Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
-29.7. What is the nearest to 0.1 in 2/5, -0.4, d? 2/5 Let h = -1586/275 + 63/11. Let x = 83/200 + h. What is the closest to 0 in 0.2, x, -3? 0.2 Let n = 17.5 + -18. What is the nearest to -1/2 in n, -4/5, -1? n Let x = -2.55 + 0.55. Which is the nearest to 2? (a) x (b) 0.2 (c) -1 b Let m = 11 - 11. Let j = -0.82 - -0.52. Let y = 77 - 387/5. Which is the closest to m? (a) -5 (b) j (c) y b Let h = -16.8 - -26. Let p = 9 - h. Which is the closest to p? (a) -0.2 (b) 1 (c) 0 a Suppose -4m + 9m - 10 = 0. Let w = 0 + m. Let n be 2 - (-1)/(-2)w. Which is the nearest to n? (a) 3 (b) 0.2 (c) 2 b Let w = 2 + 10. Let a = w - 12.3. What is the closest to 2/5 in a, -1/4, -1/3? -1/4 Let w = -27/5 + 253/45. What is the nearest to 1 in 0.2, w, -0.2? w Let m = -4 - -6. Let l = m - 5. Let h = 7 - 6. Which is the nearest to h? (a) 2/17 (b) 1 (c) l b Let k(s) = s3 + 13s*2 + 2s + 30. Let j be k(-13). Which is the nearest to -2/5? (a) 0 (b) 0.04 (c) j a Let x be 3/(-27)(0 - -2). What is the nearest to 0.1 in -1/4, 5, x? x Let g = 89 - 980/11. Let x = -1.02 + 0.62. Which is the nearest to 0.1? (a) g (b) 0.4 (c) x a Let t = 14.1 + -10.1. Let o = 1.3 - 6.3. Let j = o + t. Which is the nearest to j? (a) 0.1 (b) -3 (c) 2/7 a Let s = 23 - 34. Let d = s + 8. Let a = -1.1 - -0.1. What is the closest to a in d, -2, 3? -2 Let l be -3 + ((-24)/2)/(-4). Which is the nearest to -1? (a) 4 (b) 1/5 (c) l c Let n = -16 - -23. Let a = n + -9. What is the nearest to a in -1/7, 1, 5? -1/7 Let y = 0.09 - 0.13. Let s = y + 2.04. What is the nearest to s in -1/2, 4, 5? 4 Let w = 7.13 + -5.2. Let x = 0.07 + w. What is the nearest to 3 in x, 3, -4? 3 Let r = -2.979 - 0.021. Suppose 20 = -2a + 3p, 2a - 4p = -2p - 16. What is the closest to 1 in 2, r, a? 2 Suppose 22 = -4z - 30. Let u = z - -11. What is the nearest to -0.1 in -1/4, 1, u? -1/4 Let n = 10.7 + -11. Which is the nearest to n? (a) -5 (b) -0.2 (c) 2 b Let f be 1/4 + (-3)/(-20). Let z = -0.0288 - 4.9712. What is the closest to f in -1, -0.3, z? -0.3 Let v = -0.1 + -0.9. Let o = 5.6 + -6. Which is the nearest to v? (a) -3 (b) 3/4 (c) o c Let o be -2 - 24/(-14) - (-29)/28. Which is the closest to 1/3? (a) -4 (b) -0.1 (c) o c Let f be (-2)/38(-1 + -1). Let i = -26 + 25. Which is the closest to 0.2? (a) -5 (b) f (c) i b Let w = 15 + -15.5. Which is the closest to 3? (a) 0.5 (b) 0 (c) w a Let q = -92/5 + 18. Let m = -209 + 417/2. Which is the nearest to m? (a) 2/5 (b) 4/5 (c) q c Let i = 9.8 - 9.8. Let q = 3 - 2.9. What is the closest to q in 2/5, 5, i? i Let n be (8/6)/((-1)/3). What is the closest to 1 in n, 1/7, -0.3? 1/7 Let p be (2 - 9/6)2. Let f be (1/(-3))/(-2 + p). Let d be (-2)/12 + (-1)/(-2). What is the nearest to f in 1/4, d, 4? d Let v = -3.98 + -0.22. Let u = -0.8 + v. Let d = u - -5.5. What is the nearest to -1/4 in -0.2, d, 1/3? -0.2 Let i be 54/24(-1 + -3). Let z(x) = x*3 + 9x*2 + 1. Let o be z(i). Which is the nearest to -1/2? (a) o (b) 5 (c) -0.1 c Let n = -118/5 - -24. Let l = 16 - 24. Let c = -9 - l. What is the closest to n in -1/6, c, -3/8? -1/6 Let o = 1.8 - 2. Let i be (-2)/(-5) + 92/20. Which is the closest to o? (a) 0 (b) i (c) 0.4 a Suppose -4j = -0j. Let h = 171 - 172. What is the nearest to j in 0.2, 1/7, h? 1/7 Let i = 5.04 - 5. Let t = i - -0.96. Let h = -5.1 + 0.1. Which is the closest to 1? (a) t (b) 5 (c) h a Let q = 8.97 + 0.03. Let g = -13 + q. What is the nearest to 2/3 in g, -2, 0? 0 Let k be 1(-2)/311. What is the nearest to 2/11 in -5, k, 0? 0 Let p = 0.143 + 0.157. What is the nearest to -2 in -2, 1, p? -2 Let t = -345/4 + 86. Which is the nearest to t? (a) 2 (b) 2/11 (c) -2/5 c Suppose -x + 2 - 1 = 0. Let l be 6/(-78)2/x. What is the nearest to l in 2, 6/5, -2? 6/5 Let k = -0.37 + 0.07. Suppose 0 = 8z - 4z + 32. Let s = -13 - z. Which is the nearest to 0? (a) s (b) -0.2 (c) k b Let y be (1 + 1)(-9)/36. Which is the closest to 1/3? (a) 4 (b) -4 (c) y c Let d = 0.44 + 0.06. Let h = 35 - 35.1. What is the nearest to -4 in -1/2, h, d? -1/2 Suppose -3k = 31 - 40. What is the closest to -0.1 in k, -4, 5? k Let r = 0 + 7. Let k = r - 11. What is the closest to 0 in -3, k, 0? 0 Let d = 1.3 - 0.3. Let k = -5.2 - -0.2. Let a = d + k. What is the nearest to 1 in -3, 3, a? 3 Let i = 19 + -27. Let j = i - -10. Which is the closest to j? (a) 1/5 (b) 0.4 (c) 0 b Let x = -0.7 - -1. Let v = 0.74 - 4.84. Let j = 4 + v. What is the nearest to j in -1/4, x, 0? 0 Let h = -52 - -52. Let c = 4.4 - 0.4. What is the closest to h in c, -2, -0.4? -0.4 Let g = 186 - 933/5. Let o = -4 + 3.9. What is the closest to 0 in o, 4/5, g? o Let j be 0 - 3 - -12(-21)/(-112). What is the nearest to -1 in j, 4, -5? j Suppose -w + 0 - 5 = 0, 5r + 40 = -w. What is the nearest to r in 1, 5, 0.5? 0.5 Let q = 17 + -15. Which is the nearest to q? (a) 0.4 (b) 2 (c) 5 b Let x = 1.5 - 1.8. What is the closest to 2 in x, -2, -5? x Let p be 674/(-102) + 3 + 3. Let l = p + -1/17. What is the nearest to l in -0.5, -2/11, 1/3? -0.5 Let h = -109 - -109.4. What is the closest to -0.1 in 2/7, -0.3, h? -0.3 Let m be 4/(-18) + 1/45. Let l be -31/(-126)-4. Which is the nearest to 1/4? (a) m (b) -3/4 (c) l c Let m be 574/(-147) + (-4)/(-1). Let f = 11/12 - 5/12. Which is the nearest to 2? (a) m (b) 3 (c) f b Let l = -0.052 - 0.148. What is the closest to -1/3 in 6, l, 5? l Let i = -18 + 23. Which is the closest to 0.1? (a) -1/5 (b) i (c) -4 a Suppose -g - 1 = j - 2, -2j - 4g + 10 = 0. Let d be (-12)/(-10)(-2)/(-6). Let h be (-1)/3 - (-1)/5725. Which is the nearest to -1? (a) j (b) d (c) h c Suppose 5h + 12 + 3 = 0. Which is the nearest to 1? (a) h (b) 0.1 (c) 0.5 c Let m = -0.3 - -1.6. Let r = m + -0.3. Let y(f) = -f3 - f2 + f - 1. Let p be y(0). Which is the closest to r? (a) 1/2 (b) p (c) -0.1 a Let h = -16 - 2. Let q = h + 15. What is the nearest to 1/3 in q, -1, -5? -1 Let r = 13.66 + 0.34. Let t = -9 + r. Let b = -4.8 + t. What is the nearest to 0 in -0.4, b, 1? b Let q = 5.013 + -0.113. Let o = q - 5. Which is the closest to o? (a) 1/4 (b) 0.1 (c) -1 b Let i = 0.5 + 1.5. Let s = -2/35 - -9/35. Which is the nearest to -0.1? (a) -0.2 (b) s (c) i a Let z = -5 + 3. Let q = z + 1. What is the closest to q in 2, -1/3, 1? -1/3 Let l be 2 + (-51)/9 + 3. Which is the nearest to l? (a) 0 (b) -1/6 (c) -1/8 b Let y = -0.11 - 3.89. Let h be (-3)/(-6)-25. Let j = 447/5 + -89. Which is the nearest to j? (a) y (b) h (c) 1/3 c Let g = 7 - 8. Let v(t) = -t2 - 8t - 9. Let i be v(-7). Let x be -1(1 + 1 + 3). Which is the closest to i? (a) 0.5 (b) x (c) g c Let o be (-14)/(-7) + 1 + -46. Let z = 259/6 + o. Let f = -2.96 + -0.04. What is the nearest to 0 in f, z, 4? z Suppose 5z = -5t + 2z + 1, 3t + 11 = 4z. Let m be 92/(-20) + (-4)/10. Let v = 4.08 - 0.08. What is the nearest to t in 0.5, m, v? 0.5 Let f = 0.074 + 0.926. What is the nearest to 0.1 in -0.5, 0.1, f? 0.1 Let i = 412 - 415. Let p be 1/3 - (-1)/(-2). What is the nearest to -2/5 in p, -1/2, i? -1/2 Let l be ((-45)/(-9))/((-2)/(-2)). Let t(y) = -y*2 - 2y + 1. Let r be t(-2). Let m be (r + 1)2/(-18). What is the closest to m in l, 0, -4? 0 Let s = -0.31 + 0.61. Let u = -0.5 - -0.5. What is the closest to 0.1 in u, s, 1/4? u Suppose r = -4r + 25. Let f = 45 - 42. Which is the closest to 0.1? (a) r (b) 0 (c) f b Let q = -8 + 9. Let p = 0.3 + 0.9. Let t = p + -1. Which is the nearest to q? (a) -0.5 (b) t (c) 2/9 c Suppose 6i - 17 + 47 = 0. Suppose -25 = -2w - 3b, -w - 5b + 3b = -14. Let l = -4 + w. What is the closest to 0.1 in -2, i, l? -2 Let q(j) be the third derivative of 1/6j*3 - 4j*2 + 0 - 1/120j*6 - 1/12j*5 - 1/6j*4 + 0j. Let o be q(-3). What is the closest to -0.1 in o, 4, -4? -4 Let l be -2 - (-8)/(-7) - -3. Let i = 2.6 + -2.8. Which is the nearest to -3? (a) l (b) i (c) 0 b Let w = 29/15 - 13/5. Let x(k) = k*2 - 5k - 7. Let j be x(6). What is the nearest to -0.1 in j, w, 4? w Suppose -3l = 4b + 32, 0l + 3b = -3*l - 27. Let m = 0.07 + 0.73. Let t = 0.2 + m. What is the nearest to -1 in -2, t, l? -2 Let p = -1 + 0.6. Let i = -9 - -10. Let v be 1/10 - 2/(-5). What is the closest to v in p, i, -1? i Let d = -1.4 +	{ "pile_set_name": "DM Mathematics" }
. -24sqrt(2) + 44 Simplify (2sqrt(156)5)/sqrt(12). 10sqrt(13) Simplify (-4 + sqrt(304) + sqrt(19))2 + (sqrt(133)/sqrt(7) + 3)2. -34sqrt(19) + 519 Simplify 5 + ((-2sqrt(420) + sqrt(420))/sqrt(12) + sqrt(35))/(sqrt(240)/sqrt(3)). 5 Simplify (((sqrt(143) + sqrt(143)1)/sqrt(11))2 - sqrt(13)) + 1. -sqrt(13) + 53 Simplify -5 + ((2sqrt(396))*2 - sqrt(396)) + (sqrt(132)/(sqrt(12) + 1sqrt(12)2))2. -6sqrt(11) + 14222/9 Simplify sqrt(15)/(1sqrt(5))1. sqrt(3) Simplify (1(sqrt(19) + sqrt(304)) - ((2 + sqrt(931) - sqrt(931)) + sqrt(931) + sqrt(19)))2. 12sqrt(19) + 175 Simplify -2 + -3sqrt(2)-1. -2 + 3sqrt(2) Simplify sqrt(2448) - (-4sqrt(2448))*2 - (4 + -1sqrt(17)). -39172 + 13sqrt(17) Simplify (-3 + sqrt(300) + -1)2. -80sqrt(3) + 316 Simplify -5 + -4 + (sqrt(11) - (sqrt(33)/sqrt(3))*2). -20 + sqrt(11) Simplify 2-6(sqrt(17) - sqrt(1377))2. -13056 Simplify 2((1sqrt(144) - sqrt(144))/sqrt(8))2. 0 Simplify (sqrt(245)1 + sqrt(245))-4. -56sqrt(5) Simplify (sqrt(99)/sqrt(3))/sqrt(3) - 1(sqrt(44)/sqrt(4))2. -11 + sqrt(11) Simplify ((sqrt(102) - -33sqrt(102))/sqrt(6))2. 1700 Simplify (sqrt(76)/(sqrt(24)/sqrt(6)))2-5. -95 Simplify -4 + sqrt(1100)-2 + sqrt(11) + sqrt(99)2 + 1. -13sqrt(11) - 3 Simplify (6sqrt(40)/sqrt(2))/(sqrt(90)/(sqrt(18)/sqrt(2))). 6sqrt(2) Simplify (-1 + (sqrt(91) - 1sqrt(91))/sqrt(7))-4 + -4. 0 Simplify -2 + (1 + sqrt(2) + -1)2 + 3. 3 Simplify 1(sqrt(19) - (-4 + sqrt(19)-6)2 - sqrt(19)). -700 - 48sqrt(19) Simplify (sqrt(133)/sqrt(63))*2 + 5. 64/9 Simplify 3 + 1sqrt(2)1 + 3. sqrt(2) + 6 Simplify (sqrt(13) + -1 + 5 + sqrt(13)2 + -3)*2. 6sqrt(13) + 118 Simplify 3sqrt(112) - (-4 + sqrt(7)-1). 4 + 13sqrt(7) Simplify ((2sqrt(24)-3)/(6sqrt(8)2))2. 3/4 Simplify ((sqrt(360)/sqrt(6))/(sqrt(20)/sqrt(4)-6))*2. 1/3 Simplify 2(sqrt(13) + (sqrt(637))*2 + 4). 2sqrt(13) + 1282 Simplify -5(sqrt(13) - (sqrt(637))26 - sqrt(13)). 19110 Simplify 5 + 4(3sqrt(475))*2. 17105 Simplify 1(sqrt(175) + 1sqrt(175))2 - 5((sqrt(175) + 0)*2 - sqrt(175)). -175 + 25sqrt(7) Simplify (3(2 + sqrt(9)/(sqrt(9)/sqrt(3)) + sqrt(3)))2 + 0. 72sqrt(3) + 144 Simplify (((sqrt(1008) - (sqrt(1008) + 1)) + -4 - sqrt(1008)) + sqrt(1008) + (sqrt(1008) - (2 + sqrt(1008) + sqrt(1008)))6 + sqrt(1008))2. 2040sqrt(7) + 25489 Simplify (sqrt(11) - (-2 + sqrt(11) + sqrt(11) + 0))*2 + sqrt(44)/(sqrt(8)/sqrt(2)). -3sqrt(11) + 15 Simplify (sqrt(85) - (sqrt(85) + -2sqrt(85))5)/sqrt(5). 6sqrt(17) Simplify ((sqrt(112)/sqrt(7))/sqrt(8) + -3)2. -6sqrt(2) + 11 Simplify (sqrt(3) + 3 + -1sqrt(3) - (-5 + 1 + sqrt(3)))2 + 3. -14sqrt(3) + 55 Simplify (6(sqrt(396) + sqrt(11)) + (sqrt(88)1 + sqrt(88))/sqrt(8))*2. 21296 Simplify sqrt(204)/((sqrt(12) + (sqrt(12) - sqrt(60)/sqrt(5)))3). sqrt(17)/3 Simplify 3 + 5sqrt(95)/(sqrt(5) + sqrt(45)). 3 + 5sqrt(19)/4 Simplify ((-2sqrt(2156) - sqrt(2156))/(sqrt(36)-6))*2. 539/36 Simplify 43sqrt(2736). 144sqrt(19) Simplify ((sqrt(312)/(sqrt(72) + sqrt(8)))/(sqrt(300) - (sqrt(300) - 1sqrt(300) - sqrt(300))))2. 13/6400 Simplify ((sqrt(7) - (sqrt(1008) + (sqrt(1008) - (2sqrt(1008) + sqrt(1008)))))1)2. 1183 Simplify -5 + (sqrt(136)/(2sqrt(8)) - ((sqrt(17) - -2(sqrt(17) + 1)) + sqrt(17))2). -281 - 31sqrt(17)/2 Simplify (((sqrt(2) - (-3 + sqrt(2) + 1)) + 0)-3)2. 36 Simplify (3(sqrt(125)/sqrt(5) - sqrt(25)))/(sqrt(5) - (-1sqrt(45))/sqrt(9)). 0 Simplify (sqrt(242) + 1 + sqrt(242) + -6sqrt(98))*2. -40sqrt(2) + 801 Simplify (1(sqrt(187)1 + sqrt(187) - sqrt(187)))/(5sqrt(33)/sqrt(3)). sqrt(17)/5 Simplify (5 + (sqrt(847)1)*2 - (4((-1 + sqrt(847))*2 + sqrt(847)) + sqrt(847))) + -2. -2542 + 33sqrt(7) Simplify 1(-3 + sqrt(117))2 + -1. -18sqrt(13) + 125 Simplify (31sqrt(228) + sqrt(228))/(sqrt(72)/(sqrt(6)2)). 8sqrt(19) Simplify sqrt(33)/((sqrt(132)2)/sqrt(12) + sqrt(11) + sqrt(11) - sqrt(11) - sqrt(11)). sqrt(3)/2 Simplify (sqrt(12) + sqrt(108)-1)/sqrt(6). -2sqrt(2) Simplify 4 + (-2sqrt(720) + -1)*26. 288sqrt(5) + 17290 Simplify ((sqrt(96)/sqrt(3))/sqrt(2))/sqrt(8). sqrt(2) Simplify -4 + sqrt(112)5 + (sqrt(448)1)2. 20sqrt(7) + 444 Simplify (-2 + 5(-2 + sqrt(2)))2. -120sqrt(2) + 194 Simplify -6sqrt(76)/sqrt(4) + (0 + sqrt(19) - sqrt(19)) + sqrt(19) + 0 + 0. -5sqrt(19) Simplify sqrt(242) + 2sqrt(242)4. 99sqrt(2) Simplify 1((sqrt(208) + 2)3-3)*2. 1296sqrt(13) + 17172 Simplify (4(sqrt(76) + sqrt(76) + ((sqrt(76) - -6sqrt(76))4 - sqrt(76)) - sqrt(76) - sqrt(76))/sqrt(4))2. 221616 Simplify 0 + (sqrt(180)1)*2 + 5. 185 Simplify (sqrt(40)/sqrt(2)-2)/(sqrt(20)/(sqrt(6)/sqrt(3))). -2sqrt(2) Simplify 5 + ((sqrt(108) + -1 + 1 + sqrt(108) - sqrt(108)) + -1)2. -12sqrt(3) + 114 Simplify (sqrt(8)/sqrt(100)6)2. 72/25 Simplify (sqrt(66) - -1sqrt(66))/sqrt(6) + (1 + sqrt(1584))*2. 26sqrt(11) + 1585 Simplify -1 + 1(2sqrt(51)/sqrt(27))*2. 59/9 Simplify (sqrt(130)/(sqrt(20)/sqrt(2)) - (sqrt(13) - (sqrt(468) - -2sqrt(468) - sqrt(13)))*2) + -3. -3331 + sqrt(13) Simplify sqrt(288)/sqrt(6) - sqrt(3)13. sqrt(3) Simplify (3(sqrt(108) - (sqrt(108) + 0)))*2 + (sqrt(108) + sqrt(108)25)2. 13068 Simplify ((1sqrt(3) - sqrt(3)) + 4)*2 - 2sqrt(3)6. -12sqrt(3) + 16 Simplify -2 + ((sqrt(448) + -1)*2 - ((sqrt(448)-2)*2 + sqrt(7))). -1345 - 17sqrt(7) Simplify (sqrt(78)/(-6sqrt(6)2))*2. 13/144 Simplify (sqrt(1872) - (2sqrt(1872) + sqrt(1872)))/((sqrt(16) + (sqrt(16) + sqrt(16)2 - sqrt(16)) + sqrt(16))/sqrt(4)). -3sqrt(13) Simplify 2(2sqrt(126))/(sqrt(21)/sqrt(3)-1). -12sqrt(2) Simplify ((-2sqrt(144))/sqrt(8))/(sqrt(54)1). -2sqrt(3)/3 Simplify 3 + 6(sqrt(104) - (sqrt(104)-3 + sqrt(104) + sqrt(104)) - sqrt(104))/sqrt(8). 3 + 6sqrt(13) Simplify -1(sqrt(77) + 62sqrt(77) + sqrt(77))/sqrt(7). -14sqrt(11) Simplify (sqrt(700) + -5(sqrt(700) + 1) - 6(sqrt(700)-1 + sqrt(700)))2. 400sqrt(7) + 11225 Simplify (sqrt(117) + -3 + sqrt(13))-5-1. -15 + 20sqrt(13) Simplify 3(-3 + 2sqrt(800)). -9 + 120sqrt(2) Simplify -2sqrt(98) + 5 + sqrt(98)-21. -28sqrt(2) + 5 Simplify ((sqrt(3993) + sqrt(3993) + (sqrt(3993) - 4sqrt(3993)) + sqrt(3993))/sqrt(3))2. 0 Simplify (-3 + sqrt(175) + sqrt(175))-6. -60sqrt(7) + 18 Simplify 3(sqrt(3) + (sqrt(3) - 3(sqrt(3)-2 - sqrt(3))) - sqrt(3)). 30sqrt(3) Simplify (-3sqrt(242))*2 + -5. 2173 Simplify (-6(sqrt(637) - (sqrt(637) + 1)) - 3sqrt(637)-2)*2. 504sqrt(13) + 22968 Simplify (2 + 4sqrt(1700) + sqrt(1700))2. 200sqrt(17) + 42504 Simplify (-4 + (sqrt(5) + -2sqrt(20))-6)*2. -144sqrt(5) + 1636 Simplify 4 + (-1sqrt(18))2 + ((sqrt(98) + sqrt(98) + -1)-4)*2. -448sqrt(2) + 6310 Simplify (sqrt(405) - (5sqrt(405) + 2)) + -3. -36sqrt(5) - 5 Simplify (sqrt(21) - (-1sqrt(21) - sqrt(21))1)/sqrt(7) - (sqrt(27)-5 - -6(sqrt(3) + 1 + sqrt(3))). -6 + 6sqrt(3) Simplify (-1(sqrt(77) + (sqrt(77) - ((sqrt(77) - 1sqrt(77)) + sqrt(77)))) - sqrt(77))/(-6sqrt(252)). sqrt(11)/18 Simplify (sqrt(102)/(sqrt(12)/sqrt(2) + sqrt(6)) + 2sqrt(136)/sqrt(8))2. 425/4 Simplify -4(sqrt(112) + -1)*2 - sqrt(112). -452 + 28sqrt(7) Simplify 0 + sqrt(256)/(sqrt(800) - sqrt(8)). 4sqrt(2)/9 Simplify (2sqrt(14)/(sqrt(7)-2))2. 2 Simplify (((sqrt(136) + -2sqrt(136) - sqrt(136))-4)/sqrt(8))2. 1088 Simplify -4((sqrt(2) + -3)-2 - sqrt(2))2-2. -288sqrt(2) + 432 Simplify ((sqrt(209) + 1sqrt(209))2 - sqrt(209))/(sqrt(891) - ((sqrt(891) - 2sqrt(891)) + sqrt(891) + sqrt(891) - sqrt(891))). sqrt(19)/3 Simplify (-1 + (sqrt(704)-3 - sqrt(704)))2 + 6(sqrt(704) - (sqrt(704) - (sqrt(704) + 0 + sqrt(704)))*2). 112sqrt(11) + 7041 Simplify (4(sqrt(128) + sqrt(128) + -1))2-5. -41040 + 2560sqrt(2) Simplify ((sqrt(119) + (sqrt(119) - 2sqrt(119) - sqrt(119)))5)/((sqrt(84)-2)/sqrt(12) - sqrt(7)). 5sqrt(17)/3 Simplify (2 + (sqrt(162) - (2 + sqrt(162) + -2 + sqrt(162))))2. -36sqrt(2) + 166 Simplify sqrt(70)/(sqrt(10) - 3sqrt(30)/sqrt(3)). -sqrt(7)/2 Simplify -2 + sqrt(209)/(sqrt(22)/sqrt(2)). -2 + sqrt(19) Simplify (sqrt(76) - -3(sqrt(76) - (4sqrt(76) - sqrt(76)) - sqrt(76)))/sqrt(4) + -3. -8sqrt(19) - 3 Simplify (2(-1 + sqrt(2352) - sqrt(2352))-4)*2. 64 Simplify (5(sqrt(99) + 4sqrt(99)))/sqrt(9). 25sqrt(11) Simplify 3*(sqrt(90)/sqrt(5)	{ "pile_set_name": "DM Mathematics" }
671504120 Convert 4.769839mg to micrograms. 4769.839 Convert 0.4723317 meters to kilometers. 0.0004723317 What is twenty-six fifths of a litre in millilitres? 5200 Convert 3.173891 years to millennia. 0.003173891 Convert 64.1034 nanograms to grams. 0.0000000641034 How many seconds are there in 138.05 days? 11927520 What is fifty-one halves of a litre in millilitres? 25500 How many litres are there in 11.419ml? 0.011419 How many seconds are there in 189.7792 days? 16396922.88 How many millilitres are there in 13/8 of a litre? 1625 Convert 5.958987 millilitres to litres. 0.005958987 How many centuries are there in 186.25467 months? 0.155212225 How many micrometers are there in 852.9469 nanometers? 0.8529469 What is 85171.6m in millimeters? 85171600 How many nanograms are there in 21/5 of a microgram? 4200 Convert 8.130471 nanometers to meters. 0.000000008130471 What is 0.6351284 kilometers in millimeters? 635128.4 How many litres are there in 454.7656 millilitres? 0.4547656 Convert 45.68721kg to tonnes. 0.04568721 What is 98213.92ml in litres? 98.21392 How many kilograms are there in one tenth of a tonne? 100 How many millilitres are there in twenty-nine fifths of a litre? 5800 What is 6/25 of a micrometer in nanometers? 240 What is 1/10 of a milligram in micrograms? 100 What is 1.195183 years in months? 14.342196 How many millimeters are there in one tenth of a meter? 100 Convert 8013.661km to micrometers. 8013661000000 What is 45/4 of a gram in milligrams? 11250 What is 178.2017ml in litres? 0.1782017 Convert 41920.95cm to millimeters. 419209.5 What is 10.00868m in micrometers? 10008680 How many milligrams are there in 175.6104ug? 0.1756104 How many minutes are there in 11/8 of a week? 13860 What is 698416.5g in micrograms? 698416500000 What is 46/5 of a litre in millilitres? 9200 How many millilitres are there in five eighths of a litre? 625 Convert 45.25888t to nanograms. 45258880000000000 What is three fifths of a millennium in centuries? 6 How many hours are there in 807711.8 weeks? 135695582.4 What is 2/27 of a day in seconds? 6400 What is fourty-five halves of a century in months? 27000 What is one tenth of a kilometer in millimeters? 100000 How many millilitres are there in 55991.64 litres? 55991640 How many days are there in 692.44596 minutes? 0.48086525 Convert 1829.949 meters to nanometers. 1829949000000 What is 21/4 of a millennium in months? 63000 How many minutes are there in 2/9 of a week? 2240 Convert 12.49578ns to hours. 0.00000000000347105 How many months are there in 0.521341 centuries? 625.6092 How many milliseconds are there in 62.6219 hours? 225438840 What is 4273156.8 nanoseconds in hours? 0.000001186988 How many grams are there in three fifths of a kilogram? 600 How many centimeters are there in twenty-seven halves of a meter? 1350 Convert 940914.2nm to kilometers. 0.0000009409142 How many nanometers are there in seventeen halves of a micrometer? 8500 What is one quarter of a milligram in micrograms? 250 What is 74336.03mg in grams? 74.33603 What is eight thirds of a millennium in months? 32000 What is 3/5 of a century in decades? 6 Convert 27194.96l to millilitres. 27194960 Convert 272.6088 months to millennia. 0.0227174 How many months are there in 12/25 of a millennium? 5760 What is 1/20 of a centimeter in micrometers? 500 How many tonnes are there in 2442.78kg? 2.44278 What is eleven eighths of a millisecond in microseconds? 1375 How many litres are there in 0.391602 millilitres? 0.000391602 How many millilitres are there in eleven halves of a litre? 5500 Convert 9333.216 litres to millilitres. 9333216 Convert 77.85037 meters to kilometers. 0.07785037 How many seconds are there in seven eighths of a hour? 3150 Convert 0.4945115l to millilitres. 494.5115 What is three fifths of a meter in millimeters? 600 How many nanometers are there in 12622.02 centimeters? 126220200000 How many kilometers are there in 7.968922 meters? 0.007968922 What is 26/5 of a litre in millilitres? 5200 What is seventeen halves of a litre in millilitres? 8500 What is 44.19883 millimeters in meters? 0.04419883 How many nanograms are there in sixty-one quarters of a microgram? 15250 Convert 509362.9 weeks to days. 3565540.3 What is 623.0796 months in centuries? 0.519233 What is eighteen fifths of a hour in seconds? 12960 How many years are there in 14075.81 millennia? 14075810 How many millilitres are there in 0.7278318l? 727.8318 Convert 6403.77 hours to milliseconds. 23053572000 What is 0.5445399 milligrams in tonnes? 0.0000000005445399 Convert 85571.68 nanometers to kilometers. 0.00000008557168 How many milligrams are there in five eighths of a gram? 625 How many seconds are there in 4/3 of a hour? 4800 What is 46197.85 decades in months? 5543742 Convert 4.33551 nanograms to micrograms. 0.00433551 How many kilometers are there in 0.4763148 centimeters? 0.000004763148 What is thirty-seven halves of a tonne in kilograms? 18500 What is 94742.38 micrograms in kilograms? 0.00009474238 What is 8682.209 millilitres in litres? 8.682209 How many micrograms are there in 57/5 of a milligram? 11400 What is 1.588129 hours in minutes? 95.28774 Convert 451.338 years to millennia. 0.451338 What is twenty-one halves of a kilometer in meters? 10500 How many months are there in 6/5 of a millennium? 14400 Convert 406888.2um to centimeters. 40.68882 What is 5870.862 tonnes in micrograms? 5870862000000000 How many seconds are there in 27.01458 nanoseconds? 0.00000002701458 Convert 2.708885 millimeters to micrometers. 2708.885 What is 1/10 of a millennium in years? 100 What is 25/2 of a kilogram in grams? 12500 What is nine tenths of a decade in years? 9 How many milliseconds are there in twenty-one fifths of a second? 4200 How many millilitres are there in one fifth of a litre? 200 How many years are there in 0.2668855 millennia? 266.8855 What is 3/25 of a litre in millilitres? 120 What is 27/5 of a centimeter in millimeters? 54 How many millimeters are there in 15/4 of a meter? 3750 What is 8/3 of a year in months? 32 What is 29.72073 millilitres in litres? 0.02972073 How many micrograms are there in 543.6299 nanograms? 0.5436299 How many millilitres are there in fifty-nine quarters of a litre? 14750 Convert 90669.9 kilometers to nanometers. 90669900000000000 What is three fifths of a microgram in nanograms? 600 What is 844.1643 litres in millilitres? 844164.3 How many millennia are there in 551.0273 decades? 5.510273 How many millilitres are there in 1/10 of a litre? 100 What is 26/5 of a millennium in years? 5200 What is 3/40 of a century in months? 90 What is 60829.45 millennia in years? 60829450 What is 2.37348m in centimeters? 237.348 What is seventy-four thirds of a day in hours? 592 How many grams are there in 644.1956ug? 0.0006441956 How many centimeters are there in 727.2739m? 72727.39 What is thirteen fifths of a litre in millilitres? 2600 What is seventy-five quarters of a litre in millilitres? 18750 What is 23.2498km in centimeters? 2324980 How many nanometers are there in seven quarters of a micrometer? 1750 How many meters are there in 49/4 of a kilometer? 12250 Convert 7.4655um to meters. 0.0000074655 How many weeks are there in 182765494.8 milliseconds? 0.302191625 What is 17/2 of a micrometer in nanometers? 8500 How many centuries are there in 6.750593 millennia? 67.50593 Convert 145.9595 minutes to seconds. 8757.57 What is fifty-five quarters of a kilogram in grams? 13750 Convert 9.012693ml to litres. 0.009012693 How many millimeters are there in 3/5 of a meter? 600 What is 1/10 of a millennium in years? 100 Convert 589.4762 decades to months. 70737.144 Convert 1753.956 centuries to months. 2104747.2 How many grams are there in 3/25 of a kilogram? 120 How many milliseconds are there in 58.7765 minutes? 3526590 What is 6.979479kg in micrograms? 6979479000 What is 482340.8 centimeters in micrometers? 4823408000 How many months are there in 37/5 of a millennium? 88800 What is 6.188238 millilitres in litres? 0.006188238 Convert 50.40827 millennia to centuries. 504.0827 What is 3178.2168s in hours? 0.882838 What is 4571.766 centuries in months? 5486119.2 What is 38730.38m in millimeters? 38730380 What is 494.4837um in kilometers? 0.0000004944837	{ "pile_set_name": "DM Mathematics" }
m x + ir and give x. 0 Express -37 - 38 - 3k - 6k + 58 in the form n + ck and give c. -9 Express (-710 + 375u - 131u + 709)(-2u + 3u - 2u) as fu2 + yu + c and give f. -244 Rearrange (r - 2r + 0r)(2 - r - 2 + 6)(-3r2 - 30r*2 + 3r*2) to the form gr*3 + sr*2 + a + br + cr4 and give c. -30 Express 41k + 37 - 38 + 167k + 589k as mk + j and give j. -1 Rearrange 0c*4 - 2c4 + c4 + (6c + 11c + 2c - 4c)(30c*3 - 52c + 52c) to the form fc*2 + k + qc + pc4 + bc*3 and give p. 449 Rearrange -373 + 373 + 281i to q + zi and give q. 0 Rearrange (4u - 6u + 4u)(224 - 170 - 559) + 0u - u + 0u + 2 + u - 2 + (-4u - 2u + 5u)(4 + 2 - 4) to bu + q and give b. -1012 Express x*3 + 2 - 2 + (45x*3 - x - 84x*3 - 160x*3)(2 + 0 - 5) in the form jx3 + k + qx*2 + ox and give o. 3 Express -157q - 159q - 1726q in the form w + yq and give y. -2042 Rearrange -55p3 + 82p*3 - 28p*3 - 79p to the form dp2 + ap + yp3 + t and give a. -79 Rearrange 1 + 1 - 3 - 403z + 2 - 2 to the form t + lz and give t. -1 Rearrange (3z - 3 + 3)(-3z - 24z2 - 5 + 2z + 26z2)(6z - 3z - z) to vz4 + dz*2 + yz + sz3 + p and give d. -30 Express (2 - 1 + 7)(-4 + 6 + 23)(1 + 1 - 1)(3 - 7 + 2)(-5v + 5v - v2) as xv + u + wv2 and give w. 400 Rearrange (-5 + 1 + 5)(g - 1 + 1) - 53 - 32g + 34g + 378 to og + f and give f. 325 Rearrange (0w*4 - 2w4 + w4)(-4 + 0 + 2) + 75w*4 + 3 - 48w*4 - 62w*4 to yw*2 + gw + x + lw4 + zw*3 and give g. 0 Express 93 + 90 - 23z - 191 - z as j + gz and give g. -24 Express -2y + 3y4 + 2y - 17y4 + 165y*3 + 399y*3 + 16y4 + (y3 + 0y3 + y3)(2y + 4 - 4) as oy*4 + w + dy*2 + sy + uy3 and give o. 6 Rearrange (-3 + 0 + 1)(12 + 11 - 21)(-3 + 3 - 7)(0i - i + 0i) to the form zi + n and give z. -28 Rearrange -1391v*2 - 6733 + 6733 + (-2v - v + 2v)(-2v + v + 2v) to the form c + mv2 + qv and give m. -1392 Express -10z2 - 76z*2 - 71z*2 + (2z - 1 + 1)(-z + 0z + 2z) as x + qz + kz2 and give k. -155 Express 74z - 127z - 68z + 26z - 201z in the form w + mz and give m. -296 Express (-4v*2 - 9v*2 + 3v*2)(-11v + 3v + v) in the form kv3 + pv*2 + tv + w and give k. 70 Express ((3 - 5 + 3)(5 - 3 - 1) + 2 - 2 - 2)((x + 3x - 2x)(3 - 1 + 0) - x + 0 + 0) as h + nx and give n. -3 Express (0n2 - n2 + 3n*2)(5 + 4 - 5)(-23n + 37n + 26n) as tn2 + hn + mn3 + q and give m. 320 Rearrange 15k*3 - 3 - 18k*3 - 7 - 73k3 + 12 - k4 + 2k to lk*3 + u + pk*4 + qk*2 + ok and give l. -76 Rearrange -371l3 - 10l*4 - 1 + 371l*3 - 17l to jl + ul*4 + al*3 + ql*2 + k and give u. -10 Express (-105 + 181 - 159)((-3r + 6r + 0r)(3 - 2 + 0) + r + 2r - 2r) in the form or + p and give o. -332 Express 4u*4 - 5u4 - u4 + (-2u3 + u4 + 2u*3)(36 + 30 - 15) as yu + cu*2 + su*4 + gu3 + q and give s. 49 Express (y3 - 2y3 - 2y*3 + (0y*2 + 0y2 + y2)(2y + 5 - 5))(2y + 105y - 46y) as n + dy4 + qy*3 + ay + iy2 and give d. -61 Express (-55k + 56k + 86k)(-24 - 4k + 24) in the form tk + vk*2 + i and give v. -348 Rearrange (-3n + 3n - 2n)(7n + 57n + 9n) + 3n2 + 2n2 - n2 to the form sn2 + x + zn and give s. -142 Rearrange (2 + 3t - 4t - 3t)(29t2 + 54 - 53 - 174t*2) to lt*3 + gt + x + rt2 and give g. -4 Rearrange n - 2n + 27n3 - 26n*3 - 22 - n to jn*3 + sn*2 + f + gn and give f. -22 Rearrange 18o + 4 - 5 + 28 + 4 to the form wo + g and give g. 31 Express -a*4 + a + 115 - 117 + 0a*2 - 4a*2 + 0a*2 + 5a*2 as ga*3 + ca*2 + fa + u + ia4 and give i. -1 Express (8k*3 + 52k*2 - 52k*2 + (-5k + 2k + k)(4k2 - 2k*2 - 4k*2))(2k + 2k - 3k) as y + sk*2 + tk + rk3 + vk*4 and give v. 12 Rearrange 2j*4 - 30j - 11 + 46j - 16j - 2j2 to bj + xj3 + zj*4 + dj*2 + c and give z. 2 Express -1110c + 19 + 1007c - 24 as y + mc and give y. -5 Rearrange -2 + 4459c + 2c*2 + 3c*4 - 4457c - 8c2 + 7c*4 - 2c*3 to ic + r + ac4 + pc*3 + kc2 and give r. -2 Express (i2 + 0i2 + i2)(-1549i + 7i + 1087i - 768i - 2635i) as fi*2 + xi*3 + t + mi and give x. -7716 Rearrange -6c + 6c - 2c + 47 to the form nc + g and give n. -2 Rearrange (2 - 2 + 2k)(-3 + 3 + 2) - 1335k + 391198 - 391198 to dk + y and give d. -1331 Express (-1362m - 1356m + 75 + 2715m)(2 + 1 - 2) in the form fm + r and give f. -3 Express ((2 + 1 - 2)(1 + 1 + 1) - 1 - 3 + 3)(-i2 + 2i*2 + 0i*2)(-558 - 1068 + 614) in the form ki2 + pi + m and give k. -2024 Express 21f2 - 34f*2 + 5 + 0 - 34f*2 - 2 in the form tf*2 + df + y and give y. 3 Express (71 - 2h - 2h3 + 35 + h2 - 148)(-3 + 3 + 2 + (6 - 3 - 2)(-2 - 1 + 0)) in the form oh + d + xh*2 + nh3 and give o. 2 Express -33 - 20 - 60 - t4 + 2t3 - 17 + 2 in the form ct*4 + s + it*3 + gt*2 + ft and give c. -1 Rearrange (-w + 4w - 2w + 257 - 257 - 114w + (3 - 2 - 3)(-2w - 4 + 4))(w*2 + 0w*2 + 0w*2) to the form d + hw*2 + uw + mw3 and give m. -109 Rearrange -9p*4 - 32p*3 - 33p*3 - p + 63p*3 - 2 to the form np*3 + ip*2 + mp*4 + r + wp and give m. -9 Express (-l*2 - 2l3 + l2)(-1 + 2 - 2) - 2l + 11l3 + 325 - l2 - 325 - 11 + 11 - 7l*3 as gl*3 + ql + il2 + s and give g. 6 Rearrange 4y*2 + 5 + 2y*3 + 460y*4 - 462y*4 + 2y*2 + y to xy + m + sy2 + ny*4 + iy*3 and give m. 5 Rearrange (69 + 12s - s - 10s)(s - s - 3s) to the form c + qs*2 + ms and give c. 0 Express (-o + 2o + o + o4)(-1 + 1 + 12 + 1 - 2 + 3 + (-2 + 1 + 0)(1 - 3 + 0) + 4 + 0 - 2) in the form wo*2 + b + ko*4 + to*3 + ro and give k. 18 Express -238i4 - 3i*3 + 239i*4 - 57 + i + 10 + 0i in the form ri2 + ki + ci3 + u + ti4 and give t. 1 Rearrange (-d2 + 0d2 + 2d*2)(3 - 1 + 1) - 216d - 21d*2 + 216d to z + yd2 + ud and give y. -18 Express 86 + 34g2 - 12 + 809g*2 - 74 as dg*2 + xg + b and give d. 843 Express (3k + 13k - 12k + (2 + 0 + 3)(6k - k - 3k))(-1 - 1 + 1) - 1 + 1 - k as s + dk and give d. -15 Express -241 + 494 + 10g - 247 in the form x + tg and give x. 6 Express -151t2 - 126t*2 + 70t*2 - 462t*2 - 135t*2 in the form i + dt*2 + zt and give i. 0 Express 4 - 6 + 6s + 6 + 14 as o + qs and give q. 6 Rearrange (-5i + i3 + 5i - 1)(-7 + 0 - 6) to the form l + ki*3 + di*2 + xi and give k. -13 Rearrange (0h3 + 4h3 - h3)(-h + 0h + 2h) + (0h - 6h - 2h)(-3h*3 - 4h*3 + 0h*3) to kh*2 + dh + g + xh4 + lh*3 and give k. 0 Rearrange 70p - p*2 + 16 + 4p*3 + 73p - 141p - 6p*3 to the form c + yp + dp3 + lp*2 and give c. 16 Express -24p*4 + 0p*3 - 174p*2 - 2p*3 + 175p*2 - 32p*4 in the form a + np*4 + mp*3 + yp*2 + xp and give n. -56 Rearrange 2s3 - s + 203s*2 + 4s - 202s2 + 2 - 20s + s*4 to fs*2 + ks + js3 + p + ts4 and give t. 1 Express -55 + 95 + u2 + 4u - 47 as cu*2 + s + du and give d. 4 Express -1 - 14o3 + 61o - 114o + 53o in the form xo3 + m + uo*2 + ko and give x. -14 Rearrange 18 + 3t4 - 9t4 - t2 + 2t4 - 16 + 14t*3 to st*2 + xt + r + ft3 + it*4 and give r. 2 Rearrange (4631a - 2010a - 9778a)(-2a + 6a - 2a) to b + sa + ia*2 and give s. 0 Rearrange 276f*3 + 2f + 4 - 4f - 6 - 29f*3 to the form yf*2 + g + bf + tf3 and give b. -2 Express -3h*2 + 2h*2 + 4h*2 - 40 - 36 - 2h*2 in the form u + mh*2 + gh and give u. -76 Express 51b - 5 - 25b - 20b + 2b*2 as db + xb2 + y and give y. -5 Rearrange 0c*4 - 3c*4 + 0c*4 + (-2c + 2c - 8c*3)(-8c + 4c - 7c) to xc + pc2 + fc*4 + t + kc*3 and give k. 0 Express -3 + 4w + 0w2 + w2 + 3w + 31 - 3w in the form lw + mw2 + f and give m. 1 Rearrange 277m*2 - 276m*2 + 3m4 + 0 + 1 - m3 to the form um2 + nm*3 + zm*4 + sm + d and give z. 3 Express 2 + 13 - 4q - 8 + (-1 + 2 - 5)(-2q + 2q + q) + 0q + 2q + 0q as hq + z and give z. 7 Express -57t2 - 2t*2 - 13t2 + t2 - t + 3 as b + j	{ "pile_set_name": "DM Mathematics" }
, -802, -1258, -1816, -2476? -51o2 + 3o + 2 What is the o'th term of 8, 5, 2, -1? -3o + 11 What is the s'th term of 83, 165, 247, 329? 82s + 1 What is the d'th term of 13548, 13550, 13552? 2d + 13546 What is the h'th term of -54, -194, -428, -756? -47h2 + h - 8 What is the t'th term of -134, -489, -1066, -1859, -2862, -4069, -5474, -7071? t3 - 117t2 - 11t - 7 What is the i'th term of -10, -36, -64, -94, -126, -160, -196? -i*2 - 23i + 14 What is the s'th term of 25, 57, 99, 151, 213? 5s2 + 17s + 3 What is the l'th term of 66, 65, 64? -l + 67 What is the l'th term of -45, -42, -39, -36? 3l - 48 What is the j'th term of 565, 569, 577, 589? 2j*2 - 2j + 565 What is the x'th term of 173, 246, 317, 386, 453? -x*2 + 76x + 98 What is the a'th term of 2691, 5384, 8077? 2693a - 2 What is the f'th term of -7, -26, -75, -172, -335, -582, -931? -3f*3 + 3f*2 - 7f What is the w'th term of -120, -424, -930, -1638, -2548, -3660? -101w2 - w - 18 What is the z'th term of 60, 117, 162, 189, 192, 165? -z3 + 64z - 3 What is the r'th term of -197, -178, -159, -140, -121? 19r - 216 What is the x'th term of 549, 542, 535, 528? -7x + 556 What is the d'th term of 44, 46, 56, 80, 124, 194, 296, 436? d*3 - 2d2 + d + 44 What is the i'th term of -158, -161, -170, -191, -230, -293, -386, -515? -i3 + 3i2 - 5i - 155 What is the l'th term of 264, 528, 792, 1056, 1320, 1584? 264l What is the y'th term of 84, 169, 252, 333, 412, 489? -y2 + 88y - 3 What is the k'th term of 35, 67, 99, 131, 163, 195? 32k + 3 What is the q'th term of -46, -59, -80, -115, -170, -251, -364, -515? -q3 + 2q*2 - 12q - 35 What is the i'th term of 4, 15, 26, 31, 24, -1, -50? -i*3 + 6i*2 - 1 What is the f'th term of -7821, -15638, -23455, -31272, -39089? -7817f - 4 What is the l'th term of -52, -292, -962, -2278, -4456, -7712, -12262, -18322? -36l3 + l2 + 9l - 26 What is the o'th term of 536, 1071, 1606? 535o + 1 What is the l'th term of 768, 757, 738, 711, 676, 633, 582? -4l2 + l + 771 What is the q'th term of 25, 23, 37, 73, 137, 235, 373, 557? q3 + 2q2 - 15q + 37 What is the v'th term of -63, -252, -569, -1014, -1587, -2288, -3117? -64v2 + 3v - 2 What is the m'th term of -42, -41, -42, -45, -50, -57, -66? -m*2 + 4m - 45 What is the u'th term of -39, -42, -45, -48, -51, -54? -3u - 36 What is the o'th term of -6, -16, -38, -78, -142, -236? -o3 - 3o - 2 What is the s'th term of 1401, 1399, 1395, 1389, 1381, 1371, 1359? -s*2 + s + 1401 What is the b'th term of 530, 1061, 1592, 2123, 2654? 531b - 1 What is the k'th term of 7, 80, 285, 688, 1355, 2352? 11k3 - 4k What is the k'th term of -30, -22, -30, -66, -142, -270? -2k3 + 4k*2 + 10k - 42 What is the t'th term of 63, 125, 199, 291, 407, 553, 735? t*3 + 55t + 7 What is the k'th term of -256, -244, -232? 12k - 268 What is the k'th term of -125, -1010, -3409, -8078, -15773, -27250, -43265? -126k3 - k2 + 2 What is the u'th term of 607, 608, 609? u + 606 What is the l'th term of 2156, 2152, 2148, 2144? -4l + 2160 What is the t'th term of -15, -38, -65, -96, -131, -170? -2t*2 - 17t + 4 What is the r'th term of -170, -180, -200, -236, -294, -380, -500, -660? -r3 + r2 - 6r - 164 What is the z'th term of -415, -836, -1267, -1714, -2183, -2680, -3211? -z3 + z2 - 417z + 2 What is the i'th term of 1180, 1181, 1182, 1183, 1184, 1185? i + 1179 What is the v'th term of 291, 297, 315, 351, 411, 501, 627, 795? v*3 - v + 291 What is the o'th term of -82, -132, -176, -214, -246, -272, -292? 3o*2 - 59o - 26 What is the t'th term of 2402, 2404, 2410, 2420, 2434, 2452? 2t2 - 4t + 2404 What is the z'th term of 75, 153, 231, 309? 78z - 3 What is the c'th term of -39, -70, -129, -222, -355, -534, -765? -c3 - 8c2 - 30 What is the f'th term of 688, 689, 690? f + 687 What is the a'th term of 154, 155, 144, 115, 62, -21? -a3 + 8a + 147 What is the n'th term of -12059, -12060, -12061? -n - 12058 What is the b'th term of -499, -500, -501, -502? -b - 498 What is the v'th term of 1857, 1861, 1867, 1875, 1885? v2 + v + 1855 What is the x'th term of -42, -64, -80, -90? 3x*2 - 31x - 14 What is the q'th term of -46, -88, -116, -124, -106, -56? q3 + q2 - 52q + 4 What is the w'th term of 202, 402, 602, 802, 1002? 200w + 2 What is the v'th term of -64, -80, -86, -76, -44, 16? v3 - v2 - 20v - 44 What is the h'th term of 7, -7, -23, -41, -61, -83? -h2 - 11h + 19 What is the m'th term of 13, 23, 17, -23, -115? -3m3 + 10m*2 + m + 5 What is the h'th term of -56, -111, -166, -221, -276, -331? -55h - 1 What is the u'th term of -437, -448, -467, -494, -529? -4u2 + u - 434 What is the q'th term of -13, -35, -83, -169, -305, -503? -2q3 - q2 - 5q - 5 What is the m'th term of -39, -52, -19, 66, 209, 416, 693, 1046? m3 + 17m*2 - 71m + 14 What is the d'th term of 277, 274, 271? -3d + 280 What is the q'th term of -4, -29, -68, -121, -188? -7q*2 - 4q + 7 What is the j'th term of 3433, 3435, 3437, 3439? 2j + 3431 What is the z'th term of -91, -164, -213, -226, -191, -96? 2z*3 - 87z - 6 What is the y'th term of 3158, 3157, 3156? -y + 3159 What is the t'th term of 53, 92, 133, 176, 221, 268? t*2 + 36t + 16 What is the r'th term of 320, 312, 306, 302, 300? r*2 - 11r + 330 What is the c'th term of 16, -14, -64, -134, -224, -334, -464? -10c2 + 26 What is the v'th term of -709, -709, -707, -703? v2 - 3v - 707 What is the n'th term of -23, -43, -67, -95, -127, -163, -203? -2n2 - 14n - 7 What is the l'th term of 43, 79, 113, 145, 175, 203? -l*2 + 39l + 5 What is the t'th term of 316, 633, 950, 1267? 317t - 1 What is the u'th term of 19, 22, 13, -14, -65? -u3 + 10u + 10 What is the c'th term of -34, -89, -180, -307, -470, -669? -18c2 - c - 15 What is the v'th term of -180, -185, -190? -5v - 175 What is the o'th term of -4595, -4583, -4573, -4565, -4559, -4555, -4553? -o*2 + 15o - 4609 What is the q'th term of -45, -77, -107, -135, -161, -185? q*2 - 35q - 11 What is the x'th term of 41, 34, 15, -22, -83, -174? -x*3 + 42 What is the f'th term of -82, -162, -242, -322? -80f - 2 What is the m'th term of 701, 687, 665, 635, 597, 551, 497? -4m2 - 2m + 707 What is the a'th term of 9, 31, 67, 117, 181, 259? 7a2 + a + 1 What is the v'th term of -17, -25, -37, -53, -73, -97? -2v*2 - 2v - 13 What is the a'th term of -124, -247, -368, -487, -604? a*2 - 126a + 1 What is the p'th term of 8, 5, 2, -1, -4? -3p + 11 What is the i'th term of -135, -108, -71, -30, 9? -i3 + 11i*2 + i - 146 What is the j'th term of -1011, -1009, -1007, -1005, -1003, -1001? 2j - 1013 What is the x'th term of 16, 64, 142, 250, 388, 556, 754? 15x2 + 3x - 2 What is the a'th term of 34, 25, 26, 43, 82? a3 - a2 - 13a + 47 What is the i'th term of 5, 7, 7, 5? -i2 + 5i + 1 What is the q'th term of 3956, 7912, 11878, 15860, 19864? q3 - q2 + 3952q + 4 What is the r'th term of -73, -126, -177, -226, -273, -318, -361? r2 - 56r - 18 What is the g'th term of 2343, 2332, 2321? -11g + 2354 What is the t'th term of 6, -5, -34, -81? -9t*2 + 16t - 1 What is the v'th term of 4096, 4092, 4088, 4084? -4v + 4100 What is the l'th term of 2, 11, 26, 47, 74? 3l*2 - 1 What is the i'th term of -5, -20, -43, -74? -4i*2 - 3i + 2 What is the a'th term of -364, -365, -366? -a - 363 What is the s'th term of -42, -107, -186, -285, -410? -s3 - s2 - 55s + 15 What is the f'th term of 291, 304, 317? 13f + 278 What is the v'th term of 226, 225, 224, 223, 222, 221? -v + 227 What is the z'th term of 1227, 2457, 3687? 1230z - 3 What is the k'th term of -33, -23, -7, 15? 3k*2 + k - 37 What is the n'th term of -185, -754, -1703, -3032, -4741, -6830? -190n*2 + n + 4 What is the p'th term of -15, -171, -601, -1443, -2835, -4915, -7821? -23p3 + p2 + 2p + 5 What is the u'th term of 213, 405, 589, 771, 957? u3 - 10u*2 + 215u + 7 What is the y'th term of 1, 3, 11, 31, 69? y*3 - 3y*2 + 4y - 1 What is the q'th term of 3340, 3327, 3298, 3247, 3168, 3055? -q*3 - 2q2 + 3343 What is the h'th term of -3608, -7213, -10808, -14387, -17944, -21473, -24968? h3 - h*2 - 3609h + 1 What is the g'th term of -24, -46, -74, -1	{ "pile_set_name": "DM Mathematics" }
3 Collect the terms in 133r*3 - 1263r + 885r3 - 63r*3 + 1263r. 955r3 Collect the terms in 28h - 17990h2 + 63048h*2 + 41964h*2 - 28h. 87022h2 Collect the terms in -1098165 - 8216o*2 + 1098165. -8216o*2 Collect the terms in 71269q*2 - 143154q*2 + 71866q*2. -19q*2 Collect the terms in 41152s + 498401s + 122886s - 31409s. 631030s Collect the terms in 41772 - 83555 + 41783 - 27r + 16r. -11r Collect the terms in 390599a*3 + 390464a*3 - 781068a*3. -5a*3 Collect the terms in -3 + 276x + 300x + 3 - 896x + x*3 + 306x. x*3 - 14x Collect the terms in -3x2 + 6x*2 + 0x*2 + 4x*2 - 5x*2 + 426552x*3. 426552x*3 + 2x*2 Collect the terms in -390x*2 - 393x*2 - 375x*2 + 1554x*2 - 9 - 394x*2. 2x*2 - 9 Collect the terms in 1638v3 - 2 - v2 - 3275v3 + 2 + 1648v*3. 11v3 - v2 Collect the terms in -4 + 6128k + 3 - 6687k - 2 + 5. -559k + 2 Collect the terms in 1551l - 2 + 0 + 2 + 894l. 2445l Collect the terms in 13261725 - 12007d - 13261725. -12007d Collect the terms in 286734351 - 286734351 + 133c. 133c Collect the terms in -1924v + 5027v + 3505v + 3398v. 10006v Collect the terms in 1454462k*3 + 15k*2 - 34k*2 - 1454465k*3 - 35k + 19k2. -3k*3 - 35k Collect the terms in -2l3 + 3 - 873479l*2 - 3 + 3125700l*2. -2l*3 + 2252221l2 Collect the terms in -40086 - j2 + 80384 - 40298. -j2 Collect the terms in -l2 + 1107l3 - 365l*3 - 365l3 + l2 - 373l3. 4l*3 Collect the terms in -500o + 1504o - 510o - 519o. -25o Collect the terms in -16k2 - 127777k + 10k2 - 2k*2 + 127777k. -8k2 Collect the terms in -1483648o*3 + 2967266o*3 - 1483620o*3. -2o*3 Collect the terms in 64g*3 + 210g*3 - 8g*2 + 8g*2. 274g*3 Collect the terms in 8f + 5649239739 - 5649239739. 8f Collect the terms in -13207859 - 13207869 - 13207865 + 39623585 - 5q. -5q - 8 Collect the terms in 15 + 85p - 11 - 90p + 21 + 2. -5p + 27 Collect the terms in 0 - 53 + 4 - 434l + 49. -434l Collect the terms in -2876591 + 693h2 + 2876591 + 164h*2. 857h*2 Collect the terms in 15j + 2 + 0 - 27j + 3 - 4 + 15j. 3j + 1 Collect the terms in 214386p + 23p2 - 214386p + 3 + p3. p3 + 23p2 + 3 Collect the terms in -14q*2 - 1401530887q + 1401530887q. -14q*2 Collect the terms in 0z*3 + 9 - 2z*3 + 258z*2 - 3 - 6 - 90z*2. -2z*3 + 168z*2 Collect the terms in 33333z - 33332z + 6545 + 13122. z + 19667 Collect the terms in -338c*3 + 5 - 5 + 630c*3 - 307c*3 + 0. -15c*3 Collect the terms in 29 + 14n - 6n + 8n - 29 + 56n. 72n Collect the terms in -694b3 - 932b*3 + 886b*3 - 1252b*3. -1992b*3 Collect the terms in 29 - 17 + 24548l - 12. 24548l Collect the terms in -3 - 4 - 44654f*2 + 18f - 44654f2 + 89316f*2. 8f*2 + 18f - 7 Collect the terms in 7 - 32 + 856b2 - 3b - 272b2 - 295b*2 - 4b - 269b2. 20b*2 - 7b - 25 Collect the terms in -1 - 3569w + 1760w + 1783w. -26w - 1 Collect the terms in -4g + 15g*2 + 1 + 19g*2 + 1 - 7g*2. 27g*2 - 4g + 2 Collect the terms in 59z3 - 28z*3 - 22z*3 - 5059 - 24z*3. -15z*3 - 5059 Collect the terms in 30l + 28l - 90l + 12l + 30. -20l + 30 Collect the terms in 78467d + 165111d + 107567d - 71797d. 279348d Collect the terms in 1172167 - 1172167 - 1670d*3. -1670d*3 Collect the terms in 531413u2 + u3 + 521558u2 - 1052971u2. u3 Collect the terms in -2109996v2 - 2110000v*2 + 4219953v*2. -43v*2 Collect the terms in 5w + 2594w2 - 2770w*2 + 8w - 13w. -176w*2 Collect the terms in -9882817m*3 + 9882810m*3 + 2m*2 - 2m*2. -7m*3 Collect the terms in -83 + 263z - 82 - 6 + 14 - 4. 263z - 161 Collect the terms in 583g + 589g - 120g*3 - 1761g + 418g3 + 589g. 298g3 Collect the terms in 71 - 211 + 17578j*2 - 18303j*2 + 70 + 70. -725j*2 Collect the terms in 3674670387184 + 18l2 - 3674670387184 - l3. -l*3 + 18l*2 Collect the terms in 1123590n - 2259754n + 1136172n. 8n Collect the terms in -2 - 2652x*3 - 81x + 12x + 4x*2 + 2676x*3. 24x*3 + 4x*2 - 69x - 2 Collect the terms in 19630431 - 2p2 - 19630431. -2p*2 Collect the terms in 234 + 157 + 10t + 149 + t2 - 540. t2 + 10t Collect the terms in -63319334359i - 21i2 + 63319334359i. -21i2 Collect the terms in 31i - 33 - 6i - 9i - 7i + 4i*2 - 5i. 4i2 + 4i - 33 Collect the terms in -3994c3 - 4565c*3 + 860c*2 + 729c*2 - 1589c*2. -8559c*3 Collect the terms in -18 + 18 + 17231632x*3. 17231632x*3 Collect the terms in -7o - 12 - 11o - 18o + 13o + 12. -23o Collect the terms in 41m + 405m*2 - 41m - 751m2 + 289m*2. -57m*2 Collect the terms in -1203x*2 - 1209x*2 - 1216x*2 - 1204x*2 + 4819x*2 - 47x + 47x. -13x*2 Collect the terms in -6j + 537j3 - 372j*3 - 40j + 46j + 483j*3. 648j*3 Collect the terms in -1220173587 + 2317f + 1220173587 - 2314f. 3f Collect the terms in -32c2 - 177c*2 + 15c*2 - 3 - 37c*2 + 65c*2. -166c*2 - 3 Collect the terms in -f + 125f*2 - 129f*2 + 2741 - 331 + f. -4f*2 + 2410 Collect the terms in -182d*3 - 40968067109d*2 + 40968067109d*2. -182d*3 Collect the terms in -72 + 25 - 59k*2 + k + 40 + 21. -59k*2 + k + 14 Collect the terms in -9m*2 + 3248 - 3248 + 18m*2 + 12m*2. 21m*2 Collect the terms in 383m + 545m - 886m. 42m Collect the terms in 0k + 0k + 6467506k*2 - 6465889k*2. 1617k*2 Collect the terms in 26x*2 - 7x*2 - 13x*2 + 14008x + 14016x - 28024x - 4x2. 2x2 Collect the terms in b3 - 1673b + 547b + 548b + 578b + 139b2. b3 + 139b*2 Collect the terms in -13h*3 + 368641h + 368636h - 737277h. -13h3 Collect the terms in -85 + 85 + 8868c. 8868c Collect the terms in -242749632 + 242749614 + 6m*3 + 6m*3. 12m*3 - 18 Collect the terms in -138t*3 + 497225 - 497225 - 64t*3. -202t*3 Collect the terms in -110h*3 - 154h*3 - 12991117h + 12991117h. -264h*3 Collect the terms in 498g*2 + 2580986g - 2580986g. 498g*2 Collect the terms in -10833i*2 - 1269i + 1269i + 36813i*2. 25980i*2 Collect the terms in 0f - 389f3 + 1158f*3 - 379f*3 - 387f*3 + 0f. 3f3 Collect the terms in 895055d - 895032d - 41 + 41. 23d Collect the terms in -169q + 415837q*2 + 83q + 86q. 415837q*2 Collect the terms in 1225d*3 - 700d - 615d3 - 612d*3 + 23. -2d*3 - 700d + 23 Collect the terms in 2 - 907p3 - 2 + 249907p*2 + 901p*3 - 249907p*2. -6p*3 Collect the terms in -315126b*2 + 103405b*2 + 41b - 41b. -211721b*2 Collect the terms in -687819a*3 + 2 - 2717629a*3 - 2. -3405448a*3 Collect the terms in 50t - 185t + 41t + 35t + 51t. -8t Collect the terms in y2 - y2 + 16y*2 - 5y*2 + 133y*2 - 134y*2 - 8y*2. 2y*2 Collect the terms in -162o - 159o - 173o + 952o - 162o - 169o - 151o. -24o Collect the terms in 386 - 4q - 485 - 16q - 560. -20q - 659 Collect the terms in -1132156x - 324953x - 3 + 3. -1457109x Collect the terms in -2o + 1 - o + 56046677o2 - 56046685o*2. -8o*2 - 3o + 1 Collect the terms in -4c2 + 2366c + 2352c + 2350c - 7063c. -4c*2 + 5c Collect the terms in -44d + 122d - 95d + 35d. 18d Collect the terms in 889 + 1748 + 775 + 446 - g. -g + 3858 Collect the terms in 1040 - 3120 + 1039 + 370k + 1041. 370k Collect the terms in 1 - 78337c - 5 + 3 - 57416c + 2. -135753c + 1 Collect the terms in -1167k + 7054k + 749k + 1554 - 1554. 6636k Collect the terms in -10444 + 10444 - 45r2 - 51r*2 + 114r*2. 18r*2 Collect the terms in 29k*3 - 83k*3 + 26k*3 - 97k*2 + 39k*2 + 27k3. -k3 - 58k2 Collect the terms in 3h*2 - 44h*3 - 44h*3 + 133h*3 + 6047 - 6047 - 49h*3. -4h*3 + 3h*2 Collect the terms in -1047y + 2827y - 1782y. -2y Collect the terms in -92 - 91 + 287 + 15a - 95. 15a + 9 Collect the terms in 1 - 138s - 2 + 36s + 19s. -83s - 1 Collect the terms in 863i*3 - 773i*3 + 720i*3. 810i*3 Collect the terms in 1115q - 1487q - 4q - 860q - 1440q. -2676q Collect the terms in 12 + 3 + 430h - 1299h + 434h + 22 + 437h. 2h + 37 Collect the term	{ "pile_set_name": "DM Mathematics" }
he terms in -12124 - 12019 + 36238 + 2a - 12053. 2a + 42 Collect the terms in -960x2 + 69 + 59 + 15 + 960x*2 - 30x*3 + 31x3. x3 + 143 Collect the terms in -101 - 83 - 115 + 2k - 92 + 385 - 82. 2k - 88 Collect the terms in 70t - 37t - 21t - 154t - 41t. -183t Collect the terms in -2w2 - w3 + 118w*2 - 37w*2 - 17w*2 - 23w*2 - 16w*2 - 23w2. -w3 Collect the terms in 13588s - 40762s + 153s2 + 13587s + 13589s. 153s*2 + 2s Collect the terms in -10024n + 17979n + 25732n + 13288n + 30550n. 77525n Collect the terms in -2 + 759p3 - 6 - 391p*3 - 377p*3 + 5. -9p*3 - 3 Collect the terms in 9155g - 10294g2 - 18307g + 9152g. -10294g*2 Collect the terms in -27w + 77w + 623889w*2 - 623887w*2 - 34w. 2w2 + 16w Collect the terms in 846n + 1065n + 2718n + 475n. 5104n Collect the terms in 38g*3 - 194g*3 - 41g*3 - 2g*2 - 163g*3 - 39g*3 + 78g*3. -321g*3 - 2g*2 Collect the terms in 1580o*3 - 3175o*3 + 1 + 1510o*3. -85o*3 + 1 Collect the terms in -971230j*2 + 242784j*2 + 242784j*2 + 242788j*2 + 242878j*2. 4j*2 Collect the terms in 256 + 32 - 66 + 44 + 49b. 49b + 266 Collect the terms in 1344x*2 + 2651893x - 2651893x. 1344x*2 Collect the terms in -59 - 131 + 13585b - 6466b + 6136b. 13255b - 190 Collect the terms in -46p - 63p + 259p - 40p - 32p - 29p. 49p Collect the terms in -173z + 55z + z*2 + 118z - 1233z2. -1232z*2 Collect the terms in -63 - 343411f + 63. -343411f Collect the terms in -6902470x - 770x3 + 6902470x. -770x3 Collect the terms in -1585b*3 - 596b*3 + 784 - 784. -2181b*3 Collect the terms in 7s + 17810 - 8748 - 2s - 9062. 5s Collect the terms in -18n + 70n*2 - 101n*2 + 105n*2 - 5n*3. -5n*3 + 74n*2 - 18n Collect the terms in 238501258t2 - 238501175t*2 + 2 - 2. 83t*2 Collect the terms in -23g*2 - 18g*2 - 25g*2 - 16g*2 - 14g*2 + 79g*2. -17g*2 Collect the terms in 92g*2 - 11g + 122g2 + 4 + 156g*2 + 445g*2. 815g*2 - 11g + 4 Collect the terms in 418033k - 836077k - 82k2 + 418044k. -82k2 Collect the terms in 13 + 4824d + 6 + 10222d. 15046d + 19 Collect the terms in 351i - 90i + 73 + 22i2 - 146 - 261i + 73. 22i2 Collect the terms in 7615m - 2555m - 2510m - 2443m. 107m Collect the terms in 1 - 1 - 214493h2 + 214467h*2. -26h*2 Collect the terms in 762413067 - 4c - 762413067. -4c Collect the terms in -35w*3 - 42w*3 - 6w*3 + 78w*3. -5w*3 Collect the terms in -384882g + 1783931g + 1838928g - 29179g. 3208798g Collect the terms in 75 - 277 + 32 + 90 + 39 + 22b3 + 41. 22b*3 Collect the terms in -50852g*2 + 96258g*2 - 45403g*2. 3g*2 Collect the terms in -39532 + 349k + 351k + 129067 - 697k. 3k + 89535 Collect the terms in 749561p - 374828p - 374750p. -17p Collect the terms in -1 + 1 + 491696l + 678130l. 1169826l Collect the terms in -4198u3 + 1 + 2363u*3 + 1974u*3 - 1. 139u*3 Collect the terms in -7k + 37k2 + 11 + 40 + 9k + 15k2 + 35. 52k*2 + 2k + 86 Collect the terms in 7j3 + 5j*2 - 42 - 55 + 154 - 57. 7j*3 + 5j*2 Collect the terms in -78i - 3176059 + 7i2 + 3176058 + 78i. 7i2 - 1 Collect the terms in 2930 - 110289o + 220570o - 2930 - 110281o + 53o2. 53o*2 Collect the terms in 1407 - 136j - 2807 + 36j3 + 1400 - 31j*3. 5j*3 - 136j Collect the terms in -6499j2 + 2j - 3788j2 + 52j*2 + 4j - 6j. -10235j*2 Collect the terms in -1315n - 1027n - 3289n - 3077n. -8708n Collect the terms in 3135i + 10625i + 950i. 14710i Collect the terms in -244131u - 244859u + 488991u. u Collect the terms in 28z*3 + 15819 - 69z*3 - 31785 + 15966. -41z*3 Collect the terms in -207q*2 - 117q*2 - 72q*2 + 98q*2 - 316q*2 + 13q. -614q2 + 13q Collect the terms in 1 + 48s + 0 - 4 - 3 - 1070s + 6 + 1019s. -3s Collect the terms in -6r3 - 3r*3 - 57r*3 + 101r*3. 35r*3 Collect the terms in 88r*2 - 1030r*2 - 747r*2 - 27r*2 + 407r*2 - 1101r*2. -2410r*2 Collect the terms in -88 - 8k*2 + 12k*2 - 94 + 52 - 104. 4k*2 - 234 Collect the terms in 16t*2 - 539t*3 - 579t*3 - 20t*2 + 1722t*3 - 593t*3. 11t*3 - 4t*2 Collect the terms in -6d*2 - 3d2 - d2 - 988 + 11d2. d2 - 988 Collect the terms in 277k + 343k + 443k - 532k. 531k Collect the terms in -293121943456 + 20b2 + 293121943456 + 36b*2. 56b*2 Collect the terms in -119355f*3 + 395634 - 395634 + 119393f*3. 38f*3 Collect the terms in -169865985901v - 40v2 + 42v*2 + 169865985901v. 2v2 Collect the terms in -161q + 207q - 166q + 10q2 - 169q + 457q - 168q. 10q2 Collect the terms in 98c*2 + 101c*2 + 2c*2 - 291c*2 + 98c*2. 8c*2 Collect the terms in -5201b - 5148b - 5207b - 5210b + 20766b + 4b3 - 5b*3 + 0b3. -b3 Collect the terms in 5329234o2 + 5329327o*2 - 10658556o*2. 5o*2 Collect the terms in -3g*2 + 19543g*3 + 3g*2 - 64431g*3 + g. -44888g*3 + g Collect the terms in 8u*2 - 8u*2 - 37u*2 - 23u*2 - 1. -60u*2 - 1 Collect the terms in 66 - 159 + 93 - 85574d. -85574d Collect the terms in -5w*2 - 32w*2 - 4w - 779 - w*2. -38w*2 - 4w - 779 Collect the terms in -60503146y3 + 60503145y*3 - 6y*2 + 6y2. -y3 Collect the terms in -451v2 - 451v*2 - 77v*3 - 140v*3 + 1318v*2 - 416v*2. -217v*3 Collect the terms in 351v*2 + 352v*2 - 1063v*2 + 33 + 540 + 359v2. -v2 + 573 Collect the terms in -338 + 96 - 39l + 100 + 72 + 70. -39l Collect the terms in -134o - 140o - 454o + 826o - 100o. -2o Collect the terms in 52o + 29o + 39o + 26o + 51o - 221o + 47o. 23o Collect the terms in 0d2 - 721019d*3 + 240328d*3 + 240345d*3 + 0d*2 + 240348d*3. 2d*3 Collect the terms in 111 - 4y - 25 + 8y - 18 - 16 - 44. 4y + 8 Collect the terms in -10820 + 1109 - 7532 + 16v - 18v - 3405. -2v - 20648 Collect the terms in -112275t*2 - 8613 + 8613 + 56141t*2 + 56140t*2. 6t*2 Collect the terms in 1407g*2 - 323g*3 - 701g*2 - 706g*2. -323g*3 Collect the terms in -5l*2 - 14l*2 + 82l*2 - 11l*2 - 14l*2 - 21l*2. 17l*2 Collect the terms in -2958 - 2967 + 149l + 5910. 149l - 15 Collect the terms in -f - 118622 - 117560 + 236182. -f Collect the terms in 2 + 121734b - 6 + 264364b - 1. 386098b - 5 Collect the terms in 799358f3 + 2848541f*3 - 9 + 9. 3647899f*3 Collect the terms in -3 + 96153o + 96116o + 3 - 288385o + 96156o. 40o Collect the terms in 344m2 - 142m*2 - 139m*2 - 3302m. 63m2 - 3302m Collect the terms in -208w3 + 173w*2 - 173w*2 - 56w*3 - 612w*3. -876w*3 Collect the terms in -333h + 5263h - 4917h. 13h Collect the terms in -6 + 6 - 2603o + 4969o - 783o. 1583o Collect the terms in 401 + 158d*2 - 121 - 280 - 157d2. d2 Collect the terms in 2046m2 - 333m*2 - 1673m*2. 40m2 Collect the terms in -116514 + 230144 + s3 - 113630. s*3 Collect the terms in -907830c*3 - 29c + 2723404c3 + 29c - 907801c3 - 907816c*3. -43c*3 Collect the terms in 42b*2 + 41b*2 + 47b*2 + 40b*2 - 174b*2. -4b*2 Collect the terms in 150 - 3501x*3 - 47 + 6887x*3 - 51 - 52 - 3379x*3. 7x*3 Collect the terms in 26147x - 34267x - 108045x - 147330x. -263495x Collect the terms in 2355o3 + 18o + 12o + 21o - 51o - 2357o*3. -2o*3 Collect the terms in -5 + 13 - 36b - 921b2 + 934b*2 - 6. 13b*2 - 36b + 2 Collect the terms in -1623920 + 5j - 8j + 4j. j - 1623920 Collect the terms in -129168t*3 - t + 64652t*3 + 64596t*3. 80t*3 - t Collect the terms in 585886f + 266222f + 65 - 65. 852108f Collect the terms in -2p2 + 0 + 2 + 0 - 285p - 92p. -2p*2 - 377p + 2 Collect the terms in -10c3 + c + 151c*3 + 38421 - 38418 - c. 141c*3 + 3 Collect the terms in -9772y*2 - 7186y*2 + 1647y*2. -15311y*2 Collect the terms in 822752d*3 + 5d - 5d - 291575d*3. 531177d*3 Collect the terms in -145f*2 + 9f - 117f2 - 165f*2 + 528f*2. 101f*2 + 9f Collect the terms in -692520c3 + 345783c*3 + 344369c*3. -2368c*3 Collect the terms in 2g - 277347 + 92188 + 9	{ "pile_set_name": "DM Mathematics" }
2 - q + 2. Give -5k(h) + t(h). 2h3 - h2 + 286 Let j(b) = -b*2 - 472b + 2. Let o(g) = -2g - 1. Determine -j(w) - 2o(w). w*2 + 476w Let a(w) = 7w - 2. Let q(h) = -11h + 1. What is -5a(l) - 6q(l)? 31l + 4 Let a(u) = u2 + 2u - 1. Let k(m) = 5m2 + 10m + 52. Give 4a(x) - k(x). -x2 - 2x - 56 Let m(t) = 107t + 4. Let r(h) = -213h - 7. What is 10m(u) + 6r(u)? -208u - 2 Let w(l) = 2l. Let m(r) = r*2 - r. Let z be (-10 - -14) + (18 - 2)/(-1). Determine zm(i) - 6w(i). -12i*2 Let l(k) = 3k*2 + k + 9. Let w(b) = 13b*2 + 5b + 35. Determine -9l(d) + 2w(d). -d*2 + d - 11 Let c(s) = -4s - 2. Let x(j) = j - 1. Suppose -25 = 67y - 72y. Calculate yx(z) + c(z). z - 7 Let n(g) = -20g + 7. Let x(h) = 14h + 0h - 3 - h - 9h + 6h. What is -4n(i) - 9x(i)? -10i - 1 Let d(a) = 4171a*3 - 215a + 215. Let j(w) = 39w3 - 2w + 2. Determine -2d(q) + 215j(q). 43q3 Let d(u) = 2u*3 - 2u*2 - 5u - 6. Suppose 4w - 90 = -3f, 1 - 125 = -5w + 2f. Suppose 4k = -0k - w. Let l(b) = b + 1. Give kl(n) - d(n). -2n*3 + 2n*2 - n Let v(o) = -o. Let q(n) = -4n. Let r(h) = -2h. Let w(m) = -6q(m) + 14r(m). Give -3v(a) - w(a). 7a Let l(o) = o3 + 2o*2 + 4o - 2. Let b(a) be the third derivative of 8a2 - 17/24a*4 + 0a - 3/20a5 + 0 + 3/2a*3 - 1/24a*6. Give -2b(g) - 9l(g). g3 - 2g Let d(i) = 4i + 1. Let p(j) = -j2 - 4j. Let x = -633 - -635. Give xd(m) + 3p(m). -3m2 - 4m + 2 Let v(z) = -z*2 - 11z - 7. Let c(s) be the second derivative of -s*4/12 - 5s*3/3 - 3s*2 - s + 248. What is 7c(l) - 6v(l)? -l2 - 4l Let g(z) = 10z3 + 42z. Let x(n) = -4n. What is -g(y) - 10x(y)? -10y3 - 2y Let s(f) = f*3 - f - 3. Let x(b) = 105b*3 - 8b - 27. Determine 18s(p) - 2x(p). -192p3 - 2p Let q(b) = -107b - 3. Let f(s) = -108s - 3. What is -3f(x) + 2q(x)? 110x + 3 Let n(s) = -3s - 7. Let k(y) = -y - 1. Let t(m) = 4k(m) - n(m). Let q(d) = 5d - 16. Let l = 496 - 494. Give lq(p) + 11t(p). -p + 1 Let s be 104/65 - 2/(-5). Let p = -4 + 10. Let d be (-30)/44/p. Let v(o) = -6o - 4. Let z(a) = -3a - 2. What is dz(t) + sv(t)? 3t + 2 Let k(i) = -i - 1. Let j = 16 - 6. Let m(u) = 4u - 11. Let b be m(4). Let o(d) = jd - bd - 4d. Calculate k(h) + 3o(h). 2h - 1 Let r = 0 - 2. Suppose -7i = -14 - 0. Let u(q) = qi + 94 - 53 - 52. Let o(w) = 1. Calculate ru(l) - 22o(l). -2l*2 Let s(h) = -5h*3 + 2h*2 - 27h + 2. Let c(g) = -66g3 + 27g*2 - 351g + 27. Give -2c(d) + 27s(d). -3d3 - 27d Let w(b) = 3b - 2. Let v(l) = -101l - 17. Determine -2v(p) + 18w(p). 256p - 2 Let i(g) = 8g - 5. Suppose -3b + 17 = 5q, 0b + 3b + 19 = 4q. Let s be (-2 + q)3(-6 - -5). Let n(z) = -z + 1. Determine sn(t) - i(t). -2t - 1 Let l(w) = -w + 1. Let j(h) be the first derivative of h + 6. Let k be 1/4 + (-165)/(-44). Suppose -2 = 6b - kb. Calculate bl(u) + j(u). u Let z(k) = -288k + 7. Let n(y) = -863y + 22. What is -6n(m) + 19z(m)? -294m + 1 Let y(c) = -c2 + c. Let x(f) = -3f - 9f2 - 16f*2 - 4 + 28f*2 + 3. What is x(z) + 4y(z)? -z2 + z - 1 Let g(x) = x2 + 4x + 3. Let p(t) = 2t*2 + 11t + 8. Suppose -n + 11 = -2n. Let b be (-12)/((-6)/(-3)) - -10. Calculate bp(j) + ng(j). -3j*2 - 1 Let b = -9 - -5. Let v(a) = -4a*2 - 5a - 3. Let k(n) = 4n2 + 4n + 3. Let m(x) = 5k(x) + 4v(x). Let i(c) = -5c2 - 4. Determine bm(p) - 3i(p). -p2 Let w(h) = -h + 1. Let z(g) be the second derivative of -g4/6 + 2g*3/3 - 3g*2/2 + 6g - 1. Give 4w(d) + z(d). -2d*2 + 1 Let r(f) = 13f*2 - 8f - 1. Let s(y) = y*2 + y. Determine -r(l) - 6s(l). -19l2 + 2l + 1 Let y(x) = 51x + 9. Let t(w) = -5w - 1. What is 42t(g) + 4y(g)? -6g - 6 Let d(h) = -21h + 5. Let z(f) = 7f. Determine d(c) + 2z(c). -7c + 5 Let y(c) = -1. Let n(j) = j2 + j. Let w(l) = -l + 3. Let f(b) = -n(b) - w(b). Calculate f(q) - 3y(q). -q*2 Let r(j) = -4j*2 + 2j + 6. Let b(h) = -39h3 - h2 - 2. Let i be b(-2). Let y(f) = f + 153f*2 + 152f*2 + 1 - if*2. Determine r(g) - 2y(g). -2g2 + 4 Let r(i) = -15i*2 - 21i. Suppose -16 = -9x + 5x. Let y(b) be the first derivative of -b*3 - 2b*2 - 4. Give xr(n) - 21y(n). 3n*2 Let s(c) = -4c2 + c - 3. Let n be ((-4)/2)/((-1)/(81/(-54))). Let p(a) = -a2 - 1. Determine np(q) + s(q). -q2 + q Let w(z) = -4z*3 - 2z - 1. Let c(j) = -5j + 20 - 5j*3 + 4j*3 - 8j*2 + 16j. Let l be c(-9). Let d(u) = 3u3 + 2u + 1. Calculate lw(b) + 3d(b). b*3 + 2b + 1 Let y(t) = 16t3 + 4t*2 - 3t + 2. Let g(r) = r*3 + 2r*2 - r + 1. Calculate -2g(q) + y(q). 14q3 - q Let a(f) = -160f*2 + 2f + 1. Let c(w) = 802w2 - 11w - 5. Give 11a(p) + 2c(p). -156p2 + 1 Let z(a) = 3a*2 + 2. Let c(v) = 4v + 73. Let h be c(-27). Let r(l) = 50l2 + 35. Give hz(g) + 2r(g). -5g*2 Let y(h) = -10h + 21. Let k(o) = -12o + 22. What is -4k(x) + 5y(x)? -2x + 17 Let r(t) = 512t + 515t - 1019t + 3 - 3t*2. Let c(h) = -2h*2 + 7h + 3. Give -5c(s) + 4r(s). -2s2 - 3s - 3 Let q(i) = 51i - 4. Let y(j) = 46j - 2. Calculate -2q(o) + 3y(o). 36o + 2 Let k(s) be the first derivative of 5s - 76. Let j be (-5)/(-1 - 0/1). Let a(c) = -c + 11. What is jk(u) - 2a(u)? 2u + 3 Let d(n) = 4n - 4n - n + 2n. Let g(w) = -6w + 2. Let m(p) = -2p - 5. Let j be m(-5). Suppose -jh - 7 = -2. Determine hg(v) - 5d(v). v - 2 Let c(u) = 29u + 7. Let w(p) = -14p - 3. Determine 6c(m) + 13w(m). -8m + 3 Let p(d) = -21 - 11d + 7d - 11d. Let u = 427 + -429. Let z(w) = 3w + 4. What is up(y) - 11z(y)? -3y - 2 Let p(g) = 3g*3 + 5g + 4. Let q(w) = 4w3 + 7w + 4. What is 5p(r) - 4q(r)? -r*3 - 3r + 4 Let o be -3(-7 + 5)1/(-2). Let s(h) = -h + 1. Let r(a) be the first derivative of a*2 - 2a - 35. Calculate os(q) - r(q). q - 1 Let k(q) = 3156q + 13150. Let m(c) = c + 5. Calculate k(s) - 2630m(s). 526s Let h(i) = 4i - 8. Let g(d) be the first derivative of -d - 49. Let k = 14 - 13. Determine kh(l) - 8g(l). 4l Let m(u) be the third derivative of u*4/6 + 5u*3/6 - 72u*2. Let r(p) = p + 1. What is m(b) - 3r(b)? b + 2 Let v(d) = -9d + 6. Let g(c) = 14c - 10. What is -5g(b) - 8v(b)? 2b + 2 Let j(g) = g2 + g. Suppose 2 = 3r - 4r - 2u, 2r - 12 = 4u. Let w(p) = 2p2 + p2 + 0p*r - 4p*2 + 2p. Give -j(n) + w(n). -2n2 + n Let d(g) = 15g*3 + 9g*2 + 3g - 5. Let o(c) = -10c2 + 11c + 10c - 11c*2 + 8 - 26c + 7c2 - 23c*3. What is -8d(v) - 5o(v)? -5v*3 - 2v*2 + v Let s(g) = -16g*3 - 4g*2 - 6g - 7. Let a(c) = -15c3 - 3c*2 - 5c - 6. Suppose -20l + 117 = -3. Calculate la(t) - 5s(t). -10t*3 + 2t*2 - 1 Let l(d) = 21d*2 + 16d - 92. Let g(f) = 4f2 + 3f - 18. Determine 11g(j) - 2l(j). 2j2 + j - 14 Let h(o) = 10o + 30. Let v(d) = 7d + 20. Give -5h(f) + 7v(f). -f - 10 Let s(v) be the third derivative of v4/24 + 701v*2. Let a(j) = j - 4. Determine -a(b) - s(b). -2b + 4 Let h(x) = -4x + 2. Suppose -14s + 16 = -12. Let y(t) = 7 - s + 3t - 6. Determine 2h(g) + 3y(g). g + 1 Let m(k) = -162k + 16. Let c(f) = 108f - 11. Determine -7c(z) - 5m(z). 54z - 3 Let j(k) = 5k3 - 6k*2 - 6. Let w(y) = -94y - 88. Let p be w(-1). Let x(i) = 4i3 - 5i*2 - 5. Give px(z) - 5j(z). -z3 Let j(u) = -6074495u*2 + 33096u - 11032. Let i(f) = -2753f2 + 15f - 5. Determine -11032i(l) + 5j(l). -1379l2 Let u(b) = -184b. Let j(o) = 2o. Calculate -460j(d) - 4u(d). -184d Let d(w) = 2w2 + 2w - 4. Suppose -h + 20 = 4h. Suppose 2z + 2 = 4x + 14, x + 3 = hz. Let g(o) = o*2 + o - 1. Give xg(j) + d(j). -j*2 - j - 1 Let t(w) = -6w*2 + 6w + 2. Let a(g) = -5g2 + 5g + 1. Determine 5a(r) - 4t(r). -r*2 + r - 3 Let v(a) = -1. Let z(s) = 3s*2 - 10. Let c(d) = -24d + 313. Let g be c(13). Give gz(p) - 6v(p). 3p2 - 4 Let k(p) = 3p - 4. Let f be ((-65)/2)/52. Let j(y) = -6y + 8. Let i(o) = fk(o) - 6j(o). Let q(u) = 11u + 2u - 6u - 1 - 8. Calculate -5i(s) - 2q(s). s - 2 Let b(x) = x2 + x - 1. Let o(n) = 2n*2 + 2n - 3. Let r be ((-1)/(-3 - -2))/(4 + -3). What is ro(p) - b(p)? p2 + p - 2 Let z(i) = -2i3 + i2 - 3. Let h(n) = 2n3 - 2n*2 + n + 4. What is -3h(y) - 4z(y)? 2y*	{ "pile_set_name": "DM Mathematics" }
ress 1 - 114452z2 + 0 - 3z*3 + 114510z*2 as v + hz*3 + pz + tz2 and give v. 1 Rearrange -119n + n*2 + 254n - 16n3 - 85n to the form zn2 + g + tn*3 + in and give t. -16 Express -425o + 715 - 711 + 154o as x + zo and give z. -271 Rearrange -v + 0v - 35127 + 36276 + 3v to the form rv + n and give n. 1149 Rearrange 3287z2 + 3369z*2 - 7158z*2 + (3z + z - 5z)(0z - 4z + 6z) to y + tz*2 + nz and give t. -504 Rearrange 2a2 - 155 - 650 - 265 - a2 - 22 + a to b + ma*2 + oa and give b. -1092 Rearrange (43 - 27452k + 27430k + 0k2 - k2)(-6 + 2 - 1) to ok2 + a + fk and give f. 110 Rearrange -1209g2 - 1244g + 1244g + 2g2 + g2 - 5g2 + (2g + 0g - 4g)(5g - 3g + 0g) - 4 + 4 - g*2 to lg*2 + p + vg and give l. -1216 Rearrange (49 + 22 + 56)(-13b + 17b - 15b) to the form h + fb and give f. -1397 Rearrange (2297 - 7107 - 10284 - 5488 - 2275)(6t - 3t - t) to o + at and give a. -45714 Express (-9 + 5 - 5)(2359l - 1269l*2 - 2359l + (0 + 3 - 2)(2 - 2l*2 - 2)) as d + xl + bl2 and give b. 11439 Rearrange 3u - 1141u2 + 0u - 3u + 1173u*2 - 45 to the form z + tu + su2 and give z. -45 Express (-717s*4 - s - 15s*4 - 1111s*4)(0 + 4 - 5)(-1 + 2 + 1) as gs*4 + fs*2 + ks + js3 + a and give g. 3686 Express r2 - 2 + 2 + (r2 - 3r2 + r2)(-46258 - 45589 + 91132) in the form zr*2 + p + xr and give z. 716 Rearrange -69t3 + 117t*3 + 14055t*2 + 2909t*2 - 49t*3 to the form rt*3 + it + j + pt2 and give p. 16964 Express -3470 - 221n + 467n - 244n as d + rn and give r. 2 Rearrange -292f - 6368f + 77 - 13 - 62 + 761f + 2f2 to g + qf*2 + vf and give q. 2 Rearrange 10z2 - 13z*2 + 8z2 + z3 - 20 - 2z4 - z2 to p + cz*2 + qz*4 + rz*3 + dz and give p. -20 Express -892i + 707i + 108i - i2 + 656i + 1 as hi2 + f + zi and give f. 1 Express (2v - v + 0v)(-20 - 24 - 6)(5v - 3v + 0v)(4v - 9v + 4v) as zv*3 + kv + c + bv2 and give z. 100 Rearrange 114 - 346 + j + 99 + 113 - 3j + 4j2 to s + xj*2 + wj and give x. 4 Express -1138k - k4 - 437k - 2 - 1159k + (3 - 3 + 2k*2)(-3k - 2k*2 + 3k) as yk4 + t + ok*2 + mk*3 + vk and give o. 0 Rearrange -128r - 125r - 204 - 126r + 377r + (-3r + 4r + r)(1 + 1 - 4) to ar + y and give a. -6 Rearrange -9h + 1 - 7 + 7 - 2h*3 + 10h - 17h3 to the form ih*3 + lh*2 + y + vh and give i. -19 Rearrange -206p2 + 386p*2 - 205p*2 + 0p + 0p + 1 - 4p*3 to bp*2 + gp*3 + v + ap and give b. -25 Rearrange (-5 + 2 + 0)(4379n*4 - 1273n4 - 8701 + 8701) - n4 - 3n + 3n to qn + zn*4 + c + pn*2 + sn*3 and give z. -9319 Express -3349t + 922t - 4022t - 1789t in the form ft + c and give f. -8238 Rearrange (126g - 7652 + 7652)(-20 + 30 + 120 + 155 + 3) to the form n + sg and give s. 36288 Rearrange 142r*2 + 7r*4 - 3 + 2r*3 + 3 + 2r - 143r2 to sr*2 + mr + c + wr4 + ur*3 and give w. 7 Rearrange (521u*2 - 1949u*2 - 2031u*2)(u*2 + 2u*2 + 0u*2) to vu*4 + m + wu + ru3 + du*2 and give v. -10377 Express -252y - 169y + 104y + 4 + 10 - 6 as fy + u and give u. 8 Express -3 - 183g + 8 + 165g - 5 + 171g*2 in the form jg*2 + lg + p and give l. -18 Express -276f2 + 825f*2 - 277f*2 - 14f - 276f2 + 30 + 2f*3 + 0f in the form bf + af*2 + o + pf*3 and give o. 30 Rearrange 7b + 14b + 21b + 14b - 58b + b*2 - 445 to the form k + ob*2 + db and give o. 1 Rearrange 4704b + 5921b + 457b - 1518b + 1162b to the form ib + q and give q. 0 Express -10v4 - 67v*2 + 4v*2 - 2 - 2v*3 + 49v2 + v4 - v + 7v2 in the form qv*3 + kv + sv4 + zv*2 + f and give f. -2 Rearrange (2 - 2 + d)(-1 - 1 + 3) + 2d + 25d + 16d - 5d + 24d - 3d to b + id and give i. 60 Rearrange -59r*2 + 2770 - 6r - 3r2 - 2770 - 19r*2 to f + dr*2 + kr and give k. -6 Express -v*4 + 0v*4 + 10v*2 + 14v + 2 - 4v2 - 4 - 18v in the form g + mv4 + fv*3 + iv + uv2 and give i. -4 Express -5 + 0 - 299u - 5 + 39u + 24 in the form s + tu and give s. 14 Rearrange (-4 - 4 + 1)(-12027p + 16 - 1122p - 108 + 80 + 13) to i + up and give u. 92043 Rearrange (-8t - 5t - t - 2t - 898 + 20t)(-2t - 4t + 5t) to xt + gt*2 + v and give g. -4 Rearrange 0b*3 + 0b*3 - 1 - 43b*4 + 35b*4 - 78b*2 + 4b*3 + 7b*4 to the form hb*4 + kb*3 + j + qb + gb2 and give k. 4 Rearrange -3p*4 + 15 - 15 + (4p*3 + 6p + 10p3 - 4p*3)(-5p + 6p + 0p) to the form gp + v + op4 + xp*3 + up2 and give u. 6 Express -q3 - 4q4 + 6q*4 + 325q*2 - 291q2 - q3 + 2 as xq2 + p + bq*4 + iq + hq3 and give x. 34 Rearrange -3t - t + 3t + (-3 + 2t + 3)(-396 - 104 - 131) - 5t + 0t + 3t to w + zt and give z. -1265 Express 1407f + 1023f + 744f*3 - 742f*3 in the form z + tf*3 + vf*2 + qf and give q. 2430 Rearrange 8 - 32706q3 - 5q*2 - 32709q*3 + 5q*2 + 6q + 65409q3 to kq*3 + uq*2 + hq + o and give k. -6 Rearrange (-43 + 24 + 203 + (-4 + 3 - 3)(0 + 0 - 2))(4 + 3l - 4) to dl + f and give d. 576 Express (92 + 39m - 92)(0 - 2 + 0)(-m2 - 22 + 0m*2 + 10085m - 10086m) as hm + i + ym2 + tm*3 and give y. 78 Express -15307 + 1551 - 5823 + 2854 + 2k - 10581 in the form c + bk and give c. -27306 Rearrange (0a*2 + 0a*2 - 5a*2)(-25a2 - 407a + 17a + 23a*2) to the form ya*3 + n + ra*4 + ia + sa2 and give y. 1950 Express 5725d + 6325d + 15593d + 11512d as b + gd and give g. 39155 Rearrange (-r*3 + r - r)(-4461 - 1685 - 31 - 2543) to the form a + xr + cr*3 + nr*2 and give c. 8720 Rearrange ((0 - 1 + 2)(3 + 0 - 2) + 0 - 4 + 5 + 3 - 8 + 2)(-5w - 33w - 6w) to rw + f and give f. 0 Express 16n*4 + 4n*2 - 28n - 397 - 17n4 + 394 - 18n + 4n as vn + dn4 + c + on*3 + jn*2 and give d. -1 Express 7059t - 974t + 3227t + 4899t + 477t as at + r and give r. 0 Express 77n - 132n + 9 + 15 + 5 as v + sn and give s. -55 Rearrange 53u3 + 2339u*2 + 19u - 2339u2 + (-4u + u*3 + 4u)(1 + 1 - 1) to the form iu + qu3 + du*2 + x and give i. 19 Express 250 + 285 - 470 - 2l + (-1 - 61l + 8l - l)(1 - 2 + 0) as rl + t and give t. 66 Express 1426l - 2871l + 1435l - 166 + 45 as b + hl and give h. -10 Rearrange 205544j - 579j*2 - 205544j + (-1 + 3 + 10)(-j2 + 2j2 + j2) to r + lj2 + dj and give l. -555 Rearrange (3 - 2 - 2)(-q3 + 2q*2 - 2q*2) + (-3 - 7 - 7)(-q + 2q + 0q)(q2 - 2q*2 + 10q*2) to the form rq*3 + jq*2 + bq + g and give r. -152 Rearrange -4j2 + 235j - 237j - j2 - 244 + 461 - 16j*2 to c + ij*2 + xj and give x. -2 Rearrange -186 + 711v3 + 102 - 703v*3 to the form zv + cv2 + j + bv*3 and give j. -84 Express 414u - 794u - 27u - 405u - 1033u in the form hu + b and give h. -1845 Rearrange -625 + 626 - 1179c + 2343c + 3056c to the form b + oc and give b. 1 Express 7o*2 - 317o*3 + 308o*3 - 10o*2 + 3o*3 - 5o*3 + 0o*3 + (1 + 0 - 3)(o*3 + 3o*3 - 2o*3) as wo*2 + qo + to3 + r and give w. -3 Express 2y - y*2 + 1971 - 57y*4 - 2096 + 56y*4 in the form l + ky*4 + my*2 + vy*3 + dy and give l. -125 Express 3117o + 4862o + 2755o in the form ro + m and give r. 10734 Rearrange 24 + 2 - 16 + 5m3 - 4m*3 + 22m*2 - 27m + 23m to the form om + ym2 + im*3 + x and give y. 22 Rearrange (-5m + 5m + 2m*2)(0 + 1 + 0)(5m - 3m - 4m) + (0 - 3 + 0)(-45m*3 + 36m*3 - 184m*3) to km*3 + fm + gm2 + h and give k. 575 Express -130i - 374i + 203i - 258i as di + t and give t. 0 Rearrange 94l3 + 82l*3 - 197l*3 + l + 18l to the form pl2 + g + tl*3 + vl and give v. 19 Rearrange -1007 + 1007 - 114m4 + (-14 - 29 - 1)(-2m4 + 0m*4 + 3m*4) to the form dm*3 + vm*2 + l + wm + cm4 and give c. -158 Rearrange 42z*2 - 5z*3 + 0z*3 + 6z*3 - 3z*3 to the form d + mz*3 + nz*2 + lz and give n. 42 Express 3772o2 + 1903o*2 + 457o*2 - 2o2 - 3 + 3 - o2 + 4o - 4o + (3o + o - 3o)(2o - 4o + 0o) - o*2 + 1 - 1 as u + to + po*2 and give p. 6126 Express (-	{ "pile_set_name": "DM Mathematics" }
d Find the second derivative of -89j*4 - 14j*3 - 3j*2 + 606581j wrt j. -1068j2 - 84j - 6 Find the second derivative of 43a5 - 752a*3 - 38626a wrt a. 860a3 - 4512a Find the third derivative of -a*3jv2 - 102611a*3v*3 - 34a*2jv3 + 6a*2 + 5ajv + 126j wrt a. -6jv2 - 615666v*3 What is the derivative of 2fjx + fx + 7251f - 11jx + 2667j - x + 1 wrt j? 2fx - 11x + 2667 Differentiate 2n4r - 18n4 - 216nr + 2r - 129757 with respect to n. 8n3r - 72n3 - 216r What is the first derivative of -23643h3 + 2h*2 - h + 275708? -70929h*2 + 4h - 1 What is the second derivative of 21qy*3 - 52772qy + 7y*3 + 6y*2 wrt y? 126qy + 42y + 12 What is the second derivative of 348883k2 - 337k - 267? 697766 Find the third derivative of 645q2w*4 + 11q*2w*3 + 50q*2 + 2qw3 + 124w*2 wrt w. 15480q*2w + 66q2 + 12q What is the third derivative of 252033t5 + 216695t*2 wrt t? 15121980t*2 What is the second derivative of -102401jw2 - 65698jw wrt w? -204802j Find the third derivative of -339190w4 - 16451w*2 - 37. -8140560w What is the second derivative of -75920t2 - 297429t wrt t? -151840 Find the third derivative of 41399i5 + 1167i*2 - 149i wrt i. 2483940i2 Find the second derivative of 25941m*4 + 900m + 22. 311292m2 What is the first derivative of -2721p*3x*3 - 115p*2x*3 + 771x*3 + 544 wrt p? -8163p*2x*3 - 230px3 What is the second derivative of 2010w*3x*2 - 15746w*3 - 4wx wrt x? 4020w*3 What is the third derivative of -89212u5 + u4 - 146041u2? -5352720u*2 + 24u Find the third derivative of -r*5 + 122r*4 + 7r*3 - 53646r*2. -60r*2 + 2928r + 42 Find the second derivative of -5952z3 + 2z*2 - 29412z. -35712z + 4 Differentiate 1155940gj3m - 2g - 187574j*3 with respect to m. 1155940gj3 Find the third derivative of -27076p*3 + 15p*2 - 100p - 2 wrt p. -162456 Find the third derivative of -17141b3 - b2 + 280b - 3 wrt b. -102846 Differentiate -dis - 184269di - 31d - 3s + 8818 with respect to i. -ds - 184269d What is the derivative of -1648754x3 + 2549640 wrt x? -4946262x2 What is the second derivative of -g5 + 23g4 + 479g*2h + 13gh - g + 184h wrt g? -20g*3 + 276g*2 + 958h Find the third derivative of 4y6 + 287771y*5 + 2101746y*2. 480y*3 + 17266260y*2 Differentiate 23774bq - 28b - 357 wrt q. 23774b What is the second derivative of -f2v*2 - 18f*2v - 187fv*2 - 138v*2 - 3631 wrt v? -2f*2 - 374f - 276 Find the third derivative of 25958i6 + i2 - 23i + 217 wrt i. 3114960i3 What is the second derivative of 277562u*2y2 - u2y - 3u*2 + 324uy - u + 2 wrt y? 555124u*2 What is the second derivative of 55710s*3v*2 + 12s*3 + 3sv - 658v*2 + v - 25 wrt s? 334260sv2 + 72s What is the third derivative of -9x6 - 10633x*4 + 298x*2 + 2x - 7? -1080x3 - 255192x Differentiate -2824984y + 3313644. -2824984 Find the second derivative of -3u*2v*3 - 820u*2v + 5729uv*3 + 36v wrt v. -18u2v + 34374uv Find the second derivative of 2040086c3d*2 + 4c*3d + 24c3 - 6c*2d - d - 6 wrt d. 4080172c3 What is the third derivative of 546365p*5 - 70603p*2? 32781900p*2 Differentiate 50231m3 - m2 - 210242. 150693m2 - 2m What is the third derivative of 5c5w*3 + 2088c*3w*3 - 13c*2w*2 - 2cw3 - 6c + 2w3 wrt c? 300c*2w*3 + 12528w*3 Find the first derivative of 150l*2rv2 + 7l*2r - l*2v*2 - 3lr - 7v*2 + 188v wrt r. 150l2v*2 + 7l*2 - 3l What is the third derivative of -742b2q*3y - 6b2q*3 + 2b*2q*2y - b*2q*2 + 5q*3y - 66011q2y wrt q? -4452b2y - 36b2 + 30y Find the first derivative of 4d3o - d*3z - 2d2yz - 2d*2 - dyz2 - 7oyz + 413oz*2 - 5z*2 wrt o. 4d*3 - 7yz + 413z*2 Differentiate 72055bj - 31568j with respect to b. 72055j Find the second derivative of -2622p*3u - p3 - p2u + 640pu - p + u - 6 wrt p. -15732pu - 6p - 2u Find the second derivative of 605s*4 + 21s*3 - 2s*2 + 1287s - 24 wrt s. 7260s2 + 126s - 4 What is the third derivative of 3090gy*3 - 153gy2 - 92gy - y3 wrt y? 18540g - 6 What is the first derivative of -3gk + 2079g + 4532k*4 + k wrt k? -3g + 18128k3 + 1 What is the second derivative of -12418ac2d*3 + 36521acd*3 + 3cd - d3 wrt c? -24836ad3 Find the first derivative of 2t*4 - 9t*3 + 2391t*2 + 1839566 wrt t. 8t*3 - 27t*2 + 4782t What is the third derivative of -60w3y*2z + 10226w3z + 11w2yz - wy*2z + 10121wyz wrt w? -360y*2z + 61356z Find the second derivative of -14005h*2r - 1518hr - 2r - 3 wrt h. -28010r What is the second derivative of -67463p3 + 54479p? -404778p Differentiate -792576s - 1604563. -792576 What is the second derivative of fn2 + 2fn + 12052n*2 + 98310n wrt n? 2f + 24104 What is the third derivative of -754t*5 - 37t*4 + 4t*3 - 3039789t*2 wrt t? -45240t*2 - 888t + 24 What is the third derivative of -302hu*4y + 2hu*2 - 13h + u*5 + 226u*3y - u*2y + 6u2 - 2u + 44y wrt u? -7248huy + 60u2 + 1356y What is the third derivative of -34081d4 - 30408d*2? -817944d Find the third derivative of 7v3z*3 - 1692v*3 - 26v*2z*2 - 2vz - 30z*4 - 8z*3 wrt z. 42v*3 - 720z - 48 Find the third derivative of 15381u4 + 28232u*2 - 2. 369144u What is the derivative of 5g2l*2 + 88g*2l - g*2 + 205gl2 + 3409998 wrt l? 10g*2l + 88g2 + 410gl What is the third derivative of 1344b*2p*3w*2 - 2b*2p*2w + 2b2p*2 - 17b*2w*3 + 22bp3w*3 - 15bpw + 1 wrt p? 8064b2w*2 + 132bw3 Find the second derivative of -2c*2n*2 + 182c*2 + 3cn2 + 10cn - 298n*2 wrt n. -4c*2 + 6c - 596 What is the third derivative of 190870n4 - 451222n*2? 4580880n What is the first derivative of -1052219b4 + 3164506? -4208876b*3 Differentiate 702b*3h*2 - 3b*3 - 7b*2h*4 + 94b - 2 with respect to h. 1404b3h - 28b2h*3 Differentiate 83606z*2 + 2z - 353718 wrt z. 167212z + 2 Differentiate -70g*3h - 4g3 + 43g*2h - 47911g wrt h. -70g*3 + 43g2 Find the third derivative of o5s + 202927o*5 - 3o*2s + 2o2 - 2os + 27s wrt o. 60o2s + 12175620o2 What is the third derivative of -25x*6 - 43x*5 + 2x*3 - 4x*2 + 15x - 13 wrt x? -3000x3 - 2580x*2 + 12 Find the third derivative of 625n*5 - 2n*4 + 6n*3 - 6n*2 + 2465n wrt n. 37500n2 - 48n + 36 What is the derivative of 195960h3 - 236789 wrt h? 587880h*2 What is the first derivative of 12r*4 - 11r*2 - 4r + 41085? 48r3 - 22r - 4 What is the second derivative of -a*3f + 50817a3 - 2a*2 + 54af + 8a - 24f wrt a? -6af + 304902a - 4 Find the third derivative of -290062c6m - 560c2 - 11m - 4 wrt c. -34807440c3m What is the second derivative of 372390o2uz3 + 2ouz*2 + 3151oz3 - 9uz2 wrt o? 744780uz3 What is the third derivative of 28572i*3 + 13i*2 - 1112i wrt i? 171432 Differentiate -4m3 + 18885m - 101145. -12m2 + 18885 What is the third derivative of -20318c*2f*3 - 2c*2f*2 - 20607c*2 - 12f*3 wrt f? -121908c*2 - 72 Differentiate -3mpz + 2mp - 4mz + 1962m + 8041pz - z + 1 wrt p. -3mz + 2m + 8041z What is the third derivative of -103097a*3 + 2a*2 - 1732a + 21 wrt a? -618582 What is the second derivative of 73479h4y2 + h4y + 1990hy2 - 32h wrt h? 881748h2y*2 + 12h*2y Find the third derivative of -120126s3 + 16s*2 + 4s - 254. -720756 What is the third derivative of 1670084i3 + 2i*2 + 574839i? 10020504 Differentiate 2h4 + h2 + 52360h + 4185574 with respect to h. 8h3 + 2h + 52360 What is the derivative of -47411fv*3 + 77674f + v wrt v? -142233fv*2 + 1 What is the derivative of -109690a*4 + 24717 wrt a? -438760a*3 Differentiate -4t*2 + 45735tx2 - 33594x*2 - 4x with respect to t. -8t + 45735x*2 Find the third derivative of 12b*3u4 - b3u + 3339b	{ "pile_set_name": "DM Mathematics" }
+ -0.7011. Is k smaller than q? True Let c(p) = -p*2 + 15p - 9. Let x be c(14). Suppose q + 3 + 1 = 5z, -2z + xq = 3. Let a = 6/7 - 2/35. Which is smaller: z or a? a Let l(q) = 2q*2 + 9q - 61. Let m be l(29). Is 1883 less than m? False Let k be (630/420)/((-3)/(-2)). Is 6/179 greater than or equal to k? False Suppose -2u + 151z - 158 = 147z, -3u - 4z = 177. Is u > -269/4? True Let i = -2/5467 + 827/125741. Is i at least 0.032? False Let g = -195 - -194. Let p be (-126)/6212/(-7). Is g at least as big as p? False Suppose 4l + 37832 = 4v, -l - 15583 = -5v - 6121. Is 2/9 <= l? False Suppose 8c + 11c - 4x + 28664 = 0, 5c - x = -7543. Which is greater: -1503 or c? -1503 Let v be (-1 - 68/(-64))(52 - 36). Which is bigger: v or 8/1231? v Let t = -131.13 - -158.42. Do t and 0 have the same value? False Let u = 4387 + -4388. Let y = 9389/51 - 184. Which is smaller: u or y? u Suppose 7p + 49877 = 46650. Is p equal to -3228/7? False Let y be (4 - 2 - 2)/(-23 - -28). Is -2/7165 less than y? True Let c = -0.0342 + 405.0342. Let g = c - 404. Is -83 smaller than g? True Suppose 3v = 4r - 0r + 44, 5v - 25 = -3r. Suppose vi - 2b + 2 = 3i, 5b = -5i + 5. Suppose 7x + 5x - 288 = i. Is x equal to 24? True Suppose 0 = -4a - 5h + 8 + 34, -3a = h - 26. Suppose 0 = -3x + 4x - 4. Suppose a = -4y + 3f + f, -xf + 8 = -y. Which is smaller: y or 4? y Let i(t) = 2t*2 + 96t + 456. Let j be i(-44). Which is smaller: 94 or j? 94 Let n = -6 - -28/5. Let h = -6817.771 - -6815. Let s = h - -0.071. Is n at most as big as s? False Let a = -202.5 + 193.5. Let p = -32 - -32. Which is bigger: a or p? p Suppose 173843 - 38452 = -27k - 245444. Which is greater: k or -2/7? -2/7 Let f = 1.05 - 1.18. Suppose -2s - s - 13 = 2v, -v = -3s - 7. Which is greater: f or v? f Suppose 14 = -4n + 34. Let x be (1(-117)/(-6))/(6/(-40)). Let h be 6/10x/(-18). Is n > h? True Let n = -157 - -155.67. Let o = 3.33 + n. Which is smaller: o or 25? o Let v = 0.4189 - -0.0551. Let s = -0.044 + v. Let u = -0.43 + s. Is 1/9 at least u? True Let m = -27 - -42. Let i be (m33/27)/((-1)/(-3)). Let d = -72 + i. Is -19 at least d? False Suppose -34o + 39o - 25 = 0. Suppose -180 = oi - 85. Is i >= -20? True Let v be (20244/10)/(-7)(-5)/(-2). Let u = v + 22433/31. Does u = 0? False Let g = 10 - 4. Let o(y) = -217y - 1296. Let a be o(-6). Is g <= a? True Let f(w) = w3 + 18w*2 - 40w - 1. Let a be f(-20). Let i be a/(((-1)/7)/(-1)). Which is smaller: i or 2? i Suppose 5i + 7x - 6x - 3 = 0, 14x + 31 = 3i. Is -12/293 < i? True Let u = -0.3 - -1.3. Let t = 0.92 - u. Let w = 8863 + -8860. Which is greater: t or w? w Let d be (-4)/(-30) - -2(-12 + 3043/255). Which is greater: 10/8389 or d? 10/8389 Let y(t) = -84t - 292. Let w be y(-33). Is 2480 not equal to w? False Let g = -267/4370 - -4/115. Let b = 176 - 176. Suppose -8o + 5o + f = 8, 2f - 10 = b. Is o greater than g? False Let u(k) = -k*3 + 4k + 2. Let s be u(-2). Let n be (1 + s)(-7 - 242/(-33)). Which is greater: -80/11 or n? n Let c be 2/16 + (-696779)/(-1224) - 8/(-18). Which is bigger: 569 or c? c Let g = 1686 + -3067. Which is bigger: -1370 or g? -1370 Let t = 22793.2 + -22793. Are 0.06719 and t equal? False Let p = 1361/465 - -44/93. Let i be 2((-2)/(-4) - 1). Let r be i/(((-4)/6)/2). Which is smaller: r or p? r Let l = -11 + 37. Suppose -a + 12 = -r - l, 0 = -5r + 4a - 190. Let s = r + 31. Do s and -23/4 have different values? True Let b(l) = 7l2 - 8l + 15. Let a be b(3). Suppose 0 = az - 49z - 5. Let x be (3 - (22/8 + 0))/(-17). Which is smaller: z or x? x Let m = 32.31 - 0.31. Let k = m + -33. Let j = 3 + k. Which is smaller: -1/7 or j? -1/7 Let v = 61 - -190. Let n(l) = v - 128 - l - 135. Let c be n(-17). Which is smaller: c or 52/9? c Let j = 4658 + -4658. Is j < -0.042? False Let i = 3102.3 - 3093.3. Let v = 14 - 9. Suppose -4 = 3f + v. Do f and i have the same value? False Let s = 0.049 + 11.751. Let r = s - 8.8. Let a = 8 + -7. Which is bigger: r or a? r Suppose 3g = 3s - 15, -4s + 24 = -5g + 4. Let c be 0 + 3 + g - (-1100)/(-374). Is c <= -1? False Let u = 10176 - 8897. Which is smaller: 0 or u? 0 Let r = 31.1 - 5.1. Let i = r - 24.1. Let d = i - 1.2. Do d and -2 have different values? True Let v = 1640/11 - 8178/55. Are v and -86 unequal? True Let m = -1882 - -1880. Are -7.11 and m nonequal? True Let u(h) = -h3 - h2 + 17h + 17. Let d be u(-1). Which is greater: d or -13/254? d Let d = -9.2 + -4.9. Let q = -14.1 - d. Let p = 21 + -13. Is p not equal to q? True Let v(k) = -28k - 648. Let l be v(14). Is -1040 greater than l? False Let o be (6 + 8 + -14)25/(-50). Let b be 158/112 - 2/7. Which is greater: o or b? b Suppose -k = 3h + 9, -232k = -235k + 9. Is h smaller than 0.25? True Let p be ((-4)/((-12)/(-5)))/((-10)/12). Let z be (p/(-7))/((-154)/98). Suppose -4y + 9y = -5. Is z < y? False Suppose 1854 = 6t - 1692. Let x = t - 588. Which is smaller: 116 or x? x Suppose -257 - 17 - 38 = -2s. Let u = 2925/38 - 30843/133. Let o = s + u. Which is smaller: 1 or o? 1 Let i = -9.19 - -9. Let x = -14.81 + i. Let d = -9 - x. Which is smaller: -1 or d? -1 Suppose -12o - 2331 = 981. Let g be (12/8)/((-9)/o). Let l = g + -19. Is l less than 29? True Let c(s) = -2s2 - 158s - 628. Let m be c(-72). Are 380 and m nonequal? False Let l be 56/21 + -3 - 1/(6/2782). Are l and -464 equal? True Let j be (2484/(-48) - 5)/(-1 + 0). Are j and 0.06 nonequal? True Let u = -0.0384 - -0.1794. Let o = 66.141 - u. Is o at least as big as 3/2? True Let a(q) = 66q - 78. Let l be a(-19). Let d = l - -22670/17. Which is bigger: 2 or d? 2 Let q = -468101/10 - -46720. Which is smaller: -90 or q? q Let f be 38 - (-27 - -3)/4. Suppose -5y = -4i - 49, 6i = 8i + 4y + f. Which is greater: i or -17? i Suppose -4g = -0g. Suppose 17l - 13l - 84 = g. Let v = 54 - l. Is 0.2 smaller than v? True Let k = -32.4 + 32.3. Is 1269 at least k? True Let w(n) = -578n - 1155. Let c be w(-2). Which is smaller: c or 9596? c Suppose 54c - 109278 = -32436. Which is smaller: c or 1422? 1422 Let v be ((-19)/(-57))/(-1(-2)/(-78)). Let q be ((-828)/63 - v)(-2)/4. Is q <= 1? True Let n be 332/(-83)(-57)/4. Which is smaller: 508/9 or n? 508/9 Let x(n) = -n2 - 13n - 14. Let h be x(-9). Let q = h + -19. Suppose b = -2y + q, b + 2 = -y + 3. Which is greater: b or 8? 8 Let t(n) = -n3 - n2 + 5. Let v be t(0). Suppose vx = 56 + 324. Let j = x + -76. Is j at least 2.8? False Let m = -2.6 + 2.698. Let i(u) = -159u2 + 17174u - 214. Let g be i(108). Are g and m unequal? True Let d = -107 - -359. Let a = d + -255. Is a greater than or equal to -3? True Let i = 208 - 206.72. Let t = i - 1.18. Is -2/9 at least as big as t? False Let g(d) = 19d + 6. Let b be g(6). Let x be (b/(-84))/((-6)/21). Suppose i - xo + 68 = 0, -3o - 14 - 154 = 3i. Which is smaller: i or -59? -59 Suppose -4d - 6 - 1 = i, -2i - 2d = 38. Let c = 6821 - 6834. Which is bigger: i or c? c Let t(f) = f - 3. Let q be t(5). Suppose 11s = qs. Let n = s - -2. Which is smaller: n or 8/9? 8/9 Let d be ((-6)/4)/(3/(-100)). Let j = 5257/40 - 15691/120. Is d equal to j? False Let j(s) = 44s + 5. Let i be j(0). Is -0.16 not equal to i? True Let k = 1.665 + 0.335. Are k and -2/4369 equal? False Let t(c) = -33c + 51. Let a be t(-6). Suppose -2n - a = n. Let y = 248/3 + n. Which is smaller: y or 4/7? y Let k = 10 - 16. Suppose 122q - 127q = 25. Let b be (10/((-25)/q))/6. Which is smaller: k or b? k Suppose p - h = -94, -2 = 5h + 3. Let u = p + 96. Let x = -4854/13 - -374. Is u not equal to x? True Let g = -6210 + 6209. Do g and 2/11501 have different values? True Let k = 5.3 + -5. Let q = 16092/18823 - -6/2689. Is q greater than k? True Suppose 4d + 3m = -33243, -65d + m + 16619 = -67d. Is d > -8307? False Let x = 9/3883 - 102893/834845. Is -1 less than or equal to x? True Let v(g) = -8g*2 + g + 4. Let p be v(2). Let b be 7 - (-216)/28 - (-4)/14. Suppose 200 = -23d + bd. Which is smaller: d or p? p Let y be 3/(-6) - 821907/(-2052). Let i = 866 - 466. Let w = i - y. Which is greater: w or 1? 1 Let z be -1(2 - (-1 + 4)). Let q = -4 + z. Let j be q/12 - 85/28 - 0. Is j at most -3? True Let i be -234 - 1 - 616/(-44). Is -216 l	{ "pile_set_name": "DM Mathematics" }
p(w)). -364w2 + 28 Let y(q) be the second derivative of 11q*4/4 + 8q. Let c(x) = x*2. Calculate y(c(l)). 33l4 Let p(z) be the second derivative of -z7/840 - z*4/2 + 6z. Let k(m) be the third derivative of p(m). Let t(n) = 2 - 2 - 2n. Give t(k(r)). 6r*2 Let a(g) = 4g*2. Let w(y) = -23y - 1. Give w(a(s)). -92s2 - 1 Let b(r) = 3r*2 - 19. Let w(k) = -6k*2. Give b(w(i)). 108i*4 - 19 Let b(c) be the first derivative of -c + 0c*3 - 1/4c*4 + 0c*2 - 3. Let g(h) be the first derivative of b(h). Let m(x) = 2x. What is m(g(f))? -6f2 Let p(o) be the first derivative of o2/2 + 3. Let u(g) = g2 - 9g - 9. Let x(j) = 4j + 4. Let d(w) = 4u(w) + 9x(w). Determine p(d(n)). 4n2 Let a(b) = -b2 + b*2 + 3b*2. Let f(y) = -3y*2. Determine a(f(l)). 27l4 Let v(r) be the first derivative of -r3/3 + 1. Let m(d) = 14d. What is v(m(t))? -196t*2 Let u(x) = -x + x - 5x*2 + 3x*2. Let q(g) be the second derivative of -2g*3/3 - g. What is u(q(b))? -32b2 Let m(l) = -l2 - 4l. Let j be m(-3). Let v(x) be the second derivative of -2x*j + 2x3 + x3 + 4x. Let y(h) = 2h*2. What is v(y(b))? 12b2 Let a(t) = t. Let k(l) = l3 - 5l2 - 5l - 2. Let d be k(6). Let w(f) = f - 2. Let i be w(d). Let h(z) = -2zi + 2 - 6 + 4. Give a(h(u)). -2u*2 Let h be 12/(-9)3/(-2). Let l(i) = 4i + hi - 7i. Let a(o) = -6o. Let x(w) = -w. Let d(g) = -2a(g) + 11x(g). Calculate l(d(b)). -b Let a(i) = -2i2. Let r(b) be the third derivative of b7/630 + b4/12 + b2. Let g(y) be the second derivative of r(y). Give g(a(t)). 16t*4 Let r(c) = 12c. Let p(m) be the third derivative of m*4/24 + 5m*2. What is p(r(h))? 12h Let x(v) = 362v. Let c(r) = 3r*2. Give x(c(z)). 1086z*2 Let s(j) = -11j*2. Let x(p) = p - 5 + 0p + 5. Calculate x(s(y)). -11y2 Let d be 85/(-15) + 2/3. Let m = d + 8. Let l(r) = 6r + 3r - mr. Let t(x) = x*2. Give l(t(h)). 6h*2 Let s(c) = -2c + 25. Let y(u) = -5u2. What is y(s(v))? -20v*2 + 500v - 3125 Let u(w) = w. Let s(q) be the second derivative of -1/24q4 + 2q + 0 + 1/2q2 + 0q*3. Let d(g) be the first derivative of s(g). Calculate u(d(j)). -j Let c(h) = -2h - h + h. Let j(f) = -25f. Calculate c(j(d)). 50d Let l(v) = 6 - 3 + 4v - 3. Let k(c) = -4c*2. Give k(l(j)). -64j*2 Let j(u) = 3u. Let a(l) = -4l2 + 2l + 2. Let g(m) = -m*2 + m + 1. Let n(h) = -2a(h) + 4g(h). Determine n(j(r)). 36r2 Let w(c) = c2 - c + 1. Let j(u) = -4u2 + 7u - 7. Let o(s) = 2j(s) + 14w(s). Let p(h) be the first derivative of 2h3/3 - 8. Give p(o(t)). 72t*4 Let h(o) = -2o2. Let y = -7 + 9. Let j(a) = a2 + 0ay - 7a*2. Determine h(j(m)). -72m4 Let v(c) = -c2. Let a(p) be the first derivative of -8p3 - 1. Determine a(v(y)). -24y4 Let t(b) be the second derivative of -b2 - b. Let q(k) = -k + 22. Let w(g) = 2q(g) + 22t(g). Let r(v) = 3v. Calculate r(w(s)). -6s Let q(i) = -12i2. Let z(k) = k2 + 6. Determine z(q(y)). 144y4 + 6 Let g(k) be the second derivative of -k4/6 + 5k. Let b(f) be the second derivative of 1/3f*4 + 0f*2 - 2f + 0 + 0f3. Determine b(g(s)). 16s*4 Let x(q) = 2q*2. Let z(h) = -13h*2. What is x(z(f))? 338f*4 Suppose 4f - 5i - 308 = 0, 232 = 3f - 5i + i. Let g(z) = -72 - 2z + f. Let k(y) = -9y2. What is k(g(m))? -36m*2 Let v(t) = 4t + 7t2 - 15t*2 + 6t2. Let x(k) = k2. Determine v(x(w)). -2w4 + 4w*2 Let d(j) = 3j*2. Let a(q) = 0q - 5q + 3q. What is d(a(b))? 12b2 Let l(z) = z. Let q(i) = -2i. Let y(t) = -t. Suppose 4h = -4r - 16, 4h + r + 16 = -r. Let k(j) = hy(j) + 3q(j). What is l(k(c))? -2c Let p(z) be the second derivative of 19z3/6 - z. Let v(h) = -2h. What is v(p(o))? -38o Let t(g) = 3g*2. Let j(b) = 5b. Let d(w) = w + 2. Let k = -14 - -8. Let m be d(k). Let c(v) = -11v. Let p(z) = mc(z) - 9j(z). Calculate p(t(a)). -3a*2 Let p(x) = -3x*2 - 2x. Suppose -3z + 1 = -2. Let a(y) = -y2 - y. Let f(m) = zp(m) - 2a(m). Let c(v) = -2v. What is c(f(t))? 2t2 Let x(h) = -420h + 5. Let o(p) = 2p2. Calculate x(o(m)). -840m*2 + 5 Let z(v) = -11v. Let t(n) = -8n2 + 7n + 7. Let w(p) = 7p2 - 6p - 6. Let f(b) = 6t(b) + 7w(b). Determine z(f(l)). -11l2 Suppose -2r = 4z - 8, -2r = 2z + 2 - 4. Let c(x) = zx*2 - 3x + 4x - x. Let g(m) = -2m. Determine c(g(n)). 12n2 Let y(z) = 8z*2 - 6z. Let f(g) = -g*2 + g. Let t(v) = 12f(v) + 2y(v). Let c(n) = 20n - 11n - 8n. Give c(t(u)). 4u2 Let w(r) = -3r + 2 - 2. Let n(g) = 2g - 7. Suppose -4b + 0b = -4i - 4, -5i = 20. Let f(j) = j - 3. Let z(o) = bn(o) + 7f(o). Calculate z(w(a)). -3a Suppose -5i + 1 - 14 = 3m, -3i + 21 = -3m. Let q = 10 + m. Let u(w) = w - 2w2 - qw*2 - w. Let o(b) = -2b*2. Calculate u(o(c)). -24c*4 Let l(y) = 3y. Let j(a) be the third derivative of -5a4/24 + 2a*2. Give l(j(v)). -15v Let l(t) = t. Let q(a) be the third derivative of -a*5/15 + 4a*2. Calculate q(l(r)). -4r2 Let n(z) be the third derivative of -z7/1680 + z5/30 - z2. Let b(m) be the third derivative of n(m). Let p(i) = -2i. Determine p(b(x)). 6x Let z(t) = t. Let c(r) be the third derivative of r7/1680 + r5/60 + 4r2. Let y(l) be the third derivative of c(l). Determine z(y(p)). 3p Let x(g) be the third derivative of -5g4/24 - g3/6 - 3g*2 - 3. Let v(d) = -2d*2. What is v(x(t))? -50t*2 - 20t - 2 Let p(u) be the second derivative of u*3/3 - u. Let b = 8 - 7. Let m(n) = -n - 1. Let g(y) = 4y + 5. Let z(a) = bg(a) + 5m(a). Calculate z(p(s)). -2s Let n(r) = 470r - 233r - 238r. Let k(l) be the first derivative of l5/60 + l3/3 - 1. Let h(i) be the third derivative of k(i). Calculate h(n(v)). -2v Let d(i) = -6i. Suppose 0u + 3u = -g, g - 3u - 6 = 0. Let s(t) = -t - gt + 3t. Let r(z) = -3d(z) + 16s(z). Let k(a) = 2a. Calculate r(k(x)). 4x Let y(l) = 921 - 921 + 7l. Let s(i) = -9i. Give s(y(b)). -63b Let a = 6 - 3. Let z be 1 - (-2 - 0) - 0. Let s(m) = -am2 + z - 3. Let y(t) = -2t. What is y(s(d))? 6d2 Let i(k) = 9k*2 - 18k + 18k - 10k*2. Let u(d) = -16d*2 - 2. What is i(u(a))? -256a*4 - 64a2 - 4 Let x(j) be the second derivative of j3/3 + 5j. Let o(l) = -2l + 4l - 5l. Give x(o(c)). -6c Let s(t) = -t2. Let w(o) = 20 - 5o*2 - 20. Determine w(s(f)). -5f*4 Let n(q) = -9q. Let c(g) = 2g2 - 4g - 4. Let h(p) = -p*2 + p + 1. Let x(j) = -c(j) - 4h(j). Calculate n(x(z)). -18z2 Let l(u) = 8u*2 + 7u + 7. Let d(v) = 7v2 + 6v + 6. Let r(y) = 7d(y) - 6l(y). Let w(h) = -6h. Calculate w(r(o)). -6o*2 Let f(q) = 3q. Let n be (0 + 2)/(4/6). Let b(i) = -ni2 + i2 + 3 - 3. Calculate f(b(p)). -6p*2 Suppose -h + 10 = 4q, 0h + 4q + 14 = 3h. Let n(r) = -hr + 4r - 2r. Let m(w) = -w. Calculate m(n(u)). 4u Let t(o) = 11o*2. Let v(r) = 2r*2. What is t(v(s))? 44s*4 Let g(v) = 4v - 5. Let t(w) = 5w - 6. Let q(b) = -6g(b) + 5t(b). Let k(j) be the third derivative of -j5/60 - 2j2. What is q(k(u))? -u2 Let z(n) = 4n2. Let f be -1((-8)/2)/2. Suppose 6r = fr + 8. Let u(x) = -x*2 + r - 2. Give z(u(k)). 4k*4 Let q(k) = -k. Let c(f) = -18f - 12. Let i(s) = 1. Let z(a) = c(a) + 12i(a). Calculate q(z(o)). 18o Let d(v) = -17v - 4. Let i(b) = -2b*2 + 13b. Calculate d(i(a)). 34a2 - 221a - 4 Let j(t) = 3t2. Let p(i) = 11i. Let n(l) = 23l. Let w(x) = -4n(x) + 9p(x). Give j(w(k)). 147k2 Let q(z) = -z2. Let k(u) be the third derivative of 0u + 0u*4 - 1/60u*5 + 0 + 0u*3 + 3u2. What is k(q(f))? -f4 Let d = -50 - -103/2. Let m(a) be the first derivative of 0a - 1 + da*2. Let k(o) = 2o*2. Calculate k(m(v)). 18v*2 Let x(g) = -g - 2g + g. Let w(u) be the first derivative of 4u3/3 + 52. What is w(x(k))? 16k*2 Let q(u) = -20u*2. Let o(h) = 4h. Let i(f) be the first derivative of -5f2/2 - 11. Let y(x) = 2i(x) + 3o(x). What is q(y(l))? -80l2 Let g(w) be the third derivative of -w5/30 + 24w2. Let z(d) = 10d. Calculate g(z(t)). -200t2 Let j(i) be the first derivative of 13i*3/3 - 19. Let s(y) = -3y. Determine s(j(f)). -39f2 Let f(m) = 2m - m*2 - 2m. Let p(d) be the second derivative of -3d + 0d**3	{ "pile_set_name": "DM Mathematics" }
-2t2 - 3t + 3. Let d = 5 - 3. Let a(c) = 2c2 + 2c - 2. Calculate dg(x) + na(x). 2x2 Let q(t) = -4t*2 - 3t - 3. Let p(j) = -j*2 + j + 3. Let v be 60/21 - 3/(-21). Let h be p(v). Let w(a) = 9a*2 + 7a + 7. What is hw(d) - 7q(d)? d*2 Let g(p) = -33p*3 - 11p*2 - 2p - 11. Let c(l) = -17l3 - 6l*2 - l - 6. Determine 11c(y) - 6g(y). 11y*3 + y Let k(g) = 4g - 2. Let u(p) = 7p - 4. Determine -5k(v) + 3u(v). v - 2 Let l(n) = -4n + 2. Let o(u) be the second derivative of -u*3/6 + u. What is l(q) - 6o(q)? 2q + 2 Let s(b) = -b3 - 4b*2. Let u(h) = -2h*3 - 7h*2 - 1. Let q(v) = -5s(v) + 3u(v). Let y(m) = 2m*2 + 1 + 0m2 - m2. What is -q(d) - 2y(d)? d3 - d2 + 1 Let k(c) = 2c + 1. Let o(y) = -3y. Calculate -5k(s) - 4o(s). 2s - 5 Let v(b) be the first derivative of -7b3/3 + b2 - 37. Let l(m) = m2 - m. Give -2l(c) - v(c). 5c2 Let w(d) = 3 - 32d - 28d - 2 + 59d. Let n(t) = t + 4. Let c be n(0). Let r(y) = y - 2. Calculate cr(j) + 7w(j). -3j - 1 Let b(d) = d3 + d2. Let q(s) = -5s*3 + 7s*2 - s. Calculate -6b(v) + q(v). -11v3 + v2 - v Let q(y) = -y3 + 3y*2 + 5y + 2. Let z be q(4). Let h be -15(2 + (-14)/z). Let d(x) = 2 + 4 - 9 + 7x. Let r(n) = 20n - 8. Give hr(t) - 14d(t). 2t + 2 Suppose 6 - 2 = 4a. Let m(f) = f3 + f + 1. Let b(c) = -c - 6. Let u(r) = r + 7. Let n(l) = -6b(l) - 5u(l). Determine an(g) - m(g). -g*3 Let g(i) = 6i*3 - 4i*2 - 7. Let p(s) = -6s*3 + 5s*2 + 8. What is -6g(t) - 5p(t)? -6t3 - t2 + 2 Let f(i) = -i3 - i2 + i - 1. Let a(b) = 12b3 + 6b*2 - 4b + 4. Calculate -a(g) - 6f(g). -6g*3 - 2g + 2 Suppose -4j - 39 = 5. Let k(t) = -t2 + 3t - 2. Let z(i) = -3i2 + 8i - 6. Give jk(c) + 4z(c). -c*2 - c - 2 Let o(f) = 11f - 9. Let h(d) = 6d - 5. Let c = -6 + -1. Suppose 8g = 12g - 16. What is ch(m) + go(m)? 2m - 1 Let o(b) = -3b2 + 5b + 11. Let f(c) = 1. Let i(a) = 6f(a) - o(a). Let l(k) = k + 1. Give -i(t) - 4l(t). -3t2 + t + 1 Let s(c) = c - 1. Let f(a) = -5a + 1. Calculate f(g) + 4s(g). -g - 3 Let g(j) be the third derivative of j5/15 + 3j4/8 - j3 - 25j2. Let r(w) = w2 + w - 1. Determine g(l) - 6r(l). -2l2 + 3l Let c(a) = 35a + 20. Let y(d) be the first derivative of -5d*2/2 - 3d - 6. What is 3c(o) + 20y(o)? 5o Let a(q) = -6q - 4q2 + 4 + 4 + 3q2 - 1. Let p(t) = t2 + 7t - 8. Calculate -7a(d) - 6p(d). d2 - 1 Let c(i) = -11i*2 + 5i + 2. Let t(y) = -35y2 + 15y + 7. Determine -7c(u) + 2t(u). 7u2 - 5u Let d(p) = -5p - 4. Let n = 17 - 12. Suppose -70 = -nr - 5c, -c = -r - 4r + 46. Let m be 26/(-6) + r/30. Let t(i) = 11i + 9. What is mt(b) - 9d(b)? b Let q(v) be the third derivative of v4/24 + 14v*2. Let g(s) = s. Suppose 4 = 3i + 16. Let j = 6 + i. What is jq(p) - 3g(p)? -p Let r(g) = 2g + g - 3 + 3 + 2. Let t(i) = 5i + 3. What is -8r(s) + 5t(s)? s - 1 Let n = -27 - -21. Let w(y) = -4y2 + 3y + 1. Let h(f) = 17f2 - 13f - 4. Give nh(t) - 26w(t). 2t2 - 2 Let r(a) = 33a - 55. Let i(w) = w - 1. Give 55i(y) - r(y). 22y Let s(f) = -f*2 + f - 1. Suppose 2b + 0b = 8. Let h(y) = -5y*2 + 5y - 5. Let i(r) = -5r2 + 4r - 5. Let c(n) = bi(n) - 6h(n). What is c(k) + 12s(k)? -2k*2 - 2k - 2 Let p(t) = 3t - 2. Let m(f) = 0 + f + 1 - 2f. Let i(o) = o*2 + 8o - 8. Let y be i(-9). Let j(w) = w - 3. Let v be j(5). Give vm(x) + yp(x). x Let t(c) = -2c3. Let s(m) = m3 - 124m + 124m. What is 5s(g) + 3t(g)? -g3 Let f(p) = -5p*3 - 3p*2 - 6. Let m(y) = -6y*3 - 4y*2 - 6. Determine -4f(w) + 3m(w). 2w*3 + 6 Let p(z) = 5z*3 + 11z*2 + 25z + 11. Let c(j) = -j*3 - 2j*2 - 5j - 2. Determine 22c(g) + 4p(g). -2g3 - 10g Suppose -3o = 5f + o - 22, -3f - 4o = -10. Let i(h) = 2h2 + 7h + 4. Let u(j) = -j - 1. What is fu(g) + i(g)? 2g*2 + g - 2 Let y(p) = 2p*2 + 2p - 1. Let n(w) = w*3 - 10w*2 - 11w + 5. Determine -2n(h) - 11y(h). -2h3 - 2h*2 + 1 Let q be 1/(-2)26. Let g(i) = 2i*2 + 16i + 13. Let t be g(-6). Let z(a) = 4a2 - 2a. Let c(o) = -7o2 + 4o. Calculate qc(y) + tz(y). -2y2 - 2y Suppose 0 = -6i + i - 5. Let g = 2 + i. Let u(v) = v - 2v + v*2 + 8 - 9 + 0. Let o(a) = 2a*2 - 4a - 3. Determine go(f) - 4u(f). -2f2 + 1 Let u(k) = -k + 14. Let z(h) = -4h + 42. What is -10u(y) + 3z(y)? -2y - 14 Let a(z) = 9z*2 - 5z - 11. Let p(y) = 5y2 - 3y - 5. Give -3a(s) + 5p(s). -2s2 + 8 Let b(d) = 3. Let i(m) = m + 7. Let n(j) = 5b(j) - 2i(j). Let a(r) = 0 - 5 + 4. Give 3a(v) + n(v). -2v - 2 Let f(g) = g - 1. Let b(h) = -2h3 - h2 + 2h - 3. Suppose -5t + 4t - 3 = 0. Give tf(o) + b(o). -2o3 - o2 - o Let b(m) = 13m - 8. Let l(a) = 1. What is 3b(v) + 24l(v)? 39v Let t(r) = r2 - 1. Let u(f) = -4f*2 - 38. Determine -3t(m) - u(m). m*2 + 41 Let x(n) = -7n*3 + 6n*2 - 6n - 6. Let q(b) = 8 + 4 + b*3 - b - 13 - 2b3 + b2. Give -6q(w) + x(w). -w3 Let z(i) = i2 - 7i + 7. Let n(r) be the first derivative of -r*3/3 + 2r*2 - 4r - 6. Calculate 7n(v) + 4z(v). -3v2 Let m be -1(-3)/((-3)/1). Let x(w) = -w. Let r(v) = -1. Determine mx(z) - 2r(z). z + 2 Let c(d) = 6d2 + 15d - 18. Let o(x) = 18x2 + 44x - 53. Let l(t) = -11c(t) + 4o(t). Let q(w) = 2w2 + 4w - 5. What is 4l(n) - 11q(n)? 2n2 - 1 Let l(k) = -k2 - 5k - 9. Let g(x) = -2x2 - 8x - 14. Give 5g(u) - 8l(u). -2u2 + 2 Let c(w) = -2w*3 - 3w - 1. Suppose 19g - 23g + 16 = 0. Let k(y) = 2y3 + 4y. Calculate gc(m) + 3k(m). -2m3 - 4 Let l(p) = -3p*3 + 3p*2 + 2p. Let d(y) = 4y3 - 3y*2 - 3y. Calculate -2d(v) - 3l(v). v*3 - 3v*2 Let f(a) = 6a - 2. Let i(k) be the second derivative of 0 + 4k - 17/6k*3 + 3k*2. What is 11f(c) + 4i(c)? -2c + 2 Let d(j) = -9j3 + 7j*2 + 5j - 9. Let k(q) be the first derivative of -13q4/4 + 10q*3/3 + 7q*2/2 - 13q - 14. Calculate 7d(w) - 5k(w). 2w3 - w2 + 2 Let n(g) = -3g*3 - 3g*2 + 2. Let o(t) = -7t*3 - 6t2 + 6. Let q(c) = c3 + c*2 - 1. Let y(b) = o(b) + 6q(b). Determine -n(h) + 2y(h). h3 + 3h*2 - 2 Let a(c) = -15c*2 + 3. Let u(q) = 29q*2 - 7. What is 7a(r) + 3u(r)? -18r*2 Let u(v) = -3v*3 + 6v*2 - 6v - 6. Let c(o) = -o3 + o2 - 1. What is 6c(t) - u(t)? -3t*3 + 6t Let u(g) = 5g - 1. Let i(l) be the third derivative of -l4/24 + 3l*2. What is -6i(y) - u(y)? y + 1 Let y = -12 + 7. Let o(w) = -4 - 2 - 2w2 - w - 5w + w. Let x(g) = 3g2 + 6g + 7. Determine yo(m) - 4x(m). -2m2 + m + 2 Let d(m) be the second derivative of -m4/12 + 7m3/6 - m2 + 4m. Let x = 36 + -53. Let o = x - -12. Let n(f) = f. Give on(w) + d(w). -w*2 + 2w - 2 Let o(m) = -9m2 - 6 - 1 - 1 - 5m + m*2. Let s(i) = 9i*2 + 6i + 9. Calculate -6o(k) - 5s(k). 3k2 + 3 Let k(o) = 5o - 1. Let i(q) = -6q + 1. Give 3i(y) + 4k(y). 2y - 1 Let t(b) = -3b2 - 3b + 7. Let a(r) = -2r2 - 2r + 4. Determine -7a(v) + 4t(v). 2v2 + 2v Let t(s) = 9s. Let r = 0 + -6. Let h(z) = -z. Let m(a) = 6a + 9. Let w be m(-10). Give rt(p) + wh(p). -3p Let i(l) = -1. Let z(b) = -b3 + b2 - 2. Give -7i(q) + 2z(q). -2q*3 + 2q2 + 3 Let i(j) = j3 + j*2 - j. Let x(q) = 12q*3 + 9q*2 - 6q + 3. Let a(b) = -9i(b) + x(b). Let u(v) = 3v*3 + 3 + 3 + 4v - 2. Give 4a(o) - 3u(o). 3o3 Let m(i) = -i2 + 5i - 1. Let g(y) = -5y2 + 20y - 4. Give -2g(j) + 9m(j). j*2 + 5j - 1 Let s(c) = -8c2 + 2c - 1. Let z(r) = r*3 - 8r*2 + 3r - 1. Calculate 3s(k) - 2z(k). -2k3 - 8k*2 - 1 Suppose -6 - 6 = -3b. Let t(r) = 2r3 - 3r*2 + 2r. Let z(i) = 2i3 - 2i*2 + 2i. What is bz(c) - 3t(c)? 2c3 + c2 + 2c Suppose -23 = -v - 27. Let b(r) = -3r3 - 2r*2 - 2r. Let f = 16 + -5. Let c(o) = -10o2 - fo - o*2 - 8o*3 - 8o*3. Determine vc(l) + 22b(l). -2l3 Let v(b) = b3 + 2b2 + b. Let i = -74 - -75. Let g(r) = r2 + r + 1. Determine iv(j) - g(j). j3 + j2 - 1 Let j be 6/(-14) - 48/84. Let i(w) = -w + 1. Let k be i(-5). Let o(z) = z*3 - 6z*2 + 6z + 4. Let u(q) = -q*2 + q + 1. Determine jo(v) + ku(v). -v3 + 2 Let o(f) = f2 - 4f - 4. Let d(q) = 4q2 - 12q - 13. Giv	{ "pile_set_name": "DM Mathematics" }
