Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
-20539/156) Simplify bb(-10/7)b*(-1/20)b*(7/9)/(b/(bbb(17/2)/bb)) assuming b is positive. b(12347/1260) Simplify ((n/n10)/(n/n*(6/11)n))/(n*(-8)nn(1/15)) assuming n is positive. n(-581/165) Simplify ((m/m(2/7))/(m(-3/19)m))33 assuming m is positive. m(-561/133) Simplify w/(ww16)(ww/(((w(-13)w)/w)/w)w)/ww(ww*1)/(ww7) assuming w is positive. w(-5) Simplify (w*(-4)w/(w/(((w*(-5)ww)/w)/w))(ww3)/(w/(w/w(-1/7)ww)))(-26) assuming w is positive. w(520/7) Simplify (vv*(-7/3)/vv(-8))/(v(-3/10)v/(((v/v(-5/2))/vv)/v)) assuming v is positive. v*(-128/15) Simplify (rr(-6/7))(2/9)/(r/(r/(r*(-1)rrrr)))7 assuming r is positive. r(-1321/63) Simplify (((a/a(3/8))/aa)/(a(10/3)/a))/(a(4/15)/((a/a*13)/aa)) assuming a is positive. a*(-559/40) Simplify (u((u/(u/u(-1)))/u)/u)(-2/47)u(-2/3)uu/(uu*(5/8)uuu)u assuming u is positive. u(-2489/1128) Simplify (((s(-10/3)s)/s)/s*(-3/5))/((sss(-6)/ss)/(s(s/((s/(s/(s/(ss(-31)))))/s))/s)) assuming s is positive. s(-416/15) Simplify (z/z*11zz(3/5)zzz)/(z*(-8)zzz(4/3)) assuming z is positive. z(-11/15) Simplify ((dd/d(-2/5)d)*(1/8)d*1/(dd*(-7)d))(-22) assuming d is positive. d(-2827/20) Simplify (d/d*11d(-5/2)/d)/(d(2/15)/dd/d(-4)) assuming d is positive. d(-529/30) Simplify (x(6/7)/((x/x(2/7)xx)/x))/(x(1/3))(-25) assuming x is positive. x(157/21) Simplify j(1/8)/((j/(jj*2j)j)/j)((j*1jj)/j)/j(j/(j/(j(j/j7)/jj))j)/j assuming j is positive. j(-7/8) Simplify (((o/(o/o2oo))/o(o/o*3)/oo)(-3/5))(-11/6) assuming o is positive. o*(-33/10) Simplify (h/(((((hh/(h/h*(1/8)))/hh)/h)/h)/h)h)/(hh*(2/17)h)(h(4/5))(-44) assuming h is positive. h(-22741/680) Simplify (ssss/((s/(s/(s/(sss*(-7)ss)))s)/s)ss*(4/11))/(ss*(2/13)s)(2/31) assuming s is positive. s(5429/4433) Simplify ((y/(yy(-11))yy)/(yy4))/(y10y(-9/7)) assuming y is positive. y(-5/7) Simplify (t/(tt(-6)))(6/13)(t1)(-50) assuming t is positive. t(-614/13) Simplify (r(-21))(-1/6)/((rr/r(2/17))/r)(3/7) assuming r is positive. r*(743/238) Simplify ((ii/i*(-7)i)/i(-1/4))/(i/(i(11/3)/ii)i(-1/2)) assuming i is positive. i(161/12) Simplify m*(-23)m*(11/4)mmm*(-1/5)m(m/(mm/(mm/(m/((((m(-1/5)/m)/m)/m)/m)))))/m assuming m is positive. m(-453/20) Simplify ((q(-2)q)/q(-18))/(q(-16)q/q15) assuming q is positive. q47 Simplify ((ssss/(s/(s*1s)s)s)(-1/18)/((s(-3)ss)/(s/(s*(1/8)s)s)))(2/75) assuming s is positive. s(23/540) Simplify (((x(1/7)x)/x)/x*(-6)(x*(-2/13)x)/xxx(x(-7/2)x)/x)(-20) assuming x is positive. x(-8170/91) Simplify (d*(-27)/d)/((dd/(((d/(d*(-2/35)d))/d)/dd))/dd)((d28/d)/d)/(d(-1/2)/d) assuming d is positive. d(-241/70) Simplify (p(-11))(-26)p*(-2)/pp(2/31) assuming p is positive. p(8775/31) Simplify (h(h/((h/(hh/(hh/(h(-2/13)h)h))h)/h))/h)30/(((h10/h)/h)/h)(1/3) assuming h is positive. h(-271/39) Simplify ((q*(-1/9)q)/(q*0/q)q*0q(-2))(-22) assuming q is positive. q(22/9) Simplify ((r3/r)/r)/(r*11/r)((rr(-17))/r)/r4 assuming r is positive. r(-30) Simplify ((h(1/2)/h)(-20)(h*2hh)(5/6))27 assuming h is positive. h360 Simplify i(-7)iii*(-11/4)ii(-8)/(i/(i/(i(-9)/i))) assuming i is positive. i(-19/4) Simplify (l(16/9)l/((l/l*8)/l))/((ll(1/21))/l)(-2/41) assuming l is positive. l(27845/2583) Simplify (u/(u/((u(-1)u)/u)uu))30/((u/u(-4/3))/(u5/u)) assuming u is positive. u(-265/3) Simplify (((y6/y)/y(1/10))12)(3/8) assuming y is positive. y(441/20) Simplify ((nnn(-3/8))/(nn(-3)))/(n15/(n*15n)) assuming n is positive. n*(37/8) Simplify kk/k*(-1/3)k*(2/11)(k/((k/k(2/13))/k))/((k/k(-1)k)/k) assuming k is positive. k(716/429) Simplify (((jj(-5)/j)/j(-11))(6/19))41 assuming j is positive. j*(1476/19) Simplify (((f((f/((ff(2/25))/f))/ff)/f)/(ff/((f/f1f)/ff)f))(-16))(-26) assuming f is positive. f*(-11232/25) Simplify qq*22q/(q((q/(q(-24)/q))/q)/q)q*23q19 assuming q is positive. q41 Simplify ((y/(y/(yy(-2/17)))(((y/(y/(y/(y/y(4/7)))))/y)/y)/y)/(y(-1)yy)(11/3))(12/11) assuming y is positive. y(-7444/1309) Simplify (m28((mm/(m(mm/((m/m*(3/37))/m))/m))/m)/m)/(m(m(-17)/m)/m)38 assuming m is positive. m*(26267/37) Simplify ((((((h(h*(-1/4)/h)/h)/h)/h)/h)/h)/(hh*(3/8)/h)((h*(2/7)h)/h)(14/11))42 assuming h is positive. h(-9723/44) Simplify ((m(3/2)m)/(m(mm(-14))/mm))/(m*(-1)mmm/(m/(m/((mm32)/m)m))) assuming m is positive. m(87/2) Simplify (p(-1/10)p(1/4))/(pp2)(9/5) assuming p is positive. p(-21/4) Simplify (i(-20)/ii(i*19ii)/ii)/(i*(-2/17)ii/i(-5)) assuming i is positive. i(-100/17) Simplify ((j(1/25))26)(1/5) assuming j is positive. j(26/125) Simplify n(-18)/(nnn((n/(n/((nn(-28/3)nnn)/n)))/n)/nn)(n*(-2/5)n)/(n/(n(-6)/n)) assuming n is positive. n(-316/15) Simplify (t/(t/(t/(t/t*24))t)((t/t(-1/11)t)/t)/t)/((tt/(t/(t/(tt*(-5/2))))t)/t6) assuming t is positive. t(541/22) Simplify ((c*(-1/3)c)(2/9)/(c(-3/2)c(-8)))(-2/165) assuming c is positive. c(-521/4455) Simplify (l(7/9)l(-2/49))(-5/2) assuming l is positive. l*(-1625/882) Simplify (s/(sss(-8/3)s)ss/s(1/14))(1/14) assuming s is positive. s(109/588) Simplify g10gg(g/(g/(g(-5/3)/g)))/gg(gg*(-5)/gg)(-3/22) assuming g is positive. g(326/33) Simplify bb/(b/(b(3/11)b))b(1/10)(bb/b(-3/2)b)(-4/11) assuming b is positive. b(81/110) Simplify ((bb(-2/9))9)50 assuming b is positive. b350 Simplify (j(jj(1/40)/j)/jj*(-1))/(jj/(jj(-22))j(-3/14)/j) assuming j is positive. j(-6373/280) Simplify (((v/(v*9/v))/v)/(v(((vv(1/3))/v)/v)/v))/(v/v4)(-31) assuming v is positive. v(-301/3) Simplify (yy(yy/y*(2/17))/yyy)(-9/4)/(y/(yy/(((y/y*(-4))/yy)/yyy)))(9/2) assuming y is positive. y(-2277/68) Simplify (i*(1/2)/(ii(i(13/4)i)/i))/((i/(((i/(i*(-1/2)/i))/ii)/i))/i(-1/20)) assuming i is positive. i(-43/10) Simplify l/l*(-3/4)l*(-10)ll(-2)l12 assuming l is positive. l(11/4) Simplify (((p/(p*(-6/13)/p)pp)39)(-30))(-2/57) assuming p is positive. p(3480/19) Simplify v4/(v/(v(-12)v))(v(v/v*(-2/11))/vv)(-13/2) assuming v is positive. v(-244/11) Simplify ((mm(-2/13)m)/mm(m*(15/8)m)/mm)(-1/37) assuming m is positive. m(-491/3848) Simplify (((g/(g/(g/g(-3))))/g)/g(14/5))/((g/(g(2/5)gg))/g)(9/4) assuming g is positive. g(28/5) Simplify (u(1/2))3/(u(3/17)/(uuuu(-1))) assuming u is positive. u(113/34) Simplify (d*(2/17)d(-4/7))/(d(-5))(-33) assuming d is positive. d(-19689/119) Simplify (y*(-1/9)y/(y/(y(1/19)/y)))/(y/y(3/8))(-13) assuming y is positive. y(9667/1368) Simplify (b8/((b/(b/b(2/19)))/b)(bb(-4/5))/(b/(b/b5b)))(10/11) assuming b is positive. b(88/19) Simplify (f(-4)ff(2/19))/(f(-3))(3/8) assuming f is positive. f(-269/152) Simplify (b(1/6))(-2/77)bb(-4)b(2/9) assuming b is positive. b(-1928/693) Simplify (bb(1/18)b/(bb21))/(b3b10) assuming b is positive. b(-593/18) Simplify (q/(q*(-39)q)q(1/34)q)26 assuming q is positive. q(17693/17) Simplify (jj(3/4))(6/11)/((j/j(1/7)j)/(j/((j/j(-15))/j))) assuming j is positive. j(-2295/154) Simplify ((b/(b/(b*(-10)b))(b(-4/5)/b)/b)(4/11))(14/11) assuming b is positive. b(-3304/605) Simplify (w/(ww(-7)/w))44(ww*23w)/(w(-13)/w) assuming w is positive. w391 Simplify q*(-8/3)qq8q/(qq(4/5)/qq)qq12 assuming q is positive. q(278/15) Simplify (a*12/(a/(a/(((a(a/(a/a*7))/aa)/a)/a))a))/(a/a(-18)aa/(a/a(-16))a) assuming a is positive. 1 Simplify (n/(n(-20)/n))/n(-25)((n/(n1/n)n)/n)(-2/11) assuming n is positive. n(515/11) Simplify ((k/(kk/k(3/4)k))/(kkk(-31)))(1/5) assuming k is positive. k(111/20) Simplify ((t0/t)**	{ "pile_set_name": "DM Mathematics" }
+ 28m - 31 to tm + q and give t. -182 Rearrange 243 - 243 + 5p3 - 48p*2 + 48p*2 + 6p*3 + (0 + 0 - 2p*2)(-p - p + p) to the form wp2 + op + g + tp3 and give t. 13 Rearrange -l4 + l3 - 2l + 58 + 3l2 + 61 - 182 + 63 to al*4 + xl + ql3 + yl*2 + w and give q. 1 Express 18 - 18 + 36y*2 + 48y*2 as iy*2 + uy + l and give i. 84 Express -8u + 4u - 1 - 3u3 + 4u*3 + 3u*2 + 0u - 3u4 as ju + gu2 + h + nu*4 + vu*3 and give g. 3 Rearrange -2v2 - v3 + 23v - 3v*4 + 0v*2 - 3v*3 + 2v*3 to the form rv*3 + nv*4 + yv + bv2 + s and give y. 23 Rearrange (7l2 - l2 - 2l2)(-36l - 19l - 39l) to pl*2 + xl + u + wl3 and give w. -376 Rearrange -3h*2 + 18h - 5h3 - 63h + 45h to the form qh*3 + gh + b + ih2 and give i. -3 Rearrange 282 + 8l + 2l2 + 15l + 3l3 - 285 to the form fl*3 + ql*2 + p + al and give a. 23 Express 8d - 6d - 42d3 - 69d*3 + 18d*3 in the form td + pd2 + jd*3 + m and give j. -93 Express 987z - 2053z + 844z as p + qz and give q. -222 Express 18m - 34m - 27m - 126m in the form ym + g and give y. -169 Rearrange -366t - 280t + 274t + 1248t to the form jt + g and give j. 876 Rearrange (-68d*3 - 27d + 27d)(-103 + 6d + 110 - d) to the form qd*4 + l + id + kd3 + ad*2 and give l. 0 Express 31n + 2 - 2 - 397n in the form a + un and give u. -366 Express -264g - 31g + 10g + 7g in the form vg + m and give v. -278 Express ((2 + 2 - 2)(-3x + 0x + x) + 2x - 1 + 1)(23 + 11 + 16) - 6x + 3x + 2x as o + rx and give r. -101 Express -3d + 2d + 8d - 71d*2 - d - 3d in the form cd2 + n + yd and give c. -71 Rearrange (-5j - 3j + 3j)(41 - 39 + 2j + 91) to dj + m + yj2 and give y. -10 Rearrange (-4k*2 + 2 - 2 + (0 + 1 + 2)(-k*2 - 3k*2 + 5k*2))(7k2 + 5k*2 - 6k*2) to the form h + jk*3 + wk + sk2 + tk*4 and give h. 0 Express (-180w + 102w - 112w)(-2 - 2w*3 + 1 + 3) as bw*4 + aw*2 + cw + o + fw3 and give o. 0 Express (-168 + 281 - 135 - 75k)(3 + 0 - 1)(0k - 2k + 3k) in the form j + xk + gk2 and give x. -44 Express 18h*2 - 4h*3 + 2h*4 - 6h - 3h4 + 28h*2 - 48h*2 in the form mh*2 + w + gh*4 + zh + th3 and give t. -4 Rearrange -263b*2 - 1042b*2 - 736b*2 + 286b*2 to wb*2 + f + sb and give w. -1755 Rearrange (-3 + 3q2 - 14 - q2)((8q - 5q + 9q)(2 - 4 + 1) - 3q - q + 6q) to the form f + rq3 + zq*2 + vq and give r. -20 Rearrange -674q - 11776 + q3 + 11776 to the form xq*2 + hq + rq3 + u and give r. 1 Express -157 - 145x - 159 + 27x + 2x*2 + 316 as r + dx + ix2 and give d. -118 Express 448 - 10a*3 - 489 - 12a*3 in the form ia + f + ha2 + va*3 and give f. -41 Express (-8a - a - a - 4a - a + 0a - 2a + 2 - 2 - 3a + 2a + 2a + (2 - 1 + 0)(4a + 0a - 2a))(-6a - a - a) as l + ba + fa*2 and give f. 112 Rearrange -1974l*3 + 1974l3 + l4 + 6 + l + l*2 + 0 to xl + t + jl4 + nl*2 + fl*3 and give t. 6 Express (72 - 193 - 73)(-2u2 - 2u*2 + 3u*2 + (2u + 0u - u)(-u + u + u) + 0u2 - 3u*2 + 5u*2) in the form xu*2 + bu + h and give x. -388 Express 6 + 7 + 12t - 20 + 6 in the form gt + k and give k. -1 Express 49j2 + 35 - 35 + 117j*2 in the form cj*2 + mj + f and give c. 166 Express (0r2 - 2r*2 + 4r*2)(2 - 2 + r) + 2134r3 + 33r*3 + 687r*3 in the form nr*2 + fr*3 + q + ar and give f. 2856 Rearrange (25u - 1801 + 1801)(3 - 4 - 5) to b + su and give s. -150 Rearrange (-2 - 4 + 5)(-23h2 + 67h - 67h)(2 - 5 + 1) to the form uh2 + t + oh and give u. -46 Rearrange 2n2 + 8n*2 + 10n*2 - 7n*2 to the form b + wn + hn2 and give h. 13 Rearrange (2o - 6o + 2o)(-6229 + 7762 + 7320 + 9190 - 854) to the form uo + c and give u. -34378 Express -61t + 83t - 128t + (t + 3t + 2t)(-4 + 2 + 1) as n + mt and give m. -112 Rearrange 15r + 7r + 19r + (-5r - r + 2r)(-5 + 2 + 2) to the form kr + p and give k. 45 Express -1 + 2h2 + 160h - 158h - 16h*4 - 2h*3 + 18h*4 + 5 as xh*3 + gh*4 + m + lh*2 + dh and give d. 2 Rearrange (1 - 3 + 3)(-2o - 32o3 - o2 + 2o*2 + 31o*3) to p + vo*2 + bo + uo3 and give v. 1 Rearrange -7h - 453h2 - 20h - 7 + 446h2 + 7 to wh*2 + a + uh and give w. -7 Rearrange 11 + 2374b - 1184b + b*2 - 1188b to cb + sb*2 + a and give a. 11 Express (3 - x - 3 + x + 4 - 4 - 3x + 2x + 0x + (-x - 2 + 2)(2 + 2 - 6))(46 - 25 + 110) as qx + b and give q. 131 Rearrange 4s*4 + 6s - 3 + 5 - 26s3 + 29s*3 to the form c + zs*4 + is*3 + ms*2 + os and give o. 6 Rearrange (-8t + 16t - 14t)(3 + 16 + 18)(-3 + 3 + 1) + 0 - 2t + 0 + (-t - 1 + 1)(-3 + 2 + 3) to o + vt and give o. 0 Express -23w3 + 5w*2 - 5w*3 - 2w*2 + 189w + 9w3 - 188w as yw3 + l + mw*2 + hw and give h. 1 Rearrange -23w2 + 531w*2 - 235w*2 to iw*2 + r + jw and give r. 0 Rearrange 5w + 7 + 0 + 3 - 5 to l + nw and give l. 5 Rearrange (4 + 16 + 11)((-4 + 4 - 2d)(3d + 3d - 4d) + (-4d2 - d2 - 2d*2)(-2 + 1 + 3)) to z + pd + sd*2 and give s. -558 Rearrange 451n - 234 + 463 - 229 to p + jn and give j. 451 Rearrange -a2 + 4a*2 - 2a*2 + (3a*2 - 7a*2 + 2a*2)(3 - 4 + 3) + (271 - 749 + 390)(a - a + a2) to the form i + ta*2 + ja and give t. -91 Rearrange 40 + 25h2 - 26 + 4h*3 + 46 - 23h*2 to the form y + uh*2 + oh + sh3 and give y. 60 Express 8856x*2 + 55x*3 - 4427x2 + x4 - 4410x2 as bx*3 + fx*2 + px*4 + sx + l and give p. 1 Rearrange (-1 + 1 - 1)(j + 0 + 0) - 270j + 542j - 270j + 308 to zj + o and give z. 1 Rearrange 3 - 252d - 3 + 87d to fd + o and give o. 0 Express ((-5m + 3m + m)(3 - 5 + 3) + 4 - 4 + 2m)(-95 - 39m + 44 + 42m) in the form k + lm + am2 and give k. 0 Rearrange -24 + 4k - 21 + 47 + (-1 - 1 + 3)(5k - 5k + k) - k - 1 + 1 + 0 - 2k + 0 to f + hk and give h. 2 Rearrange (2 - f2 - 2)(-3 + 0 + 2) + 8049848f + 1402f*2 - 8049848f to if + z + cf*2 and give c. 1403 Rearrange -19n + 3n3 - 47n + 48n to the form ln + an3 + jn*2 + v and give l. -18 Express -2b - 4 - 12b + 4 + 1 as qb + r and give r. 1 Rearrange (n + 2n - n)((-1 - 3 + 2)(-3n + 2n + 3n) + 3n - n - 3n + 4n - n - 4n + (1 - 1 - 2)(n + 0n + n)) to the form tn + xn*2 + w and give w. 0 Express 12t*2 - 4 + 1 - 2 - 6 as at + g + ht2 and give h. 12 Rearrange -10u*2 + 32u*2 - 2u - 23u2 + 3 to the form t + fu + qu2 and give f. -2 Express 3t2 + t2 - 146t + 43t + 57t as ut*2 + q + zt and give z. -46 Express (-4t2 - t2 + 4t*2)(-13 - 21 + 844t2 + 34) as yt*4 + rt + at3 + qt*2 + n and give y. -844 Rearrange (-197 + 197 - 35a*3)(10a - 6a + 10a) to the form ha + j + wa2 + oa*3 + ba*4 and give b. -490 Express (-4 - 6 + 3)(-373v - 1 + 62v + 39v) in the form t + nv and give n. 1904 Express 4o - 3o + 620 + 392 - 5 as vo + c and give v. 1 Express -3b*2 + 40 + 30b*2 - 41 - 3b in the form vb2 + k + lb and give k. -1 Express 4u2 - u2 + 49 + 47 - 168 as l + qu + pu2 and give l. -72 Rearrange -121r + 58r + 388r + 891r to mr + s and give s. 0 Express -1471h2 + 2h - 2h - 44h*2 - 760h*2 in the form fh*2 + j + rh and give f. -2275 Express -47d3 - d2 - 2d - 2 + 96d3 + 99d*3 in the form nd + ud2 + y + sd*3 and give s. 148 Rearrange (-5m - 6m - 12m)(0 + 0 - 13m) to xm2 + g + wm and give x. 299 Rearrange -13 + 12 + 18 - 2o4 + (2o + 3o - 2o)(-o3 + 0o*3 + 0o*3) to the form ho*3 + jo*4 + ao + so2 + w and give w. 17 Rearrange 71225f - 71225f + 126f*2 to the form y + cf + pf2 and give p. 126 Rearrange (8 - 293x + 290x + 15)(-5x3 + 4x*3 + 2x*3) to the form n + ax*3 + tx*4 + lx + bx2 and give t. -3 Express -15 - 10m*3 + 29m*3 + 22 + 15 - 17m*3 as f + sm*2 + om*3 + im and give f. 22 Express 1 - 8v - 15v + 3739v3 - 3731v*3 as zv + k + pv3 + jv*2 and give k. 1 Rearrange (0x - 4x + 5x)(23x*3 - 86x*3 + 13x*3 - 54x*3) to the form ix*2 + u + ax*4 + kx*3 + sx and give a.	{ "pile_set_name": "DM Mathematics" }
29)(q - 1027)/3 Let -5f*5 + 298205f*4 - 4460145200f*3 + 412218350340f*2 = 0. What is f? 0, 93, 29774 Factor -2b*3/9 - 868952b*2/3 - 2606854b/9. -2b(b + 1)(b + 1303427)/9 Let 4b*4 + 106b*3 - 3232b*2 + 16574b + 9108 = 0. What is b? -46, -1/2, 9, 11 Factor 68p4/13 - 496974p*3/13 + 1210774824p*2/13 - 983505202848p/13 + 433663735680/13. 2(p - 2436)3(34p - 15)/13 Determine w so that -4w*3 - 5884w*2 - 1659632w + 1665520 = 0. -1090, -382, 1 Factor -116f3 - 25117706f*2 - 1359695804504f + 70329160536. -2(f + 108266)2(58f - 3) Factor 4i*2 - 862236960i + 46465785949377600. 4(i - 107779620)2 Determine g, given that -3g*5 + 8487g*4 + 3937815g*3 + 7816161g*2 - 11762460g = 0. -404, -3, 0, 1, 3235 Solve r*4 - 121r*3 - 3399r*2 + 79749r + 266490 = 0 for r. -35, -3, 18, 141 Solve -3l4 + 2337l*3 + 1198461l*2 - 9701385l + 18255150 = 0. -359, 3, 5, 1130 Factor -d*2 - 771691d - 2315064. -(d + 3)(d + 771688) Solve -2j*3 - 64122j*2 - 555090030j - 645656066550 = 0. -15345, -1371 Factor -d*2/3 - 8672d + 260260/3. -(d - 10)(d + 26026)/3 Suppose -4h*3 - 64640h*2 - 129268h - 64632 = 0. Calculate h. -16158, -1 Factor -2h3/5 + 25744h*2/5 - 5790494h/5. -2h(h - 12643)(h - 229)/5 Solve -d4/10 + 65791d*3/2 - 3947361d*2/10 + 2960497d/2 - 1644715 = 0. 2, 5, 328943 Factor -5j3 + 397030j*2 - 1191055j + 794030. -5(j - 79403)(j - 2)(j - 1) Determine y, given that y5/6 + 2251y*4 + 14782603y*3/2 - 4271444194y*2/3 - 10239787480y - 17705647008 = 0. -6844, -4, -3, 189 Determine u, given that 3u2/2 + 205178484u + 7016368382756376 = 0. -68392828 Solve 3r4 - 11226r*3 - 964692r*2 + 2063976r + 7896864 = 0 for r. -86, -2, 4, 3826 Factor 3q3/5 - 20616q*2/5 - 41289q/5 + 61866. 3(q - 6874)(q - 3)(q + 5)/5 Find n, given that n5/8 + 825971n*4/4 + 341110742495n*3/4 - 1364483855739n*2/2 - 23877728848575n/8 + 100288500991875/4 = 0. -825975, -6, 7 Suppose -4096a3 + 818048a*2 - 43188433a + 230565606 = 0. Calculate a. 6, 6199/64 Solve -n*3/4 - 3049n*2/4 + 2575825n/4 - 485494727/4 = 0. -3767, 359 Solve -5r4/3 + 22030r*3/3 + 955585r*2/3 + 1408850r = 0 for r. -38, -5, 0, 4449 Let p*3 + 25549p*2 - 383434p + 664664 = 0. Calculate p. -25564, 2, 13 Find n, given that -4n2 - 5499380n + 10998776 = 0. -1374847, 2 Let 457o3/2 + 16001o*2/2 + 63171o + 828 = 0. Calculate o. -23, -12, -6/457 Let -j*5/6 - 119j*4/6 - 1223j*3/2 - 6303j*2/2 - 4473j = 0. What is j? -71, -42, -3, 0 Solve j*5 + 114j*4 + 419j*3 - 13626j*2 + 13284j + 164808 = 0 for j. -109, -14, -3, 6 Solve u*4/3 - 396u*3 + 117389u*2/3 + 79846u = 0. -2, 0, 111, 1079 Let -14r4/25 - 5074r*3/25 - 301844r*2/25 - 4081104r/25 - 756864/5 = 0. Calculate r. -292, -360/7, -18, -1 Determine x so that 2x2/5 - 317198x/5 + 317196/5 = 0. 1, 158598 Factor 3k3/4 + 13871523k*2 - 55486101k + 55486104. 3(k - 2)2(k + 18495368)/4 Determine g so that 2g4/13 + 30654412g*3/13 - 91963250g*2/13 + 61308836g/13 = 0. -15327209, 0, 1, 2 Find v such that 2v5/13 - 4812v*4/13 - 204670v*3/13 - 2353296v*2/13 - 4111840v/13 - 1958400/13 = 0. -20, -1, 2448 Determine a so that 2a4/9 + 540542a*3/9 - 32a*2/3 - 25945760a/9 + 69189376/9 = 0. -270271, -8, 4 Suppose -3d5/4 + 2913d*4/4 + 39330d*3 + 578217d*2 + 1864272d + 1718640 = 0. What is d? -28, -20, -2, 1023 Factor -2n3/15 + 23882n*2/15 + 670264n/15. -2n(n - 11969)(n + 28)/15 Determine d, given that d5/5 + 191d*4 + 34719d*3/5 - 116611d*2/5 - 138892d/5 + 451164/5 = 0. -917, -41, -2, 2, 3 Find y such that -2y4/9 - 33172y*3/9 - 139386514y*2/9 - 15197989856y/9 = 0. -8237, -112, 0 Find x such that 2x5/19 - 1144x*4/19 + 42394x*3/19 + 88228x*2/19 + 2352x = 0. -1, 0, 42, 532 Find j, given that -12j5 - 19816j*4 - 2850568j*3 - 142806528j*2 - 2431820556j - 794844792 = 0. -1498, -51, -1/3 Solve 2c2 - 824260c + 41208000 = 0 for c. 50, 412080 Suppose 501k4 - 1112217k*3 + 620598573k*2 - 3679983495k - 22058082 = 0. Calculate k. -1/167, 6, 1107 Suppose s*2/2 - 280664905s + 78772788898659025/2 = 0. What is s? 280664905 Factor -5m4 + 4253780m*3 - 25522560m*2 + 51045040m - 34030000. -5(m - 850750)(m - 2)3 Factor q2/3 + 224425q/3 + 523642. (q + 7)(q + 224418)/3 Factor -5m2 - 9703625m + 19407270. -5(m - 2)(m + 1940727) Solve 3t4 + 90t*3 + 519t*2 - 2232t + 1620 = 0. -18, -15, 1, 2 Determine o so that 332o5 - 5256o*4 + 12052o*3 + 3512o*2 - 17040o - 2912 = 0. -1, -14/83, 2, 13 Factor 3r4 + 221925r*3 + 4104336429r*2 + 4104114507r. 3r(r + 1)(r + 36987)2 What is x in 5x*2 - 37215x - 73143350 = 0? -1615, 9058 Factor -2a2/11 - 140796060a/11 - 2477941313940450/11. -2(a + 35199015)2/11 Determine p, given that -p3/2 + 246p*2 - 23530p = 0. 0, 130, 362 Find k, given that -2k5/13 + 2770k*4/13 - 909214k*3/13 - 34698634k*2/13 - 209387520k/13 + 244992600/13 = 0. -27, -9, 1, 710 Let -3x3/5 + 2703x*2/5 + 29040x - 1054500 = 0. What is x? -74, 25, 950 Factor 3o2 - 9945o + 7306152. 3(o - 2216)(o - 1099) Determine z, given that -z*3/3 - 16735151z*2/3 + 33470311z - 50205471 = 0. -16735157, 3 Suppose 2h2/9 + 92828h/3 + 2041248 = 0. Calculate h. -139176, -66 Solve 338a4/9 - 99424a*3/9 + 8189456a*2/9 - 13660416a - 31049568 = 0 for a. -2, 22, 1782/13 Solve 6t5 + 13202t*4 - 22102t*3 - 180650t*2 - 189392t - 44040 = 0 for t. -2202, -2, -1, -1/3, 5 Let -i*5/3 + 108i*4 - 710i*3/3 - 27156i*2 + 27285i = 0. Calculate i. -15, 0, 1, 17, 321 Factor l*3/8 + 29461l*2/8 + 3607929l/4. l(l + 247)(l + 29214)/8 Factor -2q2/13 - 8662q/13 - 9256268/13. -2(q + 1918)(q + 2413)/13 Solve x*5/3 + 3617x*4/3 - 3633x*3 - 141097x*2/3 + 300418x/3 - 50680 = 0 for x. -3620, -6, 1, 7 Suppose n*5/4 + 135n*4/4 - 7523n*3/4 - 15711n*2/4 + 3761n/2 + 3894 = 0. Calculate n. -177, -2, -1, 1, 44 Find k, given that 2k3 + 537734k*2 + 5377190k + 13442850 = 0. -268857, -5 Factor -29s3 + 364s*2 - 1401s + 1710. -(s - 3)*2(29s - 190) Factor -2a*3/11 - 284488a*2 + 3129370a/11. -2a(a - 1)(a + 1564685)/11 Determine z so that -2z*5 - 10294z*4 - 930472z*3 - 1778624z*2 + 3721920z + 7279200 = 0. -5055, -90, -2, 2 What is l in -2l4/5 - 15394l*3/5 + 215778l*2/5 - 200446l + 308440 = 0? -7711, 4, 5 Factor -a*3/5 + 4500137a*2/5 - 1012562100952a + 5062806004624/5. -(a - 2250068)*2(a - 1)/5 Factor -780x2 + 30982x/5 + 1744/5. -2(x - 8)(1950x + 109)/5 Factor -4c*3 - 2618544c*2 - 5237076c - 2618536. -4(c + 1)2(c + 654634) Factor 3c3 - 5781c*2 + 270429c + 276213. 3(c - 1879)(c - 49)(c + 1) What is z in -5z*5 - 146065z*4 - 19513290z*3 - 883322440z*2 - 14075087840z - 24770655360 = 0? -29079, -44, -2 Let 3a3/4 - 135771a*2/4 + 543045a/4 - 407277/4 = 0. What is a? 1, 3, 45253 Factor -4q2/7 + 23176q/7 + 6560660. -4(q - 7355)(q + 1561)/7 Factor -i*2/7 + 5085203i/7 - 5085202/7. -(i - 5085202)(i - 1)/7 Find a such that a2/2 - 4818892a + 11610860053832 = 0. 4818892 Find b, given that -b*5/5 - 21608b*4/5 - 38907833b*3/5 - 18284763274b*2/5 + 36686336484b/5 - 18362643768/5 = 0. -19678, -966, 1 Find y, given that 2y2 - 11525384y + 16604309543432 = 0. 2881346 Determine a, given that -4a4/9 + 634a*3 + 365938a*2/9 + 18268a - 121024 = 0. -61, -2, 3/2, 1488 What is n in -3n2/4 - 55871517n/2 - 1040542137293763/4 = 0? -18623839 Find t, given that 4t2 - 6452t - 157152 = 0. -24, 1637 Suppose g*4 - 698g*3 + 1392g2 = 0. Calculate g. 0, 2, 696 Factor j2/2 - 1903607j/2 + 4759005. (j - 1903602)(j - 5)/2 Factor x*3/3 - 48865x*2 + 1758816x - 15828372. (x - 146559)(x - 18)2/3 Factor 5u*2 + 29186450u + 42592443180125. 5(u + 2918645)2 Solve 2k*5/19 + 9032k*4/19 + 1225556k*3/19 + 1207496k*2/19 - 1225558k/19 - 1216528/19 = 0 for k. -4376, -139, -1, 1 Factor -t*3/5 - 48714t*2/5 + 370443t - 17599472/5. -(t - 19)*2(t + 48752)/5 Factor 2t2 + 38580564t + 186057489819762. 2(t + 9645141)2 Find g, given that 3g*3/5 - 2868g*2 - 433092g/5 + 184704 = 0. -32, 2,	{ "pile_set_name": "DM Mathematics" }
to -1 in 4, 0.0908, -0.1? -0.1 What is the closest to 1 in -31, -5, 0.3? 0.3 What is the closest to 0 in -82, 0, 5? 0 Which is the nearest to 30? (a) 0.2 (b) -9 (c) -2 (d) 4 d What is the nearest to 54 in 5, 1/5, 3/2? 5 Which is the closest to 0? (a) -0.3 (b) 0.5 (c) 3 (d) 5 a Which is the nearest to 1? (a) -1/3 (b) 0.02 (c) 0.3 (d) -6 c Which is the nearest to 1.8? (a) -2/319 (b) -4 (c) -1 a What is the closest to 0.1 in 2/9, -4, -0.05, 0.2? 0.2 What is the nearest to -0.1 in 3, -1, -0.5, -0.12? -0.12 Which is the closest to -2/5? (a) 2/17 (b) 5 (c) -4 (d) 1 a Which is the closest to -0.2? (a) 2/17 (b) -0.02 (c) 0.2 b Which is the nearest to -2? (a) 2/9 (b) -80 (c) -0.4 (d) -0.1 c What is the nearest to -0.1 in 2/5, 2/17, 7? 2/17 Which is the nearest to -2/3? (a) 55.4 (b) 3/2 (c) 1/4 c Which is the nearest to 9? (a) -1 (b) -3 (c) 1 (d) 0.05 c Which is the nearest to -3? (a) 2 (b) -0.5 (c) 3 b Which is the closest to 0.1? (a) -4/7 (b) 3 (c) -1/3 (d) -6 c Which is the closest to 5? (a) -10.2 (b) 0 (c) 2 c Which is the nearest to 8? (a) -28 (b) -3/4 (c) 20/9 c Which is the closest to -2/5? (a) 6/5 (b) -15 (c) 4/5 c What is the nearest to 0 in -10, 1/13, 0.4, 0.5? 1/13 Which is the nearest to 1? (a) 1/125 (b) 4 (c) 4/3 c What is the closest to 0.4 in -9/8, 4, -2/37? -2/37 What is the closest to -0.2 in -1252, -3, 3? -3 What is the nearest to 1/2 in 5, -0.58, 0.04? 0.04 Which is the closest to 0.3? (a) 0.1 (b) -0.1 (c) -1 (d) -9 a What is the nearest to 1 in -0.045, 5, 4? -0.045 What is the nearest to -2 in -20, 2, -1, -19? -1 Which is the nearest to -1/7? (a) -3 (b) 16 (c) -2/11 (d) 3/4 c What is the nearest to 2/5 in 11, 0.014, -0.3? 0.014 Which is the nearest to -0.1? (a) -5 (b) 5 (c) 4/9 (d) 0.06 d What is the closest to 19 in -4, 5, 0? 5 Which is the closest to 1? (a) 10/9 (b) -2/11 (c) 3/4 (d) -2 a What is the nearest to -4.3 in -4/9, 2, -5, -0.4? -5 Which is the closest to 0.1? (a) -4 (b) -0.5 (c) 0.5 (d) -70 c What is the nearest to 7 in 0, 1/7, -0.02? 1/7 What is the nearest to 0.1 in 4, -4, -47, -5/3? -5/3 What is the closest to 0.3 in -0.1, 0.3, -14? 0.3 Which is the nearest to 0.05? (a) -3 (b) 0.4 (c) -2/11 c Which is the nearest to 2? (a) 1/3 (b) 5 (c) -1/5 (d) 2 d Which is the nearest to -1? (a) 1/3 (b) 1 (c) -15 (d) 0.14 d What is the closest to 0.1 in -5, 0, 2/7, 1.6? 0 Which is the nearest to 1? (a) -1/3 (b) -5 (c) 1 (d) -192 c What is the closest to 0.1 in 2, -2/11, -0.5, 1/10? 1/10 Which is the nearest to -5? (a) -1/2 (b) 0.06 (c) 2 a Which is the nearest to 0.2? (a) 0 (b) -11/5 (c) -0.1 a What is the closest to -1 in -2/3, -5, 148, -1? -1 Which is the closest to -0.1? (a) -6 (b) -31 (c) -5 c What is the closest to 1 in 4, -6, -2/7? -2/7 Which is the closest to -2/5? (a) 0 (b) 49/3 (c) -0.5 c What is the nearest to 1/2 in 2/7, 2, -25? 2/7 What is the closest to 53 in -3, 5, 1/6? 5 Which is the closest to 42? (a) 2/13 (b) 1/8 (c) -4 (d) -5 a What is the closest to 1 in 5, 1, -2/19, -0.5? 1 Which is the nearest to -5/8? (a) 4/9 (b) 0.3 (c) -4 (d) 0 d What is the closest to -1 in 0.3, -2/3, 1? -2/3 What is the nearest to -8 in 1.8, -5, 0, -3? -5 Which is the nearest to -1? (a) 0.2 (b) 3 (c) 13 (d) -1/6 d What is the nearest to -0.2 in -2/3, -2/7, -2/5, 1? -2/7 What is the closest to -1 in -2/17, 2, 0.5, -2/19? -2/17 Which is the nearest to -5? (a) 0.4 (b) -12 (c) -17 a What is the nearest to 0.1 in 5, -1201, 2? 2 What is the nearest to 1 in 4, 120, -2/13? -2/13 Which is the closest to 0.1? (a) 1/5 (b) -5 (c) -5803 a Which is the nearest to 1/3? (a) 2.1 (b) -1 (c) -4 (d) -5 b Which is the nearest to -0.1? (a) 0.05 (b) 2/13 (c) -0.2 c What is the closest to 7/3 in -2, -1/3, 1, 0.1? 1 What is the closest to -20 in -0.1, 4, 1/5, 3? -0.1 Which is the closest to -0.1? (a) -69/2 (b) -2/5 (c) 0.5 b What is the closest to -2 in 5, -1, 0.4, -0.5? -1 What is the nearest to -1 in -74, -5, 4/3, 0.3? 0.3 What is the nearest to 81/4 in 3, -3, -0.2? 3 What is the nearest to -1/12 in -24, 0.4, -0.3? -0.3 Which is the nearest to -0.1? (a) 5/44 (b) -1/12 (c) -3 b What is the nearest to 100 in -4, -1, -5, 6/11? 6/11 What is the nearest to 0 in -2/3, -928, 1/4? 1/4 Which is the nearest to 1? (a) -0.3 (b) -1.6 (c) -1/2 (d) 1/14 d Which is the nearest to 4? (a) 3/4 (b) 2.3 (c) -1 (d) -0.4 b Which is the closest to 4? (a) 69 (b) -2/5 (c) 4/7 c Which is the nearest to 1? (a) 3/8 (b) -1 (c) 9 (d) -8 a Which is the closest to 3? (a) 0.6 (b) 30 (c) 1/4 a Which is the nearest to -417? (a) 1/10 (b) -4 (c) 0.3 b Which is the nearest to 5/2? (a) -2 (b) -7 (c) -3 a What is the closest to -2 in 4, -970/3, 3/8? 3/8 What is the closest to -0.2 in 5, 41, 4? 4 What is the nearest to 1/4 in -0.04, -2/5, -25, -1/4? -0.04 Which is the nearest to 2/7? (a) -0.1 (b) 0.3 (c) 0.12 (d) 1/2 b Which is the closest to 0.2? (a) 4 (b) 0.2 (c) -5 b Which is the nearest to -0.1? (a) 0.3 (b) 3 (c) -1 (d) 768 a Which is the closest to -1? (a) 0.08 (b) 0.05 (c) 0.09 (d) -0.4 d What is the closest to -0.1 in -3/8, -0.1, 22, -3? -0.1 Which is the closest to -2? (a) 2/17 (b) 0.39 (c) 2/7 a What is the closest to -2 in -6, -38, 5? -6 What is the nearest to 0.06 in 3/5, 0, -1? 0 Which is the closest to 1? (a) 0 (b) -2/15 (c) 0.1 (d) -0.001 c What is the nearest to -2 in -3, -0.13, -5, 0? -3 Which is the closest to 96? (a) 1 (b) 0.1 (c) 4/5 (d) -2 a What is the closest to 0.1 in 3, -0.1, 0? 0 What is the closest to 0.1 in -3/8, -4, 3? -3/8 Which is the nearest to -1? (a) 4 (b) 0.34 (c) -2/15 c Which is the closest to 1? (a) 0.05 (b) 33 (c) -7 a Which is the closest to 0? (a) 2 (b) 0.3 (c) 19 (d) -4 b Which is the closest to -2? (a) 0.2 (b) 0.5 (c) 2 (d) 4 a Which is the nearest to 285? (a) -0.5 (b) 5 (c) -2 b What is the closest to -1 in 4, -4/3, 8, 19? -4/3 Which is the nearest to -1? (a) 0.1 (b) -0.35 (c) 0 b What is the nearest to 3/2 in 3, -0.2, 1? 1 What is the closest to -2/11 in -1/8, 27, 0.5? -1/8 What is the nearest to -1/2 in -1/4, -9/4, -0.8? -1/4 What is the nearest to -2/5 in 7, 3, 5, -0.2? -0.2 What is the nearest to 1/5 in -2/11, 2/5, 0.5, -0.4? 2/5 What is the nearest to -2/3 in -4/7, 0.07, 0.174? -4/7 What is the nearest to 1/4 in -2.5, -2, -3/4? -3/4 Which is the closest to -12? (a) -4 (b) 5 (c) 2 (d) -2 a Which is the closest to -1/3? (a) -2 (b) 1 (c) 7.3 b What is the closest to 0.4 in 1, -0.7, -2.4? 1 What is the closest to 1 in -1/2, 4/7, 274? 4/7 What is the closest to -0.6 in 4, -5, 1/2? 1/2 Which is the closest to -2/3? (a) 1 (b) -1/3 (c) -2/7 b Which is the closest to 1? (a) 2.1 (b) -3 (c) 0.4 (d) -2/191 c What is the closest to 0.1 in -0.4, 0.17, 4.1? 0.17 What is the nearest to 6/19 in 35, 1, 4? 1 Which is the closest to -4/13? (a) 0 (b) 5 (c) 74 a What is the closest to 1 in -5, 0, 40.7? 0 What is the closest to -15 in 7, -0.1, 0.06? -0.1 What is the nearest to 0.1 in -18, 3, 1, 22? 1 Which is the closest to -1? (a) -0.1 (b) 0.21 (c) 0.02 a Which is the closest to 2/3? (a) 26/11 (b) 3 (c) -3/7 c What is the closest to 1/8 in 0, -0.01, 3, 35? 0 What is the nearest to 1 in 2/13, -0.176, -1/3? 2/13 Which is the closest to 452? (a) 1/4 (b) 3 (c) 0.5 (d) -1/2 b What is the nearest to -1/4 in -4, 0.1, 5, 4? 0.1 What is the closest to 0 in -3, -1, -2/7, -4? -2/7 What is the nearest to 0.1 in -4, 0.3, -5, 257? 0.3 What is the nearest to 1/2 in 0, 4/9, 4? 4/9 Which is the closest to 1? (a) -197 (b) -1/5 (c) 1/6 c Which is the closest to -2/9? (a) 2/11 (b) 5 (c) 0 (d) -0.5 c Which is the nearest to 0.3? (a) 2.44 (b) -3/5 (c) 2 b What is the closest to -1/2 in 4/7, -0.3, 5, 2/7? -0.3 What is the nearest to 309/4 in -2/5, 0.2, 1/4? 1/4 What is the nearest to -1 in 0.2, 3/25, -0.1, 44? -0.1 What is the closest to 1 in 0.4, -1, -1/3, 8? 0.4 Which is the nearest to 2? (a) -1/4 (b) 0 (c) -0.5 (d) -24 b Which is the closest to -0.1? (a) 0 (b) 5.1 (c) 4 (d) -0.5 a Which is the nearest to -2/11? (a) -0.1 (b) 5 (c) 2/11 a What is the closest to 2/3 in 1/6, 0.2, 1, -2.6? 1 Which is the nearest to -0.6? (a) -1/12 (b) 0.3 (c) 31 a What	{ "pile_set_name": "DM Mathematics" }
s of 718? 2, 359 List the prime factors of 15118. 2, 7559 What are the prime factors of 5249? 29, 181 What are the prime factors of 884? 2, 13, 17 List the prime factors of 6030. 2, 3, 5, 67 List the prime factors of 2571. 3, 857 List the prime factors of 38103. 3, 13, 977 What are the prime factors of 6623? 37, 179 List the prime factors of 1705. 5, 11, 31 List the prime factors of 72513. 3, 7, 1151 List the prime factors of 4503. 3, 19, 79 What are the prime factors of 13597? 13597 List the prime factors of 63510. 2, 3, 5, 29, 73 List the prime factors of 30271. 30271 List the prime factors of 14765. 5, 2953 What are the prime factors of 45? 3, 5 What are the prime factors of 71812? 2, 13, 1381 What are the prime factors of 904? 2, 113 What are the prime factors of 2818? 2, 1409 What are the prime factors of 9341? 9341 What are the prime factors of 603? 3, 67 List the prime factors of 31666. 2, 71, 223 List the prime factors of 67861. 79, 859 What are the prime factors of 19661? 19661 List the prime factors of 3689. 7, 17, 31 List the prime factors of 11. 11 List the prime factors of 146. 2, 73 What are the prime factors of 19774? 2, 9887 List the prime factors of 89541. 3, 9949 List the prime factors of 20474. 2, 29, 353 List the prime factors of 2666. 2, 31, 43 What are the prime factors of 8471? 43, 197 What are the prime factors of 21304? 2, 2663 What are the prime factors of 78661? 11, 7151 What are the prime factors of 1292? 2, 17, 19 List the prime factors of 25347. 3, 7, 17, 71 What are the prime factors of 4413? 3, 1471 List the prime factors of 2057. 11, 17 List the prime factors of 23148. 2, 3, 643 List the prime factors of 16748. 2, 53, 79 List the prime factors of 3345. 3, 5, 223 List the prime factors of 3945. 3, 5, 263 List the prime factors of 2799. 3, 311 List the prime factors of 15419. 17, 907 List the prime factors of 971. 971 List the prime factors of 35102. 2, 17551 What are the prime factors of 1206? 2, 3, 67 List the prime factors of 261. 3, 29 List the prime factors of 8074. 2, 11, 367 What are the prime factors of 849? 3, 283 What are the prime factors of 23574? 2, 3, 3929 What are the prime factors of 641? 641 List the prime factors of 2786. 2, 7, 199 List the prime factors of 7557. 3, 11, 229 What are the prime factors of 413? 7, 59 What are the prime factors of 125750? 2, 5, 503 List the prime factors of 119. 7, 17 What are the prime factors of 590? 2, 5, 59 What are the prime factors of 6113? 6113 List the prime factors of 100. 2, 5 What are the prime factors of 720? 2, 3, 5 List the prime factors of 3900. 2, 3, 5, 13 What are the prime factors of 28863? 3, 1069 What are the prime factors of 61100? 2, 5, 13, 47 What are the prime factors of 354? 2, 3, 59 List the prime factors of 37973. 13, 23, 127 What are the prime factors of 139824? 2, 3, 971 What are the prime factors of 1767? 3, 19, 31 List the prime factors of 2140. 2, 5, 107 List the prime factors of 7469. 7, 11, 97 What are the prime factors of 4840? 2, 5, 11 List the prime factors of 14796. 2, 3, 137 What are the prime factors of 12695? 5, 2539 List the prime factors of 1591. 37, 43 What are the prime factors of 14835? 3, 5, 23, 43 List the prime factors of 7131. 3, 2377 List the prime factors of 1521. 3, 13 List the prime factors of 11991. 3, 7, 571 List the prime factors of 97. 97 What are the prime factors of 15521? 11, 17, 83 List the prime factors of 1353. 3, 11, 41 What are the prime factors of 3989? 3989 What are the prime factors of 45346? 2, 7, 41, 79 List the prime factors of 868. 2, 7, 31 List the prime factors of 55143. 3, 11, 557 List the prime factors of 3609. 3, 401 What are the prime factors of 3690? 2, 3, 5, 41 List the prime factors of 6. 2, 3 List the prime factors of 981. 3, 109 What are the prime factors of 30190? 2, 5, 3019 What are the prime factors of 8937? 3, 331 What are the prime factors of 5995? 5, 11, 109 What are the prime factors of 2360? 2, 5, 59 What are the prime factors of 139681? 139681 List the prime factors of 997. 997 List the prime factors of 2143. 2143 What are the prime factors of 9388? 2, 2347 What are the prime factors of 769? 769 List the prime factors of 10019. 43, 233 What are the prime factors of 18954? 2, 3, 13 What are the prime factors of 5645? 5, 1129 What are the prime factors of 28812? 2, 3, 7 List the prime factors of 31400. 2, 5, 157 What are the prime factors of 2351? 2351 List the prime factors of 330. 2, 3, 5, 11 List the prime factors of 18927. 3, 701 List the prime factors of 3422. 2, 29, 59 List the prime factors of 921. 3, 307 List the prime factors of 170. 2, 5, 17 What are the prime factors of 2056? 2, 257 What are the prime factors of 2308? 2, 577 List the prime factors of 2550. 2, 3, 5, 17 List the prime factors of 13024. 2, 11, 37 List the prime factors of 594. 2, 3, 11 List the prime factors of 489. 3, 163 What are the prime factors of 44921? 29, 1549 What are the prime factors of 113? 113 List the prime factors of 2651. 11, 241 List the prime factors of 1800. 2, 3, 5 List the prime factors of 316. 2, 79 List the prime factors of 135. 3, 5 List the prime factors of 3916. 2, 11, 89 What are the prime factors of 33499? 139, 241 What are the prime factors of 1064? 2, 7, 19 What are the prime factors of 1227? 3, 409 List the prime factors of 7362. 2, 3, 409 List the prime factors of 53680. 2, 5, 11, 61 List the prime factors of 2804. 2, 701 What are the prime factors of 28262? 2, 13, 1087 What are the prime factors of 4254? 2, 3, 709 What are the prime factors of 10148? 2, 43, 59 List the prime factors of 788. 2, 197 What are the prime factors of 19747? 7, 13, 31 What are the prime factors of 12039? 3, 4013 What are the prime factors of 1220? 2, 5, 61 List the prime factors of 3721. 61 List the prime factors of 4366. 2, 37, 59 List the prime factors of 26168. 2, 3271 What are the prime factors of 116019? 3, 4297 What are the prime factors of 503? 503 List the prime factors of 8194. 2, 17, 241 List the prime factors of 654. 2, 3, 109 List the prime factors of 7485. 3, 5, 499 List the prime factors of 3015. 3, 5, 67 List the prime factors of 18016. 2, 563 What are the prime factors of 119004? 2, 3, 47, 211 List the prime factors of 2924. 2, 17, 43 List the prime factors of 5905. 5, 1181 List the prime factors of 25397. 109, 233 List the prime factors of 30870. 2, 3, 5, 7 List the prime factors of 18888. 2, 3, 787 List the prime factors of 1051. 1051 What are the prime factors of 1596? 2, 3, 7, 19 What are the prime factors of 4660? 2, 5, 233 List the prime factors of 2285. 5, 457 What are the prime factors of 645? 3, 5, 43 What are the prime factors of 1773? 3, 197 List the prime factors of 20092. 2, 5023 What are the prime factors of 13177? 13177 List the prime factors of 4515. 3, 5, 7, 43 What are the prime factors of 1734? 2, 3, 17 List the prime factors of 1504. 2, 47 What are the prime factors of 5682? 2, 3, 947 What are the prime factors of 110679? 3, 79, 467 List the prime factors of 1315. 5, 263 What are the prime factors of 4693? 13, 19 List the prime factors of 885. 3, 5, 59 List the prime factors of 49690. 2, 5, 4969 List the prime factors of 13733. 31, 443 List the prime factors of 3793. 3793 What are the prime factors of 76054? 2, 11, 3457 List the prime factors of 8731. 8731 List the prime factors of 24069. 3, 71, 113 What are the prime factors of 76464? 2, 3, 59 List the prime factors of 39771. 3, 491 List the prime factors of 1318. 2, 659 What are the prime factors of 1766? 2, 883 List the prime factors of 23. 23 List the prime factors of 19084. 2, 13, 367 What are the prime factors of 1634? 2, 19, 43 List the prime factors of 2097. 3, 233 List the prime factors of 1170. 2, 3, 5, 13 What are the prime factors of 48681? 3, 601 List the prime factors of 14053. 13, 23, 47 What are the prime factors of 26406? 2, 3, 163 List the prime factors of 1975. 5, 79 What are the prime factors of 3504? 2, 3, 73 What are the prime factors of 412? 2, 103 List the prime factors of 2228. 2, 557 List the prime factors of 147475. 5, 17, 347 What are the prime factors of 718? 2, 359 List the prime factors of 1412. 2, 353 What are the prime factors of 5560? 2, 5, 139 What are the prime factors	{ "pile_set_name": "DM Mathematics" }
7a3 in the form pa*2 + h + za*3 + qa and give z. 1 Rearrange (-2 + 5 - 2)(2 - v - 2) + (-10v + 39 - 39)(2 + 3 - 4) to av + r and give a. -11 Express -63h - 38h*2 + 63h + (-3 + 0 + 2)(h2 - 3h*2 + 3h*2) + 0h - 2h2 + 0h as oh + wh*2 + f and give w. -41 Rearrange 0v*3 - 2v*3 + 4v*3 + (-3v - v*2 + 3v)(0v - v + 2v) + 3v*2 + 2v*3 - 4v3 - v3 to the form xv3 + jv*2 + k + qv and give j. 3 Rearrange 2 - 2 + 2g4 + (-2g2 - g2 + 4g2)(40g2 - 87g*2 - 34g*2) to m + xg*3 + yg*2 + og + bg4 and give b. -79 Express -3m*3 + 2m*3 + 5m*2 - 3m*2 as km*3 + v + qm*2 + am and give q. 2 Rearrange 9a2 + 1 - 2 - 8a2 + a4 - a - a to za3 + sa*2 + ha + x + wa4 and give w. 1 Rearrange -2g*3 - g + 0g*3 - 2g*2 + 2 + g to the form f + wg + yg2 + ug*3 and give f. 2 Express -2j - 2 + 3j - 2j + 0j as qj + r and give r. -2 Rearrange d*4 + 2 + 0d*4 + d + 12d*2 - 10d*2 to bd*4 + kd + f + md2 + zd*3 and give b. 1 Express (-14 + 13 - 29)(w - 2w - w) as sw + u and give s. 60 Express 37t2 - t2 - 318 + 318 in the form ut + c + lt2 and give l. 36 Rearrange ((-n + 2 - 2)(-3 - 3 + 5) - 7n + 1 - 1)(-n*3 - 2n*3 + 2n*3) to the form tn + cn3 + qn*2 + zn*4 + v and give z. 6 Express 13i*2 + 7i*2 - 65i - 21i2 + 2i*2 in the form yi + m + li2 and give y. -65 Rearrange (2 - 3 - 3)(-6 + 1 - 2)(-2v - 3v + 3v) to dv + b and give d. -56 Rearrange -24p2 - 5 + 5 + p3 to the form qp2 + kp*3 + up + l and give k. 1 Rearrange 3h4 + 2h + 3h - h4 - 3h + 7h3 to the form mh*2 + qh + zh4 + o + ch*3 and give q. 2 Rearrange (-5k*2 + 5k2 - k2)(0 - 3 + 0) to the form w + qk + zk2 and give z. 3 Express (4m + 1 - m + 0m)(-3m - 2m + 3m) in the form s + om*2 + dm and give d. -2 Rearrange -13t + 35 - 35 - 11t to x + ct and give c. -24 Rearrange -8o + 5 - 6o - 12 to uo + v and give u. -14 Express -20a2 + 54a*2 - 22a*2 - 8 - 14a*2 as i + fa*2 + na and give n. 0 Express (0n2 + 8n + 3n2 + 4n*2)(n - n + n) in the form kn + g + vn*2 + hn*3 and give g. 0 Rearrange 9k - 2k + 2k + 3k to qk + m and give q. 12 Express -17p - 29p - 59p in the form v + dp and give d. -105 Express 7 + 8 + 3l - 4l - 17 - 11l3 in the form b + rl*2 + zl*3 + al and give z. -11 Express (17 + 4 + 19)(-y - 4y + 3y)(-1 - 4 + 2)(0 - 1 - 1) in the form k + xy and give x. -480 Express (157 - 53 + 31)(t - 1 + 1) as ut + y and give u. 135 Rearrange (0 - 12 + 3)(-3z - 4z + 5z) + 3z + 2z - 2 - 4z to the form qz + x and give x. -2 Rearrange (-4 + 0 + 2)(3g - 3g + 2g*2) + (-g + 2g + 0g)(0g + 3g - 5g) to the form wg + f + pg2 and give p. -6 Express -7q*2 + 3q*2 - 3q*2 - 6q*2 in the form tq + gq2 + x and give g. -13 Rearrange (3 - 2 + 2)(-x + 10 - 10 - 3) to c + vx and give v. -3 Express 68a*2 - 12a - 35a2 - 32a*2 in the form ha*2 + g + la and give h. 1 Express (-2 + 5 - 5)(-2p + 7p - 2p)(-2 - 2 + 2) as bp + s and give b. 12 Rearrange -2d - 2d - d*3 + 2d*2 - 2d + 4d to the form rd*2 + k + vd*3 + ld and give l. -2 Rearrange 0f4 - f4 + 2f*3 + 0 - 3 to zf*2 + wf*4 + tf*3 + of + v and give v. -3 Express (-24t + 2t + 0t + (t + t + 0t)(-3 + 4 + 1))(8 - 8 - 2t) in the form f + kt*2 + st and give k. 36 Rearrange 2s4 + 54s - 3 - 3s4 - 57s to ys + l + as*4 + zs*3 + ds*2 and give l. -3 Rearrange 8v - 15v2 + 9v*2 + 7v*2 to pv + mv2 + g and give p. 8 Express -2w*3 + 2w3 + w4 + (18 + 5w - 18)(w - 2w3 - w) as qw + r + fw2 + dw*3 + sw*4 and give s. -9 Express 2m - 5m4 - 2m*4 - 1 + 8m4 - 7 - m2 in the form dm3 + um*2 + jm + bm4 + g and give b. 1 Express -8q + 6q - 7q in the form oq + l and give l. 0 Express -3 - 5d - 23d + 3 as hd + y and give h. -28 Express 99 + 6w2 - w3 - 98 - w2 as aw + u + xw2 + zw*3 and give z. -1 Express -4 + n + 7 - 2 in the form b + on and give o. 1 Rearrange -9 - 15 + 24 - 83o to the form k + no and give n. -83 Rearrange 3y - 2y*3 - 6y*2 + 4y*2 + y - 3y to jy3 + xy + vy2 + h and give j. -2 Rearrange 405 - 66k - 405 to the form ak + x and give a. -66 Express -80x*2 + 14x - 14x in the form nx*2 + ax + s and give n. -80 Express (2 + 20w + 11w - 21w)(5 - 3 - 1) in the form i + yw and give y. 10 Express (0 + 2 + 1)(-344 + 344 - 11j) + (-3j + j + j)(-1 + 3 - 1) as cj + f and give c. -34 Express (-2f + f + 2f)(-f2 - 5f*2 + 3f*2) + 1 - 1 + 6f*3 in the form yf*3 + v + zf + tf2 and give y. 3 Rearrange (r + 3r - 7r)(-1 + 3 - 3) - 1034 - 48r + 1034 to yr + w and give y. -45 Express a2 + a3 + 3a2 + 0a*2 - 2 - 3a2 + a4 in the form qa2 + ja*3 + wa*4 + la + x and give w. 1 Rearrange (10h + 39 - 39)(-3 - 2h3 + 3)(-1 - 2 + 2)(-5 - 1 + 1) to ih*3 + d + kh + oh2 + wh*4 and give k. 0 Express (6 + 9 - 21)(-4 + 1 + 2)(-2 + 2 + 3v) as tv + g and give t. 18 Rearrange 43c + 1 + 2c3 - 24c - 19c - c2 to yc + t + vc3 + sc*2 and give s. -1 Express 2k*4 - 5k*4 + 2k*4 + 10k*2 - 6k*4 - 10k*2 + (2k - 3 + 3)(-4k + 2k3 + 4k) as bk3 + rk*4 + u + ok*2 + tk and give r. -3 Rearrange (7 - 18 + 9)(2c + c - 2c) to xc + f and give x. -2 Express n*3 + 0n + 0n + (-n + 1 - 1)(n*2 - 7n2 - n2) as dn + un*3 + zn*2 + c and give u. 8 Express 37 - 37 - z + (5z + 5z - 3z)(2 + 1 - 5) in the form u + yz and give u. 0 Rearrange 2d + 24 - 302d*2 + 304d*2 - 2d to h + qd2 + vd and give q. 2 Express (170m + 20m*2 - 171m + 7m2)(4 - 2 + 0) in the form km + cm*2 + j and give c. 54 Rearrange 3 + 2a*2 - 3 - 5a - a to the form ma2 + ya + w and give y. -6 Express (o - 2 + 2)(2o + 1 - 1) + 65 - 65 - 161o2 as f + zo + wo2 and give w. -159 Rearrange 448b*2 - 2b*3 - 448b*2 - 3 - 1 - 3b to the form fb + vb*2 + kb*3 + i and give k. -2 Express 94l*3 + 88l*3 - 173l*3 + (2l + l*2 - 2l)(1 - 2l - 1) + 0l3 - l3 - 2l*3 in the form zl*2 + wl + c + ml3 and give m. 4 Rearrange -o2 + 0o*2 + 2o*2 + (0 + 3o + 0)(0o + 0o + 2o) + (-2 + 0 + 0)(-4o*2 + 4o*2 - 3o*2) to the form io*2 + zo + f and give i. 13 Express -6 - 3o + 0 + 9 - 4 - 4o*2 in the form a + zo*2 + uo and give u. -3 Express (-3 + 3 + 3)(-11k2 - k3 + 11k2)(k + 0k - 3k)(-2 + 0 - 2) in the form rk*4 + bk + uk2 + n + ak*3 and give u. 0 Rearrange (-2u*2 + 0u2 + u2)(-u2 + u2 - 2u*2) + (-1 - 2 + 6)(22u4 - 269 + 269) to su*2 + du*3 + ou + bu4 + k and give b. 68 Express 18o + 309 - 309 in the form d + go and give g. 18 Express -3m*3 - 3m*3 + 5m*3 + ((3 - 5 + 4)(-3m + 0m + 0m) - 6 - 2m + 6)(m2 - 4m*2 + 2m*2) in the form zm + h + am2 + jm*3 and give z. 0 Rearrange 29n - 53n + 0 + 0 to the form t + gn and give g. -24 Express (-1 + 0 + 0)(0x2 + x2 + 2x2)(-x - x - x)(-2x + 2 - 2) as nx2 + vx*4 + yx*3 + w + dx and give v. -18 Express (-3b + 31b - 11b)(b - 5b + 5b) in the form m + sb + lb*2 and give l. 17 Rearrange 6t + 11t + 15t - 1 + 5t to the form z + ot and give z. -1 Express (-2 + 1 + 0)(-4 - 4 + 3)(0 - 2 + 3)(-2 + 2 + c2) in the form j + lc*2 + tc and give l. 5 Express 3d + 4d - 5d + (1 - 1 - 1)(-6d + 16d - 31d) as q + vd and give v. 23 Rearrange -1 - 220a2 + 107a*2 + 119a*2 - a to the form k + va*2 + xa and give k. -1 Rearrange -5c - 2c*2 + 2 + c + 7c - c to the form xc + p + nc*2 and give n. -2 Rearrange (0b + 0b + b)(5b3 - 6 + 6) - 5b4 + b4 + 0b4 to ub*2 + vb + jb3 + c + tb*4 and give t. 1 Express (-9v - v - 3v)(-1 + 3 - 3) as a + gv and give g. 13 Rearrange ((-y - y + 4y)(y2 + 5 - 5) + 2y*3 - 4y*3 + 3y*3)(-3y + 0y - 4y) to vy + wy4 + by*3 + zy*2 + m and give w. -21 Express (-5w + 4w + 0w)(6w - 2w3 - 6w - 3w - 1) as tw + d + bw3 + hw*2 + uw*4 and give u. 2 Rearrange (13v + 12v - 36v)(-2 - 2v - 3v + 6v) to the form sv2 + b + nv and give n. 22 Exp	{ "pile_set_name": "DM Mathematics" }
he form j + hc2 + wc and give w. -1194 Express 49996n2 + 43n - 50039n2 + 21n + 1 in the form jn2 + qn + z and give j. -43 Rearrange (1 - 2u - 1)(-3 + 3 + 1)((1 + 2 - 1)(1 + 0 + 2) - 7 + 5 - 5)(-54 + 54 + 19u) to the form fu2 + d + zu and give f. 38 Rearrange (-173 - 38w + 82 + 95)(w*2 - 7w2 + w2) + (-1 - 5 + 4)(2w3 - w3 + 0w3) to the form dw*3 + vw + u + sw2 and give d. 188 Rearrange (-181 + 30 - 51 + (-1 + 3 - 1)(-2 - 1 + 2))(3z - 11z + 3z) to tz + d and give t. 1015 Rearrange -104l*3 + 1709l*2 - l + 20 - 105l*3 - 18 + 207l*3 to the form ol*3 + jl*2 + d + nl and give j. 1709 Rearrange -1027 + 2037 - 1010 - 3253l to the form i + vl and give v. -3253 Express 244n4 - 492n*4 - 25n*2 + 3n + 249n4 + 3n*2 - 6 - 2n*3 as qn*2 + wn*4 + zn*3 + kn + c and give w. 1 Rearrange (-3 + 0 + 6)(-2325d - 1896d - 6653d) to the form l + td and give t. -32622 Express (1949q - 65 + 65 + 1822q)(5q + q + 0q) as zq + a + pq*2 and give p. 22626 Rearrange (0t - 4t - 6t)(5 - 11 - 11)(1 + 1 - 1) to the form gt + r and give g. 170 Rearrange 78 + 64 - 2l*3 + 114 + 439582l*2 - 439586l*2 - 2l*4 to ol*4 + zl + jl3 + y + ql*2 and give o. -2 Rearrange (-12366 + 12366 - 4u*2)(-89u2 + 31u*2 + 30u*2) to the form ou + du4 + y + au*3 + xu*2 and give d. 112 Rearrange 27p*4 - 14p*4 + 5p - 3p - 10p + 19 - 5p2 + 6p to yp + mp*2 + cp*4 + b + rp*3 and give b. 19 Rearrange 1 + 2285a*2 - 2285a*2 + 425a*3 to the form na*2 + z + ga*3 + da and give g. 425 Rearrange 8a + 0a*2 - 5873 + 5836 - 3a*2 to the form l + pa + da2 and give d. -3 Rearrange 1201z - 2537z - 3296z - 2108z - 2986z to fz + q and give f. -9726 Rearrange (4y*2 - 10y + 10y)((-16 - 16 - 12)(-y - y + 0y) + (5 - 2 + 0)(0y + 6y - 3y) - y + 1 - 1) to the form k + fy3 + dy + ty2 and give f. 384 Rearrange (7 - 4 + 0)(589c + 623c - 1086c + 9) to the form ic + r and give i. 378 Express (-o - 2o + 353 - 351 - 2o*2 - 29o*3)(-2o + 5o - 4o) in the form mo*2 + s + vo*4 + uo*3 + ao and give v. 29 Express 8v2 + 843 + 0v*2 - 844 - 3v - 14v2 + 16v*3 in the form jv*2 + a + tv + zv3 and give z. 16 Rearrange (-15 - 2i*3 + 15)(i - 1 + i - 1) + (4i2 - 11 + 11)(-7i2 + i2 + 2i*2) to the form li*2 + gi + ci3 + ki*4 + r and give c. 4 Express 2g + 11g3 - 214390 - g2 + 214328 + 4g*3 in the form y + pg*3 + ng*2 + ug and give n. -1 Express 5559x2 - 11097x*2 + 5528x*2 - 26x*3 + 5x*4 + 2x in the form mx + u + kx*2 + nx*4 + jx*3 and give m. 2 Express -74 - 78 - 73 - 2x - 73 + 297 + 537x2 in the form ix*2 + p + fx and give p. -1 Rearrange (27 - 303 + 20)(2b - 2b - 2b) + (-12 - 12 - 38)(-2 + 2 - 2b) to the form j + gb and give j. 0 Rearrange -7k*4 + 4k*2 - 12k*4 - 3k*4 - 672 - 679 + 1348 to the form c + jk*4 + bk*3 + zk + vk2 and give v. 4 Express -3u*4 - 17u + u*3 + 45 - 64 + 17 - 10u in the form qu + nu*3 + cu*2 + lu*4 + f and give l. -3 Rearrange -15q + 42q - 2731 - 10q - 15q to the form p + kq and give k. 2 Rearrange -3 + 304t + 291t - 3t3 + 78t to y + wt3 + nt + lt2 and give w. -3 Express (28 - 59 + 130)(-8 + 8 + 2c)(-2 + 4 - 5) in the form y + dc and give d. -594 Express (37y*3 - 10y*3 + 52y*3)(-16y - 5y - 19y) in the form py + ny3 + by*2 + w + ty*4 and give t. -3160 Rearrange -2882 + 4s*2 - 56s + 1445 + 1432 to the form gs + a + rs*2 and give g. -56 Rearrange (-2b*2 - 2b2 + b2)(16 + 9 - 13)(-5 + 18 + 1) to the form x + lb + gb*2 and give g. -504 Rearrange -23c - 494 + 21c + 2c + 4c2 + 0c to the form tc + wc*2 + q and give w. 4 Express (m - 2m + 0m)(196 - 616 + 2324)(3 + 1 - 3) as z + sm and give s. -1904 Express 793i + 3720i - 1067i in the form xi + c and give x. 3446 Rearrange m*3 - 38 + 38 + (-1 + 2 + 0)(-2m3 - m2 + m2) + 45m*3 + 34m*3 + 92m*3 to the form fm + gm2 + w + dm*3 and give d. 170 Rearrange 120y*3 - 8y*3 - 106y*3 - 70y*2 - 8y*3 to the form u + dy + fy3 + ry*2 and give f. -2 Rearrange v + 0v - 2v + (-32 - 16 - 55)(12 - 2v - 16 - 9 - 14) to the form n + lv and give n. 2781 Rearrange -2m2 + 61 + 17 + m2 - 4844m - 79 - 411m to the form bm*2 + a + sm and give b. -1 Rearrange (-3j3 + 0j3 + j3)(46 + 114 - 267)(9 + 0 + 16) to the form cj + vj*3 + x + oj*2 and give o. 0 Express (0h + 377 + 23h - 24h)(2h + h - h - 3h + 3h - h + (-1 + 0 + 0)(1 - 2h - 1)) as ch2 + dh + k and give c. -3 Express 141 + 151 + 1338d2 - d - 292 in the form xd + j + wd2 and give x. -1 Rearrange 126u*2 - 21u*3 + 7u*3 - 57u*3 - 2 - u - 133u*2 to k + au*2 + mu*3 + du and give d. -1 Rearrange -7076t + 11391 - 11391 to the form w + ut and give u. -7076 Rearrange -2d + 1 - 1 + (-2d + 2d + 2d)(-1 + 0 + 0) + 74158 + 286d - 74158 to the form a + xd and give x. 282 Rearrange (-845k + 845k + 83k*2)(-2k2 - 76k*2 + 28k*2) to the form sk*2 + fk*3 + lk + mk4 + n and give m. -4150 Express (12t - 12t + 6t*2)(-254 + 507t + 254)(3 + 4 + 0) as w + zt2 + ht*3 + dt and give h. 21294 Rearrange (1142v - 5068 + 5068)(2 - 1 + 1)(v - v + 3v)(-2 + 1 + 7) to the form hv*2 + q + jv and give h. 41112 Rearrange (-2d4 + 0d + 0d)(1380 - 2987 - 2800) - 2d4 + 0 + 0 + (-3d*4 + 2d4 - d4)(4 + 3 - 5) to kd*2 + yd*3 + ud + o + pd4 and give p. 8808 Rearrange -2273207y*2 + 0 + 130y - 4 + 2273224y2 + 3 to the form l + oy + by2 and give l. -1 Rearrange -8r2 - r4 - 1 + 36r - 9r*4 - 8r*4 + 17r*4 to gr*3 + lr + v + jr2 + mr*4 and give v. -1 Rearrange 325n*2 - 36 + 666n*2 - 17n*2 + 141n*2 + 39 to the form un + vn2 + w and give w. 3 Rearrange 0d - 6 - 4d - d to yd + s and give y. -5 Rearrange -3 + 281y2 - 3y + 9y - 558y*2 + 271y*2 to the form cy + v + sy2 and give v. -3 Express 2y*3 - 2 + 2 + (2y2 - y2 - 2y2)(4y + 5y - 4y) - 2y*3 + 0y3 + y3 + 22y3 - y3 - 3y*3 as t + cy + ky2 + zy*3 and give z. 14 Rearrange 9d*2 - 9523d - d2 - d2 - 6d2 - 2d*2 to kd*2 + h + md and give k. -1 Rearrange -2s3 - 218s + 37 + 57s - 2s*2 + 55s + 49s + 52s to cs + ws*2 + m + rs3 and give m. 37 Rearrange -q2 + 707 + 0q2 - 674 - q2 + 0q*2 - 5q to the form iq2 + sq + x and give i. -2 Rearrange -362u - 2724u + 6000u to q + pu and give p. 2914 Express (r*2 - 5r2 + r2)(-37r*2 + 4597r - 4597r) + 121r2 + r4 - 121r2 + 5 in the form kr + ir3 + nr*4 + o + zr*2 and give o. 5 Express 1725a + 3427a - 2823a as r + ka and give k. 2329 Rearrange 3981q*3 + 4644q*3 - 6789q3 + q2 to y + zq + jq*3 + rq*2 and give j. 1836 Rearrange (-29w + 28w + 90w*3 - 25w*3)(0 - 5w + 0) - 24w + 2w4 + 24w to the form zw + nw*2 + b + xw*4 + jw*3 and give n. 5 Express (-56 - 70 + 20)(111 - 111 - 92w) in the form f + hw and give h. 9752 Rearrange (2 + 2 - 3)(1 + 3 - 5)(s + 54 - 36 - 109) to ns + q and give q. 91 Rearrange 221 - 413 + 192 + 10691h to c + fh and give f. 10691 Express (2c*2 + 7c*2 - 6c*2)(0 - 5 + 3 + 3c)(-130 + 144 + 164) as yc3 + bc + f + pc2 and give f. 0 Express -71 + 13n*3 + 17n*3 + 2n*2 + 19n*3 + 11n*3 - 62n*3 as vn*3 + zn + t + wn2 and give v. -2 Express (2 - 3 + 0)(48r - 886 + 470 + 338)(2 - 4 + 4) in the form xr + b and give b. 156 Rearrange (5 - 4 + 1)(4 - 2v - 4)((4v - 3v - 2v)(-2v + 4v + 0v) - 27v + 137v2 + 140v*2 - 264v*2) to lv*3 + xv + yv2 + g and give y. 108 Express -21w4 + w4 + 2w2 - 58w*3 + 4 + 116w*3 - 56w3 - w2 in the form bw3 + gw*4 + aw + o + jw2 and give g. -20 Express 11465i - 98903 + 98903 as z + yi and give y. 11465 Rearrange 10496 - 55n - 17n + 359n - 10510 + (-1 + 0 + 2)(-6n + 2n + 3n) to sn + g and give s. 286 Rearrange (3 - 2 + 2)(2 + 7 + 7)(-41 + 92 - 34)(5m + 1 - 3m + 0)(-1 + 3 - 1) to the form tm + p and give t. 1632 Express (p - p - p)*(136 + 544 + 135	{ "pile_set_name": "DM Mathematics" }
57 Let d(l) = -2l + 2. Calculate the lowest common multiple of 18 and d(-1). 36 Let b = 1 + 0. What is the least common multiple of 4 + 11 + -1 + -3 and b? 11 Let r(p) = p3 + 13p*2 + 11p - 6. What is the smallest common multiple of r(-12) and 3? 6 Let i be 4/8 + 1/(-2). Find the common denominator of 0 + (-411)/30 - -2 and (i - (-33)/72)14. 60 Suppose 8 = 5l - 2. Suppose 0 = -5a - 5s + 140, -la + 0s + 71 = -s. Find the common denominator of (-2)/(2/122-18) and a. 9 Let r(h) = -3801h + 4. Let s be r(5). Let v = -379923/20 - s. What is the common denominator of (-166)/41/2 and v? 20 Let p(l) = -5l + 2. Let v be p(-6). Suppose 4t = -2q - 0t + v, 5t = -2q + 37. What is the least common multiple of 6 and q? 6 Calculate the common denominator of (-3)/(-10)(-689)/(-39) and 27/16. 80 Let o = -18 - -26. Let a(i) = -i*2 + 8i + 6. Let p be a(6). What is the smallest common multiple of o and (-4)/p + 498/54? 72 Let r(j) be the second derivative of -7j5/20 - j3/6 - j. Calculate the least common multiple of 2 and r(-1). 8 Let w = -5 + 9. Suppose -5p = wx - 60, 3x + 58 = 5p - 37. Let h = -23 - -31. Calculate the smallest common multiple of p and h. 16 Let w(d) = d2 + 10d - 7. Let z be w(-9). Calculate the lowest common multiple of 2 and ((-30)/(-8))/((-6)/z). 10 Let j = -8634 + 86409/10. Let k(i) = 663i2 - i - 4. Let v be k(3). Let w = v + -59709/10. Calculate the common denominator of j and w. 10 Find the common denominator of 2 - (1 - (1425/48)/(-5)) and 43/114. 912 Suppose -12 = -3b - 33. Let f = 16 + b. Calculate the least common multiple of f and 5. 45 Let t = 121033/24 - 5047. Calculate the common denominator of t and 46/33. 264 Suppose d + 0d - 3c = 0, 2c - 22 = -3d. Calculate the common denominator of 75/22 and 162/32 - d/(-8). 176 Suppose -5i + 12 = -3i. Suppose 6 + i = 4b. Let w = b + -2. What is the least common multiple of w and 6? 6 Calculate the least common multiple of 6/4(-8)/(-3) and -5 - -3 - 3 - -6. 4 Let y = -4 + 7. Suppose -5o - 5c = -54 - 6, 3o - 5c - 12 = 0. Calculate the least common multiple of o and y. 9 Suppose 7h = 2l + 5h + 8, -2l - 3h = -12. Let p = 86961/10 - 8689. Find the common denominator of p and (-159)/66 - -1 - l. 110 Find the common denominator of -2/7 and 3/(-5) - -1 - (-2580)/550. 77 Let z = 17220424437750217/98704 + -174465314854. Let h = z + -1/6169. What is the common denominator of -97/6 and h? 48 Let d = 7/22 - -46/11. Calculate the common denominator of d and -45/8. 8 Let s be (1 - (-5)/(-3))3. Calculate the least common multiple of 5 and (-2)/(s - (-6)/4). 20 Let b(s) = -s - 3. Let u be b(-5). Suppose f = u + 2. Calculate the lowest common multiple of 8 and f. 8 Let t = -3184103/531067859 - 1/318577. Let d = t + -148143/36674. What is the common denominator of d and (-2)/6 + (-38)/36? 198 Let g = 40 - 30. What is the lowest common multiple of 14 and g? 70 Let d(n) = n*2 + 2n - 5. What is the least common multiple of d(-5) and 12? 60 Suppose -4a = -d + 14, 3d - 7 = 2d - 3a. Calculate the lowest common multiple of 4 and d. 20 What is the common denominator of 91/30 and 178/(-132) - (-6)/1986? 30 Let t = 93098669/12 + -7748625. Let j = t + -9589. Calculate the common denominator of j and -53/14. 84 Let f = 2 + 3. Suppose -16 = -5k - 6. What is the lowest common multiple of f and k? 10 Let x(d) = d*2 + 5d - 6. What is the smallest common multiple of x(-9) and 10? 30 Let o(i) = -i - 7. Suppose -5q + 0r = 2r - 51, 3q - 3r = 39. Calculate the least common multiple of o(-9) and q. 22 Calculate the smallest common multiple of 4 and 2/4-4 + 4. 4 Let d = 14/24035 + 55471/48070. Calculate the common denominator of 5/9 and d. 990 Suppose -1380 = -3h - h. Let d = 202359/72974 + -1/3317. Calculate the common denominator of (-1 - -1) + h/(-20) and d. 44 Let q be (1 - 2) + (-2 - -5). Let h = -1 + q. What is the least common multiple of h/(-1 + 6/5) and 11? 55 Let u be 9/(-6)(-2)/(-3). Let q be 3/(((-1)/(-2))/u). What is the common denominator of (-63)/q(-1)/(-8) and -79/4? 16 Calculate the common denominator of 37/5 and (-9)/6(-67)/3. 10 Suppose -f - 5 = -1. What is the least common multiple of 14/(-8)8/(-2) and (-1)/(f/(12 - 4))? 14 Let h = -6 + 12. Let a(r) = -r2 + 5r + 8. Let g be a(h). Suppose -10 = gj - 3j. Calculate the smallest common multiple of j and 6. 30 Let i = -444464773916/1238974737 + 80/5363527. Let y = i - -557/33. Let a = -52989/154 - y. Find the common denominator of 139/18 and a. 198 Suppose 0 = 5z - 0z - 10. What is the least common multiple of z and 4? 4 Let k = -192 + 194. Calculate the smallest common multiple of 40 and k. 40 Let d be -44(-3 + (-118)/(-26)). Let y = 3655/78 + d. Find the common denominator of y and 57/20. 60 Let v = 2063/8 - 260. Find the common denominator of -2/11 and v. 88 Calculate the lowest common multiple of 10 and ((136/10)/1)/((-14)/(-35)). 170 Let v = 286 + -934/3. Calculate the common denominator of v and 28. 3 Let w(c) = -c2 + 3c + 3. Let h be w(3). Let d = h - -1. Calculate the lowest common multiple of (12 - d)(2 + -1) and 6. 24 Let f(t) = t + 16. Let i be f(-13). Suppose -is + 5c - 79 = 0, -2s - 5c = s + 29. What is the lowest common multiple of 8 and (-68)/(-18) - s/81? 8 Let g = 37 + -19. Let o = -11 + -2. Let a = 35 + o. What is the lowest common multiple of a and g? 198 Calculate the common denominator of 122/(-24)(1 - -1) and 89/14. 42 Let x(h) = h. Let t be x(0). Let m be (t - 5)(-8)/(-20). Calculate the common denominator of (-43)/3 - (m - -1) and -49/2. 6 Let x(f) = f3 - 10f*2 + 11f - 11. Suppose 0 = -b + 5 + 4. Calculate the least common multiple of x(b) and 3. 21 What is the common denominator of -31/3 and (-3)/12 + (-275)/(-108)? 27 Let j = -69419/18770 - 3/1877. Calculate the common denominator of j and 13/3. 30 Suppose 5f - 26 - 269 = 0. What is the smallest common multiple of 10 and (-3)/(-9) - f/(-3)? 20 Let v be (-3 - 2) + 2 - -153. Let o be (-4)/14 - v/(-35). Suppose -r + or = 42. Calculate the least common multiple of 18 and r. 126 Suppose 60 = 3k + 2j, 2k - 67 = -5j - 27. Let o be 11 + -23/(-6). Let d = k - o. Calculate the least common multiple of d and 4. 8 What is the smallest common multiple of 9 and 5 + -1 + -1 + -2? 9 Let r be (-3)/(-2)(-1 + 11). Suppose -o = -3d + 3, -d + 2o + r = -3o. Let v(h) = h + 10. What is the least common multiple of 18 and v(d)? 90 Let k = -3400/189794009 - 136085324931553/11500378181346. Let u = k - 2/10099. Find the common denominator of -25/6 and u. 6 Let y = 30 - 17. What is the least common multiple of y and 9? 117 Suppose 5l = 4l + 12. Let b = -22 - -11. Let s = b + 25. What is the smallest common multiple of l and s? 84 Suppose -2p + 13 = p + 5w, 4p = 2w + 26. Suppose 0 = 4t - 12 - 20. Calculate the lowest common multiple of p and t. 24 Suppose 4h + 26 = 2c, 8c + 4h = 3c - 5. Let l = -24 + 31. Calculate the smallest common multiple of l and c. 21 Let i(b) = b3 - b2 + 6. Let k = -195 - -204. Calculate the least common multiple of i(0) and k. 18 Let x = 7175/6 - 3632/3. Find the common denominator of -5/6 and x. 6 Suppose 4n + 27 - 83 = 0. Suppose n = z + z. Calculate the least common multiple of z and 5. 35 Let r = 5/13 - 51/65. What is the common denominator of 23/6 and r? 30 Let d = 8 - 6. Let p(u) = -2u + 2. Calculate the least common multiple of d and p(-3). 8 Let z be 35/15 + 2/3. Suppose 2b + 35 = 3c, zc - b - 21 = 10. Let y(x) = -2x. What is the lowest common multiple of y(-1) and c? 18 Let i = 1/288 - -2447/288. What is the common denominator of i and -5/16? 16 Suppose z + 4v + 4 = 24, 4v = z + 4. Let w = 0 - -18. What is the smallest common multiple of w and z? 72 Suppose 2o - 4 = 0, o - 2o = -4p + 26. What is the smallest common multiple of p and 3? 21 What is the lowest common multiple of (8/12)/16 and 12? 12 Calculate the common denominator of -29/30 and 623/36(-8)/(-28). 90 Let g = -10660 - -10180302/955. Let n = g - -56337/3820. Calculate the common denominator of n and (0 + -1)(-146)/36. 36 What is the common denominator of ((-4)/(-64))/(1/(-18)) and 32/9? 72 Suppose 0t = 2*t - 6. Let j be (-1)/t + (-8)/12. What is the common denominator of -46/9 and 1 +	{ "pile_set_name": "DM Mathematics" }
= 0. What is the highest common divisor of a and t? 14 Suppose -55t = -57t + 6. Suppose -n + 30 = 2n. Suppose 3s - 23 = -l, 4s = -nl + 5l + 16. Calculate the highest common factor of s and t. 3 Let z(h) = 52h*3 + 2h - 2. Let d be z(1). Let y = -35 + d. Calculate the highest common divisor of 136 and y. 17 Let g(l) = -l*3 + 29l*2 + 30l + 225. Let w be g(24). What is the greatest common divisor of w and 459? 153 Suppose 14q = 17q - 27. Let t be 5/(-3)(q - 57). Let n be (6/(-5))/(((-4)/t)/1). Calculate the greatest common factor of n and 48. 24 Let k be 268 - 18 - (9 + -1). Calculate the greatest common factor of 2200 and k. 22 Suppose 0 = -d + 3, 10q - 5d = 7q - 6. Let k(p) = 2p3 - 4p*2 + 4p - 8. Let z be k(q). What is the greatest common factor of 297 and z? 11 Let j(w) = 113w + 854. Let k be j(-7). What is the highest common divisor of 98 and k? 7 Let l be 46 + 5 + (5 - 18). What is the highest common divisor of 133 and l? 19 Let h(z) = -68z - 3998. Let l be h(-61). Calculate the greatest common factor of l and 84. 6 Let s = 1632 + -306. Let h = -833 + s. Calculate the highest common factor of 17 and h. 17 Let w be (-27)/(6480/(-5728)) + (-8)/(-60). Let d(x) = 8x2 - 4x - 8. Let g be d(6). Calculate the greatest common factor of w and g. 8 Let a = 117 + -107. Suppose ac = 3c - 7. Let h be 2/c - (-13 - -14) - -123. Calculate the highest common divisor of 24 and h. 24 Let t be ((-2)/(-4))/(1/168). Let d(r) = 1806r - 41475. Let b be d(23). What is the greatest common factor of t and b? 21 Suppose -3y + 75 + 144 = 0. Suppose 0 = -3r - 4g + 39, -30 = -4g - g. Suppose -rm + y = -27. Calculate the greatest common factor of m and 70. 10 Let m be (394/12)/(33/2178). Calculate the highest common factor of m and 11. 11 Suppose 8x - 2 = 7x. Let y(z) = 18z + 7. Let j be y(x). Let s = j + 12. What is the highest common divisor of 33 and s? 11 Let q(u) = -u2 + 228u - 2535. Let h be q(12). What is the highest common divisor of h and 474? 3 Suppose 40t - 17891 + 4252 - 12881 = 0. Calculate the greatest common factor of 2295 and t. 51 Let r(s) = -51s - 4865. Let y be r(-96). Let o be 3414/10 + (-4)/10. Calculate the highest common factor of o and y. 31 Let g(a) = 124a + 7094. Let x be g(-54). Calculate the highest common divisor of 4 and x. 2 Let x be (-3)/62 + 49 - (251 + -242). Let q be -3-1(1 + 2). Suppose 5g - z - 56 = q, -z + 26 = 2g. What is the highest common factor of g and x? 13 Let d(w) = -w*2 - 23w - 87. Let x be d(-12). Let g = 47 + -20. Let t = x - g. What is the greatest common divisor of t and 90? 18 Suppose -48m + 10m - 9m + 2303 = 0. What is the greatest common factor of m and 3577? 49 Let z = -59 + 102. Suppose -60p = -85p + 50. Let x = z - p. What is the greatest common divisor of x and 82? 41 Let r(p) = 2p*2 + 19p + 66. Let t be r(-12). Calculate the highest common factor of 4032 and t. 126 Let v be 0 + 33 - (-1 + 2). Let q be (-3 - -121) + 94/(-14) + (-745)/(-1043). Calculate the highest common factor of v and q. 16 Suppose 6g = g - 2v - 11, 5g = -v - 8. Let j be ((-522)/232)/(g/((-48)/(-1))). Calculate the greatest common divisor of j and 36. 36 Suppose -167d - 778 = -168d + 4q, -4d = -4q - 3100. What is the highest common factor of 1247 and d? 43 Suppose -5l = 2v - 419, -5v + 155 = 54l - 52l. Suppose -4y = -0q - 3q + 51, 0 = y. Calculate the highest common divisor of q and l. 17 Let b = -489 - -688. Let f = -123 + b. Suppose f = 5w + z, 42 = 3w + 5z + 14. What is the highest common factor of 64 and w? 16 Let f = -566 - -1588. What is the highest common divisor of f and 14? 14 Let f(q) = 7q3 + q2 - 2q + 4. Let g = 78 + -63. Let d be (-2)/(3(-5)/g). Let r be f(d). What is the greatest common factor of 30 and r? 30 Suppose 4p - 146 = -2z - 0z, 5z - p - 310 = 0. Let w = 65 - z. Suppose 0 = 10n - 88 - w. Calculate the highest common divisor of n and 117. 9 Let l = -310 - -370. What is the highest common divisor of l and 5220? 60 Suppose 3x + 140 = 5x + 2w, 0 = 3w - 12. Suppose 0 = 2764r - 2713r - 16830. What is the greatest common factor of r and x? 66 Let n = -8726 + 17094. What is the greatest common factor of n and 32? 16 Let k(i) = -19i - 13. Suppose 5q = -4o - 13, 5o + 12 - 1 = -q. Let c be k(q). What is the highest common factor of 36 and c? 6 Suppose -1 = -r + 2. Suppose 5z = q + 126, 5q = -23z + 21z + 18. What is the highest common factor of z and r? 3 Suppose -10 - 18 = -5s + 2l, -2s = 3l + 4. Suppose -2h = -5q - 598, h - sq - 299 = q. Calculate the highest common divisor of 23 and h. 23 Suppose 0 = 4l + 3b - 3051, -385b + 384b - 3809 = -5l. What is the highest common divisor of l and 7366? 254 Let f(w) = 98w - 1291. Let t be f(18). What is the greatest common factor of t and 297? 11 Suppose 21j = 28j + 12j - 229710. Calculate the highest common divisor of j and 90. 30 Suppose -355r + 2964 = -359r + 8608. Calculate the highest common divisor of r and 68. 17 Let c be 6/(-27) - (-5)/(90/832). Suppose -y + c = -g + 5g, 47 = 5g - 4y. Calculate the greatest common divisor of 143 and g. 11 Let g be 27/(-12)(8/(-20) - (-28)/(-30)). What is the highest common factor of g and 555? 3 Suppose -44f - 6137 = -61f. Let s = f - 328. Calculate the highest common divisor of s and 6. 3 Suppose -4c - 16 = 0, -5i + 5c + 1233 = 373. Suppose 39k = -39k + 390. Suppose kh = -i + 243. Calculate the greatest common factor of h and 75. 15 Let k = -445 + 463. Suppose -i = -5t + 31, 4t + 2i + k - 40 = 0. Suppose 14 + 4 = 3p. Calculate the greatest common divisor of p and t. 6 Let d(q) = 6q*2 + 2839q - 17126. Let n be d(6). Let h = 61 - -94. What is the highest common factor of n and h? 31 Suppose 2z - 953 = -811. What is the greatest common divisor of 11573 and z? 71 Let a = 123 + -123. Suppose a = -3t - 2q + 42 + 60, 4q + 12 = 0. Suppose 41u = tu + 35. Calculate the highest common factor of u and 35. 7 Suppose 253a - 108114 = -31a + 62a. Calculate the highest common factor of a and 1. 1 Suppose 153b = 161b - 328. Suppose 1533 = 2q + 5i, -q = -3i - 1160 + 366. Calculate the greatest common factor of b and q. 41 Let k be 1274/10 - 2460/1025. Calculate the greatest common divisor of 5500 and k. 125 Let l be 2330 + -2225 - 55/1. Let z = 224 - 94. What is the greatest common divisor of z and l? 10 Let h be (-14)/77 - (-4 - 27336/187). Let l(c) = -10c. Let k be l(-4). Calculate the highest common divisor of k and h. 10 Let o be 16/20 + ((-1048)/(-40) - 7). Calculate the greatest common factor of o and 160. 20 Let l = 38 - 33. Let w = 4 - l. Let g be (-4 - (3 - -1))/w. What is the greatest common factor of g and 32? 8 Suppose -199 + 269 = 14q. Let m = 4 - 3. Let v = 4 + m. Calculate the highest common factor of q and v. 5 Let w be (7 - 1)(-19)/(-57). Suppose -wo - 362 = -1088. Calculate the highest common divisor of 33 and o. 33 Suppose -354 - 537 = -2364v + 2355v. Let l be 2/8 - (-1053)/12. Calculate the greatest common divisor of l and v. 11 Suppose -4a - 64 = -4g, 3g + a - 41 = -3a. Suppose 105 = 4r - 3v, 2v + v + 15 = r. What is the greatest common divisor of g and r? 15 Let n be ((-3)/((-27)/(-777)))/((-62)/1302). Calculate the highest common divisor of 37 and n. 37 Suppose 0 = 2z - 60 - 10. Suppose -2c = -0c - 62. Let n = c - 21. What is the greatest common divisor of z and n? 5 Let d(s) = 31s + s3 + 7 + 7 - 11s*2 - 3 - 5. Let x be d(10). Suppose 3r - 74 - 7 = 0. Calculate the greatest common divisor of x and r. 27 Let h(t) = -6t2 + 4t - 8. Let m be h(3). Let i = -53 - m. Let v be (49 - -7) + (i - -1). What is the greatest common divisor of 36 and v? 18 Let m be ((-900)/7)/(8/(-1540)). What is the greatest common factor of m and 22? 22 Let p be -11 + 146 + -1. Suppose 9j = 234n - 238n + 137, -5j - 27 = -n. Calculate the highest common factor of p and n. 16 Suppose -19y = 8y - 81. Let c be (-8)/(45/(-54) + y/(-18)). Suppose v + 20 = 76. Calculate the highest common factor of c and v. 8 Let o = 321 - 342. Let t be (98/o)/(2/(-39) - 0). Calculate the greatest common factor of t and 65. 13 Suppose x - 22 = 3i, 0 = -5x - 3i + 145 - 53. Let a = -343 - -666. Calculate the	{ "pile_set_name": "DM Mathematics" }
t common multiple of 2 and g. 30 Let g = 470 + -172. Calculate the common denominator of 57/4 and 3/((-96)/g) - -3. 16 Suppose -5f = 4c - 560, 3f + 27c - 329 = 26c. Calculate the smallest common multiple of f and 24. 216 Suppose -2t + 12 + 12 = 0. Let w(p) = -p - 4. Let d be w(0). Let g = d + t. Calculate the lowest common multiple of 6 and g. 24 Suppose -2h = -h - 28. Suppose v + 0 - 6 = 4p, -5v - 2p + 96 = 0. Let s = h - v. Calculate the lowest common multiple of s and 4. 20 Let y = -1188 - -28553/24. Calculate the common denominator of 53/30 and y. 120 Suppose 3c = z + 845, -z - 4c = 3z + 3332. Calculate the common denominator of -101/56 and (-4)/38 - 1798/z. 616 Let q be 5 - 4 - 369/39. Let g = -29/16876 + 14939407/2413268. Let f = q + g. Calculate the common denominator of f and -64/3. 33 Suppose 0 = y + 1 - 0. Let u = 6 + y. Suppose 5o - 33 = 2l, 5o + 3l - 4l = 34. What is the least common multiple of u and o? 35 Let o = -64/11 - -628/55. What is the common denominator of o and 62/5? 5 Let z be 64 + (2/(-2) - 0). Let p be z/148/13. Let r = 305/26 + p. Calculate the common denominator of r and -77/6. 6 Let g(o) = o2 + 5o + 2. Suppose -10l = -499 + 399. Calculate the lowest common multiple of l and g(-5). 10 Suppose -5l = 5g - 5, g - 3 = -4l - 4g. Let s(o) = o2 - 2o + 1. Let v be s(3). Suppose 5c - v = 21. Calculate the least common multiple of c and l. 10 Let c = 7660 + -61203/8. What is the common denominator of 38/(-96)(-5 + 14) and c? 16 What is the common denominator of (-221)/(-476) + -1 + 4 and 5/28? 28 Let f = 2945/2 + -1428. Let u = 45/23642 - -384406649/236420. Let q = u - 1623. What is the common denominator of f and q? 20 Suppose 0 = 5n + 8 + 17, 0 = 3h - 4n + 124. Let i = 1/220 + 1677/110. What is the common denominator of i and h? 4 Let o(q) = q3 - 6q*2 - q + 5. Suppose 4r = -r + 30. Let d be o(r). What is the smallest common multiple of -44/4d and 14? 28 Let i = 26 - 16. Let x = 99/7 - i. Let o = 2825 - 19722/7. What is the common denominator of x and o? 7 Let n = -2365 - -4825/2. Let i be (20/(-2) - -3) + 3. Find the common denominator of n and ((-536)/240)/(i/10). 12 Let k(b) = -2b + 14. Suppose -4f = r + 9, -2r - r = -5f + 27. Calculate the lowest common multiple of k(r) and 4. 32 Let a = -130061/14316 + 2/1193. Calculate the common denominator of (65/(-2))/(1 + -3) and a. 12 Let p(t) = -6t + 130. Suppose w - 3c = 0, 4w - c - 22 = -0w. Calculate the least common multiple of p(20) and w. 30 Let f = -1139 - -1145. Calculate the smallest common multiple of 108 and f. 108 Let f be 22/(-16) - 33/(-88). Find the common denominator of f/(-74)(-3 - (1 - 5)) and -19/5. 370 Let p = -4/363 - -36703/3630. Find the common denominator of -61/69 and p. 690 Let p(m) = -m2 - 5m + 12. Suppose 0 = 19u - 13u. Let w = 20 - 10. What is the lowest common multiple of w and p(u)? 60 Let w = 15 + -13. Suppose -3z = -0z - 36. Calculate the lowest common multiple of z and 280/105(0 - (-3)/w). 12 Calculate the common denominator of -62/5 and ((-240)/300)/(3/(45/426)). 355 Let g be ((80/15)/8)/((-2)/(-252)). Let f = 108 - g. Calculate the least common multiple of 9 and f. 72 Let r(x) be the second derivative of x4/12 + x3/6 + 3x*2/2 - x. Let h be r(-3). Calculate the common denominator of -5 + h - 159/12 and 1/3. 12 Let w = 6/1807 + 124551/39754. Find the common denominator of w and (27/(-7))/(26/(-91)). 22 Let w = -12939/2 - -7385. Let r = 943 - w. Find the common denominator of r and (111/(-12))/(3/(-2)). 6 Let l(d) = 88d - 76. What is the lowest common multiple of 16 and l(4)? 1104 Let i = 14/785 - -66613/6280. What is the common denominator of i and -71/4? 8 Let z(x) = 12x - 7 + 4 - 11x - 3. Let a be z(12). What is the least common multiple of 9/(-6)(-88)/a and 12? 132 Let g = -34/99 + 5/11. Calculate the common denominator of -97/46 and g. 414 Suppose -25a + 32 = -17a. What is the lowest common multiple of 108 and a? 108 Let m(y) = 29y*2 + 87y - 362. What is the least common multiple of 33 and m(4)? 4950 Let r be 30/(-1024) + -4 - (-12)/3. Let x be (5259/80)/((-288)/55). Let u = x + r. What is the common denominator of u and 113/28? 84 Suppose -i = 2q - 14, -3q - 4i + 0 + 21 = 0. Calculate the smallest common multiple of 24 and q. 168 Let c(r) = -3r + 8r - 6r + 1. Let i = -3 + 5. Find the common denominator of c(i) and 35/9. 9 Suppose 2x + 8690 = 3n, -3n + 3x + 8683 = 8x. Let k = n - 63647/22. Calculate the common denominator of k and 25/6. 66 Let s = 23906/693 - 310/9. Find the common denominator of s and 13/28. 308 Let m = 10261/260 - -9/260. Find the common denominator of m and -3/146. 146 Let w = -26551/1578 + -2/263. Find the common denominator of w and 5/(-18)1/4518. 18 Calculate the common denominator of -29/4 and 2/5 + (-9686)/(-5510). 76 Suppose -5z + 40 = -5g - 0g, 2z - 4 = -g. Let w = -27 + 32. Calculate the least common multiple of w and z. 20 Let q = 5515/516 + 8/129. Find the common denominator of (4/30)/(-2 - (-212)/102) and q. 20 Suppose -2o = 19l - 24l + 130, -25 = -5o. Calculate the least common multiple of 20 and l. 140 Find the common denominator of 67/156 and (-1923)/(-252) + (-6)/(-21). 156 Suppose 6h = 24 - 12. Let v = -14 - -23. Calculate the smallest common multiple of v and h. 18 Suppose -156 = 7m - m. Let x = -15 - m. What is the smallest common multiple of 1 and x? 11 Let p be (-1 - -53162) + (-1)/1. Let y be 1/(-7) + p/112. Let s = 490 - y. What is the common denominator of s and -73/6? 6 Let g(m) = 37m + 94. Calculate the lowest common multiple of 20 and g(-2). 20 Suppose -40 = -3z - 2z. Suppose 3v - 3g - 28 = -7g, -4v + 36 = 4g. What is the least common multiple of v and z? 8 Suppose -1 + 27 = -n. What is the least common multiple of (-152)/n + (44/(-52) - -1) and 6? 6 Suppose 0 = d - 5r + 1 + 10, 2d - 3r - 6 = 0. Calculate the least common multiple of d and 5. 45 Let b(t) = -2t2 + 2t - 6. Let q be b(-9). What is the common denominator of 23/18 and ((-12)/(-672))/(1/q-4)? 1008 Let s be 293/60440/256. Let w = s - 29/24. Find the common denominator of w and -73/36. 288 Suppose 3r - 290 = 5v, 30r - 4v = 34r - 344. Calculate the smallest common multiple of 90 and r. 90 Let w(b) = -20b - 172. What is the least common multiple of 16 and w(-9)? 16 Let f(x) = 33x3 - x2 - 7x + 8. What is the lowest common multiple of f(1) and 2/1 - (1 + -2)? 33 Let p be (112/(-20) - -6)/((-1)/15). What is the smallest common multiple of 40 and 16/(-6)(5 - (2 - p))? 40 Suppose 3k - 2k + 18 = 5w, -16 = -2k - 3w. Suppose 3g + kg = -10. What is the common denominator of (-15)/12 - 1g and 19/2? 4 Suppose 14 = -3s + 74. Suppose 2r + 5l = -39, r - l + 3l + s = 0. Let n = 20053/8 + -2503. Find the common denominator of n and r. 8 Calculate the common denominator of ((-1248)/(-105))/(-2) - -4 and 48. 35 Let i(n) = 6n - n2 + n2 - 3n*3 + 6 + 2n*3 + 4n*2. Calculate the smallest common multiple of -2(-3)/2 - 1 and i(5). 22 Calculate the common denominator of (-3)/108(-375)/27 and -53/14. 2268 Let h be (0 - 2/(-26))5449. Let z = 418 - h. Let y = z + 393/104. Calculate the common denominator of y and 113/14. 56 Let i = -4/811141 - -2567143/27116443630. Let s = i - 1588057/1470920. Calculate the common denominator of s and -34. 88 Let c = 680/273 + -114/91. Find the common denominator of c and 38/3. 21 Let a be -175 - 1/(-3)3. Calculate the common denominator of (-2)/1 + a/(-9) - 1 and -11/7. 21 Let i(w) = -w3 + 25w*2 - 25w + 26. Calculate the smallest common multiple of i(24) and 3. 6 Let n be (624966/(-12))/(18/(-4)). Let c = 12049 - n. Let t = c + -476. Calculate the common denominator of 29/3 and t. 9 Let s = 2/9303 + -54497/37212. Calculate the common denominator of s and 87/40. 280 Suppose 0 = -7a + 9a + 4s - 12, 2a = s + 22. Let k = -4 + 8. What is the smallest common multiple of a and k? 20 Let i = 4022 + -10018. Let c = -36125/6 - i. Find the common denominator of -25/16 and c. 48 What is the lowest common multiple of 14 and (-31)/(-2)*(7 + -3)? 434 Let p = 27 + -15. Calculate the smallest common multiple of p and 81/12 + (-9)/12. 12 Calculate the common denominator of (2058/(-120)	{ "pile_set_name": "DM Mathematics" }
rob of sequence gb. 2/153 What is prob of sequence cc when two letters picked without replacement from wwlwwccclpllxcwllcc? 5/57 Three letters picked without replacement from {i: 1, n: 2, l: 1, b: 11, z: 3}. What is prob of sequence nin? 1/2448 Calculate prob of sequence fn when two letters picked without replacement from fnzuzuozofzn. 1/33 Three letters picked without replacement from {k: 9, n: 11}. What is prob of sequence knk? 11/95 Calculate prob of sequence muum when four letters picked without replacement from umrurn. 0 Two letters picked without replacement from anjjra. Give prob of sequence ra. 1/15 Two letters picked without replacement from aazaaaqalzqaaaqqaaoq. Give prob of sequence oa. 11/380 Calculate prob of sequence kkz when three letters picked without replacement from {z: 4, k: 10, l: 1, j: 2, w: 2}. 20/323 Four letters picked without replacement from ppzzhzzpzhzwwzzhhz. Give prob of sequence zzwp. 1/170 Two letters picked without replacement from {f: 1, j: 2, m: 7}. Give prob of sequence jm. 7/45 Three letters picked without replacement from fnnfnfnfnnfnn. What is prob of sequence fff? 5/143 Calculate prob of sequence qxq when three letters picked without replacement from qqxxqxx. 4/35 What is prob of sequence oe when two letters picked without replacement from {e: 4, o: 3, t: 5}? 1/11 Four letters picked without replacement from {g: 2, j: 8, v: 4}. Give prob of sequence jjvg. 8/429 Four letters picked without replacement from {p: 1, b: 1, k: 1, y: 2, w: 1, u: 1}. Give prob of sequence puyk. 1/420 Calculate prob of sequence pqqz when four letters picked without replacement from {x: 6, p: 2, k: 1, z: 2, q: 2, l: 4}. 1/7140 Calculate prob of sequence rnz when three letters picked without replacement from {a: 1, n: 2, z: 8, r: 2}. 8/429 Two letters picked without replacement from {i: 1, f: 3, h: 4, q: 1, a: 6, r: 1}. What is prob of sequence ar? 1/40 Two letters picked without replacement from xtxtxktktt. What is prob of sequence tt? 2/9 Calculate prob of sequence cbj when three letters picked without replacement from {j: 1, b: 2, c: 1}. 1/12 Four letters picked without replacement from {m: 4, x: 3, f: 1, u: 3}. What is prob of sequence uxuf? 1/440 Calculate prob of sequence yp when two letters picked without replacement from tpypbeyepe. 1/15 Calculate prob of sequence rj when two letters picked without replacement from {j: 1, r: 1, v: 1}. 1/6 What is prob of sequence hn when two letters picked without replacement from hhshsuhnnsnushnnhhs? 35/342 Four letters picked without replacement from {e: 1, w: 3, i: 1, o: 1, b: 1}. What is prob of sequence owie? 1/280 Three letters picked without replacement from wmmmyymll. What is prob of sequence llw? 1/252 What is prob of sequence js when two letters picked without replacement from {j: 7, t: 5, s: 4}? 7/60 Calculate prob of sequence tt when two letters picked without replacement from {m: 1, a: 1, i: 1, s: 5, t: 6, q: 6}. 3/38 Four letters picked without replacement from ebexebfeeeexfbfwf. What is prob of sequence ebxb? 1/680 What is prob of sequence rkwr when four letters picked without replacement from {q: 1, r: 5, w: 2, k: 1}? 5/378 Four letters picked without replacement from {l: 2, p: 8, g: 3, f: 3}. What is prob of sequence ffll? 1/3640 Four letters picked without replacement from {q: 2, b: 2, g: 1, h: 2, j: 7, v: 1}. Give prob of sequence jhvg. 1/2340 Three letters picked without replacement from {j: 3, o: 1, u: 1, q: 3, g: 2}. What is prob of sequence goq? 1/120 Two letters picked without replacement from wwwwwdwwwwkwwwkwddww. What is prob of sequence kw? 3/38 What is prob of sequence bsb when three letters picked without replacement from oolbllsloblolb? 1/364 Three letters picked without replacement from myolvvmvovly. Give prob of sequence yoy. 1/330 Calculate prob of sequence balp when four letters picked without replacement from aplabaatla. 1/504 Three letters picked without replacement from zzzzzozo. What is prob of sequence ooz? 1/28 What is prob of sequence wxw when three letters picked without replacement from xxwxwxxxx? 1/36 Three letters picked without replacement from ntonnnnonntnnnnnon. What is prob of sequence tot? 1/816 Three letters picked without replacement from qyyniyqqqyiifnfqfnnr. Give prob of sequence yqi. 1/114 Two letters picked without replacement from tcbctbwccs. Give prob of sequence ws. 1/90 What is prob of sequence gji when three letters picked without replacement from {j: 2, g: 2, i: 4}? 1/21 Two letters picked without replacement from zxszxsss. What is prob of sequence ss? 3/14 Calculate prob of sequence yiim when four letters picked without replacement from miviy. 1/60 Two letters picked without replacement from nbb. Give prob of sequence nb. 1/3 What is prob of sequence vgi when three letters picked without replacement from {g: 2, v: 3, i: 10, x: 3, n: 2}? 1/114 Three letters picked without replacement from rrssssp. Give prob of sequence psr. 4/105 Two letters picked without replacement from eketddiewtiwwewtiiei. What is prob of sequence it? 3/76 Calculate prob of sequence qdm when three letters picked without replacement from {q: 6, d: 1, m: 4}. 4/165 Four letters picked without replacement from evgedeeegev. Give prob of sequence evve. 1/132 Three letters picked without replacement from orara. What is prob of sequence aor? 1/15 What is prob of sequence bbbb when four letters picked without replacement from bbbbbbbbb? 1 What is prob of sequence wbwx when four letters picked without replacement from {r: 1, x: 1, b: 2, i: 2, w: 2}? 1/420 Two letters picked without replacement from ghjtehg. What is prob of sequence eg? 1/21 Calculate prob of sequence cc when two letters picked without replacement from ubbbcbuuuabcuuuuuuu. 1/171 Two letters picked without replacement from vwxvxvxxvxv. Give prob of sequence xw. 1/22 Calculate prob of sequence yebb when four letters picked without replacement from bejtbbby. 1/140 Four letters picked without replacement from nannnttf. What is prob of sequence afnn? 1/140 What is prob of sequence cf when two letters picked without replacement from {c: 2, f: 1}? 1/3 Calculate prob of sequence nnww when four letters picked without replacement from wwwnn. 1/10 Two letters picked without replacement from thhhthhhhhhhh. What is prob of sequence tt? 1/78 Two letters picked without replacement from hrshcrorosaooho. Give prob of sequence sr. 1/35 Two letters picked without replacement from hhyyhhyhyhyyhhyhhyyu. What is prob of sequence yh? 9/38 What is prob of sequence nn when two letters picked without replacement from {n: 16, i: 1, w: 1}? 40/51 Calculate prob of sequence fllf when four letters picked without replacement from vmfmljjvmvjvvj. 0 Calculate prob of sequence bx when two letters picked without replacement from sxvbh. 1/20 Three letters picked without replacement from {z: 3, y: 13}. Give prob of sequence yyz. 39/280 Three letters picked without replacement from {q: 3, r: 5}. What is prob of sequence qqr? 5/56 Calculate prob of sequence uuqq when four letters picked without replacement from unnvquevvvqnnvqvne. 1/6120 What is prob of sequence oh when two letters picked without replacement from ohhhohhhht? 7/45 Three letters picked without replacement from bgybbbbmmbbmbbbbgbb. What is prob of sequence bbb? 286/969 Three letters picked without replacement from vgpel. Give prob of sequence epe. 0 Three letters picked without replacement from {k: 1, b: 2, x: 2, d: 7}. What is prob of sequence xdb? 7/330 Calculate prob of sequence lln when three letters picked without replacement from lmqlmmqlmnlqm. 1/143 Four letters picked without replacement from bcicbcciicciciivii. What is prob of sequence ciic? 49/1530 Four letters picked without replacement from {v: 6, e: 4, y: 2, a: 3, m: 2}. Give prob of sequence aemm. 1/2380 Four letters picked without replacement from iiciwwtwlwiiwiw. What is prob of sequence iwli? 1/182 Four letters picked without replacement from {b: 4, u: 6, w: 2, n: 2, h: 2, d: 1}. What is prob of sequence dwhh? 1/14280 Four letters picked without replacement from lxglxrx. What is prob of sequence gxgl? 0 Four letters picked without replacement from oaaooooooooa. What is prob of sequence ooaa? 2/55 Four lett	{ "pile_set_name": "DM Mathematics" }
- 11. Solve u(n) = 0. -6, -2, 0 Let h = 87 - 85. Factor 3g - 3g*h + 8g*2 - 2g*2. 3g(g + 1) Let f(a) be the third derivative of 0 - 3a*2 - 1/42a*3 - 1/84a*4 + 0a - 1/420a5. Solve f(t) = 0. -1 Let r = 27 - 13. Let m be 168/245 - 4/r. Factor 4/5t + mt2 - 6/5. 2(t - 1)(t + 3)/5 Let f = -5 - -7. Suppose 32h + 1 = 59h + 1. Factor -4/5y*3 - 8/5y + h + 12/5yf. -4y(y - 2)(y - 1)/5 Let h(f) be the second derivative of 5f4/24 - 70f*3 + 835f*2/4 - 1032f. Factor h(q). 5(q - 167)(q - 1)/2 Let k(f) = f4 + f2 - f + 1. Let r(u) = -u*5 - 3u*4 + 9u*3 + 3u*2 - 14u - 14. Let v(m) = -4k(m) - 2r(m). Find c such that v(c) = 0. -3, -1, 2 Let y(h) be the second derivative of h*4/4 - 13h*3/5 + 63h*2/10 + 48h - 1. Solve y(n) = 0. 1, 21/5 Suppose -282 = 5s + 8. Let u be -5 - -2 - s/362. Let 2/9n5 + un*2 + 2/3n*4 + 2/3n*3 + 0 + 0n = 0. Calculate n. -1, 0 Let r = 144 - 144. Suppose 5z - 8 - 2 = r. Factor 10/3w*z + 0 - 8/3w. 2w(5w - 4)/3 Suppose -4w = 20, -3k - 4w = -0k + 5. Let h be (k - 3)/(-6)-12. Determine p so that 8p3 + 12p*h - 2p*4 + 4p*2 - 6p*4 = 0. -1, 0 Let v = -3199/68 + 838/17. Determine w so that 3/4w*3 - 3/4w*4 + vw*2 - 3/4w - 3/2 = 0. -1, 1, 2 Let j(k) be the second derivative of k*4/24 + 2k*3/3 + 7k*2/4 - 2k - 30. Solve j(c) = 0 for c. -7, -1 Let s(a) be the first derivative of -a7/3780 - a6/540 - a*5/270 + 10a*3/3 + 11. Let l(t) be the third derivative of s(t). Factor l(r). -2r(r + 1)(r + 2)/9 Let k be (1 - -6) + (-2106)/648 - -3. What is i in 1/4i3 + ki + 27/4 + 9/4i2 = 0? -3 Let g be 26 + (-9)/3 + 4. Let -4 + 34q - gq2 - 11q - q - 3q2 = 0. Calculate q. 1/3, 2/5 Let x(f) be the third derivative of -f6/40 + 37f*5/20 - 71f*4/8 + 35f*3/2 - 38f*2 + f. Factor x(p). -3(p - 35)(p - 1)2 Let u be 5 + ((-1)/(-26))/((-6)/768). Let l(y) be the first derivative of 0y - 4/39y3 + 3 - uy*2. Suppose l(q) = 0. Calculate q. -1/2, 0 Let r = 148 + -145. Factor 5u*r - 12u*5 + 14u*5 - 7u*5. -5u*3(u - 1)(u + 1) Let o = 58 - 34. Factor 24 - 5k*2 - o + 2k*2 + 15k. -3k(k - 5) Let v = -11 + 17. Let s(k) = 5k3 + 5k*2 - 15k + 5. Let o(y) = 5y3 + 4y*2 - 15y + 6. Let x(a) = vs(a) - 5o(a). Determine q, given that x(q) = 0. -3, 0, 1 Let l(c) be the first derivative of -2c3/21 + 10c*2/7 - 56. Factor l(v). -2v(v - 10)/7 Suppose 0 = -7c - 609 + 609. Let z(d) be the second derivative of 77/4d4 - 20d*3 + c + 6d*2 + 4d + 363/20d5. Let z(t) = 0. Calculate t. -1, 2/11 Determine b, given that 32/7b*5 - 16/7b*4 + 0 - 78/7b*3 - 34/7b*2 - 4/7b = 0. -1, -1/4, 0, 2 Let y(q) be the third derivative of -q*6/120 + 3q*5/10 - 35q*4/8 + 98q*3/3 - 48q*2 - 2q. Factor y(o). -(o - 7)*2(o - 4) Let u be (4 + (-584)/140)((-480)/18)/8. Factor 0a + ua2 + 0. 4a2/7 Let j(k) be the first derivative of k6/840 - k*4/168 - 29k*2/2 + 4. Let m(l) be the second derivative of j(l). Determine c so that m(c) = 0. -1, 0, 1 Let i be ((-245)/36)/(-7) + (-84)/112. Find x, given that 8/9x*3 + 2/9 + ix*4 + 4/3x*2 + 8/9x = 0. -1 Let k(o) be the second derivative of 1/120o6 + 1/4o*2 + 0 - 1/80o*5 + 1/24o*3 - 1/16o*4 + 9o. Solve k(v) = 0. -1, 1, 2 Suppose -4 = 4g, -v + 3g - 30 = -g. Let x(j) = 2j2 + 27j + 69. Let o(f) = 12f2 + 161f + 415. Let a(u) = vx(u) + 6o(u). Let a(k) = 0. Calculate k. -6 Let x(q) be the first derivative of 2q6/27 + 4q*5/15 - 23q*4/9 + 44q*3/9 - 28q*2/9 - 240. Let x(l) = 0. Calculate l. -7, 0, 1, 2 Factor -5k*2 + 9/2k3 - k4 + 7/4k + 0 - 1/4k*5. -k(k - 1)*3(k + 7)/4 Let x(n) be the third derivative of 0n - 9n*2 - 1/42n*7 + 0n*3 + 0 + 5/336n*8 + 0n*4 - 5/24n*6 - 1/4n*5. Factor x(m). 5m*2(m - 3)(m + 1)2 Solve 960h + 194/5h2 + 4608/5 + 2/5h*3 = 0 for h. -48, -1 Let b(w) = 7w*4 + 3w*3 - 5w*2 - 13w - 2. Let u(l) = 51l4 + 21l*3 - 33l*2 - 90l - 12. Let p(s) = 15b(s) - 2u(s). Let p(g) = 0. Calculate g. -1, 2 Suppose -10g + 23 = -7. Let j(t) = 7t*5 + 10t*3 - 9t. Let q(a) = a5 + a3 - a. Let p(u) = gj(u) - 24q(u). Factor p(y). -3y(y - 1)*2(y + 1)*2 Let g be 66/(-54) - 6/(-27). Let r be (g - (-2 - 2)) + 1. Find o, given that -ro3 - o5 - 2 + 0o + 2o*5 + 4o + 2o2 - o = 0. -2, -1, 1 What is g in -16/3 + 16/3g - 4/3g2 = 0? 2 Solve 0 - 2/9b*3 + 8/9b*2 + 8/3b = 0. -2, 0, 6 Let c(m) be the second derivative of -m*7/420 + 7m6/360 - m5/30 - 5m4/6 + 9m. Let z(a) be the third derivative of c(a). Find b, given that z(b) = 0. 1/3, 2 Let b = -17 - -17. Let a(l) be the second derivative of -2/63l7 + 0l*4 - 2/9l*3 - 4l + b + 0l2 + 2/15l*5 + 0l*6. Suppose a(j) = 0. Calculate j. -1, 0, 1 Let h be 14/(-28) + (-7)/(-2). Factor -48k*3 + 0k*2 + 37k*3 - 8k*2 + 47k*h. 4k*2(9k - 2) Let u = 2323 - 9291/4. What is d in 0 + 1/4d + 3/4d3 + ud*4 + 3/4d*2 = 0? -1, 0 Factor -648z*2 + 14408z*3 - 54z4 - z5 - 14732z3 - 2z*5. -3z*2(z + 6)3 Let b(v) be the third derivative of v5/30 - v4/24 + v3/3 + 4v2. Let a be b(1). Solve -9r - 3r3 - 4r*2 - 2r*a - 3r4 + r4 + 8r = 0 for r. -1, -1/2, 0 Let c be (9/(-28))/(30/(-35)). Let n = -1388 - -1392. Determine b, given that -3/8b*3 + cb*n - 3/8b*2 + 0b + 0 + 3/8b5 = 0. -1, 0, 1 Suppose 0 = 3b - 4v + 3v - 7, b - 4v = -16. Suppose -b - 191h*4 + 14h + 189h4 + 7h*3 - 18h*2 + 3h*3 = 0. Calculate h. 1, 2 Let 99/2j + 27/2j3 + 78j*2 - 15 = 0. Calculate j. -5, -1, 2/9 Suppose -1445 = -5a + 5g, 3g - 855 = -2a - a. Suppose -281 = 3c - a. Factor -4/5w + 6/5w*c + 0. 2w(3w - 2)/5 Let o be ((7 - 1) + 735/(-126))0. Factor -1/2z*2 + o + z. -z(z - 2)/2 Suppose 4b - t - 7 = 1, -t = 0. Suppose -o - bz = 0, -o = -0o - 5z - 14. Factor -2w3 + 4w*3 + ow*2 + 2w*3. 4w*2(w + 1) Let j(b) be the third derivative of -2b7/105 - 29b*6/30 + 2b*5 + 32b*2 + 2b. Factor j(n). -4n2(n - 1)(n + 30) Let o(h) be the second derivative of h5/30 + 11h*4/12 - 4h*3 - 18h*2 - 3h. Let k(z) be the first derivative of o(z). Suppose k(l) = 0. Calculate l. -12, 1 Let q(a) be the third derivative of a*5/90 - 5a*4/18 - 11a*3/9 - 210a*2. Suppose q(i) = 0. Calculate i. -1, 11 Let j = -871/8 + 2629/24. Factor -2 + 4/3w*2 + jw*5 + 2/3w*4 + 10/3w - 4w3. 2(w - 1)*3(w + 1)(w + 3)/3 Let j(o) = -17o*2 - 9 - 8 + 9 + 6o*2 + 13o. Let n(a) = -21a2 + 25a - 15. Let d(b) = -11j(b) + 6n(b). Let d(k) = 0. Calculate k. 2/5, 1 Let p be 4060/1305 - 1/9. Find w such that -1/6w5 - 1/2w*p - 1/6w*2 + 0 + 0w - 1/2w4 = 0. -1, 0 Let l(b) = b3 + 10b*2 + 13b + 6. Let n be l(-8). Factor -nu - 6 - 75/2u*2. -3(5u + 2)2/2 Let u(l) be the third derivative of -l7/315 + l6/36 - l5/10 + 7l*4/36 - 2l*3/9 + 96l*2 - 2. Factor u(p). -2(p - 2)(p - 1)3/3 Let u = -319 - -998/3. Let i = -13 + u. Factor -im*2 + 0 - 2/3m*3 + 0m. -2m2(m + 1)/3 Let g(w) be the second derivative of -w7/504 - w6/72 - w*5/24 + 17w*4/6 - 15w. Let a(d) be the third derivative of g(d). What is p in a(p) = 0? -1 Let q(t) be the second derivative of -t6/45 - t5/15 + 2t3/9 + t2/3 + 21t. Let q(j) = 0. Calculate j. -1, 1 Let h = -201/11 - -3505/187. Let g = 10/51 + h. Let -1/3u4 + 0 + 0u3 + u2 + gu = 0. Calculate u. -1, 0, 2 Let u(k) be the third derivative of 0k*3 + 0k + 1/72k4 - 1/90k*5 + 0 + 1/360k*6 + 4k*2. Find d such that u(d) = 0. 0, 1 Factor 21/5 - 3/5x*2 + 18/5x. -3(x - 7)(x + 1)/5 Let c(i) be the first derivative of 0i - 4/3i*3 + 17 - 12/5i*5 - 3i*4 + 0i*2 - 2/3i*6. Factor c(y). -4y*2(y + 1)*3 Factor 38/9y*4 + 0 + 4y*3 + 0y + 0y2 + 2/9y*5. 2y*3(y + 1)(y + 18)/9 Let l(z) = z2 + 4z + 3. Let x be l(-3). Let j(w) be the second derivative of 1/3w4 + x - 2/3w*3 - 5w - 4w2. Factor j(y). 4(y - 2)(y + 1) Let l(x) be the second derivative of -x6/15 - 13x*5/10 - 23x*4/6 - 11x*3/3 + 32x - 6. What is k in l(k) = 0? -11, -1, 0 Let u = 450826/67623 - 2/22541. Suppose -8/3c + 16/3c*3 + 0 - uc*2 + 4c**4 = 0. What is c? -2, -1/3, 0, 1	{ "pile_set_name": "DM Mathematics" }
= -ph - 5000008. Round h to the nearest one hundred thousand. -1000000 Let i be (-7124)/(-8) - 1/2. What is i rounded to the nearest 100? 900 Suppose j - 4m - 5269 = -0j, m - 5274 = -j. Suppose -18362 = -z - 3089. Let n = j - z. What is n rounded to the nearest ten thousand? -10000 Let n(o) = 212200o*2 + 3o + 3. Let h be n(4). Let a = -13095215 + h. Round a to the nearest one million. -10000000 Let b(k) = -3k - 4. Let p be b(-2). Suppose -4w + 22 = 5j - 4, 0 = pj + 4w - 8. Round j to the nearest integer. 6 Let c be (3 + -162503)(1 + -3). Round c to the nearest ten thousand. 330000 Let o = 66 + -65.999807. What is o rounded to 5 dps? 0.00019 Let m = -3 - 1. Let u be 1/(1/8-1). Let q be (-2)/u + 1201/m. What is q rounded to the nearest 1000? 0 Let a(s) = 144s*2 - 7s + 1. Suppose 0 = 2h + 2h - 5w + 30, 4h + 2w + 16 = 0. Let d be a(h). Let i = -1636 + d. What is i rounded to the nearest 10000? 0 Suppose -1 + 11 = 5g. Suppose -gc + 2w = -3w + 73, 3c = -w - 101. What is c rounded to the nearest ten? -30 Let a = -22499.407 + 32.407. Let m = 22467.050042 + a. Let l = m + -0.05. What is l rounded to 5 decimal places? 0.00004 Let m = -4.2 + 9. Let t = -84.8 + m. Let j = t + 80.000118. What is j rounded to five dps? 0.00012 Suppose 3o + 4x = 51005742 + 18732049, 2o - 46491864 = -2x. Let h = o - 36027469. Let w = -8181532 - h. Round w to the nearest one million. 5000000 Let g be (-12)/(2/(-1) - 0). Let t = g + -87. Round t to the nearest 10. -80 Let c = -21692 + 15332. Round c to the nearest one thousand. -6000 Let l = 50180765721 + -50180980261.07037. Let t = 214541 + l. Let p = t + -0.93. Round p to 4 decimal places. -0.0004 Let a = 57331.71195992 + -57282.8924. Let y = -22.18043955 - a. Let k = y + 71. Round k to seven dps. 0.0000005 Let a = -7.348 - 0.052. Let p = a - -7.399969. Round p to 5 decimal places. -0.00003 Let o(l) = 1231l - 16. Let m(t) = t. Let s(k) = -1848k + 24. Let p(g) = m(g) + s(g). Let v(d) = -7o(d) - 5p(d). Let u be v(6). Round u to the nearest 1000. 4000 Let j = 1418 - 1418.000000861. Round j to 7 dps. -0.0000009 Let r = 0.07 - 0.03. Let g = r + 6.96. Let y = 6.9982 - g. What is y rounded to 3 dps? -0.002 Let v = -22 - -14. Let o = -12443398 + 12443406.000057. Let g = o + v. What is g rounded to five decimal places? 0.00006 Let k = 1.75 - 1.833. Let q = 190987.082943 - 190987. Let d = q + k. Round d to five dps. -0.00006 Let s be (3/9 + -2)3. Let g = s - -2. Let v be (-323)/g - 0. Round v to the nearest 10. 20 Let z = -0.1 + 0.3. Let d = 120.794 - 121. Let l = d + z. What is l rounded to two decimal places? -0.01 Let o = 13.9 - 13.89999504. What is o rounded to 6 dps? 0.000005 Let c be 49021/4. Suppose -i + c = -6i. Let v = -112 - i. Round v to the nearest ten. -60 Let f = 1.07 - 1.0700275. What is f rounded to 5 decimal places? -0.00003 Let l = -16 + 16.59. Let h = l + -1.51. Let c = h - -0.9199878. Round c to 6 dps. -0.000012 Let x = 4 + -3. Let r(y) = 2964879y - 1. Let d be r(x). Let w = 1164878 - d. Round w to the nearest one million. -2000000 Let v = -282.4 - -221. Let b = -9.4 - v. Let a = 56.8 - b. What is a rounded to the nearest integer? 5 Let n = 8.1 - 9.23. Let v = -0.25 - n. What is v rounded to one decimal place? 0.9 Suppose 0 = -3f - 4t - 1019996, 4f = -3t - 1857969 + 497972. What is f rounded to the nearest one hundred thousand? -300000 Let c = -368.42 - -372. Round c to one decimal place. 3.6 Let l be 1/(-4) + (-68805)/(-20). What is l rounded to the nearest one thousand? 3000 Let a(i) = i*2 + 1. Let z be a(-4). Let g(f) = -8f*2 + zf - f2 + f3 + 5 - 4f. Let s be g(11). Round s to the nearest one hundred. 400 Let k = -0.2 - -0.19996. What is k rounded to 5 decimal places? -0.00004 Suppose -n = 5d - 62, -d - 2n = -4d + 32. Round d to the nearest 10. 10 Suppose -3j - 32747742 = 18252258. Round j to the nearest one million. -17000000 Let a(m) = -2m + 1400. Let l be a(0). What is l rounded to the nearest one thousand? 1000 Let p be (-4 - -1)/(6/(-8)). Let w be 1/p + (-14)/(-8). Suppose wu = 5u + 23700. Round u to the nearest 1000. -8000 Suppose 4319 = 2f - 2441. Suppose 2k + 0k = -f. Round k to the nearest 100. -1700 Let d = 2.9 + -2.792. Let z = -0.10800122 + d. Round z to seven decimal places. -0.0000012 Suppose 23933 = -3h + 8933. What is h rounded to the nearest one thousand? -5000 Suppose 3z = -z. Let b be (3 - -7) + -41. Let h be z + -40885/b. What is h rounded to the nearest 1000? -6000 Suppose 8088 = 5r + 4i, -r + 2i + 0i = -1626. What is r rounded to the nearest one hundred? 1600 Let b = 5.476565 + -0.47658. Let s = b - 5. Round s to five dps. -0.00002 Let y be -2 + (-2)/((-2)/7). Suppose -yr + 6999995 = 3b - 2b, b - 7000004 = 4r. What is b rounded to the nearest 1000000? 7000000 Let g = 1.56 - 33.06. Let k = 31.499847 + g. What is k rounded to 5 decimal places? -0.00015 Let h(r) = 2r + 8. Let k be h(7). Suppose c = 4d - k, 4c + 3d - 1 = 6. What is c rounded to the nearest integer? -2 Let l = 0.29 - 0.5. Let y = l - -0.379. Round y to two dps. 0.17 Let q = -0.45 + 0.25. Let b = 969.1995 + -969. Let x = q + b. Round x to 4 dps. -0.0005 Let a = -0.1 - -0.2. Let y = a - -0.15. Let v = -0.2334 + y. Round v to three decimal places. 0.017 Let k(f) = -974999f*2 + 3f + 2. Suppose -2n + 18 = -2d + 6, -28 = 4d - 5n. Let w be k(d). What is w rounded to the nearest one million? -4000000 Let r = 0.299909 - 0.3. What is r rounded to 5 decimal places? -0.00009 Let k = -248576.00028 + 248564. Let j = k - -12. Round j to four decimal places. -0.0003 Let r = -1968.82 - -1987. Let s = r + -18. Let c = -0.4 + s. Round c to 1 decimal place. -0.2 Let r = 30 + -30.0000045. What is r rounded to six decimal places? -0.000005 Let y = -21642 - -31073. Let j = y - 9431.07986. Let q = -0.08 - j. Round q to four decimal places. -0.0001 Let p = -0.33252905 + 0.68252827. Let t = -0.35 + p. Round t to 7 dps. -0.0000008 Suppose 0 = -7g + 3g. Round g to the nearest 100. 0 Suppose 2j + 279992 = -5i, -3j - 10419 = -5i - 290431. Round i to the nearest 10000. -60000 Let s = 0.048 - -34.952. Let h = s + -53. Let y = -15.1 - h. Round y to the nearest integer. 3 Let p = -26 + 17. Let i = 12 + p. Suppose n + 8400 = in. Round n to the nearest 1000. 4000 Suppose 3t - 5m - 83528 = 16572, -4m + 66748 = 2t. Suppose -3c = -218630 - t. Round c to the nearest 10000. 80000 Let h = 2.34 - 15.04. Let v = -12.700212 - h. What is v rounded to 5 decimal places? -0.00021 Let q = -46 + 46.0000035. Round q to six dps. 0.000004 Let t = -449784.596 - -1070.596. Let b = t - -448746.6861. Let o = -32.7 + b. Round o to three decimal places. -0.014 Let k(g) = g*2 + 6g - 10. Let n be k(-8). Suppose -2f - 1 = a - n, 0 = f - a - 4. Suppose -fw = -w + 1200. What is w rounded to the nearest one thousand? -1000 Let f = 6 - 5.96. Let q = f - 0.187. Round q to 2 decimal places. -0.15 Let z = -16.2 + 16.34. What is z rounded to 1 decimal place? 0.1 Let a = 33.97 - 34. Round a to one decimal place. 0 Let y be 0/2 + 222500. Round y to the nearest 10000. 60000 Suppose y - 1072 = -v, 2v + y - 2y = 2147. Let p be (1/(-1))/((-4)/20908). Suppose p = -o - v. What is o rounded to the nearest 1000? -6000 Let z = 0.162 + 1.658. What is z rounded to 0 dps? 2 Suppose 4m - 129972 = -4b, 3m + 9530 = b - 22963. Suppose 0 = -3v + 357507 + b. What is v rounded to the nearest 100000? 100000 Let h = -0.223428 + 0.224. What is h rounded to four dps? 0.0006 Let b = -2627 - -5397. What is b rounded to the nearest one thousand? 3000 Let t = -910.35 - -910.659896. Let r = 0.29989532 - t. Let m = -0.01 - r. Round m to 7 decimal places. 0.0000007 Let v = 2.2 + 0.2. Let m = 19.4 - v. Let j = m - 17.0000104. Round j to six decimal places. -0.00001 Let z = 83941 + -83941.169999. Let v = z - -0.17. Round v to 5 dps. 0 Let d = 440152 + -256205. Suppose -5y - f + 265004 = 0, 4y + f - 28057 = d. Round y to the nearest ten thousand. 50000 Let k = -0.287382 + 273034.287382. Let l = k + -273034.1170081. Let w = -0.117 - l. What is w rounded to six decimal places? 0.000008 Suppose 7z - 2z = 10. Suppose -zj = 3*j - 855. Round j to the nearest 10. 170 Let x be -2 - 1 - (-5 + 8902). What is x rounded to the	{ "pile_set_name": "DM Mathematics" }
