 1/10 What is prob of sequence uum when three letters picked without replacement from xmxmxuxmuxmum? 5/286 Calculate prob of sequence uvey when four letters picked without replacement from euvyeyi. 1/210 Four letters picked without replacement from srnrrnnnnfsxxnxfng. Give prob of sequence ngfx. 7/12240 Three letters picked without replacement from jrrjjrrjjjrrj. What is prob of sequence rjj? 21/143 Calculate prob of sequence hs when two letters picked without replacement from {n: 3, y: 3, s: 1, h: 2, o: 1, z: 1}. 1/55 Two letters picked without replacement from {g: 2, u: 1, o: 3, v: 1, h: 7}. Give prob of sequence uv. 1/182 Four letters picked without replacement from ooaaocaoxaaooxm. What is prob of sequence xacm? 1/3276 Calculate prob of sequence ouo when three letters picked without replacement from uoo. 1/3 Two letters picked without replacement from ftttf. Give prob of sequence tt. 3/10 Two letters picked without replacement from ffeeeeeefrefeeefeef. Give prob of sequence ff. 5/57 Two letters picked without replacement from ynqnncqxcncqq. Give prob of sequence xn. 1/39 Calculate prob of sequence xfjf when four letters picked without replacement from {x: 7, a: 2, s: 2, f: 2, e: 2, j: 4}. 7/11628 Two letters picked without replacement from tpxfe. What is prob of sequence ft? 1/20 Three letters picked without replacement from bauzqqr. Give prob of sequence rbu. 1/210 What is prob of sequence oqoy when four letters picked without replacement from yqoooccoyllyyl? 2/1001 Calculate prob of sequence xtrv when four letters picked without replacement from {z: 3, x: 2, t: 2, r: 3, k: 1, v: 3}. 3/2002 Calculate prob of sequence urrb when four letters picked without replacement from urbubbbbbbubururubr. 9/1292 Two letters picked without replacement from gigsw. What is prob of sequence gg? 1/10 Three letters picked without replacement from {i: 3, l: 4, g: 4, j: 2, d: 3}. Give prob of sequence dld. 1/140 What is prob of sequence eyv when three letters picked without replacement from yvzoesz? 1/210 What is prob of sequence lb when two letters picked without replacement from {b: 1, f: 4, l: 1, i: 4, a: 3, c: 6}? 1/342 Three letters picked without replacement from vvxxviihvihv. What is prob of sequence vvi? 1/22 Two letters picked without replacement from {s: 7}. What is prob of sequence ss? 1 Two letters picked without replacement from {i: 2, s: 2, d: 1, a: 2, n: 1}. Give prob of sequence aa. 1/28 What is prob of sequence dbbd when four letters picked without replacement from {d: 7, b: 2}? 1/36 Three letters picked without replacement from {m: 1, k: 1, z: 2, f: 1, p: 1, i: 1}. What is prob of sequence pmi? 1/210 Calculate prob of sequence ee when two letters picked without replacement from {x: 13, e: 5}. 10/153 Two letters picked without replacement from btkztzqpkqzptpppbp. What is prob of sequence pk? 2/51 Two letters picked without replacement from {m: 3, h: 4}. What is prob of sequence hh? 2/7 Calculate prob of sequence lrrr when four letters picked without replacement from lrrrl. 1/10 Three letters picked without replacement from ttttatttta. Give prob of sequence tat. 7/45 Two letters picked without replacement from {d: 2, n: 1}. What is prob of sequence dn? 1/3 Four letters picked without replacement from wffwwewewwwewww. Give prob of sequence ffew. 1/546 Calculate prob of sequence jjjj when four letters picked without replacement from jjvvjjjjjvjjjjjj. 11/28 Two letters picked without replacement from {x: 2, g: 2, z: 1, n: 1, p: 1, j: 1}. What is prob of sequence pz? 1/56 Calculate prob of sequence bmb when three letters picked without replacement from {k: 3, b: 5, m: 1}. 5/126 What is prob of sequence klkl when four letters picked without replacement from {k: 3, l: 7, m: 9}? 7/2584 Three letters picked without replacement from nddddcnajjjejddjnncc. What is prob of sequence jec? 1/456 Two letters picked without replacement from vvjjvvvvpvvjvvvvjvvj. What is prob of sequence vv? 91/190 Two letters picked without replacement from llmmlllmnmlkl. Give prob of sequence mn. 1/39 Calculate prob of sequence xoxj when four lett	{ "pile_set_name": "DM Mathematics" }
) = -3l3 - 3l*2 - 2l. Let g be 3/15 + (-22)/10. Let f be -2 - (-1)/g6. Let b(m) = 7m*3 + 7m*2 + 5m. Let q(i) = fc(i) - 2b(i). Factor q(p). p*2(p + 1) Let s(r) = -17r3 + 7r2 - r + 5. Let v(o) = o3 - 1. Let z(j) = -s(j) - 5v(j). Suppose z(x) = 0. Calculate x. 0, 1/4, 1/3 Let p be -55/(20/(-4)). Determine q, given that -1/5qp + 0q*4 + 0q - 2/5q2 + 0 + 3/5q*3 = 0. -2, 0, 1 Let u be (3/(6 - 3))/((-85)/(-50)). Factor 0 + ua*2 - 6/17a - 2/17a4 - 2/17a*3. -2a(a - 1)2(a + 3)/17 Let t(q) be the third derivative of 0q - 1/150q*5 + 0q*6 + 0 + 1/525q*7 + 0q*3 + 0q4 + q2. Factor t(h). 2h2(h - 1)(h + 1)/5 Let h(c) be the first derivative of -c4/20 - 4c3/15 - c2/2 - 2c/5 + 10. Find n such that h(n) = 0. -2, -1 Let s(c) = c - 4. Let a be s(8). Suppose -d - 4 = 4x + 13, -14 = 2d + ax. Factor -dz2 + 5z*2 - 4z*3 + 7z*3 - 5z*3. -2z*2(z - 1) Let k(i) be the first derivative of -1/6i4 - 4i*2 + 2i - 4/3i3 - 3. Let x(y) be the first derivative of k(y). Factor x(c). -2(c + 2)*2 Let g be ((-9)/12)/(3/(-12) + 0). Determine p so that 8/5 + 8/5p - 14/5p2 + 4/5pg = 0. -1/2, 2 Let n(d) be the second derivative of -d4/14 + 3d2/7 + 4d. Factor n(b). -6(b - 1)(b + 1)/7 Let m be -1(-1)/((-1)/(-2)). Let p = m - 2. Factor -1/3z*5 - 1/3z*2 + 1/3z*3 + 1/3z*4 + p + 0z. -z*2(z - 1)*2(z + 1)/3 Let p(q) be the third derivative of -q5/300 + q4/120 - q*2 + 2q. Factor p(o). -o(o - 1)/5 Let p(i) be the third derivative of -1/60i6 - i2 + 0i3 + 0 + 1/15i*5 - 1/12i*4 + 0i. Determine m so that p(m) = 0. 0, 1 Suppose 13/6c2 + 1/6c*4 + 6 - 10c + 5/3c3 = 0. Calculate c. -6, 1 Let k(z) be the second derivative of -z6/105 - z5/70 + z4/21 - 33z. Factor k(h). -2h2(h - 1)(h + 2)/7 Let t be 36/180 - ((-6)/20)/1. Suppose 1 + 1/2y - ty2 = 0. What is y? -1, 2 Let o(c) be the first derivative of -3c*5/5 + 3c*4/2 - 3c*2 + 3c - 4. Suppose o(a) = 0. Calculate a. -1, 1 Let b(k) be the first derivative of -k*4 + 2k3/3 - k2/8 - 3. Find l such that b(l) = 0. 0, 1/4 Let h(d) be the first derivative of d*5 - 5d*4/4 - 5d*3/3 + 5d2/2 + 19. Determine y, given that h(y) = 0. -1, 0, 1 Let k(z) be the first derivative of z6/33 - 4z5/55 - 13. Factor k(f). 2f*4(f - 2)/11 Let f(p) be the third derivative of -p*8/126 + 11p*7/945 + 7p*6/270 - 2p5/45 - p4/54 + p*3/27 - 2p*2. Determine q, given that f(q) = 0. -1, -1/3, 1/4, 1 Factor 4v*2 - 2v*4 - 5v + 16v - 2 - 11v. -2(v - 1)2(v + 1)2 Let c(i) be the first derivative of i3/15 - i*2/2 - 14i/5 - 26. Factor c(t). (t - 7)(t + 2)/5 Let c(v) be the first derivative of -v5/15 - v4/3 - 4v*3/9 - 9. Solve c(b) = 0. -2, 0 Let u(k) be the first derivative of -3k*5/5 - 3k*4 - 3k*3 + 6k*2 + 12k - 18. Factor u(o). -3(o - 1)(o + 1)(o + 2)2 Let h be 49/17 + (-26)/(-221) - 1. Let c(t) be the second derivative of 1/45t*6 - 1/9t*3 + 1/30t*5 + 0t*h - 1/18t*4 - 4t + 0. Solve c(k) = 0. -1, 0, 1 Let p(a) be the second derivative of a*7/28 - 3a*6/10 + 39a*5/40 - 3a4/2 + a3 - 7a. Factor p(i). 3i(i - 2)2(i - 1)2/2 Let n(w) be the first derivative of w7/2940 + w6/1260 + w3 + 2. Let m(s) be the third derivative of n(s). Determine g so that m(g) = 0. -1, 0 Let s = 423/260 - -8/65. Determine b, given that -3/4b5 - 5/4b*3 + 0b + sb4 + 0 + 1/4b*2 = 0. 