Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
and 1 c. 7/15 Three letters picked without replacement from {c: 2, u: 2, s: 1, z: 4, w: 1}. Give prob of picking 1 s, 1 z, and 1 w. 1/30 Calculate prob of picking 4 m when four letters picked without replacement from ggmmmmgmmmmgmmmggm. 11/68 Two letters picked without replacement from tvbbmvvttdtbttttvvbv. Give prob of picking 2 m. 0 Calculate prob of picking 1 x and 1 c when two letters picked without replacement from bcxqbbbbqrq. 1/55 What is prob of picking 1 k and 1 p when two letters picked without replacement from xfkpfflklfxl? 1/33 Calculate prob of picking 1 k and 2 m when three letters picked without replacement from {s: 4, m: 2, k: 6}. 3/110 Three letters picked without replacement from {k: 1, i: 1, h: 1, x: 2}. Give prob of picking 1 h and 2 x. 1/10 What is prob of picking 1 a and 1 g when two letters picked without replacement from gamamaagaea? 12/55 Three letters picked without replacement from henlreerehehnhhenh. What is prob of picking 2 e and 1 r? 5/136 What is prob of picking 1 v and 2 z when three letters picked without replacement from zzzzvzvzzvvzzz? 45/91 Calculate prob of picking 2 b when two letters picked without replacement from xvjxbvwxxxxvxxbxxx. 1/153 What is prob of picking 2 z and 2 e when four letters picked without replacement from zzzeeezzzzzeezzzez? 11/34 Four letters picked without replacement from {t: 13, q: 3}. What is prob of picking 4 t? 11/28 Calculate prob of picking 1 c, 1 d, and 1 t when three letters picked without replacement from {c: 1, n: 2, d: 1, t: 1, u: 2}. 1/35 Calculate prob of picking 2 v when two letters picked without replacement from vjjjjvjjjvjvjj. 6/91 Calculate prob of picking 4 c when four letters picked without replacement from cmcmcccccttc. 14/99 Three letters picked without replacement from {e: 1, q: 2, i: 1, y: 2, d: 1, n: 1}. What is prob of picking 1 q, 1 e, and 1 d? 1/28 Four letters picked without replacement from ovvvvvovvooo. Give prob of picking 1 v and 3 o. 14/99 Four letters picked without replacement from {r: 4, z: 6, g: 1, v: 1, i: 1, j: 3}. What is prob of picking 3 j and 1 v? 1/1820 Calculate prob of picking 1 n and 2 a when three letters picked without replacement from rrrrrrnrranarr. 1/182 Calculate prob of picking 1 p and 1 x when two letters picked without replacement from {p: 2, x: 1}. 2/3 Two letters picked without replacement from {y: 3, j: 1, f: 1}. Give prob of picking 1 j and 1 y. 3/10 Two letters picked without replacement from {p: 5, s: 12, w: 2}. What is prob of picking 2 s? 22/57 Calculate prob of picking 3 a when three letters picked without replacement from zlaaaalzzazl. 1/22 What is prob of picking 1 u and 3 j when four letters picked without replacement from {u: 3, j: 3}? 1/5 Two letters picked without replacement from okokookorkrrzo. What is prob of picking 1 k and 1 r? 12/91 Calculate prob of picking 3 p when three letters picked without replacement from pkpkpkpppp. 7/24 Two letters picked without replacement from {c: 1, i: 2, x: 1, q: 1, a: 1, z: 1}. What is prob of picking 1 a and 1 z? 1/21 Four letters picked without replacement from {j: 1, u: 6, g: 11, p: 1}. What is prob of picking 4 g? 55/646 Four letters picked without replacement from occmkjlo. What is prob of picking 2 o, 1 c, and 1 k? 1/35 Three letters picked without replacement from {m: 2, v: 2, z: 2, b: 1, s: 1}. What is prob of picking 1 v and 2 z? 1/28 Three letters picked without replacement from omolm. Give prob of picking 1 o, 1 l, and 1 m. 2/5 Three letters picked without replacement from {n: 3, q: 11, o: 3, k: 3}. Give prob of picking 1 o, 1 k, and 1 q. 33/380 Calculate prob of picking 1 c, 1 q, 1 l, and 1 j when four letters picked without replacement from jjvcttjjtvjttjqlq. 3/595 Calculate prob of picking 1 f, 1 q, 1 t, and 1 i when four letters picked without replacement from {a: 5, i: 1, f: 1, w: 4, t: 3, q: 1}. 1/455 Three letters picked without replacement from vbeebmcebemvhbe. What is prob of picking 2 v and 1 h? 1/455 Two letters picked without replacement from ggggggtgggtg. Give prob of picking 1 g and 1 t. 10/33 Two letters picked without replacement from yyyjj. Give prob of picking 1 y and 1 j. 3/5 Calculate prob of picking 3 l and 1 x when four letters picked without replacement from rhllxhll. 2/35 Four letters picked without replacement from {t: 1, p: 2, a: 2, q: 4, x: 1, c: 2}. Give prob of picking 2 p, 1 t, and 1 q. 4/495 What is prob of picking 4 c when four letters picked without replacement from {u: 7, c: 9}? 9/130 Calculate prob of picking 2 r and 1 p when three letters picked without replacement from ripri. 1/10 Four letters picked without replacement from {b: 1, m: 19}. Give prob of picking 1 b and 3 m. 1/5 Three letters picked without replacement from rcrrrcrrrrrc. What is prob of picking 3 r? 21/55 Four letters picked without replacement from cpfeffeeeeeofeei. What is prob of picking 1 f and 3 i? 0 Calculate prob of picking 2 a and 1 y when three letters picked without replacement from ytahyaaahy. 3/20 Calculate prob of picking 1 s and 1 c when two letters picked without replacement from {s: 2, b: 2, m: 2, c: 2}. 1/7 Three letters picked without replacement from jjjjjsjjjjjjjjsjjs. Give prob of picking 1 s and 2 j. 105/272 Calculate prob of picking 2 b, 1 e, and 1 i when four letters picked without replacement from jieeeieibbeeibib. 9/91 What is prob of picking 3 i when three letters picked without replacement from hiihhhhhhhhiihihhhhh? 1/114 Calculate prob of picking 2 q, 1 v, and 1 f when four letters picked without replacement from {p: 3, v: 2, u: 3, f: 2, q: 2, j: 4}. 1/455 Two letters picked without replacement from {s: 1, i: 1, m: 3, v: 1, d: 1}. Give prob of picking 1 s and 1 i. 1/21 Two letters picked without replacement from eeeekddfoeeoeoedkv. Give prob of picking 1 d and 1 e. 8/51 Four letters picked without replacement from mllhhlglmlul. Give prob of picking 1 g, 2 h, and 1 l. 2/165 Four letters picked without replacement from {v: 4, r: 3, k: 7}. What is prob of picking 2 k and 2 r? 9/143 Calculate prob of picking 1 l and 1 g when two letters picked without replacement from {l: 5, o: 2, b: 4, g: 2, d: 7}. 1/19 What is prob of picking 1 n and 1 w when two letters picked without replacement from {w: 8, n: 3}? 24/55 Calculate prob of picking 1 n, 1 f, and 1 o when three letters picked without replacement from nfnemnmmfffsfon. 4/91 What is prob of picking 1 k, 2 x, and 1 g when four letters picked without replacement from gxpgpxkggxxgpggx? 1/26 Calculate prob of picking 1 n and 2 g when three letters picked without replacement from {n: 3, g: 2, f: 5}. 1/40 What is prob of picking 1 k and 1 b when two letters picked without replacement from bkbkb? 3/5 Three letters picked without replacement from {x: 3, q: 2, i: 3}. Give prob of picking 2 q and 1 i. 3/56 Four letters picked without replacement from {y: 3, r: 1, l: 2, d: 6}. Give prob of picking 3 d and 1 l. 8/99 Two letters picked without replacement from {n: 6, b: 3, z: 9, k: 1}. What is prob of picking 2 n? 5/57 Calculate prob of picking 2 i when two letters picked without replacement from {i: 6}. 1 Two letters picked without replacement from {v: 1, i: 1, j: 1, m: 2}. What is prob of picking 1 m and 1 i? 1/5 Three letters picked without replacement from mqkkkmqmkqdukzmk. Give prob of picking 1 d, 1 u, and 1 k. 3/280 Three letters picked without replacement from {c: 5, l: 2}. Give prob of picking 3 c. 2/7 Two letters picked without replacement from {t: 18, d: 2}. Give prob of picking 2 d. 1/190 Calculate prob of picking 1 w and 1 p when two letters picked without replacement from pwsspx. 2/15 Four letters picked without replacement from {h: 3, o: 2}. Give prob of picking 1 o and 3 h. 2/5 Calculate prob of picking 1 g and 3 v when four letters picked without replacement from {g: 14, v: 5}. 35/969 Calculate prob of picking 1 k, 1 j, and 2 n when four letters picked without replacement from {w: 2, k: 1, j: 1, z: 4, n: 3}. 1/110 Two letters picked without replacement from roxxwyoyxxnxxxyynn. What is prob of picking 1 y and 1 n? 4/51 What is prob of picking 1 e and 1 w when two letters picked without replacement from dzxzwwep? 1/14 Two letters picked without replacement from ycqvyc. What is prob	{ "pile_set_name": "DM Mathematics" }
What is the cube root of 1136 to the nearest integer? 10 What is the square root of 1151 to the nearest integer? 34 What is the sixth root of 494 to the nearest integer? 3 What is 3160 to the power of 1/3, to the nearest integer? 15 What is the sixth root of 8117 to the nearest integer? 4 What is 159 to the power of 1/3, to the nearest integer? 5 What is the third root of 13767 to the nearest integer? 24 What is 50116 to the power of 1/7, to the nearest integer? 5 What is 60694 to the power of 1/2, to the nearest integer? 246 What is 4670 to the power of 1/7, to the nearest integer? 3 What is the third root of 314 to the nearest integer? 7 What is the eighth root of 97692 to the nearest integer? 4 What is 38410 to the power of 1/3, to the nearest integer? 34 What is the cube root of 26584 to the nearest integer? 30 What is 1456 to the power of 1/2, to the nearest integer? 38 What is 13166 to the power of 1/2, to the nearest integer? 115 What is the third root of 556 to the nearest integer? 8 What is the cube root of 5332 to the nearest integer? 17 What is 6984 to the power of 1/3, to the nearest integer? 19 What is 52 to the power of 1/6, to the nearest integer? 2 What is 7038 to the power of 1/8, to the nearest integer? 3 What is 37473 to the power of 1/10, to the nearest integer? 3 What is 701 to the power of 1/2, to the nearest integer? 26 What is 71877 to the power of 1/3, to the nearest integer? 42 What is 886 to the power of 1/4, to the nearest integer? 5 What is the square root of 42995 to the nearest integer? 207 What is the fourth root of 104348 to the nearest integer? 18 What is the square root of 1024 to the nearest integer? 32 What is the sixth root of 10275 to the nearest integer? 5 What is 1387 to the power of 1/4, to the nearest integer? 6 What is the sixth root of 3078 to the nearest integer? 4 What is the cube root of 27235 to the nearest integer? 30 What is 2207 to the power of 1/7, to the nearest integer? 3 What is the square root of 55460 to the nearest integer? 235 What is the ninth root of 614 to the nearest integer? 2 What is 1349 to the power of 1/2, to the nearest integer? 37 What is the square root of 46188 to the nearest integer? 215 What is the cube root of 10785 to the nearest integer? 22 What is the cube root of 705 to the nearest integer? 9 What is the sixth root of 362 to the nearest integer? 3 What is the square root of 1857 to the nearest integer? 43 What is the tenth root of 6743 to the nearest integer? 2 What is 97178 to the power of 1/3, to the nearest integer? 46 What is the third root of 30191 to the nearest integer? 31 What is the seventh root of 1644 to the nearest integer? 3 What is 158019 to the power of 1/9, to the nearest integer? 4 What is 47471 to the power of 1/3, to the nearest integer? 36 What is the third root of 19094 to the nearest integer? 27 What is the square root of 299 to the nearest integer? 17 What is the ninth root of 4480 to the nearest integer? 3 What is the square root of 9906 to the nearest integer? 100 What is the cube root of 13 to the nearest integer? 2 What is 17110 to the power of 1/4, to the nearest integer? 11 What is the square root of 1052 to the nearest integer? 32 What is 26923 to the power of 1/2, to the nearest integer? 164 What is 3622 to the power of 1/2, to the nearest integer? 60 What is the third root of 552 to the nearest integer? 8 What is 1137 to the power of 1/9, to the nearest integer? 2 What is the fourth root of 9284 to the nearest integer? 10 What is 98323 to the power of 1/2, to the nearest integer? 314 What is 6705 to the power of 1/3, to the nearest integer? 19 What is the square root of 134923 to the nearest integer? 367 What is 147736 to the power of 1/2, to the nearest integer? 384 What is 590 to the power of 1/10, to the nearest integer? 2 What is 406 to the power of 1/3, to the nearest integer? 7 What is the square root of 1316 to the nearest integer? 36 What is the fifth root of 6174 to the nearest integer? 6 What is 101811 to the power of 1/2, to the nearest integer? 319 What is 554 to the power of 1/10, to the nearest integer? 2 What is 5185 to the power of 1/7, to the nearest integer? 3 What is 6118 to the power of 1/3, to the nearest integer? 18 What is the fourth root of 34277 to the nearest integer? 14 What is the third root of 561 to the nearest integer? 8 What is 437 to the power of 1/2, to the nearest integer? 21 What is 456 to the power of 1/3, to the nearest integer? 8 What is 371 to the power of 1/10, to the nearest integer? 2 What is 3230 to the power of 1/4, to the nearest integer? 8 What is 910 to the power of 1/3, to the nearest integer? 10 What is the tenth root of 387 to the nearest integer? 2 What is the square root of 61627 to the nearest integer? 248 What is the square root of 25186 to the nearest integer? 159 What is 30294 to the power of 1/6, to the nearest integer? 6 What is 186 to the power of 1/3, to the nearest integer? 6 What is the eighth root of 5256 to the nearest integer? 3 What is 11777 to the power of 1/2, to the nearest integer? 109 What is 2749 to the power of 1/6, to the nearest integer? 4 What is the square root of 726 to the nearest integer? 27 What is 14371 to the power of 1/2, to the nearest integer? 120 What is the seventh root of 582 to the nearest integer? 2 What is 962 to the power of 1/6, to the nearest integer? 3 What is 33252 to the power of 1/10, to the nearest integer? 3 What is 5115 to the power of 1/2, to the nearest integer? 72 What is 4572 to the power of 1/3, to the nearest integer? 17 What is 1085 to the power of 1/3, to the nearest integer? 10 What is 160541 to the power of 1/6, to the nearest integer? 7 What is the cube root of 1081 to the nearest integer? 10 What is the third root of 7841 to the nearest integer? 20 What is the third root of 8425 to the nearest integer? 20 What is 8330 to the power of 1/5, to the nearest integer? 6 What is the cube root of 1599 to the nearest integer? 12 What is the square root of 35 to the nearest integer? 6 What is 13323 to the power of 1/2, to the nearest integer? 115 What is the square root of 6743 to the nearest integer? 82 What is 47154 to the power of 1/2, to the nearest integer? 217 What is the fourth root of 2296 to the nearest integer? 7 What is 36998 to the power of 1/8, to the nearest integer? 4 What is the square root of 166548 to the nearest integer? 408 What is the seventh root of 1430 to the nearest integer? 3 What is the cube root of 12688 to the nearest integer? 23 What is 842 to the power of 1/4, to the nearest integer? 5 What is the square root of 2325 to the nearest integer? 48 What is 6322 to the power of 1/10, to the nearest integer? 2 What is the third root of 2266 to the nearest integer? 13 What is the ninth root of 7876 to the nearest integer? 3 What is the cube root of 44536 to the nearest integer? 35 What is the fifth root of 5318 to the nearest integer? 6 What is the fourth root of 7360 to the nearest integer? 9 What is the seventh root of 939 to the nearest integer? 3 What is 2322 to the power of 1/9, to the nearest integer? 2 What is the square root of 14610 to the nearest integer? 121 What is 10069 to the power of 1/3, to the nearest integer? 22 What is 12798 to the power of 1/2, to the nearest integer? 113 What is 10495 to the power of 1/5, to the nearest integer? 6 What is 2275 to the power of 1/5, to the nearest integer? 5 What is 49903 to the power of 1/10, to the nearest integer? 3 What is the cube root of 230 to the nearest integer? 6 What is the ninth root of 165 to the nearest integer? 2 What is 40825 to the power of 1/2, to the nearest integer? 202 What is 6798 to the power of 1/2, to the nearest integer? 82 What is the cube root of 114808 to the nearest integer? 49 What is 94 to the power of 1/3, to the nearest integer? 5 What is the third root of 28818 to the nearest integer? 31 What is 939 to the power of 1/8, to the nearest integer? 2 What is the third root of 702 to the nearest integer? 9 What is the cube root of 638 to the nearest integer? 9 What is 70711 to the power of 1/2, to the nearest integer? 266 What is the square root of 937 to the nearest integer? 31 What is 13384 to the power of 1/3, to the n	{ "pile_set_name": "DM Mathematics" }
791490x2 - 57x + 17151. -31582980 What is the derivative of 53879031w + 542452666 wrt w? 53879031 What is the third derivative of -80855k*5 + 25k*4 + 6k3 - k2 - 56k - 68904? -4851300k*2 + 600k + 36 What is the first derivative of -57461018o4 + 20684456? -229844072o*3 What is the first derivative of -3cdk*2 - cdk + 37ck2 + 3ck - 3c - 130588d + 216k*2 - k wrt d? -3ck2 - ck - 130588 Differentiate 159921412a2 + 949251707 wrt a. 319842824a Differentiate -11y4 - 762y*2 - 2214y - 168118332. -44y3 - 1524y - 2214 Find the second derivative of -8478956m5 + 4150m - 875 wrt m. -169579120m3 Find the second derivative of -27239098v*2 - 3280593v wrt v. -54478196 Find the second derivative of 742815732a2 + 463654355a wrt a. 1485631464 Find the second derivative of 11843c2h*2 + 104c*2h - 3c2 - 62ch2 + 896c - 17h2 wrt c. 23686h*2 + 208h - 6 What is the second derivative of -114122650t2w2 + t2 + tw + 872t + 2w3 + 2w - 895 wrt w? -228245300t2 + 12w What is the third derivative of -u*5 + 2439232u*3 + 1933134u*2 wrt u? -60u*2 + 14635392 Find the second derivative of 5375c*2w*4 + 11539c*2w*2 - 3c*2w - c*2 + 5780cw - 122c - 2 wrt w. 64500c2w*2 + 23078c*2 Find the second derivative of 74976343o*2 - 72889588o wrt o. 149952686 What is the third derivative of -18b5 - b4 + 47112b*3 - 6342b*2 - 1385b wrt b? -1080b2 - 24b + 282672 What is the second derivative of -2a4b*3 + 11681058a*2b*3 + 3ab3 - 57ab2 + 12ab - 2b - 2 wrt a? -24a2b*3 + 23362116b3 Differentiate s3t2 + s3t + 7s3 - 26327s*2t - 3397s - 2760 wrt t. 2s*3t + s*3 - 26327s*2 What is the derivative of -330142t*4 + 204t*3 + 111103164 wrt t? -1320568t*3 + 612t*2 Find the second derivative of -569122407f*5 + 735141077f. -11382448140f3 What is the third derivative of 1508853445k*3m*3 + 3258954k*2m + 14km*3 wrt k? 9053120670m*3 What is the second derivative of 181764877o*2z*3 - oz*3 - 2o + z*3 + 2z*2 - 28662224 wrt o? 363529754z*3 Find the third derivative of 130o*3sz3 + 10o*3sz - 439o*3s - 37o2z*3 - 45132osz*3 wrt o. 780sz3 + 60sz - 2634s Find the third derivative of -90081970f3 + 290f*2 - 333635f wrt f. -540491820 What is the second derivative of -654915m5 + 42m*4 + 60645432m wrt m? -13098300m3 + 504m*2 What is the third derivative of -5ch4 - 103406ch3 - 2ch2 + 2287375ch + 10h*3 + 38h*2 wrt h? -120ch - 620436c + 60 Find the second derivative of -6384425k3 + 44k + 23263 wrt k. -38306550k Find the first derivative of 818n*4w - 982n4 + 13018w + 284 wrt n. 3272n3w - 3928n3 What is the second derivative of 15233879b*2 + 396496b? 30467758 Find the second derivative of -141o3 - 5640o*2 + 119417660o wrt o. -846o - 11280 Differentiate 835148k*2 - 3649083 with respect to k. 1670296k What is the second derivative of 40995632b2mz2 + b2z + 2bm*2z*2 - 110bm2 + 39938bmz - 2z2 wrt z? 81991264b*2m + 4bm*2 - 4 What is the third derivative of 101671700a*3m*2 + 315032a*2 - 85am2 wrt a? 610030200m*2 What is the derivative of -105908461v*2 - 54302488? -211816922v Find the second derivative of -a*2m*2 + 15020462a*2m + 2am*2 + 53457am - 8m*2 - m + 13 wrt a. -2m*2 + 30040924m Find the third derivative of -439089cm*3 - cm*2 + 3cm - 45c + 83m3 - 6m*2 - 5m + 196 wrt m. -2634534c + 498 What is the derivative of 18772n*2 - 8621n + 95730131? 37544n - 8621 What is the second derivative of 11948572o*2 - 1504704o + 2 wrt o? 23897144 What is the second derivative of 2281p3z*2 - 2006145p*3 - 73pz4 - z wrt z? 4562p*3 - 876pz2 What is the first derivative of 46650gw2y - 94gwy + w2 - 1860wy + y + 26 wrt g? 46650w*2y - 94wy What is the second derivative of 141026620a3 - 91295433a? 846159720a Find the second derivative of -1332003a*3 - 30859022a wrt a. -7992018a What is the second derivative of -176u*2y*3 + 100u*2y - 274u2 + 154004u - 86y3 wrt u? -352y*3 + 200y - 548 What is the first derivative of 1645466o4 + 4o*2 - 22322006? 6581864o*3 + 8o Find the second derivative of 2083g2ht3 - 12g*2ht + 6ght - 17gh - 4087ht*3 + 25h wrt t. 12498g2ht - 24522ht Find the third derivative of 28605531jq5 + 4jq2 - 4jq + 58j - q*2 + q - 177 wrt q. 1716331860jq2 Find the second derivative of -910062a*2w*2 + 4005a*2w + 3aw - a + 33w wrt w. -1820124a*2 What is the second derivative of -62678425q*3 - 3599263q - 4? -376070550q What is the second derivative of -205181186z*2 - 9z - 5108189 wrt z? -410362372 What is the second derivative of 152644186a2 - 21842193a? 305288372 Find the first derivative of 2458960fp*4t - 548047832ft - 144p3t wrt p. 9835840fp*3t - 432p2t What is the third derivative of -3103771i4 - 13i*3 - 421043427i*2? -74490504i - 78 Find the third derivative of 4ijx3 - 58ijx*2 - 4ij + 324ix3 + 618jx3 + 18jx2 - 25x*2 wrt x. 24ij + 1944i + 3708j Find the second derivative of -1973382v*5 + 15v*3 - 166677606v wrt v. -39467640v3 + 90v Find the first derivative of 978444u + 7649430 wrt u. 978444 Find the second derivative of -4349c*4 - 22c3 + c2 - 2c - 1630872 wrt c. -52188c*2 - 132c + 2 Find the third derivative of -29m5 - 989m*4 + 9498203m*2. -1740m*2 - 23736m Find the second derivative of 3g2p*3 - 253g*2p*2 - 425g*2p + 2g2 + 50gp3 - 75042p*2 wrt g. 6p*3 - 506p*2 - 850p + 4 Differentiate 1520y2 + 7602y - 195760134. 3040y + 7602 Find the third derivative of 184348853p*4 - 2p*3 - 2307p*2 + 2069p + 4. 4424372472p - 12 What is the third derivative of ku*3z*2 - 16ku3 - 58ku2z*2 - 7377kuz*2 - 2ku - 2kz2 + 150635u*3z2 - u2z + 5u*2 wrt u? 6kz2 - 96k + 903810z2 What is the first derivative of -14n*3 + 10n*2 - 571n + 15961927? -42n2 + 20n - 571 Find the first derivative of 2779cf*2 + 1248c - 50870531f2 wrt c. 2779f*2 + 1248 What is the third derivative of 5868012z*5 + 9z*3 + 60641278z*2 wrt z? 352080720z*2 + 54 What is the derivative of -933446488j*3 + 517913166? -2800339464j*2 Differentiate 689c*2u - 306cu*2 + 23357271u*2 with respect to c. 1378cu - 306u2 What is the first derivative of n3 + n*2 - 82352807n - 332385364? 3n2 + 2n - 82352807 What is the first derivative of 425389y4 + 52y*2 - 200548639? 1701556y*3 + 104y Find the third derivative of 96666525i3 + 4i*2 - 22859336i. 579999150 What is the second derivative of 2n2p - 9898018n2 - 126n + 634842p wrt n? 4p - 19796036 What is the derivative of 21856495q4 - 1439594? 87425980q*3 What is the third derivative of 35815964l*3 - 43111352l*2? 214895784 What is the derivative of -7748541h*2 - 803467 wrt h? -15497082h Find the third derivative of 8n3r*3 - 125749n*3r - 163n2r*3 + 1363nr + 10r*3 wrt n. 48r*3 - 754494r Find the third derivative of 2j5 + 9515920j*3 + 15744589j*2. 120j*2 + 57095520 Differentiate -3015im3 + 2925942im2z - im2 + 64i - m*3z + m*2 wrt z. 2925942im2 - m3 What is the third derivative of -7g*5 - 1396375g*3 + 94995g*2 - 45? -420g*2 - 8378250 Differentiate 519488963x - 365060693 with respect to x. 519488963 Find the first derivative of -78224896nu + 107571756n + 2u wrt u. -78224896n + 2 What is the third derivative of 6295c*4 + 20c*3 + 17904c*2 + 27c + 1? 151080c + 120 Differentiate 5i*3 - 3858i*2 + 30i + 30341571. 15i2 - 7716i + 30 Find the second derivative of 74l2v*3 - 99681l*2v - 145856673lv*3 wrt l. 148v*3 - 199362v Find the third derivative of -30951n4 + 223n*3 + 745145n*2 + n + 5. -742824n + 1338 Find the first derivative of -5889149d2q*3 + 142978q*3 + 12q wrt d. -11778298dq*3 What is the second derivative of 10f*2hi + 19781f*2hv - 94f*2iv - 168fhiv + 2fhi + 259fhv - 33h*	{ "pile_set_name": "DM Mathematics" }
128152s2/3 - 86880s - 131044/3. -4(s - 181)2(s + 1)2/3 Find t, given that -t4/3 - 86t3/3 - 2284t*2/3 - 6142t - 12321 = 0. -37, -9, -3 Solve t*5 - 89t*4/5 + 387t*3/5 + 81t*2/5 = 0 for t. -1/5, 0, 9 Let 2y*4/3 + 4y*3 - 14y*2/3 - 24y + 24 = 0. Calculate y. -6, -3, 1, 2 Factor 4a4 + 600a*3 + 30000a*2 + 500000a. 4a(a + 50)3 Factor -j4/5 - 3j3/5. -j3(j + 3)/5 Solve 5d3/6 + 170d*2/3 = 0. -68, 0 Let -5f*5 - 25f*4 + 25f*3 + 125f*2 - 200f + 80 = 0. What is f? -4, 1 Find f such that f*5/2 - 25f*4/2 + 69f*3/2 - 67f*2/2 + 11f = 0. 0, 1, 22 Factor -8l3 + 124l*2 - 172l + 56. -4(l - 14)(l - 1)(2l - 1) Solve -k*3/3 + 45k*2 - 1496k - 4624/3 = 0. -1, 68 Solve 3h3 - 882h*2 = 0. 0, 294 Factor -3z*2/5 - 147z/5 + 306/5. -3(z - 2)(z + 51)/5 Find t such that t*2 - 569t + 1698 = 0. 3, 566 Factor 2h4/15 + 4h*3/3 + 24h*2/5 + 36h/5 + 18/5. 2(h + 1)(h + 3)3/15 Solve -h4 - 5h3 - 3h*2 + 9h = 0. -3, 0, 1 Factor -3l3 + 624l*2 + 627l. -3l(l - 209)(l + 1) Factor -3w*2/4 + 357w/2 - 711/4. -3(w - 237)(w - 1)/4 Factor b*2 - 76b + 1444. (b - 38)*2 Determine c so that -2c*4 + 16c*3 - 42c*2 + 36c = 0. 0, 2, 3 Let -4b5 - 686b*4 - 6793b*3/4 - 5587b*2/4 - 1691b/4 - 169/4 = 0. What is b? -169, -1, -1/4 Factor -2f2/5 - 272f/5 - 9248/5. -2(f + 68)2/5 Factor -m3 + 65m*2/9 - 154m/9 + 40/3. -(m - 3)(m - 2)(9m - 20)/9 Factor 5f*5 + 30f*4 - 50f*3 - 80f*2 + 165f - 70. 5(f - 1)3(f + 2)(f + 7) Let j5/5 - 8j*4/5 + 6j*3/5 + 8j*2/5 - 7j/5 = 0. Calculate j. -1, 0, 1, 7 Factor -3g4 - 9g*3 + 12g*2 + 36g. -3g(g - 2)(g + 2)(g + 3) Find q such that -3q2 - 99q - 186 = 0. -31, -2 Determine b so that -b*4 + 35b*3 + 3b*2 - 103b - 70 = 0. -1, 2, 35 Solve p*4/2 + 3p*3/2 - 8p*2 + 6p = 0. -6, 0, 1, 2 Solve -3l4 + 9l*3 + 84l2 = 0 for l. -4, 0, 7 Factor n4/2 + 57n3/2 - 153n*2 + 124n. n(n - 4)(n - 1)(n + 62)/2 Factor p2/6 + 7p/3 - 5/2. (p - 1)(p + 15)/6 Factor k2/8 - 597k/8 + 595/4. (k - 595)(k - 2)/8 Factor -h4/4 - 3h*3 - 11h2/4. -h2(h + 1)(h + 11)/4 Factor -n*2 + 18n - 45. -(n - 15)(n - 3) Determine y, given that -3y*2/5 + 3y + 72/5 = 0. -3, 8 Suppose -8b2/9 - 178b/9 - 44/9 = 0. Calculate b. -22, -1/4 Solve 2s5 + 56s*4 + 480s*3 + 800s*2 - 4000s = 0. -10, 0, 2 Factor -2q4/7 - 4q*3/7 + 6q*2/7 + 8q/7 - 8/7. -2(q - 1)2(q + 2)*2/7 Determine d, given that 10d*5 - 75d*4 - 3235d*3 - 7535d*2 - 1395d + 2990 = 0. -13, -2, -1, 1/2, 23 What is z in 4z3 - 16z*2 + 16z = 0? 0, 2 Solve 2s3 - 12s*2 = 0. 0, 6 Factor -2h*4 - 12h*3 - 16h*2. -2h*2(h + 2)(h + 4) Solve c2/11 - 1126c/11 + 316969/11 = 0. 563 What is v in 4v4/19 - 46v*3/19 + 60v*2/19 + 434v/19 + 196/19 = 0? -2, -1/2, 7 Factor -2y3 - 15826y*2 - 31299870y + 31315698. -2(y - 1)(y + 3957)*2 Determine r so that -31r*2 + 218r - 7 = 0. 1/31, 7 Find k, given that 2k2 - 48k + 126 = 0. 3, 21 Factor -2g3/5 - 88g*2/15 - 56g/15. -2g(g + 14)(3g + 2)/15 Determine x, given that -x*5 - 44x*4 - 526x*3 - 924x*2 - 441x = 0. -21, -1, 0 Suppose -3x3 - 127x*2 - 165x - 41 = 0. What is x? -41, -1, -1/3 Find s, given that -s*2/10 + 39s/10 + 126 = 0. -21, 60 Factor -d*2/4 - 37d/4 - 35/2. -(d + 2)(d + 35)/4 Let -o3/8 + 27o*2/4 - 108o + 432 = 0. What is o? 6, 24 Factor -2r4/17 + 14r*3/17 + 24r*2/17 - 352r/17 + 640/17. -2(r - 4)3(r + 5)/17 Factor -112m5 - 4m*4 + 8m*3. -4m*3(4m - 1)(7m + 2) Factor u3/3 - 24u*2 + 23u + 142/3. (u - 71)(u - 2)(u + 1)/3 Factor -6w2/17 - 8w/17 + 30/17. -2(w + 3)(3w - 5)/17 Factor 2j*3/9 + 3298j*2/9 + 1361248j/9 + 1357952/9. 2(j + 1)(j + 824)2/9 Determine c so that c3/10 - c*2 - 37c/10 - 13/5 = 0. -2, -1, 13 Factor -4p3 + 108p*2 - 780p + 676. -4(p - 13)2(p - 1) Determine x, given that 3x4/2 + 3x*3/2 - 9x2 = 0. -3, 0, 2 Suppose -p2/4 + p/4 + 3 = 0. Calculate p. -3, 4 Factor -2m2/19 - 664m/19 - 55112/19. -2(m + 166)2/19 Determine p so that -5p*2 - 390p + 395 = 0. -79, 1 Let 15v2/4 - 531v/4 + 105/2 = 0. Calculate v. 2/5, 35 Factor -v*3/4 + 5v*2/2 + 9v/4 - 45/2. -(v - 10)(v - 3)(v + 3)/4 Find m such that -4m2/3 + 1256m/3 - 98596/3 = 0. 157 Factor 8c3 - 426c*2 + 1306c - 300. 2(c - 50)(c - 3)(4c - 1) Find d, given that d*4 - 3d3 - d2 + 3d = 0. -1, 0, 1, 3 Factor -4s*3 + 72s*2 + 160s. -4s(s - 20)(s + 2) Suppose q4/5 + 63q*3/5 - 13q*2 - 63q/5 + 64/5 = 0. Calculate q. -64, -1, 1 Factor -3o5/4 - 3o*4/2 + 3o*2/2 + 3o/4. -3o(o - 1)(o + 1)3/4 Suppose 2i*5/3 - 14i*4/3 + 4i*3 + 44i*2/3 - 14i/3 - 10 = 0. Calculate i. -1, 1, 3, 5 Determine o so that o*2/2 + 2003o + 4012009/2 = 0. -2003 Factor 4z4 - 88z*3 + 532z*2 + 192z - 6912. 4(z - 9)(z - 8)*2(z + 3) What is f in f*5/3 - 8f*4/3 + 8f*3 - 32f*2/3 + 16f/3 = 0? 0, 2 Find u, given that -7u5 + 38u*4 - 64u*3 + 42u*2 - 9u = 0. 0, 3/7, 1, 3 Factor -2h2/5 + 314h/5 + 636/5. -2(h - 159)(h + 2)/5 Determine p, given that -2p3/7 - 4p*2/7 - 2p/7 = 0. -1, 0 Factor n*3 + 2n*2 - 29n + 42. (n - 3)(n - 2)(n + 7) Let -5t5 - 20t*4 + 275t*3 + 890t*2 - 3900t - 9000 = 0. Calculate t. -6, -2, 5 Find a such that -a*3 + 10a*2 - 16a = 0. 0, 2, 8 Let -4h3/3 - 232h2/3 = 0. What is h? -58, 0 Factor s3 + 27s2 + 47s - 75. (s - 1)(s + 3)(s + 25) Suppose -45y3 + 25413y*2 + 15282y - 10176 = 0. Calculate y. -1, 2/5, 1696/3 Determine b so that -18b2 + 87b + 273 = 0. -13/6, 7 Factor -2n5 + 4n*4 + 16n*3 + 4n*2 - 14n - 8. -2(n - 4)(n - 1)(n + 1)3 Solve -8z*4 + 404z*3 - 4788z*2 - 7904z - 2704 = 0. -1, -1/2, 26 Suppose 29x3 + 30x*2 + x = 0. Calculate x. -1, -1/29, 0 Let -2u*5/9 - 172u*4/9 - 4868u*3/9 - 43384u*2/9 + 58870u/9 + 97556/9 = 0. What is u? -29, -1, 2 Determine i, given that -2i2/9 - 22i/9 - 4 = 0. -9, -2 Solve -14k5 + 24k*4 + 134k*3 - 216k*2 - 72k = 0. -3, -2/7, 0, 2, 3 Solve z*2/2 + 27z + 693/2 = 0 for z. -33, -21 What is u in -2u2 - 28u + 30 = 0? -15, 1 Factor 3l5 - 78l*4 + 207l*3. 3l*3(l - 23)(l - 3) Find i, given that -2i*5/3 + 42i*4 - 436i*3 + 4388i*2/3 - 1782i + 714 = 0. 1, 3, 7, 51 Let 88c4 - 2c*3 - 264c*2 + 182c - 4 = 0. What is c? -2, 1/44, 1 Factor 2c3 - 154c*2/5 + 12c. 2c(c - 15)(5c - 2)/5 Factor 3t2 + 168t + 2352. 3(t + 28)2 Factor t3/6 - 13t*2/3 + 145t/6 - 38. (t - 19)(t - 4)(t - 3)/6 Determine b, given that 2b3/11 - 54b*2/11 - 116b/11 = 0. -2, 0, 29 Factor 4k5 + 16k*4 - 104k*3 + 176k*2 - 124k + 32. 4(k - 1)4(k + 8) Factor -3a5/8 - 3a*4/8 + 3a*3 + 9a*2/2. -3a*2(a - 3)(a + 2)2/8 Let o2/4 - 607o + 368449 = 0. Calculate o. 1214 Find k, given that -5k4 - 130k*3 - 915k*2 - 1350k = 0. -15, -9, -2, 0 Factor -c*2/3 - 139c/3 + 140/3. -(c - 1)(c + 140)/3 Solve -2n*5/5 - 4n*4/5 + 4n*2/5 + 2n/5 = 0 for n. -1, 0, 1 Suppose -2g2/5 + 16g/5 + 378 = 0. Calculate g. -27, 35 Factor 6p3 - 15p*2 + 6p. 3p(p - 2)(2p - 1) Let 3w5/4 + 3w*4 + 3w*3/4 - 21w*2/2 - 15w - 6 = 0. Calculate w. -2, -1, 2 Factor -7q2/5 - 39q - 782/5. -(q + 23)(7q + 34)/5 Factor -3i5/4 - 3i*4 + 21i*3 - 24i*2. -3i*2(i - 2)*2(i + 8)/4 Let -25w2/4 - 99w/4 + 1 = 0. Calculate w. -4, 1/25 Let 2g2/7 - 12g + 126 = 0. Calculate g. 21 Solve i*5/6 + 85i*4/6 + 83i3/3 - i2/3 - 167i/6 - 83/6 = 0 for i. -83, -1, 1 Factor 2t*4 + 24t*3 + 40t*2. 2t*2(t + 2)(t + 10) Find f such that 2f*3/7 + 22f*2 - 156f/7 = 0. -78, 0, 1 Factor -n*3/7 - 338n*2/7 - 28561n/7. -n(n + 169)2/7 Factor t5 + t4 - 3t*3 - 5t*2 - 2t. t(t - 2)(t + 1)3 Find b such that b5/8 + 17b4/8 + 63b*3/8 - 81b*2/8 = 0. -9, 0, 1 Factor -2y*3 + 4y*2 + 10y - 12. -2(y - 3)(y - 1)(y + 2) Suppose -2l*5 + 12l*4 + 2l*3 - 108l*2 + 144l = 0. Calculate l. -3, 0, 2, 3, 4 Factor -3u2 + 90u - 375. -3(u - 25)(u - 5) Factor x*2/10 - 113x/5 - 423/2. (x - 235)(x + 9)/10 Factor -k3/2 - 341k	{ "pile_set_name": "DM Mathematics" }
2 What is 7748 divided by -56? -1937/14 Divide 62915 by 5. 12583 What is -3737 divided by -37? 101 Calculate -78 divided by 205. -78/205 Divide -5 by 5007. -5/5007 What is -12205 divided by -2441? 5 Calculate -3416862 divided by 2787. -1226 -30122 divided by -2 15061 What is 7140 divided by -1428? -5 Calculate -29988 divided by 357. -84 0 divided by -8636 0 What is 52 divided by -577? -52/577 What is -1574460 divided by -3? 524820 -578268 divided by -4 144567 Divide -9784872 by -6. 1630812 Divide -8834 by -6. 4417/3 Divide -560 by -162. 280/81 Divide 1132123 by 3. 1132123/3 Divide -56 by 40805. -56/40805 Divide -473848 by 4. -118462 902740 divided by 5 180548 Calculate -9294 divided by 3. -3098 Divide 2674467 by 297163. 9 What is -69116 divided by 1? -69116 Calculate 348525 divided by 5. 69705 Calculate 114939 divided by -38313. -3 Divide -4015 by -81. 4015/81 Divide 1752850 by 175285. 10 427683 divided by -2 -427683/2 Divide 0 by -1347480. 0 Divide -25 by 6. -25/6 What is -82091 divided by -3? 82091/3 Calculate 4487431 divided by -13. -345187 Divide -12068 by -4. 3017 Divide 97828 by 2. 48914 Divide -4 by 371565. -4/371565 Divide -10370 by 16. -5185/8 1293200 divided by -1220 -1060 -3643 divided by -380 3643/380 -135498 divided by -5 135498/5 What is -301489 divided by 301489? -1 Calculate 10757 divided by -1. -10757 Calculate 2 divided by -1595. -2/1595 -4 divided by -4905 4/4905 Divide -231290 by 229. -1010 -1007006 divided by -77462 13 What is 1279 divided by -19? -1279/19 Divide 19171 by -4. -19171/4 5000 divided by 2 2500 Divide -6289370 by 5. -1257874 4970966 divided by 26 191191 Calculate -2252 divided by -1997. 2252/1997 65175 divided by -1185 -55 Calculate 964 divided by 37. 964/37 Calculate 593 divided by 491. 593/491 Divide 40830 by 6. 6805 Calculate -53800 divided by 5. -10760 What is 385800 divided by 2? 192900 What is -515717 divided by -27143? 19 Calculate -36061 divided by 25. -36061/25 Calculate 81840 divided by -310. -264 Calculate -2536868 divided by 4. -634217 What is -86076 divided by -27? 3188 Divide -283284 by -6. 47214 45765 divided by 6 15255/2 -15691 divided by -221 71 What is 179910 divided by 5? 35982 Divide -634287 by 37311. -17 Calculate 455755 divided by 8. 455755/8 -2644595 divided by 1319 -2005 Divide 9044 by -76. -119 Divide -455056 by 112. -4063 Divide 273 by -8. -273/8 Divide -82174 by 1. -82174 -566820 divided by -113364 5 4 divided by 10582 2/5291 What is -3035574 divided by 337286? -9 Calculate -68080 divided by -13616. 5 What is 2 divided by 7616? 1/3808 39 divided by 88942 39/88942 Calculate -132294 divided by -17. 7782 What is -66195 divided by 13239? -5 Divide -32650 by 5. -6530 Divide -187 by 112. -187/112 Calculate -259134 divided by -15. 86378/5 Divide 5 by -455304. -5/455304 580669 divided by -17 -34157 Calculate -13908 divided by 732. -19 What is -3 divided by 141834? -1/47278 Calculate 683 divided by 36. 683/36 Divide 596312 by -131. -4552 Calculate -1830640 divided by -20. 91532 What is -3 divided by -8643? 1/2881 What is -22514 divided by 11257? -2 6755 divided by 55 1351/11 1485 divided by -36 -165/4 What is -1748214 divided by 3? -582738 Divide 82 by -64. -41/32 59 divided by -21525 -59/21525 Calculate 2 divided by 10898. 1/5449 168392 divided by 1736 97 Calculate 870 divided by 988. 435/494 -2 divided by 19637 -2/19637 Calculate -760 divided by -804. 190/201 Divide 125568 by -6976. -18 -1049200 divided by -6100 172 What is -50944 divided by 12736? -4 Calculate 600 divided by 2. 300 46098 divided by -7 -46098/7 2314 divided by 5 2314/5 Calculate 185 divided by -901. -185/901 What is -106563 divided by -2? 106563/2 -1 divided by 5969 -1/5969 Calculate 5945 divided by 404. 5945/404 Calculate 4 divided by 613537. 4/613537 Divide 166 by -15. -166/15 Divide 2 by 11001. 2/11001 What is 13222 divided by 6? 6611/3 Divide -810 by -28. 405/14 Calculate 2 divided by 8472. 1/4236 Divide 602826 by 301413. 2 -2861076 divided by -715269 4 Divide -64848 by -4053. 16 What is 47 divided by 394? 47/394 What is 27018 divided by 1? 27018 4018 divided by -90 -2009/45 Divide 1416261 by 472087. 3 Divide 0 by 331932. 0 Calculate 1 divided by -23995. -1/23995 Divide -2 by 25458. -1/12729 What is 5537 divided by 5537? 1 Divide -3193680 by 6. -532280 -29360 divided by 5872 -5 Divide 4220055 by 281337. 15 -3054 divided by 223 -3054/223 Calculate 2 divided by 357. 2/357 Calculate -1782846 divided by 1. -1782846 What is 731712 divided by 6? 121952 1 divided by -9884 -1/9884 Calculate 1919972 divided by -2. -959986 Divide -20955 by 11. -1905 19438 divided by 9719 2 7364 divided by 7 1052 Divide -25907 by -3701. 7 Divide -4184 by -11. 4184/11 What is 702 divided by 18? 39 -158 divided by -3 158/3 Calculate 498165 divided by -99633. -5 Calculate -54040 divided by -4. 13510 Calculate 5312 divided by 191. 5312/191 What is -33 divided by 8541? -11/2847 1084212 divided by -271053 -4 Divide 64833 by -64833. -1 Divide -11 by -1100. 1/100 Calculate -61607 divided by 4739. -13 Calculate 306936 divided by 1218. 252 Divide 14031 by -9. -1559 What is -11 divided by 3519? -11/3519 -6591 divided by 63 -2197/21 Calculate -175676 divided by 2. -87838 -55 divided by -78 55/78 Calculate -626274 divided by -2. 313137 What is -443955 divided by 147985? -3 What is -10 divided by 25689? -10/25689 Divide 38255 by -35. -1093 -487200 divided by 464 -1050 Calculate -2530073 divided by -1. 2530073 What is 3130 divided by 79? 3130/79 Calculate -384468 divided by 21. -18308 Divide 2 by -91514. -1/45757 Calculate 14 divided by -18. -7/9 What is -324 divided by 118? -162/59 What is 1 divided by -262833? -1/262833 Calculate -180 divided by 13548. -15/1129 -952560 divided by -315 3024 Divide -4 by -1227. 4/1227 Divide 578760 by -280. -2067 Divide -26456 by 26456. -1 Divide -2 by -17396. 1/8698 What is -155104 divided by -19388? 8 -32040 divided by -24 1335 Divide -1751463 by -583821. 3 Divide 469846 by 234923. 2 What is 51944 divided by 25972? 2 Divide 150368 by 18796. 8 What is 326176 divided by -163088? -2 -1352401 divided by -1007 1343 Calculate -93543 divided by -5. 93543/5 314048 divided by -4907 -64 4 divided by -19825 -4/19825 Divide -315435 by -2. 315435/2 -15997 divided by 7 -15997/7 1912320 divided by 5 382464 What is -89870 divided by -5? 17974 -90 divided by -98 45/49 Calculate 28 divided by -1679. -28/1679 266160 divided by 11090 24 Divide 1349 by -622. -1349/622 Calculate 41021 divided by 127. 323 What is -3662012 divided by 2? -1831006 Divide 1141320 by -6. -190220 Divide -136 by 4. -34 What is -59892 divided by -322? 186 What is -17013 divided by 3? -5671 -6424659 divided by -2829 2271 Calculate -3165 divided by 3165. -1 Divide 84512 by -139. -608 Divide -257 by -2330. 257/2330 Divide -4889535 by 5. -977907 What is 2 divided by 3189? 2/3189 Divide -995420 by 199084. -5 -62384 divided by 1 -62384 What is -95206 divided by 263? -362 21501 divided by 7167 3 Calculate 54850 divided by 10970. 5 Calculate 48488 divided by -1102. -44 Divide 197780 by 62. 3190 Calculate -3 divided by 52452. -1/17484 Divide 120 by 1395. 8/93 What is -245280 divided by -80? 3066 Divide -985743 by 36509. -27 Calculate -94 divided by 272. -47/136 -1443 divided by -3 481 Calculate -1 divided by 11473. -1/11473 Divide -10737 by 1193. -9 Divide -14703 by 2. -14703/2 What is 937278 divided by -17? -55134 Calculate -4398746 divided by 11. -399886 Calculate -498498 divided by 6. -83083 111800 divided by -111800 -1 What is -2 divided by 126041? -2/126041 Divide 35 by -637. -5/91 -3 divided by -193715 3/193715 Calculate -107 divided by -95. 107/95 -726340 divided by 20 -36317 -713 divided by -10 713/10 Divide 1647 by 110. 1647/110 5 divided by 29370 1/5874 What is -2 divided by -48267? 2/48267 What is -157165 divided by 85? -1849 -32 divided by -2690 16/1345 Divide 256 by 8. 32 What is -22837 divided by -5? 22837/5 Calculate 36334 divided by 1. 36334 Calculate 147 divided by -29. -147/29 Divide 2138899 by 49. 43651 What is -176504 divided by -44126? 4 Calculate 0 divided by 49842. 0 Calculate -9 divided by 59828. -9/59828 What is -234970 divided by -4? 117485/2 Divide -5598 by 19. -5598/19 What is -41220 divided by -4122? 10 Calculate 3324074 divided by -2. -1662037 Divi	{ "pile_set_name": "DM Mathematics" }
+ 2i2 + i2)(-3i - i2 + 3i). 62i4 Expand (3 - 2m - m - 2)(-m2 - 3m*2 + 3m*2). 3m3 - m2 Expand -2v5 + 5v*5 - 4v*5 + (3 - v - 3)(-5v4 + 5 - 5). 4v*5 Expand -2o2 + o2 + 2o2 + (-o2 + 2o*2 + 0o*2)(1 - 1 - 2) + (2o2 - o + o)(-2 + 0 - 3). -11o2 Expand (0n4 + n4 + 2n4 + (-5n + n + n)(n3 - 4n3 + n3))(-n + 0n + 0n). -9n*5 Expand 5i - 3i + 0i + (3i - i + 0i)(3 + 2 - 4) + 2i - 2 + 2 + (2i - i + i)(16 + 13 - 8) + (3 - 3 - 2)(i + 4 - 4). 46i Expand (-5i3 + 3i*3 + 4i*3)(-i + 5i - 3i)(2i + 1 - 1 + (0 + i + 0)(1 + 0 + 2)). 10i*5 Expand 3 - 2s - 3 + (-2 + 0 + 0)(0s - 2s + 0s). 2s Expand -v3 + 3v*2 - 3v*2 + (-4v*2 + 6v2 - v2)(3v - v - 4v). -3v*3 Expand 15i*2 - 15i2 + i3 + (-i2 - i2 + 3i2)(-3 + 2i + 3). 3i*3 Expand (1 - 6 + 2f - f)(-3f*4 + 3f4 - f4). -f*5 + 5f*4 Expand (195a - 195a + 7a*3)(-2a + a - a) + 0a*4 + 3a4 - a4. -12a4 Expand (-b3 + 0b*3 + 0b*3)(-2b + 0 + 0) + 2b - 1 + 3b4 + 14b*4 - 10b*4. 9b*4 + 2b - 1 Expand -u*3 + u - u + (-2u*2 + 4 - 4)(-6u + 6u + 20u). -41u*3 Expand -3a*4 + 2a4 - a4 + (a*3 - 3 + 3)(-3a - a + 2a) + (-a - 2a + a)(-3 + 2 - 2)(3a3 + a3 - 5a3). -10a*4 Expand (10 + 23 - 54)(-2k3 + 3k*3 - 3k*3). 42k*3 Expand ((-3 - 1 + 2)(-4 + 4 - 2y) - 4y + 3y + 3y)(5y - 5 + 4 - 6y). -6y*2 - 6y Expand -4w5 + 3w*5 + 6w*5 - 101w*2 + 101w*2 - 15w*5 + (-2w + 3w + w)(0w4 + 2w4 - w4). -8w5 Expand (-p3 + 5p*3 + 2p*3)(-1657 + 10p + 1657). 60p*4 Expand -3q - q + 5q + q + 0q + 0q + (-2 + 4 - 1)(-3 + 3 + 2q) + (4q - 5q + 3q)(4 - 11 - 5). -20q Expand (-3 + 0 + 6)(-20u*2 + 15u - 15u). -60u*2 Expand -4l*4 + 21l*4 - 2l*4 - 3l*4 + 3l*4 - 3l4 + (0 + l3 + 0)(-3l + l + 0l) - 2l*2 + 2l2 + l4 - 5l4 + 0l*4 + 3l*4. 9l4 Expand ((-c3 + 0c3 - c3)(0 + 1 + 1) + 6c3 - 3c*3 - 4c*3 + 0c*3 + 2c3 - c3)(4 - 4 - 2c*2 + (c - 4c + 5c)(-c + 2c + c)). -8c*5 Expand (2u - 3u + 0u)((5 - 2 - 1)(3u2 + u2 - 2u*2) + 3u2 - u2 - 4u2 + 7u2 - u2 - 3u2). -5u*3 Expand (3a - 3a + a)(2a3 - 36 + 36). 2a*4 Expand ((3b*2 - 5b*2 + 4b*2)(-b + 2b - 2b) - b2 + b2 + 2b3 + (-b2 + 3b - 3b)(-4b + b + 4b))(3b - b - 3b). b4 Expand (4q4 + q4 - 4q4)(3q - 12q + 2q) + (-4q + q + q)(-2q + 2q + 2q*4). -11q*5 Expand (4m - 5m + 0m)(0m - m - 5m)(m*2 - 2m*2 + 3m*2). 12m*4 Expand (-2q + 0q + 0q)(q2 - 2q + 2q)(-200q - 152q + 290q). 124q*4 Expand (-3 - 1 + 5)(-11p - 26 + 8p + p). -2p - 26 Expand (-7v2 + v2 - 4v2)(-1 + 1 - 1 + (-1 - 2 + 2)(0 + 0 + 1)). 20v*2 Expand (-5i - 9 + 9)(i + 0i + 0i)(0 + 1 + 4). -25i2 Expand (6h - 13h - 10h)(h - 3h - h). 51h2 Expand (4a*2 - 5a*2 + 3a*2 + 0a2 + a2 - 4a2 + (2 + 1 - 2)(-1 + 1 - a*2))(4 + 3 - 5). -4a2 Expand 3l*3 + 2l*3 - 3l*3 + (10l*2 - 2l*2 + 0l*2)(7l - 3l - 2l + (4l - 6l + 3l)(2 + 3 - 3)). 34l*3 Expand -4j + 3j - j + (j + 0j + 0j)(1 + 0 + 0) + j + 0j - 3j. -3j Expand 8g - 8g - 4g4 - 1 + 1 - g4 - 4g3 - 3g*4 + 4g3 + (g2 - g*2 - 2g*2)(g*2 - 2g + 2g). -10g*4 Expand (-n + 5n - 3n)(2 + 3n2 - n2 + n2). 3n*3 + 2n Expand (2s - 2s - 13s)(0 + 0 - 2s2)(-3s - 2s*2 + 3s). -52s5 Expand (u + 3 - 3)(2 - 7 + 3) + 2 - u + 0u - u. -4u + 2 Expand 21 - 17k5 - 21 + (-k3 + k3 + 2k*3)(2k2 - 4k*2 + 0k*2) + 0k*4 - 2k*5 + 0k*4 - 5k*5 + 4k5 - k5. -25k5 Expand (5n - 2n - n)(-3 + 6 - 1) + 2n - 4n + n - n - 1 + 1 + (1 - 1 + 2n)(1 + 6 - 1) - 4 + n + 4. 15n Expand (-1 - 2o*2 + 1)(-2 + 1 + 6)(5o - 2o - 4o). 10o3 Expand 7n5 - n5 - 2n5 + (0 - 3 + 1)(2n5 - 2n5 - n5) - 3n5 + 2n*5 + 3n*5. 8n*5 Expand (-102l + 102l - 10l*3)(6 - 3 - 1) - l*3 + 5l - 5l. -21l*3 Expand (2 + 3k*2 - 2)((-4 + 5 - 3)(-3 - 3k + 3) - 1 + 2k + 3k - 3k) + 3k*3 + 2k*3 - 4k*3. 25k*3 - 3k*2 Expand 0n5 + n5 - 3n5 + (-3 + 4 + 4)(3n5 - 2n*5 - 2n*5). -7n*5 Expand 5p*5 - 5p5 - p5 + (-p*3 - 8p*3 + 2p*3)(-p*2 - 5p*2 + 5p*2). 6p*5 Expand (-2v*2 - 3v + 3v)(2 - 1 + 1)(-v2 + 8v*2 + 6v*2). -52v*4 Expand 0x2 + x2 - 4x2 + 1 + (-13 - 5x*2 + 13)(1 - 2 + 3). -13x2 + 1 Expand (-16f*4 + 0f4 - f4)(-1 - f + 1). 17f*5 Expand (0o*4 - 2o*4 + 2o + 0o)(-1 + 2 - 3)(-4 + 2 + 5). 12o*4 - 12o Expand (-1 + 1 - 2s3)(2s - 5s + 2s)(0 - 2 - 3). -10s4 Expand (2 + 2b - 2)(-5 + 12 + 4). 22b Expand 4o4 + o4 - 3o*4 + (2o*4 - 1 + 1)(-1 + 1 + 2)(10 - 2 + 11). 78o*4 Expand ((1 - 2 + 3)(-4h + 3h - h) + 0h + 4h - 2h)(-7 - 6 - 6). 38h Expand (-g2 - 3g*2 + 2g*2)(170g - 308g + 66g). 144g*3 Expand (3s*3 - 3s*2 + 3s*2)(-s + 0 + 3 - 4). -3s4 - 3s3 Expand (-w2 + 0w2 + 0w*2)(w + 2w - w + (-3 + 2 - 1)(-5w + 2w + 4w) + w + 0 + 0 + 3w + 2w - 4w). -2w3 Expand 37d*3 + 9d3 - d3 - 6d3 + (-2d - 1 + 1)(-4d*2 + 2d*2 + 4d*2) + 3d*3 + 0d3 - d3 - 2d3 - d3 + d3 + 0d*3 + 0d3 - d3. 34d3 Expand (1 - 3 + 3)(-2j5 + 3 - 3) + (0j - 4j + 3j)(-2j + 2j - j4) + 2j*5 - 4j*5 + 3j5 + j5 + 4j3 - 4j3 - j5 - 4j5 + 3j5. -j5 Expand n*4 + 0n*4 + 3n*5 - 2n*5 + (-3n + 3n - 3n)(1175n*3 + 4n2 + n4 - 1175n3). -2n5 + n4 - 12n3 Expand (-60q*2 - 8q*4 + 60q*2)(1 + 3 - 2). -16q4 Expand (-7 + 3 - 8)(0g - 2g + g)(2 - 1 + 0). 12g Expand (-4i3 + 2i*3 + 4i*3)(-i*2 + 0i + 0i)(2 + 0 - 3)(1 + 7 + 1). 18i*5 Expand (v - v + 7v)(-3 + 9 - 3)(3 - 2 + 0). 21v Expand (1 - 6 - 1)(4m - 2m - 4m). 12m Expand (-2r2 - 7r - r*2 + 6r)(1 - 1 + 2r) - 21r - r3 + 21r. -7r3 - 2r*2 Expand (4m - m - m)(-4m*2 + 4m*2 - 2m*2) + 3m*2 - 3m*2 + 6m*3. 2m*3 Expand (-6h - 20 + 20 + (0h - h + 3h)(2 - 4 + 3))(0 - h*3 + 0). 4h*4 Expand (2 - 2 - 5k)(46 + 7k*2 - 46). -35k*3 Expand (0 + 1 + 0)(-2 + 3 - 3)(4l - 6l + l). 2l Expand (-4f + 0f + 3f)(-13f3 + f3 + 31f3 + (1 - 1 - f3)(2 + 0 - 1)) - f4 + 3f*4 - 4f*4. -20f*4 Expand 0l + 0l + 2l + (-4 - 3 + 6)(-3l + 4l + 0l). l Expand (-2n + 7n - 3n + (-3 + 3 - 2n)(1 + 0 + 1))(2 + 2 + 0 - 1 - 7 + 2 + (3 - 3 + 1)(1 + 3 - 2) - 5 + 2 + 2). 2n Expand 2k2 - k3 - 2k*2 + (-2k2 + k2 + 2k2)(-4k - 2k + 7k) - k2 + k2 - 2k*3 + 2k*3 - 4k*3 + 5k3. k3 Expand (-3 + 3 + 1)(-3w + 4w + w) - 3w - 2w + 2w + (0 - 3 + 1)(-3 + 3 + 2w) + 0w - w + 3w. -3w Expand (4z*3 - 5z*3 + 3z*3)(0z - 6z + 2z) - 2z*4 - 2z*3 + 5z*3 + 4z*4. -6z*4 + 3z3 Expand (u2 + 4u2 - u - 6u*2)(0 + 0 - 2u3). 2u*5 + 2u*4 Expand (-31j*4 + 18j*4 - 84j*4 + 4j*4)(2j + 0j - 4j). 186j*5 Expand (-8l - 2l2 - 8l*2 + 12l*2)(0l + 5l - 4l). 2l*3 - 8l*2 Expand (5 - 3 + 0)(0d + 0d - d)((1 + 3 - 2)(-3 + 2 + 2) + 5 - 3 - 5). 2d Expand (2 - 2 + 3)(-4 + 3 - 13q + 11q). -6q - 3 Expand (q2 + 0q2 + q2)((3q*3 - 2q*3 + 0q*3)(2 - 3 + 3) - 3 + 3 + q*3). 6q*5 Expand (51n - 21n + 42n)(1 - 1 + n). 72n*2 Expand -7532 + 151w*3 + 7532 - 2w*3 + 3w*3 + 0w*3 + (2w + 1 - 1)(w2 - w2 - 2w*2) + 2 - 2w*3 - 2. 146w*3 Expand -5u*2 - 38u + 3u2 + 39u + 3u2 - u2 - 3u*2 + 0 + 2u*2 + 0 + (-2 + 3 + 0)(5u2 - 5u*2 + 2u2) + u2 + 2u - 2u. 2u2 + u Expand (0q + 2q - q)(-4 - q + 4)(32q - 39 + 39). -32q3 Expand (4j - 3j + 4j)(-2j*2 - 2j*2 + 7j*2). 15j*3 Expand (-w + w - 2w)(0 + 0 + 3) - 6w + 6w + 12w. 6w Expand -2h*2 - 5 - 12 + 6 + (-h + 0 + 0)(h + 0h + 0h) - 2h2 + 4h*2 + 0h2. -h2 - 11 Expand -51 + 51 - y - 6y + 2y + 2y + (1 + 1 - 1)(-2y - 2y + 2y). -5y Expand (2f - 1 + 1)(2 + 2f - 2)(2 - 1 + 0). 4f2 Expand (-3 + 3 - 4)(-6l + l + 2l)(5 + 0 - 4). 12l Expand p3 + 2 - 2 + (p2 + 2p - 2p)(-4 + 4 - 2p)	{ "pile_set_name": "DM Mathematics" }
/(v/(v*(-2/51)v)))/(vvv/(v/(v/(v/((v/(vv/(v/v8)))/vv)v))))32 assuming v is positive. v(57569/255) Simplify ((u10)35)(1/16) assuming u is positive. u(175/8) Simplify ((ff*(-9))/(f(f(-17)/f)/f))/(f(-2/17)/f(-24)) assuming f is positive. f(-236/17) Simplify w/w*9w/w*(1/3)www*(-37)/ww(-6)/w assuming w is positive. w(-151/3) Simplify ((h*(-6)h(hh/(hh1))/h)/((h(-2/9)h)/(hhh(1/4))))38 assuming h is positive. h(-3097/18) Simplify (l(-6)/l)*(45/2)/((l(l/(l/(l/(ll/((ll*(1/4))/l))l)))/l)/l)(-18) assuming l is positive. l(-171) Simplify (f*(-14)(f/f5)/f)/(f(-23/5)f(-31)f) assuming f is positive. f*(78/5) Simplify (f/(ff/f*(-1)ff)f/(f25/f))7 assuming f is positive. f(-189) Simplify j(-7/3)/j*(1/44)(j/(j(j/(jj*(-23)/j))/j))/jj16 assuming j is positive. j(-1367/132) Simplify (((u/u1)/u)13/(u(-2/11))21)(-1) assuming u is positive. u(101/11) Simplify (f(-1))(-11/2)/(f(9/4)/(f/(f(3/10)f))) assuming f is positive. f(59/20) Simplify ((o/(o(-6)o))(-15/8))(-1/32) assuming o is positive. o(45/128) Simplify ((i/i(7/3))/ii(-12))/(ii*(-12)ii(11/4)) assuming i is positive. i(-85/12) Simplify (((mm7)/m)/m)(-30)m/(mm*(-2/21))m(-1/2)/m assuming m is positive. m(-7619/42) Simplify (r*(1/3)rr(-5/4)r)/(rr/r(-15)r*32r) assuming r is positive. r*(-587/12) Simplify ((mm(-3))/m)(-41)m/(m/(m7/m))m/(m/(m/m(-11))) assuming m is positive. m141 Simplify y10/(y/(y(-6/13)/y))(y/(y(-6/13)y)y)/y(6/11) assuming y is positive. y(93/11) Simplify ((l(-2/7)/l(-1/5))/((l/(l3l)l)/l1))(11/4) assuming l is positive. l(561/70) Simplify (((d/((dd4)/d))/(d(-1/4)d))/(d0)(-14))37 assuming d is positive. d(-555/4) Simplify ((k(2/7)kk/k(-1/5))/(k(-2/7)kk)49)(-41) assuming k is positive. k(116973/35) Simplify a(-3/4)a*(-9)(aa(-1/8)a)/(aa/(aa*5)aa) assuming a is positive. a(-47/8) Simplify ((jj/(j(jjj(3/5)/jjj)/jj))/((j/(jj(5/7)))/j))/(j/(j(4/7)/j))(-1/7) assuming j is positive. j(-167/245) Simplify ((c/c(-25)cc/((cc*(-2/35)/cc)/c))(6/25))(-39) assuming c is positive. c(-229788/875) Simplify (x/x(1/6))*(1/11)(x/(x/(x/((x/((x/(xx/x7))/x)x)/x))))(-5/8) assuming x is positive. x(-805/264) Simplify s*(-5)s*(-1/14)s*4/(s(ss/(s/((s/s10)/s)))/s) assuming s is positive. s(111/14) Simplify (c/(cc*(-6/7)cc))/c(-2/11)((c*(4/3)/cc)/c)(2/45) assuming c is positive. c(-9836/10395) Simplify (((v(-4))26)0)34 assuming v is positive. 1 Simplify ((y/(y(-2/7)/y))/y)25(y(1/2))(-1/11) assuming y is positive. y(4943/154) Simplify ((n12/n)/n(-25))/(((n(1/2)/n)/n)/((n(nn/(n(-1)n))/n)/nn)) assuming n is positive. n(79/2) Simplify g(2/9)/(g(-3/8)/g)(g1)(-2/7) assuming g is positive. g*(661/504) Simplify (ll(-15/8))32/(((l/l(-2/39))/l)/l(-4/15)) assuming l is positive. l(-5522/195) Simplify (d(5/8)/ddddd(-2/39))(-12/7) assuming d is positive. d(-803/182) Simplify (f(-1/11)fff(-4/11)ff)/(f18ff/f16f) assuming f is positive. f(-16/11) Simplify (f/f0)*(-2/163)/(ff(-10))(3/2) assuming f is positive. f(4397/326) Simplify (d(-1/5))(-1)/((d/d2)/d)33 assuming d is positive. d(331/5) Simplify ((jj(14/3))/jj(-1/5))(-50) assuming j is positive. j(-670/3) Simplify (c6/((cc(8/5))/cc)c(1/3)/c3)(3/17) assuming c is positive. c(11/85) Simplify (i0)(-2/3)/(i7i/i0) assuming i is positive. i(-8) Simplify o*(-34)o*(-2/63)((((o(o/o(-18))/oo)/o)/o)/o)36 assuming o is positive. o(36412/63) Simplify ((((u*27u)/uu)/uu)/((uu(-4))/u))/(u/(u(-10)u)u12/u) assuming u is positive. u11 Simplify (((n/n6)/n)/nn/(nnnnn*(1/12))n)/(n(n/(nn/(n*1/n)))/nn/(n/(n*(1/4)n))) assuming n is positive. n(-28/3) Simplify q10/(q/q*(-3/11))((q(-3)/q)/q)(-2/83) assuming q is positive. q(8078/913) Simplify (m(-19)m)/(m/(mm*(1/30)mm)m)(mm*26/mm)(-7) assuming m is positive. m(-6179/30) Simplify (y/((yy(1/4)/yy)/y))(16/3)/(y(-24))33 assuming y is positive. y796 Simplify y*(-15/7)y/(yy21)y/y*(-4)y/(y(1/6)/y) assuming y is positive. y(-685/42) Simplify n*(-7/4)nn/(n/(n/n(1/17)))(n/n34)/n(-3/4) assuming n is positive. n(-545/17) Simplify (((i/i(-1/3))(-24/11))7)(-1/4) assuming i is positive. i(56/11) Simplify ((m((mm(m(3/7)m)/m)/m)/mm)/mmmmm(5/2))/(m(-4)mmm9) assuming m is positive. m(-1/14) Simplify (((s(-6)/s)/s)/s(-6))/(s*(1/2)/(((s/(s/(s/(s/(s/(s/(sss(-2/13)))ss)))))/s)/s)) assuming s is positive. s(-17/26) Simplify ((s(-1/3))20((((ss(-10/9))/s)/s)/s)/s(1/3))(36/5) assuming s is positive. s(-364/5) Simplify (iii(1/3)i)*(2/5)/((ii(i(2/7)/i)/i)/i)(-1/62) assuming i is positive. i(1721/1302) Simplify (d(d/((d(d/(d(3/8)/dd))/dddd)/d))/dd)/dd(2/5)/d(dd0d)/(dd13) assuming d is positive. d(-569/40) Simplify ((uu(-6/11))/(u/(u(-17)/u)))/((u/((uu5)/u)u)/(u(u(-13)/u)/u)) assuming u is positive. u(-325/11) Simplify (c(-7/6)c(3/4))/(c/(c(-11)c))(-12/7) assuming c is positive. c(1549/84) Simplify i(2/5)/(i/(ii/(i*(5/2)i)))(i/((i/(i/i2))/ii))(-18) assuming i is positive. i(159/10) Simplify (i2)11/((i(i(-2/9)ii)/ii)/(ii/(iii(2/25)i))) assuming i is positive. i(4082/225) Simplify ((t(3/7)/t)/t)/(t/t*(-14))tt/(t/t(4/5))tt(-6/7) assuming t is positive. t(-512/35) Simplify (b(-14)/bb0)/(b/((b(1/6)/b)/b)b(4/11)b) assuming b is positive. b(-1267/66) Simplify (((x/(x11x))/x)(22/9))(6/7) assuming x is positive. x(-176/7) Simplify (((j(-7)/j)(11/4))(1/2))(5/7) assuming j is positive. j(-55/7) Simplify ((j(-1)/(j(-9)/j))/((j/(j/j(-10)j))/(jjj*1jj)))34 assuming j is positive. j850 Simplify (r(-2/9)/r)(-29)r/(r*(-13)/r)rr11rr assuming r is positive. r(580/9) Simplify q(-8)(q/((((q/q*(-3/13))/q)/q)/q))/q(q/(qq(1/3)q))(-1/69) assuming q is positive. q(-16715/2691) Simplify ((o(1/7)/o)/((o/o(-1/16))/o))/(o*(-1/7)oo)(-1/18) assuming o is positive. o(-823/1008) Simplify z(-2/5)z*(3/4)z(-2/117)/z(-5/6) assuming z is positive. z(2729/2340) Simplify s(-2/51)s/s(-6)s(ss*6ss)/s(-1/6) assuming s is positive. s(1747/102) Simplify (l4/(((ll/(ll(3/5)l)l)/l)/l))/(l6)(1/51) assuming l is positive. l(466/85) Simplify ((b/b(-4))/((b/(bb(-6)))/b))(4/5) assuming b is positive. 1 Simplify s*(-13)/(sss(-15))((s/(s*(1/4)ss))/s)22 assuming s is positive. s(-99/2) Simplify (l/l(1/4))/(l/(l/l(-4)))l*(-3/2)lll(4/9)/l assuming l is positive. l(169/36) Simplify (s*(-18)s(2/43))/(s(3/2)sss)(-26) assuming s is positive. s(4259/43) Simplify ((h14/hh)/h)/(h/(hhh*12))(h/h(-2/9))(-34/7) assuming h is positive. h(1264/63) Simplify (x(-1/12)x)/((xx*(-1/21)x)/x)(x(x/x*30)/x)/(xx/(x(x/(x11/x))/x)) assuming x is positive. x(-1121/28) Simplify d(-11)d/d*(-19/2)(dd(5/9))(-28) assuming d is positive. d(-793/18) Simplify (((l(1/2)/l)/(ll/l(-2/7)))46)29 assuming l is positive. l(-26013/7) Simplify y14/y(-5)y7y(13/3) assuming y is positive. y(91/3) Simplify ((c*(2/15)/ccccc(-2/15)/c)/(c/c(2/5))(2/85))(4/29) assuming c is positive. c(1676/12325) Simplify (c(2/49)ccc/c*24)/(cc/(c*(-1/9)c)ccc(5/7)) assuming c is positive. c(-10930/441) Simplify (x9x*(-12))/(xx*(-13)xxxx(-4)x) assuming x is positive. x9 Simplify (w12)16/(w/w0)(12/11) assuming w is positive. w(2100/11) Simplify ((z*(-1/5)/(z/(zzz(-6)z)z))(-15))(10/3) assuming z is positive. z260 Simplify h/(hh*(-14/5)/h)(h*(-3/10)hh)/h(hh/(h/h(2/7)))46 assuming h is positive. h(891/14) Simplify (r(-4/13)rr14)/((r/(rrrr/(r/(r/(r/(r(r/(((((r/(r3r))/r)/r)/r)/r))/r)r)))rr))/(r/(r(28/9)/r)r)) assuming r is positive. r(2993/117) Simplify ((s(8/9)/(s/(s*	{ "pile_set_name": "DM Mathematics" }
et p = -29/2 - b. Factor 1/2o - 1 + po*2. (o + 1)(3o - 2)/2 Suppose 4b + y + 2 = 0, 2b + 5y - 5 = 3. Let s(a) = -9a2 + a - 1. Let t(h) = h2 + h + 1. Let p(c) = bt(c) - s(c). Factor p(j). 2j(4j - 1) Let z = -88 - -793/9. Let m(t) be the first derivative of 1/12t*4 + 1/15t*5 + 2 - 1/6t*2 + 0t - zt3. Let m(i) = 0. What is i? -1, 0, 1 Let n(j) be the second derivative of j5/180 - j4/54 - j3/18 + 13j. What is h in n(h) = 0? -1, 0, 3 Let g(h) = 7h2 + 5h. Let m = -3 + 8. Let o(n) = 11n2 + 8n. Let b(d) = mo(d) - 8g(d). Find p, given that b(p) = 0. 0 Factor 52v2 + 3v*4 + 9 - 22v*3 - 48v + 6v - 1 + 1. (v - 3)2(v - 1)(3v - 1) Let k(h) be the second derivative of -1/60h5 - 3/2h*2 - 1/120h*6 + 1/6h*3 + h + 1/24h*4 + 0. Let f(m) be the first derivative of k(m). Factor f(v). -(v - 1)(v + 1)*2 Suppose 0 = -0r + r - 8. Let b be (-7 - -2)r/(-10). Factor 2/3p - 2pb - 2/3p*2 + 0 - 10/3p*3. -2p(p + 1)2(3p - 1)/3 Let v be 14/4 - 11/22. Factor 0 + 2/3h*4 - 2/3h - 2hv + 2h*2. 2h(h - 1)3/3 Suppose 4d = -2l + 2d + 6, 3d - 3 = -l. Let u(s) = -3s*2 - 12s - 3. Let b(f) = f - 1. Let z(a) = lb(a) + u(a). Suppose z(m) = 0. Calculate m. -2, -1 Let b = -20 - -28. Suppose u = bu - 14. Factor -2/11z + 2/11z*3 + 2/11 - 2/11z*u. 2(z - 1)*2(z + 1)/11 Let v be (-1)/(-18)(-6)/(-4). Let d(p) be the second derivative of vp*2 + 0 + 1/24p*4 + 3p + 1/12p3 + 1/120p5. Factor d(r). (r + 1)3/6 Let s be (6/4)/((-15)/(-40)). Suppose sp - 5p + 2 = 0. Solve 0 + 1/2np + 0n = 0 for n. 0 Let z = 54 + -50. Let m(j) be the first derivative of -4 + 2jz - 8/3j*3 + 0j + j*2. What is y in m(y) = 0? 0, 1/2 Let g(v) = 9v*2 - 29v + 3. Let q(p) = -17p2 + 57p - 7. Let n(t) = 7g(t) + 3q(t). Suppose n(d) = 0. What is d? 0, 8/3 Let -2/5 + 4/5y - 2/5y2 = 0. What is y? 1 Let z(o) be the third derivative of o7/175 - 11o6/300 + 2o5/25 - o4/15 - 9o2. Suppose z(k) = 0. Calculate k. 0, 2/3, 1, 2 Let p(z) be the second derivative of 0z*3 - z + 1/48z*4 + 0 + 0z*2. Determine x, given that p(x) = 0. 0 Let y = -114 + 572/5. Find v, given that 8/5v*3 - y - 6/5v + 0v2 = 0. -1/2, 1 Suppose 4l - j = 15, 9 + 6 = l - 4j. Factor -10k - 3 + l + 9k2 + 4 - 3k*2. 2(k - 1)(3k - 2) Let o be (1/5)/(12/(-636)). Let a = o + 11. Solve -al + 4/5 - 2/5l*2 = 0 for l. -2, 1 Let x(y) be the first derivative of -2/15y*3 + 1 - 1/5y*2 + 2/5y + 1/10y4. Factor x(q). 2(q - 1)*2(q + 1)/5 Let j(k) be the second derivative of -4k6/15 + 2k5/5 - k4/6 + 3k. Let j(t) = 0. What is t? 0, 1/2 Let w(n) be the second derivative of -5n7/42 + n6/6 + n*5/4 - 5n*4/12 + 44n. Factor w(g). -5g2(g - 1)*2(g + 1) What is t in 0 - 8/5t + 2/5t*2 - 4/5t*5 + 2t*4 + 24/5t*3 = 0? -1, 0, 1/2, 4 Let d(u) be the third derivative of 3u*2 - 1/30u*5 + 1/3u*4 - 4/3u*3 + 0 + 0u. Factor d(m). -2(m - 2)2 Let m(c) be the second derivative of -c7/105 - c6/75 + c5/50 + c4/30 - 24c. Factor m(t). -2t2(t - 1)(t + 1)2/5 Let n = 67/84 + -5/7. Let y(l) be the second derivative of -1/30l*6 + 0 + 1/3l*2 - 1/6l*3 - nl*4 + 2l + 7/60l5. Suppose y(r) = 0. What is r? -2/3, 1 Factor 0 + 0k*2 + 8/7k*4 + 4/7k*3 + 0k. 4k3(2k + 1)/7 Solve 0 - 2n*3 - 2/3n*4 + 0n - 4/3n2 = 0 for n. -2, -1, 0 Let g(d) be the second derivative of 5d*4/12 + 5d*3/3 + 5d*2/2 - d. Suppose g(u) = 0. Calculate u. -1 Suppose 0 = h - 2h + 4. Let r(n) be the third derivative of 2/3n3 + 1/30n*5 + 0 + 0n + 1/4nh + 2n*2. Factor r(l). 2(l + 1)(l + 2) Let v(t) be the first derivative of -t7/14 - t6/5 + t4/2 + t3/2 + 4t - 3. Let x(h) be the first derivative of v(h). Find f, given that x(f) = 0. -1, 0, 1 Suppose -342h + 338h + 8 = 0. Let 0b - 8/7 + 2/7b*h = 0. What is b? -2, 2 Let d = 6 - 11/2. Let -2v + d + 3/2v2 = 0. Calculate v. 1/3, 1 Let t(k) be the third derivative of 0k*3 + 0 + 0k + 0k4 + 1/120k*6 + 1/60k*5 + 3k*2. Suppose t(v) = 0. What is v? -1, 0 Let z = 9 + -6. Let q(x) = -4x*3 - 3x*2 + x + 2. Let l(k) = 5k*3 + 3k*2 - 2k - 3. Let c(j) = zq(j) + 2l(j). Factor c(o). -o(o + 1)(2o + 1) Let g(q) be the second derivative of -q7/42 - q6/10 - q5/20 + q4/4 + q3/3 + 8q. Solve g(c) = 0 for c. -2, -1, 0, 1 Let y(t) = -3t3 - 15t*2 + 39t - 33. Let u(p) = 6p3 + 30p*2 - 78p + 64. Let h(x) = 6u(x) + 11y(x). Factor h(k). 3(k - 1)2(k + 7) Let i(d) = 2d3 - 8d + 16. Let y(b) = -4b3 - b2 + 16b - 32. Let x(q) = -9i(q) - 4y(q). Factor x(f). -2(f - 2)2(f + 2) Determine a so that -1/5a2 + 6/5a - 9/5 = 0. 3 Suppose 3t = 6t + 15. Let b = -9/2 - t. Solve -by5 + 1/2y*4 + 0 + 0y*3 + 0y + 0y2 = 0 for y. 0, 1 Let y(t) be the third derivative of t9/60480 - t8/8960 + t7/3360 - t6/2880 - t4/12 - 2t*2. Let c(z) be the second derivative of y(z). Factor c(f). f(f - 1)*3/4 Let v(d) = 3d - 15. Suppose -j - 4s = 7, 2j + 2 = -2s + 6. Let k be v(j). Find h, given that -2/3h3 - h2 + kh + 1/3 = 0. -1, 1/2 Let i(m) = -3m*3 + 9m*2 - 6. Let d(h) = -8h*3 + 26h*2 - h - 17. Let j(w) = -6d(w) + 17i(w). Solve j(b) = 0 for b. -2, 0, 1 Let a(s) be the second derivative of s8/672 - s7/420 + s2/2 + s. Let k(y) be the first derivative of a(y). Suppose k(p) = 0. Calculate p. 0, 1 Let k(g) be the first derivative of g4/18 + 10g3/27 + g2/3 - 2g - 4. Factor k(q). 2(q - 1)(q + 3)2/9 Let g(w) be the first derivative of -w6/6 - 3w5/5 + w4/2 + 2w3 - w2/2 - 3w + 46. Find s such that g(s) = 0. -3, -1, 1 Let d(s) = -s*2 - s. Let i(v) = -3v3 + v2. Let r(g) = -2d(g) + 2i(g). Factor r(x). -2x(x - 1)(3x + 1) Let k = -170/11 + 180/11. Factor -8/11i3 + 2/11i*4 + 0 + ki*2 - 4/11i. 2i(i - 2)(i - 1)2/11 Let m(f) be the second derivative of -f5/10 + 3f*4/2 - 9f*3 + 27f*2 - 4f. Factor m(n). -2(n - 3)3 Suppose 0i*2 - 22i + 4i2 + 34i = 0. Calculate i. -3, 0 Let m(z) = -3z2 + 7z + z*2 + 5 + 3z*2. Let v be m(-7). Suppose 1/5d*v + 0d + 1/5d3 + 0d*2 - 2/5d*4 + 0 = 0. Calculate d. 0, 1 Let v be (8 - -1)/33. Suppose -2h + v = 5o, 5o - 1 = 2h - 0. Suppose -4ah + 4a*3 + 0a*4 + 6a*2 + 2a*4 = 0. What is a? -1, 0 Let k be 13 - (2-2)/2. Suppose k = 5i + 5. What is t in 4t - 5t2 - ti + 4t*2 + 0t*2 = 0? 0, 2 Let k be ((-1)/4)/((-6)/12). Let o(a) be the second derivative of 1/4a*3 - 3a + 1/12a4 - ka*2 + 0. Factor o(h). (h + 2)(2h - 1)/2 Suppose 4t = -8t + 36. Factor -1/3 + 1/6n*t - 1/6n + 1/3n2. (n - 1)(n + 1)(n + 2)/6 Let v = -519 + 521. Solve 0 - 1/4g*v + 0g = 0. 0 Let i be (16)/(12/20). Factor ix*3 + 0 + 2x*2 + 17/2x*4 + 2x*5 + 0x. x*2(x + 2)*2(4x + 1)/2 Let p be (-3)/6 + 15/6. Let x(c) be the first derivative of 0c*3 - p - 1/5c*5 + 1/4c*4 + 0c*2 + 0c. Factor x(v). -v*3(v - 1) Suppose o - d = 8, -3o = 5d - 2d. Factor -2h*5 + 8h*3 - 3h - 3h + o + h4 - h4 - 4h*2. -2(h - 1)*3(h + 1)(h + 2) Let z(b) be the second derivative of -b5/60 - b4/18 + b3/18 + b2/3 - b - 31. Factor z(x). -(x - 1)(x + 1)(x + 2)/3 Let i(c) = -3c*3 - 2c*2 + 7c - 6. Let d(v) = 2v3 + 3v*2 - 7v + 7. Let m(u) = -4d(u) - 5i(u). Solve m(z) = 0 for z. -1, 2/7, 1 Let g(n) be the first derivative of 4n5/5 + n4 - 4n*3/3 - 2n*2 - 1. Factor g(f). 4f(f - 1)(f + 1)2 Let r(l) = l3 + 6l2 + 6l + 7. Let k be r(-5). What is n in -3n3 + n4 + 3n*4 - 3n*4 + 0n*3 + 2n*k = 0? 0, 1, 2 Suppose 15 = 6n - 5n. Let a be (-51)/(-15) - 6/n. Find p, given that -4/7p*4 + 0 + 0p*2 + 0p - 2/7pa - 2/7p*5 = 0. -1, 0 Suppose 7 + 3 = p. Suppose p = k + 2k - 2c, 0 = -k + 2c + 6. Determine f, given that -1/4 + 3/4f4 + 3/4f - 1/2f3 - 1/2f*k - 1/4f5 = 0. -1, 1 Let o(h) be the first derivative of -h7/480 + h*6/720 + 7h5/480 - h4/48 + 2h3/3 + 3. Let j(x) be the third derivative of o(x). Factor j(t). -(t - 1)(t + 1)(7t - 2)/4 Let q(d) be the first derivative of -3 + 0d3 + 0d - 1/8d4 + 0d2. Factor q(f). -f3/2 Let p(u) be the first derivative of -1/3u2 + 0u +	{ "pile_set_name": "DM Mathematics" }
) 7/165 d Which is the biggest value? (a) 90 (b) 3/2 (c) -8/49 (d) -3/7 a Which is the fifth biggest value? (a) 1 (b) -3 (c) 3.06 (d) 0.4 (e) 2 b What is the fourth smallest value in 0.4, -2/7, -189, 9, -0.1? 0.4 What is the fifth biggest value in 0, 3/8, -1, 286, -1/2, 0.4? -1/2 What is the fourth smallest value in -0.5, 1.981, 3.5, 5? 5 Which is the second biggest value? (a) -4.7 (b) 0 (c) 0.059 b Which is the fourth biggest value? (a) 2/25 (b) 0.09 (c) -5 (d) 10 c What is the fourth biggest value in 0, 5, 0.192, 19? 0 Which is the fifth smallest value? (a) 22 (b) 2 (c) -6/371 (d) -1 (e) 3/4 a What is the second smallest value in -3/2, 8/4539, -6? -3/2 What is the third biggest value in 830, 1/8, -1, -0.4? -0.4 Which is the second smallest value? (a) 4/7 (b) -2 (c) -5 (d) 28 (e) 26 b What is the smallest value in -1/291, 0.4, 1/120? -1/291 What is the fifth biggest value in 3, 1/8, 4, -1/4, 8453? -1/4 Which is the smallest value? (a) -0.5 (b) 0.01 (c) -2/3 (d) -4.246 d Which is the second biggest value? (a) -5 (b) -58 (c) 6/7 (d) 3/5 (e) 2 c What is the smallest value in 0.5, -0.09, 4, -44, -34? -44 What is the smallest value in 0.1, 0.14, -35, 0.4? -35 Which is the third biggest value? (a) 0.00335 (b) -1 (c) 3 (d) -2 b What is the fourth smallest value in -2261, 1, 2, -1/4, -4/7? 1 Which is the biggest value? (a) -5/498 (b) 3/5 (c) -2 b What is the third biggest value in -1/4, -6, -0.2, 1/6, -0.3, 344.3? -0.2 Which is the fourth smallest value? (a) -0.3 (b) -5 (c) -3/5 (d) 25/33 d What is the biggest value in -0.3, -3, -2, -81, 2/15? 2/15 Which is the third biggest value? (a) 3 (b) -0.2 (c) 1 (d) -1/6 (e) -1 (f) -225 d Which is the fifth smallest value? (a) 5 (b) 21 (c) 1.8 (d) -5 (e) -0.3 (f) -2/3 a Which is the third smallest value? (a) 9/2 (b) 1368 (c) 0.2 (d) -0.2 a What is the second smallest value in -4/9, 5/2, 6.561? 5/2 Which is the third biggest value? (a) 1380 (b) -14 (c) 0 b Which is the third biggest value? (a) -0.36 (b) 6800 (c) -5 (d) 1 a Which is the smallest value? (a) -0.17 (b) -16 (c) -5/2 (d) -0.01 (e) 0.64 b Which is the third biggest value? (a) 0.93 (b) -5 (c) 3 (d) 4 (e) 1 (f) -16 e Which is the third smallest value? (a) 0.2 (b) 842330 (c) -3/5 b What is the fifth smallest value in 2/23, -12, -0.5, -0.6, 0.4? 0.4 What is the third biggest value in -10, -12, 18? -12 What is the third biggest value in 0.1, 5, 3/10, 30, -3, -0.7? 3/10 What is the biggest value in 1, 0.0926, -1.02? 1 What is the second biggest value in 105/151, 123, 2/3? 105/151 What is the biggest value in -3, -0.2, 0.3, -1/15, 0.2, 1083/10? 1083/10 Which is the biggest value? (a) -143/1273 (b) -0.1 (c) 0.4 c Which is the second biggest value? (a) 0 (b) -0.3 (c) -1381/3 (d) 3/2 (e) -1 a What is the third biggest value in 5, 3/4, 13819, -2/31? 3/4 Which is the second smallest value? (a) -6027 (b) 4 (c) 8 (d) -7 d Which is the fourth biggest value? (a) 1/2 (b) 0 (c) 45 (d) -0.3 (e) -5 d What is the second biggest value in -1/1708, 4.7, -4? -1/1708 What is the biggest value in 1/5, 3/4, -0.1, 0.01, -0.4, -4? 3/4 Which is the biggest value? (a) -1/37 (b) 0.01 (c) -13.9 b What is the smallest value in 10, -2, 29193? -2 Which is the biggest value? (a) -313 (b) -9/5 (c) -12 b What is the second smallest value in -2/3, 85, 1/73, -0.08? -0.08 What is the third smallest value in -2/7, 5, 3, -0.045, 29/18? 29/18 Which is the biggest value? (a) -0.2 (b) -12.2073 (c) 4/7 c What is the third biggest value in 10, 8/283, 5? 8/283 Which is the fourth biggest value? (a) -1 (b) 0.3 (c) -0.4 (d) -3143 d What is the fourth biggest value in -8, -2, 0.11, 1? -8 Which is the second biggest value? (a) 1/5 (b) -3450 (c) -0.2 c What is the fifth smallest value in 0.4, 6, -24, 3, 0.2, -1? 3 Which is the third biggest value? (a) -1853 (b) 31 (c) -2 a Which is the second smallest value? (a) -0.3 (b) -0.09 (c) -2/37 (d) -2 (e) -1 e Which is the smallest value? (a) -2/11 (b) -5 (c) 21 (d) 4 (e) 2/5 (f) 3/7 b Which is the smallest value? (a) 9 (b) -0.4 (c) 1/4 (d) -2/13 (e) 0.5 b What is the fourth biggest value in 3, -14, -2, 0, 1, 267? 0 Which is the smallest value? (a) -22969 (b) -3/4 (c) -2/5 (d) 5/2 a Which is the sixth biggest value? (a) 13 (b) 2/3 (c) 0.3 (d) 3/101 (e) -1 (f) -3 f What is the third smallest value in 668.785, -3/5, 1/3? 668.785 What is the fourth smallest value in -211.9, -4/5, -0.1, -6? -0.1 Which is the biggest value? (a) 0 (b) -2 (c) 1 (d) -10/23 (e) 6/7 (f) -0.3 c What is the third biggest value in 9767, -7, -0.4? -7 Which is the third biggest value? (a) 0.411 (b) -3 (c) 0.05 (d) -4 b What is the third biggest value in 2/3, 5/2, -81, -1/8? -1/8 What is the third biggest value in 0.4, 2/19, 12, -1/19, 0.56? 0.4 Which is the third smallest value? (a) 2/11 (b) 476 (c) 8/7 b What is the third biggest value in 100, -2/25, -6/5? -6/5 Which is the biggest value? (a) -0.2 (b) 0.1 (c) -6.6 (d) 1.96 d What is the second smallest value in 1, 135, 283, -3? 1 Which is the third smallest value? (a) 46 (b) 4 (c) 24.7 a Which is the smallest value? (a) 0.5 (b) -5/4 (c) 2906 b What is the fifth biggest value in -5, -2, -3, -270, 0.062? -270 Which is the fifth smallest value? (a) -4 (b) 4 (c) -0.4 (d) -6/337 (e) 0.2 (f) -1 e What is the fourth smallest value in 0.2, 0.5, 173, -139, -2/3? 0.5 Which is the fifth smallest value? (a) -1/7 (b) 1/9 (c) 3/1093 (d) -2 (e) -1 b Which is the third smallest value? (a) 3 (b) -1.5 (c) -12079 a What is the third smallest value in 4, 1, -69, -3.59, -1? -1 Which is the smallest value? (a) -3 (b) -4476 (c) -1 b Which is the fifth smallest value? (a) 3 (b) -3/5 (c) -1 (d) -0.12 (e) 0.1 a What is the second biggest value in 3418, -3, 0.1, -1? 0.1 What is the second biggest value in -2011, 4, -0.24? -0.24 What is the smallest value in -5, 7, -25/11? -5 Which is the biggest value? (a) 0.03 (b) 142 (c) -1 (d) -0.2 b What is the second biggest value in 0, -331.78, 0.4, 4? 0.4 What is the fourth smallest value in 3/103, 1/15, -3, 5, 0.03? 1/15 Which is the fourth smallest value? (a) -5 (b) -4 (c) 19 (d) -2678 c Which is the fourth smallest value? (a) -123 (b) -83.9 (c) -1/3 (d) 0.5 d What is the sixth biggest value in -18, -0.3, -1/4, 20, -0.04, 5? -18 Which is the second biggest value? (a) -10 (b) 2/3 (c) -0.104 c What is the third smallest value in -4/5, 0.07, -15, -30? -4/5 Which is the biggest value? (a) 74 (b) 0 (c) -28 a What is the fourth smallest value in 0.3, 18, 17/3, 1? 18 Which is the second smallest value? (a) -4 (b) 2 (c) -0.056 (d) 18 c What is the second biggest value in 2, 34, -0.1, -16, 1.5? 2 Which is the second biggest value? (a) 1/7 (b) 1 (c) 354169 b Which is the fourth smallest value? (a) -1/2 (b) 1 (c) 3/2 (d) -109 (e) -2/177 (f) -0.1 e Which is the third smallest value? (a) 313 (b) -2 (c) -29 a Which is the fifth smallest value? (a) -0.5 (b) 21 (c) 2/17 (d) -2 (e) 3 (f) 0.3 e What is the biggest value in -6.2, 2/11, -0.495? 2/11 What is the second biggest value in 1489, -1.5, -6? -1.5 What is the fourth smallest value in 5, -0.606, 2/13, 280? 280 What is the third smallest value in 1177, -6/19, 5? 1177 What is the fifth biggest value in -1, 5, -2/11, -41, 0.3, -0.3? -1 What is the fifth biggest value in 0.1, 2/9, -5, -41, -2, 0.36? -5 What is the smallest value in -1/3, 4/97, 0.22, 1/12, 3/7? -1/3 Which is the fifth biggest value? (a) -1 (b) -0.43 (c) 2 (d) 0.3 (e) -0.012 a What is the biggest value in 6/13, 4/3, 71, 1? 71 Which is the biggest value? (a) 5 (b) 1 (c) 2/3 (d) 84 (e) -19.3 d What is the second smallest value in -4, -196505, -2? -4 What is the third biggest value in 438/17, 10, 0, 2/7, -0.1? 2/7 Which is the fourth biggest value? (a) 0.5 (b) 0 (c) -1.06 (d) -50 d What is the fourth smallest value in -2/11, 33, -5, -1/14, 462? 33 What is the fifth biggest value in -5, -112, -53, -2/5, 2/15? -112 Which is the fifth smallest value? (a) 2 (b) 1/6 (c) 0.1 (d) -110/3 (e) -2/15 a What is the smallest value in 1/27, 42, 4/7, -0.042? -0.042 What is the third smallest value i	{ "pile_set_name": "DM Mathematics" }
t: 7, x: 3, r: 5}. Give prob of picking 1 x, 1 r, and 1 t. 3/16 What is prob of picking 1 w and 1 p when two letters picked without replacement from {c: 1, x: 2, w: 2, d: 1, p: 1}? 2/21 What is prob of picking 2 k and 2 c when four letters picked without replacement from kkkxakcccqqkqqkcqq? 1/34 Three letters picked without replacement from {b: 1, t: 3, q: 1, x: 1, h: 1}. Give prob of picking 2 t and 1 h. 3/35 What is prob of picking 2 s when two letters picked without replacement from {c: 8, l: 2, s: 2, b: 5}? 1/136 Calculate prob of picking 2 y when two letters picked without replacement from {j: 9, r: 1, q: 1, t: 1, y: 8}. 14/95 Two letters picked without replacement from exegggcgcgceg. Give prob of picking 1 c and 1 x. 1/26 Four letters picked without replacement from {t: 3, v: 3, g: 1, c: 2, y: 3, i: 3}. Give prob of picking 1 c, 1 y, and 2 t. 6/455 Two letters picked without replacement from {a: 4, y: 7}. Give prob of picking 2 y. 21/55 Four letters picked without replacement from {h: 3, d: 4, z: 2}. What is prob of picking 3 h and 1 d? 2/63 Calculate prob of picking 1 z and 1 k when two letters picked without replacement from {z: 1, k: 1, b: 3, d: 11, n: 2}. 1/153 Calculate prob of picking 2 o when two letters picked without replacement from {o: 9, h: 1, c: 4}. 36/91 Four letters picked without replacement from llljjlljljljl. Give prob of picking 4 j. 1/143 What is prob of picking 3 u and 1 b when four letters picked without replacement from eubbubuebube? 4/99 Calculate prob of picking 3 p when three letters picked without replacement from {g: 15, p: 3}. 1/816 What is prob of picking 2 r and 2 s when four letters picked without replacement from srrsrrsrsrrs? 14/33 What is prob of picking 3 v and 1 h when four letters picked without replacement from hvvvvvvhhhvhvvhh? 21/65 Four letters picked without replacement from eejdxejjesddesedx. Give prob of picking 1 e, 2 s, and 1 x. 3/595 Two letters picked without replacement from iiiiiixiiqdiiid. Give prob of picking 1 q and 1 d. 2/105 Calculate prob of picking 2 e and 1 c when three letters picked without replacement from ececec. 9/20 Four letters picked without replacement from {q: 2, b: 2, e: 2, a: 2}. Give prob of picking 1 q, 2 a, and 1 e. 2/35 What is prob of picking 1 e and 1 c when two letters picked without replacement from dcfaaedj? 1/28 What is prob of picking 2 v when two letters picked without replacement from {u: 1, t: 3, f: 2, v: 2, z: 6}? 1/91 What is prob of picking 1 s and 1 z when two letters picked without replacement from vgvaszkvsvasgk? 3/91 Two letters picked without replacement from {o: 5, q: 1, g: 1, x: 1, n: 3, z: 1}. Give prob of picking 1 n and 1 q. 1/22 What is prob of picking 1 h, 1 t, and 1 r when three letters picked without replacement from vtkhffr? 1/35 Two letters picked without replacement from {j: 3, r: 1, p: 4, i: 1, a: 2}. What is prob of picking 2 j? 3/55 Three letters picked without replacement from {y: 2, c: 2}. What is prob of picking 1 y and 2 c? 1/2 Two letters picked without replacement from {a: 1, l: 2, m: 4, r: 2, o: 3}. Give prob of picking 1 r and 1 l. 2/33 What is prob of picking 2 z when two letters picked without replacement from {z: 6, u: 8, t: 1}? 1/7 Four letters picked without replacement from {v: 1, q: 1, j: 2, l: 1}. Give prob of picking 3 l and 1 j. 0 Two letters picked without replacement from {d: 3, k: 6, x: 8}. Give prob of picking 1 x and 1 d. 3/17 Calculate prob of picking 1 a and 1 r when two letters picked without replacement from {r: 2, o: 1, i: 1, a: 2, d: 2}. 1/7 Calculate prob of picking 1 v and 2 p when three letters picked without replacement from cvppcvcppppp. 21/110 Two letters picked without replacement from {v: 4, a: 1, u: 3, p: 2, n: 3, d: 2}. Give prob of picking 2 v. 2/35 Calculate prob of picking 1 y and 1 p when two letters picked without replacement from yyyyypypyypyyypyyyyy. 32/95 Three letters picked without replacement from {b: 3, c: 4, z: 1, m: 3, h: 3, r: 1}. Give prob of picking 1 h, 1 r, and 1 m. 9/455 What is prob of picking 1 o and 1 b when two letters picked without replacement from {e: 1, l: 3, q: 2, k: 2, o: 1, b: 3}? 1/22 Three letters picked without replacement from {o: 2, h: 1, n: 1, p: 2, i: 1, z: 2}. Give prob of picking 1 z, 1 p, and 1 h. 1/21 Two letters picked without replacement from sys. What is prob of picking 2 s? 1/3 Calculate prob of picking 1 z and 3 a when four letters picked without replacement from {z: 3, a: 3}. 1/5 Calculate prob of picking 2 f and 1 v when three letters picked without replacement from {f: 8, v: 3}. 28/55 Two letters picked without replacement from nthritb. What is prob of picking 1 r and 1 t? 2/21 Two letters picked without replacement from {v: 1, a: 1, j: 4, s: 2}. What is prob of picking 2 j? 3/14 Two letters picked without replacement from okxoooxookxyg. Give prob of picking 1 o and 1 x. 3/13 Two letters picked without replacement from {e: 14, v: 4}. What is prob of picking 2 v? 2/51 What is prob of picking 1 c and 1 n when two letters picked without replacement from {f: 4, q: 1, c: 7, n: 1}? 7/78 What is prob of picking 1 v, 1 q, and 1 b when three letters picked without replacement from {b: 1, y: 2, t: 1, q: 2, v: 1, k: 1}? 1/28 Four letters picked without replacement from {x: 19, r: 1}. What is prob of picking 4 x? 4/5 Four letters picked without replacement from {l: 2, q: 1, y: 1, z: 1}. What is prob of picking 1 z, 1 q, and 2 l? 1/5 Calculate prob of picking 1 o, 1 f, and 1 t when three letters picked without replacement from ftoccfgcggccfgfc. 1/140 What is prob of picking 1 s and 1 c when two letters picked without replacement from {u: 2, f: 3, c: 1, s: 2, t: 9, b: 3}? 1/95 Four letters picked without replacement from ggcccggcccgcggggcc. Give prob of picking 4 g. 7/170 Two letters picked without replacement from {c: 2, y: 2, s: 2, x: 7, u: 2}. Give prob of picking 2 x. 1/5 Four letters picked without replacement from essesjssyeeeeeeseaae. Give prob of picking 1 j, 1 y, and 2 s. 1/323 What is prob of picking 1 z and 1 u when two letters picked without replacement from {u: 3, z: 1, j: 5, a: 1, f: 4, v: 4}? 1/51 What is prob of picking 1 j and 1 o when two letters picked without replacement from {o: 1, e: 3, p: 1, b: 1, j: 1}? 1/21 Two letters picked without replacement from ililiiiii. What is prob of picking 2 i? 7/12 Calculate prob of picking 1 z and 1 p when two letters picked without replacement from dddzdpzzzzd. 1/11 Three letters picked without replacement from {z: 1, u: 2, g: 1, t: 2}. Give prob of picking 1 t, 1 u, and 1 z. 1/5 Calculate prob of picking 1 r and 2 h when three letters picked without replacement from dfssidsridhisdh. 1/455 Calculate prob of picking 1 y, 1 m, and 1 b when three letters picked without replacement from {m: 2, b: 6, u: 3, y: 1}. 3/55 What is prob of picking 2 a and 1 u when three letters picked without replacement from {q: 2, a: 2, c: 1, u: 4}? 1/21 Two letters picked without replacement from {p: 9, z: 2, i: 4, h: 1}. What is prob of picking 1 h and 1 i? 1/30 What is prob of picking 1 q and 1 o when two letters picked without replacement from {o: 1, k: 1, q: 2, t: 1, g: 1, s: 1}? 2/21 Three letters picked without replacement from lllllllll. What is prob of picking 3 l? 1 What is prob of picking 1 e and 1 f when two letters picked without replacement from {f: 15, e: 5}? 15/38 Calculate prob of picking 2 u and 1 j when three letters picked without replacement from {u: 17, j: 2}. 16/57 Four letters picked without replacement from {p: 1, c: 1, l: 2, z: 2, b: 2, v: 1}. What is prob of picking 1 l, 1 c, 1 p, and 1 b? 2/63 Calculate prob of picking 3 n and 1 r when four letters picked without replacement from rnpnnnnnnnnnnnn. 22/105 Three letters picked without replacement from dodduduuuo. What is prob of picking 2 d and 1 u? 1/5 Two letters picked without replacement from eddddedwwe. What is prob of picking 1 d and 1 w? 2/9 Two letters picked without replacement from zyypjpddezyyy. What is prob of picking 2 p? 1/78 Calculate prob of picking 1 a and 1 r when two letters picked without replacement from {a: 1, n: 1, i: 1, b: 1, r: 1}. 1/10 What is prob of picking 2 k and 1 t when three letters picked without replacement from	{ "pile_set_name": "DM Mathematics" }
ed without replacement from vnnnyyk? 1/21 What is prob of sequence ccv when three letters picked without replacement from vicibbbvbici? 1/330 What is prob of sequence chh when three letters picked without replacement from {c: 1, h: 2}? 1/3 Calculate prob of sequence xaxa when four letters picked without replacement from ydydddxdyydayd. 0 What is prob of sequence tttg when four letters picked without replacement from utuuututuugtuguu? 1/910 What is prob of sequence ezz when three letters picked without replacement from zzzzehehzzz? 14/165 What is prob of sequence zzh when three letters picked without replacement from {z: 5, m: 3, h: 4, o: 1}? 20/429 Two letters picked without replacement from {h: 4, p: 1, g: 1, t: 7, m: 2, c: 2}. Give prob of sequence mp. 1/136 Calculate prob of sequence ccc when three letters picked without replacement from cecceceeceeececeecce. 7/95 Two letters picked without replacement from {y: 3, m: 1, j: 1}. What is prob of sequence mj? 1/20 Calculate prob of sequence knar when four letters picked without replacement from {i: 1, a: 2, n: 1, r: 1, k: 1, h: 1}. 1/420 Two letters picked without replacement from rpkarakkapa. What is prob of sequence ra? 4/55 Two letters picked without replacement from vvywwov. Give prob of sequence vv. 1/7 Two letters picked without replacement from xjchl. Give prob of sequence jl. 1/20 Calculate prob of sequence hhn when three letters picked without replacement from {h: 2, n: 3, e: 4, u: 2}. 1/165 Calculate prob of sequence fj when two letters picked without replacement from xkkfjmi. 1/42 Calculate prob of sequence wwy when three letters picked without replacement from {n: 5, y: 3, f: 3, p: 1, w: 2, m: 1}. 1/455 Two letters picked without replacement from {n: 2, j: 5, y: 3, m: 3}. Give prob of sequence ym. 3/52 Two letters picked without replacement from {i: 7, a: 4, f: 2}. What is prob of sequence fi? 7/78 Four letters picked without replacement from hyhchpphhhpfc. What is prob of sequence chch? 1/286 Three letters picked without replacement from {x: 5, e: 1, v: 3, o: 2, w: 1}. What is prob of sequence xwe? 1/264 Two letters picked without replacement from duxpxyuxuuuyppxudu. What is prob of sequence ud? 7/153 Calculate prob of sequence mu when two letters picked without replacement from {u: 3, m: 1}. 1/4 Four letters picked without replacement from {s: 2, r: 8, d: 2}. Give prob of sequence rrsr. 28/495 Four letters picked without replacement from ammmmmmmmmmmkhmkmkmi. What is prob of sequence kiha? 1/38760 Two letters picked without replacement from nclnoon. What is prob of sequence ln? 1/14 What is prob of sequence qb when two letters picked without replacement from pbpulbqqpuqp? 1/22 Three letters picked without replacement from ttatttttttatta. What is prob of sequence ata? 11/364 Three letters picked without replacement from nanonnaoonaonna. Give prob of sequence onn. 4/65 Two letters picked without replacement from cutvvuvqvcvuuuqvtvqq. What is prob of sequence qc? 2/95 Two letters picked without replacement from {s: 4, c: 4, h: 6}. Give prob of sequence cc. 6/91 What is prob of sequence xrg when three letters picked without replacement from rgxnljr? 1/105 What is prob of sequence hhm when three letters picked without replacement from {m: 3, h: 11, r: 4}? 55/816 Three letters picked without replacement from {r: 6, p: 3, m: 1, b: 5, d: 1, s: 1}. What is prob of sequence prp? 3/340 Two letters picked without replacement from {g: 4, c: 10, j: 4, u: 2}. What is prob of sequence jg? 4/95 What is prob of sequence vvv when three letters picked without replacement from {v: 10}? 1 What is prob of sequence bbb when three letters picked without replacement from ccbdddcbcdcbcdbc? 1/140 Three letters picked without replacement from {o: 5, j: 5}. What is prob of sequence joj? 5/36 What is prob of sequence ky when two letters picked without replacement from {k: 1, y: 3}? 1/4 What is prob of sequence fkff when four letters picked without replacement from kfyk? 0 Three letters picked without replacement from {s: 5, z: 14}. What is prob of sequence ssz? 140/2907 What is prob of sequence ox when two letters picked without replacement from {x: 6, o: 12}? 4/17 Two letters picked without replacement from yzyok. What is prob of sequence yy? 1/10 What is prob of sequence jj when two letters picked without replacement from {i: 3, o: 1, l: 2, f: 2, j: 9, d: 1}? 4/17 Three letters picked without replacement from {e: 2, s: 2, c: 1, f: 9}. What is prob of sequence sse? 1/546 Two letters picked without replacement from {f: 4, g: 4, m: 7}. Give prob of sequence fg. 8/105 Calculate prob of sequence ssu when three letters picked without replacement from {s: 4, w: 2, f: 2, u: 5}. 5/143 Calculate prob of sequence hll when three letters picked without replacement from htllthhhlhhhhtlhhhr. 22/969 Calculate prob of sequence ni when two letters picked without replacement from {i: 5, n: 6, u: 6, r: 1}. 5/51 Two letters picked without replacement from {o: 3, y: 1, x: 2, l: 3, u: 1}. Give prob of sequence yx. 1/45 What is prob of sequence hgh when three letters picked without replacement from hhgghgghhgggg? 40/429 What is prob of sequence ei when two letters picked without replacement from {p: 4, e: 2, i: 7}? 7/78 Two letters picked without replacement from {w: 5, j: 1, m: 4}. What is prob of sequence wj? 1/18 Calculate prob of sequence akk when three letters picked without replacement from ikkkikaa. 1/14 Four letters picked without replacement from {e: 10, h: 9}. Give prob of sequence eheh. 45/646 Calculate prob of sequence vgw when three letters picked without replacement from {g: 12, s: 1, w: 1, v: 1}. 2/455 Four letters picked without replacement from gyllgqylgyy. What is prob of sequence yqly? 1/220 Three letters picked without replacement from wwttwwwt. Give prob of sequence twt. 5/56 Four letters picked without replacement from {w: 1, g: 3}. Give prob of sequence wwww. 0 What is prob of sequence cy when two letters picked without replacement from bpryqcb? 1/42 Three letters picked without replacement from eeevevvevv. Give prob of sequence eve. 5/36 Calculate prob of sequence idai when four letters picked without replacement from {d: 2, q: 1, a: 3, i: 10}. 9/728 Calculate prob of sequence vr when two letters picked without replacement from {y: 6, w: 2, r: 4, s: 1, v: 2}. 4/105 Calculate prob of sequence rkrr when four letters picked without replacement from {k: 4, r: 3}. 1/35 Two letters picked without replacement from {d: 1, z: 1, a: 1, w: 2, c: 4}. What is prob of sequence dc? 1/18 Two letters picked without replacement from hbihhddddkkbdib. Give prob of sequence id. 1/21 What is prob of sequence nn when two letters picked without replacement from oonnnonnnnn? 28/55 Three letters picked without replacement from wwriiirtvwwrior. What is prob of sequence rvo? 2/1365 Two letters picked without replacement from {b: 4, d: 1, l: 6, w: 1, m: 6}. Give prob of sequence mb. 4/51 What is prob of sequence rrg when three letters picked without replacement from ygrugyghmmmuyurmumgu? 1/855 What is prob of sequence jr when two letters picked without replacement from jrgggjyrgjrxjg? 6/91 Calculate prob of sequence ime when three letters picked without replacement from {i: 9, m: 1, e: 1, n: 1, w: 2, u: 1}. 3/910 Two letters picked without replacement from {z: 12, l: 3, s: 1}. What is prob of sequence sl? 1/80 What is prob of sequence wofp when four letters picked without replacement from shsoffowp? 1/756 Three letters picked without replacement from {k: 4, q: 4, j: 11}. What is prob of sequence qqk? 8/969 What is prob of sequence ujwu when four letters picked without replacement from ulalaajoajuwoj? 1/4004 Two letters picked without replacement from jjjwwjjjjsjjsjjjw. What is prob of sequence ww? 3/136 What is prob of sequence kaak when four letters picked without replacement from aaaakaaka? 1/36 Calculate prob of sequence tm when two letters picked without replacement from mtmmmmmmtmmmmmkmmktm. 9/76 Four letters picked without replacement from wwvryynyywynywyv. Give prob of sequence ryvv. 1/3120 Calculate prob of sequence udv when three letters picked without replacement from {m: 1, q: 1, c: 2, u: 2, d: 7, v: 4}. 7/510 Calculate p	{ "pile_set_name": "DM Mathematics" }
pose -6c + s = -c. What is the units digit of c? 8 Suppose 3l - 2129 = -2c, -4c - 5l + 2468 = -1787. What is the units digit of c? 0 Suppose -6b - 7 + 19 = 0. Suppose -7y + 355 = -by. What is the tens digit of y? 7 Let i(b) = 8b + b - 21b*3 + 44b*3 - 24b*3 - 11b2. Let p(k) = k2 + 8k. Let d be p(-6). What is the tens digit of i(d)? 3 Let v be -1 + 10 + (4 - 8). Let f(c) = 2c*2 + c + 2. Let z be f(v). Suppose z = 4a - a. What is the units digit of a? 9 Let p(h) = 0 - 1 - 3h + h + 4h*3 - 5h*3 + 3h*2. Let g be p(-3). Let f = g - 33. What is the tens digit of f? 2 Let g = 3699 + -784. What is the tens digit of g? 1 Let g = 2 - 2. Let f be 1/2(-10)/(-1). Suppose -53 = -4c + 2y + 115, g = -fc + 3y + 211. What is the tens digit of c? 4 Let g be 95/19 - (3 + -2 - 0). Suppose 0 = -4c - 3q + 210 + 19, 4c - gq - 236 = 0. What is the units digit of c? 8 Suppose 65650 = -39u + 216112. What is the hundreds digit of u? 8 Let h(a) = -a - 1. Let b be h(-3). Suppose -bc + 6 = -18. What is the tens digit of c? 1 Let a = 187 - -159. What is the tens digit of a? 4 Let b = 383 + -118. Let p = b + -142. What is the units digit of p? 3 Let u(h) = h3 + h2 + 2h2 - h + 9 - 11. Let x be u(-2). Suppose -f = 2z + 2f - 114, -xz + 4f = -188. What is the units digit of z? 1 Suppose 3v + 3m = 6m, 5v - 2m = 15. Suppose -735 = -5u - 3i, 5u + 0i = vi + 735. What is the tens digit of u? 4 Suppose 7 = -2g + 49. Suppose 0 = gf - 15f - 1632. What is the units digit of f? 2 Suppose -u + 3759 = 4x, 3u = -4x + 5u + 3762. What is the tens digit of x? 4 Let q = 0 + 4. Suppose 5a + 41 = qj, -3a = -3 + 18. Suppose -5 = 3p - 4p + jm, 0 = 4m. What is the units digit of p? 5 Let w(d) = d3 + 12d*2 + 12d - 58. What is the units digit of w(-8)? 2 Suppose 0 = -4p - 5l + 122, 2p + l = 7p - 167. What is the tens digit of p? 3 Suppose 176 = 6d - 2d. Let r = 91 - d. What is the units digit of r? 7 Suppose -8872 - 6627 = -11h. What is the units digit of h? 9 Let c(y) = -2y - 2. Let s be c(0). Let u be 1 + 0 + s/(-1). Suppose -ut = -26 - 52. What is the tens digit of t? 2 Let g(m) = 15m*2 - 2m + 4. Let a(z) = -7z2 + z - 2. Let h(r) = -5a(r) - 2g(r). Let w be h(-2). What is the units digit of w/(-16) - (-22)/4? 4 Let j be (-1)/(3 + 57/(-18)). Suppose -2n + 170 = 4c, -c + jc - 2n = 208. What is the tens digit of c? 4 Let q = -5 - -8. What is the hundreds digit of (0 - q)-41 + -3? 1 Suppose v = -4v + 70. Suppose y = -4n + 3, -6n + n + 6 = 2y. Suppose 4 = ym - v. What is the units digit of m? 6 Let g = 48 - 6. Suppose -w + g = 2w. Suppose -2u = -5u + 3p + 21, -4p - w = 3u. What is the units digit of u? 2 Let g = -793 - -2059. What is the tens digit of g? 6 Let c(j) = 64j - 56. What is the hundreds digit of c(5)? 2 What is the hundreds digit of 4 + 5 - (-867 + -38)? 9 Suppose 0 = 3o - 3s - 57, -3o + 81 = -5s + 24. Suppose -o - 6 = -5x. Suppose 57 = xm - 93. What is the units digit of m? 0 Let q(n) = n*2 + 4n - 2. Let p be q(-8). Suppose -p = -5w + 105. Suppose -5d + 25 = 0, 6 = 2t + 3d - w. What is the units digit of t? 9 Let r be -22/(-4) + -3. Let f be 4((-2)/r - 0). What is the units digit of (-2f)/(-4)5? 0 What is the tens digit of -22(58/(-20) + 2/5)? 5 Let f(d) = -d3 + d2 + 3d - 3. Let z be f(-2). Suppose zj - 2i = 230, -2j - i = 3j - 366. What is the tens digit of j? 7 Let g(q) = q*2 + 7q + 10. Let h be g(-6). Suppose ha = 3a + 57. What is the tens digit of a? 5 Suppose 3h = -u + 10058, -u - 3032 = -h + 318. What is the tens digit of h? 5 Let g(p) = -13p - 5 + 1 + 6 - 1. Let i be g(-5). What is the tens digit of (3 - 10/4)i? 3 Suppose f + 2f - 15 = 2h, h = 0. Suppose fw - 41 = 3r + 54, -3w + 33 = 3r. What is the units digit of -3 + 3/(-3) + w? 2 Let u = -949 + 2433. What is the units digit of u? 4 Let x(g) = -458g + 27. What is the hundreds digit of x(-5)? 3 Let j = 11 - 15. What is the units digit of (17 - (3 - 6)) + j? 6 Suppose -3f + 5f - 38 = -2n, 2f + 34 = 2n. What is the units digit of -4 + 4 - (n/(-2))/1? 9 Let h = -34 - -1811. What is the tens digit of h? 7 Suppose 79c - 1964 = 77c. What is the units digit of c? 2 Let w be 22/(2/(-44)-1). Let o = w + -300. What is the tens digit of o? 8 Suppose -7f + 11658 - 1830 = 0. What is the thousands digit of f? 1 Suppose -h + 12 = 5a, a - 5 = -4h + 5. Suppose 3o + 2w = 42, -o - 7w + 27 = -aw. What is the tens digit of (-266)/(-10) - o/(-30)? 2 Suppose 5k + 15 = -0k. Suppose 108t + 492 = 120t. Let w = k + t. What is the tens digit of w? 3 Let o = -164 - -254. Let v = -63 + o. Suppose 0 = -2z + v + 63. What is the units digit of z? 5 Suppose -4305 = -3s - 3t, 2s + 5t = 3766 - 890. What is the thousands digit of s? 1 Suppose 3y = 15r - 17r + 1002, 3y - r = 993. What is the units digit of y? 2 Let y = 137 + -35. Let g = y + -38. What is the units digit of g? 4 Suppose -71g + 73g = -4r + 1780, r = 2g + 445. What is the tens digit of r? 4 Let o = 1801 + -1312. What is the tens digit of o? 8 What is the units digit of (399/7)/((-134)/140 - -1)? 0 Let c(x) = -481x3 - 9x*2 + 1. What is the tens digit of c(-1)? 7 Suppose -73v = -78v + 4050. What is the units digit of v? 0 Let j(n) = -n2 + 10n + 6. Let w be j(12). Let v = 18 - w. What is the units digit of v? 6 Suppose -386z - 6675 = -391z. What is the tens digit of z? 3 Let v = 26 - 13. Suppose -2a - v = -57. What is the tens digit of a? 2 Let h be (-1245)/5 + 6/(-2). Let f be (-4)/(-8) + h/(-8). Suppose w = 30 + f. What is the units digit of w? 2 Let s(i) = 4i + 4. Let g(t) = -3t - 4. Let a(l) = -3g(l) - 2s(l). Let r be a(0). Let o = r + 9. What is the tens digit of o? 1 Suppose -17f = -34806 - 45281. What is the units digit of f? 1 Suppose -j - 5n + 1674 = 0, -5j = -j - 5n - 6771. What is the thousands digit of j? 1 Let z = 38 + -34. Let u be (1 - 6/z)0. Suppose u = -5y - 0y + 15. What is the units digit of y? 3 Suppose -3s - 126 = 6s. What is the units digit of 12/(-210)-1355 + 6/s? 7 Let j = 4 + 9. Let n = 18 - j. Let c(k) = 8k - 6. What is the tens digit of c(n)? 3 Let x(b) = 25b3 - 5b*2 + 1. Let t(w) = -4 + 4 - 14w*3 - 12w*3 - 1 + 4w*2. Let z(f) = -6t(f) - 5x(f). What is the tens digit of z(1)? 3 Let o = -33 - -106. Suppose 0 = 107i - 110i - 3y + 411, 0 = y. Let x = i - o. What is the units digit of x? 4 Suppose 0o - 1 = -o. Let r(v) = -5v*3 + 9v*2 - 8v - 7. Let q(c) = c3 - c2 + c + 1. Let w(s) = or(s) + 6q(s). What is the units digit of w(-3)? 5 Suppose 12c - 7918 + 2854 = 0. What is the tens digit of c? 2 Let z(f) = -2f*2 - 17f - 2. Let t(g) = 5g2 + 50g + 7. Let s(x) = -3t(x) - 8z(x). Let n be s(14). What is the units digit of (-244)/(-20) - (-1)/n? 2 Let b(z) = 3z - 1. Let y be b(2). Let s(k) = k + 10. Let a be s(-5). Suppose -8i + 3i = ym - 115, -m - ai + 43 = 0. What is the tens digit of m? 1 Let o(p) be the first derivative of 5p*3/3 - 11p*2/2 + 7p - 25. What is the hundreds digit of o(7)? 1 Let s be 17 + -3 - (2 + -1). Suppose 10x + 12 = sx. What is the units digit of x? 4 Let l be (-224)/(-6)(-10 + 7). Suppose 2b - b + 5 = 0. What is the tens digit of l/b - 6/15? 2 What is the hundreds digit of 4 + -234(-2 - -1)? 2 Suppose -80y - 573 = -83y. What is the tens digit of y? 9 Let d(u) = 16u*2 + 2. Let o be d(-2). Let h be 2/12 - o/(-36). Suppose 0 = 3m - 4k + hk - 72, -2k = -5m + 124. What is the units digit of m? 6 What is the thousands digit of (-6 - 1 - 2)/(21/(-6279))? 2 Let n = 179 - 111. Let d = 114 - n. Let a = d + -18. What is the units digit of a? 8 Let r(x) = -x + 10. Let w be r(12). What is the tens digit of w/((3/(-111))/1)? 7 Let i(q) = 5q2 - 4q + 1. Let n be i(-4). Suppose b = 4c - n, 8c + 3b - 117 = 3c. What is the tens digit of c? 2 Let z(k) = 4k2 + 111k - 160. What is the tens digit of z(-47)? 5 Let r(j) = 146j + 231. What is the tens digit of r(7)? 5 Suppose 27s - 12s = -1605. Let d = 138 + s. What is the units digit of d? 1 Suppose 338 = 3w - a, 2w + 2a - 151 - 61 = 0. What is the units digit of w? 1 Let u(a) = a*3 - 8a*2 + 3. Let t be u(8). Suppose 0 = 5b + t - 18. Suppose -i + 1 = 0,	{ "pile_set_name": "DM Mathematics" }
ple of o and 7? 56 Let b be -7(0 + 60/(-14)). Suppose -y + 9 = -b. What is the lowest common multiple of ((-20)/35)/(18/21)(-12)/1 and y? 312 Suppose 4k - 5s + 532 = 2k, 0 = 3k - 2s + 820. What is the common denominator of ((-10)/(-3))/((-224)/k) and -26/7? 28 Let k = -6411 + 6459. What is the smallest common multiple of 40 and k? 240 Let n(a) = 0a*3 - 8a - 2a - 10a2 - a3 + 7a2 + 8. What is the least common multiple of n(-5) and 36? 108 Find the common denominator of (-3158)/252 + (17 - 4) and 83/210. 630 Suppose 465 = s + 3a, -5a = 3s - 0s - 1375. What is the least common multiple of 550 and s? 4950 Let i = -7050 - -7060. Let p = 68 + -38. Calculate the least common multiple of i and p. 30 Let g = -810/107 - -455911/535. Let a = g - 841. Find the common denominator of -59/105 and a. 105 Let j be (-1 + 197515/4)/((-19)/(-76)). Let r = j + -53328157/270. What is the common denominator of -85/2 and r? 270 Let v(n) = -6n - 4. Let j(c) = -c*3 + 9c*2 + 3c - 62. Let g be j(10). Let w = -124 - g. Calculate the smallest common multiple of v(-3) and w. 56 Let a = -148600882/14573 + 10197. Let i = -1180523/1603030 - a. What is the common denominator of i and 111/44? 220 Let w be (-96)/10 - 3/(105/14). Find the common denominator of 9/(-73 - w)(-1246)/20 and (-2)/(-6) - (-82)/168. 140 Suppose -2 = 7a - 16. Let b be (a - 24/10)/((-3)/(-465)). Find the common denominator of 6/18 - b/54 and -53/10. 270 Let w be 2 + (-1854754706883395)/1396200 + 2. Let b = w + 10627444239/8. Let s = b - 4/2685. What is the common denominator of -58/3 and s? 39 Let s = 160 + -155. Let m(j) = j*3 - 4j*2 - 7j + 12. Calculate the least common multiple of 22 and m(s). 22 Let d be ((-16)/5)/((-3)/75). Suppose -3i - 71 = -d. Suppose -4o - 13 = 5j - 130, 0 = -2j + 4o + 30. Calculate the least common multiple of j and i. 21 Let w = -23 - -4. Let d = 111 - w. Suppose 11 = 2m - 9. Calculate the smallest common multiple of m and d. 130 Let l = 294 - 298. Calculate the smallest common multiple of -27(-2)/(-4)-2 and -35(-14)/18 - l/(-18). 27 Let t(o) = -3o*2 + 3. Let g be t(-1). Let s(h) = 33h + 12. Calculate the least common multiple of s(g) and 24. 24 Let n be -1 - ((-128)/24)/((-6)/(-423)). Calculate the common denominator of 34/(-20) - (-1 - -1) and (54/n)/((-28)/(-245)). 50 Suppose -57o + 15o = -9408. Calculate the least common multiple of 6 and o. 672 Let f(h) = h*3 + 56h*2 + 45h - 494. Suppose -3l + 74 = -10. What is the lowest common multiple of l and f(-55)? 56 Let g(s) = -32s + 274. What is the smallest common multiple of g(6) and 1435? 2870 Suppose 30l - 30l + 756 = 14l. What is the smallest common multiple of l and 270? 270 Suppose -15 = -5y + 15. Let t(m) = m - 8. Let b(s) = 2s - 15. Let h(o) = 6b(o) - 13t(o). Calculate the smallest common multiple of h(-6) and y. 60 Let m = 2532 - 2422. Calculate the least common multiple of m and 4 + -6(-4)/(-16)-12. 110 Suppose 158g - 133g - 40560 = 39690. What is the lowest common multiple of 2247 and g? 22470 Let g(q) = 2q*2 - 11q - 1. Let i be g(6). Suppose 0d + 49 = 2l - d, 129 = il + 4d. Let s = -23 + l. What is the smallest common multiple of s and 3? 6 Let o = -988532689518549611/445230 + 2220274216741. Let p = o - -24/8245. Find the common denominator of -91/6 and p. 54 Let i be (12/8)/(2/(-12)). Let n(q) = -41q - 116. Let d(v) = 8v + 23. Let s(o) = -11d(o) - 2n(o). Calculate the least common multiple of 30 and s(i). 330 Let h be (-4997)/3060 + 30/60. Let g = h + 28/153. Find the common denominator of g and 33/170. 340 Suppose -6p + 408 = t, -152p - 1250 = -3t - 157p. Calculate the smallest common multiple of 72 and t. 2520 Find the common denominator of 39/2480 and 5/(-100)(-2338)/21 - 1. 7440 Suppose 10k - 104 = -14. Let b(h) be the third derivative of h*4/6 - 4h3/3 + h2. What is the lowest common multiple of b(3) and k? 36 Let j = 2679 - 24077/9. Let y = 72870937/28794090 - -2/221493. Let s = 120/13 - y. Calculate the common denominator of j and s. 90 Let k = 33922 + -3392153/100. Calculate the common denominator of 30/11 and k. 1100 Suppose 3n - r = 208, 5n - 4r = 81 + 268. Suppose -n = 9w - 573. Calculate the least common multiple of 63 and w. 504 Let j be 2/(-13) - (-2240)/364. Suppose 5z + z - j = 0. Let k = -6 + 14. What is the lowest common multiple of k and z? 8 Let i(g) = 31g + 9. Let q be i(1). Suppose -32c - q = -36c. What is the smallest common multiple of 34 and c? 170 Let z be 24/(-252) + 2514/(-189)3. What is the common denominator of (-5)/4((-32)/z + 11) and -85/118? 236 Suppose -25g + 21g = -72. Suppose 8 - g = 5o. Calculate the lowest common multiple of 12 and 6 + -9 - (o - 3). 12 Find the common denominator of (-10292)/616524(-2)/(-8) and 53/16. 29712 Let n = -51783/4 + 12936. Calculate the common denominator of 49/26 - (-3)/(-6) and n. 52 Suppose -25s + 28s + 27 = 0. What is the common denominator of (((-714)/s)/7)/(-3) and 43/9? 9 What is the lowest common multiple of ((-5040)/224)/(1/(-6)) and 1035? 3105 Let z = -1037 + 1513. What is the least common multiple of 340 and z? 2380 Suppose 5k + 111 = 121. Suppose 3l + 1 = y + 3y, -8 = -ky. What is the smallest common multiple of l and 5? 5 Let r = 291/11290 + -952507/8264280. Find the common denominator of r and -25/6344. 19032 Calculate the common denominator of ((-44)/6)/(-11)(-110)/60 and -85/252. 252 Let k be 1/(4 + (-76)/20). Suppose -ki - 2728 = -u, -4i + 2u + 2u = 2176. Calculate the common denominator of 293/i + 6/(-39) and -39/22. 462 Suppose 13 = 4b + 5. Suppose k - n = 3n + 7, -n + b = k. Suppose 10 = 2r - 2w, -5w = kr - 9w - 12. What is the lowest common multiple of 9 and r? 72 Find the common denominator of ((-405)/2)/(-9)16/(-160) and 99/20. 20 Let t = -16748 + 18008. What is the least common multiple of 1512 and t? 7560 Let i = 8268 + -8263. Let o(v) = v3 - 17v*2 - 11v - 21. What is the lowest common multiple of i and o(18)? 105 Suppose -4u = -65f + 61f - 9824, 2u = -4f + 4924. What is the lowest common multiple of 8 and u? 9832 What is the common denominator of -34 + (-147117)/(-5452) + (0 - 0) + 7 and 95/5546? 11092 Let y(o) = -o2 - 25o - 66. Suppose j + 3x = -44, 2j + 130 = -3j + 3x. Let n be y(j). What is the common denominator of ((-39)/n)/(180/14)262 and -65/57? 570 Suppose -4247 = -765m + 1108. Let f(s) = s*3 + 4s*2 + s + 4. Calculate the lowest common multiple of m and f(4). 952 Calculate the common denominator of -35/24 and (-1)/(-136)(4 + -9 - -12). 408 Suppose 2h - 509 = 5x, 3h + 115 = x + 872. Find the common denominator of 85/106 and (2/5)/(h/(-90)). 742 Let n be (-56)/70 + 93703/(-240). Let k = n - -1157/3. Find the common denominator of 21/44 and k. 176 Suppose -2v = -19v + 17. Let s be (-32)/24(v + 8). What is the common denominator of -97/30 and 8/(-20)s/(-15)? 150 Let z = 2/561 + -33139/11220. What is the common denominator of z and (18/76 + 15/(-60))/((-297)/13959)? 380 Let q = -56/11 + 19/4. Suppose -5y - 1 - 16 = -4c, -12 = -4c + 4y. Calculate the common denominator of -3 + c - (-1107)/144 and q. 176 Let g = 1 + 8. Let u = 35 - 31. Suppose l - 26 = 2f, -2f - 10 = -l - uf. Calculate the least common multiple of g and l. 18 Suppose -10a - 31024 = -12a - 4i, -5i = -a + 15477. Let l = 1860229/120 - a. Calculate the common denominator of 79/132 and l. 1320 Let d(v) = -61v - 511. What is the lowest common multiple of d(-11) and 304? 3040 Let z be 8((-1675)/20)/5. Let l = z + 125. What is the common denominator of (-460)/(-336) + (2 - l/(-6)) and 49/16? 336 Let v be 12/2(-2)/(-4). Suppose 0 = -3f + vs + 201, -77 = -f + 2s - 5. Let a(c) = 663c - 39113. Calculate the smallest common multiple of f and a(59). 124 Suppose 0 = -4y - 3a + 429, -4a = 2y + a - 197. Let n = y - 101. What is the common denominator of n/5 + 327/(-108) and -21/2? 36 Let d = 18994 + -18946. What is the least common multiple of 2880 and d? 2880 Let j be 0/(-3) + -4 + -1. What is the common denominator of ((-10)/(-5))/(3 - (-948)/(-356)) and (j/120)/(4/(-58))? 240 Let q(k) = -k3 - 6k*2 + 4k - 19. Let z be q(-7). Suppose 4a - 4t - 4 = -8, 4a + zt - 14 = 0. What is the least common mu	{ "pile_set_name": "DM Mathematics" }