implify ((sqrt(25) - (sqrt(2025)1 - sqrt(25))) + sqrt(25))/(sqrt(5) - sqrt(35)/sqrt(112)). -8sqrt(5) Simplify sqrt(187)/(5sqrt(121)/sqrt(11)). sqrt(17)/5 Simplify sqrt(38)/(2sqrt(128) - sqrt(2)). sqrt(19)/15 Simplify -2 + (sqrt(175) - (sqrt(175) - (sqrt(175) + sqrt(175) + 1))). -1 + 10sqrt(7) Simplify (sqrt(6) + (sqrt(288)/sqrt(6))/sqrt(8))/(sqrt(324)/sqrt(3) + sqrt(3)). 2sqrt(2)/7 Simplify (0 + -3(sqrt(180) + 1))2. 108sqrt(5) + 1629 Simplify (sqrt(91)-24)/(sqrt(896)/sqrt(8)). -2sqrt(13) Simplify (sqrt(17) + 0 + 2 + sqrt(102)/(sqrt(12)/sqrt(2)))2. 8sqrt(17) + 72 Simplify -2 + sqrt(180)-1. -6sqrt(5) - 2 Simplify (2(sqrt(11) + 5 + sqrt(22)/sqrt(2) + sqrt(11)))2. 120sqrt(11) + 496 Simplify 1((sqrt(88) + (3sqrt(88) - sqrt(88)))/sqrt(8) - sqrt(99)-2)2. 891 Simplify (-2 + sqrt(99))2 + sqrt(11) + sqrt(1584)2. 13sqrt(11) + 103 Simplify -2 + ((sqrt(5) - sqrt(20))-2 - -3(1 + sqrt(5))). 1 + 5sqrt(5) Simplify (sqrt(117)2-4)/sqrt(9). -8sqrt(13) Simplify -3sqrt(12)-1. 6sqrt(3) Simplify (3 + (sqrt(13) - sqrt(13)-2))2 + 3. 18sqrt(13) + 129 Simplify -3sqrt(48) + (sqrt(3) - sqrt(33)/(sqrt(33)/sqrt(3))). -12sqrt(3) Simplify sqrt(171)/(sqrt(36)-2 - sqrt(36)). -sqrt(19)/6 Simplify ((1 + sqrt(128))1)*2. 16sqrt(2) + 129 Simplify -44(-4 + 3sqrt(2) + sqrt(2) + sqrt(2))2. -1056 + 640sqrt(2) Simplify -2sqrt(20)/(-2sqrt(1210)). sqrt(2)/11 Simplify -4 + (sqrt(539) + 3 - sqrt(11)). -1 + 6sqrt(11) Simplify (sqrt(228)/(sqrt(300)1))*2. 19/25 Simplify (sqrt(539) + (-1sqrt(539) - sqrt(539) - sqrt(539)) + sqrt(539))*2-6 + -5(-2 + sqrt(539)). -3224 - 35sqrt(11) Simplify sqrt(18)/sqrt(9) + 4 + 6(4 + sqrt(2) - sqrt(2)). sqrt(2) + 28 Simplify (sqrt(315)/sqrt(81))/(-4(sqrt(7) - sqrt(7)-1)). -sqrt(5)/24 Simplify (3-3(-2sqrt(252) + 2))*2. -3888sqrt(7) + 81972 Simplify 4 + (sqrt(19) - sqrt(190)/sqrt(10)) + (sqrt(114) - -4sqrt(114))/sqrt(6). 4 + 5sqrt(19) Simplify 4(-4 + (sqrt(405) - (-2 + sqrt(405)))). -8 Simplify ((-2sqrt(140))/sqrt(4))/(sqrt(70)/(2sqrt(10)) - sqrt(7)). 4sqrt(5) Simplify 6sqrt(98) + -5. -5 + 42sqrt(2) Simplify (sqrt(2)31 + 1)-3. -9sqrt(2) - 3 Simplify 1(sqrt(125) + (-1sqrt(125) - sqrt(125)) + sqrt(5) + (sqrt(50)/sqrt(2))/sqrt(5)). -3sqrt(5) Simplify (sqrt(9)/sqrt(3) + 4)2 + (-2sqrt(3) - sqrt(3))-1 + 0. 19 + 11sqrt(3) Simplify (-5sqrt(784))/((1sqrt(77))/sqrt(11)). -20sqrt(7) Simplify -1sqrt(128) + -1. -8sqrt(2) - 1 Simplify -5-2sqrt(102)/(sqrt(6) - -1sqrt(6)). 5sqrt(17) Simplify 0 + -3 + sqrt(72). -3 + 6sqrt(2) Simplify sqrt(32)6 + 2 + -3. -1 + 24sqrt(2) Simplify ((sqrt(66) + -5-1sqrt(66))/(sqrt(12)/sqrt(2)-5))2. 396/25 Simplify sqrt(108)-2 - (sqrt(12) + 3). -14sqrt(3) - 3 Simplify -2sqrt(175) + -1 - sqrt(175)-1-3. -25sqrt(7) - 1 Simplify (sqrt(198)/(sqrt(33)/sqrt(3)))/(sqrt(216)/sqrt(4)). sqrt(3)/3 Simplify sqrt(468) + (-1 + sqrt(468))2 + 0 + (2 + 0 + sqrt(468))2. 18sqrt(13) + 941 Simplify (1(1sqrt(152) + sqrt(152)))/(-2sqrt(648)). -sqrt(19)/9 Simplify (2 + sqrt(2057) + 4 + 2)2. 176sqrt(17) + 2121 Simplify ((-2sqrt(17) + -3)-3)*2 - (0 + -2sqrt(1088) + sqrt(1088))*2. -395 + 108sqrt(17) Simplify (sqrt(15)/(sqrt(5) + sqrt(45)))2 + 0 + 2. 35/16 Simplify -2 + (sqrt(11) + (sqrt(88)/sqrt(8))2 + 1)-5. -62 - 5sqrt(11) Simplify sqrt(7)14 - (sqrt(7)4 + 5 - sqrt(7)). -5 + sqrt(7) Simplify 0 + 4(sqrt(320) + sqrt(320) + sqrt(320) + (sqrt(320) + sqrt(320)2 - sqrt(320)))-1. -160sqrt(5) Simplify (3(sqrt(833) + 1)-1)2. 126sqrt(17) + 7506 Simplify (5sqrt(156)/sqrt(3))/(-1sqrt(4)-1 + sqrt(4)). 5sqrt(13)/2 Simplify -2-2(3 + sqrt(2)). 4sqrt(2) + 12 Simplify (sqrt(1216)-24 + sqrt(133)/(sqrt(7) + (sqrt(175) - (sqrt(175) - (sqrt(175)2 + sqrt(175))))))*2. 19884051/256 Simplify (-1(sqrt(176) + 1))*2. 8sqrt(11) + 177 Simplify (-1 + sqrt(612) + sqrt(612) + (sqrt(612) + -1 - sqrt(612)) + 3)*2. 24sqrt(17) + 2449 Simplify -3 + sqrt(76) + 0 + sqrt(76) + sqrt(76) + sqrt(19). -3 + 7sqrt(19) Simplify 1((sqrt(272) - (sqrt(272) - ((-2sqrt(272) - sqrt(272) - sqrt(272)) + sqrt(272)))) + sqrt(272)). -8sqrt(17) Simplify (sqrt(48)-1 + -2)2. 16sqrt(3) + 52 Simplify (-6(-1 + sqrt(325) + 1 + sqrt(325)))2. 46800 Simplify ((sqrt(459) - sqrt(51))5)/(sqrt(3) + (sqrt(3) - (sqrt(30)2)/sqrt(10) - sqrt(3))). -10sqrt(17) Simplify 2 + ((sqrt(5) - sqrt(5)-3)1 - (-1sqrt(20))2). -18 + 4sqrt(5) Simplify -4 + (sqrt(192))2 - ((sqrt(108))2 + 5). 75 Simplify ((sqrt(27) - (sqrt(675) + -1)) + 1sqrt(27)-4)*2. -48sqrt(3) + 1729 Simplify 5(2sqrt(72) + sqrt(72)) + -4. -4 + 90sqrt(2) Simplify (1sqrt(70)-4 - sqrt(70))/sqrt(10). -5sqrt(7) Simplify (sqrt(1900) + -1 + 3)-5. -50sqrt(19) - 10 Simplify (-5 + sqrt(1300)1)2. -100sqrt(13) + 1325 Simplify (-1 + sqrt(175)2 - 6-1sqrt(175))2. -80sqrt(7) + 11201 Simplify (-1sqrt(891)-1 + sqrt(891) + 5)*2. 180sqrt(11) + 3589 Simplify 2 + (sqrt(104)-4-5 + sqrt(104))/sqrt(8). 2 + 21sqrt(13) Simplify (sqrt(475)-14 + sqrt(475) + 4)-2. -8 + 30sqrt(19) Simplify sqrt(475) + (sqrt(475) + 0)2 - sqrt(38)/(3sqrt(2)). 14sqrt(19)/3 + 475 Simplify 3sqrt(68) + (sqrt(272) + -1)*2. -2sqrt(17) + 273 Simplify ((1-1sqrt(38))/(sqrt(32)3))2. 19/144 Simplify 1 + (sqrt(204) - sqrt(204)15)/sqrt(12). -4sqrt(17) + 1 Simplify sqrt(52) + -1 + 2. 1 + 2sqrt(13) Simplify (sqrt(66)/sqrt(6)-6)*2 + 1 + sqrt(11) + 1. sqrt(11) + 398 Simplify (5sqrt(22)/sqrt(2))*2 - ((sqrt(11) + sqrt(176) - sqrt(11) - sqrt(11)) + -4). -3sqrt(11) + 279 Simplify (sqrt(2) + sqrt(2) + sqrt(24)/sqrt(432))2 + 2 + (sqrt(50))2. 1105/18 Simplify (sqrt(1700) + sqrt(1700)-4)-5. 150sqrt(17) Simplify sqrt(171)/(sqrt(9)1) - 5(4 + sqrt(19) - sqrt(19)). -20 + sqrt(19) Simplify (sqrt(21)/(sqrt(36)/(sqrt(72)/sqrt(6))))2. 7 Simplify (2 + sqrt(242) + (-2sqrt(242))*2 + 0)-2. -1940 - 22sqrt(2) Simplify (4 + 1sqrt(17))*2-6-1. 48sqrt(17) + 198 Simplify (sqrt(1620)-1)/(sqrt(4) + sqrt(100)6). -9sqrt(5)/31 Simplify (sqrt(360)/sqrt(300))/(sqrt(6) + sqrt(96)2). sqrt(5)/45 Simplify ((1sqrt(130))/sqrt(10)4)*2. 208 Simplify (sqrt(50) + ((sqrt(300)-1)/sqrt(6) - sqrt(50)))/((sqrt(120) + 1sqrt(120) + sqrt(120))/sqrt(12)). -sqrt(5)/3 Simplify sqrt(19) + sqrt(38)/sqrt(2) + -2 - (sqrt(19) + (sqrt(931) + sqrt(931) + sqrt(931) + sqrt(931) + sqrt(931) + -2sqrt(931))*2). -8381 + sqrt(19) Simplify sqrt(1872)-26 + sqrt(1872). -132sqrt(13) Simplify ((-1(sqrt(2057) + 1))2 - sqrt(2057)) + -4. 11sqrt(17) + 2054 Simplify (-3sqrt(45))2 + 0. 405 Simplify sqrt(63)-2 - sqrt(14)/sqrt(32). -25sqrt(7)/4 Simplify ((2 + sqrt(275) - sqrt(275)) + -3 + 4(3 + sqrt(275)))*2. 440sqrt(11) + 4521 Simplify (sqrt(2299) - (-1sqrt(2299) + 3))25. -660sqrt(19) + 46025 Simplify (sqrt(2) - (sqrt(98) - (sqrt(98) - (0 + sqrt(98))2))) + 6(sqrt(8))2. -50 + sqrt(2) Simplify (0 + (sqrt(19) - sqrt(304)) + sqrt(209)/(sqrt(33)/sqrt(3)))2. 76 Simplify (-6sqrt(70)-1)/sqrt(10). 6sqrt(7) Simplify sqrt(117)/(2sqrt(9)) - ((sqrt(52)/sqrt(4))*2 + 0). -13 + sqrt(13)/2 Simplify (sqrt(19)1)2 + -2 + (sqrt(684) + 0 - sqrt(684))2. 17 Simplify (sqrt(242)-6)2 + -2. 8710 Simplify 3 + sqrt(44)/sqrt(4) + 2 + -4. 1 + sqrt(11) Simplify (sqrt(170)2 - sqrt(170))/sqrt(10) + sqrt(17) + 4 + 3sqrt(17) + sqrt(17). 4 + 6sqrt(17) Simplify sqrt(99) + -1 + -5. -6 + 3sqrt(11) Simplify ((sqrt(85) + 3-1sqrt(85))/(sqrt(45)/sqrt(36)))2. 272 Simplify -5((2(0 + sqrt(13) + sqrt(13) + sqrt(13)))2 + sqrt(13)) + ((sqrt(156)/sqrt(4))/sqrt(3))2 + 0. -2327 - 5sqrt(13) Simplify ((0 + sqrt(3))-2-6-4)2. 6912 Simplify (6(-2 + sqrt(500)))*2. -1440sqrt(5) + 18144 Simplify 1 + (sqrt(192) - -1sqrt(192)) + (-1 + sqrt(147) - sqrt(147)). 16sqrt(3) Simplify 5 + sqrt(252)/sqrt(4) + sqrt(196)/sqrt(7). 5 + 5sqrt(7) Simplify (4 + 4(sqrt(1331) - (sqrt(1331) + -2)))*2. 144 Simplify 2 + (sqrt(36)/sqrt(3) - 3sqrt(48)) + 1. -10sqrt(3) + 3 Simplify -3 + (-2sqrt(432) + 0 - sqrt(432)) + -4. -36sqrt(3) - 7 Simplify sqrt(77)/(sqrt(49)/sqrt(252)) + -2. -2 + 6sqrt(11) Simplify ((sqrt(242)1 + -3)-4)*2. -1056sqrt(2) + 4016 Simplify (3sqrt(12)/sqrt(4) - sqrt(108)3)2. -30sqrt(3) Simplify -4 + sqrt(136)/(-3sqrt(8)-1). -4 + sqrt(17)/3 Simplify (4*sqrt(56)/sqrt	{ "pile_set_name": "DM Mathematics" }
is prob of sequence aaag when four letters picked without replacement from vvamjvgvvvvavagag? 3/2380 Three letters picked without replacement from dooowdjwcduwjc. Give prob of sequence uoj. 1/364 What is prob of sequence yj when two letters picked without replacement from {c: 1, p: 1, t: 2, y: 3, j: 3, i: 3}? 3/52 What is prob of sequence yo when two letters picked without replacement from {r: 3, o: 3, v: 5, y: 2}? 1/26 What is prob of sequence dudd when four letters picked without replacement from {u: 9, w: 1, d: 4}? 9/1001 Three letters picked without replacement from {n: 3, e: 2, r: 1, b: 1, v: 3, w: 2}. Give prob of sequence nnw. 1/110 Calculate prob of sequence pjjj when four letters picked without replacement from {p: 1, j: 7}. 1/8 Four letters picked without replacement from {c: 5, r: 7, l: 1, u: 2, a: 4, y: 1}. Give prob of sequence acyu. 1/2907 What is prob of sequence fca when three letters picked without replacement from {f: 6, c: 3, u: 1, q: 4, a: 1}? 3/455 What is prob of sequence ep when two letters picked without replacement from {e: 11, j: 4, p: 4}? 22/171 Four letters picked without replacement from nadjdjdndjdnd. What is prob of sequence dnjj? 9/1430 What is prob of sequence jc when two letters picked without replacement from {c: 3, j: 9}? 9/44 Calculate prob of sequence pp when two letters picked without replacement from {c: 1, p: 3, x: 3, h: 3}. 1/15 Three letters picked without replacement from {e: 6, q: 4, l: 2}. What is prob of sequence eee? 1/11 What is prob of sequence oyxe when four letters picked without replacement from oyyeexxxtee? 1/330 What is prob of sequence uruu when four letters picked without replacement from rwrrwurrubuhhrrppp? 7/12240 Two letters picked without replacement from {u: 6, y: 1, a: 9, f: 1}. What is prob of sequence uy? 3/136 Four letters picked without replacement from oboooubbouubububbou. Give prob of sequence ubou. 35/2584 What is prob of sequence eq when two letters picked without replacement from bexqxbqbfq? 1/30 Calculate prob of sequence wvpv when four letters picked without replacement from pvvwbp. 1/90 Four letters picked without replacement from {v: 2, q: 2, h: 2, t: 5, n: 2, e: 3}. Give prob of sequence vqvn. 1/5460 Calculate prob of sequence xz when two letters picked without replacement from {s: 1, y: 1, x: 1, v: 1, m: 2, z: 1}. 1/42 What is prob of sequence yr when two letters picked without replacement from {y: 1, q: 1, m: 1, h: 1, r: 1, g: 2}? 1/42 Calculate prob of sequence gkg when three letters picked without replacement from {g: 2, k: 1}. 1/3 Two letters picked without replacement from tttfffftfttfttftttu. What is prob of sequence uf? 7/342 Two letters picked without replacement from {g: 1, x: 10, p: 2, s: 2, w: 5}. Give prob of sequence sp. 1/95 What is prob of sequence atna when four letters picked without replacement from atnnataaaatnaana? 9/455 What is prob of sequence jb when two letters picked without replacement from birnj? 1/20 Three letters picked without replacement from {b: 4, u: 4, d: 6, h: 3}. What is prob of sequence udh? 3/170 Calculate prob of sequence vrpr when four letters picked without replacement from {p: 2, r: 5, v: 8}. 8/819 Calculate prob of sequence gzz when three letters picked without replacement from hzxqzxxxhgxx. 1/660 Two letters picked without replacement from hhvvhhhv. What is prob of sequence hv? 15/56 Three letters picked without replacement from {l: 1, i: 6, e: 2, c: 1, x: 2}. Give prob of sequence ixe. 1/55 What is prob of sequence re when two letters picked without replacement from {r: 4, e: 2}? 4/15 Calculate prob of sequence rf when two letters picked without replacement from {t: 1, p: 3, c: 1, o: 3, r: 2, f: 2}. 1/33 What is prob of sequence gd when two letters picked without replacement from ddgddgdddodo? 4/33 Two letters picked without replacement from {x: 3, d: 2, g: 1, p: 3, i: 4, b: 3}. Give prob of sequence ii. 1/20 What is prob of sequence pd when two letters picked without replacement from fffffdbddffffdidfdip? 3/190 Calculate prob of sequence rrg when three letters picked without replacement from ggrkgrkgrrgg. 3/55 What is prob of sequence jhj when three letters picked without replacement from zjhzjhyjjjzh? 1/22 What is prob of sequence jj when two letters picked without replacement from mcmj? 0 Calculate prob of sequence cc when two letters picked without replacement from {p: 1, l: 10, c: 1, n: 7}. 0 Three letters picked without replacement from {o: 6, a: 5, k: 1, h: 3, e: 1, w: 3}. What is prob of sequence ahw? 5/646 Two letters picked without replacement from ooppoopipzp. What is prob of sequence ip? 1/22 Three letters picked without replacement from {b: 4, r: 1, z: 4, d: 1}. Give prob of sequence rbb. 1/60 Three letters picked without replacement from {q: 3, r: 1, g: 4, w: 2}. What is prob of sequence wrw? 1/360 Two letters picked without replacement from vmjvklv. What is prob of sequence lv? 1/14 Calculate prob of sequence wyw when three letters picked without replacement from xwzzxxzwzyy. 2/495 Calculate prob of sequence pqj when three letters picked without replacement from pjlrbqlpjpjlljp. 8/1365 Three letters picked without replacement from {v: 5, k: 12, t: 2}. What is prob of sequence kkt? 44/969 Two letters picked without replacement from {h: 2, w: 2, c: 10}. Give prob of sequence wh. 2/91 What is prob of sequence mjjx when four letters picked without replacement from {w: 4, m: 3, r: 1, j: 8, x: 1}? 1/340 Two letters picked without replacement from {a: 11, p: 2}. What is prob of sequence aa? 55/78 Calculate prob of sequence fc when two letters picked without replacement from {y: 1, e: 2, c: 2, f: 1}. 1/15 Three letters picked without replacement from audvvvqpqvdp. Give prob of sequence uav. 1/330 What is prob of sequence xc when two letters picked without replacement from rrccxrcc? 1/14 What is prob of sequence an when two letters picked without replacement from annanna? 2/7 Four letters picked without replacement from hohfhfhooohho. Give prob of sequence fhof. 1/286 What is prob of sequence oy when two letters picked without replacement from ayypvot? 1/21 Two letters picked without replacement from {p: 1, o: 4, e: 2, x: 2, i: 2, h: 1}. What is prob of sequence xe? 1/33 Calculate prob of sequence xood when four letters picked without replacement from {r: 3, q: 1, o: 3, j: 2, d: 6, x: 5}. 1/646 Two letters picked without replacement from bxbbbxxbxxbbx. What is prob of sequence bx? 7/26 Calculate prob of sequence yyyy when four letters picked without replacement from {h: 2, b: 2, y: 4}. 1/70 Two letters picked without replacement from nruqrwtu. Give prob of sequence rt. 1/28 What is prob of sequence vtlz when four letters picked without replacement from {d: 1, z: 2, t: 2, l: 4, v: 1}? 1/315 Four letters picked without replacement from {y: 3, j: 1, v: 4, p: 4, r: 2, i: 3}. Give prob of sequence jppv. 1/1190 What is prob of sequence ak when two letters picked without replacement from aassoasaok? 2/45 What is prob of sequence dvsa when four letters picked without replacement from {h: 1, s: 4, o: 2, v: 6, a: 1, d: 1}? 1/1365 Four letters picked without replacement from {y: 1, r: 5, c: 2, v: 3, x: 8}. What is prob of sequence xvrv? 5/1938 Two letters picked without replacement from jjvvjjjjjvvjpvv. What is prob of sequence vv? 1/7 Two letters picked without replacement from {b: 1, a: 3, r: 6, u: 4, y: 1}. Give prob of sequence ur. 4/35 Two letters picked without replacement from {c: 5}. What is prob of sequence cc? 1 Three letters picked without replacement from sssssssss. What is prob of sequence sss? 1 What is prob of sequence unvq when four letters picked without replacement from {q: 5, u: 3, n: 1, g: 5, v: 4}? 1/1224 Two letters picked without replacement from {g: 2, x: 2}. What is prob of sequence gx? 1/3 Two letters picked without replacement from ddoodd. What is prob of sequence od? 4/15 Three letters picked without replacement from {u: 5, r: 1, a: 1, s: 3, p: 2}. What is prob of sequence spr? 1/220 Four letters picked without replacement from {p: 1, z: 12, r: 3}. What is prob of sequence zrrr? 3/1820 Four letters picked without replacement from {b: 4, p: 3, m: 7}. Give prob of sequence ppmm. 3/286 Three lette	{ "pile_set_name": "DM Mathematics" }
ve of j7/420 + j6/16 + 13j5/120 - 5j*4/16 - 7j*3/6 + 388j2 - j. Let f(s) = 0. Calculate s. -14, -1, 1 Let s(c) be the third derivative of c5/12 + 415c4/6 + 68890c*3/3 + 292c*2. Factor s(l). 5(l + 166)*2 Suppose 2m + 8 = 0, 96v - 100v = -m - 24. Let w be -4(-68)/32 - v. Factor 25/2d + 6d2 - wd*3 + 3. -(d - 3)(d + 1)(7d + 2)/2 Let o(r) = -2r2. Let s(c) = c3 - c - 1. Let d = 8 + -7. Let q(j) = do(j) - 2s(j). Solve q(f) = 0. -1, 1 Let k = -144127 + 144129. Factor 1/11u*k + 7/11 - 8/11u. (u - 7)(u - 1)/11 Let p(o) = -o3 - o2 + o + 3. Let v be p(0). Let j be 3 + -1 - 0/(-1). Determine m so that 20m - 48m2 + 12 - 52m*j + 15 - v = 0. -2/5, 3/5 Let w(s) be the first derivative of -104 + 2/5s*5 - 2s*3 - 24s - 3s4 + 20s*2. Factor w(a). 2(a - 6)(a - 1)2(a + 2) Let g(t) be the first derivative of 4t3/27 + 470t*2/9 - 632t/3 - 1445. Factor g(s). 4(s - 2)(s + 237)/9 Let p(s) be the first derivative of s*4/6 - 80s*3/9 + 11s*2 + 156s + 977. Factor p(n). 2(n - 39)(n - 3)(n + 2)/3 Let z(w) = 3w*5 - 801w*4 + 43905w*3 + 136089w*2 + 137607w + 46128. Let s(g) = -2g4 - 2g*2 - g. Let v(c) = -33s(c) + z(c). Factor v(p). 3(p - 124)2(p + 1)3 Let t(h) be the second derivative of h7/7 - 2h6/3 - h5/5 + 8h4/3 - h3/3 - 6h2 - 148h + 3. Suppose t(u) = 0. What is u? -1, -2/3, 1, 3 Suppose -17t - 93 + 263 = 0. Factor -422b*2 - 137b*3 + 4b*3 + t - 175b + 42b2 - 62b*3. -5(b + 1)*2(39b - 2) Let y be (-3950)/7900 + (-1)/(-8)46. Find b, given that 0 - 3/4b3 + 6b*2 - yb = 0. 0, 1, 7 Let s(p) = 4p5 + 10p*4 + 16p*3 + 2p*2. Let a(t) = 5t*5 + 9t*4 + 16t*3 + 3t*2. Let r(u) = -2a(u) + 3s(u). Factor r(o). 2o*3(o + 2)(o + 4) Factor -516 + 96a - 8a2 + 303 - 522 + 30a + 5a2. -3(a - 35)(a - 7) Let f = 47 - 44. Suppose fx + l - 5 = 0, -4x + x - 2l = -1. Factor -2cx - 7c*5 - 10c*2 + 11c*5 + 2c*2 - 10c*3. 4c*2(c - 2)(c + 1)2 Determine w so that 2900w2 + w3 - 527076 - 428770w - 95402w - 5w3 = 0. -1, 363 Let m be 6/24 + (-19)/(-4). What is n in -4n*m - 58n*4 + 28n*4 + 28n*3 + 30n*4 + 24n2 = 0? -2, -1, 0, 3 Let x(b) = b2 - 33b + 72. Let t be x(24). Let h be (2/4 - 120/t) + -1. Let 2/3d*2 - 2/3d*4 + 0d*3 + 1/3d*5 + 0 - hd = 0. What is d? -1, 0, 1 Let y(p) be the second derivative of 0p2 + 1/2p*3 + 263p - 1/40p6 - 3/80p*5 + 1/4p*4 + 0. Factor y(d). -3d(d - 2)(d + 1)(d + 2)/4 Let c(x) be the first derivative of -x3/24 + 35x*2/8 - 33x + 589. Factor c(i). -(i - 66)(i - 4)/8 Let f(n) be the second derivative of -n4/36 + 283n*3/18 + 95n*2 - 2294n. Factor f(a). -(a - 285)(a + 2)/3 Let y = 19/1003 + 23977/5015. Find s, given that -28/5s*3 - 68/5s + 68/5s2 + y + 4/5s*4 = 0. 1, 2, 3 Let j = 16240 + -16237. Let y be (-416)/(-117)(-3)/(-4). Factor -8/3r + 0 + yr*2 - 2/3r*j. -2r(r - 2)2/3 Let l(q) be the first derivative of -q4 + 32q*3 + 3536. Let l(b) = 0. What is b? 0, 24 Let b(s) be the second derivative of 2s*7/63 + 52s*6/45 + 43s*5/5 + 176s*4/9 - 184s*3/9 - 160s*2 + 42s + 9. Solve b(w) = 0 for w. -20, -3, -2, 1 Let s = -167 - -177. Find z, given that 5z - s - 4z*2 + 11z - 2 + 0z2 = 0. 1, 3 Let u(s) be the second derivative of -22s*3 + 0 + 49s - 1/5s5 - 72s*2 - 10/3s*4. Factor u(g). -4(g + 3)*2(g + 4) Solve 3g5 - 5g*4 - 6g*4 + 1345g*3 - 61g*4 - 970g*3 - 306g*2 = 0 for g. 0, 1, 6, 17 Let c(b) be the second derivative of -2/3b*2 + 0 - 5/27b*3 - 1/54b*4 - 17b. Find n, given that c(n) = 0. -3, -2 Let m be 8 - -1(-12)/4. Suppose -mo = -41 - 74. Factor 11t2 + t4 - 8t + t*4 - ot*2 + 24t*2 - 8t*3 + 2. 2(t - 1)*4 Factor -305/3p + 68 + 67/2p2 + 1/6p*3. (p - 2)(p - 1)(p + 204)/6 Let g(z) be the second derivative of 0z*2 - 1/30z*4 - 13/15z*3 + 0 + 178z. Find r, given that g(r) = 0. -13, 0 Let h(v) be the second derivative of -v*4/4 + 17v*3/2 + 57v*2 - 7v + 19. Factor h(x). -3(x - 19)(x + 2) Let u(w) be the first derivative of 1/80w6 + 1/40w*5 + 14 - 5w*2 - 1/8w*4 + 0w + 0w3. Let g(a) be the second derivative of u(a). Factor g(x). 3x(x - 1)(x + 2)/2 Let x = -2414 + 2414. Let n(p) be the second derivative of 1/13p2 + x - 1/78p*4 + 0p*3 + 4p. Suppose n(t) = 0. Calculate t. -1, 1 Let d(m) be the first derivative of -9/28m4 - 41/7m*3 + 21m - 205 - 57/2m2. Factor d(x). -3(x + 7)*2(3x - 1)/7 Let k(o) be the first derivative of 122 + 48/7o*2 - 14o + 2/21o3. Factor k(f). 2(f - 1)(f + 49)/7 Suppose 0 = 13c - 15c + 6. Suppose 0v = -cv + 27. Solve 3n - 2n + 25n*2 + vn - 15 + 0 = 0 for n. -1, 3/5 Let k(b) be the second derivative of -b*5/10 + 9b*4/2 - 50b*3/3 + 4084b. Factor k(t). -2t(t - 25)(t - 2) Let l(i) = 2i*2 - 40i + 150. Let o be l(5). Let d(n) be the first derivative of on2 - 3/20n*4 - 3/10n*3 - 1/50n*5 + 0n - 4. Solve d(f) = 0 for f. -3, 0 Suppose 6s + 936 - 3042 = 0. Let b be (-56)/(-26) - 96/s. Factor 0 + 0mb + 0m - 2/7m3. -2m*3/7 Let g = -3587 - -3591. Let u(q) be the second derivative of 1/20q*5 + 16q*2 + 0 + 5/6q*g + 9q + 16/3q3. Factor u(c). (c + 2)(c + 4)*2 Suppose 1164p = 1180p - 96. Suppose -3c - q + 14 = 0, -2 = 3c - q - p. Suppose 2/7m*c + 0m + 0m2 + 2/7m*4 + 0 = 0. What is m? -1, 0 Let w(d) be the third derivative of 0d*5 + 0 + 0d*3 + 0d + 1/30d4 - 1/150d*6 + 74d*2. Factor w(k). -4k(k - 1)(k + 1)/5 Let c(l) be the first derivative of 0l2 - 2/55l*5 - 26 + 0l*4 - 2/11l + 4/33l3. Factor c(m). -2(m - 1)*2(m + 1)*2/11 Solve -704s - 592900 + 17s2 - 11s*2 - 726s - 110s - 7s*2 = 0. -770 Let y = -141 - -120. Let m be (-14)/y - 28/(-21). What is i in -15/8i + 3/8im + 3/2 = 0? 1, 4 Suppose 3r = 19l - 22l + 540, l - 4r - 195 = 0. Solve -183i*3 + 484 - 84i*2 + li + 213i + 187i*3 = 0 for i. -1, 11 Let f(y) = 22y*3 - 4y*2 + 10y + 20. Let c(k) = 2k3 - k2 + k + 2. Let w(o) = -20c(o) + 2f(o). Determine i so that w(i) = 0. -3, 0 Let j = 11 - 9. Factor 0w*4 - 3w*4 + 65w*j - 12w - 37w2 - 13w*3. -w(w - 1)(w + 6)(3w - 2) Let c be (-12)/(-9)33/11. Find u, given that -3uc - 39u*3 - 72u + 15u3 - 78u*2 - 3u*3 = 0. -4, -3, -2, 0 Let j(p) be the first derivative of 4p2 - p4 + 0p - 53 + 4/3p*3. Suppose j(i) = 0. Calculate i. -1, 0, 2 Let u be 22 + (0 - 572/26). Let r(s) be the third derivative of -1/3s*5 + 4/3s*3 + 0 + us + 1/2s4 - 2s*2. Factor r(a). -4(a - 1)(5a + 2) Let n be (-10 - -13)/((-1)/(-13)). Suppose 3o - 3w = -3 + n, 4w = -16. Factor 24s + 46s - os*3 + 32 - 10s*4 + 28s*2 + 4s*2 - 6s - 2s5. -2(s - 2)(s + 1)(s + 2)3 Let r(l) be the first derivative of -l6/39 + 6l5/13 + 41l*4/26 - 682l*3/13 + 968l*2/13 - 975. Solve r(j) = 0. -8, 0, 1, 11 Let v = -24456 - -24485. Let c(b) be the third derivative of -2/105b*5 + 4/21b*3 - 1/420b*6 + 1/84b*4 + 0 + 0b - vb2. Factor c(r). -2(r - 1)(r + 1)(r + 4)/7 Let c(w) be the first derivative of 0w - 1029/10w*2 + 16 + 48w*5 + 931/5w*3 - 32/5w*6 - 693/5w*4. Factor c(j). -3j(j - 1)(4j - 7)3/5 Let h(q) be the third derivative of q6/30 + 1204q*5/5 + 724808q*4 + 3490675328q*3/3 + 295q*2 + 3. Solve h(f) = 0. -1204 Let x = -1047938/165 + 69864/11. Find b, given that -2/15b - xb2 + 0 = 0. -1, 0 Let o(z) be the first derivative of z4/4 - 395z*3/3 - 198z*2 + 2971. Factor o(q). q(q - 396)(q + 1) Let n(o) = 6o*3 - 24o*2 + 30o. Let f(h) = -7h3 + 25h*2 - 30h. Let j = 293 + -290. Let a(l) = jf(l) + 4n(l). Factor a(z). 3z(z - 5)(z - 2) Let z(b) be the first derivative of b5/5 + b4/12 - 2b3/3 - b2/2 - 45b + 193. Let g(q) be the first derivative of z(q). Factor g(p). (p - 1)(p + 1)(4p + 1) Let w(s) be the third derivative of 243/8s3 - 35s + 2s2 - 9/16s*4 + 0 + 1/240s5. Factor w(z). (z - 27)2/4 Let f(n) = 5n2 - 57n - 58. Let s(i) = 5i2 - 54i - 56. Let y(k) = 3f(k) - 4s(k). Suppose y(t) = 0. Calculate t. -1, 10 Suppose -12w + 10 + 26 = 0. Determine c so that 2c*2 + 242c**w	{ "pile_set_name": "DM Mathematics" }
t is 376 minutes after 10:31 PM? 4:47 AM How many minutes are there between 6:36 PM and 12:07 AM? 331 What is 644 minutes before 5:28 AM? 6:44 PM What is 252 minutes before 10:37 AM? 6:25 AM How many minutes are there between 6:48 PM and 4:05 AM? 557 What is 36 minutes after 4:38 PM? 5:14 PM How many minutes are there between 7:21 PM and 7:35 PM? 14 What is 77 minutes before 6:16 AM? 4:59 AM How many minutes are there between 4:32 AM and 6:39 AM? 127 How many minutes are there between 4:36 PM and 11:18 PM? 402 How many minutes are there between 6:20 PM and 5:38 AM? 678 How many minutes are there between 12:34 PM and 12:14 AM? 700 How many minutes are there between 12:54 PM and 3:16 PM? 142 What is 304 minutes before 1:55 PM? 8:51 AM What is 424 minutes before 3:52 AM? 8:48 PM How many minutes are there between 5:39 PM and 3:03 AM? 564 How many minutes are there between 8:44 AM and 12:44 PM? 240 How many minutes are there between 8:15 AM and 8:57 AM? 42 How many minutes are there between 9:18 PM and 6:34 AM? 556 What is 481 minutes after 6:39 PM? 2:40 AM How many minutes are there between 1:34 PM and 12:51 AM? 677 What is 676 minutes before 12:41 AM? 1:25 PM How many minutes are there between 10:21 AM and 6:13 PM? 472 How many minutes are there between 2:42 AM and 2:27 PM? 705 How many minutes are there between 11:17 PM and 12:13 AM? 56 How many minutes are there between 7:00 PM and 12:09 AM? 309 What is 470 minutes after 2:50 AM? 10:40 AM How many minutes are there between 10:40 AM and 3:29 PM? 289 How many minutes are there between 4:34 AM and 9:08 AM? 274 How many minutes are there between 2:44 PM and 12:54 AM? 610 What is 323 minutes before 8:24 PM? 3:01 PM How many minutes are there between 9:19 PM and 1:16 AM? 237 What is 327 minutes after 5:31 PM? 10:58 PM How many minutes are there between 4:55 AM and 1:03 PM? 488 What is 709 minutes after 7:27 AM? 7:16 PM How many minutes are there between 4:40 AM and 1:08 PM? 508 What is 385 minutes after 2:57 PM? 9:22 PM What is 77 minutes after 11:08 AM? 12:25 PM How many minutes are there between 10:51 AM and 12:48 PM? 117 What is 591 minutes before 12:31 PM? 2:40 AM How many minutes are there between 8:53 AM and 5:01 PM? 488 How many minutes are there between 11:13 PM and 4:28 AM? 315 How many minutes are there between 2:05 PM and 1:33 AM? 688 What is 655 minutes after 10:50 AM? 9:45 PM What is 142 minutes after 3:09 PM? 5:31 PM How many minutes are there between 1:12 AM and 5:55 AM? 283 What is 507 minutes after 7:10 PM? 3:37 AM What is 528 minutes after 11:41 PM? 8:29 AM What is 502 minutes before 10:44 AM? 2:22 AM How many minutes are there between 3:05 PM and 10:51 PM? 466 How many minutes are there between 11:12 AM and 3:21 PM? 249 What is 564 minutes before 10:19 AM? 12:55 AM What is 599 minutes before 8:51 PM? 10:52 AM How many minutes are there between 3:33 PM and 12:40 AM? 547 What is 20 minutes before 8:02 PM? 7:42 PM How many minutes are there between 6:23 PM and 11:27 PM? 304 How many minutes are there between 1:06 AM and 11:53 AM? 647 How many minutes are there between 5:26 AM and 6:43 AM? 77 How many minutes are there between 12:21 AM and 8:34 AM? 493 How many minutes are there between 12:46 AM and 8:33 AM? 467 How many minutes are there between 6:34 PM and 5:49 AM? 675 How many minutes are there between 4:48 PM and 5:47 PM? 59 How many minutes are there between 6:18 PM and 10:21 PM? 243 How many minutes are there between 6:12 PM and 5:07 AM? 655 How many minutes are there between 6:15 AM and 6:57 AM? 42 What is 321 minutes before 5:45 PM? 12:24 PM What is 618 minutes after 5:06 PM? 3:24 AM How many minutes are there between 3:10 PM and 6:00 PM? 170 How many minutes are there between 12:49 AM and 6:34 AM? 345 How many minutes are there between 8:09 PM and 7:30 AM? 681 What is 585 minutes after 2:54 AM? 12:39 PM How many minutes are there between 10:45 AM and 9:12 PM? 627 What is 423 minutes before 2:06 AM? 7:03 PM What is 388 minutes before 11:44 AM? 5:16 AM What is 63 minutes after 5:36 AM? 6:39 AM What is 341 minutes after 1:19 PM? 7:00 PM What is 10 minutes before 10:02 AM? 9:52 AM How many minutes are there between 1:25 AM and 4:48 AM? 203 How many minutes are there between 11:50 PM and 12:50 AM? 60 What is 10 minutes after 6:28 AM? 6:38 AM What is 107 minutes after 4:19 AM? 6:06 AM How many minutes are there between 9:21 AM and 2:36 PM? 315 What is 428 minutes after 5:32 PM? 12:40 AM How many minutes are there between 4:03 PM and 4:57 PM? 54 How many minutes are there between 3:38 AM and 9:50 AM? 372 How many minutes are there between 2:53 AM and 11:15 AM? 502 What is 103 minutes after 5:18 AM? 7:01 AM How many minutes are there between 7:11 AM and 7:53 AM? 42 What is 662 minutes after 9:41 AM? 8:43 PM What is 402 minutes before 12:52 PM? 6:10 AM How many minutes are there between 2:57 AM and 3:59 AM? 62 How many minutes are there between 5:00 PM and 4:37 AM? 697 What is 207 minutes after 4:23 PM? 7:50 PM How many minutes are there between 10:51 AM and 7:07 PM? 496 What is 250 minutes after 3:18 PM? 7:28 PM What is 283 minutes after 11:57 PM? 4:40 AM How many minutes are there between 10:51 PM and 3:02 AM? 251 What is 295 minutes after 7:02 AM? 11:57 AM What is 185 minutes after 3:26 AM? 6:31 AM What is 235 minutes before 3:16 PM? 11:21 AM What is 617 minutes after 11:29 AM? 9:46 PM How many minutes are there between 9:42 PM and 7:47 AM? 605 How many minutes are there between 6:32 PM and 9:17 PM? 165 What is 625 minutes after 12:19 PM? 10:44 PM What is 148 minutes before 2:34 PM? 12:06 PM How many minutes are there between 5:08 PM and 9:03 PM? 235 How many minutes are there between 11:10 AM and 4:35 PM? 325 What is 181 minutes after 5:59 AM? 9:00 AM How many minutes are there between 1:41 PM and 7:47 PM? 366 How many minutes are there between 9:42 PM and 4:30 AM? 408 How many minutes are there between 4:50 AM and 9:39 AM? 289 What is 609 minutes before 5:11 PM? 7:02 AM What is 253 minutes before 2:39 PM? 10:26 AM What is 310 minutes before 6:11 AM? 1:01 AM What is 40 minutes after 3:46 AM? 4:26 AM What is 589 minutes after 6:57 PM? 4:46 AM What is 628 minutes before 5:12 PM? 6:44 AM What is 103 minutes after 4:34 AM? 6:17 AM How many minutes are there between 11:35 AM and 11:02 PM? 687 How many minutes are there between 5:32 AM and 3:15 PM? 583 How many minutes are there between 7:50 PM and 8:02 PM? 12 How many minutes are there between 8:58 AM and 8:17 PM? 679 What is 445 minutes before 8:51 AM? 1:26 AM What is 191 minutes before 11:59 PM? 8:48 PM What is 416 minutes after 6:13 AM? 1:09 PM What is 573 minutes before 3:36 AM? 6:03 PM How many minutes are there between 2:27 AM and 7:47 AM? 320 What is 535 minutes after 1:52 AM? 10:47 AM How many minutes are there between 7:29 AM and 10:24 AM? 175 What is 676 minutes after 11:46 PM? 11:02 AM What is 492 minutes after 11:51 PM? 8:03 AM What is 589 minutes after 12:37 AM? 10:26 AM How many minutes are there between 3:14 PM and 12:04 AM? 530 What is 572 minutes before 11:44 AM? 2:12 AM What is 240 minutes before 3:57 PM? 11:57 AM What is 304 minutes before 11:26 PM? 6:22 PM How many minutes are there between 11:31 PM and 1:09 AM? 98 How many minutes are there between 2:54 PM and 4:25 PM? 91 How many minutes are there between 5:32 AM and 7:42 AM? 130 What is 631 minutes after 7:03 PM? 5:34 AM What is 611 minutes before 8:54 PM? 10:43 AM What is 171 minutes after 7:31 PM? 10:22 PM How many minutes are there between 2:15 PM and 4:39 PM? 144 How many minutes are there between 4:18 AM and 9:41 AM? 323 How many minutes are there between 4:26 PM and 1:00 AM? 514 What is 697 minutes after 6:54 AM? 6:31 PM How many minutes are there between 12:18 PM and 10:42 PM? 624 What is 52 minutes after 7:35 AM? 8:27 AM How many minutes are there between 11:06 AM and 1:30 PM? 144 What is 51 minutes before 5:32 AM? 4:41 AM What is 564 minutes after 11:24 PM? 8:48 AM What is 137 minutes before 2:58 AM? 12:41 AM How many minutes are there between 4:56 PM and 5:38 PM? 42 How many minutes are there between 7:38 AM and 1:52 PM? 374 What is 277 minutes before 4:25 AM? 11:48 PM What is 102 minutes before 9:01 AM? 7:19 AM What is 89 minutes after 1:21 AM? 2:	{ "pile_set_name": "DM Mathematics" }
-247 - o. Let s be (c/(-10))/(10/(-50)). What is the highest common factor of 12 and s? 12 Suppose -p = 2t - 2148, 110t - 111t + 1081 = 4p. What is the greatest common factor of t and 481? 37 Let w(s) = -13 - 12 + 8 - 18 - s*2 - 18s. Let b be w(-14). Suppose 3u - b = 12. What is the highest common divisor of u and 121? 11 Suppose -2p = -8, p + 18 + 38 = -2n. Let g be 286/(-33)n/4. What is the greatest common divisor of g and 13? 13 Suppose 20 = -5i - 4v, 11i - v - 5 = 12i. Let q be -21 - (-56 - (i - -3)). Calculate the highest common factor of q and 3. 3 Suppose 4h = -3r + 5698, 12r - 10r - 12 = 0. Calculate the highest common factor of h and 260. 20 Suppose -3b + 29 + 4 = 0. Suppose 0 = 7n - bn + 84. Suppose -27z + 28z - n = 0. Calculate the highest common divisor of 7 and z. 7 Suppose -3m + 9 - 12 = 0, 5 = 4n - 5m. Suppose n = -5t - 0d + 2d + 943, 915 = 5t + 5d. Calculate the greatest common divisor of 11 and t. 11 Let r = 2731 - 2690. Calculate the greatest common factor of 369 and r. 41 Suppose -m + 162 = d + 2d, -270 = -5d + 2m. Suppose 4x = -70 - d. Let n be 2 + 0 - (x + 1/1). What is the greatest common divisor of 2 and n? 2 Suppose 3y = 4a + 12330, -2y + 51a - 56a = -8220. Calculate the highest common factor of y and 45. 15 Suppose -8a = u - 7427, a + 8u = 3u + 943. Calculate the highest common divisor of a and 87. 29 Suppose 6d - 8 = 4. Let x be d/(-11) - (-32)/176. Suppose -17b + 6b + 1848 = x. Calculate the greatest common divisor of 24 and b. 24 Let r = -3194 + 3229. Let n be 5007/13 + (-18)/117. What is the greatest common divisor of n and r? 35 Let f(d) = -713d + 15. Let m be f(1). Let h = -673 - m. What is the greatest common divisor of 85 and h? 5 Suppose -5o + 37 + 13 = 3h, -5h + 20 = 2o. Suppose 0i + 3i = c - 20, -2i = o. Suppose 73 - 3 = cp. Calculate the highest common divisor of p and 14. 14 Let u(w) = -199w + 1407. Let p be u(7). What is the greatest common divisor of p and 602? 14 Let t = 4 + 18. Let j be (1001/(-35) - -11)20(-3 - -2). What is the highest common divisor of j and t? 22 Let s(y) = 3y + 14. Let z be s(1). Suppose q + 2q = -4o + 475, o = 3q - 455. Calculate the greatest common divisor of z and q. 17 Suppose t - k - 12 = 0, -2k = -k - 2. Let w(i) = -4i2 + 61i + 5. Let d be w(t). Calculate the greatest common divisor of 3 and d. 3 Let w(v) = 32v2 + 63v + 761. Let z be w(-13). What is the highest common factor of z and 5? 5 Suppose 8w - 51w + 96019 = 0. What is the highest common factor of 58 and w? 29 Let o(a) = -61a - 3942. Let c be o(-66). What is the greatest common divisor of 2835 and c? 21 Let m be (38/4)/((-5)/(-10)). Let p(h) = -9h - 38. Suppose -7u - 142 = -9. Let t be p(u). What is the greatest common factor of m and t? 19 Let x be ((-6)/205)/(-1 + (-175)/(-190)). What is the highest common factor of 1159 and x? 19 Suppose n = -0n - 25. Suppose 0 = r - 5r - 48. Let a = r - n. What is the highest common divisor of 65 and a? 13 Let q = -20 - -21. Let i be (-9 - -5) + (q - -368). Let j = i + -261. What is the highest common factor of 8 and j? 8 Let m(h) = -3 + 9h2 - 1 + 0. Let a = -1273 - -1276. Let r be m(a). Calculate the highest common divisor of r and 11. 11 Let o(u) = -8u + 62. Let h be o(18). Let z = 51 - h. What is the highest common divisor of z and 38? 19 Let v(p) = 2p2 - 11p + 29. Let w be v(9). Let t = 346 - 231. Calculate the greatest common factor of t and w. 23 Let c be (4/6)/((-6)/45). Let j be c/(-2)(-264)/(-10). Suppose -28m = -29m + j. What is the greatest common divisor of m and 6? 6 Let p be 1/2 - (72/16 + 3). Let k be 10/35 - 103/p. Let q = 4 - -2. What is the greatest common factor of q and k? 3 Let x = -5337 + 9063. Calculate the greatest common divisor of x and 162. 162 Let g(y) = 7y*2 - 10y - 71. Let r be g(14). Calculate the greatest common factor of r and 903. 129 Suppose -5d = -2d + 3, -5m - 2d + 38 = 0. Let j(p) = p*3 + 40p*2 + 252p - 1032. Let u be j(-14). What is the highest common divisor of m and u? 8 Let a(n) = 88 - 2n - 32 + 0n - 4n. Let r be a(-29). What is the highest common factor of r and 20? 10 Let b = -8470 - -10126. Calculate the greatest common factor of 252 and b. 36 Let i(v) = 3v*2 - 26v + 577. Let q be i(15). What is the greatest common factor of 10 and q? 2 Let f = 16 + 42. Suppose -3a + 3z + f = 4z, -2z = -8. Suppose 25l - al = 728. What is the highest common divisor of 8 and l? 8 Let x = -338 - -436. Let t be -2 - (20/(-5) + -12). Calculate the greatest common divisor of t and x. 14 Let g(d) = 3d2 + 3d - 1. Let f be g(1). Suppose -4x = y - 27, fy - 169 = -5x + 2x. What is the highest common divisor of y and 10? 5 Suppose 3b - 4n - 464 = 0, 3b - 472 = -0b - 4n. What is the highest common factor of b and 138? 6 Let i = 182 - 188. Let s be 126(-4 + (-102)/(-27))i. What is the highest common factor of 21 and s? 21 Suppose -z = -3x + 5 - 9, 2z - 3x = 14. Suppose -zg + 441 + 229 = 0. Calculate the highest common divisor of g and 1273. 67 Let j(q) = -q3 + q2 + 12q + 2. Let b be j(4). Suppose -10n + 6n = -bd - 1284, 3n - 952 = -4d. Calculate the greatest common factor of n and 5. 5 Let l(t) = 17t*3 + 241t*2 - 26t + 24. Let o be l(-14). Calculate the highest common factor of o and 305. 61 Let i = 2029 + -724. What is the highest common divisor of i and 45? 45 Let x be (-366 + 68)/((-1)/16). Calculate the highest common factor of x and 64. 32 Let x be 26354672/760 - (-2)/(-10). Calculate the highest common divisor of x and 9. 9 Suppose -29p = 192 - 446 - 413. What is the highest common divisor of 43 and p? 1 Let o(z) = 117z + 1839. Let g be o(-7). Calculate the highest common divisor of g and 420. 60 Suppose 0 = -5x - 3x - 1280. Let j = 163 + x. Calculate the highest common factor of 24 and j. 3 Let b(z) = 175z - 1392. Let h be b(8). What is the highest common factor of h and 172? 4 Let c(d) = d3 - 17d*2 + 16d + 4. Let v = -31 - -47. Let r be c(v). Suppose 3a - 168 = -ra. Calculate the highest common factor of 6 and a. 6 Let y = -228 - -238. Let w be (-12)/8 + 4629/6. Calculate the highest common factor of w and y. 10 Let c be ((-202)/(-4))/(7/14)9. Let v(l) = l3 - 7l*2 + 14l - 39. Let g be v(6). Calculate the greatest common factor of g and c. 9 Let t(r) = -76 + 15r - 2r - r*2 + 13r - 5r. Let k be t(13). What is the greatest common factor of 154 and k? 14 Suppose 0 = 4w - 0 + 8, 0 = -2u - 5w + 30. Let m be 2 + -2 + (51 - 1). What is the greatest common factor of m and u? 10 Suppose m + 2l = 358, 0 = 7m - 8m - 3l + 361. What is the greatest common divisor of 4664 and m? 88 Suppose -2j = -6j - 8, -2669 = -3g + j. Suppose -4h + g = 289. Calculate the greatest common factor of 60 and h. 30 Let b be (((-33)/(-14))/(40/(-140)))/((-9)/2916). What is the highest common factor of 1701 and b? 243 Suppose q = -2q + 273. Suppose 103m + 88m + 533 = 232m. What is the highest common divisor of m and q? 13 Let y(f) = -72f + 16. Let h(x) = x - 2. Let l(p) = 10h(p) - y(p). Let o be l(5). Calculate the highest common factor of 34 and o. 34 Suppose -1329u + 1323u + 30 = 0. What is the highest common divisor of 23 and u? 1 Let k = 207 + -202. Suppose -kt - p + 494 = 0, -15t + 10t = 2p - 493. Calculate the greatest common factor of t and 11. 11 Suppose -w = 3w - 520. Let y = -2233 - -2153. Let x = y + w. What is the greatest common divisor of x and 30? 10 Let h = -2980 - -3124. Suppose -4n - 8 = 0, 3d - 5 = 2n + 5. Suppose 11 = du - 21. Calculate the highest common factor of h and u. 16 Suppose -5n + 5a + 1030 = 0, -9n + 482 = -7n - 9a. Suppose -f + u + 28 = 0, -3f + 5 = 4u - 79. Calculate the highest common factor of f and n. 28 Let a(m) = 486m - 6633. Let v be a(15). What is the greatest common divisor of v and 511? 73 Suppose 17045 + 2321 + 16058 = 108r. Calculate the greatest common factor of r and 1271. 41 Suppose 25v - 6v = 209. Suppose -q = m + 1, 2m = q + 10 - 0. Suppose 3w - 6 = -m. What is the highest common factor of w and v? 1 Suppose -16d + 442 = 5w - 15d, -2d + 180 = 2w. Suppose -3p + 262 + 1586 = 0. Calculate the highest common factor of w and p. 88 Let	{ "pile_set_name": "DM Mathematics" }
38416? t*2 - 105502t + 49 What is the x'th term of 495709, 1982806, 4461287, 7931140, 12392353, 17844914, 24288811, 31724032? -2x3 + 495704x*2 - x + 8 What is the w'th term of -387, -1101, -1819, -2541, -3267, -3997, -4731? -2w*2 - 708w + 323 What is the a'th term of 45863, 91740, 137617? 45877a - 14 What is the j'th term of 61248092, 122496182, 183744272, 244992362, 306240452, 367488542? 61248090j + 2 What is the c'th term of 2431581, 2431816, 2432209, 2432760, 2433469? 79c2 - 2c + 2431504 What is the i'th term of 5728, 11250, 16842, 22504, 28236, 34038? 35i2 + 5417i + 276 What is the f'th term of -72367, -69059, -65751, -62443? 3308f - 75675 What is the c'th term of 46769, 92954, 139135, 185312, 231485, 277654, 323819? -2c*2 + 46191c + 580 What is the k'th term of -968063300, -968063302, -968063304, -968063306, -968063308? -2k - 968063298 What is the f'th term of -995361856, -995361857, -995361858, -995361859? -f - 995361855 What is the d'th term of 17634128, 35268258, 52902388, 70536518, 88170648? 17634130d - 2 What is the h'th term of -4890756, -4890758, -4890760? -2h - 4890754 What is the j'th term of -981, -1958, -2937, -3918, -4901? -j2 - 974j - 6 What is the o'th term of 324597, 324585, 324557, 324507, 324429, 324317, 324165, 323967? -o*3 - 2o*2 + o + 324599 What is the f'th term of -646, -3368, -8164, -15034? -1037f*2 + 389f + 2 What is the k'th term of 41554271, 41554266, 41554261, 41554256? -5k + 41554276 What is the q'th term of -26491, -25352, -23457, -20806, -17399, -13236, -8317? 378q*2 + 5q - 26874 What is the i'th term of 529, 1978, 4325, 7516, 11497, 16214? -9i3 + 503i*2 + 3i + 32 What is the h'th term of -87466, -87507, -87554, -87607, -87666, -87731, -87802? -3h2 - 32h - 87431 What is the o'th term of -16206581, -16206588, -16206595, -16206602, -16206609? -7o - 16206574 What is the c'th term of -3604, -3431, -3206, -2905, -2504? 4c*3 + 2c*2 + 139c - 3749 What is the g'th term of -88396, -88376, -88356, -88336, -88316? 20g - 88416 What is the p'th term of 403553, 403534, 403515, 403496, 403477, 403458? -19p + 403572 What is the l'th term of 0, -36, -314, -966, -2124? -22l3 + 11l*2 + 85l - 74 What is the a'th term of -449, -2077, -5295, -10517, -18157, -28629? -69a3 - 381a*2 - 2a + 3 What is the k'th term of 29609, 59268, 88937, 118622, 148329? k3 - k2 + 29655k - 46 What is the j'th term of -21227, -21071, -20915? 156j - 21383 What is the n'th term of -86571, -173040, -259511, -345984, -432459? -n*2 - 86466n - 104 What is the j'th term of 18197, 71033, 158491, 280571, 437273, 628597, 854543? 17311j2 + 903j - 17 What is the q'th term of -289793, -289885, -290041, -290261, -290545? -32q2 + 4q - 289765 What is the y'th term of 3951, 31314, 105565, 250146, 488499? 3907y3 + 2y*2 + 8y + 34 What is the f'th term of -121905973, -121905980, -121905991, -121906006, -121906025, -121906048, -121906075? -2f2 - f - 121905970 What is the k'th term of -15397, -61870, -139315, -247726, -387097, -557422, -758695? k3 - 15492k*2 - 4k + 98 What is the n'th term of -7292, -29143, -65552, -116513, -182020, -262067? n*3 - 7285n*2 - 3n - 5 What is the a'th term of -55212, -106437, -157662, -208887, -260112? -51225a - 3987 What is the n'th term of 15717, 15292, 15037, 15036, 15373, 16132, 17397? 14n3 + n2 - 526n + 16228 What is the o'th term of -12918877, -25837776, -38756697, -51675640, -64594605, -77513592? -11o*2 - 12918866o What is the v'th term of 32582375, 65164792, 97747195, 130329578, 162911935? -v3 - v2 + 32582427v - 50 What is the v'th term of -58, -1016, -3808, -9352, -18566, -32368, -51676, -77408? -153v3 + v2 + 110v - 16 What is the k'th term of 608786784, 1217573569, 1826360354, 2435147139, 3043933924, 3652720709? 608786785k - 1 What is the s'th term of 68589, 68598, 68629, 68694, 68805, 68974? 2s3 - s2 - 2s + 68590 What is the d'th term of 1646, 2665, 3690, 4721, 5758, 6801, 7850? 3d2 + 1010d + 633 What is the o'th term of 2735909, 2735902, 2735893, 2735882, 2735869, 2735854? -o*2 - 4o + 2735914 What is the a'th term of 392, 1164, 2548, 4850, 8376? 51a3 + 415a - 74 What is the j'th term of 1184, 2636, 5054, 8432, 12764, 18044, 24266, 31424? -j*3 + 489j*2 - 8j + 704 What is the o'th term of 532, 4821, 9110? 4289o - 3757 What is the a'th term of 881374, 1762707, 2644040, 3525373, 4406706? 881333a + 41 What is the v'th term of -1123876, -1123878, -1123880, -1123882, -1123884, -1123886? -2v - 1123874 What is the w'th term of -34961263, -34961266, -34961269, -34961272, -34961275, -34961278? -3w - 34961260 What is the f'th term of 12684, 28296, 43908, 59520, 75132, 90744? 15612f - 2928 What is the l'th term of 402, 898, 1396, 1896, 2398? l2 + 493l - 92 What is the v'th term of 350023, 349967, 349897, 349813, 349715? -7v2 - 35v + 350065 What is the l'th term of 402105, 804213, 1206323, 1608435, 2010549? l*2 + 402105l - 1 What is the x'th term of -54928, -109839, -164736, -219619, -274488, -329343, -384184? 7x2 - 54932x - 3 What is the g'th term of 870255, 870346, 870429, 870498, 870547, 870570? -g*3 + 2g*2 + 92g + 870162 What is the o'th term of -3829761, -3829763, -3829765, -3829767, -3829769? -2o - 3829759 What is the p'th term of 9402, 21903, 42740, 71919, 109446, 155327? p3 + 4162p*2 + 8p + 5231 What is the l'th term of -1972985376, -1972985377, -1972985378, -1972985379, -1972985380? -l - 1972985375 What is the x'th term of 1083674, 2167453, 3251234, 4335017? x*2 + 1083776x - 103 What is the b'th term of 7676, 61481, 207522, 491909, 960752, 1660161? 7685b3 + 8b*2 - 14b - 3 What is the b'th term of -23357515, -23357538, -23357561? -23b - 23357492 What is the h'th term of -48856, -98806, -148756? -49950h + 1094 What is the d'th term of 282261, 282151, 281959, 281679, 281305, 280831? -d*3 - 35d*2 + 2d + 282295 What is the k'th term of -958, -1498, -2984, -5896, -10714, -17918, -27988? -80k3 + 7k*2 - k - 884 What is the a'th term of -208460660, -208460664, -208460668, -208460672? -4a - 208460656 What is the v'th term of 150962886, 150962885, 150962884, 150962883, 150962882? -v + 150962887 What is the x'th term of 2147680, 2147679, 2147676, 2147671, 2147664, 2147655, 2147644? -x*2 + 2x + 2147679 What is the f'th term of -3582, -2844, -2140, -1488, -906, -412? -3f3 + f2 + 756f - 4336 What is the b'th term of 114797, 114738, 114639, 114500, 114321? -20b2 + b + 114816 What is the n'th term of -98544585, -197089168, -295633751, -394178334, -492722917, -591267500? -98544583n - 2 What is the c'th term of -228, -384, -496, -588, -684? -4c3 + 46c*2 - 266c - 4 What is the q'th term of -766416, -3065674, -6897766, -12262686, -19160428, -27590986, -37554354, -49050526? q*3 - 766423q*2 + 4q + 2 What is the v'th term of -101, -677, -2235, -5267, -10265, -17721? -82v3 + v2 - 5v - 15 What is the o'th term of 6484310, 6484246, 6484178, 6484106, 6484030, 6483950, 6483866? -2o2 - 58o + 6484370 What is the c'th term of -1842676, -1842651, -1842604, -1842535, -1842444, -1842331, -1842196? 11c2 - 8c - 1842679 What is the x'th term of 2331, 4801, 7409, 10155, 13039? 69x2 + 2263x - 1 What is the i'th term of -8034, -32464, -73184, -130194, -203494, -293084? -8145i2 + 5i + 106 What is the h'th term of -978283, -1956573, -2934865, -3913159, -4891455, -5869753? -h*2 - 978287h + 5 What is the r'th term of 2027, 4232, 6535, 8936, 11435, 14032? 49r2 + 2058r - 80 What is the g'th term of -8922, -17599, -26028, -34209, -42142, -49827, -57264? 124g2 - 9049g + 3 What is the m'th term of -46093, -46053, -45911, -45607, -45081, -44273, -43123, -41571? 10m3 - 9m*2 - 3m - 46091 What is the h'th term of 290037, 289836, 289637, 289440, 289245, 289052, 288861? h*2 - 204h + 290240 What is the s'th term of -49701, -50191, -50675, -51153? 3s2 - 499s - 49205 What is the u'th term of 786867, 1573719, 2360571, 3147423, 3934275, 4721127? 786852u + 15 What is the f'th term of 268, 2387, 8336, 20095, 39644, 68963, 110032? 330f*3 - 65f*2 + 4f - 1 What is the u'th term of -245224624, -490449251, -735673878, -980898505, -12261231	{ "pile_set_name": "DM Mathematics" }
68. Is o(5) a multiple of 12? True Let v = 45 - -83. Let m = v - -212. Is 13 a factor of m? False Let q = 406 + -401. Suppose -1129 = -5w - g, 0 = -0w + qw + 5g - 1145. Is 75 a factor of w? True Suppose 0 = -3g - 2o - 4 + 13, 5g + o - 15 = 0. Let p be (0/(-2))/(23/(-2)). Suppose -4l + l + 5r + 125 = 0, -3l - gr + 117 = p. Is l a multiple of 10? True Is 17 a factor of (-1096455)/603(2/10 + -2)? False Does 63 divide 844109/70 + 48/160? False Let s be ((-18)/(-24))/(85418/(-28472) - -3). Let z = -6883 - s. Suppose -1278 = 17h - z. Is h a multiple of 18? False Let l(g) = 8g2 + 2g - 1. Let a(j) = 3j + 1. Let t be a(0). Let u be l(t). Suppose u = -d + 5w, -d + 3w - 27 = -4d. Is d a multiple of 3? True Suppose 25730 = 2w - 2a, 79a = 4w + 76a - 51465. Is 65 a factor of w? True Let f(q) = -16q + 48. Let w be f(3). Suppose wu + u = -4g + 548, -5u - 710 = -5g. Is g a multiple of 49? False Let a(w) be the third derivative of -w*5/60 + 31w*4/24 + 315w*2. Is a(21) a multiple of 6? True Let u be 6 - (17 - 7) - -13. Is 28 a factor of (-17)/(-51) + 8979/u? False Is 33 a factor of 10 + (-16285)/50-10? True Let w = 40 + -40. Suppose v - 43 = -3j, -4v + 0v - 3j + 136 = w. Does 10 divide v? False Is (-1 + 5 + 3)((-166184)/(-56) + -5) a multiple of 157? False Let u(w) = 2376w + 775. Is u(2) a multiple of 31? False Let o be -48 + ((-32)/4)/2. Let f = 122 + o. Suppose w = -4b + b + f, -4b = -5w + 445. Is 17 a factor of w? True Suppose 94 + 20 = 6v. Let u = v + 17. Is 18 a factor of u? True Let r be (-5 - -2)/((-4)/(3 - -1)). Suppose 479 = ra - 2b, -4b - 2 + 10 = 0. Is a a multiple of 6? False Suppose -24w = -4w + 54895 - 219435. Is w a multiple of 96? False Let q(m) = 1 + 366m*2 - 10m - 363m2 + 71. Does 12 divide q(6)? True Let u(o) = 2o*3 + 85o*2 + 20o - 431. Is 2 a factor of u(-41)? True Let k(g) = 10g - 12. Let b be k(0). Is 9 a factor of (-34)/(51/b + 4)? False Is (8/(-6) - (-119)/(-21)) + 4546 a multiple of 56? False Is (3880/873 + (-4)/9)(-2 + 2071) a multiple of 9? False Suppose -f = -5c - 1197, 4c + 4f - 3f = -963. Let l be ((-4)/3)/(4/c). Let u = -32 + l. Is 8 a factor of u? True Let x be ((-4)/6)/((-4)/138). Let y = -5339 + 5385. Suppose -y = -d - q + x, 5d = 4q + 372. Is 28 a factor of d? False Suppose -2x = -4o - 4x - 114, -x = 4o + 117. Is (22/2)/(o/(-660)) a multiple of 11? True Let b(w) be the second derivative of w5/10 + w4/6 - 4w3/3 + 3w*2/2 - w. Suppose -14u + 2g = -13u - 11, 16 = -4g. Is b(u) a multiple of 4? False Suppose -5m = -4v + 55596, -2v - 2m = 3v - 69528. Does 80 divide v? False Suppose -3v - 1039 = -2l - 5183, 0 = 3l + 6. Suppose -2c = -2x - c + 539, 5x + 4c - v = 0. Is x a multiple of 16? True Let u be 17/4 + (-6)/(-8). Let v(i) = 10i - 33. Let s(j) = 9j - 33. Let y(g) = uv(g) - 6s(g). Is y(0) a multiple of 33? True Suppose 1115577 = 50f + 633497 - 1366170. Does 47 divide f? False Suppose 4f - b + 10097 = 35291, 6f = -b + 37806. Is f a multiple of 70? True Suppose 10n - 6102 = 2148. Is 36 a factor of n? False Let l(p) = p3 + 26p*2 + 40p - 12. Let i be l(-24). Suppose -11 = -2f - 1, 0 = -5v - 5f + i. Is v a multiple of 28? False Let q = 4733 - 2999. Is 15 a factor of q? False Suppose 12f = -1703 + 2855. Is 12 a factor of f? True Suppose 2x - 3f + 947 = 6146, -5x + 13017 = -f. Does 6 divide x? True Let d(j) = j2 - 8j + 10. Let y be d(4). Let w(a) = a*3 + 8a*2 + 6a - 13. Is 2 a factor of w(y)? False Let v(o) = 4o3 - 38o*2 + 22o + 262. Is 11 a factor of v(17)? True Suppose 0 = 2o + a - 27, 4o + 3a = 6a + 29. Let u be ((-97)/(-3))/(o/33). Suppose 3i = -u + 448. Is i a multiple of 9? True Let c(z) = -9z - 76. Let q be c(-10). Does 56 divide 2/4 + q/((-28)/(-783))? True Suppose 5n + 13 = -2m - 9, 4n + m + 17 = 0. Let r be -2 - ((-2)/(-4))/(n/64). Does 38 divide (26/r - 1)15? False Let f(m) be the first derivative of m*4/4 - 4m3/3 - m2/2 + 14m + 3. Let p = 123 + -117. Is f(p) a multiple of 16? True Suppose -9w = -6 - 75. Suppose -wf - 3f + 3876 = 0. Does 57 divide f? False Suppose -103 = -5z - p, -2z - 7p + 6p = -40. Suppose -18d - 63 = -zd. Is 7 a factor of d? True Is 7 a factor of (248580/105)/((-102)/(-476))? False Let i be 721 - (1 - 2). Suppose 28t - 20t = 18t. Suppose t = -4y - y, -y = -4q + i. Is 37 a factor of q? True Does 74 divide (122364/(-154))/(-27)2717? False Suppose 0 = -11p + 155201 + 2187. Is p a multiple of 14? True Suppose -887803 = -182f + 176715. Is 14 a factor of f? False Suppose -2u = 4i - 12 - 6, -18 = -5i - u. Suppose 0 = -3n - d + 10, -3d = n - 5n + 9. Suppose h - iz - 18 = 0, -74 = -nh + z - 2z. Does 4 divide h? True Suppose 2x - 12986 = 4i - 134412, 121419 = 4i - 3x. Does 24 divide i? True Let r(y) = -y3 + 33y*2 + 9y - 70. Let o be (264/(-20))/(12/(-30)). Does 32 divide r(o)? False Let q(w) = 6w3 - w2 - 29w + 444. Does 10 divide q(12)? True Suppose -868 = f - 8f. Suppose -2r = -2u - f, 3r - 60 - 130 = u. Is 16 a factor of r? True Is 9 a factor of (165/(-4))/((-3)/324)? True Suppose -10u + 17u = 420. Let l = 78 - u. Is l even? True Suppose x = 2r + 2x - 69, 4r + x - 135 = 0. Suppose 0l - 3l + 60 = 5p, 0 = 2p + 3l - r. Let q = p - -14. Does 23 divide q? True Let t = 22 + 88. Suppose 1315 = 5g - t. Is 57 a factor of g? True Let m be (2/(-4))/(1/2). Suppose -g - 2h + 102 = 3g, 3h = 9. Is 822/g - m/(-4) a multiple of 23? False Suppose 3z + 26 - 29 = 0. Let h(d) = 34d*2 + 3d - 4. Is h(z) even? False Suppose -4f - 15y = -11y - 81976, -5y - 102520 = -5f. Does 27 divide f? False Is 6 a factor of (1152/63 - 11 - 9)/(1/(-3801))? True Suppose 0 = 2a - 2k + 1766, -15 = 5k - 40. Does 71 divide a/(-6) + 123/(-27)? False Let u = 16567 + -7957. Is u a multiple of 30? True Let l = 49 + -54. Let y be (l - -7)/(1 + -3). Is (y + -84)/(0 - 1) a multiple of 31? False Let d be 2(-12)/(-8) + 37. Let z be ((-176)/d - -4)/((-1)/90). Suppose -26t = -zt + 840. Is t a multiple of 21? True Let l = -860 + 848. Is 18 a factor of ((-14623)/(-28))/((-3)/l)? False Suppose 4636 = 2w + 7a - 10a, 2300 = w + 3a. Does 34 divide w? True Let s(n) be the first derivative of n*4/4 + 8n*3/3 - 3n*2/2 + 9n + 655. Suppose 3t + 2t + 4 = m, -6 = 3t. Is s(m) a multiple of 19? False Does 13 divide (-23337)/(-15) + 10/50? False Let l(b) = -2b*2 + 4b + 0b + 11b + 17 - 3b. Let h be l(7). Suppose -4x = hx - 182. Does 25 divide x? False Suppose -3822 = -3u + 213. Suppose 215l = 210l + u. Is l a multiple of 30? False Does 39 divide 6/10-2645/(-2)? True Let z = -21794 - -28955. Is z a multiple of 38? False Suppose 2q + 3k - 16 = 0, k = q - 0k - 3. Suppose -16g - 1050 = -2x - 18g, -qx - 4g + 2628 = 0. Does 73 divide x? False Suppose 8375 = 3o - z - 8947, -z - 23097 = -4o. Does 55 divide o? True Let p = 29659 - 5976. Is 14 a factor of p? False Let b(u) be the second derivative of -u5/20 - u4/2 + 25u3/6 - 13u*2 + 58u - 1. Is 32 a factor of b(-11)? False Suppose -6g + g = -2q - 400, -g + 2q = -88. Suppose -10s + g = -9s + 3r, 5r = s - 110. Is 37 a factor of s? False Let l(y) = -255y + 2. Suppose 0g + 7 = g - 4n, -2 = -4g + 3n. Let w be l(g). Suppose -4k + 510 = 5a, 5k - 3a = 913 - w. Is 26 a factor of k? True Let g = 201 - 140. Suppose -62t + 105 = -gt. Is t a multiple of 6? False Suppose -28 = -8u + u. Let j be 12 + (-1)/(-2)(-2 - u). Is 33 a factor of 162 - (-5)/(15/j)? True Suppose 4g - 39772 = 2650a - 2654a, 0 = -3a - 5g + 29835. Is a a multiple of 7? True Suppose 51n + 4145 = 56n. Let y = -561 + n. Is 11 a factor of y? False Suppose -30b + 36837 = -8043. Is b a multiple of 9? False Does 275 divide (1725867/(-18))/(-11) - -65/20? False Suppose 32g + g = g. Suppose -106b + 109b - 441 = g. Does 49 divide b? True Let b = 37718 - 23980. Does 27 divide b? False Let a be 22 + (1 - 5). Suppose a = -5b + 420 + 735. Is 21 a factor of b? True Let z(q) = 9915q + 625. Is z(2) a multiple of 14? False Suppose 0 = 256m - 250m + 4866. Let t = -539 - m. Is 16 a factor of t? True Let d = 11058 - -1614. Is d a multiple of 132? True Let f = 2 - 0. Suppose -3u - 4r = -10, r + 0r = f*u	{ "pile_set_name": "DM Mathematics" }
er when 1540 is divided by 144. 100 Calculate the remainder when 247586 is divided by 100. 86 Calculate the remainder when 180488 is divided by 90243. 2 Calculate the remainder when 3294 is divided by 2919. 375 What is the remainder when 3061 is divided by 76? 21 Calculate the remainder when 23264 is divided by 284. 260 Calculate the remainder when 41620 is divided by 38. 10 Calculate the remainder when 28361 is divided by 14176. 9 What is the remainder when 48151 is divided by 13? 12 What is the remainder when 2395 is divided by 8? 3 What is the remainder when 57986 is divided by 14? 12 Calculate the remainder when 2158 is divided by 1204. 954 Calculate the remainder when 6260 is divided by 195. 20 Calculate the remainder when 188862 is divided by 29. 14 What is the remainder when 1529 is divided by 294? 59 Calculate the remainder when 2058 is divided by 416. 394 What is the remainder when 823 is divided by 212? 187 Calculate the remainder when 20483 is divided by 315. 8 Calculate the remainder when 1999 is divided by 1876. 123 Calculate the remainder when 93357 is divided by 240. 237 Calculate the remainder when 1028 is divided by 244. 52 Calculate the remainder when 4246 is divided by 3124. 1122 Calculate the remainder when 2216 is divided by 222. 218 Calculate the remainder when 31641 is divided by 684. 177 What is the remainder when 2996 is divided by 1483? 30 What is the remainder when 13996 is divided by 4623? 127 Calculate the remainder when 16333 is divided by 1813. 16 Calculate the remainder when 2737 is divided by 277. 244 What is the remainder when 51504 is divided by 283? 281 Calculate the remainder when 217637 is divided by 6. 5 What is the remainder when 1806 is divided by 991? 815 Calculate the remainder when 8232 is divided by 377. 315 What is the remainder when 113076 is divided by 38? 26 Calculate the remainder when 6824 is divided by 682. 4 What is the remainder when 2175 is divided by 243? 231 What is the remainder when 4620 is divided by 655? 35 Calculate the remainder when 2159 is divided by 184. 135 Calculate the remainder when 5859 is divided by 36. 27 What is the remainder when 3741 is divided by 1210? 111 Calculate the remainder when 81436 is divided by 21. 19 Calculate the remainder when 23002 is divided by 213. 211 Calculate the remainder when 2866 is divided by 67. 52 Calculate the remainder when 7684 is divided by 208. 196 Calculate the remainder when 927 is divided by 826. 101 What is the remainder when 188837 is divided by 13? 12 What is the remainder when 301278 is divided by 104? 94 Calculate the remainder when 143601 is divided by 32. 17 What is the remainder when 73635 is divided by 18? 15 What is the remainder when 1251 is divided by 119? 61 Calculate the remainder when 270429 is divided by 5633. 45 Calculate the remainder when 17175 is divided by 39. 15 Calculate the remainder when 638 is divided by 27. 17 What is the remainder when 568293 is divided by 189427? 12 What is the remainder when 22297 is divided by 5? 2 What is the remainder when 11248 is divided by 5? 3 What is the remainder when 18468 is divided by 2030? 198 Calculate the remainder when 68215 is divided by 307. 61 Calculate the remainder when 131972 is divided by 1. 0 What is the remainder when 319327 is divided by 85? 67 Calculate the remainder when 34742 is divided by 431. 262 What is the remainder when 734127 is divided by 45? 42 Calculate the remainder when 8449 is divided by 88. 1 Calculate the remainder when 6276 is divided by 563. 83 What is the remainder when 6800 is divided by 170? 0 What is the remainder when 50112 is divided by 1565? 32 What is the remainder when 4105 is divided by 1365? 10 What is the remainder when 58955 is divided by 120? 35 Calculate the remainder when 45 is divided by 26. 19 Calculate the remainder when 12372 is divided by 12317. 55 Calculate the remainder when 11032 is divided by 374. 186 What is the remainder when 4351 is divided by 118? 103 Calculate the remainder when 3060 is divided by 608. 20 What is the remainder when 91793 is divided by 46? 23 Calculate the remainder when 27009 is divided by 26855. 154 Calculate the remainder when 17441 is divided by 8720. 1 Calculate the remainder when 1293 is divided by 224. 173 What is the remainder when 9989 is divided by 144? 53 What is the remainder when 418 is divided by 140? 138 What is the remainder when 8809 is divided by 160? 9 Calculate the remainder when 186808 is divided by 224. 216 Calculate the remainder when 35524 is divided by 5073. 13 What is the remainder when 3077 is divided by 82? 43 What is the remainder when 2865 is divided by 1316? 233 Calculate the remainder when 32371 is divided by 16168. 35 What is the remainder when 95836 is divided by 326? 318 Calculate the remainder when 4680 is divided by 169. 117 What is the remainder when 2109 is divided by 225? 84 Calculate the remainder when 1001 is divided by 320. 41 What is the remainder when 1092943 is divided by 15? 13 Calculate the remainder when 673736 is divided by 19. 15 Calculate the remainder when 9566 is divided by 184. 182 Calculate the remainder when 35309 is divided by 8823. 17 What is the remainder when 150274 is divided by 147? 40 Calculate the remainder when 14333 is divided by 226. 95 What is the remainder when 93814 is divided by 1618? 1588 Calculate the remainder when 142172 is divided by 3306. 14 What is the remainder when 3264 is divided by 1087? 3 Calculate the remainder when 52259 is divided by 1683. 86 Calculate the remainder when 4176 is divided by 441. 207 Calculate the remainder when 432 is divided by 187. 58 Calculate the remainder when 468648 is divided by 321. 309 What is the remainder when 2918 is divided by 122? 112 What is the remainder when 1587685 is divided by 793837? 11 Calculate the remainder when 47599 is divided by 410. 39 Calculate the remainder when 149913 is divided by 22. 5 What is the remainder when 13187 is divided by 696? 659 Calculate the remainder when 6659 is divided by 1109. 5 Calculate the remainder when 12005 is divided by 12. 5 What is the remainder when 1472981 is divided by 17? 16 What is the remainder when 9662 is divided by 65? 42 What is the remainder when 2272 is divided by 162? 4 Calculate the remainder when 34046 is divided by 266. 264 What is the remainder when 1582041 is divided by 133? 6 Calculate the remainder when 1087109 is divided by 1115. 1099 Calculate the remainder when 9443 is divided by 91. 70 Calculate the remainder when 10193 is divided by 237. 2 Calculate the remainder when 2875918 is divided by 80. 78 What is the remainder when 100875 is divided by 151? 7 What is the remainder when 246940 is divided by 27? 25 What is the remainder when 98892 is divided by 8? 4 What is the remainder when 3290 is divided by 3214? 76 What is the remainder when 27740 is divided by 27738? 2 What is the remainder when 6692 is divided by 87? 80 Calculate the remainder when 2534 is divided by 81. 23 Calculate the remainder when 2372 is divided by 18. 14 What is the remainder when 63837 is divided by 137? 132 Calculate the remainder when 15201 is divided by 131. 5 What is the remainder when 16610 is divided by 2? 0 Calculate the remainder when 296978 is divided by 13. 6 What is the remainder when 200929 is divided by 183? 178 What is the remainder when 4999 is divided by 1546? 361 What is the remainder when 1413 is divided by 8? 5 What is the remainder when 34823 is divided by 6952? 63 Calculate the remainder when 12786 is divided by 94. 2 Calculate the remainder when 213667 is divided by 230. 227 Calculate the remainder when 1595083 is divided by 152. 147 What is the remainder when 17671 is divided by 233? 196 Calculate the remainder when 2344 is divided by 793. 758 What is the remainder when 28229 is divided by 744? 701 What is the remainder when 2450489 is divided by 245? 244 Calculate the remainder when 3951 is divided by 13. 12 Calculate the remainder when 661 is divided by 560. 101 What is the remainder when 142205 is divided by 109? 69 What is the remainder when 15035 is divided by 470? 465 What is the remainder when 25460 is divided by 25417? 43 Calculate the remainder when 9863 is divided by 249. 152 Calculate the remainder when 2946	{ "pile_set_name": "DM Mathematics" }
1 a, 2 c, and 1 h. 56/715 Calculate prob of picking 1 v and 1 c when two letters picked without replacement from cvvcvvcvvvcccvcccvvv. 99/190 Two letters picked without replacement from {v: 1, q: 1, d: 1, s: 1, p: 2, n: 1}. What is prob of picking 1 n and 1 s? 1/21 Calculate prob of picking 4 c when four letters picked without replacement from {c: 15, a: 2, p: 3}. 91/323 What is prob of picking 4 u when four letters picked without replacement from ucccuuuuuuc? 7/66 Three letters picked without replacement from {v: 12, u: 7}. What is prob of picking 3 u? 35/969 Calculate prob of picking 1 s and 1 u when two letters picked without replacement from {u: 1, g: 1, s: 1}. 1/3 Three letters picked without replacement from bbqqqcbicbcqccc. What is prob of picking 2 c and 1 b? 12/91 Four letters picked without replacement from ksskksuk. What is prob of picking 3 k and 1 u? 2/35 Two letters picked without replacement from yyyryyrryyryryyyyyy. What is prob of picking 2 y? 91/171 Calculate prob of picking 1 z, 1 d, and 1 b when three letters picked without replacement from {z: 1, d: 11, b: 3, a: 4}. 11/323 What is prob of picking 1 y and 1 w when two letters picked without replacement from mnwdwdydnwe? 3/55 Calculate prob of picking 2 i when two letters picked without replacement from {i: 6, v: 2}. 15/28 Two letters picked without replacement from wlhhhhglghwlghw. Give prob of picking 1 w and 1 g. 3/35 Four letters picked without replacement from {c: 4, j: 6}. Give prob of picking 4 j. 1/14 What is prob of picking 1 y and 1 d when two letters picked without replacement from {n: 2, z: 1, y: 4, d: 1, c: 1}? 1/9 Calculate prob of picking 3 z and 1 p when four letters picked without replacement from zzppzzppzppppppp. 11/182 What is prob of picking 1 n and 2 v when three letters picked without replacement from {v: 3, n: 2, i: 3, o: 3, j: 3}? 3/182 Calculate prob of picking 1 r and 1 w when two letters picked without replacement from wwrrw. 3/5 Calculate prob of picking 2 k and 1 a when three letters picked without replacement from {d: 3, k: 3, s: 1, q: 2, a: 1, f: 1}. 1/55 What is prob of picking 1 z and 2 l when three letters picked without replacement from {z: 5, t: 2, l: 7}? 15/52 What is prob of picking 1 s and 1 v when two letters picked without replacement from ssqvsqqqvq? 2/15 Three letters picked without replacement from jprrrprrwwrrrrpmrr. What is prob of picking 2 p and 1 r? 11/272 Two letters picked without replacement from niv. What is prob of picking 1 i and 1 v? 1/3 Three letters picked without replacement from gvjjgeggjgggjgjj. What is prob of picking 1 v, 1 g, and 1 j? 3/35 Calculate prob of picking 2 e, 1 v, and 1 c when four letters picked without replacement from ccqkvvokvcoeoe. 9/1001 Two letters picked without replacement from szzzzjsesej. What is prob of picking 1 z and 1 j? 8/55 What is prob of picking 2 y when two letters picked without replacement from {j: 1, w: 5, y: 5, s: 6}? 5/68 Two letters picked without replacement from ehhhfhuheueh. What is prob of picking 1 u and 1 h? 2/11 Calculate prob of picking 1 u and 1 q when two letters picked without replacement from uufifufquqf. 8/55 Four letters picked without replacement from {u: 6, q: 1, o: 1, m: 1, w: 3}. Give prob of picking 1 m, 2 u, and 1 q. 1/33 What is prob of picking 1 p and 1 o when two letters picked without replacement from poo? 2/3 What is prob of picking 2 o, 1 e, and 1 l when four letters picked without replacement from {e: 2, p: 1, l: 1, o: 5}? 10/63 What is prob of picking 1 m, 1 w, and 1 k when three letters picked without replacement from wjmwkmwmmk? 1/5 What is prob of picking 2 k, 1 x, and 1 w when four letters picked without replacement from {z: 2, q: 3, k: 2, o: 4, x: 1, w: 3}? 1/455 Four letters picked without replacement from {l: 2, d: 4, r: 2, e: 1, s: 2, f: 9}. What is prob of picking 2 l, 1 d, and 1 r? 8/4845 Three letters picked without replacement from {c: 6, g: 1, n: 1, z: 1, o: 6}. What is prob of picking 1 g, 1 z, and 1 c? 6/455 Calculate prob of picking 2 a and 1 v when three letters picked without replacement from vaaaava. 4/7 Calculate prob of picking 1 g and 1 e when two letters picked without replacement from {e: 2, d: 2, j: 1, y: 2, q: 1, g: 1}. 1/18 Three letters picked without replacement from ztzdddhtzhga. Give prob of picking 1 g, 1 t, and 1 z. 3/110 Calculate prob of picking 3 n and 1 d when four letters picked without replacement from {d: 7, n: 6}. 28/143 Four letters picked without replacement from {w: 2, m: 1, n: 1, q: 1, h: 3, k: 3}. Give prob of picking 3 k and 1 n. 1/330 Four letters picked without replacement from {s: 16, g: 2}. Give prob of picking 2 s and 2 g. 2/51 Three letters picked without replacement from wiwiiiiiiiiii. What is prob of picking 2 i and 1 w? 5/13 What is prob of picking 2 z when two letters picked without replacement from {n: 6, b: 1, z: 7}? 3/13 Two letters picked without replacement from {a: 6, t: 1, b: 5, u: 2, g: 3}. What is prob of picking 1 a and 1 g? 9/68 Three letters picked without replacement from {z: 1, w: 4, t: 2, y: 6}. What is prob of picking 1 y, 1 w, and 1 z? 12/143 Four letters picked without replacement from {q: 6, k: 5, v: 4}. Give prob of picking 4 k. 1/273 What is prob of picking 2 p when two letters picked without replacement from {a: 4, i: 3, d: 1, v: 1, p: 6}? 1/7 Three letters picked without replacement from kkkkkkkkk. What is prob of picking 3 k? 1 Three letters picked without replacement from xzznxnfxx. Give prob of picking 1 x, 1 z, and 1 n. 4/21 Two letters picked without replacement from vvmvmm. What is prob of picking 2 v? 1/5 Two letters picked without replacement from ubbupppoupkkuvppp. Give prob of picking 1 u and 1 p. 7/34 Calculate prob of picking 1 j and 2 o when three letters picked without replacement from oojhhohoohjjoo. 9/52 Two letters picked without replacement from {f: 2, m: 2, d: 1, p: 2, v: 1, j: 1}. Give prob of picking 1 f and 1 v. 1/18 What is prob of picking 2 q when two letters picked without replacement from {u: 1, y: 2, v: 4, r: 1, q: 2}? 1/45 Calculate prob of picking 3 a when three letters picked without replacement from {b: 14, a: 5}. 10/969 What is prob of picking 1 p and 1 k when two letters picked without replacement from hakkpdl? 2/21 Four letters picked without replacement from {s: 2, a: 6}. Give prob of picking 2 s and 2 a. 3/14 What is prob of picking 1 k and 1 o when two letters picked without replacement from jkeikkkoekkke? 7/78 Three letters picked without replacement from mhhmmma. Give prob of picking 3 m. 4/35 Two letters picked without replacement from lqwrqqrcllclqzl. What is prob of picking 1 q and 1 w? 4/105 Calculate prob of picking 2 v and 1 j when three letters picked without replacement from jjvvwfj. 3/35 Calculate prob of picking 1 n and 2 f when three letters picked without replacement from nnffnnhfnnnfnjfffj. 7/34 Two letters picked without replacement from {j: 7, u: 4, g: 6}. What is prob of picking 2 j? 21/136 Calculate prob of picking 1 p and 2 l when three letters picked without replacement from {p: 3, l: 4, x: 3, a: 2, c: 4}. 9/280 Calculate prob of picking 3 p and 1 w when four letters picked without replacement from {p: 6, w: 4}. 8/21 Two letters picked without replacement from iiiwciwiowwwiiicwi. What is prob of picking 1 c and 1 o? 2/153 Calculate prob of picking 1 e, 2 c, and 1 y when four letters picked without replacement from yceccyy. 9/35 Two letters picked without replacement from zzzzuuuuzzuz. What is prob of picking 1 u and 1 z? 35/66 Calculate prob of picking 2 x and 1 n when three letters picked without replacement from xxxzxqqxqzqqznx. 3/91 Four letters picked without replacement from nnnnnnnnrnrnnnnrnnnn. What is prob of picking 3 n and 1 r? 8/19 Three letters picked without replacement from {q: 2, l: 1, v: 1, b: 1}. Give prob of picking 1 l and 2 q. 1/10 Four letters picked without replacement from obgwwggbgowwwbwgt. Give prob of picking 2 w, 1 t, and 1 o. 3/238 Calculate prob of picking 2 t when two letters picked without replacement from dtddthettdm. 6/55 Calculate prob of picking 2 r and 1 n when three letters picked without replacement from {n: 3, v: 3, w: 1, a: 2, r: 9}. 9/68 Three letters picked without	{ "pile_set_name": "DM Mathematics" }
r 5:14 AM? 7:17 AM How many minutes are there between 4:38 AM and 7:07 AM? 149 How many minutes are there between 3:27 AM and 6:12 AM? 165 What is 373 minutes before 7:07 PM? 12:54 PM What is 251 minutes before 1:53 AM? 9:42 PM How many minutes are there between 11:49 AM and 4:38 PM? 289 How many minutes are there between 2:26 PM and 11:58 PM? 572 How many minutes are there between 3:22 PM and 4:31 PM? 69 How many minutes are there between 8:31 AM and 11:16 AM? 165 How many minutes are there between 4:46 PM and 8:13 PM? 207 How many minutes are there between 9:51 PM and 6:03 AM? 492 What is 194 minutes after 3:29 PM? 6:43 PM What is 526 minutes before 6:16 PM? 9:30 AM What is 630 minutes before 6:10 PM? 7:40 AM What is 250 minutes after 3:33 PM? 7:43 PM How many minutes are there between 1:03 PM and 9:19 PM? 496 How many minutes are there between 5:30 AM and 8:15 AM? 165 What is 466 minutes before 3:38 PM? 7:52 AM How many minutes are there between 12:38 PM and 10:21 PM? 583 What is 128 minutes after 4:50 AM? 6:58 AM What is 641 minutes before 8:23 AM? 9:42 PM How many minutes are there between 1:11 AM and 12:57 PM? 706 How many minutes are there between 9:26 PM and 11:33 PM? 127 How many minutes are there between 5:47 PM and 5:35 AM? 708 What is 159 minutes after 8:23 AM? 11:02 AM How many minutes are there between 6:09 AM and 8:31 AM? 142 How many minutes are there between 2:55 PM and 11:03 PM? 488 What is 327 minutes after 11:54 AM? 5:21 PM What is 501 minutes after 6:28 AM? 2:49 PM What is 620 minutes before 3:07 PM? 4:47 AM How many minutes are there between 6:33 PM and 1:59 AM? 446 How many minutes are there between 11:47 AM and 12:50 PM? 63 What is 154 minutes after 8:19 AM? 10:53 AM How many minutes are there between 3:32 AM and 10:35 AM? 423 How many minutes are there between 7:32 AM and 11:56 AM? 264 What is 160 minutes after 2:02 PM? 4:42 PM What is 236 minutes after 6:56 AM? 10:52 AM What is 331 minutes after 12:44 PM? 6:15 PM What is 514 minutes after 3:31 PM? 12:05 AM How many minutes are there between 3:58 PM and 3:52 AM? 714 What is 76 minutes before 12:51 AM? 11:35 PM What is 530 minutes after 12:29 PM? 9:19 PM What is 620 minutes after 5:32 PM? 3:52 AM How many minutes are there between 12:08 PM and 11:58 PM? 710 What is 367 minutes before 3:25 AM? 9:18 PM How many minutes are there between 12:07 PM and 1:14 PM? 67 How many minutes are there between 4:33 AM and 12:58 PM? 505 What is 526 minutes before 9:01 PM? 12:15 PM How many minutes are there between 9:04 PM and 10:11 PM? 67 What is 582 minutes after 9:39 AM? 7:21 PM What is 71 minutes after 6:16 AM? 7:27 AM How many minutes are there between 1:15 PM and 6:40 PM? 325 What is 52 minutes after 4:33 AM? 5:25 AM What is 504 minutes after 11:40 AM? 8:04 PM What is 618 minutes after 4:32 AM? 2:50 PM How many minutes are there between 8:48 AM and 12:25 PM? 217 How many minutes are there between 11:00 PM and 12:09 AM? 69 How many minutes are there between 6:24 PM and 4:44 AM? 620 What is 355 minutes after 5:27 AM? 11:22 AM How many minutes are there between 3:09 AM and 5:19 AM? 130 What is 652 minutes after 3:51 PM? 2:43 AM What is 127 minutes after 2:19 AM? 4:26 AM How many minutes are there between 12:36 PM and 7:37 PM? 421 How many minutes are there between 7:02 PM and 1:18 AM? 376 What is 628 minutes before 11:10 PM? 12:42 PM What is 204 minutes before 5:04 PM? 1:40 PM How many minutes are there between 2:15 PM and 5:32 PM? 197 How many minutes are there between 4:27 PM and 8:40 PM? 253 What is 181 minutes before 10:58 PM? 7:57 PM What is 591 minutes before 9:42 PM? 11:51 AM How many minutes are there between 4:08 AM and 11:04 AM? 416 How many minutes are there between 6:51 PM and 5:58 AM? 667 How many minutes are there between 4:11 PM and 6:18 PM? 127 What is 264 minutes before 4:10 PM? 11:46 AM What is 623 minutes after 8:08 AM? 6:31 PM What is 184 minutes before 3:19 PM? 12:15 PM How many minutes are there between 12:51 AM and 12:19 PM? 688 How many minutes are there between 11:26 PM and 3:46 AM? 260 What is 291 minutes after 3:41 PM? 8:32 PM How many minutes are there between 2:20 PM and 2:10 AM? 710 What is 300 minutes before 4:18 AM? 11:18 PM What is 274 minutes before 12:27 PM? 7:53 AM How many minutes are there between 4:37 AM and 12:13 PM? 456 How many minutes are there between 12:26 PM and 4:32 PM? 246 How many minutes are there between 12:29 PM and 3:53 PM? 204 How many minutes are there between 1:27 AM and 3:49 AM? 142 How many minutes are there between 10:24 PM and 5:36 AM? 432 What is 41 minutes before 10:06 PM? 9:25 PM What is 492 minutes after 9:39 PM? 5:51 AM How many minutes are there between 9:10 PM and 6:00 AM? 530 What is 344 minutes after 6:56 PM? 12:40 AM What is 491 minutes after 11:46 AM? 7:57 PM What is 36 minutes after 10:28 PM? 11:04 PM What is 627 minutes after 5:39 AM? 4:06 PM How many minutes are there between 12:28 AM and 6:10 AM? 342 How many minutes are there between 4:57 AM and 1:47 PM? 530 How many minutes are there between 10:44 PM and 10:03 AM? 679 How many minutes are there between 1:05 AM and 1:53 AM? 48 What is 428 minutes before 8:05 AM? 12:57 AM What is 535 minutes after 6:58 PM? 3:53 AM How many minutes are there between 8:24 PM and 2:37 AM? 373 How many minutes are there between 9:07 PM and 4:16 AM? 429 What is 505 minutes before 4:08 PM? 7:43 AM What is 135 minutes after 11:02 PM? 1:17 AM How many minutes are there between 5:58 AM and 11:26 AM? 328 What is 586 minutes before 2:48 PM? 5:02 AM How many minutes are there between 11:38 PM and 12:37 AM? 59 What is 266 minutes after 5:15 AM? 9:41 AM How many minutes are there between 12:51 PM and 6:46 PM? 355 What is 167 minutes after 3:11 AM? 5:58 AM What is 286 minutes before 1:49 PM? 9:03 AM How many minutes are there between 11:42 PM and 5:37 AM? 355 How many minutes are there between 1:43 AM and 7:54 AM? 371 What is 104 minutes before 6:46 AM? 5:02 AM What is 359 minutes after 8:43 AM? 2:42 PM What is 171 minutes after 8:03 AM? 10:54 AM How many minutes are there between 8:28 AM and 3:32 PM? 424 How many minutes are there between 8:27 AM and 6:16 PM? 589 What is 63 minutes before 4:16 AM? 3:13 AM What is 127 minutes before 9:04 PM? 6:57 PM How many minutes are there between 5:01 PM and 4:13 AM? 672 How many minutes are there between 8:02 AM and 9:02 AM? 60 How many minutes are there between 10:31 AM and 5:25 PM? 414 How many minutes are there between 12:55 AM and 3:20 AM? 145 How many minutes are there between 5:24 AM and 4:26 PM? 662 What is 331 minutes after 5:30 PM? 11:01 PM How many minutes are there between 10:43 AM and 1:33 PM? 170 What is 410 minutes before 9:04 AM? 2:14 AM How many minutes are there between 11:34 PM and 4:49 AM? 315 How many minutes are there between 6:00 PM and 12:28 AM? 388 What is 6 minutes after 5:49 AM? 5:55 AM What is 585 minutes before 9:56 PM? 12:11 PM What is 620 minutes after 3:31 PM? 1:51 AM How many minutes are there between 12:42 PM and 12:15 AM? 693 How many minutes are there between 1:51 AM and 1:24 PM? 693 How many minutes are there between 4:13 PM and 10:24 PM? 371 What is 630 minutes before 6:55 PM? 8:25 AM How many minutes are there between 1:39 PM and 11:07 PM? 568 How many minutes are there between 3:00 PM and 8:42 PM? 342 How many minutes are there between 11:27 PM and 9:45 AM? 618 How many minutes are there between 5:56 PM and 9:56 PM? 240 What is 171 minutes before 4:45 AM? 1:54 AM How many minutes are there between 6:21 PM and 10:32 PM? 251 How many minutes are there between 6:19 PM and 4:15 AM? 596 How many minutes are there between 11:54 AM and 9:10 PM? 556 How many minutes are there between 2:59 AM and 2:30 PM? 691 How many minutes are there between 10:52 PM and 1:27 AM? 155 What is 564 minutes before 7:40 AM? 10:16 PM How many minutes are there between 6:40 AM and 9:18 AM? 158 What is 643 minutes before 3:06 AM? 4:23 PM What is 107 minutes after 11:13 AM? 1:00 PM How many minutes are there between 1:36 AM and 11:56 AM? 620 How many minutes are there between 3:23 PM and 5:45 PM? 142 What is 458 minutes before 1:27 AM? 5:49 PM What is 404 minutes before 2:56 PM? 8:12 AM What is 71 minutes before 10:08 PM? 8:57 PM What is 504 m	{ "pile_set_name": "DM Mathematics" }
allest value in 0.2, z, 4/3, 0.03? 0.03 Suppose 9j = 2j + 21. Let o be (2(-31)/(-6) - j) + -1. What is the second biggest value in o, -0.3, -3? -0.3 Let r = 0.942 - 0.082. Let j = r + -0.56. Which is the second biggest value? (a) j (b) 5 (c) 43 b Let n = 6.284 - 2.284. Which is the second smallest value? (a) n (b) -473 (c) 5 a Let j = -1.4294 - -1.0294. Let l be 2/(-3) + (2 - 2). Which is the third smallest value? (a) l (b) j (c) 1/2 c Let o = -1.9264 - -1.7264. What is the second biggest value in 1, -9, o, -1, 30? 1 Let v = 218/79 + -41/158. Which is the second biggest value? (a) v (b) -113 (c) 1/9 c Let l be (-2)/(-30) - (-20590)/(-47850). Which is the second biggest value? (a) l (b) -5 (c) -1 c Let l = -2/3 - -11/21. Let q = -0.022 + -0.078. Let n = 211/4 - 53. What is the third smallest value in q, l, n? q Let v = -8.09 + 3.99. Let w = v + 4.3. What is the second biggest value in w, 2, -0.2, -0.4? w Let p = -186 + 188.07. Let s = -4094/5 + 819. Which is the second smallest value? (a) p (b) -1/7 (c) s c Let i = -234599/8 - -29324. What is the second biggest value in 1/22, 2, -0.2, -5, i? 1/22 Let o = -3.52 - -3.6. Let x = o + 14.92. Let q = x - 15. What is the third smallest value in 1, 1/5, q? 1 Let l = 9122.16 - 9122. Which is the third smallest value? (a) -9 (b) l (c) 2/9 (d) -1 (e) 2/3 b Let n be (-15 - -19) + (9/12-3 - 2). What is the fourth biggest value in -1/3, -2/73, 1, n? -1/3 Let b be 3/510/(-8). Let y = 85897 + -86005. What is the second biggest value in b, y, 4/3? b Let o = 46492 + -46560. Which is the fourth biggest value? (a) 0.7 (b) -3 (c) o (d) 9 c Let n = -11764.5 + 11765. What is the fourth smallest value in n, -1/26, -1, 1? 1 Suppose 0 = 2d + 3g + 8, 3d + 145g + 12 = 140g. Which is the third biggest value? (a) d (b) -0.19 (c) -3 a Let v = -759/14 - -69/2. Let t = 26231 - 26231.4. What is the third biggest value in t, -0.1, v? v Let w = -244 - -241.23. Let y = 2.65 + w. Which is the second smallest value? (a) -2/13 (b) 1 (c) y (d) -0.3 a Suppose -26i = -28i + 6i + 30i. Which is the second biggest value? (a) -7/220 (b) i (c) -0.03 c Let i = -2091 + 2096. What is the biggest value in 0.06, 0.1, 1/5, i? i Let j(z) = 2z - 22. Let l be j(12). Suppose -ly - 2y + 236 = 0. Let d = 941/16 - y. Which is the second smallest value? (a) 5 (b) 4/9 (c) d b Let m be 4 + 356/(-72) - (-2)/(-9). Let p = m + 83/66. Let r = p + -35/143. Which is the third biggest value? (a) r (b) -0.4 (c) -5 c Let p = -113 - -70. Let t = -42.33 - p. Let q = t + -0.27. Which is the third biggest value? (a) -0.2 (b) 0.1 (c) q a Let c = -1822 + 1822.1. What is the fourth smallest value in c, 0.06, -2, -3/7? c Let j = -5089.8 - -5090. Which is the biggest value? (a) j (b) -287 (c) -2 a Let j be (-10)/12(-24)/30. Let l be (-270)/4207/6. Which is the third biggest value? (a) -7 (b) l (c) 0 (d) j b Suppose 2n + 146 = 4h + 54, -52 = -2h - 2n. Let q be 2/3 - ((-448)/h)/(-7). Let z = -9 + 13. Which is the third smallest value? (a) z (b) 0.2 (c) q a Let w be (-15)/18606/4626. Let u = w + -1/514. Which is the third biggest value? (a) -0.038 (b) -2 (c) 0 (d) u d Let y = 0.4 + -3.4. Let c = y + 2.3. Let g = c - 1.3. What is the second smallest value in -0.2, -1.2, g? -1.2 Let s(m) = -802m + 804. Let r be s(1). Which is the second smallest value? (a) -5/4 (b) 0 (c) r (d) 9 (e) 3 b Let u = 10 - -2. Let d = u - 11.5. Which is the second smallest value? (a) -4 (b) d (c) -1 c Suppose -53n - 60 = 13n - 6n. What is the biggest value in n, 2, 0.5, 1.05? 2 Let w = 140 + -54. Let d = -53 + w. Let q = 32.8 - d. Which is the second smallest value? (a) q (b) -0.1 (c) 4 b Let l be 2/((-12)/147)19248/2807. What is the third smallest value in 0.3, 3.7, l? 3.7 Suppose 0 = -5p + 5 - 15. Let v = -14709 - -14724. Which is the fourth biggest value? (a) p (b) 5 (c) -1/3 (d) v a Let s = 3.2 - 3. Let z = 1.49164 - 1.56164. What is the smallest value in z, s, 0.5, 3? z Let z be 1 + (0 + -2)(-42)/(-28). Let n be -3 + ((-48)/(-15) - 0). What is the smallest value in -1/5, z, n? z Let p be 4/16 - ((-11121)/(-4932) - 2). Let i = p - -2063/1644. Let y = -4 - 1. What is the fourth biggest value in 1, i, y, -5/4? y Suppose -892g + 780g + 1232 = 0. Which is the smallest value? (a) g (b) -1 (c) 0.5 (d) 85/3 b Suppose 401k + 130 = 427k. Which is the fourth biggest value? (a) -2/3 (b) 0.2 (c) k (d) -2/7 (e) 51 d Let p = 1817 + -1817.3. Which is the biggest value? (a) -2/19 (b) 14/11 (c) p (d) -1/22 (e) 0.4 b Let s = 65/6 - 11. Let w(g) = 136g + 12. Let d be w(-6). Let z be 6/2 - d/(-276). Which is the second smallest value? (a) s (b) z (c) 0.01 c Let l = -803.5 + 806.5. What is the second smallest value in l, 0, 3946, 1? 1 Let j be 23/(-6)-1. Let v be (-70)/(j3/3). Let q = 76 + v. Which is the second smallest value? (a) q (b) -1 (c) -5 (d) -4 d Let v be 114/216 + 5/20. Let n = -131/99 + v. What is the second smallest value in -1/7, -3/4, 0, n? n Let u = -34 + -478. Let o = -508 - u. Which is the smallest value? (a) 0.2 (b) -0.2 (c) 2/3 (d) o b Suppose 0 = -3d - w - 25, 0 = -3d + 6w - w - 55. Let j be ((-2)/(-8))/((7 - -2) + d). Let v = -2 - 1. What is the second biggest value in v, j, 2? j Let k(g) = g*3 + 6g*2 - 8g - 7. Let a be k(-7). Let b = 359.3 - 316.3. What is the third smallest value in 1, b, a? b Let m = 4.941 - 4.611. What is the smallest value in m, 0, -27? -27 Let r = -153 - -147.8. Let v = 10.2 + r. Let w be (-6)/(-9)3/(-14). What is the second smallest value in w, -3, v? w Let z be -1 - ((-14)/(-9))/(-2). Let j = 1194345 + -1194349. What is the fourth smallest value in -0.33, j, z, -0.3? z Let u = 2/9481 - 9485/18962. Suppose -3d - 20 = -v, -11 = 3v + 5d - 1. Which is the second biggest value? (a) 2/3 (b) u (c) v a Let g = 28.9 - -59.1. Let z = g + -88.2. Which is the smallest value? (a) 1/7 (b) -4/7 (c) z b Let p = 7.241 - 7.041. What is the smallest value in 0.945, p, -0.4? -0.4 Let w be (9 + 42/(-4))/(9/(-12)). Which is the smallest value? (a) 0.5 (b) 3 (c) w (d) -4 (e) 586 d Let f = -54929 - -54919. Let l(t) = t*3 + 2t*2 - 2t. Let p be l(-3). Which is the smallest value? (a) p (b) f (c) -5 b Let j = 0.04 - 0.24. Let z be (-9)/241358/(-3). Let s = z - 171. Which is the third biggest value? (a) j (b) -6 (c) s b Let f be 4/(-18) + 48022/(-9). Let o be f/(-21840) - (-2)/(-5). Let u = -1/78 - o. What is the smallest value in 50, 2, u? u Let v = -1.4466 - 0.5534. Let w = -2.2 - -1.1. Which is the smallest value? (a) v (b) w (c) 0.3 (d) -0.1 a Suppose 4z - 1 = -9. Let f(i) = -i*3 + 3i*2 + 7i - 20. Let q be f(5). Let p be (4/25)/(14/q). Which is the second smallest value? (a) z (b) p (c) -1/4 b Let s = 0.2064 + -0.2064. What is the third biggest value in 0.5, 2/11, s, 216, -4? 2/11 Let u = 52 - 45. Suppose u = 4p - 9. Suppose -5j + pj = -3. Which is the smallest value? (a) -5/6 (b) j (c) -0.2 a Let m = -194 - -193.9. Let r = -0.1 - m. Let u be 2/(-7) - (-24)/(-28). What is the second biggest value in u, -0.4, r? -0.4 Let f = -0.19 + 0.18. Let l(i) = i2 - 30i + 227. Let z be l(14). Which is the second biggest value? (a) -3/2 (b) z (c) f (d) -3 c Let y = -1399.7 + 1400. What is the smallest value in -3/2, 124/13, y, 0.4? -3/2 Let j = -1.81 + 1.7. Let r be 6/42 + 6(14 - (-10747)/(-770)). What is the biggest value in -4, j, 4, r? 4 Let n = -2154.98 - -2155. Which is the third smallest value? (a) 0 (b) -28 (c) n (d) 3 c Let g = -114 - -115. Let m be -5 + -12(-42)/96. Which is the third biggest value? (a) -0.4 (b) -2/7 (c) m (d) g b Let p = -512 - -542. Let m be -3 + -1 - ((-1419)/p)/11. Which is the second biggest value? (a) -3/7 (b) -0.3 (c) m b Let n = 434/13 - 1775/52. Let i = -0.3 + 0.4. What is the second smallest value in -2, i, n? n Let k be 15/(-55) + (-1110)/(-1650). What is the second biggest value in -5, -47, -1, 3, k? k Let f = -3306 + 3302. Which is the third smallest value? (a) 0.05 (b) -5 (c) -7 (d) f d Let o be (110/(-4) - -25)*(-8)/10. Which is the third smallest value? (a) -25 (b) -3 (c) -5 (d) o b Let y = -0.06612 + -3.93388. What is the biggest value in -102, y, -1	{ "pile_set_name": "DM Mathematics" }
= -3r, -r + 4r = 15 for w. 0 Solve 0 = 2w + 3v - 4, 0w + 2w - 8 = -5v for w. -1 Solve -4w = -2i - 26, 4w - 36 = 4i - 0w for i. -5 Solve i - j = 4i - 9, 1 = -i + j for i. 2 Solve 2g = -2u + 14, g - 13 = -9u + 7u for u. 6 Solve -30 + 5 = -5o - 3v, -5o + 25 = -v for o. 5 Solve 0 = -4f + q - 8, -3f + 3 - 28 = 4q for f. -3 Solve f = -3s + 14, -4 = -4f - 3s + 7 for f. -1 Solve 5o + 5 = 0, -v + 2 = o + o for v. 4 Solve -5l - 19 = -3n - 0n, 25 = -3l - 5n for l. -5 Solve -3h - 20 = 2h - 5o, -12 = 3h - 2o for h. -4 Solve f + 3w - 16 = 0, -5f = -2f + 2w - 20 for f. 4 Solve 4l - 1 + 5 = -y, 7l = -2y - 7 for y. 0 Solve 2 = -4n - 2d - 2, 3d - 6 = 0 for n. -2 Solve -5h - 1 = 3v - 7, -3v + 6 = -4h for h. 0 Solve 2b - 3 = -x, 3b + 6 = 3x - 8x for b. 3 Solve 0 = -3m + h + 16, 33 - 11 = 5m + 3h for m. 5 Solve 6q = -u + 3, -9q = -u - 7q - 5 for u. -3 Solve -14t + 120f - 119f = -60, 0 = 2t + 4f + 8 for t. 4 Solve 5t = 2s + 20, -2t = -15 + 7 for s. 0 Solve 0g + 5u - 17 = 3g, 4g + 5u - 24 = 0 for g. 1 Solve 0p + 2a - 9 = -p, 2p + 2a = 6 for p. -3 Solve 5o + 5 = 0, -3o = 5x + 16 - 8 for x. -1 Solve -3l - 5g = -17, -l - 5g = -g - 8 for l. 4 Solve 2p - r + 6 = 0, 3p + 4r = 8r - 9 for p. -3 Solve 5s - 4h = h, 13h = 16h for s. 0 Solve 304i - 300i = -2z - 12, -2i - 4 = 0 for z. -2 Solve 8m - 5m = 2x - 9, -3m + x = 9 for m. -3 Solve -2v - 10 = -y, 5y - 4v - 18 = 4y for y. 2 Solve 3c = -4s + 13, -6s = -2s + 2c - 10 for s. 1 Solve 2p - 2n = -18, -41p + 46p + 33 = 2n for p. -5 Solve 0 = o - n - 4, 3n = -21o + 26o - 16 for o. 2 Solve 12 = 3d + 4j, -16 + 4 = 2d - 4j for d. 0 Solve -d + 0y - 2y = 0, 4y - 4 = 0 for d. -2 Solve -2v + 8 = 3z + 1, 5z - 2v = -15 for z. -1 Solve 0 = 4s - 5h + 24, -4s - 5h = -2s - 18 for s. -1 Solve 5g + 8 - 7 = 3x, 7x = -3g - 27 for x. -3 Solve 9 = 2d - v, 4d = v - 14 + 29 for d. 3 Solve 3d - 2 = v, -2v = -3v + d - 4 for v. -5 Solve -3u = -3s + 24, 3s - 8u + 9u = 0 for s. 2 Solve 12v + 55 = 23v - d, 0 = 3v + d - 15 for v. 5 Solve 2s + 9w - 6w + 8 = 0, -3w - 16 = -2s for s. 2 Solve -2a = -4r, -4a = 5r - a + 22 for r. -2 Solve -3n - 150 = 4q - 136, 0 = 5n + q - 5 for n. 2 Solve t + 11 + 11 = -5c, -2c - 2t = 12 for c. -4 Solve -5f - 7p = -2p + 40, -2f + 3p = -9 for f. -3 Solve -5x + 4n + 7 = 0, 4n - 6 + 16 = 2x for x. -1 Solve 3z - 11 = -2w, 2z + 4w + 24 = 26 for z. 5 Solve -25 = -b + 45f - 50f, 5b + 4f + 1 = 0 for b. -5 Solve 6 = 3b + 4n - 2, 2n = 3b + 4 for b. 0 Solve -2r + 2 = 0, -2p + 5r - 7 = -4p for p. 1 Solve -4a + 25 = -5k - 20, 0 = -3a - k + 10 for a. 5 Solve 5d - w - 6 = 4d, -w = 5d - 6 for d. 2 Solve 0 = -3p + 2u - 4, -5p + 4u + 0 = 4 for p. -4 Solve 3d - b - 20 = 0, -d = 3b - 4b - 10 for d. 5 Solve 2d = k, d + 2k - 4 = 1 for d. 1 Solve 4l - 6 = 14, 2i - 22 = -4l for i. 1 Solve 5v = 3i + 11, 0 = -2i + 2v - 5v + 18 for i. 3 Solve 0 = y + 3j + 11, 4y + 4 = -0y - 2j for y. 1 Solve -2l = 2v + 2, -2v - 3 + 5 = 3l for l. 4 Solve -94q + 11 = -91q + z, 0 = 3q + 5z + 5 for q. 5 Solve -t = p + 4, 0 = 10t - 7t - 5p - 28 for t. 1 Solve -3y + h = -4h - 5, -y = 3h - 11 for y. 5 Solve 3o - 5d - 22 = 0, -5o + 20 = 4d + 8 for o. 4 Solve l = 2t - 1, 0 = -l - 3t + 2t + 5 for l. 3 Solve 9m - 3n = 12m - 6, 4m = 4n for m. 1 Solve 5d = -5o, 2d = -2o + 6o - 12 for d. -2 Solve -3f - 25 = 2f, -2b - 1 = -f for b. -3 Solve 4 = 2q + 3h, -3q + 7 = 4h + 2 for q. -1 Solve -3i + 3w = -12, -18i + 21i - 5w = 12 for i. 4 Solve -4c = j + 24, 27c = 30c - 5j - 5 for c. -5 Solve -2l - 3c - 17 = 0, 8 = -l - 3c - 8 for l. -1 Solve -4o + 6s = 2, 20o - 16o - 5s + 3 = 0 for o. -2 Solve c - 3b = -c - 1, -b = -c for c. 1 Solve -4a - 16 = 0, -5a = 4o + o + 20 for o. 0 Solve 4k + y + 30 = -y, 4k + y + 25 = 0 for k. -5 Solve -5n + 5d = -6 + 1, -2n = -d - 1 for n. 0 Solve 0 = 4g - x + 5, 2g + 2x = -g - 12 for g. -2 Solve 3p + 21 = 2v, 0 = 4v + 27p - 28p - 7 for v. 0 Solve -4l + 12 = 0, x - 18 = -0x - 5l for x. 3 Solve 6z = 2z + 4g, -5g = z + 12 for z. -2 Solve 6j = 11j + 5v - 25, 3j = -4v + 16 for j. 4 Solve 11s = -3f + 13s + 15, 3s = 0 for f. 5 Solve 0y = -5o + 3y + 35, 4o - 3y = 31 for o. 4 Solve 2a - 8a - 3j = -27, 2a - 5 = 3j for a. 4 Solve 0 = 4a - 2h - 20, 4a - 18h = -14h + 28 for a. 3 Solve r - 10 = -5n, -r - 12n - 2 = -11n for r. -5 Solve -2s + 0 = -y - 2, 4y = 4s + 4 for y. 4 Solve 4m - o = 3o + 8, -5o + 6 = -m for m. 4 Solve 1 + 4 = u + 2h, -4h = -12 for u. -1 Solve -3x = m - 13, 4m - 2 = -4x + 26 for m. 4 Solve -3l - 40 = -3j - 31, -5l - 25 = 5j for j. -1 Solve -1 = 5a - 51g + 48g, 0 = a - 2g - 4 for a. -2 Solve 5o - 3 = -k + 8, 5o + 1 = -4k for o. 3 Solve 2p + 28g - 27g = 3, 2g - 15 = 5p for p. -1 Solve z + s = -1 + 7, 2s + 12 = 4z for z. 4 Solve 3o = 2x + 5, -4o = -x - 7o - 7 for x. -4 Solve -3u = -2p + 9, 2p - 6 = -5u - 5 for u. -1 Solve -c - 5d = -6, -3c + 2 = -2c + d for c. 1 Solve l = -4k + 2l + 1, 30 = -5k - 5l for k. -1 Solve 0y - 3y = -4f + 1, -5y = -2f + 11 for y. -3 Solve q = -3x, -3x - 2x = -5q for q. 0 Solve 5v = 3b + 10, -5b = -v + 9 - 29 for b. 5 Solve 29 = 4n + 3s, 4n + 4 = 3n + 3s for n. 5 Solve 5b + 15 = 5x, 6x = 2x + b + 12 for x. 3 Solve 0 = 5y - 2k + 14 - 34, -5y + 5 = k for y. 2 Solve q + 2d - 1 = 0, 3q + 3d = 8d + 3 for q. 1 Solve 2d + 1 = -5z - 18, -3z = d + 12 for z. -5 Solve -4f + m + 4 = 0, -3f = 2f - 5m + 10 for f. 2 Solve -4o + 15j - 16 = 13j, 2o = -3j - 16 for o. -5 Solve 0 = -2m - 4p - 6, -28 = -3p - 25 for m. -5 Solve -5y = 4t - 9 + 4, -t - 2y = 1 for t. 5 Solve 3m - 8 = 5w, -7w = -3m - 12w + 28 for m. 6 Solve 5q - 4w + 10 = 7q, 5q = -3w - 10 for q. -5 Solve 3l + 2w - 15 = -2w, l - 5w - 5 = 0 for l. 5 Solve 3f + 21 = -3i, 3i = -2i - 15 for f. -4 Solve -4l + 1 = -4b - 3, -4l = -3b - 7 for l. 4 Solve 0 = n - 13v + 16v + 3, -5n = v + 15 for n. -3 Solve -28 = 4l - n - n, -n = -4l - 24 for l. -5 Solve p + 40x - 45x + 9 = 0, -2p + 18 = 2x for p. 6 Solve -4g = q - 13 - 10, 2g - 4 = 2q for q. 3 Solve 29n + 2b + 10 = 31n, -2n - 3b = 0 for n. 3 Solve -z + 26 = -5r, r - 6z = -2z - 9 for r. -5 Solve 45y - 42y = 4s - 5, -3y + 20 = s for y. 5 Solve -3k + 8 = -2s - k, 4k = 5s + 21 for s. -5 Solve -2f - 26 = 4y, 0 = -9y + 13y + 20 for f. -3 Solve -1 = -5d - 5p + 9, 5d + p + 10 = 0 for d. -3 Solve 0h - 2u + 8 = -h, 16 = -3h + 4u for h. 0 Solve 2v - 6r + 10r = -12, -1 = v + r for v. 4 Solve -6 = 3j, 3t = t - j + 4 for t. 3 Solve 8g - 4u + 8 = 0, -2g + 4u + 12 = -4g for g. -2 Solve -5v + 3b = -0b + 6, 4b + 24 = -4v for v. -3 Solve -2o = 2v + 2o + 14, 0 = 3v + 2o + 13 for v. -3 Solve -12 = -2k + c, -4k + 10 + 26 = -5c for k. 4 Solve 5a = 3g, 411g + 34 = 416g + 3a for g. 5 Solve q + 18 = 5j, -4q + q = -4j + 10 for q. 2 Solve 12 = 4k, 5j - 4k + 14 + 8 = 0 for j. -2 Solve 0 = 2w - 2t - 4, -8t + 2 = 2w - 11t for w. 4 Solve 3w - 5 = -4p, -4w - 6p + 7 = -p for w. 3 Solve -5u + 15 = 3h, 4u + 8h - 12 = 13h for u. 3 Solve 5l = -4x + 9, 2x = 7x - 5l for x. 1 Solve 71l - 66l - 22 = 4x, 4 = 5l + 2x for l. 2 Solve -25 = 4w + 5p, -1 = -81p + 82p for w. -5 Solve -4f + 134k = 138k - 4, 3 = 3f - k for f. 1 Solve -y = -3m + 10, 2 = -y + 4 for m. 4 Solve 5 = -x + 4t, 2x - 2t + 19 = 21 for x. 3 Solve -5c - 4d - 8 - 18 = 0, -2c - 3d - 16 = 0 for c. -2 Solve -2p - 10 = -5k + 5, 5k = 3p + 10 for k. 5 Solve -3i - 5 + 2 = 5v, -5i - 5 = -4v for v. 0 Solve -x + 3w + 12 = 0, -2x + w + 18 = 3x for x. 3 Solve -2v - 8 = -2n, -5v = -n - n + 14 for v. -2 Solve -2q + 2o - 10 = 4o, 2q - 2o = 2 for q. -2 Solve 3b - 21 = -3r, 10 - 6 = b for r. 3 Solve 2f = 3r - 4r - 3, 5r + 5f - 5 = 0 for r. 5 Solve -4z = -5o + 4 - 2, -4o + 8 = 0 for z. 2 Solve -j - 5 = -4r + 4, -3r = 4j - 21 for r. 3 Solve 0 = -4r - 2n + 12, -47r + 48r + n = 5 for r. 1 Solve 4w + 6g = 2g - 20, 4g = -12 for w. -2 Solve -j = -5s + 15, 5s - 9s = 5j - 41 for	{ "pile_set_name": "DM Mathematics" }