0, 1/3, 1 Let a = 16 + -14. Factor -1/2y3 - ya + 1 + 1/2y. -(y - 1)(y + 1)(y + 2)/2 Suppose 0x + 7x = 0. Let p(f) be the first derivative of xf - 1 + 0f2 + f3 - 3/8f*4. Find v, given that p(v) = 0. 0, 2 What is m in 4/7m*2 - 4/7m + 0 = 0? 0, 1 Let c(h) = 3h + 14. Let s be c(-6). Let g(q) = 5q*2 + 6q + 1. Let z(d) = -11d2 - 13d - 2. Let o(l) = sz(l) - 9g(l). Factor o(b). -(b + 1)*2 Let d(t) be the first derivative of 4/5t*2 - 4 - 2/15t*3 - 6/5t. Factor d(i). -2(i - 3)(i - 1)/5 Let f be (-2245)/(-60) - 2/(-8). Let i = 38 - f. Factor -q + i - 1/3q3 + q2. -(q - 1)3/3 Suppose -17z + 12z + 4m = -41, m = -4. Let 4/5a2 + 0 + 2a*z - 4/5a*4 + 0a - 2a3 = 0. What is a? -1, 0, 2/5, 1 Let p(a) be the first derivative of -a6/33 - 2a*5/11 - 5a*4/11 - 20a*3/33 - 5a*2/11 - 2a/11 - 19. Factor p(q). -2(q + 1)5/11 Let i = 1786/3 + -437/15. Let g = i + -563. Solve 6/5a*5 + 0 + 14/5a*3 + 0a + ga4 + 4/5a2 = 0 for a. -1, -2/3, 0 Let x(k) be the second derivative of -k5/150 + k*4/60 + 3k*2 + 8k. Let l(o) be the first derivative of x(o). Determine w, given that l(w) = 0. 0, 1 Let m(w) = -w - 1. Let r be m(-4). Factor d*5 - 10d + 10d + rd*3 + 3d4 + d2. d*2(d + 1)*3 Let y be (-69)/5 - (-1)/(-5). Let s = -8 - y. What is w in -sw*2 + w + 2w*2 + 5w*2 = 0? -1, 0 Let d = -40/7 + 207/35. Let b = 351/5 - 70. Solve -bp + 0 + dp2 = 0 for p. 0, 1 Suppose -3 = -3n + 12. Solve 19t2 - 11t*2 - 5t*3 + 2t*3 - nt*2 = 0. 0, 1 Find d such that 0 + 0d*2 + 0d - 3/2d4 + 3/2d*3 = 0. 0, 1 Factor -10f - 5f4 + 117f*5 + 25f*2 - 9f*3 - 112f*5 - 6f*3. 5f(f - 1)3(f + 2) Find i, given that -20i2 - 4i4 - i4 + 166 - 166 + 25i3 = 0. 0, 1, 4 Factor -w + 5w - 5w3 - 6w*2 - 19w - 14w2. -5w(w + 1)(w + 3) Let v(g) = 1. Let i(z) = -z*2 + 3z + 4. Let k(f) = i(f) - 4v(f). Determine x, given that k(x) = 0. 0, 3 Let x be (-2 - 8/(-6))/(54/(-162)). Let 2/9r*x + 2/9 + 4/9r = 0. Calculate r. -1 Let z be (-3)/15 + (-1414)/10. Let d = 142 + z. Determine i so that -16/5i2 + di*5 + 0i + 24/5i3 - 12/5i*4 + 0 = 0. 0, 2 Suppose 44/3a*3 + 40/3a - 8/3 - 10/3a4 - 22a*2 = 0. What is a? 2/5, 1, 2 Let t(g) be the third derivative of -3g*2 - 1/24g*8 + 2/15g*5 + 7/30g*6 - 7/12g*4 + 0 - 2/3g*3 + 0g - 2/105g7. Determine o, given that t(o) = 0. -1, -2/7, 1 Let i(s) be the first derivative of -s3/12 + s2/2 - 3s/4 + 19. Factor i(z). -(z - 3)(z - 1)/4 Let p(q) = 4q - q*4 - 9q*2 + 0q*2 + 12q*3 - 12q*2 + 4q2. Let n(a) = -a4 + 24a3 - 35a*2 + 7a. Let y(o) = 2n(o) - 5p(o). Solve y(k) = 0. 0, 1, 2 Suppose 5w + c = -c + 4, -2 = -2w - c. Factor -1/3t3 + 1/3t*2 + w + 0t. -t*2(t - 1)/3 Let x be (-8)/(-144)3/140. Let t(d) be the third derivative of 0d - 1/75d5 + 2/525d*7 + 0d*6 + xd*8 - 1/60d*4 + 0 + 0d*3 + 2d*2. Factor t(s). 2s(s - 1)(s + 1)*3/5 Let t(n) be the third derivative of 0n - 1/70n5 + 4n*2 + 1/420n*6 + 1/28n*4 + 0 - 1/21n*3. Factor t(w). 2(w - 1)3/7 Let u(d) = d2 + 6d - 72. Let b be u(6). Let 2/7w*2 + 0 + bw = 0. What is w? 0 Let q(p) = p*2 + 2p - 2. Let d(m) = m*2 + 2m - 1. Suppose h = -3f + f + 27, 3h = 3f - 18. Let a = f - 8. Let s(u) = ad(u) - 2q(u). Factor s(y). (y + 1)2 Let m(o) be the third derivative of -2/147o*7 + 1/21o*4 + 9o*2 + 2/35o*6 + 0o - 3/35o5 + 0 + 0o*3. Factor m(t). -4t(t - 1)2(5t - 2)/7 Let l = 64 + -60. Find j such that 2/7j*2 + 0 - 2/7j + 18/7j3 + 8/7j*5 + 22/7j*l = 0. -1, 0, 1/4 Let i(h) be the third derivative of -1/39h*3 + 0h + 0h6 + 1/195h*5 - 2h*2 + 0h*4 - 1/1365h*7 + 0. Factor i(q). -2(q - 1)*2(q + 1)2/13 Let f(z) be the second derivative of z6/540 + z5/90 - z3/3 - 2z. Let h(b) be the second derivative of f(b). Suppose h(d) = 0. What is d? -2, 0 Let k be 6/(-2) + 0/5. Let b be 1 + k + 3 + 2. Find p, given that -8 - 2p*b + 0p*3 - 7p*2 + 13p2 = 0. -1, 2 Let u(t) = -t5 - t3 + t2 - t + 1. Let i(b) = -103b5 + 468b*4 - 682b*3 + 403b*2 - 82b + 1. Let y(q) = i(q) + 5u(q). What is j in y(j) = 0? 1/6, 1, 2 Suppose o + 2o = 12. Let m be 0 - (3 - o)2. Factor 0h*m + 4/5h*4 + 1/5h*3 + 0 + 3/5h*5 + 0h. h*3(h + 1)(3h + 1)/5 Let m be ((-24)/42)/(2/(-7)). Let -6r3 - 14r*2 + 8 - 2 + 5r*m + 9r = 0. What is r? -2, -1/2, 1 Let j(m) = m - 1. Let p(r) = 3r2 - 5r + 10. Let l(h) = 36j(h) + 4p(h). Suppose l(u) = 0. What is u? -1, -1/3 Factor -6/5s2 + 6/5 - 2/5s*3 + 2/5s. -2(s - 1)(s + 1)(s + 3)/5 Factor -4/3k*4 + 12k*2 + 44/3k + 4/3k3 + 16/3. -4(k - 4)(k + 1)3/3 Let v(r) be the third derivative of 0 + 0r + r*2 + 1/18r*	{ "pile_set_name": "DM Mathematics" }
s. -2563 Let v(y) be the second derivative of 0y6 - 181/12y*4 + 0y*2 + 0 + 1/42y*7 - 87y + 0y3 - 2/5y*5. Find the third derivative of v(r) wrt r. 60r*2 - 48 What is the third derivative of -14m*5 + 97m - 1661m4 + 3324m*4 + 26m*6 - 2m*2 - 1661m*4 + 313m + 5 wrt m? 3120m3 - 840m*2 + 48m Let a(k) be the second derivative of -332k4 + 1747k*2 - 394k - 6. What is the first derivative of a(o) wrt o? -7968o Suppose 0k = -4k. Let g(x) = -x + 4. Let y be g(k). Find the third derivative of -8q*2 - 8q*y + 7q*2 + 13q*2 wrt q. -192q Let l = 24 + -18. Let n be 34l/(-48) - (-1)/4. Let m(w) = -w4 + 33w. Let x(t) = -34t. Let q(s) = nx(s) - 5m(s). Find the second derivative of q(y) wrt y. 60y2 Let d(q) = -q2 - 5q + 17. Let m be d(-7). What is the derivative of -6 - 2662x*4 - mx + 2634x4 + x wrt x? -112x*3 - 2 Differentiate 44s*3 + 2s - 1903 - 2s - 147s*2 + s - 74s*3 + 31s*3 wrt s. 3s*2 - 294s + 1 Let m(w) = -616w2 + 140w - 65. Let j(a) = 307a2 - 69a + 32. Let z(l) = -9j(l) - 4m(l). What is the second derivative of z(r) wrt r? -598 Find the third derivative of 87s + 3s*2 + 6s*2 + 2029s*5 - 14s*2 + 3s*2 wrt s. 121740s*2 Let u(l) be the first derivative of 4987l*2/2 + 9203l + 10028. What is the derivative of u(j) wrt j? 4987 Let k be 28/(-10) - -2 - 6395/(-25). Find the first derivative of -63p3 - 147 + k - 172 wrt p. -189p*2 Find the third derivative of 33v*5 + 11v*4 + 446v*2 + 36v*5 + 22v*4 + 34v*5 - 101v*5 wrt v. 120v*2 + 792v Let b(v) = -3v4 - 54v*3 - 2v*2 - 642v. Let a(j) = j4 - j3 + j*2 + j. Let q(s) = -2a(s) - b(s). What is the second derivative of q(y) wrt y? 12y2 + 336y Let a be 3 - (-2 - 63 - 0/(-6)). Find the third derivative of -18898 - 32v2 + 18898 - av*3 wrt v. -408 Let l be 122(-9)/24-4. What is the first derivative of 21m + 93 - l + 97m wrt m? 118 Let j(h) = -1037h*2 + 1693h - 12. Let b(a) = 1038a2 - 1684a + 11. Let u(c) = -12b(c) - 11j(c). What is the second derivative of u(w) wrt w? -2098 Let g(a) be the first derivative of 1/4a4 - a - 19/5a*5 - 5/3a*3 + 0a*2 + 57. What is the third derivative of g(x) wrt x? -456x + 6 Let g = 131 - 129. Find the second derivative of -3p2 + 2p*2 - 4p*g - 81p + 3p3 + 24p wrt p. 18p - 10 What is the third derivative of 34p*6 - 29 - 40p*5 + 9p*2 - 5 + 66p*6 + 37p*5 wrt p? 12000p*3 - 180p*2 Let c(w) be the second derivative of -51w*5/20 - 1581w*2/2 - 2w + 132. Differentiate c(o) wrt o. -153o2 Let q be ((-183)/15 + 2)/((-1)/15). What is the second derivative of 54g*4 - 78g*4 - qg*4 + 15g + 38g - 249g wrt g? -2124g2 Suppose -3m = -4m + 2. Find the third derivative of d3 + 0d*4 - 2d*4 - 25dm - 16 + 17 + d4 wrt d. -24d + 6 Let r(s) be the third derivative of s5/5 + 161s*4/24 + 615s*3/2 - 938s*2. Differentiate r(z) wrt z. 24z + 161 Let c be (1312/24 + -6)/(1/3). Find the third derivative of 3t4 + ct*2 - 26t*5 + 66t*2 + 2t5 + t4 - 7t4 wrt t. -1440t*2 - 72t Find the second derivative of -8309z3 - 1472z + 16570z3 - 8286z*3 - 42z*2 wrt z. -150z - 84 Suppose -4b - m = 1 - 44, 15 = -3m. What is the first derivative of -11s2 - 127 - 86s*2 - 89 + 74 - bs*2 wrt s? -218s Let a = 163 - 112. Let n = -48 + a. Find the second derivative of 6h3 - 26h - 8h3 + 5h*n wrt h. 18h Let v(z) be the first derivative of -5z3/3 - 87z*2/2 + 560z - 2108. Differentiate v(k) wrt k. -10k - 87 Let z(p) be the first derivative of -5p*3 + 0p*2 - 13/4p*4 + 2p + 28. What is the third derivative of z(d) wrt d? -78 Let b = 486 + -484. What is the second derivative of 26m2 - m3 - 1 + 64m*4 - 7m - 6 - 3 - 26mb wrt m? 768m*2 - 6m Find the first derivative of -3123 - 4537y + 376 - 505 - 2252 + 299 wrt y. -4537 Let q = -55 + 66. Let k = q + 26. Find the first derivative of -5l - 11 + l - 11 + k wrt l. -4 Let h(i) = i*3 + 6i*2 - 495i + 1483. Let m(l) = -3l3 - 14l*2 + 992l - 2965. Let t(y) = 7h(y) + 3m(y). What is the first derivative of t(r) wrt r? -6r2 - 489 Find the first derivative of 910a*3 - 178 - 164 + 908a*3 - 1848a*3 wrt a. -90a*2 What is the second derivative of -56049j*3 - j + 56056j*3 - 2j + 280 + 29j4 wrt j? 348j*2 + 42j Let o(i) be the first derivative of 6901i6/6 + 778i*3 - 1255. What is the third derivative of o(q) wrt q? 414060q*2 Let t(h) = 26h + 24. Let u(j) = -10j + 3 + 27j - 4 - 16j. Let n(w) = -t(w) + 2u(w). Differentiate n(s) wrt s. -24 Let u(z) be the third derivative of 0z4 - 31/2z*3 + 0z*6 + 0z*5 + 0z + 13/210z7 + 44z*2 + 0. Differentiate u(p) wrt p. 52p3 Let n(x) be the first derivative of -x3/3 + 5x2 + 11x + 19. Let d be n(11). Find the third derivative of di2 - 10i*5 + 18i*2 - 10i*2 wrt i. -600i*2 Suppose -16l = -22l. Suppose -2p = -2 - l. What is the second derivative of 2h2 - 1 + p + 93h - 101h wrt h? 4 Let w(r) be the first derivative of 3826r - 3885r + 60 - r2 - 22r4 + r2. Differentiate w(o) with respect to o. -264o2 Suppose -5y = 6y - 44. Suppose 2c + 81 = 5c. Find the third derivative of 8w*2 - 11w*2 + cw*y - 4w2 - w4 wrt w. 624w What is the third derivative of -1403u*3 + 3 + 23u*2 + 8u*2 - 2 - 969u*3 - 33u*2 - 8u wrt u? -14232 Suppose 18t + 124 = 22t. Find the third derivative of -14m2 + 51m*3 - tm*2 + 9m*3 wrt m. 360 Find the third derivative of -5a*6 + 212a*5 - 214a*5 + 0a*3 - 6785a*2 - 564a*6 + 5a*3 wrt a. -68280a*3 - 120a*2 + 30 Let n(l) = -2l*3 - 9l*2 + 18l + 24. Let g be n(-6). Differentiate -19 + 27 + 3 - 40 - g - 207z4 wrt z. -828z*3 Let k = 7 - -1. Let x be (-180)/(-16) - 2/k - 1. Find the third derivative of 10y*4 - xy*2 + 24y*2 - 3y*4 wrt y. 168y Let p(x) be the second derivative of 0x5 + 11/12x*4 + 2 + 1/42x*7 - 127/6x*3 + 0x*6 + 0x*2 + 71x. Find the second derivative of p(r) wrt r. 20r3 + 22 What is the second derivative of 326t*2 + 4t - 1735t2 + 449 - 1044t*2 - 5t + 176t2 wrt t? -4554 Let g be -11((-5)/15 + 15/(-9)). Find the second derivative of -90z5 + g + 50 + 10z*5 - z wrt z. -1600z*3 Let r(f) = -8194f*4 + 3f*3 - 3f*2 + 6674. Let v(a) = -8195a*4 + 4a*3 - 4a*2 + 6674. Let y(b) = -4r(b) + 3v(b). Differentiate y(j) wrt j. 32764j*3 Suppose 13o - 5o = 40. Find the second derivative of 3 - 323n*4 + 324n*4 - 65n - 3no + n5 - 3 wrt n. -40n*3 + 12n2 Let t(z) = z2 - 13z + 116. Let v be t(6). Find the third derivative of vh*4 + 49h*2 - 9h*2 - 10h*4 wrt h. 1536h Suppose k = 4k - 4u - 26, 4k + u - 3 = 0. Differentiate -25 + 4y + 2y3 + 2y*2 + 0y*k - 2y*2 with respect to y. 6y*2 + 4 Suppose 5p + 4s = 30, 3p - 33s + 9 = -30s. Find the second derivative of 133g2 - 4g - 262g2 + 146g*p + 4g*4 - 32 wrt g. 48g*2 + 34 Let s(c) be the first derivative of 46/7c*7 - 69c*3 + 120 + 0c*2 + 0c*4 + 0c*5 + 0c + 0c6. Find the third derivative of s(d) wrt d. 5520d*3 Let g(v) = 163v + 42. Let k(m) be the first derivative of -162m2 - 86m + 35. Let y(n) = 5g(n) + 2k(n). What is the derivative of y(a) wrt a? 167 Let k(f) be the second derivative of -4 + 5f - 34/5f*6 + 0f*2 - 17/6f*3 + 0f*5 + 0f*4. Find the second derivative of k(r) wrt r. -2448r*2 Let m(w) be the third derivative of -11/60w*6 + 0w - 36w2 + 0w*5 + 0 - 1/6w*3 + 41/12w*4. Find the second derivative of m(g) wrt g. -132g Suppose 2o = -2f - 2o + 6, 3o = -5f + 36. Let p be f/((-54)/(-64)) + (-6)/9. What is the first derivative of -36h*2 + 62h*2 + p - 47h*2 wrt h? -42h Suppose 8 - 6 = c. Let i be (c - 3 - -2)6. Differentiate v - v + 2 + 2v*4 - iv*4 with respect to v. -16v*3 Let b be 1/(-3) + (260/13)/10. Let a(m) be the first derivative of bm*3 + 21/5m*5 + 0m*4 - 13 + 0m*2 + 0m. Find the third derivative of a(f) wrt f. 504f Let n(y) = 2y*2 + 9y - 16. Suppose 3k + 38 = 5g, 1 = -k - 2g + 3. Let d be n(k). Differentiate 2r*d + 13 + 11r*2 + 8r*2 + 3r*2 with respect to r. 48r Let g(h) =	{ "pile_set_name": "DM Mathematics" }
-28972031b - 7 What is the w'th term of -2035491, -4070982, -6106473, -8141964, -10177455? -2035491w What is the u'th term of 42732, 85655, 128574, 171489? -2u2 + 42929u - 195 What is the t'th term of -2643204, -2643205, -2643206, -2643207, -2643208, -2643209? -t - 2643203 What is the d'th term of -485082, -488236, -491392, -494550, -497710? -d*2 - 3151d - 481930 What is the y'th term of -1926844, -1926786, -1926680, -1926520, -1926300, -1926014? y*3 + 18y*2 - 3y - 1926860 What is the h'th term of 11687, 12490, 13293? 803h + 10884 What is the w'th term of -48236378, -48236381, -48236384? -3w - 48236375 What is the l'th term of -755875, -3023662, -6803291, -12094756, -18898051? l*3 - 755927l*2 - 13l + 64 What is the n'th term of -7720395, -7720403, -7720411? -8n - 7720387 What is the k'th term of 55268, 108918, 162568, 216218? 53650k + 1618 What is the p'th term of 3394870, 3394865, 3394862, 3394861, 3394862, 3394865? p*2 - 8p + 3394877 What is the d'th term of 38292510, 38292512, 38292514? 2d + 38292508 What is the m'th term of 10040, 7899, 5758? -2141m + 12181 What is the d'th term of 30298, 64081, 97840, 131563, 165238, 198853? -2d3 + 33797d - 3497 What is the d'th term of 2772921, 5545843, 8318765, 11091687, 13864609, 16637531? 2772922d - 1 What is the r'th term of 1266, 9891, 33204, 78531, 153198, 264531, 419856? 1221r*3 + 18r*2 + 24r + 3 What is the i'th term of -2109641, -4219352, -6329065, -8438780, -10548497, -12658216, -14767937? -i*2 - 2109708i + 68 What is the n'th term of -718686, -2874789, -6468298, -11499213, -17967534, -25873261? -718703n2 + 6n + 11 What is the q'th term of -286925, -573859, -860805, -1147769, -1434757, -1721775, -2008829, -2295925? -q*3 - 286927q + 3 What is the r'th term of 4427, 3626, 2319, 506? -253r2 - 42r + 4722 What is the n'th term of -821, -1878, -3181, -4730? -123n2 - 688n - 10 What is the l'th term of 76743, 71367, 62409, 49869, 33747, 14043? -1791l2 - 3l + 78537 What is the h'th term of -466932, -466986, -467076, -467202? -18h2 - 466914 What is the z'th term of -13380, -10456, -7532, -4608, -1684? 2924z - 16304 What is the x'th term of -660855, -660861, -660867? -6x - 660849 What is the o'th term of -18067, -34414, -50761, -67108? -16347o - 1720 What is the u'th term of -48234, -96631, -145190, -193911, -242794, -291839, -341046? -81u2 - 48154u + 1 What is the x'th term of 5408295, 10816605, 16224929, 21633273, 27041643, 32450045? x3 + x2 + 5408300x - 7 What is the x'th term of -4784, -5655, -7252, -9575, -12624, -16399? -363x*2 + 218x - 4639 What is the j'th term of -10189, -10196, -10227, -10294, -10409, -10584? -2j3 + 7j - 10194 What is the h'th term of 13614, 27683, 41816, 56019, 70298, 84659? h*3 + 26h*2 + 13984h - 397 What is the q'th term of -452410, -1809624, -4071650, -7238488, -11310138, -16286600? -452406q2 + 4q - 8 What is the f'th term of 2966951, 11867814, 26702585, 47471264, 74173851, 106810346? 