-50j + 29190 = -40j. What is the highest common factor of j and 7? 7 Let f(g) = -4g2 + 0 + 2 + 4g*2 + 9g - g*2. Let c be f(9). Suppose 2z + 0 + 4 = ch, 0 = -2z + 10. Calculate the highest common divisor of 14 and h. 7 Suppose -4f = 2i - 92, 0i + 16 = f - 3i. Let k = -12 + f. What is the greatest common divisor of 20 and k? 10 Let t(f) = -2f3 - 7f*2 + 47f + 166. Let r be t(-3). What is the greatest common factor of r and 696? 8 Suppose -3z + 2x + 247 = 0, 2z - 5x = 3z - 71. Suppose 0 = 7l - 114 + 2. Suppose 8k - lk = -216. Calculate the highest common divisor of z and k. 27 Suppose -2a + 9 = a. Suppose -5k + 5p + 601 = -k, -ap - 591 = -4k. Let o be (-1)/((1/40)/(2/(-5))). Calculate the greatest common factor of k and o. 16 Let f = -371 + 366. Let t be (f - -3)(12/4 + -47). What is the greatest common divisor of 8 and t? 8 Suppose 2u + 5i - 865 + 200 = 0, -5u - 2i = -1631. Let j = -160 + u. Let c be (297/6)/(6/8). What is the greatest common divisor of j and c? 33 Let w(q) = 312q2 + 30q - 3. Let n be w(-2). Calculate the highest common divisor of 316 and n. 79 Let o(i) be the third derivative of i*5/60 + 7i*4/24 - 37i*3/6 + 2i*2 + 9i. Let x be o(5). Calculate the highest common factor of 46 and x. 23 Let c(u) = -u + 19. Let g be c(18). Let m(p) = 11p2 + 9p - 7. Let j be m(g). Calculate the greatest common factor of j and 78. 13 Let j = 3 + 59. Suppose -j - 103 = -3s. Suppose -5n = -2l - 31, -7l + 3l + 13 = 5n. What is the greatest common factor of n and s? 5 Suppose 0 = -34i + 17269 + 90613. Calculate the highest common divisor of i and 76. 19 Let x(r) = r3 - 5r*2 - 2r - 19. Let k be x(6). Suppose 8q + k = 13. Suppose 3 + q = 2l. What is the greatest common factor of l and 22? 2 Suppose -g - 341 = -3k + 17, 3g = 5k - 1078. Let o = g + 377. Calculate the greatest common factor of o and 4. 4 Let q = -205 + 219. Suppose -25 = -5v, -2i + 3v - v + q = 0. Let a(h) = -h*3 + 4h*2 + h - 4. Let o be a(3). What is the highest common factor of i and o? 4 Let f(n) = 88n - 132. Let o(g) = -13g - 139. Let d be o(-11). Let h be f(d). Calculate the greatest common factor of 40 and h. 20 Let d(j) = 3j + 57. Let p be d(-18). Let k be 3(-5)/5(-16 + p). Calculate the highest common factor of k and 3. 3 Suppose k = -p - 0p + 100, 0 = 4p + 12. Let u = k - 38. Let n be 12 - (0 + 4 + 0)/(-4). Calculate the highest common factor of n and u. 13 Suppose -29487 = -7l - 3r, 5l - 4r - 21064 = -8r. What is the greatest common divisor of 624 and l? 156 Suppose -6z = -z - 100. Suppose -17q + 1264 = -10q - 4s, 183 = q - 3s. Calculate the greatest common factor of z and q. 20 Let i = -217 + 221. Suppose 91 + 121 = ix. Calculate the greatest common factor of 689 and x. 53 Let q be 6/(-4) + 11010/20. Suppose 17h - q = 114. What is the highest common factor of 52 and h? 13 Let c = -239 + 136. Let z = c - -23. Let s = 84 + z. Calculate the greatest common divisor of 1 and s. 1 Let i = 13374 + -6122. What is the highest common divisor of i and 74? 74 Suppose 4c - 4l + 20 = -9l, -2c - 3l - 12 = 0. Let i be (-19 - (-3 + 3))/(-1) - c. What is the highest common divisor of i and 133? 19 Let a = -186 + 290. Calculate the greatest common factor of a and 32. 8 Let q = 94 - 78. Suppose -17t + qt = -3. Suppose tj - 67 = 11. What is the highest common divisor of 286 and j? 26 Suppose -842 - 313 = -15l. Let i(u) = u3 + 7u*2 + 3u - 11. Let b be i(-6). What is the greatest common divisor of l and b? 7 Let q(t) = 23t - 658. Let d be q(29). Calculate the highest common factor of 39 and d. 3 Let w(y) = 3y*2 - 19y - 5. Let k be w(13). Suppose 6o - 3o = k. Suppose -2z + o = 15. Calculate the highest common divisor of z and 315. 35 Let h(f) = 11f - 28. Let u be h(3). Suppose -uk = -n - 73 + 20, -2k + 30 = 4n. What is the greatest common divisor of 451 and k? 11 Let h(n) = -n2 - 9n - 15. Let g be h(-4). Let b = g + 35. What is the greatest common factor of 40 and b? 40 Let z(q) = -10 + 4q - 4q + q*3 - 133q*2 + 5q + 143q2. Let l be z(-6). Calculate the greatest common factor of 39 and l. 13 Let c = 683 + -642. Suppose -4n - 2y + 346 = 0, n + y = c + 46. What is the highest common factor of n and 129? 43 Let p be (((-825)/(-45))/(-11))/((-35)/3276). What is the highest common factor of 55068 and p? 156 Suppose -8v + 14v - 240 = 0. Calculate the highest common divisor of v and 340. 20 Let a(i) = 6i - 4. Let o be a(4). Suppose 289v + 3090 = 804v. What is the greatest common factor of o and v? 2 Let m = 13011 - 12869. Calculate the highest common divisor of 12638 and m. 142 Suppose 0 = t - 4n - 22, 3t - t - 5n = 32. Let g be 27 - (t/(-9)-6 - 3). Let v be (-482)/(-4) - 13/g. What is the greatest common factor of 10 and v? 10 Let y = 80 - 65. Suppose 2i - 5i = 3a - 21, i = -2a + y. What is the highest common divisor of 64 and a? 8 Let g(r) = 41r3 - r2 + 2r. Let l be 3/(((-9)/201)/(-1)) + -2. Let i = 66 - l. Let t be g(i). What is the greatest common factor of t and 168? 42 Suppose -5456 = -3t + 3x - 824, -3t + x = -4640. Calculate the greatest common factor of t and 828. 36 Suppose 34n - 60 = 22n. Suppose -nk - 200 = -4o, 10 + 2 = 3k. Let z be (-3)/(-8) - 2634/(-16). Calculate the highest common divisor of o and z. 55 Let y = -195 + 403. What is the greatest common factor of 272 and y? 16 Let u(q) = 11q + 108. Let o be u(-9). Suppose x + 50 = -oh + 12h, x - 22 = -h. Calculate the greatest common factor of h and 126. 18 Let h = -84 - -144. Let s be (-105)/(2 - -5)(-33)/3. Calculate the greatest common factor of h and s. 15 Suppose 35 = -54q + 59q. Suppose 0 = -3c - 7 - 14. Let t be (-782)/(-7) + (-2)/c. Calculate the highest common factor of q and t. 7 Let q = 58 + 110. Suppose -33n = -234n + n + 42000. Calculate the highest common divisor of q and n. 42 Let z be (2 + 22)/(1/(3/2)). Let y(s) = 14s*2 + 5. Let v be y(-2). Suppose -8b + v = -11. Calculate the highest common factor of z and b. 9 Let q be (-2)/9 - (5 + (-38022)/27). Suppose q = 4p - 5j + 458, -3p = -2j - 700. What is the highest common divisor of p and 46? 46 Let h = -23763 - -24459. Calculate the greatest common divisor of h and 432. 24 Let m(h) = 7h - 27. Let p = -172 - -180. Let k be m(p). What is the greatest common divisor of 232 and k? 29 Let d be -130(4/10 + (-276)/115). What is the greatest common divisor of 16250 and d? 130 Suppose 433 + 503 = 4g - 2b, -4g = 4b - 936. Let h = -26 + g. Let s = -640 + 692. What is the greatest common factor of h and s? 52 Let x = 967 + -736. Calculate the greatest common divisor of 14 and x. 7 Let q(l) = 8l3 + 8l*2 + 7l + 9. Let w be q(-5). Let a = 1384 + w. What is the highest common factor of a and 62? 62 Let k = 103 + -104. Let f(d) be the first derivative of -11d2/2 + 2d - 8. Let y be f(k). What is the highest common factor of y and 91? 13 Suppose -13q = -20q + 5g + 3744, 0 = 2q + 5g - 1044. Calculate the greatest common factor of 56 and q. 28 Let n(v) = -4v*3 - 19v*2 + 16v + 89. Let k be n(-11). Calculate the greatest common divisor of 91 and k. 13 Let a = -22435 + 22477. Calculate the greatest common factor of a and 1344. 42 Let d = 48 - 33. Suppose 5m = d, 5p - 4p = -4m + 77. Calculate the highest common factor of 5 and p. 5 Let q = 9726 + -9714. Let z = 2 + 0. Let s = z - -4. What is the highest common divisor of q and s? 6 Suppose -3o - 27 = -99. Calculate the highest common divisor of 472 and o. 8 Let x(b) = -b3 - 9b*2 + 15b + 57. Let i = -158 - -148. Let q be x(i). Calculate the highest common divisor of q and 21. 7 Let y be -418(-14)/(-8)(-76)/(-266). Let h = y + 319. What is the greatest common divisor of h and 30? 10 Let m(i) = -7i + 55. Let q be m(5). What is the greatest common divisor of q and 8240? 20 Suppose -29i = -22i - 35. Suppose h - 3h = p - 250, p - 247 = -ih. Calculate the greatest common factor of 84 and p. 84 Let s(w) = -3w3 + w2 - 15w + 9711. Let z be s(0). What is the highest common divisor of 498 and z? 249 Suppose -3z - 2z = 12z - 204. What is the highest common factor of 648 and z? 12 Let v = -616 + 867. Let m = 525 - 272. Suppose 5z - h = -3h	{ "pile_set_name": "DM Mathematics" }
+ 5. Let k(h) = -8h2 + 4h - 4. What is il(f) + uk(f)? 4f2 Let k(a) be the first derivative of a3/3 + 3a*2 + 5a + 16. Suppose 10 = -10v + 8v. Let o(l) = -l*2 - 5l - 4. Determine vk(u) - 6o(u). u2 - 1 Let d(j) be the third derivative of -j3/3 + 16j2. Let x(t) = -t + 1. Suppose v + 9 = 4q, 0q + v = -q - 4. Calculate qd(y) + x(y). -y - 1 Let o(a) = -291a - 97. Let k(l) = 2l + 1. What is -194k(i) - 2o(i)? 194i Let i(b) = -123 + 40 + 4b - 21b + 43 + 49. Let z(k) = -8k + 4. Suppose 92 - 23 = -5p - 2c, -2p = 3c + 32. What is pz(a) + 6i(a)? 2a + 2 Let z(v) = -13v*3 - 283v*2 + 15v - 11. Let u(w) = 7w3 + 141w*2 - 8w + 6. Give 11u(q) + 6z(q). -q*3 - 147q*2 + 2q Let l(j) = j*3 - 8j*2 - 12j + 24. Let r be l(9). Let f(q) = -25q2. Let m(p) = 2p*2. Determine rf(d) - 35m(d). 5d*2 Let h(o) = -6o*3 + 5o*2 - 80o + 12o3 + 75o. Let b(g) = 21g3 + 18g*2 - 18g. What is -5b(n) + 18h(n)? 3n3 Let g(j) = -j - 1. Let c(x) be the first derivative of x2 + x - 8. Calculate -c(s) - g(s). -s Let w(l) = 278l - 17. Let m(b) = -93b + 6. What is -11m(y) - 4w(y)? -89y + 2 Let q(g) = 1. Suppose 0 = -3x + 5x - 8. Suppose x = -3c + 16. Suppose -2l - 5a = -2, -5l - ca = 5 + 7. Let r(u) = u - 3. Determine lq(n) - r(n). -n - 1 Let u(a) be the third derivative of -a*6/12 - 4a*5/15 - 3a*4/2 - 3a*2 - 10a. Let h(g) = 2g3 + 3g*2 + 7g. Calculate -16h(k) - 3u(k). -2k3 - 4k Let u(s) = -2s - 3. Let j = -16 - -22. Let n(l) = l + 7. Let g(h) = 3h + 20. Let p(y) = jg(y) - 17n(y). Suppose -4x + 3 = 15. What is xp(o) - u(o)? -o Let a(t) = -8t2 - 43t - 16. Let j(p) = 6p2 + 29p + 11. Determine -5a(v) - 7j(v). -2v2 + 12v + 3 Let c(j) = -15j3 - 5j + 81 - 82 + 8j3. Let d(p) = 4p*3 + 3p. Let o be ((-12)/6)/(4/10). Give od(y) - 3c(y). y*3 + 3 Let o(f) = 77f + 8. Let j(w) = -w - 2. Determine -4j(k) - o(k). -73k Let c(v) = -v - 21. Suppose 25y - 259 = 16. Let x(m) = -4. Give yx(i) - 2c(i). 2i - 2 Let v(a) be the second derivative of 2a3/3 + a2/2 - a. Let p = 154 + -157. Let o(n) = 2n + 2 - 4 - 4n + 1. Calculate pv(k) - 5o(k). -2k + 2 Let l(h) = -2h3 - 11h*2 - h. Let f(j) = -6j*3 - 32j*2 - 3j. Give 4f(p) - 11l(p). -2p3 - 7p*2 - p Let a(k) = 4k - 1. Let z(d) = -13d + 3. Suppose 35g + 64 = 3g. Determine gz(v) - 7a(v). -2v + 1 Let o(s) = 3s - 15. Let f(q) = 2q - 8. Suppose -3d = a - 23, 10a - 5a - 5d - 35 = 0. Determine af(m) - 6o(m). 4m + 2 Suppose -14a = -70 - 56. Let h(u) = 8u2 - 3u + 6. Let v(z) = 17z2 - 7z + 13. Give ah(d) - 4v(d). 4d2 + d + 2 Let y(w) = w2 + 10w - 8. Let h(m) = -m*2 + 1. Give -4h(c) - y(c). 3c2 - 10c + 4 Let n(l) = -9l2 + 3l - 4. Let u(x) = -7x2 + 4x - 3. Give 2n(z) - 3u(z). 3z2 - 6z + 1 Let i be (-3)/2(-882)/(-189). Let q(t) = -5t*2 + 5t + 4. Let a(v) = -6v2 + 6v + 4. What is iq(z) + 6a(z)? -z2 + z - 4 Let z(b) be the second derivative of b3/3 - 3b2/2 + 2b. Let f(u) = -68u - 5 - 60u + 191u + 15 - 68u. Give -2f(t) - 7z(t). -4t + 1 Let v be (-225)/90 - (-3)/2. Let l(c) = c2 - 1. Let u(n) = -2n*2 + 6. What is vu(g) - 6l(g)? -4g*2 Let j(c) = 5c*2 - 2. Let o(m) = 8m*2 + 6m*2 - 5 - 278m + 278m. Calculate -11j(u) + 4o(u). u2 + 2 Let z(w) = 3 + 3w*3 + 17474w*2 - 17479w*2 - 5. Let y(g) = -12g*3 + 21g*2 + 9. Calculate 2y(l) + 9z(l). 3l*3 - 3l*2 Let v(m) = -m - 4. Suppose j = -j + 8. Suppose -15 = k - jk. Let s(o) = -2 - 5o - 3 + ko - 2o. Calculate 3s(r) - 4v(r). -2r + 1 Let x be 6 + 3 - (-5 + 1). Let m(a) = 4 - 6 - 20a + x. Let t(s) = -7s + 4. Calculate 6m(o) - 17t(o). -o - 2 Let i(x) be the second derivative of -3x5/20 + x4/12 - x3 - 3x*2 + 17x. Let b(p) = -9p3 + 3p*2 - 17p - 17. What is -6b(g) + 17i(g)? 3g3 - g2 Let x(u) = 28u*3 - 2 - 16u*3 - 6u*2 + 3u*2 - 1 - u - 8u*3. Let k(r) = 9r*3 - 7r*2 - 3r - 7. What is 6k(f) - 14x(f)? -2f3 - 4f Let s be 3/(-6(-2)/8). Suppose -sj = 3 - 13. Let o(u) = -u*3 + 5u + 7. Let m(d) = d*3 - 2d - 3. Give jm(z) + 2o(z). 3z3 - 1 Let o(m) = 2m*2 - 5m - 7. Let s(i) = i*2 - 4i - 1. Let b be s(-2). Let g(a) = -10a + 4a - 2a - b + 3a*2. Calculate -5g(h) + 8o(h). h2 - 1 Let j = 122 - 116. Let h(l) = 2l*3 - 6l + 3. Let c(a) = -a + 1. Determine jc(w) - h(w). -2w*3 + 3 Let n(i) = 5i*3 - 2i*2 - 3i - 3. Let o(g) = -3 - 3 + g2 + 0 - g3 + 2 + 5 + g. What is n(f) + 3o(f)? 2f3 + f2 Let i(j) = 5j - 7j*2 + 2j - j + 3 + 3. Let v(g) = -g*2 + g + 1. Calculate 5i(a) - 30v(a). -5a*2 Let u(l) = 4l*3 + 10l*2 + 9l*3 + 19l*2 - 31l*2 - 2l + 2 - 2l. Let w(z) = -12z*3 + 3z*2 + 5z - 3. What is 3u(t) + 2w(t)? 15t3 - 2t Let t(r) = 1100r - 64. Let l(y) = -y - 8. Calculate 8l(q) - t(q). -1108q Let f(l) be the first derivative of l4 + l3/3 - 9l*2/2 + 10. Let v(s) = -6s*3 - 2s*2 + 14s. Determine -8f(k) - 5v(k). -2k3 + 2k*2 + 2k Let u(l) = 14l2 - 8l. Let j(a) be the first derivative of -5a3/3 + 3a*2/2 - 594. What is 8j(s) + 3u(s)? 2s*2 Let j(f) = 146f*3 + 2f*2 - 4f + 2. Let i(a) = -437a3 - 7a*2 + 14a - 7. Calculate -4i(q) - 14j(q). -296q3 Let l(c) = -c3 - 4c*2 + 53c + 6. Let y(g) = g*3 + 3g*2 - 54g - 5. Determine 3l(m) + 4y(m). m*3 - 57m - 2 Let p(v) = -23v3 + 6v*2 + 9. Let q(b) = 68b*3 - 17b*2 - 27. What is -17p(x) - 6q(x)? -17x*3 + 9 Let k(l) = -321l*2 + 48l - 24. Let r(d) = 64d2 - 10d + 5. Determine -5k(o) - 24r(o). 69o2 Suppose -10l = -8l + 6. Let r be 0 - ((-18)/3 - l). Let z(u) = 8 + 3u - 4ur + 1 + 5u2 - 3. Let j(p) = p3 - p*2 - p - 1. Calculate -5j(h) - z(h). -h*3 + 2h - 1 Let i(u) = u*2 + 19u - 40. Let d be i(-21). Let r(a) = 2a2 + a + 2. Let j(q) = -9q*2 - 6q - 11. Calculate dj(g) + 11r(g). 4g2 - g Let c(a) = 3a2 + 1. Let o(r) = -r2 - r*2 - 11r*2 - 5. Let n be 3 + ((-3)/(-7) - 152/28). What is no(v) - 9c(v)? -v2 + 1 Suppose 25 = v + z, 3z - 2z = -5v + 129. Let a(k) = -2k + 1. Suppose 2u - 4 = -16. Let q(m) = -9m + 4. What is uq(o) + va(o)? 2o + 2 Let a(o) = o*2 + 8o + 1. Let n(k) = -9k. Let t(v) = 4a(v) + 3n(v). Let l(h) = -h - 5 + 4 - 2h2 + h2. What is 6l(u) + t(u)? -2u*2 - u - 2 Let p(z) = -2z + 1. Let g be -1 - ((-8)/20)/(6/(-15)). Let o(n) = -6n + 4. Calculate go(l) + 7p(l). -2l - 1 Let i(s) = -s*2 + 2s + 9. Let y(h) = h*2 - 2h - 10. Let b(x) = -6i(x) - 5y(x). Let v(d) = d*2 - 2d - 3. Calculate -5b(u) + 6v(u). u*2 - 2u + 2 Let i(k) be the second derivative of 7k4/12 + 5k*2/2 - 14k. Let p = 12 - 7. Let a(l) = -101l2 + 100l*2 + 0 - 1. Calculate pa(f) + i(f). 2f2 Suppose 15l = -44l - 59. Let g(h) = -7h*3 - 21h*2 - 21h + 21. Let o(y) = -y*2 - y + 1. Give lg(m) + 21o(m). 7m*3 Let w(g) = g. Let v be w(3). Let c(q) = 5q. Let a(p) = -12p. Let j(z) = -3a(z) - 7c(z). Let n(o) = -4o. Calculate vj(d) + n(d). -d Let x(w) = -2w*3 - 15w*2 - w - 1. Let c(g) = 3g*3 + 22g*2 + g + 1. What is 5c(i) + 7x(i)? i3 + 5i*2 - 2i - 2 Let p(f) = 76f + 214. Let w be p(-3). Let r(d) = -10d + 14. Let y(u) = -6u + 7. Let g(z) = z - 1. Let j(s) = 4g(s) + y(s). Determine wj(t) + 3r(t). -2t Let o(v) = v3 + v2 - v - 1. Let u(f) = 24f*3 + 11f*2 - 6f - 8. What is 6o(r) - u(r)? -18r*3 - 5r*2 + 2 Let h(t) = -330t. Let x(c) = c. Give -h(v) - 4x(v). 326v Let k = -496 - -489. Let d(j) = 14j2 - 2j. Let v(r) = -43r2 + 7r. Determine kd(u) - 2v(u). -12u2 Let g(s) = 2s*3 + 4s*2 + 2s + 2. Suppose 96x + 40 = 76x. Let c(l) = 6l3 + 13l*2 + 7l + 7. Give xc(b) + 7g(b). 2b3 + 2b*2 Let v(t) = 6t*2 + 5t - 5. Let x(y) = y*2 - 6y. Let a be x(9). Suppose -30k = -21k + a. Let i(l) = -3l2 - 3l + 3. Determine kv(r) - 5i(r). -3r2 Suppose -11v + 1264 = 1220. Let s(b) = 2b2 + 5b + 5. Let t(u) = u*2 + 3u + 3. Let y(i) = -3i + 2i + 2i - 2. Let w be y(-5). Determine vs(h) + wt(h). h2 - h - 1 Let q(s) = s - 1. Let u(r) = -2r. Determine -3q(f) - 2u(f). f + 3 Let l(i) = i2 + i. Let x(g) be the second derivative of g4/6 +	{ "pile_set_name": "DM Mathematics" }
= -19 - -14. Let t = -4 - -4. Let o = 0 + 1. Which is the nearest to t? (a) -0.5 (b) o (c) n a Let t = -128 - -126. What is the closest to 0.1 in t, 5, 1/3? 1/3 Let y = -1.02 - -0.02. Let w(d) = -d. Let t be w(-3). Which is the nearest to -0.1? (a) t (b) 1 (c) y c Let d be (-70)/(-25) + 2/10. Let x be 4 - (0/d - 1). Let g = 4 - x. What is the nearest to g in -2, -0.1, 2/5? -0.1 Let p = 12 - 17. Suppose 2k = -k - 12. Let f be (-6)/k2/(-6). What is the closest to -0.1 in -2, f, p? f Let v = -0.7 - 8.3. Let j = 8.3 + v. Let p = 0.3 - j. What is the nearest to -1/3 in 3, p, 5? p Let z = -3 + -3. Let j = z - -9. Let q = -0.144 + -0.056. Which is the nearest to j? (a) 3 (b) q (c) -1 a Let j = -78/5 - -16. Which is the nearest to j? (a) -4 (b) -2/3 (c) 5 b Let z = -3 - 27. Let u be (-11)/6 + 5/z. Let g = -1 + 0. Which is the closest to g? (a) 0.5 (b) u (c) 0.3 b Let h = -97 - -389/4. Which is the closest to -4? (a) -4 (b) h (c) -2 a Let l = -0.053 - 2.047. Let r = -2 - l. Let o = -0.029 - -5.029. Which is the closest to r? (a) 0.5 (b) -4 (c) o a Let g = 165 - 822/5. Let y = -1 - 0. Let u = -0.6 - -0.2. Which is the closest to 0? (a) u (b) g (c) y a Let d = 1 + 14. Let j be ((-2)/(-5))/(d/(-25)). Which is the nearest to j? (a) 1 (b) -2/5 (c) 5 b Let x = 8.9 + -9.3. Suppose l + 3l + 20 = 0. Which is the closest to -0.2? (a) x (b) -3 (c) l a Let o be (2 + (-11)/6)2. Let v(y) = -y - 10. Let m(d) = 1. Let k(r) = -5m(r) - v(r). Let g be k(0). What is the closest to -0.1 in g, o, 2? o Let r = -39 + 36. Let h(c) = -c2 - 7c - 7. Let z be h(-6). What is the nearest to 2/3 in z, -2/7, r? -2/7 Let v be (1 + -1)/(4 + -6). Let z = 0.07 - 4.07. What is the nearest to -0.1 in z, v, -1? v Let q = 1.94 + 0.06. Which is the nearest to -0.1? (a) -1 (b) -2 (c) q a Let d be -1 + 0/3 + 4. Let i = 0.1 + 0. Which is the closest to i? (a) d (b) -2 (c) 0.5 c Let u = -86 + 89. Which is the nearest to 2? (a) -1 (b) u (c) 0.2 b Let w = -209/1544 - -2/193. Let l = 2 + -3. Which is the closest to l? (a) w (b) -0.3 (c) -1 c Suppose 9 = -6r - 9. What is the nearest to -1/2 in -1/4, -2, r? -1/4 Let z = 3.9 - 2.9. What is the nearest to z in 2, -1/2, 2/5? 2/5 Let w = 1 + 6. Let z be (-2)/4(-8 + w). Suppose 3v = 8 - 2. Which is the nearest to v? (a) z (b) 0 (c) -0.1 a Let k = 1.1 - 5.1. What is the nearest to 6/5 in 0.4, 1, k? 1 Let z = -0.7 - -0.4. Let w = 1 - 0.9. Which is the nearest to w? (a) 1/3 (b) z (c) -1/3 a Let j = 248/45 - 27/5. Let n be ((6-3)/(-3))/(-2). What is the nearest to 0 in n, j, 5? j Let r = 18444 + -3596702/195. Let t = r - -1/39. What is the nearest to 0.2 in 4, t, 4/7? 4/7 Let n be (-2)/10 + (-24)/40. What is the closest to 1 in 5/3, 2, n? 5/3 Let s = -63 - -443/7. What is the nearest to 1/4 in 2, 1/2, s? s Suppose 5k - 759 = 4c, -k = -c - 5k - 216. Let q = -1376/7 - c. What is the nearest to 1 in q, 0.1, 0.4? 0.4 Let i(r) = -r2 - 4r + 21. Let z be i(-7). Which is the nearest to 1? (a) -4 (b) z (c) 0.1 c Suppose 70 = 4o - 2v, -4v + 8v = 4o - 72. Let p = -13 + o. What is the nearest to -1/3 in p, -1, -0.4? -0.4 Let q be (-2)/(-5)(-65)/(-117). Which is the closest to q? (a) -5 (b) -0.4 (c) 5 b Let l = 0.1 - 0. Let g = -5.03 - -0.03. Let b = 212 - 211. What is the closest to b in g, -1/7, l? l Let h = -0.09 - -1.09. Suppose -1 = -5n - d - d, -3n + 5 = -d. Let x = n - 3. What is the closest to -1 in 1/6, h, x? x Suppose q - 4 = 1. Let h(a) = a*3 - 4a*2 - 4a - 6. Let k be h(q). What is the closest to 0 in 4, k, -5? k Suppose 0u = -3u - 6. Let n = 0.44 - 0.04. What is the closest to -1/3 in u, n, 0.2? 0.2 Let d = 2 - 2.1. Let r = -8 + 11. Which is the nearest to d? (a) -3 (b) 2/3 (c) r b Let g = 2.71 + 1.29. Which is the nearest to 2? (a) -1 (b) g (c) 1 c Let w = 0.141 + -0.441. Let c = -0.9 + 1. What is the nearest to -2 in 3, c, w? w Let b be ((0/2)/(-2))/(-2). Let m = -1.002 + 1.102. What is the nearest to m in -5, b, 3? b Let d = 0.42 - 0.02. Let w be 31/182. Which is the nearest to -2/7? (a) d (b) w (c) 4 b Let q = -78 - -75. Which is the closest to -6? (a) 0.4 (b) q (c) 0.3 b Let p = 1.7 + -1.9. Let r = -0.41 + 3.11. Let y = 3 - r. Which is the closest to 0.1? (a) 2 (b) y (c) p b Let r be (12/14)/((-8)/(-28)). What is the closest to 1 in -5/3, 2, r? 2 Let l = 3.1 + -6.1. Which is the closest to -1? (a) l (b) 0.1 (c) 1/3 b Let s be 6/14 + ((-3)/3)/1. Which is the closest to 0? (a) s (b) 10/7 (c) 2/7 c Let i = 9 + -17. Let h = -7.9 - i. Let o be (-4 - -2)(-1)/2. Which is the nearest to h? (a) 6/11 (b) o (c) 2/3 a Suppose 6k - 4 - 2 = 0. Which is the nearest to -4? (a) -2 (b) -5 (c) k b Let x = 0.77 - 0.27. Let p = 4.95 + -5. Which is the nearest to p? (a) x (b) 5 (c) 2/5 c Let s = 2 - -3. Let g = -0.08 - 2.92. Let j = g - -2.8. Which is the nearest to -2/7? (a) s (b) j (c) -0.5 b Let l = -0.3 - -0.4. Let d = -0.87 + 0.07. Let a = d - 3.2. What is the closest to l in -1, -3/2, a? -1 Suppose -3l = -l - 6. Let k be 2l/(-6) - -2. What is the nearest to -1/2 in -1/9, 1/2, k? -1/9 Let u = 7 + -9. Let d be 3 - 3/(-6)0. Suppose 5y - 7 = d. What is the nearest to 1 in y, u, 0.4? 0.4 Let u = 4 + -4.3. Which is the nearest to 1? (a) u (b) 3 (c) 1 c Let w = -0.7 - -1. Suppose -5q = 4f - 19, 2q = 4f - 2f + 4. Let o(d) = -d - 2. Let r be o(2). What is the closest to 1 in w, f, r? f Let t = -11/6 - -7/3. What is the closest to -3 in -3/7, -0.1, t? -3/7 Let p = -14.5 + 15. Let k = -0.1 - 0.1. Let n = k + 0.1. Which is the closest to n? (a) -0.1 (b) p (c) 1/3 a Let i be 4/10 + (0 - 0). Let h be 4/(-18) + (-24)/(-27). Let m = -1 - -1. Which is the nearest to i? (a) -2 (b) m (c) h c Let o = 4.4 - 0.4. Let z = 8 - o. Let m = 2 + -3. Which is the closest to m? (a) 0.3 (b) z (c) -5 a Let k = 0.4 + -0.36. Let p = k - 0.44. Let f = p + 0.4. Which is the closest to 0? (a) f (b) -3 (c) 4/5 a Suppose 2b - 5d - 1 = 0, -3d + 10 = 3b - 2. Suppose 4q + b = q. What is the nearest to 2 in 4, -5, q? 4 Let g = 2/9 - -5/18. Let x = 116.5 - 117. Which is the closest to 0.1? (a) x (b) 1 (c) g c Suppose -6z + 2z = 4. Let h = -4.87 + -0.13. Let q = -0.5 + 0. Which is the closest to z? (a) h (b) q (c) -0.2 b Let y = 2/91 - -85/273. Let b = -1 - 0. Let h = 4 + b. What is the nearest to y in -0.2, h, 1? -0.2 Let w = 2.932 + 0.068. What is the closest to 3 in -5, w, -3? w Let q = 9.1 + -9. Let g be -1 + (14/(-10) - -3). What is the closest to 1 in q, 0.5, g? g Suppose -3s = 3g + 3, 0s + s = g + 9. Which is the nearest to -1? (a) s (b) -3 (c) -1 c Let t = -2 + 3/2. Let z = -2/29 - 23/87. What is the nearest to z in -1, 1/6, t? t Let s = 14 + -3. Let d = s + -11. What is the closest to d in 1/4, 0, 1? 0 Let h = -159 - -1114/7. Which is the closest to 3? (a) -0.2 (b) h (c) -2 b Let j = -0.91 - 0.09. Which is the closest to -0.2? (a) j (b) -0.2 (c) -2/9 b Let k = 19 + -17. Let y be 29/(-95) - 1/(-5). Which is the closest to k? (a) 3 (b) -3 (c) y a Let z = 1 + -0.8. Let j = 453/5 + -90. Which is the nearest to 2/7? (a) 5 (b) j (c) z c Let n = 12 + -11. What is the nearest to -0.1 in n, -2/3, 2? -2/3 Let d = 15382/15 - 1023. Let n = 19/5 - d. Suppose -3w + 5 = 2. What is the closest to -1 in 3, w, n? w Let q = 5 - 3. What is the nearest to 1 in q, 3, 1/2? 1/2 Let t be 2/(40/12 + -4). Which is the closest to 0.3? (a) t (b) 0.1 (c) 1/4 c Let p(s) = s*2 - 13s + 13. Let r be p(12). Which is the nearest to -5? (a) r (b) -0.3 (c) -0.1 b Let x = 160/3 + -54. Which is the closest to 1? (a) 3 (b) 2/5 (c) x b Let d = -1.07 + 1. Let j = -0.37 - d. Let m = 15 + -11. What is the nearest to 1 in j, 0.3, m? 0.3 Let a be 120 - 1(3 + -2). Let b be 20/a - 12/42. Let r = 0.1 + -0.2. What is the closest to r in -0.2, b, -2? b Suppose -12 = 5q - q. What is the nearest to 2 in 2, -5, q? 2 Suppose -7o + 20 = 3o. Let p = 6 - 5.7. Which is the closest to o? (a) p (b) -2/3 (c) 0.1 a Let f = -3 - -2.8. Let o = -3.9 + -0.1. Let i = 4.5 + o. Which is the closest to 0? (a) i (b) f (c) 0.4 b Let n = 277/5 - 55. What is the nearest to n in 0.1, 4/3, -0.3? 0.1 Suppose s = 5*s. Let m = s + 0. Let n = -70/37 + 992/407. Which is the nearest to m?	{ "pile_set_name": "DM Mathematics" }
rounded to the nearest 10? -110 Let z = -9.2 - -7.77. Round z to 1 decimal place. -1.4 Let c = 674.1 - 624. Let m = c - 54. What is m rounded to 0 dps? -4 Let w = 0.58 - 0.8. Let t = 0.2200009 + w. Round t to 6 decimal places. 0.000001 Let u = -42 + 88. Let b = 45.858 - u. What is b rounded to two dps? -0.14 Let s = 0.4038 - -0.0592. Let y = s - 244.463. Let h = y - -245.59. Round h to one dp. 1.6 Let a(w) = 2w. Let m be a(-2). Let j be (-30400004)/(-16) + 1/m. What is j rounded to the nearest 1000000? 2000000 Let v = -28.19722388 + 47.1972246. Let z = 19 - v. What is z rounded to 7 dps? -0.0000007 Let f = -24.57 - -0.57. Let i = f - -24.001. Round i to 2 decimal places. 0 Let x = -0.68 + 41.68. Let n = x - 41.00049. Round n to four dps. -0.0005 Let l be -6 - -10 - (-2 - -4). Suppose lr - 3g - 15388 = 0, 2r - 15380 = g + 4g. Round r to the nearest one thousand. 8000 Let k = 962103844.1 + -962103985.10000067. Let f = 3.16 - -137.84. Let i = f + k. Round i to seven decimal places. -0.0000007 Let u = -2.6176 - -2.6. What is u rounded to 3 dps? -0.018 Let t = 7.00000108 - 7. Round t to 7 dps. 0.0000011 Let s = 8 - 9. Let t = -266.005 - -265. Let h = t - s. Round h to two decimal places. -0.01 Let o be 0 - (-1 + (5 - 1)). Let l be o/(6/4) - 2. Let h(g) = 17g + 4. Let b be h(l). What is b rounded to the nearest 10? -60 Suppose -3m - 3j + 4821 = -0m, 0 = -5m - 3j + 8041. What is m rounded to the nearest 100? 1600 Let l = -25 - -13.8. Let k = l - -11.20061. What is k rounded to four dps? 0.0006 Let j = -59 + 95. Let q = 56 - j. Let n = q - 19.99999961. What is n rounded to seven decimal places? 0.0000004 Let n(c) be the first derivative of c4/24 - c3/3 - c2 + 1. Let w(d) be the second derivative of n(d). Let j be w(2). Round j to the nearest 1000. 0 Suppose -24 = -z + 3z. Let c be (-20399 - 1)/(z/40). Round c to the nearest 10000. 70000 Let r = 35.62 - 36. Round r to 1 decimal place. -0.4 Let u = 19 - 5. Let d be 1/(u/(-8) - -2). Suppose 1 = -n - g, n - 2g + 2 = -dg. Round n to five decimal places. 0 Let h = 0 + 2. Suppose 5u - hv = u + 44090012, -2v + 55112506 = 5u. Suppose 47477498 + u = -5f. Round f to the nearest one million. -12000000 Let v be 2 + -193002 + -1(3 + -3). What is v rounded to the nearest 10000? -190000 Let u = 6674.2083 - 6659. Let j = 14.56 - -0.64. Let g = j - u. What is g rounded to three dps? -0.008 Let j(a) = 3a3 - a2 + 2a - 1. Let x(m) = m - 2. Let v be x(3). Let n be j(v). Let r be 6/9 + 2338/n. What is r rounded to the nearest one hundred? 800 Let t = -0.04 - 3.96. Let z = t - -3.95. Let i = -0.049904 - z. Round i to five decimal places. 0.0001 Suppose 5v - 338508 - 193007 = 0. Let z = 37011 + 20292. Let m = z - v. What is m rounded to the nearest 10000? -50000 Let t(v) = v - 3. Let g be t(4). Suppose 4s - g = -5. What is s rounded to the nearest ten? 0 Suppose -5u + 0u - 5 = 0. Let m be u/(-2) - 945/6. Let z be (-2)/8 - m/4. Round z to the nearest 10. 40 Let x = -112244.09993 - -112245. Let t = x - 0.9. What is t rounded to four decimal places? 0.0001 Suppose -f + 1 = -10. Suppose -f - 29 = -4p + 4l, -p + 22 = -4l. What is p rounded to the nearest integer? 6 Let y = -15 + 19. Suppose yw - 90 + 220090 = 0. What is w rounded to the nearest ten thousand? -60000 Let t = -1079.2 + 1085.543. Let f = -0.043 + t. Round f to 0 decimal places. 6 Let n = -29 - -29.000044. Round n to 5 dps. 0.00004 Let r = -7249 - -4727. Let b be r/(-3) + (-4)/6. Suppose -2m = -0m + b. What is m rounded to the nearest one hundred? -400 Let h = 109343 - 218343. What is h rounded to the nearest 10000? -110000 Let m = 37662.2058 - 37666. Let w = 3.8 + m. What is w rounded to 3 decimal places? 0.006 Let d = 0.032 - 0.106. Let x = d + -0.015. What is x rounded to two decimal places? -0.09 Let w = -58.9 - -0.9. Let y = w + 42.5. What is y rounded to 0 decimal places? -16 Let s = -23 + 29. Let j = 373.68 - 380. Let t = j + s. What is t rounded to one dp? -0.3 Let m = 0.19 - 0.05. Let u = 7.16 - 6.6. Let i = u + m. What is i rounded to one dp? 0.7 Let q(a) = a*2 - 306. Let x be q(0). Let c = 1276 + x. What is c rounded to the nearest one hundred? 1000 Let y = 3 + -3. Suppose yd - 3d = 5286. Let m = -452 - d. What is m rounded to the nearest 100? 1300 Let k = -5 - -13. Let y be 2/k - (-993)/12. Round y to the nearest ten. 80 Let l = -78.4 - -72. Let b = l - -6.400037. Round b to five dps. 0.00004 Let n = -248201 + 248205.00004. Let j = 4 - n. What is j rounded to 5 dps? -0.00004 Let t = 5717691044.4429948 + -5717689463. Let b = t + -1581.753. Let y = 0.31 + b. Round y to 6 dps. -0.000005 Let r = 0.3164 + -0.33. Let g = 0.003 + r. Round g to 3 dps. -0.011 Let p = -2 + 7. Suppose -2t = -5z + 94 + 254, -pt + 75 = z. Let y = -26 - z. Round y to the nearest 10. -100 Let q(u) = 2u + 2u*2 + 3u + 8u2. Let v be q(-8). Let t = 260 - v. Round t to the nearest one hundred. -300 Let i = 0.31 - 1.61. Let v = i + 1.296. Round v to three decimal places. -0.004 Let k = -21684 + 67684. Round k to the nearest 10000. 50000 Let f = -2.3 - -1.7. Round f to 1 decimal place. -0.6 Let v = 1 + 6. Let y = v + -7.005. What is y rounded to two decimal places? -0.01 Let u = -2 + 0. Let c = 372629.0000064 - 372627. Let o = c + u. What is o rounded to six decimal places? 0.000006 Suppose 2i + 0i - n + 226156 = 0, 3n - 452310 = 4i. Suppose -l = -3l - 114158. Let r = l - i. What is r rounded to the nearest ten thousand? 60000 Let n be ((-2)/(-3))/(4/(-42)). Let j be (n/(-1) - 3)/2. Suppose 2m = -j - 2. What is m rounded to the nearest integer? -2 Let d = -2 + 2. Suppose 3x - 24 - 99 = d. Suppose 3w = -x + 8. What is w rounded to the nearest 10? -10 Let c(b) be the second derivative of -1813b5/10 - b4/6 - b*2/2 - 2b. Let v be c(-2). Let j be v - -1(2 + -1). What is j rounded to the nearest 10000? 30000 Suppose w - 1672 = -w. Let s be (-450)/4w/57. What is s rounded to the nearest one hundred? -1700 Let l = 255.147 + -255. Let d = -0.14627 + l. Round d to 4 decimal places. 0.0007 Suppose -4o - 4n - 32 = -9o, 3o + 2n = 6. Suppose -2q = 3q + 185. Let t be o/(-6)(q + 4). Round t to the nearest 10. 20 Suppose 0 = -2k - 4, -2v = 2v - 2k + 1844. Round v to the nearest 100. -500 Let i = -0.3 - -0.1. Let x = -0.199955 - i. Round x to five decimal places. 0.00005 Let b = -0.09 - 4.91. Let q = 5.1 + b. Let w = -0.10024 + q. Round w to four dps. -0.0002 Let j(h) = -1040h. Let d be j(-5). Round d to the nearest 1000. 5000 Let m be 21/(-2)(-22)/(-3). Let q = 135 + m. What is q rounded to the nearest 10? 60 Let p = -3.9334 + 3.61426. Let z = 0.17 - -0.15. Let b = p + z. What is b rounded to four dps? 0.0009 Let f = -2.8 - -1.1. Let l = 85270935 + -85270936.70000052. Let s = f - l. Round s to seven dps. 0.0000005 Let a(v) = v*3 - 8v*2 - 14v - 8. Let r be a(10). Let b = 26 + -5. Suppose -5q + r = -2d, -b = -3q + q + d. Round q to the nearest 100. 0 Let x = -1754.15 + 1754.064081. Let j = -0.086 - x. What is j rounded to 5 decimal places? -0.00008 Let q = 32.32 + -33. Let p = -284.62 + 288. Let j = p + q. What is j rounded to 0 decimal places? 3 Let f be 4/24 - 93/18. Let r(z) = 959z - 5. Let p be r(f). Round p to the nearest one thousand. -5000 Let k(q) = 665q2 - 3q. Let a be k(2). Let l be a/(2(-1)/3). Let m = 219 - l. Round m to the nearest one thousand. 4000 Let v = -18 - -24. Let k = -6.0000024 + v. What is k rounded to 7 decimal places? -0.0000024 Let z = -6 + 6.92. What is z rounded to 0 decimal places? 1 Let p = -589.6472 + 644.64757. Let x = -55 + p. Round x to 4 dps. 0.0004 Let n be (-6)/15(-3 - 952). Suppose n = 2z + 1302. Round z to the nearest one hundred. -500 Let g(x) = x2 - 5x - 3. Let i be g(6). Let v(m) = 88888m2 + 4m - 4. Let k be v(i). What is k rounded to the nearest one hundred thousand? 800000 Suppose 21243919 - 128243919 = 10*h. What is h rounded to the nearest 1000000? -11000000 Let d = 3.1 - 2.89. Let p = 0.27 - 0.4. Let t = d - p. What is t rounded to 1 decimal place? 0.3 Let r = 11633622.966 + -11620046. Let f = r - 13557. Let y = -20 + f. What is y rounded to two dps? -0.03 Let r = 29.41 - 30. Let y = 3 + -3.17. Let b = r - y. Round b to one dp. -0.4 Let j = -2.5 - -1.46.	{ "pile_set_name": "DM Mathematics" }
0 Rearrange (a - a + 2a)(-4 + 0 + 1) - 5775a - 778a - 2501a - 1102a to b + pa and give p. -10162 Express 3d*3 - 47 - 2d*2 - 112d + 111d + 3 + 6 in the form l + gd*2 + cd*3 + ad and give a. -1 Rearrange -1814q - 1199q - 1266q - 435q - 456q to the form vq + y and give v. -5170 Express -2g + 76398g*2 - 12 - 76387g*2 - 2 as ig*2 + pg + s and give i. 11 Express 946a - 4444a - 8375a - 1689a + 1854a as qa + h and give q. -11708 Express -8721a + 3923a - 5921a in the form h + ba and give b. -10719 Rearrange (8x2 - x2 + 37x*2 + (2x2 - x2 + 4x2)(2 + 2 - 1))(1 - 2x - 1)(0 + 0 - x) to the form m + cx*3 + vx*4 + dx + qx2 and give v. 118 Express 4f2 - 464 - 467 + f4 - 11f3 + 1416 - 2f - 466 - f*2 as pf + yf4 + lf*3 + a + kf*2 and give y. 1 Rearrange 2s + 6s - 3s - 11s - 3 - 13 to u + ks and give k. -6 Express -6a2 + 77a - 210a - 23a*2 + 74a + 69a in the form da*2 + h + ga and give d. -29 Rearrange -235k - 3496 - 3528 + 7024 + 4k*2 to xk + s + tk2 and give t. 4 Express -2n - n + n + (0n + 0n + n)(1 - 2 + 3) + 2n - 2n + 2n + 31n + 0n + 15n - 8854 - 61n + 8854 as y + xn and give x. -13 Express (-2 + 1 + 2)(-979q + 3765q + 2291q) in the form vq + c and give c. 0 Express -5k4 - 278 + 2k + 3k2 + 3k4 - k3 + 9k4 - 2k*2 + 281 as gk*4 + jk*2 + a + lk + xk3 and give x. -1 Express (-8d + 5 - 5 - 2d + d - d + (5 - 4 - 3)(-4d + 3d + 3d))((d + 0d + d)(3 + 2 - 3) - 21d + 50d - d) as fd2 + ad + x and give f. -448 Rearrange 3 - 311l2 - 98l*3 + 647l*2 - 332l*2 to the form al*2 + w + yl + nl3 and give w. 3 Express -1123p*3 - 33p - 10 + 32p + 1117p*3 + 8 - 1621p*2 as vp*2 + bp*3 + t + sp and give b. -6 Express (-3x + 15x + x)(3 - 3 - 2) - 403x + 201x - 380x + (1 - 3 + 1)(-3x + 3x - 2x) - 3x + 4x + x in the form g + ox and give o. -604 Express (129r - 117r + 94r - 2)(-1 - 2 + 0)(r - 3r + r) as wr + br2 + j and give b. 318 Express 48d - 8d - 3d*2 + 3d*3 - 2d*3 - 2713 + 2699 + 28d as vd3 + t + yd + id2 and give y. 68 Express (539 + 161 + 19)(-2t2 + t2 + 0t*2) + (3t - t - 4t)(0 + 0 + 2t) as vt + qt2 + l and give q. -723 Rearrange 16 + 1 - 25 + 22 + 49l to xl + j and give x. 49 Express -10t*4 - 4t2 + t3 + 2t4 - 1 - 102t + 81t - 4t*4 + 8t*4 in the form jt*4 + pt*3 + x + nt + ut2 and give p. 1 Rearrange -142796z + 4 + 71816z + 71835z to tz + n and give n. 4 Express -26600k*2 - 3k + 26599k2 - k - 1355 as z + xk + sk2 and give z. -1355 Rearrange 19d + 14 - 17 + 16 + 5 to q + vd and give v. 19 Express (-14j - 11j + j)(-36j - 11j - 11j)(4j2 + 5j*2 - 2j*2) in the form oj*3 + n + pj*4 + zj*2 + tj and give p. 9744 Express 5m3 + 26m + m*4 + 4m - 16m in the form km + tm2 + sm*4 + p + vm*3 and give v. 5 Rearrange (1505o - 264o - 558o)(0o*2 + 3o2 - o2) to ko2 + uo*3 + so + i and give u. 1366 Rearrange -167c - 23 - 47c + 4c2 - 2c*2 + 18 + 56c to the form wc + pc*2 + l and give w. -158 Express 597 + 546 - 1788 + 592 - 96d + (-1 + 1 + 2)(3d + d - 3d) in the form cd + a and give c. -94 Express (1 - a*2 - 1)(540251 + 2497a - 540251) as k + pa*3 + ha + ia2 and give p. -2497 Express 1604436 - 118f*2 - 1604436 in the form mf*2 + xf + q and give x. 0 Rearrange -4c + 1 - c - 6c - 5c + 5c - 4c + (-18 - 38 + 82)(11 - 4c - 11) - c - 2c + c to the form mc + z and give m. -121 Rearrange -1475m*2 + 4020m*2 + 2016m*2 + 5047m*2 to the form am + x + tm2 and give t. 9608 Rearrange -11z - 48 + 48 + (-z - 4 + 4)(6 - 4 + 6) + 0z + z + 5z to the form a + cz and give a. 0 Rearrange (-20q + 175 - 175)(-37q2 - 49q*2 - 22q*2)(q - q - q) to the form yq3 + dq*4 + fq*2 + o + pq and give f. 0 Express (2 - 2 - c*2 + (5 - 5 - 2c)(-6c + 2c + 2c))(-1063c + 2985c + 873c)(-2 + 2 + 2) as zc*2 + wc + y + oc3 and give y. 0 Rearrange -45 + 2n + 12n2 + 353n*4 - 355n*4 - 10n*3 - 14n*2 to pn + bn2 + xn*4 + m + kn*3 and give m. -45 Rearrange (4i*2 + 0i*2 - 2i*2)(-5i2 + i2 + 2i*2)(0 + 3 + 1)(1168 - 6526 - 15780) to the form ni + li3 + b + oi*2 + ai*4 and give a. 338208 Express -383h*3 + 24 - 2h*4 + 763h*3 - 383h*3 - 32 + 10h as qh2 + th*3 + ih + o + jh4 and give o. -8 Express ((-2d - 2d + 2d)(-d + d - 2d) + (-d - 6d + 5d)(-3d + 0d + d))(18 + 87 + 305)(2 - 2 + 6)(2 - 3 - 3) in the form q + fd2 + hd and give q. 0 Rearrange (1 - 1 + 2)(-5w + 2w - 1597w*3 + 1821w*3) + 3w*3 + 3w*3 - 2w*3 to dw + bw2 + y + kw*3 and give k. 452 Express 5 - 45 + 36 + 2 + 2132x*2 as h + ax + yx2 and give h. -2 Express -69p + 950p2 + 139p - 70p - 297p*2 as zp*2 + m + xp and give x. 0 Express 968o - 962o + 1582o3 - 1579o3 - 3 + o4 in the form mo3 + vo + lo4 + y + bo*2 and give y. -3 Express 9u*2 + 145u*4 + 86925 - 86948 - 143u*4 in the form m + hu*3 + ju*4 + zu + yu2 and give y. 9 Express 50 + 1258j*2 - 50 + 2778j*2 + 3754j*2 as yj + t + oj2 and give o. 7790 Rearrange t - 37t + 2094 - 2087 to g + it and give i. -36 Rearrange 2043w*2 - 1024w*2 - 10w*4 - 1001w*2 + 2 to the form uw + tw2 + dw*4 + vw*3 + a and give t. 18 Express -73g - 419g + 11307g as vg + r and give v. 10815 Rearrange 4p*2 - 34 - 29p*3 - 2p + 37 + 33p3 to the form gp*3 + kp + zp2 + q and give k. -2 Rearrange 291w*2 - 54w*3 + 34w*3 - 1 + 23w*3 - 294w*2 - 23w - 1 to zw + u + tw*3 + dw*2 and give d. -3 Express 889r*2 + 1799r*2 + 2195r*2 - 1272r*2 in the form s + tr*2 + wr and give t. 3611 Express (5t - 2t - t + (10t - 19t - 18t)(-43 + 119 - 63))(0 + 3 - 1)(-2t3 - 2t*2 + 2t*2) as wt*2 + j + xt*3 + kt*4 + zt and give k. 1396 Express -199l - 515l - 489l - l3 - 19l + 205l - 1 as nl + c + bl3 + zl*2 and give c. -1 Express 31 - 13 - 549h + 1549h - 16 as oh + c and give c. 2 Rearrange -7342j - 11184j + 3670j + 2045j to lj + u and give l. -12811 Rearrange -922k + 28 + 108 + 918k to jk + a and give j. -4 Rearrange 6w2 - 3w*2 - 2253 + 0w*2 + 182 to the form yw + uw2 + l and give u. 3 Rearrange (-463 + 1770 + 1420)(d + 0d + d) to the form v + md and give m. 5454 Express (2 + 2 - 2)(3k - 5 + 5) + 211 - 163k + 351k - 189k as wk + h and give h. 211 Express -30420h + 30422h - 1 - 111 in the form v + xh and give v. -112 Express (-5 + 5 - 3u)((1 + 6 - 1)(0 + 103 + 40) - 2 + 2 + 2) as wu + v and give w. -2580 Express 47 + 47 - 188 + 707d + 42 + 48 in the form gd + o and give o. -4 Express (0p3 - p3 + 0p3)(-7 + 9 + 6) - 104 - 6p3 + 104 + 9p*3 + 103 - 103 in the form xp*3 + hp + mp2 + b and give b. 0 Express 25f*3 + 18f*3 - 118f - 2 + 27f3 - 68f*3 - 5f*2 + 8f*2 in the form gf*2 + jf + vf3 + r and give g. 3 Rearrange 21r*2 + 27r2 - r2 + (0 + 0 - 2r)(-6r - 1191 + 1191) to the form mr*2 + x + ir and give i. 0 Rearrange (-866i + 244i + 152i)(i + 2i - i) + 3i*2 + 2i*2 - 7i*2 + 0i + 0i - 2i2 - i2 + 6i2 - 28i*2 to m + bi + qi2 and give q. -967 Express (512 - 512 + 83m*3)((0 + 0 + 1)(5 - 5 + 8m) - m + 0m + 4m) as cm + dm*2 + y + om*3 + jm*4 and give j. 913 Rearrange 11j + 2j + 11j + 3 - 3 - 2j + (-4 + 4 - 2)(0 + 0 - 2j) + 9j + 4j - 4j - 2j - 1 + 1 to f + lj and give l. 33 Rearrange 278b2 - 22 + 1581b*2 + 10 + 12 to the form qb + p + kb2 and give k. 1859 Rearrange (12 - 1 - 7 - 4 - 31b + 2b)(-142 - 520 + 231) to hb + k and give h. 12499 Rearrange (231 + 241 - 275 + 255)(5d + 4d - 6d)(0d + 0d - d*2)(2 - 4d - 2) to the form td*2 + f + gd*3 + yd + pd4 and give p. 5424 Rearrange (5j + j*2 + 2j*3 + 5j*3 - 8j)(151j + 237j + 189j) to the form f + pj + rj*3 + ij*2 + nj*4 and give n. 4039 Rearrange 61511y - 122956y + 64966y to h + my and give h. 0 Rearrange 474 - 35z*2 + 24z*3 - 3z - 20z3 - 473 to the form mz*3 + jz*2 + sz + v and give v. 1 Rearrange 0 -	{ "pile_set_name": "DM Mathematics" }
62 - x. List the prime factors of j. 409 Let u(q) = q*3 - 11q*2 + 20q - 5. Let h be u(10). Let o(f) = hf + 12f*2 - 5 - 105f + 0. What are the prime factors of o(-4)? 227 What are the prime factors of 11 + 16/((-80)/(-13185))? 2, 331 Suppose 3n - 104390 = 4d + 4d, 0 = -n + 4d + 34790. List the prime factors of n. 2, 5, 59 What are the prime factors of ((-62)/3)/(((-4)/(-2450))/(9/(-15)))? 5, 7, 31 Let c(n) = -5n2 + 4 + 16 + 15n + 7n2 + 24. List the prime factors of c(-16). 2, 79 Let r = 3413 - -7560. What are the prime factors of r? 10973 Suppose -3m - 743 = -g, -221m = -217m + 12. List the prime factors of g. 2, 367 Suppose 0 = 51x - 55x + 216. Suppose 8y = 2y + x. Suppose -m - y = -112. List the prime factors of m. 103 Let n = 57 - 53. Let g(a) = 114a2 - 4a + 10. Let z be g(n). List the prime factors of z/15 + (-16)/(-20). 2, 61 Suppose -i + 4i = 3l + 6516, 5i + 2l = 10888. Suppose 0 = 4t + 2v - 2830, 3t + 3v + 49 = i. What are the prime factors of t? 2, 353 Let v(y) = 13y - 16. Let s(a) = a2 + 3a + 2. Let d be s(0). Suppose -dn - 4 = -22. List the prime factors of v(n). 101 Let q = 1133 - 779. Suppose -360t + qt = -3222. List the prime factors of t. 3, 179 Let o = 1230 + 25. Suppose -4d + o - 307 = 0. What are the prime factors of d? 3, 79 Let v be ((-6)/(-2))/(((-42)/8)/7). Let f(q) = -2q3 - q2 + 3q - 4. Let l be f(v). Suppose -7w = -443 - l. What are the prime factors of w? 7, 11 Let n be -1 - ((-17)/5 + 39/(-65)). List the prime factors of (-91/6)/(n/(-376)). 2, 47 Let c(f) = f*2 + 17f + 63. Let r be c(-14). Suppose rt - 3t = 3708. What are the prime factors of t? 2, 103 Suppose -397 = -2t - 3m, 5t + m - 539 = 447. Let z = 146 + t. List the prime factors of z. 7 What are the prime factors of (5/((-30)/76))/(-9 + 236390/26268)? 2, 19, 199 What are the prime factors of ((-7)/(77/(-44)))/(16/182564)? 45641 Let p = 52 + -48. Suppose -pj + 0k = k - 45, 5k = 4j - 15. Suppose 2c = -j + 130. List the prime factors of c. 2, 3, 5 Suppose -7m - 3m + 9760 = 0. Let b be 2/182 - m/(-144). Suppose v = 28 + b. What are the prime factors of v? 5, 7 Let v(g) = -g3 + g2 - 3g + 19. Let z be (-2 - (6 - -2))/(0 - -2). List the prime factors of v(z). 2, 23 Let r(y) = -7y + 13. Let k be (-4)/5 + (-216)/(-20). Let i be (k/25)/((-4)/140). List the prime factors of r(i). 3, 37 Let v(d) = d3 + 11d*2 + 10d. Let o be v(-10). Let i = o - -10. List the prime factors of 679/35 - (0 + 4/i). 19 Let a = 609 - 629. List the prime factors of 9/(-36) + (-22105)/a. 5, 13, 17 Let v(z) = 263z - 178. Let d be v(10). Let a = d - 1582. What are the prime factors of a? 2, 3, 5, 29 Let s(r) = 15533r*2 - 70r - 69. What are the prime factors of s(-1)? 2, 3, 863 Let c = 27316 - -3066. What are the prime factors of c? 2, 11, 1381 What are the prime factors of ((-36)/(-27))/((-9)/(-54)) + 53908? 2, 3, 4493 Let n(y) = 9y2 - 3y - 2. Let u be -2 + (-45)/6 + (-3)/6. Let k be (-25)/(-10)12/u. What are the prime factors of n(k)? 2, 11 Let d = 0 - 14. Let p(g) = -g3 - 12g*2 - 8g - 1. What are the prime factors of p(d)? 503 Suppose -4081c + 4083c = 67280. What are the prime factors of c? 2, 5, 29 Suppose 0 = -2n - 10r + 5r - 1302, 2r - 1288 = 2n. Let p = -400 - n. List the prime factors of p. 2, 3, 41 Suppose 2634524 = -71s + 177s. What are the prime factors of s? 2, 17, 43 Let u(i) = 206i*2 - 28i + 1461. What are the prime factors of u(-19)? 3, 25453 Suppose -5x + 2895 = -5k, -3x - 2k + 1772 = 2k. Suppose j + 3u - 647 = 0, j - 5u - 87 = x. What are the prime factors of j? 2, 41 Suppose 15u = 24u - 351. Let k = u - -592. What are the prime factors of k? 631 Let w = 48391 - 26869. What are the prime factors of w? 2, 3, 17, 211 Let s = 23 + -21. Let h(x) = -x3 + 11 + 11x*2 + 5x*2 + 20x - x + 0xs. What are the prime factors of h(17)? 3, 5 Let a(x) = 2x*2 + 5x - 16. Let c be a(-7). Let j = c + -31. Suppose 15v = jv - 95. List the prime factors of v. 5, 19 Suppose k - 2o - 5379 = 0, -14989 - 17200 = -6k - 5o. What are the prime factors of k? 7, 13, 59 List the prime factors of 1280/72 - 18 - (-1 - 491206/18). 2, 5, 2729 Let o(d) = -d3 + 7d*2 + d - 3. Let a be o(7). Suppose -al = -253 - 327. List the prime factors of l. 5, 29 What are the prime factors of (22 - 19)/((-7090)/(-3544) - 2)? 2, 3, 443 Let w = -10 + 12. Suppose -4t + wx = 8, -5t - 2 - 2 = -x. Let f(g) = -2g*3 + 30. What are the prime factors of f(t)? 2, 3, 5 Let u = 13763 - 8919. List the prime factors of u. 2, 7, 173 List the prime factors of -513(-13 + (-6 - 130/(-13))). 3, 19 Let b(j) = -2640j + 2392. What are the prime factors of b(-14)? 2, 4919 Suppose -4z = z - 135. Let g = 187 - 178. List the prime factors of g/z - 190/(-6). 2 Let x(i) = 1375i2 - 1018i + 5062. What are the prime factors of x(5)? 3, 107 Let b = -4943 + 6826. What are the prime factors of b? 7, 269 Suppose 0 = -230o + 1320695 - 926956 + 1406241. What are the prime factors of o? 2, 7, 13, 43 Suppose -10t + 10 = -0t. Let v = 18 - 26. List the prime factors of 4/vt-8. 2 Let t(v) = 6v + 3. Let m = -72 - -83. What are the prime factors of t(m)? 3, 23 Suppose 105 = -2x + 5. Let v = x - -52. Suppose va - 10 = -0a. What are the prime factors of a? 5 Suppose -125d + 126d = t - 6, 0 = 4t + 4d + 8. Let k be 2/8 + 618/24. What are the prime factors of t + (-13 - -7)k/(-6)? 2, 7 Suppose 64 - 19 = 9p. Suppose -pn + 20 = 5d, -5d + 5n - 20 = -0. Suppose -2b + 188 = -4j - dj, -b + 94 = -4j. What are the prime factors of b? 2, 47 Let f be 1 + -2 - (342/(-3) + 4). Let p = f + 322. List the prime factors of p. 431 Suppose b - 2s - 22523 = 0, -49 = -s - 42. What are the prime factors of b? 31, 727 Suppose 81y + 3g = 86y - 2513, g = -5y + 2509. What are the prime factors of y? 2, 251 Suppose -11m + 52 = 8. Let b(u) = 6u*2 - 23u + 16. Let r(j) = 3j2 - 12j + 8. Let s(h) = mb(h) - 7r(h). What are the prime factors of s(8)? 2, 17 Suppose -286560 = -19i + 225789 - 89200. What are the prime factors of i? 22271 Let q be 5/(6 - 1) + (1 - -1). Suppose v + q = 10. Suppose 22 = l + a + v, -3l = 5a - 55. List the prime factors of l. 2, 5 Suppose 0 = h + 12 - 97. Let t = 792 - h. What are the prime factors of t? 7, 101 Let n be (-12)/1648/(-9) - 0. List the prime factors of (273/(-2))/((-3)/(n - -26)). 3, 5, 7, 13 Let i be (234/4 + 3)(-8)/(-12). Let u = -18 - -7. Let l = u + i. List the prime factors of l. 2, 3, 5 Suppose -6n = -28 + 4. Suppose 2i - 751 = -0i + 3z, 0 = -4i - nz + 1552. List the prime factors of i. 383 Let c(g) = g3 - 16g*2 + 9g + 13. Let i be c(15). Let v = -72 - i. List the prime factors of ((-80)/(-1))/v - -2. 2, 3 Suppose y + 39 = 12. Suppose 2s + 31 = t, 5t - 3s + 2s - 173 = 0. Let i = y + t. List the prime factors of i. 2 What are the prime factors of ((-684)/285)/((-6)/16420)? 2, 821 Suppose 5v + 2t = -5 - 10, 0 = -t - 5. List the prime factors of (-42)/(-49) + v + (-2871)/(-7). 2, 5, 41 Let h(a) = 980a3 - 2a + 0a2 + a - 3a*2 - 290a*3. List the prime factors of h(1). 2, 7 Suppose -z = -3z + v + 11868, 0 = 4v. Suppose 0 = -3u + 9u - z. Suppose u - 259 = 5j - 2d, 3d = 4j - 577. What are the prime factors of j? 2, 37 Let v(t) = 3 - 7 - 3t - 10. Let l be v(-4). What are the prime factors of (338/3 - l/(-3)) + 4? 2, 29 Suppose 41 = 4z + 2k + 3k, -20 = -4k. Suppose -zp + 31 = 19. What are the prime factors of (p - 0) + (9 - -33)? 3, 5 Let t(l) = 25l*2 - 9l - 16. Let p be t(-7). Suppose -p = -3z - k, 2z - z = -5k + 410. Suppose -5u + z = -0u. What are the prime factors of u? 5, 17 Let z = 654 - 654. Suppose -25i + 3840 + 11860 = z. List the prime factors of i. 2, 157 Let y = -113 - -122. Suppose -2144 = -yi + 2383. What are the prime factors of i? 503 Suppose 2o - 4r = 168, 336 = 12o - 8o - 3r. Suppose 21 = 3s + 9, 3i - 3s = o. List the prime factors of i. 2 Let z be (-3821)/(-2) + (-77)/22. Suppose -29a + z = 225. List the prime factors of a. 2, 29 Suppose 39b + 464 = 10b. List the prime factors of (-12)/b - (362/(-8) + -2). 2, 3 Let f be (-3)/(3/(-2))1. Suppose 2n - 2m - 242 = n, 4n + f*m - 928 = 0. What are the prime factors	{ "pile_set_name": "DM Mathematics" }
y(d) = d*2 - 7d + 5. Let q(l) = l*2 - 3l + 3. Let j(r) = 5q(r) - 3y(r). Find the second derivative of j(v) wrt v. 4 What is the second derivative of -3n3 - 3n - 425 + 425 wrt n? -18n Let g(b) be the first derivative of 7b*6/6 + 2b*3/3 + 1. What is the third derivative of g(s) wrt s? 420s*2 Find the third derivative of -5u*6 - u + u - 7u*2 + 8u*2 wrt u. -600u*3 Let n be 8/3 + 6/(-9). Find the third derivative of 4s*2 + 6s*4 + 5s*2 - 4s*n wrt s. 144s Let n(b) be the first derivative of -5b3/3 - 7b + 4. Differentiate n(l) wrt l. -10l Let j(m) = 1. Let h(q) = -q2 + 5q - 3. Let k be h(4). Let d(i) = -6i - 15. Let r(v) = kd(v) + 6j(v). Differentiate r(f) wrt f. -6 Let q(c) be the first derivative of 0c*2 + 0c + 7/3c3 + 5 + 5/4c*4. What is the third derivative of q(x) wrt x? 30 Let i(u) be the first derivative of 4 - 5/2u*2 - u. Differentiate i(s) wrt s. -5 Let b(h) = 9h*3 - 6h*2 - 6h + 7. Let u(i) = 8i3 - 5i*2 - 5i + 7. Let m(g) = -5b(g) + 6u(g). What is the derivative of m(o) wrt o? 9o2 Differentiate -7 - 3p - 9 + 18 - 7 with respect to p. -3 Let q be 56/16(-12)/(-7). Let c(s) be the second derivative of 0s5 + s2 - 1/30sq + 0 + 0s*4 + 0s*3 + 2s. Differentiate c(m) wrt m. -4m3 Let v(t) be the third derivative of -t7/15 + t4/24 + 13t*3/6 + 29t*2 + 2t. What is the first derivative of v(y) wrt y? -56y3 + 1 What is the second derivative of -11c*3 + 3c - 4c5 + 11c*3 + 4c wrt c? -80c3 Let k(v) be the first derivative of -v8/560 + v5/40 - v3/3 + 1. Let n(p) be the third derivative of k(p). Find the second derivative of n(x) wrt x. -36x2 Let a(k) = -k3 - 7k2 + k - 8. Let t be a(-7). Let w be (-2 + 0)t/10. What is the third derivative of 3z4 - 54z*3 + 3z*2 + 54z*w wrt z? 72z Let b(g) be the second derivative of g*7/21 - 17g*4/12 + 2g. What is the third derivative of b(r) wrt r? 120r2 Suppose -5p - 2u + 4 = 2u, 8 = -2u. Let v = p + 0. What is the third derivative of f5 + 0f*5 - 2f*2 + vf*2 wrt f? 60f*2 Suppose 2r + 2i - 14 = 0, 3r + 2i - 5 = 4r. Differentiate 2 + 0ar - a3 - 8 with respect to a. -3a*2 Let g be (0 + -1)3 + -10. Let j = 21 + g. What is the second derivative of jo - o5 + 0o*5 - 9o wrt o? -20o3 Suppose 4 = 2m - 0m. Suppose 4z - 21 + 5 = 0. Find the third derivative of zym + y2 + 5y*4 - 7y*4 - 4y*2 wrt y. -48y Let s(b) be the second derivative of 11b4/6 + 9b*2 - 4b. What is the first derivative of s(p) wrt p? 44p What is the second derivative of -w5 + 7w + 2244w2 - 2244w*2 wrt w? -20w*3 Let t(z) = -6z*3 - 48z*2 - 12. Let v(h) = -1. Let y(f) = t(f) - 12v(f). Find the third derivative of y(p) wrt p. -36 Differentiate 14 + 6y4 - 19y*4 + 4y*4 with respect to y. -36y*3 Let m(u) = 6u - 8u2 + 2u4 + u6 - 2u4. Let x(b) = -b6 + 9b*2 - 7b. Let q(s) = 7m(s) + 6x(s). What is the third derivative of q(t) wrt t? 120t3 Let u(c) be the third derivative of 1/60c*5 + 0c + 0 + 1/12c4 - 2c*2 + 0c3. What is the second derivative of u(n) wrt n? 2 Let k(v) be the third derivative of v7/210 - v*6/180 - 5v3/6 - v2. Let i(y) be the first derivative of k(y). What is the third derivative of i(r) wrt r? 24 Let d be (-66)/112/(-3). Let w(z) be the second derivative of -z2 + 0 + 0z*3 + 1/6z*d - 2z. What is the first derivative of w(i) wrt i? 4i Let h be 1/(-2 + 3) + 5. Suppose f - 5 = 1. Find the third derivative of -c2 - c6 - 3c*f + hc*6 wrt c. 240c*3 Differentiate -7a*4 + 2 + 25a*4 - 12a*4 with respect to a. 24a*3 Let i(b) be the first derivative of 5b*5 - 36b + 47. What is the first derivative of i(q) wrt q? 100q3 Differentiate -1 + 6z*4 - 3 + 0 + 2z*4 with respect to z. 32z*3 Let u be (3/(-9)-3)/1. Let r be u/4 + 42/24. Find the third derivative of -4y3 - yr + 3y*3 + 3y*3 - 2y*2 wrt y. 12 Suppose -3n - 1 = 2j + 5, 4n + 3j = -7. Let x be n + 3 - (-7 - -1). Find the third derivative of m5 + xm*5 - 4m*2 + 5m*2 - 4m*5 wrt m. 120m*2 Let z(r) be the third derivative of 0r*6 + 0r + 0r3 + 0 + 0r*4 + 1/105r*7 - 2r*2 + 1/60r*5. Find the third derivative of z(x) wrt x. 48x Let j be -1(2 - 1-7). Let n be (4 - 1)/(j/(-12)). What is the third derivative of np4 + 0p4 - p2 - 2p4 wrt p? 48p What is the third derivative of -27j2 - 15j*2 + 2j*3 + 10j*2 wrt j? 12 Let a(d) = 27d*3 - 15d*2 + 42. Let h(s) = 4s*3 - 2s*2 + 6. Let l(g) = -2a(g) + 15h(g). Find the first derivative of l(q) wrt q. 18q2 Let f(q) be the third derivative of q6/15 + 3q5/5 - 12q*2. Find the third derivative of f(v) wrt v. 48 Suppose y = -2i + 97, -5y + 440 = -i - 4i. What is the second derivative of 92a - ya - 3a3 - 2a*3 wrt a? -30a Let g(a) = -5a2 + 2. Let u be -6 + 22/4. Let y(x) = 3 - 2 - 6x2 + 1. Let l(k) = ug(k) + 4y(k). Differentiate l(p) wrt p. 2p What is the second derivative of -5v + 7v + 14v + v5 wrt v? 20v3 Let m(z) = -z3 - z*2. Let n(y) = -7y*4 + 3y*3 + 3y*2 + 19y. Let k(c) = 3m(c) + n(c). Find the second derivative of k(u) wrt u. -84u*2 Let i(b) = -3b + 20. Let g be i(6). Let r(v) be the first derivative of 0v3 + vg + 0v + 1/4v4 + 2. Find the second derivative of r(n) wrt n. 6n Let r(v) = -9v + 8. Let h be (2/(-4))/((-7)/154). Let s(m) = 3m - 3. Let x(o) = hs(o) + 4r(o). What is the derivative of x(g) wrt g? -3 Let n(s) = 37s2 - 18s. Let v(m) = -18m2 + 9m. Let c(d) = -3n(d) - 5v(d). What is the second derivative of c(a) wrt a? -42 Suppose -4l + 6 = -2l. What is the second derivative of -7v + lv2 - v5 - 3v2 - 2v*5 wrt v? -60v*3 What is the second derivative of -48q + 44q3 - 47q + 53q wrt q? 264q Suppose -11j = 2j. Let n(k) be the second derivative of 0k3 + j + 0k*4 + 0k*5 - 2k - 2k2 - 1/15k*6. Find the first derivative of n(v) wrt v. -8v*3 What is the third derivative of 294j + 2j6 + 8j*2 - 294j wrt j? 240j3 Suppose 3s + s + 6 = -2r, -18 = -5r + s. Find the first derivative of q + rq + 2 - q wrt q. 3 Let h(g) = 8g + 13. Let j(i) = 7i + 13. Let z(n) = 4h(n) - 5j(n). What is the first derivative of z(v) wrt v? -3 Let z(j) = -j2 + 3j + 32. Let h be z(7). Let p(i) be the first derivative of 1/4i4 - i2 + h + 0i + 0i3. Find the second derivative of p(v) wrt v. 6v Suppose 5h - 9 = 6. Find the second derivative of -3u*3 - 4u - 4u3 + 0u*h + 3u*3 wrt u. -24u Let p(t) be the first derivative of -t7 - t3 + 8. Find the third derivative of p(x) wrt x. -840x3 What is the third derivative of -2a + 39a4 - 67a*4 + 2a*2 + 2a - 41 wrt a? -672a What is the second derivative of 46z*4 - 25z*4 - 22z*4 + 25z wrt z? -12z2 Suppose 4q - 4t = -3t + 11, q + 3t = 6. Suppose 21 = x - qk, 3k = 3x - 8x + 15. Find the first derivative of -2m*4 + 0 - x + 2 wrt m. -8m*3 Let q(f) be the first derivative of -24f*5/5 - 14f*3 + 62. What is the third derivative of q(m) wrt m? -576m Let m(n) be the first derivative of n*3 - 7n - 2. What is the first derivative of m(q) wrt q? 6q What is the third derivative of l3 - 7l*2 - 5l*4 - 8l - 2l3 + 5l wrt l? -120l - 6 Let r(x) be the third derivative of 0 + 0x*5 - 3x*2 + 1/210x*7 + 0x + 0x4 + 0x*6 + 1/3x*3. What is the derivative of r(w) wrt w? 4w*3 Let l be (-2)/(-5) - (-96)/10. Find the third derivative of 7x*4 - 2x*2 + lx*2 + 0x*2 - 3x*2 wrt x. 168x Let m(b) be the third derivative of b*6/15 + 13b*4/8 + 7b*2. Find the second derivative of m(u) wrt u. 48u Find the first derivative of 0 + 8o3 - 1 - 1 - 3 wrt o. 24o*2 Let p(g) = -8g3 + g2. Let o be p(-1). Let h be 0 - 2/((-6)/o). Find the third derivative of 3n5 - 3n*2 - hn*5 + 2n*6 wrt n. 240n*3 Find the second derivative of 42k - 32k + 52k - 10k3 - k2 wrt k. -60k - 2 Suppose 2z - 3a - 7 = 0, -2a - a - 1 = z. Find the third derivative of j4 - j2 + jz + 2j*4 + 2j*2 wrt j. 72j Suppose -5a - 2 = -12. Find the third derivative of 6p*a - 3p2 - p6 + 5p2 wrt p. -120p**3 Let a = 1/160 - -1/9	{ "pile_set_name": "DM Mathematics" }
2w2 - 9w - 3. Let u(r) = r*2 + 8r + 3. Let x(t) = 3u(t) + 2v(t). Give x(8). -13 Let u(t) = -t3 + t2 - 13. Let p(m) = m*2 - 3m*2 + 4 - 3m + m*2 + 6m. Let o be p(4). Suppose -v + o = f + 3, -2f = v + 6. Calculate u(v). -13 Suppose 0 = -5x - 4o - 6, -2x + 0x + o + 8 = 0. Suppose -8 = -xi - 0. Let q(m) = -m + 0 + 6m - 7m + m2 + 4. Give q(i). 12 Let j(h) be the third derivative of h5/60 + 7h4/24 + 14h*2 + 2h. Calculate j(-3). -12 Let b(d) be the second derivative of 11d3/3 - 3d*2/2 + 268d. Determine b(2). 41 Suppose -4z - 423 + 435 = 0. Let m(w) = w - 6. What is m(z)? -3 Let j = 29 - 25. Let k(a) = -5a + a + 0a2 + 4a*2 - j - 5a*2. Give k(-4). -4 Let h(l) = 3l3 + l2 + 8l + 14. Let s(j) = 2j3 + j2 + 5j + 9. Let q(u) = -3u - 2. Let w be q(1). Let g(i) = wh(i) + 8s(i). What is g(-2)? 6 Let z = 293 - 291. Let y(s) = 10s + 2. What is y(z)? 22 Let d(z) = -4z*3 + 8z2 - 7. Let r(j) = j3 - j*2 + 1. Suppose 0 = -4x - 28 + 8. Let i(g) = xr(g) - d(g). What is i(-2)? -2 Let d(w) = w2 - 10w - 9. Let i = -26 - -35. Calculate d(i). -18 Let k be (21/(-6) + 3)4. Let h(a) be the first derivative of -1/3a3 + a2 + 3 + 3a. What is h(k)? -5 Let s be 2-3-2 + 0 + -4. Let f = s + -20. Let y(t) = t + 13. Give y(f). 1 Let f(s) be the third derivative of -s6/120 + s5/30 + 2s*3/3 - 114s*2. Determine f(3). -5 Let i(j) = -j + 5. Suppose z - 4 = 0, 3r - 3z = 49 + 20. Suppose -4x + n = r, 0 = 5x - n + 4n + 21. What is i(x)? 11 Let c be (-60)/(-135) - (-4 - 340/(-36)). Let p(t) = 5t + 3t*2 + 0t*2 - 2t2 + 4. What is p(c)? 4 Let r(c) = c + 12. Let q = 75 + -77. Let f be 0/(1 - ((-8)/q + -6)). Calculate r(f). 12 Let w(n) be the third derivative of -n6/120 + n5/30 + n3/6 + 17n2. Let c = 7 - 5. Determine w(c). 1 Let q(f) = -3f*3 + 11f*2 - 6f - 8. Let p(x) = -10x3 + 35x*2 - 17x - 25. Let n(r) = -2p(r) + 7q(r). Calculate n(5). 4 Let o(h) = 6h2 - 1. Suppose 23 = 2l - 17. Let m = l - 21. Give o(m). 5 Let n(s) = s*2 - 5s - 3. Suppose 4f - 2i = 120, -f + 4i + 16 = -0f. Let z = 106 - 132. Let l = z + f. Give n(l). 3 Suppose -3s + 13 = 5l, -5l - 2s = -2l - 8. Suppose ld - 12 = -2d. Let i be (d - 4)(-2 - 1). Let z(v) = 2v2 - 3v - 2. What is z(i)? 7 Let g = -291 + 290. Let i(m) = 9m3 - m2 - m. Determine i(g). -9 Let u(b) = 4b + 33. Let z be 6/12 - (-33)/(-6). Let c(g) = -2g - 16. Let k(f) = zc(f) - 2u(f). Let h be k(-8). Let w(j) = j2 + j - 2. What is w(h)? 0 Let s(x) = x2 + 3x + 1. Let t(j) = j*3 - 7j*2 - 18j - 6. Let m(v) = -6s(v) - t(v). Calculate m(0). 0 Let c(g) = -g - 4. Let r(k) = 3k + 37. Let y be r(-12). Let p be (26 + -42)/(1 + y). Give c(p). 4 Let h(x) = 24x - x2 - 68x + 41x + 6. Give h(-4). 2 Let m be (-3)/(-3) - (14 + -15). Let w(r) = r3 - r2 - r + 3. Determine w(m). 5 Let o(u) = -51u - 69. Let b(l) = 5l + 7. Let k(t) = -21b(t) - 2o(t). Let h be 32/(-6) - 2/93. Give k(h). 9 Let s = -122 - -128. Let i(b) be the first derivative of b*2/2 + 2b + 1. Determine i(s). 8 Let l(j) be the third derivative of 0 + 27j2 + 1/20j*5 + 0j*4 + 1/120j*6 + 2/3j*3 + 0j. Suppose 3c + 17 = -4y, -5 - 1 = 4c - 3y. What is l(c)? 4 Let g be (-12)/(-4) + -1 + -2. Suppose 9 = 5k + 2r - r, k - 2r + 7 = g. Let f(m) = 3 - k + 3 - 1 + 2m. Determine f(-4). -4 Suppose 0m + 8 = 4m. Suppose -5w + 7w = 2. Let r(i) = i - 3i - w + mi - 8i. Give r(-1). 7 Let q(k) = -k2 - k - 1. Let p be 11(-4)/((-16)/4). Suppose 4 = 3b - p. Suppose 4n + g - 6g = -4, -g = bn + 5. Calculate q(n). -1 Let f(w) = 5w3 + 11w*2 - 12w - 2. Let s(b) = -4b3 - 10b*2 + 11b + 1. Let r(q) = 5f(q) + 6s(q). Let t be r(3). Let i(x) = x - 5. What is i(t)? -9 Let s(r) = 177r - 48. Let i(j) = 10j - 3. Let a(t) = -18i(t) + s(t). Let v be 6/42/1. Let k be (-4)/(-3)v/1. Determine a(k). -6 Let k be ((-2)/1)/((-6)/(-15)). Let p(d) = 14d*2 + 11d - 3. Let o(t) = -26t2 - 21t + 6. Let r(g) = -6o(g) - 11p(g). What is r(k)? 22 Let y(c) = -2 - 298c - 3c*3 - 303c - 295c + 1195c - 2c2 - 303c. Calculate y(-2). 22 Suppose -2a + 0a + 3y + 15 = 0, 0 = -a - y. Let k(z) = -2 - 9z + z + az - z2. Suppose -10g = -9g + 3. Give k(g). 4 Let b(u) = 112u + 107u - 220u. Let d(n) = n - 4. Let l be d(3). Give b(l). 1 Let j(a) = -a + 1. Let x be (-8)/4 + -4 - -3. Let i be ((-3)/(x/2))/(12/(-18)). Give j(i). 4 Let c(g) = g*2 - 6g. Let s be ((14 - 4)-1)/(4/(-10)). Suppose 5r + 0 = s. Calculate c(r). -5 Let o = 562 - 560. Let p(u) be the first derivative of -6u - o - 4/3u*3 + 1/4u4 + u2. What is p(4)? 2 Let j(b) = 3b + 18. Let s be -3 + (0 - -2) - -6. Let w(y) = 7y + 37. Let g(h) = sj(h) - 2w(h). Give g(0). 16 Let s(m) = 18m + 38. Let j(y) = -8y - 18. Let q(t) = 13j(t) + 6s(t). Calculate q(6). 18 Suppose 2g = -t - 2 + 6, -5t = -2g - 68. Suppose 4h = -q + t, -3h + 14 = q + q. Suppose 0 = 3m + 7 + h. Let k(f) = f*2 - 2f - 2. What is k(m)? 13 Suppose -s - 329 + 336 = 0. Let t(w) = -5w - w + 7w - 12. Give t(s). -5 Let z(u) = 2u - 2. Let a(i) = i - 4. Let q be a(9). Suppose k = 1, qk - 19 + 4 = -5s. Suppose -4t + 4 = -st. What is z(t)? 2 Let s(k) be the first derivative of k4/4 - 5k3/3 + k2 - 7k - 63. What is s(5)? 3 Let z(d) = d3 + 4d*2 + 4d + 2. Let r(p) = -2p + 30. Let a be r(0). Suppose -26i + ai + 16 = 0. Calculate z(i). -14 Suppose -5n - 3 = -2l, 0l - n = 3l + 4. Let d be 1 - ((0 - l) + 1). Let i(j) be the second derivative of 3j3/2 + j2/2 + j + 73. Calculate i(d). -8 Let o(t) be the first derivative of t*2/2 + 10t - 145. Determine o(-13). -3 Let r(a) be the first derivative of -5a2/2 + a - 455. What is r(-7)? 36 Let v = 902 - 910. Let i(m) = m + 20. Give i(v). 12 Let t(m) be the first derivative of 0m - 5 + 4/3m3 + 1/8m4 - m2. Let q(s) be the second derivative of t(s). Give q(-6). -10 Suppose -9c - 1645 = -1627. Let i(a) = 4a2 + a - 2. What is i(c)? 12 Let m(f) be the third derivative of f4/8 + f*3/2 + 18f2 + 2. Let x(r) = -r3 - r*2 + 9. Let t be x(0). Suppose -2b = -1 + t. Determine m(b). -9 Let b = 56 - 35. Let y = b + -15. Let i(k) be the first derivative of k*4/4 - 5k*3/3 - 3k*2 - 7k - 1. Give i(y). -7 Let g(c) = -41 + 148 - 35 - 32 - 36 + 2c. Determine g(-4). -4 Let q(z) be the first derivative of z3 + 2z*2 - z + 700. Give q(-4). 31 Let i(u) = 4u*2 - u. Suppose -3 = 49a - 50a. What is i(a)? 33 Let n = -166 - -169. Suppose 4j - 18 = 2j. Suppose -b + n = -4t, 3b + 3t - 3 = -j. Let q(o) = 5o3 - o - 1. Give q(b). -5 Let t(u) be the second derivative of u3/3 + 2u*2 - 72u. Determine t(-5). -6 Let r(b) = -b*3 + 4b*2 - 2. Let c be r(2). Suppose cv = 2v + 8. Let s be v - (-3 + (-2)/(-2)). Let u(h) = -h2 + 5h - 3. Give u(s). 1 Let b(w) = -w*2 - 5w - 1. Suppose 2g - 3g = 0. Suppose 3z = -v + z, g = 4z - 4. Give b(v). 5 Let u(d) = -d + 1. Let n(t) = 3t. Let i(j) = 3n(j) + 4u(j). Determine i(3). 19 Let t(c) = -c3 - 4c*2 + 4. Let g = 10 - 3. Let v = g + -7. Suppose -4b + 20 = -l - vl, l = -5b + 16. Give t(l). 4 Let g(t) be the third derivative of -t*4/24 + 7t*3/2 - 377t*2. Calculate g(14). 7 Let r be 35/5 - 3 - 3. Suppose 2z - r + 5 = 0. Let y(j) = -6j - 3. Determine y(z). 9 Let u(p) be the first derivative of p5/60 - 11p*4/24 + 3p*3/2 - 25p2/2 - 35. Let m(r) be the second derivative of u(r). Determine m(9). -9 Let h(i) = -i2 - i + 2. Let z = -19 + 37. Let w be 21/9z/(-6). Let c be ((-8)/(-14))/((-2)/w). Determine h(c). -4 Let s(y) = y3 - 6y*2 + 5y + 6. Let n(t) = 5t2 + 47t + 23. Let k be n(-9). Determine s(k). 6 Let f(l) be the third derivative of 6l2 + 0l - 5/6l3 + 1/24l*4 + 0. Give f(9). 4 Let c(x) = -x - 4. Let o be c(-5). Let l(b) be the third derivative of 4b*2 + 0b + 0 + 1/6b3 + 7/24b*4. What is l(o)? 8 Let i(k) = -5k*2 - 9k + 4. Let m(j) = 4j2 + 8j - 3. Let f = -5 + 9. Let w(z) = fm(z) + 3i(z). Determine w(-6). 6 Suppose 13 = 5k - 22. Suppose kn - 12 = 3n. Let i(d) = -d + 2. Determine i(n). -1 Suppose j - 2r = r - 4, -8 = 3j - 5r. Let q be (j + 0)/(8 + 117/(-15)). Let z(p) = p + 7. Determine z(q). 2 Suppose 5f = 2d - 6*d - 4	{ "pile_set_name": "DM Mathematics" }
+ 0b + 0b*3. Determine c(a(p)). -6p Let t(a) be the third derivative of 1239a5/20 - 7a*2 + 34a + 6. Let v(r) = r. Calculate t(v(p)). 3717p2 Let p(f) = -237f*2 - 770f. Let q(v) = 15v2. Give p(q(g)). -53325g*4 - 11550g*2 Suppose -4w + 10 = -22. Suppose 20o - 16o = w. Let l(r) = -o + 2 + r. Let h(b) = 4b2. Give l(h(y)). 4y*2 Let v(i) = 10i. Let q = 195 - 197. Let l(m) = 3m - 2. Let r(x) = -2x - 1. Let d(w) = qr(w) + l(w). Determine v(d(o)). 70o Suppose 22x + 74 = 118. Let f(r) be the first derivative of 0r*x + 4/3r*3 + 0r - 6. Let n(b) = 8b2. Give f(n(i)). 256i*4 Let x(i) = 331i - 98. Let q be x(8). Let y(b) = -q + 2550 - 3b. Let p(v) be the third derivative of v4/6 + v2. Give p(y(w)). -12w Let o = 58 + -44. Let p(l) = -ol - 8l - 1034 + 1040. Let u(w) = -w*2. What is p(u(k))? 22k*2 + 6 Let o(p) be the second derivative of 59p*3 + 9258p. Let r(i) = -2i. Determine r(o(j)). -708j Let m(l) = 1409l - 1183l + 11551l + 10618l. Let s(z) = -z*2. Determine s(m(k)). -501536025k*2 Let c(j) = -4j*2. Let v(q) = -160337019q*2. Give c(v(s)). -102831838647225444s*4 Let q(d) be the third derivative of 0d*3 + 0 - 5/24d*4 + 0d + 78d2. Let p(h) = 5h. Determine q(p(l)). -25l Let d(q) = 3q*2. Let z(w) = 3w*2 - 20w - 1. Let p be z(7). Let g(t) = -46t - 95 + pt + 95. Calculate g(d(c)). -120c2 Let f(i) = 2i - 3. Let u(c) = -65 + 34 - c + 33. Let h = 0 + -2. Let v(n) = hf(n) - 3u(n). Let a(s) = s*2 + 44s. Determine v(a(l)). -l*2 - 44l Let d(n) = -48n2 + 10. Let r(h) = 30750h. Give d(r(j)). -45387000000j2 + 10 Let r(t) = 1190t + 252t - 1443t. Let v(x) = 51x2 + 102x - 102. Let d(k) = -k*2 - k + 1. Let z(p) = 102d(p) + v(p). Determine z(r(h)). -51h2 Let p(u) be the third derivative of u5/30 - 2u*2. Let k(c) = -c + 3c - 72 + 32 + 49 + c + c. Give k(p(n)). 8n2 + 9 Let c(g) = -2g*2 - g - 67. Let i(r) = 5r*2 - 3r - 201. Let l(f) = -3c(f) + i(f). Let s(q) = 13q - 6. Determine s(l(z)). 143z2 - 6 Let d(z) be the first derivative of -19z*3/3 - 13z + 2935. Let f(s) = -7s. Determine f(d(n)). 133n*2 + 91 Suppose -4l = -4p + 36, 3p + l - 11 = -0p. Let k(c) = -36c*2 + 7 + p - 12. Let b(m) = -19m - 203m2 + 205m*2 + 19m. Give b(k(s)). 2592s4 Let m(g) = g2 - 2g - 1. Let x(y) = 20y2 - 50y - 25. Let d(z) = 25m(z) - x(z). Let w(q) = -410q. What is d(w(k))? 840500k2 Suppose -y - 5y + 12 = 0. Let b(s) be the first derivative of -15 - 9s2 + 5s*y + 2s*2 + 0s*2. Let o(k) = 7k*2. Give b(o(v)). -28v*2 Let f(m) = 2m2. Let j(y) = -y2 + 3y + 112. Let z be j(0). Suppose -o + z = 6o. Let s(x) = 2x + 12x - 10x + ox. Calculate f(s(d)). 800d2 Let r(m) = -17m + 93. Let x(d) = -8d + 40. Let p(g) = 3r(g) - 7x(g). Let k(j) = 5j + 2. What is p(k(w))? 25w + 9 Let q(v) = -1094v + 2314v - 1223v. Let c = -6 + 11. Let m(k) = 5k2 + 5k. Let n(s) = -14s2 - 16s. Let y(p) = cn(p) + 16m(p). Determine y(q(w)). 90w2 Let t(j) = 8j*2 - 84j. Let i(b) = -b*2 + 14b. Let p(a) = -24i(a) - 4t(a). Let n(x) = 43x - 2. Calculate n(p(f)). -344f*2 - 2 Let v(p) = 2p + 31 + p + 28. Let x(k) = -16k - 295. Let a(b) = 11v(b) + 2x(b). Let h(n) = -2n. Give h(a(z)). -2z - 118 Let x(c) = 467c - 238c - 10 + 38 - 235c - 20. Let v(y) = 6y. Give v(x(n)). -36n + 48 Let k(q) = -8q. Let y(a) = -5a*2 - 87a - 48. Determine y(k(t)). -320t2 + 696t - 48 Let d(c) = 9c2. Let h be -1 + 1-2 + (-5 - -8). Suppose h = 4v - 4, o + 3o + 5v = 13. Let z(f) = 23 + 17 - 40 - 2f*o. Give d(z(k)). 36k*4 Let t(s) be the third derivative of 0s - 269s2 + 0s*3 + 0 - 1/12s*4. Let l(z) = 2z - 73. Determine t(l(n)). -4n + 146 Let v(h) = -4849h - 36. Let z(p) = -10p2. Give v(z(r)). 48490r2 - 36 Let i(o) = o2. Let r(w) be the first derivative of -63 + 0w3 - 18w*3 + 7w*3 + 8w*3. Give i(r(n)). 81n*4 Let i(u) = -2489u - 1726. Let x(t) = -t*2. Determine i(x(z)). 2489z*2 - 1726 Let f(c) = 5c - 2. Let s(p) = -21p + 9. Let o(l) = -18f(l) - 4s(l). Let y(q) = q - 3. Let j(t) = 2t - 10. Let x(n) = -3j(n) + 10y(n). Give x(o(w)). -24w Let w(u) = -7u. Let t(j) = 1092816j. Give t(w(f)). -7649712f Let b(u) = -u - 37. Let t(o) be the second derivative of -o*6/360 - 49o*4/12 - 5o. Let n(x) be the third derivative of t(x). Give b(n(s)). 2s - 37 Let v(x) = 6748x*2. Let r(k) = 129k + 32. Give r(v(h)). 870492h2 + 32 Let g(i) = 7i*2 - 73. Let c(r) = 13r*2 + 104r + 624. Let a(k) = -k*2 - 7k - 42. Let b(t) = 104a(t) + 7c(t). Determine g(b(l)). 1183l4 - 73 Let w(a) = a2 - 2a - 6. Let n be w(4). Let d(m) = 6m + nm + 2m - 9m. Let k(j) = -5j. Give k(d(g)). -5g Let t(c) = 3c. Let m(n) = 43494n - 3. Determine m(t(r)). 130482r - 3 Let f(i) = 7i*2 - i + 2. Let r(w) = -w + 2. Let x(u) = -f(u) + r(u). Let l(m) = 309m + 1. Determine l(x(d)). -2163d2 + 1 Let l(i) = 16199223i*2. Let d(t) = 9t. What is l(d(g))? 1312137063g2 Let z(f) = 2f. Let o(x) = 2x2 - 83x + 68. Let r(q) = 4q2 - 133q + 102. Let l(n) = -8o(n) + 5r(n). Give z(l(t)). 8t2 - 2t - 68 Let a(y) = -116572y. Let c(o) = 2o + 4. Determine a(c(v)). -233144v - 466288 Let s(d) = 2d*2 + 2d + 3. Let g(m) = -23m2 - 22m - 33. Let n(t) = -2g(t) - 22s(t). Let w(u) = -132u2. Determine w(n(v)). -528v4 Let m(t) = -t3 - 1. Let j(o) = -6o3 - 7o - 52. Let q(i) = -j(i) + 3m(i). Let c(f) be the first derivative of q(f). Let l(w) = 2w. Calculate c(l(x)). 36x2 + 7 Let c(l) be the second derivative of -3l*4 + 8995l. Let x(r) = r*2 - r - 1. Let p(u) = 4u*2 - 3u - 3. Let q(h) = -p(h) + 3x(h). What is q(c(g))? -1296g*4 Let y(i) = 2i. Let z(s) = -s + 71. Let g(x) = -6x + 105. Let a(r) = -g(r) + 2z(r). Calculate a(y(w)). 8w + 37 Let h(p) = 134p*2 + 4. Let n(k) be the second derivative of -2k*3/3 - k + 1539. Give n(h(u)). -536u*2 - 16 Let q(h) = h. Let f(v) = -60v - 4. Suppose 13i - 34 = 15i. Let t(d) = 238d + 17. Let b(p) = if(p) - 4t(p). Determine b(q(y)). 68y Let u(k) = -223k2. Let z(j) be the first derivative of -19j*2/2 + 232. What is z(u(c))? 4237c*2 Let w(o) = 3o*2 - 165o - 185. Let d(c) = -18c. What is d(w(h))? -54h*2 + 2970h + 3330 Let t = 881 - 426. Let l(c) = 455 + 4c2 - t - 24c*2. Let q(i) = i. Calculate l(q(s)). -20s*2 Let w(g) = -5g + 40. Let z(i) = -15i + 110. Let l(r) = 22w(r) - 8z(r). Let p(s) = 53s*2. Give p(l(y)). 5300y*2 Let z = 62 - 60. Let w(x) be the first derivative of 19 - 13x*2 + 29x*2 - 14x*z. Let v(u) = -5u. Give w(v(n)). -20n Let w(c) = 485c*2. Let r(g) = -19114g*2. Give w(r(d)). 177192323060d*4 Let s(y) = 20y*2. Let p(d) be the third derivative of 1/3d*4 + 75d*2 + 0 + 0d + 0d3. What is s(p(l))? 1280l*2 Let j(x) be the second derivative of 31x4/12 + x. Let b(g) be the second derivative of g3/2 - 998g. Give b(j(t)). 93t*2 Let w(h) = 4h*2 + 6h*2 - 2h*2 + 11h*2. Let n(y) be the third derivative of -2y4/3 - y2 - y - 436. What is n(w(o))? -304o2 Let j(t) = t. Suppose -5x + 11 = z, 2z + 2x = -3z + 147. Let y(p) = -4p - 7p + z + 7p + 6p. What is y(j(o))? 2o + 31 Let n(x) = 3x2. Let j(r) = 14613r*2 - 2r - 823. What is j(n(d))? 131517d4 - 6d*2 - 823 Let l(u) = -9 - 9 + 18 - 3u*2. Suppose 0y + y - 22 = 2j, -y + 10 = j. Let i(s) = -s - ys + 69 - 69. Determine i(l(t)). 45t2 Let t(u) be the third derivative of 5u*4/12 + 6u*2. Let w(y) = 8y*2. Let m(b) = 2b*2. Let j(v) = 9m(v) - 2w(v). What is j(t(d))? 200d*2 Let z = 140 - 138. Suppose b - 2v = 25, b - 43 = -2v - zv. Let f(d) = -32d + b + 22 - 53. Let x(i) = 2i*2. Determine x(f(a)). 2048a*2 Let p(n) = 2584748n. Let u(s) = 4s. Calculate p(u(h)). 10338992h Let b(k) = -6k + k - 6k*2 + 5k. Let p(q) = 4q2 - 25 + 74 - 19 - 30. What is p(b(y))? 144y*4 Let j = 228 + -222. Let l(f) = 9f*2 - 12f - 7. Let a(d) = 9d2 - 10d - 6. Let g(u) = ja(u) - 5l(u). Let b(t) = 2t. Give b(g(h)). 18h*2 - 2 Let o(q) = 7q*2. Let j(g) = 58g + 6g - 15g + 8g. Calculate o(j(r)). 22743r*2 Let l(h) = 23h + 17. Let r(v) = 4v + 3. Let z(d) = 6l(d) - 34r(d). Let u(c) = -20c +	{ "pile_set_name": "DM Mathematics" }
th biggest value? (a) 10/21 (b) p (c) 0.5 (d) -0.3 b Let l = -168 + 173. What is the smallest value in l, -11, 2? -11 Let f = -3 + 20. Let z = -2 - 3. What is the biggest value in 4, z, f? f Suppose -207q = -209q - 72. Which is the biggest value? (a) q (b) -2/15 (c) 4 c Let o = 81 - 241/3. Let t be (-2 + 2)1-1. Let s = 1310 + -1313. Which is the second biggest value? (a) o (b) s (c) t c Suppose 9 = -4l - 3. Let j be (l + 13)3/6. What is the smallest value in 0, j, -1? -1 Suppose -g - k - 15 = 4, -3g = 5k + 59. Which is the biggest value? (a) 0.5 (b) g (c) -0.6 a Let m = 36.94 - 36. Let h = -0.64 + m. Which is the third biggest value? (a) 1/4 (b) -0.01 (c) h b Let j = -0.7 + 0.9. Let z be -31(-48)/(-18). Let k = z + 6. Which is the second biggest value? (a) k (b) j (c) -1/4 c Let o = -0.097 - 0.403. Which is the second smallest value? (a) 4 (b) o (c) 1/4 (d) 9 c Let y = 0.06 - 0.12. Let f = y - -2.06. Let d be 04/(-12) + -1 + 0. Which is the second smallest value? (a) d (b) f (c) 0 c Let b = 158 + -159. What is the third biggest value in -0.3, -4, -1/9, b? b Let s = -145 + 142. Which is the second smallest value? (a) 3/8 (b) s (c) 1/4 c Let h be (-2)/813/26. Which is the third biggest value? (a) -0.3 (b) 0.4 (c) h (d) 8 c Let y = 3.1 - 13.8. Let s = -11 - y. Let c(v) = -6v2 + 13v - 12. Let l be c(1). What is the second smallest value in s, 0, l? s Let g = 0.5917 - 0.0657. Let z = 0.126 - g. Let x be (3/4)/((-6)/(-10)). Which is the third smallest value? (a) x (b) 2 (c) z b Let p = -696/55 + 148/11. Suppose 0 = -4j + 4q - 6 + 38, 4 = -2j - 2q. Let u = 0.14 - 0.1. Which is the smallest value? (a) u (b) p (c) j a Let p be 3/(-3)(-4)/10. Let h = -460.99 - -461. What is the third smallest value in p, h, -0.3? p Let x be (-5)/(-49)7(-4)/10. What is the smallest value in -1, 2, x, -4? -4 Let w = 5102/3 + -35705/21. Let h = -0.1 - 0. Which is the biggest value? (a) w (b) 2 (c) h (d) 5 d Let c = 0 - 0. Let x = -89 - -77. Let i = -17 - x. What is the second biggest value in -2/33, c, i? -2/33 Suppose -2t - t = 3. Let o = -68 - -63. Which is the third biggest value? (a) o (b) 2 (c) t a Let k = 1.1 - 0.5. Let h = -2.4 - k. Suppose 8 = -0w + 4w. Which is the biggest value? (a) h (b) w (c) 1 b Let o be (-3 - -31) + 1 + 1. Let m be (-1 - 201/o) + 0. Let z = -15/2 - m. What is the smallest value in 5, -0.5, z? -0.5 Let s = 15 + -12. Suppose 4w - 3o = 61, 5w - 27 - 57 = -4o. Which is the smallest value? (a) -0.2 (b) w (c) s a Let z = 218 + -217.2. What is the third biggest value in 25, 1/4, z? 1/4 Let k = -5/16 + 31/48. Suppose 0 = -2r - 0r + 30. Suppose u = -4u + r. What is the smallest value in u, 0, k? 0 Suppose -2h = h + 60. Let f be (6 - 2)(-15)/h. Let d be 2 + 36/28 - f. Which is the biggest value? (a) 0 (b) 3 (c) d b Suppose -3d - 2d = 25. Suppose -l + 40 = -163. Let i = -1011/5 + l. Which is the third smallest value? (a) d (b) i (c) 0.1 b Let s = 7.04 - 0.04. Let o = 14/29 - 184/261. Which is the biggest value? (a) o (b) s (c) -0.3 b Suppose -b + 0 = 5. Let a = b + 21/4. Let m(d) = -2d + 9. Let r be m(5). What is the third smallest value in a, r, 4? 4 Suppose -c + 4 - 10 = 0. Let t be (-26)/117 + 4/9. What is the second smallest value in t, 0.2, c? 0.2 Let z = -35 + 72. Let v = 38 - z. What is the second biggest value in -5, -0.12, v? -0.12 Let y = 0.02 - 2.02. Let n = -115 - -261. Let g = -144 + n. Which is the biggest value? (a) g (b) -4 (c) y a Let p = -7.6 - -12.6. Which is the third biggest value? (a) 2 (b) p (c) 2/37 c Let o = 164 + -93. Let c = o - 68. What is the second smallest value in 5, c, -3/7? c Let y be (-6)/9020/(-6). What is the fourth smallest value in 0, y, -1, -1/9? y Let g = -2 + 1.7. Let q = -0.1 + g. Let c be (334/126 - 3) + 72/(-324). What is the smallest value in q, c, -1/4? c Let v = 497/40387 + 89213117/55935995. Let h = v + -2/277. What is the third biggest value in 2/5, h, -2/11? -2/11 Let t = -1.3 + 0.3. Let p = -2.392 - -1.9. Let k = 0.008 - p. What is the third biggest value in 1/4, t, k? t Let x = 14.36 + -16.36. What is the second smallest value in 2/157, x, 5? 2/157 Let k(z) = 2z - 7. Let s be k(5). Let t be (-8)/(-3) - 2/s. Which is the second smallest value? (a) -2/9 (b) t (c) -1/3 a Let r be (4 - 2)/(16/40). Let i = r - 1. What is the biggest value in i, -0.1, -0.2? i Let d(w) = -3w. Let b be d(-2). Let h be (-18)/(-24)b/(-9). What is the smallest value in h, 1, 1/4, -0.4? h Let j = 126 - 127. What is the third biggest value in j, 2, 4/7, 0.005? 0.005 Let v = 22 - 23.05. Let h = v - -0.05. Let a = -0.5 + 0. What is the biggest value in a, h, -2/3? a Let x = 35 - 81. Let j = 32 + x. What is the second smallest value in 3, -0.1, j? -0.1 Let i = 0.1 + -0.1. Let a = 11 - 16. Let y = a - -6. What is the third smallest value in y, i, -0.02? y Let x = -230.6 + 230. What is the smallest value in x, 2/7, -0.07? x Let x = 1.41 + -6.41. Suppose 2f = f + 1. Let i be (1/(-6))/(f/(-4)). What is the second biggest value in x, 0.5, i? 0.5 Let l = 99 - 93. Let m be -12 - (-5 - 3) - (-20)/l. What is the fourth smallest value in -2, 1, 7, m? 7 Let r = 39 - 70. Let h = -30 - 0. Let c = h - r. What is the third biggest value in -1/2, -4, c? -4 Let y be -4 + 10 + -5 + 77/(-91). Which is the third biggest value? (a) y (b) 0.2 (c) -2/3 c Let q = 107.9593 - -0.0407. What is the third biggest value in -2, 2, q? -2 Let x = 667/10 + -334/5. Which is the second smallest value? (a) -4/7 (b) 32 (c) x c Let h be (-2)/5 + (-396)/60. What is the third smallest value in -4/3, h, -2? -4/3 Let m be ((-23)/230)/((-1)/(-4)). Let j = m + 3/20. Which is the third smallest value? (a) 0 (b) j (c) 4 c Let n = 329.16 - 329. Which is the smallest value? (a) -1/2 (b) 0.5 (c) n (d) -0.4 a Let k = -712 - -713. Which is the second biggest value? (a) k (b) -14 (c) 0.3 c Let l = -5 - -2. Let w = 65/126 - -1/18. Which is the biggest value? (a) 4 (b) l (c) w a Let t = -738 + 736. Which is the fourth biggest value? (a) 0.5 (b) 2/9 (c) t (d) 2/7 c Suppose -20 = 28w - 24w. What is the second biggest value in w, -75, -2? w Suppose -19s = -9s - 30. Let l be (3 + -2)/(s/12). Which is the third biggest value? (a) 0.4 (b) 2/9 (c) l (d) -0.6 b Let n = -0.04 + -2.66. Let p = 3 + n. What is the second smallest value in 5, p, -0.4? p Let p = 0.018 - 21.018. Let f = p - -7. Let w = -18 - f. What is the second smallest value in w, 1, -2? -2 Let v(b) = 2b*3 + 5b*2 - 3b - 4. Let m = 9 + -6. Let f be v(m). Let y = 260/3 - f. What is the third biggest value in -2, y, 0.4? -2 Suppose 1 = 2v - 1. Let x be v/(((-14)/(-30))/7). Let j = -17 + x. Which is the second biggest value? (a) 3 (b) j (c) -1/3 c Let u = 16421/88 - 2058/11. Let w = u + -1/88. Which is the smallest value? (a) w (b) 2 (c) -1 (d) -0.3 c Let v = 183.1 + -183. What is the third biggest value in -5, -12, v, -3? -5 Let k = -441 + 442. What is the smallest value in 0.3, -0.4, 2/9, k? -0.4 Let n(y) = y3 + 6y*2 + 5y + 5. Let s be n(-5). Let z be -1 - -5 - (-492)/(-120). Let r = z - 11/90. Which is the biggest value? (a) r (b) s (c) 1 b Let z be -1 + 244/36 + (214 - 220). Let m be (-1)/(3/(-8))-3. Let h = 3 + m. Which is the smallest value? (a) h (b) -1 (c) z a Let g = 296.3 + -298.3. What is the biggest value in -0.3, 0.9, g? 0.9 Let j = 10443 - 10441. Let f be (4/14)/(1-2). What is the third biggest value in 3, j, f, -5? f Let f = 40 + -40.2. Which is the third biggest value? (a) f (b) -0.1 (c) -4/7 c Let m be (-50)/(-300) + 3/198. Which is the smallest value? (a) m (b) 3 (c) -2 (d) -1.9 c Let w = 0.471 - 0.111. Let i = -0.46 + w. Which is the third biggest value? (a) -3/14 (b) 2 (c) i a Let q = -336 + 342. Which is the fourth biggest value? (a) 0.06 (b) 5/2 (c) q (d) -4 d Suppose -20*k + 19 = 79. Which is the smallest value? (a) -1/3 (b) -278 (c) k (d) -4 b Let u = 15.2 - 14.2. What is the third smallest value in -2, 6, -3, u? u Let u be (13 - (-2562)/(-198))/(4/6). What is the smallest value in -1, u, -0.4, -0.9? -1 Let r = -131 - -130.6. Let j = -5.7 + 6. Let m = 7 - 5. Which is the third biggest value? (a) j (b) r (c) m b Suppose 0	{ "pile_set_name": "DM Mathematics" }
8/5)/a)/a))a)a)/a)/aaa)/a(-1/17)) assuming a is positive. a(19/255) Simplify ((oo/(ooo(-3)ooo))(-38))(-2/49) assuming o is positive. 1 Simplify (l*(-3)l)7/(((l(-3/4)l)/lll)/(l/(ll*(1/5)l))) assuming l is positive. l*(-329/20) Simplify (l/(ll/l*9ll))/l(2/21)((l/(l*(-11)/l))/ll)/(l/(l/(l/l6))) assuming l is positive. l(502/21) Simplify (h*9h(-2/15))/(h4h/(h/h(2/9))) assuming h is positive. h(209/45) Simplify (q31q(q/(qqqq*(9/7)q))/q)(3/23) assuming q is positive. q(561/161) Simplify (p*(2/31)p/p*(1/25))/(p/(pp(2/11)))19 assuming p is positive. p(38184/8525) Simplify l(-4)/ll(-6)ll(ll(-14))/(l(l(l(-3/2)/l)/l)/l) assuming l is positive. l(-39/2) Simplify d/(d/(d17d)d)d*(1/2)(d(d(-2)/d)/dd)19 assuming d is positive. d(-41/2) Simplify (ii(3/7)(i/(i*(-10/11)i)i)/ii)(-3/52) assuming i is positive. i(-771/4004) Simplify d(dd*1d)/dd/(d/(ddd(-12)))d*(-2)/(dd7) assuming d is positive. d(-17) Simplify ((h/(h*(-2/5)hh))(-22)/(h(4/11)h/h*(-8)h))(-2/127) assuming h is positive. h(-312/6985) Simplify (j*(-1/39)/(jj/((jj(-1/38))/j)))/(((j/j37)/j)/(j/(jj(j/(j/(j(-1/34)j))j)/jj)j)) assuming j is positive. j(415417/12597) Simplify (((z(11/3)z)/z)/z(z/(z/(z30z)))/z)(3/14) assuming z is positive. z7 Simplify (b/((b/b*3)/bb))*(-25)b*(-2/5)bbb(-2/31) assuming b is positive. b(-11387/155) Simplify ((b(1/4))(-32/5)(b/b0)/((b(-3)/bb)/b))13 assuming b is positive. b(221/5) Simplify (d(-15))(2/79)/((d0/d)/(d/(d/((d(-36)d)/d)))) assuming d is positive. d(-2795/79) Simplify ((pp/p*(-2)p)*(-3/2)p6/(p/p(4/5)))16 assuming p is positive. p(-136/5) Simplify (t/t*(-9)tt(2/21))(2/7) assuming t is positive. t(466/147) Simplify (n50nnn(-15))(-32) assuming n is positive. n*(-1184) Simplify ((ii*(-2/3))/(i/(ii*(-3)i)))/(i2)43 assuming i is positive. i(-263/3) Simplify (j2)*(-7)(j5)(-2/67) assuming j is positive. j(-948/67) Simplify y(-12)/(y/((y*0/y)/yy)y)(y1)(-4/7) assuming y is positive. y*(-109/7) Simplify ((ll7)/l)/(l/(l/(l1/l)))l/((l(-5/6)/ll)/l)(l/(l/l(-2/21)))/ll assuming l is positive. l(409/42) Simplify (v10/(vv(-6/17)))/((v/(v/(v(-6)/v)))/(v/(v/v(3/5)v))) assuming v is positive. v*(1356/85) Simplify gg(ggg/g(-11)g)/gg(gg(2/7)g)/gg(2/27)g/((g/(g/g*(-6))g)/g) assuming g is positive. g(4793/189) Simplify b(4/3)b(-31)(bb(b/((((bbb/(b/((bb(-17))/b)b))/b)/b)/b))/b)/(b/(b(-34/3)/b)) assuming b is positive. b(-22) Simplify z*(2/15)/zzz1(zz/(zz*(-3)/zz))(37/4) assuming z is positive. z(572/15) Simplify b(-2/9)/b(-8)((b(-4)/b)/b)(-3/13) assuming b is positive. b(1072/117) Simplify ((x(3/8)/x)/x)/((x(-11/7)/x)/x)(xx((x(x/x2)/xxx)/x)/xxx)(-1/10) assuming x is positive. x(461/280) Simplify (a(6/11)/aa(a(-2)/a)/a)/(a(-2/37)a(-3)) assuming a is positive. a(-163/407) Simplify ((t*(-3/20)t)/tt(-18))/(t(-2)ttt/(t*(1/17)t)) assuming t is positive. t(-6151/340) Simplify (((((q(1/4)q)/q)/q)(-2))(2/79))(-5/9) assuming q is positive. q(-5/237) Simplify (((h/(h/(h((hhh*(-2/11))/h)/h)h))/h)/h)/hhh*(-9)h(((h(-1)/h)/h)/h)(2/47) assuming h is positive. h(-5352/517) Simplify ((i(-14/3)/i)/i(-13))(-8) assuming i is positive. i(-176/3) Simplify (u/(u/((u/(u/(uuu/(u/(u(-2/9)u)))))/uu)))(-33)(u(3/8)/u)(2/137) assuming u is positive. u*(-150715/1644) Simplify ((aa*14/aa)/a(2/15))/((a/(a/a(-1/8)))/a)(1/4) assuming a is positive. a(7271/480) Simplify ((y(2/7))28/((y/(y((y/y(-10)yy)/y)/y))/(y/y3)))(-5/8) assuming y is positive. y(-85/8) Simplify (y/y6)(1/2)/((yy/y(1/8))/y)(-2/45) assuming y is positive. y*(-443/180) Simplify (yy/(y/(yy(6/5)/y)))(-20)/(((y(-2/5)/yyy)/y)/(y(-9)yy)) assuming y is positive. y(-253/5) Simplify ((((d/(dd/(dd5)))/dd)/d*4)/(((d/((d/(d/((d/(dd*(-1)/d))/d)d))/d))/d)/(d/(d/d*2d))))(-4/33) assuming d is positive. d(-4/33) Simplify s*(-4/9)/(s/(s/(s/((ss*(1/2)s)/ss)))s)(s(-1))(-17) assuming s is positive. s(307/18) Simplify ((g/g(-4))/(g(3/19)/gg))(-13/5) assuming g is positive. g(-1196/95) Simplify (c14/c(-4/7))/(c(-2/7)/c)(13/5) assuming c is positive. c(627/35) Simplify r(2/41)r(1/21)/rr(r/(r/(rr/(r/(rr/r(-9))r))))/r15 assuming r is positive. r(-3361/861) Simplify (d0)(-3/4)((d/d(-12))/dd)/d6 assuming d is positive. d7 Simplify (g/(ggg*(1/5))g/g*(-1))/(g/((gg/g(-10/11))/g))18 assuming g is positive. g(944/55) Simplify (q(-2/27))*(-8)(q/(qqq/(q*(-5)/q)q))(-1/83) assuming q is positive. q(1571/2241) Simplify (w*(3/2)/(w(w*3w)/w))/(w(-8)/w)(-15/8) assuming w is positive. w(-155/8) Simplify (v/(v/v(-1/2))v/v(-9)v)/(v/v*(2/23)vv(-2/7)) assuming v is positive. v(2857/322) Simplify (l/(ll(9/7)))/l14l(8/9)/(l33/l) assuming l is positive. l(-2923/63) Simplify (n19/(nnn(-17)))/(n(-2/37)n(-17)) assuming n is positive. n(1889/37) Simplify i(i/(iii/(i(-1/4)i)))/ii/(i/(i(-13)/i))(i/(i*(-1)/i))/((ii*5)/iii) assuming i is positive. i(-77/4) Simplify (r(-8)/(r48r))(-8/7) assuming r is positive. r(456/7) Simplify (ww(-7)w/(w/(w*(3/8)/ww))(w(-8)/ww)/(w*(1/2)w))(2/53) assuming w is positive. w(-121/212) Simplify p(-2/17)/(p/p(2/5))(p/(p/(pp(p/((p/(p(-2/21)p))/p))/pp)))(-31) assuming p is positive. p(-217351/1785) Simplify ((n(n*0n)/n)(5/4))35 assuming n is positive. n(175/4) Simplify ((y/((y(-9)y)/y))/y(-4)yyy*(-8/9)y(2/7))(-20) assuming y is positive. y(-19400/63) Simplify (u(1/5)uu/u13)/(u4u(-2/35)) assuming u is positive. u(-516/35) Simplify (a32/((aa(2/5))/a))/((a/(a4a))/(a(-21)/a)) assuming a is positive. a(68/5) Simplify (r(-2/7))(-1/22)rr(-2/17)rr(-11) assuming r is positive. r(-11918/1309) Simplify ((q/(q14qq))/(qq*(-1/2)q))/(q*5q/(qq/q(-11))) assuming q is positive. q(-19/2) Simplify (x/((x/(x(x(x/(xx*(-3)x)x)/x)/xx))/x))*(-24/11)(x(-1/18))(2/69) assuming x is positive. x*(-74531/6831) Simplify ((dd/(d/(d*(-1/20)dd)))/(dd(-3/11)/d))17 assuming d is positive. d*(12053/220) Simplify (((hh1)(2/49))(-9))(-6) assuming h is positive. h(216/49) Simplify ((l(-1/4)/ll)(-8/5)(lll*(-2/3)ll)(-2/27))(1/2) assuming l is positive. l(31/405) Simplify ((gg/(gg7))(-4/13))(-25) assuming g is positive. g(-600/13) Simplify o/((((o/(o(-13)/oo))/o)/o)/ooo)oo*(-2/11)(o/o(1/7))/o(-12) assuming o is positive. o*(129/77) Simplify (t/((tttttttt(t(tt/(t19tt))/t)/tttttt)/t)tt)/(t*(1/40)tt)((t/(t*(-8/5)/tt))/t)(-10/7) assuming t is positive. t(1873/280) Simplify ((d(-6)/d(-2/9))39)(11/6) assuming d is positive. d(-3718/9) Simplify ((p0/p)*(4/3)(p(1/4))26)47 assuming p is positive. p(1457/6) Simplify i*(-4)i/i*(1/12)(i/i*(-28))/ii(2/5) assuming i is positive. i(1519/60) Simplify (g*(-13)/g)/(gg*(11/4)/ggg)(((g/(g/g(12/5)))/g)/g)/(g(-7/6)/ggg) assuming g is positive. g(-1091/60) Simplify ((x(-1))(-42)/(x(1/7)x(x(x/((x/(((x(x/x*(-5))/x)/x)/xx))/x))/x)/x))(-22/9) assuming x is positive. x(-5522/63) Simplify x*(4/7)x*(2/27)x/(xx(2/35))x(-19) assuming x is positive. x(-17399/945) Simplify (v/v(4/3))37(vv*(-15)/v)/((v/(v(vv(7/5))/v)v)/v) assuming v is positive. v(-389/15) Simplify (v25/vv(-13)/v)(-3/10) assuming v is positive. v(-3) Simplify ((z(1/6)/z(-3/10))/(zz/z*(1/3)zzzz(-3)))(8/13) assuming z is positive. z(-48/65) Simplify ((b/((bb/b*(-2)b)/b)b(-6))(-25))(-24/5) assuming b is positive. b(-1080) Simplify (s(-14)/(ss/(s/s(-23/3))))/((s(-32)ss)/s(-28)) assuming s is positive. s(-16/3) Simplify (jjj/((j(j/j9j)/j)/j)jj/j*10(j/(((jj(-2))/j)/jj))(-3/28))(-14) assuming j is positive. j**(-	{ "pile_set_name": "DM Mathematics" }
t a = -48 - -59. List the prime factors of a. 11 What are the prime factors of (-138)/3(-2 - 3/(-6))? 3, 23 Suppose -5r = 4r - 621. What are the prime factors of r? 3, 23 Let l = -8 + 5. Let f = l - -9. List the prime factors of f. 2, 3 Suppose -2y = y. Suppose j + 5u - 15 = 0, 2j - u + 0 + 3 = y. Suppose jr - r = -l + 8, 0 = -4l + 5r + 28. What are the prime factors of l? 2, 3 Let v(n) = -n3 + 3n*2 + 4n - 2. Let w be v(4). List the prime factors of w(-2 + 7)-1. 2, 5 Let j be ((-1)/(-3))/(2/24). Suppose 2 - j = c. List the prime factors of 16/10 + c/(-5). 2 Suppose 2b + 179 = 3g, 2b - 44 = -3g + 143. List the prime factors of g. 61 Suppose -3 = -3v + 3. Suppose -4 = vq + 4l, -q + 0 - 4 = 4l. Suppose -2p + 3w = -20 + 1, -5p + 2w + 53 = q. List the prime factors of p. 11 Let d = -14 + 27. What are the prime factors of d? 13 Let h(p) = p*2 - 5p + 8. Suppose -18 = -n - 2n. Let q be h(n). Suppose -x = k - q, -3k + 5x = -0k - 26. List the prime factors of k. 2, 3 Suppose -r = r - 46. What are the prime factors of r? 23 Let z = 8 - -8. List the prime factors of z. 2 What are the prime factors of 1/(-2 - (-303)/151)? 151 Suppose 216 = 5f - 79. List the prime factors of f. 59 Let c(i) be the second derivative of 2i*3/3 - 5i*2/2 - i. List the prime factors of c(4). 11 Let z = 29 + 77. List the prime factors of z. 2, 53 Let q(f) = -f + 9. Let g be q(6). Suppose g - 28 = -5a. What are the prime factors of a? 5 Suppose 4 + 8 = 2m. Suppose 4b - m = b. Suppose 2s = -4u + 20, -2u - 26 = -7u - bs. What are the prime factors of u? 2, 3 Let c(b) = 2b*2 - 2b. Let q be (4/(-6) - 0)3. Let u be q - (16 + -1)/(-3). List the prime factors of c(u). 2, 3 Let l(f) = -f + 3. Let k = 13 - 20. List the prime factors of l(k). 2, 5 Let p be (-1 + -1)1 - -36. Suppose 0 = 2m - 1 - 7. Suppose v + 30 = r + 3r, mr - p = -v. List the prime factors of r. 2 Let h be ((-3)/6 + 1)62. List the prime factors of 0 + h - (-2)/(-1). 29 Let q(g) = 6g. Let m be q(5). Let j = 47 - m. List the prime factors of j. 17 List the prime factors of ((-1032)/21 - -4)14/(-4). 2, 79 Suppose -221 = -5m + 114. List the prime factors of m. 67 Suppose 26 = -3s - 2x, 3x + 21 = -2s - 2x. List the prime factors of (30/s)/((-1)/12). 3, 5 Suppose 6 = 2d, 0 = v - 2v + d + 32. List the prime factors of v. 5, 7 Suppose 0 = p - 5j + 13, j - 1 = 2p - p. Suppose -2l + 4k = 3l - 11, -pk - 10 = -4l. List the prime factors of l/9 + 58/6. 2, 5 Let p(u) = -2u*3 + 4u*2 - 3u + 1. Let d be p(2). Let y = -2 - d. What are the prime factors of y? 3 Suppose -4t = -t + 6. What are the prime factors of ((-6)/(-4))/(t/(-8))? 2, 3 Let y = 0 + 3. Let h be (y/6)/(3/18). Suppose -o - 6 = o - 4i, 5o + hi = 24. List the prime factors of o. 3 What are the prime factors of ((-145)/10)/((-2)/4)? 29 Let b(m) = m*2 - 15m + 20. Let q be b(14). Suppose qt - 38 = -8. What are the prime factors of t? 5 Let t = -1 + -4. Let k = 13 + t. Suppose 4h - k = 8. What are the prime factors of h? 2 Let t(m) = -m*3 - 2m*2 - 2m - 2. Let h = 0 - -10. Let r be (-42)/15 + (-2)/h. What are the prime factors of t(r)? 13 Suppose -4u + 142 = -22. What are the prime factors of u? 41 Let t = 0 + 1. What are the prime factors of (-16 - -5)/(0 - t)? 11 Let m(n) = 4n*3 + 2n*2 - n - 1. What are the prime factors of m(2)? 37 Let j(v) = -8v - 1. Let k be j(-1). Let f(u) = -u*3 + 8u*2 - 2u - 7. What are the prime factors of f(k)? 2, 7 Suppose 0 = 3i + 5l + 14, -5i = 3l - 5l + 13. What are the prime factors of (-34)/((-2)/(-3)i)? 17 Let p(i) = i*3 - 3i*2 + 2i - 3. Let t be p(3). List the prime factors of (-1)/t - 1050/(-45). 23 Let w = 35 - 1. What are the prime factors of w? 2, 17 Let z = 104 - 54. Let p = -30 + z. What are the prime factors of p? 2, 5 Let v = -10 + 20. Let d be 18/(-5) + (-4)/v. List the prime factors of -2211/d. 11 Suppose 2b = 4f - 46, -b + 41 - 9 = 3f. Let h = f - 9. List the prime factors of h. 2 Let m(z) = 2z + 3. Let s be m(2). Suppose 4 = 2r - 0. Let u = s - r. What are the prime factors of u? 5 Let m(d) = -4d. Let v(a) = -3a. Let s(j) = 5m(j) - 6v(j). What are the prime factors of s(-6)? 2, 3 Let b be 1 + -3 - (-6)/2. Let a(d) = 16d. What are the prime factors of a(b)? 2 Suppose -3d - 2d + 70 = 0. Let y(h) = -2 + 3h2 - dh + 3 + 15h. What are the prime factors of y(2)? 3, 5 Let t(p) = p - 4 - 3p - 2 + 0p. Let m be t(-4). Suppose z + m = 11. List the prime factors of z. 3 Suppose 0 = 5t - 17 + 2, 2p - 2t = -6. Suppose -5o - 3 - 7 = p. What are the prime factors of (-1)/(21/12 + o)? 2 Let z = 11 - 1. Suppose -5m + 180 = z. What are the prime factors of m? 2, 17 Let g be 2 + (-1 - -1) + -9. Let v = g - -13. Let m(r) = r*3 - 5r*2 - 5r + 8. What are the prime factors of m(v)? 2, 7 Let p(f) = 1. Let i(l) = 2l + 5. Let c(m) = -i(m) + p(m). Let j(n) = -n3 - 5n*2 - 5n - 3. Let g be j(-3). What are the prime factors of c(g)? 2 Let r(t) be the third derivative of -t*4/24 - 5t*3/6 - 3t*2. Let w be r(-7). Suppose -wy + 6y = 48. What are the prime factors of y? 2, 3 Let d(r) = -r3 - 4r*2 - 3. Let y be d(-5). Let m = y + -13. Suppose 0 = v - m - 0. List the prime factors of v. 3 Let u(b) = -3b*3 - 6b*2 + 4b - 1. Let r(j) = -7j3 - 12j*2 + 8j - 1. Let h(q) = -2r(q) + 5u(q). What are the prime factors of h(-7)? 2, 3 Suppose -3s - 186 = 3s. Let y = -7 - s. What are the prime factors of y? 2, 3 Suppose 2k - 6z = -z + 16, 0 = k - z - 14. What are the prime factors of k? 2, 3 Suppose -3y - d - 3d = -18, 2y = -3d + 13. Suppose -3h + 3 = -yh. List the prime factors of h. 3 Suppose 4s - 3s = 0, 5s = -5z + 60. List the prime factors of z. 2, 3 Let t(u) = -u + 11. Let h be t(11). Suppose h = 2x + 3x - 10. What are the prime factors of x? 2 List the prime factors of 2116/9 + (-3)/27. 5, 47 Let j be ((-1)/(-2))/((-1)/64). Let a = 58 + j. List the prime factors of a. 2, 13 Let g(h) = -4h + 1. Let t be g(-6). Suppose -5s + k + t = 0, -s + 2k - 7 = -3. What are the prime factors of s? 2, 3 Let l = -17 - -10. Let x(r) = -r3 - 8r*2 - 6r - 8. Let g be x(l). What are the prime factors of (12/g)/(8/(-180))? 2, 3 Let o = 40 - 26. Let n = o - 6. List the prime factors of n. 2 Suppose 3w - 65 = 13. List the prime factors of w. 2, 13 Let i(h) = h3 + 2h*2 + 2. Let j be i(-3). Let y = -5 - j. What are the prime factors of ((-28)/(-8))/(1/y)? 7 Suppose 3h - 91 - 179 = 0. List the prime factors of h. 2, 3, 5 Let u = 366 + -193. What are the prime factors of u? 173 Let b = -128 - -179. Let w = -33 + b. List the prime factors of w. 2, 3 Suppose 186 = 2i - j, -118 = -i - 3j - 25. List the prime factors of i. 3, 31 Let j be (1/3)/(8/48). Suppose -4k + 36 = jy, -1 + 7 = k + 2y. Suppose 0 = b + 3, -1 = 3n + b - k. List the prime factors of n. 2 Suppose 2o - 2 = 4q + 12, 0 = q - 4o. What are the prime factors of (-18)/(-5) - q/10? 2 Let d = -34 - -53. List the prime factors of d. 19 Let z = 2 + -3. Let h be 154/35 + (-4)/10. Let r = h + z. What are the prime factors of r? 3 Let x(p) be the first derivative of 2p*3/3 + 9p + 7. What are the prime factors of x(0)? 3 Suppose -4i + 4 = -3n + 1, -2i = n - 9. Suppose 145 = 2d + id. List the prime factors of d. 29 Suppose -60 + 16 = -2m. What are the prime factors of m? 2, 11 Let a be 5 - 0 - (0 + 1). Suppose 3x + 5c + 0c = -a, -3c = 6. List the prime factors of x. 2 Let k(b) = 34b - 5. List the prime factors of k(1). 29 Suppose 12 - 28 = -4m. Suppose 3l = 2l - m. Let u(f) = -f*2 - 6f + 1. List the prime factors of u(l). 3 Let r(n) = -3n - 8. Let d be r(-6). Suppose 5v + 5 = d. Let f = v + 2. List the prime factors of f. 3 List the prime factors of (62/(-8))/((-7)/140). 5, 31 Suppose 0 = 3h + 2f + 2f - 29, -7 = h - 2f. List the prime factors of h + -23 + 14. 11 Let l = 20 - 12. What are the prime factors of l? 2 Suppose 0 = -0h - 2h. Suppose h = 2l - 4 - 22. List the prime factors of l. 13 Let d(k) = -k - k + 3k + 1 + 4. Let t be d(-5). Suppose t = -5z + 10 + 35. What are the prime factors of z? 3 Suppose -4h = o + 4o - 56, 4o - 2h - 50 = 0. Let l = o + -8. Suppose -3r = -lr + 13. List the prime factors of r. 13 S	{ "pile_set_name": "DM Mathematics" }