se 8, what is 1 + -5072? -5071 In base 15, what is 5a - -6? 61 In base 16, what is -b - -78? 6d In base 10, what is -69 - -34? -35 In base 15, what is -5 + -3dd? -3e3 In base 16, what is 35b - 0? 35b In base 11, what is 37 - -28? 64 In base 7, what is -3 + 550? 544 In base 3, what is 11121 - 100? 11021 In base 9, what is 8 + -60? -51 In base 3, what is -1221111 + -2? -1221120 In base 13, what is 1 + 2b? 2c In base 9, what is 3880 - 3? 3876 In base 4, what is 102 + -201? -33 In base 14, what is 7446 + -5? 7441 In base 4, what is 3 + 22? 31 In base 15, what is 96 + c? a3 In base 9, what is 3 - 765? -762 In base 16, what is 888 - 4? 884 In base 2, what is 0 - -100001110110? 100001110110 In base 2, what is -11111001100 - 11? -11111001111 In base 11, what is 1295 - -1? 1296 In base 3, what is 210 - 121? 12 In base 16, what is 12 + -f? 3 In base 8, what is -107 + 4? -103 In base 10, what is -5 + 230? 225 In base 15, what is -5 + -4cd? -4d3 In base 4, what is -10 - -22021? 22011 In base 2, what is -1000101100001111 + -10? -1000101100010001 In base 2, what is 1101011 + 101001? 10010100 In base 6, what is -2 - 54? -100 In base 6, what is 12 - 450? -434 In base 8, what is 62 + 324? 406 In base 13, what is 4276 - -4? 427a In base 3, what is 1000222 + 2? 1001001 In base 6, what is 3 + 11? 14 In base 11, what is 1 - 649? -648 In base 14, what is -1346 + -3? -1349 In base 11, what is -4 - -17? 13 In base 6, what is -35232 - 2? -35234 In base 2, what is 111 + -10010001? -10001010 In base 16, what is 6 + -2? 4 In base 11, what is 127 + 12? 139 In base 11, what is 3 + 45? 48 In base 7, what is -5 - -101? 63 In base 7, what is -6 + 53? 44 In base 7, what is 1 + -6? -5 In base 8, what is 34 + -447? -413 In base 5, what is -30320 - -2? -30313 In base 11, what is 3 - -164? 167 In base 3, what is -1002 + 21? -211 In base 15, what is -2d5 + 3? -2d2 In base 6, what is 5 - -120? 125 In base 8, what is -1361 - -4? -1355 In base 10, what is 5 - 184? -179 In base 11, what is 858 + 2? 85a In base 15, what is -20e + -3? -212 In base 14, what is 4 + 33? 37 In base 10, what is 1 - 12? -11 In base 2, what is 0 - -1000010001? 1000010001 In base 13, what is -57 - 3? -5a In base 9, what is 10352 - 4? 10347 In base 12, what is 24 - 3? 21 In base 8, what is -13 + -155? -170 In base 7, what is -1152 + 3? -1146 In base 2, what is 11110 + -111000? -11010 In base 2, what is 1101 + 10100? 100001 In base 5, what is 43 - 21? 22 In base 3, what is 1101 + 11001? 12102 In base 3, what is -2220121 + -10? -2220201 In base 15, what is 5 - 7b? -76 In base 11, what is -199 + -38? -226 In base 11, what is -1 - 44? -45 In base 10, what is -10573 + 0? -10573 In base 16, what is -10 + -32? -42 In base 11, what is -1959 - -1? -1958 In base 16, what is 2 + -7? -5 In base 5, what is 22 + -144? -122 In base 4, what is -10 - 330? -1000 In base 7, what is -101246 - -3? -101243 In base 9, what is 5 - 84? -78 In base 16, what is -2 - 66? -68 In base 10, what is -8 - -103? 95 In base 14, what is 32 + 0? 32 In base 5, what is 1121 + -11? 1110 In base 12, what is -19 - 38b? -3a8 In base 4, what is 3 + 31? 100 In base 5, what is -4 - -41? 32 In base 3, what is -1102210 - 10? -1102220 In base 9, what is 7 - 215? -207 In base 7, what is -2 - -5? 3 In base 2, what is 11 + -10111? -10100 In base 2, what is 0 - 10111010101? -10111010101 In base 15, what is 2e + 3? 32 In base 14, what is -251d + 4? -2519 In base 8, what is 6 + 35? 43 In base 12, what is 4 + 377? 37b In base 9, what is -6 - -10? 3 In base 11, what is -1a - -14? -6 In base 9, what is -104 - -4? -100 In base 9, what is 4 + 133? 137 In base 14, what is 6 + 1d? 25 In base 12, what is 3 - -3b? 42 In base 15, what is 5e47 + -1? 5e46 In base 9, what is 668 - -1? 670 In base 16, what is -314 - -1? -313 In base 10, what is -2 - -40? 38 In base 9, what is -33 - -4? -28 In base 13, what is ba + -2? b8 In base 7, what is 2 + -603? -601 In base 15, what is 45 - 16? 2e In base 2, what is 100 - -101100? 110000 In base 9, what is -76 + 5? -71 In base 11, what is 1 - a5? -a4 In base 15, what is 814 - -3? 817 In base 15, what is -a + -e? -19 In base 11, what is -1 + -138? -139 In base 14, what is -3 + 9? 6 In base 6, what is -212 - -3? -205 In base 4, what is 3 - 200313? -200310 In base 11, what is -a6 + 30? -76 In base 9, what is -37 - 102? -140 In base 9, what is 203 - 263? -60 In base 12, what is -370 - 1? -371 In base 6, what is -312 + 31? -241 In base 12, what is 9 - -5? 12 In base 8, what is -12 + 1054? 1042 In base 14, what is -3 - 13a? -13d In base 7, what is -23 + -115? -141 In base 15, what is e + -187? -178 In base 2, what is -1000011 + 100? -111111 In base 15, what is 5a40 + 5? 5a45 In base 9, what is 51 + -1? 50 In base 15, what is 604 + 0? 604 In base 7, what is 5 - 26? -21 In base 16, what is -3 - -6? 3 In base 6, what is 5355 - -3? 5402 In base 3, what is 1000 + -100? 200 In base 7, what is -256 - -3? -253 In base 13, what is 3 - 74b? -748 In base 9, what is -283 + -20? -313 In base 15, what is -1 - -13c? 13b In base 4, what is -33 + 10312? 10213 In base 5, what is 10 + -10213? -10203 In base 10, what is 3 + 16? 19 In base 8, what is 5 - 120? -113 In base 12, what is 3 + 164? 167 In base 12, what is -23 + 4? -1b In base 7, what is 1013 - 5? 1005 In base 8, what is -5 - -771? 764 In base 9, what is 1 - 761? -760 In base 12, what is -13 - 236? -249 In base 16, what is c + 0? c In base 4, what is -3 + 1120? 1111 In base 8, what is -1111 - 0? -1111 In base 6, what is 1 + -2? -1 In base 2, what is -110010 + -101? -110111 In base 2, what is 1010 + -1010011100? -1010010010 In base 5, what is -4302 - 3? -4310 In base 11, what is -3795 + -3? -3798 In base 9, what is -2 + -12? -14 In base 8, what is 23 - -351? 374 In base 7, what is 556 + -5? 551 In base 15, what is a9 + -5? a4 In base 16, what is -3 - 52? -55 In base 9, what is 7 - 80? -72 In base 14, what is 9c - -31? cd In base 13, what is 853 + 3? 856 In base 12, what is -1 + -38b? -390 In base 10, what is 44 - 212? -168 In base 11, what is -1085 - 2? -1087 In base 11, what is 6 - 285a? -2854 In base 15, what is -10d - -3? -10a In base 5, what is -330 + 1? -324 In base 16, what is 4 + fe? 102 In base 13, what is 171 + -25? 149 In base 9, what is -20 - -4? -15 In base 15, what is 12 + 3? 15 In base 10, what is 1 + -23? -22 In base 10, what is 1 - -65? 66 In base 5, what is 34 - 33? 1 In base 4, what is 201 + 3011? 3212 In base 16, what is 4 + 3c3? 3c7 In base 11, what is -1 - -31? 30 In base 11, what is 10a + 5? 114 In base 4, what is 2 + -1011320? -1011312 In base 2, what is 101 + 1010101010? 1010101111 In base 9, what is -3 - -16? 13 In base 2, what is 100000010010 - -101? 100000010111 In base 13, what is 3 + -1c7? -1c4 In base 14, what is -14 + -14b? -161 In base 16, what is -301 + -3? -304 In base 4, what is 0 + 1322? 1322 In base 16, what is 26 - 4? 22 In base 7, what is 4223 - -5? 4231 In base 13, what is b7 + -50? 67 In base 10, what is -4 + -11? -15 In base 7, what is 4214 - -5? 4222 In base 10, what is -4 + -32? -36 In base 11, what is 8 + 163? 170 In base 3, what is -12 + -212200? -212212 In base 12, what is -2 + 445? 443 In base 8, what is 0 + 267? 267 In base 8, what is -717 - 3? -722 In base 6, what is 303 - 5? 254 In base 10, what is -2 - 16? -18 In base 5, what is -33 - -34? 1 In base 14, what is -41 - -4a? 9 In base 5, what is -341 - -3? -333 In base 5, what is -11 + 3040? 3024 In base 2, what is -11 + 1010011101? 1010011010 In base 14, what is 197 + 3? 19a In base 7, what is 63 + -301? -205 In base 4, what is 310 - 1? 303 In base 13, what is 9c - 1? 9b In base 9, what is -16 - -3? -13 In base 16, what is -a - -7? -3 In base 11, what is -23a + 4? -236 In base 4, what is 10 + -1311? -1301 In base 6, what is -212 + -2? -214 In base 13, what is -9 - 2b? -37 In base 4, what is 110131 + 0? 110131 In base 13, what is 2 - -316? 318 In base 12, what is -24 - -649? 625 In base 2, what is 11110100111 + 100? 11110101011 In base 2, what is 10010 - 11? 1111 In base 13, what is 12 + 1c? 31 In base 9, what is 51 + -4? 46 In base 7, what is -5 - 326? -334 In base 11, what is 99 + 1? 9a In base 12, what is -146a - -4? -1466 In base 16, what is 2 - -226? 228 In base 12, what is 12 + 11? 23 In base 11, what	{ "pile_set_name": "DM Mathematics" }
+ -5715. Find the common denominator of -61/4 and l. 36 Let u = 133/12 - 43/12. Find the common denominator of 6/17 and u. 34 Let b = -82/7 - 123/14. Let v = 0 + 2. Calculate the common denominator of b and (v/12)/((-10)/174). 10 Suppose x + 4r = -3, 3x - 11 = -2r - 0r. Calculate the lowest common multiple of (-1)/62-18 and x. 30 Let a(x) = -3x + 59. Suppose 2i + 10 = i. Let d = i + 18. What is the smallest common multiple of d and a(17)? 8 What is the common denominator of 89/8 and ((-17)/8 - -2) + (-3870)/(-880)? 88 Suppose 10 = x + 1. What is the least common multiple of x and 27? 27 Let g(f) be the second derivative of f*4/6 - 7f3/6 - f2 - 3f. Let w be g(6). What is the common denominator of -11/18 and 2 + (-38)/w - 2? 126 Suppose 5 = -q - 1. Calculate the least common multiple of 2 and (-86)/q - (-1)/(-3). 14 Find the common denominator of 121/10 and 9((-33)/(-36) - 0). 20 What is the least common multiple of 5 and 1/(-9) + 715/117? 30 Suppose -5w = -j - 5226, 7j - 4j + w = -15598. Let m = j + 26181/4. Let v = -1332 + m. What is the common denominator of v and -45/2? 4 Let p(s) = s2 - s - 4. Let v = 5 + -5. Let h be p(v). Calculate the common denominator of -83/2 and ((-1)/h)/((-49)/(-1260)). 14 Let q(i) = 28i3 + i2 - i. Let a be q(1). Suppose -5w + 15 = 0, 0w = -p - 2w - 6. Calculate the smallest common multiple of 6 and a/(-6)18/p. 42 Let j be (-2)/8 + 516/16. Let a = 46 - j. Calculate the smallest common multiple of (11 + -13)/((-2)/8) and a. 56 Let r(m) = 0m - 4m + 0m + m3 - m2 - 1. Let u be r(3). Suppose -3w - 64 = -un, w - 4w = 5n - 46. What is the smallest common multiple of 7 and n? 77 Suppose -5m + 39 + 16 = -5t, -2m + 31 = -3t. Let i(q) = -27q + 39q - q2 - 22q - 7. Calculate the lowest common multiple of i(t) and 10. 10 Let k(s) = 4s2 - 4s - 4. Calculate the lowest common multiple of 18 and k(3). 180 Let t = 112 + -110. Suppose 24 = -4v + 68. Calculate the least common multiple of v and t. 22 Let c = -8 - -12. Let s = -3 - -4. Suppose -p = -5o - 11, -p - co + 3 = s. What is the smallest common multiple of p and 3? 6 Let b be ((-96)/(-28) + -3)7. Suppose -4r = -2w - 30, -br + 7r - 5w = 33. Calculate the least common multiple of 6 and r. 42 Find the common denominator of 4/18 + 546/108 and 16/33. 198 Let o(z) = -z2 - 9z - 5. Let u be o(-7). Calculate the common denominator of ((-1)/u)/((-6)/639) and 47/2. 6 Let i be (1873/(-57))/(-2 - -3). Let y = i + 381/38. What is the common denominator of y and (17/(-18))/(-1) - 0? 18 Let o = 4 - -3. Let w = -4 - -8. Suppose 2a - 3a + w = 0. What is the least common multiple of o and a? 28 Let n = -106571336/89133 + 87420/73. Let b = n + -8/111. Find the common denominator of -137/6 and b. 66 Let l(t) = t*2 + 2t + 7. What is the smallest common multiple of l(-3) and 6? 30 Let u(y) = y + 0y2 + 0y + 4y2 + 1. Let g be u(-2). Let s = g - 6. Calculate the smallest common multiple of 1 and s. 9 Let x(c) = c2 - 3c + 1. Let p(l) = l + 20 + 9l + 10l2 - l3 - 6. Calculate the lowest common multiple of x(5) and p(11). 33 Let l = 2299/116 + 27/29. Calculate the common denominator of l and ((-4)/6)/(18/(-192)). 36 Let p = -2/409 + 61795/7362. Find the common denominator of p and 53/9. 18 Suppose 18 = 4f - 62. Let a be (0 - 2)/(-1 - 0). Let x = a + 4. What is the smallest common multiple of x and f? 60 Find the common denominator of 95/8 and 5/(-4) - -1 - 110/(-16). 8 Let l(p) be the second derivative of p5/20 - 5p4/12 - p3/2 - p*2 - p. Let n be l(4). Calculate the common denominator of ((-20)/24)/(22/n) and 145/6. 66 Suppose -u - 2 = -3m, 3m - 2 = -u + 4m. Calculate the least common multiple of 17 and u. 68 Let o = 1/202495 + -3704241041/1214970. Let k = -3059 - o. What is the common denominator of -63/4 and k? 12 Let k(t) be the second derivative of 5/6t3 - 3t*2 + 0 + 2t. Calculate the lowest common multiple of k(4) and 20. 140 Suppose 0 = 3c + 6c - 72. Suppose -m = 5n - n - 36, 0 = 4m - 16. What is the lowest common multiple of c and n? 8 What is the common denominator of (0 - 1) + (-60)/(-14) and 11/10? 70 Suppose -3i = 5h + 27 + 17, -i - 24 = 4h. Let s be (i/(-12))/((-3)/9). Let j = 22 + s. Calculate the smallest common multiple of 4 and j. 20 Let u(p) = p3 - 4p*2 + 5p - 4. Let r be u(4). Let a(g) = -6g2 - 4g - 2. Let t be a(-2). What is the common denominator of 4/6 + r/t and -51/5? 45 Let n = -1 - -59. Calculate the lowest common multiple of 6 and n. 174 Let h = 1083/2 - 8603/16. Let k = 200705/18 - 11142. Calculate the common denominator of h and k. 144 Calculate the lowest common multiple of 25 and -6(-2)/48 + (-22)/(-8). 75 Let m be (-16)/40 + (-105007)/16920. Let x = 8/423 - m. Find the common denominator of x and -79/10. 40 Suppose -86 + 31 = -5a. Calculate the least common multiple of 3 and a. 33 Let q be 32793/10 - (-1 - 1). Let v = -3272 + q. Let l = 3581/222 + 26/37. What is the common denominator of l and v? 30 Let v be 1 + (-8139)/(-6) + 1. Let j = v + -1402. What is the common denominator of 11/(-12) + 0 + -1 and j? 12 Suppose -4m = 2g - 2340, 7m = 3m - 4g + 2336. Let z = -11713/20 + m. Calculate the common denominator of 23/4 and z. 20 Let a = 1903 - 41881/22. Let b = -2477/876 - -30/73. What is the common denominator of a and b? 132 Let k be 15/(-6) + (-3)/(-2). Let p be -3 + 2 + (k - -2). Calculate the common denominator of 73/6 and p/(-6) + (-2)/(-9). 18 Let o(t) = 2t*2 + t - 2. Let q be o(-2). Suppose qa = w + 8, 2a - 4 = -3w - 2w. Calculate the least common multiple of 9/3(-12)/(-18) and a. 2 Find the common denominator of (-30 + 3)3/6 and 97/2. 2 Let y(l) = -4l + 4. Let r(d) = -2d + 6. Let x be r(5). Let f be y(x). Suppose -v = v - f. Calculate the least common multiple of 11 and v. 110 Suppose 4a - 2d + 32 = -32, -d = 0. Let x = a - -22. Suppose xv - 4 = 2v. What is the least common multiple of 2 and v? 2 Let d(h) = -2h*3 - 9h*2 + 14h + 7. Let b be d(-9). Let v = -1173/2 + b. What is the common denominator of v and 1 + 0 - 38/44? 22 Let v = -1 - -2. What is the lowest common multiple of 11 and v? 11 Suppose -4p = 3y + p - 45, -3p + 19 = y. Calculate the common denominator of y(24/33)/(-4) and -3/2. 22 Suppose -9 = -8q + 7q. What is the smallest common multiple of 30 and q? 90 Suppose 7b + 12 = 9b. Let n(j) = j*2 - 5j - 10. Calculate the lowest common multiple of b and n(7). 12 Let s = 9341/2013 - 34/183. What is the common denominator of 37/8 and s? 88 Let a be 1487826/(-3928)5/(-150). Let d = -2/2455 + a. What is the common denominator of 3/28 and d? 56 Suppose -67 = -5o + 83. Suppose 5y + 0y = o. What is the lowest common multiple of 18 and y? 18 Suppose 8n - 3n = -490. What is the lowest common multiple of n/(-6) - 2/6 and (5/4)/((-13)/(-208))? 80 Let x = -37663/90 + 2096/5. Let g = -2/75 - 3071/150. What is the common denominator of x and g? 18 Let l = -349 + 354. What is the least common multiple of (-2)/(-3) + 25/3 and l? 45 Let r = 1441 - 4835/3. Let j = r - -751/6. Find the common denominator of j and 11/16. 16 Suppose -z - 9 = -4z. Suppose 4p - 3p - 10 = o, -p = zo - 2. Calculate the smallest common multiple of p and 7. 56 Suppose -2q + 1 + 3 = 4f, -5f = -2q + 13. Let s(m) be the first derivative of 2m2 - 4m + 1. Calculate the smallest common multiple of 22 and s(q). 132 Let z = -2740 + 1396. Let m = z - -3985/3. What is the common denominator of m and -97/6? 6 Let o(v) = -1 - 10v + 9 - v2 + 3v*2. Let w = -4 + 16. Calculate the smallest common multiple of o(6) and w. 60 Suppose 0 = 3o - 0o - 4y - 14, 0 = o - 4y + 6. What is the lowest common multiple of 4 and o? 20 What is the least common multiple of 18 and 31/4 - (-6)/24? 72 Let k(v) = -v3 + 2v*2 - 2. Let g be k(2). Let b be (g/68013)/(2/336246). Let a = b - 3/5038. Calculate the common denominator of a and -119/12. 36 Let i = 45259/12 - 3780. Calculate the common denominator of -43/18 and i. 36 Let u = 39577/360 + -2675/24. Let v be ((-1)/(-15))/((-18)/(-75)). Let o = v - u. What is the common denominator of o and -91/4? 20 Suppose -38 = -0u - 2u. Suppose -5 = -b, 2s - u = s - 3*b. Calculate the lowest common multiple of s and 4	{ "pile_set_name": "DM Mathematics" }
6p Collect the terms in -7g*2 + 11g*2 + 2g*2 + 3g + 0g2 - 5g2. g2 + 3g Collect the terms in o3 - 2o*3 - 10o*3 + 13o*3. 2o*3 Collect the terms in -2h*3 + 10h - 24h + 7h + 7h. -2h*3 Collect the terms in -9u*3 - 3653u*2 + 3653u*2. -9u*3 Collect the terms in -4p*2 + 28 + 57 - 85. -4p*2 Collect the terms in 0 - 6r - 2 - 1. -6r - 3 Collect the terms in -8m*2 - 18m*2 + 28m*2. 2m*2 Collect the terms in -5a*2 + 17a*2 - 9a*2 - 5a*2. -2a*2 Collect the terms in 234b*3 + 223b*3 - 459b*3. -2b*3 Collect the terms in -285v*3 - 293v*3 + 565v*3. -13v*3 Collect the terms in 3d + 0d + 7d. 10d Collect the terms in 15y + 11y + 7y - 31y. 2y Collect the terms in -34z - 1751 + 1751 + 7z. -27z Collect the terms in 18736 - 18736 + 5x. 5x Collect the terms in 6g + g - 2g - 4g. g Collect the terms in -3 + 6 - i2 - 10 + 7. -i2 Collect the terms in -3q + 21q - q. 17q Collect the terms in -39j*2 - 38j*2 - 40j*2 + 148j*2 - 40j*2. -9j*2 Collect the terms in -529q*2 + 1041q*2 - 519q*2. -7q*2 Collect the terms in -7l*3 + 30l*3 - 18l*3. 5l*3 Collect the terms in -1 + 4 + 0 + q. q + 3 Collect the terms in 68s*2 - 137s*2 + 67s*2. -2s*2 Collect the terms in -8w*3 - 8w*3 + 21w*3 - 6w3. -w3 Collect the terms in -47w2 - 49w*2 - 38w*2 + 130w*2. -4w*2 Collect the terms in 7p - 8p2 - 7p + 52p2. 44p*2 Collect the terms in -18 - 3d*3 - 6d + 31 + 6d. -3d*3 + 13 Collect the terms in -2l - 5l + 8l + l. 2l Collect the terms in -2a*2 - 8a*2 - 3a*2. -13a*2 Collect the terms in 6m*2 - 26m*2 + 5m*2 + 10m*2. -5m*2 Collect the terms in -3b - 2b + 2b + b. -2b Collect the terms in -22741q + 11368q + 11374q. q Collect the terms in -224j + 1 + 662j - 1. 438j Collect the terms in 40i*2 + 20i - 37i2 - 20i. 3i2 Collect the terms in 1 + 3 + 1 - 2 - 7t. -7t + 3 Collect the terms in -2t - 39 - 6t + 39. -8t Collect the terms in -5n2 + 2n*2 + 0n*2 + 4n2. n2 Collect the terms in -5y3 + 27y*3 + 15y*3. 37y*3 Collect the terms in 63k - 32k - 34k. -3k Collect the terms in 3d - 33 - 3d + 2d*2. 2d*2 - 33 Collect the terms in -i + i + 21i*3 - 17i*3. 4i*3 Collect the terms in j + 5j - 12j. -6j Collect the terms in 24r - 40r + 46r. 30r Collect the terms in 6v2 + 132v + 2v2 - 132v. 8v2 Collect the terms in 2 - 123x*2 - 2 + 60x*2 + 54x*2. -9x*2 Collect the terms in 151p*3 - 90p*3 + 0 - 75p*3 + 0. -14p*3 Collect the terms in -15t*3 - 14t*3 + 32t*3. 3t*3 Collect the terms in 4m*2 + 7m2 + m2 - 3m2. 9m2 Collect the terms in 2208 + a2 - 1101 - 1107. a*2 Collect the terms in -180y + 102y - 6y. -84y Collect the terms in -39b*2 + 10b*2 + 11b*2 + 17b2. -b2 Collect the terms in -2o + o - 5o + 19o - 4o. 9o Collect the terms in 270268270v - 270268270v + v3. v3 Collect the terms in l3 + 26l - 26l - 4l*3. -3l*3 Collect the terms in -22v - 8 - 9 + 17. -22v Collect the terms in 54d*2 - 130d*2 + 40d*2 + 48d*2. 12d*2 Collect the terms in -455874y + y*2 + 455874y + 0y2. y2 Collect the terms in -5y*2 + 6y*3 + 5y*2 + 0y*2. 6y*3 Collect the terms in -10r*2 + 20r2 - r3 - 10r2. -r3 Collect the terms in 166i*2 - 166i*2 - 13i*3. -13i*3 Collect the terms in 118v*3 - 59v*3 - 60v3. -v3 Collect the terms in 109l2 - 105l*2 + l - 34l. 4l2 - 33l Collect the terms in 2t - 5t - 6t - 3t. -12t Collect the terms in -137s*2 - 6s + 6s. -137s*2 Collect the terms in -137 - 3b*2 + 6b*2 + 137. 3b*2 Collect the terms in 6n + 29 - 4n - 29. 2n Collect the terms in -6 + 7 + 10s - 7s - 63. 3s - 62 Collect the terms in -5 - 4 + 2g + 9. 2g Collect the terms in 0 + 2s*3 + 0 - 22s*2. 2s*3 - 22s*2 Collect the terms in 2q*3 - 2953q*2 + 2953q*2. 2q*3 Collect the terms in -19l*2 + 7l*2 + 6l*2. -6l*2 Collect the terms in -69o*3 - 70o*3 + 136o*3. -3o*3 Collect the terms in 327l - 661l + 333l. -l Collect the terms in -1 + 49i + 97i + 1. 146i Collect the terms in -3k + 3k + 14k. 14k Collect the terms in 5g*2 - 2g2 - g2 + 0g2 - 9g*3. -9g*3 + 2g*2 Collect the terms in -40c*3 - 43c3 + c2 + 3c2 - 2c*2. -83c*3 + 2c*2 Collect the terms in 211 - 39g*2 + 30g*2 - 211. -9g*2 Collect the terms in -119p + 3 + 70p - 3. -49p Collect the terms in 37f2 + 34f - 34f. 37f*2 Collect the terms in -4v + 76v3 + 4v - 3 + 1. 76v3 - 2 Collect the terms in 170i*2 - 39i*3 - 170i*2. -39i3 Collect the terms in 7 + n3 + 14 - 21. n*3 Collect the terms in 196a + 185a - 382a. -a Collect the terms in 0w3 - 7w*3 + 32w*3. 25w*3 Collect the terms in -389 + 389 - 14z. -14z Collect the terms in -8p*2 - 5p + 11p - 6p. -8p2 Collect the terms in 27g*3 - 16g*3 - 22g*3. -11g*3 Collect the terms in -7x*2 - 13x + 35x + 49x. -7x2 + 71x Collect the terms in -34x2 - 3 + 0 - 74x*2. -108x*2 - 3 Collect the terms in -117u*2 + 55u*2 + 2 + 56u*2 - 2. -6u*2 Collect the terms in -2r*2 - 269114r + 269114r. -2r*2 Collect the terms in -2k - 4142 + 4142. -2k Collect the terms in -18r + 27r3 + 36r - 18r. 27r*3 Collect the terms in t - 42t + 39t. -2t Collect the terms in 5k2 + 3k*2 + 13k*2 - 34k*2 + 10k*2. -3k*2 Collect the terms in -t - 3t + 4t - 13t*3. -13t*3 Collect the terms in 40l - 12l - 59l. -31l Collect the terms in 6v*3 + 8v*3 - 31v*3 + 9v*3. -8v*3 Collect the terms in 10s - 10s + 7s*2. 7s*2 Collect the terms in -25w*2 - 56 + 56. -25w*2 Collect the terms in 16 - 16 + 4s*3 - 6s*3. -2s*3 Collect the terms in 565818w + 11w2 - 565818w. 11w2 Collect the terms in 127q - 133q + 0 + 0. -6q Collect the terms in -2p - 3p + 3p - 10p. -12p Collect the terms in 3b + 547750 - 547750. 3b Collect the terms in -5c*3 - 189c + 106c + 83c. -5c3 Collect the terms in -195 + 4c + 96 + 99. 4c Collect the terms in 10h*3 + 55h*3 - 64h3. h3 Collect the terms in -49t + 1 + 327t + 252t. 530t + 1 Collect the terms in 0 - 59m3 - 44m*3 - 1. -103m*3 - 1 Collect the terms in -64v*3 + 2v - 2v - 44v*3. -108v*3 Collect the terms in -12g - 41g3 + 12g. -41g3 Collect the terms in 0 - 5d + 6 + 3 - 9. -5d Collect the terms in 149 - 70 - 79 + 4m. 4m Collect the terms in -41d - 31d + 106d - 33d. d Collect the terms in -19f - 32f - 13f - 2f. -66f Collect the terms in 112u - 112u - 3u3. -3u*3 Collect the terms in 8l*3 - 39l*3 + 13l*3 + 10l*3. -8l*3 Collect the terms in -29a*2 + 17a*2 + 17a*2. 5a*2 Collect the terms in -4j - 5j + 38j. 29j Collect the terms in 2u*2 - 2u*2 + 64u + u3. u3 + 64u Collect the terms in -2 + 2 - 34l. -34l Collect the terms in 5 - 5 - 6r + 7r + 0. r Collect the terms in -62m*2 - 66m*2 - 65m*2 + 189m*2. -4m*2 Collect the terms in 348n*2 - 43 - 173n*2 - 172n*2 + 43. 3n*2 Collect the terms in 4578b + 2b2 - 4578b. 2b2 Collect the terms in 3y*2 + 570y - 570y. 3y*2 Collect the terms in 3 + 16 - 16 - 3 - i. -i Collect the terms in 8k*3 + 418441k*2 - 418441k*2. 8k*3 Collect the terms in -2a - 2a3 + 46a + 0a - a3. -3a*3 + 44a Collect the terms in -w - 129w3 + w. -129w*3 Collect the terms in 6u - 10u + 7u. 3u Collect the terms in 21f*2 + 11f*2 + 13f*2 - 16f*2. 29f*2 Collect the terms in -1 + 5n*3 + 2n*3 - 2n3 - n3. 4n3 - 1 Collect the terms in -8a + 4 - 1 - 3. -8a Collect the terms in -2b + 13b - 4b - 5b. 2b Collect the terms in 15w3 - 59w + 59w. 15w*3 Collect the terms in -3048q - q*2 + 3q*3 + 3048q. 3q3 - q2 Collect the terms in -59 + 117a + 59. 117a Collect the terms in 0x*3 + 13x*2 - 13x*2 + 23x*3. 23x*3 Collect the terms in 77 - 77 - 5q. -5q Collect the terms in 10a*2 - 717 + 717. 10a*2 Collect the terms in 6 + 18 - 12 - 12 + 9d*2. 9d*2 Collect the terms in 9l*3 - 11l*3 + l - l. -2l*3 Collect the terms in 49p - 69p + 34p. 14*p Collect t	{ "pile_set_name": "DM Mathematics" }
j = 3b - 1347. What are the prime factors of b? 2, 3, 37 Let p be (-23)/7 - 4/(-14). Suppose 10 - 73 = -3g. Let b = p + g. List the prime factors of b. 2, 3 Let q(w) = w2 - 3w - 19. List the prime factors of q(16). 3, 7 Suppose -6 = 3v + 84. Let j be 18/15v/9. What are the prime factors of j - -1 - 216/(-9)? 3, 7 Let d be (0 - 0) + -78 + 3. Let x be d/(-10)(-2)/(-3). Suppose -3v + 5v + 4o = 74, 119 = 2v - xo. What are the prime factors of v? 47 Let u = 8 - 6. Suppose 0q = -uq + 12. Let r = 10 - q. What are the prime factors of r? 2 Let q(v) = v*2 - 3v - 3. Let o(b) = b. Let y be o(6). Let j be q(y). Suppose -4u + 0u + 2f + 100 = 0, u - j = 3f. What are the prime factors of u? 3 Let t = -53 + 53. Suppose f - 112 + 9 = t. What are the prime factors of f? 103 Let v(r) = 6r2 + r + 4. List the prime factors of v(6). 2, 113 Suppose 3179 + 1701 = 8o. What are the prime factors of o? 2, 5, 61 Let d = -149 + 330. List the prime factors of d. 181 Let q(y) = y*3 + 5y*2 - 3y - 10. Let b be q(-4). Let c = 52 - b. List the prime factors of c. 2, 17 Let z(r) = -r*2 + 10r - 21. Let w be z(4). Suppose 0 = 5q - wq - 174. List the prime factors of q. 3, 29 Let p(l) = 188l2 - 167l + 6. What are the prime factors of p(-4)? 2, 7, 263 Let p(i) = i + 21. Let a(k) = k*2 - 9k + 2. Let g be a(3). Let o be p(g). Suppose 2u + 8 = 0, -102 = -or + u + 237. What are the prime factors of r? 67 Let l = 48 + 71. List the prime factors of l. 7, 17 Suppose v - 5w = -44, -v - 2w = w + 44. Let c = v + 85. List the prime factors of c. 41 Let h(k) = 6k3 + k2 + k + 2. Let s = 3 + -1. Let x be h(s). Let u = -40 + x. What are the prime factors of u? 2 Suppose -3t - 2t = -5x - 30, 0 = -4x - 3t - 38. What are the prime factors of x/(-6)(-72)/(-2)? 2, 3 Let j(t) be the first derivative of 2t*2 - 9t + 1. What are the prime factors of j(4)? 7 Let i = -317 - -650. List the prime factors of i. 3, 37 Suppose 0 = -5j - 102 - 48. Let r = 37 + j. What are the prime factors of r? 7 Let v be 34/119 - (-108)/14. Suppose -10p + 16 = -vp. List the prime factors of p. 2 Suppose 8y = 9y + 2. List the prime factors of ((-25)/y - 1) + (-3)/2. 2, 5 Let p be 62 - 0(-2)/4. Let v = 26 - p. Let c = 59 + v. List the prime factors of c. 23 Let j(y) = 2y - 1. Let k be j(2). Suppose 0 = -3v + k + 15. What are the prime factors of 122/6 + 4/v? 3, 7 Let s = 12 - -4. Suppose 4q - s = -0q - 4k, k - 6 = -2q. List the prime factors of q. 2 Suppose 4v = 2l + 398, -v + 0v + 2l + 98 = 0. Suppose 4n + 3 = 23. Suppose 0u = nu - v. What are the prime factors of u? 2, 5 Let w = 35 - 23. List the prime factors of 1/(w/(-8))-63. 2, 3, 7 Let w = 18 - 9. Let l(o) = 6o - 4. What are the prime factors of l(w)? 2, 5 Suppose 6p = -0p + 24. Suppose 616 = 4f - pc, 5f + 3c - 1039 = -293. What are the prime factors of f? 151 Suppose -4n = 4x - 16, 3n = 5x - 2x. Suppose -19 = -3y - 10, -304 = -s + ny. What are the prime factors of s? 2, 5, 31 Suppose -3x = 15, -5x - 18 = -3v + 520. Suppose 6u + v = 9u. Suppose -5z + u = -93. List the prime factors of z. 2, 3, 5 Let z = 84 + -76. Suppose zf - 248 = -0f. List the prime factors of f. 31 Let t = 440 - -430. List the prime factors of t. 2, 3, 5, 29 Suppose 0 = -a + 3 + 1. Let o(m) = -5m + 57. Let f be o(10). Let j = a + f. List the prime factors of j. 11 Let d(i) = -i2 - i + 14. Let j be d(3). Let l be (-6)/(-4) + (-1)/(-2). Suppose 0 = -jn - ln + 84. List the prime factors of n. 3, 7 Let j be 4 - 48/3 - -2. Let b = -8 - j. Suppose -a - 6 = 2a, 5q + ba = 21. List the prime factors of q. 5 Let a = 764 - 292. List the prime factors of a. 2, 59 Let v = -113 + 189. What are the prime factors of (v/2)/(2 + (-20)/12)? 2, 3, 19 Let p = 4250 - 862. List the prime factors of p. 2, 7, 11 Let k be 6192/312 + 2/13. Suppose 10g = 5g - k, -280 = -4w + g. What are the prime factors of w? 3, 23 What are the prime factors of (-16)/3(3 - 594/12)? 2, 31 List the prime factors of (3 - 7)/(((-12)/2313)/2). 2, 3, 257 Let y = -10 - -10. Suppose y = -2j + j - 1. What are the prime factors of 20 + 2/j + -2? 2 List the prime factors of 42760/44 + 285/55 + -5. 2, 3 Suppose -15n + 919 = -1856. Suppose g + n = 5t - 1076, 20 = 5g. What are the prime factors of t? 11, 23 Let k = 47 - 33. Let g = -15 + -5. What are the prime factors of 60/k + g/70? 2 Suppose 0 = 30i - 40i + 5070. List the prime factors of i. 3, 13 Let i(n) = -2n - 19 - 1 - n - n. Let x(r) = r + 7. Let z(l) = 3i(l) + 8x(l). List the prime factors of z(-9). 2 Suppose 0 = -8z + 50z - 92736. List the prime factors of z. 2, 3, 23 Suppose -g - 5o - 3 + 5 = 0, 5g - 10 = -4o. What are the prime factors of g + (-526)/(-10) - 9/15? 2, 3 Let f(q) = q + 8. Let j be f(-5). Let g(i) = -i*3 - 5i*2 - i - 1. Let x be g(-5). Suppose 16 = xu + b, -u = b + b + j. List the prime factors of u. 5 Suppose 0 = 93x - 54x - 113451. List the prime factors of x. 2909 What are the prime factors of (1 + 65)/((-6)/(-48))? 2, 3, 11 Let n = -5 + 10. Let z(y) = -ny2 + y - 3y*3 + 5 + 2y*3 - 10. What are the prime factors of z(-6)? 5 Let z(s) = 4s - 13. Let g be z(-4). Let j = 59 - g. What are the prime factors of j? 2, 11 Let z(q) = -q*2 + 3q. Let n be z(2). Suppose ng + 11 = -23. Let d = g - -34. List the prime factors of d. 17 Suppose 0x + 282 = 3x - 3o, 4o + 285 = 3x. List the prime factors of x. 7, 13 Let q(b) be the first derivative of b*4/4 - 2b*3 + 8b + 4. Let g be q(6). Let n = g + 19. List the prime factors of n. 3 Let g = 60 + -33. What are the prime factors of g - ((1 - -2) + -2)? 2, 13 Let k be -17 + 1 + 2 + -2. List the prime factors of 14(4/k6 - -3). 3, 7 Let s(z) = 324z2 + 2z + 1. What are the prime factors of s(-1)? 17, 19 Suppose -3n - 4p = -14182, -n = 2n + 3p - 14178. What are the prime factors of n? 2, 3, 787 Let r(t) = -t*3 - 5t*2 + 7t + 6. Let o be r(-6). Suppose o = 3l - 8l - 5. List the prime factors of l/1 - (-20 + 0). 19 Let p(u) be the first derivative of -u*4/4 + 10u*3/3 + 7u*2 - 17u + 6. List the prime factors of p(11). 2 Let n(k) be the second derivative of 5k3/6 + k2/2 - 2k. Let u be 5(-3)/(-9)3. List the prime factors of n(u). 2, 13 Let m(k) = k*3 - 17k*2 + 26k - 60. What are the prime factors of m(22)? 2, 733 Let u = -114 + 267. What are the prime factors of u? 3, 17 Let j(x) = x + 4. Let k be j(-2). List the prime factors of (-9696)/(-120) - k/(-10). 3 Let p(r) = 3r2 + r + 9. Let y be p(5). Let u = y + -39. List the prime factors of u. 2, 5 Suppose -n + 6 = 4w - 27, 50 = 5w + 3n. Suppose -15v + 296 = -wv. List the prime factors of v. 37 Let v be (40/18 - 2) + 318/27. What are the prime factors of ((-188)/3)/((-8)/v)? 2, 47 Let r(w) = -w + 1. Let l(g) = -7g - 6. Let u(n) = -7n - 7. Let o(z) = -6l(z) + 5u(z). Let s(y) = -o(y) - 2r(y). What are the prime factors of s(-3)? 2, 3 Let c(o) = 8o*2 + 20o - 120. List the prime factors of c(10). 2, 5, 11 Let n(w) = w + 5. Let g be n(0). Suppose 0 = -0s - gs + 30. Suppose 0 = -h + 15 + s. What are the prime factors of h? 3, 7 Suppose -3p = -4 - 2. Suppose -2t = -t - 2f - 33, -pt + f = -57. What are the prime factors of t? 3 Let l = 287 + 1017. What are the prime factors of (5/(-20)1)/((-2)/l)? 163 Let j(u) = 6u*2 - 4u + 35. What are the prime factors of j(-5)? 5, 41 What are the prime factors of 602691/395 + (-12)/(-10)? 3, 509 Suppose -4m = -98 - 98. Suppose -50w + 51w = m. What are the prime factors of w? 7 Let t = -8 - -9. Let k(n) = 14n3 + n2 - 1. List the prime factors of k(t). 2, 7 Suppose 0 = 3c + 5f - 4 - 6, 0 = 2c + f - 2. Suppose 4n - i = 684, 0 = -cn - 2n + 3i + 352. List the prime factors of n. 2, 5, 17 Suppose r + 2i = 3864, -3r = -i - 2904 - 8716. What are the prime factors of r? 2, 11 Let o be (-332)/(-3) + (-4)/(-3). Let z = 182 - o. List the prime factors of z. 2, 5, 7 Suppose -4 = -0d + d, w = 4d + 21. Suppose -3c = 3g + 3, 5c - 3c - wg - 26 = 0. Suppose -c = 3h + 3, 0 = -2o - 3h + 36. List the prime factors of o. 3, 7 List the prime factors of 7/35 - (-2894)/5. 3, 193 Let q(t) be the third derivative of -t6/240 + t5/60 - 7t*4/24 - 2t**2. Let y(g) be the secon	{ "pile_set_name": "DM Mathematics" }
027 Suppose -5m = -3m - 40. Suppose -4z - z + m = 0. Suppose -3400 = -zn + 2n. Round n to the nearest one thousand. 2000 Let s = 15 + -15.0013. Round s to four decimal places. -0.0013 Let b be (134/6)/(1/9). Suppose s - b = 4s. Round s to the nearest ten. -70 Let g(d) = -86987d2 - 2d + 2. Let n be g(2). Let l = n - -587960. Suppose i + l = 4i - 5h, -5h = -i + 80010. Round i to the nearest 10000. 80000 Let t = 55.1548 + 1.7492. Let b = t - -0.096. Let n = -57.0031 + b. Round n to 3 decimal places. -0.003 Let k(g) = -g3 - 7g*2 - 8g - 9. Let j be k(-6). Suppose 217292 = jc - 91708. What is c rounded to the nearest ten thousand? 100000 Let o be (-40)/6 + (-2)/(-3). Let f be 4/o - 22/3. Round f to the nearest 10. -10 Let k = 119281725.9 + -119361068.90056. Let s = -79340 - k. Let i = s - 3. Round i to 4 decimal places. 0.0006 Let f = 249745916.99999982 + -249745920. Let v = -3 - f. What is v rounded to seven dps? 0.0000002 Let i(f) = f3 + f2 + 1. Let q(d) = -3d*2 - d - 3. Suppose 9 + 3 = 4c. Let k(o) = ci(o) + q(o). Let a be k(-1). Round a to the nearest ten. 0 Let m = 112015640952002.0000034 - 112015574499506. Let s = 66452502 - m. Let a = s - 6. Round a to 6 dps. -0.000003 Let k = -28341922.2999954 + 28341918. Let t = k - -4.3. What is t rounded to 6 dps? 0.000005 Let f = 278 - 278.1304. Round f to 2 dps. -0.13 Let a be ((-18)/(-27))/(2/(-6)). Let d be 30/(a/((-42400)/6)). Round d to the nearest 10000. 110000 Let v = -707 + 638.2. Let x = 76 + v. Round x to the nearest integer. 7 Suppose h + 3h = 89898224. Suppose 4u - h = 90325444. Suppose -2z + u = z. What is z rounded to the nearest one million? 9000000 Let v = 80 - 74.9. Let q = 5 - v. Let b = q - -0.1000003. What is b rounded to 6 decimal places? 0 Let g(q) = -63q3 + 11q*2 + 9q + 15. Let i be g(-7). What is i rounded to the nearest one thousand? 22000 Suppose 2m - 79992 = -2m. Suppose -k + m = -5u, 3u - k + 11992 = 3k. Round u to the nearest 1000. -4000 Suppose 3x + 0x - 12 = 0, -3m = -x + 34. Let i(o) = -234001o2 - 10o. Let r be i(m). What is r rounded to the nearest 1000000? -23000000 Suppose 107000 = -z + 6z. What is z rounded to the nearest 1000? 21000 Let q = -501 + 500.9733. Let r = q + 0.024. Round r to three dps. -0.003 Let v = 78.452758033 + 1.547249867. Let r = -80 + v. Round r to six dps. 0.000008 Let w = -1.5 - -0.5. Let n = -0.5348 - 0.4656. Let y = w - n. Round y to four decimal places. 0.0004 Let b = 0.485 - 0.5. Let v = 0.96 - 0.889. Let p = v - b. What is p rounded to two dps? 0.09 Let n(m) = 2563m*3 + 12m*2 - 7m + 9. Let q be n(9). Suppose -q = -5h + 330655. What is h rounded to the nearest 100000? 400000 Let f = 47793 - 47786.9998. Let a = 6 - f. Round a to three decimal places. 0 Let v = 0.08546 + 7.10054. Let l = v + -7.1. Let b = -6.714 - l. Round b to zero decimal places. -7 Let b be ((-50)/15)/(6/9). Let y(v) = -v + 72v*2 + 0v*2 - 5 + 48v*2. Let t be y(b). What is t rounded to the nearest 10000? 0 Suppose 2b + 3b + v = 1755000, -2v = -4b + 1404000. Round b to the nearest 10000. 350000 Suppose 5t = 3v - 1995000, -2v = -2t + 3t + 399000. What is t rounded to the nearest 10000? -400000 Let g = -127 + 126.99999844. What is g rounded to seven decimal places? -0.0000016 Let t = 223 + -223.0137. What is t rounded to 3 decimal places? -0.014 Let f = -137 - -136.99999965. Round f to 7 decimal places. -0.0000004 Let i(v) = -4v + 3. Let k be i(2). Let w(b) = -17b*2 + 7b. Let p be w(k). What is p rounded to the nearest 100? -500 Let f = 0.5 - 14.9. Round f to zero dps. -14 Let v(j) = -j - 3. Let d be v(-8). Suppose w = -6x + 4x + 138, 315 = dx - 5w. What is x rounded to the nearest 10? 70 Let n = -0.2047 - 0.0543. Round n to 2 decimal places. -0.26 Let q = 196 - 195.9999757. Round q to 6 dps. 0.000024 Suppose 4q = -2w - 0q + 3380012, 3379994 = 2w - 2q. Round w to the nearest one million. 2000000 Let a = -9529096453334 - -9529102568911.700039. Let j = -6115575 + a. Let b = -2.7 + j. Round b to 5 decimal places. 0.00004 Let n(l) = -3588l*3 - 4l*2 - 6l + 1. Let k be n(4). Let b = k - 36772. Let w = b + 726491. What is w rounded to the nearest one hundred thousand? 500000 Suppose 0 = -3s + 4b - b - 2249991, 3b = 2s + 1499991. Round s to the nearest 100000. -800000 Suppose -4w - 8 = 4s, 3s - 2w + 0 = -6. Let v be s/3 - 1085536/(-6). Let o = v + -98922. What is o rounded to the nearest ten thousand? 80000 Let o be -8750((2000 - -2) + -2). What is o rounded to the nearest 1000000? -18000000 Let f = -2137.51 + -20.49. Let a = 2260.1 + f. Let o = a - 107. What is o rounded to zero dps? -5 Let w = -109 + -21. What is w rounded to the nearest 100? -100 Suppose -760000 = -0o + 4o. What is o rounded to the nearest 100000? -200000 Let o = 291.9999722 - 292. What is o rounded to six dps? -0.000028 Suppose c + 0c + 6400000 = 0. What is c rounded to the nearest 1000000? -6000000 Let s = 0.7 - 0.70063. Round s to 4 decimal places. -0.0006 Let l = 0.107 - 0.772. Let v = -0.31 + l. Let x = 0.085 + v. Round x to one decimal place. -0.9 Let j be (-7)/28 - 52193/(-4). Suppose -5a = 131952 + j. Round a to the nearest ten thousand. -30000 Let y = 2.8 + -3. Let o = y + -28.8. Let n = o - -29.0055. What is n rounded to 3 dps? 0.006 Let p = 0.8 - 2. Let k = p - -1.19932. Round k to four decimal places. -0.0007 Let h = -2013 + 773. Round h to the nearest 100. -1200 Let i = 11 - 11. Suppose ik = -3k + 3y + 284988, 4y = 16. What is k rounded to the nearest ten thousand? 100000 Let f = -5 + 7. Let w = f - -3. Suppose 0 = wa + 541078 - 1291078. What is a rounded to the nearest 100000? 200000 Let l = -56 - -56.00000168. Round l to seven dps. 0.0000017 Let h = 17.9015 + -18.6. Let y = -0.7 - h. What is y rounded to 3 decimal places? -0.002 Let o = 23 - 24.7. Let a = 1.7003 + o. What is a rounded to four dps? 0.0003 Let y = -0.077 - 16.423. Round y to zero dps. -17 Let s = -6.3 - -6.2999928. Round s to 5 dps. -0.00001 Let x = 42 - 41.9999972. What is x rounded to 6 decimal places? 0.000003 Let i = -185 + 184.999999794. What is i rounded to 7 decimal places? -0.0000002 Let g be -6450((-2400)/(-9) - 0). What is g rounded to the nearest one hundred thousand? -1700000 Let t = 46.999982 + -47. Round t to 5 dps. -0.00002 Let n = 0.41 - 0.07. Let d = -0.3399915 + n. Round d to 6 dps. 0.000009 Let r = -0.1 - 2.9. Let m = -3.2 - r. Let o = m + 0.16. What is o rounded to one decimal place? 0 Let i(v) = -4179v*2 - 8v - 4. Let y be i(4). Round y to the nearest one thousand. -67000 Let d = 5 + -4. Let o = 1.04 - d. What is o rounded to one dp? 0 Suppose 4g + 5i - 2i = 32, -i + 4 = 0. Suppose -3x + 15 = -0, gz + 3x = 2300015. Round z to the nearest one hundred thousand. 500000 Let h = 0.0783 - 0.094. Round h to three dps. -0.016 Let f = -0.1794596 - -0.41045791. Let q = f - 0.231. Round q to 7 decimal places. -0.0000017 Let i = 3454.531 - 3456. Let m = -0.401 + i. Round m to one decimal place. -1.9 Let s = -109 + 200. Let a = 90.959 - s. Round a to 2 dps. -0.04 Let h = 18.650001011 + -18.65. What is h rounded to seven dps? 0.000001 Let g(m) = 45715m + 5. Let s be g(-7). What is s rounded to the nearest one hundred thousand? -300000 Let w = -1.59999975 - -1.6. What is w rounded to seven dps? 0.0000003 Let z(d) = d + 10. Let v be z(-7). Suppose 2x + 228 = -924. Let i be ((-5)/v)/(3/x). Round i to the nearest 100. 300 Let y = -0.7 + -0.1. Let u = -0.2 - y. Let v = u + -0.6000015. What is v rounded to 6 dps? -0.000002 Let x = 2.99 - 3. Let m = -0.4 - -0.44. Let q = x + m. What is q rounded to two decimal places? 0.03 Suppose 0 = -8r + 3r. Suppose rp = -3p - 1710000. What is p rounded to the nearest 100000? -600000 Let w = 3459060.1 + -3459059.45779452. Let l = 0.0422062 - w. Let f = l - -0.6. What is f rounded to seven dps? 0.0000007 Suppose 0 = -0h - 4h - 4. What is h rounded to one decimal place? -1 Let d = -0.045 + 116.045. Let r = 115.03 - d. What is r rounded to one decimal place? -1 Suppose 0 = 2*w + 266 - 90. Round w to the nearest 10. -90 Let k = -696.5175 + 706.5. Let z = k - 10. Round z to 3 decimal places. -0.018 Let t = -5.6011 - -5.476009. Let c = 3.5 - 3.375. Let d = c + t. Round d to five de	{ "pile_set_name": "DM Mathematics" }
-r = q. What is the units digit of u? 2 Suppose -b + 16 - 3 = 0. Let v = 18 - b. Let n(q) = -q*3 + 6q*2 + 6q + 4. What is the units digit of n(v)? 9 Suppose 11c - 12 = -4w + 7c, 0 = -5w - 4c + 12. Let f(k) = -2k*2 + 54. What is the tens digit of f(w)? 5 Let t(k) = 35k*3 + 3k*2 - k + 5. Let b(l) = 106l*3 + 9l*2 - l + 14. Let i(c) = 2b(c) - 7t(c). What is the hundreds digit of i(-3)? 8 Suppose -3d - 411 = -3m, -2m - 412 = 3d - 6m. Let h = -90 + -138. Let i = d - h. What is the units digit of i? 2 What is the units digit of 1322946/50 + -4 - (10 + (-2520)/250)? 5 Suppose l - 3 = -0. Let y be 24/16(-16)/(-6). Suppose 7m = 4p + ym - 811, 2m - 621 = -lp. What is the tens digit of p? 0 Suppose -l - 3415 = -5r, -896 - 1837 = -4r + l. Let w = 1328 - r. What is the hundreds digit of w? 6 Let c(a) = a3 - a2 + a - 4. Let l be c(2). Suppose -m = 2i - 71 - 90, lm = 4i + 322. Let g = 237 - m. What is the units digit of g? 6 Suppose 7i + 2i - 43361 = 18190. What is the hundreds digit of i? 8 What is the hundreds digit of (4(-1 - 36/(-40)))/(2/(-37970))? 5 Suppose -8i = -0i - 79784. What is the thousands digit of i? 9 Let c(y) = 2y3 - 2y*2 + 6. Let v be c(3). Suppose vq + 588 = 45q. What is the hundreds digit of q? 1 Let o(q) = 279q*2 + 35q + 1. Let k be o(6). Suppose 18w - k = 5927. What is the hundreds digit of w? 8 Suppose 3w = -4k + 120, 6k - 13 = 5k - 5w. Suppose 0 = 27q - kq + 7704. What is the hundreds digit of q? 2 Let z(u) be the first derivative of 4/3u3 + 16 - 25/2u*2 - 27u. What is the units digit of z(11)? 2 Suppose 0 = -4x - 4i - 185 + 553, 5i + 395 = 4x. Suppose 0 = -4c + x + 137. Let g = c + -25. What is the units digit of g? 3 Suppose 0 = k + 4j - 7827, -8788 = -2k + 3j + 6899. What is the tens digit of k? 3 What is the tens digit of (3 - -2) + (16124)/2? 2 Let z = 27 - 3. Suppose zh - 28 = 17h. Suppose 0 = 4s + 2j - 0j - 152, -hj = -4s + 176. What is the tens digit of s? 4 Let y(l) = 46l3 + 7l*2 + 5l - 37. What is the hundreds digit of y(5)? 9 What is the hundreds digit of (-14 + 111/6)35764/9? 8 Suppose -108036 + 357133 = 5u + 2q, 4q = u - 49837. What is the ten thousands digit of u? 4 Let f = 1924 - 1914. Let o = 2119 - 869. Suppose 0 = -fm + 15m - o. What is the hundreds digit of m? 2 Suppose 26c + 19c + 1279684 = 73c. What is the units digit of c? 3 Suppose c = 4a - 1557, a + a - 765 = 5c. Suppose 1928 = 5s + 4p, 0 = 6s - 5s + 3p - a. What is the tens digit of s? 8 Let j(a) = 4a - a2 + 0 + 0a + 2a - 2. Let l be j(8). What is the tens digit of 66/l9-3? 9 Let i(x) = 64x - 6. Let y(z) = -47z + 9. Let q(k) = 23k - 4. Let a(b) = 15q(b) + 6y(b). Let o(m) = -4a(m) + 5i(m). What is the hundreds digit of o(2)? 1 Let w(c) = 67c - 73. What is the tens digit of w(16)? 9 What is the thousands digit of (-278320)/(-28) + (-4 - 4)? 9 Let x(w) = -4w*3 - 12 + 3w*3 + 8 + 4w + 7w2 - 8. Let l be x(7). Suppose -275 = 11o - lo. What is the units digit of o? 5 Suppose 14y + y = 0. What is the units digit of 24 + (y - (-5 - -6))? 3 Let z(k) = -7k3 + 5k*2 + 5k + 11. Let q be z(4). Let p = q + 570. What is the hundreds digit of p? 2 Let u = 1167 + -564. Let w = u + -277. Suppose 38o + w = 40o. What is the units digit of o? 3 Let u = 504 + -397. Let z = 627 - u. What is the tens digit of z? 2 Let g be (28/70)/(1/5 - 0). Suppose -ga - 49 = -4r + 3a, 0 = 2a + 10. Suppose -rw - w = -1197. What is the units digit of w? 1 Let k(u) = 1954u - 2541. What is the thousands digit of k(10)? 6 Let n be 72/10 - (-1)/(-5). Suppose 0 = -q - n + 5. What is the tens digit of q - (-94 + 0 - -4)? 8 Let c(d) = 31d - 1. Let l be c(1). Let t = l + -23. Suppose 2y = ty - 220. What is the tens digit of y? 4 Let a = 19889 - -4191. What is the hundreds digit of a? 0 What is the ten thousands digit of (2 - 6519/(-6))216/21 + -3? 1 Let q be (-3 + 2)/(2/10). Let v(a) = 20a - 38. Let u(z) = 60z - 104. Let n(y) = -5u(y) + 14v(y). What is the units digit of n(q)? 8 Let y(o) = 9o - 24. Let g = 110 + -81. Let p = g - 5. What is the hundreds digit of y(p)? 1 Suppose -p + 102 + 596 = -v, 2790 = 4p - 3v. Suppose -86i = -85i - p. What is the tens digit of i? 9 Let d(j) = 363j - 5. Let i(m) = -m - 2. Let y be i(-3). Let n be d(y). Suppose 2f = 4h - f - 494, n = 3h + 4f. What is the tens digit of h? 2 Suppose 3y = 7 + 17. Let p be 44/66 - (-22)/(-6). What is the tens digit of 6/y(-1148)/(p - 4)? 2 What is the hundreds digit of (235272/(-10))/(452/(-565))? 4 Let q = 4649 - 661. Suppose q + 4201 = 19l. What is the hundreds digit of l? 4 Let n = 82 - 40. Let g = -15 + 16. Let m = n + g. What is the units digit of m? 3 Suppose 21 = 3i + 3. Suppose 4u = c - ic + 3909, -c + u = -780. What is the tens digit of c? 8 Suppose -5d + 3n = n - 19, 0 = 5d + 2n - 11. Let a be (-26)/(-8) - (-2)/(-8). Suppose -4o = -ds - 171, 0s - as = o - 39. What is the tens digit of o? 4 Let m(p) = -9p3 - 20p*2 + 99p + 2027. What is the units digit of m(-17)? 1 Suppose 17f = -4659 - 4878. Let t = 95 - f. What is the hundreds digit of t? 6 Let h(z) = -180z + 47. Let d(i) = i*3 - 9i*2 + 8i - 2. Let n be d(8). What is the hundreds digit of h(n)? 4 Suppose -4n = 2w - 852, 16 = -2w + 6w. Suppose -r - n = -o, -3r + 879 = 23o - 19o. What is the tens digit of o? 1 Let s(h) = h3 + 24h*2 + 29h + 34. Let o be s(-20). Suppose -7z = -997 - o. What is the hundreds digit of z? 2 Suppose -5s + 8s = -3l + 1110, -12 = -4l. Let y = 452 - s. What is the tens digit of y? 8 Let j be -6(369/2)/(-9). Suppose -5v - j = 567. Let k = v + 221. What is the tens digit of k? 8 Let b be 14/21133. What is the units digit of 3/((-9)/(-1446)) + (18 - b)? 8 Let w(f) = 3f*2 - 16f + 15. Let h(u) = u*2 + u - 1. Let m(x) = 2h(x) + w(x). What is the hundreds digit of m(6)? 1 Let m(n) = -n*3 + 19n*2 - 2n + 42. Let k = -51 - -70. Let j be m(k). Suppose -3z = -2h + 10, 24 = jh - z - 6. What is the units digit of h? 8 What is the tens digit of 2 + 5 - (-5143 + (5 - 11))? 5 Let d = 38 + -38. Suppose 32c - 31c - 84 = d. What is the units digit of c? 4 What is the hundreds digit of (336/4)/(149/2384)? 3 Let n = 5531 + -2787. Suppose -j + 684 = 2q, -4j - q + n = 3q. What is the units digit of j? 8 Suppose 2k - 24 = k + 4a, 4k = 5a + 63. Suppose 34 = -5v - kv. What is the hundreds digit of (365/v)/(-5)(2 - -2)? 1 Let a(t) = -t2 + 4t + 23. Let g be a(-3). Let s(f) = -3 + 4 + 1 + 6 + 14f. What is the tens digit of s(g)? 3 What is the units digit of 11(-5314)/(-18)9? 7 Let h(c) = 6c*2 + 46c + 804. What is the hundreds digit of h(-13)? 2 Suppose -8a + 6a + 2574 = -2c, 6433 = 5a - 4c. What is the tens digit of a? 8 What is the units digit of (-398052)/(-324) - -2(-2)/(-9)? 9 Suppose 3w + 5v = 98, 3w + 4v - 86 = 2v. Let n be 74/(-10) - w/(-65). Let m(l) = -31l - 1. What is the units digit of m(n)? 6 Suppose -14w + 46590 = -10w + 5a, -16w + 186258 = 3a. What is the ten thousands digit of w? 1 Let j(a) be the second derivative of 5a*3/6 + 7a*2/2 - 329a. Suppose -4r + 62 = -c, -4r - 4c = -13 - 59. What is the units digit of j(r)? 7 Let i be -3(2/(-4) + (-1)/6). What is the tens digit of 24/(-48) - (-735)/i? 6 Let n(r) = -78r - 284. Let z be n(-4). Let h = -7 - -96. Let g = h - z. What is the tens digit of g? 6 Let g(w) = 118w + 4874. What is the hundreds digit of g(0)? 8 Let o(c) be the third derivative of 82/3c3 + 0c + 0c5 + 0 - 1/120c*6 + 16c*2 - 1/24c*4. What is the units digit of o(0)? 4 Suppose 43 - 15 = 2u. What is the hundreds digit of (-6)/u - (-14100)/70 - 2? 1 Suppose 3u + 2w = -525 + 30671, w = 2u - 20102. What is the units digit of u? 0 What is the units digit of (8/(-56))/(10/(-3267530))? 9 Suppose q = -y + 1052, y = -0y - 4. Let g = q + -629. What is the hundreds digit of g? 4 Suppose -2i + 4l + 7716 = 0, -4131 + 23410 = 5i + l. What is the thousands digit of i? 3 Let x = -45 + 47. Let k(i) = 8 + 85i*x - 90i2 - i3 + 0i3. What is the tens digit of k(-7)? 0 Suppose 4a + 39z - 45z - 140234 = 0, 5z = -4a + 140311. What is the units digit of a? 9 Let o(h) = h*2 - 3h - 53. Le	{ "pile_set_name": "DM Mathematics" }
a prime number? True Suppose 0 = -5n + o + 1652, -2n + 1640 = 3n - 5o. Is n composite? False Let i(q) = 367q2 + q - 1. Let k be i(-2). Suppose 5l = -0l + k. Is l prime? True Let v(m) = 18m*3 - m + 2. Is v(3) a prime number? False Let c = -279 + 578. Is c a prime number? False Let y be (-6)/4 - 27/(-6). Suppose 135 - 993 = -yz. Suppose -5n = -z + 21. Is n a prime number? True Suppose b + 36 = 4i - 3b, -i + 13 = -2b. Let q(n) = 11n - 4. Is q(i) composite? True Let f = 15 + -10. Suppose -7y + fy = -74. Is y a composite number? False Let x(r) = 4r*2 - 8r + 5. Is x(4) composite? False Let a(f) = -f - 7. Let w(m) = 6m + 2. Suppose -6 - 2 = 4t. Let k be w(t). Is a(k) a prime number? True Let t = -7 + 7. Suppose 0 = -3a - 5x + 137, t = 5a + x + 5 - 248. Is a composite? True Suppose 0 = -4j + 3y + y - 28, 3y = -j + 1. Let b(s) = -2s3 - 3s*2 - 5s + 3. Is b(j) a prime number? False Let y be (5/4)/((-5)/(-20)). Suppose yo - 130 = -2t + 57, 2o + t = 75. Is o a prime number? True Suppose -4q - 3x + 193 = 0, 0 = -3q - x + 185 - 44. Is q prime? False Suppose 1785 = 4p + 269. Is p a prime number? True Suppose -30 = -4p - 2i, -2p + 5p + 2i - 25 = 0. Suppose -4n = 3f - 8, 0 = -f + pn + 9. Suppose 0 = fx - 4v - 171 - 129, 2x - v - 152 = 0. Is x prime? False Let l(g) = -g*3 - 6g*2 + 5g + 8. Let a = -5 + -2. Is l(a) prime? False Let g(m) be the second derivative of m*4/3 - 11m3/6 + m2/2 - 3m. Let z(v) be the first derivative of g(v). Is z(8) composite? False Suppose -2m + 5b - 4 = 0, 2m + b = 2b + 4. Suppose 0 = -2q - ml - 118, -q = 2q - 2l + 177. Let c = -38 - q. Is c composite? True Let x(u) = 33u - 11. Is x(18) composite? True Let p(x) = -110x + 21. Is p(-5) a composite number? False Suppose -1 = k - 2, -k - 1100 = -3a. Is a prime? True Let n(r) = 82r2 - r + 2. Let g(l) = l2 + l. Let j(h) = 2g(h) + n(h). Is j(-1) composite? True Suppose 0n - 4n = 436. Let u = n - -304. Suppose -3c = 2c - u. Is c prime? False Suppose 4j - 2217 = -x - 0x, x + 2760 = 5j. Is j prime? False Suppose 4z = -6d + 2d + 36, -5d + 30 = 2z. Suppose 4u = zn + 237, 0 = 2u - 7u - 3n + 250. Is u composite? False Let h(z) = 43z3 + z2. Let u be h(-1). Let v = u + 133. Is v prime? False Let l = 383 - -100. Let n = -253 + l. Suppose -n = -j - j. Is j composite? True Let m(n) = -15n3 - 4n*2 + 6n - 3. Let q = 10 + -6. Let a be m(q). Is (-4)/22 + a/(-11) composite? True Let s(v) = 5v2 + 2v + 3. Let c be -2(-3)/(-15)5. Is s(c) prime? True Let w(r) = -19r - 6. Let t(q) = 2q - 1. Let j be t(-2). Is w(j) composite? False Suppose -d + v - 2 = -0v, -5d - v = -14. Let g be (4/10)/(d/270). Is 4/6g/4 a prime number? False Let n(z) = z2 + z - 6. Suppose 2h + 20 = -2. Let u = 6 + h. Is n(u) a composite number? True Let i(p) = -p*2 - 2p. Let b be i(-2). Suppose 0 = -q - j + 65, -260 = -4q + 2j - bj. Is q a composite number? True Let o(q) = -7q*3 - 2q*2 - 4q - 3. Is o(-2) a prime number? True Let v = 2138 + -1164. Is v a prime number? False Suppose 0 = k + 15 - 53. Let o = 85 - k. Is o a prime number? True Is 11/77 + 4542/7 a prime number? False Suppose -5i + i = 3q - 41, q - 3 = 0. Let v(a) = a*3 - 9a*2 + 7a + 10. Let b be v(i). Is (3/(-9))/(b/(-474)) a prime number? True Suppose -2o - 177 = -5o. Is o a composite number? False Let m(b) = b*3 - 8b*2 + 8b - 29. Is m(14) a composite number? False Suppose 2p - 872 = -9a + 7a, -3a + 430 = p. Is p a prime number? True Suppose -2p = 2m - m - 155, -305 = -4p + 3m. Is p a prime number? False Is (1557 - -4) + (-6)/3 composite? False Suppose 205 + 1178 = 3l. Let c = l + -276. Is c prime? False Let g(r) = -53r*3 - 2r*2 - 2r - 1. Let l be g(-1). Let j = -3 + l. Suppose 2s = j + 25. Is s composite? False Let c(o) = -2o + 5. Let x be c(3). Let n = x + 142. Is n composite? True Let d be 334/6(3 + 0). Suppose f = 86 + d. Is f prime? False Let b(r) = 14r - 7. Let u be b(5). Let n = u + -40. Is n a prime number? True Suppose -13 - 1 = -2i. Is i composite? False Let k(w) = -w3 + 2w*2 + 2w + 4. Let a be k(3). Is 219a + 9/(-9) a composite number? True Let b be 1 + ((-1)/1 - 3). Let o(q) = -52q + 3. Is o(b) a composite number? True Let a(d) = -d*2 + 5d - 4. Let i be a(4). Suppose 4j = -ij + 452. Is j a composite number? False Suppose -l + 14 = -7. Suppose 5o = 4u - l, o + 0 - 7 = -2u. Suppose -3a + 14 = -u. Is a a prime number? False Let h = -158 + 301. Is h composite? True Let p = -10 + 12. Is p a prime number? True Let m = 52 + 411. Is m composite? False Let x(o) = -2o - 160. Let b be x(0). Is -1(2 + b)/2 a prime number? True Let x(s) be the second derivative of s*4/12 + 2s*3/3 - 4s*2 - 2s. Is x(-9) prime? True Let r(v) = -v - 3. Let j be r(-5). Suppose 4l = -jb + 206, -l + b = l - 93. Is l a composite number? True Suppose -4j + 5d + 204 = 0, j - 264 = -4j + 4d. Suppose 0 = -5i + 6p - 2p - 79, -i - 4p - 35 = 0. Let b = i + j. Is b prime? True Suppose 5p = -4c - 12 + 47, 6 = -3p + 3c. Suppose 4z + 0t = -pt + 696, -5z - 2t + 870 = 0. Suppose 0 = -4u + u + z. Is u composite? True Suppose 2v = -3v + 830. Suppose v = 4z - 166. Is z a prime number? True Let c be 2 + 1 - (-1 - 0). Suppose -cj - 3m + 22 = -2j, 3m - 7 = j. Suppose 4d = -jb + 296, -2d + 180 = 2b + 30. Is d a prime number? True Let j be ((-2)/(-6) + 3)84. Let x be j - (-5 - (-4)/2). Suppose -34 = 3a - x. Is a a prime number? True Let v = 62 + -16. Is v a prime number? False Suppose 9 = -4p + 7p. Let o = p - -2. Suppose -i - 60 = -oi. Is i composite? True Let h(y) be the first derivative of 15y2/2 - y - 8. Is h(4) a prime number? True Suppose 0a - 3a = -6. Suppose af - 37 = -5t, 5f + 6t - 3t - 64 = 0. Is f a composite number? False Let t(k) = 21k2 - 2k + 4. Let p be t(-4). Suppose -2j - 605 = -5j + 4d, -j + 2d + 203 = 0. Let i = p - j. Is i prime? True Let u be (1 + 1)1-5. Let f = u + 11. Is 14f34/4 a prime number? False Let p be 2 + (11 - 6/(-2)). Suppose 4i + 4s + p = 2i, 3i + 5s = -19. Is i composite? False Suppose 37 + 254 = 3j. Is j a composite number? False Suppose 0 = -2b + 2 + 4, -5b = -3j + 8802. Is j prime? True Suppose 2t - 318 = -4q, -65 + 220 = 2q - 3t. Is q a composite number? False Let n = 3 - 1. Suppose c - 64 = 3i, 2c = 5c + ni - 137. Suppose -u + 2u = c. Is u a composite number? True Let d = -641 - -1214. Is d a prime number? False Let q(a) = a + 7. Let l be q(-5). Suppose -4g + 5g - 644 = -4c, 5g = lc - 322. Is c a prime number? False Let o = -143 - -99. Is 6 + -6 + 3 - o composite? False Let n be (10/(-4))/(-5)-2. Let o = n + 6. Suppose -oy + 4f = -175, -4y + 4f = -139 + 3. Is y composite? True Suppose -24q + 19q + 1420 = 0. Let w = -157 + q. Is w prime? True Let d = 931 + 290. Suppose -4l = -l - d. Is l composite? True Suppose 0 = 2v + 3 + 1. Let h = v + 2. Suppose h = 2k - k - 37. Is k a composite number? False Suppose -2v + 5v = 9. Suppose 3f - 5c = 678, 0 = -3f - vc + 532 + 122. Is f a prime number? False Let f = 12 - 7. Suppose -2r - 4m = 20, -53 = 8r - 4r - fm. Is (-3171)/r - (-6)/8 a composite number? True Let u = 6 - 2. Suppose -3 = uc - 151. Is c a prime number? True Let j be -3 + 56 - (-1 - -3). Let l = j - 32. Is l prime? True Suppose -a = 47 - 54. Is a a composite number? False Suppose 2i = 3 + 3. Suppose 4y - 180 = -4p, -iy - y = 4. Is p prime? False Let u(i) = 3i*2 + 41i + 41. Is u(18) a composite number? True Let v(c) = -c*3 + 6c*2 - 4c + 3. Let q be v(5). Is (-2)/(3/((-4452)/q)) prime? False Let n be -17 + (2 - 2). Let f = 21 + n. Is f a composite number? True Let p = 256 - 140. Suppose -3h - s + 25 = -81, s = 3h - p. Is h composite? False Let w(s) = -s3 + 6s*2 - 4s - 7. Let o be w(5). Let t = 2 - o. Let r(i) = i*2 - i - 2. Is r(t) prime? False Suppose -145 = -5u - g, -5u + 3u = -2g - 70. Let v be -12(0 + u/(-9)). Let o = v - 27. Is o prime? True Suppose -j + 3 = j - p, -2p = -j + 3. Let a be (-8)/(-20)595/j. Suppose 2d - 84 = a. Is d prime? False Suppose -267 + 53 = -3g + d, -2*g = -d - 143. Is g a prime number? True Let g be -43 - (2/(-2) - -2). Let j = g + 186. Is j compos	{ "pile_set_name": "DM Mathematics" }
ssuming z is positive. z Simplify (q/(q(3/4)/q))/(q/((q/q40)/q)) assuming q is positive. q*(-159/4) Simplify cc*(-32)/c(c(-1)/c)/c assuming c is positive. c(-35) Simplify (c(-28))(-28) assuming c is positive. c*784 Simplify (f/(ff(-2/29)))/(f(1/5)/f)f/((f/f(-4))/f)f(-3) assuming f is positive. f(-744/145) Simplify (i*(-2/31)i/(ii/(i/(i/i(-6)))))/(i(-7/4)i0) assuming i is positive. i(-659/124) Simplify ((cc(-19))/c)/(c/(c(1/5)/c)) assuming c is positive. c(-104/5) Simplify (zz/z*20)/zzz/(z(-1)/zzz) assuming z is positive. z(-17) Simplify ((y7/y)/((y/y9y)/y))(-29) assuming y is positive. y(-406) Simplify (d*(5/4)dd/d1)/((ddddd2d)/(d*(2/17)/ddd)) assuming d is positive. d(-247/68) Simplify (d(-2/7)/d(2/13))/(d(-1))(4/23) assuming d is positive. d(-556/2093) Simplify (zz(-1/38))/(z(1/4)/zzz) assuming z is positive. z(-21/76) Simplify (d(2/23)d(-6))/((dd*(4/13))/ddd(-1/12)ddd) assuming d is positive. d*(-36373/3588) Simplify (kk*16k)/k(-3) assuming k is positive. k21 Simplify (q*(-1)q(2/9))(3/5) assuming q is positive. q(-7/15) Simplify c(7/4)/c*(-7/5)c/(c*(-1/2)/c)c7 assuming c is positive. c(253/20) Simplify ((w*(-17/2)w)/w)/(w/(w/(((w*30/w)/ww)/w))w) assuming w is positive. w(-75/2) Simplify ((w1)(-30/7))(-2/31) assuming w is positive. w(60/217) Simplify (i(-3/7))(-48) assuming i is positive. i(144/7) Simplify (o7/((((o(-5)o)/o)/o)/o))/((oo(-4)o)/(o(2/29)/o)) assuming o is positive. o(437/29) Simplify (k(-3)/(k7/k))/(((k/(kk3))/kk)/k4) assuming k is positive. k(-2) Simplify vv(2/3)v/v*(-21)v assuming v is positive. v(74/3) Simplify (t1)*(-4/7)(tt/(tt/t*2)t)(12/13) assuming t is positive. t(200/91) Simplify h*(-2)hhh(h/(h/h(-6)))/hh*(-9)hh/h6 assuming h is positive. h(-19) Simplify xxx/x(-6)xxxx(x*(-1/3)/xxx)/x assuming x is positive. x(38/3) Simplify (c/c(-1/2)c(2/3))(-3/14) assuming c is positive. c(-13/28) Simplify (a1)*15a*(1/11)a(1/2) assuming a is positive. a(343/22) Simplify (ii(-3/11)i(ii/i7)/i)29 assuming i is positive. i(-1363/11) Simplify b33/(bb(-43)) assuming b is positive. b75 Simplify ((i(-6))3)46 assuming i is positive. i(-828) Simplify c/((c(3/16)/cc)/c)c/c(-1/4)c assuming c is positive. c(65/16) Simplify (x(2/7)x(2/3))/(x/x(-5/4)xx/(x/x(-3))) assuming x is positive. x(59/84) Simplify (s7/s)/((s/(s/s(-1/7)))/ss)(s6s)/sss1/s assuming s is positive. s(92/7) Simplify (f/(f*(-5)f))(9/7) assuming f is positive. f(45/7) Simplify (xx(-2/53)x)(-3/14) assuming x is positive. x(-156/371) Simplify (rr(r/((r*(2/21)r)/r))/r)(-37) assuming r is positive. r(-1480/21) Simplify l/(l/l*(1/2))(ll(-4)l)/ll(-2/13)ll(-6) assuming l is positive. l(-199/26) Simplify (o/(o/o(-15)))/(o(-6)/o) assuming o is positive. o(-8) Simplify (l7/l(l/l(1/12))/l)/(l/l(2/5)l5/ll) assuming l is positive. l(19/60) Simplify i23ii/(i*(-37)i) assuming i is positive. i61 Simplify (f(-20)f(2/59))(-1/8) assuming f is positive. f(589/236) Simplify ((zz*(9/4)/z)/zz)/z(-5/6) assuming z is positive. z(37/12) Simplify (w/((w*(-2/7)ww)/ww)w/w(-3))/(ww(2/7))(3/4) assuming w is positive. w(65/28) Simplify (v(-2/11)v)/((vvv(1/4)/v)/v)(vvv*(-6)vv)/(v(-3/4)/v) assuming v is positive. v(7/22) Simplify (m(-2/3))(-13)/((((m/(mm(2/3)))/m)/m)/m(-4/3)) assuming m is positive. m10 Simplify a24/aa(-12/7)/aa assuming a is positive. a(149/7) Simplify ((k(-3))(-23/4))(-1/11) assuming k is positive. k(-69/44) Simplify ((r16/rrr)/(rr/r(-2/35)r))(-1/46) assuming r is positive. r(-244/805) Simplify t/(tttt9)t/((t/(t/(t/(tt(4/5))))t)/t) assuming t is positive. t(-46/5) Simplify (w8w(3/7)w)/((w/(ww/(w0www)))/w)(-37) assuming w is positive. w(325/7) Simplify (z*3z)/(zz/(z/(zz/z(-2/15)))) assuming z is positive. z(13/15) Simplify ((r(3/4))22)5 assuming r is positive. r(165/2) Simplify (q(-1/3))(-41)(q/q(-3/2))/(q/q(-2/27)) assuming q is positive. q(815/54) Simplify ((i(-2/9))(1/16))(-28/9) assuming i is positive. i(7/162) Simplify n(-5)/n(2/77) assuming n is positive. n(-387/77) Simplify (z(2/5)/(z(-3/2)/z))/((zz*(1/2)z)/z)(-10) assuming z is positive. z(179/10) Simplify ((u/(u(4/3)/u))(-30/13))(-24) assuming u is positive. u(480/13) Simplify (n*(-11)nn(-2)/n)43 assuming n is positive. n(-559) Simplify v(3/2)/vv*(-6)vv(-1)/vvvv*(-1/4)v assuming v is positive. v(-15/4) Simplify (f(-2/15)f(3/5))/(f/f0f1) assuming f is positive. f(-23/15) Simplify (g*(-5/3)g/g*(-3)gg)/((g/(g(1/4)/g))/g(-2/7)) assuming g is positive. g(193/84) Simplify (q(-4)/((qq*3q)/q))/(q*7q/q(-5/2)) assuming q is positive. q(-37/2) Simplify b(-41)/(b/b(-43)) assuming b is positive. b(-85) Simplify ((r1)(2/13))(-16) assuming r is positive. r(-32/13) Simplify ((((w(2/3)w)/w)/w)/w(-6))(-2/37) assuming w is positive. w(-34/111) Simplify i(-5)ii4(i/i*2i)/(ii(2/13)) assuming i is positive. i(-15/13) Simplify (bb/b(-12))(-19) assuming b is positive. b(-266) Simplify ((h/h(3/11))/hhh*(-3)hh)/(h2/h1) assuming h is positive. h(-14/11) Simplify (o2(o*(2/7)/oo)/o)/(o*2/ooo/(oo*(2/21)o)o) assuming o is positive. o(-13/21) Simplify ((pp/(pp9p)p)/(p5/p))/((p/(pppp(p/(p1/p))/ppp))/p)(-32/3) assuming p is positive. p(-76) Simplify (bb(-1/6))/b(2/5)b(-1/6)bbbb/b(1/3)bbb assuming b is positive. b(104/15) Simplify s7s/s(-2/5)s/(s/(s*(2/11)s))((ssss*(1/6)s)/ss)/s assuming s is positive. s(4207/330) Simplify (g(-4/9))(-4/17) assuming g is positive. g(16/153) Simplify v(3/10)v*4((vv/((vv/(v*(1/2)v))/v))/v)0 assuming v is positive. v(43/10) Simplify ((c*3c)/(c(2/15)/c))/((c/c(-2/39)c)/(c(-1/2)ccc)) assuming c is positive. c(691/130) Simplify ((w/(w(2/13)ww))/(w*(4/7)/w))/(ww*(1/4)w)20 assuming w is positive. w(-4161/91) Simplify ll/(l/(ll/l*(-2/15)))lll*4(l/((l/(l*6/l))/l))/(ll/l(-2/7)) assuming l is positive. l(1349/105) Simplify (o2/o(1/2))/(o*(-2/23)/(o/(o(oo(-3)/o)/o))) assuming o is positive. o(257/46) Simplify v(-6)/v(-2/25)v*5vv6vv assuming v is positive. v(202/25) Simplify (z(-1/8)z(z/(z/(z/(zz/(zz/z(-2))))))/z)/(z(1/4)zz0) assuming z is positive. z(13/8) Simplify ((((k/k(3/8))/kk)/k)/(k/(k/((k(kk*(5/3))/kkk)/k))))/((k(-3/5)/k)/(kk(6/11))) assuming k is positive. k(-1183/1320) Simplify ((dd(-2/23)dd)/(dd5))/(d(-1/5))(-8/9) assuming d is positive. d(-3379/1035) Simplify (((u*3u)/u)/(u/(uu/(u(u/(u/(u/u*(-5)))u)/u))))/(u(-4)/(u(1/4)/uu)) assuming u is positive. u(5/4) Simplify (l(-2)/l)13l*8/(l/(l(l*(-1)l)/lll)l) assuming l is positive. l(-31) Simplify i(-6)/(i/((i/i(-4/5))/i))(i0)(-1/53) assuming i is positive. i*(-31/5) Simplify ((qq(3/2))(-24))37 assuming q is positive. q(-2220) Simplify (www*(1/19))/ww(-16) assuming w is positive. w(-284/19) Simplify i*11/(i((i/i(-2/21))/i)/i) assuming i is positive. i(229/21) Simplify (j*4/(jj*(-3/14)j))/(j*(2/9)/jj)19 assuming j is positive. j(-253/126) Simplify (a(a(-27)/a)/aaaaaa)20 assuming a is positive. a(-460) Simplify y/y*(4/7)y(2/21) assuming y is positive. y(11/21) Simplify ((i/i(1/5))(-2))(-14) assuming i is positive. i(112/5) Simplify (w((w(-2/35)/w)/www)/wwww)/w(3/14) assuming w is positive. w(191/70) Simplify (mmm(m(m/(mm/m(4/9)))/mm)/mmm)(-39) assuming m is positive. m(-520/3) Simplify zz/(z/(zzzz*(5/3)zz))z(-16) assuming z is positive. z(-25/3) Simplify (r/(r/r*(3/28)rr))/(r(-12)rr) assuming r is positive. r(227/28) Simplify (k(1/17)/k)/k26 assuming k is positive. k(-458/17) Simplify (j(-8)j)/	{ "pile_set_name": "DM Mathematics" }
55 What is prob of picking 1 b and 1 w when two letters picked without replacement from {w: 2, b: 4}? 8/15 Three letters picked without replacement from {u: 7}. Give prob of picking 3 u. 1 Three letters picked without replacement from {c: 5, m: 7, z: 1, b: 6}. Give prob of picking 1 z and 2 c. 10/969 Three letters picked without replacement from ygylyllll. Give prob of picking 3 y. 1/84 Calculate prob of picking 4 h when four letters picked without replacement from vcvfhhfhfvh. 1/330 Calculate prob of picking 1 w and 1 q when two letters picked without replacement from wpwpwppewwwwwrq. 8/105 Two letters picked without replacement from {p: 1, a: 1, e: 1, w: 3, u: 1}. What is prob of picking 1 w and 1 e? 1/7 Three letters picked without replacement from {p: 1, n: 1, u: 6, s: 3, q: 3}. What is prob of picking 1 p, 1 n, and 1 s? 3/364 Two letters picked without replacement from {o: 8, l: 1, i: 10}. Give prob of picking 1 o and 1 i. 80/171 Calculate prob of picking 3 h when three letters picked without replacement from nnhflunhnnuulnuh. 1/560 Calculate prob of picking 3 u and 1 q when four letters picked without replacement from qquwueqecueuueuee. 3/119 Calculate prob of picking 4 k when four letters picked without replacement from {o: 4, k: 6, x: 1, n: 4, w: 5}. 1/323 Calculate prob of picking 1 j, 1 q, and 1 e when three letters picked without replacement from {g: 7, j: 1, e: 1, q: 2, l: 7}. 1/408 Four letters picked without replacement from {c: 3, h: 2, w: 2, l: 9, p: 3}. What is prob of picking 1 w, 2 l, and 1 p? 18/323 Three letters picked without replacement from {l: 3, i: 1, b: 6, q: 2, m: 1}. Give prob of picking 1 i and 2 q. 1/286 Three letters picked without replacement from {o: 12, t: 3, s: 2}. What is prob of picking 2 s and 1 t? 3/680 Calculate prob of picking 2 b and 2 g when four letters picked without replacement from {g: 6, b: 6}. 5/11 Four letters picked without replacement from {k: 3, y: 1, t: 1, c: 4, w: 5, a: 6}. Give prob of picking 3 c and 1 a. 8/1615 Calculate prob of picking 1 s and 2 p when three letters picked without replacement from {g: 1, a: 1, s: 8, p: 2, l: 2}. 2/91 Four letters picked without replacement from {u: 3, j: 4}. What is prob of picking 3 j and 1 u? 12/35 Calculate prob of picking 1 v and 2 w when three letters picked without replacement from {k: 4, h: 1, w: 7, a: 2, v: 6}. 21/190 Two letters picked without replacement from esxlr. What is prob of picking 1 x and 1 r? 1/10 What is prob of picking 2 c and 2 v when four letters picked without replacement from ccccqvcvcvvvc? 42/143 Calculate prob of picking 1 o and 1 n when two letters picked without replacement from nononngooojoog. 4/13 Two letters picked without replacement from {g: 3, x: 2, c: 5, f: 2}. What is prob of picking 2 x? 1/66 What is prob of picking 1 q and 1 f when two letters picked without replacement from {g: 2, q: 3, c: 3, i: 2, f: 2, e: 4}? 1/20 Four letters picked without replacement from {y: 2, q: 3}. What is prob of picking 2 q and 2 y? 3/5 What is prob of picking 1 m and 1 b when two letters picked without replacement from mbkbemmkm? 2/9 Three letters picked without replacement from eeteeccttrheetotcehc. What is prob of picking 1 t, 1 e, and 1 o? 7/228 Calculate prob of picking 3 e and 1 d when four letters picked without replacement from {e: 3, d: 2}. 2/5 What is prob of picking 1 a and 1 u when two letters picked without replacement from ouaouagaoa? 8/45 What is prob of picking 2 f and 1 v when three letters picked without replacement from ffvfffvffttffvffvtff? 26/95 Three letters picked without replacement from {c: 3, q: 2, l: 8, j: 2, u: 2}. Give prob of picking 1 l, 1 c, and 1 q. 6/85 Calculate prob of picking 2 r, 1 f, and 1 a when four letters picked without replacement from rxrrxafxxffrrjr. 3/91 Calculate prob of picking 3 g when three letters picked without replacement from ngntgnr. 0 Two letters picked without replacement from yvuooougoooovvuov. Give prob of picking 1 g and 1 u. 3/136 Four letters picked without replacement from iiwwiiwwwwwwwwwwwww. Give prob of picking 3 i and 1 w. 5/323 Four letters picked without replacement from yowoguf. Give prob of picking 1 y, 2 o, and 1 w. 1/35 What is prob of picking 2 w when two letters picked without replacement from aaacwawccaw? 3/55 Two letters picked without replacement from {a: 1, b: 5, w: 1, u: 4, d: 3, v: 1}. What is prob of picking 1 w and 1 u? 4/105 Two letters picked without replacement from wxx. What is prob of picking 1 x and 1 w? 2/3 Calculate prob of picking 1 i and 2 g when three letters picked without replacement from {g: 2, h: 8, i: 2}. 1/110 Calculate prob of picking 1 q and 1 x when two letters picked without replacement from xceheqcchxeccccxe. 3/136 Calculate prob of picking 1 h and 1 a when two letters picked without replacement from {m: 1, h: 3, a: 1}. 3/10 What is prob of picking 1 u, 1 s, and 1 c when three letters picked without replacement from sysyuycyyusucsuyyys? 40/969 Calculate prob of picking 2 s and 1 b when three letters picked without replacement from bwbsbsbbsbsbbsbw. 9/56 Two letters picked without replacement from {k: 1, z: 2, r: 1, i: 1, v: 1, y: 1}. Give prob of picking 1 r and 1 y. 1/21 What is prob of picking 2 h and 1 r when three letters picked without replacement from {r: 1, l: 1, h: 6, j: 1}? 5/28 Three letters picked without replacement from cfccccfccc. Give prob of picking 1 f and 2 c. 7/15 Four letters picked without replacement from {i: 6, k: 2, u: 2, r: 3, e: 3}. What is prob of picking 2 i, 1 u, and 1 e? 9/182 Four letters picked without replacement from {k: 2, n: 1, z: 1, g: 4, p: 2, c: 5}. Give prob of picking 1 g, 1 z, 1 p, and 1 n. 8/1365 Two letters picked without replacement from pfxxufxfxtx. Give prob of picking 1 x and 1 f. 3/11 Two letters picked without replacement from tttswwttttttwwttttws. Give prob of picking 1 s and 1 w. 1/19 Two letters picked without replacement from bqbqbqqqbiq. Give prob of picking 1 q and 1 b. 24/55 What is prob of picking 1 z and 1 u when two letters picked without replacement from {o: 2, z: 1, k: 1, y: 1, p: 2, u: 1}? 1/28 Three letters picked without replacement from {h: 7, j: 7}. What is prob of picking 3 j? 5/52 What is prob of picking 1 o and 1 s when two letters picked without replacement from ossrrsssrssrsrssr? 5/68 What is prob of picking 1 q, 1 t, and 1 d when three letters picked without replacement from {q: 8, t: 1, o: 1, r: 2, x: 4, d: 4}? 8/285 Four letters picked without replacement from yususy. Give prob of picking 1 s, 2 y, and 1 u. 4/15 Three letters picked without replacement from {y: 5, d: 1, z: 3, x: 2, q: 1}. Give prob of picking 1 x, 1 y, and 1 q. 1/22 Three letters picked without replacement from ccppccp. What is prob of picking 3 p? 1/35 Two letters picked without replacement from {h: 3, i: 1, w: 1, o: 1, q: 1}. Give prob of picking 1 w and 1 q. 1/21 Calculate prob of picking 2 n when two letters picked without replacement from {n: 3, g: 9}. 1/22 Three letters picked without replacement from pjdjeetjeeeed. What is prob of picking 1 d, 1 e, and 1 t? 6/143 Three letters picked without replacement from vjuualusjuja. Give prob of picking 3 u. 1/55 Two letters picked without replacement from {f: 2, l: 1, w: 3, n: 1, p: 3, o: 1}. Give prob of picking 2 p. 3/55 What is prob of picking 1 k and 1 v when two letters picked without replacement from ynvyokk? 2/21 What is prob of picking 2 c when two letters picked without replacement from {c: 11, t: 1}? 5/6 What is prob of picking 1 w and 1 u when two letters picked without replacement from {p: 2, k: 1, f: 1, w: 1, u: 2, a: 1}? 1/14 Three letters picked without replacement from kkkkkkkkikkiki. What is prob of picking 3 k? 165/364 Two letters picked without replacement from {x: 1, j: 1, k: 3, o: 2}. What is prob of picking 1 j and 1 k? 1/7 Four letters picked without replacement from fffffmmmfmmm. What is prob of picking 2 m and 2 f? 5/11 What is prob of picking 1 n, 1 y, and 1 g when three letters picked without replacement from {g: 4, v: 1, a: 1, y: 5, n: 1}? 1/11 Calculate prob of picking 1 r and 1 e when two letters picked without replacement from xhwrexyr. 1/14 What is prob of picking 1 u and 1 s when two letters picked withou	{ "pile_set_name": "DM Mathematics" }
ivided by 693. 265 What is the remainder when 13008 is divided by 360? 48 Calculate the remainder when 36102 is divided by 18037. 28 What is the remainder when 2350903 is divided by 48? 7 What is the remainder when 3819 is divided by 133? 95 Calculate the remainder when 86534 is divided by 43251. 32 What is the remainder when 17139 is divided by 5671? 126 Calculate the remainder when 35913 is divided by 151. 126 What is the remainder when 5036 is divided by 333? 41 Calculate the remainder when 189309 is divided by 18. 3 What is the remainder when 1248 is divided by 19? 13 What is the remainder when 609023 is divided by 976? 975 Calculate the remainder when 48281 is divided by 92. 73 What is the remainder when 27299 is divided by 455? 454 Calculate the remainder when 21871 is divided by 547. 538 Calculate the remainder when 42539 is divided by 1380. 1139 What is the remainder when 177648 is divided by 13? 3 What is the remainder when 471500 is divided by 255? 5 Calculate the remainder when 1161 is divided by 375. 36 Calculate the remainder when 74033 is divided by 257. 17 Calculate the remainder when 23667 is divided by 11786. 95 Calculate the remainder when 37271 is divided by 327. 320 What is the remainder when 5379 is divided by 349? 144 What is the remainder when 2642 is divided by 1321? 0 What is the remainder when 317 is divided by 105? 2 What is the remainder when 439235 is divided by 1327? 1325 Calculate the remainder when 233849 is divided by 288. 281 What is the remainder when 29815 is divided by 42? 37 Calculate the remainder when 792778 is divided by 73. 71 Calculate the remainder when 2966591 is divided by 3. 2 Calculate the remainder when 7498349 is divided by 9. 8 What is the remainder when 261228 is divided by 53? 44 Calculate the remainder when 6981 is divided by 9. 6 What is the remainder when 2062423 is divided by 52? 51 What is the remainder when 63207 is divided by 38? 13 What is the remainder when 4287 is divided by 9? 3 Calculate the remainder when 20368 is divided by 971. 948 What is the remainder when 582847 is divided by 16? 15 Calculate the remainder when 766391 is divided by 8. 7 Calculate the remainder when 4782 is divided by 2391. 0 What is the remainder when 55149 is divided by 277? 26 Calculate the remainder when 8800 is divided by 26. 12 What is the remainder when 2330 is divided by 2307? 23 What is the remainder when 14730 is divided by 975? 105 What is the remainder when 57122 is divided by 5? 2 Calculate the remainder when 4669 is divided by 25. 19 What is the remainder when 111535 is divided by 330? 325 Calculate the remainder when 144213 is divided by 48018. 159 Calculate the remainder when 283895 is divided by 231. 227 Calculate the remainder when 333220 is divided by 184. 180 What is the remainder when 437852 is divided by 32? 28 Calculate the remainder when 40449 is divided by 114. 93 What is the remainder when 64019 is divided by 22? 21 What is the remainder when 35825 is divided by 41? 32 What is the remainder when 38609 is divided by 133? 39 Calculate the remainder when 17957 is divided by 40. 37 What is the remainder when 1410 is divided by 141? 0 Calculate the remainder when 13300 is divided by 135. 70 What is the remainder when 1313 is divided by 12? 5 What is the remainder when 23237 is divided by 11457? 323 What is the remainder when 4704 is divided by 40? 24 What is the remainder when 10239 is divided by 185? 64 Calculate the remainder when 9217965 is divided by 362. 359 What is the remainder when 1160 is divided by 228? 20 What is the remainder when 12754 is divided by 1822? 0 Calculate the remainder when 252280 is divided by 126127. 26 Calculate the remainder when 6422 is divided by 6190. 232 What is the remainder when 33209 is divided by 4738? 43 What is the remainder when 2908579 is divided by 51? 49 What is the remainder when 350096 is divided by 214? 206 Calculate the remainder when 4229 is divided by 210. 29 What is the remainder when 5033 is divided by 1491? 560 Calculate the remainder when 1382 is divided by 47. 19 What is the remainder when 6754649 is divided by 147? 146 Calculate the remainder when 1877 is divided by 157. 150 What is the remainder when 61899 is divided by 171? 168 What is the remainder when 2292 is divided by 103? 26 What is the remainder when 79965 is divided by 147? 144 Calculate the remainder when 18818 is divided by 51. 50 What is the remainder when 12290 is divided by 1? 0 What is the remainder when 67738 is divided by 1992? 10 What is the remainder when 69879 is divided by 208? 199 What is the remainder when 867 is divided by 16? 3 Calculate the remainder when 4730 is divided by 1573. 11 What is the remainder when 414 is divided by 53? 43 What is the remainder when 46885 is divided by 100? 85 Calculate the remainder when 44529 is divided by 36. 33 What is the remainder when 1077639 is divided by 274? 271 Calculate the remainder when 2716 is divided by 7. 0 What is the remainder when 7849 is divided by 9? 1 Calculate the remainder when 27267 is divided by 135. 132 Calculate the remainder when 4912 is divided by 183. 154 What is the remainder when 400241 is divided by 43? 40 Calculate the remainder when 20511 is divided by 6830. 21 What is the remainder when 136847 is divided by 14? 11 Calculate the remainder when 129527 is divided by 512. 503 Calculate the remainder when 1800 is divided by 115. 75 What is the remainder when 5707 is divided by 1898? 13 What is the remainder when 32809 is divided by 10? 9 Calculate the remainder when 2595 is divided by 630. 75 Calculate the remainder when 690610 is divided by 156. 154 Calculate the remainder when 1270 is divided by 204. 46 What is the remainder when 401 is divided by 27? 23 What is the remainder when 114045 is divided by 27? 24 What is the remainder when 76861 is divided by 9607? 5 What is the remainder when 7760 is divided by 7741? 19 Calculate the remainder when 50839 is divided by 5638. 97 Calculate the remainder when 185478 is divided by 177. 159 Calculate the remainder when 203436 is divided by 15. 6 Calculate the remainder when 220431 is divided by 184. 183 What is the remainder when 68295 is divided by 142? 135 Calculate the remainder when 3456 is divided by 382. 18 What is the remainder when 263947 is divided by 24? 19 Calculate the remainder when 2125 is divided by 158. 71 What is the remainder when 73743 is divided by 49? 47 What is the remainder when 4582 is divided by 2069? 444 Calculate the remainder when 41325 is divided by 530. 515 What is the remainder when 2279 is divided by 185? 59 What is the remainder when 2207 is divided by 189? 128 What is the remainder when 21663 is divided by 439? 152 Calculate the remainder when 305252 is divided by 237. 233 Calculate the remainder when 231314 is divided by 12. 2 Calculate the remainder when 289 is divided by 157. 132 Calculate the remainder when 303552 is divided by 68. 0 What is the remainder when 4375 is divided by 314? 293 Calculate the remainder when 8986 is divided by 219. 7 What is the remainder when 471518 is divided by 5547? 23 What is the remainder when 19391 is divided by 141? 74 Calculate the remainder when 342503 is divided by 426. 425 What is the remainder when 12474 is divided by 137? 7 What is the remainder when 91965 is divided by 2478? 279 Calculate the remainder when 12915 is divided by 498. 465 Calculate the remainder when 130150 is divided by 6507. 10 What is the remainder when 711172 is divided by 439? 431 Calculate the remainder when 22727 is divided by 22524. 203 What is the remainder when 11890 is divided by 399? 319 What is the remainder when 532373 is divided by 149? 145 Calculate the remainder when 135962 is divided by 45318. 8 What is the remainder when 3427978 is divided by 856994? 2 What is the remainder when 11390 is divided by 50? 40 What is the remainder when 2273226 is divided by 46? 44 Calculate the remainder when 2794 is divided by 570. 514 Calculate the remainder when 37209 is divided by 71. 5 What is the remainder when 49881 is divided by 182? 13 What is the remainder when 13105 is divided by 328? 313 Calculate the remainder when 2380 is divided by 868. 644 What is the remainder when 10610 is divided by 3514? 68 C	{ "pile_set_name": "DM Mathematics" }
to base 16. a43a -41 (base 13) to base 15 -38 11354 (base 6) to base 16 676 34176 (base 9) to base 13 a47c What is 553 (base 8) in base 10? 363 Convert -91 (base 16) to base 3. -12101 Convert -2 (base 15) to base 12. -2 What is -1426 (base 8) in base 12? -55a Convert 12321 (base 4) to base 11. 371 -21010220 (base 3) to base 6 -40040 What is 63ca (base 15) in base 7? 115363 What is -1c2 (base 14) in base 13? -222 -221030 (base 6) to base 8 -43712 Convert 10444 (base 6) to base 10. 1468 45 (base 6) to base 8 35 -564a (base 11) to base 9 -11171 What is -18a (base 16) in base 6? -1454 -4530 (base 15) to base 5 -432140 What is 11100100 (base 2) in base 9? 273 Convert -242 (base 11) to base 13. -192 -10003 (base 11) to base 3 -202002101 What is 100304 (base 6) in base 4? 1323100 Convert -2a7 (base 16) to base 4. -22213 -606 (base 11) to base 14 -3a4 -330005 (base 6) to base 4 -12221111 Convert -11b8e (base 15) to base 9. -85578 -3206 (base 11) to base 7 -15236 What is -1081 (base 14) in base 4? -230221 -1303 (base 4) to base 15 -7a Convert 131 (base 5) to base 15. 2b Convert -9d1 (base 14) to base 4. -132123 What is 28 (base 16) in base 2? 101000 1001110000 (base 2) to base 3 212010 8170 (base 9) to base 11 4543 Convert -1304 (base 15) to base 6. -30434 Convert -52 (base 14) to base 15. -4c -a710 (base 14) to base 7 -150020 28958 (base 12) to base 6 1114152 Convert 18230 (base 10) to base 6. 220222 -6a8 (base 14) to base 15 -5d4 271 (base 9) to base 15 101 Convert 1110110000 (base 2) to base 14. 4b6 -76502 (base 8) to base 6 -404242 Convert 365 (base 8) to base 6. 1045 1dc (base 15) to base 14 22c Convert 99 (base 16) to base 4. 2121 What is 1623 (base 8) in base 7? 2445 -205 (base 8) to base 11 -111 -443 (base 6) to base 11 -146 -114245 (base 6) to base 11 -75a5 Convert -1304 (base 7) to base 13. -2c0 Convert -c7 (base 16) to base 12. -147 Convert -14 (base 7) to base 12. -b Convert 34431 (base 10) to base 7. 202245 What is a264 (base 16) in base 4? 22021210 What is -303211 (base 6) in base 8? -56767 What is -10001010110101 (base 2) in base 14? -3349 -100010011 (base 2) to base 4 -10103 What is -11047 (base 8) in base 3? -20101010 Convert 1264 (base 7) to base 3. 200001 What is -11844 (base 11) in base 6? -210352 -20003 (base 7) to base 2 -1001011000101 Convert 210121 (base 3) to base 14. 2d9 Convert -324 (base 9) to base 16. -109 40738 (base 9) to base 16 68de Convert -131301 (base 4) to base 15. -870 What is -440 (base 15) in base 16? -3c0 Convert 34333 (base 5) to base 9. 3342 What is -8964 (base 10) in base 8? -21404 What is 1001100101101 (base 2) in base 8? 11455 Convert -1c289 (base 13) to base 15. -1161b What is 40065 (base 9) in base 10? 26303 What is -5548 (base 9) in base 12? -2452 514 (base 12) to base 14 3a8 What is 4381 (base 9) in base 4? 302200 What is 16496 (base 11) in base 10? 23216 What is 1101032 (base 5) in base 6? 223244 -54b (base 13) to base 12 -638 10200200 (base 3) to base 13 12c0 -2825 (base 10) to base 11 -2139 100110001 (base 2) to base 15 155 1001110100 (base 2) to base 12 444 Convert 332021 (base 5) to base 9. 16710 8f3 (base 16) to base 13 1073 10000100001 (base 2) to base 14 557 3013210 (base 4) to base 14 4924 Convert -111100010010011 (base 2) to base 3. -1120100020 What is -226 (base 10) in base 14? -122 Convert 1266 (base 7) to base 3. 200010 Convert -3503 (base 6) to base 12. -593 What is -112200110 (base 3) in base 5? -320304 Convert 10011100100 (base 2) to base 7. 3436 Convert -11142 (base 5) to base 12. -565 -1100010010111 (base 2) to base 4 -1202113 Convert -1210101 (base 3) to base 8. -2432 Convert -1182 (base 9) to base 6. -4032 What is 868 (base 15) in base 11? 1476 Convert 400032 (base 5) to base 3. 122011121 Convert -112a (base 12) to base 8. -3562 Convert 2902 (base 12) to base 3. 20112002 What is 1a7 (base 12) in base 4? 10033 -23643 (base 12) to base 2 -1011100111010011 Convert 1244242 (base 5) to base 15. 75d2 291 (base 12) to base 6 1501 241 (base 15) to base 9 627 -39a (base 11) to base 3 -122111 Convert -111101000110000 (base 2) to base 8. -75060 Convert 98a (base 16) to base 11. 1920 What is 1060 (base 10) in base 11? 884 -1001011 (base 2) to base 7 -135 100 (base 9) to base 11 74 Convert 2964 (base 10) to base 12. 1870 8c2 (base 16) to base 13 1036 Convert -f38 (base 16) to base 3. -12100022 What is 3344422 (base 5) in base 12? 2a42a What is 4272 (base 11) in base 8? 13015 7271 (base 13) to base 8 36701 109c9 (base 15) to base 3 2200111000 2425 (base 9) to base 2 11100001101 4050 (base 8) to base 13 c48 -a53 (base 13) to base 15 -7c3 -111 (base 10) to base 11 -a1 -110110101 (base 2) to base 5 -3222 1234 (base 10) to base 7 3412 636 (base 7) to base 4 11001 4016 (base 8) to base 11 1605 Convert -3506 (base 8) to base 2. -11101000110 Convert -5824 (base 11) to base 10. -7649 What is -18027 (base 9) in base 11? -936a 957 (base 11) to base 12 7bb 3717 (base 9) to base 5 42040 1a8 (base 16) to base 2 110101000 -3124 (base 5) to base 15 -1c9 15b2 (base 12) to base 5 40312 1124333 (base 5) to base 10 20593 -32224 (base 7) to base 6 -101021 Convert 32 (base 6) to base 14. 16 What is -210 (base 14) in base 3? -120001 Convert -9b (base 14) to base 7. -254 Convert 110011010111101 (base 2) to base 15. 7bd6 1235 (base 9) to base 6 4135 What is -200122220 (base 3) in base 15? -4070 What is 1005 (base 7) in base 14? 1ac What is -4205 (base 8) in base 5? -32211 -2220221102 (base 3) to base 4 -32003030 Convert 11100101110011 (base 2) to base 13. 6904 Convert -6c9a (base 14) to base 15. -5937 What is 432012 (base 5) in base 10? 14632 What is -1233424 (base 5) in base 11? -17236 What is -120211 (base 3) in base 10? -427 Convert 12102000 (base 3) to base 15. 127c -10096 (base 10) to base 2 -10011101110000 What is -4000 (base 5) in base 2? -111110100 What is 53a (base 12) in base 16? 2fe What is 1376 (base 10) in base 15? 61b 9a7 (base 15) to base 5 32212 What is -a28 (base 13) in base 5? -23344 Convert 20133 (base 4) to base 3. 202010 Convert 1b22 (base 16) to base 2. 1101100100010 What is a0 (base 11) in base 9? 132 What is -2000 (base 6) in base 12? -300 Convert -183 (base 13) to base 10. -276 Convert 8 (base 12) to base 5. 13 What is 1010111010001100 (base 2) in base 4? 22322030 Convert 11300 (base 8) to base 3. 20120210 What is -224040 (base 6) in base 11? -13332 Convert -833 (base 11) to base 8. -1754 15342 (base 6) to base 8 4716 2220332 (base 4) to base 3 112211112 What is -1434 (base 7) in base 16? -234 What is -38c (base 15) in base 5? -11212 -101233 (base 7) to base 14 -641a Convert 4864 (base 10) to base 2. 1001100000000 231 (base 13) to base 5 3003 40203 (base 6) to base 8 12213 What is -629 (base 11) in base 5? -11012 527 (base 11) to base 15 2c4 Convert -22 (base 9) to base 16. -14 Convert 3010 (base 6) to base 13. 3b4 Convert -1011101001110 (base 2) to base 12. -3552 2040 (base 9) to base 16 5d6 Convert 7a53 (base 13) to base 11. 1196a What is -33137 (base 12) in base 9? -112627 -1232 (base 12) to base 11 -15a8 What is -4451 (base 16) in base 2? -100010001010001 -13012 (base 4) to base 9 -554 -362 (base 12) to base 9 -622 What is -54101 (base 6) in base 16? -1cd5 -6646 (base 13) to base 4 -3132232 Convert 1719 (base 15) to base 3. 20211020 Convert 325a (base 14) to base 11. 65a3 -2034 (base 5) to base 3 -100222 Convert 1001010110 (base 2) to base 12. 41a Convert da3c (base 14) to base 6. 450250 1001000000010111 (base 2) to base 4 21000113 What is 7c82 (base 16) in base 2? 111110010000010 Convert 35a (base 11) to base 8. 654 Convert 273 (base 14) to base 13. 2bc 93a (base 16) to base 2 100100111010 220033 (base 4) to base 8 5017 429 (base 11) to base 12 36b What is -3120 (base 5) in base 15? -1c5 -5195 (base 10) to base 5 -131240 Convert -2120202020 (base 3) to base 9. -76666 Convert 172 (base 9) to base 2. 10010010 What is 171 (base 11) in base 8? 307 8372 (base 15) to base 7 143666 Convert 2602 (base 7) to base 3. 1100101 What is -13a3 (base 14) in base 8? -6623 Convert 123441 (base 5) to base 4. 1030013 Convert 1101022 (base 3) to base 7. 2636 Convert -b90 (base 12) to base 8. -3234 1c11 (base 13) to base 14 178b 50600 (base 7) to base 15 399e What is -2a (base 15) in base 4? -220 What is -33	{ "pile_set_name": "DM Mathematics" }
t is the difference between 85.8185796 and 0.0466? 85.7719796 What is -85 - 4.39542659498? -89.39542659498 What is -0.3 plus 4273444610069? 4273444610068.7 -0.0213829102531 + -1.9 -1.9213829102531 What is 0.9 less than 47365.74551? 47364.84551 What is -584850948069 - -0.4? -584850948068.6 What is 0.09 - 59643999676.9? -59643999676.81 0.011087+6569486.85 6569486.861087 What is 1530373.9 plus -40689816? -39159442.1 Total of 127928 and -0.22348745. 127927.77651255 Total of 921036485 and -215636. 920820849 Calculate -2.948751 - 248653.9. -248656.848751 What is -881392 take away 333309? -1214701 Calculate 25706.1734522694 - 0. 25706.1734522694 Calculate 1.78 - 1526125536.6. -1526125534.82 What is 666937 take away 452313? 214624 Put together -0.0327 and 255828488. 255828487.9673 What is the difference between -31017.2 and 188.65152? 31205.85152 What is the distance between -0.1572 and 9631594098.9? 9631594099.0572 Add 0.5 and 4.37889400948. 4.87889400948 What is 0 + -1572239408307? -1572239408307 Work out -28314512452842 - -0.2. -28314512452841.8 Add -2658.42 and -0.126379698. -2658.546379698 Add 243.6 and 0.426809. 244.026809 What is -968.024465441 less than 164? 1132.024465441 Work out -0.3 - -9904411428541. 9904411428540.7 10880125.1 + -6686 10873439.1 What is the difference between 38736 and 0.07393127? 38735.92606873 Total of -1163894537884 and 0.01. -1163894537883.99 Total of 25029463422 and -0.08. 25029463421.92 -19.38+1.65609673 -17.72390327 -119649327+-3.235 -119649330.235 What is 0.06826 minus 4996916? -4996915.93174 Work out 118.342 - 563.820856. -445.478856 Total of -0.118773 and 74593460. 74593459.881227 Total of -0.270972 and 2440329. 2440328.729028 Add together 3 and -7862269999. -7862269996 -5 + -58532481936 -58532481941 Work out -7 + 259883959032. 259883959025 What is 217.25 - 543935406? -543935188.75 Total of 12 and -87484628195. -87484628183 Total of -0.4 and 590066180.765. 590066180.365 What is the difference between 46716888.5 and 99.92? 46716788.58 Put together 116327 and -0.0215291343. 116326.9784708657 What is -2964857 less than -40908171? -37943314 Work out -124539543473 - 0.1. -124539543473.1 Add -343 and -1.38876469. -344.38876469 0.064 - 146365.83267 -146365.76867 -2 - 16087.352910379 -16089.352910379 Add together 1043530007386 and 0.5. 1043530007386.5 Calculate -2079 + 5817724.646. 5815645.646 What is 863614 plus 1.19814? 863615.19814 What is -92 less than 9704.7924877? 9796.7924877 What is the difference between -5 and 3147614061817? 3147614061822 Total of -73 and 72978694934. 72978694861 Calculate 246452235.5 + 541. 246452776.5 283702702633 - -532 283702703165 Subtract -4048646 from 29.426. 4048675.426 Subtract -0.668351734 from -0.0161. 0.652251734 Total of -0.068426491 and -372539. -372539.068426491 What is 0 minus 16104801.776558? -16104801.776558 What is -5450.6436906 take away 0.0963? -5450.7399906 What is -10389644817.4 + 1094? -10389643723.4 Calculate 5.16649055 + 47. 52.16649055 Sum -1.07780280253288 and 6. 4.92219719746712 Put together -6156 and 560812447. 560806291 What is 15236924 + 4347? 15241271 -0.11+76526908542 76526908541.89 What is -825295013 - 167211? -825462224 Add 23045983 and -9842.08. 23036140.92 2 - 0.1721228600042 1.8278771399958 Total of -0.0222414 and -122382. -122382.0222414 Calculate -314563848 + -0.35. -314563848.35 What is -2236.1002771 minus 0.1562? -2236.2564771 -28115 + -3.1913139 -28118.1913139 Put together -1369.20115007 and -122. -1491.20115007 What is -286 - -0.4676925? -285.5323075 Add together -21 and 201463569.68. 201463548.68 Subtract -0.16 from -321.57588623984. -321.41588623984 What is -5531.7335489 less than -45.9? 5485.8335489 -59980.715046+0.014 -59980.701046 Work out 25 - 612326903763. -612326903738 Add 204853 and 0.2708704. 204853.2708704 Add 111722106100197 and -4. 111722106100193 Total of -0.18 and -3069188697791. -3069188697791.18 What is the difference between -20968.4 and -97253.9? 76285.5 What is -1.0167175 minus 276676? -276677.0167175 Put together -3 and 108200818481508. 108200818481505 Subtract 56369.37 from -200.54. -56569.91 Calculate -0.3 + -7037867943574. -7037867943574.3 -3807428843628+1 -3807428843627 What is 148.31175 plus -177256? -177107.68825 Sum -79475166742 and 0.0093. -79475166741.9907 What is 127241491458 + 2121? 127241493579 Calculate 4.6 + -0.3729742436208. 4.2270257563792 Put together -0.8556946 and 5819. 5818.1443054 -96147329+-7222.06 -96154551.06 -1.06+-779.977969 -781.037969 What is 22.62526 + 6317.69? 6340.31526 Work out -32968 + 3300796. 3267828 Work out -67922.5836 + -7. -67929.5836 Work out -0.061 + -5628788845. -5628788845.061 Add 578887 and -297.152. 578589.848 What is 345171742765 less than 179? -345171742586 What is the distance between -2 and 172621355502409? 172621355502411 What is 43487.7985 plus 0.39532? 43488.19382 0.4 - -18.3781644917343 18.7781644917343 What is the distance between 148758 and 11.44773? 148746.55227 Total of 0.02 and 33893772426673. 33893772426673.02 What is 0 less than -21840.345107? -21840.345107 10318.096 + 28762 39080.096 Work out -116074560 + -0.0434468. -116074560.0434468 What is -72.6385775 minus -94.552? 21.9134225 What is -3706 minus -132960584? 132956878 What is -276422.311 take away 1135339? -1411761.311 Add 10487965 and 11231109. 21719074 Total of 308918679662594 and 3. 308918679662597 Put together 3051.0569 and 82. 3133.0569 796 - 3671007635 -3671006839 Sum -64434 and 2414553970. 2414489536 What is 0.1 plus 0.04025278879? 0.14025278879 What is 63 plus -0.274563833968? 62.725436166032 Sum 3.6286 and -36633792. -36633788.3714 What is -6344135431787 + 2? -6344135431785 Calculate -87086507780.9 - -6. -87086507774.9 What is the distance between 0.1 and -7927.43954377? 7927.53954377 What is the distance between 535.757 and 3356240? 3355704.243 Calculate 10762 + -9629541486. -9629530724 Put together -12 and 74.46715053. 62.46715053 What is the distance between 3.1 and 5520968094.1? 5520968091 -879.2 - 7519856828 -7519857707.2 Subtract 2 from -1161037953652. -1161037953654 What is -75 plus -2342734407742? -2342734407817 What is 0.1055111 less than 348175? 348174.8944889 What is -0.0589 minus 220762257? -220762257.0589 What is -195524325.30075 less than -0.2? 195524325.10075 -26493156 - 147383 -26640539 Total of 34.18 and 1058438186. 1058438220.18 What is the distance between -24178173738 and -0.041? 24178173737.959 0.69499 - 5616152504 -5616152503.30501 Add 13614448 and -7.86. 13614440.14 What is 1 minus -381527489938? 381527489939 Subtract 159598.347907 from 38. -159560.347907 What is 1538.719076232 less than 4? -1534.719076232 -34.4336843786 - 0.2 -34.6336843786 What is the difference between -889029985556 and -0.5? 889029985555.5 What is -92792884658 + -3.3? -92792884661.3 What is 44555 take away 3.7556684? 44551.2443316 6336440 + -35013407 -28676967 Add together -1162 and -7247662010.5. -7247663172.5 What is the distance between 29.216651 and 16.54? 12.676651 Sum -364536 and 17.7234. -364518.2766 Calculate 0.1 + 1268819485.1. 1268819485.2 What is -0.317 minus -17.24267003809? 16.92567003809 Put together -43401.0732 and 80.98. -43320.0932 What is -52.2493 take away -46.732? -5.5173 Calculate -1.1 - 8066900156. -8066900157.1 What is -8898521270.03715 + -0.2? -8898521270.23715 Subtract -18 from -67310838526. -67310838508 Put together 2 and 1508.2138623111. 1510.2138623111 What is -8 - 3367198744.8? -3367198752.8 Calculate -1405038067 - -18.182. -1405038048.818 What is -17 minus 383815530749? -383815530766 Calculate -24968761 + 1.7488. -24968759.2512 What is 1206305200 less than -0.22? -1206305200.22 666.531032 - 149836 -149169.468968 -0.28536 + -6296815 -6296815.28536 12.50242889 + 10729 10741.50242889 -37.63785829559 - -0.01 -37.62785829559 What is the difference between -52060885 and 35732? 52096617 Work out -3601.63642 + 76.4. -3525.23642 Work out 0 + 0.2229633115468. 0.2229633115468 Calculate 4 + -990612011.51. -990612007.51 42.44406+-5614689 -5614646.55594 Calculate -20775306279.3 + 2003. -20775304276.3 What is 75.826 - 33204.03? -33128.204 -1709351+-1873415 -3582766 What is 4 take away -283717207219? 283717207223 What is 471.567273 take away 293467? -292995.432727 What is -4.78 minus 112.6809115	{ "pile_set_name": "DM Mathematics" }