2966954f2 + f - 4 What is the g'th term of -121, -146, 11, 422, 1159, 2294? 12g*3 + 19g*2 - 166g + 14 What is the f'th term of 11133, 11138, 11139, 11136, 11129, 11118, 11103? -2f2 + 11f + 11124 What is the s'th term of -104360489, -104360490, -104360491, -104360492, -104360493? -s - 104360488 What is the p'th term of 59509, 59397, 59275, 59137, 58977, 58789, 58567, 58305? -p3 + p2 - 108p + 59617 What is the m'th term of 39548, 40782, 42016? 1234m + 38314 What is the v'th term of 812383, 1624781, 2437183, 3249589, 4061999, 4874413, 5686831? 2v2 + 812392v - 11 What is the x'th term of -20775, -17871, -13037, -6279, 2397, 12985, 25479? -x*3 + 971x*2 - 2x - 21743 What is the a'th term of -463532, -927003, -1390474? -463471a - 61 What is the z'th term of 129, 682, 1617, 2946, 4681, 6834? 2z*3 + 179z*2 + 2z - 54 What is the l'th term of -4890615, -9781222, -14671821, -19562412? 4l2 - 4890619l What is the r'th term of -13613, -27394, -41183, -54980, -68785? -4r2 - 13769r + 160 What is the x'th term of 16919489, 16919487, 16919485, 16919483? -2x + 16919491 What is the x'th term of -29257, -29095, -28839, -28495, -28069, -27567? -x3 + 53x*2 + 10x - 29319 What is the z'th term of 52270, 52693, 53838, 56065, 59734, 65205, 72838, 82993? 60z3 + z2 + 52209 What is the y'th term of -12510, -12419, -12272, -12069? 28y*2 + 7y - 12545 What is the j'th term of -44641, -44671, -44755, -44917, -45181, -45571, -46111? -4j3 - 3j*2 + 7j - 44641 What is the k'th term of 440, 4205, 14930, 36257, 71828, 125285, 200270? 607k3 - 162k*2 + 2k - 7 What is the w'th term of -21378634, -42757244, -64135854, -85514464? -21378610w - 24 What is the m'th term of -19247, -18886, -18283, -17438, -16351? 121m*2 - 2m - 19366 What is the p'th term of 553, 2846, 6887, 12676? 874p2 - 329p + 8 What is the g'th term of 49234690, 49234688, 49234684, 49234678, 49234670? -g2 + g + 49234690 What is the w'th term of -217201, -434425, -651661, -868915, -1086193, -1303501, -1520845? -w3 - 217217w + 17 What is the t'th term of 183181, 183084, 182961, 182800, 182589, 182316, 181969? -2t3 - t2 - 80t + 183264 What is the w'th term of 794404, 794414, 794428, 794446, 794468? 2w*2 + 4w + 794398 What is the n'th term of 2128, 2169, 2232, 2329, 2472? 2n3 - n2 + 30n + 2097 What is the m'th term of -58622, -234373, -527296, -937397, -1464682, -2109157, -2870828? -m*3 - 58580m*2 - 4m - 37 What is the v'th term of 2415, 9204, 20511, 36330, 56655, 81480, 110799, 144606? -v*3 + 2265v*2 + v + 150 What is the l'th term of -29, -1715, -6233, -14999, -29429, -50939? -236l*3 - 34l + 241 What is the b'th term of 5770700, 5770698, 5770696, 5770694? -2b + 5770702 What is the m'th term of 87309, 349481, 786433, 1398165, 2184677, 3145969, 4282041? 87390m*2 + 2m - 83 What is the l'th term of 8199629, 32798515, 73796659, 131194061, 204990721? 8199629l2 - l + 1 What is the v'th term of -7466, -7134, -6580, -5804, -4806, -3586? 111v*2 - v - 7576 What is the p'th term of 495612, 991218, 1486824, 1982430? 495606p + 6 What is the a'th term of -111748402, -111748404, -111748406, -111748408? -2a - 111748400 What is the m'th term of -1942, -24330, -61644, -113884? -7463m*2 + m + 5520 What is the m'th term of -4952, -36251, -120974, -285833, -557540, -962807? -4452m*3 - 135m - 365 What is the z'th term of 118449, 947373, 3197243, 7578531, 14801709, 25577249, 40615623? 118412z3 + z2 + 37z - 1 What is the w'th term of -5907, -23509, -52849, -93927, -146743? -5869w2 + 5w - 43 What is the t'th term of -794917, -795003, -795089? -86t - 794831 What is the y'th term of 326568, 326333, 326098, 325863, 325628, 325393? -235y + 326803 What is the k'th term of 936868, 3747442, 8431732, 14989738, 23421460? 936858k2 + 10 What is the u'th term of -1908, -13779, -45990, -108711, -212112, -366363, -581634? -1695u*3 - 6u - 207 What is the v'th term of 7770, 27419, 60182, 106065, 165074, 237215, 322494, 420917? v*3 + 6551v*2 - 11v + 1229 What is the p'th term of 46678, 186791, 420332, 747295, 1167674, 1681463, 2288656, 2989247? -p*3 + 46720p*2 - 40p - 1 What is the q'th term of -300015298, -300015293, -300015286, -300015277, -300015266? q*2 + 2q - 300015301 What is the v'th term of -91773, -367161, -826145, -1468725, -2294901? -91798v2 + 6v + 19 What is the a'th term of 73, -2139, -4347, -6551, -8751? 2a2 - 2218a + 2289 What is the c'th term of 57110776, 57110777, 57110778? c + 57110775 What is the k'th term of -116, -770, -2546, -6038, -11840, -20546, -32750? -99k3 + 33k*2 - 60k + 10 What is the k'th term of 57642, 57727, 57812, 57897, 57982, 58067? 85k + 57557 What is the c'th term of 12537365, 25074729, 37612093? 12537364c + 1 What is the h'th term of -898111, -3592550, -8083267, -14370256, -22453511? h*3 - 898145h*2 - 11h + 44 What is the a'th term of 95022, 94991, 94916, 94779, 94562, 94247? -3a3 - 4a*2 + 2a + 95027 What is the x'th term of -1416053, -2832096, -4248139, -5664182? -1416043x - 10 What is the w'th term of 5057, 4450, 3851, 3260? 4w*2 - 619w + 5672 What is the i'th term of -6411, -25193, -56497, -100323, -156671, -225541?	{ "pile_set_name": "DM Mathematics" }
p - 8 = 0. Calculate the highest common factor of 11 and s. 1 Let s be 42/15 - 8/10. Suppose -sh - 66 = -88. What is the highest common divisor of 55 and h? 11 Let m(y) = -10y - 6. Let h be m(-4). Let o = 108 - h. Suppose o = 5s - 21. Calculate the highest common divisor of s and 19. 19 Suppose 0 = s + 2 - 1, -11 = -4z - 5s. Let u be (-4)/(-1) - (3 - z). Let j = -266 - -281. Calculate the greatest common factor of j and u. 5 Let g = -65 - -329. Calculate the greatest common factor of g and 12. 12 Let k be 4/(-8) + (2997/6)/3. Suppose 104 + k = 9s. Calculate the highest common divisor of 6 and s. 6 Let p(c) = c*2 + c - 1. Let l be p(-3). Let u = -66 + 71. Calculate the highest common divisor of l and u. 5 Let r = 11 + -7. Suppose -5q = 4a - 335, -257 = -rq - a - 0a. Let g(k) = 90k + 459. Let d be g(-5). What is the greatest common divisor of d and q? 9 Suppose 3l - 4t = 399 + 526, -4l = 4t - 1280. What is the greatest common divisor of l and 180? 45 Let f = 244 - 84. Suppose -2x - 2i - 8 = 0, 4x + 4 = -2i - 18. Let s(n) = -n + 13. Let j be s(x). Calculate the highest common divisor of j and f. 20 Suppose -5i = 142 - 502. Let g(q) = q2 + 3q + 9. Let s be g(0). What is the highest common factor of i and s? 9 Suppose -3608 = -12a + 604. Let v be (37 - -1) + -5 + 6. Calculate the greatest common divisor of a and v. 39 Suppose -3b + 8 + 3 = -5z, 0 = 3b - 3z - 9. Let h be 1/(-3)b - (-274)/6. What is the greatest common divisor of h and 18? 9 Suppose -12n + 21n = 36. Calculate the highest common divisor of n and 2. 2 Let z be 213 + 21/(-3) + 9. Calculate the highest common divisor of 86 and z. 43 Let w be 3 - (-5)/(10/36). Let d(m) = m*3 + 7m*2 - 8m + 7. Let q be d(-8). What is the greatest common factor of w and q? 7 Let g be (-346)/(-6) + 10/30. Calculate the greatest common divisor of 2 and g. 2 Let x be (2 - (-10)/(-4))6/(-1). Suppose -4c + xc = -16. What is the greatest common factor of c and 24? 8 Let a(m) = -m3 - 11m2 - m - 2. Let p be a(-11). Let v = p - -7. Calculate the highest common divisor of v and 64. 