+ 7k + 1 - 4 + k2 + 0k*2. Give s(-6). -7 Let g(z) be the second derivative of -3z5/20 + z4/12 - z*3/6 + 6z. Let d = -3 + 4. What is g(d)? -3 Let f = -123 - -131. Let z(n) = n - 8. What is z(f)? 0 Let a(r) = -7r + 6. Let v(p) = -20p + 17. Let m(k) = 17a(k) - 6v(k). Let j be (0 - -12)2/(-28)-7. Give m(j). 6 Let u(s) = -3s3 - s2 - 2s + 1. Let q(v) = v - 1. Let j(k) = -q(k) - u(k). Suppose y - 15 = -2y. Let d = y - 6. Give j(d). -3 Let b(w) = -w3 - 6w*2 + 5. Suppose 3d + 68 = 50. What is b(d)? 5 Let d(u) = 2u - 6u + 2u + 3. Calculate d(5). -7 Let x be 1/(-2)11-2. Let m = x - 15. Let t(b) = -4b*3 - 3 + 0b*2 - 5b + 5b3 + 3b*2. Determine t(m). 1 Let y(a) = -a - 9. Suppose 2h + 0 = -g - 5, 0 = -4h + 12. Calculate y(g). 2 Let m(b) = -2b + 1. Let n be 15 - (-6)/(-3). Calculate m(n). -5 Let l = -1 - -5. Let g(w) = -w3 + w + 2 - l + 0w. Suppose 4t = 4, 9t = 3k + 4t - 1. Determine g(k). -8 Let w(j) = j + 6. Suppose 2x = -5r - 2x + 34, 2x = 3r - 16. What is w(r)? 12 Let f(x) = -x3 - 4x*2 - 3x - 2. Let w be (4/5)/(46/(-115)). Calculate f(w). -4 Let n(l) = 2l - 1. Suppose 0 = -5b + 6 - 16. Let d be 3b/(-6)3. Calculate n(d). 5 Suppose 2j = 1 - 5. Let v(r) be the third derivative of r6/120 - r4/8 - r3/2 + 19r2. What is v(j)? -5 Let n(m) be the third derivative of -m5/60 + m4/24 + m3 - m2. Let z(a) = -a3 + 9a. Let s be z(-3). Determine n(s). 6 Let m(i) = -7i - 3. Let n(w) = -20w - 10. Let x(j) = 17m(j) - 6n(j). Determine x(-7). 2 Let a(s) = -s3 + 3s*2 - 1. Suppose 0c - 10 = -2c. Let b = c + -2. Calculate a(b). -1 Let m(k) be the first derivative of -2k*3/3 + 3k*2/2 + k + 2. Let s(h) be the first derivative of m(h). Let f be ((-4)/(-5))/((-2)/(-5)). What is s(f)? -5 Let y(u) be the third derivative of 5u*2 - 1/6u*3 + 1/12u*4 + 0u + 0. Let m = -3 - -1. Determine y(m). -5 Let y(j) be the second derivative of 0 - 3j + 1/360j*6 + 1/2j*3 + 1/12j*4 + 0j*2 + 1/60j*5. Let m(u) be the second derivative of y(u). Give m(-3). 5 Let a = 153 - 149. Let y(s) = -s + 2s*2 - 1 - 3s*2 + 5s. Calculate y(a). -1 Let k(r) be the first derivative of 3/2r2 + 1 + 7/24r*4 + 0r - 1/6r3. Let b(l) be the second derivative of k(l). Calculate b(1). 6 Let x(t) = -9t*2 - 7t. Let z(f) = -4f2 - 4f. Let b(w) = -3x(w) + 7z(w). Give b(-6). 6 Let s(f) = -f*3 + 4f*2 + 6f - 6. Suppose -4z - 5a + 35 = 0, -2z - 2a + 0 = -16. Suppose -2p - 4v + 10 = 0, -7v - 25 = -zp - 3v. Give s(p). -1 Let m(j) = -j. Let v(w) = -w3 + 12w*2 - 12w + 13. Suppose -23 = -3l + 10. Let n be v(l). What is m(n)? -2 Let v(a) be the second derivative of -a3/6 - a2 - a. What is v(0)? -2 Let t be 2/13 - (-99)/117. Let q(o) = -12o3 - o2 - o + 1. Give q(t). -13 Let o(n) = 11n + 5. Let t(p) = -9p - 4. Let k(s) = 4o(s) + 5t(s). Let l = -6 + 8. What is k(l)? -2 Let z = 1 + -6. Let w(c) = -c*2 - 4c - 6. Give w(z). -11 Suppose 8 = 2q + 2q. Let z(s) = 4 + 2s + s - 12s. Let n(j) = -8j + 3. Let w(g) = -6n(g) + 5z(g). Calculate w(q). 8 Let g(k) = -k3 - 2k*2 + 3k - 3. Suppose s = 3s - 4. Calculate g(s). -13 Let k(h) be the first derivative of h3/3 - 3h*2/2 + 5h + 13. Determine k(5). 15 Let d be ((-1)/(-4))/((-2)/8). Let w(x) = -x + 1. Give w(d). 2 Let g(c) = -c + 5c + 7 - 3c - 2c. Give g(3). 4 Let d(a) = 5a*3 + 2a - 1. Let y(n) = -11n3 - 4n + 2. Let v(l) = -5d(l) - 2y(l). Calculate v(1). -4 Let v be 3-812/(-36). Let l(i) = i + 2. Calculate l(v). 10 Let z be (1 - 0) + 0 - 6. Let g(q) = 2q3 - 3q*2 - 3q - 4. Let j(w) = 3w3 - 7w*2 - 7w - 7. Let m(d) = -5g(d) + 3j(d). What is m(z)? 4 Let k(t) = -t*2 + 5t - 6. Suppose 0 = -4r - 4p + 3 + 1, 0 = -4p - 20. Let b = -1 + 2. Let j(m) = -m + 1. Let c(l) = bk(l) + rj(l). Calculate c(0). 0 Let r(l) = 4l - 8. Let y(d) = -3d + 5. Let q(h) = -5r(h) - 7y(h). Give q(-10). -5 Let z = 18 - 22. Let n(u) = 2u + 5u - 2u2 - u3 - 2u. What is n(z)? 12 Let v(b) be the second derivative of b4/6 + b3/6 - b2/2 - b. Let r(j) = -2 + j - 7j2 - 7 + 3 + j3. Let p be r(7). Give v(p). 2 Let q(d) = d*2 + 4d + 1. Let s be 28/6(-18)/12. Determine q(s). 1 Let i = 17 - 36. Let f = -22 - i. Let q(l) = 4 + 5l2 - 1 + 5l + 1 + l*3. What is q(f)? 7 Let i(f) be the first derivative of -f + 2/3f*3 - 2f2 + 2. What is i(3)? 5 Let f(g) be the third derivative of -g5/60 - g4/4 - g3/2 - g*2. Let i be f(-5). Let p(a) = a - 47a*3 + 2a*2 + 46a*3 + 2a - 3. What is p(i)? 3 Let o(g) = 5g2 + 2g - 1. Let n be o(1). Suppose -4p = -2t + 16, -2p = -np + 3t - 14. Let l(f) = f2 + 6f. Determine l(p). -5 Let p(z) be the third derivative of z*4/24 + 7z3/2 + z2. Let n be p(-16). Let i(f) = -2f + 6. What is i(n)? -4 Let j = 9 + -5. Let l(b) be the first derivative of -b5/60 + 5b4/24 + b3/3 + b2/2 - 2. Let y(z) be the second derivative of l(z). Determine y(j). 6 Let d(l) = l2 + 7l + 1. Suppose -17 = 5s + 23. Let t = s + 14. Let b = 1 - t. Determine d(b). -9 Let t be 22/(-6)3. Let q be (-3)/(t(-3)/(-2)). Let u(o) = 10o - 1. What is u(q)? 9 Let d = 137 - 141. Let k(v) = -6v + 3v*2 - 2v*3 + 3v*3 - 3 + 0. Determine k(d). 5 Let w = 7 + -2. Suppose 0y + wy = -4g + 3, -2g - 1 = 5y. Let f(x) = 5x3 - 2x*2 - x - 4x*3 - 3 + 4x. Determine f(g). 3 Let q(s) = 5s2 + s - 9. Let o(m) = m2 + m - 1. Let i(l) = 6o(l) - q(l). Calculate i(-3). -3 Let q be 6/8 + (-203)/(-28). Let w = q - 11. Let r(i) = i*2 + 7i + 3. Calculate r(w). -9 Let q be 2/11 + (-62)/(-22). Let b(s) = s + s + q + 0s. What is b(-3)? -3 Let p(a) = -a2 - 8a + 2. Suppose 3n + 24 = -n. Let r(d) = d2 + 6d - 8. Let b be r(n). Let z be p(b). Let v(f) = f*2 - 3f + 2. Determine v(z). 0 Let m(g) = g + 5. Let k(i) = i + 7. Let r = -18 + 11. Let p be k(r). Let u be (p/(-2))/(-1 - 1). Give m(u). 5 Let p(b) = -b*3 - 2b*2 + 5b + 3. Suppose -7 = 2x - 4h + 15, 10 = -2x + h. Calculate p(x). -3 Let k(b) be the third derivative of -b4/24 - b3/6 + b2. Let o be 0 + 0 - 2/(0 + 2). Calculate k(o). 0 Suppose 4v - 111 = 5q, -74 = 5v - 3q - 203. Suppose 0 = -6x + 7x - v. Suppose -x = -5f - 3h, 0h + 2h - 3 = f. Let p(i) = -3i + 2. Give p(f). -7 Let g = 1 - 3. Let d(c) = c*2 + 3c + 3. Let j be d(g). Let y(b) = b*2 + b + 1. Let r(l) = 6l*2 + 5l + 5. Let a(i) = r(i) - 5y(i). Determine a(j). 1 Let w(s) = s2 - s + 5. Suppose -3f - 2q + 4 = 0, -f + 6 = -0f + 3q. Calculate w(f). 5 Let y(i) = -2i + 4. Let a(f) = 5f - 12. Let o(m) = -3a(m) - 8y(m). Give o(-6). -2 Let r(w) = 3w - 41 + 45 - 7w. Determine r(4). -12 Suppose 2c + 3y - 19 = 0, -c - 23 = -4y - y. Let g(i) = -11 - ci - 2i + 3i. Suppose 0t - 2t = -0t. Calculate g(t). -11 Let y be 1/360/5. Let u(m) be the first derivative of m4/12 - 5m*3/6 - 3m*2/2 - m + 1. Let t(k) be the first derivative of u(k). Determine t(y). -7 Suppose 3u = 3 + 15. Let i(t) = -ut3 - 6 + 6 + t - t2 + 1. Determine i(-1). 5 Let u(l) = l3 + 5l*2 - 3. Let g(i) = 2i*2 + 16i - 5. Let f be g(-8). Give u(f). -3 Let g(v) = -v*2 + 15v + 15. Let r(y) = 3y + 3. Let s(z) = -2g(z) + 11r(z). Suppose j = -1 - 1. Give s(j). 5 Let r(w) = 0 - 2 + 2w - 2 + 5. Let q = 7 - 13. Give r(q). -11 Let c(t) be the first derivative of -t*2/2 + 1. Calculate c(1). -1 Suppose -2n = 2n + 3c + 12, -5n + 2c - 15 = 0. Let q(k) be the first derivative of -k*4/4 - 2k3/3 + k2/2 - 194. What is q(n)? 6 Suppose -2f - 4 = -4f. Let b(h) = -3h - 2. Let q(l) = -l - 1. Let a(u) = 4b(u) - 9q(u). What is a(f)? -5 Let g(c) be the second derivative of 2c + 0 - 1/2c2 + 1/6c*3. Suppose -4n - 9 = 15. Determine g(n). -7 Let w(q) be the second derivative of -q*3/6 + 2q*2 - 3q - 8. Calculate w(0). 4 Let y be (24/(-28))/((-2)/7). Let k(p) be the first derivative of y - 6p + 3/2p2. What is k(4)? 6 Let h(b) be the first derivative of -b3/3 - 5b2 - 7b + 45. Calculate h(-9). 2 Let o(a) = a*3 - 5a*2 - 6a - 3. Suppose 0 = 6v + 145 - 181. Give o(v). -3 Let x(h) be the second derivative of 11h*3/6 - 7h. Calculate x(1). 11 Let x be (4 + (-104)/20)/(6/20). Let d(g) = -2g2 - 5g. What is d(x)? -12 Suppose -3m = -0m	{ "pile_set_name": "DM Mathematics" }
e Let k(b) = 30b2 + 1. Let w be 2/8(-1 - 1)2. Is 6 a factor of k(w)? False Let t = -126 - -72. Let o = -10 - 0. Let g = o - t. Is g a multiple of 11? True Let q(w) = -w2 + 6w + 4. Let n be q(6). Suppose -2y + 6 = y + 3z, 0 = 2y - 3z - n. Suppose -3j + 2j = -5o + 6, -62 = -5j + yo. Is j a multiple of 7? True Let o be 12/1040/12. Suppose -op - 199 = 273. Let l = p - -209. Does 26 divide l? False Let j = -60 + 60. Suppose 570 = -jw + 3w. Is w a multiple of 38? True Let r(p) = 48p*3 + 2p*2 - 4p + 2. Let t be (-9)/(-36)(-1 + 5). Is 5 a factor of r(t)? False Suppose 7n + 6 + 1 = 0. Let x = 3 - 9. Is 3 a factor of (7 + x)/(n/(-13))? False Let x(t) = -t*2 + 0t*2 + 3t*2 - t + 2t. Let s be x(0). Suppose 0 = -3l - sl - 2b + 149, 3b - 150 = -3l. Is 17 a factor of l? False Suppose 0 = -2d - 5p + 10, 2d + 3p = 7 - 1. Suppose 548 = 4m - 4q, m + 2q - 7q - 121 = d. Is m a multiple of 47? True Suppose 10t - 406 = 304. Does 3 divide t? False Suppose -4i - 35m = -36m - 981, -5i + 4m = -1218. Does 2 divide i? True Let g = -12 + 14. Suppose -gk = -7k + 95. Is k a multiple of 16? False Let z(o) = -17o - 2. Let n be z(-7). Suppose -3b + 295 = 5c, 2c = b - 2b + n. Is 8 a factor of c? True Suppose 2u - 4h - 288 = 0, u + 2u + 3h = 423. Let j = -37 + u. Is j a multiple of 8? False Let i(a) = 2a - 22. Let w be i(10). Is w/6 + 441/27 a multiple of 2? True Let s be 5 - (-72)/4 - (0 - -3). Let q = 22 - s. Is q even? True Is -5(-4)/(-40) + (-114)/(-4) even? True Suppose 0 = 3u - 1208 - 1672. Is u a multiple of 30? True Let c(x) = -253x. Let b be c(-1). Suppose -5g + 2g + 3u + 201 = 0, b = 4g - u. Does 13 divide g? False Let q(o) = -29o - 18. Let l be q(-5). Let m(u) = -12u - 7. Let c be m(6). Let h = c + l. Does 14 divide h? False Let p be 4/(-6) - (-225)/(-27). Let g be (-10)/(-4) - p/6. Suppose 0 = gw + t + 2t - 120, -5w + 150 = t. Is w a multiple of 10? True Let q be -2 + (4 - 0) + 5. Let o(a) = -a3 + 9a*2 - 11a. Does 5 divide o(q)? False Suppose -7945 = -9q + 22007. Is q a multiple of 104? True Suppose 2z + 1 + 4 = -3f, -2f + 2 = 4z. Does 13 divide -3 - 25/(-5)22/z? True Suppose 0 = -3z + 8z - 900. Let d(q) = q3 - q2 - 1. Let v be d(2). Suppose k + vk = z. Is k a multiple of 15? True Let b(i) = i3 - 3i*2 - 3i + 6. Suppose 0 = 8w - 13 - 27. Is b(w) a multiple of 8? False Let n(s) = 2s + 16. Let o be n(-5). Suppose -oz + 160 = -2z. Does 8 divide z? True Suppose 5w = m - 258, -2m - 4w = -0m - 488. Does 9 divide m? False Let l(q) = 4q2 + 7q - 84. Is 17 a factor of l(-14)? False Suppose -w + 2a = 3a - 770, -2a = -10. Does 17 divide w? True Let v be 0/2(-2)/2. Suppose -4i - 8 + 152 = v. Does 9 divide i? True Let q(o) be the second derivative of o5/20 - 7o*4/6 - 7o3/3 - o2 + 4o. Does 2 divide q(15)? False Let h(p) = p3 - 13p*2 - 14p. Let g be h(14). Suppose -2o = -go. Suppose t + ot + 2 = 0, -5m - 5t + 255 = 0. Does 12 divide m? False Suppose 0 = -19m + 16m + 117. Is 3 a factor of m? True Suppose 0 = w - 4h - 17, 0 = 2h + 3h + 15. Suppose -wa - 5j + 260 = 0, -83 = -2a + 2j + 5. Let l = a - 13. Does 32 divide l? False Let z(n) = n*3 + 12n*2 - n - 10. Let f be z(-12). Suppose 5i + f + 83 = 5h, 64 = 2h + 4i. Let o = h + -17. Is o a multiple of 2? False Suppose u = 2, 4u + 4519 = 3g + 879. Is g a multiple of 15? False Let b = -8 - -13. Suppose -447 + 57 = -bg. Is 13 a factor of (-1)/(1(-2)/g)? True Let y(n) = -2n*2 + 55n + 33. Let g be y(28). Is 40 a factor of 3609/45 - 1/g? True Let z(w) be the first derivative of -33w2/2 + w - 2. Let l be z(1). Let b = 0 - l. Is 8 a factor of b? True Suppose -426v - 2844 = -432v. Is 79 a factor of v? True Suppose -3q - 5d = -1, 0 = q - 0d + 2d. Suppose -75 = -5a + qa. Let j = -14 + a. Does 11 divide j? True Let o(t) = -22t + 101. Does 27 divide o(-25)? False Suppose -5o = -4o - 2. Let t(v) be the third derivative of 17v4/12 + v3/6 - v2. Is 23 a factor of t(o)? True Suppose -2j + 3y = -5, 0 = 2j - 0j - 5y - 3. Suppose -4 = l + 2f - 7f, jl = 3f - 33. Does 6 divide (l/(-2))/(9/12)? True Suppose 12750 = 20d - 3d. Does 18 divide d? False Suppose 4k + 30 = -5f + 370, 164 = 2f - 4k. Suppose a + 5 - f = 0. Does 6 divide a? False Let l = 6631 + -4342. Is 45 a factor of l? False Suppose 5x + 104 + 61 = 0. Let p be x/9 - (-10)/15. Does 2 divide p + 7(-3)/(-3)? True Let g(n) = -12n - 40. Let o be g(-12). Does 2 divide ((-494)/o)/((-1)/4)? False Suppose 8v - 2812 = 2700. Is v/3 - -3(-8)/36 a multiple of 42? False Is (-48)/(-40)5 - 14-1 a multiple of 4? True Suppose 2744 = -82x + 89x. Does 14 divide x? True Let x be ((-68)/1)/(3 + -2). Let c be 12/(3 - x/(-24)). Suppose -4i = -i - c. Is 10 a factor of i? False Let o(i) = -i*3 - 33i*2 - 59i - 35. Does 57 divide o(-32)? False Let k(z) = -1 - 45z + 45z - z*2. Let s be k(-2). Is 3 + (-5)/(s/11) a multiple of 4? False Let z(c) = -c - 8. Let a be z(-12). Suppose -x = 3, -2x = -m - a + 24. Suppose m = 2h - 0h. Does 2 divide h? False Is 2 a factor of (4/7)/(-1 - 1331/(-1309))? True Suppose 0 = 18d - 86d + 80716. Does 65 divide d? False Suppose 0 = 3j + j - 1344. Suppose -3i - 284 = -4c, -5c + j = -0c + i. Suppose 13 - c = -5f. Does 11 divide f? True Suppose -60c + 54c = -4368. Does 14 divide c? True Let n(t) = 2t + 87. Is 13 a factor of n(15)? True Suppose 78 = -6i + 12. Let s be (i/(-3) - 1)-3. Let y = s + 29. Is 21 a factor of y? True Let c be (12/9)/(2/31). Suppose 3x - cv = -6v + 291, -4x - 4v = -384. Is x a multiple of 19? False Let u be 5 - 2/(-1)-6. Let l = u - -83. Is 4 a factor of l? True Suppose -5 = 7v + 9. Does 5 divide 2 - 7-5 - v? False Suppose -24928 = -29s - 684. Is 76 a factor of s? True Let a(f) = f2 + 5f + 75. Is a(17) a multiple of 30? False Let b(a) = a*3 + 15a*2 - 16a + 4. Let t be b(-16). Suppose 0 = -3j - tj + 42. Is j a multiple of 3? True Let d be 3/48/1212. Let t = 95 - d. Does 7 divide t? False Suppose 0u = u + 14. Let k be -67 - 2(4 - 5). Let v = u - k. Is 17 a factor of v? True Let w(y) = -y*2 + 8y + 9. Let x be w(-6). Does 13 divide (-20)/(-5) + -1 - x? True Let p(f) be the first derivative of f*4/4 + 10f*3/3 + 3f*2 + 10f - 16. Is p(-9) a multiple of 20? False Let m(k) = 0k - 3k - 4k + 6 + 0. Let w be m(-4). Suppose 0 = -0n + n - w. Is n a multiple of 8? False Let p = -1005 - -1113. Is 5 a factor of p? False Let p = -66 + 73. Is p a multiple of 5? False Suppose 0i = -4i + 8. Suppose -14m = -13m. Suppose m = -0f - f + i. Is f a multiple of 2? True Let s(q) = 24q - 12. Let a be s(4). Suppose 87g - 345 = ag. Is 11 a factor of g? False Suppose 9f = 11f - 4s - 1346, 3s + 670 = f. Is f a multiple of 7? True Let a = 798 + -679. Is 16 a factor of a? False Let r = 11 - 7. Suppose ri = 3i - 227. Let l = i - -321. Is 25 a factor of l? False Let n(y) be the second derivative of -y5/20 - y4/2 - y*3/3 - 15y*2/2 - 4y. Does 30 divide n(-8)? False Let x(c) = 31c. Let f be x(-1). Let w = 33 + f. Suppose -56 = -0o - wo. Does 4 divide o? True Suppose 0 = -9y - 10y + 2888. Does 23 divide y? False Let w(q) = 8q*3 - 3q*2 - 11q + 9. Is 13 a factor of w(4)? True Let r = -77 - -345. Suppose -7w = -3w - r. Suppose -w = -5z + 133. Does 10 divide z? True Suppose -5t = b - 0b - 49, 4t = 3b + 43. Suppose 0 = -3w + 5 + t. Suppose 0 = -v - d + 35, 3d - d = -wv + 187. Is 10 a factor of v? False Let f = -48 - 89. Let n = -83 - f. Does 14 divide n? False Let j = -19 - -21. Suppose -4 = jh - 156. Suppose -2b - 2b = -h. Does 19 divide b? True Let y(w) = 3w + 23. Let m be y(-5). Let h(z) = -z*2 + 16z - 1. Is 19 a factor of h(m)? False Is 8 a factor of (-12)/(-10) + (-10968)/(-60)? True Let s(w) = w - 14. Let o be s(18). Is 23 a factor of (o/(-2))/(26/(-663))? False Let t(w) = w*3 + 23w*2 + 2w - 23. Does 33 divide t(-22)? False Let x(z) = z*2 + z + 1. Let m be x(0). Suppose -4j + 1 = 4h - 3, -3j - 5h - m = 0. Let f = j + 6. Does 4 divide f? False Suppose -4u - 4v = -384, -2u + 3v + 206 = -2v. Suppose u + 212 = 5l. Does 16 divide l? False Is (88/(-55))/((-4)/200) a multiple of 9? False Suppose 5x = 202	{ "pile_set_name": "DM Mathematics" }
+ k - 10. Let z be l(h). What is the tens digit of 0 + (-29)/(-1) + z? 2 Let b = -10 - -26. Suppose b = -q + 3q. What is the tens digit of q/(-6)261/(-6)? 5 Let n(j) = 3j2 - 8j - 1. Let b be n(7). Let m be 3/2b/27. Suppose -5w - ml = -w - 63, 4w + 3l - 65 = 0. What is the tens digit of w? 1 Let z(k) = -5k*3 + 11k*2 - 3k + 6. Let o(n) = -9n3 + 21n*2 - 6n + 11. Let s = 13 + -7. Let d(j) = so(j) - 11z(j). What is the units digit of d(-4)? 8 Suppose 4g = 2m - 5m + 8, 0 = -g + 4m + 2. Suppose -gs = -12 + 2. Suppose st - 28 = -5h - 3, 3h = -5t + 25. What is the units digit of t? 5 Let k = -32 - -28. What is the tens digit of k/(84/(-497))(4 - 1)? 7 Suppose -3z - 21 = -12. Let v = -3 + 18. Let k = z + v. What is the tens digit of k? 1 Let d(k) = -11k + 29. Let i be d(9). Let a = -22 - i. What is the units digit of a? 8 Let b(h) = -h + 2. Let p be b(0). Suppose 3d - 6 = pr - r, -2d = 4r - 46. Let u(c) = c*3 - 10c*2 + 10c + 13. What is the units digit of u(r)? 2 Suppose -t - c - 866 = -2t, -3476 = -4t - 2c. What is the tens digit of t? 6 Suppose -42544 = 241r - 257r. What is the units digit of r? 9 Let u be 16/10(-30)/(-12). Suppose ur = x - 238 + 85, -r + 578 = 4x. What is the units digit of x? 5 Suppose 4c = 4a - 7a + 1891, 0 = -2c + 3a + 923. What is the tens digit of c? 6 Suppose -5w - 642 = -2322. What is the tens digit of w? 3 Let k(h) = -h*2 + 8h + 12. Let a be k(9). Suppose q + 5v - a = 0, -4q + 0v + 84 = 2v. Let u = q + -9. What is the tens digit of u? 1 Let w = -159 + 1037. What is the hundreds digit of w? 8 Suppose 2v = -w - 4w + 3744, 3w + 5v - 2235 = 0. What is the hundreds digit of w? 7 Suppose 61 = 4h + 45. Suppose 3p = 3g, hg + 20 = 2p + 6g. What is the units digit of p? 5 Suppose 4k + 5f - 23 = 0, -17 = -k - 0k - 5f. Suppose -kj = 0, 2j + 34 = s - 3j. What is the units digit of s? 4 Let p(g) be the third derivative of g4/24 - g3/6 + 6g*2. Let v be p(3). Suppose -3 = vu - 7, 1 = z - 5u. What is the units digit of z? 1 Suppose -235x + 1728 = -231x. What is the units digit of x? 2 Suppose -2u + 4u + 3n = 2000, -4u - 3n + 3988 = 0. Suppose t = -5y + u, 5t = -y - 0t + 194. What is the tens digit of y? 9 Let v(t) = 6t*2 + t + 14. Let h be v(-8). Suppose -19p + h = -16p. What is the units digit of p? 0 Let o be (-114)/(-8) - 10/40. Let v = 17 - o. Suppose 2z = -5l + 177, vl + 47 = -2z + 150. What is the tens digit of l? 3 Let x = -113 + 114. What is the units digit of x - (5 + -290) - -1? 7 Suppose 34 = -3v + 2v. What is the units digit of 2(-2)/4v? 4 Let m(j) = j3 - 3j + 1. Suppose -5q = 4v + 11, -4q + 0v = 2v + 4. Let k be 2/2 + (2 - q). What is the units digit of m(k)? 3 Let x be (18/(-27))/(1/3). Let m be -1 - (-3 - x - 91). Suppose m = 5n + 11. What is the tens digit of n? 1 Let b = 122 + 15. Let g = b - 75. What is the units digit of g? 2 Suppose 0 = -20i + 1552 + 648. What is the units digit of i? 0 Let o be (-6)/(-4)(0 + 2). Suppose -3j + 6 = 0, 3j = ov - 0v - 312. What is the hundreds digit of v? 1 What is the tens digit of -179(-20 + (15 - 6))? 6 Suppose -5c + 95 = -5y, c = -2y - 10 + 32. Suppose -18l = -cl + 418. What is the units digit of l? 9 Suppose -10c = -893 - 4057. Suppose 0 = -4v + 429 + c. What is the units digit of v? 1 Let f(v) be the first derivative of -23v2/2 - 72v - 4. What is the tens digit of f(-7)? 8 Suppose 6l - 2l - 4508 = 0. Suppose -l = -5d + 2043. What is the units digit of (-6)/(-33) - d/(-22)? 9 Let a(g) = 9g*2 + 6g + 2. What is the hundreds digit of a(-7)? 4 Let k(h) = -24h - 180. What is the tens digit of k(-11)? 8 Let y = -894 - -1973. Suppose 6x + 209 - y = 0. What is the tens digit of x? 4 Suppose 0 = 2i - 4, 39i = 2c + 41i - 1238. What is the units digit of c? 7 Suppose d + 2i - 3 - 9 = 0, -3i = 2d - 20. Suppose -5q = -dv + 3v - 222, -2q = -v - 90. What is the tens digit of q? 4 Suppose 0 = -5t + 25 - 300. Suppose 273 = -2c + 5c. Let o = c + t. What is the units digit of o? 6 Suppose j + 3x = -1 - 4, -4j = -5x - 14. Let r be 2j(-51)/6. Let v = r - -34. What is the units digit of v? 7 Let a(s) = -168s - 26. What is the hundreds digit of a(-3)? 4 Let j(k) = 2k3 - k2 + 2k - 1. Let r(v) = -v + 4. Let i be r(3). Let c be j(i). Suppose c = 5l - 63. What is the tens digit of l? 1 Suppose -g + 2 + 88 = 0. Let o = 46 + -41. Suppose -g = -oz - 0z. What is the units digit of z? 8 Let i(x) be the second derivative of -x4/12 + 13x3/6 + x2 + 6x. Let b be 1 + 1 - -52. What is the units digit of i(b)? 4 Let n(o) = -34o3 + o2 + 2o + 1. Suppose 6 - 11 = 5y. What is the units digit of n(y)? 4 Let p(l) = -l2 + 10l - 15. Let j be p(5). Suppose 2u + 2d - j - 58 = 0, -162 = -5u + 3d. What is the units digit of u? 3 Suppose 5k - 21 = 14. Suppose -1 - k = -g. What is the tens digit of (32/(-6))/(g/(-48))? 3 Suppose 199 + 2476 = 5a. What is the hundreds digit of a? 5 Let r(d) = -448d + 12. What is the hundreds digit of r(-1)? 4 What is the units digit of ((-12)/8)/(410/(-404) - -1)? 1 Suppose 5i - 10i - 1250 = -5j, 2i = j - 247. What is the hundreds digit of j? 2 Let w = 449 - 252. What is the hundreds digit of w? 1 Let f = 227 + 1523. What is the thousands digit of f? 1 Let w(t) = -17t + 221. What is the tens digit of w(-24)? 2 What is the units digit of ((-10332)/11)/(-7) - 2/11? 4 Let d(m) = 10m2 + 13m + 1. What is the hundreds digit of d(-16)? 3 Let n = 3249 + -1609. What is the units digit of n? 0 What is the tens digit of 2944 + -68/48? 4 Let f = 2230 + -1349. What is the units digit of f? 1 Suppose -4l - 8z + 1646 = -10z, -3l - z + 1247 = 0. What is the units digit of l? 4 Suppose -3x - 1705 = -5f - 6x, 0 = -5f + 3x + 1705. Suppose 2d - f = 43. What is the units digit of (18/24)/(4/d)? 6 Let b = 6 - 6. Suppose bi - 4k + 328 = 4i, -i - 5k = -82. What is the units digit of i? 2 Let c(v) be the first derivative of 27v*2/2 + 5v + 15. What is the units digit of c(2)? 9 Suppose -3s = -5b - 8, 3b = -5s + s + 30. What is the hundreds digit of (-170)/(-1) + -5 + s? 1 Let x be (24/10)/(4/20). Suppose 0 = -5y + 2h + x, -h + 3 + 1 = 0. Suppose 0 = -n - yn + 85. What is the tens digit of n? 1 Let k(t) = 2t*2 - 3t*2 + 9t + 13t - 24 - 5. What is the tens digit of k(20)? 1 Let n = -20 + 23. Let a be (n/(-6))/((-3)/(-18)). What is the units digit of (-258)/(-18) + 1/a? 4 Suppose -177 = 7h - 10h. What is the units digit of h? 9 Let w = 26 + -21. Suppose -2l - 15 = -2u - 43, wu = 15. What is the units digit of l? 7 Let t(p) be the third derivative of -p5/30 + p4/24 + p3/3 - p2. Let q(u) be the first derivative of t(u). What is the units digit of q(-3)? 3 Let s(r) = r*2 - 7r - 9r2 + 9r*2. Let t be s(7). Suppose d + tj - 36 = -3j, 2d + j - 52 = 0. What is the units digit of d? 4 What is the units digit of -1 + 12/(-6) + 5793 - -2? 2 Suppose -9d = 4o - 11d - 8, 2o - 28 = -5d. What is the units digit of o? 4 Suppose -10u = -y - 5u + 100, 0 = -3y - 5u + 240. What is the tens digit of y? 8 Suppose q - 4z = -z - 15, 10 = 4q + 2z. What is the units digit of 2 + q + 4/4? 3 Suppose -2u = 4, -1 = 5x - 4u - 4. What is the units digit of (3 - -9)x(-15)/2? 0 Let s = -1907 + 2004. What is the tens digit of s? 9 What is the units digit of (-34 - -33)/(0 - 2/2880)? 0 Let p(g) = g2 - 6g - 2. Let o(u) = u*2 - 12u + 12. Let a be o(11). Let x be 1((10 - a) + 0). What is the units digit of p(x)? 5 Let c(g) = -g3 + 2g*2 + 2g. Let o be c(3). What is the units digit of -2(63/(-2) - o)? 7 Let v(l) = 5l3 + l2 - 17. What is the units digit of v(4)? 9 Let m(j) = -6j3 - 5j*2 - 4j + 1. Let t be m(-2). Let q = t + -36. What is the units digit of q? 1 Suppose -251 + 1313 = 9m. Let l = 198 - m. What is the units digit of l? 0 Suppose 0 = -5p - 20, -d + 44p - 48p + 5795 = 0. What is the thousands digit of d? 5 Let v be 12/(-4)(0 + 3). Let a be (26/3)/((-2)/v). Let l = a - 28. What is the tens digit of l? 1 Let z(q) = 3q*3 - 6q*2 - 22q - 1. Let j be z(9). Suppose -j + 543 = -7b. What is the hundreds digit of b? 1 Let c be ((-21)/14)/(2/4). Let n be -37/c*-5.	{ "pile_set_name": "DM Mathematics" }
1384.7 + 94792.2545. 93407.5545 What is the difference between -68733.0193878 and 0.5? 68733.5193878 What is 0.14 take away -236943175.84607? 236943175.98607 Work out -40 - 240362167939. -240362167979 What is the difference between -0.05294904 and 377.9755? 378.02844904 What is the distance between 90146574 and -9758060? 99904634 Put together 4740 and 7325294141. 7325298881 Add together 1794420447697 and 0.08. 1794420447697.08 Total of -0.2 and 823725904035. 823725904034.8 What is the distance between -5908302285347 and 4? 5908302285351 Work out -29896422 - 1926068. -31822490 Put together -0.5 and 7184010763045. 7184010763044.5 What is 2391.04 less than -55065787.4? -55068178.44 Add 329.91 and -5132.271. -4802.361 What is 2955415 + -17688135? -14732720 -1.122501035885 + -0.7 -1.822501035885 Subtract -4 from -195088533628. -195088533624 Total of -532986900 and 0.0315. -532986899.9685 What is the distance between -727982 and 61163118? 61891100 What is -1707 take away -589550585.285? 589548878.285 Work out -11129 - -57.55176358. -11071.44823642 Subtract 9006530 from 73970. -8932560 Sum 2.20573 and 348647. 348649.20573 Add together -0.29 and 22848734.64999. 22848734.35999 What is -440576.14517 less than 169? 440745.14517 What is -96521640 - -1054182? -95467458 260869.05 + -149593 111276.05 Put together -2 and -468726348242.11. -468726348244.11 What is -1753705 plus 42949? -1710756 74706512+-5.205275 74706506.794725 1579039+21044753 22623792 What is the difference between -16025 and 0.1356354598? 16025.1356354598 -216.45568 - -5340.6 5124.14432 Add 1.637 and -16847978726. -16847978724.363 Calculate 38 + -7322.66474. -7284.66474 Put together -0.209617755 and -14. -14.209617755 What is 1057117.6574 less than 0.4? -1057117.2574 1618+268381640 268383258 Add 13834621.4325 and 727. 13835348.4325 What is -0.5 less than -14653869.5109? -14653869.0109 What is -0.3 - -100236621273? 100236621272.7 What is 2450304531 less than -44936? -2450349467 Sum 64.76 and -13468266980. -13468266915.24 Total of 74133894118 and -1. 74133894117 Work out 1.266185317951 + 1182. 1183.266185317951 Add 0.2041 and 156.0924931. 156.2965931 What is 0.5 less than -42382616154.2? -42382616154.7 Total of 148158941469 and 0.5. 148158941469.5 Calculate 205684.46897 + 0.12. 205684.58897 Calculate -20792719852398 - 7. -20792719852405 What is -126.901 - -65.35? -61.551 10.7828+0.04013938604 10.82293938604 Sum 1192720122 and 215. 1192720337 Add together -3785 and 1075298589. 1075294804 Calculate -0.884757829 + -4605. -4605.884757829 101401 - 11265457 -11164056 -10941349.8 - -2.38 -10941347.42 What is 91 less than -980.379676? -1071.379676 Total of 15.1874371 and 2.827. 18.0144371 Work out -7340.6359287 + -132. -7472.6359287 Total of 83835742.3 and -53235. 83782507.3 Sum 11 and 14773855712. 14773855723 What is -353769897096 - 0.5? -353769897096.5 What is the difference between -0.1 and -23186322621302? 23186322621301.9 Calculate -4790351.634 - 121561. -4911912.634 Add -30142760354 and -495. -30142760849 Calculate -36813 - 531501038. -531537851 Add 306 and -4817137124. -4817136818 What is -36577.63 minus -11977? -24600.63 What is the difference between 839 and -723134555.098? 723135394.098 Calculate 103453451 + 127. 103453578 Add 61583692216 and -11. 61583692205 What is -4 take away 1965808.15867? -1965812.15867 Work out -0.2 + 24891210829342. 24891210829341.8 Total of -0.33 and -100.9513229086. -101.2813229086 Work out -0.5 + 2.09219245263. 1.59219245263 Work out -2.64 - 13512441.4. -13512444.04 -0.048836+-0.02073001 -0.06956601 150082 + -1603809 -1453727 2646.814660617+-0.2 2646.614660617 Subtract 123912711452 from 49. -123912711403 Work out 139315108401 - 0.4. 139315108400.6 What is -29.75 plus 2094650? 2094620.25 Put together -19.334 and 17981317745. 17981317725.666 Work out 77 + -1168052480. -1168052403 Work out 0.1 - -36666048723.84. 36666048723.94 What is -27281788761 + -2.56? -27281788763.56 Calculate 1812851720040 + 0.092. 1812851720040.092 Subtract -4.71192 from -42496470. -42496465.28808 What is 0.08 minus 660.4510779237? -660.3710779237 Calculate -131763752 - 318.5. -131764070.5 -0.41 + -11995.206096 -11995.616096 Work out -67629 - -0.11502095. -67628.88497905 Calculate 430.2 - 3849608177. -3849607746.8 -23.8422 - 0.0270489685 -23.8692489685 Sum 5 and -118022766106. -118022766101 Sum 733776510990 and 0. 733776510990 Calculate 3368719 - 7996535. -4627816 Subtract -1560228568 from -47. 1560228521 What is 5515.2242 minus -1105.524? 6620.7482 What is the distance between -1304001214 and -278.4? 1304000935.6 What is -156887603197 less than -0.02? 156887603196.98 -1.33 - -126622412531 126622412529.67 What is 0.4 - 0.013160778649? 0.386839221351 Calculate 55.7 + -11.81267309. 43.88732691 What is -12 minus -409766683993? 409766683981 What is 3 less than 5874522685429? 5874522685426 What is 20825 - 171.9114? 20653.0886 Put together -89575.01 and -447889. -537464.01 What is the difference between 10066109 and -18281665? 28347774 Sum -29826108.57698 and -18. -29826126.57698 26712671 + 17324 26729995 -334.8331 + 8530050 8529715.1669 Work out -65820.3717019 - -0.55. -65819.8217019 What is -120029336 minus -0.879? -120029335.121 Subtract -1415 from 4212199254. 4212200669 Add together 29514679 and -15.11661. 29514663.88339 446.650826 + 830 1276.650826 What is 22737493717825 take away -5? 22737493717830 Add -2961 and -95995501387. -95995504348 Put together 0.04 and -3425558909040. -3425558909039.96 -27 + 336.0177426 309.0177426 What is 0.695621 take away -1592.0348? 1592.730421 What is -1454284 minus -767588? -686696 Put together -3806.5 and -619184.201. -622990.701 Sum -2886318968413 and -17. -2886318968430 What is 331581981806 plus -4? 331581981802 Total of 2941 and -155308660. -155305719 Add together -2 and 46373912767. 46373912765 Calculate -42715133 - 0.5563123. -42715133.5563123 What is 7.409568617507 plus 0.5? 7.909568617507 What is 922.7247835649 + 7? 929.7247835649 Work out 1493085691821 - 1. 1493085691820 What is -2762534 - -2928.11? -2759605.89 Work out 0.0113 - 19706.5359915. -19706.5246915 Sum -3861034.593 and -25582. -3886616.593 Total of 2.5 and 224011074822. 224011074824.5 -47326565646 - -126 -47326565520 What is -0.053078 take away 79509001? -79509001.053078 What is 51384.1175 less than 9326? -42058.1175 Sum 0 and 625567652.42. 625567652.42 What is the difference between 0.5 and -349241870? 349241870.5 What is 3 + 3645976130.512? 3645976133.512 Add -1309 and 1084.9286791. -224.0713209 Work out -6 - 217416467029. -217416467035 Total of 1.0812303481166 and -0.6. 0.4812303481166 -6221.566978 - -4 -6217.566978 What is the distance between -0.4 and 367957.4971989? 367957.8971989 782 + 108007432190 108007432972 Subtract 638296553 from -3720.13. -638300273.13 What is the difference between -180 and -581195023? 581194843 Subtract 43779569654 from -1.44. -43779569655.44 Work out -4489738 - 0.389. -4489738.389 52591.25 - 24.236471 52567.013529 Sum -280874.045648 and -5. -280879.045648 Subtract 106301.88 from -913.5846. -107215.4646 What is -4 plus -20687.361957? -20691.361957 What is -44 plus 40324.403602? 40280.403602 What is -191896 take away -7889493? 7697597 Work out 55.4 + 762611.043538. 762666.443538 What is -43666876587219 + 3? -43666876587216 -0.8 + 242391.342716 242390.542716 What is the distance between -0.0114776928395 and -0.51? 0.4985223071605 601579 + -169691.35 431887.65 What is the distance between 158.08597 and 0.1470024? 157.9389676 What is the difference between -10970416644 and -0.42? 10970416643.58 Add -2.2 and 16.926020783. 14.726020783 Put together -789.5377 and -0.39043803. -789.92813803 What is -5 minus -554862521.45? 554862516.45 Calculate 836172 - -40.2427. 836212.2427 Calculate -7.859857745 + 9. 1.140142255 Add -4 and -1.81014026951. -5.81014026951 -124.08849763 + 0.02 -124.06849763 Total of -151 and -16034.0632718. -16185.0632718 What is 0.14 + -29190.0816797? -29189.9416797 Calculate -0.462 - -244.4950688. 244.0330688 What is -36850 plus -34542112? -34578962 What is -112578325874 take away -2? -112578325872 What is 67515485 less than 0.829278? -67515484.170722 Add together 0.16 and -7096327114. -7096327113.84 Calculate -1548950563 - 18.49. -1548950581.49 W	{ "pile_set_name": "DM Mathematics" }
= u*2 - u - 1. Let a(y) be the second derivative of -5y3/6 - y2 - 715y. Give a(x) - 5f(x). -5x2 + 3 Let x(d) = -385d - 3840. Let r be x(-10). Let j(m) = -18m. Let h(u) = 35u. Determine rj(w) + 4h(w). -40w Let i(u) = -2u*3 - 19u*2 - 75u + 6. Let x(j) = -5j2 + j + 2. What is i(s) - 3x(s)? -2s3 - 4s*2 - 78s Let w(a) = -598a + 18. Let c(t) = 298t - 7. Determine 5c(n) + 2w(n). 294n + 1 Let g(p) = 28p*2 + p - 4. Let r(n) = 125n*2 - 2n - 13. Let b(o) = -243o2 + 3o + 26. Let j(h) = 6b(h) + 11r(h). Calculate -7g(k) - 2j(k). -30k2 + k + 2 Let o(b) = -4b*2 - 10b. Let c(q) = 7q. Let y(w) = -7w. Let u(x) = 30x. Let z(p) = 6u(p) + 25y(p). Let n(d) = 3c(d) - 4z(d). Determine -8n(j) - o(j). 4j2 + 2j Let w(p) = 3p3 + 2692p*2 - 6p + 2. Let d(v) = -3v + 1. What is 2d(z) - w(z)? -3z3 - 2692z*2 Let w(a) = 8a*3 + 110a*2 + 14a + 3. Let q(j) = -5j3 - 53j*2 - 8j - 2. Give 7q(d) + 4w(d). -3d3 + 69d2 - 2 Let i(f) = -f3 + 5f2 - f + 1. Let k(u) = -147u*3 + 25u*2 - 5u + 5. Calculate 5i(l) - k(l). 142l*3 Let y(n) = -7n + 57. Let p be y(8). Let s(o) = -o3. Let a(j) be the second derivative of -j5/4 - 8j + 3. What is pa(f) + 5s(f)? -10f*3 Let j(f) = -14f*3 - 6f*2 + 6f - 10. Suppose -5w - 30 = -2z, -6z - 16 = -10z - w. Let t(c) = 13c3 + 5c*2 - 5c + 9. What is zj(q) + 6t(q)? 8q3 + 4 Let y(g) = 454g*2 - 24g - 12. Let b(z) = 120310z2 - 6356z - 3178. Determine 6b(i) - 1589y(i). 454i2 Let o(k) = 14k*3 + 11k*2 - 11k + 7. Let x(n) = 7n3 + 5n*2 - 5n + 3. Let u(y) = 452y - 5417. Let q be u(12). Determine qx(r) - 3o(r). 7r*3 + 2r*2 - 2r Let b(q) = -5q2 + 23 + 18209q*3 + 3q - 22 - 18203q3. Let z(v) = -3v*3 + 2v*2 - v. What is -2b(y) - 5z(y)? 3y*3 - y - 2 Let x(y) = 2y*3 + 3y*2 - 3y + 843. Let q(s) = -6s3 - 10s*2 + 10s - 2529. Calculate 3q(l) + 10x(l). 2l3 + 843 Let g = -5467 - -5469. Let y(m) = 4m*2 + 4m + 5. Let v(j) = -9j2 - 9j - 11. What is gv(x) + 5y(x)? 2x2 + 2x + 3 Suppose 414 - 409 = 5m. Let x be -2 - (-3 - 0) - (-2 + m). Let k(t) = t2. Let s(y) = -2y*3 + 2y*2 - 2. Determine xk(a) - s(a). 2a3 + 2 Let x(c) be the third derivative of -7c4/24 + c3/6 - 4c2 + 9915c. Let d(h) = -h. Let t(n) = -n*2 - 4n + 1. Let r be t(-4). What is rx(u) - 4d(u)? -3u + 1 Let q(a) = -8a*3 + 23a*2 - 4a. Let r(h) be the second derivative of -3h5/4 + 15h*4/4 - 7h*3/6 + 3h - 529. What is 11q(c) - 6r(c)? 2c3 - 17c*2 - 2c Let w(l) = 19l3 - 6l*2 - 4l. Let b(h) = -5692h + 5699h + 6h3 - 43h*3 + 11h*2. What is 4b(p) + 7w(p)? -15p*3 + 2p*2 Let o(a) = -3a3 + a2 - 6a + 6. Let x(q) = q3 + 2q*2 - 64q - 2. Let t be x(-9). Let i(c) = -2c3 + c2 - 5c + 5. Give ti(p) - 6o(p). 4p3 + p2 + p - 1 Let d(k) = 15k + 94. Let c(a) = 2a + 11. Let x(l) = 17c(l) - 2d(l). Let u(j) = 5j. Calculate -3u(f) + 4x(f). f - 4 Let v(d) = 40d - 5. Let u(b) be the third derivative of -5b4/6 + b3/3 - 16b2 - 5b. Determine 5u(k) + 2v(k). -20k Let p(o) = 2o + 13. Suppose 0 = 24z - 30z - 30. Let u be p(z). Let k(h) = -h - 1. Let g(m) = m*2 - 3m - 3. Calculate uk(a) - g(a). -a2 Let d(z) = -385z*3 - 49z + 49. Let r(s) = -1886164s + 2 + 1886162s + 7s3 - 23s*3. Calculate 4d(q) - 98r(q). 28q3 Let t(y) = -y2 - y - 1. Let c(p) = -34p2 + 5p + 1. Let u(r) = -138r2 + 21r + 3. Let v(h) = 9c(h) - 2u(h). Determine 3t(d) + v(d). -33d*2 Let t(z) = -4. Let h(g) = g - 187. Let u(x) = 2x - 280. Let r(l) = -3h(l) + 2u(l). Give -r(m) + t(m). -m - 5 Let t(a) = -8a2 + 2a + 2. Let d(f) = -f*2. Let v be 118/8 + 60/48. Suppose -p - 2k - v = -6k, p = 5k - 21. What is pd(y) - t(y)? 4y*2 - 2y - 2 Let y(o) = -61o2 + 20o + 14. Let l(k) = -21k2 + 7k + 5. Let i(d) = -8l(d) + 3y(d). Let n(u) = -30u2 + 9u + 4. Determine 5i(z) - 2n(z). -15z2 + 2z + 2 Let i(u) = -5u3 - 6u*2 - u - 5. Let w(k) = -17k*3 - 26k*2 - 4k - 16. Give 13i(o) - 4w(o). 3o3 + 26o*2 + 3o - 1 Let z(o) = 7o3 + 296o*2 + 7o - 77. Let w(c) = -2c3 - 74c*2 - 2c + 21. Calculate 22w(y) + 6z(y). -2y3 + 148y*2 - 2y Let o(r) = -5r3 + r - 1. Let h(y) = 5y*3 + 2y*2 - 6y - 79. Give h(z) + 6o(z). -25z*3 + 2z*2 - 85 Let r(v) = 3v - 4. Let s(l) = -21896l + 25024. Give -6256r(z) - s(z). 3128z Let a(g) = -g2 - g + 93. Let h be a(9). Let f(m) = -h + 52m + 3 - 3 - 55m. Let n(u) = 0 - 4 - u + 3. Calculate f(r) - 4n(r). r + 1 Let h(g) = -24g3 + 40g*2 + 8g. Let c(b) = -98b3 + 170b*2 + 35b + 1. What is -2c(q) + 9h(q)? -20q3 + 20q*2 + 2q - 2 Let v(l) = l + 6. Let u(y) = 2y + 7. Let w(o) = -o3 - 42o*2 - 2. Let g be w(-42). Let i be (g/4)/((-31)/248). Calculate iv(k) - 3u(k). -2k + 3 Let o(k) = -2k2 - 3k + 1. Suppose 206 = 2x + 204. Suppose 4q - q + 24 = -5w, 3w - q = -6. Let j(l) = 9l + 6l - l*2 - 16l. What is wj(t) + xo(t)? t*2 + 1 Let c(z) = 3107 + 3105 + z - 6238. Let l(k) = -k + 13. What is -3c(m) - 5l(m)? 2m + 13 Let j(y) = -y - 1. Let w(o) = 28o + 144. Let q be w(-5). Suppose -4t + 2b - 4 = 0, q - 9 = 5t - 2b. Let g(v) = v + 10. What is tg(m) - 2j(m)? m - 8 Let x(f) = -422f*2 - 170f + 6. Let u(b) = -422b2 - 141b + 5. Give 6u(h) - 5x(h). -422h2 + 4h Let k = 57 - 78. Let f(w) = -9w. Suppose -3j = -2v + 2, 5j - 3v + 5 = 1. Let h(r) = r. What is jf(n) + kh(n)? -3n Let n(o) = -57o + 19046. Let q(p) = 31p - 9522. Give 6n(u) + 11q(u). -u + 9534 Let f(i) = -35i2 - 6i + 11. Suppose 7s - 57 = -71. Let b(d) be the third derivative of 7d5/60 + d4/24 - d*3/3 + 88d*2. Calculate sf(o) - 11b(o). -7o2 + o Let l(a) = -a3 - 9a2 + 3. Let d(t) be the first derivative of 3t*4/4 + 26t*3/3 - 9t + 10082. Calculate 3d(k) + 8l(k). k*3 + 6k*2 - 3 Let b(g) = -3g + 8. Let y(q) = 7 - 6q + 2 + 8. Let j(w) = -13b(w) + 6y(w). Let h(s) = 6s - 3. Let d = 1971 + -1968. Give dh(l) - 5j(l). 3l + 1 Let o(p) = 2p*2 - 6p + 173. Let t(b) = -2b2 + 5b - 1. What is -o(g) - 2t(g)? 2g*2 - 4g - 171 Let h(w) = -6660w3 + 19w + 8. Let v(a) = 2219a3 - 7a - 3. Give 3h(c) + 8v(c). -2228c3 + c Let b = -252 + 251. Let r(z) = -z - 2. Let l(f) = 4f + 11. Let p(i) = bl(i) - 6r(i). Let w(y) = 6y + 3. Calculate 7p(o) - 2w(o). 2o + 1 Let n(x) = -5x + 405. Let q(p) = -2p + 407. Give 2n(t) - 3q(t). -4t - 411 Let o(f) = -3f - 3. Let d = 363 + -22. Suppose -14s + d = 299. Let p(n) = -n - 1. What is so(w) - 7p(w)? -2w - 2 Let z(g) = 1. Let a(q) = -q + 9. Let v = -354 - -350. Suppose 21 = 2o - 51. Calculate oz(i) + va(i). 4i Let t(v) = -14v2 - 5v. Let u be (-6 - -3)/((-9 - -5) + 5). Let k(l) = -7l2 - 3l. Give ut(r) + 5k(r). 7r2 Let r(w) = -224w*2 + 29w - 4. Let h(x) = -465x2 + 62x - 9. Give -6h(p) + 13r(p). -122p2 + 5p + 2 Let y(d) = -95d + 241. Let w(j) = 77j - 239. Determine 5w(z) + 4y(z). 5z - 231 Let c(s) = -2s*2 + 5s + 5. Let t(u) = 15u2 - 79u - 25. Let n(j) = -29j2 + 163j + 46. Let r(p) = -6n(p) - 13t(p). Calculate 49c(x) - 5r(x). 7x2 Let j = -7894 + 7886. Let i(s) = s2 + 7s - 7. Let v(g) = 11 - 5g - 3g*2 - 6g + g*2. Determine ji(l) - 5v(l). 2l*2 - l + 1 Let x(h) = 26h*3 - 14h. Let b(p) = p*3 + 19670367p*2 - 19670367p*2 - p. What is 56b(s) - 4x(s)? -48s3 Let p(j) = j2 + 3j - 143. Let z(g) = 2g*2 + 7g - 285. Give 9p(v) - 4z(v). v*2 - v - 147 Let i(d) = -3d*2 - 7d - 2. Let n(a) = -a*2 - 3a - 1. Let m be ((-33)/9)/((-2)/6) + (-18 - -14). Determine mn(v) - 3i(v). 2v2 - 1 Let y(o) = -157o + 83. Let i(b) = -79b + 46. What is -11i(c) + 6y(c)? -73c - 8 Let v(y) = 255y3 + 13y*2. Let j(g) = 85g*3 + 4g*2. Determine 7j(x) - 2v(x). 85x*3 + 2x*2 Let z(v) = 3v*3 + 19v*2 - 5. Let u = -13359 - -13351. Let f(k) = -5k*3 - 29k*2 + 8. Calculate uz(r) - 5f(r). r3 - 7r*2 Let s(v) = 2v*2 + 6v*3 - 10v*3 + 7v3 + v3. Let a(b) = b*2 - 13b - 16. Let i be a(14). Let u(q) = 5q3 + 3q*2. Determine iu(m) + 3s(m). 2m*3 Let d be -20 + 22 - (-1)/(-1). Suppose 0 = -5c + 13	{ "pile_set_name": "DM Mathematics" }
v*(4/9)v((v(1/4)/v)/v)/v(-9) assuming v is positive. v(313/36) Simplify ((gg(3/2))/g)/g0g(-1/15)/ggg(-1/15) assuming g is positive. g(41/30) Simplify ((l(2/7))(-3/10))4 assuming l is positive. l(-12/35) Simplify (((n(-2/3)/n)/n)/n)48n*(-1/3)/(nnn(-3)n) assuming n is positive. n*(-529/3) Simplify ((oo*(-1/2)o)31)(2/141) assuming o is positive. o(31/47) Simplify ((q/q(-1/2))/q(-2/3))/((q(10/3)/q)/q0) assuming q is positive. q(-1/6) Simplify ((v*5/vv)/v)(-7/10) assuming v is positive. v(-14/5) Simplify (p*(2/9)ppp6)29 assuming p is positive. p*(2146/9) Simplify t/(t/((tt*(-29))/t))t(-19) assuming t is positive. t(-48) Simplify (w(-8))(-1/5) assuming w is positive. w*(8/5) Simplify (ll/l*(8/5))/((ll(-5/3)/l)/l) assuming l is positive. l(46/15) Simplify q*9q/(q*(-2/21)/q)q*3/(q(qqqq/((q(-9)q)/q)q)/q) assuming q is positive. q(2/21) Simplify (j(-5/4)/(j/(jj(-3/2))))(-16) assuming j is positive. j*44 Simplify rr(r9r)/rr/(rr(-17)) assuming r is positive. r28 Simplify (g/(g/(g*6ggg))(g/(g/g2))/g)/(g(-1)/g)(44/7) assuming g is positive. g(158/7) Simplify (n(3/4))(39/5) assuming n is positive. n(117/20) Simplify (xx/x*(1/5)xx(-1/7))/(x(-9)/(x/(x((x*(-3/8)x)/x)/xx))) assuming x is positive. x(3369/280) Simplify (n/(nnn28))/nnn(-1/9) assuming n is positive. n(-262/9) Simplify (ww*(-9)w(w((www*1)/w)/w)/w)/((ww/w8)/w(-6)) assuming w is positive. w(-6) Simplify ((o(-4)/o)/o(2/3))/(o(1/8)o(5/3)o) assuming o is positive. o(-203/24) Simplify (f(-1/7)/(f/((f*5f)/fff)))/(f(-1)/(f(-2/3)/f)) assuming f is positive. f(109/21) Simplify (y(1/5))*(1/9)y*(-4)/(yyy7) assuming y is positive. y(-584/45) Simplify (www(1/15))/w(-32) assuming w is positive. w(511/15) Simplify r(3/7)rrr*(1/4)rr(2/21)rr/r(-5/4) assuming r is positive. r(295/42) Simplify ((vv(-7/2)/v)/v)(-9/2) assuming v is positive. v(81/4) Simplify r(-28)r/(r(-20)r) assuming r is positive. r(-8) Simplify (w0)(1/3)/(w(2/5)/(ww(1/6))) assuming w is positive. w(23/30) Simplify (b/(b/(b3/b))b/b(-3))/(b(-5)/(b/(b/b8))) assuming b is positive. b19 Simplify h*29/hhh/h(-24) assuming h is positive. h54 Simplify (oo(-6))(-1/24) assuming o is positive. o(5/24) Simplify (k/((k(-2/9)k)/k))/kkk9/kk assuming k is positive. k(92/9) Simplify ((b(1/4)b)(1/21))(-28) assuming b is positive. b(-5/3) Simplify ((f(-4))(16/5))(-6/25) assuming f is positive. f(384/125) Simplify (w(9/7)/w)/w(-1) assuming w is positive. w(9/7) Simplify ((h(3/2))(-30))(2/7) assuming h is positive. h(-90/7) Simplify (z/z1)(-2/69)/((z/(zzz/z(-2/5)zz))/(z1/z)) assuming z is positive. z(22/5) Simplify (aa/(a*(-32)a))/a(1/9) assuming a is positive. a(296/9) Simplify ((l/((ll/(l(-2)l))/l))/ll/((l/((l/(l(1/6)/l))/l))/ll)l)/(l0ll)35 assuming l is positive. l(-421/6) Simplify (jj*3j)(-4/11) assuming j is positive. j(-20/11) Simplify (r(4/15)/r)48 assuming r is positive. r(-176/5) Simplify (y(-2/3))*(-15)/(y/(y/(y/((yy(1/3))/y))))0 assuming y is positive. y*10 Simplify ((cc/(c/(c(1/2)/c)))(-18))19 assuming c is positive. c(-171) Simplify (s/s*3s)(5/9) assuming s is positive. s(-5/9) Simplify xxxx(-17)x(-29) assuming x is positive. x(-43) Simplify (f(4/5))(-1) assuming f is positive. f(-4/5) Simplify (c1/(cc(-1/2)))/((c/c(-10))/((cc(-2/37))/c)) assuming c is positive. c(-781/74) Simplify ((o/(oo/o5o)o)/ooo(-5))/(o(1/3)o*(-1/8)o) assuming o is positive. o*(-53/24) Simplify (j/(jjjj*(2/75)j))(-1/14) assuming j is positive. j(227/1050) Simplify (z/(z/((zz(-5/2))/z)zz))/(zz/z(-12)) assuming z is positive. z(-37/2) Simplify (n(-2))(-1/12)(n(-1))(-41) assuming n is positive. n(247/6) Simplify (dd(-7))7 assuming d is positive. d(-42) Simplify (w(2/5)ww*(-4/9)w)(5/8) assuming w is positive. w(11/9) Simplify q*16q*(5/2)qq assuming q is positive. q(41/2) Simplify gg/(gg(-2/7)g)gg*(3/7)(g*(-1/2)g)/g(-2) assuming g is positive. g(59/14) Simplify ((o(-1))(4/5))(-2/59) assuming o is positive. o(8/295) Simplify (g*(3/7)/(g/(gg/g(1/2))))(-36) assuming g is positive. g*(-234/7) Simplify (rr(-6/17))/r(-3) assuming r is positive. r(62/17) Simplify h5/hhhh/(hhh/(h(-1/7)/h))h assuming h is positive. h*(27/7) Simplify (v(v(2/3)/v)/v)(-12)v(1/9)(v/(v(-3/8)/v))/v assuming v is positive. v(395/72) Simplify (dd/d(-4)d(-9))(-46) assuming d is positive. d138 Simplify (y(8/3)yy(y/y(-2/3))/y)/((y/(y10yy))/(y/((y(-2/13)y)/y)y)) assuming y is positive. y(721/39) Simplify (i(1/4)/((i/(i/(ii/(i*(-3/8)ii))))/ii))/(i(-1/3))(-1/52) assuming i is positive. i*(-41/312) Simplify (ss*(-1/2)ss)/ss/s(-8) assuming s is positive. s(21/2) Simplify m*(2/5)mmmm(-6)m(-2/3)/(m(1/5)m) assuming m is positive. m(-67/15) Simplify (vvv/(v/(((v/v(-10/3))/vv)/v))v)/((v/v(-7))/v) assuming v is positive. v(-2/3) Simplify q(2/57)/q20 assuming q is positive. q(-1138/57) Simplify t/(tt*(-2/5)/tt)(t(2/17)/t)/tt assuming t is positive. t*(-41/85) Simplify (s/(ss/s*(1/5)s))38 assuming s is positive. s(-342/5) Simplify aa(1/3)aa(-5/8) assuming a is positive. a(41/24) Simplify (n/(nnnn*(-6/5)))/(nn*(1/4))(n*(2/3)n)(-6) assuming n is positive. n(-241/20) Simplify w(-42)/w(-3/4) assuming w is positive. w*(-165/4) Simplify (hh/(hhh*(-7/5))h)/h(-3/2) assuming h is positive. h(39/10) Simplify f*(1/5)/(ff/f*(-2)f)(f(2/7))(-12/7) assuming f is positive. f(-1296/245) Simplify ((s(-7)ss)/(s/((s(-4)/ss)/s)))/(s*(1/3)sss(-5/6)) assuming s is positive. s(-25/2) Simplify (d(dd*21d)/dd)/(dd16) assuming d is positive. d7 Simplify pp(-3/4)(pp/(pp/p*(-2/19))p)/p((p/(pp/((pp(1/4)p)/p)))/p)(1/2) assuming p is positive. p(-35/152) Simplify (f/(f*4/f)(ff(-3/4)ff)/f)/(f/(f/((f5f)/f))f5) assuming f is positive. f(-43/4) Simplify b/b7bb(-6) assuming b is positive. b(-11) Simplify (v(-2/31)vv5)/(v(-3)/v9) assuming v is positive. v(556/31) Simplify h/(h/(((h/(h(4/5)/h))/h)/hh)h)hhhh/((h/h(-1/4))/h)h2/h2 assuming h is positive. h(59/20) Simplify (c(4/5)/(c/c*(-2/13)))/(cc*(3/4)cc(-2/9)) assuming c is positive. c(-6743/2340) Simplify (sss(-2/11)((s/s*(2/9)s)/ss)/s)(-30) assuming s is positive. s(-2570/33) Simplify (h(-5))(-1/53) assuming h is positive. h(5/53) Simplify dd/(ddd/d*(16/3))(dd/d(-31))/d assuming d is positive. d(109/3) Simplify (ww*(-4/5)/ww(-3/7))/(w3/(w*6w)) assuming w is positive. w(97/35) Simplify (t1)(-2/11) assuming t is positive. t(-2/11) Simplify (i/(i*(2/7)i)i)/((ii(-3/7)/i)/i) assuming i is positive. i(15/7) Simplify (((s*(-1)/s)/s)/ss)26 assuming s is positive. s(-78) Simplify ((i/i2)(1/63))4 assuming i is positive. i(-4/63) Simplify (((r*3r)/rr)/r(1/10))/(r6/(r/(r(2/19)/r))) assuming r is positive. r(-39/190) Simplify x(-1/6)/(xx(xx(2/29))/x) assuming x is positive. x(-389/174) Simplify m/(m/(mm(1/7)))mmm*(-6)(m*(-1/2)m)(-2/101) assuming m is positive. m(-2027/707) Simplify (w9)34 assuming w is positive. w306 Simplify (c(-2/7))*(-2)cc/(c/(cc*2))ccc*(-1/11)c assuming c is positive. c*(576/77) Simplify q/(q((q/(qq(-2)/q)q)/q)/q)qq((q(-26/5)/qq)/q)/q assuming q is positive. q*(-36/5) Simplify (bb/b(2/15))21 assuming b is positive. b(196/5) Simplify ((b/((b/b(-10)b)/b))/(b/(bbbb(-1/14))))/((b7/b)/(b/b9)) assuming b is positive. b(-309/14) Simplify (y/(yy0))42/((y(6/7)y)/yyy/((y/y*(-2))/y)yy) assuming y is positive. y(-20/7) Simplify (a(-1))42/((aa*6/a)/aaa7) assuming a is positive. a(-55) Simplify b7b*(-3/5)b*(3/4)/(b((bb*(4/7))/b)/b) assuming b	{ "pile_set_name": "DM Mathematics" }
cending order. -5, -25, -18498 Put -4, -123, 4, 58 in decreasing order. 58, 4, -4, -123 Sort 1/5, -2, -4, -18, 1/46 in ascending order. -18, -4, -2, 1/46, 1/5 Sort -0.4, -0.2351, 0.04 in decreasing order. 0.04, -0.2351, -0.4 Put 5, 0.6, -3, 2111 in descending order. 2111, 5, 0.6, -3 Sort 0.1, 0.2, 3/13, 2/63 in decreasing order. 3/13, 0.2, 0.1, 2/63 Put -4, 0.5, 43.3, -0.3 in descending order. 43.3, 0.5, -0.3, -4 Sort 9, -4, -122, 2, 1, -2. -122, -4, -2, 1, 2, 9 Put -3, 4886, -9, 4 in descending order. 4886, 4, -3, -9 Sort 0, 0.3, -0.1, 13, 37 in descending order. 37, 13, 0.3, 0, -0.1 Sort 1, 2, 5, -204 in descending order. 5, 2, 1, -204 Sort -0.7, -3/5, 0.06159 in increasing order. -0.7, -3/5, 0.06159 Sort 2, -1/80, -1/2, 3/8, 0.1. -1/2, -1/80, 0.1, 3/8, 2 Sort -2/19, -5, 64, -8 in ascending order. -8, -5, -2/19, 64 Put -2, -4536, 3, 5 in descending order. 5, 3, -2, -4536 Put -5, -1/2, 34275/2 in descending order. 34275/2, -1/2, -5 Put -2, 17, 41, 2, -203, 5 in decreasing order. 41, 17, 5, 2, -2, -203 Put 4, 41, 82, 24 in ascending order. 4, 24, 41, 82 Sort 5, -2/13, 2/5, -0.39, 0.3, 28. -0.39, -2/13, 0.3, 2/5, 5, 28 Sort -2/3, 9, -5/23584, 0 in ascending order. -2/3, -5/23584, 0, 9 Sort 2, -4, -12, -94, -5, -1 in ascending order. -94, -12, -5, -4, -1, 2 Put 6, -3, 109 in increasing order. -3, 6, 109 Put 3, 0.24, 0.1, 10 in descending order. 10, 3, 0.24, 0.1 Put 2056, 12, -4 in descending order. 2056, 12, -4 Sort -12095, 96, 5/6 in decreasing order. 96, 5/6, -12095 Sort 2, 5, 10, 92, 0, 3 in decreasing order. 92, 10, 5, 3, 2, 0 Sort -1/2, 0, 4653 in descending order. 4653, 0, -1/2 Put -2, -555, 3, 11 in increasing order. -555, -2, 3, 11 Put -0.1, -47, 4/7, 1/106 in decreasing order. 4/7, 1/106, -0.1, -47 Sort 2/7, 2/9, -19, 1/2 in decreasing order. 1/2, 2/7, 2/9, -19 Sort -0.101, 7876, 0.5 in decreasing order. 7876, 0.5, -0.101 Sort -1, -2, -9861 in descending order. -1, -2, -9861 Put 7, -72, -1, -4, -5 in increasing order. -72, -5, -4, -1, 7 Sort 1, 5328, -3, 4, 0.3. -3, 0.3, 1, 4, 5328 Put -9/2, -2/13, -8193 in decreasing order. -2/13, -9/2, -8193 Put 18, 80, 0 in descending order. 80, 18, 0 Sort 5, -1, -2, 0.16, 95 in ascending order. -2, -1, 0.16, 5, 95 Put 0.010653, -2/9, 5 in decreasing order. 5, 0.010653, -2/9 Put -6, 3, -2/3 in increasing order. -6, -2/3, 3 Sort 3, 317, -596, 4, -2 in decreasing order. 317, 4, 3, -2, -596 Sort 6, 0.07, 11, -3, -518 in increasing order. -518, -3, 0.07, 6, 11 Put 1/12, -2, -747 in ascending order. -747, -2, 1/12 Sort 2/5, 35, -25/6, 1.9 in decreasing order. 35, 1.9, 2/5, -25/6 Put -19, 0.01, 3.65 in ascending order. -19, 0.01, 3.65 Put 0.48, -3, 0.8, 0, 5/4 in increasing order. -3, 0, 0.48, 0.8, 5/4 Sort 9, -0.7, 66, 4/7 in decreasing order. 66, 9, 4/7, -0.7 Put 28, -4/69, 1 in descending order. 28, 1, -4/69 Sort -70, 3, -1, -3, -2, -16 in ascending order. -70, -16, -3, -2, -1, 3 Sort -0.3, -1/5, 24311, -3, -5 in decreasing order. 24311, -1/5, -0.3, -3, -5 Put 13, -3, 4, -2, 39, 32 in increasing order. -3, -2, 4, 13, 32, 39 Sort -4/3, -1, 4, -2/9, 8 in decreasing order. 8, 4, -2/9, -1, -4/3 Put 65, 5, -4, -22, -12, -3 in descending order. 65, 5, -3, -4, -12, -22 Sort 19, 9, 236 in descending order. 236, 19, 9 Sort 3, 0, 46, -2, 32, -1 in increasing order. -2, -1, 0, 3, 32, 46 Sort -459, -0.1, -0.6, -1 in descending order. -0.1, -0.6, -1, -459 Sort -167, 11, 1.2 in increasing order. -167, 1.2, 11 Sort 3, 7, 103168. 3, 7, 103168 Sort 2/5, 23, 0.2, -0.3, -38 in ascending order. -38, -0.3, 0.2, 2/5, 23 Sort 4, 1, -631, -5, 5 in decreasing order. 5, 4, 1, -5, -631 Sort -22, 338, -4 in descending order. 338, -4, -22 Put -8/7, -62473, 0.1 in decreasing order. 0.1, -8/7, -62473 Sort -6, 327, -35, 2/11 in descending order. 327, 2/11, -6, -35 Put 0.13, 16, 5, -17, 0.3, 4 in increasing order. -17, 0.13, 0.3, 4, 5, 16 Sort -62, -1, 16, 0.5, -0.1, 0.3 in decreasing order. 16, 0.5, 0.3, -0.1, -1, -62 Sort 40, 267, 1. 1, 40, 267 Sort 0, -49, -3, 18 in decreasing order. 18, 0, -3, -49 Put 35275, 2, -31 in increasing order. -31, 2, 35275 Sort 9, -3, 10, 2, 8, -5. -5, -3, 2, 8, 9, 10 Sort 18, -181, 226 in ascending order. -181, 18, 226 Sort -6, -3, -4, 147, 5. -6, -4, -3, 5, 147 Sort -7, 44197, -5. -7, -5, 44197 Put -8, 54, 1, -3, -5 in ascending order. -8, -5, -3, 1, 54 Put -3/14, 2, 57984 in increasing order. -3/14, 2, 57984 Sort -7, -1645, -4 in ascending order. -1645, -7, -4 Sort -36, -2, -6, -2/9, 1. -36, -6, -2, -2/9, 1 Sort 1, 194/13, -1, 1/5, -3, 1/4 in ascending order. -3, -1, 1/5, 1/4, 1, 194/13 Sort -3, -306, 4, 7 in descending order. 7, 4, -3, -306 Put -848/9, 15, 0.2, 5 in descending order. 15, 5, 0.2, -848/9 Sort -1, 7/2343, -2, 0.1 in decreasing order. 0.1, 7/2343, -1, -2 Sort 119, 3, -5/3, 0.11, -0.1. -5/3, -0.1, 0.11, 3, 119 Sort 41, -1, -2, 479, -3, -4 in decreasing order. 479, 41, -1, -2, -3, -4 Sort 1/4, -10, 1, 187. -10, 1/4, 1, 187 Sort 0.0281, 0.0599, 0.1. 0.0281, 0.0599, 0.1 Put 1232, -2, -0.5 in decreasing order. 1232, -0.5, -2 Sort 347, -794, -2, 4 in decreasing order. 347, 4, -2, -794 Sort 0.17, -2, -3, 8.6 in increasing order. -3, -2, 0.17, 8.6 Sort -3, 32, -5, 13, 5 in decreasing order. 32, 13, 5, -3, -5 Sort -447, -28, 5 in ascending order. -447, -28, 5 Sort 0.04, 0, -3909, -5 in ascending order. -3909, -5, 0, 0.04 Put -355, 4, -1, -14, -3 in increasing order. -355, -14, -3, -1, 4 Put -1/5, -1, -1/3, -0.3, 6 in increasing order. -1, -1/3, -0.3, -1/5, 6 Put 1, -282, 46, -0.21 in decreasing order. 46, 1, -0.21, -282 Put 405, -4, 1, 4, -2, -5 in increasing order. -5, -4, -2, 1, 4, 405 Sort 0.2, 86, 25380 in increasing order. 0.2, 86, 25380 Put -0.02, 127, 16, 0.8, -0.4 in ascending order. -0.4, -0.02, 0.8, 16, 127 Put -24, -5, -1, 3, 420, -3 in descending order. 420, 3, -1, -3, -5, -24 Sort -3, 116, 4, 6. -3, 4, 6, 116 Put -3, 9, 2/11, -158, 2/5 in increasing order. -158, -3, 2/11, 2/5, 9 Sort -4, 5, -5, 6, 1367, -2 in ascending order. -5, -4, -2, 5, 6, 1367 Sort 4, -1/3, 3896. -1/3, 4, 3896 Sort -1, 5, 1, 14, 35 in descending order. 35, 14, 5, 1, -1 Put 3, 20, 8, 4, 5 in increasing order. 3, 4, 5, 8, 20 Sort 0.535, 2, 2/31, -0.4 in descending order. 2, 0.535, 2/31, -0.4 Put 25, 3, -39, 4, -4 in descending order. 25, 4, 3, -4, -39 Sort 6, 5, 60, -2 in ascending order. -2, 5, 6, 60 Sort -15, -288, -5 in descending order. -5, -15, -288 Put -1/24, 0.4, 0.02, -2/15, 0 in ascending order. -2/15, -1/24, 0, 0.02, 0.4 Put 15, 8, -3, 0, 11, -4 in increasing order. -4, -3, 0, 8, 11, 15 Put -7/6, -1, 1/6, 5, 4 in increasing order. -7/6, -1, 1/6, 4, 5 Sort -43, -0.027, -1, -2, 0.5 in descending order. 0.5, -0.027, -1, -2, -43 Put 200, 3, -21 in ascending order. -21, 3, 200 Put 0.3, 1834, 0.01, 2/3, 4/5, -4 in decreasing order. 1834, 4/5, 2/3, 0.3, 0.01, -4 Sort -3/35, -231, -0.3. -231, -0.3, -3/35 Put 0.3, 8, 23, -1/5, -16.2 in descending order. 23, 8, 0.3, -1/5, -16.2 Sort -5, 32, 0, -3, -18 in increasing order. -18, -5, -3, 0, 32 Put -40, 60, 0 in increasing order. -40, 0, 60 Sort -20, 0, 2, -167, 3 in increasing order. -167, -20, 0, 2, 3 Put -2/3, -0.64, 4, 47, -0.2, 3 in ascending order. -2/3, -0.64, -0.2, 3, 4, 47 Sort -3, -4, 17, -2248, -5 in decreasing order. 17, -3, -4, -5, -2248 Put 0.3, 5606, 2 in ascending order. 0.3, 2, 5606 Put 1, -3/4, -11, 48, 0 in descending order. 48, 1, 0, -3/4, -11 Sort 88.46, -2/9, -0.5, -3, 5, 3 in decreasing order. 88.46, 5, 3, -2/9, -0.5, -3 Put -0.0472, -4, -2/7, -0.12, -5 in decreasing order. -0.0472, -0.12, -2/7, -4, -5 Sort 54, 3695, -4 in increasing order. -4, 54, 3695 Sort 3/5, -223585/4, 5 in increasing order. -223585/4, 3/5, 5 Put -5, 5, 6, 4157 in decreasing order. 4157, 6, 5, -5 Sort 91, -2, -12, 42, 4, 1 in descending order. 91, 42, 4, 1, -2, -12 Put 2, -5, 87, -0.3, -30 in increasing order. -30, -5, -0.3, 2, 87 Sort -2, -4, -6, -18, 2, 1. -18, -6, -4, -2, 1, 2 Sort 6, 5, 0, 30, 9 in descending order. 30, 9, 6, 5, 0 Sort -741, 5, 0.44. -741, 0.44, 5 Sort 166, 66, 1, -4 in descending order. 166, 66, 1, -4 Sort 8/7, -52.1, -1, 0.4. -52.1, -1, 0.4, 8/7 Sort 1.2, 3/4, -403. -403, 3/4, 1.2 Sort 4880/7, -0.5, 8 in descending order. 4880/7, 8, -0.5 Sort -0.2, 0.3, 496, 0.1, -5/2 in increasing order. -5/2, -0.2, 0.1, 0.3, 496 Sort 2.16035, -3/7, -2 in ascendi	{ "pile_set_name": "DM Mathematics" }
+ 5 - 12. Let y(o) = o - 4. What is -4j(d) + 7y(d)? -d Let q(n) = 8n + 3. Let p(w) = -21w - 8. Let u(c) be the first derivative of -20c2 - 15c - 34. Let d(t) = 5p(t) - 3u(t). Give -3d(m) + 5q(m). -5m Let d(x) = 3x*2 - 3x + 3. Let f(c) = -c3 + c2 + 1. Let o be 4/(-24)(13 - 7). Determine od(j) + 3f(j). -3j*3 + 3j Let t(q) = -17q - 4. Suppose -5h + 8 = 2i, i + i = -2. Let d(u) be the first derivative of -3 + u2 - 3u*2 + 0u*h - u + 0u*2. Give 9d(z) - 2t(z). -2z - 1 Let p = -3 + -11. Let q = -68 + 74. Let w = q + p. Let k(h) = 4h3 + 5h*2 + 7h - 5. Let i(u) = -6u3 - 8u*2 - 11u + 8. Calculate wk(j) - 5i(j). -2j3 - j Let q(p) = -2 + 5p - 5 + 3. Let w(h) = -35h - 1. Let y be w(-1). Let m = y + -40. Let s(x) = x - 1. Give ms(n) + q(n). -n + 2 Let x(o) = -o*3 + o. Let m(n) = 4n*3 - 4n*2 - 5n - 8. Let z(j) = 7j3 - 9j*2 - 10j - 17. Let q(r) = 7m(r) - 3z(r). Determine q(l) + 5x(l). 2l3 - l2 - 5 Suppose 448 = -66k + 118. Let i(d) = -3d - 2. Let s(o) = -12o - 9. Give ks(t) + 21i(t). -3t + 3 Let b(u) = -37u2 + 4u + 18. Let n(x) = 9x2 - x - 4. Calculate 6b(y) + 26n(y). 12y*2 - 2y + 4 Let g = -4 + 5. Let v(t) = 37t + 7. Let o(b) = 68b + 13. Let x(n) = 6o(n) - 11v(n). Let l(f) = -8f - 3. Give gl(c) + 3x(c). -5c Let h(x) = 4x + 14. Let d(g) = -4 - 1266g + 1267g + 9. What is -8d(v) + 3h(v)? 4v + 2 Let l(g) = -g*3 + 4g*2 + 2g + 2. Let k(m) = -m*3 + 4m*2 + 2m + 2. Calculate -6k(p) + 5l(p). p*3 - 4p*2 - 2p - 2 Let l(y) = 6y + 14. Let c(d) = 2d + 5. Suppose t = -3t - 5n - 63, 5n = -t - 12. Calculate tc(h) + 6l(h). 2h - 1 Let c(r) = -9r - 105. Let x(j) = -14j - 158. Give 8c(k) - 5x(k). -2k - 50 Let r(v) = -3v*3 - 11v*2 - 56v - 1. Let t(j) = j*3 + 5j*2 + 27j. Calculate 2r(l) + 5t(l). -l*3 + 3l*2 + 23l - 2 Let k(d) be the second derivative of -d3/6 + d2 - 2d. Let o(y) = -14y + 9. Let b(u) = 5u - 3. Let m(j) = -8b(j) - 3o(j). Give -4k(q) - 3m(q). -2q + 1 Let l(f) = -28f2 + 35f - 35. Let o = -283 - -248. Let a(i) = i*2 - i + 1. What is oa(b) - l(b)? -7b2 Let q be 4/7 - 1533/(-147). Let g(x) = 14x + 5. Let i = 110 + -106. Let z(r) be the first derivative of -5r2/2 - 2r + 2. Determine ig(o) + qz(o). o - 2 Let l(w) = 3w - 3. Let c(f) = -3f + 2. Let y(b) = b*2 + 12b - 2. Let v be y(-12). Let r be 15/3 + (v - -1). Calculate rl(j) + 5c(j). -3j - 2 Let h(j) = 16j*2 + 4j + 6. Let a(p) = -256 + p + 129 + 5p2 + 129. Give -10a(u) + 3h(u). -2u*2 + 2u - 2 Let p(m) = 4m2 + 4m - 6. Let t(r) = -3r2 - 3r + 5. Let i be (-6)/7(-6 + -1). Let b = 8 - i. Suppose bs + 12 = 2. What is st(w) - 4p(w)? -w*2 - w - 1 Let c(o) = 7o - 13. Let y be c(2). Let j be (45/(-10))/y. Let h(f) = 3f - 4. Let s(z) = 4z - 4. What is js(m) + 3h(m)? m - 4 Let p(a) = 3a*3 + 145a*2 - 4a - 1. Let x(l) = l*2 + l. What is p(h) + 4x(h)? 3h3 + 149h*2 - 1 Let d(l) = -13l + 4. Let p(n) = 4n - 1. Let w be (-40)/(-280) + 54/14. What is wd(x) + 14p(x)? 4x + 2 Suppose 181a + 11 = 192a. Let v(h) = -h3 + h2 + 1. Let j(m) = 7m3 - 4m*2. Calculate aj(t) + 4v(t). 3t*3 + 4 Let h(j) = -7j - 4. Let c(u) = -24u - 7. Let f(x) = 26x + 7. Let q(n) = 6c(n) + 5f(n). What is 7h(l) - 4q(l)? 7l Let a(n) = 2n*3 + n. Let p(x) = -7x*3 - 47x*2 - 5x. Give -5a(f) - p(f). -3f*3 + 47f*2 Let x(f) = -3f*2 + 2f - 2. Let i(w) = w*3 + 13w*2 - 9w + 9. Suppose 42b - 109 + 25 = 0. Give bi(z) + 9x(z). 2z3 - z2 Let i(h) = 5h3 - 6. Let m(o) = 4o*3 - 5. Suppose 3j + 2g + 8 = -0g, 2 = 3j + 4g. Give jm(a) + 5i(a). a3 Let b(n) = -2. Let k(q) = -q3 + 6q2 + 9q - 12. Let l be k(7). Let g(z) = 4z + 0z - 3z + 4 + zl. What is -5b(d) - 2g(d)? -2d*2 - 2d + 2 Let q = 139 + -140. Let z(t) = -t - 1. Let f(k) = 5k2 - 3k - 3. What is qf(j) + 3z(j)? -5j2 Let o(m) = -46m - 10. Let d(t) = -138t - 32. Give 5d(i) - 16o(i). 46i Let b(v) be the second derivative of -11v3/6 - 863v - 1. Let n(h) = -2h. Let d(f) = -4f. Let r(o) = 6d(o) - 15n(o). Give 4b(a) + 7r(a). -2a Let y(s) = 1. Let x(d) = 2d - 3. Let n(f) = -5f + 8. Let c be 6/(-1 + (-10)/(-4)). Suppose -ca = 15 + 17. Let q(h) = ax(h) - 3n(h). Give q(l) - y(l). -l - 1 Let r(u) = 485u + 4. Let t(n) = -729n - 6. Give -7r(c) - 5t(c). 250c + 2 Let d(b) = 0 + 1 + 6b2 - 3. Let o(p) = -p2 + p. Let t(s) = 2s2 - 3s. Let j(i) = -3o(i) - t(i). Give d(h) - 4j(h). 2h2 - 2 Let f(t) = -213t*2 - 12t - 20. Let r(n) = -106n2 - 7n - 12. What is 3f(a) - 5r(a)? -109a2 - a Let m(o) = 4 + o - 3o2 + o2 - 2o2 - o2. Let k(x) = -3x + 1 - 2x + 4x + 9x2 - 8. Determine -3k(y) - 5m(y). -2y*2 - 2y + 1 Let c(k) = 16k2 + 7k - 6. Let x(d) = d*2 + d - 2. Determine c(t) - 3x(t). 13t2 + 4t Suppose -3s + 0s + 21 = 0. Suppose 0 = -l - 4 + s. Let j(a) = -10 - 3a + 9a + 30 + l. Let x(d) = 2d + 8. Determine -6j(u) + 17x(u). -2u - 2 Let c(h) = -6h3 - 2h*2 + 5. Let s(k) = 7k*3 + 3k*2 - 6. Calculate 5c(u) + 4s(u). -2u*3 + 2u*2 + 1 Let t = 6 + -12. Let y(m) = 1. Let a = 123 + -82. Let v(q) = -23q*3 - 19q*3 + 2 + aq*3. Determine ty(h) + 3v(h). -3h*3 Let c = -157 + 152. Let f(g) = -6g*3 - 4g + 1. Let u(h) = -11h3 - 7h + 1. What is cf(a) + 3u(a)? -3a3 - a - 2 Suppose -3 + 5 = w. Let y(i) = -i3 - 2. Let b be 3/2154/21. Let c(z) = bz3 + 6 - 7z*3 + 1. What is wc(x) + 7y(x)? x3 Let b(w) = -2w*2 - 3w + 3. Let k(g) = 3g2 + 2g - 2. Let v = -1143 - -1140. Calculate vk(a) - 2b(a). -5a2 Let x = -1443 + 1442. Let m(r) = -r2 + 1. Let q(i) = 3i + 3. Calculate xq(n) + 3m(n). -3n2 - 3n Let r(i) = 7i + 1. Let z(b) = -20b - 270. Determine 3r(a) + z(a). a - 267 Let v(g) = -2g - 1. Let z(o) = -30o2 + 34o - 4. Let q(j) = 20v(j) + 2z(j). Let h(s) = 11s2 - 5s + 5. Determine 28h(w) + 5q(w). 8w2 Let l = -35 - -37. Suppose -lh + 25 = -5k, -5k + h - 18 - 7 = 0. Let t(b) = 2b - 1. Let a(d) = -d. What is ka(y) - 2t(y)? y + 2 Let y(j) = 9j + 38. Let c(u) = -18u - 70. Let i(n) = 6c(n) + 11y(n). Let b(d) = 279d + 63. Calculate 4b(p) + 126i(p). -18p Let b be ((-1)/(-2))/(6/48). Let t be b + -9 + 7 - 20/2. Let l(o) = o - 2 + o + o. Let n(w) = -w + 1. What is tn(p) - 3l(p)? -p - 2 Let m(k) = 1. Suppose -2z = -6, 17f = 16f - z - 2. Let d(t) = 5t - 3. What is fm(x) - d(x)? -5x - 2 Let i(j) = -5j*3 - 16j*2 + j + 16. Let g be i(-3). Let c(y) = y - 2. Let l(p) = p. Let h = -1 - 0. Give gl(u) + hc(u). 3u + 2 Let l(f) = -7f - 2. Let v(g) = -3g - 1. Suppose -57 = -2y + 4a + a, 5y - a = 108. Let h be 6/y - 60/14. Let m = -31 + 40. What is hl(w) + mv(w)? w - 1 Suppose 5a = 3a - 26. Let q(u) = -550u - 2u2 + 9u*3 + 567u + 2 + 15u2. Let f(w) = -4w*3 - 6w*2 - 8w - 1. Calculate af(c) - 6q(c). -2c3 + 2c + 1 Let r be (-22)/(-66) - (-24)/9. Let j(w) = 15w3 - 2w*2 - 8w + 3. Let c(l) = 5l3 - l2 - 3l + 1. Determine rj(a) - 8c(a). 5a3 + 2a*2 + 1 Let w(c) = -c - 1. Suppose -30 = -226x + 236x. Let f(p) = p + 4. What is xw(o) - f(o)? 2o - 1 Let r(c) = -3c - 2. Let p(o) be the first derivative of 7o2 + 11o + 2. Suppose -14y + 15y = 2w - 2, 2w = -3y - 22. Determine wp(u) - 11r(u). 5u Let h(z) = z*3 + 6z*2 + 5z + 4. Let t be h(-5). Let s(y) = -3y - 6 + 5y - y + 4y. Let l(c) = c - 1. What is tl(x) - s(x)? -x + 2 Let m(p) = -4p. Let b(r) = -25r*2. Let c be b(-1). Let s be 2/((60/c)/(-6)). Let v = -1 + s. Let u(l) = 3l. Determine vm(q) + 4u(q). -4q Let h(r) be the first derivative of 2r*3 - 20r + 21/2r2 - 26. Let s(v) = v2 + 4v - 4. Calculate 2h(o) - 11s(o). o*2 - 2o + 4 Let r(m) = m*2 - m. Let c(j) = -7j*2 + 7j + 3. Suppose 32k + 68 = 260. Give kr(q) + c(q). -q*2 + q + 3 Let y(q) = 6 + 1 - 3. Let j(c) = -c - 9. Give 2j(s) + 5y(s). -2s + 2 Suppose 64 = -5n + 29. Let y(o) = 5o - 1. Let x(c) = 22c - 13. Let j(b) = 11b - 6. Let m(u) = -9j(u) + 4x(u). Determine ny(v) - 3m(v). -2v + 1 Let q(l) = 2l*3 + 4l*2 - 21. Let u(k) = 6k*3 + 12k*2 - 63. Give -11q(r) + 4u(r). 2r*3 + 4r*2 - 21 Let f(o) = 8o - 2. L	{ "pile_set_name": "DM Mathematics" }
False Does 34 divide 1632? True Is 4 a factor of 1064? True Is 947 a multiple of 10? False Is 13 a factor of 10816? True Is 1383 a multiple of 32? False Is 209 a multiple of 19? True Does 8 divide 23165? False Does 3 divide 510? True Does 3 divide 237? True Is 240 a multiple of 24? True Is 1957 a multiple of 75? False Does 4 divide 24220? True Is 1505 a multiple of 8? False Does 10 divide 3620? True Is 412 a factor of 24885? False Is 2557 even? False Does 10 divide 467? False Is 15846 a multiple of 117? False Does 110 divide 10230? True Is 20 a factor of 678? False Is 1789 a multiple of 18? False Does 7 divide 57708? True Is 1020 a multiple of 54? False Is 24 a factor of 1989? False Is 8 a factor of 2797? False Is 4 a factor of 1224? True Does 9 divide 1159? False Does 91 divide 35763? True Is 6 a factor of 1578? True Is 493 a multiple of 17? True Does 39 divide 1427? False Does 42 divide 10668? True Does 13 divide 48545? False Is 928 a multiple of 29? True Is 125 a factor of 11663? False Does 35 divide 606? False Is 33 a factor of 924? True Does 39 divide 390? True Is 41 a factor of 615? True Is 2848 even? True Does 73 divide 1314? True Is 12765 a multiple of 21? False Does 9 divide 558? True Is 16 a factor of 3513? False Is 3989 even? False Is 2730 a multiple of 65? True Does 6 divide 215? False Does 193 divide 10229? True Is 949 a multiple of 6? False Is 14605 a multiple of 28? False Is 3495 a multiple of 15? True Is 5064 a multiple of 211? True Does 129 divide 1677? True Does 38 divide 159? False Does 49 divide 3853? False Is 8 a factor of 448? True Is 69030 a multiple of 26? True Does 52 divide 12428? True Does 203 divide 5075? True Is 57 a factor of 6042? True Is 81 a factor of 16583? False Is 1287 a multiple of 99? True Is 1385 a multiple of 15? False Is 26588 a multiple of 14? False Is 94 a factor of 15322? True Is 18100 a multiple of 50? True Does 148 divide 56832? True Is 26 a factor of 2158? True Is 8 a factor of 33882? False Is 61 a factor of 11651? True Is 416 a multiple of 66? False Is 37 a factor of 3404? True Does 59 divide 1765? False Is 184 a multiple of 20? False Is 31 a factor of 62403? True Is 11 a factor of 110? True Is 25959 a multiple of 36? False Is 10435 a multiple of 25? False Is 67 a factor of 2077? True Is 674 a multiple of 44? False Is 108 a factor of 1944? True Does 4 divide 1492? True Is 11 a factor of 289? False Does 185 divide 24420? True Is 5476 a multiple of 148? True Does 47 divide 188? True Is 3475 a multiple of 25? True Is 96 a factor of 1705? False Does 4 divide 308? True Is 3468 a multiple of 51? True Does 7 divide 255? False Is 1326 a multiple of 5? False Is 14 a factor of 490? True Is 12363 a multiple of 122? False Is 32725 a multiple of 25? True Is 28 a factor of 13300? True Is 86208 a multiple of 48? True Does 49 divide 1078? True Is 168115 a multiple of 15? False Is 1558 a multiple of 11? False Does 21 divide 12957? True Is 12 a factor of 334? False Is 23 a factor of 6274? False Is 77477 a multiple of 87? False Does 9 divide 3818? False Is 341 a multiple of 2? False Is 48 a multiple of 8? True Does 14 divide 55258? True Does 112 divide 647? False Is 52 a factor of 1582? False Does 3 divide 18052? False Is 52276 a multiple of 14? True Is 7 a factor of 29468? False Is 184 a factor of 8648? True Does 28 divide 139? False Is 157 a factor of 34287? False Does 13 divide 377? True Is 284 a multiple of 71? True Does 16 divide 15871? False Is 1340 a multiple of 10? True Is 10 a factor of 4788? False Does 20 divide 7416? False Is 3060 a multiple of 60? True Is 29 a factor of 3770? True Is 38444 a multiple of 15? False Does 15 divide 35139? False Is 7 a factor of 5642? True Does 7 divide 329? True Is 1595 a multiple of 29? True Is 42 a factor of 3444? True Is 27758 a multiple of 87? False Is 1456 a multiple of 16? True Is 6779 a multiple of 25? False Is 1779 a multiple of 138? False Does 7 divide 2336? False Does 9 divide 35? False Is 33 a multiple of 3? True Is 3173 a multiple of 19? True Is 43 a factor of 1488? False Is 30 a factor of 1620? True Is 18618 a multiple of 17? False Is 19 a factor of 4009? True Is 998 a multiple of 6? False Is 13806 a multiple of 354? True Is 19981 a multiple of 53? True Is 30615 a multiple of 13? True Does 2 divide 9158? True Is 1248 a multiple of 48? True Is 4 a factor of 220? True Is 8 a factor of 521? False Is 11 a factor of 28245? False Does 72 divide 3384? True Does 74 divide 12831? False Does 77 divide 19549? False Does 22 divide 16280? True Is 14874 a multiple of 57? False Does 29 divide 37059? False Is 332 a multiple of 38? False Is 4 a factor of 76? True Is 24 a factor of 377? False Does 6 divide 288? True Is 22607 a multiple of 23? False Is 31618 a multiple of 85? False Does 16 divide 7489? False Is 38 a factor of 35264? True Is 49473 a multiple of 17? False Is 14 a factor of 94240? False Does 5 divide 165? True Does 83 divide 15438? True Is 149050 a multiple of 22? True Is 7 a factor of 606? False Is 127 a multiple of 11? False Is 1072 a multiple of 16? True Does 8 divide 656? True Is 78 a multiple of 3? True Does 8 divide 1715? False Is 125 a multiple of 3? False Does 19 divide 789? False Does 30 divide 18136? False Is 7 a factor of 322? True Is 136 a multiple of 68? True Is 50 a factor of 1012? False Is 462 a multiple of 21? True Does 4 divide 407? False Is 34 a factor of 9130? False Does 15 divide 2970? True Is 69 a factor of 759? True Does 25 divide 1650? True Is 33207 a multiple of 30? False Is 9 a factor of 228? False Does 27 divide 5131? False Does 12 divide 3168? True Is 1242 a multiple of 27? True Is 4690 a multiple of 67? True Is 2912 a multiple of 18? False Is 152 a factor of 2736? True Does 11 divide 1615? False Is 5187 a multiple of 13? True Does 23 divide 2047? True Does 207 divide 42021? True Is 1659 a multiple of 11? False Does 79 divide 8018? False Is 624 a multiple of 16? True Is 17 a factor of 3927? True Is 65 a factor of 55055? True Is 4832 a multiple of 118? False Is 6591 a multiple of 77? False Is 1116 a multiple of 12? True Does 64 divide 6080? True Is 108 a multiple of 36? True Is 15399 a multiple of 29? True Is 11 a factor of 4405? False Is 1355 a multiple of 15? False Does 7 divide 168? True Does 9 divide 1782? True Is 1926 a multiple of 43? False Is 1250 a multiple of 25? True Does 42 divide 31080? True Is 5 a factor of 902? False Is 728 a multiple of 56? True Is 42 a factor of 19340? False Is 38 a factor of 17970? False Is 53 a factor of 53053? True Does 35 divide 46130? True Is 1985 a multiple of 12? False Is 72 a multiple of 24? True Is 26 a factor of 52052? True Is 1496 a multiple of 2? True Is 36077 a multiple of 23? False Is 7 a factor of 2674? True Does 11 divide 9036? False Does 14 divide 460? False Is 18 a factor of 21906? True Is 23 a factor of 162? False Is 2 a factor of 27? False Does 6 divide 883? False Is 10024 a multiple of 56? True Is 20033 a multiple of 13? True Is 27405 a multiple of 63? True Is 37944 a multiple of 68? True Is 13 a factor of 33462? True Is 4703 a multiple of 153? False Does 4 divide 139? False Is 8 a factor of 3704? True Does 16 divide 122? False Does 40 divide 400? True Is 846 a multiple of 3? True Does 17 divide 545? False Is 752 a multiple of 21? False Is 576 a multiple of 8? True Is 25 a factor of 1522? False Is 771 even? False Is 6777 a multiple of 27? True Is 41 a factor of 4387? True Is 26 a factor of 2886? True Is 1208 a multiple of 37? False Is 24041 a multiple of 29? True Is 5 a factor of 2275? True Does 56 divide 784? True Does 3 divide 1173? True Is 910 a multiple of 103? False Does 28 divide 5124? True Does 7 divide 125? False Does 21 divide 23421? False Is 48 a factor of 54384? True Does 23 divide 102695? True Is 7 a factor of 42? True Is 135 a multiple of 12? False Does 17 divide 104550? True Is 2 a factor of 110? True Is 35 a factor of 558? False Does 4 divide 39988? True Does 30 divide 404? False Is 39808 a multiple of 14? False Is 50098 a multiple of 302? False Does 100 divide 6117? False Does 11 divide 1997? False Is 73 a factor of 1302? False Is 11 a factor of 1608? False Does 2 divide 314? True Is 363 a multiple of 4? False Is 23 a factor of 31763? True Is 3741 a multiple of 87? T	{ "pile_set_name": "DM Mathematics" }
12b, 20p - 14 = -2b + 11p + 4p for b. 12 Solve -61 = 4g + 5w, -2g + 1778w - 28 = 1780w for g. -9 Solve -9g = 4v + 268 - 249, 0 = 6g + 3v + 12 for g. -3 Solve 3d + 5b = 34, -40 = -4d + 79113b - 79117b for d. 8 Solve -12a - 5659x = -5656x, 4x = -a for a. 0 Solve -76 = 4m - r, -274 = -5m - 5r + 9r - 369 for m. -19 Solve 413y - 8v - 464 = 417y, -2v = 2y - 6v - 240 for y. 2 Solve 0n - 4 = n + o + 7, 0 = -5o - 55 for n. 0 Solve 4t = j - 2, 5j - 29 = 35t - 34t for t. 1 Solve -2y + 2k + 0 - 14 = 4, 0y - y - k = -3 for y. -3 Solve -12n + 136 = 4f, 2n - 12 = -4f + 14 for n. 11 Solve 3o = -12, r - 1844570 + 1844568 = -o for r. 6 Solve 4p + 392o = 394o - 48, 15o = -5p - 3o - 142 for p. -14 Solve -2k = -5p + k - 20, 6p - 61874k + 61871k + 21 = 0 for p. -1 Solve -3i - 2u + 18 = 11 + 14, i + 5u = -37 for i. 3 Solve -11n + 9n - j - 1230 + 621 + 658 = 0, 2n - 2j = 58 for n. 26 Solve 18r - 4m + 95 = -101, -13 = -3m - 14 - 14 for r. -12 Solve 3q = 2x - 53, 4x + 8 = 2q + 3x + 44 for q. -19 Solve 5k + 85923 = 5x + 86023, -2 = -2x for k. 21 Solve 0a = 2y - 12a + 274, 5y - 2y - 22y - 6y - 3a + 94 = 0 for y. 1 Solve 2k = -2q + 5q + 16, -232q - 42 = -228q - 13k for q. -4 Solve o + 2o - 7 = -4r, -57r - 5o - 24o = -34o + 139 for r. -2 Solve 1555260 - 1555221 = -34j + 5g, -g = j for j. -1 Solve 657l = 2a + 655l + 48, 0 = 2a + 2l - 64 for a. 4 Solve 5d - 16 = -4o, -5o - 6d - 325 = -2d - 345 for o. 4 Solve 4c - 74 = -3q - 0c, 4q + 3805c - 3811c = 95 - 19 for q. 22 Solve 10n - 3n = -9n - 4a - 32, -98n + 2a = -101n - 6 for n. -2 Solve w - 2a = -14, -5w + 18348a - 2 = 18346a + 4 for w. 2 Solve -1056q + 9 = -1059q - 4v, 0 = -4q + 4v + 44 for q. 5 Solve 35j + j - 40j + a = -26, 0 = -5j - 4a - 20 for j. 4 Solve -4p - g + 5 = 0, 14522p - 4g = 14518p - 20 for p. 0 Solve -9 = 53f - 54f - 5y, 4f = 9y - 40 - 11 for f. -6 Solve 3m + 1774 = g + 1815, -5g + 6m = 250 for g. -56 Solve 2 = -4r - q, -20r + 92r = 60r - 2q - 6 - 10 for r. -3 Solve 2r + j + 0 + 19 = 0, 31 = -2r - 2j + 5j for r. -11 Solve -66k + 9j - 23 = -69k + 14j, -8j = -3k + 35 for k. 1 Solve 0 = 6w - 3w - 76u + 258, 630w - 3u + 49 = 626w for w. -10 Solve 1 + 2 = u + 1, -8 - 2 = -p - p - 9u + 11u for p. 7 Solve p = 4k - 4, 2k - 5p + 87140 = 87124 for k. 2 Solve 2o - 26 = -2j, 53j - 23j - 4o = 27j - 17 for j. 5 Solve 2g - 12950 = 3j - 12977, 0 = 2j + 48g + 130 for j. 7 Solve -8187a + 16374a - 8184a + 3 = 0, 5a + 21 = 2o for o. 8 Solve 3340r - 28 = -4l + 3336r, 6l - r - 28 = 0 for l. 5 Solve 1911k - 1921k = 13j + 8j + 169, k + 13 = 3k - j for k. 2 Solve t + w - 9 - 4 - 9 = 0, 463t + 6w - 7881 = 4w for t. 17 Solve 5j - 2484 = 2a - 2419, -129 = 3a + 3j for a. -40 Solve 2s - 2247214m + 6 = -2247216m, 15m - 60 = 0 for s. -7 Solve 2t - 52370 = 8f - 52386, -42 = -3f + 3t for f. -2 Solve -4r - 33 = 5m, -1004 = -4r + 167m - 177 for r. -2 Solve -3l = 5v + 8, -10648l + 10652l + 3v = -18 for l. -6 Solve -80 = -5c + 4d - 5 + 17, 9d = 14c - 8d - 246 for c. 20 Solve -132 = 20u + 2p, 6u + 62 = -8u + 18u - 3p for u. -4 Solve 0 = 3f - 5h + 17, 3h + 3078 = 4f + 3097 for f. -4 Solve -5r + 3s = -303, 194s + 158s + 236 = 4r + 356s for r. 60 Solve 5q + 71 = 4d - 49, 25d - 2q - 48 = 32d for d. 0 Solve 5z = -2k + 5, 2z + 1591955k - 31 = 1591960k for z. 3 Solve -3f = 2z + 67, -35z + 236 - 550 = -3f + 1025 for z. -38 Solve 0 = -2m - 5o - 55, -5566m - o - 103 = -5561m for m. -20 Solve 4h = -4d + 12 + 272, -h - 23h + 5d - 268 = 0 for h. 3 Solve -62 = -2b - 2g, 0b - g - 20 = -3b - 55 for b. -1 Solve -2u - 576 = -15w - 12w - 5w, 3w + 18 = -2u + 4w for u. 0 Solve 4d - 27u + 12 = 59, u = -4d - 1156 + 1175 for d. 5 Solve -16904v - 12 = -4h - 16905v, 0 = -23h - 3v + 80 for h. 4 Solve 3m = 5a + 6 + 46, 324 = 352m - 347m - 38a for m. 4 Solve 4b - 31578k = -31581k - 72, 5k = 13b + 234 for b. -18 Solve -4f + 0f = -f - 17s + 57, -15f = 76f - 3s + 191 for f. -2 Solve -5x + u + 6u + 19 = 6u, -2x - 4u - 77 + 67 = 0 for x. 3 Solve 3l = -2n + l, 5n - 2112 + 225 = -465l - 169l for n. -3 Solve -4n = -3k + 14, -2n - 4k - 813 = -861 for n. 4 Solve 202 = -k - 5u, -2k = 3u + 39438 - 39314 for k. -2 Solve 55n - 49 = 204 - 62 + 139, -q + 3n - 14 = n for q. -2 Solve 3m - 142 = -17l, 3m - 5l + l = -3l + 52 for m. 19 Solve 39z - 29 = 4m, -2469m = -2467m - 5z - 29 for m. 22 Solve -2w = -298t + 300t - 32, -4t = -3w - 43 for t. 13 Solve 11x - 17x - 2x = 11v + 27 - 252, 0 = -2v + 8x + 22 for v. 19 Solve 169w - 2c = 165w - 80, -11c - 74 = -2w - 414 for w. -5 Solve 4g + 6z - 3z + 16 + 45 = 0, -4g = -5z - 123 for g. 2 Solve -37 = -a - 7b, 93b - 98b - 55 = -40a for a. 2 Solve -3 = 3h - 2h + 5f + 8 - 10, 159 = 37h + 5f + 16 for h. 4 Solve -15 = -13246v + 13244v - 3y, -16v + 7y = -275 for v. 15 Solve 4v = -7b + 299, 10690v - 10693v - b = -50 for v. 3 Solve -86z + 21 = -3m - 82z, 25z - 19z = 18 for m. -3 Solve -g + 3p + 10 = 0, -27663g + 27662g + 4 = -p for g. 1 Solve 42 = 32b - 4w - 66, 2b - 7w + w - 33 = 2w + w for b. 3 Solve -3z + 4z = 7s + 2z + 32, 3s + 28 = -4z for s. -4 Solve -101 = 4g + 5w - 117, -2g + 28w - 114 = 0 for g. -1 Solve 2u + 2p + p + 595 = 568, 9u = 4p + 71 for u. 3 Solve 28 = -5m + 4c, -284m + 287m + 4c + 7 = 3 for m. -4 Solve -4n - 713 + 1393 = 2s + 712, 0 = 2s + 3n + 34 for s. -20 Solve -8z + 24 = -11z + 3c, 0 = 3z - 4c + 28 for z. -4 Solve 19p + 126 = 5u, 450038 = 4u + 4p + 450014 for u. 10 Solve 0 = 3r - 29g + 75g + 6531 - 6554, 0 = r + 3g - 20 for r. 23 Solve 610h = 605h + 4r - 3, 0 = -4r - 12 for h. -3 Solve -4u - 70 = 3c, 183u - 94 = 5c + 184u for c. -18 Solve -5v + 0 = -3w + 9, -1021v = -1029v - 12w + 120 for v. 3 Solve -2p + 5p - 5p = -4p + 3s - 21, 0 = 17p + 3s + 264 for p. -15 Solve -106l = 39a - 108l, 0 = -4a + 3l for a. 0 Solve 0 = 346c - 345c + 30z - 146, -5z = -25 for c. -4 Solve -40g + 46g = -12g + 5l + 1 - 30, -32 = 4g + 4l for g. -3 Solve -92 = -4c - 11q - 22, -32c + 34c + c = -3q + 21 for c. 1 Solve 165t - 164t + 1 = -5h + 29, t - 18 = -3h for t. 3 Solve 27 = -l - 8i - 9i + 22i, -2l + 3i = 47 for l. -22 Solve 3v + 4m + 31 = 0, -4438v - 4m = -4432v + 46 for v. -5 Solve -r - 32 + 66 = -z + 30, 2z + 13 = -5r - 4z for r. 1 Solve 2054091 = 3g - 2z + 2054028, g - 177 = 5z for g. -3 Solve 5w = -91t + 3893, -168286w + 4 = -168287w for t. 43 Solve -4a - 4k + 52 = 0, -27a + 3k + 37 = -28a + 48 for a. 14 Solve 15z + 22z - 35z = b - 1, z + 4b - 10 = 6z for z. 2 Solve x - 1 = -5j - 50, -19j - 123 = -3x + 36 for j. -9 Solve -3y - 125 + 25 = -5i - 39, 0 = 5i - 8y - 121 for i. 5 Solve -2b + 5n - 46 = 0, b + 3 = -356n + 369n + 1 for b. -28 Solve 0u - 3o = -3u - 8o + 43, -23 = -3o - 8 for u. 6 Solve -5j + 4s - 238 = -174, 5s + 185 = -60j for j. -4 Solve -h + 105 = -28s + 90, -72 = -5s + 2h for s. -2 Solve -706q = -710q - 23o - 175, 5q - 5o + 185 = 0 for q. -38 Solve 5q + 5a = 325, 857a - 862a - 179 + 256 = -3q - 224 for q. 3 Solve 4u - 18 = -2m - u, 68m + u - 9 = 73m for m. -1 Solve 2g - 5a - 1 = 8g, 6g + 28 - 29 = 9g + 2a for g. -1 Solve 3 = -8c + 32861f - 32860f, -5f = -4c - 8f - 19 for c. -1 Solve -9g + g - 124 = -4u, 5g + 4u = 2g + 168 for g. 4 Solve 4t + 359n = 364n + 257, -121t + 126t - 5n - 315 = 0 for t. 58 Solve 9c + 0c + 10 = -4t + 4c, 2 = t - c for t. 0 Solve 6v - 7j = -4v - 3j - 32, 1354j + 2 = 1353j for v. -4 Solve 17s - 2g = 81, -97s + 95s + 8 = -g for s. 5 Solve -3272v + 5r + 138 = -3255v, 5r = 6v - 149 for v. -1 Solve -2y = -4o + 16, -5o + 2y + 23 - 1 = 0 for o. 6 Solve -p + 3p + 112 = -4l, 2l - 105p + 1106 = 5l + 6158 for l. -4 Solve -2c + 34o - 30 = 32o, -34o - 17 + 59 = 2c for c. -13 Solve 14u - l + 902 = 232, 7u + 338 = -l for u. -48 Solve -3q - 5688 = -11y - 5774, -q + 25 = 3y - 17 for y. 2 Solve 5p - 6s - 61 - 29 = 2p, -8p - 19s + 22s = -279 for p. 36 Solve 49*	{ "pile_set_name": "DM Mathematics" }
-2 Let m be (4 - -1) + 2/(-2). Let q(s) = s*2 - 11s + 25. Let j be q(8). Let n be (-182)/(-12) + j/(-6). Solve -mh - n = -9h for h. 3 Let x(q) = -30q. Let s be x(-1). Suppose -72 = -2w - 0w - p, 4w - 2p - 128 = 0. Let h = w - s. Solve m - 25 = -hm for m. 5 Let p be ((-5)/10)/((-2)/4). Let n be (5 - 3) + 4/p. Solve g + n = -g for g. -3 Suppose -30 = -2x + 4x + 5v, 0 = 4x + 5v + 50. Let l(k) = k2 - 9k - 22. Let c be l(12). Let w = x + c. Solve -5 = wy - 25 for y. 5 Suppose -2s + 5s = -3x + 30, 8x + 3s = 105. Solve 0 = 22q - xq - 28 for q. 4 Let i(q) = q*3 - 2q*2 + q. Let m be i(3). Let u = m - -8. Suppose 3j = -4n - u, j + 2j + 5n + 25 = 0. Solve 3 = s - js for s. 3 Suppose -3w + 120 = a, a + 198 = 5w + 2a. Let g = w - 36. Solve 1 = -b - g for b. -4 Suppose 3d - 57 + 24 = 0. Let w = d - -4. Let j = w + -12. Solve -2g = g - j for g. 1 Suppose -66 = -3l - 4m, 3m + 2m = 5l - 75. Suppose -7g = -0g - 42. Let s be 1(8/(-2) + g). Solve -s - l = 4f for f. -5 Let i be (-23 - -3)(-1 + 0). Suppose -i = -9n + 16. Solve 9 = -f + nf for f. 3 Let f be 3/(-12) + (-84)/(-16). Suppose fx - 3 = 6x, 5x + 15 = -o. Solve -g + og + 4 = 0 for g. 4 Let w be (-7 - -5)/(-2) - (-1 - 0). Solve -ws + s = 0 for s. 0 Let i be -4(-75)/121. Let q = 39 - i. Let v = 19 - q. Solve 25 = 5h + v for h. 4 Let s = 0 + -4. Let x = -489 + 490. Let p = x - s. Solve 3b = -p + 11 for b. 2 Let d = -28 - -38. Suppose 0k = 5k - d. Solve -g = -kg - 2 for g. -2 Let n(r) = -5r + 9. Let t be n(5). Let j = -10 - t. Solve x = jx for x. 0 Suppose 5f - 5j + 2j - 31 = 0, -37 = -5f + j. Solve fu = -0u for u. 0 Let h = -17511 - -17514. Let y be 1/(-3) + 62/6. Solve hf - y = 2 for f. 4 Suppose 10u + 125 - 255 = 0. Solve -2 - 11 = uy for y. -1 Let d(g) = 39g + 241. Let z be d(-6). Solve -3n - 10 = zn for n. -1 Let p(c) = c + 36. Let l(v) = -4v - 109. Let d(n) = 2l(n) + 7p(n). Let u be d(29). Solve -3z = -uz for z. 0 Let i(p) = -p*2 + 8p + 3. Let k be i(8). Suppose kq - 21 = -60. Let r = -10 - q. Solve 7 + 5 = -rl for l. -4 Let t(v) = v - 1. Let h be t(3). Let k = 406 + -203. Suppose 6r + 203 = k. Solve r = -hg - 2 - 6 for g. -4 Suppose -o - 2c + 28 = 2c, -4o + 4c = -112. Suppose 31 = 3l + o. Solve 2p - 3 = l for p. 2 Let j(g) = -g*3 + 13. Let s be j(0). Suppose 4v - 39 = s. Suppose -74 = -66y + 256. Solve -3 + v = -yf for f. -2 Suppose -5p + 3w - 6 = 0, 4p - 7p - 10 = -5w. Solve 3z - 2z - 1 = p for z. 1 Suppose 2k - 4k + 6 = 0. Suppose ku + 6 = 6u. Solve 3j = j + u for j. 1 Let x(i) = 12i2. Let c(r) = r2 + r - 1. Let h be c(0). Let j be x(h). Let o = -10 + j. Solve 3l = ol for l. 0 Let k(u) = 4u + 49. Let h be k(-9). Solve -3z + h - 10 = 0 for z. 1 Let k = -29 + 29. Suppose 3s - 2s + 25 = 5d, -3d + s + 13 = k. Solve dt + 10 = 4t for t. -5 Let v(r) be the third derivative of -1/60r*5 + 3r*2 + 0r + r*3 + 0 + 0r*4. Let q be v(0). Solve l + q = 1 for l. -5 Suppose -d - 1 = 0, 3j + 2d + 323 = 3d. Let h = j - -67. Let i = h - -42. Solve 5a - i = 4 for a. 1 Suppose 4f = 8 + 4. Let w(t) = 8 + 10t2 + 2t2 - 36 - t3 + 3t. Let u be w(12). Solve -u - 4 = -fj for j. 4 Let g be 2/(4/(-6))-1. Let y(u) = u3 - 8u*2 + 8u - 9. Let i be y(8). Let t be 2/14 - i/(-7). Solve c + gc = -t for c. -2 Let b be (3 + -2)/(8/8). Solve -7v + b = 8 for v. -1 Let g be (-11)/88 + 1042/16. Suppose -g = -5j + 4q, 30 = 2j + 3j + 3q. Suppose 10z = jz + 3. Solve zt - 3 = -0t for t. 1 Suppose -171b = -166b - 2p - 199, p - 208 = -5b. Solve 37 - b = 4l for l. -1 Suppose 4a - 5 = 3. Let y = -176 - -186. Solve -y + a = 4x for x. -2 Let v(z) = 5z + 26. Let h be v(-5). Let d(o) = -o3 + 10o*2 - 8o - 11. Let t be d(9). Let b = 2 - t. Solve -bk + h + 19 = 0 for k. 5 Let d be 2 + 0 + (17 - 7). Let x be (-4)/(-5) - d/(-10). Solve -i + x = i for i. 1 Let m = -5 + 7. Suppose j + 0 = m. Let t be 1 + 10/(-6) + (-1536)/(-144). Solve 0i - t = -ji for i. 5 Let p be 0/(8/((-4)/1)). Let w = p - -8. Solve -f = f - w for f. 4 Let y(h) = h - 17. Let u(j) = -2j + 34. Let c(g) = -3u(g) - 7y(g). Let m = 20 - 6. Let q be c(m). Solve -5 = -qd - 2d for d. 1 Let g = -4 - -9. Let v(h) = -2h3 + 3h*2 + 3 + 4h + h*3 + 4 - g. Let o be v(4). Solve -4z + 14 = -o for z. 4 Let d be 20/(-3)(-3)/2. Let s = 13 - d. Let u be ((-1)/s)/(1/(-9)). Solve ux - 20 = -2x for x. 4 Suppose 203b + 425 = 220b. Solve -bf + 18 = -34f for f. -2 Let q(l) = -5l + 71. Let u be q(13). Solve 2w = -u - 2 for w. -4 Suppose -i = -3o + 4i + 37, 0 = 5o - i - 25. Solve -2l + o = -3l for l. -4 Suppose -2x - 27 - 13 = 0. Let n = 24 + x. Suppose -nz = 2i - 8, 3z + i = -2i + 12. Solve c + z = -4 for c. -4 Let m = -21 - -26. Suppose -mg + 8 = -7. Solve -g = 4z - 11 for z. 2 Let n be ((-60)/(-45))/(11/9 + -1). Suppose c + 5f = -0c + 22, -n = 3c - 3f. Solve -2 - 4 = -cw for w. 3 Let x be (42/(-4))/((-14)/28). Let z = -9 + x. Suppose 4b + z = 4n - 0, -2 = 2n + 2b. Solve -9 = 2u + n for u. -5 Suppose 0 = 2o - o - 2j - 3, 2o - 2 = 5j. Let f = o + 1. Suppose 2w + 2h - f = -0h, 3h - 27 = -4w. Solve -4s + 20 = -ws for s. -4 Let b be (-626)/(-42) - (3 + (-130)/42). Solve 74w - b = 69w for w. 3 Let k = 24 - 15. Suppose 8y = 4y + a + 12, 3a - 12 = 0. Let w = -16 + 27. Solve -yp = k + w for p. -5 Suppose 135 = -4l + 79. Let o = l + 16. Solve oc + 0 = 4 for c. 2 Let m = 527 + -544. Let l(h) be the first derivative of h*2/2 + 23h - 1. Let k be l(m). Solve -k + 3 = z for z. -3 Let d(y) = -y*2 - 26y - 57. Let b be d(-23). Solve l = b - 14 for l. -2 Suppose 3p + 6 = c + 2c, -c - 4p = -2. Solve 5b - 15 = cb for b. 5 Let o be -2(4/(-6) - (-468)/(-108)). Solve -ou + 4 = 14 for u. -1 Suppose -5l = 16l - 231. Solve -2q + 1 - l = 0 for q. -5 Suppose 7z - 4z = 4n + 139, -5z - 5n = -255. Solve 16x + z = -15 for x. -4 Let z = 421 + -406. Solve -8j = -5j - z for j. 5 Let h = -962 + 982. Solve 10l - 20l = -h for l. 2 Suppose -2a = 2a - 16. Suppose 2 + a = c. Suppose -5s - 5 = 0, 0 = -l + 3l - 3s - 5. Solve k - c = -l for k. 5 Let u(r) = -r2 - 10r + 17. Let a be u(-10). Suppose -2w - 11 + a = 0. Solve 4 - 1 = wc for c. 1 Let s(g) = g*3 - 2g*2 - 2g - 2. Let l(f) = -f*2 + 4f. Let c be l(3). Let b be s(c). Let w(v) = v*2 + 17v + 16. Let d be w(-16). Solve d = h + b for h. -1 Suppose 4z - 2 = 10. Solve zk = -3 + 6 for k. 1 Suppose -14f + 25f - 11 = 0. Solve 4 + f = 5h for h. 1 Suppose 18 = 5p - 22. Suppose p = 6k - 3k - 2h, 4h = k - 16. Solve k = 3l - 3 - 12 for l. 5 Let w(n) = -n2 + 15n - 15. Let b be w(13). Suppose -5 = -2o + b. Solve -y + 3y + o = 0 for y. -4 Let i(w) = w*2 - 42w - 328. Let u be i(-7). Solve 9 = -uk - 66 for k. -5 Let x = 35 - 34. Let g be 2x/2 + 1. Solve -gu = -3 - 7 for u. 5 Let u be (-1 - 0)(-4)/2. Let r(v) = -10 + 6 + uv2 - v3 + 3v*2 - 3 + 8v. Let d be r(6). Solve 0 = -dc + c + 20 for c. 5 Suppose 0 = 2f + 4c - 102, 0 = f + 2c - 3c - 36. Solve -f = 2h - 33 for h. -4 Let v be (1 + -4)4/6. Let z(x) be the second derivative of -x3/6 + x2 + 84x. Let y be z(v). Solve -yp = -5p for p. 0 Let k(u) = 6u3 + 4u*2 + u + 1. Let a(c) = -7c*3 - 5c*2 - 2c - 1. Let y(w) = 3a(w) + 4k(w). Let d be y(1). Solve -dm + 12 = -0 for m. 4 Let j(y) = -4y + 46. Let p(v) = 3v - 31. Let q(c) = 5j(c) + 7p(c). Let d be q(-11). Solve 0k + d = 2k for k. 1 Suppose 2a = -2 + 8. Let p(d) = -2d3 - 10d*2 - 10d - 2d + d3 + 11 + 2d*a. Let x be p(11). Solve xj = -4j for j. 0 Let x = -19 + 19. Solve 3s - 6 = -xs for s. 2 Let u = -1719 - -1723. Let j be (-6)/9 + 10/6. Let w(z) = -z - 1. Let t be w(-4). Solve -j = tq - uq for q. 1 Let o = 0 + -6. Let x be ((-8)/(-6))/((-1)/o). Let z be 22 - 5/(20/x). Solve -6d + z = -2d for d. 5 Let x(i) = 11i + 156. Let r be x(-14). Solve -rm = -m + 5 for m. -5 Suppose 86o = 310 - 52. Solve 0 = 10b + 7 + o for b. -1 Suppose 0k - k + 103 = 5h, -4h + 4k + 92 = 0. Suppose 0o = -8o + 136. Suppose 4 = -ol + hl. Solve 3 = -2d + l for d. -1 Suppose -3u - 99 + 96 = 0. Let x be 0/61(3/(-2) - u). Solve f - 4f = x for f. 0 Let y(r) be the second derivative of r*4/12	{ "pile_set_name": "DM Mathematics" }
-4, -0.4, d, y Let a be (-2)/((-2)/8-2). Suppose -5q = 5v - 62 + 17, -v + 2q - 3 = 0. Suppose -19 = u + vt, 5u - 2t + 0 = 13. Sort a, 5, u in decreasing order. 5, u, a Let b(t) = -t3 + 4t*2 - 3t - 4. Let p be b(5). Let u = -45 - p. Put -3, u, 4 in decreasing order. 4, u, -3 Let n be (4/(-8))/((-1)/2). Let d be (n/(-3))/(12/(-144)). Suppose 3v + q - 9 = 0, -v + dq - 3 = -2v. Sort -3, -4, v. -4, -3, v Let b = 1075 + -1078. Sort 1/6, 0.07, 0.3, b in decreasing order. 0.3, 1/6, 0.07, b Let t = 14 - 12. Let m = t + 0. Let i = -3.33 + -0.67. Put i, m, -0.4 in increasing order. i, -0.4, m Let m be (3 + 0)((-56)/147)/8. Put -1, m, -5, -2/7 in increasing order. -5, -1, -2/7, m Let f(q) = q*3 - 31q*2 - 63q - 97. Let j be f(33). Let v = 3 - 6. Sort j, -4, v, 5 in increasing order. -4, v, j, 5 Let u = -0.5 + 0. Let k(p) = -1 - 175p2 - 2p*3 + 156p2 + p3 + 0p3. Let x be k(-19). Put -2/5, u, x in ascending order. x, u, -2/5 Suppose -6d + 4d = 0. Suppose -16 = -12f + 8f. Sort 3, d, f. d, 3, f Let k be (-2)/6 - (102/(-18) - -6). Put k, -5, 2/3 in descending order. 2/3, k, -5 Suppose 142j - 152j = -20. Sort 5, -2, j, -5 in ascending order. -5, -2, j, 5 Let w be (-7)/(-39) - (-24)/156. Let y = 31.2 - 31.4. Put -0.05, w, -3, y in descending order. w, -0.05, y, -3 Let u(i) = 2i3 - i2 + i - 1. Let j be u(1). Suppose 50 = 2c - 4s, -5s = 3c - 22 + 2. Suppose cm - 75 = -0m. Put j, 4, m in increasing order. j, 4, m Let a = 4 + 27. Let u = -63 - -36. Let w = u + a. Sort 4/5, w, -3 in increasing order. -3, 4/5, w Let v be 2((-533)/123)/((-2)/(-3)). Put v, -3, -1, 4 in descending order. 4, -1, -3, v Let v be (-648)/900(-10)/(-3). Put 0.1, v, 0.4 in descending order. 0.4, 0.1, v Let y = 17.4 - -0.6. Let s = y - 17.8. Sort 3/2, s, -0.3. -0.3, s, 3/2 Suppose 267v + 418 = 229v. Let n(y) = y2 - y - 3. Let l be n(3). Let w = -2 + l. Sort v, 0, w. v, 0, w Let f(t) = t3 + 6t2 + 5. Let m be f(-6). Suppose -7l + ml = -4l. Sort -5, l, 6, -4/7 in decreasing order. 6, l, -4/7, -5 Let d = 12.6 - 12.7. Sort -1, 2, -1/5, d. -1, -1/5, d, 2 Suppose -4l = 3a - 2 + 3, l = -2a + 6. Sort l, 3, 23. l, 3, 23 Let p be 0 + (0 - -56)/4. Suppose -4q - p = -5y, y - 2y - 2 = 4q. Let r = -1 + -3. Sort r, -2, y in descending order. y, -2, r Let b = -0.129 + 57.129. Let t = -26 + b. Let c = t - 28. Put -3, -2, c in increasing order. -3, -2, c Let h be 2/1 + -24 + -5. Sort h, -2/5, -0.5, 5. h, -0.5, -2/5, 5 Let c = -5239 - -5265.63. Let t = 0.63 - c. Let b = 26 + t. Sort 2/5, b, 4 in increasing order. b, 2/5, 4 Let i = 0.01 + -5.01. Let u = 14 - 12.3. Let v = u - 1.4. Sort 4, v, i in descending order. 4, v, i Let w be (27/2 - 1/2) + -4. Suppose 3z + wv - 5v = -57, 2z + 5v + 38 = 0. Put 4, 2, z in ascending order. z, 2, 4 Let t = 0.00284 + -27.31084. Let v = 0.592 - t. Let z = 28 - v. Put 8, z, 1/4 in decreasing order. 8, 1/4, z Let d(c) = -c3 - c2 - 4c + 2. Let u be d(0). Put 7, u, 4, -9 in ascending order. -9, u, 4, 7 Suppose -3n - 4h = 44, -26n + 4h = -23n + 4. Sort -5, 3, -6, n in increasing order. n, -6, -5, 3 Let y = -121/6 - -20. Suppose -4r + 2q = r + 5, -r + 11 = 2q. Let g = 0.47 + -0.48. Sort r, g, y. y, g, r Suppose n - 25 = -4n. Let p = n - 2. Let y = p + -3. Sort 2/15, 1/2, y in ascending order. y, 2/15, 1/2 Suppose h + 2h = 6. Suppose 0 = -102o + 68o - 68. Let x = 8 + -12. Sort h, x, o. x, o, h Let y(b) = 4b + 115. Let z be y(-30). Let k = -5 + 10. Sort 0.4, k, z. z, 0.4, k Let h = -72 + 72. Let s = h - -4. Let m = 2.3 - 2. Put 0, m, s in increasing order. 0, m, s Let r(m) = m*2 + 4m - 27. Let k be r(-8). Let u(o) = o*3 + 1. Let t be u(0). Suppose 3s = s. Sort s, k, t in descending order. k, t, s Let o be (15/6 - 2)8. Suppose 10 = -6z - 8. Let p be (-4)/4 + (-6 - z). Put o, 5, p in ascending order. p, o, 5 Let d be 6 - ((-1650)/(-24))/11. Let y = -7 - -2. Sort -0.03, y, d in descending order. -0.03, d, y Let r = -0.6 + 0.3. Let a = 23 + -15.7. Let i = a + -7.7. Sort r, -2/25, i in decreasing order. -2/25, r, i Suppose -2k - 3v - 8 = -2v, -3k - 5v = 5. Let c be 3616/304 - (-2)/19. Put c, k, -3, -2 in descending order. c, -2, -3, k Let b = -6 + -2. Let k = 264.4 + -256. Let v = k + b. Sort -1/2, v, -0.1 in decreasing order. v, -0.1, -1/2 Let z be 14 + -13 + 4/(-3). Sort z, 0, 2/11, 2. z, 0, 2/11, 2 Let w = 0.12 - -0.28. Let m = -140 - -139. Sort w, -2, -29/4, m. -29/4, -2, m, w Let n be (-2 - 2)3/3. Let d = 67 + -113. Let z be (-8)/44 - d/11. Sort -2, z, n in decreasing order. z, -2, n Suppose -i + 114 - 104 = 0. Suppose 0 = 4f + i + 2. Suppose 3t = w - 4, -2t + 4w = 9w - 3. Sort 0, f, t in descending order. 0, t, f Let i = 267.1 + -267. Sort 2/5, i, 31 in decreasing order. 31, 2/5, i Let i be (12/9)/((-11)/(-132)). Put 3, 4, 2, i in descending order. i, 4, 3, 2 Let b = 4174 - 4106.96. Let k = b - 71. Let u = 0.04 - k. Sort u, -3, -0.05 in descending order. u, -0.05, -3 Let i = 2 - 3. Let o = 263/77 + -36/11. Let r be (-2)/11(-3 - -2). Sort i, r, o in decreasing order. r, o, i Suppose 4a - 5t + 25 + 7 = 0, 6 = 2a + 3t. Sort 0, a, 21, 1. a, 0, 1, 21 Let b = 230.6 + -231. Put b, 0.3, -5, 2/11 in ascending order. -5, b, 2/11, 0.3 Let y = 46 - 39. Let v be (-6)/(-24) + y/(-20). Sort 2, v, 0.1. v, 0.1, 2 Let x = -341 - -319. Sort x, 0.3, -2 in descending order. 0.3, -2, x Let f = -30 + 31. Let o = f - -4. Suppose -2u = -4l - 8, 2u + 3u + 16 = l. Put -0.5, o, l in descending order. o, -0.5, l Let n = -157 + 1103/7. Suppose 2l - 6 = g, -3g = -l - 2l + 18. Put n, -0.5, g in increasing order. g, -0.5, n Let w = 13 + -13. Let r be 1/(-5) - (-8)/(-110). Let c = -20/33 - r. Put w, 2/5, c in ascending order. c, w, 2/5 Let l = 134 - 139. Let w = 15 + -11. Suppose 2s + 2a + 0a - 8 = 0, -ws + 3a + 9 = 0. Put s, -1, l in increasing order. l, -1, s Let m = -74.74 + 74. Let n = m + 0.24. Put 0.5, -3, n in decreasing order. 0.5, n, -3 Let g(z) = 18z + 35. Let a be g(-2). Suppose 4c - 21 = w, -3w = -c - 2w + 3. Suppose f = 6f. Sort f, a, c in descending order. c, f, a Suppose x + 2 = o - 3, 0 = -4o + 5x + 21. Suppose 2a = -2a - 3z + 21, oa = 3z + 27. Sort 4, a, 3. 3, 4, a Let j = -2 - -6. Let z(y) = -20 - 4y + y + 6. Let t be z(-5). Sort j, t, -12. -12, t, j Let p = 378 + -383. Sort p, -2/15, -1. p, -1, -2/15 Let n = -2 + 7. Let f = -6 + n. Sort -3, f, -2 in decreasing order. f, -2, -3 Let h be (-4 + 11)/((-2)/4). Let x be -2 - (1 - (-46)/h). Sort 0.5, x, 3/8 in increasing order. x, 3/8, 0.5 Let k = 37 + -38. Suppose -3o - 3r = -3, 0 = o - 3o + 2r + 10. Sort o, k, -4 in decreasing order. o, k, -4 Let g = -1.111 + 1.311. Put 0.3, -20, g in decreasing order. 0.3, g, -20 Let o be (-2 - 12/(-8))(-2 + 4). Sort -0.2, o, 1. o, -0.2, 1 Let b be (-2 - -4)/((-4)/(-14)). Suppose -bt = -3t. Sort t, 6, 1, 3. t, 1, 3, 6 Suppose 0 = 14017g - 14004g - 416. Sort g, 3/2, -0.2 in ascending order. -0.2, 3/2, g Suppose 4f + 34 = 3s, 18 - 60 = -5s + 3f. Let x be (-16)/(-12) + 2/(-6). Sort x, -5, s, -3. -5, -3, x, s Let p(i) = 99i + 687. Let n be p(-7). Put 2/13, 11, n, -2 in descending order. 11, 2/13, -2, n Suppose -61u + 24 = -55u. Sort -1, 0, u, -2 in ascending order. -2, -1, 0, u Let g(p) = -2p3 + p2 + 15p - 19. Let a be g(-3). Let m(s) = 7s. Let t be m(-1). Put 5, a, 0, t in ascending order. t, a, 0, 5 Suppose -5s + 4s + 5 = -2q, 2s - 10 = 0. Suppose q = -2x - x - 12. Let i = 88 - 89. Sort x, 0, i in increasing order. x, i, 0 Let s = -1814 + 5440/3. Let u = -3 - 1. Let p = u - -6. Sort s, -4, p in descending order. p, s, -4 Let s(r) = r3 - 2r - 46. Let p be s(0). Sort -5, 1, p in descending order. 1, -5, p Let u = -0.49 + -0.05. Let z = u - -0.65. Sort 0.3, z, -4/3 in increasing order. -4/3, z, 0.3 Let t = 53 + 61. Let q be 8/(-44) - t/(-22). Put q, -3, 2, 3 in descending order. q, 3, 2, -3 Let z = 233 - 158. Let o be ((-6)/z)/((-36)/(-20865)). Let k = 93/2 + o. Sort 0.5, k, -3/5 in descending order. 0.5, k, -3/5 Let n(l) be the third derivative of 1/120l6 + 3/2l*3 + 0 + 5l*2 + 0l + 3/8l4 + 2/15l*5. Let x be n(-7). Sort x, 5, 0 in ascending order. x, 0, 5 Let m = 30 + -152/5. Suppose -50r + 6 = -52*r. Sort 4, r, -0.02, m in decreasing order. 4,	{ "pile_set_name": "DM Mathematics" }
(-1)/(-3) - ((-8)/(-3))/(-1) 3 What is the value of 1 + (1 - 1) - -2? 3 18/4(11 + (-585)/54) 3/4 ((-2)/10)/(377/290) -2/13 (9/63)/(11/7 + -1) 1/4 4/6((-2)/(-14) + -1) -4/7 Calculate -15/(-8)16/(-40). -1/4 Evaluate 18/(-10) - -2015/375. -1 What is the value of (9 - 8715/975)/((-2)/5)? -2/13 What is (-20)/6 - -2 - 260/(-156)? 1/3 What is the value of 10/8 + 60/(-40)? -1/4 What is 1 + -4 - (-41)/(-9) - -8? 4/9 Evaluate (357/98 - 4)-14. 5 Evaluate 54/(-81) + -1 + 21/18. -1/2 What is the value of (-12)/20 + (-5)/((-175)/(-119))? -4 What is (-6)/6 - -1 - 0? 0 (-24)/36 + (12/9)/(-1) -2 Calculate (-31)/(-93)(1 - -2). 1 (-8)/6(7 + (-290)/40) 1/3 What is 4/26 + (-200)/(-52)? 4 Evaluate 2/((-6)/(-9)) - -2. 5 What is ((-14)/(-84))/((0 + 1)/(-3))? -1/2 Evaluate (0 - (-7 + 4)) + 0. 3 Calculate -2 - (5 - (-102)/(-15)). -1/5 6/120-5-16 4 -4 + 5 + -5 + 8 4 (-152)/(-950)5/2 2/5 What is (-11)/(-2) - (2 + 1)? 5/2 32/15 + 4 - (-42)/(-7) 2/15 What is (95 + -13)6/100 + -5? -2/25 Evaluate 5 - 90/(-10 + 19). -5 What is the value of -13 + 13 + -12? -2 What is (-36)/(-64)12 - 3/4? 6 (45/10 + -4)(-7 - -7) 0 What is the value of 6(-4)/244? -4 Evaluate (-2)/((-60)/9) - 2/(-10). 1/2 What is the value of 1/(-2) - (1/10)/(-1)? -2/5 Evaluate 42/120 - 3886/(-435). 9 What is 22/8 - 0 - 2/(-8)? 3 Evaluate (-16)/221/(-56). 3 Calculate (-2 - 64/(-40))15/48. -1/8 What is the value of 2 - (14 + -6) - (-4)/2? -4 What is (58 - 62) + 10/4-2? -9 (133/(-114) + 1)2-1 1/3 Evaluate -6((-51)/(-6))/17. -3 What is the value of (-184)/252 + (123/(-27) - -5)? -2/7 What is ((-40)/30)/((-7)/3 + 3)? -2 66/(-18) + 3 + 16/18 2/9 Evaluate (-4)/(-16) - ((-51)/(-12) + -2). -2 Evaluate (2/3)/(((-20)/75)/(-2)). 5 What is the value of (5-1)/((-8)/(-16)-2)? 5 Evaluate -2 - 2 - (-4)/2. -2 What is 6/(14/4(-30)/70)? -4 Calculate ((-2)/14)/1 + 152/280. 2/5 Evaluate (-4)/4 + ((-30)/(-27))/1. 1/9 What is the value of (-9)/1(16/6)/(-8)? 3 What is the value of (4 - 0)/(45/255)? 4/9 What is the value of (-4)/(-6) - (1 - (-1)/6)? -1/2 Evaluate (22 - 16) + (-16 - -5). -5 What is ((-5)/(-2))/((35/10)/7)? 5 (2 + -5 + 1)/(-2) 1 Evaluate -27 + 24 - (-9)/4. -3/4 Evaluate ((-481)/130 + 4)10/12. 1/4 What is the value of (9 + (-172)/20)(-5)/(-1)? 2 Evaluate (-7 + 8)/(12/15 - 1). -5 (-1 - (-20)/18) + 26/117 1/3 What is 4/(-1) - 66/(-17)? -2/17 Calculate (-15)/(-15) + -1(-21)/(-15). -2/5 What is 114/209 + 25/55? 1 2 + (27/(-28) - (-39)/(-52)) 2/7 Evaluate 10/(-4)(-76)/(-285). -2/3 Evaluate (-2)/6 + 1 - 1222/1410. -1/5 (-13)/(-117) + (-1638)/162 -10 2/((-20)/3)(-445)/(-178) -3/4 3/2(-30)/315 -1/7 What is the value of 3/2(220/99 + -2)? 1/3 Calculate ((-1)/704)/(22/(-462)). 6/5 Evaluate (18/(-27))/(1/2) - -1. -1/3 What is the value of ((-11)/(-5) + -2)/(1/3)? 3/5 Calculate 495/(-190) - (-15)/6. -2/19 Calculate (120/110)/((-6)/(-3)). 6/11 What is 8/(-14) + 12/(-28)? -1 Calculate ((-2328)/(-390) - 6)5. -2/13 Evaluate (16/(-14))/((-54)/(-63)). -4/3 Evaluate 4(-21)/(-12) - 4. 3 Calculate (-22)/44(-14 + 2). 6 ((-8)/(-20) + (-66)/(-10))/(-1) -7 ((-1)/2)/(5 + (-4 - 0)) -1/2 What is the value of (((-8)/6)/(-2))/((-18)/(-81))? 3 What is the value of 4/(-10)109/(-109)? 2/5 What is the value of 10/20(-1)/((-1)/(-10))? -5 What is 0 + 2/2 + (-5)/6? 1/6 Evaluate 1 + -6 - (-12)/((-10)/(-5)). 1 Evaluate 2/25 - 176/(-550). 2/5 What is the value of 13 - ((-737)/(-110) + 6)? 3/10 Evaluate 24/(-8) + 23. 5 Evaluate (15/(-9))/((-25)/(-30)). -2 What is the value of (-34/(-6))/((-6)/(-12))? 4 -1 + -6 + 3 + 2 -2 What is (42/180)/(-7)3? -1/10 Evaluate -4 + 14 + -4 + -1. 5 What is the value of (3/12)/(7 + 1128/(-160))? -5 (-4)/14 - -79(-8)/(-56) 11 Evaluate 8/(-32) - ((-351)/12)/9. 3 Evaluate (-3 - -4)/((-11)/(-11)). 1 Calculate 20/(-6)1/(-5). 2/3 Calculate -8 - -10 - 48/22. -2/11 Calculate 6/(-20)112/56. -3/5 Evaluate 3(-5)/40 + (-105)/120. -5/4 What is the value of (-30 + 10)/(-5) + -9? -5 What is the value of 9/(-7) + 7 + -6 - 0? -2/7 What is the value of 459/(-1190) + 12/42? -1/10 Evaluate (27/(-15))/(-3) - 198/30. -6 Evaluate (718/(-63))/1. -2 Calculate 36/180(-7 + 2). -1 ((-16)/126)/(38/(-133)) 4/9 Evaluate -8 - 110/20-2. 3 ((-4)/(-8) + (-11)/2)/(-1) 5 What is (-8)/36 + (-8)/((-2016)/(-52))? -3/7 What is 27/93/(90/4)? 2/5 (94/282)/(1/(-12)-7) 4/7 What is the value of -9 - (7 + 2 + -11)? -7 Evaluate 1 + (14/8)/(30/(-24)). -2/5 Evaluate (-5 + 17)/3(-7)/126. -2/9 What is 6/(-8)(-80)/270? 2/9 What is the value of ((90/(-14))/(-15))/((-18)/(-4))? 2/21 Evaluate 4/(-8) - ((-76)/8 - -9). 0 0 - -2 - 4(-4)/(-8) 0 Evaluate -3(-5)/(-15)3. -3 Calculate (-11 - (-456)/40)-1. -2/5 Calculate (14 - 3) + 369/(-33). -2/11 What is the value of (-126)/(-56) + 1/(-4)? 2 2 - (2/(-17) - 127/(-68)) 1/4 What is the value of (-2 + 1 + 2)100/(-500)? -1/5 Calculate -5 + (-1 - 0) + -2 + 5. -3 What is (-45)/18 - 12/(-8)? -1 (12 + -2 + 0)86/(-215) -4 What is 4/(-198)((-70)/7 + 1)? 2/11 What is 31 - (-289)/(-102)? 1/6 Evaluate 16/45 - 24/(-540). 2/5 Evaluate 2 + 148/(-32) + 3. 3/8 1 - -2 - (-72)/(-20) -3/5 What is 4/(-8)0 - (-12)/(-21)? -4/7 Calculate 3 + 1 + 8 + 357/(-28). -3/4 What is (6 - 0/(-5)) + -2? 4 What is the value of (-2)/(-6) - 19/21? -4/7 Evaluate (9/(-15))/((-9)/(-45)). -3 ((15/(-25))/(-3))/((-5)/25) -1 What is the value of (-2210)/(-286) - 18/(-66)? 8 Evaluate (-6 - -62)/7 - 6. 2 8 + 0 + -6 - (-6)/(-2) -1 Evaluate 60/35(-2)/(-24)3. 3/7 Evaluate (-2)/16 - (-5)/680. -2/17 14/6 - (-2)/(-6) 2 What is the value of (3 + 1 - 3)(-12)/39? -4/13 What is the value of (-18)/(9/((-63)/(-14)))? -9 Calculate (-45)/5(-13 + 12). 9 What is the value of (64/32)/(((-2)/(-5))/(-1))? -5 What is the value of 54/72 + 1/(-3)0? 3/4 Evaluate 1/(3 + 26/(-8)). -4 (-6)/(-18) - (2 - (-56)/(-30)) 1/5 Calculate 93/96/63. 2/7 (-8)/7735/(-2100) 2/5 What is the value of -2(-4)/84? 4 Calculate 4/3(-1 - 6/(-4)). 2/3 What is the value of ((-2)/4 + 0)/(47/94)? -1 Evaluate 40/16 + 4/8. 3 Evaluate 8/32 + (-15)/28. -2/7 What is 8/36 + (58/(-18) - -3)? 0 What is ((-2)/18)/(1(-2)/12)? 2/3 What is ((-32)/(-18) - 2)(13 - 12)? -2/9 Evaluate (2/(-5))/((-66)/(-15) - 5). 2/3 Evaluate (8/60)/(21/(-9) + 3). 1/5 (0 + 2/(-5))/((-56)/(-42)) -3/10 What is (-8)/(-14)(-1197)/114? -6 What is (-68)/(-51)12/8? 1/3 Calculate 0 + 23/((-2622)/12). -2/19 Evaluate -8 - ((-270)/990 - (-184)/(-11)). 9 Evaluate ((-4)/6)/((-3)/9) + 3. 5 What is the value of (0 - 8) + (15 - (-165)/(-15))? -4 -65(-36)/270 + (-2)/(-6) 9 What is the value of (2/4 + 0)(-266)/(-1197)? 1/9 What is (-10)/(-4)(-12)/(-15)1? 2 22/(-4) + (-10 - -14) -3/2 What is the value of (-4)/(-15) + (-2 - 8/(-6))? -2/5 Evaluate -182(-6)/72. 3 What is the value of (45/11 - 3)/(60/330)? 6 Calculate (-6 + -4)/(-2)8/10. 4 Evaluate 6/75(-4 + 14). 4/5 Calculate 28/330/40. 7 (-85)/(-20) - (-12)/16 5 What is the value of 4/(-6) - ((-14 - -12) + 4)? -8/3 (-3 - 80/(-14)) + 63/(-21) -2/7 What is (-7(-3)/(-6))/(25/(-50))? 7 What is (-78)/13 - (-2 - 0)? -4 13/5 - 2 - 1 -2/5 What is -45(6/(-3) - 45/(-25))? 9 Evaluate (-2)/4 - (-35)/14 - 1. 1 What is (-6)/(-24) - (-1)/(-2)? -1/4 Evaluate ((-4)/(-1) - 7) + -2. -5 ((-4)/(-9))/(140/(-42) + 4) 2/3 Evaluate (-2)/12 + 35/(-294). -2/7 What is (-24)/(-168) + (-44)/14? -3 48/(-220) + 4/10 2/11 (-1788)/(-298) - (7 - (1 + 0)) 0 Evaluate (-1)/3 + (-6)/(-14). 2/21 What is the value of ((-2)/4-2)/(121/22)? 2/11 ((-46)/(-12))/232 1/3 Evaluate 4/1 + -6200/312. 2/13 Calculate 2 + (-78)/14 + (-56)/(-98). -3 What is 2(18/4 + -3 + -2)? -1 82/492 - 1(-46)/(-132) -2/11 Calculate (-1 + 8 - (-80)/(-12))-33. -11 (-8)/327/(-18) 4 -1(-5)/10(4 + 0) 2 ((-3)/6)/(68/340) -5/2 What is 27/(-6) + ((-2)/(-4))/1? -4 1(-12)/(600/10) -1/5 What is -12 + 6 + 2 - 50/(-14)? -3/7 Evaluate 15 - 9 - (4 - 2). 4 What is (-2)/(40/(-18)) + 6/(-15)? 1/2 Evaluate (12/(-45))/((-104)/117). 3/10 What is 4/654/(-36)? -1 What is the value of (-3)/6 + (-5 - 7/(-14))? -5 Calculate 1/(23/(-1035) + (-2)/(-9)). 5 What is the value of 20/(-24)(-16)/(-20)? -2/3 Calculate (60/(-75))/((-1)/5). 4 Calculate (-2)/40 + 9 + (-35)/4. 1/5 What is ((-16)/6)/4 + 342/(-54)? -7 -7 + -13(-1 - 24/(-26)) -6 Calculate (-5)/(-24)44/(-10). -1/3 Evaluate (1/2)/((-7)/(-112)8). 1 What is 1365/75 - (-2)/(-30)? 9 What	{ "pile_set_name": "DM Mathematics" }