= 7o - 11o + 867. What is the highest common divisor of b and o? 27 Let q be (-2)/(-7) + (-26)/(-7). Let m be q-134/(-4). Suppose m = 5u - 6. What is the highest common factor of u and 2? 2 Suppose -3i = 3o - 39, 2i - 37 = -3o - 0i. Calculate the highest common factor of o and 77. 11 Suppose -424 = -3q + 4t, 0q + 574 = 4q - t. What is the greatest common divisor of q and 18? 18 Suppose l = -3m - 0m + 16, 0 = 5m - 2l - 12. Suppose mz - 660 = -0z. Suppose -2h = -27 - 3. What is the greatest common divisor of z and h? 15 Suppose -2m - 3 = -5. Calculate the highest common divisor of m and 4. 1 Suppose 0 = -3h + 5 + 1. Suppose -24 = -hl - l. Let d be (960/9)/(-8)48/(-10). What is the greatest common factor of d and l? 8 Let k be -4 - (0 + -2 - 222). What is the highest common factor of k and 22? 22 Let r(v) = 4v - 25. Let m be r(12). What is the greatest common divisor of m and 207? 23 Suppose 0l + 4l = 12. Suppose -lz + 14 = -g + 6, 2g = -5z + 28. Suppose -zd + 289 = -71. What is the greatest common factor of 10 and d? 10 Let r be (-2)/(-1) - 1 - (-154)/7. Calculate the greatest common divisor of 115 and r. 23 Suppose -4m - 40 = -4q, 5m + 9 = 2m. Suppose 4y - 5 = q. Suppose -h + 0x = 2x - 15, -yh + 9 = -3x. What is the greatest common divisor of 21 and h? 7 Let h be (-43)/(-5) - (-4)/10. Let w = -2 + 5. What is the greatest common factor of w and h? 3 Suppose 0 = -3z + 5235 - 1893. Let p be z/14 - 12/(-28). Calculate the highest common divisor of p and 32. 16 Let i be 252 + (-6 - -38)/8. What is the highest common divisor of i and 27? 27 Suppose l + 4l - 40 = 0. Suppose 2c - a - 642 = -0c, 3c + 4a - 952 = 0. Suppose -4v + 32 + c = 0. Calculate the highest common divisor of l and v. 8 Let m = -7 - -8. Let x = m + 10. Let i = 102 + -58. Calculate the greatest common factor of x and i. 11 Let n(a) = 2a3 - a2 - a - 3. Let g be n(5). Calculate the greatest common divisor of 31 and g. 31 Suppose -19 = 2n - 31. What is the greatest common factor of n and 42? 6 Suppose 2y = 6 + 16. Let i = 44 - 18. Let u = 81 - i. What is the highest common factor of y and u? 11 Let v(f) = -f + 8. Let w be ((-1)/(-3))/((-2)/(-36)). Let q be v(w). Calculate the greatest common factor of 18 and q. 2 Let r = -15 - -1. Let b be 2 - 7/(r/(-60)). Let t be (-8)/b - (-194)/7. What is the highest common divisor of 14 and t? 14 Let y = 11 + -8. Suppose -16p + 13p + 18 = 0. What is the highest common factor of p and y? 3 Let n(t) = 4t2 - 9. Let g be n(-6). What is the greatest common divisor of 15 and g? 15 Let o(w) = 2w*2 + 4w + 2. Let x be o(-2). Let n = 2 + x. Suppose nf + 0f - 32 = 0. What is the highest common divisor of f and 72? 8 Let t be ((-14)/4)/((-4)/8). What is the greatest common factor of 35 and t? 7 Suppose 62 = 3v + 2z, -1 + 10 = v + 3z. Let u(m) = m3 + 7m*2 - 2m. Let n be u(-5). Calculate the greatest common factor of n and v. 12 Let a be 0(0 + 1/1). Suppose -21 = -5d + 2b, ab - 2b = 3d - 19. What is the highest common divisor of 40 and d? 5 Let t(d) = -d2 + d + 6. Let x be t(0). Calculate the highest common divisor of x and 6. 6 Let p(c) = c2 - 5c - 74. Let d be p(-10). Calculate the highest common factor of 190 and d. 38 Let r(z) = -z2 - 10z + 12. Let w be r(-8). What is the greatest common divisor of 21 and w? 7 Suppose -u - 4 + 6 = 0. What is the greatest common factor of 5 and u? 1 Suppose 0n = 4n. Suppose 3i + i = n. Suppose i = x - 0 + 2, 2k - 32 = 3x. What is the greatest common factor of 26 and k? 13 Let d be (-33)/(-4)8/3. Calculate the greatest common divisor of d and 2. 2 Suppose 0k + 36 = 3k. What is the greatest common divisor of 132 and k? 12 Let h(i) = 2i2 - 2i + 1. Let y be h(2). Let b(s) = 2s + 5. Let p be b(y). Let f = 128 - 83. Calculate the greatest common factor of f and p. 15 Suppose -5s - 36 = -3i - i, -2i - 4s = -18. What is the greatest common factor of i and 99? 9 Let w be (2 - 4)2/(-4). Let s be (-74)/(1 + -3) + -1. Let b be (-3)/6s/(-2). Calculate the greatest common divisor of w and b. 1 Let h(q) = 2q*3 + 6q*2 + q + 10. Let z be h(-3). What is the highest common divisor of 2 and z? 1 Let f = 268 + -136. Calculate the greatest common divisor of f and 12. 12 Let y(z) = -31z. Let c be y(-1). Suppose -4m + 113 = -c. Let v be ((-54)/5)/((-1)/5). What is the highest common factor of v and m? 18 Let o be (3/6)/((-1)/(-6)). Suppose 4w = ow + 446. Suppose 0 = -4f + 86 + w. What is the highest common factor of f and 19? 19 Let p(h) = 11h - 8. Let a be p(4). Calculate the greatest common divisor of a and 4. 4 Suppose -3y + 68 = 4f + 11, 2y = -3f + 43. Let q be (6 - 1)(-2)/(-2). Suppose 0 = -qz + z + 12. What is the highest common factor of z and f? 3 Suppose 0 = 7y - 3y - 28. What is the greatest common divisor of y and 77? 7 Suppose -q = 5x + 2q - 618, 2x - 3q - 264 = 0. Calculate the greatest common divisor of x and 18. 18 Let l be 2(5 + 6/(-2)). Suppose 2v + lt = 19 + 1, 5v - t = 28. Calculate the greatest common factor of 54 and v. 6 Suppose h = 3v + 1, -4h + 40 = -v - 2v. Calculate the highest common factor of 143 and h. 13 Let f = 6 + -9. Let x(c) = c - 9. Let z be x(7). Let d = z - f. Calculate the greatest common factor of d and 5. 1 Let m(s) = 16s - 93. Let f be m(7). Calculate the greatest common factor of 19 and f. 19 Let s = -113 + 114. Suppose -2z + 0z = -14. What is the greatest common divisor of s and z? 1 Let q(d) = 27d - 18. Let w be q(6). What is the highest common factor of 16 and w? 16 Suppose -m + 112 = -5. What is the highest common divisor of 13 and m? 13 Let u be (1 - 1)/(2-1). Suppose -f + 128 - 11 = u. Suppose 0 = 3i - 4i + 13. What is the greatest common factor of i and f? 13 Let n be -2 + ((-72)/10)/(1/(-5)). What is the greatest common divisor of 17 and n? 17 Let h = -6 + 10. Suppose -ho + 15 = 3. Calculate the highest common factor of 12 and o. 3 Let o = 144 + -80. What is the greatest common divisor of o and 8? 8 Let c = 2 + 0. Suppose f = -3 + c. Let s be (f + -49)(-1)/2. What is the greatest common factor of s and 5? 5 Suppose 7x + 50 = 2x. Let n be (198/x)/((-12)/40). What is the greatest common factor of 6 and n? 6 Let b(k) = 4k - 23. Suppose 5m + 2 = 57. Let t be b(m). What is the highest common factor of 7 and t? 7 Suppose 2i - 6i + 12 = 5y, -4y = 5i - 6. Let b be i/5 - (-128)/20. What is the highest common factor of 66 and b? 6 Let r be 2 + 2 + 2 + -6. Suppose -m - 2m = 5j - 39, -j - 4m + 18 = r. Calculate the highest common factor of 3 and j. 3 Suppose -2l - 3b + 50 = 0, 4l - 94 - 6 = 3b. Suppose -l = 2m - 79. Calculate the greatest common divisor of m and 135. 27 Let s = 154 - 106. Calculate the greatest common divisor of s and 48. 48 Let j(y) = -5y - 3. Let t be j(-3). Let h = -3 + 13. Suppose 2 = 2a - h. What is the highest common factor of a and t? 6 Suppose 49 + 83 = 2x. Suppose 4 - 10 = -i. Calculate the greatest common factor of i and x. 6 Let o be (-9)/(27/8)-120. Calculate the highest common divisor of 40 and o. 40 Suppose -3y - 2t + 3t + 37 = 0, y - 3t = -1. Suppose c - 25 = -4. Calculate the highest common divisor of c and y. 7 Suppose 15o - 149 = 106. What is the greatest common divisor of 187 and o? 17 Let x be (-4)/14 - (-80)/35. Let z(y) = -y3 - 8y*2 - 15y - 8. Let w be z(-6). What is the highest common factor of x and w? 2 Let a be 5/(-15) - (-38)/(-3). Let q = 17 + a. Suppose -4i = -4t + 124, -4i + 44 = -t + 3t. Calculate the highest common factor of t and q. 4 Suppose -5y + 31 + 59 = 0. Calculate the highest common divisor of y and 9. 9 Let x be 246 + -1(3 - 0). Calculate the highest common divisor of x and 27. 27 Let x = 14 + -9. Let k(a) = -13a - 4. Let n be k(-3). What is the greatest common factor of x and n? 5 Suppose -4 = 3v - 4v. Suppose 3s - 5b + 4b - 6 = 0, 4s - b = 8. What is the greatest common factor of v and s? 2 Let v(y) = 38y*3. Let r be v(1). Suppose 4s + 2b = 84, 0 = 3s + s + 5b - 96. What is the greatest common factor of r and s? 19 Let u be (-33)/(-9) - 1/(-3). Let v = u + -4. Suppose 5g + v*g = 50. What is the highest common divisor of 30 and g? 10 Let g be (1/((-1)/6))/(-2	{ "pile_set_name": "DM Mathematics" }
Sort 5, z, y in decreasing order. 5, z, y Let y(w) = -w*2 - 2w + 45. Let o be y(-8). Put 5, o, -2, -11/4 in descending order. 5, -2, -11/4, o Let z(m) be the third derivative of m*4/24 + 3m*3/2 + 18m*2. Let q be z(-8). Sort q, 9, 4 in decreasing order. 9, 4, q Let t = -7 - -2. Let n(z) = -2z*3 - 10z*2 + z + 3. Let v be n(-5). Put 1, -3, t, v in ascending order. t, -3, v, 1 Let x = 79 + -79.5. Sort -30, -1, x. -30, -1, x Let a = 3.7 + -4. Let o = -35.86 - -36. Let c = o - 0.1. Put c, a, -4/3 in descending order. c, a, -4/3 Let c = 16 - 16.02. Let d = -3.98 + c. Put -2/9, 0.5, d in increasing order. d, -2/9, 0.5 Let p = -2 + 5. Let a = 19144 + -19121. Put -4, p, a in decreasing order. a, p, -4 Let s = 21 + -19. Suppose s = 3l - 13. Let k = -4 - -7. Put 4, k, l in descending order. l, 4, k Let l = 0.1 - 0. Let h = 1.5 + -2.1. Let z = h + l. Sort -0.3, 2/5, z. z, -0.3, 2/5 Let m = 7/8 + -1/8. Let a = -170.7 - -159. Let v = a - -12. Sort v, -0.4, m. -0.4, v, m Let n(k) = 4k. Let v be n(1). Suppose t = 3z, 2t = -5z - t. Suppose z = -u - u - 2. Sort u, -5/3, v. -5/3, u, v Let f(g) = g*2 - 3g - 18. Let a be f(6). Suppose 0 = 4m, -2k - m = -0k + 2. Put a, 3, k in decreasing order. 3, a, k Let p(h) = 15h + 1169. Let v be p(-78). Put v, -29, -6 in descending order. v, -6, -29 Let a(n) = 2 - 1 + 26n - 17n + n*2. Let b be a(-9). Let x(u) = -u + 3. Let l be x(6). Put -10, l, b in decreasing order. b, l, -10 Let w = -236 + 235. Let n(z) = -z - 2. Suppose -2x - x = 12. Let b be n(x). Put b, w, 4 in decreasing order. 4, b, w Let g = -13.55 - -13.25. Sort -79, 1/4, 3, g in ascending order. -79, g, 1/4, 3 Let w = -75 - -65. Let b be (-138)/w - (-4)/(-5). Sort b, -3, 1 in decreasing order. b, 1, -3 Let p = 2190 + -2188. Put 1, p, 146 in decreasing order. 146, p, 1 Let h = 1030 + -995. Put 0.3, h, 0.2 in decreasing order. h, 0.3, 0.2 Let a = 2.88 + -3.88. Put a, -26, -3 in decreasing order. a, -3, -26 Let n(s) = -s3 - s2 + 2s. Let q be n(1). Sort 64, 3, q in ascending order. q, 3, 64 Let r = -89 - -87. Let j = -5.01 + 0.01. Put -4, j, r in descending order. r, -4, j Let b = 283 - 284. Put b, 5, 16 in ascending order. b, 5, 16 Let j = 2.9 + 4.1. Sort -1/2, -1, j, 0.5 in ascending order. -1, -1/2, 0.5, j Suppose -2u - 2p = 0, 3u - 2 = 5u + 3p. Suppose 3o - 8 = 3j - 2o, -5j - 9 = -4o. Put j, 4, -3, u in descending order. 4, u, j, -3 Let o = 248 - 244. Suppose 0 = 7j + 7 + 7. Sort 3, o, j. j, 3, o Suppose -54y + 4 + 64 = 14. Suppose -3p = -5d - 6p + 30, -2d - 2p + 12 = 0. Let z be (-4)/6(-45)/d. Sort z, 2, y in descending order. z, 2, y Suppose -2x = -x. Suppose 0m + m + 5 = x. Let b(j) = j3 - 4j*2 - 3j - 5. Let z be b(5). Sort m, -1, z. m, -1, z Suppose -4u + 7 - 3 = 0. Let n be -7 + (-10)/((-680)/484). Put n, u, -2/11, -2 in ascending order. -2, -2/11, n, u Suppose 165 = 2h + h. Suppose 3u = -2u - h. Let n = -7 - u. Put n, 2, 6 in decreasing order. 6, n, 2 Suppose 0n - 5n = 0. Let f be (n + 1/1)/(-1). Let m be 3 + (4/6 - (-14)/(-21)). Sort m, 1, f. f, 1, m Suppose -5 = a, -i + 2a + 18 = -18. Let q be i/(-7) + (-2)/7. Suppose -109p = -96p - 52. Sort 2, p, q in decreasing order. p, 2, q Suppose -3v + 13 = -3r - 11, 0 = -2v - 3r - 9. Suppose 0 = -3y + vl + 21, -4y - 7l = -3l - 12. Sort -2/7, 3/4, y. -2/7, 3/4, y Let l = -60 - -50. Let i(f) = -2f + 31. Let k be i(18). Put 0, l, k, 4 in ascending order. l, k, 0, 4 Let n(i) = -i3 - 8i*2 - 11i + 24. Let h be n(-5). Sort -2, h, -2/7 in ascending order. -2, -2/7, h Suppose 21 = 2x + 5r, -2x - 6 = -5r + 3. Suppose 26z - 29z = 24. Sort -3, z, x. z, -3, x Let s = -12 - -10. Let c be ((-48)/28)/(s/7). Sort -4, -1, c. -4, -1, c Let o(p) = -p3 - p2 - 13. Let c be o(0). Let m = 10 + c. Let a be (-2 - m)/((-9)/15). Sort a, -1/6, -3 in ascending order. -3, a, -1/6 Let p = -6 - -10. Let f(d) = d*3 - 17d*2 + 24d + 92. Let n be f(15). Sort n, -1, p, -5. -5, -1, n, p Let w = 2.779 - -17.221. Sort w, 4/7, 1/5 in ascending order. 1/5, 4/7, w Suppose -122 = 6x - 152. Put 0.5, -104, x in ascending order. -104, 0.5, x Suppose 2t + b = -3b - 4, -b + 8 = -4t. Let w be (-3)/368 - 3/9. Put t, 1, w in ascending order. t, w, 1 Let o(h) = -5h + 0h + h + 2h + h*2 - 31. Let n be o(7). Put -4, n, 13 in descending order. 13, n, -4 Let j = 6 - 2. Suppose -5s + 0s = 25, 0 = -3i - 5s - 22. Let x = 5 + -3. Sort i, j, x in decreasing order. j, x, i Let p = 28.7 - 28.72. Sort p, 4/3, 0.3, -5 in descending order. 4/3, 0.3, p, -5 Let i be (-3)/(-9)(2 - -13). Let k be (-1)/3 - (-105)/(-9). Let d be i/(-2)k/(-15). Put -4, d, -3 in increasing order. -4, -3, d Suppose -15c = -16c + 5. Suppose 4r = -5d, -3d - 3r = 2d + c. Sort 1, d, -2 in decreasing order. 1, -2, d Let g = -1.2 - 0.8. Let m = -7 - g. Sort -2, m, -0.3 in increasing order. m, -2, -0.3 Let i = -3 + 2. Let x be 0 + i(0 - -4). Let u = 44.84 + -44.84. Sort 5, u, x in ascending order. x, u, 5 Suppose 3q - 2q = -5u + 9, 4q - 102 = 2u. Suppose 2n - 6n + q = 0. Let v be 0 + -1 + n/3. Put v, 4, 3 in increasing order. v, 3, 4 Suppose 7 = n - 0. Let z = -0.19 + -2.81. Put 3, z, n in increasing order. z, 3, n Let v = -1259.5 + 1259. Put -0.1, v, 2/7, -0.26 in increasing order. v, -0.26, -0.1, 2/7 Let f(y) = 2y2 + 38y - 1. Let i be f(-19). Let l be (i - -1)/(0 + 1). Sort 5, 3, l. l, 3, 5 Let s = -1756 - -1751. Let t = -6 - -2. Sort t, 0, s, 4. s, t, 0, 4 Let g = -6.4 + 4.1. Let d = g - -2.8. Put d, 0.4, 5/2, 3/4 in decreasing order. 5/2, 3/4, d, 0.4 Suppose 0 = -3l + 2g + 370, 375 = 6l - 3l + 3g. Sort l, 2, -4 in descending order. l, 2, -4 Let w = -118 - -124. Suppose 4v + 9 + 13 = 5i, -5i - 2 = 4v. Put w, v, -7, -2 in increasing order. -7, v, -2, w Let g(r) = -r2 - 4r + 7. Let x be g(-5). Suppose -b = -3p + 15, -2p = 3b - 12 + x. Let h be p/(-5)(18 - -1). Put h, -5, -2 in ascending order. h, -5, -2 Let b be 2/5(-5)/13. Let w = 409 + -409.2. Sort b, w, 0. w, b, 0 Let x be (2 - 2)/(3 + -4). Suppose -4p = -5y + p, 2y - 3p + 4 = x. Suppose 10d = 5d. Put y, 2, d in increasing order. d, 2, y Let o = -2544 + 2539. Suppose 2z - 5z = -3. Put z, -2, o, -3 in decreasing order. z, -2, -3, o Suppose 6 = -i + 4k - 7, 4k - 33 = 5i. Let t(m) = m + 12. Let d be t(-7). Put -3, d, i, 2 in decreasing order. d, 2, -3, i Let v be (-1 + 6/3)/1. Let z be (-118)/28 - (v - 3). Let k = z - -5/7. Sort k, -4, 1 in descending order. 1, k, -4 Let s = -2 - -3. Let h = s + -0.99. Let b = -5.01 + h. Sort b, 0.1, 5/4. b, 0.1, 5/4 Let s = -1 - 5. Let m = -3 - s. Put m, 1/4, 1 in descending order. m, 1, 1/4 Let a = -0.101 - -2.101. Put 2/13, -1, a, 22 in descending order. 22, a, 2/13, -1 Let k(w) = -5w - 6. Let s be k(-1). Let o be (-4)/14 - (-36)/(-21). Sort 16, s, -3, o in decreasing order. 16, s, o, -3 Let j(g) = -g2 - 46g - 335. Let a be j(-37). Put 5, -322, a, 2 in ascending order. -322, a, 2, 5 Let b = -578 + 582. Sort -45, 0, b in ascending order. -45, 0, b Let x = -2.72 + -0.28. Sort -4, -0.5, 0, x in descending order. 0, -0.5, x, -4 Let a = 105 - 65. Suppose 2v - 7v + a = 0. Let b = 10655 + -10658. Put v, b, -2 in decreasing order. v, -2, b Let l(m) = 3m + 35. Let j be l(-12). Put -0.1, j, -0.4, -2 in increasing order. -2, j, -0.4, -0.1 Let d = -22 - -87. Let h = d - 131/2. Sort 5/2, h, -3 in decreasing order. 5/2, h, -3 Suppose 5p + 9d = 8d + 6, -42 = -p + 10d. Let f(s) = -s2 - 5s - 2. Let m be f(-5). Let n be (2/((-2)/2))/2. Sort n, m, p in descending order. p, n, m Let c(s) = s*2 - 3. Let z be c(0). Let f = z - -5. Let p be 6/21 - (-16)/(-7). Sort f, p, -5 in decreasing order. f, p, -5 Let y(u) = -87u - 350. Let x be y(-4). Sort 4, -6, -3, x in descending order. 4, x, -3, -6 Let u be 1/212/(-30). Suppose -4t - 3 = -t. Let c be 5 + (-6 - (t + -1)). Sort c, u, 2 in decreasing order. 2, c, u Suppose 0 = -o - 3, x = 3x - 4o - 26. Let v = -13 + -4. Let b be (v + 22)/(1 - 0). Put b, -2, x in ascending order. -2, b, x Let v be ((-6)/(-10))/((-3)/15). Sort -1, 5, v, -2 in decreasing order. 5, -1, -2, v Let j be (-11)/6 - (-3 - -1). Let b be 15/6 - (5 - 55/10). Put j, 3/2, b, 0.01 in decreasing order. b, 3/2, j, 0.01 Suppose 0r = o - 4r, -3o - 4r = 16. Let f be 2 -	{ "pile_set_name": "DM Mathematics" }
. Let g be 2 + 0 + w + 3. Let q(x) = 6x3 - x2 + 3x - 2. Let r be q(1). What is the highest common divisor of g and r? 3 Suppose -168 - 184 = -8t. Calculate the highest common factor of t and 44. 44 Let d be (2 - -3)/(15/6). Suppose -dy - y = -18. Calculate the greatest common factor of y and 24. 6 Suppose -5t + 2c + 334 = 0, -3t - t + 287 = 5c. Calculate the greatest common divisor of 1156 and t. 68 Let m = -386 - -491. Calculate the highest common factor of 30 and m. 15 Let t be (3564/48)/(2/8). Let z be (2/3)/(6/t). Let a be ((-2)/3)/(2/(-9)). Calculate the greatest common factor of z and a. 3 Let q(n) = -2n + 5n + 8n + 9 + 5. Let z be q(2). What is the greatest common divisor of z and 288? 36 Let g be ((-60)/(-2))/(11 - 10). Let q = -213 + 363. Calculate the highest common factor of q and g. 30 Let o(q) = q3 + 7q*2 - 12q - 78. Let c be o(-7). What is the highest common divisor of 4 and c? 2 Let b be 2/(-13) + (-11745)/(-39). Suppose -3k = -4l - 289, 3k + 2l - b = -0l. What is the highest common divisor of 11 and k? 11 Let a = -11 + 17. Suppose -a + 15 = p. Suppose 28 = 4m - 4u, m - 22 = -4u - 5. Calculate the greatest common divisor of m and p. 9 Suppose 4y - 1972 = 4x, y + 5x - x - 498 = 0. Suppose -18b + y = -5b. What is the highest common factor of 19 and b? 19 Let x be ((-93)/6 - 1)(-340)/15. Suppose o + 22 = -3n + 310, -4n + x = -2o. What is the highest common factor of n and 19? 19 Let x be 1(-1 + (3 - 3) + 3). Suppose 0 = 3c - 6, 2t + x = 2c + 110. What is the greatest common divisor of t and 28? 28 Let z = 12 + -7. Suppose zc - 5t + 425 = 0, 2 = -2c - t - 165. Let s be c/(-8) + (-9)/(-6). Calculate the highest common factor of s and 18. 6 Let c = 14 - 9. Let j = -16 + 20. Suppose 0 = -5x - 4r - 4 - 3, jr = 2x - 14. What is the greatest common divisor of x and c? 1 Let z be 51(-108)/(-30). Let u be (-6)/(-3) + 6 + z. What is the greatest common divisor of 39 and u? 13 Suppose 0 = -4k - 5t - 27 - 140, -t + 5 = 0. Let h = k + 66. What is the greatest common factor of 126 and h? 18 Let m = 38 + -12. Let a = 434 - 235. Suppose -2w + a = -217. What is the greatest common factor of m and w? 26 Suppose -32 = l - 357. Let a = l + -171. Calculate the greatest common divisor of 22 and a. 22 Let o = 179 - 159. What is the highest common factor of o and 500? 20 Suppose -12s - 17 = -53. Calculate the greatest common divisor of 33 and s. 3 Let i(p) = -p3 + p2 + 5p + 20. Let y be i(0). Suppose -3g + g - l + 20 = 0, g + l = 12. What is the highest common divisor of y and g? 4 Let r be (-39)/(-10) - (-27)/270. Let y be ((-1)/(-1))/(1/2). Suppose -4z + 14 = -y. Calculate the greatest common factor of r and z. 4 Let t be (3 + -2)-1 - 0. Let f be (-70)/(-20) - t/(-2). Suppose fy + 0y = 33. Calculate the greatest common divisor of 11 and y. 11 Let u be (-8 - -1)/(12/(-36)). Suppose t - 3 = -3m - 15, 2t + 4m = -14. What is the highest common divisor of u and t? 3 Let g(y) = 2y*2 - 2. Let c be g(3). Let h = 15 - 21. Let x be (-23)/(h/40). What is the greatest common divisor of c and x? 8 Let n = -663 - -674. What is the highest common factor of 31 and n? 1 Let f = 377 - -176. Suppose -4r = -f + 217. Calculate the greatest common divisor of r and 12. 12 Suppose -w + 4w - 54 = 4h, 0 = h + 3w + 21. Suppose y - 28 = -o, 4o - 4y + y = 98. Let u = o + h. What is the greatest common factor of u and 1? 1 Let c(u) = u*3 + 9u*2 - 33u + 73. Let t be c(-12). What is the greatest common divisor of t and 111? 37 Suppose w = 5w - 144. Let g be 8/12 + (-56)/3. Let i be 9/g + 37/2. What is the greatest common divisor of w and i? 18 Let u be 4 - 7 - (-13 + 10). Suppose -75 = -0x - 5x. Suppose b = -u + x. Calculate the greatest common divisor of b and 45. 15 Let b = 54 - 51. Suppose a + 5 = l + 4, -2a = bl - 13. Suppose 1 + 1 = 2h. What is the greatest common factor of h and a? 1 Let b(d) = -56d - 363. Let t be b(-8). Calculate the greatest common factor of 187 and t. 17 Let a be 1 - (-31)/(-5) - (-9)/45. Let q be 0/(-2) - (a - (-2 + 5)). Calculate the greatest common divisor of 56 and q. 8 Let r(i) = -45i - 9. Let l be r(-2). What is the greatest common factor of l and 27? 27 Let y be (-9)/(-2 - 44/(-24)). Suppose 5x + 2b = -b + 74, -5b + y = 4x. What is the greatest common factor of 16 and x? 16 Suppose -9r + 15r - 54 = 0. Suppose 141 + 183 = ri. Calculate the highest common divisor of i and 12. 12 Let p(m) = m3 - 5m*2 - 4m - 10. Let k be 4/(2(-1 + 0)). Let r be (-27)/(-4) - k/8. Let t be p(r). What is the greatest common factor of 12 and t? 12 Let a be (2 + 2 + -1)(-60)/(-36). What is the highest common factor of 845 and a? 5 Let k be (-6)/(-3)1 - (-629 - -1). Suppose 0 = -3q - 6q + k. Calculate the highest common factor of 28 and q. 14 Suppose 25a - 29a - 86 = -3o, -4a - 146 = -5o. Calculate the greatest common factor of 270 and o. 30 Let n be 3(-3 - (-8)/4). Let d be ((-12)/(-5))/(n/(-10)). Calculate the highest common factor of 8 and d. 8 Suppose 3q + 0q + 4n = 17, 23 = 3q - 2n. Suppose -2x - 1 = -q. Let j = -605 + 632. What is the greatest common divisor of x and j? 3 Let d be (6/(-2))/((-1)/7). Suppose -g + 13 = -d. Let m = -4 + g. Calculate the greatest common divisor of 12 and m. 6 Let d(x) = 21x - 33. Let n(l) = 41l - 65. Let u(y) = 5d(y) - 2n(y). Let b be u(5). Calculate the greatest common divisor of 120 and b. 40 Let j = 1123 + -491. What is the highest common divisor of 8 and j? 8 Let s = 47 + -37. Let t be ((-64)/s)/((-20)/150). Calculate the highest common divisor of 32 and t. 16 Let g(j) = 5j*2 + j. Suppose -w + 0y = 5y - 13, 23 = 5w + 4y. Let c be g(w). What is the greatest common factor of 24 and c? 24 Let t(q) = 2q*3 + 21q*2 + 10q + 20. Let l be t(-10). Calculate the greatest common factor of l and 80. 20 Suppose -n + 4h + 21 = 0, n + n = h + 14. Let a(o) = -n - 1 + 2o + 89o2 + 5. Let p be a(1). Calculate the greatest common divisor of p and 36. 18 Let i(k) = -2k + 12. Let z be i(4). Suppose -zp = 4o - 119 + 3, -3o = 9. Calculate the highest common divisor of p and 16. 16 Let p(b) = 13b - 717. Let r be p(57). What is the greatest common factor of 376 and r? 8 Suppose -2b + k - 1160 = -6b, 3b + 5k = 887. Let n(o) = -o*2 - 29o - 151. Let h be n(-8). What is the greatest common divisor of h and b? 17 Let x = -22 + 42. Let i = 71 + 9. Calculate the highest common divisor of i and x. 20 Suppose 1390 = 4o - 2i, -2o + 4i + 705 = 5i. Let h = 161 + -157. Let n be (h - 10/15)(-63)/(-6). What is the greatest common divisor of o and n? 35 Suppose 13k - 17k = 44. Let b = k + 73. Calculate the greatest common divisor of 93 and b. 31 Suppose 4g + 3 + 25 = 0. Let n be (-3)/g + (-24)/56. Suppose n = 5h - 369 - 396. Calculate the highest common divisor of h and 17. 17 Let c(l) = -3l - 8. Let y be c(-6). Suppose 0 = 9f - yf + 110. What is the greatest common factor of 44 and f? 22 Let u = -16 - -27. Let z(x) = -3x + 78. Let v be z(24). Suppose 5l - 55 = 5g, -5l + 55 = 2g - vg. Calculate the greatest common divisor of l and u. 11 Let g be 38/(-6) - (-6)/(-9). Let m be -1 + g(-3 - -2). Calculate the greatest common factor of 6 and m. 6 Let o be 27/(-6)(2 - 4). Let p = o - -29. Suppose -9 = -3b, -5f + p = 4b - 3b. What is the highest common divisor of f and 7? 7 Let m = 109 - 177. Let o be (m/(-8))/((-2)/(-4)). Calculate the greatest common factor of 51 and o. 17 Let o(g) = g2 + 2g. Let p be o(-6). Let a(b) = 11b - 65. Let u be a(7). Calculate the highest common factor of u and p. 12 Let i(f) = 8f + 246. Let l be i(-26). Calculate the greatest common factor of 703 and l. 19 Suppose -4d + 23 - 387 = -4h, 185 = 2h - 5d. Let f = -15266 - -15401. Calculate the greatest common divisor of h and f. 45 Suppose o + 5t - 93 + 73 = 0, 4o = -5t + 80. What is the highest common factor of o and 70? 10 Let c(m) = 0m + 8 - 10 - 11 + 3m. Let r be c(6). Suppose rl + 31 = 3u - u, -4 = 2u + 2l. What is the greatest common factor of u and 1? 1 Suppose -522 = -16l + 278. Let f = -186 - -261. What is the highest common divisor of f and l? 25 Let n(s) = 19s3 - s2 + 26s - 79. Let i be n(4). What is th	{ "pile_set_name": "DM Mathematics" }
46, 73 Put -0.5, -1, 0.5, -67, 4/3 in increasing order. -67, -1, -0.5, 0.5, 4/3 Put 2/5, -0.5, -13318, 3, -2, 2/11 in ascending order. -13318, -2, -0.5, 2/11, 2/5, 3 Put -1, 26, -5, -3, 5, 362 in descending order. 362, 26, 5, -1, -3, -5 Put 5, 1, -2, -3, 4, 23 in decreasing order. 23, 5, 4, 1, -2, -3 Sort -8, -1, -4, 2, 0, 12 in descending order. 12, 2, 0, -1, -4, -8 Sort -2, -8, -4, 1, -0.6 in decreasing order. 1, -0.6, -2, -4, -8 Put -214, -16, -5, -3, 4, 0 in descending order. 4, 0, -3, -5, -16, -214 Sort -231, 5, -29 in descending order. 5, -29, -231 Sort -1, -3/4, 0.2, 93, 2 in descending order. 93, 2, 0.2, -3/4, -1 Put -9, -5, -6, -1, 16 in decreasing order. 16, -1, -5, -6, -9 Put 2399, 4/5, 2/11, 1 in descending order. 2399, 1, 4/5, 2/11 Put 0.4, 4, -1/6, 4154, 5 in increasing order. -1/6, 0.4, 4, 5, 4154 Sort -2/7, 0.2, 7579/2, 0.1, 2/5 in descending order. 7579/2, 2/5, 0.2, 0.1, -2/7 Put -6, -4, -0.5, 3, -0.2332 in increasing order. -6, -4, -0.5, -0.2332, 3 Sort -10, 2, -273, 3 in descending order. 3, 2, -10, -273 Sort 2/17, -0.0098, -1/2, 67 in ascending order. -1/2, -0.0098, 2/17, 67 Put -7, 2, -3, -1502 in increasing order. -1502, -7, -3, 2 Sort 0, 5, 58974, -5 in ascending order. -5, 0, 5, 58974 Sort -255, 1, -14. -255, -14, 1 Put 1/2, 270538, -1/6 in descending order. 270538, 1/2, -1/6 Sort 30, 29, 21, 5. 5, 21, 29, 30 Sort 12, -4, -3, 2, -2. -4, -3, -2, 2, 12 Put -4, -2, -1, -250480, -3 in descending order. -1, -2, -3, -4, -250480 Sort -3, 2/11, 726.1 in decreasing order. 726.1, 2/11, -3 Sort 5, 3, 29, 1, 215, -1. -1, 1, 3, 5, 29, 215 Put 1, 0.3, -2, -1, -0.45 in decreasing order. 1, 0.3, -0.45, -1, -2 Put 5, 1, 3, -15 in descending order. 5, 3, 1, -15 Sort 31, 10, 0, -261, -3. -261, -3, 0, 10, 31 Put -3, -13372, -4, 3, 4 in decreasing order. 4, 3, -3, -4, -13372 Put -4, 1709, 3, 1 in descending order. 1709, 3, 1, -4 Put -3, -2, -285, -1, -5 in decreasing order. -1, -2, -3, -5, -285 Sort 8, -2/5, 68, -22.6 in ascending order. -22.6, -2/5, 8, 68 Sort -172, -1, 179 in increasing order. -172, -1, 179 Sort -124/5, -1, -0.3 in ascending order. -124/5, -1, -0.3 Sort -3, 0, -672, -1 in ascending order. -672, -3, -1, 0 Put -4/9, -390, -5, 2/5 in descending order. 2/5, -4/9, -5, -390 Sort -3, 22/25, -0.3, 2. -3, -0.3, 22/25, 2 Put -1, 3, -4, 2479, -3, 1 in descending order. 2479, 3, 1, -1, -3, -4 Sort -4.7, 0, -4, 1/4, 3/4 in ascending order. -4.7, -4, 0, 1/4, 3/4 Sort 4, 1333, -45, -4/7 in decreasing order. 1333, 4, -4/7, -45 Sort 3, -1196, 2, -5/6 in descending order. 3, 2, -5/6, -1196 Put 10, -5, 22, -6 in decreasing order. 22, 10, -5, -6 Sort 0, 21, 6, 46 in ascending order. 0, 6, 21, 46 Sort 5, 37, 1256 in ascending order. 5, 37, 1256 Put -98, 7, 1, -2, 0 in increasing order. -98, -2, 0, 1, 7 Put -191, -5964, -1 in decreasing order. -1, -191, -5964 Sort -2/7, 96, 7, -0.3 in increasing order. -0.3, -2/7, 7, 96 Put -16, 38, 7, 503, -2, 4 in increasing order. -16, -2, 4, 7, 38, 503 Put 465, -746, 0 in increasing order. -746, 0, 465 Sort 80, 0.4, -1734 in decreasing order. 80, 0.4, -1734 Put -37, 5, 4, -1597 in increasing order. -1597, -37, 4, 5 Put -17, -41, 264 in decreasing order. 264, -17, -41 Put 30, 5, -5, -1, -2 in decreasing order. 30, 5, -1, -2, -5 Sort -7391, 3, -7. -7391, -7, 3 Put 3, 5, 9, -208 in increasing order. -208, 3, 5, 9 Sort 46, -1/7, 0.5, 3, -0.0057 in ascending order. -1/7, -0.0057, 0.5, 3, 46 Put 0.1, -45, 353 in descending order. 353, 0.1, -45 Put -13, 3, 0, 6, -5 in ascending order. -13, -5, 0, 3, 6 Put -0.2, -0.5, 2, 7/19300 in descending order. 2, 7/19300, -0.2, -0.5 Sort 13, -5, 3, -24, 4, -4. -24, -5, -4, 3, 4, 13 Put 31, -7, -890 in descending order. 31, -7, -890 Sort -255, 4, -1, 8. -255, -1, 4, 8 Sort 15, -6, -55, 4, 0, -1 in decreasing order. 15, 4, 0, -1, -6, -55 Put -3, -4, 2303 in increasing order. -4, -3, 2303 Sort -3/11, 177, -213. -213, -3/11, 177 Put -4, 2.048, -0.2, 2, -5 in increasing order. -5, -4, -0.2, 2, 2.048 Put 0, -0.5, -0.31 in descending order. 0, -0.31, -0.5 Put -3, 0, 1, -14269 in decreasing order. 1, 0, -3, -14269 Put 16, 1, -2, 268, -9 in ascending order. -9, -2, 1, 16, 268 Sort 0.1, -917, -0.5, -3, 0.3, 0.5 in ascending order. -917, -3, -0.5, 0.1, 0.3, 0.5 Put -2, -430, -11 in decreasing order. -2, -11, -430 Sort 5, -2, -0.4, 10/7, -1/5, -4. -4, -2, -0.4, -1/5, 10/7, 5 Sort -5, 6, -91, -4 in decreasing order. 6, -4, -5, -91 Put 0.4, 0.87, -0.6, -9 in descending order. 0.87, 0.4, -0.6, -9 Sort 816, 4, 3, -4, -3 in descending order. 816, 4, 3, -3, -4 Sort 0, 47, 12, -26, -4, 2 in descending order. 47, 12, 2, 0, -4, -26 Sort -13, -0.17, 4/3, -0.4, -2/3, 7 in decreasing order. 7, 4/3, -0.17, -0.4, -2/3, -13 Sort -4, -73, 114 in ascending order. -73, -4, 114 Put -6, 364, -4, 2, 5 in decreasing order. 364, 5, 2, -4, -6 Sort 3/7, -8, 2/5, 6, -1/11 in ascending order. -8, -1/11, 2/5, 3/7, 6 Put 312, -70, 6, 5 in increasing order. -70, 5, 6, 312 Put -5, -1/95, -4, -478, 0.11, 2 in ascending order. -478, -5, -4, -1/95, 0.11, 2 Put 156, 48, 16 in ascending order. 16, 48, 156 Put -0.151, -5, -38.6, -3 in decreasing order. -0.151, -3, -5, -38.6 Sort -0.09, 16.9, -2 in decreasing order. 16.9, -0.09, -2 Put -300/13, 2, 3, -3, 0.6, -1 in decreasing order. 3, 2, 0.6, -1, -3, -300/13 Sort -429, -5, -10, -4 in decreasing order. -4, -5, -10, -429 Sort -3/7, -3412, -3, 4/5, -4. -3412, -4, -3, -3/7, 4/5 Sort 22, -1, -4, 194, 3. -4, -1, 3, 22, 194 Put 0.4, -5, 3/5, 4, -1/83 in ascending order. -5, -1/83, 0.4, 3/5, 4 Sort -44, -4351, -7 in ascending order. -4351, -44, -7 Put 2/11, 0, -4, 0.018 in decreasing order. 2/11, 0.018, 0, -4 Sort -8, -28059, 3, -6 in decreasing order. 3, -6, -8, -28059 Sort -1288, -0.1, 514. -1288, -0.1, 514 Sort -5, -0.068, 44. -5, -0.068, 44 Put -403, -6, 13, 3 in decreasing order. 13, 3, -6, -403 Sort 227, 5, 0, -26, -55 in decreasing order. 227, 5, 0, -26, -55 Sort -5, 1, 29, -0.06, -8 in descending order. 29, 1, -0.06, -5, -8 Sort -7, -2, 1764. -7, -2, 1764 Put -172446, -5, -4 in descending order. -4, -5, -172446 Put -0.0292, 34, 4 in increasing order. -0.0292, 4, 34 Put 2, 8, -68, 5, -6 in descending order. 8, 5, 2, -6, -68 Sort -2/5, 1770, 0.1, -1/6, 2, 3 in decreasing order. 1770, 3, 2, 0.1, -1/6, -2/5 Sort -8, 0, -1, -3, -2, 27 in increasing order. -8, -3, -2, -1, 0, 27 Sort -3, 611, 993. -3, 611, 993 Put 5, -31/625, -1.8, -2/7, 4 in ascending order. -1.8, -2/7, -31/625, 4, 5 Sort -4, 1.3542, 0.03. -4, 0.03, 1.3542 Put -2, 4, 83, 0, -1 in decreasing order. 83, 4, 0, -1, -2 Put 0.4, -2, 0.3, -0.4, -28, -140 in ascending order. -140, -28, -2, -0.4, 0.3, 0.4 Sort 1/4, -916, 53, -0.4, -1/4. -916, -0.4, -1/4, 1/4, 53 Sort -1, 6, -5045. -5045, -1, 6 Put 3, -4, -1, 4, 18930, 5 in descending order. 18930, 5, 4, 3, -1, -4 Sort -5, -1, -63413 in ascending order. -63413, -5, -1 Sort -76, 6, -4, 1, 4 in descending order. 6, 4, 1, -4, -76 Sort 1, -6, 3, 79974, -1, 0 in ascending order. -6, -1, 0, 1, 3, 79974 Sort -70, 6, 3, -24 in increasing order. -70, -24, 3, 6 Put 78, 1, 24 in decreasing order. 78, 24, 1 Put -4, -2/1233, 18/11 in descending order. 18/11, -2/1233, -4 Sort 6, -2/9, -3/4, -323, -1, 2/7. -323, -1, -3/4, -2/9, 2/7, 6 Put 5, 689, 74 in decreasing order. 689, 74, 5 Sort 64, 4, -1605, -5. -1605, -5, 4, 64 Put 36, -11, -23 in descending order. 36, -11, -23 Put -116, -1, -0.2, 0.15, -3/7 in increasing order. -116, -1, -3/7, -0.2, 0.15 Sort -9, -1197, 15 in increasing order. -1197, -9, 15 Put -6, -2, -37, -5, 7 in ascending order. -37, -6, -5, -2, 7 Sort 4, 244.31, 5, 2 in descending order. 244.31, 5, 4, 2 Sort -0.2, -3/7, 2, 5.53, 3. -3/7, -0.2, 2, 3, 5.53 Sort 0.6, -62, 1/3, -0.2, -2/5 in descending order. 0.6, 1/3, -0.2, -2/5, -62 Sort -120, 3137, -5, -1 in ascending order. -120, -5, -1, 3137 Sort 1.4, 0.02, -19829 in increasing order. -19829, 0.02, 1.4 Put -4, 121, -45, -47 in decreasing order. 121, -4, -45, -47 Sort 1, -62, -272, -5. -272, -62, -5, 1 Sort -47, 47, -4 in descending order. 47, -4, -47 Put 2, 0.5, 19, 0.3, 117 in increasing order. 0.3, 0.5, 2, 19, 117 Put -5, 7, -647, -0.1 in decreasing order. 7, -0.1, -5, -647 Put 0.9, 179, 1, -5 in descending order. 179, 1, 0.9, -5 Sort 4, 0, 50, 3, -3, -7 in increasing order. -7, -3, 0, 3, 4, 50 Put 4, -119, -1/27,	{ "pile_set_name": "DM Mathematics" }
s positive. l*(-134/7) Simplify uu*2/u(u/(uu(-27))u)/u assuming u is positive. u29 Simplify ((b(-4/5)b)/(b/(b/(bb*(-1/3)b))))/((bb(-2))/b(-2/35)) assuming b is positive. b(-11/21) Simplify r24/(r30r) assuming r is positive. r(-7) Simplify (s(3/5)ss*(-1/4))/((sss(-1/3)/ss)/s(2/7)) assuming s is positive. s(-13/420) Simplify (l*(-1/4)l(2/27))50 assuming l is positive. l(-475/54) Simplify ((y/(y(-2/7)/y))(4/23))(9/7) assuming y is positive. y(576/1127) Simplify b/b(-12)b/b(-5/2) assuming b is positive. b(33/2) Simplify (g/g25)(-29) assuming g is positive. g696 Simplify ((z11z)/z)(-8/3) assuming z is positive. z(-88/3) Simplify (tt(2/7))(-8)(tttt3)/(t/(t(-7)/t)) assuming t is positive. t(-93/7) Simplify (mm*(2/7)/m)/mm(2/67) assuming m is positive. m(-321/469) Simplify (aa(2/9))(-1/22)/(a(1/4))(-7) assuming a is positive. a(61/36) Simplify c0/c(2/29) assuming c is positive. c(-2/29) Simplify j(2/45)/((j/j(-7))/j) assuming j is positive. j(-313/45) Simplify (((u5u)/u)/u8)/(u(-2/3))(-35/3) assuming u is positive. u(-97/9) Simplify f/f*(2/13)fff/f*7ff(-1/4)f0 assuming f is positive. f(-125/52) Simplify ((hh(2/17))/(h/(hh/(h*0h)h)))(7/5) assuming h is positive. h(252/85) Simplify (ii(-12))(-2/43) assuming i is positive. i*(22/43) Simplify (aa/(aaa*(-3))a(a(-4)a)/a)/(a*(1/5)(a(a/((aa*(-5)a)/a)aa)/a)/aa) assuming a is positive. a(-36/5) Simplify (((n(-1/3)/n)/n)/n(3/2))/((n2n)/n(2/5)) assuming n is positive. n(-193/30) Simplify ((v/v(3/8))/v(-5))/(v/v*3vv/(vv/(v(v/(v(-4/5)/v))/v))) assuming v is positive. v(193/40) Simplify ((h(2/15)hh)/((hh*(-5/3))/hhh))(1/18) assuming h is positive. h(1/10) Simplify w4((w*3/w)/w)/ww*9/(ww(-5/3)) assuming w is positive. w(41/3) Simplify bb6bb(-3/8)(b*(-1/4)/bb)(-26) assuming b is positive. b(113/8) Simplify ((a(7/2)/a)13)3 assuming a is positive. a(195/2) Simplify (gggg/(g(g/(g2/g))/g))48 assuming g is positive. g192 Simplify j(-3/19)((j(-13)/jj)/j)/j assuming j is positive. j(-288/19) Simplify g(5/11)gg(-24) assuming g is positive. g(-248/11) Simplify ((ll(-2/3)ll)(-30))(-24) assuming l is positive. l1680 Simplify l(-6)/(ll(-4/7)) assuming l is positive. l(-45/7) Simplify b*17/bb/b26 assuming b is positive. b(-9) Simplify ss(9/5)ss(2/7)/s assuming s is positive. s(108/35) Simplify (ddd(-13))/(d(-21)d) assuming d is positive. d*9 Simplify (y/(yy/(yy(5/3))))30 assuming y is positive. y50 Simplify (m(3/7)/mmmm(-2/3))(-1/12) assuming m is positive. m(-4/63) Simplify y(-2/37)/(y/(y/(yy(-5/3)/yy)y)) assuming y is positive. y(179/111) Simplify (o(1/15)/oo/(o((o/(ooo/(o(7/5)/o)o))/o)/o))7 assuming o is positive. o(77/3) Simplify ((l/((((l*(3/2)/ll)/l)/l)/l)l)/l(-2/23))/(l(1/2)/ll3) assuming l is positive. l(25/23) Simplify (m/(m(((m/((m(-2/31)m)/m))/m)/m)/mm))/m11 assuming m is positive. m(-312/31) Simplify (y(2/17)/y3)/(y0)50 assuming y is positive. y(-49/17) Simplify (w2/(w2/w))/(ww*(-1/8)w/(ww(-1/9))) assuming w is positive. w(1/72) Simplify (l(1/4))(3/20)/(l1l2) assuming l is positive. l(-237/80) Simplify s/(s*(2/9)/s)s/s(-2/17) assuming s is positive. s(443/153) Simplify i*18i6 assuming i is positive. i24 Simplify (hh(h/h*(-1))/hhh/h(-2/5))/(h(-6)/h(2/9)) assuming h is positive. h(523/45) Simplify (j/(j(-10)j))(-35) assuming j is positive. j(-350) Simplify ((v/(v(2/33)/v))/v)(-37) assuming v is positive. v(-1147/33) Simplify (b(-1))*(-1/33)(b*(-2/3)b)(-23) assuming b is positive. b(-84/11) Simplify (yy(-3/22))/(y/(((yy*(5/2)y)/y)/y)) assuming y is positive. y(26/11) Simplify s/s(7/2)ss(-1/6) assuming s is positive. s(-5/3) Simplify s*(4/3)/(s/(ss/((s/s*4)/s))s)(s1/s)(-10) assuming s is positive. s(16/3) Simplify t(2/7)/(t/t11) assuming t is positive. t(72/7) Simplify ((tt*(-1/4)tt)/tt)*(-36)t/(t*(2/9)/t)t(2/3) assuming t is positive. t(-869/9) Simplify (z/(z(zz*(5/6))/zzz))(-3) assuming z is positive. z(17/2) Simplify (hh/(h/(h/h*(1/3)h)))*29(h(-2/7)/h)1 assuming h is positive. h(1597/21) Simplify (v(-15/7))*0 assuming v is positive. 1 Simplify (c(cc/((cc*(-2/5)/c)/c))/cc)*(-1/34)/(((cc*(-3/5))/c)/(c((c(-2/33)/c)/c)/c)) assuming c is positive. c(-892/561) Simplify (r(-1))(-1/11)/(r(1/4)/r)(-3/4) assuming r is positive. r(-83/176) Simplify (g/(g(-12)/g))(-15) assuming g is positive. g(-210) Simplify (s(s/s1)/ss*1s)46 assuming s is positive. s92 Simplify ((q*(-1/5)q)/qq(q*(-1/9)qq)/q)/(q/(q/q(2/5)))(-23/3) assuming q is positive. q(214/45) Simplify (g23)23 assuming g is positive. g529 Simplify (kk/((k/(k*(-3/11)k))/kk)k)/(k/((kk(kkk*(-2/19))/k)/k)k)(k/((k/k(2/3))/k))(-9) assuming k is positive. k(-2587/209) Simplify (y7yy3)24 assuming y is positive. y264 Simplify m/(m/m(-20))m/(mm6) assuming m is positive. m(-26) Simplify ((i/(i(-8/7)/i))/iiii*(1/5)i)/(i(-1/2))(-22) assuming i is positive. i(-198/35) Simplify g(-37)/(g10/g) assuming g is positive. g(-46) Simplify ((mm/(m/m(-2/17)m))/(mm/(((m/m5)/m)/mm)))/(m*(1/14)m(-2/11)) assuming m is positive. m(-18345/2618) Simplify (q/q*4)/qq*(2/15)q*(-2/7)/qq2 assuming q is positive. q(-331/105) Simplify b*(-11)(b/(b(-40)/b))/b assuming b is positive. b30 Simplify i*(-2/9)/ii/(iii*6ii)i*(-1/13)((i/i*(-4))/ii)/ii assuming i is positive. i(-620/117) Simplify (a(4/7)a/(a(a(-2/3)/a)/a)aa)/(((a/a(-2))/a)/(a(-2/19)/a)) assuming a is positive. a(851/399) Simplify ((aa*5a)/a(-7))/(a(-7)a7) assuming a is positive. a14 Simplify q(-1/7)/(q/(q(-3/7)q)) assuming q is positive. q(-4/7) Simplify (y0y6/y)48 assuming y is positive. y240 Simplify (v/(v/(vv*36)))/vvv((v*30v)/v)/vv assuming v is positive. v68 Simplify (m(-7))(-23) assuming m is positive. m161 Simplify a(2/7)/a6(aa/(a/(aa*(-2/9)))aa)(-44) assuming a is positive. a(-10832/63) Simplify (h(h/h*(2/27))/h)/hh14 assuming h is positive. h(376/27) Simplify ((a*(1/3)a)/(a*(2/15)/aa))/(a/(aa1))(11/3) assuming a is positive. a(73/15) Simplify (s6s*(-2/23)s)/(sss*(-2)s)40 assuming s is positive. s(-761/23) Simplify ((t/t6)/t0)/(t*(-6/11)tt/(t/((t/(t/(t/(tt*(-4)/t)t))t)/tt))) assuming t is positive. t(-137/11) Simplify ((s7)(2/35))(-27) assuming s is positive. s*(-54/5) Simplify (bb21)(29/3) assuming b is positive. b(638/3) Simplify (v/(v/v(-1/3))(v/v(-6))/v)(2/15) assuming v is positive. v(34/45) Simplify ((uuu/(u(-4/7)u))/uu/u(-2/23))/(u(1/8)u/(u*(-3)/uu)uuuu) assuming u is positive. u(-7041/1288) Simplify (j(-5/2)/j19)(1/7) assuming j is positive. j*(-43/14) Simplify (vv/v(1/12))/v(2/21) assuming v is positive. v*(51/28) Simplify ((ss(-23/4))/s)(-47) assuming s is positive. s(1081/4) Simplify (r/r(2/21)rrrr*9)/(r/(r(r/r(-1/3))/r))(-2/77) assuming r is positive. r*(993/77) Simplify (s((s/(s*19s)s)/s)/s)/(s(-7)s) assuming s is positive. s*(-13) Simplify tt*1ttt*6(t(2/9))(-29) assuming t is positive. t(32/9) Simplify z14/((zz/z(-8))/z) assuming z is positive. z5 Simplify (m/((m(-7)/m)/m)mm(-1/25)m)(-1/43) assuming m is positive. m(-299/1075) Simplify ((r(1/3))(-30))(-2/37) assuming r is positive. r(20/37) Simplify p*(2/13)/pp(1/2) assuming p is positive. p(-9/26) Simplify f/(ff/(f/f0)ff)f*(1/7)(ff(1/8)/f)/(f/f8) assuming f is positive. f(295/56) Simplify (d/(d/((d(-19)d)/d)d))/(d/(((dd*(3/25))/d)/d)d) assuming d is positive. d(-572/25) Simplify ((r(-1/3)rr)/r(-2/7))0 assuming r is positive. 1 Simplify (k*(-7)/kk*(-6))/((kkk0/k)/k)(-32) assuming k is positive. k(-14) Simplify (u*(-12	{ "pile_set_name": "DM Mathematics" }
72sqrt(5) + 421 Simplify 5 + 1sqrt(448) - (2sqrt(448) + 2) - (-5((sqrt(448) + -1 + sqrt(448))6 - (1 + sqrt(448) + 0)))2. -1356422 + 30792sqrt(7) Simplify 2 + -3 + (-5 + -4sqrt(17)-1 - 4(sqrt(102)/sqrt(6))2-6). 4sqrt(17) + 402 Simplify -5 + sqrt(12)-1 + -2 + 4 - (2 + (sqrt(42)/sqrt(2)3)/(sqrt(847)1)). -5 - 25sqrt(3)/11 Simplify (-4(sqrt(152) - sqrt(152)-5) + sqrt(152) + -4sqrt(152)4)/((24sqrt(392) - sqrt(392))1). -39sqrt(19)/49 Simplify (4sqrt(1944) - sqrt(192)/sqrt(392))/((sqrt(384)-1)/(sqrt(30)/(sqrt(10)2))). -251sqrt(3)/56 Simplify (sqrt(39)-1-3)/((sqrt(84)/sqrt(4))/sqrt(7)) - (-2(((-2sqrt(13))22 - sqrt(13)) + sqrt(13)) + (sqrt(13) + sqrt(208) + 4)1). -2sqrt(13) + 204 Simplify 4 + 3((sqrt(1372) + sqrt(1372)-1 + sqrt(1792)-2 + sqrt(1792))/(sqrt(36)/(-1sqrt(9)-3)))2-5. -60476 Simplify (3 + (1(0 + sqrt(684) + sqrt(684)) - sqrt(684))2 + 1 - (4(sqrt(684) + 0 + 5 + sqrt(684)) + 5)*2)1. -43713 - 2400sqrt(19) Simplify -3(sqrt(252) - (0 + sqrt(252) + sqrt(252))*2)4-5 - (-1 + sqrt(252) + 2 - (0 + sqrt(252))-6)*2. -72829 + 276sqrt(7) Simplify 5(((sqrt(500)-3)/sqrt(10))/sqrt(2))/(sqrt(15)/(-2sqrt(432) + sqrt(432))). 180sqrt(5) Simplify 0 + (-1sqrt(1539)-6)*2 + -5(sqrt(19) + -5 + -2)*25. 350sqrt(19) + 53704 Simplify (-6((-1 + sqrt(153) + -1)-2 + 3 + 3)-4)*2. -69120sqrt(17) + 410112 Simplify (3(sqrt(68) - (sqrt(68) + -51sqrt(68)))-5)/(((sqrt(240) - (sqrt(240) - -1sqrt(240)))/sqrt(10))/(sqrt(24)/(sqrt(4) - sqrt(16))))-5. 375sqrt(17) Simplify (-5sqrt(9)/(-2sqrt(432) + sqrt(3)) + 3((sqrt(300) - (sqrt(300) + -4sqrt(300))) + sqrt(300))4)*2. 571734075/529 Simplify (0 + (-1(0 + sqrt(612) - sqrt(612)) - -1sqrt(612)-5 - (sqrt(612) + -1 + sqrt(612) + -2 + (sqrt(612)1 - sqrt(612))-3))*2)-5. -149985 + 1260sqrt(17) Simplify -5 + (0 + 5 + 4 + ((sqrt(180) + 0 + sqrt(180) - sqrt(180))-5 + sqrt(180) - 3sqrt(180)1) + -1)*2. -672sqrt(5) + 8879 Simplify -2(((-1 + sqrt(175) - sqrt(175)) + -5)21 - -5(sqrt(28) + 0)-3). -72 + 60sqrt(7) Simplify (-3(4 + sqrt(108)) - (-2 + (sqrt(72)1)/sqrt(6)))2-5. -6500 - 2000sqrt(3) Simplify ((sqrt(513) + (sqrt(513) - (sqrt(513) - ((-4sqrt(513) - sqrt(513)) + sqrt(513)) - sqrt(513))))/sqrt(9)1)/(sqrt(33)/((-1sqrt(110))/sqrt(10)))5. 10sqrt(19) Simplify ((sqrt(65) + (sqrt(65) - sqrt(65)-3))6 - sqrt(65))/(sqrt(245) + sqrt(245)4) - ((0 + sqrt(1573))2-5 - (sqrt(1573) + (3(0 + sqrt(1573)))2)). 414sqrt(13)/35 + 22022 Simplify 4-1(((sqrt(1053) + 0)-6)2 - -2(-1 + sqrt(1053)))65-1. 2160sqrt(13) + 4548720 Simplify (5 + 3 + 5 + 5(sqrt(99) + -2)3 + -2)*2. -1710sqrt(11) + 22636 Simplify ((4(sqrt(56) - sqrt(56)-1) - (sqrt(896) + sqrt(896) + (sqrt(896) - (sqrt(896)3 + sqrt(896) + sqrt(896))) - sqrt(56)))/(-61sqrt(128)1))*2. 2023/576 Simplify 4(4(-1((sqrt(1377) + 0)4 - sqrt(1377)) + -2))26. 41472sqrt(17) + 4760448 Simplify (5 + ((sqrt(245) - (sqrt(245) + -1))-5 + sqrt(245))*2-6-1 + -4)46. -10080sqrt(5) + 38904 Simplify (-3(11sqrt(1260) - sqrt(1260)))/(-1sqrt(10)/((sqrt(24) + sqrt(24)1)/sqrt(12))). 0 Simplify ((sqrt(286)1-3)/(sqrt(176) + -2sqrt(176)))/(sqrt(6)/sqrt(3)-4 - ((sqrt(242)2 - sqrt(242)) + sqrt(242) + sqrt(2))). -sqrt(13)/36 Simplify (-2((1 + sqrt(72) + sqrt(72))2 + (-1(sqrt(2) + -1))2) - (2 + sqrt(242) - (sqrt(16)/sqrt(8) + -1)2))6. -3498 - 342sqrt(2) Simplify (3 + (sqrt(45)2-1)/sqrt(9) + -3)*2 - (((-3(1 + sqrt(80)))*2 - sqrt(80)) + (sqrt(80)-1 + 2)*2)5. -4045 - 260sqrt(5) Simplify (-2 + 4-6sqrt(847) + sqrt(847) + 4sqrt(7) + 0 + sqrt(63)/(sqrt(99)/sqrt(11)))*2. 992sqrt(7) + 430532 Simplify (2 + (-5 + (1 + sqrt(1300) - sqrt(1300) - sqrt(1300)) + sqrt(1300) + -1 - (-1sqrt(208) - (sqrt(13) - (sqrt(13) - -1sqrt(52))))-4) + 0)2. 48sqrt(13) + 841 Simplify 1(4((sqrt(832)1-5)*2 + sqrt(832)) + sqrt(832)2 + 0 + (1sqrt(832))2 + 3). 48sqrt(13) + 84035 Simplify ((-4sqrt(5)-1)*2 + -5(sqrt(5) - (1 + sqrt(5) - sqrt(5)))*2 - (sqrt(150)/(sqrt(30)/sqrt(5)))/(2(sqrt(80) - sqrt(5)) + sqrt(5)))-1. -50 - 69sqrt(5)/7 Simplify (-6(4(sqrt(133) - -2sqrt(133)) - (sqrt(133) - 6(2sqrt(133) - sqrt(133)))))/(-5(sqrt(7) + (sqrt(7) - sqrt(784)/sqrt(7)))-5). 51sqrt(19)/25 Simplify (1(5 + sqrt(13)) + -3 - (5sqrt(1872) + sqrt(1872))-5)23. 4332sqrt(13) + 5082531 Simplify -4(3 + ((sqrt(84)/sqrt(64) - (sqrt(2541) - 2sqrt(2541)))/(sqrt(6)/((-2sqrt(12))/sqrt(6))))*2). -14187 Simplify (-4(-2 + (sqrt(720) + (sqrt(720) + sqrt(720) + 2)-4 - (-3 + (sqrt(720) - (sqrt(720) + 2))))6)5)2. 8064000sqrt(5) + 508192000 Simplify ((sqrt(133) + (2sqrt(133) + sqrt(133))-3)/(sqrt(7) + (sqrt(28)-3)/sqrt(4)))2 - ((1(sqrt(171) + -1))*2 - (4(sqrt(19) - sqrt(304)2))2). 6sqrt(19) + 15028 Simplify -1 + (51(sqrt(180) + -1)6-6)*2. -388800sqrt(5) + 5864399 Simplify ((-1 + 5(sqrt(50) + sqrt(2) + -3) + 5 + sqrt(4)/sqrt(2)-1 + sqrt(2) + sqrt(4)/sqrt(2) + 0)4)2. -10912sqrt(2) + 32688 Simplify 3 + (-1(sqrt(72) + sqrt(72)-2-6 - sqrt(72) - sqrt(72)) + -4 + sqrt(72)-161 + 0)*2. 816sqrt(2) + 20827 Simplify ((sqrt(85) - (sqrt(85) - sqrt(85)1))1 + sqrt(85) - (sqrt(85)26 - sqrt(85)))/((2sqrt(270) + sqrt(30))/sqrt(216)). -54sqrt(17)/7 Simplify 5 + 2(5sqrt(125)1 - sqrt(125) - ((sqrt(125)3)*2 + -4)) + -5. -2242 + 40sqrt(5) Simplify -1 + -5 + 2sqrt(2) + -2 + sqrt(2) + sqrt(14)/sqrt(343) + sqrt(2) + (sqrt(2) - (-3 + sqrt(2) + 1)) + -4. -10 + 29sqrt(2)/7 Simplify (-2 + -3-4sqrt(72))*2 - ((-2(2 + sqrt(72)) - sqrt(72))*2 + (sqrt(72) - ((sqrt(72)-2)*2 + sqrt(72) + 4))). -432sqrt(2) + 10000 Simplify (5(sqrt(171) - (sqrt(171) - -4-1sqrt(171) - sqrt(171)) - sqrt(171))-4)/((2sqrt(90)1)/(sqrt(40)/(sqrt(4)2))). -20sqrt(19) Simplify (sqrt(231)/(sqrt(11)-3 - sqrt(11))2)/(-2(sqrt(448)2 - sqrt(448))). sqrt(3)/32 Simplify ((sqrt(19) - ((sqrt(19) + 2 + sqrt(19))3)2) + -5-2sqrt(19) + -3(sqrt(1900)-1 + 5))4. -2940 - 124sqrt(19) Simplify (-5 + sqrt(4)/sqrt(2)2 + sqrt(2) - (sqrt(2) + sqrt(50)5 + 0))2 + 2 + 2. 230sqrt(2) + 1087 Simplify (-52sqrt(76) + sqrt(76) + sqrt(76) - (sqrt(76) - sqrt(76)-3)4)/((sqrt(2304) - (-1sqrt(2304) - sqrt(2304)))/(-3-1sqrt(4))). -2sqrt(19) Simplify (0 + 2(0 + sqrt(1100)) - (-4sqrt(275) - (5sqrt(11)-2 - sqrt(11))))*2. 9251 Simplify 4 + 1 + (-5(3 + sqrt(567) + 1))*2 + (-5 + 2(sqrt(567) + 1) + sqrt(567) + sqrt(567) + sqrt(567) + sqrt(567)-26)*2. 2178sqrt(7) + 42372 Simplify (6(-2sqrt(114) + sqrt(114))-54)/(((sqrt(60) - (2sqrt(60)5 - sqrt(60))) + sqrt(60))/(sqrt(120)/(sqrt(12)-2))). 60sqrt(19)/7 Simplify (((sqrt(198) - sqrt(198)-24 - sqrt(198) - sqrt(198))/(sqrt(216)2))/(5(sqrt(363)-1-4 - sqrt(363))))*2. 49/356400 Simplify (-4(sqrt(1200) + sqrt(1200)3 - sqrt(12) - sqrt(12))/sqrt(4))2 - (3 + sqrt(243) + -1 + 4). -9sqrt(3) + 69306 Simplify ((2sqrt(117) - 3-4sqrt(13) - ((sqrt(1872) + sqrt(1872)2 + 1 - sqrt(1872)) + -2)) + 4)*2-5. -2465 + 300sqrt(13) Simplify 2(1 + ((6((sqrt(720) + sqrt(720) + (sqrt(720)2 - sqrt(720)) + sqrt(720))/sqrt(12) - sqrt(60)))/(-3sqrt(48)6))*2)4. 18 Simplify (-3(sqrt(80) + 0 + sqrt(80) + sqrt(80) + 1 + sqrt(80)))2 + (sqrt(245) + 1)2 + (sqrt(405) + 0 + sqrt(405) + sqrt(405) - sqrt(5))2 + 5 + 0. 302sqrt(5) + 15160 Simplify (-2sqrt(363)-4)2 - (-5 + -3 + sqrt(363))2 - (sqrt(24) - 3sqrt(1944))/(-6sqrt(24)/sqrt(3)). 515sqrt(3)/3 + 22805 Simplify -4-1(sqrt(27)/sqrt(225) + 3 + (2sqrt(3024) + sqrt(3024))/sqrt(7)). 12 + 724sqrt(3)/5 Simplify (-5 + (sqrt(3) - (sqrt(3) - (sqrt(147) - sqrt(3))2)) + sqrt(3) + sqrt(363) + sqrt(363) + 1 + (sqrt(72)/(sqrt(4)1))/(6sqrt(54)))3. 415sqrt(3)/6 + 312 Simplify (6(-2(sqrt(2156) + sqrt(2156) + (21sqrt(2156) - sqrt(2156))))/((-5(2sqrt(16) + sqrt(16)))/(sqrt(484) - (sqrt(484) + 1sqrt(484))))4)2. 150264576/25 Simplify ((3 + sqrt(125))4)*21 + -4 + 1sqrt(605) + (2sqrt(605))*2 + 3. 491sqrt(5) + 4563 Simplify -1(sqrt(567) - (sqrt(567) + 0) - (sqrt(35)/sqrt(5))25) + (sqrt(56)/sqrt(144))/(-2sqrt(2)6 - sqrt(2)) + -5. -sqrt(7)/78 + 30 Simplify 4(-1sqrt(76)/((sqrt(12)/sqrt(3) - sqrt(4)) + sqrt(4)) + -2 - (sqrt(171) - (sqrt(171) - (-5sqrt(171)2 - sqrt(171))))/(sq	{ "pile_set_name": "DM Mathematics" }
) -0.5 d Which is the third biggest value? (a) -0.2 (b) -199 (c) 0.1 b What is the second smallest value in -19, -0.5, 4/3? -0.5 What is the third smallest value in -0.3, 3/2, -1/2? 3/2 What is the second biggest value in 4, -0.5, -5, -2.2, -13? -0.5 What is the biggest value in 0.1, 2, -28? 2 Which is the third biggest value? (a) 0.2 (b) 0.4 (c) 4 a What is the second biggest value in -2/9, -1/4, -3, 106? -2/9 Which is the second biggest value? (a) 0 (b) -2/111 (c) 2 a What is the third smallest value in 2/7, -0.3, 20? 20 Which is the third smallest value? (a) -8 (b) 0.08 (c) -2 b Which is the fourth smallest value? (a) -6 (b) 3 (c) 0.1 (d) 1/2 b Which is the third smallest value? (a) 4 (b) -859 (c) 2 a What is the smallest value in -1/2, 4, 6, 0, 0.05? -1/2 What is the second smallest value in -2, -0.06, 3/4, -3? -2 What is the third biggest value in -11/5, 4, -2, 1, 3/5? 3/5 What is the second biggest value in 2/19, 70, 0, -2/13? 2/19 What is the biggest value in -3, -0.4, 11? 11 What is the second smallest value in -6, 0.5, -123/11? -6 Which is the third biggest value? (a) -2/17 (b) -53 (c) 1 b Which is the biggest value? (a) -11 (b) -7/20 (c) 1/4 c What is the fifth biggest value in 38, -5, 0, -3/7, -1/11? -5 Which is the biggest value? (a) 0.06 (b) -6.6 (c) 2 c Which is the third biggest value? (a) 4 (b) -29 (c) 0 (d) 0.17 c What is the third smallest value in -4/3, 0, -1, -59? -1 What is the third biggest value in 0, -0.4, 2? -0.4 What is the second biggest value in 84, -4, 1/4? 1/4 What is the fourth biggest value in 0.5, 1/156, 3, -0.1? -0.1 What is the biggest value in 88, 167, 1/6, -0.1? 167 What is the third smallest value in -44, 6, -1/5? 6 Which is the second smallest value? (a) -3 (b) 0.4 (c) 3/5 (d) 5991 b Which is the fourth smallest value? (a) 0 (b) 4/11 (c) 2/13 (d) 1 d Which is the biggest value? (a) -7 (b) 91 (c) 0.4 b What is the smallest value in -38, 1, -1/6, -1? -38 Which is the third biggest value? (a) 1/6 (b) 1/5 (c) -3 (d) 3 (e) 24 b What is the second biggest value in 1/3, 0.8, 0.4? 0.4 Which is the second smallest value? (a) -0.07 (b) -2 (c) 0.1 a Which is the second biggest value? (a) -5/2 (b) -0.2 (c) 0 b What is the fourth smallest value in -0.4, -138, 2/17, 0.5? 0.5 Which is the second smallest value? (a) 0.4 (b) -0.3 (c) 0.206 c What is the fourth biggest value in -3, 3, -211, -1? -211 What is the second biggest value in 2, 5, -1, -4/7, -186? 2 Which is the second smallest value? (a) 5 (b) -3 (c) -5/4 (d) -1/3 c Which is the fourth smallest value? (a) 9 (b) -0.2 (c) 2 (d) -1 a What is the third smallest value in 3/8, 3, 2/3? 3 What is the fourth biggest value in 4, -2/7, -9, -8, -3/5? -8 Which is the third smallest value? (a) 2/7 (b) -4 (c) -2 (d) -16 c Which is the third biggest value? (a) -3 (b) 0.04 (c) -7 c What is the third biggest value in -41/3, -2, -1/2, -0.06? -2 What is the fourth smallest value in 2/9, 16, -0.2, -64? 16 Which is the smallest value? (a) 3 (b) 0.01 (c) -5/8 c What is the second biggest value in 1/4, 6, -5.3, 0.4, 2? 2 Which is the biggest value? (a) 2 (b) -5 (c) 0.4 (d) -1/3 a What is the second smallest value in -3/5, -0.2, -8/5? -3/5 What is the third smallest value in -1, -4, -3/2, -2/23? -1 What is the biggest value in 0.1, -2/9, -1/7, 3/2? 3/2 Which is the biggest value? (a) -4/7 (b) 0.135 (c) -1/4 (d) 4/5 d What is the second smallest value in 3/2, -0.055, 6/7, -7? -0.055 What is the third biggest value in 3, -19, -0.054? -19 Which is the second biggest value? (a) -1/2 (b) 28 (c) 5 c What is the smallest value in -1/2, -1/37, -3? -3 Which is the third smallest value? (a) -2 (b) 0.154 (c) 3 c Which is the third smallest value? (a) 20.49 (b) -4 (c) 3 a Which is the smallest value? (a) 0 (b) -0.01 (c) 4 (d) -4 (e) 0.5 d Which is the biggest value? (a) 2 (b) -0.2 (c) -11 a What is the third biggest value in 3, 0.8, 1, 0.064? 0.8 What is the smallest value in 0.1, 6/5, 1.5? 0.1 What is the smallest value in -27, -3, -10? -27 Which is the second smallest value? (a) -5 (b) 8/15 (c) 0.5 c Which is the fourth smallest value? (a) -2 (b) -4 (c) 1/2 (d) -1/3 c Which is the third smallest value? (a) -0.4 (b) -0.3 (c) 2/5 (d) -0.11 d What is the smallest value in -0.4, -112, 1/2, 5, 2? -112 Which is the third biggest value? (a) 1/6 (b) 0.1 (c) 198 b Which is the second biggest value? (a) 3 (b) 8 (c) -1/9 (d) -0.1 a What is the fifth biggest value in 4/55, 1/2, 2, -0.2, 3/10? -0.2 What is the biggest value in 3, -50, 1, -2? 3 What is the smallest value in -4, -13, -0.07? -13 What is the second biggest value in 0.4, -3, 4.1? 0.4 Which is the fourth biggest value? (a) 0.5 (b) -13.9 (c) -3 (d) 6 (e) 0.3 c What is the second smallest value in -5, 34, -3? -3 What is the third smallest value in -15, 1, -0.2, 7.8? 1 Which is the biggest value? (a) -19 (b) 2 (c) 11 (d) 1 c Which is the second biggest value? (a) 1/3 (b) -3/5 (c) 1.1 a What is the biggest value in -3/2, 17, -6? 17 Which is the biggest value? (a) -10 (b) 1 (c) 0 (d) -51 b Which is the third biggest value? (a) -8 (b) 2/19 (c) -0.086 (d) -4 d What is the second biggest value in -0.3, 163, -31? -0.3 What is the third biggest value in -2, 3.4, -6, 0.1? -2 Which is the third biggest value? (a) 2 (b) 0 (c) 4/15 b What is the second smallest value in 0, -6, 31/4? 0 What is the second smallest value in 0.63, -0.5, 3/2? 0.63 Which is the third smallest value? (a) 5 (b) -0.275 (c) 4 (d) -0.5 c What is the second smallest value in 592, 3, -0.1? 3 Which is the biggest value? (a) -0.03 (b) 2 (c) 0.2 (d) -1/3 (e) 4 e Which is the third smallest value? (a) 0.06 (b) 0.5 (c) 4 (d) -11.4 (e) 1 b What is the smallest value in -3/5, -3, -0.026, 27/4? -3 What is the third biggest value in -2/33, -1/6, 0.4? -1/6 Which is the smallest value? (a) 2/671 (b) 0.4 (c) -0.1 c Which is the fourth smallest value? (a) -4 (b) 2/15 (c) 1/2 (d) -6/11 (e) -0.2 b Which is the second smallest value? (a) 3 (b) 0.3 (c) -2497 (d) 5 b What is the smallest value in -1201, -3/5, 0.3? -1201 Which is the biggest value? (a) -7/6 (b) 4 (c) -3 (d) 0.4 b Which is the third biggest value? (a) -3.6 (b) 4 (c) 44 (d) 1 d Which is the biggest value? (a) 1 (b) 4 (c) 0 (d) 20 (e) 4/3 d Which is the third smallest value? (a) 0.5 (b) -0.3 (c) 3 (d) 1/51 a What is the third smallest value in -2/3, 1, 5, 0.2? 1 Which is the smallest value? (a) -2 (b) 0.03 (c) 0.09 a What is the third smallest value in -2/3, -17/6, -4, 1/2, -0.5? -2/3 Which is the second smallest value? (a) -8/67 (b) 0.3 (c) 2/7 c What is the second smallest value in 3/7, -872, -1? -1 Which is the second biggest value? (a) 1 (b) -0.1 (c) 4.3 (d) 4 d Which is the second biggest value? (a) 0.1 (b) -0.4 (c) 1/655 c Which is the second biggest value? (a) -0.2 (b) 0.28 (c) -0.1 c Which is the third biggest value? (a) 0.4 (b) 3 (c) -3 (d) -11/7 d Which is the second smallest value? (a) -6/7 (b) -0.2 (c) -1 a What is the second smallest value in 0.2, 5, 29, 0? 0.2 What is the smallest value in 5, -0.1, -4? -4 What is the smallest value in 17, 2, -71? -71 What is the second smallest value in -0.3, -4, 0.5, 1787? -0.3 Which is the smallest value? (a) 0.5 (b) -12/13 (c) 0 b Which is the biggest value? (a) 63 (b) -2 (c) 4 (d) -4 a Which is the fourth biggest value? (a) -0.1 (b) -3 (c) 2/21 (d) 7.6 b Which is the second smallest value? (a) 2 (b) 5/9 (c) -1/5 (d) -2 (e) -5 d Which is the fourth smallest value? (a) 1 (b) 1/3 (c) -3 (d) 4/9 a Which is the second smallest value? (a) 0.1 (b) 6/1115 (c) 0.2 a Which is the second smallest value? (a) -0.2 (b) -0.4 (c) 50 (d) 0.2 a Which is the third smallest value? (a) 1 (b) -3 (c) 1/4 (d) -83 c What is the smallest value in -0.4, -1, -17? -17 Which is the third smallest value? (a) 1/7 (b) -40/7 (c) 0.1 a Which is the third smallest value? (a) -0.4 (b) -0.5 (c) 0.5 (d) -17/10 a Which is the third smallest value? (a) -23 (b) -4/5 (c) 1/4 c What is the second biggest value in -404, 2, -0.25? -0.25 Which is the third biggest value? (a) -1/4 (b) -2 (c)	{ "pile_set_name": "DM Mathematics" }
-1). Solve 2x + sx = 40 for x. 2 Let g be 1 + 0 + 12. Suppose 0 = 70h - 72h + 6. Suppose 2v + 8 = -2, -hp + 26 = 2v. Solve -3 - p = -gq for q. 5 Let o = -13 - -15. Suppose i + 5y = 23, -i - i - oy = -22. Suppose 3m - i = -m. Solve f - 2 = mf for f. -2 Let k be (0 + -3 - (-7 - 59)) + 3. Let l = 76 - k. Solve -4q - l = -2 for q. -2 Suppose -s - 3s = 4. Let m(i) = 3i*2 - 1. Let w be m(s). Suppose wj = -2d + 7 + 1, 0 = -4j + 4d. Solve 0 = -jk + k for k. 0 Let y = 41 + -40. Suppose 5r = -5j + y + 94, -36 = -2j - 4r. Solve -3u - j = u for u. -5 Let q(r) = -r3 - 2r*2 + 2r + 2. Let f be q(-2). Let y be (4/(-8))/(f/(-192)). Let u = -29 - y. Solve 4v + u = -1 for v. -5 Let o be 50/(-1 + 2) + -3. Let g = -30 + o. Suppose 0 = -u - 2r + 15, -5u - g + 52 = 2r. Solve u - 7 = q for q. -2 Suppose -5k + 6k - 8 = 0. Let m be (-4 + k - 5)2. Let p be (2 + -3)/(m/40). Solve 2b = 6b - p for b. 5 Let c = -18 - -20. Solve -4 - 4 = -cg for g. 4 Suppose 0 = j + 3, -2w + 23 = -4j + 1. Suppose 0 = wv + 49 - 64. Solve vz = -z for z. 0 Suppose 5z = -2k + 40, -5z + 4k = -2z - 50. Suppose 0 = -zq + 8q + 4. Solve 0x + 2x = q for x. 1 Suppose -19f + 2013 = 1975. Solve 7z = fz for z. 0 Let g = -18 + 22. Solve -ga - 25 + 5 = 0 for a. -5 Let n be 99/24 - (-2)/(-16). Suppose -12 = -ni + i. Suppose 3l = il. Solve l = 5o - 5 for o. 1 Let s = 37 + -43. Let l = 11 + s. Let u = 22 - 12. Solve -u = 3v + l for v. -5 Let l(p) = -p*2 + 55p - 725. Let i be l(25). Solve -5m = -50 + i for m. 5 Let i(b) = -15b - 283. Let j be i(-19). Solve -2q = 8 - j for q. -3 Suppose 3b - 40 = 14. Solve -10 = 4x - b for x. 2 Let b(x) be the first derivative of x2/2 + 6. Let d be b(2). Suppose 4i = 2j + d, -3j = 3i - 9 + 3. Solve i - 6 = 5m for m. -1 Let j(d) = -d*3 + 12d*2 + d - 8. Let s be j(12). Suppose sk = -8k. Solve 2t = -k + 2 for t. 1 Suppose 0 = -69n + 73n - 8. Suppose -2 = -nb + 6. Solve -bp - 4 = -12 for p. 2 Suppose n = 6n + 15. Let i = 6 + n. Suppose -7w = -6w - i. Solve -2 + 11 = wc for c. 3 Suppose 0 = -o - 7d + 2d - 3, -4o - 5d + 3 = 0. Suppose 38c = -0c + 684. Solve 4f - c = -o for f. 4 Suppose 3p = 44 + 43. Suppose -28r = -pr + 3. Solve -rt + 0 = 3 for t. -1 Let q(u) = 5u*2 + 7u - 19. Let g be q(4). Solve x - 87 = -g for x. -2 Suppose 0 = 19n - 21n + 8. Suppose nk + 2s + 10 = 0, 3k = -2s + s - 5. Solve u + u + 6 = k for u. -3 Suppose -2l = 3s - 1, 9l - 3 = 8l + s. Solve 0 = -lm + m + 3 for m. 3 Let t(n) = -n3 + 9n*2 - 9n + 13. Let l be t(8). Solve -l = 11c + 17 for c. -2 Let m(p) = 9p + 69. Let l(i) = 4i + 17. Let b be l(-6). Let g be m(b). Solve -z = 2z - g for z. 2 Let v be (-312)/30 - 4/(-10). Let g = v + 13. Suppose -2o = -g - 1. Solve -o = 2y + 6 for y. -4 Let z(a) = a*3 - 5a*2 + 4a + 2. Suppose 3h + 1 = 7. Suppose -ht = -3t + 4. Let f be z(t). Solve fx - 4x - 4 = 0 for x. -2 Let l = 1259 + -1259. Suppose 3i = -2j - 0 - 7, 0 = j - 5i - 29. Solve s + js + 5 = l for s. -1 Suppose 4q - 3s = s + 8, -8 = q + 4s. Suppose -3 = -3p - qp. Solve -4r - 15 - p = 0 for r. -4 Let g be (-3154)/(-6) + -6 + (-16)/(-3). Solve g - 524 = -o for o. -1 Let r be (-8)/10 - (9 + (-4104)/30). Solve ri + 3 = 130i for i. 1 Let s = -219 - -238. Solve 16a = sa for a. 0 Let x be (-146)/(-10) - 136/(-340). Solve 20l = xl for l. 0 Let v be 2 - 2 - (-4 + 0). Let n(o) = 10o*2 - 27o - 281. Let r be n(7). Solve -r + v = 4f for f. -4 Suppose -3l - z + 13 = -2z, 2l - 5z = 13. Let s be l((-21)/(-12) - 1). Let h = 19 - 17. Solve -1 = -hg + s for g. 2 Suppose -2k + 9 = -7. Let p be 45/18 - 1/(-2). Suppose -pd = -4 - 11. Solve du = ku for u. 0 Let j be (-10)/(-25)5/1. Suppose 0 = -l + 4n - 19, 3n = 4l - 5l + 16. Let v be 0/(-2l/j). Solve -t - 2t + 12 = v for t. 4 Suppose -t = -5t - 128. Suppose -7q + 371 = 126. Let z = t + q. Solve -z + 0 = -f for f. 3 Suppose 132 = 23k - 29. Solve -kn + 11 - 46 = 0 for n. -5 Let p be (-73)/(-2) + (-3)/(48/(-8)). Suppose 3b - 8 = p. Suppose -8l = -3l. Solve 5s = -l + b for s. 3 Let l(n) = 11n2 + n + 1. Let s be l(-1). Let w be 34/8 + 90/120. Solve s = wk - 9 for k. 4 Suppose -3t + 4u - 163 = 0, 5t - 3t - u + 102 = 0. Let x = t + 51. Solve b = -b + x for b. 1 Suppose 2p - 25 = -3p. Suppose -5b - 1 - 24 = 0. Let j = b + p. Solve -5u + 4u + 1 = j for u. 1 Let g(a) = -a - 5. Let p(q) = -2q - 11. Let f(y) = -5g(y) + 3p(y). Let j be f(-14). Suppose 0 = -3w + j - 0. Solve -m = -0 - w for m. 2 Let h(u) = 4u - 14. Let o be h(4). Suppose -9y + oy + 35 = 0. Solve 3 = -yj + 23 for j. 4 Let r = -269 + 270. Solve -17 = -4f - r for f. 4 Let x = -17 - -17. Suppose -r + x = 1. Let g be (-1)/(r/(-2)) + 2. Solve g = -2n + 4n for n. 0 Suppose 7u - 3u = -h + 79, 5h = -5. Let y(s) = 2s + 51. Let k be y(-21). Suppose -kq = -3 - 15. Solve u = 2r + qr for r. 5 Let k(u) = -5u + 28. Let i be k(5). Suppose -5x + 2 = -i. Solve -3m + x - 7 = 0 for m. -2 Suppose a - 12 = -2a. Let f = 595 - 590. Solve fu = a + 1 for u. 1 Let z(n) = -643 + n - 2n + 659. Let k be z(-5). Solve -k + 6 = 3b for b. -5 Suppose 37w = -6w + 172. Solve -wt - 8 = -6t for t. 4 Let p = 3 + 0. Let y(g) = -g*3 + 17g*2 + 16g + 36. Let b(c) = -3c + 9. Let x be b(-3). Let w be y(x). Solve -4o + o + p = w for o. 1 Let t(v) = -17v + 9v*2 + 24v + 2v3 - 11v + 7. Let k be t(-5). Solve 2 = g - k for g. 4 Let j = -42 - 45. Let q = 105 + j. Solve -6 + q = -3h for h. -4 Let m(g) = -4g + 4 + 2g + g. Let o be (6/4)/30. Let w be m(o). Solve -3d = w - 1 for d. -1 Let q = 815 - 813. Solve -qt - 5t = -28 for t. 4 Suppose -5l - 35 = -5s, 3l + 2s + 0s = -36. Let b be 66/15 - -22/l. Solve 0 = br + 6 - 26 for r. 5 Let b be (-60)/8(-2)/3. Solve -bu + 3u = 0 for u. 0 Let s = -21 + 29. Suppose -3j + 4y = -s + 1, -2j - 5y + 20 = 0. Solve -4 = jz - 3z for z. -2 Let c(i) = 3 + i2 + i + 2 - 4. Let j(s) = 3s*2 + 7s + 8. Let y(x) = 4c(x) - j(x). Let v be y(5). Solve n + v - 1 = 0 for n. -5 Suppose -3d = 5q - 22, d - 3 = 3q - 5. Let b be 0 + (d - 3)2. Let u be 12/7 + (-18)/(-63). Solve 0 = bw + uw for w. 0 Let j be (-1 + 5)3 - 4. Let n be 1 + 1 - (5 - 1). Let b be (n + 4 + -14)-1. Solve 5v + b = -j for v. -4 Let r = 9 + -8. Let t = r - -4. Let l be 21/((2 - t)/(-1)). Solve -2n + 3 = -l for n. 5 Suppose 4z = -2f, -5f - 10 = 10. Suppose zm = a + 1 - 10, 4a + 4m = 0. Suppose 5u = -5y, 0 = 4y - au + 2u - 20. Solve 11 = -yn - 9 for n. -5 Let z = -227 + 234. Solve 5p = -8 - z for p. -3 Let r(y) = -y*3 + 5y*2 + 40y - 126. Let z be r(3). Solve 11 + 13 = zf for f. 2 Let h = 5 + -5. Let z be 6 + 1 + (-1 - 1 - h). Solve 29 = -zc + 4 for c. -5 Let g = 5 - 0. Let w = 28554 + -28545. Solve -4x + wx = -g for x. -1 Let p = 18 + -10. Let b = p + -4. Solve -3u + 5 = -b for u. 3 Suppose -19d = -101 - 32. Solve -dm - 11 = 3 for m. -2 Suppose 3i + 3z - 18 = 0, -21 = 3i + 5z - 45. Solve -9d - 3 = -i for d. 0 Let x be ((-5)/3)/((-295)/708). Solve 10 = -xs + 2s for s. -5 Let q(x) = x*3 - 3x*2 - 4x + 4. Let z(n) = n*2 - 1. Let g = -2 - -1. Let s(k) = gq(k) - 6z(k). Let m be s(-4). Solve -h = mh for h. 0 Suppose 2q - 8 = -l - 0, -2q - 2l + 8 = 0. Solve -1 = qm + 3 for m. -1 Suppose 0m - 2 = -m. Let t(h) = -hm + 5h - 5h2 - 1 + 5h*2. Let d be t(4). Solve -2r + d = 9 for r. -3 Suppose 23 = -4b - 1. Let n be ((-16)/b - 2)/(8/12). Solve 0 = x + 2 - n for x. -1 Let r(g) = g + 13. Let x be r(-9). Solve -11 = -xl + 1 for l. 3 Let a(p) = -3p3 + 2p*2 + 3p + 1. Let w be a(-1). Suppose -3x + 67 = 5q, 3x + 14 = 2q + x. Suppose -13 = -3s + q. Solve -v - wv = -s for v. 2 Let b = 70 - 62. Solve -bf + 3f = -5 for f. 1 Suppose 6d + 33d - 156 = 0. Let n(w) be the third derivative of w*4/4 - 2w3/3 - w2. Let b be n(4). Solve -b = da + a for a. -4 Suppose 2c - 45 = -13c. Solve 4q - 7 = -c for q. 1 Let r = 876 + -864. Solve 3k = -0 + r for k. 4 Suppose -8g - 420 = -468. Solve gp + 6 + 0 = 0 for p. -1 Suppose 69 = 3q - 3g, 4q + 3g - 113 = 14. Solve -qv + 31v = 15 for v. 5 Let q = 7 + -6. Let m be q(0/(-4))/2. Solve -2k + 3 + 3 = m for k. 3 Suppose 28 = 4o - 4b, -2b = -b	{ "pile_set_name": "DM Mathematics" }
of 60 and d. 10 Let q(p) = -p*3 + 4p*2 + p - 3. Let y be q(4). Let c = 9 + -8. Calculate the highest common divisor of y and c. 1 Let d be (3 - (1 + 1))/(-1). Let p be (-2)/d(2 + 1). Suppose v - 2v + p = 0. What is the greatest common divisor of 15 and v? 3 Suppose 4a + 4m = 484, -7m = a - 3m - 133. Let y = -14 + 32. Suppose 21 = 3x - y. What is the highest common divisor of a and x? 13 Let r(n) = -3n - 2. Let d be r(-2). Suppose -i + 0 = -2c + 3, 4c = -di + 24. Calculate the greatest common divisor of 3 and c. 3 Let m be 12/((-6)/(-36)6). What is the greatest common divisor of m and 8? 4 Let f(i) = -i2 + 1. Let l be f(1). Suppose 3w + r - 32 = l, 2r = -r - 12. Calculate the highest common factor of w and 3. 3 Let d = 30 - 16. Calculate the greatest common divisor of 154 and d. 14 Let s(n) = n3 - 2n*2 - 5n - 3. Let o be s(4). Let f be 839/o + 14/(-63). What is the greatest common factor of f and 62? 31 Let y(c) = -c*2 - c + 5. Let s be y(0). Let f be (-18)/72 + 42/8. What is the greatest common factor of s and f? 5 Suppose 0 = -4n - 12 + 4. Let g be -2 - n - -2 - -2. Suppose -4w - w - 67 = -3q, 0 = 2q - gw - 48. What is the greatest common divisor of 98 and q? 14 Let q(u) = -u + 3. Let m be q(0). Suppose c + 3v + 2v - m = 0, 17 = 2c - v. Let p(f) = -2f. Let y be p(-8). What is the greatest common divisor of y and c? 8 Let m be -7 + 10 + 339. Suppose -m = -5r + 530. What is the greatest common factor of 13 and r? 13 Suppose -2c + 46 = -82. Let j(f) = f - 2. Let y be j(-2). Let n be 164/10 - y/(-10). What is the greatest common factor of n and c? 16 Let y be (-4)/(-3)(0 - -3). Let a be (-2 - -22)6/y. Let s be (-44)/(-10) - (-48)/80. Calculate the highest common divisor of s and a. 5 Let g = -12 - -17. Let k(t) = 7t*2 - 1. Let v be k(-1). Suppose -4 = -2r + v. What is the highest common factor of g and r? 5 Suppose 3r - 5r - 2l = -78, 3r = -5l + 123. Suppose -138 = -2f - 2w, 7f - w - 363 = 2f. Calculate the greatest common factor of r and f. 36 Suppose 2f = 5d - 31, d - f = -d + 12. Suppose -163 = -4t + 89. Suppose -3i = -4i + t. What is the highest common factor of i and d? 7 Let r = -23 - -32. Calculate the highest common divisor of 99 and r. 9 Suppose -x - 25 = -6x. Let w be -3x/((-5)/6). Let c(g) = 24g2 - 3g. Let q be c(2). Calculate the highest common factor of w and q. 18 Let y be 22/434. Let v(f) be the third derivative of -f5/60 - f4/24 + 17f3/6 + 2f*2. Let t be v(0). Calculate the highest common divisor of t and y. 17 Let j(k) = -2 - 3k + 6k + 0. Let v be j(3). Calculate the greatest common divisor of v and 14. 7 Let q(m) = 5m + 11. Let p be q(-8). Let r = p - -41. Let g(k) = 2k + 36. Let i be g(24). Calculate the greatest common factor of r and i. 12 Suppose -4d = 2u, -5u + 5d + 15 = -0d. Suppose 0q - 2 = q, 4t + uq = 8. What is the greatest common divisor of 6 and t? 3 Let t = 3 - 0. Let n be 34/6 - t/(-9). Let s = -14 + 20. What is the highest common factor of s and n? 6 Let a(f) = -f2 + 7f - 4. Let k = -7 - -11. Suppose -3b + 7 = 4s - 6s, -b + ks - 11 = 0. Let g be a(b). Calculate the greatest common divisor of 6 and g. 6 Let z(x) = 19x2 + 6x - 4. Let j be z(2). Let p be (-4)/6 + (-65)/(-3). Calculate the highest common divisor of j and p. 21 Let f = -112 + 238. Suppose -5l = 5o - 45, -2l + 3 = 5o - 0o. Calculate the highest common divisor of l and f. 14 Let v be (-1584)/(-21) - (-6)/(-14). What is the greatest common divisor of 15 and v? 15 Let y(u) = 2u*2 - u - 1. Let b be y(2). Suppose -1 = bw - 36. Let r = w + 3. What is the highest common divisor of 15 and r? 5 Let h(x) = 3x3 - x2 + x - 1. Let i be h(2). What is the greatest common factor of 84 and i? 21 Suppose 3r - 5 = 2r - 2h, -r - h = -10. Suppose 15 = 3a - r. What is the highest common factor of 50 and a? 10 Suppose 5c = -2q + 50, -4c + 36 = -2c + 4q. Let t = c + -6. Let j be (-20)/t(-2)/4. What is the greatest common factor of j and 10? 5 Let o be 4/6 + 21/9. Let d be -2 + o + 1 + 18. Let q be 19/4 - 2/(-8). What is the highest common divisor of d and q? 5 Let d(b) = b3 - 5b2 + 1. Let u be d(7). Let k(r) = r3 - 6r2 - 4r - 10. Let w be k(7). Calculate the greatest common factor of u and w. 11 Suppose -2h - 2h + 24 = 0. Let g be (-1)/(-2) + 15/h. Suppose -a + 11 = l, 2l - ga = l - 1. Calculate the greatest common divisor of 4 and l. 4 Let n(t) = t*2 - 7t + 17. Let l be n(8). What is the highest common divisor of 125 and l? 25 Let d(p) = p*3 + 4p*2 - 4p + 10. Let r be d(-5). Let u = 11 - -4. What is the highest common divisor of r and u? 5 Let k(y) = 66y2 - y. Let l be k(-1). Suppose -5a - 17 = -l. What is the highest common factor of a and 15? 5 Suppose 3d = 5l - 171, -4l - 5d = -13 - 109. What is the greatest common divisor of l and 3? 3 Let r be (-6)/27 + 598/18. What is the greatest common divisor of r and 11? 11 Suppose 5w - 210 = 2w. Let j = -2 - -2. Suppose jx - x + 10 = 0. Calculate the greatest common divisor of w and x. 10 Let s(b) = -b2 + 3b + 5. Let u be s(4). Let l be (10/3)/(u/6). Suppose -10 - 22 = -4y. Calculate the highest common divisor of y and l. 4 Suppose 3t - 810 = -0t. What is the greatest common divisor of 27 and t? 27 Let c = 11 + 14. Suppose -c = -3q + 2q. Calculate the greatest common divisor of q and 5. 5 Suppose -3z + 3 = -18. Let f(q) = -q*2 + 9q + 2. Let d be f(z). Let c = -42 + 46. What is the greatest common factor of c and d? 4 Suppose -3z + 0k = 5k - 62, 0 = -z + 3k + 30. What is the greatest common factor of z and 24? 24 Suppose -8z = -7z - 1. Let y(b) = 3b2 - 2b + 1. Let t be y(z). Calculate the highest common factor of t and 10. 2 Let d(m) = -m*2 - 20m - 15. Let n be d(-12). What is the highest common factor of 9 and n? 9 Let a be (7/(-3))/(2/(-102)). Suppose -2t + a = -57. What is the highest common factor of 8 and t? 8 Let q(d) = -d2 + 3d + 1. Let w be q(3). Let t(g) = 6g - 166. Let r be t(29). Calculate the greatest common factor of r and w. 1 Suppose 8 = 5f - 4t, 0f - 2 = f - 2t. Suppose 0 = 8h - 5h + 12. Let g be 5/(2(-1)/h). Calculate the highest common factor of f and g. 2 Let s(f) = f - 5. Let z be s(10). Suppose -m + zm = 120. Suppose p - 6p = -100. Calculate the highest common divisor of m and p. 10 Let v(x) = -x + 13. Let m be v(7). Let f be (16/3)/(1/6). Let z be (18/(-8))/((-12)/f). Calculate the highest common divisor of z and m. 6 Suppose -5b - 4h + 36 = 0, -5b + b = 4h - 32. Suppose -5f + bf = 5l + 8, 2f - 40 = 4l. What is the highest common factor of 24 and f? 12 Let p be 7 + ((-22)/(-33))/(2/(-12)). Let i = -17 - -32. Calculate the highest common factor of p and i. 3 Suppose c - 3 = 3s - s, -3c - 2s = -17. What is the highest common divisor of c and 40? 5 Let i = 87 + -61. Calculate the greatest common factor of i and 182. 26 Suppose 16m = 12m + 104. Calculate the highest common divisor of 182 and m. 26 Suppose 4z - 44 - 4 = 0. Calculate the greatest common divisor of z and 48. 12 Suppose 27 - 207 = -6w. Calculate the greatest common divisor of w and 5. 5 Suppose 3k = -875 - 1213. Let f be k/(-10) + (-6)/(-15). Calculate the greatest common factor of 10 and f. 10 Suppose j - 5j - 78 = -3m, 5j = -5m + 95. Let r(v) = -v2 + 7v - 4. Let l be r(6). What is the greatest common divisor of l and m? 2 Let a be (-4)/8(12 + 2). Let x = a - -10. Suppose 0 = -xl - l + 28. Calculate the highest common factor of 7 and l. 7 Suppose -4q = 2q - 108. Suppose 4x = -75 + 651. What is the greatest common divisor of q and x? 18 Let v = 3 - 2. Let w = v + 0. Suppose 0 = -a - w + 2. What is the greatest common divisor of a and 1? 1 Let u(h) = -h. Let i(s) = -2s - 9. Let g(f) = -i(f) + 3u(f). Let d be g(8). What is the highest common factor of d and 1? 1 Let o(z) = 3z3 - z2 + 4z. Let j = 5 - 2. Let d be o(j). What is the highest common divisor of 21 and d? 21 Let t(l) = 2l - 4. Let c be t(4). Let p be 6/21 + (-33)/(-7). Suppose 3y + 30 = 4y - 5i, 3y - pi = 70. Calculate the highest common factor of c and y. 4 Suppose 5q - 19 = 301. Let k = q + -46. Suppose -4i + 46 = 5w, w = 3*i - 62 + k. What is the highest co	{ "pile_set_name": "DM Mathematics" }
57z + 52z - 243)(3z2 - z2 - 4z2) to the form iz*3 + dz*2 + l + vz and give d. 486 Express -13 + 29k2 + 8k4 + k2 - 2k4 + 0k*4 + 10 as lk*3 + u + dk + wk4 + jk2 and give u. -3 Express 1050 - q2 + 60q - 1050 + 12q in the form cq2 + tq + d and give t. 72 Express -2532s2 + 4s - 2518s2 + 5112s*2 as v + gs*2 + ns and give n. 4 Express (-17c + 2c*4 + 101 - 53 - 46)(7 - 10 - 14) as zc4 + ic + sc3 + w + pc*2 and give i. 289 Rearrange -3y*4 + 4y*4 - 3y*4 + (-424y*2 + 424y*2 - 18y*3)(4y + 2y - 4y) to dy*3 + o + vy + iy4 + my*2 and give i. -38 Rearrange (-568 + 3k + 568 + 4k2)((13k - 96 + 96)(1 + 0 - 3) + k + 4k - 6k) to yk3 + ck + vk2 + o and give y. -108 Rearrange (-5s + 0s + 0s)(3s - 2s - 2s)(59 - 59 + 7s) - 1 + s*3 + 1 to ws + os3 + js*2 + m and give o. 36 Express (-5a - 29a + 2a)(2a - 2a + 2a)(7 + 4a - 7) - 4a3 + 4a*3 + 2a*3 as ka*3 + v + ua + ha2 and give h. 0 Rearrange 11k - 11k - k - 15k - 2k + k2 to qk*2 + z + rk and give r. -18 Rearrange (30n2 + 23n*2 - 63n*2)(2n + 0n - n) - 2n3 + 7n*3 - 3n*3 to the form fn*2 + zn + vn3 + m and give v. -8 Express -4u*3 - 5u - 9u3 + 9u*2 + 0u + 5u in the form zu + p + wu2 + xu*3 and give x. -13 Rearrange ((-5 + 2 + 5)(0 - 1 + 2) - 3 + 0 + 5)(-51q - 1967 + 1967) to p + yq and give y. -204 Express -48x - 268x + 47x - 7x - 270x as sx + o and give s. -546 Rearrange (-5z - 6z + 2z)(-3z + 2z + 0z)(-91 - 147 + 124) to q + hz*2 + az and give h. -1026 Rearrange (-3x + 3x*2 + 3x)(-118 - 17 + 6) to g + vx*2 + rx and give v. -387 Rearrange 244f3 + 1 + 2f*2 - 2f*2 + 2 - 88f*3 to wf*3 + af*2 + d + xf and give d. 3 Rearrange 11d - 62d - 56d to ld + c and give l. -107 Rearrange (-5 + 5 + 1)(2 - 2 - t4) - 127t*4 - 77t*4 + 64t*4 to k + st*4 + bt + pt2 + ht*3 and give s. -141 Express 678f*2 + 86f*2 + 376f*2 - 230f*2 in the form s + pf + of2 and give p. 0 Rearrange (5c*3 + 5c*3 + 5c*3 + 41c*3)(-5 + 3 + 5) to the form sc2 + ac + y + dc3 and give d. 168 Rearrange -2s*2 + 1 - 1 + (-4s*2 + 2s*2 - 6s*2)(3 + 0 - 2) + 4s2 - 3s*2 - 2s*2 + (s - 3 + 3)(-s - 12s - 3s) to y + us2 + ds and give u. -27 Express -4w2 + 15w*3 - 2w - 3w2 + 4w2 - w - w2 in the form dw2 + vw + k + lw3 and give l. 15 Express -y + 24y + 2 + 3y - 8 in the form n + gy and give n. -6 Express (15c + 3c + 2c + (-2 + 3 + 0)(2c + 2c - 3c) - 3 + 3 + c + 2 - 2 + c)(1 + 0 + 1) + 4c - 3c + 0c in the form gc + i and give g. 47 Express 15h + 2 + 26h - 35h + 58h in the form ph + r and give p. 64 Rearrange 68 - 221x - 135 + 66 to the form g + jx and give j. -221 Express (-4u*2 - 31u + 31u)(-11u + 37u - 7u)(5 - 5 + 1) as mu2 + c + vu*3 + du and give v. -76 Express -3o4 - 36o*4 - 2o*4 + (4o + 2o - 3o)(2o*3 - 2o3 - o3) as mo2 + yo*3 + zo + w + xo4 and give x. -44 Rearrange 29l*3 + 49l*3 - 14l*4 - 62l*3 + 7l*4 - 2 to a + fl*4 + sl + ol2 + dl*3 and give a. -2 Rearrange -4o + 0o - 2o + (-2o + 3 - 3)(0 - 1 + 3) + 17 + 3 - 3 + 2o to the form r + lo and give r. 17 Rearrange (4 + 35g - 4)(5g3 + 5g*3 - 4g*3) - 5g*4 + g - g to fg*2 + tg + ug4 + qg*3 + w and give u. 205 Express 232n - 149n + 176n in the form m + ln and give l. 259 Rearrange -2r + 79 + 16 + 19r2 - 21r*2 to or*2 + fr + v and give o. -2 Express -1 + 2v - 9v*3 - 7v*3 + 123 + 12v*3 in the form uv*3 + cv*2 + z + qv and give z. 122 Rearrange 60 + 41 + v - 33 to ov + s and give s. 68 Express (2 - 7 - 15)(0s + 0s + 7s)(2s - s + s)(5 - 3 - 1) as xs2 + ls + z and give x. -280 Rearrange -i*2 + 3i*2 + 0i*2 + (5 + 0 - 3)(2i2 + 3i - 3i) - 25i*2 - 40i*2 + 17i*2 to the form wi*2 + n + yi and give n. 0 Rearrange (-2x3 + 5x3 + x3)(-141x + 66x - 30x) to the form i + yx3 + fx*2 + vx + jx4 and give j. -420 Rearrange (26q - 70q + 35q)(-1 - 8q + 0q - 3q) to the form wq2 + x + cq and give c. 9 Rearrange 3 + 4 - 11 - 15g + 5g to the form m + hg and give h. -10 Express (4p + 2p - 4p + p*2)(164 - 117 + 83)(-4 + 3 + 3) as yp*2 + np + f and give f. 0 Express -10l3 + 0 + 30l + 2 - 4 - 29l - l2 in the form cl*2 + q + hl + wl3 and give h. 1 Express (-2d - 3d + 6d)(-6d*3 + 0d + d + 13 + 5d3) as jd*3 + v + yd + bd4 + zd*2 and give z. 1 Rearrange 2a2 + 19817 + a3 - 19817 - 3a2 - 3a - 90a4 to z + ha*3 + ja*4 + ba*2 + ca and give h. 1 Rearrange -145 + 36o3 - 11o*3 - 9o*3 - 13o*3 - 40 to xo + ko3 + q + po*2 and give q. -185 Rearrange (2q + 17q - 5q)(1 - 100 - 33) to the form cq + f and give c. -1848 Express 2 - 66d2 + 136d*2 - 1 + 1 as n + ud + hd2 and give h. 70 Express 75467j*2 - 76950j*2 - 5j + 3j + 2j in the form uj2 + aj + l and give u. -1483 Express -23u3 - 2u*2 - 39u*3 + 4 + 55u*3 - 3 + 0 + 6u as ju3 + gu + o + bu2 and give j. -7 Express (34f + 47f - 20f)(-1 + 1 - f)(-4f - 5f + 4f)((-1 + 0 - 1)(-3 + 4 + 1) + 2 + 0 - 4 + 2 + 1 + 0) as x + af*3 + df + of2 and give a. -915 Express 1954c + 614c + 58c in the form m + tc and give t. 2626 Express -10g*3 - 5g + 3091 - 2g - 10g - 3093 + 3g3 in the form ug + zg3 + og*2 + x and give x. -2 Express (-3o + o + 4o)(0o + 2o - 3o) - 97o - 17 + 98o + 19 - 9o*2 - 4 - 16o*2 + 4 in the form po*2 + l + so and give s. 1 Express 2k - 4 + 14k*2 + 7 - 159k*3 + 1 + 158k*3 as q + hk + bk3 + wk*2 and give h. 2 Rearrange (-3j - j + 2j)(72 - 10 + 228 + (1 - 1 + 3)(1 - 2 + 2)) to the form p + hj and give h. -586 Express (-4o - 7o + o)(-5o - 3o + 5o) + (-2o + o + 4o)(4o + 2o - 4o) as z + mo + bo*2 and give b. 36 Rearrange -3v*2 + 0v*3 - 2v*3 + 15v*2 - 9v*2 - 6v*2 + 3 to gv*3 + ov*2 + q + zv and give g. -2 Express -173r3 - 33r*2 + 90r*3 - 46r*2 - 126r*2 + 81r*3 in the form br*2 + ur*3 + kr + z and give b. -205 Rearrange (19 - 259 - 8)(4n*3 + 3n*4 - 5n*3 + 17n*2 - 19n*2) to the form rn*3 + zn*2 + wn + u + fn4 and give f. -744 Rearrange -4598 + 367r + 4598 to ur + y and give u. 367 Express 65s - 101s2 - 102s*2 - 105s*2 + 311s*2 as w + vs*2 + js and give j. 65 Rearrange -2 + 33z2 + 22z*2 + 52z2 + z2 - 17z2 to the form kz*2 + b + pz and give b. -2 Express -n + 39n2 - 37n2 + n4 - n*3 - 7 + 3n as pn3 + y + on*4 + zn + in2 and give o. 1 Express -148h*2 + 231h*2 + 189h*2 - 63h*2 + 338h*2 in the form ih + mh2 + t and give m. 547 Express -16t - t2 - t2 - 20t + 368t*3 - 366t*3 as xt + bt3 + zt*2 + m and give x. -36 Express 29298h - 29298h - 163h*3 + (0h - h + 0h)(2h2 - 2h2 - h2) as k + qh2 + uh + sh3 and give s. -162 Express 26 - 21 - 6j*2 - 8j*2 - 2j*3 + 33j*2 - 4j*2 - 2j*4 in the form gj + qj3 + pj*4 + mj*2 + x and give p. -2 Rearrange (2 - 1 - 4)(12b + 5b - 7b - 1) - 25 - 4b + 25 to the form zb + x and give x. 3 Express -4c + 9c2 - 5 + 5 - 314c*3 + 315c*3 in the form yc + wc2 + j + zc*3 and give w. 9 Express 481q*2 + 73q*2 + 5q*2 as uq + l + oq2 and give o. 559 Rearrange -37k*4 + 94k*4 - 23k*4 + (-3k - k + 5k)(-k3 + k3 + k*3) - 64k*2 + 2k*4 + 64k*2 to dk*3 + ok + yk2 + r + nk*4 and give n. 37 Rearrange (70 - 15 + 20)(4r2 - 3r*2 + 0r*2) to the form br*2 + k + ar and give a. 0 Express (2j - 4j + 3j)(6 + 4 + 32j - 12) as oj + dj2 + q and give d. 32 Rearrange -877r + 879r + 2r3 - 1 - r2 + 0r3 - 3r*4 to ir + ur2 + yr*4 + kr*3 + d and give u. -1 Rearrange (-3z + 2z + 12z)(3z*2 - 2z*2 + 4z*2 + (-4 + 1 + 4)(-z + z + z*2)) - 2z3 - z3 + z*3 to the form lz*2 + t + vz + uz3 and give u. 64 Rearrange 324t - 324t - 17 - 7t2 - t2 to o + gt + rt*2 and give o. -17 Express (-6g - 2g2 + 6g)(54 - 4 + 16 + (4 - 3 + 0)(2 - 2 - 1) + 0 - 2 + 0) in	{ "pile_set_name": "DM Mathematics" }
*2 + 425i + 750 = 0? -6, -5 Solve 144z5 + 1632z*4 - 1196z*3 - 532z*2 - 48z = 0. -12, -1/6, 0, 1 Let -t*2 + 7t = 0. Calculate t. 0, 7 Find y, given that -y*5/4 + 5y*4 - 59y*3/2 + 72y*2 - 297y/4 + 27 = 0. 1, 3, 12 Let -c*2/5 - 9c + 46/5 = 0. Calculate c. -46, 1 Find m such that 3m2/8 - 33m/8 + 15/4 = 0. 1, 10 Factor -g*2 - 3g + 18. -(g - 3)(g + 6) Let o5/3 + o4 - o3/3 - 7o*2/3 + 4/3 = 0. What is o? -2, -1, 1 Factor -2r*4/3 - 2r*3/3 + 16r*2/3 + 8r. -2r(r - 3)(r + 2)2/3 Factor -2m*2/3 - 10m/3 + 100/3. -2(m - 5)(m + 10)/3 Find o such that 3o5 + 3o*4 - 39o*3 - 3o*2 + 36o = 0. -4, -1, 0, 1, 3 Suppose -5c3 - 225c*2 - 2640c - 2420 = 0. Calculate c. -22, -1 Factor 2v3/9 + 40v*2/9 - 62v/3 + 16. 2(v - 3)(v - 1)(v + 24)/9 Let 2s*2 + 70s + 68 = 0. What is s? -34, -1 Determine c, given that 2c5 + c4 - 30c*3 + 64c*2 - 52c + 15 = 0. -5, 1, 3/2 Factor j*4/6 - 13j*3/6 + 11j2/3. j2(j - 11)(j - 2)/6 Factor 170g3 + 15g*2 - 170g - 15. 5(g - 1)(g + 1)(34g + 3) Factor -14k4/19 - 32k*3/19 - 22k*2/19 - 4k/19. -2k(k + 1)*2(7k + 2)/19 Factor -2b*2 - 196b + 198. -2(b - 1)(b + 99) Factor -2s3/7 + 8s*2/7 + 10s - 300/7. -2(s - 5)2(s + 6)/7 What is g in -4g2 + 164g + 528 = 0? -3, 44 Factor -4f3 - 16f*2 + 20f. -4f(f - 1)(f + 5) Factor -i3 + 7i*2 - 12i. -i(i - 4)(i - 3) Solve 3s5 + 93s*4 + 846s*3 + 1932s*2 + 1176s = 0 for s. -14, -2, -1, 0 What is o in 5o5 - 35o*4 + 70o*3 - 40o*2 = 0? 0, 1, 2, 4 Determine x so that -2x*2/5 + 2x/5 + 8 = 0. -4, 5 Factor 3r4 + 15r*3 - 21r*2 - 15r + 18. 3(r - 1)2(r + 1)(r + 6) Determine f so that -4f*5 - 30f*4 - 80f*3 - 90f*2 - 36f = 0. -3, -2, -3/2, -1, 0 Factor 4b5 + 108b*4 + 392b*3 + 568b*2 + 372b + 92. 4(b + 1)4(b + 23) Suppose -4u4 + 4u*3 + 20u*2 + 12u = 0. Calculate u. -1, 0, 3 Suppose 3a3 - 90a*2 + 171a - 84 = 0. What is a? 1, 28 Factor -2q2 + 14826q. -2q(q - 7413) Find n, given that n*5/2 + 7n*4 + 21n*3 - 20n*2 - 107n/2 + 45 = 0. -9, -5, -2, 1 Factor -5m2 - 1430m - 102245. -5(m + 143)2 What is s in 2s*5/7 - 60s*4/7 + 506s*3/7 - 120s*2 + 56s = 0? 0, 1, 14 Find g, given that -g*2/3 + 10g - 209/3 = 0. 11, 19 Suppose -2z2/3 - 88z = 0. Calculate z. -132, 0 Let -2w3 - 48w*2 - 232w - 288 = 0. Calculate w. -18, -4, -2 Determine p so that -p*3/2 - 11p*2/2 + 13p = 0. -13, 0, 2 Determine c, given that -9c4/2 - 1941c*3/2 + 4595c*2/2 + 3709c/2 + 327 = 0. -218, -1/3, 3 Factor -o*2 + 2026o - 1026169. -(o - 1013)*2 Solve -3v*4 - 84v*3 - 357v*2 - 276v = 0 for v. -23, -4, -1, 0 Determine f so that 4f5/7 - 10f*4/7 - 8f*3/7 + 24f*2/7 = 0. -3/2, 0, 2 Suppose 3q*2 - 75q + 72 = 0. Calculate q. 1, 24 Solve 2q4 - 112q*3 + 984q*2 - 3008q + 2944 = 0. 2, 4, 46 Determine x so that -3x2 - 174x - 2523 = 0. -29 Factor -h*3/4 - 34h*2 - 1008h + 10368. -(h - 8)(h + 72)2/4 Solve -5l*2 - 190l - 185 = 0. -37, -1 Suppose 2i5 + 8i*4 - 58i*3 + 56i*2 + 56i - 64 = 0. What is i? -8, -1, 1, 2 Factor 3s2/4 - 123s + 489/4. 3(s - 163)(s - 1)/4 Let 4d3 - 248d*2 + 4292d - 13456 = 0. Calculate d. 4, 29 Factor 5f4 + 53f*3 + 178f*2 + 160f - 96. (f + 3)(f + 4)2(5f - 2) Factor -6y*4 - 4y*3 + 24y*2 + 16y. -2y(y - 2)(y + 2)(3y + 2) Solve 4s2 - 4 = 0. -1, 1 Find q such that -q3/5 - 4q2/5 + 12q/5 = 0. -6, 0, 2 Find p such that 7p4/2 - 33p*3/2 - 26p*2 - 6p = 0. -1, -2/7, 0, 6 Factor 4d2. 4d2 Let w5/6 + 7w4/2 + 31w*3/2 + 35w*2/6 - 25w = 0. Calculate w. -15, -5, -2, 0, 1 Factor 98u3/9 - 22106u*2/9 + 12608u/9 - 200. 2(u - 225)(7u - 2)2/9 Determine b so that 5b*4 + 235b*3 + 1070b*2 + 840b = 0. -42, -4, -1, 0 Determine k so that 7k4/5 + 10k*3 + 21k*2 + 14k + 8/5 = 0. -4, -2, -1, -1/7 Suppose -3m5 + 24m*4 + 135m*3 + 108m2 = 0. What is m? -3, -1, 0, 12 Factor -l2/9 + 2l/9 + 32. -(l - 18)(l + 16)/9 Suppose -4y3/7 - 248y*2/7 + 512y/7 = 0. What is y? -64, 0, 2 Suppose 2t3 - 70t*2 + 494t + 2166 = 0. What is t? -3, 19 Factor 3k5/4 - 3k*4 - 96k*3 + 576k*2. 3k*2(k - 8)*2(k + 12)/4 Factor 8w4/9 + 14w*3/3 + 10w*2/9. 2w*2(w + 5)(4w + 1)/9 Factor h*2/4 + 5h + 19/4. (h + 1)(h + 19)/4 Factor 3f*4 + 6f*3 - 9f*2. 3f*2(f - 1)(f + 3) Factor x2/4 + 1039x + 1079521. (x + 2078)*2/4 Factor 5d*2 + 590d + 6360. 5(d + 12)(d + 106) Determine l so that 2l4/5 + 5908l*3/15 - 13808l*2/15 + 9868l/15 - 658/5 = 0. -987, 1/3, 1 Solve -52r4 + 216r*3 - 188r*2 + 24r = 0 for r. 0, 2/13, 1, 3 Suppose 3g4 + 1941g*3 - 9g*2 - 5817g + 3882 = 0. Calculate g. -647, -2, 1 Factor a*2/3 - 10a/3 - 13. (a - 13)(a + 3)/3 What is l in -l4 - 61l*3 + 130l*2 + 244l - 504 = 0? -63, -2, 2 Factor 4s2 - 92s - 96. 4(s - 24)(s + 1) Solve -2u4/7 + 4u*3/7 + 6u*2/7 - 8u/7 - 8/7 = 0 for u. -1, 2 Factor r*2/4 - r - 45/4. (r - 9)(r + 5)/4 Let -5w5 + 870w*4 + 3620w*3 - 10520w*2 - 28800w + 56960 = 0. Calculate w. -4, 2, 178 Suppose -15c4 - 155c*3 - 280c*2 + 20c + 160 = 0. Calculate c. -8, -2, -1, 2/3 Solve 4q4/7 - 472q*3/7 + 14388q*2/7 - 27376q/7 + 13456/7 = 0 for q. 1, 58 Factor 5k5 + 5k*4 - 35k*3 - 65k*2 - 30k. 5k(k - 3)(k + 1)2(k + 2) Factor 5v5 - 215v*4 + 3240v*3 - 20800v*2 + 48640v. 5v(v - 19)(v - 8)3 Solve n3/4 + 2051n*2/4 + 1048567n/4 - 3164187/4 = 0 for n. -1027, 3 Let 6b2 - 3314b + 1104 = 0. Calculate b. 1/3, 552 Suppose -2500q3 - 56300q*2 + 27456q - 3312 = 0. Calculate q. -23, 6/25 Find x, given that x*2/4 - 5x/2 = 0. 0, 10 Factor l*4 - 10l*3 + 19l*2 + 30l. l(l - 6)(l - 5)(l + 1) Factor 2k*4/5 - 6k*3/5 - 138k*2/5 + 286k/5 - 144/5. 2(k - 9)(k - 1)*2(k + 8)/5 Factor -3h4/5 + 3h*3/5 + 3h*2 + 9h/5. -3h(h - 3)(h + 1)2/5 Factor m3 - 86m*2/5 + 227m/5 - 42/5. (m - 14)(m - 3)(5m - 1)/5 Solve 2b*4 + 2b*3 - 4b*2 = 0 for b. -2, 0, 1 Let 3r*3 - 246r*2 + 1824r - 3552 = 0. Calculate r. 4, 74 Determine j so that -3j5/2 - 9j*4/2 + 27j*3/2 + 69j*2/2 - 36j - 54 = 0. -3, -1, 2 Determine g, given that -8g2/3 - 12106g/3 - 3026/3 = 0. -1513, -1/4 Suppose 40p3 + 76p*2 - 16p - 16 = 0. Calculate p. -2, -2/5, 1/2 Suppose 6o4 - 10o*3 - 34o*2 + 26o + 12 = 0. What is o? -2, -1/3, 1, 3 Let -y*3/8 - 147y*2/4 - 7203y/2 - 117649 = 0. What is y? -98 Find x, given that -5x5 + 10x*4 + 30x*3 - 100x*2 + 95x - 30 = 0. -3, 1, 2 Factor 2g4/7 - 10g*3/7 - 6g*2/7 + 34g/7 - 20/7. 2(g - 5)(g - 1)*2(g + 2)/7 Factor -3c3/4 - 201c*2/4 + 207c/2. -3c(c - 2)(c + 69)/4 Factor -7q*3/4 - 243q*2/4 + 161q/2 - 18. -(q - 1)(q + 36)(7q - 2)/4 Find g, given that g3/3 - 140g*2/3 + 277g/3 - 46 = 0. 1, 138 Factor 12w3 - 33w*2 + 15w + 6. 3(w - 2)(w - 1)(4w + 1) Solve 3v2/2 - 48v - 102 = 0 for v. -2, 34 Factor 3r3 + 102r*2 + 756r - 1944. 3(r - 2)(r + 18)2 Factor f4/3 + 6f3 + 27f2. f2(f + 9)2/3 Factor -f5 - 5f4 - f3 + 17f2 + 22f + 8. -(f - 2)(f + 1)3(f + 4) Determine g, given that -13g2/5 - 27g/5 - 2/5 = 0. -2, -1/13 Factor -3f2/5 - 8082f/5 - 5443227/5. -3(f + 1347)2/5 Determine k, given that -4k*4/7 + 30k*3/7 + 92k*2/7 + 78k/7 + 20/7 = 0. -1, -1/2, 10 Find a, given that -a*3/3 + 16a*2/3 - 5a = 0. 0, 1, 15 Determine r so that 21r3 + 771r*2 - 222r = 0. -37, 0, 2/7 Solve -2o5/3 - 20o*4/3 - 32o*3/3 + 4o*2/3 + 34o/3 + 16/3 = 0 for o. -8, -1, 1 Factor -3j2/7 + 15234j/7 - 19339563/7. -3(j - 2539)2/7 Find a such that -2a*2/11 - 42a/11 + 144/11 = 0. -24, 3 Factor 15c3 - 305c*2 - 560c + 220. 5(c - 22)(c + 2)(3c - 1) Let 14f3/5 + 32f*2/5 - 2f/5 - 4 = 0. What is f? -2, -1, 5/7 Factor -2j2 + 24j - 64. -2(j - 8)(j - 4) Factor -4u3/3 + 2080u*2/3 - 89436u - 181656. -4(u - 261)2(u + 2)/3 Factor -2g4/3 + 16g*3/3 + 50g*2 + 84g. -2g(g - 14)(g + 3)2/3 Factor 2x*2/7 - 3568x + 11139296. 2(x - 6244)2/7 Suppose -n5/2 + 17n*4/2 + 61n*3/2 - 17n**2	{ "pile_set_name": "DM Mathematics" }
74647562 In base 14, what is 483 + -dd30? -d88b In base 2, what is -110001100001111 + 1000000000000? -101001100001111 In base 13, what is 550c29 + -4? 550c25 In base 8, what is -1573260 + -671? -1574151 In base 15, what is -19ea0b + -e? -19ea1a In base 3, what is -2111010222 + -1101000? -2112111222 In base 15, what is -1223 + d23? -400 In base 5, what is -1341 + 230332? 223441 In base 15, what is 2a - 12b1d5? -12b1aa In base 5, what is -44310030 - 242? -44310322 In base 10, what is -378458052 - -5? -378458047 In base 13, what is -5 + -79c1a? -79c22 In base 15, what is -8e1 + 47d? -463 In base 11, what is 2a07 - -9497? 113a3 In base 8, what is -72 + 2011777? 2011705 In base 6, what is -5032034 + 32? -5032002 In base 2, what is -10 + 110011010001000001001? 110011010001000000111 In base 14, what is -6856924 + -5? -6856929 In base 3, what is 12122 + 2122001210? 2122021102 In base 12, what is 9a1 + -2183? -13a2 In base 6, what is 1 - 12223105? -12223104 In base 4, what is 11013301 + -21232? 10332003 In base 8, what is -22 - -1273707? 1273665 In base 11, what is -552733 - -17? -552717 In base 16, what is -20a - -557f? 5375 In base 2, what is 101 - -11000010001111011101100010? 11000010001111011101100111 In base 10, what is 2 - 4429372? -4429370 In base 4, what is 13102223122200 - 10? 13102223122130 In base 16, what is -474 + c03e? bbca In base 5, what is 21133 + 342132? 413320 In base 15, what is 5671b2 + b? 5671bd In base 11, what is -20610 - -315? -202a6 In base 13, what is 18 + 1a2a624? 1a2a63c In base 6, what is -2011333 - 52? -2011425 In base 6, what is 21101452 + 1224? 21103120 In base 4, what is -101300212112 + -3? -101300212121 In base 14, what is -1880cb5 - 1? -1880cb6 In base 4, what is 10102221132103 - 3? 10102221132100 In base 11, what is 8 + 70a143? 70a150 In base 16, what is -8454 - 15? -8469 In base 4, what is 1313 + 23211230? 23213203 In base 12, what is 435 - -5a4292? 5a4707 In base 9, what is 1886 + 2440? 4436 In base 16, what is 48aa714 - 8? 48aa70c In base 12, what is -169a - -626b? 4791 In base 16, what is -3b2 - 10e90? -11242 In base 11, what is 16 - -91412? 91428 In base 15, what is 3 + 3cb824? 3cb827 In base 13, what is 30a134 - 11? 30a123 In base 5, what is -41334324 - -2133? -41332141 In base 10, what is -1143202 - 1? -1143203 In base 14, what is -6 - 6c1c9? -6c1d1 In base 3, what is 0 + -102012021222000120? -102012021222000120 In base 9, what is 60067 - -4267? 64345 In base 6, what is -244542 + 5114? -235424 In base 8, what is 213 + 14610? 15023 In base 15, what is 254 + -70ce? -6d7a In base 7, what is 0 + -363020515? -363020515 In base 4, what is -31210232 - -222132? -30322100 In base 3, what is -1001101011 - 10211000? -1012012011 In base 12, what is -8 - 140735b? -1407367 In base 10, what is 27 - -13179? 13206 In base 12, what is -17 + -811b5? -81210 In base 9, what is 36 + -3347823? -3347776 In base 7, what is -5 - 2641106231? -2641106236 In base 13, what is 1 + -214699? -214698 In base 4, what is -103303323112111 - -3? -103303323112102 In base 10, what is -1362 + -28413? -29775 In base 3, what is 2202020111220222 - -11? 2202020111221010 In base 4, what is 11021211032 - -1201? 11021212233 In base 9, what is -322164485 + 4? -322164481 In base 6, what is 5 - 14325210032? -14325210023 In base 9, what is 157 - 13538? -13371 In base 11, what is 1299 + 4034? 5322 In base 7, what is -2035566 + -253? -2036152 In base 13, what is 31127 + 12b? 31255 In base 5, what is -11322 + -11132032? -11143404 In base 5, what is -141204302444 - -3? -141204302441 In base 15, what is -c334ed + 5? -c334e8 In base 8, what is 3030 - -3331? 6361 In base 2, what is 100011 - 110100101101110? -110100101001011 In base 12, what is -7474a8 + b8? -7473b0 In base 5, what is 12 - 3130020210? -3130020143 In base 16, what is -5 - 8d7c88? -8d7c8d In base 6, what is -302422440142 + 5? -302422440133 In base 11, what is 6618225 + -5? 6618220 In base 14, what is -1b + 286c50? 286c33 In base 10, what is 266 + 212091? 212357 In base 16, what is -5167b2 - -7? -5167ab In base 13, what is -5 - -5370677? 5370672 In base 14, what is -1 + -15d6c? -15d6d In base 8, what is -377674 + -13? -377707 In base 10, what is -22645 - 460? -23105 In base 10, what is -5093243 + -7? -5093250 In base 5, what is 42142332412 + 0? 42142332412 In base 8, what is -2125557 + 0? -2125557 In base 7, what is -261 + -6660644? -6661235 In base 12, what is -261537 + -69? -2615a4 In base 16, what is -2ec + 8d98? 8aac In base 15, what is 58cd + 22d? 5b0b In base 2, what is -1000100001 + -10111100001010? -11000100101011 In base 14, what is -2d - -1663a73? 1663a44 In base 9, what is 25 + 8112831? 8112856 In base 6, what is -2335 - -122524515? 122522140 In base 3, what is 11 - -111102200102221? 111102200110002 In base 13, what is 373 - -6452? 67c5 In base 6, what is -110032 + 153352? 43320 In base 12, what is 572827b - 5? 5728276 In base 11, what is 4 - -895090? 895094 In base 4, what is 3 - -20002201233? 20002201302 In base 6, what is -20404 + 131453? 111045 In base 4, what is 10133112220203 + -12? 10133112220131 In base 11, what is 5250 - 613a? -99a In base 2, what is -10011001011 + -1010101101000111? -1011000000010010 In base 6, what is 1 + -1005552212? -1005552211 In base 10, what is 4 - -1820636? 1820640 In base 10, what is -5 - 444384? -444389 In base 4, what is 1330033320 - -11111? 1330111031 In base 10, what is 469310 - 91? 469219 In base 12, what is -34960 - -56? -34906 In base 10, what is -203098000 - 1? -203098001 In base 14, what is -2c5b1 - 2? -2c5b3 In base 8, what is -65735641 + 3? -65735636 In base 12, what is 595393 - 1? 595392 In base 12, what is -4 + -14860688? -14860690 In base 9, what is 5327 + -48300? -42862 In base 6, what is 523135 + 211? 523350 In base 13, what is 5 - 2414a206? -2414a201 In base 2, what is 101 + -1001001010101110100001? -1001001010101110011100 In base 2, what is -11110000101011111000111 + 100? -11110000101011111000011 In base 8, what is -4651635724 - -5? -4651635717 In base 8, what is -3 - 1355070314? -1355070317 In base 13, what is -22a984b + 8? -22a9843 In base 15, what is 255e - -1547? 3aa6 In base 9, what is -63 - -433735? 433662 In base 4, what is -2 + 13112130303? 13112130301 In base 4, what is -322 - -3223031203? 3223030221 In base 7, what is -5 - 10512342? -10512350 In base 12, what is 1a067390 + 2? 1a067392 In base 10, what is -119 + -17145584? -17145703 In base 6, what is 254142003 - 0? 254142003 In base 9, what is -66285 - 1200? -67485 In base 10, what is 359154 + -111? 359043 In base 2, what is -11101011100101 - 1001111101101101? -1101101001010010 In base 3, what is -2 - 1020120120220110? -1020120120220112 In base 6, what is -104355042540 - -5? -104355042531 In base 16, what is -1fee - -ea9? -1145 In base 10, what is 2 + 37430106? 37430108 In base 3, what is 22222210000100011 + 2? 22222210000100020 In base 3, what is 110121 + 10121101201010? 10121102011201 In base 6, what is 3 - -30554300? 30554303 In base 7, what is 44554503 + 2? 44554505 In base 13, what is -10351789 + 2? -10351787 In base 9, what is -5 + -45621137? -45621143 In base 11, what is -21701a940 + 5? -21701a936 In base 15, what is -2d5a + -93a4? -c20e In base 5, what is -11132 + 1421044? 1404412 In base 5, what is -332 - 1023203? -1024040 In base 6, what is 44 + 235431230? 235431314 In base 13, what is -4 - -9313a58? 9313a54 In base 5, what is -2 + 11120121? 11120114 In base 5, what is 223123430343 + -2? 223123430341 In base 13, what is -8251c858 - 1? -8251c859 In base 6, what is 341002 + -524? 340034 In base 16, what is 39b6 - -10b? 3ac1 In base 16, what is -27679e - d4? -276872 In base 3, what is -21102202 - -2100022? -12002110 In base 8, what is -3 - 5710000? -5710003 In base 10, what is 50378942 - -1? 50378943 In base 14, what is 1 + 9155630? 9155631 In base 12, what is 2639 + 2ab? 2928 In base 4, what is 31233023233 - -3? 31233023302 In base 15, what is -8 - -c88e? c886 In base 16, what is 32f + 1181? 14b0 In base 2, what is -100 - -10011011010110010101010? 10011011010110010100110 In base 3, what is -11 - -110020102111020? 110020102111002 In base 5, what is -4202441014 - 4? -4202441023 In base 6, what is 113450513 - 1033? 113445440 In base 16, what is 21f574b - -3? 21f574e In b	{ "pile_set_name": "DM Mathematics" }
is positive. l(-248/81) Simplify (o/(((o2/o)/o)/o)oo*1o*(-3)oo/(o(o/(o/(o(-1)/o)))/o))/((o(-1/4)o)(-21)/((oo/o(-1/4))/o1)) assuming o is positive. o22 Simplify (p(-5/4)/p4)(-1/40)(p(-1/2)p)*29/((p/(p/((pp/p*(-1/6)p)/p)p))/(pp/(pp(-2/3))p)) assuming p is positive. p*(2581/160) Simplify (((oo(o/(o(-4)o))/o)/o(-11/4))/((((o19o)/o)/o)/(oo*(7/3)o)))(2/5) assuming o is positive. o(-71/30) Simplify (cc(3/19))12/(c(1/6)cc22) assuming c is positive. c(-1057/114) Simplify ((tt(-1/31))(4/23)(t/t(-2/51)t)(1/17))(-2/23) assuming t is positive. t(-356384/14217933) Simplify ((j/(j(-2/25)/j))/(j/(jj/(j18j)))jj/(jjj/j*(-1/7)j)jj(-13)/j)50 assuming j is positive. j(-10872/7) Simplify ((v/(v(3/4)/v))*(20/7)(v(v/(v/(v1v)))/v)(4/15))(2/15) assuming v is positive. v(862/1575) Simplify (o2o(2/11))/(o0o*(-2/9))(o(-6/5)/o(-2/11))48 assuming o is positive. o(-23002/495) Simplify (k*8k/k(-1/12))16/((kk(3/4))/(k/(k(-5)/k))kk/(k/(k((k*6/k)/kk)/kk))k(-6)) assuming k is positive. k(1795/12) Simplify (((v(((v(2/5)vv)/v)/v)/v)(-1/30)(v(-2))50)(2/11))(-2/19) assuming v is positive. v*(30004/15675) Simplify (jjj/j(-19))/(j/(j(-1/10)/j))(j*(-18)j)/jj22 assuming j is positive. j(239/10) Simplify (((h(1/7)hh(-1)hh)/(h/(hh/h1))(39/5))(-14/13))(-6/13) assuming h is positive. h(180/169) Simplify (p(-1)/(p/(p*14/p)p)(p/((p2/p)/p))(27/2))(1/81) assuming p is positive. p(47/162) Simplify w(-2/3)/(w(-2/5)/w)w/w*(1/9)(w/(ww/(w(2/3)/w)))/w(w*2www)*(-24)(ww/(w(-2)w))(2/3) assuming w is positive. w(-5342/45) Simplify ((uu(-1/5)/uu)/u(-2/7))38(u0u/u(1/3))/(((u(3/5)u)/u)/(u(-3)u)) assuming u is positive. u(4129/105) Simplify ((x/((x/(x/(x/(x(-2/25)x)))x)/x)x(-5)/xx*(1/3)xx/(xxx(-5/4)x))(-2/13))(-4/3) assuming x is positive. x(-2698/2925) Simplify (k(2/3)k(-2/7))13/(((k(3/5)/k)/k(1/4))/(kk*(-1)kk)12) assuming k is positive. k(12433/420) Simplify (((f/((ff*(-26))/f)ff)/f(5/8))/(f(-9)ffff(-26)))38 assuming f is positive. f(9177/4) Simplify (fff(-1/4)/f)/f3(ff2)(1/8)((f(-3)/f)/f(-4))/((f/((f/(f*(-1)f))/f))/(f/(((ff(-8))/f)/f))) assuming f is positive. f(57/8) Simplify (((o/o(-8))/oo/o(-2))/(o2o9))11 assuming o is positive. 1 Simplify ((u(-1/16)/u)/(u(-11/4)u))*(-26)(uu/u0)(-2/23)/(uuu7u(u9uu)/uuuu) assuming u is positive. u(-7553/184) Simplify (j/j(-2/5))*(-24)(jj/(jj*(-7)j))/jj/j2((j/(j/(j*(-1/3)j)))(4/19))(-8) assuming j is positive. j*(-8471/285) Simplify ((q/(q/(((q(q*(-4)/q)/qq)/qqq)/q)))(-2/3))(-45)((q(-3/5))(4/5))(2/67) assuming q is positive. q(-201024/1675) Simplify ((ooo7)/ooo7)(-21)(o*(3/4)o/(o/o5))/(o(-2/17)o/((o/o1)/o)) assuming o is positive. o(-22585/68) Simplify ((m/m(-1/4)m)(6/23))41/((m*(-6)m)/(mmm/m*2m))(-28) assuming m is positive. m(-7909/46) Simplify ((k0/k(-14))5)45 assuming k is positive. k3150 Simplify ((b2/(b*3b))/(b1)(1/3))/((((bbb/(bbbb(b/(b*(2/5)/b))/bb))/bb)/b)49b/(bb6)b(3/4)/b) assuming b is positive. b(10819/60) Simplify ((cc(-1/4))33)25ccc/((c/(c/(c*5cccc)))/ccc)c*(2/21)(ccc(-2/11))/c(-5) assuming c is positive. c(571645/924) Simplify (n(-6)/((n/(nn(nnn/(nn(-2/3)n)n)/nnn)n)/n)(n0n)(1/31))/((n(1/2))*(-16/5)/(n/((nn(-2))/n))(-43)) assuming n is positive. n(-59846/465) Simplify ((d(-2/9)/d)(-29))(-20)(d1)3(d0)(-40) assuming d is positive. d(-6353/9) Simplify ((k/k(-4/3)k)/(kkk(1/6)k)k(6/13)/kk29)(-28) assuming k is positive. k(-31262/39) Simplify s(-2/13)/sss*1ss(2/3)s/(ss(-2)s)(s(-6)s/s*4)/(sss(s/((ss(2/7)/ss)/ss))/sss)46 assuming s is positive. s(-48142/273) Simplify (ww*(-2)w(-3/4)/w)/(w(1/3)/(w*(-7)/w))(w/(w*(-1/4)w)w)(-2/13)/(w(-1)/w)39 assuming w is positive. w(10409/156) Simplify (a6aa/a2a)/(a*(-2)a*(2/3)/a)(a0)(-1/35)/(a*(2/3)aa/a(3/5)a) assuming a is positive. a(94/15) Simplify (((j28j)/jjj(13/3)jj)(-28/5))43 assuming j is positive. j(-127624/15) Simplify ((x(4/3)/x)/(x(x/x(-2/25))/x))(-1/17)x7/(x/(x/(xx/((x*(-1)/xxx)/x)xx)))x*(1/5)x3 assuming x is positive. x(6686/1275) Simplify ((t/t*(1/5)tt)/t)/(t(-6)tt)(t/(tt(-5)))/tt/(ttt/(tt5t))((t(-1)/t)/t)(-2/129)(t1)48 assuming t is positive. t(13512/215) Simplify (c/(c/c(2/3))c(-2/11))(26/9)c*(-2/3)c*(-2/5)c*(-4)c(3/7) assuming c is positive. c(-33653/10395) Simplify ((g*(-4)gg(-6/7)g)/((ggg*(-2/7)ggg)/g)(1/9))(-19) assuming g is positive. g(3914/63) Simplify (w(2/5))(-45)/((w5w)/w(-1/12))((w0)(3/8))(1/14) assuming w is positive. w(-289/12) Simplify (((j/(jj(2/5)))/j)/(j/j(-7)j))/(jj/j(1/3))(-3/14)(j*6j*(-6)j)11 assuming j is positive. j(67/70) Simplify ((((pp(-29))/ppp(-1/3)/p)(-40))(-49))41 assuming p is positive. p(-7071680/3) Simplify ((y(-11/5))(-19)/(y/y(-11))(-26))36 assuming y is positive. y(63684/5) Simplify (o/(oo(2/11)))/o(-3/7)(oo*(-2/7)o)/o*5(o*(-1/5)o)/oooo(-4)oo(-1/3)o(-1/3) assuming o is positive. o(-5666/1155) Simplify ((i*(4/15)iii*(-16/5)i)(-28))37 assuming i is positive. i*(-1036/15) Simplify ((gg*(-1)g)10)(7/4)(g(-1/4)/(gg7/g))(-48) assuming g is positive. g(731/2) Simplify (l(-3/10)/(ll(-12)/l))23(l/(ll(-2))l)*13l*(3/5)l(-2/9) assuming l is positive. l(27763/90) Simplify (h*(-2/11)/(hh(1/6)))/((h(1/3)h)/hh/((h/(h*6/h))/h)h)h(-6)/((h(-1/4)h)/h)(h(3/4)h)/h(6/5) assuming h is positive. h(-1527/110) Simplify ((x*(-22)/(xx/(x*(-21/2)/x)xx))/((x/(xx/((xx/(xx*12))/x)))/(x((x(16/3)/x)/x)/x)))25 assuming x is positive. x(-3175/6) Simplify (b/b(-8)b/(b/(b(-2)b)))/(((b*(-2/7)b)/b)/(b/(b/(b*(-6)/b))))((b/b*(-2/25))/bb(-5/2)/b)(-19) assuming b is positive. b(23193/350) Simplify ((k(1/4))25)(-5)(k(-2/5))12/(kk/(k*(-2/7)/kk))(2/53) assuming k is positive. k(-268131/7420) Simplify (q(-25))(-34)/(((qq(qq7q)/q)/q)/(qq/((q(2/41)/q)/q))) assuming q is positive. q(34643/41) Simplify (((z(2/29)/z)/(z/(z(2/5)/z)))/(((z(-1)zz)/z)/z)(1/3))/((z/(z/z(3/4)))/(z7z)(z(-2/7)z)(-3/4)) assuming z is positive. z(34031/6090) Simplify (g(-7))(4/21)g(5/13)(((g((g(-5/8)g)/g)/gg)/g)/gggg)/gg assuming g is positive. g(133/312) Simplify n((n*(2/63)n)/n)/n(n10/n)/n(n/(n/(n(n/(n(-15)/n)n)/n)))(-3/28) assuming n is positive. n(769/126) Simplify ((((j(-6)/j)/j)/(j2/jj))/((jjj(-3/2))/j(1/7)))/((j9j)/j(-3))10 assuming j is positive. j(-1965/14) Simplify ((b1b(-6)/bb)/(b0/b)(-35))/((b*(1/3)/(((b((b/(b/b*(2/15)))/b)/bbbb)/b)/b))/((bb(2/3)bb)/b(-2))) assuming b is positive. b(-518/15) Simplify x(2/9)xx(-1)/x(x0)(-2/21)(x4/(x(-1/2)x))(-10/3) assuming x is positive. x(-112/9) Simplify ((s*3/s)/(ss2))(-2/25)(ss*3s(-2/11))/(s(2/5)s/(s/(s(-1/10)/s))sss) assuming s is positive. s(879/550) Simplify ((b(-4/7)b/(bbbb*(-1/4)/b)b*3b12)(20/7))17 assuming b is positive. b(32555/49) Simplify ((k(kk/((k/(k/k(1/3)))/k))/k)(-38))*(-50)(kk(-2/27)/kk)/kkkkk*(-3/2)(kkk(-1/5))/k(-2/13) assuming k is positive. k(17795863/3510) Simplify (((t(-7)/(tt(-1/3)))/(tt*(-10)t(4/3)))(-8/3))(-2/25) assuming t is positive. 1 Simplify q/(((q6/q)/q)/q)q/q7q*(2/15)qq(-5/3)(q/q*6qq(-4))38 assuming q is positive. q(-4688/15) Simplify ((y/((y/(yy/(y*(-6)/y)))/y))/yy/y*(2/5))/(y/(yyy2)y)*(-12/11)((yy/y(-2/11)yy)/(y10y))(3/23) assuming y is positive. y(8259/1265) Simplify ((((p/p*3)/pp)*(1/18)(p(-1/4))12)(1/2))(-9/7) assuming p	{ "pile_set_name": "DM Mathematics" }