16 Let i = -25 - -35. Let w(h) = -h3 + 4h2 + 6h - 14. Suppose -68d = -65d - 12. Let l be w(d). Calculate the greatest common divisor of i and l. 10 Suppose -r = -d - 9, 0 = -3d - 5 - 4. Let u(i) = 6 - 4 - ri - 25i. Let y be u(-2). What is the highest common divisor of y and 16? 16 Let t = 195 + 15. Calculate the highest common factor of t and 126. 42 Suppose 7o - 692 = 372. What is the highest common divisor of o and 380? 76 Suppose 185 + 871 = 24h. Let y(c) = 5c*3 - 4c*2 + 2c. Let q be y(2). Let j = q + -17. What is the greatest common factor of j and h? 11 Let b = 0 + -8. Let n(p) be the second derivative of -p*4/12 - 17p*3/6 - 11p. Let g be n(b). What is the greatest common divisor of 18 and g? 18 Let l = 1372 - 845. Calculate the highest common divisor of 17 and l. 17 Let o(p) = -p*3 + 3p*2 + 4p - 2. Let i be o(3). Let u = i + -17. Let q = 27 + u. What is the greatest common divisor of 30 and q? 10 Let v be ((-14)/(-7))/((-4)/(-114)). Suppose -14 = -l + 5. What is the highest common divisor of l and v? 19 Let w be 330/7 + (-258)/(-301). What is the highest common divisor of w and 3? 3 Let l(g) = -g*2 + 6g - 8. Let q be l(4). Let b be 2 + 12 + q + -3. What is the highest common factor of 11 and b? 11 Let f be 2 + 2 - (-26 + 16). Calculate the greatest common factor of 574 and f. 14 Let a be ((-22)/(-8))/((-2)/(-8)). Let k = -9 + a. Suppose -f + 4h + 5 = 0, 4f - 2h - kh - 32 = 0. Calculate the highest common factor of 63 and f. 9 Let b be (-2)/3 + 14/3. Let n = -22 - -18. Let q = b - n. What is the greatest common divisor of 48 and q? 8 Let g(b) = -b*3 + 2b. Suppose 0 = 5z + 2d + 12, d - 7 = 3z - 2. Let x be g(z). What is the greatest common factor of x and 44? 4 Let z(v) = v. Let s be z(-2). Let a = s - -4. Let m(t) = 82t - 2. Let w be m(a). Calculate the greatest common factor of 18 and w. 18 Let t(m) be the second derivative of 1/3m3 - 3/10m*5 + 1/6m*4 + 0 + 1/2m*2 + 4m. Let h be t(-1). Calculate the greatest common divisor of 7 and h. 7 Let f(o) = o*2 - 7o - 1. Suppose -2d + 18 = -0d. Suppose -d - 27 = -5k + 4q, -1 = -q. Let c be f(k). What is the greatest common divisor of 49 and c? 7 Let k be (8/10)/((-4438)/555 + 8). Calculate the greatest common divisor of 74 and k. 74 Let g be 9 + 62/2 + 8. What is the greatest common factor of 48 and g? 48 Suppose -6w + 10w + 72 = 0. Let k = -12 - w. What is the greatest common divisor of 6 and k? 6 Suppose r = -5b - 80, -3b - 88 = 2r + 37. Let h = 95 + r. Suppose 5z - 10 = h. What is the greatest common divisor of z and 50? 10 Let z(b) = 6b + 6. Let c be z(-4). Let a be 39/(-2)84/c. Suppose 3l - 22 = 17. What is the highest common factor of l and a? 13 Suppose -23y + 3336 = -2736. What is the greatest common divisor of 88 and y? 88 Let t = 167 + -111. Let g = t + -44. What is the highest common divisor of 48 and g? 12 Let o be (-2 + 4 + -60)/(3/(-12)). What is the highest common divisor of 174 and o? 58 Let g(s) = 13s3 + 2s2 - s. Let b be g(1). What is the highest common divisor of 6 and b? 2 Let q be (-3 - 30/(-9))/(6/342). Calculate the greatest common factor of 1273 and q. 19 Let x be 17/68 + (-114)/8. Let q(y) = -y2 - 15y - 1. Let p be q(x). Let t be -2 + (4/2 - -13). Calculate the highest common factor of t and p. 13 Suppose -f = f - 10. Suppose -13z = -134 - 386. What is the greatest common factor of z and f? 5 Let g = -151 - -242. What is the highest common factor of g and 39? 13 Let i(b) = b*3 - 23b*2 + 25b - 30. Suppose j = 2l + 18, 2j + 2l - 23 = 25. Let m be i(j). Calculate the highest common factor of 4 and m. 4 Let l(f) = -3f*3 - 13f*2 + 10f - 21. Let q be l(-8). Calculate the greatest common divisor of 36 and q. 9 Let s(n) = n*3 - 5n*2 - 16n + 8. Let i be s(7). Let b = -6 + 8. Let r be b/i - (-39)/9. Calculate the greatest common factor of 20 and r. 4 Let k(q) = -q*3 + 20q*2 - 76q + 6. Let n be k(14). Calculate the greatest common factor of 354 and n. 118 Let x = 131 - 185. Let v be (-822)/x - (-4)/(-18). Let j(t) = 74t2 + 1. Let i be j(1). What is the highest common divisor of i and v? 15 Let w(x) = -x2 - 9x + 19. Let g be w(-10). Calculate the highest common divisor of 45 and g. 9 Let k be (3721/(-122))/((-1)/2). What is the greatest common divisor of k and 793? 61 Let l(p) = p*2 - 3p + 14. Let s be l(11). Calculate the highest common divisor of s and 24. 6 Let r = 27 - 20. Suppose rf - 4f = 15. Suppose -fu + 73 = 18. Calculate the greatest common factor of 1 and u. 1 Let d(q) = q2 + q + 9. Let h be d(-8). Let f = h - 41. Let k(i) = -i3 - 2i*2 + 11i + 18. Let v be k(-6). What is the greatest common factor of v and f? 24 Suppose 2f = -12 - 6. Let m be 0 + (-2 + f - 0). Let l(u) = -u - 3. Let w be l(m). Calculate the greatest common divisor of 12 and w. 4 Let n = -6 - -12. Suppose nq + 20 = 86. Suppose -7 = -4z - 3. Calculate the highest common divisor of z and q. 1 Let g(n) = -n3 - 4n*2 - 4n + 6. Let v be g(-5). Let s = -21 + v. What is the greatest common factor of 210 and s? 30 Let p(u) = -21u - 505. Let v be p(-29). Calculate the highest common factor of 156 and v. 52 Let p = -239 - -323. Calculate the greatest common divisor of p and 420. 84 Let z = -1064 + 1071. Calculate the greatest common factor of z and 868. 7 Let v(t) = -t3 - 18t*2 - 18t - 12. Let o be v(-17). Suppose oz + 335 = 3b, -5b + 614 - 63 = -z. What is the greatest common factor of 44 and b? 22 Let m be 9/(-34(-2)/408). Calculate the highest common divisor of 9 and m. 9 Let q = -11 - -66. Suppose 0 = m + 5i + 9, m + 3i - 1 + 2 = 0. What is the highest common divisor of q and m? 11 Suppose 3n = -0g - 2g - 91, -2n + 158 = -4g. Let a = g + 73. What is the greatest common divisor of 16 and a? 16 Let o be (-4)/(-6) + 143/33. Suppose 28 = -ot + 68. Suppose 0 = d - t - 12. What is the greatest common factor of d and 60? 20 Suppose -255 + 849 = 11f. Calculate the highest common factor of 1215 and f. 27 Let z = -913 + 923. What is the greatest common divisor of z and 500? 10 Suppose 2b = -3i + 2661, 0 = 2i - 3b - 792 - 969. Calcul	{ "pile_set_name": "DM Mathematics" }
- 192, 4t + 108 = g + 7t. List the prime factors of g. 3, 11 Let x(v) = -v*2 - 74v - 595. What are the prime factors of x(-30)? 5, 29 Suppose 5w = 2n - 1249, 11w = -4n + 14w + 2533. Let f = 1534 - n. List the prime factors of f. 3, 13, 23 Suppose -d = -5t + 183, 3d = t - 0t - 31. Let f be (-4)/10 + t/5. Suppose -f = -3y + 2. List the prime factors of y. 3 Suppose 0 = -2z - 8, -6r - 473 = -r - 3z. Let l = r - -9. Let d = l - -128. What are the prime factors of d? 2, 5 List the prime factors of (12 - (-95514)/12)2. 107, 149 Suppose -36803 = -15v - 1433. Let k = v - 1379. What are the prime factors of k? 11, 89 Let a(f) = 3f3 - 3f*2 + f + 8. Let u be a(3). Suppose -15 + 3 = 4x, -5w = -5x + 720. What are the prime factors of 67/w + u/7? 3 Let k = 14 - 9. Suppose -1025 = -10j + kj. Let t = j - 120. What are the prime factors of t? 5, 17 Suppose -4f = -17 - 3. Suppose 0 = fz - 20, p + 6z = 3z. What are the prime factors of 131(8/p)/(4/(-6))? 131 Suppose -u - 2 = -2v, -14 = -3u + 3v - 5. Let m be u/46/(-4). List the prime factors of (2/m)/(16/(-1584)). 