et l(a) = a. Determine bl(t) - f(t). t - 1 Suppose 4y + 8 + 4 = 0. Let u(g) = 5g. Let t(z) = 4z + 1. Calculate yt(h) + 2u(h). -2h - 3 Let y(w) = 7w3 + w2 - 5w + 6. Let c(o) = -o3 - o - 1. Give 6c(r) + y(r). r3 + r2 - 11r Let q(d) = 4d3 - d2 + 2d. Let c be -5(1 + (-24)/15). Let j be -2 + (-13)/c. Let x(u) = -3u*3 - u. Let m = -5 + 3. Give jx(a) + mq(a). a3 + 2a2 - a Let v(n) be the third derivative of n4/24 - n3/6 + n2. Let d(u) = u*3 - 10u*2 - 11u + 2. Let f be d(11). Let q(r) = 10r - 11. Give fq(p) - 22v(p). -2p Let f(g) = 5g2 - 12g. Let b(w) = -9w2 + 23w. Determine -3b(o) - 5f(o). 2o2 - 9o Suppose 6y = -10 + 28. Let n(d) = -d2 + d + 1. Let x(k) = -k + 5. Let g be x(4). Let h(i) = -i3 + 3i*2 - 3i - 3. Give gh(l) + yn(l). -l*3 Let i(x) = -3x*3 + 3x*2 + 3x - 2. Let a(n) = 3n3 - 2n*2 - 2n + 1. Calculate 6a(h) + 4i(h). 6h3 - 2 Let n(f) = -f3 + f2 + 1. Let c(b) = 3b3 + b2 - 2b. What is c(w) + n(w)? 2w*3 + 2w*2 - 2w + 1 Let k(b) = -1 + 682b + b3 - 682b. Let i(f) = 6f3 - 1. Give -i(x) + k(x). -5x*3 Let f be 14((-15)/(-6) - 3). Let z(p) = p*3 + 8p*2 + 6p + 1. Let j be z(f). Let s(h) = -6h. Let m(g) = 4g. Determine jm(w) + 5s(w). 2w Let p(c) = 6c - 5. Let u(l) = -9l + 8. Let y be 4 + 2 + -2 + -1. Suppose f - yf + 10 = 0. Calculate fu(v) + 8p(v). 3v Let w(k) = 4k*2 + 8k - 3. Let q(r) = -r*2 - r + 1. Calculate -5q(x) - w(x). x*2 - 3x - 2 Let x(c) = 5c - 3. Suppose -3 + 9 = -2p, 0 = 2j - 2p + 12. Let d(y) be the third derivative of 11y4/24 - 7y*3/6 - 5y*2. Calculate jx(w) + 4d(w). -w - 1 Let o(l) = l3 - l2 + l. Let d(b) = 114b*3 - 95b*2 + 95b. Determine -d(y) + 95o(y). -19y*3 Let d(o) = -o + 1. Let i(u) = -22 - 24u + 17u + 31. Determine -18d(y) + 2i(y). 4y Let c(l) = -2l + 3. Let v(d) = -d2 - 8d + 13. Calculate 9c(a) - 2v(a). 2a2 - 2a + 1 Let v = -8 - -3. Let b = 25 + v. Let y be -1 + 2 + b/(-5). Let p(a) = 26a2. Let c(l) = 5l*2. What is yp(f) + 16c(f)? 2f*2 Let a(h) = -2h3 - h2 - 3h + 1. Let i(n) = 4n3 + n2 + 5n - 2. Suppose -3q = -5p, -2p = -q + 2 - 3. Determine pi(j) + 5a(j). 2j3 - 2j2 - 1 Let v(p) = -p2. Let m(j) = j3 - j2 - 5j. Give m(w) - v(w). w3 - 5w Let v(u) = u*2 - u - 1. Let r(k) = 13k*2 - 5k. Let x(b) = r(b) - 6v(b). Let p(t) = -8t*2 - t - 7. Give 6p(d) + 7x(d). d2 + d Let n(c) = -11c + 11. Let q(z) = -6z + 6. Let h(r) = r3 - 5r*2 + 2r + 3. Let k be h(3). Let g = -16 - k. Give gq(m) + 4n(m). -2m + 2 Let r be 1 + -1 + -11 + 6. Let x(p) = p + p - 4 + p2 + 3p. Let i(d) = -d*2 - 6d + 5. Give ri(z) - 6x(z). -z2 - 1 Let b(u) = u2 - 9u + 9. Let h be b(8). Let w(f) = f3 - f2 + f. Let i(y) = 2y*3 - 4y*2 + 4y. Calculate hi(m) - 4w(m). -2m3 Let q(y) = 7y*2 - 3. Let a(h) = 6h*2 - 2. Give 3a(b) - 2q(b). 4b2 Let i(s) = s2 + 2s + 2. Let w(m) = -m2 + 3m + 14. Let y be w(6). Let n(r) = 3r2 + 5r + 5. What is yn(f) + 10i(f)? -2f2 Let n(c) be the third derivative of c5/60 - c4/12 - c2. Let y(j) = -23 + 13 - 6j*2 + 11 + 8j + j*2. Let l = 8 + -6. Determine ly(v) + 9n(v). -v2 - 2v + 2 Let u(a) = 6a - 11. Let v(k) = k - 2. Let n(d) = -2u(d) + 11v(d). Let g(c) be the second derivative of c3/3 + c. What is 4g(f) + 7n(f)? f Let q(p) = 4p + 4. Let l = -22 + 16. Let c(r) = 9r + 9. Give lc(w) + 14q(w). 2w + 2 Let l(z) = -z - 1. Let b(w) = 2w3 + 12w*2 + 3w + 3. Calculate -b(x) - 3l(x). -2x*3 - 12x*2 Let u(g) = -5g*3 + 3g*2 + 3g. Let o(f) = 8f2 - 360f - 9f3 + 368f - 5f3. What is -3o(i) + 8u(i)? 2i*3 Let m(s) = -s - 18. Let w be m(-7). Let j(u) = -9u + 6. Suppose 4x - x - 15 = -5f, 2f + x - 7 = 0. Let c(o) = -17o + 11. Give fc(y) + wj(y). -3y Let f(h) = 14h2 - 6. Let k(d) = d2 - 7 + 5 + 5d2 - d2. Give 4f(r) - 11k(r). r2 - 2 Let u(w) = -w3 - w2 + w - 1. Let z(i) = 3i3 + i2 - i + 1. Give -6u(s) - 6z(s). -12s3 Let a(t) = -4t*3 - 4t*2 + 5t - 3. Let v(p) = -5p3 - 5p*2 + 4p - 3. Calculate 3a(o) - 2v(o). -2o3 - 2o*2 + 7o - 3 Let z(v) = -13v2 + 5v. Let k(i) = -14i2 + 6i. Determine -4k(m) + 5z(m). -9m2 + m Suppose 1 = -i + 4. Let n(d) = di - d + d2 + 0 - d3 - 2d3 - 1. Let x(b) = -b3 + b2 - b - 1. What is -n(s) + x(s)? s3 Let j(r) = 29r3 - 6r*2 + 6r. Let n(w) = 29w3 - 5w*2 + 5w. Calculate 5j(z) - 6n(z). -29z3 Let z(y) = -11y + 11. Let c(s) = -4s + 4. Let i(b) = -b + 25. Let r be i(8). Determine rc(j) - 6z(j). -2j + 2 Suppose 0 = 3v - 2h - 30 + 10, 0 = -4h + 8. Let p = v - 3. Let s(a) = 3a + 1. Let b(i) = 7i + 2. Give ps(k) - 2b(k). k + 1 Let p(v) = 4v*2 - 4v - 3. Let k(i) = -i*2 + i. Give 2k(b) + p(b). 2b2 - 2b - 3 Let t(q) be the first derivative of -7q2/2 - 4q + 7. Let v = 3 + -4. Let f(z) = z + 1. Determine vt(n) - 6f(n). n - 2 Let k(c) = 3c + 1. Let r(m) = -13m - 5. Let o(u) = 8u2 + u - 2. Let t be o(2). Suppose 0 = -g + t - 3. Suppose -7 = -4x + g. Determine xk(l) + 2r(l). l - 1 Let l(p) = -3p2 + 4. Let h(c) = c2 - 1. Suppose 1 - 5 = -s, -2s + 8 = -3a. Suppose u + 2 - 10 = a. Suppose 0 = -2d - u. What is dh(i) - l(i)? -i2 Let j(f) = 31f - 4. Let g(r) = -435r + 55. Calculate 4g(a) + 55j(a). -35a Let h(q) = 3q + 11. Let x(b) be the first derivative of -b2/2 - 5b - 13. What is -3h(p) - 7x(p)? -2p + 2 Let l(p) = -2p - 2. Let k(s) = -4s + 10s + 7 - 1. Suppose -5w + 4z = 6, 4w + 4z - z - 20 = 0. What is wk(q) + 7l(q)? -2q - 2 Let s be 0 - (-2 + -1) - 2. Let l(x) = -5x*3 - 2x2. Let z be l(s). Let p(o) = o3 + o + 7. Let r(h) = h*3 + h + 6. Calculate zr(t) + 6p(t). -t3 - t Let p(d) = d3 + 3d2 - d + 8. Let f(o) = o3 + 4o2 - 2o + 9. Determine -3f(u) + 4p(u). u*3 + 2u + 5 Let z(c) = c - 1. Let j(s) = -3s + 4. Suppose 0 = n - 5f - 2, n - 1 - 1 = -4f. Give nz(v) + j(v). -v + 2 Let r(u) = u*3 + 2u + 2 - 3u3 + 3u*3. Let z(c) = -3c*3 - 5c - 5. Suppose 8 = 3m - 4. What is mz(t) + 11r(t)? -t3 + 2t + 2 Let n(u) = 4u2 + 2u - 2. Let y(i) = -3i2 - i + 1. Give 2n(x) + 3y(x). -x2 + x - 1 Let u(d) = -13d - 15. Let k(q) = -q + 1. Let p(f) = -2k(f) - u(f). Let b(m) = 7m + 6. Determine 13b(g) - 6p(g). g Let i(m) = 11m3 + 2m*2 - 2. Let w(v) = 540v*3 + 99v*2 - 99. Calculate 99i(h) - 2w(h). 9h*3 Let k(t) = -5t2 + t3 - 4t2 - 3t - 4 + 11t2 + 1. Let i(c) = 3c*3 + 3c*2 - 7c - 7. Calculate -3i(j) + 7k(j). -2j3 + 5j*2 Let p(f) = -8f - 6. Let l(x) = -8x - 5. Calculate 4l(u) - 3p(u). -8u - 2 Let l(y) = y. Let a(n) = -n*2 + 7n + 2. Let i(c) = c - 2. Let t be i(6). Suppose 0 = -th - h. Let p be -1 + 0 + (h - 0). What is pa(u) + 6l(u)? u2 - u - 2 Let i(j) = -j - 1. Let b = 22 - 26. Let d(h) = -5h - 6. What is bi(u) + d(u)? -u - 2 Let j(k) = k. Let p = -3 - -1. Let c be ((-1)/(-1))/(p + 1). Let g(w) = -2w*2 + 5w - 1. Determine cg(n) + 5j(n). 2n2 + 1 Let q(o) = -o3 + o2 - o. Let r(f) = 8f*3 - 9f*2 + 9f. Let a be ((-132)/(-55))/(2/15). Calculate aq(b) + 2r(b). -2b3 Let c(r) = 5r - 2. Let s(l) = 377 - 20l - 366 - 6l. Give 11c(q) + 2s(q). 3q Let h(y) = 8y*3 + 6y*2 + 2y. Let c(j) = -15j3 - 11j*2 - 3j. Determine 4c(d) + 7h(d). -4d3 - 2d*2 + 2d Let s(p) = -5p3 + 3p*2 - 6p + 3. Let a(j) = 6j3 - 4j*2 + 7j - 4. What is 3a(w) + 4s(w)? -2w3 - 3w Let z(q) = -143q - 44. Let i(w) = -16w - 5. Determine -44i(b) + 5z(b). -11b Suppose 0 = -5l + 4 + 21. Let t(j) = j. Let f(g) = -7g - 1. Calculate lt(i) + f(i). -2i - 1 Let b = -131 + 132. Let d(f) = 12f*2 + 12f. Let c(s) = s*2 + s. Give bd(p) - 15c(p). -3p*2 - 3p Let a(z) = -z*3 - 4z*2 - 4z - 4. Let b(l) be the third derivative of 3l6/40 + 11l*5/20 + 11l*4/8 + 11l*3/2 + 11l*2. Determine -33a(g) - 4b(g). -3g3 Let k(z) = -z2 + z + 1. Let r(m) = -11m2 + 2m + 2. Determine 2k(l) - r(l). 9l*2 Suppose 5o + 15 = 2g, 0 = -2g + o - 1 - 4. Let b(h) = 2h2 - 3 + 2 - 4h*2 - 5h*2 - 7h. Let q(u) = -u*2 - u. What is gq(s) + b(s)? -2s2 - 2s - 1 Let n(j) = -j.	{ "pile_set_name": "DM Mathematics" }
- -0.4273. What is s rounded to 3 decimal places? -0.022 Let a = 79.42671 - 0.15671. What is a rounded to zero decimal places? 79 Let l = 136.5 - 26.5. Let b = 75.6 - l. What is b rounded to the nearest integer? -34 Let i(v) = v*3 + 13v*2 - 33v - 46. Let d be i(-15). Let q be (d + (-9)/(-6))/(8/833600). Round q to the nearest 1000. 52000 Let m = 0.3296 + -0.4713. Let q = m - -0.0185. What is q rounded to two decimal places? -0.12 Let c = -26.398 - -26.39815523. What is c rounded to 5 decimal places? 0.00016 Let o = 0.98402 + -1.1903. Round o to one decimal place. -0.2 Let x = 570 + -293. Let y = -278.29 + x. What is y rounded to 1 decimal place? -1.3 Let z = -58.65 + 56. Let q = -2.64999929 - z. Round q to six decimal places. 0.000001 Let s = -20.1641 - 1.5569. What is s rounded to the nearest integer? -22 Let g = 0.017317 + -0.046358. Round g to 3 decimal places. -0.029 Let q = -103 - -46. Let h = -241428 - -241371.000175. Let x = h - q. What is x rounded to 5 decimal places? 0.00018 Let m = 79572.999966963 + -79573. Round m to seven decimal places. -0.000033 Suppose 4s + 3375 = s. Let d be s/(-6)158592/(-9). Round d to the nearest 100000. -3300000 Let g = 1066.1354 + -0.1354. Let q = g + -1066.00773. Round q to 4 decimal places. -0.0077 Suppose -34y - 45 = -25y. Let l(u) = 68u2 + 9u - 3. Let p be l(y). Round p to the nearest one hundred. 1700 Let y = 74671197 + -74671227.674103. Let k = y + 29.3940997. Let r = 1.28 + k. Round r to six decimal places. -0.000003 Let o be (-36)/(-5)(-10)/(-4). Suppose 3c - 9x + 14x = 8, 3x = -4c + o. Let k be 6/(-9) + 5940004/c. Round k to the nearest 100000. 1000000 Let n = -0.19642 + 0.6189. What is n rounded to two dps? 0.42 Let n = 667 - 665. Suppose -ns + s + 401700 = 0. What is s rounded to the nearest ten thousand? 400000 Let l(w) = -75015w*2 - w + 172. Let b be l(12). Round b to the nearest one million. -11000000 Suppose 304 = z + 295. Let k(w) = -348w*2 - 39w - 1. Let n be k(z). Round n to the nearest one thousand. -29000 Let m = -13732 - -8635. Let i = 5104.398 + m. Let d = i - 8. Round d to two decimal places. -0.6 Let v = -144 + 83. Let b = v - -23. Let n = 37.932 + b. Round n to 3 dps. -0.068 Suppose -5z = 5k, 3z + 2k - 8 = k. Let y(c) = -207c2 + 6c - 22. Let m be y(z). What is m rounded to the nearest 1000? -3000 Let c = -419.6 - -420.0483. What is c rounded to 2 dps? 0.45 Let m = -69 - -69.076. Let z = m - 263.076. Let o = z - -261.41. Round o to 1 dp. -1.6 Let l be (-3835)/195 + 1/(-3). Let z be 557999996/l - ((-1)/5)/(-1). Round z to the nearest one million. -28000000 Let b = 15017.9993757 - 15018. What is b rounded to 4 dps? -0.0006 Let d = 0.459 + -0.459001309. Round d to 7 dps. -0.0000013 Let i = 644 - 299. Let m = -344.999763 + i. Round m to five decimal places. 0.00024 Let r = 944 + -944.00008378. Round r to 6 dps. -0.000084 Let o = 793867 - 793854.00017. Let r = 13 - o. Round r to three decimal places. 0 Let c = -0.4854 - -4.6844. Round c to 1 dp. 4.2 Let j = 16034 - 16034.00043494. Round j to six dps. -0.000435 Let r = 0.23898 + -0.336055. What is r rounded to three dps? -0.097 Suppose 76i - 96i - 292504 + 61804 = 0. What is i rounded to the nearest one hundred? -11500 Let l = -16603.010801 - -16603. What is l rounded to 4 decimal places? -0.0108 Let b be 1/(-3) - (-3)/(27/39). Suppose 0 = 5t + 3i - 103661 - 288375, bt - 313634 = -5i. Let a be 3 - (-4)/(-8)t. Round a to the nearest ten thousand. -40000 Let u(s) = 33458s + 848. Let q be u(-16). Round q to the nearest 10000. -530000 Suppose -5i = 17i - 4i. Suppose -g - 13 - 26 = i. Round g to the nearest integer. -39 Let f = 1991.0000002893 - 1991. What is f rounded to seven decimal places? 0.0000003 Suppose 4068485 = -4a + 3c - 5019472, 2a + 3c = -4543983. What is a rounded to the nearest 10000? -2270000 Let i = 121.0763 + -0.0763. Let t = i + -121.00851. Round t to three decimal places. -0.009 Let b = 1220.59234 - 0.71234. Let s = 1241 - b. Round s to 0 decimal places. 21 Let s = -65555319289903.000113 - -65555408082139. Let v = s - 88792139. Let i = v + -97. What is i rounded to four decimal places? -0.0001 Let h = 2.2285 - 2.02624. Let t = 0.204 - h. Round t to 3 dps. 0.002 Let p = 6 - 12. Let v(y) = -4y - 6. Let a be v(p). Let g(j) = -405555j - 10. Let w be g(a). What is w rounded to the nearest one million? -7000000 Let w = 36256 - 36252.2118. Let s = w - 0.0732. What is s rounded to one dp? 3.7 Let d = 19 + -94. Let j = 74.99998799 + d. What is j rounded to 6 dps? -0.000012 Suppose -14t + 912006 = -12t - 2o, 1367999 = 3t - o. Let r be t/8 + -25/(-40). Round r to the nearest one thousand. 57000 Suppose 331y = 345y + 322. Let g = -2345 + 558. Let r = g + y. Round r to the nearest 100. -1800 Let o = -0.0249 - 0.2181. Let d = o + 119.243. Let k = 119.00000006 - d. What is k rounded to 7 dps? 0.0000001 Suppose t - 94 - 26 = m, -3m = 3t - 372. Suppose 37466265 = tu - 117u. Let p = u + -12823253. Round p to the nearest one million. -5000000 Let l(r) = 46r3 - r - 9. Let h be l(-5). Let d = -9692 - h. Let o = d - -2738. What is o rounded to the nearest 100? -1200 Let a = -94.64 - -95.2393. Round a to two decimal places. 0.6 Let o = 19011 + -17040.1. What is o rounded to the nearest 100? 2000 Suppose -43966017 - 5011968 - 3291015 = 57u. What is u rounded to the nearest 100000? -900000 Let s = 83 - 50. Let t be ((-4)/(-6))/(2/s). Suppose 8v = tv - 2250000. Round v to the nearest 100000. 800000 Let s = -8005 - -8088.98. What is s rounded to 0 decimal places? 84 Let r = 3253 + -1169. Let f = r - 3003. Let b = f + 918.9427. Round b to 2 dps. -0.06 Let k(j) = j - 3. Let q be k(6). Suppose -5y + 4420 = -qd, -d + 5y = 25 + 1435. Let f be d/(1502/1500 - 1). What is f rounded to the nearest 100000? -1100000 Let b = -708.28 - 39.82. Round b to the nearest one hundred. -700 Suppose -5z + 47627 - 2916 = -3b, 5b = z - 74467. Round b to the nearest one thousand. -15000 Let s = 390890434.6346118298 + 310100.3653850702. Let a = 391200593 - s. Let r = a + -58. Round r to 6 dps. 0.000003 Let v(p) = -375379p + 53. Let z(h) = -h - 3. Let a(o) = -v(o) - 2z(o). Let y be a(-13). Round y to the nearest one hundred thousand. -4900000 Let u = 169240102 - 509839554. Let p = -340599106.999434 - u. Let o = p - 345. What is o rounded to four decimal places? 0.0006 Let y be 411(-632)/60 + (-84)/105. Round y to the nearest one hundred. -4300 Let a = -10147151.3 - -10147719.29163. Let n = a - 568. What is n rounded to 2 decimal places? -0.01 Let l = 522.46 + 2.34. What is l rounded to the nearest ten? 520 Let s = 0.038 + 0.042. Let x = 0.064 + s. Let k = -0.14463 + x. What is k rounded to four dps? -0.0006 Let r be (-52646987 - 1)/(-1) + -4 + 16. What is r rounded to the nearest 1000000? 53000000 Let b = -18.6667 + 2.5737. Let h = b + 0.093. Let i = h - -15.2. Round i to zero dps. -1 Let s(k) be the second derivative of -k3/3 + 23k*2/2 + 9k. Let r be s(11). Let i be 2(4r - (-3 + 5)). Round i to the nearest 10. 0 Let t = -0.7814 + -7.6416. Round t to zero dps. -8 Let u = 2569106938 - 2569106968.00000421. Let h = u - -30. Round h to 6 dps. -0.000004 Let b = 168578841.123485719 + -168578841. Let j = -0.12348 + b. Round j to seven dps. 0.0000057 Let u = -1371 - -1397.08. Let c = -23.561 + u. Let d = 2.35 - c. Round d to 2 decimal places. -0.17 Let q = 9221.2966984458 + 0.0653215542. Let k = -9087.3620094 + q. Let m = -134 + k. Round m to six dps. 0.000011 Suppose 0 = 28a - 31a - 74681979. Suppose 17d - 14593993 = 18d. Let o = a - d. Round o to the nearest 1000000. -10000000 Suppose 0m + 3 = -m. Let a(c) = -3c*3 + 31c - 30. Let p be a(1). Let t be (p - -1 - m) + 884992. What is t rounded to the nearest 10000? 180000 Let l = -4 - -9. Suppose -116u + 2 = -114u, -800002 = -lr - 2*u. What is r rounded to the nearest 100000? 200000 Let c = -6.1 + -4.888. Let i = -11.1 - c. What is i rounded to 1 dp? -0.1 Let k = 9.82 - 9.8200039195. What is k rounded to seven decimal places? -0.0000039 Let k = 32.61 - -3448.49. Let f = k + -3481.1240273. Let r = f - -0.024. What is r rounded to five dps? -0.00003 Let a = -804 - -574. Let i = a - -158.5. What is i rounded to the nearest ten? -70 Let z =	{ "pile_set_name": "DM Mathematics" }
etermine c(-4). 21 Let w(q) = -39q + 7q*2 - 4 + 82q - 2q3 - 23q - 11q. Calculate w(-3). 86 Let z = 361 - 356. Suppose q + 1 = -4s, -4s = -6q + 11q + z. Let j(l) = 0l + l - 2 - 4 - l*2. Determine j(s). -6 Let u be 80/(-28)21/(-6). Let y(i) = -6i + 6i - 7i + 7 + ui2 - i3 - 4i2. Suppose -w + 3d = -0w - 5, 2w - 10 = 5d. Calculate y(w). -3 Let a be 120/10051. Let i be 8/3(-9)/a. Let j(h) = -2h + 6 - 25 + 8 + 10. Give j(i). 7 Let w(n) = n2 + 2n + 2. Let s = 209 - 133. Suppose -35p = -16p - s. Calculate w(p). 26 Let q = -7 - -9. Let v = 368 - 357. Let l(c) = -c*q - vc - 15c + 18c. What is l(-8)? 0 Let l(h) be the second derivative of h*3/2 + 7h*2/2 + 797h. Give l(-5). -8 Suppose -29k - 238 = 11k - 57k. Let j(b) = -b2 + 14b + 4. Give j(k). 4 Let p be -8 + 40/10(5 - 2). Let l(d) = -6d*3 + 6d*2 - 4d + 10. Let s(j) = j*3 - 1. Let v(g) = -l(g) - 5s(g). Calculate v(p). -21 Let z(q) = -4q - 4. Let x(l) = -3l*2 + 5l + 25 - 36 + 8 + l*3. Let o be x(2). Calculate z(o). -16 Suppose 5d - 5t = -t - 12, -d + 2t = 0. Let r(a) = -a*3 - 4a*2 - 6a - 26. What is r(d)? -2 Let t(k) = k*3 + 11k*2 - 27k - 8. Let g be t(-13). Let o(b) = -b + 0b - 254b*3 - g - 256b*3 + 509b3. Calculate o(0). -5 Let g(o) = -o3 + o*2 + 7o + 3. Let t be (10/3)/(18 + (-1133)/66). Give g(t). -17 Let x(u) be the third derivative of -u6/120 - u5/20 + u4/4 + u3/3 + 2u2. Suppose 0 = 308t - 313t + 2w - 10, -t + 21 = -5w. Calculate x(t). -6 Let d(m) = m3 - 37m*2 - 41m + 118. Suppose -200 = -5n + 2f, -5n - 2f + 166 = -14. Give d(n). 4 Let x(o) = -4o + 1. Let l(w) = 5w*2 + 155w + 540. Let j be l(-27). Determine x(j). 1 Let v(f) = 4f + 4. Let s(g) = -5g - 3. Let p(u) = -3s(u) - 2v(u). Let z = -377 + 589. Let r = 213 - z. Calculate p(r). 8 Let p(c) be the first derivative of 11c2/2 + 2c + 85. Suppose 0 = -178y + 171y + 14. Calculate p(y). 24 Suppose 38k - 3967 = -269k + 2173. Let j(n) = -4n + 57. Determine j(k). -23 Let q(s) = -11 + 81 - 147 + 75 + s. Let v be (2/1 - 1)/1. Let f = v - 8. Calculate q(f). -9 Let p(h) be the first derivative of h3/3 - 6h*2 - 3h + 1731. Calculate p(14). 25 Let c(h) = 2h2 - 128 + 129 + h3 + h2 - 6h. Let n(y) = 0y2 - 2y*3 + 4y + 8y - 2 - 5y*2. Let p(u) = -7c(u) - 3n(u). What is p(-7)? 6 Let h(i) = 5i + 7i - 193 - 3i - 4i + 204. Determine h(-7). -24 Let r(g) = 2g*2 + 38g + 119. Let s be r(-15). Let q be (-2 - s)/((9 - 1)/8). Let p(z) = 5z. Let i(h) = 9h. Let y(b) = 4i(b) - 9p(b). Determine y(q). 9 Let b(t) = -10t + 40. Let y(g) = 3g - 14. Let f(o) = -2b(o) - 7y(o). Determine f(-8). 26 Let p be 81/729 + 2/(-18). Let v(q) be the third derivative of -17q2 + 0 + 1/12q*4 - 2/3q*3 + pq. Give v(6). 8 Let b be (-14 + 4 - -18) + -22. Let p(s) = -s*2 - 19s - 36. Determine p(b). 34 Let m(q) = -3q + 9q - 6q2 + 4q2 - 10 + q2 - 2q. Let p(z) = 12z*2 - 29 + 7z - 14z2 + 8. Let t(a) = 5m(a) - 3p(a). Give t(0). 13 Let w(k) be the second derivative of -3k4/4 + k3/3 + k*2/2 + 61k - 13. Let s(h) = -12h + 34. Let l be s(3). What is w(l)? -39 Suppose -4m - 1548 + 1528 = 0. Let v(w) = -w*3 - 5w*2 + 3w. Give v(m). -15 Let r be 4/(-30)-35. Let a(l) = -r + 4 + 0l + 1 + 2l. Let x = -49 + 47. Calculate a(x). -1 Suppose 6 = -98j + 104j. Let w(g) = g*2 - 33g + 31. Let f be w(j). Let h(d) = 7d3 - 2d - 1. Calculate h(f). -6 Let b(p) = 4p2 + 32p + 2. Let t be b(9). Let n = t - 611. Let u(l) = -3l + 3. Calculate u(n). -6 Let s(j) = 26j + 41 - 21 + 38 - 11j - 21j. Determine s(8). 10 Let s(w) = -48w + 499. Let k be s(10). Let i(a) be the first derivative of 3a + k + 1/4a4 - a3 - 5/2a*2. Calculate i(4). -1 Let u(z) be the first derivative of 1/20z5 + z2 + 24z - 1/3z*3 + 9 - 1/4z*4. Let i(m) be the first derivative of u(m). Determine i(3). -4 Suppose 7n = 2n - 5, 5g - 2n = -58. Let d(a) be the first derivative of a2/2 + 883. Determine d(g). -12 Let w(k) = -k3 - 4k*2 - 3k - 6. Let f be (-765)/(-306)(96/15)/(-4). What is w(f)? 6 Let n = 4 + -5. Let h(b) = -12b - 5. Let c(y) = 90y + 15. Let d(j) = -43j - 8. Let u(s) = 4c(s) + 9d(s). Let x(l) = -5h(l) + 2u(l). Give x(n). -5 Let j(r) = -r*3 - 4r*2 + 21r + 88. Let l(m) = -m*2 + 187m - 736. Let p be l(4). Calculate j(p). 4 Let z(r) = 5r - r2 + 3 - 13 - 2r + 7. Let g(a) = -2a2 + 5a - 7. Let h(t) = 2g(t) - 5z(t). Give h(6). 7 Let g(j) = 3233 + 2j + 2090 - 5279. Suppose 4a + 52 = -2d, 0 = 4d + 3a - 57 + 151. Give g(d). 0 Let u(f) be the first derivative of -1/2f*2 - 6f - 10. Suppose -m + 2q = 4m + 45, 4q - 27 = 3m. What is u(m)? 3 Let a(n) = -5n + 2. Suppose 5o + f + 8 = 103, 0 = 4f. Let x = -31771 - -31754. Let v = o + x. What is a(v)? -8 Let o(n) = -19n - 5 - 13n + 3 - 6n*2 - 22n*3 + 42n*3 - 21n*3 + 29n. Let x = 1 - 1. Suppose 0 = -w, x = 5u - 2w + w + 20. What is o(u)? -22 Let t(h) be the third derivative of 5h4/24 - 5h*3/6 - 78h*2 - 35. What is t(-13)? -70 Suppose 0 = 5r - 4i - 71, -5i - 56 + 47 = r. Let x(n) be the second derivative of rn + 1/20n*5 + 5/12n*4 + 2/3n3 + 0 + n2. Give x(-3). 8 Let a = 103 + -92. Let j(w) = -11w3 - 10w*2 - 6w + 21. Let c(z) = -9z3 - 10z*2 - 7z + 20. Let k(y) = 6c(y) - 5j(y). Calculate k(a). 4 Let p(u) = 4u - 28. Suppose 0 = -109t + 121t. Calculate p(t). -28 Let r(a) = -2a*2 + 31a + 115. Let m be -1(17 - 11)/2. Give r(m). 4 Let c(x) be the first derivative of 4x + 3x2 + 5/3x*3 + 1 + 1/4x4. Let g(l) = l3 + 6l2 + 7l + 5. Let u(r) = 4c(r) - 3g(r). Calculate u(-2). -5 Let q(d) = -5d3 - d2 + d + 1. Let t(u) = -27u*3 + 17u + 12. Let i(p) = -5q(p) + t(p). Calculate i(-1). 2 Let w(g) = 28g + 474. Let p be w(-17). Let y(j) be the first derivative of j4/6 + j3/6 + j + 2. Let s(o) be the first derivative of y(o). Determine s(p). 6 Suppose 37x - 2156 + 898 = 0. Let l(n) = -n2 + 39n - 170. What is l(x)? 0 Let s(y) be the first derivative of 4y3/3 - 3y*2 + 8y - 15. Let j(a) = 17a2 - 24a + 33. Let u(p) = -2j(p) + 9s(p). Give u(4). 14 Let s(v) be the first derivative of -v*2/2 + 2v + 45. Let u(y) = 7y - 11. Let r(m) = -6s(m) - u(m). Let j = -1 + 0. What is r(j)? 0 Suppose 0 = -i + 4g + 10, -6g + 10g + 16 = -2i. Let l be (-196)/(-42) - i/(-3). Let u(v) = -v*3 + 3v*2 + 4v - 4. Determine u(l). -4 Let o(u) = u*3 + 7u*2 - 10u - 6. Let g = -86 - -175. Suppose -2z + 73 = g. Give o(z). 10 Let y(u) = u2 - 115 + 450 - u - 111 - 116 - 120. Let l(z) = z2 + 2z + 1. Let t be l(-1). What is y(t)? -12 Let z(a) = a*3 + 14a*2 + 13a + 4. Suppose -51c = -79c - 364. Calculate z(c). 4 Suppose -a = -0l + 5l - 43, -a = 2l - 19. Let i(m) be the third derivative of m4/24 + m3/6 + m2. Determine i(l). 9 Let g(d) = d2 + 4d + 3. Let z(w) = 6w2 + 10w + 3. Let h be z(-2). Suppose q + hq = q. Suppose q = -5v - 7 - 13. What is g(v)? 3 Let p(y) be the second derivative of y3 + y2/2 + 12y. Let o = 5 - 3. Suppose -5f + 2f - 2s + 13 = 0, -3f + s - o = 0. Determine p(f). 7 Let k(u) = -u - 9. Let p be ((-65)/4 - -2) + 9/(-12). Let o be k(p). Let w(g) = g + 1. What is w(o)? 7 Let u(t) = -t. Suppose 2205 + 7975 = 10f. Let y(d) = -9 - d*3 + 0d*3 + 1002d - 9d2 - fd. Let h be y(-7). What is u(h)? -5 Suppose 35d = 23d + 60. Suppose 2r + di = 25, -2r + 5 = 2r - 5i. Let l(g) = 2g - 10. What is l(r)? 0 Let h(l) = -3l2 + 5l + 2. Let z be h(2). Suppose z = -8j - 101 + 69. Let k(c) = -c3 - 6c*2 - 5c + 1. Give k(j). -11 Let u(x) = -4x + 2. Let h(l) = -29l + 34. Let c(j) = 2h(j) - 14u(j). Determine c(22). -4 Let j = 2 - 2. Let i(a) = a*2 - 11a + 24. Let o be i(9). Let p(x) = 1 - 1 - o - x*3 + 1. Give p(j). -5 Let k(x) = -6 - 14199x*3 + 28402x*3 + 4x + x*2 - 14202x*3. Give k(2). 14 Suppose j + 2o = 2j - 14, -6 = -3j - 3o. Suppose b + 4 = j. Let d(k) = 0k + 3k + 2k*2 - 3k*2 - 17 + 16. Calculate d(b). 1 Suppose -4o = -3g - 20, -3g - g = -5o + 25. Suppose -v - m - 14 = -5m, m + 7 = -ov. Let n(k) = k + 1. Give n(v). -1 Let h(x) = -6 - 453x + 472x - 28 - 7. What is h(6)? 73 Let z(t) = 5t + 39. Let h(j) = 429	{ "pile_set_name": "DM Mathematics" }
t term in -169, -170, -171, -172, -173, -174? -175 What is next in 38, 39, 40? 41 What is next in 28, 46, 58, 64, 64, 58, 46? 28 What is next in 443, 444, 445, 446? 447 What comes next: 92, 95, 98, 101, 104, 107? 110 What is the next term in -5366, -5367, -5368, -5369? -5370 What is the next term in 286, 515, 744, 973, 1202? 1431 What is next in 80, 126, 172, 218, 264, 310? 356 What comes next: -774, -775, -776? -777 What is next in -4172, -4173, -4174, -4175? -4176 What is the next term in -631, -629, -627, -625, -623? -621 What is next in 53, 110, 167, 224, 281, 338? 395 What comes next: -154, -168, -170, -154, -114, -44? 62 What is next in -74, -82, -90, -98? -106 What is next in -1680, -1679, -1678? -1677 What is the next term in 2003, 8036, 18085, 32144, 50207, 72268, 98321? 128360 What is the next term in -142, -270, -396, -520, -642? -762 What is the next term in -126, -134, -144, -156, -170? -186 What comes next: 3, 31, 77, 141? 223 What is the next term in 40, 48, 62, 82? 108 What is the next term in 2, 5, 12, 23, 38, 57? 80 What comes next: 130, 237, 344, 451, 558? 665 What is the next term in -33, -242, -803, -1890, -3677? -6338 What is the next term in -17720, -17709, -17686, -17645, -17580, -17485, -17354, -17181? -16960 What comes next: -15, -30, -63, -120, -207, -330, -495, -708? -975 What is next in -163, -165, -167, -169? -171 What is the next term in 73, 317, 727, 1303? 2045 What is the next term in 106, 87, 44, -35, -162, -349, -608? -951 What is the next term in 14, 5, -4, -13, -22, -31? -40 What is next in 7, -6, -19, -32? -45 What comes next: -35, -85, -149, -233, -343, -485, -665, -889? -1163 What comes next: -160, -254, -348, -442, -536? -630 What is the next term in -7, -6, -1, 8? 21 What is the next term in -142, -175, -230, -307, -406, -527, -670? -835 What is next in -9, -33, -77, -141, -225? -329 What is next in 1230, 2457, 3684, 4911, 6138, 7365? 8592 What is next in -18, -21, -14, 3? 30 What is the next term in -68, -64, -58, -50, -40, -28? -14 What is the next term in 2, -12, -32, -52, -66? -68 What is next in 1, 19, 41, 67, 97, 131? 169 What is next in 111, 100, 89, 78? 67 What is next in 171, 169, 165, 159? 151 What is the next term in 152, 307, 462, 617, 772? 927 What is next in -660, -659, -658, -657, -656, -655? -654 What is the next term in -1064, -2132, -3202, -4274, -5348, -6424, -7502? -8582 What is next in 103, 116, 129, 142, 155? 168 What comes next: 0, 10, 40, 102, 208, 370, 600, 910? 1312 What is next in 9, 0, -11, -24, -39, -56, -75? -96 What comes next: -17, -42, -53, -44, -9, 58, 163? 312 What comes next: 8702, 8699, 8696, 8693, 8690, 8687? 8684 What is next in 386, 1532, 3442, 6116? 9554 What is next in 88, 160, 236, 316, 400, 488? 580 What is next in -306, -599, -892, -1185, -1478, -1771? -2064 What is next in -18, -45, -98, -183, -306, -473, -690? -963 What is the next term in -227, -447, -671, -899, -1131, -1367? -1607 What is the next term in 6, -6, -4, 18, 66, 146? 264 What comes next: 253, 1014, 2281, 4054, 6333, 9118, 12409? 16206 What comes next: -10, -39, -110, -241, -450, -755, -1174? -1725 What is the next term in -865, -1733, -2603, -3475, -4349, -5225? -6103 What is the next term in -41, -37, -31, -23, -13, -1? 13 What is the next term in -309, -314, -319, -324, -329, -334? -339 What comes next: -253, -249, -245, -241, -237, -233? -229 What is the next term in -2340, -2342, -2344, -2346, -2348? -2350 What is the next term in -131, -1022, -3447, -8174, -15971? -27606 What is next in -240, -239, -238, -237? -236 What is next in -230, -230, -228, -224? -218 What comes next: 216, 431, 646, 861, 1076, 1291? 1506 What comes next: 318, 324, 330, 336? 342 What comes next: 337, 335, 333, 331, 329? 327 What comes next: 83, 135, 201, 287, 399, 543, 725, 951? 1227 What is the next term in -470, -472, -476, -482, -490, -500? -512 What comes next: -50, -100, -148, -194, -238, -280, -320? -358 What comes next: 19, 29, 33, 31, 23, 9? -11 What comes next: 22, 27, 20, -5, -54? -133 What is the next term in 24, -27, -120, -261, -456, -711, -1032, -1425? -1896 What is next in 18, 64, 148, 276, 454, 688, 984? 1348 What comes next: 560, 551, 542? 533 What is the next term in 1, -23, -63, -125, -215, -339, -503? -713 What is next in 51, 53, 55, 57, 59, 61? 63 What comes next: 40, 55, 80, 115, 160? 215 What is next in 4, 6, 10, 16, 24, 34? 46 What is next in -74, -140, -206? -272 What comes next: -185, -368, -537, -686, -809? -900 What is next in -72, -82, -96, -114? -136 What is the next term in 248, 491, 730, 965, 1196, 1423, 1646? 1865 What is the next term in -7, -2, 3, 8, 13, 18? 23 What is the next term in 671, 675, 679? 683 What comes next: -58, -110, -164, -220, -278? -338 What comes next: -89, -168, -235, -284, -309, -304? -263 What is next in -1, -18, -73, -184, -369? -646 What comes next: -128, -146, -166, -188? -212 What is the next term in 652, 646, 640, 634, 628, 622? 616 What comes next: -4268, -4267, -4266? -4265 What is next in -3488, -3493, -3500, -3509, -3520, -3533, -3548? -3565 What is next in -368, -366, -364? -362 What is the next term in 1360, 2716, 4072, 5428? 6784 What is next in 19, 22, 27, 34, 43? 54 What is next in 43, 25, -17, -95, -221? -407 What is the next term in 56, 127, 194, 257, 316, 371? 422 What is next in -16, -75, -230, -529, -1020, -1751? -2770 What comes next: -8, -23, -18, 19, 100, 237? 442 What comes next: 277, 279, 281, 283? 285 What is next in 441, 879, 1311, 1737, 2157, 2571, 2979? 3381 What is next in -64, -97, -180, -337, -592, -969? -1492 What comes next: -78, -103, -130, -159? -190 What comes next: -29, -47, -87, -155, -257, -399, -587, -827? -1125 What is the next term in -101, -99, -97? -95 What comes next: 325, 649, 963, 1261, 1537, 1785? 1999 What is the next term in 79, 132, 191, 256, 327? 404 What is the next term in 3, -5, -37, -105, -221, -397? -645 What comes next: 375, 751, 1127, 1503? 1879 What is the next term in 910, 884, 840, 778? 698 What comes next: 230, 197, 114, -43, -298, -675, -1198, -1891? -2778 What is next in -402, -399, -396? -393 What is next in 5, 36, 133, 332, 669, 1180, 1901? 2868 What is next in 563, 2247, 5053, 8981? 14031 What is next in -22, -76, -208, -454, -850, -1432, -2236? -3298 What is next in 13, 71, 167, 301, 473, 683? 931 What is next in 143, 293, 453, 623, 803, 993? 1193 What is the next term in -491, -504, -517? -530 What is the next term in -32, -12, 36, 106, 192? 288 What is the next term in 19, 15, 9, 1? -9 What is the next term in 1686, 1705, 1716, 1713, 1690, 1641? 1560 What is the next term in -51, -99, -147, -195, -243, -291? -339 What is the next term in 45, 207, 647, 1503, 2913? 5015 What is the next term in 364, 341, 306, 253, 176? 69 What is next in -4, -37, -98, -193, -328, -509? -742 What is the next term in -25, -32, -39, -46, -53, -60? -67 What comes next: -1, 11, 33, 71, 131? 219 What comes next: -396, -387, -366, -327, -264? -171 What is next in -9, -8, 3, 30, 79, 156, 267? 418 What is the next term in -510, -1008, -1494, -1962, -2406? -2820 What is next in 7, 20, 49, 100, 179, 292, 445, 644? 895 What is next in -53, -96, -157, -242, -357, -508, -701, -942? -1237 What comes next: -350, -353, -366, -395, -446, -525, -638, -791? -990 What is next in 43, 50, 57, 64, 71, 78? 85 What is next in -221, -188, -165, -158, -173? -216 What is the next term in -53, -67, -93, -137, -205, -303, -437? -613 What comes next: 79, 136, 195, 250, 295, 324? 331 What is the next term in -1309, -1314, -1325, -1342? -1365 What is the next term in -4, -39, -100, -199, -348, -559? -844 What is the next term in 6, 31, 78, 153, 262, 411, 606, 853? 1158 What is the next term in -59, -55, -47, -35, -19, 1? 25 What is next in -88, -192, -308, -442, -600, -788, -1012, -1278? -1592 What is next in 4, 25, 66, 133, 232, 369? 550 What comes next: 21, 19, 7, -21, -71? -149 What comes next: 10, -4, -34, -86, -166, -280? -434 What is the next term in -116, -208, -298, -386, -472, -556, -638? -718 What is the next term in 5, -16, -53, -106, -175, -260, -361? -478 What comes next: -358, -361, -366, -373? -382 What is next in -499, -494, -485, -472, -455? -434 What is next in -588, -586, -582, -576, -568, -558? -546 What comes next:	{ "pile_set_name": "DM Mathematics" }
1408 -42.377984 Work out -5911 0.3329. -1967.7719 Multiply -0.3 and -86322474. 25896742.2 Work out 0.192042 * -101. -19.396242 -163031 * 0.05396 -8797.15276 Product of 57808 and 1029. 59484432 -4.020.474 -1.90548 545269.553 146906.385 -9.404949 times 0.8 -7.5239592 What is the product of 2983472 and 120? 358016640 What is -2.2 times 2.01565? -4.43443 Product of 50 and -1590603. -79530150 14880576-0.5 -7440288 439 times -215.63 -94661.57 Product of -0.051 and 8183.75. -417.37125 -18593 -503 9352279 0.09 * -22631661 -2036849.49 Multiply 0.8577607 and -37. -31.7371459 What is 50575 times -3.913? -197899.975 What is -4 times -2.0493624? 8.1974496 Calculate -0.160148810.1. -1.61750288 What is the product of -267.9 and 30.754? -8238.9966 -0.2 times 15230121 -3046024.2 0.9 times -8753719 -7878347.1 Multiply -0.4437311 and -21. 9.3183531 Product of -45.8 and -4521. 207061.8 What is the product of 43.935 and 2.16? 94.8996 103080.235 30802.35 What is 17225.1 times 18? 310051.8 7094086 * 4.1 29085752.6 -1393.9 * 41792 -58253868.8 Multiply -0.51 and 24471. -12480.21 Product of 0.06 and -0.2321036. -0.013926216 Calculate -5036.4676. -3404606.4 What is the product of -0.2 and 21.7977? -4.35954 Product of -1.826098171 and 3. -5.478294513 What is -25511 times 0.1391? -3548.5801 Multiply -12737.9 and 1.92. -24456.768 What is the product of 15988477 and 3? 47965431 0 times 17897.83 0 Multiply -4029939 and -14. 56419146 1684.2310.03 50.52693 -246782 * 0.1737 -42866.0334 What is -177688 times -830? 147481040 What is -121 times -908557? 109935397 Product of 0.5 and 235407.54. 117703.77 What is the product of 0.19 and 788148? 149748.12 0.23401 times 606 141.81006 What is 23 times 625723? 14391629 -4.2-863863 3628224.6 -0.4 times 2509426 -1003770.4 Product of -0.041282 and 5854. -241.664828 74292.0106-3 -222876.0318 Product of -2608675 and -59. 153911825 17986.8410.5 8993.4205 Product of -5 and 2577.01594. -12885.0797 Calculate 2.43-18663. -45351.09 -171 * -130.09 22245.39 -65.72738 times -7 460.09166 What is 1928721 times -0.079? -152368.959 -154763538 times 0.5 -77381769 -6.7-0.20646 1.383282 What is the product of 5 and -42861.4? -214307 Multiply -2229682 and -3. 6689046 53720 times -1452 -78001440 What is 1 times -193792336? -193792336 What is -21 times -286572? 6018012 Multiply 1 and 193.88549. 193.88549 435.24-13 -5658.12 0.010896 * 167 1.819632 What is the product of 0.31 and -10558.97? -3273.2807 -9 times -266.35288 2397.17592 Multiply -58 and -806.17. 46757.86 Calculate -0.4-0.046124. 0.0184496 -37051739 -6442995 -9 times 0.16069607 -1.44626463 -0.1 * -76462153 7646215.3 -4 * -0.24502691 0.98010764 What is the product of -2566 and -71? 182186 What is -0.00034877 times -1? 0.00034877 Product of -1.8933 and -0.0423. 0.08008659 Multiply 3 and 296561.54. 889684.62 22894756230.5 1144737811.5 Multiply -4 and 452603.91. -1810415.64 What is 8777057 times 3.1? 27208876.7 381 -0.1211534 -46.1594454 -0.4 times 9.236804 -3.6947216 Multiply -739 and -2738. 2023382 Multiply -0.02337 and 33. -0.77121 -0.3 times -146892851 44067855.3 Multiply -236.159 and -11.3. 2668.5967 Calculate 139652330. 0 -96-18327 1759392 Product of -0.04 and -359.84306. 14.3937224 -104264 * -3016 314460224 What is 0.81 times -398158? -322507.98 6869 * 2.596 17831.924 Work out -119 * 3665996. -436253524 Calculate 69265190.5. 3463259.5 Calculate 62.56630.5. 31.28315 Calculate -8869.3432. -283818.88 Work out 0.12 -48818.44. -5858.2128 Calculate -0.6-96961.9. 58177.14 Multiply 86410.9 and -0.45. -38884.905 32 times 0.132571 4.242272 Calculate -2-858.0705. 1716.141 Work out -797671 * 0.07. -55836.97 -16 * 8733.9 -139742.4 What is 2863870.3 times 3? 8591610.9 Multiply -0.3 and -4740201. 1422060.3 -16-71480.8 1143692.8 Calculate -1-3462520. 3462520 Multiply -660375 and 18. -11886750 Product of 1748454432 and 5. 8742272160 Work out -43706 * 9.742. -425783.852 -2.45682350 -859.887 Work out 58 -111620. -6473960 Calculate 0.41423544. 225.34112 What is 22 times 726486? 15982692 Multiply 0.2 and 9323999. 1864799.8 Calculate -2-678.488. 1356.976 Work out -14930637 * -0.9. 13437573.3 What is -5005274 times 16? -80084384 0.161055 * -14 -2.25477 Multiply -1809 and 58266. -105403194 -5.407 times -0.17449 0.94346743 Product of -16299 and 571. -9306729 Product of -0.435 and -0.099513. 0.043288155 What is 41445 times -168? -6962760 Work out -68857 * 32.8. -2258509.6 Multiply 251.115 and 34. 8537.91 What is -0.13463 times 0.1199? -0.016142137 Work out -3 * -1.600893. 4.802679 What is the product of -12 and -1968576.7? 23622920.4 Multiply -0.092 and -3967958. 365052.136 1 times -10195615 -10195615 -278779994-0.1 27877999.4 42.19508-0.11 -4.6414588 -39.8884 times -202 8057.4568 Work out 48587 * 0.22. 10689.14 What is the product of -55898 and 4.74? -264956.52 Product of 410 and -516612. -211810920 What is -28 times -7633.483? 213737.524 -7840 times -45322 355324480 Calculate -1.71202-2507. 4292.03414 221634-1.034 -229169.556 Calculate -98-33.552. 3288.096 Multiply 277109 and -1.647. -456398.523 What is -2488.1 times 0.049? -121.9169 Work out -1.26 -131284. 165417.84 Work out 0.0712 * -1336267. -95142.2104 Multiply -28426624 and -0.4. 11370649.6 What is 358664 times -47? -16857208 Work out 3 * 99127197. 297381591 0 times -61373 0 Product of 24.654547 and 0.03. 0.73963641 9584976.3 4767295.4 12.494-92 -1149.448 Product of 52.42 and -25060. -1313645.2 Multiply -4972133 and 26. -129275458 What is the product of -175048616 and -0.1? 17504861.6 Work out 0.018 * 475. 8.55 Multiply -222 and 429995. -95458890 Product of -432 and 0.13626. -58.86432 Work out 5.46 * 34500. 188370 What is the product of 5 and 13423062? 67115310 What is -1.2735 times -2870? 3654.945 Multiply 0.597 and -339192. -202497.624 0.0483-10.0842 -0.48706686 -628 5139 -3227292 -1.263359-1.88 2.37511492 What is 202862 times 1.87? 379351.94 -3976231.5 -1252503 Work out -33636129 * 5. -168180645 -0.3-34.1587 10.24761 -70014 times 28 -1960392 What is -1.5 times -0.6261559? 0.93923385 19874079 -3 -59622237 -381.6198 times 4 -1526.4792 Multiply 1420608 and 11. 15626688 Product of 0.0607 and -1023.4. -62.12038 Work out 38515120 * 0.2. 7703024 Calculate -1873110.2583. -48382.4313 What is 7964221 times -3? -23892663 -50273 -602 30264346 Work out -0.6182 * 16041. -9916.5462 Multiply -391 and -832801. 325625191 Work out -0.19465 * 2.58. -0.502197 What is -0.5 times 231832.1? -115916.05 Calculate 0.034273639. 9303.726 What is the product of -1152520003 and 0? 0 What is 0.1 times 34745594? 3474559.4 0.096-2663900 -255734.4 Work out -1.9 * -3300032. 6270060.8 -99851.062 -10604.07 Product of 131166.9 and -36. -4722008.4 Multiply -0.4 and -3034579. 1213831.6 Work out -0.13453793 -0.4. 0.053815172 311 * 92420 28742620 What is the product of -2532.9 and 58? -146908.2 329.481 times 0.0829 27.3139749 14092.33 times 0.6 8455.398 Product of 0.4 and 10289395. 4115758 533091720.5 26654586 6.7 times -10800.3 -72362.01 2.493384 0.06 0.14960304 Product of -992 and 249.9. -247900.8 Work out -20741086 * -75. 1555581450 Product of -8191 and -2113. 17307583 What is the product of -554837 and -1.82? 1009803.34 What is the product of -143.844 and 0.74? -106.44456 Work out -277979 * 17. -4725643 658.716168 110664.288 Calculate 767652440.1. 7676524.4 63 times 233.8961 14735.4543 What is 0.2 times 391.73569? 78.347138 Multiply -13.5806243 and 4. -54.3224972 0.16371572 637157.2 1.5 -15.8338 -23.7507 Work out -0.03 * 5322258. -159667.74 Calculate -0.41.44944516. -0.579778064 What is the product of -895892 and 17? -15230164 Calculate -1240789-92. 114152588 Calculate -10.21-127836. 1305205.56 Work out -1628950 4. -6515800 0.11 times -384310.1 -42274.111 Multiply 1407 and 64103. 90192921 Calculate 1-3931634. -3931634 Work out -6.2 -916.52. 5682.424 Calculate 4150906-4. -16603624 Calculate -2.70.118037. -0.3186999 Multiply -10730021 and 7. -75110147 What is -855.23 times -23? 19670.29 -0.2361282 * -0.03 0.007083846 What is 10735483 times 0.08? 858838.64 Calculate -18531-698. 12934638 Product of 3.27 and -344668. -1127064.36 Multiply 47 and -459026. -21574222 -1389110 0.3 -416733 Work out 222849 * -0.0137. -3053.031	{ "pile_set_name": "DM Mathematics" }
33h + 300. Determine t(-7). 20 Let c(a) = -a3 + a - 191. What is c(0)? -191 Let p(w) = -52w - 204. Give p(-4). 4 Let q(t) = -44t + 155. Calculate q(5). -65 Let u(k) = k2 - 62k - 382. Give u(65). -187 Let k(r) = 2r2 - 105r + 493. Give k(48). 61 Let z(h) = 2h + 33. Give z(13). 59 Let c(m) = -14m + 137. Give c(10). -3 Let u(d) = d*3 - 5d*2 - 46d + 223. Give u(7). -1 Let c(t) = 8t2 - 178t + 699. Calculate c(4). 115 Let x(n) = -2n2 - 66n - 96. Give x(-31). 28 Let z(a) = -88a2 - 209a - 208. Calculate z(-1). -87 Let b(y) = y*3 + 33y*2 - 984y - 47. What is b(19)? 29 Let q(k) = -390k + 7028. What is q(18)? 8 Let s(g) = 2g*3 - 40g*2 - 523g + 12. Determine s(29). -17 Let n(h) = 2h3 - 16h*2 - 165h + 1322. Calculate n(8). 2 Let m(a) = -19a - 374. Calculate m(-37). 329 Let y(i) = -290i*2 - 3771i - 16. What is y(-13)? -3 Let u(c) = -4c3 + 255c*2 + 60c + 18. Give u(64). -238 Let b(a) = -a*3 + 106a*2 + 353a - 2834. Calculate b(109). 0 Let i(b) = 21b2 + 310b - 53. Give i(-15). 22 Let r(a) = -44a - 447. What is r(-10)? -7 Let z(b) = b2 + 25b - 490. Calculate z(-31). -304 Let f(n) = -4n2 - 359n + 1288. Determine f(-93). 79 Let l(r) = 176r + 3201. Calculate l(-18). 33 Let u(t) = -2t + 20. What is u(-44)? 108 Let k(m) = -60m - 2216. What is k(-35)? -116 Let q(x) = 62x + 696. Give q(-11). 14 Let p(b) = 2b3 - 200b*2 - 161b - 4121. Determine p(101). 20 Let z(m) = -59m - 6225. Calculate z(-107). 88 Let v(b) = -2b*3 - 30b*2 - 5b - 73. Give v(-15). 2 Let w(s) = -23s2 - 157s + 28. What is w(-7)? 0 Let g(k) = -27k2 + 5k + 5. Calculate g(-2). -113 Let b(l) = -3l2 + 3294l + 13220. Give b(-4). -4 Let c(p) = 4p3 + 116p*2 + 54p + 1560. Calculate c(-29). -6 Let u(c) = c*2 - 41c + 466. Give u(17). 58 Let k(z) = 2376z + 11845. Determine k(-5). -35 Let s(j) = -7j*2 - 59j + 65. Give s(-12). -235 Let u(l) = -l*3 - 17l*2 - 16l + 8. What is u(-9)? -496 Let o(q) = q*2 - 63q + 202. Give o(59). -34 Let d(v) = 4405v - 17616. What is d(4)? 4 Let b(a) = 34a - 1349. Calculate b(39). -23 Let h(o) = o*3 + 24o*2 + 18o - 93. Give h(-23). 22 Let x(j) = -j*3 - 6j*2 + 6j + 31. Calculate x(-8). 111 Let d(a) = -a*3 + 11a*2 - 3a - 27. Calculate d(11). -60 Let q(d) = 3d2 - d - 184. Calculate q(0). -184 Let k(g) = -g3 - 19g*2 + 20g + 5. What is k(-20)? 5 Let z(m) = -m*3 - 53m*2 + 292m + 207. What is z(-58)? 91 Let q(w) = -16w2 + 462w + 51. Give q(29). -7 Let s(a) = 1070a - 31041. Calculate s(29). -11 Let q(d) = -36d*2 - 362d - 16. Give q(-10). 4 Let x(r) = -967r + 15483. What is x(16)? 11 Let d(b) = -2b*3 - 22b*2 + 13b - 36. Calculate d(-12). 96 Let o(p) = p*2 + 62p + 77. Give o(0). 77 Let t(k) = 31k + 44. Determine t(-1). 13 Let a(d) = -7d*2 + 5d + 37. Calculate a(-4). -95 Let f(z) = 2z2 - 75z - 3856. Give f(-29). 1 Let z(o) = -39o - 93. What is z(-2)? -15 Let c(q) = q3 - 24q*2 + 23q - 46. Determine c(23). -46 Let j(m) = 96m - 7302. Determine j(76). -6 Let r(w) = -w3 + 163w*2 - 209w + 7618. Calculate r(162). 4 Let r(h) = -3006h + 5958. Calculate r(2). -54 Let u(p) = 2p*3 - 26p*2 + 2p - 10. Determine u(13). 16 Let c(d) = -951d - 5710. Calculate c(-6). -4 Let j(m) = m3 + 34m*2 + 168m - 3. What is j(-28)? -3 Let i(a) = 2a2 - 98a - 509. Determine i(-5). 31 Let m(a) = -11a2 + 10. Give m(2). -34 Let c(b) = -b3 - 14b*2 + b + 11. Calculate c(-10). -399 Let l(g) = 9g*3 + 3g*2 - 25g - 68. Determine l(-3). -209 Let i(d) = 188d2 - 187d + 3. Determine i(1). 4 Let p(t) = -36t + 821. What is p(23)? -7 Let u(x) = x3 - 27x*2 + 79x - 164. Give u(24). 4 Let y(i) = i*3 - 6i*2 - 28i + 115. Give y(8). 19 Let s(n) = -45n + 276. What is s(6)? 6 Let s(m) = -m - 100. Give s(7). -107 Let k(p) = 7p*2 - 89p + 256. Determine k(8). -8 Let l(q) = -4506q - 252337. Calculate l(-56). -1 Let f(l) = -86l + 854. Give f(9). 80 Let d(n) = -n*3 - 19n*2 - 24n - 97. Give d(-18). 11 Let f(m) = 3m2 + 10m - 19. Give f(0). -19 Let r(k) = 3k2 + 243k - 3033. Give r(-92). 3 Let a(v) = -25v2 + 3v - 14. Give a(3). -230 Let u(b) = 5b3 - 2b*2 + 24b + 36. Determine u(-5). -759 Let u(s) = s*2 - 36s + 108. Determine u(32). -20 Let u(a) = -11a2 + 83a + 7. Give u(7). 49 Let f(k) = -53k2 + 583k - 19. Give f(11). -19 Let h(l) = 3l2 - 167l - 759. Calculate h(60). 21 Let u(r) = 4r3 - 115r*2 - 54r + 835. Calculate u(29). 110 Let q(l) = -l*3 - 507l*2 - 3011l - 1. Calculate q(-6). 29 Let d(f) = 5f3 - 2f*2 + 2f - 3. Calculate d(4). 293 Let x(p) = -p*2 - 144p - 4966. Give x(-89). -71 Let u(f) = -236f + 211. Determine u(1). -25 Let s(p) = -9p + 147. Calculate s(20). -33 Let p(q) = -259q + 382. Calculate p(1). 123 Let k(w) = -2w*3 + 55w*2 - 29w - 90. What is k(27)? -144 Let f(g) = -g*3 + 3g - 171. What is f(0)? -171 Let y(t) = t*2 - 30t - 52. Give y(28). -108 Let n(d) = -53d + 3956. Calculate n(73). 87 Let z(y) = y3 - 40y*2 - 139y + 415. Calculate z(43). -15 Let k(y) = -3y2 + 19y - 18. Calculate k(12). -222 Let j(q) = -2q2 - 6q - 189. Calculate j(-9). -297 Let w(s) = 3s3 + 30s*2 + 21s - 49. Calculate w(-9). 5 Let m(y) = y*3 - 8y*2 - 38y + 263. Calculate m(10). 83 Let v(m) = 2m - 202. Give v(-17). -236 Let y(k) = k3 - 21k*2 + 100k + 32. Calculate y(8). 0 Let r(v) = v*3 - 5v*2 - 5v + 29. What is r(4)? -7 Let q(h) = -18h2 - 198h - 6. Give q(-11). -6 Let m(c) = -2c2 + 19c + 137. What is m(-5)? -8 Let d(o) = -920o + 6444. Calculate d(7). 4 Let m(a) = -54a*2 - 13a + 40. Give m(-1). -1 Let s(m) = 19m - 38. Give s(3). 19 Let h(n) = -3n*3 - 90n*2 + 7n - 15. Determine h(-30). -225 Let g(h) = -h*3 - 3h*2 + 11h - 4. Calculate g(-5). -9 Let a(k) = 17202k - 51590. Give a(3). 16 Let g(z) = z3 - 56z*2 + 176z - 943. Determine g(53). -42 Let k(f) = f*3 - 19f*2 + 2f - 35. What is k(19)? 3 Let y(j) = -346j - 723. Determine y(-2). -31 Let u(l) = 3l*3 - 24l*2 + 4l - 10. What is u(8)? 22 Let c(s) = -10s + 831. Give c(79). 41 Let l(q) = -q3 - 199q*2 - 589q - 204. What is l(-196)? -8 Let k(r) = -9r2 - r - 8. What is k(0)? -8 Let j(m) = 1240m*2 + 5m + 3. Calculate j(-1). 1238 Let i(o) = -15o2 - 209o - 196. What is i(-1)? -2 Let q(b) = 417b - 12494. Calculate q(30). 16 Let o(s) = s2 - 1786s - 12545. Determine o(-7). 6 Let s(x) = -x*3 + 10x*2 + 12x - 78. Calculate s(4). 66 Let i(v) = 256v - 9739. What is i(38)? -11 Let a(u) = u2 - 22u - 1733. Calculate a(54). -5 Let k(h) = -h3 - h2 + 11h + 9. Give k(6). -177 Let n(v) = 39v - 1935. Calculate n(49). -24 Let q(t) = -102t - 1538. Give q(-15). -8 Let h(b) = 6151b - 30738. Give h(5). 17 Let j(p) = p*2 + 238p + 13968. Calculate j(-105). 3 Let x(g) = -g*3 + 5g*2 + 22g - 90. Determine x(6). 6 Let o(k) = k*2 + 43k - 1178. Give o(-62). 0 Let b(m) = m*2 - 83m - 36899. Determine b(-155). -9 Let i(w) = -6w3 + 104w*2 + 88w - 16. Calculate i(-1). 6 Let h(u) = 12u2 + 226u - 43. Give h(-19). -5 Let y(c) = -c*3 + 27c*2 + 51c - 648. Determine y(28). -4 Let l(t) = t*3 + 27t*2 + 21t - 84. Determine l(-26). 46 Let z(i) = -36i + 176. What is z(6)? -40 Let j(s) = -33s + 447. What is j(-13)? 876 Let i(a) = a*2 - 176a + 1179. What is i(169)? -4 Let n(z) = 2z3 + 20z*2 + 69z + 677. Give n(-10). -13 Let j(m) = 20m2 - 36m - 2. Determine j(2). 6 Let s(a) = -a*2 - 5a + 20. Determine s(-6). 14 Let h(n) = n*3 - 10n*2 - 53n - 54. Determine h(14). -12 Let w(x) = 7x2 + 8x - 89. What is w(7)? 310 Let n(s) = 76s + 3106. Determine n(-41). -10 Let r(h) = h3 + 9h*2 + 7h + 20. Determine r(-6). 86 Let n(a) = -4a3 + 9a*2 + 3a + 5. Calculate n(5). -255 Let f(a) = -a*2 - 24a - 141. Determine f(-9). -6 Let x(h) = -488h + 1836. Determine x(4). -116 Let i(b) = -b - 452. Give i(-31). -421 Let i(z) = -42z - 109. Give i(0). -109 Let j(n) = -4n2 - 33n - 44. Determine j(-10). -114 Let t(g) = 2g2 + 21g + 33. Determine t(-9). 6 Let m(k) = 2k3 - 33k*2 + 58k - 658. Give m(16). 14 Let t(l) = 30l + 1331. Give t(-27). 521 Let l(f) = f3 + 10f*2 + 4f + 21. Determine l(-10). -19 Let p(l) = 2l2 + 79l - 2006. Give p(18). 64 L	{ "pile_set_name": "DM Mathematics" }
-2v3 - 694 - 330 - 232 - 451 + 0v3 - v3 + 3v3 + (0v + 0v - 2v*2)(3v - 3v + 2v) as tv*2 + s + uv + zv3 and give z. -4 Express -x2 - x2 + 0x*2 + (2x - x + 0x)(-x - 2 + 2) - 3x2 + x2 + x2 - 650 - 2159x*2 + 650 as vx*2 + t + bx and give v. -2163 Rearrange (-1 - 2f + 1)((f*3 - 3f*3 + 0f*3)(-3 + 3 - 3) + (10f2 - 9f*2 - 8f*2)(-f + 0f - f)) to v + lf*4 + qf*3 + hf*2 + bf and give l. -40 Rearrange (547n + 239n + 168n + 104n - 108n)(n + 0n + 3n) to ln2 + t + vn and give l. 3800 Rearrange 3 + 8308b3 - 8322b3 - 3 - b2 to tb2 + ob + n + ub3 and give u. -14 Rearrange 2n + 7n + 0n + (2n + 2n - 2n)(0 + 1 + 1) + 35n + 202 - 202 to the form o + rn and give r. 48 Rearrange -105w + 56w + 23w3 + 2 - 6w*3 + 51w to the form nw2 + bw*3 + uw + l and give b. 17 Express 2 + 3x - 27 + 13 - 30 in the form ax + n and give a. 3 Rearrange -5d - 7 - 2d*2 + 0d*2 - 467d*3 + 468d*3 + 2 - 3 to td + cd2 + q + jd*3 and give c. -2 Rearrange -16b*2 + 2 - 3b*3 + 6b*2 + 8b*2 + 18b*4 to wb + zb3 + mb*4 + v + jb*2 and give v. 2 Rearrange -27n - 321n2 + 638n*2 - 321n*2 to sn + hn2 + y and give s. -27 Express 2426d - 1386d - 1285d in the form y + fd and give f. -245 Express -2z*3 - 15z*4 - 1 - 11z + 2z + 16z*4 - 1 - 2z*2 as wz*4 + c + kz*2 + vz + hz3 and give w. 1 Express (7 + 4 + 2)(-3 + 3 - 2z)(-6z2 + 4z*2 + 3z*2) in the form rz*2 + g + sz*3 + xz and give s. -26 Rearrange -1 + 186i4 + 3i + 2i2 + 0 - 188i*4 - 4 to the form y + si*3 + hi*2 + bi + ci4 and give h. 2 Rearrange 2i2 + i3 + 509i + 0i*2 + 9 - 512i - 2i3 to the form ji*3 + a + ni + pi2 and give n. -3 Rearrange 3 - 2 + 43175u*2 - 380u - 43176u2 to the form j + nu*2 + mu and give m. -380 Rearrange (-3 - 10 + 4)(-2 - 1 + 2)(0 + 0 - 2b) to the form l + zb and give l. 0 Rearrange 87g + 42 + 86g - 170g to the form o + kg and give k. 3 Express -20v + 0v*3 - 5v*3 + 18v + 2v2 as av + xv3 + kv*2 + l and give k. 2 Express 2b*2 + 69 + 66 + 2b*2 + 4b*3 - 133 in the form rb*2 + kb + h + vb3 and give r. 4 Rearrange 35 + 3u*2 - 7 + 13 to z + ku + qu2 and give z. 41 Express (-1 + 2 - 3)(-4f + f2 + 4f) + (2f - 2f - f)(2f - 1304 + 1318 + 7f) in the form gf*2 + c + yf and give y. -14 Rearrange 14 + 13s2 + 14 - 26 + s - 6s*2 + 7s to the form k + vs2 + us and give k. 2 Rearrange (-2 + 4 - 1 + (3 + 0 - 1)(-2 - 4 + 4) + 0 + 0 - 54)(2j + 2j - 6j) to h + sj and give s. 114 Express -59h + 49h - 1029h2 + 10h as wh2 + k + ch and give c. 0 Rearrange (4t - 2t - t)(t - 3t + t - t + 0t + 0t + (2 + 1 + 2)(-2t - 1 + 1)) - 20t2 + 21t*2 + 58t*2 to the form x + rt*2 + bt and give r. 47 Rearrange (7b + b + 5b)(-8794 + 8794 - 69b*2) to sb*3 + tb*2 + z + xb and give s. -897 Express 0 + x2 + 0 + x - x2 - x + (2x2 - x + x)(-3 + 0 + 2) + 2x - 2x - x*2 - 7x*2 + 48x*2 - 5x*2 in the form f + kx + zx2 and give z. 33 Rearrange 16w*3 - 2 - 2w*4 + 4 + 22w*3 - w to kw*4 + x + gw*2 + vw + jw3 and give v. -1 Rearrange (0f*2 + 0f2 - f2)(18f - 25f - 17f)(-2f + 2f + f) to the form xf + lf3 + jf*2 + m + df*4 and give j. 0 Rearrange (-6 + 6 + 18t*3)(-11t + 12t + 18t) - 5t*2 + 2t*4 + 5t*2 to the form pt*4 + ht*3 + jt*2 + qt + w and give p. 344 Express (-2p - 2p + 3p)(-4p + 0p + 6p) - 8p + 22p - 8p*2 - 13p in the form mp2 + y + up and give m. -10 Express -4j + 10 - 6j - j*2 + j + 6j + 5j as q + ij + nj2 and give n. -1 Rearrange (68r - 208r + 56r)(1 + 0 - 3)(9 + 7 + 3) to s + vr and give v. 3192 Express -3 + 2 + 2l + 2l4 - 5l*2 + 4 + 1 + 2l*3 + 4 in the form bl*4 + al*2 + o + xl + rl3 and give x. 2 Rearrange -9 + 35g - 56g + 33g - 8 to the form n + kg and give k. 12 Express -r3 - 2 + 0r + 3r + 13r + 0r3 in the form mr*3 + d + fr + cr2 and give f. 16 Rearrange 138 - 4u*2 + 141 - 280 + 8u to xu2 + vu + f and give v. 8 Rearrange 3v3 - 5v*3 + 53 + 3v*2 + 19 - 7 + 27 to the form mv + hv3 + z + jv*2 and give z. 92 Express (-7h - h + 0h)(-h + 2 + 0 + 12h2 - 3) in the form xh*2 + mh*3 + n + ph and give n. 0 Express 2a3 + 6a + 11a - 29a + 12a - 172a*2 in the form g + ha + xa2 + ca*3 and give c. 2 Express 20406k - 20406k + 705k*2 in the form qk + j + xk2 and give x. 705 Express (4 - 13 - 12c + 11)(3 + 3 - 4)(126 - 283 + 139) in the form vc + y and give y. -72 Express (2l - 2l3 - 2l)(3l + 4l + 0l) + 55l4 + 1311l*2 - 1311l*2 as xl*4 + sl*3 + ql + c + rl2 and give x. 41 Rearrange (-g3 + 4g3 - g3)(2g + 12 - 12)(-452 + 254 + 242) to the form fg*4 + pg*3 + b + cg*2 + rg and give f. 176 Rearrange 2s3 - 11 + 74s*4 + 9 - s - 113s*4 to x + ks*3 + ls*2 + os*4 + bs and give k. 2 Rearrange 135 - 135 - 201m2 to the form i + am*2 + gm and give a. -201 Express (2y + 4y - 3y + (2y - y - 3y)(-4 + 4 + 2))(6y + 23y - 11y)(-2y + 2y + y) in the form gy + u + qy3 + wy*2 and give q. -18 Rearrange -29 + 614 + 46j*4 - 44j*4 - j - 3j + 2j to aj*3 + hj*2 + t + zj*4 + pj and give t. 585 Express 3q + 9q*4 - 3q + (5q + 3q + 9q)(q2 - q2 - q*3) in the form kq*2 + lq + yq4 + z + dq*3 and give y. -8 Rearrange 49 - 179 - 93 + 2y*3 to the form x + jy*3 + sy + uy2 and give j. 2 Express -x + 0x - 3x2 + x3 + x4 + 0x*3 + 2x2 + x3 in the form sx4 + j + wx + vx2 + lx*3 and give l. 2 Rearrange -3c*2 + 0 + 0 + (-12c - 9c + 4c)(-3c - 11c - 8c) to the form k + ac + wc*2 and give w. 371 Express 144y*2 + 240y*2 + 41y*2 in the form p + vy*2 + ky and give p. 0 Rearrange 5b2 + 12b*2 - b + 3b - 4b to the form j + yb + xb2 and give x. 17 Rearrange -93 + 11c + 28c + 12c*2 + 93 to fc + z + sc2 and give s. 12 Rearrange 1730f + 1730f - 3f*2 - 3459f - 2 + 4f3 to the form if*3 + cf*2 + w + nf and give i. 4 Rearrange (1 + 0 + 0)(2q - q + 4q) - 2q - 3q - 5q to oq + w and give o. -5 Express (5 - 5 - g)((6 - 1 - 3)((-2 + 3 - 2)(1 - 4 + 1) + 20 + 15 - 16) + (-2 + 2 - 2)(-4 + 1 + 0)) as o + lg and give l. -48 Express (2v2 - 4v*2 + 0v*2)(-2 - 1 - 1) - 2v - 142v*2 + 2v - 367v2 - 865v*2 in the form q + sv*2 + gv and give s. -1366 Express 1 - 1670i + 1887i - 1 as li + j and give l. 217 Rearrange 28 + 22p*2 + 57p*2 - 13 - 11 to tp + zp2 + n and give z. 79 Express (i + 3 - 3)(-765i - 5951 + 11902 - 5951) as di*2 + qi + b and give d. -765 Express 11f2 - 3 + 13 + 13 - 2f*4 - 21 + f in the form jf*2 + rf*4 + cf + u + kf3 and give c. 1 Rearrange 24s - 127s - 120s - 164s to y + as and give a. -387 Rearrange (0 + 0 + 8i2)(-2i + 2i + i)(0 + 4 - 1)(2 - 2 + 2i) to si + q + di2 + gi*3 + ti*4 and give q. 0 Express -44 - 1 - 82j + 4j3 + 45 as lj + gj3 + y + pj*2 and give g. 4 Express (-3c*4 + 3c*4 - 8c*4)((1 - 2 + 2)(-6 + 4 + 0) - 34 + 62 - 30) in the form jc*3 + qc + dc2 + hc*4 + m and give h. 32 Rearrange 241r*3 - 16 + 3 - 1 - 31r*2 - 243r*3 to the form nr + mr3 + zr*2 + g and give m. -2 Rearrange -2396s*2 + 13055s - 13055s to r + bs + zs2 and give z. -2396 Rearrange (74i - 74i - 10i*4)(3 + 3 - 4) + 17i4 + 25i*4 - 16i*4 to ti*3 + vi*2 + wi + z + si4 and give s. 6 Rearrange 83u + 109 - 42u - 38u to r + wu and give r. 109 Express -6 + r + 0r + 18 + 15 in the form l + wr and give w. 1 Express 3b2 - b2 - 4b2 + (-495b - 413b + 791b)(2b - 3b + 2b) in the form hb2 + o + zb and give z. 0 Express (-3s2 + 0 + 0)(2 - 2 + 1) + (3s + 1 - 1)(-2s + 6s - 2s) as xs + ms2 + b and give x. 0 Rearrange (12 - 4 + 10)(-27t + 25t + 14t) to wt + v and give w. 216 Rearrange -2 + 10298i + 5 - 10i*2 - 10323i to r + xi2 + ki and give r. 3 Express (1 - 2 + 0)(-g - g + g) - 118 - 148g + 118 + 2g - 3 + 3 + (-2g - 2g + 8g)(4 - 2 - 1) in the form lg + m and give l. -	{ "pile_set_name": "DM Mathematics" }
-10248, -18219, -28468, -40995? -55800 What is next in -128, -294, -578, -986, -1524? -2198 What is next in -2705, -5418, -8131, -10844, -13557? -16270 What is next in 19375, 19357, 19315, 19237, 19111, 18925, 18667? 18325 What is the next term in 9638, 9641, 9648, 9659, 9674, 9693, 9716? 9743 What comes next: -542, -4647, -15842, -37673, -73686, -127427, -202442, -302277? -430478 What is the next term in -1679575, -1679576, -1679577, -1679578? -1679579 What is next in 2749, 2695, 2641? 2587 What is next in -1625, -6408, -14261, -25088, -38793, -55280, -74453, -96216? -120473 What is next in 145049, 145027, 144967, 144851, 144661, 144379? 143987 What comes next: 1198676, 2397349, 3596022, 4794695? 5993368 What is next in -1070, -2184, -3298, -4412? -5526 What is the next term in -1037, -2389, -3743, -5099, -6457? -7817 What is next in 2536, 2643, 2750, 2857, 2964, 3071? 3178 What is the next term in 941346, 1882690, 2824034, 3765378, 4706722, 5648066? 6589410 What is the next term in -1002, -1118, -1234, -1350, -1466? -1582 What is next in -145, 453, 2097, 5315, 10635, 18585, 29693? 44487 What is next in -364, -1402, -3128, -5542? -8644 What comes next: 1963, 5305, 10875, 18673, 28699? 40953 What is the next term in 63, 85, 107, 129, 151? 173 What comes next: -186, -397, -646, -933, -1258, -1621? -2022 What is next in -950, -917, -864, -797, -722, -645, -572, -509? -462 What is the next term in -474, -3854, -13054, -30984, -60554? -104674 What is next in -9761, -19520, -29293, -39086, -48905, -58756? -68645 What is the next term in -477, -1060, -1643? -2226 What is next in 23819, 23233, 22649, 22067, 21487, 20909? 20333 What is the next term in -1637, -396, 845, 2086? 3327 What is the next term in 77, 542, 1391, 2630, 4265? 6302 What comes next: -23, -151, -277, -401, -523? -643 What is next in -26278, -52570, -78874, -105196, -131542, -157918, -184330, -210784? -237286 What comes next: 5370, 10703, 15942, 21039, 25946? 30615 What comes next: -720, -1522, -2324, -3126? -3928 What is next in -210, -712, -1522, -2640, -4066? -5800 What is the next term in -76866, -76864, -76862? -76860 What is next in -5630, -6043, -6456, -6869, -7282, -7695? -8108 What comes next: -86942, -347762, -782458, -1391030? -2173478 What comes next: -185, -2457, -6237, -11519, -18297, -26565? -36317 What comes next: -33, 101, 361, 753, 1283, 1957, 2781? 3761 What is next in -98119, -98123, -98127, -98131, -98135? -98139 What comes next: 308, 1187, 2652, 4703? 7340 What comes next: -147, -541, -1187, -2085, -3235, -4637, -6291? -8197 What comes next: 808, 810, 812? 814 What is the next term in -1541, -6271, -14183, -25271, -39529, -56951, -77531, -101263? -128141 What is the next term in 5571, 11127, 16697, 22275, 27855, 33431, 38997? 44547 What is next in 874173, 874186, 874201, 874218, 874237, 874258, 874281? 874306 What is next in -252, -456, -660? -864 What is next in -110, -344, -744, -1316, -2066, -3000, -4124? -5444 What comes next: -3138, -3156, -3202, -3288, -3426, -3628, -3906? -4272 What comes next: -1645, -6549, -14723, -26167, -40881? -58865 What is next in -1281, -1246, -1211, -1176? -1141 What is the next term in 3304, 3300, 3298, 3298, 3300, 3304? 3310 What is the next term in -3481, -13809, -31025, -55129, -86121, -124001? -168769 What comes next: 637, 629, 619, 607, 593? 577 What comes next: 36621, 146548, 329755, 586236, 915985, 1318996, 1795263, 2344780? 2967541 What comes next: -1479, -1492, -1513, -1536, -1555, -1564, -1557? -1528 What is next in -26998, -26992, -26986, -26980, -26974, -26968? -26962 What comes next: -20883, -41669, -62455? -83241 What is next in -491, -774, -1253, -1928? -2799 What comes next: 143, 538, 933, 1328? 1723 What is the next term in -2077, -8239, -18503, -32863, -51313? -73847 What is next in -5324, -11019, -16714, -22409? -28104 What is the next term in -15465, -30975, -46483, -61989, -77493, -92995? -108495 What is the next term in -14576, -14559, -14518, -14441, -14316, -14131, -13874? -13533 What is the next term in 17680, 17360, 17038, 16714, 16388, 16060? 15730 What is next in 1274, 2565, 3856, 5147, 6438? 7729 What is next in 302, 347, 392? 437 What is next in -624, -786, -1006, -1284? -1620 What comes next: 13178, 52769, 118760, 211157, 329966, 475193, 646844, 844925? 1069442 What is the next term in -60713, -242855, -546425, -971423, -1517849? -2185703 What is next in -9291, -9253, -9231, -9231, -9259? -9321 What is the next term in 6738, 6748, 6764, 6786, 6814? 6848 What comes next: -104, -1140, -3962, -9464, -18540? -32084 What comes next: -137, -291, -537, -923, -1497, -2307, -3401? -4827 What is next in -1770, -3578, -5426, -7320, -9266, -11270? -13338 What is next in -73, -258, -565, -1000, -1569? -2278 What is next in -25, -84, -175, -298? -453 What is the next term in -61146, -122297, -183450, -244605? -305762 What comes next: -806, -1863, -3624, -6089, -9258? -13131 What is the next term in 8466, 8237, 8006, 7773? 7538 What is next in -117832, -117842, -117852, -117862, -117872, -117882? -117892 What comes next: -1752226, -1752230, -1752234? -1752238 What is the next term in 2532, 5137, 7740, 10341, 12940, 15537, 18132? 20725 What comes next: 6324, 25853, 58394, 103941, 162488, 234029, 318558? 416069 What is next in 1302, 2560, 3818, 5076, 6334? 7592 What comes next: 221, 465, 727, 1019, 1353, 1741? 2195 What comes next: -8658, -8668, -8702, -8772, -8890? -9068 What is next in 1980, 5072, 10226, 17442, 26720? 38060 What is the next term in -155, -800, -1879, -3392, -5339, -7720? -10535 What is next in -83, 28, 513, 1558, 3349, 6072, 9913, 15058? 21693 What comes next: 3991, 4050, 4143, 4288, 4503, 4806, 5215? 5748 What is the next term in -714, -583, -210, 525, 1742, 3561, 6102, 9485? 13830 What is next in 89338, 89339, 89340, 89341? 89342 What is next in -108, -309, -592, -945, -1356, -1813, -2304? -2817 What is next in -444937, -444974, -445035, -445120, -445229, -445362? -445519 What comes next: -2651, -5309, -7973, -10643? -13319 What is the next term in 1505, 1534, 1563? 1592 What is the next term in -1236, -2788, -4656, -6840, -9340? -12156 What is the next term in -69379, -138773, -208169, -277567, -346967? -416369 What is the next term in 727, 1525, 2321, 3115? 3907 What comes next: 352, 345, 330, 307, 276, 237? 190 What is the next term in 13279, 13369, 13459, 13549? 13639 What comes next: 215605, 431220, 646845, 862480? 1078125 What is next in -440, -1853, -4196, -7469, -11672, -16805? -22868 What is next in 7912, 7902, 7880, 7840, 7776? 7682 What is the next term in 2744, 2804, 2864, 2924? 2984 What is next in 74, 91, 114, 137, 154? 159 What comes next: -4059, -8116, -12175, -16236? -20299 What is next in 39034, 156138, 351310, 624550? 975858 What is the next term in -154, -262, -400, -580, -814, -1114, -1492, -1960? -2530 What is next in 2740, 2760, 2792, 2836? 2892 What comes next: -59673, -119327, -178983, -238641? -298301 What comes next: 103, -46, -295, -644? -1093 What is the next term in 910, 7018, 23592, 55864, 109066, 188430, 299188? 446572 What is next in -42, 1, 138, 417, 886, 1593, 2586? 3913 What is the next term in 2332, 2425, 2518, 2611? 2704 What is next in 1209, 1204, 1195, 1182? 1165 What comes next: -306, -643, -980, -1317? -1654 What is next in -51936, -103870, -155804, -207738? -259672 What is the next term in 196, 159, 96, 7, -108? -249 What is the next term in 2798, 4417, 6048, 7697, 9370, 11073? 12812 What comes next: 44596, 44597, 44608, 44635, 44684, 44761? 44872 What is the next term in 1082, -479, -2040, -3601? -5162 What is the next term in -5657, -5649, -5639, -5627, -5613, -5597? -5579 What is next in 25851, 103387, 232601, 413487, 646039? 930251 What is the next term in 173867, 173885, 173915, 173963, 174035, 174137, 174275, 174455? 174683 What comes next: 631, 563, 435, 235, -49, -429? -917 What comes next: -14037, -28070, -42103? -56136 What comes next: -19, -182, -357, -550, -767, -1014? -1297 What comes next: 79114, 79117, 79120, 79123? 79126 What is next in 867, 666, 439, 180, -117, -458, -849? -1296 What is next in 185, 263, 373, 509, 665? 835 What is the next term in -564837, -564837, -564839, -564843? -564849 What is the next term in 25, -37, -177,	{ "pile_set_name": "DM Mathematics" }
er? 10 What is 15065 to the power of 1/2, to the nearest integer? 123 What is the cube root of 7604 to the nearest integer? 20 What is the seventh root of 25459 to the nearest integer? 4 What is 635 to the power of 1/2, to the nearest integer? 25 What is the tenth root of 20944 to the nearest integer? 3 What is the fourth root of 5588 to the nearest integer? 9 What is the third root of 32799 to the nearest integer? 32 What is 3737 to the power of 1/5, to the nearest integer? 5 What is 107683 to the power of 1/3, to the nearest integer? 48 What is 41640 to the power of 1/3, to the nearest integer? 35 What is the square root of 2337 to the nearest integer? 48 What is 27006 to the power of 1/2, to the nearest integer? 164 What is the eighth root of 5038 to the nearest integer? 3 What is the square root of 17362 to the nearest integer? 132 What is the square root of 60 to the nearest integer? 8 What is the third root of 401 to the nearest integer? 7 What is 5226 to the power of 1/5, to the nearest integer? 6 What is 67629 to the power of 1/2, to the nearest integer? 260 What is the cube root of 60647 to the nearest integer? 39 What is 5210 to the power of 1/4, to the nearest integer? 8 What is 11253 to the power of 1/2, to the nearest integer? 106 What is the cube root of 10486 to the nearest integer? 22 What is 1107 to the power of 1/10, to the nearest integer? 2 What is the cube root of 1886 to the nearest integer? 12 What is the sixth root of 32334 to the nearest integer? 6 What is 1146 to the power of 1/6, to the nearest integer? 3 What is the seventh root of 12692 to the nearest integer? 4 What is 33740 to the power of 1/8, to the nearest integer? 4 What is the ninth root of 32402 to the nearest integer? 3 What is 137 to the power of 1/2, to the nearest integer? 12 What is 87481 to the power of 1/3, to the nearest integer? 44 What is the square root of 13154 to the nearest integer? 115 What is the cube root of 2374 to the nearest integer? 13 What is the square root of 66370 to the nearest integer? 258 What is the tenth root of 11880 to the nearest integer? 3 What is 1152 to the power of 1/3, to the nearest integer? 10 What is the eighth root of 17112 to the nearest integer? 3 What is the cube root of 911 to the nearest integer? 10 What is 14023 to the power of 1/7, to the nearest integer? 4 What is the square root of 9546 to the nearest integer? 98 What is the cube root of 71968 to the nearest integer? 42 What is 826 to the power of 1/3, to the nearest integer? 9 What is the eighth root of 1114 to the nearest integer? 2 What is the seventh root of 912 to the nearest integer? 3 What is 6777 to the power of 1/8, to the nearest integer? 3 What is 129 to the power of 1/3, to the nearest integer? 5 What is the tenth root of 19565 to the nearest integer? 3 What is the cube root of 6393 to the nearest integer? 19 What is the cube root of 89298 to the nearest integer? 45 What is the square root of 10413 to the nearest integer? 102 What is 1019 to the power of 1/6, to the nearest integer? 3 What is the cube root of 1521 to the nearest integer? 12 What is the third root of 8000 to the nearest integer? 20 What is the third root of 753 to the nearest integer? 9 What is 4428 to the power of 1/7, to the nearest integer? 3 What is 12191 to the power of 1/7, to the nearest integer? 4 What is 27352 to the power of 1/2, to the nearest integer? 165 What is the third root of 13158 to the nearest integer? 24 What is the third root of 7002 to the nearest integer? 19 What is the fourth root of 145844 to the nearest integer? 20 What is 31321 to the power of 1/2, to the nearest integer? 177 What is 19385 to the power of 1/8, to the nearest integer? 3 What is 31565 to the power of 1/2, to the nearest integer? 178 What is 444 to the power of 1/7, to the nearest integer? 2 What is the eighth root of 7271 to the nearest integer? 3 What is 1137 to the power of 1/6, to the nearest integer? 3 What is the cube root of 25490 to the nearest integer? 29 What is the seventh root of 10719 to the nearest integer? 4 What is the fourth root of 789 to the nearest integer? 5 What is 39061 to the power of 1/3, to the nearest integer? 34 What is 1827 to the power of 1/3, to the nearest integer? 12 What is 3850 to the power of 1/10, to the nearest integer? 2 What is the square root of 1518 to the nearest integer? 39 What is 79819 to the power of 1/3, to the nearest integer? 43 What is the fourth root of 3022 to the nearest integer? 7 What is 14048 to the power of 1/2, to the nearest integer? 119 What is the sixth root of 107938 to the nearest integer? 7 What is 991 to the power of 1/4, to the nearest integer? 6 What is 19 to the power of 1/2, to the nearest integer? 4 What is 1990 to the power of 1/8, to the nearest integer? 3 What is the cube root of 118 to the nearest integer? 5 What is 7196 to the power of 1/2, to the nearest integer? 85 What is the cube root of 112357 to the nearest integer? 48 What is the third root of 4865 to the nearest integer? 17 What is 2311 to the power of 1/3, to the nearest integer? 13 What is the third root of 128 to the nearest integer? 5 What is 111714 to the power of 1/2, to the nearest integer? 334 What is the third root of 8239 to the nearest integer? 20 What is 18662 to the power of 1/2, to the nearest integer? 137 What is 15888 to the power of 1/8, to the nearest integer? 3 What is the third root of 115881 to the nearest integer? 49 What is the square root of 841 to the nearest integer? 29 What is the third root of 1626 to the nearest integer? 12 What is 13892 to the power of 1/2, to the nearest integer? 118 What is the third root of 1241 to the nearest integer? 11 What is 3036 to the power of 1/2, to the nearest integer? 55 What is the sixth root of 54119 to the nearest integer? 6 What is the third root of 6263 to the nearest integer? 18 What is the ninth root of 12243 to the nearest integer? 3 What is the eighth root of 3037 to the nearest integer? 3 What is the cube root of 55952 to the nearest integer? 38 What is the cube root of 871 to the nearest integer? 10 What is 1489 to the power of 1/7, to the nearest integer? 3 What is the third root of 350 to the nearest integer? 7 What is 837 to the power of 1/3, to the nearest integer? 9 What is 203 to the power of 1/2, to the nearest integer? 14 What is 1070 to the power of 1/2, to the nearest integer? 33 What is the seventh root of 45877 to the nearest integer? 5 What is the seventh root of 1039 to the nearest integer? 3 What is the third root of 9470 to the nearest integer? 21 What is 9210 to the power of 1/4, to the nearest integer? 10 What is the tenth root of 1327 to the nearest integer? 2 What is 10091 to the power of 1/3, to the nearest integer? 22 What is 18320 to the power of 1/7, to the nearest integer? 4 What is 160 to the power of 1/2, to the nearest integer? 13 What is 9778 to the power of 1/5, to the nearest integer? 6 What is the seventh root of 18338 to the nearest integer? 4 What is the ninth root of 1333 to the nearest integer? 2 What is 4113 to the power of 1/2, to the nearest integer? 64 What is 105451 to the power of 1/2, to the nearest integer? 325 What is 36440 to the power of 1/3, to the nearest integer? 33 What is 774 to the power of 1/4, to the nearest integer? 5 What is the third root of 7276 to the nearest integer? 19 What is the third root of 4953 to the nearest integer? 17 What is the sixth root of 902 to the nearest integer? 3 What is the eighth root of 892 to the nearest integer? 2 What is the square root of 2692 to the nearest integer? 52 What is the cube root of 357 to the nearest integer? 7 What is the seventh root of 19673 to the nearest integer? 4 What is the third root of 7051 to the nearest integer? 19 What is the square root of 6855 to the nearest integer? 83 What is the square root of 669 to the nearest integer? 26 What is 114508 to the power of 1/2, to the nearest integer? 338 What is 1124 to the power of 1/6, to the nearest integer? 3 What is 39537 to the power of 1/2, to the nearest integer? 199 What is the cube root of 3892 to the nearest integer? 16 What is the eighth root of 278 to the nearest integer? 2 What is 443 to the power of 1/9, to the neares	{ "pile_set_name": "DM Mathematics" }
2 - 581i2tz + 3i*2t wrt z? -74236i3t + 14i2t Find the third derivative of 5jlp2 - 12jp3 + 8jp2 - 2j - 3lp*3 + 35lp + l + 4563p*3 - 2p*2 - 681p wrt p. -72j - 18l + 27378 Differentiate -9551344v2 - 15700438 wrt v. -19102688v Find the second derivative of -2pw*3 - 196475960pw - 2p + 27343624w4 wrt w. -12pw + 328123488w*2 What is the third derivative of 21nr5 + 321908nr4 + 9n - 209314r2 - 19r wrt r? 1260nr*2 + 7725792nr Differentiate -18bn3o - 885bn*2o + 31bo - 3n3 - 6768o with respect to b. -18n3o - 885n2o + 31o Find the second derivative of -kl*2 + 1136kl + 22800k + 1226717l2 - l wrt l. -2k + 2453434 Find the first derivative of -28483467b3 - 2322616 wrt b. -85450401b2 What is the third derivative of -y5 - 14595018y3 + 397y*2 - 7550y? -60y2 - 87570108 Find the first derivative of 3135117qt3 + 888836771q + 106t3 wrt t. 9405351qt2 + 318t*2 Find the second derivative of -4494162v*3 - 2v*2 - 6009256v - 5. -26964972v - 4 What is the second derivative of -581l*4 - 4371l*2 - 84928504l? -6972l2 - 8742 Find the second derivative of -p4 - 308419053p*3 - 1527428102p. -12p2 - 1850514318p Find the third derivative of -11658383q4 + 3243q*2 - 158q - 2 wrt q. -279801192q What is the third derivative of 410n*2y*3 - 1715n*2 - 17ny3 + 77ny2 - 139y*3 - 2y*2 + 2y wrt y? 2460n2 - 102n - 834 What is the second derivative of -2q3t*2 + 4q*3 + 209q + 388689977t2 + 272t + 158 wrt t? -4q3 + 777379954 Differentiate 4473548g*2ns3 - 13g*2s*3 - 2g*2s2 - g2 + gs2 - 1275s*3 with respect to n. 4473548g*2s*3 What is the derivative of 7q*2r*2 - 27qr3 - 1361q + 1069568r3 wrt q? 14qr2 - 27r*3 - 1361 What is the second derivative of -4383741l*2p + 4l2 + 30773lp + 789p wrt l? -8767482p + 8 Find the second derivative of 15746403a*2 + 2a + 137695. 31492806 What is the second derivative of 5975b3f*3 - 79b*3 - 10b*2 - 2bf + 142b + 2134f4 - 4f wrt f? 35850b3f + 25608f2 Find the second derivative of -84191490k*3 + 3143903k - 2 wrt k. -505148940k Find the second derivative of 24158897c*3 - 16513464c wrt c. 144953382c Differentiate 40851798c*2 + 46259301. 81703596c What is the third derivative of -357584717j6 + 2j*2 - 18184387j? -42910166040j3 What is the derivative of 36041533i + 77858210 wrt i? 36041533 What is the second derivative of 79nr*3 - nr*2 + 2nr - 12112n + 2r3 - 91r*2 + 7r wrt r? 474nr - 2n + 12r - 182 Differentiate 2a4 - 110614a*2 + 79a + 617940302 with respect to a. 8a3 - 221228a + 79 What is the derivative of 6641560t + 14661535 wrt t? 6641560 What is the derivative of -145939070x - 235860717 wrt x? -145939070 What is the second derivative of -3535364m4 - 2m*3 - 7757193m wrt m? -42424368m2 - 12m What is the first derivative of 198462231c2o + 33041c2 + 3072c wrt o? 198462231c2 Find the second derivative of 190991g*3s - 67g2s - 21577g + 2098s wrt g. 1145946gs - 134s What is the third derivative of -735021467b*6 + 7b*2 - 9b - 5927458 wrt b? -88202576040b3 What is the first derivative of -4021b*4 - 3957b + 36850370? -16084b3 - 3957 What is the first derivative of 1144512024cn + 499278n - 145 wrt c? 1144512024n What is the third derivative of -1580529k*4 - 9123218k*2 wrt k? -37932696k Find the third derivative of -c*3z*3 + 223c*3z - 1210c3 + 1857646c*2z*3 + 4cz3 + 2c + 12z2 wrt z. -6c*3 + 11145876c*2 + 24c Find the third derivative of 268300318jo*3 + 3jo2 + 312769jo - 6j - 2o2 wrt o. 1609801908j Find the second derivative of -37550010k2 + 2k + 17083648. -75100020 What is the third derivative of 55681310l3 - 149l*2 + 109363l wrt l? 334087860 What is the derivative of -37975019h4 + 9899427 wrt h? -151900076h*3 What is the third derivative of -348473862x*4 - 137116478x*2 wrt x? -8363372688x What is the derivative of -107360480t - 391084403? -107360480 Find the second derivative of -130972025c*5 + 2c - 29704063. -2619440500c3 Find the third derivative of -62998j*3o*3 + 188940j*3o*2 + 1134j*3 - 323jo3 wrt o. -377988j*3 - 1938j Find the second derivative of 3u4 + 42u*3 - 6696u*2 - 27076u + 221 wrt u. 36u2 + 252u - 13392 What is the third derivative of 113444161i6 - 172402234i*2? 13613299320i*3 Find the second derivative of -21bp2s*2 - 5bp2s + 427bps - 326031bs3 - 3bs + 13b + p*2s + 16ps - 4s wrt s. -42bp2 - 1956186bs What is the first derivative of 12j*3 - 2j*2 + 278770j + 328978229? 36j2 - 4j + 278770 What is the derivative of 6w3 - 72w*2 - 2465w - 420937? 18w2 - 144w - 2465 What is the third derivative of -956254u5 - 9u*2 - 103158u - 2? -57375240u2 Find the third derivative of -433912587i*3q + 2i2q + 4877i2 + 6iq - 2i - 5q - 1 wrt i. -2603475522q Find the second derivative of -202559058t5 + 7t + 296404. -4051181160t3 Find the third derivative of -33828131h*4 + 4468562h*2 wrt h. -811875144h Find the second derivative of 2897876f3 - 2f*2 + 18081417f wrt f. 17387256f - 4 Find the second derivative of -319805d*4 - 156d*3i + 9di - 130d - 127i + 20 wrt d. -3837660d2 - 936di Find the third derivative of -58c*2r*3 + 24c*2r*2 + 128c*2r - 842672cjr3 - cjr - 6c - 6jr*2 wrt r. -348c*2 - 5056032cj What is the first derivative of 4638802h + 4271519 wrt h? 4638802 Differentiate -47965918a3 + 65060586. -143897754a*2 What is the second derivative of -55617141f*2z2 + f2z - 75f*2 - 2fz - 3f + 6z + 53 wrt z? -111234282f*2 Differentiate -59287208s*2 + s + 731274900 wrt s. -118574416s + 1 What is the second derivative of -7805894b3 + 8223399b - 1? -46835364b Differentiate -112h*3 + 11278hs2 - 10s*2 + 104102 with respect to h. -336h*2 + 11278s*2 What is the derivative of 14001188gq3 + 9997658q*3 wrt g? 14001188q*3 What is the derivative of -8254hpv*2 + 3185123hv2 + 17155pv2 + 32v*2 wrt p? -8254hv2 + 17155v*2 What is the third derivative of -54914555g*3 + 7450276g*2 wrt g? -329487330 What is the second derivative of -2a*2d*2k + 938a2dk + 6ad2k + adk + 1088ak + 254066d2k wrt d? -4a2k + 12ak + 508132k Find the third derivative of -106p*6 + 4p*5 - 797p*3 - 9925438p*2. -12720p*3 + 240p*2 - 4782 What is the first derivative of 99z*3 + 40584z - 19901392? 297z2 + 40584 Find the third derivative of 5860v*6 + 2v*5 + 101v*3 + 2v*2 - 2v + 130935 wrt v. 703200v3 + 120v*2 + 606 What is the second derivative of 713m*4 + 32479m*2 - 59004901m wrt m? 8556m2 + 64958 Find the first derivative of p4 + 14760p*3 + 4068p*2 + 688244065 wrt p. 4p*3 + 44280p*2 + 8136p What is the third derivative of -356863138f3 + 269544950f2? -2141178828 Find the third derivative of -k4 + 920982k3 + 18387k*2 - 331 wrt k. -24k + 5525892 Find the second derivative of -15253m5 - 160m*2 - 37086m + 45 wrt m. -305060m3 - 320 What is the second derivative of 27585376d*2 + 824970d - 27 wrt d? 55170752 Find the second derivative of -605296974o5 + 842103056o. -12105939480o3 What is the second derivative of 11519117u*2 - 14847754u wrt u? 23038234 Find the third derivative of 29791m2x*6 - 31394m*2x*2 + 2m*2 + 4mx - 686x*6 - 20 wrt x. 3574920m*2x*3 - 82320x*3 Find the first derivative of -17887376y*4 - 17526058. -71549504y*3 Find the third derivative of 5776879z*3 + 9888485z*2 wrt z. 34661274 Find the third derivative of 19712152n*2y*3 + 12704740n*2y*2 wrt y. 118272912n*2 What is the third derivative of -11975f*2hv3 - 732f*2h - 329f2v*2 + 2fhv*2 + 335hv5 wrt v? -71850f*2h + 20100hv*2 What is the third derivative of 5965k*3v*3 + 249k*3v + 6355k2v*2 - 690v*3 wrt v? 35790k*3 - 4140 Find the second derivative of -69027725u*5 + 61u + 39756 wrt u. -1380554500u*3 What is t	{ "pile_set_name": "DM Mathematics" }
+ 14) Factor -2x2/9 - 856x/9 - 9920. -2(x + 180)(x + 248)/9 Suppose 3b4 + 51b*3 - 1074b*2 - 7512b - 10368 = 0. What is b? -27, -4, -2, 16 Factor -z*2/2 - 414857z - 172106330449/2. -(z + 414857)*2/2 Factor 15n*3/8 - 38523n*2/4 + 77031n/8. 3n(n - 1)(5n - 25677)/8 Find v, given that v*5/3 - 12v*4 - 518v*3/3 + 12v*2 + 517v/3 = 0. -11, -1, 0, 1, 47 Suppose -3c4/2 - 19541c*3 - 127270531c*2/2 + 42438710c + 21216098 = 0. What is c? -6514, -1/3, 1 Factor y*3 + 10y*2 - 312y + 576. (y - 12)(y - 2)(y + 24) Determine y so that 4y2/3 - 374y/3 + 8236/3 = 0. 71/2, 58 Suppose -5k3 - 645k*2 - 4320k - 6100 = 0. Calculate k. -122, -5, -2 Determine m, given that -m*3/6 + 363m*2/2 = 0. 0, 1089 Factor -20c*3 + 15c*2/2 + 20c - 15/2. -5(c - 1)(c + 1)(8c - 3)/2 Find t such that 2t5/13 + 10034t*4/13 + 12529752t*3/13 - 139164984t*2/13 - 151684704t/13 = 0. -2514, -1, 0, 12 Factor -z*2/3 + 180z - 11396/3. -(z - 518)(z - 22)/3 What is f in -13f*3 + 434f*2 - 2973f + 1080 = 0? 5/13, 9, 24 What is f in 5f4 + 38745f*3 + 74961765f*2 - 376010845f - 450933870 = 0? -3877, -1, 6 Determine o so that -2o5/21 - 20578o*4/21 - 54846o*3/7 - 431846o*2/21 - 452380o/21 - 54832/7 = 0. -10281, -4, -2, -1 Let 3v5 + 687v*4 + 51909v*3 + 1290561v*2 - 51912v - 1291248 = 0. What is v? -84, -61, -1, 1 Determine c, given that c*3/4 - 9721c*2/4 + 58299c/4 - 87435/4 = 0. 3, 9715 Factor -2z2 - 335700z - 335698. -2(z + 1)(z + 167849) Factor -3a2 + 101775a - 203538. -3(a - 33923)(a - 2) Factor -4j4 + 472j*2 - 2400j + 3276. -4(j - 7)(j - 3)*2(j + 13) Let 5i4 - 620i*3 + 22025i*2 - 171570i + 259920 = 0. What is i? 2, 8, 57 Factor -c*3/2 + 2573c*2 - 5145c/2. -c(c - 5145)(c - 1)/2 Find k, given that 621k5 + 49212k*4 + 106116k*3 - 99714k*2 + 23775k - 1386 = 0. -77, -3, 2/23, 1/3 Let -2d5/9 - 28d*4/3 + 1438d*3/9 - 2360d*2/3 + 11200d/9 = 0. Calculate d. -56, 0, 4, 5 Factor 20o2/3 - 269204o - 323048/3. 4(o - 40381)(5o + 2)/3 Let 4l*2 + 3036l + 79056 = 0. Calculate l. -732, -27 Let -3u2/4 - 138243u/2 - 6370375683/4 = 0. Calculate u. -46081 Factor 14n2/3 + 191362n/3 - 54676/3. 2(n + 13669)(7n - 2)/3 Factor -12u*2 - 22156u - 7384. -4(u + 1846)(3u + 1) Factor 1268n*3 + 6314648n*2 + 7861766640n + 49600800. 4(n + 2490)2(317n + 2) Find c such that -c2/3 + 798c - 19088/3 = 0. 8, 2386 Factor 3j2 - 8376j + 8373. 3(j - 2791)(j - 1) Factor 3u3/2 + 399u*2 + 37125u/2 - 126063. 3(u - 6)(u + 69)(u + 203)/2 Find u such that u4 - 187u*3 - 204u*2 + 2992u + 3008 = 0. -4, -1, 4, 188 Factor -4t3 + 544t*2 - 16756t - 120984. -4(t - 71)2(t + 6) Solve -4p2/9 + 3868p/9 - 7592 = 0. 18, 949 Determine z, given that -4z2 - 3196656z - 638663098896 = 0. -399582 Suppose -2d5/9 - 2d*4/9 + 146d*3/9 + 2d*2/9 - 16d = 0. What is d? -9, -1, 0, 1, 8 Determine c, given that 3c5/2 + 405c*4/4 + 6171c*3/4 + 27279c*2/4 + 30867c/4 + 2340 = 0. -48, -13, -5, -1, -1/2 Factor b*2 + 17372b + 225667. (b + 13)(b + 17359) What is s in 2s*5/3 - 52s*4 + 878s*3 - 2176s*2/3 - 1656s = 0? -1, 0, 2, 23, 54 Suppose -m*4/3 + 653m*3/6 + 164m*2 + m/6 - 164/3 = 0. Calculate m. -1, 1/2, 328 Find d such that 5d*3 + 2408795d*2 + 290118280760d + 870333163260 = 0. -240878, -3 Solve -2w2/19 + 8786w/19 = 0 for w. 0, 4393 Find g, given that 375g5 - 4490g*4 + 3255g*3 + 75840g*2 - 132980g - 3600 = 0. -4, -2/75, 2, 5, 9 Let 2a2/5 + 742a/5 - 80784/5 = 0. Calculate a. -459, 88 Solve -12y4 - 308y*3 + 1148y*2 - 348y = 0. -29, 0, 1/3, 3 What is z in 3z3/2 + 765z*2/2 + 1917z - 80676 = 0? -249, -18, 12 Factor -4v2/3 - 7196v - 21584/3. -4(v + 1)(v + 5396)/3 Factor 3f5 + 2157f*4 + 390936f*3 + 1153476f*2. 3f*2(f + 3)(f + 358)2 Find w such that 123687w*4 + 275184w*3/5 + 30684w*2/5 + 16w/5 = 0. -2/9, -4/7635, 0 Find j, given that 3j4 - 9363j*3 + 37416j*2 - 37404j = 0. 0, 2, 3117 Let -3r3 + 397257r*2 - 13151689536r + 39451493376 = 0. Calculate r. 3, 66208 What is o in 5o4/4 + 92o*3 - 4243o*2/4 + 5229o/2 - 882 = 0? -84, 2/5, 3, 7 Factor -4s2 + 97408s - 593019904. -4(s - 12176)2 Factor 3a*3 - 159a*2 - 2004a + 32940. 3(a - 61)(a - 10)(a + 18) Determine s, given that -14s*4/9 + 842s*3/9 + 3392s*2/9 + 4072s/9 + 512/3 = 0. -2, -1, -6/7, 64 Let 2d3 - 266d*2 + 3800d - 6552 = 0. What is d? 2, 14, 117 Let -4p5 + 268p*4 - 5820p*3 + 44980p*2 - 124096p + 84672 = 0. Calculate p. 1, 4, 7, 27, 28 Determine d so that 2d2 + 1518d - 4572 = 0. -762, 3 Factor -20p4 + 5262380p*3 + 5262395p*2 + 1315600p. -5p(p - 263120)(2p + 1)*2 Determine b, given that 2b*4/7 - 10b*3 + 258b*2/7 - 314b/7 + 124/7 = 0. 1, 2, 31 Factor 8364a2 - 66920a + 64. 4(a - 8)(2091a - 2) Factor -4m*4 - 1024m*3 - 79096m*2 - 1735680m - 11492100. -4(m + 15)2(m + 113)*2 Suppose 3z*4 - 51z*3 + 153z*2 + 51z - 156 = 0. What is z? -1, 1, 4, 13 Solve -3y3 + 132y*2 - 1659y + 5850 = 0. 6, 13, 25 Factor -x*3/2 - 56285x*2/2 - 791972163x/2 + 792028449/2. -(x - 1)(x + 28143)2/2 Factor -3r*3 - 82935r*2 - 82932r. -3r(r + 1)(r + 27644) Let -3i*3 + 1140i*2 + 1161i - 6858 = 0. Calculate i. -3, 2, 381 What is k in -10k5/9 - 2k*4/9 + 4k*3 = 0? -2, 0, 9/5 Factor 2c*2/7 - 5742c/7 + 820. 2(c - 2870)(c - 1)/7 Find k, given that 4k2 - 13792k - 13796 = 0. -1, 3449 Factor -z*4 + 124z*3 + 507z*2 + 638z + 256. -(z - 128)(z + 1)2(z + 2) Suppose -54495f2 + 2755f - 30 = 0. What is f? 1/63, 6/173 Factor 4s3 + 1900s*2 + 3772s - 5676. 4(s - 1)(s + 3)(s + 473) Solve -2x*5/3 - 136x*4/3 + 308x*3/3 + 12280x*2/3 + 12650x = 0 for x. -69, -5, 0, 11 Solve 2o5/3 - 25o*4/3 + 95o*3/3 - 30o*2 - 24o = 0 for o. -1/2, 0, 3, 4, 6 Find l such that 4l3 + 12712l*2 + 151916l - 164632 = 0. -3166, -13, 1 Factor 4516749557042n2/9 + 12022312n/9 + 8/9. 2(1502789n + 2)*2/9 Factor -3r*2 + 6342r + 38160. -3(r - 2120)(r + 6) Factor 5m3 - 2647828m*2 + 350549126313m + 140220074178. (m - 264783)*2(5m + 2) Factor 5b*5 - 15910b*4 - 2204475b*3. 5b*3(b - 3315)(b + 133) Let -2d*3/7 - 412d*2/7 + 418d/7 + 828/7 = 0. Calculate d. -207, -1, 2 Let w*4/3 + 1838w*3/3 + 3613w*2/3 - 36164w - 102816 = 0. Calculate w. -1836, -7, -3, 8 Factor v*2 + 4455v + 8906. (v + 2)(v + 4453) Factor -2a*4 - 56a*3 + 314a*2 - 520a + 264. -2(a - 2)2(a - 1)(a + 33) Find y, given that -y5 + 1062y*4 - 172764y*3 + 7350952y*2 + 31511040y + 32219136 = 0. -2, 96, 874 Factor -5h2 - 6045080h - 1827149610320. -5(h + 604508)2 Let 2a*2/17 - 236a/17 + 3920/17 = 0. Calculate a. 20, 98 Solve 4x2 + 35392x = 0. -8848, 0 What is m in -2m4/7 - 1586m*3 - 15390138m*2/7 + 46248158m/7 - 30846916/7 = 0? -2777, 1, 2 Determine l, given that 6l5/5 - 97744l*4/5 + 3675264l*3/5 - 33902884l*2/5 - 14206566l/5 + 23469332/5 = 0. -1, 2/3, 19, 16253 Factor 3v3/7 + 1083v*2/7 + 89517v/7 + 2148885/7. 3(v + 53)2(v + 255)/7 Let -20n4 + 764n*3 - 1612n*2 + 1012n - 144 = 0. Calculate n. 1/5, 1, 36 Solve -450t5/17 - 1204590t*4/17 + 2571088t*3/17 - 2014352t*2/17 + 685792t/17 - 85728/17 = 0 for t. -2679, 2/5, 2/3 Find x such that 2x3/13 + 13526x*2/13 + 27046x/13 + 13522/13 = 0. -6761, -1 Let i*2/10 + 36821i/5 + 1355786041/10 = 0. What is i? -36821 Find g, given that -2g3/3 - 796g*2 + 36218g/3 - 20956 = 0. -1209, 2, 13 Factor 3p3 + 1854p*2 - 34101p + 154548. 3(p - 9)2(p + 636) Factor 3m3 + 1695m*2 + 11736m + 10044. 3(m + 1)(m + 6)(m + 558) Find w such that -4w*3/5 + 1548w*2/5 - 27840w - 416000 = 0. -13, 200 Find n such that 44n3 - 604n*2 + 404n + 156 = 0. -3/11, 1, 13 Solve -15x4 - 1960x*3 + 78455x*2 - 98420x - 101060 = 0. -163, -2/3, 2, 31 Find q such that -158q5 + 11696q*4 - 135070q*3 + 126652q*2 - 3120q = 0. 0, 2/79, 1, 13, 60 Determine a, given that -2a4 + 136a*3 - 878a*2 + 1464a = 0. 0, 3, 4, 61 What is a in -a*3/8 - 85a*2/4 + 25a/8 + 2125/4 = 0? -17	{ "pile_set_name": "DM Mathematics" }
ibblmmimlmmlmmimcim. What is prob of sequence ic? 2/171 Two letters picked without replacement from hhv. What is prob of sequence hv? 1/3 Three letters picked without replacement from ydqryyqyy. Give prob of sequence rqd. 1/252 Three letters picked without replacement from kkffmuffffmmffm. What is prob of sequence fum? 16/1365 Calculate prob of sequence ea when two letters picked without replacement from {e: 7, a: 9}. 21/80 What is prob of sequence khks when four letters picked without replacement from {h: 1, m: 1, g: 1, k: 3, s: 5, p: 2}? 1/572 What is prob of sequence vd when two letters picked without replacement from dkddudkdvkk? 1/22 Four letters picked without replacement from {h: 3, s: 1, f: 1, u: 3, b: 2, x: 1}. What is prob of sequence bfus? 1/1320 Calculate prob of sequence njz when three letters picked without replacement from zjjkdkjnjzzn. 1/55 Calculate prob of sequence dd when two letters picked without replacement from tiddtoa. 1/21 Three letters picked without replacement from ddddddwnnnwwgd. What is prob of sequence ngd? 1/104 Calculate prob of sequence uf when two letters picked without replacement from ffffuffffffffff. 1/15 What is prob of sequence wr when two letters picked without replacement from {b: 3, w: 3, t: 1, l: 2, r: 2, e: 3}? 3/91 What is prob of sequence lxx when three letters picked without replacement from {x: 6, l: 7}? 35/286 Calculate prob of sequence ixug when four letters picked without replacement from uxyuiuyuiguigu. 3/2002 Calculate prob of sequence yfy when three letters picked without replacement from jyyfwfyyfwywwy. 15/364 Calculate prob of sequence vra when three letters picked without replacement from uvawrvuuu. 1/252 Calculate prob of sequence dduu when four letters picked without replacement from {n: 4, g: 1, u: 2, d: 6}. 1/286 What is prob of sequence pbx when three letters picked without replacement from uxpxbhhhhpuhph? 1/364 Two letters picked without replacement from ofottaoogg. What is prob of sequence ag? 1/45 Two letters picked without replacement from {f: 3, n: 3}. Give prob of sequence fn. 3/10 Calculate prob of sequence byby when four letters picked without replacement from {y: 2, b: 10}. 1/66 Four letters picked without replacement from aajyuttjjujjjvj. What is prob of sequence uyjj? 1/390 What is prob of sequence ab when two letters picked without replacement from {b: 1, v: 2, h: 4, a: 3}? 1/30 Three letters picked without replacement from uusggvguuu. Give prob of sequence guv. 1/48 Two letters picked without replacement from {w: 7, u: 1, s: 2}. Give prob of sequence sw. 7/45 What is prob of sequence df when two letters picked without replacement from {g: 2, d: 5, u: 2, f: 4}? 5/39 Two letters picked without replacement from {p: 6, o: 1, f: 2, m: 3}. Give prob of sequence om. 1/44 What is prob of sequence vyd when three letters picked without replacement from dvvvdvkky? 1/63 Two letters picked without replacement from hjjhgjjjjqqjj. Give prob of sequence gh. 1/78 Two letters picked without replacement from aaabaaaaaabb. Give prob of sequence ba. 9/44 What is prob of sequence baia when four letters picked without replacement from ijssjissabaj? 1/2970 What is prob of sequence emm when three letters picked without replacement from {m: 2, q: 1, s: 3, e: 1}? 1/105 Calculate prob of sequence iwaw when four letters picked without replacement from {a: 6, w: 4, i: 1}. 1/110 Three letters picked without replacement from qpnpqpppnpqqu. Give prob of sequence qnq. 2/143 What is prob of sequence pplf when four letters picked without replacement from {l: 2, c: 5, f: 2, p: 6, m: 1, z: 1}? 1/476 What is prob of sequence cc when two letters picked without replacement from cxcxc? 3/10 What is prob of sequence ya when two letters picked without replacement from {k: 6, a: 11, y: 1}? 11/306 Three letters picked without replacement from {t: 1, d: 4, p: 2, w: 1}. Give prob of sequence twp. 1/168 Two letters picked without replacement from gsgggjetgfejf. Give prob of sequence fj. 1/39 Calculate prob of sequence rzz when three letters picked without replacement from {z: 17, r: 2}. 16/171 What is prob of sequence hykr when four letters picked without replacement from rfhkhyfl? 1/840 Calculate prob of sequence qqq when three letters picked without replacement from qqqq. 1 Two letters picked without replacement from hhpkpkpvphhkhh. What is prob of sequence kk? 3/91 Two letters picked without replacement from eeeleelllleel. What is prob of sequence le? 7/26 What is prob of sequence ffem when four letters picked without replacement from {f: 5, i: 3, e: 1, m: 4, h: 6, a: 1}? 2/2907 Four letters picked without replacement from ywwhhhyowhhywbywyyw. Give prob of sequence yybw. 5/2584 Two letters picked without replacement from rhfrhfrhh. What is prob of sequence ff? 1/36 Two letters picked without replacement from {f: 1, x: 1, i: 1, e: 4, p: 1}. What is prob of sequence ep? 1/14 What is prob of sequence dfz when three letters picked without replacement from dfczdzdccdcdkk? 5/1092 Two letters picked without replacement from ppt. Give prob of sequence pt. 1/3 What is prob of sequence ff when two letters picked without replacement from {l: 2, d: 1, f: 4, i: 2, z: 1}? 2/15 Three letters picked without replacement from {q: 7}. What is prob of sequence qqq? 1 Four letters picked without replacement from nfaaaahttqqaf. Give prob of sequence taqh. 1/858 What is prob of sequence xs when two letters picked without replacement from ssssxsxsxssxssxxss? 4/17 Three letters picked without replacement from ggppg. Give prob of sequence gpp. 1/10 Two letters picked without replacement from taattattmammmtat. What is prob of sequence mm? 1/20 Two letters picked without replacement from {p: 5, x: 1, z: 5}. What is prob of sequence zp? 5/22 Calculate prob of sequence yhh when three letters picked without replacement from httjhynnp. 1/252 What is prob of sequence nr when two letters picked without replacement from nnnnnnnnnnnnnnnnrnn? 1/19 Four letters picked without replacement from rnrnnnnrnrrrnrnrnrrr. What is prob of sequence rrnr? 99/1292 Four letters picked without replacement from zzrzzzzzzyzzzyrrzy. Give prob of sequence yzry. 1/340 Calculate prob of sequence rde when three letters picked without replacement from rierruidtrut. 1/330 Calculate prob of sequence vvy when three letters picked without replacement from {p: 7, v: 3, y: 1, h: 2, x: 1}. 1/364 What is prob of sequence spp when three letters picked without replacement from sspsspppppsppsssppsp? 11/76 Four letters picked without replacement from {f: 7, n: 2, w: 1}. What is prob of sequence nfnw? 1/360 What is prob of sequence jepg when four letters picked without replacement from ypsjejjeypjpgspjjess? 1/1615 What is prob of sequence mwd when three letters picked without replacement from mwttidy? 1/210 Four letters picked without replacement from boboobaba. What is prob of sequence obbo? 1/42 Calculate prob of sequence sd when two letters picked without replacement from {l: 4, c: 1, z: 3, d: 2, s: 1, b: 4}. 1/105 Three letters picked without replacement from {r: 1, n: 1, q: 1, z: 2, w: 2, v: 1}. Give prob of sequence vqq. 0 Two letters picked without replacement from sks. Give prob of sequence ss. 1/3 Two letters picked without replacement from hhhfffhffhhlflhhlf. Give prob of sequence lh. 4/51 Three letters picked without replacement from {t: 17, z: 2}. What is prob of sequence tzz? 1/171 Calculate prob of sequence ic when two letters picked without replacement from {k: 1, a: 4, i: 3, w: 1, c: 4}. 1/13 Three letters picked without replacement from rnnnnffnrnnrr. Give prob of sequence frn. 14/429 Calculate prob of sequence pe when two letters picked without replacement from {p: 2, e: 1}. 1/3 Three letters picked without replacement from zfmfonmmzyzzz. Give prob of sequence fyn. 1/858 Calculate prob of sequence jij when three letters picked without replacement from {q: 7, i: 1, y: 4, o: 4, j: 2}. 1/2448 Calculate prob of sequence kk when two letters picked without replacement from okkkokkkkk. 28/45 Four letters picked without replacement from pppeupepuepe. What is prob of sequence uuee? 1/495 Two letters picked without replacement from {r: 1, o: 4, n: 1, v: 1, t: 2}. What is p	{ "pile_set_name": "DM Mathematics" }