54148 for t. 55 Solve -1365077 = 290l - 1363917 for l. -4 Solve 56t - 36t + 276597 = -66t + 277199 for t. 7 Solve 0 = 500b - 34b + 63b + 6877 for b. -13 Solve -10631w - 10359 - 19870 + 4200 - 5864 = 0 for w. -3 Solve -437p = 1577p - 104728 for p. 52 Solve -3670 = -457n + 1407 + 5434 for n. 23 Solve 68200 = 1008o + 1720o for o. 25 Solve 818310 = -168z + 798318 for z. -119 Solve 0 = 1472i - 7705i + 458443 - 22133 for i. 70 Solve 29u + 2748 = 3038 for u. 10 Solve 267c = -484c - 1081 + 10844 for c. 13 Solve 1407g + 91738 - 5911 = 0 for g. -61 Solve 720d - 71d + 1343 = -650d + 19529 for d. 14 Solve 257x - 7034 - 5059 = -160x for x. 29 Solve -32p + 1469 = p + 1172 for p. 9 Solve 46105 + 174643 = 3806p for p. 58 Solve -2534w - 30726 + 15732 = 33152 for w. -19 Solve -3065 = -38d - 1599 - 1542 for d. -2 Solve 188n + 2403 + 3882 + 1284 = -2207 for n. -52 Solve 108l + 13431 = 7599 for l. -54 Solve 72090 = -3272v + 869v for v. -30 Solve 274p + 875 = 239p for p. -25 Solve -34680 = 673w + 1959 - 9719 for w. -40 Solve 108q = 50q - 10q - 2108 for q. -31 Solve 880z + 1060z = 1012z - 34336 for z. -37 Solve 93m + 17m = -52m + 12474 for m. 77 Solve -285p - 237p = 340p - 966p + 3432 for p. 33 Solve -278i + 8 + 72 = -65 - 133 for i. 1 Solve -2615h = 43305 + 60619 + 11232 - 21016 for h. -36 Solve 2640 - 1904 = -73o + 1612 for o. 12 Solve -392d - 1371 = 415d + 7506 for d. -11 Solve 0 = -134437b + 134309b - 7040 for b. -55 Solve -2758q = -2783q + 550 for q. 22 Solve -7513b - 140247 = 37786 - 296973 - 324327 for b. 59 Solve 131p + 28 - 9290 = 1087 for p. 79 Solve 36r + 1074 = -646 + 471 - 731 for r. -55 Solve 241w - 2711 = 104w + 775w + 7497 for w. -16 Solve -2984 = 1620m - 1247m for m. -8 Solve 2248a - 17157 + 157710 = -189903 for a. -147 Solve 909t - 26718 = 10551 for t. 41 Solve -1774k = 482k + 99264 for k. -44 Solve -670z + 388z - 1009 - 1196 = -303z for z. 105 Solve -182h + 336h + 437h - 9h + 61692 = 0 for h. -106 Solve 16k - 4299 + 2303 = -2220 for k. -14 Solve -12582m = -12349m - 75 - 391 for m. 2 Solve 87816 - 34743 = -464b - 4141b - 121917 for b. -38 Solve 904u = 443u + 614u + 4284 for u. -28 Solve 209l + 5128l - 833712 = -2198l + 1219l for l. 132 Solve 9046 = 191x - 25510 + 7816 for x. 140 Solve 118r - 32411 + 6395 = -424r for r. 48 Solve -758g - 3280 - 2784 = 0 for g. -8 Solve 118184 = 245t + 1251t for t. 79 Solve 221h = -152h + 106h + 23229 for h. 87 Solve -70s - 90 = 125 - 915 for s. 10 Solve -31c = 33c - 5c + 885 for c. -15 Solve 0 = -265q - 614 - 660 - 2436 for q. -14 Solve -117f + 68f = -74f + 629 - 104 for f. 21 Solve 3522a + 3480 = 3174a for a. -10 Solve -6991 = -912z + 6076 + 30709 for z. 48 Solve -8949 - 730198 = 12577w + 90935 for w. -66 Solve 0 = 1954666a - 1954478a - 5640 for a. 30 Solve 103c + 20996 = -481c + 19030 - 38330 for c. -69 Solve 1314n - 515n - 12864 = 598n for n. 64 Solve -1697d - 522d = 97636 for d. -44 Solve 195882 - 59370 = -3792h for h. -36 Solve -459c + 4402c + 2130c - 230774 = 0 for c. 38 Solve 0 = 1109n - 9108 - 19726 for n. 26 Solve 3100 = 281066t - 281376t for t. -10 Solve 147n - 1384 = 6701 for n. 55 Solve 105 - 440 - 109 = -169r + 21r for r. 3 Solve -3t - 187 - 4446 = 110t for t. -41 Solve -49m + 10m + 1107 = 2m for m. 27 Solve -1913o - 1714o - 355o - 4297 - 59415 = 0 for o. -16 Solve 104c - 463 = -76c + 299 + 5358 for c. 34 Solve -145939 = -3497h + 1413h - 60594 + 116803 for h. 97 Solve 9577t + 176180 + 126385 = 542412 + 545467 for t. 82 Solve -38726 - 23981 = -777n - 12979 for n. 64 Solve -2368 - 7423 - 289 = 240d for d. -42 Solve 439 - 290 = -30i - 560 - 191 for i. -30 Solve 10b - 28b = 5b - 735 - 392 for b. 49 Solve 758v + 609v + 64249 = 0 for v. -47 Solve 36312 - 95250 = 1786l for l. -33 Solve -168a - 7893 = 4500 + 4911 for a. -103 Solve 701r - 8055 = -194r for r. 9 Solve 12k = 7k + 24k - 855 for k. 45 Solve -445d - 3927 = -374 + 9797 for d. -30 Solve 53148 = -2830h + 192848 + 129150 for h. 95 Solve 80j + 19j = -52j - 23j + 13572 for j. 78 Solve -7s = 224 + 212 - 107 for s. -47 Solve 5329 - 31151 = -1334x - 62456 - 48742 for x. -64 Solve 17y - 439 + 117 + 120 = -100 for y. 6 Solve -75b + 3 = -66b - 24 for b. 3 Solve -4177i - 6193i - 342210 = 0 for i. -33 Solve 80h = 191h - 65h - 184 for h. 4 Solve -370 = -192j + 182j for j. 37 Solve 52m + 713 + 1203 = 198m + 310 for m. 11 Solve 0 = -1626r - 107948 - 28636 for r. -84 Solve 491b = 158b + 9324 for b. 28 Solve 51 = -67r + 186 - 1 for r. 2 Solve -704y - 12624 = -43231 - 46064 + 14719 for y. 88 Solve -2755m + 668m - 17953 = -9796 - 229379 for m. 106 Solve -2708x - 1232x - 554x = 886x - 220580 for x. 41 Solve 15936j - 121674 = 13039j for j. 42 Solve 1103v - 52954 = -7688v - 414441 + 9847 for v. -40 Solve 1011 - 6384 = 128s - 1346 + 2629 for s. -52 Solve -52p + 188p = -126 - 4906 for p. -37 Solve 882y = -453y - 1438y + 448y + 37200 for y. 16 Solve 1814y - 192y = 16220 for y. 10 Solve 0 = -621k + 533k - 4664 for k. -53 Solve -1230l = -39789 + 7709 - 13430 for l. 37 Solve -561 - 519 = -49r - 183 + 230 for r. 23 Solve 1217w - 2918 - 46427 = 85742 for w. 111 Solve 7454n - 3795n - 7011 = 3782n for n. -57 Solve 49983z - 47605z = -302006 for z. -127 Solve 367r - 640r + 7098 = 0 for r. 26 Solve 278p - 59p + 374p - 108p = 29585 for p. 61 Solve 31440 = 327j - 1587 for j. 101 Solve -3947 = -183k + 30k + 4481 - 6898 for k. 10 Solve 0 = -4071a + 1882a - 15881a + 596310 for a. 33 Solve 148f + 152f = 6300 for f. 21 Solve -3110f + 77601 = -1701 - 1558 for f. 26 Solve 17107 = 54j + 19969 for j. -53 Solve -10336 = -6330157l + 6329885l for l. 38 Solve 6321m = 3120m + 3163m + 798 for m. 21 Solve 0 = 676o - 1184 - 844 for o. 3 Solve 19134816q - 19134643q + 12802 = 0 for q. -74 Solve 50x - 20x = -164x - 1272 + 302 for x. -5 Solve 86c - 1827 = 534 + 1423 for c. 44 Solve -429l = 160l - 39l - 15400 for l. 28 Solve -49290 + 18440 - 35571 = -4280t + 91939 for t. 37 Solve 0 = 161651r - 161626r - 525 for r. 21 Solve 0 = 4223r - 4183r + 440 for r. -11 Solve 0 = -222y - 713 - 1063 for y. -8 Solve -412h + 4674 + 34071 = -1847h for h. -27 Solve 0 = 2184n - 60806 - 30922 for n. 42 Solve -92 = 37823x - 37869x for x. 2 Solve 1173y = -657y - 690y - 2520 for y. -1 Solve -10632p + 5290p + 5049 = -5635 for p. 2 Solve 8478y - 399182 = 355360 for y. 89 Solve 916z + 119z - 72779 = -932z for z. 37 Solve -2676a + 170139 = 2133a + 64341 for a. 22 Solve 0 = 496d + 631 + 1849 for d. -5 Solve -217u + 1543 = 387u - 18993 for u. 34 Solve 151 - 43 = 435m + 447m - 774m for m. 1 Solve -4645y + 212365 + 228910 = 0 for y. 95 Solve 798u + 546u + 29568 = 0 for u. -22 Solve 71b + 28b = -694b - 486b - 24301 for b. -19 Solve 90q - 1730 - 2230 = 288q for q. -20 Solve -1890m + 1680 = 107520 for m. -56 Solve -8262w - 8256w - 705 = -16503w for w. -47 Solve 87885 = 3493s - 48342 for s. 39 Solve -324p - 2658 = -1118p - 92p for p. 3 Solve 726q - 11268 = -2556 for q. 12 Solve 15132 = -595v - 17051 + 8978 for v. -39 Solve 305 = 11v + 23v - 1 for v. 9 Solve 3975j + 139930 = -23j for j. -35 Solve -158s - 163s - 105s = 193s + 14237 for s. -23 Solve -20387 + 447089 = 17773f - 23168 - 243277 for f. 39 Solve 0 = 87915h - 85998h + 21087 for h. -11 Solve 0 = 728m + 11036 + 34100 for m. -62 Solve -1240241y + 1763 = -1240282y for y. -43 Solve -110u - 133u + 17u - 2260 = 0 for u. -10 Solve 258q + 32q = -170q + 6440 for q. 14 Solve -81j - 25j + 1155 = -73j for j. 35 Solve 447z - 24594 + 10599 = 16401 for z. 68 Solve 0 = 1203g + 43534 + 14210 for g. -48 Solve 0 = -3922d + 5090d + 10059 - 3051 for d. -6 Solve -217m + 1147 = -106m - 142m for m. -37 Solve 90a - 79 = -45 - 484 for a. -5 Solve -158719q - 5145 = -158824q for q. 49 Solve 6134k - 235200 = -1706k for k. 30 Solve 1128 - 517 = -43u - 636 for u. -29 Solve 0 = 104p + 83 + 236 + 201 for p. -5 Solve 339575m - 339389m - 1116 = 0 for m. 6 Solve 771s + 92646 = 154326 for s. 80 Solve -228i - 163i + 2643i = -87828 for i. -39 Solve -358u = 1219u - 466*u - 84436 for u. 76 Solve 18	{ "pile_set_name": "DM Mathematics" }
positive. p*288 Simplify ((ooo(-6)/o)/(o((o/o(-8/7))/o)/o))/(((o/o(-2/5))/o)/o)(-41) assuming o is positive. o(-1076/35) Simplify (rr/(rr*0/r))/(rr*(-1/7))(r*(-2/7)r)/(rrrr/r(-1/5)) assuming r is positive. r(-82/35) Simplify ((w(1/21)w)/((ww(-4/7))/w))3 assuming w is positive. w(34/7) Simplify (((h/(h(-4)h))/h)(-37))36 assuming h is positive. h*(-3996) Simplify n/(n/(n/(n((((n/(n/n*(-1))n)/n)/n)/n)/nn)))nn9 assuming n is positive. n13 Simplify (r(-1/5)/r)34 assuming r is positive. r(-204/5) Simplify (hh10)(-2/57) assuming h is positive. h*(-22/57) Simplify (yy(-1/2))(-1/15)((yyyy*3y)/y)29 assuming y is positive. y(5219/30) Simplify (f*(10/7)f)/f30 assuming f is positive. f(-193/7) Simplify z*(-4/7)z/(z(((z/(z(zzzz/(z/(z(-3)z)z))/zz)z)/zz)/z)/zz)(z*(-5)/z)/(z/(zzz(zz(1/5)z)/zz)z) assuming z is positive. z(-118/35) Simplify c(-1/2)ccc/(cc*(3/32))c assuming c is positive. c(77/32) Simplify ((o/(o(4/3)/o)o)/(o(-1/5)/o))(14/5) assuming o is positive. o(602/75) Simplify ((r5/r)/(r/r(-7)))/(rrrrr(-8)/rr*5r) assuming r is positive. r(-5) Simplify (u(-1)/u*(2/5))/((uu(2/17))/(u(-2/7)u)) assuming u is positive. u(-1073/595) Simplify (n(-35))(-2) assuming n is positive. n70 Simplify ((ccc/((c20c)/c)c)/cc)/(c/(((cc(-19/4)c)/c)/c)) assuming c is positive. c(-87/4) Simplify ((u(2/7))(-50))43 assuming u is positive. u(-4300/7) Simplify (f(-1)f/(f/(f(7/3)f)))/(ff(2/19)ff(-3/5)) assuming f is positive. f(236/285) Simplify ((uu*(-1/5)/u)/uu)(-4)/(u(2/5)u(-1/5)) assuming u is positive. u(3/5) Simplify (m/((m/(m(-22)m))/m))(-5/6) assuming m is positive. m(50/3) Simplify p6/p8 assuming p is positive. p(-2) Simplify ((v(-1/4)vvv)/vv(vvv(2/27)v)/v)/((vv(-4/7))/vv(-2/7)) assuming v is positive. v(4295/756) Simplify (d(-11))(12/5) assuming d is positive. d(-132/5) Simplify ((q0)(2/67))(-5) assuming q is positive. 1 Simplify w(-1)/((w/w(-8/3))/ww)(w*(-2)w)8 assuming w is positive. w(-38/3) Simplify (b/b(2/5))/b2(bbb0b)/bbb(-4) assuming b is positive. b(-12/5) Simplify ((r*(-1/2)r)/r*(-2))/((r/((rrr(-1/5)rrrr)/r))/(rr*(-2)rr)) assuming r is positive. r(73/10) Simplify (l/((l6l)/ll)l(-7/6))/(l/((l(2/9)/l)/l))20 assuming l is positive. l(-1129/18) Simplify (b/(bb(-3)))/b(-6)b*(-1/4)bb(-1/11) assuming b is positive. b(425/44) Simplify (((vv0/v)/v)/v)/v(2/3) assuming v is positive. v*(-8/3) Simplify (v/(vv*36))/(v(v/(vv(-2/43))vv)/vv) assuming v is positive. v(-1679/43) Simplify (f(-1/2))*15((fff/(f/(ff3f)))/f)/ff/(ff(3/5)) assuming f is positive. f(-31/10) Simplify (j/(jjj*(-2/3)jj))(-12) assuming j is positive. j28 Simplify ((n0/n)(1/33))42 assuming n is positive. n(-14/11) Simplify (g(-3/4)gggg)(-11/5)(g(-1/4))(-27/4) assuming g is positive. g(-437/80) Simplify ((o(-2/5)oo)/oo)/o(2/17) assuming o is positive. o(126/85) Simplify (((ff5/f)/f)/f)(-7/5) assuming f is positive. f(-21/5) Simplify n(-18/13)/(n(-38)/n) assuming n is positive. n(489/13) Simplify (f/(fff*8f))(1/29) assuming f is positive. f(-10/29) Simplify (l(-12/13)/l)7 assuming l is positive. l*(-175/13) Simplify bb*(1/2)bb/(bb/b(-2/59)) assuming b is positive. b(173/118) Simplify n36/n(-1/8) assuming n is positive. n(289/8) Simplify (h/h3)30 assuming h is positive. h(-60) Simplify w*(-18)(w*(1/3)/w)/ww assuming w is positive. w(-56/3) Simplify ((r/r(4/9))/r9)/((r(-5/3)r)/(r/(rr(r(2/9)/r)/rr))) assuming r is positive. r*(-8) Simplify (n/(n/(n/(nn/n1))))/n(1/9)(n0/nn)/n(4/9) assuming n is positive. n(-5/9) Simplify (t4/t(-11))18 assuming t is positive. t270 Simplify (h*(-1/4)h)(-13/2) assuming h is positive. h(-39/8) Simplify (c(-2/9)/(c(-1/2)c))/(c0cc)(-1/30) assuming c is positive. c(-59/90) Simplify y(-2/21)yy2yy(-2/13)yy(-4/5)y assuming y is positive. y*(6758/1365) Simplify (qq(2/3))(1/62)/(q*(1/5)/(qq(-2/3)/q)) assuming q is positive. q(-781/930) Simplify (y*(1/10)/y)/yyyy/((y/(((y9/y)/y)/y))/y) assuming y is positive. y(71/10) Simplify ((rr(-2))/r)15 assuming r is positive. r(-30) Simplify x(-2/21)x(-1/8) assuming x is positive. x(-37/168) Simplify t*5t*5t/(tt10)((t*(-4/7)tt)/t)/t assuming t is positive. t(-4/7) Simplify (z(-2/7)/(z/z1))/((zz(-2/5))/z6) assuming z is positive. z*(179/35) Simplify dd*(-2/5)dd(-3/11) assuming d is positive. d(73/55) Simplify (v(-5/8)/vvvv)/(v/v(-5)) assuming v is positive. v(-37/8) Simplify ((k/(kk(-15)))/k)/((kk(-1/5)/k)/k) assuming k is positive. k(76/5) Simplify (uu(-4/5))42 assuming u is positive. u(42/5) Simplify ((h/h(-9/5))/h)/((hh(h(-6/23)h)/hh)/hh) assuming h is positive. h*(-108/115) Simplify tt*(-2)t*(-20)tt assuming t is positive. t(-19) Simplify w(2/91)ww/(www/w(16/11)www)w assuming w is positive. w(-1525/1001) Simplify ((s(-1/3))42)46 assuming s is positive. s(-644) Simplify (h2/h(2/3))(-10) assuming h is positive. h(-40/3) Simplify (m/m(1/26))21 assuming m is positive. m(525/26) Simplify tttt*15tttt(-2/9) assuming t is positive. t(187/9) Simplify (k/(k0/k))(2/137)(kk0)(-16/5) assuming k is positive. k(-2172/685) Simplify zz*(16/9)zz(-31) assuming z is positive. z(-245/9) Simplify r/r6(r*19r)/r assuming r is positive. r14 Simplify (h/(h(2/5)/hh)h/(hh4))(-2/19) assuming h is positive. h(34/95) Simplify (q/q(12/11)qq/(qq*16/qq)q)(-4/23) assuming q is positive. q(620/253) Simplify o(2/5)oo/(oo/o*(-1/8)oo) assuming o is positive. o(-69/40) Simplify r(-6)rr(-3)/rrrr(rrr4)/rr(-5) assuming r is positive. r(-6) Simplify (k(2/31)/k(-4/11))/(k/(k*(2/7)/k)k/(k/k(-2/17))) assuming k is positive. k(-47416/40579) Simplify (vv(1/40))/((v(v/(v/(v*2v))v)/v)/vv) assuming v is positive. v*(-119/40) Simplify y/(yy/(y/y*(-5)))yy/((yyy/(yy*(-2/9))y)/y)yyy(3/4)y(-6) assuming y is positive. y(55/36) Simplify (mm/m(-22))(-47) assuming m is positive. m(-1128) Simplify o14oooo(1/2)oooo assuming o is positive. o(43/2) Simplify (u0uu(-1))/(u(-6)/(uu/(u(u/u(3/4)uu)/uuu)u)) assuming u is positive. u(19/4) Simplify ((v5v)/vv*(-3))/(v/(v/(v/(vvv(-1)v))))(-2) assuming v is positive. 1 Simplify a/(a(-4)a)(a*(-7)/a)/aaa/a(1/9)a(-3)/a assuming a is positive. a(-64/9) Simplify (z*(-1/5)/(zz(-2/7)))/(z0z/(z/(z(zz3)/zz))) assuming z is positive. z(-207/35) Simplify ((j/j0)/(jjj/((j/j*8)/j)j))/(j*(1/2)/(j(j/(j/(j/j(1/6))))/j)) assuming j is positive. j(-32/3) Simplify (i/(i/(i/(((i*(-1/4)i)/i)/i))))(2/83) assuming i is positive. i(9/166) Simplify ((q/((qq/q(-3/28))/q))/q)(-10) assuming q is positive. q(155/14) Simplify f/(f(2/5)/f)f(-21/4) assuming f is positive. f(-73/20) Simplify ((kk/(kkkk/(k/k*(-2))kkk))/k)*(3/13)kkk*(7/2)k(1/3) assuming k is positive. k(401/78) Simplify (m/(m/m*(2/39)m))/m3 assuming m is positive. m(-154/39) Simplify (y*(-2/3)/y(yy(-5))/yy)/(yy(-2/7))(-44) assuming y is positive. y(541/21) Simplify ((l(-4)/ll)(30/7))19 assuming l is positive. l(-2280/7) Simplify (n(1/2))(-5/8)/(n/n(1/4))(-3/19) assuming n is positive. n(-59/304) Simplify ((z/(((z*(1/2)/z)/z)/z))/zz/z*10)/(((zz*(-2/11)/z)/z)/(zz/z*(-3)zz)) assuming z is positive. z(37/22) Simplify (n/(n(-1/4)nn)n(-2/3))/(n(-2/5))(-8) assuming n is positive. n(-277/60) Simplify hh(4/7)hhh/(h/(h/(h/((h*17/hh)/h)))) assuming h is positive. h(137/7) Simplify t(-6/5)t(-10)(t/(t*(2/3)/t)t)/t6 assuming t is positive. t(-223/15) Simplify ((k/(k*(2/7)k))(-27))(-3/7) assuming k is positive. k(-162/49) Simplify (s(-3)s/(s/(s*0/s)	{ "pile_set_name": "DM Mathematics" }
Solve 2j3/3 - 7j*2/3 + 8j/3 - 1 = 0. 1, 3/2 Let -2p2 + 50p + 988 = 0. Calculate p. -13, 38 Factor 4l4 - 68l*3 + 252l*2 + 980l - 5488. 4(l - 7)3(l + 4) Suppose 5f5 + 60f*4 + 175f*3 + 120f*2 = 0. Calculate f. -8, -3, -1, 0 Determine o, given that 3o*2 - 81o - 84 = 0. -1, 28 What is r in -r*3/10 - 11r*2/2 - 527r/10 + 6727/10 = 0? -31, 7 Factor 8o2/5 + 68o + 168/5. 4(o + 42)(2o + 1)/5 Solve 15w*2/2 + 115w + 75/2 = 0. -15, -1/3 Factor -y*2/4 - 57y - 3249. -(y + 114)2/4 Suppose -m2/2 - 39m - 1521/2 = 0. Calculate m. -39 Factor -3i*3/4 + 15i*2/4 - 9i/2. -3i(i - 3)(i - 2)/4 Factor -y5/7 + 4y*4/7 + 59y*3/7 + 178y*2/7 + 212y/7 + 88/7. -(y - 11)(y + 1)(y + 2)3/7 Solve -v2/3 - 89v/3 - 88/3 = 0. -88, -1 Factor -5p*4 + 110p*3 + 125p*2 - 230p. -5p(p - 23)(p - 1)(p + 2) Find i such that -i3 - i2 + i + 1 = 0. -1, 1 Find t such that 2t3/5 - 132t*2/5 - 1152t/5 - 2368/5 = 0. -4, 74 Factor -2l3/7 - 46l*2/7 - 158l/7 - 114/7. -2(l + 1)(l + 3)(l + 19)/7 Factor l2 + 49l + 220. (l + 5)(l + 44) Find v such that -560v*4 + 7880v*3 - 28795v*2 + 12955v - 1560 = 0. 1/4, 39/7, 8 Solve -25t2 + 98t + 8 = 0. -2/25, 4 Determine d so that 3d4/7 - d3/7 - 9d*2/7 + 9d/7 - 2/7 = 0. -2, 1/3, 1 Factor -4n2 - 220n + 1736. -4(n - 7)(n + 62) Factor 2w4 + 112w*3 + 110w*2. 2w*2(w + 1)(w + 55) Determine g so that -5g*4 + 5g2 = 0. -1, 0, 1 Determine c, given that c4/4 - 13c3/4 - 75c*2/4 + 109c/4 + 85/2 = 0. -5, -1, 2, 17 Factor -g*2/2 + 422g - 89042. -(g - 422)*2/2 Factor -3z*3/4 - 15z*2/2 + 18z. -3z(z - 2)(z + 12)/4 Solve 4u*4 + 52u*3 + 48u*2 = 0 for u. -12, -1, 0 Determine n so that -4n*2/7 - 20n/7 - 16/7 = 0. -4, -1 Find i such that -8i4/3 + 262i*3/3 - 2438i*2/3 + 2624i - 1896 = 0. 1, 6, 79/4 Factor -5s4 + 95s*3 + 125s*2 - 515s + 300. -5(s - 20)(s - 1)*2(s + 3) Solve o*3/6 - 11o*2/2 + 119o/6 - 29/2 = 0. 1, 3, 29 Factor -35h2/6 + 125h/6 + 10. -5(h - 4)(7h + 3)/6 Find t, given that -2t*2 + 2512t - 788768 = 0. 628 Factor 2l5/9 - 116l*4/9 + 1562l*3/9 + 1160l*2/3 + 200l. 2l(l - 30)*2(l + 1)*2/9 Solve -2312i*2 - 408i - 18 = 0. -3/34 Factor -2b2 - 132b. -2b(b + 66) Solve -3v3/7 - 60v*2/7 + 993v/7 - 930/7 = 0 for v. -31, 1, 10 Determine z, given that 2z5/9 - 10z*4/9 - 2z*3/9 + 10z2/9 = 0. -1, 0, 1, 5 Determine x so that -x2/3 - 5x/3 + 14/3 = 0. -7, 2 Factor 7a*3 + 20a*2 - 9a - 18. (a - 1)(a + 3)(7a + 6) Suppose 3b*2 - 45b + 78 = 0. Calculate b. 2, 13 Solve 4r4 - 128r*3 + 1320r*2 - 4576r + 3380 = 0. 1, 5, 13 Find f, given that -5f4 + 215f*3 + 1200f*2 = 0. -5, 0, 48 Solve -2f*2 + 6f - 4 = 0 for f. 1, 2 Factor -m*2/5 - m/5 + 12/5. -(m - 3)(m + 4)/5 Find v, given that 22v4/9 - 2v*3 - 16v*2/3 - 8v/9 = 0. -1, -2/11, 0, 2 Determine z so that 2z4/13 + 266z*3/13 + 11062z*2/13 + 133870z/13 - 145200/13 = 0. -55, -24, 1 Determine r so that 4r4/17 - 42r*3/17 + 132r*2/17 - 152r/17 + 48/17 = 0. 1/2, 2, 6 Factor -2c4/3 + 4c*2/3 - 2/3. -2(c - 1)*2(c + 1)*2/3 Factor 60o*2 + 136o. 4o(15o + 34) Solve 3k*4 + 21k*3 - 219k*2 + 195k = 0. -13, 0, 1, 5 Factor 2n2/7 - 576n/7 + 41472/7. 2(n - 144)2/7 Factor 2j*2/13 + 744j/13 - 746/13. 2(j - 1)(j + 373)/13 Determine r, given that 5r5/3 - 17r*4/3 - 13r*3 + 133r*2/3 - 106r/3 + 8 = 0. -3, 2/5, 1, 4 What is j in -2j2 + 50 = 0? -5, 5 Factor -2t*3 + 6t*2 - 4t. -2t(t - 2)(t - 1) Factor -n3/5 + 47n*2/5 - 115n + 529/5. -(n - 23)*2(n - 1)/5 Let -10g5/17 + 62g*4/17 - 52g*3/17 - 52g*2/17 + 62g/17 - 10/17 = 0. Calculate g. -1, 1/5, 1, 5 Factor -3d4 - 12d*3 + 33d*2 - 18d. -3d(d - 1)*2(d + 6) Let 4g5/3 - 16g*4/3 + 16g*3/3 + 8g*2/3 - 20g/3 + 8/3 = 0. What is g? -1, 1, 2 Factor 3p2 - 177p. 3p(p - 59) Suppose 5b4 + 50b*3 + 65b*2 - 300b + 180 = 0. What is b? -6, 1 Factor 9248c5/3 + 9520c*4/3 + 274c*3/3 + 2c*2/3. 2c*2(c + 1)(68c + 1)*2/3 Let 21v*3 - 30v*2 - 33v + 18 = 0. What is v? -1, 3/7, 2 Determine g, given that -2g4/7 - 19g*3/7 - 48g*2/7 - 11g/7 + 20/7 = 0. -5, -4, -1, 1/2 Find j, given that j4 - j3 - 12j2 = 0. -3, 0, 4 Determine m, given that 2m*5 - 17m*4/2 + 12m*3 - 13m2/2 + m = 0. 0, 1/4, 1, 2 Solve g5 + 51g4/7 - 16g*3 - 36g2/7 = 0. -9, -2/7, 0, 2 Suppose -d3/4 - 3d2/4 + 9d/4 - 5/4 = 0. Calculate d. -5, 1 Let -2s4/3 + 50s*3 + 308s*2/3 = 0. What is s? -2, 0, 77 Factor 3m*3/4 - 9m*2 + 15m. 3m(m - 10)(m - 2)/4 Determine r, given that -3r*4/4 - 33r*3/4 + 3r*2/4 + 33r/4 = 0. -11, -1, 0, 1 Factor -2l2/11 + 8l - 88. -2(l - 22)2/11 Let x4/4 - 3x3/4 - x2/4 + 3x/4 = 0. Calculate x. -1, 0, 1, 3 Solve -2r*4 + 42r*3 - 108r*2 = 0 for r. 0, 3, 18 Let -2j*4/3 - 95j*3/6 + 14j*2/3 + 95j/6 - 4 = 0. Calculate j. -24, -1, 1/4, 1 Factor 7l3 - 10l*2 - 29l - 12. (l - 3)(l + 1)(7l + 4) Let -4l*3 + 204l*2 - 936l + 736 = 0. What is l? 1, 4, 46 Factor -n*3/6 - 135n*2/2 - 18225n/2 - 820125/2. -(n + 135)*3/6 What is y in -4y*2 = 0? 0 Let -2h*3 - 2h*2 + 32h + 32 = 0. Calculate h. -4, -1, 4 Factor -5p2 - 110p + 3315. -5(p - 17)(p + 39) Factor -a*2/3 - 505a + 3034/3. -(a - 2)(a + 1517)/3 Factor -w2/3 + 402w - 121203. -(w - 603)*2/3 Determine r, given that 3r*4 + 237r*3 + 4554r*2 - 5280r - 9600 = 0. -40, -1, 2 Determine z, given that z4/6 + z3 + 11z2/6 + z = 0. -3, -2, -1, 0 Let -5p*3 + 4595p*2 + 13820p + 9220 = 0. Calculate p. -2, -1, 922 Suppose 2v2/7 - 3296v/7 + 1357952/7 = 0. Calculate v. 824 Factor 5o3 - 10o*2. 5o*2(o - 2) Suppose 5p2 - 3260p + 531380 = 0. What is p? 326 Suppose 32k4/3 + 1664k*3 + 4966k*2/3 + 310k = 0. What is k? -155, -3/4, -1/4, 0 Factor -4m4 + 16m*3 + 4m*2 - 16m. -4m(m - 4)(m - 1)(m + 1) Factor -5q3 + 70q*2 - 220q + 200. -5(q - 10)(q - 2)*2 Find c, given that -2c*5/3 + 62c*4 - 364c*3/3 - 4c*2/3 + 122c - 182/3 = 0. -1, 1, 91 Suppose l*3/4 + 25l*2/4 - 53l/4 + 27/4 = 0. Calculate l. -27, 1 Find l, given that 24l2 + 572l + 460 = 0. -23, -5/6 Determine n so that n*2/4 + 192n + 36864 = 0. -384 Determine a so that -5a3 + 510a*2 - 1005a + 500 = 0. 1, 100 What is r in 3r2/2 + 45r/2 - 114 = 0? -19, 4 Factor -3z2 - 663z + 666. -3(z - 1)(z + 222) Find z, given that -5z4/3 + 5z*3/3 + 5z*2/3 - 5z/3 = 0. -1, 0, 1 Factor -4t4 + 72t*3 - 324t*2 + 448t - 192. -4(t - 12)(t - 4)(t - 1)2 Determine n so that 4n*3 - 112n*2 + 784n = 0. 0, 14 Suppose -g3/10 + g2 + 3g/10 - 54/5 = 0. Calculate g. -3, 4, 9 Solve 2z*4 + 6z*3 - 30z*2 + 34z - 12 = 0. -6, 1 Suppose -2j2/5 - 12j/5 - 16/5 = 0. What is j? -4, -2 Find y, given that y*5/6 - 25y*4/6 - 14y*3/3 + 26y*2/3 = 0. -2, 0, 1, 26 Factor 2w*3/13 + 16w*2/13 - 150w/13 + 252/13. 2(w - 3)2(w + 14)/13 Factor 21l3/8 - 771l*2/8 + 1275l/4 + 99. 3(l - 33)(l - 4)(7l + 2)/8 Let 2a2/3 - 734a/3 + 1460/3 = 0. Calculate a. 2, 365 Factor -2n3/7 + 6n/7 + 4/7. -2(n - 2)(n + 1)*2/7 What is j in 14j*3 + 872j*2 + 2726j + 708 = 0? -59, -3, -2/7 Factor 2b2 - 270b + 268. 2(b - 134)(b - 1) Solve -2v4 - 4450v*3 - 2477536v*2 - 2473088v = 0 for v. -1112, -1, 0 Determine o so that -o*2 + 1 = 0. -1, 1 Factor 3g*4 + 24g*3 + 18g*2 - 24g - 21. 3(g - 1)(g + 1)*2(g + 7) Suppose 3v3 + 6v*2 + 3v = 0. What is v? -1, 0 Let 98h5/11 - 2114h*4/11 + 12944h*3/11 - 16688h*2/11 + 6560h/11 - 800/11 = 0. Calculate h. 2/7, 1, 10 Let 3u4/4 - 39u*3/4 + 105u*2/4 + 39u/4 - 27 = 0. Calculate u. -1, 1, 4, 9 Determine x, given that -2x5 + 12x*4 - 2x*3 - 48x*2 - 32x = 0. -1, 0, 4 Factor -2w3/9 - 418w*2/9 + 140w/3. -2w(w - 1)(w + 210)/9 Factor 2l*4/21 + 32l*3/21 + 128l*2/21. 2l*2(l + 8)2/21 Factor -z3/3 - 20z2/3 - 64z/3. -z(z + 4)(z + 16)/3 Factor -6u5 - 170u*4 - 56u*3. -2u*3(u + 28)(3u + 1) Solve -2d5 - 22d*4 + 2d*3 + 22d*2 = 0 for d. -11, -1, 0, 1 Factor -3t*4 + 27t*2 - 12t - 36	{ "pile_set_name": "DM Mathematics" }
ppose 3u = 2h + 10 + 1, 2u - 5h = 0. Let x be (3/u)/((-8)/(-40)). Solve -x - 1 = -4z for z. 1 Let c(i) = -3i. Let u be c(-1). Let t = u + -3. Suppose g - 4g = t. Solve 0 = -gq + q - 1 for q. 1 Suppose 0 = -2z - 2 - 6. Let g = 1 + z. Let o be 2 + g + (5 - 2). Solve oq - 6q = -4 for q. 1 Let p = 11 + -5. Solve -2r + p = r for r. 2 Suppose -8u + 3u = 0. Let o = u + 4. Solve on - 2n + 2 = 0 for n. -1 Let y(d) = -d*3 + 4d*2 - d - 2. Suppose -3x = 2x - 15. Let q be y(x). Solve 2r - q + 0 = 0 for r. 2 Let j = 21 + -18. Solve 0 = -jc + 5c for c. 0 Let r = -4 + 10. Let c be (-4)/(-6)(0 - -3). Suppose -cv - g + 6 = 2v, v = -4g - r. Solve vn - 2 = 6 for n. 4 Let z(n) = n + 20. Let h be z(-15). Solve -hy + 6 = 21 for y. -3 Let s(a) = a + 8. Let d(i) = i + 2. Let p be d(0). Let f be 9/p4/(-3). Let q be s(f). Solve qo = o for o. 0 Suppose h + 21 = 3m, 2m + 3h = 6m - 33. Solve -4r + mr = 10 for r. 5 Let f(x) = -x - 3. Let i be f(-6). Let q(d) = d - 1 + 2d3 - 4d*3 + 3d*3. Let h be q(1). Solve iu + 11 = -h for u. -4 Let f = 9 + -6. Suppose -16 = 4r, -r + 6r = -4u - 188. Let c be (f/(-2))/(3/u). Solve 0 = 5s + c - 1 for s. -4 Suppose -20 = -q + 5y + 9, 25 = -5y. Let a = q - 2. Solve 5d = ad for d. 0 Let j be 11 + 9/(-7 + 4). Let k be 13 + -8 - 6/(-2). Solve -4g = j + k for g. -4 Suppose -60j = -63j + 12. Solve -n = jn for n. 0 Let r = -10 - -10. Solve -v - 3v = r for v. 0 Let l(k) = k3 + 7k*2 - 7k - 4. Let o be l(-8). Let u be (8/o)/((-2)/9). Solve us = 9 - 0 for s. 3 Let w(f) = -f2 - 7f - 6. Suppose -3y - 4j - 7 = 27, -y - 4j = 22. Let u be w(y). Solve u = 6v - v + 15 for v. -3 Let k be 5 - (-1 - -1 - (-33)/(-11)). Solve 0 = -4b - 0b - k for b. -2 Suppose -4t - 4x - 20 = 0, t + 5 = 2t - x. Suppose -5u = -4b - 120, -5u + 2b - 27 + 137 = t. Solve 3g = -2g - u for g. -4 Suppose j - 30 = 5o, 1 = 5o + 26. Suppose y = -2 + j. Solve 0 = -4w + yw for w. 0 Let d(r) be the first derivative of -r3/3 - 5r*2/2 + 4r - 1. Let v be d(-5). Suppose vq - q = 9. Solve qg = -g for g. 0 Let i(m) = m*2 - 3m - 5. Let k be i(4). Let r = k - -3. Suppose v - 1 = r. Solve 0h = vh - 15 for h. 5 Suppose 0 = y - 3 + 5. Let x(m) = 2m - 2. Let i be x(2). Let a be i/1 - 0/y. Solve -al + 3l = 0 for l. 0 Let d(s) = 9s*2 - s. Let o be d(1). Let w = -9 - -12. Suppose wi - 11 = -5. Solve 0 = 5v + i + o for v. -2 Let a(t) = -t3 + 6t*2 + 7t - 6. Let x be a(7). Let d be (-8)/x(-18)/4. Let q be 2/10 - d/(-30). Solve 0z + 2z = q for z. 0 Let q(p) = p2 + p + 1. Let m(l) = -l. Let g be m(-3). Let k be 2 - (2 - -10)/g. Let x be q(k). Solve -11 + x = -4v for v. 2 Let u = -4 - -4. Solve u = -4c - c for c. 0 Suppose -14g + 15g = 0. Solve -2o + 15 - 5 = g for o. 5 Let c = -2 - -7. Let x be -2(4 + 44/(-8)). Suppose -cv = 0, -3v = -xg - 4v + 21. Solve -4p + 1 + g = 0 for p. 2 Suppose -g - 12 = 3g. Let n be 0 - -2 - (g + 4). Let z be (-2 - -3)/(n/4). Solve -z = 5w - 14 for w. 2 Let w be 3 + (0/(-2) - -1). Suppose 3 = 3d + 3o, -2d + 4o + 0o - w = 0. Suppose g + 2 - 4 = d. Solve 5 = gp - 5 for p. 5 Suppose 0 = -2v + 5 + 7. Suppose -1 + v = 5w. Solve -f = -0f - w for f. 1 Suppose 2i = 5i - 6. Suppose -5h = in - 16, 2h - 4n = n + 18. Let b be ((-6)/(-4))/((-1)/(-2)). Solve -hr + 3r = -b for r. 3 Let o = 1 + 1. Let j be o24/8. Solve -h = j - 7 for h. 5 Let i be ((-1)/(-2))/((-2)/(-72)). Suppose -r + 5 = 3. Let w be r/4 - i/(-12). Solve wj - 3j = -1 for j. 1 Let i(t) = 3t. Let v be i(-2). Let z be (4/(-6))/(v/27). Solve -w = zw for w. 0 Let c(x) = x3 - 4x*2 + x. Let p be c(4). Let f = 7 - p. Suppose 8y = fy. Solve -3w = -yw + 15 for w. -5 Let p(m) = -m2 - 14m - 6. Let c be p(-10). Let h = -19 + c. Solve -h = -3f - 0 for f. 5 Suppose -c + 6c = 185. Let m = 36 - 24. Solve -5q - m = -c for q. 5 Let f be 3 + (-2 - -5) + 0. Solve -4b + 2b - f = 0 for b. -3 Let c be ((-3)/6)/((-1)/44). Let s be c/4 + 6/(-12). Suppose -a + s = -2. Solve 2 = t + a for t. -5 Let l = -4 + 28. Suppose -h + l = 2n, n - 4 = -3h - 2. Let k = -12 - -14. Solve -k = -3w - n for w. -4 Let q(v) = v*3 - 7v*2 + 7v + 1. Let l be q(6). Suppose 0 = -3m + 19 + 2. Let g = m - l. Solve g = -3o + 15 - 0 for o. 5 Let r = 22 + -12. Let h be r/20 + 9/2. Suppose 5g + 5b = -6 - 19, -3g - b - h = 0. Solve gl = -l + 4 for l. 4 Suppose p = 3u + 2, 0 = -3p + 13 + 2. Let y = 4 - u. Solve -i - 2i = -y for i. 1 Suppose 4z - 2g + 2 = 0, -20 = 4z - 5g - 3. Solve -v = v - z for v. 1 Suppose -4s - 36 = -13s. Solve st = -t for t. 0 Let u be 4/(-10) - (-17)/5. Suppose -ut + 18 + 27 = 0. Solve 5i + t = 2i for i. -5 Suppose -7 + 3 = -3j + 2v, j - 20 = -4v. Suppose 3h - 2h - 3r = 12, 18 = jh - 2r. Solve 0 = -b + 5 - h for b. 2 Let i be 2/(((-16)/6)/4). Let l be ((-1)/1)/(1/i). Solve g + 2 = -l for g. -5 Let s = 16 - 5. Suppose 1 = 3h - s. Solve 0 = hc - 1 - 3 for c. 1 Suppose 0 = 4g - 0f - 3f - 87, 0 = 3g + 4f - 59. Suppose -4s + g = -7. Solve s + 3 = 2n for n. 5 Suppose 2w + n + 1 = 13, 0 = 3n - 12. Solve -wl - l = 0 for l. 0 Let p(m) = -m3 + 10m*2 + 12m + 1. Let w be p(11). Solve -u = -4u - w for u. -4 Let n(p) = p2 + 2p. Let q be 8/63/(-2). Let b be n(q). Solve bi = 2i for i. 0 Let c = 36 - 33. Solve 0 = -cx - 8 + 2 for x. -2 Let v = 4 + -6. Let n = v - -6. Suppose 4h - a = 6, -5h + a + 2 = -3a. Solve -h = 2p - n for p. 1 Let t(p) = -p*3 + 8p*2 - 6p - 10. Let z be t(7). Let q = 13 + z. Solve q = -5a + 3a for a. -5 Let i(s) = s*2 + 14s - 12. Let a be i(-15). Solve 0 = -ap - 0p - 3 for p. -1 Suppose -4q + 40 = -2q. Let d(s) be the third derivative of s5/60 + s4/8 - 3s2. Let h be d(-4). Solve 0i + q = -hi for i. -5 Let x be 50/8 + (-2)/8. Suppose h + 3c = x, -5h + 4c - 10 = -c. Solve hb = b + 1 for b. -1 Suppose 0 = -3l + l + 2. Let m be (2/(-4))/(l/(-6)). Solve -5 = ms + 4 for s. -3 Let o(i) = -i2 + 11i + 5. Let f be o(11). Solve -1 = 4j - f for j. 1 Suppose 3c = 29 + 31. Suppose -5u + 4u + 4 = 0, -5u = -4n - c. Solve n = -0x + 3x for x. 0 Suppose -9c - 40 + 49 = 0. Solve 2 + c = -r for r. -3 Let m be (-70)/9 - 16/72. Let n be (-18)/m - (-9)/12. Solve 10 = nz - z for z. 5 Let u be 0/(-7 + 4 + 1). Suppose -4d + 2d + 1 = q, -4d - 16 = -4q. Solve u = -qi - 9 - 0 for i. -3 Let f = -9 + 14. Suppose 0 = -3c + 7 + f. Solve 0x = cx - 8 for x. 2 Suppose 0 = 13m - 7 - 32. Solve -2c + mc = 4 for c. 4 Let j be (3/6)/((-2)/(-8)). Solve o = -jo - 12 for o. -4 Let m(b) = 3b - 6. Let k be m(3). Suppose kp - 4 = 2. Solve 4 = pg - 3g for g. -4 Let s = -12 + 11. Let h(w) = 3w2. Let q be h(s). Solve l - q = -0 for l. 3 Suppose -2m + 3m - 2 = 0. Suppose -1 = mi - 7. Solve -4f + i = -1 for f. 1 Suppose 15 = -5f - 85. Let m = -17 - f. Solve -mo = -4o - 2 for o. -2 Let b be 2/3 + (-70)/(-21). Solve bd - 1 = 3 for d. 1 Suppose 0 = -4h + 3h + 5n - 5, 5n = 5. Solve -2s - 7 - 3 = h for s. -5 Let x = -16 + 19. Solve 0o - x = 3o for o. -1 Let g(b) = b + 10. Let f be g(-5). Suppose -15 = -3n - fs + 2s, 0 = -4n + 4s + 12. Solve 0 = -nk + 1 + 19 for k. 5 Let i = -84 - -42. Let b be (-12)/i - 2/7. Solve 3z - 7 + 4 = b for z. 1 Suppose -3x = -0x. Suppose -2f + 28 = -3h, f - 6f - h + 36 = x. Suppose -4 = p - f. Solve pl - 16 = -0l for l. 4 Suppose c + 7 - 38 = 0. Suppose 5k + 24 = -r + 3, 0 = 4r - 3k - c. Solve -22 = -rw - 2 for w. 5 Let l(u) = -u*2 - 9u - 7. Let d be l(-7). Suppose -21 = -2j + 5i + d, -j - 12 = 4i. Suppose -3t = 5s - 9, 0 = js - s + 3t - 9. Solve s - 6 = 3q for q. -2 Suppose 33x + 6 = 35x. Solve -xj = -0 + 9 for j. -3 Let z = 0 - 0. Suppose 4t = -zt. Suppose 3v + 2s - 3s = 6, 4v - 8 = -4s. Solve d + v = -td for d. -2 Let a = 44 + -21. Suppose -a = -j + 4n, j + 1 - 29 = 5n. Solve j = t - 2 for t. 5 Suppose 3o - 4 = -1, 5o = -4m + 13. Let w be (-194)/(-6) + 1/(-3). Suppose -w + m = -2f. Solve j + 4j = -f for j. -3 Let g be ((-1)/(-1))/(3/6). Suppose -4p + 48 = -4q, -gq + 3 = -p + 12. Solve 0 = -3z - 0 + p for z. 5 Suppose r - 4r = 0. Let n be 24 - (1 + -1 + 1). Suppose -2q = -9 - 1, n = 3u + q. Solve -5h + 4 + u = r for h. 2 Suppose 0 = 4j - 0j	{ "pile_set_name": "DM Mathematics" }
29 (d) 0 (e) -11 (f) 0.3 b Which is the biggest value? (a) 6/1171 (b) 0 (c) -3/2 (d) 5 d What is the biggest value in 1.4, -7921259, -3? 1.4 Which is the second smallest value? (a) -0.5925 (b) 13 (c) 328/5 b Which is the second biggest value? (a) 6/11 (b) -3 (c) 476 (d) 1.057 (e) 3 e Which is the fourth biggest value? (a) 2/3 (b) 65 (c) -2 (d) 94 (e) 4 (f) 2 f What is the fourth biggest value in -4, -16976, -3.7, -0.26? -16976 What is the smallest value in -2559, -0.1, -1, 1/73? -2559 Which is the third biggest value? (a) 2 (b) -437/4 (c) 2/9 (d) -0.1 (e) -2/75 (f) -5 e What is the smallest value in -152/1153, 13, -2/15? -2/15 Which is the smallest value? (a) 300182 (b) 8 (c) 2/7 c Which is the fourth biggest value? (a) -3345 (b) -0.02 (c) -0.3 (d) 3/7 (e) 0.2 (f) 0.4 b What is the fourth smallest value in -4, -2, 0, 401628? 401628 Which is the third smallest value? (a) -3315 (b) -2 (c) 0 (d) -9 (e) 4 b Which is the seventh smallest value? (a) -2/17 (b) -9 (c) 12.5 (d) 0.16 (e) -3 (f) -1 (g) -1/3 c Which is the seventh biggest value? (a) 20.8 (b) -5 (c) 1/4 (d) 0.3 (e) 14/113 (f) -0.2 (g) 1 b What is the second biggest value in 2, -15/31, 0.4, -19/5, -3/164, -0.4? 0.4 What is the third biggest value in 132990, 23, -0.5, -0.2? -0.2 What is the third smallest value in -2/3, 2, -7245988? 2 Which is the seventh smallest value? (a) -1 (b) -2.353 (c) -0.3 (d) 1 (e) -2 (f) 0.46 (g) 3 g Which is the fourth smallest value? (a) -4 (b) 4/5 (c) -3 (d) -1264 (e) 14 b Which is the second biggest value? (a) -0.03 (b) 33 (c) 4 (d) -62 (e) -0.4 (f) 0.1 c Which is the fifth smallest value? (a) 0.02 (b) -0.8 (c) -0.3 (d) -112 (e) -0.008 a What is the second smallest value in -2, 5, -6956, -7/9, 3/11, 2/11? -2 What is the smallest value in 15, 33, 2/7, -23670? -23670 Which is the sixth smallest value? (a) 5/2 (b) -5 (c) 20/3 (d) 35.66 (e) -4 (f) 2 d What is the third smallest value in 7, -221/7, 4, 2/43, 5, 1? 1 What is the fifth biggest value in -1/8, 0.2, 51, 73, 5? -1/8 What is the smallest value in -2, -8, -0.0467, 0, 136, 0.5, 4? -8 What is the fourth biggest value in -2, 19391, -0.2, -5, -19? -5 Which is the fifth smallest value? (a) 0.06 (b) -23 (c) -4 (d) 0.02 (e) -2/93 a Which is the fourth biggest value? (a) -1/463 (b) 5096 (c) -4 (d) -2/9 c Which is the second smallest value? (a) 0.001 (b) -61 (c) -240 b Which is the biggest value? (a) 401 (b) 0.011 (c) -2 (d) -717 a What is the biggest value in -5, 1/2, 36, 0, 88, -0.3? 88 What is the fourth smallest value in -0.3, 1/6, 5, -0.2, -0.488, -2/7, 0? -0.2 What is the fourth smallest value in 5, -4/7, 263, -2/23, -1073? 5 Which is the third biggest value? (a) 548 (b) 0.47 (c) -2 (d) 3/8 (e) -0.5 d Which is the third smallest value? (a) -3/4 (b) 7/31723 (c) 2 (d) -2/11 (e) -4 d What is the third smallest value in -2/13, 670, -2, 30? 30 Which is the sixth smallest value? (a) -25 (b) 2 (c) -2/39 (d) -74 (e) 0.4 (f) 35 f Which is the biggest value? (a) 0.11 (b) -0.032 (c) -3 (d) -0.3 (e) 1.5 (f) -2088 e Which is the third biggest value? (a) 2 (b) -31 (c) -19 (d) 4 (e) 0 (f) 213 (g) -2/11 a Which is the biggest value? (a) -11 (b) 3010494 (c) -0.4 b Which is the fifth biggest value? (a) -2/33 (b) -2353 (c) -0.01 (d) 1/3 (e) -4/3 b Which is the biggest value? (a) 67 (b) -10 (c) 0.9 (d) 2 (e) 2/5 (f) 12 (g) -2 a Which is the third smallest value? (a) 1/3 (b) 0.4 (c) 1/6 (d) 0.1 (e) -16723258 c Which is the third biggest value? (a) 1/10 (b) 158779/9 (c) 9 a What is the biggest value in 133, 346, -10? 346 Which is the third biggest value? (a) 5 (b) -1.58 (c) 119/4 b What is the second smallest value in 8, 0.5, -2/9, 3.294, 0.3, -77? -2/9 Which is the smallest value? (a) 1/75 (b) -2/9 (c) -120 (d) 0.2 (e) 0.3 (f) 0 c Which is the fifth smallest value? (a) 4 (b) -0.3 (c) 0.4 (d) -0.12 (e) 27.08 e What is the fifth smallest value in 0.0296, 2/9, 7, 4/3, -1/2, -1.1, -2? 2/9 What is the biggest value in 0.035, -0.13, 0.02, 231/5, -0.1? 231/5 Which is the third smallest value? (a) -1/363 (b) 2/1077 (c) -2/9 (d) -0.2 a What is the biggest value in 918, -4/3, -512.57? 918 What is the second smallest value in -2/399, -1, 22? -2/399 What is the third biggest value in -1/6, -1/5, 0, 5, -87, 37/11? 0 What is the third biggest value in -1, 27287, 8245? -1 Which is the smallest value? (a) 0 (b) -0.1 (c) -12410 (d) 1 (e) -5 (f) 2/7 (g) -3/5 c Which is the second smallest value? (a) 0.7 (b) 4 (c) -0.2 (d) 3/13 (e) 16.48 (f) -5 (g) -10 f What is the smallest value in -54015, 0.5, 8? -54015 What is the second smallest value in -229, 0.5, 0, -3/2, -3/4, 42? -3/2 Which is the third smallest value? (a) 1663/8 (b) 7/9 (c) 5 a Which is the seventh smallest value? (a) 471 (b) 5 (c) 1.31 (d) -5 (e) 1 (f) -2/9 (g) -65 a Which is the second biggest value? (a) -271 (b) 3149 (c) -24.4 c What is the second biggest value in -2, 18789/2, -4576? -2 What is the fourth biggest value in 167, -5, -9, -0.4? -9 What is the smallest value in -588796993, 2/17, 2/9? -588796993 Which is the seventh smallest value? (a) -0.02 (b) 5 (c) -2/9 (d) 2/5 (e) -9 (f) -0.0525 (g) -1/5 b Which is the second biggest value? (a) -0.0679977 (b) 1/13 (c) 7 (d) 0.5 d What is the fourth biggest value in 6.3, 2/9, -1/2, 5, -1.951? -1/2 What is the sixth smallest value in 0.06, -51, -0.1, 16, 0.4, 2, -2? 2 What is the fourth biggest value in -0.0502, 1/5, 13, 3020? -0.0502 What is the second biggest value in 0.002, 42, 0, 2/7, 14, -2/5? 14 Which is the smallest value? (a) 1 (b) 3/7 (c) 0.3 (d) -30.7 (e) -2 (f) 2 d Which is the third smallest value? (a) 3/5 (b) 1 (c) -1/5 (d) 0.02 (e) -230298 d Which is the third smallest value? (a) -3 (b) -447 (c) 0.28 (d) -2/11 d What is the second biggest value in -2/397, -1/3, 1482, 0, 0.2? 0.2 What is the second biggest value in 13, -1, -4/7, -524269? -4/7 What is the second biggest value in -2/7, -3, -94754, 0, 9? 0 What is the second biggest value in -21.4, 300, -97? -21.4 What is the third biggest value in -0.4, 1/11, 274, -1161, 5? 1/11 Which is the second biggest value? (a) -0.2 (b) 4/134929 (c) -3 a Which is the second smallest value? (a) -2.2 (b) -1 (c) 1304 (d) -0.4 (e) -23 a What is the fifth biggest value in 5, -3, 4.8, -2/7, -1/8, -0.1, -5? -2/7 Which is the second biggest value? (a) 515/211 (b) 0 (c) 204 a What is the fourth biggest value in -5, -17390, -2/17, 1.3? -17390 What is the third biggest value in 1, -17287, -171? -17287 What is the third biggest value in 1/11, -1, 0.1, 10, -2/57, 8, -0.3? 0.1 Which is the second biggest value? (a) 3 (b) 0.047 (c) -0.3 (d) 1/4 (e) 73 (f) -0.4 a What is the third biggest value in 0.3, -0.1, 0.6, -2/27, -696, 6/5? 0.3 What is the biggest value in -0.51, -3/8, 1/117? 1/117 What is the fourth smallest value in -3/2, -166, 3, -26204, -1/3? -1/3 Which is the third biggest value? (a) 5.8 (b) 0.2 (c) -25/418 c Which is the second smallest value? (a) 21200 (b) 4/17 (c) -90 b Which is the fifth biggest value? (a) 1/12 (b) 8/7 (c) 0.2 (d) -472 (e) -0.8 (f) 0.068 e Which is the smallest value? (a) 2869 (b) 0.4 (c) -6 (d) 0 (e) -392/5 e What is the fourth smallest value in 52, 63, 3, 1, 12? 52 Which is the third smallest value? (a) -1 (b) -1228/7 (c) -0.002244 c What is the second smallest value in -69/5, 22, -2174? -69/5 What is the third smallest value in 76, -1679, -0.3, -3/4, -59, 2/3? -3/4 What is the fifth smallest value in 1, -3, -1, 1/7, -0.3, 1.167? 1 What is the second biggest value in 0.4, -7, 0.42356? 0.4 Which is the fourth biggest value? (a) -0.926 (b) 21 (c) -2/13 (d) -1 (e) 5 (f) 0.5 c What is the second smallest value in 4/3, 28, 5197, -0.5, 0.06, 2? 0.06 What is the fifth biggest value in 5, 2.8072, -2, 0.2, -0.2, 3? -0.2 Which is the second biggest value? (a) 5273 (b) 0 (c) -29 (d) -2 b Which is the third biggest value? (a) 397142 (b) 3 (c) 0.4 (d) 2 d What is the fifth biggest value in -13, 2, -607, 4, -3, -17? -17 What is the fourth biggest value in 146, 4, -1006, 1, -2? -2 What is the fourth biggest value	{ "pile_set_name": "DM Mathematics" }
ppose 0 = -q - 2d + 12, 0 = -q - hd - 4 + 16. Suppose -qn + 297 = -1863. Is n a multiple of 20? True Let v(b) be the second derivative of -8b*3/3 + 373b*2/2 - 33b. Is 48 a factor of v(0)? False Let f = 0 + 8. Let q(s) = -10s + 126. Is 14 a factor of q(f)? False Let n(l) = l3 - 13l*2 + 25l + 15. Let j be n(7). Let x = -66 - j. Is 38 a factor of x? True Let m = -134 - -92. Let l = m - -44. Suppose -146 = lf - 4f. Does 10 divide f? False Let g(o) = o*2 - 12o - 20. Let u be g(12). Is 7 a factor of 15/u + (-1275)/(-20)? True Let o be (-1)/((4/(-12))/(2/3)). Suppose 1062 = 3i - oh, 3i - 3h - 1436 = -374. Is 6 a factor of i? True Suppose 2u - 169q = -166q + 2795, 3u - 4155 = -3q. Is u a multiple of 139? True Suppose -2140753 - 1443107 = -147d. Does 230 divide d? True Suppose 0 = -5r, -r - 3r = 3z + 780. Let u = z - -512. Is 14 a factor of u? True Let o(b) = -b - 7. Let r be o(-21). Suppose -rz - 3360 = -21z. Does 32 divide z? True Let i(f) = 4f - 5f - f + 0f + 18. Let s be i(18). Is 10 a factor of -1 + (-3 - s - 4)? True Let h(m) = 2 + 10m + 41 + 4m + 5. Let s be h(22). Suppose 0x + s = 2u + 5x, -5u + 4x = -956. Is 47 a factor of u? True Let z be 7698 + ((-4)/10 - (-84)/60). Suppose -13i + z = 2785. Is 27 a factor of i? True Suppose 89v + 2 = 90v. Suppose -3j - 5p - v = -1, -3 = -3j - 3p. Does 12 divide (-12)/(j(-5)/90)? True Let n(w) = 4w*3 - 31w*2 - 3w - 44. Is 37 a factor of n(12)? True Let t be (7/(-7))/((-2)/(-4)). Let i = t - 16. Is 11 a factor of (i/(-2))/(1/11)? True Let u(y) = 2y - 13. Let d be 0/(-1) - (1 + -9). Let f be u(d). Suppose 4b - b = -3k + 219, -3k + 231 = -fb. Does 17 divide k? False Suppose 22v = 19v + 738. Suppose 9z + v = 12z - 2w, -435 = -5z - 5w. Is 12 a factor of z? True Suppose -33l + 7d + 349 = -28l, 4d = -l + 32. Is 6 a factor of l? True Let h be (2/(-2) + -1)(-70)/20. Suppose -4 = -hp - 60. Let z(v) = 4v2 + 14v + 16. Is 10 a factor of z(p)? True Let x = -258 - -249. Is 4 a factor of (x/(-7 + 4))/((-3)/(-72))? True Let k(r) = r*3 - 10r*2 - 10r + 8. Let u be k(11). Let f = u + 56. Suppose 12h + f = 2055. Is 20 a factor of h? False Let k be 350 + 0 - 0. Suppose -8s + 384 = -4s + o, -16 = -4o. Let p = k - s. Is p a multiple of 7? False Let o = 3907 - 1212. Is 55 a factor of o? True Let c = -34 - -46. Let x be -9(8/c - 1). Is 92/1 + 4 + x a multiple of 11? True Let y(g) = 4 + 0 - 1 - 7 - 2g. Is 3 a factor of y(-10)? False Let a(c) = -c3 - 6c*2 + 3c - 1. Let b be a(-7). Suppose 4n - b = -m, -3m + 23 = 5n - 16. Suppose 218 = nl + 2. Does 9 divide l? True Let r(s) = -s*3 - 2s*2 + 2s + 2. Let g be r(0). Suppose 3n - 50 = -gn. Suppose 3v + n = o - 4, -o + 16 = -4v. Is o a multiple of 2? True Suppose -2299w = -2254w - 1237860. Is w a multiple of 46? True Suppose -4d + 5q + 1383 + 18367 = 0, -4q + 9836 = 2d. Does 10 divide d? True Let s = 17116 - 11180. Is 106 a factor of s? True Let t(f) = 27f2 - 246f + 667. Is t(23) a multiple of 16? False Let k(c) = 113c2 + 25c - 48. Is k(5) a multiple of 13? False Let p(q) = -11q + 6. Let s be p(0). Suppose -3f = 2k - 582, 8k + 570 = 3f + sk. Is 48 a factor of f? True Let q be (50/5)/(-2) - -3. Let l be ((-42)/10 - -3)/(q/(-60)). Let p = l + 66. Does 30 divide p? True Suppose 4r + 3l = r + 33, 5r - 3l - 23 = 0. Suppose rm - 1038 = -345. Let g = 197 - m. Does 25 divide g? False Let l be ((-48)/(-90)10)/(1/(-30)). Is 41 a factor of ((-336)/l)/(-21) - 3282/(-20)? True Suppose 7584 = 3f - 5g - 38731, -f + 15415 = 3g. Does 12 divide f? False Suppose -8n - 12 = -14n. Suppose -3p + z + 12 - 4 = 0, np = 5z + 14. Suppose -3m = -2j - 281, -j = m - pj - 95. Is 13 a factor of m? True Let l(w) = -448w + 1142. Is l(-22) a multiple of 24? False Suppose -7r + 65044 = 14r - 35966. Is 26 a factor of r? True Suppose 71p + 16412 = 48930. Is p a multiple of 4? False Is 13 a factor of 20 + (-23 - 0) - (0 - (9092 + -2))? True Let w = 189 + -89. Suppose 110s - ws = 5760. Is 9 a factor of s? True Suppose 3m = -4w + 2396, 3m = -3w + 1503 + 897. Is m a multiple of 6? True Suppose 2z = 4p + 209 + 85, 3p + 450 = 3z. Does 76 divide z? False Let z(n) = 4n*2 - 90n + 616. Is 25 a factor of z(44)? True Suppose -4j + a + 81536 = 0, 4j - 2a - 19243 = 62293. Is j a multiple of 182? True Suppose 26 = 2s - 3s. Let d = 525 - 478. Let m = s + d. Does 21 divide m? True Let g = -5778 - -5999. Let u = 5 + -163. Let s = u + g. Is 5 a factor of s? False Let d(s) = -65s + 10. Let z be d(2). Let t = 246 + z. Is t a multiple of 21? True Let w(s) be the third derivative of -s6/120 + s5/5 + s*4/6 + 25s*3/6 + 80s2. Does 5 divide w(12)? False Let s = -12426 + 14979. Is s a multiple of 5? False Let s(k) = k3 - 13k2 + 26k - 17. Let f be s(11). Suppose 29h - fh + 708 = 0. Let u = -246 - h. Is u a multiple of 36? True Let k(l) = 2170l2 - 137l + 137. Is k(1) a multiple of 18? False Let q(i) = i - 12. Suppose -6c + 0c = -78. Let j be q(c). Is 38 a factor of (96 - j)2/5? True Suppose 12m - 7194 - 165066 = 0. Does 45 divide m? True Let m(b) = 2b2 - 2b + 3. Let u be m(2). Suppose 5j = uj - 312. Is 16 a factor of j? False Let k = 132 + -213. Let l = k - -185. Is l a multiple of 26? True Suppose 7a - 25960 = -1075. Is 15 a factor of a? True Suppose -4s + 239 = -n + 22, -3s + 180 = 5n. Suppose s = 5o - 550. Does 19 divide o? False Let b(z) = 13 - 9z - 6 + 15z - 6 - 8. Let j = -17 + 25. Does 13 divide b(j)? False Suppose p + 3 = 0, 0o - o + 523 = 3p. Let q = o + -118. Is 14 a factor of q? False Suppose -4v = -z - 2525, 4z - 2324 - 176 = -4v. Is 5 a factor of v? True Let a(z) = -1523z2 - 22z - 2. Let m be a(-1). Let r = 2511 + m. Is 36 a factor of r? True Suppose 8c - 9c - 5d = 125, -3c = d + 403. Let z = -43 - c. Does 4 divide z? True Suppose -z + 665 = 5a - 0z, -3a - 4z = -416. Let m = 105 + -21. Suppose -ar - m = -134r. Is 6 a factor of r? True Let j(o) = o*3 + 7o2 - 12. Let i be j(-7). Let z(x) = x3 + 12x2 - 8x - 10. Does 13 divide z(i)? False Is ((-42639)/9 + 3)/(-15 + 1869/126) a multiple of 134? True Let s(g) = g*2 - 11g + 16. Let m = 271 - 134. Suppose 7y + 46 = m. Is s(y) a multiple of 5? False Let m = 378 - 283. Suppose 2r + 155 = -3j, -3r + 3j = 40 + 185. Let o = r + m. Is 5 a factor of o? False Does 20 divide -24283(((-32)/24 - -1) + (-2)/3)? False Let w be 6(-8 - 354/(-36)). Suppose 4651 - 16388 = -wi. Is i a multiple of 66? False Suppose 4a = -4j + 16, -2a + 6j - 3j = -18. Let x(i) = 39i - 55. Is x(a) a multiple of 7? False Let l = -53307 + 85825. Is l a multiple of 97? False Let v be (1 - 4) + -1 - -36. Suppose -4g + 22 = 2p - v, -g = -5p + 14. Suppose 0 = 3s - 4x - 13, x + 0x - g = -4s. Does 3 divide s? True Let k(y) = 2y*2 + 66y + 8. Let h be k(12). Suppose h = 9s - 3385. Is 71 a factor of s? True Suppose -160 = q - 4q + k, -3k + 276 = 5q. Suppose m - 2b = -0m + q, 0 = 3m + 3b - 162. Is m a multiple of 27? True Suppose 5j - 79197 - 42603 = -5x, 5x - j - 121782 = 0. Is x a multiple of 69? True Let o = -3421 - -4195. Is 3 a factor of o? True Suppose 2k - 15709 = -3u - 464, 3u - 7633 = -k. Is 44 a factor of k? True Let k(s) = s*3 + 11s*2 + 9s + 6. Let r be k(-10). Let m(t) = 170t2 + t - 13. Let h be m(-5). Suppose rf = h + 824. Is 25 a factor of f? False Let b(k) = 13k2 + 27k - 145. Let l(z) = -7z2 - 14z + 72. Let a(y) = 3b(y) + 5l(y). Is 22 a factor of a(7)? True Let n be 3 - ((-27)/45)/(1/(-15)). Let c(j) = -j3 - j2 - 9j. Is 21 a factor of c(n)? False Suppose 0 = -6p + 1402 - 256. Let q = 264 - p. Is q a multiple of 16? False Suppose -4b = 2 - 2. Suppose 3a + by - 513 = 3y, -2a = y - 333. Does 10 divide a? False Let w be (-96)/1296 + (-45418)/(-54). Suppose 29n - w = 812. Does 3 divide n? True Let x(b) = -996b - 6204. Does 4 divide x(-8)? True Suppose -5q + 20 = -10. Let n = -1 + q. Suppose 2d + 51 = nd + o, -3d + 57 = -o. Is d a multiple of 18? True Suppose -177 = -3l - z, -4l - 3z = -2l - 111. Suppose -3x - 32 = -4s, 5x + s = -24 - l. Does 13 divide (2 + -5)(x + 9)? False Let u(v) = 2 + 5v - 5 + 8v2 - 3v. Let p(w) = 7w*	{ "pile_set_name": "DM Mathematics" }
= 24v2 - 30v - 47. What are the prime factors of p(-9)? 11, 197 Let q(g) = -22g + 6. Let v be q(1). What are the prime factors of (291/6)/((-8)/v)? 97 Suppose 19 = -2u + 5l, -4l + 13 = u + l. What are the prime factors of 5/(10/(-89))u? 89 Let s(d) = 3 + 39d + 5 - 15d - 4d2. List the prime factors of s(6). 2 Let w(x) = -x3 + 13x2 - 11x - 8. Let c be w(12). Suppose -6r + 8r - c = 0. Suppose ry - 3y = -54. What are the prime factors of y? 2, 3 Let t(g) = -2g2 + 24g - 7. Let p be t(12). What are the prime factors of (-6)/42 - 925/p? 2, 3, 11 Suppose 15 + 16 = w. Let z = 87 - w. Suppose -8x = -4x - z. What are the prime factors of x? 2, 7 Let s(n) = -2n - 75. Let c be s(29). Let f = -68 - c. List the prime factors of f. 5, 13 Let c(t) = t2 + t + 35. List the prime factors of c(-17). 307 Let x = 1129 - 651. List the prime factors of x. 2, 239 What are the prime factors of 7/(35/30) - -1262? 2, 317 Let t = 23010 + -14360. List the prime factors of ((2 + 0)/1)/(100/t). 173 Let h = 270 - -877. List the prime factors of h. 31, 37 What are the prime factors of -3(-1 + 24/18) - -547? 2, 3, 7, 13 What are the prime factors of 16912/126 - 4/18? 2, 67 Let n(p) = p*3 - 13p*2 + 12p + 5. Let f be n(12). Let l be 2 - f/(15/(-12)). Suppose 8d = ld + 74. List the prime factors of d. 37 Suppose -7m - 43 = -393. Suppose -4z + 166 + m = 0. List the prime factors of z. 2, 3 Suppose 6346 + 4089 = 3r - 2a, a + 13920 = 4r. What are the prime factors of r? 59 What are the prime factors of (21/9 - 4) + (-5680)/(-24)? 5, 47 Suppose -5i = 19m - 22m - 8939, 0 = -i + 2m + 1785. List the prime factors of i. 1789 Let w(m) be the third derivative of -5m*4/24 + 3m*3/2 - 6m*2. Let f be w(-4). Suppose -3s + 10 = -f. List the prime factors of s. 13 Let o = -21 - -27. List the prime factors of (o + -3 - 1) + 70. 2, 3 Suppose -62f + 3m - 12555 = -65f, -2m - 4179 = -f. List the prime factors of f. 47, 89 Suppose 5d = -25, 2u + 0 = -4d - 4. Let f = -11 + 16. Let m = u - f. List the prime factors of m. 3 Suppose 0 = 6d - 258 + 696. Let q = 305 + d. What are the prime factors of q? 2, 29 Let j(o) be the first derivative of 22o3/3 + 23o*2/2 + 5o - 13. List the prime factors of j(-4). 5, 53 Suppose 31j - 1809 = 2810. What are the prime factors of j? 149 Let y be 8/(-6)18/(-12). Let v(g) = -g*2 + 21g - 39. Let d be v(8). Suppose 3u + 2p + 56 - 144 = 0, -d = -yu + 5p. List the prime factors of u. 2, 3, 5 Suppose -186 = 2t - 830. What are the prime factors of t? 2, 7, 23 Let z be (-5)/15 + 178(-2)/(-6). Suppose -z = -5k + 41. List the prime factors of k. 2, 5 Suppose -8 = -8s + 152. Let l = s - 18. What are the prime factors of l? 2 Let w = -73 + 78. List the prime factors of w/(-10)-110 - (0 + 3). 2, 13 Let c be -28 + (-61 - -2) + 0. What are the prime factors of (303/(-2))/(24/c) - -3? 5, 41 Let w = -1124 - -1936. What are the prime factors of w? 2, 7, 29 Suppose -a + 353 = 46. Suppose 0g = -3g - 3m + 210, -a = -4g + 5m. List the prime factors of g. 73 Let q(b) = 3b + 25. Let z be q(9). Let g = z + -21. What are the prime factors of g? 31 Let s be (-3)/(-3)125/5. Let w be s/(-9) + 28/(-126). List the prime factors of (-117)/(-5) - w/5. 2, 3 Suppose 24446 = 21a - 3946. What are the prime factors of a? 2, 13 Let p(x) = x*2 + 32x + 8. List the prime factors of p(40). 2, 19 Let m = 44 + 170. What are the prime factors of m? 2, 107 Let m be (-5 + 0)/10-4. Suppose 0u = 5u + 2p - 431, -mu - 2p + 170 = 0. What are the prime factors of u? 3, 29 Let j(i) = -2i - 3. Let m be j(-4). Let s(n) = -n3 - 34n*2 + 3n + 127. Let x be s(-34). List the prime factors of ((-132)/(-20))/(m/x). 3, 11 Suppose 6j - 27402 = 1104. List the prime factors of j. 4751 Let r be (13/26)/(1/(-2))31. Let o = -26 - r. List the prime factors of o. 5 Suppose 5y = y - 5a + 33, 3 = -y + a. Suppose yl = 9g - 5g + 630, l = -3g + 320. What are the prime factors of l? 317 Let h(m) = -8m + 35. Suppose i + 30 = 12. List the prime factors of h(i). 179 Let p = -26 + 27. Let v(b) = 66b - 2. What are the prime factors of v(p)? 2 Let m(i) = -2i3 - 24i*2 - 49i - 13. What are the prime factors of m(-16)? 2819 Let g = 32 + -28. Suppose -5x = gr - 401, 2x + 3r - 78 = x. List the prime factors of x. 3 Let q(h) = 7h - 59. Let y(s) = s + 13. Let m be y(5). List the prime factors of q(m). 67 Suppose -6y + 11769 + 6759 = 0. What are the prime factors of y? 2, 193 Let l = 9 + -6. Suppose 2w - 81 = -2t + lw, t = 3w + 48. Let h = t - 22. What are the prime factors of h? 17 What are the prime factors of (-2)/9 - 42(-18452)/378? 2, 5, 41 Suppose -p + 3h = 46, -2p + 4h - 9 = 81. Let u = 52 - p. List the prime factors of u. 5, 19 Suppose -5k = 8 + 32. Let m be (-4)/k - 3412/(-8). Suppose 6p = -p + m. What are the prime factors of p? 61 Let x(v) = 2v2 - 8v - 25. What are the prime factors of x(20)? 3, 5, 41 Let f be (-40)/(-30)(-9)/(-2). Let y(s) = -s3 + 7s*2 + 7s + 6. What are the prime factors of y(f)? 2, 3, 7 Suppose 1460 = 12w - 9w - a, a = 2w - 974. What are the prime factors of w? 2, 3 Suppose -2p + 250 = 3p. Let o(k) = k3 + k + 3. Let y be o(0). Suppose 2f + yq - p = 0, q = -5f + 6f - 20. What are the prime factors of f? 2, 11 Suppose 3r - 1855 = -2k, 3r - 3k + 1009 = 2884. What are the prime factors of r? 3, 23 List the prime factors of 4438/4 + 2 - 16/(-32). 2, 139 Suppose -5s - 3p + 80 = 0, -6s + 4s = -5p - 1. List the prime factors of (139/(-4))/(s/(-52)). 139 List the prime factors of 36/((64/(-180))/(-8)). 2, 3, 5 Suppose 3170 = 17u - 3596. List the prime factors of u. 2, 199 Let m(h) = -h2 - h + 1. Let z(o) = 2o*2 + 13o + 11. Let x(r) = -m(r) - z(r). Let j(c) = 3c + 15. Let f be j(-8). List the prime factors of x(f). 3, 5 Suppose 14c = 6 + 330. Suppose -c = -0t - 3t. What are the prime factors of t? 2 Suppose -40x + 56040 = -13480. What are the prime factors of x? 2, 11, 79 What are the prime factors of (-4)/40-331365? 2, 3, 331 Suppose -4o = 4m - 43 - 5, o + 30 = 5m. Suppose -b + 13 = m. Suppose 49 = v - b. What are the prime factors of v? 5, 11 Suppose -2m = -5l + 3012, 0 = l - 4l - 3m + 1824. What are the prime factors of l? 2, 151 Let a(g) = -g - 1. Let z be a(-3). What are the prime factors of 46/(-4)(-4 + (z - 0))? 23 Let j(u) = -1. Let g(c) = -7c + 25. Let a(b) = -g(b) + 4j(b). List the prime factors of a(13). 2, 31 Let n(y) = -y*2 + 9y + 12. Let k be n(10). Suppose 7 = -5w + k. Let l = w + 54. What are the prime factors of l? 53 What are the prime factors of (-376)/235 - (-3818)/5? 2, 3, 127 Suppose -5 = j - 6. Suppose 2v = 5o + 115, -3o - 10 = -j. What are the prime factors of v? 2, 5 Let j = 334 - 94. Suppose -7l = -2l - j. What are the prime factors of l? 2, 3 Let b be ((-12)/(-10))/(11/(-550)). What are the prime factors of (b/8)/(12/(-56))? 5, 7 Let h = -450 - -1074. What are the prime factors of h? 2, 3, 13 Suppose -3r - 120 = 2r. Suppose 5m + 19 = -106. What are the prime factors of r/28(-3 + m)? 2, 3 Let q(l) = l. Let m be q(4). Let h(i) = -i*2 - 6i + 9. Let n be h(-7). Suppose 3a + na = -4o + 26, 0 = -o + 4a - m. List the prime factors of o. 2 Let v(d) = -d*2 - 13d - 6. Let o be v(-13). What are the prime factors of ((-6)/18)/(2/o) + 125? 2, 3, 7 Let i be ((-16)/(-3))/((-6)/(-450)). Suppose 0 = 10y - 0y - i. List the prime factors of y. 2, 5 Let u(l) = l + 14. Let i be u(-8). Suppose -2v + 12 - i = 0. Suppose vd = 17 + 109. List the prime factors of d. 2, 3, 7 Let v = -555 + 937. What are the prime factors of v? 2, 191 Let s be (-1392)/33 + 6/33. Let r be s/(-11) - (-4)/22. Let n(a) = -a*3 + 6a*2 - 5a + 2. What are the prime factors of n(r)? 2, 7 Suppose 3f + 363 = -5r - 0f, -f + 143 = -2r. List the prime factors of (-6)/(r/(-6)) + (-157)/(-2). 2, 3, 13 What are the prime factors of (-24)/33/6 - -540? 2, 67 Suppose -u = 25 - 15. Let h(q) = -q + 22. List the prime factors of h(u). 2 Let t(r) = -4r - 30r + 18 - 5r - 3r. List the prime factors of t(-3). 2, 3 Let t be 3/3 + -1 - -26. Let o be (-2)/(-4)-1t. Let u = o + 30. What are the prime factors of u? 17 Let v be -3 + 1/(2/22). Suppose -vx + 4*x = -	{ "pile_set_name": "DM Mathematics" }
- 2 + 598t - 304t + 11t2. Is o(x) a multiple of 5? True Let h be -2((-52)/117 + (-14)/9). Suppose 3n = -3d + 600, hd = 3n + 499 + 301. Does 7 divide d? False Suppose 4d = -22k + 26k - 48216, 12074 = k + 3d. Does 20 divide k? False Let p = 70164 + -48706. Is 94 a factor of p? False Let u be (-8)/(-40) - ((-29552)/(-10))/(-4). Let y = -203 + u. Let j = y + -365. Is j a multiple of 18? False Let s(w) = w*3 + 6w*2 - 6w + 9. Let q be s(-7). Suppose -g + qg = -2. Does 7 divide 5/2(g + 8)? False Suppose -4d = 5i - 32, -4d - 2i + 5i = 0. Suppose -4u = -dt + 2823, 3t - 2805 = 73u - 75u. Does 30 divide t? False Let f be 2/(-3)(5/(-1) - -2). Suppose 3w = 2w + f. Suppose 0 = 5c - k - 707, -c = wc + 3k - 417. Is 20 a factor of c? False Let n(u) = 649u2 + 71u - 365. Is n(5) a multiple of 12? False Let k = -3627 - -6411. Is 37 a factor of k? False Let t = 41025 + -22197. Is 51 a factor of t? False Suppose 44l = 651 + 2077. Suppose -x + 13 = -l. Is x even? False Let q(x) = -149x*3 - 2x*2 + 63x + 241. Does 67 divide q(-4)? False Does 5 divide (4 - 3)/(4/12) + 6321 + -16? False Let a = -9995 - -13251. Does 37 divide a? True Let c(g) = 5g2 + 7g - 2. Let p be c(6). Suppose 5n - 1165 + p = 0. Is 23 a factor of n? False Suppose -2p + 6p = s - 24, -5s + 5p + 45 = 0. Does 49 divide (-490)/s(-180)/50? True Let q(x) = 266x2 - 10x + 38. Is 34 a factor of q(3)? False Suppose 0 = 4o + 3h + 17 + 4, 2o + 17 = 5h. Let r(p) = -p*3 - 4p*2 - p + 15. Let f be r(o). Suppose 4d - f = 103. Does 9 divide d? False Let m(h) = 17h + 89. Let k be m(-4). Suppose kr - 13r = 960. Is r a multiple of 15? True Let o(w) = -1 + 5782w - 2 - 5784w + 12w*2 - 2w*3. Does 6 divide o(5)? False Is 12/(-26) - (-2107026)/702 a multiple of 4? False Suppose -4v + 2i + 2130 = 0, 0v - 4i = -4v + 2124. Suppose 5h - 15 = 0, -3h = -4q + v + 257. Is 10 a factor of q? True Suppose -3l - 123 + 7 = 5y, 4l + 193 = y. Let a = l + 94. Suppose -2s = -163 + a. Does 34 divide s? False Let c = -1447 - -2757. Suppose -59s - c = -64s. Is s a multiple of 8? False Suppose v + 5m = 19776, -v + 3m = -3205 - 16603. Does 49 divide v? True Let i be (116/(-3) + 3)/((-5)/60). Let c = 0 - -5. Suppose 2s - 3t - t - 176 = 0, -cs + 4t + i = 0. Does 14 divide s? True Let g(p) = -3p - 3. Let s be g(-2). Let t be s - (-3 + 4 + 2). Suppose 4h - 44 = -w, -4w = -3h - th - 252. Does 7 divide w? False Suppose 35q = -536 - 304. Is 20 a factor of (-1514)/(-2) - -6(-20)/q? False Let y(x) be the third derivative of -x*4/6 + 28x*3 - 10x*2 - 2x. Does 58 divide y(26)? False Let p = 4110 - 3158. Does 149 divide p? False Let x(w) = -1 - 23w - 1 - 46w + 5w. Is 41 a factor of x(-1)? False Let h = -5386 + 7588. Suppose a + 4b - 1116 = 0, 11a + h = 13a - 2b. Is 12 a factor of a? True Let u = 151 + -8. Suppose 2m - 449 = -u. Does 9 divide m? True Let f be -3(1 - 0)5. Suppose 2p + 5i - 225 = -73, 0 = 5p + 3i - 342. Is (-25)/1p/f a multiple of 10? True Suppose 0 = -244k + 241k - 2f + 38143, -3f - 38118 = -3k. Is 19 a factor of k? True Let s = 21605 - 678. Is 117 a factor of s? False Let s = -21173 - -30673. Is 25 a factor of s? True Let s(m) = 239m - 300. Let r(x) = -232x + 301. Let k(v) = -5r(v) - 6s(v). Does 11 divide k(-4)? False Let d(t) = -t*2 - 14t + 17. Let l be d(-15). Suppose z - k = lk - 12, 28 = z + 5k. Suppose -128 = -zv + 337. Is 16 a factor of v? False Suppose -3x + 63 = 3g, 90 = 5x - 4g + 6g. Suppose -12z = -xz. Suppose 2a = -3r - 3a + 552, -a + 3 = z. Is 26 a factor of r? False Let w = 540 - 573. Let p(x) = x + 109. Does 12 divide p(w)? False Let a = -509 - 46. Let z = -345 - a. Is z a multiple of 15? True Suppose 19k + 225 = 14k. Let q be (-4)/18 + 1485/k. Does 14 divide 6/33 - 2616/q? True Let l(t) = -52t - 143. Is 93 a factor of l(-39)? False Suppose -143j + 93062 = -124j. Is 25 a factor of j? False Let w(b) = 27b - 43. Let j(m) = -28m + 43. Let o(p) = 4j(p) + 5w(p). Does 9 divide o(5)? True Suppose -8 = -4y + 12. Suppose -3q + 12 + 0 = 3l, yq = 5l. Suppose 0h - 2x + 100 = h, 5h - 468 = -qx. Is h a multiple of 23? True Let x(z) = -56z - 1211. Does 3 divide x(-23)? False Suppose -r + 3 = 3v, 5v - 4r - 22 = -0r. Suppose -vk - 20 = -5f - 4, -4 = -f. Suppose -3a + 5x = -32, 5a - 2x = kx + 49. Does 3 divide a? True Is -16(-400)/(-32)(-560)/25 a multiple of 14? True Let d = 6843 - -259. Does 48 divide d? False Let z = 44 - 40. Suppose 0p + 2v = -3p + 11, v - 8 = -zp. Is 9 a factor of (-2)/(-2p/36)? True Suppose 10 = 5n + 2w, 3w + 16 = -n - w. Is 1274/n - (14/(-4) + 2) a multiple of 58? False Let q be (4 - (-90)/(-21)) + (-5282)/(-14). Suppose -6v + 2593 = -q. Does 38 divide v? False Let r(m) = -48m*3 - 3m*2 + 2m + 2. Let u be r(2). Let j = u + 502. Is 14 a factor of j? True Suppose -5u = -5, 0 = -0w - 5w - 4u - 491. Let d = w - -161. Does 6 divide d? False Let c(l) = -l - 21. Let h be c(-15). Is 18 a factor of 715/(-15)h? False Suppose 54w = 42083 - 13355. Is 7 a factor of w? True Let f(v) = 3v*2 + 66v + 508. Let t be f(-13). Let d = -42 + 9. Let s = t + d. Is 26 a factor of s? False Let y = -1011 + 83. Is 6 a factor of 20/(-110) - y/22? True Let c = -11 - -16. Let a(p) = 8p + 29. Let l be a(-3). Suppose 6b = cq + 3b - 232, -lb - 196 = -4q. Is 11 a factor of q? True Let k = 12862 - 8606. Is k a multiple of 13? False Suppose 14q - 11q = 0. Suppose qy - 5 = -y. Suppose ys - 74 = 3s. Is s a multiple of 5? False Does 48 divide (-337)/(14/18-3) - 15/35? True Let d = 819 + -1230. Let a = 781 + d. Does 10 divide a? True Suppose 0 = -p - 5h + 30, -2p + 4h = -0p - 18. Suppose 0 = pw - 16w + 3. Suppose -23 - 274 = -wg. Is 17 a factor of g? False Let h be (10 + 154/(-4))/((-6)/40). Let l = h - 106. Is l a multiple of 42? True Let i(b) = -318b - 916. Is 2 a factor of i(-5)? True Let i(b) = 4b - 80. Let m be i(21). Suppose 4s - s = mp + 649, -5p - 867 = -4s. Is 12 a factor of s? False Let v be (-191980)/(-150) - (-14)/105. Let q = -209 + v. Is q a multiple of 102? False Let l(g) = -12 + 18g + 16g - 33g. Let f be l(7). Is 12 a factor of (-122)/f + 10/(-25)? True Let d = 2100 + -1267. Is d a multiple of 7? True Suppose 4w = 5c - 18 - 29, -3w = -2c + 23. Suppose 9g + 11 = -c. Is g/(-1) + 6 + 55 a multiple of 21? True Let t(g) be the third derivative of 35g*4/12 - 23g*3/3 - 81g*2. Does 22 divide t(6)? True Let f = -125 - -127. Let u(v) = -2v2 - v3 + 10v2 - vf. Is 36 a factor of u(6)? True Let f(r) = r3 + 38r*2 + 11r + 197. Does 4 divide f(-37)? False Is 22 a factor of (-5 + 222/42)/(16/50512)? True Let t(a) = 314a + 1654. Is t(-3) even? True Suppose 9y + 64 = 91. Suppose t - 1086 = -2h - 181, -yt + 2719 = 5h. Is 21 a factor of t? False Does 10 divide ((-63)/15)/(9/(-52485)) + 21/3? True Let y(r) be the third derivative of 49r*5/60 + 7r*4/24 - 2r*3/3 - 6r*2 + 3r. Is y(1) a multiple of 4? True Suppose -5b = -2510 + 160. Suppose 9u - 340 = b. Does 45 divide u? True Let a(l) = -2l2 - 17l + 12. Let w(q) = -q*2 + q. Let j(m) = -a(m) + 4w(m). Let p be j(9). Suppose -12 - p = -y. Is y a multiple of 10? False Suppose 14t - 63 = -21. Suppose -2f + 1056 = 5m, -8f + 12f = tm + 2138. Is 47 a factor of f? False Let u be ((-36)/15)/(-6) + (-26)/(-10). Let w be (20 + (-12)/u)9/4. Let x = 72 - w. Is x a multiple of 8? False Let i(l) be the second derivative of -l5/20 - l3/2 + 129l*2/2 + 7l - 6. Is 7 a factor of i(0)? False Suppose 0 = -r - 5x + 404, 0 = -r + 4r - 2x - 1127. Suppose 3m + r - 631 = 0. Is m a multiple of 3? True Let x(u) = 5u2 - u. Let s = -16 - -20. Suppose 2k + 5n - n = -18, -sn = -3k - 17. Is 14 a factor of x(k)? True Is ((-28)/(-20) - 1)/(11 - (-4007290)/(-364300)) a multiple of 38? False Suppose -3g = h - 4769 - 75, 3g + 4h - 4841 = 0. Does 85 divide g? True Let b(m) = m*3 + 13m*2 + 10m + 30. Let i be b(-12). Let k be 2/9 - 12/i. Suppose -4n = 2t - 152 + 24, 4n + t - 126 = k. Is n a multiple of 31? True Let x = 321 + -319. Suppose -12w = -7w + 5c - 455, xc + 198 = 2w. Is w even? False Is 14 a factor of (14/3)/((4/33)/(-1 - -87))? False Let	{ "pile_set_name": "DM Mathematics" }
three letters picked without replacement from rkwns. 1/60 Two letters picked without replacement from jjjmjmsmuylmmym. Give prob of sequence ms. 1/35 Calculate prob of sequence vrk when three letters picked without replacement from kkvkkekrv. 5/252 What is prob of sequence oozo when four letters picked without replacement from dfoozoodyz? 1/105 Two letters picked without replacement from czccccz. Give prob of sequence zz. 1/21 Two letters picked without replacement from {e: 2, b: 1, n: 1, z: 1}. Give prob of sequence ee. 1/10 What is prob of sequence ss when two letters picked without replacement from smooomooooooso? 1/91 What is prob of sequence zt when two letters picked without replacement from vvtzvvzzvelv? 1/44 Three letters picked without replacement from {c: 1, o: 2}. What is prob of sequence oco? 1/3 What is prob of sequence qhjj when four letters picked without replacement from qjshqhjqqqqi? 1/495 Two letters picked without replacement from uxxrxwruxuxyxxxuxu. Give prob of sequence ry. 1/153 Two letters picked without replacement from {k: 1, y: 2, t: 3, e: 6, m: 2, a: 6}. Give prob of sequence ek. 3/190 Calculate prob of sequence waa when three letters picked without replacement from {a: 3, p: 3, w: 4, o: 4}. 1/91 Calculate prob of sequence awaw when four letters picked without replacement from aaawwaa. 1/21 Calculate prob of sequence hhh when three letters picked without replacement from {q: 11, h: 5}. 1/56 Three letters picked without replacement from plppkkpplplppkwpkwp. Give prob of sequence kpk. 20/969 Three letters picked without replacement from {c: 1, o: 2, q: 1}. What is prob of sequence coo? 1/12 What is prob of sequence hhwh when four letters picked without replacement from wwhwhhhwwwwwhhhw? 9/208 What is prob of sequence mm when two letters picked without replacement from {d: 1, m: 10, b: 7}? 5/17 Four letters picked without replacement from kkkkddk. What is prob of sequence dkdk? 1/21 Two letters picked without replacement from nnnnnnnnnn. What is prob of sequence nn? 1 What is prob of sequence uu when two letters picked without replacement from ffufuff? 1/21 Four letters picked without replacement from {z: 6, x: 5, n: 2}. What is prob of sequence nnzx? 1/286 Two letters picked without replacement from {v: 3, z: 2, t: 2, o: 2}. What is prob of sequence vt? 1/12 What is prob of sequence oqo when three letters picked without replacement from dqqoddqoqodqddo? 2/91 Calculate prob of sequence fsuf when four letters picked without replacement from {u: 6, s: 4, f: 4}. 12/1001 Two letters picked without replacement from wwwwwwwww. What is prob of sequence ww? 1 What is prob of sequence lj when two letters picked without replacement from yyygjllyyypddy? 1/91 Calculate prob of sequence xar when three letters picked without replacement from {s: 1, d: 1, x: 2, a: 5, r: 6, y: 1}. 1/56 Four letters picked without replacement from btdbltlddtd. Give prob of sequence btdb. 1/330 Four letters picked without replacement from wkkffs. What is prob of sequence ksfk? 1/90 Four letters picked without replacement from yyppyyssyyysspyyyyyy. What is prob of sequence spsy? 13/3230 Three letters picked without replacement from {d: 10}. What is prob of sequence ddd? 1 Calculate prob of sequence zg when two letters picked without replacement from {z: 1, g: 1, s: 2, r: 1, m: 5}. 1/90 Calculate prob of sequence tjjj when four letters picked without replacement from {t: 5, j: 8, o: 4}. 1/34 What is prob of sequence xxyx when four letters picked without replacement from {c: 7, r: 1, z: 2, x: 3, y: 1}? 1/4004 Four letters picked without replacement from {q: 6}. Give prob of sequence qqqq. 1 Three letters picked without replacement from {u: 5, c: 9, l: 3, y: 1}. Give prob of sequence lyu. 5/1632 Four letters picked without replacement from whhwwhhhww. Give prob of sequence wwhh. 5/63 Calculate prob of sequence aa when two letters picked without replacement from {o: 1, a: 2}. 1/3 Four letters picked without replacement from xffxxfxfxfffff. Give prob of sequence xxxf. 45/2002 What is prob of sequence epe when three letters picked without replacement from {j: 1, x: 1, e: 9, h: 1, p: 1, g: 4}? 3/170 Two letters picked without replacement from hhirtrttrhhhhttrr. What is prob of sequence ih? 3/136 Two letters picked without replacement from {s: 1, j: 2, v: 1, r: 2, m: 1, q: 1}. Give prob of sequence sq. 1/56 Four letters picked without replacement from nplnscnpnn. What is prob of sequence lcsp? 1/2520 Three letters picked without replacement from artoaaoararar. Give prob of sequence oot. 1/858 Two letters picked without replacement from knkkkudd. Give prob of sequence du. 1/28 What is prob of sequence fec when three letters picked without replacement from {c: 1, e: 1, b: 2, f: 2, y: 1}? 1/105 What is prob of sequence qg when two letters picked without replacement from rrgq? 1/12 Two letters picked without replacement from {i: 3, w: 4}. Give prob of sequence iw. 2/7 What is prob of sequence jzr when three letters picked without replacement from zjybr? 1/60 Three letters picked without replacement from {t: 2, n: 6}. Give prob of sequence tnt. 1/28 Calculate prob of sequence lloo when four letters picked without replacement from booblolloobbo. 3/286 Three letters picked without replacement from lrqqqrrlkklleekllql. Give prob of sequence elq. 28/2907 Two letters picked without replacement from {z: 1, p: 1, e: 1, v: 2}. What is prob of sequence vp? 1/10 What is prob of sequence uhhu when four letters picked without replacement from {u: 6, h: 7}? 21/286 Calculate prob of sequence rd when two letters picked without replacement from drjr. 1/6 Three letters picked without replacement from mmmdmmddmmmmmmmmdmmm. What is prob of sequence mmd? 8/57 Calculate prob of sequence hb when two letters picked without replacement from {b: 3, u: 2, h: 10}. 1/7 Three letters picked without replacement from {m: 7, d: 7}. Give prob of sequence mdd. 7/52 Calculate prob of sequence rr when two letters picked without replacement from {c: 7, r: 2}. 1/36 Calculate prob of sequence msu when three letters picked without replacement from sum. 1/6 Three letters picked without replacement from {w: 1, j: 7}. What is prob of sequence jjw? 1/8 Three letters picked without replacement from {e: 2, z: 2, a: 1, o: 1, t: 1}. Give prob of sequence tez. 2/105 What is prob of sequence gj when two letters picked without replacement from {j: 1, g: 4, x: 2}? 2/21 Calculate prob of sequence jzj when three letters picked without replacement from {t: 4, z: 5, j: 8}. 7/102 Four letters picked without replacement from {e: 2, g: 3, n: 1, i: 3, f: 5, y: 1}. Give prob of sequence gneg. 1/2730 Two letters picked without replacement from {b: 5, m: 3, d: 4}. Give prob of sequence mb. 5/44 What is prob of sequence ayy when three letters picked without replacement from uyuyurrnmyryauuu? 1/280 Three letters picked without replacement from {g: 8, k: 1, y: 4}. Give prob of sequence ygk. 8/429 What is prob of sequence my when two letters picked without replacement from nncnucmuugyyc? 1/78 Four letters picked without replacement from {z: 6, y: 13}. Give prob of sequence zzyz. 65/3876 What is prob of sequence rrr when three letters picked without replacement from {r: 5}? 1 Calculate prob of sequence hoh when three letters picked without replacement from ohhhouuouoh. 8/165 Four letters picked without replacement from qnngqnnrunngnmgnu. What is prob of sequence nrgm? 1/2380 Calculate prob of sequence cn when two letters picked without replacement from {n: 1, c: 3, s: 3}. 1/14 Calculate prob of sequence gy when two letters picked without replacement from {g: 2, x: 8, w: 2, y: 2, b: 1}. 2/105 What is prob of sequence ah when two letters picked without replacement from ahjtaja? 1/14 Calculate prob of sequence jdjj when four letters picked without replacement from {j: 4, d: 7}. 7/330 Four letters picked without replacement from yxxxyykkkyyykxxyy. Give prob of sequence xxky. 4/357 What is prob of sequence xmhm when four letters picked without replacement from hmxmmxhx? 3/140 Calculate prob of sequence pb when two letters picked without replacement from poirb. 1/20 Three letters picked without replacement from sasmmssssassssos. Give	{ "pile_set_name": "DM Mathematics" }
er when 455 is divided by 59. 42 Calculate the remainder when 3607 is divided by 240. 7 Calculate the remainder when 171 is divided by 50. 21 What is the remainder when 263 is divided by 86? 5 What is the remainder when 1015 is divided by 100? 15 What is the remainder when 1319 is divided by 95? 84 What is the remainder when 824 is divided by 162? 14 What is the remainder when 195 is divided by 73? 49 What is the remainder when 280 is divided by 57? 52 Calculate the remainder when 815 is divided by 71. 34 Calculate the remainder when 591 is divided by 85. 81 Calculate the remainder when 94 is divided by 19. 18 What is the remainder when 102 is divided by 27? 21 What is the remainder when 2935 is divided by 70? 65 What is the remainder when 2571 is divided by 112? 107 What is the remainder when 6438 is divided by 20? 18 Calculate the remainder when 343 is divided by 114. 1 Calculate the remainder when 171 is divided by 76. 19 Calculate the remainder when 230 is divided by 95. 40 Calculate the remainder when 1687 is divided by 421. 3 Calculate the remainder when 1327 is divided by 184. 39 What is the remainder when 300 is divided by 64? 44 What is the remainder when 1086 is divided by 35? 1 Calculate the remainder when 591 is divided by 25. 16 What is the remainder when 74 is divided by 47? 27 What is the remainder when 14 is divided by 14? 0 Calculate the remainder when 730 is divided by 31. 17 Calculate the remainder when 980 is divided by 79. 32 What is the remainder when 152 is divided by 41? 29 Calculate the remainder when 206 is divided by 59. 29 What is the remainder when 3807 is divided by 67? 55 Calculate the remainder when 3117 is divided by 94. 15 What is the remainder when 2811 is divided by 42? 39 Calculate the remainder when 81 is divided by 55. 26 Calculate the remainder when 9685 is divided by 27. 19 Calculate the remainder when 215 is divided by 24. 23 Calculate the remainder when 1001 is divided by 200. 1 What is the remainder when 1021 is divided by 64? 61 Calculate the remainder when 389 is divided by 126. 11 What is the remainder when 399 is divided by 5? 4 What is the remainder when 249 is divided by 90? 69 Calculate the remainder when 510 is divided by 53. 33 Calculate the remainder when 421 is divided by 53. 50 Calculate the remainder when 7465 is divided by 97. 93 What is the remainder when 177 is divided by 45? 42 What is the remainder when 630 is divided by 228? 174 Calculate the remainder when 3209 is divided by 531. 23 Calculate the remainder when 238 is divided by 83. 72 What is the remainder when 70 is divided by 21? 7 Calculate the remainder when 2567 is divided by 198. 191 What is the remainder when 4866 is divided by 157? 156 Calculate the remainder when 82 is divided by 5. 2 Calculate the remainder when 163 is divided by 120. 43 What is the remainder when 46 is divided by 6? 4 Calculate the remainder when 2918 is divided by 21. 20 What is the remainder when 1313 is divided by 29? 8 Calculate the remainder when 31 is divided by 9. 4 What is the remainder when 203 is divided by 32? 11 Calculate the remainder when 1872 is divided by 5. 2 Calculate the remainder when 272 is divided by 143. 129 Calculate the remainder when 95 is divided by 49. 46 Calculate the remainder when 13277 is divided by 10. 7 Calculate the remainder when 204 is divided by 14. 8 Calculate the remainder when 413 is divided by 131. 20 What is the remainder when 410 is divided by 125? 35 What is the remainder when 404 is divided by 37? 34 What is the remainder when 164 is divided by 58? 48 Calculate the remainder when 58 is divided by 19. 1 Calculate the remainder when 235 is divided by 17. 14 What is the remainder when 1184 is divided by 15? 14 Calculate the remainder when 853 is divided by 107. 104 What is the remainder when 28 is divided by 22? 6 Calculate the remainder when 937 is divided by 119. 104 Calculate the remainder when 79 is divided by 27. 25 Calculate the remainder when 129 is divided by 44. 41 What is the remainder when 5979 is divided by 105? 99 What is the remainder when 328 is divided by 66? 64 Calculate the remainder when 368 is divided by 182. 4 What is the remainder when 2813 is divided by 200? 13 Calculate the remainder when 994 is divided by 44. 26 Calculate the remainder when 41 is divided by 9. 5 What is the remainder when 674 is divided by 114? 104 Calculate the remainder when 232 is divided by 26. 24 Calculate the remainder when 2855 is divided by 946. 17 Calculate the remainder when 4371 is divided by 81. 78 Calculate the remainder when 106 is divided by 102. 4 What is the remainder when 1409 is divided by 692? 25 Calculate the remainder when 7121 is divided by 17. 15 Calculate the remainder when 11396 is divided by 25. 21 What is the remainder when 1716 is divided by 52? 0 What is the remainder when 207 is divided by 86? 35 Calculate the remainder when 123 is divided by 39. 6 What is the remainder when 581 is divided by 205? 171 Calculate the remainder when 2146 is divided by 50. 46 What is the remainder when 199 is divided by 20? 19 What is the remainder when 479 is divided by 20? 19 Calculate the remainder when 148 is divided by 50. 48 Calculate the remainder when 230 is divided by 34. 26 What is the remainder when 250 is divided by 37? 28 What is the remainder when 1311 is divided by 434? 9 What is the remainder when 1407 is divided by 287? 259 Calculate the remainder when 549 is divided by 267. 15 What is the remainder when 3035 is divided by 40? 35 Calculate the remainder when 1012 is divided by 102. 94 What is the remainder when 483 is divided by 61? 56 Calculate the remainder when 113 is divided by 23. 21 What is the remainder when 1214 is divided by 76? 74 Calculate the remainder when 921 is divided by 42. 39 Calculate the remainder when 1319 is divided by 15. 14 What is the remainder when 44 is divided by 34? 10 Calculate the remainder when 1197 is divided by 323. 228 What is the remainder when 3202 is divided by 89? 87 What is the remainder when 740 is divided by 9? 2 Calculate the remainder when 486 is divided by 24. 6 What is the remainder when 484 is divided by 96? 4 What is the remainder when 799 is divided by 399? 1 What is the remainder when 116 is divided by 59? 57 What is the remainder when 1093 is divided by 58? 49 What is the remainder when 244 is divided by 2? 0 What is the remainder when 251 is divided by 63? 62 Calculate the remainder when 82 is divided by 49. 33 What is the remainder when 361 is divided by 88? 9 Calculate the remainder when 662 is divided by 396. 266 Calculate the remainder when 248 is divided by 50. 48 Calculate the remainder when 68 is divided by 21. 5 Calculate the remainder when 1765 is divided by 31. 29 Calculate the remainder when 1262 is divided by 159. 149 What is the remainder when 221 is divided by 42? 11 What is the remainder when 365 is divided by 93? 86 What is the remainder when 447 is divided by 223? 1 What is the remainder when 133 is divided by 53? 27 Calculate the remainder when 247 is divided by 31. 30 Calculate the remainder when 103 is divided by 22. 15 What is the remainder when 70 is divided by 19? 13 Calculate the remainder when 641 is divided by 86. 39 Calculate the remainder when 74 is divided by 25. 24 Calculate the remainder when 1994 is divided by 29. 22 Calculate the remainder when 1194 is divided by 9. 6 Calculate the remainder when 159 is divided by 32. 31 What is the remainder when 97 is divided by 18? 7 What is the remainder when 6964 is divided by 54? 52 What is the remainder when 525 is divided by 86? 9 Calculate the remainder when 354 is divided by 348. 6 What is the remainder when 407 is divided by 34? 33 Calculate the remainder when 597 is divided by 59. 7 What is the remainder when 2380 is divided by 16? 12 What is the remainder when 163 is divided by 54? 1 What is the remainder when 388 is divided by 65? 63 What is the remainder when 237 is divided by 49? 41 Calculate the remainder when 197 is divided by 45. 17 What is the remainder when 7316 is divided by 13? 10 What is the remainder when 530 is divided by 20? 10 Calculate the remainder when 525 is divided by 15. 0 Calculate the remainder when 125 is divided by 48. 29 What is the	{ "pile_set_name": "DM Mathematics" }
emainder when 4/(-18) + i/9 is divided by q? 7 Let r(i) = 32i2 + 4i + 3. Calculate the remainder when r(-1) is divided by 8. 7 What is the remainder when 956/28 - (-2)/(-14) is divided by 12? 10 Suppose 5q + 15 = 8q. Suppose 394 = qz + h, -4z + 0h = -h - 317. What is the remainder when z is divided by 27? 25 Let m(q) = q3 - q2 + q - 12. Let y(r) = -1. Let t(i) = -m(i) - 3y(i). Let n be t(0). Suppose -a + 19 = -n. What is the remainder when a is divided by 18? 16 Let q = -29 + 23. Let l(p) = 2p - 6. What is the remainder when (-42)/(-4) + 3/q is divided by l(6)? 4 Suppose 3z = 3i + 39, 0 = -i - 4z + 1 - 4. Let n = i - -23. What is the remainder when 23 is divided by n? 11 Let l = -8 - -11. Suppose s + ln = 20, -2n - 2 = -12. Let j = -21 - -30. Calculate the remainder when j is divided by s. 4 Suppose -i + m + 11 + 15 = 0, i - 36 = -4m. Let b = 10 + -18. Let d = 18 + b. Calculate the remainder when i is divided by d. 8 What is the remainder when 57 is divided by 17 - 0 - ((-40)/4 - -6)? 15 Let v(a) = -2a + 2. Let j(q) = -q*3 - 18q*2 - 2q - 30. Calculate the remainder when v(-4) is divided by j(-18). 4 Let f = 16 + -11. Suppose 0 = -3p + 1 + f. Suppose 0 = -3q - j + 184 - 54, -q = -pj - 55. Calculate the remainder when q is divided by 12. 9 Suppose -4h = -458 + 146. Calculate the remainder when h is divided by 20. 18 Suppose 0y + 31 = 3y + l, -4l - 80 = -5y. Calculate the remainder when 47 is divided by y. 11 Let z(q) = q - 3. Let x be z(8). Calculate the remainder when 714/15 + (-3)/x is divided by 12. 11 Suppose 3g - 2 = 4g, -4r = -4g - 8. Suppose -2o + 4 + 24 = r. Calculate the remainder when 53 is divided by o. 11 Suppose 0 = 7f - 3f - 80. Suppose y = -0y + 59. Suppose -3z + y = -2z. Calculate the remainder when z is divided by f. 19 Let k be ((-12)/(-8))/(-1)-2. Suppose 2n - 56 = -3j + 19, -kj + n + 66 = 0. Calculate the remainder when j is divided by 6. 5 Suppose -r = -2v - 1, -5v - 5 = -2r - 0. Let u = r - 4. What is the remainder when 2/9 - 115/u is divided by 7? 6 Let z(p) = -p3 + 8p*2 + 5p + 2. Let m = 44 - 22. What is the remainder when z(8) is divided by m? 20 Suppose -1 - 7 = 4z, -4z - 260 = -4t. Suppose -t = -2r - r. Calculate the remainder when r is divided by 11. 10 Suppose 0 = 2g + 3g - 185. What is the remainder when g is divided by 13? 11 Suppose h = 2h - 7. Suppose -r + 2r - h = 0. Suppose -5c + 12 = -8. What is the remainder when r is divided by c? 3 Let a = -12 - -20. Let n be (-303)/(-12) - 2/a. Calculate the remainder when n + 2/2 - 0 is divided by 7. 5 Let m(c) = c2 + 4c - 5. Let j be m(-6). Let o = 4 - j. Let i = 7 + o. What is the remainder when i is divided by 3? 1 Suppose -80 = w - 3w. What is the remainder when w is divided by 26? 14 Suppose 2s - 7s - 40 = 0. Let w = s + 15. What is the remainder when 19 is divided by w? 5 Suppose -n - 2n - 2 = 2t, -3n = 12. Suppose tz + 26 = 3i - 0i, -4z = -2i + 18. Calculate the remainder when 19 is divided by i. 5 Suppose -22 = -5u + 28. Calculate the remainder when (-5)/((-20)/88) - 3 is divided by u. 9 Suppose -4m + 61 = -5x - 48, -3m - 5x + 38 = 0. Calculate the remainder when 83 is divided by m. 20 Suppose 16 = -4b, 2w + 10 = 3w - 2b. Suppose -4 - 2 = -wr. Suppose ru - 7 = 2u. Calculate the remainder when u is divided by 2. 1 Let f(p) = -p3 + 19p*2 - 19p + 49. Calculate the remainder when 84 is divided by f(18). 22 Let t(d) = d*3 + 12d*2 + 15d - 10. What is the remainder when t(-9) is divided by 11? 10 Let m be 34(-1)/2 - -2. Calculate the remainder when 6 is divided by 44/10 - (-6)/m. 2 Let p(w) = -w2 + 4w + 5. Let g be p(5). Calculate the remainder when 44 is divided by (g - 3) + 0 + 26. 21 Let w = 299 - 443. Suppose 2x + 189 = -5c, -309 = 2x + x - c. Let q = x - w. What is the remainder when q is divided by 15? 12 Let f(z) = 3z*2 - z - 3. Let o be f(4). Suppose -3u + o = k, -8u + 68 = -4u + 4k. What is the remainder when 35 is divided by u? 11 Suppose -5m = -2m - 2t + 12, 4m + 18 = 2t. Let y(n) = -3n - 9. Let w(q) = 9q - 1. Calculate the remainder when w(2) is divided by y(m). 8 Suppose 5b - l - 150 = -0l, 25 = -5l. Let q = 47 - b. Suppose -8z + 212 = -4z. Calculate the remainder when z is divided by q. 17 Calculate the remainder when ((-6)/(-9))/((-4)/(-1 + -203)) is divided by 5. 4 Let h = -25 + 29. What is the remainder when 14 is divided by h? 2 Let g(s) = -1 + 4s*2 - 2 + 4. Suppose 2i = -3k - 14, 2i = -4k + i - 12. Calculate the remainder when g(k) is divided by 9. 8 Let d be (120 - -10)2/(-5). Let t = -36 - d. What is the remainder when 29 is divided by t? 13 Suppose -q + 0q = -9. Let s(o) = 16o. Suppose 4 = -4g + 8g. What is the remainder when s(g) is divided by q? 7 Suppose -54 = -7t + 4t. Let m = t - -2. Calculate the remainder when 58 is divided by m. 18 Suppose 11l + 150 = 16l. What is the remainder when l is divided by 14? 2 Suppose 0 = 4l - 4w - 92, -w + 2w - 55 = -2l. Suppose -5z + l = -39. Calculate the remainder when 37 is divided by z. 11 Let n = 35 - -14. What is the remainder when n is divided by 25? 24 Suppose 0 = 4g - 4f - 24, -4g - 3f + 5f + 30 = 0. Let j be (7/(-21))/((-2)/12). Calculate the remainder when 255/10 + j/4 is divided by g. 8 Let t = -2 - -6. Calculate the remainder when 163/t - (-2)/8 is divided by 42/4(-12)/(-9). 13 Suppose 6u + 2g = 2u + 78, 3u - 3g - 63 = 0. What is the remainder when 56 is divided by u? 16 Let w(h) = -9h + 1. Let q be w(1). Let v = -6 - q. Suppose 2a - 10 = -0a. Calculate the remainder when a is divided by v. 1 Let m(v) = -v3 - 9v*2 - 7v + 10. Let d be m(-8). Suppose -dz + 2 = -2. Let c = -7 + 10. Calculate the remainder when c is divided by z. 1 Let v(h) be the first derivative of h3 - 4h*2 + 4h + 10. Calculate the remainder when 78 is divided by v(4). 18 Let w = -4 - -7. Suppose 0 = -wh - 2 - 1. What is the remainder when ((32 - 1)h)/(-1) is divided by 11? 9 Let j = -2 - -6. Suppose -jr = -6r + 52. Calculate the remainder when 103 is divided by r. 25 Suppose 5l - 2x - 18 = 0, l + l - 2x = 6. Let t(q) = 2q*2 - 2q + 2. Calculate the remainder when t(l) is divided by 14. 12 Let o(b) = -9b + 3 + 80b - 2. Let p be o(1). Suppose -p = -2u + 5x, 4u - 6x + x = 124. Calculate the remainder when u is divided by 9. 8 Let s(b) = -b*2 - 5b - 3. Let n be s(-3). Suppose 3p - 33 = 5l, 33 = np + 7l - 3l. Calculate the remainder when 41 is divided by p. 8 Let r = 52 - 43. Calculate the remainder when 13 is divided by r. 4 Suppose 2k - 36 = -2. Calculate the remainder when 99 is divided by k. 14 Let v(u) = 9u2 - 3u - 1. What is the remainder when v(3) is divided by 25? 21 Let n be (1 + 8)1/3. What is the remainder when 1001/21 - 2/n is divided by 25? 22 Let h = 44 + -12. What is the remainder when 93 is divided by h? 29 Let g = 17 - -42. Suppose -c + 2v + 5 + 10 = 0, 0 = -5v. What is the remainder when g is divided by c? 14 Let j = -149 + 150. Let n be 0 + 2 - (-5)/5. Suppose -3v = -b - 9, -2 = nv - 14. What is the remainder when b is divided by j? 0 Let p(d) be the first derivative of -2d3/3 - d2/2 + 2d - 1. Let a(i) be the first derivative of p(i). What is the remainder when 4 is divided by a(-1)? 1 Suppose -8l - 31 + 319 = 0. Calculate the remainder when 140 is divided by l. 32 Let y(c) = 6c2 + 3c. Suppose -4j + 6j + 4 = 0. Let n be y(j). What is the remainder when 4/(-6)(-459)/n is divided by 5? 2 What is the remainder when (-7)/(-42)-3 - (-39)/6 is divided by (-3)/(-1 - (1 + -1))? 0 Let z = 17 - 12. Let f = z - -14. Calculate the remainder when 37 is divided by f. 18 Let v(m) = m*3 - 6m*2 + 3m + 2. Let k = 9 + -5. Suppose ki - 130 - 106 = 0. What is the remainder when i is divided by v(6)? 19 Let y = 83 + -58. Calculate the remainder when y is divided by 18. 7 Suppose 0 = 3y + 5l - 8, 2y - 5l + 22 + 6 = 0. Let t be (y/6)/(3/18). Let w(u) = -u3 - 4u2 - u - 1. What is the remainder when w(t) is divided by 3? 0 Let z(s) = s3 + 7s2 - 3s - 1. Let u be z(-7). Suppose 18 = 2f + 5x, f + 4x = 7x + u. Calculate the remainder when f is divided by 4. 2 Suppose -5c + 3c = 4d - 56, -56 = -4d + 5*c.	{ "pile_set_name": "DM Mathematics" }
d*6 + 35d*2 - 620986d wrt d. -9247944600d3 Find the first derivative of -2c*3t - 874763763c3 + 4387t*3 + 490t*2 wrt t. -2c*3 + 13161t*2 + 980t What is the first derivative of 2374068q4 + 3q - 31370360 wrt q? 9496272q3 + 3 Differentiate -367580295h*3 + 46516163. -1102740885h*2 Find the second derivative of 7054k*3 - 418k*2 + 16066321k wrt k. 42324k - 836 What is the third derivative of -259g*2l*3 + 2g*2l*2m + 127gl*3m + 2gl*2m + 116065gl*2 + 4gl - 9gm - 28l*3m - 2 wrt l? -1554g2 + 762gm - 168m Differentiate -1626692v2 + 5201754 wrt v. -3253384v Find the third derivative of 4o4u + o*3u - 114838o3 - 4o*2u - 7o2 + 13504ou + 2o - 2u wrt o. 96ou + 6u - 689028 Find the third derivative of -3z5 - 29738z*4 + 1887585z*2. -180z*2 - 713712z What is the derivative of -129502194l3 + 149513219? -388506582l*2 What is the second derivative of -159875893g*2z - 25792g + 26z + 6 wrt g? -319751786z Find the first derivative of 901026830v - 571070875 wrt v. 901026830 What is the derivative of 2b3f + 230b3n + 218b2f*3 - 451bf3n + 9bf + 4fn + 258f wrt n? 230b*3 - 451bf3 + 4f What is the third derivative of -34416816y4 - 4893y*2 - 4429? -826003584y Find the first derivative of 647707y2 + 177y - 372473768. 1295414y + 177 What is the second derivative of 1454910d*4 + 4d*3 - 7969364d wrt d? 17458920d2 + 24d What is the second derivative of 2456205t5 - 8t*2 - 19t + 1782495? 49124100t3 - 16 Differentiate ioz - 2io - 721i - 1675oz + 28o + 224z wrt o. iz - 2i - 1675z + 28 Find the second derivative of -1928l*4 - 9707l*3 - 2l*2 - 738930839l. -23136l2 - 58242l - 4 What is the first derivative of ap2t - ap2 + 78162ap - a - 230p*2t + p*2 - 2pt + t + 700 wrt a? p2t - p*2 + 78162p - 1 Find the third derivative of -d*5 - 160d*4 + 5725d*3 - 9511606d*2 wrt d. -60d*2 - 3840d + 34350 Find the second derivative of -468152777f3 - 605144374f. -2808916662f Find the third derivative of 85766054m4 - m2 + 39m + 239855 wrt m. 2058385296m What is the third derivative of 2d5g - 5989903d3g2 + d2g2 + 2d*2 - 205196dg2 + 2d wrt d? 120d2g - 35939418g2 What is the second derivative of -147274j*3 + 57j*2 + 52307775j wrt j? -883644j + 114 Differentiate -530807t*3 + 22t*2 - 14684645 wrt t. -1592421t*2 + 44t What is the first derivative of -7332462i + 6038849? -7332462 Find the second derivative of 556t*4 - 72t*3 - 7t - 109828. 6672t2 - 432t Find the first derivative of 3lu*3 + 4lu2 + 7lu + 412560l - 250075293u3 wrt l. 3u*3 + 4u*2 + 7u + 412560 What is the second derivative of -620375099ru*2 + 1933ru - 47376r + 2u wrt u? -1240750198r What is the second derivative of 3o2vz - 123o*2z2 + o2 - 7ov*2 + oz + 1314v2z*2 - 158v*2z + 8z2 - 11 wrt z? -246o*2 + 2628v*2 + 16 What is the second derivative of 33834324z*3 - 97008438z wrt z? 203005944z Find the first derivative of -m3 + 6239m*2 + 381m + 55168130 wrt m. -3m2 + 12478m + 381 What is the third derivative of -13092190z3 + z2 - 100z - 12050? -78553140 What is the second derivative of -2c2q*2 + 9c*2qx + 2cqx*2 - 3cqx - c - 68q2x*2 + 13905q*2x + qx + 7q wrt q? -4c2 - 136x*2 + 27810x What is the first derivative of -28107190i4 - 967433589? -112428760i*3 What is the second derivative of -3ag2x + 180ax*3 - 416a - 17g2x*2 + 2g*2x + 6g2 + 9x*3 + 18 wrt x? 1080ax - 34g*2 + 54x Find the first derivative of 165997563l + 364758427. 165997563 Differentiate -22159h*2w2 - h2 - 32hw*2 + 12334810w*2 wrt h. -44318hw2 - 2h - 32w2 Differentiate -5530900q*2v + 8174q2 - 343q with respect to v. -5530900q2 Find the second derivative of 1141h*5 - 58h*4 + 10h*2 - 337613h + 40 wrt h. 22820h3 - 696h*2 + 20 Find the second derivative of 1015p*3 + 84581p*2 - 19195575p + 4. 6090p + 169162 Find the third derivative of 19a*4 + 3045573a*3 + 16a*2 - 1640740. 456a + 18273438 What is the second derivative of 64124631c2 - 64341403c wrt c? 128249262 What is the third derivative of 21633o3p*2 - 706o*3p - 4o3 + 703o*2p*2 - 1698o*2 + op + 2o + 2p - 6 wrt o? 129798p2 - 4236p - 24 What is the derivative of p*3 - 3p*2 + 136640001p + 716556061 wrt p? 3p2 - 6p + 136640001 What is the derivative of 13fg*3 - 16fg2 - 88fgi*2 - 3f - 283640g3i*2 + 2g*3 - 3g + 635 wrt i? -176fgi - 567280g*3i What is the derivative of 13p2x*2 + 396891p*2 + px*2 + 53579129x*2 wrt p? 26px2 + 793782p + x*2 Differentiate -21n*4 - 2045121n*2 - 640671081 wrt n. -84n*3 - 4090242n What is the second derivative of bh4 - 36bh + 18363b - 6391218h5 - 1 wrt h? 12bh2 - 127824360h*3 Find the second derivative of 7404f*2r + 1258f2 + 25558fr - f + 38 wrt f. 14808r + 2516 What is the second derivative of -11507145v4 - 2v*3 + 7718374v + 31 wrt v? -138085740v2 - 12v Find the third derivative of 28648685b5 - b2 + 116873 wrt b. 1718921100b*2 What is the derivative of 2c*2l - 2c2 + 60cl + 151632c + 7855l + 20 wrt l? 2c*2 + 60c + 7855 Find the third derivative of 2898206v3z*2 - 28v*2z*2 - 8v*2z + z*2 - 2z + 8 wrt v. 17389236z2 What is the third derivative of 2d*4u + 11136736d3 + 2d*2u + 897d2 - 6498 wrt d? 48du + 66820416 What is the third derivative of -94364v*4 + 420v*3 + 66v*2 - 67v + 1222? -2264736v + 2520 What is the second derivative of -66580707x*2 + 1199173x - 34 wrt x? -133161414 Find the second derivative of 15349746z3 + 40599127z wrt z. 92098476z Find the third derivative of -5os3u*3 - 78os2 - 10osu*3 + 559ou3 - 15064391s*3u*3 wrt s. -30ou3 - 90386346u*3 Differentiate 48847858b*3 - 13359564. 146543574b*2 Find the second derivative of -60999241w*4 + 57w + 176132. -731990892w2 What is the derivative of -486057l*3q + l*3 - lq - 3086542l + 2q wrt q? -486057l3 - l + 2 What is the first derivative of 82890712m*3 - 64782955? 248672136m*2 Find the first derivative of 83077341l*2 - 1140274572. 166154682l What is the third derivative of -11950394b4 + 6b*3 + 19b*2 - b - 2250855? -286809456b + 36 Find the second derivative of 542756w4 + 55w3 + w2 + 130170873w wrt w. 6513072w*2 + 330w + 2 Differentiate 35968101t2 - 2t + 47856494 wrt t. 71936202t - 2 Find the second derivative of -109528085b*4r + 109939br + 53 wrt b. -1314337020b2r Find the first derivative of 25442283x - 174233386 wrt x. 25442283 What is the third derivative of 11080716h*3i*2 - 2h*2i*2 + 12h*2i - 52h2 - 751hi2 wrt h? 66484296i*2 Differentiate 1012214855sw - 700s + 182357 with respect to w. 1012214855s Find the second derivative of 356f*3pz + f2pz3 - 2112f*2p + 2575fp + 6pz - 229z3 wrt f. 2136fpz + 2pz*3 - 4224p Find the first derivative of -26l3n - 2l3 - 122065l*2n*2 - 22369l*2 - 57 wrt n. -26l*3 - 244130l*2n What is the second derivative of -7273m4 - 2m*3 - 86m*2 - 4m + 926877 wrt m? -87276m2 - 12m - 172 Find the first derivative of 2jls + 303jl - 2js2 - 10ls2 - 1661l - 483136s2 - 24s wrt l. 2js + 303j - 10s*2 - 1661 Find the third derivative of -4n*5 + 12032515n*4 + 197990370n*2 wrt n. -240n*2 + 288780360n What is the second derivative of -20042787a5 - 32454519a? -400855740a3 What is the third derivative of -38n*3x3 - n3x2 - 55n*3 + 166n*2x3 + n2x2 - n2x + n + 44x3 + 32492x*2 wrt x? -228n*3 + 996n*2 + 264 Find the third derivative of 168516009g3 - g2 - 4109232g + 3. 1011096054 What is the first derivative of 2mt2 - 53073mtx - 68m - 38t*3x - 380t3 + 2t wrt x? -53073mt - 38t3 Find the first derivative of 39418829n*2 + 73891 wrt n. 78837658n Find the second derivative of 99192993w2 + 14936013w wrt w. 198385986 Find the second derivative of -682894	{ "pile_set_name": "DM Mathematics" }
t 1? True Let u = 221 + -221.2. Which is smaller: 10 or u? u Let p(u) = u*3. Let n be p(2). Let k be n/(-28) - 136/14. Suppose a + j + 6 = 0, a + 5j = 2 + 4. Which is bigger: k or a? a Let a(d) = -d - 2. Let g(v) = 3v + 5. Let b(j) = -8a(j) - 3g(j). Let x be 82(-3)/(-8). Let k be b(x). Is k less than -6? False Let x be 10/(-4)2 + 1. Let j = x + 0. Suppose -3f + 32 = -5t, 2f - 28 = -0t + 5t. Is j != t? False Let d = -23.8 - -24. Let q = 0.1 - d. Let n = -3/5 + 29/15. Which is smaller: q or n? q Let j(h) = 5h*2 + h - 2. Let g be j(1). Suppose -11 = r - gn, r - 6r - 33 = 2n. Suppose 2p + 35 = -5z, z + 35 = -4z + 2p. Is r >= z? True Suppose 0 = 2b + 3f + 6, 5b + 3f = 2b - 6. Let t be b/((-1)/(-3 - -3 - -1)). Is t >= 1/2? False Let l(b) = b2 - 11b + 12. Let m be l(10). Suppose -mv = v - v. Is 2/5 not equal to v? True Let w be (-1)/((3/(-40))/(1674/(-2015))). Which is smaller: -11 or w? w Let y = -5/81 + -2501/162. Which is bigger: y or -16? y Let a(g) = -2g - 5. Let y(v) = -3v - 5. Let u(x) = 4a(x) - 3y(x). Let c be u(-3). Is -8 at most c? True Let l = -6527/14 + 466. Let r(y) = -y3 - 17y*2 - 16y + 1. Let u be r(-16). Which is bigger: l or u? u Let n = -183 - -186. Is n greater than 31? False Let y = -20.3 + 20.4. Which is bigger: y or 14/3? 14/3 Let y = 0.8 + 0. Let t = y + -0.9. Is -40 >= t? False Let i be -4 - (3/(-6) + (-5)/2). Which is smaller: -1/7 or i? i Suppose -5 = 3p + y - 7, -2y = 3p - 1. Are p and 36/53 unequal? True Let k be ((-5)/(-3))/((-42)/(-1386)). Is k less than or equal to 54? False Suppose -35w + 5u - 16 = -34w, 10 = -w + 3u. Is -1/32 less than or equal to w? False Let j be 595/(-1198) + (-9)/(-18). Are 0 and j non-equal? True Let o = -241 + 242. Suppose -2y = -5y + 21. Which is greater: o or y? y Let q = -1626 - -13011/8. Which is smaller: 7 or q? q Let c = 15.7 - -2.3. Let g = c - 10. Let r = g + -14. Is 1 > r? True Let q be ((-3)/(-5))/(15/(-75)148). Are q and 0 non-equal? True Suppose 0 = -5o + 3y + 95, -2o + y = 2y - 49. Let g = 12 + o. Let i be 2 + -5 - (-106)/g. Are i and 0.1 equal? False Suppose 2s + 41 = -3f, s = -3s + 2f - 122. Let z be (6/s)/((-6)/7). Which is greater: z or 0.2? z Let i = 1057/3 - 352. Which is greater: -5.79 or i? i Let b be 138/(-217) + 24/42. Which is bigger: -0.9 or b? b Let b be (10/(-70)7)/(-311). Which is bigger: -1 or b? b Let a be (-1 + 15/10)12. Let o be ((120/(-18))/10)/((-4)/a). Which is smaller: -3/58 or o? -3/58 Suppose -k - 4w - 12 = 0, -2k - 6 = -0w + 2w. Are k and -4/41 non-equal? True Suppose 50 = 6b - 358. Is 68 >= b? True Let q = 5 + -7. Suppose -5l = -2l - 12. Let h be (-23)/10 - (-6)/l. Is q > h? False Let q = 191/21 + -66/7. Which is bigger: 1.03 or q? 1.03 Suppose 3s = 5s - 30. Suppose 3a - 67 = -3j + 74, 3j = -s. Let h be (-3)/2 + 94/a. Is 1 not equal to h? True Let l(d) = -d*2 - 6d. Let q(a) = -a - 16. Let c be q(-11). Let p be l(c). Let w be ((-1)/p)/((-1)/2). Which is smaller: 3 or w? w Suppose 4t + 76 = -0t. Let g(q) = q*3 + 6q*2 - 4q. Let p be g(-6). Let m be t + 15 - p-1. Which is smaller: 19 or m? 19 Let l(x) = 2x + 4. Let i(t) = 1. Let k(p) = -i(p) - l(p). Let s be k(-9). Is s at least 11? True Let w = -290 - -290.117. Let l = w - 2.117. Is l >= 4/15? False Let a = -39 + -65. Let b = 103 + a. Which is bigger: 4/5 or b? 4/5 Let r = 266 - 259. Are r and 12 equal? False Let b = -306 - -303. Which is smaller: b or -0.05? b Let h(b) = 3b2 - 2b + 3. Let l be h(2). Let j = l + -9. Suppose -5 = -ja - 3. Do 1/30 and a have the same value? False Suppose 32t = 79t + 188. Which is smaller: -231 or t? -231 Let r = 2773/178437 - 5/879. Is -1 greater than r? False Let a = 492637/8981 - -5/1283. Which is greater: a or 55? 55 Suppose 26g - 22g = -8. Let s be (-992)/112 + g/14. Which is greater: s or -10? s Let t be (-6)/(-57) + 2563/1463. Which is greater: -5 or t? t Let q(c) = -c3 - 5c*2 + 18c - 35. Let d be q(-8). Suppose -5 = -3f - 2b, 4b = f - 0f + 17. Is d at least f? True Let z(i) be the third derivative of i4/12 + i3/3 + 6i2. Let q be z(-8). Let n = q + 25. Which is greater: 10 or n? n Let b(i) = -4 + 2i - 7i + 5. Let n be b(1). Let p = 92 + -98. Is n >= p? True Let p = 32 - 29.7. Let h = p - 4.1. Do h and 1 have different values? True Let u = -0.0656 - -2.0656. Is 0.279 greater than or equal to u? False Let x = -92 + 65. Let o = x + 41. Let d be (-4)/o - 12/(-189). Which is bigger: d or 1? 1 Suppose -6s - 5i = -4s - 160, 4s - 320 = -3i. Let o be (-6)/27 - s/(-36). Is o at least as big as -0.02? True Let i be -5 - -7 - (-2 + 1). Suppose -7 - 2 = h + 3u, 0 = 4h - 5u - 15. Suppose h = 5o - 1 - 9. Is i equal to o? False Let m = 4 - 3. Let s be 180/(-16) + m/4. Let v be 2/4 - (-69)/(-6). Do s and v have the same value? True Let j = 27 - 25. Let r be (6 - 3) + j + 0. Let g be (1 - 2)(r + -6). Is g less than or equal to 13? True Suppose -y + 3f + f - 26 = 0, -4y + f - 179 = 0. Let j = 13 + y. Is -32 >= j? True Suppose 4a + 5u = -24, -3 + 4 = a + 3u. Let r = -38 - a. Which is greater: -28 or r? r Let l = -110 + 114.7. Let j = -5 + l. Which is greater: j or -0.01? -0.01 Let c be 19 - (25 + -5)/5. Let f be ((-103)/c - (-20)/(-150))-1. Is 9 bigger than f? True Let n(p) = p - 4. Suppose -2m + 2o + 120 = 3m, 3m - 71 = o. Suppose 2l + 3w + 2 = 7w, m = 4l + 5w. Let s be n(l). Is s < 0? True Suppose -4d = -93 + 97. Is d greater than or equal to 3/277? False Let o be -2(60/50)/((-8)/30). Let l be o/(-6)12/45. Is 28 at least as big as l? True Let a be 114(-10)/(-60) - 9. Let d(v) = 6v. Let m(k) = 5k + 1. Let n(w) = -3d(w) + 4m(w). Let z be n(3). Do a and z have different values? False Let d be (1 - -74)/(6 - (-255)/(-40)). Are -801/4 and d equal? False Suppose 2v + 2z - 7z = 235, -122 = -v + 4z. Does v = 109? False Suppose 5u - 3u = 0. Let w be ((-2)/5)/(9/(-720)). Is u greater than or equal to w? False Let x = -10/19 + 205/209. Is -1 greater than x? False Let d(t) = 4t + 7. Let u(j) = -11j - 20. Let o(v) = -17d(v) - 6u(v). Let s be o(-1). Let r be (-2 - -8)/s + -4. Is -2 at least as big as r? True Let r be (0 - 45)48/(-18). Let h be ((-18)/8)/((-5)/r). Let q be (6/5)/(h/180). Is 3 greater than or equal to q? False Suppose 6 = -2k + 2v, -6v = -3k - 5v + 1. Suppose -k = -i + 1. Suppose ig - 4 = -4b + 7, -5g = -25. Is 0 greater than or equal to b? True Let l = 0.84 - -1.16. Let q = -52 - -50. Is q at most as big as l? True Let q(p) = -p2 - 2p + 8. Let d be q(0). Suppose -4m + 4l + d = -2m, 3m + 2 = -l. Let i = 171/905 - -2/181. Is i <= m? False Let n = 762 - 2083. Is n greater than or equal to -1320? False Let u(m) = -11m3 + 4m*2 + 8m + 7. Let y = -4 - 1. Let s(v) = 7v3 - 3v*2 - 5v - 5. Let t(o) = yu(o) - 8s(o). Let r be t(4). Are r and 4 equal? False Let g = -663 - -655. Which is greater: 8 or g? 8 Let w(n) = -n*2 - 39n - 44. Let r be w(-40). Which is smaller: r or -2? r Let j = 126 + -118. Let l be (-11)/((-44)/j) + -9 + -1. Is -8 less than or equal to l? True Let w be (-12)/(-7) + -2 + (-1452)/(-84). Suppose -2i + 4f - w = 17, 3f = -i + 8. Which is smaller: i or -1? i Let q = 156/61 - 25316/549. Which is bigger: q or 0.1? 0.1 Let v(n) = 22n*2 + 15n - 62. Let q be v(4). Which is smaller: q or 349? 349 Suppose l - 16 = y, 5y = -3l + 38 - 134. Let u be (y/45)/(2/40). Which is greater: u or -3? -3 Let h(c) = c*3 - 12c*2 + 2c - 23. Let g be h(12). Is g at least as big as -2? True Let u = 145 + -69. Suppose -5w + 8 = 4g - 0g, -w + 2g = 4. Let k be w - u/28 - -3. Which is greater: 3 or k? 3 Suppose 4w = -12 + 12. Is w equal to -12/13? False Suppose 5g + 19 + 6 = 2q, -3g = 15. Suppose -4t - 5h - 66 = q, -4h - 50 = 4t - t. Let c be (-8)/(-16) - (-3)/t. Which is smaller: c or -0.2? -0.2 Suppose 0 = -4k + 14 + 6. Suppose k = -5t, 0l + 4t - 20 = -3l. Suppose -7j - l = -3j. Is 0.4 at most as big as j? False Let x(c) = -c3 - 9c*2 + 7c - 28. Let d be x(-10). Suppose -q + 67 = 4z - 6q, -dz + q + 29 = 0. Is 10 at most as big as z? True Let y(u) = 3u*2 - 2u*3 + u - 3 + 3u - 2 + u**3. Let o be y(2). Let n = o + -7. Is 2/19 at most n? False Let l = -0.0305 + -0.0895. Is l at least as	{ "pile_set_name": "DM Mathematics" }