:58 AM? 145 How many minutes are there between 12:15 PM and 7:11 PM? 416 How many minutes are there between 11:25 PM and 2:16 AM? 171 What is 160 minutes after 7:45 AM? 10:25 AM What is 472 minutes before 9:36 PM? 1:44 PM How many minutes are there between 8:26 AM and 1:09 PM? 283 How many minutes are there between 1:05 AM and 1:04 PM? 719 What is 286 minutes after 6:43 PM? 11:29 PM What is 664 minutes after 12:13 PM? 11:17 PM What is 401 minutes before 9:17 AM? 2:36 AM What is 96 minutes before 5:07 AM? 3:31 AM How many minutes are there between 5:33 AM and 12:15 PM? 402 How many minutes are there between 5:55 AM and 6:48 AM? 53 What is 250 minutes after 11:08 AM? 3:18 PM What is 54 minutes before 7:25 PM? 6:31 PM How many minutes are there between 4:29 PM and 9:32 PM? 303 What is 289 minutes before 4:15 AM? 11:26 PM What is 687 minutes before 5:59 PM? 6:32 AM How many minutes are there between 12:39 AM and 7:43 AM? 424 What is 141 minutes before 7:03 PM? 4:42 PM How many minutes are there between 6:02 AM and 3:49 PM? 587 What is 156 minutes before 10:36 PM? 8:00 PM What is 454 minutes before 7:39 AM? 12:05 AM What is 254 minutes before 6:09 AM? 1:55 AM How many minutes are there between 9:33 AM and 4:59 PM? 446 What is 237 minutes after 6:52 AM? 10:49 AM How many minutes are there between 10:02 PM and 8:54 AM? 652 What is 191 minutes before 5:20 PM? 2:09 PM What is 367 minutes before 5:16 PM? 11:09 AM How many minutes are there between 1:08 PM and 12:24 AM? 676 How many minutes are there between 2:36 AM and 5:29 AM? 173 How many minutes are there between 1:56 AM and 11:51 AM? 595 What is 609 minutes before 5:43 AM? 7:34 PM What is 249 minutes before 8:38 PM? 4:29 PM What is 399 minutes after 7:04 AM? 1:43 PM What is 474 minutes after 5:20 AM? 1:14 PM What is 38 minutes after 6:22 AM? 7:00 AM How many minutes are there between 4:16 PM and 1:44 AM? 568 What is 303 minutes after 12:09 PM? 5:12 PM How many minutes are there between 5:14 PM and 12:00 AM? 406 How many minutes are there between 11:38 PM and 1:33 AM? 115 What is 373 minutes before 6:56 PM? 12:43 PM What is 223 minutes before 11:55 PM? 8:12 PM What is 482 minutes before 6:14 AM? 10:12 PM What is 628 minutes after 12:41 PM? 11:09 PM What is 573 minutes after 6:00 AM? 3:33 PM What is 693 minutes after 2:59 AM? 2:32 PM How many minutes are there between 8:03 AM and 1:40 PM? 337 What is 14 minutes after 4:45 PM? 4:59 PM What is 170 minutes after 3:32 AM? 6:22 AM What is 627 minutes before 5:24 PM? 6:57 AM How many minutes are there between 12:16 PM and 2:56 PM? 160 How many minutes are there between 9:02 AM and 8:02 PM? 660 What is 616 minutes before 8:44 AM? 10:28 PM How many minutes are there between 6:43 PM and 1:27 AM? 404 How many minutes are there between 10:43 PM and 8:54 AM? 611 What is 587 minutes after 11:19 PM? 9:06 AM What is 585 minutes after 8:43 PM? 6:28 AM How many minutes are there between 9:25 AM and 3:10 PM? 345 How many minutes are there between 4:32 AM and 3:53 PM? 681 How many minutes are there between 4:14 AM and 4:55 AM? 41 What is 557 minutes before 6:05 PM? 8:48 AM What is 697 minutes before 5:51 AM? 6:14 PM How many minutes are there between 7:22 AM and 1:22 PM? 360 How many minutes are there between 7:01 PM and 6:44 AM? 703 How many minutes are there between 6:10 PM and 12:56 AM? 406 What is 171 minutes before 5:12 PM? 2:21 PM How many minutes are there between 4:38 PM and 12:30 AM? 472 What is 625 minutes before 6:22 AM? 7:57 PM How many minutes are there between 4:18 AM and 1:30 PM? 552 What is 532 minutes before 10:41 AM? 1:49 AM How many minutes are there between 2:38 PM and 7:48 PM? 310 How many minutes are there between 3:36 PM and 7:46 PM? 250 How many minutes are there between 11:24 AM and 5:31 PM? 367 How many minutes are there between 7:40 AM and 5:28 PM? 588 How many minutes are there between 11:45 AM and 11:35 PM? 710 What is 260 minutes after 3:38 AM? 7:58 AM How many minutes are there between 10:41 PM and 3:27 AM? 286 What is 628 minutes before 5:31 AM? 7:03 PM How many minutes are there between 8:31 AM and 10:02 AM? 91 What is 578 minutes after 7:51 PM? 5:29 AM How many minutes are there between 8:18 AM and 2:13 PM? 355 What is 170 minutes before 11:25 AM? 8:35 AM How many minutes are there between 9:25 PM and 6:02 AM? 517 What is 243 minutes before 9:52 AM? 5:49 AM What is 625 minutes after 4:06 AM? 2:31 PM How many minutes are there between 7:18 AM and 2:54 PM? 456 What is 298 minutes before 5:30 PM? 12:32 PM How many minutes are there between 6:41 PM and 4:26 AM? 585 What is 300 minutes before 5:34 PM? 12:34 PM How many minutes are there between 5:00 PM and 11:40 PM? 400 What is 714 minutes after 4:23 AM? 4:17 PM What is 160 minutes before 11:04 PM? 8:24 PM How many minutes are there between 1:56 AM and 7:27 AM? 331 What is 446 minutes after 8:14 AM? 3:40 PM How many minutes are there between 1:48 AM and 11:45 AM? 597 How many minutes are there between 7:11 AM and 12:16 PM? 305 What is 260 minutes after 11:34 PM? 3:54 AM What is 42 minutes after 1:00 AM? 1:42 AM What is 300 minutes before 4:38 PM? 11:38 AM What is 663 minutes after 3:29 PM? 2:32 AM How many minutes are there between 1:20 AM and 10:08 AM? 528 What is 25 minutes before 3:14 AM? 2:49 AM How many minutes are there between 6:35 AM and 12:35 PM? 360 How many minutes are there between 11:59 PM and 10:42 AM? 643 How many minutes are there between 11:24 PM and 2:04 AM? 160 How many minutes are there between 5:01 PM and 4:19 AM? 678 How many minutes are there between 7:15 PM and 9:22 PM? 127 What is 286 minutes before 1:02 AM? 8:16 PM How many minutes are there between 2:25 PM and 2:19 AM? 714 How many minutes are there between 3:23 AM and 3:07 PM? 704 What is 470 minutes after 11:53 AM? 7:43 PM What is 82 minutes before 7:22 AM? 6:00 AM How many minutes are there between 8:43 AM and 6:34 PM? 591 What is 556 minutes after 4:02 AM? 1:18 PM What is 691 minutes after 2:12 AM? 1:43 PM What is 62 minutes before 8:43 PM? 7:41 PM What is 82 minutes after 2:34 AM? 3:56 AM How many minutes are there between 9:19 AM and 6:43 PM? 564 How many minutes are there between 3:03 PM and 8:25 PM? 322 What is 485 minutes before 5:43 AM? 9:38 PM How many minutes are there between 8:12 AM and 4:33 PM? 501 What is 428 minutes after 1:30 PM? 8:38 PM What is 14 minutes before 3:51 PM? 3:37 PM How many minutes are there between 6:38 AM and 1:50 PM? 432 How many minutes are there between 10:40 PM and 2:02 AM? 202 How many minutes are there between 4:54 AM and 12:46 PM? 472 How many minutes are there between 7:27 PM and 3:38 AM? 491 How many minutes are there between 1:11 PM and 7:39 PM? 388 What is 54 minutes after 1:40 AM? 2:34 AM What is 244 minutes after 10:43 AM? 2:47 PM How many minutes are there between 4:28 PM and 8:34 PM? 246 How many minutes are there between 3:00 AM and 11:52 AM? 532 How many minutes are there between 5:17 PM and 4:14 AM? 657 How many minutes are there between 3:20 PM and 1:27 AM? 607 How many minutes are there between 2:43 AM and 2:01 PM? 678 What is 195 minutes before 1:20 AM? 10:05 PM How many minutes are there between 1:14 AM and 4:45 AM? 211 What is 688 minutes after 9:34 AM? 9:02 PM How many minutes are there between 4:22 AM and 4:47 AM? 25 How many minutes are there between 9:31 PM and 7:15 AM? 584 How many minutes are there between 6:11 PM and 11:09 PM? 298 How many minutes are there between 10:18 PM and 12:57 AM? 159 What is 560 minutes before 6:54 AM? 9:34 PM How many minutes are there between 9:25 AM and 5:33 PM? 488 How many minutes are there between 3:47 AM and 10:18 AM? 391 How many minutes are there between 7:19 PM and 9:38 PM? 139 How many minutes are there between 7:48 AM and 5:21 PM? 573 What is 553 minutes after 3:41 AM? 12:54 PM What is 82 minutes before 12:30 PM? 11:08 AM What is 373 minutes after 10:02 AM? 4:15 PM How many minutes are there between 3:59 PM and 7:14 PM? 195 What is 372 minutes after 6:11 AM? 12:23 PM What is 583 minutes after 1:27 PM? 11:10 PM How many minutes are there between 3:29 AM and 1:26 PM? 597 How many minutes are there between 6:42 PM and 9:38 PM? 176 How many minutes are there between 10:33 PM and 4:15 AM? 342 How many minutes are t	{ "pile_set_name": "DM Mathematics" }
+ 3p4 - 2p*4). -4p*4 Expand 5m*2 - 5m*2 + 5m*3 + (4m*2 + 2m - 2m)(4 - m - 4). m*3 Expand (1 + 3 + 1)(11z - z - 2z). 40z Expand (-2g*2 - 5g*2 + 8g*2)(-g - g + 0g) - 2g*3 - 2g*3 + 2g*3 + (0g*2 - 2g*2 + 0g*2)(-3g + 7g - 2g). -8g*3 Expand (-34u + 10 - 10)(-2u2 - u2 + u*2). 68u*3 Expand (-5c2 + c2 + 2c2)(3c - c - c) + 2c*3 - 2c3 + c3 - 4c3 + 2c*3 - 4c*3. -7c*3 Expand (4 - 4 - 2)(-3y + 6y - 4y)(-2 - 1 + 4) - y + 5y - 3y. 3y Expand (12 - 7 + 0)(-2y5 + y5 + 0y*5). -5y*5 Expand 2x*3 - 2x3 - x5 + (-1 + 2 + 0)(-2x*3 - 2x*5 + 2x*3) + 4x*5 - 2 + 0x*5 - 3x*5. -2x*5 - 2 Expand 5y2 - y2 - y*2 + (0y + 3y - 2y)(3 + 2y - 3). 5y2 Expand (0f - 2f + f)(-25f2 + f2 - 7f*2) - 2f*3 + 4f*3 - 3f*3. 30f*3 Expand (-1 + 2 - 3)(2d4 + 3d*2 - 3d2) - 2 - d4 + 2 + (-8 + 1 + 1)(0d*4 - 2d4 - d4). 13d4 Expand -2q - q + 2q + (1 - 2 + 2)(-q + 0q - 2q) - 3q - 2q + 3q. -6q Expand (-9b - 2b - 41b)(-2 + 0 + 4). -104b Expand -2v4 + v4 + 3v4 + 4v - v*4 - 4v + (-3v + v + 3v)(4v - 4v + v3) + 3v + 2v4 - 3v - 2v4 + 2v4 + v4. 5v4 Expand (5 + 3 - 3 - 3)(-44z + 18z - 14z). -80z Expand 0 - 2 + 0 + 5o2 + (2o + 2o - 5o)(-3o + 2o + 2o). 4o2 - 2 Expand -37 + 5l*3 + 37 - 4l3 + l3 + 2l3 - 2l2 + l3 + 2l2 + 2 - 2 + l3 + (-1 - l2 + 1)(-l - 2l + l) + 2l*3 - 2l*3 + 2l*3. 10l*3 Expand (-2 + 4 - 1)(2v + 0v - 4v) - 3v + 2v + 2v - 15v + 102v - 50v. 36v Expand (11f2 + 12f - 12f)(-6f + 4f + f). -11f3 Expand (-6i*2 + 5i*2 + 3i*2)(2 - 2 + 2i) + (-6i*2 + 0i2 + i2)(-4i + 2i + 4i) + 0i3 - 2i*3 + 4i*3. -4i*3 Expand (0h*2 - 5h2 + h2)(-1 + 2h + 1) + (0h3 + 2h*3 + 0h*3)(-5 + 3 + 0) - 9h3 + 8h*3 + 2h*3. -11h*3 Expand -3k - 2k + 4k + (2 + 1 + 4)(-5k + 3k - 3k). -36k Expand (46f*3 - 20f*3 - 10f*3)(-1 - 2 + 1) + 4f3 + f3 - 4f*3. -31f*3 Expand (m - 3m + 4m)(5m4 + 0m + 0m + (0 - 2m*2 + 0)(6m2 - m2 - 3m*2)). 2m*5 Expand 11i*2 - 23i*2 - 17i*2 + (i + 2i - 6i)(-i + 0i + 0i). -26i2 Expand (3 - 2 - 3 + (-2 + 5 - 1)(-4 + 1 + 2) + 5 - 2 - 4)(15c - 4c - 4c) - c + 0c + 3c. -33c Expand (4 - 6 + 5)(0p4 - 2p4 + p4). -3p4 Expand (-9v*3 - 4 - 11v*3 - 2v*3)(0v2 + 4v*2 - 2v*2). -44v*5 - 8v*2 Expand (1 + 0 + 1)(-2t + 7 - 8 - t). -6t - 2 Expand 0j - 4j + 2j + (5 - 2 - 1)(2j - 2 + 2) + 9 + 7j - 9 + 2j + j - 4j + (-j + j - 2j)(-4 + 3 + 0) + 1 + j - 1. 11j Expand i3 - i4 - i3 + (6 - 1 - 3)(3i + 0i - i)(5i + 3i3 - 5i). 11i4 Expand (-2g*2 + 4g*2 - 3g*2 + (-2g + g + 3g)(6g - 4g + 2g))(3g2 - 4g*2 + 2g*2). 7g*4 Expand 5 - 5 + 2t*2 - 5t*2 + 3t*2 + 3t*2 + (4t + 0t - 2t)(-t - 2t + 2t) + (4t + 4t - 4t)(-3t + 4t - 2t + (-5 - 1 + 1)(-t + 3 - 3)). 17t*2 Expand -3g*5 - 2g*5 + 2g*5 + (-4 + 4 + 2g + (1 + 3 - 5)(-g + 3g - 4g))(-g*4 + 4g*4 - 4g*4). -7g*5 Expand -2r*2 + 10r*2 + 0r*2 + (-3r - 2r + 3r)(1 - 2r - 1). 12r2 Expand (-3a3 + a3 + 5a3)(2 + 2 - 5)(1 - 1 - 2) - 6a3 + a3 + 6a3. 7a*3 Expand (-2o + 2o + 2o)(-2o*2 + 0o + 0o) - o3 + o3 + 2o*3 - 144o - 146o + 1 + 292o - 5o3 - 5o*2. -7o*3 - 5o*2 + 2o + 1 Expand (-3j + 3j - 3j2)(-11j2 + 9j - 9j) - j4 + 2j*4 + 0j*4. 34j*4 Expand (f - 5 + 5)(-18 - 17 + 36 + 12f). 12f2 + f Expand n4 - 4n3 + 4n*3 + (2n*2 + 3n*3 - 2n*2)(n + n + 0n). 7n*4 Expand (4 + 1 - 4)(-2 + 2 - 2h) - 2 + 5 - 2h + h. -3h + 3 Expand (-9v + 9v - v)(v - v + v2). -v3 Expand (0 - 1 - 1)(3b + b - 6b) - b - 1 + 1 + 4b - 2b - 3b + (-3b - 5b + 5b)(0 + 3 - 4) - 1 + 3b + 1. 8b Expand 2 - 2 - 2x3 + x3 - 4x*3 + 2x3 + (-x2 + x2 + x3)(1 - 1 + 2) + (x - x + x)(3x2 - x2 - 3x2) - x3 - 1 + 1. -3x3 Expand (3r*2 + 3r*2 - 7r*2)(-6r + 7r + 6r). -7r*3 Expand -5f4 + f4 + 3f4 + (f3 + 0f*3 - 3f*3)(-2f - 3f + 3f) + 1 - f4 - 1 + (2f - 4f + f)(-2 + 1 + 4)(-3f*3 - 3f*2 + 3f*2). 11f*4 Expand 1 + 5 - r - 8 - 5r + 2r + r + (0 + 4 - 5)(r + 0 + 0) + 2r - 4r + r + 3r + 0r - 2r. -4r - 2 Expand (10 - 11 + 6)(-4n + 3n - n)(-n2 + n2 - 2n4). 20n*5 Expand (-j + 2j + 0j + (-3 + 0 + 5)(0j - 4j + 2j) + 3j + 0j - 4j + 3j + j - 2j - j + 0j - 3j - 3j + 5j - 3j)(-5j3 + 2j*4 - 2j4 + j4). -7j5 + 35j4 Expand (-k2 - k*2 + 3k*2)(-k + 4k + 0k)(-2 + 2 + 2). 6k*3 Expand (1 + 1 - 6 - b)(78 - 5 - 12). -61b - 244 Expand (1 - 4 + 0 + 3 + 2 - 3 + (-2 + 5 - 2)(-2 + 0 + 0) + 5 + 2 - 5 - 3 - 2 + 3)(-c - 2c + 2c). 3c Expand (-z + z + 4z2)(1 + 0 + 0)(-1 + 0 + 2). 4z*2 Expand (2i*2 - 5i*2 + 2i*2)(2i - 2i + 2i) - 2i*3 + 3i*3 - 2i3 + i2 - i3 - i2 + 2 + i + 5 - 5 - 2i3. -6i*3 + i + 2 Expand (3 - 2 - 2)(0o + 2o + 2o). -4o Expand (2s - 4s - s)((-1 + 3 + 0)(-2 + 3s + 2) + 6s - s - 3s) - 2s*2 - 2s*2 + 2s2 - s2 - 2s2 + 2s*2. -27s2 Expand (-h3 + 3 - 3)(-h + 2h + 2h)(-1 + 6 + 0). -15h4 Expand (-23 + 23 - 2c)(5c + 3c - 3c) - 4c2 + 0c*2 + 5c*2. -9c*2 Expand (0d - 2d + 3d)(-d - 3d + 2d)(16 - d - 16). 2d3 Expand (13 - 43 - 19)(-6 + 2 + 3)(-1 + 1 - 2i). -98i Expand (-3w4 + w4 + 3w4)(w + 0w + 0w) + w*3 - 6w*5 + 8w*5 + 12w*5. 15w5 + w3 Expand (-9 - 4 + 5)(-4 + 3 + 3)((-n*2 + 2n*2 - 3n*2)(-2 + 1 - 1) + 5 - 5 - 2n2). -32n*2 Expand 2v - 2v - v3 + (-3v - v + 5v)(4 - 4 - 2v2) - v3 + 0v*3 + 0v*3 - 12v*3 - 37v*3 + 13v*3. -40v*3 Expand (-44g + 4g - g)(-1 + 4 - 2). -41g Expand (4 - 1 - 5)(-2c + c + 3c)(-7c - 3c2 + 3c*4 + 7c). -12c5 + 12c*3 Expand (2u - 3u + 0u)(9u - 3u2 - 9u)(u + 3 + 1 - 3). 3u*4 + 3u*3 Expand (-o + o + 2o - 2 - 2o + 2 + (0 + 0 - o)(1 + 0 + 1) + 4 - o - 4 + 0o - 4o + 2o)(3o2 - 3o2 - o2). 5o3 Expand (-8 + 2 - 7)(-5a + 4a + 2a). -13a Expand 2l4 + 2l*4 - 3l*4 + (2l*3 - 1 + 1 + 2l*3 + 0 + 0 + (0l + 0l - 2l*3)(0 - 2 + 0))(4 + 3l - 4). 25l4 Expand (2a + 0a - a)(-2917 + 2917 + 67a). 67a*2 Expand (-4c + c + 4c)(5 + 1 - 4)((0c - 2c + 0c)(3 - 1 + 0) - 2 - 5c + 2). -18c2 Expand (-19a*2 - 17a + 6a + 13a)(-3a*2 + 2a*2 - 2a*2)(-a - 3 + 3). -57a5 + 6a*4 Expand (4u - 5u + 3u)(-8u + 19u + 9u). 40u2 Expand (-1 + 0 + 0)(-x*3 + 0x*3 + 2x3 + (-6 + 6 - x2)(2x + x - x)). x*3 Expand (3 + 1 - 3)(-2j + 3j + j)(9j*2 - 47j*2 + 19j*2) + 4j3 + j3 - 3j3. -36j*3 Expand 4r*2 - 2r2 - r2 + (5 - 2r - 5)(-3r - r + 3r) - 2r2 + r2 + 2r*2. 4r*2 Expand (-65b - 4595 + 4595)(2 - 2 + b2)(b - 4b + b) - b3 + b3 - b4. 129b*4 Expand 4b*2 + 3b + b*4 - 3b + (2b - b + b)(b*3 - 3b3 - b3). -5b4 + 4b*2 Expand (-2p2 + p2 + 0p2)(2p + 2p*3 - 2p) + (4p - p3 - 4p)(-p2 - p2 + 0p2) + p5 + 2p3 - 2p*3 - 2p*5 + 3p*5 - 3p5. -p5 Expand (-2o + 2o - 2o)(-5o + o3 + 5o) - 21o4 + 152o*3 - 152o*3. -23o*4 Expand (0 + 0 - 2l)(-2l*2 + 3l2 + l2) + 20l3 + 75 - 75. 16l*3 Expand (2 + q - 2)(-2q + 0q - 2q) + 6q*2 - 3q*2 - 2q*2 + (-4q + 4q - 2q)(-q - 1 + 1). -q2 Expand (-5y2 + y2 + 0y2)(-2y2 + 0y + 0y). 8y*4 Expand 1 + 2d - 1 + (-4d + d + 4d)(-1 + 1 - 4) + d + 1 - 1 - d + d + 2d + (0 - 2 + 0)(0 - 2d + 0) + 0d - 4d + 2d - 3d + 0d + 2d - 3 + 2d + 3. 4d Expand (-2 + y + 2)(-4y*2 + 4y2 + y2) + (-2y2 + y2 + 2y*2)(y + 3 - 3). 2y3 Expand (-s + s - 2s*4 + 0s*4 + 2s*4 - 4s4 + (-1 + 1 - s4)(12 - 2 - 4))(0s + 0s + s). -10s5 Expand (0h*3 + 0h*3 + 2h*4)(15 - 8 + 2) + 3h2 - h4 - 3h2 + (h3 + 0h3 + 0h*3)(1 - 1 + 2h). 19h*4 Expand (3v - 6v + 0v)(v2 + 5v - 3v2 - 2v). 6v3 - 9v*2 Expand (2q*2 - 5q2 + q2)(q - 2q + 0q)(4q - q - q). 4q*4 Expand 28i**5 - 83	{ "pile_set_name": "DM Mathematics" }
culate 14373700732 + 0.7509. 14373700732.7509 What is 27.082 - -2916215977.4? 2916216004.482 What is 1591144969 plus -297.17? 1591144671.83 What is -2 + 0.0597196159766? -1.9402803840234 Work out -163939 - -413.335845. -163525.664155 -1480315216 - 4949 -1480320165 What is -0.1 less than 11503.1211955? 11503.2211955 -0.5 + 76847.0036678 76846.5036678 Total of 60781270526927 and -6. 60781270526921 Work out 271.649 + -25586.4. -25314.751 Work out -870000.6727 - 85. -870085.6727 Total of -0.169552 and 385488. 385487.830448 Calculate 43509.986 - 205686. -162176.014 Add 18470368719579 and -3. 18470368719576 -371433363514 - -0.2 -371433363513.8 Put together -190736 and 216090.88. 25354.88 What is 132.53 + -61353034? -61352901.47 What is -10184234 - -1043228.9? -9141005.1 What is 0.3 take away 17.03333661845? -16.73333661845 What is the distance between -5411.2763 and 5860? 11271.2763 What is the difference between 29043.954 and -7624554? 7653597.954 Subtract -597.87 from 0.135009. 598.005009 Put together -0.2 and -54760727778. -54760727778.2 What is -0.5 plus -86041741168? -86041741168.5 -98 - 41517319814 -41517319912 Put together 1656953648.44 and -56. 1656953592.44 -32720031.6 - 367 -32720398.6 Total of -1.1468635 and -3346301. -3346302.1468635 Calculate -3.5248 - -100.1349. 96.6101 What is -25.27016 less than -11805715? -11805689.72984 46818228065 - -467 46818228532 What is 2334 less than -744.41838? -3078.41838 -16900590575+0.01 -16900590574.99 Subtract 4 from 3566280.3281. 3566276.3281 Work out -361 - 123923.293141. -124284.293141 Add together 1824.958456082 and 0.3. 1825.258456082 Add together -53753297 and -23847.2. -53777144.2 Total of 459008.535 and 26653. 485661.535 What is the distance between 465080857 and 26.7? 465080830.3 Add together 1139.053399611 and -0.3. 1138.753399611 What is -48 + 8400.36449112? 8352.36449112 What is the difference between 4 and -622308511131? 622308511135 Add together -2174 and 16.218213. -2157.781787 What is 169995965770 less than -0.4? -169995965770.4 What is -3319992213031 plus 0.052? -3319992213030.948 What is -55.391 + -70478093.8? -70478149.191 -21219784311634 + 0 -21219784311634 Calculate 16361.5321289 + -6. 16355.5321289 What is -0.18 plus 3167771298078? 3167771298077.82 What is 9096565010511 - -0.3? 9096565010511.3 What is 688266377987 + -2.7? 688266377984.3 Calculate -694164.4981 - -2.1. -694162.3981 What is 7.9544 plus -1517433355? -1517433347.0456 -0.4 + -153941880017 -153941880017.4 What is -2.57144767 - 2382? -2384.57144767 What is 0.312 minus 6.7966884342? -6.4846884342 What is the distance between -971295 and 2925164? 3896459 Calculate -42331826 + -27.3. -42331853.3 -1.79829988 + 252086 252084.20170012 Total of 8509878027 and -12.281. 8509878014.719 What is the difference between 2288792203 and -1864? 2288794067 What is 2 take away 0.533290068093? 1.466709931907 Sum 81474654.49 and -20. 81474634.49 What is -35.963 plus -4275781167? -4275781202.963 What is -71 minus 200392702470? -200392702541 Calculate 0.02109783243 + 5.9. 5.92109783243 What is -187454 - 0.639268? -187454.639268 What is -0.7731837286394 - -0.6? -0.1731837286394 Total of -0.34595 and -4574.51. -4574.85595 Add together -17556.744 and -16.5946. -17573.3386 Put together 185881536.26 and -105.1. 185881431.16 What is -751819.7072 - -1.4871? -751818.2201 What is 19916 minus -14627889? 14647805 Add 6.44 and -201666747. -201666740.56 Work out 16673567814 - 0.016. 16673567813.984 What is 20 less than -20.11269147? -40.11269147 What is -67.48299 - 151739? -151806.48299 Calculate 821 - 1692920136. -1692919315 Sum 8218.46 and -2234734. -2226515.54 -7604629201+-21 -7604629222 What is 0.01 plus -454098615463? -454098615462.99 Sum 260376900166 and -29. 260376900137 What is 1 less than -0.08140204673248? -1.08140204673248 Add together 28.0531 and 0.370973. 28.424073 Add together 349233128445 and -16. 349233128429 Calculate -1.9372 + 187393052. 187393050.0628 What is 424532.01 take away 1477446? -1052913.99 -32.8216341 - -28375 28342.1783659 What is 443505334141 + 0? 443505334141 What is -0.04 + 5534.275789? 5534.235789 What is the distance between -0.3 and -1.5510127056714? 1.2510127056714 What is -4937.8 take away 12928715? -12933652.8 Calculate -1.5 + -411536189712. -411536189713.5 -406621912 - -54 -406621858 Total of 11554278445 and 124. 11554278569 Calculate -0.2 + -228915329343305. -228915329343305.2 Add together 355844182865 and -2.8. 355844182862.2 Calculate -173425315703 - 4583. -173425320286 What is -83093897923 take away 6? -83093897929 What is 531382920953 + 0.4? 531382920953.4 Total of -36689.924 and -3501.6. -40191.524 -52314 + 4252196 4199882 What is the difference between 644178667 and -3845.5? 644182512.5 Work out -16 + -62759153501. -62759153517 Work out -879589 - 339884.8. -1219473.8 What is -1230907253 take away 1.98? -1230907254.98 What is 1782.02371512 minus -0.1? 1782.12371512 Work out 65 - 152935890413.3. -152935890348.3 What is -41383309574 take away 0.8? -41383309574.8 Total of 17.27 and -85309913. -85309895.73 Add -37247713550 and -0.3. -37247713550.3 What is 1.9 + 4589956453858? 4589956453859.9 What is the difference between 11444973024.6 and -0.038? 11444973024.638 What is -2750.8 - 3436970? -3439720.8 What is 1464.3263582 - -142? 1606.3263582 What is 0.34 take away 274.70636168? -274.36636168 What is the difference between -1 and -11362880066.7? 11362880065.7 Total of -351460663 and 260. -351460403 -4103 + -22544431 -22548534 Work out -0.01 + -287777366.92. -287777366.93 -60+337382207469 337382207409 What is the distance between -148277155628886 and -3? 148277155628883 2 + 968923316.19 968923318.19 3+4441.577259992 4444.577259992 What is 21344930800440 + 0.08? 21344930800440.08 Add -1957035 and 4799.8. -1952235.2 Add -0.000419 and -0.621736554. -0.622155554 What is -2660929469 + -0.08? -2660929469.08 What is -3791146466963 minus -1? -3791146466962 Total of -125580.452 and 2817.63. -122762.822 Total of 4046791629.53 and 46. 4046791675.53 Add together 2.59 and -35473856231. -35473856228.41 Work out -0.1160791 - 23148710. -23148710.1160791 Total of 72.1180924 and -23.3. 48.8180924 What is -1757383388540171 minus -0.5? -1757383388540170.5 Total of 7721452 and 1.1062483. 7721453.1062483 Calculate -49914183235.337 - 2. -49914183237.337 0.776474703+-4165 -4164.223525297 What is the distance between -3 and -29806812683205? 29806812683202 Total of -0.887386 and 353506. 353505.112614 What is -873348 + 478259? -395089 1.6 + 71687471055 71687471056.6 What is the distance between 0.59166 and -181568845? 181568845.59166 3 - 0.149355954191 2.850644045809 What is the difference between 0.2 and -46.21215423? 46.41215423 What is the difference between -7530752 and -23009.56? 7507742.44 What is 2075210946 take away 0.052866? 2075210945.947134 What is the difference between -16105 and -27481547? 27465442 What is 37075891 minus -0.0334? 37075891.0334 What is -63 minus 0.1481429572772? -63.1481429572772 What is -9796299895 + 2.23? -9796299892.77 7823932026 + -0.3 7823932025.7 Calculate 4 - -36898923921. 36898923925 Calculate -2709 + 95606657. 95603948 Work out -20177 + 0.6180654. -20176.3819346 -139859.1+-75766469 -75906328.1 What is the difference between -15462567389 and -1.15? 15462567387.85 Subtract -3.55 from 6009.947. 6013.497 Add 24.6978605 and -3.872. 20.8258605 4698 - 49941.452 -45243.452 What is -25166635.41 plus 9145? -25157490.41 -1066386091 - 338 -1066386429 What is 3159 plus 483683998? 483687157 20+2.301718433 22.301718433 What is the distance between -11596 and -29946655? 29935059 What is 1133.7755 minus 1892? -758.2245 What is 449096169146 less than -0.3? -449096169146.3 -5.2457+-343.32137 -348.56707 Work out -41481610 - -0.53076. -41481609.46924 Calculate 3838983025855 - -0.06. 3838983025855.06 Calculate 0.182 + -46167704513. -46167704512.818 What is the distance between -49377507124068 and 0.09? 49377507124068.09 Sum -825155.9 and 5.5893. -825150.3107 Work out -382354156909 - -22. -382354156887 Add together 57154 and -9442558. -9385404 What is -166.22 - 9970749? -9970915.22 Total of -8749787 and 94016. -8655771 Work out 1820.7 + -39755071. -39753250.3 Add 279966836120982 and 0.4. 279966836120982.4 What is 259 minus 1	{ "pile_set_name": "DM Mathematics" }
n = 654 - 358. Find the third derivative of 10i5 + 3i2 + i2 - 296 + n wrt i. 600i2 Let i(a) be the first derivative of 0a + 31/5a5 - 34 + 0a*4 - 10a*2 + 0a*3. What is the second derivative of i(f) wrt f? 372f*2 Let d(i) be the first derivative of 43i*4/12 - 25i*2/2 - 49i - 31. Let j(m) be the first derivative of d(m). Differentiate j(u) with respect to u. 86u What is the third derivative of 55p*2 - 127p*3 + 59p*2 + 0p + 174 + 0p - 113p2 wrt p? -762 Let l(d) be the first derivative of -d4/4 + 17d3 - 42d + 70. What is the first derivative of l(w) wrt w? -3w2 + 102w Let m(p) = 13p3 + 5p*2 - 6p - 4. Let b be m(4). Suppose -44 = 6a - b. What is the second derivative of 8c + ac4 - 140c*4 - 9c*5 wrt c? -180c3 Let b(y) = -y2 + 2y. Let g(s) = -201s*3 - 176s*2 + 2s. Let x(j) = -b(j) + g(j). What is the third derivative of x(p) wrt p? -1206 Let n(f) be the first derivative of 56f5/5 - f4/4 - f3 + 7f*2/2 - 168. Find the third derivative of n(h) wrt h. 1344h - 6 Let s = -4 + 21. Find the third derivative of -8 + 13 - 5 - 6r3 + sr*2 wrt r. -36 Differentiate 11z*4 - 13z*4 - 7z*4 + 233 - 25z*4 + 328 - 3z*2 with respect to z. -136z*3 - 6z Let s(g) be the first derivative of 4g7/7 + 4g*5/5 - 22g3/3 - g2/2 - 130. Find the third derivative of s(p) wrt p. 480p3 + 96p What is the second derivative of -33w3 + w3 - 12 - 73w + 25 - 13 - 4w2 wrt w? -192w - 8 Suppose y - 7 = 19. Find the third derivative of -35u2 + yu*2 + 21u*2 + 20u*5 wrt u. 1200u*2 Let s(f) be the third derivative of 17f*6/15 - 3f3 - f2 + 1. Find the first derivative of s(a) wrt a. 408a2 Let r be (4/3 + -1)91. Find the second derivative of -26g*2 - 19g*2 - 2g + r - g wrt g. -90 Let h = 33 + -29. Suppose hy = 4 + 4. Find the third derivative of 2k*y - 304k + 304k - 3k*4 wrt k. -72k Let d(f) be the second derivative of -11f6/15 + 3f*5/20 + 61f*2 - 46f + 2. Differentiate d(s) with respect to s. -88s3 + 9s*2 Let p be (1 - 5)/(-1 + -1). Differentiate 3m*2 + 20m*4 + 18 - 4m2 + mp with respect to m. 80m3 Differentiate -405 - 39r*3 + 462 - 53r*3 wrt r. -276r*2 Let c(l) be the second derivative of 7l*6/360 - 17l*5/120 - 13l*4/6 + 4l. Let h(q) be the third derivative of c(q). Differentiate h(m) wrt m. 14 Let k(q) be the first derivative of 20 + 14/3q3 + 0q*2 - 11q. Find the first derivative of k(b) wrt b. 28b Let w(y) be the first derivative of -3y6/40 - y5/15 + 3y2/2 + 11. Let b(n) be the second derivative of w(n). Find the third derivative of b(p) wrt p. -54 Let k(s) be the second derivative of s6/45 + s5/15 - s4/3 - 54s. Let q(c) be the third derivative of k(c). What is the derivative of q(n) wrt n? 16 Find the first derivative of -4n2 - 2n*3 - 163 + 293 - 331 wrt n. -6n*2 - 8n Let h(m) = m*3 + 10m*2 + 9m + 12. Let f be h(-9). Let g = 13 - f. What is the second derivative of -3 + 2 - 3r4 - 3r + g wrt r? -36r2 Let f(d) = 177d*3 - 263d*2 - 18d + 9. Let h(w) = -44w3 + 66w*2 + 4w - 2. Let c(p) = 4f(p) + 18h(p). Find the third derivative of c(j) wrt j. -504 Let s(x) = -x4 + x3 - x + 1. Let v(d) = 15d4 - 2d*3 - 91d - 5. Let k(r) = -5s(r) - v(r). What is the second derivative of k(h) wrt h? -120h*2 - 18h Let r(y) be the second derivative of -7y5/10 + y4/2 - 50y*3/3 - 15y + 3. What is the second derivative of r(t) wrt t? -84t + 12 Let j(f) be the first derivative of 9 + 0f*2 - 2f - 15/4f4 + 0f*3. Differentiate j(v) wrt v. -45v*2 Let d(k) be the first derivative of 33 - 31/6k*6 + 0k + 0k4 + 2/3k*3 + 0k*5 - 7/2k*2. Find the third derivative of d(a) wrt a. -1860a*2 What is the derivative of -107g*3 - 5g*4 + 4g*4 + 3 - 54g*3 - 1 + 1 wrt g? -4g*3 - 483g*2 Let a(o) = 3247o*3 - 228o*2 + 13o + 24. Let g(z) = 541z3 - 38z*2 + 2z + 4. Let v(b) = 2a(b) - 13g(b). Find the third derivative of v(d) wrt d. -3234 Let d(x) = -300x5 - 13x*2 + 310x - 13. Let n(i) = 75i5 + 3i*2 - 78i + 3. Let v(b) = 6d(b) + 26n(b). What is the second derivative of v(m) wrt m? 3000m3 Let g(y) = -232y*3 + 13y*2 - 26y - 70. Let x(q) = -116q3 + 6q*2 - 12q - 35. Let a(n) = -6g(n) + 13x(n). Differentiate a(s) with respect to s. -348s2 Suppose -2c - u = -4, u + 3 - 16 = -5c. Find the first derivative of 3n - 12nc + n - 4n - 27 wrt n. -36n2 Let w(s) = 13s*5 - 6s - 7. Let x(h) = -7h5 + 3h + 3. Suppose 60 = k + 74. Let n(l) = kx(l) - 6w(l). Find the second derivative of n(q) wrt q. 400q3 Let n(v) be the second derivative of -15v7/14 + v5/10 - 7v4/12 - v3/2 - 38v. What is the third derivative of n(y) wrt y? -2700y2 + 12 Suppose 0m - 3m + 87 = 0. Let c = m - 22. What is the second derivative of -28z*2 + 13z*2 - 11z*3 + 15z*2 - cz wrt z? -66z Let k = 1787 + -1784. Let b(u) be the third derivative of 1/6u*3 - 13/60u*5 + 0u + ku2 + 0u*4 + 0. Find the first derivative of b(m) wrt m. -26m Let h(o) be the third derivative of -o8/140 + o5/6 + 4o3 + 19o*2. Let x(b) be the first derivative of h(b). Find the second derivative of x(j) wrt j. -144j*2 Let t(v) = 661v*3 - 751v*2 + 13v + 13. Let p(s) = -330s3 + 376s*2 - 6s - 6. Let i(c) = 13p(c) + 6t(c). Find the third derivative of i(l) wrt l. -1944 Let f(b) be the second derivative of b*4/4 + 41b*3/6 - 59b*2 + 134b. Differentiate f(l) with respect to l. 6l + 41 Let j(r) = -97r*4 + 5r*3 + 13r*2 + 5r - 6. Let p(h) = -h4 - h3 - h + 1. Let q(k) = j(k) + 5p(k). Find the third derivative of q(o) wrt o. -2448o Let r(l) = 2l2 - 4l*4 - 18l4 + 3 - l2 - 5l2. Let i(t) = 23t*4 + 5t*2 - 2. Let u(k) = -3i(k) - 2r(k). Find the third derivative of u(y) wrt y. -600y Let r(b) = 58b2 + 42b - 7. Let q(k) = -116k2 - 85k + 15. Let v(a) = -6q(a) - 13r(a). Find the second derivative of v(h) wrt h. -116 Suppose 2p - w + 5w - 20 = 0, 29 = 4p - 3w. Find the third derivative of py5 + 7y - 14y + 2y*2 + 7y wrt y. 480y2 Let k be (-6)/(-5)50/3. Let n be k/30(-3)/(-2). Differentiate v - 4 - 1 + n + 0v wrt v. 1 Let j(l) = -15l6 - 5l*4 - 21l*2 - 3. Let o(k) = 10k*6 + 3k*4 + 14k*2 + 2. Let r(m) = 5j(m) + 8o(m). Find the third derivative of r(i) wrt i. 600i*3 - 24i Let l(g) = -154g3 + 5g*2 + 26. Let j(a) = 156a*3 - 5a*2 - 28. Let q(c) = 6j(c) + 7l(c). Find the third derivative of q(s) wrt s. -852 Let y(u) = 2u*3 + 2u*2 - 3u + 2. Let v = 31 + -30. Let s be y(v). Find the first derivative of 2z3 - 4 - zs + 2z*3 + 2z*3 wrt z. 15z2 Let y(l) = l2 + 4l + 2. Let d be y(-6). Find the third derivative of -db*2 + 11b*5 - 8b*5 - 5b*5 wrt b. -120b*2 Let k be 36/48 - 10/(-8). What is the second derivative of 14j*3 + 809 - kj - 809 wrt j? 84j Let g(u) be the third derivative of 19u6/60 + u5/10 + 2u3/3 + 88u*2. Find the third derivative of g(m) wrt m. 228 Find the first derivative of -14 - 18 + 4 - 69h - 28 + 5 wrt h. -69 What is the second derivative of 4n3 - 47n + 26n + 2 + 23n2 - n4 - 23n2 wrt n? -12n*2 + 24n What is the second derivative of 36c - 23c*2 - 41c - 32c2 wrt c? -110 Let w(g) = -10g - 9. Let m be w(-5). What is the derivative of m - 3 + 6c4 + 8c*4 wrt c? 56c*3 Let o be 23 - 3 - (1 + 3). Find the third derivative of -2m*2 + 23m*3 - om*3 + 17m2 wrt m. 42 Let u(k) be the first derivative of -k6/3 - k*3/3 + 29k*2/2 - 56. Find the third derivative of u(d) wrt d. -120d*2 Suppose 0 = 4w - 0 - 20. Suppose i - wi = -20. Differentiate -3b3 + b3 + i - 3b3 with respect to b. -15b*2 Let z(s) = -22s*3 + 2s*2 + s - 5. Let v(f) = 6f - 17f - f2 + 11f. Let n(t) = 4v(t) + 2z(t). What is the second derivative of n(x) wrt x? -264x Suppose m + 5 - 4 = 0. Let z(a) = -a2 + a + 1. Let r(f) = 5f*2 - 4f. Let t be (-1 - -4) + (-28)/4. Let q(j) = mr(j) + tz(j). Differentiate q(u) wrt u. -2u What is the derivative of -10d*3 + 20d*2 + 25d*3 + 3 + 1 - 14d*3 wrt d? 3d*2 + 40d Suppose 3k + 2k - 3 = 3*b, -b = k + 1. What is the s	{ "pile_set_name": "DM Mathematics" }
l*5 + (-l - l + l)(-2l4 + 3l*3 - 3l*3). 11l*5 + 6l*4 + 6l*3 Expand (3s*2 - 58 + 56 - 8s*2)(1 - 1 - s) - s*3 + 2s - 2s + (-s3 + 3s - 3s)(-4 + 4 + 1). 3s3 + 2s Expand (66 - 66 + 195w)(1 + 2 + 4w - 1). 780w*2 + 390w Expand (4u3 + 2u*4 - 4u*3 + (-3u - u + 2u)(-u + u - 2u3) + 3u*4 + 4u - 4u)(0 + 0 + 6u). 54u*5 Expand (-6c*2 + c - c)(c + 6 + 0 - 3c). 12c*3 - 36c*2 Expand (0g*2 + 0g*2 - 2g*3)(-3g2 + 0g2 - g2) + 16g5 + 2g*5 + 4g*5. 30g*5 Expand (3 + 2 - 2)(3525u - 3525u + 247u5). 741u5 Expand -o4 + 0o4 - o4 + (5o + 5o - 5o)(-o3 - o3 - o3) + 3o*4 - 10o*4 - 2o*4. -26o*4 Expand (-2 - 5 + 5)(q - q - 2q) + (2 - 2 + 3q)(80 - 567 + 7). -1436q Expand (0r + r + 0r)(6r + 0r - 2r + r - 4r + r + (13 - 1 - 2)(6r + 28 - 28)). 62r*2 Expand 2o + 0o - 8o - 3o - 11o + 2o + (1 - 1 - 2)(3 - 3 + o) + o - 4o + 5o. -18o Expand (0 - 4 + 3)(-5 + 2 + 5)(1 - 1 + u)(-18 + 8 - 7). 34u Expand (-2v*4 + 0 + 0)(-584 + 876 + 1380). -3344v4 Expand (-u2 + 14u - 14u)(15u2 - 38u*2 - 2u + 15u2)(0 - 2 + 0). -16u4 - 4u*3 Expand (-3t + 3t - t2)(4t - 5t*2 - 4t) + (-1 + 1 + 2t3)(-3t - 2 + 2) + t4 + 0t4 + t4. t*4 Expand (2t + 2 - 2)(2 - 2 + t2) - t3 + 0t*3 + 4t*3 + (8t*2 + 6t*2 - 25t*2)(-3 + 3 + t) - 5t3 + 3t*3 + 0t*3. -8t*3 Expand -39b*2 - 69b*2 + 22b*2 - 3b*3 + (3b*2 - 2b2 + b2)(0b + 3b - 2b). -b*3 - 86b*2 Expand (-3n + 2n + 5n)(7 - 4 - 2) + (-3 + 4 - 4)(0n + 0n + n). n Expand (-51v + 137v + 53v + 47v)(-3v2 + v2 + 3v2). 186v3 Expand (x2 + 5x2 + 2x*2)(-x2 + x2 + x*2 + (2x - 3 + 3)(11x + 16x + 4x)). 504x4 Expand (-2a*3 + 10 - 10)(1 + 13a2 - 46a + 46a). -26a*5 - 2a3 Expand -o2 - o2 + o2 + ((-4o + 5o - 2o)(-6 + 4 - 1) + 3 + 2o - 3 + (-3 - 1 + 2)(-4o + 4o + 2o))(-5o + 9o - 8o). -5o*2 Expand (2c2 - c2 + c*2)(-93 - 1 + 34). -120c2 Expand (24 - 24 + 61l)(6l + 8 + 8l - 16l). -122l2 + 488l Expand (3w - 16w - 61w)(w*2 + 0w*2 - 2w*2) + (-4 - 1 + 6)(0w3 + w3 - 2w*3). 73w*3 Expand 17 - 17 + 4b*3 + 0b*3 - 4b3 - b3 + (2b3 + 3b*2 - 3b*2)(6 - 1 - 4). b*3 Expand (-7 + 14w*3 + 7)(2w + w - 5w). -28w4 Expand (11d*4 + 3d*3 - 3d*3)(-9d - 43d + 5d + (0 + 0 + 2d)(-8 + 3 + 3) + 4 - 4 + d + 3d + 3d - 5d) + 2d5 + 2d - 2d. -537d*5 Expand (-3w + 6w - 2w)((-2w*2 + 0w + 0w)(-2w2 - 2w*2 + 2w*2) - 3w*4 + 0w*4 + 5w*4). 6w*5 Expand (-430 + 430 - 26c + 3c + 0c - 2c + (-3 + 1 + 0)(-2 - c + 2))(c2 - 7c*4 + 5c*2 - 7c*2). 161c*5 + 23c*3 Expand b + 5b - 5b + (4b + 0b - 2b)(142 - 19 + 30) - b + 2b + b. 309b Expand (0w*2 + 0w*2 - 2w*2)(-4 + 4 + 3w) - w3 + 4w*3 - 5w*3. -8w*3 Expand (23m + 0m + 25m)(-4 + 4 + 2m) + m2 + m2 - 6m2. 92m*2 Expand (7 - 3 - 17)(s*2 + 4s*2 - 4s*2)(1 - 4 + 4)(-1 - s2 + 1 + s). 13s*4 - 13s*3 Expand (1 - 4 + 4)(-1 + 1 - r) - 2r - 1 + 1 + (-9 - 1 + 2)(-3r - 3r - 17r). 181r Expand (12h + 5h - 6h)(-4 + 2 + 1)(1 - 1 - 2h). 22h2 Expand (3z*3 - 3z*3 - 4z*3)(-z - 2z + 5z)(0z + 0z + 3z) + 0z4 + 0z4 - z5. -25z5 Expand (-2h + h*2 + 2h + (-2h + h + 3h)(-5h + 2h + h) + 0h*2 - 4h*2 + 2h*2)(-h + 3h + h2 - 4h). -5h4 + 10h*3 Expand (2z - z - 3z)(2z - z - 2z) - 3z2 + 0z*2 + 0z2 + z2 - 2z2 + 3z*2 + (-4z + 5z - 3z)(z + 0z + z) - 219 + 219 - 41z2. -44z*2 Expand (-3k - 2k + 18k)(-1 + 2 + 2) - 2 + 4 + k + 0. 40k + 2 Expand (-6 + 27 - 4)(2 - 2 - g) + (-2 + 5 - 1)(-2 - 2g + 2). -21g Expand (5z5 - z5 + 5z*5)(1 - 3 + 0) + (-2z3 - 2z*3 + 3z*3)(-5 - 2z2 + 5) + 2z*5 + 2z*5 - 5z*5 + 3z5 + z3 - z*3. -14z*5 Expand (-c - 5 + 5)(-c*2 + 3c*2 - 4c*2) + (-c + 0c - 3c)(-5c2 + 3c*2 + 13c*2). -42c*3 Expand (2 + 2 - 3)(b + b + 0b) - 394b + 1552 - 1552. -392b Expand (-3k + 2 - 2)(-20 + 3 - 11). 84k Expand (36j - 21j + 26j)(3j + 0 + 0) - 2j*2 + 0j*2 + 3j*2. 124j*2 Expand (-2f + f + 0f)(1 + 1 + 3) + 4f - 2f + 0f + 1 - 3 + f + 4. -2f + 2 Expand (0g + 2g - 3g + 1 - 2g - 1 - g + 5g - 3g + (-2 + 3 + 1)(0g + 0g - 2g) - 4g + 0g + 3g - 4g + 2g + g)(4 - 1 + 10)(-7 + 3 - 2). 624g Expand -a2 - a2 + 4a2 + 2148a + 76a2 - 2148a + (-a + a + 2a)(-a + 2a + a). 82a*2 Expand (2m*2 + 4m - 4m)(-2m + 2m*2 + 2m) - 41m4 + 75m*4 - 41m*4 - 18m*2. -3m*4 - 18m*2 Expand (3t + 1 - 4t + 2t)(-49434t*2 + 49434t2 + t4 + 97t + (4t*3 - 5t*3 + 0t*3)(-1 + 2t + 1)). -t5 - t4 + 97t*2 + 97t Expand (2w + 2w - 6w)(-9w + 10 + 10 - 17)(-2w3 - 3w*3 - 3w*3)(-2 + 1 - 1). 288w5 - 96w*4 Expand (0c*4 + 0c4 + c4)(0c + c - 2c) - 3c*5 - 26c + 29c - 147c - 4c5 + 4c*5 - 2c*5 + (0c2 - c2 - c*2)(-4c3 - c3 + 3c*3). -2c*5 - 144c Expand (-66a + 854a + 909a + 704a)(-a3 + 0a*2 + 0a*2). -2401a*4 Expand (1 + 5 - 3)(-83l - 55l + 31l). -321l Expand (-g + g - 2g)(2 - 2 + g*2) + 27g*3 + 13g*3 + 22g*3. 60g*3 Expand (3x*3 + 3x*3 - 5x3 + x2)(0x + 0x + 2x + (-3 + 2 + 3)(-7x + 4x + x) + 4 - 4 + x). -x4 - x3 Expand -5a + 5a + a5 + (0a3 + a3 + a*3)(a*2 + 0a*2 + 0a*2) - 4a*3 + 4a*3 + 2a*5 + (4a*2 + 9a*2 - 10a*2)(-5 + 5 + 11a3). 38a*5 Expand (-14 + 2k + 14)(-2 + 1 + 2) + (-4 + 2 + 0)(5 - 1 - 3)(0k - 2k + 0k) + 26 - 18k - 26. -12k Expand (4 - 3 - 3)(-3 + 2i + 3) - 4i + i + 2i + 1 - 1 - i + 0i + 0i - i + (1 + 0 + 0)((6i - 2i + 0i)(4 - 1 - 7) + 1 - i - 1). -24i Expand 0d - 4d + 6d - 2d + d - 3d + 4d - 3d - 2d + (2d + 0d + 0d)(2 - 2 + 2) + d + d - 4d - d + d - 2d - 212d + 364d + 426d - 21d + 199d. 753d Expand (0u + 3u*2 + 0u)(4 - 5 - 3 + (0 + 0 + 2)(2 - 2 + 1))(-2 + 2 - 5). 30u*2 Expand 2h - 2h - 2h*2 + (-2h + 5 - 5)(0h + 4h + h) - 35 + 35 - 19h*2 - 3h + 2h - 1 + 2h*2 + 2h. -29h2 + h - 1 Expand (14n + n + 31n)(-2 + 2 + 1). 46n Expand (-730l*2 + 379l*2 + 408l*2 - 11l)(-2l*3 - 2 + 2). -114l*5 + 22l*4 Expand (11 + 6x - 11)(2x*3 - 3x3 - x3) + (-57x + 57x + 25x2)(-1 + x*2 + 1). 13x*4 Expand y - 5y + 2y + (3y - 5y + 0y)(-2 - 1 + 1) - 5y + 2y + y + 2 + 4y - 2 - 2y - 2y + 3y. 3y Expand (-9u3 + 14u*3 + 5u*3)(-1 - 1 + 7) - u*3 + 3u3 - u3 + (u - u - 2u2)(-2 + 2 + u) + (2u3 + 0u*3 - 4u*3)(0 + 3 - 6). 55u3 Expand (-3 + 3 - h)(-45 + 21 + 90). -66h Expand (-2l*2 + 0l*2 + 4l*2)(31 + 17 - 11)(-3 + 3 - 1). -74l2 Expand (h2 + 7 + 29654h - 29654h)(-2h - 2h + 2h). -2h3 - 14h Expand (0k + 2k - 3k)(5k - 3k - 5k)(-1 - 2k + 1) + (-2k*2 + 2k2 - k2)(0k + 2k + 0k). -8k3 Expand (2m*4 + 3m*3 - 3m*3)(-12 + 12 - 29m + (-6 + 4 + 1)(2m + 3m - 6m) - 5m - 16 + 16). -66m5 Expand (-2f*2 + 13f*2 + 6f*2)(3f - 2f + f)(0 - 2 + 0)(-3 - 3 + 4). 136f3 Expand (-3j - 2j + 6j + 0j + j - 3j + (-2 - 1 + 4)(-2j + j - j) + 0j + 0j - 2j - j - j + j + 0j + j - 2j)(3 - 6 + 1) - 3j - 4j + 6j. 13j Expand -2u + 2u - u2 + (-u2 + 40u + 0u*2 - 41u)(-2 - 2 + 6). -3u*2 - 2u Expand -g*4 - 4g*4 + 2g*4 + (11g*4 - 25g*4 - 25g*4)(-1 + 2 - 3). 75g4 Expand 0m - m + 0m + (-4 + 2 - 5)(-m + 5m + 5m). -64m Expand (-1 + 1 - 2)(-321n + 73n + 139n). 218n Expand (14 - 14 + 48z3)(3 + 3 - 7). -48z3 Expand -c - 4c + 0c + (4 + 0 + 2)(-c + 0c + 3c) + 2c + 0c + 0c. 9c Expand (-10m - 3 + 3)(-38m + 48 - 48)(-3m + 3m + 2m). 760m3 Expand 0 + 0 + h2 + (-11 - 14 + 28)(0h + 3h2 + 0h). 10h2 Expand (1 - 5 + 3)(3g3 - 6g*3 - 11g*3)(-36 + 36 + 8g). 112g4 Expand (-z3 - 3z + 3z)(2z*2 - 2z*2 + 2z*2) + 4z*5 - 3z*5 + 0z*5 + (-z + 2 + 0 + 0z)(-154 + 154 + 76z*4). -77z*5 + 152z*4 Expand ((2w*2 - 3w*2 + 4w*2)(4w - 6w + 4w) - 4w*3 + 5w*3 - 2w*3)(4 - w + 3 - 2w). -15w**4 +	{ "pile_set_name": "DM Mathematics" }
ch is the nearest to x? (a) j (b) -4/7 (c) 5 b Suppose m = -0 - 1. Let g be ((-5)/(-30))/(2/(-6)). What is the nearest to g in -4/9, 1/6, m? -4/9 Let d = -21 - -27. Which is the closest to d? (a) 2 (b) 3 (c) -0.2 b Let a = -15 - -15.3. What is the nearest to a in 1, 0, 4? 0 Let x = 0.03 + 1.97. Let t = 4 + 1. Suppose -16 = -tl + l. Which is the nearest to x? (a) l (b) -4 (c) 0.4 c Let o = -3 + 3.1. Let k(c) = -2c*3 + 4c*2 - 2c + 1. Let h be k(1). What is the closest to h in o, 0.2, 3? 0.2 Let p(d) = d*2 + 6d + 10. Let n be p(-5). Which is the closest to 1? (a) -4 (b) n (c) -1/7 c Let u(h) = h*3 + 5h*2 - 5h + 6. Let m be u(-6). Let o = -47 - -46.9. Which is the closest to m? (a) o (b) -0.3 (c) 3/5 a Let i = 0.39 + 0.01. Let k(g) = g*3 - 4g*2 - g - 22. Let f be k(5). Which is the nearest to -1? (a) 1 (b) f (c) i b Let y = -1 - -2. Suppose -10 = -2n + 5p, -p - 9 = -4n + 11. Suppose z = -ng - 13, -y = z - g - 0. Which is the nearest to -2/7? (a) 2/11 (b) z (c) 0.3 a Let u = 4 + 1. Let m = u - 2. Let g = 0.1 + -0.2. What is the closest to g in m, 0.5, -3? 0.5 Let w = 8/17 + -49/68. Let r = -17 + 14. What is the closest to w in -5, 0.1, r? 0.1 Suppose -2r + 8 = -4r - 4k, 0 = 2r + k + 2. Let j be 1/(-2)(-3)/12. What is the closest to r in j, 1, -3? j Let d = -0.33 - -0.03. Let m be 27/(-18)(-1)/(-3). Let v = 2/395 + -318/395. Which is the nearest to m? (a) v (b) d (c) -5 b Let t = -0.963 + -0.037. What is the nearest to t in -2/17, -5, 5? -2/17 Let z = -0.24 - -0.24. Let x(k) = -k3 - 5k*2 - 2k - 6. Let f be x(-5). Let w = -1.11 + 0.11. Which is the closest to -3? (a) w (b) z (c) f a Let w = 1.93 + 1.07. What is the nearest to 2/3 in 1/8, -2, w? 1/8 Suppose d = -d - 2. Let r = -0.78 + 0.68. Let s = -4 - 1. Which is the closest to r? (a) s (b) -2/5 (c) d b Let g = -31 + 31.5. What is the nearest to 2 in -2/15, 2, g? 2 Suppose 0 = -5g + 11 + 4. Suppose -2p - go = -5, -o = -2p + 4 + 5. Let h = p + -6. Which is the closest to -0.2? (a) 4 (b) 0.1 (c) h b Let m = -108 + 112. What is the nearest to 1 in m, -0.4, 2/9? 2/9 Let o = 55 - 58. What is the nearest to 0 in -15, -0.2, o? -0.2 Let j = -2.7 + 3. Which is the nearest to -2? (a) -3 (b) -3/7 (c) j a Let m be -6 - (-2 - -2)/1. Let y be 6/(-8) - 4/m. Let u = 2 + -3. What is the closest to u in 0.3, -0.4, y? -0.4 Let w = -17.2 - -17. What is the nearest to w in 3/4, 1/3, -1? 1/3 Let b = 57 - 56.5. What is the nearest to -2 in b, -4, -0.2? -0.2 Let u(f) = f*3 - 3f*2 - 2f + 3. Let r be u(3). Which is the closest to 0.1? (a) r (b) 5 (c) -0.09 c Let o = -5 + 23. Let r be (4/(-2))/((-60)/o). Let k = -5 + 9. Which is the closest to 1/3? (a) r (b) k (c) 0.4 c Let m = 523/65 + -41/5. What is the closest to -1 in 3/5, m, 1/2? m Suppose 0 = -3n + 5c - 10, 3c = -2n - 2c + 10. Suppose -2 = 4p + 2t + 4, n = p - 3t + 19. What is the closest to 0 in p, 1, -0.4? -0.4 Let t = -53/12 + 11/3. Let f = -92/469 + -6/67. What is the nearest to 0.1 in -2, t, f? f Let n = 866/15 + -288/5. Which is the closest to 0? (a) 2 (b) 1 (c) n c Let y be 48/(-462) - 4/(-14). Suppose 0 = d + d + 2. Which is the closest to d? (a) -4/5 (b) -2 (c) y a Let s = 2.16 + -0.16. Which is the closest to 0.1? (a) s (b) -0.4 (c) -1/7 c Let g = 3 - 2.5. Let v = 22.83 + -23. Let m = -0.07 - v. Which is the closest to m? (a) 2/3 (b) g (c) 4 b Let u = -21/65 + -1/13. What is the nearest to u in 0, 0.2, 5? 0 Let d = -9 - -9.1. Which is the closest to 1/3? (a) -1 (b) -6 (c) d c Let y be (-3)/117-3(1 + 1). What is the nearest to 9 in -3/7, -2/3, y? y Let i = 1 - 0.5. Let t = -20 + 19. What is the nearest to t in -2, -4, i? -2 Let r = 102 - 106. Which is the closest to -1? (a) 0 (b) r (c) 1/12 a Let i = -77.7 + 84. Let k = 1.3 - i. Let o = -5.5 + 6. What is the nearest to -1 in k, 2/9, o? 2/9 Let x = -0.2 + 0.4. Let m = 2/97 - 200/291. Let i = -0.2 - 0. What is the closest to -2/3 in i, m, x? m Let k = -13 + 14. Which is the closest to 0? (a) k (b) -2 (c) 0.1 c Let r = 14 - 10. Let y = 159/5 - 32. Which is the closest to -2/5? (a) r (b) y (c) -0.5 c Let n = 0 + -0.1. Suppose 0 = -3l - 3 - 3. What is the nearest to n in 5, l, 0.3? 0.3 Let p = -0.4 + 5.4. What is the closest to 1/4 in -0.4, 18, p? -0.4 Let i = 0.11 + -0.51. Let p = -0.4 - i. What is the nearest to -2 in p, 1, 3/7? p Suppose 0 = -0x + 2x - 2. Let y = 4 + -11. Let m = y + 6. Which is the closest to x? (a) m (b) -5 (c) 5 a Let v be -3((-4)/6 - 0). Suppose -va + 75 = -a. Let f = -676/9 + a. What is the nearest to -1 in 1/2, f, -3? f Let c = 28 - 27. What is the nearest to 0 in 0.03, c, -4? 0.03 Let h = -0.08 - 2.92. Let u be 1/(-3) + (-19)/(-117). Let i = u - 2/39. What is the closest to 1 in h, i, -4? i Let s = 4.6 + 0.4. Let h = s + -9. What is the closest to 1 in h, -0.3, -2/7? -2/7 Let o = 125 + -121. Which is the closest to 2? (a) 1/5 (b) -0.1 (c) o a Suppose 0t + 4t = 4. What is the closest to t in -0.3, 1/11, -3/8? 1/11 Let h = -16 + 15.7. Let c = 0.8 - 1. What is the closest to 0 in h, c, -0.5? c Let x = -32 + 28. What is the closest to -1 in 0, 5, x? 0 Let v = 1.1 + 5.9. Let h = v + -6.7. Let p = -66.1 - -66. What is the closest to p in -4, h, 1/7? 1/7 Let f = 15 + -13. Let a = -2/541 + -1064/4869. What is the closest to f in 1/5, 2, a? 2 Let j be (-6)/(-4) + (-55)/50. Let z = 3 + -7. Which is the closest to j? (a) -1/2 (b) z (c) 3 a Let o = -2.2 + 1.2. What is the nearest to 1 in -0.1, o, 0.3? 0.3 Let v = -10 - -10.02. Let y = 0.48 + v. Let r(f) = -f2 - 6f - 4. Let g be r(-6). Which is the nearest to 0.1? (a) g (b) y (c) 5 b Let f = -194 - -321. Let p = f - 124.06. Let h = -0.06 - p. Which is the nearest to 1? (a) h (b) 1 (c) -3/8 b Let t = -0.286 + 0.086. Which is the nearest to 5? (a) t (b) -0.4 (c) 0.2 c Let m = -4 + 0. Let h = -21.6 - -22. Let y = -1 - -1. What is the nearest to y in m, -2, h? h Let s = -0.04 - -3.04. Which is the closest to 0.1? (a) s (b) 2/11 (c) -3 b Let r = -3 + -4. Let g(u) = -u*3 - 8u*2 + 0 - 12u + 0 + 5u. Let m be g(r). Which is the closest to 2? (a) -3 (b) m (c) 2/3 c Let s(i) = 2i*3 + 2i*2 + 5i + 3. Let z be s(-1). What is the closest to z in 1/7, -0.2, 3/7? -0.2 Let v = -0.73 + -1.27. Let t = -1.1 - -0.8. What is the nearest to v in 0.5, -5, t? t Suppose 3z + 6 = 5z. Which is the nearest to -1/2? (a) z (b) -2/3 (c) 3/2 b Let z = 0.33 - -3.67. Which is the nearest to -0.1? (a) z (b) -0.1 (c) 0 b Suppose -35 = -z + 6z. Let p be (z - -5)(-1)/2. Let i = 0.9 + 0.1. Which is the nearest to p? (a) i (b) 0.4 (c) 5 a Let x = 0.112 - -0.088. What is the nearest to -0.3 in x, -0.3, 13? -0.3 Let s = 0.1 - -0.2. Let y = -30 + 26. Which is the closest to s? (a) 0.3 (b) y (c) -1 a Let p = 0.4 - 0.1. Let v = -0.75 - 0.25. What is the nearest to v in p, 2, 0.5? p Let v = -1697/7 - -243. Let d = -5 + 3. What is the closest to v in 4, d, -0.3? -0.3 Let x(i) = -i*2 - 8i + 6. Let g be x(-9). Let j be ((-2)/4)/((-1)/g). Let v = 0.01 - -1.99. Which is the closest to 0? (a) j (b) v (c) -1 c Suppose -4z + 4l = -12, 2l - 4l - 12 = 4z. What is the closest to z in -3, -0.1, -3/2? -3/2 Let s = 2.5 - 2. Let m = 0.08 - 1.08. Which is the closest to -1? (a) 3 (b) s (c) m c Let o = -31 + 34.8. Let v = 1.2 + o. Let y = 0.93 - 0.63. What is the nearest to 0 in y, -1, v? y Let g = 3.021 - 0.021. Let o = 5 + -5. Which is the closest to o? (a) 5 (b) g (c) 4 b Let m = -52.6 + 53. Which is the nearest to 0? (a) -5 (b) -1/2 (c) m c Let z = -0.5 - -0.4. Which is the nearest to 4? (a) z (b) 1/3 (c) -0.5 b Let v = -2 - 11. Let j = -12.5 - v. Let h = -3 + 17/5. Which is the nearest to -1? (a) j (b) h (c) 1 b Let z = 3.2 + -3. Let g = 0.049 - -3.951. Which is the closest to 0? (a) z (b) -2/7 (c) g a Let m = 73 + -68. Which is the closest to 2/3? (a) -2 (b) 4 (c) m a Let u = -0.01 - -3.01. What is the closest to 1 in -0.2, u, 3/4? 3/4 Let m = -428/5 - -85. What is the nearest to -1 in m, 4, 0? m Suppose 4r = -0*r. Let z = -0.11 - -0.21. What is the nearest to r in -0.5, z, -0.3? z Let j = -13.8 + 14. Which is the nearest to 3? (a) -2/5 (b) -2/7 (c) j c Let d = -0.1 - 4.9. Let z = 6 - 3. Let p = z -	{ "pile_set_name": "DM Mathematics" }
f)/f) assuming f is positive. f(-379/22) Simplify ((u(-4))(3/13)(u*(-4)u)/(u*(-2/5)u))13 assuming u is positive. u(-294/5) Simplify ((p/p(-1/36))(-1/28))(1/16) assuming p is positive. p(-37/16128) Simplify (m(-2/5)/m)(-2/37)((mm/m*(-2/5))/mm)(4/3) assuming m is positive. m(606/185) Simplify ((g*(-7/2)/g)/g)/(g(g*3/g)/g)(ggg/(g*(-2/75)gg))/((g(-13/5)g)/g) assuming g is positive. g(-581/150) Simplify (d(4/11))(-50)/(d(-2/7)dd(-1/18)) assuming d is positive. d(-26113/1386) Simplify (s*13ss7)(-5/4) assuming s is positive. s(-105/4) Simplify (l(2/43))(-29)/(l(-1/9)/(l/(l/(ll/(l*(-16)/l)l))l)) assuming l is positive. l(7648/387) Simplify (((gg*2/gg)(5/2))(-2/71))*0 assuming g is positive. 1 Simplify (((kk(3/11))/k)/(k(-1/20)/k))(2/13) assuming k is positive. k(291/1430) Simplify (qq(-16)q)/(q*14/q)q*(-9)/qq/((q/q*21q)/q)q assuming q is positive. q(-15) Simplify ((r(-3)/(r/(r(-3/4)r)))(-16))(-3/2) assuming r is positive. r(-90) Simplify j/j(3/37)jj*(-16)(j/(((j/j20)/j)/j))(-3/5) assuming j is positive. j(-5047/185) Simplify (f(-2/3))(-1/4)/((f/(f(1/11)f))/(f/f(-4/7))) assuming f is positive. f(845/462) Simplify ((mm*(-3/5))/mm(-2/3))/((m9/m)/(m*(-7)m)) assuming m is positive. m(-229/15) Simplify ((a6/a)18)(1/11) assuming a is positive. a(90/11) Simplify m7m/((m/(m(2/9)/m))/m)m*(2/57)m(1/4) assuming m is positive. m(5135/684) Simplify (((f/((f*(2/5)f)/ff))/(f(-3/4)f))(-2/27))22 assuming f is positive. f(143/135) Simplify x4x4x/((x*(2/17)/x)/x)x((x(-4)x)/x)/x assuming x is positive. x*(117/17) Simplify ((aa(-3/4))/a(-20))/((aa(-7/4))/a)(-2/73) assuming a is positive. a(5899/292) Simplify nnnn*(-2/3)nnn*(-23)(n(-3))(-1) assuming n is positive. n*(-47/3) Simplify (((h/(hh*(-5)))/hhh)/h(hhh*(-17)h)/h)/(h(-21)/h(-1/24)) assuming h is positive. h(263/24) Simplify ((c/c(-12))/(c11/c))/(c(1/13)c(-3/8)c) assuming c is positive. c*(239/104) Simplify v/(((vv*(-2/5))/vvv)/v)v*1/vvv2v(-1) assuming v is positive. v(12/5) Simplify (tt/(t/(t/(tt((t/(tt*(-7/3)))/t)/tt)))t7(t(t(t(t/(t(1/5)t)t)/t)/t)/t)(2/7))(-22) assuming t is positive. t(-13618/105) Simplify f((((f*(-3)f)/f)/f)/f)/ff(2/9)(f(f12f)/f)/f2 assuming f is positive. f(56/9) Simplify (y/((yy/y(-10))/y))/(yy*(-1/4))y*(-3/26)y*(-14)yy assuming y is positive. y(-1189/52) Simplify ((w(10/9)w)/(ww(-4/5)))/((w/w(-2)w)/(ww(2/5)w)) assuming w is positive. w(14/45) Simplify (((f/f(-2))/f*(-7/2))/((ff*(1/2))/f(f/(ff(3/7)))/f))28 assuming f is positive. f208 Simplify (d/(dd/d*(1/2)dd))(-4/9)/(ddd(-1/12)(dd(-20))/d) assuming d is positive. d(691/36) Simplify ((r(7/8)/r(1/6))(4/3))(-2/3) assuming r is positive. r(-17/27) Simplify (h/h1)/(((h/(h/(h/h(-24))))/h)/h)(hh(-2/19))/h3 assuming h is positive. h(-477/19) Simplify (i(-2/9)/i(-3/4))/(i(-4/5))(-20) assuming i is positive. i(-557/36) Simplify (ww*(2/3)w/(ww(-5))w)/(w/(www*(-3)w))3 assuming w is positive. w(14/3) Simplify (dd17d)/(dd/(d/(d/d(1/5)dd)d))(d18d)/d(-8/5) assuming d is positive. d(184/5) Simplify ((((s(-1/2)/s)/s)/(s(-7)s))1)(-6) assuming s is positive. s(-21) Simplify ((x(-10)(x/((x4/x)/x))/x)33)(25/6) assuming x is positive. x(-1650) Simplify (hh2)(-29)h*9/(h/((h/(hh*(2/19)h))/h)) assuming h is positive. h(-1541/19) Simplify (o(-4)/o)*30/(ooo(-5)o)(-2/81) assuming o is positive. o(-12154/81) Simplify ((j(3/13)/j(-6))32)(1/23) assuming j is positive. j(2592/299) Simplify (a12/a(-4/3))/(((a8/a)/a)/(a/a(5/4))) assuming a is positive. a(85/12) Simplify ((x*5x(x(1/6)/xxx)/x)/(xx/(x/(x/x*(2/15)x))x(-2)))(1/4) assuming x is positive. x(53/40) Simplify (t/t(-5/6))(-44)/(t21t3) assuming t is positive. t(-314/3) Simplify ((c*(23/4)c(-7))20)(-12) assuming c is positive. c300 Simplify (((tt/(tt(-4)))(2/39))(-2/41))(1/56) assuming t is positive. t(-5/22386) Simplify ((n(-9)n(-2/17))/(n(-2/5)n)15)25 assuming n is positive. n(-7700/17) Simplify ((a/(a/(a/(a/(a11aaa))))a)/a(18/11))/(((a(-13/4)/a)/a)/aa(-1/43)) assuming a is positive. a(37153/1892) Simplify (d/(dd*(2/3))d(-10/9))/(d/d(5/2))(4/11) assuming d is positive. d(-122/99) Simplify r/(r(rr*(-1/28))/rrr)r/(rr(-1))(r(((((r/r(-1/31))/r)/r)/r)/rr)/r)/(((r(-19)/r)/r)/r) assuming r is positive. r(16551/868) Simplify v/(v/(((vv/(v/(v/v(-2/17))))/vvv)/vv))v16vvv(-13)/v(7/2) assuming v is positive. v(157/34) Simplify ((c6c(-6))/(((c/((c/(c(-3/5)c))/c))/c)/(c/c(-6))))(4/3) assuming c is positive. c*(44/5) Simplify (rr/r*(-2/15)rr)/r(-20)r/(((r/r*(7/3)r)/r)/r)(rr/(rr/(rr*(6/13)))rr)/r assuming r is positive. r(5836/195) Simplify hh/h*(-27)h/(h*(-1/28)/h)h/((h*(1/9)h)/h)h(-26/5) assuming h is positive. h(33673/1260) Simplify uu*13uuu/(((((u/(u*(9/7)u))/u)/u)/u)/u)uu(uu/u*(-3))/u(uu/(u(-1/15)/u))/u assuming u is positive. u(3187/105) Simplify (b(-7))(-3/20)/(b(3/4))(6/19) assuming b is positive. b(309/380) Simplify (u6)(-2/93)/((u(4/7)u)/(uu(1/22))) assuming u is positive. u(-3127/4774) Simplify (((ppp(pp(-13))/p)/p)/(p/p26))/(p(2/23)((p*(12/7)p)/p)/p) assuming p is positive. p(2125/161) Simplify (x(8/7)/x*8)/(x(x/x*(1/2))/xx)(-8/5) assuming x is positive. x(-156/35) Simplify (ss(-5/8))/(s/s(2/7))s/(s/s*(-8))ss(-1/3) assuming s is positive. s(-1289/168) Simplify ((nnn(-1/8)nnn/n*(-2/7))/((nn(n/(n/((n/n(-4/5))/nn)))/n)/((n/n4)/n)))(10/7) assuming n is positive. n*(-459/196) Simplify (((uu/u*(-5)u)(-30))23)20 assuming u is positive. u(-110400) Simplify (h(-1/16))(6/11)/(h(-1/4)/(h/h(-3)h)) assuming h is positive. h(459/88) Simplify (((n/(nn/(nn/(n1/n))))/n)(-6)(n(n(n*0nn)/nnn)/n)(-10/3))(-2/51) assuming n is positive. n(80/153) Simplify (i(-6)/ii/(ii6)iii*(1/2)ii/(i/(iii(4/5)iiiii)))(-12/5) assuming i is positive. i(102/25) Simplify ((v/((v/(v(v/(v(v*27v)/v))/v))/v))(-7/3))(9/4) assuming v is positive. v*(273/2) Simplify ((y(y/(y*(-4)y)y)/y)/((y/y(3/2))/y))/(y/y(-1/3)y(-10)) assuming y is positive. y(91/6) Simplify ((((s/s*(1/3))/s)/s)/s)/(((s(s/(ss7)s)/s)/s)/s)(s/(s/(s/s(-2/31)))s)/ss(-1/17) assuming s is positive. s(10549/1581) Simplify (m/(m/(mm/(mm(3/8)m)m)mm))/m3(m/((m/(m2/m))/m))32 assuming m is positive. m(477/8) Simplify (((m/m(3/11))/mm)/m(13/3))/(m1)50 assuming m is positive. m(-1769/33) Simplify ((ww(-18/7))/(w(-3/13)/w))(-32) assuming w is positive. w(992/91) Simplify (p(8/3))(-1/6)p/(pp*(-2/27))p/(pp7) assuming p is positive. p(-199/27) Simplify (q(2/5)qq7qq(q/q*(-1/2))/qqq/q(1/4))(2/147) assuming q is positive. q(253/1470) Simplify (q(q*(2/31)q)/q)/(q/q*(-2/5))(q*(-1/5)q)(1/2) assuming q is positive. q(2/31) Simplify t7/t(-2/9)t(2/5)(t/(ttttt/t*(-15)tt))/t assuming t is positive. t(-647/45) Simplify (((y(-1/5)/y)(1/28))28)(-14) assuming y is positive. y(84/5) Simplify ((s/((s/(s(((s/(s(s/(((ss*(-16))/s)/s))/ss)s)/s)/s)/ss))/s)sss(-5/4))7)(-33) assuming s is positive. s(15015/4) Simplify (x(2/27))(10/11)/(x(-1/34))(-2/17) assuming x is positive. x(5483/85833) Simplify ((b0b)/b)*(2/31)(bb3)(-5/3) assuming b is positive. b(-20/3) Simplify (((w/((ww/((w/(ww6ww)w)/w))/ww))/(w(-3/5)w))/((w(4/9)/w)/w(-4/7)))(-5/4) assuming w is positive. w(1483/126) Simplify j*(-3/7)j((jj*(-2/11))/j)/jjj/(jj*(4/7))j12 assuming j is positive. j(130/11) Simplify ((q/q*5)/qqqq(qq*17q)/q)/(((q*(20/3)qq)/q)/q8) assuming q is positive. q(49/3) Simplify (ww*(-14)(w/((ww(1/5))/w))/w)/((w20/w)/(ww	{ "pile_set_name": "DM Mathematics" }
m)(-7 + 3 + 2)(13 + 16 + 33). 744m Expand -l + 1 - 4l*3 - 2l*2 + 4l2 + l3 + 1588 - 59l3 - 1588 + (-2l2 - l2 + l*2)(4l - l - 2l). -64l3 + 2l*2 - l + 1 Expand (-5w*2 + 4w*2 + 3w*2)(2 - 6 + 1)(-17 + 8 - 13)(4 + 11 - 2). 1716w2 Expand (-354 + 314 - 737)(4r2 - 2r2 - r2)(-1 + r3 + 1 + (0 + 0 - 3r*2)(-r + 2r + 0r)). 1554r5 Expand 6f - 3f - f + (3 - 2 - 4)(121365 + 364f - 121365). -1090f Expand -3 - 47f + 75f - 6f - 5 + 5 + 3f + (-4f + 5f - 3f)(0 - 2 + 3). 23f - 3 Expand (0y + 0y - y)(-3y + 3y - 2y2) + y3 + 2669y + 2 - 1088y - 1083y. 3y3 + 498y + 2 Expand (3 - 4 + 2)(-3z + z*2 + 3z)(-101 - 103 + 57)(-4 + 0 + 2 + (-2 + 1 - 1)(-2 - 1 + 1))(-2 + 2 - 2). 588z2 Expand (4v - 5v + 3v)(3 + 3 - 4) - 4 + 4 - 10v + (0 - 1 + 4)(-44 + 42 - 130)(-1 - 2v + 1). 786v Expand (-2q3 + q3 - q3 + (5q*2 - 2q*2 - 4q*2)(-2q - 6 + 6) - 4q + 4q + q3)(4 - 4 + 2)(4q + 2q + 10q). 32q4 Expand 14 - 14 + i + (-44i - 37i + 29i)(3 - 1 - 3)(10 - 2 - 1). 365i Expand (-r - 6 + 0r + 2)(674r - 1758r + 409r) + (3 - 3 + 2r)(-r - 2 + 2) - 4r2 - r2 + 6r*2. 674r*2 + 2700r Expand (3k2 + 10k*2 - 2k*2)(827 + 79k2 - 827). 869k*4 Expand (1 - 4095496z + 4103335z - 1)(0z + 2z - z). 7839z2 Expand (-200 + 200 + 402k)(1 - 1 - 2k2 + k + k2 - k + (2k + 4k - 4k)(-5 + 5 - 2k) - 2k + 2k - k2). -2412k*3 Expand (-5 + 5 + 2s*2)(-69 + 35 - 125 + (3 - 5 + 0)(2 + 1 - 7))(-1 + 2 + 0)(3 - 3 - 2). 604s*2 Expand (35 - 35 + 6g)(17g - 10g - 21g + 2g2). 12g*3 - 84g*2 Expand -2r*5 + 5r*5 - 4r*5 + 2r + (3r2 - 5r*2 - 3r*2)(-4 + r*2 + 4)(-18r - 11r + 3r). 129r*5 + 2r Expand (-5 - 6 - 3)(2q + 9q + 0q)(q + q + 5q). -1078q2 Expand (7z*2 + 31z*2 - 9z*2)(44z2 - 36z*3 - 14z*2 - 28z*2). -1044z*5 + 58z*4 Expand (-3z + z + 0z)(-10959 - 10954 + 959z2 + 21912). -1918z*3 + 2z Expand (p*3 + 0p3 + p3)(2 + 5 - 1 + (-8 - 41 - 4)(3 + 1 - 2))(p - 1 + 4 + p). -400p*4 - 600p*3 Expand 4q*3 + 0q*3 - 2q*3 + (3 - 3 - 2q*2)(5q + 0q - 3q) + (2q*3 + 4q - 4q)(50118 - 30248 - 33147). -26556q3 Expand (8y*3 - 8y*3 + 8y*4)(511 - 173y - 511) - 9y*5 + 2y5 + y5. -1390y5 Expand (-m2 + m2 - 5m*3)(2m - 5 + 0m + 3 - 17m + 35m + 31m + (0m + m + 0m)(5 + 2 - 5) - 4m + 4m + m + 3m + m - 2m). -280m4 + 10m*3 Expand (37c*2 - 22c*2 - 10c - 17c2 + 4c*4)(-88c - 88c + 182c) + 7c5 - c5 - 2c5. 28c*5 - 12c*3 - 60c*2 Expand (1608z - 1859z2 - 1608z)(3z*2 - 4z*2 + 4z*2). -5577z4 Expand (-s3 + s*3 + 2s*3 + (0 + 2 - 1)(2s3 + 2s*3 - 3s*3) - 4s + 4s - 2s*3)(2712s2 + 1664s*2 - 25854s*2 - 19029s*2). -40507s*5 Expand (6 - 1 - 3)(3 + 3 - 4)(16296k - 33088k + 13832k)(-1 + 0 - 2). 35520k Expand (0k + 2k + 2k)(k + 3k - k)(-40k - 31 - 35k + 77k). 24k*3 - 372k*2 Expand 94a - 9a + 49a + (-1 + 1 - 1)(2a - 3a - 3a) - 5a + 4a - 4a. 133a Expand 287h - 286 + 286 - 3563h - 1 + 1 - 2h + 0h - 5h + 4h + (-4h + 0h + 3h)(-5 + 4 + 2) - 2h + 2 - 2 + h + 0 + 0 + 4 - 4 - h. -3282h Expand (-1 + 4 - 5)(-4 - q + 4) - 2q + q + 5q + (2q - 5q + 4q)(2 + 12 + 3)(-9 + 4 - 4). -147q Expand ((1 - 2p + 6p2 + 2p)(p - 2p + 2p) + (-2p*2 - 3p*2 + 7p*2)(-2p + 0p + 4p))(-1 + 1 + 2p)(-71 - 193 + 28). -4720p4 - 472p*2 Expand 101s*4 + 2s*3 - 101s*4 + 13s*5 + (-4s + 0s + 3s)(-3s2 - s4 + 3s2). 14s*5 + 2s*3 Expand (974 - 974 + 8g*2 + (4 - 3 - 2)(3g2 - 4 + 4))(7g2 + g - g). 35g*4 Expand (-3u + 2u - u - 3)(728u2 + 733u*2 - 981u*2). -960u*3 - 1440u*2 Expand (3q2 + q3 + 0q4 - 5q2 + q4)(1 - 1 + q + (-4q + 4q + 2q)(-1 + 3 + 0) - q + q - q + 10q + 13q + 120q). 147q5 + 147q*4 - 294q*3 Expand (6748 - 6748 + 3944l)(-l2 + 7l2 - l2). 19720l3 Expand (-6 + u2 + 6 + (0u + 5u - 11u)(4u - 5u + 0u))(126u - 91u + 44u). 553u3 Expand ((-j + j - 3j)(-j - 2j + 0j) + 26 + 6j*2 - 26)(2j2 + 3j - 7j2 + 6j*2). 15j*4 + 45j*3 Expand (58b*3 - 110b*3 - 11b*4 + 66b*3)(-3 - 1 + 0). 44b4 - 56b*3 Expand (-1098f + 1378f + 2327f)(4f - 2f - 3f). -2607f2 Expand -3f + 1 - 1 + (f + 0 + 0)(-1 + 3 + 0) + (2 - 3 + 0)(54f + 2f - 5f + 4). -52f - 4 Expand (5y + 2y - 4y)((-y + 1 - 1)(-7 + 7 + 4y + (-1 + 1 + 2)(1 + y - 1) + 2y - 4y + 0y + 60y - 28y - 12 - 37y) - 2y*2 - 2y*2 + 2y*2). -3y*3 + 36y*2 Expand (3i - 5i - 4i)((-2i - i + 2i)(-1 + 1 - 1) + 107 - 107 + 8i)(2i - 4 - 1 + 3). -108i*3 + 108i*2 Expand -183p*2 + 239p*2 + 439p*2 + 804p*2 - 2p*2 + 2p*2 + 2p*2 + (4p*2 - 3p*2 + 3p*2)(-2 + 0 + 0). 1293p2 Expand -25l*3 - 12l*4 + 25l3 + (l - l - l3)(0l + l + 5l + (-3 - 3 + 3)(8l + 3l - 4l)). 3l*4 Expand (1080w + 664w + 731w)(-2 - 2 + 2). -4950w Expand (0y + 0y - 2y3 + (-8y + 6y + 9y)(2y*2 - 3y*2 + 0y*2) + 16 - 16 + 5y*3)(-y - 5y + 2y). 16y4 Expand (41c*2 + 3 + 3c*3 - 5c - 41c2)(-62c + 88c - 71c)(-1 + 1 - 2). 270c4 - 450c*2 + 270c Expand (-2 + 0 + 0)(-2w3 - w2 + w*2) + 2 - 2 + 2w*3 + 109 + 17w*2 - 93 - 15 + 17w*3. 23w*3 + 17w*2 + 1 Expand -2c*3 - 2c*3 + 15c*3 + 3 - 3 + 2c*3 + (47c - 181 + 181)(0c*2 - 9c*2 + 6c*2). -128c*3 Expand (-z - 5z + 4z)(-5z3 + 4z*3 - 3z*3) + 554z*4 + 453z*2 - 453z*2. 562z*4 Expand (10627 + 6065 - 3542)(u2 - u2 + u*3). 13150u*3 Expand (-z + 2z - 2z)(-4 - 4z + 2z + 11 + 4z + 5z + 5z + (z + 2 - 2)(-2 - 1 + 5)). -14z2 - 7z Expand ((0 + 6 - 18)(1 - 2 + 2) + (6 - 2 - 2)(-1 - 1 + 3))((3f + 0f - f)(f - 3f + 0f) + f*2 - 4 + 4). 30f*2 Expand -4g - 3g + 5g + (-2g + 4g + 0g)(1 + 3 + 1) - 2g - 3g + 3g + (0g + g + 0g)(-5 - 1 + 4) - 2g + 1 - 1 - 1 - 2g + 1 - 2g - 4g + g. -5g Expand (-28 + 28 + 8c*3)(0c - 3c + 2c) + (-2c2 - c2 + c*2)(-2c2 + 2c - 2c) - 3c*3 - 27c*4 + 3c*3. -31c*4 Expand 3f*5 - 3f5 - f5 + (3f2 + f3 - 29101 + 29101)(38f2 + 139f*2 - 24f*2 + 17f*2). 169f*5 + 510f*4 Expand (-177j + 177j + 27j*5)(-32 + 67 - 90). -1485j5 Expand (18 + 23 - 67)(9n2 - 9n*2 + 11n3 + n2 - n*2 - 2n*3 + (-3n - n + 2n)(2n2 - 1 + 1) + 3n*3 - 3n3 - n3 - 8n3 - 8n + 8n). 104n*3 Expand (3 - 4 + 2)(p - 3 + 4 - 2p + (-1 + 4 - 2)(-6p + 4p + 6p) + 1 - 1 - p)(0p2 + 0p*2 + 5p*4 + (-3 + 1 + 3)(-6p + 4p*4 + 6p)). 18p5 + 9p*4 Expand (-3t*2 - 4 + 4t*2 + 2 + 30t*2 - 125t*2 - 15t*2 + (-1 + 2t + 1)(t + 6 - 6))(t + 2t - t + (-1 - 2 + 2)(3t + 0t - 5t) + 3t + 0t - 4t). -321t3 - 6t Expand (-81 - 137h + 81)(-7 - 12 + 10). 1233h Expand (5d + d - 4d)(-62 - 126 + 59)(0 + 1 + 4) + 3 - d - 3. -1291d Expand -14p - 23p + 40p + (p - p + p)(-3 + 3 - 2) + p - 4p + 4p. 2p Expand (-k3 + 0k3 - k3)(-3k + 0k + k - 3k - 2k + 3k + (-4 + 0 + 2)(6k + 0k - 4k) + 114097k + 118272k - 226734k). -11254k*4 Expand (-2m*3 + 3m - 3m + (2 - m - 2)(0m + 0m + 2m2) + (-150 + 9m*2 + 150)(7 - 3m - 7))(m*2 - 2m*2 + 5m*2). -124m*5 Expand (-1282d + 1282d + 1367d*2)(-6d + 0d*3 - 2d*3 + 3d*3). 1367d*5 - 8202d*3 Expand (-2j + 4 - 4)(-2j - 9j - j)(844 - 1268 + 681)(-1 + 0 + 3). 12336j*2 Expand (-1017 + 334 - 715o*3 + 14o + 328 + 355)(0 + 1 + 0). -715o*3 + 14o Expand (-2a + 2a + 4a2)(-2 + 1 + 2) + a*2 - 8 + 2a*2 + 6 - 108a*2 - 131a*2 + 318a*2. 86a*2 - 2 Expand (-2 - 5 + 1)(2567 + 107f2 - 2567 - f2 + 0f*2 + 0f*2 + (2 - 1 - 3)(f*2 - 2f2 - f2)). -660f2 Expand (-2j - 2j3 + 2j)(-1 + 1 + 1) - 4j*3 + 2j*3 + 0j*3 - 206970j*2 + 7j + 206970j2 + 59j*3 - 2j*3 + 4j*3 - 3j*3. 54j*3 + 7j Expand (-312 + 54 - 136)(-1 - 3 + 3)(2 - d - 3d + 11d). 2758d + 788 Expand -41564s - 1302s3 + 234s*3 + 41565s + (2 - 6 + 2)(0s*2 + 0s2 + s3). -1070s3 + s Expand (-77k + 16k2 + 77k)(185k + 4	{ "pile_set_name": "DM Mathematics" }
2 + (16 - (-28)/4). Let f be (-6)/((-30)/a) + 2. Solve fi + 9 = -26 for i. -5 Let d(y) = -88y*2 - 94y + 2. Let p be d(-1). Solve -384t = -388t - p for t. -2 Let l be (-1 - -8 - 1211/(-519))(-3)/(-2). Solve 0 = -ln + 3 - 45 for n. -3 Let t be 0(2/(-3))/(120/45). Suppose -h + 1 = -0. Solve 3b - h - 8 = t for b. 3 Suppose 6237b - 728 = 6209b. Suppose -10 = -4d + 14. Solve -d + b = 4l for l. 5 Let t be (0/(-2))/(5(-10)/(-25)). Suppose t = 135p - 152p + 17. Solve -o - p = -4 for o. 3 Let w = -116 + 118. Let g be (-2856)/(-75) + 1 + (-44)/550. Solve -37r + gr = -w for r. -1 Let o(q) = -2q*2 - 172q + 3034. Let m be o(15). Let p(g) = -g*3 - 7g*2 - 7g - 6. Let c be p(-6). Suppose 5r + 3 - 8 = c. Solve m = v - r for v. 5 Suppose 295k = -27k + 33810. Solve kv = 66v + 117 for v. 3 Let q = 147 - 87. Suppose 0i - q = -4z - 5i, 0 = -2z - 2i + 32. Solve 6v + z = 2v for v. -5 Let i be 4/(-7) - (-3 - 68/(-28)). Suppose 5d = 7z - 3z - 52, i = -z + 4d + 24. Solve 3k - z = 7k for k. -2 Let q(r) = -r*2 - 11r - 18. Let i = -135 + 63. Let j = i + 63. Let n be q(j). Solve 9 = -3v - nv for v. -3 Let v(t) = -467t - 3709. Let j be v(-8). Solve ju - 21u + 37u = 0 for u. 0 Let k(z) = z*3 - 7z*2 + 4. Let t(i) = i + 4. Let d be t(-1). Suppose 2v = 5o - 35, -do - 21 = -6o + 4v. Let h be k(o). Solve hc - 4 = -20 for c. -4 Suppose 34n = 27n - 91. Let c be (1 - 46/4)26/n. Solve 10x = 3x + c for x. 3 Let j(m) = 7m. Suppose 0 = 5n - 10, 4d - 4n + 2 + 6 = 0. Let r be j(d). Solve -4x + 8 + 0 = r for x. 2 Suppose 18 - 58 = -4y. Suppose 0 = yu + 7u - 34. Suppose ui - 7i = -2i. Solve 0h - 2h + 2 = i for h. 1 Let f be 105/(8/9618). Solve f + 91 = 23m for m. 7 Suppose 2c = 4n - 30, 4c - 1 + 5 = 0. Suppose nv - 4v + 3q = 15, -3v + 24 = -6q. Solve -vh + 2h - 4 = 0 for h. -1 Suppose -140p + 77p = -94p + 11842. Solve -384a = -pa - 12 for a. 6 Suppose 5l - 6 = -6. Suppose 20a - 129 - 471 = l. Solve 0 = -7v - a + 2 for v. -4 Suppose 117 = 111a - 102a. Let u(w) = -w3 + 13w*2 + 9w - 95. Let p be u(a). Solve 4o - p = -18 for o. 1 Suppose 0 = 1051q - 1067q + 320. Let b(t) = t - 1. Let k be b(2). Let r be -1 - (-6 + 1)/k. Solve 0d = -rd + q for d. 5 Suppose -43 = -5c - 35i + 33i, 0 = 2c - i - 10. Suppose 0 = 2a + c - 37. Solve 6u - 3u = -a for u. -5 Let i = -2 + 3. Suppose 8r - 4 = 6r. Suppose 0 = o - ro - 2m + 7, 1 = o - m. Solve -2c = -oc - i for c. -1 Let j(x) = -x*2 + 100x - 364. Let g be j(4). Solve 150 = go + 30 for o. 6 Let y = -38 + 46. Suppose yj - 225 = 5j. Let c be 1 - (-174)/45 - (-10)/j. Solve -h + ch - 8 = 0 for h. 2 Let u(r) = r*3 + 2r*2 - 3r + 1. Let t(q) = -5q2 - q + 2. Let s be t(1). Let n be u(s). Let a = n - -21. Solve -1 = -3z + a for z. 1 Let h be (-10)/6(9 + 2 + 1). Let v = -20 - h. Suppose -12u + 15u - 12 = v. Solve 0 = uj + 12 - 0 for j. -3 Suppose -2b + j + 107 = 0, -2b - 4j - 51 = -163. Solve -63a + ba = -45 for a. 5 Suppose -2m = -4k + m + 269, -4m + 183 = 3k. Let q = 67 - k. Solve 11h - 10h = q for h. 2 Suppose -481r + 23471 + 8689 = -41433. Solve -34g + r + 85 = 0 for g. 7 Let t(a) = -a3 + 6a*2 + 13a - 7. Let l be t(7). Suppose -lf + 30f = -10. Solve p + f = 1 for p. -1 Let f(r) = r*2 + 2 + 6r*2 + 4r*2 - 8r - 6r2. Let y be f(4). Let n = -47 + y. Solve 1 - 10 = -nh for h. 3 Let a(h) = -h*3 - 10h*2 - 8h - 179. Let y be a(-11). Solve 46t - 36t = y for t. 3 Let h(q) = 11q - q - 70 - 6q. Let g be h(20). Solve -3r - g = -13 for r. 1 Let g be 3/2(-60)/(-18). Suppose q - 2q = -3i + 5, 5q = g. Let b be 57/(-95)-15. Solve 10 = bn + in for n. 2 Let h(y) = y - 8. Let x be h(12). Suppose 1225 = 70m - 21m. Solve -xp + 9p = m for p. 5 Let y = -373 - -401. Suppose 10g = yg - 198. Solve g = -p + 7 for p. -4 Let n(b) = -b3 - 4b*2 - 3b - 6. Let r be n(-4). Suppose q = rq - 10q. Suppose 18 = t + 5j, qt + 12 = 2t - 2j. Solve 0 = 5u - t - 7 for u. 3 Suppose -17i = -8i - 18. Suppose -iv = 5q + 4, 4v = -14q + 9q + 2. Let s(g) = -g*2 - 8g - 4. Let x be s(-7). Solve v = 2l - x for l. 3 Let y = -17 + 36. Suppose 3g - 6 = -i, 3i + 3g - y = -7. Solve 25 = -8q + iq for q. -5 Suppose -3p + 4h - 8 = 34, 3p + 42 = -3h. Let q = p + 13. Let b be (3 + (-12)/4)/(q + -2). Solve -w - 1 = -bw for w. -1 Let z(f) = 2f*3 + 41f*2 + 9f - 63. Let t be z(-9). Solve t = -3s + 1707 for s. -4 Suppose 3g = -4 + 28. Suppose gb + 70 + 90 = 0. Let o be (-32)/b(-15)/(-2). Solve -2m - m = o for m. -4 Suppose 150 = -6h - 324. Let w = 84 + h. Let a be (4/w)/(54/(-15) - -4). Solve s + as = -3 for s. -1 Let n(m) = m3 - 9m*2 + 3m + 5. Let l be n(8). Let u = 40 + l. Suppose -15 = 2c - uc. Solve 0 = -w + cw - 20 for w. 5 Suppose 0 = -84w + 232 + 272. Solve -wh - 34 + 4 = 0 for h. -5 Suppose 2v + 3f - 99 = 0, 75v + f = 73v + 85. Solve 49u - 20 = vu for u. 2 Let r = 47 + -42. Suppose 0 = u - r - 27. Let k = u - 29. Solve 0a - k = a for a. -3 Let t(k) = k*3 - 24k*2 + 24k - 17. Suppose 3u = 15, 4u - 1 + 4 = p. Let r be t(p). Solve -5l = 16 - r for l. -2 Let v = 25 + 91. Let f be ((-25/15)/(-2))/(3/(-1035)). Let o = v + f. Solve -o - 3 = g for g. -4 Let i = 981 + -979. Suppose 43 = 5w + 4p + 38, iw + 4p + 10 = 0. Suppose -10 = u + 5d, -2u + 5 = 4d + d. Solve w = -4g - u for g. -5 Let i(k) = -k*3 + 40k*2 + 2k - 79. Let d be i(40). Let r be (-510/150)/(d/(-15)). Solve 6c + 2 = rc for c. -2 Let s(n) = 8n*2 + 5. Let o(k) = -7k*2 + k - 4. Let r(y) = 7o(y) + 6s(y). Let u be r(7). Suppose -166w + 1300 = 94w. Solve 3 = -wb - u for b. -1 Let h(c) = -c + 27. Let w be h(20). Suppose wi = 27 + 85. Suppose j + 4t - 16 = 0, -2t + i = 2t. Solve j = -0s - s for s. 0 Let n be 3 + 0 + 7 + 4. Suppose 0 = 2g - 4q - 8, n = 6g - g - 4q. Let z = 25 + -9. Solve 0 = gr + 2r + z for r. -4 Let v = -393 + 877. Let p = v + -466. Solve pk - 33 = 7k for k. 3 Let b = -2732 - -2760. Solve 12m = 4 - b for m. -2 Suppose 156d = 305d - 152d + 807. Solve ds - 5 = 274s for s. -1 Suppose 6k = 2k - 16, -5s + 36 = -4k. Suppose s + 8 = 4o. Suppose -10 = -4a + ob + 7, 4b = -12. Solve -ah - 20 = 3h for h. -4 Let v(l) = -l2 + 13l + 24. Let f be v(12). Let a = -36 + f. Let c be (a/(-4))/(-4) + 20. Solve i = -3i + c for i. 5 Let m = -31 - -40. Let l(j) = j2 - 24. Let t be l(m). Let g = t + -57. Solve 4 = -gw + 4w for w. 1 Suppose -7r = -2r + 5i - 1950, 0 = -4i. Solve -r = 44l + 21l for l. -6 Suppose -5o = -c - 35, o + 4c - 32 = -4. Solve oz - 3z = 0 for z. 0 Suppose -25o - 16159 - 1466 = 0. Let g = o + 708. Solve gt = 3 - 18 for t. -5 Suppose 0 = -2u + 114 + 112 - 174. Solve -132l = -119l + u for l. -2 Suppose -2m = -2k + 20, -5k - 5m - 14 + 34 = 0. Solve 28 = ko - 7 for o. 5 Suppose 4 = 37n - 41n. Let h be (60/10)/(-18)(n - 5). Solve ho - 3 = -1 for o. 1 Let w be 496/2728 + (-37462)/(-22). Solve 1699p = wp + 16 for p. -4 Let f(d) = d2 + 136d + 409. Let w be f(-3). Solve -wx - 40 = -20 for x. -2 Let z(c) be the first derivative of c4/4 + 4c3/3 + c2/2 - 3c - 1022. Let b(f) = f2 - 4f - 3. Let j be b(4). Let y be z(j). Solve yr + r = 8 for r. 2 Suppose 5g + b = -15, -2g + b + 1 = 14. Let i be (-40)/(-8) - 4/g. Solve it - 20 = 2t for t. 5 Let h = 33 + -23. Let b be 0/((-20)/(-25) - (-2)/h). Solve b = 4n - 16 for n. 4 Let g be (22 - 14 - 7)20. Solve 41s + 84 = gs for s. -4 Let g = -253 + 257. Let d be (-15)/(-6) + 3/24g. Solve -d = l - 4 for l. 1 Suppose 15k + 3o + 1500 = 18k, -980 = -2k - 3o. Let n = -488 + k. Solve -6 = 2x - nx for x. 1 Let l be 16(121045/40)/43. Solve -1139p - 65 = -lp for p. -5 Suppose 107 = 4q + 5c, 3c + 5 = 2c. Solve -qf - 82 = 17 for f. -3 Suppose 4t - 137 = -67 + 342. Solve 19p + t - 27 = 0 for p. -4 Let c = 7882 - 7816. Solve -21k - 39 = c for k. -5 Let q be 29 - -74/(-28). Let l(v) = v2 - 28v + 10. Let f be l(q). Solve 4 = -fn + 24 for n. 2 Let p = -19 + 16. Let y be 8/(-4)p/(-6). Let i be (-1)/((-3)/6) - (-1 - y). Solve ij = -3j + 25 for j. 5 Let w = -14 - -23. Let h = 10 - w. Suppose 73l + 76 - 222 = 0. Solve lf - h = 1 for f. 1 Suppose -4b = 3l - 161, -b	{ "pile_set_name": "DM Mathematics" }
-25y + 2. Determine l(t(f)). -2500f*2 + 400f - 16 Let q(o) = 12447o2. Let f(d) = -d2. Determine q(f(h)). 12447h*4 Let b(m) = -2m. Let s(q) = 18q - 7q - q - 6q. Give b(s(y)). -8y Let s(w) be the first derivative of -2w2 - 3. Let g(l) = 6l + 5. Let r(p) = -p - 1. Let d(b) = -2g(b) - 10r(b). Give d(s(k)). 8k Let b = -3 - -5. Let a(x) = -14x + bx2 + 14x. Let z(i) = 2i2. Determine a(z(g)). 8g*4 Let a(g) = -16g + 10. Let v(y) = -5y + 3. Let b(x) = 3a(x) - 10v(x). Let z(l) = 2l. What is b(z(c))? 4c Let r(i) = 2i*2. Let n(p) be the third derivative of 11p*4/12 - 5p*2. Determine n(r(m)). 44m*2 Let i(n) be the first derivative of 83n*3/3 - 38. Let r(h) = -2h*2. Give r(i(v)). -13778v*4 Let r(i) = -2i*2. Let u(z) = 888z*2. What is r(u(d))? -1577088d*4 Let i(q) = -3q + 2q + 3q. Let f(r) = 546r - 546r - 3r2. Calculate i(f(v)). -6v*2 Let n(d) = 291d. Let k(q) = -2q2. Determine n(k(w)). -582w2 Let m(l) = l2. Let z(g) = -191g2. Give z(m(q)). -191q*4 Let b(p) be the second derivative of 2p + 0 + 7/6p3 + 0p*2. Let s(d) = -11d*2 - 14d*2 + 26d*2. Calculate s(b(l)). 49l*2 Let t(q) = -279q. Let j(w) = 22w2. Calculate j(t(v)). 1712502v*2 Let d(b) = -5b*2. Let f(t) = -7t + 60. Determine d(f(p)). -245p2 + 4200p - 18000 Let m(a) = -395a2 + a - 2. Let z(u) = 4u. Calculate m(z(j)). -6320j2 + 4j - 2 Let z(u) = -u*2. Let x(w) = 3w*2. Let s(a) = -x(a) - 2z(a). Let m(p) = -52p. Let l(v) = -11v. Let q(i) = -14l(i) + 3m(i). Calculate q(s(y)). 2y2 Let o(r) = -2r*2. Let b(a) be the first derivative of -1 + 0a*2 + 0a + 1/3a3. Calculate b(o(s)). 4s4 Let s(p) = p2 - 8. Let q(l) = 5l2. Give q(s(b)). 5b*4 - 80b*2 + 320 Let z(p) = -p + 130. Let t(q) = -3q. Determine t(z(g)). 3g - 390 Let r(v) = -2v. Let j(i) = -156i. Give r(j(q)). 312q Let k(z) = -13z. Let q(w) = 2w + 2. Determine k(q(h)). -26h - 26 Let m(w) = -7w. Let i = 2/5 - -4/15. Let c(y) be the first derivative of -iy3 + 0y + 2 + 0y2. Determine m(c(d)). 14d*2 Let w(s) = -s. Let c(g) = -5g2. Let z(f) = -f2. Let j(y) = -4c(y) + 25z(y). Determine w(j(m)). 5m2 Let v(r) = -2r*2. Let y(m) = 30m*2 - 14m*2 - 11m*2. What is v(y(b))? -50b4 Let h(z) be the third derivative of z5/60 - 2z2. Let l(p) = 35 - 35 + 0p - p. Determine l(h(d)). -d*2 Let b(n) = 2n. Let j(c) be the third derivative of -c5/20 + c2. Calculate b(j(o)). -6o2 Suppose 4g + g - 3t = 30, 29 = 3g - 4t. Let n(s) be the third derivative of 0s + 0sg + s2 + 0 - 1/8s4. Let x(l) = -l2. Give n(x(j)). 3j2 Let i(w) = -2w - 2. Let p(t) = t*2 - t - 1. Let y(b) = -i(b) + 2p(b). Suppose f - 6f + 10 = 0. Let h(k) = -3 + k2 - 3k*f + 3. What is h(y(s))? -8s4 Let s(q) be the first derivative of q5/120 + 2q3 - 1. Let u(o) be the third derivative of s(o). Let t(y) = -4y - 3y + y. What is t(u(x))? -6x Let k(y) = 3y2. Let m(n) = -8 + 0n + 3n + 8. Give m(k(w)). 9w*2 Let g(t) = -t + 2t + 2t - 5t. Let l(x) = 5x2. Determine l(g(o)). 20o*2 Let p(n) = -5n*2. Let l(b) = -b. Let m be 2/6(-30)/(-5). Let w(y) = -4y. Let x(h) = ml(h) - w(h). Determine p(x(t)). -20t2 Suppose -4c + 9 - 1 = 0. Let k(v) = -v*2 + 5v - 3v2 + cv2. Let g(r) = r2 - 2r. Let w(z) = -5g(z) - 2k(z). Let a(q) = -2q*2. Give a(w(d)). -2d*4 Let d(y) = 7y - 6. Let g(b) be the first derivative of -4b2 + 7b - 3. Let n = 11 + -17. Let r(t) = ng(t) - 7d(t). Let s(j) = 2j. Calculate s(r(v)). -2v Let i(a) = 4a2 + 2a - 2a. Let h(y) be the third derivative of 0y + 0y3 + 0 + 4y*2 - 1/12y*4. Calculate h(i(f)). -8f2 Let f(w) = -w2 - 2 + 2. Let a(v) = -v*2 + 3v - 3. Let m(o) = 2o2 - 5o + 5. Let l(u) = 5a(u) + 3m(u). Give f(l(x)). -x*4 Let m(n) = 8n*2. Let k(t) = -5t. Let f(p) = p*2 - p. Let x(q) = -5f(q) + k(q). Calculate x(m(a)). -320a4 Let y = 17 - 32. Let c(i) = 18i2. Let j(w) = -w2 - 4w - w + 5w. Let p(n) = yj(n) - c(n). Let r(k) = -2k*2. Calculate r(p(q)). -18q*4 Let i(q) = -12q*2. Let o(k) = 20k - 6k - 13k. Determine i(o(z)). -12z2 Let m(r) = 12r. Let h(t) = 2t + 183. Give m(h(l)). 24l + 2196 Let j(h) = -2h. Let f(s) = s + 9. Let d be f(-4). Let g(m) = m + 2m - dm. What is j(g(o))? 4o Let d(p) = 12p. Let i = -14 - -18. Let a(o) = -2o - 2o + 9o - io. Calculate a(d(f)). 12f Let l(s) = 3s. Let x(i) = 8i - 7. Let f(m) = 7m - 6. Let w(u) = -7f(u) + 6x(u). What is w(l(v))? -3v Let z(t) = -312 - 9t2 + 312. Let y(c) = -c2. What is z(y(i))? -9i*4 Let h(v) = 374v*2. Let t(z) = -3z. Calculate t(h(s)). -1122s2 Let c(z) be the third derivative of z5/60 + 4z*2. Let i(j) = -7j*2. What is c(i(d))? 49d4 Let y(b) be the second derivative of -b4/12 - b. Let z(n) be the first derivative of 20 + 11n2 - 7n*2 - 7. Give y(z(j)). -64j*2 Let w be 5/30-2-3 - 1. Let v(t) be the third derivative of 1/24t*4 + 0t + 0t3 - t2 + w. Let x(d) = d2. Determine x(v(q)). q2 Let w be (6/(-39) - (-6)/39)/1. Let q(b) be the first derivative of -1/3b*3 + 0b*2 + wb - 2. Let p(s) = 6s2. What is q(p(k))? -36k*4 Let r(h) = -8h*2. Let f(v) = -32v*2. Determine r(f(p)). -8192p*4 Let w(t) be the second derivative of 0 + 0t*3 + 4t - 1/6t4 + 0t*2. Let c(p) = 2p. Give c(w(d)). -4d2 Let r(q) = q. Let b(v) = -3090v. Determine r(b(j)). -3090j Let f(c) = -c. Let x(o) be the second derivative of -o3 - 2o + 28 - 28. What is x(f(i))? 6i Let a(p) = -4p - 6. Let o be ((-27)/(-6))/(6/(-8)). Let v(n) = 12n + 17. Let x(u) = ov(u) - 17a(u). Let y(s) = -2s. Determine y(x(t)). 8t Let r(w) = 15w. Let l(q) be the first derivative of -2q3/3 + 9. Give l(r(x)). -450x*2 Let f(b) = -8b*2. Let w(j) = 4j - 8. Determine f(w(c)). -128c2 + 512c - 512 Let r(a) = -38a. Let f(z) be the second derivative of z4/4 + z - 8. Calculate r(f(u)). -114u*2 Let t(m) be the second derivative of -3m + 0m2 + 0 + 2/3m3. Let x(v) be the second derivative of v4/6 - 3v. What is t(x(c))? 8c*2 Let w(b) = -2b. Let g(a) = -5a2 + 5a. Let f(s) = 3s2 - 2s. Let p(i) = -5f(i) - 2g(i). Calculate p(w(c)). -20c2 Let b(p) = -13p*2. Let c(k) = 57k*2. Determine b(c(z)). -42237z*4 Let l(x) be the third derivative of -71x*4/24 - 34x*2. Let y(b) = -2b. Give y(l(d)). 142d Let n(w) = -5w*2. Let c(p) = 8p + 6. Let h(v) = 7v + 5. Let t(r) = -5c(r) + 6h(r). Determine n(t(f)). -20f*2 Let c(q) = q. Let g(a) = -286a. Give c(g(m)). -286m Let d(m) = -9m. Let y(u) = 10u + 14. Determine d(y(k)). -90k - 126 Let d(i) = -i*2 - 16. Let s(v) = 44v. What is s(d(k))? -44k2 - 704 Let b(m) be the first derivative of -m2 - 2. Suppose p - 1 - 5 = -2v, 3p - 2 = -2v. Let x(i) = 3i - 2i + 6i - vi. What is b(x(q))? -6q Let i(c) = -41c*2 + 17c*2 + 20c*2. Let q(z) = -2z. Calculate q(i(o)). 8o2 Let t(j) = -2j*2. Let r(h) = -3 + 48h + 3 - 31h. What is t(r(d))? -578d*2 Let i(p) = 23p - 18p - 13p. Let u(j) = -j*2. Determine i(u(o)). 8o*2 Let l(b) = b. Let i(j) = 613j*2. What is i(l(c))? 613c*2 Let n(a) = -7a. Let f(c) = 134c2. Determine f(n(y)). 6566y*2 Let z(x) = -2x. Let l(g) = 31g2 - 6. Let j(p) = -340p*2 + 65. Let v(b) = -6j(b) - 65l(b). Determine z(v(a)). -50a*2 Let q(v) = 1806v. Let c(h) = 6h2. What is q(c(j))? 10836j*2 Let v(w) = 2w. Let j = 6 + -4. Let q(k) = -5kj + 3 - 5 + 2. Determine q(v(c)). -20c*2 Let s(p) = 21p - 9. Let m(c) = 5c - 2. Let z(q) = -18m(q) + 4s(q). Let v(d) = -6d*2. What is v(z(j))? -216j*2 Let h(z) = -2z*2. Let d(j) = -211j. Calculate h(d(i)). -89042i2 Let f = 2 - 0. Let w(p) = 4 - 4 + 2p*f. Let h(s) = 572s + 566s - 1719s + 574s. Give h(w(t)). -14t*2 Let s(j) = -2 + 2j + 2. Let d(h) = 7h + 6. Let x(q) = 0 - q + 1 - 2. Let n(g) = -d(g) - 6x(g). Calculate s(n(u)). -2u Let b(o) = -o. Let z(k) be the third derivative of k6/180 + k4/24 + 4k*2. Let v(c) be the second derivative of z(c). Determine b(v(r)). -4r Let n(u) = -4u2. Let d be ((-4)/(-14))/((-2)/(-14)). Let t(z) = 2z*2 - 3z*2 + 0z*2 + 2z*d. Calculate n(t(i)). -4i**4 Let f(b) be the first deri	{ "pile_set_name": "DM Mathematics" }
(d) -0.5 d Let w = 11.7 - -53.3. Let k = w - 68. Which is the biggest value? (a) 0.5 (b) -5 (c) k (d) 0.4 a Let z = 407 + -406. What is the biggest value in 3/7, z, 1/21? z Let y(u) = u*3 - 7u*2 - 9u + 12. Let n be y(8). Suppose -m - 20 = nm. Let o = -88 + 87.6. Which is the third smallest value? (a) m (b) 0 (c) o b Let q = -214 + 211. What is the biggest value in 5/2, -5/4, -0.4, q? 5/2 Let f = 1517 + -1521. What is the third smallest value in -5, f, -2/55? -2/55 Let z = -10 - -7. Let j = 20660 + -309727/15. Let h = 57/5 - j. Which is the third biggest value? (a) -0.3 (b) z (c) h b Let s be (6/((-210)/(-55)))/(-2). Let y = -1/2 - s. Which is the third smallest value? (a) y (b) 4/3 (c) -9/5 b Let c = -98.63 - -98. Let k = -0.93 - c. Let q = -0.2 + 0.6. What is the third biggest value in 6, k, q? k Let x(p) = -p2 + 139. Let u be x(12). Let i(y) = y3 + y2 + 2. Let m be i(-2). What is the second biggest value in 1, u, m? m Let h = -80 - -80.37. Let o = -0.57 + h. What is the smallest value in -2, o, -0.4? -2 Let r be 11 + (-9)/(243/303). Let t(w) = -w - 8. Let g be t(-7). What is the fourth smallest value in -1/7, 3/4, g, r? 3/4 Let x = -0.2 + -1.8. Let s(n) = 26n + 161. Let r be s(-6). What is the smallest value in r, 0.2, x, -1/4? x Let p = -53/6 + 26/3. Let x = -391/174 + 70/29. What is the third biggest value in x, -5, p? -5 Let y = 0.027 + 0.001. Let w = -1.028 + y. Which is the second smallest value? (a) w (b) 5 (c) -3 (d) -2/33 a Suppose 2h = -387 + 381. Which is the biggest value? (a) 0.09 (b) h (c) -8 a Let v = -6/59 + 20/1357. Which is the second biggest value? (a) v (b) -3 (c) 6/7 (d) 2 c Let r = -25.2 + 19.2. What is the fourth biggest value in 0.8, -5, r, 0.4? r Let m = -1807 + 1806.44. Which is the smallest value? (a) m (b) 1/2 (c) 2 a Let h = -127.8 + 190.9. Let u = 63 - h. Which is the third biggest value? (a) 2/23 (b) 3 (c) 0.3 (d) u a Suppose 3k = -9k + 216. Let p be k/44/(-6). Let b be (-2)/4 - (-2 + 2). What is the third smallest value in p, b, -11? b Let n = -63 - -67. Suppose 4 = -s - n. Which is the third biggest value? (a) -5 (b) -1 (c) -0.5 (d) s a Let g = 0.088 - 0.388. Let v be (-8)/(-190)(-4)/(-16). Let y = v - -18/95. What is the third smallest value in y, g, 0.4? 0.4 Let f = 6185/6 + -1031. What is the third biggest value in f, 0.3, 5, 28? 0.3 Let h = -0.8 + -207.2. What is the second smallest value in -2/3, h, -2? -2 Let h = 1 + -0.6. Let d = 51.9 - 23.1. Let u = d + -29. Which is the second smallest value? (a) u (b) -5 (c) h a Suppose 7w + 2448 = -11w. Let v = w - -132. Which is the smallest value? (a) 0.5 (b) v (c) -3/2 b Suppose -5h - 16 = l - 5l, 3h = 2l - 10. Let v = -154 + 619/4. What is the third smallest value in l, 0.3, v? v Let x = 246 - 88. Which is the fourth biggest value? (a) 2/7 (b) 3 (c) x (d) -1 d Let l be (-4)/1 + -4 - 0. What is the second smallest value in -1/3, -1, l, 4? -1 Let w = 2.01 - 2. Let t = -310.8 - -311. What is the biggest value in t, -1/5, w? t Suppose -h + 4y = 11, 0 = h - 2h + 2y - 7. Let g be (1 - (-7)/(-5))-5. Let i be -1 - (g + 0 - -1). What is the biggest value in i, -1/7, h? -1/7 Let g = -27 - -191/7. Let t be (2 - 1) + (-35)/20. Which is the third biggest value? (a) t (b) -4 (c) g b Let h be (-1020)/681/(-3). What is the smallest value in -49, -9, h? -49 Let o be ((-1)/2)/((-49)/(-14)). Suppose -6 = 2h - 0. Let r = -0.6 + -1.4. Which is the third biggest value? (a) h (b) r (c) o a Let x = 0.1765 + 0.0235. Let t = 13 + -9. Which is the biggest value? (a) x (b) -3 (c) t c Let p be 2 + 16-1. Suppose -107 + 35 = -8i. Let k = -54.7 - -52.7. What is the second smallest value in p, k, i? k Let d = 0.12 + -10.12. Let k = d - -10. Let b = 0.1 + 0.4. What is the second smallest value in b, k, 4/3? b Let o = -18.31 - -0.31. Let d = 18.3 + o. Let l = 0.07 + -0.37. Which is the third biggest value? (a) l (b) 3 (c) d a Let r be (-70)/(-390) + (-3)/9. What is the third biggest value in -0.3, r, -3/7, -3/8? -3/8 Let o = -0.1 - -1.2. Let s = o + -1.17. Which is the second smallest value? (a) 1/4 (b) 2/11 (c) s b Suppose 5j = -h - 7, h = 5j - 14 - 33. Let l be 2 + (170/(-45) - (-6)/h). Which is the second smallest value? (a) -3 (b) 0 (c) l c Let x = -267 - -216. Which is the second biggest value? (a) x (b) -2/5 (c) 2/7 b Let u = -1565 - -1567. What is the third biggest value in u, -5, -1/5? -5 Let x = 8 + -8.3. Let m(n) = -n*2 - 4n - 6. Let i be m(0). Let y be (-4)/i(-1)/(-2). Which is the smallest value? (a) -0.5 (b) y (c) x a Let s = 24.1 - 24.03. What is the third biggest value in 0.5, 4, s? s Suppose 0 = 13d - 16d - u + 11, 2d - 4u = 26. Which is the third biggest value? (a) 3/4 (b) d (c) 0.02 c Suppose 4g + 5a = 8g, g = -3a. Suppose -u + 2 = -g. Let m be (7/2 - u)/(-3). What is the second biggest value in -4, 5, m? m Let n = -20.9 - -15. Let g = -2.9 - n. Let d = -4 + 0. Which is the third biggest value? (a) d (b) g (c) 0 a Let a = -0.01 - 19.99. Let w = a + 18. What is the second smallest value in 2/13, w, 5? 2/13 Let x = 4/11 + -65/88. Let o(l) = 4 - 2l + 0l - 4l + l*2 + 3l. Let u be o(3). Which is the third smallest value? (a) x (b) -1 (c) u c Let y = -0.2 - -0.18. Let o = 4.02 + y. Suppose -2k = 7k + 27. What is the third smallest value in k, 0.3, o? o Let y be (-4)/10(-120)/(-36). Let w be 4/(-10) - 4/(-20). Which is the second biggest value? (a) y (b) -1/3 (c) 4 (d) w d Let k be 7/147-177 + 8. Let x = -4.8 - -2.6. Let u = 2 + x. What is the biggest value in k, 0.5, u? 0.5 Let i = -950 + 54152/57. Which is the second biggest value? (a) i (b) -2 (c) -1/6 c Let o = -56.416 + 58.4. Let v = o - -0.016. Which is the smallest value? (a) v (b) 1/6 (c) 4 b Let x = -0.42 + 0.02. Let k = -320 - -316. Which is the second smallest value? (a) k (b) -2 (c) 1/5 (d) x b Let z = 72.3 + -73. Which is the second smallest value? (a) 5 (b) 2/7 (c) -3 (d) z d Let u = -702/5 - -141. Suppose t + 3t = -16. Let l be (2 + 2)(-1)/t. Which is the second biggest value? (a) u (b) -3/2 (c) l a Suppose s - 4 = 0, -32s = -3f - 30s + 28. Let m(c) = -3c - 2. Let b be m(-2). Let v = -0.05 + -1.95. What is the biggest value in f, v, b? f Let f = -148 - -736/5. Which is the smallest value? (a) f (b) -18 (c) -1 (d) 1 b Let q be (-93)/19 + 8/(-76). What is the smallest value in -0.1, -2/9, q? q Let s be (-176)/(-154)(-2)/8-14. Let m(p) = 6p. Let v be m(-3). Let z be (v/40)/((-18)/15). Which is the third biggest value? (a) z (b) s (c) 2 a Let b = -91.1 + 87. Let a = -0.9 + b. Let o = -6 + 11. What is the third biggest value in a, -1/2, o? a Let r = -257 - -1283/5. Which is the second biggest value? (a) 2 (b) r (c) 3 (d) -2 a Let o be (-8)/6 + (-1078)/(-1470). Let i = 0.08 - 3.08. What is the second smallest value in i, 4, o? o Let f be (-2)/(-3)(8 - 2/4). What is the smallest value in f, 9, -4/3, 1/6? -4/3 Let w = -0.61 + -0.39. Suppose -j - 1 = 2k - 3, -9 = -2j + k. Let g = 137/189 + -8/27. Which is the third smallest value? (a) g (b) j (c) w b Let l = 2246.3 - 2145. Let g = l + -101. Which is the second smallest value? (a) -0.1 (b) -7 (c) g a Let f = 23.6451 - -0.0549. Let x = 24 - f. Which is the second smallest value? (a) x (b) 5 (c) 1 c Suppose 0 = 4h - 12, -26 = -3u + 3h - 32. Which is the third biggest value? (a) 4 (b) u (c) 23 b Let l = -32.037 + 0.037. Let c = l + 32. What is the second smallest value in c, -2/7, 18? c Let m = 0.09 + 0.21. Let l = 26.3 - m. Which is the second smallest value? (a) -2/5 (b) l (c) 2 c Let m = -2.9749 - -0.0409. Let a = m + -0.066. What is the biggest value in -0.3, 1, a? 1 Let x be ((-16)/(-18))/(6/(-9)). Let c = -34 - -56. Let j = c - 21. What is the smallest value in j, x, 5? x Let o be (-4 - -1 - -6)(-12)/(-18). Which is the third biggest value? (a) -2 (b) o (c) 2/7 a Let l = 2605 - 2627. What is the smallest value in l, -2, -1? l Let f be ((-2)/(-8))/(14/16). Let y be (-56)/(-10) - 120/20. What is the smallest value in 0.6, y, f? y Let g = -1391 - -1390.7. Let h = -6.09 - -0.09. What is the third smallest value in 0.2, h, g? 0.2 Suppose 0 = 5m - 3z + 780, 5m - z = 3z - 785. Le	{ "pile_set_name": "DM Mathematics" }
2)/(-40) - q)? 0 Suppose -255c + 129064 = -238c. What is the units digit of c? 2 Let y(x) = x*3 + 18x*2 + 36x + 315. Let r be y(-15). Let o = 304 - 175. Suppose on - 132n + r = 0. What is the tens digit of n? 5 Suppose 0 = 5s + 25, -5v - 2s = -17251 - 6159. What is the thousands digit of v? 4 Let o = -2726 - -1602. Let d be (-3 + 25/10)/((-2)/o). Let c = d + 406. What is the units digit of c? 5 Let a(i) = 10843i*2 - 202i + 203. What is the ten thousands digit of a(1)? 1 Suppose m + 12079 - 41563 = -i, 2m = 4i + 58986. What is the thousands digit of m? 9 Suppose 608 = k + 7k. Suppose km - 3885 = 71m. What is the hundreds digit of m? 7 Suppose -22h + 101 + 9 = 0. What is the units digit of (12/(-1))/(3h/(-310))? 8 Let p = -1091 + 669. Let h = -121 - p. What is the hundreds digit of h? 3 Suppose -f + 5t = -4f - 19, -4t = -4f + 28. Let k be (f - 36/15)(-6 + 1). Suppose -ky = y - 2o - 561, -5o = y - 170. What is the units digit of y? 5 Let t = -7952 + 14138. What is the hundreds digit of t? 1 Suppose 0 = s - 10 + 8. Suppose 14q - 4068 = sq. What is the units digit of (1 - 0 - q)70/(-140)? 9 Suppose 25q - 245847 = 158075 + 192578. What is the units digit of q? 0 Suppose -4i = -6i + 5d + 45893, -91831 = -4i - 5d. What is the units digit of i? 4 Suppose -2m = -5m - 165. Let w = m - -56. What is the units digit of w? 1 Let i(n) = 86n2 + 640n + 15. What is the tens digit of i(17)? 4 Let i = -130 + 252. Suppose 2n = 4w + i + 190, 5n - 5w - 790 = 0. What is the units digit of n? 0 Suppose -109v = 24v - 2396394. What is the tens digit of v? 1 Suppose -2r - 119 = -601. Suppose 3u - r = 29. Let p = 242 - u. What is the units digit of p? 2 Suppose 119995 = 13o - 8o. Suppose -46f - o = -84627. What is the thousands digit of f? 1 Suppose -6d = -5o - 3d - 319, -3o - d = 197. Let z be (-162)/(-48) + -3 + 1030/(-16). Let s = z - o. What is the units digit of s? 1 What is the units digit of -9 + 10760 + (-36)/3? 9 Let f(s) = 13s*3 - 138s*2 + 38s + 68. Let p(w) = -6w3 + 69w*2 - 18w - 34. Let u(g) = -3f(g) - 7p(g). What is the tens digit of u(23)? 1 What is the units digit of 1/3 + (-3941825)/(-435)? 2 Let x(m) = -2m3 - 7m*2 - m - 4. Suppose 46 = 8g + 6. Suppose 5 = gh - 6h. What is the tens digit of x(h)? 7 Suppose 0 = -5k - 3359 + 459. Let f be k/(-16) - 1/4. Let q = 127 - f. What is the tens digit of q? 9 Let i = 2786 + 276. What is the units digit of i? 2 Suppose 10d - 49 = 1. Suppose -3w = -do + 39, -w - 3 = -0w - 5o. What is the units digit of (-2 - w/10) + (-4446)/(-30)? 8 What is the units digit of 153/(-3)61264/(-84)? 6 Let j be 1/(((-3)/(-8))/3). Suppose -3r - 220 = jr. What is the units digit of (68/r - 1)/((-2)/5)? 1 Let h(b) = b3 + 32b*2 + 63b + 92. Let i be h(-30). Let t be 4/(-18) + 2/9. Suppose -in + 103 + 61 = t. What is the units digit of n? 2 Let f(k) be the first derivative of k3/3 - 5k*2 + 19k - 21. Let o be f(8). What is the units digit of 3 + 0 - (3 + (-222)/o)? 4 Let y be (1206/99 - 8) + 6/(-33). Suppose 1020 = 2t + yk, -5k + 1525 = 3t - 4k. What is the units digit of t? 8 Suppose -4h = 81o - 77o - 4364, 5o = -h + 5475. What is the hundreds digit of o? 0 Let h(d) = 2d*2 + 20d + 68. Let y be h(-8). What is the units digit of (-3)/((y/(-1424))/9)? 8 Suppose -5w + 2p = 25, -2w - 3p + 6 = -3. What is the units digit of (2 - (1 - 2))/((-1)/w)? 9 Let n = -5772 + 10288. What is the tens digit of n? 1 Let x(k) = 3k2 + 62k - 20. Let b be x(-21). Suppose -b = -3y + 2. What is the tens digit of -11(y - -84)/(-5)? 8 Suppose 884w = 841w + 2304026. What is the tens digit of w? 8 Let j(o) = -o*3 + 6o*2 - 4o + 18. Let k be j(6). Let h(g) = -3g3 - 9g*2 - 11g - 35. What is the units digit of h(k)? 5 Let c(t) = t*3 - 30t*2 + 28t + 35. Let j be c(29). What is the units digit of 1216/(-10)(-15)/j? 4 Let p be (5 + -20)8/6. Let n(x) = -11 + 2x2 + 0x*2 + 0x*2 + 28x. What is the units digit of n(p)? 9 Let m(y) = -y*3 - 74y*2 + 322y - 199. What is the tens digit of m(-80)? 4 Suppose 2n - 392u + 393u - 31043 = 0, 0 = -n + 2u + 15539. What is the tens digit of n? 2 Let h(x) = x*3 + 5x*2 + 2. Let b be h(-5). Suppose w + 3 = bu, 6w - 7w = -u. Suppose 467 = 5j + 2s + 29, 2j = us + 160. What is the units digit of j? 6 Suppose -22j = 12j - 38j + 25040. What is the units digit of j? 0 Let h(k) = -k3 - 16k*2 + 11k + 9. Suppose 0 = 3p - 5c + 145, -2c - 6 = 2. Let a = 38 + p. What is the units digit of h(a)? 1 Suppose 3x + 11084 = 6f - 4f, -5529 = -f - 5x. What is the units digit of f? 9 Suppose 3u - 4989 = h, h = 2u + 6h - 3343. What is the hundreds digit of u? 6 Suppose -3t + 3k = 2706, -35t + 3k = -31t + 3612. Let w = t - -1194. What is the tens digit of w? 8 Suppose 60q - 54q = 522. Let u = 94 - q. What is the tens digit of -1 + 170/14 - 1/u? 1 Let f(s) = 156s + 7583. What is the units digit of f(0)? 3 Suppose 22 = -17w + 18w. Suppose 18102 + 1170 = wl. What is the units digit of l? 6 Let k(i) = 1 + i2 - i - 6i*3 + 0i3 + i3. Suppose 2j + 230 = 2c + 244, 2j = 4c + 18. What is the units digit of k(c)? 7 Let q = -58 + 60. Let t(y) = 0y + y - 2y + y*3 - 985y*2 - 3 + 996y*q. What is the tens digit of t(-8)? 9 Let l = 42883 + 15962. What is the tens digit of l? 4 Suppose 14925 = 21l - 91125. What is the hundreds digit of l? 0 Let b be ((-72)/(-21))/((-6)/21). Let z(q) = -32q - 39. What is the hundreds digit of z(b)? 3 Let y(d) = -5d + 123. Let p be y(20). Let a(h) = -h*2 + 19h + 120. What is the tens digit of a(p)? 2 Let h be (-3 - -1)18547/(-34). Suppose 5x - h = 1129. What is the tens digit of x? 4 Suppose 19h = -110529 + 376871. What is the thousands digit of h? 4 Let d(n) = -n + 5. Let k be d(4). Suppose -43q - 266 = -38q - 3m, -2q = -4m + 112. What is the units digit of (q/(-39))/(244/(-246) + k)? 4 Let s(g) = -31g2 + 7g + 39240. What is the hundreds digit of s(0)? 2 Suppose 0 = -9i + 14i - 2n - 14, 4n - 4 = 2i. Suppose 0 = z + 1 - 2, 0 = it + 3z - 339. What is the units digit of t? 4 Suppose 0 = -3z + 727 + 83. Let m = z + 732. What is the units digit of m? 2 Let k(z) = 11z2 - 53z + 271. What is the hundreds digit of k(-23)? 3 What is the hundreds digit of (2048/(-12))/((-14)/(-36) + (-2)/4)? 5 Let y(w) = -4w - 40. Let p be y(-26). Let a = p + -63. What is the units digit of (18/(-54))/(a/(-6))? 2 Let h(v) be the third derivative of -53v*4/24 + 133v*3/3 - 57v2. What is the tens digit of h(-12)? 0 Let v(l) = -l3 + 25l2 - 11l + 9. Suppose -4g = 3i - 72, 4g = 8g - i - 88. What is the hundreds digit of v(g)? 5 Let r = 23085 + -15742. What is the hundreds digit of r? 3 Let k = 99 + 20. Let s = -74 + k. What is the hundreds digit of s/((10/15)/2)? 1 Suppose 1 = -2q + 5. What is the hundreds digit of q/(6/3) + -12 + 779? 7 What is the thousands digit of 35300/15 + -1 + 4/6? 2 Suppose 1027599 = 847t + 790t - 1586t. What is the thousands digit of t? 0 Suppose 4j = -3n + 54068, -n = 2 + 2. What is the units digit of j? 0 Let x = 5513 + -2988. What is the tens digit of x? 2 Let x(m) = -9m + 143. Let b be x(-6). Suppose w - 467 = -2v, w - 274 - b = -4v. What is the tens digit of w? 6 Let z(m) = m3 - 25m*2 + 44m + 46. Let l be z(23). Suppose -k + 5i + 805 = l, -5i - 4738 = -5k - 633. What is the hundreds digit of k? 8 Suppose 2r - 39259 = -3o + 91043, -3r = 2o - 86873. What is the tens digit of o? 3 Suppose -4c = -3f + 218, 3f = f + 3c + 145. Suppose -h + 0h + 76 = 3v, -h = 2v - f. What is the units digit of h? 0 Suppose -3v = -40 + 19. Suppose vp - 11 = 3. Suppose 2w = pd - 76, w + 2w = 2d - 77. What is the units digit of d? 7 Suppose 14h - 16h + 45h = 86688. What is the tens digit of h? 1 Let o(g) = 54g - 11. Let a(l) = 3l - 14. Let u = 94 - 88. Let m be a(u). What is the hundreds digit of o(m)? 2 Let c(r) = 2r - 27. Let d(z) = 5z + 14. Let i be d(0). Let n be c(i). What is the units digit of (-7134)/(-54) + n/(-9)? 2 Suppose -f - 8f - 6f = 0. Suppose -5z + 63 + 102 = f. What is the tens digit of z? 3 Let v(i) = i*2 - 8i + 12. Let f be v(7). Suppose c + 1218 = 3o - 687, -5o + 3	{ "pile_set_name": "DM Mathematics" }
Does 8 divide b? False Is 2 a factor of (15/((-180)/1456))/((-1)/3)? True Suppose 0 = 2v - 3g - 119 + 9, 5v - 292 = -g. Is 6 a factor of v? False Suppose 2x - 1943 = x - 4p, 4x - 4p = 7852. Is x a multiple of 8? False Let r = -8 - -12. Let q(k) = 0k*2 + rk + 2k2 + 4k2 + 2. Does 9 divide q(-2)? True Let t(y) = y2 - 5y - 46. Is t(-21) a multiple of 25? True Suppose -q - 13 = -y + q, -y + q = -8. Suppose 0 = -4x - 2r - 94, 0 = -4x - yr + 6r - 89. Does 12 divide 3/(-3) - (-2 + x)? True Suppose 3g - 56 = 2g. Suppose -221 = 5i - h, -h + g + 120 = -4i. Let d = i - -76. Does 9 divide d? False Let l(s) = -4s3 - 2s - 1. Let i be l(-2). Let y = i + -24. Suppose -24 = -5a + y. Is a a multiple of 7? True Let v(k) = 2k3 - k2 - 2k - 1. Let u be v(2). Let z = u + -8. Let c(p) = 15p*2 - 2p - 1. Is 16 a factor of c(z)? True Let s(n) = 6n3 + 2n*2 - 10n + 7. Let f be s(4). Suppose 0 = 5r + f - 963. Does 5 divide r? False Suppose 0 = 3v + 2v + 485. Let f = 35 - v. Suppose f = 2g - 4u, 2g + 54 = 3g + 2u. Is 11 a factor of g? False Let u(n) = -n*3 - 3n*2. Let i be u(-4). Suppose -244 - 113 = h. Is i/(-40) + h/(-5) a multiple of 22? False Suppose -3u - u + 12 = 0. Let s be (-6 + (-56)/(-8))3. Is 2/s - (-16)/u a multiple of 2? True Suppose 0 = -v + 5y + 16 + 13, -4v = 4y + 4. Let d(b) = 3b - 7. Let h be d(v). Suppose hp - 149 = 171. Does 16 divide p? True Let y(g) = -8g - 6 - g3 + 3 - 6g*2 + 0. Does 13 divide y(-6)? False Suppose 22f - 17f = -4b + 5020, 3b - 3764 = -4f. Is 18 a factor of b? True Let q = 298 - 180. Does 23 divide (q/(-3))/(22/(-33))? False Suppose 131 = 3s - 145. Let t = s + -6. Is t a multiple of 14? False Let h be 57/8 + 11/(-88). Suppose -3i - 3r + 6 = 0, 3r + h = 4i - 1. Suppose -i + 13 = d. Does 3 divide d? False Let n = 1150 - 751. Is n a multiple of 18? False Let y = -29 + 16. Let i = -10 - y. Suppose -3d + 166 = 2v, id - 207 + 13 = 5v. Does 15 divide d? False Let t(u) = -u3 + 3u - 1. Let y be t(2). Let r be ((-4)/y)/(4/6). Suppose ri - 4 = 4. Is 4 a factor of i? True Let w = 632 + -272. Is w a multiple of 9? True Let a(t) = -t3 - 9t*2 - 2t - 2. Let j be a(-9). Suppose 20m - 480 = jm. Does 20 divide m? True Let r(x) = 6x2 + 11x + 3. Is 4 a factor of r(-3)? True Let x be (5/(-2))/(1/(-2)). Suppose -3y + 0y = xj + 1, -j = 5y - 13. Is 34/812/y a multiple of 6? False Suppose 2g = -x - 11, 5x + 19 = g - 2g. Let w be -1 + (-2 - g) + -18. Let z = 27 + w. Does 5 divide z? True Suppose 0 = -5z + 2882 + 763. Is z a multiple of 27? True Suppose -5c + 492 + 1714 = -2f, -2f - 1764 = -4c. Does 26 divide c? True Let q(j) = j2 - 18j + 35. Suppose -3u - 9 = 4s - 65, -s = 5u + 3. Is q(s) a multiple of 6? True Let t(q) = -12q - 3. Let h = -29 - -33. Let k be t(h). Does 12 divide (-2)/3 - 1258/k? True Let y = 24 + 94. Suppose -2p - y = -2w, 3w - p = 3p + 181. Does 5 divide w? True Suppose -5 + 11 = i. Suppose 0 = il - l - 10. Suppose 0 = -3r + lh + 26, 3h = -4r - h + 68. Is r even? True Suppose -13s = -12s + 8. Does 3 divide s/12(-90)/4? True Suppose 0 = 2h - 7h + 675. Is h/36128/6 a multiple of 40? True Let p = -49 - -64. Does 8 divide (-766)/(-12) + p/90? True Let w(b) = -36 - 2b + 3b - 2b + 32 + 9b2. Is w(-2) a multiple of 4? False Suppose -23z = -8z - 7245. Does 21 divide z? True Let t(v) = -v3 + 3v*2 + 2v - 6. Let h be t(-5). Suppose -w = 3w - h. Let j = w - 27. Is j a multiple of 19? True Let l(v) = 92 + v2 + 5v*3 - 91 + 0v*2. Is l(2) a multiple of 35? False Suppose -5l + 555 - 145 = -3z, 0 = z + 4l + 148. Let f = 34 - z. Does 14 divide f? False Suppose -4u - 368 = -4f, -4u = f - 56 - 16. Is f a multiple of 11? True Suppose -b + 5 + 108 = -2f, -2f = -4b + 422. Suppose 197 = 4w - 0w + 5j, -2w - j + b = 0. Does 6 divide w? False Suppose -3m = -h + 54, 4h = m - 3m + 160. Is 3 a factor of h? True Let r(b) be the third derivative of b4/12 - 4b3/3 - b2. Does 4 divide r(6)? True Let r(b) = 3b2 - 3b - 8. Suppose -6n + 0 = -24. Does 14 divide r(n)? True Let u = 10 - 10. Suppose n - 5n + 260 = u. Is n a multiple of 12? False Let u(v) = 2v2 - 12v + 3. Let r be u(7). Does 12 divide ((-3)/(-6) + 0)2 + r? False Suppose 497w - 1664 = 489w. Does 16 divide w? True Suppose 25 = 2d - 7d, 0 = -h + d + 28. Does 2 divide h? False Let q be 4 + -3 + 3 + -6 + -32. Let c = q - -72. Is 20 a factor of c? False Let p = -18 + 27. Let c be (10/(-15))/((-2)/p). Is 1/(-1) + (50 - c) a multiple of 10? False Let i be -3 - -3 - -2 - -2. Let x(d) = 3d*2 - 2d. Is 7 a factor of x(i)? False Let b = 7 + -5. Suppose 188 = 5g + 3k, -31 + 103 = bg + 2k. Is 16 a factor of g? False Does 11 divide (2/4)/(45/49500)? True Let b be (0 + (3 - -3))2. Suppose 3n - n = b. Suppose 0 = -na + 2a + 52. Is 4 a factor of a? False Suppose -5q - 379 = -939. Suppose 3j + 2a = -17 + q, 0 = -2j + 5a + 57. Is 7 a factor of j? False Let f = 172 - 179. Suppose 0 = 7c - 2c + 10. Let m = c - f. Is m a multiple of 3? False Let a(n) = n3 - 17n*2 + 17n - 21. Let q be a(16). Does 28 divide 111/(-6)q/(15/6)? False Let x be 6/(3/(-816)2). Let w be (-6)/(-4)x/(-18). Is (-15)/(-45) - w/(-3) a multiple of 4? False Suppose 3d = 2i - 2043, -5i + 10d = -3i - 2022. Does 19 divide i? True Suppose -r = -3, 5z - r + 19656 = r. Suppose 10 = 2s + 3p, 0 = -3p + 5p - 4. Does 12 divide z/(-54) + s/9? False Suppose q = -4m + 250 + 61, 2m - q = 157. Let a be (0 - 1) + 0 + 1. Suppose 0 = -2w - 0u - u + 45, -3w - 5u + m = a. Does 15 divide w? False Let y be 700/6 - (-3)/9. Suppose -v = 2v - y. Suppose -5b = -v - 101. Does 9 divide b? False Let q be (1 + (-5)/2)/((-13)/(-26)). Is 24 a factor of (q + -1)/((-12)/144)? True Suppose 1 = -t + 6. Suppose -10 = tu + 7b - 2b, 0 = -3u + b + 10. Suppose -uy - 16 + 190 = 0. Does 29 divide y? True Let j(m) = -13m3 - 2m*2 - 2m - 1. Let t be j(-2). Suppose -3r + 30 = 3g, -r + 3g + 26 = 8g. Suppose -5n + t = -r. Is n a multiple of 7? True Suppose -996b + 997b = 1078. Does 7 divide b? True Suppose 0 = -2d + 4o + 79 + 55, -5o + 161 = 2d. Suppose -5g + 4j = -0g - 337, g + 2j - d = 0. Is g a multiple of 10? False Let h(b) = -b - 16. Let j be h(-10). Let g be j/(-4) + (-18)/(-12). Is 1119/12 + g/(-12) a multiple of 12? False Let j(d) = -9d3 - d2 + 2d + 3. Let r be j(-1). Let b(c) = c + 6 + 2c + 2c. Is b(r) a multiple of 12? False Let v(b) = b + 7. Let x be v(-5). Suppose -2w - 43 = -p - 7w, 3w - 39 = -p. Suppose -t + xt - p = 0. Is t a multiple of 8? False Suppose -3y - 4t + 107 = 0, 2y - 97 = t - 11. Suppose -22 - y = -7r. Does 9 divide r? True Let a be (4 - 1)28/42. Suppose -4s + 203 = -v - 186, -as + 2v = -196. Does 14 divide s? False Let l(f) = 3f + 15. Let c be (-1 + 37)11/33. Let w be 92/c + (-2)/(-6). Does 9 divide l(w)? False Let b = 66 + -67. Let n(p) = 76p + 4. Let i(s) = 114s + 6. Let h(g) = 5i(g) - 8n(g). Does 9 divide h(b)? True Suppose 3z = 4z - 7. Suppose -z - 4 = -g. Let d = g - -17. Is d a multiple of 10? False Let a = 155 + -30. Does 10 divide a? False Let v(z) = z3 + 19z*2 + 16z + 54. Does 17 divide v(-16)? False Suppose -4 = -2h, 4x - 5h - 2568 + 730 = 0. Does 11 divide x? True Let q be (5 + 4/4)26. Let r = 283 - q. Does 24 divide r? False Let r(x) = -13x - 46. Let p be r(-14). Suppose 344 = 15f - p. Is f a multiple of 15? False Suppose -3t = -0t. Suppose t = 22z - 27z + 440. Is 8 a factor of z? True Suppose 0 = 2b - v - 4172, 5b - 2v - 8369 - 2060 = 0. Is 86 a factor of b? False Suppose 4h - 32 = 4k - 0k, -3h = 3k. Suppose 78 = ha + a - 2l, 5a = 5l + 90. Is 6/14 + 806/a a multiple of 29? True Let b(h) = 8h + 6. Let v be b(9). Suppose -19c + v = -16c. Is c a multiple of 19? False Let q = 137 + 27. Suppose -q - 53 = -7n. Is n a multiple of 22? False Let x(w) = w*3 - 4w*2 + 3w + 3. Let u be x(4). Suppose 0 = -2l + u + 43. Is 6 a factor of l? False Suppose -5b + 45 = 140. Let f = b - -28. Is 4 a factor of f? False Let s = -17 - -21. Suppose o = -2o + si + 85, 0 = -2o + i + 60. Is o a multiple of 7? False Suppose 48 = -56b + 60*b. Suppose r - 6 - b = 0. Is 4 a factor of r? Fal	{ "pile_set_name": "DM Mathematics" }