(d) = d*2 - 11d - 2. Let h(s) = 3l(s) - 2r(s). Suppose h(u) = 0. Calculate u. -7, 0 Let h be 60/(-100)3/(-27). Let g(u) be the third derivative of 2u*2 + 0 - 1/120u*6 + 0u*3 - hu*5 - 1/6u*4 + 0u. What is d in g(d) = 0? -2, 0 Let v(y) be the third derivative of y5/20 - y4/2 - 45y3/2 - 851y*2. Let v(p) = 0. Calculate p. -5, 9 Solve 2/7m*4 - 2 - 16/7m*3 + 16/7m + 12/7m2 = 0. -1, 1, 7 Determine r so that 6r*4 + 2/3r*5 + 56/3r*3 + 0 + 32/3r + 24r2 = 0. -4, -2, -1, 0 Let z(g) be the second derivative of -g4/15 + 2g*3/5 + 36g*2/5 - 387g. Solve z(t) = 0. -3, 6 Factor 19z4 - 9 + 35z - 4z4 + 25z - 11 - 50z3 + 15z*2. 5(z - 2)*2(z + 1)(3z - 1) Let s = 5986 + -23941/4. Factor sk - 1/4k*2 - 1/2. -(k - 2)(k - 1)/4 Let i(y) = -y5 - y4 + y*2 + y + 2. Let n(c) = 6c*5 + 10c*4 + 6c*3 - 9c*2 - 13c - 10. Let j(b) = 10i(b) + 2n(b). Factor j(q). 2q(q - 1)(q + 2)3 Let i = -2/153 - -932/1071. Let d = -138 + 968/7. Factor 4/7 - il + dl2. 2(l - 2)(l - 1)/7 Suppose -5w + 2g + 30 = 16, -2g = -2w + 2. Factor fw + 2f*2 + 0 - 1/6f*5 - 2/3f - 13/6f3. -f(f - 2)*2(f - 1)*2/6 Let a(h) be the second derivative of 0 + 0h*2 - 2/5h*5 + 1/15h*6 + 14h + 5/6h4 - 2/3h*3. Let a(b) = 0. Calculate b. 0, 1, 2 Let w(a) = -9a*5 - 2a*4 - 2a*3 + 8a*2 - 9a. Let n(k) = -k*5 - 2k*3 + k. Let g(f) = -7n(f) + w(f). Solve g(p) = 0. -2, 0, 1, 2 Let z(d) be the second derivative of d8/6720 + d7/3360 - d6/1440 - d5/480 - 2d3 - 11d. Let x(c) be the second derivative of z(c). Factor x(u). u(u - 1)(u + 1)*2/4 Suppose m = -4u + 5m + 20, -2m = 10. Suppose 0 = -2f - 3l - 9, -f = -uf + 2l + 7. Factor 4/9g2 - 2/9g*f + 0g + 0. -2g2(g - 2)/9 Let b(x) = 17x + 10. Let o be b(-6). Let c be 8/6(o/(-20) + -4). Solve -6/5k + ck*3 - 2/5 - 4/5k*2 + 6/5k*4 + 2/5k*5 = 0. -1, 1 Let l(p) = 2p*2 - 7p + 21. Let f(i) = 2i2 - 8i + 11 + 2 + 7. Let m(h) = -5f(h) + 4l(h). Factor m(x). -2(x - 4)(x - 2) Let f(o) = 2o3 - 50o*2 - 156o - 168. Let p(t) = t3 - t2 + 2. Let z(k) = -f(k) + 6p(k). Factor z(j). 4(j + 3)*2(j + 5) Let w = -69 - -72. Let t(z) be the first derivative of -2/33zw + 0z + 1/11z2 - 8 + 2/55z*5 - 1/22z*4. Let t(a) = 0. What is a? -1, 0, 1 Let t(i) = 18i*3 + 146i*2 + 260i + 52. Let a(k) = -19k3 - 145k*2 - 260k - 50. Let s(y) = -2a(y) - 3t(y). Solve s(v) = 0 for v. -7, -2, -1/4 Let f(r) be the second derivative of r8/6720 - r7/2520 + 4r4/3 + 30r. Let y(d) be the third derivative of f(d). Factor y(i). i*2(i - 1) Let n be 8/(-8) - 12/(-2). Suppose v - nv + 108 = 0. Let 6t - 3t2 + 6t + 20t3 + vt*2 + 2 + 6t*4 = 0. What is t? -1, -1/3 Let c(x) be the third derivative of -2x*7/105 + 7x*6/30 - 16x*5/15 + 2x*4 + 5x*2 + 6. Factor c(b). -4b(b - 3)(b - 2)*2 Let x = 331 - 328. Let q(m) be the first derivative of -1/10m*4 - 2/15m*x + 2/25m*5 + 0m + 1/5m2 - 6. What is i in q(i) = 0? -1, 0, 1 Let w(x) be the third derivative of -9x*2 + 2/45x*5 + 0 + 0x + 1/4x4 + 2/9x*3. Factor w(k). 2(k + 2)(4k + 1)/3 Let d be 93/2 + 12/8. Suppose 2u - d = -4u. Factor -30p2 + 0p*2 - 42p*2 + up + 20p2 + 84p*3. 4p(3p - 1)(7p - 2) Let a = 831 - 411. Let z = a - 2091/5. Let 2/5f - f4 + 1/5f*5 + 0 + zf*3 - 7/5f*2 = 0. What is f? 0, 1, 2 Let d(s) = -9s*3 + s. Let f be d(-1). Let v be ((-12)/f - -2)4. Factor -g*4 + 6g3 + gv - 7g3 + 2g3 - g5. -g*2(g - 1)(g + 1)2 Suppose 7x - 1 = 27. Suppose -54 + 2lx + 12l*2 + 16l*3 + 20l*2 + 4l*2 = 0. Calculate l. -3, 1 Find s, given that -5s*2 + 2s*2 + 108 + 9s - 86 + 2s2 = 0. -2, 11 Factor 16p*5 - 44p*5 + 4p*2 + 4p*3 + 11p5 - p4 + 16p5. -p2(p - 2)(p + 1)(p + 2) Suppose 5u + 3j + 22 = 207, 2u = j + 74. Let s = u - 35. Factor 2/7z*s + 0z + 0. 2z2/7 Let a = 581 - 6967/12. Let l = 1/4 + a. Factor 0 - 2/3f*2 + lf. -2f(f - 1)/3 Factor 1020p2 + 69360p + 642p3 - 320p*3 + 1572160 - 317p*3. 5(p + 68)*3 Solve 4/3v*3 + 2/3v*4 - 10v*2 - 64/3v - 32/3 = 0 for v. -4, -1, 4 Let g = -708 + 708. Let f(x) be the first derivative of gx3 + 6 - 3/4x*4 + 9/2x*2 + 6x. Factor f(o). -3(o - 2)(o + 1)2 Let t = 13836 + -13836. Suppose c2 - 2c3 + 0c + 3/4c5 + t + 1/4c4 = 0. Calculate c. -2, 0, 2/3, 1 Let n(c) be the third derivative of c5/120 - 7c4/4 + 147c*3 - 27c*2 - 1. Determine t, given that n(t) = 0. 42 Let p = 12 - 9. Let k = 0 + p. Suppose 146 + 10h*2 - 146 - 15hk = 0. What is h? 0, 2/3 Let d(a) be the second derivative of -a7/140 - a6/40 - a5/40 + 37a2/2 - 18a. Let m(g) be the first derivative of d(g). Factor m(c). -3c2(c + 1)*2/2 Suppose -6u*4 + 11 + 35u*3 + 16 + 16u*4 - 82u*2 + 2u*5 - 61u*3 + 24u + 45 = 0. What is u? -6, -2, -1, 1, 3 Solve 12b3 + 14821 - 29620 + 150b - 2b5 + 14745 - 124b*2 + 18b*4 = 0 for b. -3, 1, 9 Find m such that 106m + 88m - 9m - 350m2 + 35m - 40 + 125m3 = 0. 2/5, 2 Let v be (2 - (-9)/(-4))/(28/((-896)/12)). Let 4/3 + vr - 2/3r2 = 0. Calculate r. -1, 2 Factor 10k*4 + 6k*2 + 25k*2 - 59 - 21 + 84k*2 - 75k*3 + 120k. 5(k - 4)2(k + 1)(2k - 1) Factor -6/5 + 2/5w2 + 11/5w. (w + 6)(2w - 1)/5 Suppose -275l = -282l. Factor 2/11z + l + 0z*2 - 2/11z*3. -2z(z - 1)(z + 1)/11 Let 3/4x2 - 27/4 + 6x = 0. What is x? -9, 1 Let g(i) be the first derivative of -i*3/7 + 3i*2/14 + 6i/7 - 73. Factor g(o). -3(o - 2)(o + 1)/7 Let w be (2/(-6))/(22 - (-2136)/(-96)). Determine o, given that -w + 11/3o + o2 = 0. -4, 1/3 Let i be 12/14(-18)/(-4). Let b be 2 - 176/(-140) - (-6)/10. Factor iu + 1/7u*3 + 9/7u2 + b. (u + 3)3/7 Let h be (-1 + -1)/((-9)/18). Suppose h = -x + 10. Factor -3w + 0w - xw5 + 0w*5 + 3 + 3w*4 - 6w*2 + 3w*5 + 6w*3. -3(w - 1)*3(w + 1)*2 Let m(y) = 3y*2 + 40y - 10. Let q be m(-14). Suppose qr - 50 = -7r. Factor -9/5dr - 3d*3 - 3/5d*4 + 27/5d + 0. -3d(d - 1)(d + 3)2/5 Factor -11/4g*2 + 1/8g*3 - 27/4 + 75/8g. (g - 18)(g - 3)(g - 1)/8 Determine l so that 0 + 8/3l + 2/3l*5 - 2l*2 - 10/3l*3 + 2l*4 = 0. -4, -1, 0, 1 Suppose -3u - 4g - 1 = 0, -5g = -g + 16. Suppose 12lu - 7l*4 - 36l*3 + 17l*4 - 16l - 2l4 - 48l*2 = 0. What is l? -1, -2/3, 0, 2 Let c(o) be the first derivative of 1/24o*4 + 1/3o + 0o3 - 1/4o2 + 16. Factor c(l). (l - 1)2(l + 2)/6 Let h(l) be the third derivative of -49l*6/24 - 2569l*5/12 + 925l*4/3 - 530l*3/3 - 267l*2. Factor h(r). -5(r + 53)(7r - 2)*2 Let f = -1387 + 1388. Determine k, given that -1/2k + 1/2k2 - f = 0. -1, 2 Let l be 18/5 - 6/(-15). Let r(w) = w3 + 4w*2 + 4w + 2. Let y be r(-2). Factor g*4 - 6g3 + g5 + 1 + g + lg3 - yg*2 + 0g4. (g - 1)2(g + 1)3 Let m(q) be the first derivative of -3/2q + 3/4q4 + 3/10q*5 - 17 - 3/2q*2 + 0q*3. Factor m(g). 3(g - 1)(g + 1)3/2 Let k = -6 - -9. Factor 5r*5 + 8r*5 + 8r*5 - 24r*5 - kr + 6r3. -3r(r - 1)2(r + 1)*2 Suppose 5s = 9 + 11. Let b(g) be the third derivative of 1/24g6 + 0g*3 + 12g*2 - 1/6g*5 + 0 + 0g*s + 0g. Solve b(c) = 0. 0, 2 Let u(x) be the second derivative of -4/33x3 + 27x - 1/66x4 + 0 - 4/11x*2. Let u(q) = 0. Calculate q. -2 Let g(a) = -47a*4 + 7a*3 + 32a*2 + 8a. Let d = -35 + 34. Let n(y) = -y4 + y3. Let x(p) = dg(p) - 3n(p). Factor x(s). 2s(s - 1)(5s + 2)*2 Let g = 196 - 191. Let d(m) be the first derivative of 4m - 4m2 + 0m*3 + 3 - 4/5m*g + 2m*4. Factor d(b). -4(b - 1)*3(b + 1) Suppose -4t2 + 11184t*5 + 12t*2 - 8t*4 + 4t*3 - 11188t*5 = 0. What is t? -2, -1, 0, 1 Let u = -868 - -2608/3. Let p(t) be the first derivative of 9 - ut*3 + 0t*2 + 2/5t*5 + 1/2t*4 + 0t. Determine f, given that p(f) = 0. -2, 0, 1 Let i(r) = 5r2 + 65r - 114. Let k(z) = -5z2 - 60z + 113. Let h(v) = 3i(v) + 4k(v). Determine a, given that h(a) = 0. -11, 2 Suppose 3 = -d + 15. Suppose -w + d = 5w. Let -2z - wz4 + 8 - 6z*2 + 8z*3 - 6z + 0 = 0. Calculate z. -1, 1, 2 Let c = -146 + 149. Factor -cf*	{ "pile_set_name": "DM Mathematics" }
z2 + 0z*2. 3z2 Expand g4 - 7 + 7 - 3g3 - g4 + 3g*3 + 0g*2 + 2g*4 + 0g2 - g4 + 0g4 + 3g4 + (-4 + 4 - g2)(-2g*2 - 3g*2 + 3g*2). 6g*4 Expand ((4f*3 + 3f*3 - 5f*3)(f + 3f - 3f) + f*4 + 0f*4 + 0f4 - f4 + 6f4 + 0f*4)((-1 - 1 + 0)(-f + 3f - f) + 2f - 4f + 3f). -8f*5 Expand 2h4 + h4 - 5h4 + (4 - 4 + 2h*2)(-3h2 + 0h*2 + 5h*2) - 2h4 - h4 + 5h4 + h4 - h4 - 3h4. h4 Expand -o*3 - 4o + 4o + (-6 + 1 + 3)(-2o3 + 2o*3 - 2o*3) + 4o*3 - 18o*3 - 7o*3 - 3o*3 + 3o3 + o3. -17o3 Expand (0p + 0p - 2p)(3p*2 + 1 - 3 + 3). -6p*3 - 2p Expand -c*5 - 3c*5 + 3c*5 + (-5c*3 + 8c*4 + 5c*3)(-2c + 4c + 0c). 15c*5 Expand (4g*4 - 3g4 + g4)(3g - 5g + g) - 12g*5 - 10g*5 + 27g*5 + 3g*5 - 2g*5 - 2g*5 + 2g5 + g3 - g*3. 4g5 Expand ((u2 + u*2 - 3u*2)(2u + 1 - 1) - 1 + 1 + u3)(u - 3 + 7u + 0). -8u*4 + 3u*3 Expand 6 + 2t2 - t2 + 3 - 2t2 + t2 + 3t*2 + 2t2 - t2 + t*2 + (2t - t + t)(0 + t + 0). 7t*2 + 9 Expand (-8h + 8h + 10h*3)(2h2 + 4h2 + h2). 70h5 Expand (-3p*5 - 6p + 2p5 - p5)(2 + 8 - 4). -12p5 - 36p Expand (2 + 3 - 6)(1 - 4 + 1)((0 + 0 + 2)(q - 3q + 3q) + 4q + 2q - 4q). 8q Expand 0f3 + f4 + 0f3 + (3f*3 - 3f*3 + 2f*3)(-3f + f + 4f) + (0f2 + f2 - 3f*2)(-f*2 + 9f*2 + 2f*2). -15f*4 Expand (3 + 0 - 5)(6i2 + 4i*2 - 17i*2 + 6i2 - i2 - 2i2 + (6i - 3i - 2i)(-4 + 4 + 2i)). 4i2 Expand 2v4 + v4 - v*4 + (-1 - v + 1)(0v + 4v - 3v)(0v2 + 2v*2 - 4v*2). 4v*4 Expand w - 3 + 3 + (-3w - 3w + 4w)(1 - 2 + 3) + w + 4w - 4w - w + w - w + 3w - 4w + 3w - 9w - 15 + 15. -10w Expand (-s + 6s - 3s)(-7 + 8 + 14)(4s - s - s). 60s*2 Expand 0u*2 + 2u*5 + 0u*2 + (3u + 4u - 4u)(11u - 11u - u4). -u5 Expand (3 + 1 - 2)(1 - 1 - 1)(3 - 9 + 5)(0 + 2n + 0). 4n Expand (m + 5m - 2m)(3m - m*3 - 3m + (-m*2 + 2m*2 - 3m*2)(-5m + m + 2m) + (2m + 2m - m)(5m*2 + 0m*2 - 4m*2)). 24m*4 Expand (-4o2 + o2 + o*2)(-2o2 + 3 + 0 - o3 - 4). 2o*5 + 4o*4 + 2o*2 Expand (x - 3x + x)(26x + 9x3 - 11x*3 - 37x - x4). x5 + 2x4 + 11x*2 Expand 0c + 2c + 0c + 4c + 0c - 3c + (17 - 11 + 14)(5 - c - 5). -17c Expand (2w*2 - w + w)(0 - 1 + 0) - 2w2 + 0w*2 + 3w*2 - 3w*2 - 89w - 18 + 89w. -4w*2 - 18 Expand (2p*2 + 2p - 2p)(2p2 - 3p2 - p2) - 3p4 + 5p*4 - 4p*4 + 5p*4 + 5p*4 - 9p*4. -5p4 Expand (o - o + o2)(-2 + 25 - 2). 21o*2 Expand (4c*2 - 10c*2 - 2c*2 - 2)(2 + 1 - 5). 16c2 + 4 Expand (9c - 58 + 58)(-2c + 3c + c)(0c2 + c2 + 3c*2). 72c*4 Expand (-4 + 3 + 3)(-1 + 1 - v) + 2v + 14v - v + (-3 - 2 + 4)(-3 - v + 3) + 0v - 3v - 3v. 8v Expand (-b4 + 4 - 4)(0 - 5 - 44). 49b4 Expand -2t - 4t + 5t - t - 3t + 3t + (-t - 3 + 3)(5 - 2 - 1) + 2t + 0t - 4t + (3 + 5 + 2)(3t + 0t - 2t). 4t Expand 2t3 + t2 - t*2 - 5t*3 + 2t - 2t + (2t - t + t)(0 + 0 + t2) + 2t*3 - 6t*3 + 3t*3. -2t3 Expand -f5 + 2f5 - 3f*5 + (-1 + 1 - 3f)(0f*4 + 0f*4 + 2f*4) + 2f*5 + 3f*2 - 3f*2. -6f*5 Expand 59 + 12f4 - 59 + (-2 + f4 + 2)(5 - 4 + 0). 13f*4 Expand (4d + 0d + 2d)(d - 3 - 2d + 5) + (-d*2 + 0d*2 + 3d*2)(-2 + 4 - 3). -8d2 + 12d Expand (-3i + 2i + 0i)(-3 + 7 - 8)(i - 2i - i). -8i2 Expand -3j*3 + 5j*3 + 0j*3 + (3j - 3j + j3)(4 + 1 + 1). 8j3 Expand (-k4 - 1 + 1)(-1 + 0 - 1) - k*4 + 6k*4 - 4k*4 + (3k*2 - 3k*2 - 2k*2)(0k2 + k2 - 2k*2). 5k*4 Expand (-22m*2 - 17m + 17m)(5m3 - 6m*3 + 3m*3) - 2m5 + m4 - m*4 + (-3 - 4 + 5)(0m5 - 3m*5 + 4m*5). -48m*5 Expand (-2r*2 - 4r*2 + 7r*2)(-5r2 - 2r*2 + 4r*2 + (-3r*2 + 4r*2 - 3r*2)(-4 + 5 - 2) - r2 - r2 + 4r2) - 2r4 - r4 + r4. -r4 Expand (0 - 2o - 2 + 0o)(6o*2 + 4o*2 - 3o*2). -14o*3 - 14o*2 Expand (5m + 3m - 5 - 9m)(-m - 1 + 1). m2 + 5m Expand (-a - a + 4a2 - 2a*2)(-4a + 3a - a)(1 + 7a - 1). -28a4 + 28a*3 Expand -2i*5 - 5i - 3 + 5i + 3i5 + i5 - 2i5 + 0i4 - i5 + 0i4 + (-4i4 - i5 + 4i4)(1 - 2 - 1). i*5 - 3 Expand (2d + d*2 - 2d)(2 - 6 + 3) + d2 + d2 - 3d*2 + 0d*2 + 3d*2 - 2d2. -d2 Expand (5 - 9 - 6)(5 - 1 - 3)(-2p + 5p - 2p). -10p Expand (-5i + 4i + 0i)(52 - 52 + 30i). -30i*2 Expand 2r*4 - 2r + 2r + (3r - 5r + 3r)(3r3 + 0 + 0) + (r2 + 0r2 + 0r*2)(1 - 1 - 2r2) + 2r*4 - 6r*4 + 3r*4 - 4r + 4r - r4. r4 Expand (2 - 2 + 1)(-4p - p + 4p)(-1 + 1 + 2). -2p Expand 5z5 + z5 - 4z*5 + (-3 + 3 + 3z*2)(0z3 + z3 + z3) - z5 + z5 - z5. 7z*5 Expand (-p - 3 + 3)(-2p3 + 3p*2 - 3p*2)(3p + 0p + 2p). 10p*5 Expand (-6k*4 + 2k*4 + 2k*4)(-k + 2k + 0k) + (k2 - k2 - 3k2)(4k2 + k3 - 4k*2). -5k*5 Expand (-5 + 3 + 0)(5v - 2v - 5v)(2v4 - 3v*4 - 8v*4). -36v*5 Expand (-3g + 0g - g)(-1 + 0 + 0) + (3 - 3 + 1)(2g - 3g - 2g). g Expand (4n + 3n - 5n)(-13n3 - 20n3 + 2 - n3). -68n4 + 4n Expand i*2 - 4i3 - i2 + (-i + 0 + 0)(-2i*2 + i - i) + 0i*3 - 2i*3 + 3i3. -i3 Expand (1 - 1 - 3x + 3x - 3x - x + (-3 + 0 + 1)(2 + 2x - 2))(13x - 13x + x*2). -8x*3 Expand (7u - 3u - 17u)(2u - 4u + 1 + 3u). -13u2 - 13u Expand (m - 4m + 2m)(18 - 3 + 0)(2 - 6 + 2). 30m Expand (-2j*3 + 3j*3 + j - 3j + 6j3 + 8j*3 - 6j*3 + (3 - 2 + 1)(-2j3 - j3 + j3))(j*2 - 2j*2 + 3j*2). 10j*5 - 4j3 Expand (o2 - 2 + 2)((-4 - o + 4)(-1 + 1 + 2) - 2o - o + 2o). -3o3 Expand -u2 + u2 - 2u - 2u4 + (u3 + 0u*3 - 2 + 0)(10u - 8u - 7u). -7u*4 + 8u Expand (5c4 - 5c*4 - 2c*4)(-2 + 2 - 6). 12c4 Expand (0 + 5 - 3)(-v - v + v + (0 - 1 + 0)(4v - 4v + 2v) - 2 + 2 - 2v + 2v + v - 2v). -8v Expand (-i + 0i - 2i + (-4i + 0i + 5i)(-1 + 0 + 0) - 2 - 2i + 2)(0i2 + 4i*2 - 3i*2). -6i*3 Expand (j + 3j - 2j)(5j - 2j + 18j + (-2 - 4 + 4)(3j - 4j + 0j) + 0j + j - 2j). 44j*2 Expand (12 - 12 + 4k*3 + (0k*2 + 0k*2 + 2k*2)(0k + 4k - 2k) + 9 + 3k*3 - 9)(-4 + 2 + 1). -11k3 Expand ((3s - 2s + 2s)(0 + 1 - 2) + 2s - 3s + 3s + (s + 5s - 4s)(-1 + 0 - 1))(3 + 4 - 3). -20s Expand -t3 - 3 + 3 + (t - 3t - 2t)(4t2 - 3t*2 - 3t*2). 7t*3 Expand (-11x + 2x + 35x)(1 + 3x - 1). 78x2 Expand (0 - 7 + 8)(0w - 3w + 2w) - 1 + 0w + w - 2w. -2w - 1 Expand (0q2 + 3q*2 - 2q*2)((-4 - 4 + 6)(-6q + 3q + q) + 3q - 6q + 13q) + 4q3 + q2 - q2. 18q*3 Expand (-5 + 7 + 5)(-2t2 + 3t*2 + 13t*2). 98t2 Expand (t2 - 3t2 + t2)(-1 + 5 + 0). -4t2 Expand (88v - 45v - 43v - 53v2)(-2v3 + 5v3 - v3). -106v5 Expand 2p3 + p3 - 4p3 + (p3 + 2 - 2)(-3 + 0 + 5) + (4p - 2p - p)(-1 + 1 + 2p*2). 3p*3 Expand (-5z + z + 2z)(-4z2 - z2 - z2). 12z*3 Expand (-3 + 3 - 2x)(3 - 4 + 2) + (0x - x + 2x)(-2 + 0 + 3) - x - 5x + 2x + 2x - 4x + 0x + (2 + 2 - 5)(x - 2 + 2). -8x Expand (2 + f - 2 + 2 + f - 2 + (0f + f + 0f)(5 + 0 - 3))(-6f + 4f - f). -12f*2 Expand (3 - 3 - 2q)(0q - 26q4 + 25q*4 - 6q). 2q5 + 12q*2 Expand 2k3 - k3 + 0k3 + (1 - 1 + 5k)(-7 + 7 - k2). -4k*3 Expand (4 + 2u - 4)(0u2 + u3 + 0u2) + 3u*4 - 4u*4 + 0u4. u4 Expand -80u3 - 12u2 - u2 + 13u2 + (-1 - 3 + 6)(-4u3 - 2u*3 + 4u*3). -84u*3 Expand (0d3 + d3 + d*3)(-d2 + 2 - 2) + d5 + 0d3 + 0d*3 + 4d - 4d - d5 + (21 - 11 - 9)(-3d2 + d5 + 3d2). -d5 Expand (5n2 - 12n*2 - 38n2 + 3 - 3 - n2 + (-3 + 3 + n)(0n + n - 3n))(-3n2 - 2n*2 + 3n*2). 96n4 Expand (-u4 - 2u4 + 6u*4)(-5 + 2u + 5) - 24u*2 - 2u5 + u4 - 2 + 24u2 - u. 4u5 + u4 - u - 2 Expand (37x - 4x + 2 - 12x)(-3x - 2x + 3x). -42x*2 - 4x Expand (4o2 - 4o*2 + 2o*2)(2o + 1 - 1 + (1 - 4 + 5)(-4 - 2o + 4) - o + 4 - 4 - 2o + 1	{ "pile_set_name": "DM Mathematics" }
y = 23 - 20. Is i(y) a multiple of 18? False Is 38 a factor of (-6)/(-4)(1348/12 + -3)? False Let b(n) = -n2 + 14n + 11. Is 9 a factor of b(11)? False Let q(h) = -h*3 - 3h*2 - 2h - 8. Let a be q(-7). Suppose -5t = 3f - 0f - 234, 4t - a = 5f. Is t a multiple of 16? True Let r = 11 - 8. Suppose -2n - y + 2 = -r, -n = -5y - 19. Suppose -35 = -u - 2u - 5l, -2l + 56 = nu. Does 4 divide u? False Suppose 2b = 17 - 7. Suppose -59 = -bu - 14. Is u a multiple of 9? True Suppose 2h - 637 = -2h + n, h + 3n = 169. Let t = -67 + h. Does 35 divide t? False Let h = 5 - 0. Let z = h + -3. Suppose 3t - 155 = -zt. Is t a multiple of 13? False Let r = 3 - -2. Suppose -p = -2n + 8, -4p = n - 3n + 20. Suppose 0 = -ri + 25, 2q + ni + i = 45. Does 15 divide q? True Let i = -3 - -6. Let f = i - -3. Is f a multiple of 4? False Let l(y) be the third derivative of -y*5/60 - 3y*4/8 + 5y*3/3 + 4y*2. Is 5 a factor of l(-9)? True Let j(g) = 2g*2 + 6g - 3. Let x be j(4). Let r = -36 + x. Does 10 divide r? False Let m(o) = o*2 + o + 2. Does 14 divide m(5)? False Let i(k) = k - 3k2 + k2 - 2k2 - k3 - 6k*2 + 13. Is 2 a factor of i(-10)? False Let m(k) = -5k + 5k - 12k. Let s = 20 - 22. Does 13 divide m(s)? False Suppose 2n - 3i = -3n, 0 = 2n - 5i + 19. Let m = n + -9. Let f(z) = 2z*2 + 8z + 5. Is f(m) a multiple of 18? False Suppose u = -2y + 3y - 19, -4y = -u - 91. Is 9 a factor of y? False Let m be (-5 + 1)(-72)/3. Suppose -6w = -2w - m. Is 8 a factor of w? True Let d be (-2 - -3)2/2. Suppose 2 + d = c. Suppose -21 = -cr - 0. Does 7 divide r? True Suppose 4i = -40 + 120. Does 7 divide i? False Let g(w) = 8w*3 + 5w - 3w + 5w*2 - 6w*2 - 1 + 0w. Is g(2) a multiple of 16? False Let o be (3 - 2) + 2 + -1. Let q(p) = -2p2 - 5p*2 - 2 + 4p + 6p2. Is q(o) even? True Suppose 2d + 3d - 220 = 0. Let b = d + -14. Is 7 a factor of b? False Suppose -14 = -3n - 5. Suppose 2j = -z - 5 + 37, nz + 5j = 95. Is 5 a factor of z? True Let u(k) = -k3 - 6k*2 + 6k - 6. Let y be u(-7). Let f be 2-2y/2. Is f(-15)/6 - 3 a multiple of 2? True Let p(j) = -4j - 13. Is 3 a factor of p(-7)? True Suppose 11 = -5m - 9, x + m = 48. Is 20 a factor of x? False Suppose -8b + 218 + 86 = 0. Does 13 divide b? False Suppose -7c + 108 = -6c. Is c a multiple of 18? True Suppose -5g = -3s - 0s - 25, -3s + 20 = 4g. Suppose 0 = -sq - 3q + 291. Suppose -q - 28 = -5c. Does 8 divide c? False Suppose 0 = -5j + 5t - 2t - 336, -t = -j - 66. Let f = j + 97. Suppose 0x - x = -f. Is 14 a factor of x? True Suppose -k + 9 = 2k. Suppose -6 = -2j - j. Suppose ky - 33 = -js + 10, 0 = 4y - 5s - 42. Is 13 a factor of y? True Let s(m) = -m - 1. Let i be s(-6). Suppose -a + 90 = 3d - ia, -d = -3a - 25. Does 17 divide d? True Let x(n) = -6n*3 + 3n*2 - n - 2. Let i be x(2). Let g = 60 + i. Is 10 a factor of g? True Let o(g) = -3g*3 - 5g*2 - 3g + 4. Let p be o(-3). Let u = 144 - p. Suppose 0 = -4k - k + u. Is 10 a factor of k? False Let t = 26 - -134. Is t a multiple of 20? True Suppose -3p = 3j - 12 - 3, 4j + 3p - 22 = 0. Suppose -jf + 101 + 4 = 0. Is f a multiple of 9? False Suppose 2c + 10 = c - 3g, -2g - 3 = -3c. Let r = c + 3. Suppose -rz = -62 + 6. Does 15 divide z? False Let t(b) = b3 - 3b*2 - 4b - 4. Let m be t(-2). Let i = m + 22. Is i a multiple of 2? True Suppose 0 = 3p + 2 - 17. Suppose 5h + 4q = -32 - 14, 2q = ph + 22. Let l(s) = -6s + 2. Does 15 divide l(h)? False Suppose 0 = -5g - 2c + 356, 4g = -4c - 0c + 280. Is g a multiple of 12? True Suppose -4b = -5h + 347, 3b - 77 = -h - 0h. Does 30 divide h? False Suppose -5o + 7 = -8. Let u = 79 - o. Does 25 divide u? False Let u be ((-75)/(-20))/((-2)/(-8)). Suppose 0 = -3p - 4i + 45 + u, -4i = 0. Suppose -4a - 5c + 20 = 0, -c = 4a - 5c - p. Is 5 a factor of a? True Let c(g) = -g + 1. Let x be c(4). Let n = 1 - x. Suppose -4z + 3f = -62, nz - 2f + 10 = 70. Is 7 a factor of z? True Let b be (-5)/15 - (-1)/3. Suppose -5i + i + 60 = b. Let v = i - 1. Is v a multiple of 7? True Suppose 2w + 54 = 4c + 626, -2c = 4w - 1184. Does 8 divide w? False Let s(o) = -o3 + o2 - o + 13. Let w be s(0). Is (-14 + w)/(2/(-44)) a multiple of 11? True Suppose -k = 2b - 175, 6k = 2k - 20. Is b a multiple of 18? True Let h(c) = 128c3 + c2 + 2c + 1. Let u be h(-1). Let t = u + 182. Is t a multiple of 18? True Let n(i) = i2 - 2i - 6. Let j(p) be the first derivative of 4p3/3 - 9p*2/2 - 23p + 2. Let m(l) = -2j(l) + 9n(l). Does 19 divide m(7)? False Let l = 4 - -1. Suppose 3u - 4 = lu. Let m(r) = -9r + 2. Is m(u) a multiple of 12? False Suppose 0 = 2o + 113 - 513. Suppose -d - o = -3d. Is d a multiple of 27? False Let f be ((-6)/(-12))/((-2)/(-8)). Let g = f - 2. Suppose 3k + 24 - 117 = g. Does 8 divide k? False Let l(y) = 22y + 15. Is l(9) a multiple of 35? False Suppose -2l + 17 = -7. Is 14 a factor of 333/l + (-3)/(-12)? True Let t be (-3)/(-3) + (-165)/(-3). Suppose 3z + 4h - 71 - t = 0, -4h = -5z + 233. Suppose -m - z = -4m. Is 7 a factor of m? False Let u = -126 + 171. Does 5 divide u? True Let n = 323 + -190. Let q = -93 + n. Let j = q + -29. Is 11 a factor of j? True Suppose 0 = -4h + 68 + 60. Is 8 a factor of h? True Is 20 a factor of 79 + ((-24)/(-16))/(3/(-4))? False Let f(g) = g*3 - 2g - 1. Let o be f(2). Does 17 divide o/1 + 66/3? False Suppose 0c - 4c = -68. Does 3 divide c? False Let x(f) = -f - 1. Let h be x(-1). Suppose 2t - 37 = -3k + t, -3k + t + 47 = h. Is k a multiple of 14? True Does 9 divide (-3)/(-9) + 77/3? False Let k be (4/7)/(8/28). Suppose -3o + 2o + k = 0. Suppose -h + 14 = -o. Is 16 a factor of h? True Let g = -12 + 27. Suppose 4a = -a + g. Is a a multiple of 3? True Suppose -5s + 20 = -5. Suppose 4d - 2u - 28 = -3u, su = 4d - 4. Is ((-18)/(-4))/(d/12) a multiple of 9? True Let g be 14/(-4)2-1. Let h = g + -4. Let p = 14 - h. Does 7 divide p? False Suppose -7 = -4s + 45. Let r = s - -21. Does 14 divide r? False Let y = -21 + 48. Is y a multiple of 7? False Let v = -128 - -195. Suppose -4g + k = -153, 3g - 44 = -3k + v. Is g a multiple of 19? True Let g = -97 + 181. Is g a multiple of 21? True Let s(u) = 11u + 167 + 13u - 167. Is s(2) a multiple of 12? True Let n = -280 + 550. Is 52 a factor of n? False Let z = 2 - 8. Is ((-8)/z)/((-8)/(-132)) a multiple of 16? False Let x be -13 + 9 + (2 - -100). Let w = x + -41. Is 14 a factor of w? False Let q(z) = 4z2 - 1. Let j(r) = r - 10. Let t(y) = -y + 4. Let a be t(-4). Let u be j(a). Is q(u) a multiple of 10? False Let d = 3 + -3. Suppose y - 68 = -2n - 26, 5y - 4n - 238 = d. Suppose 2b + 3t - y = -t, 2b - t - 21 = 0. Does 10 divide b? False Suppose 2t = 39 + 3. Is 7 a factor of t? True Let g(y) = 6y + 1. Let i be (-12)/(-2 - 1) - -1. Suppose 3v - 2v = -4o + 22, io + 3v = 24. Is 23 a factor of g(o)? False Suppose 4a = -n + 6n + 11, 15 = 3n. Is a a multiple of 3? True Let o(l) = 9l*2 - 2l + 5. Does 2 divide o(2)? False Does 14 divide 21/24/3? True Let z be (-8)/12(-117)/1. Let i = -42 + z. Is i a multiple of 10? False Let y = 46 - 25. Let m be (-345)/7 + 6/y. Let b = m - -69. Does 18 divide b? False Let n = 211 + -145. Is n a multiple of 11? True Let b = 561 + -95. Is b a multiple of 76? False Let m(t) be the third derivative of t*4/4 + 3t*2. Let a be m(1). Does 5 divide 9/(-3)(-10)/a? True Let t(f) = 9f2 + 4f - 3. Suppose 2l + 5p - 19 = 0, -4l - 10 = -5p - 3. Is t(l) a multiple of 21? False Let c(d) = -d*2 - 19d - 33. Is 19 a factor of c(-12)? False Let t be (-1)/(-3 - -2)2. Suppose -5c = 2i - 32, -ti + 0i - 8 = -5c. Is 6 a factor of i? True Let r be (-3)/(13/(-39)). Let s = r + 1. Is s a multiple of 8? True Suppose 0 = 4c + 22 - 58. Is c a multiple of 5? False Suppose -2x + 3 + 3 = 0. Suppose 0 = -0i - 4i + 2j + 40, -5i - 5j + 80 = 0. Suppose -x = -t + i. Is 12 a factor of t? False Suppose 36 - 396 = -5u. Is 18 a factor of u? True Let b(m) be the first derivative of -68m3/3 - m2 - m - 1. Let w be b(-1). Let p = -35 - w. Is p a multiple of 22? False Is 32 a factor of 128 + 0 + 3 + -1? False Suppose 2z + 3z - 20 = -4l, -2l = -4*z	{ "pile_set_name": "DM Mathematics" }
5, 23, 2141 List the prime factors of 286442. 2, 13, 23, 479 List the prime factors of 11199738. 2, 3, 11, 169693 List the prime factors of 320279. 53, 6043 What are the prime factors of 26369812? 2, 7, 61, 15439 List the prime factors of 138821. 138821 What are the prime factors of 5623145? 5, 11, 19, 5381 What are the prime factors of 1026718? 2, 7, 11, 59, 113 List the prime factors of 266624. 2, 2083 List the prime factors of 2873839. 2873839 List the prime factors of 2137246. 2, 89, 12007 What are the prime factors of 56590? 2, 5, 5659 What are the prime factors of 2753761? 31, 211, 421 What are the prime factors of 496937? 7, 70991 What are the prime factors of 14462918? 2, 7231459 What are the prime factors of 5032447? 7, 31, 3313 List the prime factors of 6634957. 7, 947851 List the prime factors of 383761. 7, 73, 751 List the prime factors of 172440. 2, 3, 5, 479 List the prime factors of 2772206. 2, 31, 61, 733 What are the prime factors of 285294? 2, 3, 17, 2797 What are the prime factors of 2233451? 11, 277, 733 List the prime factors of 13735926. 2, 3, 254369 What are the prime factors of 3554038? 2, 1223, 1453 List the prime factors of 2107208. 2, 263401 What are the prime factors of 6376299? 3, 197, 10789 List the prime factors of 195744. 2, 3, 2039 List the prime factors of 6947222. 2, 3473611 List the prime factors of 218145. 3, 5, 14543 What are the prime factors of 125527? 125527 What are the prime factors of 4017629? 7, 11, 52177 List the prime factors of 11281671. 3, 1253519 List the prime factors of 1972322. 2, 11, 37, 2423 What are the prime factors of 3109352? 2, 137, 2837 List the prime factors of 2547379. 547, 4657 List the prime factors of 357648. 2, 3, 7451 What are the prime factors of 27639615? 3, 5, 1842641 List the prime factors of 273999. 3, 11, 19, 23 What are the prime factors of 15840703? 401, 39503 List the prime factors of 431902. 2, 17, 12703 What are the prime factors of 195265? 5, 7, 797 List the prime factors of 365246. 2, 7, 3727 What are the prime factors of 6060240? 2, 3, 5, 19, 443 What are the prime factors of 641159? 73, 8783 What are the prime factors of 162554? 2, 7, 17, 683 List the prime factors of 5911410. 2, 3, 5, 17, 67, 173 What are the prime factors of 5886552? 2, 3, 7, 37, 947 List the prime factors of 373633. 13, 41, 701 What are the prime factors of 249572? 2, 43, 1451 List the prime factors of 113985. 3, 5, 17, 149 List the prime factors of 6616343. 6616343 List the prime factors of 3012163. 7, 11, 39119 List the prime factors of 11684782. 2, 23, 389, 653 What are the prime factors of 42294189? 3, 7, 2014009 List the prime factors of 1512877. 1512877 What are the prime factors of 96326? 2, 48163 What are the prime factors of 6694365? 3, 5, 19, 83, 283 What are the prime factors of 963184? 2, 37, 1627 List the prime factors of 3109711. 11, 19, 14879 What are the prime factors of 568630? 2, 5, 101, 563 What are the prime factors of 9438166? 2, 29, 162727 List the prime factors of 10323557. 283, 36479 What are the prime factors of 835893? 3, 83, 373 List the prime factors of 13135902. 2, 3, 13, 168409 What are the prime factors of 2018825? 5, 23, 3511 List the prime factors of 24184215. 3, 5, 11, 48857 List the prime factors of 460764. 2, 3, 12799 What are the prime factors of 6639490? 2, 5, 11, 13, 4643 What are the prime factors of 1810545? 3, 5, 11, 10973 List the prime factors of 626946. 2, 3, 104491 What are the prime factors of 566747? 29, 19543 List the prime factors of 1777533. 3, 223, 2657 List the prime factors of 11496665. 5, 23, 99971 What are the prime factors of 1285530? 2, 3, 5, 73, 587 List the prime factors of 277521. 3, 92507 List the prime factors of 8103554. 2, 1553, 2609 List the prime factors of 13168319. 17, 47, 16481 List the prime factors of 474462. 2, 3, 43, 613 List the prime factors of 2558973. 3, 43, 83, 239 List the prime factors of 221865. 3, 5, 7, 2113 What are the prime factors of 1234260? 2, 3, 5, 6857 What are the prime factors of 8959957? 37, 242161 List the prime factors of 2605325. 5, 23, 197 List the prime factors of 39011. 7, 5573 List the prime factors of 283358. 2, 141679 What are the prime factors of 830611? 97, 8563 List the prime factors of 3922940. 2, 5, 7, 4003 What are the prime factors of 280874? 2, 11, 17, 751 List the prime factors of 32910903. 3, 61, 151, 397 List the prime factors of 1940309. 7, 109, 2543 List the prime factors of 237717. 3, 61, 433 List the prime factors of 576555. 3, 5, 7, 17, 19 List the prime factors of 11392854. 2, 3, 11, 172619 List the prime factors of 682923. 3, 233, 977 What are the prime factors of 1815460? 2, 5, 43, 2111 List the prime factors of 55935. 3, 5, 11, 113 What are the prime factors of 912202? 2, 43, 10607 What are the prime factors of 655670? 2, 5, 173, 379 List the prime factors of 1034572. 2, 7, 11, 3359 What are the prime factors of 3438190? 2, 5, 7, 49117 What are the prime factors of 91196? 2, 7, 3257 What are the prime factors of 48044? 2, 12011 What are the prime factors of 10246978? 2, 7, 104561 What are the prime factors of 18979508? 2, 23, 206299 List the prime factors of 4967429. 179, 27751 List the prime factors of 5422320. 2, 3, 5, 17, 443 List the prime factors of 10020. 2, 3, 5, 167 List the prime factors of 1730060. 2, 5, 23, 3761 What are the prime factors of 20250983? 59, 343237 List the prime factors of 115512. 2, 3, 4813 What are the prime factors of 2237669? 7, 29, 73, 151 What are the prime factors of 595083? 3, 293, 677 List the prime factors of 5772516. 2, 3, 481043 What are the prime factors of 7433571? 3, 619, 4003 What are the prime factors of 1758604? 2, 83, 5297 List the prime factors of 6680338. 2, 7, 83, 5749 What are the prime factors of 11701158? 2, 3, 7, 23, 12113 List the prime factors of 348925. 5, 17, 821 What are the prime factors of 52123? 47, 1109 What are the prime factors of 1091485? 5, 17, 12841 What are the prime factors of 19921113? 3, 737819 List the prime factors of 6791876. 2, 7, 13, 47, 397 What are the prime factors of 678095? 5, 11, 12329 What are the prime factors of 162004? 2, 101, 401 List the prime factors of 4717904. 2, 294869 What are the prime factors of 189745? 5, 137, 277 What are the prime factors of 411274? 2, 19, 79, 137 What are the prime factors of 105138? 2, 3, 11, 59 What are the prime factors of 243734? 2, 121867 What are the prime factors of 65134? 2, 29, 1123 What are the prime factors of 9013014? 2, 3, 500723 List the prime factors of 455911. 163, 2797 List the prime factors of 191021. 191021 List the prime factors of 71167. 71167 What are the prime factors of 2630432? 2, 7, 11743 List the prime factors of 395643. 3, 43, 3067 What are the prime factors of 2617586? 2, 79, 16567 List the prime factors of 1631332. 2, 407833 What are the prime factors of 55582? 2, 27791 List the prime factors of 20234. 2, 67, 151 List the prime factors of 142680. 2, 3, 5, 29, 41 What are the prime factors of 1254560? 2, 5, 7841 List the prime factors of 676997. 347, 1951 List the prime factors of 638902. 2, 11, 113, 257 What are the prime factors of 1712567? 1712567 List the prime factors of 96939. 3, 10771 What are the prime factors of 4756504? 2, 594563 What are the prime factors of 68769? 3, 283 List the prime factors of 689454. 2, 3, 38303 What are the prime factors of 271693? 271693 What are the prime factors of 25159805? 5, 11, 47, 9733 List the prime factors of 374320. 2, 5, 4679 What are the prime factors of 2911204? 2, 181, 4021 What are the prime factors of 19832? 2, 37, 67 List the prime factors of 452298. 2, 3, 7, 11, 89 List the prime factors of 44391. 3, 14797 List the prime factors of 209113. 79, 2647 List the prime factors of 6020374. 2, 71, 42397 List the prime factors of 895141. 13, 37, 1861 List the prime factors of 2803998. 2, 3, 467333 List the prime factors of 12262. 2, 6131 What are the prime factors of 19197085? 5, 3839417 What are the prime factors of 2707652? 2, 19, 23, 1549 What are the prime factors of 161166? 2, 3, 26861 What are the prime factors of 10428707? 73, 373, 383 List the prime factors of 31601155. 5, 29, 47, 4637 What are the prime factors of 3180636? 2, 3, 53, 1667 List the prime factors of 72981. 3,	{ "pile_set_name": "DM Mathematics" }
of -m*4/18 - 142m*3/27 + 296m*2/9 - 200m/3 - 1042. Factor l(s). -2(s - 2)2(s + 75)/9 Let h = 427 - 422. Let g(v) = -5v2 - 160v + 5. Let u(q) = -5q2 - 163q + 4. Let m(p) = hu(p) - 4g(p). Find x, given that m(x) = 0. -35, 0 Suppose -5x = -4b + 36, -5x - 16 = 4. Factor -74v*3 + 3v*b - 97v*2 - 36v - 40v3 + 18v*4 + 15v*3 - 59v*2. 3v(v - 6)(v + 1)(7v + 2) Factor 4n2 + 0n*2 - 3n*2 + 3n*2 + 24n - 3n2. n(n + 24) Let m(d) be the third derivative of d*6/540 - 67d*5/45 + 1111d*4/3 + 81608d*3/27 - 3d*2 + 7d + 78. Determine u, given that m(u) = 0. -2, 202 Factor -149/2a - 1/4a2 - 22201/4. -(a + 149)2/4 Let r(w) be the second derivative of -w*5/4 - 610w*4/3 - 2435w*3/6 - 3947w. Factor r(f). -5f(f + 1)(f + 487) Suppose -6n - 3n = n. Let i be (-4)/2 - -4 - n. Factor k - 5k - 4k3 - 27k*i + 35k*2. -4k(k - 1)2 Let j = 1282 - 6402/5. Let q(v) be the first derivative of 5/2v*4 - 4/3v*3 - jv*5 - 2 + 1/3v*6 + 0v*2 + 0v. Factor q(n). 2n2(n - 2)(n - 1)2 Let r = 103316/819 - 884/7. Let j = 10/117 - r. Factor 4/9 + 10/9v + 2/3v2 - jv*4 - 2/9v*3. -2(v - 2)(v + 1)3/9 Factor 42875 + 61z3 + z4 + 91z3 + 3177z*2 + 46550z - 46z3 + 603z*2. (z + 1)(z + 35)*3 Let h(z) be the first derivative of 0z*2 - 11/1620z*6 + 0z + 1/270z5 - 9z*3 + 0z*4 - 39. Let f(p) be the third derivative of h(p). Factor f(c). -2c(11c - 2)/9 Let x(d) be the second derivative of -d*6/40 + 9d*5/20 - 3d*4 + 10d*3 - 17d*2 - 2d + 6. Let o(q) be the first derivative of x(q). Factor o(m). -3(m - 5)(m - 2)*2 Let r(u) be the first derivative of -5u*5/2 + 2995u*4/32 + 1073u*3/8 + 139u*2/2 + 31u/2 + 794. Determine g, given that r(g) = 0. -2/5, -1/4, 31 Let v = -474107 + 4267123/9. Factor -32/9r3 + vr*2 + 0 + 2/9r*4 - 256/9r. 2r(r - 8)(r - 4)2/9 Suppose 17833 = 18a - a. Suppose -1045c = -ac. Factor 2/5m2 + cm*3 + 0 - 3/10m*4 - 1/10m*5 + 0m. -m*2(m - 1)(m + 2)2/10 Let f = 300 + -298. Factor -1638w*f - 3w*4 + 8232 + 3535w - 97w - 38w*3 + 161w*3 + 3030w. -3(w - 14)3(w + 1) Suppose 4h = -b + 32, 1070h - 2 = 1072h - b. Suppose 35/3o - h + 5/3o3 - 25/3o*2 = 0. Calculate o. 1, 3 Let n be (19/(-38) - 408/(-16))/(-1 + (-34)/(-4)). Factor -n - 7/3q - 1/3q2. -(q + 2)(q + 5)/3 Let m(n) = n*3 + 12n*2 - 15n + 2. Let f be m(-13). Suppose 0 = q + 6q - f. What is g in -g3 + 12g*2 - 15g*3 - 228 + 6g*q + 226 = 0? -1/3, 1 Determine o so that 662/11o + 658/11o2 - 60 + 2/11o*4 - 662/11o*3 = 0. -1, 1, 330 Let 4n*2 - 6n*3 + 76n + 58n3 - 4n*4 - 128n*3 = 0. Calculate n. -19, -1, 0, 1 Let u(q) be the first derivative of -4q*5/5 - 83q*4 + 1372q*3/3 - 866q*2 + 696q + 1047. Factor u(p). -4(p - 2)(p - 1)*2(p + 87) Let d = -80710 + 80713. Factor 9sd + 33/2s - 3/2s4 - 3/2s*5 + 9/2 + 21s*2. -3(s - 3)(s + 1)4/2 Let f(o) be the third derivative of -2o + 16o2 + 44/15o*3 + 0 + 38/15o*4 + 1/75o*6 - 19/30o*5. Factor f(r). 2(r - 22)(r - 2)(4r + 1)/5 Let z = 9871/33 - 299. Let v(q) be the first derivative of 0q - 1/22q4 + zq*3 + 7 - 1/11q2. Suppose v(y) = 0. What is y? 0, 1 Let m(o) be the first derivative of -o8/1680 - o*7/168 - 19o3 - 115. Let i(r) be the third derivative of m(r). Factor i(v). -v3(v + 5) Let j = -404 + -42. Let m = j - -482. Determine q, given that -24/7q - 232/7q2 + 162/7q*5 - 622/7q*3 - mq4 + 0 = 0. -1, -2/9, 0, 3 Let l(k) be the third derivative of -k6/660 + 4k5/33 + 25k*4/11 - 6000k*3/11 + 67k*2 + k - 1. Factor l(o). -2(o - 30)*2(o + 20)/11 Let n(a) be the first derivative of 0a - 2/3a*3 - 1/6a*4 + 4/3a2 - 121. Let n(o) = 0. What is o? -4, 0, 1 Let l(a) be the first derivative of -a4/10 - 4a3/3 + 88a*2/5 - 256a/5 - 2026. Find x, given that l(x) = 0. -16, 2, 4 Find p, given that 24 + 361p - 5p*4 + 389p + 2p3 + 65p*2 - 836p = 0. -4, 2/5, 1, 3 Let j(m) = 5m3 - 14m*2 + 11m - 5. Let u(z) = -11z3 + z4 + 0 + 10z*3 - 2z - z*2 + z - 1. Let k(i) = -4j(i) + 4u(i). Factor k(c). 4(c - 2)*2(c - 1)*2 Let q(r) = -2r - 6. Let f be q(-4). Suppose -4i = -2i - l, 16 = 4l. Factor 170n + fni + 2 - 167n + 3n2 - 4n*2. (n + 1)(n + 2) Let n(t) be the first derivative of 3t4/22 + 38t*3/11 - 348t*2/11 + 576t/11 - 2759. Factor n(i). 6(i - 4)(i - 1)(i + 24)/11 Let r be (-130347)/(-84)24/(-18). Let z = -2066 - r. Determine n so that 4/7nz - 13500/7 + 2700/7n - 180/7n2 = 0. 15 Let b(a) be the second derivative of -3a*5/160 + 3a*4/16 - 9a*3/16 + 3a*2/4 - 806a - 2. Find m such that b(m) = 0. 1, 4 Suppose -i - 5u = 13, 2u - 1 = 2i + 1. Let h be (2/i)/(((-40)/45)/4). Find l, given that 8/15l + 2/15lh + 0 - 8/15l*2 = 0. 0, 2 Let g = -4/279269 + 279285/1117076. Find w, given that -31/2w - gw2 - 961/4 = 0. -31 Let m = 121842 - 121840. Factor -m - 8/3g - 2/3g2. -2(g + 1)(g + 3)/3 Let k be (-98)/(-5)(-83)/(-86 - 495). Determine j so that -8j + 206/5j*3 + 0 - 108/5j*4 + kj*5 - 72/5j*2 = 0. -2/7, 0, 1, 2, 5 Let w = -8771 + 8775. Let c(b) be the second derivative of 1/9b*3 + 0 - 1/30b5 + b2 - 1/6bw + 6b. Solve c(a) = 0 for a. -3, -1, 1 Let k be 64/(-416) - -261/624. Let a(q) be the third derivative of 0 - kq*4 + 1/60q*5 + 0q - q*2 - 1/6q*3 + 1/120q*6. Factor a(p). (p - 1)(p + 1)*2 Let t(x) be the first derivative of -16x - 1/35x5 - 2 - 2/21x*4 - 2/21x*3 + 0x*2. Let j(d) be the first derivative of t(d). Factor j(h). -4h(h + 1)2/7 Suppose -5y = -2y - 36. Suppose -4l - 2c = 8, -4l - y = -c + 4c. Factor -14x*3 - 2x*2 - 8x*2 + lx*5 + 5x5 - x3. 5x2(x - 2)(x + 1)2 Let v(r) be the third derivative of 7r8/720 - r7/180 + r6/720 + r5/6 + r*2 - 30. Let b(i) be the third derivative of v(i). Find p such that b(p) = 0. 1/14 Factor -24g*3 - 1/3g*4 + 0 - 46g - 209/3g2. -g(g + 1)(g + 2)(g + 69)/3 Let x(b) be the first derivative of -b*6/15 + 4b5/5 - b4 - 40b3/3 - 25b*2 + 88b + 69. Let l(z) be the first derivative of x(z). Factor l(g). -2(g - 5)2(g + 1)*2 Suppose -2k - 13v + 9 = -14v, -v = k. Let x(j) be the second derivative of 0 - 9j + 1/48j*4 + 25/8j*2 - 5/12j*k. Determine i so that x(i) = 0. 5 Factor 1/4a*4 + 3264a*2 + 262144 + 49a*3 + 77824a. (a + 4)(a + 64)3/4 Factor 256/3b - 86 + 2/3b2. 2(b - 1)(b + 129)/3 Let p be 3104/(-291) + ((-4)/(-2))/(-6). Let o be p/(-33) - (-115)/60. Factor -3/2s*2 - 1 + 1/4s*3 + os. (s - 4)(s - 1)2/4 Let o(c) = 299c + 5681. Let k be o(-19). Let k + 2b - 12/5b*2 + 2/5b*3 = 0. Calculate b. 0, 1, 5 Suppose -6z - 15 = -3z - 33. Let k(b) be the second derivative of 1/5b*5 - 2/15b*z + 0b*2 + 0b*3 + 2/3b*4 + 0 - 24b. Factor k(c). -4c2(c - 2)(c + 1) Determine h so that 5h*2 + 3083 - 44h*2 - 274h + 3h3 + 27h*2 - 779 - 110h = 0. -12, 8 Let j(w) be the first derivative of -1372w5/25 - 4067w*4/5 - 4424w*3/5 - 1864w*2/5 - 352w/5 - 813. Determine p so that j(p) = 0. -11, -2/7 Suppose -128v - 419 - 34 = -709. Let 64/3 - 32/3j + 4/3jv = 0. What is j? 4 Let u(p) be the second derivative of 27p - 1/3p4 + 40p*2 - 16/3p*3 + 0. Factor u(m). -4(m - 2)(m + 10) Let i = -10841/5 - -53529/20. Let r = -507 + i. Suppose -rj*5 + 5/2j*4 + 0j*3 + 5/4j + 0 - 5/2j2 = 0. What is j? -1, 0, 1 Suppose 3s - 21 + 0 = 0. Let t(a) = -a*2 + 5a + 17. Let i be t(s). Factor 8bi - 3b5 + b4 + 4b2 + 7b*5 + 11b*4 + 4b*3. 4b*2(b + 1)*3 Suppose 66 = -2s - s + 3q, 0 = 2s + 3q + 64. Let d = s - -101. Factor -157h*2 + dh*2 + 73h*2 + 3h*3 + 6h. 3h(h - 2)(h - 1) Factor 2/7k*3 - 10/7k*2 - 48/7k + 0. 2k(k - 8)(k + 3)/7 Let f be (264/2970-20)/(((-8)/18)/2). Determine q, given that -64 + fq - 1/4q*2 = 0. 16 Suppose 3q - 3 - 3 = 0. Let i(p) = 24 - 29p2 + 13p - 4p + 8p*q. Let z(h) = -125h*2 + 55h + 145. Let j(n) = -25i(n) + 4z(n). Factor j(u). 5(u - 1)(5u + 4) Let w(r) be the third derivative of 46r*8/231 - 312r*7/385 - 163r*6/220 - 23r5/165 + r4/44 + 4147r*2. Suppose	{ "pile_set_name": "DM Mathematics" }
is 1247.01um in kilometers? 0.00000124701 How many micrograms are there in 7/4 of a milligram? 1750 How many kilograms are there in 7.553468 grams? 0.007553468 How many micrometers are there in five eighths of a millimeter? 625 How many months are there in 2/125 of a millennium? 192 What is 1.7616531 months in years? 0.146804425 Convert 98.00656 weeks to minutes. 987906.1248 How many litres are there in 403.975ml? 0.403975 How many nanograms are there in seven halves of a microgram? 3500 How many milliseconds are there in 3/40 of a minute? 4500 How many meters are there in 43/2 of a kilometer? 21500 How many months are there in fifteen quarters of a year? 45 Convert 78160.27 micrograms to milligrams. 78.16027 How many kilograms are there in eleven halves of a tonne? 5500 How many centuries are there in 294000.63 months? 245.000525 How many nanometers are there in fourty-eight fifths of a micrometer? 9600 What is 663.3365 years in decades? 66.33365 What is 3/40 of a centimeter in micrometers? 750 How many milligrams are there in 0.2397021g? 239.7021 How many months are there in 1/6 of a decade? 20 Convert 749.009 decades to millennia. 7.49009 What is eleven eighths of a decade in months? 165 Convert 23.9250186 microseconds to days. 0.0000000002769099375 What is 5/4 of a litre in millilitres? 1250 What is 7/4 of a gram in milligrams? 1750 What is 4.174469ml in litres? 0.004174469 What is 3/5 of a kilometer in centimeters? 60000 How many kilograms are there in 1/4 of a tonne? 250 How many decades are there in 9.74557 millennia? 974.557 How many millimeters are there in thirteen fifths of a meter? 2600 How many millilitres are there in 17/4 of a litre? 4250 What is 7/4 of a milligram in micrograms? 1750 How many litres are there in 39.92209ml? 0.03992209 Convert 3311.739 micrograms to tonnes. 0.000000003311739 What is 42/5 of a litre in millilitres? 8400 What is 381.9488ng in tonnes? 0.0000000000003819488 How many years are there in 3/5 of a millennium? 600 How many months are there in six fifths of a century? 1440 What is 1/30 of a minute in seconds? 2 How many microseconds are there in six fifths of a millisecond? 1200 How many micrometers are there in one fifth of a millimeter? 200 Convert 152202.96 months to millennia. 12.68358 Convert 4680.477 months to centuries. 3.9003975 Convert 1876.051 decades to years. 18760.51 How many kilograms are there in 0.7726914 tonnes? 772.6914 What is twenty-three sixths of a decade in months? 460 What is 13/4 of a litre in millilitres? 3250 What is 33/5 of a centimeter in millimeters? 66 What is 23.59741 millennia in centuries? 235.9741 What is 1/5 of a litre in millilitres? 200 What is 7.384711 tonnes in grams? 7384711 How many centimeters are there in 6134.57km? 613457000 Convert 41288.36ng to kilograms. 0.00000004128836 How many grams are there in eleven eighths of a kilogram? 1375 What is 3/5 of a gram in milligrams? 600 How many months are there in one fifth of a decade? 24 What is 41289.55 micrometers in centimeters? 4.128955 How many millilitres are there in 768.668l? 768668 How many months are there in twenty-one fifths of a century? 5040 What is 17/4 of a litre in millilitres? 4250 What is eighty-one quarters of a meter in millimeters? 20250 What is 7/2 of a centimeter in micrometers? 35000 How many millennia are there in 2506.1031 months? 0.208841925 What is 45/4 of a litre in millilitres? 11250 Convert 2027.845 minutes to seconds. 121670.7 How many centuries are there in 1.5419826 months? 0.0012849855 How many grams are there in 32451.5kg? 32451500 How many nanograms are there in 26/5 of a microgram? 5200 What is 38509.53s in minutes? 641.8255 What is 328.6994um in kilometers? 0.0000003286994 What is 4323013.2 seconds in days? 50.034875 How many milliseconds are there in 6/5 of a second? 1200 How many millilitres are there in 2663.55 litres? 2663550 What is seventeen quarters of a gram in milligrams? 4250 Convert 740666.6l to millilitres. 740666600 Convert 3.177302 grams to nanograms. 3177302000 How many nanograms are there in 5093.857mg? 5093857000 What is 32794.3 micrometers in meters? 0.0327943 What is 506306.7 tonnes in micrograms? 506306700000000000 Convert 569267.9 grams to tonnes. 0.5692679 How many years are there in 648779.3 millennia? 648779300 How many nanograms are there in 7/4 of a microgram? 1750 What is 75.43193 litres in millilitres? 75431.93 What is 16589724.48 milliseconds in weeks? 0.0274301 How many milligrams are there in 95.96596 grams? 95965.96 What is 32423.7m in nanometers? 32423700000000 What is 5501.385s in hours? 1.5281625 What is 27/4 of a kilogram in grams? 6750 What is one tenth of a kilogram in grams? 100 What is fourty-three sixths of a day in hours? 172 How many millimeters are there in 19/4 of a meter? 4750 What is 75/2 of a microsecond in nanoseconds? 37500 How many millimeters are there in 7289.627 micrometers? 7.289627 How many seconds are there in 8/15 of a minute? 32 What is 29/5 of a litre in millilitres? 5800 What is 7/4 of a litre in millilitres? 1750 How many months are there in three eighths of a decade? 45 What is 13/5 of a millisecond in microseconds? 2600 Convert 0.6181676 seconds to microseconds. 618167.6 How many micrometers are there in 3/25 of a millimeter? 120 How many litres are there in 19796.23ml? 19.79623 What is 18/7 of a week in minutes? 25920 How many years are there in 39.00077 millennia? 39000.77 What is 2.590794ml in litres? 0.002590794 What is 13/5 of a litre in millilitres? 2600 What is 0.132349l in millilitres? 132.349 How many millilitres are there in 3/50 of a litre? 60 What is 39.27958 micrometers in meters? 0.00003927958 Convert 31.7855ug to tonnes. 0.0000000000317855 Convert 1084.163 seconds to microseconds. 1084163000 What is 10650.6144ns in days? 0.000000000123271 How many millilitres are there in 192748.6 litres? 192748600 What is 1/4 of a millimeter in micrometers? 250 How many years are there in 85279.31 centuries? 8527931 What is 15159.92 millilitres in litres? 15.15992 How many millilitres are there in 83682.15 litres? 83682150 How many micrometers are there in nineteen quarters of a centimeter? 47500 How many minutes are there in 0.7312256 hours? 43.873536 How many months are there in 7/2 of a decade? 420 What is 26/5 of a minute in seconds? 312 How many seconds are there in 3617.52 microseconds? 0.00361752 What is 13/5 of a kilometer in meters? 2600 What is 1.2298464 hours in days? 0.0512436 How many years are there in seven eighths of a millennium? 875 How many seconds are there in 2/15 of a week? 80640 Convert 59.3499ms to microseconds. 59349.9 What is three tenths of a milligram in micrograms? 300 How many microseconds are there in 12/25 of a millisecond? 480 What is 24.814182 months in decades? 0.20678485 What is 26/5 of a centimeter in micrometers? 52000 How many months are there in 7/3 of a century? 2800 What is 654649.4ug in nanograms? 654649400 How many milliseconds are there in 59.88463 days? 5174032032 How many centuries are there in 0.1372256 decades? 0.01372256 What is 0.0958042 centuries in millennia? 0.00958042 What is thirteen fifths of a litre in millilitres? 2600 How many milliseconds are there in 145854.3 nanoseconds? 0.1458543 Convert 63565.5 decades to months. 7627860 What is 3/8 of a micrometer in nanometers? 375 What is one twentieth of a litre in millilitres? 50 How many millilitres are there in 17/2 of a litre? 8500 How many grams are there in nineteen quarters of a kilogram? 4750 What is seventeen quarters of a millennium in years? 4250 What is 17/2 of a century in years? 850 What is 50.18167ml in litres? 0.05018167 How many days are there in 31227.156 minutes? 21.685525 How many decades are there in 1.039817 millennia? 103.9817 How many millilitres are there in three tenths of a litre? 300 What is 8462.022nm in meters? 0.000008462022 Convert 63.8491 minutes to nanoseconds. 3830946000000 How many micrometers are there in 9407.851 kilometers? 9407851000000 How many millimeters are there in 25/2 of a meter? 12500 What is two ninths of a week in minutes? 2240 How many litres are there in 59.27931 millilitres? 0.05927931 What is 79/2 of a microgram in nanograms? 39500 How many millilitres are t	{ "pile_set_name": "DM Mathematics" }
m(b) = tb + b3 + 0b + 9 + 3b2 - 4b2. Give m(0). 9 Let g be 3 + 16/(-2) + 5. Let j(h) = -h3 + h*2 + h - 11. Give j(g). -11 Let i be 15/6 + 1/(-2). Let y(s) = 4 - 2 - 5s*i + 3s + s*3 + 2s. Suppose -24 = -6f - 0f. Calculate y(f). 6 Let x(j) be the third derivative of j*4/24 + 2j*3/3 - 2j*2. Let i(h) = -h - 3. Let p(o) = 3i(o) + 4x(o). Let g = 14 - 14. Give p(g). 7 Let k(j) = -j3 + 7j*2 - 4j + 1. Let m(v) = -2v3 - 11v*2 + 6v + 6. Let a be m(-6). What is k(a)? 13 Let g = -6 - -3. Let a(s) be the second derivative of s6/720 - s5/30 - s*4/4 + 2s. Let r(u) be the third derivative of a(u). What is r(g)? -7 Let g be 6/(-10) - (3 + (-144)/40). Let b(i) = i*2 + i + 5. What is b(g)? 5 Let a(o) = -2o + 29. Let l be a(17). Let f(r) = r*3 + 6r*2 + 5r + 4. Calculate f(l). 4 Let i(y) be the first derivative of 1/12y4 - 2 + 0y - 1/2y3 + 2y*2. Let x(c) be the second derivative of i(c). Determine x(4). 5 Let v(s) = 7s + 5. Let y(u) = -u - 1. Let m(c) = -v(c) - 6y(c). Calculate m(1). 0 Let u(t) be the third derivative of -t8/2520 + t6/720 - t5/30 - 3t2. Let c(j) be the third derivative of u(j). Give c(-1). -7 Let o(s) be the third derivative of s5/60 + 5s4/24 - s3/6 + 3s*2. Suppose -2f + 38 = 50. Give o(f). 5 Let h(n) = 0n - 3n + 2 + 2n. Let k(v) = v3 - 6v*2 + v - 1. Let s be k(6). Suppose 0f = sa - 2f - 21, 0 = -5a + 3f + 24. Determine h(a). -1 Suppose 0 = 6x - 2x + 3b + 16, -2b = 4x + 16. Let p(g) = g2 + 4g - 5. Calculate p(x). -5 Let t(c) = -c3 - c2 - c - 1. Let u(a) = 2a - 18. Let v be u(10). Suppose -3j = vj + 10. What is t(j)? 5 Let x(s) = 7s*2 + 2s + 1. Let i(f) be the second derivative of 7f4/12 + f3/3 + f2/2 + 3f. Let r(d) = 4i(d) - 3x(d). Give r(-1). 6 Let m = -12 - -18. Suppose -y = 4u - m, 3y = -4u - 2y + 14. Let q(s) = s - 1. Let v(b) = 2b2 - 6b + 4. Let h(w) = uv(w) + 5q(w). Determine h(2). 5 Let s(m) = -1. Let n = 0 - 2. Let r = -3 - n. Let g(l) = -l*2 - 3l - 1. Let f(x) = rg(x) + 6s(x). Determine f(-4). -1 Let w(r) = r + 1. Let q(o) be the first derivative of 5o + 7/2o*2 + 3. Let g(s) = q(s) - 4w(s). Determine g(-1). -2 Let d(z) = -2z2 + 3z*2 + 3z - 2z2 + 4. Suppose 2x = 4i - 0i - 20, -5i + 2x = -24. Determine d(i). 0 Let p(j) = j*3 + 5j*2 + 5j + 1. Let n = -5 + 3. Let g be n/6 + 34/(-6). Let o be (-3)/(-2g/16). Determine p(o). -3 Let s(h) = -h + 4. Let r be s(3). Let t(o) = 12o + 1. Give t(r). 13 Let z(j) = -3j2 + 13j - 1. Let x(i) = -i*2 + 4i. Let q(d) = -d*2 - 7d + 8. Let r be q(-7). Let o(l) = rx(l) - 3z(l). Determine o(5). -7 Let i(q) be the second derivative of -q*5/20 - 3q*4/4 - 4q3/3 - q2/2 + 6q. What is i(-8)? -1 Suppose 0 = -5b - 0 + 15. Suppose bh - 9 = 0, u + 2 = -h - 3. Let s(d) = -d3 - 8d2 - d - 6. Determine s(u). 2 Let i be ((-63)/28)/(1 - (-11)/(-8)). Let c(h) = h - 1. Determine c(i). 5 Let y(u) = 710 - u3 + 4u - 4u*2 - 716 + 0u3. Calculate y(-5). -1 Let b(f) be the third derivative of f7/840 - f6/72 + f5/30 + f4/8 - f3/3 + f*2. Let s(c) be the first derivative of b(c). Determine s(4). 3 Suppose -13d - 21d = -12d. Let l(f) = -4f - 13 - 3f + 6f. What is l(d)? -13 Let r(x) = 4x2 + x + 1. Let y(h) = h3 - 2h - 2. Let m be y(-1). Determine r(m). 4 Suppose -4w + 0w - 36 = 0. Let l(r) = -r2 - 11r - 12. Let y be l(w). Let f(m) = -m*2 + 4m + 4. Determine f(y). -8 Let u(a) = 5a3 + 33a*2 - 41a + 7. Let x(s) = s*3 + 8s*2 - 10s + 2. Let o(h) = -2u(h) + 9x(h). Calculate o(5). -11 Let n(r) be the third derivative of r*5/60 + 5r*4/12 + 7r3/6 + r2 - 13. Determine n(-7). -14 Let n(m) be the first derivative of 4m3/3 - m2/2 - 2m - 19. What is n(2)? 12 Let r(j) be the third derivative of j4/12 - j3/6 - 49j2. Determine r(6). 11 Suppose 3g - 36 = -3m, -4g + 46 = 4m - 2m. Let c(z) = -z*2 + 10z + 7. Give c(g). -4 Let u(t) = -4t + 16. Let a = 18 - 11. Let n(z) = -3z + 11. Let x(w) = an(w) - 5u(w). Give x(6). -9 Let f(b) = b - 2. Suppose -6 = 148c - 149c. Give f(c). 4 Let u(n) be the third derivative of -1/12n4 - 1/6n*3 + 0n + n*2 - 3/20n*5 + 0. Let a = -231 + 230. Give u(a). -8 Suppose 5a - 3o - 12 = 0, -8 = 5a - 0a + 2o. Suppose a = -0z + 2z. Let r(c) = c + 10. Determine r(z). 10 Let g(b) be the second derivative of b3/6 - b2 + b. Suppose 4u = -23 + 55. Let w be -6 + u + (1 - 7). Determine g(w). -6 Suppose 3x = -2s - 19, -5x + 5s - 21 = 3s. Suppose -2q - q = 0. Let m(n) = -8n + n - 6 + qn2 - n2. What is m(x)? 4 Let j(b) = -b2 + b. Let g(q) = q3 + q2 - q + 23. Let o(a) = -g(a) - 2j(a). Calculate o(0). -23 Let h(x) = 6x - 7x - 6x - 1. Give h(-1). 6 Let b(r) = -6r*2. Let v(f) = 2f - 14. Let k be v(7). Let o = 1 + k. Give b(o). -6 Let v be (-2(6 - 1))/(-2). Suppose -5u + vn = 15, -7u + 3u - n - 2 = 0. Let m(x) = -6x - 1. Calculate m(u). 5 Let g(p) = -4p2 + 3p3 - p - p3 + 0p3. Give g(3). 15 Let q(m) be the third derivative of -m4/12 + m3/6 + m2. Let d = -3 - -5. Let x be d/(-5) - (-17)/5. Calculate q(x). -5 Let q(w) = -w3 - w2 - 1. Let r be (-8)/66/4. Determine q(r). 3 Let o(x) = 20x - 3 - 11x - 5x - 6x. Determine o(6). -15 Let h(f) be the second derivative of -f6/120 - f4/24 + f*3/3 - 2f*2 - 2f. Let p(o) be the first derivative of h(o). Give p(0). 2 Let f = -5 - -8. Let l be (-185)/(-35) - 2/7. Suppose 0 = -fi + lu - 0 + 28, -5u - 22 = 3i. Let g(x) = 2x2 + 2x - 1. What is g(i)? 3 Let n(k) = 5k2 - 4k + 5. Let w(l) = -6l2 + 4l - 5. Let u(x) = -7n(x) - 6w(x). What is u(-4)? -5 Let r(d) = -9d2 + 6d*2 - 2d2 - d3 + 1. Give r(-2). -11 Suppose 90 = -u - 4u. Let p = u + 12. Let k(l) be the third derivative of l4/24 + 2l*3/3 + 5l2. Determine k(p). -2 Let p(j) be the third derivative of -j4/8 + 2j2. Let g be p(-1). Let y(s) = 2s - 1. What is y(g)? 5 Let o(m) = -5m2 - 9m*2 + 0 + 2m - 2 + 15m2. Determine o(3). 13 Suppose -7u + 14 + 21 = 0. Let f(g) = g*3 - 5g*2 + g + 7. Calculate f(u). 12 Let s be 1-4 + 81/9. Let m(g) = g + 5. What is m(s)? 10 Let z(a) = 4a3 - 4a2 + 3. Let t(h) = h3 - h + 1. Let f(i) = 3t(i) - z(i). Give f(2). 2 Let x(q) = 11q*2 + 13q + 26. Let u(n) = 7n2 + 9n + 17. Let p(b) = 8u(b) - 5x(b). Give p(-5). -4 Let x(l) = 3l2 + 4l - 6. Let f(b) = 2b2 + 4b - 5. Let u(r) = 5f(r) - 4x(r). Give u(3). -7 Let m(x) = 7 + 8 - x - 5. What is m(0)? 10 Suppose -4x - 11 = -t, -2t = 3t - 5x - 25. Let m(u) = u + 0 - 1 + 2 + t. Give m(0). 4 Let d(g) = -g - 4. Let a be -2 + (6 + -2)19. Let r be (-16)/(-56) + a/(-14). Determine d(r). 1 Suppose 4x + 24 = 4. Let o(d) = d - 3. Give o(x). -8 Let r(j) be the third derivative of j5/60 - j4/8 - 7j3/6 - 9j*2. Calculate r(6). 11 Suppose -2v = -11v - 54. Let n(a) = -5a*2 + 3a*3 - 3a*3 - 4a*3 + 3a*3 + 5a - 4. Determine n(v). 2 Suppose 0 = -2w - l + 19, -w = 2w + l - 29. Let b be 16/10w/4. Let c(o) be the third derivative of o5/60 - o4/6 - 6o2. Calculate c(b). 0 Let o(p) = -p2 - 10p - 6. Let q be (-1)/(-3) + (-196)/21. Determine o(q). 3 Let w(v) = -2v + v*3 + 3328 - 3332 + 8v*2 + 0v*2. Give w(-8). 12 Let v(m) = 9 + 1 - 6 + m. Give v(0). 4 Let t(f) = -3f*2 - 2f - 4f + 2f*2 + 3f. What is t(-5)? -10 Let c(b) be the second derivative of -b6/45 + b5/120 - b4/24 - b3/3 + 5b. Let t(i) be the second derivative of c(i). Calculate t(1). -8 Let y(k) = 4k*2 + 5k - 11. Let o(x) = 3x2 + 5x - 10. Let l(j) = 5o(j) - 4y(j). Let w be (2 - (2 - 2)) + 2. Give l(w). -2 Let b(v) = -6v2 - v - 1. Let k(n) = n2 - 6n - 4. Let s be k(7). Suppose -s = -3g + 3i, 0g + 2g + 16 = -4i. Let d be 1 - (2 - 0/g). Give b(d). -6 Let b(t) = t2 + 13t - 19. Let s be b(-14). Let c(f) = f*2 + 5f + 7. Calculate c(s). 7 Let m(o) = 1. Let z(b) = -2b - 7. Let f(v) = -6m(v) - z(v). What is f(-3)? -5 Let x(w) be the third derivative of -w5/60 + w4/6 - 7w3/6 + 2w*2 + 16. What is x(6)? -19 Let g(p) = 3p*3 + 7p*2 - 4. Let r(k) = 4k*3 + 8k*2 + k - 3. Let w(h) = 3g(h) - 2r(h). Calculate w(-5). 4 Suppose -m + 2m + 3 = z, 3z - 5m - 11 = 0. Let r(x) = 7	{ "pile_set_name": "DM Mathematics" }
+ sqrt(24)/(-2sqrt(12)) + -2 + 1 + -4)2. 5sqrt(2)/2 + 201/8 Simplify (-5 + (-2 + sqrt(11) + 0 - (sqrt(33)-2)/sqrt(3)))2 + (5-5(sqrt(704) + -1 + sqrt(704)))2. -20042sqrt(11) + 1760773 Simplify -1 + (4(-1 + ((-1 + sqrt(75) - sqrt(75))-5 + sqrt(75))-6 + -1 + -4))2. 34560sqrt(3) + 63935 Simplify 1 + (-1sqrt(19)-1 + -2)2 + (0 + sqrt(171))2 + -1 + 2. 2sqrt(19) + 169 Simplify (-4 + 6(sqrt(684)1 + -3 - (2 + sqrt(684) + 0))*2-1)2-3. 924 Simplify ((3 + (sqrt(637) + 0 - sqrt(637)))-2 + 1)2 - -6(-4 + -2sqrt(637))2-4. -61511 - 2688sqrt(13) Simplify ((sqrt(22)/(sqrt(2) + (5sqrt(2) - sqrt(2))) + sqrt(11))*2 - (sqrt(704)-2)*2) + ((2sqrt(77)-1)/sqrt(7))2 + 4. -68804/25 Simplify (1 + 2 + 4((sqrt(153) - sqrt(153)2)3 - (2(sqrt(153)2 + sqrt(153)) + sqrt(153))) + 0)*2. -720sqrt(17) + 244809 Simplify (3sqrt(2688)1 - -2sqrt(2688)-5)/(-3(1sqrt(384) + sqrt(384))-4). -7sqrt(7)/24 Simplify (2(-3 + 5((sqrt(637) - 5sqrt(637)2 - sqrt(637))-3)2) + -3)-4. -22931964 Simplify ((sqrt(133) + -3sqrt(133) + sqrt(133))1 + -3sqrt(133)2)/(6(sqrt(2268) - sqrt(2268)-2 - sqrt(28))/sqrt(4)). -7sqrt(19)/156 Simplify ((4-3sqrt(152)2-4)/(-2(sqrt(288)/sqrt(6)-6)/sqrt(6)))2. 1216 Simplify (32sqrt(2401) + (sqrt(2401) + -1sqrt(2401) + sqrt(2401) + sqrt(2401) - sqrt(2401))1)/(sqrt(56)/sqrt(128) - (-4sqrt(700) + sqrt(7))). 196sqrt(7)/157 Simplify (3 + (((sqrt(125) + -2)6-4)2 - ((-2sqrt(125))*23 - sqrt(125) - (sqrt(125) + 0)*2-6)))-4. -288228 + 46060sqrt(5) Simplify (2 + sqrt(300)-2 + 2 + -5 + -1 + 1sqrt(300) + 0 + 2)*2. 300 Simplify -4((sqrt(156)/sqrt(6) - sqrt(26))2)/sqrt(2) + -3 + sqrt(143)/sqrt(11) + sqrt(130)/(sqrt(10) - (sqrt(360) - sqrt(10))). -3 + 3sqrt(13)/4 Simplify (6sqrt(38)/sqrt(2) + sqrt(19) - (-2 + sqrt(19) + 3))2 + (sqrt(228) - sqrt(228)-1-5)/(sqrt(108)/(sqrt(36)/sqrt(4))) + -3. -5 + 8sqrt(19) Simplify (-5((sqrt(75) - sqrt(75)-2) + 2 + sqrt(75) + 4)-2 + 1 + 5)*2. 26400sqrt(3) + 124356 Simplify (-5 + (0 + sqrt(13))5 + 2 + 4 - (-1 + sqrt(468) + 0 + -1 + 3))2. 13 Simplify (-3 + sqrt(1100) + 1 + (-2 + sqrt(1100))2 - (6((sqrt(1100) - (-5 + sqrt(1100)) - sqrt(1100)) + 0))*2)4. -157592 + 14280sqrt(11) Simplify 0 + (sqrt(475) + sqrt(475) + (sqrt(475) - (-2 + sqrt(475))) + 1 + sqrt(475) + -2)2-5-5 + -3. 750sqrt(19) + 106897 Simplify -6((3 + sqrt(243))-5)*2 - ((sqrt(192) - sqrt(12))/sqrt(4) + sqrt(36)/(sqrt(12)1))-1. -37800 - 8096sqrt(3) Simplify (sqrt(10)/(sqrt(288) + -2sqrt(288)) + 3 + -12sqrt(5) + 2 + (sqrt(20) - sqrt(5)))2. -65sqrt(5)/6 + 4445/144 Simplify (((sqrt(320) - (sqrt(320) + 2 + sqrt(320))5 - (-3(-3sqrt(320) + sqrt(320)) + sqrt(320))) + (6sqrt(320)-2 + sqrt(320) - (-3 + sqrt(320)1)))4)2. 50176sqrt(5) + 4014864 Simplify (26(3 + sqrt(468)1) - (sqrt(468) + -1sqrt(468) + -3 - (sqrt(468) + sqrt(468) + -3 + 2)))*2. 6384sqrt(13) + 93172 Simplify 3 + -5 + (2(1 + -4((sqrt(833) - (sqrt(833) - (sqrt(833) + -2))) + 2)))*2. -224sqrt(17) + 53314 Simplify ((sqrt(153) + 6(sqrt(153) + 4 + sqrt(153)) + (sqrt(153) - -2(3 + sqrt(153))))-14)*2. 46080sqrt(17) + 641088 Simplify 4(41sqrt(500) + -3 + sqrt(500)3-6 + 5). -560sqrt(5) + 8 Simplify (sqrt(360)-2 - sqrt(360))/(sqrt(96)/(sqrt(48)/sqrt(4))) - (3 + sqrt(35)/(sqrt(7) - (sqrt(175) - 1sqrt(175))))*2. -15sqrt(5) - 14 Simplify (-1 + sqrt(99) + 1 + 2)*2 + 3 + (((sqrt(99) - (1sqrt(99) + sqrt(99))) + sqrt(99))2)/(sqrt(225)-4). 12sqrt(11) + 106 Simplify ((sqrt(16) + -4sqrt(256) + sqrt(256))-43)/((sqrt(48)/sqrt(150) + sqrt(512) + sqrt(512)-2)-4). 55sqrt(2)/13 Simplify (-6sqrt(200)/sqrt(10) + ((sqrt(20) - (sqrt(20) - 2sqrt(20))) + sqrt(20))1)/(sqrt(400)-4 - sqrt(28)/sqrt(7)2). sqrt(5)/14 Simplify -1(0 + sqrt(704) + -4 + 3 - (6(sqrt(704) - sqrt(704)-2) + -2sqrt(704) + 3))*2. -158416 - 960sqrt(11) Simplify -4 + ((4 + sqrt(405) + -1 - (sqrt(405) + 0 + 3) - (sqrt(405) + sqrt(405)2 + 4 + -5))2)*2. -216sqrt(5) + 14580 Simplify -3 + (-3-4(3(sqrt(2057) - (sqrt(2057) - ((sqrt(2057)1 - sqrt(2057) - sqrt(2057)) + sqrt(2057)))) + 1 + sqrt(2057) + 2)-4)2. 152064sqrt(17) + 4760061 Simplify (4 + (-3(sqrt(637) + 1) - (sqrt(637) - sqrt(637)-1)-1) + 0 + (sqrt(637) - (0 + sqrt(637)) - sqrt(637)) + -3)2. 56sqrt(13) + 2552 Simplify -1((6(sqrt(240) - sqrt(240)1) - sqrt(240)) + -5(sqrt(240) + 2sqrt(240)))/(((sqrt(240)/sqrt(4))/sqrt(4))/sqrt(3)). 64sqrt(3) Simplify 3 + ((-4 + (sqrt(1573)2-4 - (-4 + (sqrt(1573) - (0 + sqrt(1573)))))-4)-3)*2. -126720sqrt(13) + 14500371 Simplify (6(sqrt(22)24)/sqrt(11) + (-6sqrt(200)1)/sqrt(4))4. 72sqrt(2) Simplify 3-5(-1 + sqrt(176) + sqrt(176) + 4 + 4 + (1 + 1 + sqrt(176) + 2)2). -2985 - 600sqrt(11) Simplify (4(sqrt(119) + sqrt(119)1-2))/((4sqrt(2268))/sqrt(4)). -sqrt(17)/9 Simplify (4(5 + (sqrt(171) + 0)6)-2)24. 46080sqrt(19) + 1582336 Simplify (sqrt(165)/(4sqrt(30)/sqrt(6) + sqrt(5)))/((sqrt(1215)2)/sqrt(5)) + 0. sqrt(11)/90 Simplify -5(4 + (sqrt(119) - (sqrt(119) + sqrt(119)-1-3 - sqrt(119)))/((sqrt(7) - 3sqrt(7))-6) + 5). -45 + 5sqrt(17)/6 Simplify 3 + (6(sqrt(975)43)/(((sqrt(72) + sqrt(18))6)/sqrt(6)))2. 5203 Simplify (-1 + sqrt(304) + -1 + -4(0 + sqrt(304)) - (1 + 5 + sqrt(133)/(sqrt(56)/sqrt(2))))*2. 200sqrt(19) + 12131/4 Simplify 6((sqrt(117) + 3sqrt(117))-45)/(sqrt(27)/(sqrt(6)/sqrt(2))5) + -4. -96sqrt(13) - 4 Simplify -3 + (-3-4((5(sqrt(1088) - -3sqrt(1088)) - sqrt(1088)) + 1sqrt(1088)1)-3-4)*2. 9024307197 Simplify ((sqrt(720)-16)2 - (sqrt(720) + (3 + sqrt(720) + sqrt(720))-6)*2) + (-5 + (-2sqrt(720) + 1 - (sqrt(720) + 5(sqrt(720) + 2))))2. -15248 - 2064sqrt(5) Simplify -2 + 5sqrt(2)-1 + (sqrt(2) + 0 + sqrt(128) + sqrt(2))*2 + ((sqrt(264) + sqrt(264)-1)/sqrt(11))/(sqrt(108)/(sqrt(18)/sqrt(2))). -5sqrt(2) + 198 Simplify 4 + sqrt(1872) + -1 + 4 - (-3(1(sqrt(143) + sqrt(143) + 2sqrt(143)))/sqrt(11))*2. -1865 + 12sqrt(13) Simplify (-2 + ((1 + sqrt(162) + sqrt(162))1 + sqrt(162)3 + 3 - (-4 + 1(-2 + sqrt(162)2))))*2. 432sqrt(2) + 1522 Simplify ((1 + sqrt(1377))-6 - (-5 + -2sqrt(1377))) + -6(-1 + (sqrt(1377) - (sqrt(1377) + 1)))-1. -36sqrt(17) - 13 Simplify -1 + 0 + (((sqrt(675)-3)*2 - sqrt(675)) + 5 - 1(-2 + sqrt(675))*2)-2. -10803 - 90sqrt(3) Simplify (1 + 2(5 + (sqrt(420)/(sqrt(50)/sqrt(45)))/(sqrt(48)/(sqrt(32)/sqrt(4)-2))))-3. -33 + 36sqrt(7) Simplify 4 + (sqrt(243)/(sqrt(54)/(sqrt(6)-2)))/(((sqrt(36)2)/sqrt(4) - sqrt(9))4)-1. sqrt(3)/2 + 4 Simplify ((sqrt(1872) + 3)4 + 1(sqrt(1872) + 3))2 - (((1sqrt(637) - sqrt(637))-3)2 - (-6(sqrt(130) + (sqrt(130) - sqrt(130)-2)))/sqrt(10)). 1776sqrt(13) + 47025 Simplify (-3(sqrt(175)2)/sqrt(5))/(-6-2sqrt(7)-6). sqrt(5)/12 Simplify (sqrt(3) - ((sqrt(3) + (sqrt(3) - -5sqrt(147)))*2 - sqrt(3)) - sqrt(3)) + sqrt(432) + 4 - ((3sqrt(540) + sqrt(540))/sqrt(5) + 5). -4108 - 11sqrt(3) Simplify (sqrt(252) + -3 + -1 + ((-4sqrt(175) - sqrt(175) - sqrt(175))/sqrt(5))/sqrt(5) + -3)2. -14 Simplify -625((sqrt(245)22 - (sqrt(245) + 1 + 0)) + 2)*2. -132360 - 2520sqrt(5) Simplify (sqrt(143) - sqrt(143)33 - sqrt(143)-33)/(-22sqrt(176)-1). sqrt(13)/16 Simplify (2(sqrt(187)1 + sqrt(187) + sqrt(187)))/(sqrt(88)/sqrt(128)) - (((-2sqrt(102) - sqrt(102))1)/(sqrt(30)/(sqrt(5) - sqrt(125))))2. -2448 + 24sqrt(17) Simplify (-1 + -3-2sqrt(95)/sqrt(5) + sqrt(931) + -1 + -3 + 1 + -5)*2. -234sqrt(19) + 3292 Simplify 1-3((sqrt(20) + (sqrt(320) - (0 + sqrt(320))))*2 + sqrt(20) + 4sqrt(60)/sqrt(3) - (-1 + (2sqrt(80))/sqrt(4))). -63 - 18sqrt(5) Simplify ((sqrt(504)2 - sqrt(504))-4-2)/((4sqrt(6))/sqrt(3) + (sqrt(22)-2 - sqrt(22))/sqrt(11)). 48sqrt(7) Simplify (4sqrt(112)/(4sqrt(144) + sqrt(144)))/((4(sqrt(40)-2 + sqrt(40)))/(sqrt(40)-2)). 2sqrt(7)/15 Simplify -4 + ((-6((sqrt(153) - (sqrt(153) + 3)) + -4) - (-4 + -1 + -3 + sqrt(153)))4)*2. -4800sqrt(17) + 42444 Simplify -5 + (-2 + (-2sqrt(1331))2)6 - (4 + (-3sqrt(44)/sqrt(4)-6)*2-5). 49743 Simplify 5 + (-1 + (-5 + sqrt(300) + -2 - sqrt(300)) - ((sqrt(300) + sqrt(300)2 + sqrt(300))3 - (-1 + sqrt(300))-1))2 + -5. 1820sqrt(3) + 50749 Simplify 1 + -2 + (((-5 + -2*sqrt(325) + sqrt(325)	{ "pile_set_name": "DM Mathematics" }
? 141044 In base 12, what is 48a87 + -b? 48a78 In base 2, what is -101 + 110001111011000110? 110001111011000001 In base 10, what is 4 - 100921? -100917 In base 14, what is 1cb57 - -1? 1cb58 In base 12, what is 33 + 1a69? 1aa0 In base 5, what is -41 + 2042? 2001 In base 5, what is 4 + -2223032? -2223023 In base 9, what is 11433 - 0? 11433 In base 12, what is 415 + 22? 437 In base 2, what is -1100 + 100101011110010? 100101011100110 In base 5, what is -10 - 111304? -111314 In base 8, what is -13304652 - 4? -13304656 In base 6, what is -5 + -14321300? -14321305 In base 15, what is -10 + -12d8b? -12d9b In base 3, what is 0 + 121110221200? 121110221200 In base 10, what is 3 - 9348? -9345 In base 8, what is 21263352 + 0? 21263352 In base 11, what is 1818 - 145? 1683 In base 10, what is -42 - 38? -80 In base 3, what is 11 + -212011211111? -212011211100 In base 3, what is 0 + -1022020221? -1022020221 In base 15, what is 4e7 + 9? 501 In base 4, what is -3013130212 - 3? -3013130221 In base 10, what is -11 - -13573? 13562 In base 10, what is -5 + 253862? 253857 In base 5, what is 0 - 23244312? -23244312 In base 2, what is 10000111000111011001 - 11? 10000111000111010110 In base 4, what is 11000 + 20? 11020 In base 6, what is -1345 - 4112? -5501 In base 5, what is 10 + 41311141? 41311201 In base 10, what is 4316 + -44? 4272 In base 7, what is -4 + 110601? 110564 In base 14, what is -24d1 - 5? -24d6 In base 3, what is -2111 + -200? -10011 In base 15, what is 1d6a + 53? 1dbd In base 10, what is 0 - 9776? -9776 In base 2, what is -110111100111 - -11101? -110111001010 In base 10, what is 572 + 5348? 5920 In base 16, what is 4 - 6c28b? -6c287 In base 15, what is 4 + db52? db56 In base 2, what is 1010 + -1110011011? -1110010001 In base 12, what is -193 - 40? -213 In base 12, what is 0 - -366? 366 In base 7, what is -4512 - -20? -4462 In base 8, what is 7051 + 350? 7421 In base 3, what is -12200102 - 11? -12200120 In base 6, what is -4 + -45100? -45104 In base 6, what is -1144410 - 303? -1145113 In base 5, what is -1141140 + -2010? -1143200 In base 14, what is -68b17 - -1? -68b16 In base 2, what is -10000101111 + -10101111101? -100110101100 In base 2, what is 11 - -110110001111? 110110010010 In base 15, what is 4d - -482e? 487c In base 11, what is -2 - 4679? -4680 In base 2, what is 10100001000110 - -100? 10100001001010 In base 5, what is -10 - -2201102? 2201042 In base 10, what is 67 - -394? 461 In base 2, what is 11100100100111 - 1000011? 11100011100100 In base 16, what is a7 - -2893? 293a In base 9, what is 72 + 4142? 4224 In base 2, what is 11101111011 + -11001? 11101100010 In base 2, what is 101110110 - -10001000? 111111110 In base 9, what is -3081 - -11? -3070 In base 10, what is -37 - 719? -756 In base 13, what is 5 - 158cb? -158c6 In base 4, what is -33 - 122111002? -122111101 In base 4, what is 10030032 - -21? 10030113 In base 8, what is 1172 + -4? 1166 In base 11, what is 3388 + -683? 2805 In base 6, what is 440 + 355531? 400411 In base 9, what is -17 - -7242? 7224 In base 6, what is 44150405 + 0? 44150405 In base 2, what is -1000 - -1111100111100? 1111100110100 In base 14, what is -d490 - 1? -d491 In base 16, what is a - 2cc? -2c2 In base 14, what is cd - -a6? 195 In base 11, what is 4 - 530? -527 In base 4, what is 3 + -2310302? -2310233 In base 15, what is 0 - 5326? -5326 In base 11, what is 11 + a2725? a2736 In base 15, what is 5 - -2b12? 2b17 In base 11, what is 1484a77 - 2? 1484a75 In base 6, what is -1 + 22425345? 22425344 In base 6, what is 12 - -21104112? 21104124 In base 8, what is 4515 + 1224? 5741 In base 16, what is -1b1 + -4? -1b5 In base 4, what is -2232221 + -1302? -2300123 In base 9, what is -56 - 872? -1038 In base 15, what is -33e - -2d? -311 In base 10, what is 5 - 9026? -9021 In base 7, what is 211 - -3042? 3253 In base 9, what is -10120 - -18? -10101 In base 13, what is -6a + 2bb? 251 In base 2, what is -11001000110 - -101? -11001000001 In base 14, what is 3 - 9d40? -9d3b In base 13, what is 255a - 203? 2357 In base 3, what is 2001121221 + 1011? 2001200002 In base 12, what is 3 - -3324? 3327 In base 10, what is 251 - 336? -85 In base 15, what is -135b8 - -3? -135b5 In base 15, what is -27 + 485? 45d In base 4, what is 3 + -10002231? -10002222 In base 5, what is -1041414304 - 1? -1041414310 In base 9, what is 255266 - 5? 255261 In base 14, what is 4d20b + 5? 4d212 In base 13, what is -4 + -13cc6? -13cca In base 6, what is -5 - -233454? 233445 In base 10, what is 945 + 1242? 2187 In base 16, what is 386 - -28? 3ae In base 2, what is -11101010101111010 - -1? -11101010101111001 In base 4, what is -102 - 12122320? -12123022 In base 9, what is -6654 + -3? -6657 In base 6, what is -12011 - -351? -11220 In base 7, what is 1234 - -10154? 11421 In base 15, what is -89 - -6ee? 665 In base 14, what is 0 + -491a? -491a In base 10, what is -4443 - 312? -4755 In base 11, what is 4 + 14890? 14894 In base 12, what is 1 - -14688b? 146890 In base 16, what is -e59 + -59? -eb2 In base 12, what is -1 - 6037? -6038 In base 8, what is -24 + -63411? -63435 In base 10, what is -152 + -2477? -2629 In base 8, what is 3 - 25464? -25461 In base 10, what is -2036799 + -4? -2036803 In base 14, what is -1 + -1335a? -1335b In base 7, what is -42 - -5064? 5022 In base 8, what is -251264 + -7? -251273 In base 9, what is -345 - 563? -1018 In base 2, what is 1 + 110001000000? 110001000001 In base 10, what is -50 + -6938? -6988 In base 14, what is 2 + -ba158? -ba156 In base 14, what is 0 - -6559b? 6559b In base 12, what is 1 + 9263? 9264 In base 12, what is -1 + 219944? 219943 In base 15, what is 570 - -4? 574 In base 9, what is -346653 - 3? -346656 In base 12, what is -3 + 1307a? 13077 In base 9, what is 35614 + 2? 35616 In base 5, what is 11 + 2314233? 2314244 In base 16, what is 0 + 4c8d? 4c8d In base 11, what is -7 - 1a48? -1a54 In base 4, what is 2 - 10202002202? -10202002200 In base 16, what is -9c + 1ab4? 1a18 In base 7, what is -2 - 401023? -401025 In base 14, what is 68 + -35a? -2d2 In base 10, what is -35 - 14072? -14107 In base 13, what is -98bb + b? -98b0 In base 6, what is 33143 - -42? 33225 In base 9, what is -615310 + -5? -615315 In base 16, what is -a48 - 6? -a4e In base 4, what is -1111 + 11301212? 11300101 In base 16, what is 55 - -fb? 150 In base 11, what is 18 + -9611a? -96102 In base 11, what is 3 + 200247? 20024a In base 7, what is -4 + -1240023? -1240030 In base 14, what is -15a - -b0? -8a In base 5, what is -10001 + -113? -10114 In base 6, what is -34 - -3303? 3225 In base 10, what is 298 + 9956? 10254 In base 3, what is 12010000121 + -2001? 12002221120 In base 11, what is -133 - -73? -70 In base 2, what is -1000000 + 1110100101? 1101100101 In base 8, what is -153155 - -1? -153154 In base 12, what is 13 + 6aa5? 6ab8 In base 9, what is -5 + 24666? 24661 In base 5, what is 124 - 33123? -32444 In base 10, what is 16902 + 2? 16904 In base 5, what is 2 + -13120143? -13120141 In base 10, what is 707844 + -5? 707839 In base 8, what is -67434 - 2? -67436 In base 12, what is 6 - -3ab0? 3ab6 In base 7, what is 1 + 34611? 34612 In base 10, what is -2036 - -215? -1821 In base 10, what is 4 + 1992? 1996 In base 16, what is -17e3d + -5? -17e42 In base 12, what is -4341 - 6? -4347 In base 6, what is -1430 - -1204? -222 In base 10, what is -4 - 146737? -146741 In base 6, what is 30 - 2344? -2314 In base 2, what is 11011110001 + 1001101? 11100111110 In base 16, what is -20f120 - 3? -20f123 In base 14, what is 2c + 216a? 2198 In base 13, what is b + 8416? 8424 In base 5, what is -1340341 - -2? -1340334 In base 6, what is -1410 + 5443? 4033 In base 15, what is 2 - -76145? 76147 In base 9, what is 1663 + 5? 1668 In base 10, what is -157 + -342? -499 In base 8, what is -113 - 23? -136 In base 3, what is -12011 + -1210022? -1222110 In base 16, what is -9 - -145b6? 145ad In base 10, what is -5438 + 24? -5414 In base 2, what is -100011011100010101 + 0? -100011011100010101 In base 8, what is -1162 - 15353? -16535 In base 8, what is 261 - -104? 365 In base 8, what is 26 + 171556? 171604 In base 13, what is bbc83 - 8? bbc78 In base 12, what is 9a - 2b7? -219 In base 14, what is -3397c5 - 4? -3397c9 In base 13, what is 4 + 40687? 4068b In base 4, what is 30 - -201012013	{ "pile_set_name": "DM Mathematics" }
t p be s(o). Solve -pg + 0g = 0 for g. 0 Suppose 3w - w = 30. Let l be (-21)/(-15) - (-8)/(-20). Let s(i) = i2 + 5i - 2. Let c be s(-6). Solve -ct - l = w for t. -4 Let z = -6 - -8. Suppose -5t - zq + 5q + 12 = 0, -2t - 5q + 11 = 0. Suppose 1 = -f + t. Solve fc = c for c. 0 Let o = 7 + -3. Suppose 2l + o = 10. Suppose 12 = lm + 5v - 22, -5v + 40 = 5m. Solve -6 = -0c - mc for c. 2 Suppose 4p = x + 5, 5p + 0x - 13 = -x. Solve 0y = y + p for y. -2 Let t be ((-6)/(-15))/((-3)/15). Let r be (-2 - -3)/(t/(-14)). Let w = r + -1. Solve n = -2n - w for n. -2 Suppose 0 = 2m + 24 - 28. Solve -2 - m = -2v for v. 2 Let s(c) = c3 - 5c*2 + 3c + 2. Let y be s(4). Let l = y + 5. Solve -lr + 20 = r for r. 5 Suppose q = 3q - 8. Let x(a) = -a - 3. Let n be x(-5). Let j = q - n. Solve -8 = -3k - j for k. 2 Let j = -38 - -44. Solve 0 = q + j - 1 for q. -5 Suppose -6q - 3 = -3q. Let a be 1(-1 - 1/q). Solve 3m + am = 6 for m. 2 Suppose -i + 20 = s - 2s, 3i = -3s - 60. Let w be s/(-3(-2)/6). Let o be 2/3(-2 - w). Solve 0 = 3v - 3 - o for v. 5 Let y = 0 - -1. Let p = y + 2. Let o = 21 - 21. Solve o = -pm + m for m. 0 Suppose 4 = 2q - 4. Let x(u) be the third derivative of u*4/24 - 5u*3/6 + 2u*2. Let k be x(7). Solve -2 = -qs + k for s. 1 Let g(u) = -u + 6. Let j be g(5). Let q = 0 + 2. Let i = q + -2. Solve i = -3z + j + 2 for z. 1 Let d = 41 - 34. Solve -dz = -2z - 15 for z. 3 Suppose 5r - 11r + 120 = 0. Solve -g = 4g - r for g. 4 Suppose -4b - 7 = -3g - 0g, -3g + 21 = 3b. Let r = 13 - 12. Solve b - r = s for s. 1 Let a be ((-5)/13)/(-8 - -7). Solve -3n + a = 6 for n. 3 Let j(l) = -l3 + 3l*2 + 1. Let y be j(3). Let u be y + (2 - 5 - -2). Solve uk - k = -4 for k. 4 Let w = -66 - -71. Solve 3z + 2z - w = 0 for z. 1 Let n be 32/14 + 2/(-7). Suppose -3i + 13 + 8 = 0. Suppose -nl = -b - 3, b + 5l = 25 + i. Solve bk - 3k = -12 for k. -3 Suppose 6 + 57 = 21g. Solve -m + gm = -8 for m. -4 Suppose 4a = -a + 20. Suppose -2x - 11 = -3, 0 = m + 3x + 12. Solve a = f - m for f. 4 Let z = 46 - 41. Let g be -1 + 3/(3/2). Solve -zo = -4 - g for o. 1 Let x be (-2)/(((-5)/(-2))/(-5)). Let v be -6((-9)/3)/6. Suppose v = p + 1. Solve -p + 14 = xo for o. 3 Let y = -11 + 13. Solve yt - 3t = 0 for t. 0 Let v be 20/8 - (-2)/4. Solve 0 = x - vx - 4 for x. -2 Let f(q) = q*2 + 7q - 2. Let z = -9 - -3. Let k be f(z). Let t = k - -17. Solve 3s = -0s - t for s. -3 Suppose -17 = -3u + 4l, -u = u + 5l + 4. Let p(f) = 3f + f*2 + 2f*2 + 2 - 4f*2. Let r be p(u). Solve r = -k + 2k for k. 2 Let j = 49 + -45. Suppose 2k + d = -3k + 26, -4k + 19 = -d. Suppose 7 = 2p + 5s - 0, s = -k. Solve 5a + p = -j for a. -4 Let z(g) = -g*2 - 11g - 15. Let y be z(-9). Let x = 8 - 5. Solve 0 = -yf - x - 0 for f. -1 Let k(p) = 3p - 15. Let m be k(6). Solve 5 = -mf - 10 for f. -5 Suppose 42 = 4b - k, 0 = 5b - 2b - 5k - 40. Solve 4n - 2n = b for n. 5 Suppose 0 = 4x + k - 9, 2x + 9 = 2k + 1. Solve x = p - 1 for p. 2 Let l(s) be the second derivative of s4/12 + s3/3 + s*2 - 2s. Let q be l(-2). Solve 10 = -qg - 3g for g. -2 Suppose 0 = -4i - 4d + 12, i - 3i + 3d + 16 = 0. Suppose -im = -m - 320. Let o be ((-6)/5)/((-12)/m). Solve o = -2n - 0n for n. -4 Let u(k) = -k3 + 3k*2 - k. Let m be u(2). Suppose -b - m = -0. Let s = 0 - b. Solve st - 10 = -3t for t. 2 Let f(n) = 4n*3 + n - 2. Let x = 5 - 4. Let v be f(x). Solve 2l = 1 + v for l. 2 Let d be ((-3)/2)/(3/(-8)) - 1. Let v(u) = u*3 + 4u*2 - 7u - 3. Let r be v(-5). Solve r = -5z - d for z. -2 Let z(d) = -3d - 4d - d2 + 0d*2 + 0d*2. Let y be z(-7). Suppose -q + 4q + 3k - 51 = y, -4q + 77 = k. Solve h = 6h - q for h. 4 Let c = 7 + -4. Suppose -w - 14 = -2p - 2, 3w = -p - 1. Suppose -7y = -py. Solve q + 0q + c = y for q. -3 Let j(f) = f + 20. Let p be j(-18). Solve ps - 7s + 15 = 0 for s. 3 Let y(h) be the first derivative of -h4/4 + h2/2 + 4. Let p be y(-1). Solve g + g - 2 = p for g. 1 Let u = -6 - -10. Suppose 0l - l + 5a = -14, 2l - 16 = ua. Solve -lw + 0 - 4 = 0 for w. -1 Let l(z) = -z3 + 4z*2 - 3z + 1. Suppose -3 = -3u + 3. Let s be l(u). Solve a - s + 2 = 0 for a. 1 Suppose 3l - s - 42 = 22, -5l + 5s + 100 = 0. Suppose -6a + l = -4a. Solve -a - 1 = -3f for f. 4 Suppose 3b - 5t = 37, -18 = -5b + 2t + 12. Solve -5l + bl = 2 for l. -2 Suppose 0 = 5u + b - 25, -4b + 21 = 4u - 3b. Solve 0 = -ur + 11 + 5 for r. 4 Let s(l) = l*2 - 4l - 2. Let q be s(4). Let d = 6 + q. Solve 2z - 8 = dz for z. -4 Suppose -6 = -3o + 6. Solve -2c = 2c - o for c. 1 Let u be 54/8 + 4/16. Suppose -3c - 3q + 1 = -14, q + u = 5c. Solve -4f + 2f + c = 0 for f. 1 Let y(o) = -o*3 - 2o*2 + 2o + 3. Let r be y(-3). Suppose -4i + r = -18. Solve 3s + i + 3 = 0 for s. -3 Let i = -35 + 71. Let z be 908/i - 4/18. Solve -4q + z = q for q. 5 Let u(x) = -7x*3 - 2x*2 - 2x - 1. Let n be u(-1). Solve -3l + n = 18 for l. -4 Suppose -66 = -5c + 3k, 3k = -3c - k + 57. Suppose 2r + 2r = 2p + 6, 0 = 5r - c. Solve 2q = -pq + 15 for q. 3 Suppose 0 = 5y - 3l - 112, 12 + 8 = y - 3l. Let u(d) = -d*2 + 5d - 2. Let r = 6 + -3. Let m be u(r). Solve 7 = -mz + y for z. 4 Let y be ((-8)/(-6))/(26/39). Solve 2j + 12 - y = 0 for j. -5 Let o(j) = 2j + 4. Let d be o(-10). Let k = d + 19. Solve kx + 14 - 2 = 0 for x. -4 Let c(l) = -l3 + l2 + l. Let o(t) = 7t3 - 11t*2 - 4t + 2. Let y(g) = -6c(g) - o(g). Let q be y(3). Solve q = -d - d for d. -5 Suppose 0 = 7w - 0w - 21. Solve -wy = 5 + 1 for y. -2 Let p(a) = 0a2 - 5a*2 - 3 + 4a*2 + 2 + 5a. Let c be p(4). Let b(t) = -t*3 - 8t*2 - 7t + 2. Let m be b(-7). Solve -c = r + m for r. -5 Suppose 0 = -0o - o - 5. Let b = 5 + o. Let y(c) = -3c. Let x be y(-1). Solve bd = xd + 12 for d. -4 Let u = -4 - -28. Suppose 4g + 2y - 19 = g, u = 3g + 3y. Solve gf - 4f + 2 = 0 for f. 2 Let u(n) = -n*3 - 3n*2 - 4n - 10. Let z be u(-4). Solve 5a - 3 = z for a. 5 Let i(z) = z2 - z + 54. Let t be i(0). Let q be (2 - t/15)-10. Solve j + 3j - q = 0 for j. 4 Suppose -7k = -5k - 4. Let t = 2 - 2. Solve t = j + k for j. -2 Let k(i) = 16i*2. Let c be k(-1). Solve 4v + 0 + c = 0 for v. -4 Suppose w - 51 = -2m, -2m = 3w - 10 - 47. Solve 5o = m + 1 for o. 5 Let h(f) = f*3 - 5f*2 - 15f + 8. Let r be h(7). Solve -x - r = -4 for x. 3 Let y(h) = -h*3 - 2h*2 + 1. Let o be y(-1). Suppose 0s + s = o. Solve -c - 1 = -sc for c. -1 Suppose -4c + 9 + 3 = 0. Suppose 0 = 3o + 5b - c, -4o - 5b - 9 = -3o. Suppose v = 4v - o. Solve 2 = 4k - v for k. 1 Let k = 18 + -11. Solve 2v - kv - 5 = 0 for v. -1 Let i(x) = -x2 + 5x + 5. Let z be i(5). Solve 8 = zc + 33 for c. -5 Let l(r) = 2r. Let n be l(1). Suppose 3s = 2f + n, 0f + 5s = -3f + 35. Solve -3o + 1 + f = 0 for o. 2 Let g be 6/(5/2 + -1). Solve -2 = u - g for u. 2 Suppose -y + q - 6 = 0, 3y = -2q - 3 + 5. Let c be 0y3/(-12). Solve cr = 2r - 6 for r. 3 Let f(l) = -7l2 - 11l - 5. Let p(n) = 3n2 + 5n + 2. Let c(i) = -2f(i) - 5p(i). Let q be c(-3). Solve q - 4 = 4w for w. -1 Let w(q) = -q3 + 8q*2 + 10q - 13. Let x be w(9). Let n be -1x/84. Solve -5r = -3r + n for r. -1 Let r(w) be the second derivative of w5/20 - w4/3 - w*3/6 + w. Let k = 49 - 44. Let v be r(k). Solve 0 = -m - 4m + v for m. 4 Let q be 1(-10)/(-1 + -1). Suppose 0 = w - qw + 32. Suppose 5h - w = 2a + 8, 3h + a = 3. Solve -n = -hn for n. 0 Let l(r) = r*3 + 4r*2 + 3r + 3. Let n be l(-3). Solve j + 0 = n for j. 3 Suppose -10 = 4w - 9w. Suppose -h = wh + 2m + 23, 4h + 2m + 28 = 0. Let u = 5 + h. Solve g + 0g = u for g. 0 Suppose 5t - 3 = 2. Let q be (53/3)/t. Solve qg + 6 = 2g for g. -2 Suppose 97x = 101x. Solve -s - 1 = -xs for s. -1 Suppose -2p + 3i + 12 = 0, -3p + 8p - 4i - 37 = 0. Let o = -5 + p. Solve -1 - o = 5q for q. -1 Suppose 5d - 2d = 6. Solve ds = -s - 15 for s. -5 Let h be -5(0 + -1 - 2). Solve d + h = 4d for d. 5 Suppose 0 = x + 3y - 21, -3 - 145 = -4x + 4y. Solve -5s + 13 - x = 0 for s. -4 Let y = 16 - 11. Let m = y + -3. Solve -l + 5 = m for l. 3 Let m be (-3)/1(3 - 4). Solve 4 = -mn + 4n for n. 4 Suppose -2*m + j +	{ "pile_set_name": "DM Mathematics" }
1:33 PM and 2:20 AM? 167 What is 467 minutes before 12:57 PM? 5:10 AM What is 171 minutes after 8:54 AM? 11:45 AM What is 209 minutes after 1:16 AM? 4:45 AM What is 456 minutes before 3:07 PM? 7:31 AM How many minutes are there between 12:23 PM and 12:59 PM? 36 What is 675 minutes after 4:46 PM? 4:01 AM How many minutes are there between 4:08 PM and 4:56 PM? 48 What is 274 minutes before 8:15 PM? 3:41 PM What is 49 minutes after 4:31 PM? 5:20 PM What is 644 minutes before 9:24 AM? 10:40 PM How many minutes are there between 12:05 AM and 5:26 AM? 321 How many minutes are there between 9:14 AM and 12:09 PM? 175 How many minutes are there between 4:01 AM and 11:00 AM? 419 How many minutes are there between 11:48 PM and 11:09 AM? 681 What is 265 minutes before 12:55 AM? 8:30 PM How many minutes are there between 12:40 PM and 11:42 PM? 662 What is 195 minutes after 4:57 PM? 8:12 PM What is 578 minutes after 5:14 AM? 2:52 PM How many minutes are there between 1:04 AM and 10:46 AM? 582 How many minutes are there between 2:32 AM and 4:22 AM? 110 How many minutes are there between 7:08 PM and 8:00 PM? 52 What is 456 minutes before 1:24 PM? 5:48 AM How many minutes are there between 10:32 PM and 12:15 AM? 103 What is 623 minutes before 9:37 PM? 11:14 AM What is 342 minutes before 6:24 AM? 12:42 AM How many minutes are there between 1:30 AM and 9:16 AM? 466 How many minutes are there between 2:39 AM and 10:03 AM? 444 How many minutes are there between 4:44 PM and 11:15 PM? 391 How many minutes are there between 9:20 PM and 12:25 AM? 185 What is 517 minutes after 3:05 AM? 11:42 AM What is 708 minutes before 10:04 PM? 10:16 AM What is 50 minutes before 10:05 AM? 9:15 AM How many minutes are there between 6:02 PM and 6:13 PM? 11 How many minutes are there between 4:46 AM and 8:37 AM? 231 What is 67 minutes before 11:19 AM? 10:12 AM How many minutes are there between 4:04 PM and 8:18 PM? 254 What is 704 minutes after 5:21 AM? 5:05 PM What is 253 minutes before 2:52 PM? 10:39 AM What is 430 minutes after 7:23 PM? 2:33 AM What is 661 minutes before 12:25 AM? 1:24 PM How many minutes are there between 9:47 AM and 11:25 AM? 98 How many minutes are there between 3:38 AM and 3:32 PM? 714 What is 27 minutes after 12:53 AM? 1:20 AM How many minutes are there between 9:00 AM and 11:15 AM? 135 What is 41 minutes after 11:10 AM? 11:51 AM How many minutes are there between 5:56 PM and 5:21 AM? 685 How many minutes are there between 4:39 AM and 7:54 AM? 195 How many minutes are there between 9:01 AM and 11:35 AM? 154 How many minutes are there between 10:31 PM and 11:25 PM? 54 What is 462 minutes before 11:12 AM? 3:30 AM How many minutes are there between 12:39 PM and 7:10 PM? 391 How many minutes are there between 9:34 PM and 5:57 AM? 503 What is 655 minutes after 3:27 PM? 2:22 AM What is 708 minutes before 12:59 PM? 1:11 AM What is 2 minutes after 2:28 PM? 2:30 PM What is 367 minutes after 5:54 AM? 12:01 PM How many minutes are there between 10:51 AM and 12:57 PM? 126 What is 158 minutes before 5:12 AM? 2:34 AM How many minutes are there between 11:21 AM and 7:55 PM? 514 What is 505 minutes before 10:08 AM? 1:43 AM How many minutes are there between 8:13 PM and 9:44 PM? 91 How many minutes are there between 9:20 AM and 10:56 AM? 96 What is 676 minutes after 10:14 AM? 9:30 PM What is 126 minutes before 3:32 AM? 1:26 AM How many minutes are there between 6:53 PM and 6:14 AM? 681 How many minutes are there between 6:34 PM and 1:00 AM? 386 How many minutes are there between 11:27 AM and 9:13 PM? 586 What is 59 minutes before 9:25 AM? 8:26 AM How many minutes are there between 2:25 PM and 9:51 PM? 446 How many minutes are there between 2:45 AM and 1:31 PM? 646 What is 310 minutes after 5:07 PM? 10:17 PM How many minutes are there between 6:10 PM and 8:26 PM? 136 How many minutes are there between 8:04 AM and 5:20 PM? 556 What is 501 minutes before 4:10 PM? 7:49 AM What is 337 minutes before 6:12 PM? 12:35 PM How many minutes are there between 12:21 PM and 8:08 PM? 467 What is 132 minutes after 4:10 PM? 6:22 PM What is 661 minutes after 3:39 PM? 2:40 AM What is 254 minutes before 11:01 PM? 6:47 PM How many minutes are there between 3:25 AM and 6:18 AM? 173 What is 167 minutes after 5:16 PM? 8:03 PM What is 634 minutes before 10:50 PM? 12:16 PM How many minutes are there between 10:07 PM and 12:41 AM? 154 How many minutes are there between 9:49 PM and 6:29 AM? 520 What is 101 minutes after 9:46 PM? 11:27 PM How many minutes are there between 11:08 AM and 9:13 PM? 605 What is 520 minutes before 10:23 AM? 1:43 AM What is 154 minutes before 6:01 PM? 3:27 PM How many minutes are there between 1:27 AM and 8:11 AM? 404 What is 688 minutes after 4:39 PM? 4:07 AM What is 398 minutes after 2:15 PM? 8:53 PM How many minutes are there between 1:47 PM and 11:25 PM? 578 How many minutes are there between 9:58 PM and 8:41 AM? 643 How many minutes are there between 3:09 PM and 8:31 PM? 322 What is 101 minutes before 9:11 AM? 7:30 AM How many minutes are there between 9:28 AM and 10:20 AM? 52 What is 20 minutes after 11:50 AM? 12:10 PM What is 76 minutes before 5:28 AM? 4:12 AM What is 453 minutes after 8:46 AM? 4:19 PM What is 418 minutes after 7:28 PM? 2:26 AM How many minutes are there between 10:09 AM and 12:59 PM? 170 What is 310 minutes before 8:42 PM? 3:32 PM What is 286 minutes before 9:56 AM? 5:10 AM What is 670 minutes after 3:40 PM? 2:50 AM What is 456 minutes before 6:09 AM? 10:33 PM What is 289 minutes before 7:10 AM? 2:21 AM How many minutes are there between 6:01 AM and 6:42 AM? 41 What is 560 minutes before 11:01 PM? 1:41 PM What is 315 minutes after 6:18 AM? 11:33 AM How many minutes are there between 7:59 PM and 12:59 AM? 300 What is 588 minutes after 8:10 PM? 5:58 AM How many minutes are there between 6:14 AM and 3:52 PM? 578 What is 705 minutes before 8:41 PM? 8:56 AM How many minutes are there between 8:42 AM and 4:44 PM? 482 How many minutes are there between 10:47 AM and 10:29 PM? 702 How many minutes are there between 7:04 AM and 8:35 AM? 91 What is 54 minutes after 11:47 AM? 12:41 PM How many minutes are there between 1:17 PM and 3:01 PM? 104 How many minutes are there between 10:32 AM and 3:42 PM? 310 How many minutes are there between 4:05 PM and 2:44 AM? 639 What is 481 minutes before 7:52 PM? 11:51 AM How many minutes are there between 1:28 PM and 1:30 PM? 2 How many minutes are there between 9:08 PM and 6:15 AM? 547 How many minutes are there between 8:43 AM and 4:16 PM? 453 What is 148 minutes before 4:11 AM? 1:43 AM How many minutes are there between 12:05 PM and 2:43 PM? 158 How many minutes are there between 7:27 AM and 8:19 AM? 52 How many minutes are there between 2:22 PM and 3:01 PM? 39 How many minutes are there between 5:16 PM and 7:35 PM? 139 How many minutes are there between 10:06 AM and 4:52 PM? 406 How many minutes are there between 4:57 PM and 5:49 PM? 52 How many minutes are there between 4:01 PM and 3:13 AM? 672 How many minutes are there between 1:02 PM and 12:09 AM? 667 What is 458 minutes after 3:23 AM? 11:01 AM What is 313 minutes before 6:18 AM? 1:05 AM What is 97 minutes before 3:06 AM? 1:29 AM How many minutes are there between 3:52 AM and 10:34 AM? 402 What is 337 minutes before 7:20 PM? 1:43 PM How many minutes are there between 12:02 PM and 6:44 PM? 402 How many minutes are there between 1:08 PM and 6:36 PM? 328 How many minutes are there between 8:25 AM and 8:44 AM? 19 How many minutes are there between 12:13 AM and 6:40 AM? 387 How many minutes are there between 11:39 AM and 12:17 PM? 38 What is 572 minutes before 6:49 AM? 9:17 PM What is 111 minutes before 11:05 PM? 9:14 PM What is 398 minutes after 9:14 PM? 3:52 AM What is 96 minutes after 11:11 AM? 12:47 PM How many minutes are there between 5:56 PM and 5:39 AM? 703 What is 126 minutes after 12:45 AM? 2:51 AM How many minutes are there between 11:48 AM and 11:05 PM? 677 How many minutes are there between 10:51 PM and 10:53 PM? 2 How many minutes are there between 6:19 AM and 4:30 PM? 611 What is 667 minutes after 8:16 PM? 7:23 AM What is 490 minutes before 9:48 AM? 1:38 AM What is 675 minutes before 12:43 PM? 1:28 AM How many minutes are there between 9:12 PM and 1:36 AM? 264	{ "pile_set_name": "DM Mathematics" }
4 Which is the second smallest value? (a) 0.02 (b) 2.5 (c) 0.0278 c What is the second biggest value in -525, -0.05, 0.1? -0.05 What is the third smallest value in -10, 311, -34, 0? 0 What is the biggest value in 0.4, 2/9, 5897/2? 5897/2 What is the second smallest value in 1/39, 2, -13, -4/7, 9? -4/7 What is the third smallest value in -201, 4/5, 2/5? 4/5 Which is the fourth biggest value? (a) 8093 (b) -11 (c) -5 (d) -4/3 b Which is the third smallest value? (a) -1/9 (b) 91 (c) -3 (d) 4 (e) 3/5 (f) 0.5 f Which is the second biggest value? (a) 3 (b) -3 (c) 320/61 a What is the fifth smallest value in 1, 16, -1/8, 0.4, -1.25? 16 What is the second biggest value in -0.3, -5, -3/5, -6, 3, -12392? -0.3 Which is the second biggest value? (a) 0.1 (b) 1 (c) -0.025 (d) 209 b What is the second biggest value in 26/7, 1, 270? 26/7 Which is the third biggest value? (a) -3 (b) -10537 (c) -4 b What is the fifth biggest value in -0.055, -0.5, 0.4, 3, 107? -0.5 Which is the third smallest value? (a) -4 (b) -1/3 (c) -10/11 (d) -0.1 (e) 49 b Which is the second smallest value? (a) 7/6 (b) 34 (c) -15/8 a What is the third smallest value in -1/4, 545, -0.06, 0.3, 3? 0.3 Which is the fifth smallest value? (a) -3 (b) -2 (c) -0.06 (d) -8 (e) -0.9 c What is the second smallest value in 7/4, 11, -0.2, -572? -0.2 Which is the second biggest value? (a) -0.15 (b) 1/3 (c) 116 (d) -162 b Which is the fourth biggest value? (a) 0.1 (b) 0.4 (c) -1 (d) 0.65 (e) -1/5 (f) -2/15 f Which is the fourth smallest value? (a) 0.2 (b) -25/6 (c) -1/7 (d) -1.63 a What is the third biggest value in 0.1, 5, 2/9, 0.227, -1/2? 2/9 What is the third smallest value in 0.25, -323, -11? 0.25 Which is the third smallest value? (a) -2/339 (b) 2/13 (c) 14/5 c What is the smallest value in -32, 3, -3, -24, 0.5, 11? -32 What is the second biggest value in -0.02, -6, -0.17? -0.17 What is the second smallest value in -4, 2011/3, -11, 0.1? -4 Which is the second smallest value? (a) 0.18 (b) 4 (c) 6382 b Which is the second smallest value? (a) 2/3 (b) -74/99 (c) -3 b Which is the fifth smallest value? (a) 2/193 (b) 0.2 (c) 18 (d) -0.01 (e) -1 c Which is the second smallest value? (a) 4 (b) -0.08 (c) -0.09 b What is the biggest value in -0.3, -0.2, -4, -21? -0.2 What is the sixth biggest value in 9, 3/11, -5, -13, -3, 7? -13 What is the third biggest value in 10, 0.02, 0.0366? 0.02 Which is the sixth smallest value? (a) -4 (b) 1 (c) 0.41 (d) 4/7 (e) 2 (f) 2/11 e Which is the third biggest value? (a) -6 (b) -386 (c) -3/5 (d) 0 a What is the third smallest value in 14.7, -4/5, -24/7? 14.7 Which is the fourth biggest value? (a) 0.1 (b) 124/19 (c) -0.1 (d) 4 c What is the biggest value in -0.3, -0.4, 0.01, -50/17? 0.01 What is the smallest value in -34008, -15, -4? -34008 What is the fourth smallest value in 0, 8/3, -2, 2/31, 0.3? 0.3 What is the third smallest value in 2/213, -0.3, 209? 209 What is the biggest value in -0.216, -1/20, -0.7, 2? 2 What is the smallest value in 1060.2, 0, 88? 0 Which is the third smallest value? (a) -4 (b) -21/5 (c) 34 (d) 5/2 (e) 3 (f) 39 d Which is the fifth smallest value? (a) -5 (b) 4 (c) 2/229 (d) -305 (e) 0.4 b What is the smallest value in 1/170, 2/35, -0.3, 4, -1/3, -3? -3 What is the smallest value in -90, -119, -2, -4? -119 Which is the second biggest value? (a) -3 (b) -8/429 (c) -0.4 (d) 0.016 b What is the third biggest value in 4/9, -257635, 0.12? -257635 What is the smallest value in 0, 232/9, -2/7, 5, -0.1? -2/7 What is the second biggest value in 5, 2/45, -4, 1, 0.71? 1 Which is the fourth biggest value? (a) -5 (b) -1/24 (c) 0.3 (d) 0.4 (e) 3/4 (f) -9/11 b Which is the second biggest value? (a) -0.03 (b) 2/35 (c) -1/2 (d) 1 (e) -11/4 b What is the third biggest value in -2, 0.0259, 0, -23.9? -2 What is the fourth smallest value in -24, 3/8, -0.5, -5/4, 1, 0.2? 0.2 Which is the third biggest value? (a) -1.1 (b) 5/2 (c) -0.1538 (d) 5 c Which is the fifth biggest value? (a) 19/2 (b) 0.1 (c) -4/7 (d) -5 (e) 4/7 d What is the smallest value in -1/7, 0.204, 0.4, -1.9? -1.9 What is the second biggest value in -3.72, -0.033, -3? -3 Which is the third biggest value? (a) 0 (b) 3 (c) -0.017 (d) -2/71 c What is the smallest value in 10, -2/5, 27.6? -2/5 Which is the fifth smallest value? (a) 0.42 (b) -0.4 (c) 0 (d) 2/21 (e) -55987 (f) 1/4 f Which is the fifth biggest value? (a) -4 (b) 0 (c) 1.39 (d) 5 (e) 22/25 a Which is the fifth smallest value? (a) 1 (b) -2 (c) -3 (d) 6/127 (e) -3.6 a What is the sixth smallest value in -0.1, -0.4, 4/37, -5, 0, 3? 3 Which is the third biggest value? (a) 4/9 (b) -2/3 (c) 14 b Which is the second smallest value? (a) -67/19 (b) 0.7 (c) -2/11 c Which is the second biggest value? (a) -0.3 (b) -0.345988 (c) -3 (d) -1 b Which is the fourth smallest value? (a) 4 (b) -3/5 (c) 2 (d) 0.2 (e) -0.0865 c Which is the smallest value? (a) -3/7 (b) 4/3 (c) -6 (d) 0.03 c Which is the fifth smallest value? (a) -2/5 (b) 0.07 (c) 1/2 (d) -0.2 (e) -3/2 c Which is the second smallest value? (a) -1/4 (b) -3/5 (c) -1 (d) -3 (e) -0.023 c What is the fourth biggest value in 1/6, 0, -1, -2/57, -2/25? -2/25 What is the biggest value in -1/42, -6, -0.5, -239, -4? -1/42 What is the biggest value in 3/23, -52/55, -4? 3/23 What is the fourth biggest value in -2, 3, -0.52, 1, -0.3, 0? -0.3 Which is the third biggest value? (a) 1 (b) 19941 (c) -3/8 c Which is the second smallest value? (a) 0.1 (b) -3569 (c) 1/6 (d) 0.4 a Which is the smallest value? (a) -1/3 (b) -0.1 (c) -221818 c Which is the fifth biggest value? (a) 2/13 (b) 1/7 (c) -21 (d) 2 (e) 3/17 c Which is the second biggest value? (a) 1/8 (b) 2/19 (c) -6 (d) 31 (e) -643 (f) 17 f What is the sixth smallest value in 2/13, 4908, 0.4, -2/7, 1/5, -2/15? 4908 What is the fourth smallest value in 3, -2/7, -3/2, 1/3, -2/41, -6/37? -2/41 Which is the second biggest value? (a) 13/5 (b) -8 (c) -0.016 c Which is the fourth smallest value? (a) 0.02 (b) -24 (c) 4/13 (d) 0.5 (e) -0.4 c Which is the third smallest value? (a) 5 (b) -7 (c) 84/101 a Which is the third smallest value? (a) 1/2 (b) 18/91 (c) -0.1 (d) 4/3 (e) -1/2 b What is the smallest value in 163, -0.2, 23, 5, 1/10? -0.2 Which is the second biggest value? (a) 8597 (b) -2 (c) -0.5 c What is the third biggest value in 2/3, 0.5, 1/67, -2, 35/4, 1/4? 0.5 Which is the third smallest value? (a) 6 (b) -3.29 (c) 2/7 a What is the fifth smallest value in -0.15, -2, -9/7, 2, 1/4? 2 Which is the biggest value? (a) -12.725 (b) 0 (c) 0.2 (d) -5 c Which is the second smallest value? (a) -5.5 (b) -98/5 (c) -4 a Which is the biggest value? (a) 17551 (b) -2 (c) 1/4 a Which is the third biggest value? (a) 0 (b) -144 (c) -4 (d) -1/29 c What is the fifth smallest value in -0.1, 0, -6/17, 11/9, 0.18? 11/9 Which is the third biggest value? (a) 18/11 (b) 2/89 (c) 19/3 (d) 2/5 d Which is the biggest value? (a) 145 (b) 2 (c) -0.524 a What is the biggest value in 0.1, -16, 71, 5? 71 What is the second biggest value in 0.99, -2/11, -570? -2/11 Which is the third biggest value? (a) -37 (b) 0.04 (c) -2/9 (d) 2/13 c What is the second smallest value in -7, -349, -0.044? -7 What is the second smallest value in 3, 1/7, 1/28, -139? 1/28 What is the biggest value in -0.17, 0.4, -596, 9, 5? 9 What is the fourth smallest value in 1/156, 1, 2/481, 3, 2? 2 Which is the biggest value? (a) 5 (b) 17/10 (c) -12/11 (d) 2 a What is the second smallest value in 2/8013, 92, 5? 5 What is the second biggest value in 2/703, 0.09, 4, 0.18? 0.18 Which is the biggest value? (a) -29 (b) 0.3 (c) 18 (d) -0.3 c What is the second biggest value in 233, -30/23, 0.28? 0.28 Which is the second biggest value? (a) -5 (b) -93936 (c) 0.4 a Which is the third biggest value? (a) 1 (b) -3 (c) -2/11 (d) -1/4 (e) 5/4 (f) 1/404 f What is the second biggest value in -760, -1, 2, 2/7? 2/7 Which is the smallest value? (a) 559 (b) -2 (c) 0 (d) -0.4 b What is the fourth smallest value in -1, 3, -1/3, 10, -190? 3 What is the biggest value in -10, 0.5, 17489, 1/5? 17489 What is the third	{ "pile_set_name": "DM Mathematics" }
-1.3 - j. Round f to 1 dp. 0 Suppose 3f = 4f + 4650804. Let t = -12150804 - f. Round t to the nearest 1000000. -8000000 Suppose -183 - 624 = -3c. Let n(d) = -1 + 2916d + 3672d + cd. Let l be n(-7). What is l rounded to the nearest 10000? -50000 Let c = 19 + -19.022. Let m = c - -0.065. What is m rounded to 2 dps? 0.04 Let r = 43 + -42.9999977. What is r rounded to 6 dps? 0.000002 Let z = 0.177 - 0.17541. Round z to 4 dps. 0.0016 Let k = -2.718 - -0.078. Round k to 1 dp. -2.6 Let o = 20.799335 + -20.8. What is o rounded to 4 decimal places? -0.0007 Let l = 1984794.3000021 - 1984795.8. Let r = 7.5 + -6. Let f = l + r. What is f rounded to six decimal places? 0.000002 Let r = 3792.229 + -3790. Let v = -0.678 + r. Let h = -1.65 + v. Round h to two decimal places. -0.1 Suppose -9x + 14x - 281000 = 0. Round x to the nearest one thousand. 56000 Let h(m) = 3499m3 + m2 + 3m - 2. Let t = 3 + -3. Let i = 2 - t. Let c be h(i). Round c to the nearest ten thousand. 30000 Suppose 0i = -5i. Suppose iq = 3q + 2b - 254990, 339985 = 4q + 3b. Round q to the nearest 10000. 90000 Let r = 75.34 + -76. Let n = -0.6559 - r. What is n rounded to three decimal places? 0.004 Let a = -772.12 + 804. Let m = -31 + a. What is m rounded to 1 dp? 0.9 Let j be (466/3)/((-6)/18). What is j rounded to the nearest one hundred? -500 Let r(q) = 84926q - 6. Let d be r(4). Let l = -794938 + d. Let g = -144760 + l. What is g rounded to the nearest one million? -1000000 Suppose -p = p - 68548. Suppose -5o = -5274 + p. What is o rounded to the nearest one thousand? -6000 Let t = 1.05 - 1. Round t to two decimal places. 0.05 Let g = -0.3 + 0.4. Let d = -4419.800115 - -4419.7. Let f = g + d. What is f rounded to five dps? -0.00012 Let c = -95.7 - -109. What is c rounded to the nearest integer? 13 Let q(p) be the third derivative of 7p5/60 - p4/4 - 4p3/3 - 3p*2. Let b be q(-6). What is b rounded to the nearest 100? 300 Let n(f) = -12 + 2f*2 - 12f + f - 3f2. Let u be n(-9). Let r be (65625/u)/((-2)/1024). What is r rounded to the nearest one million? -6000000 Let y = 0.002998 + -0.003. What is y rounded to 5 decimal places? 0 Let c(x) = -3x + 2x - x3 - 8 - 8x*2 + 3x - 4x. Let k be c(-6). What is k rounded to the nearest 10? -70 Let x = 48 + -48.0206. Round x to 2 decimal places. -0.02 Let m = -25 + 13.3. Let s = -10.23 - m. Round s to 1 decimal place. 1.5 Let d = 6.8 - -1.2. Let s = d - 7.97. Round s to 1 dp. 0 Let x be ((-53)/2)/(1/(-2)). Let c = x + -153. What is c rounded to the nearest 1000? 0 Let h = 291330.9900021 + -291305.99. Let y = 25 - h. Round y to six dps. -0.000002 Let l = -10 + 19.2. What is l rounded to zero dps? 9 Let u = -6.46 + -0.94. Round u to zero decimal places. -7 Let y(q) = -3527q*2 + 3q + 2. Let c be y(2). Round c to the nearest ten thousand. -10000 Let i be (1-40)/(-2)-22000. Round i to the nearest 100000. -400000 Suppose -4n + 0n - 4m + 3240016 = 0, 2m = 2n - 1619992. Round n to the nearest one hundred thousand. 800000 Let d = 9 + -8.9994. What is d rounded to three dps? 0.001 Let i = -466.1 - -489. Let a = i + -22.9000097. What is a rounded to six dps? -0.00001 Suppose -5t - j = 4j - 4500000, -4j - 1800000 = -2t. Round t to the nearest 100000. 900000 Let b be 5359972/8 + 3/6. Let u be -1 + (-2 - 0) - b. Round u to the nearest one hundred thousand. -700000 Let x = 40.91 - 0.91. Let h = x + -45.8. What is h rounded to the nearest integer? -6 Suppose -3k = 0, 2q - 3040 = -2q + 2k. Suppose 6p + q = 8p. Round p to the nearest 100. 400 Let j = -4.7 + 4.89. Let t = j - 0.18999887. What is t rounded to 7 decimal places? 0.0000011 Let v be 5258 + 1/5 + (-18)/(-10). What is v rounded to the nearest 1000? 5000 Let w be (154/(-9))/(2/165). Round w to the nearest 100. -600 Suppose 3o + 11 = -22. Let w = -6 - o. Suppose -wh + 2m = -23994, -15087 = -5h - 3m + 8922. Round h to the nearest 1000. 5000 Let k = 0.24 + -0.17. Round k to 1 dp. 0.1 Let f(w) = w2 + w + 10397. Let j be f(0). Suppose x - r = -j, -4x - 2r = 44319 - 2713. Round x to the nearest 1000. -10000 Suppose -5r - 5w = -62963025, 0 = -w + 2w + 1. Suppose -5q - 56592606 = -r. Round q to the nearest 1000000. -9000000 Suppose 4q - 27 = 3r, 2q - 3r = -r + 14. Suppose qb + 5v + 30499985 = b, -24399985 = 4b + 5v. Round b to the nearest one million. -6000000 Let l = 814.0985 + -815. Let d = l - -0.9. What is d rounded to three decimal places? -0.002 Suppose -m - 2m = 0. Suppose w + mw - 32400 = 0. Suppose s = -2s - w. Round s to the nearest one thousand. -11000 Let g = 3.5 - 3. Let c = -5.6 - -5.025. Let h = c + g. Round h to two dps. -0.08 Let d = -108875678.0000007 - -108875686. Let t = 0.2 + -8.2. Let r = d + t. Round r to 6 dps. -0.000001 Let x be 252/7(-158)/6. Let p = 428 + x. What is p rounded to the nearest one hundred? -500 Let m = 9718.3 + -402.3. Let j = m + -9316.19055. Let d = j + 0.19. Round d to four dps. -0.0006 Let w = -9.8 + 19.4. Let o = -22103629 - -22103638.599937. Let t = o - w. Round t to 5 dps. -0.00006 Let c = -20.92 + 14.1. Let m = c - 0.18. Let j = -6.9928 - m. Round j to three dps. 0.007 Let f = -19 - -11. Let d(j) = 32814j*2 + 12j. Let p be d(f). What is p rounded to the nearest one million? 2000000 Let i(n) be the third derivative of -n5/60 - n3/2 - 2n2. Let l be i(-6). Round l to the nearest 10. -40 Let w = -1691.101 + -4413.9025. Let g = w - -6103. Let m = 2 + g. Round m to three dps. -0.004 Let a = 28.68384 + -5.68694. Let g = a - 23. What is g rounded to three dps? -0.003 Let h = 8.8 + -0.8. Let a = h - 7.936. What is a rounded to 2 dps? 0.06 Let t = -27.5 - -36.428. Let f = 9 - t. What is f rounded to two decimal places? 0.07 Suppose -a + 5a = -20, -4m + 27 = -3a. Suppose mf = -4379433 + 1229433. Round f to the nearest one hundred thousand. -1100000 Let o = -1 + -2. Let u = o + 3.0000005. What is u rounded to 6 dps? 0.000001 Suppose -4m + 3m = w + 65, 0 = 2w + 8. What is m rounded to the nearest 10? -60 Let l = -19.33 + 0.33. Let x = l + 18.999962. What is x rounded to 5 decimal places? -0.00004 Let c = 2.480001584 + -2.48. Round c to 7 decimal places. 0.0000016 Let x = -351.00876 + 351. Round x to three dps. -0.009 Suppose 2814626 - 529114 = 4h. Let g = -341378 + h. Round g to the nearest 100000. 200000 Let d = -0.48 + 0.08. Let a = -0.289648 + -0.110364. Let p = a - d. What is p rounded to 5 decimal places? -0.00001 Let a = 472483.369973 - 472483. Let z = 0.37 - a. Round z to five decimal places. 0.00003 Let b be (-13 - -3)(0 - -1). Let m be (-719996)/(-6) - b/15. Round m to the nearest one hundred thousand. 100000 Let t = -0.33 + 10.13. Let m = t + -29. Round m to the nearest integer. -19 Let o be ((-168)/(-40))/(2/30). Suppose 12k - 13k = -o. Round k to the nearest ten. 60 Let g = 0.5 + 4. Let c = g - 4.4973. What is c rounded to 3 dps? 0.003 Let l = -180 - -180.414. Let w = l - 0.31. Round w to 2 dps. 0.1 Let f = -157.933 + 158. Round f to 2 decimal places. 0.07 Let n = -1961 + 1926.73. Let b = -27.3 - 6.7. Let c = n - b. What is c rounded to one decimal place? -0.3 Let w = -17 - -19. Let s(y) = -y + 1. Let n be s(-3). Suppose wi - 945 - 7254 = t, nt - 16404 = -4i. What is i rounded to the nearest 1000? 4000 Let b = 168.815 - 5.875. Let z = 0.06 + b. Let x = z - 170.7. Round x to the nearest integer. -8 Let c(b) = -5b3 - b2 - b - 1. Let u be c(-1). Suppose 5s - 8002 = s - 2o, -us = 5o - 8005. Round s to the nearest 10000. 0 Let s be 116699 - 12/(-12). Round s to the nearest one thousand. 17000 Let w = -62.6 - -62.59438. What is w rounded to 4 dps? -0.0056 Let s = -16315.2583046015 - 0.0711753985. Let o = s - -16315. Let c = o - -0.33. Round c to four dps. 0.0005 Let u(r) = 58r*2 + 5r - 15. Let q be u(-7). Suppose -5n - 958 = q. What is n rounded to the nearest one hundred? -800 Let l(x) = -400x. Let i be l(4). Round i to the nearest 100. -1600 Let u = -394.191 - -296732.191. Let y = u + -296338.599997. Let n = 0.6 + y. Round n to five dps. 0 Let j = 12.6 + -14. Let w = -3 - j. Let d = 0.45 + w. Round d to one dp. -1.2 Let l = 6 - 3. Suppose 5u + 3c = 547, 0 = 5*c + 2 + l. What is u rounded to the nearest 100? 100 Let m = -3.16 - 0. Let a = -2.7 -	{ "pile_set_name": "DM Mathematics" }