2, 3, 11 Suppose -x - 763 = -191. Let i = 880 + x. What are the prime factors of i? 2, 7, 11 Suppose -2b + 68 = 5m, -b - 20 = -m - 3b. Suppose 3j - 7j = 0. Suppose jz = -3z + m. List the prime factors of z. 2 Suppose 0 = -42f + 37f + 4b - 949, -12 = 3b. Let l(s) = 68s. Let n be l(4). Let t = n + f. What are the prime factors of t? 79 Let h(p) = -2p3 - 21p*2 - 19p - 397. List the prime factors of h(-24). 67, 233 Let v(g) = -29g - 24. Let a = -250 + 245. List the prime factors of v(a). 11 Let d be ((-30)/75)/(4/(-4430)). Suppose -5x = -d + 108. List the prime factors of x. 67 Suppose 5o - 20 - 30 = 0. Let b(t) be the third derivative of t5/60 - t4/2 + 35t*3/6 - 2189t*2. List the prime factors of b(o). 3, 5 Suppose 549n = 594n - 1569780. What are the prime factors of n? 2, 3, 17, 19 Let n(j) = -5j*2 + 25j - 14. Let h be n(5). What are the prime factors of (-564)/535/h? 2, 3, 47 Let k be -8(228/(-24) - 6/8). Let i = 125 + k. List the prime factors of i. 3, 23 Let i(f) = 3f3 + 18f*2 + 35f - 1210. List the prime factors of i(29). 2, 3, 5, 11, 89 Suppose -2c - 5255 = -t, -165t + 3c = -168t + 15783. What are the prime factors of t? 3, 1753 Let z = 138 + -145. Let i(p) = -115p + 9. List the prime factors of i(z). 2, 11, 37 Let d be 1/214 - -1. Let v = 0 + 450. What are the prime factors of v/d - (-18)/24? 3, 19 Suppose 5g - 4g + 3g = 22956. What are the prime factors of g? 3, 1913 Let g = -5813 + 19386. What are the prime factors of g? 7, 277 List the prime factors of ((-15)/12)/((-7)/(-22610)40/(-144)). 3, 5, 17, 19 Let r = -580 + 358. Let j = 77 - r. What are the prime factors of j? 13, 23 Let d = -277 - -289. Suppose 1398 = 2q - d. List the prime factors of q. 3, 5, 47 Let n be (-3)/(24/25 + -1). Suppose -b + 5o = n + 4, -4b + 5o = 346. List the prime factors of -3 + (-5 - (-1 - 3)) - b. 5, 17 Let b(m) = -36m2 - 56m + 2. Let a be b(-4). What are the prime factors of 12/10 - (-7)/(a/(-79790))? 1597 Let x(q) = -q*2 - q + 1. Let a(o) = 4o*3 + 9o*2 + 15o + 74. Let s(l) = -a(l) - x(l). List the prime factors of s(-6). 3, 5, 13 Let i be ((-30)/40)/3(-8)/(-2). List the prime factors of 1039 + (4 - 9) + (-3 - i). 2, 3, 43 Let s(a) = a3 + 37a*2 - 264a + 29. What are the prime factors of s(-25)? 71, 199 Let h be 2 - (25422/(-39) + (-4)/26). Suppose -h = -13s + 12s. What are the prime factors of s? 2, 3, 109 Let o(d) = 147d + 238. Let k be o(-11). Let s = k + 2373. What are the prime factors of s? 2, 7, 71 Suppose 0 = 2j + 4, 2j - 3j = c. Suppose 2r - 8 = 0, -d + 4d - r = c. Suppose -5p + 499 = 4v, -dp + p = -3v + 398. What are the prime factors of v? 131 Suppose 4p = -2r + 56, -4p + 30 = 3r - 30. Let m be -50(p/(-5) + 2). Let f = m - -6. What are the prime factors of f? 2, 13 List the prime factors of 2582 + 817/(-34). 2, 1289 Let y(t) = 31t2 - 103t + 1654. What are the prime factors of y(36)? 2, 7, 389 Let w be (-1)/(-2 + 6) - (-583)/44. Suppose 23d + wd - 19656 = 0. What are the prime factors of d? 2, 3, 7, 13 Suppose 48h - 18h - 53220 = 0. Suppose 5s + 2848 = 2l, -s + h + 5400 = 5l. What are the prime factors of l? 2, 3, 239 Let k be (-14)/(-5)((-180)/8)/(-9). Let n be (1953/(-6))/k-2. Suppose c - 39 - n = 0. What are the prime factors of c? 2, 3, 11 What are the prime factors of (((-90)/27)/10)/(2/18) - -13865? 2, 29, 239 Let v(s) = -5s3 - s2 + s - 22. Let i be v(5). Let w = 283 - i. List the prime factors of w. 2, 5, 19 What are the prime factors of (7551 + 4)(11 - (-50)/(-5))? 5, 1511 Let h = -423 - -438. What are the prime factors of h/20 - (-22855)/28? 19, 43 Let s = 659 + -969. Let x = -29 - s. What are the prime factors of x? 281 Suppose 1888 = 5i + 11i. Suppose s = 29 + i. What are the prime factors of s? 3, 7 Let m be 3/4 + 12555/(-20). Let s = m + 1314. List the prime factors of s. 3, 229 Let c(x) = 4x - 33x3 - 32x*3 + 3x*2 - 28x*3. Let m(l) = -92l*3 + 2l*2 + 3l. Let w(z) = -3c(z) + 4m(z). List the prime factors of w(-1). 2, 11 Suppose -89b = -341b + 2112768. List the prime factors of b. 2, 131 Let l = -30 - -34. Suppose 3f = lh + 2173, 0h + 729 = f + h. List the prime factors of f. 727 Suppose -22s + 690833 - 24607 = 0. What are the prime factors of s? 11, 2753 Let y(m) = 2m3 - 7m*2 - 6m + 1. Let k = -75 + 72. Let r be (-1)/(k2/36). What are the prime factors of y(r)? 5, 29 Let y(p) = -356p - 4626. List the prime factors of y(-33). 2, 3, 1187 Suppose -d = y - 42, 0 = -3y + 6d - 3d + 156. Suppose yv - 79567 = -27914. List the prime factors of v. 7, 157 Let p(l) = 1017l2 + 336l + 23. What are the prime factors of p(-4)? 14951 List the prime factors of (-35)/1(-21 + 2492/(-140)). 2, 7, 97 Suppose z + 0z + u + 20 = 0, 2u = z + 14. Let v be 171/z + (-1)/(-2). Let x = v - -95. What are the prime factors of x? 2, 43 Let c = 40 - 40. Suppose -5x - 30 = h, -2h = -ch - 4x + 4. List the prime factors of 1 + (-804)/h - 54/(-90). 2, 41 Let p(k) = 4k + 17. Let z be p(-5). Let t be 6 + 2 + 0/4 + z. Let w = 9 - t. What are the prime factors of w? 2 Let h be 60/45 + (-188677)/3 + -1. List the prime factors of (-10)/35 + h/(-63). 2, 499 Suppose -286f + 293f = 61215. List the prime factors of f. 3, 5, 11, 53 Let w = 2535 - 2533. Let l(s) = 2 + 17s3 - s2 + 0s + 2s - s. What are the prime factors of l(w)? 2, 17 Let n = 322 - 320. List the prime factors of ((10248/35)/(-6))/(n/(-10)). 2, 61 Let x(y) = -y3 - y2 + y. Let l(i) = -12i3 + i2 + 3i - 6. Let n(p) = -l(p) + 6x(p). Let k be n(4). Let u = k - 128. What are the prime factors of u? 2, 3 Suppose 0 = -13r + 8r + 10. List the prime factors of 210/((r/33)/2). 2, 3, 5, 7 Let g be ((-2276)/(-6) - -3)(6 - 3). Suppose 2f = -3p + g, 17 - 7 = -2p. List the prime factors of f. 7, 83 Let c(k) = k + 6. Let p be c(-6). Suppose 3a - 2d - 1863 = p, 0 = -21d + 24d + 9. List the prime factors of a. 619 Let j be (8/(-40) + (-38)/(-40))68. Let a = 52 - j. List the prime factors of a - -92 - (-6 - -2). 97 Suppose 0 = -4z + a + 1561, 0z = -z - 2a + 397. Let t = z + -256. What are the prime factors of t? 3, 5 Let w = -25823 - -44967. List the prime factors of w. 2, 2393 Let o be ((2/6)/(-1))/(36/(-13716)). Let y = 1234 + o. What are the prime factors of y? 1361 Let w be (-5 - (0 - 5))/(-1). Suppose 2c = -2x - wx + 1652, -5c + 10 = 0. Suppose -8y + x = -576. What are the prime factors of y? 5, 7 Suppose -k = -3g - 5k - 52, 3g + 70 = 5k. Let o = g + 23. List the prime factors of (4/2)/(o/27). 2, 3 Suppose 124897 = 4d + 3i, 0 = 135d - 130d + i - 156146. What are the prime factors of d? 31231 What are the prime factors of (-370941)/(-366)((1 - 0) + 5)? 3, 2027 Suppose 0p + 24p + 2141 = -3235. Let f(n) = -106n - 1. Let k be f(3). Let j = p - k. List the prime factors of j. 5, 19 Let b = 17996 + -11158. List the prime factors of b. 2, 13, 263 Let f = 7931 - 4498. List the prime factors of f. 3433 Let v(c) = 845c2 - 2023c - 10. What are the prime factors of v(8)? 2, 19, 997 Suppose 9 = 7k + 2. Let j be 34/4(k-6)/1. List the prime factors of j(7	{ "pile_set_name": "DM Mathematics" }