centuries in millennia? 580.6517 What is 26198.88 meters in millimeters? 26198880 How many kilograms are there in 57/2 of a tonne? 28500 Convert 924760.1ml to litres. 924.7601 Convert 16396.4nm to micrometers. 16.3964 What is 7097856.3 milliseconds in hours? 1.97162675 How many centimeters are there in 1/20 of a meter? 5 How many kilometers are there in 424.4591 centimeters? 0.004244591 How many millilitres are there in six fifths of a litre? 1200 Convert 84.54843 millennia to centuries. 845.4843 How many grams are there in 6/5 of a kilogram? 1200 What is three tenths of a week in minutes? 3024 What is 965682.3 millilitres in litres? 965.6823 Convert 43.8948 decades to centuries. 4.38948 How many centuries are there in 1760067.9 months? 1466.72325 Convert 21568.74 micrograms to milligrams. 21.56874 What is 5164.215g in tonnes? 0.005164215 What is seven eighths of a litre in millilitres? 875 What is fourty-five halves of a day in minutes? 32400 How many months are there in 42448.56 decades? 5093827.2 How many minutes are there in fourteeen ninths of a day? 2240 What is thirty-four fifths of a kilometer in meters? 6800 How many days are there in 12667.3497us? 0.00000014661284375 How many millilitres are there in 14803.6 litres? 14803600 What is 5/8 of a day in seconds? 54000 What is 5.840462 grams in nanograms? 5840462000 How many tonnes are there in 0.0049522ug? 0.0000000000000049522 How many millimeters are there in 18.45139km? 18451390 What is twenty-five eighths of a litre in millilitres? 3125 How many minutes are there in 3/8 of a week? 3780 What is 162.174mg in grams? 0.162174 Convert 5.36637 grams to nanograms. 5366370000 Convert 0.846716 days to seconds. 73156.2624 How many millilitres are there in 5/8 of a litre? 625 How many nanograms are there in 87/2 of a microgram? 43500 Convert 2674560.6 nanoseconds to minutes. 0.00004457601 What is 74.5783ml in litres? 0.0745783 What is 0.0505392 weeks in nanoseconds? 30566108160000 What is 1/5 of a litre in millilitres? 200 What is 3/40 of a second in milliseconds? 75 How many millilitres are there in 1/10 of a litre? 100 How many nanometers are there in 7819.757 micrometers? 7819757 What is 2721.217l in millilitres? 2721217 How many hours are there in 23/6 of a day? 92 Convert 734563.6l to millilitres. 734563600 What is 24143.49 millilitres in litres? 24.14349 What is fourty-eight fifths of a micrometer in nanometers? 9600 What is 77964.32 millilitres in litres? 77.96432 What is one fifth of a litre in millilitres? 200 What is 3870682.2 milliseconds in hours? 1.0751895 What is 75.21686l in millilitres? 75216.86 How many nanograms are there in 341.8399g? 341839900000 How many kilograms are there in fourty-five halves of a tonne? 22500 How many nanometers are there in 471253.4 kilometers? 471253400000000000 Convert 68.31748g to nanograms. 68317480000 How many millennia are there in 9.298321 years? 0.009298321 What is 3/40 of a litre in millilitres? 75 How many decades are there in one tenth of a century? 1 How many nanoseconds are there in 3/32 of a millisecond? 93750 What is 0.2031397 weeks in nanoseconds? 122858890560000 How many centimeters are there in 211462.2 meters? 21146220 What is 8.809185 centuries in millennia? 0.8809185 How many nanograms are there in 99.89716ug? 99897.16 What is twenty-seven quarters of a hour in seconds? 24300 How many milliseconds are there in 3/5 of a second? 600 How many millilitres are there in 1/5 of a litre? 200 How many millilitres are there in thirteen eighths of a litre? 1625 Convert 36432.15nm to centimeters. 0.003643215 What is one quarter of a minute in milliseconds? 15000 What is 1/4 of a kilometer in meters? 250 Convert 103854.582us to days. 0.000001202020625 What is 358099.4 minutes in nanoseconds? 21485964000000000 What is 0.8050774 centuries in months? 966.09288 Convert 21.82792 millilitres to litres. 0.02182792 How many years are there in one quarter of a millennium? 250 What is three fifths of a century in months? 720 What is 498144.7 hours in nanoseconds? 1793320920000000000 What is 2514.226l in millilitres? 2514226 What is 11/8 of a kilometer in meters? 1375 How many hours are there in 1.8471732 minutes? 0.03078622 How many meters are there in thirty-two fifths of a kilometer? 6400 What is 25/4 of a litre in millilitres? 6250 Convert 8.73081 hours to seconds. 31430.916 What is 799.6675um in nanometers? 799667.5 What is 12/25 of a meter in millimeters? 480 How many meters are there in 21/5 of a kilometer? 4200 How many microseconds are there in 19/4 of a millisecond? 4750 What is 10/21 of a week in minutes? 4800 How many milligrams are there in 45/2 of a gram? 22500 How many micrometers are there in 11/2 of a centimeter? 55000 How many millilitres are there in one quarter of a litre? 250 Convert 5.232642 nanometers to kilometers. 0.000000000005232642 Convert 10686.45 millimeters to meters. 10.68645 How many milligrams are there in 1824.271 kilograms? 1824271000 Convert 5041.725cm to meters. 50.41725 What is four thirds of a millennium in months? 16000 How many grams are there in eighteen fifths of a kilogram? 3600 What is 55.63201 years in centuries? 0.5563201 How many millilitres are there in 0.3421128l? 342.1128 How many hours are there in 38/7 of a week? 912 How many nanoseconds are there in 105175.8 hours? 378632880000000000 What is 4.96686ng in micrograms? 0.00496686 What is seven halves of a day in hours? 84 How many litres are there in 5.21243 millilitres? 0.00521243 Convert 68.46764 nanograms to kilograms. 0.00000000006846764 Convert 74.51118 months to decades. 0.6209265 What is 17/4 of a litre in millilitres? 4250 Convert 5658.096 millennia to months. 67897152 How many meters are there in 3/5 of a kilometer? 600 What is three eighths of a gram in milligrams? 375 What is thirty-four fifths of a meter in millimeters? 6800 What is 404.2747kg in grams? 404274.7 What is 5.217368 centuries in months? 6260.8416 Convert 6127.3 meters to kilometers. 6.1273 How many millimeters are there in 12/25 of a meter? 480 What is 13/8 of a litre in millilitres? 1625 What is nine tenths of a kilometer in centimeters? 90000 Convert 102.0113m to centimeters. 10201.13 What is twenty-one eighths of a day in hours? 63 What is 57.00428 millimeters in kilometers? 0.00005700428 How many millilitres are there in 5/4 of a litre? 1250 Convert 3.15862 kilometers to nanometers. 3158620000000 Convert 73652.88 meters to kilometers. 73.65288 How many milligrams are there in 2339.902ug? 2.339902 What is 7/2 of a litre in millilitres? 3500 How many millimeters are there in 11/2 of a centimeter? 55 How many millimeters are there in 49/5 of a meter? 9800 How many nanograms are there in 0.9919187 kilograms? 991918700000 What is seven halves of a meter in millimeters? 3500 What is 41/2 of a microgram in nanograms? 20500 What is one tenth of a litre in millilitres? 100 What is 80825.19 minutes in microseconds? 4849511400000 What is 290425.14 microseconds in minutes? 0.004840419 What is one quarter of a gram in milligrams? 250 What is 8609.116 days in minutes? 12397127.04 Convert 532.241 hours to milliseconds. 1916067600 How many nanoseconds are there in 0.6440899 minutes? 38645394000 How many millilitres are there in three eighths of a litre? 375 What is 1/10 of a microgram in nanograms? 100 How many litres are there in 970608.8 millilitres? 970.6088 How many minutes are there in fourteeen ninths of a day? 2240 What is fifty-seven fifths of a litre in millilitres? 11400 What is 4/3 of a millennium in months? 16000 How many months are there in 1/10 of a decade? 12 How many minutes are there in 9273.139 weeks? 93473241.12 What is 32402.9ug in kilograms? 0.0000324029 What is 9533.812 kilograms in tonnes? 9.533812 How many micrometers are there in eleven quarters of a millimeter? 2750 What is 11/2 of a meter in millimeters? 5500 How many nanograms are there in 3/8 of a microgram? 375 What is 833263.9 millennia in centuries? 8332639 How many micrometers are there in 0.1532981 centimeters? 1532.981 Convert 0.272594us to milliseconds. 0.000272594 How many micrograms are there in 0.6779245 grams? 677924.5 Convert 906675.1 litres to millilitres. 906675100 How many grams are there in si	{ "pile_set_name": "DM Mathematics" }
10:46 AM What is 481 minutes before 10:32 PM? 2:31 PM How many minutes are there between 2:44 AM and 12:36 PM? 592 How many minutes are there between 3:57 PM and 6:29 PM? 152 What is 391 minutes after 12:55 PM? 7:26 PM How many minutes are there between 5:07 AM and 2:59 PM? 592 What is 485 minutes before 8:47 AM? 12:42 AM How many minutes are there between 3:32 AM and 7:23 AM? 231 How many minutes are there between 10:04 PM and 1:47 AM? 223 How many minutes are there between 7:00 PM and 6:18 AM? 678 How many minutes are there between 7:52 AM and 7:35 PM? 703 How many minutes are there between 9:44 PM and 6:00 AM? 496 How many minutes are there between 8:18 PM and 11:09 PM? 171 How many minutes are there between 9:02 PM and 4:55 AM? 473 What is 482 minutes after 6:16 AM? 2:18 PM What is 49 minutes before 11:57 PM? 11:08 PM What is 398 minutes before 12:56 PM? 6:18 AM How many minutes are there between 12:20 AM and 12:56 AM? 36 What is 502 minutes before 1:03 PM? 4:41 AM How many minutes are there between 2:36 PM and 2:48 PM? 12 What is 341 minutes before 1:39 PM? 7:58 AM What is 647 minutes before 11:04 PM? 12:17 PM How many minutes are there between 6:45 PM and 4:31 AM? 586 What is 274 minutes before 12:19 AM? 7:45 PM What is 102 minutes after 2:25 PM? 4:07 PM How many minutes are there between 5:51 AM and 5:37 PM? 706 How many minutes are there between 5:35 PM and 10:52 PM? 317 How many minutes are there between 12:12 PM and 8:24 PM? 492 What is 706 minutes before 9:41 AM? 9:55 PM How many minutes are there between 1:39 AM and 10:03 AM? 504 How many minutes are there between 4:28 PM and 8:23 PM? 235 What is 401 minutes before 3:01 PM? 8:20 AM What is 707 minutes before 11:22 AM? 11:35 PM What is 552 minutes before 2:35 AM? 5:23 PM How many minutes are there between 4:49 PM and 8:13 PM? 204 What is 217 minutes before 1:36 AM? 9:59 PM How many minutes are there between 5:18 AM and 4:05 PM? 647 What is 401 minutes before 3:42 PM? 9:01 AM How many minutes are there between 10:32 PM and 5:17 AM? 405 How many minutes are there between 5:46 AM and 2:07 PM? 501 How many minutes are there between 10:52 AM and 8:24 PM? 572 What is 19 minutes before 5:28 PM? 5:09 PM How many minutes are there between 9:03 AM and 11:18 AM? 135 How many minutes are there between 1:46 PM and 3:14 PM? 88 What is 156 minutes before 6:11 PM? 3:35 PM What is 432 minutes after 12:50 PM? 8:02 PM How many minutes are there between 5:22 PM and 10:42 PM? 320 What is 631 minutes before 12:25 PM? 1:54 AM How many minutes are there between 10:25 AM and 9:44 PM? 679 What is 700 minutes before 9:59 PM? 10:19 AM What is 386 minutes after 7:43 AM? 2:09 PM How many minutes are there between 5:03 AM and 10:25 AM? 322 How many minutes are there between 10:27 AM and 12:24 PM? 117 What is 630 minutes after 2:58 PM? 1:28 AM What is 104 minutes before 11:44 PM? 10:00 PM How many minutes are there between 12:16 AM and 12:15 PM? 719 What is 416 minutes after 2:31 AM? 9:27 AM What is 709 minutes after 9:47 AM? 9:36 PM How many minutes are there between 10:53 AM and 2:30 PM? 217 How many minutes are there between 6:40 PM and 8:23 PM? 103 What is 667 minutes after 7:18 PM? 6:25 AM What is 374 minutes before 2:47 PM? 8:33 AM How many minutes are there between 8:24 AM and 11:53 AM? 209 What is 40 minutes before 11:02 PM? 10:22 PM What is 155 minutes before 2:36 AM? 12:01 AM How many minutes are there between 10:25 AM and 6:35 PM? 490 How many minutes are there between 11:16 PM and 6:39 AM? 443 How many minutes are there between 1:28 PM and 3:10 PM? 102 How many minutes are there between 2:06 AM and 5:43 AM? 217 How many minutes are there between 12:59 AM and 1:35 AM? 36 What is 677 minutes after 2:04 PM? 1:21 AM What is 524 minutes before 9:14 AM? 12:30 AM What is 584 minutes after 3:03 PM? 12:47 AM How many minutes are there between 5:57 AM and 5:14 PM? 677 How many minutes are there between 11:37 PM and 1:08 AM? 91 What is 617 minutes before 5:32 AM? 7:15 PM What is 145 minutes after 5:32 AM? 7:57 AM What is 538 minutes before 6:03 AM? 9:05 PM How many minutes are there between 6:01 AM and 1:47 PM? 466 What is 504 minutes before 4:13 PM? 7:49 AM What is 685 minutes before 4:00 PM? 4:35 AM How many minutes are there between 1:49 AM and 4:24 AM? 155 What is 402 minutes before 7:27 AM? 12:45 AM How many minutes are there between 9:40 PM and 5:32 AM? 472 How many minutes are there between 8:30 PM and 7:48 AM? 678 How many minutes are there between 7:52 AM and 2:19 PM? 387 What is 646 minutes after 8:05 PM? 6:51 AM How many minutes are there between 11:41 PM and 8:21 AM? 520 What is 337 minutes after 4:04 AM? 9:41 AM What is 416 minutes after 9:14 AM? 4:10 PM How many minutes are there between 4:42 AM and 7:35 AM? 173 What is 139 minutes after 2:29 AM? 4:48 AM What is 36 minutes before 2:49 PM? 2:13 PM What is 481 minutes before 10:16 PM? 2:15 PM How many minutes are there between 4:43 AM and 2:11 PM? 568 What is 526 minutes before 10:19 PM? 1:33 PM What is 250 minutes before 11:04 PM? 6:54 PM What is 458 minutes after 8:42 AM? 4:20 PM What is 246 minutes after 10:57 PM? 3:03 AM How many minutes are there between 8:17 PM and 9:07 PM? 50 How many minutes are there between 1:13 AM and 11:57 AM? 644 How many minutes are there between 1:50 PM and 3:20 PM? 90 What is 371 minutes before 5:09 AM? 10:58 PM How many minutes are there between 2:08 AM and 1:15 PM? 667 What is 110 minutes before 12:18 PM? 10:28 AM How many minutes are there between 5:18 AM and 3:43 PM? 625 What is 92 minutes after 4:00 AM? 5:32 AM How many minutes are there between 8:54 PM and 2:49 AM? 355 How many minutes are there between 10:21 AM and 11:59 AM? 98 How many minutes are there between 3:12 PM and 1:03 AM? 591 How many minutes are there between 9:50 AM and 11:34 AM? 104 How many minutes are there between 4:12 AM and 12:49 PM? 517 How many minutes are there between 1:21 AM and 2:12 AM? 51 How many minutes are there between 3:35 AM and 5:52 AM? 137 What is 107 minutes after 11:54 AM? 1:41 PM What is 341 minutes before 6:11 AM? 12:30 AM What is 171 minutes after 6:11 AM? 9:02 AM What is 691 minutes after 3:33 AM? 3:04 PM What is 572 minutes before 3:33 AM? 6:01 PM How many minutes are there between 4:58 AM and 4:26 PM? 688 What is 556 minutes after 6:57 PM? 4:13 AM How many minutes are there between 9:00 PM and 7:43 AM? 643 What is 374 minutes before 3:52 PM? 9:38 AM What is 589 minutes before 5:33 AM? 7:44 PM What is 132 minutes after 9:36 PM? 11:48 PM What is 286 minutes before 8:38 PM? 3:52 PM How many minutes are there between 9:38 AM and 7:20 PM? 582 How many minutes are there between 6:37 PM and 11:41 PM? 304 What is 664 minutes after 2:38 PM? 1:42 AM What is 181 minutes before 2:41 AM? 11:40 PM How many minutes are there between 3:26 PM and 8:05 PM? 279 How many minutes are there between 1:40 PM and 9:19 PM? 459 What is 372 minutes after 7:21 PM? 1:33 AM How many minutes are there between 9:55 AM and 6:54 PM? 539 How many minutes are there between 1:56 PM and 4:34 PM? 158 What is 539 minutes after 8:18 AM? 5:17 PM What is 646 minutes before 2:13 AM? 3:27 PM What is 690 minutes after 12:04 PM? 11:34 PM What is 354 minutes before 12:03 PM? 6:09 AM How many minutes are there between 2:38 PM and 7:29 PM? 291 How many minutes are there between 11:18 PM and 12:48 AM? 90 How many minutes are there between 10:09 PM and 7:25 AM? 556 What is 25 minutes before 4:51 AM? 4:26 AM What is 49 minutes before 10:48 AM? 9:59 AM How many minutes are there between 7:07 AM and 12:27 PM? 320 How many minutes are there between 4:27 PM and 10:53 PM? 386 How many minutes are there between 1:15 PM and 11:25 PM? 610 What is 40 minutes before 2:58 AM? 2:18 AM How many minutes are there between 3:53 PM and 8:55 PM? 302 How many minutes are there between 3:09 AM and 6:32 AM? 203 What is 102 minutes before 6:29 AM? 4:47 AM How many minutes are there between 8:31 AM and 9:27 AM? 56 How many minutes are there between 9:26 PM and 4:25 AM? 419 How many minutes are there between 8:06 PM and 12:19 AM? 253 What is 597 minutes after 11:17 PM? 9:14 AM How many minutes are there between 5:19 PM and 3:16 AM? 597 What is 360 minutes before 8:05 AM? 2:05 AM How many minu	{ "pile_set_name": "DM Mathematics" }
-4s - 20. Which is the closest to -2/3? (a) t (b) d (c) 2 a Let y be ((-2)/30)/((-10)/(-25)). Let v be 1 + (-6)/8 + -1. What is the nearest to 2/11 in 4, v, y? y Suppose -19 + 3 = 8v. Which is the closest to -1/4? (a) 5 (b) 0.06 (c) v b Let y = -5.5 - -5. Let i = 0 + -0.1. Let o = i - -0.2. Which is the closest to o? (a) y (b) 4 (c) 0 c Let k be (1/10)/(2/4). Let u be (-1)/(-6) + (-11)/(-6). Suppose -4q = -2s - 8, -u = -4s + q - 2q. Which is the closest to s? (a) 0 (b) k (c) 2/11 a Let w = -12 - -10. Let a be -2-11/w. What is the nearest to a in -2/9, -5, 3/5? -2/9 Let a = 1 - 0.9. Let v = 39/8 + -33/8. Let q = -3/4 - v. What is the closest to a in -3, q, -4? q Let m = 95 - 94. Which is the closest to m? (a) -2 (b) 3 (c) 4/5 c Let t = -3/5 + 4/5. Which is the closest to 0.1? (a) t (b) 5 (c) -2/11 a Let z = 6.2 + 0.8. Let p = z + -6. Let i = p + -1.4. What is the nearest to -1 in i, -4, 1/4? i Let l = 7.4 + -8. Let n = l - 2.4. Which is the closest to 2/7? (a) n (b) -5 (c) -4 a Let p be 2/(-24) + 2/6. Let j = -14 - -19. Suppose c = -j, 9 = q + 2c + 24. What is the closest to p in -0.2, q, -2? -0.2 Suppose 2y = 7y - 50. Let n = -41/4 + y. What is the closest to -1 in n, -3/2, -0.3? -3/2 Let s(t) = -2t*2 - 7t - 4. Let k be s(-3). Which is the nearest to k? (a) 4/5 (b) 5 (c) 3 a Let k = 0.34 - -0.06. Let m = -0.3 + k. Suppose 4v - 3 = -4h - 7, 0 = 4h + 5v + 1. Which is the closest to m? (a) 2 (b) 0 (c) h b Let p be (10/(-25))/(14/10). Let r = 1 + -5. What is the closest to p in 2/3, r, 0? 0 Let q(z) = -3 + 0 + z + 2. Let s be q(-4). Let c = -0.8 - -4.8. What is the nearest to 1 in s, -0.5, c? -0.5 Let a = 14 + -18. What is the nearest to 0 in -1/2, 3, a? -1/2 Let y(k) = 4k + 1. Let g(m) = -2m - 1. Let r(z) = -5g(z) - 2y(z). Let h be r(-3). Which is the closest to -1? (a) -1 (b) 0.2 (c) h a Let o = -88 - -87. What is the closest to 0.1 in -2, o, 10? o Let d = 7.5 + -7. Which is the nearest to -2/3? (a) 5 (b) 0.1 (c) d b Let y = -9 - -13. Let i be (-60)/9 + y/6. Let t = 5 + i. Which is the closest to 0.2? (a) -5 (b) t (c) -1/6 c Let j = 6 - 4. Let d = -0.084 - -0.384. Which is the nearest to j? (a) 2 (b) -1 (c) d a Suppose 0 = 5j - 4f + 20 - 4, 0 = 2j + f + 9. Let p = 585 - 583. Which is the closest to p? (a) -2/19 (b) -1 (c) j a Let l = 76/3 - 25. Let w be (-16)/(-10) + 18/(-30). Which is the closest to w? (a) -0.4 (b) l (c) 5 b Let y = 47 - 49. Which is the nearest to 2/5? (a) y (b) -0.1 (c) 2/11 c Let o = 4 + -6. Let t(k) = -k3 + 6k*2 + 8k - 7. Let v be t(7). Let c = 3 + -3. What is the closest to v in o, c, -5? c Let k be 2/(-14)(-13 - -14). Which is the nearest to 2? (a) k (b) -3 (c) 0 c Let u = -97 + 96.9. Which is the nearest to u? (a) 6 (b) 4 (c) 0 c Let y = 0.37 - 0.07. Let m = 0.3 - y. Let n = -91 - -457/5. Which is the closest to n? (a) -0.5 (b) 5 (c) m c Let z = -12 - -6. Let g = 6.5 + z. Which is the closest to 0? (a) g (b) 1 (c) 5 a Suppose -w = -8 + 5. Let t(u) = 15u + 1. Let b be t(-1). Let p be 4/b(-1)/(-3). What is the closest to 2/9 in -3, w, p? p Let n = -0.3 - 0.1. Let k = n + -0.1. Which is the nearest to 0? (a) 0.1 (b) 3/2 (c) k a Let y = 8/17 - -1/34. Which is the nearest to 1? (a) y (b) 5 (c) -0.1 a Let t = 0.4 - 0.3. Let g = 0.8 - 1.8. What is the nearest to t in g, 2/13, 5? 2/13 Let i = -2.62 - 12.68. Let j = i - -15. Let z be -2 - (-13)/4 - 1. Which is the nearest to z? (a) -5 (b) 1 (c) j c Let x = 39.7 + -42. Let l = 0.7 - x. Let w = -14/57 + 3/38. What is the nearest to 0.1 in w, -0.3, l? w Let r = -8.3 - 0.7. Let d = -35 - -28. Let t = r - d. Which is the closest to -1? (a) t (b) -0.2 (c) 3 b Let y = 0 - -0.1. Let m = -5 + 2. Let t = -73 + 72.9. Which is the closest to -1? (a) m (b) t (c) y b Let g = -5.862 + 0.062. Let v = 6 + g. Let z = -2 + 2.1. What is the closest to 0 in 3, z, v? z Let f = 221.3 - 221. Which is the nearest to 2/9? (a) f (b) 0.4 (c) 2 a Let k = 7 - 10.8. Let s = -0.2 + k. What is the closest to 0.3 in -1/7, s, -0.2? -1/7 Let i = 36/19 - 290/133. Let k be (0 - 5)8/(-10). Suppose -11 = v + ko, 0 = -3v - 0v + o + 6. What is the closest to v in 1/2, -3/4, i? 1/2 Let v = -792 - -797.19. Let u = -0.19 + v. Which is the closest to 0.1? (a) 1/2 (b) -5 (c) u a Let m = -53 - -51. What is the closest to 2 in m, 0.1, -0.1? 0.1 Let l = -0.3 - -1.3. Let u = 10 - 6. Let z = 4 - u. Which is the closest to z? (a) l (b) -2/13 (c) 0.4 b Let l = 13 + -12. What is the nearest to l in -3/4, -3/5, 2? 2 Let r be (-2 + 3/2)-48. Let b be 1 - -1 - r/9. Let l = -2 - -1. What is the nearest to l in -4, b, -5? b Let h = 14.5 - 14. What is the closest to 1/5 in -0.5, h, -2? h Let o = 0.34 + -0.4. Let x = o + -0.34. Which is the closest to 0? (a) 0 (b) x (c) -5 a Let m(l) = -l*2 + 4l + 13. Let n be m(6). What is the nearest to 2/7 in -0.3, n, 5? -0.3 Let h = 0.103 - 0.303. Which is the closest to 0? (a) 2/3 (b) h (c) 0.1 c Let b = 0.05 + -0.55. Let u = -0.06 - -0.56. What is the nearest to 0.1 in 2, b, u? u Let r = 3 - 2. Let q(o) be the third derivative of -o*4/24 + 2o*3/3 - 2o*2. Let s be q(4). Which is the nearest to r? (a) -1 (b) s (c) -0.5 b Let p = -0.5 - -0.4. Which is the nearest to p? (a) -3 (b) 0 (c) -1 b Let k = -3 - -2.6. Let u be 11/(-7)2. Let q(i) = -i + 7. Let a be q(3). What is the closest to u in 1, k, a? k Let f(k) = -k2 + k + 2. Let d be f(2). Let m = 6 - 10. Let r(p) = -p2 - 6p - 9. Let v be r(m). What is the nearest to -0.1 in -0.5, d, v? d Let q = -16 + 14. Which is the nearest to 1? (a) 2 (b) -5 (c) q a Let t = -2.3 - 2.7. Let n = 4.2 + -0.2. What is the closest to -1/4 in -3/8, n, t? -3/8 Let o = 6.9 - 6. Let v = o - 0.4. Let s be (24/90)/(4/10). What is the closest to 2 in s, 5/3, v? 5/3 Let y = -788 - -782.77. Let s = y + 0.23. Which is the nearest to -4? (a) 0 (b) s (c) 2 b Let d(k) = k*3 + 4k*2 - 9k + 1. Let y be d(-7). Let b be 2/(-18)-13-57. Let x = b - y. What is the nearest to 0 in 5, -1/9, x? -1/9 Let a = -109 + 107. Let d = -1.1 - -1. What is the closest to d in -0.1, -5, a? -0.1 Let o = -3 + 6. Let p = 4.7 + -3.7. Which is the nearest to p? (a) -2 (b) -0.5 (c) o b Let x = 33 - 50. Let k = x - -17.1. Which is the nearest to k? (a) -0.2 (b) 0 (c) -4 b Let y be (14 - 12) + (-2 + -3 - 0). Which is the closest to 0? (a) -2/17 (b) 5 (c) y a Let d = 14 - 14.3. Let j = -1 - 0. Let m = 0.01 + -0.21. Which is the nearest to j? (a) d (b) -0.1 (c) m a Let z = 2.16 + -1.16. Which is the nearest to 2? (a) 2 (b) -2/9 (c) z a Let j = 2047 - 114645/56. Let o = 3/8 + j. Which is the closest to -1? (a) o (b) 0 (c) -0.4 c Let g = 43 - 38. Which is the closest to -3? (a) -2 (b) g (c) 0 a Let j be 1438/14 - (2 - 1). Let l = j + -102. What is the nearest to l in -2/21, -4/3, -2? -2/21 Let n(x) = x*3 - 19x*2 + 17x + 22. Let j be n(18). Suppose -y - jr = -4y + 5, 5y = -2r - 9. Which is the nearest to 2? (a) 2/11 (b) y (c) -2 a Let t = 3 + -2.98. Let z = -93 + 94. Which is the nearest to z? (a) 4 (b) t (c) 3 b Let d = 17.02 + -17. Which is the nearest to 0.1? (a) d (b) -5 (c) 1/4 a Let v = 2/11 - -3/44. Which is the nearest to 2/7? (a) -10 (b) -3/7 (c) v c Let r = 0.35 + -0.55. Which is the closest to r? (a) -1 (b) -4/5 (c) 0.2 c Let p(u) = -u - 6. Let t(l) = l*2 + 8l - 2. Let x be t(-7). Let d be p(x). Which is the nearest to 0.1? (a) 5 (b) 1 (c) d b Let o = -2.8 + 3. Let u = 134 - 668/5. Which is the nearest to 2? (a) u (b) o (c) 0.5 c Let b = 0 - -3. What is the nearest to b in -4, -0.4, 1/6? 1/6 Let o be (-19)/45 + (-4)/(-20). Let y = 0.019 - -9.281. Let n = y + -9. What is the nearest to n in o, -5, 2/17? 2/17 Let n = -8 - -1. Let j = 0.6 - -4.4. Let a = j + n. What is the nearest to 1 in -2/5, -2/15, a? -2/15 Let g = -0.3 - 0.7. Let r = -198 - -197.7. Let i = 4 - 7. What is the closest to g in i, r, -2/7? r Let y = 7.07 + -7. Let j = y - 0.47. Suppose r = 4r. Which is the nearest to 0.1? (a) r (b) j (c) -0.2 a Let t = 7 + -4. Which is the nearest to -1/3? (a) 0 (b) t (c) -0.5 c Let f be (5 - 47/9)/((-2)/3). Which is the nearest to 0? (a) f (b) 5/4 (c) 0 c Suppose -5p - 3 = -13. Suppose p*q +	{ "pile_set_name": "DM Mathematics" }
3? 3 Which is bigger: -0.0217 or -4? -0.0217 Is -4/1223 at least -1? True Do -4 and -15 have different values? True Do -201 and -188 have different values? True Which is bigger: -18 or -72? -18 Is 137/12 smaller than 11? False Is -8/1035 < 0? True Is -0.2 greater than or equal to -214? True Which is greater: -93 or -94? -93 Is 797 at least as big as -5? True Which is smaller: 0 or -225/259? -225/259 Which is smaller: -10 or 6? -10 Which is smaller: -163 or -28? -163 Which is bigger: -165 or -0.1? -0.1 Is -7 at most as big as -168/25? True Is -2/54603 >= -1? True Which is smaller: -4 or -6? -6 Which is bigger: 22 or 23? 23 Is -1 not equal to 2/11955? True Is -70 >= -65? False Which is smaller: 9 or 305/32? 9 Are -7/267 and -1 equal? False Which is bigger: 203 or 208? 208 Is 17/27 less than or equal to 1? True Are -148 and -150 non-equal? True Is -3300 at least as big as -3311? True Which is bigger: -2617 or -2619? -2617 Is -5/22 at most 1? True Which is smaller: 323 or 322? 322 Which is smaller: -1 or 1/11? -1 Which is greater: 3/14309 or -1? 3/14309 Which is smaller: 775 or 759? 759 Is -402 not equal to -402? False Is -1332/11 bigger than -120? False Which is bigger: -1/7261 or 1? 1 Do 178 and 179 have different values? True Which is smaller: 0 or 3/4694? 0 Which is smaller: 4/4137 or 0? 0 Do 19262/3 and 6420 have different values? True Which is smaller: 158 or 155? 155 Which is greater: -0.17 or -1/4? -0.17 Is 1 at least as big as 17246? False Which is smaller: 1 or 9/263? 9/263 Is 4/475 equal to 0? False Which is greater: 2240 or -0.1? 2240 Is 55 bigger than 35? True Which is smaller: -2/13363 or 1? -2/13363 Which is greater: -4554 or -4553? -4553 Which is smaller: 1 or 35/78? 35/78 Which is smaller: -0.112 or 0.077? -0.112 Which is bigger: -3/62 or 0? 0 Is 0.2 less than 26? True Is 2/143 bigger than -4/5? True Is -95 at least as big as -98? True Which is smaller: -4 or 142? -4 Is 0 at most as big as -1/10422? False Is 51/664 >= 0? True Which is greater: -17.7 or 73? 73 Which is smaller: 17 or 19? 17 Which is bigger: -8/167 or -1? -8/167 Do 31/67 and 1 have different values? True Is -4/77 equal to -2/7? False Which is smaller: 514 or 516? 514 Which is smaller: -86 or -81? -86 Is -107 greater than -26? False Which is smaller: 1/208 or 10? 1/208 Is 0.1 greater than or equal to 45/16? False Which is bigger: 8643 or 8644? 8644 Which is greater: 53/56 or 0? 53/56 Which is smaller: 0.1029 or 0.2? 0.1029 Which is smaller: -867 or -863? -867 Is 0 smaller than -3/12071? False Which is greater: 2/3 or -584? 2/3 Is 2901 greater than 2899? True Which is greater: 3483 or 3479? 3483 Is 12587 greater than 12589? False Is -53 at most as big as -77? False Is 38 bigger than -70? True Is -16 > 1/2? False Are 136 and 117 nonequal? True Which is greater: -136 or -137? -136 Is -1 <= -6/695? True Is -420/19 less than or equal to -22? True Which is smaller: 0 or -2/205? -2/205 Is -270 at most as big as -2? True Which is smaller: -1 or -57? -57 Is 486 smaller than -2? False Do -421/27 and -15 have the same value? False Which is smaller: 138 or 5.2? 5.2 Which is smaller: -135 or -134? -135 Which is bigger: -1.1 or 43? 43 Which is smaller: -0.36 or 39? -0.36 Are 7848 and 7848 equal? True Which is smaller: 2649 or 2651? 2649 Which is smaller: 143 or 89? 89 Which is smaller: 0.1 or -55132? -55132 Which is bigger: -0.2 or -78? -0.2 Is 11513 > 11515? False Is -34371 at most -34370? True Is -134 != -134? False Is -0.1 less than -4701? False Which is greater: 1 or -3/32? 1 Which is smaller: 15 or 2/27? 2/27 Which is greater: 33/2 or 17? 17 Which is greater: -1 or -5/1491? -5/1491 Is 17.84 bigger than 1? True Which is smaller: -1/3 or -0.01? -1/3 Do 0.745 and -1 have the same value? False Which is greater: -101 or -100? -100 Which is greater: -64 or -391/6? -64 Are 3/5 and 4.9 nonequal? True Which is smaller: 3 or 232? 3 Which is greater: 36 or -211? 36 Which is greater: 2/13 or -52? 2/13 Which is smaller: -4/3 or 0.0043? -4/3 Which is greater: -962 or -971? -962 Is 19236 > 19235? True Which is smaller: -35/13 or -2? -35/13 Is -0.1 at most -290? False Which is smaller: 2838 or -0.3? -0.3 Is 7/1241 <= -1? False Which is greater: 1 or -16/957? 1 Is 44 <= 45? True Which is smaller: 47/18 or 4? 47/18 Is -0.1 greater than -9201? True Which is greater: -1 or -6/15793? -6/15793 Which is greater: 9/743 or -2/5? 9/743 Which is smaller: -134 or -121? -134 Is -8455 > -8452? False Does -2364 = -2363? False Which is greater: -625 or -618? -618 Is -7/11 greater than or equal to -2? True Is 192/49 greater than 4? False Which is bigger: -122 or -123? -122 Is 221 < 239? True Which is smaller: -294 or -300? -300 Are 0 and -22/1007 nonequal? True Which is smaller: -0.3 or 45? -0.3 Is 59 greater than 64? False Which is greater: 0.1 or -53.5? 0.1 Which is smaller: 329 or 331? 329 Which is bigger: 2/1475 or 1? 1 Is -23 at most as big as -40? False Do 0.1 and -107 have the same value? False Are 395 and 389 unequal? True Which is smaller: 2 or 18.9? 2 Which is bigger: 5/207 or -1? 5/207 Which is smaller: -104 or -105? -105 Is -2/2589 equal to 0? False Which is bigger: 793 or 807? 807 Do -7 and 13 have the same value? False Which is smaller: 397/4 or 98? 98 Is -1/18 smaller than 39/7? True Which is smaller: 3/23 or 1/337? 1/337 Which is smaller: 20 or 5? 5 Is 212 smaller than -0.2? False Which is bigger: -1 or 1/2574? 1/2574 Which is smaller: -164/3 or -54? -164/3 Which is bigger: -2/717 or -1? -2/717 Which is bigger: -7/23 or 1/2? 1/2 Which is smaller: -21 or -39? -39 Which is smaller: 1 or 1/12763? 1/12763 Is 2491 <= 4983/2? True Which is smaller: 2 or -1/6311? -1/6311 Is 3 smaller than 6? True Which is smaller: 1 or 2/3869? 2/3869 Which is smaller: -116/23 or -6? -6 Is 408 at most 404? False Which is smaller: 1397 or 1388? 1388 Is 2 > 30/43? True Is 5/7793 at most -1? False Which is bigger: -3/137 or 2? 2 Is 11646 bigger than 11645? True Is -866/47 > -18? False Which is bigger: 3 or 109/31? 109/31 Is -68 smaller than -62? True Which is greater: -3/1223 or 1? 1 Are 2/119 and 17/14 nonequal? True Is -13228 smaller than -13228? False Which is greater: -5/1659 or 0? 0 Is 2/2059 < 0? False Which is bigger: -91 or -94? -91 Is 3.6 > 148? False Is 121 greater than or equal to 121? True Which is smaller: -59 or -58? -59 Do 461/39 and 11 have different values? True Is 2 >= 49/20? False Is -74 at most -510/7? True Which is smaller: -2/97 or -0.3? -0.3 Which is smaller: 488 or 485? 485 Is -3272 < -2/5? True Which is bigger: 0 or -3/74? 0 Is -2654 <= -2653? True Which is smaller: -19 or 365/2? -19 Do 110/23 and 4 have different values? True Which is greater: 628/47 or 12? 628/47 Which is bigger: 757 or 0.1? 757 Do 41 and 83/2 have different values? True Which is smaller: 1 or 7/26? 7/26 Which is bigger: 18 or -9? 18 Which is greater: 8421 or 8420? 8421 Is 379/19 at most 20? True Which is smaller: 2/3 or -452? -452 Is -276 < -282? False Is 1 < 7/320? False Is 171 > 155? True Is -1/127 less than 0? True Is 2406 < 2405? False Which is smaller: 0 or 70/87? 0 Does -1 = -1/26795? False Which is smaller: -1 or 13/720? -1 Is -1 < -2/1295? True Is 0 less than 5/1159? True Which is smaller: -312/5 or -63? -63 Is -17 at least as big as -22/3? False Is 1/345 > 1? False Which is smaller: -26 or 0.0912? -26 Is 277 < 3? False Which is greater: -363 or -364? -363 Is 557 < 561? True Which is smaller: -68/3 or -46/5? -68/3 Is 425 equal to 428? False Which is bigger: -2700/13 or -208? -2700/13 Which is smaller: -251 or -255? -255 Is -2/13 > 4/723? False Which is greater: 4566 or 4565? 4566 Is -9.2 <= -52? False Which is smaller: -1 or 2/721? -1 Which is smaller: 13 or -1/4? -1/4 Which is smaller: -3.5 or -0.2? -3.5 Which is bigger: 4/1317 or -1? 4/1317 Is -1 < 12/103? True Which is greater: 28 or 809/29? 28 Which is bigger: 263 or 2/5? 263 Does -4 = 1229/2? False Is -5 greater than or equal to -140/29? False Which is smaller: -593 or -594? -594 Which is smaller: -6/91 or 1? -6/91 Which is greater: -26291 or -26290? -26290 Is 232 at least as big as 221? True Is 1 <= 11/37? False Which is smaller: -13599 or -13598? -13599 Which is bigger: -34 or -38? -34 Is -3/14 smaller than 18? True Which is greater: 2 or 12.9? 12.9 Is 8.	{ "pile_set_name": "DM Mathematics" }
= 5n, 3w + n + 1084 = -0n. Let j be ((-2)/(-3))/((-16)/w). Let i = j - 16. Give l(i). 2 Let r(s) = -7s - 21. Suppose -165j + 1127 = 669 - 1192. Calculate r(j). -91 Let i(j) = -j2 - 6j + 2. Let v be i(-6). Let l(h) = -5h + vh + 0 - 1 - h*2. Let o(d) = -175d - 177. Let q be o(-1). What is l(q)? 1 Let u = 30 + -26. Let w(c) = -2 + 2c2 + 0 - uc*3 + 5c*3. Let h(a) = -4a*3 - 9a*2 + 9. Let s(d) = 4h(d) + 18w(d). Give s(1). 2 Let f(a) = 129a*3 - 152 + 27a*2 + 461a - 128a3 - 441a. Calculate f(-26). 4 Let l be (-2)/(-4) + (-19)/(-2). Suppose 3z + 28 = lz. Let v(t) = -2t2 + 4t + 2. Determine v(z). -14 Let n be ((-770)/(-99) - 4/(-18)) + -4. Let c be (n/16)/(4/(-16) - 0). Let v(k) = -12k - 3. Let h(f) = -13f - 4. Let z(b) = 3h(b) - 4v(b). Calculate z(c). -9 Let x be 9/(-27) + 0 - (-32)/6. Let j(b) be the second derivative of 0 + 1/2b3 + 1/20b*x + 16b - b*2 - 5/12b*4. Determine j(5). 13 Suppose -3t + 64 = 22. Suppose -3s + t = -7. Let c(i) be the second derivative of -i3/3 + 5i*2/2 - 56i - 3. What is c(s)? -9 Let v(j) = j*2 - 203j + 7338. Let o be v(47). Let b(a) = -a*3 + 4a*2 + 5a - 2. Calculate b(o). -44 Let v(r) = 3r - 18r - 4206035 + 4206290. Give v(17). 0 Let g(n) = 824n - 209n - 209n - 2 - 205n - 203n. What is g(1)? -4 Let s(b) be the first derivative of b3/3 - 14b*2 - 378b - 3701. Determine s(-10). 2 Let l(t) = -t*3 + 9t + 9t + 12t + 17t - 11t*2 - 54t - 18. What is l(-11)? 59 Let a(z) = -z3 - 1. Let s(g) = g2 + 7g + 6. Let x be s(-4). Let j be 4/(-10) + x/10 - 0. Let l(k) = -k2 - 5. Let r(t) = jl(t) + 6a(t). Determine r(1). -6 Let g(n) = 8n - 24. Let s(y) = -421y + 1272. Let r be s(3). Give g(r). 48 Suppose -6n - r + 22 = -n, -2n = 5r - 18. Let m(t) = 4 - 2t + 3 - n - 3t2 + t3. Suppose -3a = -3h - 7 - 2, -h = -5a + 23. Determine m(h). -5 Let f = 317 - 295. Suppose -f = -16p + 58. Let m(g) = -2g + 9. Give m(p). -1 Suppose -4m = -5w - 13, 3m = -4w - 0w + 2. Let t(z) = 400604 - 400604 + 11z. Determine t(w). -11 Let q(r) = 62r + 2165. Let i be q(-35). Let c(b) = -b*3 - 4b*2 + 10b + 21. Determine c(i). -4 Let j = 22 - 18. Let m(n) = -n*2. Suppose 3h + 2t - 1 = 0, 10 - 3 = 4h - 3t. Let s(l) = -7l*2 + 3l - 4. Let v(g) = hs(g) - 6m(g). What is v(j)? -8 Let s be (-2 + 7)(0 - -1). Let h(r) = 7r*2 - 6r*2 - 6 + 5r - 3r - sr. Let v = 372 - 367. Give h(v). 4 Suppose 0 = 2p + 4n + 16, 2n - 24 = p + 2p. Let g(c) be the second derivative of -c4/12 - c3 + 3c2 + 109c - 1. Determine g(p). -10 Let m be (-2)/(5(786/790 + -1)). Suppose -5a = -68 + 458. Let d = a + m. Let g(v) = 13v2 - 2v + 1. Calculate g(d). 12 Let r(c) be the third derivative of 2c5/15 - c4/8 + 7c3/2 - c2. Let f(l) = 3l2 + 19 - l - 68 + 56. Let i(h) = -11f(h) + 4r(h). What is i(0)? 7 Let w(l) = 27l. Let c be ((-93)/(-12) - 8) + 9/4. Let n(f) = -f*3 + 5f*2 - 10f + 9. Let y be n(c). Determine w(y). 27 Let u(a) = a*2 + 21a - 73. Suppose -139h + 186 - 3522 = 0. Give u(h). -1 Suppose -33i + 32 = -i. Let l(j) = -2j3 - 4j*2. Let b(t) = -6t*3 - 9t*2. Let g(v) = 3b(v) - 7l(v). Determine g(i). -3 Let k(i) be the second derivative of -35i4/12 + i3/6 - i*2 + 4i + 6. Determine k(-2). -144 Let l(n) = 2180n - 8. Let b be l(2). Let s(p) = 4p - 4p2 + b - 4354 + p2. Determine s(2). -6 Let q(t) = 4t - 6. Suppose 5j = 1138 - 203. Let l = j - 181. Determine q(l). 18 Let a(q) be the second derivative of 0 + 1/6q*3 - 190q + 6q2. What is a(-7)? 5 Let j(a) be the first derivative of a3/3 - 9a*2/2 - 5a + 359. Suppose n + n = 18. What is j(n)? -5 Let w = -638 + 594. Let m(q) = -3q + 1. Let h(r) = 64r - 22. Let l(o) = wm(o) - 2h(o). What is l(-2)? -8 Let y(l) = -19l2 - 3l - 4. Let v = 3526 + -3527. Give y(v). -20 Suppose -2a + q - 121 = -7a, -5q = 3a - 77. Suppose 34i = ai - 20. Let l(o) = 2o3 + o2 - 2o. Determine l(i). -8 Suppose -b + 144 = b. Suppose y - 10y + b = 0. Suppose 0 = 4p - yp + 4. Let n(v) = -5v*2 - 2v + 1. Give n(p). -6 Let t(f) be the third derivative of -f*4/8 + 7f*3/6 - 20f*2 + 1. Suppose 7 = -5j + 6j. Calculate t(j). -14 Let i(d) be the first derivative of -85 - 1/4d*4 + 2d*2 + 0d - 2/3d3. Give i(-3). -3 Let m(y) = -3y*3 + 2y*2 + 7y - 14. Suppose -55 - 47 + 214 = 56q. Give m(q). -16 Let v(u) = -119201u*2 + u + 119199u*2 - 4 - 8u. What is v(-7)? -53 Suppose 0 = 4y + 5t - 18, -4y - 4t + 14 = -y. Suppose 0 = -n - 5q - 9, 4q = 3n + q - 9. Let g(r) = 2r - n + 8r + 5r + r - 12r. Calculate g(y). 7 Suppose -a = -6a - 15. Let t = 90 - 88. Let g(b) = -2b2 - 3b + 5b2 - 6b*t + 4 + 0b*2 - 1. Calculate g(a). -15 Let z(l) be the first derivative of 4l + 4/3l3 + 3/2l*2 + 1/4l*4 - 70. Give z(-4). -8 Let v(y) = -6y + 14. Suppose -165s - 18 = -162s. Let f(x) = -7x + 17. Let q(z) = sv(z) + 5f(z). What is q(-2)? -1 Let y be 7(-7 - -8) - (-2 - -7). Let f(m) = m*3 + 7m*2 - m - 1. Let t(i) = 6i*3 + 34i*2 - 7i - 4. Let z(q) = yt(q) - 11f(q). Calculate z(9). -24 Let b(q) = -q*2 + 2q - 4. Let j(t) = 0t - 4568 - 2t*2 + 13t + 4558. Let d be j(5). Determine b(d). -19 Let t(j) = -j*2 - 18j - 77. Let s be t(-8). Let v(l) = 17l - 50. Give v(s). 1 Let l(s) = s2 + 5s + 1. Suppose -5d = -4q - 7, -13 = d + 24q - 20q. Let m be d + -7 - (12 - 17). Give l(m). -5 Suppose 83o - 303 = -18o. Let b(l) = l*3 - 2l*2 - 2l - 5. Determine b(o). -2 Let w(p) = -8p. Let i(a) = -11a + 7. Let c be i(1). Give w(c). 32 Let u(y) = 6y - 39. Let w be u(5). Let k be 0 + (2 - w/(36/8)). Let i(n) = n3 - 4n*2 - 2n + 2. What is i(k)? -6 Let g(u) be the second derivative of u*5/20 + 7u*4/12 + 4u*3/3 - 7u*2/2 - 2u - 53. Let c be g(-5). Let j(b) = -3b2 - 4b. Give j(c). -39 Let y(m) = -m + 2. Let a(k) = -6k + 20. Let p(u) = -a(u) + 8y(u). Let j be p(-1). Let i(g) = g - 6g2 - 1 + 3 - 2g. Calculate i(j). -20 Let s(r) be the third derivative of -31r6/120 + r5/60 - r4/24 + r3/6 + 689r*2. Calculate s(1). -30 Let p(x) = 6x - 87. Let v(o) = -9o + 119. Let t(q) = -7p(q) - 5v(q). Calculate t(-10). -16 Suppose -4d = -l - 521, -d = 2l - 3d + 1030. Let n = -515 - l. Let m(x) = -5. Let t(j) = -j - 4. Let v(r) = -3m(r) + 4t(r). Calculate v(n). 7 Let t(c) = -c3 + c2 + 2c - 3. Suppose -k + n = -3n - 32, 2k = 5n + 49. Suppose -kz = -14z - 2. Let g be -6 + 6 + (-2)/z. Determine t(g). -3 Let k(s) = 9s + 3. Let i(u) = 1. Let p(r) = 12r + 10. Let z(j) = 8i(j) - p(j). Let o(n) = 3k(n) + 2z(n). Calculate o(4). 17 Let m be ((-62)/(-155))/((-1)/(-5)). Let v(c) = 14 + 0 - 153c*2 + 154c*m + 2c - 3c - 1. Calculate v(0). 13 Let r be 1/(((-2)/4)/(274/(-4))). Let k = r - 45. Let i = -89 + k. Let d(u) = u2 - 3u - 2. Give d(i). -2 Let q = 225 - 216. Suppose -qt - 12 = -13t, 0 = 4l + 2t - 38. Let d(z) = -z*3 + 8z*2. What is d(l)? 0 Let a be ((-13)/(-2) + 4)/(30/(-80)). Let j(w) = 2w + 62. Determine j(a). 6 Let r(d) = -12d3 - d2 + 2d + 1. Let b = -3394 - -3393. What is r(b)? 10 Let k(x) = -24x - 230. Let i(c) = 27c + 219. Let r(t) = -5i(t) - 6k(t). Determine r(-32). -3 Let t(p) = -p*2 - 10p - 16. Let w be (1 + 21/(-12))(-1080)/162. Suppose 5u + 12 - 2 = -5j, wu - 2j = -45. What is t(u)? 5 Let m(v) = -v3 + 2. Let g(a) = 2a*3 + 7a*2 + 8a - 8. Let w = -93 + 94. Let u(p) = wg(p) + 3m(p). What is u(8)? -2 Let q be (2 + -2)(-1)/(-2) - 10. Let x(i) = 5i*2 + 51i + 3. Calculate x(q). -7 Let j(l) = 18l - 27. Suppose -12w - 199 - 195 + 418 = 0. Give j(w). 9 Let w(b) = 37b3 + b2 - 10b + 9. Let l(o) = 17o3 + o2 - 5o + 5. Let s(f) = 13l(f) - 6w(f). Determine s(7). -24 Let i(g) = -g*3 - 14g*2 + 2g + 31. Suppose 24v = -84v + 652 - 2164. Give i(v). 3 Let p(x) = x + 292. Let m(t) = -t - 332. Let o(s) = -7m(s) - 8p(s). Give o(-3). -9 Suppose 245u - 234u = -44. Let a(n) = -n*2 - 5n + 18. Calculate a(u). 22 Let g(a) = 42a - 35. Let l = -12507 - -12508. Calculate g(l). 7 Suppose 0 = 3k - 3a - 1 + 7, 3 = a. Let p(y) be the third derivative of -y6/5 - y5/60 + 794y2. Determine p(k). -25 Let o(f) = -f - 1. Let r(p) = -p2 - 14p - 12. Let t(b) = -6o(b) +	{ "pile_set_name": "DM Mathematics" }
- 202u + 73. Let j(a) = 6w(a) - 17z(a). Let f be j(11). Solve -l + f - 22 = 0 for l. -3 Suppose -24d = 77d + d + 93d. Solve -13v + 34 + 31 = d for v. 5 Let v = 29 - 35. Let d be 12/(-36) - 152/v. Let m = 25 - d. Solve 2z = -mz - 4 for z. -2 Suppose -4a + 29 = l, -20 = -122a + 119a + l. Solve -ai - 16 = -23 for i. 1 Suppose x + 0x = 4. Suppose xp = -o + 23, -5o + 31 = -3p - 38. Suppose 3a - 21 + o = 0. Solve a = g - 3 for g. 5 Suppose -2s - 4i + 120 = 0, 5s - i + 292 = 636. Solve s - 4 = -16l for l. -4 Let c = -241 + 249. Let u be (c - (-10 + 5)) + (-5)/(-5). Solve -uo + 10o = 0 for o. 0 Let n be 1/(-2 + 1)(-56 - -50). Solve -nk = 11k - 68 for k. 4 Suppose 2x + 0 = -4v + 20, 4x - 28 = -4v. Let k = -52 + 55. Let d(n) = n2 + 8n - 19. Let y be d(2). Solve -ka = -xa + y for a. 1 Suppose 2h + 0w - 11 = -5w, 5h - 12 = 3w. Suppose 56b - 61b - g + 27 = 0, -5g = -4b + 39. Solve -bt = -5t + h for t. -3 Let g = 56 + -8. Let k(r) = 2r*2 + 4r - 16. Let o be k(-7). Let l = o - g. Solve -2a - 4 = l for a. -5 Let n = -10 + 8. Let j(s) = 7s3 + s2 - 2s. Let g be j(n). Let t = g + 50. Solve tr - 3r = -5 for r. 5 Let b = 600 + -958. Let q = -358 - b. Let t be (-3)/(2 - 26/10). Solve qk + tk + 10 = 0 for k. -2 Suppose -28g + 32g = 3296. Let k = 832 - g. Solve -5 + k = -3y for y. -1 Let t be 1-149(-10 - -12)/(-2). Solve 42q + 42 = tq for q. 6 Suppose 223 - 463 = -12h. Solve 0 = -25b + h + 130 for b. 6 Let h be 6/10 + (-210)/350. Suppose h = 10v + 5 - 55. Solve -vl - 73 = -58 for l. -3 Suppose 5i - 107 = -77. Suppose 7c = -ic. Solve -2g + c = 8 for g. -4 Let z = 12 - 10. Let d be (-1)/z + (-27)/(-6). Suppose 3t - ds + 7s = 0, -t - 20 = 5s. Solve -t = 6g - g for g. -1 Let p be 6/(-18)-9 + 19. Let z be 156/858 - (-260)/p. Solve -z = -3t - 6 for t. 2 Let i(l) = -28 - l + 28 + 6l2. Let r be i(1). Let v(f) = -2f*2 + 3f + 189. Let g be v(-9). Solve n + g - r = 0 for n. 5 Let o(x) = -2x2 + 19x + 5. Let m be o(8). Suppose 286 = 2460p - 2449p. Solve -q + m = p for q. 3 Let r be 60/241/(40/32). Solve -30 + r = -7g for g. 4 Suppose 77s + 48s + 33s - 18802 = 0. Solve -sx - 62 = -657 for x. 5 Let h be 18 + (3/18)/(6/180). Let v(r) = r*3 - 21r*2 - 46r + 17. Let q be v(h). Solve -qx = -19x + 2 for x. 1 Let v be 8/1449/14. Suppose p - h = -p + 42, 0 = vh. Let g = -16 + p. Solve -8x + 3x = -g for x. 1 Let f(i) = 4i - 21 - 6 + 3i - i. Let t be f(5). Solve to - 10 = -2o for o. 2 Let p be 1/(-3)4/(16/60). Let r be ((-21)/(-7) + p)-4. Solve -5j + j = r for j. -2 Let j(t) = 13t*2 - 75t + 87. Let n be j(8). Solve 0 = 316y - ny + 21 for y. 7 Let o = -1778 - -1784. Solve -og = 3g + 9 for g. -1 Suppose 14z - 4062 = 8z. Let a = -665 + z. Solve -2n = 2n - a for n. 3 Suppose 4i - 72 = 8i. Let h = i - -31. Suppose -9j - 8 = -hj. Solve jc = -c for c. 0 Suppose -s + 12 = 2s. Let b = 1 - 1. Let r be (-4 + 4)/(-2 - -1). Solve sl + bl = r for l. 0 Let t be ((-310)/15 - (-3)/(-9)) + 0. Let g be ((-21)/t)/((-1)/(-7)). Let d = 15 - 15. Solve -2k - g - 3 = d for k. -5 Let f be ((-5)/7 - 1)(-91)/26. Let u(k) = -3k + 25. Let q be u(f). Solve 3b - q = -10 for b. -1 Let x = -6 - -9. Let t(v) = -3v2 + 24v + 60. Let p be 188/16 + 21/(-12). Let f be t(p). Solve f = -2u + xu - 2 for u. 2 Let p(t) = t*3 - 85t*2 + 4t - 338. Let w be p(85). Solve 172l = 173l - w for l. 2 Suppose 10z + 1169 = -2481. Let v = z - -381. Solve 4n + 0n = v for n. 4 Let k = 760 - 708. Solve -11y = k + 3 for y. -5 Let a = 1669 - 1380. Solve -282o = -ao + 14 for o. 2 Let a = -104 - -112. Let t be (-6)/a(153/(-27) - -3). Solve -t - 10 = 4p for p. -3 Suppose -49i + 50i = -4. Let l(v) = 2v + 43. Let k be l(i). Solve 0 = 5f - k + 10 for f. 5 Let d = -301 - -318. Let l = 188 - 186. Solve 0 = 3x - d + l for x. 5 Suppose -549i = -648i + 120186. Solve 1216d - id + 4 = 0 for d. -2 Suppose -991 = 15f - 1006. Solve -f = -24s + 25s for s. -1 Suppose t = y + 364, -3t + 175 + 899 = 3y. Solve -t = p - 362 for p. 1 Suppose 2j = -90 + 20. Let f be j + (1 - (3 - 4)). Let u = -31 - f. Solve -3 = a - u for a. -1 Let t(h) = 4h - 5. Let p be t(2). Let a be ((-26)/8)/(p - (-44)/(-16)). Let y be 2/(-3)(a - -4). Solve -3x + y = -9 for x. 5 Let z = 132 - 140. Let x(l) = l*3 + 9l*2 - 3l - 79. Let k be x(z). Solve -k = 6t + 9 for t. -3 Let i = -4316 + 4516. Solve 0 = -2a - i + 208 for a. 4 Suppose 3y + 52d - 55d + 15 = 0, -5y = d - 29. Let i = -22 - -31. Solve -yr + r = i for r. -3 Let t(b) be the third derivative of b5/20 + b4/6 + b3/3 + 3b*2. Let p be t(-2). Suppose -4d = -10 - p. Solve 4m + 0 = -d for m. -1 Let a(s) = 4s*2 + 7s + 4. Let o(f) = -5f2 - 7f - 3. Let h(c) = 4a(c) + 3o(c). Let q be h(-8). Let v = -15 + q. Solve 2w + vw - 2 = 0 for w. 1 Suppose -470 = -49r + 39r. Suppose 0 = ro - 44o - 3. Solve x = 1 + o for x. 2 Suppose 5t + 4p - 133 = 2p, -3p + 105 = 4t. Suppose 5 = -to + 28o. Suppose -od + 27 = -2d. Solve 3u + 3 + d = 0 for u. -4 Let t = 2249 - 2231. Solve -td + d = -5d for d. 0 Suppose -10m = -6798 + 1328. Let i = m + -512. Solve 5t + i = 30 for t. -1 Suppose 5r - 49 = 4x, -5r = -x + 4x - 42. Suppose -8i = -ri - 22. Let h = 23 + i. Solve d + h = 3 for d. 2 Let x(q) = -14q + 18. Let t be x(1). Suppose 3g + 5 = 14, -5z + 47 = 4g. Suppose 9 = tp - 3o - 9, -5o = p + z. Solve 0 = pr - 3 - 6 for r. 3 Let l(i) = -4i2 - 10i. Let g be l(5). Let x be ((-28)/(-21))/(2/g2). Let m = x + 59. Solve -4o - m = -7o for o. 3 Suppose 10s = -29 + 169. Suppose -3v = 3k, 3v = 3k + 4 + s. Solve -vh + 1 = -2h for h. 1 Let t = 178 - 198. Let m(b) = b*2 + 15b + 2. Let l be m(-12). Let z = t - l. Solve z = -5w - 1 for w. -3 Let p be 15 + 270/(-20) - 2786/(-4). Let x = p + -689. Solve -6m - x = -9m for m. 3 Let c be (-1150)/16 + 3/(-24). Let h = c + 185. Let v = 113 - h. Solve v = 2w + w - 3 for w. 1 Let r be 25/(-575) + 3960/92. Solve -377 = rq - 76 for q. -7 Let w be (4/(-8)6)/(57/(-21356)). Solve w = 5h + 1104 for h. 4 Suppose 5m - 36 = r, 20 = 5m - m - 3r. Let s(d) = -d*2 - 7d - 2. Let w be s(-5). Suppose i + 27 - 31 = 0. Solve ib + w = -m for b. -4 Let l(h) = h3 - 15h*2 + 12h + 40. Let g be l(14). Solve -111r + 107r = -g for r. 3 Suppose 12 = 3b + 3b. Let h be b-242/(-4). Suppose -2t - 6t = -h. Solve -v - 7 = -t for v. -4 Suppose -199v = 80v + 212v + 169v. Let k(l) = 2l2 - l - 1. Let y be k(-1). Suppose -z + y = -3. Solve -zb + 4 + 6 = v for b. 2 Let a be (-4732)/35 + (-2)/(-10). Let t = a - -138. Suppose -2h + 5x - x - 18 = 0, 3x - 16 = -h. Solve o - t = h for o. 4 Suppose -3 = q + 2t, q + 12 - 3 = -4t. Solve -8w = -qw for w. 0 Let x(k) = -11k3 - k2 + 15k + 16. Let a be x(-1). Let g(u) = -u3 + 12u*2 + 8u - 206. Let v be g(a). Suppose f - 7 = -3. Solve -5 = vh - fh for h. 5 Suppose -499a = -525a + 728. Solve 25v = av + 21 for v. -7 Let x(v) = -2v + 7. Let c be x(0). Let p be (5 - (4 + 4) - 1) + 9. Suppose -3a + 17 = 4n, 0n = 2n - 4. Solve -po = -a - c for o. 2 Suppose -4113 = 19o - 4379. Solve -op - 267 = -211 for p. -4 Let k be ((-5)/(-35) + -3)/((-4)/14). Let g(q) = 2q2 - 37q - 19. Let b be g(19). Solve -5v - k = -bv for v. -2 Let d(b) = -9b - 47. Suppose 3c + 6 = -21. Let n be d(c). Solve n = 7o + 6 for o. 4 Let d = 2051 + -2049. Solve 0b = 4b + db for b. 0 Suppose 212u - 7395 = 72u + 7445. Solve -u = 44z - 18 for z. -2 Suppose -3s - 3w = 57, 4s - 5w + 3w = -76. Let u = s + 23. Let r(i) = i*2 + i - 5. Let x be r(3). Solve u = xd - 3d for d. 1 Suppose 10g + 26 - 160 = 26. Solve -14 - 114 = gm for m. -8 Let n = 254 + -221. Let g = n - 29. Solve 8 = gf - 2f for f. 4 Let o = -2393 - -2404. Solve 2p - op = p for p. 0 Let p(j) = 84j - 2644. Let q be p(32). Solve -q = -15m + 61 for m. 7 Let j(u) = -1 + 3u*2 - u - 16 - 2u*2. Let g be j(5). Suppose 5r = -m + 2, 3m + gr + 8 = 7m. Solve k - 2 = m for k. 4 Let g be ((-2)/(-6))/(2/(-24)). Let r be (-2)/(-4) + 0 + (-26)/g. Let n be 1/4 - (-11)/4. Solve 8 = ni - r for i. 5 Let l be (-3 + (-7)/(-3))(0 - 9). Suppose -i + 0i = -20. Suppose -s = 3z + 12, -ls + i = -3s - 5	{ "pile_set_name": "DM Mathematics" }
ve g = 2m - 4z - 4, -4z - 2 = -m + 2 for m. 0 Suppose -5 + 2 = -u. Suppose -un - 44 = -5n. Let y(x) = -x3 - 5x*2 - 6x - 5. Let p be y(-4). Solve -3q = -h - 2, -pq - 2h - 2h + n = 0 for q. 2 Let a = 13 + -12. Solve 3t = 4t + 2x + 1, a = -t - 5x for t. -1 Let l = -3 - -8. Solve 4z = -16, -lf + 0f = 4z + 41 for f. -5 Let g(k) = -k*3 - 4k*2 + 5k + 1. Let u be g(-5). Let t(j) = -j*2 - 8j - 11. Let v be t(-6). Let n = v + u. Solve 0 = -3q - 3x, -q - x + 2 = nq for q. 1 Let m = 191 - 191. Solve 0 = 4f - f - 5n + 1, -5f - 3n - 13 = m for f. -2 Suppose -3p = -2u - 22, 4p - 25 - 16 = 5u. Solve 0o - 1 = x - o, -5x - 6 = -po for x. -2 Let n be (2 + 3 - 3) + 3. Let k = n + 13. Solve -5w + u + k = -0u, 2w + 6 = -4u for w. 3 Suppose 6 = -3a + d - 7, 5d = 2a + 13. Let t = 14 + a. Solve -4m + 5u - 12 = 0, -3m + 2m + t = 2u for m. 2 Let v = 9 - 4. Let w(d) be the third derivative of -d4/8 + d3/3 - 2d2. Let u be w(-4). Solve c + u = x + 5c, vc = 5x + 30 for x. -2 Let g = 24 - 5. Let z be -4((-21)/6 - -3). Suppose -p + 4p - 4w = 46, -3p + 51 = -3w. Solve 0 = -3j - 4i - g, zi = -2j - 2j - p for j. -5 Let x = 3 - -2. Let m be 1/((-20)/18 + 1). Let r = -5 - m. Solve s + 2w = -r, 0 = xs + 5w + 1 + 14 for s. -2 Suppose 0 = 2c - 0 - 8. Solve 2g + 3l - 12 = cl, -3g - 8 = 5l for g. 4 Let y(g) = -g3 + 3g*2 + 2g - 2. Let r be y(3). Let z = 23 + -11. Suppose -2a + 6 = -z. Solve -4l = ro - 20, -o + a = 4l + l for l. 1 Let l be (-3)/5 - 206/(-10). Solve b - 5b + 3h - 16 = 0, 5b + l = -h for b. -4 Suppose -3v + 8 + 22 = 0. Solve 5x - 12 = -0n + 2n, -5x = -v for n. -1 Let i(z) = -z + 4. Let l be i(1). Solve 5m - 13 = 5b - 38, -3b - lm = -9 for b. 4 Let i(c) = c*2 + 0c3 + c3 + 3c3 + c - 1. Let w be i(1). Solve 3t - 4x = w, 4t - 5x = -t + 10 for t. 3 Let f be (-6)/12 - ((-5)/2 - 0). Solve -5s + 8 + 7 = ft, t + 4s - 15 = 0 for t. -5 Let k(n) = n - 5. Let g(f) = f - 6. Let o(j) = -4g(j) + 5k(j). Let z be o(3). Let p be 65/25 + (-2)/(-5). Solve 23 = 5s - 2t, 0 = -2s + pt + 5 + z for s. 5 Let p be (-17)/(-1) - (-24)/8. Solve -4h + 4v = -p, -v - 10 = -2h - 0h for h. 5 Let v(r) = r3 - r2 - 2r + 2. Let d be v(2). Solve -h - 4 = -ds - 15, h + 9 = -2s for h. 1 Let s(k) = -3k + 6. Let z(i) = -16i + 31. Let w(c) = 11s(c) - 2z(c). Let f be w(4). Solve fg + 4g = d - 7, 5g - 2d = -5 for g. -3 Let z = 6 + -6. Suppose zg + g - 33 = 0. Solve -5 = k - 3m, -m + g = -5k + 8 for k. -5 Let h be 43/(-3) - -6. Solve -2a + 5w = -33, hw = -a + 3a - 18 for a. 4 Let r be ((-2)/(-4))/((-4)/(-32)). Solve -rl + 24 = -i, 2l + 5i = 2i - 2 for l. 5 Let o = -204 - -209. Solve 2t = 2a, 2a = a - 4t - o for a. -1 Let d be (8/(-6))/((-1)/3). Suppose -4r = 4u + 8, 2u + 0u - dr = 20. Let p = -6 - -10. Solve 4h = -12, 3v - uh = -ph + 6 for v. 4 Suppose -y = -6y + 25. Suppose 3d = -d. Let o be (d - 3/(-6))28. Solve 5l = 5g + 20, yl - 14 = -3g + o for l. 5 Suppose -13 = -0w - w. Solve 0 = i + 4, 5t = -4i + w - 4 for t. 5 Let c be (-1 + 31)/(40/240). Let i(n) = 4n*3 - 2n*2 + n. Let z be i(1). Let h be 2 + 0(-2 + z). Solve -q - hr - 8 = 3, 4r = -c for q. -5 Let k = -34 - -9. Let s = 26 + k. Solve 0 = -5n - 3z - s, n + 2z - 4 = -0n for n. -2 Let v be 11/3 - 2/(-6). Suppose 9 = 5x - 16. Solve -xi - 4l = v + 7, -4l + 4 = 0 for i. -3 Let y = 9 - 6. Let a = 3 + y. Let p be a/8 - 54/(-24). Solve 4 + p = -3n - 4h, -h = -3n - 17 for n. -5 Suppose -2u + 5g - g = 4, 3g = -5u - 10. Let f = u + 11. Let w(r) = r2 + 1. Let z be w(-1). Solve 2y = zi + 10, 2y = -0y + i + f for y. 4 Suppose 3r - 7r = 0. Suppose -11k + 14k - 6 = r. Solve -2b + 0 = -5d - 1, b - 5 = -kd for d. 1 Let b = -54 - -56. Solve -2t - bk = -3k - 1, -3k = -3 for t. 1 Suppose 2b - 4c - 20 = -4, 15 = -5c. Solve -15 = -bp - 3p - 5y, -6 = -2p + y for p. 3 Let y = -11 - -31. Suppose 0 = -2b + 4i + y, i + 10 = 3b - i. Solve b = -5a - 5t + 5, 1 = 5a + 2t - 10 for a. 3 Let b(y) = 4y + 9. Let m(z) = -1 + z - 1 + 4. Let i(h) = -2b(h) + 9m(h). Let n be i(0). Solve -w = -nw + 5s - 24, 4s = 20 for w. -1 Suppose b = 4b. Let d be (1 + 0)(b + 20). Suppose m - 7 = 3o + 12, 4m = o + 54. Solve 0 = -4g - d, 5y + m = -g - 7 for y. -3 Let s = 60 - 58. Solve 2x = sd + 3d - 6, -5d - 3x + 16 = 0 for d. 2 Let r(q) be the first derivative of -q3/3 + 9q*2/2 - 5q + 6. Let a be r(8). Solve ap + 4i + 3 = 0, 2p = -0i + 5i + 21 for p. 3 Let i be (-4)/(-2)(-39)/(-26). Solve -6 = 4c + 2, ic = -5f - 6 for f. 0 Let c be 1/6 - 87/18-1. Solve 4o = -3r + 3o + 15, 2r - 10 = co for r. 5 Let w(y) = y3 - 9y*2 - 10y + 2. Let b be w(10). Solve 0 = -5h - 7l + bl, -5h + 3l - 32 = 0 for h. -4 Suppose 7 = 3s + 1. Solve sb + z = 0, 0 = 3b + b - 2z for b. 0 Let h = -4 - -9. Let p = h - 5. Solve -v + 5 = -4c, -2v = 3c - pv + 1 for c. -1 Suppose m + 12 = 5j, -3m - 1 = 2j - 16. Solve 5d + 12 = -2i + 1, ji = -2d for i. 2 Let l(w) = 4w - 3w + 2w. Let g be l(1). Let v be ((-4)/g)/((-1)/3). Solve vp - 4 = 3j - 1, -3j = -3p + 6 for j. -5 Let s(c) = -c3 + 6c*2 - 9c + 4. Let u be s(2). Solve 4 = -w + ug, -3w + 4g - 2 = 2w for w. 2 Let v(a) = -3a2 + 4a + 0a + 2a*2 + 5 + 6a. Let u be v(10). Solve y - m = 4, -y + m = -uy - 4 for y. 0 Suppose -6p - 3w = -4p - 18, 5p - 4w = 91. Solve 15 = 3s, -z = z - 5s + p for z. 5 Let s be (-3)/(-9) + 20/(-6). Let q(u) = -2u3 - 5u*2 - 3u - 3. Let d be q(s). Let x be (50/d)/((-2)/(-3)). Solve 3z + 0y = 4y - 2, xz = 4y + 2 for z. 2 Suppose -5m = 3y - 25, 25 = y + 4y. Suppose -mj - 1 = -5. Solve -2u + 9 = 2k - 3u, -jk - 1 = u for k. 2 Suppose 0 = 4d + n + 25, -2n + 0n = -5d - 15. Let k = d - -7. Suppose 40 = 2h + 2i, -2h + 0 + 5 = -5i. Solve -kb = -y - h, -b = 4b + 4y - 5 for b. 5 Let k = 10 + -7. Suppose -s - 2q + 3q = 2, -5q = ks - 18. Solve 0 = -3n + 5b - 4 - s, -3n = 4b - 31 for n. 5 Suppose g + 3p = -4g + 48, 0 = 4p - 4. Suppose -11 - g = -5c. Solve -30 = -2f - co, -2o = -f + 3o - 20 for f. 5 Let y(o) = -4 + o*2 + 5o + 4. Let f be y(-6). Suppose -u + 2u - f = 0. Solve 5c = -v + 28, -3v = -uv + 2c - 1 for v. 3 Let s be -1 + -3 + -3 + 9. Solve -g - 5z = -8, -sg - 5z + 7 = -4 for g. 3 Let b = -33 + 18. Let g = -13 - b. Solve j = -gj - 6, 2s = 3j + 4 for s. -1 Suppose -p = h - 19, p + 61 = 3h + 6p. Solve -5k - q - 7 = 13, k - h = 4q for k. -3 Let g be (-14)/(-6) - 10/(-15). Suppose 0 = gi - 12 - 3. Solve 0 = 5v + 4m - 17, -4v + 0 = im - 10 for v. 5 Let q(z) = z + 11. Let d be q(-5). Let j be (-4)/d(-36)/8. Suppose 4 = x + x. Solve 0 = -jg - h + 1, xg - 4g - 1 = h for g. 2 Let w(q) = q*3 - 2q*2 - 3q. Suppose 3s - 4s = -3. Let u be w(s). Solve 2o - 3r = 4o, 4o - 4r = u for o. 0 Suppose 2p - 10p = -40. Solve 3t + pd - 6d - 4 = 0, 4t = 5d + 9 for t. 1 Let n = -1 + 1. Solve n = -5q + o - 10, 3o + 0 = -q - 2 for q. -2 Suppose -12 = -5i + i. Suppose -3r + 2o = -19, -3o + 4 = 3r - r. Let y = r - i. Solve 5b - 5s + 15 = 0, 0 = -5b + yb - 3s + 21 for b. 2 Suppose o = 6o + 15. Let z = o - -40. Solve -4q - 7 = -3k, 4k + 15 = -q + z for q. 2 Let f(u) = u*3 - 4u*2 - 2u + 1. Let c be f(6). Suppose -4b + 155 = -c. Solve -4z - 23 = -i, 5z - 20 = 3i - b for z. -5 Let i(p) = 36 - 2p2 + 33 - 16p + p*2 - 64. Let f be i(-16). Solve 3j - 9 = 0, 0l = -4l + fj - 23 for l. -2 Let d(p) = 2p*2 + 2p - 2. Let t be d(-2). Let x be 15/(-3) + t - -3. Solve -4c - 5l + x = 2, -4c - 3l = -2 for c. 2 Let u = -20 - -25. Solve 9 = -5s - ub + b, 2s + b + 6 = 0 for s. -5 Let j be ((-45)/(-30))/((-6)/(-20)). Let d = -13 - -13. Solve 2i = -0i - 5l + 2, -4i + jl - 26 = d for i. -4 Suppose 0 = d - 3y - 14, -4d + 70 = 2y. Solve t - d = -4j, -t - 2t + 16 = 5j for t. -3 Let q = -28 - -22. Let n(b) = b*2 + 6b + 10. Let f be n(q). Solve -4s - f = 2k, 2s + 13 = 5 for k. 3 Suppose 2x + 8 = 0, -w + 0x + 12 = -2x. Solve 0 = b - w + 2, 0 = -5i - 5b + 5 for i. -1 Suppose 0 = 11b - 9b - 8. Solve 0y - 3y = n - b, 4 = n - 2*y for n. 4 Let f = 31 - 34. Let i(c) be the second deri	{ "pile_set_name": "DM Mathematics" }
2. Let q be o(3). Solve a = -0v + qv for v. 4 Suppose 4u = -2z + u + 3, -3z = 5u - 5. Solve z = 5y + 18 - 3 for y. -3 Suppose 0 = 3x - 3p - 3, -2p + 3 - 2 = -x. Let h(l) = l + 3. Let v be h(-7). Let i be 3-1v/3. Solve -i = u + xu for u. -1 Let x = 53 + -2. Suppose -3b + l = -x, 5l + 3 = -3b + 36. Solve -2s - b = 2s for s. -4 Let c(t) = t3 + t2 - t + 4. Suppose -4w + 0w = 0. Let q be c(w). Suppose 0 = -a - qa. Solve 3h + 12 - 27 = a for h. 5 Let s = -15 + 14. Let h = 1 - s. Solve z = 1 - h for z. -1 Let v(j) = -j*3 + 3j*2 + 3j - 4. Let p be v(3). Suppose -1 = z - 2. Let q = p - z. Solve -qc - 8 = 12 for c. -5 Let z = -1 + 6. Suppose 0 = 5p - z, -2r - 4p + 3 = -51. Suppose 2l - r = l. Solve -w + l = 4w for w. 5 Let v(c) = 4c - 3. Let f be (-42)/(-8) - 1/4. Let s be v(f). Solve 2k - s = -7 for k. 5 Let w(i) = -i*3 + 3i*2 + 5i - 1. Let s be w(4). Let b be (-68)/(-8) - 3/2. Solve sj + 1 - b = 0 for j. 2 Let d = 108 + -108. Solve du - 2u - 8 = 0 for u. -4 Suppose -3 = 2m - 21. Let y = m + -4. Suppose 3k - 19 = -2l, k - 1 = yl - 3l. Solve 1 - l = j for j. -1 Let f(q) = q + 10. Let g be f(-6). Let b = g + 10. Suppose -2k + 2 = -4m - 2, -k - 5m = -16. Solve -5r - k = b for r. -4 Let i(r) = -r*3 - 5r*2 - 6r - 6. Let b(o) = o*3 - 3o*2 - 4. Let q be b(3). Let a be i(q). Solve 5x = 27 - a for x. 5 Suppose -21a + 18 + 24 = 0. Solve -ar = -0r + 10 for r. -5 Let d = 8 + -5. Solve -3 - 9 = do for o. -4 Suppose -11 = -5v - 3p, 26 = 7v - 2v - 2p. Solve -j = -vj - 15 for j. -5 Suppose -12 = -4k - 4. Let s be (-1)/(k + -1)-3. Suppose 4g - 62 = -2p, 28p - 26p = 6. Solve g = so - 1 for o. 5 Suppose -2m - 144 = -11m. Solve 4i = -0i - m for i. -4 Suppose -5f + 7 + 18 = 0. Suppose 0w + 6 = 3o + 3w, o - 22 = 4w. Let x be (10/15)/(2/o). Solve -5 - f = xu for u. -5 Suppose 0p = -3p + 9. Suppose x + px = 4. Suppose -2f = -f - 3j - 18, 0 = j + 5. Solve -fb = 4 - x for b. -1 Let g(h) = -4h - 90. Let x be g(-23). Solve -2q - 4 + x = 0 for q. -1 Let x(g) = 5g - 32. Let a be x(7). Solve az - 12 = 6z for z. -4 Suppose 3q + 3 + 9 = 0, -12 = 4n + 5q. Let u = n + 0. Let r(g) = g3 + g2 + 2g - 1. Let v be r(2). Solve -3s + v = us for s. 3 Suppose -4z = l - 0l - 12, 0 = -3l + 4z - 12. Solve l = -v - 3 for v. -3 Let g be -1 - (-4)/((-12)/27). Let z = g + 16. Solve -z = 2l - 0 for l. -3 Let c be (-30)/66/(-5). Solve 3k + c = k for k. -3 Let y be (1/(-7)8)/((-146)/511). Solve 0 = 2t - 0 + y for t. -2 Suppose 2i - 8i = -0i. Solve 2y + 12 - 2 = i for y. -5 Let d(u) = -u2 - 5u. Let k be d(-5). Let i(r) = k + 2 - 5 + 2r - 2. Let h be i(4). Solve -b = -hb for b. 0 Let z = 30 - 29. Solve -4s + 7 + z = 0 for s. 2 Let q(g) = g. Let u be q(-6). Let m(a) = a3 + 7a*2 + 6a. Let h be m(u). Solve 12 = -hl + 4l for l. 3 Let w = -84 - -54. Let z = -15 - w. Solve -u + 6u = z for u. 3 Let o be ((-8)/24)/((-1)/24). Suppose -3m - 5 = -om. Solve 7 = -4r - m for r. -2 Suppose -1 = -4c + 19. Suppose -5s + 3z + 48 + 33 = 0, -2s - cz = -20. Suppose 3y - 6 - 3 = 0. Solve 0b + s = yb for b. 5 Let z(d) = d*2 - 2d - 4. Let m be z(-2). Let s = 1 - 1. Let r = s + m. Solve rl + 13 = 33 for l. 5 Let k = 6 - 0. Let g be (-2)/k - (-125)/15. Solve -y - g = y for y. -4 Let v be 5/2 - 2/4. Suppose -vp = 2p + 112. Let u = -14 - p. Solve 2s - 6 = -u for s. -4 Suppose u - 5 = 4. Let d(g) = g*2 - 8g + 3. Let p be d(u). Suppose t - 4 + 16 = 3k, 3t + p = 3k. Solve t = -5a + 5 for a. 1 Let z(l) = l*2 - 5l - 2. Let n be z(6). Solve -ny = -5 + 1 for y. 1 Let q be (-18)/(-99) + (-18)/(-22). Suppose 3y - 3i - 16 = -1, 5i + 25 = -y. Let d be y/((2 + 0)/q). Solve d = 3c - 7c for c. 0 Suppose 5r + 3 = 4n - 129, -4n = -3r - 84. Let s be 5/2r/(-15). Solve m + 3 = sm for m. 1 Let q(r) = r + 7. Let j = -15 + 12. Let v be q(j). Solve -u - u - v = 0 for u. -2 Let d(o) = o*2 - 2o + 2. Let p be d(2). Suppose 2l - 8 = -0l. Suppose ln - 16 = 3f + pf, 3f + 20 = 5n. Solve f = 2h - 7h + 10 for h. 2 Let c = 6 + 1. Solve 2 = 3j - c for j. 3 Suppose 2 = 5t - 3v - 10, 2t + 4 = -v. Suppose -d = -p - 5, p - 2 + 19 = 4d. Solve t = h - 0 - d for h. 4 Suppose -r - 9 = 3p, -3p + 6 - 3 = 3r. Suppose t + r - 16 = 0. Solve 3f - f + t = 0 for f. -5 Let c be 41/3 + (-4)/6. Suppose 5d - c = 7. Suppose 3 = dj - 3j, -3j = 3i - 18. Solve 0x - 15 = ix for x. -5 Let d = 69 - 66. Solve -dw + w = -4 for w. 2 Suppose 1 - 13 = -4j. Solve ji + 3 + 9 = 0 for i. -4 Suppose 3d + 2 = 4v + 28, d + 18 = -4v. Let y(l) = l2 + 3l - 6. Let n be 42/(-9) - (-2)/(-6). Let m be y(n). Solve -d = j - m for j. 2 Let q be (-6)/9(-9)/2. Suppose -4 = t + 4d, -qd = -2t - 2d + 10. Suppose z - 12 = -g, -tz = -5g - 2z + 60. Solve f + 2f = g for f. 4 Let s be ((-30)/(2 + -5))/2. Suppose 5g - 4g = s. Solve 3 = m + g for m. -2 Let o(v) be the third derivative of v4/24 - 5v*3/6 - 2v*2. Let m be o(7). Solve -mt = t - 6 for t. 2 Suppose 7 + 2 = -3u, -5c + 35 = -5u. Solve 14 = cr - 2 for r. 4 Suppose 3i - 5a + 3a - 10 = 0, 0 = -i + 3a + 15. Solve ib = 5b for b. 0 Let k be (-234)/(-24) + 3/(-4). Let i = k - 15. Let v be 2/i - 6/(-18). Solve vt - t = -1 for t. 1 Let g(p) = -10p*3. Let x be g(-1). Solve -3i + 2 = -x for i. 4 Let v = 58 - 38. Solve v = u + 4u for u. 4 Let h = -9 + 4. Let o be 8/(-4)h/2. Solve 0 = -oj - 0j for j. 0 Suppose -8z + 62 + 138 = 0. Solve 3n + z = -2n for n. -5 Let d(o) = -o3 - 3o*2 - 2o - 2. Let f be (-1)/((-2)/(0 + -6)). Let m be d(f). Let u(j) = j*2 + 1. Let t be u(-1). Solve mi = 3i - t for i. -2 Let f = 3 - 3. Suppose 0 = k + 3 - f. Let x = k + 5. Solve c = xc - 1 for c. 1 Let l(r) be the first derivative of 7/2r2 + 1/3r*3 + 5r + 2. Let n be l(-7). Solve 8 = u - nu for u. -2 Let t = -89 - -99. Solve -5f + t = -5 for f. 3 Let g = 124 + -124. Solve -v = -1 - g for v. 1 Let p be 26/(-39) + 17(-4)/(-12). Suppose 3h - 6 = -f, 9h + 3f - 6 = 4h. Suppose 0 = -d - hd. Solve pb + 0b = d for b. 0 Let f(q) = q*2 - 23q + 8. Let n be f(23). Solve 5j = nj + 9 for j. -3 Suppose 4k + 4w = 36, -4k + 4 = -6w + 2w. Suppose kc + 0c - 11 = a, -c + 3a = 9. Solve -1 = -l + c for l. 4 Let t(y) = 5y2 - 10y. Let k(b) = -4b2 + 9b + 1. Let s(m) = 4k(m) + 3t(m). Let l be s(5). Let o be 34/6 + (-6)/l. Solve -3d = -2d + o for d. -5 Let k = -10 + 17. Let v = k + -3. Let d be (1/3)/(1/15). Solve vs - 17 = -d for s. 3 Let l(t) = 6 - t - 6 - 8. Let s be l(-8). Solve 5k - k - 8 = s for k. 2 Let c be 114/8 + 3/(-12). Let n = c + -21. Let l = n + 8. Solve -r - 5 = -l for r. -4 Suppose 4a = -0a - 4. Let l = 6 + a. Suppose lg - 10 = 0, -11 = -2x - 4g - 3. Solve x = -2u - u for u. 0 Let b(t) = -t*2 + 4t + 1. Let q be b(2). Solve -u + q = -6u for u. -1 Let h(a) = a3 + a2 - a - 1. Let b(y) = 5y*3 - 4y*2 + 4y - 20. Let q(v) = -b(v) + 6h(v). Let p be q(-11). Solve pr = -r for r. 0 Let m = 33 + -13. Solve -m + 0 = 5d for d. -4 Suppose 2h = 11h - 63. Solve -9g = -hg + 8 for g. -4 Suppose 15 = 6z - z. Suppose 2j + 12 = 4g, -1 = -5g - j - 0j. Suppose g = o - 3. Solve -z = -3c + oc for c. -3 Let i(x) = x*2 - 8x + 3. Let f be i(8). Suppose 4p + fn - 16 = 0, -p + 3p = 3n + 26. Solve 0 = pb - 2b + 15 for b. -3 Suppose -5v = -v. Suppose vt + 3t = 0. Let g be (-1 - -2)t/2. Solve 0p + 2p - 4 = g for p. 2 Let u be (2/4)/(4/80). Let a = u - 7. Let h be -6(2-3)/a. Solve 5d + h = d for d. -3 Let j(t) = 9t - 5. Let f(s) = -8s + 4. Let c(h) = -3f(h) - 2j(h). Let z be c(3). Suppose -z = -p - p. Solve p = 5w - 7 for w. 3 Suppose -9r + 15 = -30. Solve 14z = 13z - r for z. -5 Let y(x) be the first derivative of x2/2 + 6x - 5. Suppose 4q - 2w + 20 = 2w, 0 = 4q + 3w + 13. Let n be y(q). Solve n = t - 1 for t. 3 Suppose 0 = 4t - 2o - 34, t - 7 = -o - 3. Let y = t - -1. Solve -3k = -5k - y for k. -4 Suppose 0 = -2d - 2 + 42. Suppose o + d = k - 4o, -4k - o = -17. Solve k = 3n - 7 for n. 4 Suppose -62 = -10g - 2. Solve q + g = 3q for q. 3 Let y(g) = g2 - g + 16. Let s be y(0). Suppose -4u + c + 4 = -0, 5u - c - 6 = 0. Solve -s = -uv + 6v for v. -4 Suppose 4l - 68 = -4*n,	{ "pile_set_name": "DM Mathematics" }
7 Calculate 3/78 - (-134128)/(-5252). -51/2 Evaluate (664/(-140) + 5)/((900/168)/5). 6/25 Evaluate 2180/(-9592)12(-1)/(-10). -3/11 868/38 - (-78 + 31059/399) 23 What is 31360/11662 - 5/((-175)/(-90))? 2/17 Calculate (-3880)/130 - 3 - (60/585)/((-4)/(-6)). -33 Calculate -7 - (8090/(-2427) - (20/(-6))/(-1)). -1/3 What is the value of (-76)/(-6) - 345(-87)/(-2001)? -7/3 What is the value of (35620/(-959))/(10/(-7))? 26 ((-786)/2358)/((-156)/9 - -3) 1/43 Evaluate (-2)/75 + (-372519)/382725. -1 Calculate (-203)/2668(-272)/(-1190). -2/115 Calculate -10((-13 - 60/(-4)) + (-15)/7). 10/7 (2/4)/(3/22) - 228938/60780 -1/10 (35 - 33 - 336/172) + 8780/(-172) -51 (-80)/3240 + 14/567 0 What is the value of 0/2 - (-17)/((-510)/(-270))? 9 What is (890/356)/(14/70)? 25/2 (-82)/(-14) + -3 - (3110 + -3109) 13/7 What is the value of (-2064)/(-6)108/(-2808) + (-1 - -14)? -3/13 What is the value of 1(-56 - -61)11/935? 1/17 Evaluate 3996/(-7326) - 226/(-11). 20 Evaluate (-126)/6 + -6 - (15 - (-2 + 4)). -40 What is the value of 1 + 1 - (-60 - -69)/((-18)/(-4))? 0 Calculate 630/168 - (-285)/(-76) - (-1 + -73)-1. -74 192/3584-2850/(-9) 25/3 Evaluate 31423/(-8978) - (11/(-2) + 0). 2 What is 2242/1155-19 - -11? -21/5 What is the value of 19/114(9/30)/(135/(-75))? -1/36 What is (3 - (-447)/21)(-9660)/(-2760)? 85 Evaluate 1135/35 + (22/(-33))/(28/18). 32 What is the value of 594/15840380 + (-2 - (-36)/(-3))? 1/4 Evaluate 2691/(-460) + (-1 - (25 - 32)). 3/20 Evaluate (-1)/((-16)/(-40))9/315(-2)/(-6). -1/42 ((-36)/228)/(34 - 33) -3/19 Evaluate (-1446)/24 - (-156)/(-416)(-136)/12. -56 29/(-348) - 2075/9003 -7 Calculate (1488/(-6975))/(100/125). -4/15 Calculate 1(-40 + -3(4 - 3)/1). -43 -25 - (45024/21)/67 -57 Evaluate 1083/(-228)(-1965)/4978. 15/8 What is the value of (10 - -44) + -123 - -56? -13 Evaluate (-41184)/6006(-1 + -3)/(-12). -16/7 What is the value of ((-2673)/126)/(-33) + (-12)/8? -6/7 Calculate -22 + (-309 + 6)/(1323/(-98)). 4/9 Evaluate 1848/30029940/10978. 84/5 Evaluate (90/(-21) + (-37)/(-2331)54)/(45/(-14)). 16/15 ((-2720)/(-408))/(-3 + (-1256)/(-432)) -72 What is 26896/287 - 30 - (-6)/21? 64 What is the value of 7836/(-1188)66/72? -13/6 Evaluate 8/(8/(-14)(-230)/(-460)). -28 What is the value of -1 - (-46 - -15 - -8)? 22 What is the value of -41((-336)/6216 - 39/(-37))? -41 What is (((-28)/(-12) - 3) + (-7 - (-1160)/120))19? 38 What is the value of (-1 - -3)/(-8)2(-73 + 14325/225)? 14/3 What is the value of 5/4 + -1 + (-5)/(-12) - (-1578039)/82692? 79/4 What is the value of -50 + 40 + 4 - (1444/(-234) + (-6)/(-39))? 2/117 Evaluate 7 + (4 - -18) - (113 + -89). 5 Calculate 304/(-57)6((-20)/(-16) - 0). -40 (-9 - 10050/(-1110)) + 2464/(-407) -6 Calculate 2920/(-85) + 5 + 2108/612. -29 (-652 + 655)/(1/46-3) -46 90/(-27) + ((-4)/(-306))/(17/3876) -6/17 Evaluate (-15)/18567/(-315) + 373/2. 57 What is the value of 5 - (-2)/((-1540)/(-1070)) - ((-168)/(-154))/(-6)? 46/7 54000/(-600) + 24 + 6 -60 Calculate 256/67221 - 71. -63 Calculate (-2)/(((-738)/3444)/((-3)/(-1))). 28 What is ((-1191600)/2592)/331(-63)/(-15)? -35/6 (-4 - (-104 - 48/(-8)))/((-2)/(-1)) 47 What is the value of (-7)/154-2 + (53600/(-176))/50? -6 Evaluate 1581/348 - 1254/264. -6/29 Evaluate (((-59)/(-5) + 780/(-65))/((-3)/(-15)))/(-20). 1/20 ((5/2040)/(-1))/(2 - 6/2) 10 (-3)/(-4)-1 - (-25929)/(-804) -33 Evaluate 162/(-3) - (-30576)/728. -12 Calculate 466/(-12) + (-11)/(-6) + -34 + 32. -39 Evaluate 1088/(-30) - (-141 + (-240654)/(-1710)). -36 What is the value of ((-280)/4200)/((-4)/(-24))? -2/5 What is the value of ((-10)/(-3))/((3/(-4))/(8046/98936) - -9)? -15 What is the value of 49/133 - ((-432)/48)/(-9)? -12/19 26 - (1748/(-6555) + 1958/30) -39 What is the value of -56 + (-78)/22815-16385? 2/117 What is ((-36)/(-10))/((-200574)/3175755)? -57 Evaluate -3 + -45 + (22 + 32 - 78). -72 Calculate (1 + 1)11 - (217 - 18 - 212). 35 Evaluate (152 - (149 - 131))2/(-4). -67 What is ((-768)/(-60) + -113)/(54/30)? -1/9 Calculate (19050/18288)/(25/(-20)). -5/6 Evaluate (-7 - 7) + (-5 - (34 + -25)). -28 (-28)/(-6)((-6)/28)/(3/(-36)1) 12 What is the value of (-13)/(12675/(-23426)) - (15 - -9)? 2/75 340676/(-69828) - (10/22 + -1) -13/3 What is the value of (39/(-211770)342010 - -63)(-6)/(-8)? 2/181 Evaluate 2/(-14)-69 - (-1572)/(-1834). 9 What is (2/12)/(133/100548-54)? -7/3 Evaluate 16 - (-14 - -40) - ((-24933)/2355 - (-30)/50). -2/157 What is (3436/(-23193))/(-3 + (-25)/(-9))? 2/3 Calculate 657/180 + (-504)/224. 7/5 What is the value of 490/(-38) - (113 - 98) - 6/57? -28 Evaluate (-479)/(905310/1620) + 44/351. 2/5 Calculate ((-104400)/46409/5)/(1/2). -81 Evaluate ((-352)/(-77))/4 - (22 + (-1014)/(-42)). -45 (2 - -37)/(142142/43736) 12 Calculate (324/81)/(-4 + 0 + 81/21). -28 (-1)/((-9)/(-2)42/1323525) -1/75 Calculate (3(-6)/3105)/(1((-270)/(-25) + -11)). 2/69 Evaluate 3349/(-591)(-6)/(-2)-1. 17 What is (1562 + 53)3/57? 85 What is (8/(-36)-36)/(24/(-24))? -24 Calculate 5568/13920 - (2 + 496/(-10)). 48 Evaluate (-11 - (105/(-6) + 6))/(17/(-6)). -3/17 Calculate ((-637)/182)/(1139/1258 + -11). 37 ((-1)/15)/((-1260)/(-26460)) -7/5 Evaluate (-12714)/(-978) + ((-2)/(-3) - (-717)/(-63)). 16/7 What is the value of 16/(-32)-3(-2)/(-30)(-945)/(-54)? 7/4 Evaluate (1 - 26) + 35 - -22. 32 (177/(-1062))/(10/9) -3/20 What is the value of 13/((-19266)/(-7695)) + (-7 - -2)? 5/26 Evaluate (-8 - (-6 + -12))84/(-70). -12 Evaluate (-24 - (23 + 60305/(-1260))) + 6/(-8). 1/9 What is (-417)/(-12) + (-56050)/2360? 11 Calculate 74/3(-16)/(-56)27/(-2). -36 3 + -21 + (-11154)/(-242) + -28 1/11 What is (-116 - 103)(-1)/3? 73 Evaluate 38/(-5) - 96/((-14400)/(-210)). -9 Evaluate ((10/4)/(10225/818))/((-12)/(-50)). 5/6 Calculate 81 - (-263268)/(-2772) - 28/(-2). 2/77 What is 6/(-5) - (14/(7560/76662) + (-715)/330)? -141 What is the value of (2/22)/((-2572)/(-537548))? 19 What is (-6)/(-243)1284/856? 1/27 Evaluate ((-122)/(-183))/(4 + 99/(-24)). -16/3 Calculate (-14084928)/15724814/(-11). 114 What is the value of ((-57)/((-340)/(-16) + -16) + 8)/(6/(-63))? 30 What is the value of (10 - 11)/(535/51895)? -97 What is the value of (((-18 - -35) + -14)/(81/369))/(1/3)? 41 What is (17/((-2601)/(-1632)))/((-2)/(-6))? 32 What is 1343/(-68) - (-111 + 91)? 1/4 What is the value of 37/20202-1335/304/7? -1/63 What is the value of (41 - 1862/57)(-3)/30? -5/6 What is the value of (155/((-36425)/(-94)))/(42/(-285))? -19/7 Calculate (-52)/(-8) - 4 - 11277/358. -29 What is the value of 3418/2232 - (-28)/(-18)? -1/3 (1 - 57/9)/(71/((-17253)/3384) - -14) -72 What is ((-663)/(-30940))/(66/154)? 1/20 Evaluate (62573/12770)/((-7)/(-8)). 28/5 Evaluate 2 - (8 - 981/108)/(((-60)/55)/2). 1/72 (-99)/(-4)(-4)/6-6 99 Evaluate -1 + (-68)/(-76) - ((-18000)/190)/(-12). -8 What is 621/(-14 - -83) - (-19)/(-6)? 35/6 Evaluate 100 - 114 - 108423/(-8337) - (-1 - 0). 2/397 What is the value of (2173 - 2168) + (-1 - (-14)/(-11)) + 0? 30/11 What is the value of 4 - (-1413)/(-72) - -15 - (-8420)/160? 52 Evaluate 79/((-20)/(-16) - ((-793)/(-61) + (-172)/16)). -79 Evaluate (-28294)/(-230) + (-1246)/71645. 123 (-98)/((-43512)/2146) + (-1)/(-6) 5 What is 4 + 1/1 - (809325/(-218))/(-297)? -15/2 54/42 + (-17716)/14899511 -1/45 Evaluate -31 + 1089/(-33) + 52 + -54. -66 Evaluate ((-442)/(-39) + -5 - (22 + 1)) + 13. -11/3 5 - (-1038)/(-272)(-2352)/(-1764) -3/34 Evaluate -20 + -64 + 986/(55 - 21). -55 What is the value of 2/((-217)/21 + -11 - -22) + 53-1? -50 What is the value of 6/(-32) + (122 - 36725/400)? 30 Evaluate -47560/(-570) + -5. 45 What is the value of (-392)/(-13) - (0 - 10/(-190) - (-650)/6422)? 30 What is (((-492)/60)/(-41))/(-7)? -1/35 20/30(-1485)/90 - -22 11 What is (-40)/18 + (72/27 - (-70)/(-42))? -11/9 Calculate (-11550)/(-450)63/(-77). -21 What is the value of (-988)/1520 + 4/16? -2/5 15 + (0 - 176/(-5))/(-144 + 159562/1105) 103 (-190 + 134)/(-12 - (-223)/18) -144 What is 2000/(-2000)219? -38 Evaluate -66 - (-2976)/(121 + -28). -34 Calculate ((-3)/222)/((-9306)/(-376) + (1 - 25)). -2/111 Evaluate 209/950(-6 - 48/(-36))(-12)/154. 2/25 -27 - 25428/(-910) - ((1 - 3) + 3) -2/35 What is (-8)/(-44)22337/(-6382)? -7/11 What is 6/(-11)*(18 - (-3666)/(-156))? 3 What is (41/((-1066)/(-52)))/	{ "pile_set_name": "DM Mathematics" }
)34))*2. 8/81 Simplify ((sqrt(6655)-2)/(1sqrt(180)) + (sqrt(2816) + sqrt(2816) + -1)-25)2. -19420sqrt(11)/3 + 10372151/9 Simplify 0 + ((sqrt(204)/sqrt(48))*2 - (sqrt(17) + (-1sqrt(204))/sqrt(12))*2) + (5-1sqrt(187) - sqrt(187))/(sqrt(132)/(sqrt(36)/sqrt(3))). -6sqrt(17) + 17/4 Simplify (((1(sqrt(11) - (sqrt(11) + -1)) + sqrt(33)/sqrt(27) - (sqrt(110)3)/sqrt(10)3) + 1)5)*2. -2600sqrt(11)/3 + 186800/9 Simplify 3 + sqrt(45) + (1sqrt(5) + -2)2 + (sqrt(3840)1 + sqrt(3840))/(sqrt(108)2). 5sqrt(5)/3 + 12 Simplify (((-1sqrt(119) - sqrt(119)) + sqrt(119))-3-12)/(5-2-1sqrt(252)). -sqrt(17)/10 Simplify -2 + 43((4 + sqrt(432) + -1)-3-5 + -4 + 0)2. 177120sqrt(3) + 1186570 Simplify 6-5(((sqrt(1872) + 4 + sqrt(1872) + -1 - sqrt(1872)) + 0)*2 + -5(sqrt(1872) - 1(sqrt(1872) - (sqrt(1872) + -2))2)). -57030 - 360sqrt(13) Simplify -3(sqrt(171) + (-2sqrt(171)-3 - sqrt(171)) + (-1sqrt(171) - sqrt(171))4)/((sqrt(81) + -6sqrt(81)3)/sqrt(9)). -6sqrt(19)/17 Simplify ((2 + 1 + -3(1 + sqrt(1377) + 1) + 0)45)2. 64800sqrt(17) + 4960800 Simplify (-4(sqrt(63)/(-1sqrt(144) + sqrt(9)))2 + ((sqrt(7) - (-4 + sqrt(252)))2 - (sqrt(7) - (1 + sqrt(567)))))-3. -1700/3 + 96sqrt(7) Simplify 4 + -1sqrt(931) + 4 + 2 + -4 + (0 + sqrt(931) - sqrt(931)) + (sqrt(931) + 1 + sqrt(931)-1)*2. -7sqrt(19) + 7 Simplify -2 + ((-5(sqrt(1584) + sqrt(1584) + -2) + sqrt(1584)3 + -3)-5)2. -29400sqrt(11) + 1941623 Simplify (4sqrt(45)/(sqrt(243)-2))/((-2sqrt(18)6)/(sqrt(12)/sqrt(2)-4 + sqrt(6))). -sqrt(5)/18 Simplify (-5 + 1 + 3(sqrt(19) + sqrt(2299) + -1) + 1 + -6(0 + sqrt(475)) + 0)2. -72sqrt(19) + 720 Simplify (-5sqrt(68)/sqrt(2)-1)/((sqrt(200) - (sqrt(200)-1 + sqrt(200))-6) + sqrt(200))4. sqrt(17) Simplify (-2 + sqrt(5)-4 - (sqrt(5) - ((sqrt(5)-1 - sqrt(5)) + -3))2) + 2 + 0 + sqrt(25)/sqrt(20). -54 - 43sqrt(5)/2 Simplify (-4-6sqrt(96)/((sqrt(2) - sqrt(18)) + sqrt(2)) - (4sqrt(270))/(sqrt(30)/((sqrt(3) + sqrt(18)/sqrt(6) + sqrt(3) - sqrt(3)) + sqrt(3))))2. 52272 Simplify -4((-3 + sqrt(17)3)2 - (sqrt(17) - ((-2 + sqrt(1700))2 - sqrt(1700)))) - (5 + ((sqrt(17)-2 - sqrt(17))1 - (sqrt(153)/sqrt(3))/sqrt(3)))-5. -7439 + 256sqrt(17) Simplify 6(5(sqrt(343) + 4 + -1)-4 + 3)*25-4. -16853880 - 1915200sqrt(7) Simplify (sqrt(119) + sqrt(119)-2-5 + (sqrt(119) - (-2sqrt(119) - sqrt(119)))-4)/(((1sqrt(1008) + sqrt(1008) - sqrt(1008))4 - sqrt(1008)) + sqrt(1008)). -5sqrt(17)/48 Simplify 2(-5 + (-6(3 + sqrt(112)))2-6 + 4). -52274 - 10368sqrt(7) Simplify 5 + (5(1sqrt(112) + 1))2 - (5 + (sqrt(2268) + 2 - sqrt(28)) + 1). 184sqrt(7) + 2822 Simplify (sqrt(132)/((sqrt(36)2)/sqrt(3))-4 + (2 + -1sqrt(11))-1 + 2)*2. 11 Simplify (-4 + 6((sqrt(847) - (-2 + sqrt(847))6) + (sqrt(847) - (sqrt(847) + -4 + sqrt(847)1)))2)2 + 5. -297792sqrt(7) + 4426197 Simplify (-4sqrt(153)-3-4)/(sqrt(9) + (1sqrt(225) + sqrt(225) - sqrt(225)) + sqrt(1089) + sqrt(1089) + sqrt(1089)2)1. -24sqrt(17)/25 Simplify ((1(1 + (sqrt(2448) - (-2 + sqrt(2448))))-4 + -5)-5 + 5)*2. 8100 Simplify (-2((-1 + sqrt(125) + -2)3 - (sqrt(125)-1 + 0 - sqrt(125))-4)1)*2. 1800sqrt(5) + 12824 Simplify (-1sqrt(720)-25)/(4((sqrt(640) + (sqrt(640) - 1sqrt(640)) - sqrt(640)) + sqrt(640)) + sqrt(640) - sqrt(640) - sqrt(640)). 5sqrt(2)/2 Simplify (-5(sqrt(684) + 3(sqrt(684) + sqrt(684) + 2 + sqrt(684) + sqrt(684)) - (-4 + sqrt(684)3) - (1(3 + sqrt(684)) + -3sqrt(684) + 0)))2. 25200sqrt(19) + 2463625 Simplify -1(sqrt(605) - (sqrt(605) + 0))46 + 2 + 5 + 5. 12 Simplify (6-2(sqrt(187) - (sqrt(187) + 5((sqrt(187) - (1sqrt(187) - sqrt(187))) + sqrt(187)) + sqrt(187))))/((sqrt(66)1-6 - sqrt(66))/sqrt(6)3). -44sqrt(17)/7 Simplify ((4((sqrt(76) - sqrt(76)-2)-2 - (sqrt(76) + sqrt(76)-2)-3))/(1sqrt(16)51))2. 6156/25 Simplify -3(-4 + ((1sqrt(3500) - sqrt(3500))-3)/(sqrt(15)/sqrt(3)1 + sqrt(5) - sqrt(55)/(sqrt(11) + sqrt(99)))). 12 Simplify -4 + (-2 + (sqrt(72) + 2)2)-4 - (4 + sqrt(10)/(6-1sqrt(5)) + 4). -308 - 575sqrt(2)/6 Simplify -2((sqrt(272) + 0)*2 - (-2 + -1sqrt(17) + sqrt(17))) + 6((sqrt(17) + (2sqrt(153))/sqrt(9) + sqrt(17))*2 + -3 + -4). 1042 Simplify -6(-1 + -1 + (3 + sqrt(2448) - sqrt(2448))-55). 462 Simplify (sqrt(441)/(sqrt(1296) + 5sqrt(1296) - sqrt(9)))/(-5sqrt(21)/(sqrt(21)/sqrt(7)))-4. 4sqrt(7)/355 Simplify -21(1sqrt(19))2-2 + ((0 + sqrt(475))2 + (sqrt(475) - -1sqrt(475)-2) + sqrt(475))2. 1976 Simplify 2-3(-2 + -3sqrt(304) + (sqrt(304) - ((-2(sqrt(304) + -3 + sqrt(304) - sqrt(304) - sqrt(304)))2 - sqrt(304))) + -5)6. 144sqrt(19) + 1548 Simplify (sqrt(132) + sqrt(132)-2 - sqrt(33) - 2sqrt(825))/(sqrt(88)/((sqrt(200) - sqrt(8))6)). -312sqrt(3) Simplify -3(sqrt(900)/sqrt(5) - (sqrt(40) - sqrt(40)1)/sqrt(8)) - ((sqrt(45) + (sqrt(180) - sqrt(45)))-2 - (-1(-1 + sqrt(5) + sqrt(5)))25). -26sqrt(5) + 105 Simplify ((-2 + (sqrt(1300) + -61sqrt(1300) + 5)-5)-2-6)*2. -1944000sqrt(13) + 117104976 Simplify 3((sqrt(17) + sqrt(170)/(-3sqrt(10)) + sqrt(17) + sqrt(17) + sqrt(17))4 - (-1 + -5sqrt(17) + -2))-6. -354sqrt(17) - 54 Simplify 0 + ((sqrt(2156)-26)*2 + ((-2sqrt(2156) + sqrt(2156))-2)2 - (4 + sqrt(2156) + -1 + 1)). -14sqrt(11) + 319084 Simplify (-4 + (1 + sqrt(500) - sqrt(500)) + (sqrt(500) - (sqrt(500) - (0 + sqrt(500) + -4)*2)) - ((sqrt(500) + -1)-4-4)2)4. -510972 + 20160sqrt(5) Simplify (-4sqrt(832) - sqrt(91)/(sqrt(56)/sqrt(8)) - (-3(-3 + sqrt(13)) + (sqrt(143)-1)/sqrt(11)))*2. 522sqrt(13) + 11014 Simplify ((3 + sqrt(125) + -2 - sqrt(125)) + 4 + (2 + sqrt(125) + -2)5)21. 250sqrt(5) + 3150 Simplify (sqrt(208) - (sqrt(208) - (sqrt(208) + 1 + sqrt(208) + -5)) - (-1 + sqrt(208)1))*2-2 - (0 + 4 + -1 + (0 + sqrt(13) + -2)*2). -454 + 52sqrt(13) Simplify (23sqrt(18)-4)/(((1sqrt(72))/sqrt(12) - sqrt(6)) + 2sqrt(384))-5-4. -30sqrt(3) Simplify 0 + (((sqrt(459) - 3sqrt(459)-5)/sqrt(9))/(((sqrt(15) + (sqrt(15) - -2sqrt(15)))/sqrt(5) - sqrt(3)) + (sqrt(21)/(sqrt(21)/sqrt(3)) - sqrt(3))))2. 4352/9 Simplify (16-2sqrt(72))/(-1(sqrt(6) + sqrt(12)/sqrt(2) + sqrt(6)) - (sqrt(6) - (sqrt(72)/sqrt(4))/sqrt(3))). 8sqrt(3) Simplify 3(-5 + (sqrt(95) - -11sqrt(95))/(sqrt(80)-4) + -5). -30 - 3sqrt(19)/8 Simplify (sqrt(300) + 2 + sqrt(33)/sqrt(275) + -3 - (6(1sqrt(75) - sqrt(3)) + -4))-1. -3 + 69sqrt(3)/5 Simplify ((sqrt(110)/(sqrt(20)/sqrt(2)6) - (0 + (sqrt(11) + -2 + sqrt(11))3)2) + -4)6. -2616 + 433sqrt(11) Simplify -2(-3 + (((sqrt(195) - -1sqrt(195))/sqrt(5))/(-2sqrt(192)) - (sqrt(208) - (sqrt(208) + 1 + -1))-1)2). 179/32 Simplify -5 + (-4(-3 + sqrt(108)-2 + sqrt(108) + (sqrt(108) - (sqrt(108) + 1 + 4 + sqrt(108))) + -5(sqrt(108) - (sqrt(108) + 0 + -1))))*2 + -5. 4992sqrt(3) + 9606 Simplify ((-1 + sqrt(1088) - 3(2 + sqrt(17) - sqrt(17))) + 3sqrt(102)/(sqrt(6) + (sqrt(600)-3 - sqrt(600))))2. -1442sqrt(17)/13 + 188634/169 Simplify -15(-6(sqrt(847) + -4(4 + sqrt(847))*2 - sqrt(847)) + -3). -103545 - 10560sqrt(7) Simplify (-3 + sqrt(108)2 - (1 + sqrt(108) + sqrt(108) + -3) - ((6(sqrt(3) + sqrt(6)/sqrt(2)) - sqrt(3) - (-5 + -1 + sqrt(3))) + 1))*2 + 1. 160sqrt(3) + 365 Simplify (-5 + -2 + (0 + sqrt(48) - sqrt(3)-1-4 - (2 + sqrt(192))))5. -40sqrt(3) - 45 Simplify (-2(sqrt(1539)3 + 5)*2 - (-2(4 + sqrt(1539)1))2)1. -33972 - 828sqrt(19) Simplify -1 + (2-5(sqrt(3) - ((sqrt(27) - sqrt(3)) + 4)) - (-2 + sqrt(3)-1 - (sqrt(3) + (sqrt(432) - (2 + sqrt(432) - sqrt(432))))))*2. 1920sqrt(3) + 3327 Simplify (((sqrt(133)21 - sqrt(133)) + sqrt(133))-125)/((sqrt(1008) - 13sqrt(1008)) + 3(sqrt(1008)3 + sqrt(1008)) + sqrt(1008)). -5sqrt(19)/33 Simplify (-5(-1sqrt(85)-5 - (sqrt(85) + -6(sqrt(85) - sqrt(85)-2) + sqrt(85))))/(3sqrt(80) + sqrt(20)/sqrt(36)). -315sqrt(17)/37 Simplify (2sqrt(187)-4 - (sqrt(187) + sqrt(187) + sqrt(187) + -1sqrt(187))-4)/((1sqrt(275) - sqrt(275) - sqrt(275))-3-2). 0 Simplify 1 + (sqrt(7) + sqrt(28)/(sqrt(12)/sqrt(3)) - sqrt(7) - (-3 + (sqrt(7) - (3 + sqrt(7)))))2 + (4 + sqrt(175))2 + (sqrt(7) - -4sqrt(175)). 73sqrt(7) + 235 Simplify (sqrt(2662)2)/(sqrt(2)-16)1-52. 110*sqrt(11)/3 Simplify (sqrt(390	{ "pile_set_name": "DM Mathematics" }
8 + 12.298438. Let t = q + -12. What is t rounded to 4 decimal places? 0.0006 Let y = -12.999995 + 13. Round y to 5 decimal places. 0.00001 Let k = -217691.593 - -217720.5929953. Let d = 29 - k. What is d rounded to six dps? 0.000005 Let w = 99263.869966 + -99302.87. Let d = 39 + w. What is d rounded to 5 dps? -0.00003 Suppose 0 = u + 2u - 11595252. Suppose -2p - 4j = -u, p + 2j - 1932546 = -2j. Let m = -3067462 - p. Round m to the nearest one million. -5000000 Suppose -7p = -891 - 2399. Round p to the nearest one hundred. 500 Suppose -3v = -8v + 10. Let w be (0/4)/v - -60. What is w rounded to the nearest 100? 100 Let s be (131006/4)/((-2)/(-4)). Let r be (-400)/2(-3 + s). Round r to the nearest one million. -13000000 Let h = 22.8 - 26. Round h to the nearest integer. -3 Let r = 81 + -52. Let v = -29.000011 + r. Round v to 5 dps. -0.00001 Let k = -25 + 15. Let r = 10.0003 + k. What is r rounded to three dps? 0 Let v = 2.4 - 2.358. Let i = -0.995 + 1. Let o = i - v. What is o rounded to 2 dps? -0.04 Let c be 2/(-1) + 2 - 13518. Let v = -40518 - c. What is v rounded to the nearest 10000? -30000 Let u = 0.3 - -2.7. Let w = -2.992 + u. What is w rounded to three dps? 0.008 Let b = -5903 + 5910.0008. Let f = b + -7. What is f rounded to 4 decimal places? 0.0008 Let q(b) = 8b*2 - 7b + 9. Let c be q(13). Round c to the nearest 100. 1300 Let q = -4 - -4. Suppose c - 260 = -qc. Round c to the nearest 100. 300 Let g = 32.499999677 - 32.5. Round g to seven decimal places. -0.0000003 Let t = -3.6 + 3. Let q = -0.60000032 - t. What is q rounded to seven dps? -0.0000003 Let u be (625/(-10))/(0 - 1/6752). Round u to the nearest 100000. 400000 Let h = -5700 - -12900. Suppose -p - h = 2p. Round p to the nearest 1000. -2000 Suppose -17143 = -v + 8858. Let f be (-10)/(-20) - v/2. What is f rounded to the nearest ten thousand? -10000 Suppose 0 = -9g + 4g + 15. Suppose 0r + gr = -5s + 2441, 5s = -5r + 2435. Round s to the nearest 100. 500 Let h = 0.01 - 0.092. Let p = -0.082258 - h. What is p rounded to 5 dps? -0.00026 Let b = -323.99793 + 324. Round b to four dps. 0.0021 Let m = -4 + 8. Let b = 7268013 + -963776. Suppose mz + b = -4495763. What is z rounded to the nearest one million? -3000000 Let l = 0.052 + -0.0497. Round l to 3 decimal places. 0.002 Suppose 5y - 12 = 2y. Let n(v) = yv - 2 + v + 4. Let d be n(9). What is d rounded to the nearest 10? 50 Let r = -6 - 1. Let c = r + -75. What is c rounded to the nearest ten? -80 Let n = -0.42166 - -357.09966. Let r = n - 402.6862. Let b = r - -46. What is b rounded to three decimal places? -0.008 Let y = -1014 + 993.44. Let m = -20 - y. What is m rounded to one dp? 0.6 Let l = 5278.137 + -5274. Let i = 4 - l. Let y = i + 0.198. Round y to 2 dps. 0.06 Let f = 0.8 - -2.7. Let g = f + -6.3. What is g rounded to the nearest integer? -3 Let l = 6.2653 + 48.8577. Let d = -0.123 + l. Let b = -54.999934 + d. What is b rounded to 5 dps? 0.00007 Suppose 2q - 19102792 + 3896880 = 0. Let x = -3197044 - q. Round x to the nearest 1000000. -11000000 Let p = 75 - 75.0078. What is p rounded to three decimal places? -0.008 Let r = 265273 + -265272.000052. Let h = -1 + r. What is h rounded to 5 decimal places? -0.00005 Let s = 128.59 - 0.59. Let a = -138.8 + s. What is a rounded to zero dps? -11 Let q = 0.09100053 - 0.091. What is q rounded to 7 decimal places? 0.0000005 Let f be (-84)/(-105) - (2 - (-2570012)/(-10)). What is f rounded to the nearest 100000? 300000 Let p = 7.3 + -14.7. What is p rounded to the nearest integer? -7 Let d(r) = 89999r3 + r - 2. Let n be d(-2). Suppose 5b = 6z - z - 45, -4b + 3z = 37. Let g be (-4)/b - n/10. What is g rounded to the nearest 10000? 70000 Let i = -1.634032 - -89.626732. Let d = -163 + 251. Let h = i - d. What is h rounded to 3 dps? -0.007 Let z = -42 + 42.017. Let b = z - -0.145. Let v = 0.16067 - b. What is v rounded to 4 dps? -0.0013 Let i = 29 + -28.9999888. What is i rounded to six decimal places? 0.000011 Suppose -3 = -j, -3d = 3j - 26 - 1. Suppose d - 4 = -l. Let y = 45 + l. Round y to the nearest ten. 40 Suppose -b - b - 1050 = 0. Let v be b/(-20) - (-3)/4. Let w = 69 - v. Round w to the nearest 10. 40 Let f = 116.7 + -107. Let k = f - 2.9. Round k to the nearest integer. 7 Let j = -1212525721560 + 1212525062053.700003. Let b = j - -659506. Let z = b - -0.3. What is z rounded to 6 dps? 0.000003 Let l = -350529.46293 + 350531. Let t = -0.07113 - l. Let n = t + 1.6. What is n rounded to three decimal places? -0.008 Let m = -46.3 - 6.7. Let r = 53.00000062 + m. What is r rounded to 7 dps? 0.0000006 Let t = 0.8000003 - 0.8. Round t to six dps. 0 Let h be (3 - 4)(-1001 - -1). Suppose z + 4z = h. Round z to the nearest 1000. 0 Let q = 557.37 + -555. Let l = q - -2.67. Let v = -0.66 - l. Round v to zero dps. -6 Let l be -3920000(0 + 30/(-4)). What is l rounded to the nearest one million? 29000000 Let w = 7 + -6.85. Let o = -0.1525 + w. What is o rounded to 3 dps? -0.003 Let m = -349158.0117 - -349122. Let j = m - -36. Round j to 3 dps. -0.012 Let u = 14 + -15.6. Let t = u + 1.29. What is t rounded to 1 decimal place? -0.3 Suppose -15 = -6g + 3g. Suppose 4h = -2t - 2, 2t - 3h - 2 = -gh. Suppose -3q - t = -2q. What is q rounded to the nearest integer? -3 Let a = -103.03 - -103. Round a to 1 decimal place. 0 Let l(z) = 243749z*2 - 3z + 10. Let v(c) = -c + 1. Let w(n) = -l(n) + 6v(n). Let a be w(4). Round a to the nearest 1000000. -4000000 Let q = -10 + 5. Let c = q + 5.57. Round c to one decimal place. 0.6 Let p = 0.026 + 21.974. Let m = p - 9. Let u = -12.32 + m. What is u rounded to one dp? 0.7 Let c = -0.232 + 0.012. Round c to one dp. -0.2 Let b = -0.12956 - -0.133. What is b rounded to three dps? 0.003 Let y = -0.03 + 3.53. Let v = y - 3.612. What is v rounded to two dps? -0.11 Let z = -23801549742.62201966 + 23464727452.922019. Let o = 336822286 + z. Let x = -3.7 - o. Round x to seven decimal places. 0.0000007 Let q = -27.9 + 25. Let r = q - -2.90076. What is r rounded to four dps? 0.0008 Let a = -19.6 + 5.2. What is a rounded to zero dps? -14 Let y = 17 + -29. Let l = -12.00000048 - y. What is l rounded to 7 dps? -0.0000005 Let a = 0.4 - 0.475. Let m = -7.16 + 7. Let k = a - m. What is k rounded to two dps? 0.09 Let r = 0.1072 - -0.3998. Round r to one dp. 0.5 Let i = -30 + 32.86. Round i to 1 dp. 2.9 Let y = -0.253 - 171.747. Let h = 171.999862 + y. What is h rounded to five decimal places? -0.00014 Let f = -21859.59994 + 21860. Let m = f + -0.4. Round m to 5 decimal places. 0.00006 Let d = -220.2254 - -351.22631. Let t = 136 + -267. Let x = d + t. What is x rounded to four dps? 0.0009 Let l = 97048.7999996 + -97048.3. Let w = -0.5 - -1. Let r = l - w. Round r to seven dps. -0.0000004 Let i = -23559 - 90441. Round i to the nearest ten thousand. -110000 Suppose 14g + 2073 = -4787. Round g to the nearest 100. -500 Suppose i - 31 = -3i + 5u, 3i + 4u = 0. Suppose n + 40 = -io + 139, -5o = -3n - 145. Let t be 100000/(-1 - o/(-24)). Round t to the nearest 1000000. 1000000 Let y = 35 + -35.0000005. Round y to 7 dps. -0.0000005 Let j = -128 - -128.063. Let m = -0.062957 + j. What is m rounded to five dps? 0.00004 Let o = -5136.1448517 + 5101.14485. Let l = 0.7 + -35.7. Let s = o - l. What is s rounded to 6 decimal places? -0.000002 Suppose -3l + 46785 = -0l - 3s, 2s = l - 15599. Suppose 2o = -0o + 51182. Let i = o - l. What is i rounded to the nearest one thousand? 10000 Let t = -421 + 991. Let y = t + 120. Round y to the nearest 100. 700 Let k = -37.1 + -175.9. Let z = 213.0093 + k. What is z rounded to 3 decimal places? 0.009 Suppose v + 2v - 2040002 = -i, 3399990 = 5v - 5i. What is v rounded to the nearest 100000? 700000 Suppose -4 = -3u - 13. Let a be ((-19164)/9)/(1/u). Suppose -2h + 6h + a = 4v, -3v + 4812 = 4h. Round v to the nearest 1000. 2000 Suppose 136 = -3o - 4v, -o - v - 47 = 2v. What is o rounded to the nearest 10? -40 Let t be (-1)/4 + 9/4. Let a be t + -2 + 460000/(-1). Round a to the nearest 100000. -500000 Let h = 3.87 + 0.23. Round h to 0 dps. 4 Let l be (-1 + 5)30/(-8). Let q be (27500/l)/((-2)/18). What is q rounded to the nearest one thousand? 17000 Let g = -117 + 110.7. Let w = g + 6. Le	{ "pile_set_name": "DM Mathematics" }
2. Let v = w - -26. Which is the third smallest value? (a) v (b) 1/3 (c) 6 c Let r(y) = y*2 - 3y. Let n be r(3). Suppose 4u - m = 13, 0 = -nu - 4u - 2m + 10. What is the third smallest value in -2/7, 4, u? 4 Suppose 15l + 110 = 20l. Suppose -ly + 23y - 3 = 0. What is the third biggest value in y, -3, 0.5? -3 Let d = -419.6 - -420. What is the third smallest value in -2/5, 4, d, 36? 4 Let x = 1914 + -2005.3. Let o = 91 + x. Let q be (-5)/28 - (-1)/(-4). What is the second smallest value in q, -4, o? q Let g = -183.15 - -183. What is the second biggest value in 1, g, 0.01, 0.5? 0.5 Let v = 19 - 21. Suppose 2n = 3w + 2, 5 = 3n - 4w - 0w. Let k be (-14)/49 - (-2)/n. What is the biggest value in 0.5, k, v? 0.5 Let k = 12 + -21/2. Suppose -2f + 4f + 8 = -3x, 4x + 26 = 5f. Let i = 192 - 195. What is the second smallest value in i, x, k? i Let k be 0 - ((-7)/(-5) - 1). Let t = -23.663 + 14.663. What is the third smallest value in k, -1, -4, t? -1 Let l = -15.29 + 14.99. Which is the third smallest value? (a) 5 (b) -2 (c) l (d) -2/115 d Let h = 2.7 - 2.9. Let m be (0 - -1)0 + 0. Suppose -j + 2u + 0 + 1 = 0, m = 3j + 2u - 3. What is the smallest value in h, -5, j? -5 Let k(d) = -4d + 25. Let l be k(6). What is the second biggest value in -0.5, -29, -2/13, l? -2/13 Let g = 0.0019 + 0.2981. Let k be (12/21)/(3/(-7)). What is the third biggest value in 5, k, g? k Let i = -258 + 118. Let o be (4 - i/(-36))/(4/(-30)). Which is the third biggest value? (a) o (b) 5 (c) -0.3 (d) -3/5 d Let p be (1 - 3)3/30. Let v = -217.4 + 217.7. Which is the third biggest value? (a) -8 (b) p (c) v a Let h(z) = -z*3 + 12z*2 - 11z + 7. Let d be h(11). Let p = d + -7. Suppose p = i + 2 - 1. What is the smallest value in -2, -5, i? -5 Let z = 0.28 - 49.28. Let w = -48.9 - z. Which is the second biggest value? (a) w (b) 33 (c) -1/5 a Let l = 237/2 + -117. Let q be (-2)/(-3)36/(-304). Let d = -49/342 + q. What is the third biggest value in 1, d, l? d Suppose 4 - 13 = y. Let m = y - -14. Which is the fourth smallest value? (a) m (b) -7 (c) 4/7 (d) -2/17 a Let h = -6.62 - -9.62. Which is the smallest value? (a) 0.3 (b) h (c) 2/7 (d) 0.064 d Let t = -0.0967 + 0.1967. What is the biggest value in t, 9/7, -11? 9/7 Let w = -1.4 - -1. Let u = 884 + -7957/9. What is the fourth smallest value in 1/4, w, u, 2/27? 1/4 Let d = -1.11 + 0.11. Let i = -275 - -1657/6. Let r = i + -8/3. Which is the third smallest value? (a) r (b) d (c) 0.5 c Let i be ((-43)/6 + 7)-3. What is the third smallest value in -0.2, 2, i, -0.02? i Let z = -19 - -15. Let n be z/(-18) - 18/81. Suppose g + g + 4 = n. What is the second smallest value in 2, -0.1, g? -0.1 Let a = 0 - 0.3. Let p = -23/36 + -1/36. Let w = -21 + 20. What is the third biggest value in a, p, w? w Let t = -0.02 - -0.19. Let i = -1.83 - t. What is the smallest value in -5, -2/9, i? -5 Let g = 1 - -12. Which is the second smallest value? (a) g (b) -0.2 (c) -2/9 b Let d = -37/34 - -10/17. Let g be 28/((-3 + 0)/3). Let r be (4/(-14))/((-6)/g). Which is the smallest value? (a) d (b) 2/15 (c) r c Let g = -103 + 97. Which is the fourth smallest value? (a) -0.4 (b) g (c) 8 (d) -3 c Let n = -0.3 - 0.7. Let j be (-1)/4-6(-2144)/5460. Let u = j - 1/91. Which is the smallest value? (a) n (b) -0.5 (c) u a Let r = 0.16 + 23.84. Let t = -26.938 + -0.062. Let i = r + t. What is the biggest value in -5, i, 0? 0 Let w = -0.8794 - 0.0206. What is the fourth smallest value in -6, 0.3, w, 1? 1 Suppose 8 = x + a + 11, -4x + 5a - 39 = 0. What is the second biggest value in x, 0.21, -0.3? -0.3 Let a = 59.59 + -59. Let h = a - 0.09. Let u = 6 + -2. What is the smallest value in 2/17, u, h? 2/17 Let k = -0.551 + -6.449. Which is the third smallest value? (a) 2 (b) -1 (c) k a Let v = -41 + 14. Let s = 27.2 + v. What is the biggest value in s, 6, 4? 6 Let n = 24.5 + 95.5. Let k = -120.4 + n. Which is the third biggest value? (a) k (b) 0 (c) -6 (d) 3/7 a Let k = -86 + 119. Let x = -163/5 + k. What is the second biggest value in -1, -0.1, -3, x? -0.1 Let c be -11 - 92(-7)/56. What is the third biggest value in 10, -0.4, c? -0.4 Let d = 32.87 - 33. Let z = d - 4.87. Let l be 50/(-88) - (-3 + 18/8). Which is the third smallest value? (a) z (b) -3/5 (c) l c Let u = 0.121 - -0.179. Let p = 2 + -4. What is the third biggest value in u, p, 1/8? p Let f be (-43)/15 + (6 - 3). Let h = -7 + 6.5. Which is the third biggest value? (a) h (b) f (c) 0.17 a Let s = -7217/10 - -722. What is the second smallest value in s, -4, 5, 3? s Suppose 91 + 59 = -5k. Let c = k + 20. Let l = -21/2 - c. What is the second smallest value in 4, -4/5, l? l Let r be 3/4 - (-39)/12. Let l be r/16 + (-1)/2. Let h be (2 + (-21)/9)0. What is the second smallest value in -3/4, h, l? l Let z = -690 - -690.1. What is the second biggest value in 0.004, -2, z, 1/8? z Suppose 0 = -4l + 9 + 3. Let t = -44 - -55. Suppose 0 = -13k + tk - 4. Which is the third smallest value? (a) 1 (b) k (c) l c Suppose 0 = 3i - 4i + 4. Suppose 379q = 378q + 3. Let u be -5 + i + 7/q. What is the second smallest value in u, -1, 1? 1 Suppose 0z - 29 = -z - 5f, 3z - 23 = f. Let w be 32/z-3. Let g be (7/(-35))/(w/(-4)). What is the biggest value in 1, g, -1/8? 1 Suppose -41k = -44k + 6. Let o(m) = -m3 - 3m*2 + m - 3. Let h be o(-4). Which is the second biggest value? (a) k (b) h (c) 4 c Let z = 196 + -1565/8. Let l be -1 + (1 - 0) - 2. Let k be (-44)/(-10) - (2 - l). Which is the second smallest value? (a) -6/7 (b) k (c) z c Let i = -0.4 - 0. Let k = -12.4 + 0.4. Let y = -11.5 - k. Which is the biggest value? (a) i (b) y (c) 0.2 b Let k = -18 + 20.6. Let v = -0.6 + k. Which is the third smallest value? (a) -0.4 (b) v (c) -5 b Let l = -0.033 + -0.167. Let t = -51 + 50.6. Which is the third smallest value? (a) 2/5 (b) t (c) 6 (d) l a Suppose -4k = n + k + 17, 2n = 2k + 26. Suppose -29 = -nd - 5. What is the second biggest value in 0.1, 2/3, d? 2/3 Let s = 102873/125 - 823. Which is the third smallest value? (a) 5 (b) -4 (c) s a Let w = 31/45 + -4/45. Let q = -5 + 5.1. What is the biggest value in -0.2, w, q? w Let c = -2.9 - -3. Let v = 1813/1130 - 1/226. Let p = -2 + v. What is the second biggest value in p, -4, c? p Let t = 14 + -16. Which is the second biggest value? (a) -16 (b) -2/5 (c) t c Let p = -2947/3 + 982. Which is the biggest value? (a) -0.06 (b) p (c) -0.4 a Suppose -4q = -44q. Which is the fourth smallest value? (a) -4 (b) q (c) 0.1 (d) -7 c Let f = 308 - 304. What is the smallest value in -1/7, f, 68, -4? -4 Let l = 2.6 - 0.6. Let q = -31 - -30.988. Let c = q + 4.012. What is the second smallest value in c, -2, l? l Let k be 105/(-90) + -3 + 4. What is the second biggest value in 0.2, -39/5, k? k Let g = 26.83 + -27. Let a(i) = -2i*2 - 9i + 59. Let l be a(-8). What is the third biggest value in -0.2, l, g? -0.2 Let s = -0.22 - -0.165. Let p = 0.055 + s. Which is the third smallest value? (a) p (b) 3/4 (c) 1/2 b Let s = -26.0735 - 0.0265. Let u = 26 + s. Let c be (-6)/4(-8)/18. What is the biggest value in c, 1/2, u? c Let z = 21 - 21.2. What is the third smallest value in -15/4, z, 2, 2/11? 2/11 Let o = 16 - 11. Let m(j) = -j3 + 5j*2 - 5j + 4. Let l be m(2). Let d be 4/(-12)l/4. Which is the second smallest value? (a) 0.4 (b) d (c) o a Let i = 96 + -1438/15. Let x(n) = n3 - 5n*2 + n - 3. Let j be x(4). Let f be 4/j + 8/(-24). Which is the biggest value? (a) i (b) 3 (c) f b Let t = 1357.8 - 1358. What is the fourth biggest value in t, 0.2, -179/3, 2/11? -179/3 Let t = -195 + 972/5. What is the third smallest value in t, 4/7, 3? 3 Let w = 9 - 9.5. Let i = w - -1. Let r be (-34)/(-8) - 1 - 3. Which is the third smallest value? (a) -0.02 (b) r (c) i c Let m = -0.0038 - -5.0038. Which is the third smallest value? (a) 0 (b) m (c) 7 (d) 2 b Let f = 8 + -7.93. Let s = -5.07 + f. Let p = -413 + 410. What is the third biggest value in s, p, -0.3? s Let c be 3(0 + ((-29)/9 - -3)). What is the second smallest value in -0.4, c, -4/5, -1/2? c Let j = 4 - 9. Let f be 40/(-48)-23. Which is the fourth smallest value? (a) f (b) 2 (c) 2/13 (d) j a Let k = 0.023 +	{ "pile_set_name": "DM Mathematics" }