- 10r - 6 + 1 - 2. Let c be (-2)/(-7) - (-24)/14. Let b(h) = ch + 4 - 13 - 9h. Calculate -7b(k) + 5j(k). -k - 2 Let x(u) = -7u - 2. Let r(w) = 6w + 2. Calculate -5r(q) - 4x(q). -2q - 2 Suppose -4i = -5b - 10, 5i - 34 = -5b + 1. Let k(y) = 2y2 + 4y - 3. Let x(z) = -2z2 - 3z + 2. Calculate bk(g) + 3x(g). -2g2 - g Let u(a) = -7a*2 - 3a - 4. Let w(h) = -15h2 - 7h - 9. Determine -7u(n) + 3w(n). 4n2 + 1 Let v(w) = -12w + 4. Let h(r) = 23r - 9. Give -4h(g) - 9v(g). 16g Let k(y) = -4y2 + 6y + 5. Let l(q) be the third derivative of 3q5/20 - 13q*4/24 - 11q*3/6 + 10q*2. Determine 13k(z) + 6l(z). 2z*2 - 1 Let q(n) = -21n - 11. Let k(r) = -11r - 6. Determine 11k(c) - 6q(c). 5c Let t(r) = 14r2 + 17. Let b(y) = 5y*2 + 6. Calculate 17b(p) - 6t(p). p2 Let s(q) = -2q - 4. Suppose -j + 9 = -2. Let r(z) = -3z + 3z - 6z - j. Let n = 19 + -2. Calculate ns(c) - 6r(c). 2c - 2 Let z(q) = q*3 - 5q2 - 6. Let v be -5 + 6 - (-4)/(-2). Let g(l) = l2 + 1. Calculate vz(k) - 5g(k). -k*3 + 1 Let l(p) = -26p*3 + 16p*2 + 16p + 16. Let b = -6 + 9. Let h(z) = 3z2 - 3 + 5z*3 - 5z + 2z - 6z*2. Calculate bl(g) + 16h(g). 2g*3 Let x(o) = 32o - 6. Let u(n) = -21n + 4. Determine 7u(q) + 5x(q). 13q - 2 Let w(l) = -2l3 + 2l - 2. Let t(k) = 9 + 4k3 - 7 - 3k - 2k + 3. Suppose 2c + 10 = -3c. Let q = 11 + -16. Determine ct(n) + qw(n). 2n*3 Let r(n) = 5n + 13. Let y(i) = -i + 1. Calculate -r(v) - 2y(v). -3v - 15 Let g(f) = f - 1. Let v(n) = -2n2 + 6n + 8. Let p(z) = -2z2 + 5z + 7. Let l(b) = 7p(b) - 6v(b). Calculate -3g(y) - l(y). 2y*2 - 2y + 2 Let t(i) = 2i + 13. Let f be t(-8). Let b(a) = -2a + 4. Let r(n) = -1. Determine fr(h) - b(h). 2h - 1 Let d(u) be the third derivative of -u*4/12 + 4u3/3 + u2 - 12u. Let h(w) = -1. Determine d(o) + 6h(o). -2o + 2 Let a(g) be the third derivative of g6/40 - g5/15 - 5g*4/24 - 7g*2. Let q(z) = -4z - 3z - 8z*2 + 2z*2 + 4z*3. Give -7a(w) + 5q(w). -w3 - 2w*2 Let j(y) = -4y*2. Suppose 8s - 9s = -5. Let u(r) = -8r*2. Determine sj(m) - 2u(m). -4m*2 Let u(b) = -3b + 2. Let d(r) = -13r + 9. Calculate -2d(i) + 9u(i). -i Let l(a) = 5a + 2. Let u(s) = -1. Calculate l(y) + 4u(y). 5y - 2 Let j(w) = 9. Let d(f) = -f + 10. Give 3d(r) - 2j(r). -3r + 12 Let q(z) = -2z*2 - z. Let s(r) = -2r*2 - 1. Determine 3q(t) - 2s(t). -2t*2 - 3t + 2 Let o(u) = 4u - 2. Let v(y) = -y - 4. Let g(a) = 3a + 12. Let q(n) = 4g(n) + 11v(n). Let d be q(0). Let z(x) = 5x - 3. What is do(h) - 3z(h)? h + 1 Suppose -52 = -2x + 6. Suppose -n - v + 19 = -4v, 0 = n - 5v - x. Let h(g) = -2g2 + 3g - 3. Let u(a) = 3a2 - 4a + 4. Calculate nh(i) + 3u(i). i*2 Let j(q) = -91q. Let m(y) = 92y. What is 6j(x) + 7m(x)? 98x Let c(o) = -11o2 - 33o + 33. Let i(t) = -t + 1. What is -c(l) + 33i(l)? 11l*2 Let k(i) = 9i + 4. Let v(x) = -46x - 21. Determine 11k(s) + 2v(s). 7s + 2 Let a(x) = 4 + 3x - 1 - 5. Let u(b) be the first derivative of -2b*2 + 3b - 1. Suppose 9m - 20 = 5m. Determine ma(o) + 4u(o). -o + 2 Let q(f) = -8f - 9. Let n(r) = -8 + 13r + 12r - 32r. Give -6n(w) + 5q(w). 2w + 3 Let d(j) = -j. Let u(s) = 2s + 2s + s2 - 4s + 5s. Give -20d(w) - 4u(w). -4w*2 Let c(g) = 0g + 4g + 3 - 2g - g2. Let b(n) = n2 - 3n - 5. Give -3b(p) - 5c(p). 2p*2 - p Suppose 2n - 2 = -q - 0, 4 = -q + n. Let i(k) = -50k2 + 35. Let x(a) = -3a*2 + 2. Calculate qi(s) + 35x(s). -5s2 Let h(m) = m2 + m. Let d = 8 - 3. Let s(y) = -3y2 - y. Let g(p) = 2p*2 + p. Let x(o) = -11g(o) - 6s(o). Calculate dh(a) + x(a). a*2 Let h(b) = -8b*3 - 5b*2 - 6b + 5. Let d(j) = 15j3 + 9j*2 + 11j - 9. Give 6d(q) + 11h(q). 2q3 - q2 + 1 Let a(w) = -3w*3 + 4w - 2. Let t(s) = -7s3 + 9s - 5. Let b(l) = l*3 + 5l*2 - 4l + 8. Let m = -17 - -11. Let o be b(m). Determine ot(j) + 9a(j). j*3 + 2 Let k(g) = -2g + 2. Let c(n) = 3n - 2. Let j(s) = -8s*2 + 8s + 9s2 + 9 - 1. Let h be j(-6). Determine hc(q) - 5k(q). -2q - 2 Let m be 1/6 + 70/12. Let j(b) = -1 - b - 3 - 7b - 7b. Let k(u) = -4u - 1. What is mj(z) - 22k(z)? -2z - 2 Let u(g) = 2g2 - 11g. Let t(c) be the second derivative of -c4/12 + c3 - 5c. Suppose 0 = 4p + 47 - 3. Determine pt(l) - 6u(l). -l2 Let a(w) = w2 - w + 1. Let y(f) = -2f + 1. What is 4a(z) - 3y(z)? 4z*2 + 2z + 1 Let b(j) = -15j. Let d(g) = 6g. Suppose -5s - 3y = -25, 0 = 7s - 3s + 4y - 20. Give sb(q) + 12d(q). -3q Let p(z) = -z*2 + 9z + 0z2 - 9 + 6z*2. Let m(d) = -2d*2 - d + 1. Let q(j) = 6j*2 + 4j - 4. Let h(g) = -8m(g) - 3q(g). Give 9h(w) + 4p(w). 2w2 Let c(w) = w. Let x(n) = -n3 - n2 - 10n. What is 3c(q) + x(q)? -q3 - q2 - 7q Let y(r) = 2r3 - 4r*2 - 3r + 4. Let a(f) be the second derivative of -3f5/10 + 11f*4/12 + 4f*3/3 - 11f*2/2 + 55f. Calculate -4a(k) - 11y(k). 2k3 + k Let v(a) = 2a + 5. Let t be v(-3). Let h(s) = -5s2 - 2s - 2. Let k(w) be the first derivative of w*3/3 + w - 4. Determine th(u) - 4k(u). u2 + 2u - 2 Let u(f) = -f. Let v(l) = -2l. Calculate 4u(y) - v(y). -2y Let x(g) = -4g*3 + 7g*2 - 7g + 7. Suppose c - 5 = 1. Let h(o) = 3o3 - 6o*2 + 6o - 6. Calculate cx(s) + 7h(s). -3s3 Let u(y) = -y - 3. Let h(o) = 7. Let d(k) = 3. Let i(g) = 9d(g) - 4h(g). What is -4i(w) + u(w)? -w + 1 Let j(l) = 3l + 4. Let p(q) = -2q - 3. Let z = -14 + 17. What is zj(r) + 4p(r)? r Let u(p) = 8p. Let w(x) = x. Calculate -u(f) + 6w(f). -2f Let u(d) = 4d + 1. Let z be (9/(-15))/(2/(-10)). Let f(k) = 5k + 1. Determine zu(s) - 2f(s). 2s + 1 Let z(j) = -5j2 + j - 2. Let v(h) = -9h*2 + h - 3. What is -3v(k) + 5z(k)? 2k*2 + 2k - 1 Let n(a) = -2a2 - a - 8. Let d(i) = -2i*2 - i - 9. What is 3d(t) - 4n(t)? 2t*2 + t + 5 Let y(i) = 5i*2 - 5. Let p(h) = 6h*2 - h - 6. Give -4p(l) + 5y(l). l2 + 4l - 1 Let q(s) be the first derivative of 2s3/3 + 2s*2 - 3s - 5. Let t(v) = -3v2 - 7v + 5. Determine 5q(m) + 3t(m). m*2 - m Let w(y) = 675y*2 + 105y. Let l(q) = -13q2 - 2q. Determine 105l(s) + 2w(s). -15s2 Let f(k) = 3k*2 - 3k + 1. Let u(r) = r*3 - 8r*2 + 8r - 2. Give 8f(w) + 3u(w). 3w3 + 2 Let g(y) = 9y*3 + 29y + 11. Let w(v) = -5v3 - 15v - 6. What is 6g(k) + 11w(k)? -k*3 + 9k Let g(i) = -7i2 - 6i + 51. Let n(w) = 15w2 + 13w - 102. Calculate 13g(f) + 6n(f). -f*2 + 51 Let u(x) = -5x*2 - 7x + 7. Let h(b) = -3b2 - 4b + 4. Suppose 4o - 2o = -20. Let p = o + 14. Suppose w = -pw - 20. Calculate wu(k) + 7h(k). -k2 Let n(w) = 39w. Let o(p) = 13p. Give -4n(c) + 11o(c). -13c Let a(p) = -23p3 + 6p - 10 + 0p + 4. Let k(s) = 8s*3 - 2s + 2. Let d be (-24)/10-5(-5)/(-10). Give da(f) + 17k(f). -2f3 + 2f - 2 Let h(l) = -l*3 + 5l*2 + 7l - 3. Let f be h(6). Suppose -d = 4d + 5. Let p(j) = 3j - 5j - 3j + 4j. Let n(x) = -2x + 1. What is dn(k) + fp(k)? -k - 1 Let i = 7 + -3. Let b(d) = 6d - 2d + d*2 - 2d + i - 2. Let n(q) = -q*2 - 3q - 2. Let j be (-1 + -1)/(1/2). What is jn(t) - 5b(t)? -t*2 + 2t - 2 Let a be 8/12 + 32/(-12). Let o be 2 + 0 + (-1 - -1). Let t(m) = 2m3 - 1. Let b(w) = w3 - 1. What is at(n) + ob(n)? -2n3 Let i(w) = w3 + 9w2 - 5w + 12. Let k(m) = -4m2 + 2m - 6. Calculate 2i(h) + 5k(h). 2h3 - 2h*2 - 6 Let r(d) = -15d. Let v(u) = 31u. What is -5r(m) - 2v(m)? 13m Let p(r) = 5r2 + 6r. Suppose f = 3c, -f = 4f + 2c + 34. Let u(q) = q2 + q. Give fu(z) + p(z). -z*2 Suppose -4v + 69 = 3r, -r = -4v - 5r + 72. Suppose -v = -6q + 3q. Let m(o) = -7o - 1. Let s(y) = -21y + 35y - 17y. What is qs(x) - 2m(x)? -x + 2 Let t(u) = -1. Let d(r) = 2. Let x(p) = d(p) + 3t(p). Let y(g) = -9g + 3. Let w(n) = -5n + 2. Let h(m) = 7w(m) - 4y(m). Give -2h(k) - 5x(k). -2k + 1 Let v(m) = 7m*3 + 6m*2 - 7m - 7. Let b(y) be the second derivative of 4y2 - 7/12y*4 + 4/3y*3 + 0 + y - 2/5y*5. Give 6b(o) + 7v(o). o3 - o - 1 Let z(q) = -2q*2 - 7q - 4. Let s(y) = -y - 1. What is 4s(g) - z(g)? 2g*2 + 3g Let o(b) = 4b3 + 16b**2 -	{ "pile_set_name": "DM Mathematics" }
t replacement from cccmbcb. 12/35 Calculate prob of picking 2 c when two letters picked without replacement from {c: 8, q: 2, x: 2, t: 2}. 4/13 Three letters picked without replacement from kwekeeyedyweke. What is prob of picking 1 w and 2 y? 1/182 Three letters picked without replacement from {a: 4, g: 3, x: 2}. Give prob of picking 2 x and 1 a. 1/21 Four letters picked without replacement from fghfdgivdhiidihf. Give prob of picking 2 g and 2 d. 3/1820 Two letters picked without replacement from mmmsmssshmmshmummhs. What is prob of picking 1 u and 1 h? 1/57 Calculate prob of picking 1 z and 1 c when two letters picked without replacement from tptkkttthtzthttckhz. 2/171 What is prob of picking 2 c when two letters picked without replacement from ccccaaccccccaccccc? 35/51 Three letters picked without replacement from {u: 1, q: 2, y: 2, b: 1, c: 1, x: 1}. Give prob of picking 1 u, 1 y, and 1 c. 1/28 Two letters picked without replacement from {r: 1, u: 2, j: 1}. What is prob of picking 1 r and 1 j? 1/6 What is prob of picking 3 y and 1 f when four letters picked without replacement from ctcytyfcytffyftff? 6/595 Two letters picked without replacement from {i: 4, j: 2, q: 1, c: 3, z: 4}. What is prob of picking 1 q and 1 i? 4/91 Calculate prob of picking 1 u and 1 g when two letters picked without replacement from ugqjfvq. 1/21 What is prob of picking 3 z and 1 p when four letters picked without replacement from npzpzzz? 8/35 What is prob of picking 1 w and 2 o when three letters picked without replacement from {w: 10, o: 6, m: 2}? 25/136 Calculate prob of picking 1 v and 2 x when three letters picked without replacement from {m: 3, s: 1, u: 1, v: 2, w: 2, x: 8}. 7/85 Two letters picked without replacement from cccccqccqcccccccccc. What is prob of picking 1 c and 1 q? 34/171 What is prob of picking 1 k and 1 j when two letters picked without replacement from jefkefflll? 1/45 What is prob of picking 2 i when two letters picked without replacement from jiiijijiijiij? 14/39 What is prob of picking 2 x when two letters picked without replacement from xxxxxxyxxxxxxxxxxxxx? 9/10 Calculate prob of picking 1 a, 1 n, and 1 b when three letters picked without replacement from {i: 7, n: 1, a: 1, b: 7, j: 3}. 7/969 Three letters picked without replacement from ndnzm. Give prob of picking 2 n and 1 z. 1/10 Two letters picked without replacement from {g: 1, d: 4, f: 1, t: 7}. Give prob of picking 1 d and 1 g. 2/39 What is prob of picking 1 p and 2 w when three letters picked without replacement from wpwpppwwpwppp? 40/143 What is prob of picking 2 d when two letters picked without replacement from {b: 7, d: 5}? 5/33 Two letters picked without replacement from xuxuxux. Give prob of picking 2 u. 1/7 What is prob of picking 2 i and 1 r when three letters picked without replacement from {r: 2, i: 5}? 4/7 Two letters picked without replacement from {v: 4, i: 1, u: 3, b: 2, s: 1}. What is prob of picking 1 i and 1 v? 4/55 Calculate prob of picking 3 f when three letters picked without replacement from eefff. 1/10 Calculate prob of picking 1 s and 1 a when two letters picked without replacement from wmamnunanmus. 1/33 Two letters picked without replacement from {h: 1, k: 4, l: 2, q: 1, d: 2}. What is prob of picking 1 d and 1 q? 2/45 What is prob of picking 3 v when three letters picked without replacement from {v: 4, c: 5, f: 7}? 1/140 Three letters picked without replacement from rkmjrmykkrmmkrrrr. What is prob of picking 2 k and 1 m? 3/85 Two letters picked without replacement from {k: 1, t: 2, w: 2, e: 2, l: 1}. What is prob of picking 1 k and 1 w? 1/14 Calculate prob of picking 2 s and 1 j when three letters picked without replacement from sjsjj. 3/10 Calculate prob of picking 4 h when four letters picked without replacement from hhhthdddfddddh. 5/1001 Calculate prob of picking 1 h, 1 y, and 1 g when three letters picked without replacement from vfhvgyk. 1/35 What is prob of picking 1 u and 2 y when three letters picked without replacement from yeuyyeeuyeeyypu? 9/91 What is prob of picking 1 n and 1 x when two letters picked without replacement from {f: 1, x: 3, n: 2, k: 2, z: 2, s: 2}? 1/11 What is prob of picking 3 n when three letters picked without replacement from {j: 1, s: 2, n: 4, x: 1, g: 1}? 1/21 Four letters picked without replacement from vttxbvvvvvxx. What is prob of picking 2 t and 2 x? 1/165 Two letters picked without replacement from {l: 1, j: 3}. Give prob of picking 2 j. 1/2 Four letters picked without replacement from pgzpppggpfnpgmggnppp. Give prob of picking 1 p, 1 f, 1 z, and 1 m. 3/1615 Calculate prob of picking 1 k and 1 b when two letters picked without replacement from kbhvvbhbbt. 4/45 Three letters picked without replacement from {m: 3, p: 4}. Give prob of picking 3 p. 4/35 Two letters picked without replacement from {m: 1, w: 1, c: 1, d: 1, n: 1}. Give prob of picking 1 d and 1 c. 1/10 What is prob of picking 1 v and 1 m when two letters picked without replacement from {o: 1, v: 4, m: 6, q: 3}? 24/91 Three letters picked without replacement from {d: 1, h: 2, k: 6, v: 3}. What is prob of picking 1 v, 1 d, and 1 h? 3/110 Two letters picked without replacement from ofoiroyrpyiyiroffriy. Give prob of picking 1 i and 1 y. 8/95 Four letters picked without replacement from mmgdmmmmmgnmgmgnnmm. Give prob of picking 1 d, 2 m, and 1 n. 55/1292 Calculate prob of picking 1 a and 1 p when two letters picked without replacement from {a: 4, m: 2, p: 4}. 16/45 What is prob of picking 3 s when three letters picked without replacement from sscsjscqssqq? 1/11 What is prob of picking 2 k, 1 p, and 1 s when four letters picked without replacement from kjfpksj? 1/35 Two letters picked without replacement from {u: 8, k: 1, d: 8}. What is prob of picking 1 k and 1 u? 1/17 Two letters picked without replacement from atttattaatt. Give prob of picking 1 t and 1 a. 28/55 Two letters picked without replacement from {f: 3, g: 1, l: 5, h: 1}. Give prob of picking 2 f. 1/15 Calculate prob of picking 1 s, 1 f, 1 c, and 1 y when four letters picked without replacement from {o: 7, c: 2, s: 1, t: 1, y: 1, f: 5}. 1/238 Three letters picked without replacement from rxdmddxxrdl. Give prob of picking 1 m, 1 l, and 1 x. 1/55 Four letters picked without replacement from {j: 1, s: 3, k: 4, o: 5, g: 1, v: 4}. Give prob of picking 2 s and 2 o. 1/102 What is prob of picking 1 p, 1 o, and 1 h when three letters picked without replacement from motwhwp? 1/35 Four letters picked without replacement from {h: 1, w: 1, o: 2, v: 4, f: 3}. Give prob of picking 1 h, 1 f, and 2 v. 3/55 Three letters picked without replacement from xlvpppjjhxllvxxxpx. What is prob of picking 1 v and 2 x? 5/136 Two letters picked without replacement from {x: 1, r: 1, o: 1, t: 2, j: 1, c: 1}. What is prob of picking 1 r and 1 j? 1/21 What is prob of picking 1 j, 1 x, and 2 q when four letters picked without replacement from {d: 6, l: 1, x: 2, q: 2, j: 1}? 2/495 Calculate prob of picking 1 b and 1 p when two letters picked without replacement from {b: 1, p: 1, j: 1}. 1/3 Four letters picked without replacement from ryryrryryyrprrrprrr. What is prob of picking 4 y? 5/3876 Four letters picked without replacement from lhpplphphppllp. What is prob of picking 1 h and 3 l? 12/1001 Three letters picked without replacement from {b: 1, a: 1, c: 2, o: 1}. Give prob of picking 1 a, 1 o, and 1 c. 1/5 What is prob of picking 1 l and 1 y when two letters picked without replacement from ywwslwysycyjwjljwsw? 8/171 Two letters picked without replacement from {y: 2, z: 1, c: 4, s: 9}. Give prob of picking 1 z and 1 y. 1/60 What is prob of picking 1 f and 1 u when two letters picked without replacement from {f: 3, u: 2, v: 1, w: 6}? 1/11 Two letters picked without replacement from {x: 3, b: 1}. What is prob of picking 1 x and 1 b? 1/2 What is prob of picking 1 q and 2 h when three letters picked without replacement from hhhqqqo? 9/35 Two letters picked without replacement from {c: 1, p: 3, o: 1}. Give prob of picking 1 c and 1 p. 3/10 What is prob of picking 1 x and 1 y when two letters picked without replacement from {x: 13, y: 5}? 65/153 Two letters picked without replacement from mdsui. Give prob of picking 1 m and 1 s. 1/10	{ "pile_set_name": "DM Mathematics" }
t 3, -7, -1, 2587, -116, 8 in increasing order. -116, -7, -1, 3, 8, 2587 Sort 1, 2, 914361, -2, -15 in ascending order. -15, -2, 1, 2, 914361 Sort -124, 0.1225, 6, 1/7, 4 in descending order. 6, 4, 1/7, 0.1225, -124 Sort -657, -439, 4, -2, 2, 0, 3. -657, -439, -2, 0, 2, 3, 4 Put 1, -2, 17, -5, 3875 in decreasing order. 3875, 17, 1, -2, -5 Put -5, -309, -1, -851, 0 in increasing order. -851, -309, -5, -1, 0 Put 84, -31, 69, -12 in increasing order. -31, -12, 69, 84 Put -5, -13, -83, -25, -2 in decreasing order. -2, -5, -13, -25, -83 Sort 1, 3, 2, 5, 6, -294 in descending order. 6, 5, 3, 2, 1, -294 Sort 5, 10.03, -0.289 in ascending order. -0.289, 5, 10.03 Put 44, 1.94, -4/257 in decreasing order. 44, 1.94, -4/257 Sort 1/74, -3, 2, -16, 487, 5 in descending order. 487, 5, 2, 1/74, -3, -16 Sort -2, -3, 4, 19, 8, -2356. -2356, -3, -2, 4, 8, 19 Put 5, -2, -178, -5, 54, 4 in ascending order. -178, -5, -2, 4, 5, 54 Sort 8, -7, -1, -5, -4, -719, 1. -719, -7, -5, -4, -1, 1, 8 Sort -3/5, -2, 6, 10314, 2/13, -26. -26, -2, -3/5, 2/13, 6, 10314 Sort -25, -4/7, 0.6, 7/1104. -25, -4/7, 7/1104, 0.6 Sort -2, -815401, 4, 5 in ascending order. -815401, -2, 4, 5 Put -246316, -1, 9, 1 in decreasing order. 9, 1, -1, -246316 Put 4, -13, 228769, -4 in decreasing order. 228769, 4, -4, -13 Sort -8, 1/5, -3.301, -1/2, 2, -4 in ascending order. -8, -4, -3.301, -1/2, 1/5, 2 Sort -1497, -0.4, 1/23, -8/13 in decreasing order. 1/23, -0.4, -8/13, -1497 Sort -2, 685, 2, 75, -1, 3, -12 in decreasing order. 685, 75, 3, 2, -1, -2, -12 Put -244, 0, -2, -17, -5, 2 in decreasing order. 2, 0, -2, -5, -17, -244 Sort 5, -1446715, -6, -5, 2 in increasing order. -1446715, -6, -5, 2, 5 Sort 51, 2, 3834, 5, -4, 3. -4, 2, 3, 5, 51, 3834 Sort -718759, 5, -5 in descending order. 5, -5, -718759 Sort -18646, 18, -49, 0 in increasing order. -18646, -49, 0, 18 Put 392, 5, -4, 2, 7, -6 in descending order. 392, 7, 5, 2, -4, -6 Sort 53072, 1, -4, -10/7. -4, -10/7, 1, 53072 Sort 0, -103, 12, 65, 3 in ascending order. -103, 0, 3, 12, 65 Put -1, 0, -11905, -154 in decreasing order. 0, -1, -154, -11905 Sort -0.3, -0.08, 189, 1/22, 2/3 in ascending order. -0.3, -0.08, 1/22, 2/3, 189 Sort 194/83, 8, 1/4, -2/5 in increasing order. -2/5, 1/4, 194/83, 8 Sort -4, -59/8, 150, -3, 0.5 in ascending order. -59/8, -4, -3, 0.5, 150 Sort -5/6, -1741/8, -2, 4.4 in decreasing order. 4.4, -5/6, -2, -1741/8 Sort -1, 5, -353, -0.6 in descending order. 5, -0.6, -1, -353 Sort 3, -12, 1334, 2, 1072 in ascending order. -12, 2, 3, 1072, 1334 Sort 26, 1, -5, -7, 3, -37, -4. -37, -7, -5, -4, 1, 3, 26 Put -314, 0.1, -140, 0.17 in ascending order. -314, -140, 0.1, 0.17 Put 1.752, -1846, 0.1 in increasing order. -1846, 0.1, 1.752 Put -2/19, 1/5, -0.5, 5, 42 in descending order. 42, 5, 1/5, -2/19, -0.5 Put 1, -2/5, -1, 3, -4, 2, -3023 in descending order. 3, 2, 1, -2/5, -1, -4, -3023 Put 7, -15356953, -3, 5 in descending order. 7, 5, -3, -15356953 Put -2, 48, -71, -7790, 3 in decreasing order. 48, 3, -2, -71, -7790 Put 29, 2/3, -0.05102, 6 in descending order. 29, 6, 2/3, -0.05102 Put -5, -1, 21281, 2, 57, 0 in decreasing order. 21281, 57, 2, 0, -1, -5 Put 3, 8, -79, 314, 5 in ascending order. -79, 3, 5, 8, 314 Sort 30, 1/4, 0, 79, -4, -127 in decreasing order. 79, 30, 1/4, 0, -4, -127 Sort -3/8, 1, -78, 23, -3, 0.00112 in descending order. 23, 1, 0.00112, -3/8, -3, -78 Put 50, -12, -2, -6, -606 in ascending order. -606, -12, -6, -2, 50 Put -116, 31, -1, -117, 3 in decreasing order. 31, 3, -1, -116, -117 Sort 5, 2, -242, -5, 24, -4 in increasing order. -242, -5, -4, 2, 5, 24 Put -0.02, -0.3, 61.16, 35/2 in decreasing order. 61.16, 35/2, -0.02, -0.3 Put -1841, -5, -4, 8, -3, -174 in descending order. 8, -3, -4, -5, -174, -1841 Sort -12130, -2, 18588 in descending order. 18588, -2, -12130 Sort -19, 108, 2862, -4 in increasing order. -19, -4, 108, 2862 Put -1404483, 39, 2 in ascending order. -1404483, 2, 39 Sort 154, 5, 0.5, 4, -1, 10/83 in decreasing order. 154, 5, 4, 0.5, 10/83, -1 Sort -5, 17, -1, 7260. -5, -1, 17, 7260 Sort 4, 309, 3, -5, -4 in decreasing order. 309, 4, 3, -4, -5 Put 10.2, 350.834, -4/5, -5 in decreasing order. 350.834, 10.2, -4/5, -5 Put -3, 120, 5, -19, -28, 3 in descending order. 120, 5, 3, -3, -19, -28 Sort 651, -21970, -1 in decreasing order. 651, -1, -21970 Sort -21851884, -5, -0.4. -21851884, -5, -0.4 Sort -6, -4, 68, -165, -2 in decreasing order. 68, -2, -4, -6, -165 Put 133006, -1, 115 in increasing order. -1, 115, 133006 Put -15, 4, 1, 49, -1, -21, -38 in descending order. 49, 4, 1, -1, -15, -21, -38 Put 9, -17, -3, 14, -4, -73 in descending order. 14, 9, -3, -4, -17, -73 Sort -1/9, -1, 0.9, 6564, 2/7, -1/3. -1, -1/3, -1/9, 2/7, 0.9, 6564 Sort 2, -23, 3, -111, 1, -4 in ascending order. -111, -23, -4, 1, 2, 3 Sort -13/19, -6383/8, -11/5. -6383/8, -11/5, -13/19 Put 2/211, -0.3, 2, 35/2, -0.048 in descending order. 35/2, 2, 2/211, -0.048, -0.3 Sort 1/2, -2/13, 15313, -0.4, 5, -1 in increasing order. -1, -0.4, -2/13, 1/2, 5, 15313 Sort -7, 3, 4, -23, -1, -17 in descending order. 4, 3, -1, -7, -17, -23 Sort 0, 5, 51955, -5. -5, 0, 5, 51955 Sort 1287, 24920, 2 in increasing order. 2, 1287, 24920 Put -4, -3, 7, -17, -6, 174 in descending order. 174, 7, -3, -4, -6, -17 Sort 4, 1536, -12, 166, 0, -1 in increasing order. -12, -1, 0, 4, 166, 1536 Sort 48, -483, 136 in increasing order. -483, 48, 136 Put 0, -4, -297, -11, 2, 5 in decreasing order. 5, 2, 0, -4, -11, -297 Sort -5, 0, 51, -8, -31, -30, -4 in ascending order. -31, -30, -8, -5, -4, 0, 51 Sort -101795, -43, 0. -101795, -43, 0 Put 1, 2/7, 987, 9925 in increasing order. 2/7, 1, 987, 9925 Sort -33, -0.086, -6, -2, 13 in increasing order. -33, -6, -2, -0.086, 13 Sort -1299, 1, 0.4, 0.3, -1/46, 1.4 in ascending order. -1299, -1/46, 0.3, 0.4, 1, 1.4 Sort -3, -18, -86, 2, -2, 88. -86, -18, -3, -2, 2, 88 Sort 1, -0.122659, -0.09, -0.04. -0.122659, -0.09, -0.04, 1 Sort 3/2, 3, -1924691. -1924691, 3/2, 3 Put -34, -15, 50 in decreasing order. 50, -15, -34 Put -50, 2, 4, 1, -12, -1, -33 in increasing order. -50, -33, -12, -1, 1, 2, 4 Sort 0, 636, -376, -2, 1, 3 in descending order. 636, 3, 1, 0, -2, -376 Sort -12792, 23, -4, -1. -12792, -4, -1, 23 Put -4, -152.9, 4, -197 in increasing order. -197, -152.9, -4, 4 Sort 140, 6, -3, -5, -86, -2 in decreasing order. 140, 6, -2, -3, -5, -86 Put -2/3, -1, -2/29, 14, 1213, 1/4 in descending order. 1213, 14, 1/4, -2/29, -2/3, -1 Sort 1, -20532, -399 in decreasing order. 1, -399, -20532 Put 12, -1, -0.00739, 5/2 in increasing order. -1, -0.00739, 5/2, 12 Put 3, -1, -1055, -296, -2, -4, -3 in ascending order. -1055, -296, -4, -3, -2, -1, 3 Sort -836, 0.4, -0.6, -18/7 in decreasing order. 0.4, -0.6, -18/7, -836 Sort 7144182, -20, -1, 0 in increasing order. -20, -1, 0, 7144182 Sort -1, 135, 2, -3, -12477 in decreasing order. 135, 2, -1, -3, -12477 Sort -18, -209203, 2 in ascending order. -209203, -18, 2 Sort 2, -9, 25, -156, 84 in descending order. 84, 25, 2, -9, -156 Put -2, 5, 1506, 3, -4, -797 in ascending order. -797, -4, -2, 3, 5, 1506 Sort -6, -27, 6, 5, -98, 2 in ascending order. -98, -27, -6, 2, 5, 6 Sort -0.25, -2/97, 7, -16 in increasing order. -16, -0.25, -2/97, 7 Put 7/4, -5, 126/167, -2/7 in descending order. 7/4, 126/167, -2/7, -5 Sort 110, -4, -3, -2, -2085, 2, -1 in ascending order. -2085, -4, -3, -2, -1, 2, 110 Sort -3/2, -0.5, 11098/53, 1/7. -3/2, -0.5, 1/7, 11098/53 Sort 19, -178, -2, -1, 0, 36. -178, -2, -1, 0, 19, 36 Put -175162, -5, 1, -2, -1, 2 in descending order. 2, 1, -1, -2, -5, -175162 Sort -5, 390, -3, -1, 22, 0, 5 in descending order. 390, 22, 5, 0, -1, -3, -5 Sort 0.7, 5, 3, 375/31844, -0.4 in ascending order. -0.4, 375/31844, 0.7, 3, 5 Put 5, -0.2, 3, 0, 1, 8/11, 27 in descending order. 27, 5, 3, 1, 8/11, 0, -0.2 Sort -1, -265, 2, 31, 4 in increasing order. -265, -1, 2, 4, 31 Put -4, 365, -274 in increasing order. -274, -4, 365 Sort -7, 20596, 166 in decreasing order. 20596, 166, -7 Sort 19752, -18, 26 in increasing order. -18, 26, 19752 Put -43039, -2, -4, 3, 1/9, 2/7 in ascending order. -43039, -4, -2, 1/9, 2/7, 3 Put -4, 1, 1/2, -1/5, -21565, 1/57 in increasing order. -21565, -4, -1/5, 1/57, 1/2, 1 Sort 0.04, 3, -5, 37, 203, -1/3 in increasing order. -5, -1/3, 0.04, 3, 37, 203 Sort 3, -7, 1	{ "pile_set_name": "DM Mathematics" }
- 2f, -4l + 4f + 444 = 0. Suppose l - 19 = 3s. List the prime factors of s. 29 Suppose 4 = 3v - 2v. Suppose -k = vk - 25. Suppose y = 3q + 4, y + 36 = ky - 2q. What are the prime factors of y? 2, 5 Let r(h) = h*3 - 8h*2 - 7h - 3. List the prime factors of r(9). 3, 5 Let g be (-3)/(-6) - 36/8. Let n = g + 17. What are the prime factors of n? 13 Let l = -1 - -4. Suppose -25 = -lk - 10. Suppose kp = -5c + 30, 0 = 5p + 3c + 2 - 36. List the prime factors of p. 2 Suppose 0i = -6i + 294. What are the prime factors of i? 7 Suppose 41 = 5n - 34. Let a = -2 + n. List the prime factors of a. 13 Let r = -152 - -237. Suppose 0 = -y - 2v + 15, 3y + 0v - r = 2v. What are the prime factors of y? 5 Let w(q) = 7q - 12. List the prime factors of w(7). 37 Let d = -25 + 187. What are the prime factors of d? 2, 3 Suppose 6a = 2a - 4. Let g = a + 1. Let p(i) = i2 - i + 12. What are the prime factors of p(g)? 2, 3 Suppose 3g - 5p - 32 = 0, p - 6p - 50 = -5g. Suppose -5f - 11 - g = 0. List the prime factors of (-20)/(-16) + (-3)/f. 2 Let v(c) = 3c - 3. Let y be v(2). Let l(i) be the third derivative of i5/60 + i3/2 - 2i*2. What are the prime factors of l(y)? 2, 3 What are the prime factors of (-5268)/(-60) - 2/(-10)? 2, 11 Suppose -6o + 2o = -8. What are the prime factors of 10 - (o + -2 + 2)? 2 Let k(x) = x3 + x2 - 2x - 2. Let u be k(-2). What are the prime factors of (-58)/(-12) - u/12? 5 What are the prime factors of (-4 + -2)/(12/(-560))? 2, 5, 7 Let c(t) = 30t2 + 13t - 39. What are the prime factors of c(3)? 2, 3, 5 Let a(u) = u*2 - 3u - 6. Let h be a(5). Suppose -k - 2v + 8 = 0, -6k + 4k + 16 = -hv. Suppose d + k = 3d - 2c, -6 = -2c. List the prime factors of d. 7 Let t = -1 + 6. Suppose l + t - 20 = 0. Let f = l + -11. What are the prime factors of f? 2 Let c be 0 + -20 - 0/2. What are the prime factors of (2 - 3) + c/(-4)? 2 Suppose -3o + 3f = -0f - 153, 5o + 2f - 262 = 0. List the prime factors of o. 2, 13 List the prime factors of (0 - -2)/(4/26). 13 Suppose 0x + 4 = 2x. Let r(l) = 2l3 - 2l*2 - l. List the prime factors of r(x). 2, 3 Let v = 88 - 43. What are the prime factors of v? 3, 5 Suppose 0 = -2b + 60 - 12. What are the prime factors of b? 2, 3 Suppose 4y = -68 - 120. Let j = y + 85. Let s = 54 - j. What are the prime factors of s? 2 Let d(j) = -j + 36. What are the prime factors of d(0)? 2, 3 Suppose -341 + 77 = -4o. List the prime factors of o. 2, 3, 11 Let g = 311 - 123. List the prime factors of g. 2, 47 Suppose 2y - 57 = 29. List the prime factors of y. 43 Suppose -2k = 2z - 10, 3z + 3k - 14 = k. Let r = z - -5. List the prime factors of r. 3 Let w = 242 - 171. What are the prime factors of w? 71 Let v(t) = t2 - 7t + 11. What are the prime factors of v(8)? 19 Let v be (3/(-2))/(2/12). Let n be (-2)/3 - 5/(-3). Let f = n - v. What are the prime factors of f? 2, 5 Suppose -a - a - 4 = 0. Let j be a + 1 - (1 + 0). Let s(x) = -x. List the prime factors of s(j). 2 Suppose -z - 2 + 4 = 0. Let l be (52 - z)(-1)/(-2). Suppose 0 = -10s + 5s + l. What are the prime factors of s? 5 Let h be ((-4)/(-8))/((-3)/(-54)). Let s be 110(-8 + h). List the prime factors of 16/(-10)(-25)/s. 2 Let r = -68 + 103. What are the prime factors of (-202)/(-10) + (-7)/r? 2, 5 Suppose -p = -34 - 8. What are the prime factors of -2(p/(-4) + 3)? 3, 5 Let f(h) = -15h - 1. Suppose -5x = 10 + 5. Let a be f(x). Suppose -2l + 0l - 5v + a = 0, 0 = -2v + 8. What are the prime factors of l? 2, 3 Let o(k) = 19k*2 + 3k - 3. List the prime factors of o(1). 19 Let p(s) be the first derivative of s*4/4 - 8s3/3 + s2 - 2s - 2. List the prime factors of p(8). 2, 7 Let j be (-21)/(-4) + (-1)/4. Suppose -3w + c + 13 = 0, -4w - c - j = -5w. Suppose -2g = 2i - 12, -3i = -wi - 3g + 2. List the prime factors of i. 2 Let w(f) = 19f*2 + f - 1. List the prime factors of w(-2). 73 Suppose 0l + 2l = 4c - 4, 2l + 2c + 10 = 0. Let m(h) = -h. Let s be m(l). Suppose 0 = 3n - 3 - 12, -80 = -5w + sn. List the prime factors of w. 2, 5 What are the prime factors of ((-1)/(-1))/(3/90)? 2, 3, 5 Let l(x) = -x3 + 10x*2 + 2. Let n be l(10). Suppose -2b - m + 14 = -3m, -16 = -3b - nm. What are the prime factors of b? 2, 3 Suppose 0 = -5n + 4q + 32, 2n + q = -0n + 5. What are the prime factors of n? 2 Let o = -3 - -7. Let w(d) = d3 - 3d*2 - 2d - 5. Let b be w(o). Suppose -3x = -k - 16, -bx + 2x - 4k = -27. What are the prime factors of x? 7 Let g(y) = -144y - 13. What are the prime factors of g(-3)? 419 Let b(n) = -5n + 9. List the prime factors of b(-8). 7 Suppose 5 = -5y, -2k + 5k + y - 239 = 0. List the prime factors of k. 2, 5 Let t = 5 - 14. Let l = 23 + t. List the prime factors of l. 2, 7 Let t(f) = 2f - 10. Let a be t(6). List the prime factors of a - 9/(-3) - 2. 3 Suppose 0 = -p - 0p + 20. List the prime factors of p. 2, 5 Suppose -2p + 108 = 2g, 4p + 3g - 221 = 4g. List the prime factors of p. 5, 11 Suppose -5c + 24 = -66. Suppose 0o = o + 10. Let v = o + c. What are the prime factors of v? 2 Suppose 2v + 1 = -4z + 25, 4v - 8 = -3z. List the prime factors of z. 2 Let t(l) = -16l - 1. What are the prime factors of t(-4)? 3, 7 Suppose 3m + 7 = -2. Let r be (3/9)/((-1)/m). Let s = 5 - r. List the prime factors of s. 2 Let y be 19 + (4 - 3) + 0. Suppose u = -3z - 22, 2z = -u - u - y. What are the prime factors of z/(-1) - (3 + -4)? 7 What are the prime factors of (-3276)/(-30) + (-4)/(-5)? 2, 5, 11 Let x = -416 - -586. List the prime factors of x. 2, 5, 17 Let n(c) = -c*3 + c - 1. Let x(i) = -5i*3 + 9i*2 + 13i - 17. Let z(w) = -6n(w) + x(w). Let g be z(-8). List the prime factors of -9((-2)/g - 2). 2, 3 Let k = 8 - -29. Suppose c + 2c - k = -5n, 0 = 2c + 2n - 26. What are the prime factors of c? 2, 7 Let c be (24/18)/((-2)/(-3)). What are the prime factors of 1/c(-3 - -9)? 3 Let o be 9(1/(-3))/(-1). Let d = o - -7. What are the prime factors of d? 2, 5 Suppose 5 + 5 = 5s. Suppose 0 = sr - 4r. Suppose -3d + 23 = i, r = -5i - 3d + 41 + 14. What are the prime factors of i? 2 Suppose -2 = 3s - 5. Let q = 14 - s. List the prime factors of q. 13 Let v = 9 + -5. Let h be (-14)/v + 2/(-4). What are the prime factors of (6/h + 1)-14? 7 Let i = 15 + -13. What are the prime factors of i + (3 - -101)? 3, 5 Suppose -x = -6x - 5. Let m = 2 - x. Suppose -3q + 2r + 18 = -mr, -2q + 12 = -4r. What are the prime factors of q? 2, 3 Let n(f) = -5f + 23. List the prime factors of n(-5). 2, 3 Suppose 5g = -0g + 80. Suppose -u = -55 - g. Suppose u = 5r + 2v + 19, 5r = -3v + 53. List the prime factors of r. 2, 5 Let w be (-26)/(-10) - (-4)/10. Suppose -4v = -5g + 47, 54 = 4g + 2v + wv. What are the prime factors of g? 11 Let n be 66/8 - 2/8. Let r(x) = x3 - 7x2 - x - 6. What are the prime factors of r(n)? 2, 5 Let c(b) = -b2 - 3b - 1. Suppose -3p - 17 + 6 = -2u, -5u + 5 = 0. Let z be c(p). Let o = z - -6. What are the prime factors of o? 5 Suppose -3l + 2 = -4. Let z(w) = 5w*2 - 4w + 3. What are the prime factors of z(l)? 3, 5 What are the prime factors of (-6)/(-30) + (-1068)/(-10)? 107 Let f(o) = 5 + 29 - o - 11. What are the prime factors of f(12)? 11 What are the prime factors of 2 - (1 + (0 - 17))? 2, 3 Suppose -11 = -2u - 3v + 4v, 5u - 2v - 26 = 0. Suppose -uy + 63 - 7 = 0. What are the prime factors of y? 2, 7 Let h = 45 + -22. What are the prime factors of h? 23 Let k = 7 - 5. Suppose k = 5v - 33. What are the prime factors of v? 7 Let i = -90 - -133. What are the prime factors of i? 43 Let q = -30 - -51. Suppose 4s - q = 15. List the prime factors of s. 3 Let q(g) = g - 1. Let y be q(4). Suppose l - 5o = -yl + 65, 0 = -2o - 2. What are the prime factors of l? 3, 5 Suppose 0 = -3b + b - 3r + 139, 0 = -5b - 2r + 375. List the prime factors of b. 7, 11 What are the prime factors of ((-10)/216)/(-1 - 0)? 2, 5 Let z(p) be the third derivative of p6/120 + p5/60 - p3/3 - p2. Let v be z(2). What are the prime factors of v/(-4)(-12)/10? 3 Suppose -12 = -7j + 3j. Suppose jn - 4 = n. Suppose -n = c - 12. What are the prime factors of c? 2, 5 Let j be (-18)/(-24) - 3/4. Suppose j = g +	{ "pile_set_name": "DM Mathematics" }
h = -161.4 - -115.4. Let o = h + q. Which is the second biggest value? (a) o (b) -4 (c) -0.2 c Let s be 1/(-2) - (-15)/14. Let r = -2.7 + 2.9. What is the second smallest value in r, s, 5, 3/4? s Let w = 1298.5 + -1298. Which is the biggest value? (a) w (b) -2/17 (c) 5618 c Suppose 9t = -12 - 78. Let i be (-14 - t)/(0 - -3 - 4). Let r = 2.3 + 0.7. Which is the second biggest value? (a) r (b) -1 (c) 5 (d) i d Let s = -122.4 - -122.1. Which is the second smallest value? (a) s (b) -4 (c) 0.5 (d) -6/55 a Let t = 0.1 - -12.9. Let w = -49 - -51. Which is the biggest value? (a) -0.4 (b) 1 (c) w (d) t d Suppose 4b = 2t + 2b + 82, 4t = -b - 159. Let m be 2 - ((-248)/t - 5). What is the second biggest value in -1/3, -2/15, -2, m? -2/15 Let h(b) = 16b + 484. Let w be h(-30). What is the smallest value in -4, 0.25, w, -0.5, 5? -4 Let z = 25642.2 - 25642. Which is the smallest value? (a) -38 (b) -4 (c) z (d) -5/3 (e) 5 a Let l = 11547/2 - 5774. What is the smallest value in 4, 0.2, -1, 2/15, l? -1 Let r = -19.26 - -18.76. Let v = 18 - 13. Which is the second smallest value? (a) -2 (b) v (c) r (d) 1 c Let y be 72/(-28) + 3 - (5 - 24/42). What is the fourth smallest value in 2/11, -1/6, y, 0.4, 1/6? 2/11 Suppose -20 = -4c, 10w = 6w - c + 9. What is the second biggest value in -0.3, w, -370? -0.3 Let k = -8423 - -8422. What is the third smallest value in 3, 1.9, k? 3 Let v(o) = -o2 + 7o - 11. Suppose -3c = -5w - 43, 61 = 4c - 4w + 17. Let i be v(c). Let u = -11 + 11.5. What is the fourth smallest value in u, i, 0, -3? u Let z = -0.0969 - -0.0269. What is the fifth biggest value in z, -8, -4, -14, -5? -14 Let p = 2.5 - 3. Let r be (2/12)/((-78)/351). What is the biggest value in 1, p, r, -2/19? 1 Let q = 151 - 63. Let u = 91 - q. Which is the third smallest value? (a) -2/5 (b) -2/7 (c) -0.5 (d) u b Let u = -0.4 - -0.8. Let m = 12.32262 + 98.67738. Which is the second biggest value? (a) m (b) -1 (c) u c Let m = 27.72 + -27.59. What is the third smallest value in m, -1, 0.11? m Let d = 14.44 + -0.44. Suppose 3h = 5n + 27, 6h - 3n = h + 29. Let c = 4312 + -4317. What is the third smallest value in h, d, c? d Let s = 2993.8 - 2990.8. Which is the second smallest value? (a) s (b) 0.119 (c) 5 a Let m = -703 + 769.8. Let k = 72 - m. Let u = k + -0.2. Which is the third biggest value? (a) 2/7 (b) u (c) 0.5 (d) -1/3 a Let d(n) = 38n2 + 3n - 3. Let y be d(1). Let o = 39 - y. Let f = -26 - -24. What is the biggest value in f, o, 0? o Let t(d) = d*2 - 2d - 2. Let y be t(10). Let v = -86 + y. What is the fourth smallest value in 2/13, v, 0, -0.3? 2/13 Let k = -302.6 - -298.6. What is the smallest value in 2/7, k, 19, -2? k Let o = -94 - -90. Let l(q) = -3q + 28. Let g be l(9). Let h be 3g/(5 + o). Which is the fourth biggest value? (a) -4/9 (b) -3 (c) -1 (d) h b Let c be ((-18)/234)/((-21)/14). What is the biggest value in 18/5, c, 5, -1? 5 Let f = 0.01196 - 6.01196. Which is the third biggest value? (a) 33 (b) f (c) 5 (d) -4 d Let r = -43/255 + 29/51. Which is the third biggest value? (a) r (b) 0.02 (c) -5 (d) -1/4 (e) -0.018 e Let d = 38.36 + -40.36. What is the third smallest value in -9, d, 0.101, 0.2? 0.101 Let t = 1.98 - -0.02. Let l = 6.9816 - -0.0184. Which is the biggest value? (a) -0.1 (b) l (c) t (d) 4/5 b Suppose -q = f - 6q + 59, 305 = -4f - 3q. Let h = 92 + f. Let x be 6 - (2/(-6) - (-24)/h). What is the biggest value in x, -0.04, 3? x Let a be (-2)/5 - (-322)/35. Let q = -35182 + 35181.8. What is the biggest value in a, 0.4, q? a Let x = 23614 - 23618. Which is the second smallest value? (a) 1918 (b) x (c) 2 (d) 1/3 d Let u = -83.1 + 83.3. Let o = -1.36 + 0.96. Let d(t) = t3 + t2 - 2t - 1. Let g be d(2). What is the second biggest value in g, u, o? u Let j = 0.1 - 0.2. Let r = -2.59 - -2.09. Let z = 37 + -36.9. What is the second biggest value in j, z, -3, r? j Let n(l) = l3 - l2 - 64l - 4. Let o be n(0). What is the second biggest value in o, -3, -1604? o Let h = 0.055 + 0.145. Let o = -908/3 + 239. Let r = o + 2095/33. What is the second smallest value in h, 0.3, r? h Let v = -0.41 - -0.47. Let j = v - -0.94. Let d = 348/5 + -70. What is the second biggest value in j, d, -4, 0.4? 0.4 Let f be (54/216)/((-84)/99 - 6/(-33)). What is the smallest value in f, -0.008, -0.03, 0.05? f Let u = -22283.2 + 22286. Which is the third biggest value? (a) u (b) -2 (c) 23 (d) -0.4 d Let t = -0.215 + 184.215. Which is the biggest value? (a) -10 (b) t (c) 4 b Let y = 385 - 380. Let w = 25.8 + -30.8. What is the second smallest value in -6, y, w, 1? w Let s = 0.1 + 4.9. Let g = -3.01 - -2.31. Let f = -0.8 - g. Which is the fourth biggest value? (a) -5 (b) f (c) s (d) 0.1 a Let d = -3.402 - -3.302. What is the third smallest value in -5, -1/31, d? -1/31 Let z = -6196.3 + 6196. Let y = 3.75 + -1.82. Let h = -0.07 - y. What is the second smallest value in 0.4, h, z? z Let m be (-2072)/(-111)(-1017)/(-6). Let d be (m/(-210) - -14) + 4/10. What is the second biggest value in 0.267, 2, d? 0.267 Let s be ((-23)/23)/(1/4). Let u = 46 - 29. Suppose 3p + 3h = -p - 27, u = -4p - h. Which is the second biggest value? (a) -0.1 (b) p (c) s (d) -1/7 d Let s(h) = 8h*3 - 3h*2 - 8h - 78. Let m be s(7). What is the smallest value in -2, 0.2, m? -2 Let w = -32 + 28. Let n be (15/10)/((-26)/w). Let m = -1004 + 1003. Which is the second biggest value? (a) -0.3 (b) n (c) m a Let i = -25.03 + 26.2. Let s = i - 0.17. Let d = 90 - 98. What is the smallest value in s, -0.1, d, -1/3? d Suppose -g = -6g - 725. Let u = g + 244. Let s be (-407)/u + (-4)/(-1). What is the smallest value in 3/4, s, -2? -2 Let t = 199043 + -199042. Suppose 2f = -0f + 12. What is the biggest value in t, f, 0? f Let o = -88/57 - -7190/4731. Which is the second smallest value? (a) o (b) 0.01 (c) 2 b Let m = 0.9 + 4.1. Let j = -0.038 - -8.038. Let g = j + -6. Which is the fourth biggest value? (a) 2/3 (b) 4 (c) m (d) g a Let t = 7 + -3. Let i be -4t/144-2. What is the second smallest value in 3, i, -4/7? i Let a = -313171/10 - -31407. Let s = a - 457/5. What is the biggest value in -4, -2/5, 0, s? 0 Suppose -395h = -415h + 20. What is the third biggest value in 3/2, -0.06, h, 1/2? 1/2 Let s = 41799 - 376193/9. Let l = -2 + -3. Which is the smallest value? (a) -0.4 (b) 0.3 (c) l (d) s c Let t = 356492/45 - 7922. Which is the biggest value? (a) -1/7 (b) t (c) -0.5 b Let r = -56822.051 - -56926. Let a = -104 + r. Let z = a + 6.051. What is the second smallest value in -3, -2/7, z, 0.2? -2/7 Let d = -8 - -2.3. Let n = 4274 - 4279.76. Let i = n - d. Which is the smallest value? (a) 4 (b) i (c) 0.4 b Let t = 255/8 - 32. Let y = 1661 + -1661.11. Which is the third smallest value? (a) t (b) -2 (c) 4 (d) y d Let r(m) = -2m + 5. Let v be r(4). Let y = -69.4 + 61. Let p = y + 6.4. Which is the third smallest value? (a) p (b) -0.1 (c) v b Let k = -8/15 - -61/30. Let m = 35.816 + -37.146. Which is the third biggest value? (a) k (b) 0 (c) m c Let i = 12361 - 12361.3. Let s = -25 + 25.4. Which is the third smallest value? (a) 2/17 (b) 5 (c) s (d) i c Let t = 1/52246 - 52251/261230. Let s = -1.1 - 2.9. Let n = -0.1 + 0.14. What is the third smallest value in n, t, s? n Let x = -1043 + 1048. Let f = -0.4 - 0.1. Let z = f - 0. Which is the smallest value? (a) z (b) 2/9 (c) x a Let c be 1 + -2 + 1 - -8. Let t be (-2)/10 + -2(-707)/70. Let p be ((-2)/4)/(75/t). What is the smallest value in p, 0, c? p Suppose -147u - 74u = 442. Let i be 3(-2 - (-192)/99). Which is the biggest value? (a) 8 (b) i (c) 0.2 (d) u a Suppose 5a - 6 - 7 = 4y, 5a = 5y + 15. Let i be ((0 - a) + -2)-1. Let j = -5599.5 + 5591.5. What is the third biggest value in 2, i, j? j Let b be (-1)/((-30)/(-196))20/202. Let l be 5(2 + 2024/(-1010)). Let j = b + l. What is the biggest value in 4, -4/5, 2/5, j? 4 Let k = -1 + -1. Let w(s) = 34s*3 + 3s**2 + 32. Let l be w(0). Which is the biggest value? (a) k (b) 0.4 (c) 5 (d) l d Let u = -0.2116 + -0.0194. Let x = -243.4 - -243.431. Let l = x + u. What is the biggest value in l, 11, -4, -2/3? 11 Let f be (17/((-34)/4))/(2/(-7)). What is the th	{ "pile_set_name": "DM Mathematics" }
ithout replacement from jjgwhuhhjwphgwjhg? 15/136 Four letters picked without replacement from {w: 10, x: 4}. Give prob of picking 1 x and 3 w. 480/1001 What is prob of picking 1 d and 1 f when two letters picked without replacement from eftlfdglfgg? 3/55 Calculate prob of picking 1 f and 1 x when two letters picked without replacement from fxxxfx. 8/15 Calculate prob of picking 1 z and 1 w when two letters picked without replacement from {i: 1, d: 2, z: 8, m: 2, w: 2}. 16/105 Three letters picked without replacement from ggoooooo. Give prob of picking 2 o and 1 g. 15/28 Calculate prob of picking 3 l when three letters picked without replacement from {l: 8, o: 5}. 28/143 What is prob of picking 3 g when three letters picked without replacement from rrgrgdgrgrddgdx? 2/91 What is prob of picking 1 i, 1 r, 1 n, and 1 t when four letters picked without replacement from kntrtiskrits? 4/165 Two letters picked without replacement from {e: 5, l: 1, b: 11, o: 3}. Give prob of picking 2 o. 3/190 Three letters picked without replacement from {z: 2, g: 1, v: 3, f: 1, s: 3}. What is prob of picking 1 v, 1 z, and 1 s? 3/20 Three letters picked without replacement from brrurkhrcuuuck. What is prob of picking 1 b, 1 u, and 1 c? 2/91 Two letters picked without replacement from iiiisiisiiiiiiiiiii. Give prob of picking 1 i and 1 s. 34/171 What is prob of picking 1 y and 1 w when two letters picked without replacement from {y: 2, d: 6, w: 5}? 5/39 What is prob of picking 1 r and 1 u when two letters picked without replacement from {s: 11, u: 2, r: 2}? 4/105 Four letters picked without replacement from {j: 3, c: 3, r: 1, o: 1, x: 2}. What is prob of picking 2 c and 2 x? 1/70 What is prob of picking 1 s, 2 f, and 1 q when four letters picked without replacement from qqfsffqffffp? 7/55 Two letters picked without replacement from hhhy. What is prob of picking 2 h? 1/2 Three letters picked without replacement from {g: 1, s: 1, e: 1, w: 7, p: 5}. What is prob of picking 3 w? 1/13 Calculate prob of picking 3 n when three letters picked without replacement from {n: 2, m: 6}. 0 What is prob of picking 1 u and 1 f when two letters picked without replacement from {f: 1, u: 3, g: 5, k: 1, a: 1}? 3/55 Four letters picked without replacement from {x: 12, a: 7}. What is prob of picking 4 a? 35/3876 Two letters picked without replacement from uuuluucumuumccclumll. Give prob of picking 1 u and 1 m. 27/190 Two letters picked without replacement from xggjjnjjxjjxnnx. What is prob of picking 2 n? 1/35 Calculate prob of picking 1 z and 1 y when two letters picked without replacement from czzvvmyvzmv. 3/55 Three letters picked without replacement from mmhhhhhhhhhmmmhhhh. What is prob of picking 3 m? 5/408 Calculate prob of picking 1 b, 1 v, and 2 y when four letters picked without replacement from {y: 4, b: 1, v: 3}. 9/35 Calculate prob of picking 1 d, 1 i, and 1 k when three letters picked without replacement from {r: 1, k: 3, d: 1, y: 1, e: 2, i: 8}. 3/70 Calculate prob of picking 1 h, 1 o, and 1 p when three letters picked without replacement from {o: 1, b: 3, d: 2, h: 1, k: 1, p: 5}. 5/286 Four letters picked without replacement from iyyyyyiiyy. Give prob of picking 4 y. 1/6 Three letters picked without replacement from {c: 4, a: 3}. What is prob of picking 3 c? 4/35 Calculate prob of picking 1 q and 1 p when two letters picked without replacement from kckbpcbkckbkrbrbqkkk. 1/190 What is prob of picking 1 q and 1 b when two letters picked without replacement from {b: 10, q: 10}? 10/19 Two letters picked without replacement from nvv. What is prob of picking 1 v and 1 n? 2/3 What is prob of picking 3 o and 1 v when four letters picked without replacement from {o: 3, v: 4}? 4/35 What is prob of picking 2 c and 2 r when four letters picked without replacement from {r: 3, c: 5}? 3/7 Two letters picked without replacement from {g: 6, d: 3, q: 2, t: 3, c: 5, r: 1}. What is prob of picking 1 c and 1 q? 1/19 What is prob of picking 3 p and 1 v when four letters picked without replacement from {v: 8, p: 3}? 4/165 Three letters picked without replacement from iiapmipyimipi. What is prob of picking 1 i, 1 m, and 1 p? 18/143 What is prob of picking 2 q when two letters picked without replacement from rrqirqcr? 1/28 Calculate prob of picking 1 a, 1 l, 1 t, and 1 h when four letters picked without replacement from tyhljah. 2/35 Two letters picked without replacement from feeimgrrfffrffr. What is prob of picking 1 f and 1 r? 8/35 Four letters picked without replacement from jjeeejejee. What is prob of picking 4 e? 1/14 Three letters picked without replacement from {u: 1, a: 2, k: 1, e: 11}. Give prob of picking 1 u, 1 e, and 1 a. 22/455 Calculate prob of picking 2 y and 1 x when three letters picked without replacement from {e: 9, x: 2, m: 1, w: 1, y: 3, s: 3}. 2/323 Four letters picked without replacement from lkkdlkdidd. What is prob of picking 2 d and 2 k? 3/35 Three letters picked without replacement from {p: 5, l: 9}. What is prob of picking 1 p and 2 l? 45/91 Three letters picked without replacement from {w: 1, j: 2, z: 1, i: 1, f: 1, q: 1}. Give prob of picking 2 j and 1 q. 1/35 Two letters picked without replacement from iyyiiyy. What is prob of picking 2 i? 1/7 Two letters picked without replacement from oooooooooyoooooooy. What is prob of picking 1 y and 1 o? 32/153 What is prob of picking 2 e and 2 s when four letters picked without replacement from spstkuee? 1/70 Calculate prob of picking 3 g when three letters picked without replacement from sggggsggggsggg. 165/364 Calculate prob of picking 1 e and 1 p when two letters picked without replacement from {p: 4, a: 3, c: 2, m: 1, e: 3, n: 6}. 4/57 Two letters picked without replacement from {n: 2, w: 17}. What is prob of picking 2 n? 1/171 Four letters picked without replacement from gvvvgvvvvvvvvvvggvgv. Give prob of picking 3 g and 1 v. 10/323 Calculate prob of picking 1 d, 1 o, 1 p, and 1 l when four letters picked without replacement from deeepdsdoopeodpld. 9/476 Calculate prob of picking 1 q and 2 j when three letters picked without replacement from {j: 3, q: 2}. 3/5 Two letters picked without replacement from {f: 1, d: 1, s: 1, h: 1, e: 1}. What is prob of picking 1 h and 1 s? 1/10 Three letters picked without replacement from {h: 4, j: 4, a: 6}. What is prob of picking 1 j, 1 h, and 1 a? 24/91 Calculate prob of picking 3 o when three letters picked without replacement from ooococoo. 5/14 Two letters picked without replacement from uuuuuwuxuuu. Give prob of picking 1 x and 1 u. 9/55 Two letters picked without replacement from {b: 2, z: 2, e: 1, f: 1, o: 1}. What is prob of picking 1 b and 1 z? 4/21 Two letters picked without replacement from ppzzzzpzzpvvzpp. Give prob of picking 1 v and 1 z. 2/15 What is prob of picking 2 d when two letters picked without replacement from yyydyyyyyyyyyydyyyyy? 1/190 What is prob of picking 2 s when two letters picked without replacement from hshshasssaahah? 10/91 Four letters picked without replacement from otototototto. Give prob of picking 4 o. 1/33 Calculate prob of picking 3 z when three letters picked without replacement from {z: 5, x: 5}. 1/12 Two letters picked without replacement from rpqttgt. Give prob of picking 1 q and 1 t. 1/7 Three letters picked without replacement from oeeeeeooeeeoeeeeee. What is prob of picking 1 o and 2 e? 91/204 What is prob of picking 1 m and 2 f when three letters picked without replacement from mmmfffm? 12/35 Calculate prob of picking 1 d and 1 q when two letters picked without replacement from {s: 6, z: 2, g: 5, q: 1, d: 2}. 1/60 Calculate prob of picking 1 m and 1 v when two letters picked without replacement from {b: 3, v: 1, m: 1}. 1/10 Three letters picked without replacement from mmcmcm. Give prob of picking 3 m. 1/5 What is prob of picking 3 y when three letters picked without replacement from yyjbjyjy? 1/14 Calculate prob of picking 1 h and 1 o when two letters picked without replacement from chocoooohoohhcohc. 5/17 Three letters picked without replacement from xqqqxxxqqxtxxxqtt. What is prob of picking 2 q and 1 t? 9/136 Three letters picked without replacement from {h: 2, y: 9, v: 2}. Give prob of picking 1 h and 2 v. 1/143 Calculate prob of pick	{ "pile_set_name": "DM Mathematics" }
a and 7. 7 What is the smallest common multiple of (-168)/(-27) - 2/9 and 7? 42 Let o(f) = -2f3 - 2f*2 + 3f + 1. Let h be o(-3). Let s = -17 + h. What is the lowest common multiple of 8 and s? 88 Suppose 5s - 3u - 114 = -44, 0 = u + 5. What is the smallest common multiple of s and 6/18 + 4/6? 11 Let a = -14995 + 269977/18. Let x = -33617/20 + 1687. What is the common denominator of x and a? 180 Let j(k) = -k*3 + 5k*2 + k + 1. Let d(y) = 3y - 2. Let n be d(1). Let c(g) = 21g2 + 2g - 1. Calculate the smallest common multiple of j(5) and c(n). 66 Let h = -89 + 145. Suppose 0 = -3b + h - 14. Calculate the least common multiple of 18 and b. 126 Suppose 0 = -r + 3r - 40. Let c(x) = -x*3 + 4x*2 - 4x. Let w be c(3). Let v = w + 11. What is the least common multiple of r and v? 40 Let p = -3028 + 66581/22. Let w be ((-9609)/6)/((-1)/(-2)). Let j = -32129/10 - w. Calculate the common denominator of p and j. 110 Calculate the common denominator of (700/(-2254))/(4/(-7)) and (268/(-120))/((-2)/(-6)). 230 Let f = -4/1063 + -338006/7441. Let m = 3103/70 + f. Find the common denominator of -58/7 and m. 70 Suppose -2t - 3o = -6t + 148, -t + 46 = -3o. Calculate the smallest common multiple of 5 and t. 170 Let g(o) = 7o2 + 3o - 4. What is the least common multiple of g(2) and 15? 30 Let v = 7 + 3. Let w = -1 + 17. Calculate the smallest common multiple of w and v. 80 Let j = -27 - 84. Find the common denominator of j/2(-4)/36 and -47/12. 12 Let i = -21 + 39. Calculate the smallest common multiple of 4 and i. 36 Let i(l) = l3 - 6l*2 + l - 3. Let s be i(6). Suppose -22 + 7 = -sy. Suppose -yr + 16 = 1. What is the lowest common multiple of r and 1? 3 Suppose 3c - 3d - 1050 = 0, 2d = -4c - 3d + 1373. Let x = -3389/10 + c. Find the common denominator of 33/4 and x. 20 Let v(g) = -7g3 - g2 - 2g. Let i = 0 + 4. What is the lowest common multiple of v(-1) and i? 8 Calculate the common denominator of (-456)/(-32) + 0 - (0 - 0) and 29/6. 12 Let h = -607/12 + 213/4. Calculate the common denominator of 49/(-10)(1 - 0) and h. 30 Suppose -3p + 24 = -5z, -3z - 6 + 3 = 2p. Let w be (z + 4)(-2593)/(-183). Let x = 10/61 + w. What is the common denominator of x and 26/3? 3 Suppose -6x + 1 = -11. What is the lowest common multiple of 16 and x? 16 Suppose 3h - 7419 = -4b + 2b, 3h = -b + 3702. Let n = -40837/11 + b. Find the common denominator of n and 1 + -4(-22)/20. 55 Suppose -5r = -6r + 8. Suppose 0 = a - 9 - 7. What is the smallest common multiple of a and r? 16 Suppose -3q = -13 + 1. Suppose -2z = -qz - 2j + 18, 0 = 3z - 2j - 42. Let a = 10 + z. What is the least common multiple of a and 18? 198 Suppose o - 5i = 20 + 18, -2o - 4i = -20. Suppose 58 = 5l - 2. What is the least common multiple of l and o? 36 Let c(g) = -g*2 + 23g - 55. Calculate the smallest common multiple of c(19) and 3. 21 Let r(i) = i3 - i2 - 5i - 5. Suppose -u - 15 = -4u. Let b be r(u). Suppose -4k = k - b. Calculate the smallest common multiple of 14 and k. 14 Let q = -77/32 + -3/32. Suppose 0p = 2p - 12. What is the common denominator of q and (-36)/(-2)p/(-30)? 10 Let h = 282664271/2963 + -95398. Let p be -1 + (-317029)/(-11852) + -2. Let l = p - h. Calculate the common denominator of l and 113/10. 20 What is the common denominator of 89/(-4)2/20 and 47/2? 40 Let q(p) = -p2 - 15p. Find the common denominator of q(-11) and 9/7. 7 Let p(z) = -3z - 1. Let g be p(1). Calculate the smallest common multiple of g/(-3)30/4 and 20. 20 Suppose 0 = -x + 4c + 5 + 13, -5x + 30 = -5c. Let q = 1085/24 + 55/24. Calculate the common denominator of q and (-183)/155/x. 2 Let h = -2 - -6. Suppose 5p + 2z - z - 34 = 0, -hp + 25 = 3z. What is the lowest common multiple of p and ((-2)/(-3))/((-2)/(-3))? 7 Let k = -7 + 11. Suppose -5j + 20 = -g + 5g, g - 16 = -kj. Suppose ji = -3l + 22, 4i - l - 20 = -3l. Calculate the lowest common multiple of i and 4. 4 Find the common denominator of (-1)/(-6)(3 + -76) and -85/14. 42 Let f be (99 + 2)/(3 + -2). Suppose 4b - f + 21 = 0. Calculate the least common multiple of b and 18. 180 Find the common denominator of 2/4 + (-13 - 14) and 44/5. 10 Suppose 4b - y - 7 = -0y, -5b - y = -11. Suppose 3x = 4j - 7, 7j - 3 = 2j - bx. What is the smallest common multiple of 4 and 16 + 1 + -2 + j? 16 What is the common denominator of -143/6 and (-72)/24 - 35/9? 18 Suppose 0 = 3s - 5f - 40, 4f = 5 + 11. What is the lowest common multiple of s and 14? 140 Suppose 9 = -5k + 2m, k = -4k + 5m. Find the common denominator of -138((-9)/132)/k and 69/26. 286 Let g be (-10)/(-4)12/(-10). Let j be -1 - (1 - 0)/(-1). What is the least common multiple of 8 and j/g-1 - -6? 24 Let g = 8343 - 183593/22. Find the common denominator of g and 333/60 + 2/(-8). 110 Let n = 9381/4 + -2326. What is the common denominator of -125/6 and n? 12 Let j = -3542 + 63731/18. Calculate the common denominator of j and -57/44. 396 Suppose 5r - 7r = -10. What is the lowest common multiple of 6 and r? 30 Let a = 3/341 + 10209/2387. Calculate the common denominator of 17/2 and a. 14 Find the common denominator of (134/4)/(2/(-2)) and -43/10. 10 Suppose -o = -5o + 64. Calculate the smallest common multiple of 4 and o. 16 Let f = 1454 + -11605/8. Find the common denominator of -89/18 and f. 72 Suppose g = -2g + 9. Let d = 1 - g. What is the common denominator of 81/2 and -642/(-99) - d? 22 Let a = 3 - 6. Let l(z) = -z - 1. Calculate the lowest common multiple of 18 and l(a). 18 Find the common denominator of ((-13)/5)/((-24)/20) and 2/12(-436)/8. 12 Let y be (-236)/(-10) + (-4)/(-10). Calculate the common denominator of (-35)/y - (-6)/(-9) and ((-1)/(-3))/(6/62). 72 Find the common denominator of (2 + 143)/(108/(-9)) and 143/12. 12 Let q = -12300/11 - -1120. What is the common denominator of 1 - 3 - 62/(-7) and q? 77 Let m = -9389/104705750 + 666704761299833/201244451500. Let v = 97/14415 + m. Let t = v + -6607/2. What is the common denominator of -85/2 and t? 12 Suppose -2k - q = -24, 0k = -2k + 5q. Calculate the common denominator of (2/8)/(k/76) and -73/6. 30 Let v = -20 + 30. Calculate the lowest common multiple of v and 3. 30 Suppose 3h + 20 = 7h. Let x(u) = u. What is the smallest common multiple of h and x(3)? 15 Let a = -2497/10 + 252. What is the common denominator of 17/16 and a? 80 Let y = 9 + -13. Calculate the common denominator of ((-22)/y)/((-5)/(-2)) and 13/9(-2 - (-20)/5). 45 Let k(n) = 9n2 + 2n - 4. Let m be k(3). Suppose -3b - o - o = -76, -m = -4b + o. Let d(z) = -2z - 2. Calculate the lowest common multiple of d(-4) and b. 66 Let h(m) = m2 + 5m - 3. Let l be h(-7). Let a = l - 7. Calculate the least common multiple of 4 and a. 4 Suppose 2x = 5p - 66, -p = 3p + x - 58. Calculate the lowest common multiple of p and 3. 42 Let v = -2 + 8. Let c(y) = 3y - 9. What is the smallest common multiple of 5 and c(v)? 45 Let j = 1/8 - 5/8. Let k(o) = -2o3 + 2o*2 + 6o + 1. Let u be k(-5). Let v = u - 513/2. Find the common denominator of v and j. 2 What is the common denominator of (-2)/(40/(-3))82 and 10/(-50) + (-15)/(-2)? 10 Let t = 2176353 - 1186113787/545. Let x = -3/109 + t. Calculate the common denominator of 52/11 and x. 55 Let w = -13755/8 + 1725. Find the common denominator of 62/5 and w. 40 Suppose -5x + 27 = -3n, -3n - 18 = -x - x. Suppose 100 = -q - xq. Let m = -15 - q. Calculate the smallest common multiple of 16 and m. 80 Let v = 7188 - -1397. Let l = -85771/10 + v. Find the common denominator of -43/9 and l. 90 Let i be 78/15 - 1/5. Suppose 2j = -iw - 58, -2j - 3w - 30 = -j. Calculate the common denominator of 31/16 and 1 - ((-1485)/j)/5. 16 Let f(x) = -x2 - 5x - 4. Let y be f(-5). Find the common denominator of -7/20 and ((-42)/8)/(y/(-3)). 80 Let o = -5/88 + 13/11. Suppose 0 = 3*a - 17 - 19. Find the common denominator of (a/5)/(11/(-15)) and o. 88 Let d = 128/13 + -669/130. What is the common denominator of 62/9 and d? 90 Let h = 25 - -42. Calculate the common denominator of (-1)/1 + 415/(-70) and h/(-60) - 2/(-3). 140 Let v be (-1275)/(-522) + 3/(-18). Let w = 1117/580 - v. Calculate the common denominator of 0 - (249/18 - 0) and w. 60 Let a b	{ "pile_set_name": "DM Mathematics" }
05n + 502n = 4j - 87 for j. 21 Solve -4f - 34 = -6c, c - 4f = -2f + 405 - 390 for c. 1 Solve 0 = -6k, -117k + 24 - 19 + 46 + 9 = -5v - 119k for v. -12 Solve 0m + 26c + 217 = -3m, 23 = 3m + 2640c - 1324c - 1320c for m. -3 Solve n + 4o - 18 = 0, -2n = -2o + 478 - 464 for n. -2 Solve -6992j + 47 = 4n - 6993j, 4j = -7n + 65 for n. 11 Solve -5z - 5771i - 5770i + 43 = -11539i, -3z = 5i - 136 for z. -3 Solve -110 = 784s - 786s + 6z, -3s + 5z + 190 = z for s. 70 Solve 5t - 5z + 697 = 677, 4 = z for t. 0 Solve -4q - 17 = 3g, 0 = 3g + 5594204q - 5594208q - 23 for g. 1 Solve 13u = 2f - 23 + 65, -6u = -9u + 3f - 3 for u. 4 Solve u - 3u = -7q + 5q + 74, -q = 2u + u + 99 for u. -34 Solve -34m + 29m + 5a - 46 = 24, 132 = 12a for m. -3 Solve -3d - 738p = -741p + 51, -23d - 2p - 16 = 0 for d. -2 Solve -7v = -3p + 41, 6111p - 57 = 4v + 6116p for v. -8 Solve -67 = -5t + 4i, -1495873t + 1495869t = -2i - 26 for t. -5 Solve -2g = 20v + 12v - 36v + 14, -5g - 288 + 251 = -9v for g. -11 Solve 14j + 4q + 102 = 15j + 35, j + 2q + 35 = 0 for j. -1 Solve 160u - 163u - 45 = -3y, 313 = 4y - 27u for y. 4 Solve 5p = -15, -4728n - 2p - 4 = -4727n for n. 2 Solve -b + m = 12, b + 8771230m = 8771205m + 196 for b. -4 Solve -11q = -14q - 9, 15x - 4q + 3q + 354 = q for x. -24 Solve 6h + 20 = 2h + 4k, k + 7 = -20120h + 20124h + 27 for h. -5 Solve 561t - 560t - 9 = -5o, 3 = t - o for t. 4 Solve 0 = -3i - 4k, 13 = -395i + 405i - k + 56 for i. -4 Solve 5g + 77 + 111 = -5u + 53, 4g + 58 = -2u for g. -2 Solve 7n + 3y + 0y = 27n + 69, -3y - 4 + 13 = 0 for n. -3 Solve -132k + 127k - n = 14, -99 = k + 5n - 101 for k. -3 Solve 0 = -7n + 2n + 30, 4 = a - 4n - 4 + 39 for a. -7 Solve -5t + 2a = 93, 5a - 863907 = -3t - 863969 for t. -19 Solve b - 8 - 12 = -4g, 14 = 2b + 704g - 1420g + 711g for b. 12 Solve 5r - 5 = 3l - l - 0, l - 3l = 116r - 358 for r. 3 Solve t + 3z - 11 - 6 = 0, -2t - 3t + 22z - 16 = 47 for t. 5 Solve -10w - 4f = -12w + 164, -3f + 202 = 67w - 71w + 505 for w. 72 Solve 70 = 7l - 4j, -4l + 321545 = 2j + 321505 for l. 10 Solve 915871 = 33b - 2p + 915673, 5b - 30 = -p for b. 6 Solve n - 11g + 12g = -1, 11g - 4g = 28 for n. -5 Solve -13 = -3l - 9h - 3 + 23, 6l + 5h = 3l + 21 for l. 2 Solve -1744i - 5a = -1745i - 33, 3 = -2i + a for i. 2 Solve -4p = 4u + 44, -471p - 421p + 7 + 8 = -5u - 887p for u. -7 Solve 14o + 233 - 751 = 3d, 0 = o + 5d - 37 for o. 37 Solve -5j - 17 = -2f, -65f + 3 = -32f - 33f - 3j for f. 6 Solve -25 = -3j + 2r, -28 = 196j - 192j + 10r + 2 for j. 5 Solve -4i + 110 = -47894d + 47916d, 39 = -5d + 2i for d. 1 Solve 5k = 57i + 4421, 17307k + 103 = -i + 17302k for i. -78 Solve 0 = 4h - y + 12, -3h = 5y - 51478 + 51487 for h. -3 Solve -n - 3 = -n - n + 3w + 24, -19n = -3w - 459 for n. 24 Solve -2691h + 2695h = -4q - 100, -184 = 8h for q. -2 Solve 2r + 4n - 73 = -35, -1660n + 1656n = 12 for r. 25 Solve 3828t = 4f + 3823t + 92, -4f - t + 4 = 0 for f. -3 Solve -28 = -4r - 22f, -5r - 115f - 16 = -112f + 43 + 4 for r. -15 Solve 4v + 5j = 11j + 364, 92v - 87v - 65 = j for v. 1 Solve -5k - 4y - 287 - 18 = 0, -3y = 198k + 423 for k. -1 Solve 5o - 5564 = -5p - 5379, -3p = -3o + 117 for o. 38 Solve -8u - 30 = 10, 24 = 5c - 21u + 18u - 16 for c. 5 Solve 55k - 214 = -3u, 46736u - 46739u - 4k = -10 for u. -2 Solve -9g - 608w + 70 = -612w, -g - 10 = -4w for g. 10 Solve 0 = -3l + 68o - 7680 + 2719, 15o - 75 = -2l + 14o for l. 1 Solve 3v = -3a - 36, 70v - 5a = 22a + 26a - 26a - 355 for v. -7 Solve -10p + 12p + 4 = -w - 2w - w, 0 = 79p - 329p - w - 1 for p. 0 Solve -4r + 3r - 5 = -6r + 5, -126 = 2v + 3r - 122 for v. -5 Solve 0 = -q - 10w, -q - 40157w + 40155w = 24 for q. -30 Solve -515k + 9 = -512k - i, -2k + 6 = i + i for k. 3 Solve -534393 = -g + 35h - 534040, 5h + 59 = 3g for g. 3 Solve 3q + u + 83 = -q + 90, -5u = 6q - 77 for q. -3 Solve -5a + 5x = 90, 9a - 3x = 2x - 98 - 4 for a. -3 Solve 2p + 8p + 6p - 18p + 4r = 36, -5p - 45r + 117 = -343 for p. 2 Solve -2m + 8 = 2m - 2r, -2m - 26 = 3m - 36r + 38r for m. -2 Solve 2s - 18 = r - 3 - 13 - 9, -7r = -190r + 2s + 917 for r. 5 Solve 3w = 12, 7b + 13947w - 3 = 13948w for b. 1 Solve 5q = -2h + 442, -16218677 = 3q + 3h - 16218944 for q. 88 Solve -284r - 129 = -289r + 21j, 4r - 10j = 110 for r. 30 Solve -416n + 421n + 23u - 680 = 0, -2u = n - 36 - 22 for n. -2 Solve 15r + 5l = -14225 + 14260, 3l - 35 = 5r for r. -1 Solve 31o + 403 = -308610j + 308610j, 2j - o - 49 = 2o for j. 5 Solve -f + 4j = -3, f + 2j - 12995 = -13004 for f. -5 Solve 5f = 3w + 1238 - 642 - 578, -18 = -6f for w. -1 Solve 0 = -2t + 9r + 40636 - 40603, r = -3t + 6 for t. 3 Solve s - 28 = x, s - 50x + 45x = 148 for s. -2 Solve -3w - i = -21, 28i - 50i = 5w - 21i - 25 for w. 2 Solve -78 = -5w + 2r, -16w + 68 = -23w + 13w + 4r for w. 14 Solve c - 6f - 25 = 0, 22c - 15c + 59 = 12c + 3f for c. 13 Solve 32 = 4z - m + 4m, -5z - 22 = -7z + 1158m - 1161m for z. 5 Solve 0 = -4u + 5c + 10, 92c - 77 = -u + 56c for u. 5 Solve 3z - 21 = 0, 5m + 480 - 454 = 8m + 2z for m. 4 Solve -5i = -9c + 67, -5c - 19682i = -19686i - 36 for c. 8 Solve -31 = -j - a, -3a - 323 = 57650j - 57663j for j. 26 Solve 0l + 43 = -s + 2l, -2l - 273 = -15l for s. -1 Solve -167 = 5a - 19j, a + 47 = 272j - 275j for a. -41 Solve -1362 = 73j - 109j - 3d, -3j = -4d - 122 for j. 38 Solve -4z - 4y - 28 = 0, 15z + 16z = 27z - 2y - 8 for z. 3 Solve 3678x = -4n + 3664x - 118, -n + 2x + 9 = 0 for n. -5 Solve 437a + 433a + 19 = 3h + 872a, -h + 2a = -1 for h. 5 Solve -n = 3r + 5, -27n + 112 = -32n - r + 2r + 103 for n. -2 Solve -19 = 55m - 54m - 7s, m - 9s = -13s + 14 for m. 2 Solve 19q = -16q + 39q + 3 + 1, -5p - 7 = -3q for p. -2 Solve 3f - 2b = 70, 96f - 46f - 46f + b + 3b - 80 = 0 for f. 22 Solve 26 = -2q + 2d, 0 = -4q - 98d + 100d - 52 for q. -13 Solve -3p + 38w = -163, 0 = 5w + 163 - 138 for p. -9 Solve -10w + 9 + 1 = -8w, 4w + 1495 = -61y - 618 - 2686 for y. -79 Solve 3255w - 14 = 3251w + 2v, 2w - 10 = -2v for w. 4 Solve -66f - 166 + 140 = -2r + 240, -f = 3r + 1 for r. 1 Solve 41 = 7t - 11t + u, 45 = -36t - 32t + 63t - 5u for t. -10 Solve 0 = -3p + 4c - 121, -6457p = -6459p - 3c - 75 for p. -39 Solve -z = -78f + 74f - 10, -4f - 91 + 22 - 49 = -7z for f. 2 Solve 20 = 6988l - 6983l - 3d + 57, -7l - 51 = -4d for l. -5 Solve 5s = 3f - 1, -47s - 39s = -2f - 2f - 91s + 13 for f. 2 Solve 47s = k + 49s - 7, -3k = -s + 3s - 9 for k. 1 Solve -4o = -18a + 460 - 246, -3o - 2a - 238 = 0 for o. -76 Solve 0 = 7a + 3r - 82, -257492a + 257493a - 5r = -10 for a. 10 Solve r = 4o + 35, -41r = -46r + 3o + 39 for r. 3 Solve 0 = -5u - 2w - 4, 179u = 182u - w + 1 - 3 for u. 0 Solve 66l = 68l - 4w - 4, 0 = -190l + 2w - 376 for l. -2 Solve 0 = -5f - 161s + 156s + 250, 3f - 2s + s = -33 - 17 for f. 0 Solve 76 = k - 3k - 15r + 14 - 38, -2r - 48 = 2k for k. -20 Solve 17s - a - 17 = 18s, 15s + 141 = -9a for s. 2 Solve 14i = 30g - 70 - 26, 4g - 2i - 14 = 0 for g. -1 Solve t - 1 = n, 2979t - 12n - 38 = 2980t for t. -2 Solve -59732n + 59729n + 211 = -16g, 3g + 38 = -n for n. 1 Solve 961i - 960i - x - 46 = -2x, x = -3 for i. 49 Solve -828t + 816t - 5g + 20 = 4, 1 = -t - g for t. 3 Solve 45 = 4g + q, 0 = 6528g - 6521g - 3q - 55 for g. 10 Solve 315 = 7g, -19a + 37 = -15a + g for a. -2 Solve -2t = -7x - 5x + t - 3, -7t = 4x - 11t + 16 for x. 1 Solve -4o + 57 = q, -9q + 65 = -502677o + 502681o for o. 14 Solve -3n + 23 = 2w, 17n + 15n + 4w - 21 = -34n + 65n for n. 5 Solve 42q = 17q + 20q - 165, 6s = 5q + 135 for s. -5 Solve 3j - t = 12, 5j - 67084t + 67093t = -44 for j. 2 Solve -4354q + 19 = -4357q + 2w, -3q = -21w + 114 for q. -3 Solve 193 = -5t - 3n, -1484 = -11t - n - 3n - 1737 for t. 1 Solve -10 + 4 = -6o + 3x, -849o + 3x + 10 + 10 = -844o + 8x for o. 2 Solve 0 = -5k - 3h + 27, 3167	{ "pile_set_name": "DM Mathematics" }
3 - 2r*2v*3 - 486r*2v - 2rv + v*3 wrt r? -300r*2v - 420v3 Find the first derivative of 15423au3 + 5u*3 - 651 wrt a. 15423u*3 Differentiate -10m*2 - 6m + 119. -20m - 6 Find the second derivative of 129h*2w*3 - hw*3 - 2hw2 - h wrt h. 258w*3 Find the first derivative of -41w + 93 wrt w. -41 Find the second derivative of -40b5q + 6b2q - 2b2 + 4bq - 2b + 52 wrt b. -800b3q + 12q - 4 What is the first derivative of 7w*3 + 459w*2 + 9218? 21w*2 + 918w What is the derivative of -268h - 1663? -268 Find the second derivative of -5b*3nu2 + 3b*3nu - 16b*3u - 235b2nsu*2 + 2b*2u + 7bns wrt u. -10b*3n - 470b2ns What is the second derivative of -3f*4 + 230f*3 + 1567f wrt f? -36f2 + 1380f Differentiate -i*4 - 2952i*2 + 7311. -4i*3 - 5904i What is the third derivative of 15890g2n*3x - g*2n*2x - 17g2nx - 2g*2 - 14gx wrt n? 95340g*2x What is the second derivative of -449df*2k - 2dfk - 520dk - 18f*2k wrt f? -898dk - 36k What is the second derivative of 2h*3 - 112h*2 + 2h - 545 wrt h? 12h - 224 What is the second derivative of 5h*3n + 12h2n*2 - 3h*2 + 19hn + 51n*2 wrt h? 30hn + 24n*2 - 6 Find the first derivative of -66o*3 + 264 wrt o. -198o*2 What is the derivative of 70s*3y - 454s3 - 8sy + 1 wrt y? 70s*3 - 8s What is the third derivative of -11ns*5 - 2ns3 + 2ns2 - 5ns + 3 wrt s? -660ns2 - 12n Find the second derivative of 9530u2 - 8303u wrt u. 19060 Find the third derivative of -87o6 + 6o*5z - 2o2z - 6o2 - 66z wrt o. -10440o3 + 360o*2z What is the second derivative of -2g3i*3 - 58g*3i + 230gi*3 + g wrt g? -12gi3 - 348gi Find the third derivative of 66b*3 + 42b*2 wrt b. 396 What is the second derivative of -2g*2w - g*2z*2 + 5g*2z - 67gwz2 - gz - 2wz wrt z? -2g2 - 134gw Find the third derivative of 574j*3n*6 - 9j*3n*2 + 3jn2 - 20jn - 2n*3 wrt n. 68880j*3n*3 - 12 What is the third derivative of -464g3 - g2 + 109 wrt g? -2784 What is the first derivative of -r*2z*2 + 298r*2 - 147z*3 + 2 wrt z? -2r*2z - 441z2 Find the first derivative of 964w - 1013 wrt w. 964 What is the first derivative of 7c3 + 191c - 2586 wrt c? 21c2 + 191 What is the second derivative of 59j*3u*2 + 6j*3u - j + 149u2 wrt j? 354ju2 + 36ju Find the second derivative of -7630f*4 + 22f + 4. -91560f2 Find the third derivative of -3j*6 - 605j*5 + 3j*4 + 69j*2 - 22. -360j*3 - 36300j*2 + 72j Find the third derivative of 1541fz*6 - f + 7z*2 - 3z wrt z. 184920fz3 Find the second derivative of p5 + 2011p3 + 2624p - 2 wrt p. 20p3 + 12066p What is the second derivative of -2h4x + 4h4 - 2h*2x - 2h2 + 2hx + 5x + 7 wrt h? -24h2x + 48h2 - 4x - 4 What is the second derivative of 2h2mw - 4h*2m + h*2w*2 + hmw3 + 3hmw - 2h - 44mw3 wrt w? 2h*2 + 6hmw - 264mw What is the derivative of -1472s - 1007? -1472 Differentiate 594f*3 + 409. 1782f*2 What is the second derivative of -2k*4 - 4k*3q*3 + 3k*2q*3 - 8kq - q3 wrt k? -24k*2 - 24kq3 + 6q*3 Differentiate -843my3 + 2046y*3 wrt m. -843y*3 Differentiate 2365dq2y - q*2 + 2q + 2y - 60 with respect to d. 2365q*2y Differentiate -1358s + 679 with respect to s. -1358 Find the first derivative of -3y*3 - 114y*2 + 9y - 3225. -9y2 - 228y + 9 Differentiate -380b2k*2 + 16k*2 - 6 with respect to b. -760bk2 Differentiate -5dg + 181d + 18g with respect to g. -5d + 18 Differentiate 2by*4 + 633by + 2846b with respect to y. 8by*3 + 633b What is the derivative of -131l3 + 1056 wrt l? -393l*2 Find the second derivative of 2450m*2s*4 - 1484m*2s + ms5 wrt s. 29400m*2s*2 + 20ms3 What is the second derivative of 7082ow2 - 39o - 26w wrt w? 14164o Differentiate 1111x3 + 1177. 3333x*2 What is the second derivative of -2f*3 + 73f*2p*3 + 2f*2p - 3fp*3 - 12f wrt f? -12f + 146p*3 + 4p Find the second derivative of p*4y*3 - 172py3 wrt p. 12p*2y*3 Find the third derivative of -2i*6v + 78i4v*2 + 8i*2v + iv2 wrt i. -240i*3v + 1872iv*2 Find the second derivative of 2p*5 - 14491p*4 - 6250p + 2. 40p3 - 173892p*2 Find the second derivative of 17r*5 + 7r*3 + 49r + 8. 340r3 + 42r What is the second derivative of 2r3 + 96r*2 + 4r + 21? 12r + 192 Find the second derivative of 125d*3 - 4d*2 - 560d. 750d - 8 What is the third derivative of -8721r*6 + 2r*2 - 47r wrt r? -1046520r3 What is the derivative of -105fl3 + 21f + l*3 + 2 wrt l? -315fl2 + 3l2 Differentiate c2dz - 530c2d - 2c2z + 21cdz with respect to z. c2d - 2c2 + 21cd What is the third derivative of 2bsw*3 - 16bsw*2 - bs - bw3 + 4w3 + w2 wrt w? 12bs - 6b + 24 Find the third derivative of -102s*3t*2 + 4s*3t + 15s2t2 + s2 + 9t2 wrt s. -612t*2 + 24t Find the third derivative of 5w4 - 69w*3 + 2w*2 + 86w wrt w. 120w - 414 What is the third derivative of 2nw4 - nw*3 - 2nw + 2n - 2w4 + 8w*3 - 46w*2 + 1 wrt w? 48nw - 6n - 48w + 48 What is the second derivative of 833b*3 + 6b*2 + 7b - 930 wrt b? 4998b + 12 What is the second derivative of -cn*2 + 24cn + c - 73n*5 wrt n? -2c - 1460n3 Find the second derivative of -10381j*3 - 84j - 65 wrt j. -62286j Differentiate 326k*3n - 159n wrt k. 978k*2n Find the second derivative of -16v3y - 103v2y + 66vy + v + 18y - 2 wrt v. -96vy - 206y What is the first derivative of 58p3 + 257 wrt p? 174p*2 Find the third derivative of 340i*3 + 1283i*2 wrt i. 2040 What is the third derivative of -10112d*3q + 6102d2q wrt d? -60672q What is the derivative of 924pu2 + pu - 2066u2 wrt p? 924u*2 + u What is the second derivative of -784fl3z - flz + 48f - 2lz + 2z wrt l? -4704flz Find the third derivative of -5b*6 - 39b*3 - 3377b*2 wrt b. -600b*3 - 234 Find the first derivative of 512o*4u*2 + 2ou3 + 2u*3 - 82u*2 wrt o. 2048o*3u*2 + 2u*3 Find the first derivative of -24q*4 - 2q*2 - 47. -96q*3 - 4q Find the third derivative of 1750f3t*2 + 2f*3tw3 + 11f*2w*3 + 3ft2w*3 - ft + 4t2w*3 - t wrt f. 10500t*2 + 12tw3 What is the first derivative of -445o*3x*3 + 4o*3 + 6 wrt x? -1335o*3x*2 Find the third derivative of -9cr3 + 218cr2 - 5r*3 + 2r*2 wrt r. -54c - 30 Find the third derivative of 3i2m*6 - 48i*2m*4 - 20i*2m*2 - 2i*2m wrt m. 360i2m*3 - 1152i*2m Find the second derivative of -3hr*2w + 16hr - h - 96r2w*2 - 2w*2 wrt r. -6hw - 192w*2 What is the first derivative of 74i*2 - 381 wrt i? 148i Differentiate -13m4 - 7m + 755 with respect to m. -52m3 - 7 Find the second derivative of 26497i*3x*5 + 14i*3 + 220i*2 - 2x wrt x. 529940i3x*3 Find the second derivative of -346x*2 + 9x - 35 wrt x. -692 What is the third derivative of 50o5 - 162o4 - o3 - 23589o2? 3000o*2 - 3888o - 6 What is the second derivative of 9l2m*3 + 35l*2m*2 - 2l*2m - 33lm*2 - 2l + 71m3 wrt l? 18m*3 + 70m*2 - 4m Differentiate b*2v + 2bv*2 + 400bv + 25v*2 + 2v + 40 with respect to b. 2bv + 2v2 + 400v Find the third derivative of 3469u3 - 3u*2 + u + 37. 20814 What is the second derivative of -10u*3w*4 + 5u*3w - 3u2 + 8uw5 - 10w wrt w? -120u3w*2 + 160uw3 Find the second derivative of 29i*3q*2 + 11i*3qt2 + 4i*3qt + iq*4t*2 - 2qt2 wrt q. 58i*3 + 12iq2t*2 What is the third derivative of 1340b*2l*3 + 102b*2l*2 - 3bl2 + 2l*3 - 3l*2 wrt l? 8040b*2 + 12 Find the third derivative of -4386o*6 + 8o*2 - 5o - 32. -526320o3 Find the third derivative of 36b*2g*3 + 3593b*2g*2 + 9bg4 wrt g. 216b*2 + 216bg Find the second derivative of 1442t*4 + 27t + 4. 17304t*2 Find the second derivative of	{ "pile_set_name": "DM Mathematics" }
ch is the second smallest value? (a) -2 (b) -16 (c) i (d) -0.8 a Let q = 1227 + -1228. What is the second biggest value in -4, 2/1165, q? q Let h = -5.417 - 0.467. Let s = 4.2 + -4.084. Let d = s - h. Which is the second biggest value? (a) -1 (b) d (c) -4 a Let r = -92.5 + 109.5. Which is the fourth biggest value? (a) r (b) 0 (c) -2/11 (d) 2 (e) -0.4 c Let t = -7143.1 - -7452. Let s = t - 309. Which is the second biggest value? (a) -3 (b) -206 (c) s a Let w = 0.0653 + -0.0811. Let r = -0.4842 + w. What is the second smallest value in 0, 8.9, r? 0 Let u = -0.009 + 0.409. Let g(s) = 4s - s + 55 - 36. Let l be g(-6). Which is the third biggest value? (a) u (b) l (c) -2/5 c Let d be 128/96(3 + (-18)/8). Which is the second biggest value? (a) 0 (b) d (c) -19 a Let j be (6 - (-26524)/(-28)) + 2. Let v = 939 + j. Which is the fourth smallest value? (a) 0.2 (b) v (c) 0.3 (d) 5 d Let f = -0.03314 + 3.03314. What is the second biggest value in 2/5, f, -16, 8, 1? f Let h = -15.16 - -17.16. Let g = -262 - -485/2. Which is the biggest value? (a) g (b) h (c) 2/15 b Let t(j) = -2j - 3. Let z be t(1). Let p = -37 + 98. Let i = p + -58. Which is the fourth biggest value? (a) z (b) -3/5 (c) i (d) 0.5 a Let y = 4.4 - 0.4. Let r be -1 - 16/70 - 14/((-882)/27). Which is the smallest value? (a) y (b) r (c) 0.04 b Let n = -272.642 - -0.642. Let h = n + 274. What is the smallest value in -1, 95, h? -1 Suppose 0 = -3t + 4d + 31, t + 4d - 6 = d. Let r be (15 - 18) + (1 - 1). Let s be ((-1)/(r/(-9)))/7. What is the third smallest value in t, -0.5, s? t Let k(y) = y*3 - 5y*2 + 2y + 5. Let s be k(4). Let n = 847 + -863. Let q = 23/918 - -5/54. What is the third biggest value in q, s, -0.4, n? s Let c = -13887 - -13887.4. What is the third smallest value in 1, -3/5, -106, c? c Let j = -2.309 - -2.309. Let x(u) = u*2 - u + 3. Let y be x(-3). What is the third smallest value in -3/4, y, j? y Let h = 1 + 34. Let f = h - 35.5. Let u = -40 - -40. Which is the fourth biggest value? (a) -4 (b) f (c) u (d) 6 a Let k = 45 + -33. Suppose -k = 5f - 22. Suppose h + o = fo + 8, 0 = -2h - 2o. Which is the smallest value? (a) -0.4 (b) 0.3 (c) h a Let t = 0.70981 - 0.10981. What is the second biggest value in -2/7, 11, t? t Let f = -29 - -29.5. What is the smallest value in f, -1, 307? -1 Let v = 2.466 - -0.124. Let h = v - 2.39. What is the third smallest value in 19, -2/7, h? 19 Let n = 6.653 + -6.953. Which is the fourth smallest value? (a) n (b) 0.2 (c) 122 (d) -2 c Let q = -0.3 - 0.2. Let x = -690 - -3504/5. Let d = -363/35 + x. What is the smallest value in q, d, 0? q Let f(w) = w2 + 9w + 10. Let j be f(-8). Let t = 1306.9 - 1307.4. Which is the second smallest value? (a) -1/19 (b) j (c) t a Suppose 2w + 5p + 19 - 9 = 0, -2p - 8 = 0. Suppose -wn = -n + 7n. Let v(h) = -3h. Let d be v(-1). What is the biggest value in -2/7, -0.2, d, n? d Let n = 0.177 + -0.377. Which is the third biggest value? (a) n (b) -27.3 (c) -1 (d) -0.1 c Let x = -9448 - -9443. What is the second smallest value in 183, x, 0.4? 0.4 Let j = -50.3595 + 50.3. Let l = j + -0.4405. Let g = 3613/21 - 172. Which is the biggest value? (a) l (b) g (c) 6/5 c Let i = -0.8 + 0.3. Let l = 3.5 - 4.3. Let x = l - i. What is the biggest value in x, -2, -6? x Let s(j) = 10j + 6. Let f be s(0). Let t be ((-4)/6)/((-6)/(-9 + f)). Which is the biggest value? (a) -14 (b) t (c) -7/4 b Let u = 27877/8 - 3466. Which is the fifth smallest value? (a) -4 (b) 0.1 (c) -0.2 (d) -1 (e) u e Let n = -256 + 255.91. Let y = 0.175 + -0.675. Let x be (4/(-10))/(14). Which is the smallest value? (a) x (b) -1 (c) y (d) n b Let z = -50 + 48. Let m = 16.95 + -17.95. Which is the third smallest value? (a) 0.44 (b) m (c) z a Let h = -6.7 + 7. Let s = 0.11 + 0.89. Let b = 5616 - 5620. What is the third biggest value in 3/4, h, s, b? h Suppose 5p + 13 = 4n + 6, 4p - 3n = -5. What is the third biggest value in 0.3, 3/2, -7/4, p, 3/7? 3/7 Let j = -8/7 - -73/70. Let r(k) = 9k - 454. Let d be r(50). Let x = 5 - 7. What is the smallest value in j, d, x, 4? d Let u = -181 - 110. Let m = u + 295. What is the third smallest value in -0.2, m, 5? 5 Let r be (-1220)/(-1586) - ((-60)/52)/5. Which is the fifth smallest value? (a) -125/2 (b) r (c) 2/17 (d) -0.3 (e) 1/4 b Let s = -4.7 + 5. Let w = 11512/9 - 1288. Let v = w + 28/3. Which is the second smallest value? (a) s (b) 1 (c) v (d) -2 a Suppose 0 = 258i - 261i, -3w + i + 18 = 0. Which is the second smallest value? (a) w (b) -4/7 (c) -5/6 b Let u = 6919 - 6926. Which is the biggest value? (a) 3/4 (b) 0 (c) 1/7 (d) u a Let s = -1774 + 1779. What is the second biggest value in -5, 0.81, s? 0.81 Let g = -0.10725 - -17.20725. Which is the smallest value? (a) g (b) -7 (c) -1 b Let n = 2326 + -11631/5. What is the biggest value in n, -2, -5? n Let x = -0.16 + 0.09. Let f = 50286.8 - 50287. What is the second biggest value in x, 4, -1/6, f? x Let m = -230 - -294. Let n = m + -64.05. Let z = 0.5 - 0.1. Which is the smallest value? (a) n (b) 1/2 (c) z a Let q = 120 + -8. Let r = 103 - q. Let t = -10/13 + 67/104. What is the second smallest value in r, t, -0.5? -0.5 Let v = -2.065 + 224.985. Let n = -223 + v. Which is the biggest value? (a) -1/4 (b) 3/5 (c) n (d) 1/4 b Let v be ((-12)/15)/((-3)/10). Let h = 110 + 29. Let j = 140 - h. What is the fourth biggest value in -5, j, 0.1, v? -5 Let m = 366 - 198. Let i be (-8)/(-10) - m/10. Let n be -5 + 1 + 16/i. What is the third biggest value in 0, -1/5, n, -3? -3 Let h be (1/3)/((-8)/18). Let u = 1.475 - 0.975. Let z = 1.2 - 8.2. Which is the second biggest value? (a) u (b) z (c) h c Let a(p) = -123p - 5048. Let u be a(-41). Let o = 488/1245 + 2/249. What is the smallest value in o, u, 2/25? u Let h = -2 - -9. Let i = h - 9. Let w = -678 + 14236/21. Which is the smallest value? (a) i (b) 2 (c) w (d) -1/4 a Let o = 4.8 + 0.2. Let m = -27 - -27.4. Let g = -127 + 126.9. Which is the smallest value? (a) g (b) m (c) -1 (d) o c Let m = -1 + 5. Let q = -203.5 - -213.5. Which is the fourth biggest value? (a) -5 (b) q (c) m (d) 3/7 a Let f = 57.6 - 26.6. Let b be ((-6)/(-2))/(4/8-14). What is the third smallest value in f, b, -4? f Let c = -2.88 - -8.88. What is the second smallest value in -2/11, c, 5/2, 21/4? 5/2 Let z = 0.3013 - 0.0013. Which is the fourth biggest value? (a) -1/8 (b) z (c) 2 (d) 0.4 (e) -0.1 e Let q(w) = 2w + 45. Let t be q(-16). Suppose -2 - t = 15n. Let d be (-4)/(-10) - (-56)/(-190). Which is the biggest value? (a) n (b) d (c) 3 c Let r = 0.2 + 0.3. Let n = 2859 - 2858.6. Let p be (-3)/6 - (-21)/54. Which is the second biggest value? (a) p (b) n (c) 3 (d) r d Let q = 45.7 + -42.7. What is the third smallest value in 24, q, -5, 1/3? q Let x = 1/10 + 7/30. Let l be 2 + 18/(-16) - 7/14. Let g be (1 + -2)-1-5. Which is the fourth smallest value? (a) g (b) -3/4 (c) x (d) l d Let c = 10169 - 10168.9. What is the third smallest value in -120.9, -3, c? c Suppose -3m = -5t + 21 + 46, 46 = -2m + 2t. Let x be (-3 - 20/(-7))/(m/(-28)). Which is the third biggest value? (a) 1 (b) x (c) -0.9 c Let z = -8/997 + 1045/5982. Let m be (25/(-45))/(2/(-3)). Which is the third biggest value? (a) z (b) -0.3 (c) -2 (d) m b Let p = -0.078 + 2.078. Let a = -10419/7 + 1488. What is the smallest value in 5, a, p? a Let x = 22.5 + -17. Let j = x + -5. Let p = 189 - 186. What is the fourth smallest value in -0.5, p, 0.4, j? p Suppose 0 = 38y - 92y. Which is the fourth smallest value? (a) y (b) -12 (c) 2/13 (d) -10 c Let y(u) = -2u2 - 83u + 788. Let n be y(8). Which is the third smallest value? (a) 32 (b) -2 (c) n (d) -2/5 (e) -1 e Let x = 4.4 - 6.4. What is the smallest value in -0.2, -0.15, 1, x, 0.2? x Let k = -184 - -401. Let n = -219 + k. Let g = 0.3 + -5.3. Which is the third biggest value? (a) g (b) -1/9 (c) -1/6 (d) n d Let r = -150 - -24. Let s = r + 125.94. What is the biggest value in s, 0.2, 1? 1 Let y(s) = -4*s + 16. Let i be y(17). Let z = i - -47. Let t = 0.18 - 0.48. What is the third smallest value in -0.1, t, z, -1/3? t Let u = 0.294 + -1.994. Let j be 9/(-6) + (-4)/(-2). Let n be	{ "pile_set_name": "DM Mathematics" }
4 What is -4084561 divided by 6? -4084561/6 9032 divided by 9032 1 Divide -3 by 373902. -1/124634 Calculate -9 divided by -15783. 3/5261 -4 divided by 55315 -4/55315 13 divided by -5297 -13/5297 What is -42764 divided by -24? 10691/6 2121080 divided by -16316 -130 Divide -1271431 by 4909. -259 What is -2748901 divided by 144679? -19 Calculate -4076 divided by -13. 4076/13 What is -1581 divided by -2? 1581/2 Calculate 0 divided by -287. 0 What is -428 divided by 3? -428/3 What is -49247 divided by -49247? 1 -3 divided by -14177 3/14177 What is 1554264 divided by 43174? 36 Divide 783 by -481. -783/481 Calculate -11474 divided by 3. -11474/3 0 divided by -464 0 Calculate 55 divided by 94. 55/94 Divide -79 by -10257. 79/10257 What is 342866 divided by -1? -342866 Calculate 4 divided by 1626. 2/813 -3720 divided by 30 -124 -1301 divided by 5 -1301/5 What is -4552 divided by 3? -4552/3 -4 divided by 4989 -4/4989 Calculate -69938 divided by -2. 34969 What is 56148 divided by 3? 18716 What is 728314 divided by -11747? -62 Divide 5 by 7717. 5/7717 What is 2352 divided by 112? 21 -3 divided by -1544 3/1544 -3 divided by -43082 3/43082 Calculate -23722 divided by 4. -11861/2 Calculate 18189 divided by 1. 18189 Divide -1606888 by 4. -401722 Calculate 2 divided by -48727. -2/48727 -298 divided by 118 -149/59 Divide -4371795 by -874359. 5 Calculate -31 divided by 23591. -1/761 Divide 7582 by -6. -3791/3 -433426 divided by -1 433426 Calculate -8173 divided by -11. 743 -438323 divided by 1 -438323 What is 14100565 divided by -6? -14100565/6 -2 divided by 3136 -1/1568 22712 divided by -2839 -8 What is -42112 divided by 448? -94 What is 3 divided by 183663? 1/61221 Calculate 855904 divided by -14. -61136 Calculate -562873 divided by -4. 562873/4 What is 1 divided by -17776? -1/17776 Divide 230191 by -4. -230191/4 What is 2332590 divided by -466518? -5 Calculate 97710 divided by -6514. -15 What is 16 divided by -654? -8/327 Divide 439896 by 7. 439896/7 Divide -16 by -58375. 16/58375 What is -11 divided by -923? 11/923 Divide -808269 by -11. 73479 What is -12348 divided by 147? -84 Calculate 29388 divided by -4898. -6 What is 355921 divided by -41? -8681 What is -1 divided by -58918? 1/58918 What is -183435 divided by 61145? -3 3921 divided by -229 -3921/229 Divide -46 by -1193. 46/1193 140499 divided by -2097 -67 Calculate 629 divided by -37. -17 Calculate -178745 divided by -25535. 7 What is -62644 divided by 5? -62644/5 10 divided by 3611 10/3611 Calculate 198457 divided by 12. 198457/12 -1019370 divided by 6 -169895 What is 2 divided by -14779? -2/14779 2412 divided by -137 -2412/137 What is -148 divided by -802? 74/401 Calculate 2556 divided by -318. -426/53 Calculate 176358 divided by -88179. -2 What is 5023109 divided by -55199? -91 15204 divided by -9 -5068/3 What is 5 divided by -9046? -5/9046 Calculate -566198 divided by 2. -283099 Divide 14812 by -167. -14812/167 -2636408 divided by 659102 -4 0 divided by 459198 0 Calculate 2 divided by 48849. 2/48849 What is 250452 divided by 6? 41742 What is 0 divided by -61100? 0 Divide -42120 by 3. -14040 Calculate 332220 divided by 147. 2260 Divide -33960 by -120. 283 Calculate 19 divided by 2051. 19/2051 Calculate -12 divided by -12112. 3/3028 -3124164 divided by 3 -1041388 What is -4432 divided by -8? 554 Divide -251454 by 42. -5987 Calculate -2438 divided by 11. -2438/11 What is -40 divided by 1392? -5/174 What is 9 divided by 5831? 9/5831 Divide 0 by 6828. 0 Divide -26952 by 1123. -24 What is -8 divided by -117570? 4/58785 What is 0 divided by -62114? 0 What is -780 divided by 15? -52 Divide -180480 by 2820. -64 Divide -95315 by -5. 19063 Divide -9865 by -1. 9865 31499 divided by -5 -31499/5 Calculate -1873336 divided by 468334. -4 Divide -481 by 270. -481/270 Divide 197 by 307. 197/307 Calculate 403 divided by 891. 403/891 Calculate -830553 divided by 3. -276851 Calculate -1142841 divided by 4. -1142841/4 371475 divided by 1143 325 Divide 54210 by 6. 9035 Calculate -998228 divided by -12964. 77 Divide -89760 by -255. 352 Calculate 3609552 divided by 6. 601592 Divide 20100 by -75. -268 What is -1938 divided by -57? 34 What is -11784 divided by 168? -491/7 Calculate 4 divided by 1513. 4/1513 What is -1619204 divided by -4? 404801 15984 divided by 1 15984 -3 divided by -18348 1/6116 534018 divided by 6 89003 215814 divided by 2 107907 0 divided by 5560 0 What is -237018 divided by -3? 79006 Divide 29316 by -3. -9772 What is 796579 divided by 7? 113797 -619 divided by -694 619/694 Calculate 868 divided by -27. -868/27 Calculate 1857 divided by 21. 619/7 Divide 1046601 by -27. -38763 Divide 162057 by -7717. -21 Divide 8485 by 7. 8485/7 What is 1808 divided by -1588? -452/397 -496 divided by -820 124/205 Calculate -36 divided by 38408. -9/9602 1706 divided by -1706 -1 Divide -102017 by 102017. -1 What is -158537 divided by 158537? -1 2 divided by 924 1/462 What is 366350 divided by -73270? -5 What is 43273 divided by 1? 43273 -21706644 divided by -6 3617774 What is -4867224 divided by -4? 1216806 Calculate 74360 divided by 22. 3380 3490 divided by -42 -1745/21 Calculate -1060835 divided by -4. 1060835/4 What is -97 divided by 23758? -97/23758 779706 divided by -2 -389853 4 divided by 463144 1/115786 What is 2 divided by 7178? 1/3589 Calculate -5 divided by 75224. -5/75224 What is 0 divided by -8322? 0 Calculate 9 divided by -4981. -9/4981 -1069 divided by -1225 1069/1225 -15936 divided by 2 -7968 7728 divided by -6 -1288 Calculate 1 divided by 21343. 1/21343 Divide 48351 by -16117. -3 4 divided by -1412774 -2/706387 Calculate -11 divided by -312691. 11/312691 115875 divided by 5 23175 Divide -4 by -38579. 4/38579 -841454 divided by 37 -22742 -40220 divided by -1 40220 -4508 divided by -53 4508/53 What is -3 divided by 36241? -3/36241 Divide -5220 by 5. -1044 Divide -735 by -147. 5 6364 divided by 148 43 Calculate -1236405 divided by -593. 2085 -2933 divided by 25 -2933/25 What is 3134 divided by 25? 3134/25 4705373 divided by 17363 271 Divide 3 by -1183985. -3/1183985 What is 19758 divided by -9879? -2 Divide 74 by -277. -74/277 Calculate 37 divided by 48554. 37/48554 Calculate 26609 divided by 41. 649 -7 divided by -50944 7/50944 What is 41000 divided by 10250? 4 -27471 divided by -9157 3 What is 0 divided by -11005? 0 2 divided by -20371 -2/20371 Divide 615985 by -1745. -353 What is 691923 divided by -3477? -199 Calculate -1 divided by 538483. -1/538483 -11770 divided by 11770 -1 Divide -168150 by 59. -2850 Calculate -13889 divided by 817. -17 What is -8876 divided by -2219? 4 1822485 divided by 7 260355 Calculate -580368 divided by -1284. 452 Calculate 194564 divided by -127. -1532 Calculate -1032924 divided by 6. -172154 Calculate 147174 divided by 1291. 114 -1358204 divided by -914 1486 What is -3457965 divided by 1152655? -3 Calculate 810057 divided by -3. -270019 Calculate 10703 divided by 658. 1529/94 Calculate 86191 divided by -7. -12313 137723 divided by -137723 -1 What is -419462 divided by 262? -1601 Divide -45120 by 10. -4512 -49374 divided by -211 234 Calculate -7802 divided by 3901. -2 What is -985 divided by 195? -197/39 Divide -38124 by 54. -706 Divide 425344 by -128. -3323 Calculate -153428 divided by -76714. 2 Divide 4530 by -1. -4530 361422 divided by -180711 -2 Divide 438220 by -87644. -5 Calculate -147602 divided by 4. -73801/2 546360 divided by -109272 -5 Divide -488136 by -40678. 12 Divide -131122 by 53. -2474 Divide -912912 by -228228. 4 Divide -48804 by -3. 16268 What is 6051 divided by -3? -2017 Divide 529 by 179. 529/179 Calculate 362 divided by -48. -181/24 Divide 2889 by -145. -2889/145 Calculate 97 divided by -609. -97/609 What is 4 divided by -54380? -1/13595 Calculate -2926 divided by -1. 2926 -420451 divided by 22129 -19 82 divided by -6833 -82/6833 Calculate 73 divided by 5. 73/5 -165 divided by -173 165/173 450 divided by 146 225/73 15537 divided by 3 5179 854920 divided by 232 3685 Divide 3274 by -1637. -2 Divide -813535 by 162707. -5 Calculate -2 divided by 355945. -2/355945 What is -195 divided by 6725? -39/1345 Divide 1019096 by -4264. -239 Calculate -364265 divided by -72853. 5 What is 3981816 divided by 348? 11442 518400 divided by 6 86400 Calculate -330 divided by 448	{ "pile_set_name": "DM Mathematics" }
Calculate (2/(-9))/((-12)/(-18)). -1/3 What is the value of 37/(-74)(22)/1? -2 -1(-16)/(-64)16/(-26) 2/13 Calculate (-3(-16)/(-24))/1. -2 Calculate 8((-2)/(-8))/((-7)/(-14)). 4 What is the value of (-3)/(-4)(-240)/(-72)-2? -5 Calculate 49/28(-10)/(-35)-1. -1/2 Evaluate 1115/(-5). -3 Evaluate -1(-2)/(-2)6069/867. -7 Calculate (12/(-14))/((18/21)/(-6)). 6 What is ((15/10)/(-1))/((-2)/4)? 3 What is 2/(-4)(-144)/(-18)? -4 What is ((-3)/12)/(7/(-42))? 3/2 -10((-42)/(-6))/141 -5 What is the value of (-1)/1(-148)/37? 4 What is the value of -1(((-16)/4)/8)/(-1)? -1/2 Calculate (-54)/(-84)(-1)/((-6)/(-4)). -3/7 Evaluate (1/(16/(-20)))/((-6)/(-24)). -5 What is the value of 7(-2)/2(-840)/980? 6 Calculate 2/(-12)-15(-38)/95. -1 Calculate (-39/30)/((-12)/10). 3/4 ((-3)/(-6)56/14)/13 2/13 What is (-30)/102(-3)/45-6? -2/17 What is the value of 126/(-12)? -1 (-62/70)/((-1)/(-5)) -6/7 ((-4)/(-75))/(((-16)/(-6))/4) 2/25 Evaluate (5/(-1)-1)/(-1). -5 What is (-9)/((-126)/(-49))60/21? -10 (360/8)/(-9)(-4)/(-4) -5 Evaluate (1/1)/(6/48). 8 Calculate (-1)/(-44/64). 4 (18/(-81))/((-2)/362) 2 (-9)/(108/(-8))3/(-1) -2 Calculate (-2)/12216/(-24). 3/2 What is the value of (-1)/(-1)1(-120)/210? -4/7 What is ((-5)/(25/15))/1? -3 Evaluate 1/(46/(-72)). -3 Calculate 12/(-22)(-506)/69. 4 Evaluate (-3)/((3/(6/(-2)))/1). 3 -20(-1)/(8/(-20)-5) 10 What is the value of 4(-20)/(-32)-2? -5 (22/44)/(5/(-6)) -3/5 What is 342/57(-1)/((-6)/4)? 4 Evaluate ((-8)/30)/(204/(-153)). 1/5 What is the value of ((-666)/1221)/(3/(-22))? 4 What is the value of (-59)/(-295)(-10)/(-4)? 1/2 Calculate (0/(8/(-4)))/3. 0 Calculate (-30)/9-63/6. 10 Calculate (-30)/50(-1)/((-4)/5). -3/4 What is the value of 1/((-3)/(-15)(-25)/10)? -2 Evaluate (381/889)/(6/(-2)). -1/7 10/18(-3)/(-60)6 1/6 Evaluate (-6(-3)/(-135))/((-6)/(-10)). -2/9 (10/(-25)1)/(6/15) -1 Evaluate (3/6)/((-5)/30). -3 What is the value of ((-108)/(-54))/((-2)/(-4))? 4 Calculate (0/(-1)1/(-1))/(-1). 0 ((-4)/6)/(14/21) -1 What is the value of ((-2)/(-6))/(8/(-24))? -1 Evaluate (-6)/2824/(-9). 4/7 Calculate (3/21)/(20/700). 5 What is the value of (((-540)/(-75))/9)/(2/(-20))? -8 ((-3)/(-3))/((-15)/15) -1 What is (-4)/(-4)(-14)/(-4)-2? -7 What is -151(-43)/(-129)? -5 Evaluate ((-7)/(28/(-5)))/10. 1/8 What is the value of -12(-15)/10? 3 (2/4)/((-6)/((-300)/5)) 5 ((-6)/(-18))/(-2(-2)/(-4)) -1/3 What is the value of (8/6)/((-16)/24)? -2 What is the value of (4/(-9))/(4/6)? -2/3 What is 2(315/14)/(-9)? -5 What is the value of (2/5)/(24/420)? 7 ((-920)/46)/(-14) 5 Evaluate ((-162)/243)/(-32/(-9)). -1 What is the value of 32/60(-6)/24? -2/15 Calculate ((0/(-2))/(-4))/(12). 0 Evaluate ((-4)/7)/(16/192-8). 6/7 Evaluate (7/(315/12))/(-2). -2/15 (-1)/(-2)0(-6)/(-24) 0 ((-4)/10)/((-1)/10-26) -2/13 Evaluate 6/((-1)/((-4)/40)). 3/5 What is ((-1)/3)/(11/99)? -3 What is ((-38)/(-57))/(22/(-6))? -2/11 What is the value of 1/(8/4)-1? -1/2 What is the value of (-5)/(-5)(-18)/(-3)? 6 Evaluate (27/30)/1(-116)/(-261). 2/5 Calculate ((-2)/(18/3))/((-1)/3). 1 Calculate (-10)/(-40)64/3. 2 What is ((-6)/(-4))/(-3)(-1)/2? 1/4 What is the value of (8/(-6))/(300/(-450))? 2 37/(-42)(-2)/3 1/3 What is the value of (((-9)/(-3))/(-21))/((-8)/168)? 3 What is ((-4)/6)/(33/(1287/104))? -1/4 -112/(-16)1 3/4 What is 3(1/(-2))/(117/26)? -1/3 Evaluate 1/(77/(-11))-3. 3/7 Evaluate (-36)/6(3/18)/(-1). 1 Calculate ((-10)/150)/((-2)/12)10. 4 What is the value of 6/(-14)(1260/96)/(-15)? 3/8 What is (-30)/(-5)(-5)/(-50)? 3/5 What is the value of 221/141? 3 -5(-2)/(-3)(-72)/40 6 What is the value of ((-132)/165)/(14)? -1/5 Evaluate 14/(-4)(-1200)/(-840). -5 What is -6(-4)/245/1? 5 What is (-24)/(-100)-1(-10)/4? 3/5 What is the value of 4(-4)/(800/(-70))? 7/5 What is the value of (8/(-10))/((-96)/80)? 2/3 Calculate ((30/3)/2)/(15/3). 1 What is ((-16)/(-12))/260/(-200)? -1/5 (1-6)/((-5)/(10/(-3))) -4 Evaluate ((-16)/24)/((-3)/(-27)). -6 Evaluate (280/15)/(-14)(-2)/4. 2/3 (-21)/((-20)/(-560)-14) 4 What is the value of (((-3)/(-6))/(6/(-72)))/2? -3 What is the value of ((-12)/(-15))/(7/(-5))? -4/7 What is the value of -11/((8/(-2))/20)? 5 What is -2(10/(-26))/(-5)? -2/13 What is 16/((-704)/77)-4? 7 Evaluate 3/(((-4)/(-6))/(36/(-162))). -1 6/27/((-126)/24) -4 ((-20)/(-10))/(1/(-1)) -2 (4/16)/((-8)/256) -8 ((-25)/(750/12))/((-1)/(-5)) -2 What is 4/(-21)(-96)/64? 2/7 What is ((3/6)/(4/(-40)))/1? -5 What is the value of (((-495)/30)/(-11))/(6/(-10))? -5/2 What is ((-6)/(-5))/(-3)(-60)/32? 3/4 Calculate 12/(-2)0/(-2). 0 What is the value of (14/35-35)/(-2)? 7 What is the value of 10/4-4(-7)/(-70)? -1 Evaluate 3(-4)/99/6. -2 What is the value of ((-32)/12)/418/(-120)? 1/10 What is the value of (29/(-9))/11? -2/11 What is (1/1)/((105/14)/(-1))? -2/15 (-16)/(-84)(-3)/(-2)-1 -2/7 What is (3-4)/415/(-15)? 3 What is (6/4-4)/(-2)? 3 What is the value of ((-3)/3(-6)/6)/7? 1/7 (-4)/(-6)-6(-1)/18 2/9 What is the value of (-44)/55(15/1)/3? -4 Calculate 55/1002/(-11). -1/10 Evaluate 21/((-56)/21). -3/4 (-14)/(-42)19 3 What is -1(-2)/(-2)0/(-19)? 0 Evaluate ((-5)/(70/(-16)))/((-30)/(-105)). 4 What is the value of (5/(-20))/(-181/(-16))? -2/9 Calculate 5/((-275)/(-22))-10. -4 Evaluate (6/(-26))/(63/42). -2/13 What is (51/68)/((-15)/20)? -1 What is (8/(-4))/(66/(-6))? 2/11 What is the value of (4/(-20))/((-8)/300-6)? -5/4 Evaluate 0/26/18. 0 Evaluate (-3)/48(-1)/((-2)/(-4)). 1/8 Calculate (-4)/61219/(-38). 4 ((-4)/(-12))/((-5)/(-60)) 4 (-12)/32-82/(-6) -1 Evaluate 20/(-10)(-9)/6. 3 165/33-11 -5 What is ((-1)/(-2))/(57/(-38))3? -1 What is ((-16)/12)/(240/(-45))? 1/4 (-7)/(-3)16/56 2/3 What is -348/1893/4? -4/7 What is (24/(-20)(-55)/231)/(-1)? -2/7 Evaluate 4/(-8)13/6. -1/4 (1/(-2))/(((-25)/6)/25) 3 Evaluate ((-8)/14)/(7/(49/2)). -2 What is 2/52185/2618? 3/11 ((-260)/(-24))/1356/(-70) -2/3 Evaluate (-78)/13(-1)/6. 1 (120/10)/(-204)-1 1/17 Calculate ((-36)/360)/(((-9)/24)/(-3)). -4/5 What is (-10)/(5/(25/10))? -5 Evaluate (221)/((-531)/1062). -8 What is (-10)/(-12)59/300? 1/8 Calculate ((-350)/(-210))/((-2)/6). -5 What is the value of (4/(-4))/(-1)2? 2 ((-2)/7)/(32/(-140)) 5/4 What is the value of (-12)/81/(5/2)? -3/5 What is 1/116/(-3)? -2/11 What is (4/(-10))/(1/(-30)-3)? -4 What is the value of ((-2)/(-5))/(5/25)? 2 What is (4/33)/((-36)/(-18))? 2 Evaluate (3/3)/((-2)/10). -5 (-153)/1024/21 -2/7 Calculate (-5)/912/1204. -2/9 10/166(-10)/15 -5/2 What is (2(-6)/(-6))/(-6)? -1/3 What is the value of ((-6)/180)/((-2)/(-23))? -1/10 What is the value of (36/54)/((-1)/(-6))? 4 Calculate -2(6/8)/((-30)/(-100)). -5 What is (250/(-5))/((-75)/30)? 8 What is the value of ((-1)/((6/(-3))/(-8)))/2? -2 Calculate (((-2)/(-2))/(-1))/(37/(-37)). 1 What is the value of (-3)/290/135? -1 Evaluate ((-6)/(-4))/((-6)/(-12)). 3 What is (55/200)/(1/8)? 1 0((-26)/(-4))/13 0 ((-21)/21)/(6/2) -1/3 Evaluate (16/(-60))/(1/((-9)/6)). 2/5 Calculate (4/(-4))/(2/6). -3 What is the value of (-2)/(-6)60/(-160)? -1/8 What is the value of (-2)/32/(-4)? 1/3 (2/(-133))/((-76)/532) 2/19 What is ((2/20)/1)/(18/(-36))? -1/5 5/2016/(-22) -2/11 What is the value of (-4(-10)/(-20))/(2/4)? -4 What is the value of ((-2)/(-15))/(-8(-8)/320)? 2/3 (-1)/(-2)406/(-116) -7/4 What is the value of (1/(-3)3)/(2/8)? -4 2/(((-14)/(-105))/(1/(-5))) -3 What is (6(-40)/(-288))/((-50)/(-15))? 1/4 300/72(-8)/20 -5/3 Calculate 14/(-42)12/(-10). 2/5 (282/94)/(1/(4/2)) 6 What is 3/(-1)8/12? -2 What is (-12)/855/(-99)-12? -10 What is (40/(-25))/(8/(-100)-5)? -4 Evaluate (-4)/(24/(-4)1/3). 2 What is the value of (3/(-2))/(19/(-38))? 3 Evaluate ((-40)/(-250))/((-22)/55). -2/5 Calculate (16/4)/(3/(-18)-8). 3 What is the value of 8(-2)/(-16)-2? -2 Evaluate ((-12)/5)/(-6)(-15)/(-39). 2/13 What is (-68)/(-51)(-90)/(-24)? 5 What is 26/(-13)(-1)/2? 1 825/(-75)2/11 -2 Evaluate (165/11)/(9/3). 5 What is (-6)/8592/1265? -3/11 What is ((-2016)/(-20))/(-28)5/2? -9 What is the value of ((-60)/440)/(-33/12)? 2/11 Evaluate ((-6)/9)/(5/(105/14)). -1 ((-4)/(-6))/(1/(-6)) -4 What is the value of ((-15)/(-3))/(-15)6? -2 Calculate -111(-65)/(-65). -11 Evaluate 27/30*(-140)/168. -3/4 (3/(-2))	{ "pile_set_name": "DM Mathematics" }