6 + 15h + (-1 - 1 + 1)(-4h + 3h + 4h) + 4h + 3h - 11h. 8h + 44 Expand (40 - 4v*2 + 5v*2 - 3v*2)(-2 + 7 + 0 + 2 + 0 + 0 - 4 + 3 - 1 + (-1 + 1 - 1)(-3 + 1 + 0) - 2 + 0 - 1 - 1 + 3 - 1). -10v*2 + 200 Expand (-3160404 + 3160404 - 6z - 249z2 + 4z*3)(z*2 - 2z*2 + 0z*2). -4z*5 + 249z*4 + 6z*3 Expand (270s + 262s - 47s*2 - 532s + 3310s2)(4s2 - 3s*2 - 3s*2). -6526s*4 Expand (-1 + 2 + 1 + (1 + 2 - 5)(-3 + 3 - 2) - 2 - 1 + 5 - 5 + 1 + 2)(2 + 2 - 7)(-8u2 - 10u*2 - 3u*2)(-11 + 11 + u*2). 378u*4 Expand (3i + 0i - i)(6234i + 2346i - 551i - 778i). 14502i2 Expand (-4k + 4k - 5k)(-17615k - 796 + 264 + 17617k). -10k*2 + 2660k Expand (-u*2 - u + u)(3u3 - 150u + 465u2 - 462u*2 - 2u3 + (u2 - 3u2 + 4u*2)(-4u - 2u + 3u)). 5u*5 - 3u*4 + 150u3 Expand (v2 + 2v2 - v2)(-2 + 0 + 9) - 11v2 + 4v*2 + 14v*2 - 90v - 64v. 21v*2 - 154v Expand (269v + 23v*2 - 269v)(5 - 10 + 3v + 7)(-1 + 1 + 3). 207v*3 + 138v2 Expand (o2 - 3o2 + 6o*2)(-257236 + 1138o2 + 1944o*2 + 257236 - 667o*2). 9660o*4 Expand (-2 - 1 - 3)(-m - 2 + 2) - 10m + 17m - 4 - 8m + 5m + 4m - 2m. 12m - 4 Expand (-19o - 522 + 522)(-4o - 3o + 4o)(-5 + 2 - 4). -399o2 Expand (v2 - 5v2 + 2v*2)(-5 - v*3 + 5)(3 - 2 + 1) + (387 - 58v - 387)(2v - 2 + 2)(-5v3 + v3 + 2v*3). 236v*5 Expand (3j*2 - 2 + 5 - 18)(-j + j - 2j2)(-5 - 2 + 5)(-4j - j + 3j). -24j*5 + 120j*3 Expand (-5y + y - 5 + 2y)(-262 + 264y + 262). -528y*2 - 1320y Expand (7 - 20 + 7)(-85 - 4p + 79 + 8p)(-5p + 0p + 3p)(-p*2 + 0p + 0p). -48p*4 + 72p*3 Expand 107v + 16v + 15v + (4 - 5 + 2)(2v + v - 6v). 135v Expand (316 - 2f + 4f + 256)(2f + f - 4f) + 4f - 5f + 3f + f2. -f2 - 570f Expand -22r - 19r4 + 22r + (2r3 - 4r*3 + 3r*3)(3r + 0r - r) - 39r4 - 28r*4 + 21r*4 - 2r*3 + 4r*4 + 2r*3. -59r*4 Expand (-6k + 6k - 2k*3)(0 + 3 - 5) + (-4 - 10 + 15)(-k3 + k3 - k3) + (3k + 2k + k)(k + 5k - 5k)(4k - 3k + k). 15k*3 Expand (4o - 13o3 - 10o + 19o)(-2o - 2o - o)((-3 + 3 + 2)(-2o - 1 + 1) + o + 4o - 4o). -195o*5 + 195o*3 Expand 2m - m + m + 2m + 3m - 3m + (1 + m - 1)(3 + 3 - 4) - m - 1 + 1 - 3m - m + 3m + 3m + 10 - 10 + (-2 - 3 + 4)(-2 + 2 + 2m). 5m Expand (-5y + 0y + 4y)(0y - 2y + 6y) + (-1 + 1 + 2y)(4y - 3y + y) + 0y2 - y2 + 2y2 - 425y*2 - 150y*2 + 56y*2 - 141y*2. -659y*2 Expand -924j4 - 16546 + 16546 + (-j2 - 8j2 + 0j*2)(3j2 + 0j2 - j2). -942j4 Expand (0o*2 + 2o*2 + 0o*2)(4 - 4 - 2o) - 58o*3 - 11 + 9o*3 + 156o*3. 103o*3 - 11 Expand (2f + 254 - 129 + f*2 + 223)(4f2 - 10f*2 - 4f*2). -10f*4 - 20f*3 - 3480f2 Expand r4 + 20r4 - 22r*4 + 30r*3 + (10r*3 + 7r*3 + 16r*3)(0r + r - 2r). -34r4 + 30r3 Expand -n5 - 4n5 + 3n5 + (-n + n - n3)(489n*2 - 49n*2 - 136n*2). -306n*5 Expand (3y*2 - 186y + 93y + 95y)(-68y + 6 - 6) + (-4y + 4y + y)(2y*2 + 3 - 3). -202y*3 - 136y*2 Expand ((4 + 6 - 5)(-3 + 3 + 5d2) + (d2 + 0d*2 + 0d*2)(2 + 3 - 3) + 2d2 + 3d*2 - 4d2 + 1 - 1 - d2)(915 + 965 - 1743). 3699d*2 Expand (-213 + 41i + 213)(9i - 88 - 2i - 6i). 41i2 - 3608i Expand (-1 + 0 - 1)(-1061h - 1051h + 2090h + (0 + 2 - 4)(-6h + 2h - 3h)). 16h Expand (-1 + 2y - 4y + y)(11 - 14y - 11)(-2y - 2 + 2) + 7404y*2 + 22y - 7405y2 - 3y*3 + 2y*3. -29y*3 - 29y*2 + 22y Expand (-7z2 - 2 - z + 7z*2 + 3z*2)(-9492 + 289z + 9492)(1 + 0 + 2). 2601z3 - 867z*2 - 1734z Expand (2115 - 2115 + 530j + 15j)(8 - 8 - 4j). -2180j2 Expand (-8a*2 - 42 + 2a + 42)(38a + 16a - 2a) - a*3 + 0a*3 + 0a*3. -417a*3 + 104a*2 Expand (-47p + 2152 - 2152)((0 + 0 + 2p)(4 - 4 - 1) - 11 - 8 + 27p + 18)(4 - 3 + 0). -1175p*2 + 47p Expand 138319 + b - 68812 - 69015 + (0b + b - 3b)(-2 + 3 + 0). -b + 492 Expand (-6f - 4f - 1 + 17f)(-f - 2847f*2 - 5 + 2845f*2 + 7f). -14f3 + 44f*2 - 41f + 5 Expand -145m + 74m + 56m - 3m + 3m + 3m + (2 - 5 - 1)(2m - 7m + 4m). -8m Expand 63d*4 + 853d*5 + 27d*4 - 86d4 + d4 - d5 - d4 + (-d + 3d - 3d)(-2d*4 + 2d*4 + 2d*4) - 2d5 + d5 + 0d5. 849d*5 + 4d*4 Expand (-3 + c + 3)(-24 + 4 - 8) - 38c + 1 + 47c + 78c. 59c + 1 Expand -2 + 2 - 2q5 + (-2q*4 + 10q*3 - 10q*3)(2q + 2 - 2) - 3550q*4 + 3550q*4 - 171q*5 + 2q*5 + 4 - 4 + 2q*3. -175q*5 + 2q*3 Expand (-5 - 49 + 13 + (5 - 5 + 1)(2 - 6 + 3) + 4 - 1 - 1 + 14 - 5 - 15)(-2q + q - q). 92q Expand 56y*5 - 43 + 43 + (-2y - y + 5y)(-3y2 - y4 + 3y*2) + (5y*3 - 15y*3 + 52y*3)(-5y2 - 2y*2 + 6y*2). 12y*5 Expand (-162 + 226 + 290)(-2 + 1 + 3)(7v3 - v3 - v*3). 3540v*3 Expand (-9576n*2 + n - 6n + 9451n2)(-2n2 + n2 + 0n*2). 125n*4 + 5n*3 Expand (-51h + 33h - 54h)(-5h*2 + 19h*2 - 5h*2 + (-2h + 4h - 3h)(-4h + 5h - 2h)). -720h3 Expand (-5 + 2j + 5)(j - 2j + 3j + (1 - 2 + 7 + (-1 + 3 - 4)(2 + 0 - 1) - 3 + 2 - 1 - 2 + 1 + 0 - 11 + 11 + 125)(5j - 4j + 0j)). 256j2 Expand (5t + 4t + 0t)(14t - 12t - 20 + 19). 18t*2 - 9t Expand 10u - 99u*3 + 204u*3 - 103u*3 - 2u*2 + 1 + (-u + 4u - u)(8u*2 + 15u*2 + 14u*2). 76u*3 - 2u*2 + 10u + 1 Expand 5m4 + 7m*4 - m - 16m*4 + (-1 + 1 + 1)(101m - 28m*4 - 101m). -32m4 - m Expand 10v - 10v - 4v*5 + 3v*5 - 5v*5 + 3v*5 + (3v + 6v - 4v)(160v*4 - 22v*4 - 68v*4). 347v*5 Expand 4y*2 + 3y*2 - 3y2 - y2 + 4y - 4y - 2y2 + y2 + 0y*2 + (y - 2y + 3y)(-2y - 5 + 5) + 183y*2 + 26y*2 - 15y*2 - 1. 192y*2 - 1 Expand (-2w*2 + 6w2 - w2 + (-2w - 4w + 2w)(-4 + 4 - 4w))(3w - 9w - 2w) + 3w*2 - 2w*3 - 3w*2. -154w*3 Expand (-37j*2 - 5j3 + j2 + 5j + 43j*2)(j + 2j + 4j + (-5j + 3j + j)(3 - 1 + 0)). -25j*4 + 35j*3 + 25j*2 Expand (8f - 2f - 15f)(-11f*2 + 8f*2 - 2f*4 + 4f*2 - 10f + 4 - 4 - 2f4 + (-1 + 1 - f3)(-2f + 3f - 2f)). 27f*5 - 9f*3 + 90f*2 Expand 2w2 - w5 - 2w2 + (2w4 - w2 + w*2)(w + 3 - 3) - 18w4 + 33423w*3 + 18w*4 + 33429w*3 - 102632w*5 - 66852w*3. -102631w*5 Expand (3630z - 782z - 1595z)((3 + 2z - 3)(2 - 3 - 1) - 3z + 4z + 2z) + (-4z2 - 2z + 2z)(-1 + 3 + 0). -1261z2 Expand (-579867q - 158 + 108 - 294 + 579846q)(0 + 0 + 2q). -42q*2 - 688q Expand ((3z - z - 4z)(-z + 3z - z) + 11129z2 - 5543z*2 - 5542z*2 + 38)(-3z + 2z + 0z). -42z*3 - 38z Expand (4u + 0u - u)(u + 0u + u)(860u*2 - 860u*2 + 640u*3). 3840u*5 Expand (-5 + 4 - 3)(2l + 4l - 5l) + (l + l - 4l)(105 - 39 + 95). -326l Expand (1 + 0 - 3)(348l*5 + 510l*5 + 2 + 611l*5). -2938l*5 - 4 Expand (-642 - 646 - 44v + 1284)(-5v + 14v - 2v)(5v - 2v - 2v). -308v3 - 28v*2 Expand ((-4 + 4 + 2)(2 + 2 - 5) - 3 + 2 + 2)(762z + 167844 - 167844)(5z4 - z4 - 2z4). -1524z*5 Expand (-4 + 1 + 1)(2777s + 5396s + 1146s). -18638s Expand (5v3 + 3v - 3v)((2v - 3v + 0v)(-2 + 7 - 2) + 0 + 0 + v + 2v + 2v - 3v + (-3v + v + 5v)(28 + 38 - 20) - 2v + 2v + v). 690v4 Expand (-3t - 2t - 2t)(-19t*2 - 8t*2 - 10t*2). 259t3 Expand -f2 - 3 - 5f3 + 43367f + 6f3 - 43384f + (-f + f - f*2)(-2f - f + 2f). 2f3 - f2 - 17f - 3 Expand -72w4 - 710w + 710w + (11w - 14w3 - 11w)(-1 - w + 1) + w4 + w4 - 4w*4. -60w*4 Expand ((4 - 1 - 4)(6 + 8 - 3) - 5 - 1 + 0)(13v*5 + 30v*4 - 30v*4). -221v*5 Expand ((-4 + 2 + 3)(-3x + x + 0x) - 3x - x - x)(30x - 42x + 20x). -56x*2 Expand (2f*4 - 24f*2 + 27f*2 + 0 - 1)(-2378 + 1336 + 1190). 296f4 + 444f*2 - 148 Expand (0 - 2 - 2)(-b - b + 3b) + b - 2b - b - 38b + 22b - 31b + (-5 + 3 + 4)(-2b - b + 4b)(0 + 2 - 3). -55b Expand (-7s2 - 4s*3 + 7s*2)(11s - 6s - 11s) + s4 + 0s*4 - 5s*4. 20s*4 Expand (-4o2 + o2 + 2o2)(66726 - 66726 - 3400o2). 3400o*4 Expand -12j + 12*j -	{ "pile_set_name": "DM Mathematics" }
, what is 15 + -3020? -3001 In base 14, what is -1 + 167? 166 In base 3, what is -11211 + -100? -12011 In base 11, what is -3a8 - 1? -3a9 In base 8, what is -46 - 7? -55 In base 12, what is -247b + -4? -2483 In base 15, what is -1 + 12? 11 In base 12, what is 2 + -131? -12b In base 4, what is 2 - -23100? 23102 In base 10, what is -7843 + 0? -7843 In base 14, what is -10a + -3? -10d In base 9, what is -1 + 25? 24 In base 2, what is -11 + -10101111? -10110010 In base 3, what is 11 - -122010? 122021 In base 6, what is 1 - -33153? 33154 In base 10, what is 4 + -1442? -1438 In base 12, what is -2b3 - -4? -2ab In base 7, what is -45 - 5? -53 In base 3, what is -122202 + 1? -122201 In base 3, what is 102 + 1101? 1210 In base 15, what is -9b + 23? -78 In base 8, what is -46400 - 4? -46404 In base 14, what is 28 - -2? 2a In base 3, what is 21 + 1002022? 1002120 In base 11, what is -1 - 52? -53 In base 16, what is -6 + ecc? ec6 In base 9, what is -86 + -2? -88 In base 15, what is 4 + 25a2? 25a6 In base 15, what is 1 + -ae? -ad In base 5, what is 21214 + -1? 21213 In base 15, what is 2 + 296? 298 In base 10, what is 15 + -357? -342 In base 5, what is -1 + -1144? -1200 In base 13, what is 5 + 1672? 1677 In base 3, what is 10 - 10222? -10212 In base 12, what is -1 - 97? -98 In base 8, what is 1 + 167? 170 In base 16, what is -2 + b8c? b8a In base 8, what is 301 - -2? 303 In base 11, what is 441 - 14? 428 In base 4, what is -213033 - 10? -213103 In base 9, what is -7 + -414? -422 In base 15, what is 144 - 10? 134 In base 13, what is 12 + c5? 107 In base 9, what is 10 - -4? 14 In base 15, what is 3 - -14? 17 In base 2, what is -11101 + 10000? -1101 In base 7, what is -1150 - 5? -1155 In base 14, what is 8 + -5c? -54 In base 13, what is -285a + -1? -285b In base 10, what is 136 + 16? 152 In base 16, what is -2 + 71e? 71c In base 12, what is -7 + 240? 235 In base 16, what is -1db + -3f? -21a In base 6, what is -150 - -5? -141 In base 9, what is -8 - -18? 10 In base 13, what is -89 + -8? -94 In base 14, what is 6 + -29? -23 In base 9, what is -16 + 763? 746 In base 5, what is 4 - -1114? 1123 In base 12, what is 8 + 37? 43 In base 13, what is -1 - 88? -89 In base 8, what is -214 - 6? -222 In base 6, what is 100 + 100? 200 In base 14, what is 3c + 2? 40 In base 9, what is -21437 + -1? -21438 In base 7, what is -433 + -3? -436 In base 13, what is -69 + -5? -71 In base 8, what is 1045 + -15? 1030 In base 6, what is -322 + 0? -322 In base 16, what is 1 + -12c? -12b In base 2, what is 1001000111 + -1? 1001000110 In base 15, what is -7 - 15? -1c In base 9, what is 11 + -1? 10 In base 2, what is -101 + 111001010011? 111001001110 In base 2, what is -1011 + 10001100? 10000001 In base 3, what is 10220002 + 0? 10220002 In base 7, what is -6642 - -4? -6635 In base 5, what is 3 - -1312? 1320 In base 16, what is -e + 0? -e In base 15, what is -2 - -23? 21 In base 10, what is -5 - 247? -252 In base 9, what is -3 + 57? 54 In base 10, what is 0 + 72? 72 In base 12, what is -4 + -4a? -52 In base 12, what is 0 + 207? 207 In base 6, what is -3320 + 1? -3315 In base 8, what is 15 - 422? -405 In base 15, what is 21 + 10? 31 In base 10, what is 37 + 33? 70 In base 11, what is -6 + 5? -1 In base 4, what is 3002 - 2? 3000 In base 14, what is 2311 - -4? 2315 In base 14, what is 30 - 0? 30 In base 12, what is -1223 + 3? -1220 In base 3, what is -12 - -1210121? 1210102 In base 16, what is 41e - 1? 41d In base 8, what is -1 + 7? 6 In base 9, what is 4485 + 0? 4485 In base 5, what is -122202 - -3? -122144 In base 4, what is -10 - 113? -123 In base 5, what is -214 + 12? -202 In base 8, what is -64 + 123? 37 In base 5, what is 100110 + 2? 100112 In base 15, what is -e4c + 2? -e4a In base 16, what is -3 + 10d? 10a In base 6, what is 5 - -353? 402 In base 15, what is 9c8 - 1? 9c7 In base 7, what is 2 + 40? 42 In base 12, what is a + 7? 15 In base 15, what is 0 + -26c? -26c In base 4, what is 13 + -120103? -120030 In base 10, what is -79 + 42? -37 In base 12, what is 9a - 3? 97 In base 2, what is -1011 + -11? -1110 In base 15, what is 28 - -b? 34 In base 16, what is 7 - 1c? -15 In base 4, what is -12 + 1? -11 In base 15, what is -6 + -1a? -21 In base 8, what is -2 + 251? 247 In base 12, what is 64 - -19? 81 In base 15, what is -5 - 9e0? -9e5 In base 2, what is -1010110 + -100? -1011010 In base 5, what is 13403 + -1? 13402 In base 4, what is -13313 - 0? -13313 In base 7, what is -335 - 1? -336 In base 2, what is 1001 - -11011011011? 11011100100 In base 2, what is -1110 + -11010101? -11100011 In base 15, what is -263 - 2? -265 In base 6, what is -2 - -23? 21 In base 5, what is -4044 + -1? -4100 In base 3, what is 0 + -11100? -11100 In base 16, what is -1 + -b? -c In base 4, what is 11221 + 3? 11230 In base 8, what is 6463 + 1? 6464 In base 12, what is 46 - -24? 6a In base 11, what is -2 + 22? 20 In base 10, what is 331 + -2? 329 In base 15, what is 0 - -42? 42 In base 5, what is 4 - -31? 40 In base 7, what is -2204 - -32? -2142 In base 9, what is 7 - -85? 103 In base 14, what is 5 + 326? 32b In base 11, what is -5a0 + -4? -5a4 In base 14, what is -3 - 34? -37 In base 3, what is 120 + -12? 101 In base 3, what is -11 - -1212? 1201 In base 3, what is 111202211 + -12? 111202122 In base 16, what is -16d - -5? -168 In base 8, what is 3 + -1? 2 In base 14, what is 0 + -2636? -2636 In base 6, what is -2 - -32505? 32503 In base 5, what is 412 - 11? 401 In base 7, what is -1 + -4201? -4202 In base 6, what is 4 + 2020? 2024 In base 13, what is 3 - 9? -6 In base 13, what is 8 - 77? -6c In base 6, what is -2 + -11104? -11110 In base 6, what is -253 + 1? -252 In base 12, what is -5 + -60? -65 In base 16, what is -1 - -222? 221 In base 7, what is -2242 + -5? -2250 In base 16, what is -4 + 85? 81 In base 9, what is 4183 - -5? 4188 In base 15, what is 59 + -4? 55 In base 16, what is -2 - -75f? 75d In base 5, what is 131 + -1? 130 In base 14, what is 0 - -38? 38 In base 16, what is -34 + -1? -35 In base 7, what is 2 + 500? 502 In base 10, what is -33 + 16? -17 In base 14, what is -137 + -5? -13c In base 13, what is 58 - -4? 5c In base 11, what is -23 + -4a? -72 In base 16, what is dc6 + -7? dbf In base 12, what is -5 - 74? -79 In base 6, what is 355 - 0? 355 In base 6, what is -204 + -2? -210 In base 10, what is -17540 + 4? -17536 In base 6, what is 12241 - -2? 12243 In base 10, what is -12 - 32? -44 In base 16, what is -51 - -1? -50 In base 4, what is -23101 - -3? -23032 In base 13, what is 5 + 30? 35 In base 5, what is -10 + -344? -404 In base 6, what is 10 - 21? -11 In base 3, what is -10201 - 1? -10202 In base 8, what is 3 - -7322? 7325 In base 6, what is 1011 + 4? 1015 In base 6, what is -4050 + 1? -4045 In base 7, what is -2041 - -3? -2035 In base 7, what is -3 + -124? -130 In base 5, what is -4 - 1040? -1044 In base 5, what is -12 + -213? -230 In base 8, what is -37 - 14? -53 In base 13, what is -3 - -23? 20 In base 12, what is -4 + 1512? 150a In base 16, what is -1 - -a? 9 In base 13, what is -2 + -8b1? -8b3 In base 2, what is 1001010001111 - 1? 1001010001110 In base 11, what is -5761 - 1? -5762 In base 7, what is 5233 + 5? 5241 In base 7, what is -3524 + 4? -3520 In base 10, what is -36 + -12? -48 In base 14, what is -3 - 29? -2c In base 16, what is 8 + -393? -38b In base 3, what is -1110 - 10212? -12022 In base 10, what is 4306 + 3? 4309 In base 13, what is 477 + 2? 479 In base 3, what is -11002 + -112? -11121 In base 14, what is -2 + 2ac? 2aa In base 7, what is -211 + -3? -214 In base 7, what is -5 + 1510? 1502 In base 15, what is 27 - -e? 36 In base 10, what is -129 - 4? -133 In base 6, what is 1013 + -1? 1012 In base 14, what is -49 - 1? -4a In base 3, what is -1012 - -2111? 1022 In base 2, what is 1 - -110111001? 110111010 In base 16, what is 0 + 45? 45 In base 11, what is -1 - -4822? 4821 In base 8, what is -1135 + -3? -1140 In base 4, what is 1103022 + 11? 1103033 In base 7, what is 24 - 142? -115 In base 15, what is 4 - -62? 66 In base 14, what is -938 + 1? -937 In base 14, what is -2 - 51? -53 In base 15, what is -3 + 37a? 377 In base 5, what is -14 - -2? -12 In base 12, what is -6 - 42? -48 In base 15, what is 201 - 0? 201 In base 4, what is -1 - -122? 121 In base 3, what is 2 + 11102? 11111	{ "pile_set_name": "DM Mathematics" }
est common divisor of 470 and 20? 10 Calculate the highest common factor of 5 and 7145. 5 What is the greatest common divisor of 2428 and 4? 4 What is the greatest common divisor of 35 and 2065? 35 What is the greatest common factor of 861 and 21? 21 What is the highest common divisor of 94 and 34? 2 What is the greatest common divisor of 186 and 496? 62 Calculate the highest common factor of 400 and 500. 100 Calculate the highest common factor of 9 and 33552. 9 What is the greatest common factor of 570 and 30? 30 Calculate the highest common divisor of 57 and 2337. 57 What is the highest common factor of 6963 and 66? 33 Calculate the highest common factor of 297 and 11. 11 Calculate the greatest common divisor of 1496 and 8. 8 What is the highest common divisor of 27 and 441? 9 Calculate the greatest common divisor of 9 and 3762. 9 What is the highest common divisor of 3475 and 10? 5 What is the highest common factor of 16 and 104? 8 Calculate the highest common factor of 975 and 39. 39 Calculate the highest common divisor of 4334 and 1970. 394 Calculate the greatest common factor of 234 and 2772. 18 What is the highest common factor of 485 and 3104? 97 What is the greatest common divisor of 4433 and 429? 143 What is the highest common factor of 15 and 215? 5 Calculate the greatest common divisor of 474 and 678. 6 What is the highest common factor of 35 and 15? 5 What is the greatest common factor of 2086 and 14? 14 Calculate the greatest common factor of 145 and 40. 5 Calculate the highest common factor of 332 and 83. 83 What is the greatest common divisor of 268 and 272? 4 What is the highest common divisor of 18 and 4086? 18 Calculate the greatest common divisor of 20 and 620. 20 What is the greatest common factor of 93 and 62? 31 Calculate the greatest common divisor of 64 and 32. 32 What is the greatest common divisor of 182 and 28? 14 What is the highest common divisor of 116 and 87? 29 Calculate the highest common factor of 9 and 639. 9 What is the greatest common divisor of 40 and 128? 8 What is the highest common factor of 156 and 8? 4 What is the highest common divisor of 20 and 50? 10 What is the greatest common divisor of 15 and 5? 5 What is the highest common divisor of 26 and 16406? 26 What is the highest common divisor of 21 and 4179? 21 Calculate the highest common factor of 80 and 170. 10 What is the highest common divisor of 30 and 65? 5 What is the highest common divisor of 32 and 976? 16 Calculate the greatest common factor of 11 and 88. 11 What is the highest common factor of 162 and 126? 18 What is the highest common factor of 527 and 31? 31 What is the greatest common factor of 72 and 324? 36 What is the greatest common factor of 8 and 104? 8 What is the highest common factor of 285 and 15? 15 What is the greatest common divisor of 26 and 117? 13 What is the highest common factor of 72 and 13752? 72 What is the greatest common divisor of 2178 and 990? 198 What is the greatest common factor of 9672 and 62? 62 Calculate the highest common factor of 49 and 161. 7 What is the greatest common divisor of 92 and 12? 4 What is the greatest common factor of 112 and 6? 2 What is the highest common factor of 1890 and 105? 105 Calculate the greatest common divisor of 1482 and 390. 78 Calculate the highest common factor of 7 and 28. 7 What is the highest common divisor of 11 and 2354? 11 Calculate the highest common factor of 348 and 17139. 87 Calculate the highest common divisor of 5321 and 3443. 313 Calculate the highest common divisor of 342 and 9. 9 Calculate the highest common divisor of 912 and 12. 12 Calculate the highest common divisor of 19395 and 45. 45 Calculate the greatest common factor of 954 and 18. 18 Calculate the highest common factor of 8 and 62912. 8 Calculate the greatest common divisor of 22 and 594. 22 Calculate the highest common factor of 350 and 1120. 70 What is the greatest common factor of 418 and 190? 38 Calculate the greatest common factor of 1680 and 2280. 120 What is the greatest common factor of 1519 and 2107? 49 What is the highest common factor of 24 and 300? 12 Calculate the highest common divisor of 10 and 30. 10 Calculate the greatest common divisor of 899 and 87. 29 What is the greatest common factor of 1950 and 455? 65 Calculate the greatest common factor of 42 and 608. 2 What is the greatest common divisor of 44 and 66? 22 What is the highest common divisor of 90 and 120? 30 What is the greatest common divisor of 60 and 372? 12 What is the highest common factor of 861 and 21? 21 Calculate the highest common divisor of 632 and 32. 8 Calculate the greatest common divisor of 62 and 1550. 62 What is the greatest common divisor of 35 and 10535? 35 Calculate the greatest common divisor of 1676 and 32. 4 Calculate the greatest common factor of 21 and 33. 3 Calculate the highest common factor of 35 and 2345. 35 What is the highest common divisor of 68 and 5270? 34 What is the highest common factor of 3 and 80? 1 What is the highest common divisor of 6986 and 14? 14 What is the highest common factor of 621 and 92? 23 What is the highest common factor of 33 and 102? 3 Calculate the greatest common divisor of 28 and 44. 4 Calculate the highest common divisor of 605 and 1089. 121 What is the greatest common divisor of 1768 and 1394? 34 Calculate the highest common factor of 1180 and 180. 20 Calculate the greatest common factor of 60 and 72060. 60 What is the highest common divisor of 205 and 60? 5 Calculate the greatest common factor of 57 and 171. 57 Calculate the highest common divisor of 16 and 784. 16 What is the highest common divisor of 133 and 19? 19 Calculate the greatest common divisor of 144 and 64. 16 Calculate the highest common factor of 612 and 396. 36 Calculate the highest common divisor of 441 and 98. 49 Calculate the highest common factor of 63 and 36. 9 What is the greatest common divisor of 476 and 364? 28 What is the highest common factor of 20 and 95? 5 What is the highest common divisor of 19738 and 142? 142 Calculate the highest common divisor of 2697 and 87. 87 Calculate the highest common divisor of 29718 and 104. 26 Calculate the highest common divisor of 20 and 180. 20 What is the greatest common factor of 15620 and 40? 20 Calculate the greatest common factor of 23256 and 38. 38 Calculate the highest common factor of 96 and 1104. 48 What is the highest common divisor of 399 and 19? 19 Calculate the highest common factor of 12 and 186. 6 Calculate the greatest common factor of 620 and 100. 20 Calculate the highest common divisor of 3471 and 39. 39 What is the greatest common factor of 9 and 2? 1 What is the highest common divisor of 200 and 88? 8 Calculate the highest common divisor of 60 and 620. 20 Calculate the highest common divisor of 185 and 111. 37 What is the highest common divisor of 12 and 192? 12 Calculate the highest common factor of 826 and 14. 14 What is the greatest common divisor of 69 and 14076? 69 Calculate the highest common factor of 348 and 20. 4 What is the greatest common factor of 9 and 1611? 9 Calculate the highest common factor of 160 and 64. 32 What is the highest common divisor of 15 and 465? 15 What is the highest common divisor of 91 and 13? 13 Calculate the highest common divisor of 7 and 448. 7 Calculate the highest common divisor of 180 and 252. 36 What is the highest common divisor of 420 and 6405? 105 Calculate the greatest common divisor of 44 and 726. 22 What is the highest common divisor of 324 and 234? 18 Calculate the greatest common factor of 1664 and 13. 13 What is the greatest common factor of 442 and 7038? 34 What is the highest common factor of 231 and 84? 21 What is the highest common divisor of 517 and 47? 47 What is the greatest common factor of 10256 and 16? 16 What is the greatest common divisor of 82960 and 85? 85 What is the greatest common divisor of 450 and 9630? 90 What is the greatest common divisor of 10 and 1390? 10 What is the greatest common divisor of 2562 and 2379? 183 Calculate the highest common factor of 1387 and 38. 19 What is the greatest common divisor of 57 and 42? 3 Calculate the highest common factor of 228 and 1083. 57 What is the highest common factor of 45 and 153? 9 Calculate the highest common facto	{ "pile_set_name": "DM Mathematics" }
53 a Which is the nearest to 0.47? (a) 3/7 (b) 1/5 (c) -4 (d) 2 a Which is the nearest to 0? (a) 2/3 (b) -3 (c) -6105 (d) -2 a Which is the nearest to -3? (a) -749.1 (b) -1/6 (c) 2 (d) 5 b Which is the nearest to -0.1? (a) 0.4 (b) -0.7 (c) -8.3 a Which is the closest to 2? (a) -2/19 (b) 0.28 (c) 1 (d) -2/7 c Which is the closest to -51? (a) 3 (b) -3 (c) 5 (d) -6 d What is the closest to -2 in 3, 1, -3, 47722, 1/6? -3 Which is the closest to -1.3? (a) 1/3 (b) 0.1 (c) 5 (d) 7 b What is the nearest to 1 in 1/7, 18, -0.5, 2212, -3? 1/7 Which is the nearest to 0? (a) -239 (b) -0.3 (c) 5 (d) -2/23 d What is the closest to -2/5 in -0.129, 2, -0.3, 0? -0.3 What is the closest to 7/5 in 5, -23, -4? 5 What is the nearest to 1 in -5, -2/125, -58.5? -2/125 Which is the nearest to 1? (a) 0 (b) 30 (c) 16/11 (d) 2/3 d Which is the closest to -0.2? (a) -29 (b) -8 (c) 1/6 (d) -0.4 d What is the nearest to 17.3 in -5, -27, -0.5? -0.5 Which is the nearest to 0.2? (a) -33/14 (b) -20 (c) -7 a What is the closest to 0.1 in 0, -1/5, 0.5, -16, -64? 0 Which is the nearest to -2/243? (a) -0.5 (b) -41 (c) 1/2 a Which is the closest to 0.1? (a) 22 (b) 5 (c) 811 b Which is the nearest to 1? (a) -1/153 (b) 4 (c) 8 (d) -2/63 (e) 0 e What is the nearest to 0 in 1/3, 131/5, 94, -2? 1/3 Which is the closest to 0.921? (a) -3 (b) -1/2 (c) 0.2 (d) 22 c Which is the nearest to -2/7? (a) -5 (b) 7.421 (c) -0.2 (d) 1/5 (e) -4 c What is the closest to 0.2 in 3/5, 776/43, 0, 2/3, -4? 0 Which is the nearest to -2/3? (a) 1/38 (b) 14 (c) 2/11 (d) 5 (e) 8 a Which is the closest to -6? (a) 0.49 (b) 0 (c) 1 b What is the closest to -6/5 in 4, -2.2, 0, -63? -2.2 What is the closest to 1 in 0.06, 2, -14/27, 4, 0.8? 0.8 Which is the nearest to -2? (a) 0.5 (b) 0.2 (c) -423 b Which is the closest to 11.6? (a) -5 (b) -0.3 (c) 8/5 (d) 1 c Which is the closest to 0.3? (a) -8 (b) -55 (c) 0.2 c Which is the closest to 2/13? (a) 16 (b) 3 (c) -240.1 b What is the nearest to -0.1 in 11, 1/8, -2, 1/2, -103? 1/8 What is the nearest to 12 in -1/5, -23/101, -4, 0.4? 0.4 Which is the nearest to 2? (a) 1 (b) 6/13 (c) -2 (d) 0.64 a What is the nearest to -0.0286 in -116, -9, -1? -1 Which is the nearest to 2? (a) -4/11 (b) -122 (c) 3/7 (d) -1 (e) -0.3 c What is the closest to -3/2 in 0.7, 1/3, 20/9? 1/3 What is the nearest to 17 in 0.4, 1, -903? 1 What is the closest to 3 in 3, 5.092, -3, -0.4? 3 Which is the closest to -2/3? (a) 21/5 (b) -2 (c) -43/5 b What is the closest to 1/4 in 1.8, 0, -2, -1/4? 0 What is the nearest to -175 in -0.4, 2/13, 57, -0.5? -0.5 Which is the closest to 0.12? (a) 196/9 (b) 2/11 (c) 12 (d) 1/2 (e) 0.11 e Which is the closest to 0.2? (a) -0.2 (b) 175 (c) 71 (d) -2/7 a Which is the nearest to 51? (a) 6/5 (b) 3/4 (c) -15 a Which is the closest to 1/4? (a) -0.9 (b) -0.2 (c) -35/4 (d) 2 (e) -3 b What is the nearest to 0 in -2/23, -3/52, 1, 1/4? -3/52 What is the nearest to -2 in 2/9, 154, -72, -2/9? -2/9 Which is the closest to -37? (a) 4 (b) 0.6 (c) 1 (d) 1/4 d Which is the closest to 1? (a) 3 (b) -4421.94 (c) 0.3 c What is the closest to 759 in 3, 2/9, 2, -12? 3 Which is the closest to 2? (a) 0 (b) -9/8 (c) -2 (d) 0.2 (e) -34/15 d What is the closest to -1924.6 in -5, -0.04, -0.3? -5 What is the closest to 4191 in -2, -5/2, -2/61? -2/61 Which is the closest to 1/8? (a) -6/7 (b) 3 (c) -1/10 (d) -14 (e) 5 c What is the nearest to -2/25 in 3, 22, -1/15, -6? -1/15 Which is the nearest to -7/2? (a) -0.022 (b) 4/3 (c) 2/7 (d) -2/9 (e) 0.01 d Which is the nearest to -2/3? (a) -0.5 (b) -3 (c) -577 a What is the closest to -2 in 0.2, 0.21, 1? 0.2 Which is the nearest to 0? (a) -61 (b) 1 (c) -24 b Which is the closest to 1? (a) 2/85 (b) 0.05 (c) -3 (d) -0.04 (e) 0.3 e What is the nearest to 1 in -6/83, 222, 0.3, -4? 0.3 Which is the nearest to 1/3? (a) 1.38 (b) 5 (c) 14 (d) -2 a Which is the closest to -1? (a) 25 (b) 4 (c) 99 b Which is the closest to -2/3? (a) 0.3 (b) 694 (c) 3 (d) 177 a Which is the closest to -77/5? (a) -2/7 (b) 2 (c) -4 (d) 0.01 c What is the nearest to -1 in -1/12, 0.5, -4, -0.1, 299? -0.1 What is the closest to -3/11 in 0.11, 15, 5? 0.11 What is the closest to 0.1 in 0, 859, 2/7, 6, -2/11? 0 Which is the closest to 55? (a) -650/7 (b) -2/7 (c) 0 c Which is the closest to 0.09? (a) -2 (b) -17/19 (c) -0.7 c Which is the closest to 1? (a) -20/9 (b) 3 (c) 139 b What is the nearest to -1 in 0.074, -3/5, 0.051? -3/5 What is the closest to 3/4 in 3, -5, -0.6, -1/210? -1/210 What is the closest to -3 in -0.81, -5, -4, 0? -4 Which is the closest to -2? (a) -1 (b) 1550 (c) 0.2 (d) 0.3 (e) -2/15 a Which is the closest to 0.3? (a) 13/2 (b) 3 (c) 0 (d) -1/104 c Which is the closest to 1/19? (a) 0.05 (b) -4 (c) 0.4 (d) -2 (e) 1/6 a Which is the closest to -0.05? (a) -0.06 (b) -15 (c) -4 (d) -3 a What is the closest to 4 in -7, -26, -2/7? -2/7 What is the nearest to -40 in 5, -3, -1.2, -2/11? -3 What is the closest to 52 in 8, 2/3, -0.1, -1.2? 8 Which is the nearest to 0.085? (a) -5 (b) -1 (c) -0.8 (d) 2/7 (e) -20 d Which is the closest to -1/2? (a) 0.3 (b) -26039 (c) 0.4 (d) -0.2 (e) 2 d Which is the closest to -24? (a) -694 (b) 0 (c) 3/8 b Which is the closest to -4? (a) 0.3 (b) -20 (c) 31 a What is the closest to 1/4 in 28, 1.4, 0.07? 0.07 What is the nearest to 1 in 6, 92, -2/21, 1/11? 1/11 Which is the nearest to 1? (a) 0.4 (b) 1050 (c) -2 a What is the closest to -3 in 3, -708.4, 43/2? 3 What is the nearest to 2103 in 2, 2/9, 4, -5, 5? 5 Which is the nearest to -0.19? (a) -2/129 (b) -1 (c) -132 (d) -1/3 d What is the closest to 17 in 0, 4, -1/7, -63? 4 What is the closest to 3181 in 1, 23, 0.3? 23 What is the closest to 0.02 in 0.1, -1, 2? 0.1 What is the nearest to -1/5 in 0, 0.1, 28, -2/93, 2? -2/93 What is the nearest to 0.3 in 5, -9, -73? 5 What is the nearest to 0.2 in -22, -4, -1, -1270? -1 What is the nearest to -1/5 in -44, -4/3, -0.1, -19? -0.1 What is the nearest to -1/7 in 5, -15, 305? 5 Which is the nearest to 3156? (a) 0.2 (b) -4 (c) -0.07 a Which is the nearest to 0? (a) -2/635 (b) -111 (c) -0.6 a What is the closest to -368 in 1/2, -5, -9, -0.3, 4? -9 What is the closest to 2009 in 3/5, -1, 1? 1 What is the closest to -4/3 in -4/7, 36977, 1? -4/7 Which is the closest to -17? (a) 2 (b) 6 (c) -0.3 (d) -50 (e) 3 c What is the closest to 7 in -97, -2/63, 12? 12 Which is the nearest to -2? (a) 1 (b) 3 (c) -6.6 (d) 91 a What is the nearest to -1.813 in -4, 4, -9? -4 Which is the nearest to -1/33? (a) -1/3 (b) 2/9 (c) -2/3 (d) 0.005 (e) -1/10 d Which is the closest to -2? (a) -3/5 (b) -5 (c) 7270/11 a Which is the nearest to -29? (a) 3/5 (b) 3 (c) 143/5 (d) 2/5 d Which is the nearest to -0.1? (a) 298/3 (b) 0.02 (c) -2/93 c What is the nearest to 2/3 in -1/4, -16, -0.0731? -0.0731 What is the nearest to -2 in 1/2, -6, -1/2, -1/6, 0.1? -1/2 What is the closest to 0.1 in 181, -2/3, -3/11, 0.2, 5? 0.2 Which is the closest to -37? (a) -1/4 (b) 2/3 (c) 15.1 a Which is the nearest to -22? (a) 7 (b) 2 (c) 13 b What is the nearest to 0.43 in 0.2, 0, -5, 0.5, -217? 0.5 Which is the nearest to 20? (a) 2.5 (b) 4 (c) 0.07 b What is the closest to -15/7 in -1/10, 32.8, 0.4, 1/3? -1/10 What is the nearest to 15 in 1/4, -0.5, 33, -8, 0.2? 1/4 What is the nearest to -1 in -8/9, 455, -113? -8/9 What is the closest to 2/5 in -3/5, 126, -0.02, 1? -0.02 Which is the closest to 14/3? (a) 1 (b) -0.5 (c) -0.1 (d) -5 a Which is the nearest to 2? (a) -0.2 (b) 2/9 (c) 2/3 (d) -4 (e) -5/3 c What is the nearest to -1 in -0.3, -8/47, -626? -0.3 What is the closest to 2/11 in 0.288, -188, 1/3? 0.288 What is the nearest to 1/2 in 24, 56, 2, -1/7? -1/7 Which is the nearest to 3/2? (a) -714 (b) 0.4 (c) -17 (d) 3 b What is the nearest to -1 in -2/9, -2157, -9.5? -2/9 Which is the closest to 48? (a) -9 (b) -5 (c) 2/3 (d) 0.05 c Which is the closest to 7? (a) 3.245 (b) 3 (c) 2 a Which is the nearest to -1? (a) -0.4 (b) 777 (c) -4/5 c What is the closest to -0.6 in -3/4, 2, 4/11, -228? -3/4 What is the closest to 1 in -1.7, 0.3, 1/3, 9885? 1	{ "pile_set_name": "DM Mathematics" }
t common factor of 324023 and 19229. 287 What is the highest common divisor of 10197 and 11039643? 927 Calculate the greatest common factor of 6664761 and 81. 81 What is the greatest common factor of 26483308 and 166? 166 Calculate the greatest common factor of 72459 and 490779. 747 What is the greatest common divisor of 22290112 and 1088? 64 Calculate the greatest common factor of 1167398 and 736250. 1178 Calculate the highest common factor of 168069956 and 476. 68 What is the highest common divisor of 8973749 and 69? 23 Calculate the greatest common factor of 1136925 and 8649. 279 Calculate the highest common factor of 73 and 180947509. 73 What is the highest common divisor of 886478 and 106? 106 What is the highest common divisor of 1412977 and 413561? 277 Calculate the greatest common divisor of 3636 and 103213314. 1818 What is the highest common factor of 30400 and 355334200? 3800 What is the highest common factor of 229830944 and 3808? 224 Calculate the highest common divisor of 98131 and 467947. 811 What is the highest common divisor of 13833 and 747? 9 What is the greatest common divisor of 13593 and 3509340? 69 What is the greatest common factor of 928727968 and 98? 98 Calculate the greatest common factor of 6119496 and 576. 72 Calculate the greatest common divisor of 44 and 46148476. 44 Calculate the greatest common divisor of 31570449 and 331. 331 What is the greatest common divisor of 2216526 and 9050? 362 Calculate the highest common divisor of 377 and 1132479. 29 What is the greatest common divisor of 12493104 and 1040? 208 Calculate the greatest common divisor of 68429673 and 117. 117 Calculate the greatest common factor of 9288 and 2948184. 216 Calculate the highest common factor of 2718 and 8126826. 6 Calculate the greatest common divisor of 2419420 and 253724. 548 What is the highest common factor of 702375 and 11125? 125 Calculate the greatest common divisor of 49 and 182730947. 49 Calculate the greatest common divisor of 5820 and 346080. 60 Calculate the greatest common factor of 86457 and 1007377. 161 Calculate the greatest common factor of 548548 and 112. 28 Calculate the highest common divisor of 15 and 22659995. 5 Calculate the highest common factor of 641303543 and 2551. 2551 What is the highest common divisor of 25123 and 2619? 97 What is the greatest common divisor of 39343673 and 134? 67 What is the highest common factor of 6 and 18131436? 6 Calculate the highest common divisor of 2480 and 2127530. 310 What is the highest common factor of 1574 and 32630594? 1574 What is the greatest common divisor of 3618 and 46644462? 1206 What is the greatest common factor of 91 and 315539? 7 What is the greatest common factor of 18324 and 479536026? 3054 What is the highest common factor of 54672 and 732768? 816 Calculate the highest common factor of 4787832 and 840. 168 What is the highest common factor of 136810986 and 5356? 2678 What is the highest common factor of 11745 and 92880? 135 What is the highest common factor of 383662523 and 146? 73 Calculate the greatest common factor of 81622666 and 370. 74 Calculate the highest common divisor of 346 and 15260157. 173 Calculate the highest common divisor of 596835098 and 172. 86 What is the highest common divisor of 17420 and 1768780? 260 What is the highest common factor of 72 and 136682712? 72 What is the highest common divisor of 1386799738 and 2738? 2738 Calculate the highest common factor of 1831090 and 670. 10 Calculate the highest common factor of 557404 and 2947. 421 What is the highest common divisor of 1040 and 99515? 65 What is the greatest common factor of 3517979 and 497? 71 What is the greatest common divisor of 1898 and 745980430? 1898 What is the highest common divisor of 28 and 11848802? 14 Calculate the greatest common divisor of 554963 and 33337. 1961 Calculate the highest common factor of 386906 and 4784. 598 What is the greatest common factor of 40048 and 944? 16 Calculate the highest common factor of 6716472 and 924. 84 Calculate the greatest common factor of 3552318 and 18634. 1694 What is the greatest common factor of 838576 and 1496? 136 Calculate the greatest common divisor of 212352 and 104912. 1264 Calculate the greatest common factor of 4512563891 and 2563. 2563 Calculate the greatest common divisor of 252923930 and 35. 35 What is the highest common factor of 2 and 2924353? 1 Calculate the highest common divisor of 930 and 913229. 31 What is the greatest common divisor of 747 and 10078275? 249 What is the greatest common factor of 69594816 and 1440? 96 Calculate the highest common factor of 4272780 and 923. 71 What is the highest common divisor of 65 and 117189085? 65 Calculate the highest common divisor of 1149172 and 8418. 46 Calculate the greatest common divisor of 118 and 226789628. 118 What is the highest common factor of 264 and 67139952? 264 What is the highest common factor of 16200 and 4423680? 1080 Calculate the greatest common factor of 1713756 and 80058. 66 What is the greatest common divisor of 34612 and 1319328? 2036 Calculate the highest common divisor of 38391 and 220223. 191 Calculate the greatest common divisor of 21211513 and 43. 43 What is the greatest common divisor of 2366 and 105424904? 338 What is the highest common divisor of 100720820 and 130? 10 What is the greatest common divisor of 22 and 1532171993? 11 What is the highest common divisor of 8130645 and 18320? 1145 Calculate the greatest common factor of 61300 and 120761. 613 Calculate the highest common factor of 121531481 and 926. 463 Calculate the greatest common divisor of 127502 and 291782. 74 What is the highest common divisor of 1062228692 and 140? 28 What is the highest common factor of 8346 and 347781993? 4173 Calculate the highest common divisor of 41460 and 110. 10 What is the highest common divisor of 5530 and 1543186? 158 Calculate the highest common divisor of 5864 and 32180899. 733 What is the greatest common divisor of 161672 and 12712? 56 Calculate the highest common divisor of 211925886 and 5748. 2874 What is the highest common factor of 344 and 555248? 8 Calculate the highest common divisor of 125475 and 1323343. 1673 What is the highest common factor of 41177571 and 779? 41 What is the greatest common factor of 7213743 and 184? 23 Calculate the highest common divisor of 175373 and 20009. 1177 What is the highest common factor of 55360 and 28480? 320 Calculate the greatest common divisor of 1351104 and 50778. 186 Calculate the greatest common factor of 444 and 150972543. 111 What is the highest common factor of 2241 and 4238229? 249 Calculate the greatest common divisor of 9044 and 40285966. 266 What is the highest common factor of 486858 and 34609? 53 What is the highest common divisor of 224296 and 207092? 92 Calculate the highest common factor of 3947222 and 1331635. 1163 Calculate the highest common divisor of 2876472 and 1840. 184 Calculate the greatest common factor of 1369851 and 1010199. 5289 What is the highest common divisor of 54766846 and 98950? 3958 What is the greatest common divisor of 828 and 4989? 3 What is the greatest common factor of 425332 and 241594? 226 What is the highest common factor of 3649725 and 200? 25 Calculate the highest common factor of 7552840 and 3720. 1240 What is the highest common factor of 2 and 218881598? 2 Calculate the highest common divisor of 940128 and 3360. 672 Calculate the greatest common factor of 1357 and 322789. 59 What is the greatest common divisor of 64282010 and 13? 13 Calculate the greatest common factor of 121723883 and 5582. 2791 What is the greatest common factor of 3299366 and 1274? 98 What is the greatest common factor of 25449905 and 78? 13 What is the greatest common divisor of 26 and 13743353? 13 What is the highest common divisor of 6156 and 518787666? 3078 What is the highest common factor of 42 and 2423953? 7 Calculate the greatest common factor of 198276 and 47437. 533 Calculate the highest common divisor of 30218385 and 120. 15 What is the greatest common divisor of 245377740 and 3522? 3522 Calculate the highest common factor of 68090 and 3376645. 3095 Calculate the greatest common divisor of 13166676 and 15. 3 Calculate the highest common divisor of 1688096 and 120366. 1486 What is	{ "pile_set_name": "DM Mathematics" }
lve 0 = -3b - 15 + 15 for b. 0 Solve 25o - 159 = -28o for o. 3 Solve -25h + 28h = -6 for h. -2 Solve -25a + 10 = -30a for a. -2 Solve 153 - 342 = 63d for d. -3 Solve 10c - 84 = -4c for c. 6 Solve 90 - 5 = 85n for n. 1 Solve 0 = 7x - 5x + 4 for x. -2 Solve 7q = 17 - 45 for q. -4 Solve -132 = -11g - 220 for g. -8 Solve -60 = -28f + 13f for f. 4 Solve 56b + 52b = -216 for b. -2 Solve -61y - 400 = -101y for y. 10 Solve f = -4f + 10 for f. 2 Solve -1 - 3 = -4i for i. 1 Solve -9l + 12 = -13l for l. -3 Solve 74 = 8q + 10 for q. 8 Solve -20h = 29h - 343 for h. 7 Solve -15 = -3i + 6i for i. -5 Solve -41 + 85 = -22m for m. -2 Solve 86 = -8q + 30 for q. -7 Solve -2k - 34 + 42 = 0 for k. 4 Solve -9 = 5b - 8b for b. 3 Solve -7o - 66 = -29o for o. 3 Solve 0 = -72p + 49p - 207 for p. -9 Solve 9g - 16 = -25 for g. -1 Solve -60 = 8s + 7s for s. -4 Solve -269k + 261k = -32 for k. 4 Solve -29r + 23r + 24 = 0 for r. 4 Solve 0 = -9m - 9 for m. -1 Solve -12q = -5q + 21 for q. -3 Solve 103m - 51 = 52 for m. 1 Solve 59b = -37b + 96 for b. 1 Solve 9d = 100 - 55 for d. 5 Solve -22 = -0l + 11l for l. -2 Solve 115t - 4 = 113t for t. 2 Solve -18u + 8u + 50 = 0 for u. 5 Solve 10 = 5i - 10i for i. -2 Solve 15c = -50 - 10 for c. -4 Solve 12q = -16 + 52 for q. 3 Solve -64 = 9f - 25f for f. 4 Solve -26p - 8 - 148 = 0 for p. -6 Solve -l = -53 + 62 for l. -9 Solve 10o - 93 = -43 for o. 5 Solve 39h = 220 + 92 for h. 8 Solve 20d - 133d + 226 = 0 for d. 2 Solve -17a = 11a - 140 for a. 5 Solve -29q = -30q + 7 for q. 7 Solve 63 = 12b + 15 for b. 4 Solve -13j = 12j + 125 for j. -5 Solve -8f = -0f - 8 for f. 1 Solve 4k - 985 = -1021 for k. -9 Solve 49j - 176 = 167 for j. 7 Solve 0 = -2x - 20x - 44 for x. -2 Solve 12m - 44 = 16 for m. 5 Solve 60q - 36q - 35q = 0 for q. 0 Solve 11 = -4r - 13 for r. -6 Solve 0 = 25b + 106 + 169 for b. -11 Solve 13t + 26 = -39 for t. -5 Solve 0 = -15i - 15i + 150 for i. 5 Solve 16i + 348 = 74i for i. 6 Solve -4m - 2m - 18 = 0 for m. -3 Solve 24u = 23u + 2 for u. 2 Solve 0 = 11n - 34 - 10 for n. 4 Solve 72 = 29l - 15 for l. 3 Solve 0 = 108d - 113d + 25 for d. 5 Solve 11h = -5h + 64 for h. 4 Solve 6a - 8a = 10 for a. -5 Solve -89 = -26f + 15 for f. 4 Solve -28 = -21a + 56 for a. 4 Solve 0 = 2g + 2g + 2g for g. 0 Solve -15 = 16d - 11d for d. -3 Solve 0 = -138s + 144s + 6 for s. -1 Solve 0 = -x - 7x + 16 for x. 2 Solve 17 - 14 = b for b. 3 Solve 3c - 25 = -28 for c. -1 Solve 7a - a = -2a for a. 0 Solve 2593c - 2622c = 203 for c. -7 Solve 6t + 24 = 14t for t. 3 Solve -53l - 12l - 455 = 0 for l. -7 Solve 65p = -0p + 585 for p. 9 Solve -26q + 27q = -4 for q. -4 Solve 4p + 116 = 96 for p. -5 Solve 20 = -22f + 12f for f. -2 Solve -6i = -0 + 12 for i. -2 Solve -5h - 43 = -33 for h. -2 Solve -24d = -16d for d. 0 Solve 5g - 16 = -31 for g. -3 Solve 2z + 203 = 215 for z. 6 Solve -429 = -9l - 357 for l. 8 Solve 169b = 168b - 7 for b. -7 Solve 0r = 3r + 3 for r. -1 Solve 2m - 6 - 2 = 0 for m. 4 Solve 5k - 1 = 34 for k. 7 Solve 57o = 52o for o. 0 Solve -24k + 56 = 152 for k. -4 Solve 30z - 40 = 80 for z. 4 Solve 0 = -3s + s - s for s. 0 Solve 4u = -3u - 7 for u. -1 Solve 25 = 5l + 5 for l. 4 Solve 14q + 15 = 9q for q. -3 Solve -18u + 2 = -19u for u. -2 Solve 25o - 22o + 15 = 0 for o. -5 Solve -11 + 5 = -3h for h. 2 Solve -52 + 55 = -k for k. -3 Solve -134z = -23z - 111 for z. 1 Solve 15c - 270 = 42c for c. -10 Solve -13 = -3j - 4 for j. 3 Solve 16x = 17x + 5 for x. -5 Solve 2 = -6c + 4c for c. -1 Solve 125 = 11t + 14t for t. 5 Solve -14 = -20v + 13v for v. 2 Solve -1149o + 1144o - 55 = 0 for o. -11 Solve -1129t = -1136t for t. 0 Solve 59 = -21r - 25 for r. -4 Solve -4q = -0q + 4 for q. -1 Solve 8t + 0t - 16 = 0 for t. 2 Solve 203c - 9 = 206c for c. -3 Solve -12 = -6w + 12w for w. -2 Solve 0 = 21j - 40 - 65 for j. 5 Solve 23 = -6a - 7 for a. -5 Solve 40 = -189a + 169a for a. -2 Solve 4b = -b + 15 for b. 3 Solve 24 = -z + 7z for z. 4 Solve -20 = 4g + g for g. -4 Solve 0 = 30q - 29q for q. 0 Solve -12r = -8r - 20 for r. 5 Solve -31t + 120 = -7t for t. 5 Solve 23 = 2i + 15 for i. 4 Solve -569 = -78z - 101 for z. 6 Solve -5w + 0 = 10 for w. -2 Solve 7i = -60 + 32 for i. -4 Solve -40z - 234 - 46 = 0 for z. -7 Solve 175 = 8v + 17v for v. 7 Solve 28w = -202 + 34 for w. -6 Solve 0 = 44h - 114h + 490 for h. 7 Solve -12b = -23 - 1 for b. 2 Solve 28 - 4 = 8t for t. 3 Solve 22m - 21m = 2 for m. 2 Solve -2c + 19c - 17 = 0 for c. 1 Solve 223 = -30l - 77 for l. -10 Solve 10w - 27w + 11w = 0 for w. 0 Solve -5g + 11g + 30 = 0 for g. -5 Solve 6u + 1 = -17 for u. -3 Solve 0 = -7v + 65 - 51 for v. 2 Solve 13d + 41 = 132 for d. 7 Solve 7 = 3x + 1 for x. 2 Solve 239s = 230s + 27 for s. 3 Solve -2 = -0y - 2y for y. 1 Solve 0 = -38a - 101 - 89 for a. -5 Solve -i = -4 - 0 for i. 4 Solve 29y = -53 - 63 for y. -4 Solve 93l + 521 + 37 = 0 for l. -6 Solve -26l - 30 = -16l for l. -3 Solve 0 = -3r - 91 + 79 for r. -4 Solve -84s = -96s for s. 0 Solve 0 = -13x + 54 + 11 for x. 5 Solve 11o + 16 = 7o for o. -4 Solve 3r - 11r = 3r for r. 0 Solve 440 - 391 = -7j for j. -7 Solve -129 = 4t - 113 for t. -4 Solve 10g - 16 = -6 for g. 1 Solve -11b + 68 = -28b for b. -4 Solve 39 = 5d + 19 for d. 4 Solve -71 + 101 = 10h for h. 3 Solve j + 22 = 17 for j. -5 Solve 692 = -2j + 688 for j. -2 Solve 9u + 5 = -4 for u. -1 Solve -169 + 33 = -17z for z. 8 Solve 540n - 530n + 30 = 0 for n. -3 Solve -2j + 32 = -18j for j. -2 Solve -9s + 0 = 18 for s. -2 Solve -25s = -36s - 39s for s. 0 Solve -297k = -311k + 14 for k. 1 Solve -10p + 5p = -5 for p. 1 Solve -43x + 21 = -40x for x. 7 Solve 0 = 311j - 310j - 1 for j. 1 Solve 5o - 44 = -17o for o. 2 Solve -187u = -191u + 8 for u. 2 Solve -7 - 6 = -13y for y. 1 Solve 0 = 24q - 3 + 147 for q. -6 Solve 0 = -1359c + 1353c + 6 for c. 1 Solve -10r + 11651 = 11581 for r. 7 Solve 32q = 106 + 54 for q. 5 Solve -491f + 533f = -462 for f. -11 Solve -5s + 24 = 19 for s. 1 Solve 3v = -6v + 36 for v. 4 Solve 5z = -28z for z. 0 Solve -g - 16g = -102 for g. 6 Solve 40m - 30m - 50 = 0 for m. 5 Solve 4g - 34g = 240 for g. -8 Solve -9d + 9d = 8d for d. 0 Solve -19w - 64 = 12 for w. -4 Solve -14g - 7g = -63 for g. 3 Solve 3v + 1 + 11 = 0 for v. -4 Solve -6 = 8m + 2 for m. -1 Solve -p = 16p - 51 for p. 3 Solve 3n = 14n + 22 for n. -2 Solve 0 = 13b + 20 + 45 for b. -5 Solve -27f + f = 0 for f. 0 Solve 27w + 119 = 10w for w. -7 Solve 11r = -4 + 15 for r. 1 Solve 0 = q - 0q for q. 0 Solve 0 = -716v + 751v - 315 for v. 9 Solve 974b - 24 = 977b for b. -8 Solve 70x = 46x - 168 for x. -7 Solve 11k = 10k - 6 for k. -6 Solve 34c = -70c - 832 for c. -8 Solve 3 = -a - 2 for a. -5 Solve 53 + 43 = 24a for a. 4 Solve -6d = -28 + 4 for d. 4 Solve 6m + 180 = 51m for m. 4 Solve 7y + 14 = -0y for y. -2 Solve -5 = -6p - 5 for p. 0 Solve 9y = 4y - 10 for y. -2 Solve 45c + 35 = 38c for c. -5 Solve -3 = -3d - 6 for d. -1 Solve 867x - 864x + 9 = 0 for x. -3 Solve 540 = 7r + 561 for r. -3 Solve 44 = -y - 10y for y. -4 Solve -6 = -11w + 38 for w. 4 Solve 3 + 3 = 6y for y. 1 Solve 0 = -6l - 183 + 141 for l. -7 Solve -76k + 77 = 1 for k. 1 Solve 363 - 35 = -41x for x. -8 Solve 5j + 434 = 399 for j. -7 Solve 72 = -22c - 16 for c. -4 Solve -17c + 140 = 242 for c. -6 Solve -3461c - 91 = -3474c for c. 7 Solve -115 + 3 = 28x for x. -4 Solve -91q = -74q for q. 0 Solve -350 = -2q - 338 for q. 6 Solve 6b + 2 + 28 = 0 for b. -5 Solve 3h = -2124 + 2121 for h. -1 Solve -34f + 36 = -28f for f. 6 Solve -7j - 8 = 27 for j. -5 Solve 9z = -676 + 649 for z. -3 Solve 86h - 51 = -481 for h. -5 Solve 68g - 104g + 180 = 0 for g. 5 Solve 0 = -76j + 84j + 8 for j. -1 Solve 60 - 30 = -6w for w. -5 Solve -6x + 12 = -8x for x. -6 Solve 0 = -12p - 0p + 48 for p. 4 Solve -9 = 22s - 75 for s. 3 Solve -18t + 303 = 195 for t. 6 Solve 315 = 128y - 65y for y. 5 Solve 14v + 24 = 8v for v. -4 Solve -213a = -172a for a. 0 Solve 0 = 777o - 784o for o. 0 Solve -42r + 45r + 18 = 0 for r. -6 Sol	{ "pile_set_name": "DM Mathematics" }
23886775. -5(i - 28955471)(i - 5) Factor 2q3/5 + 1461124q*2/5 - 23379904q + 467610880. 2(q - 40)2(q + 730642)/5 Let c*3/2 - 317c*2/6 - 4041c/2 - 11803/6 = 0. What is c? -29, -1, 407/3 Find x such that 25x3 - 40970x*2 - 586745x - 115710 = 0. -14, -1/5, 1653 Factor 2c2 - 13309820c + 22143913554050. 2(c - 3327455)2 What is q in 2q*3/15 + 15212q*2/15 + 10761408q/5 + 6983407872/5 = 0? -4582, -1512 Find q such that -3q2 + 190947q = 0. 0, 63649 Factor 2m4 + 36367834m*3/5 + 44087316510762m*2/5 + 17815123223498141262m/5 + 7126042235430942324/5. 2(m + 1212261)3(5m + 2)/5 Solve -5m*2 - 77170m + 35984055 = 0 for m. -15887, 453 Solve -68186u4/3 - 170473u*3/3 - 11371u*2 + 68182u/3 + 8/3 = 0. -2, -1, -4/34093, 1/2 Let -o*2/4 - 5941o/4 + 102153 = 0. What is o? -6009, 68 Let -9002l3/9 - 486106l*2/9 + 1008332l/9 - 224/9 = 0. Calculate l. -56, 1/4501, 2 Find i such that -450i4/7 - 343513680i*3/7 + 2839742872i*2/7 - 738944032i/7 + 48855808/7 = 0. -763372, 2/15, 8 Let -48k4 + 28748k*3 - 773456k*2 + 3458560k + 28061696 = 0. Calculate k. -4, 16, 6851/12 Factor -3m2/2 + 45099m - 1172067/2. -3(m - 30053)(m - 13)/2 Determine l, given that 3l2 - 90135l + 5307522 = 0. 59, 29986 Let 2v2/9 - 376033220v/9 + 17675122817946050/9 = 0. What is v? 94008305 Suppose -3c4 + 57819c*3 - 693312c*2 - 1617924c = 0. What is c? -2, 0, 14, 19261 Determine z, given that -2z5/15 - 7646z*4/15 - 3484814z*3/15 - 424605122z*2/15 + 13939288z/15 + 1698542824/15 = 0. -3317, -253, -2, 2 Factor 2s2/17 - 20s + 306. 2(s - 153)(s - 17)/17 Suppose -y*3/4 - 553y*2/4 - 8403y - 127575 = 0. What is y? -486, -42, -25 Suppose -2y2/3 - 35984y/3 - 2116094/3 = 0. What is y? -17933, -59 Suppose 13r5 - 1182501r*4 + 26892687591r*3 - 97196672891r*2 - 347471202624r - 223380659628 = 0. What is r? -18/13, -1, 6, 45479 Suppose 6x4 - 5851x*3 + 934417x*2 - 153624x - 311148 = 0. What is x? -1/2, 2/3, 201, 774 Suppose 5u3 + 4424403u*2 - 28316340u + 38935028 = 0. What is u? -884887, 2, 22/5 Factor -3j2/7 + 278658j/7 - 278655/7. -3(j - 92885)(j - 1)/7 Find s such that 3s2 - 29937186s - 149686005 = 0. -5, 9979067 Suppose 2g3 - 267818g*2 - 1874840g + 2142656 = 0. Calculate g. -8, 1, 133916 Factor -5q3 - 2298710q*2 - 160891325q - 2815491000. -5(q + 35)2(q + 459672) Factor 2q3 - 7978q*2 + 15950q - 7974. 2(q - 3987)(q - 1)*2 Factor -4a*3 + 2145400a*2 - 150163300a + 2627772000. -4(a - 536280)(a - 35)*2 What is n in 102992180512500n*3 + 25748063282325n*2 + 22692754n/5 + 1/5 = 0? -1/4, -1/11346375 Factor -2x3 + 2270x*2 + 1489936x - 1759995936. -2(x - 1004)2(x + 873) Factor -3l2 - 137736l + 42567699. -3(l - 307)(l + 46219) Solve 25k3 - 45197165k*2 + 20427850799515k - 12256694208735 = 0 for k. 3/5, 903943 Suppose t*3 + 786t*2 - 324715t - 325500 = 0. Calculate t. -1085, -1, 300 Suppose 2a4 - 82924a*3 + 845361840a*2 + 295340408000a - 594061600000 = 0. What is a? -340, 2, 20900 Solve q*2 - 31662188q + 250623537236836 = 0. 15831094 Find r such that -4r2 + 464261544r - 13471173827328996 = 0. 58032693 Determine q so that 4q4 - 9644q*3 - 1419168q*2 - 51428720q - 50019200 = 0. -70, -1, 2552 Factor -3p2 - 15237528p - 19348521629232. -3(p + 2539588)2 Factor 5t*2 + 2873230t - 97695600. 5(t - 34)(t + 574680) Solve v*3 - 12417490v*2 - 24834983v - 12417492 = 0. -1, 12417492 Let 2f4/5 + 231302f*3/5 + 6692085708f*2/5 + 260720552008f/5 + 467814709040 = 0. What is f? -57806, -25, -14 What is u in -5u2 - 415245u - 127833300 = 0? -82740, -309 Factor l*3/7 + 29861l*2/7 - 328582l/7 + 298720/7. (l - 10)(l - 1)(l + 29872)/7 Suppose u*2/5 - 11017u/5 + 142376 = 0. What is u? 65, 10952 Factor t*3/3 + 1091257t*2/3 + 99237001880t + 99236638128. (t + 1)(t + 545628)2/3 Factor 2f*3/17 - 35656f*2/17 + 159381306f/17 - 4119845652/17. 2(f - 8901)2(f - 26)/17 Factor -3m2 - 50529m - 2569176. -3(m + 51)(m + 16792) Let 16d5/9 + 50258d*4/9 - 38550d*3 - 2109770d*2/9 - 1920346d/9 - 69256/3 = 0. What is d? -3148, -3, -1, -1/8, 11 Factor -4v2 + 948804v - 6641432. -4(v - 237194)(v - 7) Factor 3h2/2 + 117831h/2 + 176733. 3(h + 3)(h + 39274)/2 Factor z*3/4 + 193793z*2/4 + 872037z/2 + 872028. (z + 3)(z + 6)(z + 193784)/4 Find o, given that -30o5 - 301325o*4 + 3267390o*3 - 4876765o*2 - 904950o = 0. -10055, -1/6, 0, 2, 9 Suppose g*2 + 60647752g + 919537455663376 = 0. What is g? -30323876 Suppose z*2/3 + 830z/3 + 19327 = 0. What is z? -753, -77 Suppose x*4 - 87183x*3 + 2533450773x*2 - 24533090709605x - 147289767318282 = 0. Calculate x. -6, 29063 Let h*2/2 + 45407h/2 - 68115 = 0. Calculate h. -45410, 3 Solve h*2/4 - 23192h + 4728567/4 = 0. 51, 92717 Suppose -24b4/17 - 7879970b*3/17 + 7223330b*2/17 + 1313330b/17 - 656666/17 = 0. What is b? -328333, -1/3, 1/4, 1 Let 5c3 - 1570c*2 - 347255c - 345680 = 0. Calculate c. -149, -1, 464 Let -2l3 - 2321488l*2 - 9285910l + 11607400 = 0. Calculate l. -1160740, -5, 1 Suppose l*3 + 699l*2 - 44640l - 72082688 = 0. Calculate l. -496, 293 Solve 2j4 + 552j*3 - 149192j*2 - 2208j + 596736 = 0. -444, -2, 2, 168 Suppose 46r4/5 + 9362r*3/5 + 45292r*2/5 - 75264r/5 - 438336/5 = 0. Calculate r. -4566/23, -4, 3 Factor 2p2/3 + 1892834p/3 + 630944. 2(p + 1)(p + 946416)/3 Determine d so that -3d5/2 + 357d*4 - 28890d*3 + 839193d*2 - 7238217d/2 + 2808450 = 0. 1, 4, 75, 79 Find o such that 33o5 - 216o*4 - 1599o*3 + 6030o*2 + 16200o = 0. -60/11, -2, 0, 5, 9 Solve -3q2 - 86859q - 3729390 = 0. -28910, -43 Factor -3j3 - 65028j*2 + 1301460j - 6508800. -3(j - 10)2(j + 21696) Factor -5v3 - 10225v*2 + 3774160v + 11802333120. -5(v - 1011)(v + 1528)*2 Factor 5n*3/2 + 3272540n*2 - 13090175n/2 + 3272545. 5(n - 1)2(n + 1309018)/2 Determine h, given that -h*5/2 + 21h*4 - 255h*3 + 1142h*2 - 4065h/2 + 1125 = 0. 1, 3, 10, 25 Let -2j5/7 - 682j*4/7 + 67338j*3 + 35852110j*2 + 4378927532j = 0. Calculate j. -301, 0, 562 Factor 2i3/3 - 199234i*2 - 4184012i/3. 2i(i - 298858)(i + 7)/3 Factor q2/3 + 73199q/3 + 4022920/3. (q + 55)(q + 73144)/3 Determine r, given that 21r*5/4 + 15123r*4/4 + 1518705r*3/2 + 28450455r*2 + 337863786r + 943883928 = 0. -338, -162/7, -17, -4 Determine m, given that -2m2/9 - 400558m/9 + 5208268/3 = 0. -200318, 39 Factor 3g4/2 - 14614491g*3 + 47462961170520g*2 - 51381234287968421925g - 102762563501888413875/2. 3(g - 3247665)3(g + 1)/2 Factor f*3/2 - 56063f*2/2 + 779816955f/2 + 167046752259/2. (f - 28137)*2(f + 211)/2 Factor m*2 + 506652m - 2533285. (m - 5)(m + 506657) Factor k2/2 - 435201k/2 + 65887047. (k - 434898)(k - 303)/2 Solve -2g*4/9 + 8120g*3/9 + 40676g*2/9 - 105704g/9 + 18970/3 = 0. -7, 1, 4065 Suppose -14040o5 + 19558368o*4 - 6805356174o*3 - 4228939346o*2 - 489461308o = 0. What is o? -7/15, -2/13, 0, 4181/6 Factor 2u3 + 3356u*2 + 89298u + 237744. 2(u + 3)(u + 24)(u + 1651) Suppose -5i*3 + 77470i*2 - 161308525i - 161386000 = 0. What is i? -1, 2480, 13015 Suppose 2w4/13 - 1940w*3/13 - 167842w*2/13 - 165900w/13 = 0. What is w? -79, -1, 0, 1050 Factor -2m3/3 + 75430m*2/3 - 234854850m - 41873186250. -2(m - 18945)2(m + 175)/3 Find n such that -4n2 - 319417848n - 6376735101309444 = 0. -39927231 Suppose -4z5 - 392z*4 - 8508z*3 + 58184z*2 + 1560544z - 3279360 = 0. What is z? -61, -35, -16, 2, 12 Find i, given that i*4 - 21153i*3 - 21155i*2 + 21153i + 21154 = 0. -1, 1, 21154 Suppose 2t2/13 + 55784t/13 + 27660870/13 = 0. What is t? -27387, -505 Factor -3i2/8 - 2679i/8 + 70725/4. -3(i - 50)(i + 943)/8 Factor -u*3 + 9885u*2 - 530819u - 540705. -(u - 9831)(u - 55)(u + 1) Factor 2t2/11 + 12779268t/11 + 25558528/11. 2(t + 2)(t + 6389632)/11 Factor -2z2/17 - 40878974z/17 + 327031920/17. -2(z - 8)(z + 20439495)/17 Factor -2y5/13 - 11760y*4/13 + 200498y*3/13. -2y*3(y - 17)(y + 5897)/13 Factor -4m*3/5 - 834728m*2/5 - 8710136240m - 261274037856/5. -4	{ "pile_set_name": "DM Mathematics" }
/11))/(z*(9/4)/(z/(z/(z/(zz*5z))))) assuming z is positive. z(-391/44) Simplify (t/t(-19)t)/t(1/23) assuming t is positive. t(482/23) Simplify ((r(-1)r)/(r*6rrrr))/((r((r*(2/7)r)/r)/r)/(r/(r/(r*(-3)/r))r)) assuming r is positive. r(-93/7) Simplify ((x/((x/x(-1/3))/xx))(1/4))(4/23) assuming x is positive. x(-1/69) Simplify o(-1/2)o/((o/(oo(1/2)))/oo)(o3/o)/ooo(-4) assuming o is positive. 1/o Simplify z(-1/4)z*(-3/5)(z/(z*(2/7)/z)z)(-43) assuming z is positive. z(-16459/140) Simplify s/s*(-29)((s(-5)/s)/s)/s assuming s is positive. s22 Simplify (k*(-11)k)(-3/20) assuming k is positive. k(3/2) Simplify (y3)(-11/5) assuming y is positive. y*(-33/5) Simplify (y/(y/(yy*(3/19)yy)y)y(-2/47)/y)(9/7) assuming y is positive. y(8964/6251) Simplify (z/(z/(zz*(-5/3)z))z)(-8/15) assuming z is positive. z(-32/45) Simplify (y6/y)/(y(-2/9)/yy)y8/y(8/3) assuming y is positive. y(95/9) Simplify (ppp6pp)/(p/(pp*4pp))(p/p0)(-8/9) assuming p is positive. p(136/9) Simplify (a0)*(8/9)a*(-5)a/(aa2/a) assuming a is positive. a(-6) Simplify ((ss*(-1/6))/s)/ss/s*(-7)sss*(-2/9)ss/(s/(s/s7s))s assuming s is positive. s(101/18) Simplify (b(-1)bb0/b)/(b(-6)(bb(b/b*(-6))/bb)/b) assuming b is positive. b(-3) Simplify k(-12)k/k(-2/33) assuming k is positive. k(-361/33) Simplify (h2/h)(-1/6) assuming h is positive. h(-1/6) Simplify (((m/m25)/m)/m)(1/50) assuming m is positive. m(-13/25) Simplify (uu/(uu6)u)/(u/(u(u(-1)uuu)/uuu)) assuming u is positive. 1/u Simplify o*(-9)/o((o/(o*2/o))/oo)/o assuming o is positive. o(-11) Simplify r(13/4)/(r/((r/(rr/(r/((rr/(r/((r*(-1/29)/r)/r)))/r))))/rr)r) assuming r is positive. r(381/116) Simplify nnn14/nnn(-1/10) assuming n is positive. n(159/10) Simplify ((d(1/4))(-14/9))(6/11) assuming d is positive. d(-7/33) Simplify (hh(1/2))(-9/4) assuming h is positive. h(-27/8) Simplify (v/v(2/53))36 assuming v is positive. v(1836/53) Simplify ((c/(c*(-3/10)/c))/(ccc/c9cc))30 assuming c is positive. c189 Simplify (ss(1/8))(40/9) assuming s is positive. s5 Simplify ((q(-5)q)/q0)/(qq*(-2/11)qq)(15/8) assuming q is positive. q(-817/88) Simplify (o/(oo(-1/3)/o))(26/3)/(o*(-7)(oo(4/3))/ooo) assuming o is positive. o(137/9) Simplify y(-7)/yy(-4/15) assuming y is positive. y(-124/15) Simplify (k0)(9/8) assuming k is positive. 1 Simplify (www(1/14))/w(2/23) assuming w is positive. w*(639/322) Simplify (bb(-4))(-3/4) assuming b is positive. b*(9/4) Simplify (vv*(-2)v6)(-2/69) assuming v is positive. v*(-10/69) Simplify (q/(qq/(q(((qq*2)/q)/q)/q)))/(qqq(-2/7)q)q(-2/7)/(qq*(-1/2)q) assuming q is positive. q(-9/2) Simplify d(1/4)(dd(-5/2))/d assuming d is positive. d(-9/4) Simplify (n3/(n0n))(-4/3) assuming n is positive. n(-8/3) Simplify o(-4/13)(o/(o(o(1/11)o)/o))/o assuming o is positive. o*(-200/143) Simplify (p/(p/(p/(pp*(-2)p))pp))*(-4)p*(-2/11)/(p/(pp*(-2/7)pp)p) assuming p is positive. p*(349/77) Simplify ((h/(hh*(-2/3)))/hh)/(h*(2/23)/hh) assuming h is positive. h*(40/69) Simplify (ff/((f(f/f(-2/7))/fff)/f)f)*27(f6/f)/(f/(f/f(1/8))) assuming f is positive. f(1353/56) Simplify (h/h(-1/3))(-1/35) assuming h is positive. h(-4/105) Simplify (z/(zz(1/4))zz(-2/7))/((zz/z(-3/7))/(z/z(-2/7))) assuming z is positive. z(-19/28) Simplify (((b(-3/2)b)/bbb)/b)/b(-2/23) assuming b is positive. b(-19/46) Simplify (r23r)(-3/16) assuming r is positive. r(-9/2) Simplify (k/(k/(kk(k/(kk/(k/(k/(k(-23)k)kk))k)k)/kkk)))/(k/(((kk/(k/(kk*10/kk)))/k)/kk)kk) assuming k is positive. k(-14) Simplify ((rr*(-2)r)/(r*(1/3)r))/(r*(-1/2)r)(-13) assuming r is positive. r(31/6) Simplify f(4/7)/(f(-3/2)ff)(f/((ff/((f*(-1/2)ff)/f))/f))(-2/39) assuming f is positive. f(25/546) Simplify (h/h11)/h(-1) assuming h is positive. h(-9) Simplify f(-1/13)f(-2/3) assuming f is positive. f(-29/39) Simplify aa1aaaa7 assuming a is positive. a12 Simplify (d1)(-33)/(d/d(1/3))3 assuming d is positive. d(-35) Simplify n(-2/17)n(-1/32) assuming n is positive. n(-81/544) Simplify s*9s(s(-4/7)s)/s assuming s is positive. s(66/7) Simplify (b(-2/5))*(-4/17)b*(2/13)b/(b/(b/(b(b/(b/b(2/7)))/b))) assuming b is positive. b(7443/7735) Simplify ((p(-2/5))13)(2/5) assuming p is positive. p(-52/25) Simplify (d/(dd*(3/2)d)dd)/(d/d*(2/3))d5/d7 assuming d is positive. d*(-17/6) Simplify ((t((ttt/t*(-2/7))/t)/ttt)0)(12/7) assuming t is positive. 1 Simplify (((l/(ll*(-2/23))ll)/l)/l15)(-18/7) assuming l is positive. l(5760/161) Simplify v7/v(-6/5)(v1)(-2/13) assuming v is positive. v*(523/65) Simplify ((ss*(1/9)s)/s)/(s/(ss(-1/45))) assuming s is positive. s(49/45) Simplify p(-4/5)/((pp*(-3/13))/ppp) assuming p is positive. p(-167/65) Simplify (uu*22)/uuuu(1/4)/u assuming u is positive. u(93/4) Simplify (gg(-1/3)ggg)*50/(((gg/(gg0))/g)/g)26 assuming g is positive. g(628/3) Simplify (vv*(2/7)/vvv)(-7)vv(2/9)v*(3/5)v assuming v is positive. v*(-593/45) Simplify (ww(-1/3))(-25)/(w*3www(-2/23)) assuming w is positive. w(-1489/69) Simplify q*(-1/2)q*(4/7)(qq(2/5))/q4 assuming q is positive. q(-177/70) Simplify (i/(i(i*4/i)/ii))/(i/(((i/i*7)/i)/i)i)(ii/(((ii/i(2/7))/i)/i))46 assuming i is positive. i(645/7) Simplify p/(p(1/25)/p)p3/p assuming p is positive. p(99/25) Simplify (w(-7/2)/(w(4/3)w))/(w1/w)(6/23) assuming w is positive. w(-35/6) Simplify (p(-2/5))(-44)/(pp*6p*(1/3)/ppp) assuming p is positive. p(139/15) Simplify ((tt/(t/t(2/3)))/(t/t(-3)))/(t*(2/3)t)(1/8) assuming t is positive. t(-61/24) Simplify u/u*(-4)u(u/(uu/(u/(u*(-4/5)u))))/u assuming u is positive. u(24/5) Simplify m(-5)/(m*(-4)/m)(m(-2))(4/19) assuming m is positive. m*(-8/19) Simplify yy*(2/3)y/(y*(1/3)y)(((yy*(-1/3))/y)/yy)12 assuming y is positive. y(-8/3) Simplify u*(-43)((uu18u)/u)/u assuming u is positive. u*(-25) Simplify (oo*5)/(o/(o/(oo*(7/2)))oo) assuming o is positive. 1/sqrt(o) Simplify (g(-1/2)gg)/(gg/((g/((gg(-8/5)/gg)/g))/g)g)(g/g(-3/11))/g4 assuming g is positive. g*(-289/110) Simplify rr*(-14)r(-7) assuming r is positive. r(-20) Simplify ((j(3/8))12)37 assuming j is positive. j(333/2) Simplify (w*(-3/2)w*(6/7)/ww)(-1/20) assuming w is positive. w(9/280) Simplify (u(u/u(-16/7)u)/uu)/(u/u(4/13)) assuming u is positive. u(418/91) Simplify (a/(a/a(-1/5)))(37/2) assuming a is positive. a(-37/10) Simplify r/(r/(r/((r(-5/3)/r)/r)))r/(r*(-4/7)r)r(-2)r5 assuming r is positive. r(173/21) Simplify ((f/(f/f*11))/ff6)46 assuming f is positive. f736 Simplify (v15)(-4/11) assuming v is positive. v(-60/11) Simplify u(-1/8)/(u(1/2)u) assuming u is positive. u(-13/8) Simplify (v(-4/9))(-3/4) assuming v is positive. v(1/3) Simplify ((y(-2/45)/y)/y)41 assuming y is positive. y(-3772/45) Simplify (((o/(o/(o0/o)))/o)/o)/o8 assuming o is positive. o(-11) Simplify (q(-6)q)/qq9 assuming q is positive. q3 Simplify (u(1/4))6/(u(-3/2)u/(u/(u(-6)/u))) assuming u is positive. u10 Simplify ((g*(-1/11)g)/g)(-50) assuming g is positive. g(50/11) Simplify s*(-6)ss(-5/2)/ss assuming s is positive. s*(-15/2) Simplify p(pp(-14))/pp(-5) assuming p is positive. p(-18) Simplify ((nnn/(n*(-2/5)n)n)(1/23))(-18) assuming n is positive. n(-306/115) Simplify (pp*(-11)p)/p12 assuming p is positive. p(-21) Simplify (b(b(1/3)/bbb)/b)(-16)/((b/(b(-2/17)b))/b(-1/2)) assuming b is positive. b(-2239/102) Simplify p(-3/2)/(p/(p/(p21p))) assuming p is positive. p(-47/2) Simplify (ww/(w/w*10))/((ww/w*(3/5))/w)((w/(wwww(1/2)ww))/w)*41 assuming	{ "pile_set_name": "DM Mathematics" }
escending order. 4/7, k, 0 Suppose 6v = 5v. Sort v, 1, -5 in ascending order. -5, v, 1 Let d = -2 - 1. Let s = -10 + 14. Sort -2, s, d in descending order. s, -2, d Let d = -4 + 4. Let p = d - 2. Let x be (-15)/25 + p/5. Put 2, x, -5 in increasing order. -5, x, 2 Let a(j) = -2j + 7. Let w be a(6). Let p(i) = -i2 - 4i + 5. Let b be p(w). Put -4, -5, b in increasing order. -5, -4, b Suppose -4z - z = 20. Let a(j) = -j - 2. Let o be a(-5). Suppose w - 3t - 25 = t, ow = -5t - 10. Sort w, -1, z in increasing order. z, -1, w Let v = -12 - -2. Put v, -4, -1 in ascending order. v, -4, -1 Let k(n) = n*3 - 7n*2 - 2n + 10. Let h be k(7). Put h, 0, -2 in decreasing order. 0, -2, h Suppose -5x + 3x + 2 = 0. Sort 0, x, -3 in descending order. x, 0, -3 Let t = -0.1 + -4.9. Put 3, t, -2/7 in ascending order. t, -2/7, 3 Let o(r) = -r*2 + 7r + 5. Let y be o(7). Let p(j) = 0j3 + yj2 + 3 - j3 - 4j2. Let w be p(0). Sort -2, w, 5. -2, w, 5 Let p be 4 + 0 + (-2 - -1). Let l(x) = 3 + 10 - x - 7. Let j be l(p). Sort 4, j, -1 in decreasing order. 4, j, -1 Let k = -1/26 + 7/13. Let c = 1 + 0. Let o = 0 + c. Sort o, k, 0.1 in ascending order. 0.1, k, o Let l = 0.82 - 0.12. Let d = 0.3 + l. Sort 1/2, 1/5, d in decreasing order. d, 1/2, 1/5 Let w = -3 + -7. Let a = w + 8. Sort -0.1, a, 3 in ascending order. a, -0.1, 3 Let p(w) = -13w*3 + 2w*2 + 2w + 1. Let s be p(-1). Suppose s = -5b + 4, -3l = -4b - 14. Put -1, 0, l in decreasing order. l, 0, -1 Let n be -64/(-6) - 0/4. Sort n, 2, 1, -2 in descending order. n, 2, 1, -2 Let y = 13 + -12.8. Put -0.3, -3, y in increasing order. -3, -0.3, y Let h be (-10)/14 - (-12)/(-42). Suppose -19 = -3l + d, -2l - 6 = -d + 5d. Suppose 4z - 3z = -4. Sort l, h, z. z, h, l Let m be (-28)/(-98) - (-23)/(-7). Sort m, 4, -4. -4, m, 4 Let a(p) = 3p + 1 - 4 - 2p2 + 4 - 3 - p3. Let g be a(-3). Let l = 1 - -2. Sort g, l, -5. -5, g, l Let n = -18 + 13. Let c = -11 + 13. Put c, n, -2 in increasing order. n, -2, c Let h be 6/((-1)/(-1)-2). Let p be (1 + h)(-12)/8. Put p, 2, -5 in increasing order. -5, 2, p Suppose -3x + 8x + 10 = 0. Let z(l) = -1 + 2l + 4l2 + 1 + l3 + 3. Let a be z(-4). Put x, a, 4 in descending order. 4, x, a Let w = 4 + 0. Suppose -4j = -2n - 8, -4n = -4 - 4. Suppose -23 = -jy - 8. Put w, 0, y in increasing order. 0, w, y Let p(v) be the first derivative of 7v - 1/2v2 - 2. Let j be p(6). Put -5, 5, j in decreasing order. 5, j, -5 Let i be (-6)/14(-7)/(56/8). Sort -5, 1/5, i, 1/10. -5, 1/10, 1/5, i Let f be (-4)/12 - (-3)/9. Suppose -q + 18 = 4c, 0 = -q + 2q + c - 3. Sort f, q, -5 in decreasing order. f, q, -5 Let h(k) = -k*3 - 3k*2 + 6k + 2. Let z be h(-4). Let j be (30/9 - 0)102/68. Sort z, j, -3. z, -3, j Let t(l) = -l2 - 3l + 2. Let a be t(-2). Suppose 6 = ad + 18. Let i be 80/(-15) + (-2)/(-6). Sort i, 5, d in decreasing order. 5, d, i Let x = -7 + 7. Suppose -1 = -h - x. Put 3, h, -4 in descending order. 3, h, -4 Let g be (-2305)/(-7950) + 2/(-6). Let a = g + -3/53. Let p = 4 + -5. Put a, -4, p in decreasing order. a, p, -4 Let c = 187 - 932/5. Suppose n - 2n = 6. Let r = -5 - n. Sort r, c, 0.3 in ascending order. 0.3, c, r Suppose 2 = 3w - 2w. Put w, 11, 3 in increasing order. w, 3, 11 Let y be 4 + (-4 - 0) + 1. Suppose 2l - 5m + 0m - 10 = 0, -5l = -2m - 25. Sort l, y, 3. y, 3, l Suppose 2a = 2 + 2. Suppose a = 5c - 8. Suppose 0 = ck - 5n - 1 - 4, 0 = -5k + 4n + 21. Sort k, -3, -2 in decreasing order. k, -2, -3 Suppose 4n - 25 = -5c, 5n - c - 41 = -4c. Let u be 41(-5)/n. Let t = 3 - 0. Put u, -3, t in ascending order. -3, u, t Let v(a) = -a2 + 21. Let s be v(5). Sort s, 5, -3, 11. s, -3, 5, 11 Let i = -0.2 - -0.3. Let q = -0.7 - -6.9. Let l = 1.2 - q. Put l, i, -1 in increasing order. l, -1, i Let a = -1.5 + -16.5. Let x = a - -13. Let s = 8 + x. Sort s, -1/3, -1/5. -1/3, -1/5, s Let j be (-11)/(-15) + 6/10. Suppose 3t + 7 = 3y + y, 0 = -5y + 5t + 5. Sort j, y, 0.5. 0.5, j, y Let h = 70 + -69.9. Put h, 2, -4 in increasing order. -4, h, 2 Let j = -2 + 8. Sort 1, -2, j. -2, 1, j Let k(q) = q2 + 18q + 27. Let d be k(-16). Put 4, d, 2 in ascending order. d, 2, 4 Suppose 3 = -6j + 3j. Suppose -5 = 4a + 3. Put j, a, 1 in descending order. 1, j, a Let h = -0.12 + -1.18. Put -1, 1, 3, h in ascending order. h, -1, 1, 3 Let f = 64 - 64.06. Sort -0.5, -3, f in decreasing order. f, -0.5, -3 Let k be 2 + 13/3. Suppose z - 6 = 3z, 0 = w - kz - 11. Suppose -30g + 10 = -32g. Sort w, g, -4. g, -4, w Let z(r) = -r*2 - 9r - 4. Let b be z(-10). Let y be 1/(3/(b - -2)). Put 3, y, 5 in ascending order. y, 3, 5 Let r = 8.6 + -9. Sort r, -0.5, -1 in descending order. r, -0.5, -1 Let x(t) = t + 8. Let l be x(-4). Let f be -6 + 62/l. Let p = 7 + f. Sort p, 0, -1. -1, 0, p Let o(s) = s2 - 6s - 9. Let k be o(7). Let t = 5 - 3.8. Let l = t + -1. Sort k, -3, l. -3, k, l Suppose -3k + 5 + 1 = 0. Suppose 5h - 15 = kh. Sort h, -3, -5 in ascending order. -5, -3, h Let j(k) = k3 + 9k*2 - 21k - 23. Let s(n) = -n*3 - 8n*2 + 22n + 24. Let q(u) = -6j(u) - 5s(u). Let x be q(-15). Sort -1, x, -2 in increasing order. -2, -1, x Let s be (1 - 2)2/(-2). Let v(i) = i3 - 5i*2 + 2i + 5. Let g be v(4). Sort s, g, 2 in increasing order. g, s, 2 Let l be 3/(15/(-10) - 0). Sort l, -3/4, 4.9 in decreasing order. 4.9, -3/4, l Suppose 13v = 5v - 40. Let b be (1 + 7/(-5))5. Let u be b + 1 + 1 + 1. Put v, -3, u in descending order. u, -3, v Let r = -24 + 22.7. Let y = r - -3.3. Sort -0.4, y, 1 in decreasing order. y, 1, -0.4 Suppose -q - 4 = 5h, -5q + h + 0h - 20 = 0. Put 5, -11, q, 1 in ascending order. -11, q, 1, 5 Suppose 5k - 30 = -2d, 3d = 2k + 6 + 58. Suppose 0 = 4m + 4y - 3 - 9, 5y = d. Put -3, m, -2 in ascending order. -3, -2, m Let q be 603/1 + (-2)/2. Let k be ((-20)/35)/((-12)/q). Let t = k + -28. Put t, 0.5, 0 in descending order. t, 0.5, 0 Suppose -5w = -5 - 10. Let k(z) = 39z2 - 38z*2 - 2 - 1. Let a be k(2). Put w, a, -2 in increasing order. -2, a, w Let a be (-4)/14 + (-48)/(-21). Put -8, a, 1 in decreasing order. a, 1, -8 Let p be 75/6(-174 - -2). Let k be (-4)/6 + p/(-21). Let o = -102 + k. Put o, -1/4, -1 in descending order. -1/4, o, -1 Suppose 0 = -6c + 3c + 12. Sort 4/7, 0.4, c. 0.4, 4/7, c Let u(l) = 4l - 3. Let c be u(1). Put -2, c, -1, 0 in decreasing order. c, 0, -1, -2 Let z = 5.1 - 5. Let i = 0.5 - z. Sort i, 3, -2/9 in ascending order. -2/9, i, 3 Suppose 4a = 15 + 17. Let o be a/5 - (-4)/10. Suppose 0 = -5k + 7 - 2. Sort 0, o, k in decreasing order. o, k, 0 Suppose i - 6 = -3n, -4 = -n - 1. Let b(w) = -w*2 - 10w - 2. Let g be b(-10). Put g, 4, i in increasing order. i, g, 4 Let q = -2063/16 - -129. Put -1/2, q, 2/9 in ascending order. -1/2, q, 2/9 Let j(p) = -11p3 + p2. Let v be j(1). Let q = -6 - v. Let w = -2 + q. Sort w, -3, 1 in descending order. w, 1, -3 Suppose 5j - 3 - 3 = -2n, -9 = -3n - 3j. Let d be (-2)/115/(-6). Put n, 2, d in descending order. d, n, 2 Let a = -96 + 96. Sort -4/9, a, -2/3 in ascending order. -2/3, -4/9, a Let f be (-6)/8(-24)/9. Sort 1/6, f, 5. 1/6, f, 5 Suppose -w + 3q = 20, 30 = -3w - q + 4q. Put -2, 1, w in descending order. 1, -2, w Let j(n) = n*3 - 2n*2 + 1. Let d be j(1). Put d, -8, 3 in decreasing order. 3, d, -8 Let a be ((-2)/(-5)5 - 9) + -3. Sort a, 0.2, 5. a, 0.2, 5 Let l = -0.72 - -4.82. Sort -1, -1/8, l in descending order. l, -1/8, -1 Suppose 17 = -7g - 18. Sort 12, -3, g in increasing order. g, -3, 12 Suppose 3t - 3 = 2t. Put t, 11, -5 in increasing order. -5, t, 11 Suppose p = -p - 3a - 7, -3p + 2a = 17. Let t(v) = 2v + 30. Let q be t(-13). Put p, -2, q in descending order. q, -2, p Let o = 10 + -8. Let x = o + 2. Suppose -5t = -4i, 0 = -xi + i - t. Sort -5, 3, i in ascending order. -5, i, 3 Suppose 6r - r = 0. Suppose r = -2a - 2a. Put a, 1, -5 in descending order. 1, a, -5 Let s(r) = r + 6. Let h be s(0). Let b be (-32)/h + (-8)/(-24). Sort b, -3, -1 in ascending order. b, -3, -1 Suppose 7 = -3z - 2i - 4, -3z - i - 10 = 0. Let h = -11.1 + 2.6. Let f = -8 - h. Sort -1, f, z. z, -1, f Let m be (-3 - -4) + (-9)/12. Let s = -1/175 + 8927/350. Let w = -25 + s. Put m, 0.4, w in increasing order. m, 0.4, w Let m	{ "pile_set_name": "DM Mathematics" }
i + 1 - 9i + i + si. What is r(n)? 11 Let x(p) = 4 + 4 + p*3 - 6p + 2p2 - 6 + 3p2. Let o(h) = -h + 5 - 5 + h3. Let b be o(-2). Give x(b). 2 Let q = -14 - -16. Suppose p = 5f + 38, 2f - 3f - q = -3p. Let t(a) be the second derivative of a*3/3 + 5a*2/2 + 8a. What is t(f)? -11 Let v(j) = -4j - 22j + 17341j2 + 13 - 17348j2 + j3 + 4j. Calculate v(9). -23 Let d(p) = 11p - 79. Let i(k) = -k*2 - 85k + 8. Let s be i(-85). Determine d(s). 9 Let g(l) be the first derivative of 1/4l4 + 3l*3 + 79 - 11l + 7/2l2. Calculate g(-8). -3 Let x(s) = 8s + 1. Suppose 4h - 13 - 181 = 2u, 5u = 2h - 109. Let q be (-2 + (2 - h))-1. Suppose 3n = -q + 41. Give x(n). -15 Suppose 22f - 4b = 21f + 346, 4f = 3b + 1397. Let i(r) = -1 + fr2 + r3 - 708r2 + 352r*2. Calculate i(6). -1 Let g(f) = 3f*3 + 5f*2 - 5f. Let q be g(3). Suppose -7p + 937 = q. Let r(s) = 7s - p + 113 - 6s. Calculate r(5). 0 Let m(b) = b - 1. Let r(u) = 1. Let q(c) = 5m(c) + 4r(c). Let v(i) = i2 + 14i - 46. Let a be v(-17). What is q(a)? 24 Suppose -128s + 12642 = -386s. Let t(u) = -4u - 192. Determine t(s). 4 Let m(f) = 7f + 19. Let o = 12671 - 12663. Give m(o). 75 Let g(w) = w*3 + 2w*2 - 5w - 3. Let j be (-225)/(-45) - (5/5 - (-1 - -1)). Determine g(j). 73 Let i(s) be the second derivative of 3/2s2 + 5/6s*3 + 1/3s*4 + 2s + 15. Give i(-3). 24 Suppose -20 = 2n - 2h, -3n = 6h - 3h. Let b be (((-4)/n)/2)/(12/60). Let i(z) = 3z*b - 2z*2 + 6z + 31 - 34. What is i(-5)? -8 Let w be 1666/(-21)15/(-10). Let b = -127 + w. Let i(j) = -j - 1. Calculate i(b). 7 Let p(q) be the third derivative of q4/24 - 25q*3/6 - 14q*2 - 81. Calculate p(11). -14 Let d(x) = -3x*2 - x. Suppose -2w + 384 = -8w. Suppose 2u + 44 - 36 = 0. Let j be 3/u(w/12 + 4). Give d(j). -4 Let l(v) be the second derivative of 11v*3/6 + 55v*2/2 + 5481v. Determine l(-8). -33 Let g(m) = m*2 - 8m + 2. Let z be 10/(-2 - 27/(-12)). Suppose 0 = 5x - 6x. Suppose x = 6t - 8 - z. Calculate g(t). 2 Let a(g) = 215g - 655g + 213g - 2 + 222g. Give a(3). -17 Let h(a) be the third derivative of -5a*4/6 - 35a*3/6 - 50a*2 + 45a. What is h(-2)? 5 Let h(r) = 2r2 - r - 5. Let d(y) = 11y*2 - 14y + 42. Let c(u) = -d(u) + 6h(u). Determine c(5). -7 Let j(u) = 174u - 1470. Let v(f) = 11f - 91. Let i(s) = -2j(s) + 33v(s). Calculate i(4). -3 Let s(i) = i2 - i + 2. Suppose -2z = 5v + 1, -z - 755v = -757v + 5. Suppose 94 = -3t + d + 1, 5t + 3d + 169 = 0. Let k be z/4 + 40/t. Calculate s(k). 8 Let x(t) be the second derivative of t*5/20 + 3t*4/4 + 4t*3/3 - 5t*2/2 + 11t. Suppose 7q = 9q - 74. Let p = q + -45. What is x(p)? -5 Let y(o) = 17o3 + 6o*2 - 5o + 3. Let v(a) = 25a3 + 7a*2 - 7a + 1. Let x(i) = -2v(i) + 3y(i). What is x(-6)? -59 Let q(x) = x*2 + x. Suppose 0 = -7j + 8j - 7. Let d be (1 - j)/((-3)/(-2)) - -4. Give q(d). 0 Let t(i) = -13 + 4i - 9i - 14 + 0i - 18. Calculate t(-8). -5 Let x(u) = -20u2 - 32u + 68. Let m(p) = -25p2 - 40p + 87. Let g(r) = 9m(r) - 11x(r). Determine g(3). -34 Let p(q) = 17q3 + 9q*2 - 27q + 11. Let s(k) = -5k3 - 4k*2 + 9k - 4. Let r(g) = -2p(g) - 7s(g). Give r(-11). -16 Let v(q) = q*2 - 5q - 1. Let b be v(4). Let t be 0/((-9)/155). Let z(f) = -2 + 8f2 + f3 - 6f2 + tf*2 - 7f + f2. Determine z(b). -17 Let x(z) = z3 - 4z2 + 4z - 1. Let t(g) = -784g2 - 5g - 4. Let c be t(-1). Let f = 786 + c. Give x(f). 2 Let x(b) = -50b - 40. Let m be (1/(-4))/((-10045)/(-196) + -51). What is x(m)? 10 Suppose 17 + 81 = 4t + 18i, -5t - 5i = -35. Let u(y) = y3 - 8y*2 + 6y + 9. Let g be u(7). Let w(d) = -gd + 0d*3 + 3d2 + d3 - 2d3. Give w(t). 0 Suppose 0 = 3x + 3. Let n(t) = -5t + 23. Let c(a) = -43a + 219. Let h(b) = -2c(b) + 19n(b). Give h(x). 8 Let u(p) be the third derivative of 0 + 1/6p4 - 141p*2 + 0p - 1/2p3. Determine u(-4). -19 Let d(z) = z + 7. Let o(l) = 2l - 60. Let w be o(35). Suppose 0 = -wc - 16c - 104. What is d(c)? 3 Let z(h) = 35h2 + 11h + 15. Let s(c) = -19c2 - 5c - 7. Let v(u) = 13s(u) + 6z(u). Determine v(-1). -39 Let a(r) = -r3 - r2 + 10r + 1. Suppose 0 = 5z + 11z + 37 + 43. What is a(z)? 51 Let r(t) = t - 2. Let k(v) = v3 - 18v*2 + 35v - 17. Let p(o) = -k(o) + 2r(o). Give p(16). -3 Let x be (-3 - -146/12) + -14. Let w(v) be the third derivative of -1/8v*4 + xv - 21v2 + 0 + 1/60v*5 + 1/2v*3. Calculate w(3). 3 Let w(f) be the second derivative of 217f - 1/2f2 + 0 + 1/20f*5 - 13/6f*3 - 5/12f*4. Determine w(7). 6 Let p(d) = -11d - 260. Suppose -4z + 4 = 2w + 116, 106 = -4z - w. Calculate p(z). 15 Let g(p) = p3 - 18p*2 - 2p - 322. Let k be g(19). Let n(c) = 48c - 52. Determine n(k). -4 Let i(l) = l2 + 2l - 1. Let p(w) = w*3 + 12w*2 - 9w - 19. Let b be -10 - 1/((-1)/(-2)). Let f be p(b). Let d = f - 91. Give i(d). -1 Let r(w) be the third derivative of -w5/60 - w4/8 + w3/2 + w2. Let f = -772 + 386. Let p = -391 - f. Calculate r(p). -7 Let r(l) = -15l + 4l + l*3 + 11l + 3 + 3l + 7l*2. Let x be r(-5). Let f(t) = 1 + 3t + 73t2 - 36t*2 - xt*2. Determine f(-2). -9 Suppose 2w + 5 = -9. Let u(s) be the second derivative of -s6/720 - s5/120 + 70s4/3 + 278s. Let f(i) be the third derivative of u(i). Determine f(w). 6 Let u(t) = -9 - 1200t + 3608t - 1204t + 30 - 1196t. Determine u(0). 21 Let z(g) = -3g - 62. Let h be z(-24). Suppose -hq - 120 = 10q. Let i(x) = x + 7. What is i(q)? 1 Let n(d) = 7d*2 - d + 22. Let f(k) = -19k*2 + 2k - 67. Let w(r) = -4f(r) - 11n(r). What is w(-4)? -2 Let l = 4 + -11. Let d(j) = 10j + 240. Let z be d(16). Let g(a) = -8a*2 - 778 + 388 + z - 5a - a*3. Give g(l). -4 Let d(h) = -2h*3 + 12h*2 - 9h - 3. Suppose -318b = -320b + 10. Suppose 5l - bp = -p + 21, 2p = 4l - 18. Determine d(l). 2 Suppose -u = -4m + 20, -25 = -7u + 3u - 5m. Suppose u = d - 243 - 82. Let n(a) = 0a - d + a + 318. Determine n(10). 3 Let x(b) = b3 + 5b*2 + 5b + 7. Let r = -501 + 498. Let l be (-5 + 20/3)r. Give x(l). -18 Let v be (-4404)/4037(-3)/(12/22). Let z(b) = -b + 21. Calculate z(v). 15 Let c(v) = 34v2 + 11v*2 + 0v + 2v + 53 + v3 - 33v*2 + 22v*2. What is c(-34)? -15 Let f(s) = -16s - 111. Let t be 5/(-2)2640/825. What is f(t)? 17 Let z be 92/28 + 1/((-7)/2). Let k(m) = -28m + 14m - z + 6m. Calculate k(3). -27 Let i(p) be the first derivative of p5/60 - p4/6 - 67p3/3 - 22. Let x(w) be the third derivative of i(w). Determine x(4). 4 Let x(a) be the third derivative of -a5/60 - a4/3 - 5a*3/3 + 5a*2. Suppose -u + 1 = n, 295n - 293n - 56 = 4u. Give x(u). -19 Let j(z) = -7z + 10 - 55 + 120 + 3z2 - 48 - 47. Give j(-6). 130 Let h(l) be the third derivative of -l5/15 - l*4/2 + 2l*3 + 6539l*2. What is h(-5)? -28 Let x(b) = 20b - 4. Suppose -59m + 54m = -4g - 17, -5g - 12 = 3m. Give x(m). 16 Let l(t) be the third derivative of 0 + 0t - 1/6t3 - 21t*2. Let q(m) = 4m + 2. Let n(x) = -6l(x) - q(x). What is n(3)? -8 Suppose -34k + 31k = u + 16, 3u + 4k = -28. Let t(n) = 4n + 66. Calculate t(u). 50 Let g(l) = -2l - 1. Let m be ((-7)/(-98)7)/(1/(-2)). Let c(f) = 14f + 4. Let b(p) = mc(p) - 6g(p). What is b(-1)? 4 Let i(w) = 31w + 145. Let c(d) = 33d + 178. Let f(x) = -5c(x) + 6i(x). Determine f(2). 22 Let m(w) be the second derivative of -w5/20 + 2w*4/3 - 5w*3/2 + 28w*2 - w - 3188. Determine m(7). 0 Suppose p - 3p - 20 = 0. Let b(g) be the second derivative of g*5/20 + 11g*4/12 + 3g*3/2 - 7g*2/2 - 43694g. Determine b(p). 3 Let c be 37/((-63)/150). Let x = -106 - c. Let y = -67 - x. Let p(n) = n - 1. Give p(y). -12 Let u = 16151 + -16154. Let c(j) = -j3 - j2 + 11j + 8. Determine c(u). -7 Let a(c) = -6c + 251 - 334 + 112. What is a(5)? -1 Let n(l) = -45l + 821. Let x(h) = -2h2 - 9h + 36. Let p be x(-6). Determine n(p). 11 Let k(y) be the third derivative of -y*5/20 + 7y4/24 + y3/6 - 9y2 - 13. Let t(o) = o3 + 5o*2 - 7o - 3. Let z be t(-6). Determine k(z). -5 Let z(m) = 49m + 7. Let f = 2137 - 2139. Determine z(f). -91 Let n be ((-18)/(-6) - 5) + -14. Suppose 12 =	{ "pile_set_name": "DM Mathematics" }
.000044161 rounded to 7 decimal places? 0.0000442 Round -907.6 to the nearest one thousand. -1000 Round -0.03990956 to 2 dps. -0.04 Round -1288145650 to the nearest one hundred thousand. -1288100000 Round 1.963104 to two decimal places. 1.96 Round 0.0000427063 to seven dps. 0.0000427 Round 86.532 to the nearest integer. 87 Round -259.5723 to 0 dps. -260 Round -299.4556 to 1 dp. -299.5 What is -0.5555 rounded to 1 dp? -0.6 What is 5638330 rounded to the nearest one hundred thousand? 5600000 What is -0.000005727192 rounded to seven dps? -0.0000057 What is 697.15544 rounded to one dp? 697.2 What is -291464.9 rounded to the nearest 100? -291500 Round 0.035861172 to three decimal places. 0.036 What is 13.603205 rounded to one dp? 13.6 What is -7153.8 rounded to the nearest 10? -7150 Round -0.0012052087 to six dps. -0.001205 Round 145333600 to the nearest 10000. 145330000 Round -10.29235 to the nearest 10. -10 Round 257147.53 to the nearest one thousand. 257000 Round 0.0000276982 to 5 decimal places. 0.00003 What is -7.06713 rounded to two dps? -7.07 What is 11563.023 rounded to the nearest one hundred? 11600 Round 1049682 to the nearest one hundred thousand. 1000000 Round -2.6293752 to 3 decimal places. -2.629 What is 13118.1839 rounded to the nearest 1000? 13000 What is -0.000889503 rounded to 5 dps? -0.00089 Round 29374.7 to the nearest 1000. 29000 What is 0.0087508301 rounded to 3 dps? 0.009 Round -0.1906927 to 4 decimal places. -0.1907 What is -0.01640208 rounded to 4 decimal places? -0.0164 Round -6.2594 to 1 dp. -6.3 Round 11024820 to the nearest one million. 11000000 What is -7.8653 rounded to 2 dps? -7.87 Round -896114 to the nearest 10000. -900000 Round -112723.3 to the nearest 1000. -113000 What is -134944800 rounded to the nearest ten thousand? -134940000 What is -0.06911279 rounded to 2 dps? -0.07 What is 14622.13 rounded to the nearest 1000? 15000 What is -0.001093424 rounded to 4 decimal places? -0.0011 Round -16950.99 to the nearest ten. -16950 What is 2433070.8 rounded to the nearest 100000? 2400000 Round 0.086381 to 1 dp. 0.1 What is 0.232776 rounded to two dps? 0.23 What is 433100 rounded to the nearest one thousand? 433000 What is -0.00016150175 rounded to six decimal places? -0.000162 Round -16.98404 to 1 dp. -17 What is -0.00000010513 rounded to seven dps? -0.0000001 What is 0.0000131125 rounded to 5 decimal places? 0.00001 What is 0.002453825 rounded to six decimal places? 0.002454 What is -1989266 rounded to the nearest one hundred thousand? -2000000 Round -0.0000149048 to seven decimal places. -0.0000149 What is 17997170 rounded to the nearest ten thousand? 18000000 Round 1.983053 to one dp. 2 Round 85563540 to the nearest 100000. 85600000 Round -130.16604 to one dp. -130.2 Round -1810805 to the nearest one thousand. -1811000 What is 0.3494508 rounded to 2 decimal places? 0.35 What is 13534387 rounded to the nearest one million? 14000000 Round -319.9678 to the nearest integer. -320 What is 0.000013749112 rounded to seven dps? 0.0000137 Round -0.15028995 to four decimal places. -0.1503 What is -0.00001030321 rounded to six decimal places? -0.00001 Round 34015791 to the nearest one hundred thousand. 34000000 Round 0.006600394 to 3 dps. 0.007 What is -0.00001348039 rounded to 7 dps? -0.0000135 Round 876.0634 to the nearest one hundred. 900 What is 52.12376 rounded to the nearest ten? 50 What is -1.58398 rounded to 2 decimal places? -1.58 What is 330601 rounded to the nearest ten thousand? 330000 What is -13977.2 rounded to the nearest 100? -14000 Round 0.00560264 to two dps. 0.01 What is -0.000051043 rounded to 5 dps? -0.00005 What is 0.00020972552 rounded to 4 dps? 0.0002 What is 372.79166 rounded to 0 dps? 373 What is 256324 rounded to the nearest one hundred thousand? 300000 What is -70607000 rounded to the nearest 1000000? -71000000 What is -0.082808 rounded to one decimal place? -0.1 Round 673130 to the nearest 100000. 700000 Round 0.000354441 to 6 dps. 0.000354 What is 2.256598 rounded to one dp? 2.3 What is -496.62352 rounded to the nearest 100? -500 What is -0.000351744 rounded to 5 dps? -0.00035 Round 0.00005835526 to five dps. 0.00006 What is -5.7359092 rounded to one decimal place? -5.7 What is -0.0011418853 rounded to 5 decimal places? -0.00114 Round -0.001048364 to five decimal places. -0.00105 What is -523518 rounded to the nearest one hundred thousand? -500000 What is -0.0659178 rounded to 3 dps? -0.066 What is 57072.613 rounded to the nearest one hundred? 57100 Round 433191 to the nearest one thousand. 433000 Round 0.000017986 to 6 decimal places. 0.000018 What is 1245.225 rounded to the nearest 1000? 1000 Round -7655.829 to the nearest 1000. -8000 What is -3430.22 rounded to the nearest 10? -3430 What is -0.00065377 rounded to four dps? -0.0007 Round -0.0328185 to five dps. -0.03282 What is 610260000 rounded to the nearest one million? 610000000 Round -1139.738 to the nearest 10. -1140 What is 11.9285 rounded to zero dps? 12 What is -1605507 rounded to the nearest 100000? -1600000 What is 48351.4 rounded to the nearest 1000? 48000 What is -0.0000287589 rounded to 7 decimal places? -0.0000288 Round -0.00116597 to 6 dps. -0.001166 Round 0.0017005 to 2 dps. 0 What is 1.814433 rounded to 3 decimal places? 1.814 Round -25443.907 to the nearest one hundred. -25400 Round -3876.05 to the nearest one hundred. -3900 What is -4775932 rounded to the nearest 10000? -4780000 Round 0.0001703181 to seven decimal places. 0.0001703 What is 0.000343903 rounded to six decimal places? 0.000344 Round -18435.93 to the nearest one thousand. -18000 What is -102603000 rounded to the nearest one million? -103000000 Round 28616.733 to the nearest one hundred. 28600 What is 0.03461662 rounded to four decimal places? 0.0346 What is 0.00008114159 rounded to four dps? 0.0001 What is 3073.2671 rounded to the nearest ten? 3070 What is -625591 rounded to the nearest one thousand? -626000 Round -19888000 to the nearest 100000. -19900000 What is 0.00733538 rounded to 3 dps? 0.007 Round 0.0000996659 to seven dps. 0.0000997 Round -0.000000827203 to seven decimal places. -0.0000008 Round -0.02410865 to 4 dps. -0.0241 What is -0.0088731 rounded to 3 dps? -0.009 What is 0.0003735066 rounded to six decimal places? 0.000374 Round -0.0004919923 to 7 dps. -0.000492 Round -361732.8 to the nearest 10000. -360000 Round 48480 to the nearest 1000. 48000 What is -189.403 rounded to one dp? -189.4 Round -21532.783 to the nearest one thousand. -22000 Round 0.00558843 to 3 dps. 0.006 What is -0.00000829141 rounded to seven decimal places? -0.0000083 Round -0.000757731 to 4 decimal places. -0.0008 Round -2182.012 to the nearest 100. -2200 What is 0.003451747 rounded to 3 decimal places? 0.003 What is -29216.41 rounded to the nearest ten? -29220 Round -125590700 to the nearest 100000. -125600000 What is 283.9066 rounded to the nearest integer? 284 What is -0.00459189 rounded to four dps? -0.0046 What is 0.4963343 rounded to 2 decimal places? 0.5 What is -226.83433 rounded to the nearest integer? -227 Round 922.6554 to the nearest 100. 900 What is -292.763 rounded to the nearest ten? -290 What is 661271000 rounded to the nearest 1000000? 661000000 Round -152953.21 to the nearest 100. -153000 What is -3948192.4 rounded to the nearest 100000? -3900000 Round -834.0389 to the nearest 100. -800 What is 182636.47 rounded to the nearest ten thousand? 180000 Round -0.009532258 to four decimal places. -0.0095 What is -0.0670983 rounded to 2 dps? -0.07 What is 0.00020314 rounded to five decimal places? 0.0002 Round -20665400 to the nearest 10000. -20670000 What is -2244082.1 rounded to the nearest one million? -2000000 What is -0.00025800293 rounded to seven decimal places? -0.000258 What is 0.078547331 rounded to two dps? 0.08 Round -662943700 to the nearest 1000000. -663000000 What is 0.000495229 rounded to 4 dps? 0.0005 What is 1.636636 rounded to the nearest integer? 2 Round 6414650 to the nearest one million. 6000000 What is -0.0666282 rounded to three dps? -0.067 What is 1318.288 rounded to zero dps? 1318 What is -0.0003527772 rounded to seven dps? -0.0003528 What is 2010.079 rounded to the nearest ten? 2010 What is -422396 rounded to the nearest one thousand? -42200	{ "pile_set_name": "DM Mathematics" }
nd the common denominator of -1/396 and 61/625104. 6876144 Calculate the least common multiple of 80721 and 3713166. 3713166 Calculate the least common multiple of 769088 and 9456. 2307264 Find the common denominator of -139/17515770 and 13/5838590. 17515770 What is the least common multiple of 600 and 104935980? 1049359800 What is the common denominator of -45/26503 and 101/5693468? 96788956 What is the smallest common multiple of 6530 and 78? 254670 What is the lowest common multiple of 53006 and 131546? 205080214 Calculate the least common multiple of 747446 and 36624854. 36624854 Calculate the common denominator of 43/9212 and -103/8148014. 16296028 Calculate the common denominator of -91/64500 and -89/215250. 18511500 Calculate the common denominator of 15/3152 and 145/1427856. 1427856 What is the common denominator of 74/405871479 and 2/405871479? 405871479 What is the lowest common multiple of 10909451 and 5356? 567291452 What is the least common multiple of 8223806 and 384290? 41119030 What is the smallest common multiple of 252 and 2633652? 2633652 Find the common denominator of 81/19616 and -27/69408764. 555270112 Calculate the lowest common multiple of 2893791 and 7038. 17362746 What is the smallest common multiple of 98731678 and 1? 98731678 What is the smallest common multiple of 425 and 4055265? 20276325 Calculate the common denominator of 157/29718 and 53/737997. 4427982 Calculate the common denominator of -53/42 and -115/1377132. 9639924 Find the common denominator of -121/300950 and 109/120380. 601900 Find the common denominator of 203/165740520 and -151/127248. 331481040 What is the common denominator of -167/26806020 and 41/2680602? 26806020 Calculate the smallest common multiple of 40821 and 45045. 55720665 Calculate the lowest common multiple of 126621833 and 13. 126621833 What is the common denominator of 163/15252288 and 41/3144112? 716857536 Calculate the least common multiple of 3748276 and 56. 7496552 Calculate the smallest common multiple of 1376850 and 1193270. 17899050 Calculate the smallest common multiple of 208480 and 20. 208480 Calculate the smallest common multiple of 15184 and 728832. 728832 Calculate the common denominator of -17/83014855 and -61/7546805. 83014855 What is the smallest common multiple of 1790984 and 20? 8954920 What is the common denominator of -41/2064084 and 199/74119380? 815313180 What is the least common multiple of 36 and 58100? 522900 Find the common denominator of 7/5652 and 83/122720. 173403360 What is the lowest common multiple of 5 and 20970027? 104850135 Calculate the least common multiple of 6 and 12170820. 12170820 Calculate the smallest common multiple of 431365 and 19665. 73763415 Find the common denominator of 121/21804 and -35/1188476. 82004844 Calculate the common denominator of -199/29400 and 55/50323. 30193800 Find the common denominator of 13/12802 and -79/1554. 268842 Find the common denominator of 109/12 and -55/861807916. 2585423748 What is the least common multiple of 352524 and 8352? 8460576 What is the common denominator of 23/77110 and -107/9670? 74565370 Find the common denominator of 17/54 and 17/12169650. 109526850 Calculate the common denominator of -125/1368 and -39/5953802. 214336872 What is the least common multiple of 391104 and 20924064? 41848128 What is the smallest common multiple of 4267874 and 6656? 1092575744 What is the smallest common multiple of 62041708 and 155104270? 310208540 Calculate the lowest common multiple of 564 and 16656. 782832 Calculate the least common multiple of 75305 and 240976. 1204880 Find the common denominator of -1/102 and -6/93127207. 558763242 Find the common denominator of 41/1548016 and 23/13545140. 54180560 Find the common denominator of 7/6 and -43/1749507266. 5248521798 Calculate the smallest common multiple of 3234 and 955108. 2865324 What is the lowest common multiple of 2014728 and 381? 2014728 Calculate the lowest common multiple of 44005122 and 6. 44005122 What is the smallest common multiple of 168 and 112832? 2369472 Calculate the smallest common multiple of 164469 and 2409. 1809159 What is the common denominator of 1/10458 and -79/214306? 13501278 Find the common denominator of -23/22692600 and -43/1620900. 22692600 What is the smallest common multiple of 3737 and 233947411? 233947411 What is the lowest common multiple of 189453658 and 481254? 568360974 Find the common denominator of 127/2094216 and -119/1704. 2094216 What is the least common multiple of 8267 and 186340? 220067540 What is the smallest common multiple of 117349470 and 1190? 117349470 Calculate the common denominator of 36/7986791 and -59/12045652. 734784772 What is the least common multiple of 5579200 and 2789600? 5579200 Find the common denominator of -49/3165 and -37/2257700. 6773100 Calculate the smallest common multiple of 141435 and 402. 18952290 Calculate the common denominator of 31/98067 and 76/22509. 735796701 Calculate the common denominator of -19/31780650 and 83/6356130. 31780650 Calculate the least common multiple of 3053187 and 10177290. 30531870 Find the common denominator of 47/25 and -29/2783930. 13919650 Find the common denominator of 55/3741836 and 48/10290049. 41160196 Calculate the smallest common multiple of 16879840 and 16879840. 16879840 What is the smallest common multiple of 203933166 and 3? 203933166 Calculate the lowest common multiple of 1481076 and 48. 5924304 What is the common denominator of 29/10166 and 83/3933? 1738386 Calculate the smallest common multiple of 51039856 and 7747121. 867677552 What is the least common multiple of 16327256 and 101035? 81636280 What is the least common multiple of 1393 and 6756050? 6756050 What is the least common multiple of 2112 and 422400? 422400 What is the lowest common multiple of 716 and 196048? 35092592 What is the smallest common multiple of 14 and 32708898? 228962286 Calculate the lowest common multiple of 3822005 and 104931410. 1154245510 What is the smallest common multiple of 354750 and 141900? 709500 What is the smallest common multiple of 7443518 and 884? 193531468 What is the lowest common multiple of 2248 and 116819568? 116819568 What is the common denominator of 23/767700 and 37/3838500? 3838500 What is the common denominator of 42/13 and 40/1665087? 21646131 Calculate the common denominator of 6/35401721 and 52/524117. 389418931 Calculate the smallest common multiple of 112 and 331640. 4642960 Calculate the least common multiple of 8814 and 93600. 10576800 Calculate the lowest common multiple of 776445 and 7971502. 119572530 What is the common denominator of -77/654 and -73/4310187? 8620374 What is the smallest common multiple of 2438 and 403489? 806978 Find the common denominator of 79/65753550 and -3/650. 854796150 What is the common denominator of -29/84 and 61/101248? 303744 Find the common denominator of -9/31730 and 13/1615. 539410 Find the common denominator of -87/3524 and 79/16400. 14448400 Find the common denominator of 38/573 and -46/2891. 1656543 Calculate the common denominator of -27/507815 and -81/2640638. 13203190 Calculate the smallest common multiple of 475380 and 90. 475380 What is the lowest common multiple of 10448 and 17216? 11242048 What is the common denominator of 127/12817350 and -79/315? 12817350 Calculate the smallest common multiple of 20136927 and 21. 140958489 Calculate the smallest common multiple of 41885360 and 36649690. 293197520 Calculate the common denominator of -79/53550 and -133/10151550. 71060850 Calculate the common denominator of 139/2072622 and -173/2058. 710909346 What is the smallest common multiple of 496925 and 271050? 2981550 What is the common denominator of -97/3184 and -47/1977264? 1977264 Calculate the lowest common multiple of 72984879 and 24354. 437909274 What is the common denominator of 81/631916 and -47/1088884? 719752324 What is the smallest common multiple of 16318 and 513? 8371134 What is the least common multiple of 5984 and 275946? 75057312 Find the common denominator of 43/3493120 and 71/2619840. 10479360 Calculate the least common multiple of 64 and 196224. 196224 Calculate the least common multiple of 2020 and 1563850. 315897700 Calculate the common denominator of 23/88 and 13/2656632. 2656632 F	{ "pile_set_name": "DM Mathematics" }