n 29212955 is divided by 593. 589 What is the remainder when 50962 is divided by 768? 274 Calculate the remainder when 24538 is divided by 12207. 124 What is the remainder when 694020 is divided by 9435? 5265 What is the remainder when 18167 is divided by 7974? 2219 Calculate the remainder when 1501785 is divided by 4303. 38 What is the remainder when 646893 is divided by 6669? 0 What is the remainder when 32456 is divided by 32280? 176 What is the remainder when 1743017 is divided by 614? 485 What is the remainder when 540232 is divided by 539872? 360 Calculate the remainder when 19131416 is divided by 5. 1 Calculate the remainder when 18974 is divided by 73. 67 What is the remainder when 4254758 is divided by 252? 242 What is the remainder when 9324181 is divided by 1177? 1164 Calculate the remainder when 166044 is divided by 13956. 12528 What is the remainder when 113852 is divided by 2076? 1748 Calculate the remainder when 948547 is divided by 57. 10 Calculate the remainder when 3113111 is divided by 4354. 1 What is the remainder when 101970138 is divided by 6362? 2 What is the remainder when 14036210 is divided by 22? 12 Calculate the remainder when 8110584 is divided by 173. 171 Calculate the remainder when 41127548 is divided by 14657. 6 Calculate the remainder when 163518418 is divided by 80. 18 Calculate the remainder when 119262 is divided by 4539. 1248 What is the remainder when 204688 is divided by 25561? 200 What is the remainder when 7403 is divided by 4087? 3316 Calculate the remainder when 1592568 is divided by 4168. 392 Calculate the remainder when 151996 is divided by 3447. 328 What is the remainder when 76131 is divided by 1003? 906 What is the remainder when 894 is divided by 180? 174 Calculate the remainder when 9011089 is divided by 278. 275 What is the remainder when 17891492 is divided by 2844? 2732 What is the remainder when 59260794 is divided by 904? 882 Calculate the remainder when 11236494 is divided by 375. 369 What is the remainder when 7847942 is divided by 763? 487 Calculate the remainder when 999728 is divided by 5404. 5392 Calculate the remainder when 20750183 is divided by 1482150. 83 What is the remainder when 4043160 is divided by 10? 0 Calculate the remainder when 86709 is divided by 3435. 834 Calculate the remainder when 168142 is divided by 167326. 816 What is the remainder when 726912 is divided by 2415? 2412 Calculate the remainder when 30456513 is divided by 162869. 10 Calculate the remainder when 1478399 is divided by 54. 41 Calculate the remainder when 5040632 is divided by 1088. 1016 Calculate the remainder when 228175288 is divided by 45635057. 3 What is the remainder when 10160643 is divided by 148? 147 Calculate the remainder when 21757054 is divided by 7252345. 19 What is the remainder when 161633850 is divided by 3361? 3360 Calculate the remainder when 649316 is divided by 522. 470 Calculate the remainder when 123632 is divided by 298. 260 Calculate the remainder when 1377286 is divided by 1128. 1126 Calculate the remainder when 33131983 is divided by 12303. 4 Calculate the remainder when 3083932 is divided by 342655. 37 What is the remainder when 800753250 is divided by 494? 492 What is the remainder when 962735 is divided by 71? 46 What is the remainder when 16656746 is divided by 125? 121 What is the remainder when 341164 is divided by 92? 28 Calculate the remainder when 568568 is divided by 189361. 485 What is the remainder when 22921840 is divided by 739414? 6 What is the remainder when 17967249 is divided by 54? 45 Calculate the remainder when 478344 is divided by 1339. 321 Calculate the remainder when 91419046 is divided by 4197. 4189 What is the remainder when 236470 is divided by 2038? 62 Calculate the remainder when 25045798 is divided by 31. 30 What is the remainder when 58274 is divided by 704? 546 What is the remainder when 3075 is divided by 2195? 880 What is the remainder when 6723 is divided by 6541? 182 What is the remainder when 232865 is divided by 223? 53 Calculate the remainder when 386836 is divided by 96657. 208 What is the remainder when 381626 is divided by 5157? 8 What is the remainder when 18031912 is divided by 175? 87 What is the remainder when 214179 is divided by 15280? 259 What is the remainder when 657781 is divided by 21907? 571 What is the remainder when 1237809 is divided by 792? 705 Calculate the remainder when 5228101 is divided by 1065. 16 Calculate the remainder when 1736680 is divided by 17026. 28 Calculate the remainder when 369786 is divided by 16807. 32 What is the remainder when 91206 is divided by 4307? 759 Calculate the remainder when 18620636 is divided by 15. 11 Calculate the remainder when 1609301 is divided by 76632. 29 Calculate the remainder when 8347 is divided by 2654. 385 Calculate the remainder when 3753646 is divided by 31543. 29 What is the remainder when 12819122 is divided by 3733? 0 Calculate the remainder when 17637290 is divided by 272. 266 What is the remainder when 6012965 is divided by 3006472? 21 Calculate the remainder when 3833367 is divided by 1685. 1677 What is the remainder when 116381221 is divided by 145? 16 Calculate the remainder when 309732 is divided by 309696. 36 Calculate the remainder when 1273510 is divided by 19294. 106 Calculate the remainder when 199022650 is divided by 67. 21 Calculate the remainder when 435719 is divided by 319. 284 Calculate the remainder when 2896491 is divided by 1720. 11 Calculate the remainder when 4831767 is divided by 500. 267 Calculate the remainder when 17434739 is divided by 1013. 1009 Calculate the remainder when 766977 is divided by 135. 42 What is the remainder when 105096 is divided by 3296? 2920 Calculate the remainder when 3510324 is divided by 63824. 4 What is the remainder when 62947794 is divided by 4821? 4818 Calculate the remainder when 8062229 is divided by 44. 21 What is the remainder when 357916 is divided by 2738? 1976 What is the remainder when 1231478 is divided by 2374? 1746 What is the remainder when 8889166 is divided by 24? 22 What is the remainder when 359854 is divided by 2768? 14 What is the remainder when 3795458 is divided by 2230? 2228 Calculate the remainder when 724718 is divided by 45263. 510 What is the remainder when 29327675 is divided by 2104? 19 What is the remainder when 6374309 is divided by 754? 747 Calculate the remainder when 51527 is divided by 837. 470 Calculate the remainder when 58523912 is divided by 237902. 20 Calculate the remainder when 1620819 is divided by 273. 18 Calculate the remainder when 173319 is divided by 716. 47 What is the remainder when 812982 is divided by 6719? 6702 What is the remainder when 36676958 is divided by 431493? 53 Calculate the remainder when 7578893 is divided by 3789408. 77 What is the remainder when 128314842 is divided by 89? 71 Calculate the remainder when 15966406 is divided by 25065. 1 Calculate the remainder when 2780325 is divided by 173769. 21 Calculate the remainder when 9478039 is divided by 2539. 2491 What is the remainder when 5973150 is divided by 13099? 6 Calculate the remainder when 827213 is divided by 9387. 1157 What is the remainder when 97247 is divided by 5086? 613 Calculate the remainder when 20790494 is divided by 52. 10 Calculate the remainder when 148581 is divided by 14. 13 What is the remainder when 16712762 is divided by 42? 38 What is the remainder when 1510628 is divided by 502209? 4001 What is the remainder when 2131081 is divided by 532767? 13 What is the remainder when 63004830 is divided by 294415? 20 What is the remainder when 3839052 is divided by 150? 102 Calculate the remainder when 3259724 is divided by 344. 324 Calculate the remainder when 1027032 is divided by 63. 6 Calculate the remainder when 35316849 is divided by 3918. 3915 Calculate the remainder when 46408944 is divided by 132. 120 What is the remainder when 1809047 is divided by 107? 105 Calculate the remainder when 412100 is divided by 137334. 98 What is the remainder when 127151951 is divided by 1756? 1747 Calculate the remainder when 178629 is divided by 12284. 6653 Calculate the remainder when 4842197 is divided by 18768. 53 Calculate the remainder when 584021978 is divided by 364. 358 What is the r	{ "pile_set_name": "DM Mathematics" }
be u(-6). Let x be 3 - (q + (2 - 6)). Let d be -2 + 3/(x/12). Give k(d). 3 Let d(n) = -8n. Let k(q) = -21q + 1. Let y(r) = -8d(r) + 3k(r). Let a(p) = p*2 - 9p + 7. Let b be a(7). Let g = 2 + b. What is y(g)? -2 Let s(y) = -6y2 + y - 1. Let g be s(-1). Let h(t) = t2 + 8t - 11. What is h(g)? -11 Suppose 5c - 4j - 24 = 0, -2c - 2c + 21 = -5j. Suppose -c + 20 = -4p. Let z(m) = m*2 + 5m - 2. What is z(p)? -6 Let n(p) = 2 - 3 + p - 4 + 1. Let q be n(3). Let l(d) = 3d2 + 1. What is l(q)? 4 Let f(y) = y - 16. Let j(v) = v2 - 11v + 26. Let q be j(9). Determine f(q). -8 Let o(m) = m*2 - 7m + 3. Let c(f) = -f + 1. Let y(i) = -4c(i) + o(i). Determine y(3). -1 Let y = -17 + 16. Let k(c) = c - 1. Let a(v) = 8v - 8. Let o(n) = ya(n) + 6k(n). Let m be (6/8)/(1/4). What is o(m)? -4 Let i(k) = 2k - 7. Let w = 12 - 20. Let j = 7 + -20. Let o = w - j. Determine i(o). 3 Suppose -2n + 2w + 18 = 0, 3n + 4 - 15 = -w. Let x(k) = -6k - 2. Let h(a) = -a - 1. Let s(r) = nh(r) - x(r). Give s(4). 1 Let o(x) = x*2 + 3x + 7. Let t(u) = -4u2 - 13u - 29. Let z be (-4)/(-10) + 32/20. Let a(s) = zt(s) + 9o(s). Determine a(0). 5 Let q(m) = -m*3 + 2m*2 + 2m - 2. Let l = 7 + -5. Let p be q(l). Let y(g) = -3g + 4g + 0g + pg. Calculate y(3). 9 Suppose -2f = -5j - 3f - 80, -3f = -2j - 32. Let d = j + 20. Let r(c) = c + 2. Calculate r(d). 6 Let m = -1 - -6. Let u(g) = 5 - g2 - g3 + 0g - g + mg2. What is u(4)? 1 Let n(g) = g - 4. Let s be n(7). Let j(o) = so*2 - 2o - 6o2 - 3o + 3 + 2o2. Calculate j(-6). -3 Let g(o) = -o - 2. Let v be (-6)/(-9)-3 + 2. Suppose 4k - 3k = v. Determine g(k). -2 Let b(d) = -d*2 + 3d - 3. Let p(k) = -k*2 + 7k + 7. Let f be p(7). Let h = 3 - f. Let n(v) = -2v - 5. Let u be n(h). Give b(u). -3 Let x = 6 - 11. Let o be (-2)/x + 44/(-10). Let u(p) = -p2 - 3p + 1. Calculate u(o). -3 Suppose 0 = -7x + 2x. Let d(n) = -n*2 + 4 + x + 4n + 0. Let y(j) = 2j - 6. Let o be y(5). Give d(o). 4 Let j(i) = 4i*2 - 3i + 2. Let h be j(1). Let y(g) = g*2 - 3g + 2. Determine y(h). 2 Let l(m) = -2m3 + 2m*2 - 2m + 1. Let q be -5(-8)/20 + -1. What is l(q)? -1 Let s = -722 - -728. Let k(j) = 9j - j + 0j3 - 8 - j3 + 5j2. Determine k(s). 4 Let s(h) = -h2 + 10h - 9. Let u be s(9). Let w = -3 - u. Let l(a) = 2a + 2. Give l(w). -4 Suppose 4x - 60 = 3m, 2x - 30 = m + 4m. Suppose 0 - x = j. Let k be 3/(-3 + j/(-4)). Let h(o) = o - 5. What is h(k)? -1 Let g(u) = -u*3 + 5u*2 - 5u + 5. Let c be -12((-4)/3)/4. Determine g(c). 1 Let h(g) = 0g + 0 - 1 + 2g. Suppose -5l - 2v = -0v - 29, -4v + 3 = -l. Determine h(l). 9 Let b(t) be the second derivative of t6/120 - t5/15 + t4/12 - t3/3 + 3t*2 - 11t. Let a(d) be the first derivative of b(d). Give a(4). 6 Let r(u) = 15u3 + 12u - 3u3 + 11u*2 - 13u*3 - 4. Give r(12). -4 Let h(j) = -j. Let z be (16/6)/((-4)/(-6)). Let f(d) = 2d - 2. Let c be f(z). Calculate h(c). -6 Suppose -6o - 4 = -10o. Let p(j) = 9j2 - 1. Give p(o). 8 Let k(n) = 4n*2 - n - 2. Let v(o) = 2 + 0 - 12o + 9o - o2. Let b be v(-4). Determine k(b). 16 Let x(b) = -2b. Suppose -5r + 20 = -2c, -27 = -2r + 3c - 8. Suppose rh + 2h = 0. Suppose -3s + hn + 3 = -n, -n = s - 5. Calculate x(s). -4 Suppose -5g = -4 - 16. Let x be g/(-10) + 6/15. Let s(j) = -j - 2. Give s(x). -2 Let k(j) be the second derivative of -j4/6 + 5j*3/6 - 2j*2 + 6j. Let t be 2/(-3) + (-22)/(-6). What is k(t)? -7 Let k = -4 + 6. Let o(x) = 3 - 5x3 + x3 - 4xk + x3 + 7x + 2x3. Let n be (-5)/(5/6) - -1. Give o(n). -7 Let u(t) = -t2 + 4t + 7. Let a(c) = c3 + 17c*2 + 15c - 11. Let x be a(-16). Determine u(x). 2 Let j(w) = w - 5. Let o(x) = 1. Let y(k) = -j(k) - 5o(k). Determine y(1). -1 Let z(o) be the third derivative of o5/60 - 7o*4/24 + 7o*3/6 - 7o*2. What is z(7)? 7 Let d(z) = -46z + 86z - 42z + 0 + 1. Give d(2). -3 Let h(z) = -z*2 - 3z + 7. Suppose -3o - o = -12. Let j(m) = m2 - m. Let g be j(o). Let y = g - 11. Give h(y). -3 Suppose 0l - 23 = -2u + 5l, -3l = 15. Let x(p) = 8p*2 + p. Determine x(u). 7 Suppose 0 = 2r + 3b - 26 - 17, -3r + b + 92 = 0. Let v = -19 + r. Let t be 2/v(1 - -4). Let n(l) = 8l - 1. Determine n(t). 7 Let d(j) be the third derivative of 3/2j3 - 1/12j*4 + 0 + 0j - j*2. Let f(l) = l - 5. Let t(p) = -3d(p) - 7f(p). Give t(0). 8 Let n(d) = -d + 1. Let z be n(0). Let r(i) = -22i - 7. Let f(l) = 2 + 5l + 0l + 2l. Let h(x) = -7f(x) - 2r(x). What is h(z)? -5 Let y(h) = 3h + 23. Let s be y(-6). Let f(u) be the second derivative of -u*3 - 2u + 0 + 1/20us - 1/3u*4 + 2u*2. Give f(5). -1 Let u(h) = 4h*2 + 4h - 1. Let w = 25 + -28. Calculate u(w). 23 Suppose -z + 5i - 10 = 0, 3z - 5i + 10 = -0z. Let g(d) = -d*2 - d + 10. Let v(j) = -3j*2 - 2j + 21. Let c(o) = -5g(o) + 2v(o). What is c(z)? -8 Let j(u) = u*2 - 5u + 9. Let c be j(3). Let w(k) = 9k2 - 7k2 - 3 - k3 - 4k2 + ck. Suppose -5m + 2r = r + 19, -2r = -8. What is w(m)? -3 Let u(a) = 14a*2 - 18a + 11. Let k(l) = -5l2 + 6l - 4. Let c(p) = 11k(p) + 4u(p). What is c(5)? -5 Let l(s) = 12s + 1. Let j = 19 + -20. Determine l(j). -11 Suppose 5h = 4h - 13. Let k = h + 20. Suppose -4u + k = -17. Let y(f) = -f*2 + 7f - 8. What is y(u)? -2 Let c = -8 + 13. Let f(q) = q*2 - 5q - 6. Let h be f(c). Let t = h + 9. Let w(j) = -j*2 + 3. Calculate w(t). -6 Let i(n) = -4n*2 + 5n + 10n2 - 6n2 - 2 + n2. What is i(-6)? 4 Let b(w) = -w*3 - 2w*2 + 3w - 3. Suppose 797 - 167 = 6k. Let m be (-30)/k - (-38)/(-14). Determine b(m). -3 Let s(z) be the third derivative of -z6/120 + z5/12 - z4/6 + z3/3 - 10z*2 + 2. Let b be -514/(-10). What is s(b)? 6 Suppose -r + 13 = 2u + 2r, -5u + 5r = -45. Let h(i) = -ui + 2 - 6 - i2 - 3. Let t(q) = -q2 - 7q - 6. Let a(z) = -5h(z) + 6t(z). Determine a(-2). -1 Let p(k) = 2k. Let i be ((-30)/(-45))/((-1)/3). What is p(i)? -4 Let a(g) = g*2 - 2g. Suppose -19 - 13 = -8k. What is a(k)? 8 Let a(h) be the first derivative of 5h4/24 + h3/6 + 5h2/2 - 3. Let f(g) be the second derivative of a(g). Give f(1). 6 Let q(r) = 32 + 8r - r*2 - 30 + 2r. Calculate q(10). 2 Let k be 5-49/(-30). Let n(i) = i*2 - 8i + 6. Give n(k). -6 Suppose -3w = 3q, -4w + 40 = -5q + w. Let a be q/(-1) - (-2 - -3). Suppose 0 = am + m + 8. Let z(n) = 3n*2 + 4n + 2. What is z(m)? 6 Let k(d) = d - 2. Let y(c) = 1. Let g(x) = -k(x) - 2y(x). Determine g(0). 0 Let y(h) = 3h. Let c(m) = 16m + 1. Let u(n) = -2n + 4. Let d be u(3). Let l(z) = dc(z) + 11y(z). What is l(2)? 0 Let a(b) = 10b2 - 5b + 5 + 4b2 - 2b + 0b. Let n(j) = 13j*2 - 6j + 4. Let x(v) = 5a(v) - 6n(v). Let i = -1 - 0. Determine x(i). -8 Let c(z) = -3z2 - z - 29. Let w(v) = v2 + 10. Let t(s) = -6c(s) - 17w(s). Let y be t(-3). Let b(q) = q2 + 4q - 5 + 1 - 1. Calculate b(y). 0 Let x(t) be the third derivative of t6/120 - t5/12 + t4/6 - t3/3 + 45t2 - 3t. Let y be 6 + 3/((-3)/2). Let q be y/5(-1 + 6). Give x(q). -2 Suppose 2s = x + 4, 0s + 3x = -3s + 6. Let d(b) = -sb + b + b + 4b. What is d(-1)? -4 Let d(y) be the first derivative of -y4/4 - 5y*3/3 + 3y*2 - 7y + 126. Let a be -5 + -2 + (1 - 0). Determine d(a). -7 Let f(x) = -x3 - x2 - x + 1. Let v(y) = -2y3 - 4y*2 - 3y + 11. Let b = -12 - -9. Let l(p) = bf(p) + v(p). Give l(0). 8 Let y(g) = -5g + 0g - 2 + 7 + g2. Suppose 7r - 19 - 16 = 0. Give y(r). 5 Let v(c) = -c*2 - 4c + 6. Let u(p) = p2 + p - 6. Let w be u(0). Let q be v(w). Let f be 3/(-9) - 2/q. Let x(j) = j + 2. What is x(f)? 2 Let a(s) = s3 + 3s2 - 5s - 3. Let y be a(-4). Suppose 2 = -0c + c. Let m(o) = -2o - c + 2. What is m(y)? -2 Let h(s) be the first derivative of -1/2s2 - 4 + 0s. Suppose 2o + 2v - 12 = -2o, -16 = -4o - 4v. Give h(o). -2 Let k(i) = i2 + i - 4. Suppose 4c - c = -9. Let y be k(c). Let x(d) be the third derivative of d6/120 + d5/60 - d*4/24 - 5d*2. Determine x(y). 10 Let i(t) = 4t - 3t + 0 - 1. Let u be -1 - ((-2 - -3) + -6). Give i(u). 3 Let g(u) = 5u*2 + 3u*2 - 6u2 - u. Calculate g(3). 15 Let t(b) be the first derivative of b3/3 - 2b*2	{ "pile_set_name": "DM Mathematics" }
3 a What is the closest to -1 in 2/3, -4084, 0.1? 0.1 What is the closest to 1/4 in -0.06, 5, -37? -0.06 What is the closest to -0.05 in 5, -2/5, -0.5, 2/9? 2/9 What is the nearest to 1 in -3, -115, -2/5, 2? 2 What is the closest to -2/7 in 0.3, 3, -2, 1/16? 1/16 Which is the closest to 1? (a) -4 (b) -3 (c) -0.01 (d) 0.4 d What is the closest to -1/11 in 5, 15.6, -5? -5 Which is the nearest to 1? (a) 4/7 (b) -2/11 (c) -2/41 (d) 2/25 a Which is the closest to 1/58? (a) 2/17 (b) -0.6 (c) 2/19 (d) -1/4 c Which is the closest to 1? (a) -15 (b) -4 (c) 2/9 (d) -1/4 c Which is the nearest to -13? (a) 1 (b) 36 (c) -3 c What is the closest to 2/11 in -0.5, 0.2, -8/23? 0.2 What is the closest to -1/12 in -1/2, 4/7, 1, -11? -1/2 Which is the closest to -4? (a) 0.1 (b) 3/8 (c) -0.8 c Which is the closest to 2? (a) -13/5 (b) 5 (c) 2/15 (d) 0.4 d What is the nearest to 1 in 4, -15, 1, 2? 1 What is the nearest to -1 in 0.4, 1/3, -1/4, 0.5? -1/4 Which is the closest to 0.01? (a) -2/7 (b) 2/5 (c) 0.24 c What is the closest to 0 in -2, 0.3, -9? 0.3 Which is the closest to 0.2? (a) 2 (b) -2/5 (c) 5/4 (d) -1/27 d What is the closest to 2/5 in 5, -4, 0.4, 1.4? 0.4 Which is the nearest to 2? (a) 1/6 (b) 1/14 (c) 4 (d) 3 d Which is the closest to 118? (a) -0.5 (b) 0 (c) 0.3 (d) -5 c What is the closest to -1 in 1/31, -2, 3, 3/8? -2 What is the closest to 2 in 0.7, -2/3, 13? 0.7 Which is the nearest to 2? (a) -0.013 (b) 1/21 (c) 1 (d) 2 d What is the closest to -15 in -0.7, -0.1, 5, 3/2? -0.7 Which is the closest to -0.1? (a) 0.2 (b) 4 (c) 15 (d) -12 a What is the closest to -3 in -5, 15, 2? -5 What is the nearest to 0.2 in -629, -1/5, 0.4? 0.4 Which is the closest to -1/3? (a) 1 (b) 0.4 (c) -0.3 (d) 0.83 c What is the closest to -2/5 in -0.1, 0, -8, -0.2? -0.2 Which is the nearest to -2/77? (a) 1/3 (b) 0.1 (c) 4 (d) -1/4 b Which is the nearest to -1? (a) 1/4 (b) 3 (c) 7 (d) 1 a Which is the nearest to 2? (a) 1/7 (b) 143 (c) -8 (d) -2/9 a Which is the nearest to -2/3? (a) 0.4 (b) -4/7 (c) -86 (d) 4 b Which is the closest to -0.5? (a) 4 (b) -3/7 (c) 5 b Which is the nearest to -1/6? (a) 0.4 (b) -54 (c) -3/5 c Which is the closest to -9? (a) 0 (b) -1/5 (c) 2/7 (d) -2 d What is the closest to -1 in -1/11, -2, -0.3, -3? -0.3 Which is the nearest to 1/10? (a) 0.1 (b) 0.12 (c) -1 a Which is the closest to 0.1? (a) 1.63 (b) 0.2 (c) 2 b What is the nearest to 0.31 in -4, -3, 0.04, -1? 0.04 Which is the closest to -5? (a) 5 (b) -2 (c) -23 (d) 4 b Which is the nearest to -0.1? (a) 1629 (b) 3 (c) -0.4 c Which is the nearest to 1.3? (a) -1 (b) -3 (c) 2 (d) -110 c Which is the closest to 3? (a) 17 (b) 0.3 (c) -4 b What is the closest to 0.2 in 2, 7, 3, 3/22? 3/22 What is the nearest to -1 in -0.5, -39, -2, -0.2? -0.5 What is the nearest to 0 in -318, -0.3, -2? -0.3 What is the closest to 7 in -3, -0.2, -0.9, 3? 3 What is the closest to -2/13 in 0.5, -301.2, 1/5, 5? 1/5 What is the nearest to 1/2 in -3/13, -2/9, 0.08, -3/5? 0.08 What is the closest to 3 in -3, -5, -1/10? -1/10 What is the closest to -2 in -5, -0.3, -5/271, 0.4? -0.3 Which is the closest to 11? (a) -4 (b) -3 (c) -2/5 (d) 2 d Which is the nearest to 0? (a) -2/65 (b) 1/4 (c) -0.1 a Which is the nearest to 0? (a) 1165 (b) -3/2 (c) 5 b Which is the nearest to 1? (a) -1/6 (b) -5 (c) 0.07 (d) 1/2 d Which is the closest to -2/7? (a) 1 (b) -13.9 (c) 3 (d) -3 a What is the closest to -2/5 in -710, 3, 0.1? 0.1 What is the nearest to -0.6 in -1, 704, 0? -1 What is the closest to 0 in 9, -256, 2/3? 2/3 What is the nearest to 6 in -0.3, -4/9, -0.2? -0.2 What is the closest to 2/5 in -3/7, -2/5, 116/5? -2/5 Which is the nearest to 30? (a) 0 (b) 1/5 (c) 2/5 c What is the nearest to -4 in 0.009, -4/3, 6? -4/3 Which is the closest to 2.2? (a) -20 (b) -4 (c) -1/5 c Which is the nearest to -1? (a) -1/3 (b) 3/8 (c) -4 (d) 0.4 a What is the nearest to 0.1 in 2, -6, 0, -0.02? 0 Which is the closest to -1/3? (a) 2/7 (b) 2/5 (c) -631 a What is the nearest to -0.3 in -0.5, 0.05, 2? -0.5 What is the closest to -0.1 in 34, 0.5, 0.1? 0.1 Which is the nearest to -5/7? (a) -0.01 (b) -4 (c) 0.4 a Which is the nearest to -5? (a) 0.1 (b) 3/8 (c) 0 (d) 6 c Which is the nearest to -1.77? (a) -1 (b) 1/4 (c) -5 a What is the nearest to -1/5 in 2, 0.4, -1/4? -1/4 What is the closest to 37 in 5, 0, 29? 29 What is the nearest to 1/3 in 0.1, 3/2, -5/7, -0.11? 0.1 Which is the nearest to -1? (a) 117 (b) -1 (c) 0 (d) -3 b Which is the nearest to 0.013? (a) -3/8 (b) 4 (c) 3 a Which is the nearest to -0.03? (a) -3 (b) -3/8 (c) -5 b Which is the closest to -1? (a) 0.1 (b) 0.5 (c) -17/6 a Which is the closest to -0.7? (a) -1/8 (b) 3 (c) -2/63 a Which is the closest to -1? (a) -18/7 (b) -3 (c) -34 (d) -0.5 d What is the nearest to 0 in -3, -0.5, 0.3, -40? 0.3 What is the nearest to 0 in -332, -0.3, -3? -0.3 Which is the nearest to -2/9? (a) -4 (b) -2 (c) 4 (d) -2/21 d What is the nearest to 1 in -3, -18, -0.09? -0.09 What is the nearest to 76 in 1/9, -0.4, 2/15, -0.3? 2/15 What is the nearest to -0.3 in -4, -2, 3, 5? -2 Which is the closest to 0.2? (a) -1/250 (b) 2/11 (c) -3/5 b Which is the closest to 2? (a) 0.1 (b) 1/9 (c) 5 (d) -5/13 b Which is the nearest to -1/4? (a) 308 (b) 0.3 (c) -0.12 c What is the nearest to -414 in 4, -5, -0.1, 1? -5 Which is the closest to -3.258? (a) -3 (b) 0 (c) -0.5 a Which is the closest to -2/11? (a) -1/3 (b) 1 (c) -2/13 c What is the nearest to -39 in 0.1, -0.3, -2/11, 0.3? -0.3 Which is the closest to -3? (a) 5 (b) -4/5 (c) 3/8 b Which is the nearest to -21? (a) 0 (b) -2 (c) 4/7 (d) -0.1 b What is the closest to 1/2 in 19, -1/23, 3? -1/23 What is the nearest to -0.1 in -0.1, -2/15, -5, 1/6? -0.1 What is the nearest to -2/3 in 0, 710/13, 5/3? 0 Which is the nearest to 232.7? (a) 0.4 (b) -4/7 (c) 2 c Which is the closest to 0.1? (a) -3.6 (b) -0.5 (c) -1 b Which is the nearest to -1? (a) 0.07 (b) -1 (c) 4 b Which is the nearest to 0.02? (a) 2/9 (b) -0.13 (c) -5/4 b Which is the nearest to -1/3? (a) -92 (b) 3 (c) -0.01 (d) 3/2 c Which is the nearest to 1? (a) 2.2 (b) 1 (c) 0.1 (d) 5 b Which is the closest to -0.3? (a) -0.3 (b) -0.6 (c) -0.5 a What is the closest to 1 in -1/5, -2/7, -1/4? -1/5 Which is the closest to 10? (a) 2 (b) 3/19 (c) -5 a Which is the closest to -2? (a) -10 (b) 0.3 (c) 189 b Which is the nearest to -0.1? (a) 3 (b) -5 (c) 0 (d) -1/3 c Which is the nearest to -2/3? (a) 183 (b) -2/11 (c) 0.4 (d) -1/6 b What is the nearest to 7/8 in -3/7, -4, 4, 2? 2 Which is the nearest to -1.4? (a) 0.3 (b) 0 (c) 4 (d) -1/3 d What is the closest to -5/14 in 3, 4, 0.5, -1/10? -1/10 What is the closest to 0 in 2/9, -1/7, -0.2, 0? 0 What is the nearest to -2/7 in 0.2, -7, -3, 0.07? 0.07 Which is the closest to -7? (a) -0.4 (b) -1/11 (c) -3 c Which is the closest to 0.1? (a) 1/5 (b) 25 (c) -9 a What is the closest to 1 in -1, 0.5, -2/83, -0.1? 0.5 What is the closest to 2 in -0.3, 0.1, -0.1, -332? 0.1 Which is the nearest to 2? (a) -5 (b) -4 (c) -0.3 (d) -0.5 c Which is the nearest to -0.08? (a) 2/5 (b) -5 (c) 1/4 c Which is the closest to -0.5? (a) -0.3 (b) 1/8 (c) -0.4 c Which is the nearest to -2/9? (a) -0.2 (b) 0.3 (c) 25 (d) -1 a What is the closest to 2/5 in -1, 0.15, 2/15? 0.15 Which is the closest to -1? (a) 0.01 (b) 3 (c) -1/2 (d) -4 c What is the closest to 1 in 4, -1, -26? -1 What is the nearest to 0 in -0.3, 4, -0.12? -0.12 Which is the closest to 1/3? (a) 0.08 (b) 1 (c) 0.09 c Which is the nearest to -0.2? (a) -774 (b) -0.3 (c) 1 (d) -0.05 b Which is the closest to -1? (a) 19.9 (b) -4 (c) -2/3 c Which is the nearest to 1? (a) 1/8 (b) 3 (c) -0.4 (d) 1 d Which is the nearest to 1? (a) 0.2 (b) 0.4 (c) -49 (d) 0 b Which is the closest to -0.15? (a) 5 (b) 1/9 (c) -3 b Which is the closest to -6? (a) 63 (b) -3 (c) -1 b Which is the closest to 0.2? (a) -4/7 (b) -0.7 (c) -2 a What is the closest to -2 in -3, -6/5, 1/4? -6/5 What is the nearest to -1 in -4, -5, 0.6? 0.6 Which is the nearest to -4? (a) -4/3 (b) -2 (c) -30 b Which is the nearest to	{ "pile_set_name": "DM Mathematics" }
lse Which is greater: 0.1 or -1/161? 0.1 Which is smaller: 19 or 110? 19 Is -0.15 smaller than 1/2? True Is 85/7 > 11? True Is 29 >= 25? True Which is smaller: 18 or -1012? -1012 Is 1 > 2/10173? True Are -1/4630 and 1 unequal? True Do 4 and 46/11 have the same value? False Which is smaller: -1/5 or -1/19? -1/5 Is 25103 greater than or equal to 25101? True Which is smaller: -489 or -503? -503 Which is smaller: -556/5 or -112? -112 Which is greater: -0.504 or 8? 8 Which is smaller: 55 or 51? 51 Which is smaller: 4084 or -0.4? -0.4 Which is bigger: -82 or -5? -5 Which is bigger: -4744 or -4745? -4744 Are -172 and -172 non-equal? False Is -5/8933 at most as big as 1? True Is 0 at least as big as 1/13? False Are 1559 and 1558 nonequal? True Is 285/4 > 1/4? True Is -92 equal to -92? True Which is smaller: -1 or 1.3? -1 Which is greater: 0.1 or -1005/4? 0.1 Which is smaller: 0 or -6/53? -6/53 Is 5/51 greater than -1? True Which is smaller: -444/7 or -62? -444/7 Is 734 at most as big as 0.5? False Does 1/1026 = 0? False Is 1 at least 2/26067? True Which is smaller: -505 or -500? -505 Does -1 = 8.816? False Is -56 at least -51? False Are 304/11 and 28 nonequal? True Is -431 less than -430? True Is -111 != -113? True Is -3/2 equal to 19? False Is 3/845 < 1? True Which is smaller: 39 or -8? -8 Is 22/2927 smaller than -1? False Which is bigger: 1 or -45/32? 1 Which is smaller: 17/222 or 1? 17/222 Which is smaller: -122 or -126? -126 Is -790 greater than or equal to -786? False Are 90 and 88 equal? False Is 647 <= 657? True Is 4/91 <= -4? False Which is smaller: 343 or -36? -36 Do -451 and -450 have the same value? False Which is smaller: 56/43 or 1? 1 Is 1 at least -4/183? True Which is smaller: 232 or 230? 230 Is 526 bigger than 524? True Is -0.05 greater than or equal to -775/4? True Which is greater: 12 or 13? 13 Does -1 = -2/11? False Are -2/3 and -13 equal? False Which is bigger: 2902 or 2903? 2903 Do -1 and 2/93 have the same value? False Which is smaller: -20 or -21? -21 Is -0.1 less than 9821? True Do -18552 and -18552 have different values? False Which is bigger: -326/3 or -110? -326/3 Which is greater: 2/3 or 0.022? 2/3 Is -11657 bigger than -11657? False Which is greater: -287 or 3? 3 Which is smaller: -11 or -2/9? -11 Which is smaller: 2373/16 or 148? 148 Is 2/569 less than -1? False Is -421 bigger than -422? True Are 4 and 327/73 non-equal? True Which is smaller: -69 or -65? -69 Are 376 and -9 unequal? True Do 722 and 720 have different values? True Which is smaller: -184 or -194? -194 Which is smaller: -3/112 or -6.1? -6.1 Which is smaller: -0.39 or 3? -0.39 Which is smaller: 53 or 65? 53 Which is smaller: 17/3 or -2/23? -2/23 Which is smaller: 60/17 or -0.9? -0.9 Which is bigger: -93 or -94? -93 Which is bigger: 4091 or 4093? 4093 Do -10/4113 and 1 have the same value? False Is 22 at least as big as 57? False Which is smaller: -142 or -143? -143 Is 0 at most 128? True Is 1 bigger than 4/773? True Is -2/44373 greater than 1? False Is -4419 smaller than -4420? False Is -45 bigger than -43? False Is -1 != 20615? True Which is greater: 46 or 6? 46 Which is bigger: 1/5329 or -1? 1/5329 Which is smaller: -222/7 or -32? -32 Which is smaller: 1390 or 1391? 1390 Which is smaller: 0 or 5/204? 0 Is 11 greater than -5? True Is 1/2128 equal to 1? False Is 289 at most as big as -0.02? False Which is bigger: 9 or -0.006? 9 Which is smaller: -77 or -79? -79 Which is bigger: -1 or -14/19? -14/19 Is -1634 smaller than -1634? False Which is smaller: 7262 or 14525/2? 7262 Is -111 less than or equal to -113? False Which is smaller: -40 or -30? -40 Is 439 != 439? False Is -30 < -398/13? False Are 1/46 and 1/11 equal? False Which is bigger: -33/4 or 0.2? 0.2 Is 6/11 bigger than 0? True Is 6 at most 0.8? False Does 20/3 = -1/15? False Is 190 <= 191? True Which is smaller: -44 or -145? -145 Is -14231 less than or equal to -14231? True Are 0.67 and -18 equal? False Are -2 and 0 non-equal? True Which is smaller: 0.02 or -12/85? -12/85 Is 1990 less than 0.04? False Which is smaller: -441 or -442? -442 Is 1046 greater than or equal to 0.2? True Is 1 at least -2/22471? True Which is smaller: -168/319 or -1? -1 Which is smaller: 0 or -2/12179? -2/12179 Is -54/5 >= -0.1? False Is -1 equal to 2/12741? False Which is greater: 54 or 898/17? 54 Is 0 less than -2/8129? False Which is smaller: 119 or 115? 115 Which is greater: 5 or -2/369? 5 Is -206 at least as big as -172? False Which is smaller: 1 or 51/46? 1 Which is smaller: -6/4201 or 1? -6/4201 Which is greater: 2/33 or 17? 17 Is 112/3 greater than or equal to 36? True Is -1110 > -1110? False Do -0.171 and 8 have the same value? False Is 30 less than 0? False Is -58 equal to 1? False Is 697 greater than -1/2? True Which is smaller: 1 or 6/211? 6/211 Do 2/323 and -1 have different values? True Are 1 and -21/107 equal? False Is -9 less than or equal to 171? True Is 32 less than 433/14? False Is 452/21 greater than 21? True Which is smaller: 12 or 0.21? 0.21 Is -2856 not equal to -2854? True Which is smaller: -1/172 or -3/65? -3/65 Is -3036 at least as big as -3036? True Which is greater: -52/21 or -3? -52/21 Is 21 at least as big as 512/25? True Is -1 at least as big as -11/20? False Are -5860 and -5861 non-equal? True Does -1/15 = -21? False Which is greater: -279 or -281? -279 Does 2/9 = -166? False Which is smaller: 1 or -1/37092? -1/37092 Is 13 <= 295/21? True Are 397 and 402 equal? False Which is greater: -1/23768 or -1? -1/23768 Is -3.3 > 0.3? False Is 2/7 less than or equal to -48.3? False Is 2 at least -91? True Which is smaller: -753 or -755? -755 Which is smaller: -1/5570 or 0? -1/5570 Is 1467 != 4403/3? True Is -1 bigger than -1/843? False Which is smaller: -55 or -59? -59 Is -36/355 less than 0? True Is 8 less than or equal to 0.81? False Which is bigger: -5 or 176? 176 Is 663 at least 663? True Which is greater: 77/117 or 2? 2 Which is smaller: 37/60 or 0.4? 0.4 Is 47 at most 229/5? False Is -20/71 >= 0? False Does -337 = -327? False Which is greater: -3.09 or -12/13? -12/13 Which is smaller: -1394/15 or -92? -1394/15 Which is greater: -336 or -342? -336 Is 652 greater than or equal to 652? True Which is smaller: 321 or 322? 321 Which is greater: 78 or 81? 81 Is 16073 bigger than 16075? False Which is bigger: 14/823 or -1? 14/823 Which is bigger: 1/18 or -6? 1/18 Which is greater: -96/25 or -5? -96/25 Does -2 = 1233? False Are -2 and -281 equal? False Is -1 <= 2.17? True Which is smaller: -17 or -115/7? -17 Which is smaller: 78 or 704/9? 78 Which is greater: 338 or 339? 339 Is -5215/4 >= -1304? True Which is smaller: -1/7 or -17? -17 Which is greater: -13 or -409/29? -13 Which is bigger: -13 or 7/128? 7/128 Which is smaller: -6 or -3? -6 Is 2 at least -38? True Does -2556 = 0.2? False Are 1776 and -2 nonequal? True Which is bigger: 11 or 32? 32 Is 1 less than or equal to -84/205? False Does -122 = -108? False Is 28 at least 2/13? True Is 1 < -6/2597? False Which is greater: -9/2 or 819? 819 Is 10 at most 4? False Which is greater: -41.96 or -0.2? -0.2 Is 1 bigger than -2/142085? True Do 0.1 and -3.54 have the same value? False Is -949 at most -948? True Is -1703 greater than -1703? False Which is smaller: -40/7 or -7? -7 Which is smaller: 7/9 or 0.3? 0.3 Which is smaller: -87 or -3/5? -87 Does -10/41 = 0? False Is -1136 bigger than -11? False Is 625 at most 626? True Which is smaller: -854 or -856? -856 Which is greater: -19509 or -19508? -19508 Is 4/441 >= 0? True Is 3527 equal to 3526? False Which is bigger: -0.07 or 390? 390 Is -39 not equal to -42? True Which is smaller: 0.35 or 16? 0.35 Is -1675 < -1676? False Which is greater: -476 or -468? -468 Do 22 and 41 have the same value? False Which is greater: -29/13 or -1? -1 Is -25 != -9.36? True Which is bigger: 2292 or 2293? 2293 Is 1503 != -0.03? True Which is greater: -165 or -164? -164 Does -7 = -7? True Which is bigger: 3106 or 3107? 3107 Is 10/21 bigger than 7/4? False Are -24 and 3 non-equal? True Which is greater: -0.1 or -4307? -0.1 Which is greater: 307 or -4? 307 Are 225 and 4/7 unequal? True Is -3 at most 268? True Which is bigger: -181 or -190? -181 Which is greater: 4/7 or 10872? 10872 Is 0.7 < -310? False Which is bigger: -194 or -192? -192	{ "pile_set_name": "DM Mathematics" }
t p = -12.6 + 11.6. Which is the second smallest value? (a) 3 (b) -1.6 (c) -0.1 (d) p d Let k = -120 - -118. Which is the smallest value? (a) 11 (b) -6/7 (c) k c Let w be 2/(3/(1 + 2)). Which is the second biggest value? (a) 1 (b) -4 (c) w a Let f = 0.3 - 0.8. Let w be ((-2)/6)/(32/(-36)). What is the second smallest value in 1, w, f? w Let j(r) = 64r - 4. Let k be j(5). Let q = 2208/7 - k. Which is the third smallest value? (a) q (b) 5 (c) 2 b Let t = -2.4 + 2.4. What is the second smallest value in t, 1.3, 4, 1/7? 1/7 Let f = -13.8 - -14. What is the second biggest value in -0.04, -0.5, f? -0.04 Suppose -3 + 11 = -4w + 2p, 3w + 16 = -p. Suppose 4f - 1 + 5 = 0. Which is the smallest value? (a) 1/3 (b) w (c) f b Let j = 2.2 + -5.2. What is the third smallest value in 0.7, j, -3/4? 0.7 Let a = -71/30 + 13/6. Let f = 7/23 + -31/253. Let y be 3 + -1 + 3 + -3. What is the smallest value in a, f, y? a Let s = 0.003 - -0.097. Which is the second smallest value? (a) 3/5 (b) s (c) 1 (d) -5 b Let f = -3.02 + 0.02. Let p = 388 - 198. Let k = -765/4 + p. What is the third biggest value in f, 1, k? f Let m = -2.99 - -3. Let r = 0.31 - m. Let d = -8 - -8.5. Which is the second smallest value? (a) r (b) d (c) -0.1 a Let r = 1 + -1. Let z = -0.1 + r. Let y = -0.1 - -4.1. What is the smallest value in z, y, 2/3? z Let t = -2 - -2.4. Let i be 456/20(-5)/(-2). Let s = i - 173/3. What is the third smallest value in t, s, 1? 1 Let v be (-2)/2 - 18/(-12). Which is the smallest value? (a) -4 (b) v (c) -2 a Suppose 2u - g = g - 4, 6 = -3g. Let h = 0.54 + -0.24. Which is the smallest value? (a) h (b) u (c) 1/3 b Suppose 10 = -b + 7. Suppose 2m = 4c + 10, c = -3m - c - 9. What is the third smallest value in m, 2/15, b? 2/15 Let u = -94.5 - -95. What is the second smallest value in u, -16, -0.4? -0.4 Let n = 34 + -33.9. Which is the second biggest value? (a) 5 (b) n (c) 2/13 c Suppose -5l + 4l - 3 = 0. Let r = l - 0. Let u = -4 + 4.4. Which is the third smallest value? (a) r (b) -1/3 (c) u c Let z be (-18)/84 - 1/(-2). Let g = -3 + -1. Let k = 1 - g. What is the biggest value in k, -5, z? k Let m = -29 + 29.3. What is the third smallest value in -0.4, -0.2, m? m Let b(m) = -m3 + 11m*2 + 2. Let d be b(11). Let s be -1(1/(-3) - 0). What is the biggest value in s, d, -3? d Suppose -4t = 4o - 36, -o - 17 = -t - 4o. Let b = -82 + 412/5. What is the biggest value in b, t, 0.3? t Suppose 4i - 4p + 4 = -24, 4i - 3p + 25 = 0. Let l = -1.05 - -1. Let t = l + 2.05. Which is the third smallest value? (a) i (b) -0.1 (c) t c Let b(a) = -6a + 4. Let l be b(0). What is the second biggest value in 8, 6, l? 6 Suppose -4x = 3 + 5. Which is the second smallest value? (a) -3 (b) x (c) -1 b Let u = -22 + 16. Let y be (-9)/68/(-3). What is the biggest value in u, y, -4? y Let v = 108 + 30. Let w = 31 - v. Let q = 853/8 + w. Which is the third biggest value? (a) q (b) 1/6 (c) 4 a Let a = -1 + 4. Suppose 4d = -aw + 30, -w = -0w - 2d. Let m be w(2/(-6) - -1). What is the second biggest value in -1, m, -0.3? -0.3 Let i = 0 + -1. Let q = -10 + 19.5. Let o = -9 + q. Which is the second biggest value? (a) 5 (b) i (c) o c Let m be 0 + (-4 - -2) + 7. Suppose -4d = a + 5, 3a - 4a + 4 = -md. What is the second smallest value in -4/7, -4, a? a Let p = 159/4 + -40. What is the biggest value in p, 2, -5, 2/11? 2 Let h(j) = -j2 + 6j - 1. Let k be h(6). Let o = 20 - 9. Let y = o + -8. Which is the biggest value? (a) y (b) k (c) -0.1 a Let v = 79/185 + -1/37. What is the smallest value in v, 0.1, 3/8? 0.1 Let c(t) = -t*2 - 4t + 1. Let x be (4 - -2)/(-2) - 1. Let z be c(x). Let o = -2.04 + 0.04. What is the second biggest value in o, z, -3/4? -3/4 Let w = -0.2 - -0.23. Let x = w + -0.33. Let s = -1 + 1.4. What is the smallest value in s, x, -2/7? x Let f = -17 + 14. Let h = -8 - f. Which is the third biggest value? (a) 4 (b) 2 (c) h c Let w(u) = u*3 + 5u*2 - u - 4. Let j be w(-5). Let o be 1/5(0 - j). Let x = -0.06 - 0.34. What is the third biggest value in o, 1/2, x? x Let h = -11 - -11.3. Which is the third biggest value? (a) -2 (b) h (c) -0.7 a Let d = 19 + -18.1. Let x = 1 - d. Let w = -3 + -2. What is the third smallest value in -2/9, x, w? x Suppose 2z = h - 3z - 23, -3z = 12. Which is the second biggest value? (a) -5 (b) 2 (c) 5 (d) h d Let z = 556/91 + -72/13. Let b = 4 - 4.4. What is the second smallest value in b, z, -0.5? b Let j be (-1)/(-3)3/(-7). Let l = 1.1 + -1. Let h = -0.4 - l. What is the third biggest value in h, j, -2? -2 Let u = -0.05 - 1.95. Let h = -0.14 - -1.94. Let x = 2 - h. Which is the second biggest value? (a) 0 (b) u (c) x a Let r = -6.3 - -1.3. Let l = 248 + -2234/9. Let v = 17/36 + l. Which is the third smallest value? (a) r (b) v (c) 5 c Suppose 0 = 2s + 23 - 7. Which is the smallest value? (a) s (b) 1 (c) 2 a Let c = 0.2 + -0.6. Let q = 1.4 - 5. Let i = 0.6 + q. What is the second smallest value in 0.2, i, c? c Let t = 21 - 21.3. Suppose -4d + 0d + 1 = o, -3o - 2d + 13 = 0. Which is the second smallest value? (a) o (b) t (c) 2/9 c Let g = -1 + 0.8. Let f be (-4)/(-14) - (-9)/42. What is the second smallest value in -0.1, g, f? -0.1 Let l = 0 - -3. Let x = -5 + 6. Let r be (-1 - (-3)/18)1. What is the biggest value in l, r, x? l Let h be (1/3)/(33/(-18)). What is the biggest value in h, 0.4, 4, 0.2? 4 Let u be ((-2)/(-4) - 1)-10. Let d = 2 - u. Let s be 8(10/4 + d). Which is the third biggest value? (a) -0.5 (b) 1/3 (c) s c Suppose -89 = -4l - 9. Suppose j - 5q - 15 = 3j, 2j - 2q - l = 0. Which is the third smallest value? (a) -5 (b) 0.3 (c) j c Let k = 2.2 - 2. Suppose -f = 3d - 0f + 5, -5d = f + 5. Suppose 2q - 7q + 5 = d. Which is the smallest value? (a) 4 (b) q (c) k c Let z = 61 - 61.1. What is the fourth smallest value in -1, -4, z, -2/7? z Let d be (-74)/(-4) + (-4)/(-12). Let l = d - 1255/66. What is the third biggest value in l, 1, -0.3? -0.3 Let s = 11 - 14. What is the smallest value in 2, 0.3, s? s Let c = 122.94 - 121. Let r = c - -0.06. Let u = 0.2 - 0.3. What is the biggest value in -0.4, r, u? r Let w be ((-4)/5)/((-32)/(-80)). Which is the third smallest value? (a) 5 (b) -0.7 (c) w a Let f = -51 + 49. What is the biggest value in f, -0.1, 11/6? 11/6 Let x = 0.23 + -0.01. Let i = -0.23 + x. What is the third smallest value in i, 1, 4/7? 1 Let s = -8259/23 - -359. Which is the third smallest value? (a) -0.17 (b) s (c) -4 b Let z = 4.6 + -9.6. What is the smallest value in -4, -2, 3, z? z Let y = 0.026 - 0.426. What is the third biggest value in 1, y, -0.3, -0.1? -0.3 Let r = 113 + -113.2. Which is the biggest value? (a) -20 (b) 2 (c) r b Let k = -9.3 - -9. Let n = 3.04 - 0.04. Let o = 3 - n. What is the third biggest value in -3, o, k? -3 Let d = 43 - 46. Let n = -3 - -1. Let g = -0.1 - 0.1. What is the smallest value in n, d, g? d Let l = -57/4 + 14. Which is the second smallest value? (a) -0.1 (b) l (c) -5 b Let q(r) = r2 - 8r - 4. Let i be q(8). Let d be 8/i - 0/(-1). What is the third smallest value in d, -5, 0? 0 Suppose -5n + 2n + 23 = 4l, 2l = -n + 9. Suppose -3i + v = -l, 2i - 3i = 2v - 10. What is the second biggest value in 5, -1, i? i Let w = 26 - 9. Let n = 21 - w. What is the third smallest value in n, -5, 1/7? n Let j = -0.34 - -0.04. Let y = -0.14 - -0.1. Let w = y - 0.36. Which is the biggest value? (a) w (b) 0 (c) j b Let z = 0.4 - 0.9. Let u = z - 0. Let p = u + -0.5. What is the second biggest value in -2/3, p, 5? -2/3 Let b = 2.6 + 1.4. Let w be (2/1)/2 + 2. What is the second biggest value in -3, w, b? w Let q = 163/5 + -33. Suppose -h + 31 + 16 = -5a, 4a = 2*h - 70. Let w = 53/2 - h. What is the second biggest value in w, q, -2/19? q Let u = 1.8 + 4.2. Let a = -45.6 - -52. Let c = a - u. What is the third biggest value in 2, c, -3/4? -3/4 Let k = -6.7 + 7. What is the third biggest value in k, -0.3, -0.1? -0.3 Let h be 3574/3528 - 9/12. Let q = -2/49 + h. What is the biggest value in -0.5, -4, q? q Let h = 0.52 - -0.48. What is the smallest value in -4, -0.2, h? -4 Let x = -0.7 + 4.2. Let v = 3 - x. Let f = -2 + 3. What is the third biggest value in f, 0, v? v	{ "pile_set_name": "DM Mathematics" }
illilitres? 875 How many nanograms are there in 15/4 of a microgram? 3750 What is 8.860583cm in nanometers? 88605830 How many nanograms are there in 5/8 of a microgram? 625 How many years are there in eighty-one halves of a millennium? 40500 What is 3/10 of a minute in milliseconds? 18000 Convert 6463.44 tonnes to nanograms. 6463440000000000000 How many decades are there in 23.34115 years? 2.334115 What is three fifths of a litre in millilitres? 600 What is six fifths of a litre in millilitres? 1200 What is 972293.1 kilograms in milligrams? 972293100000 How many millilitres are there in fourty-five halves of a litre? 22500 How many days are there in 26.0779392us? 0.000000000301828 How many months are there in 3/10 of a millennium? 3600 How many micrometers are there in 5/8 of a millimeter? 625 What is six fifths of a micrometer in nanometers? 1200 How many millilitres are there in eleven eighths of a litre? 1375 How many meters are there in 3/8 of a kilometer? 375 How many litres are there in 0.9421413 millilitres? 0.0009421413 How many meters are there in 6/25 of a kilometer? 240 What is 125.0594 micrometers in centimeters? 0.01250594 How many meters are there in three tenths of a kilometer? 300 How many millilitres are there in 55/2 of a litre? 27500 How many months are there in 10/3 of a millennium? 40000 Convert 6287.525 millilitres to litres. 6.287525 What is 3/5 of a meter in millimeters? 600 Convert 0.1769049 decades to years. 1.769049 What is 0.8585819ms in microseconds? 858.5819 What is 1/10 of a microgram in nanograms? 100 What is 190.0911 milligrams in kilograms? 0.0001900911 What is 4.073867 years in centuries? 0.04073867 How many years are there in 667.7669 centuries? 66776.69 Convert 17.283066s to minutes. 0.2880511 What is 1.595362 minutes in milliseconds? 95721.72 What is 44.09273 days in nanoseconds? 3809611872000000 What is 61/2 of a decade in years? 305 How many months are there in fifty-five halves of a year? 330 Convert 972.3759 days to hours. 23337.0216 What is 0.7815772 decades in years? 7.815772 What is 152030.4 minutes in hours? 2533.84 Convert 93.82576 grams to tonnes. 0.00009382576 Convert 5611.595m to nanometers. 5611595000000 What is 0.3249365 days in milliseconds? 28074513.6 How many millilitres are there in one tenth of a litre? 100 What is 83.3803 millilitres in litres? 0.0833803 Convert 3.017994 micrometers to nanometers. 3017.994 What is 74.9592 nanoseconds in milliseconds? 0.0000749592 What is 934.7325 millilitres in litres? 0.9347325 What is 21610.68 millennia in years? 21610680 What is 327.9304 nanograms in kilograms? 0.0000000003279304 How many nanometers are there in 1/10 of a millimeter? 100000 What is 1879.999 nanometers in kilometers? 0.000000001879999 How many kilograms are there in 29/2 of a tonne? 14500 How many years are there in 19474.938 months? 1622.9115 What is 72/5 of a milligram in micrograms? 14400 How many nanograms are there in 592.7663g? 592766300000 How many millilitres are there in one quarter of a litre? 250 What is 803.996ml in litres? 0.803996 What is five eighths of a litre in millilitres? 625 How many grams are there in 7129.044ng? 0.000007129044 What is 43464.9l in millilitres? 43464900 What is twenty-five halves of a milligram in micrograms? 12500 How many centimeters are there in 29/5 of a meter? 580 What is 2270.164 centuries in decades? 22701.64 How many millilitres are there in thirteen quarters of a litre? 3250 What is 84669.67 micrograms in nanograms? 84669670 What is 7.478454nm in millimeters? 0.000007478454 How many months are there in 7/3 of a century? 2800 What is 2/15 of a hour in seconds? 480 Convert 0.4007685 millilitres to litres. 0.0004007685 What is 45/8 of a gram in milligrams? 5625 How many decades are there in twenty-seven fifths of a millennium? 540 What is three eighths of a millennium in months? 4500 What is 3.525041ug in milligrams? 0.003525041 What is 49.71411nm in centimeters? 0.000004971411 Convert 3.38549 decades to millennia. 0.0338549 How many kilograms are there in 32617.06 tonnes? 32617060 Convert 0.5885974mg to kilograms. 0.0000005885974 How many micrometers are there in fifty-five quarters of a millimeter? 13750 How many minutes are there in twenty-nine thirds of a day? 13920 How many millilitres are there in 5/8 of a litre? 625 What is 197394.3m in nanometers? 197394300000000 How many nanometers are there in 0.8338571 millimeters? 833857.1 How many months are there in one quarter of a millennium? 3000 What is 16355.57 kilometers in micrometers? 16355570000000 What is 11/2 of a kilogram in grams? 5500 What is 18/5 of a litre in millilitres? 3600 What is 5/4 of a millimeter in micrometers? 1250 What is thirty-two fifths of a centimeter in micrometers? 64000 What is thirty-two fifths of a micrometer in nanometers? 6400 Convert 91696.47l to millilitres. 91696470 What is 11/4 of a millennium in years? 2750 How many nanograms are there in six fifths of a microgram? 1200 What is 7797.297 microseconds in milliseconds? 7.797297 Convert 334.5971l to millilitres. 334597.1 What is 587535.4ml in litres? 587.5354 How many years are there in 7/4 of a century? 175 Convert 616531.2km to centimeters. 61653120000 What is one sixth of a millennium in months? 2000 What is three tenths of a litre in millilitres? 300 Convert 1.476025 years to centuries. 0.01476025 What is seven halves of a centimeter in millimeters? 35 How many months are there in four thirds of a year? 16 How many millilitres are there in 24218.39l? 24218390 What is 1/5 of a century in years? 20 What is 1/6 of a minute in milliseconds? 10000 Convert 2.484773 millilitres to litres. 0.002484773 What is 11/10 of a century in decades? 11 What is thirteen ninths of a hour in seconds? 5200 What is 7/15 of a century in months? 560 How many micrograms are there in nineteen quarters of a milligram? 4750 Convert 41367.05 grams to tonnes. 0.04136705 How many years are there in 1.4793177 months? 0.123276475 How many millilitres are there in three fifths of a litre? 600 How many years are there in 0.5510684 decades? 5.510684 What is 47/4 of a meter in millimeters? 11750 How many seconds are there in 7/4 of a minute? 105 What is 3/8 of a millimeter in micrometers? 375 What is 72.033282 minutes in days? 0.0500231125 What is 17/2 of a centimeter in micrometers? 85000 What is 12/25 of a kilometer in centimeters? 48000 How many decades are there in 631.272 months? 5.2606 Convert 888860.9 grams to nanograms. 888860900000000 Convert 506764.3 millilitres to litres. 506.7643 What is 16.71842 milligrams in nanograms? 16718420 Convert 48.43627 decades to centuries. 4.843627 How many centuries are there in 0.4653357 months? 0.00038777975 Convert 7.911401 millilitres to litres. 0.007911401 What is 366.9029g in kilograms? 0.3669029 How many years are there in 1/5 of a decade? 2 How many millilitres are there in twenty-six fifths of a litre? 5200 Convert 0.8934682 millilitres to litres. 0.0008934682 How many days are there in 49251.357 minutes? 34.20233125 What is 22838.61ml in litres? 22.83861 What is 112832.3952ms in weeks? 0.0001865615 Convert 0.667018ml to litres. 0.000667018 What is eight thirds of a century in months? 3200 How many months are there in five quarters of a century? 1500 Convert 0.7551888 litres to millilitres. 755.1888 How many meters are there in 20303.38 centimeters? 203.0338 What is thirty-one fifths of a milligram in micrograms? 6200 How many grams are there in 29/2 of a kilogram? 14500 What is 66.57008nm in meters? 0.00000006657008 What is 9.702915 hours in microseconds? 34930494000 How many hours are there in 91760.9 weeks? 15415831.2 What is 3/7 of a week in minutes? 4320 How many millimeters are there in 0.5172753km? 517275.3 What is three fifths of a century in years? 60 How many millilitres are there in 17/2 of a litre? 8500 How many nanograms are there in eleven quarters of a microgram? 2750 How many minutes are there in one twentieth of a hour? 3 What is 3/50 of a litre in millilitres? 60 How many seconds are there in 86803.25 hours? 312491700 How many millilitres are there in 57/5 of a litre? 11400 How many minutes are there in 71/5 of a day? 20448 Convert 586.0242 centimeters to nanometers.	{ "pile_set_name": "DM Mathematics" }
91/46683) Simplify ((pp/(p(pp1)/p)p)1)48 assuming p is positive. p48 Simplify j(-2/13)/j(1/4) assuming j is positive. j(-21/52) Simplify ((a/(a*(4/5)aaa))/a11)30 assuming a is positive. a(-414) Simplify (y(2/3))*(11/2)/((yy*(3/4)y)/(y/((y*(-3/5)y)/y))) assuming y is positive. y*(151/60) Simplify h((h/h*(-5))/h)/hhh/(hh/(h/(h/(hh(-7))))) assuming h is positive. 1/h Simplify l(-3/5)/l7l*8/(ll(l(l(-1)/l)/l)/l) assuming l is positive. l(7/5) Simplify (z(-2/11))33 assuming z is positive. z(-6) Simplify q(1/7)/(q((q/q(3/4))/qq)/q)(qq(-1))(-35) assuming q is positive. q(-3/28) Simplify c(-1/4)cc6 assuming c is positive. c(27/4) Simplify (v(-6/7)/v)(-27) assuming v is positive. v(351/7) Simplify (s0s)(-10/9) assuming s is positive. s(-10/9) Simplify ((g/((g/g(-1/4))/g))0)(-5/13) assuming g is positive. 1 Simplify ((pp/((p/p*1p)/p))/p)/pp(-1/2)p*(-8)pp/(p0p) assuming p is positive. p(-15/2) Simplify (k(-2)k)(-25) assuming k is positive. k25 Simplify ((f/((f0/f)/f))/f)(2/27)/((f/f(-3/8))/ff(2/7)) assuming f is positive. f(-775/1512) Simplify (m/m*2)/mm/(m/m*(-3/2))(m*(-2/7)/mmm)/m(-4) assuming m is positive. m(17/14) Simplify ((m/m(6/5))/m(-12))(-2/167) assuming m is positive. m(-118/835) Simplify ((f/(f/(f(1/2)ffff)f))/f)*(1/4)f*(-7)/ff/(ff(-2/3)/f) assuming f is positive. f(-137/24) Simplify ((m(-1/3))(-44))(-6/13) assuming m is positive. m(-88/13) Simplify ((sss/s2)/(s/(s(1/2)s)s))/(ss/(sss*(-3/2)s)ss(2/3)/s) assuming s is positive. s(-2/3) Simplify ss(-3/5)(s(s(-1/3)/s)/s)/s(ss0/s)/s(-6/7) assuming s is positive. s(-113/105) Simplify t10t7 assuming t is positive. t17 Simplify ((l*(-24)l)/l)(2/57) assuming l is positive. l(-16/19) Simplify ((rr/r(2/3))/r)(2/61)/(r(1/3)r)(2/53) assuming r is positive. r(-382/9699) Simplify (d/(dd(-14)dd)d)/d(-48) assuming d is positive. d61 Simplify qq((q/q*(-1/4))/qq)/qq(-5) assuming q is positive. q(-11/4) Simplify (n(-15))16 assuming n is positive. n(-240) Simplify (t0/(tt(-1)))/(t(3/5)/(t/t1)) assuming t is positive. t(-3/5) Simplify (l(4/11))(-8) assuming l is positive. l(-32/11) Simplify (r(-1)rr)17/((r/r1r)/(rr/r*(2/9)r)) assuming r is positive. r*(169/9) Simplify (((u(u*(-3/5)/u)/u)/u)/u)/((uu/(uu(1/7)u)u)/u)(uu(u(uu(2/7))/u)/u)(-50) assuming u is positive. u(-4121/35) Simplify (o/o(-1)oo)*(4/7)(ooo(-3/4))/o(-1) assuming o is positive. o*(127/28) Simplify (ii/(i(ii*(-26)i)/i))/((ii(-19)/ii)/i) assuming i is positive. i45 Simplify x/x1x/(xx/x*(-6))(x*0x)14 assuming x is positive. x7 Simplify (ll7l)/l0 assuming l is positive. l9 Simplify (((c/(c2/c))/c)(3/40))19 assuming c is positive. c(-57/40) Simplify (r/(rr(-1/6)/r)rr)(-23/4) assuming r is positive. r(-437/24) Simplify (u(1/4)uuuu(-2/5))/(u(-2/3))(2/7) assuming u is positive. u(1277/420) Simplify (n/(n/(n/((nnnn*(8/3))/n))n)nn)(2/5) assuming n is positive. n(-16/15) Simplify (w/w*(-3/7)w)/w39 assuming w is positive. w(-256/7) Simplify s*5/ss/(s/((ss6/ss)/s))ss*(-1/14)s/s*(-3/7)s assuming s is positive. s*(187/14) Simplify (ll/l*(-1/2)l)(-5/4)/((l(5/7)/l)/l(l/l(-1/4))/ll) assuming l is positive. l*(-243/56) Simplify (f/(f/(ff/(f/f(-1)))))(-5/7)((fff0ff)/f)(-28/5) assuming f is positive. f(-84/5) Simplify w(-7/5)w*(-3/11)ww assuming w is positive. w(18/55) Simplify oo*(-1/3)o*(1/6)o*(-1/4)o/o*(4/3)o assuming o is positive. o(5/4) Simplify ((k/k2)/k)/kk(-1/4)(kk0k)33 assuming k is positive. k(251/4) Simplify q/(q/(qq(-7)q))q/(qq*(-2/5)q)(q(-2/3))(2/33) assuming q is positive. q(-2792/495) Simplify (mm*25)/((mmm(-28)mmm)/m) assuming m is positive. m50 Simplify o/o11o(-8)o*(-5/3)oo/((o(-1)/ooo)/o)o assuming o is positive. o(-47/3) Simplify z(-6)z(6/5)z assuming z is positive. z*(-19/5) Simplify (o/(o(oo/(o/(o(-18)/oo)))/o)oooo)/o(2/37) assuming o is positive. o(812/37) Simplify ((w/((w*(-5)w)/w))/(w/w2))/(w2/w3) assuming w is positive. w8 Simplify z(1/16)/(z/z(4/7)) assuming z is positive. z(-41/112) Simplify (h15hh*(-1/3)h)(-5) assuming h is positive. h(-250/3) Simplify o(-5/6)/o(-3/2)(o4o)/o(-3) assuming o is positive. o(26/3) Simplify ((k/k*3k)/((k/(kk(-1/3))k)/kkk))(-24/11) assuming k is positive. k(80/11) Simplify (((a*(3/11)/a)/a)/aaaa*(-3)a)/((a/a1)/a)28 assuming a is positive. a*(278/11) Simplify (o/(o(o*1ooo)/o))*(-1/5)o(oo*(1/15)/o)/oo(-4)/o assuming o is positive. o(-13/3) Simplify (n*(-1)n)/nn(2/65) assuming n is positive. n(-63/65) Simplify (rrr(-6))/((r/((r/((r/(r/(r/(r/r(-13)))))/r))/r)r)/rr) assuming r is positive. r8 Simplify (dd1/d)(-22/7)/(d*2/dd)(-2/63) assuming d is positive. d(-194/63) Simplify pp(p(p2p)/p)/ppp*(-2/3)p*(-4)pp(1/2) assuming p is positive. p(11/6) Simplify (k(1/2)(k/k(-4))/k)/(k(-1)/(kk(-2/5))) assuming k is positive. k(61/10) Simplify s/(s(-2/31)s)(ssss*(-21))/ss assuming s is positive. s(-556/31) Simplify (r2r(3/5))/(((r(-3/13)/r)/r)/(r5r)) assuming r is positive. r(704/65) Simplify (q(-1)/(q*(-1/4)q))(-10/19) assuming q is positive. q(35/38) Simplify (jj(jj(-3/7))/jjj14)26 assuming j is positive. j(3016/7) Simplify (xx*(-16)x)/x37 assuming x is positive. x(-51) Simplify (u(-1)/u(-2/5))/(u(2/3)/u(-10)) assuming u is positive. u(-169/15) Simplify s(1/5)s/((s/s(-2/5))/s)(s/(s/(s/(s/(s(ss(2/3))/s)))))(-5/12) assuming s is positive. s(19/180) Simplify r2/(r*(-2/13)r)r(-2/5)/(r7/r) assuming r is positive. r(-341/65) Simplify (p(-2/27)p*(-4)p)20 assuming p is positive. p(-1660/27) Simplify (m(-7/4)/m(-1/7))/((m*0/m)/(mm/m*(-4)m)) assuming m is positive. m(179/28) Simplify ((o/o(-1))/oo)(1/10)/((oo(3/4)/o)/o(-1/8)) assuming o is positive. o(-27/40) Simplify (p(-10))(1/21) assuming p is positive. p(-10/21) Simplify (qq19/q)/(qq(13/3)/q) assuming q is positive. q(44/3) Simplify ((g*(2/27)g)/(g*(-3)g))/(g*(-1)gg3) assuming g is positive. g(2/27) Simplify (qqq/q1)(-5/9)q*(2/3)qq5qq assuming q is positive. q(68/9) Simplify (z7/(z/z(3/2)))25 assuming z is positive. z(375/2) Simplify (w0)(-39)/(www(1/2)/ww)(-38) assuming w is positive. w95 Simplify (uu(-18))/u(-3) assuming u is positive. u(-14) Simplify ((p/p3)(-10/17))(-47) assuming p is positive. p(-940/17) Simplify (m/(mmmm(m/(m/(mm*(-1/2)m)))/mmmm))(1/46) assuming m is positive. m(-13/92) Simplify f/(ff/((((f/(f/(f/f*(-7)))f)/f)/f)/f)f)f3 assuming f is positive. f7 Simplify q*(6/5)q(-8) assuming q is positive. q(-34/5) Simplify ((y/(yy(-16)/yyy)y)/y)(-35) assuming y is positive. y(-525) Simplify k22/((k/k(-20/7)k)/k) assuming k is positive. k(127/7) Simplify y9/yy(y(-10)y)/y(y/(y(2/3)/y)y)28 assuming y is positive. y(193/3) Simplify r*(-7)rrr/(r/r*(-6))(rr(-2/3))(-1/12) assuming r is positive. r(-397/36) Simplify (x/x(-7))(1/43) assuming x is positive. x(8/43) Simplify www/(ww/w*(-2))www(-1/12) assuming w is positive. w(11/12) Simplify (oo(-1))17/(o(1/4))(-3/4) assuming o is positive. o(3/16) Simplify (n/n(3/8))(19/4) assuming n is positive. n(95/32) Simplify (b7)(-24) assuming b is positive. b(-168) Simplify (((u(uu(u*8/u)/u)/u)/uu)/u)(-3/4) assuming u is positive. u(-21/4) Simplify (b(-1))23/(bb6bbbb(2/7)bb) assuming b is positive. b(-247/7) Simplify (t/((ttt/(t/(t/t(5/9))t)t)/t))/t(-1/28) assuming t is positive. t(-103/252) Simplify ((p/((ppp/p(2/3)p)/pp)p)/p)*16(p*(-1)p)(-3/5) assuming p is positive. p(-112/3) Simplify ((k/k(-2/3))10)**(-41) assuming k is po	{ "pile_set_name": "DM Mathematics" }
ked without replacement from lls. What is prob of picking 2 l? 1/3 Calculate prob of picking 2 r and 2 x when four letters picked without replacement from {x: 3, r: 5}. 3/7 What is prob of picking 2 x and 1 i when three letters picked without replacement from {z: 2, i: 1, a: 1, x: 4, l: 7}? 6/455 Calculate prob of picking 2 p and 1 m when three letters picked without replacement from pcupmpcupcpuvccv. 1/56 Three letters picked without replacement from {x: 7, k: 4, g: 4}. Give prob of picking 1 x, 1 g, and 1 k. 16/65 What is prob of picking 4 e when four letters picked without replacement from bebeeebsbe? 1/42 What is prob of picking 3 t and 1 l when four letters picked without replacement from llttllttttltt? 56/143 Two letters picked without replacement from alvvv. Give prob of picking 1 l and 1 v. 3/10 Three letters picked without replacement from {k: 1, r: 3, g: 1, j: 2, z: 1, p: 4}. What is prob of picking 1 p, 1 g, and 1 j? 2/55 What is prob of picking 1 i and 2 h when three letters picked without replacement from mihihihhhhihmhhh? 9/28 Calculate prob of picking 1 s, 1 k, 1 y, and 1 p when four letters picked without replacement from {z: 9, k: 1, s: 1, p: 4, y: 2}. 2/595 Calculate prob of picking 1 l and 1 e when two letters picked without replacement from bleeeeebeeebeeeblbe. 8/57 Two letters picked without replacement from {i: 2, j: 1, c: 2, y: 2, d: 1}. What is prob of picking 2 c? 1/28 What is prob of picking 2 a and 1 q when three letters picked without replacement from qaaaaqaaaaqaqqtaqaq? 385/969 Three letters picked without replacement from enmzbej. What is prob of picking 1 b, 1 z, and 1 n? 1/35 What is prob of picking 1 f and 1 x when two letters picked without replacement from {f: 1, q: 1, x: 2, v: 2, c: 1}? 2/21 What is prob of picking 1 j and 1 k when two letters picked without replacement from {k: 4, v: 2, j: 1, h: 2}? 1/9 What is prob of picking 3 d when three letters picked without replacement from fdfdffdfff? 1/120 Two letters picked without replacement from rtr. Give prob of picking 2 r. 1/3 Four letters picked without replacement from {f: 3, h: 6, q: 8}. Give prob of picking 4 q. 1/34 What is prob of picking 1 e and 1 m when two letters picked without replacement from mmfffeommemme? 3/13 Calculate prob of picking 1 x and 1 t when two letters picked without replacement from {i: 5, a: 3, x: 3, q: 1, t: 1}. 1/26 Two letters picked without replacement from jmmmmmmmmmmjmmmmmmjm. What is prob of picking 1 m and 1 j? 51/190 Two letters picked without replacement from ppppp. Give prob of picking 2 p. 1 Two letters picked without replacement from rbrbbrbbdbdbrdbb. What is prob of picking 2 r? 1/20 Two letters picked without replacement from ypzppngpypyzpgpy. Give prob of picking 1 g and 1 y. 1/15 What is prob of picking 1 e, 1 d, 1 m, and 1 v when four letters picked without replacement from {e: 4, m: 1, d: 1, a: 1, v: 4}? 8/165 Four letters picked without replacement from iiiiiiiiii. Give prob of picking 4 i. 1 Calculate prob of picking 4 v when four letters picked without replacement from vvuvvvvvvvuvvvvvvvvv. 12/19 Calculate prob of picking 1 o, 1 s, and 1 g when three letters picked without replacement from {p: 1, r: 1, s: 2, o: 2, g: 1, k: 1}. 1/14 What is prob of picking 2 p and 2 m when four letters picked without replacement from mpmpmpmm? 3/7 What is prob of picking 1 g, 1 k, and 2 c when four letters picked without replacement from kckstcctggck? 4/55 Two letters picked without replacement from obbobbboovvbbb. What is prob of picking 1 v and 1 o? 8/91 Three letters picked without replacement from dddttdddddd. What is prob of picking 1 t and 2 d? 24/55 Calculate prob of picking 3 m when three letters picked without replacement from {s: 9, m: 10}. 40/323 What is prob of picking 2 s when two letters picked without replacement from {u: 2, f: 1, s: 5, w: 8}? 1/12 Two letters picked without replacement from {k: 4, m: 2}. Give prob of picking 1 m and 1 k. 8/15 Calculate prob of picking 1 y, 1 e, and 1 u when three letters picked without replacement from eyeynyueyyyeeyeeyye. 24/323 Calculate prob of picking 4 v when four letters picked without replacement from vvvivvvv. 1/2 Calculate prob of picking 1 z, 1 b, and 1 f when three letters picked without replacement from xabzxfaafxbafffffx. 7/408 Three letters picked without replacement from yyyyyyyyccjyq. What is prob of picking 1 q and 2 c? 1/286 Two letters picked without replacement from {d: 11, y: 1}. Give prob of picking 2 d. 5/6 What is prob of picking 1 r and 3 x when four letters picked without replacement from xrrrrrrxxrxrrr? 40/1001 Three letters picked without replacement from kkkklbbkblblrkku. Give prob of picking 1 r, 1 k, and 1 b. 1/20 Four letters picked without replacement from jnnnjttnjjjnjjnnnj. What is prob of picking 2 n and 2 j? 196/765 Two letters picked without replacement from mcdvm. Give prob of picking 2 m. 1/10 What is prob of picking 2 u and 1 g when three letters picked without replacement from uguu? 3/4 What is prob of picking 3 k when three letters picked without replacement from kksksk? 1/5 Three letters picked without replacement from ngnugngguln. Give prob of picking 1 u and 2 n. 4/55 Two letters picked without replacement from {p: 1, r: 6, h: 7, q: 1}. Give prob of picking 2 h. 1/5 What is prob of picking 3 j when three letters picked without replacement from ejmmyjjyjjjymyjjyj? 7/68 Two letters picked without replacement from xrpupxpnppxruup. Give prob of picking 1 r and 1 u. 2/35 Two letters picked without replacement from djjdjjjjddjjdj. What is prob of picking 2 j? 36/91 Three letters picked without replacement from utggu. Give prob of picking 1 g, 1 u, and 1 t. 2/5 Two letters picked without replacement from qynyssnnsysdqnysd. What is prob of picking 1 s and 1 d? 5/68 What is prob of picking 1 m and 1 e when two letters picked without replacement from {m: 2, l: 1, y: 1, e: 1, p: 1, r: 1}? 2/21 What is prob of picking 2 q when two letters picked without replacement from qpjooq? 1/15 Three letters picked without replacement from sskpfccfccspspcs. What is prob of picking 2 p and 1 c? 3/112 Four letters picked without replacement from {g: 5, a: 5, e: 2, y: 1, d: 1, z: 1}. What is prob of picking 1 y, 1 z, and 2 a? 2/273 Calculate prob of picking 1 s, 1 c, and 1 b when three letters picked without replacement from cesepczbbceeece. 8/455 Two letters picked without replacement from {f: 2, m: 3, u: 1, w: 9, n: 3, c: 2}. Give prob of picking 1 w and 1 c. 9/95 Two letters picked without replacement from mwmmwmmwmmm. What is prob of picking 2 m? 28/55 Two letters picked without replacement from {z: 17, p: 3}. What is prob of picking 2 z? 68/95 Two letters picked without replacement from {x: 1, k: 2, g: 5, f: 1, i: 1, a: 10}. Give prob of picking 1 i and 1 x. 1/190 Two letters picked without replacement from nxxnnxxnnnnnnnnnnn. What is prob of picking 1 n and 1 x? 56/153 What is prob of picking 1 o and 2 i when three letters picked without replacement from {m: 2, y: 2, o: 3, s: 10, i: 3}? 3/380 Two letters picked without replacement from ztizztbz. Give prob of picking 1 t and 1 i. 1/14 Two letters picked without replacement from {x: 2, t: 2, p: 1, l: 1, d: 5, w: 2}. Give prob of picking 1 w and 1 l. 1/39 What is prob of picking 1 j and 2 d when three letters picked without replacement from {d: 7, j: 7}? 21/52 What is prob of picking 1 s and 1 k when two letters picked without replacement from ppspsspkppkpsk? 12/91 Calculate prob of picking 1 b, 1 x, and 1 m when three letters picked without replacement from xnmbmmxnnyxmbmm. 36/455 Four letters picked without replacement from {n: 3, s: 1, h: 6, g: 2, u: 1}. What is prob of picking 2 n, 1 g, and 1 s? 6/715 Four letters picked without replacement from nqnqqn. Give prob of picking 1 n and 3 q. 1/5 Calculate prob of picking 1 e and 1 m when two letters picked without replacement from qjmyjwe. 1/21 Calculate prob of picking 2 n and 1 c when three letters picked without replacement from njbnfnnffjcfxx. 3/182 What is prob of picking 2 n and 2 t when four letters picked without replacement from {t: 2, a: 13, n: 3}? 1/1020 Two letters picked without replacement from hqwwhufhhhwh. What is prob of picking 1 h a	{ "pile_set_name": "DM Mathematics" }
rt w. -1200w3 + 24w Let g(m) be the first derivative of -m*6/3 + 3m*4/4 - 3m*3 + 3m - 58. Find the third derivative of g(q) wrt q. -120q2 + 18 Suppose 0n + l = -3n + 23, 0 = 2n + 3l - 13. What is the first derivative of -6j + j + j - 5j - n wrt j? -9 Let j(g) be the first derivative of 411g*7/7 + 268g*3/3 - 99. What is the third derivative of j(f) wrt f? 49320f*3 Let q(l) = -2l*4 + 106l2 + 5. Let h(x) = -x4 + 105x2 + x + 6. Let b(u) = -3h(u) + 2q(u). What is the second derivative of b(w) wrt w? -12w2 - 206 Let w(d) be the second derivative of -d6/45 - 7d5/120 - 2d*3 - d. Let v(a) be the second derivative of w(a). Find the second derivative of v(c) wrt c. -16 Let x = 14 - 14. Suppose x = 3n - 2n - 6. Differentiate -3u - 4u + 0u + n with respect to u. -7 Let x be ((-40)/(-60))/(2/15). Let v(q) be the second derivative of -1/3q4 + 0q*2 - 6q + 0q3 + 1/4q*x + 0. Find the third derivative of v(k) wrt k. 30 Let j be (-2)/(-6 + 4) - (-3 - -1). What is the second derivative of 37i*2 - 37i*2 - 3i*j - 6i wrt i? -18i Let t = 0 - 4. Let g(j) = -j + 6. Let i(z) = -2z + 1 - 3z + 4z + 2z. Let w(l) = ti(l) - g(l). Differentiate w(x) with respect to x. -3 Let k be 45/18 - 15/(-10). Let a(t) be the second derivative of -13t + 0t*2 + 13/20t*5 + 0t*k + 0 + 13/6t*3. Find the second derivative of a(y) wrt y. 78y Let m(y) be the second derivative of 0y4 + 0 - 1/6y*3 + 0y*2 + 5y + 3/5y5. Find the second derivative of m(d) wrt d. 72d Let i(z) = -2z3 + z2 - z - 2. Let h be i(-1). What is the derivative of hc*4 - 6c*4 + 5c4 + 12 + c4 wrt c? 8c3 Let b(c) = -4c - 15. Let s be b(-7). Find the first derivative of 11 + 9 + 10 - 19 - sh wrt h. -13 Let u(b) be the third derivative of 3b*2 + 0 - 29/60b*5 + 0b*3 + 0b - 11/24b4. Find the second derivative of u(n) wrt n. -58 Suppose -2z - 9 = -5z. Suppose 2f + 10 = -0f - 4c, 0 = -2f - 5c - 14. Find the second derivative of -fv + 5v - v + 3v - zv*5 wrt v. -60v3 Let w(q) = q6 - 2q3 - q2 - q + 1. Let k(s) = 460s*6 - 2s*3 + 262s*2 - s + 1. Let u(g) = -k(g) + w(g). Find the third derivative of u(r) wrt r. -55080r*3 Let w be (6/4)/(14/(-84)). Let p be (-8)/(-3) + (-3)/w. What is the third derivative of -pk*4 + 3k*2 + 2k*2 - 6k*2 - 2k*4 wrt k? -120k Let b(d) be the second derivative of -437d5/20 + 126d*2 - d - 29. Differentiate b(w) with respect to w. -1311w*2 Let s(r) be the third derivative of 0r*3 - 19r*2 + 0 + 3/10r*5 - 29/24r*4 + 0r. What is the second derivative of s(b) wrt b? 36 Let d = 20 + -17. What is the first derivative of -11 - 6p3 + 9p*d - 12p*3 wrt p? -27p*2 Let g be ((-14)/24)/(-2). Suppose 5k - 18 = -r, -2k + 3k - g = 5r. Differentiate -4 + 1 - 4tk + 2 with respect to t. -16t*3 Let p(w) = -4. Let j(m) = -5. Let q(b) = 3j(b) - 4p(b). Let h(d) = d + 10. Let x(u) = -h(u) + 5q(u). What is the first derivative of x(y) wrt y? -1 Let n(m) = 15m2 + 42m - 5. Let u(a) = a - 1. Suppose 0 = -22f + 6f - 16. Let r(k) = fn(k) + 5u(k). What is the second derivative of r(l) wrt l? -30 Suppose q = -o, 3q + 6 = q - 4o. Let i be (2/5)/(1/10). What is the third derivative of -4b2 + 3b*2 - ib*3 + qb*3 + 3b3 wrt b? 12 Find the second derivative of -g3 - 11g5 + 86g - 18g5 + 52g*5 + 8g*5 wrt g. 620g*3 - 6g Suppose -3o + 2 = -2i, -i + 1 = 4o + 2. Find the third derivative of d3 - d3 - 6d*4 + od*4 + 14d*2 wrt d. -144d Suppose 5v - 21 = -2s, 2s + 5v - v - 18 = 0. What is the first derivative of d*3 - 12 - 8d*s - 6 - 3 wrt d? -21d*2 Let s(x) = -115x*4 - 137x*2 + 10x - 5. Let k(w) = -58w4 - 68w*2 + 6w - 3. Let p(l) = -10k(l) + 6s(l). Find the third derivative of p(a) wrt a. -2640a Let b(i) = -i4 - i2 + i + 2. Let f(z) = -190z*4 + 7z*2 + 21z - 20. Let l(d) = 5b(d) + f(d). What is the second derivative of l(t) wrt t? -2340t*2 + 4 Let u(y) be the second derivative of 0 + 3/20y*5 - 3y*2 - 5y + 0y4 + 0y*3. What is the first derivative of u(g) wrt g? 9g*2 Let r(t) = -1789t + 1006. Let v(y) = 2386y - 1342. Let l(n) = 11r(n) + 8v(n). Differentiate l(z) wrt z. -591 Let j = 100 + -85. What is the derivative of 14 - 251m + 251m + jm*3 wrt m? 45m*2 Suppose -589q + 584q = 0. Let u(z) be the first derivative of 8/5z*5 + 13/2z*2 + 9 + qz*3 + 0z + 0z4. Find the second derivative of u(m) wrt m. 96m*2 Let a be ((-4)/(-5))/((-2)/(-5))1. What is the third derivative of 358y + 22y*a - 358y - 22y3 wrt y? -132 Suppose 8c = 5c + 15. What is the second derivative of -10s*5 - 18s + 6s + 11s + 3sc wrt s? -140s*3 Let k(x) = 5x - 5. Let h be k(3). What is the derivative of -2q4 - 10q*4 + 8 - h - 10 wrt q? -48q*3 What is the third derivative of -8n + n*2 + 4n + 3n2 - 8n*4 - 3n*2 - 12n*4 wrt n? -480n Let m(p) = p*3 + 5p*2 - 70. Let n(q) = -6q*3 - 26q*2 - q + 351. Let w(c) = -11m(c) - 2n(c). What is the second derivative of w(j) wrt j? 6j - 6 Let c(r) = r*2 - 6r + 7. Let o(d) = 5d2 + d - 1. Let i be o(1). Let f be c(i). Find the first derivative of -5 + fn*2 + 0 - 1 - 3n*2 wrt n. -2n Let i(d) be the third derivative of 13d7/35 - 37d*5/30 + 4d*2 - d. What is the third derivative of i(k) wrt k? 1872k Let x(h) be the first derivative of -h*9/504 - 3h*5/10 + 31h*2/2 + 28. Let p(q) be the second derivative of x(q). Find the third derivative of p(z) wrt z. -120z*3 Let s be 2 + 9/(-3) + 6/2. What is the derivative of -28 - 14q*s + 9q - 2q - 7q wrt q? -28q Differentiate -26 - 2a*3 - 725a - 5 + 710a wrt a. -6a*2 - 15 Let q = 625 + -1871/3. Let z(a) be the first derivative of 11a + qa3 + 0a*2 + 12. Differentiate z(s) wrt s. 8s Let w(v) = 139v3 - 2v*2 + 2v + 173. Let a(x) = 280x3 - 5x*2 + 5x + 346. Let t(l) = 2a(l) - 5w(l). Find the first derivative of t(r) wrt r. -405r2 Let b(w) = -9w*4 + 12w*2 + 15w - 154. Let o(g) = -g*4 + 2g*2 - 1. Let h(i) = b(i) - 6o(i). Differentiate h(p) with respect to p. -12p3 + 15 Let y(h) be the first derivative of -4h*2 + 3h + 9h + 11 + 8h*2. What is the derivative of y(l) wrt l? 8 Let q(x) = -130x*5 - 2x*3 - 59x*2 - 2x - 2. Let z(j) = j5 + j3 + 2j2 + j + 1. Let c(b) = -q(b) - 2z(b). Find the third derivative of c(u) wrt u. 7680u2 Suppose 47 = 8k + 7. Find the third derivative of 78x5 + 31x*5 - 152x*5 - kx*2 wrt x. -2580x2 Let c(g) be the third derivative of g8/84 - g*7/42 + 3g5/20 - g4/24 - 62g2. Find the third derivative of c(i) wrt i. 240i*2 - 120i Let i(k) = 96k4 - 9k*3 - 211k*2 - 9. Let m(n) = 48n*4 - 4n*3 - 105n*2 - 4. Let t(s) = 4i(s) - 9m(s). Find the third derivative of t(j) wrt j. -1152j Suppose 2n - 1 = 5l, -3 = 4n - l - 14. What is the first derivative of 8 - 11a*3 + 2 + 1 + n wrt a? -33a*2 Let b(t) = -6t*4 + 20t*3 + 2t*2 + 420t. Let q(d) = d4 + d3 + d. Let j(k) = -b(k) - 2q(k). Find the third derivative of j(z) wrt z. 96z - 132 Let p(k) = k*2. Let x(b) = -24b*2 - 6b - 12. Let q(g) = -g*2 - g + 1. Let o(y) = 6q(y) - x(y). Let z(u) = -o(u) + 12p(u). Differentiate z(l) wrt l. -12l Let s(c) = c*2 + 2c - 1. Let g(h) = 619h4 - h3 + 5h*2 + 237h - 5. Let f(n) = g(n) - 5s(n). Find the second derivative of f(w) wrt w. 7428w*2 - 6w Let n(z) be the first derivative of 39z4/2 + 7z*3 - 2z*2 + 13. Find the third derivative of n(r) wrt r. 468 Let s(x) = -1272x*3 - 9x*2 + 18x - 1819. Let m(r) = -318r3 - 2r*2 + 4r - 455. Let q(i) = 9m(i) - 2s(i). What is the derivative of q(k) wrt k? -954k2 Let k(n) be the second derivative of -2n - 13/30n6 + 0n*2 + 1/2n*3 + 0n*5 + 0n*4 + 0. What is the second derivative of k(q) wrt q? -156q2 Let f(g) = g3 + 4g2 - 2g + 1. Let l be f(-4). Suppose 3y = 4y - 4. What is the second derivative of 5q + q4 + qy - lq + 4q4 wrt q? 72q*2 Let z be (-20)/12 - 11/(-3). Find the first derivative of -120m*z + 71m*2 + 70m*2 - 19 wrt m. 42m Let u(y) be the second derivative of y*7/42 + 133y*5/20 - 241y*4/6 + 132y - 2. What is th	{ "pile_set_name": "DM Mathematics" }
ow many minutes are there between 4:55 AM and 2:23 PM? 568 How many minutes are there between 10:30 PM and 9:32 AM? 662 How many minutes are there between 11:50 PM and 7:26 AM? 456 What is 173 minutes before 6:39 PM? 3:46 PM How many minutes are there between 1:11 AM and 2:22 AM? 71 What is 676 minutes before 7:22 AM? 8:06 PM What is 123 minutes after 7:18 PM? 9:21 PM How many minutes are there between 1:49 PM and 10:52 PM? 543 What is 538 minutes after 8:38 PM? 5:36 AM What is 453 minutes before 7:25 PM? 11:52 AM How many minutes are there between 5:38 PM and 5:25 AM? 707 How many minutes are there between 4:43 PM and 2:32 AM? 589 How many minutes are there between 8:30 PM and 10:59 PM? 149 What is 253 minutes before 2:43 PM? 10:30 AM What is 14 minutes before 2:30 AM? 2:16 AM How many minutes are there between 8:19 AM and 6:44 PM? 625 What is 354 minutes after 2:10 PM? 8:04 PM What is 117 minutes before 11:26 PM? 9:29 PM What is 52 minutes after 9:12 PM? 10:04 PM What is 454 minutes after 8:54 PM? 4:28 AM How many minutes are there between 5:29 PM and 4:29 AM? 660 What is 235 minutes after 5:28 AM? 9:23 AM How many minutes are there between 7:45 PM and 10:50 PM? 185 How many minutes are there between 2:22 AM and 12:49 PM? 627 How many minutes are there between 4:43 AM and 7:39 AM? 176 How many minutes are there between 4:12 AM and 12:46 PM? 514 How many minutes are there between 1:00 AM and 1:41 AM? 41 How many minutes are there between 6:25 AM and 11:25 AM? 300 What is 10 minutes before 5:45 PM? 5:35 PM How many minutes are there between 12:31 AM and 10:22 AM? 591 What is 578 minutes after 7:36 AM? 5:14 PM How many minutes are there between 5:55 PM and 7:26 PM? 91 What is 67 minutes after 8:23 PM? 9:30 PM What is 587 minutes after 8:35 AM? 6:22 PM How many minutes are there between 7:45 AM and 12:34 PM? 289 How many minutes are there between 5:49 AM and 10:54 AM? 305 What is 462 minutes after 10:30 PM? 6:12 AM How many minutes are there between 11:32 AM and 12:22 PM? 50 How many minutes are there between 6:58 PM and 2:59 AM? 481 What is 595 minutes after 9:05 AM? 7:00 PM How many minutes are there between 10:32 AM and 9:08 PM? 636 What is 296 minutes before 3:30 AM? 10:34 PM What is 709 minutes before 7:28 PM? 7:39 AM What is 107 minutes after 10:59 AM? 12:46 PM What is 559 minutes after 2:23 PM? 11:42 PM How many minutes are there between 3:44 AM and 10:09 AM? 385 What is 89 minutes before 8:11 PM? 6:42 PM How many minutes are there between 5:05 PM and 3:51 AM? 646 How many minutes are there between 2:56 AM and 4:05 AM? 69 What is 191 minutes before 9:19 AM? 6:08 AM How many minutes are there between 10:24 AM and 5:18 PM? 414 How many minutes are there between 3:07 AM and 5:40 AM? 153 What is 647 minutes after 4:18 PM? 3:05 AM What is 564 minutes before 12:08 AM? 2:44 PM What is 385 minutes after 8:38 AM? 3:03 PM What is 625 minutes after 7:34 AM? 5:59 PM What is 485 minutes before 4:28 AM? 8:23 PM How many minutes are there between 12:54 AM and 3:13 AM? 139 How many minutes are there between 10:25 AM and 5:06 PM? 401 What is 663 minutes before 10:41 PM? 11:38 AM What is 505 minutes before 5:03 PM? 8:38 AM What is 706 minutes after 7:12 AM? 6:58 PM What is 98 minutes after 1:26 PM? 3:04 PM How many minutes are there between 6:56 AM and 2:22 PM? 446 What is 274 minutes before 7:44 PM? 3:10 PM How many minutes are there between 11:57 AM and 6:31 PM? 394 How many minutes are there between 3:30 AM and 3:15 PM? 705 How many minutes are there between 2:07 PM and 5:58 PM? 231 What is 576 minutes before 9:31 AM? 11:55 PM How many minutes are there between 9:18 AM and 12:23 PM? 185 How many minutes are there between 5:59 AM and 2:27 PM? 508 What is 155 minutes before 2:46 PM? 12:11 PM How many minutes are there between 4:18 PM and 5:07 PM? 49 How many minutes are there between 6:27 AM and 9:18 AM? 171 What is 588 minutes before 2:11 PM? 4:23 AM How many minutes are there between 8:34 AM and 6:22 PM? 588 What is 252 minutes before 10:11 PM? 5:59 PM What is 186 minutes after 10:33 AM? 1:39 PM What is 313 minutes before 11:20 PM? 6:07 PM What is 448 minutes after 3:55 AM? 11:23 AM What is 50 minutes after 10:22 AM? 11:12 AM How many minutes are there between 5:01 AM and 4:23 PM? 682 How many minutes are there between 8:25 PM and 6:45 AM? 620 What is 401 minutes before 1:48 AM? 7:07 PM How many minutes are there between 10:36 PM and 4:17 AM? 341 What is 578 minutes after 9:34 AM? 7:12 PM What is 12 minutes after 2:49 PM? 3:01 PM What is 302 minutes after 10:46 PM? 3:48 AM What is 687 minutes after 3:10 PM? 2:37 AM How many minutes are there between 1:39 AM and 12:02 PM? 623 How many minutes are there between 12:02 AM and 8:24 AM? 502 How many minutes are there between 3:56 AM and 2:59 PM? 663 How many minutes are there between 5:40 AM and 6:30 AM? 50 What is 152 minutes before 4:23 AM? 1:51 AM What is 596 minutes before 8:19 AM? 10:23 PM How many minutes are there between 11:46 AM and 11:31 PM? 705 What is 197 minutes before 12:08 PM? 8:51 AM How many minutes are there between 3:26 PM and 4:01 PM? 35 What is 41 minutes after 9:16 PM? 9:57 PM How many minutes are there between 4:41 PM and 4:53 PM? 12 How many minutes are there between 2:59 PM and 10:41 PM? 462 How many minutes are there between 1:10 AM and 5:53 AM? 283 How many minutes are there between 6:06 AM and 7:35 AM? 89 What is 354 minutes after 8:32 PM? 2:26 AM How many minutes are there between 10:52 AM and 12:58 PM? 126 What is 38 minutes before 12:37 PM? 11:59 AM What is 501 minutes after 2:10 PM? 10:31 PM How many minutes are there between 2:32 AM and 8:09 AM? 337 How many minutes are there between 7:36 PM and 3:49 AM? 493 How many minutes are there between 12:32 AM and 11:08 AM? 636 How many minutes are there between 1:52 AM and 5:19 AM? 207 What is 10 minutes before 11:46 PM? 11:36 PM How many minutes are there between 9:26 AM and 12:50 PM? 204 How many minutes are there between 1:39 PM and 6:44 PM? 305 What is 137 minutes after 3:25 AM? 5:42 AM How many minutes are there between 9:07 PM and 1:32 AM? 265 What is 313 minutes before 10:04 AM? 4:51 AM What is 630 minutes after 2:03 AM? 12:33 PM How many minutes are there between 12:12 PM and 7:59 PM? 467 How many minutes are there between 10:18 AM and 3:59 PM? 341 What is 327 minutes before 10:53 AM? 5:26 AM How many minutes are there between 12:25 AM and 11:01 AM? 636 How many minutes are there between 8:24 AM and 11:41 AM? 197 What is 631 minutes before 4:26 AM? 5:55 PM How many minutes are there between 6:04 AM and 4:40 PM? 636 How many minutes are there between 2:47 PM and 12:32 AM? 585 What is 596 minutes before 10:39 AM? 12:43 AM How many minutes are there between 5:40 AM and 5:39 PM? 719 What is 578 minutes after 8:29 AM? 6:07 PM What is 39 minutes after 6:23 AM? 7:02 AM How many minutes are there between 6:12 AM and 4:08 PM? 596 How many minutes are there between 12:59 AM and 2:31 AM? 92 What is 676 minutes after 3:37 PM? 2:53 AM How many minutes are there between 11:24 AM and 2:00 PM? 156 How many minutes are there between 7:30 AM and 7:39 AM? 9 What is 641 minutes before 5:23 PM? 6:42 AM What is 589 minutes after 2:31 PM? 12:20 AM What is 408 minutes before 8:34 AM? 1:46 AM What is 503 minutes after 6:47 AM? 3:10 PM What is 300 minutes after 3:20 PM? 8:20 PM What is 462 minutes before 12:03 AM? 4:21 PM How many minutes are there between 4:20 PM and 8:46 PM? 266 How many minutes are there between 12:38 PM and 4:34 PM? 236 What is 354 minutes after 6:57 AM? 12:51 PM How many minutes are there between 12:05 PM and 7:28 PM? 443 What is 496 minutes after 6:26 AM? 2:42 PM What is 644 minutes before 6:35 PM? 7:51 AM How many minutes are there between 8:00 PM and 12:24 AM? 264 What is 570 minutes after 2:47 PM? 12:17 AM How many minutes are there between 4:34 AM and 5:27 AM? 53 What is 359 minutes before 12:57 PM? 6:58 AM What is 152 minutes after 6:53 PM? 9:25 PM How many minutes are there between 2:27 PM and 5:03 PM? 156 How many minutes are there between 12:02 PM and 2:08 PM? 126 What is 388 minutes before 8:28 AM? 2:00 AM How many minutes are there between 12:37 PM and 3:42 PM? 185 What is 457 minutes before 3:14 PM? 7:37 AM What i	{ "pile_set_name": "DM Mathematics" }
dg Find the second derivative of u*3 - 1489611u*2 - 4286110u + 2 wrt u. 6u - 2979222 Find the first derivative of iky2 + 439iy2 + 335iy - 2i + ky - 73414k - y*2 - 1 wrt i. ky*2 + 439y*2 + 335y - 2 Find the second derivative of j*2v*3 + 52j*2v + 10157j2 + 722672jv3 + 2j + 2v3 + 3v wrt j. 2v3 + 104v + 20314 What is the derivative of 1244h2 - 357h + 2244847 wrt h? 2488h - 357 Find the second derivative of 2k*5l + 295129k3l - 43k2l + 15870kl + 47k - 4l + 2 wrt k. 40k3l + 1770774kl - 86l What is the third derivative of 1755692v*5 + 118v*2 - 629v + 2 wrt v? 105341520v2 What is the derivative of 1278fo - 1418f - 143471o - 28 wrt f? 1278o - 1418 Find the second derivative of 110f4 - 6976f*2 + 1511242f wrt f. 1320f2 - 13952 What is the second derivative of -b2l*2 + 9b*2l + 157b2 + 71bl - b + 200573064l*2 - 47 wrt l? -2b*2 + 401146128 What is the second derivative of 4582717f*5n*2 - 2f*5n - 2931fn*2 + 441n*2 + 1 wrt f? 91654340f*3n*2 - 40f*3n What is the third derivative of -325511767i4 - 9i*2 + 734i - 692 wrt i? -7812282408i What is the first derivative of 4036138m*2 + 9895486? 8072276m Find the third derivative of -2w6 - 10w*4 + 444966w*3 - 91w*2 + 16w - 34444. -240w3 - 240w + 2669796 What is the derivative of 69842341d4n*3 + 189045575n*3 wrt d? 279369364d*3n*3 What is the second derivative of -22725929nq3 + 2nq - 131366n + 23q wrt q? -136355574nq Find the second derivative of -3363w*2z*2 - 2629w*2 + 233wz2 + 6wz + 4w + 2z2 - 11z - 1 wrt w. -6726z2 - 5258 Find the second derivative of 4547608d*2v*2 + 1853dv2 + 536dv wrt d. 9095216v*2 Differentiate -2737732y4 - y3 + y + 47198314 wrt y. -10950928y3 - 3y*2 + 1 Find the second derivative of -8540003z*3 - 4z*2 + 59141857z. -51240018z - 8 Find the third derivative of 25s*5 + 1145887s*3 - 9s*2 - 12525942s. 1500s2 + 6875322 Differentiate 65124626l*4 + 2l*3p + 30275p + 377 with respect to l. 260498504l*3 + 6l*2p Find the second derivative of -f*3s - 88114617f2s - fs - 3677f + 549s wrt f. -6fs - 176229234s What is the third derivative of -234450486au*3 + au*2 + 2au - 27a + 3u2 - 187u - 10 wrt u? -1406702916a Differentiate 2954y*3 + 89y + 194296303. 8862y2 + 89 What is the second derivative of -60416931f*3ny2 - 2f*3ny - 3f*3n - f*2ny - 2fny + 42863fy + 2y - 1 wrt y? -120833862f*3n What is the second derivative of 108619o2p*2 - 11940o*2p - 6o2 + 6op2 + o - p + 2 wrt p? 217238o*2 + 12o What is the second derivative of 13825612w2 - 8688351w wrt w? 27651224 Find the third derivative of -23675595q5 + 91473184q*2 - 3q wrt q. -1420535700q2 Find the third derivative of 157061503v*5 - 445222995v*2 wrt v. 9423690180v*2 Find the third derivative of 69978241hn4 - 179081hn2 - 22h + n*2 wrt n. 1679477784hn Differentiate -64ik3 - 9797i - 2k3 - k2 + 69959k with respect to i. -64k3 - 9797 What is the third derivative of 511200154r*3 + 7704548r*2 + 2r - 2? 3067200924 Find the third derivative of -93179422o4 + 594887369o*2 wrt o. -2236306128o Find the second derivative of 5rw*3 - 1327rw2 - 115rw + 118r - 951w3 - 3w + 2 wrt w. 30rw - 2654r - 5706w Find the third derivative of 12799097p4 - 730184p*2 wrt p. 307178328p Differentiate 4715532t4 - 7323382. 18862128t*3 Differentiate -95596524h - 268569530 with respect to h. -95596524 Find the second derivative of -8d3 + 42560d*2 - d - 282. -48d + 85120 Find the second derivative of x*5 - 10070827x*3 - 6x*2 + 168901109x wrt x. 20x3 - 60424962x - 12 What is the third derivative of -670556297b2v*3 + 2530b*2v*2 - 3735bv - 3v*2 + 2v wrt v? -4023337782b2 Differentiate -133884168v*2 + 140156859 wrt v. -267768336v What is the second derivative of -127254043z2 - 113245583z? -254508086 What is the first derivative of -476194148w + 706973292? -476194148 Find the second derivative of -8165496j*2 + 30495698j wrt j. -16330992 What is the second derivative of -477613r5 - 10r*2 - 1773045r - 29? -9552260r3 - 20 Find the second derivative of -2035061u5 + u2 + 2915854u. -40701220u*3 + 2 Differentiate -71928850l*2 - 7884748. -143857700l Differentiate -209c3 + c2 + 26493cj2 + 621025j*2 - j - 1 wrt c. -627c*2 + 2c + 26493j2 What is the first derivative of -17235144m + 23557859 wrt m? -17235144 What is the second derivative of 7w3 + 425164w*2 - 61762w + 15 wrt w? 42w + 850328 Find the first derivative of -9d*2x - 3d2y - 28dxy + 1390460dy + 1779x*2 wrt x. -9d*2 - 28dy + 3558x What is the second derivative of -5074in*2y*2 + in*2y + in2 + iny + 2in - 25iy2 + 21n*2y*2 - 19n*2y + 131 wrt y? -10148in*2 - 50i + 42n2 What is the third derivative of 1410994c*6j + 3c3j + 9c2 - 227cj + 980c wrt c? 169319280c3j + 18j Find the third derivative of 175008703h*3s*6 - 6081h*3s + h*2 - 32hs2 + 2hs + s2 + 2 wrt s. 21001044360h*3s*3 What is the derivative of -501575244h*3 + 1240634315 wrt h? -1504725732h*2 Find the third derivative of -4963mn3r*3 + 2544036mn3 - 6mnr*3 + mnr2 - 57mr3 + 3n*3r*2 wrt r. -29778mn3 - 36mn - 342m Differentiate 9084g3y - 382g3 + 2g*2 + 1785gy3 + 6976g - 5 with respect to y. 9084g3 + 5355gy2 Find the second derivative of 1126a*2b*2x - 2847a2bx3 - 51abx*2 + 12abx + 3ab + 19ax*3 + 8b*2 - 4bx3 + 2 wrt a. 2252b*2x - 5694bx3 What is the second derivative of i3jt*2 - 83008i*3t - 15i2j - 2ijt + 5424687jt2 - jt wrt t? 2i3j + 10849374j Differentiate -1086oz + 37908o + 1816085z with respect to o. -1086z + 37908 What is the second derivative of 47543g4 + 123g*3 - 2g + 38451344? 570516g2 + 738g Find the second derivative of 10696888y5 - 35026704y. 213937760y3 What is the third derivative of 4760585m*3 + 4m*2 - 76m + 736? 28563510 What is the third derivative of -84665988j3v*3 - 7j*2v*2 + 3j*2v + j*2 - 2j - 13987v3 wrt j? -507995928v*3 What is the third derivative of -93mx4 + mx*3 - 589807mx2 - 33x*4 - 80x*3 + 2x*2 wrt x? -2232mx + 6m - 792x - 480 Differentiate 298200f*2 - 192f - 761668151. 596400f - 192 What is the first derivative of -168p*2 - 2808p - 8955469? -336p - 2808 Find the second derivative of -2921t*5 + 23486t*3x + 2t - 33758594x wrt t. -58420t3 + 140916tx Differentiate -5235800fx + 4018f + 513 with respect to x. -5235800f What is the second derivative of -20u*4 - 1607u*3 + 1403u*2 + 1121u + 18177? -240u2 - 9642u + 2806 Find the second derivative of -159377d2m*3 + 7d*2m + 4dm*3 + 2dm2 + m2 + 32108m - 1 wrt d. -318754m3 + 14m What is the first derivative of -32794997y + 39605608? -32794997 What is the second derivative of 7d*3z2 + d3z - 1049307d*2z - dsz*2 - 2dsz + 236001sz2 - z2 wrt z? 14d3 - 2ds + 472002s - 2 What is the third derivative of 168731777u5 + 500u*2 - 217737 wrt u? 10123906620u*2 Differentiate 29644658jl + 191932j - 41 wrt l. 29644658j Differentiate 3mr2u + 2mr - 3mu - 2397401m - 18821653r*2 - 2ru wrt m. 3r*2u + 2r - 3u - 2397401 Find the third derivative of 206382t4 - 69t*3 - 25368418t*2 wrt t. 4953168t - 414 What is the third derivative of 2153b6 + 359b*3 + 2080169b*2 wrt b? 258360b*3 + 2154 Find the second derivative of -707683851z*4 + 517z + 82676. -8492206212z2 What is the second derivative of -y2z*3 + 4y*2z*2 - 30y*2z - 988y2 + 2yz3 + 11742yz2 - y + z2 + 7z wrt y? -2z3 + 8z*2 - 60z - 1976 What is the first derivative of -352765541b2 + 66071173? -705531082b Find the third derivative of 3s5 - 1258s*4 - 460s*3 + 2232734s*2 wrt s. 180s*2 - 30192s - 2760 Differentiate 605637136m2 - 142213963 with respect to m. 1211274272m What is the third deriv	{ "pile_set_name": "DM Mathematics" }
y. -4 Solve -5s + 7s = -8 for s. -4 Solve -17j - 3 = 14 for j. -1 Solve -490b = -520b + 330 for b. 11 Solve 46 = 14b + 88 for b. -3 Solve 6d = 8d - 4 for d. 2 Solve -28f + 70 = 14 for f. 2 Solve -15l + 15 = -75 for l. 6 Solve 19 - 2 = 17z for z. 1 Solve 45j - 27j = 54 for j. 3 Solve 114 = 163b - 201b for b. -3 Solve 6l + 9l = 15 for l. 1 Solve -16b + 1 = -15b for b. 1 Solve 32 - 2 = -10h for h. -3 Solve 3q - 12 = 3 for q. 5 Solve -14k + 9k = 10 for k. -2 Solve -12k - 31k + 258 = 0 for k. 6 Solve -16o = -51 - 29 for o. 5 Solve 140p + 328 = -24p for p. -2 Solve -635 + 641 = -6v for v. -1 Solve -3 = -5g + 2g for g. 1 Solve -1 = 4y - 9 for y. 2 Solve 10 - 26 = 8z for z. -2 Solve -422x = -431x for x. 0 Solve -6 = -4y + 2 for y. 2 Solve 5j + 11j - 3j = 0 for j. 0 Solve 140x = 145x + 5 for x. -1 Solve 10l + 8 = 12l for l. 4 Solve -22 = -12m - 46 for m. -2 Solve 25b = 113 - 13 for b. 4 Solve -18a + 23a + 15 = 0 for a. -3 Solve 9y - 18 = -0 for y. 2 Solve 34h + 145 = 63h for h. 5 Solve -19a - 20 = -14a for a. -4 Solve 46 = -39b + 16b for b. -2 Solve 1 = 22g - 43 for g. 2 Solve -32 + 36 = -2z for z. -2 Solve 21i + 0 + 63 = 0 for i. -3 Solve 0 = -f - 8 + 4 for f. -4 Solve 46d - 20 = 41d for d. 4 Solve -47u + 232 = -3 for u. 5 Solve 0 = 3g - 11g - 24 for g. -3 Solve -147q + 749 = -40q for q. 7 Solve -124s = -116s - 64 for s. 8 Solve 0 = -2v + 2 + 4 for v. 3 Solve -33a + 5a = 112 for a. -4 Solve -48 = 17c - 9c for c. -6 Solve -8t = -12 - 28 for t. 5 Solve 552 - 482 = 10v for v. 7 Solve 2341v - 2338v - 18 = 0 for v. 6 Solve 17a + 127 - 8 = 0 for a. -7 Solve 0 = -23c + 18c for c. 0 Solve -216u = -211u + 30 for u. -6 Solve -21 = 7a + 21 for a. -6 Solve 5h + 3h = 8 for h. 1 Solve -22 = 4j - 42 for j. 5 Solve 74w - 88w + 56 = 0 for w. 4 Solve -3x + 57x - 162 = 0 for x. 3 Solve -2 - 2 = 2t for t. -2 Solve -154a = -167a - 78 for a. -6 Solve 8l - 3l = -25 for l. -5 Solve 9j + 15 + 30 = 0 for j. -5 Solve 36w - 42w = 6 for w. -1 Solve -7f = -2f - 20 for f. 4 Solve -6w + 13 - 19 = 0 for w. -1 Solve -30d = -28d for d. 0 Solve 204d = 212d - 40 for d. 5 Solve -9 = 6n - 45 for n. 6 Solve -7v = -1 + 29 for v. -4 Solve -8f + 3 - 11 = 0 for f. -1 Solve -104 + 128 = -12i for i. -2 Solve -13 - 19 = -16b for b. 2 Solve -50 = -11n - 61 for n. -1 Solve 24i + 85 = -11 for i. -4 Solve -6h - 63 = -39 for h. -4 Solve 111 - 631 = -52w for w. 10 Solve -8 = -70z + 68z for z. 4 Solve 31 - 33 = 2t for t. -1 Solve 5g = 8g + 6 for g. -2 Solve -n + 34 - 39 = 0 for n. -5 Solve -12o = -61 + 13 for o. 4 Solve -8k = -989 + 1037 for k. -6 Solve 23l - 2l - 210 = 0 for l. 10 Solve -88 - 48 = -17z for z. 8 Solve 2a + 4 = -4 for a. -4 Solve -12z = 17 - 53 for z. 3 Solve 0 = -0j + 28j - 7j for j. 0 Solve -167f + 157f + 90 = 0 for f. 9 Solve -2 + 6 = s for s. 4 Solve 27h - 42 = 6h for h. 2 Solve 0 = -952j + 962j - 30 for j. 3 Solve 4 = -2d - 2d for d. -1 Solve 2w - 3w = 3 for w. -3 Solve 6b + 8 = 2 for b. -1 Solve 0 = 10i - 6i + 12 for i. -3 Solve 96i = 8i - 176 for i. -2 Solve 0 = -9d - 3 - 6 for d. -1 Solve -p + 6 - 9 = 0 for p. -3 Solve 8l + 156 - 172 = 0 for l. 2 Solve -67y + 113 = -21 for y. 2 Solve 66 = -2s + 60 for s. -3 Solve 0 = -4p + 14p - 30 for p. 3 Solve -57 + 55 = -c for c. 2 Solve 0 = 27x + 24x + 102 for x. -2 Solve 0 = -4i + 5 - 1 for i. 1 Solve -13 = -a - 17 for a. -4 Solve 66m - 98 = 17m for m. 2 Solve 39y - 144 + 456 = 0 for y. -8 Solve -6 + 2 = 2z for z. -2 Solve -14b + 35 = -21b for b. -5 Solve -168n = -181n for n. 0 Solve 60 = 208c - 218c for c. -6 Solve 0 = 107d - 140d - 165 for d. -5 Solve -129 + 9 = -20y for y. 6 Solve 13r + 94 = 159 for r. 5 Solve 0 = 31z + 3z - 68 for z. 2 Solve 662g + 66 = 651g for g. -6 Solve 0 = -9y - 30 + 48 for y. 2 Solve 0 = -7p - 7p + 56 for p. 4 Solve -77j = -86j - 45 for j. -5 Solve 26i + 115 = 3i for i. -5 Solve 16p = 11p - 15 for p. -3 Solve -1 = -8o + 15 for o. 2 Solve 0 = 75i - 81i + 24 for i. 4 Solve -21 = 5c - 11 for c. -2 Solve -2r - 15 = r for r. -5 Solve 0 = 7u + 267 - 218 for u. -7 Solve 133 = 330w - 311w for w. 7 Solve -44h + 493 = 185 for h. 7 Solve -4389v = -4373v - 48 for v. 3 Solve 35f - 188 - 162 = 0 for f. 10 Solve -26 = 9v + 1 for v. -3 Solve 6k - 713 = -713 for k. 0 Solve 14 - 113 = 33s for s. -3 Solve -8s - 10 = 2s for s. -1 Solve 0 = p + 10 - 14 for p. 4 Solve 8a - 11 - 29 = 0 for a. 5 Solve 7o + 39 - 11 = 0 for o. -4 Solve -8j + 253 = 181 for j. 9 Solve -19w = -53 - 42 for w. 5 Solve -19d - 51 - 44 = 0 for d. -5 Solve 0 = -96b + 89b + 35 for b. 5 Solve 126 = 8i + 142 for i. -2 Solve 0 = -39f - 37 - 158 for f. -5 Solve 24 - 8 = -2d for d. -8 Solve -9c - 113 = -77 for c. -4 Solve -6d + 104 = 128 for d. -4 Solve -123p = -113p + 20 for p. -2 Solve 590 - 100 = 70p for p. 7 Solve -21 + 1 = -4h for h. 5 Solve 9u - 6u = -9 for u. -3 Solve -z = 5z - 6 for z. 1 Solve -23a - 25 = -18a for a. -5 Solve 3z = 4z - 3 for z. 3 Solve 2n - 20n + 90 = 0 for n. 5 Solve -4u + 13 = 13 for u. 0 Solve -9 = -2y - 3 for y. 3 Solve 0 = -4c + 15 - 3 for c. 3 Solve 942 = 2f + 950 for f. -4 Solve 26r = 14r - 24 for r. -2 Solve 0 = -7n - 5450 + 5387 for n. -9 Solve -19l = 65 + 49 for l. -6 Solve -10y + 3y = 7 for y. -1 Solve 0 = 905v - 908v - 9 for v. -3 Solve 8j + 9 = -23 for j. -4 Solve 0 = -7v - 5v for v. 0 Solve -6 = 4j + 6 for j. -3 Solve 0 = 15a - 29a for a. 0 Solve -13c = -4c + 9 for c. -1 Solve -3v - 2268 + 2262 = 0 for v. -2 Solve -5m - 27 + 2 = 0 for m. -5 Solve -16u = 92 - 28 for u. -4 Solve 0 = -115c + 123c for c. 0 Solve 425o = 411o - 126 for o. -9 Solve -4n = -0n - 2n for n. 0 Solve -122 = 41y + 1 for y. -3 Solve -6j + 11j = 25 for j. 5 Solve -26 + 41 = 5w for w. 3 Solve -50g - 366 = 11g for g. -6 Solve -6w - 10w + 48 = 0 for w. 3 Solve 6 = 7q + 34 for q. -4 Solve 0 = 14o + 5o + 114 for o. -6 Solve 0 = -33r + 41r + 8 for r. -1 Solve -y + 11y = 30 for y. 3 Solve 0 = -18x + 13x - 25 for x. -5 Solve -33 = -6n - 3 for n. 5 Solve 0 = 3s + 36s + 195 for s. -5 Solve -3i - 6i - 36 = 0 for i. -4 Solve 0 = -24t + 23t - 5 for t. -5 Solve 11h - 2 = 12h for h. -2 Solve 40 = 6f + 2f for f. 5 Solve -52 + 32 = -5p for p. 4 Solve 5g - 18 = -28 for g. -2 Solve -32j + 20 = -12 for j. 1 Solve -2v + 18 = 8 for v. 5 Solve 0 = 9q - q + 8 for q. -1 Solve 3o + 10 + 2 = 0 for o. -4 Solve 25 = 6b - 11b for b. -5 Solve -36 = 7i - 1 for i. -5 Solve 10f - 5f = 20 for f. 4 Solve -15m = 398 - 518 for m. 8 Solve 11h = 27h + 48 for h. -3 Solve -11x + 3x = 24 for x. -3 Solve -30 = 5d - 11d for d. 5 Solve 0 = s - 12s + 33 for s. 3 Solve 10r = 36r - 78 for r. 3 Solve 0 = -9l + 34 + 2 for l. 4 Solve -7u = -12u - 25 for u. -5 Solve -4j - 15j - 5j = 0 for j. 0 Solve -16k + 16 = -0k for k. 1 Solve -8o - 10o + 72 = 0 for o. 4 Solve 11 = -14p - 17 for p. -2 Solve 5h - 9h = 0 for h. 0 Solve n + 22 - 23 = 0 for n. 1 Solve -j - 13 = -11 for j. -2 Solve -5k + 8k + 6 = 0 for k. -2 Solve -14 = -3x - 8 for x. 2 Solve 20 = -232c + 242c for c. 2 Solve -58n = 852 - 272 for n. -10 Solve 43k = -338 + 80 for k. -6 Solve -135 = -49h + 159 for h. 6 Solve -185b + 351 = -146b for b. 9 Solve 0 = -34i - 8 + 42 for i. 1 Solve -2d + 64 = 14d for d. 4 Solve -128u = -134u for u. 0 Solve -226 + 100 = 14a for a. -9 Solve 3k = 21k - 18 for k. 1 Solve 172f + 108 = 145f for f. -4 Solve 0 = -22o + 10o for o. 0 Solve 15t = 7 + 8 for t. 1 Solve 21p + 15 = 15 for p. 0 Solve 48t - 24t = -24 for t. -1 Solve n = 18n - 51 for n. 3 Solve -19g = -157 + 271 for g. -6 Solve 17o = 8o + 45 for o. 5 Solve 15h - 46 = -1 for h. 3 Solve -2n - 3n + 5 = 0 for n. 1 Solve 12t - 6t = -6 for t. -1 Solve 0 = -3f - f + 16 for f. 4 Solve 0 = 109t - 91t - 144 for t. 8 Solve -10v + 14v + 8 = 0 for v. -2 Solve -6b - 13 = -1 for b. -2 Solve 5y + 3 = -2 for y. -1 Solve 31o + 51 - 20 = 0 for o. -1 Solve 84c - 147 + 735 = 0 for c. -7 Solve 9q - 4q = -20 for q. -4 Solve 0 = 6v - 529 + 553 for v. -4 Solve -82 + 52 = -10w for w. 3 Solve -680n = -666n + 154 for n. -11 Solve 0 = -3u - 13 + 7 f	{ "pile_set_name": "DM Mathematics" }