85900. 273132z3 Find the second derivative of -5277dy4 - 102721dy - 2d + 63y5 wrt y. -63324dy2 + 1260y*3 What is the third derivative of 82253c*4 - 2c*2 - c - 2338 wrt c? 1974072c What is the second derivative of -5464q4 - 2q*3 - 22769q? -65568q2 - 12q What is the first derivative of -6461d3w*2 + 2d*2w*2 + 4w*2 - 2330 wrt d? -19383d*2w*2 + 4dw2 Find the third derivative of 363r*6 - 463r*4 - 2r*2 - 965601r wrt r. 43560r3 - 11112r What is the second derivative of -2x3z + 50214x2z*3 + xz*3 + 30761xz2 wrt x? -12xz + 100428z*3 Differentiate -637786v - 265063 wrt v. -637786 What is the third derivative of 5q6 - 86q*4 + 6q*2 - 2q - 2943 wrt q? 600q3 - 2064q What is the second derivative of -21530g3v*3 - 105g*3v - 42g3 + gv*4 - v wrt v? -129180g*3v + 12gv*2 Find the second derivative of 21b*2g2 - b2g + 25106b*2 + 12bg2 + 40496bg + g2 wrt b. 42g*2 - 2g + 50212 What is the second derivative of 883524d2 + 3781d - 3? 1767048 What is the second derivative of -2f5 + 21f*3 - 387f*2 + 8f + 5359? -40f3 + 126f - 774 Find the third derivative of -364712h3x*3 - 55h*2x*2 + 56h*2 + hx*2 + 33x*3 wrt h. -2188272x*3 What is the third derivative of 3c*2h*2z*2 + 2c*2hz2 + 4c*2z*3 + 6226c*2z + 151669ch*2z*3 - 2ch2z + 3z2 - 2z wrt z? 24c2 + 910014ch2 Find the first derivative of 21773a - 18426 wrt a. 21773 What is the first derivative of 122526cv*2 + c - 66792v*2 wrt c? 122526v*2 + 1 Find the second derivative of 7195a*2f*4 + 88a*2f*3 - 11703a*2 + 6f wrt f. 86340a2f*2 + 528a*2f What is the second derivative of -6b4 - 3208b*2j*2 - 80bj2 - 4b - j - 13 wrt b? -72b2 - 6416j*2 Find the third derivative of -505593i*3 + 91684i*2 - 9i. -3033558 What is the second derivative of 7w4 - 275939w*2 + 30w - 42191? 84w2 - 551878 What is the first derivative of -2c*4 + 4579c*2y + 5592y + 3 wrt c? -8c*3 + 9158cy Differentiate 1013z*4 + 120z + 334910 with respect to z. 4052z3 + 120 Find the third derivative of 127ds4 - 13ds3z*3 - 7ds - 1889dz3 - 3s*4 - 2s*2z wrt s. 3048ds - 78dz*3 - 72s Find the first derivative of 4h3 + 6208h*2 - 39773. 12h*2 + 12416h What is the first derivative of 271052df + 331f + 625 wrt d? 271052f Find the third derivative of -3gn*4 + 3gn3 - 17gn2 + gn + 5n4 + 425n*3 + 2n*2 - 21n wrt n. -72gn + 18g + 120n + 2550 What is the second derivative of -67m3 + 163m*2 + 211940m wrt m? -402m + 326 Differentiate -b4t - 9942bt - 8t - 4270 wrt b. -4b*3t - 9942t What is the third derivative of 2226s*4 - 5s*3 - 95s*2 - 5s - 10? 53424s - 30 What is the second derivative of 138037b*2 + 24b + 1490? 276074 Find the first derivative of 124a4 - 2a*2c - 5429ac + c - 286130 wrt a. 496a3 - 4ac - 5429c What is the first derivative of 855186p - 1443185? 855186 What is the third derivative of -28186v*4 + 7v*3 - 9v*2 - 2v - 32514 wrt v? -676464v + 42 What is the derivative of -436h*2x + 17h + 21414x - 2 wrt h? -872hx + 17 Differentiate 7147oq - o - 16q - 616 wrt o. 7147q - 1 Find the second derivative of 3f2i + 35187f2 - 1511fi - f + 2i wrt f. 6i + 70374 Find the third derivative of -16916b*3d3 - b3 - 35413b2d*2 wrt d. -101496b*3 Find the second derivative of -28530v*4 - 4v*2 + 80799v - 3 wrt v. -342360v2 - 8 Find the third derivative of -36075q*5 - 26q*2 + 27q + 5. -2164500q2 What is the first derivative of -166162y*2 + 11y + 2984709 wrt y? -332324y + 11 Differentiate -29407f*2s - 121f2t*3 - 3239ft3 + 2st3 wrt s. -29407f*2 + 2t*3 Find the second derivative of -319438q*2 - 355182q. -638876 What is the second derivative of -31ns*2 - 10ns + n - 5434s*2 - 74733s wrt s? -62n - 10868 Find the third derivative of -20k*5 - 2k*3q + 52k3 + 57k*2 + kq + 5k - q wrt k. -1200k*2 - 12q + 312 Find the third derivative of 5019y4 + 11y*3 + 21y*2 - 2y - 199 wrt y. 120456y + 66 Differentiate 12694j*2w*2x - 305j2w - 2jw*2x - 219jw*2 + 3w*2 with respect to x. 12694j*2w*2 - 2jw2 Find the first derivative of -12696r*4u + 38r3u + 772952u wrt r. -50784r*3u + 114r2u What is the second derivative of -203c2hl + 9c*2l + c*2 + 116ch - 102cl - 2hl wrt c? -406hl + 18l + 2 What is the second derivative of 49208b2c*2 - 58bc2 - 2b + 2c2 wrt b? 98416c2 What is the second derivative of -w4 - 4679w3 + w2 - 18314w? -12w2 - 28074w + 2 Differentiate -9206bc + 674934b + 16c + 2 wrt c. -9206b + 16 What is the second derivative of -18x*4 - 45008x*2 + 968968x + 1 wrt x? -216x2 - 90016 Find the first derivative of -40721dr3 + 65204r*3 wrt d. -40721r*3 Find the first derivative of 367lq2 + 55l + 176102q2 wrt l. 367q*2 + 55 What is the second derivative of -4f*4hs + 2304f*3h*2s + 3fh*2s + f - 19s + 2 wrt f? -48f*2hs + 13824fh2s What is the third derivative of -573731ix*5 + 696ix2 + 7ix - 6i - x*6 + 2 wrt x? -34423860ix2 - 120x*3 Find the first derivative of dn*2t - 30751dt*3 - 2n*2t*3 - 21n*2t2 + t3 + 11t2 wrt d. n2t - 30751t3 Find the second derivative of -1632j*4s*2 - 28j*3s*2 + 138j + 333s2 wrt j. -19584j*2s*2 - 168js2 Find the second derivative of 4577w*4 + 18w*3 - 8155w - 5. 54924w2 + 108w Find the third derivative of -1671371c3 + 1318582c*2 wrt c. -10028226 Find the first derivative of 2640i*2r - 16i2t - 6irt - 6it + 150rt + 17r wrt t. -16i2 - 6ir - 6i + 150r What is the third derivative of -13700h*3v + 23h2v - 468h2 + 2v - 1 wrt h? -82200v What is the second derivative of 85x*4 + 45x*3 - 36182x - 1? 1020x2 + 270x Find the second derivative of 92653x4 - 3x3 + x2 + 3x - 147665 wrt x. 1111836x*2 - 18x + 2 Differentiate -4sz*3 - 1474sz2 + 23808s - 3 wrt z. -12sz*2 - 2948sz Find the third derivative of 73311z*3 + 20z*2 + 3z + 22. 439866 Find the first derivative of -41b2l*2r - 134b2l*2 - 9b*2l - 1190lr*3 + 49l wrt r. -41b2l*2 - 3570lr2 What is the second derivative of 1026833l*4 + 10734l - 2? 12321996l2 Differentiate -5st4 - 3st3 + 34925s + 11t2 with respect to t. -20st3 - 9st2 + 22t What is the third derivative of 6a3lp2 + 4464a*3p2 - a3p - 2a*2p*2 + 3alp*2 - 4ap2 - 5lp + 114p*2 wrt a? 36lp2 + 26784p*2 - 6p Find the first derivative of -39608k - 39389. -39608 Find the second derivative of -30n*3p - 8529n2p*2 - np*2 + np + 11939n wrt n. -180np - 17058p*2 Find the first derivative of 366622f + 2500625. 366622 What is the third derivative of 35i3l*4 + 754639i*3l*2 + 2343i*2l6 - l2 wrt l? 840i3l + 281160i2l*3 What is the third derivative of -11612l*5 - 2l*3 - 170514l*2 wrt l? -696720l*2 - 12 Find the third derivative of 644817j*5x*3 + 11j*2 - 345x*3 - 40 wrt j. 38689020j*2x*3 Find the first derivative of 2c*4 + 20151c*2 - 430503 wrt c. 8c*3 + 40302c Find the third derivative of -44610j6 - 29640j*2 wrt j. -5353200j*3 Find the second derivative of 22h*3k*2 - 10637h*3k + 3hk*2 + 6253hk + 4h - 2k wrt h. 132hk2 - 63822hk Find the second derivative of 36481o*5 + 3o*2 - 2o + 224424 wrt o. 729620o3 + 6 What is the second derivative of -1358393u*2 + 2u - 567250? -2716786 What is the second derivative of 653c4d*2 + 33c*3d*3 - 827cd3 - 4c - 4 wrt c? 7836c2d*2 + 198cd3 Find the second derivative of -7alq*2r + 4alqr - 132aqr2 - 2aqr + 5lq*2r*2 + 15lqr + 11q3r*2 - 3q*3 wrt r. -264aq + 10lq2 + 22q*3 Find the first derivative of 6l*4 + 204797l*2 - 716957 wrt l. 24l*3 + 409594l Find the second derivative of 2h2l*2 + 372h*2l + 6h2 + 112hl2 - 3hl + 59h - 2 wrt h. 4l2 + 744l + 12 What is	{ "pile_set_name": "DM Mathematics" }