Two letters picked without replacement from {o: 5, f: 2, t: 2}. Give prob of picking 2 o. 5/18 What is prob of picking 1 q and 1 p when two letters picked without replacement from {s: 1, z: 1, f: 2, d: 1, q: 1, p: 2}? 1/14 Two letters picked without replacement from {p: 3, h: 1}. What is prob of picking 1 h and 1 p? 1/2 What is prob of picking 1 i and 1 h when two letters picked without replacement from uhihhuhuuhhhhhii? 9/40 What is prob of picking 2 h and 1 r when three letters picked without replacement from hrdhrrhdrrh? 2/11 Three letters picked without replacement from {u: 6, c: 2, d: 1, l: 5, q: 2}. Give prob of picking 1 d, 1 c, and 1 q. 1/140 Four letters picked without replacement from zzksuuzuozssoszoouo. What is prob of picking 1 k, 1 z, and 2 s? 5/646 Calculate prob of picking 1 e and 1 l when two letters picked without replacement from eplpllllplpeleellll. 44/171 What is prob of picking 1 x and 1 f when two letters picked without replacement from {e: 1, v: 1, t: 1, s: 1, x: 2, f: 1}? 2/21 Two letters picked without replacement from yyyyvvvysvy. Give prob of picking 2 v. 6/55 Two letters picked without replacement from denepeeddednedeep. What is prob of picking 2 p? 1/136 What is prob of picking 1 t, 1 u, 1 p, and 1 z when four letters picked without replacement from dzuuuduuuuuuptzdu? 1/119 Two letters picked without replacement from {d: 3, l: 2, n: 1, z: 7, x: 4}. What is prob of picking 1 x and 1 n? 1/34 Four letters picked without replacement from jyyyfjjyyfjj. Give prob of picking 1 f, 2 j, and 1 y. 20/99 Calculate prob of picking 3 o when three letters picked without replacement from koopoxx. 1/35 Calculate prob of picking 1 v and 1 t when two letters picked without replacement from {t: 2, v: 1, c: 1, j: 2, m: 1}. 2/21 Calculate prob of picking 2 y when two letters picked without replacement from aayaaaaayaaaayaaaaya. 3/95 Two letters picked without replacement from {j: 9, d: 9}. Give prob of picking 2 j. 4/17 Two letters picked without replacement from vvvqvqvq. Give prob of picking 2 v. 5/14 Two letters picked without replacement from {s: 3, v: 1, i: 1}. Give prob of picking 1 v and 1 s. 3/10 What is prob of picking 1 e, 1 t, 1 o, and 1 q when four letters picked without replacement from jqvotej? 1/35 Two letters picked without replacement from nmcicinuunuuma. Give prob of picking 1 n and 1 c. 6/91 Calculate prob of picking 1 m and 2 q when three letters picked without replacement from {q: 5, u: 1, z: 6, n: 1, m: 2, d: 1}. 1/28 What is prob of picking 1 s, 1 o, and 1 v when three letters picked without replacement from ooooooooooooovoosoo? 1/57 Three letters picked without replacement from {r: 11, j: 2, q: 1}. What is prob of picking 1 j and 2 r? 55/182 Calculate prob of picking 2 c when two letters picked without replacement from {h: 5, c: 2, p: 3, k: 3}. 1/78 What is prob of picking 1 t and 2 y when three letters picked without replacement from {i: 3, b: 3, y: 4, t: 4, l: 5}? 8/323 What is prob of picking 1 r and 1 o when two letters picked without replacement from bbrbbrborobor? 2/13 Three letters picked without replacement from ekfoeekooekooeoo. What is prob of picking 3 k? 1/560 Two letters picked without replacement from qwlklqqcqwqw. What is prob of picking 2 w? 1/22 Calculate prob of picking 3 x and 1 o when four letters picked without replacement from {b: 1, o: 2, s: 4, x: 12}. 110/969 Four letters picked without replacement from gvggpghvp. What is prob of picking 2 v and 2 p? 1/126 Three letters picked without replacement from njnjjnjjnjnjj. What is prob of picking 3 j? 28/143 Two letters picked without replacement from eeeeqeqeqeeeee. Give prob of picking 2 e. 55/91 Calculate prob of picking 3 g when three letters picked without replacement from {g: 7, k: 3}. 7/24 Two letters picked without replacement from jjjmjmjjmmjjmj. What is prob of picking 2 j? 36/91 Calculate prob of picking 3 y and 1 n when four letters picked without replacement from yynynnnyynnn. 14/99 Four letters picked without replacement from ytyttty. Give prob of picking 2 y and 2 t. 18/35 Calculate prob of picking 1 v and 3 q when four letters picked without replacement from {q: 3, s: 4, v: 3, o: 1, x: 3, z: 1}. 1/455 Two letters picked without replacement from {u: 1, w: 2}. Give prob of picking 2 w. 1/3 Four letters picked without replacement from {l: 3, j: 2, r: 5, h: 3, b: 2}. Give prob of picking 2 h and 2 r. 2/91 Four letters picked without replacement from {f: 6, u: 4, k: 2, j: 2, c: 4, p: 1}. What is prob of picking 2 c and 2 k? 1/646 What is prob of picking 1 p and 2 w when three letters picked without replacement from wpwppouuwqqpwp? 15/182 Calculate prob of picking 1 z and 3 i when four letters picked without replacement from {y: 1, s: 5, z: 5, i: 7}. 35/612 Two letters picked without replacement from iifuqiqissisfifuissi. Give prob of picking 1 s and 1 q. 1/19 Four letters picked without replacement from {t: 3, i: 4, e: 2, m: 2, v: 2, p: 3}. Give prob of picking 1 t, 1 p, and 2 m. 9/1820 What is prob of picking 2 n when two letters picked without replacement from znznznn? 2/7 Calculate prob of picking 1 w and 1 u when two letters picked without replacement from wwwdufwdfwdu. 5/33 Three letters picked without replacement from trvtdrvdttvrtvdd. What is prob of picking 1 r, 1 v, and 1 d? 3/35 Two letters picked without replacement from hphhxxxxxxpphp. Give prob of picking 2 x. 15/91 Two letters picked without replacement from mbrrfmbbrbbf. What is prob of picking 1 b and 1 r? 5/22 What is prob of picking 2 u when two letters picked without replacement from {u: 5}? 1 Two letters picked without replacement from gtyygtyyyyyygyyyyy. Give prob of picking 1 t and 1 g. 2/51 Calculate prob of picking 1 s and 1 d when two letters picked without replacement from {q: 2, s: 1, p: 5, d: 2, i: 6}. 1/60 Three letters picked without replacement from {j: 6, i: 1, b: 12}. Give prob of picking 3 j. 20/969 What is prob of picking 2 c when two letters picked without replacement from {w: 2, v: 1, c: 2}? 1/10 What is prob of picking 1 n and 1 k when two letters picked without replacement from wwwnkkwnkwwnn? 2/13 Two letters picked without replacement from stts. What is prob of picking 2 s? 1/6 Two letters picked without replacement from qqjjqtrq. What is prob of picking 1 r and 1 j? 1/14 Calculate prob of picking 2 x and 1 r when three letters picked without replacement from {x: 4, r: 2, m: 1}. 12/35 What is prob of picking 2 a when two letters picked without replacement from auc? 0 Three letters picked without replacement from {v: 2, y: 8, q: 2, c: 1, r: 5}. Give prob of picking 3 y. 7/102 What is prob of picking 1 r and 1 k when two letters picked without replacement from kptrn? 1/10 Two letters picked without replacement from ksbsskxkeassx. What is prob of picking 2 k? 1/26 Calculate prob of picking 4 f when four letters picked without replacement from {f: 10}. 1 Calculate prob of picking 3 x when three letters picked without replacement from {s: 3, m: 2, w: 1, t: 5, x: 6}. 1/34 Calculate prob of picking 1 m, 1 a, and 1 h when three letters picked without replacement from zzzzpzaszzhazm. 1/182 Three letters picked without replacement from {m: 4, e: 6, l: 10}. What is prob of picking 1 l, 1 e, and 1 m? 4/19 Calculate prob of picking 1 f and 1 t when two letters picked without replacement from {d: 4, m: 3, w: 2, f: 2, t: 2}. 2/39 Calculate prob of picking 1 z and 1 i when two letters picked without replacement from {f: 5, i: 2, z: 8, e: 1}. 2/15 Four letters picked without replacement from {t: 1, h: 3, w: 1, v: 1, a: 4, g: 6}. What is prob of picking 1 w, 2 h, and 1 t? 3/1820 Two letters picked without replacement from eoooooooeoooo. Give prob of picking 2 o. 55/78 Three letters picked without replacement from pxllpppllxx. Give prob of picking 3 x. 1/165 What is prob of picking 2 k when two letters picked without replacement from {u: 2, k: 17}? 136/171 Calculate prob of picking 1 x and 2 p when three letters picked without replacement from gmmmmqxmmmxxxgxxxpp. 7/969 Two letters picked without replacement from fsfghjfjfbffbfsgf. Give prob of picking 1 j and 1 b. 1/34 Calculate prob of picking 1 n and 1 r when two letters picked without replacement from szn	{ "pile_set_name": "DM Mathematics" }
1/q)/q)*(-10/3)(q(qq*1)/qqq)(-10))(-17/6) assuming q is positive. q(935/9) Simplify ((j/j(2/11))17)(2/89)(jj(-12)jj(-3/11))(3/8) assuming j is positive. j(-27723/7832) Simplify (i3/((iii(4/7))/i)i*2(i/((i*(-1)/ii)/i))/i)/(((i/i(1/6))/i(3/2))/(i/i*(5/2)i(-1))) assuming i is positive. i(151/42) Simplify ((m(2/7))(2/37)/(m/(m(-2/3)/m))(4/33))/(((mm(2/3)m)/mm)(-1/68)/((m/(mm*(6/7)))/mmmm(-1/8)/m)) assuming m is positive. m(-4361465/3487176) Simplify (((z/(zz(-2/5)zz))/z)(-1)(zz2z)/z(z/((zz/z(-1))/z))/z)31 assuming z is positive. z(558/5) Simplify ((k(1/2))1)(-3)(k(1/7)/k(-6/7))/(k(-3/7)/k(2/5)) assuming k is positive. k(23/70) Simplify (r(1/2)/(r/r(2/7)))(1/14)/(((r/((rr*(-2/11))/r))/rr*6)/((rrr3)/r3)) assuming r is positive. r(-9049/2156) Simplify ((v/(vvv0v))/v5)(43/5)((v/(v/(vv(vv/((v*(2/9)/v)/v))/v)))/((vv/v(2/3))/v))(-32) assuming v is positive. v(-9109/45) Simplify ((((k0k)7)(-43))(-2/3))(20/3) assuming k is positive. k(12040/9) Simplify (((o2o)(-5/13))(-17/4))22 assuming o is positive. o(2805/26) Simplify (((i/(i/(ii(-3/4))))/(i(4/5)ii))/(i(1/5)/(ii2)))/((i/(i/i(2/3)i))/i2(i5/i)/(i/i(-1/6)i)) assuming i is positive. i(3/4) Simplify (p0/p(-5/3)(p*(1/2)/pp)(-42))/(p(-5)/p(-2/9))16 assuming p is positive. p(514/9) Simplify (r(1/8)/(r/(rr(2/9)r))(r3/r)/(r(-1/8)/r))/((r(r/r4)/r)(9/5))(-19) assuming r is positive. r(-17663/180) Simplify z*(-1/8)/(zzz(1/5))(z(1/3))(-21)((z/(zz*(-2/5))zz)/zz*(1/2)z)/(z(zz*(-3/7))/zz/(z(-1/6)/z)) assuming z is positive. z(-7697/840) Simplify (t(2/25)/((t(-4)t)/t))(1/42)/((((tt1/t)/t)/t)(-30)(t(2/7))(1/2)) assuming t is positive. t(-5258/175) Simplify ((bb/(b/b*6b))/(bb/b(3/4)))/(b2)(-2)(b/(b/(b*(3/10)/b))b(-1/7))/(b1/b)2 assuming b is positive. b(1107/140) Simplify (q/((q/q*(-2))/q)q/((q*(2/11)/q)/q)(qq0qq)(-49))/((q(2/7)q/(qq4))/(q(-3/5)q(-1/5))) assuming q is positive. q(-54773/385) Simplify ((x*(-2/45)x/((x*(2/7)x)/x))/((x/x(-20))/x7))(-2/21) assuming x is positive. x(8398/6615) Simplify ((oo(-11/2)o*(-15)o*(-3)oo(5/6))(-42))(-36) assuming o is positive. o(-31248) Simplify (((kk*(2/37)k)/(kk6))/((kk(k/(k/((k/(kk/(kk(-19)k))k)/k))k)/k)/(kk/k(-2)kk)))8 assuming k is positive. k(5048/37) Simplify (w(-15))(-4)(ww/((w/w(32/3)ww)/w))(-1/52) assuming w is positive. w(2332/39) Simplify ((((((l(-2/3)/ll)/ll)/l)/l)/(llll(1/4)))/(l(-24)/(ll(-2))))(-8/7) assuming l is positive. l(-410/21) Simplify ((u7u/(u*5u))/((uu(-2/15)u)/((u*5/u)/u)))/((uu*(-1)uu)(-21)/(uu(1/4))(-45)) assuming u is positive. u(-667/60) Simplify ((((g/g(2/7)gg)/g)/g(-18))/(g(-18)/(g24/g)))(-33) assuming g is positive. g*(-14025/7) Simplify ((xx*1/xx)(1/22)/(((x/x(-1))/x)/(x/((xx1)/x))))/((((x/(xx/(x(x/(xx*(2/3)x))/x)))/x)/x)(3/16))(-34) assuming x is positive. x(-1349/44) Simplify (((x0)*(3/10)(xx/(xx(-4)))/(x(2/7)x))44)24 assuming x is positive. x(27456/7) Simplify ((q/(q(-6)/qqq)q/((qq(-3/7))/q))/((qq(-3/4))/(q/q2)))(-5) assuming q is positive. q(-865/28) Simplify ((a1/a)/(((a(-4)a)/a)/a)(a/(aa(-2/3)))(-43))/((((aaa(1/3))/a)/(aa/(aa(3/4))))/(aa*1a)(-2/53)) assuming a is positive. a(-5271/212) Simplify ((w(-3))(-5/11)/(w(-1/5))(-12))(14/13) assuming w is positive. w(-798/715) Simplify ((kk/(k(1/18)k))/kk)0(k(-18))35 assuming k is positive. k*(-630) Simplify ((l/(ll/(l(5/2)/l)))/(l/(l/(l0/l))))/(l1)4(l0)(1/28)l*(6/7)/ll/(ll3)l assuming l is positive. l(-65/14) Simplify (u/(u5/u)u(2/3))16/((uu/(u/(u/u*(5/2)))uu)/u(-8))(-12) assuming u is positive. u(230/3) Simplify (x0x(-3/5))(2/87)/(x/(xx5)x(-2/7))(-1/20) assuming x is positive. x*(-1129/4060) Simplify ((w/(w/(w((w*(-2/13)w)/w)/w))wwwwww/w(-5))/((w(-6)/w)/ww4))/((w2w)*16w*(2/3)ww/(w(-2/3)ww)) assuming w is positive. w(-1345/39) Simplify (((w/(w/(((w7/w)/w)/w)))/w)(-36)w*(1/2)w30)(1/10) assuming w is positive. w(-31/4) Simplify ((g1)26/(g/(g(-1/3)g))45)(8/5) assuming g is positive. g(88/5) Simplify (((n(n/n(31/5))/n)/n(-2/5))(6/35))(11/4) assuming n is positive. n(-396/175) Simplify ((k(-1))(2/23))(7/10)((kk*4kkkk)/(kk(1/2)))/(k/(k(-1/3)k))5 assuming k is positive. k(3983/690) Simplify ((mmm(-1))(-5/2)mm(4/7)/mmmm3/m)/((m/m(-1))(-25/3)/(m(-6)/m5)) assuming m is positive. m(325/42) Simplify (v44/(((v/v(-2/11))/v)/v))/(v/((vv(-31)/v)/v))23 assuming v is positive. v(-7856/11) Simplify (t/(t3/t))/(t/t(-1/2)tt)t8/(t/t4)((t(-3/7)t)/t11)(3/32) assuming t is positive. t(1237/224) Simplify (p/(p0pp))*(-2/23)((pp(-1)p)/pp)12((p3)(-41))(-47) assuming p is positive. p(133241/23) Simplify (m(-3/11)/(m/((m/(m/((m/m(-3))/m)))/m)))(-5)/((m(1/4))*(-49)(m/(m/m*(-3)))/(m/(m/(m/(mm*1m))))) assuming m is positive. m(423/44) Simplify ((y(1/3)y)(1/19)(y/(y/(y/(y/(yy/((y/(y/(y(-1/4)yy))y)/y)))))y)(-3/10))8 assuming y is positive. y(-139/57) Simplify (z(2/11)/(z(-6)zz))/((z/(z1/z))/(z/(z/(z(-6)z)zz)))((zz(-1/3))/(z/(z/(z/z(4/7)))z))(-29) assuming z is positive. z(4222/231) Simplify (p(-2/65)/(p/p4)p*22p/(p/(p(-16/11)/p)))(-4/11) assuming p is positive. p(-64392/7865) Simplify (a(-1/10)/(a(a/(a/(((aa/a*(-2/67)a)/a)/a)))/a)a(-27)aa(-5/4))(3/7) assuming a is positive. a(-114087/9380) Simplify ((ss/s*(2/53)s*(-26))/((ss*11s)/(s*(3/2)s)))23 assuming s is positive. s(-84203/106) Simplify (((oo/(o4o)o)/(((o(-1/4)/oo)/o)/o))/(oo/(oo/o*(1/4)o))22)/((o/(o(2/3)o))(-10/11))(-2/3) assuming o is positive. o(6793/396) Simplify ((x(xx(x/(x*0x))/x)/x)(23/2))(1/20)/((xx0)(-17/4))(2/33) assuming x is positive. x(1099/1320) Simplify (vv*(-11)v(v(-14)v)/v)(5/3)/((v/((v11/v)/v))/v(-2/23))(-2) assuming v is positive. v(-3737/69) Simplify ((w(3/5)ww)(3/10))(2/81)/((w/(w/(w*(-1/2)w)))/(w(-1)/w))(1/2) assuming w is positive. w(-3323/2700) Simplify ((((k(2/17)k)/k(-3/5))/(k(-2/3))(2/13))(-39))(14/11) assuming k is positive. k(-84476/935) Simplify (((i/(ii/(ii/(ii*(1/4))))i)*(-2)(i/(i0/i))(1/40))(6/13))22 assuming i is positive. i(-957/65) Simplify (j(-1/3))*11/((jj*(1/4))/((jj*(-4/7))/j))((j/(jjjj/j13jj))/(j(-2/33)j))(8/7) assuming j is positive. j(795/308) Simplify (((((q/q*12)/q)/q)/qq)/qq(-3/5))(-1/44)/((qq/(q/(q/q*(2/9))q))/q(13/5))(-27) assuming q is positive. q(-10751/220) Simplify u35/(u*(-2/65)/uuu)u*34u(-31/5) assuming u is positive. u(4019/65) Simplify ((s4)(-2/91))*(-1/44)/(ss*6/ss((ss*13/ss)/s)/s)(-3/10) assuming s is positive. s(57077/10010) Simplify ((q(-3/10)/q)50/((q/q*33)/(qq*(-29)q)))(-9) assuming q is positive. q540 Simplify (r*(-3/7)(rrr*(-2/3)r)/rr(8/5)/r(4/5))/((r5r(-4/9)/r)/((r/((r(-1/3)/rr)/r))/(r(-2)/r))) assuming r is positive. r(1097/315) Simplify ((t/t1)(1/27)/(t(-5)t/(tt/(t/((t(-2/7)/t)/t)))t))/((tt(-4))/(t/(t/((t/t(3/4))/t))))(4/13) assuming t is positive. t(219/91) Simplify w(1/2)w*4w(-4/3)/w(2/13)((ww*(2/13))/(ww(2/9)))(-27) assuming w is positive. w(379/78) Simplify ((k/k(-1/2))*30(k/k*(-13/4)k)/(kk(-2/21)/k))18 assuming k is positive. k(12687/14) Simplify (o(-1/2))11/(o(-1/8)/(o(oo(-6)o)/o))((o(-1/3)/o)/oo)*(2/13)(o(2/13)/o)/(o(4/7)o) assuming o is positive. o(-26203/2184) Simplify (m(6/7)/(mmm/((m6/m)/m)))(-4/19)/((m/(m5/m))/m(-2)(m/(m/m(-4)))/m(-2/5)) assuming m is positive. m(2799/665) Simplify (s(4/7)s/s(-9))/((s/(s/(s(3/5)/s)))/(s/(sss*(-2/13)	{ "pile_set_name": "DM Mathematics" }
, 19, 41, 41299 List the prime factors of 998350773. 3, 7, 47540513 What are the prime factors of 53870834? 2, 26935417 What are the prime factors of 434302971? 3, 144767657 What are the prime factors of 45037828? 2, 11, 17, 19, 3169 List the prime factors of 13699461. 3, 1087, 4201 List the prime factors of 151245409. 7, 3086641 List the prime factors of 2910341473. 13, 19, 31, 47, 8087 List the prime factors of 972601619. 11, 101, 875429 What are the prime factors of 237769797? 3, 79256599 List the prime factors of 14538233. 257, 56569 What are the prime factors of 2976046578? 2, 3, 1123, 147227 What are the prime factors of 398738595? 3, 5, 26582573 What are the prime factors of 85497303? 3, 28499101 What are the prime factors of 17598585? 3, 5, 1173239 List the prime factors of 2019198513. 3, 109, 6174919 What are the prime factors of 24339584? 2, 29, 79, 83 What are the prime factors of 199704498? 2, 3, 7, 29, 59, 397 List the prime factors of 490903672. 2, 7, 8766137 What are the prime factors of 16927230? 2, 3, 5, 557, 1013 What are the prime factors of 67828906? 2, 33914453 What are the prime factors of 2584891459? 2584891459 What are the prime factors of 76409952? 2, 3, 795937 What are the prime factors of 688897545? 3, 5, 7, 17, 167, 2311 What are the prime factors of 178416865? 5, 11, 23, 141041 List the prime factors of 29973714. 2, 3, 31, 161149 List the prime factors of 7382803. 467, 15809 List the prime factors of 583633830. 2, 3, 5, 13, 19, 79, 997 List the prime factors of 17659308. 2, 3, 23, 109, 587 What are the prime factors of 96284114? 2, 439, 109663 What are the prime factors of 192868? 2, 13, 3709 What are the prime factors of 90877747? 181, 502087 What are the prime factors of 2468795444? 2, 12479, 49459 What are the prime factors of 2446330? 2, 5, 244633 List the prime factors of 60066709. 457, 131437 List the prime factors of 179000216. 2, 19, 659, 1787 What are the prime factors of 118483667? 118483667 List the prime factors of 1921489571. 599, 613, 5233 What are the prime factors of 182060668? 2, 45515167 List the prime factors of 394729526. 2, 3359, 58757 List the prime factors of 20951423. 20951423 What are the prime factors of 256057141? 256057141 What are the prime factors of 5747057198? 2, 2873528599 What are the prime factors of 201098203? 821, 244943 What are the prime factors of 703010629? 113, 233, 26701 List the prime factors of 37881801. 3, 19, 29, 7639 What are the prime factors of 242653622? 2, 37, 877, 3739 What are the prime factors of 1675635771? 3, 558545257 List the prime factors of 3117848028. 2, 3, 259820669 What are the prime factors of 610870415? 5, 122174083 What are the prime factors of 91063936? 2, 711437 What are the prime factors of 701837332? 2, 7, 59, 424841 List the prime factors of 1270771329. 3, 29, 14606567 What are the prime factors of 134171613? 3, 4969319 What are the prime factors of 81516004? 2, 19, 457, 2347 What are the prime factors of 2359283? 1069, 2207 What are the prime factors of 103377439? 11, 101, 769 What are the prime factors of 97807653? 3, 127, 85571 List the prime factors of 53189792. 2, 41, 71, 571 List the prime factors of 444712560. 2, 3, 5, 1852969 List the prime factors of 829674473. 12251, 67723 What are the prime factors of 1082280933? 3, 311, 14321 What are the prime factors of 49542079? 49542079 List the prime factors of 4280951685. 3, 5, 241, 1184219 List the prime factors of 1452011397. 3, 617, 784447 What are the prime factors of 469552081? 469552081 List the prime factors of 547847134. 2, 17, 47, 342833 List the prime factors of 265101335. 5, 23, 1259, 1831 List the prime factors of 767801656. 2, 523, 183509 What are the prime factors of 2612902544? 2, 7, 53, 440179 List the prime factors of 2606981717. 3083, 845599 List the prime factors of 30156612. 2, 3, 2513051 What are the prime factors of 1293262223? 11, 157, 748849 What are the prime factors of 330476330? 2, 5, 33047633 What are the prime factors of 3695110606? 2, 11, 167959573 What are the prime factors of 36380664? 2, 3, 23, 2441 What are the prime factors of 72570905? 5, 11, 29, 173, 263 What are the prime factors of 28306044? 2, 3, 13, 20161 List the prime factors of 231030093. 3, 7, 139, 79147 What are the prime factors of 36838232? 2, 233, 19763 What are the prime factors of 158752902? 2, 3, 7, 11, 17, 29, 41 What are the prime factors of 8078048092? 2, 26029, 77587 List the prime factors of 568823617. 97, 101, 58061 List the prime factors of 237361371. 3, 13, 6086189 What are the prime factors of 4145502517? 13, 19, 16783411 What are the prime factors of 9124304312? 2, 1140538039 What are the prime factors of 933802357? 79, 479, 24677 List the prime factors of 424136866. 2, 131, 257, 6299 What are the prime factors of 729580263? 3, 23, 359, 29453 List the prime factors of 113550779. 113550779 What are the prime factors of 7396998835? 5, 23, 919, 69991 List the prime factors of 535296646. 2, 17, 15744019 What are the prime factors of 3207271613? 7, 13, 2503, 14081 List the prime factors of 514680619. 37, 2939, 4733 List the prime factors of 151386158. 2, 7, 11, 233, 4219 What are the prime factors of 168580595? 5, 33716119 What are the prime factors of 4714867539? 3, 83, 103, 233, 263 List the prime factors of 1306290133. 107, 12208319 List the prime factors of 58770638. 2, 29385319 What are the prime factors of 51509547? 3, 1907761 List the prime factors of 78142246. 2, 7, 13, 53, 8101 List the prime factors of 935147030. 2, 5, 89, 1050727 List the prime factors of 2456718822. 2, 3, 37, 136621 What are the prime factors of 447665386? 2, 7, 17, 1880947 List the prime factors of 36947465. 5, 7389493 What are the prime factors of 672172624? 2, 42010789 List the prime factors of 3372241940. 2, 5, 168612097 What are the prime factors of 63766412? 2, 15941603 List the prime factors of 57869483. 7, 8267069 What are the prime factors of 53556193? 19, 1201, 2347 What are the prime factors of 506388322? 2, 11, 1877, 12263 List the prime factors of 60295040. 2, 5, 13, 7247 What are the prime factors of 2218120985? 5, 17, 26095541 List the prime factors of 1141093540. 2, 5, 71, 803587 What are the prime factors of 171579575? 5, 31, 221393 List the prime factors of 10127927. 10127927 What are the prime factors of 13729836? 2, 3, 1144153 List the prime factors of 87634774. 2, 43, 139, 7331 List the prime factors of 461888988. 2, 3, 11, 547, 6397 List the prime factors of 57964515. 3, 5, 7, 173, 3191 List the prime factors of 166095842. 2, 11, 43, 337, 521 List the prime factors of 85367272. 2, 10670909 What are the prime factors of 530121940? 2, 5, 23, 37, 31147 List the prime factors of 39102900. 2, 3, 5, 130343 What are the prime factors of 248062584? 2, 3, 7, 11, 12203 List the prime factors of 3379890270. 2, 3, 5, 112663009 List the prime factors of 3356898841. 55819, 60139 What are the prime factors of 320461649? 157, 13001 List the prime factors of 6528395263. 13, 1549, 324199 List the prime factors of 182148459. 3, 19, 1549, 2063 What are the prime factors of 27276136? 2, 1031, 3307 List the prime factors of 935077188. 2, 3, 77923099 List the prime factors of 320738489. 320738489 List the prime factors of 3242807869. 7, 29, 359, 44497 List the prime factors of 5187092460. 2, 3, 5, 11, 97, 81023 List the prime factors of 419043588. 2, 3, 1289, 27091 What are the prime factors of 52345313? 52345313 What are the prime factors of 4473479? 4473479 What are the prime factors of 2906311290? 2, 3, 5, 96877043 What are the prime factors of 19424437? 19424437 What are the prime factors of 26389459? 337, 78307 List the prime factors of 207218730. 2, 3, 5, 23, 300317 List the prime factors of 420351280. 2, 5, 439, 11969 List the prime factors of 227877076. 2, 7, 8138467 What are the prime factors of 38534451? 3, 19, 676043 What are the prime factors of 145405840? 2, 5, 229, 7937 List the prime factors of 73254577. 11, 41, 59, 2753 List the prime factors of 3846525. 3, 5, 51287 List the prime factors of 1050347566. 2, 525173783 What are the prime factors of 3746253? 3, 7, 178393 What are the prime factors of 12468326? 2, 13, 337, 1423 What are the prime factors of 436470746? 2, 1231, 177283 What are t	{ "pile_set_name": "DM Mathematics" }
24. 8 What is the greatest common divisor of 812 and 5481? 203 Calculate the greatest common factor of 91718 and 242. 242 What is the greatest common divisor of 34 and 425? 17 What is the greatest common factor of 62 and 4123? 31 Calculate the highest common divisor of 110 and 320. 10 Calculate the greatest common divisor of 32 and 208. 16 What is the greatest common divisor of 1935 and 215? 215 Calculate the greatest common factor of 53 and 4. 1 Calculate the highest common factor of 3375 and 27. 27 What is the highest common divisor of 11 and 51953? 11 What is the greatest common factor of 12 and 4? 4 Calculate the highest common factor of 50 and 70. 10 Calculate the highest common divisor of 124 and 31. 31 What is the greatest common factor of 782 and 34? 34 Calculate the highest common divisor of 25 and 25. 25 What is the highest common divisor of 23 and 92? 23 Calculate the greatest common divisor of 80 and 192. 16 Calculate the highest common factor of 12 and 536. 4 Calculate the highest common divisor of 1849 and 301. 43 Calculate the highest common factor of 20 and 580. 20 What is the highest common divisor of 2784 and 522? 174 What is the highest common divisor of 18 and 150? 6 Calculate the greatest common factor of 360 and 460. 20 What is the highest common divisor of 11 and 143? 11 What is the greatest common factor of 12 and 7040? 4 Calculate the highest common factor of 192 and 324. 12 What is the highest common divisor of 3612 and 129? 129 Calculate the greatest common divisor of 2810 and 190. 10 What is the greatest common divisor of 8688 and 48? 48 Calculate the greatest common divisor of 3179 and 17. 17 Calculate the greatest common factor of 70 and 1785. 35 Calculate the greatest common divisor of 93 and 434. 31 What is the greatest common factor of 288 and 544? 32 What is the highest common divisor of 29 and 4147? 29 What is the highest common factor of 738 and 2173? 41 What is the greatest common factor of 2912 and 52? 52 Calculate the highest common factor of 2632 and 4277. 329 Calculate the greatest common divisor of 627 and 66. 33 What is the highest common factor of 312 and 65? 13 Calculate the greatest common divisor of 108 and 156. 12 What is the highest common divisor of 91 and 13? 13 Calculate the greatest common factor of 21206 and 46. 46 Calculate the greatest common factor of 132 and 132. 132 What is the greatest common factor of 4757 and 67? 67 What is the greatest common factor of 150 and 2175? 75 Calculate the highest common factor of 16 and 2096. 16 Calculate the highest common factor of 1670 and 10. 10 What is the highest common divisor of 445 and 85? 5 What is the highest common factor of 236 and 4? 4 What is the greatest common divisor of 102 and 170? 34 Calculate the greatest common factor of 22 and 209. 11 What is the greatest common divisor of 6 and 18? 6 What is the highest common factor of 46347 and 21? 21 What is the highest common factor of 12 and 2808? 12 Calculate the highest common factor of 1961 and 53. 53 What is the greatest common divisor of 142 and 17750? 142 Calculate the highest common divisor of 10604 and 22. 22 Calculate the greatest common divisor of 1888 and 1072. 16 Calculate the greatest common factor of 5 and 15. 5 What is the greatest common divisor of 1037 and 85? 17 Calculate the highest common factor of 48 and 1648. 16 What is the highest common divisor of 200 and 88? 8 Calculate the greatest common divisor of 17 and 697. 17 Calculate the highest common factor of 430 and 10. 10 What is the highest common divisor of 3827 and 267? 89 What is the highest common factor of 265 and 10? 5 Calculate the greatest common divisor of 59 and 5. 1 Calculate the highest common factor of 2475 and 150. 75 What is the highest common divisor of 123 and 1517? 41 What is the highest common divisor of 23 and 391? 23 Calculate the highest common factor of 224 and 476. 28 Calculate the highest common factor of 50 and 80. 10 Calculate the highest common divisor of 1264 and 80. 16 What is the highest common divisor of 143 and 2197? 13 What is the highest common divisor of 2745 and 45? 45 Calculate the greatest common divisor of 198 and 528. 66 What is the greatest common factor of 115 and 10? 5 What is the highest common factor of 188 and 32? 4 Calculate the greatest common factor of 154 and 3374. 14 What is the highest common divisor of 18 and 78? 6 Calculate the highest common divisor of 34 and 6. 2 What is the greatest common factor of 494 and 26? 26 Calculate the greatest common factor of 2117 and 29. 29 Calculate the highest common divisor of 516 and 36. 12 What is the greatest common factor of 1104 and 16? 16 What is the highest common divisor of 9 and 417? 3 Calculate the highest common factor of 23 and 736. 23 What is the greatest common divisor of 56 and 144? 8 Calculate the highest common factor of 164 and 123. 41 Calculate the highest common factor of 7 and 9. 1 Calculate the highest common divisor of 4845 and 2295. 255 Calculate the greatest common factor of 66 and 286. 22 What is the greatest common divisor of 114 and 24? 6 Calculate the highest common divisor of 54 and 459. 27 What is the highest common divisor of 123 and 1968? 123 What is the highest common factor of 8838 and 18? 18 Calculate the highest common factor of 7616 and 56. 56 What is the highest common factor of 2625 and 15? 15 Calculate the greatest common factor of 1519 and 196. 49 What is the greatest common divisor of 3 and 535? 1 What is the greatest common factor of 19 and 1881? 19 What is the greatest common factor of 2639 and 3248? 203 Calculate the highest common divisor of 45 and 10. 5 Calculate the highest common factor of 133 and 7. 7 What is the highest common divisor of 54 and 558? 18 What is the highest common factor of 20 and 490? 10 Calculate the highest common divisor of 3123 and 18. 9 Calculate the highest common factor of 470 and 188. 94 What is the greatest common divisor of 49 and 1421? 49 What is the highest common factor of 1603 and 7? 7 What is the greatest common factor of 7371 and 65? 13 Calculate the highest common factor of 16 and 632. 8 What is the highest common factor of 416 and 91? 13 What is the greatest common divisor of 12 and 1182? 6 Calculate the greatest common factor of 1225 and 1519. 49 What is the greatest common divisor of 140 and 220? 20 What is the highest common factor of 4 and 556? 4 Calculate the greatest common divisor of 1599 and 13. 13 What is the greatest common divisor of 195 and 260? 65 What is the highest common divisor of 2002 and 77? 77 Calculate the greatest common factor of 5495 and 105. 35 Calculate the greatest common divisor of 896 and 28. 28 Calculate the highest common divisor of 13 and 221. 13 What is the highest common factor of 40 and 120? 40 What is the highest common divisor of 1118 and 52? 26 What is the highest common divisor of 303 and 7171? 101 What is the greatest common factor of 24 and 440? 8 Calculate the highest common factor of 6913 and 62. 31 Calculate the highest common divisor of 70 and 5. 5 What is the highest common factor of 24 and 1608? 24 What is the greatest common divisor of 104 and 962? 26 Calculate the greatest common divisor of 72 and 768. 24 What is the highest common factor of 2910 and 480? 30 What is the highest common factor of 5600 and 14? 14 Calculate the greatest common factor of 52 and 494. 26 Calculate the greatest common divisor of 178 and 64. 2 What is the highest common divisor of 221 and 2925? 13 What is the highest common factor of 781 and 142? 71 What is the highest common divisor of 88 and 4576? 88 Calculate the greatest common factor of 920 and 276. 92 What is the greatest common factor of 153 and 1734? 51 Calculate the greatest common divisor of 368 and 12. 4 Calculate the greatest common divisor of 23 and 575. 23 What is the greatest common factor of 56 and 32? 8 What is the highest common factor of 13 and 377? 13 What is the greatest common factor of 10480 and 80? 80 Calculate the highest common divisor of 7 and 7175. 7 What is the highest common factor of 420 and 1380? 60 Calculate the highest common divisor of 9 and 1179. 9 Calculate the greatest common factor of 106 and 1643. 53 What is the highest common fac	{ "pile_set_name": "DM Mathematics" }
10 = 0. Suppose 4j + o = fo + 4, -2j = -3o - 12. Are 0 and j equal? True Let a = -8.07 - -0.07. Let b = -8.2 - a. Let x = 0.1 + -0.1. Which is smaller: x or b? b Suppose 2 = 5t - 18, p - 5 = -t. Let c(b) = -b3 + 2b*2 + b - 1. Let f be c(p). Let a be f/5(-10)/16. Which is greater: a or 1? 1 Let s = 3.5 + -75.5. Which is smaller: s or -2/3? s Let t be (-95)/(-4) + 9/36. Is t bigger than 24? False Suppose -i + 1 = -4. Suppose 7g - ig + 18 = 0. Which is smaller: g or -8? g Let z = -3 + 5. Let k be 4 - (0 + -3 + z). Which is smaller: k or 6? k Suppose -5q + 3f = -2, 2q - 10 = -2f - 22. Let j = -81 - -79. Are j and q unequal? False Let z(u) = -u + 14. Let q be z(-15). Is q at most 30? True Let q = -17 - -11. Let a be (-8)/12q/(-4). Let j be -1 + a + 1 + 2. Which is smaller: -2/5 or j? -2/5 Suppose -23 = 13f + 55. Are -6 and f equal? True Let b(w) = -8w + 7. Let g be b(3). Which is smaller: g or -19? -19 Let k = -7.3 + 7. Is k less than or equal to 3/5? True Let l = -71 + 47. Let a = l + 25. Are a and 2/7 non-equal? True Suppose 3f + 53 = -0v + 5v, 0 = 2v - 5f - 25. Is v equal to -3? False Let x be (-32)/(-6) + (-6)/(-9). Let v = x - 8. Let h be 6/v2/(-15). Which is smaller: h or -1? -1 Let a be 15/6(-4)/40. Is -22 less than a? True Let l = -3.57 - -1.57. Which is greater: l or 1/3? 1/3 Suppose -5d - 120 = -5k, -d = 2k + k + 32. Is -26 smaller than d? False Let m(c) = c2 - 1. Let v be m(2). Suppose -x = -54 + 12. Let g be 3/2 + 7/x. Which is smaller: v or g? g Let z = 15 - 23. Let r = 11 + z. Which is smaller: r or -0.1? -0.1 Let l(z) = -z2 + 4z - 1. Let x be l(3). Suppose i = 6i - 5. Are i and x non-equal? True Let m = -1745/18 + 97. Let v = 14/9 - m. Which is smaller: 2 or v? v Let b = 45851/6 + -7567. Let k = 75 - b. Does 1 = k? False Let t(w) = 2w + 1. Let j be t(-1). Let m = 33/7 - 34/7. Which is smaller: m or j? j Suppose 3l - 6 - 9 = 0. Let n be 0/(-2) - (-15)/l. Let z be (-2)/n1/(-1). Which is greater: z or 0? z Let r be (1 + -4 - -4) + 0. Which is bigger: r or 2/47? r Let c(n) = n*2 - 3n - 2. Let a be c(4). Suppose -15 = 3v - 3r, -av - 2r - 10 = 4. Let s be (-1)/(-2) + 15/v. Is 1 greater than s? True Suppose -3n - n = 0. Is 4/9 smaller than n? False Let z(g) = -g2 - 21g + 28. Let b be z(-22). Is b < 2? False Suppose -4f + d - 7 = 0, -f - 8 + 22 = 5d. Let r(m) = -m + 2. Let p be r(2). Let z = -2 + p. Which is smaller: z or f? z Let d(b) = 5 + 0b2 - b2 - 2b - b. Let k be 1/6916/(-6). Let c be d(k). Is c less than -1? False Let t be ((4 - 0)1)/3. Suppose -5r = -8f + 3f, -4r + 6 = -f. Is t < r? True Suppose 0o - 4o = -1640. Let a = -5737/14 + o. Which is smaller: -1 or a? -1 Suppose 6b - 3j = b - 10, 2 = -3b + j. Let r be 0/(b + -21). Let w be ((r - 0) + -2)/(-9). Which is smaller: w or 1? w Let g = -0.325 - -0.395. Let t = 0.2 - 1.2. Let f = t - -1. Which is smaller: f or g? f Suppose -4v - 60 = 5b, -10 = 2v - 0v. Let o = b - -9. Which is bigger: -0.1 or o? o Let u = 7.437 + -0.037. Let w = u + -7. Is w smaller than -2/11? False Let z(j) = 2j + 8. Let a be z(-7). Let b(o) = 2o + 7. Let c be b(a). Let x = 0.81 - 0.81. Is x less than or equal to c? False Let w = -2 - -2. Let c be ((-9)/(-54))/(1/(-3)). Let l = c + 1. Is w < l? True Let a = 13756 + -178912/13. Which is smaller: a or -5? a Let m(f) be the third derivative of f5/60 - f4/8 + f3/3 - 8f*2. Let n be m(1). Does n = 5/9? False Suppose 3c - 10 = -w, 0 = c - 0c - 4. Which is smaller: w or -5/9? w Let a(c) = 3c - 15. Let w be a(10). Are 15 and w equal? True Let u = -1/218 + -1741/654. Suppose 0 = 2c - 3c - p, c = -2p + 2. Are c and u equal? False Let o(b) be the second derivative of -b5/10 + b4/6 - b2/2 + 14b. Suppose -5k + 1 = -4. Let r be o(k). Is r less than or equal to -1? True Let z(u) = 4u3 + u2 + 3u + 3. Let b be z(-2). Is -32 >= b? False Let w(c) = c2 + 4c + 3. Let o be w(-5). Suppose 0 = -p + 5p - o. Let q be (-1)/(-3) + 5/3. Does q = p? True Let z = -7/15 + -1/30. Let k(p) = p + 6. Let q be k(-6). Suppose qr = 2r + 4. Do r and z have the same value? False Let h(q) = -q3 + 2q - 1. Let w = 6 + -5. Let a be h(w). Are -2 and a equal? False Let o be -1 - 10/(-15) - 10/(-18). Which is smaller: -1 or o? -1 Let c be 0/(1(0 - -1)). Suppose c = 5s - s. Which is bigger: -1/8 or s? s Let s be 12/78 - 12/(-91). Is s greater than 1/2? False Let a(t) = t*2 + 5t - 6. Let u be a(-6). Let k(f) = f + 167. Let s be k(u). Let d = s + -1167/7. Which is bigger: d or 0? d Let x = -0.01 - 0.12. Let r = x + 0. Which is greater: -1 or r? r Let j = 0 + 0.08. Are -1/9 and j nonequal? True Let c be -6 - 150/(-24) - (-46)/(-120). Which is bigger: c or -1? c Let d be 7/2(-8)/(-20). Is d greater than 0? True Let m = 161/272 - 9/17. Suppose 6r - 3r + 2r = 0. Is m >= r? True Suppose 3l - 2l - 2z - 42 = 0, 0 = -2l + 3z + 80. Which is bigger: 33 or l? l Let w = 3.4 - 3. Let k = 0.8 + 2.2. Let q = k + -3. Which is greater: w or q? w Let m(o) = o - 4. Let q be m(6). Let s(h) = 0h - h - h + 3. Let u be s(q). Which is greater: u or 4? 4 Let r = 7/20 - -17/5. Let u = -49/12 + r. Is u smaller than -1/2? False Let h = -0.02 + 0.02. Is h at most 2/9? True Let h = 13.18 + -13. Which is smaller: 0.1 or h? 0.1 Let u = -7 + 6.9. Which is smaller: u or 0? u Suppose u + 5 = g + g, 0 = -4u - 4g + 16. Let s be (-43)/111 + 26/39. Let p = -2/37 - s. Which is greater: p or u? u Let r = 63 + -1. Is 0.1 greater than or equal to r? False Let u(q) = q*3 - 8q*2 + 6q + 6. Let i be u(7). Let b be ((-15)/9 - -2) + i. Is -1 equal to b? False Let w = -7 - 13. Let a be (6/w)/(6/(-5)). Suppose 0 = 4h - 3h + 1. Is h equal to a? False Let s = -513/5 + 103. Suppose u - 5 - 2 = -2i, 0 = 4u - 5i + 11. Is s < u? True Let n(w) = 3w + 20. Let p be n(-8). Let q = p - -7. Is q greater than 3? False Let k = 35 + -32. Suppose 0r - 11 = -2r + 5j, -2r + 2j = -8. Are r and k nonequal? False Let p(b) = -17b + 16. Let x be p(2). Which is smaller: -19 or x? -19 Let d(j) = 6j - 7. Let b be (-2)/3 - (-98)/21. Let v be d(b). Which is smaller: 16 or v? 16 Let p = -201 - -200.9. Which is smaller: p or -0.28? -0.28 Suppose 2i + 4 = i + g, 4g = 0. Which is bigger: i or -3? -3 Let w = -38 + 54. Is 15 <= w? True Let n be (-1)/6(-3 - 1). Let g(v) = -2v - 9. Let r be g(-7). Let l(q) = -q3 + 4q*2 + 6q - 3. Let d be l(r). Which is bigger: d or n? d Let y = -4.2 - -3.2. Are y and 8 nonequal? True Let c(h) = h*2 - 11h + 12. Let z be c(9). Suppose f = -5 + 4. Let b be (3/z)/(f/(-2)). Is b at least as big as -1? True Suppose o + 19 - 104 = 0. Let p be o/45(-78)/4. Let f = -37 - p. Which is smaller: f or 1? f Let i be ((-222)/8)/((-1)/(-8)). Let m = i + 2440/11. Let v(y) = -y2 + 5y - 1. Let o be v(5). Which is bigger: o or m? m Let n be 4/2 - (-287)/(-147). Is n greater than -1? True Let k = -1 + 0.97. Let h = 4.97 - k. Is -0.2 at most as big as h? True Let b = 149/21 - 20/3. Which is greater: 0 or b? b Let s be ((-1)/2)/(5/(-20)). Suppose 6l = 2l + 3n + 4, -2 = -sl - 5n. Which is smaller: -3/7 or l? -3/7 Suppose 5h - 46 = 24. Suppose 15 = -3c, 3c + h = g - 0. Let u be 4/4(g + 0). Which is greater: -3/2 or u? u Suppose -3c + 39 = 3u + 12, -4u - 2c + 38 = 0. Let f(s) = -s2 + 11s - 8. Let y be f(u). Is 5/4 smaller than y? True Let a = 0 - -2. Suppose 6p - 4 = ap. Let n = 143/540 + -2/135. Which is bigger: n or p? p Let q = -3 + 3. Let z = -212 - -1699/8. Which is bigger: z or q? z Let s(l) = l*2 + 6l + 5. Suppose i = -2w - 12, -i - 2i - 2w = 20. Let h be s(i). Let r be (-2)/7 + 4/14. Does r = h? False Let r = -71 + 73. Is -16/9 at least as big as r? False Let j = 0.6 + 0.4. Let d = j - 2. Suppose a + 8 = 4v - a, -v - 20 = 5a. Is v less than d? False Let z = -0.082 + 0.182. Do z and 6/5 have the same value? False Let g(n) = -n + 2. Let p be g(3). Let t be 4/(-2(-3)/(-9)). Let c be -2(3/t)/(-1). Is p greater than c? False Let m(y) = 4y + 12. Suppose -2 - 3 = -l. Let i(k) = -5k - 13. Let n(v) = li(v) + 6m(v). Let t be n(6). Is t at most as big as 3? True Let t be ((-18)/(-27))/(34/13470). Let d = 264 - t. Is d greater than 1? False Suppose -2j + 13 = -u, u + 7 = -j + 6*u. Let t = j + -7. Is t a	{ "pile_set_name": "DM Mathematics" }
Is o(-22) a composite number? True Let v = -27 - 3. Let g = v - -30. Suppose g = q + 5, -2p - 2p + q = -585. Is p composite? True Suppose 4m - 26 = -k, -3k = 5m - 17 - 19. Let c(o) = 3o - 7. Let n be c(3). Is (652/m)/(n/3) a composite number? False Suppose -5q + h = -7712, 2q + 5h = 3131 - 30. Is q a prime number? True Is 16/(-40)-5 + 3807 composite? True Suppose -5f + 5x = -6f + 807, -2x = -f + 807. Is f a composite number? True Let g(b) = 5b + 9. Let u be g(1). Suppose uo + 1541 = 6147. Is o prime? False Suppose z - i - i - 2716 = 0, 3i = -5z + 13645. Let h = z + -739. Is h a prime number? True Suppose 0 = -4y + 2 + 46. Is (-2 + -594)(-3)/y composite? False Suppose 4x + 10 + 10 = 3q, -x = 5. Suppose q = -5g + 826 + 339. Is g a composite number? False Let o(k) = k2 + 3k - 10. Let f be o(-5). Let p(t) = t*3 + t + 6. Let u be p(f). Suppose uw - 2w = 196. Is w a prime number? False Let w = -338 - -859. Is w composite? False Let m(u) = 8u*2 - 8u - 2. Let f be m(11). Let s = f - 284. Let n = 857 - s. Is n composite? False Suppose 0 = 7r - 5r + 772. Suppose 59 = -3c + o + 2277, 0 = 3c + 2o - 2233. Let z = c + r. Is z prime? False Is (-2 + -4 - 19792)1/(-2) a composite number? True Let f be 0/(-1 - 0/(-1)). Suppose f = -5a - 4 + 9. Is a + 352/(4 - 0) a prime number? True Let h(u) = -u3 + 2u*2 + 4u + 9. Is h(-4) a prime number? True Let a = -35519 - -63616. Is a a prime number? True Let n = 37 - 39. Is n/(-15)6387 + (-3)/5 a prime number? False Let u be -2 + 5 + 1 + -2. Suppose -7124 = -uo - 2o. Is o a prime number? False Let n be 1940/(15/18 - 2/(-12)). Is (7/4)/((-5)/n)-1 a prime number? False Let c(y) = 2y3 - 2y*2 + 6y + 5. Let l = 7 - 26. Let v = l + 25. Is c(v) prime? True Suppose 4g - 2 - 26 = 0. Suppose 3r = gr - 1172. Is r a composite number? False Suppose -122b + 26086 = -120b. Is b a prime number? True Suppose 21v - 165250 = 258971. Is v a composite number? False Let i = 1130 + 1135. Suppose -n - 9070 = -4w - 0n, -w - n + i = 0. Is w a composite number? False Let c(i) be the third derivative of 0i - 6i*2 + 11/24i*4 + 0 + 1/6i*3 - 1/60i5. Is c(8) composite? True Let p(i) be the first derivative of i6/72 - i5/15 - i4/24 - 4i3/3 + 4. Let h(w) be the third derivative of p(w). Is h(10) prime? True Let m = 0 - -5. Let f(v) = 78v - 3. Let h(a) = 77a - 3. Let r(p) = 3f(p) - 2h(p). Is r(m) a prime number? True Let a(f) = -4f + 13650. Suppose 4 = -2o + 4c, -c - 5 = 3o - 6c. Let u be a(o). Is u/45 + (-2)/6 composite? True Suppose z - g - 9 = 0, -g + 4 = -2z + 21. Suppose 50 = 2o + z. Suppose -l + o = 2l. Is l composite? False Let n(g) = 91g*2 - 126g - 1. Is n(-34) prime? False Let u be 51/(-34)2084/3. Let a = -599 - u. Is a prime? True Let l = 24 - 15. Let z(p) = lp + 13p - 3p. Is z(5) prime? False Suppose 1 = 4p + g - 6, p + g = -2. Suppose 5y - pc = 3170, -3y + 1913 = -7c + 3c. Is y prime? True Let x(r) = -401r + 137. Is x(-4) a prime number? True Let v = 21 - 42. Let l be (-4)/(-14) + (-99)/v. Suppose -3h = -5c + 337, lh = -2c + 122 - 12. Is c a composite number? True Let v = -315 + 181. Suppose 3j - 4i = 11, 6j - 2j - 6 = i. Is vj(9 - 10) a prime number? False Is (704/2 + (-6)/4)2 a prime number? True Suppose 3c - t - 12 = 9, 2t + 6 = 0. Suppose g = 5a - c, 4 = -3a + 2g + 2. Suppose -i + 6i - 1258 = -u, ai = u + 499. Is i a composite number? False Suppose -9 = 6g - 387. Let r = 80 + g. Is r a prime number? False Is (-138)/41(-1 - 1) composite? True Let b be (-4)/6 - 40/(-15). Suppose -8r + 2910 = br. Is r prime? False Suppose 3c = -8y + 3y + 11659, 0 = -2y - 5c + 4656. Is y composite? False Let w(b) = 4 - 5 - 44b + 425b + 4. Let u be w(6). Suppose -4x = -u + 341. Is x a prime number? True Let u(o) = 5o - 13. Let h be u(4). Suppose hk = 13k - 522. Is k composite? True Let o be (-2 - (-1902)/(-3)) + -2. Is 9/2o/(-33) a prime number? False Suppose -34i + 3383414 = 84i. Is i composite? True Suppose 0 = -0b + 2b - 5o - 19, 0 = b - 5o - 17. Let i be (-4)/b - 1 - -170. Suppose -3x + n = -0n - i, -45 = -x - 5n. Is x a prime number? False Suppose 5258 = 453a - 451a. Is a a composite number? True Is (-90732)/(-30)15/6 a prime number? True Let v be 2598/(-1)133/(-21). Is v/26 - 2/(-13) a prime number? False Let p be ((-6)/12)/(3/(-52278)). Suppose 4o + p = s + 3152, -2s + o = -11157. Is s composite? False Let x be 3/((-27)/(-38)) + (-28)/126. Suppose 0 = xi + b - 3286, -4i = -9i + b + 4103. Is i prime? True Suppose 5a = -3x + 5x + 7, 3a = 9. Suppose 10 = 5b, xb + 599 + 96 = u. Is u a prime number? False Suppose 1227 = 3i + 354. Suppose 0 = -2z - 4x + 788, -2 - 2 = -2x. Let g = i + z. Is g composite? True Suppose -85h + 2967 = -82h. Is h a prime number? False Suppose 0 = 9u - 8u - 1535. Suppose -3j + 12 = 4c + 3, 0 = c + 3j. Suppose 0 = cq + 2q - u. Is q a composite number? False Let m(v) = 171v*2 - 3. Let i be m(-3). Suppose -5w + 5p + 5263 = p, -3w + 4p = -3161. Let y = i - w. Is y prime? False Let v = 636 + 233. Is v composite? True Let x(t) = -t3 + 9t2 - 19. Let p be x(9). Let q(g) = -g3 - 14g2 + 7g - 1. Is q(p) a composite number? True Suppose 0 = 4z + 46 - 2. Let d(r) = -r3 + 6r*2 + 20r + 10. Is d(z) prime? True Let l(t) = t*3 - 10t*2 + 19t - 11. Let f be l(17). Let h = f - 1380. Is h a prime number? False Let v(l) be the first derivative of 17l4 - 2l3/3 + l2/2 - 7. Suppose 2k - 2 = -0k. Is v(k) a composite number? False Let y(u) = -2u2 + 45u - 4. Let b be y(22). Let d(w) = 48w - 61. Is d(b) a prime number? False Let j(o) = -199o*3 + 2o*2 - 68o + 3. Is j(-8) a prime number? True Let k(u) = -u*2 - 2u + 1. Let x be k(3). Let f = x + 23. Suppose -185 = -ft + 8t. Is t prime? False Suppose 4o = -335 - 49. Is (0 - (-1100 - 1)) + o/48 a prime number? False Let t(c) = -2c + 10. Let p be t(6). Let o be 6/p(-2124)/27. Let h = -15 + o. Is h a composite number? True Suppose -3c + 5020 = 2c. Suppose -5k = -f + 2316, -f + 3305 - c = -2k. Is f prime? False Suppose 0 = h - 10 + 4. Suppose -hx + 3x + 4605 = 0. Is x composite? True Let b = 3 + -1. Suppose 0 = -2o + 1343 - 257. Suppose -s + 553 = 3r, -2s - o = -3s + br. Is s a composite number? False Suppose 2083 = 5t - g - 2107, -g = -t + 834. Is t a prime number? True Let l(d) be the third derivative of -d4/12 - 10d*3/3 - 7d*2. Let o be l(-11). Suppose -5i = 5a - 660, -oi - 625 = -9a + 4a. Is a prime? True Let z be ((-1056)/40)/((-6)/80). Suppose -o = 3o - z. Is -2 + 0 + o - -1 a prime number? False Let a = 67746 + 18959. Is a composite? True Let t = -1546 + 961. Let s = -115 + -213. Let l = s - t. Is l prime? True Suppose -2x - 276 = -2n + 898, n - 587 = 4x. Is n a prime number? True Suppose 3931 = h + 4h + 3m, h - 4m - 777 = 0. Let o(j) = j3 + 19j*2 + 5j - 31. Let x be o(-20). Let f = h + x. Is f composite? True Let v(d) = d*3 + 8d*2 - 7d + 11. Let c be v(-8). Let y = 102 - c. Let u = y - 13. Is u prime? False Let p = 5304 - 2887. Is p composite? False Suppose 39h - 268129 = 289298. Is h prime? True Suppose w = 3m - m + 29783, -4m - 148933 = -5w. Is w composite? False Let s = -1 - -1. Suppose -3k = -2i - 26, -k + 9 = -4i - 13. Suppose -kp + 3p + 33 = s. Is p prime? True Is 25535/(-10)(3 - 25) a prime number? False Let p = -29 - -40. Let s be 8/(-12) - p/(-3). Suppose sq = 6q - 1623. Is q prime? True Let d = 20 + -25. Let o be (-110)/50 + (-1)/d. Is -141(o - 1)/9 composite? False Let p(g) = 21g*2 + 6g - 9. Let t be p(2). Let h = t - 81. Is h composite? True Let l be (3 + -6 + 4)8. Let a = -10 + l. Is a/(16/92)-10 a prime number? False Suppose -27q + 5169 = -26q. Suppose 4x + 1034 = b - 695, 3b - 3x - q = 0. Is b composite? False Let z(q) = -q3 + q2 - q + 44. Let t be z(0). Suppose -3f + 2h = -1471 + t, 2380 = 5f - 3h. Is ((-4)/(-1))/2 + f a composite number? True Let i(v) = 376v*2 - 31v + 66. Is i(5) prime? True Let a = 1 + -1. Suppose 3j - 7j + 8 = a. Suppose 3x + 3t = 2t + 744, 5x - 1229 = jt. Is x composite? True Let v(d) = -24d - 24 + 6d + 55 - 6d. Is v(-4) a composite number? False Is (12981/5)/((-	{ "pile_set_name": "DM Mathematics" }
ase 13 563 -2767 (base 9) to base 2 -100000100110 165aa (base 11) to base 6 300040 Convert -958 (base 15) to base 8. -4074 -851 (base 13) to base 14 -734 -1196 (base 10) to base 6 -5312 1034311 (base 6) to base 12 25997 1455 (base 16) to base 9 7123 -3406 (base 12) to base 6 -42410 What is -425 (base 8) in base 2? -100010101 What is -3303 (base 8) in base 3? -2101010 Convert 158 (base 14) to base 15. 134 What is -28400 (base 9) in base 15? -5aa3 What is 111202122 (base 3) in base 16? 2732 -1200210 (base 3) to base 14 -644 4141 (base 7) to base 16 5aa 131145 (base 6) to base 8 27251 Convert 12203 (base 4) to base 13. 263 698 (base 10) to base 15 318 -72a (base 11) to base 3 -1012120 Convert 10001110 (base 3) to base 9. 3043 What is 217f (base 16) in base 13? 3b98 -1111001021 (base 3) to base 14 -a8d4 1863 (base 11) to base 9 3221 Convert -173 (base 16) to base 9. -452 Convert -18ad (base 14) to base 5. -120330 What is -10313002 (base 4) in base 7? -112015 a77 (base 15) to base 10 2362 Convert -569a (base 13) to base 5. -342001 Convert 211000 (base 3) to base 16. 252 134635 (base 7) to base 3 1022020221 1011100 (base 2) to base 9 112 Convert -1370 (base 10) to base 5. -20440 1041 (base 8) to base 7 1406 What is 10162 (base 8) in base 10? 4210 Convert -10c (base 16) to base 8. -414 4381 (base 9) to base 8 6240 What is 402322 (base 6) in base 4? 13232222 3113333 (base 4) to base 12 7bbb 4541 (base 7) to base 6 11342 What is 12101 (base 3) in base 6? 401 -32605 (base 9) to base 13 -9b00 b669 (base 15) to base 8 113256 432 (base 9) to base 2 101100001 What is -2af (base 16) in base 14? -371 -111011010001111 (base 2) to base 9 -45563 3611 (base 7) to base 14 6b1 Convert -3654 (base 7) to base 11. -1029 What is 2d06 (base 16) in base 15? 3636 Convert -21234 (base 6) to base 12. -181a What is 17cb (base 13) in base 2? 110111011011 What is -143162 (base 7) in base 8? -65615 -1365 (base 7) to base 14 -2a5 16b (base 12) to base 3 22102 What is 14040 (base 5) in base 15? 515 What is -120211 (base 3) in base 9? -524 What is 21 (base 3) in base 11? 7 5564 (base 12) to base 14 3620 Convert 1d (base 14) to base 2. 11011 -2845 (base 9) to base 11 -1682 What is -32e0 (base 16) in base 11? -9870 What is 9296 (base 11) in base 15? 39bb Convert -34305 (base 7) to base 8. -21027 What is -20001001 (base 3) in base 15? -1487 What is -432213 (base 5) in base 13? -68b6 Convert 524 (base 14) to base 7. 2644 Convert -11340 (base 9) to base 5. -220234 Convert 22111 (base 5) to base 15. 6c1 Convert -107 (base 14) to base 16. -cb What is -10101 (base 4) in base 3? -101010 What is -65 (base 15) in base 14? -6b What is -1001110100 (base 2) in base 12? -444 507 (base 11) to base 14 31a 1010100110111 (base 2) to base 6 41051 What is 5411 (base 7) in base 14? 9b1 -22221 (base 3) to base 13 -157 4051 (base 7) to base 2 10110000000 Convert -28 (base 13) to base 15. -24 Convert 2201230 (base 4) to base 3. 112012021 -651a (base 11) to base 5 -233422 What is 1001222 (base 3) in base 7? 2165 Convert 1451 (base 10) to base 9. 1882 -492 (base 11) to base 7 -1464 Convert -220222 (base 3) to base 16. -2a2 Convert -2504 (base 12) to base 5. -113210 What is 1013 (base 9) in base 14? 3ad What is d604 (base 15) in base 5? 2421404 Convert -101110110 (base 2) to base 8. -566 -624 (base 8) to base 11 -338 What is -22102131 (base 4) in base 16? -a49d Convert -424 (base 13) to base 15. -321 Convert -2323 (base 12) to base 10. -3915 Convert 10101221 (base 3) to base 7. 10144 -22164 (base 11) to base 2 -111110110000111 7ce2 (base 15) to base 14 9957 What is -3242 (base 8) in base 6? -11510 Convert -111110001010101 (base 2) to base 14. -b857 Convert -43260 (base 10) to base 4. -22203330 What is 65a4 (base 11) in base 8? 21001 Convert -19664 (base 10) to base 4. -10303100 53445 (base 6) to base 14 2937 -10111101 (base 2) to base 11 -162 -1425 (base 7) to base 3 -202200 What is 858c (base 14) in base 10? 23056 Convert 50344 (base 6) to base 16. 19d8 What is 7a (base 13) in base 14? 73 8a31 (base 12) to base 4 3233011 Convert -155342 (base 6) to base 14. -58d0 Convert 879 (base 10) to base 3. 1012120 127cb (base 14) to base 8 130617 -41454 (base 6) to base 3 -21122121 -210100 (base 3) to base 16 -240 73a6 (base 11) to base 8 23104 Convert 100001011100110 (base 2) to base 12. 9ab2 11245 (base 6) to base 16 64d -1220000102 (base 3) to base 7 -213266 What is -661 (base 9) in base 2? -1000011101 What is -101021121 (base 3) in base 10? -7495 What is 3066 (base 9) in base 2? 100011000111 What is -3928 (base 12) in base 8? -14560 -3233 (base 4) to base 5 -1424 -244 (base 13) to base 5 -3034 Convert -322033 (base 4) to base 13. -1909 122120 (base 3) to base 9 576 Convert 3375 (base 8) to base 7. 5134 -3162 (base 9) to base 8 -4424 -7c0 (base 13) to base 2 -10100111011 Convert 471 (base 9) to base 3. 112101 -15552 (base 6) to base 16 -a1c What is -12242 (base 5) in base 16? -3b3 200 (base 16) to base 12 368 What is 7586 (base 9) in base 8? 12722 e3 (base 16) to base 3 22102 Convert -3012 (base 5) to base 14. -1d4 What is -1c77 (base 13) in base 3? -12221010 What is -1015 (base 12) in base 9? -2348 What is -5764 (base 11) in base 7? -31035 What is -3032 (base 5) in base 16? -188 What is -ad (base 15) in base 3? -20001 20a (base 14) to base 7 1113 -2a0 (base 11) to base 3 -111001 Convert 5e (base 16) to base 7. 163 What is -1221200112 (base 3) in base 5? -2212113 What is 2576 (base 12) in base 14? 17aa What is -20201 (base 3) in base 13? -10c -89 (base 14) to base 13 -94 Convert 226 (base 11) to base 15. 130 -417 (base 15) to base 14 -49c What is -1aa (base 15) in base 12? -281 What is 13581 (base 9) in base 2? 10010000001010 What is 1bb (base 15) in base 14? 209 Convert 18596 (base 11) to base 15. 7a84 -4102 (base 5) to base 14 -299 -111020 (base 3) to base 7 -1020 What is -330451 (base 6) in base 3? -1101120111 Convert -20001021 (base 3) to base 4. -1010320 What is -660 (base 8) in base 3? -121000 Convert -62212 (base 8) to base 2. -110010010001010 Convert 3014414 (base 5) to base 9. 72884 Convert 2334 (base 5) to base 15. 17e Convert 121102 (base 4) to base 14. 838 24624 (base 7) to base 3 22220020 -1110010101 (base 2) to base 9 -1228 41312 (base 5) to base 13 1303 110021112 (base 3) to base 12 521b Convert -6a (base 11) to base 2. -1001100 What is -3130124 (base 5) in base 8? -145312 Convert 17360 (base 8) to base 12. 4700 -33367 (base 8) to base 4 -3123313 What is -482 (base 12) in base 11? -563 What is 1663 (base 9) in base 3? 1202010 What is -14267 (base 9) in base 2? -10010111100100 Convert 7477 (base 16) to base 2. 111010001110111 -1ba3 (base 12) to base 10 -3435 Convert -441131 (base 5) to base 9. -22721 What is 2144 (base 14) in base 15? 1a7e 252a4 (base 12) to base 14 145ac -5b0 (base 16) to base 11 -1104 Convert 1224040 (base 6) to base 2. 10000000010011000 Convert 1346 (base 12) to base 3. 10001000 -2de8 (base 15) to base 8 -23245 -7091 (base 14) to base 15 -5ae0 Convert -201323 (base 4) to base 15. -99b Convert 331203 (base 4) to base 16. f63 245a (base 14) to base 10 6352 1655 (base 7) to base 16 2a5 Convert 127065 (base 8) to base 2. 1010111000110101 What is -1540 (base 7) in base 3? -211211 -1110310 (base 5) to base 6 -230023 -471 (base 10) to base 16 -1d7 Convert 138a7 (base 11) to base 7. 111330 3c (base 13) to base 14 39 Convert -1011000010 (base 2) to base 10. -706 What is 1310 (base 7) in base 3? 200102 Convert -14616 (base 8) to base 2. -1100110001110 -4064 (base 7) to base 5 -21133 Convert 8b (base 13) to base 5. 430 -52505 (base 7) to base 2 -11001010001101 Convert -14433 (base 6) to base 15. -a50 Convert 73 (base 8) to base 13. 47 What is -1011010101000111 (base 2) in base 14? -12cab What is 8b9a (base 12) in base 13? 70b4 114 (base 14) to base 10 214 What is 1769 (base 10) in base 4? 123221 382 (base 12) to base 3 201122 Convert 12666 (base 7) to base 8. 6545 Convert -5902 (base 11) to base 7. -31404 What is 3103313 (base 4) in base 12? 7a1b What is 10020233 (base 4) in base 8? 41057 Convert d256 (base 14) to base 10. 36140 Convert -65b2 (base 14) to base 3. -220010212 -100001011 (base 3) to base 12 -3994 Convert 18189 (base 14) to base 6. 1144541 What is -5115 (base 10) in base 7?	{ "pile_set_name": "DM Mathematics" }
f (1670/(-7515))/((-1)/(-189))? -42 What is ((-2)/14)/((-1168)/63072)(21/2)/(-3)? -27 What is 43100/(-30)(-12)/401? 43 What is (-8)/84154/121? -4/33 11/(-2)(-145)/(331760/2184) 21/4 What is the value of ((-198)/(-65472)-62)/((-11)/(-12))16/3? -12/11 Calculate 4130/(-15045)(-15)/(-70)-1. 1/17 What is ((-456)/14)/((-557)/(635537/326))? 114 What is the value of 12/2(-9213)/(-777)14/(-12)? -83 Calculate (3660/4270)/((-2)/(-49)). 21 (1/(10/2))/((-71)/(7100/(-30))) 2/3 What is the value of ((-284)/(-1704))/((-9)/(-2376))? 44 What is the value of (10/(-24))/((-23790)/(-1008696))? -53/3 Calculate (15/12)/(-10(-13)/520)(-1)/(-18). 5/18 Evaluate ((-335280)/1524)/(2/1). -110 Calculate (-900)/1560429/(-110). 9/4 What is (17825/460)/(300/1600(-10)/6)? -124 What is (252/294)/(((-2592)/160)/(-27))? 10/7 (13398/43120-20)/((-1)/(-14)) -87 Evaluate ((-561)/17)/6664/(-112). 2/7 ((-1804)/738)/(255/(-425)(-8)/18) -55/6 What is the value of 740080/11101226/(-40)? -13/3 What is (1216/228)/(((-30)/(-20))/3)? 32/3 What is the value of (-520)/(-1820)595/(-2)? -85 Calculate (-232)/(-174)50/(-160)-156. 65 What is the value of (7/(1050/40))/((-12)/((-3600)/(-15)))? -16/3 Evaluate (((-1)/(-12))/((-19)/((-304)/(-6))))/(1188/81). -1/66 What is the value of -571/(-6)116/29-12? -76 What is the value of ((-2177604)/(-216))/(-143)6/(-9)? 47 What is the value of -1718/459((-10)/3)/(-5)? -4/9 (-5)/(-1012)(-253)/((-314985)/(-1992)) -2/253 What is the value of ((-271)/271)/(((-90)/(-225))/((-6)/5))? 3 Calculate 2(((-40)/70)/(256/(-1344)))/(-1481). -3/74 (8/(-24))/(-3896/(-580032)) -53 What is 30/7319200/42750? 32 ((36/(-12))/(6/(-8)))/(13640/(-220))6 -12/31 Calculate -4((-453097)/159)/(-83)1/(4/3). -103 Calculate (150/(390/39))/((-35)/56). -24 What is (-840)/5250(-30)/3618/(-8)? -3/10 (28/(-14))/(((-4859)/(-226))/((-1)/2)) 2/43 Calculate (143(-24)/(-528))/(((-2)/12)/((-8)/(-12))). -26 ((-148)/370)/((-24)/(-110)) -11/6 Calculate ((-100125)/2136)/(305/(-488)). 75 ((-96)/7)/((-22404)/(-117621)) -72 What is the value of (-5)/10-1210/480-46? -23/4 What is ((-15)/(-385))/((-2943)/123606)? -18/11 What is (928/(-2320))/((-64)/(-4080))? -51/2 Calculate (-2)/(84/(-270396)-87). -74 What is the value of 3857/(-76)(-16)/28? 29 Evaluate 39/(-11856)96((-66)/(-55))/(4/10). -18/19 What is the value of (-825/(-240))/(350/105(-6)/(-20))? 5/6 2/(-11)(-6996)/(-38160) -1/30 136/(-17)109/(-327)90/(-4) -60 1334/(-663)30 -20 What is the value of -216069/(-18326)(-4)/(-9)? 34/11 What is the value of ((-56)/72)/((304/(-19))/576)? 28 (1452/98098)/((-2)/(-11)) 2/49 Calculate (-6)/(209/(561/51)). -6/19 What is (-205)/(-1148)-248/16? -15/7 Calculate ((-350)/210)/(245/(-294)(-4)/50). -25 Evaluate (2/(-88))/((-2)/(-44)). -1/2 Calculate ((-141)/(-6))/((4465/380)/(-47)). -94 (((-1200)/(-24))/25)/((-11)/((-3080)/(-16))) -35 What is ((-84)/(-490))/(204462/(-4298))? -2/555 Evaluate (252/15)/((-42)/(-28))(1980/(-24))/(-33). 28 What is the value of (2(-110)/60)/((20/(-5))/(-8))? -22/3 What is the value of ((-36)/(-111))/3-1321/1092? -1/37 Evaluate ((45/19)/(-3))/((1190940/3312)/(-863)). 36/19 -9((-112)/21)/((162/39)/(-9)) -104 Calculate 120/66(126/(-168))/(30/(-32)). 16/11 Evaluate (140/10)/((-912)/1905). -7/12 What is the value of -5((-4)/(-8))/(62/(2108/(-1785)))? 1/21 Evaluate (-1)/349/((-21805)/(-979)). -11/15 What is 6/(-9)-114390/(-26)3/(-36)? 95 1-1((-21)/378)/((-33)/((-16038)/(-180))) -3/20 What is the value of 240/(-1248)(-3)/((-225)/70)(-36)/(-147)? -4/91 Evaluate (-68)/991440-81-8. -2/45 Calculate ((-160)/244/(-60))/(46/16149). 2/63 Evaluate 10/(-220)1364/(-248). 1/4 Evaluate -27(1690/1521)/(10/36). -56 Evaluate (-2)/(-21)(-132804)/3689. -24/7 What is (-42)/(-203)(-25375)/(-217875)? 2/83 Calculate (((-755082)/553)/(-59))/(-95/(-105)). 54 What is the value of -57755/(-6600)24/3? 47 -67/3-12105/(-338905) -2/23 Evaluate 24/(-21)(-5061)/(-34704). -1/6 Calculate -32656/364. -12 What is (-2)/(46/(-61))(-61180)/(-2660)? 61 (158/(-6))/(8/167/(-42)4) 79 What is the value of ((6072/16)/11)/(((-9)/5)/((-5)/25))? 23/6 What is the value of ((1/(-15))/(10/36))/((3813/(-155))/(-41))? -2/5 What is the value of ((-10)/14)/((24420/(-14168))/111)? 46 Evaluate ((-2)/4160)/((-2534)/81088). 1/65 What is the value of (179/(600545/61))/(2(-2)/(-8))? 2/55 What is the value of (-3)/66(12/(-14))/((-138)/966)? -3/11 33/(-121)29/(-435)2365 43 What is (41/((-6355)/2511))/((-9)/15)? 27 What is the value of (-230)/(-6)6762/56350? 23/5 What is (-5)/35(-4844)/3462/(-4)? -1 Evaluate ((-1340)/(-1675)5/203)/((-18)/(-21)). 2/87 What is the value of (16/13)/((-80478)/58123)? -8/9 ((-27)/(-7))/((2/(-42))/((-1431)/(-4293))) -27 What is (-569)/8535(-360)/1164? 2/97 Evaluate (10/(-3)80/16)/(-44/24). 25 What is 189/504(115/138)/((-1)/(-8))? 5/2 (-198)/(-2233)84/184/(-32) -3/58 Calculate (27/(-1))/(254/(5842/(-69))). 9 Evaluate ((-12)/2643)/(((-1512)/(-1344))/(3/(-2))). 2/11 (36/10)/((-1694)/1210)2/(-30) 6/35 Calculate (((35/14)/5)/1)/(156/17100). 95 What is the value of (9/(-2))/((-35)/(945/54))? 9/4 What is (-6)/(((-1)/3)/(20/((-12600)/(-385))))? 11 Calculate 4/(312/((-168)/(-21)))61. 8/13 What is 86/4292/((-6424)/44)? -43 Evaluate (-248)/(-68)4777/281. 62 What is (-1312)/(-1968)9/138? 1/23 6/195-45215/129 -30/13 Calculate (-5600)/563/2444/55. -10 32/(-120)126/(-28) 6/5 What is 2046/(-1364)2/17? -3/17 What is ((-1)/(1/2))/(48460/(-240))? 1/46 What is the value of ((-7653762)/46107)/(1/(2(-1)/(-4)))? -83 What is ((1344/(-272))/42)/(11/(-110)-5)? -4/17 Evaluate (-80)/(-55)5/40-44. -8 What is ((-16)/(-8))/((-7)/(28/(-16)))(-206)/(-12978)? 1/126 Evaluate ((36/180)/(1/(-2)))/((49/35)/(-7)). 2 What is the value of ((128/(-112))/((-18)/7))/(((-2950)/(-675))/1)? 6/59 Evaluate (-134)/(-2(-48)/8649). -134 What is the value of (-91)/((-4641)/408)15/(-40)? -3 Calculate 99(-82)/17589(-51)/(-9). -34/13 Calculate 1986/(-3268)-142. 71 ((-3)/(-15))/((-13061)/706(-4)/10) 1/37 (((-24)/(-28))/((-2760)/483))/(((-108)/(-15))/3) -1/16 Calculate ((-2380)/(-100))/(1540/3300). 51 What is 98/1960-30(-3)/(66/(-4))? -3/11 What is ((-59)/(-118))/(-311/(-2772))? 42 What is (-3668)/(-1048)18/21-21? -63 Calculate (990/495)/(46/(-161)). -7 Calculate ((-990)/(-891))/(10/(-45)). -5 (1/(-12))/(17(-1545)/10506) 1/5 What is the value of ((-9)/60-8)/(-17(-3)/1785-1)? -42 What is the value of 21/((11/110-5)/((-13)/(-39)))? -14 What is (-486/2472)/((-690)/115)? 2/103 What is the value of (((-44)/(-5))/2)/(119344/307020)? 33 What is ((-3)/((-345)/4))/((5746/(-201110))/(6/14))? -12/23 What is 1/501134/(-42)(25/(-3))/5? 9/10 (-5019)/76958(-161)/(-56) -3/16 What is (-7625)/(-260775)-91? -5/19 What is the value of 1255(-60)/3009600? -1/76 What is (-6)/(-423)(-68)/((-2108)/(-31))? -2/141 Evaluate (50/16)/(-42955/(-32088)). 5/2 What is (-115)/621(-8)/(160/3)? 1/36 What is the value of (-94)/((2(-12)/(-4))/(-3))? 47 22492/(-1691)19 -56 Calculate (-4774)/(-16709)(-329)/10. -47/5 What is (-160)/(-135)365175/(-5410)? -80 What is (((-4524)/(-5915))/(-87))/(4/14)? -2/65 Calculate 6536/(-258)7/14-3. 38 Calculate (-10)/(-12)((-1040)/(-425))/(-52)15. -10/17 ((-6141)/(-267))/((-21)/21) -23 (252/270)/(-7)736(-20)/6 112 What is the value of (-375)/1252220/180? -37 Calculate 20/(-9(-300)/(-3240)). -24 Calculate 171/38(-95)/30120/90. -19 Calculate 297/((-596673)/82)(-14)/(-24). -1/42 What is (((-12)/(-10))/((12992/145)/16))/((-46)/(-161))? 3/4 Evaluate 99/(250272/3713)-8. -47/4 Calculate (155/248)/(7/(252/30)). 3/4 What is -1-15((-4760)/150)/34? -14 ((-30)/(-55))/((-895)/(-1969)(-32)/(-10)) 3/8 What is the value of (-504)/(-32)-2-15(-2)/(-45)? 21 Calculate 36/(-360)(-14)/(28/4)145. 29 What is the value of (-75(-57)/299250)/(1/4)? 2/35 Calculate (-168)/(-945)-9(-4)/((-28)/245). -56 (-108)/(-132)7920/(-20520) -6/19 Calculate 731(-10)/(-10)(-2208)/18768. -86 Calculate (-12)/(-19)(39/(-390)-6)/((-12)/(-190)). 6 What is ((-36)/(-27)630/(-112))/((5/4)/1)? -6 What is 20((-3094)/455)/17? -8 (90/8)/(5901/(-7868))(28/5)/2 -42 What is 5/(-2)((-47960)/(-10175))/109? -4/37 Calculate (((-804)/((-24)/(-4)))/6)/(18/91817). -67	{ "pile_set_name": "DM Mathematics" }
divided by 2 -3771 -11851 divided by 1693 -7 Calculate 380443 divided by 4. 380443/4 Calculate 3 divided by -6733. -3/6733 Calculate 45178 divided by 7. 6454 Divide -1247220 by 205. -6084 Divide -464831 by -12563. 37 What is -402 divided by -243? 134/81 Divide 595960 by -6340. -94 33 divided by 41 33/41 7 divided by 954 7/954 Calculate 19491 divided by -6497. -3 Divide 0 by 19111. 0 What is -61047 divided by 153? -399 276568 divided by -69142 -4 -19 divided by -1418 19/1418 1 divided by -33639 -1/33639 Calculate -1720 divided by 13. -1720/13 What is 3100 divided by 50? 62 0 divided by 27555 0 78 divided by -185 -78/185 Divide 122961 by -2411. -51 What is -6258 divided by -7? 894 What is -33440 divided by 8360? -4 -86135 divided by -12305 7 What is 8 divided by -109798? -4/54899 Calculate 4 divided by -198514. -2/99257 Divide 97 by 1127. 97/1127 Divide 9388 by 98. 4694/49 -451490 divided by -90298 5 Calculate 4372 divided by -2. -2186 90635 divided by 1 90635 Divide -648940 by 4. -162235 What is 508849 divided by -46259? -11 Calculate -119 divided by 3. -119/3 What is -6342 divided by 1132? -3171/566 Divide 112814 by -2. -56407 Divide -3044 by -173. 3044/173 -2802291 divided by -147489 19 Calculate -472365 divided by 9. -52485 What is 197367 divided by -3? -65789 Divide 2387000 by -341000. -7 What is -146261 divided by -8? 146261/8 Divide 1223664 by 94128. 13 692062 divided by -7 -98866 Divide 37087 by 6. 37087/6 Divide -68352 by 178. -384 -9914 divided by 5 -9914/5 Calculate -723135 divided by -5. 144627 What is -2100 divided by -210? 10 1508618 divided by 73 20666 What is 289968 divided by -3? -96656 What is 6286 divided by 6286? 1 -237397 divided by 1 -237397 Divide -666270 by 6. -111045 Calculate -46345 divided by -65. 713 Calculate -228983 divided by -5. 228983/5 Calculate 41942 divided by -2. -20971 Calculate 4 divided by -5267. -4/5267 Calculate 5382 divided by -414. -13 -2326585 divided by 5 -465317 Divide 42140 by 2107. 20 -1819677 divided by 606559 -3 Divide -54366 by -123. 442 Divide 1022 by 164. 511/82 Divide 984687 by -984687. -1 Calculate 525570 divided by 105114. 5 Calculate -1 divided by 106534. -1/106534 -213 divided by 11250 -71/3750 What is 1096074 divided by -6? -182679 -315864 divided by 6 -52644 Divide -367257 by 1077. -341 What is -10498 divided by 1? -10498 Divide 200166 by 2. 100083 Calculate -96157 divided by 4. -96157/4 -301653 divided by 121 -2493 Divide 2381 by -238. -2381/238 -40494 divided by -1191 34 Calculate -4940 divided by -95. 52 Divide -544188 by 136047. -4 -11437434 divided by -6 1906239 -134705 divided by -26941 5 Calculate 2123392 divided by 8. 265424 0 divided by -318459 0 -1 divided by -6225 1/6225 What is 14 divided by 29853? 14/29853 1940 divided by 304 485/76 What is -56331 divided by -5121? 11 -2 divided by 46306 -1/23153 5 divided by -107266 -5/107266 Calculate 436 divided by 143. 436/143 Calculate 2776 divided by -703. -2776/703 Calculate -1528 divided by -764. 2 Divide 2447 by -636. -2447/636 Divide 109 by -114. -109/114 What is -5 divided by 1812? -5/1812 What is -403254 divided by -67209? 6 Divide 255132 by 114. 2238 Divide -21912 by -1. 21912 Calculate -112024 divided by 56012. -2 518040 divided by -12 -43170 What is 43026 divided by 7171? 6 What is 227 divided by 35? 227/35 77680 divided by -14 -38840/7 Divide -100330 by 79. -1270 Divide -638332 by -4. 159583 5 divided by -35152 -5/35152 Calculate -322 divided by -84. 23/6 Calculate -3 divided by -192043. 3/192043 What is -20069 divided by -2867? 7 -19197 divided by 4 -19197/4 Divide 4 by -452551. -4/452551 Calculate -115965 divided by -3. 38655 Divide 3 by 416082. 1/138694 Calculate -14256 divided by 396. -36 What is -595 divided by -684? 595/684 Calculate 99540 divided by 7110. 14 Divide 18571 by 2. 18571/2 What is 2618 divided by -374? -7 3 divided by -235548 -1/78516 31 divided by -18659 -31/18659 Divide -293772 by 3. -97924 Divide 20548 by -12. -5137/3 Divide -2 by 63994. -1/31997 Calculate 1324280 divided by 2. 662140 Divide -126266 by -7. 18038 -1022 divided by 1039 -1022/1039 What is 14476 divided by -7238? -2 Divide -1483222 by 26. -57047 Calculate -48531 divided by -7. 6933 What is 8956744 divided by -4? -2239186 -382 divided by 852 -191/426 Calculate -58760 divided by -11752. 5 Calculate 164906 divided by -1. -164906 What is 330548 divided by 330548? 1 Divide 961 by 6. 961/6 Calculate -277515 divided by -3. 92505 Divide 34165 by -3. -34165/3 -21330 divided by -6 3555 What is -1 divided by 16228? -1/16228 What is 2667510 divided by 107? 24930 What is -67335 divided by 67? -1005 Divide -3 by -68433. 1/22811 Calculate 2514568 divided by 4648. 541 Divide -3045 by -29. 105 Calculate 3 divided by 3017. 3/3017 What is -2413 divided by 481? -2413/481 What is 480 divided by -2020? -24/101 Divide -419366 by -934. 449 4753392 divided by -6 -792232 51324 divided by 2 25662 Calculate -93132 divided by -15522. 6 What is -259527 divided by 11? -259527/11 Divide 889404 by 296468. 3 Divide -607075 by -24283. 25 Calculate -56157 divided by 3. -18719 -4 divided by 322 -2/161 Divide -15095 by -2. 15095/2 What is -61600 divided by -15400? 4 Calculate 19686 divided by 1158. 17 410610 divided by -205305 -2 Calculate -510420 divided by 10860. -47 Divide 620009 by -13. -47693 What is -94460 divided by -94460? 1 -192168 divided by 6 -32028 57830 divided by -11566 -5 Divide 137448 by -11454. -12 2996946 divided by -19 -157734 What is 98984 divided by -24746? -4 Divide -31 by 4558. -31/4558 What is -5 divided by 1262? -5/1262 What is -3029028 divided by -6? 504838 Divide -45 by -6123. 15/2041 -723 divided by -311 723/311 What is -76 divided by 218? -38/109 What is 18286 divided by 5? 18286/5 Divide 374 by 7739. 374/7739 What is -689 divided by -203? 689/203 Calculate -82839 divided by -3. 27613 What is -4 divided by -9724? 1/2431 Divide 127295 by -18185. -7 437 divided by -7 -437/7 What is -292776 divided by 6? -48796 Divide -12638 by -36. 6319/18 2423 divided by 76 2423/76 Calculate 3430980 divided by -3. -1143660 1202247 divided by 400749 3 What is 5696244 divided by 4? 1424061 7583708 divided by 344714 22 427262 divided by 427262 1 Calculate -21 divided by -26745. 7/8915 Calculate 121 divided by -1358. -121/1358 Divide 575 by -8. -575/8 4594 divided by -73 -4594/73 What is 1340335 divided by 67? 20005 Divide 40152 by -168. -239 What is 65733 divided by -3? -21911 306210 divided by 61242 5 Calculate -5 divided by 2120546. -5/2120546 Calculate -1325352 divided by 1127. -1176 Calculate 56800 divided by 800. 71 Calculate -27569 divided by 1451. -19 Divide 155 by 10971. 155/10971 Calculate -7 divided by -75999. 1/10857 Calculate -277 divided by 64. -277/64 Divide -378080 by 1360. -278 Divide 0 by -145466. 0 What is -18270 divided by -6? 3045 What is -10816 divided by -26? 416 Divide -582288 by 6. -97048 Divide -317490 by -8. 158745/4 What is -305613 divided by -189? 1617 Divide -33 by -29366. 33/29366 -36 divided by -4488 3/374 What is 74834 divided by 37417? 2 What is 191862 divided by -14? -95931/7 Divide -85020 by 218. -390 143062 divided by 307 466 Divide 1939704 by -646568. -3 What is 2519673 divided by -8427? -299 What is 82 divided by -376? -41/188 What is -82384 divided by -3? 82384/3 Calculate -1924 divided by 481. -4 2030548 divided by 2 1015274 Divide 9755 by -1. -9755 Divide 17766564 by 4. 4441641 Divide 4481550 by 3. 1493850 Divide 1406758 by 1. 1406758 What is 1840 divided by 460? 4 31 divided by 46 31/46 What is -49153 divided by 3781? -13 -69 divided by -8594 69/8594 15 divided by -14665 -3/2933 Calculate -4 divided by 47195. -4/47195 Calculate 18197 divided by -26. -18197/26 What is -246085 divided by 7? -35155 What is 525116 divided by 4? 131279 Divide -11 by 3124. -1/284 -1931502 divided by 38 -50829 What is -1976041 divided by 2? -1976041/2 Divide 22 by 924. 1/42 Calculate 4 divided by 347255. 4/347255 What is 67770 divided by -13554? -5 What is -293403 divided by -8891? 33 67475 divided by -13495 -5 What is 29636 divided by -14818? -2 Calculate 125020 divided by -14. -8930 148545 divided by -45 -3301 What is 73284 divided by 186? 394 What is -668580 divided by -220? 3039 Calculate 925 divided by -185. -5 Calculate -836355 divided by -	{ "pile_set_name": "DM Mathematics" }
+ ko2. Let c(y) = 6y. Determine c(d(n)). -6n2 Let f(l) = l2. Let t(q) = 4766q*2 - 1927q - 1. What is t(f(o))? 4766o4 - 1927o*2 - 1 Let a(r) = r - 2. Let k(f) = 2f*2 - 3f + 6. Let m be (910/20)/(-13) + (-2)/(-4). Let u(t) = ma(t) - k(t). Let s(c) = 7c. Give s(u(x)). -14x2 Let y(f) = -10f*2. Let p(x) = 23 + 21x - 30x2 - 10 + 8. Let w = 790 - 769. Let l(n) = -6n*2 + 4n + 4. Let j(u) = wl(u) - 4p(u). Give j(y(q)). -600q4 Let g(o) be the first derivative of o6/40 - 80o*3 - 213. Let p(k) be the third derivative of g(k). Let s(f) = 5f. What is s(p(z))? 45z2 Let o(t) = t2 + 26t + 30. Let s be o(-27). Let x(y) = -15y + 157y - 4y + sy. Let m(n) = -n*2. Determine x(m(z)). -195z*2 Let b(n) = 6n*2. Let f = -15 + 17. Suppose -3g + f = -4. Let p(j) = 0j2 - 5 + 5 + jg. Give p(b(k)). 36k*4 Let n(p) = -p. Let y(i) = -8827i*2 - 1264i. What is n(y(h))? 8827h2 + 1264h Let t(u) = 23546u. Let r(x) be the first derivative of x2 - 10581. Calculate r(t(y)). 47092y Let i(b) = 144165330b. Let w(f) = 3f*2. Determine i(w(h)). 432495990h*2 Let g(v) = -2v*2. Let d(s) = 46 - 24 + 638s*2 - 22 + 398s*2. Give g(d(k)). -2146592k*4 Let y(s) = -2s. Let r(d) = 10054d - 27. Let v(o) = -2510o + 6. Let g(x) = 2r(x) + 9v(x). What is y(g(l))? 4964l Let x(n) be the first derivative of 4n*3/3 + 196n + 1111. Let v(u) = -u. What is v(x(c))? -4c2 - 196 Let q(l) = 1928147l. Let d(x) = 15x2. Calculate d(q(z)). 55766262804135z*2 Let q(g) = 32g - 1. Let k(a) be the second derivative of -a*6/360 - 8a*3 + 24a. Let o(s) be the second derivative of k(s). Give o(q(w)). -1024w2 + 64w - 1 Let w(n) = -3n + 0n - 2n. Let c(z) = z + 40. Calculate c(w(f)). -5f + 40 Let p(h) = -7 - 53 + 60 + 16h. Let k(u) = 52u*2. What is k(p(v))? 13312v*2 Let r(t) = -t + 7. Let y be r(-13). Let v be ((-128)/y)/(-22/40). Let g(l) = 2l - 2 - 81l*2 + vl*2 - 2l. Let s(x) = -x*2. Determine g(s(f)). -17f*4 - 2 Let r(b) be the second derivative of -31/2b*2 + 0 - 1/6b*4 + 24b + 0b3. Let y(v) be the first derivative of r(v). Let q(w) = 4w*2. What is q(y(g))? 64g*2 Let j(k) = -326k - 396835. Let r(q) = -2q. What is r(j(f))? 652f + 793670 Let j(l) be the first derivative of 611l2/2 + 3506. Let y(p) = 4p. Determine j(y(s)). 2444s Let t(s) = -10s. Let q(k) = 3k + 123543. Calculate t(q(n)). -30n - 1235430 Let n be (-1)/3 + 30/9. Let r(y) = -ny + 6y - 10y - 10y. Let z(k) be the third derivative of -k*4/12 + 3k*2. Give z(r(t)). 34t Let z(n) be the third derivative of n*4/8 - 16n*2 - 2n. Suppose -4c + 2c = -6. Let v(y) = 0y2 + cy*2 + 9y*2. Determine v(z(h)). 108h*2 Let k(l) = 97l. Let h(u) = -1068574u. Calculate k(h(w)). -103651678w Let s(f) = -41f + 1. Let w(o) = -3198o. What is s(w(m))? 131118m + 1 Let l(j) = 5j. Let t(k) = 3262092k. Calculate t(l(x)). 16310460x Let q(b) = 44b + 3b*2 - 22b - 22b. Let k(j) = 99j. Let p(s) = 840s. Let z(x) = 42k(x) - 5p(x). Determine q(z(u)). 5292u*2 Let w(k) = -2k. Let u(f) = -37f - 3. Let i(d) = 38d - 13 + 3d + 7 + 10 - 6d. Let y(s) = -3i(s) - 4u(s). What is w(y(b))? -86b Let p(u) = 21u*2 + 2u. Let k(j) = 42j2 + 5j. Let t(l) = 2k(l) - 5p(l). Let x = -16 - -17. Let y(g) = -1 + 773g + x - 771g. Give y(t(b)). -42b2 Let r(o) = o. Let x(p) be the second derivative of 2703p*4/4 - 4592p. Give r(x(h)). 8109h2 Let c(u) = -18u*2. Let f(r) = -383r + 32r + 1812751 - 1812751. Give f(c(h)). 6318h*2 Let u(o) = 2 + 0 + 2 - 24o + 26o - 2. Let h(n) = 8n*2. Give u(h(c)). 16c*2 + 2 Let l(q) = 9q*2 + 3. Let s(j) = -273291j*2. Determine l(s(x)). 672191736129x*4 + 3 Let o = -32 + 1324. Let c(a) = -640a - 649a + oa. Let b(x) = -2x + 4. Let q(z) = 5z - 11. Let y(w) = -11b(w) - 4q(w). Determine y(c(i)). 6i Let k(r) = 2r. Suppose -4h = -2z - 8 - 2, 4z - 4h = -4. Let c(g) = zg + 2383 + 21g*2 - 2383. Calculate k(c(q)). 42q*2 + 6q Let h(n) be the second derivative of 3n4/4 + 1217n. Let b(s) = -19s - 3. Give h(b(m)). 3249m*2 + 1026m + 81 Let n(j) = 98024148j. Let t(k) = k2. Determine t(n(v)). 9608733591125904v*2 Let q(y) = 49815y + 49833y - 99635y. Suppose 5c = -j + 3, 2c + 0c = 2j + 6. Let g(s) = -1 + c - 5s. Determine q(g(x)). -65x Let l(p) = 16p - 6. Let q(f) = 4f - 72. Let a(z) = -z + 16. Let w = 309 - 318. Let m(o) = wa(o) - 2q(o). Calculate m(l(h)). 16h - 6 Let s(z) = -2z*2. Let j be 10/(-40) + (-230)/8. Let m = -18 - j. Let c(x) = -31x + 4 - mx - 4. Give c(s(g)). 84g*2 Let a(o) = -4o + 12. Let l be -4 - -2 - (-8 - -3). Let i(w) = -lw + 147 - 147 + 4w. Determine i(a(h)). -4h + 12 Let m(q) = 15q - 4q - 2152 + 2152 - 9q. Let r(b) be the first derivative of -202b3/3 + b2 + 2. Give r(m(o)). -808o*2 + 4o Suppose -2t = 2t + 24. Let r = t - -5. Let a(q) = -9q2 - 15q. Let z(x) = -x*2 - x. Let i(h) = ra(h) + 15z(h). Let o(d) = -3d*2. Give i(o(l)). -54l*4 Let r = 9329/2 - 4664. Let b(f) be the first derivative of 0f - 13 + rf2. Let l(j) = -22j*2. Determine b(l(c)). -22c*2 Let q(i) be the second derivative of 5i*4/3 + 3i - 12. Let v(s) be the first derivative of -s*3/3 + 15. What is v(q(h))? -400h*4 Let l(c) = -1721c + 78. Let j(w) = -495w. Calculate l(j(s)). 851895s + 78 Let h(q) = -4q2. Let t(s) = -56393s + 672. Calculate t(h(w)). 225572w2 + 672 Let p(d) = 33 - 41d*2 + 6 + 1 - 40. Let c(r) = 15r. What is p(c(n))? -9225n2 Let n(d) = -d2. Let m(c) = -29c*2. Let i(w) = -m(w) + 5n(w). Let y(x) = -10152386x2 + 3x + 10152379x2 - 3x. Calculate y(i(q)). -4032q4 Let c(n) = 84996n. Let u(t) = 1347t2. Give c(u(j)). 114489612j*2 Let m(p) = -348p*2 - 11p*2 - 510p*2 + 123p*2. Let v(u) = -158u*2 + 402u*2 - 246u*2. Determine v(m(f)). -1113032f*4 Let x(o) be the first derivative of 5/2o*2 + 0o - 317. Let d(y) = -y - 1. Let p(t) = -4t2 - 12t - 12. Let a(s) = -12d(s) + p(s). What is a(x(l))? -100l*2 Let m(z) = 2z. Let a(b) = -846545 + 846545 - 48b2. Determine m(a(d)). -96d*2 Let n(s) = -569s*2. Let q(v) be the third derivative of -5v*4/24 - 4v*2 + 870. Calculate q(n(x)). 2845x2 Let h(m) = -m2 - 39m + 3. Let l(s) = -2s*2 - 91s + 7. Let g(c) = -7h(c) + 3l(c). Let t(f) = -36f2 - 2f + 4. Determine t(g(k)). -36k4 - 2k*2 + 4 Let v(j) = -6j + 1269. Let z(a) = -a + 47. Let i(y) = -5v(y) + 135z(y). Let r(l) = -4l2. Give i(r(m)). 420m*2 Let p(g) = 3g*2 + 2g - 996. Let n(j) be the first derivative of -j*2/2 - 4952. Calculate p(n(d)). 3d*2 - 2d - 996 Let g(h) = -39351h2 + 102h. Let q(s) = -12s. Determine g(q(o)). -5666544o*2 - 1224o Let h(c) = 2c2. Let d be (-410)/(-14) - (-14)/(-49). Suppose -8j = -d - 11. Let z(a) = -20a + 20a - ja2. What is z(h(k))? -20k*4 Let x(l) = 2l*2. Let g(n) = 12085097n*2. Determine x(g(p)). 292099138998818p*4 Let a(n) be the second derivative of 23n - 1/12n4 + 0n*3 + 0n*2 - 4. Let s(p) = -18p + 2. Calculate a(s(k)). -324k2 + 72k - 4 Let w(h) = -15h2 - 3h. Let t(n) be the first derivative of -22n2 + 645. Give t(w(j)). 660j*2 + 132j Let u(z) = 9z2 + 13z + 15. Let b(q) be the first derivative of -5q3/3 - 7q*2/2 - 9q + 203. Let r(k) = -5b(k) - 3u(k). Let i(m) = m. Give r(i(t)). -2t2 - 4t Let r(l) = 2539l2 - 3l - 259. Let i(d) = -17d2. Calculate r(i(f)). 733771f*4 + 51f*2 - 259 Let g(c) = -2c2. Let r(i) = i3 - 8i2 + 2i - 10. Let h be 8/(-5)(-12 - -7). Let y be r(h). Let x(u) = yu + u - 2u. Give g(x(p)). -50p*2 Let h(n) = -40n + 2. Let g(p) = 22p - 1. Let z(r) = 9g(r) + 5h(r). Let i(u) = 2u*2 + 3u*2 - 9u*2. What is z(i(w))? 8w*2 + 1 Let f(q) = 0q - 2q + 3q. Let h(k) be the second derivative of 0k2 - 4/3k*3 + 0 - 468k. Determine f(h(o)). -8o Let i(y) = -114y + 465y - 119y + 20 - 115y - 113y. Let a(t) = -23t2. Determine a(i(p)). -368p*2 - 3680p - 9200 Let b(r) = 175996r + 782. Let i(v) = -225v - 1. Let o(w) = -2b(w) - 1564i(w). Let a(d) be the first derivative of 5d2/2 - 2. What is o(a(c))? -460c Let f(y) = 5y - y - 3 + 2. Let p(a) be the third derivative of a6/360 - a	{ "pile_set_name": "DM Mathematics" }
rs of m. 2, 11 Suppose 18 = -4x + 7x. What are the prime factors of x? 2, 3 Suppose 4a - 3 = 5. List the prime factors of a. 2 Let r(c) = -3c*3 - 10c*2 - 5c + 5. Let u(f) = -4f3 - 10f*2 - 4f + 6. Let v(o) = -3r(o) + 2u(o). List the prime factors of v(-9). 3, 5 What are the prime factors of (147/2)/(15/30)? 3, 7 Suppose 3d + 2d = -15. Let a(s) = -s*2 - 3s + 3. Let x be a(d). Suppose 0g - xg + 39 = 0. What are the prime factors of g? 13 What are the prime factors of 5898/2164 + 2/(-9)? 109 Let y(m) = 2 - m + 4m + 0 + 0m. Suppose -3c = -6 - 0. List the prime factors of y(c). 2 Suppose 168y - 164y - 872 = 0. What are the prime factors of y? 2, 109 Suppose 0 = -5d + 6 + 4, -3w + d + 382 = 0. List the prime factors of w. 2 Let o = 77 + 17. List the prime factors of o. 2, 47 Let f = -566 - -885. List the prime factors of f. 11, 29 Suppose 2 = -5f - 3, -5y + f - 54 = 0. Suppose b = 19 - 0. Let m = b + y. List the prime factors of m. 2 List the prime factors of (-3)/(12/4) + 8. 7 Let y(x) = x*2 - 7x + 7. List the prime factors of y(12). 67 What are the prime factors of 1/(((-2)/474)/(6/(-9)))? 2, 79 Suppose -3d - j - 37 = -11, -j = 5d + 40. Let t(z) = -z*2 - 8z + 2. What are the prime factors of t(d)? 3 Let w(d) = 4 + d + 1 - 2d. Let t be w(9). Let o = t - -8. List the prime factors of o. 2 Let h(p) = -p + 1. Let t = -6 + 5. What are the prime factors of h(t)? 2 Let t = -1 + 2. Let y = -1 + t. Suppose -4s - 33 = -3h, -4h - 2s - 3s + 13 = y. What are the prime factors of h? 7 Let p be (-2)/(-4) + (-40)/(-16). Let o be (-1)/(p/9) - -21. What are the prime factors of (o/27)/((-2)/(-18))? 2, 3 Let l = 13 + -7. Suppose 34 = 2y + l. What are the prime factors of y? 2, 7 Let k = 34 - 18. Suppose -8 = -p - 4j, -2p + 3j = -0j - k. List the prime factors of p. 2 Suppose -4a + 22 = 4o - 22, -3a - 5o = -37. Let n = 23 - a. List the prime factors of n. 2, 7 Suppose 2h = -3o + 161 - 40, 0 = -3o - 15. What are the prime factors of h? 2, 17 Suppose 3a - 8 - 4 = 0. List the prime factors of (-102)/a4/(-6). 17 Let t(u) = u*2 - 11. Let q be t(-9). Suppose 0 = 5r - 5, r = -5f + q - 14. Suppose -4d + 5z = -23, 2d - 1 = 2z + f. What are the prime factors of d? 7 Let c = -7 - -5. Let q(h) = 2h - 7. Let s be q(5). What are the prime factors of (s/(-6))/(c/20)? 5 Suppose 9 = -4n + j, -5n + 5 = -10n - 5j. Let c be (-2)/4 + (-7)/n. Suppose -2z - 2x + 10 = cz, -4x - 28 = -2z. What are the prime factors of z? 2 Let t(r) = r3 + 5r*2 + 4r - 3. Let o be 18/(-4) - (-2)/4. Let y be t(o). Let c(u) = -2u. List the prime factors of c(y). 2, 3 Suppose -20 = 5f, 2j - f + 31 = 7j. What are the prime factors of j? 7 Suppose -6r = -2r - 16. Suppose -15 = -h - rh. Suppose -4y = 0, -y - 30 = -5n - hy. List the prime factors of n. 2, 3 Suppose k + 13 = 5z, 3z + 0k - 5k = -1. Suppose zd + 0 - 48 = 0. Suppose j - 3j = -d. List the prime factors of j. 2 Let t be -3 + (-3)/6-10. Suppose 4h + 2n = 8, 3h - tn + 2 = 15. List the prime factors of h. 3 Suppose 27 + 8 = 5v. Let k(o) = o*2 - 5o - 4. List the prime factors of k(v). 2, 5 Suppose 2 = -r, 141 + 36 = 5d + 4r. Suppose 3f + d = 3k - k, -2k - f = -25. What are the prime factors of k? 2, 7 Let j(q) = 1 - 1 - 2q - 1 + 2q2 + 2. List the prime factors of j(3). 13 Let n = 11 + -3. Let x = n + -2. List the prime factors of -1 + (-8)/(-6)x. 7 Let z(g) = -2g + 5. Let s be z(4). Let a be s/5 - 66/(-10). Suppose -100 = -ad + d. List the prime factors of d. 2, 5 Suppose 7y - 3s - 738 = 4y, 2s + 1242 = 5y. What are the prime factors of y? 2, 5 Let l be (-2 - -1)(-48)/3. Suppose -2f - 5 = 3f + 3h, 2h = 3f - l. Suppose f = b - 5. List the prime factors of b. 7 What are the prime factors of 133 + (-16)/4? 29 Let q = -55 - -132. What are the prime factors of q? 7, 11 Let z(s) = -s*3 - 5s*2 + 4s - 8. Let w be z(-6). What are the prime factors of (-7)/28 + 157/w? 3, 13 Let w(s) = -2s + 31. List the prime factors of w(-15). 61 Let u(y) = -y3 - 8y*2 - 3y - 8. Let k be u(-7). Let o = 13 + 38. Let a = k + o. What are the prime factors of a? 3, 5 Suppose -5h + 5m - 15 = 0, 4h - 13 = m - 2m. Suppose 0 = -hl + 3l + 1. List the prime factors of 8 - (l + 2) - -1. 2 Let j = 15 - -31. List the prime factors of j. 2, 23 Suppose 3f + 191 = 4i, 3i + 2f - 135 = 7f. List the prime factors of i. 2, 5 Let z = 79 - 31. List the prime factors of z. 2, 3 Suppose -i - 2i + 9 = 0, 0 = 3j + 4i - 141. List the prime factors of j. 43 Let z = 35 - 16. List the prime factors of z. 19 What are the prime factors of (17 + -2)/(3/9)? 3, 5 Suppose 3i - 5i = 2. Let y be 14 - (1 + -1)i. Let k = y + -3. What are the prime factors of k? 11 Suppose -466 = -4y - 5q, -3y = -3q + 5q - 346. Suppose 4d + y = 5a + 9, 3d - 3a + 78 = 0. Let b = -14 - d. What are the prime factors of b? 11 Suppose -6l = -54 - 78. What are the prime factors of l? 2, 11 Let x be -2(2 + -4) - 1. Suppose -xg + 96 = -0g. What are the prime factors of g? 2 Let x = -49 + 72. Suppose -2k = -3k + x. What are the prime factors of k? 23 Let g(t) = -t*3 + 12t*2 + 4t + 23. What are the prime factors of g(11)? 2, 47 What are the prime factors of ((-13)/(-26))/((-1)/(-74) + 0)? 37 Suppose -2p = -0p - 5c - 121, -5p + 274 = -3c. Suppose 5z - 72 = p. Suppose -3t = -8t + z. List the prime factors of t. 5 Suppose 5p - 3p = 14. Let w = 18 - p. What are the prime factors of w? 11 Let w(a) = -a*3 + 14a*2 + 7a + 30. What are the prime factors of w(14)? 2 Let u(s) = -28s3 - 6s*2 - s + 2. List the prime factors of u(-2). 2, 3, 17 Suppose 0 = 4w - 0w - 404. Suppose 2c = -3c + 2l + w, -c = 3l - 27. List the prime factors of c. 3, 7 Suppose 0 = -0g - 5g + 15. Let x(b) = 1 - 2b*2 - 3b - 8 + gb2. List the prime factors of x(6). 11 Let u(o) = o2 - 6o + 5. List the prime factors of u(9). 2 Let q(i) = -i*3 + 10i*2 - 7i - 9. Suppose 30 = 4s - 6. What are the prime factors of q(s)? 3 Let v be 0 + (-2 - (-12)/3). Let o(n) = -2n*2 - n + 7n + nv - 3 + 6. List the prime factors of o(6). 3 Let z(y) be the third derivative of -y5/60 - 3y4/8 - 3y*3/2 - 3y*2. Let h be z(-6). List the prime factors of (-6)/h15/(-2). 5 Suppose -8 = 2y - 0. Let a(o) = -6o - 9. What are the prime factors of a(y)? 3, 5 Let k = 12 - 7. Let f(h) = -2h2 + 6h - 7. Let m be f(k). What are the prime factors of m/(-6)2/3? 3 Let i(b) = -1. Let g(r) = r - 9. Let u(m) = g(m) - 6i(m). List the prime factors of u(6). 3 Let q(r) = 8r2 - 1. Let g be q(-1). Let h(p) = p3 - 7p2 + 1. Let t be h(g). Suppose n = t + 5. List the prime factors of n. 2, 3 Let l(d) = d3 + 4d2 + 3d + 2. Let b be l(-2). Suppose bg - 5a + 4 = 82, 0 = 4g + 5a - 58. List the prime factors of g. 17 Suppose 0 = 4m - 16 + 4. What are the prime factors of (m - (-3)/(-2))16? 2, 3 Suppose -2v + 20 = -24. Suppose 0 = 3z - 4a + 3a - v, 0 = -2z - 2a + 28. What are the prime factors of z? 3 Let m(d) = -d*2 + 2d + 72. List the prime factors of m(0). 2, 3 What are the prime factors of (-231)/7(-4)/6? 2, 11 Suppose -5a + 3a + 8 = 0. Suppose -2t = 3g - 36, -ag + 29 + 19 = -4t. List the prime factors of g. 2, 3 Suppose -2 - 4 = -2b. Let s(x) = -x*3 + 7x2 + x + 8. Let y(k) = k3 - 6k2 - k - 7. Let w(a) = -3s(a) - 4y(a). What are the prime factors of w(b)? 7 Let a = 411 + -252. What are the prime factors of a? 3, 53 Let p(a) = -a3 - 7a*2 + 7a + 8. Let w be (8/(-5))/((-2)/(-10)). Let h be p(w). Let k = h - 11. List the prime factors of k. 5 Let i(y) = -y*3 - 6y*2 - 6y + 3. Let u be i(-5). List the prime factors of (12/(-21))/(u/(-28)). 2 Let s = 442 - 315. List the prime factors of s. 127 Let p be 22/(-5) - 3/5. Let j = 11 + p. List the prime factors of j. 2, 3 Suppose 2l - 4k + k - 4 = 0, 5k = 10. Suppose -lt - 30 = -0t. List the prime factors of ((-20)/t)/(2/6). 2, 5 Let v be (38/2)/((-2)/(-4)). Let p be 0/2 + -25 + -1. Let f = p + v. List the prime factors of f. 2, 3 Let p(a) = -3a - 1. Suppose 3n + 1 = 4. Let v be p(n). List the prime factors of v/3(-27)/6. 2, 3 Let a = 29 - 17. Suppose 0 = -2t + a - 4. List the prime factors of t. 2 Let u(z) = 4z +	{ "pile_set_name": "DM Mathematics" }
945620? -s*2 - 57s - 945242 What is the a'th term of -5525, -22329, -50407, -89765, -140409, -202345, -275579, -360117? -a*3 - 5631a*2 + 96a + 11 What is the r'th term of 5149980, 10299948, 15449904, 20599842, 25749756? -r*3 + 5149975r + 6 What is the n'th term of 1490, 5499, 9508, 13517, 17526? 4009n - 2519 What is the h'th term of -113719, -113622, -113531, -113452, -113391, -113354, -113347, -113376? -h3 + 3h*2 + 95h - 113816 What is the j'th term of 2252, 2614, 2886, 3068, 3160, 3162, 3074? -45j2 + 497j + 1800 What is the w'th term of -856844, -856657, -856146, -855149, -853504, -851049? 27w3 - 2w - 856869 What is the b'th term of 1176, 4882, 11084, 19782, 30976, 44666? 1248b2 - 38b - 34 What is the g'th term of 3724, 2755, 1788, 823, -140? g*2 - 972g + 4695 What is the x'th term of -12787, -13053, -13319? -266x - 12521 What is the r'th term of 1739461, 1739464, 1739467, 1739470, 1739473, 1739476? 3r + 1739458 What is the i'th term of 25200, 28293, 33448, 40665, 49944? 1031i2 + 24169 What is the r'th term of -31399, -62820, -94275, -125764, -157287, -188844? -17r*2 - 31370r - 12 What is the y'th term of 934387730, 934387729, 934387726, 934387721, 934387714, 934387705? -y*2 + 2y + 934387729 What is the k'th term of 3084, 12486, 28166, 50118, 78336, 112814? -k*3 + 3145k*2 - 26k - 34 What is the f'th term of 21657, 43249, 64843, 86439? f*2 + 21589f + 67 What is the s'th term of 30784514, 30784513, 30784512, 30784511, 30784510? -s + 30784515 What is the x'th term of -8815, -6479, 7005, 31637, 67417, 114345, 172421? 5574x2 - 14386x - 3 What is the f'th term of 365142, 364299, 362894, 360927, 358398, 355307? -281f2 + 365423 What is the g'th term of 13140, 12835, 12332, 11637, 10756, 9695? g3 - 105g*2 + 3g + 13241 What is the k'th term of -473, -2929, -8929, -20033, -37801? -260k3 - 212k*2 - 1 What is the y'th term of -2545637, -2545630, -2545623? 7y - 2545644 What is the v'th term of 5094979, 5095000, 5095035, 5095084, 5095147, 5095224, 5095315? 7v2 + 5094972 What is the i'th term of 13783, 13322, 12545, 11446, 10019, 8258, 6157, 3710? -i3 - 152i*2 + 2i + 13934 What is the j'th term of 272690, 545691, 819000, 1092617, 1366542? 154j2 + 272539j - 3 What is the z'th term of -12572743, -25145487, -37718231, -50290975, -62863719? -12572744z + 1 What is the o'th term of 105605, 105053, 104501, 103949, 103397, 102845? -552o + 106157 What is the t'th term of -622967, -1245978, -1868989, -2492000? -623011t + 44 What is the l'th term of 7078, 6724, 5762, 3886, 790, -3832? -51l*3 + 2l*2 - 3l + 7130 What is the n'th term of -701, -3729, -11379, -25961, -49785? -385n3 - n2 - 330n + 15 What is the w'th term of -12297, -15229, -8797, 6999? 4682w2 - 16978w - 1 What is the x'th term of -3029, -7404, -19279, -42404, -80529? -625x3 - 2404 What is the q'th term of -7381, -7595, -7965, -8569, -9485, -10791? -13q*3 - 123q - 7245 What is the s'th term of -292156, -583989, -875822? -291833s - 323 What is the y'th term of -1036353, -1036366, -1036377, -1036386, -1036393? y2 - 16y - 1036338 What is the j'th term of -7614, -64233, -217910, -517173, -1010550, -1746569? -8088j3 - j2 + 475 What is the s'th term of 4187, 16980, 38367, 68348, 106923? 4297s*2 - 98s - 12 What is the g'th term of 25260521, 25260526, 25260531? 5g + 25260516 What is the o'th term of 47413628, 47413649, 47413670, 47413691, 47413712, 47413733? 21o + 47413607 What is the k'th term of 3114, 3156, 3206, 3246, 3258, 3224? -3k3 + 22k*2 - 3k + 3098 What is the m'th term of 1412, 11305, 38148, 90407, 176548, 305037? 1411m3 + 9m*2 - 11m + 3 What is the c'th term of 698048, 698033, 698006, 697967, 697916, 697853, 697778? -6c2 + 3c + 698051 What is the i'th term of 664723, 664720, 664715, 664708, 664699, 664688? -i*2 + 664724 What is the r'th term of 14647, 14483, 14313, 14137, 13955, 13767, 13573? -3r*2 - 155r + 14805 What is the v'th term of -6133, -5188, -3619, -1426? 312v2 + 9v - 6454 What is the h'th term of -1083698241, -1083698242, -1083698243? -h - 1083698240 What is the d'th term of -25774, -25178, -24582, -23986? 596d - 26370 What is the o'th term of -1979, -7936, -17849, -31718? -1978o*2 - 23o + 22 What is the b'th term of 252, 131, -246, -885, -1792, -2973, -4434? -b*3 - 122b*2 + 252b + 123 What is the f'th term of 11693709, 11693689, 11693667, 11693643, 11693617, 11693589, 11693559? -f*2 - 17f + 11693727 What is the s'th term of -16879, -16751, -16529, -16207, -15779, -15239, -14581, -13799? s*3 + 41s*2 - 2s - 16919 What is the k'th term of -96128, -192205, -288282, -384359? -96077k - 51 What is the c'th term of -66, -292, -562, -882, -1258, -1696? -c3 - 16c*2 - 171c + 122 What is the i'th term of 9809, 19494, 29045, 38444, 47673, 56714, 65549, 74160? -3i3 - 49i*2 + 9853i + 8 What is the w'th term of 101032, 404121, 909262, 1616449, 2525676, 3636937? -w*3 + 101032w2 + 1 What is the p'th term of -31683, -32284, -33293, -34716, -36559, -38828? -p3 - 198p2 - 31484 What is the l'th term of 116435, 116423, 116391, 116339, 116267, 116175? -10l*2 + 18l + 116427 What is the d'th term of -863, -76, 711? 787d - 1650 What is the n'th term of 82407, 329658, 741741, 1318656, 2060403, 2966982? 82416n*2 + 3n - 12 What is the y'th term of 74917, 149848, 224791, 299740, 374689, 449632, 524563? -y*3 + 12y*2 + 74902y + 4 What is the p'th term of 30859441, 30859435, 30859429, 30859423, 30859417, 30859411? -6p + 30859447 What is the p'th term of 2727, 1811, 895, -21? -916p + 3643 What is the y'th term of 479, 677, 891, 1121, 1367? 8y2 + 174y + 297 What is the w'th term of 616, 2483, 5614, 10045, 15812, 22951, 31498, 41489? 6w3 + 596w*2 + 37w - 23 What is the a'th term of 12634, 8845, 5056? -3789a + 16423 What is the u'th term of 118303, 473121, 1064485, 1892395, 2956851? 118273u2 - u + 31 What is the q'th term of 2641, 4135, 4485, 3697, 1777, -1269? q3 - 578q2 + 3221q - 3 What is the m'th term of -974, -1960, -2996, -4106, -5314, -6644, -8120, -9766? -4m3 - m2 - 955m - 14 What is the g'th term of 4729, 19170, 43313, 77158, 120705? 4851g2 - 112g - 10 What is the c'th term of -2628, -19832, -66398, -156966, -306176, -528668, -839082, -1252058? -2440c3 - 41c*2 - c - 146 What is the d'th term of -40454, -40350, -40246? 104d - 40558 What is the t'th term of 20936029, 41872063, 62808097? 20936034t - 5 What is the r'th term of -93217, -94275, -95333? -1058r - 92159 What is the q'th term of -1000, 6, 1726, 4196, 7452? 6q3 + 321q*2 + q - 1328 What is the o'th term of 69856, 279410, 628662, 1117612, 1746260? 69849o*2 + 7o What is the w'th term of -132057, -528291, -1188683, -2113233? -132079w2 + 3w + 19 What is the l'th term of 26989390, 53978779, 80968164, 107957545, 134946922, 161936295, 188925664? -2l2 + 26989395l - 3 What is the w'th term of -7117, -65036, -224511, -536320, -1051241? -8463w3 + 1322w + 24 What is the l'th term of 82870123, 165740250, 248610377, 331480504? 82870127l - 4 What is the q'th term of -4143474, -4143577, -4143748, -4143987, -4144294? -34q*2 - q - 4143439 What is the n'th term of -658, 2708, 8322, 16184, 26294, 38652, 53258? 1124n*2 - 6n - 1776 What is the o'th term of 2552, 10253, 23134, 41231, 64580, 93217? 6o3 + 2554o*2 - 3o - 5 What is the u'th term of 212075, 212097, 212119, 212141, 212163? 22u + 212053 What is the x'th term of 47243, 94111, 140607, 186731? -186x*2 + 47426x + 3 What is the p'th term of 856071, 856090, 856129, 856194, 856291, 856426, 856605? p*3 + 4p*2 + 856066 What is the w'th term of -9737306, -9737264, -9737164, -9736976, -9736670, -9736216, -9735584, -9734744? 5w3 - w2 + 10w - 9737320 What is the d'th term of 1026776, 2053549, 3080322, 4107095, 5133868, 6160641? 1026773d + 3 What is the a'th term of 2396, 2556, 2682, 2774, 2832, 2856, 2846? -17a2 + 211a + 2202 What is the x'th term of -71130, -142181, -213232? -71051x - 79 What is the r'th term of -112974, -223018, -333062, -443106, -553150, -663194? -110044r - 2930 What is the f'th term of -397, -3348, -8853, -16912, -27525? -1277f2 + 880f What is	{ "pile_set_name": "DM Mathematics" }
of sequence cobb. 1/840 Two letters picked without replacement from vpraarvttrtsrrt. Give prob of sequence rv. 1/21 What is prob of sequence xnx when three letters picked without replacement from {n: 4, l: 4, x: 2, j: 3, v: 1}? 1/273 Two letters picked without replacement from {d: 1, a: 1, q: 3, k: 2, t: 1, w: 3}. Give prob of sequence kq. 3/55 Two letters picked without replacement from {v: 2, d: 15, s: 3}. Give prob of sequence dv. 3/38 Two letters picked without replacement from hvvvdwwdvhdhvdd. What is prob of sequence hd? 1/14 What is prob of sequence ntc when three letters picked without replacement from ntc? 1/6 Four letters picked without replacement from {m: 2, g: 1, l: 2, t: 1, s: 1, o: 1}. Give prob of sequence lgsl. 1/840 Four letters picked without replacement from {v: 1, i: 3, a: 4, k: 5, y: 5}. What is prob of sequence kaik? 1/306 Three letters picked without replacement from didilddhdeil. Give prob of sequence dih. 1/88 Three letters picked without replacement from {c: 4, e: 4, l: 4, i: 1, b: 3, k: 4}. Give prob of sequence lec. 8/855 Calculate prob of sequence smis when four letters picked without replacement from sidwmisx. 1/420 What is prob of sequence ppyy when four letters picked without replacement from {y: 10, p: 5, b: 4}? 25/1292 Calculate prob of sequence ll when two letters picked without replacement from dlzlzlzld. 1/6 Four letters picked without replacement from {q: 1, l: 4, i: 2, s: 3}. What is prob of sequence qsii? 1/840 Two letters picked without replacement from bbbmsgsmbbbgsbsbgbgm. Give prob of sequence bg. 9/95 What is prob of sequence nnb when three letters picked without replacement from kbkknkbbknbhkbn? 1/91 Two letters picked without replacement from {o: 16, g: 4}. What is prob of sequence gg? 3/95 Four letters picked without replacement from {k: 3, m: 1, i: 2, z: 1, j: 3, u: 5}. Give prob of sequence iuum. 1/819 Three letters picked without replacement from {s: 3, g: 1, p: 3, i: 3}. Give prob of sequence iss. 1/40 Calculate prob of sequence php when three letters picked without replacement from {a: 2, p: 2, h: 3, b: 2}. 1/84 Two letters picked without replacement from {e: 4, g: 2}. Give prob of sequence ee. 2/5 What is prob of sequence zzky when four letters picked without replacement from kzzky? 1/30 Three letters picked without replacement from gpbbggbb. What is prob of sequence bbg? 3/28 What is prob of sequence ggg when three letters picked without replacement from gggcggggggggggggcc? 455/816 Calculate prob of sequence fe when two letters picked without replacement from {k: 2, f: 5, p: 1, h: 2, e: 2, r: 2}. 5/91 Calculate prob of sequence ip when two letters picked without replacement from frfcgcip. 1/56 What is prob of sequence kcf when three letters picked without replacement from czzfcfzzfzzcczcfkc? 1/204 Two letters picked without replacement from awow. What is prob of sequence ao? 1/12 Two letters picked without replacement from osggfo. What is prob of sequence so? 1/15 Two letters picked without replacement from lvvqaqvvvvvqvqaaiv. What is prob of sequence al? 1/102 Three letters picked without replacement from {k: 11, o: 2}. Give prob of sequence koo. 1/78 Two letters picked without replacement from nnyyyanqylyy. Give prob of sequence la. 1/132 Two letters picked without replacement from ddrdrddwwdsrrdsddw. Give prob of sequence rd. 2/17 Calculate prob of sequence nvvi when four letters picked without replacement from vvinvnn. 3/140 Three letters picked without replacement from onomttjj. Give prob of sequence ojo. 1/84 Two letters picked without replacement from kesaaejq. Give prob of sequence kj. 1/56 Calculate prob of sequence jn when two letters picked without replacement from ciijnc. 1/30 Three letters picked without replacement from bbvbvbbbbbbvbbbbbb. Give prob of sequence vvv. 1/816 What is prob of sequence hv when two letters picked without replacement from phphvfhpvfhhp? 5/78 Calculate prob of sequence nc when two letters picked without replacement from kknc. 1/12 Three letters picked without replacement from {i: 5, x: 1, k: 3}. Give prob of sequence kix. 5/168 Three letters picked without replacement from {y: 5, u: 2}. What is prob of sequence yyy? 2/7 Calculate prob of sequence dtxx when four letters picked without replacement from xdtxtxtddxdxxtd. 5/273 Calculate prob of sequence xqq when three letters picked without replacement from {q: 4, x: 2}. 1/5 What is prob of sequence ox when two letters picked without replacement from {l: 2, o: 2, x: 4, z: 2, b: 2}? 2/33 Three letters picked without replacement from iffikfcksvsis. What is prob of sequence fsf? 3/286 What is prob of sequence msyf when four letters picked without replacement from {x: 2, a: 1, m: 1, y: 1, s: 1, f: 1}? 1/840 Four letters picked without replacement from fppsspfsfffpssx. What is prob of sequence ppps? 1/273 Calculate prob of sequence ae when two letters picked without replacement from eeeeeaeaaeeeeeeeee. 5/34 What is prob of sequence ix when two letters picked without replacement from xxjijxixi? 1/6 Calculate prob of sequence xx when two letters picked without replacement from eoeokxeakxlo. 1/66 Two letters picked without replacement from {h: 4, n: 2, a: 6}. What is prob of sequence nh? 2/33 Three letters picked without replacement from nkknkknnnnkkn. What is prob of sequence knk? 35/286 Three letters picked without replacement from {g: 2, z: 1, f: 1, v: 3}. What is prob of sequence gzf? 1/105 What is prob of sequence lg when two letters picked without replacement from {y: 2, g: 11, l: 5, p: 1, t: 1}? 11/76 Calculate prob of sequence tt when two letters picked without replacement from tjttdjdtt. 5/18 Calculate prob of sequence npgx when four letters picked without replacement from {x: 4, p: 2, n: 1, g: 10}. 1/714 Four letters picked without replacement from jhhheqqjjhqeqjeh. What is prob of sequence hhqq? 1/182 What is prob of sequence nn when two letters picked without replacement from {m: 1, n: 10, z: 2, y: 3}? 3/8 Four letters picked without replacement from hhphpggbbppf. What is prob of sequence hbfg? 1/990 What is prob of sequence mjr when three letters picked without replacement from ojrrrjmjjmomo? 3/143 What is prob of sequence koav when four letters picked without replacement from kaookv? 1/90 What is prob of sequence kxe when three letters picked without replacement from {k: 1, e: 1, x: 2}? 1/12 Calculate prob of sequence zx when two letters picked without replacement from {z: 2, x: 2}. 1/3 Two letters picked without replacement from gbguuujebgebbu. What is prob of sequence bu? 8/91 Two letters picked without replacement from {d: 7, f: 2, g: 8, p: 1}. Give prob of sequence gf. 8/153 Four letters picked without replacement from {s: 3, t: 7}. What is prob of sequence tttt? 1/6 Calculate prob of sequence jar when three letters picked without replacement from {j: 2, c: 1, r: 1, y: 2, a: 1}. 1/105 Calculate prob of sequence zc when two letters picked without replacement from {z: 1, t: 1, w: 1, j: 1, c: 1}. 1/20 Four letters picked without replacement from nnnk. Give prob of sequence nknn. 1/4 Two letters picked without replacement from {j: 1, b: 4, z: 6, r: 3, n: 1, k: 1}. What is prob of sequence bk? 1/60 Calculate prob of sequence qjjq when four letters picked without replacement from {j: 5, q: 15}. 35/969 Four letters picked without replacement from {b: 2, u: 2, w: 1, d: 1, x: 1, r: 1}. Give prob of sequence dxur. 1/840 Calculate prob of sequence yyku when four letters picked without replacement from kyzuy. 1/60 Calculate prob of sequence so when two letters picked without replacement from {s: 1, o: 1, y: 1}. 1/6 Three letters picked without replacement from bsbssbsbbsbs. What is prob of sequence sbs? 3/22 Three letters picked without replacement from qqrxirrrqqxbrrrqrrxr. Give prob of sequence rix. 1/228 Calculate prob of sequence np when two letters picked without replacement from kkpnp. 1/10 Four letters picked without replacement from jeeeeeeeejjeejjeee. What is prob of sequence ejje? 13/306 What is prob of sequence es when two letters picked without replacement from {h: 1, x: 1, s: 1, b: 8, e: 1}? 1/132 What is prob of sequence ho when two letters picked without replacement from ohohoohhoh? 5/	{ "pile_set_name": "DM Mathematics" }