+ 1sqrt(26)/sqrt(2). 3sqrt(13) Simplify 0 + sqrt(108)-2 + 1. -12sqrt(3) + 1 Simplify (sqrt(45)/(sqrt(9) - (-2sqrt(99))/sqrt(11) - sqrt(9))2)*2. 5 Simplify sqrt(405) + -1 - ((-1 + sqrt(5) - sqrt(5))-1 + sqrt(5))*2. -7 + 7sqrt(5) Simplify ((2 + sqrt(162))-6)2. 1296sqrt(2) + 5976 Simplify sqrt(343) + 3(sqrt(343) - (1 + sqrt(343)))2 + (sqrt(343) - (sqrt(343) - (-4 + sqrt(343) + -1)))2 + 5. -63sqrt(7) + 376 Simplify (sqrt(5)2-4 + -5 + -2)*2. 112sqrt(5) + 369 Simplify ((sqrt(119)-2 - sqrt(119))-3 - sqrt(119) - sqrt(119))/(sqrt(28)2). 7sqrt(17)/4 Simplify -5 + (sqrt(700) - (-1 + sqrt(700))) + sqrt(700) + 1. -3 + 10sqrt(7) Simplify (sqrt(171) - -2sqrt(171) - sqrt(171))/sqrt(9) + sqrt(19) + sqrt(19) + (sqrt(95)/sqrt(5) + -5)*2 + sqrt(19) + sqrt(19) + 2. -4sqrt(19) + 46 Simplify (sqrt(40) + sqrt(40) + sqrt(1000)2 + sqrt(40))/(sqrt(16)/sqrt(2)3). 13sqrt(5)/3 Simplify 2sqrt(39)/sqrt(3) + (sqrt(13) - -5sqrt(117)). 18sqrt(13) Simplify 5(2 + (sqrt(68) + sqrt(68)-1 + sqrt(68))/sqrt(4)). 10 + 5sqrt(17) Simplify -6(sqrt(25)/sqrt(5) + -3). -6sqrt(5) + 18 Simplify -2((-6(1 + sqrt(605)))2 - ((-2sqrt(605) + sqrt(605))*2 + 0)). -42422 - 1584sqrt(5) Simplify ((-14sqrt(187))/sqrt(11))*2-6. -1632 Simplify ((sqrt(1300) - (1sqrt(1300) + -4)) + 3 + 5)2. 144 Simplify 5(sqrt(2) + 3)5. 25sqrt(2) + 75 Simplify -5 + (0 + (sqrt(11) - sqrt(44) - sqrt(11)))*2. 39 Simplify sqrt(847) + 1sqrt(847) + -2. -2 + 22sqrt(7) Simplify (1-1sqrt(133))/((sqrt(7) - (sqrt(7) + sqrt(28)))4). sqrt(19)/8 Simplify (sqrt(7) + 1 + 3 - sqrt(70)/(sqrt(30)/sqrt(3)))*2 + -5. 11 Simplify ((sqrt(128)1 - ((sqrt(2) - (-2sqrt(2) + 0) - sqrt(2)) + sqrt(2))) + -5)2. -50sqrt(2) + 75 Simplify (sqrt(50) + sqrt(2))-5-6. 180sqrt(2) Simplify sqrt(22)/sqrt(99) - 1(sqrt(2) + 0). -2sqrt(2)/3 Simplify -1(4 + (-2 + -2 + sqrt(19) - sqrt(19) - sqrt(19)))-1. -sqrt(19) Simplify (-4(-1 + sqrt(1584)) - -41sqrt(1584))*2. 16 Simplify sqrt(832)2 + 0. 16sqrt(13) Simplify -4sqrt(117) + 1. -12sqrt(13) + 1 Simplify (-1 + (sqrt(252) - 4sqrt(252)))*2. 36sqrt(7) + 2269 Simplify (1sqrt(24)-6)/(sqrt(48)-2). 3sqrt(2)/2 Simplify 3sqrt(11)-1 - (sqrt(11) + 2sqrt(704)). -20sqrt(11) Simplify 1sqrt(88)/sqrt(8)4. 4sqrt(11) Simplify -3sqrt(684) + 5 + 1 + (-2 + sqrt(684) + sqrt(684) + sqrt(684))*2. -90sqrt(19) + 6166 Simplify (((1sqrt(204) + sqrt(204) + sqrt(204))1 - sqrt(204) - sqrt(204))/(sqrt(108)2 - sqrt(12))-6)*2. 612/25 Simplify ((1-2sqrt(2299) - sqrt(2299) - sqrt(2299)) + 4)2. -352sqrt(19) + 36800 Simplify (5 + -2 + sqrt(3)-1)2. -6sqrt(3) + 12 Simplify sqrt(52)2 + -2 + (sqrt(130) + (sqrt(130) - 5-2sqrt(130)) - sqrt(130))/sqrt(10). -2 + 15sqrt(13) Simplify (sqrt(110)/(sqrt(30)/sqrt(3)) + -1 + sqrt(891))2 + 3 + (3 + sqrt(44)/sqrt(4) - sqrt(11))2. -20sqrt(11) + 1113 Simplify (sqrt(114) + sqrt(114) + (2sqrt(114)-1 - sqrt(114)) + sqrt(114))/(sqrt(54)/sqrt(36)). 0 Simplify 1sqrt(6)/sqrt(2) + 0. sqrt(3) Simplify ((sqrt(1053) + 3)*2 - sqrt(1053)) + sqrt(208) + -4. 49sqrt(13) + 1058 Simplify (sqrt(192) - (sqrt(192) - (-4 + 1 + sqrt(192)))) + sqrt(192) + ((-3 + (sqrt(192) - (sqrt(192) + 1 + sqrt(192))) + sqrt(192))*2 - sqrt(192)). 13 + 8sqrt(3) Simplify (-4-2sqrt(85))/(sqrt(5) + (sqrt(45) + sqrt(5))-5 - sqrt(5)). -2sqrt(17)/5 Simplify (3 + sqrt(2) + sqrt(8)/sqrt(4) + 4 + 0 + sqrt(2) + 2 + sqrt(2))*2. 72sqrt(2) + 113 Simplify (sqrt(42)/(sqrt(12)/sqrt(2))-6)2. 252 Simplify -3sqrt(3)3 - sqrt(3) - (sqrt(3) + 1 + 4 + sqrt(3)). -12sqrt(3) - 5 Simplify (sqrt(130)-1-4)/((sqrt(100) - (sqrt(100) - sqrt(100)-2) - sqrt(100) - sqrt(100))/sqrt(10)). -sqrt(13) Simplify (sqrt(200) - (3 + (-1sqrt(200) - sqrt(200))) - sqrt(200))*2 + -3. -120sqrt(2) + 806 Simplify -2sqrt(304)-1. 8sqrt(19) Simplify -4sqrt(13)2 + 1. -8sqrt(13) + 1 Simplify 4(sqrt(5) - sqrt(5)2) - (sqrt(5) + (sqrt(45) + 0)*2 + sqrt(5)). -45 - 6sqrt(5) Simplify (((sqrt(34) - sqrt(850)1) + sqrt(34) + sqrt(34))/(sqrt(18)/(sqrt(27)/sqrt(3))))2. 68 Simplify (-3(sqrt(153) - -1(sqrt(153) + sqrt(153)-1 + sqrt(153))))*2. 5508 Simplify 1(5 + sqrt(91)/(2sqrt(7))). sqrt(13)/2 + 5 Simplify 1(-2 + sqrt(3) + -1)3. -9 + 3sqrt(3) Simplify (-1-2(sqrt(17) + -1 + sqrt(17)))*2. -16sqrt(17) + 276 Simplify ((sqrt(2736) - sqrt(2736)1)2 - sqrt(19)) + sqrt(152)/(sqrt(8) + sqrt(24)/sqrt(3) + sqrt(8)). -2sqrt(19)/3 Simplify sqrt(65)/(sqrt(5) - sqrt(80)) + 2sqrt(468). 35sqrt(13)/3 Simplify (1(sqrt(2299) + 0))2. 2299 Simplify (sqrt(1872)-2)/(sqrt(32)/sqrt(200)). -60sqrt(13) Simplify (sqrt(448) + 1 + sqrt(448))-3 + -4 + -1sqrt(448). -56sqrt(7) - 7 Simplify (6(4sqrt(33)/sqrt(3) - sqrt(132)/(sqrt(48)/sqrt(4))))*2. 3564 Simplify -1 + (sqrt(114)/sqrt(6)-5 - sqrt(19)). -6sqrt(19) - 1 Simplify 6(1sqrt(125) + -1 + sqrt(5)-1)*2. -48sqrt(5) + 486 Simplify (-6(0 + sqrt(612)) + sqrt(612) + sqrt(612) - sqrt(612))2. 15300 Simplify -4sqrt(132)/sqrt(12) - sqrt(1100)/sqrt(4). -9sqrt(11) Simplify (sqrt(12)/sqrt(6)2)*2 + -3. 5 Simplify -5(1 + 1 + sqrt(13) + 2sqrt(117)). -35sqrt(13) - 10 Simplify (sqrt(38) - sqrt(76)/sqrt(2))/sqrt(2) - (sqrt(19) + sqrt(38)/sqrt(2) + 1)*2. -77 - 4sqrt(19) Simplify sqrt(175)-1 - (sqrt(504)/sqrt(8) + sqrt(63))/sqrt(9). -7sqrt(7) Simplify (sqrt(3200) + (sqrt(3200) - (sqrt(3200) + 1)-1))2. 240sqrt(2) + 28801 Simplify (sqrt(143)/(sqrt(33)/sqrt(3)) + sqrt(13)1 + -2)2. -8sqrt(13) + 56 Simplify (sqrt(22) - (2sqrt(132))/sqrt(6))/(sqrt(450) + sqrt(2)). -sqrt(11)/16 Simplify ((5(-1 + sqrt(128)) - sqrt(128))2)2. -1280sqrt(2) + 8292 Simplify sqrt(304)1 + -1. -1 + 4sqrt(19) Simplify -4(-1sqrt(4000))/(2(sqrt(32) - sqrt(8))). 20sqrt(5) Simplify (sqrt(143) + (sqrt(143) - -41sqrt(143)))/(-2sqrt(11)-1)3. 9sqrt(13) Simplify sqrt(1100) + -1(sqrt(1100) + 0). 0 Simplify ((sqrt(130) - (2sqrt(130)-2 - sqrt(130))) + sqrt(130))/(sqrt(40)6). 7sqrt(13)/12 Simplify (2(sqrt(70) - sqrt(70)1))/(sqrt(10) + sqrt(10)14). 0 Simplify 3 + sqrt(13) + sqrt(13) + sqrt(52) + -2 - (41sqrt(13)3)*2. -1871 + 4sqrt(13) Simplify (4 + sqrt(245) + 2)*2 + -1 + sqrt(245) + -3. 91sqrt(5) + 277 Simplify sqrt(1100) + 3(sqrt(1100) + -3). -9 + 40sqrt(11) Simplify (sqrt(140)/(sqrt(28)-3))2 + 0. 5/9 Simplify sqrt(78)/sqrt(486)3. sqrt(13)/3 Simplify ((sqrt(576) - sqrt(36))-5)/(sqrt(24)/(2sqrt(2))). -30sqrt(3) Simplify -5 + (1sqrt(720)6)2. 25915 Simplify 1sqrt(5) + -2 + sqrt(15)/sqrt(3)-5. -4sqrt(5) - 2 Simplify sqrt(847) + -4 + (-1 + sqrt(847))*2 + -4. -11sqrt(7) + 840 Simplify 2(sqrt(1216) + ((sqrt(1216) - sqrt(1216)2) + sqrt(1216) - sqrt(1216)))-5 + 3. 3 Simplify (sqrt(17) + 2 + -3 + sqrt(17))26. -24sqrt(17) + 414 Simplify (sqrt(132)/(sqrt(12) + sqrt(12)25))2. 1/11 Simplify (sqrt(171) + (sqrt(171) - (sqrt(171) + 4)) + sqrt(171))2 + sqrt(19) + -3. -47sqrt(19) + 697 Simplify (3(sqrt(7) + 0 - sqrt(7))1)*2. 0 Simplify sqrt(91)/(sqrt(70)/sqrt(810) + sqrt(7)). 9sqrt(13)/10 Simplify (((sqrt(72) - (sqrt(72) - sqrt(72)-2))/sqrt(4))/(sqrt(1296)2 - sqrt(9)))*24. 32/529 Simplify ((2sqrt(112) + sqrt(7) + (sqrt(7) - (sqrt(126)/sqrt(2))/sqrt(9)))5)*2. 14175 Simplify (-1sqrt(153)4)/(3sqrt(36)). -2sqrt(17)/3 Simplify (sqrt(10)/(sqrt(2) - (sqrt(2) - sqrt(18)/sqrt(900)))-6)*2. 18000 Simplify -3((6sqrt(11) + sqrt(11))-1 - sqrt(11)). 24sqrt(11) Simplify 2 + (sqrt(171) - (sqrt(171) + -1)) + sqrt(19). 3 + sqrt(19) Simplify -4(-3 + sqrt(396))-3. -36 + 72sqrt(11) Simplify 1 + sqrt(68) + sqrt(17) + sqrt(17) + ((sqrt(119)-2)/sqrt(7))2. 4sqrt(17) + 69 Simplify sqrt(605)-1 + 3. -11sqrt(5) + 3 Simplify -2(1sqrt(45))/sqrt(9). -2sqrt(5) Simplify (0 + (sqrt(637) - (5 + 3 + sqrt(637))))2. 64 Simplify sqrt(5) + (sqrt(5) + 4)4 - 2sqrt(605). -17sqrt(5) + 16 Simplify ((2sqrt(176) + sqrt(176))33)2. 128304 Simplify 2(0 + sqrt(72) + 0). 12sqrt(2) Simplify (2 + sqrt(1872)1 - (-1 + sqrt(1872) + 0 + sqrt(1872)))*2 + -3. -72sqrt(13) + 1878 Simplify 6((sqrt(11)-2 - sqrt(11))-1)2. 594 Simplify (sqrt(3) + (sqrt(48))2 + -1 + sqrt(3))-1. -47 - 2sqrt(3) Simplify (sqrt(425) - 2sqrt(425) - (sqrt(2057) + sqrt(2057) + -2))*2. -108sqrt(17) + 12397 Simplify 3 + 3sqrt(2057) + 5. 8 + 33sqrt	{ "pile_set_name": "DM Mathematics" }
. -21, 8665 Solve -2b4 - 204784b*3/3 - 582405694b*2 + 776639528b - 582496712/3 = 0. -17066, 1/3, 1 Let -5k3 - 905k*2 = 0. What is k? -181, 0 Solve 25m*5/4 + 285m*4/4 - 3125m*3/2 + 6055m*2/2 + 58065m/4 + 39445/4 = 0 for m. -23, -7/5, -1, 7 Factor 3z4 - 522z*3 - 12z*2 + 2088z. 3z(z - 174)(z - 2)(z + 2) Find b, given that 4b2 + 388564b + 388560 = 0. -97140, -1 Factor 4o3 + 16384o*2 + 16875088o + 200148672. 4(o + 12)(o + 2042)*2 Suppose 3j*4 + 360j*3 - 10368j*2 = 0. What is j? -144, 0, 24 Factor -5r*3 + 1930r*2 + 17885r - 43450. -5(r - 395)(r - 2)(r + 11) Find r such that -45r*2 - 3725r + 76330 = 0. -898/9, 17 Factor -3u2 - 1070088u - 95424027312. -3(u + 178348)2 Factor -f2 - 11399f - 79744. -(f + 7)(f + 11392) Factor 4t*3 - 4240t*2 + 554468t + 558712. 4(t - 907)(t - 154)(t + 1) Let 3g*3 - 3048g*2 + 817887g - 21874410 = 0. What is g? 30, 493 Let -f*5 - 36f*4 - 163f*3 - 252f*2 - 124f = 0. What is f? -31, -2, -1, 0 Let -4x3/3 + 10x*2/3 + 146x/3 + 80 = 0. What is x? -3, -5/2, 8 Factor r*3 - 152r*2 + 7316r - 107632. (r - 62)*2(r - 28) What is q in q*5/2 + 47q*4/2 + 226q*3 + 158q*2 - 408q = 0? -34, -12, -2, 0, 1 Factor 3x3 - 5109x*2 - 12x + 20436. 3(x - 1703)(x - 2)(x + 2) What is y in 2y*2 - 2402y = 0? 0, 1201 Let -2h3 - 730h*2 - 33124h + 144304 = 0. What is h? -311, -58, 4 Let 58j4 + 898134j*3 + 3475600116j*2 - 10195006976j - 719634432 = 0. Calculate j. -7744, -2/29, 3 What is a in 529a3/3 - 10603a*2/3 + 47432a/3 + 58564/3 = 0? -1, 242/23 Factor -2k2 - 1678k + 102144. -2(k - 57)(k + 896) Let 4r5 + 360r*4 + 7728r*3 + 48608r2 = 0. Calculate r. -62, -14, 0 Factor o3/2 + 1965o2/2 - 11821o/2 + 9855/2. (o - 5)(o - 1)(o + 1971)/2 Solve 138w4/5 + 1221w*3/5 - 1569w*2/5 + 42w = 0 for w. -10, 0, 7/46, 1 Factor -3h4/5 - 11562h*3/5 - 4623h*2 - 11556h/5. -3h(h + 1)*2(h + 3852)/5 Find k, given that -5k2 + 41975k + 41980 = 0. -1, 8396 Determine x so that 2x5/3 - 16x*4/3 - 184x*3/3 - 132x*2 + 18x + 180 = 0. -3, -2, 1, 15 Solve m*3 - 1754m*2 + 7004m - 7000 = 0 for m. 2, 1750 Find k, given that k*3/2 - 91k*2 + 356k = 0. 0, 4, 178 Suppose 4k4/3 + 80k*3 + 1204k*2/3 - 28712k - 175232/3 = 0. Calculate k. -37, -2, 16 Determine y, given that 417y4/8 - 1653y*3/8 - 477y*2/8 + 1653y/8 + 15/2 = 0. -1, -5/139, 1, 4 Factor -x*2 - 341112x - 29089349136. -(x + 170556)2 Suppose q2/2 + 1013742q + 513836421282 = 0. Calculate q. -1013742 Solve 65w*5/2 - 2205w*4/4 + 1215w*3/4 + 6265w*2/2 + 120w = 0. -2, -1/26, 0, 3, 16 Suppose 3m5 - 2124m*4 + 479178m*3 - 44661372m*2 + 1540978155m - 4233748608 = 0. What is m? 3, 107, 384 Suppose -3z4 + 14694z*3 - 18080751z*2 + 215384652z - 644570892 = 0. Calculate z. 6, 2443 Find y, given that 3y3/2 + 332460y*2 = 0. -221640, 0 Solve 3c*2 - 48951c - 48954 = 0 for c. -1, 16318 Factor -4a4 - 252a*3 - 3072a*2 - 8960a + 12288. -4(a - 1)(a + 8)*2(a + 48) Suppose -5h5 + 105h*4 + 55h*3 - 1245h*2 + 1930h - 840 = 0. Calculate h. -4, 1, 2, 21 Suppose -c*4/4 + 733c*3/4 - 100215c*2/2 + 6061775c - 273899750 = 0. What is c? 170, 223 Factor -4h3 + 448h*2 + 7056h. -4h(h - 126)(h + 14) Let -i5/2 + 585i*4/4 + 2679i*3/4 - 1759i*2/4 - 6849i/4 + 2673/2 = 0. Calculate i. -9/2, -2, 1, 297 Factor 3650692d4 + 2548070108d*3 - 78808620d*2 + 812468d - 2792. 4(d + 698)(97d - 1)3 Suppose 3t*2/2 - 994965t + 329985117075/2 = 0. What is t? 331655 Factor -4t3 - 336t*2 - 932t + 3240. -4(t - 2)(t + 5)(t + 81) What is o in 2o*5/7 + 458o*4/7 - 208o*3 - 14968o*2/7 - 27904o/7 - 14848/7 = 0? -232, -2, -1, 8 Find l such that -3l2/2 + 199l/2 + 13905 = 0. -206/3, 135 What is c in 2c5 + 21168c*4 + 55989356c*3 - 112042224c*2 + 56031698c = 0? -5293, 0, 1 Suppose -p*4/2 - 83p*3/2 - 159p*2/2 + 243p/2 = 0. Calculate p. -81, -3, 0, 1 Suppose 24q5 + 16443q*4 + 34773q*3 - 41157q*2 - 120981q - 61470 = 0. Calculate q. -683, -2, -1, 15/8 Suppose 2a4 + 74a*3 - 748a*2 - 5664a + 6336 = 0. Calculate a. -44, -6, 1, 12 Determine v so that -20v4 - 8235v*3 + 2959880v*2 + 2226585v - 741510 = 0. -642, -1, 1/4, 231 Let 4q3 - 64q*2 - 9668q - 28320 = 0. What is q? -40, -3, 59 Let -2g5/7 - 1324g*4/7 - 304376g*3/7 - 28302352g*2/7 - 936054272g/7 - 1761313024/7 = 0. Calculate g. -244, -86, -2 Factor -231426098l2 + 1032672l - 1152. -2(10757l - 24)*2 Factor 5k*3 + 795k*2 + 11760k - 1776740. 5(k - 37)(k + 98)*2 Determine i, given that 5i*4 - 135i*3 + 320i*2 + 4860i + 4400 = 0. -4, -1, 10, 22 Find t such that -5t4 - 1030t*3 - 53345t*2 - 103620t - 51300 = 0. -114, -90, -1 Find v, given that -v*5/6 + 9589v*4/6 - 11515172v*3/3 + 103363418v*2/3 - 275405840v/3 + 183552800/3 = 0. 1, 4, 4790 Factor -a*3 - 15392a*2 + 76985a. -a(a - 5)(a + 15397) Factor -3m5 - 261m*4 - 1968m*3 - 5784m*2 - 7632m - 3792. -3(m + 2)4(m + 79) Factor -4j3/7 - 340j*2/7 - 7104j/7. -4j(j + 37)(j + 48)/7 What is d in -4d*3 + 1116d*2 - 54060d + 52948 = 0? 1, 61, 217 Factor -y*5 - 44y*4 - 80y*3 + 176y*2 + 336y. -y(y - 2)(y + 2)*2(y + 42) Factor g*5/12 + 2057g*4/6 + 1058840g*3/3 + 2113568g2/3. g2(g + 2)(g + 2056)*2/12 What is o in 55o*2 - 115o - 840 = 0? -3, 56/11 Suppose o*3 - 393873o*2 - 787749o - 393875 = 0. What is o? -1, 393875 Factor -3l3 + 92775l*2. -3l*2(l - 30925) Find u such that 2u4/19 - 78u*2/19 - 140u/19 = 0. -5, -2, 0, 7 Let -3a3/4 - 276a*2 - 2172a - 4320 = 0. What is a? -360, -4 Let 3o5/8 + 27o*4/8 + 3o*3/4 - 39o*2/2 - 9o + 24 = 0. Calculate o. -8, -2, 1, 2 Determine z so that -z*5/3 + 136z*4/3 - 1813z*3/3 - 67094z*2 - 434112z + 5094432 = 0. -19, 6, 84 Factor 2d2/7 - 6772d/7 - 6774/7. 2(d - 3387)(d + 1)/7 Find z such that 121z4 + 68651z*3 + 365193z*2 + 254485z - 688450 = 0. -562, -35/11, 1 Determine d so that -21d4 - 216d*3 - 543d*2 - 432d - 84 = 0. -7, -2, -1, -2/7 Let 4i5 - 688i*4 + 26964i*3 + 269848i*2 - 3548608i = 0. What is i? -14, 0, 8, 89 Find b, given that -5b5/3 + 3185b*4/6 + 11455b*3/2 + 59135b*2/6 + 27965b/6 = 0. -17/2, -1, 0, 329 Factor h*3 + 1087h*2 - 16516h + 15428. (h - 14)(h - 1)(h + 1102) Suppose 25k2 + 2470k - 5040 = 0. What is k? -504/5, 2 Find j such that -88360j3 - 1062952j*2 - 158018j/5 - 1176/5 = 0. -12, -7/470 Let s*2/4 + 631s/4 - 99561/2 = 0. Calculate s. -862, 231 What is f in 374f2 + 51258f/5 + 548/5 = 0? -137/5, -2/187 What is h in -h*4 + 110h*3 + 45075h*2 - 2645500h - 578402500 = 0? -130, 185 Let b*3 - 22350b*2 + 124992300b - 1247689000 = 0. Calculate b. 10, 11170 Find a, given that a*4/6 + 125a*3/2 + 17854a*2/3 + 17050a - 23064 = 0. -186, -4, 1 Let 2z5/5 + 36z*4/5 - 194z*3/5 - 3604z*2/5 - 12864z/5 - 13376/5 = 0. What is z? -19, -4, -2, 11 Suppose k*2/3 + 419k/3 + 6878 = 0. What is k? -362, -57 Determine a, given that 5a3 + 19240a*2 + 76895a + 57660 = 0. -3844, -3, -1 What is i in 50i5 + 19460i*4 + 1805258i*3 - 17293960i*2 + 12963656i - 2534464 = 0? -199, 2/5, 8 Factor -4m4 - 2804m*3 - 57708m*2 - 401212m - 932960. -4(m + 7)3(m + 680) Factor 2j3/5 + 1164j*2/5 + 65638j/5 + 126636/5. 2(j + 2)(j + 61)(j + 519)/5 Find i, given that -5i*4 + 140i*3 + 29655i*2 + 183610i - 18711880 = 0. -43, 22, 92 Factor -5p5 - 155p*4 + 2130p*3 - 7480p*2 + 3680p + 13440. -5(p - 4)3(p + 1)(p + 42) Let -5v*5 + 140v*4 - 95v*3 - 1140v*2 + 1620v = 0. Calculate v. -3, 0, 2, 27 Solve -5p2 + 76420p - 292000820 = 0. 7642 Find h such that -2h2/5 - 2568h/5 - 7686/5 = 0. -1281, -3 Suppose 17q2 - 54769q + 38652 = 0. What is q? 12/17, 3221 Factor -r*2/2 - 45r/4 - 11/2. -(r + 22)(2r + 1)/4 Factor -3r3/4 + 45r*2/2 - 819r/4 + 588. -3(r - 16)(r - 7)*2/4 Factor -2r*3/9 - 296r*2/3 + 498r - 3592/9. -2(r - 4)(r - 1)(r + 449)/9 Solve -r3/4 + 74r*2 + 2441r/4 - 684 = 0 for r. -9, 1, 304 Suppose -c*3 - 3c*2 + 130c = 0. What is c	{ "pile_set_name": "DM Mathematics" }
ement from eeeeeeeeeeeqe. 11/13 What is prob of sequence ii when two letters picked without replacement from {i: 2, e: 4}? 1/15 What is prob of sequence rcr when three letters picked without replacement from ccr? 0 Four letters picked without replacement from {g: 2, n: 2, s: 1, q: 2, p: 1}. What is prob of sequence sqgp? 1/420 Two letters picked without replacement from rbptv. What is prob of sequence tr? 1/20 What is prob of sequence hvug when four letters picked without replacement from uggqggvvqvh? 1/660 What is prob of sequence cdm when three letters picked without replacement from cdcuuduuuum? 2/495 Calculate prob of sequence nn when two letters picked without replacement from {n: 3, t: 4}. 1/7 Two letters picked without replacement from tiiiititttttt. Give prob of sequence tt. 14/39 Four letters picked without replacement from ififdggiidigiifiig. What is prob of sequence gigf? 3/680 Two letters picked without replacement from {i: 4, t: 5, e: 2}. What is prob of sequence ee? 1/55 What is prob of sequence qq when two letters picked without replacement from {k: 1, v: 1, g: 6, t: 1, q: 3}? 1/22 Calculate prob of sequence vkiv when four letters picked without replacement from {i: 2, o: 2, k: 3, v: 2}. 1/252 Two letters picked without replacement from gggggggggmgg. Give prob of sequence gm. 1/12 What is prob of sequence xjxw when four letters picked without replacement from wnwxxjxtexejttj? 1/455 Two letters picked without replacement from rirjrrrrrrjrjjaijrr. What is prob of sequence rr? 55/171 What is prob of sequence iss when three letters picked without replacement from {t: 3, s: 2, a: 2, i: 4}? 4/495 Calculate prob of sequence bifi when four letters picked without replacement from {c: 4, b: 1, i: 6, f: 2, n: 2}. 1/546 Three letters picked without replacement from {p: 2, y: 1, i: 2, f: 2, z: 1, u: 4}. What is prob of sequence pyf? 1/330 What is prob of sequence nnn when three letters picked without replacement from rrrkrnkkkr? 0 Four letters picked without replacement from {n: 5, p: 1, d: 1, h: 3}. What is prob of sequence dphh? 1/840 Two letters picked without replacement from {c: 1, f: 2, w: 1, u: 1, x: 3, e: 3}. Give prob of sequence ee. 3/55 What is prob of sequence wbb when three letters picked without replacement from rbrwb? 1/30 What is prob of sequence rn when two letters picked without replacement from rgbqrqqbqqgbnqqqqqq? 1/171 What is prob of sequence sm when two letters picked without replacement from wscmm? 1/10 Calculate prob of sequence hxh when three letters picked without replacement from ddgrhhdddrgdxdx. 2/1365 Three letters picked without replacement from {j: 1, u: 1, c: 3, d: 2}. Give prob of sequence jdd. 1/105 Calculate prob of sequence jj when two letters picked without replacement from jjpnjjpnpjjpnjjjjnnn. 9/38 Calculate prob of sequence ye when two letters picked without replacement from {a: 1, e: 5, y: 4, l: 1, x: 1, u: 7}. 10/171 Calculate prob of sequence tbtf when four letters picked without replacement from {f: 2, b: 4, t: 4}. 2/105 Three letters picked without replacement from jjjplpcppgqpgjpggjp. What is prob of sequence ppc? 7/969 Four letters picked without replacement from eessss. What is prob of sequence esss? 2/15 Two letters picked without replacement from aexaaazz. Give prob of sequence xz. 1/28 What is prob of sequence oy when two letters picked without replacement from wvwaoayaa? 1/72 Three letters picked without replacement from kkkkfkkfkkkkbfkkk. What is prob of sequence kfb? 13/1360 Two letters picked without replacement from {d: 1, v: 1, n: 2, i: 2}. Give prob of sequence ni. 2/15 What is prob of sequence gzgp when four letters picked without replacement from {g: 2, p: 1, z: 4}? 1/105 What is prob of sequence xxbb when four letters picked without replacement from {x: 2, b: 4}? 1/15 Calculate prob of sequence hvq when three letters picked without replacement from qhv. 1/6 What is prob of sequence xt when two letters picked without replacement from cucxuuxtuppqpppccpqq? 1/190 Two letters picked without replacement from yayayyyaay. What is prob of sequence ay? 4/15 Calculate prob of sequence oqo when three letters picked without replacement from {o: 5, q: 2}. 4/21 Four letters picked without replacement from yyye. Give prob of sequence yyye. 1/4 What is prob of sequence ww when two letters picked without replacement from {p: 6, h: 2, w: 5, j: 1, t: 1}? 2/21 Calculate prob of sequence qqgr when four letters picked without replacement from {r: 1, q: 2, g: 1}. 1/12 What is prob of sequence pj when two letters picked without replacement from ttjptptp? 3/56 Three letters picked without replacement from {w: 12, f: 1, g: 1, e: 1}. Give prob of sequence gef. 1/2730 Calculate prob of sequence mm when two letters picked without replacement from {m: 6, z: 12}. 5/51 Calculate prob of sequence aaa when three letters picked without replacement from {a: 15, g: 4}. 455/969 Three letters picked without replacement from {k: 1, h: 1, o: 2, w: 1}. What is prob of sequence kko? 0 What is prob of sequence qqkv when four letters picked without replacement from {p: 1, y: 2, q: 4, v: 1, k: 3}? 1/220 What is prob of sequence bw when two letters picked without replacement from {r: 1, e: 3, b: 6, w: 2, a: 7}? 2/57 Two letters picked without replacement from ppppepnpppvppsbvppbp. Give prob of sequence pp. 39/95 Calculate prob of sequence ppq when three letters picked without replacement from {j: 1, y: 2, f: 3, q: 1, p: 5}. 1/66 Calculate prob of sequence xzj when three letters picked without replacement from fannnnnzxzjnann. 1/1365 Three letters picked without replacement from {c: 5, y: 6, q: 6, i: 1}. Give prob of sequence iyc. 5/816 Two letters picked without replacement from nvhncnnhhhnnnzhhnczb. What is prob of sequence nz? 4/95 Three letters picked without replacement from zzczzzjczzzzczzzijz. Give prob of sequence cjj. 1/969 Four letters picked without replacement from {j: 1, x: 1, l: 2, t: 1, q: 2, v: 8}. What is prob of sequence vjqx? 2/4095 Calculate prob of sequence uc when two letters picked without replacement from ukkcuuufua. 1/18 Calculate prob of sequence pb when two letters picked without replacement from pbpbppbzxpppbzpxb. 5/34 Calculate prob of sequence fiuf when four letters picked without replacement from {i: 3, u: 6, f: 6}. 3/182 What is prob of sequence tk when two letters picked without replacement from {i: 1, k: 3, t: 1}? 3/20 What is prob of sequence px when two letters picked without replacement from {e: 1, x: 1, p: 8, g: 4, b: 3}? 1/34 Calculate prob of sequence hhkk when four letters picked without replacement from hhhkhhlrkllk. 1/99 Two letters picked without replacement from yhhrnrrrrrnr. What is prob of sequence hn? 1/33 Calculate prob of sequence ev when two letters picked without replacement from {v: 1, f: 4, e: 9, w: 1, z: 3}. 1/34 Four letters picked without replacement from {g: 5, v: 7, y: 4}. Give prob of sequence yvvg. 1/52 Two letters picked without replacement from fgofooffofoofgffog. Give prob of sequence fo. 28/153 Four letters picked without replacement from mfffeqfeq. What is prob of sequence ffeq? 1/63 Calculate prob of sequence ttct when four letters picked without replacement from {c: 2, t: 11}. 3/26 What is prob of sequence pg when two letters picked without replacement from {g: 1, v: 7, i: 3, p: 1}? 1/132 Four letters picked without replacement from {y: 5, m: 7}. What is prob of sequence ymmm? 35/396 Two letters picked without replacement from {r: 8, u: 5, f: 3, b: 2, n: 1}. What is prob of sequence bb? 1/171 Calculate prob of sequence cz when two letters picked without replacement from {i: 2, c: 2, x: 2, v: 4, z: 3, o: 2}. 1/35 Calculate prob of sequence ffvv when four letters picked without replacement from vvvvvfvvvvvvfvvvff. 91/3060 Calculate prob of sequence wnw when three letters picked without replacement from zwawunq. 1/105 Four letters picked without replacement from ssseseessssssssees. Give prob of sequence sses. 143/1224 Calculate prob of sequence rm when two letters picked without replacement from mmrmsrmmarmarra. 1/7 Four letters picked without replacement from {f: 2, e: 2, l: 3, t: 3, p: 7, g: 1}. Give prob of sequence lllp. 7/12240 Three letters picked witho	{ "pile_set_name": "DM Mathematics" }
st to 1 in 2/9, -4/7, x? 2/9 Let v = -91 - -91.2. Which is the closest to -1? (a) 5/3 (b) v (c) -4/3 c Let d be 483/(-182) + (-20)/(-8). Which is the closest to d? (a) 3/7 (b) 0.3 (c) 5 b Let c = -0.8 - -0.6. Let y be 2 - (-1 - -4) - -2. What is the closest to c in -3, -5, y? y Let k = -0.03 + 4.03. Let q = k - 0. Which is the nearest to 0.1? (a) q (b) -2/17 (c) -2/15 b Let x = 0.3 + -0.1. Let j = 0.05 + -0.15. Let r = 2.1 + j. Which is the nearest to x? (a) r (b) -2 (c) 2/5 c Let p = -28 - -32. Let t be -1 + ((-40)/(-6))/p. Which is the closest to -0.1? (a) -2 (b) 0 (c) t b Let h(k) = -2k - 2. Let m(i) = 3i + 3. Let y(a) = 5h(a) + 3m(a). Let g be y(-1). What is the closest to 1/2 in -1, -3, g? g Let d = 24/13 + -9/26. Let r = -139/4 + 35. Which is the closest to -2/7? (a) r (b) -0.2 (c) d b Let l = 716 + -37950/53. Let o = l - 43/265. Which is the nearest to -1? (a) o (b) -1/6 (c) 1 a Let u(z) = -z - 5. Let p be u(-4). Let j be p(-3 + (-2 - -1)). Which is the closest to 2? (a) 1/7 (b) 1 (c) j b Let s = 63681/5 + -12795. Let u = 59 + s. Let r be 3/2(-24)/9. What is the nearest to -2 in r, 4, u? r Suppose 0 = n + 4n - 4w - 36, 2n + 3w = -4. Let q be 18/(-12) + 2/n. Which is the closest to -1? (a) q (b) -0.1 (c) -3 a Let n be (-8)/(-64) + (1 - 15/12). Which is the nearest to n? (a) 0.5 (b) 2/5 (c) -0.2 c Let l be (38/(-40) - 0) + 16/80. Which is the nearest to 2? (a) -4 (b) l (c) -5/4 b Let v(y) = 4y3 - 2y2 - y. Let l be v(-1). Let k be 2/11 - (25/(-44) - -1). Which is the nearest to k? (a) l (b) -0.3 (c) -0.4 b Let i(p) = p3 + 9p2 - 10p + 5. Let y be i(-10). Suppose 0 = yo + f - 6, -o + f = 2f + 2. Which is the nearest to -2/7? (a) 0.1 (b) o (c) 0.3 a Let b(d) = -d*3 - 2d*2 + 2d. Let j be b(-2). Let x = 0.8 + -0.86. Let k = x - -0.36. What is the closest to 0 in j, 2, k? k Let l be ((-1)/(-5))/(4/30). Let j = 0.06 - -1.94. Let q be (-4)/10 + 78/45. Which is the closest to -0.1? (a) l (b) j (c) q c Let h = 0.12 - 0.32. Suppose -7o = -3o - 12. Which is the closest to h? (a) -1 (b) o (c) -2 a Let v be 94/(-10) + 8/20. Let j = -41/40 - -5/8. What is the closest to j in v, 1/5, -1/8? -1/8 Let w = 15 - 16. Which is the closest to 1? (a) w (b) 2/5 (c) -2/11 b Let k = 0.07 + -0.01. Let l = k + 1.94. Let y = 0.05 - -0.95. What is the nearest to 0.1 in y, l, -1/8? -1/8 Let l = 5.4 - 5.4. Let t = -0.3 - -0.1. Which is the closest to t? (a) 0.5 (b) -0.1 (c) l b Let d = 8.9 + -8. Let t = 1.2 - d. What is the nearest to 1 in 0.1, -3/7, t? t Let h = -6.8 - -8.8. Let r = 9 + -14. Which is the closest to h? (a) r (b) 3 (c) -1 b Let v = 0.061 + 1.899. Let g = -0.04 - v. What is the nearest to 0.2 in -1/4, 0.2, g? 0.2 Let z be (24/64)/((-6)/4). What is the closest to -0.3 in 0.3, 0.5, z? z Let l be 8/12(-3)/7. Let g = -109 + 101.9. Let i = -7 - g. What is the closest to l in -5, 3/2, i? i Let n = 23 - 68/3. Let g be (11 + -8)(-2)/(-24). Which is the closest to n? (a) 2 (b) 0.2 (c) g c Let b = 0.9 + -1. What is the nearest to -0.06 in 2, b, 1/8? b Suppose -2 = u + 13. Let k be u/12(-4)/6. Let x = 2 + -2.5. What is the nearest to -1 in x, k, -0.4? x Let u = -5 + 5.3. Let k = -0.72 - -2.72. Which is the closest to k? (a) -2/11 (b) u (c) -2 b Let z = 1 - 0.9. Let l = -196/5 + 39. Which is the nearest to z? (a) l (b) -5 (c) 4 a Let d = -6 - -4. Let s = 1 - -1. Let x = -5 + s. What is the closest to 0.1 in d, x, -4? d Let t = -234 + 2108/9. Which is the nearest to -2/5? (a) t (b) -0.07 (c) 4 b Suppose 0m - m - 14 = 0. Let w be (-4)/(-14) - 66/m. Let l be 13/39 + 14/(-78). Which is the closest to 1? (a) w (b) -5 (c) l c Let i be (-1)/(-3) + (-10)/(-6). Which is the closest to -1? (a) i (b) -0.1 (c) 2/11 b Suppose -4l = l - 25. Which is the closest to -1? (a) -1/4 (b) l (c) -5 a Let w = 7 + -3. Which is the nearest to 1/2? (a) w (b) -5 (c) 1/3 c Let r = 676/9 - 75. Let u(s) = -s2 - 8s + 2. Let k be u(-8). Let q = k - 1. Which is the nearest to 0? (a) q (b) r (c) -2/9 b Suppose 0 = 4z + 2a - 12, -3z + 4 = -2a + 2. Let t(d) be the first derivative of d*2 - 2d + 2. Let i be t(z). What is the closest to 1 in -1/2, -0.2, i? i Let y = 39 + -13. Let v be (-8)/(-16) - y/36. Let z = 1/16 + 3/16. Which is the closest to z? (a) -5 (b) v (c) 1/2 c Suppose -3q + 30 = 2o + 2q, -o + 25 = 5q. What is the closest to 1 in o, 0.2, -2/7? 0.2 Let d = 17 - 25. Let k = 4 + d. What is the nearest to -0.1 in -4/7, 1, k? -4/7 Suppose 2o = -2n - 12, -3o - 3 = -2n - 0n. Let m = 87 - 91. Let a = 0.7 + -0.4. What is the closest to n in 5, m, a? m Let p = 1684/7 - 240. Let i = -20 - -22. Which is the nearest to 0? (a) i (b) p (c) 0.5 c Suppose -6 = 2g + 4. Let q be (-18)/(-12)4/(-3). Which is the nearest to -2? (a) g (b) q (c) 1/3 b Let m(y) = -21y + 1. Let w = -6 + 7. Let q be m(w). Let f be q/(-21) - (-2)/(-3). What is the closest to f in 0, -2, 4? 0 Let z = -0.06 - 0.14. Let p be (1/3)/((-6)/(-72)). Suppose -pd - 30 = -4b - 2d, b + 15 = -4d. What is the closest to 0.1 in 4/5, b, z? z Let t = 3 + 4. Let n = t + -8. Let a = 47 + -187/4. What is the nearest to a in 4, 5, n? n Let m = -10 - -6. Let u be (-6)/(-20) + (-2)/4. Let i = 0.2 - 0.1. What is the closest to i in -1, u, m? u Let p be -1 + 2 + (-4)/4. Let y = -7 + 10. What is the closest to 0.2 in -2/5, p, y? p Let t be (56/(-105) - (-2)/10)-15. What is the closest to 0 in t, -1/6, -1/3? -1/6 Let y = -0.8 + 0.8. What is the nearest to y in 1, -3, 1/3? 1/3 Let g be (-2 - -4) + (-20)/9. What is the nearest to 0 in 0.5, 2, g? g Let z = -97/36 + 22/9. Which is the nearest to 0? (a) z (b) -2 (c) -3/11 a Let f be (2/(-11))/(4 + -2). Which is the nearest to -1? (a) f (b) -0.3 (c) -2 b Let y = 51/2 + -25. What is the closest to 1/5 in y, 2/3, 5? y Let x = -2.98 - 0.02. Let j = -0.4 - -0.8. Let v = -109/63 + 13/9. Which is the closest to 2/5? (a) j (b) v (c) x a Let j = -1.9 - -2.9. What is the closest to 1 in 5, -2, j? j Let r = 0.505 - 0.005. Which is the closest to 0? (a) -1 (b) 0.2 (c) r b Let c = -4.584 - 0.016. Let d = c + 5. Let h = 1.56 + 0.44. What is the closest to 0 in h, d, 0.2? 0.2 Let l = -193/8 + 24. Let d be (-10)/8 - 3/(-3). Which is the nearest to d? (a) 1 (b) -5 (c) l c Let l = -0.174 - 0.026. What is the nearest to 0.2 in 2, 5, l? l Let z be 1/2 + (-18)/20. Let w = -107 + 113.3. Let g = w + -1.3. What is the nearest to z in g, 0.3, 1? 0.3 Let l = 1 - 0.7. Let g = 3 + -7. Let o(h) = h3 + 3h*2 + h + 1. Let z be o(-2). What is the nearest to 0 in g, l, z? l Let t = -139 - -137. What is the closest to 6 in 3/8, t, 0.1? 3/8 Suppose 2l - 35 = g + 4g, 0 = -5l + 5g + 50. Let q = -7/4 - -27/20. Which is the nearest to l? (a) -1 (b) -5 (c) q c Let b = -1.09 - -6.39. Let k = -0.05 + 5.05. Let h = k - b. What is the closest to 1/3 in -4, h, -5? h Let c = -118/273 - 4/91. Let w = -1/7 - c. What is the closest to -1/3 in -2, 0, w? 0 Let f = 308/9 + -34. Which is the closest to 0? (a) -0.05 (b) 1/4 (c) f a Let o = -0.5 + 0.7. Let w = 3.1 + -3. Let f = -0.1 - w. What is the closest to f in o, 3, 5? o Let f = 0.2 - 0.1. Suppose -4d - 23 + 1 = p, 0 = -2d - 2p - 8. Let x be 3/6(-4)/d. Which is the nearest to 2/3? (a) x (b) 4 (c) f a Let h = -7.4 - -7. Let z = -3 - -3.4. Let d = z + h. Which is the closest to d? (a) 0 (b) 2 (c) -3 a Let v = 0.03 + 0.07. Suppose 3 = -m + 5t, -3m + 3t = 2 - 5. Suppose 2n = -m - 6. Which is the closest to v? (a) 2 (b) n (c) 3 a Let v = -257/655 + -1/131. What is the nearest to 1/4 in -2, v, 3? v Let s = -30 - -17. Let o = s - -16.3. Let d = o + 0.7. What is the closest to 1/5 in 2/7, -5, d? 2/7 Let r = -38059745/2898 - -118208/9. Let j = r - 24/23. Let u = j - -5/126. Which is the closest to 0? (a) 0.2 (b) -2/7 (c) u c Let y = -16 - -14. Which is the nearest to -1? (a) -0.3 (b) y (c) -3 a Suppose -2g = 3g + 2w + 9, 1 = 3g - 2w. Let p = -0.8 - -0.5. Which is the closest to g? (a) p (b) 4 (c) 5 a Let l = -116/3 + 1282/33. Let f be (-1)/(-2 + -1) - 1. Which is the closest to -1? (a) l (b) f (c) -3 b Suppose 0 = -2t + g + 2g, -5*g - 7 = -t. Let p be (2/t)/(26/6). What is the nearest to 0 in -2/5, p, -1/2? p Supp	{ "pile_set_name": "DM Mathematics" }
10100100011 In base 7, what is -103 - 330043434? -330043540 In base 4, what is -2310033300 - 33? -2310033333 In base 4, what is -2112330230 + 3210? -2112321020 In base 14, what is 8b - 28dd7? -28d4a In base 8, what is 20172311 - 24? 20172265 In base 6, what is -10041552450 - 4? -10041552454 In base 12, what is -b6 + -1b02b6? -1b03b0 In base 2, what is -10100011010100010100010011 - 101? -10100011010100010100011000 In base 11, what is 1 - 2035173? -2035172 In base 9, what is 155 - 1134080? -1133824 In base 4, what is -332022111031 + 3? -332022111022 In base 3, what is -1 - -221201002112002? 221201002112001 In base 14, what is -d70c236 - 2? -d70c238 In base 4, what is 10210330 + -12231? 10132033 In base 12, what is -43920 + -13? -43933 In base 5, what is -1101130120 - 114? -1101130234 In base 9, what is -68262 + 51? -68211 In base 14, what is 384b + 19719? 1d166 In base 9, what is 582 + -4576? -3884 In base 15, what is 14 + -2590c8? -2590b4 In base 3, what is -11122221202221211201 - -1? -11122221202221211200 In base 16, what is 192d383 + -18? 192d36b In base 6, what is 443545 - -25? 444014 In base 9, what is 3 - 323523461? -323523457 In base 12, what is -9a08246 + 3? -9a08243 In base 4, what is -11 - -103320233033? 103320233022 In base 3, what is 20020 - -221111101? 221201121 In base 6, what is -142230 - -123132? -15054 In base 12, what is 2 - -13b4968? 13b496a In base 14, what is -113 - -8b538? 8b425 In base 5, what is -1234311 + -31004? -1320320 In base 3, what is 20100 + -1010222012001? -1010221221201 In base 7, what is 1150 + -651306? -650126 In base 2, what is 10101 + -1011011101001? -1011011010100 In base 8, what is 315577 - 1127? 314450 In base 8, what is 1 - -5032472? 5032473 In base 2, what is -1 + 100011011111101000101111? 100011011111101000101110 In base 12, what is 23159a6 - 1? 23159a5 In base 12, what is -a7 - 11744? -1182b In base 13, what is 72 + 21690? 21732 In base 5, what is 4 - 42430334024? -42430334020 In base 8, what is -4035416 - -10? -4035406 In base 2, what is -1 - 110110000111110010001010? -110110000111110010001011 In base 9, what is 1428537 + 254? 1428802 In base 14, what is -15144 - -1b45? -133dd In base 2, what is 11100100011100 + -10000001100? 11010100010000 In base 8, what is -4227 - -2010? -2217 In base 10, what is -3 - 3130741? -3130744 In base 13, what is 4 - -53c348? 53c34c In base 5, what is 2 + 4323132102? 4323132104 In base 15, what is 4b - -8996e? 899ba In base 3, what is -2 + -211111102100121? -211111102100200 In base 11, what is -1 - 9371184? -9371185 In base 13, what is -10ba6 + 87? -10b1c In base 3, what is 1022021222102202 - -11? 1022021222102220 In base 11, what is 222 + 48aa43? 490165 In base 11, what is -1 + -45205175? -45205176 In base 5, what is 4 + -403333134? -403333130 In base 10, what is 3179 - 2189? 990 In base 8, what is -1265 - 11461? -12746 In base 11, what is 13822 - -4685? 183a7 In base 3, what is -2001210220000022 - -11? -2001210220000011 In base 15, what is 0 - -d78203? d78203 In base 2, what is 1011 - -1101110100000111111011010? 1101110100000111111100101 In base 3, what is -20012100222002102 + -10? -20012100222002112 In base 9, what is -20 + 240262? 240242 In base 16, what is 618da23 + 0? 618da23 In base 12, what is 88a1 + -330? 8571 In base 4, what is -13 - -1101303201203? 1101303201130 In base 6, what is 102320041 + 141? 102320222 In base 13, what is 2a8 - 9c59? -9981 In base 8, what is 13077305 - 15? 13077270 In base 3, what is 12 + 121211102101? 121211102120 In base 8, what is 6 + -2165522? -2165514 In base 9, what is 1280025 - -26? 1280052 In base 5, what is 1103 - 12030341? -12024233 In base 12, what is -12320 + -b8? -12418 In base 7, what is 2 - -25544541? 25544543 In base 11, what is -8a25301 - 29? -8a2532a In base 11, what is -973289a7 - 5? -97328a01 In base 10, what is 1423 + -13183? -11760 In base 3, what is -12 + 21111201121000110? 21111201121000021 In base 16, what is 7f4a5f - 5? 7f4a5a In base 12, what is 7b + 908329? 9083a8 In base 7, what is 100036 + -2640? 64066 In base 4, what is -12320 - 2030030? -2103010 In base 5, what is -3303 - -120414124? 120410321 In base 4, what is 3013 + 200033? 203112 In base 2, what is 101010110101110100 + 1101? 101010110110000001 In base 2, what is -101110110111 - 1001010001? -111000001000 In base 12, what is -948 + 118a7? 10b5b In base 3, what is -2022 + -10210211020010? -10210211022102 In base 9, what is 1204281 + 22? 1204313 In base 15, what is b0 + 72869? 72929 In base 4, what is -30 - 1120313121202? -1120313121232 In base 5, what is -11343341 + 20432? -11322404 In base 6, what is -2020042334 - 1? -2020042335 In base 9, what is 4 + -602381671? -602381666 In base 13, what is 14a489 - 23a? 14a24c In base 12, what is 1339 + -1304b? -11912 In base 12, what is -1a + b68b9b5? b68b997 In base 3, what is -1200121101 - -110212010? -1012202021 In base 15, what is b1aad + -4? b1aa9 In base 9, what is 2435 - -65337? 67773 In base 11, what is -13a02602 + -1? -13a02603 In base 9, what is -4800184 + 11? -4800173 In base 13, what is 316049a - -48? 3160515 In base 10, what is 283 + -51440? -51157 In base 11, what is 17 + -93956? -9393a In base 15, what is d - 86c62d? -86c620 In base 2, what is 100111101 - -100011110100? 101000110001 In base 13, what is -6320696 - 4? -632069a In base 2, what is -100101111111 + 11001100001? -1100011110 In base 6, what is 22452025305 - -4? 22452025313 In base 3, what is -221020010022020 + -10? -221020010022100 In base 15, what is -3 + d9b40b7? d9b40b4 In base 3, what is 20001021211120 + -1202? 20001021202211 In base 6, what is -131 + 2542041? 2541510 In base 7, what is 20 - -2110423? 2110443 In base 8, what is 1076054 - 7? 1076045 In base 7, what is -2 - -2125513263? 2125513261 In base 2, what is -100 + -1100001110110111101100? -1100001110110111110000 In base 8, what is 3156344 + 356? 3156722 In base 13, what is -85c31 - 17a? -860ab In base 3, what is -2122211 + -110200200? -120100111 In base 16, what is -2b + bb280? bb255 In base 16, what is bc - -73133? 731ef In base 3, what is -1000022100022 + -12201? -1000022120000 In base 16, what is 2 + 976068? 97606a In base 2, what is -101000000111101100101111 - 110? -101000000111101100110101 In base 4, what is -11320032113 - 111? -11320032230 In base 10, what is -140242 - 47? -140289 In base 16, what is 1a22 - -433c? 5d5e In base 16, what is -459d2 - -2a? -459a8 In base 15, what is 855 + 4d6? d3b In base 13, what is 44a + -20513? -20096 In base 14, what is -1901 - 78d? -2290 In base 13, what is -1 + -4c914? -4c915 In base 6, what is -1 - -44141101? 44141100 In base 2, what is 101100110111011000001 - -101011? 101100110111011101100 In base 9, what is 1405 + 1252081? 1253486 In base 9, what is -5025 - -3131? -1784 In base 16, what is 932 + 1af68? 1b89a In base 12, what is -4 - 10293b33? -10293b37 In base 5, what is -4 + 30023021441? 30023021432 In base 8, what is 141376 - 236? 141140 In base 6, what is 314 - 43415331? -43415013 In base 4, what is -20232121300200 - 10? -20232121300210 In base 3, what is 211111121212 - -210001? 211112101220 In base 13, what is -65 - 1212b6? -12134b In base 9, what is -5 + 2274437? 2274432 In base 13, what is -ac1 + -420? -1211 In base 9, what is 235 + -5404? -5158 In base 10, what is -69 + -11988? -12057 In base 3, what is -1001020120 - -21202221? -202110122 In base 3, what is 1102212 + -10120011? -2010022 In base 8, what is 1153451442 - -6? 1153451450 In base 4, what is 3113010 - -3232222? 13011232 In base 11, what is 5398a65 - 3? 5398a62 In base 7, what is 4413 + -2440? 1643 In base 5, what is -104404432340 + 10? -104404432330 In base 7, what is 6 + -1630513? -1630504 In base 4, what is -23012200003 - -3? -23012200000 In base 8, what is -3 - 32224262? -32224265 In base 14, what is -ab92 - 1c7a? -ca2c In base 8, what is 2 + -5213164? -5213162 In base 2, what is 110010010000 + -111000011011010? -110010001001010 In base 15, what is -105cd85 - -2? -105cd83 In base 10, what is -3234 + -2294? -5528 In base 11, what is 9674440a - 4? 96744406 In base 2, what is 0 + -1101100101000011100001101? -1101100101000011100001101 In base 9, what is 1058137 + -17? 1058120 In base 10, what is -558 + 13230? 12672 In base 16, what is 27c - 3f6b? -3cef In base 16, what	{ "pile_set_name": "DM Mathematics" }
*3 + 6s*3 - 24s*3 + 28 - 165s*2 + 12. -5(s + 1)(s + 4)(7s - 2) Let z(t) be the third derivative of t6/840 + 43t*5/84 + 11663t*4/168 + 11449t*3/42 + 949t*2. Factor z(i). (i + 1)(i + 107)*2/7 Solve 0 + 1/4n*4 + 12n*2 + 9n + 13/4n3 = 0. -6, -1, 0 Suppose 10r = 3r + 273. Suppose 1 = v - 1. Find b such that -rb + 7b - 66 + 4b*2 + 2 - 8bv = 0. -4 Let a(b) be the third derivative of -b8/1512 - b7/135 - b6/36 - 13b5/270 - b4/27 + 919b*2. Solve a(g) = 0. -4, -1, 0 Let j(s) = 2s + 11. Let g be j(-4). Determine z, given that 0z3 - 5z*3 + 4 + 6z*3 + gz*4 - 9z2 - z4 - 4z = 0. -2, -1, 1/2, 2 Suppose 0 = -8l + 7l - 6. Let u(p) = 4p*2 - 11p + 16. Let k(z) = -9z2 + 23z - 32. Let r(d) = lk(d) - 14u(d). Suppose r(o) = 0. Calculate o. 4 Let r be 5 - ((-52)/12)/(-1). Suppose 2c - 3g = 5 - 1, -8 = -4c - 3g. Solve 0 + 2/3lc + rl*3 + 0l = 0. -1, 0 Let d(m) = -4m2 - 267m - 196. Let u be d(-66). Factor -8/3c + 8/3c*3 - 4/3 + 4/3c*4 + 0c*u. 4(c - 1)(c + 1)3/3 Let s = 15181/4 - 3795. Suppose 0 + 2m*2 + 3/4m*3 - 1/2m*4 - sm*5 + m = 0. Calculate m. -2, -1, 0, 2 Let u = -51 - -62. Let z = u + -43/4. Find v such that -1/4v + 1/4v2 - zv*4 + 0 + 1/4v*3 = 0. -1, 0, 1 Let i(x) be the second derivative of -54x*7/7 - 1158x*6/5 - 2096x*5 - 4168x*4 - 2720x*3 - 800x*2 - 73x + 2. Find j such that i(j) = 0. -10, -1, -2/9 Let b(z) = z*3 - 2z*2 - 3z + 3. Suppose 4r + 9 = 3v, 5r - 1 + 16 = 5v. Let n be b(v). What is p in -p*3 + 2p*3 - 7p*n + 3p*3 = 0? 0 Find w, given that -3/7w*5 - 423/7w*3 - 30w*2 + 0w + 0 - 216/7w4 = 0. -70, -1, 0 Let s(c) be the third derivative of c6/450 - c5/75 + c4/30 + c3/6 - 16c*2. Let v(z) be the first derivative of s(z). Suppose v(l) = 0. What is l? 1 Let d be -22/122/(-8). Let x(k) be the second derivative of 0 + 1/42k*7 - 1/20k*5 + 0k*3 - k - dk*4 + 1/30k*6 + 0k*2. Solve x(t) = 0 for t. -1, 0, 1 Determine o, given that 45o*2 + 0 + 0o + 5/3o3 = 0. -27, 0 Suppose -5q + 23 = -2. Suppose -qk4 + 17k*2 - 11k*2 + 3k*4 + 2k*3 - 10k + 4 = 0. Calculate k. -2, 1 Let w(u) be the second derivative of 3u5/80 + u4/16 - u3/2 - 3u*2/2 - 21u - 7. Solve w(h) = 0. -2, -1, 2 Suppose 88/5o - 12o*2 - 48/5 + 18/5o*3 - 2/5o*4 = 0. What is o? 2, 3 Let s = 30 + -34. Let c(x) = 8x*3 - 10x*2 + 8x - 2. Let u(w) = -15w3 + 20w*2 - 16w + 4. Let v(g) = su(g) - 7c(g). Factor v(n). 2(n - 1)2(2n - 1) Let k = -66 + 261. Factor kv*3 - 210v*4 - 84v*2 + 12v + 75v5 - 26v*3 + 38v*3. 3v(v - 1)2(5v - 2)2 Factor 83w*2 - 2w - 43w2 + 2w - 44w2 + 2w*4 + 2w*3. 2w*2(w - 1)(w + 2) Let w = -932/1105 - 15366236/7735. Let b = 1992 + w. Factor -b + 16/7v - 2/7v2. -2(v - 4)*2/7 Solve -10/11n*2 - 2/11n*3 + 0 - 12/11n = 0. -3, -2, 0 Let i(c) be the second derivative of 3/40c5 - 3/2c*2 + 5c + 0 - 9/8c4 - 9/4c*3 + 3/20c*6. Suppose i(x) = 0. What is x? -1, -1/3, 2 Let l(x) be the first derivative of -3x*5/10 - 9x4/8 - x3 - 76. Suppose l(a) = 0. Calculate a. -2, -1, 0 Let p = 324 - 1295/4. Suppose 1/4x + 1/4x*2 - p - 1/4x*3 = 0. What is x? -1, 1 Let 1/8s*4 + 0 + 15/8s*3 + 17/8s - 33/8s2 = 0. What is s? -17, 0, 1 Let l(w) = 4w*4 - 10w*3 - 8w*2 + 54w + 36. Let k be 4/10 - (-56)/(-40). Let s(j) = -j*3 - j. Let z(m) = kl(m) - 6s(m). Determine o so that z(o) = 0. -1, 3 Let d(o) be the third derivative of 0o + 0 + 0o3 - 3o*2 + 0o*5 + 1/210o*6 - 1/42o*4. Factor d(b). 4b(b - 1)(b + 1)/7 Let m(r) be the third derivative of r5/60 + r4/24 - r*3/6 + 19r2. Let p(c) = -c3 + 7c2 + 7c - 7. Let j(s) = -35m(s) + 5p(s). Factor j(a). -5a3 Suppose -o + 7 = 2y + 1, -3o = -4y + 2. Factor 1 + 7s2 + 6s*2 - 16s + 3 - s*o. 4(s - 1)(3s - 1) Let p(u) = u - 2. Let f be p(10). Let g be (27/24)/(12/f). Suppose -g - 1/2r + 1/4r2 = 0. What is r? -1, 3 Let p(j) be the first derivative of j6/120 + j5/20 + j4/8 - 4j3/3 - 12. Let h(q) be the third derivative of p(q). Factor h(z). 3(z + 1)*2 Suppose 5y + 10 = 45. Let i(w) be the second derivative of 1/15w6 + 4/3w*3 - 4w*2 + 0 - 2/5w*5 + 1/2w*4 + yw. Factor i(c). 2(c - 2)2(c - 1)(c + 1) Determine b so that -13/6b*2 - 2b + 0 - 1/6b3 = 0. -12, -1, 0 Let c(y) = 3y*3 + 2y*2 - 3y. Let x(z) = 7z3 + 5z*2 - 6z + 1. Let l(s) = -10c(s) + 4x(s). Factor l(o). -2(o - 2)(o + 1)*2 Let v(b) be the second derivative of 2b2 + 0 - b3 + 28b + 1/6b4. What is h in v(h) = 0? 1, 2 Let n(h) be the second derivative of -h7/21 - 14h6/15 - 16h*5/5 + 64h*4/3 + 7h + 6. Factor n(y). -2y2(y - 2)(y + 8)2 Determine x so that 2/5x*3 + 3/5x*2 - 18/5x - 1/10x4 + 27/10 = 0. -3, 1, 3 Let y(f) = -3f*2 - 10f + 1. Let w be (-66)/48 + 3/8. Let a(z) = -z + 1. Let o(p) = wy(p) + a(p). Determine g, given that o(g) = 0. -3, 0 Suppose 0 = 5q - 2q - 15. Let h(i) = 12i*2 - 22i - 12. Let n(y) = -11y2 + 21y + 11. Let j(l) = qh(l) + 6n(l). Factor j(d). -2(d - 3)(3d + 1) Let u = -1092 + 3278/3. Let x(q) be the first derivative of 5/3q*2 - 4/3q - uq3 - 1. Suppose x(h) = 0. Calculate h. 2/3, 1 Let g(s) = -s2 + 26s - 163. Let l be g(11). Factor -6/5 + 3/5cl + 3/5c. 3(c - 1)(c + 2)/5 Let q(a) be the first derivative of 0a4 + 13 + 0a*2 - 1/15a*5 + 0a + 0a3. Let q(f) = 0. What is f? 0 Let o(v) be the first derivative of -7v*3/6 - 15v*2/2 - 4v - 104. Suppose o(u) = 0. Calculate u. -4, -2/7 Let p(k) = -k*2 + 9k - 6. Let n be p(1). Factor 888v - 2v*3 - 888v + 0v3 + vn. -v2(2v - 1) Factor 119p*2 - 4p*3 - 4232 + 268p - 796p + 57p*2 - 1220p. -4(p - 23)2(p + 2) Let t(m) = 4m3 - 35m*2 + 137m + 5. Let l be t(5). Determine k, given that 12 - 102k + 375/2k*4 + lk*2 - 825/2k*3 = 0. 2/5, 1 Let z(i) = -2i*3 + 84i*2 + 177i - 44. Let y be z(44). Let -6/7o2 - 4/7o*3 + 2/7 + yo = 0. Calculate o. -1, 1/2 Suppose -t = 3 - 6. Suppose -a = -2m + a, tm - 2a = 3. Determine g, given that -3g*m - 5g*2 + 3g3 + g3 + g + 3g3 = 0. 0, 1/4, 1 Let i(h) = 34h - 12. Let y(n) = n*2 + 2n. Let w(j) = 2i(j) + 18y(j). Determine k, given that w(k) = 0. -6, 2/9 Let b = 55786/5 - 11053. Let j = 106 - b. Factor 3/5p + 1/5p3 + j - p2. (p - 3)*2(p + 1)/5 Let r be (-1)/28-2(4 + -2). Find q such that 12/7q - rq*2 - 36/7 = 0. 6 Let x = 22 - 13. Find i, given that -10i - 64 - 11i3 + i4 - xi + i + 2i + 36i2 = 0. -1, 4 Let k(q) be the second derivative of -q5/20 - 61q4/12 + 125q*3/6 - 63q*2/2 + 7q + 14. Factor k(d). -(d - 1)*2(d + 63) Factor -24z - 6z - 2z3 + 21z*2 + 12 - 5z*2 + 4z. -2(z - 6)(z - 1)2 Let h(f) be the second derivative of f7/56 + 3f6/20 + 3f5/10 - f4/8 - 9f3/8 - 3f*2/2 - 48f - 2. Find a, given that h(a) = 0. -4, -1, 1 Let c(w) = 498w2 - 273w - 159. Let a(k) = -31k2 + 17k + 10. Let n(b) = 33a(b) + 2c(b). Factor n(l). -3(l - 1)(9l + 4) Let u(x) be the third derivative of 1/48x*6 - 10x*2 + 0 - 5/48x*4 + 0x - 5/336x7 + 7/160x*5 + 1/12x*3. Suppose u(y) = 0. Calculate y. -1, 2/5, 1 Factor 388b*2 - 391b*2 - 467 - 167b - 187 - 133b + 66. -3(b + 2)(b + 98) Factor -11n + 5n2 - 3n2 + n2 - n - 44 + 29. 3(n - 5)(n + 1) Let q(r) be the first derivative of -2/25r5 + 0r*4 + 0r*2 + 0r*3 - 1/15r*6 + 0r - 2. Solve q(v) = 0. -1, 0 Suppose 4w + w - 137 = -4r, -2w = -4r + 102. Suppose -r = 3a - 7a. Factor 3t4 - at*4 - 5t*4 + 6t*3 + 14t*5 - 11t*5. 3t*3(t - 2)(t - 1) Let d(p) be the second derivative of -p4/54 + 5p*3/9 + 16p*2/9 + p + 133. Determine y so that d(y) = 0. -1, 16 Let p = 21 + -6. Factor pa + 7a - 6a + 29a2 - 25a*2. 4a(a + 4) Let n(y) be the third derivative of -7y*6/120 + 11y*5/60 + 7y*4/24 - 11y*3/6 - 4y*2 - 2y. Factor n(i). -(i - 1)(i + 1)(7i - 11) Let f(k) be the second derivative of -k4/6 + 2k*3 + 3k + 6. Suppose f(y) = 0. Calculate y. 0, 6 Factor -24h4 - 3h*5 - 280h*3 + 0h*5 + 259h*3. -3h*3(h + 1)*(h + 7) Let z(t) be the second derivative	{ "pile_set_name": "DM Mathematics" }
+ 2j + 85 = q, j + 1 = -b + 18. Solve 0 = -4l + 2y + 14, l + b = -xl - 4y for l. 1 Let n(o) = -o3 - o2 + 14. Let j be n(0). Solve 2u - 2y = -j, y = 5u + 4y + 3 for u. -3 Suppose 0 = -v + 2 + 1, -2v - 3 = -3r. Suppose -1 + 25 = ru. Solve 0 = w, 2a + w + u = 4w for a. -4 Suppose 3n - 4 = 5l - 0, -5n + 10 = -5l. Let k = l - 0. Solve b = 2, -o - k = b - 0 for o. -3 Let u = 111 - 32. Suppose -5f + s = -172, 2s + s - u = -2f. Solve -2d = d - 4l - f, -4d + 3l + 35 = 0 for d. 5 Suppose -5u + 4y + 71 = 0, -u + 3y + 31 = -2y. Solve -2w - 2w = -m, 4m - 5w = -u for m. -4 Let i(d) = -2d - 6. Let n be i(-5). Suppose 8 = 2l, a - l + 0 = -n. Suppose 14 - 2 = -v - 5r, a = -v - 3r - 2. Solve 3 + v = 4g, 0 = -5q + 2g - 18 for q. -2 Let a(t) = -t*2 - 12t + 4. Let w be a(-12). Solve 2s - 8 = wo, s - 2s = o + 5 for o. -3 Let x(s) = s2 + 9s + 2. Let d be x(-9). Solve 7i = 4i + 2c + 4, 2c = di for i. 4 Let x be 27/6 - 1/(-2). Suppose -4m = xa - 9 - 28, 5m - 3a - 37 = 0. Let p = 59 + -56. Solve q - l - p = 0, ml + 27 = -q + 3l for q. -2 Suppose -3 = 2a - 5a. Let s = 1 + 1. Let i = a + s. Solve 0 = u - 4z - 15 + 5, 3u - iz - 3 = 0 for u. -2 Suppose 2z + 2x = 5z - 99, x - 33 = -z. Let w = -18 + z. Solve 0t = -3t - 3d + w, 4t - 4d = 12 for t. 4 Let u(y) = -25 + 50 - 4y2 - y3 - 3y - 22. Let p be u(-3). Solve -1 - p = -2k + 3a, -2a = 5k - 10 for k. 2 Suppose 8 = -4d, 0 = -3j - 3d + 6d + 12. Let p be (6/9)/(j/15). Suppose 3f - pn = -13, n + n + 6 = 4f. Solve q + 23 = fi, 3 = 3q - 4q for i. 5 Let p = -166 + 283. Let v = 68 - p. Let o be v/(-14)(-8)/(-14). Solve -2i = 8, -oq + 0i - 4i = 6 for q. 5 Suppose 10 = -q + 3q. Suppose -p + 5 + 3 = -5n, n - 8 = qp. Let t = 1 - n. Solve t = -a, 0 = -3f + f + 5a + 13 for f. -1 Suppose 4 = -h + 2y, 0 = -h - h + y + 1. Solve 4w - 3z - 20 = 0, hw - 10 + 2 = z for w. 2 Let t be (-8)/36 - 2/(-9). Suppose -3p + p + 4 = t. Let g = p - 0. Solve -g = 2k + 3k - b, -2k + 6 = 3b for k. 0 Let o = 36 - 21. Suppose -4c + o = c. Solve -2i = -r + cr - 12, -2r + 16 = 3i for r. 2 Let s be (-8)/(-12) + 43/3. Suppose x - 1 = 3. Suppose -h - s = -xh. Solve l + 3m = -14, 3l - m + hm = -22 for l. -2 Suppose 10k = 5k. Suppose p - 15 = -kp. Suppose -5l - x = -p, -3x = -l - l + 6. Solve -4f - 2a = 5 + l, -f - 2a = -1 for f. -3 Suppose -6d = -2d - 32. Solve 2p + 16 = 4q, -q - 3p + d = q for q. 4 Let s be 3 + 33/9. Suppose 0 = 3y + 15, -2d - d - y = -s. Solve -5q - 5p = 25, 2q + 8 + 2 = -dp for q. -5 Let c(p) = -p*3 + 9p*2 - 10p + 16. Let d be c(8). Solve d = 4z + z + x, -2z - x = 0 for z. 0 Let i = 11 + -5. Suppose t - it + 25 = 0. Suppose 13 - 3 = ty. Solve 0 = -yl - 3x + 5 + 4, 5x = -2l + 11 for l. 3 Let m = -1417 - -2348. Let c be m/(-42) + 1/6. Let r = c - -32. Solve l - 5 = h, 0l - 2l = -h - r for l. 5 Suppose 3h = -10 - 2. Let n be (-18)/h(-16)/(-24). Solve -4b + 3 = -p - n, 2p + 2b = 8 for p. 2 Let s(i) = i3 - 11i*2 + 11i - 9. Suppose -9 = -4n - 1, h - 16 = -3n. Let m be s(h). Solve 22 = -5q - 2j, 0 = -0q - q + 3j - m for q. -4 Let a = 53 - 49. Solve -4j + 4k - 6k - 14 = 0, j - ak = -8 for j. -4 Suppose h - 4 = 7z - 2z, -4h + 4z + 16 = 0. Suppose 29 = hc + 9. Suppose 0j + cj = 20. Solve -5f = 3b + 3, 5b + 5 = -f + jf for f. 0 Let l = -12 + 16. Suppose -l = -n + 2. Solve -d + 4 = 0, u = -4d + 15 + n for u. 5 Suppose 3v = s + 13, -3v = 5s - 21 - 4. Solve 2i + 3 = -4a + 21, 22 = 2i + va for i. 1 Let t(a) = 5a*2. Let y be t(1). Suppose -2 = yb + j + 17, -2b - j = 10. Let r be 1 - b/((-6)/(-8)). Solve 5d = 4k + k - r, 2d = -8 for k. -3 Let h(t) = t - 2. Let g be h(5). Suppose gm = 3q + 9, 4m = -4q - 3 + 23. Solve -2b - 8 = -3y - m, y - b = 0 for y. 4 Let t be -6 - 01/3. Let l(m) = m3 + 5m*2 - 7m - 2. Let y be l(t). Solve -3a + 3g - 2g = 2, y = 4a + 2g for a. 0 Suppose 5g + q - 11 = -0g, q + 7 = 4g. Solve 3t + g = 4p + 6, 5t = 3p + 3 for t. 0 Let r = -2 + 12. Let o be 10/(((-40)/(-12))/(-5)). Let k be 14/4 + o/10. Solve 2z + k = q, z - r = -z - 2q for z. 1 Let g = -29 + 47. Suppose 20i = gi + 6. Suppose -2 = 4z - 22. Solve 0 = -v - io - 18, 2o = zv - 2o - 5 for v. -3 Let k be 2/(-6)(2 + 7). Let c be 2(-1 + 3) - k. Solve -y + 7 = -6q + 2q, 3y + c = -2q for q. -2 Let s(w) = -7w - 2. Let o be s(-1). Solve f + 3f = oi - 28, -3i + 14 = -f for f. -2 Let a = 40 + -13. Solve -2y = -3k - 5y - a, 4k + 2y = -28 for k. -5 Let d = -49 + 69. Solve 0 = h - 3h + 8, 4h = -r + d for r. 4 Let n be -2 - -42 - (2 - 1). Solve -2z = 3i - 17, -4z = -nz + 4i - 19 for z. 1 Let j(z) = z + 7. Let s be j(-5). Let b be (-3)/(-3) - (3 + -5). Solve bq = 4p + 2 + 1, 6 = -4q + sp for q. -3 Let u = 29 + -24. Solve ud + 40 = -4y, -y + d - 4 = -3 for y. -5 Let s be (9 + -3 - 2)2. Suppose 2k - 2t = 4, k = -st + 3t + 20. Solve 3g - d = d - 10, -kg - 16 = -3d for g. -2 Suppose 0x = -5p + 2x + 36, -5p - x + 42 = 0. Solve g + 23 - p = 5m, 4m = g + 13 for g. -5 Let g(r) = 2r - 11. Let h be g(8). Suppose q + 7 = 2p + 1, hp - 37 = -3q. Solve -po = 4z + 8, -5o = 4z + z + 10 for o. 0 Suppose 4x - 99 - 93 = 0. Suppose -5a = -52 - x. Solve -4m = -4i + 3i + 9, 0 = 4i - a for m. -1 Let d = 24 - 14. Suppose -5z = -0z - 4g + 15, -d = 5z - 3g. Let r = 1 - z. Solve -p - 3l + l = 9, r = l + 3 for p. -3 Suppose -5 = -2p + 5p + 5m, -4p = 4m - 4. Suppose -q = 3, -2o + 2 - p = q. Suppose -6c = -c. Solve y + 1 = -oy + g, c = -2g for y. -1 Let h = -16 + 23. Suppose a - h - 1 = 0. Solve 4y - 15 = 3v, -5y + 2v = a - 18 for y. 0 Let b = -5 - -3. Let c = b + 7. Solve 0g + w + 3 = -5g, -10 = -cw for g. -1 Let f = -20 + 22. Solve -4h = 2m - f, m - 5h - 2 = -1 for m. 1 Suppose -h - 8 = -0h. Let x = -3 - h. Solve 0 = 2b + 3l - 11, -xb - l + 10 = 3l for b. -2 Let l = -42 + 44. Solve -5z - 3n + 10 = 0, z + 0n + ln = 2 for z. 2 Let q = -6 + -3. Let y(v) = v + 12. Let p be y(q). Solve -3g = -4x + 10, pg + 8 = 2x - 0x for g. -2 Let v = -2 - -11. Let c = v - 5. Let z be (-1)/5 - (-80)/25. Solve zu + 4r = -1, cu - 11 = u - r for u. 5 Let v = 70 - 55. Solve -20 = -2y - 4c, -2y + 0c = 3c - v for y. 0 Let b = -28 - -49. Suppose b = 4a + 5. Solve 2z + 5 = n, 3n - z - az - 15 = 0 for n. 5 Suppose 2 = 2c - 2. Solve -j - 7 = -3a - 1, -2a - cj + 12 = 0 for a. 3 Suppose -2l = q + 2, -q + 4l = -9 - 7. Solve -4z = qs + 12, 2s - 4z + z - 14 = 0 for s. 1 Let d(f) = 2f - 1. Let z be d(2). Suppose -u + 37 = -5b, 185 = 5u + 2b + b. Let k = u + -22. Solve 2v - 24 = 4t, -zv + t + k = 2v for v. 2 Let r(z) = 2z - 13. Let p be r(7). Solve 4s - 4y = p + 3, -5s - y - 7 = 0 for s. -1 Suppose -12 = -4r + 12. Suppose -3h - 2q - 2 = 0, r = 3h - 2q - 8. Solve 2y + 6d + 33 = d, 3y - hd + 2 = 0 for y. -4 Suppose 0p + 2p - 4 = 0. Solve 4 + 4 = 2z, w + pz - 9 = 0 for w. 1 Let l be -8((-3)/2 + 1). Solve -2g + 4 = -4k, 1 = -2g - lk - 3 for g. 0 Let v = 10 + -7. Suppose -y + 20 = vy. Solve -27 = -4p - 5q, 12 = yp - 3q + 2q for p. 3 Let f be 1/2 - 2(-28)/16. Solve -5x + 9 = -2o - 1, 16 = fx for o. 5 Suppose 5g - 12 = 2g. Suppose 0 = 4u, 0 = -5k - 2u - u. Suppose 24 = -0v + 3v. Solve k = -n - s - v, 0 = 3n + 2n - gs + 13 for n. -5 Let p(a) = -2a + 5. Let y be p(4). Let c be (-2)/(1y/6). Solve -5i - 1 = cu, u = -3i - 4u + 2 for i. -1 Suppose -g - 4v = 11, -6g = -2g + 5v. Solve gc - 7 = 2c - i, -3c + 3i + 27 = 0 for c. 4 Let x be (-52)/(-91) - (-76)/14. Solve -r - 5d + 20 = 0, -xd = -3r - 2d - 16 for r. 0 Let x be 19/(-57) + (-14)/(-6). Solve 2q = -xo, 2q - q + 6 = o for q. -3 Let h(u) = 2u. Let j be h(-2). Let v be j/6 + (-34)/(-6). Solve 3d + 3 = 5m, 0d - vd - 5 = -4m for m. 0 Let j = 19 + 32. Suppose 11 - j = -5f. Solve 3r = f - 2, -2r + 16 = -4x for x. -3 Let x(i) = 15i3 - 2i*2 + i. Let c be x(1). Let r = c + -12. Solve 3n + 14 = -4p, -rp = -3n - 1 - 1 for p. -2 Let o = -47 + 50. Solve -3n + o = -4u, -2n = -4n - u + 13 for n. 5 Let u(c) = -5c + 3. Let m(t) = 5t - 2. Let p(v) = -5m(v) - 4*u(v). Let q be p(-1). Solve -b + 2 =	{ "pile_set_name": "DM Mathematics" }
= j - h. Round o to six dps. -0.000002 Let p = -2049 - -796. Let r = 1252.9369 + p. Let b = r + 0.054. What is b rounded to three decimal places? -0.009 Let t = 267.278 + -265. Let q = t + -2.3. Let y = -0.0171 - q. Round y to three dps. 0.005 Let b(r) = 2r + 810. Let m be b(0). What is m rounded to the nearest 100? 800 Let d = -3.99 - 0.01. Let i = d + 2. Let j = 2.0000002 + i. What is j rounded to 6 decimal places? 0 Suppose 3q - 26 = 5i - 610, -15 = 3i. Let b be q(1 - (0 - -2)). Let x = b - -4297. Round x to the nearest one thousand. 5000 Let d = 0.085 + -0.0889. What is d rounded to 3 dps? -0.004 Let z = -6.76 - -5.8. Let p = 0.04 - -0.1. Let c = p - z. Round c to the nearest integer. 1 Let c = -872354.02 - 17238.98. Let z = c + 889598.00003. Let t = z - 5. Round t to 4 decimal places. 0 Suppose -68 - 27 = 5i. What is i rounded to the nearest ten? -20 Let s = 3 + -1. Suppose sr - 32172 = -8524. Suppose 51824 - r = -w. What is w rounded to the nearest 10000? -40000 Let p = 10.1556889 - 0.1549189. Let c = -35 + 25. Let k = c + p. Round k to 4 dps. 0.0008 Let i = -19.9 - -39.6. What is i rounded to the nearest integer? 20 Let b be -3 + 44010/2 - 2. Round b to the nearest ten thousand. 20000 Let v = -0.14 + 0.1435. What is v rounded to 3 decimal places? 0.004 Let h = 0.34 - 0.34017. What is h rounded to four decimal places? -0.0002 Suppose -5f = -2f. Suppose f = 5n + 50900 - 295900. What is n rounded to the nearest ten thousand? 50000 Let z = 7.7 + -7. Let q = z + 2.3. Let b = q + -2.99986. Round b to four dps. 0.0001 Let p = 6.87 - 6.86477. Round p to 4 decimal places. 0.0052 Suppose 6 = -3h, 0 = 4d - d + 3h + 98276205. Let i = 4058733 + d. What is i rounded to the nearest 1000000? -29000000 Let v = -25036 - -12274. Let z = v + 8461. Let d be 2/(2-1) - z. What is d rounded to the nearest one thousand? 4000 Let z = 1 + 3. Let r be 2/z - (-16796)/8. What is r rounded to the nearest 1000? 2000 Let r(u) = -780003u - 15. Let l be r(-5). What is l rounded to the nearest 1000000? 4000000 Let y = 2.236 - 2.2. Let u = y - 0.04. Let v = u + 0.00546. Round v to four dps. 0.0015 Let p = 33 - 28.3. Round p to the nearest integer. 5 Let w = 23.0000013 + -23. Round w to 6 decimal places. 0.000001 Let l = 0.4 - -4.6. Let s = -5.000003 + l. Round s to six decimal places. -0.000003 Let u = 2259 + -682. Let o be (-12)/4 + 0 - 744. Let l = o + u. Round l to the nearest one hundred. 800 Suppose -f + 3b - 2167 = 4727, 0 = b + 2. What is f rounded to the nearest one thousand? -7000 Suppose 2r - 20 = -3r. Suppose 8p + rj = 3p - 501, -5p - 5j - 505 = 0. What is p rounded to the nearest ten? -100 Let a = -1.94 + -0.06. Let y = a + -1. Let d = y + 2.9999996. What is d rounded to 7 dps? -0.0000004 Let x = 163.19 - 164. What is x rounded to 1 dp? -0.8 Let b = -8185690648 + 8185686424.970021. Let j = 4223 + b. Let z = 0.03 + j. What is z rounded to 5 decimal places? 0.00002 Let h = -110804076.207214349 + -1246806.892785721. Let k = h + 112050884. Let p = k - 0.9. Round p to 7 dps. -0.0000001 Let f = 18.99999995 + -19. What is f rounded to seven dps? -0.0000001 Suppose 4h + 9 - 93 = -4n, -2h + 4n + 42 = 0. Let c(b) = 17b - 2. Let j be c(2). Let y = j + h. What is y rounded to the nearest ten? 50 Let x be 2/(-22/(-802)). Let j = x - 31. What is j rounded to the nearest one hundred? 400 Let w = 68.0319865567 + -0.0319868667. Let z = w + -68. Round z to seven decimal places. -0.0000003 Let r(s) = -70001s*3 - 3s*2 + 1. Let g be r(-3). Suppose -4 = -4v, 0v = -3q - v + g. Round q to the nearest one hundred thousand. 600000 Let g = 5.669 + -5.5. What is g rounded to 2 decimal places? 0.17 Let s be 0(0 + (-1)/4). Suppose -7d + 4d - 1560000 = s. What is d rounded to the nearest 100000? -500000 Let v = 7.2 - 4.9. Let r = -3.23366 - -0.933621. Let m = v + r. What is m rounded to five decimal places? -0.00004 Let v = 149.08 + -152. Let i = 3 + v. Let w = i - 0.08000003. What is w rounded to seven decimal places? 0 Let l(b) = 686638b - 7. Let k be l(9). Let z = -14779735 + k. Round z to the nearest one million. -9000000 Let h = 13.00000012 - 13. What is h rounded to seven decimal places? 0.0000001 Suppose -2m = -6m - 1018228. Let v = m - -1204557. What is v rounded to the nearest 100000? 1000000 Let z = -0.59 + 0.589908. What is z rounded to five dps? -0.00009 Let i = 0.17 - 0.45. Let d = i + 202.28. Let q = d + -201.99907. Round q to four dps. 0.0009 Let w(i) = -37i + 5. Let t be w(5). Let a be t/((-6)/2)-10. What is a rounded to the nearest 1000? -1000 Let c = -7.3 + 7.238. Round c to 2 dps. -0.06 Let n = -14.46 + 13.759. Let t = 0.9 + n. Let r = t - 0.2. Round r to three decimal places. -0.001 Let a = 355.12 - 346. Let h = a + -9. Round h to one dp. 0.1 Let t = 0.78 + -0.31. Round t to one dp. 0.5 Suppose -5y + 3r + 513838 = -31162, 0 = -3r. Round y to the nearest ten thousand. 110000 Let s = -0.4 + 0.39. Let b = 0.252 + s. Let y = b - 0.2420109. Round y to six decimal places. -0.000011 Suppose -3v - 267 = -4v. Suppose v = -4k + 27. Let z = k - 23. What is z rounded to the nearest ten? -80 Let t = 104 - 33. Let g = t + -43. Let x = g + -28.042. Round x to 2 decimal places. -0.04 Let c = -0.142 + 68.142. Let z = c - 68.0000058. Round z to six decimal places. -0.000006 Suppose 0 = 4j + k - 1011, j - 4k + 755 = 4j. Round j to the nearest 10. 250 Let m = -0.105 + 0.10598. What is m rounded to four decimal places? 0.001 Let z(f) = -f2 - 9f - 5. Let l be z(-8). Suppose lc = -c - 12. Let x be (-215)/c(-1 + -5). What is x rounded to the nearest 100? -400 Let i = -0.1701642562 + 0.0327334676. Let q = i + 10.1374308986. Let j = 10 - q. What is j rounded to seven dps? -0.0000001 Let y = 0.02 - -11.98. Let u = y + -11.99991. Round u to five decimal places. 0.00009 Suppose 4o + 2a = 2o - 498000, 3a = -o - 249000. Round o to the nearest 100000. -200000 Let m = -3.4 + 3. Let z = m + 0.38. Let y = -0.0224 - z. What is y rounded to three dps? -0.002 Suppose 5l + 5q = 940, l + 3q = 132 + 66. Let m = -127 + l. Round m to the nearest ten. 60 Let u(l) = 2717l*2 + 9l + 4. Let p(w) = 8151w2 + 27w + 12. Let s(c) = 4p(c) - 11u(c). Let i be s(-9). Round i to the nearest 10000. 220000 Let v be ((-320)/(-6))/((-6)/832500). What is v rounded to the nearest 1000000? -7000000 Let z = 14101 + -14100.59545. Let t = -30.61645 - z. Let h = 31 + t. Round h to 2 dps. -0.02 Suppose -78267 = 2g + 169209. Let q = g - 126262. Round q to the nearest one hundred thousand. -300000 Let t = 167.1005 + -167. Let l = 3 - 2.9. Let k = l - t. What is k rounded to four decimal places? -0.0005 Let o = -93.00000225 + 93. What is o rounded to seven decimal places? -0.0000023 Let r = 0.03 - 0.29. What is r rounded to 1 decimal place? -0.3 Let p = -10 - -17. Suppose -4c - 3v + v - 18 = 0, -3v - p = 2c. Let t(m) = m3 + 6m*2 + 4m. Let s be t(c). Round s to the nearest ten. 10 Let m = 2.150541 - 2.15. Round m to 4 decimal places. 0.0005 Suppose 2l = -l - 4j + 34943, -3j = 4l - 46593. Let f = l - 3951. Let w = f - 11798. Round w to the nearest one thousand. -4000 Let l = 1.59 + 0.51. Let b = l + -34.1. Let o = b - -31.9937. What is o rounded to three decimal places? -0.006 Suppose 5s + 1 = 16. Suppose -s = x - u, 2x = 6x - 2u + 2. Let t be ((-3)/x)/((-1)/(-9400000)). Round t to the nearest one million. -14000000 Let c = -27336.44 - -27355.38117. Let w = c - 116.94008. Let r = w + 98. What is r rounded to 4 decimal places? 0.0011 Let i be -1(-4 + 1) - 0. Let q(n) = -1500000n. Let g be q(i). What is g rounded to the nearest 1000000? -5000000 Let l = 148 + -126.7. Round l to the nearest 10. 20 Let u = 0.2 - 0.5. Let k = u + 0. Let v = k - -0.2948. Round v to three dps. -0.005 Suppose -12554036 + 3654036 = 5q. What is q rounded to the nearest 100000? -1800000 Let y = 42 + -16. Let t = -29.4 + y. Round t to 0 decimal places. -3 Let d = -0.095 - -0.095047. What is d rounded to five decimal places? 0.00005 Let v be (4 + -1)8/(-6). Let g(b) = -31250b3. Let q be g(v). What is q rounded to the nearest one million? 2000000 Suppose 5r - 3r = 4. Let i be 92396/12 - r/(-6). Round i to the nearest one thousand. 8000 Let m(w) = -w*2 + 10100. Let i be 3	{ "pile_set_name": "DM Mathematics" }
he nearest to 1 in -0.2, -1/4, -10.8, 0.0124? 0.0124 What is the closest to 1 in -275, -2, 0.081? 0.081 What is the nearest to 5 in -0.3, -2, -2/5, -1002? -0.3 What is the nearest to -6 in 2, 1.757, 1/4, 3? 1/4 Which is the nearest to -0.2? (a) 18 (b) -1/4 (c) 1/3 (d) 60 (e) 0.3 b Which is the nearest to 2/7? (a) -23 (b) -0.05 (c) -2/3 (d) -9 b Which is the nearest to 0? (a) 2 (b) 78 (c) 3 (d) 0.3 d Which is the nearest to -1/3? (a) -1/4 (b) -1/2 (c) -32/13 (d) 0.1 (e) 3/5 a Which is the nearest to 96? (a) 3 (b) 4 (c) 0.7 b What is the nearest to -1 in -2/9, 0.2, -6369/7, 2/11? -2/9 Which is the closest to -10? (a) -1/4 (b) -0.1 (c) -0.56 (d) 2 c What is the nearest to -0.01 in -0.1, 10, -0.61, -0.3? -0.1 What is the nearest to -5 in -4346, -0.02, 5? -0.02 What is the nearest to 4/1709 in 2, -0.4, 1.2, -1/2? -0.4 Which is the nearest to -3? (a) -1/8 (b) 0.3 (c) 13/2 a What is the nearest to -2/433 in 2/7, -1/3, 1.2? 2/7 What is the nearest to -3 in 0, 1, -3, -20757? -3 What is the nearest to -0.265 in 0.1, 17, -2, -1/3, 2/9? -1/3 What is the closest to -0.1 in 0.2, -480, 112, -11? 0.2 Which is the nearest to -114? (a) 2/7 (b) 0.3 (c) 5 (d) 3.1 a Which is the nearest to 6? (a) 89 (b) 1.47 (c) -3 b Which is the closest to 1? (a) 286 (b) 103 (c) 1 (d) 2 (e) 5 c What is the closest to -2/1097 in 2, -2/7, 1/3, 3, -6/11? -2/7 Which is the nearest to 2/7? (a) -4 (b) 1/10 (c) -3 (d) -3120 b What is the closest to 2/7 in -0.5, -17/3, 45, 8? -0.5 Which is the nearest to 2? (a) 43 (b) 2 (c) 3 b What is the nearest to 1 in 3/8, 0.35, 5.8? 3/8 What is the closest to 5.8 in 2/5, 54, 11? 11 Which is the nearest to -3/7? (a) -8/31 (b) 0.362 (c) 0.3 a Which is the closest to 0.08? (a) 1/8 (b) 83/20 (c) 18 (d) -0.4 (e) 0 a What is the closest to -4 in 4, 0.4, -37? 0.4 Which is the closest to 49? (a) 3 (b) 2/17 (c) -1/5 (d) 0.04 (e) -8 a Which is the closest to 1? (a) -27 (b) 24 (c) -0.1 (d) -733 c What is the closest to 0.037 in -25, -1.1, -1, -5, 3? -1 What is the nearest to -4 in -21, -1.02, 3, 0.12? -1.02 Which is the nearest to 0? (a) 3 (b) -1/2 (c) 0.25 (d) -0.129 (e) -100 d What is the closest to -53 in 15/13, 0, 4/5? 0 What is the nearest to 0.5 in -3/4, -1.4, -0.4, -1/50? -1/50 Which is the closest to -4? (a) 0.06 (b) 2/9 (c) 0 (d) 224 c Which is the closest to 21/10? (a) -1 (b) -46 (c) -2/13 (d) -2/7 c Which is the nearest to -1? (a) 7 (b) -7.54 (c) -0.1 (d) 35 (e) -0.5 e What is the closest to 2/217 in 0.5, -314, -2? 0.5 What is the closest to -2 in -6.11, -3, -7, -5, -2? -2 Which is the nearest to 0.375? (a) -0.1 (b) 5 (c) 0.3 (d) 12 c What is the nearest to 1/8 in 2/25, -10, 0, -1? 2/25 Which is the closest to -117? (a) -3/2 (b) -7/3 (c) -13.1 c What is the nearest to -1/7 in -0.5, -1/145, -0.03? -0.03 Which is the nearest to 4? (a) -0.05 (b) 0 (c) -1/4 (d) 2 d Which is the nearest to 7? (a) 2/9 (b) -138 (c) 3 (d) 5 d What is the nearest to 0.031 in -0.05, -0.4, 4, -0.1, -2/3? -0.05 What is the closest to -5 in -1, -3, 5, -1.2, -3.1? -3.1 Which is the nearest to 1? (a) 8 (b) 26 (c) -63 (d) -1/7 (e) -0.5 d What is the closest to -0.1 in -1/5, 2/53, 5, -0.07, 3.2? -0.07 Which is the nearest to 0.3? (a) -4 (b) 9/4 (c) 2.1 (d) -4/5 (e) -0.1 e What is the nearest to 1 in 1/2, -9, -3, -0.74, -0.2? 1/2 What is the closest to -1760 in -2/13, 0.4, 3/2, 0.3, 2/7? -2/13 Which is the closest to 13? (a) 2/23 (b) -16 (c) 7 c Which is the closest to -2? (a) 3 (b) -6612 (c) 2 c What is the nearest to 35 in -12, 0.2, 4? 4 What is the closest to -2/9 in -6.1, -309, 2? 2 Which is the closest to 5/78? (a) -1.3 (b) -5 (c) -2 a Which is the nearest to -2/5? (a) 0.04 (b) 1.2 (c) -3 (d) 0.033 d Which is the closest to 3/25? (a) -133 (b) -6 (c) -5 c Which is the closest to 1/4? (a) 8/5 (b) -1 (c) 0.2 c What is the nearest to -1 in 10/9, -1, -26? -1 Which is the closest to 5? (a) 0.309 (b) -0.5 (c) 14 a Which is the nearest to -3/2? (a) 1/5 (b) 60 (c) -88 a Which is the nearest to 8.59? (a) 2 (b) -1 (c) 0.9 a Which is the nearest to 1? (a) -4 (b) 2 (c) 67 (d) -13 (e) -0.15 b What is the closest to 0.3 in 2, 2/5, -23/5, -4? 2/5 What is the nearest to 1 in 19/3, 0.5, -16? 0.5 Which is the closest to -397? (a) -4 (b) 46/9 (c) -6/7 a Which is the closest to 0? (a) 2/7 (b) -1/3 (c) 0.4 (d) -0.1 (e) -1386 d Which is the nearest to -0.3? (a) 34436 (b) 0.2 (c) -0.05 c What is the nearest to 0.1 in -1/3, -2.3, -47/6? -1/3 What is the closest to 0 in 2/9, -16, 4, 0.136? 0.136 Which is the closest to 0.019? (a) -2 (b) 3 (c) -3/7 (d) 2/211 (e) 0.1 d What is the nearest to -1/3 in 129, -3, -1/3? -1/3 Which is the closest to -2/3? (a) 19 (b) -1971 (c) 0.1 c Which is the nearest to 2/3? (a) -1021 (b) 2 (c) 2/3 c Which is the nearest to -3? (a) 0.5 (b) 821 (c) -5 (d) -3 d Which is the nearest to 0.1? (a) -11 (b) -1/3 (c) 5 (d) 57 b What is the closest to 0.2 in -2/3, 0.1, -3, -82/729? 0.1 Which is the closest to 1/4? (a) 0 (b) 9.483 (c) -10/23 a Which is the nearest to -1/3? (a) 14 (b) -4 (c) 5 (d) 2/17 (e) -1 d Which is the closest to -13? (a) 0.5 (b) 6/7 (c) -2/11 (d) 1 c What is the closest to -0.4 in 2, 0.3, 1, 4, 2/11? 2/11 Which is the closest to 3/4? (a) -0.5 (b) -3/8 (c) -1/9 (d) 0.3 (e) 169 d What is the nearest to 1 in -1/79, 2, -3/5, -26, 3/7? 3/7 Which is the nearest to -14? (a) -6 (b) 1/3 (c) -1.3 (d) -7 d What is the nearest to -15.8 in 0.01, -2/9, -2/23? -2/9 Which is the closest to 2/3? (a) 4 (b) 251 (c) 619/3 a What is the closest to -7/1020 in 8, -0.7, 0.1? 0.1 What is the nearest to -0.04 in 0.15, -4, 1? 0.15 What is the closest to -14 in 3, -8, 12? -8 What is the closest to 13/7 in -14, 1, -3/8, 5, -3/2? 1 What is the nearest to 48 in 2, -2, -3, -4/11? 2 Which is the closest to 2? (a) 0.059 (b) -0.1 (c) 0.06 (d) 2/3 (e) 18 d Which is the closest to -0.5? (a) -1/11 (b) -1/8 (c) 1/4 b Which is the closest to -6/5? (a) 0.2 (b) -2.64 (c) 1/11 c What is the closest to 5688 in 3, -5, 1/5? 3 Which is the nearest to -0.1? (a) -1097178 (b) 2 (c) -1 c Which is the closest to 0.02? (a) 18 (b) 25 (c) -19/4 (d) 3 d What is the closest to 0 in -91, 0.4, -0.8? 0.4 What is the closest to 2/5 in -4140, 4, -0.3? -0.3 Which is the nearest to -0.3? (a) -403 (b) 0.4 (c) -4/261 c What is the closest to -0.1 in 0.562, -3, 0.1, -4? 0.1 Which is the nearest to 0? (a) -0.8 (b) -0.6 (c) 2 (d) 3 (e) -2/129 e What is the nearest to 348 in 0.3, 0, 1? 1 What is the closest to -2/7 in 7, -42, 5, -17? 5 What is the closest to -2/7 in -3/4, -15/7, 0.06, -2, -5? 0.06 Which is the nearest to 5/4? (a) 5 (b) -37/5 (c) 1/6 (d) -197 c What is the nearest to -8 in -2/5, -1, 1468? -1 Which is the nearest to 5/28? (a) 122 (b) -2/9 (c) 0.2 c What is the closest to 36/19 in -2, -44, -0.3? -0.3 What is the nearest to 0.2 in -6, 1/10, 22? 1/10 Which is the closest to -0.04? (a) -1/10 (b) -2/7 (c) -5.9 a What is the closest to -1/4 in 3, -69, 2.8, -4? 2.8 Which is the closest to -5351? (a) -1.3 (b) 2/7 (c) -2/3 a Which is the nearest to -0.3? (a) -1 (b) -0.5 (c) 0.10624 b What is the closest to -0.2 in 4/3, -29, -4.6, -2/5, 5/2? -2/5 Which is the nearest to -0.4? (a) 5 (b) -0.5 (c) -0.4 (d) -20.1 (e) 0.4 c What is the closest to 1/4 in -0.8, -0.1874, 0.1? 0.1 Which is the nearest to 4? (a) -5 (b) -4 (c) 6497 b Which is the closest to -2? (a) -24 (b) 1/3 (c) -13 (d) -1 d Which is the nearest to 0? (a) 0 (b) 0.1 (c) -8.9 (d) 16 a What is the nearest to -7 in -0.5, 0.1, -0.9, -88? -0.9 What is the closest to 122 in -1, 4/3, 1/2? 4/3 Which is the closest to 130076? (a) -2/5 (b) 3 (c) 0.2 b What is the closest to -0.1 in 18, -3/8, -23/8? -3/8 Which is the nearest to 0.56? (a) 3/25 (b) 0.5 (c) 0.3 (d) -5 b Which is the closest to 0.2? (a) 4 (b) -0.11 (c) -4 (d) -3.97 b Which is the closest to -32? (a) -0.03 (b) -1/6 (c) 0.2 (d) -3 (e) -0.2 d Which is the closest to -2? (a) 57 (b) -4 (c) 97 (d) 3/5 b Which is the closest to 6? (a) -0.2 (b) -9 (c) 12.5 a Which is the closest to 0.3? (a) 6 (b) 3 (c) -16 (d) 0.5 d What is the nearest to -89 in 1861,	{ "pile_set_name": "DM Mathematics" }
2c = -25. Let q(h) = -h2 - 7h - 7. Calculate the lowest common multiple of q(j) and 11. 33 Let r(m) = m*2 - 8m + 4. Calculate the smallest common multiple of 5 and r(8). 20 Suppose -5h = -2b - 3b - 325, 0 = 2h + 5b - 109. Suppose h = -4r + 2. Let u = r + 35. What is the lowest common multiple of u and 18? 180 Let y(w) = w*3 - 6w*2 + 3w - 2. Suppose -a + 5 + 0 = 0. Suppose 1 = d - a. Calculate the lowest common multiple of y(d) and 10. 80 Let g be (-152)/6 + 4/12. What is the lowest common multiple of 9 and g(1 + (-7)/5)? 90 Find the common denominator of -42/5 and ((-2)/8)/((-25)/1675). 20 Let h(u) = u - 2. Suppose 0 = 2v - 0v - 10, 2f + 2v = 14. Let w be h(f). Calculate the common denominator of (121/(-10))/1 + w and -49/4. 20 Suppose -2z + 12 = -0z. Let g = -4 + 6. What is the least common multiple of g and z? 6 Let j(m) = -2m + 3m - 2m + m*2. Let n be j(-1). What is the lowest common multiple of 9 and (n/5)/(2/40)? 72 Let h be 36/16 + 2/(-8). Suppose -4k - 4 = -hk. What is the lowest common multiple of 4 and -2((-1)/k - 1)? 4 Let p = -3 - -5. Let f(q) = q*2 + 18q + 68. What is the least common multiple of f(-4) and p? 12 Let z be (-2 - -2)(-2)/(-2). What is the common denominator of -93/2 and 2 + 57/18 + z? 6 What is the lowest common multiple of (-16)/6279/(-12) and 22? 682 Let p = 0 + 4. Suppose 2 = -3d + pd. Calculate the least common multiple of 1 and d. 2 Let z be (-6)/21 - 89/7. Let k = 21 + z. Calculate the smallest common multiple of 9 and k. 72 Let b = -246946/407037 + 117/193. Let d = b + -13825/1406. Find the common denominator of d and (24/(-22) + 1)-47. 66 Let c(g) = -g3 - 5g*2 + 7g - 7. Let s be c(-7). Let z = s - 30. Calculate the smallest common multiple of (2 + 4)/(3/2) and z. 12 Let r = 143 + -410. What is the common denominator of (-1)/1 - r/(-18) and -93/2? 6 Let n(c) = 6c - 6. What is the least common multiple of n(4) and 18? 18 What is the lowest common multiple of 3 and (8/(-48) - (-53)/(-42))-7? 30 Let i(y) = -y*2 - 4y + 4. Let u = -20 + 36. What is the least common multiple of i(-4) and u? 16 What is the common denominator of 41/154 and (-41)/22 - 7/((-21)/(-3))? 154 Let d(i) = -26i2 - 2i - 1. Let s be d(-1). Let l = -16 - s. Let u(k) = k*3 - 5k*2 + 3k - 7. What is the least common multiple of u(5) and l? 72 Let c(p) = p*2 - 2p - 2. Let k be c(5). Let t = 19 - k. What is the lowest common multiple of 8 and t? 24 Let w = -20 - -29. Let y = w - 13. Let p = y - -20. What is the lowest common multiple of p and 6? 48 Let k(b) = -b*2 + 5b + 6. What is the smallest common multiple of 6 and k(5)? 6 Suppose -3k - 2 = 7. Let t = k + 9. Suppose 4x + 8i = 5i + 97, x - 28 = -2i. What is the least common multiple of x and t? 66 What is the common denominator of (-86)/41/9 and -3/4? 36 Let k be 4/14 + (-7674)/7. Let m = 9844/9 + k. Find the common denominator of m and 14/3. 9 Let c = -16594 + 365179/22. Suppose t + 17 = -3y, -2 = -y - 5. Calculate the common denominator of c and ((-4)/(-10))/(t/335). 44 Let d = -138 + 62. What is the common denominator of d/2(-1)/8 and -23/3? 12 What is the lowest common multiple of 10 and (3/2)/((-18)/(-12))? 10 Let y be (-3 - (3 + -6)) + 50. Suppose -8m = -3m - y. Calculate the smallest common multiple of m and 6. 30 Let a = -527/6 + 106. Calculate the common denominator of a and -14/3. 6 Let a be 5 - (-1 + (-6)/(-2)). Suppose -y - az - 7 = 2z, 5y - 3z = 21. Calculate the smallest common multiple of 1 and y. 3 Calculate the common denominator of -2 + 2 + (-57)/24 and -95/2. 8 Let w = 53447/10 + -5349. Let n be (-19804)/6 + 3/(-6). Let r = 3323 + n. What is the common denominator of w and r? 30 Let l = 1135 - 2183/2. Let o be ((-244480)/88)/(4/(-10)). Let d = o + -6950. Find the common denominator of l and d. 22 Let l = -38 - -155. Suppose r = 5z + 39, 7r = 4r + 3z + l. Suppose -5f - d = 41 - 104, -3f - d = -r. Calculate the smallest common multiple of 8 and f. 24 Let i = -529 + 2127/4. Find the common denominator of i and -29/20. 20 Calculate the lowest common multiple of 1 and -1 - 440/(-36) - (-6)/(-27). 11 Let f = -4 - -6. Suppose 0 = 2y + 4l - 6 - 0, -2l - 33 = -3y. What is the least common multiple of f and y? 18 Find the common denominator of 41/10 and 5/25 + (-1484)/120. 30 Let t(a) = -60a2 - a - 1. Let o be ((-3)/9)/(4/(-24)). Let r be t(o). Calculate the common denominator of (-4 - -2)/((-24)/r) and -29/3. 12 Let q = -2 + 2. Suppose qu + 72 = 4u. Let h = 6 - -4. What is the smallest common multiple of u and h? 90 Suppose 16845 + 17505 = -3i. Let q be ((-7)/126)/(2/412557). Let u = i - q. What is the common denominator of 95/2 and u? 12 Let d = 196 - 151. Calculate the smallest common multiple of d and 5. 45 Let t(i) = i*2 - 11i - 15. Calculate the lowest common multiple of t(13) and 3. 33 Suppose 5d + 67 = 227. What is the lowest common multiple of 24 and d? 96 Let c be (-524)/(1/(-3) + 0). Let l = -11038/7 + c. Calculate the common denominator of -69/8 and l. 56 Let o(z) = 39z*2 + 2z. What is the least common multiple of 7 and o(-1)? 259 Suppose -p - 7 = -g, 6g + 2p - 49 = g. Calculate the least common multiple of g and 42. 126 Let h = 5 + -3. Suppose 0 = 2i - 4r - 24, 0i - 120 = -5i - 2r. What is the least common multiple of i and h? 22 Suppose -2u - 5r = 256, 5u = 4u - 5r - 138. Find the common denominator of 13/20 and (u/(-20) - -3) + -1. 20 Calculate the common denominator of 154/(-132)21/2 and ((-1)/6)/((-12)/(-207)). 8 Suppose -5f = 3 - 28. Suppose 0 = 2t - g + f, 2g = -5t + t - 6. What is the common denominator of 53/4 and t/(-6)21/10? 20 Let g(x) = -150x2 + 4x - 2. Let n be g(2). Let i = n + 3583/6. What is the common denominator of 35/8 and i? 24 Let u be (-2 + 4 - 6)/1. Let h = -16 + u. Find the common denominator of -51/8 and ((-118)/h)/(4/10). 8 Let l(d) = 5d - 2. Let o be l(-4). Calculate the common denominator of o11/36 and 69/22. 198 Let c(m) = 2m*3 - 3m*2 + 1. What is the lowest common multiple of 11 and c(2)? 55 Let g(w) = 34w3 - w2 + 2w. Let r be g(2). Find the common denominator of -49/4 and r/88 + 1/(-1). 44 Let t = 5737/8 - 711. Calculate the common denominator of 45/8 and t. 8 Suppose 3k + 81 - 18 = 0. What is the common denominator of 1/((-36)/k) + -2 and -133/12? 12 Let u(a) = -11a3 + a2 - 1. Suppose 0 = -2h + 4z + 16, -2h + 0h - 4z = 0. Calculate the lowest common multiple of u(-1) and h. 44 Suppose -2o + 4 = -16. Let r = 10 - -11. Let b = r - 3. What is the lowest common multiple of o and b? 90 Suppose 3t + 4y = 96, 0y = 2t + 5y - 71. Calculate the least common multiple of 12 and t. 84 Let a = -5 + 12. What is the least common multiple of a and 5? 35 Suppose 4c = -c + 50. Let y be 2/(-1 + -1) - 0. Let k = 5 - y. Calculate the least common multiple of k and c. 30 Let a(r) = -r2 - 3r - 2. Let n be a(-5). Let m = n + 17. Calculate the smallest common multiple of 22 and m-1(-4)/10. 22 Let i(b) = 2b2 + b + 3. What is the least common multiple of i(-3) and 4? 36 Find the common denominator of (1 - (-8)/(-2)) + (-6608)/(-1008) and 56/15. 45 Let x be (3/(-2))/(6/(-8)). Let d(h) = h2 - 6h + 5. Let w be d(5). Suppose -xu - u + 30 = w. Calculate the smallest common multiple of u and 22. 110 Suppose 0 = -6h + 127 + 53. What is the smallest common multiple of h and 21? 210 Let w be 2/(442/23266). Let a = w - 529. Let t = -252/5 - -229/10. What is the common denominator of t and a? 22 Let x be 26/3 - 3/(-9). Suppose 2j - 4b = -xb + 42, -5j + 3b + 43 = 0. Calculate the lowest common multiple of j and 11. 11 Let y be (-27)/45 + 168/5. Calculate the common denominator of y/15 + (-1 - 1) and 59/2. 10 What is the common denominator of (-1)/(7/((-266)/(-20)))1 and -55/36? 180 Suppose 4k = -6p + 5p - 11, -2p + 11 = -3k. Let v = -10 + 13. What is the smallest common multiple of v and p? 3 What is the common denominator of 27/(-30)((-1)/(-2) + 0) and 77/26? 260 Let f = -27 + 43. Let x(n) = -n2 + 7n + 6. Let g be x(6). Suppose h + 2*h - g = 0. Calculate the smallest common multiple of h and f. 16 Let u = -10325/66 + 470/3. Let p = -1019 + 10211/10. Find the common denominator of u and p. 110 Let i = -93 -	{ "pile_set_name": "DM Mathematics" }
t x(w) = -j(w) + 3u(w). Let q(r) be the first derivative of x(r). What is f(q(k))? -4k2 Let h(x) be the third derivative of x5/10 - 12x2. Let g = 15 - 12. Let t(p) = -4p + gp - p + 0p. What is h(t(y))? 24y2 Let f(n) = -243329n. Let i(r) = -2r. Give f(i(b)). 486658b Let j(l) = -19l2 - 6. Let d(w) = -39w*2 - 15. Let z(u) = 2d(u) - 5j(u). Let f(r) = 6r. What is f(z(q))? 102q2 Let c(m) = -m2. Let v(i) be the second derivative of -5/2i*3 + 0 + 0i*2 + 14i. Determine c(v(b)). -225b2 Let j(y) = 46y*2 - 107y*2 + 31y*2 + 40y*2. Let o(g) = -7g. Give j(o(f)). 490f2 Let y(b) = 16b*2 + 7b + 14. Let z(m) = -7m2 - 3m - 6. Let n(a) = -3y(a) - 7z(a). Let h(x) = -14x2 + 1 - 1. Give h(n(f)). -14f*4 Let p(i) be the third derivative of -26i*2 + 0i*4 + 1/30i*5 + 0 + 0i*3 + 0i. Let m(g) = g. What is m(p(b))? 2b2 Suppose 3n - 9 - 3 = 0. Let i be 3/(27/15) - (-17)/51. Let b(t) = 102 - 102 - nt2 + 7t*i. Let v(a) = -5a*2. What is b(v(h))? 75h*4 Let a(r) = 84r. Let q(i) = 441i2. Calculate a(q(y)). 37044y*2 Let a(m) = 104 + 7m - 104. Let d(l) = -3l - 1 + 1 + 0. Determine a(d(v)). -21v Let t(i) = -i + 13. Let x be t(11). Let y(g) = 0g2 + 0g*2 - 7g*x - 3g2. Let p(v) be the second derivative of -v3/3 + 2v + 4. Determine p(y(l)). 20l*2 Let h(p) = p. Let x(w) = -5w - 7 + 10 + 10 + w. Give h(x(q)). -4q + 13 Let d(n) = -151n*2 + 9n. Let y(q) = 46q2. Give d(y(h)). -319516h*4 + 414h*2 Let u(h) = 612h - 310h - 301h. Let a(z) be the third derivative of z6/360 + z3/6 - 2z2. Let o(f) be the first derivative of a(f). What is u(o(x))? x2 Let b(l) = 29l*2 + 3l*2 + 36l*2. Let a(t) = 2t. Determine b(a(j)). 272j2 Let a(k) = -7k. Let f(y) be the third derivative of 5y4/6 - 109y*2 + y. What is f(a(i))? -140i Let w(b) = 8b. Let y(o) = -3o. Let j = 35 + -40. Let t(d) = jy(d) - 2w(d). Let k(h) = 57h. Give k(t(q)). -57q Let n(g) = -8g2. Let q(w) = 14w - 16w - 6w. What is n(q(d))? -512d2 Let f(w) = 46w. Let q(u) = 2u2 + 4u - 2783. Give q(f(b)). 4232b2 + 184b - 2783 Let c(u) be the second derivative of 71u4/4 - 4u. Let z(w) = -3w2. Give z(c(b)). -136107b*4 Let a(w) = 226w. Let d(p) = 118p + 1. Calculate d(a(y)). 26668y + 1 Let q(d) = -3d. Let n(k) = 2k*2 + 16k + 41. Give q(n(g)). -6g2 - 48g - 123 Let s(u) = -381u2. Let x(i) be the third derivative of i4/8 + 177i*2. Determine s(x(l)). -3429l*2 Let y(t) = -15t. Let o(s) = 65124s2. What is o(y(n))? 14652900n*2 Let a(z) = -4z - 3z - 7z - 6z - 5z. Let s(j) = -17j. Calculate a(s(i)). 425i Let z(l) = -2l2. Let d(a) = 3a*2 - 6a + 10 - 3a + 3a - 4. Let h = -1 + 2. Let i(s) = -s + 1. Let f(t) = hd(t) - 6i(t). Give z(f(u)). -18u4 Let d(y) = -8y*2. Let v(z) = -105z - 11. Calculate d(v(f)). -88200f2 - 18480f - 968 Let q(y) be the first derivative of 29y3/3 - 2y - 125. Let h(v) = -6v2. Determine h(q(c)). -5046c*4 + 696c*2 - 24 Let r(q) = 12q*2 + 15. Let o(b) = -11b*2 - 11. Let l(i) = -5o(i) - 4r(i). Let v(x) = -5x*2. What is l(v(y))? 175y*4 - 5 Let r(a) = -89a*2. Let q(l) = 44l*2 + 127l. Determine q(r(b)). 348524b4 - 11303b2 Let b(z) be the second derivative of -z3/6 + 4z. Let c(w) = 2w2 + 4. Let p(h) = h2 + 5. Let q(o) = 5c(o) - 4p(o). Calculate b(q(f)). -6f2 Let l(d) = -139d*2. Let i(b) = 46b - 2. What is l(i(r))? -294124r2 + 25576r - 556 Let k(m) = 16042m + 6. Let x(y) = 5y*2. Calculate k(x(g)). 80210g*2 + 6 Let m(i) = -119i. Let h(a) = 15a2 + 4. Give h(m(v)). 212415v*2 + 4 Let j(t) = 5t + 4. Let p(v) = -8v - 6. Let l(b) = -3j(b) - 2p(b). Let f(r) = r2 + r + 1. Let s be f(-2). Let a(m) = -m + 6m + sm. What is l(a(d))? 8d Let r(c) = -2c. Let p(z) = -2z + 500056. Give p(r(s)). 4s + 500056 Let i(d) = 20d. Let o(f) = -1700f + 16. Calculate o(i(t)). -34000t + 16 Let a(s) = 8s - 13. Let o(j) = j2 - 45j. Determine a(o(f)). 8f2 - 360f - 13 Let d(r) = -32r2. Let o(s) be the second derivative of s7/2520 - 5s*4/6 - 19s. Let b(j) be the third derivative of o(j). Calculate d(b(l)). -32l4 Let w(s) = 560426s*2. Let k(j) = 4j. Calculate k(w(t)). 2241704t2 Let f(u) = 6u*2 + 6. Let b(a) = 1. Let w be ((-7)/8 - 0) + (-2)/16. Let o(k) = wf(k) + 8b(k). Let r(s) = 2s. Give r(o(p)). -12p2 + 4 Let h(s) = -3s - 20134. Let f(d) = -d. Determine f(h(v)). 3v + 20134 Let y(p) = -55p + 10. Let w(z) = -137z - 2. What is y(w(n))? 7535n + 120 Let z(n) = 3n. Let h(a) = 93a*2 + 15a. Let k(x) = 23x2 + 4x. Let y(j) = 4h(j) - 15k(j). What is z(y(m))? 81m2 Let w(v) = 36948v - 22v2 + 9 - 36948v. Let n(r) = -2r2. What is w(n(m))? -88m4 + 9 Let h(r) = -r. Let z(m) be the first derivative of m2 + 91m + 293. Give h(z(v)). -2v - 91 Let v(c) = c. Let g(w) = -9w2 + 26608. Determine v(g(r)). -9r*2 + 26608 Let i(d) = -d. Let y(o) = 889o*2 + 7o - 2. Let w(t) = 3t - 1. Let h(l) = 2w(l) - y(l). Give h(i(c)). -889c2 + c Let n(c) = -18c - 22c + 42c. Let h(w) = -2w2 - 82. Give h(n(k)). -8k*2 - 82 Let c(l) be the first derivative of -3l*2 - 112. Suppose 0 = -2m + 5r + 13 + 3, 4r + 8 = 0. Let u(f) = mf - 3f - f. Give u(c(t)). 6t Let q(v) = 12v. Let y(o) be the first derivative of -o*2/2 - 17o + 589. Determine q(y(j)). -12j - 204 Let c(q) = -2q*2. Let u(v) = -25v*2. Let b(j) = 22c(j) - 2u(j). Let t(x) = x2. Determine b(t(r)). 6r*4 Let j(q) = -10q*2 - 12q*2 + 7q2. Let d(h) = h2 - 4h + 4. Let t be d(4). Let u(b) = tb + 1 - 1 - 3b. Give j(u(k)). -15k*2 Let x(y) = -2y. Let b(k) = -k*2 + 5k + 5. Let w(d) = -2d2 + 16d + 16. Let m(n) = 16b(n) - 5w(n). Give m(x(q)). -24q2 Let p(g) = -2288g. Let s(y) = 5y. Calculate p(s(v)). -11440v Let w(p) = -3p. Let u be 1/(-2) - 27/(-6). Let x(g) = 2g. Let r(y) = uw(y) + 5x(y). Let d(o) be the third derivative of o*4/8 - 53o*2. Determine r(d(j)). -6j Let f(r) = -34r + 70 + 6r - 71. Let n(k) be the first derivative of -2k3/3 - 112. Determine n(f(w)). -1568w*2 - 112w - 2 Let s(n) = -3n. Let z(t) = -4t. Let j(m) = -3s(m) + 2z(m). Let u(f) = -5f2 + 12f - 12f + 0f. Calculate u(j(i)). -5i2 Let w(k) = 2k - 14. Let y(u) be the second derivative of -u*3/6 - 7u - 6. Calculate w(y(n)). -2n - 14 Let y(z) be the third derivative of -z4/6 + 53z*2 + 2z. Let g(w) = 39w. Calculate y(g(b)). -156b Let h(m) = -517961m. Let q(x) = 2x*2. Calculate h(q(y)). -1035922y*2 Let o(g) = -18 + 25 - 2g - 7. Let n(j) = -3j - 5. What is o(n(t))? 6t + 10 Let q(b) be the first derivative of -5b2/2 - 48. Let t(l) = 4l. What is q(t(f))? -20f Let n(v) = v2 - 8v + 2. Let y be n(8). Let h(b) = -3b2 - 5b*y + 7b*2. Let s(i) = i - i + 3i. Determine s(h(c)). -3c2 Let t(a) be the second derivative of a5/30 + a3/2 - 4a. Let f(d) be the second derivative of t(d). Let h(s) = 2s2. Calculate f(h(v)). 8v*2 Let o(j) = 7j*2. Let i(w) = w. Let t = -44 + 47. Let c(k) = 4k. Let b(q) = tc(q) - 15i(q). Determine o(b(g)). 63g2 Let w(n) = -n - 5084. Let z(m) = 18m*2. Calculate w(z(d)). -18d*2 - 5084 Let l(r) = -5r2. Let z(n) be the first derivative of -n2/2 - 75. Give l(z(o)). -5o2 Let m(w) = -4666w - 4w2 + 4666w. Let l(y) = y + 11 + 0y - 11. Calculate l(m(z)). -4z*2 Let z(i) = -37i. Let c(y) = 3168y. Determine z(c(k)). -117216k Let x(d) be the second derivative of -d5/40 - d3/6 - 5d. Let p(z) be the second derivative of x(z). Let n(w) = -7w*2. Calculate p(n(t)). 21t*2 Let j(f) = 20790f + 2f2 - 20790f. Let r(i) = 4i2. Determine j(r(u)). 32u*4 Let g(l) = 11l + 2 - 2. Let o(m) = 151m - 34 - 153m + 34. What is o(g(a))? -22a Let y(q) = 34q + 2. Let m(g) = 2378g. What is y(m(r))? 80852r + 2 Let d(g) = 34g2. Let y(k) = k + 1793. Give y(d(t)). 34t*2 + 1793 Let h(x) = -13x - 1. Let m(l) = 3l + 444. Give m(h(j)). -39j + 441 Let k(u) = 0u - 3u - 11 - 5u + 16. Let v(r) = -6r + 4. Let z(n) = -4k(n) + 5v(n). Let d(f) = -26f. What is z(d(o))? -52o Suppose 0 = t - 5y - 0y + 18, y = 4. Let p(r) = 15rt - 11r*2 - 8r*2. Let x(s) be the second derivative of -5s*	{ "pile_set_name": "DM Mathematics" }
osest to 2 in -2/17, 1, n? 1 Let d = 74 + -73.7. Let z = -0.1 - -0.1. Which is the closest to z? (a) -2 (b) d (c) -4 b Let x = 2.9 + -3. Let d = 113 + -117. What is the closest to -1/4 in -0.3, d, x? -0.3 Let y = -33 + 35. Let k = 0.2 - 0.3. Which is the closest to k? (a) -2/7 (b) -5 (c) y a Let o = 29/12 + -8/3. Let y be (-934)/((17 - -3)/(-2)). Let l = y - 94. Which is the nearest to o? (a) l (b) 0 (c) -2/3 b Let f be 6/(-54) - 23/(-45). What is the closest to f in -1, 5, 2? -1 Let j = -4 + 2. Let a = 0.5 + -1.5. Let y = j - a. What is the nearest to 2/5 in y, -2/23, 1/5? 1/5 Let n = -30 - -208/7. Let s = -0.16 - -13.16. Let i = s - 9. What is the nearest to n in i, 2, -0.5? -0.5 Suppose 4n + 5m = -0n - 17, 0 = -3n - 5m - 19. Let x be (-4)/3n/(-12). Let g = -10/11 - -31/22. Which is the closest to g? (a) x (b) 0.4 (c) 2/3 b Let r be ((-16)/(-6))/(8/240). Let j be (-2)/7 + r/84. Which is the nearest to -1? (a) 5 (b) j (c) 0 c Let i = -15 - -15. What is the nearest to 0 in -0.7, 3, i? i Let h(b) = 2 - 3 + b*3 - 5b*2 + 4b*2 + 0. Let q be h(1). What is the nearest to -0.1 in 3/5, 4, q? 3/5 Let k = -104.8 + 106. What is the closest to -2/5 in k, -1/4, 2? -1/4 Let k = 14 + -20. Let s = k + 8. Which is the closest to s? (a) 2/9 (b) -0.4 (c) 0.2 a Let r = -5 + 4.9. Let p = 4.9 - r. Which is the closest to -2/3? (a) 3 (b) p (c) -2/3 c Suppose -y + 4w - 9 = 0, 5y + w - 30 = -4w. Which is the closest to y? (a) 0.5 (b) -1 (c) 5 c Let j be 8/(-2) + (-1182)/(-212). Let o = j - 4/53. What is the nearest to -0.2 in 3, -4, o? o Let n = -0.4 - -1.4. Let g = n + -1. Let m = 2 - g. Which is the closest to -1/3? (a) m (b) -2 (c) 1/12 c Suppose 5q = 2k - 13, 2q - 4q - 5k + 18 = 0. Which is the nearest to q? (a) 2/9 (b) 2 (c) -0.4 c Let i be (-1)/(1 - 5/(-5)). What is the nearest to -0.1 in i, 2/5, 4? i Let n be (18/(-27))/(7/3). Let p = 0.1 - 0. What is the nearest to p in -0.4, -2, n? n Suppose -75 + 3 = -3q. Let n be 126/q + (-1)/4. Which is the closest to -0.1? (a) n (b) -0.4 (c) -4 b Let l be (4/(-38))/(-1 - 0). Suppose 5s = -4s + 27. Which is the closest to 0? (a) s (b) l (c) -0.5 b Let z be (-6)/(-15)(-20)/(-32). Let o = 3 + -8. What is the closest to z in o, 0.4, 2? 0.4 Let u = -1206/7 - -172. What is the nearest to -1 in -5, -1, u? -1 Suppose 4w + 5x + 1 = 2, w = x - 2. Let l = -125/6 - -21. Which is the nearest to w? (a) l (b) 5 (c) 3 a Let p = -15 + 15.4. What is the nearest to -1 in 0.5, 2, p? p Let r = -131 - -128. Which is the closest to -1? (a) r (b) -5 (c) 3/7 c Let h = 0.36 + -0.66. Let j = -3 - -2.9. What is the nearest to 0 in h, j, 5? j Let n = -18 - -18. What is the nearest to n in -0.3, -2, 2/5? -0.3 Let t = -0.8 - 0.2. Let l = -1 - t. Let i = l - -1. Which is the closest to 0.1? (a) -0.2 (b) i (c) 0.5 a Let i be (-24)/15 + 10/(-25). What is the nearest to 0.2 in 5/3, i, -3? 5/3 Let i = 179/385 - 2/55. Let d = -1 - -0.8. What is the nearest to -1/3 in d, i, -3? d Let j = -51/2 + 25. Which is the nearest to 1? (a) -2/7 (b) -3 (c) j a Let g = -3.8 + 2.8. What is the closest to g in 4, 3/20, -2? -2 Let s = 0.96 - -0.04. Let w = -0.06 + 0.56. Let y be (4/(-14))/((-2)/4). What is the nearest to s in w, y, 3? y Suppose i - 5b + 4 = -i, 4i - 2b - 24 = 0. Let c = -10 + i. What is the closest to -1/6 in 3, 0.5, c? 0.5 Let f be ((-4)/(-5))/(8/(-60)). Suppose -2b + 3a + 1 = 2b, -3b + 4a - 1 = 0. Let g be (-2)/fb/1. What is the closest to -2 in 2/9, g, -1? -1 Let u = -12/91 - 2/13. What is the nearest to -1/2 in u, -0.06, 3? u Let t = -19 - -20. What is the closest to -0.3 in -0.2, -2, t? -0.2 Let h = 2.1 + -2.5. Let r be (-16)/5 - 2/(-10). Which is the closest to 0? (a) r (b) 1/3 (c) h b Let j = 15 + -10. Suppose -v - j = -2v. Let d be (-2)/(-12)(v - 1). What is the closest to 1 in d, -1/4, -5? d Let z = -4 - -1. Let g = 47 - 43. Let k be ((-2)/8)/(6/8). What is the nearest to 1 in k, g, z? k Let y = -54.4 - -54. Which is the nearest to 2/7? (a) -2/85 (b) 1/8 (c) y b Let g be -2 + (-10)/(-6) - (-44)/60. What is the nearest to g in 3/2, -0.3, 1/4? 1/4 Suppose -2x - 4n + 0n - 22 = 0, 4x - n = -17. Which is the closest to 0.1? (a) x (b) 5 (c) -32 b Let f = -3.6 - -0.6. Which is the nearest to f? (a) -4/7 (b) -4 (c) -2/5 b Let v = -46/3 + 15. What is the nearest to 0 in v, 2/3, 0.4? v Let r be (-7)/3 + (-4)/(-12). Let a = 2.1 + -2. Let w = 0.1 + a. What is the closest to 2/3 in -3/5, w, r? w Let n = 2/39 + 31/156. Let i = 621/4 - 156. Let x = -93 + 91. Which is the nearest to n? (a) i (b) 2 (c) x a Let x be (3 - -1)/(2/(-1)). Let z = x + 3. What is the nearest to z in -1, -4, 0.5? 0.5 Let h = -137741/18 - -7655. Let m = h - 5/2. Let i = -3 - -2. Which is the nearest to 0.1? (a) 2/3 (b) i (c) m c Let k = -3.937 - 0.063. Which is the nearest to -2/7? (a) 0 (b) 0.3 (c) k a Let h(y) = -y*2 + 3y + 5. Let v be h(4). Let l = 8/9 - 41/36. Which is the closest to v? (a) l (b) 2 (c) 5 b Let q = 12.1 - 11.9. What is the closest to 2/9 in -1, -2, q? q Let z = -873/2 - -422. Let c = z + 83/6. Let t = 1.1 - 1. What is the nearest to c in 6/5, t, -0.5? -0.5 Let b = -1.5 + 4. Let v = 0.5 - b. Let l = -53 + 57. What is the nearest to -1/2 in v, 3/2, l? v Suppose m + 4m = 15. Suppose -4z + 8z - 16 = -4w, 5w - 10 = 5z. Let s = 0.1 - -0.4. Which is the closest to z? (a) s (b) -1/3 (c) m a Let b = 107.6 + -87. Let t = -21 + b. Suppose -3h + 21 = 2h - q, 3h - q = 11. What is the nearest to -1 in -4, h, t? t Suppose q = 2i, 2 = 3q + 3i - 7. Let p be (7/(-5) - 1) + q. Let d(m) = 2m2 + m. Let z be d(-1). What is the closest to z in p, -1/8, -0.1? -0.1 Let r = 12 - 10. Let d = 6.4 + -6. Which is the nearest to r? (a) 3 (b) d (c) -1/6 a Let r = -0.2 + 0.1. Let l = 1/14 - -3/7. Which is the closest to r? (a) l (b) -1/3 (c) -3 b Let a = 18.9 + -19. Let g be (4/2)/((-18)/(-27)). What is the nearest to a in 3/5, g, -0.5? -0.5 Let w = -10 - -9.7. Which is the nearest to w? (a) 1/8 (b) 4 (c) -6 a Let m = 3 - 4. What is the closest to m in 0.3, -1, 4? -1 Let u = 96 + -96.2. What is the closest to u in 2/31, 0, 5? 0 Let g = -7 - -5. Suppose 5j = -2n + 137, 0 = -3j - 3n + 46 + 38. Let v be 1/3 - 3/j. What is the nearest to v in g, 0, -2/5? 0 Let r = 22 + -18. What is the nearest to r in 5, 0.4, 0? 5 Let j = -14 + 5. Let u be ((-1)/(-5))/(3/j). Let z = 2.4 + -2. What is the closest to 0 in z, -1/2, u? z Let l = -0.2 - -0.1. Let n = -11.5 - -11. Let f = 2.1 - 2. Which is the closest to f? (a) 4/9 (b) l (c) n b Let k = 194 - 1354/7. Let n be 2 + 1 + (-50)/20. Let h = -8/7 - -6/7. Which is the nearest to h? (a) k (b) 1 (c) n c Let x = 0.3 + -0.8. Let o = 1.1 - 1.1. What is the closest to -1 in -5, x, o? x Let w(v) = v - 8. Let k be w(6). Let i = k - -2. Which is the closest to i? (a) 2 (b) -3 (c) -1 c Let u = -46 - -41. Which is the closest to 0.2? (a) -4 (b) u (c) 4/9 c Let g be 2/4-1(-18)/15. What is the closest to -0.2 in g, -3, -2? g Let l = -0.05 - -0.15. Suppose -31 - 5 = -2v. Let n be (-4)/v + (-20)/72. Which is the nearest to l? (a) 4 (b) n (c) 0.4 c Let i = -4 - -4.4. Let o be (-4)/(-36)(-1 - 0). Which is the closest to 1? (a) i (b) 4 (c) o a Let f = -2.112 + 0.112. What is the closest to f in -1, 0, 0.4? -1 Let z = -2 - -4. Let x = -0.2 + 0. Let f = -19 + 19. Which is the nearest to f? (a) x (b) 0.5 (c) z a Let j = 1.08 + -1.08. Which is the nearest to 1? (a) j (b) -0.11 (c) -1 a Let v = 2.47 - 0.47. What is the nearest to v in 1/6, -0.1, -1/5? 1/6 Let w be (-4)/(-2)(-1)/(-7). Which is the nearest to 2/3? (a) w (b) 1 (c) 4 b Let v = 0.08 - 0.58. Let g = -22 + 35. Let f = g + -18. What is the nearest to -1/3 in f, -3, v? v Let w = 1.4 + -1.3. Which is the closest to w? (a) 0.3 (b) 0.4 (c) -2/9 a Let p = -5 + 9. Let i = 4 - p. Which is the nearest to 0? (a) i (b) 0.1 (c) 0.3 a Let w = 1/158 + 233/632. Let g(r) = 0r - 2 + r - 1 + r2. Let x be g(0). Which is the closest to 1/2? (a) w (b) x (c) -5 a Suppose 14 = -y - 3r + 2, 2r = -2y - 12. Let d be 17/y - (-2)/3. Let u = 2 + -3. What is the nearest to u in -1/3, 3/2, d? -1/3 Let j = -0.008 - -11.008. What is the closest to 0.1 in j, -2/3, -0.4? -0.	{ "pile_set_name": "DM Mathematics" }
/7 - 15531 = 0. Calculate z. -21, 5177 Factor -4r3 - 96988r*2 + 193988r - 96996. -4(r - 1)2(r + 24249) Determine y, given that 3y3 + 591y*2/2 - 897y/2 + 150 = 0. -100, 1/2, 1 Suppose -3q5/4 + 123q*4/4 + 951q*3/4 - 5079q*2/4 + 1707q - 705 = 0. What is q? -10, 1, 2, 47 Suppose -5o3 - 2280o*2 - 307545o - 10302250 = 0. Calculate o. -203, -50 Solve 2z4 + 1309364z*3 + 214302951194z*2 - 428609830488z + 214305569928 = 0 for z. -327342, 1 Factor -n*3/4 - 4619n*2/4 - 5336099n/4 - 5331481/4. -(n + 1)(n + 2309)2/4 Let 4s*3 - 242620s*2 + 3679392928s - 11035995312 = 0. Calculate s. 3, 30326 Factor 2d3 + 334d*2 - 2436d. 2d(d - 7)(d + 174) Determine z, given that -z5/2 - 434z*4 - 189221z*3/2 - 187489z*2 = 0. -433, -2, 0 Factor 1024n*5 + 110016n*4 + 47985n*3 + 5243n2. n2(n + 107)(32n + 7)2 Factor 5r*3 - 13505r*2 + 9085395r + 45765225. 5(r - 1353)2(r + 5) Solve -g*4/5 + 319g*3/5 + 9147g*2/5 + 67301g/5 + 58474/5 = 0 for g. -13, -1, 346 Suppose -178802t2/5 + 739128t/5 - 763848/5 = 0. Calculate t. 618/299 Suppose 5g4 - 10320g*3 - 197890g*2 + 10320g + 197885 = 0. What is g? -19, -1, 1, 2083 Find x such that 16x3 + 77712x*2 + 77700x + 19424 = 0. -4856, -1/2 Factor 5u4 - 55445u*3 - 110910u*2. 5u*2(u - 11091)(u + 2) Solve 28h*2/3 + 6268h/3 + 17680/3 = 0 for h. -221, -20/7 Find t such that -111t4/5 - 240t*3 + 16326t*2/5 - 17808t/5 + 2793/5 = 0. -19, 7/37, 1, 7 What is a in -3a2 - 127740a - 255468 = 0? -42578, -2 Factor 4h3 + 420h*2 - 10692h + 61468. 4(h - 11)2(h + 127) Factor -2u3/7 + 4u*2 + 552u/7 + 1872/7. -2(u - 26)(u + 6)*2/7 Let -9l*5 - 3138l*4 - 258450l*3 + 2636712l*2 - 4887237l + 1345722 = 0. What is l? -179, 1/3, 2, 7 Factor 4g2 - 860g + 46216. 4(g - 109)(g - 106) Factor -4d3 - 820d*2 - 38588d - 37772. -4(d + 1)(d + 71)(d + 133) Factor -2q*2/3 - 1559180q/3 + 1559182/3. -2(q - 1)(q + 779591)/3 Determine c so that -c*5/2 + 189c*4 - 26934c*3 + 1753375c*2 - 96080883c/2 + 308764980 = 0. 9, 83, 120 Suppose -2x2/7 - 6227436x/7 - 4847619891762/7 = 0. What is x? -1556859 Determine f so that 28f4 + 15724f*3 + 2204148f*2 - 956524f - 1263376 = 0. -281, -4/7, 1 Factor -8t3 - 2t*2/7 + 220t/7. -2t(t + 2)(28t - 55)/7 Factor 3t2 - 1050t + 25272. 3(t - 324)(t - 26) Determine n, given that -2n4 + 53180n*3 - 471316608n*2 + 1391954907136n + 2785795506176 = 0. -2, 8864 Determine h, given that 3h3 - 990h*2 + 8709h - 13482 = 0. 2, 7, 321 Find s, given that -3s2/5 - 6160596s/5 - 3162745256268/5 = 0. -1026766 What is x in 35x2 + 149x + 54 = 0? -27/7, -2/5 Suppose 2s3 - 17608s*2 + 37859808s + 3964060800 = 0. Calculate s. -100, 4452 Factor 5m2/4 - 491605m/4 - 245805/2. 5(m - 98322)(m + 1)/4 Solve -5q2 + 295q + 25680 = 0. -48, 107 Solve l*2/2 + 286415l + 82033552225/2 = 0. -286415 Determine w, given that 172w3/7 - 2414w*2/7 + 1216w - 42 = 0. 3/86, 7 Solve -10h4 - 436h*3 + 5416h*2 - 10736h + 3456 = 0 for h. -54, 2/5, 2, 8 What is g in 260g4/7 + 2868g*3/7 - 136g*2 - 11472g/7 - 352/7 = 0? -11, -2, -2/65, 2 Factor -3z3/5 + 8742z*2/5 - 6394692z/5 + 38054088/5. -3(z - 1454)2(z - 6)/5 Factor 3b4 + 2421b*3 + 7245b*2 + 7239b + 2412. 3(b + 1)3(b + 804) Factor -2i2/3 - 918i + 11048/3. -2(i - 4)(i + 1381)/3 What is c in -c*4/2 + 467c*3/2 + 1663c*2 - 1896c = 0? -8, 0, 1, 474 Factor 2b4 - 174b*3 - 192b*2 + 1384b + 2112. 2(b - 88)(b - 3)(b + 2)2 Factor 5g*2/4 - 35520g + 252334080. 5(g - 14208)2/4 Determine g so that -400g*4 + 25760g*3 + 183084g*2 + 309276g = 0. -33/10, 0, 71 Let -2q4 + 406q*3 - 23682q*2 + 305226q - 518940 = 0. What is q? 2, 15, 93 Let 3a5 - 423a*4 + 22113a*3 - 531441a*2 + 5668704a - 19131876 = 0. What is a? 6, 27, 54 Factor 3g4 + 9324g*3 + 37260g*2 + 37248g. 3g(g + 2)*2(g + 3104) Factor 858050h2 - 15720h + 72. 2(655h - 6)*2 Factor 31l*3 - 68l*2 + 43l - 6. (l - 1)*2(31l - 6) Determine l, given that 2l*3/5 - 12262l*2/5 - 36804l/5 = 0. -3, 0, 6134 Factor -3g3 + 5378g*2/3 - 807580g/3 + 1243256/3. -(g - 298)*2(9g - 14)/3 Factor -2y*3/7 - 22y*2 - 2120y/7 + 696. -2(y - 2)(y + 21)(y + 58)/7 Find z such that z2 - 1070z + 86416 = 0. 88, 982 Determine k so that -k*2/2 + 6115k + 294672 = 0. -48, 12278 Factor -4a5 + 2552a*4 - 426692a*3 + 6190144a*2. -4a*2(a - 311)*2(a - 16) Solve 3z3/8 - 25785z2/8 = 0 for z. 0, 8595 Determine s so that -s3/4 - 786s2 - 6285s/4 - 1571/2 = 0. -3142, -1 Factor 2v4/15 + 3164v*3/15 + 111720v*2 + 20065500v + 135056250. 2(v + 7)(v + 525)3/15 Factor -d4/2 - 207d3 - 41589d*2/2 + 130410d - 198450. -(d - 3)*2(d + 210)2/2 Find o, given that o4/7 - 7211o3/7 + 43215o*2/7 + 108067o/7 + 57640/7 = 0. -1, 8, 7205 Find k, given that -2k4 + 2646k*3 + 106236k*2 = 0. -39, 0, 1362 Find g, given that -8g*5 - 820g*4 + 30004g*3 + 17228g*2 - 76796g + 30392 = 0. -131, -2, 1/2, 1, 29 Factor -4w2 + 82776w - 496512. -4(w - 20688)(w - 6) Solve -2d3/17 + 90d*2/17 + 10004d/17 - 20352/17 = 0. -53, 2, 96 Let -n*4/3 + 5316n*3 - 63520852n*2/3 - 169644192n - 1018375744/3 = 0. What is n? -4, 7978 Factor -5f3/6 - 230f*2/3 - 3275f/2 - 7245. -5(f + 6)(f + 23)(f + 63)/6 Solve -22u*4 - 202u*3 - 18u*2 + 162u = 0 for u. -9, -1, 0, 9/11 Suppose -s*5/3 + 2039s*4/3 - 347476s*3 + 3100816s*2/3 + 4169728s/3 - 4145296 = 0. Calculate s. -2, 2, 3, 1018 Factor -z*2 - 15265z - 15264. -(z + 1)(z + 15264) Solve 34d*4/7 - 10748d*3/7 - 378482d*2/7 + 435132d/7 - 45936/7 = 0 for d. -33, 2/17, 1, 348 Factor 4a3 + 3866a*2/7 + 276a/7. 2a(a + 138)(14a + 1)/7 Factor -2i2/7 + 3522i/7 + 38252. -2(i - 1834)(i + 73)/7 Suppose 2z3/17 - 750z*2/17 + 4446z/17 - 6642/17 = 0. What is z? 3, 369 Suppose -k*3/3 + 35k*2 - 2714k/3 = 0. Calculate k. 0, 46, 59 Find n, given that 4n5/5 - 268n*4/5 + 5204n*3/5 - 30932n*2/5 + 25992n/5 = 0. 0, 1, 9, 19, 38 Find n, given that -6n4/11 + 140n*3/11 - 850n*2/11 + 940n/11 - 224/11 = 0. 1/3, 1, 8, 14 What is g in g*5/4 - 251g*4/4 + 5229g*3 - 142884g*2 - 148176g = 0? -1, 0, 84 Suppose -2042f2 + 6f/13 = 0. Calculate f. 0, 3/13273 Factor -q*4 - 10186q*3 - 25938648q*2 + 10186q + 25938649. -(q - 1)(q + 1)(q + 5093)*2 Solve 4i*5 - 12i*4 - 7704i*3 + 127528i*2 + 278100i + 142884 = 0. -49, -1, 27 Determine g, given that -3g3 + 99g*2 - 78g - 576 = 0. -2, 3, 32 Factor -3481t3/2 + 190747t*2/2 + 19452t + 990. -(t - 55)(59t + 6)2/2 Suppose j2/4 - 361j - 244341/4 = 0. What is j? -153, 1597 Determine x, given that -2x*2/3 + 154x/3 + 6432 = 0. -67, 144 Suppose a*2/4 - 1637a/4 - 819/2 = 0. What is a? -1, 1638 Find s such that -3s5/2 + 36s*4 + 258s*3 + 360s*2 = 0. -4, -2, 0, 30 Let 4l*5 + 16l*4 - 572l*3 - 40l*2 + 1712l - 1120 = 0. Calculate l. -14, -2, 1, 10 Suppose -2j5 + 2194j*4 + 4396j*3 + 4j*2 - 4394j - 2198 = 0. Calculate j. -1, 1, 1099 Let -3i3 - 126108i*2 - 252207i - 126102 = 0. Calculate i. -42034, -1 Factor -4o5 + 23008o*4 - 33085504o*3. -4o*3(o - 2876)*2 What is v in 4v*2 - 478144v = 0? 0, 119536 What is p in -p*2 - 4331p - 30268 = 0? -4324, -7 Find g, given that 2g2 - 564972g - 564974 = 0. -1, 282487 Factor 2y3 - 182y*2 - 672y + 10152. 2(y - 94)(y - 6)(y + 9) Solve -2p*3/9 + 26p*2/9 + 316p/9 - 80 = 0 for p. -9, 2, 20 Determine v, given that -v*5/2 + 273v*4/4 + 1531v*3/2 + 3693v*2/4 - 1323v/2 = 0. -9, -2, 0, 1/2, 147 Factor -3o3/2 + 33939o*2/2 - 2153664o + 68720640. -3(o - 11185)(o - 64)*2/2 Suppose 3x*4 + 5252x*3 + 8747x*2 + 3498x = 0. What is x? -1749, -1, -2/3, 0 What is k in -3k4 - 156543k*3 - 2721864600k*2 - 15752300040000k + 300277368000000 = 0? -17400, 19 Let 3b2/5 - 9182538b/5 + 7026583676787/5 = 0. Calculate b. 1530423 Find d, given that 240d3 + 205915d*2 + 1425390d - 29785 = 0. -851, -7, 1/48 Suppose 8l2/3 - 602l/3 - 152 = 0. Calculate l. -3/4, 76 Let -3q*2 - 9	{ "pile_set_name": "DM Mathematics" }