ose -f - 1 = -4, f = -px + 2758. Is x composite? True Let x(v) = -v3 + 36v*2 + 9v - 31. Is x(36) a composite number? False Let c = 2617 + -1615. Suppose -5m + 4843 = 2x + c, 5m + 3x - 3839 = 0. Is m prime? True Suppose -3l + 31 = -5j, 0l - j = -4l + 47. Let d(r) = 7r3 - 8r*2 - 5 - 9r - 6r3 - 3r*2. Is d(l) prime? True Let q = 15 + -6. Suppose qw - 4w - 15 = 0, -5t - 4w = -717. Suppose 0r + s = -4r + t, -2s = 3r - 107. Is r a prime number? False Let z(m) be the third derivative of 8/15m*5 + 0m + 1/12m4 - m2 - 1/6m*3 + 0. Is z(3) prime? True Let n(s) = 3948s. Let g be n(3). Let z = -7413 + g. Suppose z = 2k + k. Is k a prime number? False Is ((-20122)/10)/((-13)/65) a composite number? False Suppose -5v + 11 = -14. Suppose 3u - b - 61 = 13, -vu = -b - 126. Is u prime? False Suppose -2d + 4n = 843 + 35, -5d + 3n - 2202 = 0. Let t = d - -704. Let l = 564 - t. Is l a composite number? True Let b(r) = -720r3 + 4r*2 + 4r + 3. Is b(-2) a prime number? False Let h(s) = 436s3 + s2 + 18s - 31. Is h(2) a prime number? False Is 24/(-44) + ((-1256235)/55)/(-3) composite? True Suppose -3h - 42 + 84 = 0. Is 21455 - (-13 + h) prime? True Suppose -2c = c - 9. Suppose 15 = -cx, 3s + 2x + 23 = 4x. Let t = 32 - s. Is t a prime number? True Suppose -x = 2x - 6. Let o be (-1)/(-4)(-35 + 35). Suppose v - 2v - a + 248 = 0, -3v - xa + 743 = o. Is v a composite number? True Is 63756/5 - ((-147)/15 + 10) prime? False Let h be 2/11 - (-42531)/33. Suppose 7w = 13770 - h. Is w a composite number? False Let k(p) = 6p*2 - p + 1. Let x be k(9). Let g = x + -185. Is g prime? True Suppose 79z + 44539 = 90z. Is z composite? False Suppose 2l = 3w + 25, -w - 3w - 5 = 3l. Let k be (-70)/(-7)2/l. Suppose 3g - kr = 95, g - 6g = -4r - 161. Is g composite? True Let s = -31 - -9. Let k = 32 + s. Is (148/(-10))/((-4)/k) prime? True Let u = 26 + -23. Suppose -2d = 3b - 4745 + 660, -ud - 1358 = -b. Is b a composite number? False Let s(b) = -10b*2 + b - 7. Let k be s(-6). Let c = 4304 - k. Is c prime? False Suppose 3x = -0x + 33. Suppose 3j = s + x, s = -0 + 1. Suppose -jh + 1353 + 4243 = 0. Is h a composite number? False Is (-128)/768 + (-82519)/(-6) composite? True Suppose 3r = 53x - 58x + 35267, 4r + 35239 = 5x. Is x composite? True Suppose -2v = 9m - 4m - 31203, -4v - 24940 = -4m. Is m prime? False Suppose 3208 = 4q - 6z + z, -5q - 3z = -3973. Is q prime? True Let x be (-22)/77 - (-16)/7. Suppose 200 = xu - 84. Is u composite? True Suppose -3u - 2y + 3301 = -2u, -4u - 2y = -13216. Let l = u + -1152. Is l a composite number? False Suppose z - 638 = -10z. Suppose -zs = -57s - 1049. Is s prime? True Let b = -5 + 15. Let z(t) = 345t + 5. Is z(b) composite? True Let s(a) = 5a*2 + 19a - 1. Let f be s(13). Suppose -2t + 2o - 256 = -4t, -12 = -3o. Let j = f - t. Is j composite? False Let l(p) = p*3 - 26p*2 - 37p + 3. Is l(34) prime? True Suppose -14826 = -2o - p, -22225 = -3o + p + p. Is o a prime number? True Let p = 606 - 254. Let l = p - 59. Is l composite? False Suppose -5d + 5 = g, 2d + 0g = 3g - 15. Suppose 8h + dh = 0. Suppose -6z + 1506 = -hz. Is z prime? True Let j be (42/(-4))/((-5)/20). Suppose 3i - 2o = i + j, 2i - 43 = o. Suppose -k + i = -45. Is k prime? True Let v = 21215 - 5562. Is v prime? False Let i be (3/(-4))/((-69)/36 + 2). Is i/21 - 6592/(-28) a prime number? False Let s(m) = -77m + 613. Is s(0) a composite number? False Suppose 6x + 3597 - 1197 = 0. Let b = -222 - x. Is b a prime number? False Let v = -20 - -27. Suppose -vi + 9i = 6. Suppose c - 219 = -a + 33, ic = 3a + 750. Is c a prime number? True Let k(f) = 896f - 87. Is k(14) prime? True Suppose 0 = -20i + 18i + 2480. Suppose -6s + 6260 = -s - 5t, -s - 3t = -i. Is s prime? True Let u(p) = -p2 + 2p + 47. Let v be u(7). Suppose 395 = -4i + 9i. Let j = i - v. Is j composite? False Let i(q) = 281q2 - 15q + 21. Is i(5) a composite number? False Let g(z) be the second derivative of -97z3/6 + 7z*2 + 5z. Is g(-9) composite? False Let x be (-5 - -6) + (-884)/(-2). Suppose -4j + x = -321. Is j a prime number? True Suppose 3 + 6 = 3x. Is (526)/1 - x a prime number? True Let y(i) = -26i + 15. Let k be y(28). Let h = k + 2226. Is h a composite number? True Suppose 3p - 369 = 426. Is p a composite number? True Suppose 2m = 22 - 16. Suppose 3r = -7a + 6a + 952, 3r = -ma + 2868. Is a a prime number? False Suppose -2x - 40 = -10x. Suppose -4n + 423 = xm, m = -m - n + 171. Is m a composite number? True Is 319/(3/((-11)/((-11)/3))) composite? True Let o(x) = -48x*3 + 7x*2 + 4x + 10. Is o(-3) composite? True Let i = 20 + -18. Suppose -654 + 28 = -ih. Suppose 4r - h = 643. Is r a composite number? False Let p = 1 - 3. Let z be (0 + p)/((-5)/(-10)). Is z/30 + (-2661)/(-45) composite? False Let k = -25 + 26. Let r be 1(-1 - (3 - k)). Is r/12-8382 composite? False Suppose -o - 2492 = -2u + 6160, 2o = -u + 4331. Is u a prime number? True Let c = -5997 + 8878. Is c composite? True Let j be 5 + 0 + (0 - 1). Let h = 53 - 55. Is (-7)/j424/h a composite number? True Let u(x) = x*3 + 7x*2 + 8x + 15. Let w = 5 + -11. Let g be u(w). Suppose -h = gh - 52. Is h a prime number? True Let k(s) = s2 + 20s + 55. Let w be k(-17). Suppose 4h - o - 4458 = 0, -wh + 3o - o = -4456. Is h prime? False Let z(f) = f3 - 7f*2 + 6f. Let w be z(6). Suppose -4p - 2p + 126 = w. Suppose 4v - 4j - j = 42, p = v + 4j. Is v a prime number? True Let n be ((-10)/(-4))/(-5)-2. Let f(p) = 0 + p - 6 + n + 0. Is f(16) composite? False Suppose 0 = -4d + 2d + 14. Suppose do - 15o = -2888. Is o a composite number? True Let q(u) = 59u + 28u + 19 + 9u + 30u. Is q(7) composite? True Let z = 63 + 18. Suppose 2436 + z = 3k. Is k prime? True Let p = -190 + 1590. Suppose 8t = 12t + p. Let j = 585 + t. Is j prime? False Let j = -3335 + 7281. Is j a prime number? False Let p(o) = 129o*2 - 17o - 35. Is p(-3) a prime number? False Let m = 273 - 87. Suppose 5g = 3569 + m. Is g prime? True Let o(p) = -881p - 1. Let k(l) = -440l. Let i(a) = 5k(a) - 3o(a). Is i(2) composite? True Suppose 6815 = 5a + 5u, 5u - 9u - 4075 = -3a. Is a a composite number? False Suppose 0 = -12t + 35 + 13. Let f(n) = -n + 1. Let b be f(-3). Is 202 + (-1)/(b/t) a prime number? False Let z be -61/(-9)-3. Is (-65)/(z - 1 - -2) a composite number? True Suppose 0n - 2n - p + 11 = 0, n - 13 = p. Suppose ny = 10y - 206. Is y a composite number? False Suppose -2v + 1164 = 2u, 3v - 3u = -u + 1741. Let d = -402 + v. Is d composite? False Suppose -3a = -2h + 3013, 0 = -5h + 4a + 8320 - 805. Is h composite? False Let q be 2/((-20)/(-12) + -1). Suppose 0 = -2b + 4b + qv - 602, 5v = -4b + 1204. Is b prime? False Let x be 2/3(-42)/(-28). Is (-1)/(-2)x1438 prime? True Suppose 51i - 29i = 163042. Is i a composite number? False Let o be ((54/(-4))/(-3))/((-8)/(-16)). Suppose 3d = 4d - 291. Is (-1 + 4)/(o/d) a prime number? True Suppose -3218 - 1874 = -4o. Suppose 4z + 4l - o = 603, -z + 469 = -l. Is z composite? True Suppose 4c + 2 = -6. Let i = -36 + 87. Is i/(-2)c1 composite? True Let l = 53 + -53. Is 44/66(l - -1)717 a prime number? False Suppose -4n = 5c - 25, c - 5c = -4. Suppose -5r + 3z = -710 - 4680, 3r - 3218 = nz. Is r a composite number? True Suppose 3 = 8p - 5. Is -466(p/(-6))/(2/6) a composite number? False Suppose -4c + 2845 = -8479. Is c a prime number? False Suppose 4g + 6 = -10, 27 = m + 2g. Let z be 2335/m - 4/(-14). Suppose -885 + z = -2t. Is t a prime number? True Let d = 6935 - -224. Is d prime? True Let s(p) = -505p + 252p + 2 + 87p - 521p. Is s(-7) prime? False Let a(c) = -4836c3 + 4c*2 - 2c - 5. Is a(-1) composite? True Suppose -4z = 5t - 13 - 15, 3t - 20 = -4z. Let n = 1839 - 954. Suppose -n = -3i - y - zy, 0 = -2i - 3y + 592. Is i a composite number? False Suppose -3n - 34 = -10. Let y(u) = -50u + 27. Is y(n) composite? True Suppose -2r = -0t + 3t - 12590, 5r + 25 = 0. Let u = t - 2689. Is u composite? False Let o(q) = q - 3. Let u be o(9). Let g be 20/u210/25. Suppose 0 = -3z - z + g. Is z a c	{ "pile_set_name": "DM Mathematics" }
r of 14480 and 880. 80 What is the greatest common factor of 107532 and 45? 9 What is the highest common divisor of 470890 and 140? 70 Calculate the highest common factor of 195 and 1443. 39 Calculate the highest common divisor of 663921 and 1278. 639 What is the highest common factor of 76 and 6860? 4 Calculate the greatest common divisor of 96 and 7188. 12 Calculate the highest common factor of 5123 and 7849. 47 Calculate the greatest common factor of 248503 and 67. 67 Calculate the highest common factor of 1188068 and 1208. 604 Calculate the greatest common factor of 140 and 1375115. 35 Calculate the greatest common factor of 7301 and 3283. 49 What is the highest common factor of 2936655 and 3645? 1215 What is the highest common divisor of 8691 and 27? 3 What is the highest common factor of 15345 and 1980? 495 Calculate the highest common factor of 26705 and 109. 109 Calculate the greatest common divisor of 4223 and 3811. 103 What is the highest common factor of 165393 and 207? 207 Calculate the greatest common factor of 539260 and 20. 20 Calculate the greatest common divisor of 11 and 516967. 11 What is the greatest common factor of 272 and 5696? 16 What is the highest common factor of 23713 and 207? 23 Calculate the greatest common divisor of 522332 and 1206. 134 What is the highest common divisor of 197488 and 48? 16 What is the highest common factor of 192098 and 111942? 1382 Calculate the greatest common factor of 52 and 165763. 13 What is the highest common factor of 2313 and 639? 9 What is the greatest common divisor of 1368 and 1158012? 684 Calculate the greatest common factor of 1482 and 11934. 78 What is the highest common divisor of 12282 and 7038? 138 Calculate the greatest common factor of 40825 and 230. 115 What is the highest common divisor of 108960 and 3360? 480 Calculate the highest common divisor of 28910 and 2240. 70 Calculate the highest common factor of 6528 and 25296. 816 What is the greatest common factor of 2681 and 25661? 383 What is the greatest common factor of 190 and 725610? 190 What is the greatest common factor of 12 and 72074? 2 What is the highest common divisor of 1420 and 51620? 20 Calculate the highest common factor of 37450 and 98. 14 What is the highest common factor of 13321 and 2768? 173 Calculate the greatest common divisor of 19920 and 6420. 60 Calculate the greatest common divisor of 23281 and 62. 31 What is the highest common divisor of 36 and 6963156? 36 What is the greatest common factor of 4 and 7577? 1 Calculate the greatest common divisor of 90447 and 236. 59 Calculate the highest common divisor of 135176 and 1708. 244 Calculate the greatest common factor of 13629 and 168. 21 Calculate the greatest common factor of 142395 and 1320. 165 What is the greatest common divisor of 7658 and 434? 14 Calculate the highest common divisor of 9972 and 2070. 18 Calculate the highest common factor of 46 and 416622. 46 What is the greatest common divisor of 323088 and 14416? 848 Calculate the greatest common divisor of 461296 and 144. 16 Calculate the highest common divisor of 16326 and 54. 18 What is the highest common divisor of 14580 and 560? 20 Calculate the greatest common factor of 922650 and 750. 150 Calculate the greatest common divisor of 1002 and 18. 6 What is the highest common divisor of 2568 and 88917? 321 Calculate the highest common divisor of 1589801 and 1437. 479 What is the highest common factor of 6156 and 2565? 513 What is the highest common factor of 3192 and 8550? 114 Calculate the greatest common divisor of 2348 and 485449. 587 What is the highest common factor of 37984 and 2208? 32 What is the highest common factor of 2808 and 51288? 24 Calculate the greatest common factor of 4899 and 6504239. 1633 What is the highest common factor of 85426 and 55? 11 Calculate the greatest common factor of 35 and 255005. 5 What is the greatest common factor of 11 and 162239? 11 Calculate the highest common divisor of 812 and 11424. 28 What is the highest common divisor of 6324 and 625549? 527 What is the greatest common factor of 197295 and 315? 105 What is the greatest common divisor of 7718 and 5338? 34 What is the highest common divisor of 10045 and 21805? 245 What is the highest common divisor of 10761 and 44099? 211 Calculate the greatest common divisor of 14333 and 11. 11 What is the greatest common divisor of 7545 and 36? 3 What is the highest common divisor of 1071 and 148428? 63 What is the greatest common factor of 118 and 1762? 2 Calculate the highest common divisor of 480 and 165216. 96 Calculate the greatest common divisor of 1997191 and 49. 49 What is the greatest common divisor of 2166 and 372210? 114 What is the greatest common divisor of 138 and 138? 138 What is the greatest common factor of 1206 and 378? 18 What is the greatest common factor of 518 and 13958? 14 What is the highest common divisor of 332 and 80676? 332 What is the greatest common divisor of 34010 and 230? 10 What is the greatest common divisor of 45 and 66355? 5 What is the highest common factor of 39 and 5199428? 13 Calculate the greatest common divisor of 56500 and 13108. 452 Calculate the greatest common factor of 3 and 1062582. 3 Calculate the highest common factor of 18648 and 26064. 72 What is the greatest common divisor of 9314 and 2? 2 What is the highest common divisor of 45937 and 142? 71 What is the greatest common divisor of 480 and 116610? 30 Calculate the highest common divisor of 546 and 387478. 182 Calculate the highest common divisor of 27443 and 169. 13 Calculate the greatest common divisor of 5199586 and 1666. 1666 What is the greatest common divisor of 2031368 and 248? 248 Calculate the highest common divisor of 2153584 and 281. 281 What is the greatest common factor of 1404 and 7514? 26 What is the greatest common factor of 5520 and 171465? 345 Calculate the greatest common factor of 63 and 1113588. 63 What is the highest common factor of 9296 and 21? 7 Calculate the highest common divisor of 111846 and 84. 42 Calculate the highest common divisor of 109718 and 476. 238 What is the greatest common factor of 4185 and 3813? 93 Calculate the greatest common divisor of 8043 and 766383. 1149 Calculate the highest common factor of 2794105 and 305. 305 What is the highest common factor of 54 and 57483? 27 Calculate the greatest common divisor of 1230 and 1530. 30 What is the highest common factor of 2184 and 2436? 84 Calculate the highest common divisor of 21330 and 2160. 270 What is the greatest common factor of 918 and 25364? 34 Calculate the highest common divisor of 787083 and 61. 61 Calculate the greatest common divisor of 88 and 24928. 8 Calculate the highest common divisor of 164539 and 148. 37 Calculate the highest common divisor of 20 and 3722010. 10 What is the highest common divisor of 3997 and 3283? 7 Calculate the highest common factor of 137860 and 488. 244 What is the highest common divisor of 258 and 213194? 86 Calculate the greatest common factor of 63 and 19681. 1 Calculate the greatest common divisor of 2376 and 28728. 216 Calculate the highest common divisor of 21 and 2538. 3 Calculate the greatest common factor of 91200 and 1995. 285 Calculate the highest common divisor of 228 and 4151880. 228 Calculate the greatest common divisor of 52560 and 1200. 240 Calculate the greatest common factor of 391 and 312041. 23 What is the highest common factor of 491392 and 1152? 128 What is the highest common divisor of 313 and 306? 1 Calculate the greatest common factor of 17864 and 17893. 29 What is the highest common divisor of 228 and 15524? 4 Calculate the greatest common divisor of 1399960 and 200. 40 Calculate the greatest common divisor of 3918 and 71177. 653 Calculate the highest common factor of 23556 and 546. 78 What is the highest common factor of 4323 and 93927? 393 Calculate the greatest common factor of 473 and 5633. 43 Calculate the highest common divisor of 137 and 193581. 137 What is the highest common divisor of 25 and 238330? 5 Calculate the greatest common divisor of 12 and 475896. 12 Calculate the greatest common divisor of 10 and 92270. 10 Calculate the greatest common divisor of 584 and 229804. 292 Calculate the greatest common factor of 73932 and 8383. 101 Calculate t	{ "pile_set_name": "DM Mathematics" }
g2n wrt g? -672g + 678n What is the third derivative of -5767g3n*2 + 2g*2n*2 - 2g - 26n2 - 9n wrt g? -34602n2 Find the first derivative of 121h*2 - h + 2148. 242h - 1 What is the derivative of 479h2r - 3h2 - 367h + r*2 wrt r? 479h*2 + 2r Find the third derivative of 267q5 + 8q*2 + 4q wrt q. 16020q2 What is the second derivative of 9f*2pr3 - 4f*2rx - 2fpx + 3fx + 2px + 2r3x + 4rx wrt f? 18pr*3 - 8rx Differentiate 144y*2 - 418 wrt y. 288y Find the second derivative of -354m3u3 - m3u - 2m3 + m2u3 + 6m*2u wrt u. -2124m3u + 6m2u Find the second derivative of 3b3x + 5b3 - 2b*2x - 2bx - 3b + 4x wrt b. 18bx + 30b - 4x Find the second derivative of 63n3o*2 - 6n*3 - 3no + 2n - 4o2 - 2 wrt o. 126n*3 - 8 Find the second derivative of -4793l*3w - 2lw + 121l + 22w wrt l. -28758lw What is the first derivative of -25rv*3 - 3rv2x*3 + 2rvx - v*3x*3 - 2vx3 wrt r? -25v*3 - 3v*2x*3 + 2vx Find the third derivative of m3v*3 + 5m*3v - m*3y3 - m2v2y*3 - 2mv3 + mvy3 - 13v*2y wrt m. 6v3 + 30v - 6y3 What is the third derivative of 154i*3m2 + i2 - 5i + 7m*2 wrt i? 924m*2 Differentiate -63h*4 + 23h + 7652 wrt h. -252h3 + 23 What is the second derivative of 36kn3u*2 + 13kn3 + ku*3 + 2n*3 + 6u*3 + 7u wrt u? 72kn*3 + 6ku + 36u Find the second derivative of 1332m2 - 1217m wrt m. 2664 Find the second derivative of -28655i2 - 2190i. -57310 What is the third derivative of -7k4 + 73k*3 - 6k*2 + 27k wrt k? -168k + 438 Find the second derivative of -8kn4 - 4kn + 55k - n*5 wrt n. -96kn2 - 20n*3 Find the second derivative of 5s*3 + 42s*2z - 2s - 93z wrt s. 30s + 84z What is the derivative of 17364m + 8358 wrt m? 17364 Find the first derivative of 27q*2 - 44q + 5214 wrt q. 54q - 44 What is the second derivative of 275k*2 + 9k + 1? 550 Find the third derivative of -6bd*2o*3 - 3bd2o*2 + 2bd2 - 90bo3 + 289d*2o*2 wrt o. -36bd2 - 540b Differentiate -66f2j - 2f2 + 3fj + 21f + 19j + 2 wrt j. -66f*2 + 3f + 19 What is the second derivative of 44uy*4 + 2uy2 + 35uy wrt y? 528uy2 + 4u Differentiate 50j3p + 413j3 - 4j*2p with respect to p. 50j3 - 4j*2 What is the derivative of -551a*2x*3 + 4a*2x - 2ax*3 - 44x*3 + 4x wrt a? -1102ax*3 + 8ax - 2x*3 What is the derivative of 167b*4 - 757? 668b*3 Find the third derivative of 2h*5 - 306h*4 + 2h*3 + 2h*2 + 48h wrt h. 120h2 - 7344h + 12 What is the first derivative of -235o2u - 22o2 - o + 8u + 1 wrt u? -235o2 + 8 What is the derivative of 22bd - b + d4 + 22 wrt d? 22b + 4d3 What is the first derivative of -3500i*2q - 27i2 + 1 wrt q? -3500i*2 Differentiate -11c*2 - 257. -22c What is the first derivative of 74a3h*2 + 3a*2h*3 + 166h*3 wrt a? 222a*2h*2 + 6ah3 What is the second derivative of -545l*4 + 4l*2 + 512l - 1? -6540l2 + 8 What is the first derivative of 15p*2 - 99p + 6047? 30p - 99 What is the first derivative of 65fg2h*2 - 3fh3 - 915g*2h + 2g - 2h*3 wrt f? 65g*2h*2 - 3h*3 Find the third derivative of -28l*3o*2u2 + l3u2 + 2l*2u + 9lo*2u*2 + 6o*2u wrt l. -168o2u*2 + 6u*2 What is the derivative of -4f*3l*2 - 8f*3 - 274fl3 + 37f wrt l? -8f3l - 822fl*2 What is the second derivative of 18g*2t*2w*2 - 2g*2tw2 - 132g*2 - 6gt2w2 + t2 - tw2 wrt t? 36g*2w*2 - 12gw2 + 2 Find the second derivative of b2h*2 + 21b*2 - bh + 29b - 13h*2 wrt b. 2h*2 + 42 Find the third derivative of -9mv6 - 43mv3 - 4mv2 + 2m + 83v2 wrt v. -1080mv3 - 258m Differentiate 2168fh + 588h + 1 wrt f. 2168h What is the second derivative of 180b2i*2 + 9b*2 + 2i wrt i? 360b2 What is the second derivative of 319f*2 - 25f + 10 wrt f? 638 Find the third derivative of oq5 - 5oq4 - 3oq2 + 2q*3 - 2q*2 - 3q wrt q. 60oq*2 - 120oq + 12 Differentiate 5697g - 7751 wrt g. 5697 Find the third derivative of -298f5 - 570f*2 wrt f. -17880f*2 What is the third derivative of -18p*5 + 36p*3 + 2377p*2 wrt p? -1080p*2 + 216 What is the second derivative of -189n*2w*3 - 2n - 5w3 wrt n? -378w*3 What is the derivative of -997z*4 - 1451 wrt z? -3988z*3 Find the third derivative of 19112j*3z*3 + 15j*3z*2 + 2j*3 + 23j*2 + 2jz2 wrt z. 114672j*3 What is the first derivative of -8234n + 2108 wrt n? -8234 Find the second derivative of -2qs*2 + 186qs + 47s*2 wrt s. -4q + 94 Find the third derivative of 16119r3 + 12236r*2 wrt r. 96714 Find the third derivative of -2q*3v*3 + 32q*3v - 14q2v*2 + 69qv3 + 3q + 2v3 wrt v. -12q*3 + 414q + 12 Find the first derivative of -y*2z*3 - 605y*2 + 208yz3 wrt z. -3y*2z*2 + 624yz2 What is the third derivative of -2p*2r*3 - 12360p*2r*2 - 2p*2r + 938pr*3 - 7r3 - r2 wrt r? -12p2 + 5628p - 42 What is the first derivative of 14570j + 17810 wrt j? 14570 What is the derivative of 10i*2 - 13i - 2695 wrt i? 20i - 13 Find the first derivative of -504j*3w - 2747j3 wrt w. -504j*3 What is the third derivative of -81c*3s + 2c3 - 2c*2s - c*2 - 81s wrt c? -486s + 12 Differentiate -5g*3r - 66gr*2 + 189r*2 wrt g. -15g*2r - 66r2 Find the second derivative of 4ij3t - 7ij*2 - 19ijt + 27it*2 + 16j*2t*3 + 2t*3 wrt j. 24ijt - 14i + 32t*3 Differentiate 215dl + 55d + 3 with respect to l. 215d Differentiate -15734t + 8885 wrt t. -15734 What is the third derivative of 4b2w*3 - 5b*2w*2 - 5b*2 + 111bw3 + 4w*2 wrt w? 24b*2 + 666b Find the second derivative of 15j3 - 9j*2 + 2j + 316. 90j - 18 Find the second derivative of b4 + 2b*3 - 5b + 2. 12b2 + 12b What is the second derivative of 6h3q*4 + 5h*3q + 4h2q - 5q4 - 3q wrt q? 72h3q*2 - 60q*2 What is the third derivative of 18m*2s*5 - 2m*2s*2 + 5s*5 - 46s*2 wrt s? 1080m*2s*2 + 300s*2 What is the derivative of -4l*2z*4 + 13l*2 - 2z*4 + 3 wrt z? -16l*2z*3 - 8z*3 What is the third derivative of 43f*2j4 - f2j2 + 242f*2 - 22fj4 wrt j? 1032f*2j - 528fj What is the second derivative of -9o5t*3 + 15o*5t + 6ot*3 - 18ot wrt o? -180o*3t*3 + 300o*3t What is the second derivative of 10d2s*2 - 61d*2x*2 + ds*2x*2 - 250ds2 - 3s*2x wrt d? 20s2 - 122x*2 Find the first derivative of -df + 5dw - 2d - 2fw2 - f - w2 wrt w. 5d - 4fw - 2w Find the first derivative of 2h*3m*4 - 2626h*3 - 2hm4 + 2624m wrt m. 8h3m*3 - 8hm3 + 2624 What is the third derivative of -5i*3t*6 - 3i*3 + 11it6 - 24t*2 wrt t? -600i*3t*3 + 1320it3 Find the first derivative of -205q + 149. -205 Find the third derivative of 501l6s - l*5s + l*2s - 66l2 - 21ls wrt l. 60120l*3s - 60l2s What is the third derivative of m*2rz3 + m2rz2 + 22m*2rz + 2m*2z*2 + 2mrz*3 + 6rz3 wrt z? 6m*2r + 12mr + 36r Find the second derivative of -856n*2x*2 + 2n*2x + n*2 - nx*3 - 2x + 513 wrt x. -1712n2 - 6nx Differentiate -11c*2u2 + c2 - 5cu*2 - 73c - 2u2 wrt u. -22c*2u - 10cu - 4u Find the first derivative of -69j*3y - 323j3 + 2y wrt y. -69j3 + 2 What is the second derivative of -4d*3 + 358d*2 + 9d + 40 wrt d? -24d + 716 What is the derivative of 3ajy + 82aj - 5ay - jy2 wrt y? 3aj - 5a - 2jy What is the first derivative of -g*2mx - 237g*2m + g*2 + gm*2 - 1580gx - 1 wrt m? -g2x - 237g2 + 2gm Find the second derivative of 58b*2n*2 - 3b*2nq - 2b*2q - bn2q + 38bq - q wrt b. 116n2 - 6nq - 4q Find the first derivative of 2i2p - 28i2 + 147ip - 24i - 15p wrt p. 2i*2 + 147i - 15 What is the third derivative of -152v4x - v*2x + 2v2 + 52vx wrt v? -3648v	{ "pile_set_name": "DM Mathematics" }
m = -m. Determine j(m). 3 Let p(y) = -2y2 + 1. Let j(g) = -g2 + 2g + 1. Let w be j(3). Determine p(w). -7 Let f(p) = 7 + p + 5p - 7. Determine f(1). 6 Let f(t) = -7t - 2. Let d be 16/(-3) - (-2)/(-3). Let r(a) = a - 1. Let q(c) = dr(c) - f(c). Give q(-6). 2 Let q = 2 - 0. Let u(l) = l2 - l - 1. Let j(k) = -5k*2 + 5k + 5. Let c(d) = 2j(d) + 11u(d). What is c(q)? 1 Let y(x) = -x*3 + 6x*2 - 2x + 8. Let t be y(6). Let k(p) = p*3 + 5p*2 + 4p - 1. Let u be k(t). Let n(f) = 2f. Determine n(u). -2 Let u(q) = -5 - 5q + 4 + 3 + 2q2. Let k = -15 - -18. Calculate u(k). 5 Let r(p) = p + 1. Let s = -25 + 19. Determine r(s). -5 Let d(j) = -j3 - 4j*2 - 3j - 3. Let m(v) be the first derivative of v*4/4 - 3v2/2 - v - 3. Let t be m(-2). Calculate d(t). -3 Let q(w) = w3 - 7w2 + 3. Suppose -4j = -9j + 35. Determine q(j). 3 Let x(o) = o3 - 5o2 + 5. Let c(u) be the third derivative of u4/12 - u3/6 + u2. Let a be c(3). Give x(a). 5 Let s be (10/4 - 2)2. Let i(q) = 1 + 3q - 6 + s. Give i(3). 5 Let n(a) be the first derivative of a4/3 + a3/6 + 5a - 6. Let z(g) be the first derivative of n(g). Let l be (2/1)/((-8)/(-4)). Give z(l). 5 Let o(k) = 3k*2 + k. Let v be o(-1). Let u(w) = 6w + w*v + 3 - 4w - 10. Suppose m + 3m = -20. Calculate u(m). 8 Let u(s) = s - 2. Let p = -30 - -26. What is u(p)? -6 Let i = 18 + -12. Let k(l) = 0l + 2l - 3l - i. Let o(v) = -v*2 - 3v + 5. Let g be o(-5). What is k(g)? -1 Suppose 2t - 30 = -4j, 2t + 6 = 3j - 2t. Suppose -4r + 2d = j, 8r - 4r - 5d = -15. Let w(g) = -g3 + g2 - g - 7. Give w(r). -7 Let j be 30/48/12. Suppose js + 1 - 11 = 0. Suppose 3i - 17 = -4n, i + 15 = -4i + sn. Let d(g) = 6g3 - g2 - 2g - 1. What is d(i)? -6 Let p(i) = -6i + 127 + 3i - 128 + 0i. Give p(1). -4 Let z(k) be the first derivative of -k4/4 + 4k3/3 + k2/2 - 2k + 6. Let l = -1 - -4. What is z(l)? 10 Let l(t) = t + 12. Let w(p) = -15p3 + p2 - 1. Let b be w(-1). Suppose 0a + 3a + b = 0. Calculate l(a). 7 Suppose -10 = -3k - 7. Let l(x) be the first derivative of -1/3x*3 + 3x - 2x2 - k. What is l(-4)? 3 Suppose -3d - 4v + 8 = -0, 5d = v + 21. Let c(s) be the third derivative of 0 - 1/30s6 - 1/6s*3 + 1/12s*d - 1/60s*5 + 0s - 2s2. Determine c(1). -4 Suppose 17 - 67 = 10t. Let o(i) be the second derivative of i3/6 + i2/2 - 2i. Calculate o(t). -4 Let b(x) = -2x*2 + 3x + 4. Let q be (0/3)/2-1. Suppose q = -5f - 3a, -2 - 2 = -3f - a. Calculate b(f). -5 Let g(v) = 2v2 + v + 7. Let m(p) = -9p*2 + p - 30. Let f(s) = -3s*2 - 10. Let t(y) = 7f(y) - 2m(y). Let c(j) = 7g(j) + 5t(j). What is c(-3)? -1 Suppose 4z = 3q - 2, -2q + 7 = -2z + 5z. Let r(o) = -4 + 2oq - o2 + 5. Suppose -2j + 2 = -0. What is r(j)? 2 Let n(r) = -r + 1. Let g(b) = -2b + 1. Let i be g(-4). Let v = i - 7. Suppose 2w = -10, 0w = 3c + vw - 5. What is n(c)? -4 Let l be 4 - 2 - 4 - -3. Let y(m) = 5m*2 - m. Determine y(l). 4 Let a(x) = x. Let i be a(4). Let u(k) = 3k3 + k2 + 1. Let g(j) = 2j3 + 2j*2 + 1. Let z(y) = iu(y) - 3g(y). Give z(1). 5 Let r be (-42)/189 - ((-22)/18 + -1). Let h(p) = -3p*2 + p + 2. Give h(r). -8 Suppose -c + z + 13 = 4z, 3c - 3 = 3z. Let d(u) = 0u + cu + 0u - 3u. Give d(1). 1 Suppose 4r + 3s = -5, -2r - 2s + 0 - 2 = 0. Let q be (1 - -4)/((-2)/r). Let t(z) = -z*3 + 5z*2 - z - 1. Determine t(q). -6 Let m = 2 + 3. Let g(l) = -4 - 1 + 3 + ml. Let c = 3 - 1. Give g(c). 8 Suppose -2 = 4z - 5v + 2, -5z + 3v = 18. Let o(m) be the first derivative of -m*3/3 - 2m*2 + m - 228. Calculate o(z). -11 Let h be -5(0 + 2 + -1). Let g(c) = -c*3 - 5c*2 + 3c + 6. What is g(h)? -9 Let v be (-6)/(-21) - 10/35. Suppose v = -c - 6 + 3. Let w(y) = y + 3. Calculate w(c). 0 Suppose 2x = -r, 3x - 4r - 26 = -2x. Let p(k) = -k + x - 5 - 3k2 + 0k*2 - 2k - k*3. Calculate p(-2). -1 Suppose -1 = 4s + 11. Let f(z) = -2z3 - 3z*2 + 4z - 1. What is f(s)? 14 Suppose -3 = -t - s + 2, 2t - 2s = -2. Suppose -j - 16 = -3f, -2 = -2f - j + 2. Let z(u) = -4u - 3u + fu + 4u + 1 - tu2. Determine z(-2). -9 Suppose 3 + 1 = -g. Let b be (33/(-22))/(6/g). Let w(q) = 23q*2 - 5q - 2. Let l(i) = 12i2 - 3i - 1. Let v(m) = -5l(m) + 3w(m). What is v(b)? 8 Let x(p) = -1 + p*3 - 5 - 7p + 6p. Let z = 0 - 0. What is x(z)? -6 Let n = -6 - -6. Let q(z) = nz + 3z + 6z*2 - 5z*2. What is q(-5)? 10 Let p = -38 - -39. Let o(f) = -10f3 - f2 - f + 1. What is o(p)? -11 Let s(k) = 12k + 2. Let z(w) = -6w - 1. Let c(n) = -6s(n) - 11z(n). Let b(v) = -v. Let g be b(-2). Suppose -5q + 3q - g = 0. What is c(q)? 5 Let r(p) = 2p + 1. Suppose 17q = 19q - 8. Determine r(q). 9 Let h(x) be the first derivative of 0x - 1/24x4 + x2 - 1/60x*5 + 1 + 0x*3. Let c(r) be the second derivative of h(r). Give c(0). 0 Let m be 30/(-2)1/(-5). Let t(h) = h2 + 4. Give t(m). 13 Let u(t) be the third derivative of -t6/120 + t5/30 + t4/24 + t*3/3 + 6t2. What is u(3)? -4 Let x(o) = -o2 + 2 - 2o + 0o*2 - 3 - 2. Suppose 1 = b + 3. Calculate x(b). -3 Suppose 2 = 4m - 6. Let o(p) = p*3 + 2p*2 + 0 + mp*2 - 3p + 1. Determine o(-4). 13 Let t(k) = k. Let o(v) = v - 8. Let c be o(10). Suppose 4 = 4a - cj - 2j, j - 1 = 3a. Calculate t(a). -1 Let f(c) be the first derivative of -c*6/360 + 7c5/120 - c4/6 - 5c3/3 - 3. Let g(a) be the third derivative of f(a). Calculate g(5). 6 Let o(w) = -w3 + w2 + 5. Suppose t = -3t - v + 3, -v = 5t - 3. Determine o(t). 5 Let o(m) = 4 - 7 + 6m + 0m3 - 5m*2 + 4m*3 - 5m3. Give o(-6). -3 Let r(m) = m2 - 7m + 4. Let t be r(6). Let f(j) = -4j + 4j + j2. Determine f(t). 4 Let v(u) = -3u*3 + 0u*3 + 2 + 4u*3 - 2u + 18u2 - 16u*2. Give v(-3). -1 Suppose 0 = 14s - 2s - 72. Let c(q) = q3 - 5q*2 - 4q + 3. Calculate c(s). 15 Let j be (2/(-5))/(1/(-10)). Let t be (j/(-10))/(-1)-5. Let i(l) = l3 + 2l*2 + 2l. What is i(t)? -4 Let t(u) be the third derivative of -u5/60 - u4/6 + u*3/6 + 2u*2. Let o = -13 - -5. Let v = o + 5. Determine t(v). 4 Suppose 0 = 2i + 4v - 6, -i = -6i - 3v + 8. Let z(n) = 4n - 1. Let p(r) = -8r + 2. Let w(m) = -3p(m) - 7z(m). What is w(i)? -3 Let k(t) be the second derivative of -t3/2 - 5t*2/2 + 2t. Let b(h) = -13h - 20. Let m(q) = -2b(q) + 9k(q). What is m(0)? -5 Let z be 1/(-4) + 26/8. Let a(b) = 7b + 2. Let v(f) = f. Let r(k) = -a(k) + 6v(k). Calculate r(z). -5 Let t be (1 + 0)(-5 + 2). Let r(q) = -q + 3. Let k(u) = -2u + 3. Let s(v) = tr(v) + 2k(v). Suppose -4j = a + 6, 0 = -2a + 2j - 4j - 6. Calculate s(a). -1 Let g(o) = -6o*2 + 2o + 1. Let k be 2/(-2)11. Determine g(k). -7 Let i(n) = -6n3 + 5n*2 + 2n + 1. Let l(c) = -7c3 + 5c*2 + 3c + 1. Let j(z) = 6i(z) - 5l(z). Determine j(4). 5 Let q(r) = r + 1. Suppose -30 = 69m - 64m. Determine q(m). -5 Let o(c) = -4c. Let t(i) = 7i. Let y(p) = 5o(p) + 3t(p). Give y(-1). -1 Let q(y) = y*3 + 6y2 - y - 3. Let c = 15 - 10. Let r(v) = v2 - 7v + 4. Let i be r(c). Give q(i). 3 Let q = 14 - 9. Suppose q = 3o + 2o. Let l(c) = -c + 2c + 0c + 3 + o. Give l(0). 4 Let l be ((-7)/(-3) + -1)/(10/15). Let d(b) be the second derivative of -1/6b*3 + 2b + b*l - 5/12b*4 + 1/20b*5 + 0. What is d(5)? -3 Let f(v) = -6v*2 + 5v - v*3 + 12v*2 + 2v*3. Suppose -t - t + 21 = -3l, -2l - 10 = 0. Suppose -3z + 8z = tw + 12, -5w + z = 20. Calculate f(w). 12 Let r(i) = -i2 + 4 + 4 - 7 - 5 + 8i. Determine r(6). 8 Let v(o) = -o*2 - 7o - 2. Let k(x) = x*2 - 8x - 8. Let c be k(8). Determine v(c). -10 Let l(y) = y*2 + 3y - 7. Suppose -3 = -5h + 17. Suppose 4 = -ho - 5r - 1, -4o = -3r + 29. Determine l(o). 3 Let a(t) = t + 0t + 0 - 3. Give a(5). 2 Suppose -3 = 2k + 5. Let y(z) = 2z*2 + 3z + 7. Let u(t) = -t*2 - 2t - 3. Let i(b) = ky(b) - 9u(b). Determine i(-6). -1 Let t(c) = -3c2 + 2c - 1. Let h be (12/(-27))/(4/(-18)). Let d be (-2)/(-5) - 136/(-10). Let s be 10/d - h/(-7). What is t(s)? -2 Let s(m) = -m*3 - 13m*2 + 9m + 5. Let w(h) = h*3 + 12h*2 - 9h - 4. Let k(g) = 5s(g) + 6w(g). Calculate k(-8). 9 Suppose 3h + 3y - 32 + 2 = 0, -h + 2*y - 5 = 0. Let	{ "pile_set_name": "DM Mathematics" }
Collect the terms in 97w2 - 97w2 + w3 - 5w3. -4w*3 Collect the terms in 4a + 3a + 8a - 26a. -11a Collect the terms in 4f2 + 0 + 0. 4f*2 Collect the terms in 0u*3 - 235181 + 2u*3 + 235181. 2u*3 Collect the terms in 6136z*3 + 6141z*3 - 12278z3. -z3 Collect the terms in -599i2 + 599i*2 + 13i*3 - 6i*3. 7i*3 Collect the terms in -2 + 103q*3 + 53q*3 - 157q3 + 2. -q3 Collect the terms in -7g3 + 5g*3 - 3g3 - g3. -6g3 Collect the terms in -3o*3 - 94o + 94o - 3o*3. -6o*3 Collect the terms in 2c*2 - 29c*2 - 13c*2 + 7c*2. -33c*2 Collect the terms in 156m + 30m - 18m. 168m Collect the terms in 15n + 10n - 7n - n. 17n Collect the terms in 4y*3 + 0y*3 - 3y3. y3 Collect the terms in -6n - 4n + 8n + 2n + 12n3. 12n*3 Collect the terms in 3 + 95x - 3 + 230x. 325x Collect the terms in 358p + 5 - 350p - 3. 8p + 2 Collect the terms in -7161 - 7g + 7161. -7g Collect the terms in -2p*2 + 2p*2 - 152p*3 - 307p*3. -459p*3 Collect the terms in -16i + i + 9i + 0i + 9i. 3i Collect the terms in 61 - 122 + 61 - 5s2. -5s*2 Collect the terms in 2829 - 2829 + 27c*2. 27c*2 Collect the terms in 9l + 0l - l + 0l. 8l Collect the terms in -8c + 42c - 35c. -c Collect the terms in 1 + 15s - 1 - 1 - 1. 15s - 2 Collect the terms in 17b2 - 4b*2 + 69b - 12b2 - 69b. b*2 Collect the terms in -189k - 169k + 361k. 3k Collect the terms in -15r*2 + 37r*2 - 13r*2 - 12r*2. -3r*2 Collect the terms in -3z*2 + 3277z - 22z2 - 1637z - 1640z. -25z*2 Collect the terms in -3c*2 + 25023151c - 25023151c. -3c*2 Collect the terms in 30d*3 - 56 + 56. 30d*3 Collect the terms in 49n - 6n + 9n - 4n. 48n Collect the terms in -1227z - 7 + 10 + 1226z - 3. -z Collect the terms in 453s + 0 + 0 + 1. 453s + 1 Collect the terms in 9a2 + 188 - 188. 9a*2 Collect the terms in 62 - 62 - 721w. -721w Collect the terms in -26m*3 + 9m*3 + 19m*3. 2m*3 Collect the terms in -8h + h + 17h - 6h. 4h Collect the terms in 41s2 - s2 - 13s2 - 26s2. s2 Collect the terms in -4f - 23 + 2f - 3f + 4f. -f - 23 Collect the terms in -249 - 256 + 505 - 2g. -2g Collect the terms in 5 + 29q - 57q + 35q + 7. 7q + 12 Collect the terms in -2b + 0b + 13b + 6b. 17b Collect the terms in 232a*3 - 114a*3 - 113a*3. 5a*3 Collect the terms in -35d*3 + 145d*3 - 39d*3 - 34d*3 - 40d*3. -3d*3 Collect the terms in 100q + 2 - 2. 100q Collect the terms in -36x*3 + 161x*2 - 161x*2. -36x*3 Collect the terms in -233 + o + 115 + 118. o Collect the terms in 306d*2 + 120d*2 + 158d*2. 584d*2 Collect the terms in 90s*2 - 30s*2 - 50s*2. 10s*2 Collect the terms in -20647 + 20647 - 4y*3. -4y*3 Collect the terms in -3k*2 + 0k*2 + 1133k + k*2. -2k*2 + 1133k Collect the terms in -262 + 262 + 16y - 9y. 7y Collect the terms in -20q + 11q + 10q. q Collect the terms in 14w - 14w - 2w2 + w2. -w2 Collect the terms in 658078 - 658078 - 2s. -2s Collect the terms in 3o + 54 + 5 - 59. 3o Collect the terms in 31i + 21i - 23i. 29i Collect the terms in -2h*2 - 7h*2 - 2h*2 + 3h*2. -8h*2 Collect the terms in 2h*2 - 10h2 + h2. -7h2 Collect the terms in -23p + 112p - 31p - 26p - 27p. 5p Collect the terms in 14z*3 - 21z*3 - 10z*3. -17z*3 Collect the terms in 4z*3 + 0z*3 + 2z*3 + 6z*3. 12z*3 Collect the terms in -111b*2 + 9b*2 + 0b + b. -102b2 + b Collect the terms in 24z - 24z - 40z*3. -40z*3 Collect the terms in -48q*2 + 12q + 46q2 + 14q. -2q2 + 26q Collect the terms in -1517c - 3c*3 + 3040c - 1523c. -3c*3 Collect the terms in 288o*2 - 589o*2 + 287o*2. -14o*2 Collect the terms in -5l*2 + 6l2 - l2 - l3. -l3 Collect the terms in -2j - 2j - 2j. -6j Collect the terms in -4040 + 4040 - w3. -w3 Collect the terms in p*2 - 14p*2 + 3p*2. -10p*2 Collect the terms in -4k - k*3 + 0k + 6k3 - 3k. 5k3 - 7k Collect the terms in 14w - 73w*3 + 9w*3 - 14w. -64w3 Collect the terms in 13y*2 - 3y*3 + 4y2 + y3 + 9y2. -2y*3 + 26y*2 Collect the terms in -2y*2 + 0y*2 + 12y*2 + 0y*2 - 2y*2. 8y*2 Collect the terms in -11 + 5c - 9 + 20. 5c Collect the terms in 93y + 18 - 18. 93y Collect the terms in -24g*3 - 11g*3 + 38g*3. 3g*3 Collect the terms in 4l2 + l2 - l*2 + 3l - 3l2. l2 + 3l Collect the terms in -3s - 22s + 19s - 16s. -22s Collect the terms in 269 - 733l*2 - 269 + 738l*2. 5l*2 Collect the terms in -2f*3 - 23f - 32f + 82f - 27f. -2f*3 Collect the terms in 13f*2 + 0f*2 - 23f*2 - 2f*2. -12f*2 Collect the terms in 2a*3 - 4a*3 - 3a3 + a3. -4a3 Collect the terms in -33v*3 - 38v*3 + 69v*3. -2v3 Collect the terms in -r3 - 99614 + 99614 - 4r3. -5r*3 Collect the terms in 6r + 19r + 3r + 45 - 2r. 26r + 45 Collect the terms in -l + 3l3 + l + 5l*3. 8l*3 Collect the terms in 427l - 427l - 3l*2. -3l*2 Collect the terms in -4 + 4 + 0 + 2t*3. 2t*3 Collect the terms in -376296r + 376296r - 4r*2. -4r*2 Collect the terms in -104 + 104 + 67i. 67i Collect the terms in -185a*2 - 246a*2 - 627a*2 - 336a*2. -1394a*2 Collect the terms in 18o + 16o - 52o + 20o. 2o Collect the terms in -6 + t3 - 2 + 16. t3 + 8 Collect the terms in 16v - 6v + 12v + 6v - 9v. 19v Collect the terms in -45z2 + 2 - 105z*2 - 2. -150z*2 Collect the terms in -23d*2 - 3d + 3d + 11d*2. -12d*2 Collect the terms in -1674m*2 - 3m + 3m + 1677m*2. 3m*2 Collect the terms in -3v*3 - 7v*3 - 2v*3. -12v*3 Collect the terms in -1029 + 29q*2 - 30q2 + 1029. -q2 Collect the terms in 11c3 - 72 + 72. 11c*3 Collect the terms in 7 - 404u - 7 + 401u. -3u Collect the terms in -346p2 + 696p*2 - 344p*2. 6p*2 Collect the terms in 4z + 276z + 0 + 0. 280z Collect the terms in -2j2 - 2j*2 + 8j*2 - 5j2. -j2 Collect the terms in 38g3 - 19g*3 - 29g3 + g2 - 27g3. -37g3 + g2 Collect the terms in 139z - 292z + 157z. 4z Collect the terms in -90n + 1 - 6n*2 - 93n + 183n. -6n*2 + 1 Collect the terms in 322 + 23j*2 - 322. 23j*2 Collect the terms in -6o - 19o - 23o + 45o. -3o Collect the terms in -2f3 - 1370 + 1370. -2f*3 Collect the terms in 975u*3 - 1949u*3 + 975u3. u3 Collect the terms in -2y3 + y3 - 11 - 2y*3 + 11. -3y*3 Collect the terms in 10c*2 + 32c*2 - 50c*2 + 10c*2. 2c*2 Collect the terms in -24z*3 - 4 + 0 + 4. -24z*3 Collect the terms in -27m + m + 27m. m Collect the terms in 128 - 14s*2 - 128. -14s*2 Collect the terms in -251k + 502k - 249k. 2k Collect the terms in 29l - 18l - 12l. -l Collect the terms in 25u3 + 3u2 - u2 + 0u2 - 42. 25u*3 + 2u*2 - 42 Collect the terms in 44r + 52r3 + 44r - 89r - 3r*3. 49r*3 - r Collect the terms in -28u*3 + 195u*2 - 195u*2. -28u*3 Collect the terms in 64m*2 - 7m*2 - 58m2. -m2 Collect the terms in -2t2 - 409 + 2t*2 + 3t*2. 3t*2 - 409 Collect the terms in 2r*3 - 14994727 + 14994727. 2r*3 Collect the terms in 101f*3 - 216f*3 + 104f*3. -11f*3 Collect the terms in -4a - 7a - 3a + 6a. -8a Collect the terms in -9w3 - 12w*3 - 10w*3 + 5w*3. -26w*3 Collect the terms in -64s + 180 - 180 + 59s. -5s Collect the terms in 7m2 + 22151m - 22151m. 7m*2 Collect the terms in -173l + 26l - 80l. -227l Collect the terms in 1082a + 493a - 521a. 1054a Collect the terms in 60d - 22d - 31d. 7d Collect the terms in 4p*3 - 11p + 9p3 - 33p + 44p. 13p*3 Collect the terms in 3122574w - 3w3 - 3122574w + 2w3. -w3 Collect the terms in 129f*2 + 5f - 5f - 130f2. -f2 Collect the terms in 27n - 21n + 0 + 0 + 0. 6n Collect the terms in 103o - 51o - 56o. -4o Collect the terms in -4r*2 + 18 + 5r*2 + 3r*2 + 0r*2. 4r*2 + 18 Collect the terms in -4v - 7v - 16v. -27v Collect the terms in 5 + 1 + 6 + 5g*2. 5g*2 + 12 Collect the terms in 9u*3 - 56u*2 + 56u*2 - 4u*3. 5	{ "pile_set_name": "DM Mathematics" }
he remainder when 5754389 is divided by 34? 25 What is the remainder when 155169 is divided by 164? 25 Calculate the remainder when 161597 is divided by 39163. 4945 What is the remainder when 15474214 is divided by 97? 95 Calculate the remainder when 28583801 is divided by 23. 22 What is the remainder when 11381 is divided by 2137? 696 Calculate the remainder when 1611872385 is divided by 852. 849 What is the remainder when 685330 is divided by 4284? 4174 What is the remainder when 75774071 is divided by 775? 771 What is the remainder when 106260303 is divided by 17? 1 What is the remainder when 25906845 is divided by 33689? 4 What is the remainder when 33806418 is divided by 153? 150 Calculate the remainder when 8320771 is divided by 223. 195 What is the remainder when 210975 is divided by 210384? 591 What is the remainder when 2108548 is divided by 231? 211 What is the remainder when 5003832 is divided by 48580? 92 Calculate the remainder when 187389 is divided by 93679. 31 What is the remainder when 2377505 is divided by 763? 760 Calculate the remainder when 23030 is divided by 1125. 530 What is the remainder when 781823 is divided by 31? 3 What is the remainder when 348218 is divided by 612? 602 Calculate the remainder when 147864 is divided by 49265. 69 What is the remainder when 23367963 is divided by 2248? 3 What is the remainder when 1787789 is divided by 2856? 2789 What is the remainder when 369947 is divided by 195? 32 Calculate the remainder when 2273246 is divided by 234. 170 Calculate the remainder when 476168 is divided by 7104. 200 Calculate the remainder when 4574859 is divided by 1842. 1173 What is the remainder when 696624 is divided by 696310? 314 Calculate the remainder when 3223722 is divided by 54. 30 Calculate the remainder when 3849018 is divided by 620. 58 Calculate the remainder when 1628198 is divided by 54273. 8 What is the remainder when 414747 is divided by 59077? 1208 What is the remainder when 7340004 is divided by 2446655? 39 Calculate the remainder when 50142 is divided by 1437. 1284 What is the remainder when 191230 is divided by 27241? 543 What is the remainder when 28810894 is divided by 19? 16 What is the remainder when 975337 is divided by 357? 13 Calculate the remainder when 3518704 is divided by 154. 112 Calculate the remainder when 17932961 is divided by 8966473. 15 What is the remainder when 25613089 is divided by 290? 289 Calculate the remainder when 306793 is divided by 980. 53 Calculate the remainder when 8668763 is divided by 1938. 89 What is the remainder when 55695156 is divided by 10823? 10821 Calculate the remainder when 125449 is divided by 4369. 3117 Calculate the remainder when 386129 is divided by 17547. 95 What is the remainder when 99626602 is divided by 231? 229 What is the remainder when 52541 is divided by 2544? 1661 Calculate the remainder when 621041 is divided by 310508. 25 Calculate the remainder when 1537590 is divided by 2651. 10 Calculate the remainder when 468336 is divided by 5859. 5475 Calculate the remainder when 1725535845 is divided by 148. 145 What is the remainder when 12412902 is divided by 144336? 6 What is the remainder when 1360015 is divided by 68? 15 Calculate the remainder when 23020958 is divided by 852627. 29 What is the remainder when 35425 is divided by 2103? 1777 Calculate the remainder when 2402565 is divided by 1512. 1509 What is the remainder when 1359676 is divided by 240? 76 Calculate the remainder when 256291 is divided by 127916. 459 What is the remainder when 201332 is divided by 50317? 64 Calculate the remainder when 14501262 is divided by 43. 28 What is the remainder when 63198 is divided by 103? 59 What is the remainder when 18476638 is divided by 32? 30 Calculate the remainder when 305872 is divided by 352. 336 Calculate the remainder when 804245 is divided by 102. 77 What is the remainder when 498475 is divided by 99613? 410 Calculate the remainder when 54792567 is divided by 1152. 1143 What is the remainder when 1148478 is divided by 9043? 17 Calculate the remainder when 188488867 is divided by 2574. 2569 Calculate the remainder when 7618507 is divided by 19046. 107 Calculate the remainder when 47239931 is divided by 23619897. 137 What is the remainder when 31096094 is divided by 66? 62 What is the remainder when 178645234 is divided by 2382? 2380 What is the remainder when 67503207 is divided by 22501069? 0 What is the remainder when 2803208 is divided by 300? 8 What is the remainder when 8422321 is divided by 4615? 4561 What is the remainder when 317386 is divided by 298? 16 Calculate the remainder when 94687 is divided by 5895. 367 Calculate the remainder when 1257991 is divided by 3847. 22 What is the remainder when 46417 is divided by 23184? 49 Calculate the remainder when 153143 is divided by 2876. 715 Calculate the remainder when 204650 is divided by 11. 6 Calculate the remainder when 2810080 is divided by 74. 4 Calculate the remainder when 1047193 is divided by 1241. 1030 Calculate the remainder when 305637 is divided by 8260. 17 Calculate the remainder when 365238 is divided by 1323. 90 Calculate the remainder when 47110 is divided by 5037. 1777 Calculate the remainder when 74376 is divided by 8182. 738 What is the remainder when 1219446 is divided by 17175? 21 What is the remainder when 5759211 is divided by 54849? 66 Calculate the remainder when 1500418 is divided by 478. 454 Calculate the remainder when 1025785 is divided by 228. 13 What is the remainder when 46199796 is divided by 25? 21 What is the remainder when 27006 is divided by 1081? 1062 What is the remainder when 57771459 is divided by 58? 37 Calculate the remainder when 3952344 is divided by 719. 1 Calculate the remainder when 635487 is divided by 1696. 1183 What is the remainder when 165616 is divided by 82332? 952 Calculate the remainder when 18689307 is divided by 480. 27 What is the remainder when 418708 is divided by 810? 748 What is the remainder when 4189377 is divided by 3001? 2982 Calculate the remainder when 2910012 is divided by 2089. 35 Calculate the remainder when 60363 is divided by 2149. 191 Calculate the remainder when 129439 is divided by 2132. 1519 What is the remainder when 636411 is divided by 30? 21 What is the remainder when 28983338 is divided by 63? 62 Calculate the remainder when 2192182 is divided by 4474. 4396 Calculate the remainder when 1493589 is divided by 4092. 9 Calculate the remainder when 35474811 is divided by 236. 235 Calculate the remainder when 1386476908 is divided by 2583. 2581 Calculate the remainder when 8091753 is divided by 773. 762 What is the remainder when 830052 is divided by 158? 78 What is the remainder when 27456 is divided by 13204? 1048 Calculate the remainder when 27798 is divided by 128. 22 Calculate the remainder when 263880 is divided by 65604. 1464 Calculate the remainder when 2212176 is divided by 54. 12 Calculate the remainder when 22180426 is divided by 62130. 16 What is the remainder when 1183658 is divided by 244? 14 Calculate the remainder when 4771778 is divided by 22298. 6 What is the remainder when 14715293 is divided by 314? 311 What is the remainder when 11635762 is divided by 23? 16 Calculate the remainder when 123712 is divided by 39926. 3934 Calculate the remainder when 873491 is divided by 44. 3 Calculate the remainder when 71381 is divided by 1530. 1001 What is the remainder when 4004266 is divided by 667377? 4 What is the remainder when 4188371 is divided by 3388? 803 Calculate the remainder when 472235 is divided by 94438. 45 What is the remainder when 75820606 is divided by 37910273? 60 Calculate the remainder when 97929 is divided by 3373. 112 What is the remainder when 31533 is divided by 14138? 3257 What is the remainder when 268362 is divided by 44719? 48 What is the remainder when 67605772 is divided by 204? 172 What is the remainder when 7460246 is divided by 147? 143 Calculate the remainder when 845079 is divided by 211105. 659 Calculate the remainder when 30421891 is divided by 1872. 19 What is the remainder when 28795228 is divided by 1235? 1203 Calculate the remainder when 231552 is divided by 946. 728 What is the remainder when 484037 is divided by 21858? 3161 Calculate the remain	{ "pile_set_name": "DM Mathematics" }
the greatest common factor of 128936 and 284. 284 Calculate the greatest common divisor of 17 and 13. 1 Calculate the highest common divisor of 65 and 10. 5 Calculate the highest common divisor of 711 and 9. 9 Calculate the highest common factor of 252 and 567. 63 Calculate the highest common factor of 13 and 5. 1 What is the highest common factor of 38 and 152? 38 What is the highest common factor of 610 and 30? 10 What is the greatest common divisor of 10148 and 172? 172 Calculate the greatest common factor of 128 and 3456. 128 Calculate the greatest common factor of 224 and 16. 16 Calculate the highest common factor of 69 and 322. 23 Calculate the highest common divisor of 459 and 27. 27 What is the greatest common factor of 1309 and 99? 11 Calculate the greatest common divisor of 7 and 350. 7 What is the highest common divisor of 10 and 65? 5 What is the greatest common factor of 34512 and 48? 48 Calculate the greatest common factor of 874 and 230. 46 Calculate the highest common factor of 225 and 3150. 225 Calculate the highest common factor of 53 and 9. 1 What is the greatest common factor of 88 and 88? 88 What is the highest common factor of 54 and 30? 6 Calculate the greatest common factor of 20 and 3785. 5 Calculate the greatest common divisor of 33 and 77. 11 Calculate the highest common divisor of 43 and 731. 43 What is the highest common divisor of 34433 and 7? 7 Calculate the greatest common divisor of 104 and 5902. 26 Calculate the greatest common factor of 3816 and 1008. 72 Calculate the highest common factor of 35 and 55. 5 What is the greatest common divisor of 1852 and 32? 4 Calculate the greatest common divisor of 4 and 5. 1 What is the highest common divisor of 39 and 871? 13 Calculate the highest common factor of 7 and 1869. 7 What is the greatest common divisor of 124 and 1426? 62 What is the highest common factor of 750 and 162? 6 Calculate the highest common factor of 9193 and 58. 29 Calculate the highest common factor of 1110 and 165. 15 Calculate the highest common divisor of 354 and 1357. 59 Calculate the highest common divisor of 3 and 1707. 3 Calculate the highest common divisor of 198 and 297. 99 What is the highest common divisor of 2865 and 75? 15 What is the greatest common divisor of 996 and 12? 12 What is the highest common factor of 2636 and 4? 4 What is the highest common factor of 507 and 117? 39 What is the greatest common divisor of 3398 and 2? 2 Calculate the greatest common divisor of 128 and 4. 4 Calculate the greatest common factor of 61 and 2257. 61 What is the highest common factor of 658 and 14? 14 What is the greatest common divisor of 63 and 567? 63 Calculate the highest common factor of 1752 and 552. 24 What is the greatest common factor of 25414 and 524? 262 What is the greatest common divisor of 1313 and 1212? 101 Calculate the highest common factor of 242 and 308. 22 What is the highest common factor of 3 and 27? 3 Calculate the highest common divisor of 136 and 34. 34 What is the greatest common factor of 1620 and 1485? 135 What is the highest common divisor of 22 and 1122? 22 Calculate the greatest common divisor of 152 and 38. 38 What is the highest common divisor of 10 and 545? 5 Calculate the highest common divisor of 282 and 141. 141 Calculate the highest common divisor of 93 and 3. 3 What is the greatest common factor of 328 and 16? 8 What is the highest common divisor of 7112 and 112? 56 Calculate the greatest common divisor of 33 and 1837. 11 Calculate the highest common divisor of 1926 and 18. 18 Calculate the greatest common factor of 24 and 6824. 8 Calculate the greatest common factor of 546 and 21. 21 What is the greatest common factor of 120 and 768? 24 What is the greatest common factor of 39 and 384? 3 What is the greatest common divisor of 444 and 12? 12 What is the highest common divisor of 133 and 19? 19 Calculate the greatest common factor of 4672 and 64. 64 Calculate the highest common factor of 315 and 333. 9 What is the greatest common divisor of 151 and 2? 1 Calculate the highest common divisor of 72 and 828. 36 Calculate the highest common factor of 9668 and 4. 4 What is the highest common divisor of 12 and 9? 3 Calculate the greatest common divisor of 57 and 6. 3 What is the greatest common divisor of 72 and 9702? 18 What is the greatest common divisor of 48 and 64? 16 What is the highest common factor of 291 and 194? 97 Calculate the greatest common factor of 292 and 12. 4 Calculate the highest common factor of 448 and 7. 7 What is the highest common factor of 126 and 36? 18 Calculate the highest common factor of 11736 and 9. 9 Calculate the highest common divisor of 3 and 237. 3 What is the highest common factor of 414 and 1044? 18 What is the highest common factor of 5 and 5455? 5 What is the highest common divisor of 1256 and 2041? 157 Calculate the greatest common divisor of 850 and 400. 50 What is the greatest common divisor of 1400 and 1075? 25 Calculate the highest common factor of 12 and 1866. 6 What is the highest common divisor of 16 and 752? 16 Calculate the greatest common divisor of 8 and 128. 8 What is the greatest common factor of 6 and 3084? 6 Calculate the greatest common factor of 16 and 28. 4 What is the greatest common factor of 97 and 8051? 97 Calculate the highest common factor of 390 and 180. 30 What is the highest common divisor of 1166 and 22? 22 What is the highest common divisor of 11067 and 51? 51 Calculate the greatest common factor of 30 and 405. 15 Calculate the greatest common divisor of 31 and 1519. 31 Calculate the highest common divisor of 117 and 729. 9 Calculate the greatest common divisor of 40 and 8. 8 Calculate the greatest common divisor of 1176 and 24. 24 Calculate the highest common factor of 47306 and 124. 62 What is the greatest common factor of 1 and 44? 1 What is the greatest common factor of 403 and 372? 31 What is the greatest common divisor of 9306 and 198? 198 Calculate the highest common divisor of 141 and 4371. 141 Calculate the highest common factor of 525 and 42. 21 Calculate the greatest common divisor of 1230 and 510. 30 What is the greatest common divisor of 320 and 10? 10 What is the greatest common factor of 648 and 48? 24 Calculate the greatest common divisor of 24 and 84. 12 Calculate the greatest common divisor of 45 and 18. 9 What is the highest common divisor of 23 and 368? 23 What is the highest common factor of 130 and 52? 26 What is the greatest common divisor of 80 and 550? 10 Calculate the greatest common factor of 12 and 5836. 4 What is the greatest common divisor of 10 and 2? 2 Calculate the highest common factor of 3 and 111. 3 What is the greatest common divisor of 1032 and 24? 24 What is the highest common divisor of 40 and 810? 10 Calculate the greatest common factor of 75 and 800. 25 What is the highest common divisor of 2236 and 156? 52 Calculate the greatest common divisor of 180 and 3900. 60 What is the greatest common divisor of 1725 and 150? 75 What is the highest common divisor of 180 and 50? 10 Calculate the highest common factor of 160 and 1460. 20 What is the highest common factor of 198 and 726? 66 What is the highest common factor of 475 and 665? 95 What is the highest common factor of 4071 and 118? 59 Calculate the greatest common divisor of 10 and 1285. 5 What is the greatest common factor of 36 and 702? 18 Calculate the highest common divisor of 130 and 10. 10 Calculate the greatest common divisor of 196 and 245. 49 Calculate the greatest common factor of 147 and 392. 49 What is the greatest common divisor of 37 and 333? 37 Calculate the greatest common divisor of 61 and 1647. 61 Calculate the greatest common factor of 1690 and 40. 10 What is the greatest common divisor of 4316 and 572? 52 Calculate the highest common factor of 406 and 174. 58 Calculate the greatest common factor of 12362 and 14. 14 Calculate the greatest common factor of 452 and 4. 4 What is the greatest common factor of 286 and 121? 11 Calculate the highest common factor of 18 and 42. 6 What is the highest common factor of 1925 and 28? 7 What is the greatest common factor of 126 and 70? 14 Calculate the highest common divisor of 15 and 615. 15 Calculate the highest common factor of 36 and 1152. 36 Wha	{ "pile_set_name": "DM Mathematics" }
-42) assuming k is positive. k(-1407/40) Simplify g(3/5)/g*(-2/3)(g1)(-4/21) assuming g is positive. g(113/105) Simplify (a(-1))*(-14)/(((aa0)/a)/a)19 assuming a is positive. a33 Simplify d(1/2)/(d/d*(2/7))((dd4d)/d)/(d/d(-7)) assuming d is positive. d(-45/14) Simplify j(-12)/(((j(-20)j)/j)/j) assuming j is positive. j9 Simplify ((p/(p(-1)/p))(-4/9))28 assuming p is positive. p(-112/3) Simplify (m(-1)mmm(-3/5))(-1/4) assuming m is positive. m(-1/10) Simplify r/r0rrr10r/((r/(rr(2/15)r))/rr)r(r/r(-3))/r assuming r is positive. r(287/15) Simplify n(-1/6)/n(3/25) assuming n is positive. n(-43/150) Simplify ((l(ll0)/ll)/ll)/((l0l)/l)l(-2/3)((ll(-2/5)l)/l)/l assuming l is positive. l(14/15) Simplify (n(6/5)nn/n*(-17)n)(-5/7) assuming n is positive. n(-106/7) Simplify ((ll/l(-1/5)l)22)(21/4) assuming l is positive. l*(1848/5) Simplify ll*(8/5)llllll10/ll assuming l is positive. l*(88/5) Simplify qqqq*(-5)q/(((qqq*(4/11)q)/qqq)/q)q0q/(qq/q(-3)) assuming q is positive. q(-92/11) Simplify ((a/(a/a(-2/17)))/a(-8))15 assuming a is positive. a(2010/17) Simplify (y(6/7)/y(6/7))/(y(yy/(y1y)y)/yy)(5/2) assuming y is positive. y(-5) Simplify a*(-4)a*(7/4)a/((aa(-8/3)/a)/a)aa(-8)/a assuming a is positive. a(-67/12) Simplify (z(1/3))(-43)z*(-4)/(z/(zzz(-2/11)z)) assuming z is positive. z(-545/33) Simplify y(-25)/y(-30) assuming y is positive. y5 Simplify ((mm/m(-4))/mmm(-6))47 assuming m is positive. 1 Simplify (a13/a)(-45) assuming a is positive. a(-540) Simplify (r(-1))(-2/65)(rr/(r(2/3)r))(-19) assuming r is positive. r(-1229/195) Simplify (u/(uu(-3/8)/u))/(u/((uu5)/u)) assuming u is positive. u(43/8) Simplify u*7u(-11/3) assuming u is positive. u(10/3) Simplify (i(-1))(-2)/(i(4/3)/(i(-4/5)/i)) assuming i is positive. i(-17/15) Simplify t(-4)t5(t0)28 assuming t is positive. t Simplify ((m4)22)(-26/3) assuming m is positive. m(-2288/3) Simplify z*28zz14 assuming z is positive. z43 Simplify (t(1/2)/t)/(t9t) assuming t is positive. t(-21/2) Simplify (i(1/4)i(-2))/(i(4/7)/(i(8/5)/iii)) assuming i is positive. i(39/140) Simplify n(-4)(n/(nn4)n)/n(n(1/2))(6/13) assuming n is positive. n(-101/13) Simplify (g(2/3)/g6)/(gg/g0)(-33) assuming g is positive. g*(182/3) Simplify (zz/(z(2/7)/z))(-14)(zz0)(-18/7) assuming z is positive. z(-284/7) Simplify ((m(2/7))31)(-6/23) assuming m is positive. m(-372/161) Simplify (m(-2/7))(-28) assuming m is positive. m8 Simplify ((i/(iii*(-7)i))/i(-5))/(i(-7)/i7) assuming i is positive. i24 Simplify (k/(k*(2/3)k))/(k(-1/29)/k) assuming k is positive. k(32/87) Simplify pp20p(4/3) assuming p is positive. p(67/3) Simplify a(a(1/7)a)/aa/a(2/43) assuming a is positive. a(631/301) Simplify (k(-1)/k)(-39) assuming k is positive. k78 Simplify (w0)(-47)/((ww*(-3))/ww1) assuming w is positive. w2 Simplify j/(j*2/j)jjj*(-2/5)j(j/j(-5/6))/(j(-3)j) assuming j is positive. j(193/30) Simplify u(1/19)uuu(3/4)u assuming u is positive. u*(289/76) Simplify (xxx(1/5)/xx)(4/11) assuming x is positive. x(4/5) Simplify ((j/(j/((j*(-5/3)jjj)/j)))/j)/jj/(jj/j*(2/3)j)(j/j(-3/8))/((j((j/j*(1/8))/j)/jj)/jj) assuming j is positive. j(-5/2) Simplify f(3/4)ff/(f(-3/11)/f) assuming f is positive. f(177/44) Simplify (nn*(-4)n(-3/4))/(n5nnnn(-2/17)) assuming n is positive. n(-791/68) Simplify (mm(-2/9))(-1)m*0m(1/14) assuming m is positive. m(-89/126) Simplify ((k/k2)/k(-5))/((kkk*(-3)k)/((k/(k/(k/k*3k)))/k)) assuming k is positive. k2 Simplify (s39/s)(-23) assuming s is positive. s(-874) Simplify (r/r0)(-6/5)/(rrr*0/rr)(13/2) assuming r is positive. r(-71/5) Simplify (q*1q)/q*8((qq(-3/2)qq)/q)/qq/(q*(-2)q) assuming q is positive. q(-9/2) Simplify (z/((z/(z(-16/3)/z))/zz))/(z/((zz*(13/4)zz)/z)) assuming z is positive. z(-25/12) Simplify ((m(-1/6)m)/m)/mm/((m5m)/m)mmm(m(mm(-5))/m)/(((m(-5/6)mm)/m)/m) assuming m is positive. m(-16/3) Simplify (b(-1/3))*(-49)(b/b(-2/7))(2/59) assuming b is positive. b(20291/1239) Simplify (x(-1/9))(1/19) assuming x is positive. x(-1/171) Simplify ((q/(qq(-3/2)))/(q(q(1/7)/q)/q))/((q/q0)/q)(1/5) assuming q is positive. q(33/14) Simplify (kkk/k*(-9)k)/kk(1/3)kk10kk(-3) assuming k is positive. k(64/3) Simplify (z/(zz(z/(z/(zz*(3/7)z)))/z))/(z(3/17)/z) assuming z is positive. z(-191/119) Simplify ((yy(-3)/yy)/y10)/((y/(y(2/3)/y))/((yy/(y/(y(1/14)/y))y)/y)) assuming y is positive. y(-557/42) Simplify u(-16)u/u(-8/9) assuming u is positive. u(-127/9) Simplify (w1)39/(w(-5)(ww/(w(-1/8)/w)w)/w) assuming w is positive. w(327/8) Simplify (d/(d(-15)/dd))/dd5 assuming d is positive. d20 Simplify (hh/h1)(-1/2)/(hhh(-2)h((h10/h)/h)/hh) assuming h is positive. h(-19/2) Simplify r(-2)rr/(r/(r/(rr/(r/(rrr(-9/2)r)r))r))(r/(r0r))8 assuming r is positive. r(5/2) Simplify (r*(3/2)/rr(4/7)/r)(1/55) assuming r is positive. r*(1/770) Simplify ((wwww/(www/(ww/(www2/w)w))w)/w)3/((wwww*5/w)/wwww*(1/20)w) assuming w is positive. w(-121/20) Simplify (j(-1)j)(2/11)/((j(-1/3)j)/((j/(j*(-3)jj))/jj)) assuming j is positive. j*(4/3) Simplify (iii29i)(6/7) assuming i is positive. i(192/7) Simplify (yy(y/(yy(3/8)))/yy)/y(-24) assuming y is positive. y(205/8) Simplify (f*(-13/5)ff)/fff/f(-2/7) assuming f is positive. f(24/35) Simplify t47t(-17) assuming t is positive. t30 Simplify (w/(w/(w/w*(7/2)))www/(ww8))/(ww*(1/11)w(-1/2)) assuming w is positive. w(-100/11) Simplify yyy*(-15)/yy(3/4) assuming y is positive. y(-53/4) Simplify (p1)(-44)(p/(pp/p*1)p)41 assuming p is positive. p(-3) Simplify (y/y(-14))/y25 assuming y is positive. y(-10) Simplify (u/(u/u(-6)))44 assuming u is positive. u(-264) Simplify w*(-2/7)ww(-3) assuming w is positive. w(-16/7) Simplify ((a/(a/(a4a)))/(aaa*(-1)a))(-20) assuming a is positive. a(-60) Simplify (v/v*(5/2)v(-3))23 assuming v is positive. v(-207/2) Simplify ((((t(-1/6)/t)/t)/t)/tt(-4)/t)/((tt4)/t(3/10)) assuming t is positive. t*(-208/15) Simplify (cc/(c/c(14/5)))(-1/35) assuming c is positive. c*(-19/175) Simplify ((xxx7)/xx)31 assuming x is positive. x279 Simplify ((y(yy*5)/yyy)/yyy/y(3/10))/((y5/yy)/(y/y(-1/2))) assuming y is positive. y(26/5) Simplify (f/f(-6))(-16) assuming f is positive. f*(-112) Simplify (ccc15c)/c11 assuming c is positive. c7 Simplify ((t*(-1/2)/tt)/ttt)(5/3) assuming t is positive. t(5/6) Simplify ((d1)(-3/2))48 assuming d is positive. d(-72) Simplify rr/r(-2/11)rrr15 assuming r is positive. r(211/11) Simplify (bbb*10b(2/11))(6/31) assuming b is positive. b*(804/341) Simplify bb*(-2/9)bbb*(-4/11)(b1)(-10/9) assuming b is positive. b(43/33) Simplify t(4/13)/((t(-10)/t)/t) assuming t is positive. t(160/13) Simplify (d*(-1/4)d*(-6))/(((ddd(-2/3))/d)/ddddd)(-1/57) assuming d is positive. d(-4235/684) Simplify ((d/(dd(-10)))/d(-6))/((ddd*(2/3)d)/d(-9)) assuming d is positive. d(10/3) Simplify (d*(-13/6)/d)/(d/((dd*(15/7)dd)/d)) assuming d is positive. d(-1/42) Simplify ((dd/(dd/(d/(d/(dd*(-17)d))d)))/d)/ddd/(dd35) assuming d is positive. d(-50) Simplify (pp(8/9)(((p/p6)/p)/p)/p)20 assuming p is positive. p*(-1100/9) Simplify ((vv/(v(-1/6)/v))/v)/((v/(v/v8)v)/v)v*(-1/4)v/v*(-2/7)v assuming v is positive. v*(-319/84) Simplify (dd((d(d/((ddd*(3/26)dd)/dd))/d)/d)/ddd)/dd(-2/35)/d assuming d is positive. d(-2887/910) Simplify (v19v)(-2) assuming v is positive. v(-40) Simplify (((b**(2/7	{ "pile_set_name": "DM Mathematics" }
- 13w - 11. Calculate the remainder when i(s) is divided by 9. 7 Suppose -f = 5f - f. Suppose fh = -5h + 4p + 309, 0 = 4h - 3p - 248. What is the remainder when h is divided by 4/14 + 117/7? 14 Let s = 407 - 254. What is the remainder when s is divided by 110? 43 Suppose n + 114 = 4n. Let l(r) = -r*3 + 13r*2 - 121r + 1586. Calculate the remainder when n is divided by l(13). 12 Suppose 6z - 21z + 10170 = 0. Let w = z - 651. Calculate the remainder when 348 is divided by w. 24 Suppose -i + 907 = 2m, 4m = 3i + 95 + 1744. Calculate the remainder when m is divided by 85. 31 Suppose 4 = u - 2p - 0, -5p = -5u + 40. Suppose 1840 = uv + 580. Calculate the remainder when v is divided by 31. 12 Suppose 0 = 5z - 7z + 26. Let o(f) = -f2 + 56 + 0f2 - 33 - f2 + 32f. Calculate the remainder when o(16) is divided by z. 10 Let p(d) = -d3 - 6d*2 + d + 57. Calculate the remainder when p(-9) is divided by 1. 0 Suppose -16k = -14k. Let i be 1 - -39 - (k - -4). Suppose 3h = 90 + i. Calculate the remainder when 81 is divided by h. 39 Let i = -34426 - -34661. Calculate the remainder when i is divided by 97. 41 Let v = -385 - -387. Calculate the remainder when (9/(-2 + 11))/(v/178) is divided by 48. 41 Let w(b) = -b*2 - 32b + 145. Let y = -1058 + 1067. Calculate the remainder when w(-35) is divided by y. 4 Let k = -121 - -121. Suppose 3u = -4g + 85 + 37, -g + u + 34 = k. Calculate the remainder when g is divided by 20. 12 Suppose -868 = -7j + 2058. Let r = j + -385. What is the remainder when 94 is divided by r? 28 Let s = 25 + -23. Suppose -30 = -2h - h - 4l, -sh + l = -20. What is the remainder when 26 is divided by h? 6 Suppose -58b = -16b - 25b - 136. Suppose 0 = 4u - 33 - 43. Calculate the remainder when u is divided by b. 3 Let z be 74324/(-442) - (-4)/26. Calculate the remainder when (-4)/(-14) - 11464/z3 is divided by 9. 7 Let d = -16 - -22. Suppose 3y - 50 = o, 5y = -do + 4o + 98. Suppose 6 = 3u, -j - u + 4 = -y. What is the remainder when j is divided by 10? 0 What is the remainder when ((1 - 2) + 3)(-3 - (-511)/14) is divided by 47? 20 Let i(b) = -24b*3 - 2b*2 - 2b - 2. Let m be i(-1). Let k = m - 104. Let h = -74 - k. Calculate the remainder when 33 is divided by h. 1 What is the remainder when (3398/2)/(-30 - -31) is divided by 4? 3 Suppose 7472 = 16q + 2200 - 2904. What is the remainder when q is divided by 132? 115 Suppose 2z = -1185d + 1182d + 1158, -z + 593 = 5d. Calculate the remainder when z is divided by 53. 43 Let m(l) = -l + 14. Let g be (-1 - -3)/((-3)/18). Calculate the remainder when 70 is divided by m(g). 18 Calculate the remainder when 34 - (-169 - -28) is divided by 26. 23 Let s(a) = 12 - 1733a + 5192a - 1728a - 1736a. Suppose 2m + 8 = -b, b = 4b + 5m + 22. What is the remainder when 62 is divided by s(b)? 30 Suppose -3t + 4 = p, -4t + p + 5 = -5. Suppose -tx + 191 = 47. Suppose 2b - x = 32. Calculate the remainder when b is divided by 18. 16 Let x(v) = -13v + 1. Let f(n) = -2n + 44. What is the remainder when x(-9) is divided by f(7)? 28 Let j = -4 - 2. Let a be (-9)/j24/9. Suppose -z - 1 = 0, s - 3z + 72 = as. Calculate the remainder when 43 is divided by s. 18 Suppose -30n + 531 = -58n + 8091. Calculate the remainder when 286 is divided by n. 16 Let a = -17322 - -17614. Calculate the remainder when a is divided by 28. 12 Let m = 12 + -3. Calculate the remainder when (-106)/((-15)/(-105)-14) is divided by m. 8 Suppose -88q + 2232 + 165 = -1827. What is the remainder when 189 is divided by q? 45 What is the remainder when 29 is divided by (-20)/((-600)/(-42)) + 156/15? 2 Suppose 2k + 24 = 36. Let u(o) = -7o + 10. Let x be u(7). What is the remainder when 42 is divided by (5 - x)(-2 - (-15)/k)? 20 Let h(z) = -z3 + 66z*2 - 125z - 159. Calculate the remainder when 121 is divided by h(64). 22 Let n = 684 - 682. What is the remainder when n/(18/(-621))-3 is divided by 5? 2 Let i(s) = -s3 + 33s*2 - 112s + 6. What is the remainder when 8722/35 + 2/(-10) is divided by i(29)? 5 Suppose 172 = 2z + 2d, 887z - 884z - 5d - 250 = 0. Calculate the remainder when 2801 is divided by z. 81 Suppose -458 = -3t + 5p, -3p - 2p = -t + 136. Calculate the remainder when 312 is divided by t. 151 Let i = 82 + -57. Suppose -j + 2z = -44, z = j - 4z - 41. What is the remainder when 4 - (-6 - -10 - j) is divided by i? 21 Let g be 1(-1)/(-7) + 23820/(-140). Calculate the remainder when g/(-5 + 3 - 0) is divided by 29. 27 Let s(t) = -4t + 1 - 9t + 11t + t2. Suppose 1 = 3a - 14. Calculate the remainder when s(-2) is divided by a. 4 Let f(q) = 138q + 6496. What is the remainder when f(-37) is divided by 20? 10 Suppose -q = 2s - 43, s + 13q = 8q + 26. What is the remainder when 487 is divided by s? 4 Let g(l) = 40l3 - 39l*2 + 7l - 7. Let i be g(4). Let j = -1798 + i. Calculate the remainder when j is divided by 4/(-10) + (-404)/(-10). 39 Let z(q) = q*3 + 9q*2 + 9q + 11. Let i = -43 + 35. Let w be z(i). Let v(c) = 2c3 - 3c*2 - 2c - 4. Calculate the remainder when v(w) is divided by 10. 7 Let y(q) = -3q + 82. Let l(x) = -3x + 81. Let r(c) = -2l(c) + 3y(c). Calculate the remainder when 64 is divided by r(15). 25 Suppose 0 = -5p + 32 - 12, 24 = -5f - 4p. Let u(g) be the second derivative of -g3/3 + 33g*2/2 + 11g. What is the remainder when u(f) is divided by 5? 4 Let o(x) = 2x2 + 21x - 11. Let q be o(-11). Suppose 2n + 2t = -qn + 102, -5t = n - 67. Let c = n - 35. Calculate the remainder when 58 is divided by c. 10 Suppose 6g = 11g + 35. Let c(n) = 4n2 + 7n + 3. Calculate the remainder when c(g) is divided by 78. 72 Let k = 188 + -457. Let r = -101 - k. Calculate the remainder when r is divided by 35. 28 Let u = -45 - -235. Suppose -30k + 133 = -23k. Suppose -k - u = -d. What is the remainder when d is divided by 14? 13 Suppose 2v = v + 4. Let s be v - (-2 + 2) - 25. Let x = 61 + s. What is the remainder when x is divided by 7? 5 Let y = 131 - 99. What is the remainder when 796 is divided by y? 28 Let x = -2096 + 2152. Calculate the remainder when 231 is divided by x. 7 Suppose -11p = -14p + 4n + 1294, 2178 = 5p + 4n. What is the remainder when p is divided by 117? 83 Let r = 921 - -98. Calculate the remainder when r is divided by 63. 11 Suppose 99z + 1170 = 108z. Suppose 15 = -27x + 312. What is the remainder when z is divided by x? 9 Let k = -671 - -209. Let q = k - -517. Calculate the remainder when 62 is divided by q. 7 Let q(w) = -w3 + 19w*2 - 15w - 60. Let a be q(18). Let n(y) = -y3 + y2 + 3y + 3. What is the remainder when n(-2) is divided by 1 + 0 - (4 + -3 + a)? 3 Suppose 0 = 11q - 39q + 112. Suppose -o = -qw - 44, -8o + 9o - 5w = 43. Calculate the remainder when 958 is divided by o. 46 Suppose 4j - 8a - 29 = 35, 4a = -5j + 10. Suppose 3l - l = 72. What is the remainder when l is divided by j? 0 Let a(x) = -x - 3. Let q be a(-3). Suppose -5u + 6 = h + 2h, q = -3u - 3h + 6. Suppose 0 = -d - u + 1. What is the remainder when 3 is divided by d? 0 Suppose 193y + 48y - 985 - 220 = 0. Calculate the remainder when 2591 is divided by y. 1 Suppose 9924 - 4932 = 8j. What is the remainder when 1254 is divided by j? 6 Let i(k) = -k2 + 12k + 18. Calculate the remainder when 10059 is divided by i(0). 15 Suppose 0 = -u + j, 3u + 3j - 5j = -2. What is the remainder when 255 is divided by (u83)/((-2)/(-8)-8)? 6 Suppose 0 = -0y + 5y - 50. Let v be -2(-5)/y - -2. Suppose -va - 40 = -5a. What is the remainder when 137 is divided by a? 17 Let m(v) = -4 - 16 - 2 - 6v + v. Let u be (-232)/32 - 6 - (-1)/4. What is the remainder when m(u) is divided by 16? 11 Calculate the remainder when 1643 is divided by (190/(-152))/(20/(-976)). 57 Let n = -152 - -382. Suppose d - 42 - 12 = m, -3m + n = 5d. Calculate the remainder when d is divided by 10. 9 Suppose 50 = 5h + 10. Let o be (6/(-8))/((-3)/h). Let g = 21 + o. Calculate the remainder when 67 is divided by g. 21 Calculate the remainder when 300 is divided by 28/(-2) - (-135 - -26). 15 Suppose 0 = -4*h - 121 + 21. Let t = -18 - h. What is the remainder when (((-96)/(-40))/4)/((-9)/(-510)) is divided by t? 6 Let s be (4 - -11	{ "pile_set_name": "DM Mathematics" }
4693 What is the seventh root of 566912 to the nearest integer? 7 What is 18980219 to the power of 1/2, to the nearest integer? 4357 What is 3315138 to the power of 1/3, to the nearest integer? 149 What is the square root of 26420667 to the nearest integer? 5140 What is the third root of 305683 to the nearest integer? 67 What is the seventh root of 1024593 to the nearest integer? 7 What is the square root of 834722 to the nearest integer? 914 What is the cube root of 36501033 to the nearest integer? 332 What is 312572 to the power of 1/2, to the nearest integer? 559 What is the tenth root of 5588947 to the nearest integer? 5 What is the fifth root of 2188768 to the nearest integer? 19 What is 5743877 to the power of 1/2, to the nearest integer? 2397 What is the third root of 182582 to the nearest integer? 57 What is the square root of 1041823 to the nearest integer? 1021 What is the sixth root of 3180009 to the nearest integer? 12 What is 13808020 to the power of 1/5, to the nearest integer? 27 What is 2876618 to the power of 1/2, to the nearest integer? 1696 What is 372066 to the power of 1/6, to the nearest integer? 8 What is the cube root of 699027 to the nearest integer? 89 What is the third root of 1729774 to the nearest integer? 120 What is 13713297 to the power of 1/2, to the nearest integer? 3703 What is 177863 to the power of 1/2, to the nearest integer? 422 What is 11253894 to the power of 1/7, to the nearest integer? 10 What is 664632 to the power of 1/2, to the nearest integer? 815 What is the seventh root of 1620884 to the nearest integer? 8 What is the third root of 303768 to the nearest integer? 67 What is the fourth root of 1626409 to the nearest integer? 36 What is the tenth root of 17351092 to the nearest integer? 5 What is the third root of 1146712 to the nearest integer? 105 What is the eighth root of 393364 to the nearest integer? 5 What is 1337858 to the power of 1/3, to the nearest integer? 110 What is 30229465 to the power of 1/3, to the nearest integer? 312 What is 39404905 to the power of 1/3, to the nearest integer? 340 What is 204700 to the power of 1/2, to the nearest integer? 452 What is the third root of 5300337 to the nearest integer? 174 What is the cube root of 28071399 to the nearest integer? 304 What is the fourth root of 29344 to the nearest integer? 13 What is the cube root of 2573059 to the nearest integer? 137 What is the square root of 3416119 to the nearest integer? 1848 What is 473420 to the power of 1/2, to the nearest integer? 688 What is the fourth root of 733658 to the nearest integer? 29 What is the square root of 323463 to the nearest integer? 569 What is the ninth root of 109178 to the nearest integer? 4 What is the square root of 1753452 to the nearest integer? 1324 What is the square root of 524286 to the nearest integer? 724 What is 596692 to the power of 1/5, to the nearest integer? 14 What is 14311016 to the power of 1/8, to the nearest integer? 8 What is 8608837 to the power of 1/2, to the nearest integer? 2934 What is the cube root of 467275 to the nearest integer? 78 What is 3054265 to the power of 1/3, to the nearest integer? 145 What is the square root of 4482873 to the nearest integer? 2117 What is 1405 to the power of 1/3, to the nearest integer? 11 What is 74853 to the power of 1/2, to the nearest integer? 274 What is the fourth root of 3248495 to the nearest integer? 42 What is 151641 to the power of 1/2, to the nearest integer? 389 What is the square root of 282767 to the nearest integer? 532 What is 312408 to the power of 1/2, to the nearest integer? 559 What is the eighth root of 892754 to the nearest integer? 6 What is 4985332 to the power of 1/2, to the nearest integer? 2233 What is the ninth root of 154940 to the nearest integer? 4 What is 551042 to the power of 1/2, to the nearest integer? 742 What is 154848 to the power of 1/8, to the nearest integer? 4 What is the cube root of 3337638 to the nearest integer? 149 What is the third root of 432989 to the nearest integer? 76 What is 159885 to the power of 1/2, to the nearest integer? 400 What is 25758529 to the power of 1/2, to the nearest integer? 5075 What is 330646 to the power of 1/2, to the nearest integer? 575 What is the tenth root of 669165 to the nearest integer? 4 What is the third root of 3526611 to the nearest integer? 152 What is 5781812 to the power of 1/2, to the nearest integer? 2405 What is 301639 to the power of 1/3, to the nearest integer? 67 What is the sixth root of 7109754 to the nearest integer? 14 What is the square root of 17816197 to the nearest integer? 4221 What is 10525529 to the power of 1/3, to the nearest integer? 219 What is the square root of 16638747 to the nearest integer? 4079 What is the cube root of 17028101 to the nearest integer? 257 What is 7085536 to the power of 1/2, to the nearest integer? 2662 What is the square root of 304738 to the nearest integer? 552 What is the cube root of 393109 to the nearest integer? 73 What is 372768 to the power of 1/2, to the nearest integer? 611 What is 204132 to the power of 1/3, to the nearest integer? 59 What is the fourth root of 714801 to the nearest integer? 29 What is the cube root of 4790214 to the nearest integer? 169 What is the square root of 6328385 to the nearest integer? 2516 What is the square root of 151487 to the nearest integer? 389 What is the cube root of 1415897 to the nearest integer? 112 What is 1023997 to the power of 1/2, to the nearest integer? 1012 What is the square root of 9553033 to the nearest integer? 3091 What is the square root of 1283986 to the nearest integer? 1133 What is 892792 to the power of 1/10, to the nearest integer? 4 What is the sixth root of 252476 to the nearest integer? 8 What is the third root of 197692 to the nearest integer? 58 What is the cube root of 513273 to the nearest integer? 80 What is the eighth root of 662437 to the nearest integer? 5 What is the third root of 466425 to the nearest integer? 78 What is 219084 to the power of 1/7, to the nearest integer? 6 What is 98633 to the power of 1/2, to the nearest integer? 314 What is 3226660 to the power of 1/7, to the nearest integer? 9 What is the third root of 1464146 to the nearest integer? 114 What is 19231659 to the power of 1/2, to the nearest integer? 4385 What is the third root of 136799 to the nearest integer? 52 What is the third root of 15968095 to the nearest integer? 252 What is the third root of 2532269 to the nearest integer? 136 What is 15621511 to the power of 1/7, to the nearest integer? 11 What is 7302042 to the power of 1/2, to the nearest integer? 2702 What is the square root of 6261078 to the nearest integer? 2502 What is 621764 to the power of 1/2, to the nearest integer? 789 What is 718647 to the power of 1/3, to the nearest integer? 90 What is the square root of 5181728 to the nearest integer? 2276 What is 137896 to the power of 1/5, to the nearest integer? 11 What is 7489107 to the power of 1/10, to the nearest integer? 5 What is 266526 to the power of 1/6, to the nearest integer? 8 What is the fifth root of 1334477 to the nearest integer? 17 What is 4319830 to the power of 1/3, to the nearest integer? 163 What is the square root of 910210 to the nearest integer? 954 What is the third root of 15998759 to the nearest integer? 252 What is 13041905 to the power of 1/2, to the nearest integer? 3611 What is 365705 to the power of 1/3, to the nearest integer? 72 What is 15886503 to the power of 1/7, to the nearest integer? 11 What is 5986721 to the power of 1/3, to the nearest integer? 182 What is the third root of 853690 to the nearest integer? 95 What is 8192660 to the power of 1/5, to the nearest integer? 24 What is 16790708 to the power of 1/6, to the nearest integer? 16 What is the third root of 1588932 to the nearest integer? 117 What is the seventh root of 370117 to the nearest integer? 6 What is the cube root of 272333 to the nearest integer? 65 What is 1961940 to the power of 1/2, to the nearest integer? 1401 What is the ninth root of 345069 to the nearest integer? 4 What is the third root of 850727 to the nearest integer? 95 What is 8195447 to the power of 1/8, to the nearest integer? 7 What is 1369756 to the power	{ "pile_set_name": "DM Mathematics" }
7)/((6/(-3))/90). 60 What is the value of 19/((-304)/1480)(-11)/((-385)/(-14))? 37 Calculate -34((-4)/6)/(136/(-1122)11/2). -34 Calculate ((-4)/(-10))/(((-3)/27)/((-2565)/(-4617))). -2 What is ((-64)/672)/((-3658)/(-2478))? -2/31 Calculate (26/26)/(723/(-5635)15/24). -56 What is the value of (-49)/(-7)114/(-10)(-890)/(-3738)? -19 What is 22272/4435840((-10)/3)/(-1)18/(-36)? -2/239 What is the value of 4(-54)/360(-40)/(-224)? -3/28 (-35)/(-525)1550/(-93) -10/9 What is ((-350)/(-315)-13/(-5))/((-102)/(-3978))? 26 What is the value of (-8)/2(-19572)/9786? 8 Evaluate 23/((-115)/(-2))((-2925)/140)/(-39). 3/14 (2(-6)/32)/((-150627)/(-17464)) -1/23 Calculate 8/(-6)((-192465)/(-182))/235. -6 Evaluate (-235)/((-80370)/(-228))((-195)/(-4))/(-5). 13/2 What is ((-4)/(-14))/((-725)/(-6300)-9)? -8/29 ((-2650)/9275(-2)/(48/(-14)))/((-2)/1356) 113 What is the value of (118/354)/(15/(1215/(-72)))? -3/8 What is the value of (-165/13)/(-15)(-3)/(-71)? 1/71 What is (-525)/(-1600)1680/63? 35/4 What is ((-58149)/42)/(-71)(-28)/((-21)/3)? 78 Calculate 9484/(-2371)47/(-4). 47 (4/666)/((-4185)/(-37665)) 2/37 What is ((-10)/45)/(48/(-182736)18)? 47 Calculate (-17)/(136/16)-881/16. 81 Evaluate (-12)/24(((-3216)/(-7))/12)/((-6)/21). 67 What is the value of (-508)/8763(6/18)/((-10)/15)? 2/69 What is (-432)/2376(-3234)/56? 21/2 ((-29)/116)/(7/((-98)/21)1/246) 41 Calculate 5644/8774/6579. 83 What is the value of ((-20)/(-135))/(((-228)/(-133)(-21)/6)/3)? -2/27 Calculate 8/(-60)-5353/(-5295). -2/45 -5(108/10)/(-3)17234/3693 84 Calculate ((-14)/(-11))/(87/13398-14). -14 Evaluate 6/26((-138)/(-22908)166)/(51). 3/65 (22/(-880)5)/((90/48)/(81/6)) -9/10 5216/(-256)(-6)/4686 1/4 What is ((-2)/(-3))/(1372/(-588))(-7)/15? 2/15 (48/(-280)75/10)/(12/(-1344)12) 12 What is the value of (-560)/(-240)13/((-455)/2)? -2/15 What is ((-127)/254)/((-1)/(-18))-2(-3)/6? -9 Calculate (2/5)/(22/(-2200)2). -20 What is ((-14)/(-4)15/35)/(279741/440804)? 26/11 What is the value of (((880/(-528))/(50/(-12)))/(-4))/((-6)/70)? 7/6 Calculate (-76)/(-38)((-6642)/18)/9. -82 What is 23/3(-3)/((-57)/304(-44)/33)? -92 Calculate (198/84)/(858/(-1001)). -11/4 Evaluate ((-5616)/(-36)4/60)/(54/15). 26/9 Evaluate ((-294)/(152292/29785))/(2/(-4)). 115 996/1992(-20)/18 -5/9 44(7/4)/(10/(-20)7) -22 What is the value of ((-30)/(-70)27/6)/(-4(-30)/(-140))? -9/4 Evaluate (-294)/2((99/(-9))/22)/(33/(-22)). -49 Evaluate 56/(-16)126/984. -18 Evaluate (25/25-1)/(33/(-531)). 59 What is the value of (-5)/((204/(-4896))/(3/2(-6)/(-20)))? 54 Evaluate 7/(5(-10)/(-15)(-36)/360). -21 Calculate 28/(-6)(-6896)/(-18102)45/(-10). 8 Calculate (119/((-6545)/132))/((-28)/(-100)). -60/7 Calculate 53/((-1219)/(-92))(-2988)/144. -83 ((-63)/63)/((3/(-21))/1) 7 What is 78/(-572)(-10021)/25508? 3/56 What is ((-63)/81(-54)/(-126))/((-11)/18)? 6/11 (((-180)/(-4))/3)/(849/392) 15 ((((-396)/(-77))/6)/(16/28))/((-927)/5768) -28/3 What is (7308/54)/(-29)-318/9? 28 (-27)/187028/35(-6)/(-18) -28 What is the value of 4503/12(-15928)/(-75658)? 79 Evaluate 18/(-3)71/142(-6)/21. 6/7 Calculate (180/4248(24/(-25))/3)/((-2)/5). 2/59 Calculate ((-40)/4)/(2985/(-16716)). 56 Calculate (-14)/124(-28)/((-1624)/(-261)). 21 Evaluate (25/(-20))/((21/(-98))/(((-3024)/245)/(-12))). 6 ((-55)/4)/((-385)/(-3220)-23) 5 ((-1)/1)/((-109)/(12426/5985)) 2/105 Calculate ((-30)/(-112))/((-18)/(-144)). 15/7 Evaluate (53/(9540/80))/(((-9)/(-4))/9). 16/9 What is ((-22)/(-297))/((28375/(-900))/(-227))? 8/15 (((-22)/176)/(3/204))/1 -17/2 What is (87/145)/((720/(-50))/8)? -1/3 What is ((-240)/(-270))/((-222)/(-18(-9)/36))? -2/111 (105/(-70))/(33/((-11880)/20)) 27 What is the value of 57/((-4446)/(-7124))(-30)/(-55)33/12? 137 What is the value of 278762/1824624(-3)/22? -1/48 10/(-5)(-10)/(-1200)-10 1/6 (15(-2)/2)/(-107(-111)/(-11877)) 15 What is the value of (12/(-110))/((-42)/4(-83)/(-5810))? 8/11 What is 2040/(-192)(-42)/51? 35/4 What is ((((-9)/3)/15)/((-106)/(-2385)))/(7/42)? -27 What is ((-120)/(-150)50/15)/(4/2)? 4/3 What is the value of 164/4106/(-20)50/36? -1/6 Calculate ((18/(-224))/((-3)/4))/((-368)/1288). -3/8 Evaluate ((-62)/(-11))/((-44)/242). -31 (3/4)/((15/(-1440))/(108/(-81))) 96 What is (140/224)/((-520)/156)? -3/16 What is the value of ((364/(-231))/(-13))/(((-1)/8)/(119/952))? -4/33 (1263/(-1684))/((-910)/(-416)) -12/35 Evaluate (-28(-116)/6496)/((-1)/811). -4/11 Calculate 118/177-248(-3)/(-6)-1. 64 Calculate (((-3234)/220)/(-49))/((-1008)/1960). -7/12 Calculate -6252/247/105-53. 63 Evaluate ((-493)/170)/((-8)/(-80)). -29 Evaluate -13(28/(-9))/(-14)(-45)/(30/(-6)). -26 Calculate 2(-429)/(-2541)7. 26/11 Calculate (-660)/(-7040)112/(-126). -1/12 (10/5)/8140184/473340 2/147 What is the value of 1/(-93)(-140)/((-4900)/105)? -1/31 -68(3950/200)/79 -17 What is the value of (60/(-21))/((-145)/1705214)2? 48 (-312)/3232/18114(-42)/(-1596) -52 Evaluate ((-20)/(-12))/(((-50)/20)/((-804)/(-8))). -67 What is the value of (603/(-6030))/(2/(-10))? 1/2 What is the value of (-19)/(88578/370)144/30? -8/21 Evaluate ((-6057)/(-222090))/((-21)/4). -2/385 Evaluate (185/(-37))/(10/8432/972). -9 Calculate (1(-2)/18)/((-1)/(-4))(-9603)/32010. 2/15 (-433/(-48))/(306/2448) 22 Calculate ((-3)/(-50))/(599364/(-416225)). -1/24 Evaluate ((-803)/73)/((-1)/(-4))(-75)/100. 33 Calculate (((-2)/(-5))/(77/154))/((-6)/(-90)). 12 What is (50/15)/(((-660)/(-36))/(-5))? -10/11 Calculate ((-288)/120)/((-18)/(-40))(-57)/(-38). -8 What is 3/(-2)((-158)/(-948))/(-203/(-144))? -3/5 25/15(-125)/(18750/120) -4/3 Calculate 224/140(-27)/(-54). 4/5 What is the value of -113(-13356)/99666(-14)/(-4)? 53 Evaluate (28/12)/(59/(-708)). -28 4900/6375408/1040 40 What is the value of (-13)/66310914/963? -2/9 23/(-460)((6/1)/(-3))/((-136)/204) -3/20 What is the value of (2/(-10))/((8/(-7))/(7180/(-882)))? -1/4 (-66186)/1268565(-7)/((-21)/(-10)) 4/23 Calculate ((-144)/(-180))/((-6)/(-15))(-104)/(-11752). 2/113 Evaluate (22/561)/((4/1122)/12). 1/17 Calculate 9/(-15)((-403)/(-806))/(2/32). -24/5 (-527)/(-155)44/((-6160)/(-300)) 51/7 What is ((-40)/(-12)(-828)/230)/(-34)? 6/17 What is the value of ((-87)/1015)/(-6(-26)/(-20))? 1/91 Calculate (-4)/(((-5)/148)/((-7010)/11216)). -74 What is (-252)/294(-119)/(-5)5? -102 What is the value of (-248)/((-45)/(1440/256))? 31 Calculate (-116)/(-4698)3(-3)/2. -1/9 Calculate ((2392/(-1014))/(48/(-156)))/(1/(-6)-14). 23/7 Calculate 2/(-23)(21736/104)/(-1254). 1/69 ((-1)/(20/(-16))1)/(31/4650075) 16 What is ((-128)/12(-156)/624)/((-8)/288)? -96 What is ((-2)/(-20))/(108/(-13230)-49)172? 43 What is (1/10(-42)/7)/(1155/(-231))? 3/25 What is ((-1330)/703)/35(-26381)/124? 23/2 Calculate (-21/(63/42))/(9/(2673/(-6))). 66 Evaluate ((-98)/(-8))/((-142)/((-51120)/(-315))). -14 Evaluate (-351)/182(-1120)/60. 36 What is the value of (4080/350)/1721/3? 24/5 Evaluate (-3)/(16/39(-318)/(-212)). -13 Evaluate ((-18)/16(-3180)/(-73935))/((-1)/2). 3/31 Calculate ((-16)/6)/(17/102)27/1764-49. 12 What is (3/(-5))/(336/420)32/(-1)? 24 (-923)/(-426)(-20)/6527/2 -9 What is the value of (-1)/((-9)/4)3/(((-6864)/220)/26)? -10/9 What is the value of (34/((-5712)/462)36)/((-2)/2)? 99 What is the value of (-1440)/1920(-11)/((-308)/16)? -3/7 What is the value of 1/(-15)(-8715)/1162204? 102 (10/4)/(2/5(-520)/2828834) -10 What is ((-12)/3)/((3000/(-6000))/((-2)/16-10))? 10 Calculate 335(-33)/11(-59)/(-885). -67 What is the value of ((-20)/(-15))/(-4)(-5944)/2972? 2/3 Calculate (-3)/23514/753. -7 (36/(-20))/(16062/267700) -30 Evaluate (((-441)/336)/((-3)/(-12)))/((-6)/(-48)). -42 Evaluate ((-30)/8)/(945/(-540)). 15/7 What is ((-8253)/28296)/(70/270)? -9/8 (25/45)/((-4400)/(-17280)) 24/11 What is the value of 2/(-1)11/(-66)8/48-2? -1/9 (8/7050/(-20))/(1/((-12)/8)) 3/7 Calculate 12/((-59)/(2950/(-300)))((-10)/(-17))/(-1). -20/17 What is (3/(1/(-1)))/((-14)/((-13146)/313))? -9 What is the value of 1056/32140/70? 66 Calculate 9/((-61)/(67466/237)). -42 What is the value of (-21762)/3385221/1296? -1/96 What is the value of 714527/(-3038)? -17 What is the value of (85/(-646))/(216/(-1026))? 5/8 Evaluate 30(-56)/3920-1. 3/7 Evalua	{ "pile_set_name": "DM Mathematics" }
d to the nearest ten thousand? -80000 Let r be (-6)/9(-6918 + 3). What is r rounded to the nearest 1000? 5000 Let k = 446 + -187. Let g = k + -131. Let j = g + -127.9999947. Round j to 6 decimal places. 0.000005 Let a = -0.13 - 0.13. What is a rounded to 1 decimal place? -0.3 Suppose 0 = -o + 4, 2y + o + 569919 = -486077. Round y to the nearest 10000. -530000 Let t be -4 - -2 - (0 + 72998). Round t to the nearest ten thousand. -70000 Let s = 96.2 - 96.1601. Round s to 2 decimal places. 0.04 Let a = 0.26 - -0.3. Let j = 5.1 - 5. Let u = j - a. Round u to one dp. -0.5 Let j = 32.85 - 31. Let q = -1.12 + j. What is q rounded to one decimal place? 0.7 Let v(c) be the second derivative of 85c3 + c. Let j be 0 - (0 - -2)/(-1). Let k be v(j). Round k to the nearest one hundred. 1000 Let s = -16 + 16.006. What is s rounded to three decimal places? 0.006 Let u = -0.415091 - -1.395004. Let a = u + -0.98. What is a rounded to 5 decimal places? -0.00009 Let f = 312.999633 + -313. What is f rounded to 5 decimal places? -0.00037 Let c = 0.0136791 - -280112.9863209. Let w = 280114.89927 - c. Let s = w - 1.9. Round s to four decimal places. -0.0007 Suppose -3k + d = k + 199997, 4d = 5k + 249988. What is k rounded to the nearest one hundred thousand? -100000 Let c = -1451898273 + 1451898259.50000071. Let i = 13.5 + c. Round i to seven decimal places. 0.0000007 Let o = -8 - -12. Let d = o - 4.001. Round d to 3 decimal places. -0.001 Let b = 2.6 + -2.5986. Round b to three dps. 0.001 Let c(o) = 10o3 - 6o*2 + 2o + 3o + 51o*3. Let m be (-3)/2(-20)/6. Let b be c(m). Round b to the nearest one thousand. 8000 Let h = -7.728 + -92.231. Let d = 100 + h. What is d rounded to 2 decimal places? 0.04 Let w = -1481 + 1482.993. Let a = -2 + w. What is a rounded to 2 decimal places? -0.01 Let u = -28.186 - -29.18498. Let j = 0.9 + 0.1. Let f = j - u. What is f rounded to 4 decimal places? 0.001 Let z = 48 + -46.65. Let x = z - 1.261. What is x rounded to two dps? 0.09 Let b = -2.487 - -143.787. Let n = 149 - b. Round n to the nearest integer. 8 Let g = 0.1 + 7.9. Let q = -7 - g. Let b = -13.8 - q. Round b to 0 dps. 1 Suppose u + 2c = 760, 0 = -4u - c - 3c + 3028. Suppose f = 2f - u. Let g = -354 + f. What is g rounded to the nearest one thousand? 0 Suppose 10o = 11o + 10900. Round o to the nearest 1000. -11000 Let f = 1.03 - 0.13. Let u = f - -0.1. Let h = -1.000028 + u. Round h to 5 decimal places. -0.00003 Let s = 1081143.99949 + -1081139. Let m = 8 + -3. Let c = m - s. Round c to 4 dps. 0.0005 Let s = 0.17 + -0.169612. Round s to 5 dps. 0.00039 Let p = 5639845.90000028 - 5639846. Let h = -0.1 - p. What is h rounded to 7 dps? -0.0000003 Suppose -26 = -4o - 2. Let u be (14 - 2)4/o. Suppose 3m + u + 169 = 0. What is m rounded to the nearest 10? -60 Let s = 462 + -524.8. What is s rounded to the nearest 10? -60 Let t = -191190327.999963 + 191190242. Let f = t - -86. What is f rounded to 5 decimal places? 0.00004 Suppose -2h + 3215397 - 10855403 = -2b, -7640009 = -2b + 3h. Round b to the nearest 1000000. 4000000 Let i = -6483 + 3913. What is i rounded to the nearest 100? -2600 Let v = 0.54 + -0.54000096. Round v to seven decimal places. -0.000001 Let k = 21.7 - 21.70000428. What is k rounded to 6 decimal places? -0.000004 Let n = 14.0003 + -14. Round n to 4 decimal places. 0.0003 Let o = -14085720529.99999933 - -14085720466. Let l = o + 64. What is l rounded to 7 decimal places? 0.0000007 Let w = -0.099000181 - -0.099. Round w to seven decimal places. -0.0000002 Suppose 5r + 2p = 2r + 5012, 0 = -2p - 10. Suppose -23326 - r = 5x. Round x to the nearest 10000. -10000 Let q = 23.988 - -0.012. Let b = 24.00026 - q. What is b rounded to four dps? 0.0003 Let v = -15 + 21.7. What is v rounded to the nearest integer? 7 Suppose 4 = 3v - 11. Suppose -3f + 2f = -5r + 8099996, -2r + vf + 3239980 = 0. Round r to the nearest 100000. 1600000 Let y = 0.0170023 + -0.017. Round y to seven decimal places. 0.0000023 Let z = 132886389 - 132886310.94836392. Let o = z + -0.05230608. Let f = -78 + o. What is f rounded to four decimal places? -0.0007 Let y = -2426 + 6655. Suppose y = x + 23027. Let r be x/(-4) + 5/10. Round r to the nearest 1000. 5000 Let d = 1.1035 + -1.1. Round d to three decimal places. 0.004 Let g = -0.008 - 160.992. Let p = 161.0000129 + g. Round p to 6 decimal places. 0.000013 Suppose -4l = -3o + 36000012, 2o + 23662869 = -3l - 3337123. Round l to the nearest 1000000. -9000000 Suppose 3o - 35112 = 5676. Suppose 2x = -5r + 3r - o, 6804 = -x + 2r. Round x to the nearest one thousand. -7000 Let q = 0.4 - -10.6. Let s = 1.4 - q. Round s to the nearest integer. -10 Let r(y) = 14y3 - y2 - y - 1. Let t be r(-1). Let q = t + 21. Let x(k) = 367k - 2. Let f be x(q). What is f rounded to the nearest one thousand? 2000 Let l be -2499997 + 3/5(-15)/3. What is l rounded to the nearest 1000000? -3000000 Let m be ((-1)/3)/((-5)/15). Let p be 136/m + 2/1. What is p rounded to the nearest ten? 140 Let l = 17 + -17.025. What is l rounded to 2 decimal places? -0.03 Let f(o) = 8o + 1. Let q be f(-1). Let v = -13 - q. Let w be (-375002)/(-3) - v/(-9). Round w to the nearest ten thousand. 130000 Let l = -24.99838 - -25. What is l rounded to four dps? 0.0016 Suppose 11f - 1056 = -0f. Round f to the nearest 10. 100 Let t = 2.8 + -1.6. Let d = t + -1.20000056. What is d rounded to 7 dps? -0.0000006 Let y be (-1 - 2/(-4))-56388. Let n be (-5)/((-15)/y) - -2. What is n rounded to the nearest one thousand? 9000 Let o = -11.031109 - -0.056309. Let m = 10.17 + o. Let h = m + 0.8. Round h to 3 decimal places. -0.005 Let i = -2785 - -1837. Let s = i - -188. What is s rounded to the nearest 100? -800 Let q = 0.05 + -1.15. Let n = 1.15 + q. What is n rounded to 2 decimal places? 0.05 Let b be ((-135)/(-35) - 4) + (-80007)/21. What is b rounded to the nearest one thousand? -4000 Let c = 4149.3 + -4149.79978. Let n = 0.5 + c. Round n to four dps. 0.0002 Let v = 0.7 + 10.3. Let d = 10.99999906 - v. What is d rounded to 7 dps? -0.0000009 Let x = -32189262 - -32189259.0000002. Let r = 0.07 - -2.93. Let f = x + r. What is f rounded to 7 dps? 0.0000002 Let p(t) = 4t + 279007. Let o = 2 - 4. Let w(k) = -k - 93002. Let n(x) = op(x) - 7w(x). Let d be n(0). Round d to the nearest ten thousand. 90000 Let c = -0.25 - -0.196. Let v = c + 0.033. Let w = -5.179 + v. Round w to zero decimal places. -5 Let x = -0.6 + 0.33. Round x to one dp. -0.3 Suppose -3w + q = -2610, -3231 - 249 = -4w + 2q. Round w to the nearest 1000. 1000 Let c be 2/4-31-2. Let j = 25 + c. Round j to the nearest 10. 60 Let m = -944 + 647. What is m rounded to the nearest ten? -300 Let w = -1.7 - -12.9. What is w rounded to the nearest integer? 11 Let v = -0.16 - 3.84. Let d = -4.0000001 - v. Round d to 6 dps. 0 Let k = -400 - -416.1. Let i = k + 76.9. Let l = 93.00049 - i. What is l rounded to four dps? 0.0005 Let n = 75 + -74.9586. Round n to 2 decimal places. 0.04 Suppose 0 = 8m - 5m - 12. Suppose 14 = -md - 562. Round d to the nearest ten. -140 Let u = -2.8 + 2.79999856. Round u to 7 decimal places. -0.0000014 Let j be (-1)/5 + 166000001/5. Round j to the nearest 1000000. 33000000 Let u = 32 + -21. Let h = -310137665.00000052 + 310137654. Let w = u + h. Round w to seven decimal places. -0.0000005 Let r = 0.7 - -39.3. Let d = 40.0046 - r. What is d rounded to three dps? 0.005 Let m = -0.7 - 8.1. Round m to zero decimal places. -9 Let h be (-1 - -1)3/9. Let l(i) = i*2 - 2i + 3. Let x be l(-4). Suppose h = 5v - 5b + x + 188, -4v - 182 = b. What is v rounded to the nearest ten? -50 Let s be 9333/364. Suppose 81 = -5f + s. What is f rounded to the nearest ten? 50 Let x = -275 - -274.99999629. Round x to seven dps. -0.0000037 Let r = -29077.2799985 + 29069.28. Let c = r - -8. What is c rounded to six decimal places? 0.000002 Let k = 16.83 + 0.17. Let p = -16.1 + k. Let q = p - 0.35. Round q to 1 dp. 0.6 Let r(l) = -2l + 10. Let i be r(3). Let v(j) = 85000j*2 + 2j - 8. Let z be v(i). Round z to the nearest 100000. 1400000 Suppose -576 + 1671 = 5i. What is i rounded to the nearest ten? 220 Let r be 230922 + (-4)/(-2). Suppose 3*g + r = -g. What is g rounded to the nearest	{ "pile_set_name": "DM Mathematics" }
2 Collect the terms in 2g + 38g*3 - 2g*2 - 7g - 3g - 6g. 38g3 - 2g*2 - 14g Collect the terms in -77u3 + 42u*3 + 0u*2 + 40u*3 + 0u*2. 5u*3 Collect the terms in -4 - 213z*2 + 73z*2 + 5z - 18. -140z2 + 5z - 22 Collect the terms in -30n2 + 14n*2 + 14n*2 + 7n*2 + 13n*2 - 15n*2. 3n*2 Collect the terms in -20998y*2 + 10466y*2 + 10534y*2. 2y*2 Collect the terms in 15s*2 - 25s*2 + 10s*2 + 32s*3 - 58s*3 + 25s3. -s3 Collect the terms in 220w3 + 486w*3 - 117w*3 + 426w*3. 1015w*3 Collect the terms in -3193327b*3 + 3193339b3 - b2 + b*2. 12b3 Collect the terms in -z2 + 10z2 + 4z*2. 13z*2 Collect the terms in -419f - 798f - 317f + 299f. -1235f Collect the terms in 117x - 117x + 2944x2. 2944x*2 Collect the terms in -3 + 1372x + 3 + 0. 1372x Collect the terms in 55 + 42v*3 - 48v*3 - 19 - 36. -6v*3 Collect the terms in 881x + 1018x + 842x - 4044x. -1303x Collect the terms in 160i - 48i + 0i2 + 2i*2. 2i*2 + 112i Collect the terms in -32492o + 64964o - 32472o - 633o*2 + 635o*2. 2o*2 Collect the terms in 276 - 9d*2 + 19d*2 - 4d*2 - 3d*2 - 256. 3d*2 + 20 Collect the terms in 329 + 25h - 160 - 169. 25h Collect the terms in -96d - 20d - 262d + 2 - 7d. -385d + 2 Collect the terms in -133199s + 66600s + 66600s. s Collect the terms in -18c + 10c + 12c + 4c - 9c. -c Collect the terms in -14113a2 + 28223a*2 - 14101a*2. 9a*2 Collect the terms in -529 + 93n + 110n - 318n + 529. -115n Collect the terms in -3 - 1 - 4519i*3 + 4504i*3 + 4. -15i*3 Collect the terms in 13v - 141 + 127 - 3v. 10v - 14 Collect the terms in -109j + 27 + 22 - 107j + 212j + 19 - 72. -4j - 4 Collect the terms in -3u - 10u*2 - 811 + 3u + 11u2 + 870. u2 + 59 Collect the terms in 14943o - 7476o - 7470o. -3o Collect the terms in 5s + 13s - 108s + 19s + 68s. -3s Collect the terms in -31406 - 682f + 31406. -682f Collect the terms in 457j*3 + 589j*3 - 354j*3 - 76j*3. 616j*3 Collect the terms in 88256q + 291645q - 48252q + 8341q. 339990q Collect the terms in -4799 + 4799 - 1115l2 + 561l*2 + 556l*2. 2l*2 Collect the terms in -4v*2 - 2v*2 - 594 + 19v + 4v2 - 20v. -2v2 - v - 594 Collect the terms in 65i - 23i + 6i - 23i. 25i Collect the terms in -12511 + 25015 - 25m - 12504. -25m Collect the terms in -d + 30d2 + 135d*2 + 39d*2 - 87d*2. 117d*2 - d Collect the terms in 7 - 7 - 9 + 115q. 115q - 9 Collect the terms in -2609p*2 + 2539p*2 + 5881p*2. 5811p*2 Collect the terms in -8 + 1 - 4646r*2 + 7. -4646r*2 Collect the terms in -82 + 8c*2 + 12 - 8 + 28. 8c*2 - 50 Collect the terms in -5b + 196b3 + 11b*2 - 92b*3 - 97b*3. 7b*3 + 11b*2 - 5b Collect the terms in 526a - 727 + 727 - 550a. -24a Collect the terms in 10 - 10 - 298k*2 - 22k. -298k2 - 22k Collect the terms in -576m - 252m + 218m. -610m Collect the terms in 3 - 759u2 - 1 - 2 + 760u2. u2 Collect the terms in 670y - 2331y - 748y - 436y. -2845y Collect the terms in -4p - 587 - 2p - 750 + 5p. -p - 1337 Collect the terms in 4980f + 4939f - 9917f. 2f Collect the terms in 4 - 2 - 7213o3 - 2o - 3477o3. -10690o*3 - 2o + 2 Collect the terms in 547351 - 36v2 + 41v*2 - 547351. 5v*2 Collect the terms in -2r + 2r + 64727r*2. 64727r*2 Collect the terms in -60b*3 - 269b*3 - 317b*3. -646b*3 Collect the terms in -46j + 45352030 + 53j - 45352030. 7j Collect the terms in -5823a2 - 5816a*2 + 17453a*2 - 5817a*2. -3a*2 Collect the terms in 2197 - 553 - 544 - 543 - 557 + 7v*2. 7v*2 Collect the terms in 1 + 9310899k*3 - 1 - 9310891k*3. 8k*3 Collect the terms in -13 + 13 + 108155l. 108155l Collect the terms in 11f*2 + 25781f - 12895f - 12886f. 11f2 Collect the terms in 50o*2 + 6 - 6 - o - 4o*2. 46o*2 - o Collect the terms in 2a*2 - 3458a*3 - 2a*2 + 787a*3. -2671a*3 Collect the terms in -21x*3 + 24x*3 + 23x*3 - 1. 26x*3 - 1 Collect the terms in 67h*2 - 7 + 7 - 171h*2 + 111h*2. 7h*2 Collect the terms in -1679r*2 + 844r*2 + 835r*2 + 305r*3. 305r*3 Collect the terms in 3p*2 + 3p2 + p2 + 397379 - 8p2 - 397379. -p2 Collect the terms in 51 - 323y - 214 + 52 + 56 + 54. -323y - 1 Collect the terms in 9714l + 9741l - 19297l. 158l Collect the terms in 1609 - 3225 + 1616 + 41t. 41t Collect the terms in -45o - 2497o - 3080o. -5622o Collect the terms in -203r - 225r + 183r - 288r. -533r Collect the terms in 1 + 244f3 - 1 - 908f*3. -664f*3 Collect the terms in 1381302s - 2762576s + 1381273s. -s Collect the terms in 22 - 3804u - 9 - 13. -3804u Collect the terms in -4 - 1 - 4 + 1 + 263m2. 263m*2 - 8 Collect the terms in 37a*2 - 105a*2 + 17a*2 + 0a + 0a + 16a*2. -35a*2 Collect the terms in -2 - 141 - 6u*2 + 74 + 69. -6u*2 Collect the terms in 86w + 86w + 78w - 429w + 90w + 88w. -w Collect the terms in -108a*2 + 223a*2 - 119a*2 - 85. -4a*2 - 85 Collect the terms in -422w*2 - 429w*2 - 435w*2 + 1707w*2 - 422w2. -w2 Collect the terms in 443a - 682a + 342a. 103a Collect the terms in -123 - 10w + 370 - 124 - 123. -10w Collect the terms in 1053 + 2a - a + 766. a + 1819 Collect the terms in 6w*3 + 0w - 4w + 5w + 43w3 - 35w*3. 14w*3 + w Collect the terms in -5f + 857f2 - 3f + 860f2. 1717f*2 - 8f Collect the terms in 9z3 - 3z*3 - 61z - 82z. 6z*3 - 143z Collect the terms in 5338j - 68j*3 + 64j*3 - 5338j. -4j3 Collect the terms in -3250a - 2584a3 + 1623a + 1627a. -2584a*3 Collect the terms in -196n - 629n + 43n + 24n - 201n. -959n Collect the terms in -15c*2 - 3c*2 + 15c*2. -3c*2 Collect the terms in 0h*3 - 7h*3 - 2h*3 - 15 + 15. -9h*3 Collect the terms in 0w + 96w2 + 107w*3 - w - 96w*2. 107w*3 - w Collect the terms in 335 - 689 + 3j + 349. 3j - 5 Collect the terms in -9576 + 9576 - 25x*3. -25x*3 Collect the terms in 1176g + 304g2 + 62g*2 - 1178g. 366g2 - 2g Collect the terms in 2k + 18k*3 - 6k + 2k3. 20k*3 - 4k Collect the terms in -276t + 127t + 169t. 20t Collect the terms in 52891 - 52891 + 115540y - 115544y. -4y Collect the terms in -36h*2 - 614h*2 - 1041h*2 - 245h*2. -1936h*2 Collect the terms in -2c*2 + 24087494 - 24087494. -2c*2 Collect the terms in -56b*2 - 18b*2 + 24b*2 - 40b*2 - 59b*2. -149b*2 Collect the terms in 0 - 4q*2 + 6q*2 + 14 + 4q + 9 + 4. 2q2 + 4q + 27 Collect the terms in 251560u + 253013u - 504574u. -u Collect the terms in -2 - 201r + 4 - 3 + 1. -201r Collect the terms in 9r*2 - 55 + 55 - 16r*2 - 40r*2. -47r*2 Collect the terms in 780o*3 + 791o*3 - 2367o*3 + 779o*3. -17o*3 Collect the terms in 2065o - 6210o + 2076o + 2077o. 8o Collect the terms in 1 - 1 + 7558m3 - 21961m*3. -14403m*3 Collect the terms in 6 + 22h*2 - 44 - 79. 22h*2 - 117 Collect the terms in -18 + 16 + 2 + 151b + 458b. 609b Collect the terms in 4b - 36 - 22b + 5b + 4b. -9b - 36 Collect the terms in 6u + 3u2 + 59 - 2u - 2u. 3u*2 + 2u + 59 Collect the terms in k - k - 174k2 + 48k*2 + 66k*2 + 47k*2. -13k*2 Collect the terms in 41 - 2v*3 + 14 + 3v3 - 9 + 14. v3 + 60 Collect the terms in -1168a3 + 499a*3 + 171a*3 + 501a*3. 3a*3 Collect the terms in 1338j - 2j2 + 164241 - 164241. -2j*2 + 1338j Collect the terms in 129 + 644b2 + 469b*2 - 129. 1113b*2 Collect the terms in 1298v - 3928v + 1316v + 5 + 1318v. 4v + 5 Collect the terms in -t + 2t - 236t*2 + 14747t*2. 14511t*2 + t Collect the terms in -14w + w*2 - 5w + 50w + 15w - 46w. w2 Collect the terms in 2 + 73 - 38 - 37 - 3g. -3g Collect the terms in -3 - 155q - 61q + 3 + 218q. 2q Collect the terms in 158 + 715v*3 - 158. 715v*3 Collect the terms in 1088u*3 + 717u*3 - 356u*3. 1449u*3 Collect the terms in -3831s*2 + 9 - 6 - 3. -3831s*2 Collect the terms in -15a*2 - 17a*2 - 9a*2 + 50a*2. 9a*2 Collect the terms in 121 - 1071k - 121 - 67k. -1138k Collect th	{ "pile_set_name": "DM Mathematics" }