154368.65 and 0. 0 -1374 * -25.0903 34474.0722 Product of -24384 and -0.06284. 1532.29056 Multiply 60 and 168.621. 10117.26 What is the product of 0.246 and -168.57? -41.46822 Work out 0.3367789 * -1.7. -0.57252413 Work out -0.6 * 66.073. -39.6438 -339497 * 3 -1018491 Multiply -0.762 and 29914. -22794.468 Multiply -11.728 and -0.464. 5.441792 Multiply 2 and -14876472. -29752944 Product of 5.93 and 74703.3. 442990.569 Product of -3730 and 2.292. -8549.16 Multiply 0.6 and 10.212645. 6.127587 Product of 1.97843 and -53. -104.85679 Calculate -443-99.43. 44047.49 0.4676417 0.25 0.116910425 What is the product of 41 and 15.7555? 645.9755 Work out 334 * -31.703. -10588.802 Calculate 445361-0.649. -289039.289 Work out -341991 0.7. -239393.7 Multiply 2 and -14469199.6. -28938399.2 Product of 549256 and -0.01. -5492.56 Product of 10.5 and 167335.6. 1757023.8 What is -0.02 times 3357096? -67141.92 Calculate -4-6998069. 27992276 Multiply 0.9 and -4.3976422. -3.95787798 0.59574 -0.035 -0.0208509 Calculate 1474.7030.048. 70.785744 What is the product of 3.621 and 505.44? 1830.19824 What is 0.072 times -0.144961? -0.010437192 Product of 264 and 1211582. 319857648 -2 times 0.11851 -0.23702 -5773520.079 -45610.808 What is the product of -13130 and 16.282? -213782.66 -125-245.516 30689.5 430984 -0.051 -21980.184 What is the product of 186.962 and -0.03? -5.60886 -6.4386 times 129 -830.5794 Product of -41895 and -30. 1256850 Work out 1956234 * 0.34. 665119.56 What is the product of -239938.08 and -6? 1439628.48 Product of -21686 and -1714. 37169804 What is -1661979 times 105? -174507795 Product of 0.3 and 164964259. 49489277.7 What is the product of 110 and -108075? -11888250 What is 700.55 times 282? 197555.1 Product of -1 and -14.79183. 14.79183 What is the product of -5 and 12284876? -61424380 Work out -0.3 * -1223052. 366915.6 What is the product of 4 and 242669.15? 970676.6 Calculate -6-39.9205. 239.523 -0.2 -1999057 399811.4 -67-1.1987 80.3129 Product of 1683728 and 0.02. 33674.56 What is -15159646 times 5? -75798230 Calculate -10233931.04-5. 51169655.2 -10042 times -525 5272050 Work out -3.234671 * -23. 74.397433 Work out 1958 * -167.62. -328199.96 Multiply 0.043141 and -3.11. -0.13416851 Calculate -5.37-0.31576. 1.6956312 What is -0.4 times 58912555? -23565022 Product of -0.3 and 906890.8. -272067.24 Work out -0.3 -0.00024466. 0.000073398 Work out -46538303 * 5. -232691515 Work out 0.1 * 10627609. 1062760.9 Product of 20465275 and 1. 20465275 Multiply 65.34851 and -4. -261.39404 Multiply 8832 and -1.51. -13336.32 Work out -0.71 * 585.46. -415.6766 -2 times -42275533 84551066 Work out 841 * -119. -100079 89672142 * 0.08 7173771.36 Product of 1524 and -277329. -422649396 What is the product of 511075.1 and -4? -2044300.4 What is the product of 486289 and 81? 39389409 Calculate -20.17615736. -0.35231472 Calculate -13085200.18. -235533.6 Multiply -15.1 and -24245. 366099.5 -39988232-0.4 15995292.8 What is the product of 1156 and -325.1? -375815.6 Calculate -51685-1462. 75563470 What is the product of 21 and -1884? -39564 -0.12 times 50788449 -6094613.88 What is -523503 times 64? -33504192 What is 209353288 times -0.2? -41870657.6 What is the product of 4 and 95565890? 382263560 What is -22.0658722 times 0.2? -4.41317444 Product of -15.261767 and -0.3. 4.5785301 What is the product of -31.1232 and -22? 684.7104 0.034 times -76696 -2607.664 Calculate 15452.9253. 8150.4962 Product of 0.255 and -2358.171. -601.333605 4 times 4249575 16998300 -0.02135432 -2708.64 1426832971 142683297 -6.4555048-3 19.3665144 What is -5 times -1146263? 5731315 2810 * -863 -2425030 -63-2174750 137009250 Calculate -0.3617406.6. -2673.7826 What is 883655 times -0.4? -353462 0.07717672 times 0.3 0.023153016 30309550.6 1818573 Calculate 8.5845562. 7187277 2611068 times 7 18277476 Multiply -1.458 and 130.08. -189.65664 -5 * 377113 -1885565 Calculate -701.2912-5. 3506.456 What is the product of 544711 and -0.04? -21788.44 Multiply 558.973 and -0.76. -424.81948 Work out 0.39 3.9719. 1.549041 Work out 77 * 0.141764. 10.915828 3156350.25 times 2 6312700.5 0.33 times -236177 -77938.41 Product of 20437199 and 0.014. 286120.786 228011 * 6869 1566207559 Calculate -0.1798-3.896. 0.7005008 Calculate -5558-616.2. 3424839.6 What is 35488.126 times -0.3? -10646.4378 What is -2.562 times 25.37? -64.99794 Multiply 16 and -22082.5. -353320 What is the product of -0.004922 and 56.9? -0.2800618 752241255 94406120 Calculate 57477080.4. 2299083.2 Work out 14.97 * -120.4. -1802.388 3 * -39.80966 -119.42898 -4 * 110186.841 -440747.364 Multiply -3 and -234164637. 702493911 Calculate 0.29540.2775. 0.0819735 Product of 114428 and 1.04. 119005.12 -58350 -10306 601355100 Multiply 8011 and 16819. 134737009 Multiply 27469 and -112. -3076528 -0.12 * 0.28396 -0.0340752 Product of 0.1 and -77095.318. -7709.5318 -1.269161 * 24 -30.459864 Work out -372 * -31.685. 11786.82 Calculate 0.175764914. 11405.3898 4 24123167 96492668 What is 0.723 times -0.193304? -0.139758792 What is -2 times -415138618? 830277236 2.032 times 102300 207873.6 What is the product of -0.8253 and -9656? 7969.0968 Calculate -0.3-2797980. 839394 Work out -1 5035563. -5035563 What is the product of -1.1743 and -278? 326.4554 What is the product of -54 and -695298? 37546092 What is the product of 0.06 and -3657.399? -219.44394 Multiply -1.1 and -0.17552819. 0.193081009 -21 times 274667 -5768007 What is -17369 times -36? 625284 What is 306 times 0.055144? 16.874064 Calculate -249512219. -47407318 934 46765 43678510 Calculate -0.760.0663688. -0.050440288 3.905236-62 -242.124632 What is -4.0396242 times 0.2? -0.80792484 Multiply -0.07 and -2.617154. 0.18320078 What is -131675 times -8? 1053400 182.5 times -35896 -6551020 199408 * -2.78 -554354.24 Calculate -11781141. -1781141 What is the product of 1.33 and 359832? 478576.56 7180421 -2.4 -17233010.4 Multiply 351.8 and 0.204. 71.7672 0.15448114 17.61072 What is the product of -19424 and 0.05366? -1042.29184 Product of -0.1 and 284.7638. -28.47638 0.1 -2936441.1 -293644.11 Multiply -3814089 and -10. 38140890 11.99248 * -16 -191.87968 -47-24.946 1172.462 Product of -79 and 0.111375. -8.798625 What is 3.405 times -47649? -162244.845 Work out -0.2 0.52328494. -0.104656988 -132 * -37339 4928748 Calculate -2.75471281. -14772458.7 -0.22 times -1.196287 0.26318314 34341154 13023462 What is the product of 64 and 194.725? 12462.4 0.5-0.05108619 -0.025543095 Calculate -5196-0.5978. 3106.1688 Calculate -0.29350.05065. -0.014865775 Work out -5935 -3013. 17882155 Multiply 0.213 and 316397. 67392.561 Multiply 694889 and 239. 166078471 0.1 * 7647936 764793.6 Calculate 10.2920578. 0.2920578 Calculate 746625811. 82128838 -5 times 90773070 -453865350 What is the product of 7056 and -0.36469? -2573.25264 Product of 0.3 and 6.9677967. 2.09033901 Multiply 23.4 and -1179629. -27603318.6 Calculate 1023094729. 296697463 What is the product of -1127399 and 916? -1032697484 What is 2 times -18797.083? -37594.166 682958 0.05 34147.9 Product of 0.052 and -5.5223. -0.2871596 -54.66 times 2866 -156655.56 What is -3 times 42134680? -126404040 Work out 0.4 * 115501. 46200.4 Product of 9794680 and 10.7. 104803076 3 times -4834409 -14503227 Calculate -457576-2. 915152 -33429278 3 -100287834 Work out 6.088466 * 4. 24.353864 What is the product of -62043.7 and 1.46? -90583.802 0.335281766 2.01169056 Product of -1380 and -246.6. 340308 Work out -0.1 49.204468. -4.9204468 Multiply -0.3 and -147623590. 44287077 13181800 * 1 13181800 What is -49 times -0.440419? 21.580531 Product of -65 and -296483. 19271395 13926.8 times -0.4733 -6591.55444 -1524.2 times -2824 4304340.8 -0.02332 * 1.41 -0.0328812 -1.5 times 0.311291 -0.4669365 What is the product of -16542.9 and 5.1? -84368.79 Product of 3636 and -38349. -139436964 Calculate 0.11-8846044. -973064.84 Product of 0.06 and 2.8904336. 0.173426016 3421.05-2.2 -7526.31 Calculate -2209.303-0.4. 883.7212 Calculate -182.5-173.251. 31618.3075 -0.061899461 * 0.25 -0.01547486525 -63863146 times 0.3 -19158943.8 What is the product of -4037 and 4577? -18477349 What is -155485780 times 5? -777428900 -1439.9 * -0.2861 411.	{ "pile_set_name": "DM Mathematics" }
0 + 0 - q. Let t be d(6). Let h be -3 + (-90)/(-6)3/5. Do h and t have the same value? True Let u = 44191 - 44194. Let d = 3 + -1. Is u equal to d? False Suppose 2q = 3r + 30, 3r = q - r - 25. Suppose -qb - 64 = -5b. Let t be b + -1 + 4 - -2. Which is smaller: -12 or t? -12 Let s = -2/141 - 41/423. Suppose -5c - 4650 = -4j - j, 4c = -2j + 1884. Let m = j + -934. Is m < s? False Let j be (-70)/(-21)-2 + 8/(-6). Let n be (j - -6)/(-1) - (0 - -7). Which is smaller: 2 or n? n Let a be (3/(-9))/(1/6). Suppose 5z + 34 = 5u - 1, 7 = u + z. Is a > u? False Let v = 7099 + -7102. Which is bigger: 1.064 or v? 1.064 Let x = 23333 - 23332. Which is smaller: 3/10154 or x? 3/10154 Let a = 1471.8 - 1445.8. Which is smaller: 29 or a? a Suppose 0 = -36d - 15315 - 45453. Let k be (-750796)/(-444) + 1 + -4. Let f = d + k. Is 0 greater than or equal to f? True Suppose 0 = -4k - 10 + 2. Suppose 15 = o + 1. Let g be ((-8)/(-12))/(o/(-15)). Is g at most as big as k? False Let c = 65 + -65.05. Let k = -4.7 + 2. Let u = k + 3.1. Are u and c nonequal? True Let a = -14 - -47. Let m = a - 25. Let l = 8.2 - m. Which is greater: 25 or l? 25 Let k = -187 - -484. Suppose -r = 2i + 608, 3r = -i + 6r - k. Does -303 = i? True Let j = -70 - -71. Suppose 0 = 4s - o - 10, 4s + 0s - 3o - 14 = 0. Suppose -7k = sk + 504. Is j less than or equal to k? False Let q be ((-2)/338/(-114))/(194/6). Let j be ((-6)/9)/((-2)/(-3)). Is q less than j? False Let l = -61 - -64. Let x be l/36 - 10/(-15). Is x not equal to -1/16? True Let n = -4957 - -3464. Which is smaller: n or -1494? -1494 Let c be 23 + 120/(-20)4. Which is bigger: c or 4/577? 4/577 Let z = -512 - -512.2. Are z and -1495 unequal? True Let g be (28 - 32) + -3 + 22. Let w(t) = -t*3 + 4t*2 - 2t - 2. Let k be w(2). Suppose k = 2b - 0. Which is greater: g or b? g Suppose 0 = 21m + 22m. Is -1/11611 less than m? True Let m be -10 + 2 - (1 + -780). Let y = m + -769. Is 13 at most as big as y? False Suppose 5p + 63 = 4g, 1 = g - 1. Let v = 0 - p. Suppose -z - v = 3c - 0, z - 17 = 4c. Is c greater than or equal to -14? True Let n be (-2 - 1) + (4 - 8). Let s be -2n/63 - (-28)/36. Is s at least as big as 22? False Let z = 1661.7 + -1662. Which is greater: -24/7 or z? z Suppose 64 + 261 = 13l. Suppose 0 = 24o - lo - 2s, -5s - 13 = -4o. Which is smaller: o or -23.2? -23.2 Suppose d + 2u - 36 = -48, 0 = -4d + 3u - 15. Which is smaller: d or -0.83? d Let s be 6 - (2 + 3 - 4). Suppose -l + 4 = -5b, 0b - 2b + sl = -3. Which is smaller: b or 3/80? b Suppose 17787 = -32036d + 32057d. Which is smaller: 854 or d? d Suppose 0 = m + 3k - 16, -2k - 20 = -3m - 4k. Let n(u) = u2 - 2u + 4. Let i be n(6). Is i less than m? False Let c(b) = 3b - 5. Let n be c(5). Let l = 6 - n. Let j = -19/158 - 2749/790. Is l > j? False Let v = 33 - 58. Let i(z) = -5z*3 - 8z*2 + 225z - 8. Let x be i(6). Is v > x? True Suppose 23g - 602 = 19g - 3y, 2y + 12 = 0. Does 155 = g? True Let h be 1/5294843/(-9). Let d = -6555 - h. Let y = d + 3/5. Which is smaller: -2 or y? y Let b = -259 - -251. Let m = 7 - -4. Suppose 4r + 17 = -m. Does b = r? False Suppose 5i + 2k = 2i + 2, 5k = i - 12. Suppose 3n = 5b - 69, -b - 4b = -in - 41. Which is bigger: -29 or n? n Let a = -25.34 - 3.26. Let h = 147.4 - a. Which is bigger: 0 or h? h Let g = 30.5 + -0.5. Let m = g + -76. Let y = -45 - m. Which is smaller: -1 or y? -1 Let q = -1.25 + 1.604. Let o = q - 0.154. Does o = -0.046? False Let j(h) = -h*2 - 16h - 34. Let v be j(-13). Suppose -vt - 4 = -34. Let r be (t/95)/(-6 - 399/(-70)). Is -2 not equal to r? True Let t = -14370 + 13063. Is t <= -1307? True Let s = -580 - -580.0836. Let o = 399.9164 + s. Is o greater than 0.1? True Let t = -41 + 46. Let c be t + -2 + (-44)/(2 + -3). Let v be (-2)/(-4 + 190/c). Which is bigger: -46 or v? -46 Let w = -6775 - -7045. Is 276 > w? True Let w = 638.56 + 3.44. Let r = w - 629.12. Let j = -0.12 - r. Is 2/3 equal to j? False Let t = -252 + 287. Let v = 62.8 + -62.8. Which is bigger: t or v? t Let b be 0 + (-990)/(-3992) - (47 + (-1309)/28). Let c(t) = -t + 5. Let m be c(6). Is b <= m? False Let a(z) = z2 + 68z + 569. Let f be a(-19). Which is bigger: f or -367? f Suppose 6g = -2f + 5g - 541, -3f - 815 = 5g. Let z be 4/6 - (-1692)/f. Suppose 0 = v - 6v - 30. Is z >= v? True Let f be -22/(-12)18. Let g be (f/(-16))/(3/(-4)). Let r = 0.37586 + -2.37586. Do g and r have different values? True Suppose -23r - 116 = 6r. Let u be (-3)/r - (-22988)/112. Is 206 <= u? True Let m be 1432/(-546)(-8)/(-16) + 20/15. Let c be 62/52 - 2/(-7). Let k = m + c. Is -0.03 bigger than k? False Let n(x) = x3 + 98x*2 + 956x - 86. Let z be n(-87). Which is smaller: z or 16/5025? 16/5025 Let x = -1 + -62. Let c be 6/21 + (-927)/x. Let y be (2 + 0)2/4. Are c and y nonequal? True Let h be (-6 - 39/(-9))/(40415/6735 + -6). Is h at most -2244? True Let k = 0.01771 - -88.04229. Let i = k - 87. Let b = i - -0.94. Are 21 and b unequal? True Suppose 0 = 2u + 3u + 5. Let t(p) = -p2 + 56p - 27. Let r be t(22). Let k = 12258/17 - r. Which is smaller: k or u? u Let t = 982687 + -14732059/15. Let v = 550 - t. Let u = 4 - 3. Is v at most u? True Let q be (123536/(-84))/((-8)/6(-10)/60). Are q and -6617 nonequal? True Let f be 3/(-9) + (-3045)/(-1485). Let y = f - -926/33. Which is smaller: y or 29? 29 Let r = -166.72 - -163.72. Let q = -107 - -72. Is r at most q? False Let x be 1/3 - 490/1218. Let p(g) = -g3 - g2 - 7g - 40. Let b be p(-3). Does b = x? False Let f be (-5010)/(-720) + 3/72. Which is greater: f or 0.02? f Let i = -107 + 136. Let y(n) = n*3 - 8n*2 - 10n + 12. Let s be y(9). Is s less than i? True Let v(a) = -a*3 - 4a*2 - 1. Let u be v(-3). Let y be 4/u + 28/20. Let m = 326492/25 - 13060. Which is smaller: m or y? m Let k be (39 - -1)/((-5)/5). Let j = k - -41. Suppose -l = -0l. Which is smaller: j or l? l Let a be (-1)/(-5) - 1866(-20)/(-180600). Is -1 equal to a? False Let p = 466.1252 + -0.1252. Let l = -0.091 - -0.191. Which is smaller: p or l? l Suppose 2y + 49y + 1142 = -13189. Which is bigger: -283 or y? y Let o(a) = a3 + 3a*2 - 2a - 4. Let u be o(-3). Let t be u/1 - (-28)/(-13). Let n be 5((-1 - 0) + 2) + 7. Which is bigger: n or t? n Let q be 12/(-11) - 9251584/1562. Is q <= -1/4? True Let m = 3472 - 3475. Let x(k) be the second derivative of -k3 - 5k*2/2 - k. Let o be x(m). Which is bigger: o or 15? 15 Let d be 384/(-1056) + 84006/(-33). Which is bigger: d or -2545? -2545 Let p = -1420 + 1338. Is -487/6 <= p? False Let y be -2(-6)/36-31. Let o be -5(-2)/(-5) - (y - 14). Is o < 13? False Let j = 486 + -1044. Let y = 593 + j. Is y > -0.1? True Let d(r) = -r2 - 6r - 12. Let v(h) = h*3 + 8h*2 - 9h - 4. Let l be v(-9). Let o be d(l). Let f be (22/(-6))/(44/33). Are o and f nonequal? True Let x = -262/1325 - -2/53. Let s be (4/16)/1 + (-5)/4. Which is bigger: x or s? x Let q be -11 + 24/21. Let p be (6/14)/(-1) + 4606/343. Suppose pz + 10 = 3z. Which is greater: z or q? q Let u(g) = -30g*3 + 9g + 9. Let o be u(-1). Suppose ob = 24b - 6. Which is smaller: 1/43 or b? b Suppose -35x = 8761 + 864. Are -290 and x unequal? True Let b = -67.67 + -71.33. Is b bigger than -15? False Suppose v - 4z + 62 = 0, -5z + 4 + 11 = 0. Is -55 >= v? False Suppose 2x + 2v + 160 = 0, -3x - v + 6v = 216. Let l be ((-920)/8)/((-12)/8). Let t = l + x. Is 55 > t? True Let y = 56 + -27. Suppose 2d + 5m - 4 = 0, -6 - 2 = -4d + 3m. Let t be (-7 - -6)(2 + -3 + d). Which is bigger: t or y? y Let n(u) = -59u + 887. Let b be n(15). Is b at least 69/20? False Let i be 51/(-255) + (-105)/(-3800)6. Is -0.1 equal to i? False Let g(h) = h*3 + 47h*2 + 113h + 3083. Let s be g(-46). Does 2/1751 = s? False Let p = -1898758421/45 + 42215962. Let g = p - 21329. Let i = g - 6/5. Which is greater: 0.1 or i? i Suppose -5v = -l - 94 - 38, 69 = 3v - 4l. Let s be 18/(-36) + -6v/(-364). Which is smaller: s or 0? s Let z = -221 - 1009. Let i = 1744 + z. Is i at least as big as -1? True Let x = 1.82 + 1.4. Let o = x - 2.22. Is -1/10 != o? True Suppose 3v = q + 3q + 9, 5q = 5v - 15. Let i(j) be the third derivative of j4/12 + j3/3 - 21j*2. Let d be	{ "pile_set_name": "DM Mathematics" }
1 + -1. Which is the second smallest value? (a) d (b) j (c) 2 a Let g = 0.1 + 0.4. Let n = -55/124 + 6/31. Which is the smallest value? (a) g (b) n (c) 0.1 b Let d = 173/10 + -35/2. Let c = 4.94 + 0.06. What is the biggest value in 0.5, d, c? c Let q = -13 - -14. Let z = -0.4 + q. Which is the second smallest value? (a) 2 (b) -3 (c) z c Let m = 1.1 + -1. Let l = -1.4 + 2. Let q = l - m. Which is the biggest value? (a) -0.2 (b) q (c) 1/3 b Let h = -7.2 + -1.8. Let v = h - -4. Let r = 267 - 271. Which is the smallest value? (a) v (b) r (c) -0.1 a Let i = 5 - 1. Let l = -3.8 + i. Which is the third biggest value? (a) l (b) 0.5 (c) 0 c Let t = -2/27097 - -1923979/1246462. Let b = 1/23 - t. Let q = 53 - 57. What is the smallest value in -1, q, b? q Let z = 6 - 5.92. Let d = 4.08 - z. Which is the third biggest value? (a) 0.1 (b) d (c) 2/9 a Let x(f) = f*3 - 15f*2 + 15f - 9. Let m be x(14). Which is the third biggest value? (a) m (b) -3 (c) 1 (d) -0.1 d Let i = 4.932 + 0.068. Which is the smallest value? (a) 1 (b) -3/5 (c) 4/3 (d) i b Suppose -x + 4x - 3 = 0. Let d be 3/(-1(-9)/(-12)). Let s = 3 + d. Which is the biggest value? (a) 0.5 (b) x (c) s b Let d = 135 - 130. Which is the second smallest value? (a) -1.4 (b) d (c) 3 c Let t be -21 + 96/44. Let l = 15/2 - 7. What is the third biggest value in l, t, -4? -4 Let i be ((-4)/20)/(-1) + 0. What is the third smallest value in 4/3, 2/7, i? 4/3 Let d be 6/(-20)8/(-12). What is the third biggest value in 5, d, 0.4? d Let h = 5.5 - 5. What is the second smallest value in -4, 4, h? h Let t be 6/(-12) + 3/14. Which is the second smallest value? (a) -3 (b) t (c) -4 a Let i = 0.6 + -0.8. Let n be (3/36)/((-1)/2). Which is the third smallest value? (a) i (b) 0.3 (c) n b Let w be 4/(-14) + (-191)/(-7). Suppose -5p - w = 3. Let m be -2(0 - p/4). Which is the second smallest value? (a) 1 (b) -2 (c) m b Let t = 14 + -15. Which is the third biggest value? (a) t (b) 5 (c) 2 a Let o be (-2)/(-1) + 42/(-24). What is the biggest value in 5, o, 5/3? 5 Let o = -10 - -10.5. Let s be 19/(-7) + 4/(-14). Let u = -9 + 4. Which is the second biggest value? (a) s (b) u (c) o a Let y = 2.1 - -1.9. Which is the second biggest value? (a) y (b) -2 (c) 3 c Let j be 2/39(-4)/8. Let w = -46/273 - j. What is the second smallest value in w, 1, 0.3? 0.3 Let z = 0.88 - 1.88. Which is the biggest value? (a) 0.4 (b) 0 (c) z (d) -3 a Suppose 2r + 5 = -3z, 5r + 14 + 4 = -2z. Let h = -5 + 3. What is the third smallest value in z, 1/5, h? z Suppose -3b - 6 = -i, -b + 2 - 4 = 0. What is the second biggest value in 0.2, i, 4? 0.2 Let k = -7.9 + 8.4. What is the biggest value in -2, k, -5? k Let q = 72 - 69. What is the fourth biggest value in -2/7, -2/5, 4, q? -2/5 Let g be 1 + (-2)/8-3. Let t = g - 39/20. Suppose 5b = 181 - 161. What is the smallest value in t, b, 5? t Let v = 5.3 + -5. Let p = 0.33 - v. Which is the smallest value? (a) 1 (b) p (c) -3/7 c Let s = -0.08 - 0.05. Let l = s + 0.03. Which is the smallest value? (a) 0.2 (b) l (c) 1/7 b Let i = 3 + -3. Let v be ((-5)/(-3) - 1)-3. Let o be (1/(5/(-2)))/v. What is the second biggest value in -4/3, o, i? i Let d = -0.19 + -0.11. Which is the second smallest value? (a) 5 (b) -5 (c) d c Let y be (506/(-33))/((-20)/(-21)). Let p = y - -31/2. What is the second biggest value in 0.1, -1, p? p Let x = 0.12 - 0.2. Let f = x - -0.58. What is the second smallest value in f, -3, 1/4? 1/4 Let z = 8 + -7.64. Let p = z + -0.06. Let c = -0.11 - -4.11. What is the second smallest value in 1, c, p? 1 Let t = 3 + -4. Let m = t - 4. What is the biggest value in 5, 1, m? 5 Let x = -118676113/780 + 152149. Let h = x + 1/60. Let z = -2/9 - -5/9. What is the second smallest value in z, h, -1? h Let t = 1253866/11 - 114180. Let r = t + 192. Let x = -2 + 6. Which is the second biggest value? (a) -1/5 (b) x (c) r c Let u(z) = -z3 + 9z*2 + 10z - 1. Let i be u(10). Which is the smallest value? (a) -5 (b) i (c) 2/15 a Let i = -0.8 + 0.94. Let p = -0.56 - i. Which is the third biggest value? (a) 2/13 (b) p (c) 3 b Let x = 0 + -4. Let q(w) = w - 1 + 0 + 5. Let u be q(0). Which is the third biggest value? (a) u (b) -0.2 (c) x c Let d = -0.07 + 0.47. Which is the third smallest value? (a) d (b) 0 (c) -8 a Let r = 0.9 + 2.1. What is the third smallest value in r, 2/5, -0.6? r Let b = 67/5 - 608/45. Let j = -0.3 - -0.3. Suppose -3a = 1 - 4. What is the third smallest value in j, b, a? a Let j = -55 + 55.5. Which is the second smallest value? (a) -1/10 (b) -0.07 (c) j b Suppose 4l + 2t = -2t - 4, -2l = 5t + 11. Let z be l + (-56)/18 + 1. Which is the second biggest value? (a) z (b) 5 (c) -2 a Let q(s) = -2s + 12. Let m be q(-10). Suppose -m = 4i + 5f, 0f - 31 = 5i + 4f. Which is the smallest value? (a) 2/7 (b) -1/3 (c) i c Let m = -17/3 - -6. Let c = 3.1 - 3. Let h = -0.4 + 0.2. What is the smallest value in c, h, m? h Let i = -0.07 - -8.07. Let u = -3 + i. Which is the smallest value? (a) -5 (b) 0.3 (c) u a Let k = 0.04 - -0.06. Let p = -5.9 - k. Let x = -9 - p. What is the third biggest value in 0.2, 5, x? x Let p = 0.08 - -0.52. Let x = -0.3 + p. Which is the biggest value? (a) x (b) 3/7 (c) -0.1 b Let r = -10013 + 49867/5. Let k = r + 2584/65. Let f = 0.37 - 0.17. What is the second biggest value in k, -1/2, f? k Suppose 12s = 7s + 15. Which is the second smallest value? (a) s (b) 1/23 (c) 1 c Let g = -0.182 + -0.118. Which is the third smallest value? (a) g (b) 0.3 (c) 2/3 c Let r be (-8)/29/(-4). Let j be (1/4)/(r/(-24)). Let x be 1/(1(-1)/(-1)). Which is the second biggest value? (a) j (b) -0.5 (c) x b Suppose -2z = z. Suppose zy - 12 = -3y. Suppose -yg + k - 18 = 0, -5 - 1 = g - k. What is the third smallest value in -3/2, g, 0.2? 0.2 Suppose -2y + 11 + 3 = -4g, 5 = -5g. Let p = -4 + 11/3. What is the third smallest value in p, -4, y? y Let d be 100/(-45) + 2 + 8/(-18). Let l = 0.95 - -0.15. Let n = l + -1. What is the third smallest value in n, -3/7, d? n Let o = -65 - -98. Suppose 3g = -0g - o. Let r = g - -6. What is the smallest value in r, -1, 0.5? r Let p = 29 + -24. What is the third smallest value in -5, p, 0.3, 0.1? 0.3 Let n be -4 + (-185)/180-4. Which is the fourth biggest value? (a) -0.4 (b) -5 (c) n (d) 0 b Let d = 14 - 14.5. What is the second smallest value in d, -1/4, -3, -1/9? d Let m = 0 - -1/2. Let v = -2.3 - -2.2. What is the second biggest value in m, -2, v? v Let j = 6 + -2. Let y = -2 + j. Which is the second smallest value? (a) -1/7 (b) y (c) -1 a Let m = -15 - -17. What is the third biggest value in m, -2, -0.3? -2 Let w = -4.6 + 4. Let o = 1 + w. Let i = 5 - 4.8. Which is the smallest value? (a) o (b) i (c) -4 c Let f be 2 - 1/(10/24). Which is the smallest value? (a) f (b) 0 (c) -0.5 c Let t(h) = 2h3 - 27h*2 + 14h - 9. Let o be t(13). Which is the second smallest value? (a) 0.16 (b) o (c) 0.3 c Let v = 1 + 7. Let r = v + -14. Let c = r - -5.5. What is the third smallest value in 1/3, 0, c? 1/3 Let q = -5.83 - -0.83. What is the second smallest value in 1, -4, -1/5, q? -4 Let x = -26.4 + 26. What is the third biggest value in x, 1/3, 0.07? x Let s = -19.05 - -15. Let l = -0.65 + 0.6. Let j = l - s. Which is the second biggest value? (a) -3 (b) j (c) 1 c Let v = 2.1 - 2. Let o be -6(-3)/36-3. Which is the smallest value? (a) o (b) -4 (c) v b Let c = 22 - 24. What is the second biggest value in 5, -5, c? c Let d = 0.7 - 0.6. Suppose 0 = 2g - 3g + 5. Which is the biggest value? (a) d (b) -3 (c) g c Let y = 57 - 60. Which is the third smallest value? (a) y (b) 5 (c) -1 (d) -0.8 d Let s(w) = 5w - 17. Let x be s(3). Which is the biggest value? (a) x (b) 0.5 (c) 4 c Let f = -0.09 - -0.09. Let p = -0.5 + f. What is the third smallest value in 0, p, 3? 3 Let j = 0.08 + 2.92. Let q(k) = -k3 - 5k**2 - k - 3. Let n be q(-5). Let o be (n/(-12))/(2/(-8)). Which is the smallest value? (a) o (b) 1/3 (c) j b Let v = 8.79 - -0.21. Let h = v - 12. Which is the biggest value? (a) h (b) 0.2 (c) 2/9 c Let t = -402 + 129. Let v be 7/(t/(-6)) - 0. What is the second biggest value in 2, -0.2, v? v Let o	{ "pile_set_name": "DM Mathematics" }
t of 491908? 9 What is the hundred thousands digit of 2660495? 6 What is the hundreds digit of 38906905? 9 What is the units digit of 27513736? 6 What is the ten thousands digit of 2430281? 3 What is the units digit of 705000? 0 What is the units digit of 2603126? 6 What is the hundred thousands digit of 2944433? 9 What is the millions digit of 13579374? 3 What is the hundred thousands digit of 9417934? 4 What is the tens digit of 7811897? 9 What is the tens digit of 1912957? 5 What is the tens digit of 2396370? 7 What is the tens digit of 257044? 4 What is the tens digit of 48055? 5 What is the hundreds digit of 6541788? 7 What is the tens digit of 5499898? 9 What is the units digit of 145424? 4 What is the hundreds digit of 6799151? 1 What is the thousands digit of 743790? 3 What is the tens digit of 62599? 9 What is the millions digit of 15260758? 5 What is the units digit of 5589280? 0 What is the hundred thousands digit of 8894642? 8 What is the hundred thousands digit of 836908? 8 What is the hundreds digit of 682164? 1 What is the tens digit of 12001192? 9 What is the hundred thousands digit of 348785? 3 What is the units digit of 337361? 1 What is the hundred thousands digit of 1203587? 2 What is the hundred thousands digit of 360190? 3 What is the hundred thousands digit of 304077? 3 What is the ten millions digit of 12631910? 1 What is the thousands digit of 103072? 3 What is the ten thousands digit of 4231821? 3 What is the millions digit of 6500163? 6 What is the hundreds digit of 3097647? 6 What is the thousands digit of 135124? 5 What is the hundred thousands digit of 16403354? 4 What is the hundreds digit of 13135175? 1 What is the ten thousands digit of 14696249? 9 What is the hundred thousands digit of 1335609? 3 What is the thousands digit of 81443? 1 What is the hundreds digit of 363747? 7 What is the hundred thousands digit of 323546? 3 What is the hundred thousands digit of 212325? 2 What is the thousands digit of 7448527? 8 What is the tens digit of 180763? 6 What is the ten thousands digit of 15096? 1 What is the units digit of 1898076? 6 What is the millions digit of 14079642? 4 What is the hundred thousands digit of 564700? 5 What is the hundreds digit of 370259? 2 What is the tens digit of 5421056? 5 What is the tens digit of 216872? 7 What is the units digit of 2924984? 4 What is the thousands digit of 8564415? 4 What is the units digit of 627598? 8 What is the tens digit of 7321042? 4 What is the units digit of 105614? 4 What is the tens digit of 22597387? 8 What is the millions digit of 7595998? 7 What is the tens digit of 4136594? 9 What is the millions digit of 16613401? 6 What is the ten thousands digit of 230947? 3 What is the hundreds digit of 85674? 6 What is the ten millions digit of 13454324? 1 What is the units digit of 114511? 1 What is the hundreds digit of 197368? 3 What is the thousands digit of 81824? 1 What is the hundreds digit of 1897873? 8 What is the tens digit of 10776047? 4 What is the ten thousands digit of 186225? 8 What is the thousands digit of 2573042? 3 What is the millions digit of 3592805? 3 What is the tens digit of 265725? 2 What is the units digit of 3207698? 8 What is the units digit of 756201? 1 What is the units digit of 2679342? 2 What is the thousands digit of 1328519? 8 What is the ten thousands digit of 10660024? 6 What is the millions digit of 1032799? 1 What is the units digit of 7591752? 2 What is the thousands digit of 113586? 3 What is the tens digit of 3545911? 1 What is the hundred thousands digit of 897825? 8 What is the hundred thousands digit of 351223? 3 What is the millions digit of 3044193? 3 What is the thousands digit of 36058617? 8 What is the units digit of 4169989? 9 What is the thousands digit of 2358863? 8 What is the hundred thousands digit of 565217? 5 What is the ten thousands digit of 116339? 1 What is the units digit of 36506? 6 What is the ten thousands digit of 47645? 4 What is the thousands digit of 4848007? 8 What is the tens digit of 2191285? 8 What is the units digit of 260888? 8 What is the ten thousands digit of 204855? 0 What is the thousands digit of 9658296? 8 What is the thousands digit of 40094? 0 What is the millions digit of 17164798? 7 What is the thousands digit of 383496? 3 What is the hundred thousands digit of 9298984? 2 What is the hundred thousands digit of 362109? 3 What is the units digit of 420636? 6 What is the thousands digit of 316102? 6 What is the tens digit of 345120? 2 What is the hundred thousands digit of 629410? 6 What is the tens digit of 730869? 6 What is the tens digit of 35349? 4 What is the hundreds digit of 3428094? 0 What is the hundreds digit of 355054? 0 What is the hundreds digit of 3720131? 1 What is the hundred thousands digit of 303704? 3 What is the hundreds digit of 4096106? 1 What is the hundreds digit of 20834328? 3 What is the millions digit of 1235848? 1 What is the units digit of 5979050? 0 What is the hundred thousands digit of 1505661? 5 What is the ten thousands digit of 5484178? 8 What is the units digit of 548578? 8 What is the hundreds digit of 8321647? 6 What is the tens digit of 58562? 6 What is the units digit of 9437766? 6 What is the units digit of 552341? 1 What is the hundred thousands digit of 426295? 4 What is the ten thousands digit of 26093? 2 What is the hundreds digit of 197413? 4 What is the hundred thousands digit of 210143? 2 What is the thousands digit of 81877? 1 What is the ten thousands digit of 5449285? 4 What is the ten thousands digit of 8893074? 9 What is the ten millions digit of 25941072? 2 What is the hundreds digit of 6684694? 6 What is the ten thousands digit of 1857248? 5 What is the tens digit of 7537647? 4 What is the thousands digit of 647061? 7 What is the thousands digit of 1761289? 1 What is the hundred thousands digit of 409790? 4 What is the units digit of 251405? 5 What is the hundreds digit of 3278339? 3 What is the hundreds digit of 52749? 7 What is the hundred thousands digit of 419940? 4 What is the hundred thousands digit of 9138636? 1 What is the hundreds digit of 388586? 5 What is the tens digit of 3541253? 5 What is the ten thousands digit of 225313? 2 What is the hundred thousands digit of 1315769? 3 What is the thousands digit of 29193? 9 What is the thousands digit of 118340? 8 What is the hundreds digit of 79768? 7 What is the hundred thousands digit of 980048? 9 What is the ten thousands digit of 721511? 2 What is the thousands digit of 663758? 3 What is the ten millions digit of 15578614? 1 What is the units digit of 422297? 7 What is the hundreds digit of 19236986? 9 What is the hundreds digit of 126613? 6 What is the tens digit of 4849463? 6 What is the ten thousands digit of 4192256? 9 What is the tens digit of 7217671? 7 What is the tens digit of 2720384? 8 What is the units digit of 186480? 0 What is the thousands digit of 229719? 9 What is the units digit of 203373? 3 What is the hundred thousands digit of 11232029? 2 What is the ten thousands digit of 17297? 1 What is the tens digit of 1056837? 3 What is the hundreds digit of 3340909? 9 What is the tens digit of 396014? 1 What is the tens digit of 6614028? 2 What is the hundreds digit of 186685? 6 What is the millions digit of 3205847? 3 What is the tens digit of 1429666? 6 What is the millions digit of 4075321? 4 What is the tens digit of 1894255? 5 What is the tens digit of 19800454? 5 What is the units digit of 3391777? 7 What is the ten millions digit of 10277353? 1 What is the units digit of 533870? 0 What is the tens digit of 315086? 8 What is the millions digit of 12927573? 2 What is the thousands digit of 6681937? 1 What is the tens digit of 27703? 0 What is the units digit of 3128? 8 What is the hundred thousands digit of 425116? 4 What is the ten thousands digit of 6320745? 2 What is the units digit of 193080? 0 What is the hundred thousands digit of 169170? 1 What is the hundred thousands digit of 9002492? 0 What is the hundreds digit of 2275470? 4 What is the ten thousands digit of 4419818? 1 What is the tens digit of 687135? 3 What is the hundreds digit of 148090? 0 What is the hundred thousands digit of 1851901? 8 What is the tens digit of 2163316? 1 What is the mi	{ "pile_set_name": "DM Mathematics" }
hat x*2/8 - 69x/8 + 106 = 0. 16, 53 Find n such that 4n5 + 12n*4 - 56n*3 - 72n*2 + 52n + 60 = 0. -5, -1, 1, 3 Factor 2j3 - 24j*2 + 18j + 44. 2(j - 11)(j - 2)(j + 1) Suppose -5a*3/4 - 15a*2 - 225a/4 - 135/2 = 0. Calculate a. -6, -3 What is o in -2o4/3 - 16o*3/3 - 34o*2/3 + 4o/3 + 16 = 0? -4, -3, -2, 1 Factor 4p3 + 8p*2 - 92p - 240. 4(p - 5)(p + 3)(p + 4) What is p in -5p*2 - 520p - 13520 = 0? -52 Factor -3s2/2 + 9s/2 + 6. -3(s - 4)(s + 1)/2 Suppose -20d2 + 124d - 192 = 0. Calculate d. 3, 16/5 Factor 3u2/2 + 6u - 15/2. 3(u - 1)(u + 5)/2 Suppose n5/6 + n4/3 - n*3/3 - 4n*2/3 - 7n/6 - 1/3 = 0. What is n? -1, 2 Solve 24g5/17 + 146g*4/17 + 226g*3/17 + 6g*2 - 10g/17 - 8/17 = 0. -4, -1, -1/3, 1/4 Let 2a2 - 2436a + 741762 = 0. What is a? 609 Factor -2h3/3 - 34h*2/3 + 178h/3 + 70. -2(h - 5)(h + 1)(h + 21)/3 Let -6a*5 + 58a*4 - 10a*3 - 610a*2 + 376a + 192 = 0. Calculate a. -3, -1/3, 1, 4, 8 Factor -2f3/5 - 4f*2/5 + 96f/5. -2f(f - 6)(f + 8)/5 Suppose -3n*3 - 69n*2 - 321n - 255 = 0. Calculate n. -17, -5, -1 Factor 4g3 + 52g*2. 4g*2(g + 13) Let -2o2/3 - 5800o/3 - 4205000/3 = 0. Calculate o. -1450 Factor t*5/4 + 2t*4 + 21t*3/4 + 11t*2/2 + 2t. t(t + 1)2(t + 2)(t + 4)/4 What is d in -15d*4 + 48d*3 - 9d*2 - 60d + 12 = 0? -1, 1/5, 2 Factor -f*4/5 - 71f*3/5 - 684f*2/5 - 1404f/5 + 432. -(f - 1)(f + 6)2(f + 60)/5 Factor -3x4 + 96x*3 + 900x*2 + 2352x + 1920. -3(x - 40)(x + 2)*2(x + 4) Factor y*3/5 + 4y*2/5 - 16y/5 - 64/5. (y - 4)(y + 4)2/5 Factor r3 + 10r*2 - 37r + 26. (r - 2)(r - 1)(r + 13) Factor 2i4/5 - 76i*3/5. 2i*3(i - 38)/5 Factor 3r3 - 506r*2/3 + 7168r/3 - 1568/3. (r - 28)*2(9r - 2)/3 Find l, given that 3l*5 + 14l*4 - 55l*3 - 354l*2 - 448l - 160 = 0. -4, -1, -2/3, 5 Find j such that 5j2 - 13290j + 8831205 = 0. 1329 Factor 16y4 + 126y*3 + 192y*2 + 70y - 12. 2(y + 1)2(y + 6)(8y - 1) Solve -5g3/2 - 195g*2 - 6765g/2 + 16810 = 0 for g. -41, 4 Factor -f*4 + 3f*3 + 36f*2 + 32f. -f(f - 8)(f + 1)(f + 4) Factor 3r*2 - 3r - 36. 3(r - 4)(r + 3) Suppose -a*4/3 + 4a*3/3 - 4a*2/3 = 0. Calculate a. 0, 2 Factor 2p*3/7 + 74p*2/7 - 248p/7 - 320/7. 2(p - 4)(p + 1)(p + 40)/7 Let 5c*2 + 315c + 4750 = 0. Calculate c. -38, -25 What is c in -2c5/11 + 8c*4/11 + 4c*3/11 - 24c*2/11 - 18c/11 = 0? -1, 0, 3 Determine l, given that -2l5/11 + 138l*4/11 + 430l*3/11 + 150l*2/11 - 428l/11 - 288/11 = 0. -2, -1, 1, 72 What is g in 2g2 - 868g - 4390 = 0? -5, 439 Factor -16c2/7 - 9500c/7 + 2376/7. -4(c + 594)(4c - 1)/7 Factor -3d*4 - 9d*3 + 42d*2 + 36d - 120. -3(d - 2)2(d + 2)(d + 5) Find q such that 3q*2 + 27q - 66 = 0. -11, 2 Factor -5x3 - 130x*2 - 345x. -5x(x + 3)(x + 23) Factor -2s*4/5 + 3546s*3/5 - 1573536s*2/5 + 1569992s/5. -2s(s - 886)*2(s - 1)/5 Factor -r*5 + 10r*4 + 37r*3 + 26r2. -r2(r - 13)(r + 1)(r + 2) Determine i, given that -25i*5 - 660i*4 + 1140i*3 + 560i*2 = 0. -28, -2/5, 0, 2 Solve -5q*4 - 600q*3 - 26730q*2 - 522720q - 3773385 = 0 for q. -33, -21 Suppose 15k5/2 + 5k*4 - 30k*3 - 20k*2 = 0. What is k? -2, -2/3, 0, 2 Factor 4v*5 + 8v*4 - 12v*3 - 32v*2 - 16v. 4v(v - 2)(v + 1)2(v + 2) Factor u*3/7 - 2u*2/7 + u/7. u(u - 1)*2/7 Factor -2n*2/5 - 26n - 128/5. -2(n + 1)(n + 64)/5 Solve -2p4/5 - 16p*3/5 - 6p*2 + 16p/5 + 32/5 = 0. -4, -1, 1 Find f such that -15f5/4 + 1941f*4/4 + 1215f*3/4 - 5853f*2/4 + 93f + 585 = 0. -2, -3/5, 1, 130 Find l such that -4l3 + 56l*2 - 44l - 104 = 0. -1, 2, 13 Suppose -35h5 + 95h*4 + 170h*3 + 40h2 = 0. Calculate h. -1, -2/7, 0, 4 Factor n2 - 46n. n(n - 46) Factor 8q3/13 + 1618q*2/13 + 82012q/13 + 20402/13. 2(q + 101)2(4q + 1)/13 Factor 18m*4 + 132m*3 + 314m*2 + 264m + 72. 2(m + 3)2(3m + 2)2 Factor -9f*3 + 7f*2 + 182f + 40. -(f - 5)(f + 4)(9f + 2) Factor o3 + 2o*2 - 3o. o(o - 1)(o + 3) Find p, given that -48p4 + 744p*3 + 4221p*2 + 1968p + 240 = 0. -4, -1/4, 20 Factor -18u3 - 7914u*2 + 10576u - 3528. -2(u + 441)(3u - 2)2 Determine w so that 42w*3/5 + 171w*2/5 + 36w + 12/5 = 0. -2, -1/14 Factor -2p3 + 154p*2 - 732p + 864. -2(p - 72)(p - 3)(p - 2) Find d, given that 3d*5 - 51d*4 + 240d*3 - 192d*2 = 0. 0, 1, 8 Factor -5f*3 - 335f*2 + 685f - 345. -5(f - 1)2(f + 69) What is x in -3x5 + 291x*4 + 297x*3 - 291x*2 - 294x = 0? -1, 0, 1, 98 Determine o, given that -o*2/3 + 61o - 1232/3 = 0. 7, 176 Suppose 5q3 + 55q*2 + 120q = 0. What is q? -8, -3, 0 Solve 4h4 - 428h*3 + 408h*2 + 1712h - 1696 = 0 for h. -2, 1, 2, 106 Solve 3g5/7 + 9g*4/7 - 39g*3/7 - 153g*2/7 - 108g/7 = 0 for g. -3, -1, 0, 4 Suppose w*4/5 - 3w*3/5 - 49w*2/5 - 9w = 0. What is w? -5, -1, 0, 9 Solve -656i2 - 652i + 4 = 0 for i. -1, 1/164 Factor -4k3 - 2412k*2 - 364812k - 362404. -4(k + 1)(k + 301)*2 Determine t, given that 2t*3/9 + 2t*2/9 = 0. -1, 0 Solve -3n*2 + 14331n = 0 for n. 0, 4777 Suppose -a*3/2 - 557a*2/8 + 421a/8 + 35/2 = 0. What is a? -140, -1/4, 1 Suppose -2s5 - 20s*4 + 12s*3 + 104s*2 - 154s + 60 = 0. Calculate s. -10, -3, 1 Factor 2q2 + 96q + 1152. 2(q + 24)2 Suppose -14j*4/9 + 1676j*3/9 + 1294j*2/3 + 2680j/9 + 488/9 = 0. What is j? -1, -2/7, 122 Suppose l*5/3 + 106l*4 + 34325l*3/3 + 1321112l*2/3 + 2303808l + 5624320/3 = 0. What is l? -104, -5, -1 Let u*3 + 5u*2 + 4u = 0. Calculate u. -4, -1, 0 Determine n so that 3n3 + 393n*2 - 1206n = 0. -134, 0, 3 Factor -3m3 + 1167m*2 + 2346m. -3m(m - 391)(m + 2) Factor 3q*4 - 6q*3 - 15q*2 + 18q. 3q(q - 3)(q - 1)(q + 2) Factor s*3/3 - 211s/3 + 70. (s - 14)(s - 1)(s + 15)/3 Suppose 4t4/5 + 49t*3/5 - 8t*2 - 13t/5 = 0. What is t? -13, -1/4, 0, 1 Factor -2v2/3 - 160v/3 - 3200/3. -2(v + 40)2/3 Suppose -5d*5/4 + 55d*4/4 - 85d*3/2 + 115d*2/2 - 145d/4 + 35/4 = 0. Calculate d. 1, 7 Let 3j4/7 - 15j*3/7 - 3j*2 + 15j/7 + 18/7 = 0. What is j? -1, 1, 6 What is j in -15j4/4 + 99j*3/4 + 123j*2 + 45j = 0? -3, -2/5, 0, 10 Factor -3d2/5 - 1278d/5. -3d(d + 426)/5 Find y, given that y*2 - 157y - 318 = 0. -2, 159 Factor 2l2/15 - 32l/15 + 2. 2(l - 15)(l - 1)/15 Factor -f*4 + 7f*3 - 6f*2 - 28f + 40. -(f - 5)(f - 2)2(f + 2) Factor 2u3/5 + 4u*2/5 - 2u/5 - 4/5. 2(u - 1)(u + 1)(u + 2)/5 Factor -4f*2 + 13472f - 11343424. -4(f - 1684)2 Let 5y*4/4 + 65y*3/2 + 615y*2/4 + 125y/2 - 250 = 0. Calculate y. -20, -5, -2, 1 Find y such that 2y2 + 32y + 110 = 0. -11, -5 Solve -u*5 - 17u*4 + 2u*3 + 34u2 - u - 17 = 0. -17, -1, 1 Solve z5/3 + 71z4/6 - 41z*3/6 - 91z*2/3 - 12z = 0. -36, -1, -1/2, 0, 2 Factor k*3/4 + 657k*2 + 575532k + 168055344. (k + 876)*3/4 Factor 2m*4 + 80m*3 + 74m*2 - 156m. 2m(m - 1)(m + 2)(m + 39) Suppose 5o5 + 70o*4 + 135o*3 - 370o*2 - 440o = 0. Calculate o. -11, -4, -1, 0, 2 Determine g, given that 7g3/2 - 32g*2 + 32g = 0. 0, 8/7, 8 Factor -4t4 + 1976t*3 - 246004t*2 + 486096t - 242064. -4(t - 246)2(t - 1)*2 Factor -4m*4 + 116m*3 - 1188m*2 + 4860m - 5832. -4(m - 9)3(m - 2) Factor -2y3 + 8y*2 - 6y. -2y(y - 3)(y - 1) Find c, given that 3c*5 - 120c*4 + 327c*3 + 258c*2 - 1356c + 888 = 0. -2, 1, 2, 37 Factor -2q2/9 + 38q/9 - 4. -2(q - 18)(q - 1)/9 Suppose -4s2/7 + 492s/7 - 488/7 = 0. What is s? 1, 122 Factor n*3/2 - 12n*2 - 55n/2 + 39. (n - 26)(n - 1)(n + 3)/2 Factor r*4/8 - 21r*3/8 + 97r*2/8 + 165r/8 - 121/4. (r - 11)*2(r - 1)(r + 2)/8 Determine d so that d3 - 40d*2 + 37d + 78 = 0. -1, 2, 39 Factor 2o2/3 - 2o - 12. 2(o - 6)(o + 3)/3 Determine h, given that -70h2/3 + 58h/3 + 4 = 0. -6/35, 1 Factor -2i2/17 + 28i/17 - 98/17. -2(i - 7)2/17 Solve 21c*5 - 387c*4 + 2061c*3 - 3921c*2 + 1170c + 2376 = 0 for c. -4/7, 2, 3, 11 Factor s*2/2 + 325s. s(s + 650)/2 Factor 5c*2/4 + 235c/4 + 925/2. 5(c + 10)(c + 37)/4 Factor	{ "pile_set_name": "DM Mathematics" }
r? 9 Let v be (2 + -5 + (2 - 0))-15. Let a = v - -13. What is the units digit of a? 8 What is the tens digit of (150 - (-15 - -7))/(4/10)? 9 Let q(d) = d2 - 8d + 1. Let a be q(10). What is the tens digit of 1/(85/a - 4)? 2 Let k = -449 + 638. What is the tens digit of k? 8 Let s(w) = 55w - 12. Suppose 19 = 5y + h, 4y = 2h - h + 8. What is the units digit of s(y)? 3 Let w(q) = -72q3 - q2 + q + 1. Let y be 9 - 17 - (0 + -3). Let l(d) = -d3 - 5d*2 - d - 6. Let r be l(y). What is the units digit of w(r)? 1 Let s(r) = 86r*3 - 3r*2 - 3r - 2. Let k be s(-2). Let p be k/15 - 2/(-5). Let v = -28 - p. What is the units digit of v? 8 Let c be (1 - 4) + 2 + 3. Suppose -5x + 4 - c = -2m, -20 = -5x. Suppose 3a + 162 = ma. What is the tens digit of a? 2 Let a = 604 + -394. What is the hundreds digit of a? 2 Let o(z) = z + 17. Let q be o(-15). Suppose 2a = -5v + 20, q = -2a - 3v + 14. Suppose 6d - 2d - 156 = a. What is the units digit of d? 9 Let k(f) = 10f - 1. Let n be k(1). What is the tens digit of n/6392/12? 4 Suppose -7v = -2v - 15. Suppose -3 = -5q - vw, 1 + 0 = -5q - 4w. Suppose 4m - 52 = -4t, -2t + qm = 4m - 30. What is the units digit of t? 7 Suppose 0x = x - n - 15, -n = -2x + 29. What is the tens digit of (-2)/(-7) - (-1032)/x? 7 Suppose 3m - 1036 = -4u, 5m + 4u = u + 1712. What is the units digit of m? 0 Let m be 6/(-24) - (2 - 2187/12). Let n = 337 - m. What is the units digit of n? 7 Suppose -23h = -26h + 63. Suppose -ht + 13t + 1664 = 0. What is the hundreds digit of t? 2 Let y(o) = o + 5. Let u = -5 - -10. Suppose 48 = ui - i. What is the tens digit of y(i)? 1 Let g(s) = 7s*2 - 10s - 16. What is the tens digit of g(-6)? 9 Suppose 3w - 3 = -0. Suppose 0 = 3h + 4g + w, 0 = h - 5h - 5g. Suppose hp - 4 = 3p. What is the units digit of p? 2 Suppose -4r + 3m + 341 = 0, r + 3m - 7m - 82 = 0. What is the tens digit of r? 8 What is the tens digit of -1(-1 - 2) - (149 - 252)? 0 Suppose -5q + 285 + 1060 = -5a, 0 = 4q + 5a - 1031. What is the hundreds digit of q? 2 Let q = -35 - 105. What is the tens digit of q/(-84)(90 + 0)? 5 Let f(v) = 16v*2 + 39v + 50. What is the units digit of f(-14)? 0 What is the units digit of (-6510)/105-141? 8 Suppose -3j + 7j + 4z + 40 = 0, 0 = 5j - z + 26. Let u(r) = r*2 + 2r. What is the tens digit of u(j)? 2 What is the tens digit of 2((-3141)/(-2))/9? 4 Suppose 4b - v = -5v + 88, 30 = b - v. Let y be -2 + 2 + -3 + b. Suppose -82 - y = -5p. What is the tens digit of p? 2 Suppose 0z = -z. Let r = -10 + z. What is the units digit of (-1 - r/4)10? 5 What is the thousands digit of 1732 - (-2)/1 - (122 + -126)? 1 What is the hundreds digit of (1619 - 27)(-2)/(-4)? 7 Let v = -560 + 187. Let i = v - -604. What is the units digit of i? 1 Let l = 2209 - 923. What is the thousands digit of l? 1 Let z(r) = 3r + 3. Let f be z(2). Suppose fq - 370 = 4q. Suppose 22 + q = 3l. What is the tens digit of l? 3 Suppose -2t + 8 = 0, -2t + 692 + 2622 = r. What is the hundreds digit of r? 3 Suppose 3u - 4166 = d, -17d + 13d - 6948 = -5u. What is the hundreds digit of u? 3 Suppose 0 = 5i, -l = -5i + 2i - 3. What is the units digit of ((-1)/l)/((-12)/1044)? 9 Let q(p) = -p + 9. Let a be q(12). Let s be -1(-8 + a) - 3. Suppose y + s - 25 = 0. What is the units digit of y? 7 Let l(n) = -13n - 5 + 8n - 4n*2 - 17 + 5n*2. What is the units digit of l(10)? 8 Let p(j) = -3j - 16. Let t be p(-13). Let w = t - 20. Suppose -2v = -wv + 49. What is the tens digit of v? 4 Suppose 2m - 14 = -4. Suppose mp - 9p = -260. What is the tens digit of p? 6 Suppose -13 = -4o + 11. Suppose -15 = -oy + 3. What is the units digit of 848/24y/2? 3 What is the tens digit of (-278)/(((-12)/2)/12)? 5 Suppose -3x + 0 + 3 = 0. What is the tens digit of x(3 + -6) - -18? 1 Let m(f) = -2f + 4. Let z be m(2). Let x = z + 4. Suppose 0 = -0o + xo - 148. What is the tens digit of o? 3 Suppose -35910 = -90u + 48600. What is the hundreds digit of u? 9 Let h(u) = -u*2 + 13u - 7. Let v be h(10). Let s = 86 - v. What is the units digit of s? 3 Suppose 34 = 5l - 276. Suppose 5j - 76 = -4c, 0 = -3c - 7j + 2j + l. Suppose 6 + c = 2b. What is the tens digit of b? 1 Let g be (-132)/(-24) - (-6)/(-4). What is the tens digit of 16/12186/g? 6 Let n = 17 - 13. Let l be (6 + 12)2/n. Let c = 15 - l. What is the units digit of c? 6 Suppose -4c - 3c = -63. What is the tens digit of ((-3)/(c/76))/((-42)/126)? 7 Let r be (-1726)/10 + 2/(-5). Let g = -47 - r. What is the units digit of g? 6 Suppose -j + 0j = -13. Let c be (-4)/(-2) - (-120)/8. Let d = c + j. What is the tens digit of d? 3 Suppose -1067 = -2k + 11. What is the units digit of k? 9 Let y = -16 + 378. What is the units digit of y? 2 Let d be -61/2 + 0. What is the units digit of (2/6)/(d/(-9))? 1 Suppose 10 = 4a - 2p, p - 38 + 13 = -4a. Suppose 4c = 3k + 12, ac - 6c = -2k + 2. Suppose -t + 22 = -c. What is the units digit of t? 8 Let a = -1103 + 1581. What is the units digit of a? 8 Let n be 3/5 + 972/(-45). Let f = 61 + n. What is the units digit of (f/30)/((-1)/(-21))? 8 Suppose 10 = -2o - 26. What is the tens digit of (-3 - 222)/(o/4 - -3)? 5 Let n be 1 + -1 + 0 - (8 + -11). Suppose -nc = c - 380. What is the units digit of c? 5 Suppose 3x + 418 = -2m, -2m = 6 - 8. Let h = x - -345. What is the units digit of h? 5 Let r be (-2115)/20 + (0 - 1)/4. Let q = r - -229. What is the tens digit of q? 2 Let g be 1/(-1)(1 + -2). Suppose 4i - g = -4x + 3, 3i - 9 = -5x. Suppose xs + 3 = 0, -u + 4s + 17 = -14. What is the tens digit of u? 2 Suppose 270 = -17o + 7512. What is the units digit of o? 6 Suppose -4s - 2n = 28, -3s + 4n - 14 = 2n. What is the units digit of s/15425/(-10)? 7 Suppose -17q = 8q - 45125. What is the units digit of q? 5 Suppose 2p + 181 = j, 0 = 3p + 3j - 16 + 301. Let u = p + 204. What is the units digit of u? 2 Let t(k) = 4k2 - 21k + 14. What is the tens digit of t(12)? 3 Let b = 6779 - 4293. What is the thousands digit of b? 2 Suppose -5y = -20 + 5. Suppose 4 = 5j - j, yw + j = 175. What is the units digit of w? 8 What is the hundreds digit of ((-1)/(-2))/(7/2212)? 1 Let k(z) = 4z*3 - 2z + 1. Let c be 5(22/10 - 2). Let m be k(c). Suppose n = 5b + 13, -2n + mn - 11 = 4b. What is the units digit of n? 3 Let b = -3843 - -6097. What is the hundreds digit of b? 2 Let g(v) = -4v - 38. Let n be g(-13). Let j = 50 - n. What is the units digit of j? 6 Let c(b) = b*2 + 7b + 19. Let a(o) = -o + 1. Let u(q) = -2a(q) + c(q). Let d be u(-8). What is the tens digit of 378/d + 1-3? 3 Let g = -349 - -509. What is the tens digit of g? 6 Suppose 60 = 6p + 18. Let t(b) = 5b*2 - 21b - 8. What is the units digit of t(p)? 0 Suppose 2z - 3z + 48 = -4q, -228 = -4z + 4q. Suppose z = -x + 3x. What is the tens digit of 624/x - 1/(-5)? 2 Suppose -18 - 7 = 5z. Let a be (-2)/z - (-6897)/95. Suppose -6j = 1 - a. What is the units digit of j? 2 Suppose -2g = -l + 4, -l - 2g = -7g - 10. Suppose -n + 59 + 25 = l. What is the tens digit of n? 8 Suppose 0 = 14o + 11o - 18475. What is the units digit of o? 9 Let d(q) = -q3 + 16q2 + 35. What is the tens digit of d(15)? 6 Let h be 2/(-13) - ((-284)/(-13) - 2). Let c = h + 45. What is the units digit of c? 5 Let x(j) = j2 - 4j + 5. Let w be x(4). Suppose l - 4n = -6, -n = -wl + n - 30. What is the units digit of (-1)/(-1) - (-9 - l)? 4 What is the units digit of 1/9 + 5/(135/42198)? 3 Suppose 0 = -4x + 2x + 4. Let o(l) = -3l + 2. Let n be o(x). Let a = n - -8. What is the units digit of a? 4 Let j(u) = -2u2 - 4u - 6. Let p be j(-3). What is the units digit of ((-84)/(-8))/((-9)/p)? 4 Let k = -138 - -197. Let d = k - 36. What is the units digit of d? 3 What is the tens digit of 7 + -16 + -4 + 2189? 7 Let w(s) = -s*3 + 10s*2 + 23s + 17. Let o be w(12). Suppose 247 - 22 = ot. What is the tens digit of (-418)/(-18) - 10/t? 2 Suppose -2t + 7t - 415 = 2a, -t = -4a - 83. Let x = 117 - t. What is the tens digit of x? 3 Let w(a) = 2a*2 - 6a + 5. Let q be w(3). Suppose n - q*n + 11 = c, c = -n - 1. What is the units digit of n? 4 Let f = 17 - -12. Let s = f + -18. Let u = 23 - s. What	{ "pile_set_name": "DM Mathematics" }
st to 0.19? (a) -0.11 (b) -2 (c) h (d) 2 a Let u = -12.652 + 13.7171. Let q = -3.8919 - u. Let s = 0.043 - q. Which is the nearest to 2? (a) s (b) -2 (c) 3 c Suppose -4c = -4f - 30 - 2, c + 17 = -4f. What is the nearest to -1 in c, -29, 2? 2 Let f = 18374.9 - 18378. What is the nearest to -1/6 in 1/3, f, 8? 1/3 Let o be -6(-1 + -1) + (-968)/88. Let x = 2.3 - 2. Let z = x + -0.4. What is the closest to z in 2/5, o, 5? 2/5 Let p be (30 - 23 - 8)(-74)/(-7). Which is the closest to 11? (a) p (b) 0.3 (c) 5 (d) 2/7 c Let d = -0.03315 + -0.46685. Let f = 1.3 + -2.3. Which is the nearest to 0.05? (a) d (b) f (c) -1/3 c Let d(u) = -29u*2. Let g be d(1). Let p be 6 + -4 - (-61)/g. Let l = -41/116 - p. Which is the nearest to 1/3? (a) l (b) 1 (c) 3 a Let j(q) = 7q*2 - 6q - 3. Let s be j(-3). Suppose 2m + s = 80. Let n be (-44)/(-28) - (33/21 - m). Which is the nearest to 1/2? (a) n (b) 0.4 (c) 4 b Let x = -0.0512 + 287.9512. Let d = 288 - x. Let t be (1 - 3)(-4)/(-6). Which is the closest to d? (a) -0.4 (b) 4 (c) t a Let q = -252.664 + -0.336. Let y = -253.24 - q. What is the nearest to 2 in -5, y, -2? y Let u = 2.1 + -2. Let f be -23 + 7366/319 - 13/(-99). Let h = 10 + -10. Which is the closest to -2? (a) h (b) u (c) f a Let r = -0.08551 + -0.91449. What is the nearest to -6 in -0.01, r, -5, 1/5? -5 Let l = 76.7 + -77. Let j = -3.983 + -0.017. Let i = 5 + j. Which is the closest to i? (a) l (b) 4 (c) -6 a Let v = 1246.5 + -769. Let m = v + -467.528. Let z = m + 0.028. Which is the closest to z? (a) 2 (b) -0.2 (c) -6 a Let k = -0.4 + 0. Let p = 26911 - 26912. Which is the closest to p? (a) k (b) 0 (c) -0.26 a Let h = 1610 + -3227/2. What is the closest to h in -0.5, -1/6, -0.3, -1? -1 Let k = -0.589982 + 0.989982. Let g = 10 + -14. What is the nearest to -1/4 in 3/11, g, k? 3/11 Let x = 25 + -24.6. Let g be 1846/(-616) - (-4)/(-22). Let v = -24/7 - g. What is the nearest to -1 in v, -1/11, x? v Suppose -1679h + 1681h = 36. Let i be (-12)/h + ((-213)/45 - -5). Which is the nearest to 0? (a) i (b) 4 (c) -26 a Let l = -1 - -1.65. Let o be 3/9 + 2/12. Which is the nearest to l? (a) 3 (b) o (c) 4 b Let a be ((-4)/6)/(8/132). Let m = 13 + a. Let f be m/(-3)81/(-135). What is the closest to -1/6 in f, 1/5, -5? 1/5 Let i = -13357/15 + 4459/5. What is the nearest to -1 in 16, i, -1? -1 Suppose 36w + 425 = -49w. Which is the closest to -1? (a) 1/3 (b) 12 (c) -2 (d) w c Let p = 0.0414 + -4.0414. Let d be 2/((-15)/(-6) + -5). Let j = 0.3 + -0.2. Which is the nearest to j? (a) d (b) p (c) 6 a Let f be 5/(3/(-6)(-38 - -43)). Which is the closest to 16? (a) f (b) 2/19 (c) -0.5 (d) 2/13 d Let i = -4.7 - -0.5. Let h = 4.1 + i. Suppose 3q - 12q = 3q. What is the closest to h in q, 3, -1? q Let m = 4359 + -4357. Let d = 4.7 + -0.7. Which is the nearest to m? (a) d (b) 0.5 (c) 2 c Let y(c) = -18c*2 - 6c + 1. Let q be y(-1). What is the closest to q in -6, -1/6, -4/9, 2? -6 Let l = -21119 + 21111. Let u = 0.5 - 0. What is the closest to 0.1 in l, -4, -2/11, u? -2/11 Let c be ((-4)/22)/((-23800)/18700). Let x = -7.1 - -1.1. What is the nearest to -1 in 3, x, 0.09, c? 0.09 Let i = 1491 - 1486. Let n = 103 + -103. What is the closest to 1 in n, -1, -5, i? n Let s = -76/21 - -10/3. Which is the nearest to 0? (a) 5 (b) s (c) 0.5 (d) -22 b Suppose 2d + 2n - 5n + 19 = 0, -3n = 5d + 79. Let y = -30 + 35. Let s = 24.9 - 24.8. Which is the nearest to s? (a) y (b) 0.3 (c) d b Let o be -3(-12)/9 + (-20)/6. Let q = -0.06 - 25.94. Let b = 25.9 + q. What is the closest to b in -5, 1, o? o Let h = 5395.7 - 5396. Which is the closest to -1? (a) h (b) 1 (c) -314 a Let t = 593249/156 + -11405/3. Let r = t - -1/26. Let k = -2 + 2.2. Which is the closest to k? (a) -2/13 (b) r (c) 1/5 c Let u(o) = -o*2 + 5o + 40. Let w be u(-5). Let k be 2/2 + 0 + (-7 - w). Which is the closest to -2/5? (a) k (b) -10/9 (c) 2/5 b Let j = 105.1 - 105.2. What is the nearest to 1 in 1/25, 0.06, j, 0.1? 0.1 Let o = -137/56 + 65/28. What is the closest to -1.9 in 5, -0.8, o, -5? -0.8 Let k = -77 + 74. Let u = -54.75 + 56. Let o = 1.15 - u. What is the closest to o in k, 0.3, 1? 0.3 Let y be 21/(-12)(-18)/21. Let f = 12 - 10. Let g = -0.07 - 0.03. Which is the closest to g? (a) y (b) 0 (c) f b Let x = -223 - -222.9. Let k be ((-33)/(-154))/((-2)/4). Which is the nearest to x? (a) 2 (b) 4 (c) k c Let x = 0.0049 + 37.6951. Let m = x + -38.1. What is the closest to -1 in -0.2, m, -131? m Let k = 2/91 + -212/1365. Suppose -18g + 8g + 1120 = 0. Let m = 111 - g. What is the closest to k in m, -1/7, -2? -1/7 Let d = 0.1731 - 0.4731. Which is the closest to d? (a) 146 (b) 2 (c) -3 b Suppose 0 = 11g - 7g + 4, 59 = 4m - 3g. Let h be (-4)/m - -125/70. Which is the nearest to 0? (a) 0.3 (b) 0.02 (c) 1/20 (d) h b Let q be 30/36 + 2134/(-165) + 12. Which is the closest to 1/4? (a) q (b) -5/11 (c) 4 a Let j = -14.33 + 16.5. Let s = j - -0.83. Let o = -2.8 + 3. What is the nearest to 1/4 in o, -3, s? o Let v = 0.34 + -0.34. Let x(l) = l*3 - 35l*2 - 34l - 67. Let a be x(36). What is the nearest to -2 in v, a, 2, 2/7? v Let h = -95.7 - -27.8. Let t = h - -68. Suppose -2o - 4d = 20, -3d - 5 = 4o + 10. Which is the nearest to o? (a) t (b) 2 (c) 3 a Suppose 27r = -34r + 34r. Which is the closest to r? (a) 0.2 (b) 1/6 (c) -6/37 c Let q = -537/14 - -2727/70. What is the closest to -1/3 in 0.0367, q, 5? 0.0367 Let i = 0.13 + -5.13. Let x be 12/155/3. Let u = -7 + 20/3. What is the closest to -2 in u, i, x? u Let i be 8/(-3) - (-4838)/984 - 2. Let r = -10 + 4. What is the closest to 3 in r, i, 4? 4 Let v = 1.2 - -3.8. Suppose -4m = 3c + 31, 1573 = -4c + 4m + 1597. What is the nearest to c in -2/5, -0.26, v, -5? -2/5 Let f = 0.04 - 3.04. Let m = f + 5. Let a = -1311656 - -1311656. What is the closest to a in 1/3, m, 3? 1/3 Suppose 0 = 20f - 17f. Suppose 5u = -6b + 2b + 13, 2u - 2b - 16 = f. What is the closest to 1 in u, 4, 3? 3 Let f = 10 - 14. Let c = 11517 + -103655/9. What is the nearest to c in f, -1, -3? -1 Let o = 11.4 + -11.9. Let d = 12.83 - 12.33. What is the closest to -0.131 in 0, d, o? 0 Let u = 3019 + -3018. What is the closest to 42 in -0.1, u, -0.2, 6? 6 Let i(l) = -l2 - 11l - 4. Let f be i(-10). Let p = f - 5. Let m = 5280 + -5280.3. Which is the closest to -4? (a) -2 (b) m (c) p a Let p = 6663 + -6570. What is the closest to 0 in p, -2/5, -5, 3? -2/5 Let g = -4595.086 - -4595. Let p = -0.026 + 0.24. Let o = g - p. What is the closest to 1 in o, -0.4, -0.9? o Let a(j) = 4j3 - 23j*2 - 6j. Let d be a(6). Let u(s) = 77s + 1. Let m be u(d). What is the closest to 5 in 1/5, m, -3, 3? 3 Let w = -0.4417958 + 0.0417958. Let v = -5.3 + 5. Let h = -0.2 - v. Which is the closest to h? (a) -3/2 (b) -5 (c) w c Let u = -9.5 - -10. Let s = 0.940809 - -0.059191. Which is the nearest to s? (a) 1 (b) u (c) 157 a Suppose -76i - 4g + 30 = -79i, -4i = g + 2. Which is the closest to 0? (a) 219 (b) -3 (c) i c Let k be ((-12)/30)/(7/5). Let p = 260/399 + 2/133. Which is the nearest to p? (a) -3/5 (b) k (c) 2/3 c Let w be 0/(-14) - 14 - 636/(-45). Let f(q) = -q - 2. Let x be f(-6). Which is the closest to w? (a) 0 (b) x (c) 5 a Let m be (-51)/(-2)(-46)/69. Let x be (15/24)/((-15)/20). Which is the closest to -1? (a) -1 (b) x (c) m a Let l = -3/331414 + -994221/2319898. Let g = 5 + -8. What is the nearest to 0 in 7, -0.8, g, l? l Let v = 1155 - 8081/7. What is the nearest to v in 5, 0.3, -0.2, -17? 0.3 Let l = -141.35 - -3.35. Let q = l + 138.2. Which is the nearest to -1/6? (a) 3/2 (b) q (c) 2/9 b Let x = -5 - -7. Let z = -0.04409 + 4.04409. Suppose -8 = 5u + 2. Which is the nearest to x? (a) 2 (b) u (c) z a Suppose 0 = 587s - 323s - 9 - 255. Let n be (-7)/12 + (-3)/(-9). Which is the nearest to s? (a) 1 (b) n (c) 1/2 a Let s = -3 + 3.1. Let k = 6.4891 - 5.4891. Which is the closest to s? (a) 0.3 (b) -0.008 (c) k b Suppose 0 = -399f + 384*f + 45. Let n = -849/250 - 1/250. Let x = n - -163/45. Which is the closest to f? (a) 3 (b) 0.4 (c) x a Let u = -0.7537 + 0.7537. Let x = 32/3 - 11. What is the closest to -2/11 in -1/9, u, x? -1/9 Let l(v)	{ "pile_set_name": "DM Mathematics" }
e 3 = x + q for x. -3 Let f(i) = i*2 + 23i + 42. Let h be f(-2). Solve h = 3m + 160 - 172 for m. 4 Let b(l) = l + 7. Let f be ((-3)/(-9))/((-1)/3) + -6. Let a be b(f). Solve 0 = 4v - av - 4 for v. 1 Let w be 1 + 0 - (-35)/5. Suppose -19f = -8f - 22. Solve w - f = -3z for z. -2 Let y = -18 - -24. Suppose -5g - 4w = -41, -w - y = -g - g. Let k(d) = d*2 + 8d - 9. Let l be k(-9). Solve lo - g = -5o for o. 1 Let j(m) = m3 + m2 - 2m + 9. Let r be j(0). Suppose -102 = -2n - n. Suppose r - n = -5t. Solve 12 = -tb - 3 for b. -3 Suppose 5q + 24 = 74. Suppose qv = 6v + 68. Solve -5 = 4y - v for y. 3 Let j = -2323 - -2326. Suppose -4 = -2g + g. Suppose gc - 22 = -3q + 8c, -4q - 12 = 5c. Solve 0 = o + qo - j for o. 1 Suppose -2y + 14 = 2p, -28 = 5p + y - 83. Let u be (12/(-10))/(1/(-5)). Solve ur = 2r - p for r. -3 Suppose 6s = 9s. Suppose 0m = 5q + 5m, s = 4q + 3m - 5. Solve 11 - 31 = -qk for k. 4 Suppose -5r = 11r. Solve 6p + 6 + 0 = r for p. -1 Suppose -3w - 2n = -2, -5w + 5n + 29 = -4w. Suppose 4v - 20 = 2d, -10v + 9v = -5. Solve d = g + w + 1 for g. -5 Suppose p - 20 - 10 = 0. Suppose q + 3q = 2w - 28, -p = -2w + 5q. Solve 5 + w = 5j for j. 3 Suppose 1 + 2 = 2j - u, 3u - 1 = -4j. Let m be (5 - 3)(j - -1). Suppose 1 = -mt - 3v + 14, 7 = 3t + 5v. Solve -1 - 3 = tz for z. -1 Let t be (-10)/14 + (-285)/(-7). Solve v - t = -44 for v. -4 Suppose -62n + 96 = -56n. Solve 4d + n = -4 for d. -5 Let w = 418 - 414. Solve -j + 1 = w for j. -3 Let l be (0(-5)/(-15))/1. Solve -4q - 66 + 62 = l for q. -1 Let w = -113 - -212. Let y be w/6 + -1(-1)/(-2). Solve -4q - y = -0 for q. -4 Let h = 652 - 642. Solve hq + 13 + 27 = 0 for q. -4 Suppose -208u + 199u = -45. Suppose 5i - 8 = p, 0 = p - 4i - 1 + 6. Solve 2d + u = pd for d. 1 Let n(c) = -c*3 - 2c*2 + 4c + 7. Suppose -1 = 2m - 5y, 5m = -3y - 10 - 8. Let x be n(m). Solve -u - 15 = xu for u. -3 Let r = 586 - 582. Solve -3h = -5h + rh for h. 0 Let m = 67 - 62. Suppose 7j + 3z + 15 = 10j, mj = z + 17. Solve -2t + jt = 3 for t. 3 Let n(m) be the first derivative of m4/4 - m3/3 - 4m2 + 9m - 1. Let j be n(4). Solve 6k - k = j for k. 5 Let o(c) = 5c + 1 - 2c + 12 - 8 + c2. Let z be o(-5). Let x = -12 + z. Solve xn + 10 = 8n for n. 2 Suppose -1165 + 255 = -13r. Solve -5i + r = 75 for i. -1 Let x be 2/3335/14. Solve -xo - 25 = -5 for o. -4 Let t(o) = -6o - 30. Let b be t(-14). Suppose bg - 51g - 3 = 0. Solve -2 + g = p for p. -1 Let t be -2(0 - (-1 - -2)). Let x be 17 + 1/2-22. Suppose 2r + 7 = -0r - 5s, 0 = 5s + x. Solve 2b = -tb - r for b. -1 Suppose -n = 3h - 124, -2h - n = -0h - 84. Suppose 3f - h = 2c - 7c, -c = -4f + 15. Solve 0t = ft for t. 0 Let r be (88/(-40))/110. Let t = -6 - -8. Suppose tu - 15 = -u. Solve rs - us = -15 for s. 3 Let p = 558 - 554. Solve pm - 15 = 7m for m. -5 Let c be (-5)/(20/(-52)) - (1 + 2). Solve -11w + c = -6w for w. 2 Let p(a) = -16a - 15a + 42a - a*2 - 13a + 3. Let z = 1 + -3. Let r be p(z). Solve 0h = -rh for h. 0 Let l = -855 + 859. Solve 0w - lw = 4 for w. -1 Let k = -77 - -87. Solve -2b = -4b - k for b. -5 Suppose g - 30w + 26w - 44 = 0, -3g = -2w - 92. Solve g = -19t + 12t for t. -4 Suppose 7w - 4w = 18. Let o(v) = v + 3. Let u be o(w). Suppose 5r + l = -4, -4r - 25 = 4l - u. Solve -5 + r = -b for b. 5 Let l(m) = -m2 + 13m - 14. Let u be l(6). Let c = u + -28. Solve c = -3h + 2 - 17 for h. -5 Let n(t) = t2 - 10t - 191. Let u be n(20). Solve -2 = 11l + u for l. -1 Let s be ((-22)/4)/((-21)/84). Solve -s = -2a - 32 for a. -5 Suppose -12 = 5c - 92. Let g(u) = 2u + 2. Let w be g(-3). Let f(m) = -m*3 - 4m*2 - 2m - 3. Let k be f(w). Solve 1 = -kn + c for n. 3 Let t = -9 - -9. Suppose -12 = 2z - 4k, tz = 4z - k - 4. Solve -z - 3 = d for d. -5 Let x be ((-1)/(-3))/(1/9). Let h = 3 + -1. Suppose 0 = -4a - hs + 46, -2s = 2a + 4 - 30. Solve xo = -a + 1 for o. -3 Suppose 8b = 9b - 2. Suppose -x = 2a + 3, 8a - 3a + 9 = -bx. Let d be (-16)/x30/(-20). Solve 2z - 2 = -d for z. -3 Suppose -s + 8 = 7i - 5i, 4i = -4s + 16. Solve 0 = 5t - st + 20 for t. -4 Let h(m) = m*3 + 10m*2 + 2m + 20. Suppose 6 = a - 4y, -2y - 15 + 47 = -4a. Let c be h(a). Solve -2b - 1 - 1 = c for b. -1 Let i be 8/(96/(-126))(-4)/(-3). Let m be (-3 - -1) + (5 - i). Solve -2 + m = 3t for t. 5 Let s = -1116 + 1141. Let u = 4 + -1. Solve 0 = -uf - 2f + s for f. 5 Let d be (4 + -1)/(6/8). Suppose 0 = 4f - x + 275, -3x = -f + 2x - 83. Let m = -68 - f. Solve m = -2o - d for o. -2 Suppose 5u = -4a, -2a + u + 8 = -6. Suppose 2d - 20 = -3w, -w + 5 = ad - 6. Solve -b - 25 = -wb for b. 5 Let n be (122/(-8))/((147/140)/(-21)). Solve 2l - 299 = -n for l. -3 Let o = -54 - -48. Let y be o/(-4) - (-10)/(-20). Solve 0l = -l + y for l. 1 Let b = -10 - -14. Suppose s = bs. Let h(k) = k3 + k2 - k + 3. Let t be h(s). Solve -12 = tu + u for u. -3 Suppose 2v = d - 4, 3d - v - 4v - 11 = 0. Suppose 6 = -y - 2b, -4y + 6 = -y - db. Solve y = 2s - 0 - 10 for s. 5 Suppose 12 = -16v + 20v. Solve -v - 2 = -5a for a. 1 Suppose o - 5o - 3b + 49 = 0, -4o + 3b = -31. Suppose oz = 3z + 35. Solve -10s + 15 = -zs for s. 3 Let n be 2(-2)/8-110. Suppose -3b - 13 + n = 0. Suppose 0 = -12r + 5r + b. Solve -12 = -5i + ri for i. 4 Suppose -5b - 2x = -640 + 65, 5x = 2b - 230. Let q = 115 - b. Solve -2z + 4z - 6 = q for z. 3 Let s(z) = 2z2 + 1. Let k be s(0). Suppose 17 = 3v - k. Let r be v/2 - (3 + -1). Solve 3n - 2 = r for n. 1 Let u(q) = -q2 + 5q - 4. Let m be u(4). Solve m = 3c - 2c + 5 for c. -5 Let w = -765 - -793. Solve -23i + w - 5 = 0 for i. 1 Suppose 3l - 69 = s, -129 + 28 = s + 5l. Let i be (-3)/15 - s/5. Suppose 3j - 6 = -4p - 13, -9 = j + 3p. Solve -y - jy = i for y. -4 Let r = 12 + -9. Suppose 14 = 6j - rj + 5a, 0 = 5j + 2a - 17. Solve 2p = -jp for p. 0 Let a be (-85)/(-25) - 4/10. Suppose -6 + a = -q. Suppose -d = -2, 5y = qd + 5 - 1. Solve 0 = -0r - yr + 2 for r. 1 Suppose 6l = 3q + 4l + 5, 0 = -5q + l + 1. Let t(o) = 2o2 - 6o + 7. Let m be t(q). Solve mr - 6 = 9 for r. 5 Suppose -68i - 20 = -69i. Let m(g) = -g + 11. Suppose -2 + 35 = 3l. Let z be m(l). Solve 5q + i = -zq for q. -4 Let b be ((-6)/(-10))/(16/80). Let z(r) = 2r + 10r*2 - 19r*2 + 10r*2 + 8 - 11r. Let u be z(8). Solve 6s - bs = u for s. 0 Let a be -5(2 + (-25)/5). Solve 16l - al = -4 for l. -4 Suppose 41c - 39c - 10 = 0. Solve ci - 4i = 4 for i. 4 Let u = 32 - 38. Let d(x) = -x3 - 6x*2 + 2. Let q be d(u). Let y = 4 + -3. Solve c + q + y = 0 for c. -3 Suppose -11 = -4b - 3. Suppose 0 = 4m + bi, 6m - 3i - 18 = 3m. Solve -z - 6 = mz for z. -2 Let b(c) = -48c - 521. Let v be b(-11). Let h(d) = -2d - 2. Let f be h(-4). Solve 1 = fl - vl for l. -1 Suppose -n = -3r - 23 - 23, n = -2r + 51. Let k = -49 + n. Solve 4h = -kh for h. 0 Let o be 44/121 + (-8)/22. Solve 34s + 31 + 37 = o for s. -2 Let a = -65 + 46. Let o be 19/7 + 3 + a/7. Solve 0 = -on - n for n. 0 Let s be -1 - 1 - (1 - 5). Let h(r) = -3 + s + 4 - r - 2. Let y be h(-1). Solve 4o = -y - 6 for o. -2 Let g be -2(10/4 + 3). Let d = g + 8. Let l be d/(-12) + (-22)/(-8). Solve 14 + 1 = -la for a. -5 Let a be (2 + (-1 - (-4)/(-4)))/1. Suppose 2o = -ao. Let h(s) = 4s*2. Let x be h(-1). Solve 2j - xj - 4 = o for j. -2 Suppose -3b = -2z - 2b + 23, 0 = -3z + 2b + 37. Let x = -10 + z. Let u be (4/(-8)0)/x. Solve -d + u = 1 for d. -1 Let m = -6 + 12. Suppose -3 = mq - 7q. Suppose 3h + 3 = 0, 2x + 5h = x - q. Solve 3v + x = -7 for v. -3 Let c = -33 + 37. Suppose 3d + u = 6u + 40, 4u + 8 = 0. Suppose -df + 36 = -6f. Solve -cy = 3 + f for y. -3 Let p(q) = -q3 - 4q*2 + 20q + 1. Let o be p(-7). Solve 0 = -ow + 6w for w. 0 Suppose 0 = 11x - 133 + 56. Solve 4q + 11 = -xq for q. -1 Let y = -568 + 572. Solve -3r = -7r - y for r. -1 Suppose 4n - 18 = -g, 16g + 22 = 4n + 19g. Solve no - 90 = -106 for o. -4 Let w = 13 + -11. Suppose wl = -l + 6. Let v be 0(-21 - -1). Solve v = ly - 4y - 2 for y. -1 Suppose -6w + w = -40. Suppose wn + 15 - 39 = 0. Solve 2s + n = -3 for	{ "pile_set_name": "DM Mathematics" }
3060? 3393 What comes next: 1552, 7230, 16988, 30832, 48768? 70802 What is next in -3705605, -7411205, -11116805, -14822405, -18528005, -22233605? -25939205 What is the next term in 132444, 529835, 1192152, 2119395, 3311564, 4768659, 6490680? 8477627 What comes next: 249117, 1992943, 6726185, 15943551, 31139749, 53809487? 85447473 What comes next: -29334116, -29334122, -29334132, -29334146, -29334164, -29334186? -29334212 What comes next: -21987679, -87950711, -197889093, -351802825, -549691907? -791556339 What comes next: 6918, 14082, 21164, 28164, 35082, 41918? 48672 What comes next: -406334464, -406334463, -406334462, -406334461, -406334460, -406334459? -406334458 What is the next term in 3505424, 3505420, 3505416? 3505412 What is next in 67318, 65585, 63852, 62119, 60386, 58653? 56920 What is next in -4915688, -4915654, -4915620, -4915586? -4915552 What is next in -49327, -99160, -149005, -198868, -248755, -298672? -348625 What is the next term in -17014, -68170, -153450, -272854, -426382, -614034? -835810 What comes next: 8090, 15247, 22420, 29615, 36838? 44095 What comes next: -20491, -31525, -42579, -53659, -64771, -75921, -87115, -98359? -109659 What is the next term in 11941, 21958, 38653, 62026, 92077, 128806? 172213 What is next in -572867, -1145733, -1718599? -2291465 What is next in -238042, -237960, -237742, -237322, -236634, -235612? -234190 What is next in 8208253, 16416520, 24624787, 32833054, 41041321? 49249588 What comes next: -9261, -36650, -82167, -145812, -227585, -327486, -445515? -581672 What comes next: -13063, -105337, -356001, -844315, -1649539, -2850933, -4527757, -6759271? -9624735 What comes next: 131609, 131496, 131317, 131072? 130761 What comes next: 117747, 117760, 117779, 117804, 117835, 117872, 117915? 117964 What comes next: -91166, -183540, -275914, -368288? -460662 What is the next term in -16210, -19768, -23326? -26884 What comes next: 17537110, 35074222, 52611334? 70148446 What is the next term in -2227, -9520, -21759, -38944, -61075? -88152 What comes next: -7342, -15644, -29480, -48850? -73754 What is next in 11029, 22049, 33029, 43969, 54869? 65729 What comes next: 24182819, 48365646, 72548473, 96731300? 120914127 What comes next: -10780, -10604, -10426, -10246, -10064? -9880 What comes next: -1750, -6938, -15490, -27328, -42374? -60550 What is the next term in 1006883532, 2013767064, 3020650596, 4027534128? 5034417660 What is the next term in 4396, 7884, 11348, 14776, 18156, 21476, 24724? 27888 What comes next: -115212, -921769, -3110990, -7374207, -14402752, -24887957, -39521154, -58993675? -83996852 What comes next: -640, -383, -126, 131? 388 What is the next term in 18450645, 36901284, 55351923, 73802562, 92253201, 110703840? 129154479 What is the next term in 566260, 566773, 567286, 567799, 568312? 568825 What is the next term in 156, 289, 504, 837, 1324, 2001, 2904, 4069? 5532 What is the next term in -10537, -10178, -9809, -9430? -9041 What comes next: 9383, 10617, 11753, 12743, 13539, 14093, 14357, 14283? 13823 What is the next term in -379, -3432, -11711, -27826, -54387? -94004 What comes next: 4403, 4163, 3761, 3197? 2471 What comes next: -455, -1273, -2473, -4055? -6019 What is the next term in -5430, -4530, -3620, -2688, -1722, -710, 360, 1500? 2722 What is the next term in 1826755, 3653536, 5480317, 7307098, 9133879, 10960660? 12787441 What comes next: -13931, -27360, -40789, -54218, -67647? -81076 What is the next term in 24634716, 49269423, 73904130? 98538837 What is the next term in 14, 294, 612, 968, 1362, 1794? 2264 What is next in -3131, 1834, 10107, 21688, 36577, 54774, 76279? 101092 What is the next term in 5843009, 11685914, 17528819, 23371724, 29214629, 35057534? 40900439 What is the next term in 3356, 154, -8530, -25438, -53312? -94894 What is next in -22389, -44532, -66677, -88824, -110973, -133124, -155277? -177432 What is next in -4676, -5407, -7388, -11243, -17596? -27071 What is next in -876699, -876460, -876053, -875472, -874711, -873764, -872625, -871288? -869747 What is next in 32644094, 32644096, 32644098? 32644100 What is the next term in 279445, 279454, 279463, 279472, 279481? 279490 What is next in 51315, 51358, 51401? 51444 What is next in -71211, -72280, -75173, -80802, -90079? -103916 What comes next: -9009, -7811, -6613, -5415, -4217? -3019 What comes next: -61007, -244166, -549423, -976778, -1526231, -2197782? -2991431 What comes next: -9443, -7884, -6325? -4766 What comes next: 7839600, 15679199, 23518798, 31358397? 39197996 What comes next: -52, -213, -356, -379, -180? 343 What comes next: 14954, 119615, 403700, 956921, 1868990? 3229619 What is the next term in -6135, -12003, -17871, -23739, -29607, -35475? -41343 What is next in 62841, 63615, 64393, 65175, 65961, 66751? 67545 What is next in 184, 364, 756, 1354, 2152, 3144, 4324, 5686? 7224 What is next in -929, -2082, -3479, -5114, -6981, -9074, -11387, -13914? -16649 What is next in 12212, 12338, 12562, 12890, 13328, 13882, 14558, 15362? 16300 What is next in 232080, 232069, 232044, 231999, 231928, 231825, 231684, 231499? 231264 What comes next: 1293230, 2586583, 3880062, 5173667, 6467398, 7761255? 9055238 What comes next: 411158, 1650690, 3716582, 6608840, 10327470? 14872478 What comes next: 49827, 49903, 49989, 50085? 50191 What is next in -1326, -2563, -3622, -4419, -4870? -4891 What is next in 436, 202, -72, -404, -812, -1314, -1928, -2672? -3564 What is next in -37366, -37346, -37314, -37270, -37214, -37146? -37066 What comes next: 277150, 554517, 831886, 1109257, 1386630? 1664005 What is next in -19728, -17720, -15712? -13704 What comes next: -3441, -3137, -2317, -723, 1903? 5819 What is the next term in -1966, -3708, -5216, -6490, -7530? -8336 What comes next: -2498193, -2498180, -2498167, -2498154? -2498141 What is next in 117352, 116970, 116588? 116206 What is next in 29843, 29889, 29935, 29981, 30027? 30073 What comes next: -320, -742, -1312, -2024, -2872? -3850 What comes next: -152611809, -305223618, -457835427, -610447236? -763059045 What is next in 380, 1064, 2068, 3398, 5060? 7060 What comes next: -31980830, -63961658, -95942486, -127923314? -159904142 What is the next term in 223940, 447878, 671816, 895754, 1119692? 1343630 What comes next: -10280, -20693, -31106, -41513, -51908, -62285, -72638? -82961 What is the next term in -9330, -18591, -27850, -37119, -46410, -55735, -65106? -74535 What is next in -942, -973, -1070, -1269, -1606, -2117? -2838 What is the next term in 51319, 51307, 51295, 51283, 51271, 51259? 51247 What is the next term in -409, -739, -769, -499, 71? 941 What is next in 442, 1173, 1850, 2455, 2970? 3377 What is next in 821929, 1643858, 2465787, 3287716, 4109645, 4931574? 5753503 What is next in -205578, -205492, -205406, -205320, -205234? -205148 What is the next term in 568015, 567989, 567963, 567937, 567911, 567885? 567859 What is next in -747, -2376, -5115, -8964, -13923, -19992? -27171 What comes next: 267042, 2136332, 7210118, 17090646, 33380162, 57680912? 91595142 What comes next: 15641002, 15641007, 15641012, 15641017, 15641022, 15641027? 15641032 What is next in -15656, -125307, -422942, -1002551, -1958124, -3383651? -5373122 What is next in 5248, 6271, 7294, 8317? 9340 What is the next term in 26990, 27494, 27998, 28502? 29006 What is next in -84673, -166659, -248643, -330625, -412605, -494583? -576559 What is the next term in 276986, 553966, 830946, 1107926, 1384906, 1661886? 1938866 What comes next: -2816120, -2816115, -2816108, -2816099? -2816088 What is next in 1081, 4457, 10143, 18133, 28421, 41001, 55867? 73013 What is next in -9112, -9000, -8888, -8776, -8664? -8552 What is next in -1393801, -1393810, -1393819, -1393828, -1393837? -1393846 What is the next term in -768997, -3076036, -6921099, -12304180, -19225273, -27684372, -37681471? -49216564 What is next in -1463058, -5852119, -13167220, -23408361? -36575542 What is next in -22852, -45308, -67768, -90232, -112700, -135172, -157648? -180128 What is next in 749, 3186, 7273, 13010, 20397, 29434, 40121? 52458 What is next in 255262, 510522, 765782, 1021042? 1276302 What is next in -2892029, -5784048, -8676067, -11568086? -14460105 What is next in 16685992, 16685993, 16685994, 16685995, 16685996, 1	{ "pile_set_name": "DM Mathematics" }
re there in 381511.2 millilitres? 381.5112 Convert 85.84719l to millilitres. 85847.19 How many milliseconds are there in nineteen quarters of a second? 4750 How many litres are there in 9985.048ml? 9.985048 What is 174324.465 hours in weeks? 1037.645625 What is 5/8 of a day in seconds? 54000 Convert 80405.49mm to nanometers. 80405490000 What is 1/10 of a meter in micrometers? 100000 How many millilitres are there in 1/10 of a litre? 100 Convert 80892.39 centuries to years. 8089239 What is 5/4 of a minute in milliseconds? 75000 What is 725260.7 millimeters in centimeters? 72526.07 How many microseconds are there in 539.3224 days? 46597455360000 How many litres are there in 0.238646 millilitres? 0.000238646 How many millilitres are there in 8/25 of a litre? 320 What is twenty-nine fifths of a second in milliseconds? 5800 How many centimeters are there in 8/25 of a meter? 32 What is 0.2227008 nanoseconds in minutes? 0.00000000000371168 What is 5/8 of a milligram in micrograms? 625 Convert 985.9715l to millilitres. 985971.5 What is 3/32 of a tonne in grams? 93750 What is five quarters of a litre in millilitres? 1250 How many kilograms are there in 97.33857 micrograms? 0.00000009733857 How many hours are there in 5/6 of a week? 140 What is 3/10 of a kilometer in centimeters? 30000 How many grams are there in one tenth of a kilogram? 100 What is 49705.12 nanometers in micrometers? 49.70512 What is 57/5 of a litre in millilitres? 11400 Convert 54981.08 seconds to milliseconds. 54981080 How many seconds are there in two fifteenths of a week? 80640 How many meters are there in 2.362799mm? 0.002362799 How many centimeters are there in 2674.294nm? 0.0002674294 What is seven halves of a litre in millilitres? 3500 How many days are there in 16/7 of a week? 16 How many millilitres are there in one quarter of a litre? 250 How many days are there in 2.9076606 minutes? 0.00201920875 How many nanometers are there in fifty-four fifths of a micrometer? 10800 Convert 9582.778 millilitres to litres. 9.582778 What is 1/4 of a millennium in months? 3000 How many nanograms are there in 3/8 of a microgram? 375 How many milligrams are there in nineteen quarters of a gram? 4750 What is 2/15 of a century in months? 160 How many decades are there in 203143.74 months? 1692.8645 How many minutes are there in 27/2 of a day? 19440 How many seconds are there in 45.71488 hours? 164573.568 How many micrograms are there in 42/5 of a milligram? 8400 What is 90.06324 millilitres in litres? 0.09006324 How many centimeters are there in three fifths of a meter? 60 How many millilitres are there in 19/4 of a litre? 4750 How many years are there in 14445.88 centuries? 1444588 How many years are there in 9.691323 months? 0.80761025 What is 6.025921 milligrams in micrograms? 6025.921 How many millilitres are there in 935.4851 litres? 935485.1 What is 1.9484832 minutes in hours? 0.03247472 What is 1/20 of a millimeter in micrometers? 50 Convert 632.9091 micrometers to nanometers. 632909.1 How many decades are there in 6/25 of a millennium? 24 What is 21/8 of a litre in millilitres? 2625 What is five quarters of a century in years? 125 What is 3/8 of a litre in millilitres? 375 What is 3/5 of a millennium in years? 600 What is 0.7247043 hours in microseconds? 2608935480 What is 17/4 of a litre in millilitres? 4250 How many millilitres are there in six fifths of a litre? 1200 What is 227492.79 hours in weeks? 1354.12375 Convert 7602.084 minutes to milliseconds. 456125040 What is thirty-seven halves of a milligram in micrograms? 18500 What is twenty-one halves of a hour in seconds? 37800 How many decades are there in 4.177573 years? 0.4177573 How many micrograms are there in 145901.2 milligrams? 145901200 Convert 1.573244l to millilitres. 1573.244 How many millilitres are there in 11/8 of a litre? 1375 Convert 34167.12ml to litres. 34.16712 How many microseconds are there in 75823.89 hours? 272966004000000 How many centimeters are there in seventeen halves of a meter? 850 What is 557.0836 years in centuries? 5.570836 Convert 95.99704 kilometers to meters. 95997.04 What is thirteen eighths of a kilogram in grams? 1625 What is seven eighths of a litre in millilitres? 875 Convert 8702.902t to milligrams. 8702902000000 Convert 39.15129 litres to millilitres. 39151.29 What is 70035.57 decades in years? 700355.7 How many kilograms are there in 45.24087g? 0.04524087 How many millilitres are there in 3.437353l? 3437.353 What is 34/5 of a hour in minutes? 408 How many centuries are there in 59769.87 decades? 5976.987 What is 5.241225 litres in millilitres? 5241.225 Convert 769.6998 centuries to months. 923639.76 What is 9.958531cm in kilometers? 0.00009958531 What is 74.81554mm in micrometers? 74815.54 What is 9/16 of a centimeter in micrometers? 5625 How many kilograms are there in fourty-six fifths of a tonne? 9200 What is 27/2 of a millisecond in microseconds? 13500 Convert 7358.466 micrometers to meters. 0.007358466 How many millimeters are there in twenty-one halves of a centimeter? 105 How many centuries are there in 11/10 of a millennium? 11 What is 362.9785 meters in millimeters? 362978.5 What is 732350.2 litres in millilitres? 732350200 How many micrometers are there in twenty-seven fifths of a centimeter? 54000 What is 73.77638 millimeters in kilometers? 0.00007377638 What is 9.544197kg in nanograms? 9544197000000 What is 7/4 of a litre in millilitres? 1750 How many centimeters are there in 22967.69 meters? 2296769 Convert 1973.58 millilitres to litres. 1.97358 What is 624.2393 centuries in years? 62423.93 How many kilograms are there in 30433.64 nanograms? 0.00000003043364 How many days are there in 5821.002 weeks? 40747.014 How many meters are there in 381887.7 nanometers? 0.0003818877 Convert 418775.4km to nanometers. 418775400000000000 What is three eighths of a centimeter in micrometers? 3750 How many nanometers are there in 919864.8mm? 919864800000 Convert 0.573164um to meters. 0.000000573164 How many meters are there in 3/40 of a kilometer? 75 What is 892.9174 hours in seconds? 3214502.64 What is 15410.9 seconds in microseconds? 15410900000 What is 17/4 of a litre in millilitres? 4250 How many litres are there in 21.95251ml? 0.02195251 Convert 7757.82 kilograms to micrograms. 7757820000000 Convert 944.5557mm to micrometers. 944555.7 How many grams are there in 7.89922 kilograms? 7899.22 Convert 842.0547ms to seconds. 0.8420547 What is 31.6344 milligrams in micrograms? 31634.4 How many millennia are there in 90.79388 centuries? 9.079388 What is 6/5 of a litre in millilitres? 1200 What is seven halves of a milligram in micrograms? 3500 What is 4.746741mm in kilometers? 0.000004746741 How many grams are there in 0.44637kg? 446.37 Convert 52872.669 milliseconds to hours. 0.0146868525 How many nanograms are there in 0.0906926t? 90692600000000 Convert 0.5619082ml to litres. 0.0005619082 How many months are there in one sixteenth of a century? 75 How many weeks are there in 12676.51161 milliseconds? 0.000020959840625 Convert 76724.86 millilitres to litres. 76.72486 How many months are there in 392947.9 decades? 47153748 What is 704685.78 microseconds in hours? 0.00019574605 How many millimeters are there in 5/8 of a meter? 625 What is 9255.962 millilitres in litres? 9.255962 What is 57.18713 kilograms in milligrams? 57187130 What is 58.50285 millilitres in litres? 0.05850285 What is 272.8573 years in centuries? 2.728573 What is thirteen quarters of a hour in minutes? 195 Convert 465.2122 centuries to decades. 4652.122 What is 26/5 of a litre in millilitres? 5200 How many millimeters are there in 0.3440295 meters? 344.0295 What is 809.1444 millilitres in litres? 0.8091444 Convert 56.88753mm to micrometers. 56887.53 How many micrometers are there in 98554.17 meters? 98554170000 How many milligrams are there in thirty-two fifths of a gram? 6400 What is 3/8 of a millimeter in micrometers? 375 What is 69815.26mm in nanometers? 69815260000 How many hours are there in 30.8248 days? 739.7952 How many millilitres are there in 91/2 of a litre? 45500 How many meters are there in 3.621478cm? 0.03621478 What is twenty-five quarters of a micrometer in nanometers? 6250 How many nanometers are there in	{ "pile_set_name": "DM Mathematics" }
-1 Let w be (0 + -2)(-3 - -7). Let h be (-26)/(-8) + 2/w. Let z = -2 + 3. Put z, -4, h in decreasing order. h, z, -4 Let x = -18 - -21. Let w = x + -2.7. Sort w, 6, 5 in decreasing order. 6, 5, w Let n = -4 - -6. Let v = 7 - n. Let s = 22 - 23. Put v, s, 4 in descending order. v, 4, s Suppose -53u - 64 = -69u. Put 0, u, 2, 1 in descending order. u, 2, 1, 0 Let n = -0.1249 + 1.1249. Sort 1/7, n, 2/69 in descending order. n, 1/7, 2/69 Let w = -0.0166 - 1.9834. Sort -2/5, w, 2/7 in descending order. 2/7, -2/5, w Let o = -21 + 24. Let y be o/(-36)72/27. Sort y, -5, -2, -11 in descending order. y, -2, -5, -11 Let r = 25 + -20. Let v(c) = c*3 - 4c*2 - 6c + 10. Let q be v(r). Let y = 0.02 - 2.02. Put 0.1, q, y in decreasing order. q, 0.1, y Let q be (-48)/2163/4. Suppose 0d + d + 3 = 0. Let w = 1.5 + -1.5. Sort q, d, w in descending order. w, q, d Suppose -382 = -93q - 475. Let g(b) be the third derivative of b6/120 - b5/10 - b4/4 - 2b3/3 + b2. Let c be g(7). Sort q, c, -3. -3, q, c Let j = -184 - -88. Let o be ((-8)/4)/(j/38). Let k = 2/3 - o. Sort k, 3, 2/7 in descending order. 3, 2/7, k Suppose -3c + 2 = -5y, 5c - 6 = c + 5y. Sort -4/3, c, 0.3, 2 in increasing order. -4/3, 0.3, 2, c Suppose 5z - j + 3j = 0, 5j + 17 = -4z. Let y be (-249)/(-12) + (-9)/12. Suppose 0 = -0f + 5f + y, -3d - 20 = 2f. Sort d, z, 1 in descending order. z, 1, d Let g be (1 + 2)/(-13 + 10). Put 4, 0, g in increasing order. g, 0, 4 Suppose -2c + 9 = 37. Let k = 14 + c. Sort k, -4, 3. -4, k, 3 Suppose -5o = -o + 12. Let j = 23851/10 - 2385. Put j, 1, 1/9, o in decreasing order. 1, 1/9, j, o Suppose 0 = -r - 4k - 33, r + 3r + 84 = -4k. Sort r, 3, -3. r, -3, 3 Let u = -2 + 4. Suppose 49 = 3o + 37. Suppose -5g - 5h = -oh - 3, g = -h + 3. Sort 5, u, g in increasing order. g, u, 5 Let y(s) = s3 - 22s*2 + 21s + 3. Let t be y(21). Suppose 5z + 3q = tz + 4, 0 = -3z + 4q + 6. Sort -3, z, -8. -8, -3, z Let a be -9 + 21 - (-638)/(-55). Put a, -0.0087, 4 in ascending order. -0.0087, a, 4 Suppose -2 = 14n - 2. Let v be (3 + -3)(-1)/3. Suppose v = -3s - 6 - 0. Sort n, s, 4. s, n, 4 Let p(c) = -2c3 - 32c*2 + 33c - 12. Let z be p(-17). Sort -13, -3, z in descending order. z, -3, -13 Let s = 8718 - 8680.99. Let o = -37 + s. Put 1/4, o, -2 in decreasing order. 1/4, o, -2 Let c = 1148 - 1147. Put c, 0.2, -1/4, -2/7 in decreasing order. c, 0.2, -1/4, -2/7 Let u = -29 + 31.1. Let a = u + -1.4. Let o = 0.5 - a. Put 4, o, -0.4 in descending order. 4, o, -0.4 Let u be -2(-18)/16-4. Let n be 6/(-9)u + -1. Let m = -0.04 - 0.26. Sort n, -3, m in decreasing order. n, m, -3 Let q = -1/2 - -3/10. Sort -67, q, 2/9 in descending order. 2/9, q, -67 Let z = -706 + 707. Put z, -2/5, 9 in ascending order. -2/5, z, 9 Let k = 2.9 - 2. Let v = k + -1.9. Let h = 1.1 + v. Sort h, 3, -1 in ascending order. -1, h, 3 Suppose 18m = 57m - 39. Let q be -1 + (0 - (2 - 1)). Sort m, 3, q, -1. q, -1, m, 3 Suppose 77 = -8m + m. Sort m, -1, 3, 0 in decreasing order. 3, 0, -1, m Let h = 1312.98 - 1313. Put -0.4, h, -5/3 in ascending order. -5/3, -0.4, h Let g = -298 - -368. Sort g, 2, -3 in descending order. g, 2, -3 Let v = 0.5 - -8.5. Let n = 14 - v. Let z = -4.6 + n. Put -2/35, 2/3, z in decreasing order. 2/3, z, -2/35 Suppose x - 5s = 21, 2x - x + 4s - 3 = 0. Let y = -3461/12 + 896/3. Let u = x - y. Put u, 0, -3 in increasing order. -3, 0, u Let a be (-1)/3 + (-26)/(-6). Let k = -18 + 24. Let v = k - 5.7. Put v, a, 3/2 in decreasing order. a, 3/2, v Let d = -0.163 + 13.163. Sort 5/2, 0.08, d in descending order. d, 5/2, 0.08 Let o(n) = -n2 - 10n - 16. Let l be o(-8). Suppose 2u - 2a + 6a - 26 = 0, l = u - 5a + 15. Let q be (1/3)/((-3)/9). Sort q, u, -4 in decreasing order. u, q, -4 Let d = -3.4 - -8.8. Let y = d + -5.9. Sort 1, 4, y, -2 in decreasing order. 4, 1, y, -2 Let p = -4483/7 - -640. Put 3.9, p, -2/11 in decreasing order. 3.9, -2/11, p Let c = 2 + -6. Let k = -9.42 - -15.42. Let p be 3/6(-2)/1. Sort c, k, p in increasing order. c, p, k Let x be -3 + 9/24 + (-865)/(-360). Sort 0.4, x, -58 in ascending order. -58, x, 0.4 Let l be 6/36 - (-50)/(-12). Let z = -6 - -4. Sort 5, z, l in descending order. 5, z, l Let t = -6 - -10. Let h(r) = 5r + 2. Let n be h(1). Let y(m) = -3m + 16. Let i be y(n). Put t, i, -3 in increasing order. i, -3, t Let f be (-3)/(-12) - 117/36. Let p be 0 + (4 + f)1. Let t be 14/8 - 2/(-8). Put 0, t, p in increasing order. 0, p, t Let p(z) = 3z - 1. Let l be p(-1). Let b(x) = x3 - 6x*2 + 5x + 5. Let g be b(5). Suppose -14r - g = 9. Put l, -2, r in descending order. r, -2, l Let q = 4.933 + -1.233. Sort 1/3, q, 2/3. 1/3, 2/3, q Let t = 479/2 - 239. Let a = -19 + 21. Sort t, -0.2, a in descending order. a, t, -0.2 Let r = 635 + -4446/7. Let y(k) = -k2 - 3k - 1. Let m be y(-2). Let d be (0 - m)/(2/(-2)). Sort 0.5, d, r. r, 0.5, d Let n be ((-18)/27)/((-5)/(-3)). Let w = 0.5 - 0.4. Let y = 0.2 + w. Put -4, n, y in ascending order. -4, n, y Suppose -26r = 20r + 230. Put r, -398, 3 in ascending order. -398, r, 3 Suppose 3 = -2q + q, 0 = 2a - 5q + 53. Let f = 37 + a. Put f, 5, -5, 1 in descending order. 5, f, 1, -5 Let d = -4 + 4. Let l be (34 - (-3 - -1))-1. Let z be (-5)/(20/l) - 4. Sort d, 4, z in ascending order. d, 4, z Let w be 6/8(-24)/(-12 - -6). Sort w, -1/4, 5, 23. -1/4, w, 5, 23 Let y = -5.7 + 6. Let s be (30/20)/(-5 - (-4 + 2)). Sort y, 3/4, -1, s in decreasing order. 3/4, y, s, -1 Suppose -t + 1 = -0. Let f = -3/8 - -13/24. Sort f, -1, t in decreasing order. t, f, -1 Let s = 0.16 - 0.12. Let l = -3.96 - s. Let a be 2/11 + (-21)/55. Sort l, -2, a. l, -2, a Let w = 542.3 - 542. Put w, -2, -6 in decreasing order. w, -2, -6 Let a = 1782 - 1775. Suppose 0 = -2n, 4o - 4n = -0n. Let q = -1 + o. Sort -3, a, q. -3, q, a Let v be 1/(1/612/6). Suppose vb - 2k - 59 = -0k, -4k + 15 = b. Sort 0, -2, -5, b in increasing order. -5, -2, 0, b Let s = -129 - -124. Let g be (-8)/28 + 10/(-14). Sort g, s, -3 in decreasing order. g, -3, s Let u be 66/(-2) - ((-2)/(-1) - 6). Put 4, 3, 1, u in ascending order. u, 1, 3, 4 Let g = 2 - -1. Suppose 0r - 15 = -gr, -4r + 32 = 3v. Suppose 3f - 9 = 0, 4p = -3f - 0f + 1. Sort p, v, 1 in decreasing order. v, 1, p Let y be ((-1)/((-1)/(-4)))/(-1). Let b be (-5)/43/(-5). Let z = 599 - 598. Put b, z, y in descending order. y, z, b Suppose y - 39 = 4y. Suppose 8t - 170 = -178. Sort y, t, -5, 1. y, -5, t, 1 Let c be -2((-45)/6)/5. Let i be (-2)/1 - (5 + -8). Let l(w) = 2w2 + 3w - 3. Let z be l(i). Put c, z, -2 in decreasing order. c, z, -2 Let j be (-1 + 6/4)-12. Let o(p) = -5p + 105. Let d be o(19). Let r = d + j. Sort -2, 5, r. -2, r, 5 Suppose -77 = -3t + 2b, 0 = -2b - 2 + 6. Let x = 32 - t. Let y be (1 - 0)/((-2)/(-6)). Put x, -2, y in ascending order. -2, y, x Let o = 16 - 0. Let j be 112/o + -1. Put -0.2, j, 2 in descending order. 2, -0.2, j Let t = 618.4 + -618. Put -0.3, 25, t in descending order. 25, t, -0.3 Let n be (1 - -1)/((-3)/(-2)). Let r(v) = -v*2 + 6v. Let c be r(6). Suppose c = -5s + 10. Put s, -0.06, n in decreasing order. s, n, -0.06 Suppose -5p = -24p - 19. Put -4, 1, p, -3 in increasing order. -4, -3, p, 1 Let r = -124.7 + 131.7. Sort -2, r, -9 in descending order. r, -2, -9 Let d be (-8)/((-448)/(-216)) - 8/(-2). Let s = 0.3 - 0.5. Let g = s - 0.3. Sort 0.1, g, d. g, 0.1, d Let a(i) = 4i + 44. Let y be a(-13). Put 0, 4, 3, y in ascending order. y, 0, 3, 4 Let w be (-97)/(-5) - (-2)/(-5). Let v = w - -7. Sort 2, 5, v in increasing order. 2, 5, v Suppose 0 = -d - t + 3, 3t = -d + 5t - 6. Suppose -5j + dq + 4 = -2q, 0 = -2j - 3q - 6. Sort j, 3, 55. j, 3, 55 Let k = -86 - -84. Sort 6, 3, k. k, 3, 6 Let c be (-16)/((-80)/(-45)) - -11. Put c, 4, -16 in descending order. 4, c, -16 Let o be 1(0 - -1)/((-5)/(-15)). Put -2/13, o, 0 in increasing order. -2/13, 0, o Suppose 261s - 268s = 7. Sort 0, s, -3, -18 in descending order. 0, s, -3, -18 Let k = 98 - 98. Put -23, k, -5, 4 in descending order. 4, k, -5, -23 Suppose -3h + 5h = -2q - 2, -8 = 2q + 5h. Suppose -j - 23 = 5k - 0j, 0 = k + 4j - 3. Suppose -10 = -22t + 23t. Sort k, t, q in descending order. q, k, t Let n = -49 - -44. Let r = 11.8 - 11. Sort n, r,	{ "pile_set_name": "DM Mathematics" }
picking 4 v? 1 Calculate prob of picking 2 b and 1 j when three letters picked without replacement from {k: 3, u: 1, j: 2, b: 4}. 1/10 Four letters picked without replacement from {q: 3, t: 3}. What is prob of picking 3 q and 1 t? 1/5 What is prob of picking 2 l when two letters picked without replacement from {l: 11, m: 1, h: 1}? 55/78 What is prob of picking 3 m when three letters picked without replacement from zmmrmnnnnn? 1/120 What is prob of picking 2 s and 1 u when three letters picked without replacement from {l: 2, s: 3, u: 3, a: 6, n: 3}? 9/680 What is prob of picking 1 a and 1 w when two letters picked without replacement from {n: 4, t: 6, i: 2, w: 1, a: 3}? 1/40 What is prob of picking 1 l and 2 f when three letters picked without replacement from flllflfl? 15/56 Calculate prob of picking 1 y and 2 e when three letters picked without replacement from {y: 2, e: 3}. 3/5 Three letters picked without replacement from qoqggqaaqgooa. What is prob of picking 2 o and 1 a? 9/286 Three letters picked without replacement from rarvusuvsrass. What is prob of picking 1 v, 1 u, and 1 a? 4/143 Calculate prob of picking 2 y, 1 b, and 1 g when four letters picked without replacement from {g: 11, b: 2, y: 7}. 154/1615 Calculate prob of picking 3 f when three letters picked without replacement from ffccff. 1/5 What is prob of picking 1 o and 1 h when two letters picked without replacement from onjht? 1/10 Calculate prob of picking 1 n and 3 p when four letters picked without replacement from bbfpnfppbf. 1/210 Calculate prob of picking 2 w and 1 b when three letters picked without replacement from yyqwmwqqbqqzz. 1/286 Calculate prob of picking 2 s when two letters picked without replacement from {m: 10, h: 3, d: 1, s: 5, o: 1}. 1/19 Calculate prob of picking 2 x and 2 v when four letters picked without replacement from xvxxwwwfvfgxgxxxx. 1/85 Calculate prob of picking 1 y, 1 i, and 2 p when four letters picked without replacement from {c: 6, i: 1, y: 3, p: 5, e: 2, t: 2}. 5/646 What is prob of picking 2 j, 1 u, and 1 k when four letters picked without replacement from kddjju? 1/15 Four letters picked without replacement from {g: 5, z: 3}. What is prob of picking 3 g and 1 z? 3/7 Calculate prob of picking 1 a and 3 x when four letters picked without replacement from xaaxaxxxaaax. 8/33 Calculate prob of picking 3 b when three letters picked without replacement from {v: 5, b: 5, w: 5, k: 3, g: 1}. 10/969 What is prob of picking 2 q and 2 s when four letters picked without replacement from sssqsqqpspsnqqssjpnh? 56/969 What is prob of picking 1 n, 1 y, and 1 p when three letters picked without replacement from nlnlplgnxlgnyllpn? 1/68 What is prob of picking 1 l and 1 k when two letters picked without replacement from lqolok? 2/15 Two letters picked without replacement from {m: 7, v: 5, y: 7}. What is prob of picking 1 y and 1 m? 49/171 Calculate prob of picking 3 h and 1 z when four letters picked without replacement from {z: 7, h: 6}. 28/143 Three letters picked without replacement from {r: 1, h: 1, d: 2, e: 1, p: 2, i: 1}. What is prob of picking 1 p, 1 r, and 1 i? 1/28 Calculate prob of picking 1 y and 1 r when two letters picked without replacement from {p: 1, v: 1, w: 1, r: 1, y: 1}. 1/10 Two letters picked without replacement from iaiajjjaamjzzjia. What is prob of picking 1 m and 1 z? 1/60 Four letters picked without replacement from {z: 2, k: 18}. Give prob of picking 4 k. 12/19 Calculate prob of picking 2 v when two letters picked without replacement from vaynveye. 1/28 Calculate prob of picking 2 q and 2 v when four letters picked without replacement from qqvqjlvyjj. 1/70 Two letters picked without replacement from {l: 1, d: 7}. What is prob of picking 1 d and 1 l? 1/4 Calculate prob of picking 2 z and 1 q when three letters picked without replacement from qiziizqxaiaqiqiix. 1/170 What is prob of picking 2 z when two letters picked without replacement from {y: 9, z: 4, p: 1}? 6/91 What is prob of picking 1 c and 1 z when two letters picked without replacement from {z: 2, v: 1, g: 1, c: 1, i: 1, l: 2}? 1/14 Two letters picked without replacement from {f: 7, b: 3, i: 4, c: 4}. What is prob of picking 2 i? 2/51 What is prob of picking 1 z and 2 e when three letters picked without replacement from eevezzo? 6/35 Four letters picked without replacement from {u: 18, q: 1}. What is prob of picking 3 u and 1 q? 4/19 What is prob of picking 1 d and 2 p when three letters picked without replacement from ppppdpdd? 15/28 Two letters picked without replacement from llfuulllfflflfl. Give prob of picking 2 u. 1/105 Calculate prob of picking 1 q and 1 e when two letters picked without replacement from {e: 1, j: 4, z: 6, q: 2}. 1/39 Four letters picked without replacement from vgwggggvwlg. Give prob of picking 2 g, 1 w, and 1 v. 2/11 Calculate prob of picking 3 j when three letters picked without replacement from iaacjaiajcaaaicijjj. 10/969 Calculate prob of picking 3 w when three letters picked without replacement from {i: 3, r: 2, w: 4, j: 6}. 4/455 Two letters picked without replacement from dxxdxdddrxdddddrdddr. Give prob of picking 1 r and 1 d. 39/190 Calculate prob of picking 1 p and 1 d when two letters picked without replacement from {o: 1, v: 3, d: 5, p: 1}. 1/9 What is prob of picking 1 d and 1 y when two letters picked without replacement from {p: 6, y: 5, i: 3, d: 3}? 15/136 Calculate prob of picking 3 q and 1 j when four letters picked without replacement from {j: 6, q: 6}. 8/33 Two letters picked without replacement from xxxxjjjx. What is prob of picking 2 x? 5/14 Calculate prob of picking 3 a and 1 k when four letters picked without replacement from {r: 4, c: 4, k: 3, a: 3}. 3/1001 Calculate prob of picking 1 y and 3 m when four letters picked without replacement from {y: 3, m: 7}. 1/2 Four letters picked without replacement from {n: 2, z: 5, v: 4, h: 4, s: 1}. What is prob of picking 2 h, 1 s, and 1 n? 3/455 What is prob of picking 2 x and 1 s when three letters picked without replacement from stttttstxttxtxss? 3/140 Three letters picked without replacement from {p: 1, x: 2, y: 2, i: 1}. What is prob of picking 2 x and 1 i? 1/20 Four letters picked without replacement from {m: 5, u: 2, y: 2, x: 2, f: 1, q: 2}. Give prob of picking 2 x, 1 u, and 1 y. 4/1001 Four letters picked without replacement from {c: 9, u: 2}. What is prob of picking 3 c and 1 u? 28/55 Three letters picked without replacement from eree. Give prob of picking 1 r and 2 e. 3/4 What is prob of picking 2 t when two letters picked without replacement from ytttuyttu? 5/18 Calculate prob of picking 1 b, 2 m, and 1 e when four letters picked without replacement from jejbmbbejbbjb. 0 What is prob of picking 1 f and 1 h when two letters picked without replacement from rfhrvrhfahfzhrfrf? 5/34 Two letters picked without replacement from hfosfh. What is prob of picking 1 h and 1 s? 2/15 Two letters picked without replacement from kkrkr. What is prob of picking 1 k and 1 r? 3/5 Calculate prob of picking 1 w, 1 p, 1 h, and 1 l when four letters picked without replacement from pwklwlhll. 4/63 Three letters picked without replacement from xxx. Give prob of picking 3 x. 1 Calculate prob of picking 1 g and 1 s when two letters picked without replacement from zsgcsqhz. 1/14 Three letters picked without replacement from {p: 5, v: 1, m: 1, n: 1, k: 3}. What is prob of picking 1 k, 1 m, and 1 n? 1/55 What is prob of picking 1 l, 1 y, 1 x, and 1 z when four letters picked without replacement from {p: 4, b: 1, y: 4, z: 1, x: 5, l: 3}? 1/51 Calculate prob of picking 2 q when two letters picked without replacement from {s: 6, b: 7, u: 1, q: 5}. 10/171 Two letters picked without replacement from {v: 9}. Give prob of picking 2 v. 1 What is prob of picking 1 k and 1 s when two letters picked without replacement from {k: 2, s: 1}? 2/3 Three letters picked without replacement from {r: 7, g: 5}. Give prob of picking 1 r and 2 g. 7/22 Calculate prob of picking 1 y and 3 i when four letters picked without replacement from {u: 5, q: 9, y: 2, i: 3}. 1/1938 What is prob of picking 1 q, 1 u, and 1 k when three letters picked without replacement from wujquqck? 1/14 Calculate prob of picking 1 u and 1 f when two le	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.