sing order. 11, 0.1, 2/21, -0.05, -0.1 Put -36, 5, 4, -125 in descending order. 5, 4, -36, -125 Sort -4, -26, -343, 17 in descending order. 17, -4, -26, -343 Put -1/9, 4, 101, -2/17, -1, -0.5 in ascending order. -1, -0.5, -2/17, -1/9, 4, 101 Put -150, -4, -2 in decreasing order. -2, -4, -150 Put -0.3, 0.2281, 2.1, 1/2 in increasing order. -0.3, 0.2281, 1/2, 2.1 Sort -24, -497, 1 in ascending order. -497, -24, 1 Put 9, 160, 1 in ascending order. 1, 9, 160 Sort -3, 1, -5, -12, -188, 3. -188, -12, -5, -3, 1, 3 Sort 3, 2, 6, 155, 1 in increasing order. 1, 2, 3, 6, 155 Sort 0, 53, -0.4, -0.1, 0.3, -1 in decreasing order. 53, 0.3, 0, -0.1, -0.4, -1 Put 18, -2, 1, 0, 17, -4 in descending order. 18, 17, 1, 0, -2, -4 Sort 4, -26909, -4 in ascending order. -26909, -4, 4 Put 2, -26/7, -0.04, 0 in descending order. 2, 0, -0.04, -26/7 Put -38, 102, 2 in descending order. 102, 2, -38 Put -2, -5582, -328 in descending order. -2, -328, -5582 Sort 3, 4, -1, 7, -824 in descending order. 7, 4, 3, -1, -824 Put 2, -1, 712679 in decreasing order. 712679, 2, -1 Sort -0.301, -20/47, -1/2, -2/5 in ascending order. -1/2, -20/47, -2/5, -0.301 Put 1, 1716, 2 in descending order. 1716, 2, 1 Put -5.347, -2, 4 in increasing order. -5.347, -2, 4 Put -1148, -14, 2, -5, -4 in ascending order. -1148, -14, -5, -4, 2 Sort 107, 4, 0.2, -2/23 in ascending order. -2/23, 0.2, 4, 107 Put -0.4, 2/19, 5, 1, 40 in ascending order. -0.4, 2/19, 1, 5, 40 Sort 15, 100, -2, 0, 5. -2, 0, 5, 15, 100 Put -5, -2, 3.56, -3/2, 4, 0.3 in ascending order. -5, -2, -3/2, 0.3, 3.56, 4 Sort 182, 5, 254 in ascending order. 5, 182, 254 Put 3/4, -10.5, -0.3, 266, 2 in descending order. 266, 2, 3/4, -0.3, -10.5 Sort -1061, -10, 25, 3, -2 in descending order. 25, 3, -2, -10, -1061 Put 5662, -3, -11, -1, 3 in descending order. 5662, 3, -1, -3, -11 Put 6, 3, -7, 23, 60 in increasing order. -7, 3, 6, 23, 60 Sort -4, -0.1, -2, 0.2, -0.06 in descending order. 0.2, -0.06, -0.1, -2, -4 Put -6, 54, -2, 4 in ascending order. -6, -2, 4, 54 Sort -3, 29, 2/173, -1/2, 1/2 in descending order. 29, 1/2, 2/173, -1/2, -3 Put 2/3, -237/7, -0.3 in increasing order. -237/7, -0.3, 2/3 Sort 1/6, 4, 83, 0.04, 2 in ascending order. 0.04, 1/6, 2, 4, 83 Sort 2/19, 3, -7, -93, -40 in ascending order. -93, -40, -7, 2/19, 3 Put -4.23, -0.87, -2/7 in descending order. -2/7, -0.87, -4.23 Put 6, -5, -92, 4, -0.5, 1 in decreasing order. 6, 4, 1, -0.5, -5, -92 Sort -5, -1, 1, -2, 90, 2 in ascending order. -5, -2, -1, 1, 2, 90 Put -5, 1, -3, -1, 15175 in descending order. 15175, 1, -1, -3, -5 Put -3, -4/3, 199, 1, -11, -5 in descending order. 199, 1, -4/3, -3, -5, -11 Sort 21, -1, 160, 5, 1, 8 in decreasing order. 160, 21, 8, 5, 1, -1 Sort 4, -1, -1115514 in descending order. 4, -1, -1115514 Put -0.5, -0.06, -61.67 in decreasing order. -0.06, -0.5, -61.67 Sort -6, -2/83, -0.3, -0.06. -6, -0.3, -0.06, -2/83 Put -8, 30302, -4/5, 3, 3/2 in increasing order. -8, -4/5, 3/2, 3, 30302 Sort 0.2, 13, -117, -3. -117, -3, 0.2, 13 Sort -1268, 47, -2 in increasing order. -1268, -2, 47 Sort 3, -8, 1, 2 in descending order. 3, 2, 1, -8 Sort 34/9, 1, 7974 in descending order. 7974, 34/9, 1 Put -423, -2, 29 in descending order. 29, -2, -423 Put 0.03, 393, 0.5, -2/9, -2, 3 in ascending order. -2, -2/9, 0.03, 0.5, 3, 393 Put 0.01, 46.78, 2/5 in decreasing order. 46.78, 2/5, 0.01 Sort -4/5, 2714, -2/23, 4, -1/4 in descending order. 2714, 4, -2/23, -1/4, -4/5 Sort 0, 5, 4, 2, 50756. 0, 2, 4, 5, 50756 Sort -77, -22, 4, -4, -1, 2. -77, -22, -4, -1, 2, 4 Sort -4/7, -0.4, -382/13, -99. -99, -382/13, -4/7, -0.4 Put 0.04, -1/10, 2/525 in descending order. 0.04, 2/525, -1/10 Put 5, -5/2, 2/11, -1126/7 in descending order. 5, 2/11, -5/2, -1126/7 Sort -1/8, 2, 123, 68 in descending order. 123, 68, 2, -1/8 Sort -4, 5, 616, -33, -5. -33, -5, -4, 5, 616 Put 3, -1, -3, 8698 in decreasing order. 8698, 3, -1, -3 Sort -96.3, -0.02, 4/5, 2 in descending order. 2, 4/5, -0.02, -96.3 Sort 16, 2, 9, 55 in descending order. 55, 16, 9, 2 Sort -17, -15, -11, 3, 1. -17, -15, -11, 1, 3 Put -28, -5, -1, 0, 3, -46 in decreasing order. 3, 0, -1, -5, -28, -46 Put 38, -2, -9, -5, -231 in descending order. 38, -2, -5, -9, -231 Put 0.4, 5, 4, 498 in ascending order. 0.4, 4, 5, 498 Sort 32, 62, 17 in descending order. 62, 32, 17 Sort 1, -5, 36, -4, -42, 13. -42, -5, -4, 1, 13, 36 Sort -565, -6, 1/5, -2/7 in ascending order. -565, -6, -2/7, 1/5 Sort -11, -30, 16, -24 in ascending order. -30, -24, -11, 16 Put -9, -2, -3, -0.5, 4, -4/19 in increasing order. -9, -3, -2, -0.5, -4/19, 4 Put 4, 5, -1, -4, -59, 26 in ascending order. -59, -4, -1, 4, 5, 26 Sort -52, 5, -1143 in descending order. 5, -52, -1143 Sort -5, -4, -1, -17, 65, 1 in ascending order. -17, -5, -4, -1, 1, 65 Sort 5, -735, -70, -3, -1, 0 in increasing order. -735, -70, -3, -1, 0, 5 Put -3, 2, -5, -108, -34 in decreasing order. 2, -3, -5, -34, -108 Sort 3, -8, 277/8, 4. -8, 3, 4, 277/8 Put 12, 1454, 2/15 in descending order. 1454, 12, 2/15 Sort 0, -5, 8, 104972. -5, 0, 8, 104972 Sort -5/17, -0.18, 2/5, -1/8. -5/17, -0.18, -1/8, 2/5 Put -1, 2, 1, -1441 in increasing order. -1441, -1, 1, 2 Sort -566, 1/5, -0.792 in increasing order. -566, -0.792, 1/5 Sort -322, -107, -18 in increasing order. -322, -107, -18 Put 0.518, -19/2, -4 in increasing order. -19/2, -4, 0.518 Sort 2/11, 82, -0.2, -23 in decreasing order. 82, 2/11, -0.2, -23 Put 6, -2, 8, -1, 10, 3 in descending order. 10, 8, 6, 3, -1, -2 Sort 8, 1, -2778 in decreasing order. 8, 1, -2778 Put -3, -19, -5, -4, 14, 1 in ascending order. -19, -5, -4, -3, 1, 14 Sort 18, 2, 4, -3, -1, -45 in decreasing order. 18, 4, 2, -1, -3, -45 Put -13, 48, 1, 3, 5, -3 in descending order. 48, 5, 3, 1, -3, -13 Put -8601, -2, -5, -1, -3 in decreasing order. -1, -2, -3, -5, -8601 Put -5, -3, -4, -2, -119 in descending order. -2, -3, -4, -5, -119 Sort -3, 371, -2. -3, -2, 371 Sort -11, 1, -3, 0, -141. -141, -11, -3, 0, 1 Put 0, 219, -2, -3, -9, 4 in descending order. 219, 4, 0, -2, -3, -9 Sort 6/799, -1, -27, -0.1, 4 in descending order. 4, 6/799, -0.1, -1, -27 Sort -0.04, 0.0572, -31 in ascending order. -31, -0.04, 0.0572 Sort -8/39, -3/16, -4. -4, -8/39, -3/16 Sort 5, 4, 31, -7, 29 in descending order. 31, 29, 5, 4, -7 Put 5, -104, -68, 7 in ascending order. -104, -68, 5, 7 Sort -12, 8, -7/6 in decreasing order. 8, -7/6, -12 Put -251, -2, -1, 3/2, 4, -0.1 in decreasing order. 4, 3/2, -0.1, -1, -2, -251 Sort -4, -89, -6, 5, 0, -3 in descending order. 5, 0, -3, -4, -6, -89 Put 11.3, 0, 5, -4, -12, -2 in increasing order. -12, -4, -2, 0, 5, 11.3 Sort 30, 0.2, -1, 1, -2/9, -9 in decreasing order. 30, 1, 0.2, -2/9, -1, -9 Sort -4, 2317, -5, -1, -2 in ascending order. -5, -4, -2, -1, 2317 Put 1, 1253, 3, -5, 0, 4 in descending order. 1253, 4, 3, 1, 0, -5 Sort -1, 2, -337, -2, -54 in decreasing order. 2, -1, -2, -54, -337 Put 4879, -2, -0.4, -0.23 in ascending order. -2, -0.4, -0.23, 4879 Sort -1, 10, -8, 3. -8, -1, 3, 10 Sort 0.3, 0.08, 0, 4/7, 10/41 in descending order. 4/7, 0.3, 10/41, 0.08, 0 Sort -3754, -4, 1, -2, 1/3. -3754, -4, -2, 1/3, 1 Put -7, -4, 1758 in descending order. 1758, -4, -7 Put -5/2, -3, -27/7, 4 in decreasing order. 4, -5/2, -3, -27/7 Sort -17, 1, -0.4, -0.43, -4 in ascending order. -17, -4, -0.43, -0.4, 1 Sort -11, -4, 4, 0, -1, -24 in descending order. 4, 0, -1, -4, -11, -24 Sort -190, -1, -3. -190, -3, -1 Put -2058, -23, -4 in increasing order. -2058, -23, -4 Sort 0, 1, -138, -5 in decreasing order. 1, 0, -5, -138 Sort 0.14, 0.3, -2.335. -2.335, 0.14, 0.3 Put -3, 6, -499, 5, 1 in ascending order. -499, -3, 1, 5, 6 Sort 10/11, -2/3, 4/7, -2, 5, 1.2 in descending order. 5, 1.2, 10/11, 4/7, -2/3, -2 Sort -465.1, 0, 0.2, -6/5, -1, -1/4 in increasing order. -465.1, -6/5, -1, -1/4, 0, 0.2 Put -2, -12, -739 in increasing order. -739, -12, -2 Sort -1396, 2, -4. -1396, -4, 2 Sort -4, 4, 5, 1, 11, 14. -4, 1, 4, 5, 11, 14 Put 7.7, -0.5, 0.3, -16, 2, 0.7 in decreasing order. 7.7, 2, 0.7, 0.3, -0.5, -16 Put 2, -0.3, -4476 in ascending order. -4476, -0.3, 2 Put -38722, -11, -1 in ascending order. -38722, -11, -1 Sort -5, -1/5, -4, -0.06, -29 in descending order. -0.06, -1/5, -4, -5, -29 Sort -2, 7878, -5, -25 in ascending order. -25, -5, -2, 7878 Put -2, -218, -5, 3 in increasing order. -218, -5	{ "pile_set_name": "DM Mathematics" }
e s(f)? False Let j = -82 + 161. Is 23 a factor of j? False Let w(v) = 12v2 - 116v + v*3 + 56v + 2 + 57v. Is w(-11) a multiple of 11? False Suppose 3x = 4x - 71. Is (-3)/(-27) + x/9 a multiple of 8? True Suppose -3f = 4f. Suppose d - 4d + 390 = f. Does 27 divide d? False Let j(p) = p*3 - 4p*2 + 3p + 2. Let y be j(3). Suppose yt = v + v - 36, 2v - 4t = 28. Is 4 a factor of v? False Suppose 8a + 20 = 12a. Suppose -4n = -aw - 114, 0 = 3n + 2n - 5. Is 8 a factor of w/77 + 116/14? True Suppose 5v + 16 = -c, 3v - 2c = -8 + 1. Is ((-5 - -4) + -8)v a multiple of 3? True Suppose v - 4 = -1, 3 = -3s + v. Suppose 2l = d - 16, s = 5d - 3d + 2l - 26. Let f = d - -30. Is 22 a factor of f? True Let f be (2/4)/((-6)/(-2340)). Let i be 2/(-10) + (-26)/(-5). Suppose 4m + g = 552 - 135, 0 = 2m + ig - f. Is m a multiple of 30? False Suppose -3l + 16 = 4d, 2d = -2l - 1 + 11. Suppose -2 = -v + n - 2n, 0 = 2n + l. Let c(a) = 7a - 5. Is c(v) a multiple of 5? False Let j(o) = o*2 - 4o. Let v be j(4). Suppose v = 8q - 10q + 48. Is 5 a factor of q? False Let u = -55 - -45. Does 22 divide 5/u + (-246)/(-4)? False Let a = -62 + 62. Suppose -3r - 3s + 27 = a, -2r + 11 = 5s - 4. Is r a multiple of 10? True Let r(v) = -v*2 - 13v + 14. Let n(y) = -4y2 - 52y + 56. Let q(l) = -l*2 + 8l + 7. Let p be q(9). Let c(h) = pn(h) + 9r(h). Is c(-13) a multiple of 4? False Let q = -106 + 17. Let i = -257 - -132. Let z = q - i. Is 12 a factor of z? True Let l = -126 - -287. Is l a multiple of 7? True Let d = 194 - -4. Is d a multiple of 66? True Let t be (-219)/(-21) - 4/(-7). Let p = t + -10. Does 7 divide p + -2 + 1 - -7? True Is 2(-899)/(-2)2 a multiple of 74? False Let g = 21 - 13. Let z = g - 6. Suppose 12 = zk - 0. Is k a multiple of 3? True Is ((-1690)/(-195))/(1/105) a multiple of 21? False Suppose -16 = -4z + 5l + 5, 3l - 9 = -3z. Suppose -5o = -g - 202, -zg - 67 = -3o + 61. Let u = -15 + o. Is 25 a factor of u? True Suppose 0 = 7v - 5v. Suppose 0 = -4o - 5j + 20, -8 - 12 = -4o - 4j. Suppose -4 = 4u - vu, -ou + 2 = i. Is 7 a factor of i? True Let o(i) = i3 + 14i*2 - 15i + 4. Let f be o(-15). Suppose d - 4v - 1 - 1 = 0, -3v + 65 = fd. Is 7 a factor of (-6)/(-21) + 94/d? True Is 6875/7 - (-67)/(-469) a multiple of 86? False Let f(q) = -q + 22. Let o be f(-10). Suppose 3c = 3u + o + 235, -3u = 2c - 198. Does 31 divide c? True Let q(x) = -7x*3 + 2x*2 - 1. Let b be q(1). Is (-5 + b)/(2(-3)/12) a multiple of 2? True Let u be ((-8)/(-12))/(1/(-3)). Is 2 a factor of (u7/(-4))/((-2)/(-4))? False Suppose -3f - 26 - 59 = -s, -3f + 9 = 0. Is s a multiple of 2? True Let o(n) be the first derivative of -n2/2 + 3n + 7. Let b be o(-9). Does 11 divide (-148)/(-6)b/8? False Let r(u) = 5u - 4. Let c be r(9). Suppose -c - 49 = -i. Does 17 divide i? False Let v be 1 - -105 - (2 - 0). Suppose 5d - v = 501. Suppose -3r + 2k + 73 = k, -d = -5r + k. Is 8 a factor of r? True Let d(c) = 22c + 12. Is 10 a factor of d(9)? True Suppose -2f + 60 = -n + 5n, 5n + 2 = f. Suppose -8m = -10m + f. Suppose 4x - 145 - m = 0. Is x a multiple of 24? False Suppose -19g + 1836 = -13g. Does 23 divide g? False Suppose -424 = -2y + 6n, -n + 8 = n. Is y a multiple of 8? True Let f = 12 - 8. Suppose 4o = 0, fr - 4o = r + 81. Does 10 divide r? False Let o(k) = 5k - 12. Let q(p) = -2p + 11. Let j be q(5). Let a(w) = 4w3 + w2. Let g be a(j). Is o(g) a multiple of 13? True Let c = 12 - 27. Let q(g) = g3 + 16g*2 + 17g + 17. Let k be q(c). Let j(v) = -4v. Does 9 divide j(k)? False Let m(a) = 4 - 9 - 7 - 28a - 6a2 + 4a*2. Is 9 a factor of m(-12)? True Suppose o + 58 = -5b, 2b + 0o - 5o = -34. Is 27 a factor of 1/1-9b? True Let a(b) = b2 + 9b + 2. Suppose -i = -o + 6 + 3, -i - 2o = 12. Does 3 divide a(i)? True Let d be (-6)/(-4) + (-484)/(-8). Suppose 0 = 5m - 5l - 160, -d = -2m + 3l - 0l. Is m a multiple of 17? True Suppose 5s + 15 = 5p + s, -4s = -2p + 6. Is (-1510)/(-70) + p/7 a multiple of 13? False Let l = 1682 - -1990. Is l a multiple of 9? True Suppose 2y - 55 = q - 5, 57 = -q - 5y. Let n = 59 + q. Does 7 divide n? True Let k(z) = 27z - 33. Does 5 divide k(4)? True Let l = 195 - 90. Is l a multiple of 11? False Let f be 4/14 - (-174)/(-21). Let n = f - -25. Is n a multiple of 2? False Suppose -5l - 2r + 250 = 0, -2l = 2l + 4r - 200. Let b = l + -33. Is 17 a factor of b? True Let u = 266 - 68. Suppose s + s = u. Is 18 a factor of s? False Let d(o) = -2o + 8o2 + 0 - o2 + 4 + 2o2. Suppose 0 = -3w - 0t - 2t + 8, 10 = -5t. Is 36 a factor of d(w)? False Let q = -1111 - -3031. Does 15 divide q? True Suppose 0 = -105d + 103d + 592. Is d a multiple of 8? True Let n(u) = 38u*3 - 8u - 3. Let p = 19 - 8. Let o(h) = -13h3 + 3h + 1. Let s(m) = po(m) + 4n(m). Is 3 a factor of s(1)? True Let j = -39 + 42. Is 12/j + (-13)/(-1) a multiple of 2? False Suppose 2r - y = 10 + 1, 22 = 5r + 3y. Suppose -2 = rg - 12. Suppose 2z - gb - 34 = -0b, 13 = z - 5b. Is 6 a factor of z? True Suppose 2z - 71 = -5i, 0 = -3i + z + z + 49. Is 5 a factor of i? True Suppose -2s = -20 + 4. Let r = s + -7. Is -14 + 14 + (32 - r) a multiple of 13? False Let m(c) = 2c2 + 3c - 14. Let y be m(-8). Let z = y - 58. Is 15 a factor of z? False Let j(q) = -q*3 - 17q*2 + q + 24. Let b be j(-17). Suppose 5o = bo. Suppose -2f = -5k - 28 + 146, -3k - 5f + 77 = o. Is 21 a factor of k? False Suppose 29t - 6803 - 12772 = 0. Is 27 a factor of t? True Suppose v - 4f + 32 = -12, -3f - 119 = 4v. Let q = v - -29. Does 12 divide q16/(-36)27? True Suppose -3w = 4m - 1292, 4m - 24w = -29w + 1292. Does 17 divide m? True Let u = -1709 + 3031. Does 13 divide u? False Let c(g) be the second derivative of -g*5/20 + 3g*4/4 - 4g*3/3 - 9g*2/2 - 4g. Let q be c(8). Let i = q - -34. Is i a multiple of 17? False Let v be -21 - (2 - (-2)/(-1)). Let o = v - -40. Does 18 divide o? False Does 4 divide 318(21/9 - 2)? False Let s be -36(-1)/(-2)-3. Let u = -19 + s. Does 7 divide u? True Let h(d) = -6d*3 - 5d*2 + 9d - 2. Does 53 divide h(-6)? True Let i(v) = v*2 + 5v - 2. Let z be i(-6). Suppose 6 = -4b + 2n, z = b + 4n - 8. Suppose b = 2q, -5q = 3g - q - 84. Is 12 a factor of g? False Let k be -8 + 8 + (7 - 2). Suppose r + k = -0. Let a = r - -15. Does 4 divide a? False Let i(f) = f + 1. Let s(r) = -r*2 - 3r - 11. Let u(d) = -4i(d) - s(d). Let t be u(8). Is 18/t + 136/14 a multiple of 7? False Suppose 2h + 12 = 4h + 4d, 0 = -3h + 2d - 6. Suppose h = 4m - m - 357. Is 17 a factor of m? True Suppose -5q - 411 = -3g - 1226, 2q = -3g + 347. Let a = q - -101. Does 42 divide a? False Suppose 240 = 9n - 156. Is n a multiple of 2? True Suppose 0n + 1 = n + 5w, -63 = -5n + 4w. Let k = 11 - n. Suppose k = f + f - 10. Does 2 divide f? False Is 22 a factor of 1154/3 + (-55)/1324? False Let i be 3(-3 - 1576/(-12)). Suppose i + 191 = 6r. Is r a multiple of 16? True Let p(w) = -w3 - w2 + w. Let v(g) = g + 5. Let z be v(-6). Let s(a) = -2a*3 - 11a*2 + 4a + 13. Let x(q) = zs(q) + 3p(q). Is x(6) a multiple of 9? False Let j(u) = 31u + 41. Suppose -5d = 2q + 4 - 36, -4 = 2d + 5q. Is 17 a factor of j(d)? True Let f be (-6)/8 - 120/(-32). Suppose 3t + 210 + 69 = 2n, 418 = fn - 4t. Is n a multiple of 17? False Suppose 5x - 39 - 66 = 0. Let d = x + 2. Let m = 40 - d. Is m a multiple of 17? True Suppose -3v = -6v + 5w + 311, 4 = -w. Suppose v - 33 = 4l. Is l even? True Let a(y) = 3y + 10. Let p be -8 + (-1)/(1/(-4)). Let o be a(p). Is 23 a factor of (91/o)/(5/(-10))? False Let x = -542 + 787. Suppose -i + 85 = -x. Is i a multiple of 12? False Suppose -9216 = -36o + 12o. Is o a multiple of 16? True Suppose r + 4 - 6 = 0. Let f be (5 - -1)(1 - r). Let j = 34 + f. Does 11 divide j? False Let s be 2/(2/(-13)) - 1. Let o be 7/((-49)/14)14/4. Is (-62)/(-4) - o/s even? False Let k(j) = -j3 + 18j*2 + 10j + 25. Let u be k(17). Suppose 2y - 6y + u = 0. Is y a multiple of 15? False Suppose -2y - 70 = 3y. Is 9 a factor of -41/y + (-61)/(-7)? True Let a(i) = i3 - i2 + 2i + 3. Let d be a(-2). Let t = -107 + 76. Let q = d - t. Does	{ "pile_set_name": "DM Mathematics" }
erivative of 2 - 2 - 1 - p*x wrt p? -2p Suppose -2k + 0k + 2 = -4s, 0 = 2s - 2k + 6. Differentiate -sh + 7h - 6h + 1 with respect to h. -1 Suppose -2i + 4 = -0i. What is the derivative of 3b2 + 14b - 14b + i wrt b? 6b What is the second derivative of -127c - c3 + c3 + 8c*4 + 122c wrt c? 96c2 Let z(b) be the third derivative of 5b*8/336 + 5b*4/24 - 8b*2. Find the second derivative of z(j) wrt j. 100j3 Let q = 16 + -10. What is the third derivative of -f2 + 16f6 - 35f*6 + 22f*q wrt f? 360f*3 Let a(r) be the second derivative of -4r*6/15 - 3r*2/2 - 8r. Find the first derivative of a(l) wrt l. -32l3 Let b(a) = 33a + 15. Let v(c) = 8c + 4. Let n(u) = 2b(u) - 9v(u). Differentiate n(i) wrt i. -6 Let p(k) = -5k*3 + 5k + 7. Let d(c) = -2c3 + 3c + 4. Let m(a) = -5d(a) + 3p(a). What is the first derivative of m(n) wrt n? -15n2 Let v = -12 - -17. Let m = v + -2. Find the second derivative of -mg*4 + g - 2g + g*4 wrt g. -24g*2 What is the third derivative of -3s*4 - 2s*4 + 5s*2 + 5s*4 + 3s*4 wrt s? 72s Let k(r) be the second derivative of -1/21r7 + 0r*2 + 0r*6 + 0 + 0r*5 - 1/12r*4 + 0r*3 + 2r. Find the third derivative of k(d) wrt d. -120d2 Find the second derivative of -21 - 14x*3 + 9 - 12 + 4x - 2x + 2x*5 wrt x. 40x*3 - 84x Let c(f) be the second derivative of -f*5 + 47f*2/2 + 9f. Find the first derivative of c(s) wrt s. -60s2 Let o(p) be the third derivative of p8/28 + p5/60 - 15p*2. Find the third derivative of o(n) wrt n. 720n*2 Let o(n) = -5n*3 + 2n*2 - 3n + 2. Let m(j) = -5j3 + 3j*2 - 4j + 3. Let i(s) = 2m(s) - 3o(s). Find the second derivative of i(a) wrt a. 30a Let f(t) be the first derivative of 4t*5/5 + 2t*3/3 - 2. What is the third derivative of f(i) wrt i? 96i Let r(p) = -16p4 + 5p*3 + 11p + 5. Let o(h) = h4 - h3 - h - 1. Let k(l) = 5o(l) + r(l). Find the second derivative of k(y) wrt y. -132y*2 Let j(f) be the first derivative of 2f*6/3 - 7f*3/3 - 10. What is the third derivative of j(g) wrt g? 240g*2 Let w be (1/(-2))/((-3)/72). Suppose 0 = 3d + w, -7 = -3n + d + 9. What is the second derivative of -6y + ny + 0y - y*5 wrt y? -20y*3 Let v(z) be the second derivative of 19z5/20 - z3/6 + 23z. What is the second derivative of v(r) wrt r? 114r Let h(k) be the third derivative of k6/60 + k4/3 + k*3 + 6k*2. Let u(w) be the first derivative of h(w). What is the first derivative of u(r) wrt r? 12r Let c be 0/3(-1 - 0). Suppose c = -p - 3q - 4, -2q - 4 = -4p + 8. What is the first derivative of pz2 + 2 + 0 - 3 wrt z? 4z Let y(o) be the second derivative of -o*7/70 - 2o3/3 + o2/2 - 8o. Let m(z) be the first derivative of y(z). Differentiate m(r) with respect to r. -12r*3 Let l be (1 + 15/(-6))/(6/(-16)). Let s(v) be the first derivative of 3/2v*2 + 1/4v*l + 0v*3 + 0v - 2. Find the second derivative of s(p) wrt p. 6p Find the second derivative of -10q - 4q4 + 5q*4 - 5q*4 wrt q. -48q*2 Let u(c) = 0 + 2c + 6 - c. Let p be u(-4). Differentiate p - 2 + 3 - 2v2 with respect to v. -4v Let y(g) be the second derivative of 9g4/4 + 17g*3/6 + 4g. Find the second derivative of y(a) wrt a. 54 Let s(k) be the second derivative of -k6/30 + k3/2 - 6k. Find the second derivative of s(n) wrt n. -12n*2 Let f(r) = 61r*5 - 3r*4 + 3r*3 + 2r2 - r. Let p(q) = -q4 + q3 + q2. Let d(g) = -f(g) + 3p(g). What is the third derivative of d(v) wrt v? -3660v*2 Let z(f) = -3f*2 + 2f. Let b(w) = w + 1. Let u(v) = -6b(v) + z(v). Let k(o) be the first derivative of u(o). What is the first derivative of k(n) wrt n? -6 Find the third derivative of -4m*2 + 7m3 + m2 + m2 + m2 wrt m. 42 Suppose -3d + 5h = -1, 4d = -h + 5h + 4. Let t(i) = -i + 4. Let a be t(4). Find the third derivative of 0f2 - 3f*4 - 2f*d + af*4 wrt f. -72f Let a(m) be the second derivative of m8/560 + m4/8 + m*3/2 + 4m. Let b(z) be the second derivative of a(z). Differentiate b(j) wrt j. 12j3 Let m(a) be the second derivative of 11a*7/21 + 35a*3/6 + 27a. What is the second derivative of m(o) wrt o? 440o3 Let t(u) = 18u*5 + 6u*2 + 23u + 6. Let c(p) = 36p5 + 11p*2 + 47p + 11. Let x(d) = -6c(d) + 11t(d). What is the second derivative of x(m) wrt m? -360m3 Suppose 0 = -5h - 2 + 12, 0 = 5u - h + 2. What is the second derivative of -3i*2 + ui - 2i + i2 wrt i? -4 Suppose -2g + 0g + 7 = q, -2g + q + 17 = 0. Let w be 14/g - 6/(-9). Find the second derivative of 3x + 2x*3 - wx*3 - 2x wrt x. -6x What is the third derivative of -191n*3 + 43n*2 + 191n*3 + 13n*4 + 14n*4 wrt n? 648n Let t(o) be the first derivative of o8/336 - o5/60 - o*2/2 - 2. Let c(a) be the second derivative of t(a). Find the third derivative of c(x) wrt x. 60x*2 Let p be (-1 - -1)(-15 + 14). Suppose -5j + 5 + 5 = 0. Differentiate ps*4 - 2s*4 + j - 5 with respect to s. -8s*3 What is the second derivative of -7i*5 - 10i + 10i - 3i wrt i? -140i3 Let d(b) be the second derivative of -7b*6/30 - 7b*2/2 + 9b. Differentiate d(l) with respect to l. -28l3 Let h(d) = 1. Let c(v) = 2 + 2 + v + 2. Let l(j) = -6j - 5. Let o be l(-1). Let k(x) = oc(x) - 5h(x). What is the first derivative of k(a) wrt a? 1 Let t(w) = -2w2 - 2w. Let l(y) = -y*2 - y. Let s(h) = 14l(h) - 4t(h). Find the second derivative of s(z) wrt z. -12 Suppose -5s = -0s. Let t be (4 - 4) + 3 + s. Find the third derivative of 7o*3 - 4o*3 - to*3 + 4o*4 - 3o*2 wrt o. 96o Let s(o) = -o + 4. Let c be s(0). Find the second derivative of -7k - k4 + 3k4 + kc wrt k. 36k2 Let c(n) be the second derivative of -n10/10080 + n7/504 + n4/3 - 3n. Let m(i) be the third derivative of c(i). Find the third derivative of m(f) wrt f. -180f2 Let r = 4 - 1. Differentiate 1 - 3 - 5i*r - 3 wrt i. -15i*2 What is the third derivative of 20a*5 + 13a*2 - 13a*6 - 20a*5 wrt a? -1560a3 Let o(c) be the third derivative of -c7/105 - 3c4/4 - 14c*2. What is the second derivative of o(l) wrt l? -24l2 Let m(n) = n3 - n*2 + n - 1. Let z(o) = 10o*3 - 2o*2 + 2o + 9. Let c(d) = 2m(d) - z(d). Differentiate c(v) with respect to v. -24v*2 Suppose -x + 1 = -1. Suppose xr - 3 = 1. What is the second derivative of 1 + 3b5 - 4b - r + 1 wrt b? 60b3 Let a(h) be the third derivative of h8/14 - h5/20 + 27h*2. Find the third derivative of a(g) wrt g. 1440g*2 Let p(d) = -3d3 + d2 - d - 1. Let y be p(-1). Find the first derivative of 2j - y - 3 + 0j + 9 wrt j. 2 Suppose 3b = 4 + 2. Suppose -5n = -j - 12, -bj - 12 = -3n - 3j. What is the second derivative of -2t + 3t - t3 - nt wrt t? -6t Let a(l) be the first derivative of 33l*5/5 - 10l3/3 - l2/2 - 1. Find the third derivative of a(u) wrt u. 792u Suppose -4m + 2m = 0. Let y(f) be the first derivative of -2/3f*3 - f + mf*2 + 2. What is the derivative of y(c) wrt c? -4c Suppose r + 15 = 4r. What is the third derivative of t2 + 6t*3 - rt*2 - 3t*3 wrt t? 18 Let n(m) = 16m*4 - 11m*3 + 11m*2 - 6m. Let s(r) = r4 - r3 + r*2 - r. Let t(l) = 2n(l) - 22s(l). Find the second derivative of t(z) wrt z. 120z2 Let i(y) be the first derivative of y4/4 + 4y3/3 - 7. Find the third derivative of i(b) wrt b. 6 Let h(x) = 15x*3 - 3x*2 - 28x + 3. Let s(d) = -14d3 + 4d*2 + 29d - 4. Let k(i) = 4h(i) + 3s(i). Find the second derivative of k(j) wrt j. 108j Let r(b) = b3 - 6b*2 - 3. Let g(k) = -1. Let a be 2/418/3. Let q(y) = ag(y) - r(y). Find the third derivative of q(x) wrt x. -6 Let w(d) be the second derivative of -3d*3 - 10d*2 + 2d. Differentiate w(j) with respect to j. -18 Let s(q) be the third derivative of -2q6/15 - 4q*3 + 21q*2. Differentiate s(n) with respect to n. -48n*2 Let p(q) = -4 - 4 + 5q*2 + 3q + 0. Let c(v) = -3v2 - 2v + 5. Let b = -2 - -10. Let i(z) = bc(z) + 5p(z). What is the second derivative of i(f) wrt f? 2 Suppose -11 = -j + 3p, -3p = 5j - p - 4. What is the first derivative of -3n*j - 3n*2 - 4 - 3n*4 + 6n*2 wrt n? -12n**3 Find the	{ "pile_set_name": "DM Mathematics" }
lify (sqrt(70)/(sqrt(80)/(sqrt(16)/sqrt(2))))*2. 7 Simplify (2sqrt(228)2)/(sqrt(36)/(sqrt(3) - (sqrt(6)/sqrt(2) + sqrt(3)))). -4sqrt(19) Simplify sqrt(18)/(sqrt(24)/sqrt(4))5. 5sqrt(3) Simplify (21sqrt(128))2. 512 Simplify (-2 + sqrt(81)/sqrt(3))2. -12sqrt(3) + 31 Simplify (sqrt(891) + sqrt(891)2 - sqrt(891))*25. 17820 Simplify (sqrt(1100) - (0 + sqrt(1100))*2) + -2 + -2. -1104 + 10sqrt(11) Simplify (sqrt(10) - sqrt(20)/sqrt(2)5)/(sqrt(20)/(sqrt(10) + sqrt(90))). -16sqrt(5) Simplify -2sqrt(81)/sqrt(3) + sqrt(36)/(1(sqrt(12) + -2sqrt(12))). -7sqrt(3) Simplify 6(sqrt(176) + -1) + -2. -8 + 24sqrt(11) Simplify (4 + (sqrt(847) + 1 - sqrt(847))-1)2. 9 Simplify sqrt(30)/sqrt(6) + 1 + 3 + 0. sqrt(5) + 4 Simplify -4 + -3 + (sqrt(14)/sqrt(2))2 + sqrt(28) + 1. 1 + 2sqrt(7) Simplify (sqrt(500) + sqrt(500)-1 + 0)2. 0 Simplify 1 + sqrt(98) + -4. -3 + 7sqrt(2) Simplify (2 + sqrt(475) + -2)*2 + 0. 475 Simplify sqrt(16)/(sqrt(8) + sqrt(8) + sqrt(200)-1). -sqrt(2)/3 Simplify (sqrt(156) + (sqrt(156) - ((sqrt(156) - -5(2sqrt(156) - sqrt(156))) + sqrt(156))))/(sqrt(48) + sqrt(48)-1 + sqrt(48)). -5sqrt(13)/2 Simplify ((sqrt(120)/sqrt(3))/sqrt(4))/(-11sqrt(5)). -sqrt(2) Simplify sqrt(110)/(-2sqrt(810)). -sqrt(11)/18 Simplify (-1 + sqrt(475) + sqrt(475) - sqrt(19))2 - (5 + 1 + sqrt(19)). -19sqrt(19) + 1534 Simplify 1 + sqrt(80) + 6sqrt(30)/sqrt(6). 1 + 10sqrt(5) Simplify (-1(sqrt(11) - (0 + sqrt(11) + 2) - (sqrt(11) - (sqrt(11) - sqrt(121)/(sqrt(44)/sqrt(4))))))2. 4sqrt(11) + 15 Simplify sqrt(2448) + 1(sqrt(2448) + 1sqrt(2448)) - (sqrt(2448) + 0 + -4). 4 + 24sqrt(17) Simplify (-1(sqrt(539) - (sqrt(539) + (1 + sqrt(539) + -1 - sqrt(539)) + sqrt(539) - sqrt(539)))-3)2. 0 Simplify ((sqrt(80) - (sqrt(80) + -2)) + sqrt(80) + 0 + 4 + (sqrt(80) - sqrt(80)-1) + sqrt(80))*2. 192sqrt(5) + 1316 Simplify ((sqrt(51) + sqrt(204))/sqrt(3))*21. 153 Simplify (sqrt(22)/sqrt(2) + 0)*2 + 5. 16 Simplify (-5 + -3(sqrt(252) + 0))*2. 180sqrt(7) + 2293 Simplify -3 + -3 + sqrt(49)/sqrt(7). -6 + sqrt(7) Simplify (sqrt(136) + -43sqrt(136))/((-3sqrt(96))/sqrt(12)). 11sqrt(17)/3 Simplify (-1sqrt(143)-1 - sqrt(143))/(sqrt(275)1). 0 Simplify 5((sqrt(1539) - (sqrt(1539) - (1 + sqrt(1539)))) + 5 + sqrt(1539))*2 + -1. 1080sqrt(19) + 30959 Simplify sqrt(12)/sqrt(36) - sqrt(3)13. -8sqrt(3)/3 Simplify -4 + (sqrt(7) - sqrt(14)/sqrt(2)1). -4 Simplify (sqrt(63)-2 - (sqrt(7) - (sqrt(7)-1 + -5)))*2 - sqrt(14)/sqrt(162). 719sqrt(7)/9 + 473 Simplify sqrt(16)/(sqrt(8) - sqrt(96)/sqrt(48)). 2sqrt(2) Simplify sqrt(72) + (sqrt(72) - (sqrt(72) - ((sqrt(72) + sqrt(72) + -1)2 + 5))). -18sqrt(2) + 294 Simplify (sqrt(567) + (1sqrt(567))2 + -1sqrt(343))-2. -1134 - 4sqrt(7) Simplify sqrt(405) - (0 + sqrt(405) + 3)*2. -414 - 45sqrt(5) Simplify 0 + sqrt(833) + -1 + sqrt(17) + -2. -3 + 8sqrt(17) Simplify (sqrt(288)-1)/(sqrt(486)-1). 4sqrt(3)/9 Simplify sqrt(153) + -2 - (-5 + sqrt(2448)). -9sqrt(17) + 3 Simplify 4(2sqrt(104))/sqrt(8). 8sqrt(13) Simplify (1(sqrt(70) + sqrt(70) + sqrt(70)1 + sqrt(70) + sqrt(70) + sqrt(70)))/((sqrt(120)2)/sqrt(12)). 3sqrt(7) Simplify ((-2sqrt(726) + sqrt(726))/(sqrt(3)-14))2-6. -363/4 Simplify ((sqrt(1008)4 + -5)2 - sqrt(1008)) + sqrt(1008). -480sqrt(7) + 16153 Simplify -3 + (-3 + sqrt(13) + 0 + sqrt(13) - (sqrt(468)-1 - sqrt(13))). -6 + 9sqrt(13) Simplify -2(sqrt(17) - -1(4 + sqrt(17))). -4sqrt(17) - 8 Simplify (-1sqrt(500))2 + (5 + sqrt(45))2. 30sqrt(5) + 570 Simplify (sqrt(20) + 2(sqrt(20) + (-3sqrt(20) - sqrt(20))))/sqrt(4). -5sqrt(5) Simplify sqrt(95)/(sqrt(5) + sqrt(15)/sqrt(3)) - (sqrt(38)/sqrt(2)3 - sqrt(19))2 - (sqrt(57)/sqrt(3)5 + (2sqrt(19) + -5)2). -177 + 31sqrt(19)/2 Simplify sqrt(88)/(sqrt(648) - (sqrt(648) + (sqrt(648) + sqrt(648)1 - sqrt(648))) - sqrt(648)). -sqrt(11)/18 Simplify ((sqrt(637) + 0 - sqrt(637)) + sqrt(637))2 + 4. 641 Simplify ((sqrt(136)-1)/sqrt(4) - sqrt(34))/(sqrt(6)/sqrt(3)1). -2sqrt(17) Simplify (sqrt(143)/sqrt(44)-1)2 - -1(sqrt(468) + -1 + sqrt(13))*2. -14sqrt(13) + 2565/4 Simplify 2 + (sqrt(605) - (0 + sqrt(605) + sqrt(605))) + (sqrt(605) - (sqrt(605) - ((-1(-1 + sqrt(605)) - sqrt(605)) + sqrt(605)))). -22sqrt(5) + 3 Simplify -1(sqrt(156)/(sqrt(36)/sqrt(3)6))2. -13/36 Simplify (sqrt(396) - (sqrt(396) + 2))2-6-2. 48 Simplify sqrt(36)/(sqrt(60)/(sqrt(5)-2)). -2sqrt(3) Simplify (sqrt(176) - (2 + sqrt(176))*2-6)-1. -1080 - 100sqrt(11) Simplify 6(sqrt(162) - (sqrt(162) + 1 + -3)). 12 Simplify (sqrt(77)/(sqrt(528)/sqrt(3) + sqrt(11) - sqrt(11)))2. 7/16 Simplify ((sqrt(3) + sqrt(3)-1)-4)2 + (4 + 1 + sqrt(3) - sqrt(3)). 5 Simplify (sqrt(19) - (sqrt(171)2)*2)4. -2736 + 4sqrt(19) Simplify sqrt(11) + (-1 + 3sqrt(11) - sqrt(11)) - (((sqrt(11) - (sqrt(11) + sqrt(275))) + sqrt(11))*2 + -2 + sqrt(11)). -175 + 2sqrt(11) Simplify (-2 + sqrt(117)2)2. -24sqrt(13) + 472 Simplify 4 + sqrt(468) + -2 + sqrt(468). 2 + 12sqrt(13) Simplify sqrt(39)/(sqrt(3) + sqrt(27)/(sqrt(72)/sqrt(8))). sqrt(13)/2 Simplify -5((sqrt(2) + (sqrt(60)/sqrt(3) + sqrt(20))/sqrt(10))*2 + 1 + sqrt(32)). -95 - 20sqrt(2) Simplify ((sqrt(102)3)/sqrt(6) - sqrt(51)/(sqrt(3)2))*2. 425/4 Simplify -2(sqrt(1331)4 - sqrt(1331)). -66sqrt(11) Simplify (-2(0 + sqrt(475)))2. 1900 Simplify (-1 + sqrt(208) + 1)2 + 2 + -1sqrt(208). -4sqrt(13) + 210 Simplify ((-2 + sqrt(11))-452)*2. -6400sqrt(11) + 24000 Simplify -6sqrt(8) + -5-1sqrt(2) + -2 + -5. -7sqrt(2) - 7 Simplify ((sqrt(825) - 2sqrt(825)) + sqrt(825) + sqrt(33))/(sqrt(3) + (sqrt(12)2)/sqrt(4)). sqrt(11)/3 Simplify ((sqrt(832) + (sqrt(832) + (-3 + sqrt(832) - sqrt(832)) - sqrt(832)))*2 + (sqrt(13)-3)*2 + 4)-3. -2886 + 144sqrt(13) Simplify (sqrt(13) + (-5sqrt(130))/sqrt(10) + (sqrt(65)/(sqrt(5)4) - sqrt(13)))2. 4693/16 Simplify (-2 + -1 + sqrt(117) - 1-1sqrt(117))2. -36sqrt(13) + 477 Simplify (((sqrt(70) - (sqrt(70)2 + sqrt(70))) + sqrt(70))-3)/sqrt(10) - (2 + (sqrt(7) - 1sqrt(175))2). -114 + 3sqrt(7) Simplify (((sqrt(198)2 + sqrt(198))/sqrt(9) + sqrt(22) + sqrt(22))/sqrt(11))2. 50 Simplify (sqrt(192) + (-2 + sqrt(192) + sqrt(192))2)3 + -2. -168sqrt(3) + 2314 Simplify (sqrt(5200)-3 + -3 + sqrt(5200) - sqrt(5200))*2. 360sqrt(13) + 46809 Simplify (sqrt(99) + -3 - (sqrt(88) + -1sqrt(88))/sqrt(8))4. -12 + 12sqrt(11) Simplify sqrt(363)1 + -2sqrt(3) + 4. 4 + 9sqrt(3) Simplify 42sqrt(19) + sqrt(76)/sqrt(4)5. 13sqrt(19) Simplify (sqrt(65)/(1sqrt(5)) + -1)25. -10sqrt(13) + 70 Simplify ((sqrt(264)2)/sqrt(6))/sqrt(576). sqrt(11)/6 Simplify sqrt(114)/sqrt(150) + (sqrt(114)-1)/sqrt(6). -4sqrt(19)/5 Simplify sqrt(132)/(sqrt(12)-2)3-1 + 5. 3sqrt(11)/2 + 5 Simplify sqrt(153)/(sqrt(9) + sqrt(45)/sqrt(5)) - (2 + sqrt(17)-3 + sqrt(17)). -2 + 5sqrt(17)/2 Simplify -1(sqrt(539) - sqrt(539)2)2. 14sqrt(11) Simplify ((-2sqrt(42))/sqrt(2))/(5sqrt(7)1). -2sqrt(3)/5 Simplify sqrt(60)/(-1sqrt(60)/sqrt(5)). -sqrt(5) Simplify 3(sqrt(171) + 2)*2 + 4. 36sqrt(19) + 529 Simplify sqrt(52)46. 48sqrt(13) Simplify sqrt(9)/(-2sqrt(3)) - (1 + sqrt(108)). -13sqrt(3)/2 - 1 Simplify (-4 + sqrt(34)/sqrt(2) + sqrt(153)/sqrt(144))2. -10sqrt(17) + 681/16 Simplify (-2 + (-2sqrt(320) + sqrt(320) - sqrt(320) - sqrt(320)))2. 96sqrt(5) + 2884 Simplify -6(sqrt(24) + ((2sqrt(240) - sqrt(240) - sqrt(240)) + sqrt(240))/sqrt(10))/(sqrt(128)1). -3sqrt(3) Simplify (2sqrt(1300)6 - (-2 + 1(sqrt(13) + sqrt(39)/sqrt(3))))2. 472sqrt(13) + 181016 Simplify sqrt(637) + 1 - (3(sqrt(325) + sqrt(13) + sqrt(13)))2. -5732 + 7sqrt(13) Simplify ((sqrt(68)4)2 + sqrt(17) - sqrt(17)) + (sqrt(612) + 1 + sqrt(612) - sqrt(17))2. 22sqrt(17) + 3146 Simplify -3sqrt(22)/(sqrt(2)-3). sqrt(11) Simplify sqrt(6)/sqrt(48) - (2 + sqrt(8)/sqrt(4)). -2 - 3sqrt(2)/4 Simplify (sqrt(637) - ((sqrt(637) + sqrt(637)2)*2 - sqrt(637)))5 - (2 + (sqrt(637) - sqrt(637)1)). -28667 + 70sqrt(13) Simplify (sqrt(4)/sqrt(2) + sqrt(2))*21 - (3 + (-1 + sqrt(2))*2). 2 + 2sqrt(2) Simplify sqrt(18)/(sqrt(150) - -1sqrt(150)). sqrt(3)/10 Simplify ((sqrt(110) + -1sqrt(110) + sqrt(110))3)/(5-2sqrt(10)). -3sqrt(11)/10 Simplify ((-1sqrt(108) - sqrt(108))-1	{ "pile_set_name": "DM Mathematics" }
greatest common divisor of 1937024 and 144892? 148 What is the greatest common factor of 130415080 and 5048? 5048 Calculate the greatest common divisor of 613613826 and 4401. 4401 Calculate the greatest common factor of 4055942 and 10807. 107 What is the highest common divisor of 8742 and 4200390? 282 Calculate the greatest common divisor of 5840 and 192640576. 1168 Calculate the greatest common divisor of 69006 and 301134. 186 What is the highest common divisor of 374339 and 1696? 53 Calculate the highest common factor of 26384 and 20144. 16 Calculate the highest common divisor of 318 and 22008939. 159 Calculate the greatest common factor of 16672 and 126248. 8 Calculate the highest common divisor of 13 and 7169. 1 Calculate the greatest common divisor of 1824 and 92256. 96 Calculate the greatest common factor of 448317165 and 492. 123 What is the greatest common divisor of 1373705 and 4715? 205 Calculate the greatest common divisor of 26261156 and 94. 94 Calculate the greatest common divisor of 24669735 and 25125. 1005 Calculate the greatest common factor of 6760 and 450840. 520 Calculate the highest common divisor of 9 and 3780111. 3 Calculate the highest common factor of 16017019 and 36859. 1189 What is the highest common factor of 951102 and 206? 206 Calculate the highest common factor of 10350 and 1857845700. 10350 Calculate the greatest common factor of 144 and 35443. 1 Calculate the highest common divisor of 18912 and 2244027. 591 What is the greatest common factor of 515753 and 7? 7 Calculate the greatest common divisor of 489018658 and 1844. 922 What is the greatest common factor of 3051300 and 7350? 1050 What is the highest common divisor of 42986636 and 9786? 3262 Calculate the greatest common divisor of 12108415 and 6935. 95 What is the greatest common divisor of 1060565 and 157770? 8765 What is the highest common divisor of 10338510 and 98? 98 What is the greatest common factor of 394 and 1648455418? 394 Calculate the highest common divisor of 463386 and 232932. 2478 Calculate the highest common divisor of 11261526 and 534. 534 Calculate the highest common factor of 1197796 and 7564. 244 Calculate the highest common factor of 3028155 and 10. 5 What is the greatest common factor of 616 and 109299806? 154 Calculate the greatest common factor of 41726772 and 459. 459 Calculate the greatest common divisor of 1797772 and 5980. 92 Calculate the greatest common divisor of 2997 and 657099. 27 What is the greatest common factor of 20250 and 44943525? 675 What is the greatest common divisor of 3465980 and 3325? 665 What is the greatest common factor of 379280511 and 1548? 387 What is the greatest common factor of 1233 and 32172532? 137 Calculate the highest common factor of 14 and 237269410. 14 What is the greatest common factor of 1683 and 153087? 33 Calculate the greatest common factor of 112112 and 28886858. 2002 Calculate the highest common factor of 1570 and 2380087030. 1570 What is the highest common factor of 58151880 and 7080? 120 What is the greatest common divisor of 316 and 6846061? 79 What is the highest common divisor of 288 and 99328? 32 What is the greatest common factor of 274467609 and 26? 13 Calculate the highest common factor of 172316 and 105876944. 7492 Calculate the highest common divisor of 2378 and 10382. 58 What is the highest common divisor of 4581 and 2144417? 509 What is the greatest common divisor of 52332 and 19604564? 2492 Calculate the highest common divisor of 1442 and 599914. 14 Calculate the highest common factor of 2023 and 8508160. 289 Calculate the highest common factor of 14300 and 89958440. 2860 What is the highest common factor of 4627 and 58824373? 661 What is the greatest common divisor of 12165256 and 245328? 2152 Calculate the greatest common divisor of 64 and 51805856. 32 Calculate the greatest common factor of 276243179 and 6085. 1217 Calculate the highest common factor of 5194 and 17992758. 742 What is the highest common factor of 15488280 and 972? 108 Calculate the highest common divisor of 15 and 3430811535. 15 What is the highest common divisor of 123147872 and 608? 32 What is the highest common factor of 1188 and 408364? 44 Calculate the highest common divisor of 34446791 and 133. 19 What is the highest common factor of 3124078 and 10858? 178 Calculate the greatest common divisor of 890460360 and 90. 90 Calculate the greatest common divisor of 49198644 and 1188. 1188 What is the highest common factor of 2159 and 1025369552? 2159 Calculate the greatest common factor of 3971 and 63151. 11 Calculate the highest common factor of 143 and 65355862. 143 Calculate the greatest common divisor of 1382846 and 92850. 1238 Calculate the greatest common divisor of 538717 and 157619. 89 Calculate the highest common divisor of 40494636 and 6006. 546 Calculate the greatest common divisor of 209874873 and 3354. 1677 What is the greatest common factor of 283808 and 3559003? 1267 Calculate the greatest common divisor of 3054 and 916709. 509 Calculate the greatest common factor of 432 and 6192128. 16 Calculate the highest common factor of 27951 and 567. 21 What is the highest common divisor of 436104 and 32346? 54 Calculate the highest common factor of 693 and 45210891. 33 What is the highest common factor of 138 and 138590042? 46 Calculate the greatest common factor of 928 and 653084. 4 What is the highest common factor of 521352106 and 1034? 1034 Calculate the greatest common factor of 300610 and 88876. 2614 Calculate the greatest common divisor of 17820950 and 20. 10 What is the highest common factor of 699924 and 28543? 1241 Calculate the highest common divisor of 3855565 and 2485. 35 Calculate the greatest common factor of 87673 and 27623. 1201 What is the highest common factor of 81945609 and 393? 393 What is the greatest common factor of 110675203 and 2389? 2389 Calculate the greatest common factor of 57 and 27403301. 19 What is the highest common factor of 284916646 and 4855? 971 Calculate the greatest common divisor of 35800 and 146310125. 4475 Calculate the greatest common divisor of 40345620 and 49. 49 What is the highest common divisor of 363776 and 8689415? 1421 What is the highest common divisor of 45 and 402565095? 45 Calculate the greatest common divisor of 3196347 and 2192. 137 What is the greatest common divisor of 428432 and 816? 16 What is the greatest common divisor of 43690 and 1262845? 85 Calculate the greatest common divisor of 14431716 and 546. 78 Calculate the highest common factor of 408158 and 7429. 437 What is the highest common factor of 4 and 3172828? 4 What is the greatest common divisor of 1658472 and 12120? 24 Calculate the greatest common divisor of 714 and 104844066. 102 Calculate the highest common factor of 11268 and 54504. 36 Calculate the highest common divisor of 4153095 and 9810. 45 Calculate the greatest common factor of 286 and 62984584. 26 Calculate the highest common divisor of 2882745 and 3525. 705 What is the greatest common factor of 70393419 and 5319? 1773 What is the highest common factor of 4300 and 5921444? 172 Calculate the highest common divisor of 25747875 and 729. 81 What is the highest common factor of 313 and 370? 1 Calculate the highest common divisor of 42104 and 661048. 152 What is the highest common factor of 90 and 7279875? 45 What is the greatest common factor of 2354245803 and 2821? 2821 What is the greatest common divisor of 2 and 13248374? 2 Calculate the highest common factor of 591693 and 134493. 381 What is the greatest common factor of 140 and 16783340? 140 Calculate the highest common factor of 122237 and 15097. 487 What is the greatest common factor of 539301 and 259? 7 Calculate the greatest common divisor of 67 and 567781450. 67 What is the highest common divisor of 118 and 10630974? 118 What is the greatest common factor of 65481 and 8658? 39 What is the highest common divisor of 298628 and 4961? 121 What is the greatest common divisor of 32 and 3234088? 8 What is the highest common divisor of 353139 and 191754? 159 Calculate the highest common factor of 135180 and 5568. 12 Calculate the highest common factor of 11799 and 29587959. 3933 Calculate the highest common factor of 21315 and 407160. 435 Calculate the greatest common d	{ "pile_set_name": "DM Mathematics" }
pose -149p = -146p - 525. What is the hundreds digit of p? 1 Let r = -9 - -13. Suppose 1 = 3k - 4k - rh, 1 = -k + h. What is the tens digit of 1 + -2 - k14? 1 Let k(z) = -z - 5. Let v be k(-8). Suppose a - 3x = -4a + 53, -5x + 59 = va. What is the tens digit of a? 1 Suppose 0 = 3r + r - 180. What is the tens digit of r? 4 Suppose -2d - 2d = -b + 136, -5d - 4b - 170 = 0. Let p = 63 + d. What is the tens digit of p? 2 Suppose 138 = 3r - 309. What is the tens digit of r? 4 Let o = 23 - 20. What is the tens digit of (9/o - -5)5? 4 Suppose -4g + 5 = -3y, -y = g - 2g + 1. Suppose q - w + 3 = -0, gw = 10. Let j = 9 - q. What is the units digit of j? 7 Let j(w) = w3 + 3w*2. Let z be j(-3). Suppose -2a + 12 = -za. What is the units digit of a? 6 Suppose 2f + 49 = 5h, -h - 4f + 11 = -5f. Suppose 2w = 17 + h. What is the tens digit of w? 1 Suppose -6m = 4j - 2m, -3j + 3m + 18 = 0. Let v(z) = -z. Let u be v(-2). What is the units digit of 30(u - 5/j)? 0 Suppose 2q = 1 + 33. Suppose 5k + q - 42 = 0. What is the units digit of k? 5 Let m = 143 - 47. What is the tens digit of ((-1)/3)/((-2)/m)? 1 Let u(v) be the third derivative of v4/12 + v3/6 - 3v2. What is the units digit of u(4)? 9 Let o = 35 - 8. What is the units digit of o? 7 Suppose -3c + 0s + 41 = 2s, -12 = -3s. What is the units digit of (-2)/c + 670/55? 2 Suppose 0 = -2k + 2g + 8, 5g = k + 2g - 2. Let w(u) = u + 0u - k - 2u. What is the units digit of w(-6)? 1 Let m = -4 - -69. What is the tens digit of m? 6 Let y(l) = l2 - 4l - 7. Let h be y(5). Let o be 5 + -1 + 3 + h. Suppose -ow + 32 = -w. What is the units digit of w? 8 Suppose -3b - 4 = -19. What is the units digit of b? 5 Let x = 5 - 3. Suppose 2b - 5j = -xb + 15, -2j = -4b + 18. Suppose -bs + 10 = -10. What is the units digit of s? 4 Let d = -2 + 26. What is the units digit of d? 4 Let a = -11 + 16. What is the units digit of a? 5 What is the hundreds digit of (-200)/15(-171)/12? 1 Let o(z) be the second derivative of -z3 + 2z*2 + 3z. What is the tens digit of o(-2)? 1 Let k = 13 + 148. What is the units digit of k? 1 Let q = 7 + -3. Suppose -5s + 73 = -0r + qr, -3s + 54 = -r. What is the units digit of s? 7 Let m(h) = h*3 + 5h*2 + 4. Let j be m(-5). Suppose 2y + 5r - 18 = 0, -20 = -4y + 2y - jr. What is the tens digit of y? 1 Let c(y) = -2 + y + 3 + 1 - y*3 + 6y*2. Let n be (-31)/(-5) - 1/5. What is the units digit of c(n)? 8 Suppose -4m + 26 = 4o - 58, 5m + 21 = o. What is the tens digit of o? 2 Let m(p) = -21p + 3. Let u be m(-3). Suppose f = 4f - u. What is the tens digit of f? 2 Suppose 3h + 180 = 4q, -5q - 2h = -2q - 135. What is the tens digit of q? 4 What is the tens digit of (-1 + 3)/((-8)/(-136))? 3 Let y(g) = -6g + 10. What is the tens digit of y(-3)? 2 Let k = -22 - -24. Suppose 4m = -ks + 52, -s = 3m - 0m - 28. What is the tens digit of s? 2 Suppose 0 = 2y - 3y - 4. What is the units digit of 4/(-8)y/2? 1 Suppose 500 = 3v + 146. What is the hundreds digit of v? 1 Let t(f) = f*3 + 5f2 - 7. Let c be t(-5). Let r(w) = -w2 - 7w - 1. Let x be r(c). What is the units digit of -7-2x/(-2)? 7 Suppose 20 = 4z - 3z. Suppose -4u = 4a - 2a - z, -2u + 22 = 4a. What is the units digit of u? 3 Let o = -10 + 16. Let t = o - 5. What is the units digit of 2/((-10)/(-8) - t)? 8 Let y = 15 + -9. Let c(f) = -2f + 7. Let r be c(y). Let h = -1 - r. What is the units digit of h? 4 Suppose -5u - 5x - 295 = 0, 5x = 3u - u + 83. Let w = 90 + u. What is the tens digit of w? 3 Let h(l) = -l2 + 10l + 1. Let s be h(8). Suppose -3b + s = 5. What is the units digit of b? 4 What is the units digit of (6 + -1)3/5? 3 Let l = 18 - 10. Let r = 10 - l. Suppose 24 = ro + 2o + 2g, 3o + 2g = 19. What is the units digit of o? 5 Suppose -3j - 486 = -6j. What is the tens digit of j? 6 Suppose 4p - 2u = 112, 4p - 6u = -3u + 116. What is the tens digit of p? 2 Let z(o) = o - 1 - 7 + o. Let j be z(7). Suppose 2 = 2w - j. What is the units digit of w? 4 Let n be (-3 + 1)/((-6)/(-33)). Let z(g) = -2g + 2. Let r be z(-7). Let w = r + n. What is the units digit of w? 5 Let h = -1 + 2. Let i = -1 + h. What is the units digit of -2(2/(-4) - i)? 1 Suppose -9m + 8 = -226. What is the units digit of m? 6 Suppose -y + 5y - x = -295, 2y = -4x - 170. Let u = y - -111. What is the units digit of u? 6 Suppose 35 - 8 = j. Let x = 14 + -22. What is the units digit of j/(-6)x/6? 6 Let i be 3/(3/(-16))-2. Let a = i - 21. What is the units digit of a? 1 Suppose 0 = 2v - 10 + 28. Let m = -5 - v. What is the units digit of (-3 - m)(-12)/14? 6 Suppose 0 = -2h + 328 - 106. What is the units digit of h? 1 What is the hundreds digit of ((-6)/9)/(8/(-1644))? 1 Let g = -5 + 2. What is the units digit of 2 - (g + (1 - 0))? 4 Let h(i) = -i + 7. Let l be h(7). Let y be (l - 0) + (3 - 1). Suppose 2 = yr - 4. What is the units digit of r? 3 What is the units digit of (-1 + 0)/2-4? 2 Suppose 2g + 90 = 3g - v, -v - 3 = 0. What is the units digit of g? 7 Suppose 5z - 990 = -5z. What is the units digit of z? 9 Let b = 23 + -19. What is the units digit of b? 4 Let r = 83 + -48. What is the units digit of r? 5 Suppose 0g - 3g = -o + 5, 2o = -5g + 43. Let s = o + 1. What is the units digit of s? 5 Suppose 0 = -2z - g + 20, -24 = -7z + 3z + 2g. Suppose 0o + z = -4o. What is the units digit of o/4 - (-114)/12? 9 Let k be (-33 - -1)(-36)/24. Suppose k = 3a - 0a. What is the units digit of a? 6 Suppose 3h - 2 = 10, 328 = 2o + 2h. Suppose -r + 0r + 4k = -51, 0 = 4r - 5k - o. What is the tens digit of r? 3 Suppose 4g + x = -19, -g + 0g = 3x - 9. Suppose 8 = 3l - 7l. What is the units digit of g/(-4)l/(-3)? 1 Let j = -156 - -266. What is the units digit of j? 0 Suppose 0 = -4s + 4y - 2y + 174, 0 = 5s - y - 216. What is the tens digit of s? 4 Suppose -5b - 155 = -5d, -170 + 7 = -5d + 3b. What is the tens digit of d? 3 What is the units digit of 4 - 2/(-2)1? 5 Suppose -x + 0x = -5m + 101, -2x - 82 = -4m. Let l be (12/m)/((-1)/(-5)). Suppose lc = a + 7, -5c - 4a = a - 45. What is the units digit of c? 4 Let k(r) = -r + 1. Suppose -h = -3j - 22, j = 5h + 9 - 35. What is the units digit of k(j)? 7 Suppose -4g = -6g + 106. What is the units digit of g? 3 Suppose -7p - p + 2280 = 0. What is the tens digit of p? 8 Let p be (0 + 1)(0 - -21). Suppose 2g - p = -9. What is the units digit of g? 6 Suppose 8v = -v - 36. Let h(w) = 2w2 + 4w - 2. Let b(i) = -1. Let x(d) = -5b(d) + h(d). What is the tens digit of x(v)? 1 Let x = 23 + -21. Suppose 4a - b = b + 194, 5a - 242 = xb. What is the units digit of a? 8 Suppose -2j + 120 = -5b, 2j - j + 5b - 75 = 0. What is the units digit of j? 5 Suppose -12 = -4s, 21 = -2j + 3s - 4. Let l = j - -27. What is the units digit of l? 9 Suppose -o + 2 = o. Let x = o + -1. Suppose xy - 16 = -2y. What is the units digit of y? 8 Suppose -6t + 4t + 346 = 0. What is the tens digit of t? 7 What is the units digit of 308/10 + (21/5 - 4)? 1 Let q be 3(4/(-3) - -2). Suppose -10 = -4o + ql, -3l + 5 = o - l. Suppose -4s + n = -0n - 44, on = 3s - 24. What is the tens digit of s? 1 Let p be (-2)/7 - 16/(-56). Let o = 1 + p. What is the units digit of o? 1 Let w be 4/(-2 - -4) - 1. Let m be 0 + 0/(-2) - w. Let f(u) = -6u3 - u2 - u - 1. What is the units digit of f(m)? 5 Suppose 5v - 8 = 4v. What is the units digit of 14/8 + (-6)/v? 1 Let w(k) = -k3 + k2 + k + 6. Let r be w(0). Let o(g) = -g3 + g2 - 5g2 - g - 4 + r. What is the units digit of o(-4)? 6 Suppose -57 = -3m - 6. Let w = 35 - m. Let l = -4 + w. What is the units digit of l? 4 Let i(k) = -k*3 + 10k*2 + 6k + 1. What is the tens digit of i(8)? 7 Let l(f) be the first derivative of f3/3 - f2/2 - 6f + 3. What is the units digit of l(-3)? 6 Suppose 38 = -3c + j, -j - 62 + 12 = 5c. Let l(u) = u3 + 11u*2 + 2u - 15. Let t be l(c). Let b = t - -53. What is the tens digit of b? 1 Let j = 7 - -7. What is the units digit of j? 4 Suppose -m = -302 + 87. What is the tens digit of m? 1 Let z = 1 - 0. Let s(d) be the second derivative of d4/3 + d2/2 - 2*d. What is the units digit of s(z)? 5	{ "pile_set_name": "DM Mathematics" }
11 + -5))? 4 What is the value of -2 - (6 + (-8 - 1))? 1 1 + (-4 - 0) + (-10 - -17) 4 0 + (-4 - (4 - 3)) -5 Evaluate 5 + (4 - (2 + (-1 - -3))). 5 What is the value of -3 - (1 - 3 - (-13 + 14))? 0 Calculate 2 + 4 + -2 + -5 + -1. -2 Evaluate 3 + (2 - (-1 + 0)) + -4. 2 Evaluate (2 - (-8 - -4)) + -2. 4 (-2 - -2) + -8 - (-5 - -1) -4 What is 2 + -7 + 15 - 11? -1 Calculate (-15 - -12) + (-6 - -11). 2 What is (-8 + 18 - 3) + (2 - 0)? 9 -4 - (-9 - (1 - 9)) -3 Evaluate -4 - (1 - (7 - 0)). 2 Evaluate -1 - (-7 + -6 + 12). 0 Calculate (-11 - -12) + 1 + 0 + 3. 5 Evaluate (-9 - 6) + 8 + (13 - -1). 7 Evaluate 2 + 5 + -36 + 32. 3 What is 0 + 3 + (2 - (4 + -2))? 3 What is the value of (1 - 1) + -21 + 25 - 5? -1 What is the value of 3 + 3 + -4 + (-4 - -2)? 0 Evaluate -1 - ((-4 - 0) + 2). 1 6 + 2 + 2 + -7 3 9 + (-21 - 2) + 7 -7 Evaluate (-6 - 9) + 18 + 4 + -1. 6 0 - (-2 + 1) - (5 - 6) 2 Calculate 3 + -1 + -9 - (16 - 19). -4 Calculate -1 + (0 + 4 - (15 - 12)). 0 What is 1 + -5 + 0 + 3 + 0? -1 What is the value of 8 - 3 - (3 - 4)? 6 Evaluate 4 + -3 + (72 - 67). 6 3 + 3 + (1 - 4) 3 Calculate -2 - (0 + -1 + -3). 2 Evaluate -7 + (3 - -2) + -2 + 8. 4 7 + (0 + 7 - 13) 1 What is the value of -16 + 10 + 1 + 0? -5 What is 3 + (-5 - (-4 - -2))? 0 What is -8 - (-12 - -4) - (-3 - 1)? 4 What is 0 - (-8 - (-12 - -5))? 1 What is the value of 0 - (4 + -6) - (-1 + 6)? -3 What is the value of 1 - 2 - (-1 + -4 + -1)? 5 Calculate -37 - -29 - (-1 + -4). -3 (6 - 4) + -7 - 0 -5 What is (3 - -5) + (0 + -5 - -6)? 9 Calculate 0 + -1 + -7 + 2. -6 Evaluate 16 - ((5 - -1) + (55 - 54)). 9 Calculate (1 - (4 + 5)) + 3. -5 Evaluate (-1 - (0 - 1)) + -1 + 2. 1 What is 2 - (-1 + 1 - (8 + -9))? 1 What is the value of 4 + -7 + 9 + -13? -7 What is the value of 10 - ((-3 - -11) + -2)? 4 Calculate (9 - (4 + 1)) + (-8 - -6). 2 What is -10 + 14 - (3 + 3 + -3)? 1 14 + -17 - (2 + 0) -5 What is the value of 0 - (-3 + -7 + 4 + 2)? 4 Evaluate -9 - (-4 + 1 + 1). -7 -3 + 3 + -1 + 1 0 Calculate 11 - (9 - (9 + -4)). 7 6 - 3 - -3 - (-2 - -3) 5 What is the value of -12 - -8 - (2 - 1)? -5 What is 12 - (7 + -7 - -7)? 5 What is the value of 0 + 0 + (-2 - -2)? 0 Evaluate 11 + -12 + (16 - 10). 5 What is the value of -8 - (4 + -1) - -7? -4 What is -1 - (-1 - 5) - (12 - 6)? -1 What is the value of 114 + -118 + 5 + 2? 3 (11 - 9) + 0 + 1 + -4 -1 What is -2 + (4 - (1 - -2)) + 2? 1 Evaluate 20 - 22 - (1 + (0 - 3)). 0 Evaluate 22 - 16 - (10 - 1 - -1). -4 (0 - 0 - (-25 + 24)) + 2 3 What is the value of 12 - ((-2 - -1) + 2 + 5)? 6 What is the value of -5 + (-5 - (5 + -16))? 1 What is the value of (4 - 3 - 4) + 2 + 3? 2 What is -4 + 2 + -10 + 15? 3 What is 0 + -1 + 3 + -17 + 20? 5 Evaluate -8 - (6 + 12 + -29). 3 What is the value of (5 - -1) + 15 + -14? 7 (-14 - -1) + 8 + (1 - -4) 0 (0 - 1) + (8 - 9) -2 What is (-8 - (0 + -4) - -2) + -3? -5 Calculate 20 + (-20 - -10) - 11. -1 What is (-3 + 14 - -2) + -7? 6 What is (-2 - -6) + -5 + 6 + -7? -2 4 + -13 + 21 - 4 8 Evaluate -1 + -2 + 7 + (1 - -1). 6 (3 - 1 - 10) + 7 -1 What is (-4 - (1 + -3)) + (-5 - -9)? 2 What is the value of -2 + 2 + 1 + (8 - 8)? 1 Evaluate (-7 - -6) + (-5 - -8). 2 What is 4 - (1 + -6 + 6)? 3 What is 2 + -2 + (-5 - -1)? -4 What is (-1 - (2 - -2)) + (2 - 1)? -4 -13 + 7 + 5 + -4 -5 What is 14 + -15 + 6 - (-4 - 0)? 9 What is the value of 1 + (0 - 3) + -1 + 7? 4 7 + (0 - (-5 + (8 - -2))) 2 Evaluate 3 + (2 + 0 - 4) + 4. 5 What is 0 + 2 - (-11 - (-8 - 0))? 5 What is the value of -1 + (-5 - 0) + 5 + 2? 1 What is 8 + (-9 - (-14 + 11))? 2 Calculate 1 + -10 + (7 - -9). 7 Calculate -8 + 13 - ((-1 - 0) + 10). -4 What is 1 + -4 + -2 + -4 + 5? -4 What is 2 + 0 + 9 + -1 + -5? 5 What is -1 - (9 + -15) - (6 + -3)? 2 What is the value of 8 - (13 + -17 + 12)? 0 What is the value of 5 - 0 - ((-3 - -3) + 0)? 5 Calculate (0 - 0) + (-11 - -16). 5 What is (-7 - (-1 - 4)) + -2? -4 What is -12 - 0 - (127 - 141)? 2 What is (8 - 0) + 20 + -19? 9 (-9 - (-6 + 2)) + 9 4 What is (-1 - -1) + (-7 - -4) + 3? 0 Evaluate 2 - (-10 + 5) - 7 - -1. 1 Evaluate -8 + -5 + (20 - 4). 3 Evaluate -1 - -7 - (4 + 1 + -1). 2 What is the value of -3 - (-4 - (8 + -6)) - 10? -7 What is the value of 1 - (-10 + 1 + 5)? 5 Evaluate (5 - 8 - 5) + 5. -3 (4 - (-2 + 2)) + -3 1 6 - 3 - -1 - 5 -1 Evaluate -2 - -1 - (6 + -7). 0 -1 + (9 - (2 + 11)) -5 Calculate 2 - (-2 - -9) - (-12 + 8). -1 Calculate 7 - (-7 + 8 + -4 - -5). 5 What is the value of -1 + 9 - (37 + -27)? -2 -3 - -1 - (6 - 8 - 1) 1 What is 1 + (-9 - -6 - -3)? 1 Evaluate 16 + -11 + 8 - 4. 9 -46 + 48 - (1 + 2) -1 Calculate (5 - 8 - 3) + 1 + 0. -5 Evaluate 3 - (-6 - -3) - 12. -6 What is 3 + -4 + (8 - 10)? -3 What is -1 - (-9 + 4 + 0)? 4 Evaluate (5 - 12) + 2 + 8. 3 Calculate -54 - -46 - (-7 + 0). -1 What is 3 - (13 - 4) - 0? -6 What is the value of -2 + 0 + 2 - 4? -4 What is the value of -14 - (7 + (-7 - 11))? -3 What is 5 + -9 - 0 - -3? -1 Evaluate (7 - 6) + 2 + -5. -2 What is the value of 2 + (1 - (0 + 1))? 2 Calculate -6 + 4 + -2 + 4 + -2. -2 What is the value of -7 + 3 - 0 - (-5 - -1)? 0 Calculate 0 + 5 - -4 - 1 - 4. 4 Evaluate 0 + -3 + 2 - 3. -4 -1 - ((3 + -2 - 3) + -4) 5 Calculate 7 + ((-1 - -3) + -6 - 1). 2 What is the value of (4 + 1 - (23 + -26)) + -6? 2 -3 + 5 + -2 + 1 1 Calculate 11 - (14 + -1 - 0). -2 Evaluate -7 + 12 + (-3 - -4). 6 Evaluate 0 + 1 + (-2 + 6 - 1). 4 What is -1 + -4 - ((-19 - -28) + -11)? -3 What is the value of 0 + -2 - (-5 + (-6 - -13))? -4 Evaluate 10 + (-1 - (-3 - -7)). 5 4 + -2 - (12 + -13) 3 -7 + 7 + 1 - (6 - 2) -3 Calculate (1 - -1) + 1 + (0 - -2). 5 What is the value of -16 - -23 - (12 - 1)? -4 What is the value of 6 - (-9 + 5 - (-4 + -2))? 4 1 + (2 - 4) + 3 2 Calculate -3 - (-2 - (0 - 1 - -3)). 1 Calculate 7 + -4 + (-3 - (1 + -5)). 4 What is the value of (20 - 16) + (2 - 5)? 1 Calculate (-4 - (-11 - -10)) + 0 + 9. 6 -4 + (-6 + 4 - 1 - -3) -4 Evaluate 0 - (3 + 5 + (-5 - -2)). -5 What is the value of 1 - (-3 - 5) - (-5 + 7)? 7 Evaluate (5 - 8 - -7) + 0. 4 Evaluate (8 - 3) + -4 + 2. 3 Calculate (6 - (15 - 1)) + 3. -5 Calculate -4 + 0 + (-1 - -5 - 2). -2 What is 12 + (-12 - (-5 + -4))? 9 Evaluate -1 + -2 + 2 + 0. -1 Evaluate (-17 - (0 + -8)) + 2. -7 Calculate 0 + 1 + -2 + -1 + 2. 0 Evaluate 9 + -5 + (-1 - 0). 3 -3 + 2 + 6 + -4 + -2 -1 What is 5 + -14 + 6 + 0? -3 (1 - (1 - -4 - 3)) + -2 -3 What is (-2 - -1 - -1) + 9 + -7? 2 Calculate 7 + -4 - (11 - 7). -1 What is 1 + 3 + 1 + -14 + 7? -2 Evaluate (2 - 0) + (2 + 5 - 7). 2 Calculate (2 - 2) + 7 + -5. 2 -6 - -3 - (-3 - (-7 + 15)) 8 What is the value of 2 + -6 - (2 - 14 - -2)? 6 1 - 1 - 9 - (0 + -4) -5 Calculate 1 + 0 + (2 - 7 - -5). 1 (11 - 4) + -1 - 11 -5 What is the value of (0 - -6 - 4 - -1) + 1? 4 What is the value of 14 - 18 - (-8 - 1 - -1)? 4 Calculate (-12 - (-5 - -5 - 2)) + 4. -6 What is 0 + 3 + 11 + -17? -3 (4 - (5 - 5)) + 2 6 What is -3 - (-3 + -1) - 5 - -1? -3 Evaluate 1 + -6 + 4 - 0. -1 7 + -12 - (-1 - (1 + 3)) 0 (6 - 0) + -8 + 2 + 2 2 Calculate (-4 - 0) + -1 + (3 - 1). -3 What is -2 + 11 + -7 + 3? 5 Calculate -4 + (1 - -1) + -14 + 14. -2 Calculate 4 - (3 - -5 - 3). -1 What is (-2 - -1) + 6 + 102 + -100? 7 Calculate (0 - -2 - 4) + -3. -5 Calculate -17 - -14 - (-2 + (-2 - -6)). -5 Calculate 2 + 1 + 1 + 1. 5 What is the value of 5 + -5 + 1 + 4? 5 (7 - 1 - (-1 - -4)) + 0 3 Evaluate -3 - (-3 + (5 - 5) - -5). -5 What is the value of 5 + (-14 - (7 + -15) - -3)? 2 What is the value of 0 - (3 + 2 - 5)? 0 (-1 - (2 - 6)) + 0 3 Calculate 2 + (-6 - (1 - 8)) - 0. 3 What is the value of 1 - (-3 + 4) - -1? 1 Evaluate -7 + 7 - -9 - (-10 - -11). 8 What is the value of 18 + -4 + (28 - 32)? 10 0 + 0 + 2 + 0 + 0 2 What is (10 + -10 - (0 - 2)) + -2? 0 What is -6 + 12 + (-2 - 1)? 3 5 + 7 + (-4 - 5) 3 What is 7 - (14 + (-9 - -9))? -7 What is (3 - (-3 + 9)) + 16 + -12? 1 (17 - 1) + 0 - (295 + -289) 10 What is the value of -1 - (3 + -5 + 3)? -2 What is the value of -5 + 1 + (-1 - -5) - -5? 5 What is (2 - 1 - -7) + -5 - 8? -5 Evaluate 15 - 3 - 23 - -1. -10 What is 8 + -11 + (2 - 1)? -2 0 + -6 - (-2 - (3 - 4)) -5 What is the value of (-4 + 1 - -1) + -1? -3 -7 - (-5 - (4 + -7)) -5 Evaluate -5 - (11 - (6 + 5)). -5 What is 13 + -6 - (3 - -3)? 1 Evaluate 5 - (-2 - (-3 + -2)). 2 (0 - -6) + -1 + -6 + 2 1 What is the value of 1 - 5 - (-26 - -21)? 1 What is (5 - -3) + -13 + 5 - -4? 4 -7 + 1 + -21 + 18 -9 0 - -3 -	{ "pile_set_name": "DM Mathematics" }
. Suppose 11m = 14m - jr - 789, -5m + 3r = -1316. What is the units digit of m? 5 Let c(t) = 4t*2 + 159t - 294. What is the hundreds digit of c(48)? 5 Suppose 0 = r - 5g - 2, 3g - 6 = -3r. Suppose rj + 4h = 74, 21 = 3j - 4h - 110. What is the units digit of j? 1 Suppose 14z = -23297 - 23295. Let g = 4706 + z. What is the tens digit of g? 7 Let s(n) = 347n + 90. Let a be s(3). Let g = -597 + a. What is the hundreds digit of g? 5 Let z = 67 - 65. Suppose -186 = zj - 2344. What is the units digit of j? 9 Suppose 0 = -2v + 2m - 456, 2v + m + 426 = -3m. Let h = v + 505. Suppose h = 4s - 4b - 242, -8 = -2b. What is the tens digit of s? 3 Let z = 1544 + -326. Let i = 2361 - z. What is the thousands digit of i? 1 Let v = -468 - -328. Let i = v - -234. What is the tens digit of i? 9 Let u(k) = -k + 22. Let f be u(13). Let i(j) = -j3 + 9j*2 - 7j. Let x be i(f). What is the units digit of (-8)/(-14) + (-1287)/x? 1 Let d = -299 + 303. Suppose -dz + 1943 = 3v - 1058, v + 2989 = 4z. What is the tens digit of z? 4 Let a = 63582 + -17178. What is the thousands digit of a? 6 Let m = 67357 + -36307. What is the hundreds digit of m? 0 Let y(h) = -h3 - 19h*2 + 2. Let w be y(-19). Let g be ((-1)/(2/(-4)))/(w/4). Suppose u - 99 = -2k, -3u + 76 = gk - 217. What is the units digit of u? 5 Suppose 875k - 6504659 = 756k. What is the ten thousands digit of k? 5 Let l be 9/((-45)/(-10))(-20632)/16. Let t = l - -3952. What is the units digit of t? 3 Suppose 4j - 4c - 1774 = 1422, 0 = 4j - 3c - 3201. What is the tens digit of j? 0 Suppose 3p = -0p + 39. Let d(j) = -3j2 - j - 3. Let k(c) = c3 + c*2 - 8c + 24. Let a(h) = 4d(h) + k(h). What is the hundreds digit of a(p)? 1 Suppose 3h - 12 = -h, -9r - 4h = -230529. What is the thousands digit of r? 5 Let c = -286 - -292. What is the units digit of ((-6157)/(-141))/(2/c)? 1 Let m(p) = p3 - p2 - p - 17. Let j be m(6). Let r = -14 + -26. Let t = r + j. What is the units digit of t? 7 Suppose 6b - 229 - 191 = 0. What is the tens digit of (945/14)/15b? 1 Suppose 5l + 220057 = 52p - 48p, 55003 = p - 5l. What is the units digit of p? 8 Let j(h) = -33h - 4. Let l(p) = -32p - 3. Let m(t) = 4j(t) - 5l(t). Let o(i) = 308i - 12. Let c(y) = -32m(y) + 3o(y). What is the tens digit of c(3)? 8 Let u be -1 + 2262 + -60 + 64. Suppose -5t = -8t + u. What is the tens digit of t? 5 Let k = 31633 + -17877. Suppose -10l - 4876 = -k. What is the tens digit of l? 8 Suppose 3i + 189 = 4z, 4z - 5i - 232 + 37 = 0. What is the tens digit of 20 + -18 - 4z/(-2)? 9 Suppose p - 4 = 3. What is the units digit of (-766)/(p/(35/(-10)))? 3 Let w be 3 + -4 - 0/4. Let p be ((6 + -4 + 5)w)/(-1). Suppose pz - 360 = z. What is the tens digit of z? 6 Suppose 8075 = 11b - 27136. What is the thousands digit of b? 3 Let n(t) = 3t - 4. Let h be n(3). Suppose -4r + 953 = a - 2939, r - 3a = 986. Suppose -y = -2l + 4l - 389, y = -hl + r. What is the hundreds digit of l? 1 Suppose 3h - 16o + 12o - 3466 = 0, 0 = -3o + 6. What is the thousands digit of h? 1 Let o(u) = 1427u3 - 8u*2 + 33u - 30. What is the ten thousands digit of o(2)? 1 Let i be (5/159)/1. Let r(c) = -41c + i + 128c - 2. What is the tens digit of r(1)? 8 Suppose -403y + 435y - 901224 + 75752 = 0. What is the hundreds digit of y? 7 Let y(g) = -g3 + 4g*2 + 5g + 17. Let b be y(7). What is the units digit of (-608)/10b/38? 2 Let s be 2/(40/151/4). Let h be (-1050)/(-33) + s - 2/(-11). What is the tens digit of 2096/28 - (-5)/h? 7 Suppose -4o - 2q + 49662 = 0, -13q + 37245 = 3o - 12q. What is the hundreds digit of o? 4 Suppose 6w - 2w = 4628. Let a = 2357 - w. What is the tens digit of a? 0 Suppose w - 5l + 43 - 4 = 0, 0 = -5w - 4l - 224. Let f = 35 + w. Let k(n) = -25n - 6. What is the hundreds digit of k(f)? 2 Suppose 7a - 45 = 2a. Suppose 4c - 118 = -3r, 59 = r - 4c + a. Let f = -25 + r. What is the tens digit of f? 1 Let v = -3 - 516. Let n = 0 - v. What is the hundreds digit of n? 5 Suppose -2j - 1602 + 236 = -c, -2692 = -2c - 4j. What is the thousands digit of c? 1 Suppose -22c + 12c + 352590 = 25c. What is the ten thousands digit of c? 1 Suppose -i = -5j + 95, -3i - 38 = -j + i. Let y(l) be the first derivative of -2l3/3 + 20l*2 - 11l + 7226. What is the units digit of y(j)? 1 Let q(x) be the first derivative of 23x2/2 + 53x - 86. What is the tens digit of q(24)? 0 Suppose 25s + 5 = 26s. Suppose 3z = 2z - 4l + 1040, 4l = sz - 5296. What is the thousands digit of z? 1 Suppose -3v = 3g - 6v + 120, -144 = 3g + 3v. Let n = -44 + -59. Let z = g - n. What is the units digit of z? 9 Let y(q) = -q*2 + 19q - 8. Let m be y(18). Suppose -mc = -472 - 658. What is the hundreds digit of c? 1 Let v(t) be the first derivative of 17t*3 + 15t*2/2 + 58t + 243. What is the tens digit of v(-4)? 1 Let t = -6852 - -12502. Suppose 7831 = 13p - t. What is the thousands digit of p? 1 Suppose 3b = 7b - 4a + 4336, 4b + 3a + 4371 = 0. Let k = b + 1574. What is the tens digit of k? 8 What is the tens digit of (-1160)/(-464)26468/5? 3 Let w = 35 + -31. Suppose -64 = -3r - 5h + 6, -wh = 2r - 48. What is the units digit of (-8)/(-10) + 104/r? 6 Suppose -3i = -5j + 172126, j + 3i = 29159 + 5295. What is the hundreds digit of j? 4 Let g(a) = -21a3 + 19a*2 - 75a - 10. What is the ten thousands digit of g(-9)? 1 Let m = 44684 + -30423. What is the ten thousands digit of m? 1 Let o = -84321 + 154236. What is the units digit of o? 5 Suppose 0 = 5r + 2 + 43. Let x(k) = -k + 5. Let f be x(r). Suppose 284 = fq - 10q. What is the units digit of q? 1 Let d be 1 - (0 + 1 + 0). Suppose 4n - 2n + 8 = d. Let l(j) = j3 + 5j*2 + 3j + 6. What is the tens digit of l(n)? 1 Let j = -42 - -42. Suppose -p = -2f - 4, -3p + jf = 2f + 4. Suppose 3x - 6x + 36 = p. What is the tens digit of x? 1 Suppose -20 = -r - 3r. Suppose 3i = -5l + 48, -rl + 3i = -0i - 72. Suppose d - ld + 594 = 0. What is the tens digit of d? 5 Let t be -6(-2)/4109/1. Suppose -t + 2487 = 4v. What is the units digit of v? 0 Let v = -20 + 21. Let a be 960/(-55) + (-42)/77. What is the units digit of (v + 1)(-1359)/a? 1 Suppose -31w + 26w - 70 = 0. Let v(q) = -2q*2 - 76q + 15. What is the tens digit of v(w)? 8 Suppose 4y = -0y + 3y. Suppose -33c + 31c + 14 = y. Suppose -5h - 3p + 90 = 0, -2p + cp - 55 = -2h. What is the tens digit of h? 1 Let c(a) = 8a - 6. Let j be c(1). Suppose -5t + 930 = jm, -3t = -0m + 3m - 1377. What is the tens digit of m? 5 Let z(u) = u*3 + 10u*2 - 4u + 14. Let w be 170/15 - 8/6. Let o be 0 + -14 - (w - 14). What is the units digit of z(o)? 4 Let o(w) = 33w + 5949. What is the tens digit of o(20)? 0 Suppose 21c - 2052 = 20c. Suppose -8z = z - c. What is the hundreds digit of z? 2 Suppose -2k - 3u = -12629, -70k + 3u - 25273 = -74k. What is the hundreds digit of k? 3 Suppose -2z = -4k + 3476, 0 = 4k - 6z + 11z - 3490. Suppose -5s = -2a - 1089, -2a = -4s - 0a + k. What is the units digit of s? 9 Let u(p) = -5p - 104. Let z be u(55). Let h = 871 + z. What is the tens digit of h? 9 Let f(h) = -2h3 - 10h*2 + 16h + 42. Let a = 23 + -32. What is the tens digit of f(a)? 4 Suppose 5w + 5 = -3l, -2l - 3l = 4w + 4. Let g(o) = -o2 - o - 28. Let t be g(l). What is the units digit of -1 - 7/(t/192)? 7 Suppose -54 = -3q + 4j, 0q = -3q - 5j + 54. Suppose -3u - 10 = 5x + u, q = 4x - 2u. What is the units digit of x + ((-364)/(-8) - 1/(-2))? 8 Let j(f) = 11f2 + 79f - 2. What is the hundreds digit of j(-46)? 6 Suppose 0 = i - 5c - 1864 - 2150, -5i + 20175 = -4c. Suppose -24l + 4w = -21l - 2415, -i = -5l + 2w. What is the units digit of l? 9 Let x(k) be the first derivative of k*4/4 + 49k*3/3 - 17k*2/2 - 116k + 44. What is the units digit of x(-49)? 7 Let b = -21 - -24. Suppose -j + bp + 198 = -115, p = 5. Suppose -8q + 12q - j = 0. What is the tens digit of q? 8 Let x = 4292 - -4182. What is the hundreds digit of x? 4 Let c(t) = 12t3 - t2 - 1. Let w(n) = 2n3 + 5 + n + 4n*2 + 8n*2 - 4n*2 + 0n**3. Let o be w(-4). What is the tens digit of c(o)? 1 Let u = 29 - -16. Suppose -43 =	{ "pile_set_name": "DM Mathematics" }
ue? (a) 131.01 (b) -3/4 (c) -0.132 a What is the second smallest value in 2, -3/2, 4017611? 2 What is the seventh smallest value in 2, -0.22, 50, -2, -5, 6, -1? 50 What is the third smallest value in 537.6, 211/4, -2? 537.6 Which is the third smallest value? (a) 0 (b) 1371 (c) 4.487 b What is the second biggest value in -177, 0.2, -0.2, -9/5, -16? -0.2 What is the second biggest value in 23, -3, -20531/36? -3 Which is the sixth smallest value? (a) 8.7 (b) 59.34 (c) 3/7 (d) 7 (e) 5 (f) 4 b What is the second smallest value in 5, 4, 3/5, -1/4, -2056, -0.09? -1/4 What is the third biggest value in -9/4, -2/7, 20.8, -5, 0.4, 4, -4.9? 0.4 What is the third smallest value in 0.86, 5, 67186, -3/4? 5 What is the third smallest value in -0.104, 0, -0.24, 92, -2/11? -0.104 What is the fourth biggest value in -74, 25, 5, 124, -2/19? -2/19 What is the third smallest value in 338, 5, 1/5, 20, -5? 5 Which is the biggest value? (a) 4/3 (b) 409 (c) -5/83 b What is the biggest value in 7, -42, 23, -37? 23 Which is the third biggest value? (a) -0.11026 (b) 5 (c) 0.3 (d) -5/8 (e) -7/3 a Which is the smallest value? (a) 0.34 (b) 2/11 (c) -1/438 (d) 7 c What is the sixth smallest value in 1.8, -0.3, 36, 1/6, -1, 6, -4? 6 Which is the biggest value? (a) -3 (b) 0.05 (c) 1 (d) 182/321 (e) -13 c What is the fifth biggest value in 0.07, -4, 4, 2, -1/13, 2/13, -108? -1/13 What is the second smallest value in 47, 4, -0.05, 2/131, 7, -4/13, 0.3? -0.05 Which is the second smallest value? (a) -657 (b) 5/2 (c) 0 (d) -1/14 d What is the fourth smallest value in -19, 11, -3746, 27? 27 What is the third smallest value in 1009739, 3/4, -5? 1009739 Which is the second smallest value? (a) -2/11 (b) 76 (c) -2.27 (d) -0.4 (e) 0.5 d Which is the smallest value? (a) 5 (b) -4/9 (c) -86 (d) -0.2 (e) 7 (f) 2 c Which is the second smallest value? (a) -10 (b) -0.4 (c) -116216 a What is the biggest value in 4661193, -2/3, -3? 4661193 What is the seventh smallest value in -1, -6, 2, 0.4, 19, 0.01, 71? 71 What is the biggest value in 50.9198, -1/5, -6? 50.9198 What is the third biggest value in 1/2, -12, -0.1, -52, 0.2, 29/6? 0.2 Which is the sixth biggest value? (a) -3/2 (b) -0.497 (c) -2 (d) -31 (e) -0.4 (f) -3 d What is the sixth biggest value in -1/3, 0.6, 420, -25, 4, -0.5? -25 Which is the second smallest value? (a) -2 (b) -345.9 (c) -1/4 (d) -1/6 (e) 4 (f) -3/11 a Which is the biggest value? (a) 2 (b) 4 (c) 1 (d) 0.16161 (e) 4/3 (f) 2/19 b What is the second biggest value in -245/17, 4, -7183, -0.5? -0.5 Which is the fifth biggest value? (a) 4485 (b) -38 (c) 0 (d) 1/3 (e) 2/9 (f) 1 c Which is the third smallest value? (a) -1/88 (b) -8 (c) -17 (d) -2/3 (e) -26 (f) -1/7 b Which is the second biggest value? (a) -4/5 (b) -1 (c) 145 (d) 2883 (e) 0.3 c Which is the fifth biggest value? (a) 3 (b) -86728 (c) -207 (d) 3/5 (e) -3 b What is the second smallest value in -6, 4, -4/3, -20/653? -4/3 Which is the third smallest value? (a) -3 (b) -5 (c) -2 (d) 3 (e) -0.02 (f) -77.539 (g) 2 a Which is the fourth smallest value? (a) 0.5 (b) 1/25350 (c) 2/59 (d) -2 a What is the biggest value in -1723.87, 56/9, 0.03? 56/9 Which is the seventh smallest value? (a) -6061 (b) 1/2 (c) -0.5 (d) 96 (e) 5 (f) 2.2 (g) 2/7 d What is the third biggest value in -2, -33/4, -236, 2/67, 0.4, -5? -2 Which is the fourth smallest value? (a) -0.13 (b) 1/230661 (c) 0.3 (d) 0 c Which is the second smallest value? (a) -3 (b) -2 (c) 19/1048 (d) 0.04 b Which is the second smallest value? (a) -14541 (b) 25 (c) 1 c What is the second smallest value in -0.49, 5285/6, 23? 23 Which is the third smallest value? (a) -11893 (b) -22 (c) -173 b What is the third biggest value in -2, 0.26, 0.3, 2/13, -10, 0.1? 2/13 What is the second smallest value in -3, -19/10095, 5, 0? -19/10095 What is the fourth biggest value in -0.07899, -3, -7, 0.1, -0.4, -1.42? -1.42 Which is the fifth smallest value? (a) 4 (b) 4/7 (c) 0.2 (d) 10626 (e) -0.024 d What is the second smallest value in 3/26, 9, 1/4, 0.83, 38, -0.06? 3/26 What is the smallest value in -34/9, 112277, 0.2? -34/9 What is the biggest value in 994, 61/217, -1/7? 994 Which is the biggest value? (a) 1 (b) 30 (c) -4 (d) -0.16 (e) -19/15 (f) -5 b Which is the seventh smallest value? (a) 1 (b) 0.154 (c) 3 (d) -421 (e) -2/3 (f) -2 (g) 1/7 c What is the seventh smallest value in 1, -4, -2/341, 2, 0.5, 0.7, -1/112? 2 What is the second smallest value in -0.3, 2/1593, 4, -0.1, -1, -2445? -1 What is the third biggest value in 19087, -699/5, 1? -699/5 Which is the fourth biggest value? (a) 0.4 (b) 3956004 (c) -9 (d) -1/3 c What is the second biggest value in -80, -1/4, 2.1, -0.1, -5, -20, -3? -0.1 What is the fourth smallest value in 382, -57, 11, 2/57, -2? 11 What is the second biggest value in 2, 0, 5, -20, 230? 5 What is the third smallest value in -8, 5, 4, -0.2, -26178, 0.4, -0.1? -0.2 What is the smallest value in -2, 0.06, 118637? -2 Which is the fourth biggest value? (a) 20 (b) -5 (c) -1 (d) -1/13 (e) 36 (f) 16 d What is the fourth biggest value in 2/5, 0.9, 3239, -2/3, 1/3? 1/3 What is the biggest value in 1.3, 1453.79, 4? 1453.79 Which is the fifth biggest value? (a) 2/23 (b) 0 (c) 0.5 (d) 82 (e) 61.9 (f) -1 b What is the second biggest value in 352, 5, 1148/3? 352 What is the fifth smallest value in 1/6, 0.2, -3, -0.5, -68409, 1? 0.2 Which is the fifth biggest value? (a) 0 (b) 3 (c) -543 (d) -6 (e) -2/3 (f) 148 (g) -2 g Which is the third smallest value? (a) -10/3 (b) 39 (c) 546.7 c What is the second biggest value in -0.4, 0.2, 1/3, -76, -6889? 0.2 What is the fourth smallest value in 0.1, -1/7, -0.019, 1/73, -3.7? 1/73 Which is the second biggest value? (a) -247373 (b) -5.2 (c) -3/8 b Which is the second biggest value? (a) -3/4 (b) 0 (c) 34 (d) 2/9 (e) -3/2 (f) -1/6 (g) 0.08 d Which is the second smallest value? (a) -94.968 (b) -12 (c) -96 (d) -2/3 a What is the fourth smallest value in 0.1, -7/27, 0, 5, 0.2, -3, -18/31? 0 What is the seventh smallest value in -0.03, 7, -3, -801/8, -2, -0.4, 0.03? 7 What is the third biggest value in 6/625, -202, 5, -0.5? -0.5 Which is the fourth smallest value? (a) 2/3 (b) -501/17 (c) -19 (d) 4 (e) 0.5 a What is the smallest value in -3, 48.67, 1009, -2? -3 What is the third biggest value in -76223, 0.5, 0.2, 3/2? 0.2 What is the biggest value in 6/11, -12, 1.1, -49, 0.1? 1.1 Which is the biggest value? (a) 4 (b) -1228 (c) -3/7 (d) -2776 a What is the second biggest value in 320.66, -44, -3/7? -3/7 What is the smallest value in 1/7, -7/39, -63704? -63704 What is the third smallest value in 23, 0, -7/2, 1/173? 1/173 Which is the smallest value? (a) 899 (b) 13 (c) 22 (d) 0.06 d What is the fourth biggest value in -17, -148, -11, 222? -148 What is the sixth smallest value in 2, -2, 109, -244, 0.4, -13/2, -3? 2 Which is the fifth smallest value? (a) 4 (b) 0.4 (c) -0.2 (d) -1 (e) -2/11 (f) 2/49 (g) -49/808 f Which is the biggest value? (a) -3 (b) -6/2717 (c) 10 (d) 632 (e) 2 d What is the second biggest value in -0.38, 4, -4, -1.2, -1.113, -0.2? -0.2 What is the fourth biggest value in -2826, -3, -2, 0.3, 2, -3/7, -5? -2 Which is the smallest value? (a) -8 (b) -1 (c) 3.690346 a What is the second smallest value in 173, 5, 1774, -6/11, 2, 6, 4? 2 What is the fifth biggest value in -1, 26, 74695, 3/7, -5? -5 Which is the third smallest value? (a) 0.06526 (b) -65 (c) 79 c Which is the second biggest value? (a) -1 (b) 8.236 (c) -2/5 (d) 0.111 d What is the smallest value in -49569, 167.6, -5? -49569 Which is the smallest value? (a) -4 (b) 2.1992132 (c) -1 a What is the biggest value in 0.03, 1/1464, -3, -18? 0.03 Which is the fourth biggest value? (a) -1/7 (b) 0.55 (c) -35.1 (d) 0 (e) 0.8 a What is the third smallest value in 0.5, -3375, 0.112, 7? 0.5 Which is the fifth biggest value? (a) -1918 (b) -2/11 (c) -10/7 (d) 2/3 (e) -2/3 (f) -1/7 (g) 1/3 e What is the third smallest value in 2/11, 3, 291835, 1, -5, -19? 2/11 Which is the fifth smallest value? (a) -0.2 (b) -0.0402 (c) 1 (d) 2/65 (e) 0.5 c Which is the third biggest value?	{ "pile_set_name": "DM Mathematics" }
= 54 - 52. Suppose -59 = -5v + 3w, tw = v + 6 - 22. Calculate the highest common divisor of v and 4. 2 Let c be -34/6 - -6. Let j be 290/c + ((-3)/2)/3. Calculate the greatest common factor of j and 9. 9 Let f(u) = -u*3 + 12u*2 - 2u. Let q be f(11). Let s = -17 - -14. Let r be s/1 - (1 - 13). Calculate the highest common divisor of q and r. 9 Let i(y) be the second derivative of y*3/6 + 37y*2/2 + 17y. Let s be i(-17). Calculate the highest common factor of 80 and s. 20 Let v = -24 + 34. Let d(g) = g*2 - 1. Let i be d(-3). Suppose ia = -a + 810. What is the greatest common divisor of a and v? 10 Let g = 990 + -980. What is the highest common divisor of g and 1790? 10 Let a be (197 - 131) + (-4 - -1). Let q be ((-21)/(-9))/((-2)/6). Let d be (-1)/(-2 + (-13)/q). Calculate the highest common divisor of d and a. 7 Let j(a) = -a*2 + 28a + 149. Let n be j(31). Calculate the highest common factor of n and 308. 28 Let m(y) = -3y + 34. Let s be m(8). Calculate the highest common divisor of 3830 and s. 10 Let i be (-2)/(-1)(30/4 + -5). What is the greatest common factor of i and 4? 1 Let p(g) = -g*3 + 5g*2 + 2g + 2. Let a be p(6). Let t = a + 36. Let h be 63((-15)/9 + 2). What is the highest common divisor of t and h? 7 Let a be 2/10 - (-3 - 56/20). Let f be (a/8)/((-95)/48 - -2). What is the greatest common divisor of f and 144? 36 Suppose -5f - 2u + 945 = 0, f + 2u = 5f - 756. Calculate the highest common factor of f and 42. 21 Let s(b) = -2b*2 - 7b + 7. Let g be s(4). Let r = -21 - g. What is the greatest common factor of 80 and r? 16 Let z(f) = f + 45. Let c be z(0). Suppose -c = -7t + 53. What is the highest common divisor of 112 and t? 14 Suppose 2d + 2 - 6 = 0. Suppose dg - 8 = -0g - 3p, -g - p = -6. Let v = 15 + 10. What is the greatest common factor of v and g? 5 Suppose -23l = 34 - 356. Suppose -3i - 2x + 207 = 83, -4x = 5i - 206. What is the highest common divisor of i and l? 14 Suppose -5l + 165 = -0q + 2q, 4q = l + 275. Suppose 0 = 8b - 8 - 0. Let r be (-78)/(-2)b/3 - -1. What is the greatest common factor of q and r? 14 Let b(o) = -o - 3. Let n be b(-4). Let t(d) = d*3 + 11d*2 - d - 2. Let m be t(-11). Calculate the highest common factor of m and n. 1 Let x(c) be the first derivative of -3 - 7c - 1/3c3 + 13/2c*2. Let o be x(11). Calculate the greatest common factor of o and 5. 5 Suppose 4f + 3r = 417, 4f - r - 309 = 128. What is the highest common divisor of 3996 and f? 108 Suppose -4u + 4a + 8 + 8 = 0, a = 5u - 12. Let o be 3(7/3 - u). Let m = o - -55. Calculate the highest common factor of 28 and m. 28 Let x = -1 - -6. Suppose l = -3t - 4l + 214, -2l = -xt + 398. Let o(d) = 12d + 2. Let n be o(2). Calculate the greatest common factor of t and n. 26 Let x = -13 + 27. Let y be (-14)/(-1)(16 + -1). Suppose -5l + 3u = -y, -4u + 42 = 4l - 126. Calculate the highest common divisor of l and x. 14 Let w be -1(3/3)/(8/(-408)). Suppose -498 = -2j + 624. What is the greatest common factor of w and j? 51 Let h = -26 - -64. Calculate the greatest common divisor of 95 and h. 19 Suppose 0 = -m - f - 2, -6f + 2f - 8 = -m. Let i(s) = s*2 - 4s + 4. Let p be i(4). Suppose -2h + m = -p. What is the highest common divisor of h and 6? 2 Suppose -162 = -3t + 3u, u = t + 3u - 48. Let o be t - 12/(1 + 5). Calculate the highest common divisor of 10 and o. 10 Let r be (-14)/2(-2)/2. Let l = -3989 + 4024. Calculate the highest common factor of r and l. 7 Let k be (-5 - -29) + (-10)/(-5). Calculate the greatest common divisor of 2197 and k. 13 Let j(o) be the second derivative of -o4/12 + o3/2 + 10o*2 + 11o. Let q be j(6). Calculate the highest common divisor of q and 16. 2 Suppose -v + 3t + 141 = -t, t - 1 = 0. What is the greatest common divisor of 203 and v? 29 Let a(s) = 197s2 - s + 1. Let f be a(1). Let w = f + -61. Calculate the greatest common factor of w and 17. 17 Let l(z) = z2 + 8. Let k be l(0). Let c = -74 - -81. Let b = 1 + c. What is the greatest common factor of b and k? 8 Let i = 269 - 248. Calculate the highest common divisor of i and 609. 21 Let d(q) = 2q2 - 21q - 16. Let p be d(21). What is the highest common factor of 25 and p? 25 Let a be 3/2 + 4/(-8). Let p be (14/35)/(a/20). What is the greatest common divisor of 16 and p? 8 Let d be 1208/(-60) + (-8)/(-60). Let k be 14/4 - (-10)/d. Calculate the highest common factor of 33 and k. 3 Let h = -25 - -27. Let j(q) = -18q - 1. Let i be j(-5). Suppose 17 = -3u - hk + i, 3u - 72 = k. What is the greatest common divisor of 264 and u? 24 Suppose 2q - 20 = -5n + 29 + 6, 0 = -4q. Suppose 3u - 4 = -u. Let m = 0 + u. What is the highest common factor of n and m? 1 Suppose 92k = 103k - 2838. Calculate the highest common factor of 54 and k. 6 Suppose 14a = 8a + 18. What is the greatest common divisor of a and 147? 3 Let v = -9 - -10. Let p be (v - -8)22/99. Calculate the highest common divisor of 1 and p. 1 Let l = 11 + 77. Let r be l/9 + 4/18. Suppose 4c - 2b - 42 = 0, 0 = -2c + 5b + 43 - 18. Calculate the highest common divisor of c and r. 10 Suppose 380 = -t + 6t. Let d be 2/(-3) + 708/36. Calculate the highest common factor of d and t. 19 Suppose 4g = -5p + 59, -2g = 8 - 0. Suppose 0 = -5s + p, 5s - 31 = -5l + 9. Calculate the greatest common divisor of 10 and l. 5 Let f = -38 - -43. Suppose 95 = fp - 0p + 4a, -4p = 2a - 70. Calculate the greatest common divisor of 75 and p. 15 Let b(h) = h2 - 2. Let o be b(4). Suppose -159 = -6j + 597. Calculate the greatest common divisor of o and j. 14 Suppose 0 = -28m - 33m + 1342. What is the greatest common factor of m and 1474? 22 Let n be -3 + (6 - (2 - 1)). Suppose 4u + 5d = 133, 0d + 91 = 3u + nd. What is the greatest common factor of u and 9? 9 Let y be 0/(5 + -6 - -21). Suppose y = 5b - 22 - 23. What is the greatest common divisor of b and 6? 3 Let v = -7 - -10. Suppose -10 = -2z + vz. Let g(p) = -5p - 5. Let k be g(z). Calculate the greatest common divisor of k and 9. 9 Let j(y) = 7y2 - 30y - 22. Let v(s) = 6s2 - 29s - 22. Let w(z) = -3j(z) + 4v(z). Let q be w(12). What is the greatest common factor of 14 and q? 14 Let i = 1222 - 410. Calculate the highest common factor of i and 232. 116 Let r be (-7)/(1/24116/(-493)). Calculate the greatest common divisor of 102 and r. 102 Let v be 12/(-9)120/(-4). Let p be ((-16)/v)/((-1)/(-30)). Let m be p/(-42) + 878/14. Calculate the highest common factor of m and 9. 9 Suppose 312 = -8o + 888. Calculate the highest common divisor of 264 and o. 24 Let k = -220 + 242. What is the highest common factor of k and 154? 22 Let w be 4055/75 - 2/30. Let c = 29 - 2. Calculate the highest common divisor of c and w. 27 Suppose -j + v + 41 = 3v, 2v = -5j + 213. Suppose 4z + 4y = z + 32, 4z = -5y + j. What is the greatest common divisor of z and 3? 3 Let u(b) = 25b - 84. Let a be u(4). Calculate the greatest common divisor of a and 592. 16 Suppose -110 = -2g - 5n, n + 3n + 341 = 5g. Let z = -47 + g. Let h be ((-15)/(-20))/(1/16). Calculate the greatest common factor of z and h. 6 Let h(z) be the second derivative of z3/3 + 35z*2/2 - 30z. Let y be h(-17). What is the greatest common factor of 9 and y? 1 Let b(a) = -2a + 70. Let v be b(6). Let h = v - -23. Let r = -7 - -16. What is the greatest common factor of r and h? 9 Let z = -8 - -16. Suppose -zc - 24 = -10c. Calculate the greatest common factor of c and 96. 12 Let v = 176 + -167. What is the highest common factor of 963 and v? 9 Suppose 28 = 2f - 12. What is the highest common divisor of f and 18? 2 Let m = 77 - 44. Calculate the greatest common factor of 44 and m. 11 Let o be 3/(-9)-141 - 6. Suppose 5r - 323 = 87. What is the greatest common factor of o and r? 41 Let q = -100 - -137. Suppose 5a - 9 = -3t + q, -4t = -5a + 32. Calculate the greatest common factor of a and 64. 8 Let n = 175 + -467. Let x = n - -462. What is the greatest common factor of x and 68? 34 Let i(v) = -19v + 5. Suppose -2y = -0y - 18. Let a be i(y). Let s be a/(-8) - 4/(-16). What is the greatest common factor of 42 and s? 21 Let k be (-6 + 2)/(-4)1. Let h be (94 - 70)*k/((-6)/(-4)). Calculate the highest common div	{ "pile_set_name": "DM Mathematics" }
: -683.5 or 4/9517? -683.5 Is 59/1738709 equal to 1? False Which is greater: 930967/44 or 21157? 930967/44 Which is smaller: 344 or 17.67? 17.67 Is 65303374/17 at most 3841375? True Which is bigger: 62463 or 62455? 62463 Which is greater: -219497.773 or 0? 0 Which is greater: 1 or 71/78960? 1 Which is greater: -45638 or -161/16? -161/16 Is 646376/291 less than 2222? True Is 5724 at most as big as 1654347/289? True Which is bigger: 267379 or -0.047? 267379 Which is greater: -3993395 or -3993403? -3993395 Which is smaller: -2.314 or 1183? -2.314 Which is greater: -2/3658998175 or -1? -2/3658998175 Which is bigger: -6522792 or -6522810? -6522792 Is -1 at most as big as -247511530? False Which is greater: -3986293 or -3986295? -3986293 Is 0 < 297506? True Is 8202 greater than or equal to 8150? True Is 52287209 equal to 52287209? True Which is greater: -2/7 or 19630992? 19630992 Is 149394 smaller than -36/13? False Which is smaller: 0.47 or 9145168? 0.47 Is 1140402 > 1140401? True Is 3951732/1429 at least as big as 2764? True Does -283843587 = -283843586? False Is 48/39174485 >= 1? False Is -10227 >= -1956? False Is -57895880 smaller than -57895882? False Are 1 and -1/17497423 equal? False Which is smaller: -1.7 or 28244.4? -1.7 Is -443029/70 greater than or equal to -6330? True Which is bigger: 0.6 or 1/135726? 0.6 Which is bigger: -63814651 or -63814649? -63814649 Is -40/13436817 at most as big as 0? True Which is smaller: -38 or -241833? -241833 Is -1 < 48/72187? True Is 997068 <= 997496? True Do -1330 and -339 have the same value? False Which is smaller: -166804 or -167445? -167445 Is 2/679 <= 98? True Which is smaller: -2332854 or -2332762? -2332854 Is 33/61309 at least 2? False Which is smaller: -7365/6422 or -1? -7365/6422 Are -21957 and -2437217/111 non-equal? True Is 1 equal to 3816/12043? False Which is greater: -1353677 or -17? -17 Which is bigger: -36336/845 or -43? -43 Is -1 smaller than 1187699? True Which is bigger: 1 or -426888351? 1 Is 21830115 smaller than 21830117? True Which is bigger: 155/301994 or 1? 1 Are -9 and -23821/3147 equal? False Which is bigger: 273/2611522 or 1? 1 Which is smaller: 272/211999 or 2/7? 272/211999 Is -39949 at most as big as -42050? False Which is bigger: -837266 or -837200? -837200 Are -219328 and 60.1 unequal? True Is 6102993 equal to 6102992? False Which is smaller: 1363/22624 or 1? 1363/22624 Which is greater: 971577/2750 or 352? 971577/2750 Which is greater: 190456/927 or 204? 190456/927 Do 500497 and 2502486/5 have the same value? False Which is bigger: -95717 or -140? -140 Which is smaller: -41219/1715 or -23? -41219/1715 Is -855863 <= -855868? False Which is greater: -170528936/13 or -1/3? -1/3 Is 7 < -1372142/3? False Which is bigger: -38357 or -1419234/37? -38357 Which is greater: 2/23726417 or 6? 6 Is -1040053149 < 3/5? True Is 128980/19093 less than or equal to 8? True Is -0.31 less than 242185? True Is -391830 at most -391819? True Which is greater: -0.2 or -76003940? -0.2 Which is smaller: -200154 or -2601984/13? -200154 Is -1 at least as big as 492/47687? False Which is greater: -88678708 or -88678718? -88678708 Is -54314 greater than or equal to -50766? False Are 84374332 and 84374324 equal? False Which is smaller: -303872 or -304837? -304837 Which is smaller: 21654454 or 21654456? 21654454 Is 1801746 smaller than 34233181/19? True Which is bigger: 11421996 or 194173914/17? 11421996 Which is smaller: 2663 or 69267/26? 2663 Which is bigger: -70817133 or -70817131? -70817131 Which is greater: -3176481 or -3176484? -3176481 Do -1 and -2125/13326 have different values? True Which is smaller: 0 or -1/3196496? -1/3196496 Which is smaller: 4505399 or -7? -7 Which is greater: -4441 or -7156? -4441 Is -5/19995448 bigger than -1? True Is -4489074/25 < -179564? False Is -1 not equal to 4/155342545? True Is -1586/7853 < 0.2? True Which is smaller: 581012 or 581036? 581012 Is -2910970 greater than or equal to -2910978? True Which is smaller: 1095/8288 or 0.1? 0.1 Is -0.1 greater than -632183015? True Which is greater: 10 or 0.03885016? 10 Which is smaller: -2.621 or 487? -2.621 Which is smaller: 400029/31 or 12905? 400029/31 Which is greater: -245.5 or -5528? -245.5 Does 210981803 = 1? False Which is bigger: 10026 or 9917? 10026 Is 7338667 smaller than 7338636? False Which is smaller: -2/77 or -177642? -177642 Which is smaller: 814648 or -19/5? -19/5 Is 4982246 bigger than 4982247? False Which is smaller: 22096026 or 22096024? 22096024 Which is smaller: -3904962 or -5? -3904962 Does -6439619 = -45077325/7? False Are 369256 and 369245 non-equal? True Is -266622 bigger than -266622? False Is 22 bigger than -610017? True Is 0 <= 211/174148? True Is 78/26776375 equal to 1? False Is 1/2 less than or equal to 408882917? True Are -53 and 1.142 nonequal? True Which is greater: -306698671 or -306698670? -306698670 Is -460 < 39652? True Which is bigger: -15960422 or -15960421? -15960421 Which is smaller: 0 or -445/1766658? -445/1766658 Are 21218/707 and 31 non-equal? True Are 47178 and -2/2535 non-equal? True Are 136069454/7 and 19438493 equal? False Is -2126170 greater than -2126098? False Is -1 less than -56/139305? True Which is bigger: 38.13 or -185713? 38.13 Which is greater: -800.4 or 3321/8? 3321/8 Is 534/1948177 at most as big as 0? False Is -588416015 greater than -588416015? False Is -1 greater than or equal to -2/1213598503? False Which is greater: 26452 or 500? 26452 Is -6886892 >= -6886892? True Does 1.039 = 2/517? False Which is smaller: -1296914 or -1296918? -1296918 Which is bigger: -115685 or -115704? -115685 Which is smaller: -6/163 or 97.94? -6/163 Which is bigger: 3765187 or -8? 3765187 Which is smaller: -240219160 or -240219163? -240219163 Is 223 bigger than 56755/17? False Is -68/132629 <= -1? False Which is smaller: -0.2 or 133346859? -0.2 Which is bigger: 2375622 or 21380600/9? 21380600/9 Is -1/34406 equal to -416? False Is 1.13418071 smaller than -2? False Which is greater: -696.29 or 9.2? 9.2 Is -0.07874932 less than 0.1? True Which is greater: 410400 or 10259973/25? 410400 Is 3/5 bigger than -17533971? True Is -71865169 smaller than -71865166? True Is 1 at most as big as 26/1167435? False Is -1514790/43 bigger than -35227? False Which is greater: -1490239 or -9.4? -9.4 Is -4175152 smaller than -4175152? False Which is smaller: -53213 or 688? -53213 Do -1 and 3/88713314 have the same value? False Which is smaller: -5/1152 or 812? -5/1152 Is 32044 > 224314/7? False Is 5145 >= -16.3? True Is 228/388777 smaller than 1? True Which is bigger: 3642 or 5451? 5451 Is 1165/4177 at most as big as -156? False Is 84 at most as big as 180791/2157? False Which is bigger: 66244 or 1258634/19? 66244 Which is greater: -49 or -5866.67? -49 Which is greater: -1 or 1/190649598? 1/190649598 Is -2317088/373 bigger than -6211? False Which is smaller: -60/523289 or 1? -60/523289 Is -6 bigger than -66235122? True Which is bigger: 10 or 5421/551? 10 Which is bigger: 523881 or 524016? 524016 Which is smaller: 1 or 55.84125? 1 Which is greater: 7 or 17967332? 17967332 Is 0.4312 != -8311? True Which is smaller: -46877 or -47141? -47141 Which is greater: 6 or 75278/10491? 75278/10491 Which is greater: 1300467 or 1300557? 1300557 Which is greater: -11053827 or -11053830? -11053827 Which is greater: -71 or -238415/3428? -238415/3428 Is 472 equal to -34461? False Which is smaller: 9844/245 or 41? 9844/245 Which is smaller: 1425496 or 1425479? 1425479 Is 140089/238 != 590? True Which is smaller: -3480850 or 5/6? -3480850 Which is greater: 182303 or 182587? 182587 Which is smaller: -36404121 or -36404102? -36404121 Is 145295 at most 145285? False Are 537307102 and 537307102 equal? True Which is bigger: -5/6570536 or 1? 1 Which is smaller: 7154/126955 or 0? 0 Is -0.04 less than or equal to 10187394? True Which is smaller: 1723430 or 1723429? 1723429 Do 78324690 and 78324690 have different values? False Is 0 > 8508/113039? False Is -1 less than or equal to 622/2823? True Which is smaller: 153106 or 153022? 153022 Which is smaller: 1 or 2/72784363? 2/72784363 Is 682368955/4 >= 170592238? True Is -9664562 at most as big as -9664594? False Is 118/5 < -7138? False Which is smaller: 1468/1042601 or -1? -1 Which is smalle	{ "pile_set_name": "DM Mathematics" }
be (4/6)/((-6)/(-81)). Let b(r) = r*3 - 10r*2 + 10r - 7. Let j be b(s). Solve -3k = jk for k. 0 Let b(t) = t*2 - 20t + 56. Let f be b(3). Solve 16c - f = 15c for c. 5 Suppose 18 + 30 = -12j + 28j. Suppose 2l + 11 = 3n, -5n - 1 + 2 = l. Solve -jw = n - 10 for w. 3 Let p = 648 - 395. Solve -2u = 257 - p for u. -2 Let v be (6 - 0) + -2 + 6. Let y = 11 - v. Let p = 5 + -2. Solve 4h = -p - y for h. -1 Let z(c) = -3c - 23. Let k be z(-8). Solve k + 3 = -4o for o. -1 Let r be 29/3 - (-2)/6. Suppose 24 = -7j + rj. Suppose 4s + w = 13 + j, -33 = -3s + 5w. Solve -31 = 5z - s for z. -5 Let v = 108 - 97. Suppose 9 + v = 10q. Solve qf + 0 = -2 for f. -1 Let q(t) = -t*3 + 4t*2 + 6t + 3. Let j be q(5). Suppose 0 = jf - 92 - 28. Solve -2g - 3g = -f for g. 3 Let p be (-2)/(-9) + 0 - 140/(-18). Solve -2a = pa for a. 0 Let g be ((-10)/5)/((-7 - -3) + 2). Suppose 0c - 5c + 2n + 2 = 0, 0 = -4c + n + g. Solve cz - 5z - 5 = 0 for z. -1 Suppose 4z - k = -9 - 25, -4z + 2k - 32 = 0. Let n = z - -12. Suppose -j - n = -6. Solve -p = -jp for p. 0 Let b(w) = -19w - 623. Let o be b(-33). Solve os = -223 + 219 for s. -1 Suppose 3r - 4r = -3, 4u = -5r + 43. Suppose -3f + u = -8. Let m(q) = q*3 - 4q*2 - 5q + 3. Let h be m(f). Solve -1 + 7 = -hs for s. -2 Let q = 2233 - 2231. Solve 0 = -qj - 16 + 6 for j. -5 Suppose -125 - 5 = 5g. Let x = g - -29. Solve xj = 12 - 3 for j. 3 Let u(n) = n - 3. Let z be u(10). Suppose 0 = 798o - 794o - 32. Solve 3l - zl = -o for l. 2 Let w(f) = f*2 - 13f + 22. Let y be w(11). Solve yd - 2d + 8 = 0 for d. 4 Let g be 11 - 14 - (-12 - 0). Suppose 5l = 4x + 206, -3x - 48 = -l - g. Suppose 5h = 5d + 8 + l, 3h = -4d + 16. Solve -h = -j - j for j. 4 Let c(r) = -8r + 2. Let s be c(7). Suppose 36k + 59 = 167. Let j be (-18)/s - (-11)/k. Solve 3n - 11 = j for n. 5 Suppose -23 = -8d - 7. Suppose -2h = -dm + 2, 6m - m = -5h + 15. Solve r - h = -0r for r. 1 Let w(y) = y*2 - 13y + 3. Let i be w(13). Suppose -2s + 1 = -i. Let n be -1 + 3(3 - s). Solve -n - 1 = k for k. -3 Let o be (-2 - -2)/(-6 + 4). Solve 14r - 17r - 3 = o for r. -1 Let o(h) = h + 4. Let t be o(0). Suppose -tb + 6b + 4 = 0. Let c be (2 - (-4)/b)/(-2). Solve -2l - 2l = c for l. 0 Suppose 0 = -4c + s - 95, 0 = -3c + s - 3s - 74. Let z = 32 + c. Suppose a + 4y = 4, -a - 4y + zy = -12. Solve -2q + 0 = a for q. -4 Suppose -58w + 1976 = -3998. Solve -4z + w = 123 for z. -5 Let a be (48/9)/(4/6). Suppose -u + 27 = au. Solve -28 = -5s - u for s. 5 Let b be ((-5)/((-35)/(-2)))/((-1)/7). Suppose 3s = 4g + 53, -4g = -bs - g + 36. Solve 3a = -0a + s for a. 5 Let g be 0 + (2 - (-4 + 16)). Let t = 21 - g. Let c = t - 31. Solve 1 = -cq - q for q. -1 Let z = 14 - 10. Let k(p) = -2p - 15. Let u be k(-4). Let c = u + 12. Solve zd - 4 = cd for d. -4 Suppose -2 - 3 = -4r - u, 2r = 4u + 16. Let m be 4/(-10) - (-24)/10. Suppose 0 = mi + 3i. Solve i = 4z - rz + 8 for z. -4 Suppose 0 = -z + 4z. Suppose 4p = 3i - 56, z = 3i + p - 3p - 52. Suppose -b - 8 - 2 = -2v, 3v - 2b - i = 0. Solve 21 + v = -5c for c. -5 Suppose -90x + 12214 = -566. Solve -4h - x = -146 for h. 1 Suppose 0 = -p + z + 13, p - 5p - 2z + 76 = 0. Solve -pc = -15c - 10 for c. 5 Suppose p - 5p + 280 = 0. Let i be 260/p - (-2)/7. Let x be i/(-14)(6 - 20). Solve 0 = -4s + 8 + x for s. 3 Suppose 0 = 2w + 13j - 8j + 15, 3j = -9. Solve 4m = -wm + 9m for m. 0 Let o be (4 + 3)(6 + 1). Let v = 49 - o. Solve 3h + h = v for h. 0 Suppose 3d - 2t - 305 = 0, -5t + 70 - 360 = -3d. Solve 0 = -107y + dy for y. 0 Let p be 12(4 + 105/(-28)). Solve -4 = pd - d for d. -2 Suppose -15 = t - 4t. Suppose -i - 3i = 0. Let a be (0 + 2)(i - -2). Solve -an = n - t for n. 1 Let d(o) = o3 + 15o*2 + 13o - 9. Let y be d(-14). Let a(m) = m*3 - 6m*2 + 9m - 10. Let g be a(y). Solve 5j = 3j + g for j. 5 Let m be 08/96-3. Suppose 3k + k - 100 = 0. Solve 5d = -k - m for d. -5 Let i be (-1)/2 - (-18)/12. Suppose -2g - x + i = 0, g + 4x - 1 = -11. Solve g - 7 = -k for k. 5 Let k(c) = 4c2 - c. Let f(r) = -r2 - 8r + 1. Let g be f(-8). Let t be k(g). Suppose -3w - 2 = -2u + 5, -tw = 3. Solve z - uz = 0 for z. 0 Let d(m) = -3m2 + 78m - 60. Let p be d(25). Solve 0 = 7b - 4b + p for b. -5 Let i(g) be the first derivative of -g*4/4 - 19g*3/3 - 9g*2 + 6g - 15. Let q be i(-18). Solve qd - 4d = -10 for d. -5 Let j be (-692)/(-28) + (-6)/(-21). Suppose q = 6q - j. Solve -6z + q = -z for z. 1 Let i be 24/9(-1710)/(-8). Suppose -a - i = 5a. Let w be (-2)/5 + (-323)/a. Solve 2c - w = -1 for c. 1 Let g = -14 - -18. Suppose -ga = -12, -3 = 3s + s - a. Solve sp = 5p for p. 0 Let j be 2/(-3)(-18 - 0/(-3)). Let k(u) = u*2 - 14u + 24. Let r be k(j). Solve r = 5w - 2 + 12 for w. -2 Let f(l) = l3 - 2l*2 - 2l + 7. Let w be f(4). Solve -12 = wr - 27r for r. -3 Let d(s) = s*3 - 7s + 15. Let x be d(3). Solve 7j = 56 - x for j. 5 Suppose -3w = 70 - 82. Solve w = 4g - 8 for g. 3 Let f(m) = 3m*3 - 16m*2 - 3m + 26. Let l(i) = i3 + i2 - i. Let u(k) = f(k) - 2l(k). Let v be u(18). Solve 2 + v = -5p for p. -2 Let n be 344/32 + -7 - (-1)/4. Solve 0g - 2g + n = 0 for g. 2 Let h(o) be the second derivative of o*5/20 + 5o4/6 + o2 + 2o. Let x be h(-10). Solve xj = -2j + 20 for j. 5 Let v(c) = c2 - 11c + 22. Let f be v(10). Let m be (-8)/f + (-42)/(-9). Solve 0 = -2h + mh + 10 for h. -5 Let s = -19 + 23. Solve 5l + 4 = sl for l. -4 Let f(l) = -l*2 + 25l - 30. Let z be f(16). Suppose 10t = z - 4. Solve 5 = -10h + th for h. 5 Suppose 2n + 227 = -3q, -2n - 4 = -n. Let p = -71 - q. Solve 0 = -o - p + 7 for o. 5 Suppose -41u + 70 = -422. Solve -27 = -5o - u for o. 3 Suppose -67s = -65s. Suppose 13w - 20w + 28 = s. Solve -2 = wz - 10 for z. 2 Let j be ((-700)/(-42))/((-10)/(-15)). Solve -i + 6i - j = 0 for i. 5 Let j = 51 + -73. Let d = j - -27. Solve dq = 2 + 3 for q. 1 Let j(r) = r3 + 5r*2 - 7r - 1. Let v be j(-6). Suppose -4l = -vl. Suppose l = -8b + 3b + 10. Solve -b - 2 = -y for y. 4 Suppose 5h - 84 = -9. Let k(r) = -r3 - 3r2 + 4. Let u(i) = -i2 + 3i + 7. Let f be u(5). Let x be k(f). Solve h = xj - j for j. 5 Suppose -14f + 10f + 36 = 0. Solve -10 - 8 = -fb for b. 2 Let k = -66 - -68. Let i(x) = 3x - 4. Let n be i(k). Solve -f + nf + 1 = 0 for f. -1 Let a be (10/(-4))/(6 + (-221)/34). Solve 5w + aw = -30 for w. -3 Let r = -670 - -670. Solve 0 = 3v - 6 - r for v. 2 Suppose c = -3t + 48, -27 = -t + c - 5c. Solve -n = 4n - t for n. 3 Let l be (2 - 5) + 10 + -3. Solve -19x = -lx + 15 for x. -1 Suppose 5x = -5g + 10, g = -g - 4x. Let n be (15/(-30))/((-1)/(-2)). Let q be 6(-3)/(-2) + 2/n. Solve -gu - q = 5 for u. -3 Suppose -4w - s + 1 + 4 = 0, 2w = 5s + 19. Solve 3v + wv = -5 for v. -1 Suppose 56 = 3g + 5g. Suppose -o - o - 3q + 8 = 0, -3o = -5q + g. Solve -3f + 4 = o for f. 1 Let f = 7 - 3. Let j be (-2(-4)/12)/((-2)/(-51)). Suppose -j = -5a + 58. Solve a = fc + 3 for c. 3 Suppose 2o - 12 = -2, 2q + 3o - 77 = 0. Solve q = -15k + 1 for k. -2 Let u(c) = 3c2 - 11c + 8. Let k be u(4). Solve 5a + k = a for a. -3 Let c(u) = -15u - 161. Let m be c(-11). Solve -4s = 4 + m for s. -2 Let q be (-6)/(-10) + 37/5. Suppose -17g = -21g - q. Let x be (0 + 0)/(g - -4). Solve 5d = -xd + 10 for d. 2 Let a(j) = -6j*2 + 12j - 1. Let u be a(2). Let r(f) = -f*2 + f + 2. Let l be r(u). Solve c + 3c = l for c. 0 Suppose 0 = -0v - 8v + 5v. Solve v = -17b + 6b + 11 for b. 1 Suppose 0 = 3s + z - 22, -3z - 4 + 14 = 2s. Suppose 0 = 4w - s. Solve 8 - w = -2o for o. -3 Let s(l) = -l*3 - 35l*2 - 3l - 103. Let x be s(-35). Solve 0 = -3v - xv - 15 for v. -3 Let p = 43 + -37. Let w be (p - 3)/(5 - 4). Solve -wt - 2 = 13 for t. -5 Let v(h) = 16h3 - h2. Let p be v(1). Let k be p/10(-12)/(-9). Let f be (-3)/(k + -2 + -1). Solve fn - 4 = 4n for n. -4 Suppose 2x + 2c - 15 = c, 5x - 27 = c. Solve 5h + x = 11 for h. 1 Let c(s) = s2 - 8s + 3. Let l be c(6). Let w be (-4)/(-6) + (-66)/l + -1. Solve 3r + w = -8 for r. -5 Let h be (4 + -3)/((-6)/(-18)). Let q = -1 + h. Solve -4 = 3a + q for a. -2 Suppo	{ "pile_set_name": "DM Mathematics" }