ppose 7u - 42 = -0u. Is (u - 2) + (3037 - 0) a prime number? True Suppose -168k - 21 = -175k. Suppose kw - 6051 = 2m, -11w - 8070 = -15w + 2m. Is w prime? False Let n = 33428 - 13375. Is n composite? True Let j(k) = -k3 + 2k*2 - 5k - 25. Suppose 366 = -26y + 54. Is j(y) a composite number? True Suppose -11a = -6 - 38. Let i(d) = 324d2 + 13d - 9. Is i(a) a composite number? False Let u(f) = -f*3 + 10f*2 - 8f - 5. Let w be u(9). Suppose 4p = -5z - 172, 0 = wp - 0p + 12. Let x = 127 + z. Is x composite? True Let h(v) = -6v3 - 3v*2 + 43v - 5. Let g(n) = -5n3 - 4n*2 + 41n - 3. Let p(o) = 3g(o) - 2h(o). Is p(-12) prime? True Let l(t) = 234t - 37. Let f(h) = h2 + 10h + 15. Let v(w) = w*2 + 16w + 30. Let x be v(-13). Let q be f(x). Is l(q) prime? True Let x(n) = 16n3 - 29n*2 + 41n + 59. Let c be x(18). Suppose 7j = c - 22392. Is j a composite number? True Is 1 - -590803 - (176 - 187) prime? False Let o(b) = -b2 + b - 1. Let a(r) = 299r*2 - 5. Let l(f) = -a(f) + 4o(f). Let w be l(-2). Let m = w - -1860. Is m a composite number? False Let y(w) = -6w + 55. Let t be y(8). Suppose -tv + 3397 = -2742. Is v a prime number? True Suppose -2o + 63709 = 771. Is o composite? False Suppose 0 = 3p - 4k - 52, p + 3p - 61 = -3k. Suppose 4y + 4y = p. Is ((-2)/5)/(y/(-1490)) a prime number? False Let y be 4(34/(-8) - (-17 - -20)). Let g = 626 - y. Is g a prime number? False Suppose 42f + 174 = 44f. Let m be (f/6124)/(2/8). Suppose 14 = -4l + 6, -4y - 2l = -m. Is y a prime number? False Let b be 5175/(-18)(-5 - (-57)/15). Let v(h) = 399h - 2. Let z be v(2). Let l = z - b. Is l a prime number? False Let c(z) = -7z - 43. Let k be c(-9). Suppose kn - 15n - 14710 = 0. Is n a composite number? True Suppose w + 4t + 10 = -10, 2w - 5t + 105 = 0. Let m = 40 + w. Suppose -6y + 3127 - 43 = m. Is y prime? False Let c(n) = 20277n3 - n2 + 5n - 1. Let y be c(2). Suppose 25p - y - 145854 = 0. Is p composite? False Let x(s) = 5s2 + 5s + 2. Suppose -3 = 6u + 3. Let l be x(u). Is (2327/26)/((l/(-12))/(-1)) a composite number? True Let k(v) = 996v - 3. Let m(c) = -4980c + 14. Let u(i) = -11k(i) - 2m(i). Is u(-6) a composite number? False Let a(q) = -729q + 737. Is a(-48) a composite number? False Let b = -28 + 62. Is ((-1941)/(-9))/(b/(-6) - -6) prime? True Is (0 - 7) + (-5 - (-33218 - 17)) a composite number? False Let k = 3887 + -11. Let w = -1663 + k. Is w a composite number? False Suppose 7t - a - 29581 = 2t, 2a = -t + 5925. Let w = t - 71. Suppose 9g = -5x + 6g + w, -5g = -5x + 5870. Is x composite? False Let n = 89 + -87. Suppose 4q = -0d - 5d + 4, nd + 1 = q. Suppose 2r = 2t - 2r - 722, d = 5t + r - 1860. Is t prime? False Let j(f) = 1453f - 283. Let v be (-52)/(-12) - (-10)/15. Is j(v) a composite number? True Let t = 112702 - -23493. Is t prime? False Let i = -42 - -62. Suppose 0q = -q + r - 2, 0 = -5q - r + i. Is (-1)/(-2)q + 643/2 a composite number? True Is -8 - (-3 + 1843758/(-21)) a prime number? True Suppose -64116 = -13r + 17940. Suppose 5x - 4753 = r. Is x composite? False Let o(l) = 12012l2 + 223l + 1114. Is o(-5) a composite number? False Is (18 - 411606/(-9)) + -15 a prime number? True Let o(t) = -5t3 - 14t + 12. Let z be 3/(-39) - 336/26. Is o(z) a prime number? False Let s be 6/18(-3 - 0). Let x be s + -3 - 0 - -340. Suppose -x - 2186 = -2a + 4n, -3a + 3783 = 3n. Is a composite? True Suppose 75w = -16w + 1114841. Is w a prime number? True Let q(h) = h2 + 4h - 187. Let o be q(35). Suppose -34w - 5u = -38w + 4701, -4u = -w + o. Is w a prime number? False Let v be 1/2 - 29109/(-62). Suppose -39k = -44k + v. Is k prime? False Is ((-209697)/12)/((-60)/1680) prime? False Suppose 0 = -a - 5s + 29441, -7s + 58896 = 2a - 4s. Is a a composite number? True Is (293036/(-3))/((-160)/120) composite? False Let r(n) = -n*3 + 12n*2 + 2n - 21. Let u be r(12). Suppose 2y - 15 = -uy, -5m + 6095 = 5y. Let b = 2909 - m. Is b a prime number? True Let d(b) = 0b2 - 8 + 5b*2 + 9b - 37b. Is d(-13) a prime number? True Let z(w) = -w2 - 24w - 87. Let n be z(-4). Is 23/(69/8580) - n a composite number? True Suppose -2i + 4894 + 3494 = 0. Suppose -5c - t + 6476 = -i, 4t = -3c + 6419. Suppose -5v - 2y + 614 = -c, -4v + 3y = -2216. Is v prime? False Let u = 1051495 - 518646. Is u a composite number? False Let d(h) = -383h - 9. Let t be d(-7). Let a = 3988 - t. Is 9/6a/6 prime? False Let f(x) = 24x - 39. Let s be f(3). Let o = 700 - s. Is o a prime number? False Suppose -3t + 1499854 = 5w, -2t - w + 934021 + 65870 = 0. Is t a prime number? True Suppose 20 = j + 4b, -3j - 2 = -2b + 8. Let r(f) = 2f*2 + f + 1 + 4f*3 + jf*3 + 0f. Is r(4) prime? True Let p = -713 - -720. Suppose -120380 = -ph - 12573. Is h a composite number? False Suppose 5s + 11 = x, 2x = -2s - s + 9. Suppose 207883 = 19a - xa. Is a a composite number? False Let k(q) = 168q + 62. Let v be k(3). Let f = v + -381. Is f composite? True Let y(a) = a2 + 4a - 20. Let d = 19 - 27. Let l be y(d). Is 3/(0 + l/316) prime? True Let h(s) = s + 40. Suppose -2b + 5l = -57, 5b - 204 = 5l - 39. Suppose 2 = 2w - b. Is h(w) a prime number? True Suppose -28p - 187913 - 336779 = 0. Let u = p - -58386. Is u prime? False Suppose 2m - 2d + 2 = 0, -2 = -2d + 4. Let w(g) = 3g - g*2 + 5g - mg + 87g*3 - 3 + 0. Is w(2) prime? True Let f = 563508 + -112951. Is f a composite number? False Suppose 2i = 4o - 14, 1 = -2o + 7o + 3i. Suppose oj = 4r - 64878, -j + 30781 = 3r - 17865. Is r composite? False Let t be -3 + (-1 - 0)3. Let x be (3/t)/(8/(-64)). Suppose -3k + 2k + 222 = n, xk - 858 = 2n. Is k composite? True Let k = -13 + 18. Let s(q) = 371q + 7. Let g(o) = 349o + 7. Let y(h) = -4g(h) + 5s(h). Is y(k) a composite number? True Is (18/(-4)10/12)/(393/(-2569172)) prime? False Let z be ((-180)/(-27))/((-4)/6). Is 335/z-22 a prime number? False Let d(m) = 248m - 73. Let a = 64 + -55. Is d(a) composite? True Let u = -75060 - -274979. Is u prime? False Suppose 22h + 25460041 = -4h + 66238935. Is h a prime number? True Let j = 215 + -210. Suppose 20s - jh + 20388 = 23s, -4h + 20385 = 3s. Is s prime? True Suppose 760g - 7906 = 758g + 2y, 3965 = g - 4y. Is g a composite number? True Let b(o) be the first derivative of -5o + 5/2o2 + 5/2o*4 + 19 + 2/3o*3. Is b(3) a prime number? False Let b be 1/(5/15) - 3. Let x be -149(-1 - b)2. Suppose 3l + x = 5l. Is l a composite number? False Let a(y) = -y2 - 13y + 6. Let c be a(-13). Let z(w) = 2w2 - 8w - 4. Let r be z(c). Let n(k) = -k*2 + 27k - 7. Is n(r) composite? True Let u = -968 - -1424. Suppose -1709 = -z - u. Suppose 0 = -4d + 5d - z. Is d composite? True Let h(i) = 32i3 - 3i*2 + 5i + 6. Let k be h(-5). Let w = 9535 + k. Suppose -w = 4r - 7r - 4m, -5m = -4r + 7234. Is r a composite number? False Let b = 12 + -8. Suppose 2 = -2q, -bm - q = 450 - 3205. Is m a composite number? True Let i = 2975 - 2975. Suppose 4y - 4q = 4, 2q + 8 = 5y - y. Is -863(y/((-3)/1) - i) composite? False Suppose -l + 5l = 2y + 2, l + 12 = 3y. Suppose -yq = 5x - 5, -2q + 0 = -3x + 23. Suppose -xb + b + 1828 = 0. Is b prime? True Is 584889((-208)/24 + 9) - (-3 + 3) composite? False Let i(n) = 33n*2 + 322n - 393. Is i(50) a prime number? True Let j(h) = -6h - 32. Let p be j(-6). Suppose g + 0 = -2n - 2, n + 2g + p = 0. Suppose 3s - 2634 = -3r, n = -3r - 0s - s + 2636. Is r a composite number? True Is 9 - (-29 + 19 + 10-31572) prime? True Suppose 5d - 27 = -w + 3w, -5d = -4w - 29. Let k = -1956 - -1958. Suppose kc = -dp + 4153, -2c + 2490 = 3p + c. Is p composite? True Let w be ((-12)/(-20))/((-2)/(-10)). Suppose wf = f + 8. Suppose fi + 4j + j = 1093, -15 = -3j. Is i prime? False Let x(y) = 2y - 22. Let h be x(13). Suppose -5w - 587 = -2z, hz - 637 - 502 = 3w. Let j = -27 + z. Is j composite? True Let g = 189 + -184. Let s(k) = -k3 + 4k*2 - 4k + 3. Let u be s(3). Suppose gy - 1456 - 1749 = u. Is y prime? True Let l = 1676 + 37. Let a be (-3 + 9 + 4)-97. Let u = a + l. Is u prime? True Suppose 2t - 2d - 6010 = -7*d, -	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.