10.523 (b) 4 (c) 3 c What is the closest to 1 in -2/7, 2/65, 9, 1, -16? 1 Which is the nearest to -0.04? (a) 0 (b) -0.02 (c) -0.1 (d) -42 (e) -15 b Which is the nearest to -6? (a) 0.01 (b) -0.1 (c) 2/21 (d) 4 (e) 3/4 b What is the nearest to 3 in -2/11, -0.0724, 1/2, 0.4? 1/2 What is the closest to 0.1 in 0.3, -5, -126/19, -23? 0.3 What is the closest to -3/5 in 0.1, 0.5, -2/5, 191? -2/5 What is the closest to 1 in 1/15, -2/3, -3/673? 1/15 What is the nearest to 1 in 0.2, -1489, -134? 0.2 What is the nearest to 2 in -10, -2, -3.3, 2/17, 27? 2/17 Which is the nearest to -2.7? (a) -60 (b) 5 (c) -0.2 c Which is the closest to 28? (a) 1/2 (b) 5/2 (c) -10/19 (d) -16 b What is the closest to -2 in 14, -0.1, 3/16? -0.1 Which is the nearest to -5? (a) 0.4 (b) 1 (c) -0.3 (d) -0.0349 c What is the nearest to 3/5 in 78, 1/4, 5, 2? 1/4 Which is the nearest to -64.8? (a) 0.2 (b) -3 (c) -1/527 b What is the nearest to -1 in 1/4, 4, 63? 1/4 What is the closest to -5/634 in 0.2, -0.2, 5, 0.4? -0.2 Which is the nearest to -0.4? (a) -1/5 (b) -5 (c) 4371 a Which is the closest to -4/5? (a) -1 (b) -68/5 (c) -3 (d) 0 a What is the closest to 2 in 4, -529, -16? 4 What is the nearest to 29 in 0.04, -5/3, -2/5? 0.04 What is the nearest to 6 in -25.37, -3/7, 1, 2/13, 0.4? 1 What is the closest to 6 in 1, 8.1, 49.5? 8.1 Which is the nearest to -0.2? (a) 5 (b) -3 (c) -2 (d) 139 c What is the closest to -0.2 in -5035, 0.4, -12? 0.4 Which is the closest to 0.01? (a) -0.8 (b) -303/5 (c) -5 a Which is the closest to -530? (a) 2 (b) -3 (c) 0.081 (d) -0.1 b What is the nearest to -3/7 in 0.5, -7, 3, -180? 0.5 Which is the nearest to -4? (a) -26/7 (b) -1/6 (c) 2/5 (d) 2 (e) 1/4 a What is the closest to -1 in -0.4, 2/3, -0.0506? -0.4 Which is the nearest to -1/4? (a) 102 (b) 4/5 (c) -15 b Which is the closest to 1? (a) -10/29 (b) -1/6 (c) -2.6 b Which is the nearest to 1? (a) -5 (b) 1/2 (c) -5/11 (d) -13/4 b What is the nearest to -1.21 in -5, 4, -0.3, 1/16? -0.3 What is the nearest to -3 in 2/9, -534.61, 4? 2/9 What is the nearest to -0.3 in -2, -0.4, 4, -16385? -0.4 Which is the nearest to -0.3? (a) 4/5 (b) -83/14 (c) -8 a Which is the nearest to -5? (a) 19 (b) 11/5 (c) -0.1 c What is the nearest to 1/372 in 6, 5, 0.5? 0.5 What is the closest to 2/47 in 0.2, -6/23, -4, 45? 0.2 Which is the closest to -0.2? (a) 9.6 (b) 19 (c) -0.3 c What is the closest to -3 in -0.4, 1, 1/3, 61.3? -0.4 Which is the nearest to -30? (a) -1 (b) -0.287 (c) 0.3 a Which is the nearest to 4/55? (a) -9 (b) -1/6 (c) 1/2 (d) -0.1 d Which is the nearest to -2/15? (a) -5 (b) -0.05 (c) -6/13 (d) -2/7 b Which is the closest to -25? (a) 214 (b) 0.2 (c) -0.08 c What is the closest to -6 in 2/13, -29, 0.26, -1/10? -1/10 What is the closest to 6 in 3, 0, -0.8, -0.67? 3 Which is the nearest to -2? (a) 0.01 (b) -4 (c) -1 (d) -43 c Which is the closest to 22? (a) -0.1 (b) 0.2 (c) 29 (d) 0 c What is the closest to 1/73 in 2/11, 3, 1/2, -1? 2/11 Which is the closest to 0? (a) -4 (b) -9 (c) -268/17 (d) -0.4 (e) 1/9 e Which is the nearest to -0.1? (a) 0.5 (b) -2 (c) 22 (d) -4 (e) -469 a What is the closest to 3/11 in -0.12, -0.3, -2/9, 1, -23? -0.12 Which is the nearest to -0.1? (a) -1/5 (b) -7/6 (c) -14/169 c Which is the closest to 2/3? (a) -11/3 (b) -75 (c) -7 (d) -3 (e) -2/7 e What is the nearest to -2 in 2/17, -1, 5/7, 4, -1/22? -1 What is the nearest to 2 in 0, -1, 2.06, -1/27? 2.06 What is the nearest to -0.5 in -1/94, 1/3, -23? -1/94 What is the closest to 2 in 1/7, 23, -5? 1/7 What is the closest to 0.2 in 1, 2/5, -444, 19? 2/5 Which is the nearest to -1? (a) 0.15 (b) -4/491 (c) 6 (d) -0.4 d Which is the closest to -2/115? (a) 0.81 (b) -2/3 (c) 4 (d) -0.4 d What is the nearest to 84/11 in -3, -12, -0.5? -0.5 What is the nearest to -2 in 0.5, 0.2, 115265? 0.2 What is the nearest to -2/3 in 156/113, 2, -0.3? -0.3 Which is the nearest to 62? (a) 107 (b) 5 (c) -1 a What is the closest to 1 in -26, 0.2, -0.4, 0.0619? 0.2 What is the closest to 5 in 4, 2427/2, 0.2? 4 What is the closest to 13.87 in 1, -1/4, -5? 1 Which is the nearest to 0.002? (a) -1/2 (b) 4 (c) -5 (d) 17 a What is the nearest to 21 in -4/5, 4/5, 9/5, 187? 9/5 What is the closest to -1 in 0.08, 7, 0.5, 5, 177? 0.08 What is the nearest to 2 in 0.4, 2, 3/4, -17.211, 1? 2 Which is the nearest to -1/4? (a) 0.3 (b) -36 (c) -2/3 (d) 14/9 c What is the nearest to 3/94 in 5, -4, -0.3, -3? -0.3 Which is the closest to 0.027? (a) -9 (b) 5 (c) -0.3 (d) 2/11 (e) 3/7 d Which is the nearest to 3? (a) -0.07 (b) -4/11 (c) -3 (d) 1/17 d Which is the closest to 2? (a) 298 (b) 8 (c) 0.2 (d) -0.1 (e) 3/2 e What is the nearest to -2/15 in 7/2, 8, 1, -0.21? -0.21 Which is the closest to -25? (a) -3/4 (b) -4 (c) -1 (d) 3 b Which is the nearest to 1/10? (a) 2/7 (b) 33 (c) 1 (d) -6/13 (e) -3 a What is the nearest to -2 in -3, -0.8, 1/49, 3/4? -3 What is the closest to 0 in -0.56, -0.07, 3, 1, -7? -0.07 Which is the nearest to 57? (a) -3/5 (b) 10 (c) -2/5 b What is the nearest to 1/2 in 0.4, -3/19, 0.2, 123? 0.4 What is the nearest to 1 in 42/13, 3/5, 0.175? 3/5 Which is the closest to 0.05? (a) -0.4 (b) 273 (c) 270 a Which is the nearest to 0.2? (a) -24.53 (b) -2/7 (c) -5 (d) 4/9 d Which is the closest to -1? (a) -17 (b) -3/5 (c) -2/11 (d) -2 b What is the nearest to 0.1 in 7/43, 4, 0, -3, 0.5? 7/43 Which is the nearest to 1/46989? (a) 2 (b) 1/6 (c) 0.05 c Which is the nearest to 0? (a) -0.07 (b) 0 (c) 0.1249 b Which is the nearest to -2? (a) -55 (b) -4 (c) 0.1 (d) 2/5 b What is the nearest to 0.09 in 3, -0.1, 2, 22, -0.5? -0.1 What is the closest to 2/3 in -114, -3, -1/89? -1/89 What is the nearest to -50/409 in -1/4, -1, -4/3, 2/9? -1/4 What is the nearest to -564 in -2/11, -11, 5? -11 Which is the nearest to 2.6? (a) -0.06 (b) 2/37 (c) -0.3 (d) 4 d Which is the closest to 0.23? (a) -0.03 (b) -3 (c) -4 a Which is the closest to 0.14? (a) 14 (b) 0.02 (c) 0.2 (d) -4 c Which is the closest to 0.03? (a) -0.4 (b) -0.5 (c) -6 (d) 3 a What is the nearest to 1 in -8, -35, -23, 2? 2 What is the nearest to -0.1 in 5, 73, -30/19? -30/19 What is the closest to -1/5 in -2, -3/7, -0.2, 0.4? -0.2 What is the nearest to -2/3 in 2.2, -0.05, 14.1? -0.05 Which is the nearest to 4/11? (a) -0.3 (b) -180 (c) 0.4 c What is the nearest to -6 in 237, 4, -25? 4 What is the nearest to -2 in 1/10, -0.0016, -1/5, 1? -1/5 Which is the closest to 8/7? (a) 2 (b) -4 (c) 5 (d) 59 (e) -0.4 a Which is the nearest to -7? (a) -2 (b) 0.4 (c) -0.491 (d) -5 d What is the closest to -78 in 0, -5, 0.3841? -5 What is the nearest to 1219 in 0.3, -5, 3, 1, -1/52? 3 What is the nearest to 0 in 4, 69.19, -1? -1 Which is the closest to 0.1? (a) -0.4 (b) -2/17 (c) -1/22 (d) -0.234 c What is the nearest to -136/25 in 2, -1/2, -0.4, 2/3? -1/2 Which is the closest to -47? (a) -6 (b) -4 (c) 0.13 a What is the closest to -2 in -4, 3, -9, 2, 8? -4 What is the nearest to 111/7 in 4, -17, 4/3? 4 Which is the nearest to 0.1? (a) -1/3 (b) -4 (c) 613 a What is the nearest to 3/419 in -2/19, 5/3, 25, -2? -2/19 Which is the nearest to 1? (a) -0.0599 (b) 72 (c) -1/4 a Which is the nearest to -0.3? (a) -591 (b) 4 (c) -5 b What is the closest to -13/3 in -0.033, -1.6, -3? -3 Which is the nearest to -48/5? (a) -5 (b) -6139 (c) -2/5 a Which is the closest to -0.81? (a) -0.5 (b) 2/15 (c) -2/15 (d) -331 (e) -0.3 a What is the closest to -1 in 4, -48, 10, -0.8? -0.8 Which is the closest to -1? (a) 2/9 (b) 429/5 (c) 1/3 a Which is the nearest to 0.1? (a) -21/5 (b) 4/7 (c) -1.241 b Which is the closest to -1? (a) -0.02 (b) -454 (c) -1/3 (d) 3 c Which is the closest to 0.3? (a) -2/19 (b) 3 (c) 23 (d) -2/7 a What is the nearest to -1 in 1385, 3, 4? 3 What is the nearest to 404 in -3, -4, 0.3? 0.3 Which is the closest to -2/5? (a) 5 (b) -910 (c) -2/97 c What is the nearest to -3.6 in -2/13, -0.3, 4/9, -0.06, -0.1? -0.3 Which is the nearest to 0.1? (a) -32674 (b) -8 (c) -1/3 (d) -1 c What is the nearest to 231/31 in -0.1, 40, -4? -0.1 What is the closest to 0 in -718/3, -1, 2, -7? -1 Which is the cl	{ "pile_set_name": "DM Mathematics" }
Let i(j) = -2j2. Let q(g) be the second derivative of 25g4/12 - g3/3 - 3g + 6. Calculate i(q(m)). -1250m*4 + 200m*3 - 8m2 Let z(h) be the third derivative of -h4/12 - h*2. Let w(d) = -286 + 4d + 286. Give w(z(t)). -8t Let z(q) = 9q. Let f(d) = 485d. What is z(f(u))? 4365u Let n(x) = -x*2. Let i(d) be the first derivative of 12d*2 + 4. Determine i(n(r)). -24r*2 Let p(h) = -3h*2 + 4h*2 - 4h*2 + 2h2. Let g(i) be the second derivative of -i3 - 2i. Calculate g(p(s)). 6s*2 Let i(c) = -2c + 6. Let g(s) = 4s. Calculate i(g(r)). -8r + 6 Let x(l) = 8l. Let t(d) = -58d. Determine t(x(c)). -464c Suppose -2y - 2y = -12. Suppose s + ys = -3z + 24, -z + 1 = -s. Let a(t) = -3t - 2t + st. Let i(d) = -2d. Give i(a(r)). 4r Let b(c) = -2c. Let l(s) = 42s. Give l(b(h)). -84h Let g(c) = -3c*2. Let k(i) = -9i*2. Calculate g(k(p)). -243p*4 Let u(o) = 38o. Let t(m) = -2m2. Give u(t(k)). -76k*2 Let n(j) = 2j*2. Let d be 2 + -1 - (-10 - -9). Let r(v) be the third derivative of 0v - 1/24v4 + 0 + dv*2 + 0v*3. Determine r(n(y)). -2y*2 Let r(q) = -2q - 204. Let f(i) = i*2. Give f(r(o)). 4o*2 + 816o + 41616 Let q(m) = -m. Let h = -2 + 1. Let t be ((-6)/(-4))/(h/(-2)). Let r(p) = -4p2 - 2p*2 + tp*2. Give q(r(s)). 3s*2 Let i(m) = -584m. Let a(y) = -y*2. What is a(i(v))? -341056v*2 Let m(d) = -25d - 1. Let j(w) be the second derivative of w*4/12 - 13w. Give m(j(s)). -25s2 - 1 Let g(b) be the third derivative of 0 + 0b*3 + 0b + 2b2 - 1/12b*4. Let x(v) = 2v*2. What is g(x(z))? -4z*2 Let w(o) = -9o*2. Let x(t) = 6t - 50. What is x(w(a))? -54a2 - 50 Let x(a) = 9a. Let b(w) = w. Let i(v) = 21b(v) - 3x(v). Let j(h) = -5h. Let u(r) = -7r. Let n(m) = -3j(m) + 2u(m). What is i(n(c))? -6c Let q(i) = i2. Let b(h) = -11h + 6. What is b(q(n))? -11n2 + 6 Let u(a) = -4a. Suppose -6 - 2 = -2f. Suppose 5c + 3n = 76, 5n = -fc + 10 + 56. Let q(x) = 2x + c - 14. Calculate u(q(z)). -8z Let j(d) = 11d*2. Let o(q) = -3 + 6 - q - 3. Calculate j(o(w)). 11w2 Let l(j) be the second derivative of j4/6 + 76j. Let a(u) = -2u*2 - 7u*2 + 2 + 9. Let w(p) = -2p*2 + 2. Let f(q) = 2a(q) - 11w(q). What is l(f(h))? 32h*4 Suppose -3a + 2 = -2a + 2w, 3a - 3w - 6 = 0. Suppose 0 = 5q - 3j - 9, -4 = -2q + j. Let b(y) = -qy + 2y - ay. Let o(k) = -k. Give b(o(f)). 3f Let z(f) = -6f2. Let q(i) be the second derivative of i3/3 + i. What is z(q(b))? -24b2 Let i(w) = -1426w*2. Let t(r) = r. Calculate t(i(z)). -1426z*2 Let q(a) = -6a. Let w(i) = 525 + 4i2 - 525. What is q(w(x))? -24x*2 Let l(t) be the first derivative of 8/3t*3 + 0t*2 + 4 + 0t. Let y(w) = w*2. Give l(y(h)). 8h4 Let d(h) = h2. Let z(c) = -176 + 176 - c2. Calculate d(z(n)). n4 Let c(a) = -8a2. Let p(r) = 7r*2. Let b(s) = 5c(s) + 6p(s). Let d(z) = z2. What is d(b(n))? 4n*4 Let t(n) be the second derivative of 0n*2 + 7/6n*3 + 3n + 0. Let l(u) be the third derivative of u4/12 - u2. Calculate l(t(k)). 14k Let k(v) be the second derivative of 0v*2 - 2v - 1/2v3 + 0. Let z(h) = -2h. What is z(k(p))? 6p Let h(c) = -c. Let u(v) = 3v*2 + 4v. Let a(s) = -4h(s) - u(s). Let w = 6 - -5. Let k(m) = -2 + m2 - 9 + w. What is a(k(y))? -3y4 Let u(c) be the first derivative of c2 + 11. Let p(z) = 2z - 3z - 3z. Give u(p(b)). -8b Let b(l) be the third derivative of l*4/24 + 3l*2. Let r(z) = 3 - 3 - 3z. Give b(r(k)). -3k Let d(s) = 12s. Let n(w) = 5w2 - 3w. What is d(n(v))? 60v2 - 36v Let u(l) = -98l. Let y(s) = -4s. What is u(y(n))? 392n Let j(t) = -t2. Let b(w) = 5 - 14w - 2 - 3. Give b(j(x)). 14x2 Let c(x) = -4x. Let b(m) = -7m - 5m + 11m - 4m. Calculate b(c(u)). 20u Let v(a) = a. Suppose f - 2n + 6 = -2f, 4f - 4n + 8 = 0. Let k be f(0 - -1) + 4. Let q(b) = b + kb + 0b - 5b. What is v(q(c))? -2c Let p(f) be the second derivative of -f3/3 + f. Let a(j) = -j2 + 2j. Let n(d) = -3d*2 + 7d. Let u(r) = -7a(r) + 2n(r). Give p(u(z)). -2z2 Let w(k) be the second derivative of -k3/6 + 3k. Let s(d) be the second derivative of d*4/2 - 2d. What is w(s(q))? -6q2 Let j(x) = -x2. Let p be ((-2)/(-3))/(-2) - (-14)/6. Let c(n) be the second derivative of 1/2n*3 + 0n*p + 3n + 0. What is j(c(q))? -9q2 Let j(m) = 5m. Let s(g) = 2g - 4. What is s(j(n))? 10n - 4 Let b(i) = 4i - 5. Let x(z) = -3z + 5. Let n(m) = -3b(m) - 2x(m). Let g(q) = 1. Let p(d) = 5g(d) - n(d). Let o(w) = -3w. Determine p(o(k)). -18k Let z(b) = b2. Let r(c) = -c2 + c - 1. Let w be 9/7 - 4/14. Let m(d) = 3d*2 - d + 1. Let s(g) = wm(g) + r(g). Give z(s(f)). 4f4 Let l(v) = -v2 - 3. Let t(d) = -3d*2 - 7. Let i(c) = -14l(c) + 6t(c). Let o(k) = k2 - 11. Let n(q) = 2. Let s(m) = 11n(m) + 2o(m). Give i(s(g)). -16g4 Let u(d) = d2 + d - 1. Let f(k) = 5k2 + 6k - 6. Let p(n) = f(n) - 6u(n). Let m(l) = 10l. What is p(m(g))? -100g2 Suppose 6 = i - m + 4, -3i - 3m = -18. Let p(c) = 3c*2 + 2c*2 - ic2. Let q(t) = -t2. Determine p(q(y)). y*4 Let f(h) = -2h*2. Suppose 0 = -6l + l + 10. Let v(r) be the third derivative of r*l + 0 + 1/60r*5 + 0r*4 + 0r + 0r3. What is v(f(c))? 4c4 Let d(x) be the third derivative of x4/12 - 4x2. Let q(r) = r. Let p(w) = 4w. Let c(n) = -2p(n) + 11q(n). Determine c(d(f)). 6f Let g(z) be the first derivative of -z2/2 + 37. Let l(b) = 9b - 4. Give l(g(q)). -9q - 4 Let v(x) = -x. Let u = 3 + -1. Let s(f) = 2f*2 - 4fu - f2. Calculate v(s(i)). 3i2 Let i(o) = 3o*2 + 40o. Let k(d) = -d. Give k(i(p)). -3p2 - 40p Let x(n) = 7n. Let v(z) = 7z. Determine x(v(j)). 49j Let q(u) = u. Let g(f) = 3f*2 - 4. Let c(p) = 58 - 37p*2 - 25 + 13p*2. Let r(s) = 4c(s) + 33g(s). Calculate q(r(i)). 3i*2 Suppose -3w = 2z - 0z - 23, 3z - 7 = w. Let x(b) = zb + 0b - b + b. Let m(j) = j2. Determine m(x(s)). 16s*2 Let u(s) = s. Let t(d) = -2d - 5d - 30d. Give t(u(o)). -37o Let u(c) = 0 + 0 - c - c. Let x(j) = -2j*2 + 2j2 + j2. Give u(x(f)). -2f2 Let b(l) = -l2 + 0l2 - l2. Let o(r) = -34r. Calculate b(o(s)). -2312s2 Let r(d) = -d2 + 2. Let m(n) = 3n2 - 7. Let i(f) = -4m(f) - 14r(f). Let w(k) = -4k*2. Determine i(w(p)). 32p*4 Suppose 0 = 3a - 7a + 24. Let q(p) = -6 + a - 3p2. Let g(n) be the second derivative of n3/6 + n. Determine g(q(j)). -3j2 Let z(o) = -15o. Let v(m) = -m. Let n(r) = -2v(r) + z(r). Let k(p) = -p. Give n(k(h)). 13h Let j(g) = g*2. Let q(b) = -1093b. Calculate q(j(a)). -1093a2 Let a(j) = 4j - 211. Let p(c) = -2c. What is p(a(y))? -8y + 422 Let h(s) = s. Let f(y) = 3558y. What is h(f(m))? 3558m Let q(t) = 2t2. Let k(x) be the third derivative of 2x*2 + 0x + 0 + 0x3 + 1/30x*5 + 0x*4. What is k(q(j))? 8j*4 Let u(g) = 3g*2 - 3g*2 - 3g*2 + 2g*2. Let f(s) = 40s. Determine f(u(p)). -40p2 Suppose 0 = 3c - 5c + 8. Let w(z) = -z + 5z + cz - 4z. Let x(h) = 10h2 - 7. Let n(j) = -7j*2 + 5. Let m(a) = -7n(a) - 5x(a). Determine w(m(o)). -4o*2 Let t(r) = 2r. Let l(g) = 62 + 60 - 18g - 122. What is l(t(z))? -36z Let s(l) = -4l2 - 5l*2 + 10l*2. Let x(q) = 25q*2. Give x(s(d)). 25d*4 Let q(a) = -112a - 2. Let y(u) = 3u2. Calculate q(y(r)). -336r*2 - 2 Let c(r) be the first derivative of 0r*4 + 1/120r*5 + 0r2 + r3 + 0r + 2. Let p(z) be the third derivative of c(z). Let k(o) = -6o. What is p(k(q))? -6q Let j(h) = -146h*2 + 69h*2 + 74h*2. Let k(m) = 8m*2 + m. Give k(j(i)). 72i*4 - 3i*2 Suppose 5v - 3v + 3x = -8, -4x - 26 = -5v. Let c(t) = 2t2 + 3t*v - 3t*2 - 4t*2. Let p(g) = -3g*2. Determine c(p(q)). -18q*4 Let i(w) = 3w*2. Let c(r) = -4r*2. Calculate i(c(u)). 48u*4 Let p(s) = -s. Let f(a) = -25a*2 - 23a*2 + 49a2. Calculate p(f(c)). -c2 Let o = 6 - 4. Let b(t) = 1 + 18to - 16t*2 - 1. Let v(a) = -5a. Calculate b(v(l)). 50l2 Let b(i) = -13i*2. Let v(t) = 0t*2 - 2t*2 + 23 - 23. Give b(v(a)). -52a*4 Let c(z) = z. Let x(t) be the third derivative of 0 + 0t - 1/24t4 + 0t3 + t2. Give c(x(k)). -k Let k(j) = 28j + 19j - 17*j	{ "pile_set_name": "DM Mathematics" }
What is the units digit of c(-8)? 9 Let q(n) = -n*3 - 23n*2 - 31n - 72. Let z = 291 - 314. What is the units digit of q(z)? 1 Suppose 19 + 9 = 4r. Let g be (-56)/98(27/(-6) - -1). Suppose -25 = gs - rs. What is the units digit of s? 5 Suppose -298r + 1857476 = -88762. What is the units digit of r? 1 Let k(m) = -140m*2 + 11m + 5. Let x(l) = -142l2 + 10l + 4. Let n(c) = 4k(c) - 5x(c). What is the units digit of n(1)? 4 Suppose -12r + r = -55. Suppose 3u + 3x = 12, -1 - 15 = -u - rx. What is the units digit of u? 1 Suppose 142m - 81m - 183 = 0. Let o be (1 + (-17 - -1))/(-1). Suppose -5a = -o, ma + 66 = 2x + 19. What is the tens digit of x? 2 Suppose 0 = v + 336 - 1272. Suppose 4 = -4b - 12, v = -5w + b. Let g = -82 - w. What is the tens digit of g? 0 Let b = 181 - 176. Suppose bq - 8q = -651. What is the tens digit of q? 1 What is the tens digit of (-7003115)/(-385) - 3/(-33)? 9 Let l be (-3 - -9)/(-3) - -2. Suppose 0 = -2h + 6, 2b + 2b + 3h - 21 = l. Suppose -4d = -bg - 237, -4g + g + 63 = d. What is the tens digit of d? 6 Suppose -3n + 19462 = x, 3n - 103948 = -4x - 26154. What is the hundreds digit of x? 4 Let o = -36 - -41. Suppose or = -2k + 2400, 4r - 5r = -5k - 453. What is the units digit of r? 8 Let n(m) = 258m - 129. Suppose 0 = x - 5o + 22, 2x + 2x = -5o + 37. What is the hundreds digit of n(x)? 6 Let r(x) be the first derivative of x3/3 + x2 - 4x - 12. Let b be r(4). Suppose 2a - i - 46 = 101, 0 = 4i + b. What is the units digit of a? 1 Suppose 2t + 4472 = 3a + 3t, 2a - 2983 = t. Let d = a + -872. What is the hundreds digit of d? 6 Let g = 351 + -340. Suppose gr = -4x + 9r + 1666, 5x - 2055 = 3r. What is the hundreds digit of x? 4 Suppose 26d = 21d + 65. Suppose -dq + 28 = q. Suppose qu = -u + 582. What is the hundreds digit of u? 1 Let h be (-3392)/4015/(-6). Suppose 39 = -2r - 3y - h, 0 = r - y + 113. Let n = 200 + r. What is the tens digit of n? 8 Suppose -2d + 0d = 5q - 241, 5d + 206 = 4q. Let f = q + 289. What is the tens digit of f? 3 Suppose 13073 = 5z - h - 35348, 4h = -z + 9701. What is the hundreds digit of z? 6 Let r be (-9538)/10 + (-41)/205. Let c = -592 - r. What is the tens digit of c? 6 Suppose -14c + 5074 = 29c. Let m = c + 254. What is the hundreds digit of m? 3 What is the tens digit of 1 + 1 - (-9129 - 609/21)? 6 What is the ten thousands digit of (97616/14)/(13/35 + (-333)/1110)? 9 What is the units digit of ((-4)/(-29))/(3 + -5) - (-2624392)/116? 4 Let v(p) = 376p + 15. Let f(s) = 1130s + 46. Let g(r) = 3f(r) - 10v(r). What is the thousands digit of g(-3)? 1 What is the hundreds digit of ((-98307)/18)/((-3)/1(-8)/(-32))? 2 Let t(k) = 441k2 + 12k - 53. What is the tens digit of t(4)? 5 Let m = -25 + 30. Suppose 5a - 2r = 21, 5r - 8 = 2. Suppose 3n + aw - 178 = -n, mn - 3w = 204. What is the tens digit of n? 4 What is the tens digit of 79/((38 - 34) + (-6429)/1608)? 4 Let h = -123 + 185. Suppose hz - 31420 = 42z. What is the thousands digit of z? 1 Let o be (-11 - -12)/(1/9054). Suppose 4i + a - o = -a, -a + 9055 = 4i. What is the tens digit of i/12 - 6/9? 8 Suppose -5q + 253071 = 7l, 127q - 131q + 4l + 202476 = 0. What is the units digit of q? 7 Let p(w) = -w + 14. Let o be p(12). What is the hundreds digit of 327(6/(-4)o + 4)? 3 Let u = 9919 + -4542. What is the units digit of u? 7 Let x(s) = 26s2 + 19s + 311. What is the thousands digit of x(32)? 7 Suppose 52t - 35 = 47t. Suppose 13y - ty - 468 = 0. Suppose -348 = -6i + y. What is the tens digit of i? 7 Let n(f) = 43f - 42. Let i = 206 - 189. What is the hundreds digit of n(i)? 6 Let a(h) = 17h3 - 20h*2 + 14h + 101. What is the units digit of a(9)? 0 What is the ten thousands digit of (1288/126 - (13 + -3)) + (-397220)/(-18)? 2 Suppose 80x - 197455 = -35x. What is the thousands digit of x? 1 Let c = 278 - 275. Suppose -4o + 651 + 809 = cw, -5w + o + 2418 = 0. What is the tens digit of w? 8 Suppose 0 - 33 = -11n. Suppose 5l - 969 = -c, -7l + 3c + 760 = -nl. What is the hundreds digit of l? 1 Suppose 15a = 10a + 3260. Let k = a - -38. What is the tens digit of k? 9 Let j(o) be the third derivative of o4/3 - o3/3 - 41o2. Let q be j(2). What is the tens digit of (-13)/(273/(-6)) - (-598)/q? 4 Let u = 62 - 61. Let s = 3 + u. What is the units digit of (62/s)/(5/30)? 3 Let i(g) = 512g*2 + 789g*2 - 1 - 231g*2 - 106g*2. What is the hundreds digit of i(1)? 9 Suppose 68 = 4a + 2y, 2y = 3a + 7y - 58. Suppose 2s = as - 1358. What is the units digit of s? 7 Suppose 2 = 2g, -74916 - 91308 = -3a + 3g. What is the ten thousands digit of a? 5 Let w be -1 + -2 + 169 + (8 - 6). Let a be (4 - 8)/(2/4). What is the tens digit of (-665)/a + (-21)/w? 8 Suppose 12098 = 6c + 40c. What is the tens digit of c? 6 Let j(x) = -2x - 24. Let b be j(-14). Let q = b + -1. Suppose 21 = qf - 0f. What is the units digit of f? 7 Let j be 26 + (1 - 2) - (-6)/2. Let y = j + -23. Suppose yf - u - 242 = 0, 0 = f - 3u - 27 - 27. What is the units digit of f? 8 Suppose 3r - 25969 = -704o + 702o, 4o + 2r - 51958 = 0. What is the tens digit of o? 9 Suppose s - 3s - 37 = -5w, 26 = -s + 5w. What is the hundreds digit of (32/(-12))/(s/(42405/10))? 0 Suppose 36r - 41r + 39315 = 5a, a + 15705 = 2r. What is the hundreds digit of r? 8 Let q = -45 + 68. Suppose -2v + 47 = -q. What is the tens digit of v? 3 Let f be (-2 - -26)(-60)/48. Let s be 6/5f/4. Let z(k) = -6k + 21. What is the units digit of z(s)? 5 Let b = 5488 + -2348. Suppose -6z + b = 542. Suppose 0 = 5v + 8a - 6a - z, 3v - 2a - 263 = 0. What is the units digit of v? 7 Suppose -31h = -48h + 170. Suppose 0 = -c + h + 506. What is the units digit of c? 6 Suppose 2c - 17 = -v + 7c, 3v - 12 = 2c. Let z be v/(30/123) - 2/10. Suppose zp - 13p = -25. What is the units digit of p? 5 What is the tens digit of (0 - 22345)/(-16 - 341/(-22))? 9 Let v(q) = 26q3 - 3q*2 - q - 1. Let b be v(3). Let p = -450 + b. What is the hundreds digit of p? 2 Let n = 12097 + -9734. What is the hundreds digit of n? 3 Suppose 0 = -4o - 9 - 75. Let z = -10 - o. Let k(n) = -n*3 + 12n*2 - 3n - 2. What is the units digit of k(z)? 6 Suppose 4j + 2q - 18446 - 25764 = 0, 0 = -2j - 5q + 22093. What is the units digit of j? 4 Suppose 2w - 1477z - 137044 = -1482z, -136996 = -2w + z. What is the thousands digit of w? 8 Suppose -12b = -18b + 18. Suppose -4g = bp - 329, -9p = -14p - g + 520. What is the hundreds digit of p? 1 Suppose 11k + 2k - 65 = 0. Suppose kj - 5c = 65, 0j + j = -c + 13. What is the units digit of (j/2)/((-8)/(-16))? 3 Suppose -4y - 2x = -80018, -64x = -5y - 59x + 100030. What is the thousands digit of y? 0 Let q be 01/6-2. Suppose qb - b = -28. Suppose 72 = 2l - v + 16, 3v = -l + b. What is the tens digit of l? 2 Let m be (-2)/(-15)52843. Let y = m - 612. What is the hundreds digit of y? 5 Let k(j) = 7825j - 3603. What is the tens digit of k(3)? 7 Let n(d) = d2 - 6d - 33. Let q be n(10). Suppose 5k = qk - 100. Let t = 100 - k. What is the tens digit of t? 5 Suppose 7l + 136105 = 5y + 2l, -2y = 4l - 54436. What is the units digit of 2/14 - y/(-70)? 9 Let x = -20436 + 38061. What is the units digit of x? 5 Let x be (14/(-21))/((-4)/582). Suppose 5d = 2f + 485, -f - 2f = d - x. Suppose -3l + 11 = -d. What is the tens digit of l? 3 Suppose -344 = -26d + 124. Let b(u) = u*3 - 16u*2 - 3u + 29. What is the units digit of b(d)? 3 Suppose 28 = 4q - 4n, -2q + 5n - 1 = -12. Let o = 386 + q. What is the hundreds digit of o? 3 What is the hundreds digit of (-115310)/(-14) + (3408/(-6384) - 4/(-38))? 2 Let h = 17916 + -9572. What is the units digit of h? 4 Suppose -16p - 13p + 505912 + 95432 = 0. What is the hundreds digit of p? 7 Let c = 4036 - 249. What is the tens digit of c? 8 What is the hundreds digit of 2280 + (20 + -8 - 5) + 4? 2 Let l(m) = -1 - 3m2 + 25m - 2m3 + 32m*2 - 32m*2. What is the tens digit of l(-7)? 6 Let n = 92068 - 56945. What is the tens digit of n? 2 Let r(v) = 5v*2 - 424v - 309. What is the hundreds digit of r(99)? 7 Let g = 20805 + -5052. What is the ten thousands digit of g? 1 Let	{ "pile_set_name": "DM Mathematics" }
se 10, what is -3169677 - 7? -3169684 In base 16, what is 0 + 4cd9e07? 4cd9e07 In base 3, what is 22 + -100211200221022? -100211200221000 In base 8, what is 2 + 21331436? 21331440 In base 6, what is 15 - 11122225? -11122210 In base 13, what is 130 + 1275b2? 127712 In base 7, what is -522506114 - 16? -522506133 In base 11, what is 5 - -4212aa22? 4212aa27 In base 15, what is 25e0c + -107c? 24d80 In base 16, what is ab9 - -bd9? 1692 In base 14, what is -da7 + -179b? -2764 In base 3, what is -20021210 + -112210? -20211120 In base 9, what is 886 - -633715? 634712 In base 10, what is -65269 + -4? -65273 In base 8, what is -754033754 - 6? -754033762 In base 13, what is -54607b6 + -1? -54607b7 In base 15, what is -2 - b51ac? -b51ae In base 9, what is 8 + 34607531? 34607540 In base 14, what is 1bb92 - -6d0? 1c482 In base 16, what is e - -19186b7? 19186c5 In base 11, what is -2 + 66496733? 66496731 In base 11, what is 936741 + -191? 936560 In base 4, what is -13130323 - 2120? -13133103 In base 12, what is 90a3475 + 5? 90a347a In base 11, what is -294820a4 + -5? -294820a9 In base 3, what is 22101 - -102010102020? 102010201121 In base 11, what is 530899 - -a? 5308a8 In base 2, what is -100011111001000 + -1001100101? -100101000101101 In base 4, what is -11232302111002 - 0? -11232302111002 In base 7, what is -12023 + 404645? 362622 In base 14, what is -874 - 12c7d? -13713 In base 12, what is 49026a181 + -2? 49026a17b In base 4, what is 330 - -1000013000? 1000013330 In base 3, what is 12201101112220201 - 12? 12201101112220112 In base 13, what is -191caab + -c? -191caba In base 4, what is 3313022 + 10233003? 20212031 In base 13, what is -13b34cc6 + 0? -13b34cc6 In base 10, what is -2 + -203149? -203151 In base 12, what is 6a3 + -301aa5? -301402 In base 7, what is 5241 - -13342? 21613 In base 2, what is 11 - 110100001100101001110? -110100001100101001011 In base 3, what is 12002012221122121 + -10? 12002012221122111 In base 14, what is -1848a28 - 4? -1848a2c In base 2, what is 110011100 - 1010000101100001? -1001111111000101 In base 5, what is 131 + -44421410? -44421224 In base 16, what is -35444c4 - -2? -35444c2 In base 16, what is -905 + 13424? 12b1f In base 16, what is -16 + 32a0d? 329f7 In base 9, what is -4 + 1740262? 1740257 In base 9, what is -31852 - -678? -31163 In base 7, what is 6503 - -1054325? 1064131 In base 16, what is 0 - 1ba5fc? -1ba5fc In base 4, what is 0 - -10011133202? 10011133202 In base 8, what is 34 - -624275? 624331 In base 5, what is 402 + 33222032? 33222434 In base 13, what is -3758c6 + 157? -37576c In base 14, what is 178dc2 - 5? 178dbb In base 2, what is 1010000 + -1101010010101011? -1101010001011011 In base 9, what is 621 - -60264? 60885 In base 5, what is 2432222034 - -2? 2432222041 In base 11, what is 2873984 + -5? 287397a In base 6, what is -3140103 + 520? -3135143 In base 2, what is 111111100100 - -1101101100101011? 1110101100001111 In base 15, what is 2e9 - 1870? -1576 In base 10, what is 20070 - -1046? 21116 In base 5, what is -314321301 - -134? -314321112 In base 11, what is 280 + 182335? 182605 In base 6, what is 23225 + -12512? 10313 In base 14, what is -5cb299 - 5? -5cb2a0 In base 7, what is -232162 + 12445? -216414 In base 7, what is -32 - 212356? -212421 In base 7, what is 16246 - -125630? 145206 In base 12, what is 15 + 427598? 4275b1 In base 8, what is 34 + 57205677? 57205733 In base 16, what is -5 - -3debc4? 3debbf In base 3, what is -10202110 - -112102? -10020001 In base 11, what is -4 + -a78446? -a7844a In base 15, what is -1e7d75 + -174? -1e7ee9 In base 12, what is 77223b + 14? 772253 In base 6, what is 43102551 - -2035? 43105030 In base 13, what is -375 - 615? -98a In base 4, what is -3 - 3102132202? -3102132211 In base 14, what is -23662d2 - -4? -23662cc In base 12, what is 15b35b - 1? 15b35a In base 14, what is -8 + 69a3c21? 69a3c17 In base 4, what is 1022 - -122120112312? 122120120000 In base 16, what is 2e5 + 760a8? 7638d In base 9, what is -236 + -3756362? -3756608 In base 15, what is -5805 + 71? -5784 In base 7, what is 6665266651 - 0? 6665266651 In base 6, what is -4555101 + -532? -5000033 In base 2, what is 111110100110111101 - 100001111? 111110100010101110 In base 6, what is 125154 + 523? 130121 In base 3, what is -100 - -100111010022120? 100111010022020 In base 16, what is -36cd25d + 0? -36cd25d In base 15, what is -4b4 - 26d? -732 In base 8, what is -2203010 + 3? -2203005 In base 12, what is -3 - -54472b? 544728 In base 15, what is -8c514d99 - 3? -8c514d9c In base 4, what is -2330 + 303131100? 303122110 In base 3, what is -2111 - 2201110000002? -2201110002120 In base 2, what is -10101 - -10000011111000101011001? 10000011111000101000100 In base 16, what is 47 + -1a0f9? -1a0b2 In base 7, what is 121656051 + -11? 121656040 In base 10, what is -39 + 6118447? 6118408 In base 9, what is 10 - 23166004? -23165884 In base 14, what is -10 + -870b5c? -870b6c In base 14, what is -589a2 + 123? -5887d In base 12, what is -1 - -176b8b? 176b8a In base 13, what is 3355 - 102cb? -9c76 In base 8, what is 15 - -43671? 43706 In base 3, what is 1 + -12022210222? -12022210221 In base 8, what is -1336 + -144027? -145365 In base 6, what is 5515 + -335040? -325121 In base 14, what is 6 - 6651d0c? -6651d06 In base 6, what is 1201 + 422? 2023 In base 15, what is -a - 685285? -685290 In base 13, what is -47c4c + 19? -47c33 In base 13, what is 1084b + cb? 10949 In base 16, what is 2e - 21bf1b? -21beed In base 12, what is 229a - -14a86? 17164 In base 11, what is 2840 + 416? 3156 In base 12, what is -65039838 - 3? -6503983b In base 16, what is c5 - -1db11b? 1db1e0 In base 9, what is -505 - 651473? -652078 In base 16, what is -34b317 + 8? -34b30f In base 10, what is 234 - -57461? 57695 In base 10, what is -7 - 719686? -719693 In base 7, what is -1243 - -2264? 1021 In base 10, what is 4361 - 18950? -14589 In base 3, what is -1101102211202120 + 200? -1101102211201220 In base 13, what is -1732aa6 + 0? -1732aa6 In base 8, what is 5014 + 62202? 67216 In base 9, what is 1 + 127885514? 127885515 In base 10, what is 46521 - 648? 45873 In base 6, what is -210244 + -111030? -321314 In base 5, what is -114022 + 30011? -34011 In base 10, what is 39 + 693676? 693715 In base 6, what is -5 + -101004521? -101004530 In base 7, what is 3334415 - 145? 3334240 In base 13, what is 1 + -1714725? -1714724 In base 4, what is -12302 - -1230111131? 1230032223 In base 16, what is 7297f + -134? 7284b In base 3, what is -22100212221 - 1122? -22100221120 In base 3, what is 2200212200212111102 - -11? 2200212200212111120 In base 4, what is 23 + -102030323? -102030300 In base 16, what is -499 + 4ae? 15 In base 13, what is 188a - 3776? -1bb9 In base 12, what is -118 + -638a5? -63a01 In base 12, what is -18504 + -769? -19071 In base 9, what is -4 - -146518300? 146518285 In base 15, what is 11 - 164d5? -164c4 In base 2, what is -111001011100010011 + -101111? -111001011101000010 In base 15, what is 12193ec + -2? 12193ea In base 15, what is -4d36 + 7e4? -4542 In base 8, what is 45 + 543440? 543505 In base 7, what is -633113550 + -3? -633113553 In base 3, what is -220 + 12222001001110? 12222001000120 In base 10, what is -1765452889 - -3? -1765452886 In base 3, what is -21 - -12102110010100? 12102110010002 In base 14, what is -1bd94 + -29? -1bdbd In base 10, what is 9 + -152802? -152793 In base 6, what is -3 - -53430301? 53430254 In base 10, what is 20484610 + -21? 20484589 In base 12, what is 1190448 + -1? 1190447 In base 7, what is 2110 + -131? 1646 In base 13, what is -1959842c + -2? -19598431 In base 8, what is 17 + 20106300? 20106317 In base 3, what is 11102 - -2012011202? 2012100011 In base 6, what is 2000311 + 5012? 2005323 In base 16, what is 613281 + 30? 6132b1 In base 13, what is -1201 + bc5c? aa5b In base 11, what is -42717 + -120? -42837 In base 16, what is def7 + b5? dfac In base 2, what is 100000111000100010000000010 - -1101? 100000111000100010000001111 In base 8, what is -2 - 10411266? -10411270 In base 8, what is 14655 - 7666? 4767 In base 5, what is -142 - 204113202? -204113344 In base 6, what is -102 - 1230041235? -1230041341 In base 8, what is -1 + 1144554064? 1144554063 In base 3, what is -10220 + 201100022000? 201100011010 In base 14, what is -46d2 +	{ "pile_set_name": "DM Mathematics" }
highest common factor of 18 and 72? 18 What is the greatest common factor of 2119 and 1467? 163 Calculate the highest common divisor of 2346 and 184. 46 Calculate the greatest common factor of 3054 and 24. 6 What is the highest common factor of 7986 and 6? 6 Calculate the greatest common divisor of 240 and 3660. 60 What is the greatest common factor of 245 and 49? 49 What is the greatest common factor of 633 and 3? 3 Calculate the greatest common divisor of 13991 and 34. 17 What is the highest common factor of 21686 and 14? 14 Calculate the highest common divisor of 120 and 3180. 60 Calculate the greatest common factor of 5760 and 432. 144 Calculate the highest common divisor of 540 and 20. 20 What is the highest common factor of 5111 and 38? 19 Calculate the greatest common factor of 90 and 180. 90 What is the highest common factor of 32 and 5536? 32 What is the highest common divisor of 2240 and 35? 35 Calculate the greatest common factor of 165 and 24. 3 Calculate the greatest common divisor of 380 and 80. 20 What is the greatest common factor of 33 and 69? 3 What is the greatest common divisor of 270 and 243? 27 What is the greatest common divisor of 21 and 49518? 21 Calculate the highest common divisor of 42 and 567. 21 What is the highest common factor of 192 and 324? 12 Calculate the highest common factor of 396 and 8844. 132 Calculate the greatest common divisor of 9912 and 21. 21 Calculate the highest common factor of 1026 and 228. 114 What is the highest common factor of 48 and 11040? 48 What is the greatest common divisor of 525 and 165? 15 What is the highest common divisor of 42 and 105? 21 Calculate the greatest common factor of 1474 and 2. 2 Calculate the greatest common factor of 37320 and 120. 120 What is the greatest common divisor of 1855 and 35? 35 What is the greatest common factor of 799 and 611? 47 What is the highest common factor of 10 and 410? 10 Calculate the highest common factor of 28560 and 14. 14 What is the highest common factor of 3029 and 26? 13 Calculate the highest common factor of 1060 and 53. 53 What is the highest common divisor of 1265 and 528? 11 Calculate the highest common factor of 65 and 5. 5 Calculate the greatest common divisor of 3731 and 287. 287 Calculate the highest common divisor of 264 and 216. 24 Calculate the greatest common factor of 60 and 96. 12 Calculate the highest common factor of 70 and 112. 14 What is the greatest common divisor of 4368 and 1326? 78 Calculate the highest common divisor of 39 and 3978. 39 Calculate the highest common factor of 6 and 13887. 3 Calculate the greatest common divisor of 390 and 1248. 78 Calculate the highest common divisor of 7 and 42. 7 Calculate the greatest common factor of 700 and 40. 20 What is the greatest common factor of 189 and 3171? 21 What is the highest common factor of 105 and 42? 21 Calculate the highest common divisor of 3296 and 32. 32 Calculate the highest common divisor of 21 and 1743. 21 What is the highest common divisor of 12910 and 30? 10 What is the highest common factor of 27 and 45? 9 Calculate the greatest common divisor of 156 and 390. 78 What is the highest common divisor of 385 and 1015? 35 Calculate the highest common divisor of 5 and 1580. 5 Calculate the greatest common factor of 134076 and 12. 12 What is the greatest common divisor of 465 and 1581? 93 What is the highest common factor of 9 and 225? 9 Calculate the greatest common divisor of 117 and 27. 9 What is the highest common factor of 923 and 1775? 71 What is the greatest common divisor of 2346 and 17? 17 What is the highest common divisor of 535 and 4173? 107 What is the greatest common divisor of 35310 and 660? 330 Calculate the greatest common divisor of 370 and 60. 10 Calculate the greatest common factor of 224 and 104. 8 Calculate the highest common divisor of 371 and 280. 7 Calculate the greatest common factor of 436 and 327. 109 Calculate the highest common divisor of 400 and 175. 25 What is the highest common divisor of 1456 and 91? 91 What is the highest common divisor of 34 and 39899? 17 Calculate the greatest common factor of 1748 and 276. 92 What is the highest common factor of 224 and 196? 28 What is the greatest common factor of 19 and 7201? 19 Calculate the highest common divisor of 2028 and 48. 12 What is the greatest common divisor of 516 and 48? 12 Calculate the greatest common factor of 27 and 729. 27 What is the greatest common divisor of 495 and 45? 45 What is the greatest common divisor of 40 and 70? 10 What is the highest common factor of 12218 and 447? 149 Calculate the greatest common factor of 8 and 460. 4 What is the highest common factor of 126 and 2628? 18 Calculate the highest common factor of 138 and 2. 2 What is the greatest common divisor of 146 and 73? 73 Calculate the greatest common divisor of 112 and 176. 16 Calculate the greatest common divisor of 75 and 20175. 75 What is the highest common divisor of 196 and 686? 98 Calculate the greatest common divisor of 51 and 340. 17 Calculate the greatest common factor of 32 and 1360. 16 Calculate the greatest common factor of 65 and 4732. 13 What is the highest common divisor of 9715 and 87? 29 What is the highest common divisor of 54 and 564? 6 Calculate the greatest common factor of 26 and 819. 13 Calculate the highest common factor of 8 and 128. 8 Calculate the greatest common factor of 36 and 2724. 12 What is the greatest common divisor of 320 and 5? 5 What is the highest common divisor of 120 and 1410? 30 Calculate the highest common divisor of 30527 and 178. 89 Calculate the highest common divisor of 488 and 1037. 61 What is the greatest common factor of 15752 and 352? 88 Calculate the highest common divisor of 88 and 5918. 22 What is the greatest common factor of 117 and 104? 13 Calculate the highest common divisor of 1806 and 546. 42 What is the greatest common factor of 1150 and 40? 10 Calculate the highest common factor of 943 and 82. 41 What is the greatest common factor of 17546 and 62? 62 What is the greatest common divisor of 2958 and 255? 51 Calculate the greatest common factor of 28 and 4711. 7 Calculate the highest common divisor of 165 and 143. 11 What is the highest common divisor of 2967 and 92? 23 Calculate the highest common divisor of 123 and 328. 41 Calculate the highest common factor of 527 and 51. 17 Calculate the greatest common divisor of 1121 and 19. 19 Calculate the greatest common divisor of 1845 and 45. 45 What is the greatest common factor of 791 and 133? 7 What is the highest common factor of 16 and 408? 8 What is the greatest common factor of 17 and 1037? 17 What is the greatest common divisor of 46 and 621? 23 Calculate the greatest common factor of 80 and 166. 2 What is the greatest common factor of 170 and 10? 10 Calculate the highest common factor of 46 and 621. 23 Calculate the greatest common factor of 7469 and 11. 11 Calculate the greatest common divisor of 80 and 70. 10 Calculate the highest common divisor of 576 and 36. 36 What is the highest common factor of 67 and 67? 67 What is the highest common factor of 33 and 1551? 33 Calculate the greatest common divisor of 91 and 13. 13 What is the greatest common factor of 112 and 21? 7 What is the greatest common factor of 2294 and 222? 74 What is the highest common divisor of 5 and 25? 5 Calculate the highest common factor of 2895 and 15. 15 What is the highest common factor of 16 and 766? 2 Calculate the greatest common divisor of 30 and 9480. 30 What is the highest common factor of 493 and 153? 17 Calculate the greatest common divisor of 7 and 287. 7 What is the highest common factor of 39 and 3? 3 What is the greatest common factor of 144 and 396? 36 Calculate the highest common factor of 96 and 72. 24 What is the highest common factor of 161 and 45241? 161 What is the greatest common factor of 40309 and 233? 233 Calculate the greatest common divisor of 266 and 57. 19 Calculate the greatest common factor of 689 and 26. 13 What is the greatest common factor of 44 and 308? 44 What is the highest common divisor of 64 and 104? 8 Calculate the highest common factor of 128 and 16. 16 Calculate the highest common factor of 168 and 408. 24 Calculate the highest common divisor of 34 and 1462. 34 What	{ "pile_set_name": "DM Mathematics" }
/39 What is prob of sequence nzn when three letters picked without replacement from {n: 10, z: 9}? 45/323 Three letters picked without replacement from {r: 7, x: 9}. Give prob of sequence xrx. 3/20 Three letters picked without replacement from {h: 12, o: 6}. What is prob of sequence hoh? 11/68 Three letters picked without replacement from qeqqqqeqqqqqeqqeqee. What is prob of sequence qqq? 286/969 Two letters picked without replacement from {z: 10, m: 4, u: 2}. Give prob of sequence mz. 1/6 Calculate prob of sequence nkpv when four letters picked without replacement from {v: 1, e: 2, k: 2, n: 4, p: 5}. 5/3003 Three letters picked without replacement from {s: 2, x: 3, p: 5, v: 3, i: 1, a: 6}. What is prob of sequence xxi? 1/1140 Three letters picked without replacement from uaaahuaaauuuuuauaau. What is prob of sequence ahu? 9/646 What is prob of sequence ffif when four letters picked without replacement from fifiiffrififiefrfi? 49/1530 Four letters picked without replacement from bmrkrvhmrvbvrbk. What is prob of sequence rbhr? 1/910 Two letters picked without replacement from bbdddbdbbbb. Give prob of sequence db. 14/55 Calculate prob of sequence pz when two letters picked without replacement from {l: 4, f: 4, p: 1, x: 1, z: 1, s: 1}. 1/132 Four letters picked without replacement from {n: 4, o: 3, g: 7, k: 1, p: 3}. What is prob of sequence pgnn? 7/2040 Calculate prob of sequence cp when two letters picked without replacement from {p: 1, o: 2, v: 3, c: 1}. 1/42 Calculate prob of sequence om when two letters picked without replacement from {o: 2, y: 2, e: 2, m: 9, c: 2}. 9/136 Two letters picked without replacement from ksmksklmpkmsxkkkpkp. Give prob of sequence px. 1/114 What is prob of sequence cccc when four letters picked without replacement from cccccccchcccccckcc? 91/153 Calculate prob of sequence jme when three letters picked without replacement from qrjrgggremjrqqr. 1/1365 Two letters picked without replacement from {j: 1, k: 2, w: 1, q: 3}. What is prob of sequence kq? 1/7 Four letters picked without replacement from smjtttaslssl. What is prob of sequence mtlt? 1/990 Calculate prob of sequence qegq when four letters picked without replacement from qgqsqeuequqekgqgq. 9/1360 Calculate prob of sequence hff when three letters picked without replacement from {b: 1, h: 1, f: 1}. 0 Four letters picked without replacement from {i: 2, t: 2, h: 1, w: 2, j: 1}. What is prob of sequence jtii? 1/420 Calculate prob of sequence qq when two letters picked without replacement from {i: 17, q: 2}. 1/171 Two letters picked without replacement from {f: 1, k: 1, e: 11}. What is prob of sequence ke? 11/156 Calculate prob of sequence xeo when three letters picked without replacement from {o: 1, x: 1, e: 1, q: 2}. 1/60 Calculate prob of sequence mn when two letters picked without replacement from gtnmh. 1/20 Calculate prob of sequence in when two letters picked without replacement from {x: 1, i: 2, s: 1, k: 2, n: 8}. 8/91 Calculate prob of sequence dqdd when four letters picked without replacement from {d: 5, q: 4, k: 1, w: 3}. 2/143 Calculate prob of sequence xxrr when four letters picked without replacement from rxrxx. 1/10 Calculate prob of sequence dd when two letters picked without replacement from {d: 3, p: 5}. 3/28 Calculate prob of sequence ezz when three letters picked without replacement from {z: 5, q: 3, l: 1, e: 7}. 1/24 Four letters picked without replacement from {j: 4, f: 3, l: 5, p: 1}. Give prob of sequence flfj. 1/143 Two letters picked without replacement from {i: 3, f: 1, x: 3}. Give prob of sequence xx. 1/7 Three letters picked without replacement from ddv. What is prob of sequence ddv? 1/3 Four letters picked without replacement from zznzzzzzzznzzzn. What is prob of sequence zzzz? 33/91 Calculate prob of sequence sncs when four letters picked without replacement from lslenclcsclelecc. 1/4368 What is prob of sequence sw when two letters picked without replacement from iwcwcscacc? 1/45 What is prob of sequence ccc when three letters picked without replacement from {c: 4}? 1 Four letters picked without replacement from ttmwttntfftftmftmmmm. What is prob of sequence wmfm? 1/969 Four letters picked without replacement from essesssssssess. Give prob of sequence ssss. 30/91 Two letters picked without replacement from ugvvoougoou. Give prob of sequence oo. 6/55 Calculate prob of sequence sy when two letters picked without replacement from ssssyny. 4/21 What is prob of sequence equ when three letters picked without replacement from uumeuemmemqummmquumu? 7/1140 Two letters picked without replacement from {o: 3, x: 1}. What is prob of sequence ox? 1/4 Calculate prob of sequence my when two letters picked without replacement from ygym. 1/6 Calculate prob of sequence hiqi when four letters picked without replacement from yqiqyqhycyccciqch. 1/3570 Three letters picked without replacement from lsdplslsllspslsplll. What is prob of sequence lsl? 24/323 Three letters picked without replacement from {f: 2, i: 10, t: 6}. Give prob of sequence tti. 25/408 Four letters picked without replacement from {r: 1, m: 2, d: 14}. What is prob of sequence drdm? 13/2040 Calculate prob of sequence hh when two letters picked without replacement from {e: 4, p: 1, h: 3}. 3/28 Calculate prob of sequence fr when two letters picked without replacement from rrrrrrrrrrrfrfrfrrff. 15/76 Four letters picked without replacement from {x: 2, t: 1, j: 1, d: 1}. What is prob of sequence dtxj? 1/60 What is prob of sequence cy when two letters picked without replacement from {q: 1, y: 1, z: 2, e: 2, c: 1}? 1/42 Calculate prob of sequence ko when two letters picked without replacement from {o: 8, r: 3, k: 7}. 28/153 Three letters picked without replacement from nlnnnnnlnnnnnnnnnn. Give prob of sequence lnl. 1/153 Three letters picked without replacement from nnnnnnn. Give prob of sequence nnn. 1 Calculate prob of sequence sbb when three letters picked without replacement from {s: 1, r: 8, v: 2, b: 5}. 1/168 What is prob of sequence mm when two letters picked without replacement from mmmmmmmmmm? 1 Four letters picked without replacement from jtmjtmttttjt. Give prob of sequence mtmt. 7/990 Calculate prob of sequence zn when two letters picked without replacement from {n: 6, k: 4, z: 2}. 1/11 Calculate prob of sequence itzt when four letters picked without replacement from {z: 2, t: 2, i: 7}. 7/1980 Four letters picked without replacement from {j: 2, n: 2, f: 2, y: 1, q: 1, a: 4}. Give prob of sequence fjyj. 1/2970 What is prob of sequence oo when two letters picked without replacement from foofofooooo? 28/55 What is prob of sequence ht when two letters picked without replacement from hkkkhtkkkkkkkkt? 2/105 Calculate prob of sequence hrhh when four letters picked without replacement from {x: 1, r: 4, z: 5, c: 4, h: 5}. 5/1938 Calculate prob of sequence quq when three letters picked without replacement from {u: 5, q: 2, k: 5, t: 7}. 5/2907 Three letters picked without replacement from pppppp. Give prob of sequence ppp. 1 Four letters picked without replacement from {n: 1, g: 10, v: 9}. Give prob of sequence gggn. 2/323 Four letters picked without replacement from {j: 1, o: 6, u: 2, a: 3, g: 3}. Give prob of sequence goju. 1/910 What is prob of sequence jjub when four letters picked without replacement from bjoublbbojbuuubuu? 3/2380 Two letters picked without replacement from dootztzddzad. Give prob of sequence at. 1/66 What is prob of sequence kk when two letters picked without replacement from ckkcccckcccccc? 3/91 What is prob of sequence wuuu when four letters picked without replacement from {u: 4, w: 3}? 3/35 Calculate prob of sequence cbb when three letters picked without replacement from aobojcjaroobjc. 1/546 What is prob of sequence xjrj when four letters picked without replacement from rjrxrjjrjjjrrj? 3/286 Three letters picked without replacement from {r: 3, b: 1, t: 13}. What is prob of sequence tbt? 13/340 Three letters picked without replacement from yyywywyyyy. What is prob of sequence wyy? 7/45 What is prob of sequence ttt when three letters picked without replacement from {f: 5, v: 2, t: 4}? 4/165 Calculate prob of sequence vvvg when four letters picked without replacement fro	{ "pile_set_name": "DM Mathematics" }
353414 What is the distance between -56659 and -2050? 54609 Add together 9 and 54.2528228. 63.2528228 What is the distance between 1670695054 and 0.5? 1670695053.5 Add together 5478184.8 and -0.9. 5478183.9 Add together -4772 and -3514. -8286 What is -0.23106 - 356? -356.23106 What is the difference between 1.11069752 and -0.08? 1.19069752 What is -2.7 + 138.5906? 135.8906 0.055+21923902 21923902.055 Add -139483.295 and -3. -139486.295 What is 0.3 plus -1053121989? -1053121988.7 What is 17296982 - 5? 17296977 Work out -0.2318969 - 0.2. -0.4318969 What is 43 less than -8758657? -8758700 -555.6707 + 312 -243.6707 What is 518.02195 + 3.2? 521.22195 What is 1572177 take away 0.0165? 1572176.9835 What is -1732017.9 + -0.0751? -1732017.9751 What is 546280158 minus 7? 546280151 What is 2.1 plus 10478398? 10478400.1 Total of -27000 and -1203. -28203 Calculate 0.9 + -1095.3101993. -1094.4101993 What is 546635 less than 1.74? -546633.26 Put together 0.0142 and -235439. -235438.9858 What is 1.2476 + -4588530? -4588528.7524 Calculate 2700 + 25196. 27896 Calculate -0.06 + -14.8774343. -14.9374343 Sum 9696760 and 0.1. 9696760.1 What is -24 plus 0.0611348? -23.9388652 Calculate -344550 + 33. -344517 Put together 2 and 6646466. 6646468 What is the distance between 69204 and -41523? 110727 What is the distance between -0.042 and -21.1941? 21.1521 Subtract 25712779842 from -3. -25712779845 Calculate -165 + 0.18316681. -164.81683319 Sum -3.24 and 0.2691. -2.9709 What is 6.0592302 + -9? -2.9407698 -0.01 - 6.4950724 -6.5050724 Put together 2.49335 and 0.03035. 2.5237 What is 9 + 658804? 658813 Work out -0.731 + 97.801. 97.07 Calculate 0.37 + -21370. -21369.63 Calculate -1307963010 + 0.4. -1307963009.6 Total of 3 and 807.38556. 810.38556 Work out -0.0603 - 0.098263. -0.158563 What is 16.539 - 570? -553.461 What is -5074065062 + -8? -5074065070 Subtract 75470 from -6130. -81600 Work out -1 - -245014. 245013 What is 0.002 + 3.384848? 3.386848 What is 0.11379 - -385.75? 385.86379 Sum 67 and 1137762. 1137829 Add -546396450 and 5. -546396445 What is 3183819 + 7? 3183826 What is -0.142 + 4224439? 4224438.858 Calculate -0.22 + 66290.6688. 66290.4488 Calculate -0.004 - 186625. -186625.004 Work out -0.18640991 - 0.018. -0.20440991 Add 0.1 and -6503.7428. -6503.6428 Total of -0.566 and 1031168.4. 1031167.834 What is the difference between 2 and -1109667.31? 1109669.31 What is -73394 minus 85.4? -73479.4 Total of -91215.10498 and 3. -91212.10498 103845405 - -3 103845408 Total of 0.13 and -570291612. -570291611.87 What is 256.95 minus 1775? -1518.05 -4745375.4 - 1.1 -4745376.5 What is the difference between 2123 and -6999? 9122 Subtract 2060 from -516.917. -2576.917 What is 0.1 minus -16394783? 16394783.1 Put together 0.3 and -21591147. -21591146.7 Total of 2.1486 and -61.289. -59.1404 0+-0.14293424 -0.14293424 Calculate -5 - 9169.6149. -9174.6149 Subtract -0.31704 from -1155.55. -1155.23296 What is the difference between -1.9328702 and 0.05? 1.9828702 Sum -0.5 and 455782018. 455782017.5 Sum 0.4 and 1152299473. 1152299473.4 What is the difference between 3007688498 and -0.3? 3007688498.3 What is 0.37 less than 262051? 262050.63 Add together 0.2254018 and -2491. -2490.7745982 What is -20117029.9 minus 0.5? -20117030.4 -8.4 - -4522944 4522935.6 Subtract -0.67 from -17483360.3. -17483359.63 Subtract -106.6 from -36864. -36757.4 Work out 1994 - -456371. 458365 What is the difference between 0.5 and -0.14125688? 0.64125688 Put together -0.065 and -2.9753. -3.0403 What is -1.241 take away -248? 246.759 What is 33.1344 - -10190? 10223.1344 What is -78769339 plus -0.3? -78769339.3 What is 1.8 + -3.11992? -1.31992 Work out -524 + -46897. -47421 Calculate 82384363 + -10. 82384353 15008 + -39505 -24497 Add 3 and -7067.984. -7064.984 Put together 1482.3298 and 5589. 7071.3298 What is 2023865 take away -1.94? 2023866.94 -107168248+-3 -107168251 -46848 + -17571 -64419 Calculate -0.4 - -4201403653. 4201403652.6 What is 50828982 take away -0.59? 50828982.59 Add together -4 and -677547. -677551 Put together 564151 and -14. 564137 11420 + -63 11357 What is 1.137054361 - -0.5? 1.637054361 Work out -21375 - 2.79598. -21377.79598 What is 1395 minus -52506? 53901 What is the distance between -1.7 and 6112829? 6112830.7 What is -504746 - -1? -504745 Add 16874 and 164924. 181798 Calculate 11395.35445 + 0.13. 11395.48445 What is 54529052 plus -85? 54528967 What is -176823919 - -0.1? -176823918.9 What is -0.0656474281 plus 2.8? 2.7343525719 Calculate -5269 - -853.9. -4415.1 Work out -2211655.9 - 3. -2211658.9 1314750 + -0.2 1314749.8 What is -21675.8 - 8.22? -21684.02 Subtract -715008 from -0.04852. 715007.95148 Add together -0.0094538 and 1.44. 1.4305462 What is -37.035954 less than -0.1? 36.935954 Sum 105876662 and -0.2. 105876661.8 What is 797 take away -158.446? 955.446 What is the difference between 0.4248189 and -8? 8.4248189 What is 133 plus 724256? 724389 What is the difference between -46.786 and -278007? 277960.214 Subtract -3 from -25959466.81. -25959463.81 Subtract 38224.8 from 989. -37235.8 -3.35 + -75984888 -75984891.35 What is -0.1 less than 9225816935? 9225816935.1 What is -0.1065079 - 7.102? -7.2085079 Add 9329700 and 0.3. 9329700.3 Add together 1 and -3575564799. -3575564798 Add -135308503 and 6. -135308497 Total of 4500.3 and 89.163. 4589.463 -1011 + -366956 -367967 What is 5 + -18822968? -18822963 What is -1.61 minus -839136209? 839136207.39 What is 4.535 + 496? 500.535 What is the distance between -2894 and -2728145? 2725251 598.515+-0.5 598.015 What is the difference between 5.37 and -4.46? 9.83 What is the difference between 0.03 and -0.598448267? 0.628448267 Add together -1081379909 and -63. -1081379972 Put together -9 and 40162.02. 40153.02 What is -2 + -57457.19683? -57459.19683 What is the distance between 16 and 0.8822254? 15.1177746 Work out -568331 - 342.6. -568673.6 What is -1740790996 + 0.05? -1740790995.95 Calculate -0.0025865 + 181. 180.9974135 -0.3+-0.369550017 -0.669550017 What is -12234294 - 1154? -12235448 439.9+-23946576 -23946136.1 What is -0.1 take away -0.60760513? 0.50760513 Put together 3 and -68.0291. -65.0291 What is 5185.6065054 + 0? 5185.6065054 What is -3.3 take away -18.3929? 15.0929 Add together -4.09570448 and -4. -8.09570448 563+-0.15263785 562.84736215 What is -24878 - -2.371? -24875.629 What is -299 take away 6273.333? -6572.333 Calculate -110803 + 3242. -107561 -1.82 - -116408429 116408427.18 Total of -857 and -1.827398. -858.827398 Sum -35 and 96662. 96627 79120204 + 0.2 79120204.2 What is 9088 plus -5777? 3311 What is -90339583 take away 3? -90339586 What is the difference between -13 and -1596030? 1596017 What is 8807.302 minus -57? 8864.302 What is -272 plus -8937566? -8937838 What is the difference between 1223.8 and 0.7687? 1223.0313 Sum 23 and -75260.7. -75237.7 What is 23438582 - -4? 23438586 Work out -223 + 19.301. -203.699 What is 5 less than -66039.129? -66044.129 What is -0.02 less than 6091377? 6091377.02 -3699197305+3 -3699197302 -3107 - -343322.1 340215.1 Calculate 0.3 + 54.9232313. 55.2232313 -27162 + 2.7 -27159.3 What is -0.1456 + -7484880? -7484880.1456 What is the difference between 3208.7 and 475? 2733.7 What is -36.544 + -188.3? -224.844 Sum 1.924 and -5924. -5922.076 63.1 + -41.50916 21.59084 What is 837 + -1019585? -1018748 -0.068613 + 553 552.931387 Work out -6299.25 - -31. -6268.25 Total of 7 and -22.171494. -15.171494 What is -49258 + 261? -48997 What is -44.6 less than -2340943? -2340898.4 What is 4 plus -0.0034643223? 3.9965356777 Work out 272.2 + 220.22. 492.42 Put together 0.15 and 954275. 954275.15 Calculate 1.1284 - -572. 573.1284 Work out 0.5 + 3762736. 3762736.5 What is -3 + 22773.1? 22770.1 Calculate 100336 + -2928. 97408 What is the distance between 165 and 178628688? 178628523 Calculate 37 - 96719541. -96719504 What is the distance between -8707953 and 47? 8708000 What is -367 plus -33326896? -33327263 What is the distance between -358009.42459 and 1? 358010.42459 -0.1361 + -0.64851 -0.78461 193.5384 - 12.53 181.0084 What is the difference between 9.5491 and 1.2574? 8.2917 Put together 801858.37 and -1.2. 801857.17 Calculate -0.4 + 3857985. 3857984.6 Put together -522886499 and -3. -522886502 Work out -153	{ "pile_set_name": "DM Mathematics" }
97s3 + 179s*2 - 143s + 42. (s - 2)(s - 1)2(19s - 21) What is z in 80z*4 + 1572z*3 + 2436z*2 + 1088z + 144 = 0? -18, -1, -2/5, -1/4 Find i, given that i*4/4 - 85i*3/2 + 337i*2/4 - 42i = 0. 0, 1, 168 Determine g so that 2g2 + 12400g + 19220000 = 0. -3100 Solve -4r2 + 116r = 0. 0, 29 Factor 3w2/8 - 51w/2 + 99/2. 3(w - 66)(w - 2)/8 Determine p so that -3p5 - 60p*4 - 339p*3 - 210p*2 + 1692p - 1080 = 0. -10, -6, 1 Factor -4z2 + 1908z + 1912. -4(z - 478)(z + 1) Factor -238z3 + 248z*2 + 466z - 20. -2(z - 2)(z + 1)(119z - 5) Solve 5x2 - 140x + 980 = 0 for x. 14 Suppose -q*5/4 - 7q*4/4 + 57q*3/4 - 41q*2/4 - 14q + 12 = 0. What is q? -12, -1, 1, 4 Factor 1372f3/3 + 4704f*2 + 16128f + 18432. 4(7f + 24)3/3 Solve o2 + 246o + 729 = 0 for o. -243, -3 Factor -d5/4 - 4d*4 - 39d*3/2 - 28d*2 - 49d/4. -d(d + 1)2(d + 7)*2/4 Let -22i*3/7 + 116i*2/7 - 30i/7 = 0. What is i? 0, 3/11, 5 Determine c, given that 2c3 - 1528c*2/3 - 170c = 0. -1/3, 0, 255 Suppose -9w4/4 + 60w*3 - 597w*2/4 + 255w/2 - 36 = 0. What is w? 2/3, 1, 24 Factor y*3/2 - 13y*2/2 - 29y/2 - 15/2. (y - 15)(y + 1)2/2 Let -3r*3 - 7119r*2 - 5631129r - 1484741013 = 0. What is r? -791 What is u in u*2/2 - 2u - 21/2 = 0? -3, 7 Solve 50d5 + 10d*4 - 532d*3 + 808d*2 - 400d + 64 = 0. -4, 2/5, 1, 2 Factor 4v3 - 124v*2 + 536v - 416. 4(v - 26)(v - 4)(v - 1) Factor 2x*2/3 - 66x + 196/3. 2(x - 98)(x - 1)/3 What is s in -3s3 + 3357s*2 - 940797s + 937443 = 0? 1, 559 Find u such that -u*2/3 - 2u - 8/3 = 0. -4, -2 What is m in m4/2 + m3/2 - 3m2/2 - m/2 + 1 = 0? -2, -1, 1 Find h, given that -4h*4 + 60h*3 + 28h*2 - 396h - 360 = 0. -2, -1, 3, 15 Suppose -2a2/5 + 30a + 468/5 = 0. What is a? -3, 78 Find u, given that -2u4/7 - 2234u*3/7 - 6690u*2/7 - 6686u/7 - 2228/7 = 0. -1114, -1 Suppose -g*2/3 + 61g/3 - 20 = 0. Calculate g. 1, 60 Factor -2d3 - 30d*2 - 136d - 192. -2(d + 3)(d + 4)(d + 8) Let -3y*3/8 + 57y*2/8 - 75y/4 + 12 = 0. What is y? 1, 2, 16 Factor t4/2 + t3 - 3t2/2. t2(t - 1)(t + 3)/2 What is q in 5q*5 + 885q*4 - 1785q*3 + 895q2 = 0? -179, 0, 1 Suppose g3/6 - 187g2/6 + 365g/2 - 543/2 = 0. Calculate g. 3, 181 Factor -2l2 - 336l - 14112. -2(l + 84)2 Solve 5s*4 - 10s*3 + 10s - 5 = 0. -1, 1 Determine c so that -9c4/2 + 65c*3/2 + 128c*2 - 30c = 0. -3, 0, 2/9, 10 Factor 3s5 + 87s*4 + 750s*3 + 1758s*2 + 1599s + 507. 3(s + 1)3(s + 13)*2 Let 2f*5 + 230f*4 + 9110f*3 + 148770f*2 + 1069200f + 2822688 = 0. Calculate f. -44, -9 Factor -5l3 - 210l*2 - 585l. -5l(l + 3)(l + 39) Suppose -5h*3 + 3745h*2 - 706835h + 2086935 = 0. Calculate h. 3, 373 What is y in 3y3 + 62y*2 + 159y = 0? -53/3, -3, 0 Factor 2r3/7 - 138r*2/7. 2r*2(r - 69)/7 Factor s*4 - 60s*3 + 900s2. s2(s - 30)2 Let -2v*5/5 + 16v*4/5 + 4v*3 - 16v*2/5 - 18v/5 = 0. Calculate v. -1, 0, 1, 9 Factor -2k2/19 - 14k/19 - 12/19. -2(k + 1)(k + 6)/19 Factor 5c4/3 + 15c*3 + 50c*2 + 220c/3 + 40. 5(c + 2)3(c + 3)/3 Find s such that -9s2/5 + 3s - 6/5 = 0. 2/3, 1 Find z such that 31250z5/9 - 132500z*4/9 + 155600z*3/9 - 32416z*2/9 + 2464z/9 - 64/9 = 0. 2/25, 2 Factor -2l4 + 22l*3 + 272l*2 + 608l. -2l(l - 19)(l + 4)2 Factor 4g*4 + 4g*3 - 72g*2 - 208g - 160. 4(g - 5)(g + 2)*3 Let -2q*4/17 - 44q*3/17 - 330q*2/17 - 936q/17 - 648/17 = 0. Calculate q. -9, -6, -1 Factor -12g3/5 - 64g*2/5 + 48g/5. -4g(g + 6)(3g - 2)/5 Suppose -4n3 - 72n*2 + 244n - 168 = 0. Calculate n. -21, 1, 2 Determine i, given that 2i3/5 - 154i*2/5 + 302i/5 - 30 = 0. 1, 75 Determine n, given that -6n2 - 14n + 20 = 0. -10/3, 1 Factor -4u3 - 12u*2 + 472u + 480. -4(u - 10)(u + 1)(u + 12) Find t such that 3t*5 - 6t*4 - 36t*3 - 42t*2 - 15t = 0. -1, 0, 5 Factor -3r3 + 5r*2 - 2r. -r(r - 1)(3r - 2) Determine q, given that 2q*3 + 80q*2/7 - 24q/7 = 0. -6, 0, 2/7 Suppose -4q2 + 32q + 132 = 0. What is q? -3, 11 What is f in 4f3 + 41980f*2 + 110166012f + 110124036 = 0? -5247, -1 Find g, given that 115g3 + 240g*2 - 325g - 30 = 0. -3, -2/23, 1 Determine f, given that -45f5 + 450f*4 - 1135f*3 + 110f*2 + 1260f + 360 = 0. -2/3, -1/3, 2, 3, 6 Factor 3n2 - 66n + 288. 3(n - 16)(n - 6) Determine k so that 4k2/7 - 226k/7 - 120 = 0. -7/2, 60 Determine y, given that y*2 + 44y + 484 = 0. -22 Factor -2g2/13 - 174g/13 - 340/13. -2(g + 2)(g + 85)/13 Factor -8p2/21 - 6p/7 + 6/7. -2(p + 3)(4p - 3)/21 Determine u so that 3u*3 - 24u*2 + 15u + 42 = 0. -1, 2, 7 Factor -m*4/2 + 29m*3/2 + 15m2. -m2(m - 30)(m + 1)/2 Factor -11f3 - 47f*2 - 56f - 12. -(f + 2)*2(11f + 3) Find d such that 4d*3/7 - 296d*2/7 + 6256d/7 - 27744/7 = 0. 6, 34 Factor 5x2 - 170x - 175. 5(x - 35)(x + 1) Find f, given that -4f5 + 32f*4 - 16f*3 - 88f*2 + 20f + 56 = 0. -1, 1, 2, 7 Factor 3u4/5 - 6u*3/5 - 3u*2/5 + 6u/5. 3u(u - 2)(u - 1)(u + 1)/5 Let -2d5 - 62d*4 - 348d*3 - 232d*2 + 1424d + 1920 = 0. Calculate d. -24, -5, -2, 2 Determine s, given that 2s5/5 + 76s*4/5 + 74s*3/5 = 0. -37, -1, 0 Find x such that 2x*4/23 + 14x*3/23 - 6x*2/23 - 38x/23 + 28/23 = 0. -7, -2, 1 Let -h*4/8 - 5h*3/8 + 9h*2/8 + 81h/8 + 27/2 = 0. Calculate h. -3, 4 Find i, given that 2i4/13 - 250i*3/13 + 7686i*2/13 + 7938i/13 = 0. -1, 0, 63 Suppose -b*3/7 - 8b*2/7 - 9b/7 + 18/7 = 0. What is b? -6, -3, 1 Factor o*2/2 + 523o/2 + 261. (o + 1)(o + 522)/2 Factor 3n*2/8 + 1059n/8 + 1053/4. 3(n + 2)(n + 351)/8 Factor 2c2/21 - 2c/3 + 4/7. 2(c - 6)(c - 1)/21 Determine p so that 2p2/9 - 206p/3 - 620/9 = 0. -1, 310 Factor -3p4/7 + 855p*3/7 - 59616p*2/7 - 186624p/7. -3p(p - 144)*2(p + 3)/7 Factor -a*4/2 + 3a3/2 + a2 - 6a + 4. -(a - 2)2(a - 1)(a + 2)/2 Factor 6g4 - g3 - 18g2 - 9g + 2. (g - 2)(g + 1)2(6g - 1) Let -3y*4/2 + 75y*3 - 396y*2 = 0. What is y? 0, 6, 44 Suppose 4j*2 - 338j/3 + 56/3 = 0. What is j? 1/6, 28 Let 5r4/6 - 5r*3 + 15r*2/2 - 10r/3 = 0. Calculate r. 0, 1, 4 Determine u, given that -5u2 - 995u + 20710 = 0. -218, 19 Suppose 51u4/8 + 3u*3/2 - 153u*2/8 - 69u/4 - 3 = 0. What is u? -1, -4/17, 2 Let -2d3/5 + 352d*2/5 + 734d + 1860 = 0. Calculate d. -5, 186 What is g in -g*5/5 + 44g*4/5 + 48g*3/5 - 134g*2/5 - 47g/5 + 18 = 0? -2, -1, 1, 45 Let -2l4/13 - 152l*3/13 - 3034l*2/13 - 5476l/13 = 0. Calculate l. -37, -2, 0 Solve 5u3/4 + 5u*2 + 25u/4 + 5/2 = 0. -2, -1 Solve 2v5 + 12v*4 + 8v*3 - 12v*2 - 10v = 0 for v. -5, -1, 0, 1 Suppose -14v4/17 - 24v*3/17 + 358v*2/17 + 600v/17 - 200/17 = 0. Calculate v. -5, -2, 2/7, 5 Let -4l5 + 52l*4 - 72l*3 - 640l*2 - 512l = 0. Calculate l. -2, -1, 0, 8 Determine v so that -2v5/11 - 24v*4/11 + 6v*3/11 + 68v*2/11 - 48v/11 = 0. -12, -2, 0, 1 Solve l*2/3 - 46l/3 = 0 for l. 0, 46 Find w such that -2w4/7 - 148w*3/7 - 424w*2 - 980w + 7350 = 0. -35, -7, 3 What is w in -2w5/21 + 4w*4/21 + 2w*3/21 - 4w*2/21 = 0? -1, 0, 1, 2 Solve 2d*4/3 - 74d*3/15 + 88d*2/15 - 8d/5 = 0 for d. 0, 2/5, 1, 6 Determine t so that 2t2/23 - 292t/23 + 576/23 = 0. 2, 144 What is u in -1444u3 - 2432u*2 - 1024u = 0? -16/19, 0 Factor t*4/5 + 184t*3/5 + 2232t*2 + 215264t/5 - 476656/5. (t - 2)(t + 62)3/5 Factor 5t*2/8 + 309t/8 + 61/2. (t + 61)(5t + 4)/8 Determine o so that -3o2/4 - 612o - 124848 = 0. -408 Let -h*2/4 + 151h/2 - 22801/4 = 0. What is h? 151 Find o, given that 1900o2/7 + 544o + 16/7 = 0. -2, -2/475 Determine w so that 2w5/3 + 44w*4 + 726w*3 = 0. -33, 0 Factor -2r*3/3 + 82r*2/3 - 170r - 198. -2(r - 33)(r - 9)(r + 1)/3 Factor 4v*3/3 - 176v*2 - 16v/3 + 704. 4(v - 132)(v - 2)(v + 2)/3 Let o3/5 - 2354o*2/5 - 471o = 0. Calculate o. -1, 0, 2355 Determine q, given that q*3 + 423q*2 - 1704q + 1708 = 0. -427, 2 Solve -b*5/9 + 52b*4/9 - 92b*3/3 = 0 for b. 0, 6, 46 Suppose 27x*3 + 141x*2 + 192x + 36 = 0. What	{ "pile_set_name": "DM Mathematics" }
es before 7:46 AM? 12:21 AM How many minutes are there between 3:39 PM and 10:29 PM? 410 How many minutes are there between 10:55 AM and 6:56 PM? 481 What is 38 minutes after 4:37 PM? 5:15 PM How many minutes are there between 1:10 PM and 12:56 AM? 706 What is 485 minutes after 2:26 AM? 10:31 AM What is 420 minutes before 11:41 PM? 4:41 PM How many minutes are there between 12:23 PM and 8:00 PM? 457 How many minutes are there between 5:40 PM and 5:23 AM? 703 How many minutes are there between 4:23 PM and 6:18 PM? 115 What is 611 minutes after 1:45 AM? 11:56 AM How many minutes are there between 9:03 PM and 7:21 AM? 618 How many minutes are there between 12:56 PM and 3:35 PM? 159 How many minutes are there between 12:10 PM and 7:52 PM? 462 What is 584 minutes after 2:27 PM? 12:11 AM What is 553 minutes after 8:01 PM? 5:14 AM How many minutes are there between 2:44 AM and 11:56 AM? 552 What is 556 minutes before 11:37 PM? 2:21 PM How many minutes are there between 6:26 PM and 1:45 AM? 439 How many minutes are there between 1:11 PM and 9:27 PM? 496 How many minutes are there between 1:33 AM and 2:08 AM? 35 What is 41 minutes before 3:08 PM? 2:27 PM How many minutes are there between 10:30 PM and 9:13 AM? 643 What is 302 minutes after 12:57 PM? 5:59 PM How many minutes are there between 7:47 AM and 10:39 AM? 172 What is 677 minutes before 3:33 PM? 4:16 AM What is 505 minutes before 10:42 AM? 2:17 AM How many minutes are there between 2:10 PM and 4:01 PM? 111 How many minutes are there between 6:26 AM and 2:47 PM? 501 What is 142 minutes before 8:26 AM? 6:04 AM What is 344 minutes before 1:45 AM? 8:01 PM How many minutes are there between 2:03 AM and 12:26 PM? 623 How many minutes are there between 10:07 AM and 9:52 PM? 705 What is 467 minutes after 11:07 PM? 6:54 AM What is 344 minutes after 8:53 PM? 2:37 AM How many minutes are there between 9:47 PM and 9:15 AM? 688 How many minutes are there between 6:27 AM and 8:49 AM? 142 How many minutes are there between 11:47 PM and 11:24 AM? 697 What is 564 minutes after 3:51 AM? 1:15 PM What is 211 minutes before 3:40 AM? 12:09 AM What is 474 minutes after 10:24 AM? 6:18 PM What is 557 minutes before 10:02 PM? 12:45 PM What is 386 minutes after 7:34 AM? 2:00 PM What is 39 minutes after 5:14 AM? 5:53 AM How many minutes are there between 1:15 AM and 4:07 AM? 172 What is 663 minutes after 9:08 PM? 8:11 AM What is 444 minutes after 6:53 PM? 2:17 AM What is 76 minutes after 2:20 AM? 3:36 AM How many minutes are there between 4:37 AM and 3:04 PM? 627 How many minutes are there between 7:51 PM and 5:36 AM? 585 What is 715 minutes before 5:18 PM? 5:23 AM What is 270 minutes before 4:38 PM? 12:08 PM How many minutes are there between 1:04 PM and 5:15 PM? 251 How many minutes are there between 11:16 PM and 12:48 AM? 92 What is 337 minutes after 7:35 PM? 1:12 AM What is 610 minutes before 8:42 PM? 10:32 AM How many minutes are there between 3:28 PM and 1:58 AM? 630 What is 204 minutes before 4:08 PM? 12:44 PM What is 524 minutes after 6:52 AM? 3:36 PM How many minutes are there between 1:56 PM and 10:01 PM? 485 What is 171 minutes after 5:40 AM? 8:31 AM How many minutes are there between 10:08 AM and 2:38 PM? 270 How many minutes are there between 2:38 AM and 10:40 AM? 482 How many minutes are there between 8:07 AM and 7:16 PM? 669 How many minutes are there between 10:23 PM and 10:03 AM? 700 What is 35 minutes after 7:16 AM? 7:51 AM How many minutes are there between 9:41 PM and 5:05 AM? 444 What is 660 minutes before 8:10 AM? 9:10 PM What is 353 minutes after 12:01 AM? 5:54 AM How many minutes are there between 5:21 PM and 2:40 AM? 559 How many minutes are there between 8:03 PM and 2:30 AM? 387 How many minutes are there between 7:18 PM and 3:31 AM? 493 How many minutes are there between 8:15 PM and 9:31 PM? 76 What is 76 minutes after 3:11 AM? 4:27 AM How many minutes are there between 5:19 AM and 8:09 AM? 170 How many minutes are there between 10:01 PM and 2:27 AM? 266 How many minutes are there between 6:12 PM and 8:02 PM? 110 What is 136 minutes after 3:59 AM? 6:15 AM What is 697 minutes before 3:46 PM? 4:09 AM What is 587 minutes before 12:42 PM? 2:55 AM How many minutes are there between 3:42 AM and 10:40 AM? 418 How many minutes are there between 10:46 PM and 1:32 AM? 166 How many minutes are there between 7:01 PM and 6:28 AM? 687 How many minutes are there between 1:41 PM and 7:05 PM? 324 What is 39 minutes after 7:36 AM? 8:15 AM How many minutes are there between 7:15 PM and 7:29 PM? 14 What is 707 minutes after 10:26 AM? 10:13 PM How many minutes are there between 12:04 PM and 10:21 PM? 617 How many minutes are there between 1:58 AM and 6:13 AM? 255 What is 121 minutes before 2:59 AM? 12:58 AM What is 236 minutes before 11:21 AM? 7:25 AM What is 274 minutes before 1:36 AM? 9:02 PM How many minutes are there between 4:40 AM and 7:08 AM? 148 How many minutes are there between 3:42 AM and 4:22 AM? 40 What is 502 minutes after 9:08 PM? 5:30 AM How many minutes are there between 7:24 PM and 9:59 PM? 155 What is 117 minutes after 11:54 PM? 1:51 AM How many minutes are there between 10:28 AM and 6:28 PM? 480 How many minutes are there between 10:57 PM and 6:25 AM? 448 How many minutes are there between 6:45 AM and 8:32 AM? 107 What is 424 minutes after 10:26 PM? 5:30 AM What is 685 minutes before 8:42 PM? 9:17 AM What is 646 minutes after 9:04 AM? 7:50 PM What is 587 minutes before 10:02 AM? 12:15 AM What is 618 minutes after 10:45 AM? 9:03 PM How many minutes are there between 6:31 PM and 8:07 PM? 96 What is 246 minutes after 10:44 AM? 2:50 PM How many minutes are there between 8:10 AM and 7:58 PM? 708 How many minutes are there between 8:58 AM and 8:57 PM? 719 What is 249 minutes before 5:49 AM? 1:40 AM How many minutes are there between 2:05 AM and 10:13 AM? 488 How many minutes are there between 4:24 PM and 1:41 AM? 557 What is 92 minutes before 8:27 AM? 6:55 AM What is 680 minutes after 3:34 AM? 2:54 PM How many minutes are there between 4:21 AM and 10:49 AM? 388 How many minutes are there between 3:16 AM and 4:00 AM? 44 How many minutes are there between 12:26 PM and 3:19 PM? 173 How many minutes are there between 8:01 AM and 5:58 PM? 597 What is 492 minutes before 12:59 PM? 4:47 AM How many minutes are there between 3:48 AM and 9:19 AM? 331 What is 530 minutes after 4:01 AM? 12:51 PM How many minutes are there between 8:30 AM and 11:21 AM? 171 What is 39 minutes after 7:00 PM? 7:39 PM What is 685 minutes before 11:03 AM? 11:38 PM What is 305 minutes after 11:12 PM? 4:17 AM How many minutes are there between 5:34 PM and 10:32 PM? 298 What is 4 minutes before 2:11 AM? 2:07 AM How many minutes are there between 1:03 PM and 3:20 PM? 137 How many minutes are there between 12:22 AM and 11:53 AM? 691 How many minutes are there between 6:56 PM and 6:42 AM? 706 What is 372 minutes after 2:38 PM? 8:50 PM How many minutes are there between 6:42 AM and 7:38 AM? 56 How many minutes are there between 12:01 AM and 10:42 AM? 641 What is 107 minutes before 8:01 AM? 6:14 AM What is 660 minutes after 4:58 PM? 3:58 AM What is 560 minutes after 2:47 PM? 12:07 AM How many minutes are there between 6:42 PM and 9:37 PM? 175 How many minutes are there between 6:21 AM and 12:48 PM? 387 How many minutes are there between 7:32 AM and 2:44 PM? 432 How many minutes are there between 4:35 AM and 5:51 AM? 76 How many minutes are there between 6:01 PM and 3:57 AM? 596 How many minutes are there between 4:47 AM and 5:06 AM? 19 What is 195 minutes before 1:40 PM? 10:25 AM What is 92 minutes before 2:01 PM? 12:29 PM How many minutes are there between 9:09 AM and 11:28 AM? 139 How many minutes are there between 10:45 PM and 4:39 AM? 354 How many minutes are there between 9:44 PM and 4:00 AM? 376 What is 33 minutes before 5:01 AM? 4:28 AM How many minutes are there between 7:27 PM and 5:34 AM? 607 What is 525 minutes before 4:14 AM? 7:29 PM What is 697 minutes after 1:00 PM? 12:37 AM What is 597 minutes after 7:11 AM? 5:08 PM What is 443 minutes after 6:36 PM? 1:59 AM What is 388 minutes after 4:27 AM? 10:55 AM How many minutes are there between 4:15 AM and 2:12 PM? 597 What is 607 minutes after 4:05 PM? 2:12 AM How many minutes are th	{ "pile_set_name": "DM Mathematics" }
ivative of l7/18900 - l6/1350 + l*4/12 - 15l*2. Let a(y) be the second derivative of u(y). Solve a(w) = 0. 0, 4 Factor 94t*3 + 0t2 - t2 - 95t3. -t2(t + 1) Let j(o) be the third derivative of -o*5/15 - 6o*4 - 70o*3/3 + 26o2. Solve j(n) = 0. -35, -1 Let j(x) be the first derivative of x6/6 - 2x5/5 + 2x3/3 - x2/2 - 181. Factor j(r). r(r - 1)3(r + 1) Suppose 2w = 7w - 110. Let v be 4366/7 - w/(-77). Solve 48 - 89b5 - 226b*4 + 336b + 121b4 + vb*3 + 792b*2 - 136b*5 = 0 for b. -1, -2/3, -2/5, 2 Solve 220/7 + 2/7m*2 - 6m = 0. 10, 11 Let l be (4/(-2))/(5 + 235/(-30)). Factor lh3 + 0 - 2/17h*2 - 18/17h*4 + 8/17h*5 + 0h. 2h2(h - 1)*2(4h - 1)/17 Solve 1/9l*3 + 2/9l*2 + 0l + 0 = 0. -2, 0 Let p(x) = 2x4 + x2 + 6. Let v(k) = 3k4 + k3 + 2k2 + 13. Let l = -13 + 7. Let r(y) = lv(y) + 13p(y). Let r(s) = 0. What is s? 0, 1/4, 1/2 Factor -5c*5 - 50c*2 + 20c*4 + 30c*3 + 8 - 105c - 21 - 32 - 5c4. -5(c - 3)*2(c + 1)3 Let y(v) be the first derivative of -v8/10080 + v*6/2160 - 5v*3 - 13. Let z(m) be the third derivative of y(m). Solve z(r) = 0 for r. -1, 0, 1 Let n(x) be the first derivative of 21x*5/5 + 3x*4 - 10x*3 - 6x*2 + 9x - 13. Factor n(a). 3(a - 1)(a + 1)*2(7a - 3) Let m(z) be the first derivative of -z6/180 + 3z*5/20 + 5z*4/6 + 31z*3/3 - 33. Let o(u) be the third derivative of m(u). What is k in o(k) = 0? -1, 10 Suppose 12g + 153 - 465 = 0. Factor 1 - ga2 - 18a - 27a2 + 26 + 56a*2. 3(a - 3)*2 Let k be 8 - (-12 + 5) - 10. Factor 0u*3 + 0u + 0u2 + 7/2uk + 0 - u4. u*4(7u - 2)/2 Factor -604 + 9j4 - j5 - 18j - 9j*3 + 4j*5 - 33j*2 + 604. 3j(j - 2)(j + 1)*2(j + 3) Let p = 31 + -23. Suppose -pj = -7j. Factor 9w - 7w + jw4 - w4 + 1 - 2w*3. -(w - 1)(w + 1)*3 Let p(v) = -40v*3 + 1275v*2 + 17835v - 65325. Let r(x) = 11x3 - 319x*2 - 4459x + 16331. Let g(w) = -4p(w) - 15r(w). Factor g(m). -5(m - 3)(m + 33)*2 Let k(p) be the second derivative of 2/27p*4 + 8p + 0p2 + 0 - 4/27p*3 + 1/30p*5 + 1/189p*7 - 4/135p*6. Find f, given that k(f) = 0. -1, 0, 1, 2 Suppose -2a - 2o = -4, 3o + 4 = 2a - 0o. Let g be 2/a - (-4)/4. Let 0w + 8w - 2w2 + 2 - gw + 6w2 = 0. What is w? -1, -1/2 Let x(o) be the second derivative of o4/90 - 62o*3/45 + 961o*2/15 - 134o. Factor x(r). 2(r - 31)2/15 Factor 13/6 + 2w - 1/6w2. -(w - 13)(w + 1)/6 Let r = -17 + 89. Factor -3d4 + 40d + 38d - rd + 9d2. -3d(d - 2)(d + 1)2 Let q(m) be the third derivative of m6/30 - 28m5/15 + 53m*4/6 - 52m*3/3 - 2m*2 + 9m. Determine k, given that q(k) = 0. 1, 26 Let w(m) = m - 82. Let o be w(10). Let h = o - -77. What is a in 0a - a3 + 0a*4 + 0 + 1/3a*h - 2/3a*2 = 0? -1, 0, 2 Let m = 23 - 15. Let s be (-4)/20-5m. Find b such that -9b*2 + 3b*3 + 5 + s - 13 = 0. 0, 3 Let o(x) be the third derivative of -27x*7/280 - 3x6/20 - x5/10 - x*4/3 - 5x*2. Let d(l) be the second derivative of o(l). Factor d(p). -3(9p + 2)2 Let d(z) = -10z*2 + 24z + 10. Let v(h) = -4h2 + 10h + 4. Let x(f) = -5d(f) + 12v(f). Solve x(n) = 0 for n. -1, 1 Let z(d) be the third derivative of -d8/3360 - d7/5040 + d4/24 - d3/2 - 2d2 + 20. Let t(s) be the second derivative of z(s). Factor t(m). -m2(4m + 1)/2 Let c(w) be the second derivative of 0 - 3w*2 - 1/6w*4 + 3w + 4/3w3. Factor c(o). -2(o - 3)(o - 1) Let y(r) be the third derivative of r6/24 + r5/4 + 5r*4/8 + 5r*3/6 + 2r*2 - 184. Factor y(g). 5(g + 1)*3 Factor 20/3p*2 - 88/3 + 436/3p. 4(p + 22)(5p - 1)/3 Suppose 94 - 92 = s. Factor -97a*2 + 46a*s + 16a*3 - 10a*4 + 2a*5 + 43a*2. 2a*2(a - 2)*2(a - 1) Factor 2m2 + 2m*2 - 1084m*4 + 1088m*4 - 8 + 12m - 12m3. 4(m - 2)(m - 1)2(m + 1) Let p(d) = -2d3 - 2d*2 - 3d - 12. Let y be p(4). Let q = y + 739/4. Suppose qg2 - 3/2 + 3/4g = 0. Calculate g. -2, 1 Let m(h) = -5h - 15. Let q be m(-3). Let c(k) be the first derivative of 0k*2 + 0k*3 - 5 - 2/5k*5 + qk*4 - 1/3k*6 + 0k. Find s, given that c(s) = 0. -1, 0 Let -13122/11 - 42/11q4 - 180/11q*3 + 4374/11q - 2/11q5 + 972/11q*2 = 0. Calculate q. -9, 3 Let g(w) be the first derivative of 5w3/9 + w2/6 - 25. Let g(s) = 0. What is s? -1/5, 0 Suppose -4o - 29 + 93 = 0. Find x such that 8x*3 - 11x - 4x5 - ox + 23x = 0. -1, 0, 1 Let g(a) be the first derivative of 80a*2 + 20a + 245/4a4 + 385/3a*3 + 1. Factor g(t). 5(t + 1)(7t + 2)*2 Let j be -14 - (-770)/50 - 4/(-1). Factor 3/5p*3 + jp - 18/5p2 - 12/5. 3(p - 4)(p - 1)2/5 Let v be (-2)/4 - ((-763)/(-226))/(-7). Let l = v + 349/565. Suppose -li + 1/5i2 + 0 + 3/5i*3 - 1/5i*4 = 0. What is i? -1, 0, 1, 3 Let l(x) = 0x2 - x2 + 0x2 - 6 - 7x + 0x2. Let s be l(-5). Solve -8a + 3a2 - 4a2 - as - 13 - 2a4 + 8a3 + 17 = 0. -1, 2/3, 1, 2 Let n(f) be the third derivative of f8/2688 - f*7/35 + 17f*6/120 - 7f*5/80 - 137f*4/192 + 15f*3/8 - 517f2 + f. Let n(g) = 0. Calculate g. -1, 1, 2, 45 Let v(f) be the third derivative of -f8/19320 - f*7/9660 - 3f*3/2 - 13f*2. Let u(b) be the first derivative of v(b). Factor u(p). -2p*3(p + 1)/23 Let r(a) be the first derivative of a*4/22 + 8a3/33 - a2/11 - 8a/11 + 3. Find u, given that r(u) = 0. -4, -1, 1 Suppose 0s = -3s + 6. Suppose -5a - 3404 + 3419 = 0. Solve 3/2p4 + 1 - 11/2p - 13/2pa + 19/2p*s = 0. 1/3, 1, 2 Let o be ((50/(-4))/5)/(9 + -9 + -5). Let -1/2w*2 + 1/2w + o - 1/2w3 = 0. Calculate w. -1, 1 Suppose 7x - 11 = -7x + 45. Factor -1/2d*3 + 1/4d*x + 0 + 0d + 1/4d2. d2(d - 1)*2/4 Suppose -1 = -f - 5g - 3, -2f + 4 = 2g. Suppose -1 - 6 = -j + 2b, 3b = fj - 18. Let -8/5l*4 - 2/5 - 4/5l3 + lj - 1/5l + 2l*2 = 0. Calculate l. -1, -2/5, 1 Let v(x) = -46x*4 - 161x*3 - 191x*2 - 29x - 22. Let m(i) = 9i4 + 32i*3 + 38i*2 + 6i + 4. Let a(f) = -22m(f) - 4v(f). Solve a(q) = 0. -2, -2/7, 0 Let m(z) be the second derivative of -7z5/90 + z4/6 - 2z*3/27 - 27z. Suppose m(r) = 0. What is r? 0, 2/7, 1 Let j(t) = 5t5 - 2t*4 - 12t*3 - 2t*2 + 3t + 2. Let z(p) = -p4 - p3 - p*2 - p + 1. Let x(c) = j(c) - 2z(c). Factor x(o). 5o(o - 1)*2(o + 1)*2 Let u(x) be the first derivative of 0x*2 + 2/21x*3 - 2/35x*5 + 0x - 5 - 1/14x4 + 1/21x*6. Factor u(c). 2c*2(c - 1)*2(c + 1)/7 Let h(p) be the first derivative of 77/2p4 + 500p - 42 + 775p2 + 270p*3 + 2p*5. Factor h(n). 2(n + 5)*3(5n + 2) Let -9/7 - 6/7b + 3/7b2 = 0. What is b? -1, 3 Let g(l) be the first derivative of l5/10 - 3l*4/8 - 2l*3/3 + 3l*2 - 130. Suppose g(x) = 0. What is x? -2, 0, 2, 3 Let o = 323 - 320. Let k(y) be the first derivative of -1/3y*2 + 0y - 2 + 0yo + 1/6y*4. Factor k(x). 2x(x - 1)(x + 1)/3 Let a(f) be the second derivative of f*5/20 + 7f*4/12 + 7f*3/6 + 9f*2/2 - 10f. Let q be a(-6). Factor 0n2 + 3n*4 - qn3 + n5 - 3n2 + 2n*5. 3n*2(n - 1)(n + 1)2 Let a(p) be the third derivative of p5/4 - 11p*4/24 - 4p*3/3 + 4p*2. Let o(q) = -240q*2 + 177q + 129. Let g(y) = -33a(y) - 2o(y). Factor g(i). -3(i - 1)(5i + 2) Let p(w) = -26w*4 - 32w*3 - 20w*2 - 14w. Let f(x) = -35x3 - 9x*4 - 5x - 5x2 - 2x*2 + 24x*3. Let d(b) = 17f(b) - 6p(b). Factor d(s). s(s + 1)*2(3s - 1) Let f be 4/(-38) - (-472)/(-2014). Let p = -1/159 - f. Solve 0 + 2/3k*3 - 2/3k - 1/3k4 + pk*2 = 0 for k. -1, 0, 1, 2 Suppose 2a = 4u - 106, 4u - 7a + 10a = 91. Suppose -25 + u = x. Suppose 0w + x + 0w*3 - 1/2w*4 + 1/2w2 = 0. Calculate w. -1, 0, 1 Let a(v) be the second derivative of -v6/45 + v*4/6 - 2v*3/9 - 25v. Factor a(q). -2q(q - 1)*2(q + 2)/3 Let f(p) = -p*3 + 9p*2 - 12p + 31. Let z be f(8). Let u be (6 + 0 + -6)/z. Solve u + 1/10n3 - 1/10n - 1/10n4 + 1/10n*2 = 0. -1, 0, 1 Determine h so that 9/2h - 1/12h3 - 25/12h2 + 0 = 0. -27, 0, 2 Let u(d) be the third derivative of -d6/120 - d5/20 - d4/8 + 4d3 - 17d*2. Let x(y) be the first derivative of u(y). Factor x(a). -3(a	{ "pile_set_name": "DM Mathematics" }
44/9 Simplify 63(4sqrt(684) - sqrt(684))-3 - 1((sqrt(684) + (2 + sqrt(684))-4)*2 + -5). -6215 - 1260sqrt(19) Simplify (sqrt(833) - 2sqrt(833)-4) + -1 - (-5 + -2 + (sqrt(68)/sqrt(4))*2-2). 40 + 63sqrt(17) Simplify 6(((sqrt(176)-2 + sqrt(176))/sqrt(11))/sqrt(2) - (sqrt(80)/(-2sqrt(2)))/sqrt(5))5. -30sqrt(2) Simplify (3sqrt(55)-2)/(sqrt(25)/sqrt(5)-2) + (sqrt(440)/(-2sqrt(8)) + sqrt(55))/(sqrt(15)/(sqrt(15)/sqrt(5))). 7sqrt(11)/2 Simplify sqrt(72)/(2sqrt(6) + sqrt(6) + sqrt(6)) + (1 + sqrt(588))*2 + (sqrt(3)-2 + 2)*2 + (sqrt(3) - 5(sqrt(3) - (2 + sqrt(3)))). 43sqrt(3)/2 + 615 Simplify 5 + -6((-3 + (sqrt(2299) - (sqrt(2299) - -2sqrt(2299))-5))*2 + 1 + (1sqrt(2299))*2 + 2). -3545125 + 6336sqrt(19) Simplify (-3-2sqrt(500) - -6(1 + sqrt(500) - sqrt(500)))-6 + 2 + (sqrt(500) - (-3 + (2sqrt(500))2)) + 2. -2029 - 350sqrt(5) Simplify ((-11sqrt(102))/(sqrt(66)/sqrt(44)))*2-4 - ((sqrt(85) - (-4-1sqrt(85) - sqrt(85))) + sqrt(85))/((sqrt(5) - 2sqrt(5))3). -272 - sqrt(17)/3 Simplify (sqrt(672)/(sqrt(12)1) - (sqrt(280)/(-3sqrt(5)) - sqrt(56)))/((1sqrt(392) - sqrt(392))-5 - sqrt(392) - sqrt(392)-2-4). -sqrt(7)/27 Simplify (1(sqrt(672) - 5sqrt(672)))/((sqrt(30)/sqrt(5)5 + sqrt(6))-1). 8sqrt(7)/3 Simplify ((5(sqrt(1700) + 1) + sqrt(1700) + sqrt(1700))6 - (-1 + -2 + (sqrt(1700) + 0 - sqrt(1700))))2. 27720sqrt(17) + 2999889 Simplify ((sqrt(66) + sqrt(66)2)-2)/(-1sqrt(726)) - (sqrt(121) + (sqrt(121) - (sqrt(121) - (sqrt(121)21 + sqrt(121)))))/(sqrt(1584) + -2sqrt(1584)). 29sqrt(11)/33 Simplify (-2-4sqrt(200)-15 + -1 + 1-1sqrt(72)-2)*2. 776sqrt(2) + 301089 Simplify (2 + sqrt(1573) + 1 - sqrt(1573) - -3(1 + sqrt(1573)))-4 + -2(6(sqrt(1573)1 - sqrt(1573)) + (sqrt(1573) - (4 + -1 + sqrt(1573))) + sqrt(1573))2. -3188 Simplify (-2 + sqrt(1331) + 1 - (sqrt(1331) + -1 + sqrt(1331))-3)*2 + -1sqrt(66)/sqrt(6) + sqrt(539)-3. -638sqrt(11) + 65235 Simplify (3 + (4sqrt(105)/(sqrt(3)3))/((-6(-5sqrt(700) + sqrt(700)) - sqrt(700)) + sqrt(700)))5. sqrt(5)/36 + 15 Simplify ((sqrt(540) + -5sqrt(540))-5)/(sqrt(108)/(sqrt(45)/sqrt(5))-2). -30sqrt(5) Simplify ((sqrt(6)/sqrt(2) + 3 + sqrt(3) + sqrt(3))4)*2 + 2 + -6(-1 + sqrt(243) + 4). 234sqrt(3) + 560 Simplify 5 + (1sqrt(1008))*2 + (1sqrt(70))/sqrt(10) - (2sqrt(35)2)/(sqrt(15)/sqrt(27)). -11sqrt(7) + 1013 Simplify 5sqrt(78)/(sqrt(60)/sqrt(1000)) - (1 + (sqrt(208)-6)2 + 1). -7490 + 50sqrt(13) Simplify (5-2-1sqrt(150)/sqrt(3) - ((0 + sqrt(242))-3 + -1sqrt(242) + 4))2. -752sqrt(2) + 17688 Simplify (4 + (1-1sqrt(147) + 3 + (sqrt(147) - -1sqrt(147)3 - (sqrt(147) + sqrt(147) + 2sqrt(147) + -2 + sqrt(147))))2)5-5. -15425 + 3500sqrt(3) Simplify -5 + (sqrt(405)-12 + sqrt(405) + 5 + sqrt(405) + 1 + -1 + -1sqrt(405) + -2 + (sqrt(405) - (sqrt(405) + 0))-3 + sqrt(405))*2. 4 Simplify ((1sqrt(3520))/(sqrt(704)1) - (sqrt(3200)1)/(sqrt(360)-2 + sqrt(360)))2. 245/9 Simplify -5 + -2 + ((sqrt(13)3 + 1 + sqrt(13) + 2 + -5)*2 - ((sqrt(1300) - (5 + sqrt(1300)1))*2 + 1)). -16sqrt(13) + 179 Simplify ((-1 + 3sqrt(175) + (sqrt(175) - sqrt(175)3) + -3 + sqrt(175))3 + -5)2. -1020sqrt(7) + 6589 Simplify ((((2sqrt(187) - sqrt(187))5 + sqrt(187) + sqrt(187) + sqrt(187)13)-4)/(sqrt(11) + sqrt(11) + (sqrt(44)-3 - sqrt(44)) - sqrt(44)/sqrt(4)-3))2. 27200/9 Simplify (-23sqrt(175)-3-2 + -3)25. 5400sqrt(7) + 1134045 Simplify 1 + (-1 + (1((sqrt(64) - (sqrt(64) - (sqrt(64) + (sqrt(64) - (sqrt(64) + 1sqrt(64))))) - sqrt(64)) + sqrt(64)))/(sqrt(242)3))-6. 7 Simplify (-5(31sqrt(119) + (-2sqrt(119)5 - sqrt(119) - sqrt(119) - sqrt(119)) + sqrt(119)))/(sqrt(343)-3 - 3sqrt(28)/sqrt(4)). -15sqrt(17)/8 Simplify -3 + 3 + 4 + (sqrt(147) - (sqrt(147)-2 + sqrt(147))*2) + (-1 + sqrt(147) + (sqrt(147) - 1sqrt(147)) - (sqrt(147) - (sqrt(147) + 1 + -4))). -147 + 14sqrt(3) Simplify 0 + -2 + ((sqrt(300)4)*2 - sqrt(300)) + -4 + ((sqrt(300) + 4(0 + sqrt(300)))*2 - (sqrt(300) - sqrt(300)2-3)) + 3. -80sqrt(3) + 12297 Simplify 2((-1sqrt(132)2-2)/(sqrt(120)/(2sqrt(810))))2. 114048 Simplify (-4sqrt(76)-4 - (-3 + sqrt(76) + 4) - 4(sqrt(76) + (sqrt(76) + -4)1 + sqrt(76) + 2))2. 84sqrt(19) + 733 Simplify (-5 + 3(3 + (sqrt(567) - (sqrt(567) + -1)))2 + (sqrt(567) + -2 + sqrt(567))5-5 + -1)-6. -552 + 2700sqrt(7) Simplify (((-6-5sqrt(1452))/((-2sqrt(72)1)/sqrt(12)))2 + 2)3. 163356 Simplify sqrt(162) + (2sqrt(162))2-6 - (sqrt(162) + -2 + -1)*2 - (5(3 + sqrt(162) + -1) + 1). -4070 + 18sqrt(2) Simplify (((sqrt(20)/sqrt(4) + 4 - (sqrt(80) + -3 - sqrt(5)))6)*2 - (-1 + ((-1 + sqrt(80))-2)*2))3. -2928sqrt(5) + 6483 Simplify 1 + (1 + 6(3 + -2 + sqrt(448) + sqrt(448) + 0)5 + 1)2. 30720sqrt(7) + 1613825 Simplify ((5 + -3 + (sqrt(242) - (3 + sqrt(242) - sqrt(242))-1 - (sqrt(242)-2 + -5))3)-1)*2. 5148sqrt(2) + 20278 Simplify ((2(2sqrt(120)4)/sqrt(6))/((sqrt(40)-1 + (sqrt(10) - (sqrt(10) - (sqrt(10) - 1sqrt(10)))-2))-5))2. 512/25 Simplify 2 + sqrt(425) + -1 + (-1 + (sqrt(425) - (sqrt(425) + -5)))2 + ((-2(3 + sqrt(425)) - sqrt(425)) + sqrt(425) + 1 + -3)*2. 165sqrt(17) + 1781 Simplify (sqrt(1664) + sqrt(1664)1 - -2(sqrt(104) - sqrt(26)))/(sqrt(32) + sqrt(512) + sqrt(10)/(sqrt(25)/sqrt(5))). 6sqrt(13)/7 Simplify (4(3 + sqrt(468) + 2 + sqrt(468) + sqrt(468)) + -5)*2 + ((-4(-2sqrt(156) - sqrt(156)) + sqrt(156))/(sqrt(1200) - -1sqrt(1200)))*2. 2160sqrt(13) + 27048997/400 Simplify (4(sqrt(78) - sqrt(78)-2)-1)/(sqrt(864) - (sqrt(864) - -1sqrt(864))-4) + -3. -3 - sqrt(13)/9 Simplify (-5-2sqrt(1440))/(2sqrt(30)/sqrt(6)4)-11-6. 90sqrt(2) Simplify (-2((sqrt(80) + -1 - sqrt(80))-5 + sqrt(80)1 + sqrt(80) + 0)*2 + -4(sqrt(80)-1 + sqrt(80)) + (sqrt(80) + (0 + sqrt(80))5)*2 + sqrt(80) + 4)1. -156sqrt(5) + 2194 Simplify 1(1(sqrt(1053) + -2))2-2 - -1(-2 + (-2sqrt(1053))*2 + sqrt(1053) + 4). 81sqrt(13) + 2100 Simplify 4 + (2 + (-1sqrt(12))2)-4 + ((sqrt(12) - (sqrt(12) + 1 + 3)) + (sqrt(12) - sqrt(108)-1))2. -64sqrt(3) + 156 Simplify 1 + 64sqrt(128) + 0 + (4sqrt(32))/sqrt(4)-1. 1 + 184sqrt(2) Simplify (((sqrt(96)-3)/sqrt(12) + sqrt(8))-4)/(4sqrt(16) - (sqrt(96)/sqrt(4))/sqrt(6)) + -4. -4 + 8sqrt(2)/7 Simplify ((sqrt(450)/(sqrt(9) - sqrt(81)))/sqrt(10) + -3)-2 - (0 + ((sqrt(150) + (sqrt(150) - -2sqrt(150)))/sqrt(3))/sqrt(10)-4)*2. -1274 + sqrt(5) Simplify sqrt(27)/(sqrt(324)1) + 2 + (3(sqrt(300)2 - sqrt(9)/sqrt(3)4))2. sqrt(3)/6 + 6914 Simplify -6(-4(sqrt(72)-1 - sqrt(72)))*2 + -5(3(3 + sqrt(32)))2. -29493 - 1080sqrt(2) Simplify ((2sqrt(484)-6 - sqrt(484))/(sqrt(22)/(sqrt(4)/sqrt(2))))/((-4sqrt(16) + -2sqrt(400) + sqrt(4))2). 13sqrt(11)/54 Simplify -1 + (((sqrt(140)2 - sqrt(140))/sqrt(7) + -1)2 - (sqrt(10)/(-1sqrt(2)) + (sqrt(5) - sqrt(720)/sqrt(9)))). 20 Simplify (-26(5(sqrt(104) + (sqrt(104) - 1sqrt(104))) + sqrt(104))3)/(((sqrt(8) - (sqrt(72) + sqrt(72)-1 + sqrt(72))) + sqrt(72)-4)-5). -108sqrt(13)/35 Simplify (-4(-3 + (5(1 + sqrt(125) + 0) - (sqrt(125) - (-4 + 0 + sqrt(125)))4)))*2. -11200sqrt(5) + 53136 Simplify (((-3(sqrt(143) + sqrt(143)2) - sqrt(143)) + (6(sqrt(143) + 1sqrt(143) - sqrt(143)) - sqrt(143)))4)/(1sqrt(33)/(-5sqrt(3))2). 50sqrt(13) Simplify -5-3-6(-1 + 3 + sqrt(147))*2-53. 37800sqrt(3) + 203850 Simplify ((sqrt(2299) + 0 + sqrt(209)/sqrt(44) - (-3 + sqrt(19) + -1 + 2sqrt(76)))34-6)*2. 269568sqrt(19) + 4244400 Simplify (((sqrt(110) + sqrt(110)-1-4)-3)/(sqrt(50)/(sqrt(720)-2)) + 1)*2 + 5. 720sqrt(11) + 1425606 Simplify -3((sqrt(684)-5)*2-4 - (sqrt(684) + (sqrt(684) + 0)*2)1) + -3. 18sqrt(19) + 207249 Simplify (2 + 4 + 4 + -3 + 4 + -1 + sqrt(363) + 0 + sqrt(363) + -1)2. 396sqrt(3) + 1533 Simplify ((-6sqrt(72)/sqrt(144))/(sqrt(24)/(sqrt(4) + (sqrt(400)3 - sqrt(4)))))*26. 16200 Simplify (4(-1(-4 + 4 + sqrt(1573) + 1 + 5 + -1) + -1) + -3)*2. 2376sqrt(13) + 25897 Simplify -1((sqrt(12)-36 - (0 + sqrt(36)/sqrt(3)))61 + -4)2. -155968 - 1824sqrt(3) Simplify (5((sqrt(396)-4)/sqrt(4) + sqrt(11)-5 + 1 + -4))2. 2550sqrt(11) + 79700 Simplify sqrt(44) + -1 + 4 - sqrt(55)/(1sqrt(5)-2) - (-2 + (sqrt(44) + -1 - sqrt(3	{ "pile_set_name": "DM Mathematics" }
hen two letters picked without replacement from xkvslvkc? 1/56 What is prob of sequence biii when four letters picked without replacement from iibi? 1/4 Three letters picked without replacement from wfpcdddcdpqp. Give prob of sequence fdd. 1/110 Two letters picked without replacement from vvapoim. Give prob of sequence mi. 1/42 Two letters picked without replacement from bxnpxpxnnpn. What is prob of sequence bx? 3/110 Three letters picked without replacement from {t: 6, w: 2}. Give prob of sequence wtt. 5/28 What is prob of sequence ba when two letters picked without replacement from kbbkakkbab? 4/45 Three letters picked without replacement from {y: 6, w: 3, j: 1, d: 3}. What is prob of sequence dyw? 9/286 Two letters picked without replacement from xxeexxxxxxx. Give prob of sequence xx. 36/55 What is prob of sequence qk when two letters picked without replacement from {o: 3, k: 1, q: 6, b: 1, z: 3, u: 4}? 1/51 Two letters picked without replacement from {w: 2, k: 3, g: 3}. What is prob of sequence kk? 3/28 Four letters picked without replacement from {j: 2, w: 4, n: 2, o: 4, x: 2, q: 1}. What is prob of sequence oqnn? 1/4095 What is prob of sequence zjf when three letters picked without replacement from jfifzii? 1/105 Two letters picked without replacement from {y: 4, k: 2, f: 1, g: 3, z: 2, r: 2}. What is prob of sequence rf? 1/91 Two letters picked without replacement from {a: 4, z: 9, s: 3, d: 2}. Give prob of sequence ad. 4/153 What is prob of sequence ff when two letters picked without replacement from {h: 3, v: 1, e: 4, g: 1, f: 4}? 1/13 Four letters picked without replacement from {j: 4, f: 2, r: 2}. Give prob of sequence jjjj. 1/70 Three letters picked without replacement from {n: 11, h: 3}. Give prob of sequence nnn. 165/364 Calculate prob of sequence rtt when three letters picked without replacement from {r: 1, k: 1, h: 3, t: 5, p: 1, e: 2}. 5/429 What is prob of sequence gg when two letters picked without replacement from gvg? 1/3 Two letters picked without replacement from {f: 2, d: 2, x: 1, a: 1}. Give prob of sequence fa. 1/15 Four letters picked without replacement from {m: 2, g: 2, w: 1, y: 1, s: 12}. What is prob of sequence mgwg? 1/18360 Three letters picked without replacement from xxxxxxxxx. Give prob of sequence xxx. 1 Calculate prob of sequence ex when two letters picked without replacement from {o: 4, i: 6, e: 1, c: 1, x: 4, j: 2}. 2/153 Three letters picked without replacement from {q: 3, h: 1, u: 1, e: 6, d: 8}. Give prob of sequence qhq. 1/969 What is prob of sequence bb when two letters picked without replacement from {b: 3, k: 3}? 1/5 Four letters picked without replacement from rrrllrrrrrrrrlrrrrrr. Give prob of sequence llrl. 1/1140 Calculate prob of sequence fl when two letters picked without replacement from {f: 2, l: 3, s: 5, m: 3}. 1/26 What is prob of sequence rknn when four letters picked without replacement from {n: 2, k: 1, r: 1}? 1/12 What is prob of sequence lobd when four letters picked without replacement from {l: 12, d: 4, o: 3, b: 1}? 2/1615 Two letters picked without replacement from {x: 8, w: 6, d: 1}. What is prob of sequence dx? 4/105 Calculate prob of sequence ikz when three letters picked without replacement from {k: 2, z: 2, i: 2}. 1/15 Four letters picked without replacement from rrrararrra. Give prob of sequence aara. 1/120 Calculate prob of sequence gg when two letters picked without replacement from {c: 2, l: 2, g: 8, z: 2, i: 5}. 28/171 Four letters picked without replacement from {y: 4, h: 4, p: 2}. What is prob of sequence hpyh? 2/105 Three letters picked without replacement from {g: 4, j: 2, y: 1}. What is prob of sequence jyj? 1/105 Calculate prob of sequence bbxb when four letters picked without replacement from {c: 1, b: 11, x: 8}. 22/323 Calculate prob of sequence tyx when three letters picked without replacement from {a: 1, w: 2, y: 1, t: 3, x: 9, e: 3}. 3/646 Calculate prob of sequence uhjh when four letters picked without replacement from {m: 4, h: 2, u: 1, j: 2}. 1/756 What is prob of sequence ezg when three letters picked without replacement from zggegggrznzgngezgyyg? 1/95 Calculate prob of sequence vvk when three letters picked without replacement from {k: 2, v: 4}. 1/5 What is prob of sequence ho when two letters picked without replacement from nhiohuuhphuuuh? 5/182 Two letters picked without replacement from khnekej. Give prob of sequence hj. 1/42 What is prob of sequence vvvi when four letters picked without replacement from viivvii? 1/35 Three letters picked without replacement from npnpnlpnlnpln. What is prob of sequence lll? 1/286 Three letters picked without replacement from {d: 14, w: 4}. What is prob of sequence wwd? 7/204 What is prob of sequence sgdd when four letters picked without replacement from {s: 5, g: 4, d: 3, o: 2, q: 5}? 5/3876 Three letters picked without replacement from {y: 6, e: 3, q: 2, s: 3, m: 1, v: 5}. What is prob of sequence evy? 1/76 What is prob of sequence bhc when three letters picked without replacement from mmmbcmhbbmmbbmbbmm? 7/4896 Calculate prob of sequence ej when two letters picked without replacement from jjjjjjjjjjjjjjejjj. 1/18 Two letters picked without replacement from {s: 3, l: 2, d: 4, u: 2}. What is prob of sequence sl? 3/55 Three letters picked without replacement from {s: 1, t: 7, d: 5, h: 4, q: 1, x: 1}. What is prob of sequence tht? 28/969 What is prob of sequence th when two letters picked without replacement from tbheeebhebeebtbtehb? 1/38 What is prob of sequence mr when two letters picked without replacement from {v: 2, m: 2, r: 1, i: 1, p: 1}? 1/21 Two letters picked without replacement from {z: 2, g: 8}. Give prob of sequence zg. 8/45 Three letters picked without replacement from {r: 2, w: 4}. What is prob of sequence wrr? 1/15 Calculate prob of sequence szwj when four letters picked without replacement from {g: 3, z: 1, j: 1, x: 5, s: 1, w: 2}. 1/8580 Three letters picked without replacement from {f: 4, o: 10}. Give prob of sequence ofo. 15/91 Calculate prob of sequence iqe when three letters picked without replacement from ilppepqiqptpe. 2/429 Calculate prob of sequence wut when three letters picked without replacement from {m: 2, w: 2, x: 1, u: 1, t: 1}. 1/105 Two letters picked without replacement from gaaaaaaaaaaaaggaaa. What is prob of sequence ga? 5/34 Three letters picked without replacement from {k: 1, j: 1, m: 1, c: 1, y: 1}. Give prob of sequence kjy. 1/60 Four letters picked without replacement from zzzqzqzqqzzzzz. Give prob of sequence qqzq. 10/1001 Calculate prob of sequence wxo when three letters picked without replacement from dwowxxdo. 1/42 Four letters picked without replacement from mwkywwwxw. Give prob of sequence wwkx. 5/756 Two letters picked without replacement from {q: 2, t: 1, s: 11, v: 1, d: 3, f: 1}. What is prob of sequence dt? 1/114 What is prob of sequence iu when two letters picked without replacement from {w: 3, u: 3, i: 4, b: 1}? 6/55 What is prob of sequence bgg when three letters picked without replacement from {g: 2, b: 2}? 1/6 What is prob of sequence zovo when four letters picked without replacement from {o: 2, v: 3, z: 13}? 13/12240 What is prob of sequence raaa when four letters picked without replacement from naanrrnannnnaa? 5/1001 Two letters picked without replacement from wttppwwptwppwtww. What is prob of sequence tp? 1/12 Three letters picked without replacement from vvvbbbvvvvbbbb. Give prob of sequence bbb. 5/52 Calculate prob of sequence fm when two letters picked without replacement from cfnnfdmncnfccnf. 2/105 Three letters picked without replacement from hhzzc. What is prob of sequence zcc? 0 Four letters picked without replacement from {j: 3, i: 7, b: 5, n: 2}. Give prob of sequence nnbb. 1/1428 What is prob of sequence hn when two letters picked without replacement from {h: 1, n: 5, f: 1, u: 2, p: 3, e: 1}? 5/156 Calculate prob of sequence hpi when three letters picked without replacement from {r: 1, m: 6, p: 8, i: 1, w: 2, h: 2}. 2/855 Four letters picked without replacement from yylylllllyylllylyll. What is prob of sequence yyll? 77/1292 What is prob of sequence my when two letters picked without replacement from {z: 1, m: 2, k: 1, y: 1, o: 2, t: 1}? 1/28 Wha	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.