rt(34)/sqrt(2))). -3265 - 60sqrt(17) Simplify 2 + -5 + ((sqrt(320) + sqrt(320) + sqrt(320) + sqrt(320)2 + sqrt(320))6)2 + -4 + 5. 414718 Simplify (((sqrt(432)-26)/(sqrt(24)/sqrt(2)-1 - sqrt(12)))/(4(sqrt(1452)1 - sqrt(1452) - sqrt(108)/(sqrt(9)2))))2. 27 Simplify (-5(-5 + sqrt(272)-1) + (-2(sqrt(272)1)2 - sqrt(272) - (1 + sqrt(272) + 1)2))4 + 5. -3175 Simplify ((3 + -1sqrt(832) - (sqrt(832) - sqrt(832)-12)) + 0 + (sqrt(832) + 0 + sqrt(832) + 4 - (sqrt(832) - (1 + -2sqrt(832)))))*2. -640sqrt(13) + 20864 Simplify 5-23(-4 + (6(2sqrt(396))2 - (4 + -2sqrt(396)))2). -569880 - 720sqrt(11) Simplify (5 + (-3sqrt(27)/sqrt(9)2 - (sqrt(33)/(sqrt(99)/sqrt(9)) + 5)))*2. 147 Simplify -3 + ((1 + sqrt(11))-6 + -1sqrt(44))-4 - (6(sqrt(275)2 + -5 - (sqrt(275) + -2 + (2sqrt(275) - sqrt(275) - sqrt(275)))))2. -10203 + 1112sqrt(11) Simplify ((sqrt(208) + -1)26 + -3 + 0 + -61sqrt(208) + -4)*2. -912sqrt(13) + 7849 Simplify (((sqrt(17) + (sqrt(17) + sqrt(17)3)-4 - (sqrt(17) - -2sqrt(2057))) + 5sqrt(102)/(-1sqrt(96) + sqrt(96) - sqrt(96)))-2-2)2. 419033 Simplify (sqrt(56) + sqrt(336)/sqrt(6))/sqrt(8) + sqrt(14)/(sqrt(2)1) - (-1sqrt(84)/sqrt(4))/(sqrt(27)6). 55sqrt(7)/18 Simplify (-4 + ((sqrt(1088) - (0 + sqrt(1088) + 1 - sqrt(1088))) + sqrt(1088))-4 - (-1 + (-1 + sqrt(1088))3 + 5))26. 1056sqrt(17) + 789894 Simplify 3 + -3 + -3 + 3sqrt(180)2 + (sqrt(180) + sqrt(180)-1-6 + sqrt(180) - (sqrt(180) - (-5 + sqrt(180) + -1))). -9 + 84sqrt(5) Simplify ((sqrt(1728) - (-5-2sqrt(1728) - sqrt(1728))) + sqrt(1728)-15 + sqrt(1728))/((sqrt(648)-2)/(sqrt(14)/sqrt(63))). 8sqrt(3)/3 Simplify (4((sqrt(33) - (sqrt(165)-2 - sqrt(165))/sqrt(5)) + sqrt(4752)-1))/((sqrt(576) - sqrt(576)2 - sqrt(576))/(sqrt(432) + sqrt(432)-1 - sqrt(432))). -24sqrt(11) Simplify (-2(sqrt(78) + (3(sqrt(78) - (sqrt(78) + sqrt(78)-1 + sqrt(78))) - sqrt(78))))/((sqrt(66)2)/sqrt(11)2) + 4. 4 Simplify ((2sqrt(4)/(sqrt(6)/sqrt(3))-2 - (sqrt(24)/(sqrt(588) - -1sqrt(588) - sqrt(588)) + 3)*2) + 3)-3. 888/49 + 102sqrt(2)/7 Simplify -1 + -4 + -1((-3(sqrt(441) - -1sqrt(441)))/sqrt(9))/(-1sqrt(448)-4). -5 + 3sqrt(7)/16 Simplify -13(4 + (sqrt(128) - (sqrt(128) + 0)) + (6-2sqrt(128))2 + 2)-16. 331884 Simplify (((sqrt(539) - (sqrt(539) - (1 + sqrt(539)))) + 5 + (sqrt(539) - (sqrt(539) + -1)-1) + 5)*2 + (-545sqrt(99)1)2)-4. -3979804 - 1680sqrt(11) Simplify ((5 + sqrt(500) + -1)-4 - ((1 + sqrt(500))4 + sqrt(500) + (sqrt(500) - (3 + 2 + sqrt(500)))))2. 2700sqrt(5) + 40725 Simplify (-1(-1 + (-5 + -3 + sqrt(832) + sqrt(832) + 1 - (-3 + -4 + 1 + sqrt(1872)))))2. -16sqrt(13) + 212 Simplify ((4sqrt(156) - sqrt(156))-4)/(sqrt(108)/(-1sqrt(9))) - -3(0 + sqrt(1300) - -2(sqrt(13) - sqrt(78)/sqrt(6)))2. 12sqrt(13) + 3900 Simplify (-3(sqrt(19)-1 + 2 - -2sqrt(2736)))2 + (-2 + (sqrt(38)/sqrt(2))2 + sqrt(19) + sqrt(19) + sqrt(19) + (sqrt(19) - sqrt(133)/(2sqrt(7))))-1. 1649sqrt(19)/2 + 90478 Simplify (-1(sqrt(143) + -4(sqrt(143)2 + sqrt(143) + sqrt(143)))3)/((-1sqrt(891) - sqrt(891))-22). 5sqrt(13)/8 Simplify 2((-1sqrt(88)-3)/(sqrt(128)-4 + sqrt(8)) + (sqrt(22)/(sqrt(2)2) + sqrt(704)2)3). 493sqrt(11)/5 Simplify (sqrt(256)/sqrt(4) + sqrt(4))/(sqrt(200) + -2sqrt(200))-5 - (0 + -4 + 1sqrt(24)/sqrt(48)). 2sqrt(2) + 4 Simplify -2sqrt(20)/sqrt(4) + -1sqrt(405) + (1sqrt(960) - sqrt(960))/(sqrt(6)/(sqrt(2) - (sqrt(2) + sqrt(8)/sqrt(4) + sqrt(2)))) + -1. -11sqrt(5) - 1 Simplify (1sqrt(1215)-1)/(3sqrt(45)2). -sqrt(3)/2 Simplify ((-2(sqrt(112) + 1) + 5 - 32sqrt(112)5) + 0)*2 + 2. -768sqrt(7) + 114699 Simplify 1((-3sqrt(495)1)/(-1sqrt(324)))/(((1sqrt(210))/sqrt(6))/((sqrt(7) - (sqrt(77)/(sqrt(11) - sqrt(44)) + sqrt(7)) - sqrt(7)) + sqrt(7))). sqrt(11)/2 Simplify sqrt(432) + (4sqrt(432)-3)2 + -5 + (sqrt(432) - (-3 + sqrt(432)))2 - -4(sqrt(432)2-5 + sqrt(432) - (0 + sqrt(432) + 4))*2. 3852sqrt(3) + 235076 Simplify ((-1-1sqrt(136) + (sqrt(136) + -2sqrt(136) + sqrt(136) + sqrt(136))-1)4)/(3sqrt(288) + sqrt(1024)/sqrt(2)). 0 Simplify (-2((0 + sqrt(68))-1 + -2 + sqrt(68) + -3sqrt(68) + (-2 + sqrt(68) + 4)4 + -5))*2. 16sqrt(17) + 276 Simplify (3(sqrt(136)2-2 + sqrt(136))-5)/(1(6sqrt(72)1)/sqrt(9)). 15sqrt(17)/2 Simplify 1 + (-1(sqrt(1872) + sqrt(1872)-2 - sqrt(1872)) + sqrt(1872) + -4 + 0 + sqrt(1872) - 21(sqrt(1872)-2 + 5))2. -2688sqrt(13) + 120005 Simplify (((sqrt(5500) + -4(sqrt(5500) + sqrt(5500)2 - sqrt(5500)))-6)/((sqrt(320) - (1sqrt(320) - sqrt(320)))-65))*2. 539/16 Simplify (sqrt(1573) + -1sqrt(1573)-3 - (sqrt(1573) + (sqrt(1573) - 4-1sqrt(1573)) - sqrt(1573)) - ((4sqrt(104))/sqrt(2) + -5))*2. -190sqrt(13) + 4718 Simplify (sqrt(120)/sqrt(4)5 - (sqrt(750) - (sqrt(750) - sqrt(750)2)))/(sqrt(24) + sqrt(2400)-1)2 + 0. 5sqrt(5)/9 Simplify 2(sqrt(2448) + (sqrt(2448) + 0)6)2 + -5 + -2sqrt(2448) + 1 + -4. -24sqrt(17) + 239896 Simplify (-1 + -1 + -3(sqrt(1152) + 3 + 3sqrt(1152) - sqrt(1152)-23))2. 15840sqrt(2) + 1036921 Simplify (5 + 5 + -3-2(sqrt(28)/sqrt(32))/(sqrt(2) - sqrt(4)/sqrt(8) - sqrt(2)))*2. -60sqrt(7) + 163 Simplify (3(3 + (sqrt(605) - sqrt(605)1) + (sqrt(605) - ((sqrt(605) - sqrt(605)1)6 + sqrt(605))) + sqrt(605) + -1 + 2-2sqrt(605)-5))2. 8316sqrt(5) + 2401281 Simplify -4 + -4 + (((sqrt(704) + sqrt(704) + -1)*2 - sqrt(704))-6 - sqrt(704)) + (1sqrt(99) - (sqrt(11) + 0)-1). -16910 + 236sqrt(11) Simplify 4-3(0 + ((sqrt(1377)-2-2 - sqrt(1377))2 - (-1 + (sqrt(1377) - 2sqrt(1377))) - -2((sqrt(1377) - -2sqrt(1377))*2 + 3))). -446232 - 108sqrt(17) Simplify ((5sqrt(156)-2 + sqrt(156) + (sqrt(156) - sqrt(156)-1)-6)-6)/(-1(sqrt(12) - 3sqrt(1200) - sqrt(12))6). 7sqrt(13)/10 Simplify (sqrt(66)/sqrt(6)-4 - (sqrt(11) + (-5sqrt(396) + sqrt(396))2)) + (sqrt(99)/sqrt(1089) - (sqrt(1100) + -3 - sqrt(1100))2) + -4. -6349 - 54sqrt(11)/11 Simplify (5((sqrt(242) + 2 - sqrt(242)) + 2 + sqrt(242) - (sqrt(242) + 1 + -4)) + 2 + 2)2 + -2. 1519 Simplify ((-6sqrt(80)-2)/(sqrt(10) - sqrt(40)/sqrt(64)))/((sqrt(4) + (sqrt(80)/sqrt(4))/sqrt(5) + -4sqrt(36))1). -8sqrt(2)/5 Simplify -5 + (-4 + (1 + 3sqrt(108) + sqrt(108) + sqrt(108) + sqrt(108) - (sqrt(108) - (sqrt(108) + sqrt(108) + 1 + sqrt(108) + -3)))3 + -2 + 0)*2. -2592sqrt(3) + 62284 Simplify -6-3-25(sqrt(117) + -4 + -4 + sqrt(117)/sqrt(9))*26. -293760 + 69120sqrt(13) Simplify 3(((-6(sqrt(1053)-12 + sqrt(1053)))2 - (sqrt(1053) + -3(-1 + sqrt(1053)))5) + 3). 270sqrt(13) + 113688 Simplify 3-5(1 + (sqrt(153) + 0 + (sqrt(153) + -2 - sqrt(153)) + (sqrt(153) - ((sqrt(153) + 1 - sqrt(153)) + sqrt(153))2) + 1)2)-6. 900 Simplify -4 + ((-6sqrt(832))2 - (sqrt(260)1)/sqrt(5)) + 1 + 5. -2sqrt(13) + 29954 Simplify -5(4(6(-2sqrt(91) + sqrt(91)))/(-2sqrt(7)-1 - sqrt(7)) + 4)2. -37520 + 960sqrt(13) Simplify (0 + 0 + ((2 + sqrt(208) + 4)5 - -5-4(sqrt(208) + 2)))2. 1200sqrt(13) + 46900 Simplify 4 + sqrt(288)/((sqrt(60) + sqrt(540))/sqrt(10) - sqrt(6)) + sqrt(336)/(sqrt(7) - 3sqrt(7)6) + -1. 56sqrt(3)/51 + 3 Simplify ((-12sqrt(204) - (sqrt(204) + sqrt(204)1)3)/((sqrt(36)/sqrt(12) - sqrt(588)-3)3))2. 4352/16641 Simplify -2((sqrt(408)/(sqrt(48)/sqrt(4))2)/((3sqrt(64) - sqrt(64))/sqrt(8)) + -5). -sqrt(17) + 10 Simplify 6(4 + (4 + -1sqrt(11) - (-5 + sqrt(55)/sqrt(5)) - (-1 + 6-1sqrt(11) + sqrt(11)))*2). 360sqrt(11) + 1218 Simplify ((((-4 + sqrt(2448))5 - sqrt(2448)) + sqrt(2448)-2 + 4)-1-4)*2. -12288sqrt(17) + 160768 Simplify -1((1(-3 + -1 + (sqrt(147) - (sqrt(147) - (sqrt(147) + 2 + sqrt(147) - sqrt(147))) - sqrt(147)) + sqrt(147)))*22-6 + 1). -336sqrt(3) + 1811 Simplify -4 + -6((sqrt(700)12 - sqrt(700))2 - (-3 + -2sqrt(700)))-4. 480sqrt(7) + 16868 Simplify -4(1 + -1sqrt(108)-6 + -1 + sqrt(108) + (sqrt(108) - (sqrt(108) + 2sqrt(108)-1 - sqrt(108))))2-1 + -4. 43196 Simplify -1 + -1-1(-3 + -5(-1sqrt(3564) + -4))*2. 3060sqrt(11) + 89388 Simplify ((-1(sqrt(50) + sqrt(50)-1 + sqrt(50)))/(-2sqrt(490)))2 + 1 + sqrt(5) + sqrt(10)/sqrt(2) + (sqrt(180) - ((sqrt(180) + -4)2 - sqrt(180))). -38215/196 + 62sqrt(5) Simplify (-5((-5-2*sqrt(64)	{ "pile_set_name": "DM Mathematics" }
8a + 9/8a*3. 3(a - 1)(a + 1)2(a + 2)/8 Let y(h) be the third derivative of h*5/60 + 4h*4/3 - 24h*3 - 387h*2. What is m in y(m) = 0? -36, 4 Let i(x) be the second derivative of -3x2 + 0 + x3 - 1/8x4 - 23x. What is k in i(k) = 0? 2 Let q(l) be the second derivative of l8/23520 - l7/8820 + l*4/6 + 2l. Let t(o) be the third derivative of q(o). Suppose t(m) = 0. What is m? 0, 1 Let f(t) be the first derivative of -t*3 - 11t*2/6 - 2t/3 + 115. Factor f(g). -(g + 1)(9g + 2)/3 Let m(u) be the third derivative of 0 - 5/2u4 + 0u + 50u3 + 1/20u*5 + 33u*2. Determine z, given that m(z) = 0. 10 Suppose -26c = -29c - 150. Let x = c + 251/5. Factor 0 - 3/5t*2 - 2/5t + 0t3 + xt*4. t(t - 2)(t + 1)2/5 Let p(l) = -l3 - 7l*2 - l - 5. Let y be p(-7). Let o = 2247 - 6733/3. Factor 8/3k*4 + 0 + 4k*3 + 2/3k + 2/3k5 + ok*y. 2k(k + 1)4/3 Let -4f*2 - 4f*5 + 36f*3 - 5f*4 + 98f*2 - 22f*2 - 3f*4 = 0. What is f? -3, -2, 0, 3 Let s = 168/155 - 15/31. Factor -sr*5 + 0r + 3/5r3 - 3/5r*2 + 0 + 3/5r*4. -3r*2(r - 1)*2(r + 1)/5 Let m = 941/20 + -47. Let r(q) be the first derivative of mq4 + 1/15q*3 - 1/30q*6 + 0q - 1/25q5 + 0q*2 + 1. Find c such that r(c) = 0. -1, 0, 1 Let a(y) be the first derivative of 3y*5/5 - 15y4/4 + y3 + 63y2/2 - 54y - 69. Factor a(m). 3(m - 3)2(m - 1)(m + 2) Let j = -57/2 + 29. Let d(w) be the first derivative of -3 + 1/2w + jw2 + 1/6w3. Factor d(m). (m + 1)2/2 Let w(x) be the first derivative of -x*6/8 + 9x*5/10 + 3x*4/2 - 3x*3/2 - 21x2/8 + 13. Find i such that w(i) = 0. -1, 0, 1, 7 Let w(g) be the second derivative of -g5/30 + g*4/18 + 4g*3/3 + 9g - 1. Factor w(v). -2v(v - 4)(v + 3)/3 Let d(g) be the first derivative of -2g3/15 + g2/5 + 12g/5 - 2. Factor d(t). -2(t - 3)(t + 2)/5 Let n(l) be the third derivative of -1/1680l*8 + 0l*6 + 0l + 0l4 - 16l*2 + 0l*5 + 0 + 0l*3 - 1/1050l*7. Find b, given that n(b) = 0. -1, 0 Suppose -1458g + 105 = -1443g. Let w(x) be the second derivative of 0 + 0x*4 - 1/40x*5 + 1/84x*g + 0x*3 - 7x + 0x6 + 0x2. Factor w(p). p3(p - 1)(p + 1)/2 Suppose 3g + 5m = 34, 5g - 3m = -0g. Let y = -1180 + 5918/5. Let yk - 2kg + 12/5k*2 - 4/5 = 0. What is k? -1, 1/5, 2 Let t(v) = 3v*3 + 6v*2 - 8v - 6. Let w(z) = z*3 - 2z. Let f(p) = -2t(p) + 10w(p). Let f(n) = 0. Calculate n. -1, 1, 3 Suppose -5z = 5y, 4y - 1 + 13 = -z. Let n(l) be the third derivative of 0 + 1/30l*5 - 1/4l*z + 0l + 0l3 + 3l*2. Solve n(v) = 0 for v. 0, 3 Suppose -5x + 15 = 0, -2j + 9x = 4x + 7. Factor -2m + 1/4m2 + j. (m - 4)2/4 Let b be -10-8(-7)/(-70). Let y(f) be the first derivative of 1/14f*4 + 8/7f*3 + 128/7f + 48/7f2 + b. Factor y(h). 2(h + 4)*3/7 Suppose 13 = 8n - 27. Suppose 0 = -4c + 4a, a - n = -3. Factor 2/11b4 + 4/11b*3 + 0b*c - 2/11 - 4/11b. 2(b - 1)(b + 1)*3/11 Let f(p) be the first derivative of 12 + 1/10p*2 + 2/5p*4 + 0p + 1/3p3 + 4/25p*5. Factor f(w). w(w + 1)(2w + 1)*2/5 Let t = -81 + 409/5. Let b be 6 + 1/((-5)/20). Factor 4/5r*4 + 0 - tr*b + 0r*3 + 2/5r - 2/5r5. -2r(r - 1)3(r + 1)/5 Suppose 3d - 4 = d. Let o be 6655/(-363)(0 - (-12)/(-10)). Factor 0m2 - 16m - 6md + 6 - o + 2m*2. -4(m + 2)2 Let x(r) = -r2 - r + 13. Let u(g) = -1. Let f(p) = -4u(p) - x(p). Suppose k = -3k - 8. Let l(a) = 1. Let b(o) = kf(o) - 14l(o). Factor b(n). -2(n - 1)(n + 2) Let m be (-2)/448/(-8). Suppose -5 = md - 17. Determine o so that o2 + o2 - 2o + 3o*2 + 2o*5 - 5od = 0. -1, 0, 1/2, 1, 2 Let w(b) be the third derivative of b6/270 + b*5/30 + 2b*3 - 3b2. Let f(h) be the first derivative of w(h). What is r in f(r) = 0? -3, 0 Let y(l) be the third derivative of l5/30 - 14l4/3 + 784l*3/3 - 41l*2 - l. Let y(f) = 0. What is f? 28 Suppose 4l = -20h + 18h + 16, 0 = -2l - 2h + 12. Determine n, given that 9/4n4 + 3/4n*5 - 3/4 - 3/2n*l - 9/4n + 3/2n3 = 0. -1, 1 Let p = 22 - 52. Let q be (7 - (-207)/p)4. Factor -qf2 - 1/5f + 2/5 + 1/5f3. (f - 2)(f - 1)(f + 1)/5 Let v(t) be the third derivative of 4/35t*7 + 2t*4 - 16/3t*3 + 0 + 0t - 11/30t6 - 1/84t*8 + 2/15t*5 - 21t*2. Solve v(h) = 0 for h. -1, 1, 2 Determine n so that 3/2n + 0 - 5/6n3 - 1/2n*2 - 1/6n4 = 0. -3, 0, 1 Let w(x) be the third derivative of x9/4536 - x8/630 + x7/420 - x*3 - 38x*2. Let b(c) be the first derivative of w(c). Factor b(o). 2o*3(o - 3)(o - 1)/3 Let t(h) = 10h*3 + 61h*2 + 80h + 18. Let c(n) = 2n3 + 12n*2 + 16n + 4. Let f(u) = -22c(u) + 4t(u). Factor f(o). -4(o + 1)(o + 2)*2 Let b(r) be the first derivative of -16/7r - 8/7r2 - 4/21r*3 - 26. Factor b(m). -4(m + 2)*2/7 Determine z, given that 31/4z - 3/4 - 5/2z2 = 0. 1/10, 3 Let 33c + 60 - 17c3 - 44 - 9c + 3c3 - 4c*2 + 2c*5 = 0. What is c? -2, -1, 2 Solve 712a*2 - 133a - 313a + 444a*2 + 19 + 81 - 234a = 0. 5/17 Let k(t) be the second derivative of t*5/20 + 11t*4/6 + 161t*3/6 + 196t*2 + 97t. Factor k(h). (h + 7)*2(h + 8) Let r = -73 - -75. Let 7 + 1 + 2pr + 1499p - 1491p = 0. What is p? -2 Suppose -1/7t*2 + 1/7t*3 - 2/7t + 0 = 0. What is t? -1, 0, 2 Let l(v) = 3v2 - 5v - 6. Let n(b) = b*2 + 4217b - 4217b. Let u(m) = 5l(m) - 10n(m). Factor u(y). 5(y - 6)(y + 1) Let -3/4a*4 - 1/4a - 11/4a2 - 11/4a*3 + 1/2 = 0. What is a? -2, -1, 1/3 Let k = 34539 + -69075/2. Factor -9/4l*4 + 0l + 0l2 + kl*5 + 0 + 3/4l*3. 3l*3(l - 1)(2l - 1)/4 Let n = 2444/3 - 4885/6. Factor 0 - p*3 - 9/4p*2 - np. -p(p + 2)(4p + 1)/4 Suppose 4y + y = -5g + 10, 2g = -3y + 8. Suppose s - b - 15 = yb, 3 = s - b. Factor -6/5k2 - 4/5k + 0 + 2/5k4 + sk*3. 2k(k - 2)(k + 1)*2/5 Solve 48/7 - 435l*4 - 537/7l*2 + 318/7l - 5232/7l3 - 300/7l*5 = 0. -8, -2, -1/5, 1/4 Let n(c) = -80c*2 - 100c - 125. Let b = 18 + -14. Let i(a) = -9a2 - 11a - 14. Let f(v) = bn(v) - 35i(v). Determine g, given that f(g) = 0. -2, -1 Let h be (-912)/(-4 + 2). Let c be (-1)/(-2) - h/(-14). Factor -4v + 0v + 0v*3 + 2v*4 + cv*3 - 3v*3 - 2. 2(v - 1)(v + 1)3 Let q(b) be the third derivative of b8/336 + b7/84 - 3b*3 + 9b*2. Let l(g) be the first derivative of q(g). Factor l(s). 5s*3(s + 2) Let i = -411 - -416. Let g(m) be the first derivative of m*4 + 4/3m*3 - i - 2m*2 - 4m. Factor g(t). 4(t - 1)(t + 1)*2 Let j(s) = 3s - 3. Let g be j(1). Suppose -o - 3o + o = g. Suppose 1/4m*2 + o + 0m = 0. What is m? 0 Let l(d) be the third derivative of -d*3 + 6d*2 - 11/12d*4 + 0d + 1/20d6 + 0 - 1/6d*5. Solve l(n) = 0 for n. -1, -1/3, 3 Let m be 8/60 - (-84)/5(-24)/(-216). Find z such that 8/7 - 12/7z3 - 32/7z*m - 12/7z = 0. -2, -1, 1/3 Let o(w) be the first derivative of 1/2w2 - 1/20w*5 - 4 + 1/6w*3 - 1/12w*4 + w. Let b(t) be the first derivative of o(t). Factor b(u). -(u - 1)(u + 1)*2 Let w = 2545 - 2545. Let m(r) be the second derivative of 2/15r*6 + 1/2r*2 + 3/2r*3 + 97/48r*4 - 4r + w + 9/10r5. Suppose m(t) = 0. Calculate t. -2, -1/4 Let 11w*3 - 14w*3 + 552w*2 + 389344 - 25392w - w*3 = 0. What is w? 46 Let i = -5 + 6. Let p be 0(2 + -1) - (-1 - i). Solve 1/5f3 + 0 + 0f - 2/5fp = 0. 0, 2 Let b(x) be the first derivative of -10x*3/27 + 17x*2/9 - 4x/3 + 117. Determine l so that b(l) = 0. 2/5, 3 Let y(v) be the first derivative of 0v3 + 0v*5 + 0v + v*4 + 0v*2 - 2/3v*6 - 13. Suppose y(i) = 0. What is i? -1, 0, 1 Factor 1/2w2 + w4 - 3/2w3 + 0 + 0w. w*2(w - 1)(2w - 1)/2 Let m(t) be the second derivative of -t5/20 - t4/4 - t3/2 - t2/2 + 245t. Determine v, given that m(v) = 0. -1 Let t(v) be the second derivative of v7/168 - v6/72 - v5/12 + 17v*3/6 - 4v. Let n(w) be the second derivative of t(w). Factor n(z). 5z(z - 2)(z + 1) Let u be (-7 + 1)(-128)/(-48). Let q = -16 - u. Factor 1/2m2 + q - 3/2m. m(m - 3)/2 Determine h so that 0 + 3/7h*2 + 2/7h - 8/7h3 + 3/7h*4 = 0. -1/3, 0, 1, 2 Suppose -1 = 5a - 31. Let l(i) = i*3 - 9i*2 + 16i + 14. Let d be l(a).	{ "pile_set_name": "DM Mathematics" }
/30z5. Let u(i) = 719i - 356i - 362i. Give j(u(k)). -2k2 Suppose -12a + 4a = -16. Let f(n) = -18n*2 - an - 3n2 + 22n*2 + 36n*2. Let t(c) = -2c*2. What is f(t(g))? 148g*4 + 4g2 Let m(j) = j2 - 5. Let z be (-7 + -2)13/(-3). Suppose -12t + 9 + z = 0. Let a(x) = -2x - tx + 4x. Determine m(a(o)). 4o*2 - 5 Let v(f) = -17f2 + 48. Let w(r) be the first derivative of -r2/2 + 2920. Give v(w(y)). -17y2 + 48 Let b(z) = -2z. Let g(y) = -9y - 20. Let h be g(-6). Let d(l) = 376l + 14l + hl - 54l. Give d(b(x)). -740x Let t(d) = 3d2 + 73. Let h(r) = -912r + 1830r - 923r. What is t(h(s))? 75s2 + 73 Let s(i) be the second derivative of i4/3 + 17i. Let m(t) be the second derivative of -3t4/2 + t2 - 300t + 2. Determine s(m(b)). 1296b4 - 288b*2 + 16 Let m(g) = 13g. Let q = 2850 - 8549/3. Let z(u) be the second derivative of -6u + 0 + 0u*2 - qu*3. Calculate m(z(k)). -26k Let l(k) = -k*2 + 21k. Let n(q) = -7q - 9. Let p(h) = -57h - 4 + 24h + 30h. Let d(z) = -4n(z) + 9p(z). Determine l(d(u)). -u*2 + 21u Let a(l) = -5l. Let h(v) = -4610694v*2. Calculate a(h(b)). 23053470b2 Let g(j) be the second derivative of -j4/12 + 10j2 + 521j. Let w(k) = -5k. Determine g(w(r)). -25r*2 + 20 Let u(r) = -4r2 - 2. Let f = -180 + 177. Let g(t) = -t2 - t. Let x(a) = -6a2 - 3a. Let c(b) = fg(b) + x(b). What is c(u(i))? -48i*4 - 48i*2 - 12 Let t(l) = -8l*2 - l. Let f = 11 + -9. Let i(w) = -13w + 113. Let r be i(8). Let o(y) = -16yf - 14y*2 - ry*2 + 38y*2. What is t(o(d))? -8d4 + d2 Let a(d) = 2598d + 92. Let k(t) = 33t*2. Determine a(k(i)). 85734i*2 + 92 Let u be ((-28)/(-10))/(-7)-270. Let t = -106 + u. Let q(d) = -75d2 + 64dt - d + d. Let j(c) = c2. Determine q(j(z)). -11z4 Let y(d) be the third derivative of d5/15 + 5851d2. Let v(p) = -p2 + 695. Calculate v(y(n)). -16n4 + 695 Let w(h) = -8467419 - 2h*2 + 8467419. Suppose 0 = 7v - 2v - 110. Let g(l) = -4l + vl + 5l. Give g(w(r)). -46r2 Let a(k) = -k2. Let q be -9 - -28 - (-7)/(-1). Let j(r) = 0r*2 + qr*2 + 60r*2. Give j(a(u)). 72u*4 Let x(t) be the second derivative of -49t3/3 - t2 - t + 1649. Let n(o) = -6o - 1. Calculate x(n(l)). 588l + 96 Let v(y) = 82575y. Let j(w) = -121w*2. Determine j(v(l)). -825054305625l*2 Let b(t) = -11 - 480t + 981t - 480t. Let k(x) be the first derivative of 2x2 - 2x + 2. Let n(m) = -2b(m) + 11k(m). Let s(g) = -2g. Give s(n(f)). -4f Let n(l) = -2l + 16. Let u(f) = 21f*2 - f + 8. Let w(q) = 2q*2 - q + 8. Let a(s) = u(s) - w(s). Give a(n(r)). 76r*2 - 1216r + 4864 Let n(a) be the third derivative of -2a5/15 + 15a*2 - 54. Let d(s) = 18s*2 - 13. What is d(n(j))? 1152j*4 - 13 Let c(r) = -34r. Let n(h) = -9h + 3h - 17h + 6h - 10h. Give c(n(v)). 918v Let m(n) be the first derivative of 4765n3/3 - 2236. Let g(r) = -r2. Calculate g(m(h)). -22705225h*4 Let l = 222 - 137. Let u(z) = -43z + lz + 30z. Let o(d) = -3d2. Calculate u(o(a)). -216a*2 Let c = 0 + 2. Let r(k) = -11k*c + 3k*2 + 5k*2 + 9k*2. Let b(y) = 6y. Give b(r(w)). 36w2 Let l(i) = 25204i*2 - 12i + 6. Let a(p) = 2p. Give l(a(q)). 100816q*2 - 24q + 6 Let w(b) = -1656b. Let m(t) = t2 - 269 - 35 + 304. Give w(m(k)). -1656k*2 Let x(y) = -11y - 10y + 21y + y*2. Let c(s) = 6s - 39. Let z(h) = -2h + 14. Let t(b) = 3c(b) + 8z(b). Determine t(x(w)). 2w*2 - 5 Let d(p) = 4p*2 + 21p. Let s(h) = 3h2 + 14h. Let j(k) = 2d(k) - 3s(k). Let f(g) be the third derivative of 121g4/24 + 4g*2. Calculate f(j(u)). -121u*2 Let a(l) = -28l*2 - 2l. Let v(m) = -20m - 35m + 78m - 3m. What is v(a(p))? -560p2 - 40p Let g(h) = -11h. Let a(y) = 2y + 22. Let t(l) be the first derivative of -4l + 3l + 25 - 2l + 2l. Let b(p) = 2a(p) + 44t(p). Determine g(b(i)). -44i Let r(c) = c - 3. Let g(f) = 2. Let v be (9/(-15))/(5/(-125)). Let o be 0/(-1) - (18 - v). Let d(u) = og(u) - 2r(u). Let b(w) = 5w. Determine d(b(z)). -10z Let f(k) = 2k - 204. Let o(w) = 823w. Calculate f(o(g)). 1646g - 204 Let d(u) = -u. Suppose -43v + 49 - 22 = -16. Let z(n) = 3n - 6n - 3 - 3n*2 + 0n2. Let y(x) = x2 - x - 1. Let l(i) = vz(i) - 3y(i). Give d(l(o)). 6o2 Let h(y) = 34y + 2. Let v(q) = q*3 - 25q*2 - 24q - 50. Let o be v(26). Let m(s) = 11so - 23s*2 - s + s + 14s*2. Determine m(h(i)). 2312i*2 + 272i + 8 Let x(a) = 11 - 8228a + 8230a - 11. Let f(s) = 398s - 96s + 81s. What is f(x(t))? 766t Let q(k) = 6k2. Let r(j) be the second derivative of j5/12 - j3/3 + 70j. Let i(c) be the second derivative of r(c). What is i(q(s))? 60s2 Let b(q) be the third derivative of -q4/8 + 2q*3/3 - 503q*2. Let k(c) = -5c*2. Calculate k(b(r)). -45r*2 + 120r - 80 Let h(o) = 4o2. Let m(a) = -5 + 528a - 86a - 7 + 12. What is m(h(b))? 1768b*2 Let s(g) = 20g*2 - 64g. Let m(z) be the first derivative of -z*2/2 - 8575. Calculate s(m(x)). 20x*2 + 64x Let n(s) = -4s2. Suppose a = -l + 3l - 1, 15 = 5l. Suppose -278 = -aw - t, 5t + 33 = -3w + 213. Let b(o) = -67o + 132o - wo. Give n(b(r)). -400r*2 Let p(m) = -5m. Let d(t) = 40t2 + 3. Let j(k) be the second derivative of 50k*4/3 + 8k*2 - 10k - 5. Let w(c) = 16d(c) - 3j(c). What is w(p(x))? 1000x2 Let q(j) = -6j. Let x(v) = 87v - 207v - 3471 + 3471. Give x(q(n)). 720n Let k(c) be the first derivative of -c4/12 - 5c*3/2 + 7c*2 + 31. Let b(v) be the second derivative of k(v). Let n(r) = 2r*2. Give n(b(d)). 8d*2 + 120d + 450 Let f(j) = 15j. Let g = -6444 + 74707. Let o(a) = g - 68263 + 5a. What is f(o(d))? 75d Let u(d) = -6d. Let v(a) be the first derivative of 8 + 0a2 + 8/3a*3 + 0a. Calculate u(v(c)). -48c2 Let j(n) = n + 5. Suppose -3q + 5 - 12 = -2y, q - 9 = -5y. Let f(z) = 38638z + 4z*y - 38638z. Give f(j(r)). 4r2 + 40r + 100 Let w(b) = 20b2 - 24b + 8. Let m(z) = 4 + z*2 - 10 + 6 - 2z*2 - 3z + 1. Let p(n) = 8m(n) - w(n). Let a(i) = -i2. Give p(a(t)). -28t*4 Let a(n) = 70n. Let t = -3920/39 - -1311/13. Let s(y) be the first derivative of -ty3 - 31 + 0y + 0y2. Calculate a(s(f)). -70f*2 Let x(g) = 84g*2 - 12g. Let w(l) = 41l - 4. Let t(d) = -10d + 1. Let f(h) = -4t(h) - w(h). Determine x(f(j)). 84j*2 + 12j Let u(j) be the second derivative of j*4/3 + j. Let p(l) = 712l*2 - 161l*2 - 289l*2 - 274l*2. Calculate u(p(v)). 576v4 Let n(t) be the first derivative of t5/120 + t*3 - 64t - 307. Let i(s) be the third derivative of n(s). Let g(v) = 218v. Give i(g(c)). 218c Let l be -4 + (17 - 1) - -2. Let v(g) = 24g2 - 13g*2 - lg*2. Let c(j) = -8j + 6. Let d(y) = 10y - 7. Let w(u) = 7c(u) + 6d(u). What is w(v(k))? -12k*2 Let c(y) = -9y. Let f(g) = 16703g. Determine c(f(i)). -150327i Let w(n) = 14503 + 14654 - 29017 - 2n2. Let q(h) = -28h. What is w(q(z))? -1568z2 + 140 Let p(r) be the second derivative of -r3/2 - 8r. Let f(h) = 160h - 82h - 70h. Give p(f(z)). -24z Let m(g) = g - 85. Let w(l) = 188l - 19975. Let q(d) = 235m(d) - w(d). Let r(u) = -20u2. Determine r(q(z)). -44180z*2 Let o(l) = 93l - 352l + 87l + 91l + 87l. Let m(i) = -2i + 7. Calculate o(m(p)). -12p + 42 Let i(v) = 3v + 2699. Let g(p) = -2p*2 + 2976p - 1. Calculate i(g(r)). -6r2 + 8928r + 2696 Let p(v) = 34535511v2. Let f(s) = s. Determine f(p(r)). 34535511r2 Let p(y) be the third derivative of y5/30 + 41y3/3 - 117y*2 + y - 1. Let d(c) = -27c. Determine p(d(j)). 1458j2 + 82 Let l(r) be the first derivative of 1/30r*5 + 0r*4 + 8 + 0r*3 - 7/2r*2 + 0r. Let w(t) be the second derivative of l(t). Let a(h) = h*2. Give a(w(m)). 4m*4 Let d(z) = -2z + 44. Let u(g) = -3687g + 2. What is d(u(c))? 7374c + 40 Let g(j) = 6j. Suppose 3k + 39 - 18 = 0. Let w(l) = 6l2. Let o(q) = -9q*2. Let b(s) = kw(s) - 6o(s). Give g(b(t)). 72t*2 Let m(v) = -14v*2. Let b(j) = 121j*2 + 15j + 10. Let g(p) = 129p2 + 12p + 8. Let o(n) = 4b(n) - 5g(n). What is o(m(l))? -31556l4 Let d(k) be the second derivative of -165k - 1/6k3 + 0k**2 + 0. Let o(b) be the second derivative of	{ "pile_set_name": "DM Mathematics" }
c. 2c(c - 2)(3c + 1) Let g(z) = 7z4 + 15z*3 - 49z*2 + 33z - 3. Let b(i) = 4i4 + 16i*3 - 48i*2 + 32i - 2. Let v(n) = 3b(n) - 2g(n). Solve v(m) = 0 for m. 0, 1, 3, 5 Let q be (0 - 2) + 5 + -4 + 4. Suppose -2p = 0, -p = 5x - 4 - 6. Factor w*2 + 2w*q + 1 - xw*4 - 5/2w + 1/2w5. (w - 2)(w - 1)*3(w + 1)/2 Let v = -18650 - -18653. Factor vd3 - 6/5d - 9/5d2 + 0. 3d(d - 1)(5d + 2)/5 Factor -32g*2 + 88g + 3g2 - g3 + 121g*2 + 5g*3. 4g(g + 1)(g + 22) Let p = 25 - 47/2. Let n = 0 + p. Let 1/2z3 + 1/2 + 3/2z*2 + nz = 0. What is z? -1 Let z be 2 - (3 - (10 + -7))/8. Factor 57/2mz + 9m - 21/2m3 + 0. -3m(m - 3)(7m + 2)/2 Let n(q) be the second derivative of 1/26q*5 + 0 - 2/13q*2 - 5/39q*3 + 17q + 1/39q4. Factor n(d). 2(d - 1)(d + 1)(5d + 2)/13 Let l(x) be the first derivative of -768/5x - 16224/5x3 - 26364/5x*4 - 4992/5x*2 - 85683/25x*5 - 41. Let l(a) = 0. What is a? -4/13 Suppose 2w - 10w - 20w = 0. Let v(r) be the second derivative of 1/30r6 + wr*2 + 6r + 0r3 + 0r*4 + 1/42r*7 + 1/80r5 + 0. Factor v(y). y3(2y + 1)2/4 Let b(i) be the third derivative of -i5/40 + 3i4/16 - i3/2 - 468i*2. Suppose b(c) = 0. Calculate c. 1, 2 Let 1370x - 103x4 - 105x*3 - 247x*3 + 358x + 1728 + 35x4 - 288x*2 - 4x*5 = 0. Calculate x. -6, -1, 2 Let s(x) be the second derivative of -3x5/20 - x4/4 + 4x3 + 18x*2 - 47x - 1. Solve s(j) = 0. -2, 3 Let h be (2 - 7 - -5)1. Let s(y) be the third derivative of 1/21y*3 + 5y*2 + 1/420y*6 + 0 - 1/84y*4 + hy - 1/210y5. Suppose s(p) = 0. What is p? -1, 1 Factor 440/3r + 2/3r2 + 24200/3. 2(r + 110)*2/3 Let s(d) = -4d + 8. Let o be s(-4). Suppose -o = 6w - 10w. Determine t, given that 3 + wt2 - 8t - 4t2 + 5 = 0. 2 Let g be (0(-11)/(-33))/(-2). Let d(i) be the first derivative of -4i2 - 9 + gi - 28/3i3 - 5i*4. Factor d(r). -4r(r + 1)(5r + 2) Suppose 3 - 344y + 39 - 8y2 + 3y*2 + 314y - 7 = 0. What is y? -7, 1 Let i be 9/(100558/6028 + 4/22-1). Determine n so that -in - 2/11n2 - 4/11 = 0. -2, -1 Let r(p) = p5 + 7p*4 + 20p*3 - 28p*2 - 63p - 29. Let i(u) = 2u5 - u4 + u3 + u2 - 1. Let j(g) = 2i(g) - r(g). Factor j(h). 3(h - 3)2(h + 1)*3 Let f be (-12 - 1)-1 + 1. Suppose -2i - f + 18 = 0. What is k in -1/2k*i + 0 + k = 0? 0, 2 Let j = -23 + 28. Solve 36 + 26h - 12h4 + 48h*2 + 53h - 24h3 + 4h*j + 5h - 8h2 = 0 for h. -1, 3 Let b(j) be the second derivative of -j6/36 + j5/60 + 5j4/8 - j3/2 - 11j. Find t, given that b(t) = 0. -3, 0, 2/5, 3 Factor 2400x*2 + 66x*4 + 3/2x*5 + 0 + 0x + 840x3. 3x*2(x + 4)(x + 20)2/2 Let u(h) = -5h*3 - 55h*2 + 127h - 96. Let v(x) = -52x + 10x + 18x2 + 32 + 73x*3 - 71x*3. Let q(b) = -6u(b) - 17v(b). Solve q(y) = 0 for y. 2 Let f(u) be the first derivative of -u5/20 - u4/4 - u3/2 - u2/2 - 14u - 15. Let h(j) be the first derivative of f(j). Find l such that h(l) = 0. -1 Find s such that 69/7s - 60/7s*2 + 18 - 3/7s3 = 0. -21, -1, 2 Let k(r) be the first derivative of -r4/4 - 16r3/9 - 2r*2 + 16r/3 + 38. Solve k(b) = 0 for b. -4, -2, 2/3 Let u = 131/76 - -1/38. Let t(d) be the second derivative of -8d3 + 6d*2 + 3d + 0 + ud4. Factor t(m). 3(m - 2)(7m - 2) Let q be -258/(-240) - (-2)/(-12). Let g(y) be the second derivative of qy*2 + 0 - 3y - 2/9y3 + 1/36y4. Factor g(k). (k - 2)2/3 Let k be (9/(-1) + 7)(-3)/2. Let o(a) be the first derivative of -2/5a - 2/15a3 + k - 2/5a*2. Solve o(q) = 0 for q. -1 Let k(j) = -20j*3 - 2j*2 - 2j - 1. Let w be k(-1). Suppose 5x + q - 7 = w, 3x = -2q + 17. Solve 0 + 0a + 2/3a4 + 1/3a*3 - 1/3a*x - 2/3a*2 = 0. -1, 0, 1, 2 Let m be 21/10 + 9/(-15). Let p be ((-18)/8)/((-93)/310). Determine b so that 0 - mb*4 - pb*2 + 3b + 6b3 = 0. 0, 1, 2 Let l(a) be the first derivative of 9a*4/7 + 44a*3/21 + 4a*2/7 - 8. Factor l(j). 4j(j + 1)(9j + 2)/7 Let o(n) = -10n*5 + 4n*4 + 15n*3 - 18n*2 - 3n - 9. Let p(i) = i5 - i3 + 2i + 1. Let u(f) = 5o(f) + 35p(f). Let u(h) = 0. What is h? -2, 1/3, 1 Let n = -4037/6 - -671. Let g = 13/42 - n. Determine f so that -gf*4 + 3/7f*3 - 9/7f*5 + 15/7f*2 + 0 + 6/7f = 0. -1, -2/3, 0, 1 Let t(o) be the first derivative of 22 - 4/9o + 8/27o*3 + 7/9o*2. Suppose t(h) = 0. Calculate h. -2, 1/4 Let p(r) = -1. Let x(a) = -4a*3 + 16a*2 + 12a - 76. Let h(i) = -4p(i) + x(i). Factor h(v). -4(v - 3)*2(v + 2) Let u be (0/(-8 + (-8 - (3 - 24))))/1. Suppose us2 + 0s + 0 - 1/3s3 = 0. What is s? 0 Let b(k) be the first derivative of -k3/3 + 5k*2/2 - 4k - 3. Let x be b(3). Factor -5yx + 19y - 3y3 - 20y - y*3. -y(y + 1)(4y + 1) Let a(t) = -11t3 - 86t*2 - 241t - 156. Let j(r) = 5r3 + 44r*2 + 121r + 78. Let s(u) = 2a(u) + 5j(u). Factor s(g). 3(g + 1)(g + 2)(g + 13) Let b(o) = 2o*2 - 3o + 1. Let x(n) be the third derivative of n5/60 - n4/24 - 7n2. Let s(z) = -4b(z) + 4x(z). Let s(t) = 0. What is t? 1 Let y(g) be the third derivative of 0g - 7/30g5 - 1/21g*7 + 3/20g*6 + 1/168g*8 + 0 + 1/6g*4 + 0g*3 + 15g2. Determine i so that y(i) = 0. 0, 1, 2 Let n(y) be the first derivative of y4/4 + 13y3/3 + 24y*2 + 36y - 115. Factor n(q). (q + 1)(q + 6)2 Let a(f) be the second derivative of 1/90f*5 + 1/3f*3 + 0 + 0f*2 - 1/9f*4 - 17f. Determine h so that a(h) = 0. 0, 3 Let a(x) be the first derivative of -x*6/2 - 27x*5/5 - 27x*4/2 - 182. Factor a(i). -3i*3(i + 3)(i + 6) Let h(s) be the first derivative of -5s*7/42 + 3s*5/4 - 5s*4/6 - 17s - 14. Let n(a) be the first derivative of h(a). Factor n(x). -5x2(x - 1)*2(x + 2) Suppose c - 3 = -4g - 4c, -2g = 3c - 1. Factor u*2 + 5u - 2ug - 50u - 4u2. -5u(u + 9) Let d(w) be the second derivative of -7w*4/20 - 17w*3/6 - 2w*2/5 + 19w - 13. Factor d(i). -(i + 4)(21i + 1)/5 Suppose -192 = -58b - 76. Factor 4g + 10 + 2/5gb. 2(g + 5)*2/5 Let a(x) be the second derivative of 5x*6/2 - 39x5/2 + x4 + 57x3 - 135x*2/2 + 3x - 28. Factor a(j). 3(j - 5)(j + 1)(5j - 3)*2 Let x be (10/21)/((-30)/(-140)) + 20/(-90). Find s, given that -2/11 + 4/11s - 2/11sx = 0. 1 Let u be (-4)/16 + (0 - (-105)/516). Let m = 80/129 - u. Solve -4/9z*2 - 2/9z*5 - mz + 0z4 + 8/9z*3 + 4/9 = 0 for z. -2, -1, 1 Let c(s) = -8s*3 + 10s*2 - 8s - 6. Suppose -10p - 44 = 6. Let u(v) = -7v*3 + 9v*2 - 7v - 5. Let t(x) = pc(x) + 6u(x). Factor t(l). -2l(l - 1)*2 Find h such that 56/9h + 4/9 + 196/9h2 = 0. -1/7 Let n = -6959 + 6962. Factor 3/4u*4 + 0u + 27/2u2 - 81/4 - 6u*n. 3(u - 3)*3(u + 1)/4 Let k(w) = -4w - 4. Let b be k(-2). Factor 280q*5 + 16q*3 - 3q - 14 - 13q - 279q*5 - 2 + 8q*2 + 7q*b. (q - 1)(q + 2)4 Let p(h) be the first derivative of h3 + 3h2 - 45h + 38. Factor p(l). 3(l - 3)(l + 5) Let s = 0 - -2. Let a be -6 + 5/(25/40). Determine c so that 2ca + 2c*2 + sc*2 - 2c - c = 0. 0, 1/2 Let o = -60091/6 - -10016. Factor -5/6a3 + 5/6a*2 - o + 5/6a. -5(a - 1)2(a + 1)/6 Factor 0 - 35/8f3 + 1/2f*2 + 1/2f. -f(5f - 2)(7f + 2)/8 Let l = -2333/14 - -1170/7. Let z(v) be the first derivative of -v*2 + 0v - 1/3v3 + 1/5v*5 + lv*4 - 1. Find p, given that z(p) = 0. -2, -1, 0, 1 Let n(v) = -6v*2 - 5v - 4. Let c = -7 + 12. Let h = 422 - 428. Let q(z) = -7z2 - 6z - 5. Let y(j) = cq(j) + hn(j). Solve y(l) = 0 for l. -1, 1 Let 1/2u5 + 9/2u*4 - 9u - 29/2u2 + 0 - 3/2u*3 = 0. What is u? -9, -1, 0, 2 Let o = 17 - 15. What is i in -64 + 9i + 3io + 6i - 4i2 + i = 0? 8 Suppose 269/2z*2 - 261/2z*3 + 2 - 81/2z*4 + 69/2z = 0. Calculate z. -4, -1/9, 1 Let -16/17 + 4/17w2 - 2/17w*5 + 14/17w*3 - 24/17w + 0w4 = 0. What is w? -2, -1, 2 Let k(y) be the first derivative of y5 + 5y*4/4 - 280y*3/3 - 525. Factor k(x). 5x*2(x - 7)(x + 8) Let o(l) = 70l*5 - 170l*4 + 135l*3 + 25l. Let j(p) = 17p5 - 42p*4 + 34p*3 + 6p. Let g(s) = 25j(s) - 6o(s). Suppose g(v) = 0. What is v? 0, 2, 4 Let r be 6/2 + (-80)/(-30) + (-187)/	{ "pile_set_name": "DM Mathematics" }
= b*2 + 4b + 3. Let l be d(-2). Are i and l non-equal? True Let f = -9 - -7. Let r be (3 + f)(-3 - -1). Is r less than or equal to -4/5? True Suppose -2h - 11 = -2w + 1, 0 = 4w + 4h. Let u = 4 - w. Which is smaller: 0 or u? 0 Suppose 0 = 2b + 5w - 24, -4w = -3b - 1 - 9. Let m(z) = z3 + z - 1. Let u be m(1). Which is bigger: b or u? b Let w be 95/20 - 1/(-4). Let x be (-3 + w)4/8. Suppose 0 = -2n + 7n + 4j + 1, -4n = 2j + 2. Which is bigger: n or x? x Let m = -1/28 - 1/4. Let r = 0 + 2. Do m and r have the same value? False Let b = -0.1 + 1.1. Let h be -3(-10)/6 - 3. Suppose hs - 5 = -17. Which is greater: b or s? b Suppose -3m + l = -4l + 11, -3l - 27 = m. Is -12 > m? False Let x = 82 + -70. Suppose 8 = 2c - 18. Which is smaller: c or x? x Suppose -3t - 3a = -12, -5a - 4 = 2t - 24. Let q(x) = tx - 3x + 4 + x. Let f be q(3). Is -1 equal to f? False Let x be (4 + 148/(-36))/((-1)/(-5)). Is x < 0? True Suppose 4u + k - 3k - 164 = 0, 3u = 5k + 130. Suppose -z + u = -6z. Which is smaller: z or -7? z Let y = -1.7 + 1.6. Which is bigger: -6 or y? y Let d be 0/(0 + (-4)/(-2)). Suppose dn = -n. Do 2 and n have different values? True Let d be 0/3 - 86/(-78). Let u = 1053 + -13679/13. Let q = d - u. Is 1 smaller than q? False Let m be 2/(-5) + (-2)/20. Suppose 0 = -2a - 2j - 26, -j = -5a + 3j - 20. Let o be (-2)/a - 5/4. Is m bigger than o? True Let y(t) = -t + 4. Let b be y(5). Let u = -43256 + 303544/7. Let g = -107 + u. Which is bigger: b or g? g Let k = 221/50 - 1/50. Which is greater: k or 4? k Let u be 4/(-12) + (-5)/3. Let z be (1u)/((-6)/(-9)). Let m be 1/(2 + -1) - z. Is m greater than 4? False Let n = 84.2 + -84. Is -9/5 greater than or equal to n? False Let p = 1791 + -1790. Let c(j) be the third derivative of -j*4/12 - 2j3/3 + j2. Let r be c(-3). Which is smaller: p or r? p Suppose 0l - 2l + 6 = 0. Suppose -3z + 0f - 6 = -lf, -5z - f + 8 = 0. Is 1/25 > z? False Let p be (48/(-60))/(0 + (-1)/5). Which is smaller: p or 6? p Let n be (-4)/(-20) - (-3)/(-15). Is n equal to -1? False Let m be 112/34(-4)/12. Suppose c + 4f = -2c, 4c - 2f = 0. Are c and m nonequal? True Let a = 0.081 + 6.319. Let v = 3.1 - a. Let l = 0.7 - v. Is l <= 2/7? False Let n = 20 + -13. Let b = -6.8 + n. Is -1 at least b? False Let v = 1718 + -10333/6. Is v != -1/3? True Suppose t + t = 5r + 8, 3t - 12 = 0. Let a(g) = 4g. Let h be a(2). Let d be (-1)/3 - h/(-6). Is r bigger than d? False Let u be (-33)/((9/(-10))/1). Let h = -37 + u. Let v = -2 - -3. Which is bigger: v or h? v Let x be (42/(-63))/((-4)/6). Is 2/3 > x? False Suppose 0 = 3n - 7n + 8. Suppose 5l + 43 = -2g, 2l - 2g - 2 = ng. Let j(f) = f*2 + 8f + 7. Let q be j(l). Is 0 smaller than q? False Let u = 1 - 1. Let n = -15 + 147/10. Which is bigger: u or n? u Suppose 2y - v = -3y + 16, -5v - 14 = -3y. Which is smaller: 5 or y? y Suppose 2n = -0n. Which is greater: n or -6/13? n Let j(q) = -q + 1. Let n be j(1). Let k be n - (-15)/(1 + 2). Suppose -d - 6 = -k. Which is bigger: d or 4/9? 4/9 Suppose -g - 3l = 2l - 7, 0 = 5g + 3l - 13. Let t = 4 - 6. Let o be (3 - 2)(3 + t). Is o greater than g? False Let r = -1.4 + 2.4. Which is smaller: r or -0.8? -0.8 Suppose -4 = 3j + 3n + 8, 5n = -2j - 8. Suppose -4k + k - 6 = 0. Let a be k - (-1)/(j/(-10)). Which is smaller: a or 1? a Let a(y) = y*3 - 2y*2 - 5y + 3. Let t be a(3). Let m be 0(t/(-1))/(-6). Which is smaller: m or -4? -4 Suppose -p + 3c + 0 + 1 = 0, -3p + 4c + 8 = 0. Let j be ((-4)/20)/(p/(-10)). Which is smaller: 2 or j? j Let f = 142/11 - 140/11. Which is bigger: 0.12 or f? f Suppose r = -3u - 14, -4r - u = -0r + 1. Let w be (-12)/(-7) + (-4)/(-14). Let f = w - r. Is f >= 3/7? True Suppose -22y = -25y. Let v be (-1)/(-3)(3 + 0). Which is smaller: v or y? y Suppose 5g + 29 = -4n, 2n - g = -n + 2. Let a(w) = -w - 1. Let f be a(n). Let x be (-2)/3 + (-4)/(-9). Are f and x nonequal? True Let w(s) = 5s*3 - 9s*2 - 25s + 1. Let t(y) = y*3 - 2y*2 - 5y. Let a(z) = 11t(z) - 2w(z). Let l be a(5). Is -1 greater than l? True Suppose -y = -4y - 18. Suppose 6m - m - 90 = 0. Let s = -25 + m. Are y and s unequal? True Let v = -5 - -8. Let n = 4 - v. Is 1 equal to n? True Let o be (4/(-6))/(4/(-12)). Let w = -6 + o. Let p = -9 - -4. Which is bigger: p or w? w Let r(z) = -z*2 - 2z + 1. Let m be r(1). Suppose -3g + 9 = 3c, -2g + c = -g + 3. Let y = g + -2. Is m < y? False Let y = -6686 - -441299/66. Let z = -2/11 + y. Which is bigger: z or 0? z Let i be (-1)/((3/15)/(-1)). Is 5 at most as big as i? True Let z(y) = y3 + y2 - 3y + 4. Let o be z(-3). Let l = o + 7. Is 0 less than or equal to l? True Let f be 4 + 0 + 24/(-12). Are f and 1 nonequal? True Let f be 4 + 5/((-20)/(-8)). Is f less than or equal to 7? True Let m = -580/3 - -7558/39. Is 0 not equal to m? True Let v be 90/(-365)1/(-3). Let a = v - -116/365. Is 9 <= a? False Let o = 12 - 7. Suppose -oc - 8 = -7c. Which is greater: c or 6? 6 Suppose 10z = 5z. Is z > -8/7? True Let y be (-7)/28 + 1/(8/(-230)). Which is bigger: y or -30? y Let g(p) = 4p*2 + 2p + 2. Let h be g(-2). Let l be 5/(-35) - (-156)/h. Is 10 at least l? False Let n = -0.11 + 1.61. Let z = n + -2.5. Is z > -0.5? False Let l = 62 - 63. Is 6/43 less than or equal to l? False Let z be 2/(-3) + 20/(-15). Which is smaller: -12/5 or z? -12/5 Let i be 958/3304 - 6/21. Let y = i + 103/59. Is y greater than or equal to 2? False Let j = -0.033 + 20.033. Let v = j + -13. Is 3 > v? False Let j(r) = 2r + 17. Let x be j(-8). Let b = 5 - x. Is b greater than or equal to 4? True Let a be -1 + 33/12 + 0. Is a >= 3? False Let z = -5 - -7. Suppose i - 2i + 5 = -zm, 0 = -2m + 2i - 6. Let c be 0 + 1/(2/(-2)). Is m != c? True Let c = 68 - 68. Is 2/27 greater than or equal to c? True Suppose -j - 7 - 15 = 0. Let t = j + 12. Do t and -10 have different values? False Let j = 1.39 + -0.39. Is j >= 3/8? True Suppose u = -5c + 8, 5c + 5u - 18 = 2c. Suppose -4n = -5q - 2, -3q + 2 = -4n - 0q. Let k be (9/n)/(-3) - c. Which is smaller: 1 or k? k Let l = -0.054 + 0.154. Which is greater: -9 or l? l Suppose 2d = -2d + 8. Let u be (2/d)/1 - 2. Which is smaller: u or 1/19? u Let i = -37/30 - 22/15. Let v be (-117)/35 - (-1)/2. Let t = v - i. Is 0.1 greater than t? True Let h(o) = o*2 - 8o + 3. Let t be h(8). Let q(v) = v - 5. Let z be q(t). Which is greater: z or 0? 0 Let v be (-2)/(-4) + (-27)/18. Which is greater: v or -1/7? -1/7 Suppose 5z + 35 = -3f, 10 = -2z + 2. Is f equal to -3? False Let v be 2/(6/(-21))1. Which is bigger: -6 or v? -6 Let o(c) = 2c - 1. Let i be o(1). Let x(v) = -v2 + 9v - 8. Let p be x(8). Let a = p - i. Is 2/5 < a? False Let u be -2 + 30/14 + 31/77. Which is greater: -1 or u? u Let c = 29.81 + -30. Let n = -2.81 + c. Which is smaller: n or -3/5? n Let i(y) = -y*2 + 2. Let w be i(-4). Let h = 23 + w. Is h greater than or equal to 10? False Let o = 107 + -103. Do 16 and o have different values? True Let k = 296/7 - 42. Suppose b = 2f + f + 1, 5b + 6 = 4f. Which is smaller: k or f? f Suppose -q = -3q + 6. Suppose 5a - 18 = -q. Is 3 smaller than a? False Let c = 4 - -1. Suppose cx = 25, -2t + 3t + x - 6 = 0. Let p be 4(0 - t/2). Is p smaller than -4? False Let y = 194/3 + -66. Are y and 3 nonequal? True Let o be -1(-70 + (-3 - -6)). Let w be o/(-165) - 4/(-30). Which is smaller: 1 or w? w Let h(w) = -5w + 1. Let m be h(1). Which is smaller: m or -0.1? m Suppose 0 = -a + t - 3t + 3, 5a - 5t = 30. Suppose 5j + ar + 5 = 0, 7j - 3r = 3j + 3. Which is smaller: -2/19 or j? -2/19 Let s = -15 - -44/3. Let u = 0.04 + 4.96. Is u equal to s? False Let j = -1.82 + 1.81. Which is greater: j or 0.6? 0.6 Let h = 70/3 - 30. Which is bigger: h or -8? h Let r = 4 + -12. Which is greater: r or 2? 2 Let w = 0.119 + -0.078. Let s = -6.059 - w. Let o = 6 + s. Which is smaller: 0 or o? o Let r = 10 + -1. Let n be 39/r + 2/(-6). Suppose 3a + 4z = 3z, -4z = -na + 16. Which is greater: a or -1/3? a Let v = 0.6 + -0.1. Let u = v + 0.5. Which is bigger: u or 0? u Let q(u) = u3 + 2u*2 + 2u + 2. Let z be 3/(3 - (-18)/(-4)). Let i be q(z). Is i equal to -1/2? False Let k = -7 + 10. Let g = 1 - k. Which is bigg	{ "pile_set_name": "DM Mathematics" }
+ 32 + 88. Calculate the remainder when 68 is divided by j. 20 Let l = -2 + 11. Suppose -c + 41 = 3c + p, 0 = -4c - 4p + 32. What is the remainder when 120 + (l - 8) is divided by c? 10 Suppose 2o - 117 = -5k, -2k + o - 26 = -71. Calculate the remainder when k is divided by 8. 7 What is the remainder when (17 - -4 - -1) + 2 is divided by 5? 4 Suppose 316 = 5o + 3n, 4o + n = 263 - 6. Calculate the remainder when o is divided by 17. 14 Let g = 602 - 589. Suppose -90 = -4h + 110. Calculate the remainder when h is divided by g. 11 Calculate the remainder when 14 is divided by 2/(-3)(-5 + -7). 6 Suppose -y = -0y - 52. Calculate the remainder when y is divided by 19. 14 Let t be 6/(-2) - 21/(-7). Suppose -4d + 4m + 192 = t, -4 = -2d - 5m + 78. Calculate the remainder when d is divided by 16. 14 Suppose -w - q + 56 = 0, 2w - 3q - 100 = -q. Calculate the remainder when w is divided by 19. 15 Suppose 5i + 0i - 10 = 0. Let m = i - -1. Suppose 23 = h - mp, 4h + 2p = -3p + 126. What is the remainder when h is divided by 15? 14 Suppose g + 2n = 1 - 4, 3g + 8 = -5n. Calculate the remainder when 18 is divided by g + 6 + 0/1. 3 Let z(k) = k*3 - 4k*2 + 7k - 18. Let u = 72 - 45. What is the remainder when u is divided by z(4)? 7 Suppose 17 - 2 = -5s. Calculate the remainder when ((-996)/(-8))/s-2 is divided by 17. 15 Let l(n) = n*2 + 2n - 1. Let i be l(2). Let w = 9 - i. What is the remainder when 3 is divided by w? 1 What is the remainder when 11 is divided by (-52)/(-16) + (-4)/16? 2 Suppose -3 = 2s - 5s. Let w be s - (-8 - (-3 - -3)). Suppose -q - r = -7, w = 2q - 3r - 10. Calculate the remainder when 15 is divided by q. 7 Let w = -85 + 92. What is the remainder when 55 is divided by w? 6 Suppose -8 = -5n + 2. Suppose -2r = nr - 140. What is the remainder when r is divided by 12? 11 What is the remainder when (42/28)/((-6)/(-188)) is divided by 16? 15 Suppose -7k = -5k - 12. Calculate the remainder when 16 is divided by k. 4 Suppose -3p + 40 + 35 = 0. What is the remainder when p is divided by ((-2)/4)/((-1)/26)? 12 Suppose 37 = 5r - 3l, r - 3 = l + 4. Calculate the remainder when 39 is divided by r. 7 Suppose -85 = -5h + 5a - 10a, h - 19 = a. Calculate the remainder when 61 is divided by h. 7 Let v = 36 - 31. What is the remainder when 43 is divided by v? 3 Let w(x) = -4x3 + x2 + 2 + 3x3 + 0x*3. Suppose -3m = 2p + 3 - 1, -4m = -3p - 3. Calculate the remainder when 2 is divided by w(m). 0 Let d(c) = -c2 + 4c + 6. Let n be d(6). Let q = 5 - -5. Let g = q + n. Calculate the remainder when 7 is divided by g. 3 Let c be ((-21)/9 - -3)3. Let h(j) = -2 - j2 + 0j*2 + 2j*2. What is the remainder when 5 is divided by h(c)? 1 Let c = -38 + 61. Calculate the remainder when 18 is divided by (-9)/12 - c/(-4). 3 Let s = 23 - 4. What is the remainder when 35 is divided by s? 16 Suppose -2t + 8 = 2h, 4h - 6 = -5t + 6. Let j = h + -4. Suppose -jb = -5n + 64, 3n = n - 5b + 19. Calculate the remainder when n is divided by 7. 5 Let v = -8 - -7. Let u = 17 + v. Calculate the remainder when u is divided by 9. 7 Let p be 5(4/(-10) - -1). Suppose 4n - 4 = -pb - 1, -12 = n + 5b. What is the remainder when -11(0 - 3)/n is divided by 6? 5 Let w(v) = 3v2. Let k be w(-1). Calculate the remainder when 40 + 4 + -3 + k is divided by 15. 14 Suppose q - 4q - 14 = -d, -42 = -3d + 5q. What is the remainder when 37 is divided by d? 9 Calculate the remainder when 12/15 - 4/((-20)/71) is divided by 9. 6 Let v = -65 + 72. What is the remainder when 27 is divided by v? 6 Let k(n) = -n*2 - 5n - 4. Let o be k(-5). Let d(v) = -3v - 3. Calculate the remainder when (-19)/o + (-1)/(-4) is divided by d(-2). 2 Suppose 0 = -4x + p + 190, -x + p = 2x - 143. Calculate the remainder when x is divided by 12. 11 Calculate the remainder when -165(3 - 20/6) is divided by 19. 17 Let v = 20 + 1. What is the remainder when v is divided by 11? 10 Suppose 5y = 127 + 53. Calculate the remainder when 71 is divided by y. 35 Let s(i) = i3 + 8i*2 - 4i - 23. What is the remainder when 33 is divided by s(-8)? 6 Let t = -372 - -692. Suppose t = 2o + 3o. Calculate the remainder when o is divided by 22. 20 Let z = 0 + 6. Let y(m) = m + 2. Calculate the remainder when y(7) is divided by z. 3 Let w(k) = k + 4. Suppose -3x + 3y = -27, -x + 5y = -19 + 2. Suppose -124 = 2h - 6h. What is the remainder when h is divided by w(x)? 9 Let g(s) = s3 + 8s*2 + 2s - 13. Suppose -5l + 4 = 19, l - 27 = 5d. What is the remainder when g(d) is divided by 16? 15 Let x = 7 - 3. Suppose 2 = 2q + x. Calculate the remainder when 30 is divided by (-6)/3q + 9. 8 Let q = -1 - -5. Suppose 5s = -3j + 104, qs - 4j = 3s + 30. What is the remainder when 41 is divided by s? 19 Let o = -7 + 25. Calculate the remainder when 33 is divided by o. 15 Let a(j) = -11j + 1. Let u be a(-3). Let w = u - 76. Let h = -5 - w. Calculate the remainder when h is divided by 19. 18 Suppose 16 = y + 3. Suppose n - 3 = 1. Suppose -n = -5f + 31. Calculate the remainder when y is divided by f. 6 Let l = 117 - 49. Calculate the remainder when l is divided by 14. 12 Let w = 20 - -8. Let y = 16 + -6. Calculate the remainder when w is divided by y. 8 Let g = -4 - -13. Let y = 14 - 9. What is the remainder when 3/((30/32)/y) is divided by g? 7 Suppose -2c + 54 = c. Suppose -3m + 89 = -3o - 2m, -160 = 5o - 4m. Let j = o - -63. What is the remainder when j is divided by c? 17 Let r(x) = 5x - 25. Calculate the remainder when 134 is divided by r(14). 44 Suppose -7f + 16 = -5f. Suppose -5k + 3v = 5, 5k = -5v - 31 - 14. Calculate the remainder when k/(-1)(-45)/(-12) is divided by f. 7 Let s(l) = 111l*3 + 2l*2 - 1. What is the remainder when s(1) is divided by 38? 36 Let a = 36 - -7. Suppose 0r + 2r = -t + 33, 3r - 3t = 36. Calculate the remainder when a is divided by r. 13 Suppose -4h + 7h - 492 = 0. Suppose -2a - 2a + h = 0. Calculate the remainder when a is divided by 14. 13 Calculate the remainder when ((-32)/(-3))/((-14)/(-63)) is divided by 25. 23 Let r(p) = p2 + p + 2. Suppose -4q - 128 = -2n, 5n + 5q - 245 = -0q. Calculate the remainder when n is divided by r(-4). 12 Let v be (-6)/(-15) + (-86)/(-10). Calculate the remainder when 4 is divided by 33/v + 4/(-6). 1 Suppose 3v - 177 = -0v. What is the remainder when v is divided by 10? 9 Suppose 4v - 133 = 3g, -39 = -0v - v - 5g. Let m = -3 + v. Let j(z) = z + 2. What is the remainder when m is divided by j(9)? 9 Let a be ((-15)/(-6) - 3)6. Let w = a + 32. Calculate the remainder when w is divided by 6. 5 What is the remainder when (3 - -11)3/1 is divided by (0 - 1) + 16 + 0? 12 Suppose 2r + 0r = 58. Suppose -o = -3n + 31, 7n - 4n = -o + r. Calculate the remainder when 19 is divided by n. 9 Let h be 12/5(-225)/10. Let u be h/(0 - 3) - 2. Suppose 86 = 5d + u. What is the remainder when 41 is divided by d? 13 Suppose -o - 108 = -10o. What is the remainder when 22 is divided by o? 10 Let x(g) = -18g3 + g2 - g - 1. Let t be x(-1). What is the remainder when (t - 2) + (4 - 4) is divided by 9? 8 Suppose 3t + 50 = 2n, 39 = 2n - n - 5t. Let z(s) = -s2 - 14s + 2. Calculate the remainder when z(-11) is divided by n. 16 Suppose -z - 40 + 7 = 0. Let i(l) = -15l2 - 2l - 1. Let k be i(-1). Let s = k - z. Calculate the remainder when 36 is divided by s. 17 Let j(u) = u3 - u2 + u - 1. Let x(s) = 7s3 + 13s. Let l(i) = -6j(i) + x(i). What is the remainder when 18 is divided by l(-4)? 8 Let h(w) = -5w*2. Let n be h(1). Let v = -4 - n. What is the remainder when 1 is divided by v? 0 Suppose 0 = -5t - 0t. Suppose 50 = -tj + 5j. Calculate the remainder when (-2)/5 - (-654)/j is divided by 22. 21 Let f = -9 - -13. Suppose 0 = fs - 6s + 6. Suppose 2o - sq = -2o + 56, 3o + 2q - 25 = 0. Calculate the remainder when 31 is divided by o. 9 Let g be -3((-52)/12 + 4). What is the remainder when 8 + -4 + (24 - g) is divided by 7? 6 Let c(x) = 2x*2 + 5x. Calculate the remainder when 119 is divided by c(-4). 11 Suppose a - 78 = -13. What is the remainder when a is divided by 17? 14 Let h(u) = -3*u + 90. Calculate the remainder when 77 is divided by h(27).	{ "pile_set_name": "DM Mathematics" }
e number? True Is 136519813 a composite number? False Is 726331 a composite number? False Is 1030889 composite? False Is 9909311 composite? True Is 11076613 a prime number? False Is 25335881 a prime number? True Is 5264243 prime? False Is 6065329 a prime number? True Is 131300927 composite? False Is 73469603 a composite number? False Is 827072327 composite? False Is 3112051 composite? True Is 689473 composite? True Is 3851749 a prime number? False Is 10531429 composite? False Is 27151945 a prime number? False Is 1690841 a prime number? False Is 25892831 a composite number? True Is 6852421 prime? True Is 69437 a composite number? True Is 8429329 composite? False Is 25336967 composite? False Is 25046643 composite? True Is 1519289 a composite number? True Is 14636761 a composite number? True Is 7089701 a composite number? False Is 817013 composite? False Is 116466967 composite? True Is 1673821 a composite number? True Is 15569969 prime? False Is 207054281 a prime number? False Is 8181751 a prime number? True Is 370657509 a prime number? False Is 27017831 a prime number? True Is 31027985 prime? False Is 229502563 composite? False Is 544882651 a prime number? True Is 10855979 prime? False Is 17669929 composite? False Is 114365621 composite? True Is 227663781 a composite number? True Is 71311633 a prime number? False Is 2090939 prime? False Is 23502823 a composite number? True Is 15018691 a composite number? False Is 128743621 prime? True Is 407057 prime? False Is 1637407 a composite number? False Is 36965231 a composite number? True Is 17171351 composite? False Is 31352879 composite? True Is 186894053 composite? False Is 21052841 prime? True Is 42085769 composite? True Is 509108359 a composite number? True Is 504902701 a composite number? True Is 445017907 prime? False Is 59866771 a prime number? True Is 33554077 a prime number? True Is 592741 composite? False Is 4138327 a prime number? False Is 19786667 composite? False Is 35118773 prime? True Is 2032871 prime? False Is 3604397 prime? False Is 16564391 a prime number? True Is 69737 composite? False Is 16321373 prime? True Is 20325437 a prime number? False Is 100206409 prime? True Is 70193987 prime? False Is 13497019 a prime number? False Is 43062053 prime? True Is 206174329 prime? True Is 23728867 a prime number? True Is 10704835 composite? True Is 735751 a prime number? True Is 4534501 prime? True Is 22727605 a prime number? False Is 119353667 prime? True Is 1445278517 a composite number? False Is 12100793 composite? False Is 4127051 composite? True Is 1493513 a prime number? False Is 783830129 a composite number? False Is 354852035 a prime number? False Is 384976949 prime? False Is 4358945 a prime number? False Is 90715033 composite? False Is 57638801 a prime number? False Is 42534605 composite? True Is 1255150007 a prime number? True Is 60817181 a prime number? False Is 11125817 a prime number? False Is 220493221 a prime number? False Is 4511541 a prime number? False Is 27515989 a composite number? False Is 28870927 composite? False Is 2291459 a prime number? True Is 475357133 composite? True Is 145841947 prime? False Is 22610167 composite? False Is 189608281 a prime number? True Is 10206155 composite? True Is 75503869 composite? True Is 64804489 composite? True Is 186646909 composite? True Is 2470417 prime? True Is 2030683 a composite number? False Is 793927 prime? True Is 5395057 composite? False Is 2179973 prime? False Is 25899799 prime? False Is 1628257 a prime number? False Is 3062701 composite? True Is 3302459 a prime number? True Is 2882923 composite? False Is 257437 a prime number? True Is 48997 prime? False Is 400437991 prime? True Is 1347571 a prime number? False Is 12111779 composite? False Is 7827 prime? False Is 138254329 a composite number? True Is 207456569 prime? True Is 27514009 a prime number? True Is 1353167 composite? True Is 62533 prime? True Is 169377547 a composite number? False Is 8887 a composite number? False Is 1742579 prime? True Is 11987249 a composite number? False Is 50428669 a composite number? True Is 77038727 a prime number? False Is 539809 composite? True Is 108907033 a composite number? False Is 141783229 composite? True Is 3673919 a composite number? False Is 80114847 prime? False Is 2478082 prime? False Is 3212683 composite? True Is 30447619 a prime number? True Is 487274597 composite? False Is 114585839 prime? False Is 222572489 a composite number? False Is 550640531 composite? True Is 37467743 composite? True Is 25703381 composite? True Is 1341569 a prime number? False Is 1956937 prime? False Is 4178129 a prime number? True Is 13068833 composite? False Is 353762457 composite? True Is 174537641 prime? True Is 263563511 a prime number? False Is 41376143 a composite number? False Is 724964353 prime? True Is 77126437 a composite number? False Is 16729 a prime number? True Is 274345 composite? True Is 14207513 a prime number? False Is 13972811 composite? False Is 1058384161 prime? True Is 74161931 a composite number? False Is 239644829 a composite number? True Is 1547339 composite? False Is 35920037 composite? True Is 110786759 a composite number? False Is 31487831 prime? False Is 28293365 composite? True Is 2649257 composite? True Is 680255647 a prime number? True Is 3624431 composite? False Is 3171617 a prime number? False Is 11956177 prime? True Is 62644009 a prime number? True Is 1399459 prime? False Is 193118483 a prime number? True Is 688901 a composite number? True Is 9928939 composite? True Is 283303 composite? False Is 7718449 a composite number? False Is 75122737 composite? True Is 3633481 a composite number? True Is 77572177 prime? True Is 95676839 prime? False Is 357419 prime? False Is 75992729 a composite number? True Is 1583965 a prime number? False Is 130146823 a prime number? True Is 3300221 a composite number? True Is 747449 prime? True Is 120944209 a prime number? True Is 60629677 composite? False Is 273568089 prime? False Is 2467583 a prime number? False Is 7916041 a composite number? True Is 8380417 composite? False Is 7037267 a prime number? True Is 52368051 a prime number? False Is 3612599 a composite number? True Is 36341 a prime number? True Is 539978213 a prime number? False Is 1173311 a composite number? True Is 8856373 composite? True Is 4310693 composite? False Is 112854485 prime? False Is 10214027 a prime number? True Is 40153261 a prime number? False Is 5562542 prime? False Is 18138959 composite? False Is 43391 composite? False Is 185916343 composite? True Is 28250759 a composite number? True Is 26219309 a composite number? False Is 4214503 a prime number? True Is 17524259 a prime number? True Is 42509717 prime? True Is 311067767 a composite number? False Is 37357 a composite number? False Is 513749 composite? False Is 149278655 a composite number? True Is 22221737 composite? True Is 9791237 prime? False Is 48162721 composite? False Is 5020337 composite? True Is 12288905 a composite number? True Is 1400019 prime? False Is 3980657 prime? True Is 4941977 a prime number? False Is 142885321 composite? False Is 1101049 a prime number? False Is 11322163 composite? False Is 2356043 a prime number? True Is 1466203 prime? True Is 7996829 composite? True Is 763624571 a prime number? True Is 20838043 prime? True Is 14558197 a composite number? False Is 921559 composite? True Is 9371387 a composite number? False Is 8609 composite? False Is 75885721 composite? True Is 273954139 prime? False Is 2326831 a prime number? False Is 5395849 composite? True Is 192147199 a prime number? True Is 10791593 composite? True Is 901798 a prime number? False Is 186400433 composite? False Is 84142541 prime? False Is 120814917 a prime number? False Is 8558699 prime? False Is 9044801 a composite number? False Is 389687 a composite number? False Is 11795783 composite? False Is 41328019 a composite number? True Is 126667661 a composite number? True Is 24807 prime? False Is 79414099 composite? True Is 173027429 composite? True Is 3680627 a prime number? True Is 89088499 a prime number? False Is 530923 composite? True Is 25298795 a prime number? False Is 25621237 composite? False Is 1457783 composite? False Is 1403621 prime? False Is 2480497 prime? True Is 13828	{ "pile_set_name": "DM Mathematics" }
prob of sequence jlgy? 1/880 Calculate prob of sequence rt when two letters picked without replacement from {t: 7, q: 4, f: 2, r: 3, j: 2}. 7/102 Two letters picked without replacement from ssggssysug. Give prob of sequence ss. 2/9 Two letters picked without replacement from {v: 2, y: 3, w: 1, p: 1, i: 5, a: 3}. Give prob of sequence yv. 1/35 Two letters picked without replacement from zyyowiw. Give prob of sequence ww. 1/21 Two letters picked without replacement from {x: 2, w: 1, l: 1, d: 2, n: 2}. Give prob of sequence xl. 1/28 Calculate prob of sequence aa when two letters picked without replacement from {p: 1, i: 2, a: 2, o: 1}. 1/15 Two letters picked without replacement from eyeekfyoyoysyykky. Give prob of sequence sk. 3/272 Four letters picked without replacement from pjpjjjj. Give prob of sequence pjpj. 1/21 Four letters picked without replacement from koirbbd. What is prob of sequence rodk? 1/840 What is prob of sequence uo when two letters picked without replacement from {o: 6, u: 4, t: 2}? 2/11 Four letters picked without replacement from {q: 2, p: 4}. Give prob of sequence qqpp. 1/15 Calculate prob of sequence od when two letters picked without replacement from {o: 6, e: 5, q: 3, d: 3}. 9/136 Four letters picked without replacement from {b: 5}. Give prob of sequence bbbb. 1 Calculate prob of sequence pp when two letters picked without replacement from rqqqqppqqrq. 1/55 Three letters picked without replacement from {h: 1, b: 5, r: 3}. Give prob of sequence bbr. 5/42 Four letters picked without replacement from {a: 1, h: 2, t: 6, n: 10, x: 1}. What is prob of sequence ahnn? 1/646 Three letters picked without replacement from pphpppppppppppppppp. Give prob of sequence hpp. 1/19 Two letters picked without replacement from lmfqqqqaq. Give prob of sequence aq. 5/72 Calculate prob of sequence nt when two letters picked without replacement from ntttntttttttt. 11/78 Two letters picked without replacement from fwawwawafwwwwwffawr. What is prob of sequence aa? 2/57 Four letters picked without replacement from piipplpiboioiopoxibi. What is prob of sequence lpip? 7/5814 Two letters picked without replacement from {x: 1, c: 3, w: 13}. Give prob of sequence wx. 13/272 Three letters picked without replacement from {p: 1, r: 3, k: 6, d: 1, t: 1}. What is prob of sequence rpt? 1/440 Calculate prob of sequence usu when three letters picked without replacement from {s: 10, u: 4}. 5/91 What is prob of sequence bb when two letters picked without replacement from {l: 8, b: 2, s: 1, z: 3, e: 1, t: 1}? 1/120 What is prob of sequence lql when three letters picked without replacement from qqqqqqqqlqqqq? 0 What is prob of sequence mrmm when four letters picked without replacement from mmrmmrrmrmrrrmmmrrm? 45/646 Two letters picked without replacement from tktkttttkvtttkvt. What is prob of sequence vt? 1/12 Three letters picked without replacement from {j: 8, l: 2, f: 2, s: 2, e: 1}. What is prob of sequence esf? 2/1365 Calculate prob of sequence qn when two letters picked without replacement from sasnnnvqnq. 4/45 What is prob of sequence zhoo when four letters picked without replacement from {p: 1, o: 2, h: 1, z: 3}? 1/140 Three letters picked without replacement from {p: 2, c: 1, b: 1, n: 1}. Give prob of sequence cpb. 1/30 Four letters picked without replacement from tutuuibuxukkbubbxbk. What is prob of sequence tuuu? 5/1938 What is prob of sequence mdm when three letters picked without replacement from {d: 1, n: 1, m: 2, l: 2, c: 1, i: 1}? 1/168 What is prob of sequence iiui when four letters picked without replacement from {u: 6, i: 7}? 21/286 Three letters picked without replacement from lkmwvkmmkslllkw. What is prob of sequence mmm? 1/455 Four letters picked without replacement from ssssssessssssssssss. What is prob of sequence ssse? 1/19 What is prob of sequence fu when two letters picked without replacement from ufuuuuuuufu? 9/55 Two letters picked without replacement from {h: 3, q: 1}. Give prob of sequence hq. 1/4 Two letters picked without replacement from hhhbehebhehbhhhe. What is prob of sequence hh? 3/10 Two letters picked without replacement from {f: 7, r: 1, z: 6, q: 6}. Give prob of sequence rq. 3/190 Three letters picked without replacement from {o: 16, n: 4}. What is prob of sequence oon? 8/57 Three letters picked without replacement from qaboggot. Give prob of sequence tgq. 1/168 Calculate prob of sequence fcf when three letters picked without replacement from {f: 11, c: 1}. 1/12 Calculate prob of sequence pxys when four letters picked without replacement from sxxyxdsgysygxpp. 1/455 What is prob of sequence ss when two letters picked without replacement from cccsccwcccccsc? 1/91 Four letters picked without replacement from pplplil. What is prob of sequence lipl? 3/140 Calculate prob of sequence hmm when three letters picked without replacement from mhmm. 1/4 Calculate prob of sequence ss when two letters picked without replacement from sppppsppps. 1/15 Calculate prob of sequence qg when two letters picked without replacement from hvvhqvmvhvmgv. 1/156 Three letters picked without replacement from {l: 3, a: 3, m: 2, u: 8}. Give prob of sequence ama. 1/280 Four letters picked without replacement from {d: 1, g: 1, l: 2, m: 2, b: 8}. What is prob of sequence mbmb? 2/429 What is prob of sequence wyt when three letters picked without replacement from wncntwyweenwnt? 1/273 Two letters picked without replacement from pbtiq. Give prob of sequence ib. 1/20 What is prob of sequence jqby when four letters picked without replacement from nqnjybqqqbyqqqqbnnq? 3/5168 Three letters picked without replacement from vbdadbdbavd. Give prob of sequence bab. 2/165 What is prob of sequence qoyo when four letters picked without replacement from {t: 1, o: 2, y: 2, v: 4, q: 1}? 1/1260 Two letters picked without replacement from wwiiiiiiiwwiwiiwiwi. What is prob of sequence wi? 14/57 Calculate prob of sequence yy when two letters picked without replacement from {k: 1, y: 11}. 5/6 Three letters picked without replacement from {t: 3, y: 1, g: 1, e: 7}. What is prob of sequence tee? 21/220 What is prob of sequence zv when two letters picked without replacement from {f: 2, u: 1, z: 5, c: 3, v: 1}? 5/132 Two letters picked without replacement from qlqqqywjqj. What is prob of sequence jq? 1/9 What is prob of sequence ac when two letters picked without replacement from {e: 1, w: 5, p: 5, c: 2, a: 5}? 5/153 Calculate prob of sequence dg when two letters picked without replacement from {y: 2, d: 2, g: 1}. 1/10 Three letters picked without replacement from ssssssmsssssssssms. Give prob of sequence sss. 35/51 Calculate prob of sequence udz when three letters picked without replacement from uwuuuzduwuwz. 1/110 Two letters picked without replacement from sssyssssssyssyysss. Give prob of sequence sy. 28/153 What is prob of sequence haa when three letters picked without replacement from ambmh? 0 Calculate prob of sequence pl when two letters picked without replacement from {p: 2, d: 1, v: 2, l: 2, w: 1, i: 1}. 1/18 Calculate prob of sequence uq when two letters picked without replacement from uyhyqab. 1/42 Calculate prob of sequence ur when two letters picked without replacement from uuuuurueruuuuuru. 3/20 What is prob of sequence xxk when three letters picked without replacement from {k: 8, x: 3}? 8/165 Four letters picked without replacement from kkknnkkknnnkn. Give prob of sequence nnnk. 7/143 Calculate prob of sequence ggf when three letters picked without replacement from {q: 3, f: 1, g: 4}. 1/28 Calculate prob of sequence kc when two letters picked without replacement from cctkrrckrrrqqccrqt. 5/153 Three letters picked without replacement from xsesxxsdxpkkpsxxx. What is prob of sequence sde? 1/1020 Calculate prob of sequence bmt when three letters picked without replacement from bqqbwmqbwbqbbbqtbmm. 4/969 Four letters picked without replacement from {v: 6, c: 3, b: 1, r: 1, x: 2, p: 2}. What is prob of sequence cxbc? 1/2730 Calculate prob of sequence blf when three letters picked without replacement from lfeblfbeeeleeeeeblb. 16/2907 Three letters picked without replacement from ssnsnsnsssssssjsssjs. Give prob of sequence snj. 1/76 Three letters picked without replacement	{ "pile_set_name": "DM Mathematics" }
3/219 Calculate 0 divided by -332. 0 What is 280 divided by 2? 140 42 divided by 20 21/10 Divide 1107 by -3. -369 What is -339 divided by -69? 113/23 -840 divided by 6 -140 What is 27 divided by 5? 27/5 What is 920 divided by -5? -184 What is -2 divided by -67? 2/67 Calculate 98 divided by 3. 98/3 Calculate -5 divided by 264. -5/264 What is 0 divided by -89? 0 Divide 884 by 17. 52 6720 divided by -96 -70 Divide 1351 by -2. -1351/2 480 divided by 3 160 Divide -272 by -34. 8 What is 2826 divided by -6? -471 Calculate -40548 divided by -1. 40548 Calculate 380 divided by 76. 5 Calculate -4 divided by -311. 4/311 Calculate 540 divided by 135. 4 4 divided by 40 1/10 What is 528 divided by -132? -4 -1378 divided by -6 689/3 Calculate 0 divided by -449. 0 -48 divided by 9 -16/3 Calculate -11 divided by 9. -11/9 -17 divided by 147 -17/147 Divide -1168 by -2. 584 What is -240 divided by -24? 10 Divide -234 by -18. 13 Divide 505 by 101. 5 Calculate -5880 divided by -7. 840 Calculate 109 divided by -88. -109/88 Calculate -1 divided by 36. -1/36 -13897 divided by -1069 13 Divide 429 by -6. -143/2 What is -95 divided by 19? -5 Calculate -13 divided by 117. -1/9 4 divided by 107 4/107 What is -24225 divided by -5? 4845 What is 523 divided by -6? -523/6 Calculate -1860 divided by 10. -186 -14 divided by -2 7 Calculate 102 divided by 34. 3 Divide -404 by -5. 404/5 Divide 675 by -75. -9 Divide 318 by -6. -53 -5 divided by -129 5/129 What is 0 divided by 156? 0 Calculate 3 divided by 247. 3/247 Divide -88 by -42. 44/21 Calculate 0 divided by 23. 0 -6 divided by -5 6/5 What is -54 divided by -18? 3 Calculate -40 divided by -477. 40/477 What is -3159 divided by -1053? 3 Calculate 5217 divided by 5. 5217/5 What is 1452 divided by -242? -6 Calculate -2 divided by -309. 2/309 Calculate -35360 divided by 5. -7072 Divide -185 by -22. 185/22 Calculate 3 divided by 2275. 3/2275 Divide 150 by 75. 2 What is -894 divided by 3? -298 Calculate 389 divided by 11. 389/11 What is 288 divided by -72? -4 Divide 1056 by 1. 1056 What is 218345 divided by -5? -43669 What is 331 divided by -3? -331/3 -405 divided by -5 81 Divide -169 by -169. 1 Calculate -6543 divided by 6. -2181/2 Calculate 5 divided by 52. 5/52 Calculate 2696 divided by -674. -4 What is -5 divided by 180? -1/36 Divide 160 by -4. -40 What is -3 divided by 104? -3/104 352 divided by -88 -4 Divide -16392 by 3. -5464 What is -4 divided by 72? -1/18 Divide -4566 by 3. -1522 What is 3192 divided by 19? 168 What is 5730 divided by -30? -191 -4 divided by -100 1/25 4 divided by 236 1/59 -52704 divided by 6 -8784 Calculate 5 divided by -104. -5/104 Calculate -28 divided by -23. 28/23 -163 divided by 1 -163 What is -891 divided by -27? 33 What is 3450 divided by 46? 75 -29 divided by 29 -1 Divide 315 by 3. 105 Divide 1 by 855. 1/855 34 divided by 341 34/341 What is -4020 divided by 3? -1340 What is -992 divided by -11? 992/11 What is 0 divided by -2280? 0 What is 2303 divided by 5? 2303/5 Calculate 19779 divided by 4. 19779/4 What is 32 divided by 19? 32/19 What is 1852 divided by -926? -2 -130 divided by -2 65 1253 divided by -5 -1253/5 -70 divided by 70 -1 Divide 1143 by -127. -9 What is -299 divided by 13? -23 Divide 30 by -18. -5/3 -15 divided by -3 5 What is -22389 divided by 3? -7463 Divide 680 by -34. -20 Calculate 280 divided by -7. -40 What is 275 divided by 55? 5 Divide 537 by 5. 537/5 Calculate -13 divided by -708. 13/708 What is -1324 divided by -5? 1324/5 What is 895 divided by 179? 5 -248 divided by -1 248 Divide -98 by -14. 7 Calculate -215 divided by -1. 215 -723 divided by 21 -241/7 288 divided by 32 9 5 divided by 80 1/16 Divide -52 by -168. 13/42 Divide -24 by 3. -8 Divide 10395 by -693. -15 Calculate -1068 divided by -5. 1068/5 What is -130 divided by 26? -5 What is 0 divided by -78? 0 Calculate 17 divided by -5. -17/5 Calculate 1635 divided by -15. -109 What is 354 divided by -3? -118 What is -26 divided by -179? 26/179 Divide 74 by -17. -74/17 Divide -230 by -5. 46 Divide -5 by -44. 5/44 Calculate -5 divided by -191. 5/191 Divide 33 by 81. 11/27 Calculate 1 divided by -3. -1/3 420 divided by 420 1 -888 divided by 5 -888/5 What is -420 divided by -30? 14 3122 divided by 7 446 What is 672 divided by 24? 28 Divide 14189 by -2027. -7 27 divided by 4 27/4 Calculate -345 divided by -69. 5 Calculate 495 divided by 4. 495/4 Divide 2369 by -3. -2369/3 What is -538 divided by 269? -2 Calculate 112 divided by 4. 28 Calculate 17568 divided by -549. -32 Calculate -101 divided by 14. -101/14 What is 5 divided by -14? -5/14 -168 divided by 12 -14 Divide 160 by 40. 4 5 divided by 59 5/59 Divide -2550 by -85. 30 Divide -2130 by -71. 30 What is -122 divided by -2? 61 What is -18490 divided by -43? 430 Calculate 42303 divided by -6. -14101/2 Calculate -96 divided by -43. 96/43 What is 191 divided by 75? 191/75 What is -9418 divided by -17? 554 Calculate -3156 divided by 3. -1052 What is -76 divided by -76? 1 What is 13060 divided by -2612? -5 Divide 64 by 7. 64/7 Calculate 246 divided by 82. 3 Calculate 2 divided by 177. 2/177 What is 361 divided by -7? -361/7 484 divided by -121 -4 Calculate 9870 divided by 470. 21 Divide -100 by 10. -10 What is 9229 divided by -11? -839 What is -1763 divided by 1? -1763 Calculate 15086 divided by 397. 38 Calculate -14 divided by 2. -7 Calculate -17 divided by 13. -17/13 What is 5 divided by 297? 5/297 What is 4215 divided by 1405? 3 -118 divided by 19 -118/19 Divide 1002 by -2. -501 Calculate 3330 divided by 666. 5 What is -14 divided by -143? 14/143 Divide 3 by 77. 3/77 Calculate 80 divided by -40. -2 What is 3 divided by -75? -1/25 Calculate -4 divided by 2505. -4/2505 What is -4 divided by -20? 1/5 15 divided by -113 -15/113 384 divided by -6 -64 -80 divided by 2 -40 Calculate -213 divided by -56. 213/56 What is -1152 divided by -2? 576 What is 5 divided by 141? 5/141 29925 divided by -225 -133 What is -1 divided by 158? -1/158 1 divided by 91 1/91 Divide -314 by 1. -314 Divide 0 by 359. 0 Divide -231 by -33. 7 What is -230 divided by 46? -5 Divide 16 by -377. -16/377 What is -2 divided by -42? 1/21 -152 divided by 38 -4 What is -115 divided by -2? 115/2 -126 divided by -6 21 Divide -4040 by 5. -808 Calculate 42 divided by -3. -14 What is 6 divided by -2444? -3/1222 Calculate 1 divided by -22. -1/22 What is -2670 divided by 3? -890 Calculate -1595 divided by 11. -145 0 divided by -143 0 What is -4 divided by -2789? 4/2789 Calculate 2 divided by -55. -2/55 -5707 divided by -13 439 What is -944 divided by -944? 1 Calculate 12 divided by -70. -6/35 Divide 10 by -296. -5/148 Calculate 192 divided by -6. -32 What is -2 divided by -414? 1/207 What is -2 divided by -2042? 1/1021 Calculate 8480 divided by -10. -848 What is -801 divided by -267? 3 Calculate -718 divided by 359. -2 Calculate -2 divided by 3. -2/3 Calculate -144 divided by 10. -72/5 Calculate -151 divided by 69. -151/69 What is 17008 divided by 4252? 4 312 divided by 15 104/5 -7 divided by -35 1/5 -24042 divided by 6 -4007 What is 66 divided by 6? 11 128 divided by 6 64/3 What is 23768 divided by -4? -5942 What is -4774 divided by -4774? 1 Divide -42 by 17. -42/17 Calculate -5 divided by 1195. -1/239 -4 divided by -367 4/367 What is 1468 divided by 367? 4 Divide 6092 by -1523. -4 Divide -1820 by -2. 910 -35 divided by 9 -35/9 What is -115 divided by 3? -115/3 -1224 divided by -36 34 What is 120 divided by 15? 8 Divide -18 by -8. 9/4 -2956 divided by -4 739 Calculate -552 divided by -46. 12 5 divided by -54 -5/54 Divide -161 by -23. 7 2384 divided by -2 -1192 Divide 4516 by -4. -1129 -1007 divided by 23 -1007/23 Calculate 1098 divided by -3. -366 Calculate 16150 divided by 50. 323 Divide 3198 by -6. -533 Calculate -817 divided by -43. 19 Divide 3 by -144. -1/48 Divide 22 by -61. -22/61 Divide 1852 by -2. -926 Divide 2068 by -94. -22 What is 8 divided by 702? 4/351 What is 116 divided by -1? -116 Divide -166 by 2. -83 Calculate -4 divided by 45. -4/45 Divide 453 by 151. 3 Calculate 5 divided by 9. 5/9 What is -5 divided by 2934? -5/2934 Calculate 355 divided by -71. -5 Calculate 614 divided by -307. -2 Calculate -22052 divided by 149. -148 -493 divided by 29 -17 Divide -160 by 40. -4 -6916 divided by -26 266 -6 divided by 80	{ "pile_set_name": "DM Mathematics" }
z when four letters picked without replacement from {z: 4, g: 1, r: 3, m: 2, e: 2}? 2/55 Three letters picked without replacement from aczwt. Give prob of picking 1 t, 1 a, and 1 w. 1/10 Two letters picked without replacement from sxpixsinxdns. Give prob of picking 2 p. 0 Three letters picked without replacement from vuhxhhxurux. Give prob of picking 1 u, 1 v, and 1 x. 3/55 Calculate prob of picking 1 y, 2 h, and 1 o when four letters picked without replacement from yhohyhywhh. 1/7 What is prob of picking 1 d and 1 u when two letters picked without replacement from {u: 16, d: 1, m: 1}? 16/153 Calculate prob of picking 2 a when two letters picked without replacement from aaaaaaaaaaaai. 11/13 Calculate prob of picking 2 z when two letters picked without replacement from zzchchzzczc. 2/11 What is prob of picking 2 y, 1 d, and 1 s when four letters picked without replacement from dyyyyydysy? 1/5 Calculate prob of picking 1 n and 3 s when four letters picked without replacement from scxngxsynyynsxnsx. 4/595 Calculate prob of picking 2 e when two letters picked without replacement from {f: 2, o: 10, e: 2}. 1/91 Two letters picked without replacement from {r: 2, t: 1, w: 1, z: 1, s: 1, u: 1}. What is prob of picking 1 t and 1 u? 1/21 What is prob of picking 2 i when two letters picked without replacement from hzzzhhzhyiihhhh? 1/105 Calculate prob of picking 1 a and 1 v when two letters picked without replacement from susyasayyvryuuv. 4/105 Two letters picked without replacement from {r: 12, w: 1}. What is prob of picking 1 r and 1 w? 2/13 Calculate prob of picking 2 j when two letters picked without replacement from {j: 4, p: 6, u: 1, b: 3, g: 2}. 1/20 Two letters picked without replacement from {b: 2, p: 5, n: 4}. What is prob of picking 1 p and 1 n? 4/11 Two letters picked without replacement from {r: 1, b: 1, h: 1, m: 2}. Give prob of picking 2 m. 1/10 What is prob of picking 1 e, 1 y, and 1 o when three letters picked without replacement from oryyreup? 1/28 Two letters picked without replacement from {m: 4, w: 5, i: 6, a: 1}. Give prob of picking 1 i and 1 w. 1/4 Three letters picked without replacement from ccccyiciitcy. What is prob of picking 1 i, 1 t, and 1 y? 3/110 Calculate prob of picking 2 p when two letters picked without replacement from {t: 7, p: 7}. 3/13 What is prob of picking 2 z when two letters picked without replacement from zyyyyzzzlyzzyzzzzl? 5/17 Two letters picked without replacement from rrttrrrrr. What is prob of picking 2 r? 7/12 Four letters picked without replacement from {v: 1, l: 6, d: 4, s: 4, m: 2}. Give prob of picking 1 m, 1 l, and 2 s. 18/595 What is prob of picking 4 c when four letters picked without replacement from uuuuuuuuuuuuuuuucuuu? 0 Three letters picked without replacement from uhusugusuugkusss. What is prob of picking 2 g and 1 k? 1/560 What is prob of picking 2 i and 1 k when three letters picked without replacement from {k: 1, i: 5, q: 1, m: 3, b: 2}? 1/22 Four letters picked without replacement from aaococoo. What is prob of picking 2 o and 2 a? 3/35 What is prob of picking 2 g and 2 k when four letters picked without replacement from vgvgvvkkvvggvg? 10/1001 What is prob of picking 1 z and 1 f when two letters picked without replacement from zfhlhhfhhlhz? 2/33 Two letters picked without replacement from qhnju. Give prob of picking 1 q and 1 n. 1/10 Two letters picked without replacement from {y: 1, i: 2, b: 1, d: 1}. Give prob of picking 1 y and 1 i. 1/5 Two letters picked without replacement from {x: 1, s: 3, r: 2, v: 3, o: 1, q: 3}. Give prob of picking 1 x and 1 s. 1/26 Two letters picked without replacement from {r: 3, j: 2, b: 12}. Give prob of picking 1 j and 1 r. 3/68 Calculate prob of picking 1 s, 1 q, 1 y, and 1 w when four letters picked without replacement from {y: 1, i: 1, w: 1, s: 1, q: 1}. 1/5 Calculate prob of picking 1 e and 1 i when two letters picked without replacement from eueueuiu. 3/28 Three letters picked without replacement from eeeeeeue. Give prob of picking 3 e. 5/8 Calculate prob of picking 3 t when three letters picked without replacement from {t: 4}. 1 What is prob of picking 1 j and 1 g when two letters picked without replacement from {j: 2, g: 8}? 16/45 Three letters picked without replacement from hhhohhhhhoho. What is prob of picking 2 h and 1 o? 27/55 What is prob of picking 1 z and 1 k when two letters picked without replacement from {k: 3, e: 2, z: 5}? 1/3 Four letters picked without replacement from {a: 5, s: 3, k: 2}. What is prob of picking 1 k and 3 s? 1/105 Calculate prob of picking 3 q and 1 l when four letters picked without replacement from {q: 4, l: 3}. 12/35 Three letters picked without replacement from {n: 4, b: 15}. What is prob of picking 3 n? 4/969 Three letters picked without replacement from {d: 3, k: 1, i: 7, s: 1, o: 1, c: 7}. Give prob of picking 1 o, 1 c, and 1 d. 7/380 What is prob of picking 2 x and 2 s when four letters picked without replacement from {x: 2, s: 9}? 6/55 Calculate prob of picking 2 g when two letters picked without replacement from {m: 1, b: 1, g: 2}. 1/6 Calculate prob of picking 1 y and 1 d when two letters picked without replacement from ddyyydy. 4/7 Two letters picked without replacement from tzkkzkrtztttz. What is prob of picking 1 k and 1 z? 2/13 Three letters picked without replacement from kzddkdzdk. What is prob of picking 1 d, 1 z, and 1 k? 2/7 What is prob of picking 2 d when two letters picked without replacement from {d: 4}? 1 Calculate prob of picking 2 r when two letters picked without replacement from {g: 1, r: 7}. 3/4 What is prob of picking 1 o and 1 u when two letters picked without replacement from weeowcweuxc? 1/55 What is prob of picking 1 v and 1 e when two letters picked without replacement from vqqeeqejjbqbrvqr? 1/20 Calculate prob of picking 1 e and 1 m when two letters picked without replacement from ecmmhhmmhkkmeeemm. 7/34 What is prob of picking 2 d when two letters picked without replacement from ddkddkkkdkdkkdkddddk? 11/38 Calculate prob of picking 1 y and 2 h when three letters picked without replacement from {h: 2, p: 1, n: 2, u: 1, y: 2, z: 1}. 1/42 Calculate prob of picking 1 b and 1 x when two letters picked without replacement from {x: 2, e: 2, b: 4, m: 2}. 8/45 Four letters picked without replacement from mwmmwmwwmmmmmnmmwm. What is prob of picking 3 w and 1 n? 1/306 What is prob of picking 1 l and 3 b when four letters picked without replacement from lbllblblmbb? 5/33 Calculate prob of picking 2 o when two letters picked without replacement from offo. 1/6 Three letters picked without replacement from geqgfwg. Give prob of picking 1 w, 1 e, and 1 f. 1/35 Calculate prob of picking 1 d and 1 b when two letters picked without replacement from dbbdbbddbbb. 28/55 What is prob of picking 1 s and 1 w when two letters picked without replacement from {s: 1, h: 4, l: 1, w: 2, v: 9}? 1/68 Two letters picked without replacement from xpxpyydpmdppmpdpp. Give prob of picking 1 d and 1 y. 3/68 Two letters picked without replacement from hhcpdpchcchppppchc. What is prob of picking 1 p and 1 c? 4/17 Calculate prob of picking 1 z, 1 l, and 2 t when four letters picked without replacement from tteslszlss. 1/105 Two letters picked without replacement from eeutkkkkk. What is prob of picking 1 u and 1 t? 1/36 What is prob of picking 2 i when two letters picked without replacement from {i: 2, z: 1}? 1/3 Three letters picked without replacement from isiisisiiisiississs. Give prob of picking 3 i. 40/323 Calculate prob of picking 1 a and 2 e when three letters picked without replacement from {i: 1, e: 3, m: 5, y: 3, a: 3, o: 3}. 3/272 Three letters picked without replacement from {d: 1, h: 2, w: 4, t: 2}. What is prob of picking 2 t and 1 w? 1/21 Four letters picked without replacement from {x: 2, s: 1, c: 1, l: 1, i: 1, z: 1}. Give prob of picking 1 c, 1 i, 1 s, and 1 x. 2/35 Four letters picked without replacement from fffaafff. Give prob of picking 2 f and 2 a. 3/14 Calculate prob of picking 1 s, 1 d, and 1 k when three letters picked without replacement from bkbxssnskkbnssnxxd. 5/272 Four letters picked without replacement from {a: 2, t: 2, s: 1, x: 1, d: 1, i: 1}. What is prob of picking 2 a and 2 t? 1/70	{ "pile_set_name": "DM Mathematics" }
be (8/6)/((-1176)/(-36)). Which is bigger: 0 or f? f Let y = 1/42 - 5/14. Which is smaller: y or 1? y Let z be (-4 + 3)(0 + -1). Let y = z - 0. Suppose 5x + 2i - 1 = y, 2i - 2 = 0. Is 2/5 < x? False Let x = -29/46 + 3/23. Which is smaller: x or -3? -3 Let q be 1/(-1)312/9. Let k = -6 + 9. Suppose -4u + kg + 3 = -0, -5u - 5 = -2g. Which is smaller: q or u? q Let t be (4/(-9))/(3/9). Let h be -1 - 6/(-2) - 3. Let p = h + 1. Which is smaller: p or t? t Suppose -5f - 4f - 9 = 0. Which is smaller: -2/197 or f? f Let p be 4014/4 + (-2 - -1). Let w = p - 917. Let r = -84 + w. Which is greater: 1 or r? r Suppose -29 = -4k + 3w, 4k + 2w = -0k + 14. Is 6 at most k? False Suppose 9k = 22 + 5. Which is greater: k or 2? k Let j = 10 - 8. Suppose 0 = -y + 2 - 0, 2y = 3a - 2. Is a equal to j? True Let l = 9 - 6. Suppose -7r + 16 = -3r. Is r at least as big as l? True Let x = 2.114 - 0.054. Let f = x - 0.06. Let p = -8 - -7.9. Which is bigger: p or f? f Let i be 0 + 2 + (-1 - -1). Suppose 0 = ic - 10 - 0. Let z(n) = n2 - 4n - 6. Let q be z(c). Which is greater: q or -1/7? -1/7 Suppose -3l + 7 = -2. Let z be 49/2 - (l - 5). Let t = z - 26. Is t bigger than 0? True Let u(w) = 23w + 15. Let z be u(-3). Which is greater: -107/2 or z? -107/2 Let u = 3 - -1. Let v = -1/6 + 8/3. Which is greater: u or v? u Let g = 1.1 - 0.1. Let h = 0.2 + -0.3. Let y = 0.1 - h. Which is greater: y or g? g Let v = -8 - -8.11. Let b = 3.89 + v. Let o = b + -4.1. Which is greater: o or 1? 1 Let c(a) = a*3 + 15a*2 - 35a - 22. Let z be c(-17). Is z >= -5? True Let v = 82 + -572/7. Let t(y) = -4y2 - 28y. Let q be t(-7). Which is bigger: v or q? v Let u = 4 - 9. Let m(w) be the first derivative of -w*3/3 - 3w*2 - 4w - 2. Let h be m(u). Is h != 1? False Let a = -13/1800 - 6314231/23400. Let q = a + 270. Suppose 0 = 6w - 2w. Is q <= w? False Let v(r) = r*3 + 9r*2 - 11r - 8. Let x be v(-10). Let l = -5/17 + 151/51. Is l smaller than x? False Let m = 15 - 9. Let c(t) = t - 5. Let w be c(8). Suppose -4q + 2s + 12 = -m, ws = -9. Which is smaller: q or 0.1? 0.1 Let a = -76 - -1063/14. Let u = a + -95/42. Which is greater: -3 or u? u Let h = -353 + 8823/25. Let t = 31/75 + h. Do t and 0.9 have the same value? False Let u = -118/3 + 39. Which is greater: u or 12? 12 Let a be 1 + (-1)/((-4)/(-6)). Let u be 12/9 - (-10)/15. Suppose 4j + 0j - c + 4 = 0, uj - 4c + 16 = 0. Does a = j? False Let p be (-8)/(-17)3/6. Suppose -l = -0l - 5q - 9, -5l = -5q - 5. Which is bigger: p or l? p Suppose 2l - 8 = 2v, 0v + 9 = 3v + 4l. Let s be 3(v + 0) - 4. Is -3 smaller than s? False Let a(n) = -n - 1. Let q(v) = -v*3 + 5v*2 - 3v - 11. Let b(p) = 4a(p) - q(p). Let t be b(5). Which is smaller: 1 or t? 1 Let l(y) = 10y2 + y. Let m be l(-1). Let c be 4/9 + (-2)/m. Is c at most 2/7? True Let v = -12 + 22. Let q(h) = -h2 + 10h - 1. Let c be q(4). Suppose 4x - 13 - c = 0. Is x <= v? True Suppose 19 = -o + 48. Which is bigger: 27 or o? o Let k(s) = s*2 - 10s. Let q be k(10). Let o = q - 2. Are -1 and o nonequal? True Let w = -39 - -40. Is 2/23 less than w? True Let i = 0.1 - -0.9. Is -5 at most as big as i? True Suppose 5t - 6 = -3g, -t + 0t = g - 4. Let y(a) = 5 - 3a*3 + 6a*2 + 2a*3 + 7a - 4. Let i be y(g). Which is greater: 1/2 or i? i Let k be 4/6(-6)/12. Is k at most -1? False Let q be (-4)/((-60)/85)1. Are 5 and q equal? False Let f = -0.19 - -0.59. Are 3 and f equal? False Let y(t) = -3t3 + t2 + t + 1. Let o be y(-1). Suppose s - os = -9. Is s bigger than 5? False Suppose -9 = -3g - 3. Suppose -gv - 2v = 0. Let m = -8 + 26/3. Which is smaller: m or v? v Let x = 0 - 0.1. Let h = 68 + -67.94. Which is greater: x or h? h Let b = 0.16 - -0.04. Which is smaller: 3 or b? b Let m = -10 + 13. Suppose 3z + 19 = q - mq, 3q + 25 = -z. Which is smaller: -9 or q? -9 Let q = 1 + -1.2. Let f = -108 - -108. Is q <= f? True Let i = -3.1 - -2.9. Which is bigger: -0.34 or i? i Let t = 22 - 3. Is t not equal to 17? True Let s be (-725)/1036/(-15). Let r = s + -2260/13. Which is greater: r or 1? 1 Let t(f) = -2f + 2. Let u be t(2). Let b be (-8)/(-8) + u/(-6). Is b not equal to 2? True Let c be 20/8(-4)/(-5). Suppose cm - m = -3. Is 1 at most m? False Let a be 0 + -4 + -2 + -1. Let h = a - -9. Let o be (h + 0)(-2 - -3). Are o and 5/2 unequal? True Suppose -4o = -9o - 15. Is o greater than 0? False Let s = 2 - 2. Let x = 2/931 + -1952/41895. Does x = s? False Let a = -27 - -28.1. Let g = 1.13 - a. Are -0.1 and g nonequal? True Let w = -5 - -4.9. Which is smaller: w or 9? w Let r = 5/18 - 1/2. Is r < 2? True Suppose 7p = 2p. Let g = 14 + -8. Suppose -3r - g = -p. Which is greater: -1/2 or r? -1/2 Let u = -4.98 - -5. Let q = u - -0.98. Let p = -3 - -2. Is q at least p? True Let w(x) = x - 20. Suppose -3a = 3g + 18 - 78, -5a + 73 = -4g. Let t be w(a). Which is greater: t or -14/5? -14/5 Suppose c - 16 = 2g, g = -5c + 3g + 40. Which is greater: c or 5? c Let w = -6 + -5. Let t = -6 - w. Let i be 15/(-9)(-1)/t. Which is smaller: -2/9 or i? -2/9 Let w = 62.9 - 84. Let d = -22 - w. Is d bigger than 1/2? False Let k = 0.17 + 0.03. Let y = k + 0.1. Which is smaller: -2 or y? -2 Let n be (112/32)/((-2)/16). Let a be (-1)/(-6)n/(-21). Which is smaller: a or 1? a Let x be -2 - (3 + 0 + -11). Let c be 3 + ((-32)/x - -3). Suppose k + 5p = -14, -5k + k + 7 = -p. Which is smaller: c or k? c Suppose 2r = -3r. Suppose -2u + 1 - 3 = r. Let m be (u - -2)(-2)/4. Does -0.1 = m? False Let d(c) = -3c3 - c2 + 2c - 1. Let n be d(1). Let r = n - 2. Let i = 5 + r. Is i greater than or equal to 1? False Suppose 0 = 2o - 5o. Suppose 2s + 4 = -4a - 2, 3s - a - 5 = o. Let q(w) = -w*3 - 4w*2 - 2w + 2. Let x be q(-3). Which is smaller: s or x? x Suppose 4t + 5 = 9. Is t less than or equal to 4/9? False Let r = -15 - -17. Which is smaller: r or 4/5? 4/5 Let p(z) = z2 - z. Let y be p(0). Which is smaller: y or -3? -3 Let w = 3 + -3. Suppose -28 = -3t + 5b, 2t + 0b - 2b - 12 = w. Which is greater: t or 0? t Let q = -6/37 - -116/259. Let l be (-1 - -3)6/(-12). Let a be 0/(2l + 0). Is a greater than q? False Let q = 8.6 + -8.56. Which is greater: q or 1/2? 1/2 Let w = -0.063 - -2.063. Which is bigger: w or 5/4? w Suppose z + 2z + 29 = -2q, -4z + 52 = -3q. Let y = q - -15. Let a be (1/(-3))/(6/9). Is a smaller than y? False Let n(f) = 3f + 8. Let u be n(-6). Is -9 greater than u? True Let b be (-90)/25 - (-5 + 1). Is 1 > b? True Suppose -22 = -4f - 2k + 6, 2 = -2f + 3k. Suppose 0 = -3t + 3x + 9, 0t - ft + 3x = -11. Let r be (-3)/7 + 2 + -2. Is r > t? False Let y(b) be the third derivative of b4/24 - b3 + 2b2. Let q be y(6). Let t = -1 - q. Is 2/11 greater than or equal to t? True Let c(n) = n2 - n + 3. Let p be c(0). Suppose 0 = -2k + 5k + p. Which is smaller: 4/7 or k? k Let c = 16779/4 + -4154. Let z = c - 40. Let b be ((-2 - -2) + 0)/(-2). Are b and z non-equal? True Let x be 3/120-1. Which is smaller: x or 3/7? x Let y = 3 - 2. Let u = -0.3 - -0.1. Which is smaller: y or u? u Suppose 4f - 5 + 1 = 0. Let g be (f/(-2))/(49/28). Is g at least as big as 1? False Let s be 3/((-102)/(-28)) - (-20)/(-10). Which is greater: -1 or s? -1 Let r(s) = s*2 - 8s + 3. Suppose 0 = -2p - 3p + 40. Let q be r(p). Suppose -t = 3t - 4. Which is smaller: t or q? t Let s = -39.5 + 39. Is 0.02 > s? True Suppose 4w - 4 = 2w. Let n be (1-2)/(-22). Which is smaller: w or n? n Suppose 4n - 1 - 9 = -2a, 3n = -3a + 3. Suppose 0 = nh - 4, 3t + 4 = 2t + 5h. Is t at most as big as 1? True Let d = 21/41 + 551/205. Is 4 at least d? True Let p be (-9 - 10/(-2))1/(-4). Is p greater than 1/119? True Suppose 0 = 3q - 6q - 42. Let p be ((-13)/4 + 0)(-14 - -18). Is q greater than p? False Let b = 8 - 29. Are b and -21 non-equal? False Suppose -f + 2w = -10, 4f - 4w = 24 - 0. Let j be 0/(-3) + f-1. Let g = 1002/5 + -201. Is g > j? True Let k be 2(-10)/(-12)3. Suppose km + 3 = 8. Let d be 24/18 + (-3)/2. Which is bigger: d or m? m Let z = -966/11 + 88. Let n be 6/(-4) + 1/2. Is n at most as big as z? True Let j = -193 - -819/4. Let n = j - 219/20. Is n equal to 0? False Let w(o) = -o*2 + 11o + 11. Let k be	{ "pile_set_name": "DM Mathematics" }
to -0.2? (a) -4 (b) -21 (c) -0.1 (d) 1/4 c Which is the nearest to -28? (a) 1/2 (b) 2/11 (c) -0.1 c Which is the nearest to -1/2? (a) -0.4 (b) -1/6 (c) 2/57 (d) -0.1 a Which is the closest to -0.1? (a) 1 (b) -1/2 (c) -0.4 (d) 0.4 c Which is the nearest to 0.1? (a) -19 (b) -1.9 (c) 3 b What is the nearest to 1 in 2/7, -15, -12, 5? 2/7 Which is the closest to 2? (a) 2/15 (b) -0.4 (c) 36 (d) 1/5 d What is the nearest to -11 in 5, 0, -1? -1 Which is the closest to 1? (a) -4 (b) 5 (c) 1.6 (d) -5 c Which is the closest to -1? (a) 30/23 (b) 2/7 (c) -5 b Which is the closest to 1? (a) -0.1 (b) 19/2 (c) 0.4 c What is the closest to -0.1 in 3, -0.1, -0.026, 5? -0.1 What is the closest to 1 in 1/8, 1, -19? 1 What is the closest to 7 in 0.4, 0, -1/6, 1/4? 0.4 What is the closest to -2/3 in 0.3, 1, -3/7, -6/17? -3/7 Which is the closest to -1? (a) 2 (b) -0.5 (c) 3 b What is the nearest to 0.1 in -3, 0.3, -0.07, 1/2? -0.07 Which is the nearest to -1/3? (a) 1/2 (b) 0.07 (c) 0 (d) 4 c What is the closest to 0.2 in -0.2, -4, -3, 5? -0.2 What is the nearest to 4 in 0.06, 2, 4, -12? 4 Which is the closest to -1/4? (a) -21 (b) 4 (c) -1 (d) -5 c Which is the nearest to -23? (a) -6/13 (b) 5 (c) 1/9 a Which is the closest to 38? (a) -1 (b) 4 (c) -1/8 (d) -0.026 b What is the nearest to -1/2 in -1, -2, 0.5, 3? -1 What is the closest to -0.3 in 1.1, 5, 3, 2/9? 2/9 What is the closest to -1 in 4, -2/9, -7, 0.7? -2/9 Which is the closest to -1? (a) -1.8 (b) 3/2 (c) 4 a What is the nearest to -7 in 2/7, -3/8, 2/5, -2/5? -2/5 Which is the nearest to -3? (a) -5 (b) 0.2 (c) 4 (d) 0 a What is the nearest to 0.2 in -2, 6/11, -5, -2/17? -2/17 Which is the closest to 0.047? (a) 2 (b) 15 (c) -2/11 c Which is the closest to 6? (a) -1/4 (b) -0.2 (c) 2/7 (d) -7 c Which is the nearest to 46? (a) 0.5 (b) 3/2 (c) 4 c What is the closest to -22 in 3/4, -5, -0.5, 0.2? -5 What is the nearest to 1 in 4, 2/5, 3, 5? 2/5 Which is the closest to 1/38? (a) 0 (b) -0.2 (c) 1/2 (d) -5 a What is the nearest to -0.086 in -8, -1/5, 0.1? -1/5 What is the nearest to -2 in 0, -1, 2/9, -2/5? -1 What is the nearest to -1/4 in 5/2, -7, 0.01? 0.01 What is the nearest to 0 in -7, -10, 2/11? 2/11 What is the nearest to 1 in 4, -0.4, 133? -0.4 Which is the closest to -0.2? (a) 1 (b) 5/3 (c) -0.4 (d) -5 c Which is the closest to 1/4? (a) 1 (b) -18 (c) -0.07 (d) 0.3 d What is the closest to -1 in 0, 1/5, -0.5, -6? -0.5 What is the closest to -13 in 1/3, -4, -2/3, 2? -4 What is the closest to 0 in 0.04, 9, 54, 3/4? 0.04 What is the nearest to 68/5 in -5, -2/5, -0.2, -0.1? -0.1 Which is the nearest to -0.1? (a) 1 (b) 1/2 (c) 2/11 (d) -1/4 d What is the nearest to -0.1 in -64, -3, 4, 2/3? 2/3 What is the closest to 0.1 in -14, -56/5, -2/11, -5? -2/11 Which is the nearest to 0? (a) 4 (b) 11 (c) 1/5 c What is the closest to 0.3 in -5, 2, 0.047, 0.5? 0.5 Which is the nearest to 9? (a) -0.3 (b) -2 (c) -1 (d) -1.53 a Which is the nearest to -1/7? (a) -0.5 (b) 0.1 (c) -5 b What is the closest to 9/5 in 3, 4/7, -1/5, 0.01? 3 Which is the nearest to -3? (a) -0.3 (b) 0.06 (c) 0.2 a What is the closest to 1/3 in 1/4, 1.1, -1, -0.2? 1/4 Which is the closest to 1? (a) -1 (b) 0 (c) -4/5 (d) 18/13 d What is the nearest to 28 in -0.4, -3, 3/8, 4? 4 Which is the closest to -11? (a) 2/3 (b) 15 (c) 0.3 c What is the nearest to 1 in 14, 2/11, -2/9? 2/11 What is the nearest to -18 in 1, 3, 0.23, -0.1? -0.1 Which is the nearest to 1/4? (a) 4 (b) 3/2 (c) -4 (d) 20/7 b Which is the nearest to 0.11? (a) -2 (b) -1 (c) -136 (d) 3 b Which is the closest to -0.2? (a) 4 (b) -0.06 (c) -0.1 (d) 2/23 c Which is the nearest to 2/3? (a) -1/4 (b) 1.31 (c) -2/13 (d) 3 b Which is the closest to 2/7? (a) -2/5 (b) -2 (c) 0.4 c Which is the closest to 0? (a) 0.6 (b) 2 (c) -2/13 (d) 0.5 c Which is the closest to -1/2? (a) 8 (b) 4/3 (c) -0.4 (d) -0.5 d Which is the nearest to 2? (a) 0.19 (b) 1/6 (c) 0.2 (d) -1 c What is the nearest to 1 in 0, 0.03, 45/7, -5? 0.03 What is the closest to 0 in 7, 0.03, 0? 0 Which is the nearest to -1? (a) 4 (b) 0.2 (c) 5 (d) -3 b What is the closest to -10 in 5, 2/9, -0.1? -0.1 Which is the nearest to 1? (a) -2 (b) 3/2 (c) 1/6 (d) -1 b What is the nearest to -1/3 in -1338, -0.3, 5? -0.3 What is the closest to -2/3 in 8, 1, -1, 0? -1 Which is the nearest to 3? (a) 2 (b) 0 (c) 55/3 a Which is the nearest to -2/3? (a) -3 (b) 0.2 (c) -5 (d) -29/3 b Which is the closest to 33? (a) -0.1 (b) 3 (c) 1 b What is the nearest to 5 in -1, -13, -5? -1 Which is the closest to 1? (a) -0.26 (b) 3.9 (c) -5 a Which is the nearest to -1? (a) 0.7 (b) 5 (c) 1.8 (d) 2/19 d What is the nearest to -2 in 3, 1.1, 0.1? 0.1 Which is the closest to -0.25? (a) 0 (b) -1.2 (c) -5 a What is the closest to 24 in -4, 3, 0.2? 3 Which is the nearest to -1? (a) 0 (b) -0.2 (c) -106 (d) 3 b What is the closest to -28 in -2/15, 32, 0.5? -2/15 Which is the nearest to 0.1? (a) 1/3 (b) -5 (c) -4/7 (d) -1/234 d What is the nearest to 1 in -16, 0.4, -29, -1/6? 0.4 Which is the closest to -2? (a) 9 (b) 0.1 (c) 2 (d) 1 b Which is the nearest to 0.5? (a) -3 (b) 12 (c) 5 (d) -1/8 d Which is the nearest to 1? (a) 0.2 (b) 3 (c) -1.15 a What is the closest to -1 in -92, -3, -3/2? -3/2 What is the closest to 1 in 2/5, 5/4, 0, -1? 5/4 Which is the closest to 0.2? (a) 3 (b) -4 (c) -3 (d) -1/3 d What is the closest to -13 in 50, 3, -3? -3 What is the closest to 0.1 in -2, -10/7, 48? -10/7 What is the nearest to 11 in -0.14, -10, 4? 4 What is the closest to -0.2 in -0.4, 0.3, -2/23, -1/7? -1/7 What is the closest to 0 in 4, 0, 2, 9? 0 What is the nearest to -2/5 in -129, -1/2, -0.4? -0.4 What is the closest to 0.2 in 2, 38, -2? 2 Which is the nearest to 0? (a) -2 (b) -656 (c) -0.1 c What is the closest to 7 in -4, 8, 4/5, -2/9? 8 What is the nearest to -1/3 in 2/9, 3, -2/23, -18? -2/23 What is the nearest to -2/7 in -6/7, -2, -5? -6/7 What is the closest to -2/7 in -4, 0.1, 11/3, -5/6? 0.1 Which is the closest to -4/5? (a) 3 (b) -0.6 (c) -2 b Which is the closest to 0.1? (a) -3 (b) 3 (c) -2675 b Which is the closest to 128? (a) -3 (b) -0.5 (c) 0 c Which is the closest to 1/5? (a) -0.45 (b) 1/4 (c) -4 (d) 3 b What is the nearest to -1 in 3/10, -2, -5? -2 Which is the nearest to 2/7? (a) 4/7 (b) -14 (c) -0.3 (d) 2 a Which is the nearest to -1/48? (a) -1/2 (b) 1/9 (c) -4 b Which is the closest to 0? (a) -0.4 (b) -14 (c) -0.3 c What is the nearest to -1/3 in 2, 47, 8, 3/8? 3/8 Which is the nearest to -1/17? (a) 4 (b) -4/9 (c) -0.05 (d) -14 c Which is the nearest to 1? (a) -7 (b) -2 (c) 0.2 (d) -3 c Which is the nearest to -2? (a) 1/4 (b) 13/2 (c) -0.4 (d) 1 c What is the closest to 2/5 in -44, 1/2, -1? 1/2 What is the closest to -0.1 in 0.1, -5/6, -5? 0.1 What is the nearest to 3.321 in -3, -4, 5? 5 What is the nearest to 1/4 in -0.02, -1, 0.1, 3? 0.1 Which is the nearest to 0.11? (a) 5 (b) 4 (c) -4/3 (d) -5 c Which is the nearest to 2? (a) 0.2 (b) 4/3 (c) -2 b Which is the nearest to 2? (a) 0.243 (b) 1 (c) -1 b What is the closest to -2/7 in 1, -0.5, -5, 4? -0.5 Which is the closest to 0.2? (a) -1 (b) 4 (c) -2 (d) 5 a Which is the closest to -0.1? (a) -55/3 (b) -2 (c) 3/2 c What is the nearest to -8 in -2, -3/2, 3? -2 What is the nearest to -0.03 in 1/10, -9, 2/3? 1/10 What is the closest to 0.136 in -1, -3, 5? -1 What is the closest to 1 in 16, -1, -4? -1 Which is the closest to -1? (a) -1 (b) 2 (c) -2 a What is the closest to -2/161 in -1/6, -2, -2/3? -1/6 What is the nearest to -0.273 in 7, 2, -5? 2 Which is the closest to -3/13? (a) -1/11 (b) 3 (c) -0.02 a What is the closest to -2 in -3, 3, 8, -0.2? -3 What is the closest to -4 in 75, -2/9, 0.2? -2/9 What is the closest to 1/3 in 2/145, 1, 3/2? 2/145 What is the nearest to 5 in -3, -5, -4, -0.29? -0.29 Which is the nearest to 7? (a) -2 (b) 4 (c) 25.9 b Which is the closest to 1? (a) -5 (b) 569 (c) -3 (d) -2 d What is the nearest to 0.3 in 0.3, -8, -2? 0.3 What is the closest to -2 in 1/3, -151, -0.5, -0.4? -0.5 Which is the nearest to -4/3? (a) 1 (b) -72 (c) 5 a Which is the	{ "pile_set_name": "DM Mathematics" }
vative of -k*2/2 + 8k - 116. Give o(3). 5 Let b(x) = 2x2 + 65 + 2x + 61 - 3x2 - 121. Determine b(-4). -19 Let h(n) = 2n*3 - 2. Let x(i) = 5i*3 - 3i*2 - 4i - 3. Let f(b) = 2h(b) - x(b). Suppose -3t + 6 = -3p, 22 = p + 3t + 4. Calculate f(p). 11 Let n(j) be the first derivative of -j*3/3 + 13j*2/2 - 3j + 7. Let i(d) = 3d2 - 38d + 10. Let o(b) = -4i(b) - 11n(b). What is o(7)? 7 Let s(j) = -1 - 108j3 + 214j*3 - 111j*3. Let x = -3 - -4. Calculate s(x). -6 Let a be 3/12 - (-108)/(-48). Let j(b) = -3b2 + 6. Calculate j(a). -6 Let i(r) = -r2 + 13r + 90r - 98r - 2. Give i(2). 4 Let q = 19 - 22. Let f(i) be the second derivative of -i4/24 + i3/2 + i2/2 - i. Let x(u) be the first derivative of f(u). Give x(q). 6 Let d(s) = -24s*2 + 39s + 12. Let l(h) = -13h2 + 20h + 7. Let y(k) = -6d(k) + 11l(k). Calculate y(6). -43 Let d = -48 - -51. Let g(y) = -2y + 0y + 2y - 10 + y2 + yd + y. What is g(0)? -10 Let i(y) = -10 - y2 + 9y + y*2 + 0y2 - y2. Let g be i(7). Suppose -2j = -5m - 20, -j = gm - 3j + 18. Let h(a) = -2a2 - 3a - 3. Determine h(m). -5 Suppose -3x + x = -4. Let c be (-2)/(x/1 + 0). Let z(h) be the first derivative of -h3 + h2 + h - 51. Determine z(c). -4 Let u(d) be the first derivative of d4/2 - 4d3/3 + d2/2 + 3d + 241. What is u(3)? 24 Let i be (-5)/(-10)0/(-2). Suppose i = -11x + 23 + 10. Let u(w) = 4 - 3w + 0w - 1. What is u(x)? -6 Suppose -2g = 5y - 15, 4y + 3g = -g. Let u(f) = 6f*2 - y + 4f + f3 + 11 - f. Give u(-6). -12 Let w(b) = b3 + 8b2 + 8b + 4. Let l be w(-7). Let d be l/(-6)0/(-2). Let n = 5 - d. Let c(f) = f3 - 6f*2 + 4f + 7. Determine c(n). 2 Let k(o) = -6o - 4. Let n be k(-4). Suppose 25u - 25 = nu. Let j(x) = -x3 + 6x*2 - 8x + 3. Give j(u). -12 Let l = -7 + 8. Let n be (l10)/(-9 - -10). Suppose -6h + n = -32. Let q(r) = -r + 3. Give q(h). -4 Let b = -22 + 9. Let r = b + 16. Let n(l) = 4l2 - 2 + 2l*3 - 5l - 3lr + 2l3. Calculate n(-5). -2 Let z(s) = -s2 + 10s - 3. Let f = 20 + 35. Let o = f - 45. Give z(o). -3 Let y(f) = -14f*2 + 99f - 5. Let d be y(7). Let h(w) = 13w2 - 2w - 7. Let j(i) = -7i2 + i + 4. Let v(a) = -6h(a) - 11j(a). Calculate v(d). -4 Let d(k) = k2 - 5k + 1. Let m(h) = h*3 + 10h*2 - 12h - 9. Let a be m(-11). Let f be (3/1 - a) + 8. Let s = -4 + f. Calculate d(s). 1 Let d(c) = 2084 + 2090 + 2c - 4160. Determine d(0). 14 Let b(p) be the second derivative of p3/6 - p - 94. What is b(5)? 5 Let p(l) = l3 + 2l*2. Let f(c) = -2c*2 + 22c*3 - 23c*3 + 7 + 4c - 2 - 4. Let o be f(-3). What is p(o)? 0 Let r(u) = u*3 - 9u*2 + 3u - 5. Let q(g) = -g*3 + 10g*2 - 3g + 5. Let b(d) = 4q(d) + 5r(d). Let x(f) = -5f + 94. Let s be x(18). What is b(s)? -9 Suppose -26 = 5k - 1. Let z(y) = 1 + 13 + 0 - 3y - y. Let s(b) = -2b + 7. Let a(v) = ks(v) + 3z(v). Calculate a(5). -3 Let s = -4 - -4. Suppose 0 = 3h - 105 - 171. Let p(u) = 4 - hu + u*2 + 93u + 6 - 2. Give p(s). 8 Suppose -4h - 2 = 3w - 16, -h + 3 = w. Suppose 4j = 3j + 5. Let r(c) = 65c - 4c2 + 1 + c3 - 69c - j. What is r(h)? 1 Let m(n) = -8n. Let r(h) = -h + 9. Let s(j) = 1. Let w(p) = r(p) - 4s(p). Let z be w(8). Let l = z + 2. Give m(l). 8 Let h = -518 + 521. Let o(u) be the first derivative of -u2 + 5/3u*h - 7 - u. Determine o(-1). 6 Let x(r) = r - 3. Let h be ((15/(-6))/(-5) - 1)0. Calculate x(h). -3 Let g(a) be the second derivative of -a*5/20 + 2a*4/3 - 4a*3/3 + 5a*2/2 + 11a. Let z(d) = 5d + 12. Let q be z(-1). Calculate g(q). -2 Let m(j) = -2j*3 - 4j*2 - 6j - 2. Let r be m(-2). Suppose 17d - rd = 21. Let b(i) = -i*3 + 4i2 + 2. Give b(d). 11 Let g(i) be the second derivative of -i3/6 + i*2/2 - 84i. What is g(4)? -3 Let q(u) = -9u3 + 7u*2 + 6u - 6. Let f(l) = 10l3 - 8l*2 - 7l + 7. Let t(n) = 5f(n) + 6q(n). What is t(1)? -2 Let b(f) = -5f + 13. Let k(t) = -2t*3 - 7t*2 + 30t + 5. Let q be k(-6). Calculate b(q). -12 Let c(x) be the third derivative of -x*4/24 + 3x*3/2 + 2x*2. Let y(o) = 78o - 533. Let a be y(7). What is c(a)? -4 Let y = 588 + -588. Let m(f) be the second derivative of -2f + y - 1/6f*3 + 3f2. Give m(6). 0 Let s(c) = -c3 + 6c2 - 3c - 6. Suppose 44h + 75 = 59h. Suppose 0 = 3z - 2k + 4, -2z + k = -z + 2. Suppose -i + 10 - h = z. Determine s(i). 4 Let k(c) = 26c + 6. Let f(u) = 5u + 1. Let j(z) = 11f(z) - 2k(z). Let n = -39 + 41. Calculate j(n). 5 Let l(w) = w3 + 5w*2 - 5w - 5. Suppose -26 = 25i + 124. Calculate l(i). -11 Let f(v) be the second derivative of 7/6v*3 + 0 - 11v - 3v2 - 1/12v*4. Calculate f(5). 4 Let y(q) be the third derivative of 3q*4/4 + 5q*3 - 403q*2. Give y(-2). -6 Let i = -4534 + 4531. Let y(g) = 2g*2 - 2g - 3. Let l(b) = 3b2 - 2b - 3. Let d(o) = -4l(o) + 5y(o). Calculate d(i). -15 Let a(z) = -847z2 + 1695z*2 - 849z*2 + 4z. Determine a(5). -5 Let o(t) be the first derivative of -t*4/4 + 5t*3/3 + 7t*2/2 - 9t - 38. Let n(v) = 3v - 9. Let k be n(5). What is o(k)? -3 Let l(t) be the third derivative of 0 + 1/2t*3 - 19t*2 + 0t + 1/6t4. Suppose -4w + w = 6. Give l(w). -5 Let c(t) be the first derivative of -2t2 - 5t - 273. Calculate c(-4). 11 Let o(q) = -9q3 + q2 + q + 1. Let w(u) = 3u - 1. Let t(y) = -13y + 4. Let v(r) = -2t(r) - 9w(r). Let i be v(2). Determine o(i). 10 Suppose w - 8 = 3w, -5d = 3w - 3. Let z(f) = f*3 - 2f*2 + 2f - 7. Give z(d). 8 Let k(v) be the third derivative of -v6/120 - v5/12 - 5v4/24 + v3/3 - 69v*2. What is k(-4)? 6 Let v(y) = -26y + 5. Let q be -9 - -288/16. Determine v(q). -47 Let j(r) = r3 - 10r*2 + 13r - 2. Let o(t) = 5t - 41. Let n be o(10). What is j(n)? 34 Let d(g) = -25g - 1 + 1 + 1. Let c be -2(-2)/(-8)-12 - (4 + 1). Calculate d(c). -24 Suppose 5 = 2i + 3. Let l(j) be the first derivative of -1/4j*4 - 4/3j*3 - 3/2j*2 + i - j. Give l(-2). -3 Let q(t) = 7t*3 - 13t*2 + 9t - 3. Let p(r) = 1 - 191r - 5r*3 + 181r + 3 + 13r2. Let l(s) = 3p(s) + 2q(s). Calculate l(12). 6 Let n be 41(-6 + 5). Let m(q) = 2q - 7. Let k be m(4). Let l(b) = b*3 + 2 + 4b*2 + 2 + k + 3b. Determine l(n). -7 Let z(i) = i*2 - 2i - 2. Let u(k) = -2k3 + 10k*2 + 12k. Let s be u(6). Give z(s). -2 Let t(y) = -3y + 1. Let r(w) = 6w*2 - 12w + 5. Let h(o) = -r(o) + 4t(o). Determine h(2). -25 Let b(q) be the second derivative of -q3/6 + q2 - 3q. Let s be b(-2). Let h(g) = -9g - 5. Let l(f) = -4f - 2. Let y(a) = -3h(a) + 7l(a). Give y(s). -3 Suppose 3x - 4 - 32 = 0. Let w be ((-4)/10)/(x/(-30)). Let c(k) = k2 - 5k + 2. Let s(m) = -m - 1. Let q(p) = ws(p) - c(p). Give q(2). 1 Let h(t) = -t3 + 7t*2 - 2t + 10. Suppose -4l - 3d + 1 = 0, 3l + 2d - 1 = -0d. Let s be ((l - -1) + -23)/(-3). Calculate h(s). -4 Let f(o) be the first derivative of o7/840 - o6/72 + o5/60 + o4/12 + 5o*3/3 - 8. Let n(t) be the third derivative of f(t). What is n(3)? -10 Let n = -380 - -388. Let r(l) = 5l + 1. Let v(f) = f + 1. Let w(t) = r(t) - 4v(t). Determine w(n). 5 Let h = -50 - -62. Let p(v) = v2 - 11v - 8. Let a be p(h). Let s(y) = -y*3 + 6y*2 - 5y - 4. Give s(a). 8 Let m(n) be the second derivative of n*5/20 + 5n4/12 + n3/3 + 25n + 1. Suppose 6 = -2d + j, -2d + 4d + 2j + 6 = 0. Determine m(d). 12 Let s(o) = 5o*2 - 11o - 28. Let i be s(4). Let v(g) = 5g - 35. Determine v(i). 5 Let c(p) = 3p - 1. Let o(j) = j - 18. Let w be ((-54)/45)/((-4)/50). Let v be o(w). Determine c(v). -10 Let w(n) = -6n3 - 2n*2 - 2n - 1. Let k(u) = -5u3 - 2u*2 - 2u - 1. Let s be (-88)/(-14) + (-2)/7. Let f(j) = sk(j) - 7w(j). Give f(-1). -11 Let c(n) = -5n3 - n2 + 1. Let z be c(1). Let w be (-5)/5 - ((-2)/2 - 4). Let a(o) = 158 + wo - o + o*2 - 160. What is a(z)? 8 Suppose 5l - 15 = -0l. Suppose w - 2i - l = i, -w - 3i = 15. Let q = -2 - w. Let v(j) = -j3 + 6j*2 - 5j - 1. Calculate v(q). 11 Let v(f) = -f*2 - 9f - 3. Suppose 457n = 451n - 60. Determine v(n). -13 Let a(l) = -l*3 + 6l*2 + 8l - 2. Let f be -42/4 - (-3 - 2). Let s be 21 + 1 - 0/(-1). Suppose 0 = fx - s + 1. Determine a(x). 5 Suppose 48*d + 51 =	{ "pile_set_name": "DM Mathematics" }
tween 2:40 PM and 5:36 PM? 176 What is 139 minutes before 3:24 AM? 1:05 AM How many minutes are there between 3:31 PM and 8:59 PM? 328 How many minutes are there between 6:17 PM and 5:09 AM? 652 How many minutes are there between 8:51 PM and 4:24 AM? 453 What is 664 minutes after 11:39 PM? 10:43 AM What is 51 minutes after 5:23 AM? 6:14 AM How many minutes are there between 9:13 AM and 6:12 PM? 539 How many minutes are there between 12:09 PM and 1:41 PM? 92 What is 535 minutes before 9:05 AM? 12:10 AM How many minutes are there between 7:01 AM and 7:39 AM? 38 What is 121 minutes after 1:08 AM? 3:09 AM How many minutes are there between 1:25 PM and 12:26 AM? 661 How many minutes are there between 11:42 AM and 8:05 PM? 503 What is 126 minutes after 4:36 PM? 6:42 PM What is 110 minutes before 11:36 AM? 9:46 AM What is 582 minutes after 4:23 PM? 2:05 AM How many minutes are there between 4:01 AM and 5:12 AM? 71 How many minutes are there between 1:50 PM and 3:56 PM? 126 How many minutes are there between 5:04 PM and 6:55 PM? 111 How many minutes are there between 9:34 PM and 4:08 AM? 394 How many minutes are there between 10:48 AM and 10:37 PM? 709 How many minutes are there between 6:13 PM and 8:29 PM? 136 What is 320 minutes after 8:22 AM? 1:42 PM What is 607 minutes after 2:30 AM? 12:37 PM What is 309 minutes before 1:52 AM? 8:43 PM What is 525 minutes after 12:43 AM? 9:28 AM What is 385 minutes after 7:11 PM? 1:36 AM How many minutes are there between 8:09 AM and 1:36 PM? 327 What is 318 minutes after 4:36 PM? 9:54 PM What is 27 minutes after 9:40 PM? 10:07 PM What is 303 minutes before 9:20 AM? 4:17 AM How many minutes are there between 1:22 AM and 12:55 PM? 693 What is 9 minutes after 2:09 PM? 2:18 PM What is 315 minutes after 11:51 AM? 5:06 PM How many minutes are there between 10:34 PM and 4:28 AM? 354 What is 90 minutes before 11:24 PM? 9:54 PM How many minutes are there between 3:07 PM and 12:58 AM? 591 What is 669 minutes before 2:05 AM? 2:56 PM What is 408 minutes before 11:14 AM? 4:26 AM How many minutes are there between 11:53 PM and 11:02 AM? 669 How many minutes are there between 12:44 AM and 2:31 AM? 107 What is 142 minutes before 10:10 AM? 7:48 AM What is 121 minutes after 5:16 AM? 7:17 AM What is 202 minutes after 8:29 AM? 11:51 AM What is 53 minutes after 7:44 PM? 8:37 PM What is 194 minutes after 6:50 PM? 10:04 PM How many minutes are there between 3:32 AM and 6:11 AM? 159 How many minutes are there between 3:12 PM and 1:32 AM? 620 How many minutes are there between 7:01 PM and 6:20 AM? 679 What is 44 minutes before 3:03 AM? 2:19 AM How many minutes are there between 4:50 AM and 4:20 PM? 690 What is 101 minutes before 1:12 AM? 11:31 PM What is 473 minutes after 9:45 PM? 5:38 AM What is 332 minutes after 3:47 AM? 9:19 AM How many minutes are there between 12:37 PM and 2:20 PM? 103 What is 91 minutes before 1:18 PM? 11:47 AM How many minutes are there between 6:37 AM and 10:48 AM? 251 What is 503 minutes before 11:52 PM? 3:29 PM What is 557 minutes after 6:14 PM? 3:31 AM What is 690 minutes before 10:02 PM? 10:32 AM What is 679 minutes after 7:47 AM? 7:06 PM What is 470 minutes before 10:10 PM? 2:20 PM What is 556 minutes after 7:46 PM? 5:02 AM How many minutes are there between 3:34 PM and 7:38 PM? 244 What is 503 minutes before 9:10 PM? 12:47 PM How many minutes are there between 2:47 AM and 10:33 AM? 466 How many minutes are there between 9:51 PM and 12:01 AM? 130 What is 353 minutes after 11:28 PM? 5:21 AM What is 564 minutes after 2:01 AM? 11:25 AM How many minutes are there between 8:57 PM and 9:37 PM? 40 What is 507 minutes before 10:23 PM? 1:56 PM What is 482 minutes before 2:00 PM? 5:58 AM How many minutes are there between 9:25 PM and 3:53 AM? 388 How many minutes are there between 5:42 AM and 5:37 PM? 715 What is 328 minutes after 12:28 AM? 5:56 AM What is 429 minutes after 11:03 PM? 6:12 AM How many minutes are there between 4:07 AM and 6:08 AM? 121 What is 111 minutes before 10:52 AM? 9:01 AM What is 253 minutes after 9:32 AM? 1:45 PM How many minutes are there between 5:56 PM and 2:18 AM? 502 What is 286 minutes before 4:16 PM? 11:30 AM How many minutes are there between 11:51 AM and 1:42 PM? 111 How many minutes are there between 8:31 PM and 7:26 AM? 655 How many minutes are there between 12:17 PM and 9:02 PM? 525 How many minutes are there between 6:04 PM and 1:05 AM? 421 How many minutes are there between 12:06 AM and 5:47 AM? 341 How many minutes are there between 9:08 PM and 6:21 AM? 553 How many minutes are there between 6:28 PM and 4:10 AM? 582 What is 592 minutes before 6:01 PM? 8:09 AM What is 266 minutes after 4:37 PM? 9:03 PM What is 355 minutes after 10:01 PM? 3:56 AM What is 90 minutes before 4:50 PM? 3:20 PM What is 304 minutes before 2:04 PM? 9:00 AM What is 132 minutes after 12:08 PM? 2:20 PM What is 628 minutes after 6:37 AM? 5:05 PM How many minutes are there between 2:35 AM and 9:25 AM? 410 How many minutes are there between 9:43 PM and 2:41 AM? 298 What is 293 minutes before 3:30 AM? 10:37 PM How many minutes are there between 12:26 AM and 10:13 AM? 587 What is 647 minutes after 4:47 PM? 3:34 AM How many minutes are there between 6:39 PM and 8:16 PM? 97 What is 528 minutes after 6:51 PM? 3:39 AM What is 345 minutes before 4:17 AM? 10:32 PM How many minutes are there between 1:46 AM and 5:37 AM? 231 What is 405 minutes after 9:54 PM? 4:39 AM What is 679 minutes after 6:52 PM? 6:11 AM How many minutes are there between 12:13 AM and 5:22 AM? 309 How many minutes are there between 11:00 PM and 1:34 AM? 154 What is 9 minutes before 2:40 PM? 2:31 PM What is 35 minutes after 12:36 AM? 1:11 AM How many minutes are there between 11:02 PM and 10:44 AM? 702 What is 344 minutes before 9:33 AM? 3:49 AM How many minutes are there between 6:19 AM and 7:08 AM? 49 How many minutes are there between 1:41 AM and 5:56 AM? 255 What is 480 minutes before 12:31 AM? 4:31 PM What is 176 minutes before 4:34 AM? 1:38 AM How many minutes are there between 9:07 PM and 7:18 AM? 611 What is 558 minutes before 3:55 PM? 6:37 AM What is 628 minutes after 8:19 AM? 6:47 PM How many minutes are there between 1:58 PM and 3:29 PM? 91 How many minutes are there between 8:00 AM and 5:06 PM? 546 What is 386 minutes after 5:58 AM? 12:24 PM How many minutes are there between 1:00 AM and 7:45 AM? 405 How many minutes are there between 7:48 PM and 10:16 PM? 148 What is 508 minutes before 5:29 PM? 9:01 AM How many minutes are there between 10:14 AM and 1:43 PM? 209 What is 12 minutes before 8:29 PM? 8:17 PM How many minutes are there between 7:00 AM and 10:51 AM? 231 What is 103 minutes after 1:31 PM? 3:14 PM What is 6 minutes before 1:21 PM? 1:15 PM What is 463 minutes before 7:57 PM? 12:14 PM What is 103 minutes after 4:18 AM? 6:01 AM How many minutes are there between 4:50 PM and 1:14 AM? 504 How many minutes are there between 11:03 PM and 8:33 AM? 570 How many minutes are there between 3:56 AM and 1:45 PM? 589 How many minutes are there between 5:40 PM and 6:43 PM? 63 How many minutes are there between 10:39 PM and 11:29 PM? 50 How many minutes are there between 11:14 PM and 1:49 AM? 155 What is 679 minutes before 5:01 AM? 5:42 PM How many minutes are there between 11:45 AM and 11:02 PM? 677 How many minutes are there between 7:48 PM and 4:10 AM? 502 How many minutes are there between 4:56 AM and 9:58 AM? 302 What is 467 minutes after 6:54 AM? 2:41 PM How many minutes are there between 12:51 PM and 1:00 PM? 9 How many minutes are there between 4:22 PM and 7:44 PM? 202 What is 535 minutes after 12:56 PM? 9:51 PM What is 405 minutes before 9:36 PM? 2:51 PM What is 98 minutes before 1:36 AM? 11:58 PM How many minutes are there between 3:06 AM and 9:40 AM? 394 How many minutes are there between 9:55 AM and 7:08 PM? 553 How many minutes are there between 1:51 AM and 8:36 AM? 405 How many minutes are there between 7:30 AM and 7:07 PM? 697 How many minutes are there between 3:46 PM and 5:24 PM? 98 What is 62 minutes after 11:01 AM? 12:03 PM How many minutes are there between 10:37 PM and 6:45 AM? 488 How many minutes are there between 2:16 AM and 9:10 AM? 414 What is 44 minutes before 2:12 PM? 1:28 PM How many minutes are there between 9:1	{ "pile_set_name": "DM Mathematics" }
(a) -1 (b) 2/7 (c) o c Let u = 0.45 - 0.05. Let t = 635 - 634.756. Let d = t - 0.244. What is the nearest to d in 1/3, u, -0.1? -0.1 Let w be (-176)/(-924)((-36)/(-8))/(-3). Which is the closest to -2/171? (a) w (b) 5 (c) -4 (d) 0.4 a Suppose -155 + 155 = 226y. What is the closest to 5/2 in 18, 3/7, y, -2/5? 3/7 Let r = -0.1 + 0.2. Let k = 243 + -243.1. Let w = r - k. What is the closest to 2 in w, -2, -2/3? w Let w = -1035.4 - -1035. What is the nearest to 3/5 in w, -89, -1/5? -1/5 Let t = -41053/85 - -483. Let x = 36/85 - t. Let s = 9 + -5. Which is the nearest to x? (a) -5/7 (b) 0 (c) s b Let s be 3/(-108) - (-1)/4. Let n = 1.007 - 0.007. Let l = -23 + 23.5. Which is the closest to s? (a) n (b) l (c) 1/5 c Let p = 931 + 11.5. Let x = p - 942. Let t = -0.4 + 0.3. Which is the closest to 0? (a) t (b) -5 (c) x a Let p = -11 - -10. Let w = 5 + p. Let r be -1 + 3 + 240/(-100). Which is the nearest to r? (a) -0.4 (b) 0 (c) w a Suppose -4p = -8p - 20. Let x = -0.572 + -6.428. Which is the closest to -1? (a) -0.3 (b) p (c) 1 (d) x a Let y be 2/717/4. Let g = y + -5/7. Let s = -963 - -966. What is the nearest to 1 in g, 4, s? g Let j = 1.1 - 0.1. Let z = 2 - j. Let k be -34(3 + (-125)/45)/(-4). What is the closest to z in -2/5, 0.1, k? k Let z = -123/29 + 398/87. Which is the closest to -3/13? (a) 0.6 (b) -2/9 (c) -0.3 (d) z b Let t = 5.239 - 5.128. Which is the closest to 8? (a) t (b) -2/15 (c) -2 a Suppose 377x + 24 = 375x. Let d be 39/x - -3 - (-26)/40. Let g = -0.42 + 0.52. What is the closest to 2/3 in -0.3, g, d? d Let p be (22 - (-168)/12)/((-6)/40). What is the closest to p in 1/6, 2/3, 1, 0.2? 1/6 Let p be (-4 + 2)6/4416/96. Which is the nearest to -5? (a) -0.13 (b) -0.3 (c) -1 (d) p c Suppose -173 = -35i - 138. Let v = -1 - -4. Which is the closest to i? (a) v (b) 6 (c) -5 a Let y = -15.07 - -15. Let r = 593 - 531.3. Let h = r - 61.6. What is the nearest to h in y, -1, -1/2? y Suppose 5u = 61 - 31. Let t be u/(-15) + (-13)/5. Suppose n + 2 = 6. Which is the closest to -1? (a) t (b) n (c) 0 c Let g = -23507/6 + 3918. Which is the nearest to 2/13? (a) g (b) 6/5 (c) 1/5 (d) 34 a Let k = 7 + -3. Let j = 15686.6 + -15686.6. What is the closest to j in -2/7, k, 6, -0.3? -2/7 Let y = -68.619 - -68.61. Which is the nearest to -1? (a) -0.4 (b) y (c) 0.5 (d) 5 a Suppose 5p = -5q + 135, 4p - 118 + 7 = -3q. What is the closest to 0 in p, -1/4, -0.01, -5? -0.01 Let l be ((-4410)/1029)/((-3)/7). Which is the closest to 2? (a) l (b) -0.1 (c) 4/3 (d) 0.5 c Let m(t) = -t2 - 2t - 1. Let j be m(-2). Let v = -13052/77 - -1863/11. What is the closest to j in v, 3, 2/7? v Suppose -1 = 2v - 11. Suppose 10f - vp + 25 = 9f, 0 = -4f + 5p - 25. Which is the nearest to f? (a) 1/5 (b) 1/2 (c) 0.71 a Let c = 1025 + -1031.9. Let t = -6 - 0.8. Let q = c - t. What is the nearest to 1 in -5, 4, q? q Suppose -2p - 19 = -29 + 12. Which is the closest to p? (a) -6 (b) -15 (c) 6/5 c Let w = 43355/3 - 14451. Which is the closest to w? (a) -1 (b) 1/3 (c) 2 (d) 8 b Let n = -7.917 - -7.817. What is the nearest to -0.1 in 173, n, -2/13? n Let v be 1/2(-31 + 49). Let s be (-4)/(-18) - (-2 + (11 - v)). What is the nearest to 2/7 in s, -13, 0.5? s Let d = -0.3 + 0.4. Let a be (-1)/(214/4 - 2475/450). What is the closest to -1 in a, -41, -0.4, d? a Let j = 115 + -457/4. Let o be -2 + 266 - 6/(-4)-2. Let l = o + -1303/5. What is the closest to -2 in l, j, -9? l Let q = -1.34 + -2.66. Let d = -2/395 - 784/1185. What is the nearest to d in q, 0.5, 0.2? 0.2 Let r = -1426/5 + 1428/5. Which is the closest to -31? (a) -17 (b) r (c) -4/7 a Let k = -2979.5 - -2979. Which is the closest to 0? (a) k (b) -1/65 (c) -0.03 b Let y = 78.837 + 0.163. Let h = -72 + y. Let u be (-24)/562/9. Which is the nearest to h? (a) -4 (b) u (c) 0 c Let c = 0.2 + -0.3. Let p = 1530.6 + -855.3. Let z = p + -675. What is the nearest to c in z, 4, 1? z Let m = -63.3 - -65. Let o = -2 + m. Let t = -38 - -43. Which is the nearest to 0.6? (a) 2/15 (b) t (c) o a Let d = 30871/3 - 10290. Let k = 10392 + -363614/35. Let g = -24/7 + k. What is the nearest to d in 1, g, -1/5? -1/5 Suppose -73 = -2q - 2q + 3p, 0 = 3q + 2p - 42. Suppose -f - 8 = -2d - 5, 4f = d + q. Which is the nearest to -17? (a) 3 (b) d (c) -0.1 c Let z = -0.899 + 1.089. Which is the nearest to 2/15? (a) 4 (b) z (c) 0.2 (d) -2/11 b Let f = -0.0815 - -0.1815. Let d be ((-4)/(-6))/(32/(-24)). What is the nearest to f in -2/79, d, 0.3? -2/79 Let i = -663 + 663.168. Which is the closest to -0.1? (a) 4 (b) 2 (c) i c Let c = -184.44 + 186.44. What is the closest to 76/3 in -0.1, -0.3, 2/15, c? c Let y = 34.9 + -39.61. Let j = y + 5.71. Which is the nearest to 3? (a) j (b) 4 (c) -63 b Let z = -219 + 219.0551. Let w = -0.1551 + z. What is the closest to -9 in -2, w, 4? -2 Suppose 0 = 3m - 4m. Let x = -1/3 + m. Let l = 319 + -3511/11. Which is the nearest to x? (a) -5 (b) 2/19 (c) l c Let l = 78.81 + -79.01. What is the closest to -2/9 in l, -6/13, -3? l Let j(v) = v + 10. Let q be j(-5). Suppose -u - 2p - 9 = 0, 2p + 1 + 14 = qu. Suppose 10g - 9g = u. Which is the closest to g? (a) 1 (b) 0.2 (c) -2 a Let z = 4 - 19/5. Let r be (8 - 3) + -6 + 10/15. Suppose -4q - i = 5 - 6, -q - 5i + 24 = 0. Which is the nearest to r? (a) q (b) 2/5 (c) z c Let n = 34174 - 34173.93. Let q be 2 + 1 + 23/(-6). What is the closest to 1 in n, q, 0? n Let u = -16631 + 16631.1. What is the nearest to -0.15 in -2/23, 0.4, u, 221? -2/23 Let f = -0.2631 + -0.2369. Which is the nearest to -16.1? (a) 3 (b) f (c) 4 b Let z = -3833 - -3842. Which is the closest to -1? (a) -3 (b) 3/7 (c) z (d) -4/5 d Suppose 3m - 5y = -3739 + 3724, 5m = -2y + 6. Which is the nearest to m? (a) 3 (b) 7 (c) 0.3 (d) -2 c Let n = 38530/7 - 5504. Which is the closest to n? (a) -0.1 (b) 21/8 (c) -4 a Let w be (2 - -4)5/25. Let n be (3/(-14))/((-3)/6). Let m be 1((-5)/254)/(-2). What is the closest to w in -0.2, n, m? n Let r = -238 - -236. Suppose 3w = -5m + 21, -2w + 3m - 15 = -5w. Let h be w/(-8) + 63/28. Which is the closest to 1? (a) r (b) -0.2 (c) h c Let f = 16363 + -16371. Which is the nearest to -0.1? (a) 1/5 (b) f (c) -3/5 (d) -39 a Let m be (16/(-66))/(2768/(-7612)). Let o be 5/(1 + 1 - 1). Which is the closest to 0? (a) m (b) 2/15 (c) o (d) 0.05 d Let l = 7.17255 + -0.17255. Which is the nearest to -1/4? (a) -5/6 (b) l (c) -1/92 c Let m be (1 - (-93)/(-35))/((-26)/(-130)). Let n = m + 276/35. Which is the closest to 3? (a) -4 (b) -2 (c) n c Let h(w) = 69w + 1798. Let n be h(-26). Which is the nearest to -0.3? (a) -0.5 (b) n (c) -0.007 (d) -6 a Let n = -4.03 - 0.97. Let o = -0.0189 + -0.0411. What is the nearest to -0.1 in -4, o, n? o Let t = -115621 - -115628. Let z = -0.4 + 0.3. What is the nearest to z in 0.3, t, -2? 0.3 Suppose -p + 9 = 3w, 29w - 24w - 2p + 7 = 0. Which is the nearest to -1/3? (a) w (b) 4 (c) -28 a Suppose 66y - 36y = -60. What is the closest to -0.1 in 1/3, -42, y, 0.14? 0.14 Let t be 22/(-88)16/363. What is the nearest to t in 0, 3, -247? 0 Let p(i) = i*2 - 43i - 187. Let t be p(47). What is the nearest to 1 in t, -0.3, 1/4, -2/5? t Suppose 0 = 355s + 859 + 561. Let b = -1 + 1. What is the nearest to b in -54, 0.5, s? 0.5 Let f = -75 - -76.06. Let q = -0.94 - f. Which is the nearest to 5? (a) 0 (b) q (c) -1/4 a Let s = 0.145 + 0.855. Let x = -65.4 + 58. Let g = 7.5 + x. What is the closest to 7 in g, 3, s? 3 Let j(g) = -8g*2 + 1. Let o be j(-1). Let k = 3456 + -3454. Let y be k/7 - (47/o + 5). Which is the closest to 2? (a) -0.5 (b) 0 (c) y c Let w = 7/32 + -149/96. Let c = -36.8 + 67.1. Let h = c + -30.7. What is the closest to w in 2, -0.3, h? h Let h be -12 + 6 + 0 + -2 + 4. Let d be ((-21)/126)/(0 - (-2)/h). What is the nearest to -0.4 in d, -5, 1/11? 1/11 Suppose -4t + 17 = -n - 4, n - 6 = -5t. Let k be 8/20n/(-6). Let m = -4408/15 - -294. What is the nearest to -1 in -1/3, m, k? -1/3 Let v(w) = -w*2 - 2w - 7. Let r be v(-3). Let s be 2 - 3*r/(-21). Let o = s - 0. What is the closest to 0 in -3, -0.2, o? -0.2 Let k = 14.41 - 10.41. Let r = 95 + -289/3. Which is the n	{ "pile_set_name": "DM Mathematics" }
prob of picking 1 l and 1 o when two letters picked without replacement from lol? 2/3 Two letters picked without replacement from vvfvfvuu. What is prob of picking 2 u? 1/28 Calculate prob of picking 1 y and 2 i when three letters picked without replacement from {y: 2, i: 2}. 1/2 Two letters picked without replacement from {g: 1, y: 3, e: 5, p: 2, s: 8}. What is prob of picking 1 e and 1 g? 5/171 Three letters picked without replacement from {i: 11, c: 3}. What is prob of picking 2 c and 1 i? 33/364 Calculate prob of picking 4 t when four letters picked without replacement from {t: 11, f: 9}. 22/323 Calculate prob of picking 3 f and 1 t when four letters picked without replacement from ftfhftiftttfztqqfqft. 49/969 Calculate prob of picking 2 w and 1 c when three letters picked without replacement from hmchwhhmcmccchwhmh. 5/816 What is prob of picking 2 w when two letters picked without replacement from {l: 3, h: 2, w: 2, o: 1, z: 6, r: 4}? 1/153 Two letters picked without replacement from {t: 1, i: 3, w: 4, c: 1, r: 1, m: 4}. Give prob of picking 1 i and 1 t. 3/91 Calculate prob of picking 1 s, 1 b, and 1 p when three letters picked without replacement from wbpbawpwbpswwb. 3/91 What is prob of picking 1 m and 1 a when two letters picked without replacement from awpms? 1/10 Two letters picked without replacement from {n: 1, o: 4, g: 1, d: 4, x: 2, j: 6}. Give prob of picking 2 d. 2/51 Calculate prob of picking 2 c when two letters picked without replacement from {c: 10}. 1 Calculate prob of picking 1 g and 2 p when three letters picked without replacement from gggpipp. 9/35 Three letters picked without replacement from dwhwttfhwmdwdwhwdh. Give prob of picking 1 t, 1 w, and 1 f. 1/68 Calculate prob of picking 1 n, 1 h, and 1 q when three letters picked without replacement from hqccqnqqqheni. 10/143 Two letters picked without replacement from {z: 1, q: 2, j: 4, p: 3}. Give prob of picking 1 j and 1 p. 4/15 Three letters picked without replacement from bbqqbqqbqqq. What is prob of picking 1 q and 2 b? 14/55 Two letters picked without replacement from {o: 1, h: 5, m: 3}. Give prob of picking 1 h and 1 o. 5/36 Three letters picked without replacement from ceiicieccieic. What is prob of picking 1 i and 2 c? 25/143 What is prob of picking 1 f and 1 q when two letters picked without replacement from {f: 2, w: 1, q: 4, n: 1, z: 1}? 2/9 Three letters picked without replacement from {a: 2, r: 1, y: 5, u: 1, b: 7}. What is prob of picking 2 b and 1 r? 3/80 What is prob of picking 1 w and 1 l when two letters picked without replacement from wfosswswwlwslksswow? 14/171 What is prob of picking 3 g when three letters picked without replacement from gggglegxgllx? 1/11 What is prob of picking 1 i and 1 e when two letters picked without replacement from liwttellwltl? 1/66 Calculate prob of picking 1 o and 1 c when two letters picked without replacement from coossccocv. 4/15 Two letters picked without replacement from gyggyggygggygggggg. What is prob of picking 2 g? 91/153 What is prob of picking 1 r and 2 i when three letters picked without replacement from biribriwiw? 1/10 What is prob of picking 1 o and 1 k when two letters picked without replacement from {b: 2, v: 4, k: 3, m: 1, o: 1, u: 1}? 1/22 What is prob of picking 1 o and 2 t when three letters picked without replacement from xttttxttxxo? 1/11 Four letters picked without replacement from znnjkzkzvwvwkz. Give prob of picking 1 z, 1 w, 1 v, and 1 j. 16/1001 Two letters picked without replacement from vvssvvsvsv. What is prob of picking 2 v? 1/3 Two letters picked without replacement from {g: 2, h: 4, c: 3, d: 2, b: 1}. Give prob of picking 1 b and 1 d. 1/33 Four letters picked without replacement from lttvlsrvlslt. What is prob of picking 2 s and 2 t? 1/165 What is prob of picking 1 n and 1 w when two letters picked without replacement from {b: 1, n: 1, i: 1, p: 6, w: 5}? 5/91 Calculate prob of picking 2 o, 1 r, and 1 f when four letters picked without replacement from {o: 3, q: 6, f: 4, r: 1, j: 1, i: 1}. 3/455 Four letters picked without replacement from ehee. What is prob of picking 4 e? 0 Two letters picked without replacement from {q: 1, j: 4, n: 2, c: 2}. Give prob of picking 1 j and 1 c. 2/9 Three letters picked without replacement from ttzfbfyzytyfzyybff. What is prob of picking 1 t and 2 y? 5/136 Three letters picked without replacement from {z: 4, t: 12, g: 4}. What is prob of picking 2 z and 1 g? 2/95 What is prob of picking 2 v and 2 k when four letters picked without replacement from {n: 5, k: 2, v: 2}? 1/126 Three letters picked without replacement from {g: 2, t: 1, o: 1, s: 3, b: 4}. Give prob of picking 1 g, 1 o, and 1 b. 8/165 Calculate prob of picking 1 o and 1 y when two letters picked without replacement from {y: 8, h: 2, o: 2}. 8/33 Calculate prob of picking 3 b when three letters picked without replacement from {b: 4, o: 1, u: 5}. 1/30 Two letters picked without replacement from {t: 2, l: 2, z: 2, u: 4, f: 3, m: 2}. Give prob of picking 2 t. 1/105 Calculate prob of picking 1 p and 1 h when two letters picked without replacement from {h: 16, p: 2}. 32/153 Two letters picked without replacement from {m: 2, b: 9, g: 3, j: 3}. What is prob of picking 1 b and 1 g? 27/136 Calculate prob of picking 1 j and 1 u when two letters picked without replacement from {l: 3, j: 1, s: 2, h: 3, o: 1, u: 5}. 1/21 What is prob of picking 2 t when two letters picked without replacement from {v: 1, h: 7, w: 2, t: 3, r: 1}? 3/91 Four letters picked without replacement from {m: 4, y: 4, z: 11}. Give prob of picking 4 y. 1/3876 Three letters picked without replacement from {n: 12, p: 3}. Give prob of picking 2 n and 1 p. 198/455 Two letters picked without replacement from gtg. Give prob of picking 1 g and 1 t. 2/3 Calculate prob of picking 1 p, 1 d, and 1 n when three letters picked without replacement from npeppdeehehpdw. 2/91 Calculate prob of picking 1 z and 1 a when two letters picked without replacement from {n: 1, z: 1, i: 5, u: 3, x: 1, a: 1}. 1/66 Three letters picked without replacement from kssjsossvsvsessess. Give prob of picking 1 o and 2 e. 1/816 What is prob of picking 2 q when two letters picked without replacement from {q: 2, t: 10}? 1/66 Calculate prob of picking 2 h and 1 a when three letters picked without replacement from {a: 1, w: 2, n: 1, h: 2}. 1/20 Three letters picked without replacement from lvllavnllllvvlallall. What is prob of picking 1 n and 2 a? 1/380 Three letters picked without replacement from {z: 6, m: 3, w: 1, g: 1, t: 3}. Give prob of picking 1 m, 1 t, and 1 z. 27/182 Two letters picked without replacement from altae. Give prob of picking 1 a and 1 e. 1/5 What is prob of picking 1 k and 2 m when three letters picked without replacement from {a: 2, m: 2, b: 1, p: 2, k: 1}? 1/56 Four letters picked without replacement from {p: 8, n: 3}. Give prob of picking 3 p and 1 n. 28/55 Calculate prob of picking 2 a and 2 l when four letters picked without replacement from azlaazaacaalafaclc. 3/85 Calculate prob of picking 2 s when two letters picked without replacement from {q: 1, s: 2, t: 1, u: 2, d: 5, m: 6}. 1/136 Calculate prob of picking 1 z and 2 g when three letters picked without replacement from pgpppgzgpttp. 3/220 Calculate prob of picking 2 i when two letters picked without replacement from xixxxiixix. 2/15 Three letters picked without replacement from {y: 5, a: 2}. Give prob of picking 1 a and 2 y. 4/7 Three letters picked without replacement from tuauoasututauuhtuuhs. Give prob of picking 2 h and 1 u. 2/285 Calculate prob of picking 1 p, 1 q, and 1 f when three letters picked without replacement from qqqqqpfqfffffqffff. 35/408 Three letters picked without replacement from {o: 1, k: 2, b: 2, i: 9, z: 3}. Give prob of picking 1 k, 1 z, and 1 o. 3/340 What is prob of picking 2 e and 1 b when three letters picked without replacement from ebeerbxaerarabxeeb? 5/68 Four letters picked without replacement from {l: 1, i: 2, b: 2}. What is prob of picking 1 l, 2 b, and 1 i? 2/5 Calculate prob of picking 1 x, 2 e, and 1 o when four letters picked without replacement from {x: 4, o: 1, e: 2}. 4/35 Four letters picked without replacement from aaaaaaaaaaaccaaaca. What is prob of pick	{ "pile_set_name": "DM Mathematics" }
z = 26 + -20. Let w = 3 + -1. Suppose -wv + zv = 28. What are the prime factors of v? 7 Let b(x) = -x*2 - 10x - 7. Suppose -1 = -2t - 11. Let y be b(t). What are the prime factors of y/4(-3 + 5)? 3 Let g be (-234)/(-30) + 2/10. Suppose 4r + g = 4k, 2k - 2 = k. Suppose r = 5w - 37 - 28. List the prime factors of w. 13 Let t = 2 - 1. Suppose -2g - u + 9 = 0, 0 = u - 0u - t. What are the prime factors of g? 2 Let h(w) be the second derivative of w*4/12 - 2w3/3 + w2 + 2w. Let p be h(4). Suppose -n + p = -2. What are the prime factors of n? 2 Suppose 0 = -3g + 8 - 2. Suppose h - gh + 13 = 0. What are the prime factors of h? 13 Suppose 4s - 7 = 3j, s + 5j = 6s - 15. Let b = s + 1. What are the prime factors of (-8)/(0 + b) + 0? 2 Suppose 2j - 5x = 72, -2x = -2j + 47 + 31. What are the prime factors of j? 41 Let p be (6 - 0 - 1)/1. Let f(i) = i + 5. List the prime factors of f(p). 2, 5 Suppose 4i + i + 35 = 0. Let p(t) = -t*3 - 8t*2 - 8t - 10. Let q be p(i). What are the prime factors of -1(21/q + 0)? 7 What are the prime factors of 1337/63 + 4/(-18)? 3, 7 Let s be (24/9 - 2)9. Suppose 3m = -5k + 3k, 0 = 3m + 4k + s. What are the prime factors of m? 2 Let j(s) = 5s - 3. Let m = 27 + -18. List the prime factors of j(m). 2, 3, 7 Let b(j) = j + 7. Let n be b(0). Suppose -2x - 10 = 0, -4x + n = -2o + 55. List the prime factors of o. 2, 7 Suppose 0 = -2d + 5d - 5n - 155, 171 = 3d + 3n. Let r = d + -18. What are the prime factors of r? 37 Suppose -118 = -d - p, -5d + p - 4p = -586. List the prime factors of d. 2, 29 Let q(s) = 8s + 27. Let t(i) = 9i - 39. Let j(l) = -l + 5. Let b(d) = -33j(d) - 4t(d). Let p(r) = 11b(r) + 4q(r). List the prime factors of p(0). 3 Let l(n) = -n*2 - 5n + 5. Let u be l(-5). Suppose -3s = -3i - u + 20, 0 = 2i - 5s - 10. What are the prime factors of i? 5 Let f = -9 + 14. Suppose 3s - fw - 55 = 33, -s + 3w + 36 = 0. Let z = s + -12. List the prime factors of z. 3 Let d(f) = -7 + 0 - 24f + 6. Let g be d(-1). Suppose -i + 5z + g = 0, 0 = -5z - 22 + 7. What are the prime factors of i? 2 Suppose d + 10 = h, -2h + 7 = -3d - 13. What are the prime factors of 94/h - (-14)/(-35)? 3 Let a = 81 - 1. List the prime factors of a. 2, 5 Let q(a) be the first derivative of -7/2a2 - 8/3a*3 - 3 + 4a - 1/4a4. List the prime factors of q(-7). 2 Let z = 23 + -10. What are the prime factors of z? 13 Let y(m) be the third derivative of -1/2m*3 + 0 + 3/8m*4 - 1/60m5 - m2 + 0m. What are the prime factors of y(7)? 11 Suppose -3 = -3g + 3m, 3g = 3m + 2m + 5. Let s be 8 + 1 - (g - -3). Suppose 4a + 43 = 3x, -5x + sa + 61 = 2a. List the prime factors of x. 3 Let j(f) = 3f - 6. Let x(y) = 2y - 4. Suppose -40 = -5b - 4d, -3d = -7 - 8. Let l be x(b). List the prime factors of j(l). 2, 3 Let l = -8 + 18. Let q = l - 3. Suppose 3i - 42 = -2d, 0 = 3d + qi - 3i - 61. List the prime factors of d. 3, 5 Let o(k) = -4k - 4k + 1 + 2k*2 + 5 - 3k*2. Let s be o(-8). What are the prime factors of 76/s + 4/(-6)? 2, 3 Suppose 10 = -l - 5z, -5l - 5z - 4 = -54. List the prime factors of l + 1(1 - 3). 13 Let b(i) = -i3 - 20i*2 - 5i + 22. What are the prime factors of b(-20)? 2, 61 Let l be 81/(4/16-3). List the prime factors of (-1)/(((-20)/l)/(-5)). 3 Let x = 1 + -1. Suppose xr - 72 = -4r. What are the prime factors of r? 2, 3 Suppose 0 = 6n - 2n - 2j - 98, 3n - 66 = 3j. Let d = n + -2. Suppose x = -3v + d, -5v + 2x + 51 = -x. List the prime factors of v. 3 Suppose 851 = -11t + 2578. List the prime factors of t. 157 Let l(d) = d*2 + 2d - 17. List the prime factors of l(10). 103 Let x(c) be the third derivative of -3c4/8 + 11c*3/6 + 6c*2. List the prime factors of x(-5). 2, 7 Let s = -99 + 163. List the prime factors of s. 2 Let r(z) = z + 5. Let w be r(0). Suppose -wd - 4 - 1 = 0. What are the prime factors of (d - 0)/(4/(-28))? 7 Suppose -2n + 3q = q - 16, -3n = 5q. List the prime factors of n. 5 Suppose -12g = -8g - 196. List the prime factors of g. 7 Let n = -25 + 37. Let w = 19 - n. Suppose -6t - 12 = -wt. What are the prime factors of t? 2, 3 Suppose 3t = 2t + 3. Suppose 6h + 6 = th. List the prime factors of ((-4)/(-6))/(h/(-30)). 2, 5 Suppose -3q - 3m = -m + 8, -20 = -q + 5m. Suppose -31b + 34b - 48 = q. What are the prime factors of b? 2 Suppose -6 = 3i, 13 - 1 = 4c - 2i. Suppose cj - 2 = j - 2z, 5j - 10 = -4z. What are the prime factors of (j/(-5))/((-1)/10)? 2 Let c(u) = -2u - 2. Let n be c(-4). What are the prime factors of 11 - (n - -3)/3? 2 List the prime factors of 1 + -3 - (-55 + 2). 3, 17 What are the prime factors of (6 + -8 - -1)(-184)/1? 2, 23 Suppose 6z - 444 = -6z. List the prime factors of z. 37 Let m(s) = -s - 7. Let g be m(-10). Let u be g/(-2)(-4)/(-6). What are the prime factors of 1(u + 2 + 8)? 3 Let o(c) be the second derivative of c*4/12 + 2c*2 - 41c. Let b(t) = -t*3 - 5t*2 + t + 2. Let a be b(-5). List the prime factors of o(a). 13 Let s(u) = 3u*2 - 2u + 2. Let r be s(2). Suppose 5d = -3n + 14, -d = -4n + 24 + r. Suppose 2f - n = f. List the prime factors of f. 2 Suppose -v + 224 = -5v. Let z = -39 - v. List the prime factors of z. 17 Suppose 0 = 2c + h - 3h - 12, h - 4 = -4c. Suppose -f + 0 = -c. List the prime factors of (3/f)/((-9)/(-24)). 2 Let s(k) = -k*3 - 15k*2 - 4k + 11. List the prime factors of s(-15). 71 Suppose 0 = -11j + 7j + 20. Let l(h) = -h + 9. Let k be l(5). Suppose kd + 3a + 8 - 71 = 0, -ja = -4d + 23. List the prime factors of d. 2, 3 Let d = 24 - -10. List the prime factors of d. 2, 17 Let x = 69 + -24. Let t = x - 24. What are the prime factors of t? 3, 7 Let g = 178 + -105. List the prime factors of g. 73 Let u(l) = 22l2 - 5l + 3. List the prime factors of u(4). 5, 67 Let z(l) = 149l - 2. What are the prime factors of z(1)? 3, 7 Let n(c) = 5c*2 + 2c - 1. Let k = -10 + 14. Let g be n(k). What are the prime factors of g/9 - (-2)/(-3)? 3 Let f be -143/(16). Let d(g) = g*3 + 8g*2 + 7g - 2. Let q be d(f). Let o = 4 + q. List the prime factors of o. 2 Suppose -h + 9 = 22. Let m = h - -22. Suppose -4f - 35 = -mf. What are the prime factors of f? 7 Let t = 27 + -2. What are the prime factors of t? 5 Let x(p) = p*2 + p - 5. Let s be x(4). Suppose s = 4u + 3. Suppose 6 = 5a + 2k, -14 + 6 = -a + uk. What are the prime factors of a? 2 Let u(y) = -y + 2. Let i be u(1). Let a(n) = 10n + 1. List the prime factors of a(i). 11 Suppose -5l + 36 = -114. List the prime factors of l. 2, 3, 5 Suppose -87 = -3p + 150. What are the prime factors of p? 79 Let y(x) = 9x2 - 3x + 25. What are the prime factors of y(-6)? 367 Suppose -5q = -q + 12. Let p be (24/9)/((-2)/q). Suppose -pg = g - 95. List the prime factors of g. 19 Let d(o) = -o*3 - 5o*2 + 7o + 8. Let g be d(-6). Suppose 13 = a - 13. Suppose -gj = 4c - a, c = -c + 10. List the prime factors of j. 3 Let c(n) = 20n - 36. List the prime factors of c(9). 2, 3 Suppose -4 = -2j + 2. Suppose jm = -3o - o + 67, -2m + 39 = -3o. List the prime factors of m. 3, 7 Let j(l) = -77l + 13. Let z(c) = -39c + 7. Let q(b) = -6j(b) + 11z(b). What are the prime factors of q(1)? 2 Let a = 79 - 27. List the prime factors of a. 2, 13 Let a = 16 - 13. Let t(h) = h3 - h2 + 3h - 3. List the prime factors of t(a). 2, 3 Suppose 0i + 1 = -2i - 3f, 2f = -6. Suppose 9j - 4j - 15 = 0. Suppose -8 = 2z - 3o, -jo + 7o - 24 = -iz. List the prime factors of z. 2 Let i(q) be the first derivative of q7/840 - q6/360 + 5q4/24 - q3 + 3. Let w(o) be the third derivative of i(o). List the prime factors of w(0). 5 Let n be 2/((-1)/((-27)/(-6))). Let i = -6 - n. List the prime factors of i. 3 Let p = 24 + -29. Let f be (2-1)/(6/(-45)). Let c = f - p. List the prime factors of c. 2, 5 Let g = 1 - -1. Suppose -4b = 2i - 14, 3i - 7 = -3b + g. List the prime factors of b. 2 What are the prime factors of 94/5 + (-2)/(-10)? 19 Let y(o) = 6o3 - 3o + 2. List the prime factors of y(2). 2, 11 List the prime factors of 24/(-204) - 1568/(-34). 2, 23 Let t(k) be the first derivative of k*3/3 - 2k - 1. Let j be t(-2). Suppose -7d + 3d = -5r - 11, jd - 2*r - 8 =	{ "pile_set_name": "DM Mathematics" }
+ -5)*2 + sqrt(363) - sqrt(363)) + sqrt(363) + (sqrt(363) + (sqrt(363) - sqrt(363)1))*2 + -4 - (1 + 5 + 2 + sqrt(363)). -132sqrt(3) + 750 Simplify 4(5 + (-4(-1 + sqrt(208) - sqrt(208)) + 2sqrt(208)-3 + sqrt(208))*2) + 4. -640sqrt(13) + 20888 Simplify 4 + sqrt(252) + -1 + -3 + 0. 6sqrt(7) Simplify -1 + -2(1 + (0 + sqrt(7))*2) + ((-1 + sqrt(847) - (sqrt(448) + sqrt(448) + 0 - sqrt(7) - sqrt(7)))3)*2. 54sqrt(7) + 559 Simplify -5((sqrt(10) - sqrt(200)/sqrt(5) - sqrt(10))/(-1-1sqrt(2)) + 3). -15 + 10sqrt(5) Simplify 2((sqrt(1440)2)/sqrt(2) + -5 + sqrt(45) + 0)*2. -540sqrt(5) + 7340 Simplify (2(-5 + sqrt(684) + sqrt(684) + 1 + sqrt(684) + 4)-2)*2. 98496 Simplify 5 + 1 + (-3sqrt(2299)-2)2 + (sqrt(2299) + -1 + -1)2. -44sqrt(19) + 85073 Simplify (61sqrt(720)-5)2 - (1 + (sqrt(720) - 31sqrt(720))). 24sqrt(5) + 647999 Simplify -4 + -2(-6(sqrt(10) + sqrt(40)/sqrt(4)))/(sqrt(16)/sqrt(2)). -4 + 12sqrt(5) Simplify ((sqrt(2401)2 + sqrt(49) + (sqrt(1225) + sqrt(1225)1 - sqrt(1225)))/((sqrt(56) - (sqrt(56) + (sqrt(8064)-2 - sqrt(56)) - sqrt(56)))/sqrt(8)))*2. 700/169 Simplify ((sqrt(12) + (sqrt(84) - (sqrt(84) - -2sqrt(84) - sqrt(84)))/sqrt(7))1)/(sqrt(12)/(sqrt(4)/sqrt(2)) + (sqrt(864) - (sqrt(864)-1 - sqrt(864)))). 0 Simplify ((sqrt(182) + (sqrt(182) - (sqrt(182) - (52sqrt(182) - sqrt(182)))))/sqrt(7))/(sqrt(22)/(sqrt(539) + sqrt(539)1 + sqrt(539))). 210sqrt(13) Simplify -6(0 + sqrt(5) + (1 + (sqrt(10)/sqrt(2) + sqrt(5))2 + sqrt(5) - sqrt(5)) + (sqrt(225)/sqrt(5))2). -396 - 6sqrt(5) Simplify (((3sqrt(120)-1)/sqrt(6)2 + 4)3)*2. -864sqrt(5) + 6624 Simplify (-1(-5(sqrt(275)2)2 - sqrt(275)) + -5)-41. -21980 - 20sqrt(11) Simplify ((sqrt(320) + 2 + (sqrt(320) - (sqrt(320) + 1sqrt(320)) - sqrt(320)))61)2. -1152sqrt(5) + 11664 Simplify sqrt(171)/((sqrt(108)-1)/sqrt(12)) - (-2sqrt(2299) + (sqrt(19) + 1 + sqrt(19))4)2. -3740 + 111sqrt(19) Simplify ((sqrt(119) - 5sqrt(119)1)/(sqrt(567) - 3sqrt(567)))2. 68/81 Simplify 1 + sqrt(2448)2 + 1 + (sqrt(425) + sqrt(425) + 0 + sqrt(425) + 2)*2-5. -19143 - 276sqrt(17) Simplify (sqrt(63)/(sqrt(729)-3))*2 + -3 + -2. -3638/729 Simplify 5(0 + ((-1sqrt(1872) + 5)2 + 5 + 1sqrt(1872))-5). -47550 + 2700sqrt(13) Simplify ((sqrt(11) + -1 + 3)-5 - (4(1 + sqrt(176) + sqrt(176)))*2) + 0. -11290 - 261sqrt(11) Simplify -2 + ((sqrt(288) - (sqrt(288) - 2sqrt(288))) + 3 + sqrt(288) + 0 + 2 - -3(2 + sqrt(288)-1))2. 119 Simplify (sqrt(462)/(sqrt(11) + sqrt(44)) - (sqrt(336)-1)/sqrt(8))/((sqrt(6) - (sqrt(12)/sqrt(2)3 - sqrt(6)))4). -sqrt(7)/3 Simplify (2 + sqrt(325) + 1 + 0 + sqrt(325))*2 + 4. 60sqrt(13) + 1313 Simplify 3 + ((-1 + sqrt(2))-1 + -5 - (4 + (sqrt(8) - sqrt(32))/sqrt(4)))2. 67 Simplify 5 + (2(sqrt(66) + (sqrt(66) - (sqrt(66) + (sqrt(66)1 - sqrt(66))))) - sqrt(66))/(1sqrt(216) + sqrt(216) + sqrt(216)). sqrt(11)/18 + 5 Simplify (sqrt(1620) + (sqrt(1620) - (sqrt(1620) + 5-4sqrt(1620) + sqrt(1620))) - sqrt(1620))/(sqrt(10) - -3sqrt(30)/sqrt(3) - sqrt(10)-16). 171sqrt(2)/10 Simplify ((4(sqrt(1053) - -6(sqrt(1053) + -2)) + (sqrt(1053) + (sqrt(1053) - -1sqrt(1053)-1) - (sqrt(1053) - (1 + sqrt(1053))2)))-1)*2. -24840sqrt(13) + 949816 Simplify 4(0 + (6sqrt(44) + (sqrt(99)-3)/sqrt(9))1). 36sqrt(11) Simplify (sqrt(28)-1 + sqrt(7) - sqrt(7))-4 + (sqrt(567)-2)*24. 8sqrt(7) + 9072 Simplify 5((23sqrt(66))/(sqrt(36)/sqrt(24)))*2. 7920 Simplify (-5(-1sqrt(84) - sqrt(84)))/(-2sqrt(144)/sqrt(3)). -5sqrt(7)/2 Simplify sqrt(40)/sqrt(2) + ((sqrt(5) - sqrt(20)/sqrt(4)) + sqrt(5))-3 + -2 + sqrt(40)/(sqrt(8)-1) + -1. -2sqrt(5) - 3 Simplify 5 + -5((sqrt(1216) + 0 + sqrt(1216))2 + sqrt(1216)) + -1 + (6(sqrt(684) + 1))*2. 344 + 392sqrt(19) Simplify (((sqrt(99) + 1sqrt(99) - sqrt(99))/sqrt(9)6 - sqrt(110)/(sqrt(640) + sqrt(10))) + 4)*2. 424sqrt(11)/9 + 32195/81 Simplify ((sqrt(154) + -6sqrt(154)1)/sqrt(7))/(-2sqrt(2)-46). -5sqrt(11)/48 Simplify (((sqrt(114)-3 + sqrt(114))-1)/(6sqrt(42)/sqrt(7)))2. 19/9 Simplify (sqrt(19) + (sqrt(19) - sqrt(95)/sqrt(5)) + 4 - (sqrt(19)-2 + 1 + sqrt(19)))*2 + sqrt(2299) + -2 + -2. 81 + 23sqrt(19) Simplify ((1sqrt(5760) + sqrt(5760))/sqrt(5) + 5 + 0 + 0 + sqrt(128))2. 560sqrt(2) + 6297 Simplify (sqrt(143) - sqrt(143)1-2)/(sqrt(11) + sqrt(1584)-2 + sqrt(1584) - sqrt(11)). -sqrt(13)/4 Simplify ((sqrt(55)/(-3(sqrt(5) - -1sqrt(5))))2 + (sqrt(11) + sqrt(55)/sqrt(5)-2)6)5. -30sqrt(11) + 55/36 Simplify ((sqrt(176)/sqrt(4) - (sqrt(33)2)/sqrt(3)) + -2 + 5)*2. 9 Simplify -2 + sqrt(1700) + -4 + 5 + 4. 3 + 10sqrt(17) Simplify -1 + (sqrt(2592) - (sqrt(2592) + -1sqrt(2592))2) + 5 + ((2sqrt(126))/sqrt(7) + sqrt(18))/sqrt(9). 4 + 39sqrt(2) Simplify ((sqrt(121) + sqrt(121) + sqrt(121)-4 + sqrt(121))-6)/(2sqrt(539) + sqrt(539)). 2sqrt(11)/7 Simplify (1sqrt(6)/sqrt(3) - (sqrt(98)2 - sqrt(98)) - (3 + (sqrt(18) - sqrt(2)) - (sqrt(2) - (sqrt(72) + -2sqrt(72)))))*2. 6sqrt(2) + 11 Simplify (5 + -6(2 + sqrt(343)) - 2-6sqrt(343)-2)*2. 2940sqrt(7) + 308749 Simplify (sqrt(57) + sqrt(57) + (-3sqrt(2052) + sqrt(2052) - sqrt(2052) - sqrt(2052)))/((sqrt(3) - sqrt(30)/(sqrt(10)4 + sqrt(10))) + sqrt(3)). -110sqrt(19)/9 Simplify (3(sqrt(588) - (sqrt(588) + (-1 + sqrt(588))-2)) - ((sqrt(588) - (sqrt(588) + (0 + sqrt(588))5 + sqrt(588))) + -1 + sqrt(588) + -4))*2. -308sqrt(3) + 71149 Simplify -3sqrt(35)/sqrt(252) + (sqrt(40)/(sqrt(768)/sqrt(6)))2. -sqrt(5)/2 + 5/16 Simplify ((1sqrt(17))*2 + -3)4 + (sqrt(153) - (2 + sqrt(153)))2 + (-2 + sqrt(153))2 + sqrt(17). -11sqrt(17) + 217 Simplify -1(-4(-4 + sqrt(7)-1 + sqrt(7) + (sqrt(7) - (sqrt(7) + sqrt(21)/sqrt(3))) + 0 + 3))*2-4. 128sqrt(7) + 512 Simplify (sqrt(343) - (sqrt(343)-1 - sqrt(343) - sqrt(343))-1)2 + (-3sqrt(112))/sqrt(4). -6sqrt(7) + 1372 Simplify (-5 + (-2sqrt(4032) - sqrt(4032) - sqrt(4032))/(2sqrt(225)))2. 32sqrt(7) + 2417/25 Simplify (sqrt(1980) + (2sqrt(1980) - sqrt(1980))1)/(-2-2sqrt(11)1). 3sqrt(5) Simplify (sqrt(11) + 0 + sqrt(11))-5 + -1 + sqrt(44) + 5 + -4 + 2sqrt(11) + 2. -6sqrt(11) + 2 Simplify (((sqrt(170) - (-1sqrt(170) + sqrt(170))) + sqrt(170))5-4)/(5(sqrt(640)3 + sqrt(640))). -sqrt(17)/4 Simplify ((3 + sqrt(1331)11-4)-3)*2. -2376sqrt(11) + 191745 Simplify (sqrt(360)/(sqrt(441) + (sqrt(441)1 - sqrt(441)) - sqrt(9)))/(sqrt(512) - -1sqrt(512) - (sqrt(288) - (sqrt(288) - sqrt(288)2))). sqrt(5)/24 Simplify (5sqrt(576))/sqrt(12) + (sqrt(300) + 1)-1 + 1. 10sqrt(3) Simplify -2 + (4 + (sqrt(320) - (2 + sqrt(320)) - sqrt(320)))*2 - ((sqrt(320) - -4(sqrt(320)2 - sqrt(320))) + 3). -72sqrt(5) + 319 Simplify (-1sqrt(153)2-3)/(sqrt(441)1 - -4sqrt(81)). 6sqrt(17)/19 Simplify (6sqrt(125)/(sqrt(5)2))/(sqrt(245) + -6sqrt(245)-3 - sqrt(245)). sqrt(5)/42 Simplify ((sqrt(50)-2)/sqrt(2)2)/(sqrt(5) + sqrt(45)/(sqrt(27)/sqrt(3)) - sqrt(15)/(sqrt(9)/sqrt(3))). -4sqrt(5) Simplify (sqrt(110) - (sqrt(110) - -1sqrt(110))6)/((-2sqrt(90) + sqrt(90))/sqrt(9)) + -1. -1 + 11sqrt(11) Simplify (-2-22sqrt(117))/((sqrt(180)/sqrt(4))/sqrt(5) + (sqrt(225) - (sqrt(225) + 2sqrt(225)) - sqrt(225))). -4sqrt(13)/7 Simplify -2 + sqrt(209)/((sqrt(11) + sqrt(176))-1) - (sqrt(76) + -2sqrt(76) + -1)*22. -156 - 41sqrt(19)/5 Simplify (5 + -5sqrt(99) + (-1 + -1sqrt(11))4)-4. -4 + 76sqrt(11) Simplify (sqrt(63)/(sqrt(36)/sqrt(4)) - (sqrt(28) + sqrt(112)/sqrt(4))/sqrt(4)) + 0 + -3. -3 - sqrt(7) Simplify ((sqrt(63) - (sqrt(63) + -3sqrt(189)/sqrt(3)))-5)/(sqrt(18)/(sqrt(2)-15)). 75sqrt(7) Simplify sqrt(2057) - ((sqrt(2057) + (3 + sqrt(2057) - sqrt(2057)) + sqrt(2057) - sqrt(2057) - sqrt(2057)) + 1)2 - 5(sqrt(17) + sqrt(1088) + 2 + sqrt(1088)). -74sqrt(17) - 26 Simplify (2sqrt(150)/sqrt(6))/(sqrt(40)/(sqrt(8) - sqrt(8)-4)). 10sqrt(5) Simplify -2(-3 + 1(sqrt(156) + -2(sqrt(156) - (sqrt(156) + (sqrt(156) - sqrt(156)-1))))/(1sqrt(12)1)). -10sqrt(13) + 6 Simplify (2 + (-5 + sqrt(272) + -1 + 6(0 + sqrt(272)))*2-4)-4. -5376sqrt(17) + 213816 Simplify -6((sqrt(17) - -2(sqrt(17) + -2) - (sqrt(17) + sqrt(1377) + -2))3)2. -45198 - 1512sqrt(17) Simplify 1(4 + sqrt(405) + (sqrt(405) - (4 + sqrt(405))))2. 18*sqrt(5) Simpli	{ "pile_set_name": "DM Mathematics" }
69. Let h(k) be the first derivative of p(k). Let w(c) = 4 - c*2 - 6 + 2. Determine w(h(o)). -5041o2 Let t(x) be the second derivative of x3/3 + 89x. Let v(q) = 6292q + 884. Let s(y) = 170y + 24. Let p(d) = 221s(d) - 6v(d). What is p(t(k))? -364k Let t(q) = -62q2 - 8q. Let i(p) = 1290p. Give i(t(w)). -79980w*2 - 10320w Let k(b) be the third derivative of -1/4b4 + 0b + 0b3 - 2b2 + 0. Let y(j) be the second derivative of -j3/3 + 7j - 498. Determine k(y(l)). 12l Let l(c) = -3c2 + 0c*2 + 5c*2. Let d(y) = 8y*2 - 70y - 21. Let g(w) = 14w2 - 120w - 34. Let i(m) = -12d(m) + 7g(m). What is i(l(u))? 8u4 + 14 Let w(c) = 2c. Let b be 1 - (5 + 8/(-4)). Let s be ((-28)/(-12) + b)15. Let z(y) = 11y + sy - y. Calculate z(w(p)). 30p Let i(j) be the second derivative of 53j4/12 + j + 577. Let b(n) = -21n. What is b(i(u))? -1113u2 Let s(f) be the third derivative of f5/12 + 55f*2 - 4. Let q(t) = 95t. Calculate q(s(y)). 475y2 Let l(h) = -10778h. Let p(f) = 86f2 - 23f. Give l(p(d)). -926908d2 + 247894d Let f(z) = -3z. Let y(q) be the first derivative of 19q*5/15 - 25q*2/2 - 92. Let m(w) be the second derivative of y(w). Determine f(m(h)). -228h*2 Let s(p) = 41p + 16932. Let w(c) = c*2 - 8c. Determine s(w(i)). 41i2 - 328i + 16932 Let b(h) = -5h2 + 0h*2 + 34h - 34h. Let r(i) = 5i*2 + 61 - 61. What is r(b(o))? 125o*4 Let n(b) = 2b*2. Let u(k) be the second derivative of 1 + 0k*2 + 2k + 1/3k3. What is u(n(h))? 4h*2 Let o(a) = -6a. Let g(r) = -125101704r2. Give g(o(i)). -4503661344i*2 Let x(v) = -17v*2. Let z(j) be the third derivative of 377j*5/60 + 1554j*2. What is z(x(f))? 108953f*4 Let x(k) = -2k. Let w(r) = -1817996r2 - 320r. Give w(x(q)). -7271984q2 + 640q Let k(s) = -5s2. Let n(v) = 2v*2 + 12. Determine n(k(x)). 50x*4 + 12 Let l(n) = 2n*2. Let p(h) = 3h*2 + 12388659h - 4. Calculate p(l(o)). 12o4 + 24777318o*2 - 4 Let r(h) = 25 + 52h - 50h - 25. Let m(p) = 171p - 95. Let f(a) = 2a - 1. Let b(i) = -95f(i) + m(i). What is r(b(t))? -38t Let p(c) = -5c. Let l be 18/(-12)(-16)/12. Let t(u) = 171u*2 - 318u*2 + 162u*l. What is p(t(k))? -75k*2 Let n(v) be the first derivative of 23v*2 + 1261. Let y = 5 - 3. Let m(s) = -5 + 3 + ys + 2. Calculate m(n(k)). 92k Let z(i) = 57352i. Let l(w) = 25w. Give l(z(c)). 1433800c Let z(i) = 4i. Let c = -152 - -157. Let a(b) = -7b + 17b - cb. Calculate a(z(r)). 20r Let h(c) be the third derivative of 0c*4 + 0c*3 - 1/15c*5 + 0c + 0 - 73c2. Let q(n) = 37n. What is h(q(w))? -5476w2 Let o(z) = 6185z*2 - 3094z*2 - 3094z2. Let l(p) be the second derivative of -p4/12 + p*2 - 11p. Determine l(o(q)). -9q4 + 2 Let q(k) = 10k - 9. Let z(l) = 7l + 16 - 6l - 16. What is q(z(m))? 10m - 9 Let r(d) = 3d2. Let g(o) = o3 + 20o2 + 36o - 24. Let l be g(-18). Let x = l + 37. Let n(z) = 38z + z - xz. Calculate r(n(k)). 2028k2 Let n(x) = -7x + 4. Let y(b) = -83b + 22. Let d(j) = -6n(j) + y(j). Let h(s) = -51s2. Give h(d(p)). -85731p*2 - 8364p - 204 Let r(b) = 212b + 450. Let u(c) = -514c. Calculate r(u(y)). -108968y + 450 Let l(u) = 2u*2 + 259u. Let f(a) = 107a - 67a - 42a. What is l(f(q))? 8q*2 - 518q Let o(v) = -5v2 + 12. Let h = -223 - -227. Let b(y) = -3443y + h - 4 + 3441y. What is o(b(s))? -20s*2 + 12 Let m(q) = 6194q. Let i(y) = -834y2 + 2. Calculate m(i(c)). -5165796c*2 + 12388 Let j(r) = -3r + 6. Let i(q) be the third derivative of 0q3 + 0 + 0q + 1/12q4 + 18q*2. What is j(i(w))? -6w + 6 Let f(x) = 2x. Let m(y) = -y2 + 2y - 688694. Give f(m(w)). -2w2 + 4w - 1377388 Let p(n) = 645n2. Let d(z) = -412z - 41. Calculate d(p(r)). -265740r2 - 41 Let h(t) = 8t*2 - 10t - 537. Let j(y) = 56y2. Determine h(j(r)). 25088r*4 - 560r*2 - 537 Let w(g) = -386823g. Let s(d) = 363d. Calculate w(s(p)). -140416749p Let h(o) = -42o2 - 4o. Let c(p) = -1684788p. Determine c(h(l)). 70761096l*2 + 6739152l Let c(t) be the third derivative of -7t5/60 + 3t*2 + 188t - 6. Let x(u) = 13u. Give x(c(y)). -91y*2 Let w(g) be the second derivative of 5g*3/3 - 7634g. Let b(d) = 195d. Calculate w(b(z)). 1950z Let w(n) = 67n + 2. Let f(d) = -202d - 7. Let i(h) = -4f(h) - 14w(h). Let t(u) be the third derivative of -u*4/24 - 1589u*2. What is i(t(g))? 130g Let p(g) = 1080862g. Let k(i) = i2. Determine k(p(f)). 1168262663044f*2 Let a(q) = 69671143q. Let g(t) = -t*2. Calculate g(a(b)). -4854068166926449b*2 Let b(g) = -g. Let r(f) = 2671f*2 - 35f + 7. Let m(o) = -1338o2 + 15o - 3. Let q(i) = -14m(i) - 6r(i). Calculate b(q(d)). -2706d2 Let c(v) = -18031v + 11. Let q(y) = 13y. Calculate c(q(k)). -234403k + 11 Let n(k) = -2k. Let u be 70/4 - 0 - 6/(-12). Suppose -3v = 3z + 9, 4z - v - u = v. Let a(h) = 10h2 + 11h*z - 27h*2. What is a(n(c))? -24c*2 Suppose 0 = 808g - 809g + 2. Let x(j) = -212862j*2 + 3 - 3 + 212850j*g. Let d(q) = -14q. Determine x(d(r)). -2352r2 Let v(q) = -q2. Let w(b) = -4630038b. Calculate w(v(u)). 4630038u2 Let v(s) = -41s*2 - 382s. Let u(j) = -j*2 - 29. Determine v(u(k)). -41k*4 - 1996k*2 - 23403 Let u(l) = 25962867l. Let x(c) = -2c2. What is u(x(p))? -51925734p*2 Let k(h) = -7h*2. Let v(z) = 56z - 14. Let y = -182 - -185. Let t(l) = 11l - 3. Let w(o) = yv(o) - 14t(o). Determine w(k(n)). -98n*2 Let j(o) = 46o + 1. Let x(c) = 1101c2 + 5. Calculate j(x(g)). 50646g*2 + 231 Let d(v) = -13v - 45. Let t be d(-6). Let y(b) = -10b + 56b + tb. Let x(f) = -f. Calculate x(y(z)). -79z Let j(o) = 12o2. Let a(p) be the second derivative of -13p4/3 - p3/6 + 3p - 425. Determine a(j(n)). -7488n*4 - 12n*2 Let n(f) = 2f*2. Let v(b) = 256b + 39083. Calculate v(n(w)). 512w2 + 39083 Let s(b) = -888b*2. Let m(k) = 9k*2 + k - 111. Give m(s(r)). 7096896r*4 - 888r*2 - 111 Let s(m) = -105m + 5588. Let d(i) = 2i2 - 96. Determine s(d(g)). -210g*2 + 15668 Let p(i) be the third derivative of i + 1/60i*5 + 0 + 0i*4 - 21i*2 + 0i*3. Let u(q) = 45q*2. Calculate u(p(x)). 45x*4 Let f(l) = 5l2 - 10. Let w(a) = -a2 - 1. Let i(v) = f(v) - 10w(v). Let o(z) = 4. Let u(r) = 4r + 20. Let g(n) = -15o(n) + 3u(n). Give i(g(d)). 2160d2 Let t(c) = -217c. Let s(l) = 2l - 60. Let g(r) = -r + 15. Let a(h) = -12g(h) - 3s(h). Give a(t(d)). -1302d Let p(b) be the third derivative of -b*4/12 + 5426b*2. Let a be -2 - -5 - (-2 + 3). Let j(c) = -2c*2 - 8c + 3ca + 0c*2 - 17c. What is j(p(y))? 4y2 + 50y Let a(o) be the first derivative of -3o2 + o - 22o*2 + 8o*2 - 14o*2 - 67. Let t(i) = -i. Determine a(t(m)). 62m + 1 Let r(j) = -j + j - 3j. Let d(k) = 550k - 572. Suppose 1122q - 1120q = 12. Let z(h) = -23h + 24. Let s(t) = qd(t) + 143z(t). Determine s(r(g)). -33g Let v(i) = 5i2. Let d(r) = 3 + 228r + 245r - 397r. Calculate v(d(y)). 28880y2 + 2280y + 45 Let f(d) = -58804499d. Let l(h) = 3h*2. Determine f(l(g)). -176413497g*2 Let x(u) = 4u*2 - 54567u. Let a(k) = 19k. Determine x(a(h)). 1444h*2 - 1036773h Let l(u) = -11u2 - 18u - 3. Let c(b) = 232b2 + 384b + 64. Let x(q) = -3c(q) - 64l(q). Let n(z) = -14z. Calculate n(x(r)). -112r*2 Suppose -4n - 26 = -z, z + 3n = -4 - 5. Let r(h) = 4h + 9. Let v(b) = -10b - 42 - 2b + 15. Let t(d) = zv(d) + 17r(d). Let g(s) = -s. Determine t(g(c)). 4c - 9 Let t(r) = -72r. Let l(o) be the first derivative of -4o3 - 17. Let f(j) = 5j*2. Let h(d) = 10f(d) + 4l(d). What is h(t(c))? 10368c*2 Let z(u) = -2u*2 - 75. Let a(k) = 5k*2 + 198. Let p(b) = -3a(b) - 8z(b). Let x(w) = 16w - 2. Calculate x(p(g)). 16g2 + 94 Let g(n) = 4n - 47. Let x(t) = -7t - 115 + 115 + 11t. Determine x(g(u)). 16u - 188 Let k(b) = 2b. Let i be 5/((-49)/14 - -6). Let m(r) = 48r2 - 13r*i - 16r*2 - 18r - 15r2. Determine m(k(d)). 16d*2 - 36d Let y(l) = 25l. Let b(s) = -27s - 11. Let d be (29 - 11)(-3)/(-9). Let p(t) = -5t - 2. Let r(q) = db(q) - 33p(q). Calculate y(r(m)). 75m Let z(i) = -13i*2 - 182983 + 182983. Let q(s) = -752s. Calculate z(q(	{ "pile_set_name": "DM Mathematics" }
= 198455 - 198435. Suppose -2s = s - 435. Let f = s - 66. Calculate the remainder when f is divided by y. 19 Let k(v) = -19v + 4. Suppose -2f - 2m = 119 + 81, -m = -3f - 300. Let c = -59 - f. Calculate the remainder when k(-4) is divided by c. 39 Let k = -40 + 55. Suppose 4d + 2s - 6 = 0, -5d = -s - 4s - k. Calculate the remainder when (-2 - 466/d)16/(-40) is divided by 25. 19 Let p be 190/35 + 1 + 40/(-28). Suppose 7 = 3t - 44. What is the remainder when 1032/16 - p/10 is divided by t? 13 Let l(r) = r2 + 16r + 102. Calculate the remainder when l(-4) is divided by ((4 - 1)/3)/(1/19). 16 Let x be (53/2)/(4/40). Suppose -12l + x = -7l. What is the remainder when l is divided by (-4)/18 + -3505/(-135)? 9 Let b(k) = -13k + 187. Let y be b(15). Let s(h) = -31h + 206. Calculate the remainder when s(y) is divided by 8. 6 Suppose 5u - 341 = 2y, -59y + 55y = 12u - 880. Suppose -5o + 2o = -27. What is the remainder when u is divided by o? 8 Calculate the remainder when 17919 is divided by -12 + 136 - 11 - (2 + -3 + 2). 111 Suppose -8i = 9i. Let z(c) = 14c + 3. Calculate the remainder when 9/2 - (-3)/(-2) is divided by z(i). 0 Suppose -3a + 2k + 171 = 164, -k = 2a - 7. Calculate the remainder when 78 is divided by a. 0 Suppose -2o = 3k - 16, o - k - 8 = 10. Suppose -l - 2l - 4z = -18, -z = 2l - 12. Calculate the remainder when (3 - ((-8)/4 + 2)) + o is divided by l. 5 Suppose -5p + 4a + 119 = -44, 3p = 2a + 99. Let x(i) = -10i + 987. Calculate the remainder when x(78) is divided by p. 32 Suppose 26f + f = 132 + 3. Calculate the remainder when 581 is divided by f. 1 Suppose 4q = -3m - 24, 2q + 0m + 4m + 12 = 0. What is the remainder when 11 is divided by (-290)/(-70) - (q/7 - -1)? 3 Let z(o) = -3o3 + 10o*2 + 2o - 6. Suppose 0 = x - 92 + 24. What is the remainder when x is divided by z(3)? 5 Suppose 0o - o - x = -123, -19x - 267 = -2o. What is the remainder when 999 is divided by o? 7 Suppose 59s + 12 = 63s. Suppose -m + 7 - 1 = -q, 0 = sm - 2q - 15. Suppose 10 = ma - 38. What is the remainder when 31 is divided by a? 15 Let i = -111 - -193. Let b(w) = -6w2 - 57w - 109. Calculate the remainder when i is divided by b(-6). 14 Calculate the remainder when 195 is divided by (105/15)/(3/(-3)) + 30. 11 Let x(d) = 100d - 10. Let b be x(3). Suppose 2t = -t + 60. Suppose 25y - b = ty. Calculate the remainder when y is divided by 10. 8 Suppose 4l - 114 = 2z, 0 = 2l + 4z - z - 69. Let d = 1266 - 1207. Calculate the remainder when d is divided by l. 29 Suppose 16f - 11f = 140. Calculate the remainder when (-15)/20102/(-9)6 is divided by f. 23 Let z = 6334 - 5241. What is the remainder when z is divided by 113? 76 Let w(n) = 4n2 + 19n - 236. What is the remainder when 1294 is divided by w(7)? 85 What is the remainder when (-58)/(-1)2/2 is divided by 4((-126)/12 + 13)? 8 Let p = 330 + -207. Calculate the remainder when p is divided by 30. 3 Suppose -42j + 39j - 315 = 0. Let b = j + 108. Suppose s = -bm + 86 + 198, 400 = 4m - 4s. What is the remainder when m is divided by 34? 28 Let w = -16 - -16. Suppose w = -r - r - 16. Let t = 22 + r. What is the remainder when 26 is divided by t? 12 Let s(v) = -5v*3 + 5v*2 - 3v + 1. Let j be s(3). Let o = j - -149. Calculate the remainder when o is divided by 13. 12 Suppose 8y = 38y - 150. What is the remainder when 4 + -6 - y - -69 is divided by 16? 14 Suppose 148a - 4494 - 18150 = 0. Calculate the remainder when 450 is divided by a. 144 Let b = -27 + 34. Suppose -10h + 9 = -bh. Calculate the remainder when (1 - (3 - (-5)/(-3)))-27 is divided by h. 0 Let r(d) = -2d3 - 5d*2 - 10d + 23. Let u be r(-5). What is the remainder when (-3)/(u/76 + -3)10 is divided by 41? 35 Suppose 2f + 3 = 3b, 0f = -5f + 15. Suppose -3o = bz - 72, -o = -5z + 4 - 10. Let w(i) = 4i - 47. Calculate the remainder when w(o) is divided by 13. 11 Suppose 2w = -3z - 11 + 134, 4z + 193 = 3w. Calculate the remainder when 619 is divided by w. 52 Let y(c) = -3c + 5. Suppose -6x = -2x - 20. Let l = 4 + x. Calculate the remainder when y(-4) is divided by l. 8 Let g(c) = 325c2 + 3c - 3. Let r = 827345 + -827258. Calculate the remainder when g(2) is divided by r. 85 Let u(l) = -l + 9. Let b be u(7). Suppose bo - 140 = -3o. Suppose -7 = -2z + 13. What is the remainder when o is divided by z? 8 Let l be 9/(-4 - 148/(-36)). Let h = -118 + l. Let t = 42 + h. What is the remainder when 8 is divided by t? 3 Suppose -5f = -2l + 2041, 1852 = 2l - 3f + 25f. What is the remainder when l is divided by 43? 14 What is the remainder when 2174 is divided by (-1814/105)/(21/(-2380))? 270 Suppose -24t + 12340 = -14444. Let o = t - 947. Calculate the remainder when o is divided by 5. 4 What is the remainder when 83 is divided by ((-42)/11)/((-1)/11) + 5? 36 Let a = 4887 - 4728. What is the remainder when 555 is divided by a? 78 Suppose 5880d = 5929d - 35574. What is the remainder when d is divided by 238? 12 Let j be (2/(-10))/(-6 - (-9145)/1525). Let b = 171 - j. Let w = b - 106. Calculate the remainder when w is divided by 4. 0 Suppose 0 = -3o - 58 + 1390. Suppose -12u = -o + 108. Suppose 0 = 2h + h - 24. What is the remainder when u is divided by h? 4 Suppose 0 = x - 3x + 8. Let h(y) = -y*2 + 13y + 20. Let p be h(0). Suppose xa = 5a - p. What is the remainder when 35 is divided by a? 15 Let s = -36 - -70. Let k(q) = -25q - s - q2 - 9q2 + q3 + 52. Calculate the remainder when 26 is divided by k(12). 2 Suppose 26505c + 128 = 26521c. Calculate the remainder when 581 is divided by c. 5 Calculate the remainder when 236 is divided by ((-2)/16)/(43/(-38184)). 14 Let c = -6 - -31. Let q = 13058 - 11778. Suppose -35u + q = -cu. What is the remainder when u is divided by 43? 42 Suppose g - 116 = -3g. What is the remainder when g is divided by (9/(-5)(-2140)/321)/4? 2 Suppose -364 = 4t - 2d - 16490, 2d = -2t + 8060. Calculate the remainder when t is divided by 369. 341 Calculate the remainder when 118 is divided by 1 + 0 + ((-3)/(-54) - 6409/(-306)). 8 Let j(q) = 8q - 2. Suppose o = -2t - t + 17, 0 = 2o - 3t + 2. Suppose -3z + o + 1 = 0. Calculate the remainder when 22 is divided by j(z). 8 Suppose -25o + 24o = -71. Suppose 77l - 1176 = ol. What is the remainder when l is divided by 20? 16 Let m(d) be the first derivative of 63d4/2 + d3 - 2d2 + 2d + 48. Calculate the remainder when m(1) is divided by 26. 23 Let a = -24386 - -24710. Calculate the remainder when a is divided by 178. 146 Suppose 0 = 4k - 4j - 104, 5k - 122 = 4j - j. Suppose -1103 - 1603 = -kq. What is the remainder when q is divided by 55? 13 Let z = -2091 + 2474. What is the remainder when z is divided by 127? 2 Let l(i) = 5i*2 + 66i - 258. Calculate the remainder when 4722 is divided by l(4). 78 Suppose 2 + 3 = -5d. Let k = 206 - 94. Calculate the remainder when k is divided by (-3 - d)((-27)/2 + -1). 25 Let t = 320 + -228. Let v(x) = 29x - 276. What is the remainder when t is divided by v(10)? 8 Suppose 0 = -19b + 1610 + 1449. Suppose bn - 169n = -232. Calculate the remainder when 43 is divided by n. 14 Let x be ((-26)/6)/((-5)/45). Suppose 21 = 6a - x. Suppose -6 = -ar + 664. Calculate the remainder when r is divided by 23. 21 Let j(u) = 13u2 - 31u + 5. Suppose 70 = -11w + 103. What is the remainder when 33 is divided by j(w)? 4 Suppose 26 = 5o - 9. Let l(a) = a*3 + 14a*2 + 9a - 252. Calculate the remainder when l(-11) is divided by o. 5 Let t = 102 - 54. Suppose -t = 3w - 5w. Let p = -953 + 1045. Calculate the remainder when p is divided by w. 20 Suppose 6h = 4o + 2h - 280, 5o - 2h - 353 = 0. Let k = o - 47. Suppose -5p = 4x - 31, 5x - 20 = -3p + 22. What is the remainder when k is divided by x? 6 Let n be (-4)/(250/83 - 3). Let c = -181 - n. What is the remainder when c is divided by 19? 18 Let t = 183 - 175. Suppose tj = 6j + 108. Calculate the remainder when j is divided by 5. 4 Suppose 7c - 30 = 4c. Let z(v) = -108v + 350. Calculate the remainder when z(3) is divided by c. 6 Suppose -5 = -7s - 19. What is the remainder when s(212/(-4))/1 is divided by 32? 10 Suppose 2020 = t - a, t = 2*a + 157 + 1	{ "pile_set_name": "DM Mathematics" }
- 63. Is (112/l)/((-4)/30) a multiple of 14? True Let o(z) = -z*2 + 19z - 23. Let x = 36 + -20. Is o(x) a multiple of 25? True Suppose 0 = 2v - 10, 0l = 5l - v - 40. Let c = 24 - l. Let d = c - 11. Is d even? True Let q be 1/(4(-2)/(-232)). Let m = q + -3. Is 13 a factor of m? True Let w = 17 + -7. Let o = w - 1. Is 9 a factor of o? True Let k(j) be the second derivative of 31j4/4 - j3/6 + j2/2 - 5j. Is 13 a factor of k(1)? False Let s(p) = p - 1. Let y be 30/18 + (-4)/6. Let w(j) = -6j - 8. Let n(a) = yw(a) - s(a). Is 14 a factor of n(-5)? True Let d be (1 + -2 - -1)/1. Suppose 0 = n + i + 6, 2i + 3 + 1 = 0. Is d + 14 - 4/n a multiple of 6? False Suppose r - 8 = -3. Suppose s - 60 = -rj, -s - 5j = s - 115. Let b = -29 + s. Is 15 a factor of b? False Let h(d) = 21d - 2. Is h(2) a multiple of 8? True Let x(o) = 4o - 19. Is x(22) a multiple of 28? False Let h be (0/(-4))/(2/(-2)). Suppose h = -d - 3x + 2x + 34, 2x = d - 28. Is d a multiple of 19? False Let w be 2/(-5) - 164/(-10). Suppose -60 = -s + i, 2s - i = 107 + w. Let k = s - 17. Is 23 a factor of k? True Does 60 divide -2 + 5/3 - 6489/(-27)? True Does 12 divide ((-4)/(-6))/((-2)/(-36))? True Let s = 5 + 0. Suppose sy - 110 = 2w, 2w + 51 = 2y + 13. Let v = -17 + y. Is 7 a factor of v? True Is 18 a factor of 3/((-3)/(-72)2)? True Let s = -5 - -21. Suppose -t = t - s. Is t a multiple of 8? True Let v be 3/12 + 147/4. Let p(y) = -5y + 12. Let u be p(6). Let w = u + v. Is w a multiple of 9? False Let m = -6 - -6. Suppose -2k = 5b - 24, b - 2k = -mk. Suppose q - b = 7. Is q a multiple of 5? False Let c(m) = m - 9. Let w be c(7). Let d = 7 + w. Suppose 2p = dk + 71, -k = 2p - 2k - 59. Is p a multiple of 14? True Suppose -151 = 3j - 403. Is 28 a factor of j? True Let v(b) = -2b3 + 2b*2 + 5b + 2. Is 8 a factor of v(-2)? True Let c(q) = q*3 + 4q*2 - 11q + 6. Is c(-5) a multiple of 18? True Suppose 324 = 8i - 580. Is 21 a factor of i? False Let q = 59 + -41. Is q a multiple of 6? True Let k(i) be the second derivative of 7i3/6 + i2 + 5i. Let g = -1 - -3. Does 7 divide k(g)? False Suppose -7c + 0c + 112 = 0. Does 4 divide c? True Let n = -21 - -73. Let j = n + 163. Suppose -7v + j = -2v. Is 19 a factor of v? False Let k(f) = f3 - 6f*2 - 3f - 8. Let y be k(7). Suppose y = -5n, 2h + h = -2n - 8. Suppose 14 - 152 = -4w + v, h = -w - 3v + 28. Is 16 a factor of w? False Let c(q) = -3q*3 - 7q*2 - 7q - 5. Is c(-4) a multiple of 33? False Let x(g) = -g*2 - 8g + 5. Let u(j) = -3j + 1. Let k be u(3). Let s be x(k). Suppose 3c + 18 = 5v - 26, 0 = sv + 2c - 29. Is v a multiple of 5? False Let m(s) = -10s + 3. Let y be m(-7). Suppose 4l - 137 = -3r, 0r - 2r + y = -l. Is r a multiple of 13? True Suppose -l = -2, 1110 = 3b - b - 2l. Suppose 3u - 6694 = 5r, 4u - b = -r - 1882. Does 27 divide r/(-49) + (-2)/7? True Suppose 0 = -2l - 3l. Suppose l = -n + 4 - 36. Let c = n + 56. Is c a multiple of 9? False Let x = -7 - -12. Suppose 31 = 4k + 5r, -6r = -xk - r + 95. Does 7 divide k? True Is (224/(-35))/((-4)/10) a multiple of 7? False Suppose r - 3v + 4 = -r, v = 0. Let f be (0 - r) + -3 + 3. Suppose 5 = 3g - fg. Is g a multiple of 4? False Let w = 75 - 33. Is 10 a factor of w? False Is 12 a factor of (171/27)/(2/72)? True Suppose 9u = 8u + 4. Suppose 0v = v - 2m, 3v - um = 8. Suppose q = -v + 31. Is q a multiple of 8? False Let n = -16 + 29. Is n a multiple of 13? True Let g = 198 + -141. Let a = -12 + g. Let d = -23 + a. Is 11 a factor of d? True Let d be (-2 + 0)-4-8. Let t be (-1 - d) + (1 - 1). Suppose 3x - t = 2p, 0 = 2x - 0x + p - 42. Does 12 divide x? False Let r(d) = d*2 + 8d + 10. Let x be r(-7). Is (9/(-12))/(x/(-12)) even? False Let n(q) = q*2 + 11q + 19. Is n(-10) even? False Suppose 22 = 2l - d + 3d, d - 32 = -4l. Does 13 divide 109/4 - l/28? False Let t(m) = m2 - m. Suppose -2k + 35 = 13. Let x = -8 + k. Does 6 divide t(x)? True Suppose 0 = 3y - y. Suppose y = 5r + 3f - 56 - 16, -52 = -5r + 2f. Is 11 a factor of r? False Let f = -57 - -92. Is f a multiple of 5? True Let u(i) = 2i + 8. Is u(2) a multiple of 4? True Is 23 a factor of (-634)/(-18) - (-2)/(-9)? False Suppose 282 + 54 = 3q. Is 14 a factor of q? True Let g = 12 - 12. Suppose k - 4k + 111 = g. Is k a multiple of 16? False Is 16 a factor of (-2 + 1 + 3)24? True Suppose -4z + 106 + 188 = -3o, 3z + 3o - 210 = 0. Let f = -2 - -5. Suppose 5g - 66 = -3s + z, -f = g. Is 17 a factor of s? True Let o be (-45)/4 + 2/8. Let r be 2/7 + (-89)/(-7). Let z = r - o. Is 17 a factor of z? False Let a = -8 + 5. Is (-1)/a - 178/(-6) a multiple of 15? True Let n(y) = y3 - y2 + 6. Let v be n(0). Let d(w) = w3 - 6w*2 - 8w - 4. Let g be d(v). Let c = -22 - g. Is 15 a factor of c? True Suppose -3i - 2i = 2l - 46, l = i - 5. Suppose -5u - 8 = -4o, u - 4u = 5o - 10. Suppose -g + i + 16 = u. Is g a multiple of 12? True Let t(r) = 7r*2 + 5. Let n be t(-5). Suppose -3k + 7k + n = 0. Let i = -27 - k. Does 18 divide i? True Let n(q) = q + 3. Let m be n(-3). Let w be 236 - (m - 2). Suppose 5g - w = 3j, 56 + 12 = 5g - j. Is 13 a factor of g? True Is 25 a factor of (250(0 - 1))/((-4)/4)? True Suppose 3u = -5b - 3 - 7, 2b = 2. Let n be 1/3 - u/3. Suppose -nm = p - 24, -m = -2m + 3. Is 10 a factor of p? False Let h = 4 - 3. Let w(o) = -3 + 61o*2 - o - 1 + 4. Is w(h) a multiple of 17? False Let s(q) = 2q*2 + 4q + 2. Let t be s(-2). Let a be t15/(-12)-14. Suppose -2b + a = 3b. Is b a multiple of 7? True Does 3 divide -12(3 + 22/(-6))? False Suppose 4c = -10 - 2. Let q(a) be the second derivative of -a5/20 + a3/6 - a*2 - a. Is 22 a factor of q(c)? True Suppose 11a - 440 = 6a. Does 11 divide a? True Suppose 0 = -2n - 5b + 25, 0n - 4n - 4b = -32. Suppose 2s - 3s = -n. Suppose 0 = -o + i + 15, -i + si + 73 = 5o. Does 13 divide o? True Suppose 4v - p - 19 = 0, 5v - 3p - 29 = -0v. Does 4 divide (2/4)/(v/56)? False Let g(p) = -p + 9. Let x be g(5). Suppose -4k + 96 = -2z, -xk + 6z + 92 = 5z. Does 22 divide k? True Suppose -33 = -4a - p, 0 = -a - 3p + 11 + 11. Let o(q) = -q3 + 7q2 + q - 2. Does 4 divide o(a)? False Let m(o) = o3 + 9o2 + 16o - 4. Does 2 divide m(-6)? True Let a = 124 - -49. Does 11 divide a? False Let l be 98 - 6/((-6)/2). Let f(v) = -v*2 + 5v. Let t be f(4). Suppose tz - l = 4. Is 14 a factor of z? False Suppose p - 77 = 4h, 2h - 124 = -p - p. Is 13 a factor of p? True Let z be (1360/(-10))/(1/(-1)). Suppose -z + 16 = -5c. Does 15 divide c? False Let j(r) = -r*3 - 6r*2 - r + 4. Let s be j(-4). Let z be (-1 + -1)/(3/s). Suppose -4 = 3k - z. Is 2 a factor of k? True Suppose -3s = 12, 0 = -5h + 6s - 4s + 53. Let x(w) = -w*2 + 17w - 13. Let j(f) = -f + 1. Let p(c) = 5j(c) + x(c). Is 13 a factor of p(h)? False Suppose -44 = -17o + 6o. Is o a multiple of 4? True Let p(k) = -73k3 - k2 - 2k - 1. Let q be p(-1). Let y = q - 50. Suppose -10 = -3g + y. Does 5 divide g? False Suppose -4j + 3z = -2z - 144, -z = 0. Does 9 divide j? True Let g = -116 + 162. Suppose -3v - 4 = -5b + 8, 0 = -3v + 3b - 12. Let k = g + v. Is k a multiple of 22? False Let r(g) = -17g + 29. Is r(-4) a multiple of 30? False Is 37 a factor of (12 - -14)/((-2)/(-7))? False Let b(m) = 3m2 - 5m + 16. Is b(5) a multiple of 6? True Let i be 6/(-15) + 12/5. Suppose 3n - 55 = in. Is 19 a factor of n? False Let n = -126 + 204. Is n a multiple of 13? True Does 5 divide (3 - 36/20)/(4/90)? False Let z(a) be the second derivative of -a5/20 + a4/6 + a3/3 - a2 + 2a. Let m be z(2). Suppose q - h - 66 = -26, 0 = q - mh - 44. Does 12 divide q? True Let y(v) = -83v - 16. Is y(-2) a multiple of 9? False Let y(a) = -19a - 1. Suppose -d + 2 + 4 = 0. Suppose 3n = -0n - d. Does 14 divide y(n)? False Let j(a) = 2a3 - 3a*2 + a. Let u be j(2). Suppose 11w - 4s = uw + 119, 0 = 4s + 4. Does 6 divide w? False Let a = -11 + 1. Does 10 divide (-184)/a - (-6)/(-15)? False Suppose m = 2m, r + 5m - 20 = 0. Is 6 a factor of r? False Let u(y) be the second derivative of y5/20 + 5y*4/12 + 2y*3/3 + 2y. Does 6 divide u(-3)? True Let n be (-2)/(-3)*(-3)/1. Let o	{ "pile_set_name": "DM Mathematics" }
-3496q3 - 4842q*3 - 2q + 2q - 2q*2. -8338q*3 - 2q*2 Collect the terms in 31v*3 + 828v + 90v3 - 828v. 121v3 Collect the terms in -70n - 52n + 179n - 22n3 - 57n. -22n3 Collect the terms in -31052171i*3 + 0i + 31052172i3 + 0i + i - i. i*3 Collect the terms in -3308b*2 + 1066b*2 + 2246b*2. 4b*2 Collect the terms in -118l - 122l + 475l - 119l - 117l. -l Collect the terms in 19 + 13t - 5t - 2t + 4t + 9t. 19t + 19 Collect the terms in -146 - 724h + 246h + 146. -478h Collect the terms in -19 + 13 - 22 - 31k*2 - 19. -31k*2 - 47 Collect the terms in 5u + 30454 - 30454 + 9u. 14u Collect the terms in 701g2 - 322g*2 + 2g*2 + 799g*2. 1180g*2 Collect the terms in -91507116 + 91507116 - u. -u Collect the terms in w + 21w - w2 - w2 + 7w - 21. -2w*2 + 29w - 21 Collect the terms in 7 - 2882i2 + 2884i*2 - 7. 2i*2 Collect the terms in -190j*3 - 203j*3 + 384j*3 - 157. -9j*3 - 157 Collect the terms in 10 + 10m*3 - 12m*3 + 15. -2m*3 + 25 Collect the terms in -76 + 2z2 - z2 + 76 + 34z - 34z. z*2 Collect the terms in -291l + 71 + 134l + 161l. 4l + 71 Collect the terms in -2d*3 + 987d + 998d - 1985d. -2d3 Collect the terms in 23d*2 + 12d*2 - 23d*2 + 67 - 61. 12d*2 + 6 Collect the terms in 9 + 5 - 4 - 19s + 8 - 15. -19s + 3 Collect the terms in 82n + 9n - 82n - 1. 9n - 1 Collect the terms in -14 + 125j + 28 + 0 - 14. 125j Collect the terms in -23k*3 + 137k - 23k3 + 48k*3. 2k*3 + 137k Collect the terms in -456l3 - 1354l*2 + 1354l*2. -456l*3 Collect the terms in 116704a - 58269a - 58439a. -4a Collect the terms in 33h + 0 + 0 - 188h + 36h + 103h. -16h Collect the terms in -165775225 + 3b + 165775225. 3b Collect the terms in 32 + 317043u2 + 34 - 317048u*2 - 66. -5u*2 Collect the terms in 0 - 3 - o + 8o - 6o + 0o. o - 3 Collect the terms in -1010q + 3030q - 1011q - 1015q. -6q Collect the terms in -10 + 10337m*3 - 10029m*3 + 10. 308m*3 Collect the terms in 105 + 63 - 225 + 57 + 25c*2. 25c*2 Collect the terms in 982t - 48067 + 48067. 982t Collect the terms in -2y - 3445 + 2728 - 10095. -2y - 10812 Collect the terms in -12x*3 - 11x*3 + 7 - 11x*3 - 7. -34x*3 Collect the terms in 6s - 19s + 13s + 220s3 + 22s*2. 220s*3 + 22s*2 Collect the terms in 27s*3 - 373s*3 + 29s*3. -317s*3 Collect the terms in -15373 + 15373 - 109f*3. -109f*3 Collect the terms in 4u - 4u - 360u*3 + 12u + 357u3. -3u*3 + 12u Collect the terms in -l*3 + 29013l*2 + 29010l*2 - 58006l2. -l3 + 17l2 Collect the terms in 254360 - 254360 - 2m. -2m Collect the terms in -103 + x2 - 981 + 154. x2 - 930 Collect the terms in -235g + 48g - 93g - 54g. -334g Collect the terms in -985 + 1978 - 17w - 993 + 12w. -5w Collect the terms in 57l*2 - 106l*2 + 67l*2 + 36l*3 - 31l*3. 5l*3 + 18l*2 Collect the terms in -2d*2 - 863 + 285 + 287 - 22d*2 + 291. -24d*2 Collect the terms in 133p + 7p - 20p - p + 2p3 - 3p3. -p3 + 119p Collect the terms in -190 + 61 - 15v*2 + 66 + 65 + 4v*2. -11v*2 + 2 Collect the terms in 186913 + 4i + 186920 - 373833. 4i Collect the terms in 367d*2 - 20 + 20 - 668d*2 + 294d*2. -7d*2 Collect the terms in -7931j + 15923j - 7988j. 4j Collect the terms in -20o + 15o - o2 - 5o*2 + 9o. -6o2 + 4o Collect the terms in -235a2 - 227a*2 - 155a*3 - 234a*2 + 696a*2. -155a*3 Collect the terms in -46v*3 - 3v + 138v3 - 40v*3 - 25v*3 + 3v. 27v3 Collect the terms in -11 + 134y*2 - 31y*2 + 27y*2 + 11. 130y*2 Collect the terms in 833w*2 + 493w*2 + 774w*2 + 680w*2. 2780w*2 Collect the terms in 15f - 27 + 25 + 1 + 7f. 22f - 1 Collect the terms in 115g2 + 2g - 30 - 82g2 + 23. 33g*2 + 2g - 7 Collect the terms in 526t3 - 215t*3 - 319t*3. -8t*3 Collect the terms in -3838f*3 + 1942f*3 + 1921f*3. 25f*3 Collect the terms in -1206g*2 + 1639g*2 - 2 + 2. 433g*2 Collect the terms in -263m*2 - 259m*2 - 257m*2 + 780m2. m2 Collect the terms in 0w - 2w + 0w - 8w + 3w. -7w Collect the terms in -507o2 + 0o + 0o. -507o*2 Collect the terms in 40g + 40g + 52g - 138g - 2. -6g - 2 Collect the terms in -38m + 37m + 60m - 2 + 2. 59m Collect the terms in 277g + 253g - 15g3 - 231g + 1233g. -15g*3 + 1532g Collect the terms in -63 - 1320r + 1318r - 35. -2r - 98 Collect the terms in 5n*3 - 45n*3 + 4n*3 + 31n*3. -5n*3 Collect the terms in 11g*2 + 124g*2 - 20g*2. 115g*2 Collect the terms in 38r*2 - 609 - 611 - 610 + 1830. 38r2 Collect the terms in -t2 - 6t2 + 2 + 3t*2 - 440t. -4t2 - 440t + 2 Collect the terms in 39s2 - 154s*2 + 71s*2 + 49s*2. 5s*2 Collect the terms in 7103 + 229d*3 - 3557 - 3546. 229d*3 Collect the terms in 37s*2 - 4599 + 4601 - 243s*2. -206s*2 + 2 Collect the terms in 731x + 702x - 1447x. -14x Collect the terms in -52375h + 52375h - 354h*2. -354h*2 Collect the terms in 111w*2 - 768w*2 - 2268w*2. -2925w2 Collect the terms in -t3 - 6t3 + 20t*3 - 2t*3 - 8t*3 - 4t3. -t3 Collect the terms in -72o3 - 34o*3 - 8o*3. -114o*3 Collect the terms in -6 - 6o + 19o - 15o - 7. -2o - 13 Collect the terms in -60j - 22j - 3j + 11j. -74j Collect the terms in -27a3 - 70 + 51a*3 - 75a*2 + 70 - 22a*3 + 34a*2. 2a*3 - 41a*2 Collect the terms in -42 + 17 + 21 - 9y + 20y2. 20y*2 - 9y - 4 Collect the terms in -2055k - 2291k + 4357k. 11k Collect the terms in 24 - 69b + 14 + 66b + 9 - 47. -3b Collect the terms in -5k2 - k2 - 22k2 - 46k*2. -74k*2 Collect the terms in -3 - 92364c - 1 + 4 + 92354c. -10c Collect the terms in -360s - 370s - 11s2 + 729s. -11s2 - s Collect the terms in 115 - 115 - 22r*3 - 447r*3 - 490r*3. -959r*3 Collect the terms in 159871 + 499d - 159871. 499d Collect the terms in 21504v*3 - 10742v*3 - 10757v*3. 5v*3 Collect the terms in 13586 - 37l + 10l - 13584 + 19l. -8l + 2 Collect the terms in -24 + 6k - 19k + 29k + 24 + k. 17k Collect the terms in i3 + 1013i - 531i - 474i. i*3 + 8i Collect the terms in 4w - 5w - 3460w3 + w. -3460w*3 Collect the terms in 6i + 34 - 5i - 63 + 62. i + 33 Collect the terms in -691u + 185u + 310u + 210u. 14u Collect the terms in 1387q2 + 5 - 1 - 4. 1387q*2 Collect the terms in -12h*3 + 7439h*2 - 7439h*2. -12h*3 Collect the terms in 89 - 190 - 152 + 2z - 131 - 183. 2z - 567 Collect the terms in 0h - 4h + 5h - 4h - 14h + 9h. -8h Collect the terms in -2p2 + 29185837p - 29185837p. -2p*2 Collect the terms in 7s - 21s - 19s - 7s. -40s Collect the terms in -22u - 36u*2 + 48u - 8u - 18u. -36u2 Collect the terms in 3578d - 3920d + 339d. -3d Collect the terms in -30q*2 + 23 + 7 + 10q*2. -20q*2 + 30 Collect the terms in -2x*3 + 2x*3 + 35937 - 35937 + 12x*3. 12x*3 Collect the terms in 2871x - 2871x - x3 + 17x2. -x3 + 17x2 Collect the terms in 166p + 154p - 304p. 16p Collect the terms in 303 + 311 + 300 - 914 - 4h. -4h Collect the terms in -10f*3 - 2f - 7 + 2f3 + 1 - 3f*3 + 7. -11f*3 - 2f + 1 Collect the terms in 5 - 3109t + 4293t - 4. 1184t + 1 Collect the terms in 2275c*3 + 2259c*3 - 6796c*3 + 2259c*3. -3c*3 Collect the terms in 4 + 22h - 92h - h2 + 70h. -h*2 + 4 Collect the terms in -340s*3 + 471s*3 - 143s*3. -12s*3 Collect the terms in -43 - 40 - 256o + 83. -256o Collect the terms in 3089l + 111 - 56 + 1043l - 53. 4132l + 2 Collect the terms in -143c + 77c - 168c. -234c Collect the terms in -n - 4 - n - 189n3 - 205n*3 + 88n*3 + 13n*2. -306n*3 + 13n*2 - 2n - 4 Collect the terms in -477m - 1457m - 1001m. -2935m Collect the terms in 22j2 - 10 - 50j*2 + 29j*2 + 29j - 17. j*2 + 29j - 27 Collect the terms in 52694 - 924g - 52694. -924g Collect the terms in -143f + 268f - 44f. 81f Collect the terms in 105k2 - 312k*2 + 99k*2. -108k*2 Collect the terms in 20 - 12 + 148r - 3 - 3. 148r + 2 Collect the terms in -4	{ "pile_set_name": "DM Mathematics" }
of -1334261dns2 + 1946ds2 + 6ds + d - 4s*2 wrt n. -1334261ds2 Find the first derivative of -3c*2d + c*2p*3 + 2cdp*3 + 2289cd - 1514cp3 - 56p*2 wrt d. -3c*2 + 2cp3 + 2289c What is the third derivative of -2a5 - 9594a*4 + 18a*2 - 2a + 67 wrt a? -120a2 - 230256a What is the derivative of 1358g3 - 13g + 10803? 4074g2 - 13 What is the derivative of g4 + 1872gj + 23j - 42 wrt g? 4g3 + 1872j Find the first derivative of 176k3v - 8k3 - 28607v wrt k. 528k2v - 24k2 Find the second derivative of -4523d*2u*3 + 12d*2u - 3du*3 + 830du2 - 2du wrt d. -9046u*3 + 24u What is the third derivative of 5668n5 + 37n*3o - 22n2o + no - 190 wrt n? 340080n*2 + 222o Find the second derivative of -4148m3 + 37m*2 - m + 977. -24888m + 74 Find the third derivative of -5l5 - 131l*4 - 23l*2 - 2l - 20553 wrt l. -300l2 - 3144l What is the third derivative of -6d3j*3 - 413d*3 + 3d*2j*3 - 5j*3 - 3502 wrt d? -36j*3 - 2478 Find the third derivative of 6400d*6 + 30537d*2 wrt d. 768000d*3 Find the third derivative of -275289m*3 + 2m*2 - 2m - 6173. -1651734 Find the third derivative of -167837o6 - 86799o*2. -20140440o*3 Find the second derivative of -14d5 + d3 - 37003d2 - 2608054d wrt d. -280d3 + 6d - 74006 Find the third derivative of -767n6o*3 + 12n*6o + n*2 - 50no2 - 1276o*3 wrt n. -92040n*3o*3 + 1440n*3o Find the first derivative of -333523l4 - 633157 wrt l. -1334092l*3 What is the third derivative of -25s*5 + 381s4 + s3 + 9s2 - 155s + 2? -1500s2 + 9144s + 6 What is the second derivative of 295247l2 - 2931683l? 590494 Find the first derivative of 47156s - 80421. 47156 What is the third derivative of -2245125l*6 + 4l*2 - 130667 wrt l? -269415000l*3 What is the second derivative of 77524x*2 - 47929x + 2? 155048 Differentiate -37200n - 40989 wrt n. -37200 Find the third derivative of 478pz3 + 13pz2 + 103pz - 2p - 39z3 - z2 + 3 wrt z. 2868p - 234 Differentiate -603843d + 1454623 with respect to d. -603843 What is the second derivative of 30894p*3 + 2p*2 - p + 6492 wrt p? 185364p + 4 Find the first derivative of -32bh - 2153689b - 2079h wrt h. -32b - 2079 Find the third derivative of -1439h*6 + 168h*5 - 21h*2 - 525h - 6 wrt h. -172680h3 + 10080h*2 What is the second derivative of -3c*2i*2m*3 - 18c*2im2 - c2m3 + c2 + 863077ci*2m*3 + 1291im3 - 2i wrt i? -6c2m*3 + 1726154cm3 Find the third derivative of -4398523k*3 - 1017228k2. -26391138 What is the second derivative of h3s2y + 4h3sy - h3y*2 + 351543hs2y*2 - 608hs2 wrt y? -2h*3 + 703086hs2 What is the second derivative of 175483w*3 + 86718w? 1052898w Differentiate 7l*2m + 2l2x*3 + 7338lmx*3 + 65lm with respect to x. 6l*2x*2 + 22014lmx*2 Differentiate -6509074x*4 - 1197390. -26036296x*3 Differentiate -307084j*2 - 585089 wrt j. -614168j What is the second derivative of -242c4 + 3c*3 + c - 87404? -2904c*2 + 18c Find the first derivative of -4768o3v - 14o3 + 3o*2 + 52o - 4v2 wrt v. -4768o*3 - 8v What is the first derivative of -194185b2 + b - 275577? -388370b + 1 What is the derivative of -5a3 + 657a*2 - 32a - 882604 wrt a? -15a2 + 1314a - 32 Find the second derivative of 918h3i*2 - 1947h*3 - 649hi2 - 82i wrt i. 1836h3 - 1298h Differentiate 5239f3ls2 + 204f*3l + 15f3s*2 - 4f*2s*2 + 1545s*2 with respect to l. 5239f*3s*2 + 204f*3 What is the derivative of 1301146m*2 - 1205098? 2602292m What is the derivative of -4599303m3 - 1203623? -13797909m*2 What is the derivative of 24f*3 + 186f*2 + f - 49977 wrt f? 72f*2 + 372f + 1 Differentiate 3158h4 - 53h*3 - 197682. 12632h*3 - 159h*2 Find the first derivative of 99642d - 151759 wrt d. 99642 Differentiate -160p3v + 4p2 + 33p + 71v + 996 wrt p. -480p*2v + 8p + 33 Find the second derivative of 11m*3 + 293m*2 + 70370m wrt m. 66m + 586 Find the third derivative of -13822d*3 + 90d*2 - 5 wrt d. -82932 Find the first derivative of -1739540x + 2031584 wrt x. -1739540 Find the second derivative of -9799h3l*3 - 2h3 + h2l - 2hl3 + 24l - 2 wrt l. -58794h3l - 12hl What is the first derivative of -61482b - 481266? -61482 What is the second derivative of 116326im2 - 78477im wrt m? 232652i What is the derivative of 6693924fu + 4933763u wrt f? 6693924u What is the first derivative of 1101x3 - 609x*2 - 1445941 wrt x? 3303x*2 - 1218x What is the third derivative of 20738r3w*3 - 1221r*2w*3 + 2r*2w + 32rw*3 wrt r? 124428w*3 Differentiate 1229050l*3u - 355421l3 with respect to u. 1229050l*3 What is the second derivative of -308220h*5 - 364786h? -6164400h3 Find the third derivative of -946a*3q + 99a3 + 5a*2q - 399a2 - q wrt a. -5676q + 594 What is the third derivative of -68g4 - 255g*3 - 13097g*2 - 2g wrt g? -1632g - 1530 Find the second derivative of 214955y*3 - 220774y. 1289730y Find the second derivative of 87911k*5 - 3906136k wrt k. 1758220k3 What is the first derivative of -46306pw3 + 12223w3 + w2 wrt p? -46306w3 Find the first derivative of -2c*2q - 2622c2 - 2cq + 2c - 16464q wrt c. -4cq - 5244c - 2q + 2 Find the second derivative of -14601g*2s - g*2 - 6gs + 48g - 30s - 34 wrt g. -29202s - 2 Find the second derivative of -18708b2u*5 - 3b*2u3 - b2u - b2 - 3b + 635u + 6 wrt u. -374160b*2u*3 - 18b*2u Find the third derivative of 2p5 - 192p*4 - 10p*3 + 50492p*2. 120p*2 - 4608p - 60 What is the derivative of 3684i3r - 2313i3 + 2i*2r*3 - 4i wrt r? 3684i3 + 6i*2r*2 What is the third derivative of 23m*2y*4 - 25m*2y*3 - 111m*2 - 28my3 + 323my2 wrt y? 552m*2y - 150m2 - 168m Find the second derivative of 253o5 + o3x + 79o2x + 14o + 304x wrt o. 5060o3 + 6ox + 158x What is the first derivative of -123k4 + 1223k + 1364603 wrt k? -492k3 + 1223 Find the second derivative of -282223a*2 + 258025a wrt a. -564446 Find the second derivative of -210506g3h*2 + 2g*3h + g*3 - gh*2 - 7413g + h*2 + 57h wrt g. -1263036gh*2 + 12gh + 6g Find the third derivative of -367x6 - 7x*4 + 2x*2 + 2x - 5649. -44040x3 - 168x Find the third derivative of -83911q3 + 12q*2 + 497 wrt q. -503466 Find the second derivative of -948659c*5 - 84985c. -18973180c3 Find the third derivative of 268z*4 - 45z*3 - 37742z*2. 6432z - 270 Find the third derivative of -80s5 - 154s*4 + 5s*2 - 5s + 35. -4800s2 - 3696s Differentiate -2nw*3 - 879nw2 + 41nw + 6n - 2w3 - 1757w*2 - 43 wrt n. -2w*3 - 879w*2 + 41w + 6 What is the second derivative of -3520j2 - j - 5114? -7040 What is the derivative of 31iux - 25iu + 2i - 73u*2x - 10u2 + 583u + 118x wrt x? 31iu - 73u*2 + 118 What is the third derivative of 2170d*6i + 229d3i + 265d2i - 353di wrt d? 260400d3i + 1374i Find the second derivative of 28611n*5 - 31n - 106 wrt n. 572220n3 Find the third derivative of 3q*6 - 3q*4 + 83064q3 - q2 - 5039q + 145 wrt q. 360q*3 - 72q + 498384 What is the derivative of -6y3 + 47280y*2 + 211277 wrt y? -18y*2 + 94560y Find the third derivative of 317b5s*3 - 390b*3s*3 - 14b*2s*2 + 2b*2s + 50bs*3 + 1 wrt b. 19020b*2s*3 - 2340s*3 Differentiate 1647484n*2 + 1354995 wrt n. 3294968n Find the third derivative of -22588g4k + 17g3k*2 + 86g*2k*2 + 594g*2k - 3g wrt g. -542112gk + 102k*2 Find the first derivative of 132854i*2 - 66245 wrt i. 265708i What is the second derivative of -20g2n2 - g2nu*2 + 61g*2u*2 - 931gn2u*2 + 96gnu*2 + 2n wrt n? -40g2 - 1862gu2 Find the second derivative of 66l*5 + 20729l*3 - 2060655l. 1320l3 + 124374l What is the third derivative of 4587t6 - 50t*3 + 5t*2 - 81208t? 550440t*3 - 300 What is	{ "pile_set_name": "DM Mathematics" }
{j: 1, o: 2, q: 1, a: 1, c: 1, m: 2}? 1/840 What is prob of sequence yy when two letters picked without replacement from yiiyiviiyyyiv? 5/39 What is prob of sequence go when two letters picked without replacement from tgtottra? 1/56 Three letters picked without replacement from sszzkszkskzkszzzkkkz. Give prob of sequence szs. 4/171 Two letters picked without replacement from ttqhgq. Give prob of sequence tg. 1/15 Three letters picked without replacement from {h: 9, o: 5}. What is prob of sequence hoh? 15/91 What is prob of sequence ffyk when four letters picked without replacement from ffyyygyk? 1/210 What is prob of sequence hj when two letters picked without replacement from {h: 14, j: 4}? 28/153 What is prob of sequence yb when two letters picked without replacement from ssghbbbby? 1/18 Three letters picked without replacement from {e: 1, d: 1, m: 1, q: 5, n: 6, r: 3}. What is prob of sequence edr? 1/1360 What is prob of sequence zzz when three letters picked without replacement from {z: 2, x: 16}? 0 Four letters picked without replacement from uuzuzzu. What is prob of sequence zzzu? 1/35 Calculate prob of sequence lllt when four letters picked without replacement from {l: 15, t: 4}. 455/3876 What is prob of sequence yyy when three letters picked without replacement from ayyayyayyyyy? 21/55 Four letters picked without replacement from bujttttbbjnjjttjn. Give prob of sequence nuuj. 0 Three letters picked without replacement from ahacaccc. Give prob of sequence aha. 1/56 Two letters picked without replacement from {d: 3, n: 2}. Give prob of sequence dn. 3/10 Two letters picked without replacement from yemyemyemme. Give prob of sequence yy. 3/55 What is prob of sequence ss when two letters picked without replacement from hsqqqqpspqspsq? 6/91 What is prob of sequence endj when four letters picked without replacement from ddjnnde? 1/140 Calculate prob of sequence avak when four letters picked without replacement from {t: 3, v: 1, j: 5, a: 5, k: 2}. 1/1092 Three letters picked without replacement from xxsxxxssxsxsx. Give prob of sequence sxx. 70/429 Four letters picked without replacement from lnvnlknnbsslllnl. Give prob of sequence lnln. 5/364 What is prob of sequence pbz when three letters picked without replacement from pzpzppzppbzzppzppzp? 77/5814 Calculate prob of sequence leeq when four letters picked without replacement from leldllqqeqe. 1/110 Calculate prob of sequence vqq when three letters picked without replacement from {q: 3, t: 2, v: 1, b: 4, k: 1}. 1/165 What is prob of sequence mm when two letters picked without replacement from {m: 6, p: 4, v: 10}? 3/38 Calculate prob of sequence sjw when three letters picked without replacement from wwwjsjwwjf. 1/48 Two letters picked without replacement from {u: 1, i: 1, k: 1, f: 1, c: 1}. Give prob of sequence fi. 1/20 Calculate prob of sequence wqw when three letters picked without replacement from {g: 1, w: 4, q: 6}. 4/55 Two letters picked without replacement from {o: 1, j: 3, y: 2, k: 3, w: 3, d: 1}. Give prob of sequence oy. 1/78 Four letters picked without replacement from {s: 2, d: 1, k: 1}. What is prob of sequence skds? 1/12 Two letters picked without replacement from {k: 1, s: 6, g: 1, t: 2, q: 7}. Give prob of sequence ks. 3/136 Calculate prob of sequence zedz when four letters picked without replacement from eezzegd. 1/140 Two letters picked without replacement from ylqgrqrkykyylqlk. What is prob of sequence qg? 1/80 Calculate prob of sequence yyhf when four letters picked without replacement from yfyyyyyffhyyyyfyf. 55/5712 Two letters picked without replacement from {b: 2, a: 2, l: 1, z: 1}. Give prob of sequence zb. 1/15 What is prob of sequence he when two letters picked without replacement from {e: 7, h: 7}? 7/26 Calculate prob of sequence uxq when three letters picked without replacement from wyyuqxxc. 1/168 What is prob of sequence buxx when four letters picked without replacement from {x: 5, s: 2, t: 7, u: 1, b: 1, l: 1}? 1/2856 Two letters picked without replacement from bfphc. What is prob of sequence pf? 1/20 Calculate prob of sequence bqvf when four letters picked without replacement from {b: 1, v: 1, q: 1, f: 1, s: 1}. 1/120 What is prob of sequence qx when two letters picked without replacement from nqxqvv? 1/15 What is prob of sequence gg when two letters picked without replacement from {g: 2, k: 3}? 1/10 Calculate prob of sequence tc when two letters picked without replacement from kckkctr. 1/21 Four letters picked without replacement from kcxxcbxxcxcxbxx. Give prob of sequence cxcx. 4/195 Four letters picked without replacement from vjdddivvddvjdbdd. What is prob of sequence jivj? 1/5460 What is prob of sequence rrr when three letters picked without replacement from rrrrpkk? 4/35 Three letters picked without replacement from {b: 2, m: 4, l: 1, v: 2}. What is prob of sequence vlv? 1/252 Calculate prob of sequence tnct when four letters picked without replacement from {n: 10, c: 5, t: 4}. 25/3876 Four letters picked without replacement from {b: 1, k: 1, o: 1, y: 2, n: 1, u: 1}. Give prob of sequence byub. 0 What is prob of sequence geee when four letters picked without replacement from {g: 10, e: 4}? 10/1001 What is prob of sequence km when two letters picked without replacement from {k: 2, m: 1}? 1/3 What is prob of sequence jjzp when four letters picked without replacement from pzjpzpqjzqz? 1/330 Four letters picked without replacement from {v: 8, d: 2, t: 3, q: 3}. Give prob of sequence tqtt. 3/7280 Calculate prob of sequence fw when two letters picked without replacement from {u: 3, l: 3, f: 4, n: 2, w: 3, z: 1}. 1/20 Calculate prob of sequence jdoh when four letters picked without replacement from {r: 2, d: 1, m: 1, h: 1, j: 1, o: 1}. 1/840 Three letters picked without replacement from {g: 7, l: 12}. Give prob of sequence lgl. 154/969 Two letters picked without replacement from gfrkkwm. What is prob of sequence fm? 1/42 What is prob of sequence ee when two letters picked without replacement from {e: 5, j: 7}? 5/33 Calculate prob of sequence yogy when four letters picked without replacement from ogyksoyg. 1/210 Three letters picked without replacement from {x: 2, d: 6, j: 9, v: 1, f: 1}. Give prob of sequence xvd. 2/969 Three letters picked without replacement from vqqsvqsvvqqssvqqvsqv. Give prob of sequence vvs. 7/228 What is prob of sequence tta when three letters picked without replacement from ftdwwfwwfdtafdfd? 1/1680 Four letters picked without replacement from imiwmtaaiwaimaia. Give prob of sequence imwm. 1/728 Calculate prob of sequence ja when two letters picked without replacement from jsjsjjjdsjaj. 7/132 Four letters picked without replacement from {x: 6, r: 6}. Give prob of sequence xxrr. 5/66 Calculate prob of sequence xox when three letters picked without replacement from ooxo. 0 Three letters picked without replacement from neeeennnnnneee. Give prob of sequence nnn. 5/52 Four letters picked without replacement from {n: 8, r: 5}. Give prob of sequence rnrr. 4/143 Calculate prob of sequence dod when three letters picked without replacement from oddodoo. 4/35 What is prob of sequence too when three letters picked without replacement from {t: 2, o: 9}? 8/55 Four letters picked without replacement from {x: 1, j: 2, y: 1, n: 2, o: 1}. Give prob of sequence jjoy. 1/420 Two letters picked without replacement from lcccfcchcccqfhcccctc. What is prob of sequence ht? 1/190 Four letters picked without replacement from {b: 1, k: 2, f: 2, y: 14}. What is prob of sequence yykb? 91/23256 Calculate prob of sequence jajj when four letters picked without replacement from {l: 6, d: 4, j: 3, a: 2}. 1/2730 What is prob of sequence ku when two letters picked without replacement from {u: 12, k: 3}? 6/35 Calculate prob of sequence mzmn when four letters picked without replacement from mzmkknzkncnk. 1/990 Two letters picked without replacement from omomommmomm. What is prob of sequence om? 14/55 Calculate prob of sequence kww when three letters picked without replacement from {w: 2, n: 2, x: 8, k: 4}. 1/420 Two letters picked without replacement from {v: 2, t: 5}. What is prob of sequence tv? 5/21 What is prob of sequence ch when two letters picked without replacement fro	{ "pile_set_name": "DM Mathematics" }
153 Calculate prob of picking 1 a and 1 o when two letters picked without replacement from {a: 1, o: 2, x: 1}. 1/3 Three letters picked without replacement from {a: 8, i: 5, t: 2}. What is prob of picking 1 i and 2 a? 4/13 What is prob of picking 1 y, 2 s, and 1 q when four letters picked without replacement from yssqqqq? 4/35 Calculate prob of picking 3 z when three letters picked without replacement from {f: 3, z: 3, g: 1}. 1/35 Two letters picked without replacement from ofuxh. What is prob of picking 1 f and 1 u? 1/10 Two letters picked without replacement from vwbtw. What is prob of picking 1 b and 1 v? 1/10 Four letters picked without replacement from {y: 4, f: 15}. Give prob of picking 2 y and 2 f. 105/646 Calculate prob of picking 1 y and 1 q when two letters picked without replacement from gzzqqqzggqyzgggq. 1/24 Four letters picked without replacement from zrmzbzrrzbbbzzzmbbab. What is prob of picking 1 m, 1 a, 1 r, and 1 z? 14/1615 Calculate prob of picking 1 x and 1 s when two letters picked without replacement from {s: 1, p: 5, c: 7, x: 1, j: 1, b: 2}. 1/136 Four letters picked without replacement from {g: 11, r: 2}. What is prob of picking 3 g and 1 r? 6/13 Three letters picked without replacement from opgoioi. Give prob of picking 3 o. 1/35 What is prob of picking 2 p when two letters picked without replacement from {q: 1, v: 1, i: 1, p: 2, d: 2}? 1/21 Two letters picked without replacement from ipzvi. Give prob of picking 1 p and 1 i. 1/5 Two letters picked without replacement from {y: 7, m: 9}. Give prob of picking 2 m. 3/10 Calculate prob of picking 1 f and 2 n when three letters picked without replacement from nnufufnnffnnn. 42/143 What is prob of picking 2 h when two letters picked without replacement from {h: 4, g: 2}? 2/5 Four letters picked without replacement from {z: 10, c: 1, r: 7}. What is prob of picking 2 r and 2 z? 21/68 Calculate prob of picking 1 w and 1 j when two letters picked without replacement from {j: 9, w: 9}. 9/17 Three letters picked without replacement from {k: 1, h: 2, w: 5, t: 3, g: 1, f: 1}. What is prob of picking 2 h and 1 f? 1/286 Four letters picked without replacement from {j: 15, r: 5}. Give prob of picking 4 r. 1/969 Four letters picked without replacement from tetedeetteedddeeeed. What is prob of picking 2 d and 2 e? 75/646 What is prob of picking 3 a when three letters picked without replacement from {v: 2, a: 4}? 1/5 What is prob of picking 1 i, 1 a, and 2 v when four letters picked without replacement from {v: 7, i: 4, a: 5}? 3/13 Three letters picked without replacement from {a: 1, t: 6, m: 2, b: 1, n: 7, j: 2}. Give prob of picking 1 t and 2 n. 42/323 Two letters picked without replacement from {k: 3, g: 6, j: 2, b: 2, a: 2}. What is prob of picking 1 a and 1 j? 4/105 Three letters picked without replacement from {z: 1, k: 13, q: 1}. Give prob of picking 1 z, 1 q, and 1 k. 1/35 What is prob of picking 3 v when three letters picked without replacement from ttvttvttttvtvtttvvt? 20/969 Four letters picked without replacement from {w: 4, b: 7, t: 3, v: 3, o: 1}. What is prob of picking 2 t and 2 w? 1/170 Four letters picked without replacement from jffjjffjjf. What is prob of picking 3 f and 1 j? 5/21 Calculate prob of picking 1 t, 1 j, 1 e, and 1 x when four letters picked without replacement from xeejxjjjtjxttjjjt. 48/595 Calculate prob of picking 2 q when two letters picked without replacement from qqrrqqqrrr. 2/9 Three letters picked without replacement from {d: 5, m: 1, n: 7, o: 1}. What is prob of picking 2 d and 1 n? 5/26 What is prob of picking 1 q, 1 o, and 2 v when four letters picked without replacement from {f: 1, u: 3, o: 1, q: 1, b: 5, v: 2}? 1/715 Three letters picked without replacement from {d: 2, l: 7, c: 6, v: 1, i: 4}. Give prob of picking 2 c and 1 l. 7/76 Three letters picked without replacement from {z: 1, b: 3, q: 1, c: 5}. Give prob of picking 2 c and 1 b. 1/4 What is prob of picking 1 d and 1 t when two letters picked without replacement from {t: 4, d: 8, r: 1, e: 5}? 32/153 What is prob of picking 1 i, 1 y, and 1 u when three letters picked without replacement from {c: 1, u: 3, y: 1, i: 2, a: 1, s: 3}? 2/55 What is prob of picking 2 n, 1 o, and 1 s when four letters picked without replacement from {u: 9, n: 5, o: 3, s: 1}? 1/102 What is prob of picking 1 g and 1 x when two letters picked without replacement from {a: 1, b: 7, x: 2, w: 7, g: 1}? 2/153 Three letters picked without replacement from kutueeuunule. What is prob of picking 1 t, 1 k, and 1 e? 3/220 What is prob of picking 1 k and 1 o when two letters picked without replacement from {k: 1, o: 1, n: 1, i: 1, a: 2, c: 2}? 1/28 What is prob of picking 1 a and 2 j when three letters picked without replacement from vaajoaavj? 1/21 Calculate prob of picking 2 y when two letters picked without replacement from {y: 18, c: 1}. 17/19 Two letters picked without replacement from {x: 6, k: 1, f: 4}. Give prob of picking 2 f. 6/55 What is prob of picking 2 z when two letters picked without replacement from zmmczmm? 1/21 Four letters picked without replacement from {b: 3, x: 1, i: 1, y: 2, p: 4}. Give prob of picking 1 x, 1 b, and 2 p. 3/55 Calculate prob of picking 2 w when two letters picked without replacement from wwwwwwwwwwwwgwgwwwww. 153/190 What is prob of picking 1 x, 1 u, and 1 s when three letters picked without replacement from sxhhhux? 2/35 Two letters picked without replacement from {w: 2, c: 10}. Give prob of picking 1 w and 1 c. 10/33 Two letters picked without replacement from ftcsosfsycoytos. Give prob of picking 1 y and 1 f. 4/105 Three letters picked without replacement from dxhoxdxdoxxohxxxxd. What is prob of picking 2 h and 1 x? 3/272 What is prob of picking 1 i and 1 b when two letters picked without replacement from {b: 2, i: 3, k: 7, j: 3, n: 2, v: 1}? 2/51 Two letters picked without replacement from gccccgcccccc. Give prob of picking 1 c and 1 g. 10/33 Two letters picked without replacement from piiiiiiipiiii. What is prob of picking 2 p? 1/78 What is prob of picking 1 y and 2 r when three letters picked without replacement from {y: 3, r: 15, h: 2}? 21/76 Four letters picked without replacement from {m: 7, g: 2}. Give prob of picking 4 m. 5/18 What is prob of picking 3 r and 1 x when four letters picked without replacement from {x: 12, r: 7}? 35/323 Two letters picked without replacement from {k: 4, t: 8, w: 4, d: 1, u: 2}. What is prob of picking 1 t and 1 d? 8/171 What is prob of picking 1 t and 1 o when two letters picked without replacement from {a: 2, n: 1, t: 5, o: 1}? 5/36 What is prob of picking 2 n, 1 q, and 1 p when four letters picked without replacement from {p: 4, q: 7, n: 2}? 28/715 Two letters picked without replacement from ewseese. What is prob of picking 2 e? 2/7 Calculate prob of picking 1 t, 1 j, 1 b, and 1 w when four letters picked without replacement from wsbjqts. 1/35 What is prob of picking 1 l and 1 a when two letters picked without replacement from {l: 5, o: 3, q: 1, a: 7}? 7/24 Two letters picked without replacement from {a: 2, h: 3}. What is prob of picking 2 h? 3/10 Two letters picked without replacement from {j: 2, t: 4, c: 3}. Give prob of picking 2 j. 1/36 Two letters picked without replacement from vzzuuuuuzzzzuu. What is prob of picking 1 v and 1 u? 1/13 Two letters picked without replacement from uuuuutuuttutut. Give prob of picking 1 t and 1 u. 45/91 Four letters picked without replacement from {t: 13, n: 1, h: 2, a: 1}. Give prob of picking 4 t. 143/476 Calculate prob of picking 3 h and 1 p when four letters picked without replacement from epppefph. 0 Four letters picked without replacement from {w: 3, f: 9}. What is prob of picking 1 w and 3 f? 28/55 What is prob of picking 1 j and 3 h when four letters picked without replacement from jhjjhjjjjhjjjhjh? 11/182 Three letters picked without replacement from smmmmmssmmsss. Give prob of picking 2 s and 1 m. 105/286 Calculate prob of picking 2 x and 1 b when three letters picked without replacement from {b: 2, i: 1, e: 2, x: 8}. 28/143 What is prob of picking 1 v and 1 z when two letters picked without replacement from {o: 1, v: 2, s: 3, i: 2, m: 2, z: 2}? 2/33 Three letters picked without replacement from vre	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.